Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
is c(z)? 0 Let y be ((-5276)/6)/(-2) - 8/12. Let r = 425 - y. Let l(d) = d*2 + 13d - 11. Give l(r). 3 Let g(i) = -8i + i - 2i + 3i - 4 - i2. Suppose -3n + 10 = 2c - 8n, c = -3n - 6. Suppose c = -m + 3 - 8. Give g(m). 1 Let j(v) = -v3 + 6v*2 + 7v - 4. Let g(u) be the first derivative of 7/2u2 - 1/3u*3 - 10 + u. Let m be g(6). Determine j(m). -4 Let l be -2 - 1 - ((-7 - -4) + 0). Let h be (-3)/((-2)/(-2)) + l/(-7). Let v(z) = z + 3. Let w(f) = 1. Let r(i) = hw(i) + v(i). Calculate r(4). 4 Let k(i) = 12i3 + 81i*2 - 18i - 1. Let t(o) = -7o3 - 47o*2 + 9o. Let d(m) = 3k(m) + 5t(m). Let p = 3 - 2. Let x be p2/(6/(-27)). Determine d(x). -3 Let c = -29116 - -29146. Let f(y) = y3 - 31y*2 + 35y - 140. Calculate f(c). 10 Let m(o) = -5o2 - 872o - 2. Let j(d) = 4d2 + 654d + 2. Let q(h) = 4j(h) + 3m(h). Determine q(-8). 66 Let j(x) be the first derivative of x3/3 - x2 + x - 11749. Let u(a) = -a*2 - 2a + 4. Let o be u(-3). Calculate j(o). 0 Let b be (-1)/(-5) - 2201/155. Let o(k) = 5k + 65. Calculate o(b). -5 Let a(l) = l2 + 7l - 102. Let z(t) = 3t2 + 19t - 307. Let i(c) = -8a(c) + 3z(c). Give i(9). -15 Let q(t) = -3t3 - t2 - 25t - 25. Let n be q(-1). Let i(u) = -3u3 - u2 - 3u + 1. Calculate i(n). -33 Let q(b) = 14b - 9. Let d = -6572 - -6573. What is q(d)? 5 Let d(b) = 198b - 196b - 8 + 3 - 6 - 9. Calculate d(20). 20 Let r(q) = -2q*3 + 3q*2 - 6q - 4. Suppose -11i = 140i - 453. Determine r(i). -49 Let g = -611 + 605. Let v(q) be the third derivative of q6/120 + q5/10 - q*4/12 - 4q*3/3 + 7q2. Give v(g). 4 Let a(v) = -v3 + 2v2 + 1. Let f(d) = -7d*3 - 3d*2 + 4d*2 + 2d*2 + 2d + 0d2. Let j be f(-1). Let p be j/(-44) + (-26)/(-22) + 1. Give a(p). 1 Let j(l) = -5l + 194 - 67 - 43 - 72. Let w(a) = 5a - 14a + 29 - 6. Let y(d) = 7j(d) - 4w(d). Determine y(6). -2 Let z(p) = -p*2 + 8p - 6. Let u(s) be the first derivative of s*2/2 + 8s - 61. Let g be u(-3). What is z(g)? 9 Let c(y) be the second derivative of -3y5/20 + y4/6 - 2y*3/3 + 5y*2/2 - 1997y. Give c(2). -19 Let p(m) = 1. Let u = -366 + 365. Let k(y) be the first derivative of y4/4 + y3/3 + y*2 - y + 9. Let j(r) = uk(r) - 3p(r). What is j(-2)? 6 Suppose -364o - 172o = 3216. Let l(c) = c3 + 6c*2 + 3c + 32. Give l(o). 14 Let n(d) = 14d2 - 19d + 27. Suppose 2x - 5s - 28 = 0, -32x + 31x + 2s = -13. Let w(c) = 3c*2 - 5c + 7. Let m(g) = xw(g) - 2n(g). What is m(-8)? 1 Let w(n) = 2n3 - n2 + n - 1. Suppose -51 - 45 = 49o + 51. Determine w(o). -67 Let c(z) be the third derivative of 1/120z6 + 0 - 101z*2 - 5/24z*4 - 1/12z*5 - 1/6z*3 + 0z. Let g = -16 - -22. What is c(g)? 5 Let t(k) = -2k - 75. Let o(h) = -7h - 146. Let z(d) = -6o(d) + 13t(d). Calculate z(6). -3 Let w = 40 + -28. Suppose -9i + wi = 0. Let k(g) = g3 - g + 15. What is k(i)? 15 Let t be (-2)/9 - (-100)/(-36). Let w(y) be the second derivative of -y5/20 - y*4/12 + 7y3/6 - y2/2 + 53y. Give w(t). -4 Let b be 1-12(-105)/60. Let c(i) be the first derivative of 1/2i*2 - b - 4i - 1/3i3. Calculate c(0). -4 Let l(q) = -22q*2 + 2q. Let m(h) = -108h2 + 42h. Let i(p) = 4l(p) - m(p). What is i(2)? 12 Let k(d) = -4d - 31. Let v(s) = -9s2 + 94s - 51. Let g be v(10). Give k(g). 13 Let u(r) = -36 + 13 + 14 + 9 + 5 + 2r2 + 8r. Calculate u(-7). 47 Let i(b) = -b*2 - 4b + 5. Let j be i(-6). Let r(h) = 20h2 - 4 - 2h + 22h2 - 35h2 + h3 - 6. What is r(j)? 4 Let i(y) = -6y - 101. Let p(d) = 4d + 8. Let l(q) = i(q) + 3p(q). Give l(14). 7 Let i be -85/(-6 - -1). Let j(a) = -3a + ia + a*2 - 9 + 3. Determine j(-5). -6 Let s = 69 - 66. Suppose -sc - 391 = -139. Let n = c - -89. Let u(q) = q + 6. Calculate u(n). 11 Let b(k) = -k*2 + k - 2. Let s = 9 + -1. Suppose -2n + 0 = -s. Let p be -6-2(3 - 11/n). Give b(p). -8 Let y(q) = -19q3 + 4q*2 + 8q - 8. Let g(h) = -25h3 + 3h*2 + 10h - 7. Let u(i) = 3g(i) - 4y(i). Calculate u(7). -3 Let o(r) be the first derivative of -r*5/120 - 2r4/3 + r3/3 + 14r2 - 88. Let u(v) be the third derivative of o(v). Give u(-10). -6 Let s(a) = 42 - 208a + 99a + 110a - 36. Suppose -z = 2d - 26, -3d + 2 = 3z - 43. What is s(d)? 17 Let v(o) be the second derivative of -o5/15 - o4/24 + 95o*2/2 + 103o. Let z(q) be the first derivative of v(q). Give z(-1). -3 Let h(d) = 6d - 2274 + 4534 + d - 2234. What is h(-3)? 5 Let r(i) = 30i - 289. Let k be r(10). Suppose ky + 6 = 14y. Let m(c) = 2c3 - c2 - 2c + 3. Determine m(y). 11 Let x(c) = -5c + 28. Let h be x(-8). Let n(v) = 3 - 67v*2 + hv*2 - 2. Give n(-2). 5 Let v(c) = -96 - 1937c2 + c3 + c + 104 + 1931c2. Calculate v(8). 144 Let h(f) = -10f + 2f2 + 0f + 4 + 3f. Suppose 0 = 317k - 300k - 68. What is h(k)? 8 Let c(n) = -20n - 3. Let o(v) = 36v + 12. Let i(h) = 2c(h) + o(h). What is i(21)? -78 Let w(s) = -s + 4. Let a be (-3(-17)/5)/((-34)/(-170)). Suppose 24 = 5h - 4t, -a + 103 = 5h + 3t. What is w(h)? -4 Suppose -2i - 6 = 0, -12y = -13y - 4i - 16. Suppose -c - 5z = -2, 4 = 3c + z - 2. Let k(w) = -3 + wc + w + 0w*2 + 0w*2 + w. What is k(y)? 5 Let q(m) = 2m*2 - 79m + 38. Let j be q(44). Let x = j + -447. Let d(s) = s*3 + 13s2 - s - 7. Calculate d(x). 6 Let x(d) be the first derivative of d3/3 - d*2/2 + 10d + 2324. Calculate x(0). 10 Let i = 128 + -53. Let r = 73 - i. Let j(w) be the second derivative of -w3/2 + w2/2 + w. Give j(r). 7 Let j(t) = 9678t2 + t3 - 9672t*2 - 3 + 0 + 5t. Give j(-5). -3 Let n = 1154 + -1129. Let o(v) = 2v - 50. Give o(n). 0 Let x(p) = p - 3. Let u(n) = n3 + 7n*2 + n - 15. Let z be u(-6). Suppose 6g = g - z, -3g - 25 = -2s. Give x(s). 5 Let j(s) = -6s - 105. Let t be j(-17). Let z be t(-2)/(-39) + (-30)/(-26). Let q(o) = -4o3 - 2o*2 + 1. Determine q(z). -5 Let v be (-404)/1212(6 + 0)/(4 + -2). Let n(h) = -3h3 - 3h*2 + 6h + 7. Give n(v). 1 Let d(y) = -640 - 661 + 1290 - 11y. What is d(-4)? 33 Let o(f) be the second derivative of f4/12 - f3/6 + 3f*2/2 - 2f. Let s(q) = q*3 - 7q*2 + 13q. Let z = 210 - 207. Let m be s(z). Calculate o(m). 9 Let z(c) be the first derivative of c5/120 - c4/12 - 4c3/3 + 15c + 247. Let s(r) be the third derivative of z(r). Calculate s(-4). -6 Let v(w) = -w*3 - 7w*2 - 4w - 7. Let y(b) = -3b3 + 102b2 - b + 27. Let h be y(34). Give v(h). 21 Let a(t) be the third derivative of t5/60 + t4/24 - t3/6 - t*2. Suppose 0 = -32i - 13486 + 13486. What is a(i)? -1 Let y be ((-252)/17)/(-7) - 10/85. Let q(l) be the third derivative of -1/2l3 + 0 + 0l + 3ly + 1/24l*4. Give q(6). 3 Suppose -62 = -11a - 18. Let i(o) = -22o2 - o3 + 6o + 27o2 + 0o*3 + 1 - ao. Suppose 0 = -3w - w + 20. Give i(w). 11 Let k(x) = 43x*2 + 235x + 4. Let u(q) = 37q2 + 201q + 2. Let v(d) = -6k(d) + 7u(d). Let w(o) = 6o2 - o - 1. Let j be w(-1). Calculate v(j). 8 Let c be -20((-4 - -5) + (-9)/6). Suppose -25 = 3u + 2h, -2h = -3u + 3h + c. Let m(r) = r + 8. Give m(u). 3 Let i(y) = -100y + 949y3 - 3 - 13y*2 - 11y*2 + 4y*2 - 474y*3 - 476y*3. Give i(-10). -3 Let l be (-2)/327/(-6). Let s(h) = -5 - lh2 + 2 + 4h*2 - 9h. Suppose -3o - k - 24 = -6o, -3o = -2k - 21. Give s(o). -3 Let k(h) = h*2 - 6h + 6. Suppose 0 = 7d - 73 + 17. Suppose dr - 5o + 3 = 5r, 5o - 19 = -r. Calculate k(r). -2 Let k(t) = -101585 + 101585 + t. Suppose -2q - 3q = 35. What is k(q)? -7 Let p(s) = 5s*2 - s + 1. Let d be p(1). Suppose dz - b = 56, 2b + 48 = 5z - b. Let a(f) = -2 + 4f3 + 11f + zf2 - 12f - 14f2. Give a(2). 20 Let x(b) be the first derivative of b4/4 + 10b*3/3 - 5b*2 + 13b - 3. Suppose 108p = 370p + 2882. What is x(p)? 2 Let q(m) be the third derivative of -m6/120 + m5/4 + 5m4/8 + 8m*3/3 + 820m*2. Give q(16). 0 Suppose -152 = -3g - 167. Let u(d) = 6 - 7d - 9d + 13d. Give u(g). 21 Let z = -3528 + 3514. Let k(o) = -o - 15. Calculate k(z). -1 Let g(o) = -567 + 5o - 588 - 584 + 2353 - 585. What is g(-8)? -11 Let j be -2 + (3 - 11) - -1. Let f(v) = v*2 + 10v + 5. Give f(j). -4 Let b be (8 - 3) + (0 - -1). Let i(a) = 0 + 0 -	{ "pile_set_name": "DM Mathematics" }
w(-1). Solve 9 = rd - 4g + 2, d - 15 = -ng for d. 5 Let o(a) = -a2 + 13a - 4. Let d be o(11). Solve 2j + d = 4v, 4v - j - 21 = -2j for v. 5 Let k = -5 + 10. Let b be (3 + 12)/((-3)/(-2)). Solve ki + b = 4f, -3i = 3f - f + 6 for i. -2 Suppose 3n - 29 = n + 5i, -5i = -5n + 35. Solve 3b - b - na = 4, 0 = -b + 5a - 10 for b. 5 Let i = 60 - 40. Let c = i - 17. Solve 3 = 5a + 5t - ct, -5a + 2t = -7 for a. 1 Suppose 5j - 60 = -0z - 5z, j - z - 2 = 0. Solve -5b + w = 16 + j, 0 = -2b - 3w + 1 for b. -4 Let u = -60 - -60. Solve u = -5p - 4r - 3, -2p + 5p = -r - 6 for p. -3 Let r(t) = t*2 - 16t + 53. Let f be r(12). Solve -3z = -5x - 9, 0z = -2x - fz - 16 for x. -3 Let s = 36 + -36. Solve -3 - 1 = 4t - h, s = -2t + h - 2 for t. -1 Let t(c) = -c3 + 6c*2 + 10c - 6. Let o be t(7). Let x = -43 - -47. Solve 2a - o = -a, 5a = -xw + 17 for w. -2 Let f(l) = 2l*2 + 7l + 8. Let b be f(-3). Solve -bm + t = -4t - 25, -m = -5t - 5 for m. 5 Let d be (-2 - 0)/(2/(-8)). Let t = d - 4. Solve -y = 5i - 7, -ty = -5i - 2 - 1 for i. 1 Let m be 1 + -1(-6 + 5). Solve 0 = -3j + 3, 9 - 2 = mq - j for q. 4 Let t(v) = -2v - 8. Let r be t(-6). Suppose -5s - 3 = -2j - 15, -3s = -rj - 24. Let w = j - -10. Solve -2o + 22 = -4g - 4o, -5g - wo - 32 = 0 for g. -4 Suppose -4a + 3j + 60 = 0, -5j + 2j = 3a - 66. Solve 2r - 4u + 4 = -0u, 5r - 2u = -a for r. -4 Let x be 1(-4 - -1)-1. Let m = 26 + -18. Solve m = -xr + 4f, -3r + 22 = 2f - 0 for r. 4 Let y(f) = f3 + 3f*2 - 5f. Let u be y(-4). Let h(c) = 4c2 - 1. Let g be h(1). Solve -5k - 5 + 2 = gm, 3m = uk - 3 for m. -1 Suppose -o + 7o = 0. Suppose 4j + j - 3a - 48 = o, a - 26 = -3j. Solve -2s + 9y = 4y - 15, s - j = 3y for s. 0 Let b(h) = h3 + 7h*2 + 4. Suppose 2j = f - 3 - 9, 5j - 3f + 29 = 0. Let g be b(j). Solve 0 = -5w - 4l - 11, -w = -gl + l + 6 for w. -3 Let z(t) = 2t*3 - 4t*2 + 4t - 3. Let s be z(2). Suppose -36 = 2l - sl. Solve 0 = -2n - 4w + 2w - 4, -l = 3w for n. 2 Let g(s) = -2 - 2 - s*3 + 7s + 0s + 5s*2. Suppose 4v - 5 - 39 = -4i, 0 = 4v + 5i - 49. Let z be g(v). Solve -p - 5f - 18 = 9, -4p + 2f = -z for p. -2 Suppose -4w + 5w = 4. Let y = 114 - 108. Solve 4f + 5 = a, -wa = -2f - 0a - y for f. -1 Let s(q) = 45q2 - 1. Let k be s(-1). Let u = -24 + k. Solve 4a - 8 = -4i, -a + 6a = u for i. -2 Let c(l) = l*2 + 2. Suppose 5m - 2 = 13. Let p be 0/(2m/2). Let x be c(p). Solve 2r = -0r - q - x, 0 = 4r + q + 2 for r. 0 Let f be ((-1)/2)/((-3)/96). Let z = -36 + 26. Let s = f + z. Solve sw + 15 = w, 4n = 4w + 12 for n. 0 Suppose 5a - 53 + 18 = 0. Let w = a - 5. Solve -s = 3k + k - w, -3k + 10 = 5s for s. 2 Suppose 0 = 4y - 7 - 5. Solve 4t - 4 = -o, -5o + yt - 14 = -3o for o. -4 Let o(n) = -4n - 4. Let k = -1 + 5. Let m be o(k). Let w be (145/m)/((-2)/8). Solve -t + 3i = 7, -2t = 3t + i - w for t. 5 Let h be 2 - 3 - (-1 + -2). Solve 3 = -w + hk, 3k - 3 = -w + 3w for w. 3 Let n be -8(3 - (-21)/(-6)). Let x = n - 1. Solve 13 = -0o - 5o - xt, 2t = -2o - 6 for o. -2 Let w(t) = -1 + 2 + t + 1. Let c be w(4). Solve 2m + 3j - 3 - c = 0, -2j = m - 7 for m. -3 Suppose 4x + 0x - k - 13 = 0, 0 = 2x + 4k + 16. Solve m - 3 = 0, -r + xm - m + 2 = 0 for r. 5 Let u = -6 + 2. Let l be u/1105/20. Let z be (l/(-35))/((-1)/(-5)). Solve v = 0, -5i + zv + 0 = 5 for i. -1 Let h = -26 + 37. Suppose l - 3 = 0, 4g + 2l = 24 + 6. Solve -h = 2y + 3x, -2y + gx - 3x + 7 = 0 for y. -1 Let n = -96 + 100. Solve 0 = 3a - r + 7, -2r - 8 = na - 2 for a. -2 Let p be -2 - ((-65)/9 - (-2)/9). Solve 4m + u + 0u + p = 0, 0 = -3m + 4u + 20 for m. 0 Let o = 34 + -31. Solve -5u = -3r + 12, -or + 2 + 7 = -4u for r. -1 Let f(p) = p3 - p2 - p + 2. Let a be f(2). Let b = a - 1. Solve bn = 2m + 16, 0n - 4n + 3m + 23 = 0 for n. 2 Let p(v) = v3 - v + 3. Let b be p(0). Solve -5g + bh - 11 = 0, -g + h = 2g + 5 for g. -1 Suppose x + 4 = 8. Suppose -4g + 2g + 34 = 0. Solve -2z - 18 = -5o, -o + xz + 1 = -g for o. 2 Suppose 2x = -0 - 8, x = 4o + 72. Let k = 6 - o. Solve -j + k = -2j - 5r, -5r - 20 = 0 for j. -5 Suppose 5n + 4b - 32 = -10, 0 = 5n + 2b - 16. Solve 2q + 1 = -j - n, 4j = -3q - 7 for q. -1 Let u = 6 + 3. Solve -s - 5o = u, s = -4s + o - 19 for s. -4 Let p = 10 - 14. Let w(t) = -8t + 4t + 4 + 2t*3 - 5t2 - t3 - 2t3. Let j be w(p). Solve q + 2o = 0, -4o = jq - o for q. 0 Suppose b - 5b = -5z - 50, 3b - 35 = 5z. Solve -5u + f = -b, -2f = -3f for u. 3 Suppose 5c = 37 - 7. Let k(z) = -z*2 + 8z - 9. Let h be k(c). Solve 2a = 2i, 4 = -i + hi - 4a for i. -2 Let l = 0 - 9. Let y be (48/10)/(l/(-60)). Suppose 0 + y = 2t. Solve 3c - 3x = -3, 2c + 5x - x = t for c. 2 Let t(r) = -r - 8. Let a be t(-8). Suppose 5o - 20 = -ao. Let w = -1 + 3. Solve oh - 3g = 17, -3g = wh - 8g - 5 for h. 5 Suppose -5h = 15, -3t + h = -h - 96. Suppose -t = -a - 4a. Solve 5l - f = 29, 5f + a = -2l - 4 for l. 5 Let m be 3(-2 - -1) + 5. Solve -5a = 2w + m, 2w - 5a - 2 + 4 = 0 for w. -1 Let u(g) = -g2 + 7g - 6. Let k be u(4). Suppose 3o = -y + 14, -5o + k = -3y - 2o. Let a = 6 + -1. Solve 4l = y - 18, aw + 4l - 4 = 0 for w. 4 Suppose 9z = 3z + 72. Solve 0 = 3q, m - 3q = -2m + z for m. 4 Suppose -3y = -5v - 103, 4 = -2v - 0. Let o = -16 + y. Solve p + 2t = -4p + 5, -5p - 4t + o = 0 for p. -1 Let f(d) = 2d*2 + 6d + 6. Let l be f(-2). Solve 3r + 6y - ly + 32 = 0, -r + 5y = -21 for r. -4 Let z(k) = -4k + 6. Let b(f) = -f. Let u(t) = -3b(t) + z(t). Let o be u(6). Solve 3d = 3q + 6, -d - 3q + oq = 18 for d. -3 Let s be (-3)/(22/(-4)). Let x = s + 0. Suppose xf = -0f + 48. Solve 0 = -r + 5w + f, -17 = -5r + 2w + 2w for r. 1 Suppose 7j - 2j = 0. Let r be 2/8 + (-33)/(-12). Let n be (-8)/r(-6)/4. Solve nl = 5u - 21, -u + 9 = -2l - j for u. 1 Suppose 6 - 46 = -4r - 3x, -2r - 3x + 26 = 0. Suppose 5l + 3 = 23. Solve -d - 3q + 1 = -rq, -ld + 4 = -q for d. 1 Let s = 64 + -61. Solve -2q + b - 13 = 0, -2q + 1 = -4q - sb for q. -5 Let z(p) = -p - 4p + 5p2 - p3 + 4p. Let u be z(4). Suppose l - u = -2l, 5l = 4w + 16. Solve -7m + 4q = -6m + 23, -q = 2m + w for m. -3 Suppose -4b - 2 = -s + 17, -2b - 2 = 2s. Suppose 0v = -2v + 2. Let k be 6/2 + v + -1. Solve 0 = -4o + sg - 1, kg - 5 = 2o for o. 2 Let t(y) = -y*3 - 3y*2 - 2y - 1. Let p be t(-3). Suppose -d - x = -2, px = -d + 3 - 1. Solve 3 = h + v, 0 = dv - 14 + 6 for h. -1 Let n(x) = 12x2 + x. Let a be n(1). Let y = 7 - a. Let p be 254/10 - y/(-15). Solve 0f = -3f + 2k + p, 3f = -4k - 5 for f. 5 Suppose -2a + 9 = -3. Let g(l) = -l2 + 7l - 6. Let w be g(a). Solve 4o = 3d - wd + 35, -5o + 35 = -2d for o. 5 Suppose -x + 3c = -5, 5x - 47 = c - 8. Solve -i + 2 = -5s, -s - 2s + x = 4i for s. 0 Suppose -3r - 3u = -18, r + 4u = -u + 22. Solve -3j - rx = -14, 1 + 6 = 3j - 5x for j. 4 Let w be (-6)/4 + 1/(-2). Let a = w + 6. Suppose -ai = -3c - 32, -3i + 18 = -2c - 5. Solve -3o - 5r + 5 = 2o, -io + 3r - 3 = 0 for o. 0 Suppose 3a = 2a. Let d(w) = 2w - 15. Let u be d(10). Solve -uz + ai + 15 = -i, -3i = 4z - 12 for z. 3 Let z be 4 + 0 + -3 + 3. Suppose 2v - 18 = -3p, -22 = zv - 7v - 2p. Solve -5f + 3c = -35, -2c = 3f + f - v for f. 4 Suppose -3g + 4g - 4j + 4 = 0, -2g = -j + 22. Let w(r) = r*2 + 12r + 15. Let h be w(g). Solve -5m - 3l - 2 = 0, 1 + h = 2m - 3l for m. 2 Let n(y) = 2y + 18. Let x be n(-8). Solve -4d + 4 = xa, 3d - 15 = -2d for a. -4 Suppose -7t + 2t + 15 = 0. Solve -2x - q - 3q + 12 = 0, 0 = tx + 2q - 6 for x. 0 Let w = -3 - -6. Let g(p) = -7p*2 + 0p*2 + 8p*2 + 6 + 2 - 6p. Let x be g(5). Solve 5k + 3d + 0 = 8, 0 = xk - wd for k. 1 Let v = -6 + 8. Let d be (v/(-4))/(3/(-30)). Let u(i) = 2i2 - 2i. Let a be u(-1). Solve 0 = -dn, -y - an = -n + 2 for y. -2 Let h be 04/(-8) + 13. Solve 3o - 4i = -h, -3o + 2i = -0o + 11 for o. -3 Let j(h) = h + 3. Let a be j(-3). Let g = -3 + 6. Suppose -1 = gr - 3u + 5, -3u = -r - 12. Solve as - 2s + 10 = -4z, r = s for z. -1 Let d = 2 + 0. Let g = -12 - -10. Let a(w) = -3*	{ "pile_set_name": "DM Mathematics" }
u(t) + 2x(t). Let k(n) = n - 2n + 3n. Calculate k(i(g)). 8g*2 Let q = -18 + 21. Let u(d) = 6 - qd - 3 - 3. Let p(x) = 6x2. Give p(u(b)). 54b*2 Let z(i) = -2i. Let u(t) = -2t + 1. Let p be u(-1). Let a(k) = -4k*2 - k + 4k - pk. Give z(a(f)). 8f*2 Let a(v) = 11v*2. Let h(g) = -113g*2. What is h(a(r))? -13673r*4 Let o(x) = -2x*2. Let l(y) = 3y - 2. Let t(g) = -7g + 5. Let s(f) = f3 + 6f*2 + f + 8. Let m be s(-6). Let u(r) = mt(r) + 5l(r). Give o(u(a)). -2a2 Let s(t) be the second derivative of -t3/6 - t. Let m(a) = -4a2 - 14a. Let x(z) = z*2 + 3z. Let k(f) = 3m(f) + 14x(f). Give s(k(q)). -2q2 Let s(i) = i. Let v(u) = -2u - 245. Give v(s(n)). -2n - 245 Let n(l) = 0l*2 - 3l2 + l2. Let u(k) = -10k. Calculate u(n(p)). 20p*2 Let d(k) be the second derivative of 5k*3/6 + 3k. Let x(b) = -12b2. Give x(d(s)). -300s*2 Let i(s) = s. Suppose -3r - 11 = -5a, -5r = -4a + 6a - 23. Let w(b) = -4b - 5b + ab. Let z(l) = -6i(l) - 2w(l). Let p(t) = t2. Determine z(p(k)). 4k*2 Let j(i) = -25i + 97 - 97. Let f(x) = -2x. Determine f(j(k)). 50k Let u(w) = 4w2. Let x(k) = -4k + 2. Determine u(x(a)). 64a2 - 64a + 16 Let m(r) = 13r - 17r + 7r. Let g(q) = 6q. Calculate g(m(s)). 18s Let s(y) = 2y2 - 90. Let m(l) = l2. Give s(m(r)). 2r4 - 90 Let x(j) = -j2. Let l(w) be the second derivative of -w3 + 11w*2/2 + 4w. Let b(g) = 2 + 2 - 2g + 0. Let r(k) = 11b(k) - 4l(k). Calculate x(r(u)). -4u*2 Let k(m) = -838m*2. Let v(d) = -d. Give k(v(x)). -838x2 Let s(m) = -m2. Suppose -10 = 2c - 7c. Let t(b) = -3b2 + 0b*2 + 3b*c - 5b*2. What is s(t(d))? -25d*4 Let y(p) = 29p - 16p - 14p. Let u(h) = 6h2. Calculate y(u(s)). -6s2 Let o(j) be the third derivative of -j5/30 + j*2. Let b(h) = -5h + 0h + 2h + 8h. What is o(b(t))? -50t*2 Let y(j) = -j. Let l(s) = 2s*2 - 9s. Let w(m) = -2l(m) + 18y(m). Let x(f) = 16f + 2f*2 - 16f. Calculate x(w(o)). 32o4 Let i(p) = -3p - 78 + 78. Let n(r) = 7r. What is i(n(c))? -21c Let f(u) = u + 4. Let h(n) = n2. What is f(h(d))? d2 + 4 Let b(u) = -111u2. Let l(p) = -2p*2. Determine b(l(n)). -444n4 Let j(z) = -z2. Let i(v) = 11965v. What is j(i(c))? -143161225c*2 Let w(b) = 1 - 222b*2 + 111b*2 + 100b*2. Let a(y) = -2y. Calculate a(w(n)). 22n2 - 2 Let l(p) = p + 1. Let b(z) = 1 + 1 + 4 + 9z - 2z. Let a(s) = -s + 1. Let r be a(7). Let v(y) = rl(y) + b(y). Let x(f) = f2. What is v(x(g))? g2 Let o = 8 - 4. Let z be ((-16)/10)/(o/(-20)). Let j(x) = -z + 2x2 + 8. Let v(t) = t2. Determine j(v(d)). 2d4 Let p(v) = v2. Let z(c) = -2c + 1. Let a(k) = -5k + 3. Let r(b) = 3a(b) - 8z(b). Let t(j) = -5j - 6. Let f(g) = 30r(g) + 5t(g). Give f(p(l)). 5l2 Let f(r) be the third derivative of r5/60 - r*2. Let m(u) = 5 + 2u + 6 - 11. Give f(m(a)). 4a2 Let y(s) be the first derivative of -7s*3/3 - 8. Let k(l) = l. Calculate y(k(w)). -7w*2 Let u(d) = -7d*2 + 4d - 4. Let i(r) = 0 - 1 + 2 - 2r2 - r + 3r*2. Let s(m) = 4i(m) + u(m). Let n(j) = j. Determine s(n(b)). -3b2 Let u(k) be the third derivative of -7k*4/24 + 3k*2. Suppose 2t + 2t + 4o = 16, -3o = -5t + 4. Let i(b) = 0 + tb - 1 + 1. Give i(u(w)). -14w Let r(j) = j*2. Let o(u) be the first derivative of 13u*2/2 - 3. Give o(r(y)). 13y*2 Let f(s) = -9s. Let z be (4 - 1)/(27/18). Let i(t) = 0t2 + 0tz - t2. Calculate i(f(h)). -81h2 Let w(y) = -y + 0y + 2y. Let h be -6(3/(-2) + 1). Let u(l) = -hl + 0l + 6l - 2l. Give u(w(b)). b Let t(c) be the third derivative of c*4/12 - 3c*2. Let p(z) = -2z*2 + 4z*2 + 0z*2. Calculate t(p(l)). 4l2 Let c(r) be the first derivative of r2/2 + 5. Let n(v) = -3v2. What is n(c(d))? -3d2 Let h(n) be the first derivative of -n6/120 + n*3/3 - 1. Let a(u) be the third derivative of h(u). Let r(c) = 2c*2. Give r(a(i)). 18i*4 Let c(u) = 6 + 5 - 11 - 5u. Let n(k) = -2k2. Determine n(c(m)). -50m*2 Let k(f) = 12f*2. Let z = -9 + 12. Let h(b) = 6b. Let x(w) = -5w. Let j(m) = zh(m) + 4x(m). Determine k(j(a)). 48a*2 Let c(q) be the first derivative of 2q*3/3 + 2. Let h(r) = 3r*2. What is h(c(m))? 12m*4 Let r(b) = -3b*2. Let p(t) = 477t. Calculate r(p(n)). -682587n2 Suppose v - 6 = -3k + 4k, -3v + 2 = k. Let q(t) = 14 - 14 + 5tv. Let x(a) = -2a*2. What is x(q(z))? -50z*4 Let w(t) = t + 1. Let j(p) = -7p - 1. Let n(l) = j(l) + 6w(l). Let b(f) = f. Calculate n(b(a)). -a + 5 Let o(v) = -2v. Let c(a) = -11a + 26 - 26. Determine c(o(t)). 22t Let g(a) = 8a. Let q(d) = 18d. Give q(g(t)). 144t Let f(c) = -c + 2c + 2c. Let v(a) be the third derivative of 0a + 0 - 2a2 + 0a*3 + 1/12a*4. Give f(v(z)). 6z Let n(i) = -518i. Let m(d) = d2. Calculate m(n(z)). 268324z*2 Let v(c) = -10c. Let h(o) = -10o. Calculate v(h(u)). 100u Let w(y) = y2. Let s(a) be the second derivative of a4/4 + 2a. Give s(w(r)). 3r*4 Let r(a) be the first derivative of 11a*2/2 + 34. Let z(q) = 3q. Give r(z(s)). 33s Let r(h) be the first derivative of -h3/3 + 6. Let x(p) = -9 + 2p + 9. Give x(r(b)). -2b2 Let l(i) be the third derivative of -5i*4/24 + 3i*2. Let r(u) = 2u - 5. Let w(y) = -y + 2. Let n(v) = 6r(v) + 15w(v). Give l(n(j)). 15j Let z(s) = s2. Let n(c) = -553c*2. Calculate n(z(y)). -553y*4 Let q(i) = -6i - 7. Let m(h) = -5h - 6. Let z(b) = -7m(b) + 6q(b). Let a(l) = 9l*2. Determine a(z(w)). 9w*2 Let j(u) = u. Let c(y) = 146y*2 + 1. What is j(c(l))? 146l*2 + 1 Let c(y) = -2y*2. Let p(d) = 23d*2 + 11d + 11. Let t(b) = -6b2 - 3b - 3. Let k(q) = -6p(q) - 22t(q). What is k(c(r))? -24r4 Let s(d) = 2d. Let b(g) = 40g2 + 11g - 22. Let m(i) = -i*2 - i + 2. Let a(q) = -2b(q) - 22m(q). Determine s(a(n)). -116n*2 Let l(o) = -30o*2. Let r(b) = 5b*2 - 4b + 4. Let v(x) = -x*2 + x - 1. Let u(s) = r(s) + 4v(s). Give u(l(j)). 900j4 Let z(t) = 134t - 2. Let m(c) = -3c. Calculate m(z(i)). -402i + 6 Let z(u) = u + u - u + 0u. Let r(d) = -15d. Give r(z(q)). -15q Let y(t) = 2t*2. Suppose -4k + 3 = -2i + 17, -2i - 2 = 4k. Let c be -4(3/(-2))/i. Let n(s) = c - 2 - s. Calculate y(n(r)). 2r2 Let t(r) = -2r*2. Let c(d) = -14 - 10 - 2d + 24. Determine t(c(o)). -8o2 Let y(v) = -v. Let q be 2/634. Let u(a) = 4a - qa + 0a - 3a2. What is u(y(w))? -3w*2 Let c(b) = 42b*2. Let g(p) = 6p*2. Give g(c(o)). 10584o*4 Let x(h) = 2h*2. Let t be 4/(-8) - 27/(-6). Let s be (-8)/(-6)3/1. Let a(p) = -2p - sp + tp. Determine a(x(z)). -4z*2 Let h(l) = -5l + 3. Let g(t) = 56t - 32. Let s(a) = 3g(a) + 32h(a). Let o(i) = -i2. What is o(s(w))? -64w*2 Let p(z) = -z. Let y(l) = -616l. Give p(y(u)). 616u Let o(y) be the third derivative of -y5/20 + y2. Let g(i) = 2i*2 + 12 - 12. Determine g(o(n)). 18n*4 Let i = 0 - -2. Suppose -30 = -13u + 22. Let f(k) = -k2 - k2 + 4k2 - uki. Let t(w) = -w2. What is f(t(z))? -2z4 Let h(i) = i. Let l(g) be the third derivative of g4/12 + 16g*2. Give h(l(k)). 2k Let c(n) = -11n2. Let s(u) = u2 + 6u. Let v(m) = -3m2 - 17m. Let y(p) = 17s(p) + 6v(p). What is y(c(z))? -121z4 Let k(d) = d2. Let s(r) = 2175r*2 + 203r + 203. Let p(t) = 32t2 + 3t + 3. Let m(a) = -203p(a) + 3s(a). Determine m(k(q)). 29q4 Let v(u) = -153u. Let r(m) = -18m2. Calculate v(r(n)). 2754n*2 Let q(u) = -5u2. Let c(y) = y2 - y - 1. Let a(b) = -12b2 + 15b + 15. Let v(t) = t - 5. Let g be v(6). Let m(s) = ga(s) + 15c(s). What is q(m(f))? -45f4 Let d(j) = -4j. Let c(i) = 2i2 + 5i + 5. Let p(o) = -o*2 - 2o - 2. Let f(s) = 2c(s) + 5p(s). Determine d(f(l)). 4l2 Let o(g) = 26g*2 - 5. Let k(y) = 2y*2. What is o(k(f))? 104f*4 - 5 Let l(t) = -3t. Let g(x) be the first derivative of x*2 + 4. Determine g(l(k)). -6k Suppose -h = -g + 3, 0g - 22 = -4g - h. Suppose -3f + 17 = t, -5f = -2f + gt - 37. Let l(s) = fs - 6 + 9 - 3. Let i(p) = p. Calculate l(i(u)). 4u Let l(i) = 15i2. Let f(y) = 9y. Calculate l(f(s)). 1215s2 Let u(a) = -a + 10. Let c be u(7). Let x(h) = ch - 1 + 1 - h. Let v(k) = 2k. Calculate v(x(f)). 4	{ "pile_set_name": "DM Mathematics" }
6.78792189546? -9.78792189546 Add 81188372247663 and -0.5. 81188372247662.5 Work out -3751349346376.2 - -0.06. -3751349346376.14 What is -248632613708 minus 0.1? -248632613708.1 Add together 1.68 and -217229729.1. -217229727.42 Put together 6 and 45159058290.9. 45159058296.9 Sum -3575 and -6067031. -6070606 Calculate -831313601620 + 0.01. -831313601619.99 -668644644258708 - 2 -668644644258710 What is -17003 - -0.07981488? -17002.92018512 33.6848 - 1242110 -1242076.3152 -3181355 + -0.07223468 -3181355.07223468 Calculate -16614767344967 + -0.2. -16614767344967.2 Sum 0.2 and 4.846687398. 5.046687398 0.4753+362727665.9 362727666.3753 What is 422306910 - -1020? 422307930 -7.1+-701636925 -701636932.1 What is 0.3 take away 31705728135.3? -31705728135 Put together 31.4798 and 0.0492632. 31.5290632 -205.8898761+0.08 -205.8098761 Add together 1 and 137052412.15537. 137052413.15537 What is 5.921 - 10779963623? -10779963617.079 Total of 17805.10447472 and 0.39. 17805.49447472 Calculate 347933755701299 + -0.5. 347933755701298.5 Work out -60548 + -0.0225448901. -60548.0225448901 Work out 2433671703.75 + 3. 2433671706.75 Put together 2028581923.33 and 0.3. 2028581923.63 Sum 17 and 0.01880179895103. 17.01880179895103 Add -1654667063 and -0.72. -1654667063.72 Subtract 368957312436 from -0.53. -368957312436.53 What is the difference between -819360.98727 and 0.2? 819361.18727 What is the distance between -732 and -297682237? 297681505 Put together 0.0947 and -24.87963682. -24.78493682 What is 1041769778 take away -238.6? 1041770016.6 417049926897 + -1 417049926896 What is -113448112.04153 less than 0.2? 113448112.24153 25713.781 - 270 25443.781 What is 0.3 less than -189304.886746? -189305.186746 Work out -21650 - 716520255. -716541905 What is 773925789 + 38.011? 773925827.011 What is 926738766.669 less than -0.1? -926738766.769 What is 0.20954848237 less than 1.6? 1.39045151763 Put together 8915.842931 and -10220. -1304.157069 Put together -34157524252 and 2. -34157524250 -0.0986515135+1306 1305.9013484865 Add together -769260897 and -67548. -769328445 Total of 0.00653773353 and 474. 474.00653773353 What is -20870227 minus 342.13? -20870569.13 Add together -5.8692728472 and -0.3. -6.1692728472 What is -158123 + 2250109? 2091986 Work out 0.09067161865223 - 0.1. -0.00932838134777 Calculate -40917561 + -17.73. -40917578.73 Work out 0.96 + -808.3699899. -807.4099899 -1527 - -200747221258 200747219731 Subtract -0.04883071542898 from 0. 0.04883071542898 0.4 + -312.67133104 -312.27133104 What is -6075.43 plus 1932.52439? -4142.90561 What is -1212850588 take away -3140? -1212847448 Total of -5069.3668 and 2126. -2943.3668 Work out 1 - 60694516428143. -60694516428142 7286869427.3+-110 7286869317.3 44044562193491 + 0.06 44044562193491.06 What is 80847.9183 minus 1216? 79631.9183 448+15756415712 15756416160 What is 2356.44 less than 2261880? 2259523.56 What is -0.2 less than -594221300583? -594221300582.8 Sum 532181 and -2548037. -2015856 Sum -1.58943 and -11.42296. -13.01239 What is 8321.01979334 + 1492? 9813.01979334 Calculate -2 + -1859864519.6742. -1859864521.6742 What is 0.125 + 12236413039114? 12236413039114.125 Add 730893267 and -488529. 730404738 Calculate -0.135 + 6323568. 6323567.865 -0.381 - -783287886390 783287886389.619 Subtract 16618 from -4830592.7. -4847210.7 Calculate -0.1509 - -169063324. 169063323.8491 Work out 746 - 16654572465. -16654571719 Subtract -2 from -1278966452.366. -1278966450.366 What is -15418575 - -121151? -15297424 Calculate -2.425133 + -97.7823. -100.207433 Work out -43767672148 - -3.3. -43767672144.7 What is -7.47 plus 14.7725372? 7.3025372 Subtract -1.001549762 from -1. 0.001549762 -138457331 - 0.019345 -138457331.019345 What is 19736538512 - 1.5? 19736538510.5 Calculate -26310 + -231.2216. -26541.2216 What is -7.99151 + 24972.32? 24964.32849 -0.0562+217831.209 217831.1528 What is 233053788338.332 take away 0? 233053788338.332 Add 31.410030378 and 162. 193.410030378 What is the distance between 111.114509 and 510724? 510612.885491 Add 501 and 266562644. 266563145 Add -216714354 and 0.24. -216714353.76 Calculate -0.58160658953 + -168. -168.58160658953 42.2692896 - -322 364.2692896 What is -1031136501 - 146841? -1031283342 What is the difference between 178033788555059 and 7? 178033788555052 Calculate 344814185 + -702. 344813483 Calculate 73084459270 - 0.17. 73084459269.83 Subtract -0.228303411075869 from -1. -0.771696588924131 Work out -16 + -9403819328830. -9403819328846 Add 3748 and -572950180. -572946432 Add together 14 and -13633230406659. -13633230406645 What is the difference between -79069314 and 1920? 79071234 What is 24879388.86 take away -1558? 24880946.86 Total of 956 and 233.947442. 1189.947442 Work out -4.025 + 409.9706432. 405.9456432 What is -0.1 take away -2794700759.055? 2794700758.955 What is the distance between 1 and 306733104295221? 306733104295220 Subtract 0.16012 from -404552. -404552.16012 -1365892931209 - -1.1 -1365892931207.9 What is the distance between -179 and -91.06056914? 87.93943086 Add together -253151774 and 4830. -253146944 What is the distance between -0.06737 and -223.95065? 223.88328 Calculate 12796614154236 - 1. 12796614154235 What is 0.1134246 + 5480047? 5480047.1134246 907556.2 + -152588 754968.2 Calculate 331400278990 + 0.0183. 331400278990.0183 Add together 2604140 and 601.06. 2604741.06 Total of -0.3 and 9575215070843. 9575215070842.7 Total of -0.57291 and 15840268. 15840267.42709 Put together -62014680494800 and 0.3. -62014680494799.7 What is 1 + -0.23066627958215? 0.76933372041785 Subtract 0.0866 from -17376.345418. -17376.432018 Calculate -53.9 - 21577037226. -21577037279.9 What is -0.2 plus 263820413829? 263820413828.8 Calculate -1635.14839 - 0.7392. -1635.88759 What is 488161325 plus -2162022? 485999303 Work out -38.008587 - 340078. -340116.008587 Sum 126253199320 and -0.2. 126253199319.8 Work out 2276798.0324 - 1.2. 2276796.8324 What is 0.2605761 less than -442885509? -442885509.2605761 What is the difference between -1791926582 and 326.34? 1791926908.34 What is 277957753 plus 389972? 278347725 Calculate 8698150 + 2.5038. 8698152.5038 Total of 0.215235831 and -691. -690.784764169 Work out -0.09 + -2549718933490. -2549718933490.09 Add together -2941 and 112423.35353. 109482.35353 Put together 203117790 and -20.31. 203117769.69 Calculate -0.2 + -255974828388680. -255974828388680.2 What is -157089 plus -34.3265? -157123.3265 Work out -1.545 - 1971602560. -1971602561.545 What is 14.29 minus 36.704659? -22.414659 What is -718 minus -24837178624? 24837177906 What is the distance between -6990 and -121471.20222? 114481.20222 What is -6 minus -44793290703? 44793290697 What is 387 plus -1554.824551? -1167.824551 Put together -1686 and 85868.973. 84182.973 What is -19537004.42698 take away 4? -19537008.42698 Sum 11670638.46 and -47. 11670591.46 -18472 + 2731450821 2731432349 What is -821.554643 plus -0.044052? -821.598695 What is -156340263609660 + -0.4? -156340263609660.4 Add -673074491 and 0.09036. -673074490.90964 What is -112395742 take away -44.82? -112395697.18 What is -1431232072 less than -0.47648? 1431232071.52352 Work out 510549573959 - -3. 510549573962 What is 0.2 minus 506465883.93801? -506465883.73801 -0.3 + 388089549158 388089549157.7 Work out -2 + -95898744.5092. -95898746.5092 Put together -0.3487136 and -1.147756. -1.4964696 -19466483 + -0.1503289 -19466483.1503289 What is 133204285 minus -1842? 133206127 What is -42373653.8 take away -0.26353? -42373653.53647 What is 0.02 minus 1107596634145? -1107596634144.98 -49380.1496644 - -0.02 -49380.1296644 Add together 636041 and -75179832. -74543791 0.2365852 + -3646 -3645.7634148 Work out -460 - 130326957. -130327417 Calculate -824.466225 + 66. -758.466225 What is the difference between 4.01598928 and -0.003? 4.01898928 What is -299789.5947 - 8781? -308570.5947 What is -338916.21274 minus -19? -338897.21274 What is the difference between 119 and 5081740931.4? 5081740812.4 What is 111686.434 + 2295254? 2406940.434 What is -0.032185 less than 1839341? 1839341.032185 What is -0.25817550827 less than -80.89? -80.63182449173 Total of 1988113.1 and -197428. 1790685.1 Calculate 2754.219 + 258944. 261698.219 What is the distance between	{ "pile_set_name": "DM Mathematics" }
Let o = 2 - 2. Let r = -8944 - -8942. What is the biggest value in r, o, -4? o Let z be 2 + 0/2 + -3. Let t be z - (-4)/5 - (-130)/(-100). Let m = 3.4 + -3. What is the smallest value in m, t, 0.2? t Let s = -185 + 231. Which is the second smallest value? (a) 0.4 (b) -0.5 (c) s a Let r = 3 - 3. Let d = -4/41 + -13/287. Which is the biggest value? (a) r (b) d (c) -11/5 a Let y = 38.925 + 0.075. Let l = 45 - y. What is the second smallest value in 3, l, 0? 3 Let i = -79.9 + 79.94. What is the smallest value in i, 13/3, -2, 2? -2 Let n = -8.1 - -10.1. Let q(w) = -w + 7. Let z be q(11). Which is the second smallest value? (a) z (b) n (c) -0.5 c Let y = 0.087 - -0.013. What is the biggest value in -11, -0.1, 4.9, y? 4.9 Let a(u) be the second derivative of 0 + 9/2u2 - 5u + 1/6u3. Let g be a(-5). What is the smallest value in g, 0.1, 3? 0.1 Let l = -3 - -3. Let x = 8 - -28. Let y = x + -39. Which is the second smallest value? (a) l (b) -2/7 (c) y b Let u = 0.033 - 25.033. Let n = u - -30. Which is the biggest value? (a) -2 (b) 0.3 (c) n (d) 0.2 c Suppose 6y + 1257 = 1245. What is the fourth smallest value in -3, -1, -4, y? -1 Suppose 0 = p + y - 4, -4p + 7y + 14 = 10y. Which is the fourth biggest value? (a) 6 (b) p (c) -1 (d) -2 d Let n(w) = -17w - 4. Let o be n(6). Let s be -4 - (-3)/(19/4 + -4). Let q be -3 + s + o/(-34). What is the second biggest value in q, 4, 5? 4 Let n(q) = -34q2 + 1 + 13q - 5q - 30q*2 + 63q*2. Let m be n(8). What is the second smallest value in m, 0.1, 0.2, -0.02? 0.1 Let p = 2/219 + -452/1533. Let t = -1.6 - 0.4. Let x = 84 + -82. Which is the third smallest value? (a) t (b) x (c) p b Let l = 2.9 + -3. Let i = -1.5 + 0.3. Let a = i - 3.8. What is the smallest value in a, 5, l? a Let l = 123/5 - 25. Let z = 6.7 + -10.7. Let y = -3 + z. Which is the second smallest value? (a) -5 (b) y (c) l a Let y be (21 - 13) + (-119)/14. What is the fourth biggest value in 111, -0.4, y, 0.2? y Suppose 3n + 5 + 9 = -4h, -h - 11 = -3n. Suppose ni = r + 10, -r + 4 = i + 5. Let q = -5.1 + 3.1. Which is the third biggest value? (a) i (b) q (c) -0.3 b Let s = -209.1 + 201. Which is the second smallest value? (a) 2 (b) 0.3 (c) s b Let t = 879.7 - 880. Which is the third biggest value? (a) 2 (b) 15 (c) t c Suppose p + 4b = -16, -b - 3b - 40 = -5p. Let r be 3 + ((-5)/(-1))/(-1) + p. What is the second smallest value in 8, r, -2? r Let n = 10.466 + 0.034. Let p = n + -6. Let q = 5 - p. Which is the smallest value? (a) -2 (b) q (c) 0.2 a Let g = 8.9 - -0.1. Let o = g + -17. Let a = o - -5. What is the second smallest value in a, -1, 3/5? -1 Let w be (-8)/84 - (-32)/(-546). Which is the third smallest value? (a) 0.2 (b) -4/7 (c) -4/5 (d) w d Let n = 18 + -15. Let w = 3 - n. Let a be ((-5)/(-4))/(3/(-12)). What is the biggest value in w, 1, a? 1 Let l = -749.16 + 719. Let z = 30 + l. Which is the third smallest value? (a) z (b) 0 (c) -0.4 (d) 0.4 b Suppose 2 = 29f - 85. Let j = -1.8 + -6.2. Which is the third smallest value? (a) j (b) f (c) 5 c Let c = 0.921 - -0.079. Let t = -0.27 - 4.73. What is the fourth smallest value in -2/5, c, 3, t? 3 Let s(z) = -z + 1. Let y be s(6). Let g = -1.73752 - -0.03752. What is the biggest value in y, g, 2? 2 Suppose -4t = 5m + 29, 6t - 5 = t + 2m. Let l be 26/14 + (t - 1). Let n = 611/5 + -123. What is the biggest value in l, n, -1? l Let j(n) = -n3 + 27n*2 - 26n - 2. Let m be j(26). Which is the second biggest value? (a) m (b) -3 (c) -13 (d) -0.2 a Let q be (-4)/(-18) - (-1 - -1). Suppose -3l + 3 = 2v, -2v - 1 = 2v - l. What is the third biggest value in 3, q, v? v Let x = -73.57 - -68.7. Let p = x - 0.13. Let w = -4.9 - -0.9. What is the second biggest value in w, p, 11? w Suppose 10x - 7x + 9 = 0. Let v = x - -29/9. What is the smallest value in 0.2, 1.9, -2, v? -2 Let n = -52 - -32. Let b = 23 + n. Let j = b - 4. What is the biggest value in -0.1, j, 1/7? 1/7 Let d = 5.8 + -3.8. Which is the second smallest value? (a) -33 (b) d (c) 4 b Let w = 4 - 30. Let m = w + 7.5. Let j = -19 - m. Which is the second smallest value? (a) -4 (b) -0.2 (c) j c Let y = 2.6 - 1.8. Let w = y + -3.8. Which is the smallest value? (a) 0.4 (b) -0.2 (c) w c Let m be (6 - (-60)/(-8))(1 + 7). Let q be (-4 + 1)m/(-9). Which is the third smallest value? (a) q (b) -28 (c) -1 c Let w = -4/849 - -214/5377. Let x = -16 - -13. Which is the biggest value? (a) w (b) x (c) 0.3 c Let i = -0.3 - -0.5. Let u = -112.2 - -112. Which is the third biggest value? (a) i (b) -0.1 (c) u (d) 2/3 b Let d = -4.307 + 3.907. Let h = -0.4 + 0.2. Let i = h - -0.3. What is the biggest value in -0.1, i, d? i Let s = 4574/13 + -352. Let f = 4.4 + -4.8. Which is the second biggest value? (a) -2 (b) s (c) f c Suppose 0 = -534m + 530m + 1056. Which is the smallest value? (a) m (b) 5 (c) 1 c Let i = 1.62 + -1.62. Which is the second biggest value? (a) -3 (b) i (c) 15 b Let y be 3/(-12)(294/(-114) + 3). Which is the second smallest value? (a) -9 (b) y (c) 1 b Let o = 222.2 + -221.7. Let c be (-378)/(-373) + 2/(-2). Let v = -10399/3357 - c. What is the second smallest value in v, o, 0.1? 0.1 Suppose -2w - w - 1 = -d, 0 = 4w - 5d - 17. Let h = -1869 - -1872. Let r = h - w. Which is the second biggest value? (a) r (b) -4 (c) 3/4 c Let b = 143 - 138. What is the fourth biggest value in b, -5, -0.8, 0.4? -5 Let d = 59.23 - 59. Let j = 0 - d. Let s = 0.07 - j. Which is the biggest value? (a) 1/3 (b) s (c) -0.3 a Let f = -0.563 + 0.063. Which is the third smallest value? (a) 29 (b) 4 (c) f a Let l = 21334.3 + -21334. Let d = -0.2 + 0.4. What is the smallest value in l, d, 1, -4? -4 Suppose -4m + 23 = -5l, l + 49 = -m + 39. What is the fourth biggest value in -4/5, 31, 3, l? l Let x = -45 - -49. Which is the second smallest value? (a) -0.3 (b) x (c) -0.041 c Let k = -9.2 + 6.2. What is the fourth smallest value in -2, 9, 0.3, k? 9 Suppose -3p + 18 = 3y - 6p, 0 = -y + 3p + 4. Which is the third smallest value? (a) 5 (b) 2 (c) y c Let w = -1 + 0.7. Let p = 1119.4 + -1117.4. Let f = -2.6 - -3. Which is the smallest value? (a) f (b) p (c) w c Let o = 19/42 + 3/14. Let s = 21.4 - 26. Let a = s - -5. What is the smallest value in a, o, -0.2? -0.2 Let o = 153 + -248. Let t be (-4542)/163/9. Let u = o - t. What is the biggest value in u, -0.3, -3? -0.3 Let y = -2873 + 8615/3. Which is the second smallest value? (a) -1 (b) -525 (c) y c Let g = -11 - -10.9. Let u = -0.07 - 3.43. Let a = -0.5 + u. What is the second biggest value in a, g, 5? g Let n = 3.079 + 0.921. What is the second smallest value in n, 0.4, -0.038, -0.5? -0.038 Let j be (-2)/10 + 4/(-10). Let u = 1.8 + -5.8. Which is the second smallest value? (a) u (b) j (c) 2/3 b Let n = -4.985 + -0.015. Let r be (5 + 21)(-6)/(-4). Let i be 0 + (1 - 33/r). Which is the second biggest value? (a) 2/11 (b) i (c) n b Let k = 0.1 - -0.4. Let l = -2814 + 2813.6. Which is the smallest value? (a) k (b) 5 (c) l c Let n = -3051/4 - -763. Let i = 0.01 - 0. Which is the second smallest value? (a) i (b) -2 (c) n a Let a = 9/5 + -53/35. Suppose 0v = j + 3v + 12, -v - 4 = -3j. Let d = -1.09 - -0.09. What is the biggest value in a, j, d? a Let p = -18.9 - -20. Let f = -0.7 + p. What is the third biggest value in 0, f, 0.02? 0 Let v = -144.4 - -143.7. What is the biggest value in 8, -5, v? 8 Let f(x) = 3x*2 + 27x - 12. Let h be f(-5). What is the biggest value in h, 0.3, 0? 0.3 Let g = -48 - -74. Let z = g + -26.01. What is the second smallest value in -1/2, 1/4, -0.3, z? -0.3 Let n = 2/57 - -12/19. Which is the second biggest value? (a) n (b) 0.07 (c) -3 b Let h = -11.1 + 11. Let n = -9.4 - -8.9. Let o = -6 - -9. What is the smallest value in h, o, n? n Let z = -28 + 25. Let i be (-25)/35 - z/3. What is the biggest value in -0.3, i, -0.4? i Let d be 10/(-10) + 19/5 - 2. What is the smallest value in -1/5, -1/6, -1, d? -1 Suppose 12q = 11q + 3. What is the third smallest value in q, 1/4, -27? q Let t = 170.81 + -175. Let u = t + 0.19. What is the biggest value in 2/3, u, -3? 2/3 Suppose 0 = 3*t + t + 4. Let l = 15 - 11. Let h = -29220 + 29226. Which is the second b	{ "pile_set_name": "DM Mathematics" }
= -1181m2. Let r(a) = 18a + 6. What is r(j(s))? -21258s2 + 6 Let c(m) = -56215m. Let g(z) = -2z2. Give g(c(q)). -6320252450q*2 Let h(t) = -3t. Let i(x) = -9x - 6. Let r(z) = 15z + 44. Let o be r(-3). Let p(q) = -q - 1. Let l(a) = oi(a) + 6p(a). What is l(h(w))? -9w Let m(p) = 16390p*2. Let h(a) = -19a*2. Determine m(h(d)). 5916790d*4 Let b(s) = -13s*2. Let j(t) = -31t*2 + 5. Let h(w) = 15w*2 - 2. Let c(v) = -5h(v) - 2j(v). Give b(c(n)). -2197n*4 Let g = 59 - -47. Let v(u) = -2u*2 + 3u2 + g - 106. Let r(s) be the second derivative of -s3/2 - s. Determine r(v(c)). -3c2 Let w(i) = -17i. Let m(s) = 4s - 367 + 367. What is w(m(g))? -68g Let q(k) = -4k2. Let z be 1/(-5) + 154/70. Let i(d) = 33d - 3. Let o be i(z). Let h(p) = -63 - 3p + p + o. Determine q(h(v)). -16v2 Let u(w) be the third derivative of w4/12 - 4w2 - 3. Let p(t) = -2t - 42. Determine u(p(r)). -4r - 84 Let m(j) be the second derivative of -j4/4 + j. Let a(z) = 3z + 6. Let c(x) = 51x + 99. Let l(o) = -33a(o) + 2c(o). Determine m(l(h)). -27h*2 Let i(f) = -2f*2 - 2f*2 + 0f2. Let k(q) = q2 + 16. Let w(z) = -5z2 + 32. Let s(x) = 4k(x) - 2w(x). Calculate i(s(y)). -784y*4 Let n(c) = 59c*2. Let w(m) = -7902m. Give w(n(b)). -466218b2 Let b(a) be the second derivative of a4/6 + 31a. Let t(g) = -35g. What is b(t(o))? 2450o*2 Let n(c) = 4c + 4c - 1 - 22c. Let m(b) = 0 - 5 - 2b2 + 5. What is m(n(v))? -392v*2 - 56v - 2 Let u(a) = 613441a. Let h(t) = -t. What is u(h(i))? -613441i Let r(b) = -1 + 1 - 6b. Let f(i) = -i - 14. Let w be f(-16). Let g(q) = -22q - 2qw + 22q + q*2. Calculate g(r(z)). -36z*2 Let m(o) = 4o. Let f(b) = -204760b2. What is f(m(k))? -3276160k2 Let x(p) = p2. Let q(s) = -7s + 1. Let k be q(2). Let h = -4 - k. Let m(z) = -hz + 9z + z2. Determine x(m(v)). v4 Let t(a) = -4a. Let q(h) = 2h + 1. Let k(s) = -3s*2 + 15s + 4. Let x(v) = -k(v) + 4q(v). Determine t(x(y)). -12y*2 + 28y Let m(t) = 157091t2. Let u(o) = 4o. Calculate u(m(p)). 628364p2 Let o(b) = -60b*2 + b - 3b*2 - b. Let t(z) = 2z*2. Calculate t(o(y)). 7938y*4 Let d(o) = 158o*2. Let y(f) = -5f*2 - 4f + 8. Let u(k) = -k*2 - k + 2. Let p(h) = 4u(h) - y(h). Determine d(p(n)). 158n4 Let g(x) = x3 - 12x*2 + x - 3. Let y be g(12). Let s(o) = -5o*2 - yo*2 + 6o*2 - 8o*2. Let t(m) = 2m. Determine s(t(q)). -64q2 Let v(x) = -2x. Let p be 0 - 1 - (1 - 4). Let b(o) = -3o2 - 12o*2 + 4o*p - 12o*2. Give b(v(j)). -92j*2 Let n(r) = -8r2 + 7. Let j(o) be the second derivative of -o4/4 - 11o + 8. Calculate j(n(s)). -192s*4 + 336s*2 - 147 Let l(b) = 3b*2. Let g(u) = 81571u*2. What is g(l(o))? 734139o*4 Let r(n) = -12n. Let w(h) = 3289h + 5. What is w(r(y))? -39468y + 5 Let o(z) = -4z. Let h be (-6)/(-2) - 6(-1)/2. Let r(b) = hb + 10b + b - 5b. Calculate r(o(a)). -48a Let o(v) = -7v2. Let n(z) be the first derivative of -4z*3/3 - 12. Calculate n(o(l)). -196l*4 Let q(l) = -4268l + 40. Let j(z) = -2z. Determine j(q(v)). 8536v - 80 Let l(n) = -n*2. Let b(q) be the first derivative of -12q*2 + 38. Give b(l(c)). 24c*2 Let i(q) = 2q. Let h(x) = 41x - 5 + 7 + x - 5x. What is h(i(o))? 74o + 2 Let c(l) = -l - l2 + l. Let z(i) = -22i - 3. Let r(n) = -15n - 2. Let d(v) = 3r(v) - 2z(v). Give c(d(m)). -m2 Suppose -2l = -11 - 11. Let c = l + -4. Let g(x) = -7x + 7 - c + 2x. Let a(k) = 2k2. What is g(a(w))? -10w*2 Let z(j) be the third derivative of 19j*5/30 + 2j*2. Let o(u) = 12u - 7u - 3u - u + 0u. Determine z(o(w)). 38w*2 Let k(s) = -27s*2 + 15s - 73. Let n(x) = 14x2 - 9x + 37. Let t(q) = -3k(q) - 5n(q). Let u(h) = h. Determine t(u(p)). 11p2 + 34 Let h(r) = 5r. Let y be 17/(-102) - ((-1)/6)/1. Let m(b) = yb2 - b2 - b2 - b2. Give h(m(u)). -15u*2 Let g(f) = 294f + 70. Let c(i) = 17i + 4. Let v(l) = 35c(l) - 2g(l). Let u(z) = -z2 - 35z. Determine v(u(p)). -7p2 - 245p Let v(f) be the first derivative of -3f2/2 - 8. Let t = 12 - 10. Let n(m) = 0 + 0m*2 + 0 - tm*2. Give v(n(p)). 6p*2 Let z(i) = i - 1. Let c(t) = -168t + 154. Let w(y) = -2c(y) - 308z(y). Let u(n) be the second derivative of n*4/12 - 4n - 55. Calculate u(w(h)). 784h2 Let w(s) = 2s. Let x(v) be the second derivative of 0v3 + 0 + 0v*2 - 19/6v*4 - 10v. Determine w(x(b)). -76b2 Let g be (11 - 10)(-8)/(-2). Let w(k) = 71 + gk - 71. Let p(f) be the third derivative of -f5/30 + 2f*2. What is p(w(c))? -32c*2 Let f(p) = -3 - 4p + 3. Let n(y) = -y - 3. Let s(h) = 3h - 1. Let q(a) = 4a - 1. Let m(t) = -4q(t) + 5s(t). Let o(x) = 3m(x) - n(x). Determine f(o(i)). 8i Let w(z) = 56z. Let t(q) = q2 + 5q + 3. Let u be t(-8). Let x(i) = -ui2 + 47i*2 - 18i*2. Give w(x(g)). 112g*2 Let i(h) = 29 + 29 - 55 - 74h + 76h. Let r(n) = 21n*2. Determine i(r(o)). 42o*2 + 3 Let h(k) be the first derivative of 5k*3/3 - 1. Let v = -51 - -81. Let l(a) = 2a*2 - 30 + v. Calculate l(h(f)). 50f*4 Let m(v) = -33v*2 - 6v. Let f(o) = 1002o2. Calculate m(f(s)). -33132132s*4 - 6012s*2 Let n(y) = 963y - 12. Let u(w) = 2069485w - 25785. Let b(c) = 8595n(c) - 4u(c). Let g(x) = -2x*2. Calculate g(b(o)). -1824050o*2 Let f(y) be the first derivative of 2y*3/3 - 1. Suppose -8 = -4b + 20. Let v(g) = -4 + b - 3g - 3. What is v(f(u))? -6u*2 Let z(f) = 10f*2. Let y(o) = 2o*2 - 27522. Determine y(z(d)). 200d*4 - 27522 Let a(j) = 81j. Let c(i) = i. Let f(q) = -a(q) + 9c(q). Let l(r) = -2r*2. Determine f(l(d)). 144d*2 Let a(z) = 7z*2. Let g(p) = 2p. Let t(x) = -x*2 + 2x - 2. Let k be t(3). Let b(c) = 13c. Let o(w) = kg(w) + b(w). What is a(o(i))? 63i2 Let h(o) = 74o + 87. Let k(f) = -3f. What is k(h(g))? -222g - 261 Let k(h) be the first derivative of -2h3/3 - 40. Let g(d) = 2d + 15. What is g(k(z))? -4z2 + 15 Let q(o) = -7o. Let w(x) = -16x + 5. Let i(v) = 54v - 16. Let b(d) = 3i(d) + 10w(d). Give b(q(z)). -14z + 2 Let k(c) = 2c. Let s be (-66)/42/(-3). Let a(l) = -sl + 12l + l. Give k(a(y)). 4y Let a(m) = 3018m. Let u(h) = 12h*2. Calculate a(u(s)). 36216s*2 Let y(x) = -9x*2 + 33x*2 + 6x*2. Let b(k) = 3 - 3 - 18101k + 18102k. Determine b(y(v)). 30v*2 Let i(h) = 4h*2. Let q(t) be the first derivative of 0t*3 + 1/12t*5 + 9 + 0t - 5t2 + 0t*4. Let w(p) be the second derivative of q(p). Give w(i(s)). 80s*4 Let n(j) be the first derivative of 3j*2 + 14. Let v(l) = 3435l + 8l2 - 3435l. Calculate v(n(q)). 288q2 Let a(y) = -y - 596. Let q(g) = -25g. Determine q(a(b)). 25b + 14900 Let d(n) = -3n2. Let o(h) = h2 - 772. Determine d(o(f)). -3f4 + 4632f*2 - 1787952 Let f(o) = 4o - 4 - 6o + 5o*2 + 2o. Let h(q) = -q*2 + 1. Let p(x) = f(x) + 4h(x). Let m(k) = 14k. Calculate m(p(d)). 14d*2 Let a(j) = 2j. Let b(r) = -r3 + r2 + r - 3. Let i be b(-2). Let o = 9 - i. Let d(w) = -2w2 + 3w*2 - 4wo + w2. Determine d(a(x)). -8x2 Let g(d) = -2d + 9. Let w(i) = -i + 4. Let m(b) = -4g(b) + 9w(b). Let s(r) be the first derivative of r*2/2 + r + 334. Calculate s(m(x)). -x + 1 Let j(l) = -1 + 1 + 3l. Let y(s) be the first derivative of -20 - 6s2 - 31 + 47. Give y(j(w)). -36w Let s(y) = 2y2. Let v(b) = 57504b. Determine v(s(q)). 115008q2 Let k(g) = 141g*2 + g. Let c(h) = -178h. Calculate k(c(d)). 4467444d2 - 178d Let v(p) = 3p2. Let q(s) be the second derivative of -12s + 1/3s4 + 0s*3 + 0s*2 + 0. Determine q(v(k)). 36k4 Let x(b) = -b2. Let z(g) be the first derivative of -3g2/2 - 3g + 228. Calculate x(z(t)). -9t2 - 18t - 9 Let m(c) = -2c2. Let l(b) = -b2 + 21b - 36. Let v be l(19). Let i(a) = -7a + 7a - 29av + 0a. Give i(m(x)). -116x4 Let x(b) = 2b*2. Let t(z) = 8z*3 + 4z*2 - 3z - 2. Let n be t(3). Suppose -2a + n + 527 = 0. Let d(s) = 384 - a - 8s. Calculate d(x(v)). -16v2 Let d(k) be the first derivative of 2/3k*3 + 0k - 3 + 0k2. Let a(l) = 6l*2 - 2. Calculate a(d(w)). 24w*4 - 2 Let v(x) = -13x. Suppose 4b - 2 - 56 = -2z, -5z - 37 = -3b. Let g(m) = 15m - 31m + bm. What is g(v(w))? 26w	{ "pile_set_name": "DM Mathematics" }
what is 1001100100000 + 1? 1001100100001 In base 11, what is 2a + 1170? 119a In base 12, what is 2 + -b77? -b75 In base 12, what is -65b8 - -3? -65b5 In base 15, what is 27 + -191? -169 In base 3, what is -12 - 212211201? -212211220 In base 14, what is 2 - 5b18? -5b16 In base 12, what is 3 - 18672? -1866b In base 16, what is 6 + 7f? 85 In base 14, what is 0 - -86dc? 86dc In base 13, what is 1334 + 39? 1370 In base 3, what is -211222200202 + 1? -211222200201 In base 8, what is 1401 + -33? 1346 In base 8, what is 270 - 13660? -13370 In base 5, what is -10331441342 + -4? -10331441401 In base 2, what is 101 - 100110010011110? -100110010011001 In base 8, what is 2331 - 1376? 733 In base 7, what is 513 - 2503? -1660 In base 8, what is 112316 + -22? 112274 In base 14, what is -a04 - 260? -c64 In base 16, what is 6 - -b9? bf In base 13, what is 17454 + 3? 17457 In base 15, what is 804e + -6? 8048 In base 2, what is -100010011 + -11010100100? -11110110111 In base 13, what is -1 - 6cb5? -6cb6 In base 9, what is 3406217 + -5? 3406212 In base 14, what is -1282b + 21? -1280a In base 14, what is -24 + 270? 24a In base 11, what is -1 - -4125? 4124 In base 9, what is 182402 - 5? 182386 In base 16, what is -35 - 3a4? -3d9 In base 9, what is -1207436 + 5? -1207431 In base 2, what is -111111010101 - 11101011101? -1011100110010 In base 11, what is 597 + 31? 618 In base 11, what is 37 + -183? -147 In base 15, what is -2097e0 - 2? -2097e2 In base 5, what is -1401 + 114? -1232 In base 2, what is 101001011001 + 11001? 101001110010 In base 3, what is 211 - -11101201220? 11101202201 In base 15, what is 1425 - 18? 140c In base 9, what is 37481 + -72? 37408 In base 12, what is 129bb + -a? 129b1 In base 4, what is -31113332 + 10? -31113322 In base 15, what is -120bd - 4? -120c2 In base 5, what is 41 + -10234030? -10233434 In base 12, what is -1b1 + 3322? 3131 In base 12, what is -1b39 + -15b? -2098 In base 8, what is -265767 + -4? -265773 In base 8, what is 43543 + -14? 43527 In base 7, what is -6242 + -146? -6421 In base 3, what is -121200110 + 12? -121200021 In base 14, what is -d17 - 12? -d29 In base 2, what is 1010110100101100110 - -100? 1010110100101101010 In base 2, what is -10111101010 + 1001011101? -1110001101 In base 6, what is 15 - 121125? -121110 In base 8, what is 12656 - 7? 12647 In base 3, what is 2222 - 1111020210? -1111010211 In base 5, what is 42320413 - 0? 42320413 In base 10, what is 4050 + 21? 4071 In base 11, what is 1694 + 102? 1796 In base 2, what is -1010 + -10001100? -10010110 In base 6, what is 21203040 - 4? 21203032 In base 9, what is 420143 + 2? 420145 In base 7, what is -24 + -255466? -255523 In base 5, what is 22412441 + -1? 22412440 In base 12, what is -58 - -3494? 3438 In base 9, what is -1 - 52230? -52231 In base 2, what is 1100000011100001000 + -10? 1100000011100000110 In base 11, what is 51 - -941? 992 In base 10, what is -3 + -73679? -73682 In base 10, what is -130964 - 4? -130968 In base 15, what is -2 + -87c66? -87c68 In base 7, what is 326254 + -5? 326246 In base 13, what is 318 - 143? 1a5 In base 6, what is -1443 - -3233? 1350 In base 10, what is -35442 - 12? -35454 In base 3, what is -1 + -121000001? -121000002 In base 12, what is 10 - -a7450? a7460 In base 7, what is 44243561 - 5? 44243553 In base 16, what is d - -18a7? 18b4 In base 6, what is -11 - -4045403? 4045352 In base 3, what is 1211 + 1110001? 1111212 In base 8, what is 3 + 7441? 7444 In base 7, what is -64 - 614456? -614553 In base 5, what is 43 + 320410? 321003 In base 6, what is 15 + 23521? 23540 In base 8, what is 73 + -122? -27 In base 6, what is -34 - 111021? -111055 In base 4, what is -1033 - -232212? 231113 In base 14, what is 2 - 10c2b8? -10c2b6 In base 8, what is 407443 + 40? 407503 In base 8, what is 24 + -14506? -14462 In base 13, what is 9 - -2994? 29a0 In base 2, what is 11010011000111010 - -10000? 11010011001001010 In base 7, what is -1 - 123236? -123240 In base 6, what is -13 - -254012? 253555 In base 14, what is 882 + 10? 892 In base 12, what is 6ab0 - 65? 6a47 In base 7, what is -5 + 15600? 15562 In base 7, what is 6206 - -503? 10012 In base 10, what is 100 - 23? 77 In base 7, what is -1311 + -5012? -6323 In base 10, what is -138320 - 0? -138320 In base 14, what is 5 + 1c94? 1c99 In base 15, what is 3 - -bcc6? bcc9 In base 11, what is 6904 - -12? 6916 In base 10, what is 6725 + -4? 6721 In base 5, what is 12 + -13023? -13011 In base 3, what is 2111122 + -20111? 2021011 In base 14, what is -707200 - -2? -7071dc In base 6, what is -11 + -2024220? -2024231 In base 14, what is 162 + 74? 1d6 In base 10, what is 19 - -25376? 25395 In base 9, what is 3148510 + -2? 3148507 In base 10, what is 2320053 + -5? 2320048 In base 8, what is 340 - 271? 47 In base 5, what is -14 + -43312? -43331 In base 16, what is -b1 + 116? 65 In base 14, what is 0 + 7d314? 7d314 In base 3, what is 10001110120 - 1? 10001110112 In base 4, what is -1311 + -1203013? -1210330 In base 11, what is -11a + 673? 554 In base 6, what is 5320424 - 3? 5320421 In base 6, what is 1 + -34424? -34423 In base 4, what is -11 + 1333033? 1333022 In base 9, what is 444 - 1068? -524 In base 15, what is -2 - 12908? -1290a In base 5, what is 243 + -242240? -241442 In base 8, what is -21570 - 1? -21571 In base 16, what is -1 + -a3be? -a3bf In base 13, what is 3ba74c + -2? 3ba74a In base 4, what is -33001321 + -12? -33001333 In base 7, what is 61 - 2026? -1635 In base 13, what is 271 - -254? 4c5 In base 9, what is 13032 + 225? 13257 In base 14, what is 1b4 + -14? 1a0 In base 7, what is -3 + -36355? -36361 In base 16, what is 28a + 42? 2cc In base 2, what is 1111100011101111 + 100? 1111100011110011 In base 6, what is -131 + 454130? 453555 In base 8, what is -11450 - 1? -11451 In base 16, what is -1cc8f - 4? -1cc93 In base 7, what is 243 + -1103? -530 In base 3, what is 1012200221 + 0? 1012200221 In base 2, what is -100001101100100100 + -1000? -100001101100101100 In base 13, what is 25082 + -4? 2507b In base 6, what is -3445 - 3245? -11134 In base 16, what is 307c9 - 4? 307c5 In base 9, what is 170 - 337? -157 In base 10, what is 21 - -635? 656 In base 16, what is -6c5 + -13d? -802 In base 9, what is 100751 + 1? 100752 In base 6, what is 3 + 21003531? 21003534 In base 2, what is 110000111011011 + 101? 110000111100000 In base 5, what is -111221 - -2243? -103423 In base 12, what is -1b8 + 5b8? 400 In base 10, what is 66981 + 19? 67000 In base 6, what is 5 - 10404424? -10404415 In base 2, what is -1001000010110 - 1000000? -1001001010110 In base 4, what is -3031110 + 2? -3031102 In base 16, what is 22 - b7? -95 In base 3, what is -12 - -12000? 11211 In base 5, what is -21210 - -1230? -14430 In base 3, what is -11 - 111110221211? -111110221222 In base 16, what is 797 + -76? 721 In base 16, what is -2 - 8018? -801a In base 6, what is 433222 - 1? 433221 In base 6, what is 0 + 15533513? 15533513 In base 13, what is -9192 - 5? -9197 In base 15, what is 13e19 - 5? 13e14 In base 10, what is 334 - -558? 892 In base 10, what is 12 - 1705? -1693 In base 13, what is 43586 + 1? 43587 In base 9, what is -8601 - 273? -8874 In base 3, what is 0 - 12122022? -12122022 In base 6, what is 22234 + 3? 22241 In base 14, what is 133d + -25? 1318 In base 8, what is -52 + -71? -143 In base 9, what is 20547 + -114? 20433 In base 2, what is -1101010001 - 1010101? -1110100110 In base 13, what is -3a20 + -3? -3a23 In base 10, what is 23225 + 6? 23231 In base 15, what is 594 + 1b? 5b0 In base 12, what is 41 + 328? 369 In base 16, what is a7 - 38d? -2e6 In base 4, what is 10220 + 212022? 222302 In base 11, what is -13a + 4205? 4076 In base 2, what is 110110 + 11010110010? 11011101000 In base 13, what is -a5 - 149? -221 In base 5, what is -10 - -10433222? 10433212 In base 16, what is -2 + -d18e6? -d18e8 In base 10, what is -972198 + -5? -972203 In base 10, what is -478 - -67? -411 In base 15, what is 17969 - 5? 17964 In base 8, what is -407165 - -46? -407117 In base 16, what is bd4a0 - -8? bd4a8 In base 16, what is 337dd + -3? 337da In base 3, what is -10100220120 + -22? -10100220212 In base 3, what is 1221 + -112201011? -112122020 In base 14, what is 1b0 - -22ba? 248a In base 16, what is 4dba + d? 4dc7 In base 15, what is -10d13 - -39? -10cc9 In	{ "pile_set_name": "DM Mathematics" }
is -1a + 556? 539 In base 13, what is 25 - 33? -b In base 15, what is 21 - -2d? 4e In base 6, what is 401 - 1? 400 In base 12, what is -905 - 0? -905 In base 2, what is 10000 - 11000? -1000 In base 3, what is -11 + 10110000? 10102212 In base 13, what is 2 - 189? -187 In base 10, what is -596 - -5? -591 In base 12, what is 167 + -2b? 138 In base 7, what is -5 + -31122? -31130 In base 4, what is 21133 + -222? 20311 In base 9, what is -14 + 2261? 2246 In base 12, what is 5 - -28a? 293 In base 7, what is -115 + 4? -111 In base 9, what is -127 + 8? -118 In base 3, what is -102022 - -1? -102021 In base 7, what is -254 - -1? -253 In base 10, what is 8147 + 2? 8149 In base 5, what is 1 - -10? 11 In base 9, what is -4 + 2633? 2628 In base 3, what is 2221 + -1002? 1212 In base 13, what is -11 + 27? 16 In base 10, what is 0 - 1648? -1648 In base 8, what is -373 - 60? -453 In base 15, what is 5e - 0? 5e In base 8, what is 121 + 3? 124 In base 16, what is 5 + 3e? 43 In base 4, what is 10 - 2011? -2001 In base 4, what is 11003 - -1? 11010 In base 14, what is -1d9 + 2? -1d7 In base 6, what is 3 - 111? -104 In base 14, what is -c - -13d? 131 In base 9, what is 7153 + 0? 7153 In base 13, what is -76 + 293? 21a In base 14, what is 1 + 143? 144 In base 6, what is 0 + -430? -430 In base 15, what is -14a + -3? -14d In base 9, what is 28616 - 4? 28612 In base 3, what is -100 + 112? 12 In base 6, what is 25343 + -3? 25340 In base 6, what is 133 - 30? 103 In base 13, what is 112 - 1a? c5 In base 11, what is -2 + 47? 45 In base 14, what is 1 - c? -b In base 15, what is -1d - 215? -233 In base 13, what is 8a3 - -3? 8a6 In base 9, what is -82 + 420? 327 In base 13, what is -78 + 6? -72 In base 16, what is 0 - 50? -50 In base 10, what is 2 + -7? -5 In base 3, what is -1 - -12210? 12202 In base 15, what is 55 + 4? 59 In base 4, what is -11 + -121? -132 In base 16, what is -102 + 4? -fe In base 12, what is 8 + 136? 142 In base 2, what is 100 + -110111010? -110110110 In base 2, what is -10100011111 + 11000? -10100000111 In base 11, what is a6 - -31? 127 In base 16, what is 21 + 91? b2 In base 5, what is 4 + 334? 343 In base 7, what is 15 - -46? 64 In base 3, what is -10 - -11121111? 11121101 In base 15, what is -3 - d? -11 In base 13, what is 6 + 4? a In base 10, what is -42 + -187? -229 In base 10, what is -220 - 11? -231 In base 9, what is 5 + -445? -440 In base 4, what is 0 + 210? 210 In base 3, what is -212 + -20? -1002 In base 3, what is -200002 + -12? -200021 In base 2, what is 10011 + -10? 10001 In base 5, what is -113244 + -11? -113310 In base 4, what is -13 - -12112? 12033 In base 8, what is 340 + 11? 351 In base 12, what is -8 - 6? -12 In base 11, what is -2 - 170? -172 In base 2, what is 100 - -101001101? 101010001 In base 4, what is 2012021 + 11? 2012032 In base 4, what is 110100 + -2? 110032 In base 6, what is 4 + -22354? -22350 In base 5, what is -21032 + -34? -21121 In base 14, what is -5 + -39? -40 In base 4, what is -3 + -302? -311 In base 8, what is -215 + 7? -206 In base 12, what is -431 - -1a? -413 In base 13, what is 3 + 179? 17c In base 12, what is -5 + -663? -668 In base 10, what is -2246 - 5? -2251 In base 8, what is 37 + 4? 43 In base 6, what is -5 + 22010? 22001 In base 7, what is 16 - -363? 412 In base 15, what is 1 + -d4? -d3 In base 2, what is -100100101110 + -101? -100100110011 In base 16, what is 5 - -19? 1e In base 3, what is 12000 + 1000? 20000 In base 10, what is 0 + -658? -658 In base 13, what is 1 - 2b0? -2ac In base 9, what is -3 - 133? -136 In base 9, what is 1 + 185? 186 In base 10, what is 2 + -77? -75 In base 5, what is 224 - 124? 100 In base 13, what is 94a + -3? 947 In base 2, what is -100 - -1111011110? 1111011010 In base 15, what is -25ec + 2? -25ea In base 9, what is -125 - -1? -124 In base 7, what is -6 + 2452? 2443 In base 6, what is -2 + -134? -140 In base 3, what is -1120 - 22? -1212 In base 2, what is -1000001010 - -1101? -111111101 In base 7, what is -5 + 305? 300 In base 9, what is -2 - -827? 825 In base 10, what is -2 - -4531? 4529 In base 4, what is 212012 - 2? 212010 In base 8, what is -4 - -10? 4 In base 6, what is -4 - 1414? -1422 In base 11, what is -139 + 2? -137 In base 15, what is -3 + 1ca? 1c7 In base 14, what is d + 2? 11 In base 16, what is 5 + -10? -b In base 3, what is 12 + -2201? -2112 In base 5, what is 4 + -103? -44 In base 4, what is 11 - -13? 30 In base 6, what is -1 - -12500? 12455 In base 2, what is -111000010 + -11? -111000101 In base 2, what is 10110110101111 - -10? 10110110110001 In base 2, what is 11100 + -1111110? -1100010 In base 8, what is -4 + -6052? -6056 In base 13, what is 10 + -3? a In base 9, what is -5 - -215? 210 In base 9, what is -22 + 40? 17 In base 16, what is 104 + -2a? da In base 3, what is -11111100 - -10? -11111020 In base 2, what is -1100 + 1110? 10 In base 13, what is 4 - 29? -25 In base 16, what is c + b3? bf In base 12, what is 5ba + -3? 5b7 In base 13, what is -16a - 3? -170 In base 2, what is -1100011011 + 1? -1100011010 In base 8, what is -4411 + 2? -4407 In base 5, what is -4 + -2301? -2310 In base 12, what is -17 - 396? -3b1 In base 4, what is 121 + -210? -23 In base 5, what is 213 - 13? 200 In base 4, what is -10021 - -110? -3311 In base 9, what is -64 - 2? -66 In base 13, what is 4 + -55? -51 In base 5, what is 2424 - -10? 2434 In base 16, what is -3f - -1? -3e In base 9, what is -10 + -6? -16 In base 10, what is -14 - -65? 51 In base 5, what is 13 - 4420? -4402 In base 7, what is 332 - 3? 326 In base 12, what is b0 + 3? b3 In base 16, what is -e + -4? -12 In base 8, what is 2 + -42? -40 In base 6, what is -3 + 1321? 1314 In base 7, what is 6 + -414? -405 In base 8, what is 155 + 2? 157 In base 8, what is -1 - -36? 35 In base 16, what is -cf - -2? -cd In base 5, what is 143 + 3? 201 In base 8, what is 1644 - 4? 1640 In base 15, what is -4 + -8? -c In base 16, what is e6 - -5e? 144 In base 13, what is 31a6 - 3? 31a3 In base 11, what is -405 - 5? -40a In base 12, what is 3253 - 0? 3253 In base 5, what is 1304 + 4? 1313 In base 5, what is 11 - -43323? 43334 In base 5, what is -130 - 3? -133 In base 8, what is 3 + 1107? 1112 In base 8, what is 11 + -6? 3 In base 8, what is 2 - -35? 37 In base 3, what is -1220 - 2? -1222 In base 16, what is 24 + 4? 28 In base 12, what is -1132 + 1? -1131 In base 15, what is 5172 - 1? 5171 In base 2, what is -101 + 110? 1 In base 3, what is -122 + -100112? -101011 In base 3, what is 0 - -202? 202 In base 6, what is -105 - -523? 414 In base 12, what is -b3 + 0? -b3 In base 14, what is -5 + -1a91? -1a96 In base 6, what is -4 - -35? 31 In base 8, what is -4 - -1527? 1523 In base 5, what is 44 - -122? 221 In base 9, what is -4688 + -6? -4705 In base 15, what is -8 - 25? -2d In base 4, what is -10312 + -2? -10320 In base 6, what is -45445 + 2? -45443 In base 4, what is 131 - 11? 120 In base 15, what is 5 - -31? 36 In base 10, what is -163 - 7? -170 In base 14, what is 14 - -3? 17 In base 14, what is -25 - 2? -27 In base 15, what is 19 - 37? -1d In base 4, what is 0 - -20332? 20332 In base 7, what is 5 + 50? 55 In base 11, what is 77 - 1a? 58 In base 2, what is 110101111111100 + -100? 110101111111000 In base 10, what is 43 + 9? 52 In base 8, what is 605 + -6? 577 In base 10, what is -13 - 0? -13 In base 3, what is 10221 - -22111? 110102 In base 2, what is -10 - -1010001? 1001111 In base 8, what is -14070 - -2? -14066 In base 3, what is -22 - 111200? -111222 In base 12, what is 3a6 - -2? 3a8 In base 6, what is -3250 + -2? -3252 In base 16, what is 2 - 15? -13 In base 8, what is 1425 - 4? 1421 In base 16, what is -a12 + 7? -a0b In base 3, what is -2 + -20122? -20201 In base 15, what is 228 + -3? 225 In base 12, what is 12 - 3? b In base 16, what is 5 - -1d7? 1dc In base 8, what is 17 + 2? 21 In base 11, what is 3605 - -3? 3608 In base 7, what is -2 + -255? -260 In base 6, what is 2 + 135? 141 In base 11, what is 1 - -158? 159 In base 3, what is -10011202 + 10? -10011122 In base 2, what is 10000010001001 - -11? 10000010001100 In base 16, what is 5 + -216? -211 In base 6, what is -50 + -143? -233 In base 6, what is 4 - 220? -212 In base 7, what is -4 + -11436? -11443 In base 3, what is 101220110 + 11? 101220121 In base 5, what is -10 - 4032? -40	{ "pile_set_name": "DM Mathematics" }
2h2 - h - 1. Calculate b(k) + 4l(k). -18k3 + k2 + 3 Let n(v) = v2 + 45v + 299. Let g be n(-37). Let r(k) = -2k2 - 2k - 9. Let x(m) = -6m2 - 5m - 27. What is gx(a) - 8r(a)? -2a2 + a - 9 Let f(w) = 23w*3 + 3w*2 + 3w - 1. Let n(m) = -23m3 - 4m*2 - 4m + 1. What is -4f(t) - 3n(t)? -23t3 + 1 Let d(y) = y3 - y + 2. Let h(t) = 65t*3 + 2t + 7. What is 3d(k) - h(k)? -62k*3 - 5k - 1 Let l(i) = 877i + 4. Let t(b) = -250825b - 1143. Determine 1143l(m) + 4t(m). -889m Let f(r) = 939r + 16. Let d(o) = 1880o + 28. Calculate -4d(u) + 7f(u). -947u Let y(b) = -71b + 2b*2 + 119b - 48b + 4. Let p(h) = 2h*2 + 4. Calculate -4p(n) + 3y(n). -2n*2 - 4 Let m(s) = 4s + 2. Let x(l) = -7l - 3. Let w(k) = 5m(k) + 3x(k). Let o(b) = 17b*2 + 28b*2 - 65b*2 + 3b - 3 + 23b2. Calculate o(h) + 3w(h). 3h2 Let f(k) = -19k*2 + 3k + 7. Let s(z) = 15z2 - 3z - 6. Let x(d) = 4f(d) + 5s(d). Let i(n) = -n*2 - 4n - 2. Determine -4i(a) + 5x(a). -a*2 + a - 2 Let b(v) = -4v*2 - 8v + 7. Let z(x) = -19x2 - 33x + 29. Let r(s) = 9b(s) - 2z(s). Let h(j) = -3j2 + 9j - 8. Calculate -5h(m) - 8r(m). -m*2 + 3m Let x(n) = -3n2 - 6n + 6. Let v = -26 + 30. Suppose 5q + v = q. Let k be (q - 1)(-1 - 3). Let c(b) = 2b2 + 4b - 4. Calculate kc(y) + 5x(y). y*2 + 2y - 2 Let k(c) = -c. Let g be k(3). Suppose 0 = 3b - 2h - 15, 3b = 3h + 10 + 2. Let l(a) = -a*2 + 1. Let y(m) = -3m*2 + 2. Calculate bl(n) + gy(n). 2n*2 + 1 Suppose -k - 1 + 3 = -2j, -5j - 2k = -4. Suppose -2g - 5 = w, -w + j + 15 = -2g. Let r(o) = 3o - 6. Let p(b) = 1. What is gp(t) - r(t)? -3t + 1 Let c(t) = -1. Let g be ((-6)/4)/(6/36). Let k be ((-2)/4)/(g/432). Suppose -6w + 7w = a - 4, -4a - 4w = k. Let q(r) = 2r - 8. Calculate aq(l) + 8c(l). -2l Let t(o) = -272o + 2. Let k(r) = 136r - 1. Determine 9k(u) + 4t(u). 136u - 1 Let p(u) be the second derivative of -u3/3 + u2 - 1547u. Let g(t) = -t2 - 7t - 6. Let m be g(-4). Let f(b) = b - 1. Determine mp(o) + 11f(o). -o + 1 Let g(c) = 3c2 - 4. Let q(j) = -j2 + 4j + 4. Let l be q(4). Suppose 4o - l = 3o. Let b(k) = -4k2 + 5. What is ob(n) + 5g(n)? -n2 Let h(y) = 53y*3 + 9y*2 - 9y - 11. Let i(c) = -13c3 - 2c*2 + 2c + 3. What is 2h(z) + 9i(z)? -11z3 + 5 Let x(m) = 1. Let t(l) = -2l + 46. Determine -t(h) + 10x(h). 2h - 36 Let f(g) = 3g2 + 15g - 22. Let i(k) = -2k2 - 7k + 10. Let h(q) = 3f(q) + 7i(q). Let o(c) = c - 1. What is -h(b) - 4o(b)? 5b*2 Let i be 47/(-16) + (-48)/768. Let m(u) = 4u*3 + 3u*2 + 4u + 3. Let d(p) = -p3 - p2 - p - 1. Determine id(h) - m(h). -h3 - h Let d be 0(-2 + 3/2) + -2. Let l(v) = -3v2 - 2v + 4. Let q(x) = 2x - 1. Let y be q(2). Let s(z) = -4z*2 - 2z + 5. Determine ds(h) + yl(h). -h*2 - 2h + 2 Let g(i) = 2i3 - 2i*2 - 1. Suppose 0 = -5a - 4o + 534 - 138, a = -3o + 88. Let q(j) = -16j2 + 5j*2 - 80 + 10j*3 + a. What is -11g(t) + 2q(t)? -2t*3 + 3 Let c = 12 + -7. Let s(u) = 7u*3 + 9u*2 - 3u - 5. Let k(i) = -35i - 36i + 4i3 + 5i*2 + 69i - 3. Give ck(f) - 3s(f). -f*3 - 2f*2 - f Let i(d) = 14d*2 - 3d - 5. Let c(z) be the second derivative of -5z4/12 + z3/6 + z2 - z - 64. What is -11c(v) - 4i(v)? -v2 + v - 2 Let b(n) = n2 + 3n - 5. Let t(g) = g*2 + 14g + 12. Let a be t(-14). Suppose -a = -10q + 7q. Let m(i) = i*2 + 4i - 6. Determine qb(r) - 3m(r). r2 - 2 Let c(a) = -a3 + a*2 + 2a + 1. Let u(f) = f*3 - 4f*2 - 8f - 3. What is 3c(p) + u(p)? -2p3 - p2 - 2p Let f(j) = 264j*2 - 6j - 2. Let l(v) = -527v2 + 14v + 6. Calculate -5f(b) - 2l(b). -266b2 + 2b - 2 Suppose 23x - 115 = -46. Let m(n) = n. Let t(p) = -5p*2 + 3p + 2. Calculate xm(r) - t(r). 5r*2 - 2 Let d(t) = 9t + 4. Let o(l) be the second derivative of -5l3/3 - 5l*2/2 + l. Let g be 12/(-308)-11 + (-76)/14. Determine gd(k) - 4o(k). -5k Let p(j) = j + 1. Let o(y) = -6y + 2. Let k be (2 - 6)/(-6(-4)/(-6)). Give ko(c) - 2p(c). -8c Let z(n) = 39n2 - 14n + 2. Let k(f) = -19f2 + 6f - 1. Calculate 7k(p) + 3z(p). -16p2 - 1 Let y(d) = -17d + 1139. Let r(h) = -24h + 1708. What is 5r(n) - 7y(n)? -n + 567 Let y(x) = 16 - 14 - 3x*2 + 0x*2. Let b(t) = 4t*2 + t - 2. Suppose -2a = k - 1, 3a - 2 = -4k - 13. Give ay(n) + 2b(n). -n*2 + 2n + 2 Let i(z) = -6z3 - 6. Let x be -4 + 4 - (-3 - 3). Let q(k) = -1. Determine xq(o) - i(o). 6o3 Let s(k) = -2k - 2. Let c(m) = 3m + 3. Let p(w) = -3c(w) - 4s(w). Let t(g) = 21g + 14. Give -14p(x) - t(x). -7x Let v(g) = -3g2 - 5g - 5. Let s = -1498 + 1492. Let u(a) = -4a2 - 6a - 6. What is sv(r) + 5u(r)? -2r2 Let w(x) be the first derivative of 2x*3 + 11x + 175. Suppose 5a + 9 = -21. Let p(t) = -3t*2 - 6. Let u = -26 - -15. Give aw(z) + up(z). -3z*2 Let p = -32 + 16. Suppose -52 = 5h - 22. Let x be 21/hp/(-28). Let k(z) = -z - 2. Let w(m) = 2m + 3. Calculate xw(i) - 3k(i). -i Let g(m) = -7m. Let j(w) = 8w. Suppose 10x + 28 = -12. Let r be -1(-1 + x)/(-1). Determine rg(d) - 4j(d). 3d Let r(z) = -53z. Let f(c) = -1378c. What is 4f(x) - 106r(x)? 106x Let d = -751 + 748. Let l(o) = o*3 - 1. Let j(a) = -5a*3 + 1. Determine dl(t) - j(t). 2t3 + 2 Let h(v) = -v2 - 3. Let n(g) = -2g*2 - 7. Suppose 56 = 7o + o. Let m(l) = 2l2 - 16l + 7. Let s be m(o). Determine sh(q) + 3n(q). q*2 Let c(m) = -3m*3 - 13m*2 - 4m + 7. Let t(k) = k*3 + 4k*2 + k - 2. Let f be (-413)/(-56) - 21/56. Determine ft(n) + 2c(n). n3 + 2n2 - n Let c(x) = -x3 - 4x2 + 5x - 6. Let l be c(-5). Let h(j) = -6j - 7j*2 + 11 - 14 + 10 - 1. Let w(i) = 13i*2 + 11i - 11. Determine lw(t) - 11h(t). -t*2 Let w(s) = -5s*2 - 4. Suppose -4 = 2l, -5i - 2 = -2i - 5l. Let m(c) = -14c*2 - 11. Determine im(o) + 11w(o). o2 Let i = 7 - -1. Let h(d) = -d - i + 7 + 2 + 0. Let z(v) = -4v + 3. Calculate -6h(m) + z(m). 2m - 3 Suppose -2r - 5 = -5q, 4q - 2 = 2q - 4r. Let y(f) = -f. Let w = -8 - -13. Let z(j) = -4 - 5j - wj + 2. Determine qz(v) - 12y(v). 2v - 2 Let t(a) = 3a3 - 9a*2 - 5a. Let m be (-55)/(-33)(0/1 - -3). Let x(y) = 2y*3 - 5y*2 - 3y. Calculate mx(i) - 3t(i). i*3 + 2i2 Let w(y) = y3 - 5. Let r be (3 + (-1 - -1))1. Suppose 5q + 25 - 70 = 0. Let o(l) = -23 + q + 13. What is rw(z) - 15o(z)? 3z3 Let i(c) = -10c - 22. Let k(l) = -10l - 19. Calculate 3i(q) - 4k(q). 10q + 10 Let n(v) = -1629v - 14. Let g(x) = 813x + 8. What is 5g(d) + 3n(d)? -822d - 2 Let t(l) = 1. Let n(w) = -3w*2 + 6w + 6. Let a be (-333)/(-117) - (-4)/26 - 4. Let u be n(a). Let b(i) = -i*2 - 2i + 4. Give ut(d) + b(d). -d2 - 2d + 1 Let f(y) = 3y2 + 4y - 1273. Let a(i) = 4i2 + 5i - 1283. Calculate 4a(m) - 5f(m). m2 + 1233 Let k(r) = -r2 + 231r. Let p(f) = -3f. Give k(q) - 6p(q). -q2 + 249q Let r(l) = 364l2 - 22l - 6. Let i(o) = -73o2 + 4o + 1. Determine -11i(q) - 2r(q). 75q2 + 1 Let i(t) = -23t - 2. Let l(j) = 24j + 2. Determine 5i(x) + 4l(x). -19x - 2 Let r be (-2)/7 - (-69)/21. Let j(x) = 8x2 - rx - 247 + 239 - 3x2. Let d(g) = -2g*2 + g + 3. Give 11d(q) + 4j(q). -2q*2 - q + 1 Let b(c) = 8c - 4. Let g = -392 + 388. Let t(r) = 7r - 3. Let j = 8 + -5. What is gt(z) + jb(z)? -4z Let p(l) = 8l3 + l2 + 31l + 5. Let o(t) = -7t3 - t2 - 31t - 4. What is 5o(n) + 4p(n)? -3n3 - n2 - 31n Let y(t) = 31t3 + t2 - 3t + 3. Let x(i) = -94i3 - 4i*2 + 10i - 10. Calculate -3x(z) - 10y(z). -28z3 + 2z*2 Let k(n) = 2n*2 + 2n - 1. Let t(b) = 8b2 + 25b - 3. What is 3k(f) - t(f)? -2f*2 - 19f Let q(c) = 4c3 - 2c + 2. Let m(f) = -f + 1. Let b = -142 + 140. Determine bq(x) + 4m(x). -8x3 Let a(o) = 2o - 1. Let u(k) = 2k - 37. Let r(q) = -2q + 31. Let v(c) = 6r(c) + 5u(c). Let s = 2 - 7. Determine sv(n) - 4a(n). 2n - 1 Let m(h) = 167h + 3. Let u(r) = -1. Give -m(l) - 2u(l). -167l - 1 Let o(q) = 2q + 159. Let h(i) = i. Determine -4h(u) + o(u). -2u + 159 Let q(y) = y. Let x(u) = -22u. Let n = -1043 - -1045. What is nx(s) + 36q(s)? -8s Let q(o) = -23o + 891. Let a be q	{ "pile_set_name": "DM Mathematics" }
u(a) = -12a + 24a + 2 - 2 + 2. What is k(u(v))? -24v - 4 Let v(g) = -47g*2. Let s = -59 - -49. Let d(t) = 3t*2 - 5. Let w(y) = -2y*2 + 3. Let i(u) = sw(u) - 6d(u). Determine i(v(a)). 4418a*4 Let z(u) = 2u. Let f be (-57966)/(-36) + -14/24. Let i(g) = -2g*2 + 1658g + g*2 - fg + 0g2. Give i(z(v)). -4v*2 + 96v Let t(p) = -2p2 - 2p*2 + 4p*2 - 4p*2. Let x(f) = -3f + f*2 + 3f. Determine t(x(u)). -4u4 Let y(k) = -12k*2. Let c(j) = -5j*2 - 3j + 3. Let q(t) = 3t2 - t - t2 + 0t*2 - 3t*2 + 1. Let z(u) = -c(u) + 3q(u). Give z(y(o)). 288o4 Let c(w) = -1 - 2w + 1. Let q(y) = -357097y + 12y*2 + 357097y. Give c(q(a)). -24a2 Let b(c) = -13c*2 + 9c*2 - 11c2. Let t(q) = q2 + 2. Let h(a) = 3a2 + 5. Let o(j) = 2h(j) - 5t(j). Give b(o(p)). -15p*4 Let g(t) = 4t*2 + 3t*2 - 10t*2 + 2t*2. Let a(c) = -127c*2. What is g(a(k))? -16129k*4 Let p(y) = 198y - 53. Let h(z) = -7z2. Give p(h(w)). -1386w2 - 53 Let b(s) = s2 - 3s + 19. Let x(n) = 4n - 20. Let a(f) = 4b(f) + 3x(f). Let u(g) be the first derivative of a(g). Let y(r) = 8r. Give u(y(h)). 64h Let l(i) = 4i2. Let a(x) = -x - 6. Let c be a(-3). Let o(g) = -14g*2. Let z(j) = 15j*2. Let m(p) = cz(p) - 2o(p). Calculate l(m(h)). 1156h*4 Let r(t) = -44614t*2. Let z(n) = -2n*2. What is z(r(u))? -3980817992u*4 Let f(v) be the first derivative of 2v3/3 - 3. Let m(h) be the third derivative of h5/15 + 14h2. Give m(f(r)). 16r*4 Let n(f) be the first derivative of -2f*3 + 212. Let t(i) = -5i. Calculate n(t(y)). -150y2 Let s(k) be the first derivative of k2 + 1. Let z(q) be the third derivative of -q5/15 + 189q*2. Calculate s(z(t)). -8t2 Let h(b) = b2 + 4b + 4. Let v(s) = -2s*2 - 7s - 7. Let d(x) = 7h(x) + 4v(x). Let i(w) = -2w - 8. Calculate d(i(f)). -4f*2 - 32f - 64 Let o(s) = 177532s. Let g(w) = -4w*2. Calculate g(o(z)). -126070444096z*2 Let d(a) = 1607a. Let s(m) = -7m + 3. Calculate s(d(x)). -11249x + 3 Let u(p) be the second derivative of -20p4/3 - 168p. Let r(n) = -2n. Calculate r(u(y)). 160y*2 Let w(h) = -h - 3. Let l(o) = 3o + 8. Let x(c) = 3l(c) + 8w(c). Suppose -41 = 3s - 56. Let y(a) = 7a + 0a - sa. Give y(x(k)). 2k Let a(m) = 7m*2. Let n(u) = -4u2 + u2 + 159u2. Determine a(n(w)). 170352w*4 Let i(p) = -2p. Let n(l) = -2080223l. What is n(i(c))? 4160446c Suppose -3u = -4f - 7, 0 = 2u - 3f - 2f - 7. Let k(q) = 1 + 11q - u. Let a(r) = 13r. Let j(h) = -53h. Let d(m) = 4a(m) + j(m). What is k(d(w))? -11w Let q(m) = -6m2. Let z(a) = -66863 + 66863 + 29a*2. Determine z(q(n)). 1044n*4 Let k(a) = 21149a + 2. Let o(h) = -19h. Give o(k(t)). -401831t - 38 Let c(v) = -10v2 - 216v + 216v + 12v*2. Let p(b) = 278b. What is p(c(z))? 556z2 Let c(i) be the third derivative of 43i4/24 + i3/6 + 2i2 - 23i. Let a(h) = 2h2. Give c(a(z)). 86z*2 + 1 Let p(s) = -18s*2. Let t(j) be the second derivative of -2j*3/3 + 66j. Calculate t(p(b)). 72b2 Let x(y) = 2y*2. Let n(u) = -5484u. Give x(n(r)). 60148512r2 Let o(z) = -2z*2. Suppose 56 = 4u + 3h + h, 2u - h = 13. Let l(x) = 3 + 8x - u + 6. Determine l(o(i)). -16i*2 Let d be -4(10/4 + -3). Let f(u) = 14u2 + 4u*2 - 16u*d. Let x(c) = -29c. Calculate x(f(v)). -58v2 Let f(r) = 3 - 5 + 328r*2 - 311r*2. Let n(l) = -l. What is f(n(p))? 17p*2 - 2 Let s(q) = -2q*2. Let u(k) = 9k. Let d be (-108)/(-18) + 8/(-2). Let i(f) be the first derivative of -2f2 + 1. Let c(m) = du(m) + 5i(m). Give s(c(b)). -8b*2 Let q(p) = -7762p. Let r(k) = 12k2. Calculate q(r(d)). -93144d*2 Let x(q) = q. Let j(y) = 13y + 261. Give j(x(w)). 13w + 261 Let w(x) = 2x - 4x + 4x. Let g(q) be the first derivative of -q*3/3 + 68. What is g(w(n))? -4n*2 Let i(w) = -91458w2. Let u(v) = -v2. Calculate u(i(p)). -8364565764p4 Let m(b) = -451b*2 + 1358b*2 - 454b*2 - 449b*2. Let d(l) = -11l. What is d(m(u))? -44u2 Let i(r) = 2r*2. Let x(l) = -1. Let u = -10 - -6. Let h(v) = 5v + 4. Let a(m) = ux(m) - h(m). Determine a(i(w)). -10w*2 Let h(q) = -17q2 + 33. Let i(y) be the first derivative of y2/2 - 724. Calculate h(i(c)). -17c2 + 33 Let p(i) be the third derivative of i4/24 - 2i*2 - 3. Let v(c) = 20c. What is p(v(g))? 20g Let u(a) = 24a*2. Let g(l) = -15l - 108. What is g(u(o))? -360o2 - 108 Let w(m) = m2 + 349 - 693 + 344. Let s(d) be the first derivative of 3d*2/2 - 3. What is s(w(q))? 3q*2 Let f(i) = 249i. Let y(n) = 11n2 + 63. Let a(j) = -j2 - 7. Let g(m) = -18a(m) - 2y(m). Give g(f(x)). -248004x*2 Let f(t) = -77645t. Let n(g) = 6g2. Give n(f(i)). 36172476150i*2 Let w(k) = -11k*2. Let a(g) = -7462g. What is a(w(y))? 82082y2 Let w(x) = -10x2 + 1. Let m(g) = -g2 - 268g. Give m(w(u)). -100u*4 + 2700u*2 - 269 Let v(w) = -142w - 9. Let l(f) = -f. Calculate v(l(y)). 142y - 9 Let b(f) = -3f. Let t(x) = x*2 - 2x - 1. Let z(y) = 2y2 + 36y + 18. Let q(m) = 72t(m) + 4z(m). Determine b(q(p)). -240p2 Let r(q) = -2q*2. Let d(z) = -423z - 10. Let s(c) = 846c + 18. Let g(h) = 7d(h) + 4s(h). What is r(g(p))? -357858p*2 - 3384p - 8 Let x(r) = r + 2. Let t(v) = 4v - 2. Let b(i) = 2t(i) + 2x(i). Let n(l) = 11l. What is n(b(w))? 110w Let j(d) = -2d - 12 + 11 - 22. Let c(t) = t*2. What is c(j(k))? 4k*2 + 92k + 529 Let g(h) = h. Let n(u) = 4u2 + 6u + 14. Let r(v) = -5v2 - 7v - 13. Let a(f) = 7n(f) + 6r(f). Give g(a(q)). -2q2 + 20 Let m(v) = 269v - 130v - 139v - 3v2. Let o(q) = -5q*2 + q. Give m(o(l)). -75l*4 + 30l*3 - 3l*2 Let h(l) = 176l. Let k(g) = -2. Let w(x) = x - 11. Let y(j) = -11k(j) + 2w(j). Give h(y(a)). 352a Let y(g) = 2g. Let l(j) be the third derivative of j*6/360 + 28j*3/3 + 2j*2 - 7j. Let b(d) be the first derivative of l(d). Determine b(y(h)). 4h2 Let a(x) = x. Let o be -1 + (-404)/(-12) + (-4)/6. Let k(y) = 30y - 56y + 4 + oy. Calculate a(k(d)). 6d + 4 Let p(w) = w2 + 1. Let f(a) = 1. Let t(u) = f(u) - p(u). Let i(o) = 3 - 2 - 13o - 1. Determine i(t(c)). 13c2 Let r(n) be the second derivative of -11n*3/3 - 782n. Let j be (0 + 4/10)10. Let s(d) = jd*2 - 4d2 - d2. Give r(s(l)). 22l2 Suppose -v = 2a - 3, 4a + 4v - 4 = -0a. Let k(i) = -5i*a + 17i*2 + 0i*2. Let x(d) = -3d*2. Give x(k(u)). -432u*4 Let f(s) = 8s*2. Let b(g) = 9g*2 - 6. Let v(w) = 77w*2 - 49. Let k(h) = 49b(h) - 6v(h). Determine k(f(q)). -1344q*4 Suppose 10 - 14 = -l. Let u(r) = -l - r + 10 - 6. Let k(m) = -9m. Determine u(k(o)). 9o Let t(n) = 3n. Let c(b) = -b*2 - 5. Let p(z) = -2z - 1. Let v be p(2). Let d(a) = -2. Let g(j) = vd(j) + 2c(j). Calculate g(t(i)). -18i2 Let g(y) = -y2 + 42y. Let s(v) = -16v + 16v - 49v2 + 50v2. Give g(s(l)). -l4 + 42l2 Let x(q) = -3q*2. Let a(t) = 7t + 26t - 70t - 51t - 32t. Determine a(x(j)). 360j2 Let u(c) = -c2. Let g(i) be the first derivative of 2i*3 + 12. Give u(g(h)). -36h*4 Let k(c) = 19c2. Let q(y) be the third derivative of -y5/15 + 101y2. Determine k(q(g)). 304g*4 Let z(d) = -17d*2 - 6. Let u(p) = 67p*2 + 2p - 15. Give u(z(c)). 19363c4 + 13634c*2 + 2385 Let y(f) = -3f. Let q(z) = z. Let n(k) = 4q(k) + y(k). Let h(c) = -17c - 2. Let g(s) = -33s - 5. Let t(i) = 2g(i) - 5h(i). Calculate t(n(v)). 19v Let y(x) = 1127x. Let s(r) = -400r*2. What is y(s(h))? -450800h*2 Let q(p) = 91p. Let t(w) = 412w2 - 7w. What is q(t(b))? 37492b2 - 637b Let u(l) be the first derivative of -204l2 - 777. Let k(j) = -2j*2. What is k(u(a))? -332928a*2 Let h(a) = 2a. Let f(v) = -15v - 32v - 3v + 2 - 7 + 3. Calculate h(f(r)). -100r - 4 Let h(n) = -2n. Let l(d) = 102117d. Calculate l(h(j)). -204234j Let k(n) = 39 - 16 + 2n - 23. Let m(u) be the second derivative of u5/15 + u2/2 + 2u. Let y(q) be the first derivative of m(q). What is y(k(s))? 16s*2 Let z(x) = 1490x - 6. Let l(m) = -6m. What is z(l(k))? -8940k - 6 Let f(j) = 37j2. Let k(a) = -4879a. Give k(f(x)). -180523x2 Let i = -2 - 2. Let o = i + 20. Let t(k) = -12k + ok - 6k. Let z(c) = -11c*2. Calcu	{ "pile_set_name": "DM Mathematics" }
, 2468, 2985, 3518? 4067 What comes next: 544, 908, 1514, 2362? 3452 What comes next: -753, -1074, -1395? -1716 What is next in -38634, -38625, -38616, -38607, -38598? -38589 What is next in -1319, -5182, -11621, -20636, -32227, -46394, -63137? -82456 What comes next: 4515, 8877, 13237, 17595, 21951? 26305 What comes next: -12757, -25517, -38277? -51037 What is the next term in 871, 1733, 2577, 3397, 4187, 4941? 5653 What comes next: 54, 183, 526, 1191, 2286, 3919, 6198, 9231? 13126 What is the next term in -694, -1341, -1988, -2635? -3282 What is the next term in -1314, -2613, -3888, -5127, -6318? -7449 What is the next term in -2887, -2892, -2897, -2902, -2907? -2912 What comes next: -1407, -11505, -38969, -92481, -180723, -312377? -496125 What comes next: -6306, -25151, -56552, -100509, -157022? -226091 What comes next: -11310, -90590, -305780, -724836, -1415714? -2446370 What is next in 70, 34, -40, -164, -350? -610 What is next in -29628, -118505, -266632, -474009, -740636, -1066513, -1451640? -1896017 What comes next: -26523, -53049, -79577, -106107, -132639, -159173? -185709 What is the next term in -185, -479, -1023, -1943, -3365? -5415 What comes next: 184, 386, 594, 808, 1028, 1254, 1486? 1724 What comes next: -131326, -262649, -393972? -525295 What comes next: -1422, -1408, -1394, -1380, -1366, -1352? -1338 What is the next term in -6020, -6041, -6062, -6083? -6104 What is the next term in 1460, 1482, 1508, 1538, 1572? 1610 What is next in 165, 542, 983, 1338, 1457, 1190, 387, -1102? -3427 What is next in 6, -94, -170, -210, -202? -134 What is next in 7206, 7207, 7212, 7221? 7234 What is the next term in 53, -91, -473, -1213, -2431? -4247 What comes next: -850, -1717, -2598, -3499, -4426? -5385 What is next in -13230, -13257, -13286, -13317, -13350? -13385 What is the next term in -1867, -1839, -1791, -1723, -1635? -1527 What is the next term in -200, -177, -176, -203, -264, -365, -512? -711 What comes next: -892, -1782, -2668, -3550, -4428, -5302? -6172 What is the next term in 82, 275, 598, 1069, 1706, 2527? 3550 What is next in 2256, 2131, 2006? 1881 What comes next: 13151, 26307, 39465, 52625, 65787, 78951, 92117? 105285 What comes next: 13144, 26323, 39536, 52789, 66088? 79439 What is the next term in -14220, -56893, -128014, -227583, -355600, -512065? -696978 What comes next: -7728, -15430, -23130, -30822, -38500, -46158, -53790, -61390? -68952 What comes next: 5944, 10767, 15590, 20413, 25236? 30059 What is the next term in -284, -1151, -2592, -4601, -7172, -10299? -13976 What is the next term in 28366, 28375, 28386, 28399, 28414, 28431? 28450 What is the next term in -148, -203, -236, -235, -188, -83? 92 What is next in -43602, -43606, -43610, -43614? -43618 What is the next term in 190, 382, 574, 766, 958? 1150 What is the next term in -1301, -1252, -1203? -1154 What is the next term in -4933, -4939, -4945, -4951, -4957? -4963 What is the next term in 0, -55, -110? -165 What comes next: -1066, -1335, -1566, -1741, -1842, -1851, -1750? -1521 What comes next: -141, -386, -637, -894? -1157 What comes next: -2885, -2853, -2817, -2777, -2733, -2685? -2633 What is next in -57, -159, -329, -567? -873 What comes next: -313, -211, -85, 65, 239, 437? 659 What is next in -1701421, -3402844, -5104267, -6805690, -8507113? -10208536 What is next in -4573, -4638, -4731, -4858, -5025? -5238 What comes next: -3326, -3316, -3294, -3254, -3190, -3096, -2966, -2794? -2574 What is next in 104, -254, -1234, -3148, -6308? -11026 What is next in -56, -116, -136, -110, -32, 104? 304 What is next in 12991, 51938, 116839, 207694, 324503, 467266? 635983 What is next in -150, 5, 372, 1059, 2174, 3825, 6120? 9167 What comes next: 498, 566, 700, 918, 1238, 1678? 2256 What comes next: -203, -194, -183, -170, -155, -138, -119? -98 What is next in -568149, -568136, -568107, -568056, -567977, -567864, -567711, -567512? -567261 What is next in 43272, 86544, 129806, 173052, 216276, 259472, 302634? 345756 What is next in -2993, -2992, -2991, -2990? -2989 What is next in 2567, 10289, 23159, 41177, 64343, 92657? 126119 What is the next term in 375, 851, 1653, 2787, 4259, 6075, 8241? 10763 What is the next term in 410, 823, 1236, 1643, 2038, 2415, 2768? 3091 What is the next term in -982, -1944, -2906, -3868, -4830? -5792 What comes next: 3335, 3344, 3359, 3380, 3407, 3440? 3479 What comes next: -682, -2742, -6174, -10978, -17154, -24702? -33622 What is next in 4496, 8979, 13462, 17945? 22428 What comes next: 37375, 37370, 37365, 37360, 37355? 37350 What is next in 656731, 656733, 656735, 656737? 656739 What is the next term in -5369, -10697, -16025, -21353, -26681, -32009? -37337 What is next in -13744, -27492, -41252, -55030, -68832, -82664, -96532, -110442? -124400 What comes next: 60, 13, -76, -213, -404, -655? -972 What comes next: 15528, 15440, 15342, 15228, 15092, 14928, 14730? 14492 What comes next: -9038, -9205, -9486, -9881, -10390, -11013? -11750 What comes next: 3160, 12523, 28094, 49879, 77884, 112115, 152578? 199279 What comes next: 222, 202, 148, 48, -110, -338, -648? -1052 What comes next: -875121, -875120, -875117, -875112, -875105, -875096, -875085? -875072 What comes next: -2053, -2094, -2135? -2176 What is the next term in 2773, 5533, 8293, 11053, 13813, 16573? 19333 What is next in 1034, 1037, 1040, 1043, 1046? 1049 What comes next: -2230, -2208, -2172, -2122, -2058, -1980, -1888? -1782 What is next in -1216, -1174, -1086, -946, -748, -486, -154? 254 What is next in -688, -898, -1112, -1330, -1552, -1778, -2008? -2242 What is the next term in 114509, 114480, 114451, 114422, 114393, 114364? 114335 What is next in 3634, 3763, 3894, 4027, 4162, 4299, 4438? 4579 What is the next term in -255527, -255528, -255529, -255530, -255531? -255532 What is the next term in -4744593, -4744591, -4744589, -4744587, -4744585? -4744583 What is the next term in 849, 1372, 1905, 2454, 3025? 3624 What comes next: -33968, -33980, -33992, -34004? -34016 What is the next term in -4496, -4688, -4884, -5084, -5288, -5496, -5708? -5924 What comes next: 19292, 19125, 18958, 18791? 18624 What is next in -33434, -33433, -33432, -33431, -33430? -33429 What is next in 2415, 2368, 2261, 2064, 1747? 1280 What comes next: -6920, -13617, -20314, -27011, -33708, -40405? -47102 What comes next: 6900, 13815, 20738, 27669, 34608, 41555, 48510? 55473 What is next in 1594, 6384, 14376, 25576, 39990, 57624, 78484? 102576 What is the next term in 172, 40, -92? -224 What is next in 482, 506, 548, 608? 686 What is the next term in 323, 625, 923, 1217, 1507, 1793, 2075? 2353 What comes next: -72, 36, 146, 258, 372, 488, 606? 726 What is the next term in -415, -434, -425, -388, -323? -230 What is next in -14364, -14375, -14400, -14445, -14516? -14619 What is the next term in -43, -196, -449, -796, -1231, -1748, -2341, -3004? -3731 What is the next term in 1346, 2271, 3196, 4121, 5046? 5971 What is the next term in 18365, 18361, 18357, 18353, 18349? 18345 What comes next: 263, 412, 553, 686? 811 What is next in 2549, 2465, 2385, 2309, 2237, 2169? 2105 What is the next term in -230, -934, -2108, -3752, -5866? -8450 What is the next term in -128, -262, -430, -632, -868, -1138? -1442 What is next in 16, -31, -124, -263, -448, -679? -956 What is the next term in 10005, 20058, 30111? 40164 What comes next: 243, 239, 229, 213, 191? 163 What is the next term in 201, 390, 575, 756? 933 What comes next: -106, -288, -586, -1000, -1530, -2176, -2938? -3816 What comes next: -43, -8, 43, 104, 169, 232? 287 What comes next: -75929, -303716, -683351, -1214828, -1898141? -2733284 What comes next: -28, 91, 272, 509, 796, 1127, 1496? 1897 What is the next term in 3920, 3999, 4078, 4157, 4236, 4315? 4394 What is the next term in 3, -39, -95, -153, -201, -227, -219? -165 What is next in 87, 29, -65, -195? -361 What is the next term in 52, 411, 1378, 3259, 6360? 10987 What is next in -307, -875, -1717, -2839, -4247? -5947 What is next in -7963, -8006, -8069, -8146, -8231, -8318, -8401, -8474? -8531 What is next in -2296, -2300, -2306, -2314, -2324, -2336, -2350? -2366 What is the next term in -96, -46, 54, 228, 500, 894, 1434? 2144 What comes next: 56246, 56245, 56244, 56243, 56242, 56241? 56240 What is the	{ "pile_set_name": "DM Mathematics" }
is the fifth smallest value in w, -4, -0.4, -1, -3/2? w Let c = 25.084 + 0.916. What is the fourth smallest value in 2/15, c, -1/3, -4? c Let o = 3923 + -3918. Which is the second smallest value? (a) 4 (b) -25/3 (c) o (d) 0.5 (e) 1/3 e Let r = -182 - -1640/9. Suppose -2h = 5o - 6 - 14, -o + 4 = -5h. Let w be (-10)/(420/9)o/6. What is the fourth biggest value in 0.7, w, -0.3, r? -0.3 Let h(i) = -15i + 9i - 5i - 5i + 47 + 2i2 - 4i. Let x be h(3). Which is the third smallest value? (a) x (b) -4/9 (c) 4 (d) -1 c Let m = 4 - 0. Let p = 5 - 5. Let d = 8352/5 - 1670. What is the fourth biggest value in d, m, p, 1/5? p Let i = 2/139 + 260/1251. Let q = -4542.7 + 4542.8. Which is the fourth smallest value? (a) -8/5 (b) q (c) -4 (d) i d Let d(t) = 12t - 21. Let g be d(2). Let f be (g/(-9) - (-22)/(-6)) + 1. What is the second smallest value in 2/9, f, -1/3, -4? f Let i = 1786 - 1785.5. What is the second biggest value in 5, 65.4, i? 5 Let j = -1/89 + -81/712. Let o = -0.1 + 0.1. Let w = 1825 + -1823. Which is the biggest value? (a) o (b) j (c) w c Let k = 1734274/10811 - 3048/19. Let x = k - 96155/1707. Let o = x - -57. What is the second smallest value in o, 0, -0.2, -5? -0.2 Suppose -4k + 70u - 68u = -20, 5k = -3u + 25. Which is the second biggest value? (a) 1/9 (b) k (c) 1/119 a Let j = 2423/357 - 145/21. Let h = 14 - 15. What is the smallest value in j, h, 1? h Let c = -61.86 - -58. Let r = -3.36 - c. What is the fourth biggest value in 0.001, -1/6, r, -4? -4 Let o = 10 - 20. Let g = -12 - o. Suppose 7m - 3 + 31 = 0. Which is the biggest value? (a) -1 (b) g (c) -1.1 (d) m a Let i(o) = -3o - 59. Let u be (-2)/(16/24 + (-64)/114). Let d be i(u). What is the smallest value in 10, 0.3, d, 2/3? d Let o = 11.44 + -12.34. Which is the smallest value? (a) 2/11 (b) o (c) 5 (d) 1/4 (e) 1/3 b Let k = 260639/42 + -6206. Let w = k + -109/462. Which is the smallest value? (a) 1 (b) w (c) 2/11 b Let x be -8 - (1479/(-119) + 4/(-7)). What is the second smallest value in -64/11, -5, x? -5 Let w = 312.7 + -312. Let s = -0.6 + w. What is the second smallest value in s, -3, 0, -1/3? -1/3 Let r(y) = -2y + 4. Let b be r(-6). Let c be (-60)/(-18)9/(6 + -3). Let m be (0 - -3) + (-4)/((-40)/c). What is the smallest value in m, b, -2? -2 Let a = 2.95 - 3. Let c = 260 + -216. Let j = 47 - c. What is the smallest value in -0.3, a, j? -0.3 Let g = 0.075 - 16.075. Let m be (84/(-70))/((-3)/(-10)). Let f be (m + 1472/360)/(4/10). What is the second biggest value in 0.2, f, g, -3/5? 0.2 Let v be (-1)/6 - 1157/(-534). Which is the smallest value? (a) 5 (b) -1.1 (c) v (d) -1/8 b Let r = -0.08 + 0.38. Let l = 524 + -640. Let f = l + 116.08. Which is the third biggest value? (a) r (b) 1 (c) f (d) 3 a Let z be (-216)/(-48)12/729. Which is the second smallest value? (a) -4/27 (b) z (c) -2 a Let n(w) = 3w*2 + 6w + 5. Let y be n(-4). Let l be 1/1 + -3 + 36. Let a = l - y. What is the third smallest value in a, -5/4, 1/3, -2/9? 1/3 Let y = -57 + 56.04. Let v = -0.16 - y. Suppose 0 = 27p - 32p - 20. What is the second biggest value in v, 0.2, p? 0.2 Let l(y) = -y - 14. Let p be l(-12). Let u(t) = -t*3 - 2t*2 + 4t - 2. Let b be u(-3). What is the third smallest value in b, -0.2, p, 4? -0.2 Let k = 14.53 - 0.53. Let q = -15.8 + k. Let d = q - -2.2. What is the second smallest value in 3, d, -1/6? d Let p = 833337 + -10826753/13. Let q = p + -510. Let j be 2/(-9) + (-86)/(-144). Which is the fourth smallest value? (a) 2 (b) j (c) -4 (d) q a Let g = 0.0638 - 281.1638. Let d = g - -282. Which is the biggest value? (a) -0.15 (b) d (c) -4 b Let w = 1 + -4. Suppose 296b - 315 - 99 = -118b. What is the second smallest value in 0.4, -1/12, b, w? -1/12 Let d = 0.783 + -0.683. Which is the second smallest value? (a) -79/3 (b) -3 (c) d b Let j = -221/639 + -7/71. Suppose 0b + 4b = 12. Suppose -w + bw = -2. What is the third biggest value in w, -0.08, j? w Let z = -182 + 290. Let m = z + -117. Which is the fourth biggest value? (a) -3 (b) m (c) 5 (d) -4 b Suppose 5j = 2n + 309, 4n = 3j + 46 - 223. Let d be 11/(-99) - 11/j. Which is the third smallest value? (a) -4 (b) d (c) 35 c Let z = 2792 + -5585/2. Let y be (-2)/6 + (-8)/(-8). Let q = 0 - -0.4. Which is the biggest value? (a) q (b) -2/3 (c) z (d) y d Let g = -935/7 + 134. Suppose 27o + 5o - 32 = 0. Which is the third smallest value? (a) o (b) g (c) 6 c Let m be (-18)/(-63) + 184/(-140). Let h = 10/7 + m. Which is the fourth smallest value? (a) 4/3 (b) h (c) -5 (d) -0.3 a Let d be (-10)/456/(-4). Let u = 75.6 + 1.4. Let s = u + -73. What is the second smallest value in 4/11, 1/4, d, s? d Let z = 574.223 + 0.777. Let d = z - 578. What is the biggest value in -2/5, d, 1, 12? 12 Let f(i) = 2i3 - 12i*2 + 23i - 140. Let h be f(6). What is the third smallest value in -3/7, 1/72, 2/9, h? 1/72 Let g = 115 - 44. Let z = 46 - g. Which is the smallest value? (a) z (b) 5 (c) -1 a Let b = -11 - -9. Let u be b/(((-245)/10)/7). Let h = 67 - 66.9. What is the fourth smallest value in -1, 5, h, u? 5 Let w be (76/(-36) + 1)(-3)/4. Let l = -1121 + 1121.5. Which is the second smallest value? (a) 36 (b) w (c) l b Let p be (1/3)/((-20)/2). Let q = 5/6 + p. Let i = 2784 - 2783.9. What is the second smallest value in i, q, -1? i Let r = -2 + 3. Let x be 1/9 - (r + -1). Let u = -56341 - -56340.8. Which is the second smallest value? (a) x (b) 0.1 (c) -0.4 (d) u d Let z(w) = -24w - 63. Let o be z(-3). Let a = 37/4 - o. What is the third biggest value in -5, -0.044, a? -5 Suppose 0 = 2z + 2z. Let n be (1 - -1)/(30/(-75)). What is the second biggest value in n, -0.04, z? -0.04 Let s = -12 + -14. Let i = s - -84. Let r = i + -61. What is the fourth biggest value in 2, r, 5, -0.3? r Let m(p) = p*2 - 7p - 8. Let z be m(8). Suppose 5v = -2r + 34, z = r - v + 6v - 22. Which is the third biggest value? (a) r (b) 3/5 (c) -1/3 c Let n(d) = -d3 + 5d*2 + 12d + 17. Let x be n(7). Suppose -4w = xv - 48 - 54, 2v - 2w - 68 = 0. What is the second biggest value in 2/9, 0, v? 2/9 Let d = -0.1 + 0.5. Suppose 4v = 4h + 20, 5v - 2v + 2h = 0. Let x = 8.29 + -10.29. Which is the second biggest value? (a) v (b) d (c) x b Let b = -604/5 + 122. Let l = -911.29 + 936.29. What is the smallest value in b, l, -5? -5 Let h = 167.2 + -169.2. Let t(a) = -2a + 7. Let l be t(5). What is the fourth biggest value in 0.02, h, l, 3? l Let j = 3 + -6. Let x = 8365.1 + -8365. Which is the second biggest value? (a) j (b) x (c) 4 b Suppose -6 = x + 5v, -5v - 52 + 4 = 3x. Let n = 294183 + -294185. What is the third biggest value in -4, -4/7, n, x? -4 Let i = -6 - -6. Suppose 2r - 5p = 9 - 46, i = -4r + 4p - 44. Let y = 4 + r. Which is the fourth smallest value? (a) y (b) -0.5 (c) 1/5 (d) 0.1 c Let u = 4.72 - -3.28. What is the smallest value in u, 5, -2/7, 0, 3/8? -2/7 Let w = -1.25056 + 0.05056. What is the second smallest value in w, 0.5, -98? w Let t = 4.25 - 0.25. Let m = -15.79 + 16.09. What is the third biggest value in m, t, -4, 0? 0 Let t = -52/5 - -10. Let i = -14.4 + -64.6. Let o = i - -84. Which is the third biggest value? (a) o (b) t (c) -2 c Let l = 0.136 + 0.064. Let j = 202 - 401/2. Which is the third biggest value? (a) l (b) 14 (c) j a Let t = 53/40 + -9/8. Let k = -75.8 + 75.4. What is the fourth biggest value in t, k, -2/7, 0.09? k Let v = 14372 + -14367. Which is the third biggest value? (a) v (b) 4 (c) -0.042 c Let x = 1483 + -1486. Which is the third smallest value? (a) -4 (b) x (c) -95 b Let g = 8.5 + -59.5. Let p = g + 58. Let j = 10 + -15. Which is the second biggest value? (a) -0.1 (b) p (c) j a Suppose 190m - 86m = 97m - 98. Let u = -1 - -4. Which is the second smallest value? (a) u (b) m (c) -2/9 (d) -3 d Let l = 4.425 - 4.325. Let q be 2 - 7(-1)/(-4). What is the second smallest value in l, q, -3? l Suppose -355 + 52 = 3h. Let g be (74/(-12))/((-12)/(-792)-4). Let d = h + g. Which is the second biggest value? (a) 6 (b) 0.3 (c) d c Let g = 0.885 + -2.117. Let v = g - 0.768. Let a(s) = -2s + 1. Let t be a(-2). What is the fourth biggest value in t, 2/9, 1, v? v Let h(k) = -k*2 - 15k + 51.	{ "pile_set_name": "DM Mathematics" }
t is 238 minutes before 7:47 AM? 3:49 AM What is 353 minutes after 5:55 AM? 11:48 AM How many minutes are there between 1:03 AM and 11:21 AM? 618 What is 171 minutes before 10:35 PM? 7:44 PM How many minutes are there between 5:28 AM and 5:12 PM? 704 How many minutes are there between 9:31 AM and 2:29 PM? 298 How many minutes are there between 8:58 AM and 10:28 AM? 90 How many minutes are there between 11:35 AM and 3:47 PM? 252 How many minutes are there between 2:24 PM and 2:06 AM? 702 How many minutes are there between 9:10 AM and 8:28 PM? 678 How many minutes are there between 9:39 AM and 10:39 AM? 60 What is 463 minutes after 5:19 AM? 1:02 PM What is 572 minutes after 8:30 AM? 6:02 PM What is 152 minutes after 7:48 AM? 10:20 AM What is 514 minutes before 9:38 PM? 1:04 PM How many minutes are there between 4:22 PM and 11:47 PM? 445 What is 266 minutes before 3:25 PM? 10:59 AM What is 194 minutes before 9:34 AM? 6:20 AM How many minutes are there between 11:08 AM and 8:06 PM? 538 What is 556 minutes before 9:32 AM? 12:16 AM What is 328 minutes before 3:45 PM? 10:17 AM How many minutes are there between 11:47 AM and 12:50 PM? 63 What is 605 minutes after 3:39 PM? 1:44 AM How many minutes are there between 5:52 AM and 6:02 AM? 10 What is 582 minutes after 1:43 AM? 11:25 AM How many minutes are there between 11:20 PM and 1:52 AM? 152 How many minutes are there between 1:02 PM and 3:47 PM? 165 How many minutes are there between 1:58 AM and 3:30 AM? 92 What is 51 minutes after 3:21 PM? 4:12 PM How many minutes are there between 3:40 PM and 9:03 PM? 323 How many minutes are there between 9:32 AM and 3:31 PM? 359 How many minutes are there between 8:29 AM and 2:42 PM? 373 What is 2 minutes before 10:24 PM? 10:22 PM How many minutes are there between 9:56 AM and 11:03 AM? 67 How many minutes are there between 2:15 AM and 2:21 AM? 6 How many minutes are there between 1:12 PM and 2:50 PM? 98 What is 251 minutes after 7:48 PM? 11:59 PM What is 480 minutes after 7:11 PM? 3:11 AM What is 60 minutes before 3:13 AM? 2:13 AM How many minutes are there between 8:04 AM and 5:21 PM? 557 How many minutes are there between 4:47 AM and 10:09 AM? 322 What is 328 minutes before 3:24 AM? 9:56 PM What is 332 minutes before 7:34 AM? 2:02 AM What is 238 minutes before 5:21 AM? 1:23 AM What is 473 minutes after 2:08 AM? 10:01 AM How many minutes are there between 8:45 PM and 7:32 AM? 647 How many minutes are there between 4:56 AM and 3:43 PM? 647 What is 631 minutes after 1:27 PM? 11:58 PM How many minutes are there between 10:00 PM and 3:27 AM? 327 How many minutes are there between 6:41 PM and 12:18 AM? 337 What is 82 minutes after 1:42 AM? 3:04 AM What is 374 minutes before 9:05 PM? 2:51 PM How many minutes are there between 7:10 PM and 3:38 AM? 508 How many minutes are there between 7:56 PM and 10:04 PM? 128 How many minutes are there between 1:48 PM and 8:46 PM? 418 What is 456 minutes after 5:27 AM? 1:03 PM What is 547 minutes after 11:56 PM? 9:03 AM What is 570 minutes before 1:28 AM? 3:58 PM What is 186 minutes before 10:49 AM? 7:43 AM How many minutes are there between 3:22 AM and 8:01 AM? 279 What is 699 minutes after 12:40 AM? 12:19 PM What is 310 minutes before 10:12 PM? 5:02 PM What is 372 minutes before 3:16 AM? 9:04 PM How many minutes are there between 5:08 AM and 8:14 AM? 186 What is 628 minutes before 10:56 PM? 12:28 PM What is 293 minutes after 6:02 PM? 10:55 PM How many minutes are there between 7:41 PM and 5:05 AM? 564 How many minutes are there between 11:05 AM and 12:41 PM? 96 What is 279 minutes before 7:50 AM? 3:11 AM How many minutes are there between 11:51 AM and 12:26 PM? 35 What is 634 minutes before 8:33 AM? 9:59 PM What is 652 minutes before 12:48 AM? 1:56 PM How many minutes are there between 8:10 PM and 2:17 AM? 367 How many minutes are there between 9:33 AM and 9:42 AM? 9 What is 525 minutes after 4:26 AM? 1:11 PM What is 277 minutes before 1:09 AM? 8:32 PM How many minutes are there between 11:27 PM and 8:45 AM? 558 What is 184 minutes after 11:41 PM? 2:45 AM What is 702 minutes after 8:54 PM? 8:36 AM What is 423 minutes after 4:41 PM? 11:44 PM How many minutes are there between 2:17 PM and 6:31 PM? 254 What is 376 minutes before 10:43 PM? 4:27 PM How many minutes are there between 2:07 PM and 1:56 AM? 709 What is 159 minutes after 9:56 AM? 12:35 PM What is 181 minutes before 11:20 AM? 8:19 AM What is 265 minutes before 11:34 AM? 7:09 AM How many minutes are there between 4:36 AM and 12:49 PM? 493 What is 661 minutes before 1:50 AM? 2:49 PM How many minutes are there between 4:23 PM and 1:53 AM? 570 What is 385 minutes after 9:44 AM? 4:09 PM How many minutes are there between 3:51 AM and 4:58 AM? 67 What is 159 minutes after 11:30 AM? 2:09 PM How many minutes are there between 1:15 PM and 2:46 PM? 91 What is 292 minutes after 5:23 PM? 10:15 PM What is 692 minutes after 7:44 PM? 7:16 AM What is 296 minutes before 7:28 AM? 2:32 AM How many minutes are there between 5:50 PM and 2:35 AM? 525 What is 36 minutes before 7:25 PM? 6:49 PM What is 410 minutes after 5:04 AM? 11:54 AM How many minutes are there between 8:03 PM and 4:49 AM? 526 What is 596 minutes after 6:41 PM? 4:37 AM How many minutes are there between 1:49 PM and 5:06 PM? 197 How many minutes are there between 1:19 PM and 1:55 PM? 36 How many minutes are there between 2:48 AM and 6:12 AM? 204 How many minutes are there between 11:55 AM and 4:38 PM? 283 How many minutes are there between 1:00 AM and 11:18 AM? 618 What is 148 minutes after 8:29 AM? 10:57 AM How many minutes are there between 6:12 PM and 11:12 PM? 300 What is 681 minutes after 2:52 AM? 2:13 PM How many minutes are there between 5:19 PM and 8:11 PM? 172 How many minutes are there between 1:37 AM and 12:13 PM? 636 How many minutes are there between 9:24 PM and 5:25 AM? 481 What is 665 minutes after 8:59 AM? 8:04 PM How many minutes are there between 9:10 AM and 8:52 PM? 702 What is 302 minutes after 8:44 AM? 1:46 PM How many minutes are there between 10:04 PM and 3:08 AM? 304 How many minutes are there between 1:48 PM and 9:36 PM? 468 How many minutes are there between 8:47 AM and 6:17 PM? 570 What is 620 minutes after 4:24 AM? 2:44 PM What is 235 minutes after 5:15 PM? 9:10 PM How many minutes are there between 1:59 PM and 2:53 PM? 54 How many minutes are there between 7:35 PM and 5:18 AM? 583 What is 599 minutes after 5:51 AM? 3:50 PM How many minutes are there between 4:02 AM and 8:48 AM? 286 What is 54 minutes before 4:43 AM? 3:49 AM How many minutes are there between 4:17 AM and 5:16 AM? 59 How many minutes are there between 4:58 AM and 8:41 AM? 223 What is 328 minutes after 7:04 AM? 12:32 PM How many minutes are there between 3:36 PM and 3:03 AM? 687 What is 677 minutes after 4:36 PM? 3:53 AM How many minutes are there between 6:59 PM and 2:37 AM? 458 How many minutes are there between 11:39 PM and 2:54 AM? 195 How many minutes are there between 12:55 AM and 3:51 AM? 176 How many minutes are there between 2:10 PM and 6:13 PM? 243 What is 439 minutes before 5:51 PM? 10:32 AM How many minutes are there between 8:03 PM and 10:58 PM? 175 What is 599 minutes after 1:14 AM? 11:13 AM How many minutes are there between 11:09 PM and 11:18 PM? 9 What is 596 minutes before 7:36 AM? 9:40 PM What is 682 minutes before 5:07 PM? 5:45 AM How many minutes are there between 10:51 AM and 10:53 AM? 2 How many minutes are there between 9:44 PM and 9:53 PM? 9 How many minutes are there between 10:24 PM and 7:44 AM? 560 What is 141 minutes after 6:06 AM? 8:27 AM How many minutes are there between 11:28 AM and 11:08 PM? 700 What is 53 minutes before 1:49 PM? 12:56 PM How many minutes are there between 2:31 PM and 9:12 PM? 401 How many minutes are there between 10:28 AM and 12:04 PM? 96 How many minutes are there between 9:15 PM and 1:11 AM? 236 How many minutes are there between 5:41 AM and 11:36 AM? 355 What is 586 minutes after 10:28 AM? 8:14 PM What is 501 minutes after 11:17 PM? 7:38 AM What is 398 minutes before 10:28 PM? 3:50 PM How many minutes are there between 1:12 AM and 9:04 AM? 472 What is 454 minutes after 5:31 PM? 1:05 AM What is 630 minutes after 3:57 AM? 2:27 PM How many minutes are there between 11:38 PM and 10:0	{ "pile_set_name": "DM Mathematics" }
1, p: 2, g: 4}. 1/105 Two letters picked without replacement from {t: 6, q: 7, b: 1, k: 6}. What is prob of sequence qb? 7/380 Calculate prob of sequence gxpn when four letters picked without replacement from ppxgmvvnxvvg. 1/1485 Two letters picked without replacement from karack. Give prob of sequence ka. 2/15 What is prob of sequence ooj when three letters picked without replacement from jpojoojppjoj? 1/22 Calculate prob of sequence sv when two letters picked without replacement from {s: 4, v: 4, y: 11}. 8/171 Three letters picked without replacement from kkhfjkhhfr. Give prob of sequence rhh. 1/120 Calculate prob of sequence cc when two letters picked without replacement from ccc. 1 Two letters picked without replacement from nns. What is prob of sequence ns? 1/3 Calculate prob of sequence aa when two letters picked without replacement from aaaaaa. 1 Two letters picked without replacement from {z: 15, j: 4}. Give prob of sequence jj. 2/57 Two letters picked without replacement from lhrllltbwbrrrhrl. What is prob of sequence rl? 5/48 Calculate prob of sequence ecx when three letters picked without replacement from {x: 2, l: 2, c: 1, g: 1, e: 1}. 1/105 Calculate prob of sequence ss when two letters picked without replacement from sskkkskssssssssskss. 91/171 What is prob of sequence yani when four letters picked without replacement from {n: 9, a: 1, y: 6, i: 3}? 9/5168 Calculate prob of sequence sr when two letters picked without replacement from rsgricg. 1/21 Three letters picked without replacement from nnnszizngznn. Give prob of sequence zii. 0 Calculate prob of sequence kqq when three letters picked without replacement from kqbibbbqiqibbkqqk. 1/68 Calculate prob of sequence lml when three letters picked without replacement from mmmllmmm. 1/28 What is prob of sequence hqbq when four letters picked without replacement from jqbjquhuw? 1/1512 Calculate prob of sequence tw when two letters picked without replacement from {w: 3, t: 11}. 33/182 Calculate prob of sequence ljj when three letters picked without replacement from jlllllllj. 1/36 Calculate prob of sequence zsss when four letters picked without replacement from {s: 5, f: 1, h: 1, z: 5}. 5/198 Calculate prob of sequence ag when two letters picked without replacement from {f: 5, a: 2, g: 1, d: 1}. 1/36 Four letters picked without replacement from {i: 4, b: 16}. What is prob of sequence iibi? 16/4845 Calculate prob of sequence rsd when three letters picked without replacement from mmrdrrsgsmrmms. 1/182 Calculate prob of sequence epyz when four letters picked without replacement from {z: 1, h: 11, y: 4, s: 1, e: 1, p: 1}. 1/23256 What is prob of sequence xmm when three letters picked without replacement from mxmxmmmxmmmmmmvm? 33/280 Calculate prob of sequence plll when four letters picked without replacement from lpllplpl. 3/28 Four letters picked without replacement from {h: 3, g: 1, t: 6, c: 1, p: 3, l: 3}. Give prob of sequence htpc. 9/9520 Four letters picked without replacement from ddsppsdsppisdpsvvds. Give prob of sequence ppsv. 5/1938 Two letters picked without replacement from {q: 3, m: 3, k: 1}. Give prob of sequence qq. 1/7 Calculate prob of sequence jtj when three letters picked without replacement from ttjttqtqqtjqtt. 2/273 Three letters picked without replacement from {o: 1, n: 3, e: 1, l: 5, d: 1, y: 6}. Give prob of sequence yey. 1/136 Calculate prob of sequence fdf when three letters picked without replacement from dddfddfffii. 2/33 Calculate prob of sequence ood when three letters picked without replacement from {d: 6, e: 4, l: 4, o: 2, j: 2, c: 1}. 2/969 Four letters picked without replacement from {y: 2, i: 2, f: 1, o: 2, u: 2, k: 3}. Give prob of sequence offu. 0 Calculate prob of sequence dia when three letters picked without replacement from jmiijjdja. 1/252 Four letters picked without replacement from {a: 1, f: 1, i: 3, d: 5, z: 1, l: 2}. What is prob of sequence daii? 1/572 Calculate prob of sequence lff when three letters picked without replacement from {f: 2, l: 1, n: 1, x: 1}. 1/30 Four letters picked without replacement from cchccccchcc. Give prob of sequence chcc. 7/55 Four letters picked without replacement from ppppppp. What is prob of sequence pppp? 1 Two letters picked without replacement from eoobcob. What is prob of sequence eb? 1/21 Two letters picked without replacement from rrbwrrrbrrbrrrr. What is prob of sequence rb? 11/70 Four letters picked without replacement from ysnbnbooi. What is prob of sequence iboy? 1/756 Calculate prob of sequence nv when two letters picked without replacement from {n: 2, v: 1, r: 2, y: 1}. 1/15 Two letters picked without replacement from akkufu. What is prob of sequence fa? 1/30 Calculate prob of sequence syj when three letters picked without replacement from {m: 1, y: 4, w: 4, s: 3, j: 2}. 1/91 Four letters picked without replacement from xxtxxxwwwxxwxxxwwx. Give prob of sequence wxtw. 11/2448 What is prob of sequence yy when two letters picked without replacement from vvyvyv? 1/15 Two letters picked without replacement from bxzxabaaauba. Give prob of sequence zx. 1/66 What is prob of sequence cccc when four letters picked without replacement from cccccuccccccc? 9/13 What is prob of sequence nel when three letters picked without replacement from len? 1/6 Four letters picked without replacement from qrgmuugmqqmmqqrquq. Give prob of sequence uqrg. 7/6120 What is prob of sequence gtgt when four letters picked without replacement from {t: 3, g: 15}? 7/408 What is prob of sequence vu when two letters picked without replacement from vuvuvuvvuvvvvuvvvv? 65/306 What is prob of sequence sll when three letters picked without replacement from llllsllllllll? 1/13 What is prob of sequence fss when three letters picked without replacement from {f: 11, s: 5}? 11/168 What is prob of sequence tn when two letters picked without replacement from cttnnttwtwcootwnw? 9/136 What is prob of sequence yyng when four letters picked without replacement from {m: 1, n: 3, k: 1, o: 2, y: 3, g: 1}? 1/440 Calculate prob of sequence xxx when three letters picked without replacement from {x: 14, e: 1}. 4/5 Two letters picked without replacement from foof. Give prob of sequence of. 1/3 Calculate prob of sequence dcuu when four letters picked without replacement from {c: 4, a: 1, d: 7, u: 2, v: 3}. 1/1020 Calculate prob of sequence xmtm when four letters picked without replacement from xmtmsemeetmtmtm. 1/273 What is prob of sequence mn when two letters picked without replacement from {n: 1, g: 10, k: 2, z: 3, m: 1}? 1/272 Calculate prob of sequence bv when two letters picked without replacement from bnwwbbwnvyn. 3/110 What is prob of sequence gj when two letters picked without replacement from jjjggggjjjgjjj? 45/182 What is prob of sequence gzgg when four letters picked without replacement from zggz? 0 Three letters picked without replacement from jppppppppjpp. What is prob of sequence pjj? 1/66 Three letters picked without replacement from iiiwiiiiiiii. Give prob of sequence iww. 0 Two letters picked without replacement from ojyjyyjyy. What is prob of sequence yj? 5/24 Calculate prob of sequence yk when two letters picked without replacement from kmymk. 1/10 Calculate prob of sequence ndmm when four letters picked without replacement from mmnmnnmnndmnmn. 5/572 Four letters picked without replacement from vvcvjjvvjcvjvvvv. Give prob of sequence vvvc. 3/91 Three letters picked without replacement from rjjjrjjrjjjjjkjj. What is prob of sequence jjr? 33/280 Four letters picked without replacement from {z: 2, d: 4, o: 6}. What is prob of sequence dozo? 2/99 Two letters picked without replacement from vnkpjkpkpkbjjbknjjbb. Give prob of sequence bv. 1/95 What is prob of sequence fa when two letters picked without replacement from {f: 1, r: 5, a: 4, t: 1, l: 5}? 1/60 What is prob of sequence qyll when four letters picked without replacement from {j: 1, i: 2, q: 1, l: 2, y: 1, m: 1}? 1/840 Calculate prob of sequence dddy when four letters picked without replacement from yyyyddyydyyddyyyyd. 1/51 Two letters picked without replacement from dvvdppvp. What is prob of sequence dv? 3/28 Calculate prob of sequence pu when two letters picked without replacement from {	{ "pile_set_name": "DM Mathematics" }
ort 10/3, v, r in ascending order. r, v, 10/3 Suppose -3u + 15 = 2z, 5z + 20 = u + 3u. Let p = -861/5 + 173. Sort p, 1/3, z in descending order. p, 1/3, z Let l = -1455 + 1455.35. Sort 3, -5, l in decreasing order. 3, l, -5 Let o = 0.3 + -0.2. Let b = 17 - 15. Suppose -2u + bw = 10, 3w = -0u - u + 11. Sort -1/2, o, u. u, -1/2, o Let m(p) = -p*3 + 9p*2 + 20p + 27. Let k be 4 - -11 - (2 - (0 + -2)). Let x be m(k). Sort -2, 4, x in ascending order. -2, 4, x Suppose 3d + 5 = -4u - 7, 0 = -4d - 5u - 16. Suppose 165 = -6a + 183. Sort a, d, -2, -3. d, -3, -2, a Let l = -2203 + 2183. Put l, 0.7, 1 in descending order. 1, 0.7, l Let f = -67 - -70. Suppose 4h + 2a - fa - 22 = 0, 4a - 38 = -5h. Let c = -4 + 3. Put c, h, 3 in ascending order. c, 3, h Let z = -23 + 26. Suppose -zi = -7i + 56. Suppose -3j - i = -11. Sort j, 2, 3 in ascending order. j, 2, 3 Suppose a - 4a = 30. Let w be ((-2)/1)/(4/a). Let u be -6 - (3 + 1 - 5). Sort w, u, 4 in ascending order. u, 4, w Let d = 5 - 5. Suppose 3b + 13 = 2v, -5b + dv = -3v + 22. Let u = -3.7 - -4. Put u, -3/7, b in decreasing order. u, -3/7, b Suppose -3z + 39 + 3 = 0. Suppose 2 = -2f + z. Suppose -fw = -w. Sort 5, w, 11 in decreasing order. 11, 5, w Let l = -229 + 229. Sort -2/7, l, -0.7, 0.4 in ascending order. -0.7, -2/7, l, 0.4 Suppose -4s = f - 1 - 12, 2f - 36 = 2s. Suppose 0 = -g - 5j + 2j + f, j - 15 = -5g. Let z be (0 - -1)/((-2)/g). Sort 2, z, -4 in increasing order. -4, z, 2 Let m = -62 - -20. Let l = m + 41. Put l, 1, 0.5 in ascending order. l, 0.5, 1 Suppose 2t + 9 = 3. Let y(a) = 12 + 0a + 8a - 20a*2 + 19a*2. Let n be y(9). Sort t, -1, n in ascending order. t, -1, n Let u = 148 + -155. Put -5, 4, u in ascending order. u, -5, 4 Let i = 441 - 2629/6. Let z = -79/30 + i. Let a = 0.02 + -2.02. Put -3, a, z in ascending order. -3, a, z Let f be 1 + -2 + (-7 - -11). Suppose fi = -2i + 35. Suppose 0 = -z + 3 - i. Put z, -5, 2 in descending order. 2, z, -5 Let c(v) = -4v + 1. Let x be c(1). Let b be (-6)/2 - (38 - -1). Let o be (-6)/14 - (-192)/b. Sort o, x, 2 in ascending order. o, x, 2 Let s = 2102 - 2125. Sort s, 2, 0.4 in decreasing order. 2, 0.4, s Let j be 6/((-11)/((-44)/40)). Let b = -0.1 - -0.05. Let g = 0 + b. Put g, -3, j in descending order. j, g, -3 Let t = 218 - 197. Let r = -28 - -33. Sort t, -3, r. -3, r, t Let o(k) = 5k2 - 3 - 2k*3 + 3k*3 - 2k*3. Let i be o(5). Let v be i + 8 + 2 + -3. Put -3, 2, v in descending order. v, 2, -3 Let x be (-6)/9 - 16/(-6). Suppose 5k + 0k - 20 = 0. Suppose -kt - 9 = u, -t + xu = 2t + 15. Put -2, t, -5 in decreasing order. -2, t, -5 Let f(g) = -g*2 - 16g + 17. Let t be f(-17). Sort t, 50, -3. -3, t, 50 Suppose v - 3 + 2 = 0. Suppose 38y = -88 + 88. Sort v, -2, 5, y in ascending order. -2, y, v, 5 Let h = 3 + -7/3. Suppose 15 - 6 = 3j. Suppose -jo + 4 = 5x - 13, 0 = -3x + o + 13. Put h, 5, x in decreasing order. 5, x, h Let w be 17/55 - 4/10. Sort w, -0.043, -2 in descending order. -0.043, w, -2 Let h be (-18)/(-48) - 87/(-24). Let s be h/(-20)5/2. Let m(z) = -z2 + z + 1. Let o be m(0). Sort 3/5, o, s. s, 3/5, o Let i(c) be the second derivative of -c4/4 - c3/3 + c2/2 - 5c. Let w be i(1). Let u be (-1288)/(-196) + 0 + -6. Put w, 0.4, u in increasing order. w, 0.4, u Let d = 4.1 - 4. Let i = 0.26 - -0.04. Let y = -1.5 + -3.5. Put i, y, d in descending order. i, d, y Let i = 4.83 - 4.33. Sort -0.08, -2/15, i in decreasing order. i, -0.08, -2/15 Let f = -1.9693 - 0.0307. Sort -11, 0.2, f. -11, f, 0.2 Let u(h) = h + 3. Let k be u(-2). Let i be (9 + -3)k/4. Let m = 14/79 + 9/395. Put m, 1, i in ascending order. m, 1, i Suppose -14 = -4v + 6v. Let x be v/1410/4. Let n = 2 + -2.5. Put n, x, 0.3 in decreasing order. 0.3, n, x Let v = 937 + -937. Put v, 8, -4 in decreasing order. 8, v, -4 Let j = -464.7 + 485. Let y = j + -25. Let i = y - -5. Sort 3, -0.1, i. -0.1, i, 3 Let r = -1092 - -1086. Sort 1, r, 7 in descending order. 7, 1, r Let t = -5 - -2. Let s = 7 + t. Let c be (s + -2 + 0)/(-2). Sort 0, 1, c in decreasing order. 1, 0, c Suppose -31j - 555 + 648 = 0. Sort 2/5, 1/3, j, 0.5. 1/3, 2/5, 0.5, j Let u = 125 + -151. Put -2, -4, 3, u in ascending order. u, -4, -2, 3 Suppose 0 = 5o - 20 - 10. Let k be 2/(-2)o/(-24). Let g = 106 + -103. Put k, g, -5 in increasing order. -5, k, g Suppose -310j = -282j - 392. Put 4, j, 2/7, 3 in ascending order. 2/7, 3, 4, j Let p(f) be the third derivative of 0 + 1/24f4 + 2f*2 + 0f + 5/3f3. Let x be p(-8). Put x, -6, 3 in descending order. 3, x, -6 Let s be 288/(-45) - (-3 - 3). Let v = -15 + 11. Put s, 1, v in decreasing order. 1, s, v Suppose -6v + 4v = -6. Let u be 17/(510/24) + (-14)/30. Sort -3/2, v, -0.3, u in descending order. v, u, -0.3, -3/2 Let q = -154 + 155. Sort -4, -5, q, -2. -5, -4, -2, q Suppose -4r + 6h = 7h + 28, 10 = r - 4h. Sort 2/3, 0.3, r in descending order. 2/3, 0.3, r Let t = 26.1 + -25.6. Put t, 1/5, 38 in increasing order. 1/5, t, 38 Let g(r) = -r2 + 5r - 6. Let y be (-3)/(-4) - (-26)/8. Let c be g(y). Let o = -0.06 + -0.04. Put o, c, 1 in ascending order. c, o, 1 Let q = -5 + 5. Let v(m) = m*2 - m. Let d be v(2). Let z be d + -2 + (-3)/((-75)/10). Sort z, -0.2, q. -0.2, q, z Suppose 0 = -2q - 3h + 12, 5h = 5q + 3h + 8. Suppose -61p = -28 - 33. Let a be -2 - (1 + -2)/1. Put a, q, p in descending order. p, q, a Let n = 1.17 + -3.17. Sort -2/3, -5, 0, n in ascending order. -5, n, -2/3, 0 Let p(d) = -d2 - 15d - 16. Let l be p(-12). Let y(g) = 3g3 + 2g*2 + 2g + 1. Let s be y(-1). Put s, l, 3 in decreasing order. l, 3, s Suppose 0 = -3p + 3 - 12, -3r + 5p = -87. Suppose 4q - 33 = 3i, 3i + 15 = 5q - r. Let u(c) = -c + 1. Let b be u(0). Put b, 4, q in descending order. q, 4, b Let a be 3/((-6)/(-4)) - 9. Suppose -b + 6 = -2p, -4b + 15 = -42p + 43p. Sort 3, b, a in increasing order. a, 3, b Suppose -638 = -29d + 957. Put d, -4, 0 in descending order. d, 0, -4 Let k be (0/4)/((-19)/19). Sort 4, -3, k, 5 in decreasing order. 5, 4, k, -3 Let c = -146 + 145. Sort 1, c, -23, 4 in ascending order. -23, c, 1, 4 Let n be (-2)/15 + (-29)/145. Sort 0.3, 0.6, 0, n in increasing order. n, 0, 0.3, 0.6 Suppose 0 = -3w - 0w. Suppose -2a - 2p - 74 = 0, -a + 2p + 0p = 34. Let k be a/(-15) + 4/(-10). Sort 4, k, w in descending order. 4, k, w Let w = 17.1 - 16.9. Let q be (-10)/(-4)2/10. Let j = -9.2 - -11.2. Sort j, w, q in descending order. j, q, w Let c = -33 - -65/2. Let k = -0.3 + 0.04. Let x = k - -0.16. Put 0.2, c, x in descending order. 0.2, x, c Let y(s) = 18s*2 - s + 1. Let g be y(1). Let k be g/(-20)10/12. Let c = 1.3 - 6.3. Put c, 2/7, k in ascending order. c, k, 2/7 Suppose -2h = -4g - 26, -6g + 10g = -2h - 14. Let o = -1 - g. Suppose 5k = k - 16. Sort k, 1, o in decreasing order. o, 1, k Let z = -7 - -11. Let k = 0 + z. Let f = -37 + 36.7. Sort 2/3, f, k. f, 2/3, k Let x = -2.17 + -1.83. Sort 10, x, 7/8 in ascending order. x, 7/8, 10 Let v = 1.5 + -1.1. Suppose 77 = 4y + 29. Let k be (y/16)/(18/(-4)). Sort v, k, -5 in decreasing order. v, k, -5 Let v = 3563 + -3572.585. Let u = v + -0.015. Let b = u + 10. Put 0, b, -2/13 in ascending order. -2/13, 0, b Let m(l) be the third derivative of l4/8 + 7l*3/3 - 17l*2. Let u be m(-4). Sort u, -3, -5 in ascending order. -5, -3, u Let y = 28 + -4. Let s = 26 - y. Suppose -n - 4 = 2. Sort -3, n, s in descending order. s, -3, n Let i be -6 + (0 - -13) - -3. Sort -5, i, -2 in decreasing order. i, -2, -5 Let j = 750 - 2255/3. Put -4, 0.5, j, -0.3 in increasing order. -4, j, -0.3, 0.5 Let c = -93 - 6. Let n = c + 99.94. Let u = n + -1. Sort u, 0.4, -2 in ascending order. -2, u, 0.4 Let l = 47 - 53. Suppose w = 3w + 2g + 28, -36 = 3w + g. Let b = w - l. Put -4, b, 4 in increasing order. b, -4, 4 Let v = 32 + -161/5. Let y = 17.9 - 15. Let j = 2.6 - y. Put j, 0.3, v in decreasing order. 0.3, v, j Let h = 9 + -9. Let y = -31/120 - -2/15. Sort y, h, 5 in ascending order. y, h, 5 Let g be (-13)/(-4) + 2/(-8). Let h(a) = 5a + 17. Let v(q) = -4q - 15. Let y(j) = -5h(j) - 6v(j). Let o be y(8). Put g, -5, o in ascending order. -5, o, g Let u = 150.2 + -148. Sort -0.3, u, -0.5 in increasing order. -0.5, -0.3, u Let g(r) = 6*r -	{ "pile_set_name": "DM Mathematics" }
z be (-5410)/25 - 4/(-10). Let r be (z/(-4))/(6/4). Calculate the highest common divisor of 12 and r. 12 Let j be 13/5 + (-3)/5. Suppose -4h + 10 = -2x, jh - x = -4x + 17. Let k = -29 + 41. Calculate the greatest common divisor of k and h. 4 Let a = 153 - 76. Calculate the greatest common factor of a and 11. 11 Suppose -172 + 162 = -z. Let p be (-4)/6 - (-34)/6. What is the greatest common factor of z and p? 5 Let k(c) = c*3 + 6c*2 + 8c + 3. Let o be k(-5). Let i be 26/(-3) + (-8)/o. Let a be i/(-6)(-84)/(-8). Calculate the greatest common factor of 35 and a. 7 Suppose y - 37 = -0y. Let s = 28 + y. Calculate the greatest common factor of s and 26. 13 Let u(v) = -v. Let b be u(-5). Let m be b + -2 - 3 - 3. Let a be 3 + 3/m0. What is the greatest common divisor of 15 and a? 3 Let i be 0/2 + 67/1. Let a = -39 + i. Let n(c) = 12c - 6. Let x be n(4). What is the highest common factor of x and a? 14 Let v(r) = -r*3 + 6r*2 - 2r - 2. Let j = 17 - 14. Let x be v(j). Let s(d) = 37d2 + 1. Let g be s(1). Calculate the highest common factor of g and x. 19 Let i be (-4)/(-10) - (-236)/10. Let c be 4 + 6/(-3 + 0). Suppose t = -1, ch - 39 = h + 3t. Calculate the greatest common factor of h and i. 12 Let y be (6/(-10))/(1/(-5)). Suppose 0 = 5k - b - 0b - 65, -yb - 27 = -3k. What is the greatest common factor of 2 and k? 2 Suppose 2t = 22 - 6. Suppose 4y = ty - 280. Calculate the greatest common divisor of 28 and y. 14 Let j = 84 + -42. Suppose 4a - j = a. Let r(x) = -9x*3 + 2x + 2. Let g be r(-2). Calculate the highest common divisor of g and a. 14 Let g be (96/56)/((-2)/(-14)). Let p be ((-9)/g)/((-2)/32). Let i be (-636)/(-18) - (-4)/6. What is the greatest common divisor of i and p? 12 Let y be (-73 + 0)-5. What is the highest common divisor of 21 and y? 21 Suppose -j = -17 - 21. Let a = -16 + j. What is the greatest common divisor of 33 and a? 11 Suppose -5q = -3q - 90. Let k be 0 + (-2)/(0 + 2). Let s be 5 - ((0 - k) + -1). What is the greatest common divisor of s and q? 5 Let t(j) = -j*3 - 6j*2 - 8j - 6. Let b be t(-5). Calculate the greatest common divisor of b and 9. 9 Let x be ((-1)/3)/((-2)/168). Calculate the greatest common factor of x and 28. 28 Suppose 5c - 60 = -4m, 4c - m = -c + 85. Suppose 3 = -4o + o, -k - 4o = -1. Let r = c - k. What is the highest common factor of r and 55? 11 Let i be (12/24)/((-2)/(-112)). Let w = -16 + i. Calculate the highest common factor of w and 24. 12 Let c = 92 + -53. Let s = c - 11. Let y be 4/(1/11). Calculate the greatest common divisor of s and y. 4 Suppose -11 - 13 = -2c. What is the greatest common divisor of 48 and c? 12 Let j(v) = v3 + 2v*2 - v. Let a be j(3). Calculate the highest common factor of a and 12. 6 Suppose 42 = 2b - 66. What is the greatest common divisor of b and 6? 6 Let m(x) = 4x2 + x. Let w be m(-1). What is the highest common divisor of 21 and w? 3 Suppose 5j - 163 = a - 56, 0 = -2j - 2a + 50. Let d = 10 - j. Let y be 1/((9/d)/(-3)). What is the greatest common factor of y and 20? 4 Let h(z) = z*2 - 5z + 5. Let x be h(5). Suppose xa = 6a - 6. What is the greatest common factor of 6 and a? 6 Let u(t) = -t*3 + 8t*2 - 5t + 2. Let p be u(7). Calculate the highest common divisor of 144 and p. 16 Let u be (-3 - -2) + 10/2. Let k = 8 + u. Calculate the greatest common divisor of k and 132. 12 Let s = 131 - 117. Calculate the highest common factor of s and 35. 7 Suppose -2o - 4z + 24 = 0, -11 = -2o - o - z. Let n(i) = 10i - 1. Let f be n(o). Suppose -2q + f = -53. Calculate the greatest common factor of q and 9. 9 Suppose 43f - 39f - 128 = 0. Calculate the highest common divisor of f and 128. 32 Let m = -3 + 7. Let t be (m - 6)(-39)/6. What is the greatest common factor of 65 and t? 13 Let m(u) = 11u - 5. Let a be m(2). What is the highest common factor of a and 85? 17 Suppose -t + 4o + 8 = 0, 0 = 2t + 3o - 40 - 9. Let g be t/(-3)45/6. Let l be ((-6)/(-15))/((-2)/g). Calculate the greatest common factor of 110 and l. 10 Suppose l = v - 113, 3v - 4v - 3l + 101 = 0. Let h be v/3 - 16/24. Calculate the greatest common divisor of h and 12. 12 Suppose 4v = -v + 200. Suppose 0 = 7o - 2o - v. Let k be (1/34)/(18/108). What is the highest common factor of o and k? 8 Let d(p) = -p + 4. Let u be d(2). Suppose 7 = uh - 7. Suppose -2b + 21 = -35. What is the greatest common factor of h and b? 7 Suppose -11z + 13 - 2 = 0. What is the highest common factor of 7 and z? 1 Let w be 5-3(-138)/10. Calculate the highest common factor of 23 and w. 23 Let z(u) = -28u*2 + 3u - 4. Let d be z(1). Let m(k) = -6k - 2. Let s be m(3). Let a = s - d. Calculate the highest common divisor of a and 6. 3 Let f(z) = -10z - 39. Let g be f(-5). What is the greatest common factor of g and 88? 11 Let q = 31 + -8. Suppose 0 = 2b - 6, 3 - q = -s - 5b. Calculate the highest common divisor of s and 2. 1 Let t(f) = f*3 - 7f*2 - 6f + 6. Let z be t(8). Let b be 3(-2 + z/3). What is the greatest common factor of b and 40? 8 Let q be 4 - (-3 - 0)/1. What is the highest common divisor of q and 49? 7 Let u(s) = -s3 - s2 - s + 27. Let o be u(0). Suppose 0 = 2v + v - 567. Calculate the highest common divisor of v and o. 27 Suppose 281 = 5o + 2c, 78 + 209 = 5o - c. What is the greatest common divisor of 38 and o? 19 Let y = -63 + 88. Let f = y - -45. Calculate the greatest common factor of 10 and f. 10 Let g(w) = w3 - 2w*2 + 7w. Let x be g(5). Suppose 0 = -4f - 18 + 138. Suppose 2n = -n + f. Calculate the greatest common divisor of n and x. 10 Let m = 35 - 18. What is the greatest common divisor of 119 and m? 17 Let s = 113 - 76. Let k = -21 + s. What is the greatest common factor of 2 and k? 2 Let k = 58 + -28. Suppose g + 296 = 4l, 2l - 72 - 90 = -3g. Calculate the highest common factor of k and l. 15 Let g(p) = -p2 - 9p. Let h be g(-9). Suppose h = 4n - 96 + 36. Let f = 166 - 61. Calculate the greatest common divisor of n and f. 15 Suppose 3f - 137 = -5m, -2f - 27 = -5m - 160. What is the highest common factor of f and 27? 27 Let v be (1 + 118)(-3 + 2). Let o = v - -173. What is the highest common divisor of o and 6? 6 Suppose 0v + 39 = 5v - i, v + i - 3 = 0. Suppose 3k = 67 + 17. What is the greatest common divisor of k and v? 7 Let a(c) be the third derivative of 11c*4/12 + 2c*3/3 + 6c*2. Let g be a(3). What is the highest common factor of 10 and g? 10 Suppose -101 + 629 = 11c. Calculate the greatest common divisor of 16 and c. 16 Let w(j) = -8j - 2. Let m(t) = 1. Let r(z) = -6m(z) + w(z). Let q be r(-11). Calculate the highest common factor of 16 and q. 16 Let v = 23 - 14. Calculate the greatest common divisor of 72 and v. 9 Suppose -3v + 0v = 12, 4i - 64 = 2v. What is the highest common divisor of i and 2? 2 Let q be 70/(-21)(-24)/(-10). Let s be ((-4)/q)/((-1)/(-140)). What is the highest common divisor of 28 and s? 14 Let s(z) = -z3 - 5z*2 - 6z - 6. Let x be s(-4). Suppose -q = 5, q = xc + 2q - 43. What is the highest common divisor of 36 and c? 12 Let k(c) = -41c. Let y be k(-1). Suppose 0 = 4j - 23 - y. What is the greatest common factor of 128 and j? 16 Let c(w) = w - 2. Let p be c(2). Suppose n + pn = 24. Suppose 4r = r - 4k, 3k = 4r - 25. Calculate the greatest common factor of r and n. 4 Let y(v) = v2 + 6v + 39. Let g be y(-5). What is the greatest common divisor of g and 153? 17 Let d = -6 - -9. Let y(g) = 0 - 5 + d + 2g - 19g. Let t be y(-2). Calculate the highest common divisor of 48 and t. 16 Let b be (-752)/18 - (-8)/(-36). Let s be (-408)/b + 2/7. What is the greatest common factor of s and 10? 10 Suppose -l + 2 = -0. Suppose 42 - 12 = lc. Calculate the highest common divisor of 135 and c. 15 Suppose -14t - 52 = -15t. What is the greatest common factor of t and 156? 52 Suppose 4c - 2c = 40. Calculate the highest common divisor of 50 and c. 10 Let a be 6/4(-2 + 44). What is the greatest common divisor of a and 7? 7 Let z be 96/2 - (-2 - -1). Let k = z - 5. What is the highest common divisor of 4 and k? 4 Let t(j) = -j + 3. Let i be t(0). Let v be 6/6 + 1i. Suppose 0 = 2a - 6, 0 = vl - a + 3a - 22. Calculate the highest common divisor of 44 and l. 4 Let	{ "pile_set_name": "DM Mathematics" }
, 29 Let z = -58 - -87. List the prime factors of z. 29 Let v = -16 - -135. List the prime factors of v. 7, 17 Let z(q) be the first derivative of q*3/3 - 7q*2/2 + 8q + 1. What are the prime factors of z(7)? 2 Let n be (-1)/3 + (-38)/(-6). List the prime factors of (-98)/21n/(-4). 7 Let i(b) = -9b*3 - 2b*2 - 5b - 1. List the prime factors of i(-2). 73 Suppose b + 18 = 4h, 0 = -0h + 4h - 12. Let m(v) = -v2 - 7v + 5. Let l be m(b). Let c = 25 - l. List the prime factors of c. 2, 7 Suppose -f - 114 = -j, j - 6j + 4f = -566. What are the prime factors of j? 2, 5, 11 Let k(l) = -l*2 + 8l - 5. Let t(z) = -z*2 + 4z - 2. Let j(b) = 3k(b) - 5t(b). Let g = 5 + -9. What are the prime factors of j(g)? 11 Let o(x) be the third derivative of -x*4/24 + 5x*3/3 + 5x*2. List the prime factors of o(6). 2 List the prime factors of (-1)/1(-6 - 2). 2 Suppose -4w - 5 = -13. What are the prime factors of -5 + w - -24 - 2? 19 Let h be (-1 - -4 - 0) + 0. Let s be (-1 + -19)(-4)/8. Suppose 4y + s = -2u, -4y - 31 = -8u + hu. What are the prime factors of u? 3 Let j = -59 + 91. What are the prime factors of j? 2 Let x = -7 - -2. Let y = -4 - x. What are the prime factors of y39(-1)/(-3)? 13 Let o be (-1421)/(-35) - (-6)/(-10). Let f = 63 - o. List the prime factors of f. 23 Suppose 6 = -4r + 18. Suppose rx = x - 4. List the prime factors of 2/(-4) + (-5)/x. 2 Suppose l = -2l + 120. What are the prime factors of l? 2, 5 Let b be (-39)/33 - 12/(-66). Let m(f) = -24f + 2. List the prime factors of m(b). 2, 13 List the prime factors of (-5 - 415)/(-6)5. 2, 5, 7 Suppose -44 + 212 = 4p. Suppose 0 = 2y - 16 - p. What are the prime factors of y? 29 Let a(p) = -p*3 - 3p*2 - 2p. Let l be a(-3). Let s = l - -1. Let u(j) = 3j - 8. What are the prime factors of u(s)? 13 Let t be 2/(-3) - 50/6. List the prime factors of (-2)/t - 744/(-54). 2, 7 Let v(h) = 4h*3 + 13h + 9. Let l(z) = -z3 - z2 - z - 1. Let i(q) = -5l(q) - v(q). What are the prime factors of i(-5)? 2, 3 Suppose -a + 7j - 1 = 4j, -2a + 1 = -3j. Suppose al - 11 = 27. Suppose -s - x = -5x - l, -3s + 43 = -5x. List the prime factors of s. 11 Let g be (-27)/(-18) - (-2)/4. Suppose 2q + gu - 98 = 0, -281 = -5q + 5u - u. List the prime factors of q. 53 Let u = 2 - 2. Let h be u/3 + 0 + 1. What are the prime factors of (22/8)/(h/4)? 11 Suppose 12s - 14s + 480 = 0. List the prime factors of s. 2, 3, 5 List the prime factors of (-58)/(-6) - 1/(-3). 2, 5 Let f = 11 - 6. Suppose d - 62 = -2u, u + f = 3d + 43. List the prime factors of u. 2 Suppose -9 = 2n - 3g, -5n = -5g + 5 + 15. Let v(z) = z2 + 7z. Let m be v(n). Let u = m + 25. What are the prime factors of u? 13 Suppose 5o + 61 = -34. Let p = -13 - o. What are the prime factors of p? 2, 3 Let i(v) = 5v + 3. Let q be i(-2). Let t be 2/(-2)q1. Let r(f) = 3f - 9. What are the prime factors of r(t)? 2, 3 Let i(j) = -j2 - 1 + 2 + 4j + 1. Let c = -5 + 9. List the prime factors of i(c). 2 Let m = 7 + -5. Suppose -p - mq = -6, 4p + 16 = -3q + 60. List the prime factors of p. 2, 7 Suppose -4z - 4k + 23 + 65 = 0, 120 = 5z + 3k. List the prime factors of z. 3 Suppose 2s + 5i + 14 = 0, s - 4i = -6i - 5. What are the prime factors of s? 3 Suppose 0 = -3q - 5c + 134, 0 = 3q + q + 4c - 176. What are the prime factors of q? 43 Suppose 2v = 6v + 76. What are the prime factors of ((-2)/(-1) - 3)v? 19 Let i be (89/(-2))/(4/(-8)). Suppose -5g - a + 48 = -i, g + 5a = 13. List the prime factors of g. 2, 7 Let w(t) = t*3 - 7t*2 + 6t + 13. List the prime factors of w(6). 13 Suppose 0 = 5u + m - 5m - 23, 17 = 5u - m. Suppose -2y + v - uv = -88, -y - 2v + 47 = 0. Suppose y = 3d - 19. What are the prime factors of d? 2, 5 Let m(n) = -n2 + 9n - 5. Suppose y - 2 = 2l, 0l = -2y + 2l + 2. Suppose -1 = 2s + o - 14, y = 3o + 3. List the prime factors of m(s). 3 Suppose 0 = -2g + 64 + 6. Let s = g + -12. List the prime factors of s. 23 Suppose -s - 1 = -3t - 0t, 3t + 5 = -5s. Let g be (1 + t)(2 - 2). Suppose 4 = -2r + 3r - 2z, 3r - 4z - 20 = g. List the prime factors of r. 2, 3 Suppose 9y - 696 = 6y. What are the prime factors of y? 2, 29 Suppose 73 = 5j - 12. Let c = j + -10. Suppose 29 = 2d + c. List the prime factors of d. 11 Let u = 4 + -1. Let k(t) be the third derivative of t4/24 - t3/6 + 2t2. List the prime factors of k(u). 2 Let y(l) = l3 + 4l2 - 3l + 1. Let f be (-1)/(-3) + (-30)/9. Let o be y(f). Let k = o - 13. What are the prime factors of k? 2, 3 Let m(c) = c - 3. Let l be m(3). Suppose l = -2x + 3n + 12, 5x - 5n - 16 = 4. Let r = 6 - x. List the prime factors of r. 2, 3 Let i be 84/15 + (-2)/(-5). List the prime factors of i/9(-42)/(-4). 7 Suppose 2g - 24 = -4p, p - 4g - 6 = -3g. Let n = -4 + 18. Let o = p + n. List the prime factors of o. 2, 5 Let l(r) be the second derivative of -r5/20 - r4/12 - r3/6 - 19r*2 + 2r. Let w be l(0). List the prime factors of w/(-3) - 2/3. 2, 3 Suppose -3k = 3u + k + 8, 0 = -2u - 3k - 6. What are the prime factors of u - (-6 - (0 + 1))? 7 List the prime factors of ((44-1)/1)/(-1). 2, 11 What are the prime factors of (136/17)/(4/34)? 2, 17 Let w = -26 + 97. What are the prime factors of w? 71 Suppose -2y = -3p - 4 + 17, -2p = -3y - 17. Let u(s) = 24s2 - 1. List the prime factors of u(p). 23 Let f(k) = k3 - 12k2 - 13k + 9. Suppose -8 = 2n - 34. List the prime factors of f(n). 3 List the prime factors of -6(-199)/(-2)2/(-6). 199 Suppose 5m = c + 99, 2m = -c + 4c + 50. List the prime factors of m. 19 Let p(t) = t*3 - 5t*2 - 8t - 8. Let c be p(7). Suppose 2z - c = 2. What are the prime factors of z? 2, 3 Let z be (2/4)/((-1)/2). Let p = z - -3. What are the prime factors of (2/p)/(3/21)? 7 Suppose 0 = -26y + 31y - 1440. What are the prime factors of y? 2, 3 Let r(f) = 9f + 10. Let c(w) = -10w - 11. Let x(o) = -6c(o) - 7r(o). Let q be x(-4). Let z(l) = l3 - 7l*2 - 7l + 5. List the prime factors of z(q). 13 Let v(y) = 2y + 14. Let b(q) = q + 5. Let l be b(6). What are the prime factors of v(l)? 2, 3 Let b be (-1)/(-3) - 6/18. Suppose 5f - 5 - 5 = b. What are the prime factors of f? 2 Suppose -d = -4, 3d = 4l + l - 13. Let a be 1l + -5 + 3. Suppose 5p + 55 = 5x - 0p, ap = 0. What are the prime factors of x? 11 What are the prime factors of ((-3)/6)/((-1)/98)? 7 Suppose -6 = 4z + 6. Let p be -20z4/(-6). Let k = p - -56. What are the prime factors of k? 2 Let a be (4 - 2) + 2 + 22. Let o = 17 - a. Let h(d) = -d*2 - 10d - 5. List the prime factors of h(o). 2 Let y(b) = b*2 + b + 4. Let x be y(-3). Let l = x + -5. List the prime factors of l. 5 Suppose 8y - 4y = -12. List the prime factors of (-1)/y + (-106)/(-6). 2, 3 Let d(v) = 14v*3 - 1. Let p be d(1). Suppose 3z = -4m + p, -4m + 33 - 97 = -4z. What are the prime factors of z? 11 Let m be (-3)/2(-32)/6. Suppose 4t - m = 2t. List the prime factors of t. 2 Let p = -6 + -9. Let x = 0 - p. List the prime factors of x. 3, 5 Let w(q) = -q*2 - 6q + 9. Let n(x) = x*2 + 6x - 8. Let b(p) = -6n(p) - 5w(p). Suppose 0 = -3o - 8 - 7. What are the prime factors of b(o)? 2 Suppose a - 12 = -j - 0a, -4a = -4j + 80. List the prime factors of j. 2 What are the prime factors of 12/((-26)/16 + 2)? 2 Suppose w - 6 = -2x + 38, 0 = w - 5x - 44. Let h = 29 - w. List the prime factors of 3/h - 172/(-10). 17 Let q be ((-88)/16)/((-2)/4). Suppose 0 = 15h - qh - 76. List the prime factors of h. 19 Suppose -5i = g - 5g + 2, 0 = -2g - 3i - 10. Let v = 9 + g. List the prime factors of v. 7 Let l(w) = -w*2 + 15w - 8. Let p be l(11). Let f = -18 + p. List the prime factors of f. 2, 3 Suppose -5n + 37 = -63. List the prime factors of n. 2, 5 Suppose 0 = -9z - 178 + 547. List the prime factors of z. 41 Let i be (-6)/9-3 - 5. Let c(q) = q2 + 3q + 4. Let y be c(i). Suppose -yg + 5s = -3, -3g + 2g - 2s + 4 = 0. What are the prime factors of g? 2 Let b(x) = x3 + 5x*2 + 7. Let t be ((-2)/(-2))/((-1)/5). List the prime factors of b(t). 7 Suppose 1090 = 3g - c, -3c = 3g - 7c - 1084. What are the prime factors of g? 2, 7, 13 Let j be -1 + 5 + (-11 - -9). Suppose -43 = -ji - 3n, -5i = -6*n	{ "pile_set_name": "DM Mathematics" }
.41229.437 -491.7748 What is the product of 0.0109 and 548? 5.9732 Calculate 56030.02. 112.06 Work out 0.087 * -256. -22.272 Work out 8821 * 149. 1314329 0.58 * 46.3 26.854 What is 4 times 0.038553? 0.154212 7866-0.33 -2595.78 -0.734279 times -0.1 0.0734279 What is -0.5 times -1668.72? 834.36 What is 111442.1 times 5? 557210.5 -2767 -10 27670 What is the product of 0.2843 and -0.8? -0.22744 Multiply 50 and -16049. -802450 What is -88 times -0.5? 44 Work out 0.033 * -163.9. -5.4087 Product of 32379 and -21. -679959 Work out -6.51 * -4.3. 27.993 Multiply 3718.68 and 0.7. 2603.076 -707 times -4154 2936878 0.117-0.023 -0.002691 Product of 0.117 and -0.7693. -0.0900081 -2-16633 33266 127 * 1005 127635 7.9 times 104.5 825.55 Product of 11823 and -4. -47292 11.59-844 -9781.96 Product of 15731 and 48. 755088 Product of -77 and -0.65. 50.05 Product of 787 and -0.021. -16.527 Work out -136116 0.12. -16333.92 What is -1.97 times 0.21? -0.4137 Product of -1249 and -0.1023. 127.7727 Multiply -2.641 and -0.01. 0.02641 Calculate 20370.22. 448.14 -14.522 -29.04 What is 2992 times 6? 17952 What is -0.02369 times -4.1? 0.097129 Work out -910 * -0.1682. 153.062 What is 0.5 times -53101? -26550.5 What is the product of 141 and 223.4? 31499.4 What is 4 times 8918? 35672 What is the product of 2 and 5707? 11414 Calculate 19-44718. -849642 Product of -1 and 4215. -4215 -3 times -6847 20541 What is the product of -0.1 and 40690? -4069 12 8131 97572 Multiply 385606 and 4. 1542424 -0.5-0.205709 0.1028545 Work out 447.66 0.09. 40.2894 Product of 0.2 and 0.3404. 0.06808 Multiply 0 and 281026. 0 Product of -0.749 and 0.664. -0.497336 What is the product of 0.5 and 9515? 4757.5 Calculate -1-146673. 146673 -808 times 1.42 -1147.36 -3213 26 -83538 Calculate 3282.4930.4. 1312.9972 Calculate -668.610.5. -334.305 1 times -3203.63 -3203.63 What is the product of -0.1 and -196042? 19604.2 Product of -5 and -0.3608. 1.804 Calculate -35128-4. 140512 Calculate -2-111.042. 222.084 What is the product of -0.9077 and -0.51? 0.462927 What is the product of -0.37 and -17733? 6561.21 3 * 2.0358 6.1074 What is -4 times 8470.5? -33882 -2 times -331.3 662.6 -0.190957 -9095.7 What is -115154 times -21? 2418234 What is -793 times -0.621? 492.453 Calculate 8980. 7120 -0.13931 times 0.9 -0.125379 -25-3.1 77.5 Product of 68 and -46.8. -3182.4 455 times 156 70980 What is -293 times -474? 138882 0.16377 60.32 Product of -498.47 and 4. -1993.88 -24523 * 0.1 -2452.3 Product of 13.5 and 118.4. 1598.4 Work out 8111 * 214. 1735754 Product of 5.4228 and -17. -92.1876 -0.0601890.08 -0.00481512 -10670.84-0.1 1067.084 What is 0.2 times -547.903? -109.5806 What is the product of -0.6 and -128283? 76969.8 What is -1.551 times -4? 6.204 Calculate 53984-1.2. -64780.8 Product of 0.139618 and 0.04. 0.00558472 -3 times 17.8 -53.4 Multiply 4 and -16039. -64156 Work out 0 0.0139319. 0 -0.4 times -82705 33082 -0.19459-0.4 0.077836 -28666 0.1 -2866.6 244 * -0.967 -235.948 What is -30034 times -0.062? 1862.108 2729212 578548 Calculate 316.59514. 49.78542 -23481 times -0.04 939.24 Work out -1.613 * -12. 19.356 Work out -748 * 5.535. -4140.18 Calculate -2.693821-3. 8.081463 Calculate -0.111.731. -1.1731 What is -151 times -14.5? 2189.5 0.4 * -1065682 -426272.8 Multiply 14284 and -2. -28568 -0.37 times -3595 1330.15 Calculate 0.12350435. 0.6175215 Product of 0.5 and -36243. -18121.5 Work out 2603 -0.6. -1561.8 -484 * -70.1 33928.4 11.2 * 513 5745.6 Calculate 0.17-12990. -2208.3 -0.1561 times 595 -92.8795 7 -1664 -11648 -1.4 * 945 -1323 -1150 times 0.04 -46 What is -0.1 times 6340? -634 What is -43.7 times 1107? -48375.9 Multiply -5527 and -22. 121594 5206-0.54 -2811.24 What is 379 times 337? 127723 -15 387 -5805 -177 times 1208 -213816 0.5 * -57583 -28791.5 -2-80317 160634 Work out -0.07 -0.0848. 0.005936 1225.914 310.968 129399 -4 -517596 -495791 times -0.2 99158.2 Work out -12435 * -3. 37305 1186 * -0.48 -569.28 0.85652-11 -9.42172 Work out 3.64 1864. 6784.96 What is the product of -286 and -0.215? 61.49 64.18-14 -898.52 Work out -198 -10084. 1996632 -0.01343 times -0.1 0.001343 Work out 9368 * 1. 9368 Calculate 1008-0.41. -413.28 What is 6 times 24.97? 149.82 Calculate 320733-2. -641466 What is 109 times 0.463? 50.467 What is 1202.7 times -3? -3608.1 What is the product of -1 and -176619? 176619 3.81 * 47.8 182.118 -238.83295 -70454.85 Calculate -1094030.29. -31726.87 -0.0284-17 0.4828 Product of 144516 and 2. 289032 Product of -0.04047447 and -0.2. 0.008094894 What is the product of -0.76854 and 0.5? -0.38427 0 times -17.134 0 Multiply 9.6615 and -0.1. -0.96615 6 times 3297 19782 495-37 -18315 Calculate 7-0.3247. -2.2729 What is the product of 376 and 0.8? 300.8 Calculate -0.044656-0.1. 0.0044656 Product of -0.5 and 21004. -10502 -0.4 * -4026 1610.4 Multiply -25 and 0.716. -17.9 Product of -3.3 and -0.00082. 0.002706 What is -2772 times -0.75? 2079 What is 1225 times -1.5? -1837.5 Product of -2.5 and -14.87. 37.175 Work out 0 * -0.1798. 0 Product of 0.01 and -1.926. -0.01926 Calculate -62.25245. -311.262 Product of 4820 and 3. 14460 Calculate -76380-2. 152760 -0.082 * -12 0.984 Multiply -4.4 and 0.0824. -0.36256 What is -7.9 times -13.46? 106.334 Multiply -0.12 and -27.0692. 3.248304 Multiply -3 and 33.795. -101.385 67.7 * 5.4 365.58 What is 0.3 times 5902? 1770.6 0.681-535 -364.335 330.2167 7.1511 129094 * 0 0 What is the product of -1.48999 and -0.18? 0.2681982 14910 * -28 -417480 -3 * -12144 36432 Calculate -4-21032. 84128 What is 7 times 4.4311? 31.0177 What is the product of 75377 and 2? 150754 -98779 -79011 908 * 0.054 49.032 4555.7-8 -36445.6 What is -5607098 times -3? 16821294 What is the product of 0.0547191 and 0.4? 0.02188764 What is 0.2 times -12547? -2509.4 Calculate 1229846. 565708 Calculate 84.95.18. 439.782 Multiply 2.1 and 7991. 16781.1 Multiply -0.2 and -0.0139. 0.00278 -428068 times 9 -3852612 What is the product of -101 and -6010? 607010 Multiply -69 and -0.064. 4.416 0.07-683 -47.81 What is 0.6 times -1.0936? -0.65616 -25125570.1 -251255.7 -0.02 times 8269 -165.38 0.16 153.3 24.528 What is 1413 times -42? -59346 What is the product of -106.5 and -0.15? 15.975 What is the product of -341.2 and 444? -151492.8 -0.5 times 16.951 -8.4755 12500 * 3 37500 3551433 times 4 14205732 Calculate -3229-335. 1081715 -13.478 -19 256.082 What is the product of -9.774 and 316? -3088.584 Work out -57 * 217. -12369 Multiply -1601 and 479. -766879 What is 0.2 times 0.01875? 0.00375 What is -3364 times 0? 0 What is the product of 3 and 371151? 1113453 What is -0.359 times 141? -50.619 Multiply 5 and 10488. 52440 3.2 * 6168 19737.6 -31.649 times 2 -63.298 7267 5082 Work out 1.6 4804. 7686.4 Work out 62 * 2667. 165354 Product of 2.13 and 100. 213 Calculate 199-5210. -1036790 117618 8 940944 22.837-5 -114.185 Product of 0.39 and 96. 37.44 What is -0.3 times 0.126208? -0.0378624 What is the product of -0.4 and -118.9468? 47.57872 Work out -538684 5. -2693420 What is the product of 0.36 and -784? -282.24 Product of -0.3 and -0.0214344. 0.00643032 What is -0.3 times 3.0896? -0.92688 Product of 11.939 and -15. -179.085 What is the product of -0.3 and -0.03855? 0.011565 0.4912 * 509 250.0208 Work out -1118.5 * 0. 0 Calculate -2187062. -437412 Multiply -0.3 and -106860. 32058 811-6.79 -5506.69 -8681 times 0.28 -2430.68 Work out 303278 * -11. -3336058 What is the product of 15 and 0.722? 10.83 -0.078 times 4095 -319.41 Product of -13 and -218. 2834 -113.1231 -26126.1 -14 times -10.9 152.6 What is -7.19 times 103? -740.57 Calculate -0.7-71231. 49861.7 Product of 5.08 and -0.00336. -0.0170688 2.1 * -1552 -3259.2 -10 times 1.7179 -17.179 -0.1253560.02 -0.00250712 Work out 1.40888 -46. -64.80848 What is -625 times -0.1? 62.5 Work out 884 * 0.891. 787.644 Product of -13256 and -27.5. 364540 What is the product of 2 and 6475.4? 12950.8 -2.3705 times 10.4 -24.6532 What is the product of -0.0127 and 334? -4.2418 -0.043 times -0.417 0.017931 Product of 0.714322 and -5. -3.57161 Multiply 13397 and 15. 200955 Product of 145 and 656. 95120 Calculate 1958*67. 131186 0.2 times 3219 643.8 What is 63242 times 3? 189726 What is the product	{ "pile_set_name": "DM Mathematics" }
press 0 + 4h4 - h - 4 + 2 in the form dh*3 + sh + gh4 + f + jh2 and give g. 4 Express i2 - 11 + i*2 - i + 0i*2 + 15 as qi + ui2 + m and give q. -1 Express (-18 - 13 - 63)(2r + 0r - r + 2r - 2r + r + (r - 2r - r)(4 - 3 - 3) + 0r - 2r + 0r) in the form i + wr and give w. -376 Rearrange -a*4 + 7a - 40a3 - 3a*2 + 3a*2 - 1 + 38a*3 to la*3 + ta*4 + v + ra + ka2 and give r. 7 Express x + 4x*4 - x + (4x*4 - 4x*4 + 2x*4)(4 + 3 - 6) - 7x4 + x4 + 30x*4 as ox*3 + ix + wx4 + cx*2 + r and give w. 30 Express -3b - 2b + 1 - 2b*3 + 4b as jb3 + zb*2 + wb + t and give w. -1 Express (-3 + 3 - 2u2)(3u2 + 6u*2 - 3u*2) in the form qu*2 + iu*4 + gu*3 + au + c and give i. -12 Rearrange -3 - z*2 + 2z*4 - 2 + 1 - 2z*3 + 7 to nz + rz4 + az*3 + i + xz*2 and give a. -2 Rearrange (0 - 3 + 0)(0h - h + 3h)(-3 + 1 - 2)(2 - 2 + 2h) to dh*2 + sh + a and give d. 48 Express (2u - 2 + 2)(5u2 - 4u*2 - 3u*2) + (1 - 20u + 18u + u2 + 1)(2u + 0 + 0) as y + nu*2 + vu + lu3 and give n. -4 Express 89z - 1 - 48z - 54z in the form pz + s and give s. -1 Rearrange 9 - 2c*4 - 9 + (-3 - c + 3)(7c3 + 4c*2 - 4c*2) to b + jc + dc4 + zc*3 + vc*2 and give d. -9 Rearrange 6d - 3 + d*4 - 5d + 4 - 3d2 to wd*2 + kd + s + id4 + bd*3 and give k. 1 Rearrange 0c - 2c - c + 11c + 4c - 4c + (-4 - 1 + 3)(0c + 0c + c) to z + sc and give z. 0 Rearrange -11v - 16v - 49v - 14v to dv + o and give d. -90 Rearrange (-2 + 1 - 1)(-b + 4 - 4) + 0 + 0 + b to u + zb and give z. 3 Express 10 - 4n*2 + 19 - 28 in the form kn*2 + b + vn and give b. 1 Rearrange 11f2 + 3f*2 - 2f*2 to tf*2 + o + df and give t. 12 Express 97 - 30g2 - 97 as fg*2 + zg + a and give f. -30 Express -2 - 5f2 + 3f*2 - 1 + 29f*3 - 3f - 26f3 in the form wf + c + hf2 + yf*3 and give c. -3 Express 19h + 8h2 - 20h - 29h - 10h*2 as ah*2 + r + th and give a. -2 Express 10 + 0p3 - 23 - 13p4 + p3 + 11 - p as lp + jp*2 + cp*3 + gp*4 + f and give f. -2 Express -4n + 4n + 5n + (-2n + 2n + 2n)(-3 + 0 + 2) - 5 - n + 5 as hn + p and give h. 2 Express (-2a*2 + 2a*2 - 3a*2 - 2a)(-3 + 0 + 2) in the form xa*2 + za + s and give x. 3 Rearrange -34y3 - 3 + 32y*3 - 5y*4 + 0y*4 + 2y to the form hy3 + py*4 + jy + d + ay2 and give j. 2 Express -5 + 4o + 57 - 2o - o in the form mo + i and give m. 1 Rearrange 9 - 2 - 1 - 4 + 2h2 to nh*2 + ph + u and give n. 2 Rearrange 5p3 + 3p*3 - 9p3 - 4 - p3 + 2p2 + 3p*4 to the form bp + l + jp3 + sp*4 + yp*2 and give s. 3 Rearrange 13q + 5q + 13q + 20q to yq + g and give y. 51 Rearrange 28m + 5 - 3 - 3 to the form cm + d and give d. -1 Rearrange (-3c - 4c*2 + 3c)(1 - 5 + 3)(-c + 4 - 4) to the form oc + gc*3 + wc*2 + z and give g. -4 Rearrange -10h + 13h - 6h + (3h - 4h + 2h)(-2 + 6 - 2) to the form dh + c and give d. -1 Express (2 - 5 + 1)(-5x + 2x - x) + 3 - 3 + x + 8x - 2x - 2x + (4 - 4 + 3)(-4 + 4 + 4x) in the form n + dx and give d. 25 Express -3 + 5 + 21d - 2 + 3 - 2d*2 as s + fd*2 + gd and give f. -2 Express (-3 + 0 + 1)(-g2 + 0 + 0) - g2 + 0g + 0g + 3g*2 - 24 + 24 - 2g*2 + 3g*2 - 4g*2 in the form mg + o + xg2 and give x. 1 Rearrange (2u*3 - 2u*3 - 2u*3)(-2u - 2u - 3u)(3 - 3 - 2) to the form hu + l + ou*3 + cu*4 + fu*2 and give c. -28 Rearrange -68c + 70c - c3 - 5c*3 + 2 to zc*3 + lc*2 + jc + t and give z. -6 Rearrange (3 + 1 - 3)(-2 - 22l + 13l + 8l) to sl + m and give m. -2 Rearrange -16 - 20 - 43 + s - 2s to the form n + ls and give l. -1 Express -k + 2 - 1 + 3k*4 + 4k - 5k - k2 in the form vk*3 + hk*2 + fk + jk4 + a and give h. -1 Rearrange (-z - 4 + 4)(-808z3 + 116312 - 116312) to c + vz*3 + jz*2 + pz + dz4 and give d. 808 Rearrange 2z*2 - 7z*2 + 4z*2 + (-5z - 3 - 5 + 9)(5z + 14 - 14) to sz2 + d + tz and give s. -26 Rearrange p*2 + 27p - 63p + 29p to kp2 + z + fp and give k. 1 Rearrange (3 + 2s - 3)(-4s - s + 6s - 4s - 3 + 3 + (s + 0 + 0)(-1 + 4 - 4)) to the form r + ds + ps*2 and give d. 0 Rearrange (-2h + 2h + h2)(1 - 16 - 43 + 137) to x + yh + ch*2 and give c. 79 Express (11 - 2 - 2)(z + 0z + 0z + 0z - z + 2z + 1 - z - 1 + (-2 + 2 - z)(0 + 1 - 2) - 4z + 5z + 0z - z - z + 3z - z + 7 - 7) as cz + o and give c. 21 Rearrange -2g + 3g + 2g + 7g to r + lg and give l. 10 Express -12 - 7k*2 - 3 + 15 in the form f + ak + yk2 and give y. -7 Rearrange (2f - 2f + f3)(0f - f - f)(37 - 51 - 75) to gf + hf*3 + tf*2 + af*4 + w and give h. 0 Rearrange (3r - 3r - 10r)(3r - r + 0r) + (0 - 5 + 3)(-r + 2r2 + r) to the form lr*2 + m + tr and give l. -24 Rearrange -5q + 15q - 3q + 18q to b + jq and give j. 25 Express (3u - 2u - 2u + (3 - 1 + 0)(4u - 2u - 3u) + (1 + 1 - 3)(2u - u - 2u) + 3u + 6u + u)(4u + 5 - 5) as p + lu + qu2 and give q. 32 Express (3 + h - 3)(0h + 0h - 2h2) - 1 - h3 + 3 - 1 + 4h*3 - 8h*3 - 5h*3 as fh + bh3 + x + rh*2 and give x. 1 Express -y - 1 - 37y*3 + 16y*3 + 18y*3 in the form qy*3 + ny + a + py2 and give a. -1 Rearrange 4 + 2x - 13x3 + x - 5x + 4x3 to ox + yx2 + px*3 + q and give q. 4 Express (-6g + 0g + 3g)(g2 + 112g + g*2 + 2 - 110g) as kg + vg*3 + i + og*2 and give k. -6 Express 1 - 7a - 17a + 24a + 10a2 in the form ya + xa2 + m and give m. 1 Rearrange 3s + 0s2 + s2 + 0s to z + is + ns2 and give n. 1 Rearrange -l4 + 0l3 + 3l*3 + 11l + 4l - 2l*3 to the form bl*4 + kl*3 + jl*2 + g + zl and give z. 15 Rearrange (-4j2 + 2j*2 + 3j*2)((0 + 1 - 2)(-2 - 2 - 1) + (-1 + 5 - 2)(0 + 5 - 4) + 3 - 4 + 4) to the form a + mj2 + fj and give m. 10 Express (-247w + 20 + 124w + 121w)(2w2 - 3w*2 + 2w*2) in the form bw + gw3 + tw*2 + d and give b. 0 Rearrange -5r - r + 14r - r3 to the form nr + gr3 + zr*2 + s and give n. 8 Rearrange -2v*2 + 2v*3 + 2v*2 + 0 + 0 + 2v*3 + (-5 + 1 - 1)(v*3 - 2v3 - v3) to the form av3 + p + wv + zv2 and give a. 14 Rearrange -14d + 8d + 4d + 17 to the form jd + g and give g. 17 Express 3 + 4 + h3 - 16h + 16h as ch*2 + s + nh*3 + th and give s. 7 Express (0g - 5g + 3g)(0g - 2g + 4g) - 52 + 52 + 44g*2 + 3g*2 + 3g*2 - 4g*2 in the form jg*2 + bg + u and give j. 42 Express 5 - 3 + 2o2 - 2o*3 - 2 in the form to*3 + x + mo + go2 and give t. -2 Rearrange (-1 - 2 + 4)(3 - 3 + 17i) - 2i + 5i - 4i to the form p + bi and give b. 16 Rearrange (2 + 52 - 11)(1 - 1 + a)(2a + 3a - 3a) to the form ta + ba*2 + i and give b. 86 Express 7l*4 - 2l*2 - 2l*4 - 4l*3 + 32l - 34l as xl*2 + il*4 + ol*3 + n + sl and give o. -4 Rearrange 8v + 0v2 - v2 - 8v2 - 7v to the form nv + kv*2 + p and give k. -9 Express -4g*2 - 4g*2 + 4g*2 - 5g*2 as cg + x + ug2 and give u. -9 Express -15s - 5s2 + 4s*2 + 24s + (s + s - 4s)(0s + 0s - 2s) as us + r + ys2 and give u. 9 Express -3a*4 + 2a*3 - 1 + a + 4a*4 - 2a*4 in the form pa*4 + g + sa*2 + ba*3 + za and give g. -1 Express 1 - 1 + l*2 + (-2 + 3 + 2)(0l2 - 3l*2 + 2l*2) + (-l + l - 4l)(-4l - l + 4l) as kl + rl2 + j and give r. 2 Rearrange -z2 + 25 + 298z - 147z - 152z + (2z + 3z - 3z)(-4z + 3z + 5z) to the form p + az + mz2 and give p. 25 Express (1 - 1 + 2)(2d3 - 2 + 2) + 3d*3 + 3d*3 - 7d*3 + 2d*2 + 2d*3 + 0d*3 + 0d*2 as kd*2 + gd*3 + m + ud and give k. 2 Rearrange 29c - 29c + 28 + 18 + c*2 to vc + fc2 + z and give v. 0 Express (m + 0m + 0m + (m + 4 - 4)(-3 + 2 + 0) + 13m - 2m - 4m)(3m - 2m - 3m) in the form tm + nm2 + x and give n. -14 Rearrange -5 + 5 + g + (2 - 2 + 3)(-5g + 3g + g) to y + bg and give b. -2 Rearrange (p + p + 0p)(14p + 7p - 20p - 5) to qp2 + dp + g and give q. 2 Express (8g + 1 + 4g - 17g)(-4g + g + 2g)(0 - 4 + 2) in the form jg*2 + u + ag and give j. -	{ "pile_set_name": "DM Mathematics" }
et k be 2 + 2/(12/(-15) + 0). Suppose -14 = -4t + 6. Which is the closest to k? (a) t (b) 1/7 (c) 0.3 b Let i be 6/(-21) - (-52)/(-14). Suppose 0 = 3z + 42 - 27. What is the closest to 0.1 in 5, z, i? i Let i = -38 - -35. Let p = -0.62 - -0.61. Which is the nearest to p? (a) i (b) -2/7 (c) -1/6 c Let q(p) = -2p - 1. Let j be q(1). Let u = 16.45 - 16. Let n = 0.05 - u. Which is the nearest to 3? (a) n (b) j (c) -0.1 c Let i = 33.487 + 0.613. Let h = i + -34. Let u = 0 - -0.1. Which is the nearest to u? (a) h (b) -0.1 (c) 4 a Let w = 6.1 - 6. Let f be (-56)/(-3)(-90)/(-8). Let q be 6/10 + (-91)/f. Which is the closest to w? (a) -5 (b) 1/2 (c) q c Let y = -709/2145 - 2/715. Which is the nearest to y? (a) 0 (b) -2.4 (c) 0.4 (d) 4/3 a Let t = -261/469 - 1/67. Which is the closest to 2/3? (a) t (b) 1/9 (c) 4 (d) -0.5 b Let o(v) be the first derivative of v*2 + 45v - 14. Let n be o(-19). What is the nearest to 1 in 0.1, n, -0.5? 0.1 Let h = -2 + -4. Let f = h - -8. Let p = 135 - 134.9. Which is the nearest to -1? (a) f (b) -6/5 (c) p b Suppose 5m - 19 = -39. Let f be 2/((-2)/m(-20)/5). Which is the nearest to f? (a) 0.5 (b) 0.1 (c) 3 b Let o(w) = -w*3 - 3w*2 + 6w + 5. Let v be o(-4). Let q = 6629.1 - 6629. Which is the closest to v? (a) 3/7 (b) 5 (c) q c Let y = -965.4 - -965. Let w(z) = z*2 - z - 3. Let r be w(2). What is the nearest to r in 0.5, y, -0.5? -0.5 Suppose 3y + 12 = -3i, 3y + 0y + i = -8. Which is the closest to 0? (a) y (b) -7 (c) -2/7 c Let y be ((-30)/(-25))/2 - 9/(-10). Which is the closest to -0.3? (a) -2/11 (b) y (c) 0 a Let o(j) = -7j + 5. Let f be o(3). Let m = -20 + 3. Let u = m - f. What is the nearest to 0 in -2/7, u, 3? -2/7 Let d(o) = o*3 - 29o*2 + 28o + 2. Suppose -j - 2j + 3g + 84 = 0, 0 = g. Let n be d(j). Let a = 48 - 289/6. What is the nearest to -0.1 in a, n, -2/5? a Suppose 0 = 2q + 4h - 26, 20 = 4q + 4h - 12. Suppose -5j - 2 + 12 = 5i, j + 4 = -qi. Which is the nearest to 1? (a) j (b) -4 (c) 7 a Let b = 59 - 30. Let y = 29.3 - b. What is the nearest to 3 in -3, 4, y? 4 Suppose 0 = 4q + 2g + 304, -g + 88 = -q + 15. What is the nearest to 0 in q, 5, -1/4? -1/4 Let z = 0.52 - 3.52. What is the nearest to 2 in -2/7, -1/7, 0, z? 0 Let k = -2.08 - -1.68. Let p(z) = -22z2 + 1. Let r be p(1). What is the closest to -1 in k, r, -3? k Let i(q) = q2 - 8q + 11. Let y be i(5). Which is the closest to y? (a) 7 (b) -0.5 (c) -0.2 b Let x = 451.3 - 451. Which is the nearest to -0.1? (a) -2/7 (b) -2 (c) -4 (d) x a Let q = 30.3 - 29.9. Which is the nearest to 0? (a) q (b) -0.04 (c) 0 c Suppose 2g = 3q - 4q + 22612, 5g - 45226 = -2q. Let u = q + -135347/6. Let n = u - 50. Which is the nearest to -1? (a) -0.5 (b) 0.2 (c) n a Let p = -0.667 - -0.097. Let n = p + 0.67. What is the nearest to -2/5 in 2, 2/7, n? n Let o = 0.77 - 0.27. Let x = 202.1 + -202. Let z = -2.05 + 0.05. What is the nearest to x in o, z, 5? o Let o = 23.4 + -23. Let v be (3/4)/((-3)/(-1)). Let m = -4 - -1. What is the nearest to 0 in o, m, v? v Let r = -0.19 - -1.19. Let i = r - 0.9. Let l = -1.7 + 2. Which is the closest to i? (a) 0.2 (b) l (c) 4 a Let w = 162.8 + -163. Let y = -217/4 + 54. What is the nearest to w in y, 2, -0.4? y Let y be (5 - (-980)/(-176)) + 6/8. What is the nearest to -1 in y, -1/5, -0.5? -0.5 Let t(o) = o - 19 - 21 - 14 + 49. Let u(j) = j*2 + 8j + 7. Let w be u(-7). Let m be t(w). What is the closest to 2/3 in 1, 0.3, m? 1 Let u = -9.75 - -10. Let y = u - -17.75. Which is the nearest to y? (a) -0.4 (b) 2 (c) -3 b Let r(t) = t*3 - 14t*2 + 14t - 13. Let z be r(13). Suppose 0k - 2k + 16 = z. Let s = k - 9. Which is the nearest to s? (a) 0.5 (b) -2/7 (c) 0 b Let r(s) = -6 - 5s + 5 + 3s. Let l be r(0). Let v be 15/(-12) - (l - 0). Which is the closest to 0? (a) -5 (b) v (c) -3 b Let c = -2/13 - -66/91. Let w = -17/66 - -1/11. Let d be -5 - ((-87)/9 + 5). What is the nearest to 0 in c, d, w? w Let w be 46 - 58 - 23/(-2). Which is the closest to 1? (a) -1/3 (b) 0.4 (c) w (d) -1 b Let f = 1.7 + -1.7. Let m be 52/(-6)(-3)/(-2). Let l = 4 + m. What is the nearest to f in l, 1/2, 0.1? 0.1 Let s = -25/16 + 13/16. Suppose 5x = -3l - 64 - 112, 2x + 4l = -62. Let k = x - -42. What is the nearest to 2/3 in k, s, 4? s Let l = -1.84 - 2.16. Which is the nearest to l? (a) -4 (b) -3 (c) 0.07 a Let d = -0.1 + -0.4. Let t = -0.585 + 5.585. Which is the closest to -0.1? (a) 2 (b) t (c) d c Suppose 59h + 13 = 46h. Let g be (-14)/(-4) + (-2)/(-4). Suppose -gk - k = 15. Which is the closest to h? (a) -1/5 (b) k (c) -5 a Let a = -4.993 + 0.233. Let k = a + -0.24. What is the nearest to -2/5 in 1/7, k, -3? 1/7 Let v = -7816 - -101512/13. Let u = -1030/143 - v. Let q = 6 + -11. Which is the nearest to -1/2? (a) -1/8 (b) u (c) q a Let v be ((-32)/10)/((-3)/(-15)). Let h(x) = -x - 13. Let z be h(v). Let y be (z/(-7))/((-12)/(-8)). Which is the closest to -0.2? (a) 0.02 (b) y (c) -0.2 c Let j = -4.1 - -3.89. Let c = -0.19 + j. Let g = -0.1 + 0. What is the nearest to g in -5, c, -4? c Let n = -1.24 - 69.76. Let b = 71.4 + n. What is the closest to b in 4/3, -5, -1? 4/3 Let y = 0.274 + -0.374. Which is the nearest to 1? (a) y (b) 0.031 (c) -1 (d) -4 b Let w = -0.274 - -0.214. Which is the nearest to -3/4? (a) 20 (b) -5 (c) w c Let x = 2.8 - 2.74. What is the closest to -0.1 in 0.4, -0.03, x? -0.03 Let y = -234 + 234. Which is the closest to -0.1? (a) 5 (b) 2 (c) y c Suppose -3h + 2d + 12 = 5, -5d = -2h + 23. What is the closest to -2 in h, 18/13, 4? h Let n = 11.9 - 10.9. Let v = 15 + -17. What is the nearest to n in -3/4, v, 2? 2 Let d = -2 + 2. Let k = 63.8 - 3.8. Let f = -60.3 + k. What is the nearest to d in -5, f, -4? f Suppose -76a = -69a - 112. What is the closest to -2/5 in 2, a, -0.5, -0.2? -0.5 Let t = 3.83 + -6.83. Which is the closest to -16? (a) t (b) -0.3 (c) -0.5 a Let v = -293 - -291. Let y = -5 - -5.1. Which is the closest to y? (a) -5 (b) v (c) 4 b Let u = 2.7 + -2.7. Let d = -8 - -65/8. What is the nearest to 1 in d, u, 0.2? 0.2 Let k(p) = p*2 + 18p - 15. Let x be k(-7). Let m be 1/((-22)/x) + (-4 - 0). Which is the closest to 1? (a) -0.5 (b) m (c) 5 b Let d = 94/29 - 412/145. What is the closest to 3 in 0.3, d, 1.89? 1.89 Let h = -38.9 - -39. What is the nearest to -0.1 in 5, 2, 0, h? 0 Let b = -0.038 + -0.007. Let t = 0.065 + b. What is the closest to -1/2 in t, 3/2, 0? 0 Let h = 18 + -14. Let q = 23 - 23.5. What is the nearest to 0.2 in q, 2/3, h? 2/3 Let b be 2(-7)/(-10) - (-8)/(-8). What is the nearest to 9/7 in 3/5, b, -3? 3/5 Let c = 0.16 - 1.26. Let d = -0.6 - c. Let l = 2 + -2.1. What is the closest to -0.2 in l, 0, d? l Let o be ((-8)/15)/((-132)/18 - -5). Let z = 11/5955 - 37805/91707. Let a = z + o. What is the closest to -11 in 3/7, a, -5? -5 Let t = -26 + 79/3. What is the closest to 1 in 6, -0.2, t? t Let l = 1627.5 + -1627. Let i = 277/315 - 5/63. Which is the nearest to -0.2? (a) l (b) -1/7 (c) i b Let l = 0.269 + -38.069. Let x = -1.37 + 39.37. Let s = x + l. What is the nearest to -2/3 in s, 5, -0.5? -0.5 Let r be 2/(-3)(-81)/117. What is the closest to -1 in 1, 0.1, r? 0.1 Let u = 13.93 - 14. Let c = u - -0.47. Let d = 20 - 21. What is the closest to -1 in d, c, 2? d Let l = 818.5 - 819. Which is the closest to -3? (a) 2 (b) l (c) 0.05 b Let u = 0.63 + -0.23. Suppose 3w - 8w + 7 = j, j - 4 = -2w. Let p be (w/5)/(1 + -2). Which is the nearest to u? (a) -3 (b) p (c) -1 b Let g = 6674 - 6663. Suppose 4l - 2 = -6. Which is the closest to -1? (a) l (b) 3 (c) g a Let x = 59.61 - 9.61. What is the nearest to 2 in -2, 3/2, x? 3/2 Let s be (-1)/3 + 4/3. Suppose -w = -n - 5, -3n + 2w + 2 = 14. What is the nearest to s in 5, -3/8, n? -3/8 Let i = -31.57 - -0.57. Let u = -31 - i. What is the nearest to 2/7 in u, 4, -1? u Let v be (36/(-162))/((-8)/(-12)). Which is the nearest to 0? (a) 1 (b) 2/9 (c) 0.2 (d) v c Let b = -0.2 + -0.8. Let q = -413806 - -16136413/39. Let z = 155/3 + q. What is the nearest to 0.2 in z, -3, b? z Let o be (-14)/(-21) - (-56)/(-12). Which is the nearest to -2/7? (a) -0.1 (b) 5 (c) 0.09 (d) o a Let h = 20 + -163/8. Let g b	{ "pile_set_name": "DM Mathematics" }
255 - k*5/17 + 31k*4/102 - 10k*3/17 + 311k. Factor s(f). 2f(f - 5)(f - 3)(f - 2)/17 Let c(f) = -f*2 - 2f + 2. Let t be c(-2). Suppose -2r - r + ta = 8, 2r - 12 = -3a. Determine w, given that r - 3/7w2 + 0w + 1/7w3 = 0. 0, 3 Let a(p) = p5 - p4 + p2 - 2p. Let y(x) = -9x5 - 42x*4 - 234x*3 - 342x*2 - 135x. Let t(l) = -6a(l) - y(l). Factor t(q). 3q(q + 1)2(q + 7)*2 Let h(a) be the first derivative of 0a*2 + 0a*5 + 2/15a*6 + 5 - 1/4a*4 + 1/6a*3 + 5a. Let j(g) be the first derivative of h(g). Factor j(r). r(r + 1)(2r - 1)2 Let w = 34 - 32. Factor -mw + 2 - 7m*2 - 14 + 5m*2 - 12m. -3(m + 2)2 Suppose -2w + 0w + 4 = -4m, 0 = -w + 3m + 1. Suppose -2g = -2 - w. Factor -5r + 5r - 3rg + 12r*4. 3r*3(4r - 1) Let b(y) be the first derivative of -y3/6 - 26y*2 + 105y/2 - 54. Determine w so that b(w) = 0. -105, 1 Let x(q) be the third derivative of q8/30240 - q6/3240 + q*4/4 + 15q*2. Let t(r) be the second derivative of x(r). Factor t(u). 2u(u - 1)(u + 1)/9 Let j(d) = d*3 - 8d*2 + 10d - 17. Let k be j(7). Let z(m) = -9m2 - 34m - 25. Let w(b) = -26b2 - 101b - 75. Let l(a) = kw(a) - 11z(a). Factor l(t). -5(t + 1)(t + 5) Let d(a) = 8a2 - 5a + 3. Let p(o) = -65o2 + 40o - 25. Let c(s) = -6s + 41. Let z be c(11). Let q(f) = zd(f) - 3p(f). Suppose q(v) = 0. Calculate v. 0, 1 Factor 64 - 12p - 24p3 - 40p - 12p + 34p*3 + 2p*4 - 12p*2. 2(p - 2)(p - 1)(p + 4)*2 Let o(y) be the second derivative of -23y + 0 + 0y2 + 1/70y*5 + 1/21y*4 + 0y3. Solve o(w) = 0. -2, 0 Let i(p) be the second derivative of -p5/120 + p*4/4 - 3p*3 - 7p*2 - 3p. Let u(m) be the first derivative of i(m). Factor u(t). -(t - 6)2/2 Let v(t) be the first derivative of -t5 - 15t4/2 + 40t*3/3 + 15t*2 - 35t - 412. Find s such that v(s) = 0. -7, -1, 1 Let v(l) be the third derivative of 25l2 + 0l*3 + 0 - 11/360l*5 - 1/24l*4 + 0l. Find m such that v(m) = 0. -6/11, 0 Let v(t) be the third derivative of -t*5/15 - 13t*4/6 - 44t*3/3 - 224t*2. Factor v(q). -4(q + 2)(q + 11) Let j(u) = -40u*5 - 4u*4 - 8u*3 + 7u*2 - 2u4 - u3 - 3 + 44u5. Let c(a) = a3 - a2 + 1. Let z(x) = 3c(x) + j(x). Let z(t) = 0. What is t? -1, 0, 1/2, 2 Let o(l) be the third derivative of l*5/48 - 35l*4/24 + 45l*3/8 + 55l*2. Factor o(v). 5(v - 27)(v - 1)/4 Let s(d) be the second derivative of d5/40 + 3d4/16 - d3 + 12d2 + 19d. Let l(u) be the first derivative of s(u). Factor l(p). 3(p - 1)(p + 4)/2 Let a = -12265 - -12265. Factor -2j2 + 8/5j*3 + a + 2/5j. 2j(j - 1)(4j - 1)/5 Suppose -6o + 4o = 4s - 8, 0 = o + 3s - 5. Find x, given that -2x2 + 95x - 37xo + 30 + 4x*2 = 0. -2/7, 3 Let j = 600 + -91801/153. Let q = j + 311/765. Suppose -qu*2 + 0u + 2/5 = 0. What is u? -1, 1 Suppose 5b - 13 = f, -b + 2 = f - 3. Let h be f/8 - 71/(-4). Factor 12i + 8i3 - 5 + 0 - hi*2 + 3. 2(i - 1)*2(4i - 1) Let t(m) be the second derivative of -2m*7/147 + 8m6/105 - m5/35 - 10m4/21 + 8m*3/21 + 16m*2/7 - 121m. Factor t(x). -4(x - 2)3(x + 1)*2/7 Let y(k) be the first derivative of 10k*3 - 13k*2 - 4k + 13. Solve y(n) = 0 for n. -2/15, 1 Suppose 2/5h2 + 0 - 144/5h = 0. Calculate h. 0, 72 Let k be (-56)/(-84) + 26(-4)/(-24). Factor 1/4l - 1/6l2 - 1/6l*3 - 1/12 + 1/4l*4 - 1/12lk. -(l - 1)4(l + 1)/12 Let b(x) = -x3 + 19x*2 + x - 16. Let m be b(19). Factor 3/7w*m + 3/7w*2 + 1/7w + 1/7w4 + 0. w(w + 1)*3/7 Suppose 3/4s*3 - 15/4s*2 + 15/4 - 3/4s = 0. Calculate s. -1, 1, 5 Let j(v) = v*3 + 3v*2 + v + 2. Let n be j(-3). Let i be 3 - (1 - 2)n. Determine k so that -5k2 + 15k + 5k2 + 3k*i + 12 - 3k = 0. -2 Let j(l) be the third derivative of 19l7/840 + 69l*6/160 + 217l*5/120 - 61l*4/8 + 3l*3 - 96l2. Suppose j(x) = 0. What is x? -6, 2/19, 1 Let b(i) be the second derivative of -i6/3960 + i*5/220 + 2i*3 - 18i. Let p(q) be the second derivative of b(q). Factor p(o). -o(o - 6)/11 Let d = -304 + 306. Let q(g) be the first derivative of 1/2g*d + 6 - 1/9g*3 + 4/3g. Let q(z) = 0. Calculate z. -1, 4 Let b(q) be the third derivative of 4/75q5 + 4/15q*3 - 1/150q*6 + 0q - q*2 + 0 - 1/6q*4. Factor b(d). -4(d - 2)(d - 1)2/5 Suppose -4t = 76 + 32. Let l be (3/t)/(18/(-216)). Solve 4/3v3 - lv - 1/3 + 1/3v2 = 0. -1, -1/4, 1 Let h(b) be the second derivative of -1/9b*3 - 1/30b*5 - 1/9b*4 + 0 + 0b*2 + 11b. Find r, given that h(r) = 0. -1, 0 Let o(a) be the third derivative of -a8/336 + a7/56 - a*6/36 + 3a*3 - 17a*2. Let p(g) be the first derivative of o(g). Factor p(k). -5k*2(k - 2)(k - 1) Let v(u) be the second derivative of u6/30 + u5/10 + u4/12 + 19u - 1. Suppose v(c) = 0. Calculate c. -1, 0 Determine j, given that 13j2 - 36j - 27j2 - 56 + 10j*2 = 0. -7, -2 Let a(l) be the first derivative of 3l6/40 - l5/8 - l*4/2 - 23l*3/3 + 9. Let s(o) be the third derivative of a(o). Factor s(m). 3(m - 1)(9m + 4) Let y(a) = a*2 + 2a - 3. Suppose 5b = -2c - 0c - 26, 2b + 11 = -c. Let i be y(b). Let 4ji - 4j*3 - 2j*4 + 14j*4 - 12j*5 = 0. Calculate j. 0, 1/2, 1 Suppose 0 = 7c - 12c + 10. Determine y, given that -4y - 5yc - 3y + 22y - 5y = 0. 0, 2 Suppose 0 = 2g - 2 - 2. Determine j, given that gj*2 + 0j + j*2 - j + 0j = 0. 0, 1/3 Suppose 180y = 178y + 10. Let w(s) be the first derivative of 1/2s4 - 3s*2 + 0s*3 - y - 4s. Factor w(u). 2(u - 2)(u + 1)2 Let z(n) be the first derivative of -n4/4 - 20n3/3 + 4n + 7. Let j be z(-20). Determine p so that 4/3p2 + 8/3 - jp = 0. 1, 2 Let 0r2 + 0 + 0r + 6/11r3 - 6/11r*4 = 0. Calculate r. 0, 1 Suppose 19 = 2k + 5j, -4k + 12 = 3j - 5. Solve -15o*2 + 19o*k - 7o2 + 12 = 0 for o. -2, 2 Let d(o) be the second derivative of o4/6 - 11o3 + 62o*2 - 10o. Let d(j) = 0. What is j? 2, 31 Let y = 14 - 4. Suppose -4l - y + 18 = 0. Determine m, given that -3/2m + 3/4m4 + 0m*l + 3/2m*3 - 3/4 = 0. -1, 1 Find r, given that -59402r - 4r3 - 1308r*2 + 136141 - 33417r - 2148022 - 3168235 - 49753r = 0. -109 Let t(c) be the third derivative of 35c*6/24 + 13c*5/3 + 5c*4/2 - 9c*2. Suppose t(n) = 0. What is n? -6/5, -2/7, 0 Solve 0c*4 + 3/4c*5 + 9c + 0 - 27/4c3 + 3c*2 = 0 for c. -3, -1, 0, 2 Let d(j) = 3j - 13. Let c be d(5). Factor 7r4 + 5r - 3r4 + 4 - 5r - 8rc. 4(r - 1)*2(r + 1)*2 Let l(d) be the first derivative of -5d*3/3 - 310d*2 - 19220d + 441. Factor l(x). -5(x + 62)2 Factor -7f*3 - 48f - 2f2 - 34f*2 + 210f + 3f3 - 216 + 6f*3. 2(f - 12)(f - 3)2 Let z(m) be the second derivative of m5/25 - 6m*4/5 + 64m*3/15 - 4m + 2. Find w such that z(w) = 0. 0, 2, 16 Solve -2/11k2 - 88 + 8k = 0. 22 Let v = 23001 + -22999. Factor -2/9iv + 0 + 0i - 8/9i3. -2i*2(4i + 1)/9 Let f(z) be the first derivative of 0z - 1 + 1/2z3 + 3/2z*2. Solve f(g) = 0. -2, 0 Factor 4c*3 + 207 - 85 - 52c*2 - 132c + 58. 4(c - 15)(c - 1)(c + 3) Suppose 3a - 21 = 3d, 0d - 2d = -3a + 18. Let h be 15/10 + 2/a. Suppose s*3 - s + 7/2s*h - 7/2s4 + 0 = 0. Calculate s. -1, 0, 2/7, 1 Let s(d) be the first derivative of d3/3 + 15d2/2 + 26d + 94. Let y be s(-13). Factor -1/2h2 + yh + 0 - 11/4h3. -h2(11h + 2)/4 Let u(p) be the first derivative of 231852p*3 - 3336p*2 + 16p + 392. Solve u(b) = 0 for b. 2/417 Let r(k) = 0k + 0k - 2k + k4 + k5 + k2 + 0k + 4 + k3. Let n(m) = m5 + 2m4 + m2 - m + 4. Let d(c) = 6n(c) - 7r(c). Factor d(f). -(f - 2)2(f - 1)*2(f + 1) Let h(g) be the first derivative of 3/2g4 - 21/16g2 + 3 + g3 + 3/8g. Factor h(r). 3(r + 1)(4r - 1)2/8 Let g(v) be the second derivative of v6/40 - v5/10 + v4/8 + 5v2 + 9v. Let u(t) be the first derivative of g(t). Factor u(f). 3f(f - 1)*2 Let u(x) = -x - 5. Let n be u(-8). Let t(r) = 12r - 20. Let v be t(2). Find i, given that -i3 + iv + 0i2 + 3i - 6i2 + 2i - 2 + ni2 = 0. -2, 1 Suppose -205h = -204h - 126. Let m be (-10)/(-3)(-27)/h-7. Factor 4/9k*4 + 2/9k**m - 4	{ "pile_set_name": "DM Mathematics" }
. a, 1, 0.3, -2 Let a be 16/(-7) - (-552)/56. Put a, -23, 3 in increasing order. -23, 3, a Let r be ((-6)/(-10))/(13/390). Let h be ((-9)/(-3))/(r/(-24)). Suppose 48y - 53y = 0. Sort y, -1, h in ascending order. h, -1, y Let k(b) = 12b + 10. Let d be k(-2). Let p = 145 + -145. Put -2, -1, d, p in ascending order. d, -2, -1, p Let x = -349 - -350. Let z be 11/(-2) + 10/(-20) + x. Sort z, 23, -1, 4. z, -1, 4, 23 Let b = -0.1678 + 0.8868. Let n = -0.219 + b. Put -0.64, 3, n, 4 in increasing order. -0.64, n, 3, 4 Let f = -6 + 6.3. Let n = -0.2 + f. Let g = -1/338 + 1021/2366. Put g, 0.4, n in decreasing order. g, 0.4, n Suppose -4h = 3q + 11, h = -q - 4q - 7. Let f = -3 - 1. Let i = 15754 - 15759. Put 3, i, f, q in descending order. 3, q, f, i Suppose 3l - 2s - 4 = 0, s + s = l - 8. Suppose -155k + 171k = 0. Let r(t) = -6t + 1. Let m be r(-1). Put m, k, l in ascending order. l, k, m Suppose 0 = r + 2r + 12. Let w be 10 + (7 - 24) - -7. Let m = -1 - -3. Put r, w, m in increasing order. r, w, m Let i = 104 - 53. Let l = 46 - i. Let z = -1 - -0.7. Sort -2/15, l, z. l, z, -2/15 Let b(d) = -d2 + 2d + 4. Let n be b(4). Suppose 4233s - 288 = 4201s. Sort 4, s, 0, n in decreasing order. s, 4, 0, n Let o = -98.07 - -2.07. Let c = -12.47 + -85.53. Let a = o - c. Put 2/7, a, -3 in decreasing order. a, 2/7, -3 Let z be ((-14)/10 - 6/(-15))(-10 + 7). Put -1, -4, -63, -3, z in ascending order. -63, -4, -3, -1, z Let o = -2926 + 2851. Put o, -4, -2, -5, 5 in decreasing order. 5, -2, -4, -5, o Let j = 168 + -217. Suppose r = -5h - 270, 3h + 3r + 162 = 2r. Let w = j - h. Sort w, 0, 10 in descending order. 10, w, 0 Let q = 264 + -263.343. Let t = q - 5.657. Suppose 0v = -4v + 20. Put 1/7, t, 0, v in increasing order. t, 0, 1/7, v Let g be 1 + -1 + -46(14 + -15). Suppose 71 = gk + 25. Suppose 0 = -5w - 13 - 2. Sort -2, 3, k, w. w, -2, k, 3 Let d = 16.833 + 6875.167. Put d, 0.3, -2 in descending order. d, 0.3, -2 Suppose -4z + 2q - 3 + 1 = 0, 0 = 2z - 2q + 6. Suppose zl + 4 = 3g + 7, -2l + 2 = -4g. Put g, -1, -36 in increasing order. -36, -1, g Suppose 2k - 4k = -5y - 355, -2y = -2. Suppose -22g + 17g + k = 0. Let z = 36 - g. Sort 2/5, 0.3, z, 6/7 in decreasing order. 6/7, 2/5, 0.3, z Let g = -6.76 - -8.76. Put 10, -6, g in ascending order. -6, g, 10 Let z = 115 + -115. Let u = -0.382 + 0.602. Put z, 0.1, u, -1 in decreasing order. u, 0.1, z, -1 Let v be (-77)/1424/(-33). Suppose 2n = -5n + 7. Put -3, 0, v, n in decreasing order. v, n, 0, -3 Let s be 8/(-6) - 115/(-30). Let z(t) = t3 - 10t*2 + 26t - 82. Let k be z(8). Sort -0.1, s, k. k, -0.1, s Let y be (1/9)/(((-138)/9)/(-46)). Sort y, -4, 0, 0.26 in decreasing order. y, 0.26, 0, -4 Let a = 0.349 - -24.251. Let j = -25 + a. Put j, -0.2, 23, -0.1 in increasing order. j, -0.2, -0.1, 23 Let n = 113 - 112.941. Let y = n + -0.079. Sort y, -1/5, 4 in ascending order. -1/5, y, 4 Let y(l) = -2l3 - 27l*2 + 12l - 23. Let n be y(-14). Let r = 11 - 7. Suppose 0 = -5m - 2v - 8, 3m + 2m + v + r = 0. Sort n, m, -6 in decreasing order. n, m, -6 Suppose 0 = -a + 1, -3l + 4a - 30 = -38. Suppose -3h + l = 1. Put h, -5, 0 in ascending order. -5, 0, h Suppose -15q - 3 - 72 = 0. Let j be -3 + (72/29)/1. Let v = j - -192/203. Sort q, 4/5, v in descending order. 4/5, v, q Let m = -1330.6 - -1326.6. Sort 0.4, m, 0.12 in decreasing order. 0.4, 0.12, m Let h(d) = 15d3 + 195d*2 - d - 25. Let x be h(-13). Sort -9, x, -5, -4 in decreasing order. -4, -5, -9, x Suppose 8 = -5p - 4l - 5, 2l - 6 = 0. Suppose -t = a - 1, -4a + 30t + 14 = 32t. Sort a, 1, 3, p in descending order. a, 3, 1, p Let n(j) = -j3 + 38j*2 - 172j - 2044. Let w be n(30). Suppose 0 = 2d - 3d. Put d, -8, w in decreasing order. d, w, -8 Suppose -340k = -380k - 40. Put k, 1, 5, -2 in decreasing order. 5, 1, k, -2 Let i be -10 - 272/224-8. Let a = -1199/3 + 395. Let g = -13/3 - a. Put g, i, 0.3 in decreasing order. g, 0.3, i Let l = -42/461 + -3059/1844. Put 7, l, 1, 0.3 in increasing order. l, 0.3, 1, 7 Let c be ((0 - 0)/((-40)/40))/(-6). Sort c, -4, -15 in ascending order. -15, -4, c Let p = 117 + -90. Let g be (-72)/p(-3)/(-4). Suppose u - 25 = -4u. Sort -5, u, g in decreasing order. u, g, -5 Suppose 0 = 5j - 4j. Suppose -46n = 680 - 542. Put 4, n, j, 1 in decreasing order. 4, 1, j, n Let d = 2012/7 - 287. Let p = -410.13 + 408. Let g = p - -1.73. Put d, 0.2, g, -2/17 in ascending order. g, -2/17, 0.2, d Let w = -192 - -195. Suppose -4k - 2 = 2d - 4d, -wd + 3 = 3k. Put k, 1, 6 in decreasing order. 6, 1, k Suppose -8q - 17 = 9q + 85. Put 3, q, -148 in decreasing order. 3, q, -148 Let n = 2593 - 2594.171. Let u = 0.171 + n. Put u, 2/3, -5, -0.2 in increasing order. -5, u, -0.2, 2/3 Let x = -28.58 - -0.58. Let b = x - 5. Let d = 32 + b. Sort d, 1/11, -1/3 in decreasing order. 1/11, -1/3, d Suppose 0 = z - 25 - 28 + 56. Sort 1, -2, z, -699 in decreasing order. 1, -2, z, -699 Let u(c) = c2 + 140c + 538. Let h be u(-4). Let r be ((-8)/(-4) + -1)-4. Sort r, -5, h. h, -5, r Let u = 14 + 59. Let w = 73.2 - u. Let v be (-5)/(-2)(-9)/15. Put w, 0.05, v in decreasing order. w, 0.05, v Let t = -36 + 8. Let l = t + 27.7. Suppose -3w = -0w + 4k - 1, 2 = 2k. Sort w, l, -1/3 in decreasing order. l, -1/3, w Let n(a) = -7a2 - 56a + 61. Let p be n(-9). Sort -6, -5, 2, 0, p in increasing order. -6, -5, p, 0, 2 Let h = 17087 - 17092. Sort h, 5, 8/3 in ascending order. h, 8/3, 5 Let x = -3.778 + 4.178. Sort -5, x, -22, -0.2 in descending order. x, -0.2, -5, -22 Let m = 2/589 - -952/66557. Sort 0.6, 0.1, m, 3/2 in increasing order. m, 0.1, 0.6, 3/2 Let n = -22 - -65. Let x = -42.7 + n. Sort x, 0.2, -2/11, -3 in increasing order. -3, -2/11, 0.2, x Let r = -8195 - -8195.3. Put r, 1, 27, 8, 3 in descending order. 27, 8, 3, 1, r Let q = -489.4 - -489. Sort 35/6, 2/5, 0.08, 1/4, q in decreasing order. 35/6, 2/5, 1/4, 0.08, q Let h(n) = 6n + 41. Let w(d) = 2d + 14. Let k(y) = 3h(y) - 8w(y). Let r be k(-3). Suppose 1 = -s + r. Put 2, s, -10 in descending order. s, 2, -10 Suppose -2h = -6h + 4. Let y(q) = -327q - 2933. Let l be y(-9). Let d be (-3)/(-31) - -1. Put h, d, l in ascending order. h, d, l Let s = -363 + 361. Let v(u) = 15u + 31. Let i be v(s). Sort i, -5, -28 in descending order. i, -5, -28 Let k(l) be the first derivative of l4/4 - 10l*3/3 - 2l*2 - 42l - 69. Let r be k(11). Sort -4, r, 2. -4, 2, r Let g = -104827/4 - -26206. Put -1, -2, g, -11/6 in increasing order. -2, -11/6, -1, g Let n be -1(312/64 + -5)2. Sort 0.017, -6, 2, n, -4 in descending order. 2, n, 0.017, -4, -6 Let y = -451 + 13980/31. Let x = y - 55/217. Sort -0.1, 2, x, 5 in descending order. 5, 2, -0.1, x Suppose 5f + 5s = 6s + 45, 0 = f + s - 9. Let a be 2/f + 102/542. Sort 0, a, 2 in increasing order. 0, 2, a Let a be -10 - (18/24 + 481/(-52)). Sort -8, a, 2, -0.9. -8, a, -0.9, 2 Let w = 2478 - 2473. Put 1, -2, 4, w, -9 in ascending order. -9, -2, 1, 4, w Let a = -22 - -51. Let y = a + -27. Let p = -1.6 - -2. Sort p, y, 1, -1/3 in decreasing order. y, 1, p, -1/3 Let d = -19.5 + 19. Let u be 6((-15)/9 + 1). Sort 2, u, d, -1 in ascending order. u, -1, d, 2 Let a be 2 + 7/(-56)14. Suppose -m = 36m. Put 0.4, -2/3, a, m in descending order. 0.4, a, m, -2/3 Let g be 2/(-4(2-4 - 615/(-82))). Let z(s) = s2 - 2s + 3. Let v be z(2). Suppose vr = 7r - 72. Sort g, r, -3, -2. -3, -2, g, r Suppose 30i = -4q + 27i - 29, -3i - 34 = 5q. Put -2, 0, 2, 6, q in increasing order. q, -2, 0, 2, 6 Let b = 8481 - 8481.3. Sort b, -3/2, -0.266, 0 in decreasing order. 0, -0.266, b, -3/2 Let z = 59 - 55.6. Let w = z - 3.2. Let c be (-50)/136 + (-22)/(-187). Sort c, 1/6, 7/5, w in descending order. 7/5, w, 1/6, c Let g(c) = 2c*2 - 12c + 43. Let x be g(7). Suppose -xw + 50w + 28 = 0. Sort w, 5, -77 in increasing order. -77, w, 5 Suppose 36 = -3l + 57, 0 = -5q + 5l - 35. Sort -4, -1, q, -550, 4 in decreasing order. 4, q, -1, -4, -550 Let s = -0.8 - -0.8. Let l = -7883 + 7885. Put l, -1/4, s, -1 in ascending order. -1, -1/4, s, l Let t be 2/(-17) + 20/((-680)/(-378)). Suppose 5n + 2c = 21, 33 - t = 4n - c. Let z = -34 - -47. Sort z, 2, n, -1 in descending order. z, n, 2, -1 Let i(o) = -2o2 - 18o + 20.	{ "pile_set_name": "DM Mathematics" }
-2/9i + 2/9i*2 + j. 2i(i - 1)/9 Let u(w) be the first derivative of -5w6/4 + w5/10 + 3w4/2 - 2w*3/3 - 58. Solve u(x) = 0 for x. -1, 0, 2/5, 2/3 Factor -83x*4 + 30 + 70x*2 - 85x - x5 + x5 + 5x5 + 43x*4 + 20x*4. 5(x - 3)(x - 1)3(x + 2) Let n be 1 + (23 - 7) - 15. Factor 9/2b4 - 1 + 13/2b3 + b5 - 3/2b + 5/2bn. (b + 1)3(b + 2)(2b - 1)/2 Let o(c) be the first derivative of -c5/15 - 5c*4/3 - 118c*3/9 - 30c*2 - 27c + 171. Find g such that o(g) = 0. -9, -1 Let h(j) = j*2 - j + 1. Let u(z) = 4z*2 + 2z - 1. Let q(r) = -5h(r) + u(r). Factor q(d). -(d - 6)(d - 1) Let r(c) be the first derivative of -8c4 - 48c*2 + 32 - 88/3c*3 - 4/5c*5 - 36c. Factor r(p). -4(p + 1)2(p + 3)*2 Let 2/3b*5 + 8/3b - 2b4 + 0 - 10/3b*3 + 2b*2 = 0. Calculate b. -1, 0, 1, 4 Suppose -15k + 33k = -13k. Let h(s) be the second derivative of 1/18s4 - 1/15s*6 + 2s + k + 2/15s5 + 0s*2 - 2/9s*3. Factor h(p). -2p(p - 1)2(3p + 2)/3 Let t be (0/(-2))/(21 + -20). Let n(u) be the third derivative of 0u*3 + 6u*2 + tu + 0 + 1/15u5 + 1/3u4. What is w in n(w) = 0? -2, 0 Let c(v) be the first derivative of v4/3 - 6v3 + 4v*2 + 26v/3 - 389. Solve c(f) = 0 for f. -1/2, 1, 13 Let p be 2/(-186)-8216/96. Let b = p - -144/217. Factor 4/7 + bh + 2/7h*2. 2(h + 1)(h + 2)/7 Suppose 11o + 27o = 114. Factor 3/7l*4 + 3/7 + 0l - 6/7l2 + 0l*o. 3(l - 1)*2(l + 1)*2/7 Let c = 1592 + -1590. Factor 3/2j*c + 27/2 + 9j. 3(j + 3)2/2 Suppose 0 = 4z + 6z + 5i, 4z + i = 0. Let f(o) be the second derivative of -1/4o*2 + z - o + 1/8o*3 + 5/48o*4. Find h, given that f(h) = 0. -1, 2/5 Let i(w) = 52w + 58. Let y(q) = -q*2 - 206q - 232. Let u(v) = 18i(v) + 4y(v). Let u(s) = 0. Calculate s. -1, 29 Let y(k) = k*3 + 62k*2 + 67k*2 + 3k - 133k2. Let m be y(3). What is w in 0w + m - 4/3w3 + 0w*2 - 25/3w*5 - 20/3w*4 = 0? -2/5, 0 Let p be 7 + (-7 - -3) + 0. Determine b so that 0b4 + b4 - 2b3 + pb*3 - 2b*2 + 0b*3 = 0. -2, 0, 1 Let v(g) be the second derivative of 1/77g*7 + 9/110g*5 + 3/55g*6 + 0 + 0g*2 + 0g*3 + 1/22g*4 + 15g. Factor v(y). 6y2(y + 1)*3/11 Factor 2/7p*2 - 32/7p + 0. 2p(p - 16)/7 Let g(x) = -3x2 - 397x + 2. Let k be g(0). Factor 2/5sk + 14/5 - 16/5s. 2(s - 7)(s - 1)/5 Let s be ((-21)/(-14))/(27/12 + 0). Let g(n) be the third derivative of -5n2 + sn*3 + 3/4n*4 + 0 + 2/15n*5 + 0n. Suppose g(w) = 0. What is w? -2, -1/4 Let o(l) = -2l3 - 4l*2 - 2. Let z be o(-3). Factor -zc*2 - 221 + 221 + 12c + 4c3. 4c(c - 3)(c - 1) Let x(n) = -n*2 + 12n - 8. Let s be x(11). Let k be (7 - 7) + s/1. Factor h*2 + 12h - 10h + 0h*2 - k. (h - 1)(h + 3) Let g(s) be the first derivative of s4/12 - s + 2. Let y(j) be the first derivative of g(j). Factor y(f). f2 Let m(q) be the third derivative of 0 + q*3 + 1/24q*4 + 0q + 21q2 - 1/60q*5. Factor m(w). -(w - 3)(w + 2) Let q(x) be the third derivative of x8/1680 - x7/105 + 11x6/600 + 41x5/150 - x4/10 - 12x3/5 - 2x*2 + 185x. Let q(a) = 0. Calculate a. -2, -1, 1, 6 Let b(s) be the third derivative of -s7/70 - s6/8 - 7s5/20 - 3s*4/8 - 163s*2. Determine y so that b(y) = 0. -3, -1, 0 Let s = -15 + 17. Let b(o) be the first derivative of 0o*3 - 1/13o*s - 3 + 0o + 1/26o4. What is y in b(y) = 0? -1, 0, 1 Let k(g) be the first derivative of g3 - 132g*2 + 261g - 280. What is m in k(m) = 0? 1, 87 Let z(p) be the first derivative of p*4/42 - 4p*3/21 + 3p*2/7 + 8p - 13. Let k(u) be the first derivative of z(u). Factor k(a). 2(a - 3)(a - 1)/7 Let s(m) be the third derivative of -m*8/1344 + 17m*7/420 + 9m*6/40 + 11m*5/24 + 37m*4/96 - 234m*2 + 2m. Find y such that s(y) = 0. -1, 0, 37 Let s(q) be the first derivative of 3q4/20 + 27q*3/5 + 252q*2/5 - 588q/5 - 81. Factor s(n). 3(n - 1)(n + 14)2/5 Let x(v) = -v2 + 45v - 620. Let y(j) = -j + 1. Let u(i) = x(i) - 5y(i). Factor u(l). -(l - 25)*2 Let w be -1((-38)/14 + 3) + 456/665. What is s in -ws2 + 1/5s5 + 0 + s3 - 4/5s4 + 0s = 0? 0, 1, 2 Let y(c) be the second derivative of 1/12c4 - 1/2c*2 + 0 + 6c - 1/12c3 + 1/40c*5. Suppose y(k) = 0. Calculate k. -2, -1, 1 Let d(x) be the first derivative of 28125x*4/2 - 200x*3 + 4x*2/5 + 896. Solve d(f) = 0 for f. 0, 2/375 Find m, given that -8/11m*3 + 2/11m*4 + 0 + 20/11m - 14/11m2 = 0. -2, 0, 1, 5 Let d(v) be the second derivative of 0 + 1/6v*4 + 2v*2 + 0v*3 - 5v + 1/30v5. Let z(b) be the first derivative of d(b). Solve z(g) = 0 for g. -2, 0 Let s(m) = -5m*3 - 52m*2 + 145m - 53. Let i(v) = 2v3 - v + 1. Let c(u) = -5i(u) - s(u). Factor c(q). -(q - 6)(q - 4)(5q - 2) Solve 3/5r*4 - 318/5r - 9/5r2 + 108/5r3 + 216/5 = 0. -36, -2, 1 Let t(f) be the third derivative of -f5/60 - f4/4 - f3 - 4f2. Let s be t(-4). Factor -4z*s + 8z + 4z2 - 4z*2. -4z(z - 2) Suppose 33 + 93 = -3f. Let v be f/(-10)4/14. Let -6/5w*2 + 2/5w*3 - 2/5 + vw = 0. Calculate w. 1 Let t(k) be the first derivative of 2/35k5 - 2/3k*3 + 4/7k*2 + 1/7k*4 - 24 + 0k. Solve t(h) = 0. -4, 0, 1 Let i(t) = -13t2 + 9t - 39. Let j(v) = -13 + 4v - 6 - 37v*2 + 30v*2. Let x(g) = -6i(g) + 11j(g). Let x(d) = 0. What is d? 5 Let x(o) be the third derivative of o6/60 + o5/30 - o4 - o2 - 173o. What is p in x(p) = 0? -4, 0, 3 Suppose -3v = -8v + 10. What is q in -5q3 - 8q2 + q2 - 5q + 17q*v = 0? 0, 1 Suppose 3g + 14 = 26. Let j(w) be the second derivative of 8/3w3 + 0 - wg + 8w*2 + 2w. Factor j(s). -4(s - 2)(3s + 2) Let y(k) = 21k - 271. Let u be y(13). Factor -d - 1/2d3 + 0 + 3/2d*u. -d(d - 2)(d - 1)/2 Determine z, given that -45/2z*2 + 0 - 1/4z*3 - 89/4z = 0. -89, -1, 0 Let p(y) be the second derivative of -y*6/80 - 3y5/40 - y4/8 - 3y2 + 10y. Let n(z) be the first derivative of p(z). Solve n(x) = 0 for x. -2, -1, 0 Suppose x - 6 = -2x. Let o = -198 - -596/3. Solve o - 8/9s + 2/9sx = 0. 1, 3 Let h(t) be the first derivative of t4/34 + 28t*3/51 + 49t*2/17 + 128. Factor h(z). 2z(z + 7)2/17 Factor -8025 - 2a*2 + 10a + 8025. -2a(a - 5) Let l(w) be the third derivative of -w*6/240 + 5w*5/8 - 57w*4/2 - 361w*3/3 - 171w2. Let l(q) = 0. What is q? -1, 38 Let a(v) = -v3 - 6v2 - 113v - 538. Let l be a(-5). Determine r so that 0r3 - 4r*l + 8/3r + 0 + 4/3r4 = 0. -2, 0, 1 Let v(q) be the third derivative of -q6/40 - q5/2 - 4q*4 - 16q*3 - 29q*2. Let v(g) = 0. Calculate g. -4, -2 Let l(k) be the third derivative of -3/5k*3 + 0k + 0 + 4k2 + 1/8k*4 + 1/100k*5. Factor l(v). 3(v - 1)(v + 6)/5 Factor 3346w - 20 + 20w2 - 55w*2 - 3246w - 45w3. -5(w - 1)(w + 2)(9w - 2) Find v such that -4v + 0 + 6v4 - 172/5v*3 + 114/5v*2 = 0. 0, 1/3, 2/5, 5 Let o(p) be the second derivative of 31p + 0p2 + 0 + 8/33p*3 - 1/11p*4 + 1/110p*5. Find g, given that o(g) = 0. 0, 2, 4 Suppose 6y*3 + 3 + 6y*5 + 12y*2 + 31y*4 - 12y - 24y4 - 12y*4 - 10y*4 = 0. Calculate y. -1, 1/2, 1 Let l(d) = -8d*2 - 171d - 63. Let b be l(-21). Factor bs2 - 6/5s + 2/5s3 + 4/5. 2(s - 1)*2(s + 2)/5 Let u(d) be the third derivative of -10d2 + 0d + 1/30d6 + 1/84d*8 - 2/3d*5 - 2/3d*4 + 8/105d*7 + 16/3d*3 + 0. Factor u(v). 4(v - 1)*2(v + 2)*3 Let t be 5 - ((-8)/(-6) - (-4 + 1)). What is b in 0 - 2/3b + 8/3b2 + 8/3b*4 - 4b*3 - tb*5 = 0? 0, 1 Solve 104/9 - 2/9d*5 - 110/9d*3 - 34/9d*4 - 70/9d*2 + 112/9d = 0. -13, -2, -1, 1 Let x be 80/(-8) - (-225)/21. Suppose -3/7c2 - 2/7 - 1/7c*3 + 1/7c*4 + xc = 0. Calculate c. -2, 1 Let p be (5 - 27) + 22 - ((-4)/3 - -1). Let 0n2 - pn + 1/3n3 + 0 = 0. Calculate n. -1, 0, 1 Let m = -41/290 - -7/29. Let p(f) be the second derivative of -f4 + mf*6 + 0f*3 + 0 - 3/5f*5 + 0f*2 - 6f + 1/14f7. Let p(l) = 0. Calculate l. -2, -1, 0, 2 Let h(x) be the first derivative of -x6/720 + x5/60 + 5x*4/48 - 26x*3/3 + 11. Let b(g) be the third derivative of h(g). Factor b(m). -(m - 5)(m + 1)/2 Let y(b) be the first deriva	{ "pile_set_name": "DM Mathematics" }
e remainder when 275 is divided by 149. 126 What is the remainder when 8399 is divided by 70? 69 What is the remainder when 2453 is divided by 9? 5 Calculate the remainder when 932 is divided by 112. 36 Calculate the remainder when 498 is divided by 25. 23 What is the remainder when 125 is divided by 44? 37 Calculate the remainder when 345 is divided by 328. 17 What is the remainder when 4057 is divided by 70? 67 What is the remainder when 1417 is divided by 468? 13 What is the remainder when 294 is divided by 158? 136 Calculate the remainder when 15244 is divided by 77. 75 Calculate the remainder when 192 is divided by 28. 24 Calculate the remainder when 100 is divided by 36. 28 What is the remainder when 94 is divided by 12? 10 Calculate the remainder when 123 is divided by 61. 1 Calculate the remainder when 234 is divided by 40. 34 Calculate the remainder when 971 is divided by 119. 19 Calculate the remainder when 707 is divided by 18. 5 Calculate the remainder when 18678 is divided by 10. 8 Calculate the remainder when 59 is divided by 21. 17 Calculate the remainder when 7446 is divided by 14. 12 Calculate the remainder when 251 is divided by 54. 35 Calculate the remainder when 1061 is divided by 9. 8 Calculate the remainder when 671 is divided by 118. 81 Calculate the remainder when 105 is divided by 68. 37 Calculate the remainder when 362 is divided by 151. 60 What is the remainder when 1390 is divided by 35? 25 Calculate the remainder when 1710 is divided by 427. 2 Calculate the remainder when 87 is divided by 24. 15 What is the remainder when 182 is divided by 172? 10 Calculate the remainder when 7065 is divided by 2355. 0 What is the remainder when 139 is divided by 36? 31 What is the remainder when 379 is divided by 10? 9 What is the remainder when 118 is divided by 11? 8 Calculate the remainder when 56 is divided by 10. 6 What is the remainder when 23 is divided by 7? 2 Calculate the remainder when 320 is divided by 165. 155 What is the remainder when 4535 is divided by 51? 47 Calculate the remainder when 626 is divided by 33. 32 What is the remainder when 393 is divided by 132? 129 Calculate the remainder when 27 is divided by 8. 3 What is the remainder when 75 is divided by 40? 35 What is the remainder when 170 is divided by 87? 83 What is the remainder when 474 is divided by 30? 24 What is the remainder when 115 is divided by 114? 1 Calculate the remainder when 115 is divided by 37. 4 What is the remainder when 69 is divided by 13? 4 What is the remainder when 277 is divided by 194? 83 What is the remainder when 194 is divided by 30? 14 Calculate the remainder when 3959 is divided by 22. 21 What is the remainder when 347 is divided by 54? 23 Calculate the remainder when 85 is divided by 24. 13 Calculate the remainder when 64 is divided by 12. 4 What is the remainder when 503 is divided by 500? 3 What is the remainder when 224 is divided by 47? 36 What is the remainder when 238 is divided by 58? 6 What is the remainder when 715 is divided by 238? 1 What is the remainder when 84 is divided by 7? 0 What is the remainder when 1063 is divided by 15? 13 What is the remainder when 1112 is divided by 53? 52 What is the remainder when 629 is divided by 126? 125 Calculate the remainder when 68 is divided by 10. 8 Calculate the remainder when 80 is divided by 43. 37 Calculate the remainder when 97 is divided by 20. 17 What is the remainder when 291 is divided by 98? 95 What is the remainder when 10713 is divided by 57? 54 Calculate the remainder when 143 is divided by 5. 3 Calculate the remainder when 4507 is divided by 20. 7 What is the remainder when 402 is divided by 31? 30 What is the remainder when 17 is divided by 11? 6 Calculate the remainder when 909 is divided by 253. 150 Calculate the remainder when 727 is divided by 13. 12 Calculate the remainder when 3841 is divided by 62. 59 Calculate the remainder when 47 is divided by 17. 13 What is the remainder when 4520 is divided by 156? 152 What is the remainder when 444 is divided by 115? 99 Calculate the remainder when 5508 is divided by 34. 0 Calculate the remainder when 61 is divided by 45. 16 What is the remainder when 433 is divided by 135? 28 What is the remainder when 28 is divided by 9? 1 Calculate the remainder when 320 is divided by 47. 38 Calculate the remainder when 213 is divided by 102. 9 What is the remainder when 38843 is divided by 12? 11 Calculate the remainder when 726 is divided by 81. 78 What is the remainder when 1228 is divided by 414? 400 What is the remainder when 178 is divided by 20? 18 Calculate the remainder when 821 is divided by 11. 7 What is the remainder when 2561 is divided by 27? 23 Calculate the remainder when 1484 is divided by 68. 56 Calculate the remainder when 605 is divided by 178. 71 Calculate the remainder when 199 is divided by 99. 1 What is the remainder when 515 is divided by 260? 255 What is the remainder when 317 is divided by 16? 13 What is the remainder when 6993 is divided by 22? 19 Calculate the remainder when 253 is divided by 69. 46 Calculate the remainder when 555 is divided by 197. 161 Calculate the remainder when 523 is divided by 53. 46 What is the remainder when 1600 is divided by 318? 10 What is the remainder when 1690 is divided by 3? 1 Calculate the remainder when 163 is divided by 56. 51 Calculate the remainder when 488 is divided by 123. 119 What is the remainder when 148 is divided by 52? 44 What is the remainder when 847 is divided by 143? 132 Calculate the remainder when 234 is divided by 62. 48 What is the remainder when 81 is divided by 76? 5 What is the remainder when 477 is divided by 32? 29 Calculate the remainder when 5989 is divided by 28. 25 What is the remainder when 533 is divided by 67? 64 What is the remainder when 13 is divided by 6? 1 What is the remainder when 40 is divided by 12? 4 What is the remainder when 848 is divided by 208? 16 What is the remainder when 145 is divided by 24? 1 Calculate the remainder when 13796 is divided by 30. 26 Calculate the remainder when 694 is divided by 185. 139 What is the remainder when 522 is divided by 21? 18 Calculate the remainder when 1442 is divided by 257. 157 What is the remainder when 20 is divided by 15? 5 What is the remainder when 284 is divided by 75? 59 Calculate the remainder when 304 is divided by 74. 8 What is the remainder when 593 is divided by 119? 117 Calculate the remainder when 5416 is divided by 2696. 24 Calculate the remainder when 788 is divided by 113. 110 What is the remainder when 421 is divided by 129? 34 Calculate the remainder when 376 is divided by 42. 40 Calculate the remainder when 4 is divided by 3. 1 Calculate the remainder when 439 is divided by 88. 87 What is the remainder when 6288 is divided by 45? 33 Calculate the remainder when 1670 is divided by 19. 17 What is the remainder when 295 is divided by 4? 3 What is the remainder when 398 is divided by 88? 46 What is the remainder when 796 is divided by 210? 166 Calculate the remainder when 459 is divided by 7. 4 Calculate the remainder when 457 is divided by 150. 7 Calculate the remainder when 1198 is divided by 25. 23 Calculate the remainder when 228 is divided by 68. 24 What is the remainder when 21102 is divided by 201? 198 What is the remainder when 313 is divided by 53? 48 Calculate the remainder when 91 is divided by 77. 14 Calculate the remainder when 178 is divided by 29. 4 What is the remainder when 2545 is divided by 91? 88 Calculate the remainder when 54 is divided by 30. 24 What is the remainder when 361 is divided by 80? 41 What is the remainder when 2385 is divided by 12? 9 What is the remainder when 45 is divided by 5? 0 Calculate the remainder when 233 is divided by 105. 23 What is the remainder when 128 is divided by 27? 20 Calculate the remainder when 481 is divided by 230. 21 What is the remainder when 715 is divided by 48? 43 Calculate the remainder when 526 is divided by 109. 90 Calculate the remainder when 113 is divided by 64. 49 Calculate the remainder when 524 is divided by 59. 52 Calculate the remainder when 590 is divided by 120. 110 What is the remainder when 2447 is divided by 70? 67 Calculate the remainder when 221 is divided by 189. 32 What is the r	{ "pile_set_name": "DM Mathematics" }
5/20 + 11v4/12 - 7v*3/2 + 9v*2/2 - 8v + 2. Is w(6) a multiple of 15? False Let i = -29954 + 92257. Is 15 a factor of i? False Let x = 96 + 36. Suppose -q + 3q - x = 0. Suppose 0 = 4s + q - 542. Does 23 divide s? False Suppose 69692 = -22r - 6r. Let w = 3966 + r. Is w a multiple of 71? False Let w be 3/(-3)201/(-3). Let g(j) = j3 + 5j*2 - 17j + 16. Let b be g(-8). Let x = w + b. Does 19 divide x? False Let a = -10 - -88. Let n = a - -16. Is n a multiple of 17? False Is 37 a factor of (-8509 + 0 - 13/13)/(-2)? True Let s = 1557 + 5773. Is s a multiple of 41? False Is 121 a factor of (-24684)/(-85)(3 + 0 + 12)3? True Suppose -45y + 72595 = -253115. Is y a multiple of 7? True Let j(c) = 14c*3 - 3c*2 - 4c - 9. Let m be j(-3). Let z = m - -438. Is 33 a factor of z? False Let t be 3/(2(-4)/8) + -1. Let k be 2/12t(-522)/12. Suppose -17s + ks = 1332. Is s a multiple of 18? False Let m be 58/(0 + 1 - -1). Suppose -3705 = 31z - 88z. Let k = z - m. Is k a multiple of 7? False Let s(g) = 554g*2 + 86g + 85. Does 7 divide s(-1)? True Suppose 0 = l + 3l - 744. Suppose 2h - 46 = -l. Is 10 a factor of (-40)/h - 836/(-7)? True Let i(r) = 2r2 + r + 226. Let u be 22 + -20 - (-2)/(-2)1. Let h be (-3 - u) + (-9)/((-9)/4). Is i(h) a multiple of 21? False Let a = -1558 - -4079. Suppose 5k - h = a, 5k + 5h - 2577 = -62. Is 63 a factor of k? True Let w = -188 + 183. Let h(g) = -3g*3 - 10g*2 - 2g - 15. Is h(w) a multiple of 12? True Let m(y) = -4y2 + 6y. Let v be m(2). Is (-4032)/(-33) - v - (-2)/(-11) a multiple of 21? True Let g be 1 + -4 - (12 - 18). Suppose 0 = -4b - g + 51. Is 12 a factor of (8 - (0 - -3))b? True Let b be (((-32)/(-4))/2 + 1)19. Suppose -y - b = 28. Let k = y + 153. Does 5 divide k? True Suppose 5x + 2m = 23 - 137, 2m = 2x + 54. Let v be x(4 + (4 - 7)). Let c = v + 48. Does 6 divide c? True Suppose -2 = 2v, 5v - 100 = 2z + 3z. Let j = 9 + z. Let p = 50 + j. Does 6 divide p? False Let a(f) = -2f2 - 25f - 23. Let j(n) = -n*2 - 13n - 12. Let h(u) = 3a(u) - 5j(u). Let q = 1350 - 1356. Is 5 a factor of h(q)? True Let o(u) = u*3 - 47u*2 + 46u + 1. Let v be o(46). Does 7 divide v/(7/(-3724)-2)? True Suppose -53y = -64y + 7502. Suppose -v + 160 = -3a, 0 = -4v + 3a - 5a + y. Does 44 divide v? False Suppose -4c = -0c - 5f + 397, -3f + 101 = -c. Let x be (-56)/c21/6. Suppose 3g - 117 = 4m, g - 25 - 12 = xm. Is g a multiple of 7? False Let p be 163/(-5) - (-8)/((-120)/(-9)). Let y = p - -74. Does 3 divide 1230/y - (-4)/(-14)? False Let t = 11895 - 8695. Does 200 divide t? True Suppose 5137 + 2078 = 13t. Let f = 847 - t. Is 15 a factor of f? False Let f be (-2)/5250/(-10). Is 10 a factor of (53 - 5 - 0)f? True Let v(q) = 3q3 - 3q*2 + 27q + 10. Is 5 a factor of v(8)? True Let t be ((-7)/(-14))/(5/(-4370)). Let a = t - -658. Does 13 divide a? True Suppose 4133a - 4106a - 2196063 = -886428. Is 89 a factor of a? True Let b be 0 - (-4)/(16/(-372)). Let o = b + 146. Is o a multiple of 16? False Suppose 10q - 61 = 19. Is 14 a factor of (q/(-7))/(8/(-196))? True Let j be (((-10)/2)/(-5) + -1)/1. Let o(v) = 18v + 36. Is 6 a factor of o(j)? True Suppose q = 11 - 5. Suppose -2h - 1760 = -4m, -4h - 450 = -m - qh. Is 11 a factor of m? False Let h = 1 + -1. Suppose h = -4y - 14 + 26. Suppose 0 = yf - 3j - 150, f + 130 = 4f + j. Does 5 divide f? True Suppose 2f = -0f + 28. Suppose -3u = -4z + 2u + 38, 3u = 5z - 28. Suppose zb + fb - 3072 = 0. Is b a multiple of 32? True Let r = 3 + -1. Suppose 0y - 5y = -ro + 34, 5y + 24 = -3o. Is (-82)/y4 - 12/18 a multiple of 6? True Let p be 7230/165 + (-4)/(-22). Let j = 47 - p. Suppose 0 = -4n - 8, w = 6w - jn - 141. Does 9 divide w? True Suppose 0 = 3z - 3c - 21, z - 6c - 13 = -2c. Suppose zs - 5l = 7s - 673, -663 = -2s - 3l. Is s a multiple of 81? True Let o(x) = 846x + 2710. Is o(6) a multiple of 229? True Suppose 4l = 2g - 4, 2g + 0g + 2l = 4. Suppose -3n = -n - g. Suppose -4k - 4 = -w - n, 5w - 95 = 4k. Is w a multiple of 8? False Suppose -3l - 2t + 185 = -6l, 304 = -5l - t. Let r = -58 - l. Suppose -u + 361 = 5f + 7, -209 = -rf - 4u. Is f a multiple of 8? False Suppose 2w + 184 = 2q + 1184, 0 = 2w + 4q - 1024. Does 21 divide w? True Suppose -11c + 280 = 71. Suppose -2v = -2m - 14 - 2, -3v = 2m - c. Does 58 divide -44(v + (-285)/20)? True Suppose 2p = 0, -2p - 81 = -7l + 4l. Suppose 0 = 3z + 5k + l - 107, 0 = 5z + k - 148. Let i = z - -67. Is i a multiple of 16? False Suppose 0 = -3a - o + 247 + 1993, 2a - 3o = 1486. Is 19 a factor of a? False Is 103 a factor of ((-51)/(-6))/(-17) - (0 + (-10919)/2)? True Does 89 divide (1/(44/979))/(3/2748)? True Suppose -27h - 14h + 188690 + 16802 = 0. Does 14 divide h? True Suppose 31r - 2r = 3r + 51246. Is r a multiple of 62? False Suppose 42o = -38o - 10o + 608310. Is 9 a factor of o? True Suppose -9a + 8a = 2u - 26, -3u + a + 29 = 0. Suppose ug - 18g + 1701 = 0. Does 9 divide g? True Let n(g) = 20g*2 + 2g - 8. Suppose 0 = 5x - 24 - 11. Suppose -k = xk - 16. Is 38 a factor of n(k)? True Let i(q) = 51q2 + 86q - 2016. Is 90 a factor of i(19)? False Suppose a - 4a - 2j + 49 = 0, 3a = -j + 50. Let o(g) = 3g*2 + 14g - 21. Let u(k) = -k*2 - 5k + 7. Let s(y) = au(y) + 6o(y). Is s(-4) a multiple of 5? False Does 24 divide (13/4)/((-31095)/1728 - -18)? True Let l be 0 + -7 + 18 + 1. Suppose 2t + 6k - 4k = 84, -5k + 93 = 2t. Let p = t - l. Is 3 a factor of p? True Let m(v) = 39v - 8. Let t be m(2). Let x = t + 1. Does 44 divide x? False Let u be (-8)/618/(-4). Does 4 divide 122u/((-12)/(-1))? False Suppose -69 + 237 = 3l. Let o be 6/4 + l/16 + -2. Suppose oz = z - 2a + 100, 0 = -3z - 4a + 148. Does 48 divide z? False Suppose 2g - 5g + 3c = -15, -c = 1. Suppose -go + l - 482 + 2643 = 0, -2o + 3l + 1083 = 0. Is 11 a factor of o? False Let r = 1085 + -827. Let q = -239 + r. Is q a multiple of 3? False Let r(a) be the first derivative of -a + 39 + 0a*2 - 14 - a - 50a*2. Is r(-2) a multiple of 11? True Let m = -1212 + 1096. Let j(c) = -2c*2 + 6c + 8. Let n be j(7). Let q = n - m. Is q a multiple of 7? False Let c(n) = 43811n - 1416. Is 139 a factor of c(1)? True Let g(j) = -6j + 172. Let z be g(31). Is 176/308 + (-4514)/z a multiple of 22? False Let t = 13 + 4. Let a = -59 + 61. Suppose 4k - ap - 43 + t = 0, 2p = -5k + 19. Does 5 divide k? True Does 8 divide (1360/30)/((-4)/(-468))? True Let t(l) = 28 - l*2 - 6l*2 + 8l - 3l2 + l3 - 28l. Let b be t(12). Let d = 121 - b. Is 5 a factor of d? True Let r be (-94)/(-14) + (-2)/(-7). Suppose 3u = 20u + 32 + 19. Is 3 a factor of r - (-9 + 3 - u)? False Suppose 0 = -21w + 161082 - 146664 + 376140. Does 34 divide w? True Suppose 2h + 3s = -h + 29430, 5h - s = 49050. Does 90 divide h? True Let r = 94 - 264. Is (4/((-8)/(-81)))/((-17)/r) a multiple of 3? True Let o(l) = 4l2 + 8l - 54. Let b be o(7). Let f = 474 - b. Does 6 divide f? True Suppose z - 19272 = 3c, 38540 = 2z - 4c - c. Is z a multiple of 107? True Let b be (-1 + -7 + 11)/(3/5). Let o = -7 - -5. Does 15 divide (29 + o)(b - 0)? True Is 19/(-228) + (-2205153)/(-108) a multiple of 41? True Suppose 0 = 143j - 147j + 16. Suppose -2m - g + 808 + 251 = 0, jm + 3g - 2113 = 0. Does 38 divide m? True Let x(i) = 736i + 416. Is 21 a factor of x(4)? True Let k(p) = -198p3 + 4p*2 + 5p + 6. Let o be k(-2). Suppose -11l = -4839 - o. Is l a multiple of 13? True Let h = 133 - 275. Let r = h - -154. Does 3 divide r? True Let p = -41 + 44. Suppose 2q = 10, 0x - pq = -2x + 929. Is 4 a factor of x? True Let r(l) = -237l - 1973. Does 9 divide r(-33)? False Suppose 5y = 2d - 21, 3d + 0d + 3 = -4y. Suppose 0 = -dn + 7 + 8. Suppose -4c + b = -52 - 41, 0 = 4c - nb - 97. Is c a multiple of 11? False Suppose 3505 + 8390 = 5w. Does 13 divide w? True Let v(o) = 2o + 22. Suppose 27w - 23w + 12 = 0. Let n be v(w). Is 40 a factor of n/2(9 + 4 + 2)? True Let q be ((-10)/(-4))/(53/106). Suppose qt + 365 = x - 793, -2x + 4t + 2286 = 0. Is x a multiple of 108? False Let t(z) = -4z - 6. Let q be t(-2). Suppose 0 = 2v - qd + 25 - 207, 0 = v + d	{ "pile_set_name": "DM Mathematics" }
-2). -3 Calculate (-8 - -10 - -6) + -5. 3 Evaluate -4 - (2 - -2) - -4. -4 What is -3 + -3 + 10 + 8 + -9? 3 Evaluate -4 + -5 + (7 - (1 + -2)). -1 What is -4 + 2 + (-5 - -3)? -4 What is the value of -5 + (14 + -22 - -12)? -1 What is 0 + (1 - (6 - (-4 - -8)))? -1 -13 - -7 - -4 - 0 -2 What is the value of 1 + 0 - (9 - 7 - 6)? 5 Calculate 4 - (6 - (-2 - -5)). 1 Calculate -5 - (3 + (4 - 5)). -7 What is the value of 4 + (-3 - 1 - 2)? -2 Evaluate -1 + 1 + -6 + 9. 3 What is the value of -63 - -57 - (-2 - 1)? -3 (-4 + -3 - -1) + 8 + 1 3 Evaluate -4 + (11 + 2 - 6). 3 What is -2 - (-2 - -1 - (5 - 9))? -5 8 + -6 + -9 - (2 - 2) -7 (-1 - -2) + -54 + 50 -3 Calculate 2 + 3 - (6 - (7 - 8)). -2 What is the value of (3 - -3 - 8) + 8? 6 Evaluate 12 - (7 + 1) - 9. -5 What is the value of 3 + -2 + (-3 + 6 - 0)? 4 Calculate 0 + (0 - (-1 - -5)). -4 What is -1 - -6 - (4 + (10 - 4))? -5 What is (4 + -9 - -16) + -9? 2 What is -3 - (-6 - (4 + 3 + -6))? 4 Calculate -2 - (-12 - -2) - 8. 0 6 - (-10 - -5 - -14) -3 (4 - 3) + (12 - 3 - 7) 3 Evaluate (3 - 7) + (3 - 0). -1 Evaluate 5 + (-2 + 9 - 12). 0 Calculate (0 - (-17 + 10)) + (-2 - 0). 5 Evaluate 21 + -1 - (45 + -33). 8 What is (3 - (-2 + 3)) + 4 + -2? 4 What is -7 + (4 - -6) + -3? 0 Evaluate -4 - (-21 + 9 + 1). 7 What is -2 + (1 - 1 - -2)? 0 What is the value of 9 - ((-2 - -8) + -1)? 4 1 + (8 - 6) + -4 + 5 4 What is the value of -2 + (3 - 2 - -2 - 3)? -2 What is 0 + -2 + (-3 - -2 - 0)? -3 What is 7 - (4 - 1) - (-1 + 0)? 5 Evaluate 4 - (4 + 1) - -1. 0 What is -8 + (4 - 6 - -19)? 9 Calculate (6 - (2 - -6)) + -1. -3 What is 3 + (5 - (-8 - -17))? -1 What is -4 + (-8 - -18 - 13)? -7 What is the value of 2 - (-4 - -7) - 0? -1 What is the value of 0 + 0 + 2 + -5 + 7? 4 Calculate -3 + -9 + 2 - -9. -1 Evaluate 0 - -3 - (4 + -3 + 2). 0 What is -1 + 0 + -11 + (1 - -8)? -3 What is 17 + -15 + (2 - 0 - 4)? 0 What is 3 - (2 + -5 - -4)? 2 What is the value of 0 - (2 - 1 - (-3 - -1))? -3 -4 + -3 + 4 + (6 - -2) 5 What is (-1 - -9) + -2 - -1 - 4? 3 Calculate 5 + (-1 - (4 - 7)). 7 What is (0 - (-3 + -3)) + -2 + -2? 2 -2 + 6 + -5 + 1 - -2 2 What is 12 + -7 + 1 + -8? -2 What is the value of 12 + -1 + -6 + (1 - 3)? 3 Calculate -3 - (3 - 4 - 3). 1 What is 14 - (5 - -15) - (0 + -2)? -4 What is the value of -11 + 25 + (-11 - 1)? 2 What is the value of 2 - (-6 + 1 - -3)? 4 What is -2 + 7 + -1 + 0? 4 What is the value of 12 + -1 + 7 + -12 + -3? 3 Calculate (8 - 1) + -3 + 8 + -8. 4 What is (-3 - -2 - 4) + 3 - -1? -1 Evaluate -8 - (-3 - (0 + 1)). -4 Evaluate 9 + -4 + -2 - -1. 4 3 + (5 - 3 - 1) 4 What is -2 + (-11 - -5) + 7? -1 (-1 - (5 - 2)) + (0 - 1) -5 What is -2 - 1 - (-6 - 2) - 0? 5 Calculate (-26 - -11) + 10 + 2 + -2. -5 5 + (-10 - (1 - 0)) -6 0 - (0 + -1) - 7 - -4 -2 Evaluate 5 - 1 - (-10 - -11). 3 What is the value of -3 - (-14 - (-10 + -4))? -3 Calculate -1 - -1 - -2 - (286 + -284). 0 Calculate (-7 + 22 - -1 - 7) + -6. 3 Evaluate -3 + -5 - -16 - 9. -1 What is the value of 6 - 5 - (0 + 2) - -4? 3 (0 - -7 - 3) + -4 0 What is the value of 30 + -30 + (-1 - -1)? 0 Calculate 8 + -2 - 3 - (7 + 0). -4 Evaluate 2 - -3 - (-15 + (11 - -2)). 7 Evaluate 1 - (-1 + 0) - (-13 - -15). 0 What is -5 + 14 + -15 + 4? -2 Evaluate (32 - 33) + -2 + 1 + 2. 0 What is the value of -6 + (2 - (-1 - -5 - 7))? -1 Calculate -3 + -8 + 15 + -13. -9 Calculate 8 - (-7 + 16 - 10). 9 What is the value of -3 + (3 - (-3 + 2)) - -3? 4 What is the value of -1 - (6 - (1 - -3)) - -6? 3 Evaluate -4 + 1 + 4 + 0. 1 22 + -28 - (-2 + 0) - 4 -8 What is -2 - (-5 - (-3 + 5 + -2))? 3 Evaluate -1 + 4 + 0 - 1. 2 Calculate (3 - (15 - 5)) + 3. -4 What is the value of -4 + -3 + -9 + 13? -3 Calculate -2 + 0 - (-6 + 10 + -1). -5 Calculate 1 + -9 + 5 + 7. 4 What is (-3 - 3) + -1 + 13? 6 What is the value of 3 - (-3 - 6 - -14)? -2 Calculate 0 + 11 - (49 + -33). -5 What is 2 - ((-14 - -8) + (7 - 4))? 5 What is 4 - ((-6 - (2 + -19)) + -3)? -4 11 + -9 - (-1 - 1 - 3) 7 Evaluate -4 - (-5 + -1 + (-3 - -7)). -2 Calculate (-2 - (3 - 3)) + 3 + -3. -2 What is 6 - 3 - (4 - -1) - 4? -6 Calculate (-3 - -1) + 2 - (-1 - -9). -8 (3 - (18 - 10)) + (1 - -3) -1 What is -4 - (0 - 12 - -4)? 4 (5 - 16 - -4) + 4 -3 What is 2 + -2 - (-2 + -1)? 3 Evaluate 7 + -1 + -4 + 4 + -1. 5 Evaluate -9 - (-2 - 2) - (-9 + 2). 2 Evaluate -1 + -5 - (0 + -1). -5 Calculate (3 - (-1 + 5 - 1)) + 4. 4 Evaluate 3 + 4 + -3 + -5 - -4. 3 1 - -1 - (-21 - -23) 0 What is -1 - (0 - 4 - -5)? -2 Evaluate 2 + -9 - (-12 + 12). -7 Evaluate 8 + (-9 - 3 - (12 - 18)). 2 What is -4 + 5 + 0 + 48 + -44? 5 What is (4 - -1) + -16 + 16? 5 Calculate -3 - (5 - (-2 + 5) - -2). -7 Evaluate (3 - 8 - -5) + (1 - 0). 1 What is the value of -3 + (5 - 7) + 5? 0 7 + 8 + -22 + 3 -4 Evaluate 7 - (3 - (-6 + -3 + 6)). 1 Evaluate 9 + (-11 - -3) + 3. 4 Calculate (-11 + -9 - -11) + 3. -6 Evaluate 1 - 6 - 0 - (4 + -3). -6 -7 - (7 - 5 - 7) - 2 -4 Calculate -7 + (-7 + 1 - -8) + 5. 0 -1 - -5 - 3 - (-6 + 7) 0 Evaluate 6 + 1 - (0 + 5). 2 Calculate -1 + 4 - (-2 + -2 - -2). 5 Calculate -1 + -3 + 10 - 6. 0 0 - (-7 + 8 - 10) 9 Calculate (-69 - -74) + 1 + -9 + 1. -2 (1 - 10) + (-69 - -75) -3 Calculate 3 - 2 - (1 - -5). -5 Calculate -4 - (-5 + (-2 - (-1 + -2))). 0 Calculate -3 + (2 + 1 - 4) + 6. 2 Evaluate 9 - (0 + 10) - 3. -4 1 + 1 - (-5 - -12 - 3) -2 Evaluate 2 + 6 + -5 + (-6 - 0). -3 6 + -22 + 5 + 7 + -3 -7 Evaluate (134 - 140) + (15 - 1). 8 What is 0 - ((-7 - -6) + -1 + 4)? -2 What is the value of -8 + 6 - (6 + -2 + -1)? -5 -13 + (-5 + 7 - 7) + 11 -7 Calculate 53 + -51 + -1 + -9. -8 What is -5 + 5 - (-3 + (3 - 4))? 4 Evaluate -5 + 0 + 12 + -3. 4 What is 6 - 3 - 0 - 7 - 0? -4 What is the value of (3 - 7 - -3) + 6? 5 Evaluate 0 + -7 - -10 - 0. 3 What is 2 - 0 - 4 - -4 - -3? 5 Evaluate -12 - -14 - (3 - (0 + 0)). -1 Calculate (8 + -6 - 5) + -3 - -9. 3 3 - (3 - (-1 + 6)) 5 -1 + (-3 + -1 - -2) -3 What is the value of -11 - (-6 + 0) - (1 + -10)? 4 What is the value of -5 - 3 - (-7 + 3)? -4 Evaluate 8 - 0 - (5 - (-3 - -3)). 3 0 + 6 - (-7 - -9 - 0) 4 Calculate (-2 - (-5 + 11)) + 3 + 11. 6 What is the value of (-2 - 10) + 17 + -15? -10 What is the value of -5 + 3 + -4 + 1? -5 What is 2 - (-7 + 11 + 4)? -6 (-1 - 5) + (4 - 2) -4 Evaluate 53 + -53 - (1 + -2). 1 Calculate 0 + 2 - (-3 + 1). 4 Evaluate -7 + 1 + 2 + -39 + 42. -1 6 - -2 - 5 - 9 - -12 6 What is -2 - (-10 + 1) - (2 - -1)? 4 What is the value of -3 + (-9 - -18 - 5 - -7)? 8 What is the value of -1 + (9 + 4 - 10)? 2 What is 1 + ((0 - 3) + 1 - 5)? -6 Evaluate 3 + -5 + (6 - 0). 4 What is the value of -2 - (-6 + (-5 - -5))? 4 Calculate 15 + -16 + -3 + 8. 4 What is the value of 9 + 1 - (-6 + 23)? -7 -8 + 5 + -5 - -7 -1 Evaluate 1 + (5 - 0) - 7. -1 Evaluate 1 + -6 + 5 + (-3 - -1). -2 What is -12 + (-6 - -4) - -6? -8 5 - ((-1 - (3 - 4)) + -1) 6 What is the value of 1 + -2 + -1 - (26 + -35)? 7 What is -2 - (2 + (10 - 9))? -5 What is the value of 10 + (-2 - (5 - 6)) + -4? 5 Evaluate (-3 - (-3 - 4)) + 1. 5 Evaluate 3 + (-2 - (-1 + 0) - -4). 6 Evaluate (-1 - (-10 + 8)) + -1. 0 What is the value of 7 + -2 + 2 + -2? 5 What is -5 + -1 + (-3 - -6) - 0? -3 Evaluate -1 + -3 + (8 - (-7 + 14)). -3 Evaluate (41 - 45) + 2 + 1. -1 Calculate -2 - ((-1 - 2 - -2) + -1). 0 Evaluate (2 - 3) + (2 - 3) + 3. 1 What is (7 - (4 + 15) - -8) + 4? 0 What is -1 - -2 - 4 - (-4 - -1)? 0 What is 2 - (1 - 0) - 1? 0 What is the value of 8 + -14 + 9 - -3? 6 5 + 4 + -3 + -3 3 Evaluate -6 + 5 - -3 - 6. -4 What is -6 + (1 - (-6 + 3)) + 0? -2 Evaluate -3 - (2 + 5 + -14). 4 What is 0 - (-3 + 3 - (-3 - -5))? 2 Calculate 2 + -2 + 9 + (-4 - -3). 8 Evaluate (2 - 5) + 7 + -8. -4 What is the value of -3 - (7 - 11 - 0) - 2? -1 Evaluate 10 + 11 + -17 - (-2 - -3). 3 What is 5 + -8 + -6 + 10? 1 What is the value of 1 + -3 + (3 - (-3 - -2))? 2 3 + -11 + 3 + 0 -5 What is the value of (4 + -2 - 0) + (-5 - -3)? 0 Evaluate 0 - (-3 + (7 - 4)). 0 0 - (-5 - (-6 + 4)) 3 Calculate 5 + -2 + (-1 - -1 - 0). 3 Calculate -2 + (2 - 6) - -6. 0 Calculate 2 + -2 - (0 - -4). -4 Calculate (-5 - 1) + -6 + 7 + -1. -6 Evaluate -2 + 9 - (6 - 2) - -2. 5 -4 - (0 + -9 + 5 + -5) 5 What is the value of -1 - ((1 - 4) + 39 + -32)? -5 Calculate -1 + 2 + -3 + 0 + 2. 0 What is 3 + (-4 - -1) - (-27 - -26)? 1 What is (1 - -5) + (-15 - -14)? 5 What is the value of (1 - -4) + (14 - 16)? 3 Evaluate 5 - (4 + -12 + 4) - 4. 5 Calculate (2 - -6)	{ "pile_set_name": "DM Mathematics" }
Solve 5d - 2 = -8y + 4y, 416d - 4y + 8 = 420d for d. -6 Solve 5t - 2o = 3o - 16 + 111, 814o - 1627o = 8t - 816o - 137 for t. 16 Solve 5m - 52 = -3l, 8m - 80 = -199996l + 199992l for m. 8 Solve 5 = 5j + 5 - 11 - 14, 0 = -5c - 5j + 260 for c. 47 Solve -t + 4t + 19602 - 40691 = -2955y + 16999 + 15096, -t - 5 = -3 for y. 18 Solve 0o - 5f + 15 = -5o, 2165 = 4f + 2141 for o. 3 Solve -298r = -301r - i + 21, -3r - 3i + 52 = 19 for r. 5 Solve -255 = 25j + 5t, 0 = 5j - 2t - 5t + 4t - 133 for j. -1 Solve -5d + 26j - 32 = 9j, -4j + 7 = 6d - 7d for d. -3 Solve -4c - 4l = 48, 78l - 58 = 9c + 82l for c. -2 Solve -2728u + 4a - 32 = -2726u - 12, 68u + a - 5 = 0 for u. 0 Solve 24h - 20h = 5y + 293, 6y = 3h + 10y + 253 for h. -3 Solve 3c - 56w + 11477 - 11415 = 0, 0 = -4c - 3w - 5 for c. -2 Solve -17j - 9j + 27j + 9k - 50 = 0, 3j = 4k - 36 for j. -4 Solve 395s + 5t = -385, 0 = -4s - 61t + 66t - 14 for s. -1 Solve -24 = -4c + 169g - 171g, 0 = -23c + 4g - 6g + 43 for c. 1 Solve -30w = -5x + 2685 - 2840, 5x - 5w = -5 for x. 5 Solve -141 + 67 = -2a - 12n + 56, 0 = -3a - 3n + 135 for a. 41 Solve t - 3c = -2c - 7, 2t - 3c - 9701 + 9710 = 0 for t. -12 Solve -8g = -10g - 7a - 56, -8a = g - 0a + 3a + 43 for g. -21 Solve 20 = -2b, -2j + 5b - 17223 + 17277 = 0 for j. 2 Solve -3g - g = 4i - 248, 0 = -2i + 7i - 2g - g - 334 for i. 65 Solve 10m = j + 244, 2m = 3411j - 3414j + 36 for j. -4 Solve -4v = -3l - 423, 0 = -2v - 6l + 3763 - 3589 for v. 102 Solve 4y - 4c - 157953 = -157989, 0 = 3y + 5c - 21 for y. -3 Solve 12 = -3r - 3c, -269r + c = -278r + 20 for r. 3 Solve -477265x - 7 = -477264x + 3j, -5x = -3j - 1 for x. -1 Solve -364904 = 5t - 3s - 364834, -2t - 77 = -3s - 22 for t. -5 Solve 277g - 280g = -5y + 67, 3g - y = -47 for g. -14 Solve -3d - 113 = 5w - 42, 234w + d + 151 + 78 = 27w for w. -1 Solve 22l + 364 = 4w, 4625l - 74 = 2w + 4630l for w. 3 Solve -s - 64 = 8h - 38h, 0s - 2s - 16 = -4h for s. -4 Solve 4095 = 10l + 3p + 4069, -4p = 2l - 12 for l. 2 Solve -l + 51 = -5i, 7037l - 6998l = -5i - 211 for l. -4 Solve -7k + 4k + 128 = -7k - 3b, -42781k - 5b - 160 = -42776k for k. -32 Solve 2200b = 2195b + 179l - 751, -2b + 4l = 30 for b. -7 Solve 5p + 16528 - 16557 = -2j, 0 = -14j + 6p + 162 for j. 12 Solve -3958 = -3v + f - 3813, -5v = 2f - 249 for v. 49 Solve -4i - 11d - 5 = 523, -i + 288 = -6d for i. 0 Solve 266248l - 266245l - 5n - 77 = 0, 0 = l + n + 9 for l. 4 Solve 25445s - 21 = 5p + 25442s, 28 = 2p + 4s for p. 0 Solve 0 = -6m - 4c + 120, -48 = -2m + c - 3c - 6 for m. 18 Solve 2t = w - 3t + 26, 36w - 93t = 37w - 464 for w. -1 Solve 4r + 2p = -42, -152460r + 152464r + 5p = -57 for r. -8 Solve -3m - 172h + 21 = -175h, -51m = -54m - 5h - 19 for m. 2 Solve 13p + 0p - 2p + 25 = 6p - 5m, -m = 2 for p. -3 Solve p - 3308 = -5t - 3296, -11t + 23 = -3p - 19 for t. 3 Solve 2l + 78 = 0, -9u - 5l = 3u - 10u + 193 for u. 1 Solve 0u = 5k - 11u + 29, -5u - 7389 = -k - 2u - 7398 for k. 3 Solve 4t = 12p + 268, -3p + 846 = t + 905 for t. 4 Solve 20 = -4t, 827g - 6t = 1646g - 816g + 27 for g. 1 Solve -2i - a + 3194 - 3213 = 0, 6i + 67 = -a for i. -12 Solve -f + 68 = 2y - 3y, -912y = 3f - 953y - 2826 for f. -1 Solve 110916a = 3m + 110913a - 66, m + 122 = -5a for m. -2 Solve -t - 80 = -4h, -h = 91t - 88t - 33 for h. 21 Solve -603g - s = -596g - 17, -8 = -4g - s for g. 3 Solve 2i - 20 = -2j + 2 - 0, 118j - 99j + 4 = 5i + 21 for i. 8 Solve -n + 2d = 22, 8n = 41d - 43d - 16 + 2 for n. -4 Solve 3h + 8n = 26, 2h - 10432n + 10431n - 30 = 0 for h. 14 Solve -a - 28 + 145 = -5q, -37 + 42 = 4q + 4a + 113 for q. -24 Solve 2l = 5z - 65, 0 = -5572l + 5574l + 19z - 7 for l. -25 Solve -5b + 4430 - 4510 = 5y, 2y - 2b + 88 = -2y for y. -20 Solve 459 - 470 = 2c + 5d, -c + 4d + 17 = -d for c. 2 Solve -5p + 3d - 2 = 0, -27p + 27 - 6 + 141 = 3d for p. 5 Solve -3b + 28 = -4b + 3a, -7b - a + 11599 = 11729 for b. -19 Solve -120m - 2 - 2 = -l, -5l + 20 = -3m for m. 0 Solve 2p - p + 4j = -1, 0 = -3p + 3j - 77 + 74 for p. -1 Solve 7 = -u - w + 17, -3w + 239 = 227 for u. 6 Solve 5q - 11 - 24 = 35, -q + 5q + 15 = -w + 5q for w. -1 Solve 5i + 2n - 2 = 3i, 73 = 235i - 252i + n for i. -4 Solve 31h + m - 24 = 0, 4h + 4m = 156905 - 157169 for h. 3 Solve -2858y = -2857y + 6n - 7n + 3, 24 = -3y - 2n for y. -6 Solve 832l = 358l + 471l - 2a + 3, 2a = -l - 7 for l. 5 Solve -27u - 92 = 29u - 54u + 2j, -2u + 11j + 22 + 255 = 4j for u. -5 Solve 4l = -5q + 18l - 84, 18 = -5q + 29l - 26l for q. 0 Solve -41 = -59h + 57h + 5r, 5h - 98 = 14r for h. 28 Solve 3h = 2211i - 2112i - 606, -26 = -5i - h for i. 6 Solve -3u = -878m + 883m + 10, -4u + 5m + 45 = 0 for u. 5 Solve -22g = -88, -2c - 54g + 208 = 77g - 83g for c. 8 Solve -r - 66y = 4r + 15y + 459, -1 = -y - 5 for r. -27 Solve -2s = -0w - 3w - 28, s + 601w = 604w + 29 for s. -1 Solve -5n = -8n - 7x - 43, 4n - 36x + 40 = -41x for n. -5 Solve 3a - 6n - 16 = -1, 73a - 3n = 3n - n - 199 for a. -3 Solve -21530p - 83 = -21532p + 5b, -4b - 70 = 2p for p. -1 Solve 0 = -d - 6j - 3, -138 = 5d + 2j + 116 - 239 for d. -3 Solve a - 3t = 5a - 9t + 8t - 12, -26a + 75 = -3t + 29 for a. 2 Solve 147v - 102v = -4u + 36 + 128, 2v + 2u = 0 for v. 4 Solve -2x - 3j - 19 = 0, -20x - 37j + 35j = -23x - 35 for x. -11 Solve -1285a - 1286a + 2 = -3855a + 1282a + 2v, 0 = -5a - 0v + 4v - 6 for a. -2 Solve 152 = -65o + 22, -2a + o - 4 = -a - o for a. -8 Solve 231c - 258c - k = 192 + 106, c = k - 10 for c. -11 Solve -417u + 423u + t - 20 = 0, 0 = 3u + t - 17 for u. 1 Solve 51 = -4369w + 4367w - 5j, 4j = -11w - 69 for w. -3 Solve 2l + 2l - 31 = 81, 2r - 118 = -4l for r. 3 Solve 27w = -5y + 253, -3w - 4y + 17 = -18 for w. 9 Solve -1053f + 2s = -1059f - 118, -f - 2s = -7s + 41 for f. -21 Solve -6g + 8g + 90 = 40o, -12g - 28g - 4o = -42g + o - 20 for g. -5 Solve 4h = 2f - h + 65 - 220, -31 = f + h for f. 0 Solve -17i = k - 16i + 39 - 10, -k - 129 = 5i for k. -4 Solve 5z = 10n + 20 + 10, 0 = 3n - 9z - 17 - 4 for n. -5 Solve -5u - 23s + 4 = -21s, -3u + 4s + 5 = -13 for u. 2 Solve 3d + 9f = 3, 1040f + 6 = -d - 3d + 1037f - 8 for d. -5 Solve -7q - y = 9q + 1070 - 227, -5y + 25 = 0 for q. -53 Solve -p - 16876 = 8v - 16723, p - 5v - 99 = -0p + 5p for p. -1 Solve 3l = -4z + 761 - 693, -l + 22 = 2z for l. 24 Solve -3p - 4t + 8 = 0, 6p - 11041t = -11042t + 2 for p. 0 Solve -57667z + 25 = 5m - 57666z, -5z + 89 = 19m - 0z for m. 6 Solve 10d - 4w + 152 = 0, -1658d + 128 = -1662d + 2w + 2w for d. -4 Solve 0 = 2y - 26, 0y + 117 - 47 = -15w + 14w + 5y for w. -5 Solve 4n - 5t + 216105 = 216075, 13 = -3n - t for n. -5 Solve n + s = 4, 1663375n = 1663379n + 8s - 24 for n. 2 Solve 12i + 250 = 25x, -4i - 66 = x + 22 + 14 for x. -2 Solve l + 211o - 216o = -277, -218 = -l - 4o for l. -2 Solve 3p + 31 = 12186v - 12190v, v = 3p + 41 for v. 2 Solve -55 = -7u + 2a + 28, 1348 - 745 = 4u + 5a + 789 for u. 1 Solve 22a + 2h - 712 = 0, -3a + 35 = 3h - 73 for a. 32 Solve 72375g = 72364g + 2x + 26, 4x = 3g - 14 for g. 2 Solve 104j = 5x + 150 - 36, -4j - 6x = -4x for j. 1 Solve -4c = -4l + 68, -555c + 703c + 2l + 2214 = -l for c. -15 Solve -7277b = -k - 7276b + 5, 0 = 6k - 3b - 30 for k. 5 Solve 5a - 85 = 57d - 53d, 3d = 2a - 62 for d. -20 Solve -3b = j + 4, 525j + 519j - 1575j + 3b = -530j + 4 for j. -4 Solve 4q + 4r + 294 - 254 = 0, q - 40 = 4r for q. 0 Solve p = -3z + 18, 0 = -725z + 726z + p - 4 for z. 7 Solve 4d + 28 = 4o, -87o - d - 328 = -57 for o. -3 Solve -6t = 11t - 2t + 5y + 195, 5y + 120 = 0 for t. -5 Solve 1401a - 2813a + 1434a = 2c + 34, -5a + 2c = 0 for a. 2 Solve 17g + 4a - 1528 = -39g, a - 2a + 170 = 5g + a + 27 for g. 27 Solve 0 = 4d - 4, -47d = -2s + 41d - 125d + 41d - 10 for s. -3 Solve 4l + 2a = 22, -3a + 13 = -76606l + 76602l for l. 2 Solve -22c - 4l + 520 = 0, -1	{ "pile_set_name": "DM Mathematics" }
153)/(-6). Solve b = -4b + s for b. 5 Let m(v) = -v3 + 3v*2 - v + 3. Let n be m(3). Solve n = 3d - 2d for d. 0 Let q(f) = -f + 1. Let b be q(-3). Suppose 13m = 12m + b. Solve -4z - m = -8 for z. 1 Let d(r) = -r*2 + 7r - 6. Let t be d(4). Let a be (-2)/(-6) - (-16)/t. Solve -a = g - 5 for g. 2 Let i be (-14)/(-63) - 230/(-18). Solve 2a - i = -3 for a. 5 Suppose 5w = -t - 2, 5t = -2w + 10 + 3. Suppose -5s + 27 + t = 0. Solve -sf + f = 0 for f. 0 Let n(h) = -5h - 3. Suppose 3o = 5j + 10 + 3, 5o - 5j = 15. Suppose -y - o = 3. Let i be n(y). Solve -5s - 3 - i = 0 for s. -4 Suppose -32 = -4w + 2n + n, 1 = -3w - 4n. Suppose 5v - 15 = 3u + 10, -w = -v + 2u. Suppose 1 = vs - 19. Solve -2r + 4r = s for r. 2 Let u(o) = 19o + 1. Let s(k) = k. Let t be s(1). Let f be u(t). Suppose -3y = i + 12, 2i - y + 2y = 1. Solve 8c - ic + f = 0 for c. -4 Let b = 34 + -22. Suppose -3o + 24 = 3u, -u + 11 + b = 4o. Suppose -6 = 4i + 2r, -5i = -r + 2 - 5. Solve i = -2c + oc - 12 for c. 4 Let f = 23 + -23. Solve -5m = -fm + 15 for m. -3 Let m(o) = 9o - 7. Let b be m(1). Let a be (-13)/((-3)/3). Solve bl = -l + a for l. 1 Let s = 6 - 2. Suppose 4 + s = 4d. Let r = -10 - -10. Solve 0 = -rh - 2h - d for h. -1 Suppose -2d + d - 4d = 0. Solve 10 = -5p - dp for p. -2 Suppose 0 = 3m - m + 10. Let z be (-2)/3(m + 2). Solve -z = 3r - 2r for r. -2 Suppose 0f = -5f + 65. Let r(v) = -8v3 - v2 + 1. Let x be r(1). Let c = x + f. Solve -cn - 36 = -11 for n. -5 Let c be (2/(-6))/(1/3). Let d(k) = -k*3 + 12k*2 - 12k + 13. Let i be d(11). Let j = i - c. Solve -f - jf = -8 for f. 2 Suppose 0 = 2s + 2a - 36, 4s - a - 45 = 4a. Solve -s = 4y + y for y. -3 Let x = 24 + -19. Solve l + x = -4l for l. -1 Suppose 5 = 5n - 4p + 1, -32 = -5n - 3p. Solve 0 = nu - 1 - 3 for u. 1 Let d(x) = -x*3 + 4x*2 + 5x + 5. Let c be d(5). Let n(w) = -2w - 3. Let m be n(-3). Solve -c = 2a - m for a. -1 Let w be 82/14 - 15/(-105). Solve -7u + 5 = -wu for u. 5 Let o(z) = z*3 - 2z*2 - 4. Let k = 9 - 6. Let y be o(k). Solve 0 = ys - 2s - 15 for s. 5 Suppose 4v - 17 - 7 = 0. Solve 2g + 4 = vg for g. 1 Let r be (-12)/((-24)/10 + 2). Suppose -5a + 0a + r = -3t, -3a = 4t - 18. Solve 2k - a = -0k for k. 3 Suppose -99 - 77 = -4n. Suppose 4o + 0o = n. Solve -5s + o - 1 = 0 for s. 2 Suppose 3q + 4q = -0q. Let u be (-22)/(-6) - 4/(-12). Let d = 8 + -4. Solve q = dy + u for y. -1 Let q(w) = w2 + 5w + 9. Let x be q(-4). Solve 6 = -xg + 1 for g. -1 Let g = 133 + -117. Solve -g = -3c - 7 for c. 3 Suppose c = 3c - 7c. Solve c = d - 5d for d. 0 Let g = 11 + 1. Solve 0 = 5t - g + 2 for t. 2 Suppose 2o - 5o = 0. Let l be 4 + o + -7 + 5. Solve l = -m - m for m. -1 Suppose 0 = -3j + d + 10, -3d - 1 = -3j + 11. Suppose -jc + 15 = 3. Let m = -1 - -1. Solve -cu + m - 12 = 0 for u. -3 Let y = -67 + 73. Solve yz - z = 20 for z. 4 Let r(h) = h*2 + 9h + 16. Let d be r(-7). Solve -dy = -0 + 10 for y. -5 Let q(d) = -d2 + 4d + 4. Let f be q(4). Let s(j) = -2j. Let a be s(-1). Solve fb + 8 = ab for b. -4 Let n be (-8)/(0 + (-8)/4). Let r = -4 + n. Solve rp - 6 = -3p for p. 2 Suppose -i + 0i + 14 = 5v, -3i + 6 = -3v. Let y(o) = o + v - 4 + 5. Let p be y(3). Solve 0 = -5a - 9 - p for a. -3 Let l be (-5)/10 - (-6)/(-4). Let w be (12/(-3))/(l + 1). Solve -3s - w - 2 = 0 for s. -2 Let p(d) = -d3 - 5d*2 - 2d + 1. Let k be p(-5). Solve 4u - k = 9 for u. 5 Let b(v) = 10v*2 - 7v + 4. Let d be b(4). Suppose 5l - d = 3l. Let n be 4/6 - l/(-6). Solve -4f + f = -n for f. 4 Let a(h) = h3 - 4h*2 + h - 4. Let i be a(4). Suppose -4n + 4f = 12, n - 2n - 3f + 9 = i. Solve -4t - 3 + 11 = n for t. 2 Let i(m) = -2m - 4. Let h be i(-3). Let d = 167 - 158. Solve -u = hu + d for u. -3 Suppose 0 = -9p + 5p. Suppose pw - 4w = -8. Solve -wd = -d - 4 for d. 4 Let t = 90 + -87. Solve -6x = -tx for x. 0 Suppose 4x + 28 = 2x. Let p be 2 + 7/(x/(-20)). Solve -2t - p = -2 for t. -5 Let w(f) = 5f + 1. Let l be w(2). Let j = 16 - l. Let y be (-1 + 2)/((-1)/(-2)). Solve -23 = jo + y for o. -5 Suppose -5j = 4w - 16, 3j + 53 = 5w + j. Let x(v) = v*3 - 9v*2 - v + 13. Let d be x(w). Solve -12 = df - 0f for f. -3 Suppose 2b - 20 = -3p + 6b, 0 = -3p + 2b + 16. Let j = 10 - p. Solve j = 2m + 2 for m. 2 Suppose n = -4n + 3m - 37, 2n + 3m - 2 = 0. Let h = n - -5. Solve 4a + h + 8 = 0 for a. -2 Let c(n) = -n + 4. Let j be c(4). Solve -4a + 4 + 4 = j for a. 2 Let g(r) be the third derivative of r4/6 - 5r*3/6 - 4r*2. Let a be g(5). Solve -x - a = -4x for x. 5 Suppose 0 = -13k + 45 + 33. Solve -9 = -3q + k for q. 5 Let j(m) = m + 9. Let s(d) = 2. Suppose -5r + 4o + 2 = 0, 2r - 4r + 2o = 0. Let q(x) = rj(x) - 9s(x). Let t be q(2). Solve -3 - 1 = -th for h. 1 Let b = -6 - -9. Let o = -105 - -106. Solve m - b = o for m. 4 Let x be (-1)/2-2-2. Let r(p) = -2p3 - p2. Let w be r(x). Suppose q = -28 + 32. Solve 4 = -qk + w for k. 2 Let b(w) = -5w - 1. Let a be b(-1). Suppose 5m + q + 1 = 0, -2m + 4m + 4 = -aq. Solve -4z + z = m for z. 0 Suppose 12 + 0 = 3a. Let u be (-6)/(-30) - (-18)/10. Suppose 0x - ux + 9 = b, -28 = -4x - ab. Solve -4k - 2 = -xk for k. -1 Let v(m) = -m2 - 9m - 5. Let z be v(-4). Solve -z = 4h - 3 for h. -3 Let b = 18 - 14. Suppose 0 = bz + 3l - 51, 2l - 3l + 57 = 4z. Solve -2t + 5t = -z for t. -5 Suppose 0 = -u - 1 + 4. Solve 0 = uh - 2 - 7 for h. 3 Let v(t) = -t3 - 4t*2 + 5t + 2. Let p be v(-5). Solve 0 = -5w + 7 - p for w. 1 Let d(u) = -5u - 10. Let o be d(-7). Solve -o = 4f + f for f. -5 Suppose -7 = -2u + 5. Suppose 0 = -3i + u. Solve 2r = -0 + i for r. 1 Suppose 5l - 4 = -2z, l - 2l + 6 = 3z. Suppose -i = i - 10. Solve l = -2m + m + i for m. 5 Suppose 3c - 28 = -4r, -r = 2r - 12. Solve 0 = -cn - 4 for n. -1 Suppose 0r + 3t + 3 = r, 3t = -2r + 15. Solve 2y - r = -0y for y. 3 Let d(l) = -l3 - 5l2 - 5. Let w be d(-5). Let j(h) = h2 + 2h + 1. Let p be j(w). Solve 2q + p = 6 for q. -5 Let b(d) = -4d - 3. Suppose -2y - 5 = 3y. Let w be 2/(y/1 + 0). Let u be b(w). Solve -up + 5 = 30 for p. -5 Let w = 152 + -151. Solve 0 = -2i + 3 - w for i. 1 Let m be 1-1 - 4(-1)/2. Solve -f + 2f = m for f. 1 Let k = -9 - -9. Solve k = -6v + 5v for v. 0 Let l be 1(4 - (2 - -1)). Let i = l + 7. Suppose 0 = a + 2 - 6. Solve -i = -ay + 2y for y. 4 Let i = -2 + 2. Suppose -j + 4j - 12 = i. Solve 4t = -0 + j for t. 1 Let o = -17 - -29. Suppose 4p - 4u = -15 - 1, -p + o = 3u. Let a be (0 + -1)1 - -21. Solve a = -pj - 5j for j. -4 Let x = 11 + -8. Suppose x + 7 = -5u. Let p = 2 - u. Solve pj = -j + 10 for j. 2 Let u be 0/((-4)/84). Solve u = -3c + 4 + 2 for c. 2 Suppose 5q + 2g = 12, 3q - 4q + 5 = 3g. Solve qy = 4y - 6 for y. 3 Suppose 2j - 3j = -1. Let k be ((-64)/24)/(j/(-3)). Solve 4q = -0q + k for q. 2 Let s(d) = -d*2 + 11d - 10. Let r be s(10). Suppose q - 3 = -1, r = -t - 3q + 5. Let c = -1 - t. Solve -4w = -c + 4 for w. -1 Suppose 0n = 9n - 180. Solve -4b + 0 = n for b. -5 Suppose 22 = 4p + 2. Suppose 2l + 4 = -5g, -pl + 0l + 36 = g. Solve -l = -5o - 3 for o. 1 Let s be (54/36)/(2/4). Solve -so = -o for o. 0 Let z be 0 - 2/(-2) - -3. Suppose 4q - zu = 80 - 8, -4q - 5u + 45 = 0. Solve -6w + w + q = 0 for w. 3 Let k(g) = -g2 - 4g. Let z be k(-2). Solve zw - 14 = 6 for w. 5 Let m(q) = -q2 + 5q - 4. Let a be m(3). Suppose -3 = -3w + c, -ac + 6 = -3w - 4c. Solve w = -k + 2k - 1 for k. 1 Suppose -p - 2 = -d - 4, -2d + 8 = p. Solve -d = -2g - 8 for g. -3 Let h(k) = k3 + 5k*2 - 8k - 4. Let l be h(-6). Suppose -3t - 8 = 2d, -2t - 12 = 5d + l. Let c = d - -10. Solve j - 5 = -c for j. -1 Suppose -y + 18 = -3s, 2y - 14 + 2 = -2s. Solve 4n + y + 7 = 0 for n. -4 Let y = 0 + 4. Solve -3 = -3w + yw for w. -3 Let q be 8/24 - 2/6. Solve q = 4w + 3 + 1 for w. -1 Let v = 28 - 22. Let c be v/945/10. Solve 5 + 10 = -cb for b. -5 Suppose 0 = 5h - 66 - 9. Solve 2q = -h + 5 for q. -5 Suppose -u + 6u - 22 = b, 2u = -4b. Let q be (-1)/(-1) - (b - -3). Solve q = 4o + 12 - 0 for o. -3 Let q(f) = -f3 - 5f*2 + 4f - 9. Let t be q(-6). Let i(h) = -h	{ "pile_set_name": "DM Mathematics" }
s, 2s = -6. List the prime factors of g. 2, 241 Let g = 6 + -6. Suppose r + 101 = -5y + 252, -25 = -y + 5r. Suppose -2a + 5a - y = g. List the prime factors of a. 2, 5 Let h(i) = -38i*2 - 5i - 1. Let u be h(3). Let r = -179 - u. List the prime factors of r. 179 Suppose 3t = 5i - 18, 2t = -3i + 9 - 2. Suppose 0 = q + 3, v + iq = -0 + 57. List the prime factors of v. 2, 3, 11 Let j = 10 - 8. Suppose -7d + jd + 385 = 0. Suppose 163 = 6v - d. List the prime factors of v. 2, 5 Let w be (-2 - -1)-1 + 1. Suppose -3k = -2k - wu + 13, u = -3k - 4. Let q = k + 26. List the prime factors of q. 23 Let v = 2336 - -2146. What are the prime factors of v? 2, 3, 83 Suppose 3s + 15 = 5u, -u - 5s + 5 = 30. Suppose -6 = -3o - u. Suppose 0 = 3r - 4r, -4q = or - 48. List the prime factors of q. 2, 3 Let a be (-141)/(-13) + (-114)/(-741). Let c be -120(0 - (-2)/(-4)). Suppose -6b - c = -ab. What are the prime factors of b? 2, 3 Let r be -1 + 1 - (7 + 175). Let j = r + 278. What are the prime factors of j? 2, 3 Suppose -13 - 7 = -10n. What are the prime factors of ((-2)/n)/((-105)/(-27) - 4)? 3 Let r(o) be the second derivative of -o3/6 - 19o*2/2 + 6o. Let h be r(-13). What are the prime factors of 15/(1 + h)-1? 3 Suppose m - 2d = 4, -5m + 4d + 15 = -17. Let s = m - 6. Suppose -sz + 2 = -10. List the prime factors of z. 2, 3 What are the prime factors of (-637)/(-2) + 0 + 12/24? 11, 29 Let r(b) = b - 9. Let z(t) = -3t + 17. Let w(v) = -5r(v) - 2z(v). Let c be w(-7). List the prime factors of 70/c - 1/2. 17 Let q(n) = n + 10. Let a be q(-7). Suppose -5v + 2v + 24 = 0. Suppose -5x + 38 = -4l, -ax + vx - 35 = 5l. List the prime factors of x. 2, 5 Suppose 4l + l = -3p + 13229, -8819 = -2p - 3l. List the prime factors of p. 2, 19, 29 Suppose 4c = 1711 + 521. List the prime factors of c. 2, 3, 31 Suppose -i = -3i + m + 162, 320 = 4i - 4m. What are the prime factors of i? 2, 41 Let t(i) = 3i*2 + 26i + 65. Let o be t(-17). Let a = o + -322. List the prime factors of a. 2, 3, 7 Let r be (2 - 10)/(-1(-6)/(-786)). Suppose -7p + 2p + 1350 = -3c, -4p + r = 4c. What are the prime factors of p? 3, 89 Suppose 506p = 513p - 4305. What are the prime factors of p? 3, 5, 41 List the prime factors of (-16)/416 + 55698/156. 3, 7, 17 Let s = -24 - -24. Suppose s = -3c, 10 = t - 5c - 2. What are the prime factors of t? 2, 3 Let x = 67 + -63. List the prime factors of 28/(-12)-3(4 + x). 2, 7 Suppose -2n + k = -1270, 0k = -3n - 2k + 1905. List the prime factors of n. 5, 127 Let h(p) = -17p - 4. Suppose -2t - 4x = -4t - 4, -4x - 4 = 2t. What are the prime factors of h(t)? 2, 3, 5 Let d = 15 + -12. Suppose 2s = 4l - 134, 2l = s + ds + 82. Let x = -12 + l. List the prime factors of x. 19 Suppose -2c + 20 = -4c. Let f(j) = -19j - 208 + 207 + 12j. List the prime factors of f(c). 3, 23 Let w be 1/(-6) + (-1052)/24. What are the prime factors of 2 - ((w - -4) + 2)? 2, 5 Suppose -n + 10 = -7. Let t = n - -39. List the prime factors of t. 2, 7 What are the prime factors of ((-12760)/16)/(-2(-3)/(-12))? 5, 11, 29 Suppose a = -3a. Suppose 3i - u = -au + 5, 3i = 2u + 4. Suppose -iz = -4z + 40. What are the prime factors of z? 2, 5 Suppose -2q = -5 + 1. Suppose -4i = -8i + 3t + 315, 0 = -4t - 20. Suppose -qj + i = j. What are the prime factors of j? 5 Suppose 2y = -j + 1683, 51y + 840 = 52y + j. List the prime factors of y. 3, 281 Suppose 64 - 168 = 4c. Let g = -24 - c. Suppose 54 - 12 = gy. What are the prime factors of y? 3, 7 Let x be (-2)/(-6) - (-272)/(-6). Let u = 51 + x. List the prime factors of u. 2, 3 Let d be (-795)/35 + 2/(-7). Let o = -20 - d. Suppose -oq - 4a = -211, -4q + 4a + 273 = a. What are the prime factors of q? 3, 23 Let q = -1055 - -4210. List the prime factors of q. 5, 631 Let b be (-2 + 3)-1-8. Suppose 0 = -4f + 2f + b. Suppose 42 = i + n, 0 = -0i + 2i - fn - 114. List the prime factors of i. 47 Let r(t) be the first derivative of t3 + t2 - t + 8. Let i be r(-7). Suppose 0 = 3j + 39 - i. List the prime factors of j. 31 Suppose -22352 - 17272 = -52y. What are the prime factors of y? 2, 3, 127 Let f be (1 + 5)(-10)/15. Let w(s) = 6s*2 + 7s + 8. Let p be w(f). What are the prime factors of p/(-8)(2 + -4)? 19 Let d(r) = -r3 + 15r*2 + 18r - 24. Let n be d(16). What are the prime factors of (-3 + (92/n - -2))12? 2, 3, 7 Let t(r) = 9r - 1. Let j be t(1). Let s = -43 - -42. Let u = j + s. List the prime factors of u. 7 Suppose 5x + 2v + 2v + 1 = 0, -3v = -x + 15. Suppose -2a - a = -3j - 192, 0 = 5a - xj - 330. What are the prime factors of a? 3, 23 Let o(u) = -u*2 - 6u + 2. Let v be o(-6). Suppose -vm + 3c + 15 = -45, 64 = 2m - c. What are the prime factors of m? 3, 11 Let h be (1 - -5)(-6)/(-4). Let b be (144/10)/(h/60). Suppose 2z = -2z + b. List the prime factors of z. 2, 3 List the prime factors of ((-62)/6)/((-3)/(-540)-1). 2, 3, 5, 31 Let b = 6358 - 3289. What are the prime factors of b? 3, 11, 31 Let s be (0 + -3 - -301) + -4. Suppose -s = 5u - 959. What are the prime factors of u? 7, 19 Let b(z) be the third derivative of z5/120 + z4/3 + z*3/3 - 5z*2. Let c(j) be the first derivative of b(j). List the prime factors of c(-6). 2 Let t(f) = -2f - 5. Suppose 25 = -0v - 5v + 5d, d - 9 = 2v. Let c be t(v). Suppose -cu = -146 + 2. List the prime factors of u. 2, 3 What are the prime factors of (-25)/(-4 - (-114)/30)? 5 Suppose 0w + w - 50 = 3q, 5w + 4q - 326 = 0. Let o = w - 17. Let l = 65 - o. List the prime factors of l. 2, 5 Let g(w) = 3w + 21. Let z be g(-9). List the prime factors of ((-2)/z)/(((-5)/(-2820))/1). 2, 47 What are the prime factors of 7/((-21)/(-12)) - (2 - 430)? 2, 3 Let o be 10/((-6 + 4)-1). Suppose -3l = -ol + 178. List the prime factors of l. 89 Let u be (-80)/(-4) - 4 - -2. Suppose -7s - 781 = -us. List the prime factors of s. 71 Let u be 251(4 + -5 + 3). Let z = u - 308. List the prime factors of z. 2, 97 Suppose -d + 3k + 38 = -489, -1038 = -2d + 2k. What are the prime factors of d? 5, 103 Let q(m) = -m - 20. Let o be q(-23). Suppose -3j = oj - 594. List the prime factors of j. 3, 11 Let r(p) = p3 + 4p + 75. What are the prime factors of r(9)? 2, 3, 5, 7 Let u be ((-4)/(-5))/((-10)/(-25)) + 60. Suppose -5v = 3c - 230, c - v - u = v. What are the prime factors of c? 2, 5, 7 Let o(t) = t*2 + 4t - 3. Let f(a) = -a*3 + 11a*2 - 11a + 5. Let m be f(10). What are the prime factors of o(m)? 2 Let s(j) = -j*3 + 16j*2 + 3j - 21. Suppose -n = -3n + 38. Suppose -21g + 32 = -ng. List the prime factors of s(g). 3 Let h = 21 - 42. Let c = 55 - h. Let w = c + -52. List the prime factors of w. 2, 3 Let m(l) = 2l*2 - 11l + 22. What are the prime factors of m(-13)? 503 Suppose 0d + 5p = 3d - 27, 0 = d + 4p + 8. Suppose d = 4w - 336. List the prime factors of w. 5, 17 Let j(o) = -o2 - 12o - 3. List the prime factors of j(-3). 2, 3 Let t(q) be the first derivative of -q*4/4 + 3q3 + q2/2 + 9q - 4. What are the prime factors of t(5)? 2, 3, 19 Let m = 4754 + -2572. List the prime factors of m. 2, 1091 Let n(u) = 169u3 + u2 - 4u + 2. List the prime factors of n(2). 2, 3, 5 Suppose 17l - 14872 = -9l. What are the prime factors of l? 2, 11, 13 Let y(o) = o3 + 2o*2 - o. Let z be y(1). Let t(f) = -20f*3 - 2f*2 - 2f + 1. Let u be t(z). What are the prime factors of (-475)/u + 4/18? 3 Let x = 1472 - 1157. What are the prime factors of x? 3, 5, 7 Let i(z) = z*3 + 30z*2 - 10z*2 - 3z - z - 10z2 - 3. Let s be (-2)/1 + -10 - -2. What are the prime factors of i(s)? 37 Let r = 666 + -441. What are the prime factors of r? 3, 5 Suppose -33a = 27a - 181260. List the prime factors of a. 3, 19, 53 Suppose 32y + 22y - 78192 = 0. What are the prime factors of y? 2, 181 Suppose 0 = -4w - 5d - 3 + 1, -4w - d + 6 = 0. Suppose 0 = -0u + wu + 196. What are the prime factors of u/(-3) + (-2)/3? 2 Suppose -5o = -22 + 27. Let m be o/(-5) + 184/(-20). What are the prime factors of ((-8)/12)/(3/m)? 2 Let j be 45 + (-4 + 8)/4. Suppose 49x - 411 = j*x. List the prime factors of x. 137 Let o be 3/(3/(-14)) + 0. Let y be 5 - 7/(o/(-4)). Suppose 34 = s + y. Li	{ "pile_set_name": "DM Mathematics" }
- 7z4/5 + 8z*3/15 - 1. Factor n(t). 4t*2(t - 1)(5t - 2)/5 Let r(p) be the third derivative of -11p7/210 + 61p*6/360 - 8p5/45 + p4/18 - 11p2. Suppose r(k) = 0. Calculate k. 0, 2/11, 2/3, 1 Let l be 2 + 0 - (-249)/(-126). Let h(n) be the third derivative of 0n - 1/735n7 - ln*4 + 0n*5 + 0 + 1/210n6 + n2 + 1/21n3. Factor h(f). -2(f - 1)*3(f + 1)/7 Let r be (-2)/(-3) + (0 - (-6)/(-9)). Suppose -1/4z3 + 1/4z + rz2 + 0 = 0. Calculate z. -1, 0, 1 Let p(b) be the third derivative of 0 + 1/120b*6 + 2b*2 + 0b*3 + 0b - 1/36b4 - 1/180b*5. Determine o so that p(o) = 0. -2/3, 0, 1 Solve 29x*2 + 63x + 3x2 + 13x*3 + 32x*3 - 59x - 81x4 = 0. -2/9, 0, 1 Factor 16/9x + 4/9x5 + 16/9x*2 + 0 - 8/9x*4 - 4/3x*3. 4x(x - 2)2(x + 1)2/9 Let o(c) be the second derivative of -c4/6 + 2c3/3 - c2 + 6c. What is f in o(f) = 0? 1 Let c(l) = -l5 + l4 + l*2 + l + 1. Let p(j) = -14j2 + j3 + 6j4 + 21 - 12j - 5j3 - 23. Let g(h) = -2c(h) + p(h). Solve g(x) = 0. -1, 2 Let m(f) be the second derivative of -49f6/90 - 7f*5/15 + 5f*4/4 + 14f*3/9 + 2f*2/3 + 5f. Solve m(u) = 0. -1, -2/7, 1 Let z(s) = -7s - 6 + 4 + s2 + 0s. Let g be z(10). Solve -21d3 + 11d*2 + 4d*3 + 8 - gd + 3d4 + 23d*2 = 0. 2/3, 1, 2 Let y(u) be the first derivative of 10u*2 + 1 - 2u*3 - 8u - 9/4u4. Factor y(a). -(a + 2)(3a - 2)2 Suppose 6/7 + 16/7p + 10/7p2 = 0. What is p? -1, -3/5 Let s(w) be the third derivative of 4w*2 + 0w + 1/150w5 + 0 - 1/200w*6 + 0w*7 + 0w*4 + 0w*3 + 1/1680w8. Factor s(k). k2(k - 1)2(k + 2)/5 Let p(j) be the third derivative of -j11/110880 - j10/50400 - j5/60 - j2. Let d(z) be the third derivative of p(z). Suppose d(s) = 0. Calculate s. -1, 0 Let h(i) be the third derivative of -i5/120 - i4/24 - i*3/12 + 9i2. Factor h(c). -(c + 1)2/2 Let z be (-30)/(-55) + 59/33. Factor zl2 + 2/3 + 3l. (l + 1)(7l + 2)/3 Let p(u) be the first derivative of u4/24 + u3/6 + u*2/4 - 2u - 3. Let s(m) be the first derivative of p(m). Factor s(z). (z + 1)*2/2 Factor 0f*2 + 0 + 3/2f*3 + 0f. 3f3/2 Let x(h) be the third derivative of h5/240 - h4/48 + h3/24 - 7h2. Solve x(u) = 0 for u. 1 Let a(o) = -o3 - 5o2 + 5o + 3. Let r be a(-6). Let p = r - 7. Find t such that 3tp + 2t - 2t2 - 1 - 2t = 0. -1, 1 Suppose -5j + 7 + 8 = 0. Find f such that f5 + 4f*4 - 2f - 62f3 - f4 + 63f*3 - jf*2 = 0. -2, -1, 0, 1 Let b = -43 + 133/3. Let u(d) be the first derivative of -bd*3 - 3 - 5/2d*2 - d. Factor u(m). -(m + 1)(4m + 1) Suppose 0 = -8a + 3a. Factor a + 0 + v2. v2 Let r(i) be the third derivative of -i5/240 - 5i4/96 - i3/6 - 20i2. Factor r(v). -(v + 1)(v + 4)/4 Let -4/5j4 + j3 + 1/5j*5 + 0 - 2/5j*2 + 0j = 0. Calculate j. 0, 1, 2 Let i be ((-1)/(-2))/(1/18). Let k = i - 5. Factor 6x2 + 4x - kx2 - x2 + 4. (x + 2)2 Suppose 4z + 5v + 9 - 32 = 0, -v = -2z + 1. Factor zp4 + 2p3 - p2 - 2p2 - 2p5 + p2. -2p2(p - 1)*2(p + 1) Let w(f) be the first derivative of 1/2f2 - 1 + 1/48f*4 - 2f + 1/6f3. Let y(q) be the first derivative of w(q). Factor y(c). (c + 2)2/4 Let o(n) = 2n*4 - 4n + 7n5 + 13n*4 - 7n + 8n3. Let f = 22 - 44. Let r(l) = -2l*5 - 4l*4 - 2l*3 + 3l. Let a(w) = fr(w) - 6o(w). Factor a(q). 2q3(q - 2)(q + 1) Let h(v) be the second derivative of v4/30 + v. Solve h(l) = 0. 0 Suppose -5g = -2 - 8. Suppose -t = gt. Factor t + 4/3i*5 + 13/3i*4 + 7/3i*2 + 1/3i + 5i3. i(i + 1)*3(4i + 1)/3 Suppose -5k - 27 - 23 = 0. Let v be 4/20 + (-38)/k. Factor -vm2 - 6 - 4m + 4 + 2m2. -2(m + 1)*2 Suppose 5t + 10 = -5. Let h = 5 + t. What is d in -4d + 4 - 2d2 - 4 - h = 0? -1 Let t(q) be the second derivative of -q4/36 + 2q3/9 - q2/2 + 6q. Factor t(i). -(i - 3)(i - 1)/3 Suppose d - t - 19 = 5, 0 = -5d - 5t + 90. Solve 0 - 16v*2 + 4v + dv4 + 0 + 10v*3 - 9v*3 = 0. -1, 0, 2/7, 2/3 Let d = 1880/7 - 266. Factor -12/7h - 2/7h2 - d. -2(h + 3)*2/7 Let x(j) = -3j*3 - 4j*2 + 6j + 6. Let f(b) = -b*2 + b + 1. Let n(d) = 6f(d) - x(d). Factor n(i). i*2(3i - 2) Let i(r) be the first derivative of -r6/15 + r4/6 + r + 1. Let n(d) be the first derivative of i(d). What is t in n(t) = 0? -1, 0, 1 Let f(y) be the third derivative of 0 + 1/30y*5 + 1/6y*4 + 0y + 1/3y3 - 2y*2. Suppose f(t) = 0. Calculate t. -1 Let n(j) be the first derivative of 0j*2 + 0j*3 + 3 + 0j - 1/16j4. Factor n(z). -z3/4 Let a(w) = 9w*2 + 12w. Let y(r) = -10r2 - 12r. Let u(f) = -6a(f) - 5y(f). Factor u(g). -4g(g + 3) Factor 10z3 - 6z + 4 - 2z2 + 4z*3 - 8z*3 - 2z*4. -2(z - 2)(z - 1)2(z + 1) Let s(v) = -v - 3v + 5v + 0v. Let y(q) = 3q*2 + 9q - 6 + 6. Let b(m) = -6s(m) + y(m). Determine c, given that b(c) = 0. -1, 0 Let b be ((-5)/(-10))/((-5)/10) + 3. Factor 1/5c*3 + 0 - 1/5c*b + 0c. c*2(c - 1)/5 Let g(l) = l + 12. Let h be 18/46/(-3). Let o be g(h). Determine m so that -4m*3 + 0m*2 + 3mo - m2 = 0. -1, 0 Let b(v) be the second derivative of v6/45 + v5/10 + v4/6 + v3/9 + 21v. Factor b(g). 2g(g + 1)3/3 Let b be (-2 - -6) + (-94)/24. Let d = b - -7/12. Determine z, given that 1/3z - 2/3z2 + d - 1/3z*3 = 0. -2, -1, 1 Let b(w) = 3w*3 - 59w*2 + 128w. Let j(r) = -2r3 + 30r*2 - 64r. Let i(u) = -2b(u) - 5j(u). Let i(l) = 0. What is l? 0, 4 Let j(k) be the first derivative of k6/45 + k5/30 - 2k + 1. Let t(l) be the first derivative of j(l). Let t(b) = 0. What is b? -1, 0 Let g(i) be the third derivative of -i8/378 + i7/945 + i6/27 - i5/54 - 4i*4/27 + 4i*3/27 + 39i*2. Solve g(b) = 0 for b. -2, -1, 1/4, 1, 2 Let f be (-4)/4(-5)/90. Let r(c) be the third derivative of 1/36c4 + 0c + 0 + c*2 + 1/180c*5 + fc*3. Determine i so that r(i) = 0. -1 Find m, given that -3m*4 - 3m*3 - 8m*2 + 12m*3 + 5m*2 + 6 - 9m = 0. -1, 1, 2 Let y be (-40)/326/25. Let z = y + 11/20. Factor 0 + 1/4k*5 + 0k + 1/4k2 - zk*3 - 1/4k4. k2(k - 1)2(k + 1)/4 Suppose 3n + 3o = -3, -n - 9o = -4o + 17. Factor 1/6 - 3/2yn - 7/6y + 5/2y2. -(y - 1)(3y - 1)2/6 Let m(g) be the third derivative of g6/60 + 2g5/15 + g4/3 - 4g2. Solve m(z) = 0 for z. -2, 0 Suppose 4l - 5l + b + 3 = 0, -2l - 1 = 5b. Find v such that -vl + v2 + 6v - 4 + 1 - 3v2 = 0. 1 Factor 14c + 10c5 - 69c + 25 - 35c4 + 8c*2 + 50c*3 + 2c*2 - 5c*5. 5(c - 5)(c - 1)3(c + 1) Let k(c) be the second derivative of -7/15c6 + 4c + 1/5c5 + 4/3c*4 - 4/21c*7 + 2/3c3 + 0 - c2. Suppose k(w) = 0. Calculate w. -1, 1/4, 1 Suppose -2s + 5s - 24 = 0. Let d(p) be the first derivative of 38/3p3 + 2 + 91p*4 - 20p*2 + 294/5p*5 - sp. Find a, given that d(a) = 0. -1, -2/7, 1/3 Suppose h - 4h = 0. Factor 2m*3 - 6m + 0m + hm + 4m. 2m(m - 1)(m + 1) Let h(p) be the first derivative of p*6/9 + 4p*5/15 - 4p3/9 - p2/3 - 1. Let h(v) = 0. Calculate v. -1, 0, 1 Factor -2q4 + 48q*2 - 88q*2 + 38q*2 - 4q*3. -2q*2(q + 1)*2 Determine n so that 4n - 2n5 - 4n - 16n3 - 28n*4 - 6n*5 + 16n2 = 0. -2, 0, 1/2 Let m be (2/(-3))/(4/(-30)). Factor j3 + 4j3 - j - jm + 0j*3 - 3j*3. -j(j - 1)*2(j + 1)*2 Let a = 17 + 12. Let t = a - 144/5. Factor -1/5r*2 + tr + 0. -r(r - 1)/5 Let u(p) = -8p3 + p2 + 8p - 8. Let g be (-1)/1(-2 - 5). Let b(o) = -7o3 + o2 + 7o - 7. Let y(a) = gb(a) - 6u(a). Solve y(z) = 0. -1, 1 Let t(y) be the second derivative of -1/60y5 + 0 + 0y*2 - 1/126y*7 + 0y*3 - 1/45y*6 - y + 0y4. Determine m, given that t(m) = 0. -1, 0 Let i(j) = j3 + 6j2 - 8j - 3. Let c be i(-7). Suppose l + 6 = 4w, -3w - 1 = -4l + 1. Factor 3h*4 - 1 + 0h - whc - 2h*3 + 2h. (h - 1)*3(h + 1) Let w(h) = -h*2 + 3h. Let z be 1/4 + 9/(-4). Let f(k) = -k + 1. Let j = -2 - -1. Let l(m) = jw(m) + zf(m). Factor l(o). (o - 2)(o + 1) Suppose -25 = -2b - 5d, 3d + 35 + 12 = 5b. Let a be (-4)/b3/(-3). What is o in 8/5o + 26/5o*3 + 0 + 12/5o*4 + 24/5o*2 + ao**5 = 0? -2, -1, 0 L	{ "pile_set_name": "DM Mathematics" }
a(-6). -6 Let r(k) = -k*3 + 21k*2 + 23k - 4. Give r(22). 18 Let z(y) = -y*3 - 5y*2 + y - 5. Give z(-6). 25 Let b(f) = -4f*2 - 36f + 7. Calculate b(-9). 7 Let g(y) = 7y3 + 2y + 1. Calculate g(-1). -8 Let j(t) = 17t - 18. Calculate j(6). 84 Let r(w) = 4w + 17. Give r(-7). -11 Let o(p) = -2p3 - 9p*2 + 7p + 2. Determine o(-5). -8 Let g(q) = q - 1. Determine g(-5). -6 Let w(s) = 6s + 86. What is w(-14)? 2 Let j(f) = f3 + 5f*2 - 3f - 3. Give j(-6). -21 Let q(p) = p*2 + 5p + 6. Calculate q(-4). 2 Let h(j) = -99j + 582. What is h(6)? -12 Let b(u) = u3 + 2u*2 - 39u - 96. Calculate b(-6). -6 Let q(a) = -4a + 74. Calculate q(16). 10 Let h(b) = -b3 - 6b*2 - 4b + 5. Give h(-4). -11 Let w(m) = -13m + 54. Give w(8). -50 Let x(n) = n3 + 3n*2 + n - 10. Give x(-3). -13 Let k(b) = 2b*2 - 106b - 103. Determine k(54). 5 Let x(s) = 20s + 53. Determine x(-7). -87 Let g(n) = -5n*2 - 4n + 4. What is g(-2)? -8 Let y(m) = -7m + 35. What is y(5)? 0 Let s(b) = b2 + 8b - 9. Give s(-9). 0 Let c(j) = -j*2 + 34j + 194. Give c(-5). -1 Let m(v) = -v*3 - 2v + 1. Give m(3). -32 Let h(m) = -m*2 - 27m - 38. Calculate h(-24). 34 Let o(d) = -d*2 + 17d + 10. Give o(12). 70 Let j(n) = -n. Determine j(12). -12 Let l(q) = -q*2 - 1. Give l(6). -37 Let h(c) = 20c3 - c2. Calculate h(1). 19 Let t(l) = l - 5. Give t(0). -5 Let f(v) = v*2 - 7v + 5. Calculate f(2). -5 Let x(g) = g*3 + 4g2 - g + 4. Give x(0). 4 Let q(x) = x3 - 8x2 + 7x - 6. What is q(3)? -30 Let d(x) = -x + 3. Calculate d(1). 2 Let x(b) = -11b2 - b + 1. Determine x(1). -11 Let r(j) = 4j + 35. Determine r(-8). 3 Let m(l) = -l*3 + 33l*2 + l - 25. Determine m(33). 8 Let t(u) = -4u2 - u + 2. What is t(2)? -16 Let b(x) = x2 - 14x + 6. Calculate b(14). 6 Let v(g) = 2g + 2. Calculate v(2). 6 Let i(u) = -u*3 - 6u*2 - 2. Give i(-5). -27 Let m(c) = 4c + 54. Determine m(-15). -6 Let u(p) = p*3 + 15p*2 - 23. Give u(-15). -23 Let t(x) = 4x - 15. Calculate t(6). 9 Let p(m) = 11m - 28. Determine p(3). 5 Let a(x) = x2 + 8x + 8. What is a(-12)? 56 Let z(m) = -m*2 - 16m - 37. What is z(-3)? 2 Let k(o) = -19o + 121. What is k(7)? -12 Let h(x) = x - 9. Calculate h(5). -4 Let n(x) = 28x - 55. Give n(2). 1 Let s(z) = -39z - 237. Give s(-6). -3 Let x(p) = 2p*2 + 16p + 3. Give x(-9). 21 Let j(v) = -132v - 524. Give j(-4). 4 Let l(h) = h3 - 10h*2 + 4h + 2. Give l(8). -94 Let z(v) = 3v + 1. What is z(3)? 10 Let a(r) = 6r - 72. Give a(11). -6 Let n(t) = 2t2 - 17t + 17. Calculate n(4). -19 Let a(l) = l*2 + 74. What is a(0)? 74 Let b(f) = 3f*2 + 7f + 4. What is b(-5)? 44 Let r(o) = -o*3 - 4o*2 + 5o. Determine r(-4). -20 Let v(r) = 14r. What is v(1)? 14 Let c(f) = -f3 - 3f*2 - 3f - 3. Give c(-3). 6 Let b(m) = 2m2 + 4m - 10. Calculate b(2). 6 Let r(d) = -d*2 - 5d + 7. Give r(3). -17 Let r(z) = -z*2 + 3z + 4. Calculate r(-2). -6 Let c(y) = -4y3 + 17y*2 - 5y + 4. What is c(4)? 0 Let m(a) = -99a + 583. Give m(6). -11 Let r(g) = g3 - 33g*2 - 35g + 54. Calculate r(34). 20 Let a(u) = 78u - 5. Determine a(2). 151 Let t(u) = -u2 - 9u + 36. What is t(-12)? 0 Let k(n) = n + 17. Calculate k(-14). 3 Let z(f) = f*2 - 5f - 112. Calculate z(-9). 14 Let u(c) = c*3 - 6c*2 - 29c + 2. Give u(9). -16 Let a(x) = -x*2 - 8x - 18. Give a(-5). -3 Let a(p) = -8p - 9. Determine a(5). -49 Let z(p) = 15p - 1. Determine z(-3). -46 Let s(m) = -m*3 + 9m*2 - 16m - 11. Give s(6). 1 Let z(p) = -6p2 - 6p + 4. Determine z(-3). -32 Let w(b) = b*3 - 10b*2 + 9b + 25. Give w(9). 25 Let i(b) = -17b + 20. Give i(2). -14 Let c(i) = 3i - 46. Give c(8). -22 Let i(b) = b*3 - 16b*2 - b - 11. Calculate i(16). -27 Let c(b) = -3b*2 - 3b - 4. What is c(3)? -40 Let x(w) = -9w + 48. What is x(9)? -33 Let f(v) = 2v*2 + 52v + 47. What is f(-25)? -3 Let l(b) = b*3 + 8b*2 - 2b + 5. Determine l(-8). 21 Let z(d) = 6d + 26. Determine z(-8). -22 Let r(d) = -34d*2 - 1. Give r(1). -35 Let s(x) = x - 12. Determine s(0). -12 Let h(c) = 5c2 + 1. Give h(2). 21 Let n(q) = -q2 + 19q + 6. What is n(21)? -36 Let k(f) = 4f + 27. Determine k(0). 27 Let h(k) = -5k + 4. Calculate h(3). -11 Let f(q) = -q2 + 11q - 17. Give f(8). 7 Let k(i) = -i*3 + 7i*2 + 11i - 7. Give k(8). 17 Let q(t) = 3t + 6. Calculate q(4). 18 Let i(o) = o3 - 13o*2 - 30o - 27. Determine i(15). -27 Let z(u) = 3u - 5. Determine z(8). 19 Let m(x) = -4x + 7. Give m(-3). 19 Let i(w) = 21w + 7. Give i(-4). -77 Let z(q) = -10q*2 - 3q + 2. Calculate z(-2). -32 Let i(g) = g*2 + 4g - 89. What is i(-12)? 7 Let k(c) = -c*3 - 6c*2 - c - 14. Determine k(-6). -8 Let f(t) = -35t3 + t2 - 1. Give f(1). -35 Let n(f) = -6f2 - 87f + 29. What is n(-15)? -16 Let j(x) = -x*2 + 27x + 55. Determine j(29). -3 Let k(c) = -c*2 - 11c - 18. Calculate k(-11). -18 Let s(m) = m + 17. Calculate s(16). 33 Let y(w) = -w*3 - 34w*2 - 53. What is y(-34)? -53 Let b(i) = -7i*2 - 13i - 38. Calculate b(-4). -98 Let v(x) = -x*3 - 5x2 + x - 5. Determine v(-6). 25 Let v(h) = -h3 + 8h2 - 7h - 11. What is v(6)? 19 Let l(v) = v*2 + 15v - 29. What is l(-17)? 5 Let d(z) = -3z2 + 7z + 18. What is d(-2)? -8 Let y(d) = 2d2 - 3d - 23. Give y(0). -23 Let s(g) = -2g2 + 5g - 2. Calculate s(0). -2 Let o(h) = -2h - 32. Calculate o(-11). -10 Let o(v) = 22v - 68. Determine o(7). 86 Let n(z) = -z*2 + 16z - 25. What is n(15)? -10 Let l(j) = -j*2 - 13j - 38. Give l(-9). -2 Let a(d) = d - 49. Give a(32). -17 Let l(r) = -r*3 - 9r*2 - 8r - 2. What is l(-6)? -62 Let a(i) = i*3 - 3i*2 - 3i + 8. Calculate a(4). 12 Let b(s) = -2s2 + 6s - 7. Give b(7). -63 Let w(b) = -b*3 - 11b*2 - 14b - 12. Determine w(-10). 28 Let c(l) = 3l3 + 14l*2 + 9l + 13. Determine c(-4). 9 Let y(m) = m + 13. Determine y(-12). 1 Let n(i) = i*3 - 18i*2 + 16i + 23. What is n(17)? 6 Let z(n) = -7n2 - 4n - 9. Determine z(-4). -105 Let d(v) = v*3 - 13v*2 + 9v + 6. Give d(12). -30 Let o(c) = -10c2 - 4c. Calculate o(-3). -78 Let m(t) = -t*3 + 6t*2 - 5t - 2. What is m(5)? -2 Let d(k) = -18k + 258. Give d(14). 6 Let v(u) = -u3 + 12u*2 - 11u - 10. Give v(11). -10 Let r(u) = -u*3 - 37u*2 + 25u + 927. What is r(-37)? 2 Let a(s) = -s*3 + 4s*2 + 12s. What is a(5)? 35 Let s(r) = r*3 - 4r*2 + 3r - 1. Give s(2). -3 Let a(s) = 72s + 1149. What is a(-16)? -3 Let y(h) = -2h*3 - 4h*2 - 4h - 6. What is y(-3)? 24 Let v(t) = -t*3 + 8t*2 - 9t + 10. Give v(7). -4 Let c(o) = -o*2 - 21o - 28. Determine c(-19). 10 Let w(z) = -27z + 3. Give w(2). -51 Let k(y) = y + 21. What is k(-23)? -2 Let f(p) = -18p3 - p2 + p. Determine f(1). -18 Let b(j) = j. Give b(-9). -9 Let u(b) = b*2 + 3b + 11. Calculate u(-5). 21 Let y(k) = 2k - 9. Calculate y(7). 5 Let h(p) = -p2 - 19p - 25. Determine h(-18). -7 Let q(t) = -t*3 - 16t*2 - 14t + 13. What is q(-15)? -2 Let g(f) = -f*3 + 5f*2 - 3f. Calculate g(3). 9 Let l(t) = -5t - 12. Determine l(-8). 28 Let l(h) = -2h*2 + 47h + 349. Give l(-6). -5 Let b(a) = -a*3 + 19a*2 - 18a + 14. Determine b(18). 14 Let k(q) = -q*2 + 30. Give k(-5). 5 Let h(g) = 7g - 27. Determine h(4). 1 Let t(q) = -8q3 + 4q - 5. Calculate t(2). -61 Let a(w) = -9w3 + w2 + 2w. Give a(-1). 8 Let l(g) = 4g - 13. Give l(6). 11 Let h(q) = 67q - 526. Determine h(8). 10 Let f(l) = -l*3 - 8l*2 + 4l - 11. Determine f(-8). -43 Let f(s) = -s*3 - 12s*2 + 14s - 10. Give f(-13). -23 Let q(j) = 5j + 14. Determine q(-6). -16 Let b(m) = 17m - 1. Give b(1). 16 Let k(v) = -v*2 + 12v + 10. Calculate k(13). -3 Let i(l) = l*3 + 10l*2 + 9l + 4. Calculate i(-8). 60 Let g(d) = d + 23. Calculate g(-20). 3 Let k(x) = 10x2 + 2. What is k(-1)? 12 Let n(t) = 4t + 5. What is n(-3)? -7 Let r(s) = -s*3 + 5s*2 + 2s - 10. Give r(5). 0 Let w(x) = 13x2 - 960x - 143. Give w(74). 5 Let i(c) = c*3 + 37c*2 - 82c - 160. What is i(-39)? -4 Let x(h) = 18h + 64. Give x(-4). -8 Let w(x) = x3 - 7x2 - x + 8. Give w(7). 1 Let i(p) = -p3 - 33p2 - 63p - 23. Determine i(-31). 8 Let j(m) = m*2 - 20m + 28. Give j(17). -23 Let r(o) = -59o + 406. Calculate r(7). -7 Let l(x) = 6x + 39. Determine l(-6)	{ "pile_set_name": "DM Mathematics" }
ppose -11t + 14 = -41. Let p(d) = 6d*3 + 2d*2 - 5d - 11. Let g(b) = b3 - b2 - b - 1. Let y(m) = tg(m) - p(m). Calculate y(-7). 6 Let y(b) = -2b*3 + 30b2 - b + 18. Let n be 16 - (-9)/(7 + -16). Calculate y(n). 3 Let i(u) = u3 - 3u2 - 6u + 6. Suppose 14 = b + 2q, 9 + 37 = 5b + 4q. Suppose -5t + 0t - a + 21 = 0, 2t - b = 2a. What is i(t)? -2 Suppose m - 3m + 20 = 0. Let k(v) = -v*2 - 20v + 160. Let w be k(-26). Suppose 3a - m = 2t + 2t, -4t + w = 4a. Let u(j) = 2j2 - j - 2. Give u(a). 4 Let k(c) = -1 + 0 - c - 4. Let n(f) = f3 + 4f2 - f + 4. Let d be n(0). Determine k(d). -9 Let n(g) = 5g + 8g2 + 111 - 38 - 36 - 46. Let i(v) = -7v*2 - 5v + 9. Let f(k) = 7i(k) + 6n(k). Give f(-7). -5 Let o(s) be the second derivative of -s5/20 + s4/4 + 3s2/2 - 22s + 3. What is o(3)? 3 Suppose k - 4 = 1. Let z(l) = -3 - 20l2 - 4 + 21l*2 + 2549l - 2554l. Determine z(k). -7 Let b(r) = 3r - 11. Let s(u) = 4u - 13. Let v(g) = 5b(g) - 4s(g). Determine v(-7). 4 Let j(h) = 16h - 82. Let z be j(5). Let m(k) = -k*2 - 3k - 3. Determine m(z). -1 Let t(k) = 0k2 + 3k + 4k2 + k2 - k3 - k2 - 2. Suppose -8w = -7w - 2. Suppose -25 = -5r + 5s, wr + 0s - 10 = 4s. Calculate t(r). -12 Let o(w) = -w - 6. Let l be o(-9). Let x(f) = 6f + 9. Let i = 61 - 55. Let m(z) = 3z + 4. Let h(s) = ix(s) - 13m(s). What is h(l)? -7 Let c(i) be the second derivative of -i*3/6 - 7i*2/2 - 3i. Let l(z) = z + 13. Let o be l(-13). Give c(o). -7 Let f = -6 + 9. Let n be (-2 + 1)/(f/(-6)). Let x(b) be the first derivative of -2b3/3 + b2 - 2b + 7. Give x(n). -6 Suppose q + 32 = 4j, -j - 2j = 4q - 43. Let d = 11 - j. Let p(w) = 1 - w2 + 2w*d - 3 + w. Determine p(0). -2 Let w = -17 - -24. Let z(a) be the second derivative of -9/2a*2 - 5a - a*3 + 1/12a4 + 0. Give z(w). -2 Let n = 460 - 443. Let y(i) = -i3 + 18i2 - 16i - 10. Give y(n). 7 Let p(m) = 2m3 + 1. Let f(d) = d3 + d2 + 1. Let k(g) = -3f(g) + 2p(g). Calculate k(3). -1 Let z(i) = 0i - 4i + 3i + 7i. Let c(g) = -g2 - g + 57. Let v be c(-8). What is z(v)? 6 Let u(k) = 4k - 6. Let i be u(2). Suppose -io = -0 - 2. Let t(n) be the second derivative of -n3/3 - n2/2 + n. Determine t(o). -3 Let z(p) = -1 + 2 + 181745p - 181738p. Calculate z(-1). -6 Let t(c) = -c2 - 4c + 2. Let h be (-4)/(-6) + 15/(315/(-98)). What is t(h)? 2 Let g(v) be the second derivative of -v*3/3 - 3v*2 - 277v. Calculate g(0). -6 Let i(t) be the third derivative of t6/120 - t5/15 + t4/8 - t3/3 + 151t2. What is i(4)? 10 Let z(c) = -c2 + 8c + 8. Let x be z(8). Suppose 0 = -6d + xd - 4. Let n(f) = -2f2 - f - 2. Calculate n(d). -12 Let w be (-1)/(1/4) - -14. Suppose 5 + w = 5v, 4v - 28 = -4b. Let h(j) = 4j - 1. Calculate h(b). 15 Let d(y) = -y + 1. Suppose 3g + 9 + 9 = 0. Let j(s) = s*2 + 5s - 8. Let u be j(g). Let m(w) = 2w2 - 2. Let i be m(u). Calculate d(i). -5 Let a(t) = -t - 7t*3 + 5 + 0t - 3 + 0t3 + 9t*3. Let u = 5 + -7. Determine a(u). -12 Let l(u) = -5u - 1 - u*2 + 0u*2 + 3. Let s be 45/(-9)(3 + 44/(-20)). Determine l(s). 6 Let h be (-1 + 4 - 4) + -7. Let l(n) = -n - 3. Let c(x) = -1. Let d(f) = 2c(f) + l(f). Give d(h). 3 Let v(t) = -t2 + 5t + 4. Let n = -34 + 39. Calculate v(n). 4 Let n(m) = m*2 + 5m - 5. Let y = -110 - -104. Calculate n(y). 1 Let j(a) = 2a. Let x(s) = -4s + 6s - s - 10 - 2s. Let k = 14 + -21. Let g be x(k). Give j(g). -6 Suppose -b - a = -14, -3b + 10 = 4a - 36. Let h(d) = 94d - 95d - 3 + b. Give h(7). 0 Let u(a) = a*3 - 10a*2 - 13a - 6. Suppose 21 = 2g - 3y - 1, 0 = -5y. Determine u(g). -28 Let r(u) = 2u - 2. Let h(n) = -3n + 8. Let g(q) = h(q) + 2r(q). Calculate g(18). 22 Let m(l) = 57l - 29l + 12 - 29l. Let q(w) = w2 + 6w + 14. Let r be q(-6). Let k be m(r). Let n(j) = -5j + 2. Give n(k). 12 Let k(y) be the second derivative of -y5/20 + 2y*4/3 - 7y*3/6 + 4y*2 - 16y. What is k(7)? 8 Let o(n) = 2n + 9n*3 + 12n*3 - 13n*3 - 17n*3 + 1 + 2n*2. Calculate o(-1). 10 Suppose 2j + 3b = 106, 4b + 10 = -b. Let y = -50 + j. Let w(p) = -p. What is w(y)? -6 Let r(f) = 2f - 2. Let l = 279 + -278. Give r(l). 0 Let u(k) be the second derivative of -49k*3/6 + 3k2/2 - k - 207. Determine u(1). -46 Let h(m) be the third derivative of m5/60 + m*4/3 - 3m*3/2 + 30m2. Give h(-9). 0 Let l(f) = f3 + 7f2 + 5f - 6. Let a = 336 - 342. What is l(a)? 0 Let n(a) = a*2 + 5a - 4. Let l(w) = -2w2 + 8w + 20. Let m be l(-2). Let c(h) = -3 + 12h + 9 - h + 2h*2. Let s be c(m). Calculate n(s). 2 Let i(t) = 3t*2 - 2t - 2. Suppose -5f + 9 + 2 = -4n, -f = 3n + 13. Suppose o = -2o - 2w + 22, 0 = -4o - w + 26. Let g = o + n. Determine i(g). 6 Let f(k) be the first derivative of 0k2 + 4k - 1 - 1/3k3. Suppose 8z + 12 = 4z. Calculate f(z). -5 Let i(x) = 4x*3 + 8x*2 + x - 10. Let b(g) = -3g*3 - 7g*2 + 9. Let n(m) = -3b(m) - 2i(m). Let l be -1 - (-8)/((-1)/24). Give n(l). 3 Let o(y) = -y*3 - 5y2 + 2. Let t(r) = -r3 - 6r2 - 7r - 12. Let m be -2((-60)/(-8))/3. Let b be t(m). Determine o(b). -10 Let m(j) = -j3 + 4j*2 + 5j - 5. Let z = -17 - -17. Suppose 17s - 21s + 20 = z. Calculate m(s). -5 Let z(n) = -26 - 27 - 3n + 100 - 26 - 26. Determine z(0). -5 Suppose 2c - 19 + 7 = 0. Suppose 0 = 7t - 10t - c. Let n(b) = 5 + b*3 - 3b - 6 + 0. Determine n(t). -3 Let o(v) be the first derivative of -v*2/2 + 3v - 30. Determine o(11). -8 Let z(r) = -r*2 + 5r. Let y be z(3). Let h(c) be the second derivative of 1/2c4 + 0 + 1/3c3 + c2 - 1/20c5 - 11c. Determine h(y). 14 Let w(n) = n*2 + 4n + 2. Let h be w(-4). Let y(p) = -1 - p + 0 - 2 - p3 + ph. Suppose -3k - 5a = -25, -6 - 14 = -5k - 4a. Calculate y(k). -3 Let g(y) = -33y + 763. Let r be g(23). Let p(b) = b3 + 7 - 4b*2 - 2b - 1 - 4b. Give p(r). -18 Let j(y) = -2y - y - y*2 + 4 + y. Suppose 4t = -5c + 6t - 5, 0 = 3c + 4t + 29. Give j(c). 1 Let w(s) = 3s - 3s - 28 + 9s + 27. Calculate w(-1). -10 Suppose -5 = -n - 0. Suppose 5m - 5z = m + 17, nz = -5. Let y(x) = 3x - 4. Let p be y(m). Let o(u) = -u2 + 5u + 6. Give o(p). 6 Let w(c) = -12c2 + 1. Let j(k) = -k2 + 10k + 10. Let a be j(11). What is w(a)? -11 Let l(h) = h. Let q(w) = w*3 + 13w*2 + 13w + 28. Let d be q(-12). Suppose -2b - 8 + d = 0. Calculate l(b). 4 Let b(m) = 13m*2 + 4m + 18m2 - 5 - 30m*2. Let k be -3(-4)/24-8. Determine b(k). -5 Let v(o) = -o3 - 8o*2 - 6o + 6. Let c(m) = -8m - 23. Let w(q) = q3 + 16q*2 - 14q + 49. Let d be w(-17). Let k be c(d). Determine v(k). -1 Let c(u) = 5u - 14 - 9u + 5 - u + 8u. Give c(0). -9 Let f = -1 + 4. Let m(y) = y3 + y2 - 2 - 2y*3 + f + 3y*2 - 4y. Suppose 4n = 4b, b + 5n - n = 15. Calculate m(b). -2 Let v(o) = 7 + 7o2 + 10 - 23 + o3 + 3o + 21. Calculate v(-6). 33 Let k(n) = n3 + 7n*2 - 4n + 3. Suppose -23l - 27 = 4s - 22l, 5s + l = -35. What is k(s)? -29 Let g(l) = -5l2 - 4l + 2. Let f(a) = 4a2 + 5a - 3. Let u(o) = -4f(o) - 3g(o). Give u(-9). -3 Let x = 35 + -53. Let n = x - -20. Suppose 3j = -nj. Let h(z) = z + 1. Give h(j). 1 Let j(z) be the third derivative of -5z4/12 - z3/3 - 2z*2 - 259. Give j(2). -22 Let h(f) = -8f*2 - 1. Suppose -a + 0 = -5x + 6, -4x - 15 = a. Let m = a - -10. Calculate h(m). -9 Let v(b) = -5b - 11. Let s(p) = -1 + 18p - 31p + 14p. Let r(c) = -4s(c) - v(c). Calculate r(0). 15 Let o = -5 - -17. Let n be (-12)/16 - 27/o. Let b(a) = -5a2 + a - 1 - 4a - 5a3 + 4a3. Determine b(n). -10 Let y(a) = -a2 - 2a - 3. Let p = -165 - -36. Let j = 126 + p. Give y(j). -6 Let n(l) = -l3 - 10l*2 + 25l + 12. Let s be n(-12). Let r(x) = x3 - 28. Give r(s). -28 Let r(m) = m2 + 14m - 16. Suppose -27f + 31f - 61 = 5o, 0 = 5o + f + 66. What is r(o)? -29 Suppose -3q + 19a - 20a = 53, -2a = 4q + 72. Let y(o) = o*3 + 18o*2 + 18o + 13. Give y(q). -4 Suppose 0 = 3m - 6, 6m - 3m + 2 = 2u. Let n(p) = 2 + p + 3p2 - u + 3. Give n(-2). 11 Let b(k) = 2 + k3 - 5k2 - k2 + 9k2 - 2k. Let z(i) = -6i + i2 + 2 - 3i - 2*i. Let j be z(11). Calculate b(j). 18 Let v be (-44)/198 - (21/27 -	{ "pile_set_name": "DM Mathematics" }
is -19774.6908210531 - -0.4? -19774.2908210531 What is 28402560 plus 852008? 29254568 Put together -24.07671 and -22732279. -22732303.07671 -7721628.9+-5917 -7727545.9 Add -117318659451 and 0.3. -117318659450.7 Total of -235.5 and -75631803149. -75631803384.5 What is the difference between 11905 and -840416? 852321 Add 10.1250837 and 6455. 6465.1250837 Work out 7035696 + -5.9018. 7035690.0982 Add 46124637 and -4060. 46120577 Subtract 8497631741151 from -86. -8497631741237 Total of -8.184072 and 13228.9. 13220.715928 Add together -511181274652 and 14. -511181274638 What is 0.1 + 10168840666377? 10168840666377.1 Total of -2856.5 and -245601148. -245604004.5 Calculate 4579 - 13812.573533. -9233.573533 What is -167166556 take away -3035? -167163521 What is -287.8892301 take away -59? -228.8892301 -9.402355+-355 -364.402355 Calculate -0.032177 + -2723695278. -2723695278.032177 Subtract 59894516917679 from -0.4. -59894516917679.4 What is -119285697 + 238376? -119047321 Total of -193213206 and 500684. -192712522 -0.28+1.0117428574802 0.7317428574802 What is -913837 take away -144.3022? -913692.6978 Subtract -8 from -24278296234. -24278296226 What is -15026436.2 + -156910? -15183346.2 What is 47265524.1 minus -24535? 47290059.1 Calculate -5 - -3405394556306. 3405394556301 Add -0.3 and 1082642245736. 1082642245735.7 Sum -11289119129 and -1502. -11289120631 What is the difference between -386995 and 95526472? 95913467 What is 314.8659578 + -554735? -554420.1340422 What is -9166226980 + -2148? -9166229128 Put together -5037553145 and 0.18. -5037553144.82 Calculate 1944 - 14630972.624. -14629028.624 What is the difference between -733820094 and 33696.6? 733853790.6 What is the distance between -4 and 27562963849226? 27562963849230 Work out -4 + 13160.8893793055. 13156.8893793055 -1.2 + -742.1315665 -743.3315665 Calculate -2.14816 + -10954236.1. -10954238.24816 Add 0.1713 and 74651180. 74651180.1713 Calculate 0.11731 + 3483.41. 3483.52731 -58019848045271 - 7 -58019848045278 Calculate 1.815575 + -25.6382. -23.822625 What is -338.75118729 + 0.2428? -338.50838729 What is 0.1 minus 47781280453494? -47781280453493.9 Work out -1803720 + -17087567. -18891287 Calculate -12465.1 - -11206.03. -1259.07 Sum 3.47 and 644323713. 644323716.47 Put together -22033616482 and 6. -22033616476 Add -1072758.1 and -523798. -1596556.1 Subtract -0.31 from -48732231856. -48732231855.69 What is 3 - 0.09700976295? 2.90299023705 Put together -0.7591513 and 6205065. 6205064.2408487 Add together 0.479646 and 1755.573. 1756.052646 What is 724 plus -5535274.11? -5534550.11 What is the distance between 5000.479014 and 27? 4973.479014 What is the difference between 318 and 14542.95574425? 14224.95574425 Add -2952.2374 and -10285.455. -13237.6924 What is the distance between 2435762473 and -22655? 2435785128 What is 0.008 plus -3114485090036? -3114485090035.992 What is 1421651 - 1652502? -230851 What is -4.5754332 less than 411.86? 416.4354332 What is 1.4 minus 72814494587.33? -72814494585.93 What is the difference between 819108 and 15920? 803188 What is -5 minus 134368973486? -134368973491 What is the difference between 14731264947 and 0.28? 14731264946.72 -24791 + -10999.90053 -35790.90053 Work out -12.148 - 15211.235642. -15223.383642 Work out -392886 + -413031182. -413424068 Total of -71420294229 and -0.5. -71420294229.5 937 - 22676.83621 -21739.83621 Put together 104293 and -0.030090801. 104292.969909199 What is -6696 + -2161215041? -2161221737 -18 - 2755382.3584 -2755400.3584 Add together -1242 and -296944440573. -296944441815 Calculate 0.1 + 7605948.7135198. 7605948.8135198 Total of -142 and 799231.0086. 799089.0086 What is -1.5 - 27512417226.8? -27512417228.3 13.945 - 1486.427 -1472.482 What is the distance between -0.59906796 and -48192? 48191.40093204 What is -1108257507339 take away -0.3? -1108257507338.7 What is 59953 take away -12.9112185? 59965.9112185 Subtract 0.6337 from 19646598785. 19646598784.3663 Add 692220175.3 and -0.019. 692220175.281 Subtract -4 from -0.0447863221312. 3.9552136778688 -425286 + 1977.30847 -423308.69153 What is 1195370 minus -876742? 2072112 2373817+88701451 91075268 Work out 271579375 - -32.6625. 271579407.6625 Subtract 68939 from -3761. -72700 -2.5 - 8.61868963394 -11.11868963394 Put together -528982884209 and -0.03. -528982884209.03 What is 5 + -1719.43650896? -1714.43650896 What is -2 take away -5778235415816? 5778235415814 Calculate -1120047.7 - 54030. -1174077.7 What is the difference between 0.05 and -317916276822? 317916276822.05 What is the difference between -5.1 and -3.74196914635? 1.35803085365 What is 76941104 + -2856524? 74084580 Work out 218531.9882674 + 0.4. 218532.3882674 Total of -70117.938 and 37.5774. -70080.3606 Add together 215663427 and 73726. 215737153 Subtract -27331078 from 143382. 27474460 Calculate -4 + -0.1153342802403. -4.1153342802403 What is -75704.7624967 - 971? -76675.7624967 What is 8153.93497 minus 9? 8144.93497 Work out -66 - 16432598.4069. -16432664.4069 What is the distance between 1409 and -47.552326? 1456.552326 Sum 44.2500483 and -14833.1. -14788.8499517 Add together 3 and -229186442423478. -229186442423475 Put together -13428868744 and -0.32. -13428868744.32 Calculate 0.3 + 1098853199914. 1098853199914.3 Work out 110 - -1451874033.642. 1451874143.642 -0.46234113419 + 0.443 -0.01934113419 Calculate 300 - 0.0257558632. 299.9742441368 What is 16402 minus -34835529? 34851931 -5+-28142960222.4 -28142960227.4 What is -26.17045 minus -4341130.4? 4341104.22955 0.4 + -0.004611973504 0.395388026496 -409+3386194406 3386193997 Work out -440.1802 - -1420.4. 980.2198 Subtract -5 from -19609821045. -19609821040 0.02+-6710932340696 -6710932340695.98 Calculate -178 - 0.003022590203. -178.003022590203 0.2 + -63065993612824 -63065993612823.8 Sum -631251949 and -0.048093. -631251949.048093 What is 11.674382 take away -0.020978? 11.69536 Put together 1289 and -0.040033883. 1288.959966117 What is -108362275064 take away -643? -108362274421 Total of -6 and -51210352830. -51210352836 What is 13701561.6089 minus -3? 13701564.6089 Sum -8769198963.163 and 0.02. -8769198963.143 Subtract 33120390 from 6314. -33114076 Add together -2769.18422462 and 3. -2766.18422462 Calculate -1279320350682 + 10. -1279320350672 Sum 90664542161 and -66. 90664542095 Add -4.3067 and -1.860910336. -6.167610336 -0.0483012 + 9.8082 9.7598988 Calculate -37823000762 - 15456. -37823016218 -269576981.849 + 3.04 -269576978.809 Add 40423455 and 7340.643. 40430795.643 -13512.855691 - 3 -13515.855691 5843508+3935 5847443 What is 27960 - -3108413? 3136373 What is the difference between -2035110539 and -176.52? 2035110362.48 What is the distance between -41461 and 78394.432? 119855.432 -37693732129458 - -0.3 -37693732129457.7 Sum 199193786924499 and -3. 199193786924496 What is the distance between -0.6 and -0.036328783214? 0.563671216786 What is 3 less than -155045884259482? -155045884259485 Calculate 59574365 - 17.0754. 59574347.9246 What is 1358406096181 minus -11? 1358406096192 Put together -4619.3 and 0.61186468. -4618.68813532 3+62105619872 62105619875 Sum 0.48114 and 7828525146. 7828525146.48114 Add together -295216288235585 and -0.3. -295216288235585.3 -0.14+-623487252249 -623487252249.14 What is 14.21591692574 + 18.2? 32.41591692574 Work out -29 + 879007476.51. 879007447.51 What is -1285485828 take away -202? -1285485626 What is the distance between 52453988276 and 10998? 52453977278 Work out -198840244 + -0.31228. -198840244.31228 Subtract 11.037 from 305409104. 305409092.963 -367.2+-1888549345 -1888549712.2 What is 7181447489 plus 0.051456? 7181447489.051456 0.011 - 1084538451930 -1084538451929.989 What is the distance between 0.15 and -69.682706561? 69.832706561 Calculate -104359630752 - 0.213. -104359630752.213 What is -1207573 less than -0.0426616? 1207572.9573384 Add together -48911341480 and 121. -48911341359 Sum -138142726 and 15624. -138127102 Add 333 and 205688908. 205689241 Add together -10606.3169718 and -5.402. -10611.7189718 Subtract 7.5812 from -0.3621430938. -7.9433430938 Calculate 131717.085 + -270647. -138929.915 -47904863198.966+1.1 -47904863197.866 Calculate -350911.49 + -1392487. -1743398.49 Sum -3954317.0467 and 0.49. -3954316.5567 Wha	{ "pile_set_name": "DM Mathematics" }
True Let n = 152 - 43. Is n composite? False Let r be 3/(-6) + (-34)/(-4). Suppose 0 = 2n - 0n - r. Suppose -np + 8p - 24 = 0. Is p composite? True Suppose 5 = -v, 0 = 5k - 2v - 3v - 4035. Is k a composite number? True Let l(g) = 10g - 1. Let j be l(2). Suppose 4a - j = 3a. Is a a prime number? True Let j be 32/20(-10)/(-4). Suppose 3q + jd + 90 = 5q, -4q + 200 = 2d. Is q a prime number? False Suppose -2i - 447 = -5i. Is i composite? False Suppose -7p + 10039 = -6292. Is p prime? True Let j = -14261 - -1748. Is j/(-33) - (-8)/(-44) a composite number? False Let t be ((-40)/2)/((-5)/55). Suppose t = 3x + x. Is x composite? True Suppose -6y = -9y + 201. Is y a prime number? True Is 119(-1 + 2) a composite number? False Let d(f) be the first derivative of f*2/2 + 2f - 2. Let i be d(0). Is (12 + i)/(2/7) a prime number? False Let y = 1 - -1. Is ((-1)/y)/(11/(-2684)) composite? True Suppose 5f + 5774 = 2j, -3j = 8f - 3f - 8711. Is j a prime number? True Let c(d) = -d - 1. Let x(u) = u + 3. Let p(r) = -2c(r) - x(r). Let o be p(0). Is (-1)/(-2)(-422)/o prime? True Suppose 0 = b + 4n - 369, -1182 = -3b - 5n - 54. Is b prime? False Suppose -3p + 22 = -17. Is p a composite number? False Let k = 44 - 11. Let j be (3 - 1 - 4) + -12. Let w = k + j. Is w a prime number? True Let i(t) = 2t*2 - 4t + 5. Is i(5) a prime number? False Is 0 + 15/204 a composite number? False Let d be (-69)/(-2)16/12. Let u = 81 + d. Is u a composite number? False Suppose h = -38 + 461. Suppose -53 + h = 5w. Is w/5(-15)/(-6) a composite number? False Is (-6)/4(-376)/12 a composite number? False Let z = -3 - -7. Suppose 86 = f + 5k, -6k + 2k = 3f - 236. Suppose -f = -zu + 16. Is u prime? True Let d(g) = -g3 + g2 - g + 1. Let u(r) = 167r3 - 2r*2 + 2r - 4. Let p(y) = -3d(y) - u(y). Is p(-1) composite? False Let v = 18 + 5. Let x = -1 + v. Let o = x - 7. Is o composite? True Let f(g) = -g + 1. Let d be f(3). Is (106/3)/(d/(-3)) a composite number? False Let x be (-15)/2(-6)/(-9). Let u = -2 - x. Suppose 3j = 2j + u. Is j composite? False Let q(c) = c*2 + 2c - 12. Let y = 3 + 2. Is q(y) composite? False Let f = 3372 - 167. Is f a composite number? True Suppose 0 = -2a + 9a - 13307. Is a a composite number? False Let b = 201 - 92. Suppose 4w + 17 - b = 0. Is w a prime number? True Let f be 6/(-3)(-3)/2. Suppose -fg + 38 = 2w - 7g, -2w + 44 = 2g. Is w prime? False Suppose 2g + 2660 = -3g. Let s be g/(-8) - (-1)/(-2). Suppose 2a - 3 = -3b + s, 2b - 54 = -4a. Is b a prime number? False Suppose 0b + b = 563. Is b a prime number? True Suppose -3n = -p + 121, -5n - 5p - 170 - 25 = 0. Let r = -5 - n. Is r composite? True Is (155/10 - 4)10 prime? False Let g(z) = -9z2 - 20z + 4. Let m be g(-5). Let f = 404 - 610. Let c = m - f. Is c prime? False Suppose -2v = -1634 + 502. Is v a composite number? True Suppose -279 = -20r + 17r. Is r a prime number? False Let b = -68 - -115. Is b prime? True Let h = 10 + -20. Let m = 12 - h. Is m composite? True Let q(i) = -1 + 48i - 3 - 636i. Let t be q(-4). Suppose -b = 3b - t. Is b prime? True Suppose 4t - 4z + 26 = 10, -4t - 4z + 16 = 0. Let s = 5 - t. Suppose 267 = su - 2u. Is u composite? False Suppose 0 = -3s + o + 15, 4s + 3o - 10 = 10. Suppose l - 1890 = -2l - 3z, -sz = 4l - 2515. Suppose -l = -7k + 2k. Is k a prime number? True Let q(d) = -d2 - d + 263. Is q(0) composite? False Suppose -6 = -2y + y. Is y prime? False Let k = -90 - -149. Is k a prime number? True Is (36 + 1)/((-2)/(-10)) composite? True Suppose n - 718 + 210 = -4u, u = -2n + 134. Suppose u + 659 = z. Is z a prime number? False Let m = 2 + -2. Suppose m = -0y + y - 7. Is (-2 - -4) + 3y composite? False Let f be 48/(-18)(-318)/4. Suppose -5l = -4s + f, -4l + 4s = 2s + 172. Let o = l - -81. Is o prime? True Let q(z) be the first derivative of z*3/3 + 5z*2/2 + 2z - 2. Let o be q(-5). Suppose 0 = -7k + ok + 15. Is k prime? True Let w(q) = q*3 - 12q*2 - 23q - 13. Is w(17) composite? True Suppose c + 2 = 5. Suppose cw + 316 = 7w. Is w a composite number? False Let d be 4/6 + (-112)/(-12). Suppose c - 2j - 4 = 0, 0 = c - 3j + 8j + d. Suppose c = -0t - t + 47. Is t composite? False Is 6/27 - (-10969)/9 prime? False Let j = -95 - -184. Suppose 3y - 217 = 167. Let z = y - j. Is z a composite number? True Suppose -5g + 15 = -25. Let r(x) be the second derivative of x*4/3 + 5x*3/6 - 3x*2/2 + 2x. Is r(g) a prime number? True Let b(o) = -356o - 3. Is b(-1) prime? True Let m(z) = -z2 + 7z - 5. Let n be m(5). Is (-4)/(-10) + 168/n a composite number? True Let x(k) be the first derivative of k*4/4 + 3k*2/2 - 2k + 1. Is x(3) a prime number? False Let m = 159 + -71. Is (m + -5)/(-2 + 3) composite? False Suppose -f + 2f - 2 = 0. Suppose 897 = -fm + 4m + v, 1344 = 3m + 3v. Is m a prime number? True Let y(s) = -12s + 23. Is y(-3) a prime number? True Let k(q) = -19q + 1. Let t(m) = 1. Let n(f) = -k(f) + 5t(f). Let l be n(4). Let z = l - -11. Is z a prime number? False Let a = 38 - -15. Suppose -4h = -3h - a. Is h a composite number? False Let c(g) = g*3 - 2g*2 - 3g + 4. Let o be c(3). Let v(y) = y*3 - 8y*2 - 6y - 4. Let u be v(8). Is u/(-6)(-1 + o) a prime number? False Let i(u) = 9u*2 + 2 + 4 - 13u - 3u2 + 8u. Is i(-7) prime? False Suppose -x = -0x - 3. Suppose 0 = -t - 3s - 56 + 501, -865 = -2t - s. Suppose -t = -xy + y. Is y composite? True Let y be (-1 - 1)/((-4)/(-14)). Let v be (-2 - 20)/(2 - 1). Let n = y - v. Is n prime? False Is 7/14 - 331/(-2) a composite number? True Suppose 0p = 2p - 248. Let u = -57 + p. Is u a prime number? True Let w(b) = -6b + 1. Suppose -4x - 8 = 0, -5k - 2x - 43 = -3x. Is w(k) prime? False Is -1 + 2/5 + (-17752)/(-20) a composite number? False Let n = 138 + -610. Suppose -3o = 2o + 1475. Let t = o - n. Is t a prime number? False Let h be (-12)/(-8)2 + 1. Suppose -5q = -m - 0q + 201, -hm + 846 = q. Is m composite? False Suppose -5n - 63 = -4r, -9 = -n + 4n. Let c = r + -6. Is (-2)/c + (-212)/(-6) prime? False Suppose 22 = 3o - 5u, -u = -3o + 6o - 10. Suppose 3w - 208 = 5d - 1470, 4d - 1016 = -ow. Is d prime? False Suppose -4b - q + 21 + 2 = 0, 4b + 4q - 32 = 0. Suppose 4o - 84 = -w, -2o + 0w + 42 = -bw. Is o a composite number? True Suppose 0o = 4o + 140. Let x = 60 + o. Is x a prime number? False Let r(i) = -4i + 5. Let k(y) = 9y - 11. Let h(u) = 2k(u) + 5r(u). Let g = -3 + -1. Is h(g) a composite number? False Let f(m) = 72m*3 + 4m*2 - 6m - 11. Is f(5) a prime number? True Let b(k) = k*3 - 14k*2 + 12k - 12. Let r be b(13). Suppose -89 = l - 3l + z, 4l - 193 = 5z. Let m = l - r. Is m composite? False Suppose 4z - 4394 = 3122. Is z a composite number? False Let r(y) = -6y2 + 6y2 + y3 + 6. Let x be r(0). Is 140/(-12)x/(-2) composite? True Suppose -o = -3f + 22, 2f - 20 = -0o - 2o. Let c(w) = -w + 7. Let b be c(f). Is 54 - b(0 + -1) a prime number? True Suppose -y = 2c + 26, 4y - 2c + 93 = c. Let t = y + 34. Suppose 5j - t - 30 = -5m, -m = 5j + 12. Is m a prime number? True Let p(t) = t*3 - 8t*2 + 8t - 6. Is p(8) composite? True Suppose 3a = -0a + 6. Is (-2 - (a + 233))/(-1) composite? True Suppose -5i + 195 = 5l, 5i + 3 + 2 = 0. Suppose 40 = 5v - 4w - 0w, 5v - l = 3w. Let h(p) = 10p + 9. Is h(v) a composite number? False Let i(h) = 12h*2 - h. Is i(2) prime? False Let v(q) = -15q*2 + 2q - 1. Let a(k) = -15k2 + k. Let t(w) = 2a(w) - 3v(w). Is t(2) composite? True Suppose -3i + 383 = -2o - 242, 2o = 4i - 834. Is i a prime number? False Suppose -23 = c + o, -5c + o - 3o = 103. Let t = -13 - c. Let p(a) = a2 - 5a + 5. Is p(t) composite? False Let y = 703 + -384. Is y a composite number? True Suppose -3m + 92 = 5o - 24, 4m - 118 = -5o. Let n = 509 - o. Is n a prime number? True Let f = -478 - -822. Suppose 6o - 2o - f = 0. Is o a prime number? False Suppose 5g + 5 = -15. Is (-182)/(g/(-1 - -3)) a composite number? True Let b(t) = -t3 - 14t*2 + 19t - 13. Is b(-18) composite? False Is (3/(-6))/(3014/(-1004) + 3) composite? False Let v(b) = -60b3 + b2 - 2. Let m(k) = -241k**3 +	{ "pile_set_name": "DM Mathematics" }
b Let g = 0.25 - -0.05. What is the nearest to 0 in 0, 1, g? 0 Let k = -1 - -2. Suppose -4u - 2 = 2. Suppose 2z - 7z = 25. What is the closest to k in z, u, -2? u Let q = 8 + -8.8. Let f = -4.8 - q. Let z = -84/13 - -730/117. What is the nearest to -1 in z, f, 5? z Let r(s) = -5s*2 + 2s. Let k be r(2). Let f be (-1)/(-4)k/(-6). Let g = -21 - -43/2. Which is the nearest to f? (a) 0.3 (b) g (c) 2 b Let j = 402/7 - 58. Let g = 2.2 - 2.29. Let s = g + 0.59. What is the nearest to -0.1 in j, s, 0.3? 0.3 Let w = 8/3 + -35/12. Let q = -0.07 - 0.13. Let u be ((-1)/24)/(-4). Which is the nearest to w? (a) q (b) 0.3 (c) u a Let g = 6 - -16. Let m = 20 - g. Let r = 4.9 - -0.1. Which is the nearest to m? (a) 1 (b) r (c) 4 a Let d be (-2)/41(-4)/(-11). Which is the nearest to -0.4? (a) d (b) -0.5 (c) 3 b Let g = 5 + -5.8. Let s = g - 0.2. Let n = s - -1.5. Which is the nearest to -2/3? (a) -0.3 (b) n (c) -1 c Let o = 2 + -1. Let j = 19 - 35/2. Which is the nearest to o? (a) -3/4 (b) j (c) 2 b Let o = 0.1 - 0. Let l = 0 - -1. What is the closest to o in l, 0.2, -2/13? 0.2 Let b = -4 + 2. Let m be 65/(-15) - 2-2. What is the closest to m in -1/2, b, -1? -1/2 Let s be 9 - (2 + 0) - 0. Suppose 1 + 9 = 5v, -3v = -j - s. Which is the closest to 2/3? (a) -3 (b) -3/4 (c) j b Let u be (-14)/((6/(-3))/(-2)). Let x be 7/(-35) - u/(-30). Which is the closest to 2? (a) x (b) 1/4 (c) -0.5 b Let x be (-32)/(-15) - 8/4. Which is the nearest to -1? (a) 3/4 (b) x (c) 3 b Let v = 4.06 + -4. Let x = 1.06 - v. What is the nearest to x in 4, 2, -5? 2 Let s be (22/264)/((-3)/(-8)). Let w = -2 - -2.3. What is the closest to -0.1 in w, 0, s? 0 Let x = 29 - 30. Which is the closest to x? (a) 2 (b) 4/7 (c) -3/5 c Let w = -61/264 - 1/24. What is the nearest to w in 5, -2, -3/4? -3/4 Suppose -4u - 4m - 49 = -13, 3m + 9 = 0. Let p = -6 - u. Let s = 0.7 - 5.7. Which is the closest to p? (a) s (b) 4 (c) -1/2 c Suppose 0l + 4l = -16. Let v = 8 - 4. Let z be 2/7 - (-22)/(-28). What is the nearest to z in 1, v, l? 1 Let u = -0.3 - 0.7. Let t = 1 + u. Let x = 0.48 + 0.02. What is the closest to t in x, -2, 0.3? 0.3 Let u = 11 - 11.4. Let z be 2/39/12. Which is the closest to z? (a) 3 (b) 0.4 (c) u b Let u = -57 - -54. What is the closest to -12 in u, 3, 0.5? u Suppose 2y - 92 = -4k + 194, -k = 0. Let f = y - 1289/9. Let n be 0 + -5 - (1 - 2). Which is the nearest to 2? (a) f (b) n (c) -2/25 c Let u = -1/540 - -5281/540. Let m = -5068862/45 + 112631. Let i = u + m. Which is the closest to 0.1? (a) i (b) 4 (c) -0.3 c Let q = -23 - -23. Let x = 0.13 + 4.87. Which is the closest to q? (a) -0.2 (b) x (c) -2/5 a Let q = 22 + -21.9. Which is the closest to q? (a) 2 (b) -0.2 (c) 1/6 c Let x = 0.29 - -14.71. Let w = -15 + x. What is the closest to 2 in w, -3/5, -1/6? w Let u = 95.1 - 95. What is the nearest to -0.3 in u, 1/5, 4/3? u Let j = -43/126 + 1/18. Let m = -6 + 2. What is the nearest to j in 2, m, -1/6? -1/6 Let v be ((-12)/10)/(20/50). What is the nearest to v in 2, 12, -5? -5 Let j = -38.5 - -38. Suppose -2x = x + 15. What is the closest to -1 in -1/3, x, j? j Let d = 5.2 - 5. What is the closest to d in 3, -4, -2/5? -2/5 Let h = 0.2 + -1.2. Let y = -0.53 - 0.47. Which is the closest to h? (a) 0.2 (b) y (c) -4 b Let o = 92/111 - 6/37. Let k = -1.3 - -0.3. Which is the closest to k? (a) 5/2 (b) -1/5 (c) o b Let b = 35/2 - 18. What is the nearest to -1/4 in -3/7, b, -4? -3/7 Suppose 0f = -9f - 9. Which is the closest to f? (a) -0.3 (b) -0.4 (c) -4 b Let h = -32 + 18. Let f = -14.3 - h. Let s = 0.2 + 1.8. What is the nearest to -1 in 2/7, s, f? f Let t = 40 - 25. Let x = t - 8. Let h = x - 20/3. Which is the closest to h? (a) 3 (b) -2/3 (c) 4 b Let u = -0.3 - 0. Let c = u - 0. What is the nearest to c in 2/3, 2, 2/7? 2/7 Suppose -3z = -2z - 4. Let o = 14/5 + -149/55. What is the nearest to -1/3 in o, z, 5? o Let h = -16239185411/3003 + 5407654. Let w = -1/231 + h. Let t = 34.1 - 33.1. What is the closest to t in w, 5, 2/7? 2/7 Let s = -24 + 28. Let n = 0.04 + 1.96. Which is the closest to -0.1? (a) n (b) s (c) -2/7 c Let l = 0.61 + -0.11. Let y = l - 0.4. Which is the closest to y? (a) 2/11 (b) 1 (c) 3 a Let s = -1 + -3. Which is the nearest to -1/4? (a) s (b) 5 (c) 1/2 c Let i = -0.13 - -0.63. What is the nearest to -1 in i, 4, 3? i Let g = 0.02 + 1.58. Let u = 1.4 + g. Which is the closest to 2? (a) u (b) 0 (c) 0.2 a Suppose 42 = 5r - 3r. Let m be (-60)/14 + 6/r. Which is the closest to -0.1? (a) 4 (b) m (c) -1 c Let y = 1 + -2. Let j = -1.16 + 1.56. Which is the nearest to y? (a) 1/6 (b) -1 (c) j b Let d(n) = -n - 11. Let y be d(-8). Let r = 0 + 0.4. Which is the closest to 0? (a) y (b) 2/7 (c) r b Let s = -14.9 - -16. Let n = 1 - s. Let l = -2/535 + 539/1070. Which is the nearest to n? (a) l (b) -4/3 (c) 1/8 c Let i(r) = -3r + 2. Let d(w) = -1. Let y(x) = -3d(x) - i(x). Let g be y(-2). What is the nearest to 5 in g, 3, -1? 3 Let j = -11/12 - -5/4. What is the closest to j in -2, -13, 1? 1 Let k(t) = -t*2 - 2t - 3. Let n be k(0). Let x = 2.01 - 0.01. Let o = -0.1 - -0.6. Which is the closest to x? (a) o (b) 5 (c) n a Let u = -9 + 9. Let f be -2 - 1/((-1)/6). Let r = -0.06 + 5.06. Which is the nearest to u? (a) -3 (b) f (c) r a Let n(f) = -4f. Let w be n(-1). Let t be (2 + 0)/4w. Let m = 0.04 + -0.44. Which is the closest to 0? (a) m (b) t (c) -4 a Let y = -1.67 - -0.07. Let z = y - -1.4. Let g = -1 + 0. Which is the nearest to z? (a) -0.5 (b) -5 (c) g a Let k(r) = r*2 + 3r + 1. Let h be k(-4). What is the closest to -0.1 in 0, 1, h? 0 Let p = 2 - 7. Let f = -21.9 + 22. Which is the nearest to -2/7? (a) p (b) -2/11 (c) f b Let p = -20 + 9. Let n = -11.3 - p. Which is the closest to n? (a) -2/9 (b) -1 (c) -0.4 a Let q be (3 + 44/(-20))5. Suppose -d - qd - 5l = 0, -2d + 4l = 6. Let g = -3.2 - -3. What is the closest to d in 0, 1, g? g Let g = 14 - 20.9. Let h = -13 + 6. Let k = h - g. Which is the closest to k? (a) 4 (b) -4 (c) -3/2 c Suppose -23 + 3 = 4s. What is the closest to 1 in -2, s, 5? -2 Let h = 2.39 + -1.39. What is the closest to -0.8 in 1/7, h, -0.4? -0.4 Let r = 138 - 415/3. Which is the nearest to -0.34? (a) r (b) -0.5 (c) 4 a Let p = -2.6 - 0.4. Let j be ((-6)/(-20))/((-12)/(-16)). What is the nearest to j in -5/3, -1, p? -1 Let r = -3.98 + 4. Let y = r + -0.52. What is the nearest to 0.1 in -1/3, -3, y? -1/3 Let x be ((-6)/9)/(13/(-3)). Let c = -1 + -3. Let d(j) = j + 2. Let w be d(c). What is the closest to 0.1 in x, 0, w? x Suppose -2 = m, 2m - m + 1 = z. Let y = -0.3 + 0.1. Let o = 0.038 + -3.038. Which is the nearest to y? (a) z (b) o (c) 2/5 c Let g = -7.9 + 7. Let y = g + 5.9. Which is the nearest to -3? (a) 0.5 (b) y (c) -3 c Let d = -14.9 + -4.1. Let x = d + 31. Let v = -17 + x. What is the nearest to 2/7 in 1, v, -1/4? -1/4 Let n = 1 + -0.9. What is the nearest to n in 3, 0.02, 3/4? 0.02 Suppose 0 = 5z - 3d + 4, 2z - 2d + 4 = -0d. Suppose 0 = 2o - 9 - 3. Let f be ((-1)/(-3))/(o/(-18)). What is the nearest to f in z, -0.1, -1? -1 Let u = 3 - 3.4. What is the closest to -0.2 in 4/9, 2/5, u? u Let t = 0.3 + -0.2. Let m = t + -0.2. Suppose 0n + 7n = 0. What is the closest to m in 2/11, n, 4? n Let t be (-2 - 26/(-10))1. Let z = 13 + -12.1. Let l = z + -0.9. Which is the nearest to -1? (a) 1 (b) t (c) l c Let g = -1.1 + 9.1. Let r = g + -9. Which is the nearest to -1? (a) 1/3 (b) 2 (c) r c Let l = -2158/45 + 242/5. What is the closest to l in 4/3, 1, 0.3? 0.3 Suppose -4y - 2g = -22, 5y - 13 = -4g + 22. Which is the nearest to 0? (a) 1/4 (b) -1/3 (c) y a Let g(a) = -a*2 - 2a - 2. Let d be g(-2). What is the closest to 0 in 1, d, -2/7? -2/7 Suppose -2k - 2k = 0. Let t be (k + -1)/((-5)/(-5)). What is the closest to 0 in t, 4, -0.2? -0.2 Let f be (-2)/(1/(0 - 1)). Let w be ((-2)/(-6))/(-3 + 0). Which is the nearest to -2? (a) -3/2 (b) f (c) w a Let y = -947/4 + 238. Let i = 74 - 64.7. Let w = 9 - i. What is the closest to -0.1 in -3/4, w, y? w Let s = 0 + -0.1. Let t = -51 + 52. Let x be (2/(-3))/((-15)/9). What is the nearest to 0.1 in s, t, x? s Let l(y) = -y*3 + 2y. Let u be l(2). Let	{ "pile_set_name": "DM Mathematics" }
34o(w). 2w*3 - 2w*2 + 2 Let r(f) = 2f*2 + f + 1. Let h(s) = 4s*2 + 2s + 3. Calculate 2h(q) - 5r(q). -2q2 - q + 1 Let v(f) = 2f*2 + 64. Let m(y) = 2y*2 + 63. Determine -7m(t) + 6v(t). -2t2 - 57 Let x(s) be the third derivative of -s5/12 + 2s2 + s. Let y(i) = -5i*2. Give 6x(j) - 5y(j). -5j*2 Let p(a) = 5a - 6. Let g(m) = -2m + 2. Suppose 0 = -b + 6 - 25. Let z = b - -30. Calculate zg(k) + 4p(k). -2k - 2 Let n(c) be the second derivative of 5c4/12 - 3c*3/2 + 4c2 - c. Let j = -187 - -196. Let s(o) = -o2 + 2o - 2. Calculate js(r) + 2n(r). r2 - 2 Let u(g) = 2g*3 + 2g*2 + 3g + 5. Let v be (-6)/(2/1) + -14 + 16. Let o(a) = a*3 + a + 1. Give vu(j) + 3o(j). j3 - 2j*2 - 2 Let u(y) = 4y*3 - 2y*2 + 3y + 5. Let q(g) = -g*2 + 9g + 16. Let b be q(11). Let f(x) = -5x3 + 2x*2 - 4x - 6. What is bu(i) - 5f(i)? i*3 + 2i*2 + 2i Let h(r) = r + 1. Let u(n) = -n*2 + 12n + 11. Let m = 9 - 6. Suppose ml - 3b - 6 = 0, -2l + b - 4b + 4 = 0. Determine lu(s) - 22h(s). -2s2 + 2s Let h(z) = -9z2 - 4z + 3. Let j(x) = 14x2 + 6x - 5. Give 8h(u) + 5j(u). -2u2 - 2u - 1 Let k(a) = -a*2 + 12a - 12. Let d be k(11). Let g(s) = -s*2 + 5 + 5 - 5 - 7s. Let b(o) = -o + 1. Calculate dg(p) + 6b(p). p*2 + p + 1 Let d(c) = 6c. Let h(l) = 2l. Suppose -a + 0 = j - 5, 2a = -j + 7. What is ad(k) - 7h(k)? -2k Let j(i) = 4. Let f(b) = 4b + 4 + b - 3b - b. Let t be f(-6). Let h(m) = 3. Let g(u) = tj(u) + 3h(u). Let o(k) = -2k + 3. What is -5g(r) + o(r)? -2r - 2 Suppose 5q + 0 = -25. Let z(c) = -2c - 11. Let w(o) = -o - 7. What is qz(j) + 8w(j)? 2j - 1 Let k = -7 - -2. Let z(m) = -m - 1. Let o(s) = s2 - 7s + 5. Let t be o(7). Let i(f) = 0f + 3f - 6 - 5f - tf. What is kz(q) + i(q)? -2q - 1 Suppose 9k - 123 + 69 = 0. Let x(i) = -2i*2 + 13i + 17. Let j be 4/(-6) + 74/(-6). Let n(a) = -a*2 + 8 + 4a + 4a - 2a. Calculate jn(d) + kx(d). d2 - 2 Let i(r) be the second derivative of -r3/6 - r*2/2 + 5r. Let t(q) = -q3 + q2 + 4q + 4. What is -4i(x) - t(x)? x3 - x2 Let f(p) = 5p - 15. Let k be -1(-4)/((-8)/22). Let n(c) = c - 3. Give kn(u) + 2f(u). -u + 3 Let v(w) = -39w. Let q(j) = 19j. Calculate 9q(f) + 4v(f). 15f Let g(m) be the second derivative of -m4/3 - m3/2 - 3m2/2 - m. Let h = -62 + 63. Let v(d) = d2 + d + 1. What is hg(y) + 3v(y)? -y2 Let u(z) = -z2 - 3z - 1. Let k(o) = 2o*2 + 4o + 1. What is 3k(g) + 4u(g)? 2g2 - 1 Let a(q) = 11q*3 - 5q*2 - 5q + 5. Let n(l) = -28l3 + 12l*2 + 12l - 12. What is -12a(b) - 5n(b)? 8b3 Let m be (-10)/(-6)(-5)/(75/(-27)). Let c(d) = 3d2 - 3d. Let x(n) = -n*3 - 4n*2 + 4n. Calculate mx(f) + 4c(f). -3f3 Let u(j) = 2j*3 - 4j - 4. Let b = 79 + -78. Let x(r) = r*3 - r - 1. What is bu(a) - 4x(a)? -2a*3 Let u(f) = 2f - 2. Suppose 0 = j + 5 - 2, 2j = -3y. Let a(o) = -10o + 10. Determine ya(v) + 11u(v). 2v - 2 Let n(a) = 7a2 - 2a + 1. Let m(f) = f*2. Let i = 3 - 9. Give im(g) + n(g). g*2 - 2g + 1 Let v(l) = 4l - 1. Let w(g) = 3g - 2. Let q(p) = -4v(p) + 5w(p). Let i be q(-7). Let o(x) = -x*3. Let m(z) = -5z*3 - 2z*2 + z. Give im(j) - 4o(j). -j3 - 2j*2 + j Let s(t) = 2t*3 + 4t*2 - 3t - 5. Let m(o) = o*2 - o - 1. Determine 5m(x) - s(x). -2x3 + x2 - 2x Let m = 0 + 1. Let h(c) = -c*2 - c - 1. Let i(l) = 15l*2 - 15l + 9. Let r(q) = -7q2 + 7q - 4. Let v(k) = 6i(k) + 13r(k). What is mh(g) + v(g)? -2g*2 + 1 Let w(f) = 2f - 4. Let s(k) = -3. Let r(d) = 1. Let y(n) = 2r(n) + s(n). Calculate w(u) - 3y(u). 2u - 1 Let x(v) = -3v + 110. Let c(k) = -k + 37. What is -8c(i) + 3x(i)? -i + 34 Let x(k) = -k2 + k + 2. Let p = -1 + 4. Let d = p + -5. Let s(r) be the second derivative of r2/2 + r. Give ds(b) + x(b). -b2 + b Let r(o) = 1 - 56o + 1 + o*2 + 28o + 26o. Let j(l) = 12l*2 - 27l + 27. Calculate 2j(y) - 27r(y). -3y2 Let c(t) = -t - 6. Let r(d) = -d. Determine -c(n) + 2r(n). -n + 6 Let t(z) = 2z + 7 - 3z + 0z. Let b be 1(-4)/(-3 + -1). Let j(p) = p*2 + 5p + 1. Let h be j(-3). Let u(m) = 1. What is bt(c) + hu(c)? -c + 2 Let c(h) = h. Let t(y) = -4y + 2. Let l(v) = 3c(v) + t(v). Let p(s) = -3s + 5. Calculate -5l(m) + 2p(m). -m Let f(m) = 1. Let b = -3 + 1. Let c be (1 + b/1)/1. Let t(y) = -y2 + 5. Calculate ct(h) + 5f(h). h2 Let p(m) = -5m*3 + 6m*2 - 6m + 6. Let w be (-4)/(-12) - (-17)/3. Let k(h) = -4h3 + 5h*2 - 5h + 5. Calculate wk(x) - 5p(x). x*3 Let r(b) = 3b - 3. Let m(y) = -y + 1. Let l(v) = v - 1. Let u(i) = -l(i) - 3m(i). Calculate 5r(z) - 8u(z). -z + 1 Let v(p) be the third derivative of -p4/24 - p3/2 - 22p*2. Let j(k) = -k - 3. What is -2j(m) + 3v(m)? -m - 3 Let h(o) = 11o + 1. Let f be h(1). Let j = -26 + f. Let u(y) = y*3 - 7y*2 - 7y + 1. Let z(s) = s*2 + s. Give jz(v) - 2u(v). -2v3 - 2 Let l(o) = o2 - o + 1. Let g be 33/(-27) - 6/(-27). Let b(v) = 4v2 - 5v + 4. What is gb(a) + 5l(a)? a*2 + 1 Let a(i) be the first derivative of 3i*2/2 + 4i - 1. Let w(r) = -r - 1. Suppose 3o + m = 6m + 22, 0 = 5o + 2m + 15. Give oa(n) - 4w(n). n Let m(w) = -4w - 7. Suppose 3 = -f + 2y - 0, 3f + 14 = y. Let q(x) = -x - 1. Determine fq(s) + m(s). s - 2 Let o(q) = -3q - 2. Let s(g) be the first derivative of 8g*2 + 11g + 5. Give 22o(t) + 4s(t). -2t Let b(v) = -5v*2 - 1. Let d(t) = -6t*2 - 1. Suppose -3m + 30 = 18. Let o(f) = -f - 3. Let c be o(0). Calculate cd(w) + mb(w). -2w2 - 1 Let i(z) = 2z + 3. Let f(d) = 5d + 7. Calculate 3f(c) - 5i(c). 5c + 6 Let s = -21 - -26. Let v(n) = -7n - 4. Let w(l) = -3l + 12. Let a(g) = g - 1. Let k(i) = 9a(i) + w(i). Calculate sk(o) + 4v(o). 2o - 1 Suppose 1 = -3c - 5. Let l(i) = -i - 1. Let p(m) = 4m + 5. Suppose -12 = -2t + 6t. Let u be (0 - t)(-5 + 2). What is cp(a) + ul(a)? a - 1 Let a(j) = -5j - 6. Let t(o) = 10o + 13. Determine -9a(q) - 4t(q). 5q + 2 Let p(t) be the third derivative of -t4/24 - t3/6 - 24t2. Let i(m) = -m - 1. What is -5i(q) + 4p(q)? q + 1 Let i(a) = -a3 + 9a*2 + 5a + 2. Let d(z) = z*3 - 9z*2 - 6z - 2. What is -5d(b) - 6i(b)? b*3 - 9b2 - 2 Let k(f) = -f3 - 7f2 + 6f - 12. Let b be k(-8). Let m(j) = 6j2 + 9. Let o(y) = 3y*2 + 4. Calculate bm(n) - 9o(n). -3n*2 Let m(i) = 11i + 7. Let j(l) = 6l + 4. Let g(t) = -7j(t) + 4m(t). Let u(f) = 2f*2 + f. Let r be u(1). Let h(y) = 10y. Give rh(v) - 16g(v). -2v Let c(s) = -s2 + 4s. Let t(h) = 2h2 - 9h. Give 9c(f) + 4t(f). -f2 Let p(w) = 1. Let l(c) = c2 - c + 2. What is l(k) - 2p(k)? k2 - k Let a(t) = -2 + 5 + 5t*2 + 5. Let o(l) be the third derivative of 0l*4 + 3l*2 - 7/6l*3 + 0 + 0l - 1/15l5. Determine -5a(g) - 6o(g). -g2 + 2 Let k(s) = -3s*3 + 7s*2 + 5s + 4. Let y(x) = -5x + 2 + 20x*3 + 3x*2 + 7x - 21x3. Calculate 2k(r) - 5y(r). -r3 - r2 - 2 Let x(t) = 20t*2 + 1 - 16t*2 + 4 - 5t - 2t3. Let z(c) = -10c + 4c + 0c*2 - 3c*3 + 5c*2 + 6. Suppose 4 = -n - 1. Determine nx(f) + 4z(f). -2f*3 + f - 1 Let i(z) = -45z*3 - 9z*2 + 13z. Let g(m) = -11m3 - 2m*2 + 3m. What is -26g(y) + 6i(y)? 16y3 - 2y*2 Suppose -2x = -f + 4, -8 = -2f + x - 9. Let d(j) = 3j2 - 2. Let y(w) = -w2 + w + 1. Determine fy(o) - d(o). -o2 - 2o Let f(y) = y - 2. Let x = 159 + -91. Suppose -4o = -x - 16. Suppose -4n + 3v - o = -9n, -2n = 4v - 14. Let h(l) = l - 3. Give nf(d) - 2h(d). d Let g(b) = -6b + 26. Let u(n) = -n + 5. Determine 2g(q) - 11u(q). -q - 3 Let c(q) = -1. Let n(p) = 1. Suppose y - 4y - 9 = 0. Let a(r) = yn(r) - 2c(r). Let j be (0 + 1)(1 - 0). Let k(o) = -2o + 12. Give jk(f) + 12a(f). -2f Let b(o) be the second derivative of -2o*3/3 - 3o*2/2 - 45o. Let r(c) = -5c - 4. What is 6b(z) - 5r(z)? z + 2 Let h(s) = -4s*3 + 6s*2 + 6s - 3. Let c(n) = 8n3 - 11n*2 - 11n + 5. Calculate -6c(p) - 11h(p). -4p3 + 3 Let o(c) = 3c*3 - 2. Let f(h) be the second derivative of -13h*5/20 + 9h*2/2 + h. Let w be -2((-81)/(-2))/9. Let b = -18 - w. Determine bo(k) - 2f(k). -k3 Let z(y) = -y3 + y*2 - y - 1. Let h(u) = -2u**2 + 3	{ "pile_set_name": "DM Mathematics" }
617 - -15826. Let y = -51 + 71. What is the remainder when q is divided by y? 9 Suppose -3w = 9, -2v + 6 = -3v + 2w. Let y be -2 - 98/v. Suppose 115 = yx - 0u + 3u, -3u - 110 = -5x. What is the remainder when x is divided by 8? 1 Let q(z) = 3z2 + 44z + 174. Suppose -4k + 359 = 3o, 0 = -k + 5o - 5 + 66. What is the remainder when k is divided by q(-7)? 8 Suppose -3u - 31 = -5o, 2o = 4u - 7 + 25. Suppose -23 = -2f - 3. Suppose 0 = 5y - f + o. What is the remainder when 1 is divided by y? 0 Let w = -5 - -11. Suppose 8o = -2u + 10o - 12, -2o = 4u. What is the remainder when ((35/u)/5)/((-8)/48) is divided by w? 3 Let c(x) = 138x + 5007. Calculate the remainder when 9788 is divided by c(-36). 38 Suppose -42d = -37d - 110. Let p be 648/6030/4. Suppose 3l = -4y + 23, -6y - p = -5l - 2y. Calculate the remainder when d is divided by l. 9 Let o = -42 - -88. Suppose -4h = 4, 4a + 0h + 3h + 127 = 0. Let m = o + a. What is the remainder when 57 is divided by m? 12 Suppose 2w - 3m = m - 4, 3m - 3 = w. Suppose 3d - 27 - 12 = 0. What is the remainder when (-6)/27 - w - 1606/(-18) is divided by d? 11 Let i(d) = -d3 + 12d*2 - d + 6. Let m(x) = 3x*3 - 25x*2 + x - 12. Let z(l) = 5i(l) + 2m(l). Calculate the remainder when z(-8) is divided by 23. 20 Suppose -28 = 8i - 44. Suppose 0 = -2b + u + 30, -ib + 4u - 2u = -34. Calculate the remainder when 36 is divided by b. 10 Let u(p) = 2p - 1. Let f be (-42)/(-3) + 0 - 3. Suppose -70 - 96 = -2a. What is the remainder when a is divided by u(f)? 20 Suppose 0 = -38a - 37a - 39a + 34998. What is the remainder when 616 is divided by a? 2 Let s(x) = 279x + 6978. What is the remainder when 611 is divided by s(-25)? 2 Suppose -v - 5h - 201 = 2v, 3 = -h. Let g = v - -81. Calculate the remainder when 72/(2 - 0) + (1 - 3) is divided by g. 15 Let h = 26672 + -26595. Calculate the remainder when 4384 is divided by h. 72 Calculate the remainder when 1024 is divided by 52 + (-12)/3639. 10 Let m(s) = s2 + 4s + 2. Suppose -20 = 5d - 15. Let g(r) = r2 + r. Let a(k) = dm(k) + 5g(k). Calculate the remainder when 47 is divided by a(-2). 11 Let u(d) = -d2 + 48d - 262. Calculate the remainder when 1134 is divided by u(7). 9 What is the remainder when (-14 - -12)/((-30)/3675) is divided by 123? 122 Let v be (18 - 13) + (1 - 5). Suppose -2c = -v - 5. Suppose -6u + cu + 87 = 0. What is the remainder when u is divided by 10? 9 Let m(f) = -63f - 163. Calculate the remainder when 2149 is divided by m(-3). 17 Let a(m) = -m*2 + m + 42. What is the remainder when 1545 is divided by a(-5)? 9 Suppose 0 = -4q - 414 + 402. Calculate the remainder when 104 is divided by ((-2 - q) + 0)190/10. 9 Let w(s) = -s2 - 17s + 34. Let j(g) = -4g + 2. Let z be j(5). What is the remainder when 56 is divided by w(z)? 8 Suppose 2288l - 49371 = 2277l + 2945. Calculate the remainder when l is divided by 1187. 8 Suppose 20t - 109 = 51. Suppose tz - 63 = 41. What is the remainder when z is divided by 5? 3 Let z(r) = 4r*2 + 5r. Let f be z(-4). Suppose -8q - 4 - 268 = 0. Let b = f + q. What is the remainder when 127 is divided by b? 7 Let g = 3051 - 1876. Calculate the remainder when g is divided by 49. 48 Let a(i) = -2i - 14. Let p(f) = -f - 1. Let y(r) = -3r - 10. Let u(q) = 4p(q) - y(q). Calculate the remainder when a(-17) is divided by u(-6). 8 Let u(t) = 7t - 15. Suppose -5o + 2 = 3l - 10, l - 5 = -2o. Let a be u(o). Let x(j) = j*3 - 5j2 + j. What is the remainder when x(a) is divided by 9? 6 What is the remainder when 3 - (-50)/(-15) - 3344/(-33) - 3 is divided by 5? 3 Let m(f) = f2 - 12f + 14. Let p be m(11). Calculate the remainder when 254 is divided by 8008/156 + (-1)/p. 50 Let m = 172 - 180. Calculate the remainder when (-11 - m) + 2 + 103 is divided by 13. 11 Let z be (16 - 14) + 3/(6/106). Suppose y + 2p - 61 = 0, y + 0y = p + z. Let i = y + -49. What is the remainder when 12 is divided by i? 4 Let i(y) = 19y - 15. Suppose -2h = -2o + 24, -13 = o + h - 15. What is the remainder when i(5) is divided by o? 3 Suppose -328t = 58t - 3004 + 688. Suppose 0 = 2n - 2a - 2 - 40, 0 = -3a - 9. Calculate the remainder when n is divided by t. 0 Suppose 28038 - 4398 = 30g. What is the remainder when g is divided by 207? 167 Suppose 0 = -g - 8w + 7w - 9, 0 = 4w + 8. Calculate the remainder when 51 is divided by (8/g)/(13/(-91)). 3 Let x(z) = -z3 + 7z*2 - 6z + 7. Suppose -2n + 36 = 3c, 3n - 87 = -42c + 43c. Calculate the remainder when n is divided by x(6). 6 Let o(i) = 10i - 128. Let d be o(25). Suppose -9b + d + 1723 = 0. Calculate the remainder when b is divided by 35. 30 Let g(c) = 5c*3 + 4c + 3. Let j be g(-1). What is the remainder when 53 is divided by (-4 - j) + 2 + 15? 15 Let f = 18311 + -18303. Calculate the remainder when 17 is divided by f. 1 Suppose -4f - 11 = -3g - 2f, -g + 3f - 1 = 0. Suppose 2o = 6q - 3q - 124, -gq + 165 = 5o. Calculate the remainder when 186 is divided by q. 34 Let f be (-12)/(-1)182/4. Suppose 4c - 102 = f. What is the remainder when c is divided by (3/6)/((-2)/(-60)) + -4 + 0? 8 Let u(a) = -a2 + 1. Let h(o) = 3o*2 - 15o + 11. Let d(v) = 2h(v) + 4u(v). Calculate the remainder when 288 is divided by d(16). 56 Let g(y) be the second derivative of -y*3/6 + 7y*2 + 6y - 6. Let x = 1 - -7. What is the remainder when 23 is divided by g(x)? 5 Let o(v) = -v*3 - 51v*2 + 54v + 304. Calculate the remainder when o(-52) is divided by 42. 32 Suppose 0 = -2w - w + 198. Suppose -3937j + 3874j + 6343 = -5942. What is the remainder when j is divided by w? 63 Let g(k) = -4k - 34. Let s be g(11). Let i = -43 - s. Let y = 3 + 3. Calculate the remainder when i is divided by y. 5 Let n(q) = q*3 + 1 - 5q*2 - 7q + 5 + 2q + 11. Suppose 107 = 3i + 4l, 135 - 4 = 3i - 2l. Calculate the remainder when i is divided by n(6). 18 Let z(m) = 34m + 1118. Calculate the remainder when 2055 is divided by z(-30). 95 Suppose 2d - 170 = -4t, 5d - 407 = -14t + 10t. Calculate the remainder when d is divided by 23. 10 Let b(l) = l3 - 25l*2 + 31. Suppose -4n = -9n - 2g + 133, -5n + 2g + 117 = 0. What is the remainder when b(n) is divided by 17? 14 Suppose -3j = 1016h - 1020h + 588, j = 4h - 596. What is the remainder when 239 is divided by h? 89 Let y(i) = i*3 + 12i*2 + 253i + 2663. Calculate the remainder when 141 is divided by y(-11). 0 Let m(c) = c*3 + 12c*2 + 21c + 10. Let f be m(-10). Let t be 700/22 + f + 4/22. Let w = t + -20. Calculate the remainder when 47 is divided by w. 11 Suppose 17 = -v + 4h, -4h - 52 = 2v + 30. Let q = -31 - v. What is the remainder when -3 + 2 + (-6)/q + 59 is divided by 19? 17 Let c(s) = 13s*3 - 4s*2 + 1. Let k be c(2). Let r = -87 + k. Suppose 3u - 56 - 7 = 0. What is the remainder when u is divided by r? 1 Let a = -2893 - -3016. Calculate the remainder when 368 is divided by a. 122 Let h(t) = 62t2 + t - 1. Let a be h(-1). Suppose -5i + 2n + a = 0, 3n + 2 = -i - 3. What is the remainder when ((175/i)/(-7))/((-1)/2) is divided by 5? 0 Let z be 5/(100/(-8)) + (-407)/(-55). Suppose 0 = -b + 6a - za + 55, -2a - 190 = -4b. What is the remainder when 149 is divided by b? 49 Suppose -85 = -3x + 2f, 7x - 2x - 139 = 2f. Suppose xv + 96 = 29v. Suppose -vi + 41 = -47i. Calculate the remainder when 120 is divided by i. 38 Suppose 0 = -38u + 382 + 188. Suppose -4s + 350 = 3s. What is the remainder when s is divided by u? 5 Suppose -196x - 280 = -198x. Let c = -23 + x. What is the remainder when c is divided by 20? 17 Suppose 7x + 3011 = -5935. Calculate the remainder when 70 is divided by (-30)/4x/355. 16 Let h = -676 + 690. Suppose -7 = -j + 2. Suppose -jq + hq = 10. What is the remainder when q is divided by 2? 0 Let h = 37177 - 37103. Calculate the remainder when 375 is divided by h. 5 Let k = 7 - 7. Suppose k = 4m + m - 130. Suppose -3z + 276 = 3l, 0 = -l + 3z + 82 + m. What is the remainder when l is divided by 25? 21 Let q(l) be the second derivative of -5l3/3 + 87l*2 - 145l. What is the remainder when 47 is divided by q(16)? 5 Let n(h) = 43h. Calculate the remainder when n(2) is divided by 45/(-405)(-267 + -	{ "pile_set_name": "DM Mathematics" }
a be 16/(-10) - (-12)/(-30). Let i be -24a/4. Let p(k) = ik - 6k + 4k2 + 3 - 1. What is p(2)? 14 Let k(i) = -i2 - i + 1. Let c be 3/(-2 - -11)-3. Let b(w) = 5w2 + 6w - 9. Let r(j) = cb(j) - 6k(j). Determine r(0). 3 Let d be (35/15 + -7)3/(-2). Let p(a) = a2 - 2a + 5. Determine p(d). 40 Suppose -4l - l = 20. Let a(i) = 4i - 6. Let x(p) = -11p + 12. Let o(d) = 5d - 6. Let h(r) = -5o(r) - 2x(r). Let g(z) = -6a(z) - 7h(z). Give g(l). 6 Let p(l) be the first derivative of -1/4l4 + 7/3l*3 + 2l + 0l2 + 3. What is p(7)? 2 Let r(q) = 3q3 + q2 - 1. Suppose -11 = t - 16. Let m = 4 - t. Calculate r(m). -3 Let m(i) = -3i - 11. Let f be m(-5). Suppose 3y - 12 = -z, -fy + 3z + 16 = -z. Let k(u) = -yu - 2u + u. Give k(-2). 10 Let z(y) = y*2 - 18y + 12. Let q(o) = 7o + 227. Let w be q(-30). What is z(w)? -5 Let z(k) be the second derivative of 1/60k*5 + 0k*2 + 0k*3 + 0 - 1/4k*4 - 1/720k*6 + 4k. Let c(j) be the third derivative of z(j). Give c(7). -5 Let z(j) be the third derivative of -j*6/120 - 7j5/60 + j4/8 + 7j3/6 - 58j*2. What is z(-7)? -14 Suppose -5x - 15 = 0, -5x - 149 = 5c - 2x. Let y = -25 - c. Let w(v) = 4v - 3. Calculate w(y). 9 Let z be 2 + 5 + 1 + -1. Suppose 0 = 4x - 5n - 4 - 33, 14 = -2x - 4n. Let u(f) = 5f3 + 20f + f*3 - x - 8f*2 - 13f - 5f3. Determine u(z). -3 Let g(m) be the first derivative of -m2/2 + m + 62. What is g(-7)? 8 Let q(b) = b - 10. Let t be (0 - 5/(-10))(10 - 0). Determine q(t). -5 Let y(l) be the second derivative of 0l2 - 11l + 0 + 1/20l5 + 1/2l*3 - 5/12l*4. Give y(2). -6 Suppose i - 24 = -2p, -3p - i + 37 = -0i. Let h(w) = -w*2 + 15w - 12. Determine h(p). 14 Suppose 0 = 18x - 3x - 90. Let w(b) be the first derivative of -5b + 1 - 3b*2 + 1/3b*3. Determine w(x). -5 Suppose 3c - 3 + 15 = 0. Let l(t) = t*3 + 6t*2 - t. Let d(u) = -4u*3 - 25u*2 + 5u + 1. Let g(h) = -2d(h) - 9l(h). Give g(c). 2 Let f(d) = -2d + 4. Let m(b) = -1. Let r(l) = 2f(l) + 6m(l). Let g be (-10 - 390/(-40))/((-1)/(-8)). Determine r(g). 10 Suppose -12 = -5x + 2x. Let s(w) be the second derivative of -1/20w*5 + 3w + 1/4w4 + 0 + 1/2w*3 + 2w*2. Calculate s(x). 0 Let w(n) = -2n + 7. Suppose 2c + 2m = 13 - 5, 2 = -c - 4m. What is w(c)? -5 Let q(x) = -37 + 17 - 8x + 14 + 12. Let u(l) = l - 1. Let c(o) = q(o) + 3u(o). Give c(-3). 18 Let k(s) = 3 + 1 - s + 1 + 3s2 - 6. Let u = -31 - -30. Calculate k(u). 3 Let u(n) = n3 - 7n2 + 9n - 5. Let i be u(6). Let h(c) = -c + 14 - 15 + i. Let q(l) = l - 7. Let v be q(7). Calculate h(v). 12 Suppose -5f = -d - 10, 2d = -2f - 2f + 22. Let y be 9/4 + f/4. Let u = y + -1. Let i(z) = z*3 - 4z*2 + 4z - 3. Calculate i(u). -3 Let y(o) = -43 + 98 + 2o - 51. What is y(-3)? -2 Let x = 205 - 196. Let m(k) = k3 - 8k*2 - 12k + 10. What is m(x)? -17 Let w(h) = h - 6. Let n be w(8). Let z(r) = -6r + 5r - r*n + 0r*2 + 4. Let m be (-1)/(15/(-10))-3 - 1. Give z(m). -2 Let n = -11 - -3. Let f(d) = -3d2 + 32d - 18. Let k(y) = -2y2 + 21y - 12. Let h(m) = nk(m) + 5f(m). Give h(5). -9 Let a(s) be the third derivative of -s6/120 - s5/12 - s4/12 - s3/3 - 2s2. Let b = 18 - -1. Let p = b + -24. Calculate a(p). 8 Let w(h) = 7h*2 - 7h + 4. Let a(r) = 11r2 - 10r + 6. Let o(l) = 5a(l) - 8w(l). Suppose 3 = -v + 5. Suppose -vg + 15 = 5. What is o(g)? 3 Let l(b) be the first derivative of b3/3 - 7b*2 - 12b + 72. Determine l(14). -12 Let v = 33 + -19. Let x be (-672)/(-49) - (-4)/v. Suppose d = 3u - x + 3, 0 = 2d - 4u + 16. Let f(n) = n3 + 3n*2 + n - 1. Calculate f(d). 1 Let x be -5-33/15. Let v be 212/(-265)(-5)/2. Let r(q) = -xq2 + 2q - 6q2 + 8q*v - 4. Calculate r(3). -7 Let v(g) = -12 + 14 - 9g - 6 - 10 - 22. What is v(-4)? 0 Let c(q) = -q. Let h = -22 - -23. Let a(f) = -f + 2. Let k(j) = ha(j) - 2c(j). Give k(2). 4 Let k be 1/(-8) + (-105)/(-8). Let p = k - 9. Let t(x) = -x*3 + 4x*2 + 1. Calculate t(p). 1 Let z(w) be the first derivative of -3w*2/2 + 3w - 1. Suppose 0 = -6x + 10x + 336. Let v = -82 - x. What is z(v)? -3 Let l(u) = -20u2 - 6u*3 + 20u*2 + u + 5 + 5u*3. Determine l(0). 5 Let j = 6010 + -6004. Let v(m) = 5m - 14. Let s(h) = 9h - 27. Let o(g) = 4s(g) - 7v(g). What is o(j)? -4 Let z(g) = -g3 + 5g*2 - 3g + 2. Suppose 20k + 8k - 56 = 0. Determine z(k). 8 Let o(b) = -34b + 80b - 23b - 25b - 5. Give o(-5). 5 Let u(j) = 2j + 1. Let a be u(2). Suppose -2 = -2z - 0w - 4w, 0 = -aw - 5. Let x(i) = 2 + 6i + 8i2 - 1 + 5i*z - 4i*3. Determine x(-7). 8 Let o(l) be the third derivative of 0 - 5/24l*4 + 4l*2 + 0l - 1/2l3. Give o(-2). 7 Let u(m) = -146m + 301m - 153m - 8. What is u(5)? 2 Let i(y) = 96y - y2 - 285y - 5 + 93y + 96y. Determine i(0). -5 Suppose 4k = a + 3a + 36, 5a + 25 = 3k. Suppose -3u - 10 = -l, -5u = -2l - 9u + k. Let m(i) be the first derivative of i*2 - 7i - 29. Calculate m(l). 7 Let l(n) = -n*2 + 16n - 7. Let h be (4 - 232/28)/(4/(-14)). Give l(h). 8 Let p(c) = -107c + 4 - 2 + 46c + 70c. Give p(-1). -7 Let q = -2 + 8. Let l(y) be the second derivative of -y3/3 - y2/2 + 12y + 30. Determine l(q). -13 Let i = 122 + -118. Let j(y) = 0 - 267y3 + iy - 2y2 + 268y3 - 3. Give j(3). 18 Let y(v) be the first derivative of v2/2 + 9v + 68. Determine y(-4). 5 Let c = -3 + 22. Let g = c + -20. Let s(j) = -10j3 - j2 - 2j - 1. What is s(g)? 10 Let c(l) be the first derivative of -l2/2 - 2. Let m be 195/9 + (-4)/6. Suppose 11x - m + 87 = 0. Determine c(x). 6 Let g(k) = -3624k + 16 + 1815k + 1813k. Give g(-5). -4 Let g(h) = h3 + 6h*2 - 6h - 1. Let k = 108 + -115. Determine g(k). -8 Let m be (-8)/(-8)(2 + -1 - -37). Let x = m - 40. Let l(d) = d3 + d + 1. Calculate l(x). -9 Let s(i) = 8i + 8. Let n(l) = -8l - 9. Let u(v) = 6n(v) + 7s(v). Determine u(-2). -14 Suppose -61 = -4c - 1. Let f(x) = -2x2 + 13x - 2. Let m be f(6). Suppose -c + 3 = mw. Let v(j) = -4j - 3. Calculate v(w). 9 Let c(n) = n*2 - 8n + 2. Let r = 43 - 21. Suppose 8 - r = -2p. What is c(p)? -5 Let w(v) = -v3 + 1 - 1386v + 11v2 + 1386v + 1 + 2. What is w(11)? 4 Let n be (6/4)/((-4)/((-48)/9)). Let q(i) = 2i2 - 8 - 5i*2 + 4i*n - 9i. What is q(9)? -8 Let l(o) = -78 - o + 153 - o*2 - 82 - 8o. Determine l(-7). 7 Let r(k) = -k*3 + 5k*2 + 7k - 3. Suppose -22g = 10g - 192. Calculate r(g). 3 Let y(g) be the first derivative of -g7/120 + g6/360 - g5/60 + g4/24 + 8g3/3 - 19. Let j(i) be the third derivative of y(i). Give j(1). -7 Let r = 0 + -4. Let o(l) = -2l - 5. Let k be o(r). Let w(i) be the second derivative of i5/20 - i4/3 + i3/6 - i2 + i. What is w(k)? -8 Let y be -4 - 168/(3 - -1). Let a = y + 48. Let d(f) = 3f2 + f + 1. What is d(a)? 15 Let k(w) = 4w*2. Let o(x) = 3x*2 - 1. Let f = -19 + 22. Let g(b) = fo(b) - 2k(b). Let v be 3(-2 + 0 - -1). What is g(v)? 6 Let j(r) = -2r2 - r + 0 - 2r - 1. Let s(q) = 8q2 - 102q + 69. Let i be s(12). Determine j(i). -10 Let y(u) be the second derivative of -3u2 - 1/12u*4 - 3u + 0 - 7/6u3. Let z be y(-6). Let r(b) = -b + 8. What is r(z)? 8 Let l(q) = 2q - 12. Let x be l(7). Let o(k) = -xk + k - k - 2 + 3k. What is o(-3)? -5 Suppose 0 = -2908o + 2917o - 72. Let d(n) = n*3 - 6n*2 - 10n + 10. Give d(o). 58 Let n(a) be the third derivative of -a*4/24 - 3a*3/2 + 84a*2. Calculate n(-8). -1 Let r = 68 - 66. Let n(f) be the first derivative of f + 10 - 1/2fr. Give n(-6). 7 Let t(d) = d3 - 4d2 - 4d - 4. Suppose 0 = -5j - 6 + 21. Suppose 20 = -2s + 2q, jq - 44 = 5s + q. Let a be (-6)/s - 34/(-8). Calculate t(a). 1 Let o(v) be the third derivative of -v4/12 + v2. Suppose -4l + 12 = -3u, 0 = 4l + 4u + 25 - 9. Suppose l = -2x + 7x - 25. Give o(x). -10 Suppose 4f + 4x - 6x = 30, 5f + 2x - 24 = 0. Let g = 0 - f. Let n(o) = o*3 + 6o2 - o. Determine n(g). 6 Let o(k) be the first derivative of -k6/360 - k5/20 - k4/8 - 22k3/3 + 8. Let d(p) be the third derivative of o(p). Determine d(-5). 2 Let w(f) = -f2 - 32f. Let r be w(-32). Let q(c) = c2 + c - 4. Calculate q(r). -4 Let z(s) = s3 + 13s*2 +	{ "pile_set_name": "DM Mathematics" }
ing t is positive. t(134/11) Simplify (s6s/(sss(s*(-3)s)/ss))(-4/5) assuming s is positive. s(-24/5) Simplify (h9)(1/6) assuming h is positive. h(3/2) Simplify (xx(-2/7)/x)(-5/9)x(-2)/(x5x) assuming x is positive. x(-494/63) Simplify (n(2/5))*(-4/9)(n/n(1/2))(-43) assuming n is positive. n(-1951/90) Simplify t/(t/(t/t(1/16)))ttt7 assuming t is positive. t(159/16) Simplify ((bb(5/6)/b)/b(1/3))(-1/9) assuming b is positive. b(-1/18) Simplify (((tt/(t/(((tt/(t(t/(tt*(-2/7)))/tt))/tt)/tt)))/t)/t)/(t/(t*(2/5)/t))(((t(-6)/t)/t)/t)/(t(-3/8)t) assuming t is positive. t(-3223/280) Simplify (b/(b/(bb*(-1/59)))b)/(b(b(1/21)b)/b) assuming b is positive. b*(1159/1239) Simplify ((hh1/h)/(h/h5))(-28) assuming h is positive. h(-140) Simplify ((qq/(q(q*8q)/qq))/qq(-1/6))/(q(-8)/q(q2q)/q) assuming q is positive. q(-13/6) Simplify (((b(-2/5)b)/b)/b)(-1/31)/((b/(b((bb(-1/4)b)/bbb)/b))/((b(-2/11)/b)/b)) assuming b is positive. b(-2637/6820) Simplify (k*(2/19)/kk(-2/15))(-2) assuming k is positive. k(586/285) Simplify (d/(d8/d))(34/3) assuming d is positive. d(-68) Simplify (((f/f(-3))/f)(-7/5))(1/57) assuming f is positive. f(-7/95) Simplify b(19/2)/(b29b) assuming b is positive. b(-41/2) Simplify f5/ff(17/5) assuming f is positive. f(37/5) Simplify ((s/s*(-1/5)s)/sss)(-35)/(s4/(s/s5)) assuming s is positive. s(-120) Simplify (w/((w/w(-5/6))/w))31 assuming w is positive. w(31/6) Simplify (u(-6/7)/u)/(u/(uuu*9/u))(uuu/u1)28 assuming u is positive. u(442/7) Simplify ((o(2/3)o)(-2/41))(-23) assuming o is positive. o(230/123) Simplify (q/(q2q))(-20/9) assuming q is positive. q(40/9) Simplify ((z/((zz/((z/(z/z3))/z))/z)z)/z)/(zz/(z(1/7)/z)zz)(z(-1))(-38) assuming z is positive. z(246/7) Simplify z35zz*(18/11)zz assuming z is positive. z(436/11) Simplify g5/(g/(gg*4g))g(2/3)gg5 assuming g is positive. g(50/3) Simplify ((v/v17)/v)(11/7) assuming v is positive. v(-187/7) Simplify h/(hh*(-1/44))hh(-2/5) assuming h is positive. h(137/220) Simplify (jj/j(-7))(-1/7) assuming j is positive. j*(-9/7) Simplify (b(b*0/bb)/b)*(2/9) assuming b is positive. 1 Simplify ((nn(-1))(21/2))(-22) assuming n is positive. 1 Simplify ((k/(k/(k/k(-1/3))))/k)/k*(-8)(kk/k1)(-31) assuming k is positive. k(-68/3) Simplify (f/(ff*(-19/4)fff))/f(2/39) assuming f is positive. f(265/156) Simplify (c/((cc(-2/3))/cc))*(-50)c/(c/(c/c*6))c(-1/4) assuming c is positive. c(-463/12) Simplify (j/(j/(jj(-2/11))))/((j((j*5j)/j)/j)/j) assuming j is positive. j(-35/11) Simplify (k(-1/15))(4/19) assuming k is positive. k(-4/285) Simplify l*5l(l/(l/(l(1/3)/l)l))/ll(1/12)l/(ll(-3/2)/l) assuming l is positive. l(71/12) Simplify ((b(-1)/b)/(bb/(((b*(-2)b)/b)/b)))/(bb(bb(-1))/b)(-15/2) assuming b is positive. sqrt(b) Simplify (w(1/3)/w)(5/9)((w*(-2/5)/ww)/w)/ww(-2) assuming w is positive. w(-644/135) Simplify (c(1/17)c)/c*(-8)(c(-1))5 assuming c is positive. c(69/17) Simplify p/p(5/6)(pp5)/p assuming p is positive. p(31/6) Simplify (y/(y/((y/y(-3))/y)))/y(-5) assuming y is positive. y*8 Simplify ((hh*(-2)h)/(h/h*(-2)))/((h(h/h*0)/h)/hh*5/hh) assuming h is positive. h(-8) Simplify ((b/(b(-2)b))/(bbb(-3/4)b))(-44) assuming b is positive. b11 Simplify w*3((w((w(-2)/w)/w)/w)/w)/w assuming w is positive. w(-3) Simplify (w(-5))(1/34) assuming w is positive. w(-5/34) Simplify z8z/(z/z*(-34/3)z) assuming z is positive. z(-13/3) Simplify (r(-1))*48r/(rr6)r4/r assuming r is positive. r(-51) Simplify (d/(dd(2/9)dddd)d(3/2)/d)(-36) assuming d is positive. d134 Simplify (j0)(-12)/(j(1/4)/j(1/11)) assuming j is positive. j(-7/44) Simplify (o*(-1/4)o(-6))/(o(-1/5)/o0) assuming o is positive. o(-121/20) Simplify t*(-17)ttt/(tt(-15)/t)t assuming t is positive. t2 Simplify z/(z(-21)/z)zz(z/(z/z(-14)))/z assuming z is positive. z10 Simplify (k(1/4)k)/(kk(-7/2)/k) assuming k is positive. k(19/4) Simplify (x/x2(x(-16)/x)/x)(4/9) assuming x is positive. x(-76/9) Simplify m(1/9)/(mm(-1/9)) assuming m is positive. m(-7/9) Simplify (j/(jj*3)j)*(-1/2) assuming j is positive. j Simplify (ll*5ll8)20 assuming l is positive. l300 Simplify (z(2/69)/z)/(zz6) assuming z is positive. z(-550/69) Simplify (v/(((v/v*(-2/3))/v)/vv)v)(2/13)vvv/(v(v/((vv*(2/5))/v))/v)vv(-8) assuming v is positive. v(-857/195) Simplify (hh*(-15)h)/((h27/h)/h) assuming h is positive. h(-38) Simplify (z(-7)/z4)/(z*(2/17)zz(4/3)) assuming z is positive. z(-686/51) Simplify ((z1z)15)(-1/11) assuming z is positive. z*(-30/11) Simplify ((uu*(1/31))/u)/(((uu(3/10))/u)/u) assuming u is positive. u(227/310) Simplify ((n/n(-6))/(n/(n/(n/(n(-2/21)/n)))))/((n/(n/(n*(4/11)n)n))/(n/(nn2))) assuming n is positive. n(587/231) Simplify q/(qqq*(-3/2))q*(-22)qq assuming q is positive. q(-39/2) Simplify ((x/(xxxx*(-1/4)x)x)/x)(-31/5) assuming x is positive. x(341/20) Simplify ((j/j(2/3))/j)(-3/10)j*6/jjjj*(-4/3)j assuming j is positive. j*(103/15) Simplify (ff*(1/11)ff)/f0 assuming f is positive. f(34/11) Simplify ((nn(-2))/n)(16/7) assuming n is positive. n(-32/7) Simplify (o35/o)/(ooo(-19)) assuming o is positive. o51 Simplify (p/p*(-9)pp(-2/9))/(((p(-5)p)/p)/(p/(pp/(p(p/p(-9))/p)))) assuming p is positive. p(223/9) Simplify (h/h(1/2))(-1/19)hhh(-2/5)/hhhh/(hhh/(h*(-8)h)) assuming h is positive. h(-1221/190) Simplify ((o(7/3)o)/(o/(oo(-1/8))))44 assuming o is positive. o(847/6) Simplify (d(-2/3)/(dd/(d/d(-1/5))))/((d(5/3)/d)/((d/(d(d*(-10)/d)/d))/dd)) assuming d is positive. d(148/15) Simplify l(11/5)l(-2/55) assuming l is positive. l(119/55) Simplify k(-3/7)/(kk*(1/29)kk) assuming k is positive. k(-703/203) Simplify (((((l(-10/9)/l)/l)/l)/l)/ll)(1/7) assuming l is positive. l(-46/63) Simplify (h*0h)(-19/3)/(h1h)(-21) assuming h is positive. h(107/3) Simplify (s0)23(s*(2/3)/s)/ss(-3) assuming s is positive. s(-13/3) Simplify ((((t*(-1/6)t)/tt)/t)/t)/(t/(t/(tt*(-19)/ttt)tt)) assuming t is positive. t(107/6) Simplify (nn(-11/7))/n25 assuming n is positive. n(-179/7) Simplify m(-20)/m(m/(m/m(2/11)))/m assuming m is positive. m(-240/11) Simplify (ww(-12))24 assuming w is positive. w*(-264) Simplify (q/(qq23))(-4/23) assuming q is positive. q*4 Simplify kk*21kk/(k(-2/11)k)k assuming k is positive. k(266/11) Simplify (a(3/5)/(a/a(-2/9)))/(a/(aa*(-1/2)/a)a(-2/9)/a) assuming a is positive. a(-9/10) Simplify (zz(-38))/(z(6/11)z) assuming z is positive. z*(-424/11) Simplify (pp/(p/p(2/3)))(-2/3)/(p/p*(1/3)(p(p/p(-3/4))/p)/p) assuming p is positive. p(-91/36) Simplify t/t(2/9)t(1/6) assuming t is positive. t(17/18) Simplify l*2/llll*(-7)(l/(l*0l)l)(-46) assuming l is positive. l(-50) Simplify o(-6/31)/ooo41 assuming o is positive. o(1265/31) Simplify (v6/(v/(vv*(10/7)v)))(9/13) assuming v is positive. v(531/91) Simplify (j/(jj(-13)))(5/17) assuming j is positive. j(65/17) Simplify ((p/p(-6))/(pp6))/(p(-1/2))40 assuming p is positive. p20 Simplify f(-1/10)/f(-8) assuming f is positive. f*(79/10) Simplify (jj(-1/37))/j20 assuming j is positive. j*(-704/37) Simplify ((u/((uu7)/u))/((u/u(-6))/u))/(u*(1/3)/uu(-4/3)) assuming u is positive. u(-10) Simplify r/(r/(r*6/r)r)rr*(5/4)rr(-2/5)/(rrr(rr4r)/r) assuming r is positive. r*(-23/20) Simplify (d/((d/(dd/(d/(d/(d/d*(2/9)d))dd)))/d)d)/((d(1/9)/d)/d)(d*(-8)d)/(dd(-6)) assuming d is positive. d(1/9) Simplify ss*(-1/5)ssss7s*(-2/9)ss/s(-2/3) assuming s is positive. s(596/45) Simplify (y(2/15))*(-41) assuming y is	{ "pile_set_name": "DM Mathematics" }
th respect to n. -9kv*3 - 3k + 2v3 Find the second derivative of 260iq2v*3 - 308iqv*3 - 2iqv - q*3v*3 wrt q. 520iv3 - 6qv3 What is the third derivative of -168o*4 + 3o*3 - 67o*2 + 7o wrt o? -4032o + 18 Differentiate -m3t - 198m3 + 2mtz - 3tz + 25z wrt m. -3m*2t - 594m2 + 2tz Find the third derivative of 514a*4 - 5159a*2. 12336a What is the derivative of -3594o - 1529? -3594 Find the third derivative of 273j*3x - 2j3 + j2 + 291jx + 2x wrt j. 1638x - 12 Differentiate -20o*4 + 4oz3 + 147z*3 wrt o. -80o*3 + 4z*3 What is the third derivative of -160c*2dp2 + 3c*2d - 137c2p*3 - 3cdp*3 - 3dp3 - 4dp - 2d wrt p? -822c2 - 18cd - 18d What is the second derivative of 13332a2 - 5142a - 2 wrt a? 26664 Differentiate 63m3 + 2m - 37. 189m2 + 2 Find the first derivative of 140w*4 - 249 wrt w. 560w*3 Find the third derivative of -3i*3o*3y*3 + 122i*3o*3y - 2i3o*2y*3 - 2i*3o*2y - 83o2y*3 wrt o. -18i*3y*3 + 732i*3y Find the third derivative of 121a3d*3 + 83a*3d*2 + 11a*3d - a*2d*3 wrt d. 726a*3 - 6a*2 What is the second derivative of -4b*3o*3t - 535b3o*2t*2 + 6b*3o + 6b2o*3t*2 + 2bo3t + 4bo*2t - 3o3 wrt t? -1070b*3o*2 + 12b*2o*3 Find the first derivative of -214m*4 + m - 97. -856m*3 + 1 Find the second derivative of -2ux5 - 629ux3 - 22ux - 46u wrt x. -40ux*3 - 3774ux Find the second derivative of 204u*3 - 7u + 8. 1224u Differentiate 663j + 614. 663 What is the third derivative of 5d3g*2r2 - d3g2 + 473d*3g - 340d2g*2r*2 - 4d*2 - 2gr2 wrt d? 30g*2r*2 - 6g*2 + 2838g What is the derivative of 334z - 1468? 334 Find the first derivative of -63g*3 + 562. -189g*2 What is the first derivative of -1512f*3j*3 + 53f3 + j4 - 1 wrt j? -4536f3j*2 + 4j*3 What is the second derivative of 2h*4 - 24h*3 - 594h? 24h2 - 144h What is the derivative of 5f2 - 5fm2 + 2fm - f - 4853m*2 wrt f? 10f - 5m2 + 2m - 1 What is the derivative of -184o2 + 71? -368o Find the second derivative of l*3 - 495l*2 - 1698l. 6l - 990 What is the third derivative of 158f*3 + 41f*2? 948 Find the second derivative of 5976v*4 - 2v + 5756 wrt v. 71712v2 What is the derivative of -i2v*2w*2 - 3i*2v*2 - 43iv2 - 39iw + 2vw2 wrt w? -2i*2v*2w - 39i + 4vw Find the second derivative of 10g*2x*2y*2 + 10g*2x*2y - g*2y + 7gxy + 4y*2 wrt x. 20g*2y*2 + 20g*2y Differentiate 2g2x + 15gx + 8g - 2201x with respect to g. 4gx + 15x + 8 Find the third derivative of 4k*2q*4 + 3k*2q + 2k2 + 133kq4 - 3kq2 wrt q. 96k*2q + 3192kq Find the second derivative of -19r2w*3 + 2r*2w*2 + 4r*2w + 4r2 wrt w. -114r*2w + 4r2 What is the third derivative of -2i*2m4 - i2m2 - 935im4w + im2 + 17m*2w wrt m? -48i2m - 22440imw Find the third derivative of -242g*6 + 195g*2 wrt g. -29040g*3 Find the first derivative of 70d*2 - 17d - 3002 wrt d. 140d - 17 Find the third derivative of -234l6 - l2 + 5. -28080l3 What is the second derivative of 49gk3r*2 + 2gk2r*2 - 19gr + k3r + 2k2r*2 - 5 wrt r? 98gk3 + 4gk2 + 4k*2 Differentiate -6m*2t + m*2z*3 + mtz + 2t*2z*3 - 2t*2 - 54z*3 + 2z*2 with respect to t. -6m*2 + mz + 4tz*3 - 4t What is the derivative of -25f3 - 5f - 266 wrt f? -75f2 - 5 Find the second derivative of -299i*4 + 1293i wrt i. -3588i2 What is the third derivative of -1825g*6 - 30g*2 + 5 wrt g? -219000g*3 Find the second derivative of 2lt5 - 7lt4 + 3lt3 + 7lt + 2t wrt t. 40lt*3 - 84lt2 + 18lt Find the first derivative of -2123f*2 - 4425. -4246f What is the second derivative of -2d5 + 428d*2 + 218d wrt d? -40d3 + 856 What is the first derivative of 894c*4 - 2c*2 + 505 wrt c? 3576c*3 - 4c Differentiate -d*2j*2 + 3d*2 + 130dj3 - 23d + 9j2 + 81 wrt j. -2d*2j + 390dj*2 + 18j Find the first derivative of 2n3y*3 - 16n*3y - 2513n3 + 3y*3 wrt y. 6n*3y*2 - 16n*3 + 9y*2 Find the third derivative of -154l*3u2 + l2u2 + 9l*2 wrt l. -924u*2 What is the third derivative of -6385o*4 + 16o*2 + 342 wrt o? -153240o What is the first derivative of 10ov*2y*2 + 2oy3 + 4oy + 188v*2y*3 wrt o? 10v*2y*2 + 2y*3 + 4y What is the third derivative of 4bhj3z - 98bhj2z*3 - 14bj3 + 2hj3z*3 - hj*2 + 2hjz wrt j? 24bhz - 84b + 12hz*3 What is the first derivative of 20b*2t - 3759b2 - 4bt2 + 2bt wrt t? 20b*2 - 8bt + 2b What is the second derivative of -4463h4 - 2h - 5101? -53556h2 Differentiate -276hk - 38h wrt k. -276h Find the second derivative of -47x*5 + 225x. -940x3 What is the third derivative of -681x*5 + 1809x*2? -40860x*2 Find the second derivative of 66i*3 + 50i*2 - 9640i wrt i. 396i + 100 Find the third derivative of -2094jn3 - 34jn + 2n*3 - 110n*2 wrt n. -12564j + 12 What is the first derivative of -3645x4 + 4541 wrt x? -14580x*3 What is the second derivative of 323h*4 - 2h*2 - 7654h wrt h? 3876h2 - 4 Find the second derivative of 2696o*2z*2 + 1956oz + 2z*2 wrt o. 5392z*2 Find the third derivative of 309z*3 + 33z*2 + 2 wrt z. 1854 What is the third derivative of 1292k*6 - 694k*2? 155040k*3 What is the derivative of -2l*4 + 968l + 4972 wrt l? -8l3 + 968 What is the third derivative of 3t*2v*3 - 14t*2v*2 - 5t*2v - 3tv*4 wrt v? 18t*2 - 72tv Find the second derivative of -432b*2 + 237b + 1 wrt b. -864 What is the derivative of -25q - 3? -25 What is the first derivative of 168t - 89? 168 Find the second derivative of 2l3 - l2 - 151l. 12l - 2 Differentiate -291u - 63 with respect to u. -291 Find the first derivative of -108z2 - 394 wrt z. -216z What is the third derivative of 128b6 - 2b*2 - 16b wrt b? 15360b3 Find the third derivative of -5r*6 - 126r*4 + 4r*2 + 8r + 4. -600r3 - 3024r Differentiate 3158i - 645 with respect to i. 3158 Differentiate 5d*2fk + d2kp3 + 44d*2p + df - dp*3 + d + fkp - 2k + 2p3 with respect to k. 5d*2f + d*2p*3 + fp - 2 What is the derivative of -4i2p - 42i2y*2 + 5i*2y + 45py2 + y2 wrt p? -4i2 + 45y*2 What is the first derivative of 2cq3 - 280cq + 1243q*3 wrt c? 2q*3 - 280q Find the second derivative of -1956v2 - 477v wrt v. -3912 Find the third derivative of 4i5 - 13i*4 - 41i*2. 240i*2 - 312i What is the second derivative of 359g2x + 2gx + 131g + 7 wrt g? 718x Find the second derivative of 2w5 + 513w*3 - 876w wrt w. 40w3 + 3078w What is the third derivative of -5h5 - 2h*4u + 7h2u + 6h - 2u wrt h? -300h2 - 48hu Find the first derivative of -1818bd3 - 1434d*3 - 2d wrt b. -1818d3 Find the second derivative of -8366p*4 + 2618p - 1 wrt p. -100392p2 Find the second derivative of fm*2w + 11fm*2 + 35fmw + 19fw - 2m2w - 46m2 wrt m. 2fw + 22f - 4w - 92 Find the first derivative of -560cfo*2 - 11co3 - co*2 - 3c - 2fo*3 + 25o*3 wrt f. -560co2 - 2o*3 What is the third derivative of 4r*3vz2 - r3z*3 + 15r*3 - 41rvz*3 + 9z3 + z2 wrt z? -6r3 - 246rv + 54 What is the third derivative of 8228c*5 - 1853c*2 wrt c? 493680c*2 Find the second derivative of 74b*3 - 212b*2 + 5093b wrt b. 444b - 424 Find the first derivative of -3335l - 687. -3335 Find the third derivative of 85a3c2 + a3c + a2c - 10c2 wrt a. 510c*2 + 6c Find the third derivative of -12fg*3v*3 - 3fg3 - 22fg2v*3 + 3fv2 + 2g*3v - 7v2 wrt v. -72fg3 - 132fg2 Find the third derivative of -5l4 + l3 - 2l2 - 24l wrt l. -120l + 6 What is the second derivative of 6d*2i*2p + 26d2ik + 3d*2ip2 + 6di2kp2 + 5di2 - i2kp + i2k + i*2p*2 + 2k wrt d? 12*	{ "pile_set_name": "DM Mathematics" }
- 4 - 4) + 5. 3 (-1 - (6 - 8)) + (4 - 1) 4 What is (11 - 1) + -10 - 4? -4 Evaluate (5 - (-3 + -6 - -6)) + -18. -10 1 + (7 - 9) + (-1 - -4) 2 What is 0 + -2 + (-3 + 2 - -5)? 2 Calculate 6 + -8 + 9 - 0. 7 Evaluate -2 + (-2 - 4) + 10. 2 What is the value of (-15 - -21) + 1 + -10? -3 Calculate 4 - 1 - (4 - (-3 - -8)). 4 What is -2 - (18 + -11) - -10? 1 Calculate -9 - (3 + -7 + 0). -5 0 - ((-8 - (1 - 5)) + 1) 3 (-7 - -8 - -4) + (1 - 5) 1 What is the value of -11 - (-1 - (-2 - -4)) - -5? -3 Calculate -5 + 11 + -11 + 0 - -7. 2 Calculate -6 - (7 + -2 - 5). -6 What is the value of (-6 - -14 - -5) + -16? -3 Evaluate -1 - (2 - (0 + (10 - 5))). 2 What is the value of 19 + 4 + (-9 - 7)? 7 Evaluate 11 + -3 - (5 - (8 + -13)). -2 4 - (-1 - 4 - -10) -1 Evaluate -3 + (10 - 4) + (-3 - 6). -6 8 - (-1 + 0 - -4) 5 Calculate 4 - 11 - (5 + -19). 7 What is the value of (2 - 0) + -6 + (1 - -7)? 4 Calculate 3 - -1 - -4 - 3. 5 2 + -4 - 2 - 1 -5 What is -5 + -6 + 7 - (-2 + 1)? -3 Calculate 1 + -4 - (0 + 6 - 14). 5 What is the value of 0 - (3 + (1 - (3 - 0)))? -1 (2 - (5 + -1)) + 1 -1 Calculate 7 + -5 + -10 + 7. -1 -2 - ((-7 - -2) + 9 - 2) -4 What is the value of 0 - ((-6 - -5) + 3)? -2 What is the value of (-8 - (5 + -7)) + 13 - 7? 0 What is the value of -1 - (0 + 1) - (6 - 10)? 2 29 + -22 + 3 + -3 + -1 6 -1 - (12 + 1 + -7 - 11) 4 What is -4 + 2 + (0 - -1) + -3? -4 Calculate -2 + 1 - ((-7 - -1) + 2). 3 Evaluate -8 + 8 - (-3 + 2 + 0). 1 What is the value of -1 + (-1 - -3) + 0 + 2? 3 (6 - (1 + 7)) + 7 - 2 3 1 + -4 + 5 + -5 -3 What is the value of 6 + 1 - (7 + -4)? 4 Evaluate (6 - 2) + (1 - 4). 1 What is -5 + 12 - (-2 - 2 - -17)? -6 Calculate -4 + -4 + 3 + 2. -3 (34 - 30) + (1 - 10) -5 Calculate -8 + 2 + 5 + (1 - -4). 4 Calculate 2 + 7 + -3 + -9. -3 Calculate (10 - 1) + (-13 - -4 - -3). 3 (21 - (5 - -5)) + -15 -4 What is the value of -4 + -4 - -5 - -3? 0 Calculate (-1 - (7 + (2 - 6))) + 3. -1 -8 + 5 + (10 - 3) 4 Calculate -2 + -4 + 6 + 2. 2 What is -2 + 1 - (6 + -5 + 2)? -4 -1 - -2 - (0 + 5) -4 Evaluate 6 + (1 - 3 - 2). 2 Evaluate 6 + 4 + -7 - 1. 2 What is (8 + -1 - 0) + -5 - 7? -5 Evaluate -2 + (5 - 12) + 3. -6 What is -6 - (6 - (18 + -5))? 1 Evaluate 0 - -7 - (9 + -9 - -4). 3 -11 + (-6 + 2 - -3) - -3 -9 5 + (-4 + 7 - 8) 0 What is the value of -1 + (-3 - -7) + -8 + 8? 3 What is 18 + -9 + 1 - 16? -6 -29 + 38 - (-3 - -18) -6 What is 4 - (4 - (-1 - 0))? -1 Evaluate (1 - (10 + 2 - 7)) + -1. -5 What is the value of (11 - 3) + -6 - 5? -3 Calculate 1 - (1 - (1 + -4)). -3 What is -30 + 21 + (5 - -2)? -2 Evaluate 1 + (3 - (-4 - -3)). 5 What is the value of -3 + (5 + -3 + 0 - -2)? 1 Calculate 5 + 0 + (-7 - -11) + -2. 7 Evaluate -4 + (-3 - (6 + -8)). -5 (0 - 0) + -5 + 2 + 5 2 Evaluate 1 + 4 - (8 - 7). 4 Evaluate (-1 - 0) + -2 + -14 + 15. -2 (-2 - 2) + -6 + 12 + -5 -3 (0 + 0 - -5) + -4 1 What is (-1 - -7) + (0 - 6)? 0 Calculate -2 - ((4 - 8 - -5) + -3). 0 What is the value of -1 + -3 + (-1 - (-7 - -1))? 1 What is 0 + -6 - -6 - -3? 3 What is the value of (3 - 1) + (-8 - -10)? 4 Evaluate (1 + 1 - 2) + (-3 - 2). -5 What is the value of 5 + -2 + -3 - (2 - 0)? -2 -1 - 5 - -4 - -8 6 What is the value of (1 + -2 - -10) + 46 + -52? 3 What is 4 + (7 + -4 - -1)? 8 Evaluate 2 - (-4 + (2 - (-4 + 4))). 4 Evaluate -4 + 11 - 5 - 4. -2 0 + 5 - (10 + (-3 - 1)) -1 What is (1 - 0 - -1) + -10 + 5? -3 What is -5 + (-4 - -8 - 0)? -1 What is -11 - -13 - (-3 - (-4 + -2))? -1 Evaluate 2 + -2 + (-3 - 3) + 4. -2 -8 + -1 - (-121 - -121) -9 What is the value of 0 + 6 + (14 - 14)? 6 What is (-7 - -5) + (-4 + 7 - 4)? -3 8 - (-2 - 0 - (11 - 18)) 3 What is 12 + 10 + -5 + -10? 7 Calculate (0 - (1 + -3)) + (17 - 12). 7 What is the value of 0 + -7 + (12 - -1)? 6 Calculate -2 - (1 - (-8 - -7)). -4 What is the value of 104 + -110 + 14 + -1? 7 What is 0 - (-5 + 7 + 2)? -4 What is the value of -1 + -1 - (6 - 3)? -5 Evaluate (6 - -1) + -4 + 2. 5 Evaluate 6 + (-9 + 14 - 5). 6 Evaluate -1 + 7 + -8 + -2. -4 Calculate (2 - 3 - 0) + 6. 5 What is (8 - 18) + 2 - -6? -2 Calculate (3 - 11) + 6 + 1 + -4. -5 What is the value of -3 - (-4 + 3) - (-1 + 0)? -1 Calculate -4 + (-1 - (-4 - (-1 + 1))). -1 Evaluate 0 + (6 - (-4 + 10 - -6)). -6 6 + (-18 - -7) - -5 0 What is 0 + (-4 - (-17 - -5 - -5))? 3 Evaluate (3 - 13 - -5 - -5) + 3. 3 Evaluate 0 + (2 - (-1 + 1)). 2 Evaluate (7 - -2) + -5 + -7. -3 What is the value of -4 + 0 + 4 + 1? 1 What is the value of 0 + 1 + -13 + 13 + 4? 5 Evaluate -3 + 1 - (0 + -4) - 0. 2 What is the value of -3 + (6 + -6 - 1)? -4 Evaluate (2 - (-4 + 1) - 2) + -6. -3 Evaluate 7 + -4 - -6 - (0 - 1). 10 What is 3 + -2 + -1 + 2 - 7? -5 Calculate (1 - 11) + (42 - 33). -1 What is -9 + 12 - (4 + -2)? 1 Evaluate (-3 - -9) + -9 + 6 + -5. -2 Evaluate -1 + 0 + -4 + (8 - 6). -3 What is the value of -9 + (1 - -11) + -8? -5 What is 0 + (0 - 0) + (-8 - -8)? 0 What is the value of 1 - ((-2 - (3 + 0)) + 3)? 3 What is the value of 0 + -2 - 7 - -5? -4 What is 9 + -5 + 2 + (-2 - -1)? 5 What is (-4 + 3 - 2) + 7 + 1? 5 Calculate -6 + (-7 - -7 - 4) - -5. -5 What is the value of 4 + -2 - (-19 - -27)? -6 Calculate 29 + -32 - (-10 + 2 + 0). 5 What is -6 + 0 + -1 + 3? -4 What is 5 + -2 + -5 + -3 + -1? -6 Calculate (10 + -12 - -5) + (-6 - -3). 0 What is -3 - (-4 + 1 - 2) - -1? 3 -1 - ((6 - 5) + -1) -1 Evaluate 6 + 0 + (-8 - -4) - 6. -4 Evaluate -13 - (-10 + 15 + -10). -8 Evaluate -6 + 6 + 7 + -10. -3 What is 4 - 0 - (6 + 6 + -7)? -1 Calculate -1 + (3 - -4 - 6). 0 What is 33 - 42 - (0 + -7)? -2 What is the value of -11 + 15 + -9 + 14? 9 Evaluate -1 + -1 + (-14 - 1) + 12. -5 Evaluate 1 + 1 + (9 + -3 - 4). 4 (8 - 8 - -1) + (-4 - 1) -4 Evaluate 14 + -5 + (7 - 13). 3 82 + -77 + (0 - 0 - 0) 5 13 - 10 - (0 - 0) 3 What is the value of -2 - -2 - (-2 - 1 - 0)? 3 Calculate 1 - 0 - 7 - (-189 + 188). -5 What is the value of 14 - 9 - (-4 - -8)? 1 Calculate (2 - (7 + -4)) + 7. 6 2 + -2 - (-7 - -12) - 1 -6 Calculate 0 + 0 + -1 + 1 - 0. 0 Calculate -3 - (2 - (-3 - -8)). 0 Calculate -4 + (7 + -3 - 2) + 0. -2 Calculate 17 - (-5 + 15 + -1). 8 Calculate (7 - (-7 - -6 - -3)) + -11. -6 7 + -4 + (-9 - -4) -2 Calculate -20 + 18 - (-1 + 2). -3 What is (-2 - -1) + 3 - (1 + 6)? -5 Evaluate 5 - (-1 - (6 + -1 - 8)). 3 6 - ((-7 - -13) + 1) -1 Evaluate (5 - 9) + 3 - -1. 0 What is (2 - 18) + 8 + 8? 0 Evaluate 7 - (-6 - (-5 + -5)). 3 What is -42 + 42 + (3 - 6) + 10? 7 What is the value of 2 - 9 - ((-2 - 1) + 2)? -6 Evaluate 3 + 1 + -4 + (2 - -1). 3 Calculate -3 - (-10 - 6) - 21. -8 What is the value of (-1 - -10 - (-6 + 4)) + -6? 5 Calculate (-1 - 1) + 0 + 1. -1 What is -2 + 13 + -11 - (0 - 6)? 6 -1 + 5 + (7 - 14 - -10) 7 Calculate 2 + -2 + (1 - (3 - 3)). 1 Evaluate -2 - (4 - ((4 - -2) + -9)). -9 What is the value of -4 + 0 - (-58 + 46)? 8 Calculate -7 - (-3 + -6) - -2. 4 What is the value of (1 - -4) + (4 - 5 - 4)? 0 106 + -116 + -1 + 4 -7 Calculate -18 - -4 - (4 + -16). -2 Evaluate -1 - (8 - ((1 - 5) + 6)). -7 What is -3 + -4 + 10 + -8? -5 Evaluate -6 + 2 - (0 - (9 + -7)). -2 What is the value of -1 + (-1 - (2 - 1))? -3 What is -1 + 4 + -4 + 7? 6 Calculate -3 + -3 + 1 + 10. 5 Calculate 3 + 6 + 13 + -19. 3 What is the value of (1 - (-10 + 11)) + 9? 9 What is the value of 1 + 0 - (18 + -38 + 20)? 1 Evaluate 4 + 2 - 8 - -6 - 1. 3 What is the value of 9 - ((-2 - -2) + (4 - 0))? 5 What is -11 + (0 - 5) - -13? -3 Calculate -1 + (-4 - -4) - -7. 6 Evaluate 3 - (-1 + -3 + 7). 0 What is the value of -5 + 6 + -6 + 6? 1 Evaluate -4 + 3 - -15 - 13. 1 Calculate (-1 + 6 - 4) + -1 + 1. 1 What is -1 + 1 + (-3 - -7)? 4 What is -5 - ((-7 - 0) + -13 + 13)? 2 Evaluate (12 + -1 - (1 + 3)) + -4. 3 Evaluate (-1 - -6) + -15 + 13 + -1. 2 -1 + -8 + 9 + -2 -2 What is -3 + (-1 - -3 - (-1 + 2))? -2 What is (-2 + (-1 - -4) - 0) + -5? -4 Evaluate 3 - ((0 - 8) + 5) - 3. 3 Evaluate (3 - -1) + (0 - (-3 + 6)). 1 Evaluate -6 + 1 + 7 + (-3 - 1). -2 Evaluate 8 + -4 + -12 + (7 - 2). -3 Calculate 12 + (7 - 24) - -12. 7 5 + (-10 - -3 - -7) 5 -2 + 4 - 11 - -3 -6 Calculate -1 - (-3 + 2 - (1 - 0)). 1 Evaluate -1 - (5 - (-6 - (5 - 16))). -1 What is (21 - 17) + (2 - 1 - 0)? 5 -2 + 1 + -5 + 10 4 Evaluate -3 - -1 - (-2 + 0 - 1). 1 Calculate 3 + (2 - 3) + -8 + 6. 0 Calculate -3 + (8 - -15 - 13). 7 Evaluate (-14 - -5) + 5 + (8 - 4). 0 Evaluate (8 - 3) + -7 + 0 + -8. -10 Calculate 3 + -2 - (9 - 2) - -4. -2 -12 + 11 - (6 +	{ "pile_set_name": "DM Mathematics" }
(w*(-10)/www(2/21))/((w/(w(-2/11)w))/(w*(5/4)w)) assuming w is positive. w(-7241/924) Simplify ((k(-7))(-2/15))(1/5) assuming k is positive. k(14/75) Simplify (s(-1))(17/7)/(s/(s/(s/s(-4/9)))(s/(s/(s/((s/(s(-1/3)s))/s)s)))/s) assuming s is positive. s(-349/63) Simplify ((((f/f19)/f)/((f/(ff19))/f))(42/5))(37/3) assuming f is positive. f(518/5) Simplify (((u/(u/(u*1u)))(-7))(-40))(-33/2) assuming u is positive. u(-9240) Simplify (g/g1)(30/7)/(g(-1/6)/g(-15)) assuming g is positive. g(-89/6) Simplify (h3)(-37)/((h/(h/(h/h(-7)h)))/h(-1)) assuming h is positive. h(-121) Simplify (t(2/3))(7/3)/((t(-2/7)/tt)/t)(-43) assuming t is positive. t(-3385/63) Simplify ((aa/(a/a(-10)aa)aaa)/aa(-4/7))(-6/11) assuming a is positive. a(402/77) Simplify (ss*(-2/5)s/(s(s(-4)/s)/ss))/(s(1/8))(3/2) assuming s is positive. s(433/80) Simplify (t(-2))*(3/2)((t(-2)/t)/t)(1/4) assuming t is positive. t(-4) Simplify (k(-22)/k(-1/18))/((k/(k/k(3/28)k))/k(-6)) assuming k is positive. k(-6817/252) Simplify (u(-5)/(((u(u/(u/((uu(-1/4))/u)))/u)/u)/u))/((u/u6)/u(4/9)) assuming u is positive. u(97/36) Simplify ((s1/s)/(ss/s*(-3)s)((s2/ss)/s)45)(1/59) assuming s is positive. s*(39/59) Simplify ((((((l/(ll/l*(-25)ll))/l)/l)/l)/(l/(ll(1/8)/l)))(1/3))10 assuming l is positive. l(-425/4) Simplify (b*(5/4)bb(-7)/bb)/(b*(3/8)b/(b/((b(b/((b/(b/(bb*2)))/b))/b)/bb))b) assuming b is positive. b(-41/8) Simplify ((v/(vv*(-10/9)))/(v(v/(v/v*11))/vv))/((v*4/v)/(vv*(-4/9)v)) assuming v is positive. v(-37/3) Simplify (w(-10)/(((w/w*(-2/11))/ww)/ww))/(ww(-2/3))(4/11) assuming w is positive. w*(-373/33) Simplify ((h/(hh(h10/h)/h))/((h/h3h)/h))/(h0)32 assuming h is positive. h(-7) Simplify y(-21)/yy/(yy*(-9/2))y*(1/10)/(((yy(-25))/y)/y) assuming y is positive. y(43/5) Simplify ((k*(1/9)kkk*5k)/(k0)(-4/37))(6/13) assuming k is positive. k(146/39) Simplify ((((c/(c/c*(2/7))c)/c)/cccc)(13/4)(c0)40)(-2/11) assuming c is positive. c(-104/77) Simplify (qq/(q/((((q/(q/q(2/3))q)/q)/q)/q))qqqq/(q*(-1/3)/q)(q(-1/2))(-2/25))34 assuming q is positive. q(4284/25) Simplify v*14/(vvv/((v/v(3/4))/v))(v/(v*(2/19)/v)v)(-2/23) assuming v is positive. v(17477/1748) Simplify ((xx9/xx)/xx)17(x(4/7))(2/87) assuming x is positive. x(103538/609) Simplify (d(-2/9))*(3/7)/(dd*(-15/4)d/(d*14d)) assuming d is positive. d*(1399/84) Simplify (o(o*18/o)/o)/oo*(-4/11)o*(-12)/oo(-2/33) assuming o is positive. o(85/33) Simplify ((w*17w)/w(-2/9))/(w/w(-1/5))49 assuming w is positive. w(-1826/45) Simplify (f(-5/3))(-6/7)/(f*20(f*15f)/f) assuming f is positive. f*(-235/7) Simplify (h/(h/(hh*(4/3)h)))(-10/11)/(h(-14)/(hh/h(-4))) assuming h is positive. h(560/33) Simplify (((j/(jj*3j))/(j/j(-2/17)))/(j(2/7))(-3/16))(-43) assuming j is positive. j(207303/952) Simplify (f/f(-1/13)f(-3/5))/(f(1/4)(f(3/10)/f)/f) assuming f is positive. f(501/260) Simplify ((aa/(aa*(-13)))/aaa/(aa*(-2/27)aa))/((a16aa)/a(-2/17)) assuming a is positive. a(-2774/459) Simplify ((nnn14n)/(((n/(nn(-9/7)))/n)/n))/((nn(nn/(n/n5))/n)/n(1/6)) assuming n is positive. n(457/42) Simplify ((j/(j/(j/(j(1/33)/jj)j)))46)(25/6) assuming j is positive. j(37375/99) Simplify (s9/s(-1/2))/(s/s13((s/s7)/ss)/s) assuming s is positive. s(57/2) Simplify (((s(-3)s)/s(3/8))(-2/35))(2/13) assuming s is positive. s(19/910) Simplify ((r/r17r)/r)*(-31)(r(10/9))(-1/31) assuming r is positive. r*(138374/279) Simplify (gg/g(-9))11/((g/(g(g(-14)/g)/g))/gg/((g*(2/15)gg)/g)) assuming g is positive. g(1592/15) Simplify (j(-8)j*7(jj(j/(j*0j))/jjjjjj)(-9/8))(-1/5) assuming j is positive. j(31/20) Simplify ((p19/pp)/(p*(-1/31)p))/((p/(p/(p/p(-1/18))))/p(2/21)) assuming p is positive. p(66683/3906) Simplify ((k(-7)k/k(-1/9))/(k3/(kk(-3))))(-41) assuming k is positive. k(4018/9) Simplify ((j5/j(-2/5))/((j/(j3j))/jj/j(-1)))(-49) assuming j is positive. j(-1813/5) Simplify (((g0/g)/g)*(-3/14)g*3(((g*(-4)g)/g)/g)/gg)(16/5) assuming g is positive. g(-176/35) Simplify u(7/4)u*(-2/13)/uu*(-4)u*(4/13)uu assuming u is positive. u(-57/52) Simplify (v(-3))33(v(-20/9)/v)(-2/49) assuming v is positive. v(-43601/441) Simplify (f6/ff)/(ffff/(f*(1/3)/f)f)f/(fff/(ff*(-12)ff))f/(((f/f(-2/51))/f)/f) assuming f is positive. f(-148/17) Simplify (s/((s/(sssss/(ss(5/6)s)))/s))*(-45)(ss26)/s(-5/4) assuming s is positive. s(-457/4) Simplify ((ccc(-1/2))/c)/(cc*(5/6))(c*2/cc)(1/17) assuming c is positive. c(-62/51) Simplify ((g(-1))(-3/13)/((g/(g/g*(-4))g)/((gg3)/g)))(28/5) assuming g is positive. g(2268/65) Simplify (b(-2/7)bb(-13))/(((bb(-1/2))/b)/b)(-36) assuming b is positive. b(-464/7) Simplify x(18/11)x(-13)(x/x*(-17)x)/x(x(x/x*(-2))/xx)/x assuming x is positive. x*(106/11) Simplify (((rr/(r/(rr/r(1/12))))(-21))(-31/4))(-10) assuming r is positive. r(-37975/8) Simplify (((o/(oo(8/5)))/o3)(-2/43))5 assuming o is positive. o(46/43) Simplify v(-3/2)(v(4/9)vv)/vv*3(v*(-1/15)v)/v assuming v is positive. v(259/90) Simplify (k(-12)/k(-2/19))/(k(-7/4)kk20) assuming k is positive. k(-2367/76) Simplify ((yy(-5/2)y)/y)*(-14)((yy(-3))/y)15 assuming y is positive. y(-24) Simplify ((z/(z1z)z)/(z6z)(z/(zzz/(z4z)))/(zz/z(1/3)z))16 assuming z is positive. z(-320/3) Simplify ((f/f*(-1/4))/(f/(f(f/(ff/f(2/3)f))/f))f7/ff(-1/13))(1/11) assuming f is positive. f*(755/1716) Simplify (nnn/(n/(n/((n/(nnnn*(-28)))/n))n)nnn(-2/57)n)(-1/55) assuming n is positive. n(1142/3135) Simplify (((x(6/7)/x)/(x(2/21)xx))(-26))(25/2) assuming x is positive. x(15275/21) Simplify (w(7/2)/(w*(-1/7)/w))/((ww*(2/3)w)/w(-1/6)) assuming w is positive. w(38/21) Simplify (o(-1))(-2/57)(oo*0o)/(o/(o/(o(-11)/o))) assuming o is positive. o(800/57) Simplify (b(-3/13))(-43)/((b(5/7)/b)/b(3/7)) assuming b is positive. b(968/91) Simplify (((h/h(-16))/h)(17/7))(-1/18) assuming h is positive. h*(-136/63) Simplify (zzzz*(-5)z)/(z(z(7/2)/z)/zzz)((z/(z/z7))/z)(-42) assuming z is positive. z*(-515/2) Simplify ((hh*(1/9)hh(-13))(-2/45))(6/31) assuming h is positive. h(392/4185) Simplify (q(2/7))10/(q(-2/13))39 assuming q is positive. q(62/7) Simplify ((f(8/3)/ff)39)(-10/9) assuming f is positive. f*(-1040/9) Simplify ((o/(o/(o/((o(o*(-9/2)/oo)/o)/o)))o/(o/(o/(oo/(o/o*2)oo))))/(((oooo/((o/(o*1/o))/o)oo)/o)/o(-10)))(7/9) assuming o is positive. o(-175/18) Simplify (((t/(tt*(3/10)t))/t)/t(-21))(2/85) assuming t is positive. t(11/25) Simplify c7(cc*(-1))/c(ccc/(c/c*4)c)/cc(c((ccc1)/c)/c)/c assuming c is positive. c14 Simplify (k(-2/17))(-19)k*(-1/3)k(1/7) assuming k is positive. k(730/357) Simplify (xxx(3/5))/x(-2/19)xx(x/x(10/9))/xxx(3/4)x assuming x is positive. x(21697/3420) Simplify p14/pp(-4/7)(p(p/p(1/5))/p)5 assuming p is positive. p(115/7) Simplify ((cc(cc(1/3))/c)30/(c*(1/6)((c/(cc(-2/3)/c))/c)/c))4 assuming c is positive. c(842/3) Simplify (j/(((j2j)/j)/j))*(-48)(j(-4)/j)(-8) assuming j is positive. j40 Simplify (s23s)(-39)/((s/(ss(-1/4)))/(s/s(-1/33))) assuming s is positive. s*(-123449/132) Simplify ((uu/(u(u/(((uu*(2/5)/u)/u)/u)u)/uu))33/(u(-1/2)u)31)(7/2) assuming u is positive. u(-7091/20) Simplify (((r(-5)r)/r)/rr(-7/2))/(r(-10)r(rr/r(5/4)r)/r) assuming r is positive. r*(-5/4) Simplify (vv(3/2))18((v(-14)v)/v)/(v/(v(-2)/v)) assuming v is positive. v27 Simplify ((o(8/9))(1/10))(-36) assuming o is positive. o(-16/5) Simplify (n**(-	{ "pile_set_name": "DM Mathematics" }
sqrt(2))-3 + sqrt(2)))2. 432sqrt(2) + 611 Simplify (-1(sqrt(320) - 2sqrt(320)-1 - sqrt(320)))2. 1280 Simplify 5 + 2 + -1 + -1sqrt(19). -sqrt(19) + 6 Simplify 5(sqrt(13)1-5)2. 1625 Simplify -1 + (-5sqrt(7))*2 + ((sqrt(14)-1 - sqrt(14))/sqrt(2))*2. 202 Simplify (sqrt(5) - (0 + sqrt(5))) + -4 + -2. -6 Simplify ((sqrt(2736) - (-3(0 + sqrt(2736)))*2) + 1)2. -49246 + 24sqrt(19) Simplify -4(sqrt(300) - sqrt(300)3)2. -4800 Simplify ((sqrt(192) - (-1 + sqrt(192)))2 - sqrt(192))-6. -6 + 48sqrt(3) Simplify 5(3 + sqrt(11)3)2. 90sqrt(11) + 540 Simplify (sqrt(76) - sqrt(76)2-2)/(-1sqrt(4)-6 + sqrt(4)). 5sqrt(19)/7 Simplify 2 + sqrt(171) + -5(sqrt(19) + 1). -2sqrt(19) - 3 Simplify (-23sqrt(152))/sqrt(8). -6sqrt(19) Simplify ((-2sqrt(70)-5)/sqrt(10))*2. 700 Simplify (sqrt(63) + (2sqrt(378))/sqrt(6))2. 567 Simplify (sqrt(117)/sqrt(144) - (sqrt(117)/sqrt(36) - sqrt(13)))2. 117/16 Simplify 5 + ((sqrt(343)-3 + sqrt(343))-4)*2. 21957 Simplify 1sqrt(1331) - (2sqrt(11)2)*2. -176 + 11sqrt(11) Simplify (-6sqrt(24)/sqrt(8) + -3)2. 36sqrt(3) + 117 Simplify sqrt(45)/(sqrt(9) - ((sqrt(9) + sqrt(36))-6 + sqrt(9) + sqrt(9) - sqrt(9))). sqrt(5)/18 Simplify 2(((5(1 + sqrt(171)) - sqrt(171)) + sqrt(171))2 - sqrt(171)). 294sqrt(19) + 8600 Simplify 53sqrt(304). 60sqrt(19) Simplify (sqrt(20) + sqrt(20) + -1 + sqrt(20))2 - 4(sqrt(5) + -2). -16sqrt(5) + 189 Simplify -3-3sqrt(175) + sqrt(175) + sqrt(175). 55sqrt(7) Simplify -3((sqrt(637) + -1)2)*2. -7656 + 168sqrt(13) Simplify sqrt(320) + 1 + sqrt(320) + 3. 4 + 16sqrt(5) Simplify (2 + (sqrt(24)3)/sqrt(12) + sqrt(128) + 2 + sqrt(2))*2. 96sqrt(2) + 304 Simplify (sqrt(320) + -1 + -5)*25 + -3. -480sqrt(5) + 1777 Simplify sqrt(15)/((sqrt(192)4 - sqrt(192) - sqrt(192) - sqrt(192) - sqrt(192)) + sqrt(192))-3. -3sqrt(5)/8 Simplify (sqrt(448)-2)2-3-41. 21504 Simplify (0 + sqrt(27) + sqrt(48) + 1)*2. 14sqrt(3) + 148 Simplify (1 + (-4(sqrt(20) - sqrt(5)) - sqrt(5)) + 3)2. -40sqrt(5) + 141 Simplify (sqrt(7) + sqrt(3087))*2 + 3 + 2. 3393 Simplify (1sqrt(11) + 0 - (0 + sqrt(11) + 4))2. 16 Simplify -5 + (-4 + sqrt(567) - sqrt(567) - sqrt(567))2. 72sqrt(7) + 578 Simplify -3 + (sqrt(396) + -4)2 + 4. -48sqrt(11) + 413 Simplify (((sqrt(78)1)/sqrt(6) + 0)-2)*2. 52 Simplify -3 + (sqrt(48) - -1sqrt(48)) + sqrt(48). -3 + 12sqrt(3) Simplify (sqrt(6) + sqrt(216)2 + sqrt(6))/sqrt(1200). 7sqrt(2)/10 Simplify (sqrt(18) + (2sqrt(198) + sqrt(198))/sqrt(11))/(sqrt(24)/sqrt(4)1). 4sqrt(3) Simplify (-1 + sqrt(14)/(sqrt(128) - (-1sqrt(128) - sqrt(128)))-6)*2. sqrt(7)/2 + 23/16 Simplify (sqrt(1536)-2 - sqrt(1536))/sqrt(12). -24sqrt(2) Simplify -3 + sqrt(343) + sqrt(343) + sqrt(343) + (-1sqrt(343))*2 + 2. 21sqrt(7) + 342 Simplify (3(2 + sqrt(1300)))2. 360sqrt(13) + 11736 Simplify 4(sqrt(19) - -2sqrt(19)5). 44sqrt(19) Simplify (2sqrt(57)/sqrt(3) + sqrt(19) + sqrt(19)-2-3 + 3)2. 54sqrt(19) + 1548 Simplify (sqrt(20) + 5sqrt(40)/sqrt(2))/(sqrt(44)/(sqrt(11) + sqrt(99))). 24sqrt(5) Simplify (-5(1 + sqrt(9)/sqrt(3))3)*2. 450sqrt(3) + 900 Simplify 3 + (1sqrt(567))2 + -1 + (sqrt(567) - -1sqrt(567)2). 27sqrt(7) + 569 Simplify sqrt(6)/(sqrt(21)/(sqrt(63) - sqrt(7))). 2sqrt(2) Simplify 4 + -2((sqrt(720) - -2sqrt(720))2 + -4). -12948 Simplify sqrt(75)3-4. -60sqrt(3) Simplify 4sqrt(51)/sqrt(3) + (0 + sqrt(17))-3. sqrt(17) Simplify -2(sqrt(567)1)*2 - ((sqrt(567) - (2sqrt(567) - sqrt(567))) + 0 + sqrt(567)). -1134 - 9sqrt(7) Simplify (1sqrt(153) - sqrt(153))/sqrt(9) - sqrt(17)-24. 8sqrt(17) Simplify (sqrt(77) + (sqrt(77) - (3sqrt(77) - sqrt(77))-1))/(-2sqrt(11)3). -2sqrt(7)/3 Simplify (sqrt(475) + 1 - sqrt(171)3)23. -24sqrt(19) + 915 Simplify 5 + 5-2sqrt(11). -10sqrt(11) + 5 Simplify sqrt(36)/(sqrt(12)-1-4 - sqrt(12))6. 2sqrt(3) Simplify (sqrt(171)/sqrt(36) - sqrt(133)/sqrt(28))2. 0 Simplify (sqrt(704) + -1 + sqrt(704))2 - sqrt(11) - (-2 + (sqrt(11) + 1)*2). -35sqrt(11) + 2807 Simplify (5 + sqrt(13)1 - sqrt(13))21 - (sqrt(13) + (sqrt(143)-2)/sqrt(11) + sqrt(13))2-4. 25 Simplify 6(sqrt(396) + -2). -12 + 36sqrt(11) Simplify (2sqrt(26)-5)/sqrt(128). -5sqrt(13)/4 Simplify (3(sqrt(117) - sqrt(117)2)-5)*2. 26325 Simplify ((1 + sqrt(75))-4)*2. 160sqrt(3) + 1216 Simplify (((sqrt(143) + (sqrt(143) - sqrt(143)2) + sqrt(143) - sqrt(143)) + sqrt(143))4)/sqrt(11). 4sqrt(13) Simplify (sqrt(35) - -4-1sqrt(35))/(3sqrt(180)). -sqrt(7)/6 Simplify sqrt(34)/(sqrt(16)/sqrt(968)). 11sqrt(17) Simplify (4sqrt(80))*2 + -4 + (sqrt(80) + 1 + sqrt(80))5. 40sqrt(5) + 1281 Simplify (sqrt(143) - ((-5sqrt(143)-1 - sqrt(143) - sqrt(143)) + sqrt(143)))/sqrt(11) - (-3 + (sqrt(13) - (sqrt(65) - -2sqrt(65))/sqrt(5) - sqrt(13))). 3 Simplify (-5 + (sqrt(192) - (-1 + sqrt(192))))*2. 16 Simplify 4(sqrt(12)/(sqrt(36)/sqrt(6)) - sqrt(2))5. 0 Simplify (sqrt(3) - (sqrt(3) + (2sqrt(12) - sqrt(3))))2 + (sqrt(54)/sqrt(2))2 - sqrt(6)/(sqrt(2) + sqrt(6)/sqrt(3))-6. 3sqrt(3) + 54 Simplify sqrt(171) + (-2sqrt(171)2)*2 + sqrt(171) - sqrt(171). 3sqrt(19) + 2736 Simplify sqrt(91)/(2sqrt(7)1). sqrt(13)/2 Simplify (-2 + sqrt(76) + 2 - (2 + sqrt(76) + sqrt(76))5)2. 360sqrt(19) + 6256 Simplify -1 + sqrt(605)-2 + -1. -22sqrt(5) - 2 Simplify -3(-6-31sqrt(684))*2. -664848 Simplify -3 + sqrt(175) + 3. 5sqrt(7) Simplify -5(-1 + sqrt(17))4. -20sqrt(17) + 20 Simplify ((sqrt(180)2)/sqrt(12))/sqrt(3). 2sqrt(5) Simplify 3 + -1sqrt(891) - (-2(sqrt(891) - 2sqrt(891)) + sqrt(891)). -36sqrt(11) + 3 Simplify (sqrt(1053) - (-2sqrt(1053) + 0)) + -5. -5 + 27sqrt(13) Simplify (32sqrt(88))/(1sqrt(32)). 3sqrt(11) Simplify -5(-3 + (sqrt(1216) - (sqrt(1216)-1)2)). -40sqrt(19) + 6095 Simplify -4 + (sqrt(6)/sqrt(3) - sqrt(2)) + -2 + 2. -4 Simplify sqrt(13) - (1(1sqrt(13))*2 + sqrt(13)) - sqrt(65)/(sqrt(5)-2). -13 + sqrt(13)/2 Simplify (sqrt(18))*23 + (1 + sqrt(162) + sqrt(162) - sqrt(162) - sqrt(162))*2. 55 Simplify (sqrt(99) + (sqrt(99) - (sqrt(99) - sqrt(99)3) - sqrt(99) - sqrt(99))2)/sqrt(9). 3sqrt(11) Simplify -3(0 + sqrt(2)) + 4. -3sqrt(2) + 4 Simplify (1(sqrt(132) + sqrt(132)-2 + sqrt(132)))/(sqrt(540)/sqrt(5)). 0 Simplify 0 + (sqrt(6)/sqrt(2)1)2. 3 Simplify (5 + (sqrt(152)-1-2)/(-4sqrt(32)))*2. -5sqrt(19)/2 + 419/16 Simplify (sqrt(125) - (5 + sqrt(125) + (sqrt(125) - (2sqrt(125))2) - sqrt(125))) + -4 + sqrt(125)2. 10sqrt(5) + 491 Simplify 1(sqrt(304)34)*2. 43776 Simplify (sqrt(144)2)/sqrt(3). 8sqrt(3) Simplify -4((-3 + sqrt(76) + -3)*2 - sqrt(76)). -448 + 104sqrt(19) Simplify -6(2 + 5 + sqrt(720)). -72sqrt(5) - 42 Simplify 5sqrt(44)1. 10sqrt(11) Simplify (sqrt(39)/sqrt(48) + sqrt(39)/sqrt(3) + 0)6. 15sqrt(13)/2 Simplify ((sqrt(72)/sqrt(9) - (1 + sqrt(72))) + 2)2. -8sqrt(2) + 33 Simplify (1sqrt(1573)-2)*2. 6292 Simplify (sqrt(77)/(sqrt(700)5))*2. 11/2500 Simplify (sqrt(85) + sqrt(85) + (sqrt(85) + (-1sqrt(85) - sqrt(85)) - sqrt(85))-3)/((sqrt(40)2)/sqrt(8)). 4sqrt(17) Simplify (4 + 2sqrt(13) - sqrt(13)) + 4. sqrt(13) + 8 Simplify -6sqrt(833)2 + sqrt(833). -77sqrt(17) Simplify -1 + (-1 + sqrt(700))-1. -10sqrt(7) Simplify 4(1 + sqrt(1300) + -1)2. 5200 Simplify (1 + sqrt(117)/(sqrt(36)/sqrt(4)))2 + 6(sqrt(13) - -1sqrt(13)) + sqrt(13) + ((-2sqrt(468))2 - sqrt(468)). 9sqrt(13) + 1886 Simplify (sqrt(117)-24)/((-2sqrt(81))/sqrt(9)). 4sqrt(13) Simplify (3(sqrt(13)-2 + -4))*2. 144sqrt(13) + 612 Simplify (sqrt(220) - ((sqrt(220) - sqrt(220)-4) + sqrt(220)))/sqrt(5). -10sqrt(11) Simplify ((2sqrt(400))/sqrt(8))/sqrt(10). 2sqrt(5) Simplify (sqrt(7) + 1sqrt(7)-5)*2 - ((sqrt(7) - (sqrt(7) + -3 + sqrt(7)))5 + sqrt(7)). 4sqrt(7) + 97 Simplify (sqrt(10)/(sqrt(2) - (sqrt(72) - sqrt(2))))2-6. -15/8 Simplify -3 + 0 + sqrt(176). -3 + 4sqrt(11) Simplify (sqrt(125) - ((sqrt(125) + 0)-2)*2) + sqrt(125). -500 + 10sqrt(5) Simplify -6(sqrt(325) + -2)2. -1974 + 120sqrt(13) Simplify sqrt(14)/(sqrt(21)/(sqrt(3)-1)). -sqrt(2) Simplify 3(sqrt(208)-24)*2. 39936 Simplify (sqrt(224)/sqrt(4))/sqrt(8) + (-2sqrt(42))/sqrt(6). -sqrt(7) Simplify 2sqrt(13)-3 + (sqrt(39)/(sqrt(3)1))2. -6sqrt(13) + 13 Simpl	{ "pile_set_name": "DM Mathematics" }
= 13278 + -13270. Solve -3y = 3d + 21, -wy - 14 = d + 14 for d. -4 Let x = -194 + 196. Solve i + 11 = -8b + 6b, -xi - b - 7 = 0 for i. -1 Let g be (-1 + -1 + 2 + 0)/((-213)/213). Solve 5r - 2 = -3v, g = -r + 5r - 4 for v. -1 Let w = -4 + 6. Let l(a) = -a3 + 5a*2 + 2. Let s be l(5). Suppose -12c + 7c + 70 = 4o, -4c + 56 = 5o. Solve -su + 5u + 16 = wn, u = 5n - c for n. 2 Let p be ((-5)/((-25)/24))/(54/135). Solve o = 3n + p, -5o - 4n + 8n = -5 for o. -3 Let y be 2 + (-52)/20 - 90/(-150). Solve y = 2b - 5k - 20, -3b - 5k - 2 - 18 = 0 for b. 0 Let w(v) = -2v3 + 30v*2 - 30v + 21. Let k be w(14). Let x be (-2)/k - 9/42-22. Solve 3a - xy + 10 = 0, -2a - 6 = -a - 3y for a. 0 Let o(k) = -k3 - 17k*2 - 20k - 19. Let x be o(-16). Suppose -x = -10m + m. Solve 5h - 4 = 3g, mh - 9 - 9 = -4g for h. 2 Let i(q) = -q - 3. Let f be i(-4). Suppose 3d = -2a + 58, 51d = 8a + 48d - 142. Solve 2b + 3t = 17, -b - 5t - f = -a for b. 4 Suppose 0 = 47t - 251t + 2349 + 4383. Solve 0 = -3x - 3a + 12, -5a + 53 - t = x for x. 0 Let v(t) = -t*3 + 5t*2 + 15t. Let g be v(7). Suppose gd - 66 = 25. Solve 2h + d = -5i + 4i, h + 29 = -5i for h. -4 Let b = 1316 - 1316. Solve p - f + 3 + b = 0, 5p + 4f + 6 = 0 for p. -2 Let q = 3555 - 3552. Solve -qj + 19 = 4f, -4j - 4f + 9 = -3j for j. 5 Suppose -3t = -6b + 8b + 1669, b = 3t + 1663. Let d = t + 560. Let w = -4 - -6. Solve dh = u - 12, 4u + 4h - 4 = wh for u. 2 Let w be (2 + 0)/(-1 + (-9)/(-6)). Suppose wk = 2p + 58, -3k - 93 = 3p + 2p. Let q be (-10)/6(p/5 - -3). Solve 14 = qz + 4u, -7 = -4z - 4u + 13 for z. 3 Let o be 3406/655 - 2/10. Solve 0 = -4b + oj - 37, 10 = 5b - 41j + 46j for b. -3 Let a = 69 + -34. Suppose 0 = 2t + 6, i + 5t = 6i - a. Suppose -f - 4 = iu, 4f = -u - 2u - 3. Solve 3y - 2s = -0s - 5, f = y + s for y. -1 Let c(m) = 2m2 + 4m - 1. Let x be c(-3). Let q(z) = -z*3 + 8z*2. Let f be q(0). Suppose -w + x = -fw. Solve 5 = -2r + wa - 2a, -3r = -2a - 5 for r. 5 Let u(r) = -8r + 19. Let t be u(14). Let s = t + 96. Solve 3y - 20 = -f, 0 = -2f - sy + 4y + 5 for f. 5 Let y(l) = 2l2 + 93l + 49. Suppose 0 = -5a - 5d - 235, -2a = 2a - d + 183. Let j be y(a). Solve jt - 9 = -3p, -3p + 2 = 5t - 9 for p. 2 Let j be 4/(-1)(-10 - -4)/6. Suppose 2f = -jo + 12 - 4, -3o + 5f = -32. Solve -3y - 9 = oh, 0y - y - 3 = -h for h. 0 Suppose 11 = o - 174. Let l = 187 - o. Solve -n - 2 - l = -5u, -8 = 4u + 2n for u. 0 Let v be 4/14(18/4 + 13). Solve 3q = -2y - 10, 5q + 8y + 15 = vy for q. 0 Let a be ((-111)/(-555))/((-1)/(-30)). Solve 4l - a + 0 = s, -3l + 2s + 2 = 0 for l. 2 Let b = -6 - -9. Suppose -2l - 1 = -2s + 7, bs = 2l + 13. Let y = s + -5. Solve k + 4 = -2g, 3k + yk + 12 = 4g for g. 0 Suppose -857 = -139d + 1367. Solve 0 = -4i + b - 0b + d, i - b - 7 = 0 for i. 3 Suppose -4r = -8, -q + 4r - 8 = -5q. Suppose 4n + qn = 4c, -4n = -20. Solve ca = -3y - 21, 4y - 5a = 8 - 1 for y. -2 Suppose -2h + 7h + 95 = -5y, 0 = -2y - h - 34. Let m be 184/40 - (-2)/y-3. Solve -mu - 3w + 15 = -2u, -3u + 15 = 5w for u. 5 Let r be 6/276(-72)/(-16). Suppose 0 = -ra + 5a. Solve d + 2d - 13 = 2h, a = -3h + 4d - 19 for h. -5 Let l(n) = 2n - 7n - n - 5n + 31. Let a(j) = 5j - 15. Let h(g) = 13a(g) + 6l(g). Let b be h(-13). Solve 4f + 3z + 44 - 17 = 0, bf + 2z = -22 for f. -3 Let b(q) be the second derivative of q*4/12 - 35q*3/6 + 129q*2/2 - 27q + 2. Let m be b(31). Solve 3s - 23 = -5u + 2, 0 = -u - 2s + m for u. 5 Let b be 308/(-28) - 2(1 + 1). Let y = b - -16. Solve 3d = -x + 10, -d + 0x + y = -2x for d. 3 Suppose 5l - 61 = -3k, -l + 11 = -0k + k. Let x be 12/(-18) - 5/((-15)/l). Solve 4u - r - 2r = 1, -6 = -3u + xr for u. -2 Suppose -4832n + 4814n = -342. Solve 0 = -b + 5g + 20, 2g - 5 = -16b + nb for b. -5 Let r be 36/(-15) - (-2)/5. Let c be (2/(-3))/(r - 830/(-420)). Solve 5q + 10 = 0, -4i = -8i + 4q + c for i. 5 Let h = 256 - -28. Let o = h + -281. Solve 5r = -ol + 2, 4r - l + 16 = l for r. -2 Suppose -3u = -5u - 27u + 8u. Solve 2z - 5f = 22, -z - 2f - 5 - 2 = u for z. 1 Let a = -397 - -252. Let d = a + 147. Solve 5n - 12 = dw, 0n - n + w = 0 for n. 4 Suppose -197 + 5 + 12 = -12j. Solve 5 = 40r - 35r, 4o + r = -j for o. -4 Let t(p) = 5p + 30. Let o be t(-6). Suppose x - 22 = -0x - 5j, 2j = 4x. Solve l + 4u + 13 = 2u, o = 5l - xu + 17 for l. -5 Let j be (2 + -1)-6 + 6/3. Let g be -45j/(-36)-3. Suppose gb = 20b - 10. Solve bd = -5x + 5, 5d + 5x + 12 - 2 = 0 for d. -5 Let c = -49 + 39. Let d(x) = 2x + 19. Let w be d(c). Let j be (-6)/4 - w - 11/(-2). Solve 5s - 30 = -jv, 0 = -2s - 4v - 3 + 19 for s. 4 Let r = 19 + -21. Let u be (-10 - -6) + 8 + r. Solve 0 = -3z + s - 14, 2z = -uz + 5s - 37 for z. -3 Suppose 20j - 4j = 32. Solve -2f + 4d = j - 12, 0 = d + 5 for f. -5 Let a be -115 - (-6 - (-2 - -3)). Let h be 11 + (396/a - 2/6). Suppose -q - 2q = -15. Solve -k + 17 = 3x, -5k - 2 = -qx - h for x. 4 Let j(v) = 5v2 + 19v + 47. Let u be j(-6). Let m = u - 109. Solve -3d = 3w - 21, -m = 2d - 3w + 2 for d. 3 Suppose -p + j = p - 59, 3j = -3p + 93. Suppose 11b = 25 + p. Solve -bw + 35 = 6d - 2d, 17 = 4w + d for w. 3 Suppose -74q - 58 = -78q + 2y, 4q + 5y - 65 = 0. Solve 0 - 13 = -4h - 3r, -q = -5r for h. 1 Suppose 14 - 20 = 2r, 10x - 2r = 376. Solve -42h + xh = 4p + 26, 14 = -5h - p for h. -2 Let p be (-3 + 7 - 4)/2. Suppose -29u + 32u - 15 = p. Solve -s - 8 - u = 3b, 5s = -5b - 35 for s. -4 Let i = 33 + -28. Let t(v) = -3v - v + iv. Let l be t(0). Solve 2r - y + 7 = -2r, 4r - 4y - 8 = l for r. -3 Let m be 042/(-16). Let d = -13 + 47. Let t = d + -32. Solve -y + t = j, j = y - mj for y. 1 Let s = -342 + 356. Suppose 11u - su = 4d - 5, -u - 30 = -5d. Solve 2r - 6 - 2 = 4b, dr + b - 9 = 0 for r. 2 Suppose 124 - 796 = 48l. Suppose -3k + 32 = 5j - 3j, 2j - 4k - 32 = 0. Let t = j + l. Solve -4a = -4b - 12, -tb - 5a + a = 18 for b. -5 Let l = -27 - -29. Let g(s) = -s2 + 91s - 587. Let m be g(7). Solve -3n - l = 5a, 2a - m = -4n - a for n. 1 Suppose -20p + 13p = -121p. Solve 0 = -7h + 4h - 5g + 3, -3g = p for h. 1 Suppose 178 + 129 = 213l - 119. Solve -2w = -lm, 15 = 3w + 3 for m. 4 Let h = 170 + -80. Let g be ((-480)/h)/((-2)/(-6) - 1). Suppose r + 6 = g. Solve -4c + rc - 3u - 8 = 0, -3c = -2u - 1 for c. -1 Suppose -5y - 56 = -v + 5v, -y = -2v. Let c be y + (-3)/((-6)/16). Solve 3x - 3z + 8z - 25 = 0, 3z - 6 = c for x. 5 Let r(y) = y3 - 6y*2 + 4y - 22. Suppose 5w = 24 + 6. Let h be r(w). Solve 2f + 16 = -4s, -5f + 0f + hs = -20 for f. 2 Suppose -100d - 3303 + 13285 = 222d. Solve -2k - 6 = 0, -dc + k = -32c for c. 3 Let p be (1170/(-20))/(-13) - (-42)/(-12). Solve -p = -k - 4s, 1 = -k + 2k - s for k. 1 Let d be (-3470)/(-4) - 31/(-62). Suppose 0 = 6p + 25p - d. Solve 0 = -5r - 20, 2f - 4r - p = r for f. 4 Let x(d) = 3d2 + 71d + 374. Let v be x(-7). Solve -2f = -8, 20i - vi + 2f - 28 = 0 for i. -5 Suppose 245205 - 245166 = 13a. Solve 5y - y = -4, -5i = -ay - 13 for i. 2 Suppose 132h - 127h - 15232 = -443h. Solve -m = 0, 5v - hm = -35m + 25 for v. 5 Suppose -5r + 2 = -3r. Let c be r/(-5) + 126/30. Suppose -2x = -4a - 12, -2x = x - 5a - 16. Solve 8 = -4b, -u + 11 = -cu + xb for u. -5 Let f = 17829 + -17827. Let l = -178 + 333. Suppose -5u - l = -10u + g, 0 = -5u - 3g + 155. Solve -5c + fx = -30, 5 = -4c + 2x + u for c. 4 Let f(u) = -2u*2 - 16u + 3. Let a be f(-8). Suppose 0 = ah + 509 - 89. Let t be h/(-6) + (-24)/72. Solve -3w - 4g + 0g = -t, 4w + 6 = 2g for w. 1 Suppose u - 2 - 4 = -5c, 2c = -u. Suppose 3p - 6 = -y + 4, -5y = -cp - 16. Suppose -3 = -pf + 23. Solve b - f = 3o, 4o + 29 + 3 = 5b for b. 4 Suppose 11i - 9i = 3t - 16, -4t + 4i + 32 = 0. Solve 2l + 7 = -13f + 12f, -4l - 4f - 12 = t for l. -4 Let r be 2/(-10) + 26/5 + (-33)/(-33). Solve 0 = 3l - r, -6l + 1 = 3g - l for g. -3 Let n be 24/20 + ((-24)/(-5))/6. Solve 12d + 4 = 9d + nf, 3d = -f + 11 for d. 2 Suppose 5q = 9p - 9, -q + 9p - 12p	{ "pile_set_name": "DM Mathematics" }
- 3z(l). Give o(1). -6 Let k be -1 + -2 + (-15)/(-3). Suppose 0 = -kz + z. Let h(b) = b2 + b - 2. What is h(z)? -2 Let v(a) = -a2 - 5a - 2. Let d(i) = -3i + 3. Let y be d(4). Let k be ((-6)/y9)/(-1). Give v(k). -8 Let x(z) = 5z*2 + 5z + 3. Let q(g) = -11g2 - 11g - 7. Let d(r) = -6q(r) - 13x(r). Determine d(-3). 9 Let j(i) = 13i2 + 4i*2 + 2i*3 - 3i + 15 + 5i. Let d(w) = w3 + 9w*2 + w + 8. Let x(b) = 11d(b) - 6j(b). What is x(-3)? 1 Let b = -4 - -6. Let n(l) = -l2 - l. Let k(u) = 2u3 + u2 + 6u + 2. Let s(h) = k(h) + 4n(h). Determine s(b). 10 Let z(f) = -4f + 34. Let h be z(8). Let o(r) = -2r*2 + 2r - 1. Determine o(h). -5 Let u(g) = g - 5. Suppose 4b - 4 = 28. Give u(b). 3 Suppose 0 = 4g - 5 + 13. Let x be ((-3)/2-4)/2. Let c(v) = -v + v3 + 4v + 4v2 - 2 - xv. Calculate c(g). 6 Let k = 10 + -8. Suppose 0 = -0q - kq - 4. Let u(b) = -9b2 + 3b + 9. Let n(t) = 14t2 - 5t - 14. Let g(p) = 5n(p) + 8u(p). Determine g(q). -4 Let q be (-13 + 5)(-2)/4. Let h(b) = b3 - 5b*2 + b - 4. What is h(q)? -16 Suppose -5t + 15 = 0, 2t + 2 = -0m + 4m. Let f(q) = qm + 0q + 3 + 2q + 0q2. Let s(p) = p3 - p + 3. Let h be s(-2). Give f(h). 6 Let b be -10((-8)/(-10) - 0). Let m(c) = c2 + 5c - 9. Let i be m(b). Suppose -6 = 3j + z - 4, 0 = 3z + i. Let r(x) = 2x + 1. Give r(j). 3 Let t(x) = -x2 - 15x + 4. Let o be t(-15). Let g(l) be the first derivative of -l*2 + 1. Calculate g(o). -8 Let b(g) = 5g + 3g + 6 + 20. Let w(z) = z + 1. Let x(n) = 3n + 2. Let u(o) = 21w(o) - 6x(o). Let y(m) = -4b(m) + 11u(m). Determine y(-4). -9 Let x(s) = 4s + 1 + 2 - 4 - 5s. What is x(0)? -1 Let y(z) be the second derivative of z7/60 + z6/360 - z5/60 + z4/24 - 5z3/6 - 5z. Let h(r) be the second derivative of y(r). What is h(1)? 14 Let w(k) = 4k2 + k + 3. Let z(s) = -3s*2 - s - 3. Let h(y) = -6w(y) - 7z(y). Let d(a) be the first derivative of h(a). Give d(-1). 7 Let k(g) = 10g*2 + 2g + 1. Suppose -m + 5 = -0. Suppose -10 - 5 = my. Let u = -4 - y. Calculate k(u). 9 Let a(y) be the third derivative of -y6/120 - y5/60 + 5y*4/24 + 2y*3/3 + 17y2. What is a(-3)? 7 Let r(k) = -k2 - 4k - 2. Let j(o) be the first derivative of -o3/3 - 4o*2 - 8o + 2. Let a be j(-6). Let l be (6/a)/((-1)/2). What is r(l)? 1 Let m(p) = -p*2 + 5p + 2. Let b(n) be the second derivative of -n*4/12 + 5n*3/3 + 5n*2/2 + 5n. Let d be b(10). Calculate m(d). 2 Let q(v) = v*3 - 7v*2 + 6v - 5. Let y be 03/6 + 6. Determine q(y). -5 Let r be (1 + -1)/(-1 + 0). Let c(g) be the second derivative of -3/2g*2 - 1/12g*4 - 3g + 0 + 1/6g3. Calculate c(r). -3 Let n(p) = 0p*3 - 3p*3 + 8p*2 + p + 2p*3 - 2p*2 - 2. Let h = 6 - 0. Give n(h). 4 Let z(w) = w - 2. Let m be z(4). Let k(c) = -5 - 2c - 2c2 + c2 + c. Let i(b) = 2b*2 + b + 9. Let f(d) = 3i(d) + 5k(d). What is f(m)? 2 Let n(d) be the first derivative of -d6/120 - 4d*3/3 - 3d2/2 + 6. Let m(r) be the second derivative of n(r). Give m(0). -8 Let c(u) = -u2 - 2u - 2. Let g(o) = o2 + 2o + 1. Let i(d) = 4c(d) + 5g(d). Calculate i(2). 5 Let d(s) = -s*3 + 24s*2 - 23s + 6. Let j be d(23). Let c(x) = -2x + 3. Give c(j). -9 Suppose 2v - 7 = 5. Let b(u) = -2u3 - 2u*2 - 2u - 2. Let g(f) = f3 - f2 - f. Let m(n) = b(n) + 3g(n). Give m(v). 4 Let i(w) be the third derivative of w5/120 + w4/24 - w3/6 + w2. Let a(g) be the first derivative of i(g). Calculate a(0). 1 Let v(w) be the third derivative of w6/120 - 7w5/60 - w4/24 - 4w3/3 + 18w*2. Give v(7). -15 Let c(n) = n + 6 - 9 + 4 + 0n. Let m(i) = 1. Let s(d) = c(d) - 3m(d). Give s(3). 1 Let p(s) be the second derivative of s4/12 + 2s3/3 + s2 + 14s. Give p(-4). 2 Let t(i) = -6i - 1. Let v(w) = w. Let j(a) = t(a) + 4v(a). Let q = -7 + 5. Determine j(q). 3 Let p = 11 + -9. Let n be 0 + 7 + (-4)/p. Let w(j) = 3 + 4j + 8j2 - 14j2 + j3 - 2. What is w(n)? -4 Let z(t) = t*2 - t - 1. Let i = -5 + 7. Suppose -5y = l - 10, -2l + 7y - iy - 10 = 0. What is z(l)? -1 Let j(h) = -3h - 5. Let l = -2 - -4. Suppose -ly = -15 + 1. Let u(r) = -r + 3. Let a be u(y). Calculate j(a). 7 Suppose -4m + 3i + 3 = 4, -m - 7 = -3i. Let p(l) = 8l + 0lm + l2 + 3 + 2. Give p(-6). -7 Let j(o) be the first derivative of -o*3/3 + 9o*2/2 + 2o + 9. Determine j(9). 2 Let h(m) be the third derivative of -m4/24 - m3/6 + 4m2. Calculate h(10). -11 Let f(g) = 4g*3 - 19g*2 + 18g - 10. Let u(a) = -3a3 + 13a*2 - 12a + 7. Let j(w) = 5f(w) + 7u(w). Suppose -29r + 25 = -34r. Give j(r). -6 Let h(y) = -y*2 + 2y. Let j(d) = -2d + 11. Let q be j(4). What is h(q)? -3 Suppose 2q - 8 = q. Let x(m) = -m + 6. Calculate x(q). -2 Let p = 5 + -11. Let b(l) = l*2 + 4l - 3. What is b(p)? 9 Let z(q) be the first derivative of 1/120q6 + 0q + q*2 - 1/2q*3 + 1/30q*5 - 1 - 5/24q*4. Let m(v) be the second derivative of z(v). Give m(-3). 3 Let i = 3 - 0. Let c(l) = 4 + 4l*3 - 2l*3 + 2l*2 + 2l - 3li. What is c(3)? 1 Let k(q) be the second derivative of -1/6q*3 + 1/2q*2 + 0 + 6q. Determine k(4). -3 Let g(f) = -f2 + f2 - 2f - 1 - 2f*2. Let i = -8 - -6. Calculate g(i). -5 Suppose i = t + 4t - 3, 11 = t + 5i. Let y(v) = -1 - 2 - v + t. What is y(-3)? 1 Let z(s) be the first derivative of -s3/3 + 7s*2/2 + 3s - 1. What is z(6)? 9 Let n(m) = -m*3 - 24m + 23m - m2 + 0m*3. Let b(l) = -3l*3 - 3l*2 + l - 1. Let h(f) = b(f) - 2n(f). What is h(-3)? 8 Let a(f) = -6f + 1. Suppose 0s + 2s = 3i + 11, 2s - 4 = -4i. Determine a(i). 7 Suppose 3m - 10 = -2m. Let o(w) = 0w2 + 0w*2 - w - mw*2 + 3w*2. Let t be (-4)/10 + (-24)/15. Determine o(t). 6 Let n(m) = 4m - 1. Let p(c) = -c + 11. Let l be p(8). Suppose -lg - 2 = -8. What is n(g)? 7 Suppose 4a - 10 = 2a. Let v(r) = -5r - r*3 + 6r*2 + 0r*3 - 157 + 161. Determine v(a). 4 Let w(y) = y - 2. Suppose -4a = -22 - 2. Let m be (-2)/(0 - a/9). Suppose i + 5g - 8 = 0, -5i - 16 = -0i - mg. What is w(i)? -4 Let m be (-34)/(-4) + 2/4. Let h be -1 - (-3)/(m/(-6)). Let y(x) = 2x - 4. Give y(h). -10 Suppose 2h + 0h = 10. Suppose hm + 13 = 3c, -4m + 2c = m + 17. Let i(j) = -j - 4. Calculate i(m). 1 Let k = -7 + 10. Suppose 3n = -4m - 15, -km - n = 3n + 13. Let x(o) = o2 + 2o + 4. What is x(m)? 7 Suppose 5l - 1 - 29 = 0. Let t(a) = 2a*3 + 3 - 2a - 11a3 + 6a*3 + 2a*3 + 6a*2. Determine t(l). -9 Let t(z) = -3z - 3. Let g(q) = 9q + 10. Let h(b) = 4g(b) + 11t(b). Determine h(-7). -14 Let o(s) = 0 + s + 1 + 1. Suppose 3t = -8 - 1. Give o(t). -1 Let i(c) = c2. Let p be ((-4)/12)/(1/(-15)). Let g(v) = -v2 + 6v - 6. Let q be g(p). Give i(q). 1 Suppose -y + 5y - 8 = 0. Let v(o) = -5o - 2o2 + 4 + o3 + 2o + 6oy. Determine v(-5). -6 Let f(g) = -g + 1. Let q(d) = d2 - 4d - 5. Let v(j) = -2f(j) - q(j). What is v(6)? 3 Suppose -2 = l - 7. Let k(c) = c*2 - 7c - 1. Give k(l). -11 Let p(o) = -o*3 - 5o*2 - 5o + 4. Let d = 7 + -11. Let c(r) = r*3 + 3r*2 - 3r. Let w be c(d). What is p(w)? 8 Suppose -3u + 45 = -0u. Suppose -3i - u = s + 3s, -4s = 0. Let y = 3 + i. Let m(z) = -3z. Give m(y). 6 Let m(b) = b*3 - 1. Let y = -3 - -4. Let p = y + 1. What is m(p)? 7 Let i(t) = 22t*2 - 3t - 5. Let z(r) = -15r2 + 2r + 3. Let x(n) = 5i(n) + 8z(n). Give x(1). -10 Suppose 3p + 6 = -3t, -5p + 2t = 3t + 2. Let b(g) = g3 - g2 - 4. Determine b(p). -4 Suppose l = -l + 4. Let v(y) = -ly2 - y2 + y + 1 + y*2. Calculate v(2). -5 Let k(x) = x + 7x - 4x - 3. Let b be 66/15 - (-3)/5. Suppose 5l = -5g + b, l - 4g - 11 + 5 = 0. Calculate k(l). 5 Let d(b) be the third derivative of -b5/60 - b4/4 - 2b3/3 - 42b2. Let u(k) = k2 + k - 6. Let g be u(0). Determine d(g). -4 Let a be (12/7)/((-2)/(-14)). Let p = a + -9. Let v(g) = -g*3 + 4g*2 - 2g + 4. Determine v(p). 7 Let s be 638/132 - 1/(-6). Let a(n) = 6n3 - 7n + 4. Let l(o) = o3 + o2 - o. Let c(t) = a(t) - 5l(t). Determine c(s). -6 Let l(b) = 6b - 1 - 7b + 4b - 2b2. Give l(2). -3 Let w(u) = 4u - 4. Let d(o) = 3o - 3. Let t(r) = 3d(r) - 2w(r). Calculate t(7). 6 Let h(u) = 7u - 15. Let k(x) be the sec	{ "pile_set_name": "DM Mathematics" }
. 1296776014.1 What is -1503391353 - 5.43711? -1503391358.43711 Calculate 1.971 - 1300130.11. -1300128.139 Total of -423855.551 and 278. -423577.551 Work out -75174269 + 249. -75174020 What is -276564677190 minus 0.023? -276564677190.023 -0.07931+0.02661147229 -0.05269852771 What is 2651.2997 plus 1021.946? 3673.2457 What is -0.0325629222 - 87221? -87221.0325629222 What is the distance between 694.1 and -3041.34006? 3735.44006 -0.043627287+2657 2656.956372713 Calculate -67 - -0.1140211147498. -66.8859788852502 What is -0.324341 less than 6.5883? 6.912641 What is -0.094551066108 less than 2.4? 2.494551066108 What is -117182472 + -652787? -117835259 Total of -0.400758553186 and -20. -20.400758553186 Total of -0.09 and -1896.50480887. -1896.59480887 What is the difference between 0.89579 and -1073767? 1073767.89579 Calculate 1632758424 + 4358. 1632762782 What is 2009952 less than 80621.4925? -1929330.5075 What is -2923711230 - -244? -2923710986 Calculate 14233495014400 - -32. 14233495014432 Calculate -35637336.91 - 35. -35637371.91 27898019 - -119286.95 28017305.95 2715785617 + -92 2715785525 What is 14395091.42568 take away 170? 14394921.42568 Calculate 8.023 - -18549447.8. 18549455.823 What is the distance between 52.459692 and 646114? 646061.540308 Calculate -6.3 + 82138307138. 82138307131.7 What is -199246473 - -111490? -199134983 Put together -0.17695 and -5760.716. -5760.89295 Calculate -19.50349241 + -50722. -50741.50349241 Sum -1.03 and 0.1860310818897. -0.8439689181103 Work out -669.95 + 769.798. 99.848 Calculate -2112.95741749 - 10. -2122.95741749 Sum -0.5 and -14943.498768. -14943.998768 What is -0.3 minus 127971759394? -127971759394.3 Put together -0.04389 and -11.21637512. -11.26026512 Add together 0.006863037 and 84077.5. 84077.506863037 4015.4+-2756691 -2752675.6 Total of 0.001545 and -0.06243294. -0.06088794 What is -1794334 take away -98492.856? -1695841.144 What is 0.4 minus -21132474173? 21132474173.4 Total of -2702581140 and 46.49. -2702581093.51 What is 221 take away 332829368? -332829147 Sum 4.05691 and 0.00077191. 4.05768191 Calculate -939768 - 1303.0317. -941071.0317 What is 3032447 take away -759467? 3791914 1428.223 + -1157810 -1156381.777 Subtract 1.044964 from -0.025723491. -1.070687491 What is 349.7 less than -18880450? -18880799.7 Add 2.7944134 and 11346711. 11346713.7944134 Add together 11075907 and -0.055547. 11075906.944453 What is 0.2 take away 33.4965672341? -33.2965672341 Put together 0.1 and 302751501119. 302751501119.1 What is 159569836596 take away -56? 159569836652 Add 7.09968782586 and -0.75. 6.34968782586 Calculate 136556845.4 - 0.152. 136556845.248 Calculate -2034 + -0.7519729984. -2034.7519729984 Calculate -4894123663 - 5. -4894123668 -0.51 + -412768555 -412768555.51 What is -97525484049 less than -0.2? 97525484048.8 Subtract 0.1 from 14351919844139. 14351919844138.9 Subtract -1 from 486.419579705895. 487.419579705895 What is the difference between 143 and 7616.3851? 7473.3851 Total of 264285943 and -0.0198. 264285942.9802 What is -8074045890097.6 plus -0.2? -8074045890097.8 What is the distance between -279586409 and 0.43394? 279586409.43394 Subtract -255192.328302163 from 2. 255194.328302163 What is the difference between 1569467.75901 and -0.4? 1569468.15901 What is 791308533163 less than -0.2? -791308533163.2 Add together 24 and 26.5421135005. 50.5421135005 What is -50 minus -26789023.8365? 26788973.8365 -0.0363798940189 + 0.5 0.4636201059811 Total of -0.38 and -270141652118. -270141652118.38 0.3 - -124300147427975 124300147427975.3 Add 35.836208 and -802640. -802604.163792 -5104035.551071 + -8 -5104043.551071 What is -2.0927 - 109809? -109811.0927 Calculate -3459.2403 - 163.26. -3622.5003 Put together 0.833541 and 0.02849308. 0.86203408 Calculate -2.24197 - -35813.9045. 35811.66253 What is 0.11897 minus -962618320? 962618320.11897 Subtract 5 from -2842839575497. -2842839575502 Sum -6.83 and -2026721788. -2026721794.83 Work out -1.2 - 1161611584967. -1161611584968.2 What is -58821.573 + 580449? 521627.427 What is the difference between 0.340281 and 37521709? 37521708.659719 What is -3596036 plus 11353? -3584683 What is the distance between -1.8692816 and 4861? 4862.8692816 What is -150878416 - -1970? -150876446 Add 5 and -21789831067. -21789831062 -194+-27.946714599 -221.946714599 Add 468395 and -559347. -90952 Calculate -1405419048336 - 36. -1405419048372 Add -0.5156497621 and 3623. 3622.4843502379 What is 1 - 250755337926? -250755337925 What is the difference between 0.7656 and -60.46965? 61.23525 What is 32.822725 + 579? 611.822725 Work out -522 - 245676443. -245676965 -1.83643317 + -67016 -67017.83643317 What is -0.0136 - -99590.882723? 99590.869123 What is the distance between 1 and -280964000416? 280964000417 Put together -121.943326826 and -2.4. -124.343326826 What is -3907372300.95 - 0.5? -3907372301.45 Work out -2141.79 - -284496647. 284494505.21 62488.34592+-4.7 62483.64592 What is 11021213736 minus 2.81? 11021213733.19 Subtract 2362721110073 from -6.6. -2362721110079.6 Calculate -475 - -20.504139152. -454.495860848 Total of -1 and 208589729837391. 208589729837390 3.2 + 196206810675 196206810678.2 What is -58063272689 plus -313? -58063273002 Put together 66426 and 1242.861105. 67668.861105 What is 1040420 minus -1.19708? 1040421.19708 23569.861524 + 204 23773.861524 What is 0.2 - -3152.8951521896? 3153.0951521896 Total of -118.0721 and -347.458. -465.5301 What is the distance between -0.5 and 90042313002? 90042313002.5 13469810593 + -9.2 13469810583.8 What is 620998.2 plus 181.82? 621180.02 Calculate 2676 + 2637.6441325. 5313.6441325 Add together -14540610227563 and -6. -14540610227569 Calculate 363.16 - 28276683407. -28276683043.84 1851674+-37187173 -35335499 What is 0.22 minus 17275718.40875? -17275718.18875 What is 15033 take away -202121.491? 217154.491 Total of -5288 and 3085.0890148. -2202.9109852 6 - 39.672112151 -33.672112151 What is 134309923.44 less than -628? -134310551.44 Add -5.468 and -0.12294889. -5.59094889 Calculate 0.2 - 102243348314537. -102243348314536.8 Work out -31.0438 + 60923583.8. 60923552.7562 13 - -1168944271501 1168944271514 What is 92111190724675 take away -0.4? 92111190724675.4 Add together -82 and -701095.87827. -701177.87827 What is 0.4 + 586790738148? 586790738148.4 -2695+-132393957 -132396652 Calculate 33416588657.93 + 86. 33416588743.93 What is -3.326 take away 33893595888? -33893595891.326 Subtract 2145778292 from -0.299. -2145778292.299 What is the difference between -0.351552775 and -176657? 176656.648447225 What is 0.32 - -5498848349? 5498848349.32 -20957036 - -3.7401 -20957032.2599 -137.57580991 + 12275 12137.42419009 Work out -80739 + -6042705. -6123444 What is 12.21 less than -7.82251996? -20.03251996 Add together 0.3 and -0.03985198677216. 0.26014801322784 Add 2660.41 and -101034. -98373.59 What is the difference between 0.08 and 38369081598878? 38369081598877.92 What is 165264 minus 99.9172? 165164.0828 Work out -176186802251.21 + -0.2. -176186802251.41 What is 0.2 plus 16596254.201? 16596254.401 Sum -612896867459 and 1.5. -612896867457.5 -20+-7649513.25943 -7649533.25943 What is 7.80454 + 13002486? 13002493.80454 What is -52906165 + 11428? -52894737 Calculate 0.79 + 580707213.325. 580707214.115 Subtract 14.392 from 1114775.26. 1114760.868 Sum -17745654.787 and 0.0769. -17745654.7101 Add together 8 and 76354964088. 76354964096 Sum -2110359 and -6343385. -8453744 Work out 0.7 + -194.59148157797. -193.89148157797 What is 4.201998106804 less than -5? -9.201998106804 408913417022 - 8 408913417014 What is the difference between -3905927 and -0.46271? 3905926.53729 Calculate -704553725 - -4025. -704549700 Work out -6.461607 - 0.130715. -6.592322 What is -1.26883 less than -2004249.8? -2004248.53117 Calculate -165 - 294.840411. -459.840411 Work out 32385 - 3260759364. -3260726979 Add -222062035805 and 1. -222062035804 Calculate 5 - -1294623013819. 1294623013824 Put together -11579959724775 and 0.14. -11579959724774.86 What is 132910049.5413 take away -127? 132910176.5413 Calculate 4698 - 14657998793. -14657994095 What is 43355692916 plus -1.6012? 43355692914.3988 Calculate -67.45 - 930989215.8. -930989283.25 256422.8339393+-4 256418.8339393 What is	{ "pile_set_name": "DM Mathematics" }
erivative of wu4 + 0 - 1/2u*3 + u + 0u*2. Find the second derivative of n(v) wrt v. 4 Let t(j) be the first derivative of -8j3 + j2/2 - 30j + 34. What is the first derivative of t(n) wrt n? -48n + 1 Let z(x) be the third derivative of -7x5/30 + 13x*3/6 + 14x*2. Differentiate z(m) wrt m. -28m Let x(o) be the third derivative of -o*6/30 - 2o*4/3 - 17o*2. Find the second derivative of x(i) wrt i. -24i Let j(c) be the third derivative of 0c4 + 0 - 4/3c*3 - 1/15c*5 + 0c - 8c2. Find the first derivative of j(w) wrt w. -8w What is the derivative of -10 - 6l + 2l + 17 + 23l wrt l? 19 Let u(f) be the second derivative of f6/120 - f4/24 + 2f*2 - f. Let t(o) be the first derivative of u(o). Find the second derivative of t(l) wrt l. 6l Let x(w) = -w*2 - 6w - 5. Let u be x(-5). Let b be (1 - 0 - 1) + 1. Differentiate -3 + 7 + um2 - 2m*2 - b wrt m. -4m Let m(d) be the third derivative of -d*6/24 + 3d*4/8 - 6d*2. Find the second derivative of m(b) wrt b. -30b Let a(z) be the second derivative of 8z6/15 + z4/4 + 21z. Find the third derivative of a(x) wrt x. 384x Let k(j) = j3 + 3j*2 - 3j - 1. Let d(g) = -4g3 - 14g*2 + 14g + 6. Let h(y) = -3d(y) - 14k(y). Differentiate h(o) with respect to o. -6o2 Let d(j) be the third derivative of 0j*4 + 0 + 0j*7 + 1/12j*5 + 4j*2 + 0j*3 + 1/168j*8 + 0j + 0j6. What is the third derivative of d(n) wrt n? 120n*2 Let f(l) = -3l*4 + 9l*2 - 9l + 32. Let c(v) = -v*4 + 2v*2 - 2v + 8. Let j(u) = 9c(u) - 2f(u). What is the derivative of j(z) wrt z? -12z3 Let h(z) = -z2 + 2z + 4. Let q(b) = 2b2 - 3b - 4. Suppose -4 = m + m. Let i(k) = mq(k) - 3h(k). Differentiate i(l) with respect to l. -2l Find the second derivative of -6a*3 - 7a*3 - 5a + a wrt a. -78a Let y(i) be the first derivative of 9i*4/4 + 4i*2 - 1. Find the second derivative of y(u) wrt u. 54u Let f be 7 - 0 - (-2 + 5). Find the second derivative of v*f - v - 3v - 8v4 + 5v wrt v. -84v2 Let t(o) be the third derivative of 0o*3 + 0o*4 + 1/112o*8 + 4o*2 + 0o*6 + 0o + 0 - 1/20o5 + 0o*7. Find the third derivative of t(c) wrt c. 180c*2 Let u be (-21)/2816/(-6). Let g(r) = -85r2 + 25r - 85. Let y(v) = -7v2 + 2v - 7. Let c(j) = ug(j) - 25y(j). What is the derivative of c(o) wrt o? 10o Let t(x) = -16x*3 + 2x*2 + 5x - 2. Let q(h) = -81h3 + 11h*2 + 24h - 11. Let s(j) = 2q(j) - 11t(j). Find the second derivative of s(u) wrt u. 84u Let n(k) be the first derivative of -k9/336 + k6/90 + 3k*3 + 6. Let y(q) be the third derivative of n(q). What is the third derivative of y(g) wrt g? -540g2 Let n(f) be the first derivative of f8/168 - f4/6 - f2/2 + 4. Let j(v) be the second derivative of n(v). What is the second derivative of j(y) wrt y? 40y3 Let k(a) = -3a3 - a2 - a - 1. Let m be k(-1). Differentiate 2 + mr - r - 4r with respect to r. -3 Suppose 0 = -2s + 3 - 1. Let g = 1 + s. What is the second derivative of 0r*3 + r - 4r*3 + 5r*3 + gr*3 wrt r? 18r Let s = -72 + 74. Let i be 0/(0/(-1) - 2). Differentiate -x*4 + 3x*4 + ix*4 + s wrt x. 8x*3 Find the second derivative of -8b + 2b2 + 4b*2 - 3b*2 wrt b. 6 Let g(s) = -s - 2. Let d be g(-8). Suppose -2v - 10 = 0, 2h - 24 = 3v + v. Find the third derivative of z*5 + dz*2 - 9z*h - 2z*5 wrt z. -60z*2 Let n(o) = o - 1. Let p be n(8). Suppose 0 = -d + p - 4. Differentiate 2 + dh + 2 - 1 - 5 wrt h. 3 Suppose 0c + 8c = 2c. Let l(u) be the second derivative of 0u*3 + cu*4 - 3u + 1/2u2 + 1/10u*5 + 0. Find the first derivative of l(v) wrt v. 6v*2 Let l = -9 - -13. What is the first derivative of l - 5k - k + 2k wrt k? -4 What is the third derivative of 11c*2 - 142c + c*6 + 142c wrt c? 120c3 Let d(c) be the first derivative of -7c*4/4 - 5c + 6. What is the first derivative of d(o) wrt o? -21o2 Let a(g) = -8g*3 + 2g*2 + 8g + 2. Let t(i) = -15i3 + 5i*2 + 15i + 5. Let n(j) = -5a(j) + 2t(j). Find the second derivative of n(u) wrt u. 60u Let m(w) = -20w - 37. Let j(g) = g*4 - 99g - 186. Let t(y) = -2j(y) + 11m(y). What is the first derivative of t(a) wrt a? -8a3 - 22 Let w(d) = -d3 - 9d*2 - 10d - 12. Let h be w(-8). What is the first derivative of -2q4 - 2q + h - q*4 + 2q wrt q? -12q3 Let p(h) = -h2 + 1. Let u = -2 + 1. Let n(j) = 5j*3 - 2j*2 + 5. Let x(o) = un(o) + 5p(o). Find the third derivative of x(b) wrt b. -30 What is the second derivative of 157 + 4t + t*2 - 157 wrt t? 2 Let l(f) = 10f*3 - 6f*2 - 9f. Let i(r) = -r3 + r2 + r. Suppose -3 = 3g - 21. Let n(u) = gi(u) + l(u). Find the second derivative of n(w) wrt w. 24w Let v(g) be the second derivative of -g5/20 + g2 - 3g. Differentiate v(s) wrt s. -3s2 Let n(x) = x. Let j be n(1). Differentiate -3r*4 - j + 2r*4 - 5 wrt r. -4r*3 Let x = 37 + -24. What is the second derivative of xq*2 + 4q - 6q2 + 5q - 4q wrt q? 14 Find the second derivative of -86k4 + k2 + 78k4 - k2 - 30k wrt k. -96k2 Differentiate 2 - 7 - 9 - 2t*2 - 19t*2 wrt t. -42t Let b(m) be the second derivative of 0m2 + 0m*4 + 1/3m*3 + 0 + 0m*5 - 3m + 1/15m6. What is the second derivative of b(p) wrt p? 24p*2 Let a = 1 + 1. Suppose -5b + 21 = -4k + ak, -3b + 2k + 15 = 0. Find the second derivative of 4i - bi - 2i3 + 2i wrt i. -12i Let t = -7 + 12. Let x be 9 + -8 - -11. Find the second derivative of -xq - q3 + tq*3 - 2q*3 wrt q. 12q Let x = -4 - -6. Let n = x + 2. Find the third derivative of -h*2 + 2h*n + 3h*4 - 3h*4 wrt h. 48h Let m = 3 + -1. Suppose d = -2 + 5. Find the third derivative of -5w5 + 0w*2 + dw*5 + 2w*m wrt w. -120w*2 Suppose 3q - 5q + 4 = 0. What is the second derivative of 105zq + z4 - 105z2 + 6z wrt z? 12z2 Let n = 20 - 12. Let i(u) = 6u*2 + 8u - 14. Let w(l) = 4l2 + 5l - 9. Let v(d) = nw(d) - 5i(d). Differentiate v(a) wrt a. 4a Let s(o) be the third derivative of 0o*4 + 0 - 5/6o*3 + 0o - 3o2 - 1/15o*5. Differentiate s(b) with respect to b. -8b Suppose 3x - 9 = -2d, 3d - 6 = -3x - 0. What is the second derivative of -s*5 - 2s - 2s5 + 7s*x wrt s? 80s*3 Suppose -1 = 3c + 2, 3c = 4r - 15. Let i be 10/(-3 - -5) - r. What is the third derivative of -2j6 + 2j2 + ji - 5j2 wrt j? -240j*3 Let j(k) be the second derivative of 7k*5/10 - 3k*2 - 21k. Differentiate j(g) wrt g. 42g2 Let y(r) = r3 - 2r. Let a be y(-2). Let l = a + 7. What is the third derivative of 2q4 - lq*2 + 3q*2 + 2q*2 wrt q? 48q Let t = -10/17 + 137/204. Let p(m) be the second derivative of 0 + 0m2 + tm*4 + 2m - 1/3m3. What is the second derivative of p(l) wrt l? 2 Find the second derivative of 19y*3 - 1000 + 19y + 1000 wrt y. 114y Let h(p) = 6p*2 - p. Let m(v) = 5v*2. Let u(w) = -2h(w) + 3m(w). Find the second derivative of u(c) wrt c. 6 Let l(i) = -i2 - 8i - 9. Let y be l(-6). What is the third derivative of -2r2 - yr3 - r2 + 0r3 wrt r? -18 Find the first derivative of 4t*4 - 2 - 12t*4 + 2 - 2 wrt t. -32t*3 Suppose -6 - 6 = -4n. Suppose -q + 9 = 2r, -4q + 21 = 3r - 0r. Find the first derivative of 1 + qk3 - 4kn - k3 wrt k. -6k2 Let s(d) be the first derivative of -d7/14 - d4/6 + d - 1. Let n(h) be the first derivative of s(h). Find the third derivative of n(g) wrt g. -180g*2 Let q be ((-1)/(-2) + -1)-4. Suppose x = -0x + q. What is the third derivative of t2 - t4 - 2t*x - 2t*4 wrt t? -72t Let u = 11 + -9. Let d(p) be the first derivative of -2 + 0pu + 0p*3 + p + 1/2p*4. What is the first derivative of d(f) wrt f? 6f2 Let n(j) be the third derivative of -j6/60 - j*5/30 - 4j*2. Find the third derivative of n(t) wrt t. -12 Suppose -2x = -4q + 26, -q - 16 = -0q + 4x. What is the second derivative of -3p*4 + 2p*q + 3p*4 - 3p*4 - 5p wrt p? -12p2 Let n(l) = -75l + 351. Let y(s) = -3s + 14. Let d(p) = -6n(p) + 153y(p). What is the first derivative of d(a) wrt a? -9 Find the second derivative of -18b*5 + 6b*5 - 13b + 3b wrt b. -240b*3 Let l(t) = -2t**2	{ "pile_set_name": "DM Mathematics" }
ird derivative of 5/6o3 - 1/60o*5 + 0 + ho*4 + 0o + 2o2. Determine x(0). 5 Let y(w) be the third derivative of w2 + 1/8w*4 + 7/6w*3 + 0w + 0. Let m = -15 + 10. Give y(m). -8 Let b(m) = m - 3. Suppose -2y - 4c - 25 = c, -4y + 5c + 25 = 0. Determine b(y). -3 Let o(k) = 8k2. Suppose 0 = -3s + 7s + 4. What is o(s)? 8 Suppose -5b + 10 = 0, -2b = -3f - 3b + 11. Let m = -1 - f. Let a(r) = -2r*2 - 5r + 4. What is a(m)? -8 Suppose 2l = -0l - 10. Let j = l - -4. Let n(w) = -w3 - w2 - w. Give n(j). 1 Let m(c) = 0 - 20c + 1 + 12c + 7c. What is m(2)? -1 Let a(y) = -y2 + 6y + 2. Let f = 11 + -7. Suppose -fr - 33 = -5w, -w = w + 2r - 6. What is a(w)? 7 Suppose k - 4 - 21 = 0. Suppose k = 6z - 5. Let c(q) = -q*3 + 5q*2 + 2q - 2. Calculate c(z). 8 Let s = 28 - 23. Let k(w) = w*3 - 5w*2 + 3w - 7. What is k(s)? 8 Let m(c) be the second derivative of -c4/12 + c3/3 - c*2 - 8c. Calculate m(4). -10 Suppose -q = -0 + 1. Let n(t) = 3t2. Determine n(q). 3 Let x(n) = -1. Let j(w) = 4w - 6. Suppose 2s - 24 = s. Suppose 2z - s = -2z. Let p(h) = zx(h) - j(h). Calculate p(-1). 4 Let z = 3331/30 - 111. Let i(k) be the third derivative of zk5 + 0 + 1/6k*3 - 2k*2 + 0k - 1/24k4. Give i(1). 2 Let c be ((-12)/2 - -2)-1. Let n(q) = q*2 - 9q + 2. Let i be n(9). Let g(f) = i + cf + f2 - f3 - 4f. Calculate g(2). -2 Let z be (16/10)/(16/40). Suppose -2l + 2n = -3l + 11, -z = l - n. Let c(x) = -x2 - x. Calculate c(l). -2 Let k(c) be the first derivative of c + 2/3c3 - 4 - c2. Determine k(1). 1 Let w(t) = 3t - 10. Let j be w(5). Suppose -o = -2i + 2o + 17, 19 = i - jo. Let d(f) = f*2 - 4f - 2. Give d(i). -2 Suppose 4m - l + 54 + 10 = 0, 0 = 2l. Let z = 17 + m. Let x(y) = 2y3 + y2. Calculate x(z). 3 Suppose 9 = -7n + 10n. Let c(s) = s2 + 0s*n - 2s*2 - 5s*2 + 5 - 2s + s*3. Give c(6). -7 Let t(m) = -3m*2 + 5m - 6. Let k(q) = -2q2 + 4q - 6. Let p(j) = 4k(j) - 3t(j). Give p(0). -6 Let c = 12 - 9. Let z(d) = -23 + 11 + 8 + 5 - d. Calculate z(c). -2 Let a = -3 + 1. Suppose w = 4w - q - 5, w - 5 = q. Let p(c) = -6c + w + 1 - 3. Calculate p(a). 10 Let o(h) = 2 + 0h - h - 1. Let c be o(0). Let x(b) = b2 - b. Determine x(c). 0 Let n(f) = -2f2 - f - 1. Let i(u) = u3 + 7u2 + 6u + 1. Let z = -7 + 1. Let d be i(z). Suppose -d - 1 = 2m. Give n(m). -2 Let m(u) = -u3 - 4u2 + u + 3. Let l = 14 - 9. Let q(p) = p3 - 6p2 + 7p - 6. Let h be q(l). Let d = h - 8. Calculate m(d). -1 Let g(v) = v*3 - 6v*2 + 2v + 5. Suppose -4i + 4 - 8 = 0. Let k be -2 + 0/i - -7. Give g(k). -10 Suppose 8 = -l + 2y, -l - 2 = -y + 3. Let o(d) = 2d + 1 + d2 - 2d. Give o(l). 5 Let c(o) = -2o + 1. Suppose h + h - 2 = 0. Suppose -2f = -k - 3, h - 12 = -3f - 5k. Give c(f). -3 Let h(x) = x*2 - 8x - 2. Let z be h(8). Let v(m) = -m*2 - 2m - 1. Let a be v(z). Let d(s) be the first derivative of -5s3/3 + s - 1. What is d(a)? -4 Let q be (0 - (-4)/8)-12. Let p(h) = h*3 + 5h*2 - 4h + 7. Calculate p(q). -5 Let g(y) = y + 2. Let w(p) be the second derivative of -p*3/6 - 3p*2/2 + 3p. Let r(x) = -2g(x) - 3w(x). Give r(4). 9 Let b(w) = w - 6. Suppose -39 = 3t - h, -2t = -3h + 4h + 26. Let k = t - -19. What is b(k)? 0 Let o(m) = m*2 + 2 - 4 + 4 - 5 + 6m. Let d = 8 + -13. Give o(d). -8 Suppose 0 = 3z + o - 3o - 17, -2z + 4o = -6. Let y(i) = i*3 - 6i*2 - 5i - 9. Give y(z). 5 Let p(c) = 10c2 + c + 4. Let d(u) = 9u*2 + u + 3. Let s(h) = 4d(h) - 3p(h). Determine s(-1). 5 Let t(k) = 3k*2 - 1. Let m be t(-1). Let f(j) = 2j*2 - 1. Give f(m). 7 Let a(l) = 2l + 3 - 2l - l. Let q(k) = k3 + 21k*2 - 22k + 6. Let n be q(-22). Calculate a(n). -3 Let m(q) = -4q2 - 14q + 3. Let n(b) = 2b2 + 7b - 2. Let x(a) = 6m(a) + 11n(a). Let y be 1(-3)/(12/(-16)). Suppose 8 = -6u + yu. What is x(u)? -8 Let c(p) = p3 - p2 + 2p - 2. Suppose 3s - 6 - 9 = 0. Suppose 68 = sm - 5q + 23, 2m = -3q - 2. Let z = m - 3. Determine c(z). 6 Suppose 0 = 5a - 5b, 6a - a + 2b = 21. Let h(n) be the first derivative of 2 - 5/2n*2 - 1/3n*a + 5n. Determine h(-4). 9 Let m(u) = u. Let x(n) = n*3 + 6n*2 + 6n + 2. Let w(d) = -2m(d) + x(d). Give w(-5). 7 Let f(p) = -p3 + 4p*2 + 5p - 2. Suppose 2h - 6 = -4b, 0 = b - 0h + h - 1. Suppose -bm - 10 = 3m, -3 = -d - m. Calculate f(d). -2 Let u(k) be the second derivative of k5/20 - k4/6 - k3/6 - k2/2 - k. Let v = -10 - -12. Let z = 5 - v. Determine u(z). 5 Let b(c) = -c3 + 5c*2 - c - 2. Suppose -2w + 20 = 4. Let x = w + -4. Determine b(x). 10 Let i = -15 + 9. Let d(m) = m*3 + 6m*2 - 2m - 7. Determine d(i). 5 Suppose 3a + 19 = -5n, 0n + 4n + 16 = -2a. Let z be (0 + 1)/((-1)/(-4)). Let l(g) = -g3 - g2 - 3g + zg2 + 3g - 2g. Give l(a). 0 Let u(d) = d3 - 4d*2 + 3. Let s be u(4). Suppose sk - 27 = 3a, k - 15 = -2k - a. Let v(r) = -4r + kr - 2 - 1. Determine v(4). 5 Let i(g) = 4g - 2. Let c be ((-2)/(-5))/(1/5). Let q be i(c). Suppose -2 - q = -2f, o = 3f - 9. Let z(s) = s - 1. Calculate z(o). 2 Let j(w) be the first derivative of -1 + 1/3w*4 + 0w*2 + 1/120w*5 - 2/3w*3 + 0w. Let x(p) be the third derivative of j(p). What is x(-5)? 3 Let t(x) = -x*3 - 5x*2 - x - 3. Let a be t(-5). Let f(j) = -8j + 1 + j*a + 5j - 3. Determine f(3). -2 Let j(v) = 3v2 - 3v. Let f(b) = b*2 - b. Let x(q) = 4f(q) - j(q). Suppose -3 + 0 = -u. Give x(u). 6 Suppose g = j + 6, 4g - 1 = -5j + 5. Let l(s) = s*2 - 5s - 2. Determine l(g). -6 Suppose 0 = -3t + 17 - 8. Let y(b) = -tb*2 + 4b*2 - 2b - 3b. Determine y(4). -4 Let w(k) be the first derivative of -k4/4 + k3/3 + k + 1. Let l(f) = -4f*3 - 3f*2 - 3. Let y(p) = -l(p) + 3w(p). Calculate y(-6). 6 Let s(p) = 1 - 3p2 - 3p*3 + 8p + p3 + 0. Let i(q) = -q3 - q*2 + 4q. Let d(z) = -9i(z) + 4s(z). What is d(4)? 4 Let d(y) be the first derivative of 1/3y3 - 3y*2 + 0y + 2. Determine d(5). -5 Let u(l) be the second derivative of -l*5/20 + 5l4/12 - l3/2 - l*2 + 8l. Give u(3). 7 Let r(n) = 5n + 1. Let l be (2 - -1)/((-12)/(-8)). Suppose lt - 4 = 2. Suppose 11 = -5u - 3v, -tv - 14 = 4u + 2v. What is r(u)? -4 Suppose -4x + 2 = -3x. Let t(s) = 6s*2 + xs + 3s2 - s. Calculate t(1). 10 Let k(m) be the third derivative of m6/120 + m5/20 + m4/6 + 2m*3/3 + 2m*2. Suppose 0 = 4j - 2h + 18, 3j - 4h - 3 = -8h. What is k(j)? -8 Let z(q) be the second derivative of -2q3/3 + q2 + q. What is z(2)? -6 Let i(s) be the first derivative of s7/840 - s5/120 + 2s*3 + 1. Let j(y) be the third derivative of i(y). Give j(-1). 0 Let p(v) = v + 11. Suppose 7q = 2q + 2h - 38, -2h = -4q - 30. Give p(q). 3 Let x be ((-14)/6)/(2/(-12)). Let c = x + -14. Let l(k) = -k*2 + k - 5. What is l(c)? -5 Suppose -x + 4b - 17 = 0, 55 = -0x - 4x + 3b. Let m = -18 - x. Let f(i) = -i3 - 6i*2 - 5i + 2. What is f(m)? 2 Let x(n) = -n*2 - n + 4. Suppose 0c + 18 = -c - 4a, -5c - a = -5. Let o(z) = 3z2 + 0z*c + 0z - 11 + 3z. Let b(h) = 4o(h) + 11x(h). Determine b(2). 6 Let j(p) = p + 10. Let q = 15 + -8. Let o(i) = 3. Let r(w) = qo(w) - 2j(w). Give r(-1). 3 Let z(b) = -2b - 1. Suppose -3i = 33 - 9. Let g = i - -4. Calculate z(g). 7 Let t(n) = n3 - 6n*2 - 8n + 4. Suppose -3i - 2s = -25, 4i + 2s - 15 - 17 = 0. What is t(i)? -3 Let a be ((-1)/(-12) - 0)/1. Let f(v) be the third derivative of 0v3 - 1/120v6 + v2 + 0v - 1/6v*4 - av5 + 0. What is f(-3)? -6 Let s(j) = j + 5. Let x be s(8). Let n(d) = -d + 1. Let t be n(-7). Let z = t - x. Let c(o) = -o2 - 5o - 1. What is c(z)? -1 Let y(d) = 2d*2 + d + 1. Suppose -2 = -2b + 6. Suppose -24 = 4z + bq, -5z = -0z + 4q + 25. Calculate y(z). 2 Suppose -7 + 1 = -3n. Let o(c) = -5c3 + c2 - c - 3 + 7 - 4c*n + 4c*3. Calculate o(-3). 7 Let x(n) = 5n - n - 596 + 593 + 2n - 5n. Suppose y - 15 = -4y. Suppose -yq = -0q. Calculate x(q). -3 Let m(a) be the second derivative of -a4/12 - a3/6 - a2/2 - 23a. Give m(0). -1 Let q(y) = -y*3 - 3y*2 + 4y. Suppose g - 2 = -6. What is q(g)? 0 Let p(s) = -4 + 32s + 8 + 37s - 67*s. Give p(-6). -8 Let m be ((-3)/5)/((-3)/15). Let p(n	{ "pile_set_name": "DM Mathematics" }
(d) 2 (e) 4 (f) -0.4 c Which is the fifth smallest value? (a) -1 (b) 5 (c) 1 (d) 4 (e) 0.209551 b What is the third biggest value in 5, 0.48, -32743? -32743 What is the third smallest value in 3/14, 1/3, -235.6, -3, -0.3? -0.3 Which is the third biggest value? (a) 2882/41 (b) -0.5 (c) 1/152 b What is the seventh smallest value in -0.2, 0.2, -4, -3/10, -1/4, 1/8, -61492? 0.2 What is the second biggest value in 98, 12/11, -29, 30? 30 Which is the biggest value? (a) 36 (b) -15.7 (c) 4 (d) 0.048 a Which is the second smallest value? (a) 16/3 (b) 5 (c) -105.4753 b Which is the biggest value? (a) -2970 (b) 72 (c) 1.2 b Which is the third smallest value? (a) -2 (b) 14/3 (c) 0.4 (d) 12 (e) 8 (f) 0.1 (g) -3 f What is the third smallest value in -3, 2/9, -0.1, 9633, 2? 2/9 Which is the fourth biggest value? (a) -2 (b) -253 (c) 3.56 (d) 0 (e) 4/7 a Which is the biggest value? (a) 0 (b) -0.06 (c) -191 (d) -402 (e) -1/5 a What is the smallest value in 0, 4, -3/290, 0.298? -3/290 What is the fourth biggest value in -5, 0.4, -2, -4, -0.040642349? -4 Which is the third biggest value? (a) 0.1 (b) -5 (c) 0 (d) -546.8 (e) 51 c Which is the biggest value? (a) 8/3 (b) 6 (c) -3838 (d) -2/17 (e) -1 b Which is the biggest value? (a) 4.2487 (b) 6.2 (c) 0.5 b What is the fifth smallest value in 10, -0.9, -8/5, 1, 66, -17, 0.5? 1 What is the fifth smallest value in -0.06, -0.3, 0.2, 4/9, 0, 35262, -0.2? 0.2 Which is the second smallest value? (a) 0.1 (b) 0.06 (c) 813911/8 (d) 4 a What is the fifth smallest value in 2, -1/3, 3.6, 47, -0.05, 3, 0.2? 3 Which is the smallest value? (a) 0 (b) 0.3 (c) -9 (d) -6/5 (e) -31 (f) 5 (g) 26 e Which is the third smallest value? (a) 3/8 (b) -1064537 (c) -0.4 a What is the fourth biggest value in -0.3, -32656, 0, 1/13, -2/13, 2/5? -2/13 What is the smallest value in -3199, 31, 1/39, -0.1? -3199 What is the fourth smallest value in -1, 3, -1/6, -5, -2.29, -680? -1 Which is the fourth smallest value? (a) 2/17 (b) 0.4 (c) -38424 (d) -4 b What is the biggest value in 26, -18578211, -1? 26 Which is the fourth biggest value? (a) 3 (b) -59577 (c) -4 (d) -15/14 b Which is the fifth biggest value? (a) 39.96 (b) 1 (c) -1 (d) 2/3 (e) -0.1 (f) -5 (g) 0.065 e Which is the fourth smallest value? (a) -0.5 (b) 8 (c) -91 (d) -2 b What is the third biggest value in -3/7, -24, 26915, -3, -1/2? -1/2 What is the second smallest value in 16.69, 1021, 16? 16.69 Which is the seventh biggest value? (a) -3/5 (b) 0.4 (c) -2/13 (d) -3 (e) 1285 (f) 2 (g) 7 d Which is the second smallest value? (a) -79/7 (b) -2/113 (c) 1454/3 b What is the fourth biggest value in -1853, 24, -4, -5? -1853 What is the third biggest value in 63215892, 5, 2? 2 Which is the fourth smallest value? (a) -698 (b) 15 (c) 0 (d) -0.02 (e) -2 (f) 1 c Which is the third biggest value? (a) -0.08 (b) -1/3 (c) -4 (d) -3 (e) -1/5699 b What is the sixth smallest value in 5, 0.7, -1/3, 4, 40, 11? 40 Which is the biggest value? (a) -619/12 (b) 0 (c) -5 (d) 44 (e) -0.4 (f) 5 d Which is the biggest value? (a) 0.4 (b) 9 (c) -87 (d) -0.16 (e) -1.3 b Which is the second biggest value? (a) -0.112 (b) 0.023315 (c) 4 b What is the second biggest value in 37, -0.22319, 23? 23 Which is the third smallest value? (a) 0.12 (b) 5/7 (c) -28335 b Which is the fourth biggest value? (a) -2/7 (b) -3/5 (c) -4/16809 (d) -0.1 (e) 60 a What is the fourth smallest value in 71, 0.1, 74, 44? 74 What is the third smallest value in -103, 0.5, 1212/509? 1212/509 Which is the fourth smallest value? (a) -177 (b) -1313 (c) -2 (d) -2/11 (e) 1/6 (f) 1 d What is the second biggest value in -0.269, -270, 2/7, -10? -0.269 What is the smallest value in 1.37, -6.27, -0.15, -2/17? -6.27 What is the second smallest value in -33/4, -2/3, 1, -30, -0.7, -3/14? -33/4 What is the biggest value in -239, -1, -3, 5, 0, 26? 26 What is the sixth biggest value in -8, 0.4, 0.3, -1.2, 14, -0.3, 0.265? -1.2 What is the fourth biggest value in -4, -98/9, 1/11, -5/2, 2/37, 0.1605? -5/2 Which is the second biggest value? (a) 26/27 (b) 16 (c) 15/8 (d) 2/11 (e) -0.8 c What is the fourth biggest value in -13, -5, -4/5, -16/5591? -13 Which is the fourth biggest value? (a) -8 (b) 0 (c) -2/19 (d) -139 (e) -1/2 (f) -5 (g) -15 f What is the fourth biggest value in 2/3, -1434, 5230, -0.3, 0.3? -0.3 What is the second smallest value in -36, 1/9, 2/11, -20.05, -1/4, 0.2, 3? -20.05 What is the third biggest value in -10, -1, 9, -256, -4/3, -9/14? -1 What is the biggest value in -1, 4, 5/4, -264/107, 9/8? 4 Which is the biggest value? (a) -2/3 (b) 0.3 (c) -179091 b What is the smallest value in -4/215, 3/2, 3, 5, -4, -0.317? -4 What is the second biggest value in 0.2, -3/14, -4, -2/9, -12, 0.7, -71? 0.2 Which is the second smallest value? (a) -120 (b) -731 (c) 5 a What is the biggest value in -0.2, 2/21, -389, -1, 2, -0.5, 1/40? 2 What is the sixth biggest value in 0.1, 1/2, -0.2, -1220, 0.12, 5? -1220 Which is the third biggest value? (a) 2145 (b) 17 (c) 5 (d) -0.3 (e) 1 (f) -0.01 c Which is the biggest value? (a) -144 (b) 0.2 (c) 0 (d) 2/23 (e) 2/9 (f) 0.1 e Which is the third smallest value? (a) -296853/8 (b) -2/5 (c) -3 (d) -1 d Which is the biggest value? (a) 0.2517 (b) 1 (c) -50 (d) -0.05 b Which is the fourth biggest value? (a) -49.3 (b) -1/4 (c) -323643 (d) -3 c Which is the third smallest value? (a) -0.4 (b) 1414080 (c) 0.1 (d) -2/13 c What is the fifth biggest value in -0.661, 18/191, 1, 0.1, 0, 0.5? 0 What is the biggest value in -11, 1, -86704? 1 Which is the second biggest value? (a) 0.5 (b) 0.1 (c) 1/21 (d) -6/7 (e) -0.017 b Which is the smallest value? (a) -5/2 (b) -20 (c) -4 (d) -0.147776 b Which is the third biggest value? (a) 22/37 (b) -589/113 (c) -4/3 b Which is the second smallest value? (a) -1 (b) -14 (c) -36 (d) -784 (e) -0.2 c Which is the smallest value? (a) 15 (b) -1/6 (c) -0.453 (d) -1/3 (e) 0.7 (f) -2/5 c What is the biggest value in -5.1, -1/6, -2433/22, -1, 3, -0.1? 3 Which is the third biggest value? (a) -218705 (b) -4/5 (c) 2116 a What is the smallest value in -8/5, 0.069, 0.69? -8/5 Which is the third biggest value? (a) -7/3 (b) 5 (c) 1209683.1 a Which is the second biggest value? (a) -0.3 (b) -3 (c) -26 (d) 92.04 a What is the seventh smallest value in 1/30, 1, 0.2, 5, 596, 0.1, -2/7? 596 What is the third biggest value in -283, -2/5089, 44/7? -283 Which is the smallest value? (a) -0.01 (b) -5 (c) -2553 (d) 5 (e) -3.7 c What is the second smallest value in -36.53, -0.23, -33, 5, 0.3, 2/7? -33 Which is the second smallest value? (a) 0.5 (b) -3/4 (c) -5 (d) -2/21 (e) 0.199 (f) -39 c What is the seventh biggest value in 1/3, 118, 7, 0.2, 0.1, -3, 0.07? -3 Which is the fourth biggest value? (a) 274 (b) 2/3 (c) 3 (d) -367/2 (e) -0.1 e Which is the fifth biggest value? (a) -0.2 (b) -3 (c) -0.77 (d) -4 (e) 0.485 (f) 5 b What is the seventh smallest value in -3, 5, -0.2, 1/19, -0.4, -46, 0.105? 5 Which is the second biggest value? (a) 80 (b) -2/7797 (c) 0.2 c Which is the smallest value? (a) 0.59 (b) -50/9 (c) 46 (d) -3 (e) 4 b What is the fifth smallest value in 0.7, -162/49, -2, -4, -2/7? 0.7 Which is the third smallest value? (a) 12 (b) -0.1 (c) 0.3 (d) 4 (e) -206 (f) 0 f What is the fifth smallest value in 67, 1, -8/17, -0.9, -27, -3, 1/9? 1/9 What is the second biggest value in 83, 3, 0, 1/5, 2/7, 15? 15 Which is the second biggest value? (a) 274.1 (b) 2/7 (c) 120/733 b What is the third smallest value in -3/5, -235688, 0.2, 1/4, -1? -3/5 Which is the third smallest value? (a) 3 (b) -5 (c) -1/3 (d) 290 (e) -9841 c Which is the third biggest value? (a) 1/3 (b) 5/3 (c) 2 (d) -2/19 (e) -54 (f) 0.11 (g) -1/2 a What is the third smallest value in 0.2, -3/4, -99, 9.8, -100? -3/4 Which is the biggest value? (a) -0.1114 (b) 2 (c) -74048 b What is the third smallest value in 4/179, 1/224, 3, 55? 3 What is the sixth smallest value in -3/5, -1, 5, 4, 0.1, -9422, -2/15? 4 Which is the third smallest value? (a) -44/5 (b) -0.2 (c) 5670 (d) 4 d What is the smallest value in -117/46, -13,	{ "pile_set_name": "DM Mathematics" }
+ 5y, -35 = -5p - 5y. Solve j = -4j - p for j. -1 Let q = 18 - 1. Solve -3m - q + 5 = 0 for m. -4 Let u = 12 + -11. Solve b + u - 6 = 0 for b. 5 Let o(l) = -l2 - 3l + 5. Let r be o(-4). Solve -2w - 5 = r for w. -3 Let s be (-1 + (-8)/(-2))2. Suppose -4v - 5k - 5 = -32, 2k = s. Suppose 25 = -2i + 3o + 2o, -5i - vo + 15 = 0. Solve ix - 12 = -3x for x. 4 Let b = -11 + 15. Let v be (1 - 1)2/b. Solve -d + 5d = v for d. 0 Suppose -4n + 13 + 3 = 0. Solve -16 = no - 0o for o. -4 Let d be (-1)/2(1 - 1). Suppose 0 = -4c - 3i + 25, dc + i = 3c - 9. Suppose -ck = -k - 12. Solve -f = kf for f. 0 Let s = 20 - -10. Let n be s/18 - (-2)/6. Solve -3p = np + 25 for p. -5 Suppose -4p + 15 = -3p + 5a, -5p = 3a - 31. Suppose 3o + 5b - 25 = 7o, pb - 25 = 3o. Let m = 0 + o. Solve 10 = 5q - mq for q. 2 Let v be 4(-4 + 8)/8. Solve -10 = -3j + v for j. 4 Let w(c) = 7c - 27. Let s be w(5). Solve 0 = -y + 4 - s for y. -4 Let i(m) = -m3 - 19m*2 - 20m - 35. Let q be i(-18). Solve -2 = k - q for k. -1 Suppose 0 = -5p + 5u + 25, -2u + 25 = 5p - u. Solve -pl = -7 - 18 for l. 5 Let l = 10 + -6. Let s be ((-6)/l)/3-6. Solve v + s = -2 for v. -5 Suppose 2v + 4 = j, 4j + 2v + 8 = -2v. Suppose -n - n = j. Solve n = 3d - 9 - 3 for d. 4 Suppose -3m = -m - 24. Solve 0j - m = -3j for j. 4 Suppose -12 = -j - 0j. Let i = -8 + j. Let u be 2/i + 3/2. Solve 6r - ur - 4 = 0 for r. 1 Let b be ((-5)/10)/((-3)/30). Suppose b = -y + s, -5y - s + 6 = 1. Suppose 0 = -3u - 5f - 10 + 41, 4f - 22 = -u. Solve y = 3k - uk - 3 for k. 3 Suppose -152 = -5t + k, 2t + 0t = 4k + 68. Suppose -5f - t + 110 = 0. Solve 3n = -n + f for n. 4 Let x(y) = -y + 14. Let h be x(10). Let p be -6 - -4 - -1h. Solve -pj = 3j + 20 for j. -4 Let r be 2 + (-5)/(20/(-8)). Suppose -rw + 22 = 7h - 4h, -h - 2 = -w. Solve -hq + 4 = -2 for q. 3 Suppose 3t + 0t = -2m - 5, 5t = -3m - 10. Let g = 17 - 11. Suppose -a = -ga + 45. Solve a = mr - 16 for r. 5 Suppose 2f = -k + 13, -4k + f = -5 - 2. Solve -kx - 22 + 7 = 0 for x. -5 Suppose 0 = g + 3g - 20, 3w = -3g + 45. Solve k = -k + w for k. 5 Let z = -15 + 19. Solve -2y - 2 = z for y. -3 Let u(s) = s*2 + 10s + 5. Let j be u(-7). Let r = j + 10. Let m be (r/10)/((-3)/15). Solve 2t = m + 1 for t. 2 Suppose -68 = 2t - 72. Solve 4 = 2g - t for g. 3 Let v(q) = q2 + 9q + 14. Let a be v(-7). Solve -h - h - 6 = a for h. -3 Let o(s) = s*3 + 7s*2 - 9s - 6. Let i be o(-8). Suppose a = -c - 1, -2c - 1 - 1 = -ia. Solve a = 7r - 2r for r. 0 Let i(u) be the second derivative of u5/20 + u4/3 + u3/6 + u2 + 3u. Let c be i(-3). Solve 2z - 4 + c = 0 for z. -2 Let w(o) = o*2 + 3o - 3. Let g be w(-9). Let l = g - 36. Suppose z + 4 = 5s, 4z + 5s - 12 = -3. Solve -z = -4k + l for k. 4 Let n be 3 + ((-11)/(-22))/((-2)/4). Solve -n = -2j - 4 for j. -1 Let x(u) = -2u - 8. Let b be x(-6). Let f = -2 + b. Let q be (-2 - (f + -3)) + 1. Solve 2r - 6 = -qr for r. 3 Let u be 1 + 5/10(-2 + 8). Solve -h - u + 1 = 0 for h. -3 Let h(u) = u3 - 10u*2 + 13u - 9. Let q be h(8). Let k be q/(-2)(-8)/(-12). Suppose 1 = 3g - 2x, g - k = x - 3x. Solve 4c - 5 - g = 0 for c. 2 Let f be (-3)/(-18)-4-3. Suppose -3s = -h - 4h - 12, -fs = 5h - 8. Solve -2y - s = -y for y. -4 Let d be ((-4)/(-6))/((-10)/(-75)). Let s be 4 + 0 + -12. Suppose -d = -b - o, 5b - sb = -5o + 17. Solve 0u - 4 = bu for u. -1 Suppose 5b = b. Suppose 0 = -bq + q - 2. Let y be (24/(-10))/(3/(-15)). Solve -5k = -y + q for k. 2 Suppose -a - 10 = t, -8a + 3a = 3t + 30. Let y = 12 + t. Solve -yb = 2b for b. 0 Suppose 4p = 14 + 14. Let i = p + -5. Solve 0q + iq = 6 for q. 3 Let j(g) = -5g2 - g3 + 21 + g + 23g2 + 5g*3 - 3g*3. Let q be j(-18). Solve qd + 2 = 4d for d. 2 Let u be (-56)/(-6) - 10/(-15). Suppose -z - z - 5t - 16 = 0, -5z = 5t + u. Solve -3a + z = -2a for a. 2 Let k(n) = -3n2 - 3n. Let s be k(-3). Let y = -13 - s. Solve y = 2o - 1 for o. 3 Suppose -i = -2i + 4. Solve -4z + i = 16 for z. -3 Suppose 19c - 20c = -5. Solve 0 = -cf + 4 + 11 for f. 3 Let f(u) = -6u + 7. Let b be f(3). Let l = 16 + b. Solve 0 = -0n - ln - 10 for n. -2 Suppose 0 = 5p, -2o + 13 = -5p + 3. Solve 2n = on for n. 0 Suppose 3s + 1 = 4, -4s + 24 = 4t. Let v = t - 3. Solve -3m - 10 = vm for m. -2 Suppose 3r + 3f + 53 = -70, 15 = -3f. Let g = 96 + r. Let q be g/(-8)(-2)/3. Solve -i = -0i - q for i. 5 Suppose 4a - 5a = -3r + 15, 5 = -2a + r. Suppose -2i - 10 = -4g, 4i - 35 = -5g - i. Let f be ((-2)/(-1))/g8. Solve av + 2v = f for v. 2 Let s(u) = -u2 + 4u + 4. Let q be s(4). Let j = q - -1. Suppose -2w = -5i + 6 - 32, -5i = -3w + 29. Solve jg = 2g + w for g. 1 Let r(j) be the second derivative of -j*4/12 - 7j*3/6 - 5j*2/2 - 4j. Let a be r(-5). Solve 15 = au - 2u for u. 5 Let m = -3 + 9. Solve 3o = -0o - m for o. -2 Suppose -3v - v + 36 = 3s, 3v + s - 27 = 0. Suppose va - 4a + 10 = 3o, 0 = 3o + a + 2. Solve op + p = -5 for p. -5 Suppose 6g = 16 + 8. Solve gs - 5 = 3s for s. 5 Suppose -o - 5q + 9 = 0, -3o - 3q + 11 = -o. Let c = o - 11. Let g(h) = h*3 + 6h*2 - 10h - 6. Let x be g(c). Solve 4j = j - x for j. -5 Let n = 8 + -3. Solve ni = 3i for i. 0 Suppose 27s + 18 = 30s. Solve 2l + s = -l for l. -2 Let n(v) = -v*2 + 3v + 4. Let p be n(5). Let k(t) = 4t + 5 + 0t + t*2 - 12. Let b be k(p). Solve q + 3 - b = 0 for q. 2 Suppose 5c + 3p = -0c + 38, -10 = c + 5p. Solve -j - j = c for j. -5 Suppose 2g = -3c + 23, -3g + 0 = -2c - 2. Suppose -2l = -5t - 14, gl - 14 = 2l + 4t. Solve 0 = 2a - la - 15 for a. -3 Suppose 3i = -4g + 2, 2g - 5i - 16 = -2. Solve gd + 3 = 9 for d. 3 Let l = -12 + 16. Suppose 5q + lj - 20 = 0, 12 = 3q - 3j + 2j. Solve p - q = -2 for p. 2 Let a(b) = -b - 4. Let t be a(-4). Let w(z) = z*2 - 3z + 6. Let u be w(4). Let k be (-7)/(-35) + 8/u. Solve -c - k + 3 = t for c. 2 Let c(t) be the first derivative of -t4/4 + t3/3 + 4t + 1. Suppose 0 = p - 2p. Let l be c(p). Solve 0 = -lf - 0 - 16 for f. -4 Let s be -2 + 2 + 1 + 2. Solve -2 = -w - s for w. -1 Suppose 7x - x = 12. Suppose 2a - 4a = 0. Solve xv + 5 + 1 = a for v. -3 Suppose 20 = 7f - 15. Solve -6 = fi - 1 for i. -1 Let j = 5 + -2. Suppose -5a - 14 + 1 = jb, -3b = -a - 17. Solve -bn + 0 = -12 for n. 3 Suppose -4v + 25 = v. Suppose 12 = -4o + 4. Let f = v + o. Solve 0 = fh + h for h. 0 Let z = 18 + -17. Solve d = -z - 3 for d. -4 Suppose 3d - 7 + 1 = 0. Solve 2l = -0l - d for l. -1 Suppose -5z + 2j = -9, -5z + 2j + j = -6. Suppose 5 = zu - 4. Suppose -3 = -3i - 6, -3v + 57 = 3i. Solve k - v = -uk for k. 5 Let b(y) = y - 3. Let l be b(4). Let n be 65/10 + l/(-2). Let t = n - 2. Solve -3d + td = 0 for d. 0 Suppose -20 = -v - 3v. Suppose vu + 11 - 61 = 0. Solve -b + 6b = -u for b. -2 Let u be (-3)/6 - (-22)/4. Solve -ua = 6 - 1 for a. -1 Let w(n) = n - 2. Let c be 6/(-15) - 168/(-20). Let l be w(c). Solve 0 = -3o - 0o + l for o. 2 Let f = 149 - 142. Solve y - 3 = -f for y. -4 Let j(r) = -r*2 - 2r + 5. Let u be j(-4). Let w be (0 - (-2)/(-3))u. Let s be 1/(7/3 + (-2)/1). Solve -wb = sb + 20 for b. -4 Suppose 4k = -5w - 2, 1 = 4k + 2w - 3. Let b = 8 + -5. Solve 0 = -bn - k - 1 for n. -1 Suppose 15 = 9s - 39. Solve 0v + 2v = s for v. 3 Suppose -2 = s - 2s. Let d = 2 - 4. Let x be 12/5 + d/5. Solve -x = r + s for r. -4 Let t be 3 - (-1 - (2 - -3)). Solve 0 = 7x - 4x - t for x. 3 Suppose 5k - 26 = -2l, 0l + 5k - 5 = 5l. Let x(f) be the third derivative of -f5/60 + f4/6 - f2. Let i be x(l). Solve r + 12 = -ir for r. -3 Let y(m) = -2m + 9. Let w(p) = -p + 5. Let a(o) = -5w(o) + 3y(o). Let h be (1 + -1)-11. Let v be a(h). Solve -f - vf = 6 for f. -2 Let w be (-86)/(-30) - (-1)/304. Solve 5d + 7 = -w for d. -2 Let l(r) = -6r3 - r2 + r - 1. Let s be l(1). Let t be 8/10(-70)/s. Let n = t - 6. Solve -2m + 20 = nm for m. 5 Let f be (-2)/4(-11 + 3). Let g be 15 + 1/(-4)0. Solve g = fr - 1 for r. 4 Let s(j) = 9j - 12. Let l be s(3). Solve 0 = 2h - 5h - l for h. -5 Let x(j) = 3j2 + 3j - 4j2 + 0j*2. Let z be x(3). Solve z + 6 = 2c for c. 3 Suppose u	{ "pile_set_name": "DM Mathematics" }
uppose -2f3 - 1044f*2 - 41184f - 414720 = 0. What is f? -480, -24, -18 Solve -2j2/5 - 7122j/5 - 105944 = 0 for j. -3485, -76 Solve -2l5/11 + 1742l*4/11 - 197480l*3/11 + 5370872l*2/11 + 23909152l/11 + 24727040/11 = 0 for l. -2, 52, 80, 743 Factor 2b2 - 1509845b + 2264763. (b - 754921)(2b - 3) Suppose m*5/4 - 5529m*4/8 - 3473091m*3/2 + 6122261099m*2/2 + 4901913223332m - 2451721677192 = 0. What is m? -1524, 1/2, 2906 Find f, given that f*2/3 + 38635894f/3 + 373183076294809/3 = 0. -19317947 Factor 2h2/23 + 942668h/23 + 6598578/23. 2(h + 7)(h + 471327)/23 Let 7412l5 + 348368l*4 + 4262088l*3 + 3923248l*2 + 2116l = 0. What is l? -23, -1, -1/1853, 0 Suppose 2h2/5 - 1497156h/5 + 280184511042/5 = 0. Calculate h. 374289 Factor -t*2 - 5575320t - 7771048275600. -(t + 2787660)*2 Determine h, given that -104325h*3 + 160870h*2 - 112004h/3 + 7096/3 = 0. 2/15, 1774/1391 Factor 35i2 - 264662675i - 75617910. 5(i - 7561791)(7i + 2) Factor 4f*4/5 + 188184f*3/5 - 35519968f*2/5. 4f*2(f - 188)(f + 47234)/5 What is d in 5d*4 - 1065d*3 - 6545d*2 + 3389085d = 0? -53, 0, 63, 203 Solve 4u5 - 5156084u*4 - 12u*3 + 15468260u*2 - 10312168u = 0 for u. -2, 0, 1, 1289021 Let 3d4 + 321d*3 + 9345d*2 - 22833d - 2995380 = 0. What is d? -43, -36, 15 Factor -v*5/4 + 1077v*4/4 + 100230v*3 + 10986352v*2 + 390609024v. -v(v - 1389)(v + 104)*3/4 Solve -2w*2/17 + 644302w/17 + 7731912/17 = 0 for w. -12, 322163 Solve -27z5 + 21594z*4 - 1887873z*3 + 1450506z*2 + 415800z = 0. -2/9, 0, 1, 99, 700 Factor -s*2/4 + 769223s/2 - 769222. -(s - 1538444)(s - 2)/4 Determine a so that -115a*3 - 745390a*2 + 3989305a - 1297400 = 0. -6487, 8/23, 5 What is y in 2y2/15 + 43714y/3 + 145700 = 0? -109275, -10 Solve 2k4/7 + 164k*3/7 - 27078k*2/7 - 88920k = 0. -156, -21, 0, 95 Factor i*2 + 117799382i + 3469173599895481. (i + 58899691)*2 Let -2n*4/7 + 37318n*3/7 - 1786654n*2/7 - 37318n/7 + 1786656/7 = 0. Calculate n. -1, 1, 48, 18611 Factor i*4 - 5168i*3 + 9892576i*2 - 8308903680i + 2584892217600. (i - 1540)*2(i - 1044)*2 Let -3u*4 - 289365u*3 - 3182706u*2 - 5207976u = 0. What is u? -96444, -9, -2, 0 Factor 4u4 + 23752u*3 + 36837988u*2 + 4685509536u + 155658655296. 4(u + 68)2(u + 2901)*2 Determine h so that -4h*5 - 33408h*4 - 333676h*3 + 33408h*2 + 333680h = 0. -8342, -10, -1, 0, 1 Find x such that -x*5/4 - 101x*4/2 + 1059x*3/4 + 1242x*2 = 0. -207, -3, 0, 8 Factor -6v*2/11 - 3348084v/11 - 467069436294/11. -6(v + 279007)2/11 What is z in 63z*5/2 - 322485z*4/2 + 1900091z*3 - 1465781z*2 + 735419z/2 - 56177/2 = 0? 1/7, 1/3, 11, 5107 Find u such that u*2 - 112833u + 3835166 = 0. 34, 112799 Determine l so that l*3 + 70448l*2 + 19246445l + 1317095806 = 0. -70174, -137 What is g in -920g5 - 16555g*4 + 3477690g*3 - 90088740g*2 + 690619230g - 3750705 = 0? -81, 1/184, 21 Factor -o*3 + 1700o*2 - 204229o + 202530. -(o - 1570)(o - 129)(o - 1) Solve -5d2 + 7705830d - 7705825 = 0. 1, 1541165 Determine y, given that 2y3 - 2944520y*2 + 1083730584650y + 32514567661500 = 0. -30, 736145 Suppose -4t4/7 + 440t*3/7 + 20800t*2/7 + 19960t + 17052 = 0. Calculate t. -29, -7, -1, 147 Factor 10o2 + 138111035o - 276222110. 5(o - 2)(2o + 27622211) Factor 16x*2 - 1765137x + 110321. (x - 110321)(16x - 1) Solve -4t3 - 3117888t*2 - 6235764t - 3117880 = 0. -779470, -1 Factor 38g2/11 + 2797032g/11 - 5299776/11. 2(g + 73608)(19g - 36)/11 Factor 3p*4 - 71008986p*3 + 420189745404663p*2 - 840379277782380p + 420189603386700. 3(p - 11834830)2(p - 1)*2 Factor 4l*2 + 19052l - 21151472. 4(l - 929)(l + 5692) Factor -121z2 + 26318556z - 1431128904804. -(11z - 1196298)2 Determine n so that 19119n*4 + 458976n*3 + 2239803n*2 - 6448182n - 40560 = 0. -13, -40/6373, 2 Determine t so that -t*3/3 + 1168t*2/3 + 203135t/3 + 199622 = 0. -151, -3, 1322 Factor -y*2 - 12616y - 31708215. -(y + 3465)(y + 9151) Find c, given that 5c*4 + 1411895c*3 + 1411890c*2 = 0. -282378, -1, 0 Find c such that -69c*3 - 16233c*2 - 633096c - 164052 = 0. -186, -49, -6/23 Find v such that -5v3 + 11500940v*2 - 92007235v + 80506300 = 0. 1, 7, 2300180 Solve -3i4/4 - 1587i*3/4 + 565065i*2/4 + 4078539i/4 - 8639055/2 = 0. -771, -10, 3, 249 Solve 3c5/5 - 4377c*4 + 7079385c*3 + 3300455181c*2 + 317479237992c - 23502178198044/5 = 0 for c. -202, 13, 3843 Suppose -18p2 - 55442p/5 + 391244/5 = 0. Calculate p. -623, 314/45 Suppose 4n2 + 10803028n + 129635760 = 0. Calculate n. -2700745, -12 Let 52y5/3 - 96180y*4 + 400099508y*3/3 + 153997700y*2 + 20535000y = 0. Calculate y. -1, -2/13, 0, 2775 Factor 3v2/8 + 1246677v/4 - 1246683. 3(v - 4)(v + 831122)/8 Solve 3v2 + 776868v + 2330577 = 0 for v. -258953, -3 Suppose -6w5 - 178w*4 - 154w*3 + 546w*2 + 872w + 344 = 0. Calculate w. -86/3, -1, 2 Solve 21i4 + 14736i*3 + 792969i*2 - 15573306i + 4384440 = 0. -641, -76, 2/7, 15 Suppose -3g4/4 + 5415g*3/4 - 786111g*2/4 - 5736399g/4 - 2472435/2 = 0. Calculate g. -6, -1, 167, 1645 Let -p*5/5 - 72843p*4/5 - 1327144587p*3/5 - 22538663741p*2/5 + 31829622864p/5 + 143197909452/5 = 0. Calculate p. -36413, -18, -2, 3 Find u, given that -10u5/3 - 76177u*4/6 - 7443931u*3/6 + 65082161u*2/3 - 3101704u - 2150640 = 0. -3708, -116, -1/4, 2/5, 15 Factor -3n2/2 + 57519n/2 - 832764. -3(n - 19144)(n - 29)/2 Factor -5l2/3 + 416527790l - 26024309976342615. -5(l - 124958337)2/3 Suppose 3f*2 - 31518786f + 82786155909483 = 0. What is f? 5253131 Factor -r*2/4 - 4657r/2 + 46595/4. -(r - 5)(r + 9319)/4 Factor -66248h*2/3 + 359801624h/3 - 488532516578/3. -2(182h - 494233)2/3 Suppose -x2/2 - 3915707x/2 + 1957854 = 0. What is x? -3915708, 1 Let -34633225x*4 - 56943260x*3 + 475473445x*2 + 21088340x + 233220 = 0. Calculate x. -23/5, -26/1177, 3 Factor -171a2 + 8288877a + 290838. -3(a - 48473)(57a + 2) Suppose 3n*4 - 6178065n*3/4 + 66413067n*2/4 - 32820267n - 9266904 = 0. What is n? -1/4, 3, 8, 514828 Factor c*3/2 + 26572c*2 - 1010390c + 3616376. (c - 34)(c - 4)(c + 53182)/2 Factor 5f2/4 - 3308245f/2 - 6616510. 5(f - 1323302)(f + 4)/4 What is w in 2w4/5 - 126466w*3/5 - 252966w*2/5 + 328826w - 252940 = 0? -5, 1, 2, 63235 Let c*4/4 - 4691c*3/2 + 74973c*2/4 + 44524c + 23435 = 0. Calculate c. -1, 10, 9374 Factor -2h3/23 + 224256h*2/23 - 6726330h/23 + 50444100/23. -2(h - 112098)(h - 15)*2/23 Solve 2c*4/9 - 152358548c*3/9 + 967213681980694c*2/3 - 5803281634808528c/9 + 2901640741224992/9 = 0 for c. 1, 38089636 What is f in -3f3 - 3912f*2 - 420795f + 2666250 = 0? -1185, -125, 6 Factor -2g2 - 45986g + 9979440. -2(g - 215)(g + 23208) Factor -1179919b3/8 - 9439347b*2/8 + 5b. -b(b + 8)(1179919b - 5)/8 Factor -52689p*2 + 2581752p + 441. -3(p - 49)(17563p + 3) Suppose x3 - 95563x*2 - 95566x + 191128 = 0. What is x? -2, 1, 95564 Determine o, given that 50o3 - 3026o*2/9 + 1832o/9 + 248/3 = 0. -62/225, 1, 6 Determine p, given that -11p2 + 8220p - 26784 = 0. 36/11, 744 Factor 3q3/7 + 2409q*2 + 2199288q + 552745872. 3(q + 532)2(q + 4557)/7 Factor 2k3/5 + 1652k*2 + 49506k/5 + 74232/5. 2(k + 3)2(k + 4124)/5 Factor m*5 + 8496m*4 + 17405848m*3 - 2717258688m*2 + 102289949584m. m(m - 74)2(m + 4322)*2 Solve -20d*3/3 + 6724d*2/9 - 63128d/3 + 194432/9 = 0. 16/15, 49, 62 Determine i so that 3i5 - 798i*4 + 68307i*3 - 1839432i*2 - 1093680i + 29635200 = 0. -4, 4, 56, 105 Factor -3a2 - 24756a - 690816. -3(a + 28)(a + 8224) Factor 2v2/9 - 30338v/9 + 13278056/3. 2(v - 13717)(v - 1452)/9 Factor -p*2 - 4817414p - 5801869411849. -(p + 2408707)*2 Solve 2k*2/3 - 2966k/3 + 235420 = 0. 298, 1185 Solve 2s4/11 - 3847710s*3/11 + 23086204s*2/11 - 30781584s/11 = 0. 0, 2, 4, 1923849 Let -2f5 + 2476f*4 + 340772f*3 + 12143336f*2 + 63927390f + 91491948 = 0. What is f? -61, -3, 1366 Factor -4u2 - 87406832u - 477497142517264. -4(u + 10925854)*2 Determine f, given that	{ "pile_set_name": "DM Mathematics" }
rime factors of 5536. 2, 173 List the prime factors of 1626. 2, 3, 271 List the prime factors of 9820. 2, 5, 491 What are the prime factors of 120006? 2, 3, 59, 113 List the prime factors of 230. 2, 5, 23 What are the prime factors of 66369? 3, 22123 What are the prime factors of 25766? 2, 13, 991 List the prime factors of 19255. 5, 3851 What are the prime factors of 16873? 47, 359 List the prime factors of 44155. 5, 8831 What are the prime factors of 320? 2, 5 List the prime factors of 61283. 61283 What are the prime factors of 27? 3 List the prime factors of 34984. 2, 4373 List the prime factors of 175. 5, 7 List the prime factors of 1307. 1307 What are the prime factors of 679? 7, 97 List the prime factors of 34545. 3, 5, 7, 47 What are the prime factors of 2159? 17, 127 List the prime factors of 2429. 7, 347 List the prime factors of 495. 3, 5, 11 List the prime factors of 83323. 97, 859 List the prime factors of 56380. 2, 5, 2819 What are the prime factors of 159? 3, 53 List the prime factors of 37507. 37507 What are the prime factors of 74730? 2, 3, 5, 47, 53 What are the prime factors of 26254? 2, 13127 What are the prime factors of 63623? 7, 61, 149 List the prime factors of 26962. 2, 13, 17, 61 What are the prime factors of 37795? 5, 7559 List the prime factors of 2174. 2, 1087 What are the prime factors of 7239? 3, 19, 127 List the prime factors of 17428. 2, 4357 List the prime factors of 44011. 11, 4001 What are the prime factors of 9483? 3, 29, 109 List the prime factors of 10747. 11, 977 What are the prime factors of 443? 443 List the prime factors of 50273. 50273 What are the prime factors of 7855? 5, 1571 List the prime factors of 3758. 2, 1879 List the prime factors of 87616. 2, 37 List the prime factors of 8347. 17, 491 List the prime factors of 761. 761 List the prime factors of 3877. 3877 List the prime factors of 16065. 3, 5, 7, 17 List the prime factors of 59478. 2, 3, 23, 431 List the prime factors of 21. 3, 7 List the prime factors of 53230. 2, 5, 5323 List the prime factors of 31357. 31357 List the prime factors of 2734. 2, 1367 List the prime factors of 8373. 3, 2791 List the prime factors of 4831. 4831 What are the prime factors of 3543? 3, 1181 What are the prime factors of 1301? 1301 List the prime factors of 6865. 5, 1373 List the prime factors of 768. 2, 3 What are the prime factors of 33249? 3, 11083 List the prime factors of 2201. 31, 71 What are the prime factors of 717? 3, 239 List the prime factors of 66959. 66959 List the prime factors of 528. 2, 3, 11 What are the prime factors of 26026? 2, 7, 11, 13 What are the prime factors of 8892? 2, 3, 13, 19 What are the prime factors of 77692? 2, 19423 What are the prime factors of 19471? 19471 What are the prime factors of 41271? 3, 13757 List the prime factors of 1813. 7, 37 List the prime factors of 2594. 2, 1297 List the prime factors of 1860. 2, 3, 5, 31 List the prime factors of 1518. 2, 3, 11, 23 List the prime factors of 3970. 2, 5, 397 List the prime factors of 3430. 2, 5, 7 List the prime factors of 50429. 211, 239 What are the prime factors of 12? 2, 3 List the prime factors of 10030. 2, 5, 17, 59 What are the prime factors of 113077? 73, 1549 List the prime factors of 91703. 91703 What are the prime factors of 23810? 2, 5, 2381 What are the prime factors of 36991? 71, 521 List the prime factors of 27067. 27067 What are the prime factors of 3309? 3, 1103 List the prime factors of 32857. 11, 29, 103 List the prime factors of 11036. 2, 31, 89 What are the prime factors of 1631? 7, 233 List the prime factors of 4280. 2, 5, 107 What are the prime factors of 264? 2, 3, 11 What are the prime factors of 58133? 61, 953 List the prime factors of 10915. 5, 37, 59 What are the prime factors of 6877? 13, 23 List the prime factors of 133520. 2, 5, 1669 List the prime factors of 11067. 3, 7, 17, 31 List the prime factors of 1937. 13, 149 List the prime factors of 1444. 2, 19 List the prime factors of 172. 2, 43 What are the prime factors of 3271? 3271 What are the prime factors of 1875? 3, 5 What are the prime factors of 39926? 2, 19963 List the prime factors of 6928. 2, 433 What are the prime factors of 1825? 5, 73 What are the prime factors of 6926? 2, 3463 What are the prime factors of 2571? 3, 857 List the prime factors of 7292. 2, 1823 List the prime factors of 28546. 2, 7, 2039 List the prime factors of 575. 5, 23 What are the prime factors of 2657? 2657 List the prime factors of 2904. 2, 3, 11 What are the prime factors of 111561? 3, 41, 907 List the prime factors of 11406. 2, 3, 1901 List the prime factors of 2436. 2, 3, 7, 29 List the prime factors of 1648. 2, 103 List the prime factors of 39460. 2, 5, 1973 What are the prime factors of 34410? 2, 3, 5, 31, 37 List the prime factors of 2573. 31, 83 List the prime factors of 17513. 83, 211 What are the prime factors of 42546? 2, 3, 7, 1013 What are the prime factors of 2111? 2111 List the prime factors of 29847. 3, 9949 List the prime factors of 53850. 2, 3, 5, 359 What are the prime factors of 47120? 2, 5, 19, 31 What are the prime factors of 1232? 2, 7, 11 What are the prime factors of 1333? 31, 43 What are the prime factors of 359? 359 What are the prime factors of 8406? 2, 3, 467 List the prime factors of 64153. 64153 What are the prime factors of 39132? 2, 3, 1087 What are the prime factors of 2887? 2887 List the prime factors of 716. 2, 179 What are the prime factors of 1799? 7, 257 List the prime factors of 24354. 2, 3, 11, 41 What are the prime factors of 20072? 2, 13, 193 List the prime factors of 7381. 11, 61 What are the prime factors of 351? 3, 13 List the prime factors of 1263. 3, 421 List the prime factors of 3573. 3, 397 What are the prime factors of 7710? 2, 3, 5, 257 What are the prime factors of 10571? 11, 31 List the prime factors of 13990. 2, 5, 1399 What are the prime factors of 1882? 2, 941 List the prime factors of 6417. 3, 23, 31 What are the prime factors of 444? 2, 3, 37 What are the prime factors of 16713? 3, 619 List the prime factors of 18324. 2, 3, 509 List the prime factors of 10508. 2, 37, 71 List the prime factors of 6799. 13, 523 List the prime factors of 256. 2 What are the prime factors of 11774? 2, 7, 29 What are the prime factors of 1738? 2, 11, 79 What are the prime factors of 1452? 2, 3, 11 List the prime factors of 16254. 2, 3, 7, 43 What are the prime factors of 15718? 2, 29, 271 What are the prime factors of 1216? 2, 19 What are the prime factors of 881? 881 List the prime factors of 1728. 2, 3 List the prime factors of 3477. 3, 19, 61 What are the prime factors of 13205? 5, 19, 139 What are the prime factors of 1376? 2, 43 List the prime factors of 50890. 2, 5, 7, 727 What are the prime factors of 397? 397 List the prime factors of 55152. 2, 3, 383 List the prime factors of 22651. 22651 What are the prime factors of 1547? 7, 13, 17 What are the prime factors of 58978? 2, 37, 797 List the prime factors of 2068. 2, 11, 47 List the prime factors of 19713. 3, 6571 List the prime factors of 2708. 2, 677 What are the prime factors of 14470? 2, 5, 1447 List the prime factors of 1372. 2, 7 What are the prime factors of 1655? 5, 331 List the prime factors of 21459. 3, 23, 311 List the prime factors of 3028. 2, 757 List the prime factors of 2069. 2069 List the prime factors of 142642. 2, 73, 977 List the prime factors of 6702. 2, 3, 1117 What are the prime factors of 165? 3, 5, 11 What are the prime factors of 5838? 2, 3, 7, 139 What are the prime factors of 94637? 101, 937 List the prime factors of 67091. 23, 2917 What are the prime factors of 1713? 3, 571 What are the prime factors of 19483? 19483 What are the prime factors of 704? 2, 11 What are the prime factors of 31113? 3, 3457 What are the prime factors of 2690? 2, 5, 269 What are the prime factors of 2372? 2, 593 List the prime factors of 39193. 7, 11, 509 List the prime factors of 1024. 2 What are the prime factors of 182? 2, 7, 13 What are the prime factors of 51030? 2, 3, 5, 7 List the prime factors of 23336. 2, 2917 List the prime factors of 745. 5, 149 List the prime factors of 5987. 5987 List the prime factors of 31086. 2, 3, 11, 157 List the prime factors of 1204. 2, 7, 43 List the prime factors of 8046. 2, 3	{ "pile_set_name": "DM Mathematics" }
0 in increasing order. -47, -5, 0, 3, 1284 Sort -8, 5, 16, -10 in descending order. 16, 5, -8, -10 Put 977, 4, -0.23 in ascending order. -0.23, 4, 977 Sort 3, 4, 2, -16, -67 in descending order. 4, 3, 2, -16, -67 Sort 0.477, -2/33, -1/3, 0.2 in increasing order. -1/3, -2/33, 0.2, 0.477 Put 26, 1228, 24 in ascending order. 24, 26, 1228 Sort 72, 4, 0, 372, 3 in ascending order. 0, 3, 4, 72, 372 Put -1/4, 5, 7316, -0.1 in descending order. 7316, 5, -0.1, -1/4 Put 22, -5, 10, -29 in decreasing order. 22, 10, -5, -29 Sort 2, -5, 4, -4/7, 4/93 in ascending order. -5, -4/7, 4/93, 2, 4 Sort -186, -5, -4, -2, -30, 7 in decreasing order. 7, -2, -4, -5, -30, -186 Sort -15/781, -2/11, 1/8 in decreasing order. 1/8, -15/781, -2/11 Put 4, 3, -1, -2, -182 in increasing order. -182, -2, -1, 3, 4 Put 5, 2, -3/19, -1, 8/5 in increasing order. -1, -3/19, 8/5, 2, 5 Put 117, -9, 5, 1 in decreasing order. 117, 5, 1, -9 Sort 0, -85, 4, -639 in descending order. 4, 0, -85, -639 Put 0, 4, -2, -3, -1, 212 in decreasing order. 212, 4, 0, -1, -2, -3 Put -0.122, -0.6, 294 in decreasing order. 294, -0.122, -0.6 Sort -0.099, -2, 21, -0.5, 5 in decreasing order. 21, 5, -0.099, -0.5, -2 Sort -8, -4, -2, 3, -14 in descending order. 3, -2, -4, -8, -14 Put -15.2, 1/1468, -3/7, 0, 1 in increasing order. -15.2, -3/7, 0, 1/1468, 1 Put -4, 9, 21, -8 in ascending order. -8, -4, 9, 21 Sort -5, 1.6, -2/9, 0.7, -3. -5, -3, -2/9, 0.7, 1.6 Sort -3/4, -107, -1557 in descending order. -3/4, -107, -1557 Sort -1/22, -1/4, -1, 0.5, -4/23 in decreasing order. 0.5, -1/22, -4/23, -1/4, -1 Put -140, 2/5, -314 in increasing order. -314, -140, 2/5 Sort 0.1, -1/6, 10422, 2. -1/6, 0.1, 2, 10422 Sort -5, 137, -7/37. -5, -7/37, 137 Sort 4, 0, 6, 8072 in ascending order. 0, 4, 6, 8072 Sort 2, 3, -1, 59, 9 in ascending order. -1, 2, 3, 9, 59 Sort -1/4, -29, 5, 0.4, 1/4, -1/2 in decreasing order. 5, 0.4, 1/4, -1/4, -1/2, -29 Sort 28543, -2, 3 in ascending order. -2, 3, 28543 Put 5, -3, -372, 4, -2 in descending order. 5, 4, -2, -3, -372 Put -12, 3/10, -10, 2, 0.06 in ascending order. -12, -10, 0.06, 3/10, 2 Put -1/10, -5, 86 in decreasing order. 86, -1/10, -5 Sort -60, -5, -2/19, -1/4, -3/8 in ascending order. -60, -5, -3/8, -1/4, -2/19 Sort 0.5, -10885, -0.5, 0 in descending order. 0.5, 0, -0.5, -10885 Put 0, -4, 2, -5, 14 in descending order. 14, 2, 0, -4, -5 Put 60, -4, 5, -1, 36 in increasing order. -4, -1, 5, 36, 60 Sort -3, -18, -1, -160 in descending order. -1, -3, -18, -160 Sort 6/19, 1/6, 73, -5, -2/11, 1 in increasing order. -5, -2/11, 1/6, 6/19, 1, 73 Put 2, -1234805, -2 in increasing order. -1234805, -2, 2 Sort 3, -5, -2, 658, -12, 2 in decreasing order. 658, 3, 2, -2, -5, -12 Put 587, 3, -5, 2, -3, 1 in ascending order. -5, -3, 1, 2, 3, 587 Sort 1, 38, 3, 2, -4, 22 in ascending order. -4, 1, 2, 3, 22, 38 Put -2, 4456, 7 in decreasing order. 4456, 7, -2 Sort -22, -29, 12 in decreasing order. 12, -22, -29 Put 5, 1/37, -11, -49 in decreasing order. 5, 1/37, -11, -49 Sort -3, -1/12900, -1/4 in descending order. -1/12900, -1/4, -3 Put 0.569, -2, 4, -5, -1/3, -4 in descending order. 4, 0.569, -1/3, -2, -4, -5 Put -4/7, 0.2, -0.39, 2/5 in increasing order. -4/7, -0.39, 0.2, 2/5 Put -1/19, 0, 7, 2, 13 in descending order. 13, 7, 2, 0, -1/19 Sort -0.2, -14, 1/4, -8, 4/45, -1/7. -14, -8, -0.2, -1/7, 4/45, 1/4 Put -175, 0, 1/9, 249 in increasing order. -175, 0, 1/9, 249 Sort 0.1, -533, 10/7, -2, -0.2, 3 in decreasing order. 3, 10/7, 0.1, -0.2, -2, -533 Sort 0, -4, -5, -974. -974, -5, -4, 0 Sort 134, 4, 42 in decreasing order. 134, 42, 4 Sort -4, 0.1, -156.62 in increasing order. -156.62, -4, 0.1 Sort 2.1, -3/4, 21, -1/9 in ascending order. -3/4, -1/9, 2.1, 21 Sort 100, 10, 238, 0. 0, 10, 100, 238 Put 27, -24, 96 in ascending order. -24, 27, 96 Sort 0.056, -3, 965. -3, 0.056, 965 Put -1017, -1, -37, -2/23, 1 in ascending order. -1017, -37, -1, -2/23, 1 Sort -365, 5, 17, -3 in increasing order. -365, -3, 5, 17 Put -21, 0.5, 0.09191 in descending order. 0.5, 0.09191, -21 Sort -5, 93, -1, -3, 5, 4. -5, -3, -1, 4, 5, 93 Put -384, -1, 0, 34 in increasing order. -384, -1, 0, 34 Put 2/9, -2, -4/59, -12, -36 in decreasing order. 2/9, -4/59, -2, -12, -36 Put -4, -1.1, -109748 in descending order. -1.1, -4, -109748 Sort 0, 1, 431733. 0, 1, 431733 Sort -230/7, -0.4, 0.07, -79 in decreasing order. 0.07, -0.4, -230/7, -79 Put -7, -128, 1, -1 in descending order. 1, -1, -7, -128 Put -3, -0.191, 2/65 in decreasing order. 2/65, -0.191, -3 Sort 0.5, 200, -0.17, 2. -0.17, 0.5, 2, 200 Sort -1, -3, -5, 412104 in increasing order. -5, -3, -1, 412104 Put 3, 22355, 2 in increasing order. 2, 3, 22355 Sort -0.01, -5, -2/3, 1/4, 9 in increasing order. -5, -2/3, -0.01, 1/4, 9 Sort 0.4, 0.072, 2/17, -2, -1.3, -4 in ascending order. -4, -2, -1.3, 0.072, 2/17, 0.4 Sort 27, 1042, 1 in decreasing order. 1042, 27, 1 Put 222, -3, 254 in descending order. 254, 222, -3 Sort 0.4, -22, -6/5, -0.5, -3, 5 in descending order. 5, 0.4, -0.5, -6/5, -3, -22 Sort -1815, 4, -1 in descending order. 4, -1, -1815 Sort -33, 28, -2, 4, 1 in decreasing order. 28, 4, 1, -2, -33 Sort -1, 3, 33, -90, -9 in ascending order. -90, -9, -1, 3, 33 Put -1/276, -1/6, 0.4, 2 in descending order. 2, 0.4, -1/276, -1/6 Put 1, 47, -3, 50 in ascending order. -3, 1, 47, 50 Sort -3, 1, 1032, -6, -4. -6, -4, -3, 1, 1032 Sort -5, 2, -8, -6, -4, -10 in decreasing order. 2, -4, -5, -6, -8, -10 Sort 0.0718672, -5, 3/8. -5, 0.0718672, 3/8 Sort -0.104, -4, -2, 8, -3, 0.4 in decreasing order. 8, 0.4, -0.104, -2, -3, -4 Put -2, 1, 0, 903, 7, 5 in decreasing order. 903, 7, 5, 1, 0, -2 Put -2, -4, -1, -28/393 in decreasing order. -28/393, -1, -2, -4 Sort -2/11, 1, 0.075, 1.5 in increasing order. -2/11, 0.075, 1, 1.5 Sort 934, 4, -2 in decreasing order. 934, 4, -2 Put -8, -26, 3, 12 in decreasing order. 12, 3, -8, -26 Sort 530, 4, -11, 3, -6 in descending order. 530, 4, 3, -6, -11 Sort 5/21, 2, -11/27. -11/27, 5/21, 2 Put 2, 710, -114 in ascending order. -114, 2, 710 Sort 4, 0, 4806, -3 in ascending order. -3, 0, 4, 4806 Sort 2/5, -5/4, -0.013, 2/3. -5/4, -0.013, 2/5, 2/3 Sort 298, -3, 6, -14 in decreasing order. 298, 6, -3, -14 Put 1044, -258, 5, -3 in increasing order. -258, -3, 5, 1044 Sort 4, -3, -13, -52, -5. -52, -13, -5, -3, 4 Sort -60, 1/9, 1.5, 4, -1/2 in ascending order. -60, -1/2, 1/9, 1.5, 4 Sort -4, 1, 44.05. -4, 1, 44.05 Put 2, 13, 0, 12 in decreasing order. 13, 12, 2, 0 Sort -0.06, -0.1, -117, 1/9 in decreasing order. 1/9, -0.06, -0.1, -117 Sort -0.122, -2, -29 in descending order. -0.122, -2, -29 Put 2, -1, -2, 0, 46, -12 in increasing order. -12, -2, -1, 0, 2, 46 Sort 2, -5, -73, -12, 0, -1 in ascending order. -73, -12, -5, -1, 0, 2 Put -10.3682, 1/6, -1/4 in ascending order. -10.3682, -1/4, 1/6 Sort 0, 2, -3, 4, 1, 1601 in descending order. 1601, 4, 2, 1, 0, -3 Put -2/87, 0.2, 1.2, -2/3, 3, -5 in descending order. 3, 1.2, 0.2, -2/87, -2/3, -5 Sort -3, 327, 89 in descending order. 327, 89, -3 Put 2, -233, -5.11 in increasing order. -233, -5.11, 2 Sort 4, -331, -12, -7 in increasing order. -331, -12, -7, 4 Sort -26, 16, -2.03, 1/8 in descending order. 16, 1/8, -2.03, -26 Sort 26, 3, -2, -701. -701, -2, 3, 26 Sort 680202, -1/7, -1/3. -1/3, -1/7, 680202 Put 2/15, -2283/7, 6 in ascending order. -2283/7, 2/15, 6 Put 5, -217, -18 in decreasing order. 5, -18, -217 Sort 4, 380, 3, -0.05, 0.003. -0.05, 0.003, 3, 4, 380 Sort -2/13, -77819, -2/23. -77819, -2/13, -2/23 Sort 1, -90, 0, 3, -120. -120, -90, 0, 1, 3 Put -4, 2, 5, -5, 1, -37 in decreasing order. 5, 2, 1, -4, -5, -37 Put 0.3, -5, 6596, 1/9 in ascending order. -5, 1/9, 0.3, 6596 Put -75, 5, -644 in decreasing order. 5, -75, -644 Sort -1, 0, -3, -2, 5, 6140. -3, -2, -1, 0, 5, 6140 Sort 8/11, 1, 7024, 0.1 in descending order. 7024, 1, 8/11, 0.1 Put 1, -111, -18, -2, 2 in increasing order. -111, -18, -2, 1, 2 Put 1, -2, -75, 38, 5 in decreasing order. 38, 5, 1, -2, -75 Sort 5, -626, -4, 4 in decreasing order. 5, 4, -4, -626 Sort 1, 0.42, 1.09, 2 in ascending order. 0.42, 1, 1.09, 2 Sort 3, -1, 101. -1, 3, 101 Sort 3, -1.63, -1/4 in descending order. 3, -1/4, -1.63 Put 5, -2, 357 in decreasing order. 357, 5, -2 Put 2323, -1, 16 in ascending order. -1, 16, 2323 Sort 422, 1, 3 in increasing order. 1, 3, 422 Sort 255, 4, -5	{ "pile_set_name": "DM Mathematics" }
/3 (b) -0.1079 (c) -1 (d) -3 b What is the closest to -2 in -4/13, -11, 4, -4/107, 0.4? -4/13 What is the closest to -0.2 in 4, -6/4667, -0.083? -0.083 What is the closest to -5.74 in 0.4, 0.012, -0.42, -3, -5? -5 What is the nearest to -23 in -66, 0.7, -9.1, 2/3? -9.1 What is the closest to 1/3 in -1/3, 0.2, -3, 16, -2/37? 0.2 Which is the nearest to -4? (a) -311/62 (b) 3/11 (c) -4 (d) -5 c Which is the nearest to -2/163? (a) -3.542 (b) 4 (c) -1 c Which is the nearest to 11? (a) -1 (b) 40 (c) -1/1856 c Which is the closest to 2/9? (a) -0.12 (b) 3/4 (c) 305 (d) -1096 (e) -1/5 a What is the closest to -580 in 1, 0.02, 0.573, 1/8? 0.02 What is the closest to -0.2 in 29/6, -4, 414/13? -4 Which is the nearest to -8? (a) -0.2028 (b) -17 (c) 0.5 a Which is the closest to -1/4? (a) -2592 (b) -3 (c) -460/13 b What is the nearest to -1 in -3/4, 3/2, -2/3, 2/1835, -2? -3/4 What is the nearest to 0.1 in 5, 10.4, 10.485? 5 Which is the closest to -1/3? (a) -1 (b) 16 (c) -4/3 (d) -4 (e) -2/3749 (f) 2/27 e What is the closest to -0.2 in -0.59, 2, 214, -0.32, 3? -0.32 Which is the nearest to 0? (a) -4 (b) 0.1 (c) 0.5 (d) 26 (e) 171 b What is the nearest to -0.0943 in 3, -3, 850, -1/3, -0.3, 0? 0 What is the closest to 37/6 in 10/17, -0.4, -7/3? 10/17 What is the nearest to 0.08 in -83, 0.2, -9, 1, 66? 0.2 Which is the nearest to 2657? (a) 1/3 (b) -5 (c) 2 (d) -0.6 (e) -18 c What is the nearest to -22 in -2/3, 115.6, 3, -0.3, -46, 2/15? -2/3 Which is the closest to 0.1? (a) 1/27 (b) -3/10 (c) 4 (d) -2/11 (e) 2 (f) 1/5 a What is the closest to -18/17 in 0.3, -0.5, 6269, 2/7, -4? -0.5 Which is the closest to 149? (a) -0.4 (b) 3 (c) -1754.4 (d) -0.3 b Which is the closest to 0.3? (a) 34.4 (b) -6.44 (c) 4/3 (d) -4 c What is the closest to 32 in -5, 0.05, 1/2, 760? 1/2 Which is the nearest to 5? (a) -12 (b) 8 (c) 1/3 (d) 2/15 (e) -6/25 b What is the nearest to -2/37 in 0.1, -367, 245? 0.1 What is the closest to 0.1 in 1/1992, -0.5, -2/3, 3/4, -2/7? 1/1992 Which is the nearest to 1? (a) 0.156 (b) -2 (c) -1/6 (d) -0.52 (e) 27/2 a What is the closest to 406 in 1, 529/174, 0.02? 529/174 Which is the closest to 14/3? (a) 4/7 (b) -2 (c) 76 (d) -7/5 (e) -1/2 (f) -1 a What is the nearest to 478 in 0.2, 4, -88/7, -42? 4 What is the closest to 1/11 in -2/7, 0.08, -2/9, 613, -1? 0.08 What is the closest to -0.3 in 0, -25, -2/19, 6, 4? -2/19 What is the nearest to 2/13 in -9547, -0.2, 4/9, 6/13? 4/9 What is the closest to -9/4 in 0.023, -0.15, 0, -0.1? -0.15 What is the nearest to -928/35 in 1, -19, 0.0401? -19 Which is the nearest to -0.22? (a) 458 (b) 22 (c) -0.08 (d) -5 c What is the closest to 1/3 in 0, -18, 3.46, -0.4, 0.2? 0.2 Which is the closest to -1/4? (a) 0.2 (b) -4 (c) 117 a Which is the nearest to -9? (a) 161 (b) -0.4 (c) 0.4 (d) -3/7 (e) -1/2 e What is the nearest to -76/43 in -3/2, -0.42, -4, 0.1, 0.3? -3/2 Which is the closest to -352? (a) 29 (b) -2/3 (c) 168 b What is the closest to 5 in -4.55, -4, 1/5, 4? 4 Which is the closest to 9? (a) -2/5 (b) 2/5 (c) -162/19 b Which is the closest to -0.1? (a) 1.1 (b) 35 (c) -192 (d) -1/4 (e) 1 (f) 0.04 f What is the closest to -0.02 in -14, -2, 0.4, 513, -0.3? -0.3 Which is the nearest to -77484? (a) -0.3 (b) -23 (c) 1/24 b What is the nearest to 1.6 in -2.8, -28, 0.0519? 0.0519 What is the nearest to -2 in -0.32, -5, -11, 10/17, 2/41, -1? -1 Which is the nearest to 0? (a) -703 (b) 18 (c) 0 (d) 2/5 c What is the nearest to 75 in 0.2, 3/2, -4, 72, -1, -0.1? 72 What is the nearest to -652100 in 8, 2/19, 3? 2/19 What is the closest to 447 in -3, -22, -43? -3 Which is the closest to -0.9? (a) -1/9 (b) 1/3 (c) -1551 (d) -3/25 d What is the nearest to 3 in 4/5, -3/2, 29996, -3, -2/3? 4/5 What is the closest to 2.231 in -15, 64, -1? -1 What is the closest to 2/7 in 1, 259/1201, -4, 2/5? 259/1201 What is the nearest to 789 in 1/5, -3, -44, -1? 1/5 What is the closest to -0.17923 in -0.3, -15, 22? -0.3 Which is the closest to 1? (a) 2 (b) -9/8 (c) 67/4 (d) 3/5 (e) -0.2508 d Which is the nearest to 1/3? (a) 2 (b) -1/26 (c) 2/695773 c What is the closest to -1 in 4, -4.72, 150, -17/5, -1? -1 Which is the closest to -2796? (a) 7/5 (b) 12 (c) -0.1 c What is the closest to 1 in 2.39, -4/5, 1612, 0, -4? 0 What is the closest to 568 in -295, 0, 4? 4 What is the closest to -2 in -375482, 23, -4? -4 What is the nearest to 11676 in -0.2, -6, -1, 1, 0.2? 1 Which is the closest to -2/5? (a) 1/28 (b) 0.4 (c) -10/3 (d) -3 (e) 5 a Which is the nearest to -0.1? (a) 0.4 (b) 0.12 (c) -2 (d) 20 (e) 1.09 (f) -5 b Which is the closest to -2/15? (a) -15/7 (b) 0 (c) -72 (d) 105/13 b Which is the closest to 0? (a) -11 (b) 2/9 (c) -1034 b What is the nearest to 307 in 7, -6/7, -2453, -5? 7 Which is the nearest to -0.2? (a) -295183 (b) -1/5 (c) 0.1 (d) -1 b Which is the closest to 62? (a) 5 (b) 0.8 (c) 0 (d) 0.3 (e) -12 a What is the nearest to -0.3 in -0.07, -2/75, 6844? -0.07 Which is the nearest to -144? (a) -2/5 (b) 2.03 (c) 0.09 (d) 0.4 (e) 1 a Which is the closest to -2? (a) -11 (b) 5/6 (c) 6413 (d) 2 (e) 49 (f) -1/7 f What is the closest to -37 in -16, 3, 0.1, 1318? -16 What is the nearest to 15 in -1/5, -6, 2, 0.1, 5/12? 2 What is the nearest to -2/3 in 2/3, 16/15, -2/23, -1/3, -22486? -1/3 What is the nearest to 2 in -51, 89.3, -3.1? -3.1 Which is the closest to -690? (a) -2/7 (b) -212 (c) -0.82 b What is the closest to 1.7 in -1/3, 0.08, -77, -306? 0.08 Which is the closest to 3? (a) 0 (b) 0.4 (c) 12.039 b Which is the closest to -2.6? (a) -4 (b) 5 (c) -0.3 (d) 15623 (e) 0.2 a What is the nearest to -455 in -0.3, 3, 0.042, -34? -34 What is the closest to -800 in 0, 11, 14, -4/25? -4/25 Which is the nearest to 2/59? (a) -4.74 (b) 5 (c) 9 (d) 2/5 d What is the closest to 1.1 in -0.4, -5, 40/137, 0.4, -5/2? 0.4 Which is the nearest to -5/287? (a) -2/9 (b) -2/23 (c) -5 (d) 90 (e) -1.7 (f) 3/4 b Which is the nearest to 2/1433? (a) -2/51 (b) -0.8 (c) -0.14 a Which is the closest to -1? (a) -7 (b) 0 (c) 205.845 (d) -0.4 d What is the nearest to -1 in -5, -488, -4, -5745/7? -4 Which is the closest to 1000? (a) -2/5 (b) 17 (c) -1/4 (d) 8/13 b Which is the nearest to -3? (a) 5/9 (b) -375 (c) 29 (d) 0.1 d What is the closest to 649.28 in -25, -2, 2? 2 What is the closest to 19 in 4/3, -5, 8, 105? 8 Which is the nearest to 0.1? (a) -48135 (b) 22 (c) 0 c What is the nearest to -1 in -0.236, 13491, 0, -0.4? -0.4 Which is the nearest to 1? (a) 1905 (b) 8/33 (c) 0.6 (d) 5 c What is the closest to -333568 in 0, 1, -0.4, 4, 0.3? -0.4 Which is the nearest to 2/9? (a) 386348 (b) -4/7 (c) 2/3 (d) 0.06 (e) 0 d Which is the closest to -1? (a) 17539 (b) -0.0157 (c) 1/8 b What is the closest to 2/9 in 4, 1/5, -201020? 1/5 What is the nearest to 0.1 in -9, -0.04, -570, 1, 5? -0.04 Which is the nearest to -3/37? (a) 0.3 (b) -458 (c) -3 (d) -1 a What is the nearest to 0.27 in 8, -0.1, 26, -2/5, 0.6? 0.6 Which is the nearest to 1? (a) -9 (b) 0.04 (c) 2.9717 b Which is the nearest to 0.04? (a) -345/29 (b) -69 (c) -2 c Which is the closest to -2? (a) 0.025 (b) -252 (c) -0.2 (d) -0.5 (e) -2 (f) -38 e Which is the nearest to 1? (a) 0 (b) 5 (c) -22208 a Which is the nearest to 0.08? (a) 1 (b) -4 (c) 37/5 (d) -0.1 (e) -95 d Which is the closest to -2/3? (a) 0.11 (b) -13/564 (c) 46 b What is the nearest to -0.17 in -31/2, -19.74, 2.2? 2.2 Which is the nearest to 8.3? (a) -0.11 (b) -0.02334 (c) 1 c Which is the closest to -27277350? (a) -3 (b) 0.2 (c) 4 a What is the nearest to -1135/2 in 0.3, 4, 0, 0.03, -0.13? -0.13 What is the nearest to -406 in -10, 2.7, 1/3, -0.5? -10 Which is the nearest to 0.03? (a) 5350/7 (b) -5 (c) 4 (d) 52 c Which is the closest to 2/3? (a) 5 (b) 24 (c) 3 (d) 0 (e) 2 (f) 320 d Which is the closest to 1? (a) -4 (b) 14396/2807 (c) 4 c Which is the closest to -2? (a) -1/4 (b) 201 (c) 0.4 (d) -29/3 (e) 1/3 a What is the closest to -5 in 1087.3, -37, -1/11? -1/11 Which is the nearest to 186? (a) -5/28 (b) 7 (c) 2/9 (d) -3 b What is the nearest to 1374 in -1, 1/5, 1/9, 3/5, 12? 12 What is the closest	{ "pile_set_name": "DM Mathematics" }
340 What is the h'th term of 910, 891, 854, 793, 702, 575, 406, 189? -h*3 - 3h*2 - 3h + 917 What is the j'th term of 202, 611, 1288, 2233, 3446? 134j2 + 7j + 61 What is the a'th term of 9987566, 9987564, 9987562, 9987560? -2a + 9987568 What is the z'th term of -452686, -452695, -452706, -452719? -z2 - 6z - 452679 What is the q'th term of -1149, -1275, -1459, -1701? -29q2 - 39q - 1081 What is the m'th term of -2483, -1979, -1131, 67, 1621, 3537, 5821, 8479? m*3 + 166m*2 - m - 2649 What is the q'th term of -1814094, -1814097, -1814100, -1814103, -1814106, -1814109? -3q - 1814091 What is the h'th term of 1901276, 1901277, 1901278, 1901279? h + 1901275 What is the n'th term of 122292, 122289, 122284, 122277, 122268? -n2 + 122293 What is the b'th term of -4340, -4300, -4250, -4184, -4096, -3980, -3830, -3640? b3 - b*2 + 36b - 4376 What is the c'th term of -7420, -14869, -22308, -29731, -37132, -44505, -51844, -59143? c3 - c2 - 7453c + 33 What is the u'th term of -50088, -100178, -150268, -200358, -250448? -50090u + 2 What is the k'th term of -469140, -1876631, -4222456, -7506621, -11729132, -16889995? -k*3 - 469161k*2 - k + 23 What is the a'th term of 252, 411, 468, 423? -51a*2 + 312a - 9 What is the c'th term of -10601, -10624, -10671, -10748, -10861, -11016? -c*3 - 6c*2 + 2c - 10596 What is the s'th term of -475732, -475733, -475734? -s - 475731 What is the t'th term of 3639, 3644, 3649, 3654? 5t + 3634 What is the o'th term of 31303, 62562, 93821? 31259o + 44 What is the z'th term of 128, 250, 384, 536, 712, 918? z*3 + 115z + 12 What is the n'th term of 1699, 3354, 6113, 9976, 14943, 21014? 552n2 - n + 1148 What is the g'th term of -428423, -1713677, -3855767, -6854693, -10710455, -15423053, -20992487? -428418g*2 - 5 What is the p'th term of 1660, 1661, 1662, 1663, 1664? p + 1659 What is the q'th term of 454, 1758, 3936, 6988, 10914, 15714? 437q*2 - 7q + 24 What is the f'th term of 26520, 26465, 26410, 26355, 26300, 26245? -55f + 26575 What is the i'th term of -43618, -87232, -130846, -174460, -218074? -43614i - 4 What is the y'th term of -8255, -16617, -25087, -33665, -42351? -54y2 - 8200y - 1 What is the v'th term of 341227, 682455, 1023683, 1364911? 341228v - 1 What is the b'th term of 992, 1024, 1072, 1130, 1192? -b3 + 14b*2 - 3b + 982 What is the m'th term of 408, 688, 966, 1248, 1540, 1848, 2178? m*3 - 7m*2 + 294m + 120 What is the t'th term of 3126, 6222, 9316, 12408, 15498? -t*2 + 3099t + 28 What is the d'th term of 46358, 92718, 139078, 185438, 231798? 46360d - 2 What is the w'th term of 175052, 175044, 175024, 174986, 174924, 174832? -w3 - w + 175054 What is the d'th term of -1446184, -1446183, -1446180, -1446175, -1446168, -1446159? d2 - 2d - 1446183 What is the d'th term of -683, -1438, -2193? -755d + 72 What is the d'th term of -13672, -13638, -13604, -13570? 34d - 13706 What is the n'th term of -5559, -5562, -5565, -5568? -3n - 5556 What is the c'th term of 178, -30, -352, -782, -1314, -1942, -2660, -3462? c3 - 63c*2 - 26c + 266 What is the y'th term of -772, -990, -1366, -1978, -2904, -4222, -6010? -13y3 - y2 - 124y - 634 What is the s'th term of 235, 286, 385, 544, 775, 1090, 1501? 2s3 + 12s*2 + s + 220 What is the u'th term of -6051, -12152, -18253, -24354? -6101u + 50 What is the k'th term of 993, 4676, 10815, 19410, 30461, 43968, 59931? 1228k2 - k - 234 What is the x'th term of 198, 491, 872, 1347, 1922, 2603, 3396? x3 + 38x*2 + 172x - 13 What is the m'th term of -4348, -17337, -38982, -69283, -108240? -4328m2 - 5m - 15 What is the g'th term of 777, 1435, 2093, 2751, 3409, 4067? 658g + 119 What is the g'th term of 429, 846, 1277, 1728, 2205, 2714, 3261? g3 + g2 + 407g + 20 What is the v'th term of -2863, -4014, -5933, -8620, -12075, -16298? -384v2 + v - 2480 What is the r'th term of -392, -1824, -4214, -7562, -11868, -17132? -479r*2 + 5r + 82 What is the a'th term of 8824, 8800, 8744, 8644, 8488, 8264, 7960? -2a3 - 4a*2 + 2a + 8828 What is the u'th term of -12, 18, 58, 114, 192? u3 - u2 + 26u - 38 What is the n'th term of -1162, -1139, -1100, -1045, -974? 8n*2 - n - 1169 What is the t'th term of 62, 316, 990, 2294, 4438, 7632, 12086, 18010? 35t*3 + 9t + 18 What is the l'th term of -2035, -3868, -5691, -7498, -9283, -11040, -12763? l3 - l2 - 1837l - 198 What is the h'th term of -1669, -3272, -4875, -6478, -8081? -1603h - 66 What is the u'th term of 2042, 4012, 5982, 7952, 9922? 1970u + 72 What is the f'th term of -34, -167, -386, -691, -1082, -1559, -2122? -43f*2 - 4f + 13 What is the c'th term of 8571, 17120, 25653, 34164, 42647, 51096, 59505, 67868? -c*3 - 2c*2 + 8562c + 12 What is the m'th term of -64, -142, -236, -346? -8m2 - 54m - 2 What is the v'th term of -1691, -1962, -2233? -271v - 1420 What is the x'th term of 3478, 13818, 31052, 55180, 86202, 124118? 3447x*2 - x + 32 What is the y'th term of 20, -15, -72, -151? -11y*2 - 2y + 33 What is the s'th term of -884, -1008, -1118, -1208, -1272, -1304? s3 + s2 - 134s - 752 What is the j'th term of -486, -484, -502, -540, -598, -676? -10j*2 + 32j - 508 What is the t'th term of 214, 767, 1694, 3001, 4694? t*3 + 181t*2 + 3t + 29 What is the d'th term of 40864, 81722, 122578, 163432, 204284? -d*2 + 40861d + 4 What is the o'th term of 473, 429, 361, 269, 153, 13, -151? -12o2 - 8o + 493 What is the t'th term of -219, -109, 75, 333, 665, 1071? 37t2 - t - 255 What is the g'th term of -1842, -7401, -16668, -29643, -46326, -66717, -90816? -1854g*2 + 3g + 9 What is the d'th term of -310, -654, -990, -1324, -1662, -2010? -d*3 + 10d*2 - 367d + 48 What is the a'th term of 106, 430, 966, 1708, 2650, 3786, 5110, 6616? -a*3 + 112a*2 - 5a What is the l'th term of -16139, -32307, -48473, -64637, -80799, -96959, -113117? l*2 - 16171l + 31 What is the n'th term of 127, 173, 235, 301, 359, 397, 403, 365? -2n3 + 20n*2 + 109 What is the f'th term of 1634, 4146, 6658, 9170, 11682? 2512f - 878 What is the x'th term of 850, 3345, 7486, 13273, 20706, 29785, 40510? 823x2 + 26x + 1 What is the b'th term of 52, -152, -702, -1772, -3536? -29b3 + b2 - 4b + 84 What is the m'th term of -21, 91, 353, 771, 1351, 2099, 3021, 4123? m*3 + 69m*2 - 102m + 11 What is the o'th term of -8981, -18025, -27075, -36131, -45193? -3o2 - 9035o + 57 What is the x'th term of -8185, -16371, -24557, -32743, -40929, -49115? -8186x + 1 What is the g'th term of -465, -944, -1427, -1914, -2405? -2g*2 - 473g + 10 What is the t'th term of 201, 1054, 3371, 7884, 15325? 122t3 - t + 80 What is the l'th term of 83, 55, 17, -25, -65? l3 - 11l*2 - 2l + 95 What is the a'th term of -3114, -3543, -3972, -4401, -4830, -5259? -429a - 2685 What is the s'th term of 25553, 25695, 25933, 26267, 26697, 27223, 27845? 48s*2 - 2s + 25507 What is the v'th term of -3486, -3549, -3612, -3669, -3714, -3741, -3744, -3717? v*3 - 6v*2 - 52v - 3429 What is the g'th term of 1409, 906, 69, -1102, -2607, -4446, -6619? -167g2 - 2g + 1578 What is the z'th term of 11824, 23628, 35432, 47236, 59040, 70844? 11804z + 20 What is the p'th term of 113, 904, 3077, 7322, 14329, 24788? 115p3 + p2 - 17p + 14 What is the w'th term of 1062, 2122, 3252, 4488, 5866, 7422, 9192, 11212? 6w3 - w2 + 1021w + 36 What is the k'th term of -5412, -5377, -5342, -5307, -5272? 35k - 5447 What is the d'th term of -286, -246, -222, -214, -222? -8d2 + 64d - 342 What is the p'th term of 193, 185, 187, 199, 221, 253? 5p2 - 23p + 211 What is the h'th term of 2073, 1979, 1907, 1869, 1877, 1943, 2079, 2297? 2h3 - h2 - 105h + 2177 What is the h'th term of -684, -1432, -2248, -3132, -4084, -5104, -6192? -34h2 - 646h - 4 What is the r'th term of -11701, -11667, -11605, -11509, -11373, -11191, -10957, -10665? r*3 + 8r*2 + 3r - 11713 What is the k'th term of 2123, 2103, 2073, 2033, 1983, 1923, 1853? -5k2 - 5k + 2133 What is the b'th term of -16047, -64163, -144349, -256599, -400907, -577267, -785673? b*3 - 16041b*2 - 7 What is the b'th term of -358, -670, -928, -1132? 27b*2 - 393b + 8 What is the l'th term of 58, 244,	{ "pile_set_name": "DM Mathematics" }
f3 - 136f*2 - 3. Let c(u) = -d(u) + 3t(u). Find the third derivative of c(k) wrt k. -1266 Let w = -1246 + 1246. Let x(v) be the second derivative of wv5 - 3v + 0v2 + 0 + 0v*4 + 7/30v*6 - 5/3v*3. Find the second derivative of x(s) wrt s. 84s*2 Suppose 4r = -2r + 18. Suppose 2n = ry - 9, 0n - 5y = 2n - 31. What is the third derivative of -4q2 + 2q*3 - 4q*n + 6q*5 + 2q*3 wrt q? 360q*2 Let t(u) be the first derivative of 8u5/5 + u2/2 - 43u - 305. What is the derivative of t(p) wrt p? 32p*3 + 1 Suppose 2q - q = -15. Let s = -11 - q. Find the second derivative of -2y + 2y*4 + 4y*s + 0y wrt y. 72y2 Let a(i) = -i3 + 7i*2 - 2i + 9. Let y be a(6). Suppose 4h - y = 39. Find the second derivative of -20b*2 + 4b + hb2 - b wrt b. -4 Find the second derivative of 0m - 3m3 - 9m*2 - 5 - 4 - 3m - 10 - 2m2 wrt m. -18m - 22 Let s be -2 + (5 + -1 - -1). What is the third derivative of 249ns + 50n*2 - 125n*3 - 124n*3 - 10n*4 wrt n? -240n Let r(k) = 2k3 + 85k. Let m(n) = 4n3 + 169n - 1. Let w(q) = -3m(q) + 5r(q). What is the second derivative of w(z) wrt z? -12z Let k(t) be the second derivative of t8/1680 + t7/420 + 7t*4/12 + 10t. Let f(y) be the third derivative of k(y). Find the third derivative of f(m) wrt m. 24 Let t(v) = -4 + 2 + 7v2 + 1 + 2v. Let y(g) = 22g2 + 7g - 2. Let x(w) = 14t(w) - 4y(w). Differentiate x(n) with respect to n. 20n Let u(x) = -2x*2 - 8x + 42. Let w(r) = -r*2 - 9r + 42. Let q(y) = 6u(y) - 5w(y). What is the first derivative of q(t) wrt t? -14t - 3 Let v(y) = -546y*2 + 11y + 35. Let g(i) = -548i2 + 11i + 43. Let j(d) = -2g(d) + 3v(d). What is the second derivative of j(s) wrt s? -1084 Let p(x) be the first derivative of -17x8/1680 + x5/10 - x3 - 44. Let z(i) be the third derivative of p(i). What is the second derivative of z(b) wrt b? -204b*2 Let m(d) = -15d*3 - 66d*2 + 208. Let r(k) = -3k*3 - 13k*2 + 42. Let n(h) = 2m(h) - 11r(h). Differentiate n(f) wrt f. 9f*2 + 22f What is the third derivative of -2a5 + 8a*2 + 81a*4 + 4a*5 + 114a*4 - 106a*2 wrt a? 120a*2 + 4680a Let v(j) = 2j - 4. Let a be v(3). Differentiate -5y*3 - 5 + 10y*3 - ay*3 wrt y. 9y*2 Find the first derivative of -11k - 15k + 38k - 29 - 13k wrt k. -1 Suppose -17o + 5o = -120. What is the second derivative of -33z*2 + oz - 35z + 3z*2 wrt z? -60 Let x = -16 - -28. What is the derivative of 30 + x - 18w*4 + 54w*4 wrt w? 144w*3 Find the third derivative of 13b - 6b3 - 10b*3 + 3b - b*2 + 35b wrt b. -96 Let k(q) be the second derivative of 7/6q3 + 0 + 0q*5 + 0q*2 + 0q*4 + 1/3q*6 + 16q. What is the second derivative of k(z) wrt z? 120z2 Let j(z) be the second derivative of -z3/6 - 2z. Let o be j(-1). Differentiate 16 + o - 6 - 8 - 9u4 with respect to u. -36u*3 Let l(f) be the third derivative of -619f8/336 + f5/6 - f*4/8 + 325f*2. What is the third derivative of l(d) wrt d? -37140d*2 Suppose i + 0i = 1. Let g be -1 + i/1 + 3. Find the second derivative of 6p - 4p*2 - 2p + gp - p wrt p. -8 Let o = 65 + -147. Let l = o + 129. What is the second derivative of 6p*4 + p + l - 47 wrt p? 72p*2 Let g(d) be the first derivative of -97d*4/4 - 3d*2/2 - 23d - 70. Find the second derivative of g(x) wrt x. -582x Let b(h) be the second derivative of 0h*5 + 0h*4 + 13/30h*6 - 13/6h*3 + 0 + 9h + 0h2. Find the second derivative of b(q) wrt q. 156q*2 Find the third derivative of -869v + 610v2 + 104v3 - v5 + 869v wrt v. -60v*2 + 624 What is the second derivative of -225c*2 - 147c*2 + 44c*2 + 71c*2 + 113c wrt c? -514 Let p(x) = -31x3 + 7x*2 + 7x + 151. Let l(y) = -16y3 + 4y*2 + 4y + 77. Let t(h) = 7l(h) - 4p(h). What is the first derivative of t(k) wrt k? 36k2 Suppose 3q - 3l - 15 = 0, 0l + 4 = -2l. Suppose -qn - 4 = -10. Find the third derivative of 0yn + 5y2 + y6 + 5y6 wrt y. 720y*3 Let d(f) be the second derivative of 61f*6/30 + 71f*2/2 + 37f - 2. Find the first derivative of d(v) wrt v. 244v3 Let t(p) = -8p*3 - 11p - 28. Let v(r) = -4r3 - 6r - 14. Let b be 21/49 + 78/14. Let o(x) = bt(x) - 11v(x). What is the first derivative of o(u) wrt u? -12u2 Let n(h) = -5h + 3. Let g(w) = -35w + 20. Suppose 9 = 5u - 31. Let f = u + -6. Let c(r) = fg(r) - 15n(r). What is the derivative of c(q) wrt q? 5 Let b(c) be the third derivative of 31c2 + 0c - 4/15c5 + 0 + 0c*4 - 29/6c*3. Differentiate b(q) wrt q. -32q Let b(j) be the third derivative of -7j6/360 - 5j*4/12 - 2j3/3 - j2. Let g(l) be the first derivative of b(l). What is the derivative of g(y) wrt y? -14y Let y(l) be the second derivative of 1/5l*5 - 1/6l*4 + 0 - 17l + 0l3 + 0l*2. Find the third derivative of y(o) wrt o. 24 What is the first derivative of -44f + 173 - 91 + 82 wrt f? -44 Let u = -626 + 629. Let r(v) be the second derivative of -1/2v5 + 1/3v*3 - uv + 0v2 + 0 + 0v*4. Find the second derivative of r(f) wrt f. -60f Let t = -62 - -89. What is the second derivative of -8p2 + tp - 5p + 3p*2 wrt p? -10 Let z(a) be the second derivative of 0a*2 + 0a*5 - 1/4a*4 + 0a*3 + 0 + 17/30a*6 - 9a. What is the third derivative of z(k) wrt k? 408k Let i(m) be the first derivative of -5m3/3 + m2 - 14m - 162. Differentiate i(z) wrt z. -10z + 2 What is the first derivative of -23s - 392 + 177s - 497 + 663 wrt s? 154 Let s(p) be the third derivative of 0p6 + 0p + 0p5 - 1/21p*7 + 0 + 5p*2 + 0p*4 - 7/6p*3. What is the derivative of s(t) wrt t? -40t*3 Differentiate -124m*2 + 240 + 217 - 798 + 239 with respect to m. -248m Let m(w) = w*2 + 11w. Let n be m(-11). Find the third derivative of 7y2 + 10y*5 + 0y*3 + ny*3 + 0y*3 wrt y. 600y*2 Suppose 20 = -5t, -2i + 3t = -0i - 22. Find the third derivative of 15z*2 + 45z + 2z2 - 45z + 40zi wrt z. 2400z*2 Let r = -8 - -11. Suppose 36 = 10q - q. What is the first derivative of 0c4 + 3c*4 - 2c*4 + rc*q + 3 wrt c? 16c*3 What is the third derivative of -3842 + 45d*2 + 149d*3 + 73d*2 + 3842 wrt d? 894 Differentiate 0j + 23688j2 - 23718j*2 + 265 + 0j wrt j. -60j What is the third derivative of -223u*2 - 1871u*3 + 48 + 222u*2 + 1298u3 wrt u? -3438 Let l = -488 - -490. Let j(d) = -d2 + d + 2. Let m be j(0). Find the third derivative of 7z5 + 4z*l - 4z*5 - 7z*2 - 8z*m wrt z. 180z*2 Suppose 290 = -7p + 1760. What is the second derivative of 9x3 + 11x - 210x2 - 4x + px2 wrt x? 54x Let h = 55 + -52. Find the second derivative of -2r2 - 32r*3 + 2r*2 + 4r*h + 21r wrt r. -168r Let c(a) be the first derivative of -a6/2 - 8a*5/5 - 27a*2 + 1. Find the second derivative of c(u) wrt u. -60u*3 - 96u*2 What is the first derivative of 0h - 37h2 - 10h2 + h2 - 3h + 2h + 277 wrt h? -92h - 1 Let b(y) = 2y + 18. Let s be b(-7). Find the first derivative of 7 - 8x4 - 4x + sx - 2 wrt x. -32x*3 Let i(h) be the third derivative of 251h9/504 + h5/60 + 152h3/3 + 502h*2. Find the third derivative of i(f) wrt f. 30120f3 Let x(y) be the third derivative of y6/60 - 12y5/5 + y4/24 + 47y*3/6 + 170y*2. What is the second derivative of x(g) wrt g? 12g - 288 Let i(q) be the third derivative of 17/24q4 + 0 - 10q*2 + 0q + 1/2q3. Differentiate i(j) with respect to j. 17 Let a(v) be the first derivative of 0v*3 - 3v*2 + 5 - 2/5v5 - v4 + 0v. What is the second derivative of a(n) wrt n? -24n*2 - 24n Suppose -6z + 10 = -8. Find the second derivative of 10o + o - 3o + o + 18o*z wrt o. 108o Find the third derivative of -16y5 - y6 - 154y*2 - 58y + 58y + 0y*6 + 0y*6 wrt y. -120y*3 - 960y*2 Let m = 713 + -3563/5. Let j(i) be the first derivative of -5 + 0i + 1/2i2 + 0i*4 + 0i*3 + mi*5. What is the second derivative of j(k) wrt k? 24k*2 Suppose 5 = -5i - 5x, -5x = -2i + 5i + 11. Find the first derivative of 23j3 + 41 - 18j*i - 15j*3 wrt j. -30j*2 Let h(y) = -36y + 8. Let b be (-27)/(-4) + (-3)/4. Let l(m) = -2*	{ "pile_set_name": "DM Mathematics" }
z - i = 4j, 3j = -4z + z - 6 for j. -2 Let q(a) = a3 + 15a*2 + 10a - 16. Let d be q(-14). Let n = 42 - d. Solve 11 = 3p - h, -10 - 9 = -np + 3h for p. 2 Suppose 0 = -5m + 432 - 417. Solve h = 3c + 7, 2c + 2h - mh = -6 for c. -1 Let u be (-180)/(-54)12/5. Suppose -3y = h - 14 - 3, 3y + u = 4h. Solve -hd = -x - 4, x + 2d = 4 - 1 for x. 1 Let i = -75 - -77. Solve 0 = -ic + j - 4, -j + 1 = -4c - 9 for c. -3 Let r(o) = -o*3 + 14o*2 - 12o - 8. Let t be r(13). Suppose -t = -3x + 4. Solve 0 = -4k + xn - 5, 4n + 9 = -11 for k. -5 Let g(l) = l*2 - 2. Let b be g(2). Suppose -n + 0a = 2a - 20, -32 = -2n + 4a. Suppose -4m - bm = -n. Solve -2y + 3y = -v, mv = -4y - 5 for v. 5 Let w be (12/18-4)/(2/(-6)). Solve 10 = -2b - q + 2, -w = 4q for b. -3 Let w(h) = h - 3. Suppose 5y + 4k - 28 = 0, 13 = 2y + k - 0k. Let j be w(y). Solve 4q = -jg - 22, -3g = -4q - 6 - 0 for g. -2 Let w = 54 - 54. Solve -5u - 15 = 0, -4a + 2u + w = 2 for a. -2 Let u = 3 - -17. Suppose t = 5t - u. Solve 2n - 4v - 12 = 0, -2n - tv + 5 = -2v for n. 4 Suppose -24 = -2n - 0n. Let h be (-20)/(-3) - 1 - 8/n. Solve 0 = -0k + 2k - 3r - 2, k - hr = 15 for k. -5 Let c be 1 + -4 + (4 - -3). Let a(p) = p - 2. Let q be a(c). Let n be 8 - q - (-2 - -4). Solve 4l = -4y - n, -1 = y - l - l for y. -1 Let l = 24 + -21. Suppose 2 = lr - 7. Suppose 2b = 5b + y - 4, 0 = 2y + 10. Solve -4h = -bd + 1, 6 = -2d - rd - h for d. -1 Let m = -41 - -41. Suppose -4u - 4 = m, -n - 4u = -5 + 1. Solve 0 = 4s - 4t + nt - 32, -3s - 5t + 32 = 0 for s. 4 Suppose 4q + 5n - 33 = 2n, n = 2q - 29. Let j be ((-2)/3)/(8/q). Let v be j - (-3 - (3 - 3)). Solve 4p = -20, -2w - vp = -5p - 9 for w. -3 Let v = 9 + 10. Solve 4z = -2h - 22, -4z + 3h = 4h + v for z. -4 Let s be 25/((-35)/(-7)) - 2. Solve -sk - 5 = x, 2k + 3x = 5k - 15 for k. 0 Let g = 9 + -5. Let s be (4 - 1)((-140)/(-21) - 6). Suppose z - 18 = n, -gn = -sz - 0z + 42. Solve -3k + 5 = 2t - 0, 0 = k + 4t + z for k. 5 Suppose -3x + 9 + 14 = -5a, -3a - 27 = -3x. Let k be ((-30)/75)/((-1)/(-5)). Let n = 1 - k. Solve 0t = nt - 4q - x, 5q + 10 = 0 for t. 1 Suppose 0o - 4o = 2p + 12, 5p = -4o. Solve d + 5c = 11, 5d + pc - 2c = -14 for d. -4 Let v = 77 + -69. Suppose -vs + 4s + 4k = -32, -k = 5s - 10. Solve -14 = sx - l - 3l, -3x - 3l = 0 for x. -2 Let r(n) = -n - 7 - 3 + 3. Let j = 26 - 33. Let m be r(j). Solve -d + m - 4 = 0, 5t + 3d = 13 for t. 5 Let g(s) = -3s*2 + 17s + 3. Let i be g(7). Let f = 30 + i. Let z be 3(-1 + 34/6). Solve 0 = 4x - 2n - z, 0n = 5x + fn - 40 for x. 5 Let p(b) = b*3 + 14b*2 + 19b + 26. Let d be p(-13). Let t = 55 + d. Solve 0 = ty - 4y - 3w, -8 = y - 5w for y. -3 Let f(v) = v*3 - 8v*2 - 4v + 9. Let k be f(8). Let z = 25 + k. Let l = -7 + 11. Solve -17 = -3y - ln, z - 9 = y - 5n for y. 3 Let c(d) = -d2 - d. Let i be c(-1). Suppose -6z + 2z + 40 = i. Suppose 0 = -2b + z. Solve -bf + 18 = 4t - 3, -5t = f - 21 for t. 4 Suppose 0 = 5s + 2s - 42. Let p be 2 + s1/3. Solve c - 8 = -3j, -4j = -j + 2c - p for j. 4 Let h = -41 + 77. Suppose 2m = 11m - h. Solve -n - 4t = 3n - 24, -11 = -3n + mt for n. 5 Let g be (-6)/(-2)(-323)/(-57) + -3. Solve -4d - 2 = 4w - g, 2d = -5w + 9 for w. 1 Let p be 1080/165 + 18/(-33). Solve 10 = -3l + 4r, -5r + 15 = l - pl for l. -2 Suppose 0 = 4a - 4z - 84 + 36, -5z - 6 = a. Solve a = 3s + 2v - 5, 3s + 5v = 17 for s. 4 Let h = -473 + 473. Solve -5n = 3x - hx - 20, -17 = -4x + 3n for x. 5 Suppose 3q - 2o = 92, 0 = o - 5o + 8. Suppose -2z + q = 3a, 5a + 48 = -3z + 5z. Solve i + 0i = d + 3, -5i = -d - z for i. 4 Let n be (-8)/35/(100/(-30)). Solve -c = 3i - n - 3, c = 5i - 9 for c. 1 Suppose -5s = -63 - 7. Let y = s + 16. Suppose -l + a = -2, -3l - 4a = 2l - 37. Solve y = -lk - 5o, 0k + 3o = k - 10 for k. -2 Suppose 0 = d - 5h + 17, -d - 3d = h - 16. Solve 2b + dg - 2g = -1, b - 27 = 5g for b. 2 Suppose 4h = 5h - 5. Let n be (-2)/(-5) - (-64)/40. Solve 3w = 5w + 5b - 23, -26 = -hw - nb for w. 4 Suppose 6m = 206 - 176. Solve -4c + 20 = 4y, 0 = 5c - 8c + my - 1 for c. 3 Let d(x) = 7x - 28. Let m be d(4). Let i(g) = -g2 - 3g + 3. Let y be i(-3). Suppose -12 = -yp - p. Solve 5w - j - 9 = m, 5w - pj = -0 + 7 for w. 2 Suppose -23o = -22o - 2. Suppose 0 = -oz, -3i - i = -4z - 8. Solve -h - 5v = -ih, -h + 3v + 2 = 0 for h. 5 Let w = 293 + -293. Solve 4b = -2n + 3n - 3, w = 3b + 4n + 7 for b. -1 Suppose 2u - 13 = 4z - 1, -4u + 15 = z. Let p = 23 + -19. Solve 0n + n - 4o + 1 = 0, pn - 5o = -u for n. -1 Suppose z = -z + 2. Let a be z(-74)/(-4). Solve -5r = -o, o + 2r + a = -0r for o. -5 Let j(b) = 2b - 5. Let c be j(3). Let s = c + 6. Solve w - 2g + 3 = 0, 0 = -3w - 2g + s - 0 for w. 1 Suppose -2h + 0h = 0. Let y(i) = -i2 + i - 1. Let a be y(h). Let s be (-3)/(-6)0/a. Solve s = -4v - w + 15, 2w - 12 = -v - w for v. 3 Let x = -26 + 44. Solve -3t - 3 = -3f, 2f = -0t - 2t - x for f. -4 Let d(p) = -p2 + 15p - 42. Let c be d(4). Solve -5v = -ci - 2v - 2, 5i - v = 21 for i. 5 Suppose 3y + y = 12. Let u be 4/(-2) - (2 + y). Let p = u + 19. Solve 3m + 5r = -p + 2, -15 = -4m - r for m. 5 Let x be 80/12(-3)/2. Let w = x + 10. Solve i - 12 = 4n, w = -2n - n - 6 for i. 4 Suppose 5 = 5c, -2 = n - 2c + 4. Let k be (n/(-6)-1)/(190/(-285)). Let o be 1 - (-7 + 1 + 2). Solve ot - 2 = 4p - k, -3t = 5p - 8 for p. 1 Suppose 6t - 3t = y - 11, -3t = -2y + 16. Solve 3u = 12, -5w - yu + 13 = -22 for w. 3 Suppose 0v = -2v + 40. Let i be v/1(6 + -5). Let b(z) = 7z + 1. Let k be b(2). Solve p - j = 6p - k, 0 = -4j - i for p. 4 Suppose 5 = 13x - 8x + 3j, -2j = 2x + 2. Let c be 3/(-9) - 1/(-3). Solve ci + xi = -2s + 10, -2s = 2 for i. 3 Let g be ((-16)/(-10))/(2/5). Suppose -4c + g = 0, -y - 3c = 4y - 3. Let w = y - -3. Solve w = 5u - 5r - 12, 2u - 4r = 16 for u. -2 Suppose -26t = -27t - 15. Let d be (-4)/10 + (-66)/t. Solve 0 = 2k + 3k + 4g + 10, -dk + 5g - 8 = 0 for k. -2 Suppose 0 = -3c - 2 - 7. Let f = c - -6. Let b = -12 - -15. Solve -10 = -x - bk, 5x + k - 25 + f = 0 for x. 4 Suppose 0 = 3s - 4 - 2. Suppose -3j + 4p = p, 2p - 12 = -2p. Solve 2 = z - sz, 0 = -jk + 4z + 8 for k. 0 Suppose 2d = -r - 2d + 18, 33 = -4r + 5d. Let w be ((-21)/7)/(r/2). Solve p - 9 - 1 = -ws, -3s = 2p - 8 for s. 4 Let o be -1 + 63/49 - 52/(-14). Let j(h) = h*2 - 3h - 1. Let v be j(4). Solve 2a - 18 = -0a - oi, 5a = vi + 6 for a. 3 Let a = 28 + -26. Suppose -at = 3t. Suppose 0j + 3j - 15 = t. Solve jp - 4i = -32, -21 = 3p - 5i + 2i for p. -4 Suppose 5k + 5l - 9l - 28 = 0, 0 = 5l + 10. Solve 4c + 10 = -2x, 2x + 2 = -0x + kc for x. -3 Suppose 0 = -7t + 6t - 6. Let u be (-5 - -26) + 2 + t. Suppose 0s - 4s = -20. Solve u = -sj - 8, -2j = 3f + 13 for f. -1 Suppose -9a - 23a + 32 = 0. Solve 2b = 4l + 14, 0 = b - a for l. -3 Let u(v) = v*3 + 28v*2 + 26v - 12. Let y be u(-27). Solve -5f = -3o + 28, 7o - 2o = 2f + y for o. 1 Let v be 4/(-18) - (-25)/(-9). Suppose -z + 9 = 5. Let s be (5 + -8)z/v. Solve p + so = 16, -2p + 5o - 20 = -3p for p. 0 Let x(r) = 6r + 1. Let q be x(-6). Let l = 55 + q. Suppose k + k = l. Solve -y - 2a - 11 = 0, -2a = 2y - a + k for y. -3 Let n = -12 - -21. Let x be (-39)/(-6) + n/(-6). Solve -2s = -j + 4, 0 = 2j + 3s + x + 1 for j. 0 Let h be 1/(-2 - -3) + 104 - 1. Let u = h - 100. Solve un + 24 = 5v - v, -5v = -4n - 28 for v. 4 Let j(t) = t3 + 13t*2 + 11t - 9. Let f be j(-12). Suppose 0 = -2q + 7q. Suppose 18 = 2h - 0h. Solve q = -4d + 3d, fb = -2d + h for b. 3 Suppose -3p + 119 = p + 3l, -2l = 5p - 154. Let z = 35 - p. Solve 4s + 2q = 0, zs + 5q - 7 + 0 = 0 for s. -1 Suppose 0 = -9x + 6x + 3a + 6, -4a = 3x - 27. Solve -xm + 10 = 5v, m = -v - v + 2 for m. 2 Suppose -4r = -1 - 7. Let z(o) = 3o - 7. Let a be z(3). Suppose -d + 4m = -0 + 5, ad = -4m + 26. Solve p = 1, 4p - 1 - d = -rg for g. 2 Suppose 0 = 4v + 4z, -4v + 2z = -1 - 23. Solve -3g + 2g + vj + 7 = 0, 4g + 5j = -14 for g. -1 Let u(g) = g3 - 4g*2 - 37g	{ "pile_set_name": "DM Mathematics" }
divided by 17? 14 What is the remainder when 127 is divided by 10? 7 What is the remainder when 423 is divided by 5? 3 Calculate the remainder when 6924 is divided by 231. 225 What is the remainder when 75 is divided by 26? 23 Calculate the remainder when 40 is divided by 9. 4 Calculate the remainder when 149 is divided by 19. 16 What is the remainder when 896 is divided by 35? 21 What is the remainder when 234 is divided by 28? 10 Calculate the remainder when 364 is divided by 6. 4 What is the remainder when 207 is divided by 76? 55 Calculate the remainder when 548 is divided by 61. 60 Calculate the remainder when 828 is divided by 16. 12 What is the remainder when 999 is divided by 259? 222 Calculate the remainder when 414 is divided by 10. 4 What is the remainder when 483 is divided by 70? 63 What is the remainder when 43 is divided by 25? 18 Calculate the remainder when 449 is divided by 212. 25 What is the remainder when 1738 is divided by 24? 10 What is the remainder when 10757 is divided by 20? 17 What is the remainder when 1095 is divided by 227? 187 Calculate the remainder when 2234 is divided by 172. 170 What is the remainder when 159 is divided by 40? 39 What is the remainder when 13 is divided by 3? 1 Calculate the remainder when 639 is divided by 19. 12 Calculate the remainder when 239 is divided by 68. 35 Calculate the remainder when 743 is divided by 369. 5 Calculate the remainder when 649 is divided by 47. 38 What is the remainder when 763 is divided by 24? 19 What is the remainder when 5170 is divided by 2? 0 What is the remainder when 77 is divided by 13? 12 Calculate the remainder when 170 is divided by 139. 31 What is the remainder when 24114 is divided by 91? 90 What is the remainder when 84 is divided by 32? 20 Calculate the remainder when 802 is divided by 97. 26 What is the remainder when 1225 is divided by 28? 21 What is the remainder when 299 is divided by 122? 55 Calculate the remainder when 2840 is divided by 2816. 24 What is the remainder when 262 is divided by 66? 64 What is the remainder when 36 is divided by 19? 17 What is the remainder when 1914 is divided by 30? 24 What is the remainder when 2227 is divided by 279? 274 Calculate the remainder when 470 is divided by 21. 8 What is the remainder when 4401 is divided by 152? 145 Calculate the remainder when 3005 is divided by 17. 13 Calculate the remainder when 194 is divided by 51. 41 What is the remainder when 1454 is divided by 13? 11 What is the remainder when 5301 is divided by 24? 21 Calculate the remainder when 789 is divided by 72. 69 Calculate the remainder when 274 is divided by 54. 4 Calculate the remainder when 64 is divided by 13. 12 What is the remainder when 401 is divided by 61? 35 Calculate the remainder when 370 is divided by 24. 10 What is the remainder when 5564 is divided by 16? 12 Calculate the remainder when 166 is divided by 17. 13 What is the remainder when 8258 is divided by 3? 2 What is the remainder when 191 is divided by 28? 23 What is the remainder when 194 is divided by 12? 2 Calculate the remainder when 633 is divided by 6. 3 What is the remainder when 258 is divided by 71? 45 Calculate the remainder when 2896 is divided by 956. 28 Calculate the remainder when 407 is divided by 12. 11 What is the remainder when 655 is divided by 41? 40 Calculate the remainder when 1703 is divided by 12. 11 What is the remainder when 68 is divided by 25? 18 What is the remainder when 238 is divided by 15? 13 What is the remainder when 286 is divided by 99? 88 What is the remainder when 1021 is divided by 95? 71 Calculate the remainder when 1187 is divided by 41. 39 Calculate the remainder when 276 is divided by 75. 51 Calculate the remainder when 204 is divided by 41. 40 Calculate the remainder when 569 is divided by 539. 30 Calculate the remainder when 170 is divided by 39. 14 Calculate the remainder when 262 is divided by 75. 37 Calculate the remainder when 336 is divided by 68. 64 What is the remainder when 17 is divided by 9? 8 What is the remainder when 137 is divided by 44? 5 Calculate the remainder when 543 is divided by 88. 15 Calculate the remainder when 5225 is divided by 17. 6 What is the remainder when 20 is divided by 18? 2 What is the remainder when 630 is divided by 29? 21 What is the remainder when 558 is divided by 51? 48 Calculate the remainder when 232 is divided by 73. 13 What is the remainder when 1781 is divided by 876? 29 What is the remainder when 31 is divided by 8? 7 Calculate the remainder when 116 is divided by 11. 6 Calculate the remainder when 1183 is divided by 99. 94 Calculate the remainder when 1231 is divided by 113. 101 Calculate the remainder when 2232 is divided by 1112. 8 Calculate the remainder when 712 is divided by 51. 49 Calculate the remainder when 100 is divided by 28. 16 What is the remainder when 62 is divided by 34? 28 Calculate the remainder when 2289 is divided by 54. 21 Calculate the remainder when 844 is divided by 18. 16 Calculate the remainder when 61 is divided by 10. 1 What is the remainder when 8855 is divided by 277? 268 What is the remainder when 13499 is divided by 314? 311 What is the remainder when 86 is divided by 40? 6 Calculate the remainder when 831 is divided by 64. 63 Calculate the remainder when 141 is divided by 44. 9 What is the remainder when 219 is divided by 32? 27 What is the remainder when 102 is divided by 96? 6 Calculate the remainder when 5474 is divided by 1367. 6 What is the remainder when 400 is divided by 48? 16 Calculate the remainder when 146 is divided by 136. 10 What is the remainder when 852 is divided by 133? 54 What is the remainder when 2075 is divided by 1002? 71 What is the remainder when 9277 is divided by 58? 55 What is the remainder when 404 is divided by 7? 5 What is the remainder when 1998 is divided by 26? 22 What is the remainder when 116 is divided by 30? 26 What is the remainder when 120 is divided by 90? 30 Calculate the remainder when 187 is divided by 24. 19 What is the remainder when 741 is divided by 245? 6 Calculate the remainder when 2713 is divided by 14. 11 What is the remainder when 581 is divided by 39? 35 What is the remainder when 1652 is divided by 315? 77 What is the remainder when 418 is divided by 21? 19 Calculate the remainder when 236 is divided by 28. 12 Calculate the remainder when 1720 is divided by 220. 180 What is the remainder when 1149 is divided by 282? 21 Calculate the remainder when 3000 is divided by 16. 8 What is the remainder when 76 is divided by 20? 16 Calculate the remainder when 196 is divided by 67. 62 What is the remainder when 175 is divided by 14? 7 Calculate the remainder when 1835 is divided by 36. 35 Calculate the remainder when 60 is divided by 57. 3 What is the remainder when 229 is divided by 21? 19 Calculate the remainder when 81 is divided by 31. 19 What is the remainder when 142 is divided by 137? 5 Calculate the remainder when 215 is divided by 45. 35 What is the remainder when 648 is divided by 270? 108 Calculate the remainder when 324 is divided by 88. 60 Calculate the remainder when 237 is divided by 49. 41 What is the remainder when 39 is divided by 5? 4 Calculate the remainder when 71 is divided by 20. 11 What is the remainder when 224 is divided by 115? 109 Calculate the remainder when 1197 is divided by 24. 21 Calculate the remainder when 110 is divided by 8. 6 What is the remainder when 8990 is divided by 391? 388 Calculate the remainder when 1240 is divided by 89. 83 What is the remainder when 4688 is divided by 23? 19 Calculate the remainder when 541 is divided by 104. 21 Calculate the remainder when 4101 is divided by 71. 54 Calculate the remainder when 41 is divided by 5. 1 Calculate the remainder when 131 is divided by 21. 5 Calculate the remainder when 3184 is divided by 27. 25 What is the remainder when 1818 is divided by 303? 0 Calculate the remainder when 750 is divided by 76. 66 Calculate the remainder when 8988 is divided by 155. 153 Calculate the remainder when 258 is divided by 95. 68 Calculate the remainder when 132 is divided by 9. 6 What is the remainder when 575 is divided by 12? 11 What is the remainder when 1323 is divided by 441? 0 Calculate the remainder when 1162 is	{ "pile_set_name": "DM Mathematics" }
y(t)). 2t2 Let w(a) = -10a*2 - 6a + 6. Let j(y) = 18y2 + 11y - 11. Let u(o) = -6j(o) - 11w(o). Let n(p) = 1057p. Determine u(n(f)). 2234498f2 Let c(b) = b. Let u(q) = q3 - 23q2 + 21q + 23. Let d be u(22). Let z(r) = -52r. Let i(j) = dz(j) + 78c(j). Let o(p) = -p2. Determine i(o(a)). -26a*2 Let f(i) = 146i - 133i + 245i + 116i + 394i. Let g(q) = q. What is g(f(z))? 768z Let t(y) = 40y*2 + 37y*2 - 79y*2. Let x(u) = 182u*2. Calculate x(t(i)). 728i*4 Let l(x) = 3100701x. Let y(m) = -m*2. Give y(l(d)). -9614346691401d*2 Let v(c) = -17c. Suppose -16 = 6l + 50. Let o(m) = -14m*2 + 11m + 11. Let r(u) = 5u2 - 4u - 4. Let n(a) = lr(a) - 4o(a). What is n(v(h))? 289h2 Let u(h) = -16052h. Let q(x) = -102x2. What is u(q(p))? 1637304p2 Let f(m) be the third derivative of -m7/630 - 2m4/3 - m2. Let n(z) be the second derivative of f(z). Let r(l) = -l. Calculate r(n(p)). 4p*2 Let o(q) = -4q*2 + 5q - 5. Let r(f) = -2f2 + 3f - 3. Let p(y) = 3o(y) - 5r(y). Let a(t) = -56t2 + t. Give a(p(z)). -224z*4 - 2z*2 Let w(t) = -1747444t. Let m(c) = 2c. Calculate m(w(l)). -3494888l Let b(r) = 3r. Let f(h) = -h. Let l(z) = 2b(z) + 7f(z). Let c(k) be the first derivative of 0k + 1/3k3 - 9 + 0k2. What is l(c(y))? -y2 Let k(v) = -2v. Let p be ((-15)/12 + 2)12. Let c(q) = -31q2 + pq*2 + 14q*2. Give k(c(l)). 16l*2 Let z(j) = -3j2. Let d(k) = -k2 - k - 1 - 2k + 4k - 2k. Let n(c) = -2c*2 + 9c + 9. Let m(r) = 18d(r) + 2n(r). What is z(m(t))? -1452t4 Let o(i) = -3i*2. Let y = -37 - -50. Let p(x) = -7x + 18x - yx. What is o(p(d))? -12d2 Suppose 0 = 7f - 4f - 6. Let v(i) = 3i*f - 3i2 - i2 - 4i2. Let w(u) = 5u*2. Calculate v(w(q)). -125q*4 Let f(p) = p - 3. Let j(h) = 1. Let d(a) = -f(a) - 3j(a). Let g(b) be the second derivative of b*4/6 - b - 22. Give g(d(o)). 2o*2 Let h(x) = -22x. Suppose 1 = r - 3k - 1, -5r + 46 = 3k. Let b(d) = -d2 - 3d + 3. Let p(y) = -3y2 - 8y + 8. Let g(l) = rb(l) - 3p(l). Give h(g(i)). -22i2 Let s = -46 - -33. Let k = 63 + s. Let y(a) = 50 - k + a. Let c(b) = 14b. Calculate y(c(m)). 14m Let q(s) = -11s. Let l(p) = 34217p. What is q(l(j))? -376387j Let r(d) = -2d2. Let z(i) = 2i*2 - 6i - 6. Let o(l) = -2l2 + 5l + 5. Let t(m) = 6o(m) + 5z(m). Give t(r(j)). -8j4 Let l(n) = -n2. Let m(o) = o2 + 11o - 24. Let w be m(-13). Let g(r) = -r + r*2 + r - 3r*w. Calculate l(g(p)). -4p*4 Let i = 15 - 11. Let s be 8/i - 1-3. Let l(r) = sr - 2r - r. Let c(g) = -4g. Determine c(l(o)). -8o Let b(v) = v. Let o(i) = -257i2 + 9206. Give b(o(d)). -257d*2 + 9206 Let h(r) = 100r*2. Let b(j) = -3j*2 - 2j - 6. Let d(c) = -30c2 - 21c - 63. Let o(n) = -21b(n) + 2d(n). What is h(o(w))? 900w4 Let n(z) be the first derivative of -z4/6 - 16z + 16. Let r(j) be the first derivative of n(j). Let q(o) = -7o. What is q(r(c))? 14c*2 Let h(i) = -7i. Let o(z) = 5z2 - 35z - 16. Let t(c) = -2c2 + 12c + 6. Let l(w) = 3o(w) + 8t(w). Calculate h(l(m)). 7m2 + 63m Let x(m) be the third derivative of 14m5/15 + 75m*2. Let c(p) = -5p*2. Determine c(x(n)). -15680n*4 Let p(s) = -2s*2 - 18s. Let u(q) be the first derivative of -q*2/2 + 4. Let i(d) = 2p(d) - 36u(d). Let t(o) = 4o*2. What is i(t(v))? -64v4 Let t(j) = j2 + 59j + 1. Let k(c) = 6c. Determine t(k(n)). 36n2 + 354n + 1 Let g(u) = 55u2 + 134u. Let q(d) = -4d2. Give g(q(m)). 880m*4 - 536m*2 Let b(q) be the second derivative of -28q*3/3 + 10q + 3. Let z(f) = -9f2. Give z(b(y)). -28224y*2 Let o be ((-22)/(-10) - 1/5) + 9. Let t(w) = -10w - 11. Let d(h) = 2h + 2. Let g(k) = od(k) + 2t(k). Let i(c) = -16c. Calculate i(g(s)). -32s Let f(t) = -3t*2 + 17393. Let a(o) = -2o. What is f(a(d))? -12d2 + 17393 Suppose 5y - 72 = -62. Let l(p) = 6505 + 16py - 6505. Let t(j) = -5j*2. Determine l(t(z)). 400z*4 Let o(j) = 9j. Let v(c) = -c + 1. Let k(i) = -i*2 - i + 1. Let r(b) = 2k(b) - 2v(b). Determine r(o(m)). -162m*2 Let f(v) = 2v - 4v + 5v. Let d be 12/16 - (-2)/8. Let m(y) = -y. Let r(l) = l. Let c(t) = dm(t) + 5r(t). Calculate c(f(o)). 12o Let p(s) = s2 + 118s. Let k(c) be the third derivative of c*4/12 + 87c*2. What is p(k(x))? 4x*2 + 236x Let o(j) = -3j. Let b(w) = -3752w*2. Give b(o(i)). -33768i*2 Let c(b) = -21b. Let s(p) = 119252p2. What is c(s(n))? -2504292n*2 Let k(n) = 2n*2. Let j(y) = -17y*3 - 2y*2 - 2y - 1. Let f be j(-2). Let h = f - 75. Let l(t) = -h + 56 + 2t2. What is k(l(q))? 8q*4 Let f(n) = -5n*2. Let k be 5/(((-2)/16)/((-1)/4)). Let q(r) = -5r*2 + 3r - 13r + kr. Give q(f(s)). -125s4 Let m(o) = 88o + 62o - 187o. Let c(d) = 4d. Calculate c(m(a)). -148a Let v(k) = -80k - 2080. Let x(r) = r. Determine x(v(c)). -80c - 2080 Let z(f) = -f. Let c(h) = -3h2 + 6h. Suppose -8t + 20 = -4t. Let y(o) = tc(o) + 30z(o). Let p(l) = -l*2. Give y(p(s)). -15s4 Let i(k) = -k2. Let u(z) = 26271z2 + 695. Let o(g) = -151g*2 - 4. Let a(d) = 695o(d) + 4u(d). What is a(i(l))? 139l*4 Let j(q) = -52q*2 - 55q*2 - 46q*2 + 157q*2. Let i(l) = 39l*2 + 2l. What is i(j(f))? 624f4 + 8f*2 Let r(h) = 18h - 39h + 17h. Let p(u) = 23u. Give r(p(b)). -92b Let j(u) be the first derivative of -u*3/3 - 214. Let p(b) = 48b*2. Let o(f) = 7f*2. Let n(t) = -27o(t) + 4p(t). What is j(n(x))? -9x*4 Let m(s) = 18s*2. Let z(n) = 6331n*2 + 2n + 20. What is z(m(g))? 2051244g4 + 36g*2 + 20 Let u(x) be the first derivative of -4x*3/3 + 79. Let z(t) = -28t. Calculate z(u(n)). 112n2 Let i(t) = -1051t. Let q(l) = -3l2 + 6l. Give q(i(o)). -3313803o2 - 6306o Let i(y) = -43y - 3. Let f(w) = 5w*2 + 2w + 2. Let r(o) = 66o2 + 27o + 27. Let j(p) = 27f(p) - 2r(p). Calculate i(j(l)). -129l2 - 3 Let a(z) = -6z - 1. Let i(s) = 7s. Let g(v) = 5a(v) + 4i(v). Let o(p) = 5p. Determine g(o(w)). -10w - 5 Let v(d) = 2d - 7. Let y be v(5). Let r(k) = -yk2 - k2 + k2. Let f(u) = -3u - u - 7u + 13u - u. Calculate r(f(s)). -3s2 Let h(r) = -r2. Let u(c) = 18c. Let k(q) = q. Suppose -2l = -7l. Suppose 3i - 4v + 0v = -10, 2i - v = l. Let f(g) = iu(g) - 44k(g). What is h(f(w))? -64w2 Let y(w) = -101w*2 + 4. Let u(v) = -5v*2 + 9v - 3. Let k(t) = 17t2 - 30t + 10. Let x(f) = -3k(f) - 10u(f). Calculate y(x(i)). -101i4 + 4 Let b(r) = -1279r. Let p(d) = 32d2. Calculate p(b(i)). 52346912i*2 Let f(c) = c - 1. Let x be f(3). Let d(w) = 7w2 + wx + 0w2 + 2w*2. Let o(k) = -2k*2. What is o(d(y))? -200y4 Let d(w) be the first derivative of -w5/3 + 23w2/2 - 4. Let c(b) be the second derivative of d(b). Let t(v) = -2v. Calculate t(c(i)). 40i2 Let h(k) be the first derivative of -k4/12 - 7k - 20. Let b(j) be the first derivative of h(j). Let u(p) = 22p. Determine u(b(d)). -22d*2 Let l(x) = 8256x + 3. Let t(s) = -2s2. Calculate t(l(b)). -136323072b*2 - 99072b - 18 Let x(i) = -128i2. Let v(g) = 37g*2 - 2g. What is v(x(q))? 606208q4 + 256q2 Let o(j) be the second derivative of -j6/180 - 13j3/6 - 9j. Let w(m) be the second derivative of o(m). Let r(h) = -14h. What is w(r(k))? -392k*2 Suppose 0 = 4a + z - 9, -a + 2a - 15 = 4z. Let u(y) = -6y + 3. Let k(w) = -17w + 8. Let x(m) = ak(m) - 8u(m). Let l(g) = -g + 2g + 2g. What is l(x(c))? -9c Let o(j) = 2j. Suppose -11l = -14l - 9. Let k(x) = x2. Let s(n) = n2. Let c(t) = ls(t) - k(t). What is c(o(m))? -16m2 Let p(w) be the first derivative of -w2 - 79. Let g(b) be the second derivative of b*4/6 + 2b. Calculate g(p(d)). 8d2 Let a(m) = m2. Let g(t) = -196t + 78. Determine a(g(q)). 38416q2 - 30576q + 6084 Suppose 21b + 15 = 24b. Let w(l) = -6l - 5 + b - 8l. Let m(n) = n*2. Calculate w(m(q)). -14q*2 Let h(q) = -34q. Let a(m) = -37m + 89. What is h(a(u))? 1258u - 3026 Let g(z) be the first derivative of z*6/180 - 14z*3/3 + 28. Let y(d) be the third derivative of g(d). Let r(o) = -4o + 4o - 9o*2. Give y(r(u)). 162u*4 Let g(c) be the first derivative of -6 - 4c*2 - 6 + 3c*2 + 0c**2.	{ "pile_set_name": "DM Mathematics" }
o(y) = -y*2 - 3y + 2. Let a(c) = c - 6c2 - 1 - 2c*2 + 7c*2 + 2c*2. Calculate -4a(t) - 2o(t). -2t*2 + 2t Let u(t) = 2t2 - 4t - 2. Let y(z) = -6z2 + 11z + 5. Calculate 8u(s) + 3y(s). -2s2 + s - 1 Let x = 36 - 58. Let v = x - -21. Let z(o) = o. Let a(m) = -6m + 2. What is va(f) - 5z(f)? f - 2 Let h(k) = 6k3 + 5k*2 - 5k - 5. Let b be ((-9)/4)/34. Let q(m) = -m2 - 15904 + 15905 + m - 3m*3 + 2m*3. What is bh(i) - 15q(i)? -3i*3 Suppose 0 = 3g + 2g + 4q - 77, 2g + 4q = 26. Suppose f + 23 = 4a - g, -f - 51 = -5a. Let m(l) = 6l. Let w(b) = b. Calculate aw(h) - 2m(h). -h Let i(n) = 401n - 18. Let t(y) = -193284y + 8673. What is -2891i(s) - 6t(s)? 413s Let z(g) = -3g2 + 11g. Let l(s) = 3s2 - 12s. Let h(v) = -3l(v) - 4z(v). Let c(p) = 204 - 3p2 - 204 + 17p - 4p2. Give -6c(r) - 13h(r). 3r*2 + 2r Let j(x) = 5x3 + 3x2 + 4. Let a(c) = c3 + c*2 - 1. What is 2a(l) - j(l)? -3l3 - l2 - 6 Let c(w) be the first derivative of 3w4/4 - w3 + 3w2/2 - 3w - 198. Let x(b) = 3b3 - 4b*2 + 4b - 4. Determine 4c(j) - 3x(j). 3j3 Let z(a) be the third derivative of a5/30 - a4/12 - 2a*2 - 45. Let p(y) = 6y*2 - 7y. Calculate 4p(f) - 14z(f). -4f2 Let r(s) = -s3 + 10s*2 + 8s + 37. Let q be r(11). Let m(o) = 5o - 6. Let z(l) = 11l - 13. Determine qz(b) - 9m(b). -b + 2 Let f(c) = 12c - 88. Let w(s) = 9s - 88. What is -4f(o) + 5w(o)? -3o - 88 Let z(o) = 61o + 5. Let x(w) = 124w + 9. Determine 3x(q) - 5z(q). 67q + 2 Let j = 4 - 4. Let c(a) = -6a + j + 18a*2 - 16a2 + 0 - 4. Let u(v) = v2 - 5v - 3. Suppose 88g = 87g + 4. Give gu(r) - 3c(r). -2r*2 - 2r Let i be (-1)/2 - (-15)/(-6). Let z(h) = 1 + 117h - 120h - 3h2 - 3 + h2. Let f(k) = 3k*2 + 5k + 3. Give if(c) - 5z(c). c*2 + 1 Suppose -28 = 4t, t = 2b - 307 + 322. Let y(w) = 4w + 4. Let r(k) = 8k + 8. Let a(c) = -4r(c) + 9y(c). Let i(q) = 21q + 21. Calculate ba(j) + 2i(j). -2j - 2 Let l = -507 - -518. Let h(c) = -3c - 8. Let b(k) = -7k - 15. What is lh(p) - 6b(p)? 9p + 2 Let y be (-2)/4(0/(-5) + -4). Let v(m) = 27m - 4 + 4my - 23m + 0 - 4m3. Let w(r) = -4r*3 + 3r*2 + 3r - 3. Determine 3v(g) - 4w(g). 4g3 Suppose -11 = 3b + 4. Let y be b + 1/((-2)/(-8)). Let u(w) = -w - 1. Let f(o) = -4o2 - 5o - 5. Give yf(c) + 5u(c). 4c2 Let h(t) = -14t + 15. Let c(a) = -10a + 8. Let x(w) = -5c(w) + 3h(w). Let b(u) = u + 1. Determine -6b(m) + x(m). 2m - 1 Let q = 15 + -13. Let x(k) = k + 4kq - k. Let d(t) = t + 1. Let v be d(2). Let y(h) = -h2. Give vy(b) + x(b). b2 Let j(p) = 146p - 11. Let f(c) = 144c - 9. Calculate -5f(y) + 4j(y). -136y + 1 Suppose g = -i + 10, -11 = -5g + 4i + 3. Let o(d) = 7d - 6. Let h(q) = 2q + 15. Let k be h(-7). Let r(c) = 6 - c - 6 + 0 + 1. Give gr(p) + ko(p). p Let k(b) = -8b + 774. Let l(x) = 3x - 311. Calculate 5k(y) + 12l(y). -4y + 138 Let u(p) = 2p3 - p2 - p + 2. Let g = -355 - -350. Let r(h) = -4h3 + h2 + 2h - 5. Calculate gu(t) - 2r(t). -2t3 + 3t*2 + t Let r(p) = -195p*3 - 2p*2 + 6p - 2. Let o(c) = c*3 - c. What is -6o(f) - r(f)? 189f3 + 2f2 + 2 Let h(j) = j3 + j*2 + 2j - 6. Let b(o) = -o*3 - o - 2. Let t(d) = -3d*3 - 2d - 5. Let v(l) = 2b(l) - t(l). What is -h(a) - 6v(a)? -7a3 - a2 - 2a Let c(u) be the second derivative of u5/2 - u4/6 - 94u. Let z(r) = -51r*3 + 11r*2. Give 11c(g) + 2z(g). 8g*3 Let p(y) = 3y*2 + 11y - 7. Let v(h) = 4h2 + 9h - 6. Calculate -4p(w) + 5v(w). 8w2 + w - 2 Let r(u) = 8u*3 - 4u*2 + 5u - 1. Let y(b) be the third derivative of b6/120 - b5/60 + b*4/24 + 2b*2 + 245. Give -r(x) + 5y(x). -3x3 - x2 + 1 Let i(k) = -8k*2 + 5k - 5. Let n(d) = -6 + 3d2 - d - 2d*2 + 7. Calculate i(r) + 6n(r). -2r2 - r + 1 Let w be (-162)/(-15) - -1(-1)/(-5). Let b(u) = 14 + 3u2 - 6 + 5u*2 - wu*3. Let a(p) = 4p*3 - 3p*2 - 3. Determine -8a(o) - 3b(o). o3 Let a(w) = 11w*2 + 6w + 2. Let m(s) = 32s2 + 17s + 7. Give 17a(y) - 6m(y). -5y2 - 8 Let s(k) = 2. Let f(p) = p2 + 6p + 2. Let a be f(-6). Let m(d) = d - 13. Suppose 0 = -2u + 44 - 16. Give am(y) + us(y). 2y + 2 Let l(g) = 3g - 1. Suppose 9 = 3y - 0. Suppose -4s - o = -6o + 8, -5s - 10 = yo. Let h(w) = 3w. Give sl(i) + 3h(i). 3i + 2 Let g(p) be the first derivative of -2p2 - 4. Let i(t) = -6t. Let s(r) = -7r. Let v(l) = -6i(l) + 5s(l). Determine 3g(b) + 10v(b). -2b Let x(g) = g*2 + 1. Let l(c) = 7c*2 + 5. Let u = 732 - 736. Determine ux(y) + l(y). 3y2 + 1 Let b(c) = 36c*3 - 3c*2 - 3c + 4. Let y(u) = 73u3 - 4u*2 - 5u + 6. Determine -5b(j) + 3y(j). 39j3 + 3j*2 - 2 Let h(n) = -2n*3 - 5n*2 + 5n + 1. Let w(u) = u2 - u + 2. Let y(i) = i3 - 3i2 + 3i - 10. Let l(c) = 5w(c) + y(c). Calculate 2h(q) + 5l(q). q3 + 2 Let w = 4 - 7. Let d(c) = -3c. Let t(j) be the third derivative of j4/6 - j3/6 - 33j2. What is wd(u) - 2t(u)? u + 2 Let j(w) = w + 1. Let a(p) = 6 + 5p + 2 - 2p + 3 - 5. Let n = 0 + 4. What is nj(b) - a(b)? b - 2 Let d(n) = -n*2 - n. Let u(a) = 34a*2 + 8a. Determine -40d(c) - 5u(c). -130c2 Let i = -36 - -37. Suppose 5t - 85 = 2m + 3m, -2t - i = 5m. Let w(z) = 22z3 + 10z - 12. Let r(k) = -9k3 - 4k + 5. Give tr(v) + 5w(v). 2v3 + 2v Let b(a) = 8a2 - 2a. Suppose 0 = -103v - 191 + 809. Let z(l) = 9l*2 - 3l. Calculate vz(q) - 7b(q). -2q2 - 4q Let t(z) = z2 + 1. Let v(y) = -y2 + 2y. Determine -6t(x) - 5v(x). -x2 - 10x - 6 Let t(c) = -c*3 + c + 2. Let u(l) be the second derivative of 0 - 3/2l*2 + 1/10l*5 + 1/12l*4 + 38l - 1/6l3. Calculate -3t(y) - 2u(y). -y3 - 2y*2 - y Let h(b) = -64b + 21. Let k(c) = -63c + 28. What is -4h(p) + 3k(p)? 67p Let f(n) = -2n + 5. Suppose -6 = 4r - 2r - v, -5r - v - 15 = 0. Let k(z) = 3z - 10. Determine rk(j) - 5f(j). j + 5 Let r(z) = -1 + 0z - z + 2z. Let n(t) = 2t*2 + 8t - 7. Suppose -3q = -2x + 2, 6 = -q - x - x. Let p be (3 - 9)(-1 - q). What is pr(l) + n(l)? 2l2 + 2l - 1 Let t(r) = -7r2 + r - 5. Let d(b) = 16b*2 - 35b - 25. Let j(w) = 8w2 - 19w - 14. Let u(h) = 6d(h) - 11j(h). Determine 4t(n) + 5u(n). 12n2 - n Let t(a) = -4a*2 - 2a - 3. Let h(k) = -25k2 + 12k*2 + 12k*2 - 1. Suppose 4j + 9 = n, -4n + 16 = 3j - 1. Determine jt(d) + 5h(d). -d*2 + 2d - 2 Let y(g) = 3g - 3. Let w(k) = 3k - 4. Calculate -5w(v) + 6y(v). 3v + 2 Let n(j) = j. Suppose 229g = 224g - 5. Let m(s) = -2s*2 - s + 2. Calculate gm(w) + 2n(w). 2w*2 + 3w - 2 Let r(i) = -i*3 - 3i*2 + 10i - 3. Let y be r(-5). Let j(c) = c*2 - 3c - 1. Let h(w) = -6w2 + 16w + 6. Give yh(n) - 16j(n). 2n2 - 2 Let d(p) = -14p - 5. Let n(w) = 16w + 4. What is 5d(r) + 4n(r)? -6r - 9 Let i(k) = k*3 - 6k + 6. Let u(o) = -o + 5 - 7 + 2 + 1. What is 5i(v) - 30u(v)? 5v3 Let m(t) = -14t*2 + 6. Suppose 3u = 5a - 0 + 1, 0 = -4a + 3u - 2. Let o(x) = x2. Calculate am(y) + 12o(y). -2y*2 + 6 Let v(u) = 2394u*2 - 144u. Let g(c) = -479c2 + 30c. Determine 24g(l) + 5v(l). 474l2 Let h = 72 - 73. Let x(l) = -l2 + 1. Let f(g) = -2g - 1. Let k be f(-1). Let z(b) = -28b2 + 17b*2 + 12b*2. What is hx(t) + kz(t)? 2t*2 - 1 Let j(u) = 4u*2 - 7 - 2u + 2 + 3u2 - 2. Let p(z) = -15z*2 + 4z + 15. Let g(s) = 13j(s) + 6p(s). Let a(n) = -n*2 + n + 1. Determine -4a(r) - 3g(r). r2 + 2r - 1 Let z(l) = -189l2 - 77. Let j(n) = -10n*2 - 4. Let v be ((-9)/6)/(12/40) - -1. What is vz(g) + 77j(g)? -14g*2 Let o(k) = 8 + 2k - 5 - 6 + 6 - 8. Let b(q) = -q - 1. What is -5b(h) + o(h)? 7h Let t(q) = -2q3 - 3q*2 - 6q - 7. Let k(f) = -4f3 - 7f*2 - 13f - 16. Determine -3k(a) + 7t(a). -2a3 - 3a - 1 Let k be (((-4)/24)/((-1)/3))/(8/48). Let m(f) = -2f2 + 5f. Let h be 66/(-14) - 4/14. Let y(n) = -n*2 + 3n. Give hy(u) + km(u). -u*2 Let r(b) = -4b*3 + 5b*2 - 7b - 7. Let d(f) = -2f3 + 3f*2 - 4f - 3. Determine 5d(j) - 3r(j). 2j3 + j + 6 Let d(m) = 2m*3 + 6m2 - m + 1. Let g(z) = z3 + z*2. What is d(t) - 3g(t)? -t*3 + 3t**2 -	{ "pile_set_name": "DM Mathematics" }
4/7 a Let k = 81 + -83. Let j be (2/(k/3))/(20/4). Which is the third biggest value? (a) -1.1 (b) 2/11 (c) j a Let w = 0 + 0.16. Let d = -0.26 + w. What is the second biggest value in 2/5, d, -1? d Let w be ((-25)/(-20))/5 - (-1)/(-4). Suppose -4z + 3i + 4 = w, -4i + 5i = -4. Which is the second smallest value? (a) -1/3 (b) z (c) -1/6 (d) -1/9 a Let d = -269 + 268.7. What is the fourth smallest value in 0, -0.007, d, 3/5? 3/5 Let t = -40 - -73. Let m = -33.08 + t. Suppose 5 = -i - 4i, -2w - 5i = 13. Which is the third smallest value? (a) m (b) 1/8 (c) w b Let u = 320 - 639/2. Which is the second smallest value? (a) -0.3 (b) 0.2 (c) u (d) -0.7 a Suppose -x = 4i - i - 17, -x + 1 = -i. Suppose -iq - 6 = -q. Let h be -2 + (2 - q/(-11)). Which is the second biggest value? (a) h (b) 0.4 (c) -2 a Let k(b) = -b2 + 3b - 8. Let u be k(4). Let v be (-1(-2)/u)/((-3)/4). What is the third biggest value in 1/11, v, 7? 1/11 Let s = 1 + 11. Let n be ((-8)/84)/(s/(-21)). What is the biggest value in -5, n, 0? n Let u = 69 + -124. Let j = u - -58. Let i = 4.8 - 0.8. Which is the second smallest value? (a) j (b) 13 (c) i c Let w(j) = j3 - 9j*2 + 2j + 3. Let p be w(9). Let y = p + -24. Let m = 4 - 8. Which is the third biggest value? (a) y (b) 1/8 (c) m c Let g = 45.3 + 6.7. Let w = g + -55. What is the second biggest value in -0.05, -1, w, 1? -0.05 Let t = 46076014/207 + -222590. Let f = t - -18/23. Which is the second smallest value? (a) f (b) -0.06 (c) 0.3 a Let n = 10.69 + -10. Let t = n - 0.49. Which is the biggest value? (a) -2/3 (b) -2 (c) 0 (d) t d Let b(z) = -z + 6. Let w be b(6). Let f be w - 1 - (-50)/46. Let o = 3.97 - 4. What is the second biggest value in f, -2/7, o? o Let x(s) = -2s3 + 5s*2 + 3s - 10. Let l be 3 - (-3 + 3)/(-3). Let i be x(l). Which is the third biggest value? (a) i (b) 0.1 (c) -3 (d) 0 c Suppose -6p = -0 - 252. Let m be (1 - (-1)/(-2))/(p/(-36)). What is the biggest value in -0.4, 1, m, 1/4? 1 Suppose 7u + 39 = 74. Let p = 1 + -1. Suppose -3 = 3r - 4r. Which is the smallest value? (a) p (b) r (c) u a Suppose -5t + 2x = -21, -2x - 15 = -3t - 0x. What is the third smallest value in -3, -0.3, t, 10? t Let j = 134 + -133.7. What is the third smallest value in -3, j, -4.9, -4? -3 Let o = 9.798 + -4.38. Let y = -0.258 + o. Let g = -0.16 + y. What is the smallest value in g, 6, 0.2? 0.2 Suppose -17y - 10 = -61. Let b = -2.5 + 2. What is the smallest value in y, b, -4? -4 Let i = 0.6 - 0.5. Let m be 726/36 - 4/6. Let d = m - 431/22. Which is the biggest value? (a) 0.3 (b) i (c) d a Let a be (-1)/2 - 17/(-26). Let f be (1/10)/(13/78). Let h = -0.19 + -0.01. What is the third smallest value in a, f, h? f Let v be 7/(-2) + (6 - 8) - -5. Which is the third smallest value? (a) -5 (b) v (c) -1 (d) -4/3 c Let m = -0.024 - 39.976. Let o = m - -38. Which is the second biggest value? (a) 10 (b) -0.2 (c) o b Let g = 15.7 + 0.3. Which is the smallest value? (a) 0.1 (b) -0.02 (c) g b Let c be -1 - (-1 + (-2)/(-15)). Let x = -0.066 + -1.634. What is the fourth smallest value in -0.2, x, c, -4? c Let r(j) = j*2 + 2j + 4. Let d be r(-3). Let l be (6/10)/(d/35). Let k = 0.3 - 0.5. What is the smallest value in -4, k, l? -4 Let l = 68 + -68.4. Let h = l - 0. Let t = 2 + -3. Which is the biggest value? (a) -4 (b) t (c) h c Let q = -0.21 - -0.61. Let m = 23/2 + -12. Let p = -1/4 - m. Which is the biggest value? (a) q (b) p (c) 1/3 a Let c be 2 - (-15)/(-7)20/30. What is the second biggest value in 6, c, -2, 3? 3 Let i(q) = -q2 - 12q - 28. Let s be i(-9). What is the fourth smallest value in 0.1, 2, -1/11, s? 2 Let h = 0.91 + 0.09. Let r be (-581)/15 - 2/(-5). Let m = r + 39. Which is the second smallest value? (a) -2/9 (b) m (c) h b Let q be 2/6 - 4/(-6). Let l = -0.009 + -0.491. Let p = 0 + l. Which is the second biggest value? (a) -1/7 (b) q (c) p a Let z = -37 - -35. Let n be (-3)/2z/(-30). Which is the second smallest value? (a) -26 (b) -2 (c) n b Let j = 6094429 + -16558563959/2717. Let s = -4/209 + j. Which is the second smallest value? (a) 3 (b) s (c) -1 (d) -0.3 d Let c = -25679/10270 - -2/5135. Let i = -2 + 1.99. What is the second smallest value in i, 2, -0.5, c? -0.5 Let q = 53.1 - 2.1. Let j = 52 - q. What is the third biggest value in j, -2/15, -0.4, -1/3? -1/3 Let l = 2.74 - 2.98. What is the second smallest value in -2/11, 1, l? -2/11 Let z = 0.01 + -0.07. Let s = 95 - 95.4. Which is the second biggest value? (a) z (b) s (c) -4 b Let w = 12 + -9.2. Let i = 0.2 + w. Let x be (21)/(11 - -3). Which is the second biggest value? (a) x (b) i (c) 0.1 a Let t(m) = -3m - 4. Let z be t(-4). Suppose 3s - 4l + 9l = -22, -3s + l = -z. Which is the second smallest value? (a) s (b) -3 (c) 5 a Let h = 0.248 - -60.452. Let p = h + -72. Let t = p - -11. What is the third biggest value in -2/7, t, 3? t Let t be 4/(-14) - (-132)/(-420). Let y be -2(-4 + 2)-1. Let r be (y/(-30))/((-8)/10). Which is the second smallest value? (a) 1 (b) r (c) t b Let m = -185.97 + 186. Let p = 261.97 - 266. Let h = m + p. What is the second smallest value in -2, h, 2? -2 Let a = 0.1 + -16.1. Let m = a - -13. Let d be (2 + (-40)/21)/(2/(-3)). What is the second biggest value in d, 3, m? d Let t = -0.031 + 0.231. Let u = -0.03 + -0.57. Let w = u + 0.9. Which is the second smallest value? (a) w (b) t (c) 1 a Suppose 2k = -p + 9, 3k + 10 = -2k. Suppose y + 0v + v - 8 = 0, 0 = 4y - 5v + p. Let s be y + -1 + -1 + 1. What is the smallest value in 0.3, s, 3/5? 0.3 Let n = -112.6 - -115.6. Let o = 3 + -8. What is the third smallest value in n, o, 2, -0.7? 2 Let g be (-14 - -5) + 7 - 1. Let m = -29 + 17. Which is the biggest value? (a) 0.1 (b) g (c) m a Let i = 117 + -117.04. Which is the smallest value? (a) i (b) 2 (c) -3 (d) 1 c Suppose n - 9 = 4n. Let b be 2n2/4. Let z = 2327/7 - 333. What is the second smallest value in 0.4, b, z? z Let g = 0.39 + 0.01. Suppose -1 = 3k + 3q + 29, -2k - 6q - 44 = 0. Which is the third biggest value? (a) 2/15 (b) k (c) g b Let y = 3.73 - 3.63. Which is the second biggest value? (a) 0 (b) y (c) 1/17 c Let f = 68.1 - 72. Let i = 1.1 - f. What is the smallest value in -3, i, -2/5? -3 Let p = -82 - -89. Let q = -3 + 6. Suppose 2u = 3k + 8, -qu - 2 = -5. Which is the smallest value? (a) -1 (b) p (c) k c Let q = -3.7 - -3.66. Let n = q + 16.04. What is the smallest value in n, 0, -1/4, -4? -4 Let u = -0.958 - -40.858. Let p = 40 - u. What is the second biggest value in p, -1/2, 2/31? 2/31 Let m = 3.03 + -0.03. Let r = 8.679 - 1.679. What is the smallest value in -5, 1/2, m, r? -5 Let c = 3.7 - -0.3. Suppose -3z - 5b = -5, 2z - 2b - 7 - 7 = 0. Suppose -4y + 9y = -z. What is the biggest value in 3, c, y? c Let s = -29 - -26. Let d be -2 + 4 + 9/s. Let z be (-55)/30 - (-3 - d). What is the second biggest value in -1, -1/5, z? -1/5 Let t = -1775 + 1775.5. Let h = 8 + -13. Which is the second biggest value? (a) -1 (b) -3 (c) h (d) t a Let k = 686 - 683. Which is the second smallest value? (a) -8 (b) 0.3 (c) k b Let m = -93 - -93. Which is the second smallest value? (a) 0.05 (b) -13 (c) m c Let p = -15 - -20. Let u be 15/10(-4)/2. Let y = -1486/3 - -491. Which is the second smallest value? (a) u (b) p (c) y a Let y = -0.6 + 1.1. Let w = 189.3 - 189. What is the third smallest value in y, -0.5, -10, w? w Let t = -7 - -14. Let n = 10 - t. Which is the smallest value? (a) -2 (b) n (c) -1/5 a Let s = 115.2 + -10.2. Let t = 104.6 - s. Which is the third smallest value? (a) -0.3 (b) t (c) 1/2 c Suppose 5 = 12o + 5. Let r be -2 + (6/(-57) - -2). What is the third biggest value in r, -3/7, o? -3/7 Let o = 99 - 98. Which is the smallest value? (a) 2 (b) -12 (c) o b Let o = -0.52135 + 0.02135. Let n = -8 - -4. Which is the third smallest value? (a) o (b) 3/5 (c) n b Let m = 709/4 + -177. Suppose -5h = 5w - 20, 4w - 3h + h - 10 = 0. Let p = -3/220 + -159/440. Which is the smallest value? (a) m (b) w (c) p c Let p = -1339.9 - -1340. What is the second smallest value in -5, 1/9, p? p Let h = 510 - 508. What is the third smallest value in -4, -9, h, 3? h Let d be -15((-4)/2 -	{ "pile_set_name": "DM Mathematics" }
et i(f) = 205488f. Let n(u) = 2u*2. What is i(n(x))? 410976x*2 Let h(j) = 17j. Let l(q) = 4q. Let a = 31 + -33. Let p(u) = u. Let m(t) = ap(t) + l(t). Determine h(m(f)). 34f Let u(g) = -g. Let j(p) be the first derivative of 77p*2/2 + 9p - 429. Give u(j(t)). -77t - 9 Let o(d) be the second derivative of d3/6 + 6d - 9. Let g(b) = -25b2 - 23b*2 + 4b*2. Give g(o(y)). -44y*2 Let y(h) = 868h - 9. Let g(r) = -27r2. Determine y(g(i)). -23436i*2 - 9 Suppose -2z + 358 = p + 132, p - 3z - 236 = 0. Let c(s) = 230s - ps - 2s*2. Let m(r) = 3r. What is c(m(k))? -18k2 Let f(r) = 4r - 150. Let q(g) = -6g. Calculate f(q(c)). -24c - 150 Let g(d) = -d*2. Let j(o) = 145o + 4 - 101o + 46o - 2 + 0. Determine g(j(v)). -8100v2 - 360v - 4 Let w(t) be the second derivative of 0t3 + 0t*2 + 2t + 0 - 1/12t4. Let z(o) be the first derivative of -14o*3/3 + 144. What is w(z(l))? -196l*4 Let q(a) = -5 + a + 5 + 6a. Let x(t) = -50t. Let m(s) = 15q(s) + 2x(s). Let o(d) = d2. Calculate o(m(w)). 25w*2 Let f(p) = 69p - 137p + 71p. Let r(m) = -5m2. Determine f(r(g)). -15g*2 Let a(d) = 5d*2. Let g(o) = 60o*2 - 110o - 110. Let s(u) = -u - 1. Let k(f) = 2g(f) - 220s(f). What is a(k(w))? 72000w4 Let k(j) = -2887 + 2887 - 6j*2. Let g(p) = 1. Let q(a) = 1. Let o(u) = 3g(u) - q(u). Let y(s) = -s + 5. Let b(v) = 5o(v) - 2y(v). Determine b(k(n)). -12n2 Let z(d) = 3d. Let k(h) = -h. Let m(q) = -8k(q) - 3z(q). Let p(r) = -r*2 - 1. Let g(a) = 50a*2 + 25. Let l(y) = g(y) + 25p(y). What is m(l(s))? -25s2 Let k(c) = 10c - 3c + 29c*2 - 19c*2. Let z(l) = 7l*2 + 5l. Let b(q) = 5k(q) - 7z(q). Let d(y) = -10y. Determine d(b(r)). -10r*2 Let a(y) = -7y*2 - 1. Let p(u) = -19u*2 + 42u - 14. Let k(f) = 10f2 - 24f + 8. Let l(b) = 7k(b) + 4p(b). Determine a(l(w)). -252w4 - 1 Let c(w) = w. Let n(p) = -98p*2 + 2p - 4. Let v(g) = 196g2 - 5g + 10. Let i(x) = -5n(x) - 2v(x). Determine c(i(d)). 98d2 Let j(s) = 200s. Let c(z) = 9z2 + 5z. Let v(k) = -11k2 - 6k. Let m(f) = -6c(f) - 5v(f). Give j(m(o)). 200o2 Let z(n) = -n2 - 9n - 6. Let f be z(-8). Let c(t) = 2 - 11t2 - f + 15t*2. Let o(j) be the first derivative of 3j*2/2 + 2. What is c(o(x))? 36x2 Let p(w) be the second derivative of w3/3 - 8w. Let o(a) be the third derivative of -a5/30 + 3a*2. Give o(p(q)). -8q2 Let y(d) = -d2 + 0 + 6 - 2d - 5 + d3. Let p be y(2). Let n(v) = -6v - v + p - 1. Let x(q) = q. What is x(n(l))? -7l Let t(u) be the second derivative of -u3/6 - u - 27. Let m(g) = -6g*2. Give m(t(y)). -6y2 Let n(i) be the third derivative of -i5/20 + 3i2. Suppose -13 - 5 = -2h. Let t(o) = 10o - 29o + 13o + ho. Calculate n(t(s)). -27s2 Let w(u) = -u. Let g be 0/((-9)/(-3) - 1). Suppose -p = -gp - 2. Let o(c) = 3c + 0c - pc. Determine o(w(l)). -l Let m(f) = -2. Let l(y) = -y + 9. Let h(p) = 3p - 27. Let a(n) = 2h(n) + 7l(n). Let b(x) = -2a(x) - 9m(x). Let d(w) = 5w2. Calculate d(b(s)). 20s*2 Let x(f) = -36f - 2. Let p(r) be the second derivative of -r*4/6 + 2r - 99. Give p(x(t)). -2592t2 - 288t - 8 Let o(f) = -2825f + 1. Let i(c) = 3c. Give i(o(j)). -8475j + 3 Let u(a) = 3a. Let l(z) = -4z. Let k(w) = 2l(w) + 3u(w). Let r(s) be the first derivative of -5s*2 - 4. Determine k(r(f)). -10f Let t(d) = 4d2 + 14014d + 2. Let h(q) = -8q. Give t(h(k)). 256k*2 - 112112k + 2 Let d(j) = 2j. Let w(y) = -42y - 28773. What is d(w(s))? -84s - 57546 Let w(s) = 25 + 23 - 100 + 52 + 3s. Let p(j) = -191j. What is p(w(y))? -573y Let q(g) = 10g - 5g + 4g - 3g. Let p(w) = -4w2 + 3. What is q(p(x))? -24x*2 + 18 Let m(p) = -24p. Let v(g) = 98g - 14. Give m(v(o)). -2352o + 336 Suppose -3r - 14 = -26. Let v(j) = 3j - 5j + 3j - rj. Let g(q) = -3q. Calculate v(g(k)). 9k Let w(q) = q2. Let c(r) = -37556r. Calculate c(w(k)). -37556k2 Let i be (4/7)/(14/49). Let f(d) = 3d + 0d - id. Let h(b) = -20b. Calculate h(f(m)). -20m Let c(z) = 177z2. Let h(u) = 3u - 3. What is h(c(l))? 531l2 - 3 Let k(n) = 17n*2. Let p = -6 + 8. Suppose -pv - 12 = -3a + 2a, 5v = 5a - 35. Let o(w) = -w*a + 0w - 4w + 4w. Give o(k(z)). -289z4 Let z(g) = g2. Let v(r) be the first derivative of r5/20 - r3 + 10. Let t(y) be the third derivative of v(y). Give t(z(a)). 6a2 Let s(x) = x2. Let r(b) = 1886b2 + 2b + 1. What is r(s(h))? 1886h4 + 2h*2 + 1 Let q(h) = -24h + 6h + 8h + 12h + 13h. Let i(p) = -32p2. Give i(q(s)). -7200s*2 Let l(q) = -2q - 1. Let z(g) = -2g2 + 16g + 8. Let o(n) = 8l(n) + z(n). Let m(y) = 1373y. Give m(o(f)). -2746f2 Let a(q) = q2. Let c(h) = 5 - 2 + 43h - 3. Give c(a(g)). 43g2 Let w(z) be the second derivative of 7z*4/12 - 2z. Let r(t) = 23t2 + 4. Let m(f) = 6f*2 + 1. Let i(y) = -4m(y) + r(y). What is i(w(d))? -49d4 Let c(u) be the second derivative of 3u*4/4 + 216u. Let o(t) be the third derivative of t4/12 - t2. What is o(c(m))? 18m2 Let z(v) = -19 - 17 + 5v + 36. Let y(k) = -k + 1. Let u(m) = -7m + 6. Let w(o) = -u(o) + 6y(o). What is w(z(g))? 5g Let f(b) be the first derivative of -b2 - 1. Let p(i) be the third derivative of -i4/3 - 1052i*2. Calculate f(p(r)). 16r Let a(b) = -b*2. Let r(p) = -90p. Let v(j) = 89j. Let l(c) = -2r(c) - 3v(c). Determine a(l(m)). -7569m2 Let n(r) = -r2. Let t = 50 + -25. Let a(h) = -3h2 - 12 - th*2 + 11 + 5h*2. Calculate a(n(q)). -23q*4 - 1 Let y(f) = -2f - 8. Let i(w) = w + 3. Let d(v) = -10i(v) - 3y(v). Let n(q) = q*2. Determine n(d(a)). 16a*2 + 48a + 36 Let p(n) = 2n. Let q(c) = 483c - 678c + 457c. Give q(p(g)). 524g Let q(k) be the first derivative of k3/3 + 115. Let w(j) = -73j*2. Determine q(w(i)). 5329i*4 Let i(j) = -j. Let x(u) = u. Let b(w) = i(w) + 2x(w). Suppose -y - 2c + 7 = 0, 0 = 3y - 4c - 14 - 7. Let o(d) = -12d + yd + 9d. Calculate o(b(q)). 4q Let c(d) = 4d. Let m(y) be the second derivative of -13y4/4 - 2y - 28. Calculate c(m(w)). -156w2 Let l(a) be the third derivative of -a5/60 + 2a*2. Let c(v) = -69v*2 - 34. Let s(h) = 23h*2 + 12. Let q(n) = 6c(n) + 17s(n). Determine l(q(d)). -529d4 Let p(j) be the second derivative of j3/3 + 2j2 + j. Let n be p(0). Let b(a) = -1 + 11a - n + 5. Let z(u) = -2u. Calculate z(b(q)). -22q Let h(b) = 19b - 21b + 31b. Let i(f) be the second derivative of -f3/3 + 3f. Calculate h(i(o)). -58o Let y(c) = -13c. Let p(r) be the third derivative of -r5/30 - r2 + 73. Calculate p(y(u)). -338u2 Let w(p) be the first derivative of -p6/360 + 23p*3/3 - 6. Let b(c) be the third derivative of w(c). Let j(z) = -25z*2. Give b(j(m)). -625m4 Let q(w) be the third derivative of w5/60 - w2. Let b(t) be the third derivative of -t4/2 - 21t2 - 2t - 18. Determine b(q(u)). -12u2 Let k(l) = 110117l. Let v(m) = 28m. Calculate v(k(n)). 3083276n Let l(s) = -6s. Let r be 6/(-2)-1-1. Let b be (-1)/(r/91). Let a(c) = b - 3c2 + 0c*2 - 3. Determine a(l(q)). -108q*2 Let i(t) = -3t. Let s(y) be the third derivative of y*5/15 - 5y*4/24 + 428y*2. What is s(i(w))? 36w*2 + 15w Let k(y) = -y*2. Let q(i) = 99952i*2 - 2. Give q(k(d)). 99952d*4 - 2 Let i(o) = -8o. Let k(j) = 4j2. Suppose h = -5y - 17, 2h = 2y - 4y - 10. Let v(d) = d2. Let c(b) = hk(b) + 7v(b). What is i(c(u))? 8u*2 Let b(r) = 182r - 2. Let j(u) = -528u. Give j(b(l)). -96096l + 1056 Let o(k) = -5k. Let d(n) = 27n. Let i(f) = -4d(f) - 22o(f). Let s(y) = -y - 1. Let b(g) = g*2 - 6g - 6. Let c(x) = -b(x) + 6s(x). Give i(c(r)). -2r*2 Let x(g) = 3g. Let y be ((-72)/84)/(2/(-14)). Let l(t) = 11t2 + 5. Let s(d) = 12d*2 + 6. Let w(o) = yl(o) - 5s(o). What is x(w(r))? 18r*2 Let s(j) = 10j + 2 - 2 - 7j. Let p(d) = 16d. Let g(o) = -4p(o) + 22s(o). Let l(q) = 19q. Calculate g(l(b)). 38b Let p(b) = -16 + 4b2 + 16 - 5b*2. Let k(o) = -6o*2 + 8o - 8. Let h(f) = f*2 - f + 1. Let d(x) = -24h(x) - 3k(x). Give p(d(w)). -36w*4 Let u(h) = -22h*2. Let b(j) = -166j*2 + 84j*2 + 81j*2. Calculate u(b(p)). -22p*4 Let i(o) = -14161o. Let l(c)	{ "pile_set_name": "DM Mathematics" }
:25 AM and 5:30 AM? 305 How many minutes are there between 3:58 AM and 12:23 PM? 505 What is 454 minutes after 5:35 AM? 1:09 PM How many minutes are there between 11:21 AM and 5:28 PM? 367 How many minutes are there between 7:39 AM and 4:48 PM? 549 How many minutes are there between 8:40 AM and 12:43 PM? 243 What is 423 minutes after 12:39 AM? 7:42 AM How many minutes are there between 2:15 PM and 3:17 PM? 62 What is 618 minutes before 5:23 PM? 7:05 AM What is 167 minutes before 3:06 AM? 12:19 AM How many minutes are there between 1:12 PM and 1:31 PM? 19 What is 337 minutes after 1:34 AM? 7:11 AM How many minutes are there between 9:08 AM and 10:55 AM? 107 What is 353 minutes after 5:19 PM? 11:12 PM What is 295 minutes after 9:21 AM? 2:16 PM What is 670 minutes before 1:03 PM? 1:53 AM What is 557 minutes before 9:01 PM? 11:44 AM What is 682 minutes after 5:24 PM? 4:46 AM What is 266 minutes after 7:03 PM? 11:29 PM What is 103 minutes before 3:34 AM? 1:51 AM How many minutes are there between 10:41 AM and 10:01 PM? 680 What is 204 minutes after 5:30 PM? 8:54 PM How many minutes are there between 9:05 AM and 1:44 PM? 279 How many minutes are there between 7:06 AM and 2:15 PM? 429 How many minutes are there between 1:15 PM and 4:07 PM? 172 What is 628 minutes before 10:18 AM? 11:50 PM How many minutes are there between 6:21 PM and 10:46 PM? 265 What is 304 minutes after 6:50 AM? 11:54 AM How many minutes are there between 1:44 AM and 11:35 AM? 591 How many minutes are there between 11:21 PM and 9:30 AM? 609 How many minutes are there between 4:34 PM and 2:39 AM? 605 What is 12 minutes before 7:57 AM? 7:45 AM How many minutes are there between 9:25 AM and 3:52 PM? 387 What is 556 minutes after 5:57 AM? 3:13 PM How many minutes are there between 1:22 PM and 11:09 PM? 587 What is 371 minutes after 8:58 PM? 3:09 AM How many minutes are there between 1:52 AM and 4:37 AM? 165 How many minutes are there between 11:40 AM and 12:33 PM? 53 What is 344 minutes after 11:38 AM? 5:22 PM What is 283 minutes before 1:36 PM? 8:53 AM How many minutes are there between 11:51 AM and 12:40 PM? 49 What is 520 minutes after 9:56 PM? 6:36 AM How many minutes are there between 9:46 AM and 9:03 PM? 677 What is 277 minutes before 9:51 PM? 5:14 PM How many minutes are there between 2:23 PM and 11:26 PM? 543 How many minutes are there between 11:13 AM and 7:57 PM? 524 What is 170 minutes before 12:11 AM? 9:21 PM How many minutes are there between 11:26 AM and 7:39 PM? 493 How many minutes are there between 12:01 PM and 7:34 PM? 453 What is 204 minutes before 2:15 AM? 10:51 PM How many minutes are there between 1:44 AM and 2:32 AM? 48 How many minutes are there between 6:37 AM and 11:16 AM? 279 What is 264 minutes after 1:09 AM? 5:33 AM How many minutes are there between 10:10 AM and 12:25 PM? 135 How many minutes are there between 9:08 PM and 12:12 AM? 184 How many minutes are there between 2:31 PM and 10:07 PM? 456 How many minutes are there between 10:24 PM and 12:19 AM? 115 What is 443 minutes after 6:39 PM? 2:02 AM What is 44 minutes before 5:01 AM? 4:17 AM What is 54 minutes before 10:06 AM? 9:12 AM What is 707 minutes after 6:02 PM? 5:49 AM How many minutes are there between 9:36 PM and 11:04 PM? 88 How many minutes are there between 7:01 PM and 11:01 PM? 240 What is 665 minutes after 10:01 AM? 9:06 PM How many minutes are there between 5:16 AM and 4:28 PM? 672 How many minutes are there between 1:45 PM and 3:02 PM? 77 What is 612 minutes before 3:26 PM? 5:14 AM How many minutes are there between 12:10 AM and 10:19 AM? 609 How many minutes are there between 1:01 PM and 5:21 PM? 260 How many minutes are there between 12:56 PM and 5:52 PM? 296 What is 171 minutes before 12:55 PM? 10:04 AM How many minutes are there between 3:44 AM and 3:28 PM? 704 How many minutes are there between 5:55 PM and 7:31 PM? 96 What is 89 minutes before 11:17 PM? 9:48 PM What is 159 minutes before 9:02 PM? 6:23 PM What is 243 minutes after 9:34 AM? 1:37 PM What is 266 minutes before 9:38 AM? 5:12 AM How many minutes are there between 4:35 AM and 12:57 PM? 502 How many minutes are there between 1:34 PM and 12:01 AM? 627 What is 662 minutes after 2:33 PM? 1:35 AM How many minutes are there between 8:14 AM and 11:41 AM? 207 What is 367 minutes after 10:45 PM? 4:52 AM How many minutes are there between 6:50 PM and 4:38 AM? 588 What is 482 minutes after 12:27 PM? 8:29 PM How many minutes are there between 1:51 AM and 1:21 PM? 690 What is 173 minutes before 8:18 AM? 5:25 AM What is 71 minutes before 5:36 AM? 4:25 AM What is 578 minutes after 7:23 AM? 5:01 PM How many minutes are there between 11:12 AM and 9:35 PM? 623 What is 446 minutes before 6:16 PM? 10:50 AM How many minutes are there between 10:41 PM and 1:00 AM? 139 What is 291 minutes before 1:22 PM? 8:31 AM How many minutes are there between 10:37 PM and 12:34 AM? 117 How many minutes are there between 5:21 AM and 3:20 PM? 599 What is 298 minutes before 8:09 AM? 3:11 AM What is 39 minutes after 1:22 AM? 2:01 AM How many minutes are there between 4:02 PM and 6:23 PM? 141 How many minutes are there between 7:23 AM and 11:38 AM? 255 How many minutes are there between 10:23 AM and 8:33 PM? 610 What is 98 minutes before 12:14 AM? 10:36 PM How many minutes are there between 1:26 AM and 10:39 AM? 553 What is 609 minutes after 9:24 PM? 7:33 AM What is 678 minutes after 3:12 AM? 2:30 PM What is 402 minutes after 9:04 PM? 3:46 AM How many minutes are there between 7:15 AM and 4:03 PM? 528 How many minutes are there between 1:56 AM and 10:01 AM? 485 What is 279 minutes before 3:19 AM? 10:40 PM What is 203 minutes before 8:01 AM? 4:38 AM What is 60 minutes before 11:31 AM? 10:31 AM How many minutes are there between 3:25 AM and 7:25 AM? 240 How many minutes are there between 9:49 AM and 10:58 AM? 69 What is 652 minutes after 7:44 AM? 6:36 PM How many minutes are there between 5:50 PM and 2:48 AM? 538 What is 416 minutes before 10:02 PM? 3:06 PM How many minutes are there between 4:32 PM and 11:06 PM? 394 How many minutes are there between 1:18 PM and 1:20 PM? 2 What is 354 minutes before 8:00 PM? 2:06 PM How many minutes are there between 1:21 AM and 2:17 AM? 56 What is 266 minutes before 8:24 PM? 3:58 PM How many minutes are there between 2:48 AM and 5:39 AM? 171 How many minutes are there between 9:17 AM and 6:59 PM? 582 What is 616 minutes before 9:58 AM? 11:42 PM What is 391 minutes after 7:59 PM? 2:30 AM How many minutes are there between 6:39 PM and 4:49 AM? 610 What is 453 minutes after 12:45 PM? 8:18 PM How many minutes are there between 12:34 AM and 6:16 AM? 342 What is 504 minutes after 1:23 PM? 9:47 PM What is 132 minutes after 5:44 PM? 7:56 PM How many minutes are there between 8:12 AM and 4:28 PM? 496 How many minutes are there between 12:25 PM and 1:09 PM? 44 What is 372 minutes before 5:28 AM? 11:16 PM What is 444 minutes before 4:41 AM? 9:17 PM What is 354 minutes before 8:37 AM? 2:43 AM How many minutes are there between 4:27 AM and 1:13 PM? 526 How many minutes are there between 12:34 PM and 10:50 PM? 616 How many minutes are there between 11:24 PM and 4:29 AM? 305 How many minutes are there between 8:41 AM and 1:51 PM? 310 How many minutes are there between 10:40 PM and 8:08 AM? 568 What is 557 minutes before 1:50 PM? 4:33 AM How many minutes are there between 6:06 AM and 10:01 AM? 235 How many minutes are there between 8:51 PM and 8:23 AM? 692 How many minutes are there between 10:13 AM and 11:50 AM? 97 How many minutes are there between 7:20 AM and 7:55 AM? 35 What is 687 minutes after 2:39 PM? 2:06 AM What is 652 minutes before 12:26 PM? 1:34 AM What is 444 minutes after 4:50 PM? 12:14 AM How many minutes are there between 10:11 PM and 9:23 AM? 672 What is 77 minutes after 3:04 AM? 4:21 AM How many minutes are there between 8:08 PM and 2:42 AM? 394 How many minutes are there between 1:45 PM and 8:10 PM? 385 What is 292 minutes before 2:04 AM? 9:12 PM What is 71 minutes before 2:00 AM? 12:49 AM How many minutes are there between 1:12 AM and 2:05 AM? 53 How many minutes are there between 4:41 PM and 12:28 AM? 467 How many minutes are there between 1:56 AM and 12:26 PM? 630 What is 115 minutes before 11:42 PM? 9:47 PM What is 41	{ "pile_set_name": "DM Mathematics" }
+ g*5 wrt g. -420g2 Let r(i) = 3 - 1 + 1 - 2. Let f be (6/(-4))/(2/(-4)). Let n(x) = x3 - x*2 - 3. Let t(j) = fr(j) + n(j). What is the third derivative of t(g) wrt g? 6 What is the first derivative of 30o3 + 4 - 2o*4 - 30o*3 wrt o? -8o*3 Let z(c) be the third derivative of 0c*7 + 0c*5 + 0c*3 + 1/12c*4 - 1/84c*8 + 0 - 2c*2 + 0c + 0c6. Find the second derivative of z(q) wrt q. -80q3 Let h(y) be the second derivative of y6/15 + 2y2 - 8y. Differentiate h(f) wrt f. 8f3 Let v(q) = -7q*3 - 2q*2 + 2q + 7. Let y(h) = -2h2 + h2 + 5 - 5 + h - 1. Let j(i) = v(i) - 2y(i). Differentiate j(n) wrt n. -21n2 Let z(f) be the third derivative of -f6/120 - f4/12 + f2. What is the second derivative of z(p) wrt p? -6p Let k(m) = 13m2 + 9m + 7. Let x(y) = -3y + 3y - 3 - 4y - 6y*2. Let n(g) = 4k(g) + 9x(g). Find the first derivative of n(p) wrt p. -4p Let l(y) be the third derivative of 0 + 0y6 + 0y + 1/210y7 + 4y*2 + 0y*4 + 0y*3 - 1/60y*5. What is the third derivative of l(g) wrt g? 24g Let t(z) = 18z3 - 7z*2 - 3. Let a(v) = 54v*3 - 22v*2 - 8. Let l(o) = 3a(o) - 8t(o). Find the third derivative of l(j) wrt j. 108 Differentiate 0 + 2 + 0 + 7 - 9t*2 with respect to t. -18t Suppose 3s = -12, 4f - 28 = -f + 2s. Suppose fd + 15 = -5z, 3d - z - 6 = -3. Find the second derivative of 2r + dr - 4r + r3 wrt r. 6r Let j be 1 + (1 - (-8 + 1)). Let h(f) = -1 - 6 - 5f + 2f. Let r(d) = -7d - 15. Let k(s) = jh(s) - 4r(s). Differentiate k(g) wrt g. 1 Let i(b) be the third derivative of -4b*2 + 0b*3 + 0b*4 + 0 + 1/120b*6 - 7/60b*5 + 0b. What is the third derivative of i(t) wrt t? 6 Let n(c) be the first derivative of -c*5/5 - 6c*3 - 6. Find the third derivative of n(q) wrt q. -24q Let v be ((-6)/(-12))/((-2)/4). Let m(g) = -g*2 - g. Let x(w) = -3w3 + w2 + w + 1. Let r(h) = vx(h) - m(h). What is the derivative of r(q) wrt q? 9q2 Let m(u) be the third derivative of u6/40 + u*4/24 + 6u*2. What is the second derivative of m(o) wrt o? 18o Let f = 7 + -6. Let o = 4 - f. What is the third derivative of og2 - 4g*2 + 3g2 + g4 wrt g? 24g Let y be 24/(-30)5/(-2). Find the first derivative of 5 + yo - 2o - 8o - o wrt o. -9 Let m(y) = -28y2 + 5. Let x(s) = -s2 - s + 1. Let z(k) = -m(k) + 5x(k). What is the second derivative of z(l) wrt l? 46 Let b(m) be the second derivative of -4m3/3 + m2 + m. Let o(a) = a - 1. Let s(x) = b(x) + 5o(x). Differentiate s(l) with respect to l. -3 Let o(y) be the first derivative of -5y9/504 + y5/20 + y*2/2 + 2. Let q(u) be the second derivative of o(u). What is the third derivative of q(i) wrt i? -600i*3 Let l(f) = -3f - 1. Let r(m) = -1. Let u(n) = l(n) - 4r(n). What is the derivative of u(s) wrt s? -3 Let m(k) = k2. Let r(c) = 29c*2 - c + 6. Let g(w) = -m(w) - r(w). What is the second derivative of g(f) wrt f? -60 Let g(b) be the second derivative of -5/6b*3 - 6b + 0b6 + 0 + 1/7b*7 + 0b*2 + 0b*4 + 0b*5. Find the second derivative of g(n) wrt n. 120n*3 Let o = 5 + -8. Let s = o + 5. What is the second derivative of -2z + 0z2 + 2z*4 + 0z*s wrt z? 24z*2 Let f(w) be the first derivative of 4 + 4w + 0w3 + 0w*2 - 3/4w*4. What is the first derivative of f(z) wrt z? -9z*2 Let f = 24 + -16. Suppose -3a = -8a + 5l + 35, -2l - f = 0. Find the third derivative of 3k*4 - 2k*4 - ak4 + k2 wrt k. -48k Let q be ((-3)/(-2))/((-6)/(-80)). Suppose 4s = -4p + q, -1 = -s + 2s - 2p. What is the second derivative of 0b*3 + 2bs - b3 + b wrt b? 6b Let d(n) = -25n + 13. Let q(o) = -49o + 27. Let p(a) = -9d(a) + 4q(a). Find the first derivative of p(s) wrt s. 29 Let o(c) = 2c - 59. Let j(x) = x*4 - 3x + 118. Let b(n) = -2j(n) - 5o(n). What is the first derivative of b(a) wrt a? -8a3 - 4 Let j(b) be the third derivative of -13b*6/120 + 17b*4/24 - 8b*2. Find the second derivative of j(t) wrt t. -78t Let v = 3 - -1. Let b(w) = -3w3 + w2 + 4w. Let d(c) = -2c3 + c2 + 3c. Let x(g) = vd(g) - 3b(g). Find the third derivative of x(t) wrt t. 6 Let u(y) = 7y3 - 5y*2 + 10y. Let j(p) = 4p3 - 3p*2 + 5p. Let s(d) = -5j(d) + 3u(d). What is the second derivative of s(i) wrt i? 6i Let z(u) be the first derivative of -u7/105 - u3/6 + 3u*2/2 + 1. Let j(n) be the second derivative of z(n). Differentiate j(b) wrt b. -8b*3 Let s(o) = -o + 2. Let n be s(2). Suppose 4t = -f - 0t + 2, -4t = n. Find the third derivative of -gf - g3 + 2g2 + 2g*3 wrt g. 6 Let a = -3 - -1. Let x(u) = 2u*2 + 3u. Let h be x(a). Find the first derivative of 3 - 2 + hv3 - 4v*3 wrt v. -6v*2 Find the third derivative of -12a*6 - 202 + 2a3 - a2 + 213 + a*3 wrt a. -1440a*3 + 18 Let c(h) be the first derivative of -11h4/4 - h3/3 + 12. Find the third derivative of c(w) wrt w. -66 Suppose d - 2 - 5 = 0. Find the third derivative of 4z5 + 4z2 - z2 - dz2 wrt z. 240z2 Let i(j) = -2 - j2 + 4 + 1 + 3j. Let p(y) = 2y*2 - 3y + 3y - 4 - 3y. Let b(h) = 4i(h) + 3p(h). Find the second derivative of b(n) wrt n. 4 Let o(v) = -14v2 + 9v + 14. Let s(z) = -7z2 + 4z + 7. Let n(b) = -4o(b) + 9s(b). What is the derivative of n(t) wrt t? -14t Let z(d) be the second derivative of 13d*6/30 - 7d*4/4 - 3d. Find the third derivative of z(c) wrt c. 312c Let a(s) be the first derivative of 0s*2 + 0s*3 + 7 + 7s + 0s4 - 1/5s*5. What is the first derivative of a(c) wrt c? -4c*3 Suppose b - x - 7 = -b, 5b - 10 = 4x. Suppose -b = -3t, -3t + 0 = 2g - 10. What is the first derivative of -2 - i*2 - gi*2 + 2 - 3 wrt i? -6i What is the third derivative of -7z6 - 6 + 6 - 3z*2 wrt z? -840z*3 Let g be 8/1851/340. Let r(y) be the second derivative of 0y2 + 0y*5 + 2y + 1/2y3 + 0 + 0y*4 - gy*6. Find the second derivative of r(x) wrt x. -24x*2 Let c(x) be the second derivative of 0 - 3x + 0x4 + 0x3 - x2 + 1/15x6 + 0x*5. Differentiate c(j) wrt j. 8j*3 Let o(s) = -s + 3. Let m be o(-4). Let y = m + 10. What is the derivative of -3w*2 - 2 + 17w - yw wrt w? -6w Let o(s) = -s*3 - 3s*2 + 6s - 6. Let a(f) = -f + 1. Let b = 3 - -3. Let c(r) = ba(r) + o(r). What is the third derivative of c(u) wrt u? -6 Find the third derivative of 83b + 49b2 - 35b*3 - 83b - 10b3 wrt b. -270 Let a(p) be the second derivative of 77p4/12 - p3 + 5p - 2. Find the second derivative of a(z) wrt z. 154 Let j be (-2)/(-1)-1 + -1. Let l = 5 + j. What is the derivative of 3 - 5 + 0 - lo wrt o? -2 Let d(z) be the first derivative of -5z*6 + 17z*2/2 + 4. What is the second derivative of d(f) wrt f? -600f*3 Let d = -17 + 20. Let b(l) be the second derivative of 3l + 0l5 + 0 + 0l*4 + 1/10l*6 - 3/2l*2 + 0l*d. Differentiate b(s) with respect to s. 12s3 Let n(q) be the second derivative of -q7/2520 + q5/60 + q4/12 + q. Let b(r) be the third derivative of n(r). Find the first derivative of b(x) wrt x. -2x Let p(m) be the third derivative of m4/3 - 8m*3/3 + 4m2. Differentiate p(y) wrt y. 8 Let h(y) be the second derivative of y7/630 - y5/60 - y4/3 + y. Let a(q) be the third derivative of h(q). What is the derivative of a(m) wrt m? 8m Let b = 10 + -8. Find the second derivative of -2q*2 + 3q - 3qb + 3 - 3 wrt q. -10 Let s(o) be the third derivative of o6/24 + 5o*3/3 + 17o*2. What is the derivative of s(r) wrt r? 15r*2 Let a(z) = -57z*4 + 113z*2 - 5z - 5. Let n(l) = -28l4 + 57l*2 - 3l - 3. Let f(o) = 3a(o) - 5n(o). Find the third derivative of f(j) wrt j. -744j Let z(q) = q + 8. Suppose -3p - 25 = -7. Let b be z(p). Find the third derivative of bk2 - k5 + k5 - 2k*5 wrt k. -120k*2 Let r(u) be the third derivative of -1/84u*8 + 0u*6 + 0 + 0u*3 + 0u + 0u7 + 0u*4 - 1/60u*5 + 2u*2. What is the third derivative of r(g) wrt g? -240g*2 Let t(j) be the third derivative of 13j8/84 + j4/12 - 11j3/3 - 2j*2. Find the second derivative of t(i) wrt i. 1040i*3 Let s(k) be the third derivative of 55k*4/24 + 37k*3/6 - 29k**2. What is the first derivative of s(l)	{ "pile_set_name": "DM Mathematics" }
g (c) -0.3 (d) x c Let y = -2897/15994 - 1/1454. Which is the biggest value? (a) y (b) 1/4 (c) -23.5 b Let w = 12.49 - 0.19. Let h = -12.7 + w. What is the third smallest value in 0.1, h, -0.2, -1/21? -1/21 Let t = -380 - -256. Let y = t + 124. Let o = 3.2 - -1.8. Which is the smallest value? (a) o (b) -3 (c) y b Let h be 16 - 4 - 500/40. Which is the biggest value? (a) h (b) -147 (c) 1/4 c Let n = -10/7 - -1/35. Let w = -4 + 9. Let r = 31.4189 - 31.1189. What is the fourth biggest value in w, -4, r, n? -4 Let x = 0.01 - -0.09. Suppose -4 = -2w + 2, u + 5w = 19. Let f = -0.024 + 22.024. Which is the third smallest value? (a) x (b) f (c) u b Let f = -95 + 96. Let d = -244 - -244.2. What is the third biggest value in 2, d, f, 7? f Let h(z) = -z*3 - 56z*2 - 50z + 274. Let x be h(-55). Which is the fourth biggest value? (a) 0.5 (b) 2/15 (c) 3.8 (d) x d Suppose 0 = 149f - 183f + 238. Which is the second smallest value? (a) 6/17 (b) -1 (c) f a Let s = 382362 - 382369. Let n be 21/((-10)/3). Which is the third smallest value? (a) n (b) 3 (c) s (d) -0.2 d Let s = -6 + 9. Let g = -7667.954 + 7675. Let m = -0.046 + g. What is the third smallest value in m, s, 2/11? m Let q = 0.4767 + -0.9767. What is the fourth smallest value in q, -5, 0, -3/2, 34? 0 Let h = -2328 + 2327.6. Which is the fourth biggest value? (a) -0.5 (b) h (c) 2/13 (d) -0.2 a Suppose 10w + 90 + 113 - 83 = 0. Which is the second smallest value? (a) -0.1 (b) -3/10 (c) w (d) -0.4 (e) -5 e Let d = 309.73 + -309.96. What is the second biggest value in d, 3, 2, -0.4, -0.5? 2 Let u be -9 - ((-12)/(-4) - 7). Let a be u - (-4)/(72/66). What is the smallest value in 3, a, -2, -0.3? -2 Suppose 5p - 2p + 372 = 0. Let h = p + 132. Let d be 1 + -2 + 18/14. Which is the third smallest value? (a) d (b) h (c) 0.3 b Let r = -719.8996 + -0.1004. Let w = 720.09 + r. What is the fourth biggest value in -0.07, w, -0.2, 1/2? -0.2 Let w be 15/(-18) + (1 + -1)/(58 - 56). Which is the smallest value? (a) w (b) -650 (c) 4 b Let c = 149 + -208. Let i be (-10 + 507/52)/(2/4). What is the third biggest value in c, 4, i? c Let z = 4770 - 4757. Which is the second biggest value? (a) -2 (b) z (c) -2/19 c Suppose n + 2l - 9 = 0, -23 = -2n - 2l + 3l. Suppose 12g = 71 - n. Let f = -20 + 17.4. Which is the third biggest value? (a) -2/9 (b) 0.1 (c) f (d) g a Let m be -1 + 8 + -6 - 1. Suppose 4n = -4 + 44. Suppose n - 4 = -3v. Which is the biggest value? (a) m (b) v (c) -0.2 (d) 3 d Let r = 0.128 + -0.117. Let a = 0.089 + r. Let p = -1 + 2. What is the smallest value in 7, p, a? a Let i be (262/(-10))/(8/(-10)). Let f = i + -33. Let z be 4((-6)/16)/((-855)/(-190)). Which is the fourth smallest value? (a) z (b) f (c) -2/7 (d) -0.8 b Let i be -14 + 9/(-18) + 22. Let b be 2 + 27/(-9). What is the third smallest value in b, -1, i? i Let x = 3340 + -3341. What is the smallest value in -155, 1/6, x? -155 Let v = -0.00508 + 0.10508. Which is the smallest value? (a) 6/11 (b) 2 (c) v (d) 2/53 d Let h = -0.37 + 0.37. Let s = 41.5 + -19.5. What is the third smallest value in h, 5, s? s Let l = -10591/2 + 5224. Let t = -145 + 217. Let w = t + l. What is the fourth biggest value in -1, -2, w, 1? -2 Let c = -0.03 - -0.33. Let m = 332 - 332.076. What is the third biggest value in c, 0.4, 1/2, m? c Let u = 169/290 - -1/58. Let x = 345 + -344.412. Let i = -0.188 + x. What is the third biggest value in -1/8, u, i? -1/8 Let p = -270 + 275.38. Let x = p - 4.88. Let m = -5 - -1. Which is the third biggest value? (a) x (b) -2/23 (c) 3 (d) m b Let b = -135.8 - -301.4. Let d = b + -144. Let l = d - 22. What is the biggest value in -1/4, 0.13, l? 0.13 Let w = 99 - 65. Let h = 0.026 + 32.974. Let t = h - w. What is the biggest value in t, -1/3, 7/6? 7/6 Let g = 151.9936 - -0.0064. Let z = -156 + g. What is the fourth biggest value in -33, z, 5, -1/5? -33 Let w = 3855 + -15423/4. What is the fourth biggest value in w, -0.5, -40, 4? -40 Let g be 6/21 - (-62)/(-70). Let o = -3.03 + 0.03. Let h be ((-615)/(-2050))/(6/40). What is the third biggest value in o, g, 0, h? g Suppose 2w = -2j, w - 70 + 88 = 5j. Let r = 162 - 1137/7. Which is the third smallest value? (a) j (b) -1/22 (c) r a Let j = -8.9 + 9.1. What is the fifth smallest value in -4, 5, 3, 9, j? 9 Let r = -108 + -63. Let n = -172 - r. What is the fourth biggest value in 2/5, 24/5, n, -0.4? n Let u be (-13450)/62 - (13 - 14). Let n = -216 - u. What is the fourth biggest value in 0.5, n, -1, 6? -1 Let x = -862/1899 + 2/211. Let h = 0.0396 + 0.0604. Let s = -34 + 32. Which is the second biggest value? (a) h (b) x (c) s b Let v = -6523 - -52187/8. Let j = 0.02 + -2.02. Let x = j - 1. Which is the biggest value? (a) -0.5 (b) 0.5 (c) x (d) v b Suppose 34r = -28r - 62. Which is the third smallest value? (a) -4 (b) 211 (c) r b Let u be 4/70(84/(-30))/((-62)/155). What is the third biggest value in u, 0.5, -9, -8? -8 Let w = -482.4 - -483.4. What is the third biggest value in w, 0.2, 2/5, 23, 0.1? 2/5 Let g be ((-23)/(-6) - -1) + -4. Let w = 4190.1 + -4190. Which is the second biggest value? (a) w (b) 8 (c) g c Let t = 0 + 0.2. Let o(g) = -14g*2 + 308g + 6. Let u be o(22). Let m be ((-4)/u)/((-26)/312). What is the second smallest value in t, 2/3, m, -1? t Let y = 6778.99 - 6779. What is the second smallest value in 7, y, 0? 0 Let q = -3 - -2.8. Let j = 1/4045 - -4043/8090. What is the third smallest value in -0.08, j, q? j Let l = 4602/5 - 920. Let x = -63 - -69.6. Let t = -7 + x. What is the third biggest value in -3, t, l? -3 Let a = -188.9659 + -0.0341. Let y = -188 - a. Let q = -1 - -4/5. What is the second smallest value in y, 4, q, 0.1? 0.1 Let l = 136.5 + 41.5. Let i = l - 180. What is the third smallest value in 0.2, 5, i? 5 Let q = -3 - 0. Let v = -0.0628 - 30.2372. Let x = v - -30. Which is the second biggest value? (a) q (b) 1 (c) x (d) -5 c Let z be 7(-3)/181. Let m = -81/70 - -20147/17290. Let g = m - 259/1482. Which is the second smallest value? (a) z (b) -3 (c) g a Let j = 6.52 + -3.48. Let i = 6.04 - j. Let s be 6/14(-2)/3. Which is the second smallest value? (a) -3 (b) 0 (c) i (d) s d Let s(i) = i3 + 6i*2 + 4i - 5. Let u be s(-5). Let a be (-37)/5 - -1 - 450/(-3675)49. What is the biggest value in u, -4/11, a, -3? u Let z = 38.4 - 38. Let l be 3 - -15(-8)/36. Let m = 2.4 - 2.1. Which is the second biggest value? (a) l (b) -2/13 (c) m (d) z c Let a be (-8930)/(-57) - -39 - (-2)/(-3). What is the biggest value in -2, a, 0.02, -4/7, -2/7? a Let f = -1.3 + 1.4. Let h = -1550 - -17054/11. What is the smallest value in f, 0.3, h, 5? f Let x be -4 + (-86)/(-24) + 4/16. Let h = 23.7 - -2.3. Let s = 26 - h. Which is the second biggest value? (a) -1/4 (b) x (c) s b Let u = 908 + -908. Let t be 20/32(-2)/(-5). Which is the third smallest value? (a) -0.09 (b) u (c) -3 (d) t b Let f = -11.7286 + 1.7286. What is the third smallest value in 1, 0, f, 2, 4? 1 Let m = 2 - 2.5. Let i = 105597/4 - 26399. Let p = 2 - -1. Which is the biggest value? (a) i (b) 2/15 (c) p (d) m c Let j(p) = -4p*3 + 14p*2 - 10p + 9. Let y be j(3). Suppose 2v + 5 = -3i + 2i, -i + 1 = -4v. What is the third smallest value in v, y, 0? 0 Let m = 3225 + -3224.5. What is the fifth biggest value in -0.8, -0.2, m, 3, 0.12? -0.8 Let t(w) = 6w + 30. Let n be t(-3). Let z be (2 + 0 + -3)/((-42)/n). What is the third biggest value in 0.4, z, 4, -3/4? z Let p = 786943/53 + -14848. Which is the second smallest value? (a) 2 (b) p (c) -1/2 (d) 0.01 b Let t = -11883 - -11864. Which is the second biggest value? (a) -0.4 (b) t (c) -3/2 (d) -0.002 a Let f = -8532 + 8532.4. Suppose 2u + 4p - 6 = 0, u - 29 = -4u + 4p. Let r = -0.3 - -0.3. What is the fourth smallest value in 8, r, u, f? 8 Let f = -87 - -88. Let m = -311 - -311.1. Which is the smallest value? (a) -2/7 (b) 2/3 (c) f (d) m a Let p = 28 + -27.86. Let r be 2/(-40) + (-1551)/2068. What is the biggest value in p, 1/11, -3/4, r? p Let d = 0.07189 - 0.17189. Which is the second smallest value? (a) d (b) -5 (c) 3 a Let q be (-3 + 7 + -3)/4. Suppose -10y + 11*y - 16 = 0. Let v be 92/(-32) + (-2)/y. Which is the thi	{ "pile_set_name": "DM Mathematics" }
8. Sort 1/2, 2/5, v, 1, -6 in descending order. 1, 1/2, 2/5, v, -6 Suppose f - 4d - 10 = -19, 4f - 9 = d. Suppose 39x + 9 = -fo + 37x, 0 = -2o - 2x - 8. Sort 7, o, 5. o, 5, 7 Suppose 7 = -5i - 4c, -23c - 2 = 2i - 21c. Suppose -3s = -0s - 24. Suppose -4n - 7 - 4 = -3k, -2k = -2n - s. Sort n, i, 3 in increasing order. i, n, 3 Let g = -1282 + 1277. Sort 3, -3, 5, -35, g in descending order. 5, 3, -3, g, -35 Let g be 330/36 - 2/12. Suppose 0w - g = 3w. Suppose -u - 6 = -3o, 0 = -0o + 3o + 2u - 15. Put -1, w, o in decreasing order. o, -1, w Suppose 2i + 4u = -10, -u + 36 = -5i + 11. Let d = -11 + 8. Put d, -4, 0, i in descending order. 0, d, -4, i Let r(g) = -2g + 6. Let a be r(6). Suppose -11w + 8w - 5w = 0. Suppose w = 7d + 6d. Sort -2, d, a in increasing order. a, -2, d Let n = 10.022 - 10. Let t = -5.022 + n. Let l = 9 - 13. Put l, t, 1 in decreasing order. 1, l, t Let t = -61 + 105. Let m = 15595 + -15597. Put -4, t, m in descending order. t, m, -4 Let q = -0.4 - 0. Let r be 2/8 + (-235)/(-20). Let d be (-40)/18 - (r/(-6) - 0). Put d, 5, q in increasing order. q, d, 5 Let j = -2368 - -2371. Suppose 0 = 4d + 4w + 72, 4d - 14 + 93 = 3w. Put -4, d, -2, j in descending order. j, -2, -4, d Let l = -91 + 95. Let y(s) = s2 - 8s + 9. Let c be y(7). Suppose -5b + 0v + v = 17, 0 = -lb + cv - 10. Put 3, -1, 0, b in descending order. 3, 0, -1, b Let z be (87/(-6))/((-2)/4). Let i(p) = p*3 - 31p*2 + 59p - 42. Let x be i(z). Sort 3, 0, x in ascending order. x, 0, 3 Let y = -432 + 7342/17. Let w = -619 + 762.1. Let q = -141 + w. Sort 4, y, q in descending order. 4, q, y Suppose 2q - 5q = 68q - 142. Put 3, q, -1, 14 in descending order. 14, 3, q, -1 Let p = 8 - 7. Let h = -35 + p. Suppose -6n - 40 = 2u - 26, n = 3u - 19. Put 5, h, n in increasing order. h, n, 5 Let r(u) = -6u + 85. Let k be r(14). Suppose q - 3q = -8. Sort 3, -4, q, k in decreasing order. q, 3, k, -4 Let i be 215/172(-1 - (-6)/5). Put -5, 0.06, 0, i in decreasing order. i, 0.06, 0, -5 Let y = 2909 + -2901. Put y, -3, -30 in descending order. y, -3, -30 Let r(c) = 2c*2 - c + 3. Let s be r(1). Suppose -2a - 592 = 14a. Put 2, a, 3, s in descending order. s, 3, 2, a Suppose 32a = 30a - 22. Let r be (3 - -1) + 69 + -1 + 5. Let o = r + -81. Sort a, o, 1 in ascending order. a, o, 1 Let z(m) = -62m + 7821. Let i be z(126). Suppose -4v + 7 = -5. Put v, i, 0, 4 in increasing order. 0, v, 4, i Suppose -5p = -3l + 27, p - 6 = -3l - p. Suppose -8q - 3 = -5q. Suppose -3z + 103 = 103. Sort q, z, l. q, z, l Let x be (-3 + -3(-4)/6)15. Let w be (x/90)/((-2)/16). Put -0.05, 1/4, 4, w in ascending order. -0.05, 1/4, w, 4 Let n be ((-2)/(-6))/115. Suppose 24y = 18y + 24. Suppose -r + 7 = 4q, 0 = 7r - yr + 5q. Put n, 3, r, -2 in descending order. n, 3, -2, r Let b = 2.2 - 2.5. Let j = -10.432 + 10.032. Sort -2/7, j, b, 5. j, b, -2/7, 5 Let u = -0.02 + -0.03. Let m = 13.85 - u. Let v = -14 + m. Sort 0, v, -0.7, 3/5 in descending order. 3/5, 0, v, -0.7 Let y = 10250 + -10245. Sort -13, -10, y, 3, -2. -13, -10, -2, 3, y Let m = -1.44 + 1.693. Let r = -0.053 + m. Sort 0.19, r, 5, 3. 0.19, r, 3, 5 Let x = -28 - -27. Let w = -4681 + 4695. Put w, 5, 4, x in increasing order. x, 4, 5, w Let j be 3/(-20) - ((-128)/20 - -6). Let u = -49 + 49.1. Put 0.4, -4, u, j in increasing order. -4, u, j, 0.4 Let b be (-426)/(-30) - (-5)/(-25). Suppose 21f = -b - 7. Put 5, 4, f in ascending order. f, 4, 5 Let y = -30009 + 30014. Put 40, 25, y, 2 in ascending order. 2, y, 25, 40 Let u = -5400 - -5401. Let i = 30 + -27. Sort u, -389, i. -389, u, i Let s = -29.7 - -26.7. Let t = -2.6 - -2.46. Put s, 2/3, t in increasing order. s, t, 2/3 Let t = 239 + -235. Let r(i) = 11i*2 - 41i - 5. Let p be r(t). Let n be (10/(-8))/((-1)/4). Sort 4, n, 2, p. 2, 4, n, p Let i be ((-40)/96-2)/(2/12) - 0. Sort 1, -4, -12, i, 51 in ascending order. -12, -4, 1, i, 51 Let t be 48(3 - 40/6). Let i = -168 - t. Suppose c - 6 = -c. Sort c, -1, i, -3. -3, -1, c, i Let n = -271 + -16. Let b = n + 284.5. Sort b, 0.3, 5, -1/3 in decreasing order. 5, 0.3, -1/3, b Let z(b) = -b*3 - 37b*2 + 28b - 364. Let m be z(-38). Sort -6, m, 1. -6, 1, m Suppose 0 = 5s - 2s - 9. Sort 4, 1, -4, s, 6 in increasing order. -4, 1, s, 4, 6 Let c be (72/(-32))/(-2 + (3 - 6/24)). Let d be (2/(-3))/(2/(-12)). Let o(q) = -q*2 - 3q - 1. Let x be o(-4). Put d, x, c in decreasing order. d, c, x Let f be 2(-7)/(21/3). Let p be 288/63 - (-8)/(-14). Put 3, p, f, 2 in ascending order. f, 2, 3, p Let i be -1(-2 - -10)-118/(-880). Put -0.5, i, 36.3 in ascending order. i, -0.5, 36.3 Let j(d) = -712 - 712 - d + 1414. Let m be j(-6). Sort -1, m, 15, 1. m, -1, 1, 15 Let x(f) = 2f - 8. Let d be x(6). Let q be 24/30 - (-1176)/(-20). Let r = q - -63. Sort r, -3, d. -3, d, r Let g = -112 - -171.5. Let k = g - 11.5. Let n = 40 - k. Put n, -3, 0.5 in descending order. 0.5, -3, n Let p = 346 + -347. Sort -178, 2, p in ascending order. -178, p, 2 Let g be 825/(-220)44/3. Let l be ((-2)/(-3))/(42/(-27)). Put l, g, -1/3, 0.5 in increasing order. g, l, -1/3, 0.5 Suppose 29f - 26f = -69f - 72. Put f, 1, -5, 3, 40 in decreasing order. 40, 3, 1, f, -5 Let w = 29 - 29.07. Let p = 359 + -359. Put -2, p, w, 0.3 in descending order. 0.3, p, w, -2 Suppose 9g + 219 = 12g. Let u = g + -68. Let y(j) = j2 - 22j - 46. Let m be y(24). Put m, 0, u in ascending order. 0, m, u Suppose 0 = 10p - p + 17p - 26. Suppose -4 = -3l + 2b, 5l - 5b + 9 = 24. Sort p, l, -1 in ascending order. l, -1, p Let z(c) = c*2 - 11c - 106. Let a be z(17). Put a, -1, 2, -525, 3 in descending order. 3, 2, -1, a, -525 Suppose -4a - 5d + 3 = 0, a + 5d - 2d = 6. Sort 652, a, 4. a, 4, 652 Let b = 647556 - 647561. Let t(k) be the second derivative of k5/20 + k4/6 - k*3/6 + 2k*2 + k. Let d be t(-3). Sort 0, b, 3, d in decreasing order. 3, 0, d, b Let c be -15-3(-2)/(-30). Let b be (-10)/(-5)(c - (-21)/(-6)). Put -5, b, 15 in increasing order. -5, b, 15 Let t be (-2)/14 - (-385)/(-49). Let h be (1/2)/(t/(-240)). Let z = 11 + -8. Sort 2/13, z, h in descending order. h, z, 2/13 Let t(p) = 2p2 - 142p + 1414. Let y be t(12). Sort -5/4, y, -4/5 in descending order. -4/5, -5/4, y Let g(l) = l*2 - l + 4. Let u be g(-3). Suppose 4w = u, -i - 4i - 10 = -5w. Sort -2, 4, i, -1 in descending order. 4, i, -1, -2 Suppose -584 = 3m - 149. Let a be (3 - 580/12)/(20/60). Let r = a - m. Sort -3, r, 3, 5 in ascending order. -3, 3, 5, r Let h = 262.21 + -263. Let y = h + 0.29. Put y, 2, 3, 0.12 in increasing order. y, 0.12, 2, 3 Let t = -13 - -18. Let s = 9485 + -9481. Sort t, s, -20 in descending order. t, s, -20 Suppose -2k = -5d + 64, 4d = -0d - k + 59. Put -6, d, -4, 3 in descending order. d, 3, -4, -6 Let x = 516.2 - 516. Suppose 5w + 179 = -3s, 3s - 43 = w - 0s. Let q be w/(-7) - (-15 - -18). Sort q, x, 1/3. x, 1/3, q Let q(y) = -y + 1. Let o be q(-3). Let u = 1229 + -1231. Let a be -7(-3 - u) - 6. Put o, 0, 3, a in decreasing order. o, 3, a, 0 Let b = 6 - 9. Let v(n) = 3 - 4n - 13 + 0n + 1. Let u be v(b). Put -2, 5, 4, u in increasing order. -2, u, 4, 5 Let b = 8603 - 8588. Let m be (16/(-36))/(2/(-9)). Sort b, -2, m. -2, m, b Let l = 4.804 + -5.004. Put -868, l, 2/9, 3/7 in descending order. 3/7, 2/9, l, -868 Let i = 8 + -6. Suppose -5j - 2q = -q + 3, -3j = iq - 1. Suppose -8m + 400 = 133m - 23. Put 2, m, j, -2 in decreasing order. m, 2, j, -2 Suppose h + 102 = 5d, 2d + 3h - 51 = -0h. Suppose -4z - 4y = -5 + 1, 0 = z + 5y - d. Sort -2, 53, z in descending order. 53, -2, z Let u = -15.909 - -0.909. Put 0.108, 0.5, u, -1/7 in ascending order. u, -1/7, 0.108, 0.5 Let p(y) = -y2 - 9y + 19. Let s(b) = b*3 + 6b*2 + 2b - 4. Let g be s(-5). Suppose 23k + g = 22k. Let x be p(k). Put -5, -4, x in decreasing order. x, -4, -5 Suppose -3i + 36 = 2d, 0d - d = -3i + 27. Suppose 2m + i = 2s - 4s, -8 = -2m + 4s. Let q = -2.2 + 1.8. Sort m, 8/9, q in descending order. 8/9, q, m Let l = -32.1 - -34.1. Let y = -0.67 - 0.63. Let o = y + 0.3. Put l, -0.1, 1/7, o in descending order. l, 1/7, -0.1, o Let v be -10(7/(-5) + 1*(9 - 9)). Put v, 1, -4, 5, 55 in increasing order. -4, 1, 5, v, 55 Let r = -1335 + 1335.2. S	{ "pile_set_name": "DM Mathematics" }
2 + 14 - 46467g*2) to rg*3 + jg*2 + lg + d + sg4 and give l. 14 Rearrange 0c + 2c - 3c + (1 - 1 - 2)(-c + 3c + 15 - 10 + 23c + 3c - 5c + 4c - 3c - 2c + (1 + 2c - 1)(-2 + 1 + 3)) to ac + t and give a. -53 Express 150b*4 + 2b*2 + 6809 - 3400 - 3410 in the form db*2 + kb*4 + sb*3 + ub + y and give y. -1 Rearrange (-3u - 2u + 1 + 3u)(14 + 10u - 7u - 4u) to the form gu*2 + ku + z and give k. -29 Rearrange (2w - 3w + 0w)(-444w2 + 319w*2 + 3 + 447w*2) to t + jw*3 + aw + qw2 and give j. -322 Rearrange (-1 + 0 + 0)(712a2 - 47a*2 - 197a + 199a) to the form sa + x + la2 and give l. -665 Rearrange (-56 - 252y + 56)(-4y2 - y2 + 6y2) to my*3 + by*2 + dy + a and give m. -252 Rearrange (-f + f + 3f)(0 - 3 + 4 + 2 - 3 + 3 + (0 + 2 - 4)(-1 - 2 + 1) + 2 - 2 - 1 + 0 - 2 + 3)(-49 + 23 - 36) to kf + o and give k. -1302 Express 0j - 7j + 4j - 12j3 + j - j2 - 2j*4 - 4 in the form vj*2 + wj*4 + m + xj*3 + aj and give v. -1 Rearrange -10a - 37a + 15a3 - a2 + 47a - 6 to the form oa + v + ja*2 + ha*3 and give j. -1 Rearrange 3o - 3o2 + 9o*3 - 53 + 0o*3 + 55 - 3o*2 - 5o to xo2 + do*3 + r + bo and give x. -6 Express 3s2 + 1139s*3 - 8s*4 - 1142s*3 - s - s in the form ds*4 + vs*2 + as + h + ys3 and give y. -3 Rearrange -207 + 42 + 0s3 + s3 - 2s3 to the form ms + k + zs3 + qs*2 and give z. -1 Express (-480i - 474i + 952i - 98)(-6i - 7 + 7) in the form q + zi2 + li and give q. 0 Rearrange -3j + 4j + 0j + (j + j - j)(3 - 3 + 2) + 4 + j - 4 - 783 + 783 - 75j to y + aj and give a. -71 Rearrange -345y2 - 7y - y*4 + 344y*2 + 2 - 35y*3 + 4y to v + ny3 + dy + jy2 + ry*4 and give j. -1 Express (-561 - 14 - 48)(-3n - 2n + 3n) in the form on + z and give o. 1246 Express (-5 - 4 + 41)(0 - 4 + 5 - 3p*2) in the form u + mp*2 + lp and give u. 32 Rearrange -3t - 11t - 17 - 2t - 11t + 20t to v + ut and give v. -17 Express 232g - 274g + 11g2 - 10g*2 - 2 - 4g*3 in the form xg + kg2 + s + qg3 and give x. -42 Express -x2 + 45x + 11x*4 - 218x*3 + 218x*3 as fx*3 + yx + t + wx2 + jx*4 and give w. -1 Rearrange (184 - 34 + 53)((2 + 3 - 3)(-3f + 4f - 2f) + (-1 + 1 - f)(-4 + 2 + 6) - 3 - 2f + 3) to the form k + df and give d. -1624 Express (3 - 3 + 34x)(-21x*3 - 2x*2 + 2x*2) as lx*4 + d + hx + bx3 + qx*2 and give l. -714 Rearrange -4v*3 - 14v4 + v3 + 18v + 2v*3 + 12v*4 to cv*3 + iv + rv2 + x + pv*4 and give c. -1 Express 10r*2 - 6r*3 - 10 - 10r*2 + 0r*3 in the form x + cr*3 + jr*2 + gr and give x. -10 Rearrange (5 - 1 - 2)(-t + t + t)(-14 + 0 - 7) + (4 + 1 + 7)(4t - 5t + 2t) - 1 - 2t + 1 to f + ht and give h. -32 Express -977c - 313 + 159 + 154 in the form g + pc and give g. 0 Express (-2 + 0 + 0)(-27p + 14313 - 14313 + (-p + 1 - 1)(0 + 2 - 3)) as ap + h and give h. 0 Rearrange 2j3 + 7j3 + j3 + (-8j2 - 91 + 91)(0j + 4j - 5j) - 4j*3 + 2j*3 + 3j*3 to the form fj + mj3 + nj*2 + x and give m. 19 Rearrange 374a - 66 + 66 to ha + c and give c. 0 Express -2 - 623n + 699n - 1 + 1 + 0 in the form zn + k and give z. 76 Rearrange v + 16 + 0 + 1 - 4 + 3 to t + uv and give u. 1 Express 5r - 1 - 2r - r + (3r + 2 - 2)(3 - 2 - 3) - 358r + 18r - 155r as o + fr and give f. -499 Rearrange -32p2 - 6 - p3 - 5p + 31p*2 - 4p*3 + 3p to the form op2 + a + mp + jp3 and give o. -1 Rearrange (-3o + o - 2o - 2 + (5 - 2 - 2)(o + 3o - o))(9 - 12 + 5 - 32o) to the form r + qo*2 + yo and give y. 62 Express -2 + 26i + i - 3 + 7i - 3i as j + zi and give j. -5 Express -26 - 20 - 18 + 4m2 + 61 - m3 in the form om*2 + cm*3 + tm + l and give l. -3 Express 587 + 216f - 587 as r + zf and give z. 216 Rearrange -g - 3g4 + g + (0 + 0 + 2g*2)(-g + g + 2g2) + 6g*4 + 2 + 23337g - 23337g to the form jg*3 + vg*2 + qg*4 + mg + b and give b. 2 Rearrange -8r2 - 7 + 12r*2 - 2 - 1 + 13r*2 + 2r to ir + w + kr*2 and give k. 17 Rearrange -554v + 167v + 4v*2 + 169v + 167v to z + jv*2 + rv and give r. -51 Rearrange -11c + 13 + 6c + 2c + 4 to the form gc + q and give g. -3 Express 122m - 40m - 108m - 94m in the form d + hm and give h. -120 Express -126p*3 - 34p - 3p2 + 5p*2 + 62p*3 - 2 + 63p3 - p4 in the form wp4 + ip + m + vp2 + hp*3 and give w. -1 Rearrange (-5n + 8n + 2n)(6n*2 - 5n*2 + 2n*2) + 15n*3 - 3 + 3 to the form qn*2 + l + hn*3 + tn and give h. 30 Express (9 - 558x + 9 - 16)(-4x - x + 3x - x - 1 + 1 + (-3x + 4x - 3x)(-4 + 4 - 1)) as q + gx + yx*2 and give g. -2 Express (12w - 45 + 45)(-25 + 67 + 21) in the form z + jw and give j. 756 Rearrange (-1 - 3 + 3)(2y*3 - 159y + 66y + 0y) to by + g + qy*2 + ny*3 and give b. 93 Rearrange (0p - 4p + 3p)(-2p*3 - 3 + 3) + 3p*4 + 264040p*3 - 263950p*3 - 2p*4 to z + qp*4 + fp*2 + gp + jp3 and give q. 3 Rearrange 50b*2 - 162b*2 - 12b*2 + 0b2 - b2 + 2b2 + (-1 + 2 - 3)(b2 + 4 - 4) - b2 - 3b2 + 5b*2 to ub + r + ob2 and give o. -124 Rearrange (468 - 468 - 83x)(x2 - 4 - 1 + 4) to the form b + ux*3 + zx + lx2 and give z. 83 Express 4h*2 + 195h*2 + 8h*2 in the form rh + th2 + k and give k. 0 Rearrange 667a + 9 - 4 - 193a - 5 to the form j + qa and give q. 474 Rearrange 277p2 - 276p*2 + 7p - 3p + p to the form ap*2 + jp + o and give a. 1 Rearrange -4y2 + y3 - 5y*2 - 7y*2 + 10y*2 + 5y*2 + 37 to the form k + oy*3 + ay*2 + ty and give a. -1 Rearrange 5 - 5 + y3 + (y2 + y - y)(0y + 0y - 2y)(12 - 7 + 31)(-7 + 4 + 4)(-1 - 1 + 0) to hy*2 + xy + l + ay3 and give l. 0 Express (4b*2 - 2b2 + b2)(-14 - 12 - 18)(0 + 2 - 4) as w + ob2 + qb and give o. 264 Express -931h - 2 - 934h - 927h + 136h*2 + 2790h as mh2 + d + ah and give a. -2 Express 1 + 4 - 3 + 558a - 1 as x + ta and give t. 558 Rearrange (25y + 22y + 14y)(-4 + 6 - 1)(-19 + 7 + 11 + 5y*2 - 4y) to the form gy2 + o + vy + ry3 and give g. -244 Rearrange 8t - 2t2 - 8t - 2t2 - 5t2 + t2 + (-4t + 0t + 6t)(-2t - t + t) to the form jt*2 + u + xt and give j. -12 Rearrange 1 + 10o - 56o*3 - 8o + 20o3 + (o2 + 2o*2 - 2o*2)(-2 + 2 + o) to the form ko2 + do*3 + s + wo and give w. 2 Rearrange -47 + 86 + 5g2 - 41 + 0g*3 + 4g*3 to wg + mg2 + i + dg*3 and give d. 4 Express -2p*3 + 32 + 51 + 23p - 11p + 0p - 7p as bp*2 + op + hp3 + k and give h. -2 Rearrange 304j + 32j + 46j + 247j - 111j to t + sj and give s. 518 Rearrange 56 + 9v - 5v - 2v - 4v to a + zv and give z. -2 Rearrange 9r - 16 - 8r*2 + 11r*2 + 9 to wr*2 + b + sr and give b. -7 Express -4 - 5 + 4b3 + 9 - 325b - 2b3 in the form mb*2 + ib*3 + xb + k and give k. 0 Express (106 - 353 + 129)(2 - 3 + 2 - 3x) in the form bx + q and give q. -118 Rearrange 71h - 15 + 70h - 189h + 57h to the form x + lh and give x. -15 Rearrange (234756f - 234756f - 64f2)(2f2 - f2 - 2f*2) to rf*4 + af + gf3 + qf*2 + b and give r. 64 Express 3o*4 - 1268o - 10o4 + 632o - 2 - 2o2 + 640o as c + vo2 + jo*4 + wo*3 + ho and give c. -2 Express 2n + 3n*3 - 3n + 2n + (29n*3 + 14n*3 - 23n*3)(1 + 2 - 1) + 0 + 0 + 3n3 in the form bn + q + mn3 + xn*2 and give m. 46 Rearrange (a + 0a + 2a + (0 + 5 - 3)(0 + 0 - a) + a + 5a - 5a)(-9 + 8 + 3a - a) to the form xa + ka*2 + w and give k. 4 Rearrange 54q*2 + 0q - 2q - 111q*2 - 107q*2 to the form vq + k + xq2 and give x. -164 Rearrange (-38v + 24 - 24)(-2v*2 - 4v*2 + 4v*2)(-1 - 23 + 76) to the form jv + fv*3 + mv*2 + w and give f. 3952 Express (-3z - 5z - z)(-2z + 0z + 4z)(-1 + 0z - z + 2) in the form nz*2 + hz + lz3 + v and give h. 0 Rearrange -15k*3 + 3 + 0k*3 - 4k*2 - 11 + 7 + 7 to j + zk*2 + lk*3 + sk and give z. -4 Express 34420 - 34420 + 362c in the form y + zc and give z. 362 Express 134x - 687x - 148x + 303x in the form m + a	{ "pile_set_name": "DM Mathematics" }
est integer? 1541 What is the cube root of 25210337 to the nearest integer? 293 What is the sixth root of 758878 to the nearest integer? 10 What is 3151736 to the power of 1/2, to the nearest integer? 1775 What is 2585915 to the power of 1/5, to the nearest integer? 19 What is the square root of 29677 to the nearest integer? 172 What is the fourth root of 367438 to the nearest integer? 25 What is the square root of 1211387 to the nearest integer? 1101 What is the seventh root of 423331 to the nearest integer? 6 What is 476255 to the power of 1/8, to the nearest integer? 5 What is 2370126 to the power of 1/9, to the nearest integer? 5 What is 3194241 to the power of 1/3, to the nearest integer? 147 What is the cube root of 2920093 to the nearest integer? 143 What is the cube root of 408606 to the nearest integer? 74 What is the eighth root of 6703469 to the nearest integer? 7 What is 1253749 to the power of 1/2, to the nearest integer? 1120 What is the eighth root of 50060 to the nearest integer? 4 What is 40038 to the power of 1/7, to the nearest integer? 5 What is 102476 to the power of 1/3, to the nearest integer? 47 What is the square root of 1239847 to the nearest integer? 1113 What is the cube root of 5355377 to the nearest integer? 175 What is 401561 to the power of 1/5, to the nearest integer? 13 What is the third root of 517354 to the nearest integer? 80 What is the third root of 8331735 to the nearest integer? 203 What is 358785 to the power of 1/5, to the nearest integer? 13 What is 119969 to the power of 1/4, to the nearest integer? 19 What is the square root of 19664088 to the nearest integer? 4434 What is the cube root of 225998 to the nearest integer? 61 What is 537957 to the power of 1/2, to the nearest integer? 733 What is the cube root of 262230 to the nearest integer? 64 What is the third root of 18687186 to the nearest integer? 265 What is 626011 to the power of 1/3, to the nearest integer? 86 What is the square root of 268866 to the nearest integer? 519 What is 5859394 to the power of 1/2, to the nearest integer? 2421 What is 75182 to the power of 1/6, to the nearest integer? 6 What is 8354309 to the power of 1/7, to the nearest integer? 10 What is 703888 to the power of 1/2, to the nearest integer? 839 What is 190169 to the power of 1/4, to the nearest integer? 21 What is 8490091 to the power of 1/2, to the nearest integer? 2914 What is the fourth root of 803849 to the nearest integer? 30 What is 179042 to the power of 1/3, to the nearest integer? 56 What is 18227430 to the power of 1/6, to the nearest integer? 16 What is 19169734 to the power of 1/7, to the nearest integer? 11 What is 3038647 to the power of 1/7, to the nearest integer? 8 What is 940766 to the power of 1/8, to the nearest integer? 6 What is the third root of 227838 to the nearest integer? 61 What is 321349 to the power of 1/9, to the nearest integer? 4 What is 2798689 to the power of 1/2, to the nearest integer? 1673 What is 1575739 to the power of 1/10, to the nearest integer? 4 What is 1089852 to the power of 1/4, to the nearest integer? 32 What is the fifth root of 338818 to the nearest integer? 13 What is the square root of 32613696 to the nearest integer? 5711 What is 52278 to the power of 1/9, to the nearest integer? 3 What is 5021692 to the power of 1/8, to the nearest integer? 7 What is the square root of 8730239 to the nearest integer? 2955 What is the square root of 13850474 to the nearest integer? 3722 What is 117100 to the power of 1/9, to the nearest integer? 4 What is the tenth root of 599159 to the nearest integer? 4 What is the square root of 25548675 to the nearest integer? 5055 What is 2379962 to the power of 1/4, to the nearest integer? 39 What is the tenth root of 14310067 to the nearest integer? 5 What is the square root of 1233257 to the nearest integer? 1111 What is 1474620 to the power of 1/3, to the nearest integer? 114 What is the square root of 14823562 to the nearest integer? 3850 What is the seventh root of 694611 to the nearest integer? 7 What is the cube root of 25530322 to the nearest integer? 294 What is 915666 to the power of 1/2, to the nearest integer? 957 What is 10001049 to the power of 1/5, to the nearest integer? 25 What is the square root of 263695 to the nearest integer? 514 What is the square root of 223010 to the nearest integer? 472 What is 9746340 to the power of 1/3, to the nearest integer? 214 What is the fourth root of 5122602 to the nearest integer? 48 What is 1105701 to the power of 1/8, to the nearest integer? 6 What is the square root of 135879 to the nearest integer? 369 What is the cube root of 864625 to the nearest integer? 95 What is 270476 to the power of 1/3, to the nearest integer? 65 What is the cube root of 20362645 to the nearest integer? 273 What is the third root of 7675795 to the nearest integer? 197 What is the third root of 7302654 to the nearest integer? 194 What is the ninth root of 21633894 to the nearest integer? 7 What is the square root of 2783046 to the nearest integer? 1668 What is the square root of 29541491 to the nearest integer? 5435 What is the square root of 441499 to the nearest integer? 664 What is the square root of 770007 to the nearest integer? 878 What is 30536967 to the power of 1/3, to the nearest integer? 313 What is 147035 to the power of 1/4, to the nearest integer? 20 What is the third root of 213960 to the nearest integer? 60 What is 2784728 to the power of 1/4, to the nearest integer? 41 What is the square root of 48741 to the nearest integer? 221 What is the fifth root of 4611480 to the nearest integer? 22 What is 935267 to the power of 1/2, to the nearest integer? 967 What is the square root of 10953321 to the nearest integer? 3310 What is the square root of 217544 to the nearest integer? 466 What is the eighth root of 374425 to the nearest integer? 5 What is 1114821 to the power of 1/3, to the nearest integer? 104 What is the fourth root of 184887 to the nearest integer? 21 What is the third root of 4225598 to the nearest integer? 162 What is 376126 to the power of 1/3, to the nearest integer? 72 What is 593211 to the power of 1/2, to the nearest integer? 770 What is the cube root of 3746797 to the nearest integer? 155 What is 7910638 to the power of 1/7, to the nearest integer? 10 What is 1238176 to the power of 1/2, to the nearest integer? 1113 What is the square root of 1264114 to the nearest integer? 1124 What is 793006 to the power of 1/2, to the nearest integer? 891 What is the cube root of 2643972 to the nearest integer? 138 What is the ninth root of 582079 to the nearest integer? 4 What is the fifth root of 201626 to the nearest integer? 12 What is the square root of 323377 to the nearest integer? 569 What is the fifth root of 631817 to the nearest integer? 14 What is 5395626 to the power of 1/10, to the nearest integer? 5 What is the third root of 461591 to the nearest integer? 77 What is 274079 to the power of 1/10, to the nearest integer? 3 What is 2243162 to the power of 1/3, to the nearest integer? 131 What is 30906 to the power of 1/6, to the nearest integer? 6 What is the square root of 107960 to the nearest integer? 329 What is 155227 to the power of 1/2, to the nearest integer? 394 What is 941263 to the power of 1/9, to the nearest integer? 5 What is 1583465 to the power of 1/3, to the nearest integer? 117 What is the cube root of 115344 to the nearest integer? 49 What is the seventh root of 395741 to the nearest integer? 6 What is the seventh root of 874955 to the nearest integer? 7 What is 107700 to the power of 1/3, to the nearest integer? 48 What is 29305128 to the power of 1/9, to the nearest integer? 7 What is the square root of 23001025 to the nearest integer? 4796 What is 4609633 to the power of 1/5, to the nearest integer? 22 What is the eighth root of 39507 to the nearest integer? 4 What is 165088 to the power of 1/2, to the nearest integer? 406 What is 419940 to the power of 1/2, to the nearest integer? 648 What is the third root of 216152 to the nearest integer? 60 What is the eighth root of 796244 to the nearest integer? 5 What is 139321 to the power of 1/3, to the nearest integer? 52 What is 14101 to the power of 1/2, to t	{ "pile_set_name": "DM Mathematics" }
at is 139 minutes after 10:47 PM? 1:06 AM What is 676 minutes after 6:13 PM? 5:29 AM What is 327 minutes after 6:21 PM? 11:48 PM How many minutes are there between 10:26 AM and 2:30 PM? 244 What is 481 minutes after 1:47 PM? 9:48 PM How many minutes are there between 11:38 AM and 10:19 PM? 641 What is 283 minutes after 8:53 AM? 1:36 PM What is 687 minutes before 3:13 AM? 3:46 PM What is 611 minutes before 9:29 AM? 11:18 PM What is 175 minutes before 2:42 AM? 11:47 PM What is 408 minutes after 2:14 PM? 9:02 PM How many minutes are there between 5:28 AM and 3:09 PM? 581 What is 305 minutes before 10:27 AM? 5:22 AM What is 439 minutes before 5:38 PM? 10:19 AM What is 543 minutes after 4:10 PM? 1:13 AM What is 448 minutes after 3:14 PM? 10:42 PM How many minutes are there between 6:28 PM and 5:45 AM? 677 What is 291 minutes after 12:19 PM? 5:10 PM What is 374 minutes before 4:18 AM? 10:04 PM What is 496 minutes before 8:05 PM? 11:49 AM How many minutes are there between 11:32 PM and 10:49 AM? 677 How many minutes are there between 10:33 PM and 9:58 AM? 685 What is 714 minutes after 8:58 AM? 8:52 PM What is 676 minutes after 6:46 PM? 6:02 AM What is 172 minutes after 1:00 AM? 3:52 AM What is 446 minutes before 6:13 AM? 10:47 PM What is 324 minutes after 1:08 AM? 6:32 AM How many minutes are there between 12:51 AM and 4:18 AM? 207 How many minutes are there between 1:32 AM and 7:45 AM? 373 How many minutes are there between 6:33 PM and 1:59 AM? 446 What is 609 minutes before 2:33 PM? 4:24 AM How many minutes are there between 5:13 PM and 3:59 AM? 646 What is 236 minutes before 10:28 AM? 6:32 AM How many minutes are there between 2:18 PM and 11:34 PM? 556 What is 25 minutes before 7:47 PM? 7:22 PM How many minutes are there between 8:38 AM and 5:37 PM? 539 What is 624 minutes after 7:16 AM? 5:40 PM What is 313 minutes before 1:11 PM? 7:58 AM How many minutes are there between 10:51 AM and 10:22 PM? 691 How many minutes are there between 6:16 AM and 1:55 PM? 459 How many minutes are there between 7:03 PM and 2:29 AM? 446 How many minutes are there between 7:50 PM and 5:39 AM? 589 What is 669 minutes after 4:43 PM? 3:52 AM What is 599 minutes before 3:30 AM? 5:31 PM How many minutes are there between 10:53 AM and 6:01 PM? 428 How many minutes are there between 9:45 PM and 10:34 PM? 49 How many minutes are there between 4:35 PM and 11:54 PM? 439 What is 524 minutes after 9:57 AM? 6:41 PM What is 145 minutes after 6:03 AM? 8:28 AM What is 630 minutes before 10:08 AM? 11:38 PM How many minutes are there between 7:21 PM and 7:41 PM? 20 How many minutes are there between 7:12 PM and 9:31 PM? 139 How many minutes are there between 10:59 AM and 1:38 PM? 159 What is 556 minutes before 10:27 PM? 1:11 PM What is 672 minutes before 11:36 AM? 12:24 AM What is 424 minutes after 11:37 AM? 6:41 PM How many minutes are there between 10:01 AM and 2:47 PM? 286 How many minutes are there between 7:19 AM and 9:22 AM? 123 How many minutes are there between 9:59 AM and 11:16 AM? 77 What is 706 minutes before 5:44 PM? 5:58 AM How many minutes are there between 6:29 PM and 11:46 PM? 317 How many minutes are there between 8:03 AM and 10:36 AM? 153 How many minutes are there between 5:55 AM and 7:38 AM? 103 What is 423 minutes before 7:20 AM? 12:17 AM What is 250 minutes before 9:00 AM? 4:50 AM How many minutes are there between 2:48 PM and 12:47 AM? 599 How many minutes are there between 10:54 AM and 3:54 PM? 300 What is 194 minutes after 1:28 AM? 4:42 AM How many minutes are there between 5:53 AM and 9:59 AM? 246 How many minutes are there between 6:59 PM and 12:01 AM? 302 How many minutes are there between 5:52 PM and 6:55 PM? 63 How many minutes are there between 12:41 AM and 4:18 AM? 217 How many minutes are there between 1:50 PM and 2:52 PM? 62 What is 644 minutes after 6:24 PM? 5:08 AM What is 595 minutes before 3:04 PM? 5:09 AM What is 585 minutes after 4:58 AM? 2:43 PM How many minutes are there between 8:04 AM and 8:18 AM? 14 How many minutes are there between 2:28 PM and 5:51 PM? 203 What is 491 minutes after 10:23 AM? 6:34 PM How many minutes are there between 9:38 AM and 8:25 PM? 647 What is 372 minutes after 9:58 PM? 4:10 AM How many minutes are there between 10:24 PM and 12:21 AM? 117 What is 524 minutes after 8:03 AM? 4:47 PM What is 156 minutes before 11:38 PM? 9:02 PM What is 359 minutes after 4:05 PM? 10:04 PM How many minutes are there between 1:18 AM and 7:31 AM? 373 How many minutes are there between 3:42 PM and 9:09 PM? 327 How many minutes are there between 7:42 PM and 6:23 AM? 641 How many minutes are there between 6:21 PM and 1:47 AM? 446 How many minutes are there between 2:31 PM and 3:48 PM? 77 How many minutes are there between 4:03 PM and 1:49 AM? 586 What is 681 minutes after 2:15 PM? 1:36 AM What is 90 minutes before 6:23 PM? 4:53 PM How many minutes are there between 4:49 PM and 7:10 PM? 141 How many minutes are there between 6:57 AM and 3:24 PM? 507 What is 660 minutes after 1:49 PM? 12:49 AM How many minutes are there between 2:22 AM and 9:46 AM? 444 What is 578 minutes before 10:14 PM? 12:36 PM How many minutes are there between 3:53 PM and 5:22 PM? 89 What is 313 minutes before 2:31 AM? 9:18 PM What is 543 minutes after 4:27 AM? 1:30 PM How many minutes are there between 1:33 PM and 10:52 PM? 559 What is 520 minutes before 8:55 AM? 12:15 AM How many minutes are there between 8:16 AM and 5:54 PM? 578 What is 195 minutes before 1:45 AM? 10:30 PM What is 414 minutes after 3:17 PM? 10:11 PM What is 458 minutes before 2:27 AM? 6:49 PM How many minutes are there between 4:50 AM and 3:54 PM? 664 How many minutes are there between 9:45 PM and 10:41 PM? 56 How many minutes are there between 1:28 PM and 10:56 PM? 568 What is 709 minutes after 9:59 AM? 9:48 PM How many minutes are there between 8:32 PM and 4:10 AM? 458 How many minutes are there between 11:30 PM and 8:37 AM? 547 What is 173 minutes after 12:49 PM? 3:42 PM What is 286 minutes before 7:15 PM? 2:29 PM What is 669 minutes after 1:30 PM? 12:39 AM What is 327 minutes after 11:06 AM? 4:33 PM What is 530 minutes after 5:27 PM? 2:17 AM What is 699 minutes before 12:19 PM? 12:40 AM What is 366 minutes before 12:48 AM? 6:42 PM What is 331 minutes after 10:52 PM? 4:23 AM How many minutes are there between 6:34 AM and 7:25 AM? 51 How many minutes are there between 1:41 AM and 7:35 AM? 354 What is 11 minutes before 5:47 PM? 5:36 PM How many minutes are there between 10:26 PM and 11:28 PM? 62 How many minutes are there between 9:32 AM and 1:28 PM? 236 How many minutes are there between 7:43 AM and 4:17 PM? 514 How many minutes are there between 8:28 AM and 4:41 PM? 493 What is 283 minutes before 4:00 PM? 11:17 AM How many minutes are there between 4:31 PM and 4:41 PM? 10 How many minutes are there between 1:55 PM and 11:50 PM? 595 How many minutes are there between 2:02 PM and 6:00 PM? 238 How many minutes are there between 10:16 AM and 2:42 PM? 266 How many minutes are there between 11:09 AM and 1:37 PM? 148 What is 592 minutes before 4:21 PM? 6:29 AM How many minutes are there between 12:46 AM and 6:46 AM? 360 How many minutes are there between 11:52 PM and 4:29 AM? 277 How many minutes are there between 12:49 AM and 11:28 AM? 639 How many minutes are there between 8:35 AM and 3:25 PM? 410 How many minutes are there between 1:46 AM and 6:23 AM? 277 What is 260 minutes after 5:10 PM? 9:30 PM How many minutes are there between 10:44 PM and 7:11 AM? 507 What is 514 minutes after 11:50 AM? 8:24 PM How many minutes are there between 10:05 PM and 10:41 PM? 36 How many minutes are there between 4:51 PM and 11:49 PM? 418 What is 251 minutes before 9:44 PM? 5:33 PM What is 115 minutes before 10:54 PM? 8:59 PM How many minutes are there between 1:25 PM and 5:59 PM? 274 What is 391 minutes before 7:43 AM? 1:12 AM What is 277 minutes after 8:29 AM? 1:06 PM What is 592 minutes before 3:50 PM? 5:58 AM What is 360 minutes after 11:26 PM? 5:26 AM What is 254 minutes after 9:05 AM? 1:19 PM What is 292 minutes after 8:58 PM? 1:50 AM What is 559 minutes before 1:38 PM? 4:19 AM How many minutes are there between 10:27 PM and 6:27 AM? 480 How many minutes are there between 1:25 PM and 8:05 PM? 400 What is 279 minu	{ "pile_set_name": "DM Mathematics" }
ming c is positive. c140 Simplify (a/(a22a)a/(a(-2/25)/a))(-44) assuming a is positive. a*(21912/25) Simplify (q/(q/(qq(1/4))))(-1/24)/(q*(-5/2)q)(-45) assuming q is positive. q(-6485/96) Simplify (mm(3/4))/(m((mm(-4/5))/m)/mm)(m(-1/6))(-3/26) assuming m is positive. m(102/65) Simplify (rrr/(r(-2)/r))/rr*(-4/13)(r/(r/r(-6)))(-13/7) assuming r is positive. r(1441/91) Simplify (p/p(-15))*5p*3p(-19) assuming p is positive. p64 Simplify (v*(-2)/(v/(v/(v/(vv*(-5/2)v)vv)v)))/(v(-2/3))(-47) assuming v is positive. v(-215/6) Simplify (ii*(-1)i9)/((i(-22)i)/(i(9/5)i)) assuming i is positive. i(164/5) Simplify (o(2/9)oo*(-10/7)o)/(o/o(-2))(-2) assuming o is positive. o(428/63) Simplify ((h/h10)/hhh)(1/2)/(h(-2/7))11 assuming h is positive. h(-6/7) Simplify (rr(-5/3)/rrr)8r/(r/(rr/(r/(rrr(-5)rr))r))rr/(r*(-1/27)/r)r assuming r is positive. r*(208/27) Simplify h(h/h*7)/hh(hh*(4/3))/h(hhh*(-1/5)h)/h(-15) assuming h is positive. h(212/15) Simplify ((d*(-35)/d)/dd*(4/25)d)(20/7) assuming d is positive. d(-512/5) Simplify (q*(-2/5)qq)(-1/4)/(q(5/8)q1) assuming q is positive. q(-81/40) Simplify (r(1/4))28r(2/13)/(r(r/(rrr(3/7)))/r) assuming r is positive. r(781/91) Simplify ((d19/d)/d)/(d/d9)d(-25)/d(-2/91) assuming d is positive. d(2/91) Simplify ((s(-7/2)/s)/(s(s/(((s/(s/(s/(s/(ss/(ss/(sss*(-10))s)))s)))/ss)/ss))/s))(2/71) assuming s is positive. s(-27/71) Simplify (o(3/22)/oo)*(-4)o(1/10)/(o27o) assuming o is positive. o(-3129/110) Simplify i(2/3)((iii*8i)/i)/ii((ii(2/23))/i)/i(-6) assuming i is positive. i(1156/69) Simplify (((q/(q/(q(-6)/q))qq)/q(-1/5))/(qq(-1/3))(-1/12))(-2/11) assuming q is positive. q(427/495) Simplify (((ss(-3/5)/s)/sss)/ss)/s*(-1/3)(s7)(-2/35) assuming s is positive. s(1/3) Simplify ((p(4/9)p/(p/p(-4)))(1/4))4 assuming p is positive. p(-32/9) Simplify z(-6)/z(1/21)(z(z4zz)/z)(-15) assuming z is positive. z(-2017/21) Simplify (ii/(iii/i*(-1))ii(-3/2))(-1/12) assuming i is positive. i(5/24) Simplify ((nn(3/5))/(n/(n/(n(3/5)n)))((nn(-3/2)nn)/n)/nn5)4 assuming n is positive. n18 Simplify g(-2/33)/((g*16/g)/g)g/(gg/g(-27))(g(-27)/g)/g assuming g is positive. g(-2345/33) Simplify ((y/(yy(-22)))/y(-28))21 assuming y is positive. y1050 Simplify ((f/f25)/(f(fff(2/37))/f))/(f(1/16)ff*(2/21)f) assuming f is positive. f(-350729/12432) Simplify (m13mm(-32)/m)/(m(30/7)mm/(m/(m/(mm(-8/9)m)mm))) assuming m is positive. m(-1649/63) Simplify ((p20/p)/(pp/p(-2/31)p))/(((p/(p/(pp(-15)pp))p)/pp)/(pp(-1/2))) assuming p is positive. p(1701/62) Simplify ((ppp(-5/2))/p3ppp(-2/15)/pp(-4/5)/p)24 assuming p is positive. p(-532/5) Simplify x/x(-16)x(7/2)(x/(x*(-1/2)x))/xx(3/11) assuming x is positive. x(223/11) Simplify (q5/q3)/(qq/((q/(q*3qq))/q))7 assuming q is positive. q(-47) Simplify u(1/3)u*(-3/8)u*(-14)uu(-1/18) assuming u is positive. u(-943/72) Simplify (qqq(3/11))/(((q(6/11)q)/q)/q)(qq(-21))/(q(2/45)/q) assuming q is positive. q*(-8077/495) Simplify ((h(h/h1)/h)/(h16/hhh))/(((h/(h*(-3/2)h))/hh)/((h11/h)/h)) assuming h is positive. h(-19/2) Simplify (aa/(a/((a*(-4)a)/a)a))(8/9)(aa/a(1/3)a)0 assuming a is positive. a(-32/9) Simplify (h(-11))(-14)/(h(-40)/(((h(-9/4)/h)/hh)/h)) assuming h is positive. h(759/4) Simplify c(-11)c*(-4)/cc*(-7)c(-1) assuming c is positive. c(-24) Simplify x*(-1/7)x*4(xx/(x6/x))(1/5) assuming x is positive. x(114/35) Simplify (p/p(-15))/(pp*(1/9))(p/(p(-18)/p))/p(-1/3) assuming p is positive. p(317/9) Simplify (((w/w(-3))(-2/19))(-1/15))25 assuming w is positive. w(40/57) Simplify (((oo(5/3))/o6)26)32 assuming o is positive. o(-8320/3) Simplify ((xx/(xx/(xx(-2/13))))/x7)/((xxx*(-24))/((xx(-35))/x)) assuming x is positive. x(-249/13) Simplify (v*(-20)v23)(-50) assuming v is positive. v(-150) Simplify ((d(1/4)d)/d)(3/5)/((d/((d/(d22d)d)/d))/(d/(d/d(-2/81)d)dd)) assuming d is positive. d(-35437/1620) Simplify (((w0)(-15))(-6/13))*43 assuming w is positive. 1 Simplify ((uu(-3/5))/(u/((u(2/17)u)/u)))/(u(-1))(-33) assuming u is positive. u(-2846/85) Simplify (z(z*(-7/4)z)/z)(1/7)/(z/z19)17 assuming z is positive. z(8565/28) Simplify (ggg*(-18)g31)/(g37/gg(-1/29)) assuming g is positive. g(-608/29) Simplify (s(1/5)/(ss/s16))/(s(-3/7)/(s(3/10)/s)) assuming s is positive. s(195/14) Simplify (t/(tt/t(-1/2))t*(-3/14)/tt)/(t*(-12)/(tttt4)) assuming t is positive. t(121/7) Simplify ((o/(o(o/o(-2/5)o)/oo)oo(4/7))(9/5))(-4/5) assuming o is positive. o(1044/875) Simplify (o4o*(-2/3)o)/((o*(-13)o)/(o(-9/5)/o)) assuming o is positive. o(203/15) Simplify (oo(-8/9))7/(o(-3/13))(1/34) assuming o is positive. o(3121/3978) Simplify (d(-13)d(-8))/(d(2/31)/(d/(d/d*(2/9)d))) assuming d is positive. d(-6094/279) Simplify ((s3)(2/63))(-14) assuming s is positive. s(-4/3) Simplify (m/m(-19))10/((m(-16/5)/m)/m)(-3/38) assuming m is positive. m(18961/95) Simplify (t/t*(6/5)t/(t*(-2/37)tt))48 assuming t is positive. t(-10176/185) Simplify ((zz(-1/42))/z)/(z(14/9)z)(z*24z)(1/16) assuming z is positive. z(-1025/1008) Simplify ((o*(-15)o)/o12)/((o/o(-2/5))/((((((o*(-5)/oo)/o)/o)/o)/o)/o)) assuming o is positive. o*(-187/5) Simplify ((ww(4/5))/w)(3/20)(w11w)/w(-11/4) assuming w is positive. w(1487/100) Simplify (t5)(-19)/(t*(1/4)t)(-6) assuming t is positive. t(-175/2) Simplify zzz*(-20)z*(-7/6)(z/(z/(z/(zz7/z))z))(1/14) assuming z is positive. z(-59/3) Simplify (n/n(-8))15(nn((n/(n(-10)/n))/n)/nn)/n(-1/34) assuming n is positive. n(5033/34) Simplify (((p*(-4)p)/pp3)(-17/6))(1/11) assuming p is positive. p(17/66) Simplify ((w/w(1/45)w)(-37/5))33 assuming w is positive. w*(-36223/75) Simplify vv*(-2/19)v/((v/v*(-15))/v)v(-2/5)/v(-4/3) assuming v is positive. v(-3469/285) Simplify (n/(n(1/3)/nn)nn/(n/n(4/3)nn))/((n(2/7)n)/nn(-6)nn) assuming n is positive. n(33/7) Simplify (ww/((w/(w/w*(8/7)))/w)w)*(-9)(w/w(7/3))(-14) assuming w is positive. w(-148/21) Simplify (m(-10))*(-6/29)((m/(mm/(m(-2/9)/m)))/m)/((m(-13)/m)/m) assuming m is positive. m(3614/261) Simplify d11/((d((dd14/d)/dd)/d)/d)d(6/11)/((dd(-7/6)/d)/d) assuming d is positive. d(47/66) Simplify ((v/(v/(v*(2/7)/v)))/vvv(2/5))/(v7/(v(v*(-4)v)/vv)) assuming v is positive. v(-326/35) Simplify (j(2/15)jj/(j/(((jj6)/j)/j)))/(j(-1/12)jj/(jj(-1/3))) assuming j is positive. j(293/60) Simplify ((n(-13)/nn(n/n(-6/7))/n)/((nn(-1/2))/n)4)(-15/8) assuming n is positive. n(1065/56) Simplify (p/(p*1p))(-1/4)/(p(-2/11))(1/24) assuming p is positive. p(17/66) Simplify ((b*(-4)b(b/(b5/b))/b)(-50))(8/15) assuming b is positive. b(560/3) Simplify ((t/t7)/t(-5))/(t(-3/2)/t0) assuming t is positive. sqrt(t) Simplify (g(g/g*(-11))/gg(-4/19))/((g15/g)/ggg/(gg(-7/5))) assuming g is positive. g(-343/95) Simplify (b7/b(-1/16))(-48) assuming b is positive. b(-339) Simplify ((ggg(-12)g(1/10))(-16))37 assuming g is positive. g(29304/5) Simplify ((gg(-17)/g)/(ggg/g(-15)))/(g15g/(gg/g(1/9))) assuming g is positive. g(-442/9) Simplify ((tt*(1/10))/t)/((tt/t*(10/9))/t)t0/t(-3/8) assuming t is positive. t*(211/360) Simplify ((ff1)(3/13)f7/(ff/(f/(f*(9/4)/f))f))(-9/5) assuming f is positive. f(-1971/260) Simplify ((((ggg0/g)/g)/(g/(g(-3/2)g)g))/((g/g7)/g(-7)))(-7/2) assuming g is positive. g(49/4) Simplify (j(1/27))42j/j(2/37)jj(1/17) assuming j is positive. j(20155/5661) Simplify (j5j*	{ "pile_set_name": "DM Mathematics" }
? 2, 3, 17 Let d(p) = 3p3 - 2p + 1. Suppose 0 = t - 1. Let a be d(t). Suppose -2s - 2s = aw - 58, -5s - w = -74. List the prime factors of s. 3, 5 Let b(q) = 2 + 62q - 81q - 135q. Let l be b(1). What are the prime factors of (24/(-16))/(6/l)? 2, 19 Let h = 987 + -701. List the prime factors of h. 2, 11, 13 Suppose 0c - 519 = 3c. Let m = 310 + c. List the prime factors of m. 137 Let s(g) be the second derivative of -2g*4/3 + g. Let h be s(1). What are the prime factors of (5 + -3)/((-2)/h)? 2 Suppose 0 = 4f + 20, 5i - f = -5f. Let o be i - (-34 + (-3 - 0)). Let h = o - 16. What are the prime factors of h? 5 Suppose 0 = -3f - 5m + 88, -2m = 5f - 5m - 90. Suppose fw - 16w = -395. Let o = w - -129. What are the prime factors of o? 2, 5 List the prime factors of (-32 + -39)/((-2)/20). 2, 5, 71 Let o be (-60)/18(-468)/15. Let q(u) = -u*3 - 3u*2 + 1. Let g be q(-5). Let c = o - g. What are the prime factors of c? 53 Let j(d) = 101d3 + d2 + 4d + 3. Let p be j(-1). List the prime factors of 2 - (1 - (1 - p)). 103 Let d = -20 - -25. Suppose 4c + da - 329 = 0, 2c + a - 165 = -8. What are the prime factors of c? 2, 19 Suppose -4f + 2v = -3284, -2f - 2f = 5v - 3256. What are the prime factors of f? 3, 7, 13 Let p(r) = r3 + 13r*2 - r + 8. Let o be (-14 - 4/1)/(3/2). List the prime factors of p(o). 2, 41 Suppose 0 = -2p - 0k + 4k + 408, -k = -5p + 1047. What are the prime factors of p? 2, 3, 5, 7 What are the prime factors of (-18)/24 + 73381/12? 7, 331 Suppose 2466 = 5k + f, -4k + 4f + 1984 - 16 = 0. Suppose -k = -5g + 447. What are the prime factors of g? 2, 47 Let n(g) = -g3 - g2 + g + 7. Let y be n(0). Suppose -79o = -84o + 2160. Suppose -yi + o = -i. What are the prime factors of i? 2, 3 Suppose -4v + 15 + 209 = 0. Suppose -4a = -0a + 5i - v, 5a - 33 = 3i. List the prime factors of (a/3)/(2/16). 2, 3 Suppose -1 = 3u + 29. Let o = u - -7. List the prime factors of o/(6/8) + 17. 13 Suppose 0 = -2h - k + 3, 0 = -5h - 7k + 2k + 15. Let a be h - (1 - (6 + 0)). List the prime factors of a - (1 - -2)/3. 2 Let m(t) = -3t - 19. Let z be m(-7). Suppose -4v - x = -283 - 40, v + zx = 86. Suppose -v = -6u + 2u. List the prime factors of u. 2, 5 Let y be -1(-5 + 235 + 5). Let o = y - -395. What are the prime factors of o? 2, 5 Let k(r) = -r*3 + 6r*2 + 6r + 9. Let z be k(7). Suppose -2x + 151 = -d, zx = 4d - 0d + 160. Let f = -38 + x. What are the prime factors of f? 2, 3 Let c(o) = 10o - 399 + 402 + 19o. List the prime factors of c(2). 61 Suppose 0 = -7x - 30 + 86. Suppose -2u - 2s = -32, 3u - 48 = s + x. What are the prime factors of u? 2, 3 Let s(b) = -b*3 - 3b*2 - 3b + 4. Let o be 4 - ((4 - 4) + -1). Suppose -3u + 4m + 18 = -ou, -3u - 2m - 15 = 0. What are the prime factors of s(u)? 13 Let h(m) = m3 + m2 - m - 1. Let b be h(0). Let p be 5 + -4 - (b - -2). Suppose 0 = 2w + 2a - 62, pw - 5a - 43 = -w. List the prime factors of w. 3, 11 Suppose 0 = b - 1 - 11. Suppose -25 = a + 4a, 3a = 4d - 27. Suppose 4h - 110 - 6 = 2t, 0 = -dt - b. List the prime factors of h. 3 Let v = -207 + 143. Let l = v + 157. List the prime factors of l. 3, 31 Let x(w) = w2 + w + 24. Let j be x(0). Suppose 3f - j = f. List the prime factors of (f - 3)/11. 3 Let i(a) = a2 + 13a + 8. Let s be i(-13). Let x = s - 3. List the prime factors of x. 5 Suppose o - 1 - 3 = -3i, i + 7 = -2o. Suppose -3m + a + 1233 = 433, -3m + ia + 798 = 0. What are the prime factors of m? 3, 89 Let j(x) = 2x - 4x2 + 12x + 3 + 2x2 + 3x*2. Let v be j(-14). Suppose vc = c + 82. What are the prime factors of c? 41 Suppose -10d + 460 = -60. Let u = 82 - d. What are the prime factors of u? 2, 3, 5 Let p(s) = 6s*2 - s - 4s*2 + 0s + 19s2. List the prime factors of p(-2). 2, 43 Let y be (4/4)/(4/60). Let d = y - -3. What are the prime factors of d? 2, 3 Suppose -5b + 851 = -4r + 3r, -4r + 529 = 3b. List the prime factors of b. 3, 19 Let j(k) = 2k3 - 3k*2 + 7k + 12. Let o(y) = -y*3 + 4y*2 - 6y - 13. Let l(c) = 2j(c) + 3o(c). What are the prime factors of l(-6)? 3 What are the prime factors of -3 + 0 + 6 + 858? 3, 7, 41 Let g = 7241 - 4794. List the prime factors of g. 2447 Let d(n) = 3n2 + 2n + 2. Let l be d(-5). Suppose -s + 193 = l. List the prime factors of s. 2, 3, 7 Let k = 226 - 100. Suppose 10r = 3r + k. What are the prime factors of r? 2, 3 Let n(z) = -z + 9. Let o be n(-8). Let y = o - 21. What are the prime factors of -10(-2)/y-5? 5 Let h = -420 + 1285. List the prime factors of h. 5, 173 Suppose 2v + 0v = 4u - 3708, 2u - 1862 = 5v. List the prime factors of u. 2, 463 Let i(v) = -v + 3. Let d be i(2). Suppose 12 = n - d. List the prime factors of n. 13 Let m be (-3)/(0 - 3)10. Let b = m + -7. Suppose 5x - 34 = bx. What are the prime factors of x? 17 What are the prime factors of 719/7 - 2/(-7)? 103 Let p(r) = -13r + 10. Let h(i) = 53i - 41. Let d(s) = 2h(s) + 9p(s). What are the prime factors of d(-5)? 3, 7 Suppose -3g - u + 2u = 90, 0 = g - 5u + 44. Let i = g - -93. List the prime factors of i. 2 Let o(a) = -a3 - 11a*2 + 49a + 74. List the prime factors of o(-21). 5, 691 Let b(a) = -30a - 5. Let v(z) = z3 + 7z*2 + 7z + 1. Let w be v(-6). Let k be 1 + -1 + w + 3. List the prime factors of b(k). 5, 11 Suppose -j = 310 + 218. Let d = j + 810. List the prime factors of d. 2, 3, 47 Suppose 10460 = 4y + 2q, 5y = 4y + 2q + 2620. What are the prime factors of y? 2, 3, 109 Suppose -i = 3t + 9, 0t + 3t = -6. Let k be (11/i)/(1/(-9)). Suppose 3u = -0u + k. List the prime factors of u. 11 Let d(y) = -y*3 + 3y*2 - 3y - 6. Let r be d(5). Let w = 8 - r. What are the prime factors of w? 79 Suppose 0s + 8 = s. Let c be (-20)/(-6) + s/12. Suppose 2d = -5t + 10 + 1, t + cd = -5. List the prime factors of t. 3 Let k(r) = -74r3 - 2r*2 - 2r - 1. Let x be k(-1). Suppose 0 = -0z - 3z + 3a + 210, -x = -z + 2a. What are the prime factors of z? 67 What are the prime factors of -163(5 + (-6)/(-2)-3)? 2, 163 Let b(k) = -1139k + 5. Let m be b(-1). Suppose -2j + m = 9j. What are the prime factors of j? 2, 13 Let q(p) = 7p*3 + 3p*2 + 3p - 1. Let u(y) = 20y3 + 9y*2 + 10y - 4. Let c(a) = -7q(a) + 2u(a). List the prime factors of c(-2). 61 Suppose -1091 = -5r + 4k, 2r - r = -2k + 221. Suppose 2j + 5n = r, 2j = 6j - 2n - 378. What are the prime factors of j? 97 Suppose 4u = 6u - 448. Suppose -um + 220m = -432. List the prime factors of m. 2, 3 Let f(y) = -y. Let s be f(4). List the prime factors of (72/(-20))/(s/30). 3 Let q be 9/(-6)20/(-15). Let o(b) = -b + qb2 + 6b*2 - 5b*2. List the prime factors of o(-3). 2, 3, 5 Let j = 79 + -31. List the prime factors of j. 2, 3 Suppose -2b + s + 13 = 0, 2s + 19 = 5b + 4s. Suppose bv = v + 5h + 578, 0 = v + 2h - 151. List the prime factors of v. 3, 7 Let m = 7 + -7. Let v = m - 4. What are the prime factors of 145/6 - v/(-24)? 2, 3 Let t be (-2 - 12/(-5)) + (-14470)/50. Let w = -169 - t. What are the prime factors of w? 2, 3, 5 Suppose 2w = -4 - 2. Let c be (-110)/33 - 1/w. Let k = 0 - c. List the prime factors of k. 3 Let o = -143 - -212. List the prime factors of o - (7 + 15/(-5)). 5, 13 Suppose t = 3, 76y + t - 4643 = 74y. What are the prime factors of y? 2, 5, 29 Suppose -1 + 3 = i. Suppose -110 = -ih - h + 2x, -90 = -3h - 3x. Suppose 3g = -5o + h, -o + 50 = 3g - 0o. List the prime factors of g. 2, 3 Suppose 0 = 22v - 22741 - 33095. List the prime factors of v. 2, 3, 47 Suppose -182 = 4d - j - j, 3d + 5j + 143 = 0. Let r = 199 + -133. Let t = d + r. What are the prime factors of t? 2, 5 Let m(w) = w2 + 12w + 15. Let r be m(-11). Suppose 0h + 3d = h - 7, 0 = -rh + 5d + 35. List the prime factors of (h - 2)(-4)/(-8). 2 Suppose 0 = i - 3t - 16, 3t + 2t + 23 = -2i. What are the prime factors of (i - 139)(-4 - 35/(-10))? 3, 23 Let u = 11 + 42. Suppose -z = -18 - u. List the prime factors of z. 71 Suppose 0 = -7f + 4f - 5k + 17, -5f + k = -47. List the prime factors of (f/2 - 2)12. 2, 3, 5 Let t = -4577 + 8499. List the prime factors of t. 2, 37, 53 Suppose 0o = -o. Suppose -4g - 2y + 1112 = -0y, 2g - 5	{ "pile_set_name": "DM Mathematics" }
Let s(y) = y*3 - 4y2 - y - 11. Let o(z) = z2 - 6z - 11. Let j be o(8). Let c be s(j). Is 13 a factor of 3/((-1)/(-312)c)? True Let h = 44 - 44. Let m = h + 76. Is m a multiple of 38? True Let q be (-2)/(-4) + (-2)/4. Suppose q = -m + 152 - 4. Does 37 divide m? True Suppose -592w + 601w = 4140. Is w a multiple of 95? False Suppose -1619 = -4f - 5c, 22f - 1220 = 19f + 2c. Is f a multiple of 58? True Let q(a) be the second derivative of a7/2520 - a6/360 - a5/30 + 5a*4/12 - a. Let i(w) be the third derivative of q(w). Is i(8) a multiple of 16? False Is 27 a factor of 49504/65 - (-14)/35? False Suppose 4 + 5 = 3j - i, -j + 17 = -5i. Suppose t - jt = -17. Suppose -t - 7 = -l. Is l a multiple of 8? True Let v = 306 + -176. Is v a multiple of 2? True Suppose 11z = 13z - 158. Suppose d - u = 53, 0 = -5d - 5u + z + 136. Is 6 a factor of d? True Let x(u) = 2u - 4. Let m be x(10). Let d = m + -6. Is 10 a factor of d? True Let z be (-1 - -1)/(0 - -1). Suppose z = -6t + 2t + 28. Let b = t - -2. Does 3 divide b? True Suppose 5g - 29 - 1 = 0. Let q be (-3)/g + 21/(-14). Let i = q + 23. Is i a multiple of 4? False Let n(l) = l*2 - 2l + 6. Let s be n(8). Suppose 96 = 5o - s. Does 15 divide o? True Let t(u) be the third derivative of 3u5/40 - u4/8 + 5u3/6 + 5u*2. Let h(y) be the first derivative of t(y). Is 12 a factor of h(2)? False Is 128/96123/2 a multiple of 20? False Suppose -2h + 34 = 2v + 2v, -23 = -3v - h. Suppose -26 = -4q + 26. Suppose 4m - vf = -f - 8, 3m = -f + q. Is 3 a factor of m? True Suppose 3t - 3g = 2151, -3g - 844 = -t - 121. Does 14 divide t? True Let o = 8 - 6. Let g(d) = -6d + d + 0d + od + 6 + d2. Is g(4) a multiple of 5? True Let h = -17 + 609. Does 13 divide h? False Let k(g) = g3 + 15g2 + 11g + 10. Let t be k(-14). Suppose 2q - 29 = 21. Suppose 0 = -4s - 0o + 4o + t, -5s - 5o + q = 0. Is s even? False Suppose 12c - 9c - 378 = 0. Suppose -3s + 0s + d + 126 = 0, c = 3s + 2d. Is 7 a factor of s? True Let w(k) = k*2 + 5k. Let q be w(-5). Let o be -1 + -2 - -5 - q. Suppose 4n = on + 16. Is n a multiple of 4? True Suppose -13n - 440 = -d - 11n, 5n = 5d - 2180. Is 48 a factor of d? True Let x = -24 - -53. Let a = x + -16. Let i = a + 17. Does 12 divide i? False Let u(h) = h*2 - 19h + 24. Suppose t + 5v - 32 = 0, 0 = -t + 6t - 3v - 104. Is 9 a factor of u(t)? True Suppose -3k + 2 = -7. Suppose -y - y + g = 13, -ky - 4g = 36. Let n(u) = 2u2 + 6u - 4. Is 22 a factor of n(y)? False Let l(d) = -d - 6. Let j be l(-9). Let f(p) = -15p - 2 - 15 + 7p + j. Does 17 divide f(-6)? True Let w(c) = 59c - 50. Is w(5) a multiple of 12? False Let o(s) = -s2 - 10s - 3. Let l be o(-7). Suppose l = 4j + 98. Let r = j - -26. Is r a multiple of 2? True Let b(h) = h3 + 4h*2 - 9h - 10. Suppose -4t = -19 + 35. Does 26 divide b(t)? True Let r = -27 - -29. Suppose 0v + 50 = rv. Is v a multiple of 5? True Suppose 20647 + 42749 = 18q. Is q a multiple of 22? False Let u(q) = -4q3 - 34q*2 + 35q. Let b(r) = 3r3 + 23r*2 - 23r. Let l(t) = -7b(t) - 5u(t). Does 9 divide l(6)? False Let d = 106 - 53. Suppose 0 = -l + 312 + d. Suppose 5s = -0z + 2z + l, 175 = 2s + 5z. Does 25 divide s? True Let h be -7(7 - 3 - -10). Does 17 divide (-22)/11 - (h - (-1 - -1))? False Let q(d) = d - 6. Let x be q(6). Let l = 4 + -1. Suppose 4p + u = 213, lp + xp - 155 = 4u. Does 19 divide p? False Suppose 5o = i + 3821, o - 8i = -10i + 773. Is o a multiple of 9? True Suppose -1 = k, 3d + 41 = 6d - 5k. Suppose -y = -d - 26. Is 15 a factor of y? False Is 20 a factor of 56/(-3)(91 - 121)? True Suppose 0 = -35g + 38752 + 18998. Is 57 a factor of g? False Suppose -2 = 3x + 16. Let o be x/(-9)(-102)/(-4). Let d = -10 + o. Is 7 a factor of d? True Let c be -4 - (70 - -3)/(-1). Suppose c = 5n - 2n. Is n a multiple of 23? True Let t(y) be the first derivative of -y*4/4 - 11y*3/3 - 15y*2/2 - 4y + 39. Does 6 divide t(-10)? False Let w(r) = -131r + 1. Let x(g) = g - 9. Let n be x(8). Is w(n) a multiple of 22? True Suppose 6g - 3 + 33 = 0. Let p be (-1)/g + (-181)/5. Is (4 + p)3/(-2) a multiple of 13? False Let i be -1 + (-2)/1 + 5. Let h(d) = 7d*i - 2d - 5d2 + 15d*2 + d. Is h(-1) a multiple of 9? True Let z(c) = -4c*2 - 13c - 5. Let y be z(-5). Let w(f) = f*3 + 8f*2 + f - 6. Let j be w(-5). Let i = j + y. Does 8 divide i? True Suppose -8p + 12 = -5p. Suppose 4r = -p + 20. Does 14 divide 165/12 + 1/r? True Let i be 214/14 + 2/(-7). Suppose 5z + 2v = 4, 0z - 17 = -z + 5v. Let u = z + i. Does 15 divide u? False Let b be (2 - 3) + -1 + 9. Let n be 4/(-16) + b/(-4). Is (33/(-6))/(1/n) a multiple of 4? False Is 757 + (8 - (13 - 4)) a multiple of 31? False Let z = -10 + -41. Let u = -31 - z. Is 10 a factor of u? True Is 2 a factor of (-17)/(1785/(-14)) + (-223)/(-15)? False Let y(t) = 17t2 - 71t + 22. Does 85 divide y(9)? False Suppose -l + 2 = l. Let k be 0 + l + (-1 - -5). Let d(v) = 4v2 - 5v + 6. Is d(k) a multiple of 27? True Let c(t) = t - 19. Let v be c(10). Let i be -63v/((-54)/(-8)). Suppose -i = -2g + 18. Is g a multiple of 10? False Let k be -6 - (-9)/1 - (-1 - 314). Suppose 0 = -2b + 4f + 44 - 2, -3b - 3f + 90 = 0. Does 11 divide k/b - (-8)/36? False Suppose -4h + 3h = -2g + 9, 2h - 6 = -2g. Suppose -5f - 2l + 3 = -17, 2f + gl = -8. Is 2/f - (-228)/18 a multiple of 6? False Let a(z) = -28z + 94. Is 23 a factor of a(-7)? False Let r = -16 - -19. Suppose rc - 4 = 2. Is c even? True Is 49 a factor of (-3)/15 - (-11341)/55? False Let f(s) = 6s. Let o be f(7). Suppose -t - 10 = t. Is (-6 - t)/((-3)/o) a multiple of 14? True Let i(s) = -2s2 + 2. Let d be i(-2). Suppose -4y - 5 = 7. Does 6 divide 0 - ((d - y) + -11)? False Suppose 2l - 3l = -10. Let q(i) = -l - 6 + 10i - 8 + 10. Is q(6) a multiple of 23? True Suppose 5p + 2s - 7224 = 0, 3p + p - 5770 = 3s. Let m = p - 987. Let f = m + -309. Is f a multiple of 41? False Suppose 59m + 2898 = 66m. Is 18 a factor of m? True Let z(a) be the first derivative of a4 - a3/3 + 2a*2 - 3a + 7. Is z(3) a multiple of 18? True Let x = 68 + -44. Let r be (-18)/x + 54/8. Let i = r - -10. Does 16 divide i? True Let w(b) = -3b + 1. Let z be w(-1). Suppose r - zp = 14, -2p - 5 = 5r + 3p. Suppose -6n + 176 = -rn. Is n a multiple of 22? True Let v = 207 - 95. Let c be (159/(-12))/((-7)/v). Suppose 3o = -4q + c + 55, 4q + o = 265. Is q a multiple of 22? True Let v(x) be the second derivative of -17x3/3 + x2 + 6x. Is 29 a factor of v(-2)? False Suppose 3c + 273 = o - 3, -4c - 368 = -5o. Let x = c + 172. Let t = x - 39. Is 10 a factor of t? False Suppose -6o + o - z + 22 = 0, -5o - 2z = -24. Suppose oi - 13 = 3. Suppose -4 = 4h + ic, -5c + 7 = -4h + 39. Does 2 divide h? False Suppose -7t = -6t. Suppose 5y + 71 = 3j, -j + tj - 2y = -42. Is j a multiple of 7? False Let t = -17 - -53. Suppose -g = -3, -v - 4g + t = -g. Does 9 divide v? True Let u = 1164 - 894. Is 6 a factor of u? True Suppose 0 = -7n - n + 432. Suppose 0 = -nu + 50u + 64. Does 8 divide u? True Let j = 53 - -97. Suppose 5l + 5z - 8 = 12, 4l - 3z = 23. Suppose -21 + 113 = 3b - lo, 0 = -5b + 5o + j. Is 13 a factor of b? False Let p(n) = -98n + 14. Does 42 divide p(-2)? True Suppose 2z = 2d - d + 19, 4d = z + 1. Is 2 a factor of z? False Let s(x) be the second derivative of 4x*3/3 - 27x*2/2 - 50x. Is 38 a factor of s(22)? False Let z(y) = 286y + 81. Does 49 divide z(4)? True Suppose -l + 211 - 64 = 0. Does 49 divide l? True Suppose 947 = -12l + 12179. Is l a multiple of 18? True Suppose 4p - 3v - 96 - 10799 = 0, -4v = 5p - 13580. Is 17 a factor of p? True Let g = 41 - 41. Suppose 11m - 7m - 84 = g. Is m a multiple of 6? False Let n = 389 - -1543. Does 21 divide n? True Let j be ((-95)/(-20) - 4)4. Let w = j + -10. Let x(v) = v + 20. Is x(w) even? False Suppose 5j = -3g, 5g - 9g + 23 = -j. Suppose -gk = -3b - 925, 5k - 2b = 2b + 920. Is 9 a factor of k? False Let l(a) = a*2 - 11a + 83. Is 11 a factor of l(-15)? True Let o be 36/45 + (-183)/(-15). Let k = 7 - 4. Let v = k + o. Is 8 a factor of v? True Suppose 7*k + 14 - 147 = 0.	{ "pile_set_name": "DM Mathematics" }
)) assuming k is positive. k(518/369) Simplify x(1/2)/xx(2/5)xx((x*(1/4)xx)/xx)*(3/16)(x1)(-3/4)x(-1/3)x(-3)/x assuming x is positive. x(-2651/960) Simplify ((f*(1/28)(((f/(((f/f(-16/3))/f)/f))/f)/f)/f)/(f3/((f/(f/(f/f(-20/7))))/f)))(-1/6) assuming f is positive. f(541/504) Simplify (((h/h(-2/7)h)/(((h/(h(-20)/hh)h)/h)/h))/((h(-3/29)h)/(h/(h*(-23)hh))))(-3/10) assuming h is positive. h(-1032/1015) Simplify ((((bb*(2/11)bb)/b)/bb)*(-3/4)b/b*5b14/b)(-7/4) assuming b is positive. b(-567/44) Simplify q2/(q/q*(-1/5))(q(-1/4))(-40)(((qq*(-4)/q)/q)/qq)/(q/(q*(-2)q))(q/(q(q/(q/q*0))/qq))30 assuming q is positive. q(19/5) Simplify ((a/(aa(-2/9)aaa))(-37))(-1/31)/((a*(-2/7)a7)/((a/a0)/((a/a(-3))/a))) assuming a is positive. a(-23494/1953) Simplify (b/(b/(bb(-1/56)))b)*(4/3)((bbb(-2/41))/b)/b(5/13) assuming b is positive. b(23949/7462) Simplify ((m/m(-1))31/(m(1/6)(m(-9)/m)/m))(-14) assuming m is positive. m(-3059/3) Simplify (((i0/i)/i3)/((i0i)/(ii/(i/(i/(i(-2/15)/i)))i)))/(i(i(-1/5)/i)/iiiii0)(-45) assuming i is positive. i(1202/15) Simplify ((((g/g24)(5/2))(30/13))26)47 assuming g is positive. g(-162150) Simplify ((oo/o*6o*(-7)(oo/o(-2/29))/o(-2/19))(-24/7))(1/34) assuming o is positive. o(58356/65569) Simplify ((uuu/(u/u5)u)(-4/7))(-5/2)u/(u/u(-1/16))u/(u(u/(u(2/11)/u))/u)(u(1/2))11 assuming u is positive. u(19771/1232) Simplify ((t/t(-2)t)(-1/2))(7/10)(t(-1/2))(2/65)/(t(-4/3)/((t/t(2/7))/tt)) assuming t is positive. t(863/1365) Simplify ((nn*(2/5)nn)/(n/((nn*26)/n)n)(n(-2)/n)(-49))(-1/2) assuming n is positive. n(-436/5) Simplify ((((w(w*(-1/3)ww)/w)(1/17))38)(1/10))(-3/29) assuming w is positive. w(-19/493) Simplify ((z/((z16z)/z))/((zz(-1/10))/zzz)z*(-10/3)z(-11))(4/5) assuming z is positive. z(-1874/75) Simplify (h(1/6)h/h(-8))(-10/7)/((((h/(h/h8h))/h)/h(-3/5))/(h(5/4)/h(6/7))) assuming h is positive. h(-8107/420) Simplify (y*11/yy(2/3))47/((y(-2/9))(13/3)/(y2)(-1/48)) assuming y is positive. y(108487/216) Simplify j/j(2/3)j(-3)(j*(-1/2)/j)/jjj2/j((j*(4/7)j)/((j/(jj(-7)))/j))(3/11) assuming j is positive. j(-2021/462) Simplify ((rr/(r/(r*(44/7)/r))r*(2/7))/(r/(rrr(-14)))(-45))(-1) assuming r is positive. r(-4141/7) Simplify ((k4/k)/kk/(kk/((k/(k/(k/((kk*(2/7))/kkk)k)k))/k)))40/((k(k/(kk/(kkk(-1)kk)))/kk)31/((k(-5)/k)/k2)) assuming k is positive. k(-1067/7) Simplify ((mm(-1/24)/m)(-15/8)/(m(-3))(-25))(-42) assuming m is positive. m(100695/32) Simplify ((l/l(2/3))(-23/5)/((l/(ll*(-14)/ll))/ll/(ll18)))(5/16) assuming l is positive. l(13/12) Simplify w(-4/5)w3(w/((w*(-1/4)/ww)/w))/(w/(ww4))(w2)(2/35)(ww/(w/(ww/w(-4/3))w)w)/((w/w(2/17))/w) assuming w is positive. w(92929/7140) Simplify ((s(-20)/s2)/(ss*(-12)sssss7))(-3) assuming s is positive. s*66 Simplify (ww*(-5/13)www/(ww34w))/(w40/(w9/w)) assuming w is positive. w*(-837/13) Simplify (((y/(yy(-1)))/y)(7/4))*(1/55)((y*(-6)/y)/(yy5))/((y(-2)/yy)/yy(1/5)) assuming y is positive. y(-51/5) Simplify ((u*(-2)/uu)/u(2/13))(3/8)/((u(2/5))(-36)/(u1)(-11/5)) assuming u is positive. u(1481/130) Simplify (x(-3)(x6/x)/x)17((x1)(2/27))33 assuming x is positive. x(175/9) Simplify ((tt/(tt*(-19))t)*(-16)(ttt(-2/19))(4/17))(-4/21) assuming t is positive. t(144512/2261) Simplify (u*(10/9)u(-12))(2/67)/(((u(-1)/u)/u(-5))/(u/(uu/(u/u(1/3))u))(-1/53)) assuming u is positive. u(-105461/31959) Simplify ((s(ss*(-6/7)s)/s)*(6/11)s(-2)/(s/s(3/14)))(-26) assuming s is positive. s(4329/77) Simplify (g/(gg27)g/(g31/g))/(g(-1/8)/g(-24)) assuming g is positive. g(-639/8) Simplify (((p1)(3/13)p(-7)pp7)(-17))(-36) assuming p is positive. p(9792/13) Simplify (((yy*(-10)/y)/yy/(y/(((y/(yy41))/y)/yy)yy)y)/(y(-27))(39/7))(6/29) assuming y is positive. y(4050/203) Simplify (((b(3/20)/b)/(b13/b))/(b(2/17)/(b/(b(2/15)b))))(12/19) assuming b is positive. b(-13363/1615) Simplify ((mm/(m/m(-11))mm)(-11)((m/((((m/((m/(m*(-1/21)m))/m))/m)/m)/mm))/mm)/(m/(m/(m*(1/9)/m))m))(-4/7) assuming m is positive. m(-22412/441) Simplify h*3h*(-2)(h(-2/7))(8/5)(h(h((h/(h/(h/((h(hhh*(-1))/hhh)/h)))h)/h)/h)/hhh5)45 assuming h is positive. h(7894/35) Simplify ((p/p(-11/4))/(p/(p/p*(-3/25)p)))/(ppp*(-14/11)p*11p) assuming p is positive. p*(-8643/1100) Simplify ((u/(uu*(-35)u))*(5/6)/(uu/u10)(26/3))(-40) assuming u is positive. u(-11720/3) Simplify (((h*(-1/2)/h)/h)/hh)*(-1/9)(h(-1))(-47)(h(-1/2)/h)43(hhh(2/5))30 assuming h is positive. h(493/9) Simplify ((n2nn(-3/11))/(n/(n/(n(-2/3)/n))n/(n/(n(7/4)nnn))))(3/5) assuming n is positive. n(-47/220) Simplify ((ff/f(-49))/((f(-6)/f)/ff))/((((f/(f*3/f))/ff)/f)/f)(3/7) assuming f is positive. f(415/7) Simplify ((l(-24)/((l/((l(15/4)l)/l))/l))/(l(1/3)/l7))(3/2) assuming l is positive. l(-163/8) Simplify ((m/(m/(m5m))m)/m(m/m(2/13))/m)33m/m3m/m*5m(m(-6)/m)/(m/((mm(2/5))/m)) assuming m is positive. m(11721/65) Simplify ((a(1/3))(-5))*(-44)((a/(a/((((a/(a(a/(a/(a/((aa*(-6)/aaa)/aa))))/a))/a)/a)/aa)))/aa*(-5/4)a)(-17) assuming a is positive. a(2359/12) Simplify ((ll/(ll*(-7))l)/l(1/2))/(l(-6)l7l)(l(1/11)l(-5))/(l(-2))(-8/7) assuming l is positive. l(-107/154) Simplify ((uu/((uu*(-2/5)/u)/u)u)/(uuu*(4/7))u*(-2/3)/(((uuu(-3)u)/u)/u))(-19) assuming u is positive. u(-6308/105) Simplify ((x/(xx(1/2)))/xx)*15x6/x(-2/11)(xxxxxx*(-2/7)x)/x*(-3/5)(x*5x)/x4 assuming x is positive. x(5387/770) Simplify (y(yyy/y31yyy)/yy)26(yy/(yyy(-43))y)/yyy6/y assuming y is positive. y(-575) Simplify (jj(-25/4)/j)/j(-2/147)jjj*44j(-12)/j assuming j is positive. j(15737/588) Simplify (x*6x/(x*(-2/7)x)x)(-5/3)(x*2xx6)(-2/133) assuming x is positive. x(-1633/133) Simplify ((dd*(1/12)d/d*(-2/9)(d/d1)/((d/d(-12))/d))(-48))(-15) assuming d is positive. d*(-6980) Simplify ((aa/(aaa*2aa))40/(a(2/47)/a(-9)))(-2/77) assuming a is positive. a(2270/517) Simplify c(-1/2)/(c/c2)(c(-1/4))(1/6)(c/(c(-7/4)/c)cc(-5))(-29) assuming c is positive. c(185/24) Simplify ((o(2/3)oo)(3/7)/(oo*(-6)oo/o0))/(o4/(o3o)o/o4o/o*(1/3)o) assuming o is positive. o(115/21) Simplify (d(-6)d/(d6/d))(-6/5)/((dd*5d)/(d/d2))(-3/4) assuming d is positive. d18 Simplify ((b17)*10bb/b4b(5/3))38 assuming b is positive. b*(19342/3) Simplify ((rr(-7/5))(7/11)/(((rr/r(-16))/r)/rr(2/17)))(-11/6) assuming r is positive. r(7654/255) Simplify (((i6/i)/ii)/ii(i/(ii/((i/i*(1/6))/i)ii))/iiii)(-19)/(i(2/3)i/(iii2)(i/i*0i)12) assuming i is positive. i(-189/2) Simplify (cc(3/2)c(1/9))/((c(-5/4)cc)/(c/(c/(c/c*(-5)))))((c*(-3/8)c)/c5)/(c(-2/3)c(1/2)) assuming c is positive. c(263/72) Simplify (t(-3/8))16/(t/t(-12))(-28) assuming t is positive. t358 Simplify (h/(hh/(h*(-9)/h))h*(-21)/h(h*(-19/3)h)/(h/(h20/h)))32 assuming h is positive. h*(-1952/3) Simplify (((ww*(-30)w)/((((ww/w(2/15)w)/w)/w)/w))/(w(ww*41w)/ww(-9/5)))(-7/10) assuming w is positive. w(3626/75) Simplify ((q(-18/5)q)/q)/q(qqq21)/qqqq29/(q/(q24q)) assuming q is positive. q(362/5) Simplify ((g/g(-13))(-9/7)g(-22)/g(2/55))11 assuming g is positive. g(-2202/5) Simplify ((w(-1)/w)(-28)/(w/w*0www(-2/3)))(2/3) assuming w is positive. w(322/9) Simplify (c(-16/7)/c)*(-18)c*(-32)cc/(c/(c(cc(-3/11))/cc)c) assuming c is positive. c(2223/77) Simplify ((q4/q(2/13))/(qqq(6/11)q	{ "pile_set_name": "DM Mathematics" }
0c Expand (-s + 2s - 2s)(104s - 464s - 376s)(0 - 2s + 0). -1472s*3 Expand (-5w*2 - 3 + 3)(w*3 - 1 + 1) - 6w*5 + 25w*5 - 11w*5 + 2w*5 - 8w5 + w5. -2w5 Expand -b4 - 2b4 + b4 + (b3 - b3 + b*3)(-3b - 2b + 3b) + (0b*3 - 3b*3 + 5b*3)(-24b + 21b + 52b) - 8b*4 + 21 - 21. 86b*4 Expand (-8 + 25 + 7)(b2 - b2 + 8b5 - 2b*5 + 0b + 0b + (3b*2 - 3b2 + b3)(-4b2 - b2 + 3b2) + 2b5 + b5 - 4b5). 72b*5 Expand (-1007 - 980 - 3m + 2021)(-2m*2 + 3m - 3m) + (m2 - m3 - m2)(-5 + 1 - 2). 12m3 - 68m*2 Expand (-10 - 5s + 10)((-2s*2 - 3s + 3s)(-s*2 + 1 - 1) + 18s*4 + 2s*4 + 21s*4) - 1 - 2s*5 + 1. -217s*5 Expand 5k*2 + 7k*2 + 17k*2 + (-3 - 1 + 3)(-k2 - k2 - k*2) - 4k*2 + 2k*2 + 3k*2 - 8k2 - k2 - 7k2. 17k*2 Expand (0u - 2u + u + (1 + 1 + 0)(u - 5 + 5))(4 - 2 + 1)(618 - 4 + 28)(2 + 1 + 2). 9630u Expand 2 - 2t2 + 3t*2 - 1 + (-4t*2 + 5t*2 + 11t*2)((-2 + 1 - 1)(1 - 9 + 1) + 2 + 5 - 1). 241t*2 + 1 Expand (-3311f + 3310f + 46 - 1)(8f + 3f - 4f + 2f*2). -2f*3 + 83f*2 + 315f Expand (-3 - 4 + 9)(1 + 1 + 0)(166g + 1 + 5733g*2 + 148g - 316g). 22932g*2 - 8g + 4 Expand (-2 + t + 2 + (89t - 38t + 143t)(7 - 3 + 0))((4 - 2 + 0)(-2 + 2 - t) + 3t + 4 - 4). 777t*2 Expand 6i*4 - 2i*4 - 2i4 + (i2 - 4 + 4)(-i2 + i2 - i2) + 2i*4 + 0i + 0i + (2i + 4i + 0i)(2 - 2 - 2i)(-3i*2 + 14i*2 - 9i*2). -21i*4 Expand (69311 + 1897g - 69311)(0 - 3g + 0). -5691g2 Expand (-6y*2 + 3y*2 + 2y*2)(-y + 10y - 2y)((4 + 1 - 4)(0 - 2 + 1) - 4 + 0 - 84). 623y3 Expand -16d*3 + 16d*3 - 10d4 + d4 - 10d + 10d + (0d + 0d + 6d)(0 + 0 + 2d3). 3d*4 Expand (2 - 16 + 2)(-4d + 10 - 10)(d*4 - 2d*4 + 19d*4). 864d*5 Expand (4 - 2 - 1)(0 - 20 - 10)(8t - 18t + 9t + 5)(-2t + 0t - t). -90t*2 + 450t Expand (691 + 150 + 349)(-r3 + 2r*2 - 2r*2). -1190r*3 Expand (3z*2 - 4z*2 + 3z*2)(-z*2 + 2z - 2z) + ((-22z + 6z + z)(-1 - 1 + 0) - 2z + 1 - 1)(17z3 + 23z*2 - 23z*2). 474z*4 Expand (4031p*2 - 49602p + 49602p)((2 - 2 + 1)(2p2 - p2 - 2p2) + 3p - 3p - 2p*2 - 1 - 3p2 + 1 - p2 + 0p2 + 3p*2). -16124p*4 Expand (-19d + 8d2 + 19d)(-1 + 1 - 4d) + (2d2 + 755d - d*2 - 693d)(-4 + 4 + 2)(0d + 2d - 4d). -36d*3 - 248d*2 Expand (-3 + 4u + 3)(-3409u + 260418 - 260418). -13636u2 Expand (1051p + 32260 - 32260)(-3p2 + p2 + 0p2). -2102p*3 Expand (-13 + 4 - 8)(-9 + 2 + 2)(0i + 2i + 8i). 850i Expand (-3 + 5 - 3)(-2o + 0 + 0) - 4o + 3 - 3 - o + 3o + o + (-1 - 2 + 1)(-4o - 9 + 9) + 2 - 2 - o + 1. 8o + 1 Expand (6m - m - 7m)(-177 + 233 + 7m - 6m). -2m*2 - 112m Expand (40 - 104 + 55)(-8q - 2q2 + 8q)(-q2 + 0 + 0). -18q*4 Expand (4 - 3 + 2)(22 - 22 - 7u)(-5 - 2 + 2)((-2 + 0 + 1)(3 + 2u - 3) - 3u - 9u + 3u). -1155u2 Expand (0 + 1 + 1)(2q + q - q) - 2 + 2 - q - 31q + 6q + 15q + 5437 + 12q. 5q + 5437 Expand -218p - 132p + 77p + (-3 - 6 + 4)(0 + 0 - 2p). -263p Expand (0w - 15w - 8w)(3 - 3 + 2 - 1 + 1 + 1 + (2 - 1 + 0)(-1 + 4 - 5) - 1 + 1 - 2 - 4 + 1 + 4 - 1 - 1 + 1). 23w Expand (34 + 75 - 171)(-74 + 40 + 37)(u + u + 0u). -372u Expand (-2d3 + 6d*3 - 2d*3)(4863 + 8174 + 7704 + 522 + 429). 43384d3 Expand (4 - 1 + 0)(78c2 + 367c*2 + 1047c*2). 4476c*2 Expand (3h*2 + 0h*2 + 11h*2)(4 - 6 + 1)(-22h - 1 - 15h + 38h). -14h3 + 14h*2 Expand (-261g*2 - 10g + 4g + 32g*2 + 6g)(85 - 85 - 119g*3). 27251g*5 Expand (1 + 0 - 4)(-4d - 4d + 5d)(-43d - 25d - 28d). -864d*2 Expand (2 + 10j3 + j3 - j*3)((0j + 3j - j)(-2 + 3 + 0) + (0 + 0 + 2)(5 + 2j - 5)). 60j*4 + 12j Expand t*2 + 7t + 4t - 29t + (-9t + 4t - 10t)(t + t - t). -14t2 - 18t Expand (j2 + j2 + 0j2 + (0 - 3 + 1)(-3j - j2 + 3j) + 0j2 + 0j*2 - 2j*2 - 4j*2 - 11j + j*2 + 8j)(3 + 21j - 3). -21j3 - 63j*2 Expand (-2 + 2 - 2v)(-900v - 883v + 39 + 1774v - 4v + 5v - 2v + (-3 - 3 + 4)(-2v - 2 + 2)). 12v*2 - 78v Expand (13o3 - 4o*3 + 0o*3)(13o2 + 13o*2 - 12o*2 + (-4o2 + o2 + 2o2)(-3 + 0 + 1)) + (6 - 2 - 2)(2o*3 - 2o3 - o4)(o - 2 + 2). 142o*5 Expand (0l - l*4 + 0l)(0 + 3 - 4)(-l + 3l - 4l + 2)(-95 - 72 + 290). -246l*5 + 246l*4 Expand (-776 - 851 - 3477 - 8998)(-2d3 - 2d3 + d3 + (-d - d + 3d)(-1 + 1 - d*2) + 6d*3 - 4d*3 + 0d*3). 28204d*3 Expand (-69 + 301 - 145)(-1 + 1 + 2g)(-4 - 1 + 2). -522g Expand (0y + y - 2y)(-y + y + y + 2 + y - 2 - 2y + 4y - y + (y - 2 + 2)(0 + 5 - 3) + 63y - 611 + 611 + 1 + y - 1 + (-1 - 2 + 5)(-y + 4y - 7y)). -61y*2 Expand (((0 - 3 + 1)(1 - 1 - 1) - 2 + 3 - 3 - 1 - 8 + 2 - 1 - 4 + 2)(-3 - 3 + 3) - 2 + 2 + 2 + 2 - 4 + 0 + (2 - 3 + 3)(-1 + 0 - 1))(3i - i - i). 26i Expand (3 + 0 - 1)(1 - 1 + 2i4) + 4i*4 - 13i*2 + 13i*2 + 21i*4 + 37i*4 - 4i*4. 62i*4 Expand (0c2 + c2 + c*2)(2c - c + c) + 2c*3 + 0c*3 + 3c*3 + 1878c - 1878c - 270c*3. -261c*3 Expand (3 - 12 + 6 - k)(-242 - 779 + 347). 674k + 2022 Expand -s4 + 0 + 0 + (3 - 5 + 0)(-3s2 - 2s*4 + 3s2) - s3 + 2s4 + s3 + 2s4 - s4 + s*4 - 49289 + 49289 - 596s*4. -589s*4 Expand ((2 + 1 - 1)(3 + 0 - 2) + 1 + 1 - 1 - 2 + 5 - 2)(-198u - 192u - 597u). -3948u Expand -7i*3 - 3i*3 + 2i*3 + (0i*2 - 2i*3 + 0i*2)(0 - 3 + 7) + i2 - i2 - 3i3 - 2i*3 + 3 - 3. -21i*3 Expand 18z*5 + 18z - 18z + (-3z - z + 6z)(-3z3 + z4 + 3z*3) + 689z*4 - 689z*4 - 10z*2 + 13z*5. 33z*5 - 10z*2 Expand (0z - 2z + z)(0z3 + 4z*3 - 5z*3) + 14z*4 + 23z*2 + 38z*2 - 60z*2. 15z4 + z2 Expand ((-1 - 1 + 10)(-8s*2 - 6s*2 + 3s2) - s2 + 5s2 + 0s*2)(-2s + 2s - s + (-1 + 3 - 1)(1 - 1 + s) + 2s + s - 2s + 0 - 2s + 0). 84s3 Expand 3b2 - b2 - 4b2 + (-3b - b + 3b)(-1 + 1 + b) + (38 - 122 - 34)(-8b*2 - 1 + 7 - 7). 941b*2 + 118 Expand (-368n - 355n + 2 + 666n)(-1 - n + 1). 57n*2 - 2n Expand (-46x + 59x - 8x)(0 + 2 + 3). 25x Expand (3 + 7 - 6)(-23 - 77 + 22)(3k*2 - 6k*2 + 2k*2) + (2 - 2 + 2k)(3 - k - 3). 310k*2 Expand (1 - 3 + 3)(3399 - 14607 - 624)(a - 4a + a). 23664a Expand (-2073i - 2086i + 4149i - 15)(-4 + 2 + 1)(-2 + 1 + 0)(-i + 2i + 0i). -10i*2 - 15i Expand d + 0d + 0d + ((-4 - 2 + 5)(4d - 7d + d) - 9d + d + 0d)(-12 + 89 - 24). -317d Expand (-b + 3 - 3)(7 - 3 - 2)(-459 - 302 + 73)(-2b + 2 - 2). -2752b*2 Expand 4g*5 - 3g5 + g5 + (7 + 6 - 5)(31g*2 + 38g*5 - 31g*2) + 4g*4 - 5g*4 + 3g*5 - 2g*5. 307g5 - g4 Expand (0d4 - d4 + 20d*4)(54 + 671d + 30 - 670d). 19d5 + 1596d*4 Expand (-610o*2 - 474o*2 - 3463o*2)(o + 0o - 2o). 4547o3 Expand (-3 - 1 + 1)(233j3 + 615j*2 - 615j*2) + (-2j*2 - 2j*2 + 2j*2)(-j + j + j - 2j - j + 2j + 0j + 2j + 0j + (4j - j - 2j)(3 - 4 + 2)). -705j3 Expand (-4m2 + m2 - m*2)(-447 + 132 - 584) - 2m2 - 2 + 2 + (-m - 4m + 4m)(-5m + 6m - 2m) + 4m2 - m2 - 5m2. 3593m*2 Expand (-3 + 3 - 2i)(3i*2 + 2i*2 - 4i*2) + 4i*3 - 2187i - 3i3 + 2028i + 2 - i2. -i3 - i*2 - 159i + 2 Expand (-92 + 92 + 7h3)(8h - 3h - 2h + (-h + 0h - 3h)(-2 + 1 + 3) + (2h + 1 - 1)(-2 + 2 - 1) + 0 + h + 0 + 2h - 8h + 2h). -70h*4 Expand -6r2 - r2 + r*2 + (-5r - 2r + 0r)(-1 - 2r + 1) + 3r2 + 2r2 - r2 + 0r2 + 0r2 + r2. 13r2 Expand -44p - 6p3 + 4p3 - p3 - p*3 + 2p*3 + 2p*3 - 6p*3 + (-2p*2 + 5p*2 - 4p*2)(2p + 2p - p). -9p3 - 44p Expand (14n2 + 6n*2 + 11n*2)(-19n + 11n - 14n) + (-5 + 8n*2 + 5)(n + 3n - 2n). -666n3 Expand n5 - 6n*5 + 3n*5 + 418n*5 - 113n*5 + 54n*5 + (-4n*5 + 0n*5 + 0n*5)(0 + 2 - 1). 353n5 Expand (-1 + 6 - 3)((-3 + 1 + 0)(5z - 5z - z) - 1 + z + 1 + 65z + 57z + 82z). 414z Expand (-60 + 22 + 32 - 248h + 19)(6 - 2 + 0). -992h + 52 Expand (2c - 3c + 4c + 54c + 6c)(-25699c + 42c*2 + 25699	{ "pile_set_name": "DM Mathematics" }
-4/13 Calculate 19/(-16 + 111) - 14/10. -1/5 What is the value of -7-1(2 + -5) - (10 - 17)? -14 What is (((-10)/4)/((-20)/24))/(48/464)? 29 (369964/(-16863) + (21 - -1))/(1/(-6)) -4/11 Calculate 186/1562 + ((-1)/(-4))/(1375/(-500)). 2/71 Calculate (-153)/(-45) - 6932/120. -15 What is the value of -5 + (-1 - ((-2761)/308 + 4) - -1)? -1/28 What is (2/8)/((-197)/1379)(-2)/(-21)? -1/6 What is (-554)/(-3878) - (-139)/142? 20 (25235/2884)/(33/12 - 3) -35 Evaluate 291/(-168) + 9/(-54). -5/4 What is the value of (0 - (-2)/6)((-248)/8 - -37)? 2 4 - (-38 - -6) - (-65 + 70) 31 What is (0 + 1/(-3))/(2061/(-13740))? 20/9 Calculate 1680/(-2205) - (-3 + 1/(42/129)). -5/6 What is the value of 192/18720(-405)/(-18)? 3/13 What is the value of ((-153)/(-21))/((-180)/420)? -17 Evaluate 4/8 - ((-2)/11 - (-1029)/154). -6 Calculate (-31)/35 - (108/(-90) - 24/(-15)). -9/7 Calculate (-12)/5(-11 - 518/(-28)). -18 Evaluate 2 - (-110)/(-121) - 806/759. 2/69 What is -3 + -4 + -3 + 13? 3 What is 1070/4173-64/40? -2/13 Evaluate 6517/(-285) - (-41 + 48 - 103/15). -23 What is the value of ((-90)/(-700))/(3/7)? 3/10 What is ((-1)/8-30)/(459/68)? 5/9 (7/3)/(16394/182676) 26 What is the value of 15/(-5 + 5 - (-5 - (-102)/24))? 20 What is the value of 21/61312/2009? 16/7 Evaluate (-369)/(-861) + 58/(-119). -1/17 What is 12/(-16) + ((-2)/(-13) - 74217/(-2028))? 36 (-45)/(-120) - (-3)/(-8) 0 (27 - 33 - 2-1)11/682 -2/31 What is the value of ((-273)/28)/(4/(-22)(-165)/(-120))? 39 Calculate 2/(-10)170/731. -2/43 What is the value of 15/(-45)(-5 - -3)? 2/3 ((-30)/9)/(176/(-120) - (-36)/45) 5 Evaluate ((240/(-88) + 3)(-12 - -14))/(-1). -6/11 (12/15 - 0)/((-12)/20) -4/3 Evaluate (-5 + 3)/(9 + -3 - 2). -1/2 What is the value of (-42)/1 - 121/(105/(-50))? -32 What is the value of (-14 + 12 - -5) + 58/(-22)? 4/11 What is 4917/447 - 10/(-2)? 16 -8 - (-1 + 391/(-23)) 10 What is the value of (135/(-12))/((-80 + -15)/19)? 9/4 Calculate (-52)/36924/(-546). 22/9 What is the value of (15 + -13)((-216)/16 - -4)? -19 Evaluate -20 + (-177)/(-118) - (-21)/4. -18 Evaluate 0 + 28/(-35) + (-738)/(-885). 2/59 -65(-48)/9360 + 106/6 18 What is the value of (-27)/660 + 33/363? 1/20 What is (-320)/12 + 7/(-3)? -29 What is (630/36)/((-20)/(-8)) + -10? -3 What is (189/(-27) - -11)(-7)/(-12)? 7/3 What is the value of 19 + -10 - (14752/1650 - 38/627)? 3/25 28(-8 - (-186)/24)/1 -7 Calculate 860/45 + 600/(-540) + -1 + -8. 9 Evaluate (((-52)/7)/(-13))/((-390)/(-273)). 2/5 Evaluate (-1106)/(-238) - (-66)/187. 5 Evaluate (-424)/80 + 5 + 77(-3)/30. -8 100/10 + (-12)/2 4 Evaluate 81/(-105)15/6 - (3 - 5). 1/14 What is the value of 2/(-40) + (-10 - -5) + 21/4? 1/5 Evaluate (-14 - -9) + (-120)/66 + 7. 2/11 What is 280 + -263 - 189/11? -2/11 Calculate ((-20)/32)/5 - ((-13580)/32)/35. 12 Calculate ((-8)/38)/(-27 + (-471)/(-19)). 2/21 What is -14 - (-2724)/180 - 12/9? -1/5 What is (-43)/((-430)/60) + 3? 9 Calculate 240/(-320) + (-10)/8. -2 50/(-750) + 2483/2145 12/11 What is the value of 680/(-294) + 2611/1119? 1/49 What is ((-135)/10)/((-21)/(-28))? -18 (6/9)/((-4)/12) + 10 + 2 10 What is the value of (142/1775)/(((-153)/(-18))/17)? 4/25 (-3)/3 + (-19 - -2)(-19 + 18) 16 Calculate (-612/504)/((-1)/2). 2/7 What is the value of -2 - (3159/135 - (0 - (-18)/(-30)))? -26 What is the value of 156/(-65) + (1/8 - (-99)/360)? -2 What is 95/21 + (-134)/5628? 9/2 Calculate 60/25(-650)/312-4. 20 Evaluate (-970)/(-1552)(-12)/(-15). 1/2 What is 30 + 1064/(-35) + (-116)/10? -12 88/(-72)(-66)/242 1/3 1904/833 - 580/266 2/19 What is 46/(-161)28/(-64)? 1/8 (3(-17 + 10))/3 -7 Calculate 3/8 + (-8)/((-384)/(-66)). -1 What is the value of -2 - (16 + -17 - -3)? -4 What is the value of 408/(-48) + (-4 - (-22)/4)? -7 Calculate (205/(-738))/(-2 - 196/(-100)) - 7. -1/18 Evaluate 12 + (-2784)/160 - (-2)/5. -5 Calculate (-237)/10 - 4608/15360. -24 What is (-3)/84 - (-25781)/403564? 2/71 -13(8 + 3294/(-351)) 18 What is (-9)/(-45)385/(-66)? -7/6 What is the value of (-4)/(-1 + 0) - ((-6636)/(-348) - 15)? -2/29 ((-2)/6)/((-2)/22 - (-50)/1155) 7 Calculate 160/760 - (-138)/(-1197). 2/21 (-2)/(-30)-13 + 1 + 4/195 2/13 Calculate ((-64)/(-2128))/(32/(-112)). -2/19 Evaluate (((-104)/6)/1)/((-37)/(2442/(-44))). -26 What is the value of (54/117)/((-360)/(-585))? 3/4 Evaluate (1128/(-27495)39)/(21/30). -24 What is (-203 - -215)/((-76)/2)? -6/19 What is ((-144)/4)/(-4) - (-5 + (16 - 11))? 9 What is (-2)/(-10) + (-1305)/(-150)(-4)/(-6)? 6 (1974/(-188))/((-7)/(-14)) -21 Evaluate (11 - 0) + 1930/(-80) + 13. -1/8 Evaluate (-7224)/129(-2)/(-8). -14 What is the value of ((-495)/35 - -6) + (-3 - 2)/(-35)? -8 What is the value of -17 + -2 + 120/15? -11 Calculate (9/(-34))/(2028/(-5746)) + 100/16. 7 (55/(-10))/(20/48) -6 Calculate 24(-31)/(-682) + (-243)/(-231). 15/7 Evaluate (-25)/(-125) + 140/(-325) - 1468/(-52). 28 Calculate (-23)/(-66) + (-120)/720. 2/11 (18/33)/(525/(-1155)) -6/5 Evaluate 7 + -34 + (-4 - -30). -1 Evaluate ((-5)/8)/(((-3311)/(-172))/77). -5/2 What is the value of (-4)/(-2640)30 - 2/(-4)? 6/11 1(104/(-455) + 16/20) 4/7 784/266 - (-44)/836 3 12/(1 - -1) - ((-10080)/16)/42 21 What is (468/13 + -40 - 39/(-5))/1? 19/5 Calculate (4 - 1117/279)/((-22)/132). 2/93 What is (-40)/35 + 7 + ((-2545)/315 - -2)? -2/9 725/280 + 600/(-320) 5/7 (((-1)/2)/((-44)/(-132)))/((-63)/(-924)) -22 What is the value of ((-1040)/144 - -8)/14? 1/18 Calculate -10(-8)/126 + (-15)/((-1350)/20). 6/7 What is -51/6 - 1985/2382? -5/3 Evaluate 2(-13)/((-195)/(-90)). -12 Evaluate ((-26)/(1404/18))/((-2)/(-48) - 0). -8 What is the value of (-123 + 125)(-6)/1 + -8? -20 (16/(-44))/(36/(-198)) - 3 -1 (-7 - 5) + (3/(-9))/(2/(-6)) -11 What is 80/16(-10)/(-70)? 5/7 What is the value of (-6)/(-10) + (-54)/40 - 23/(-46)? -1/4 Evaluate ((-248)/12 - -19)(10 + -1). -15 What is the value of 1/(99/102) + 4 + (-168)/36? 4/11 Calculate 1/(-9) + (-2407)/(-1044)2. 9/2 Evaluate 1200/(-15000) + 263/(-150). -11/6 Calculate (9(-91)/(-1170))/((-3)/6). -7/5 What is the value of (-8)/144-9(-1 - 1)? -1 Evaluate ((-126)/315)/((-28)/5). 1/14 What is ((-54)/14 - -3)/((-14076)/3864)? 4/17 Evaluate 265/(-212) + (-6)/24. -3/2 What is the value of -85 - -63 - (-7)/(-1)? -29 Calculate -103 + 112 - 12/1. -3 What is the value of ((-3)/(9/2))/(5915/(-2535))? 2/7 What is the value of (((-144)/(-15))/(-12))/(1(2 - 1))? -4/5 Calculate (-75)/(-19) + -130 + 126. -1/19 What is 40/(-90)9(0 + (-1)/20)? 1/5 Evaluate (-1884)/533817/(-3). 2 What is the value of 11 + 1 - 1728/192? 3 What is (147/(-1372))/((3/5)/((-16)/20))? 1/7 8/108 + (-18 - 472/(-27)) + -2 -22/9 33084/9190(0 - (-10)/3)3 36 What is the value of (1344/1008)/((-12)/135)? -15 What is the value of (-5 + 9 + -2)4/30? 4/15 Evaluate 6 - (-4)/((-24)/12). 4 Calculate 1157/445(-10)/(-2). 13 Calculate 168/(-12) - 65/(-52)8. -4 618/(-21) + -2 - (-3640)/(-6370) -32 3/(9 + 14/(-8) + -5) 4/3 Evaluate (65/(-45))/(-3 + 50/(-15)). 2/19 8/(-240)5 - -67/252 0 (-19 + 187/22)(34 + -4) -15 What is 15/2(389/55 + (-9 - -2))? 6/11 (2 - (-2)/(-4))/(((-855)/38)/15) -1 Evaluate (-7)/(-2) + 3 + -111 + 106. 3/2 (-80)/(-42)224/(-80) -16/3 Calculate 15((96/46 - 2) + 5408/(-7176)). -10 What is the value of (0 - (-1)/(-5))(-5700)/(-760)? -3/2 Evaluate 3910/(-81144) - (-1)/49. -1/36 What is 1014/(-338)2/2? -3 (-15732)/(-782) + -27 + ((-45)/(-51) - 1) -7 (26/78)/((36/(-24))/(1 - 2)) 2/9 What is the value of 2/(-10)-105 - 21? 0 What is the value of (1035/(-15))/(((-50)/60)/1)? 28 (-358)/1790 - (-41)/5 8 What is -18 - (3511/(-275) - 3/5)? -16 Calculate (731/102 + -7)108. 18 What is (-20)/6(-162)/270? 2 What is the value of (-62 + 67)/((-4)/4)? -5 (-2376)/(-144) + (-7 - -6) + -18 -5/2 What is the value of -1(-33 - -19) - -2? 16 What is the value of (-426 + 327)/(-8 - 1)? 11 Calculate 1((15/24)/(-5) + 30/(-16)). -2 Evaluate 11/(297/612)6/(-8). -17 -48 + 10693/222 + (-2)/((-12)/(-55)) -9 What is the value of (-12)/(-20) - 57/(86640/832)? 1/19 (-6)/(-21) - (-3195)/(-16401) 1/11 49/(-3)27/(-21)(-26)/(-39) 14 Calculate -1((-1251)/90 - -14 - 27/(-130)). -4/13 What is (-80)/(-65)(114/(-24) + 5)? 4/13 What is the value of 4/2(105*8/80 + -12)? -3 What is the value of 6160/704 + (-9)/12? 8 -2 + 18/(-2) + 80820/7380 -2/41 Calculat	{ "pile_set_name": "DM Mathematics" }
(-33))/(2/15). Let v = d - 5. Determine u so that -8u + 5u*2 - 28u*4 + 23u*2 + 26u*5 - 4u*v - 16u*3 + 2u*5 = 0. -1, 0, 1/2, 2/3, 1 Let f(p) be the third derivative of -4/105p*5 + 2/735p*7 - 2/21p*3 + 0p - 25p2 + 1/1176p*8 - 1/12p*4 - 1/210p*6 + 0. Factor f(h). 2(h - 2)(h + 1)4/7 Let y(i) = 6i*3 - 12i*2 + 96i - 122. Let f(b) = b*3 - 1. Let w(d) = -10f(d) + y(d). Factor w(o). -4(o - 2)2(o + 7) Let p be (-5048)/2030 - (-10)/(-35). Let o = 24/29 - p. Factor 0 + 0k + 14/5k*5 + 0k*2 + 4/5k*3 - ok*4. 2k*3(k - 1)(7k - 2)/5 Find p, given that 3p3 + 0 - 6/5p*2 - 24/5p - 3/5p4 = 0. -1, 0, 2, 4 Suppose 2w - 10 = 2x, 3 = 5x + 3w - 12. Let xn + 0 - 2/7n2 = 0. What is n? 0 Suppose 0 = -5j + 2t - 3t - 100, 0 = j + 3t + 34. Let d be 20/(-175)j15/6. Find a, given that -18/7a*3 - da - 6/7 - 66/7a2 = 0. -3, -1/3 Let a be 0 - 4/(-28) - (116/28 - 6). Let g = -2 + 4. Factor 0 - 2/5u*5 + 4/5u*g + 0u - au3 + 8/5u*4. -2u*2(u - 2)(u - 1)2/5 Let q = -20 - -28. Let t be (9/12)/(2/q). Factor -4f - 5ft + 0f3 - f4 - 4f2 - 4f*2. -f(f + 1)(f + 2)2 Solve 9/10c*2 + 1/2c*3 + 1/10c*4 + 7/10c + 1/5 = 0 for c. -2, -1 Let s(y) be the third derivative of -y7/840 + y5/120 - y*3/24 - 3y*2 + 31y. Factor s(b). -(b - 1)*2(b + 1)*2/4 Let y(a) = -2a*2 - 61a + 398. Let b be y(-36). Find w, given that 1/4 - 3/8w + 1/8wb = 0. 1, 2 Let l(b) be the first derivative of b6/15 + 2b5/5 + 4b*4/5 + 8b*3/15 + 67. Solve l(v) = 0 for v. -2, -1, 0 Let x = -550 - -550. Let s(h) be the third derivative of -1/10h*5 + 0 - 1/2h*3 - 6h*2 - 1/20h*6 + 3/70h*7 + xh + 3/8h4 - 1/112h*8. Factor s(w). -3(w - 1)*4(w + 1) Factor 5s4 + 6s*5 + 16s*2 - 5s*5 - 7s*3 - 7s*4 + 7s*4 - 15s3. s2(s - 2)(s - 1)(s + 8) Factor -140g - 5g3 - 874 + 1004 - 125g + 140g2. -5(g - 26)(g - 1)2 Let p(y) be the third derivative of 0 + 1/2y*3 - 19y*2 + 1/4y*4 + 1/160y*6 + 0y + 1/16y5. Determine h so that p(h) = 0. -2, -1 Suppose -143s = 22s - 495. Find x, given that 8/3x + 22/9x2 - 20/3x*s - 8/9 - 50/9x4 = 0. -1, 2/5 Let c(m) = -m2 - 11m3 + 12m*3 + 2 - 1. Let s(j) = -4j*3 + 2j. Let n be ((-5)/(15/6))/(-2). Let p(f) = ns(f) + 2c(f). Find y such that p(y) = 0. -1, 1 Let v be (-19)/(18/(-24)). Solve v - 4k*3 + 7 - 19 = 0. 0 Let n = 104 + -99. Let a be (n/(-25))/(49/(-70)). Determine q so that -2/7 + aq*2 + 0q = 0. -1, 1 Let o(j) = -3j4 - 8j*3 - 5j*2 + 10j. Let p(a) = -12a4 - 33a*3 - 21a*2 + 42a. Let b(z) = 21o(z) - 5p(z). Suppose b(x) = 0. What is x? -1, 0 Let k(x) be the first derivative of 4x6/21 - 4x*5/7 + 4x*4/7 - 4x*3/21 + 585. Factor k(h). 4h*2(h - 1)*2(2h - 1)/7 Let z = -506/9 - -1039/18. Solve -zw + 0 - 3/2w2 = 0. -1, 0 Let x(v) be the third derivative of v7/420 - 29v*6/120 + 781v*5/120 + 145v*4/4 + 75v*3 + 279v2. Factor x(a). (a - 30)2(a + 1)2/2 Let k(u) = -55u - 273. Let d be k(-5). Factor -dz2 + 2/3z*4 - 2/3z + 4/3 + 2/3z3. 2(z - 1)*2(z + 1)(z + 2)/3 Let w(i) be the first derivative of -8i*6/3 - 96i*5/5 + 59i*4 - 52i*3 + 16i*2 + 27. Let w(o) = 0. Calculate o. -8, 0, 1/2, 1 Let a(y) be the second derivative of 0 - 1/4y*3 - 1/80y*5 + 3/32y4 + y + y2. Let c(s) be the first derivative of a(s). Suppose c(k) = 0. Calculate k. 1, 2 Let l(h) = -2h4 + 5h - h*4 - 4h*2 - 13h - 8h3 + 7h4. Let f(x) = -x4 + x. Let s(j) = 8f(j) + l(j). Factor s(p). -4p*2(p + 1)2 Let h(c) be the first derivative of c6/3060 - c*4/51 - 7c3/3 - c2 - 34. Let p(d) be the third derivative of h(d). Factor p(v). 2(v - 2)(v + 2)/17 Factor -32d2 + 50d*3 - 46d*2 + 5d*4 - 30d*2 + 153d*2. 5d*2(d + 1)(d + 9) Let t(y) = 0y - 3y + 2y - 17 + 15. Let m be t(-2). Factor 0o + 0 - 2/7o*4 - 2/7o*3 + mo*2. -2o*3(o + 1)/7 Suppose 7b = 3b + 16. Factor -8p2 - 5p*3 - 13p*3 + 6p*3 - 4p*b. -4p*2(p + 1)(p + 2) Let j(h) be the second derivative of h6/24 + h5/6 + 5h*2/2 + 7h. Let i(r) be the first derivative of j(r). Factor i(c). 5c2(c + 2) What is p in -10/7p3 + 0 - 2/7p*4 - 8/7p - 16/7p2 = 0? -2, -1, 0 Suppose -3m + 19 = 2x, 4x - 4m - 8 = -0. Let k be (-10)/8(1 - x). Factor -4wk + 2w*3 + 3w*3 + 4w*2 - 4w4 - w3. -4w2(w - 1)(w + 1)2 Let v(q) = -4q + q*2 - 1 + 5q + 2. Let p be (-7)/7(2 - 3). Let h(c) = 4c + 2. Let j(l) = ph(l) - 2v(l). Let j(t) = 0. Calculate t. 0, 1 Let a(k) be the second derivative of k5/20 - k4/8 - k*3/6 - 166k - 2. Factor a(c). c(c - 2)(2c + 1)/2 Let i(m) be the third derivative of m7/5040 - m6/288 + m5/40 - 17m*4/12 + 34m*2. Let h(q) be the second derivative of i(q). Factor h(d). (d - 3)(d - 2)/2 Factor 646/9r2 + 70/9r*3 + 2/9r*4 + 0 + 578/9r. 2r(r + 1)(r + 17)2/9 Let z(p) = 4p*2 - 9p. Let g(r) = r*2 - r - 7r + 6r. Suppose -4q + 6q = 4. Let n(d) = qz(d) - 9g(d). Solve n(a) = 0 for a. 0 Let y(w) = 69w*5 + 260w*4 + 60w*3 - 11. Let s(d) = 14d*5 + 52d*4 + 12d*3 - 2. Let k(x) = -11s(x) + 2y(x). Factor k(g). -4g*3(g + 3)(4g + 1) Let k(p) be the second derivative of -5p7/84 + 4p*6/3 - 61p*5/8 - 115p*4/12 + 200p*3/3 + 160p*2 + 2p - 39. Solve k(s) = 0. -1, 2, 8 Let i(r) be the first derivative of -25r3/3 - 35r + 10. Let l(z) = z*2 + 1. Let s(n) = -i(n) - 30l(n). Factor s(p). -5(p - 1)(p + 1) Let g(l) be the third derivative of l6/3060 + l5/170 + 3l4/68 + l3/6 + 6l*2. Let v(s) be the first derivative of g(s). Factor v(r). 2(r + 3)*2/17 Determine k, given that -4k*4 - 108k*2 + 108k*3 - 16k*5 + 22k - 238k + 12k*5 = 0. -6, -1, 0, 3 Factor -7c*3 - c - 8c - 10c + 18c + 8c3. c(c - 1)(c + 1) Let m(n) be the first derivative of -4n*2 + 0n*3 + 0n + 0n5 - 1/540n*6 + 0n4 - 4. Let h(f) be the second derivative of m(f). What is i in h(i) = 0? 0 Let k(b) = -b3 - 23b2 - 21b + 28. Let s be k(-22). Let -566 + 4i2 + si*3 + 562 - 4i - 2i3 = 0. What is i? -1, 1 Let r(p) = -5p*3 - 620p*2 - 26455p - 370440. Let m(q) = -5q3 - 618q*2 - 26454q - 370440. Let o(s) = 5m(s) - 6r(s). Factor o(v). 5(v + 42)3 Let x(q) be the second derivative of -3q*5/10 + 2q*4/3 + 5q*3/3 - 2q*2 + 2q + 91. Factor x(a). -2(a - 2)(a + 1)(3a - 1) Let h = -166640/3 + 55549. Factor hu + 1/3u*2 + 2. (u + 1)(u + 6)/3 Let l(m) be the first derivative of 2m3/27 - 2m*2/3 - 14m/9 - 117. Factor l(c). 2(c - 7)(c + 1)/9 Factor 2/17n2 + 76/17n + 722/17. 2(n + 19)2/17 Determine h, given that 4/5h*3 + 0 + 28/5h*2 - 32/5h = 0. -8, 0, 1 Let q(k) be the first derivative of -k*4/3 - 20k*3 - 450k*2 + 15k + 1. Let b(m) be the first derivative of q(m). Factor b(i). -4(i + 15)2 Let i(x) be the second derivative of -3x*5/80 + 27x*3/2 + 162x*2 + 286x. Solve i(k) = 0. -6, 12 Suppose 1290 = -3m + 8m. Find k such that -2k + m + 2k*5 - 258 - 4k*2 + 4k4 = 0. -1, 0, 1 Let n(v) be the first derivative of v4/14 - 2v3/21 - 6v*2/7 - 56. Factor n(i). 2i(i - 3)(i + 2)/7 Determine t, given that 229/2t2 + 0 + 3/2t*3 - 77t = 0. -77, 0, 2/3 Let x(p) be the first derivative of -7p4/6 - 4p*3/3 - 4p*2/7 + 34p + 13. Let d(m) be the first derivative of x(m). Suppose d(r) = 0. Calculate r. -2/7 Let c(q) be the second derivative of -2/7q3 + 2/7q*4 + 3q + 1/70q6 - 3/28q*5 + 0q*2 + 5. Solve c(w) = 0. 0, 1, 2 Factor 72/5t + 4/5t2 + 288/5. 4(t + 6)(t + 12)/5 Let o(w) be the third derivative of w6/90 + 8w*5/15 + 32w*4/3 - 7w*3/3 - 6w*2. Let m(l) be the first derivative of o(l). Factor m(f). 4(f + 8)2 Let v(d) = -d3 + 18d2 - 18d + 19. Let j be ((-204)/36)/((-1)/3). Let t be v(j). Factor tx2 + x3 - 3x*2 + 0x2. x2(x - 1) Let a = 13 + -10. Let d be (4/a)/((-4)/(-6)). Find q such that -2q2 - q + q5 - 25 + dq4 + 25 = 0. -1, 0, 1 Let d(h) be the third derivative of h7/150 - 37h*6/600 + 11h*5/50 - 11h*4/30 + 4h*3/15 - 425h2. Factor d(v). (v - 2)2(v - 1)(7v - 2)/5 Let 1/2x*4 + 0 + 4x + 5x3 + 17/2x**2 = 0.	{ "pile_set_name": "DM Mathematics" }
et z = i - -62/13. Sort 1, z, -0.5 in descending order. 1, z, -0.5 Suppose 1 = -z - 3. Let h be (-54)/z(-16)/(-24). Let n be (-26)/10 + h/15. Sort n, 3, -1 in ascending order. n, -1, 3 Let k be 10/(-35) + (-50)/(-28). Suppose b - 3y = 16, -b = -y - 0y - 6. Let v(q) = q - 3. Let r be v(b). Sort k, 0.1, r in ascending order. r, 0.1, k Let r = -244 + 292. Sort -4, r, 2 in descending order. r, 2, -4 Suppose 0 = -68c + 80c + 216. Sort -2, c, 3 in descending order. 3, -2, c Let a(v) = -v3 + 17v*2 + 20v - 30. Let m be a(18). Sort -3, 4, 1, m. -3, 1, 4, m Let d = -110.8 + 29.8. Put d, 2, -1 in decreasing order. 2, -1, d Let i = -64.4 - -64.5. Sort -0.1, -3, -5, i. -5, -3, -0.1, i Let a = 324 + -320. Put 0, -4, -2/13, a in decreasing order. a, 0, -2/13, -4 Let o = -6 + 6.12. Let i = 0.018 - -2.102. Let p = o - i. Sort -1, -2/11, p in decreasing order. -2/11, -1, p Let b be (2 - 4)38/(-76). Sort 2, -1, -5, b in ascending order. -5, -1, b, 2 Let n = 0.42 - 0.12. Sort 1, -0.5, 5/3, n. -0.5, n, 1, 5/3 Let c be ((-16)/6)/(5/90). Let m = c + 53. Sort -3, 2, m in decreasing order. m, 2, -3 Let x(g) = -g3 + 2g. Let o(p) = 3p - 6. Let n be o(2). Let t be x(n). Sort t, -1, -7 in descending order. t, -1, -7 Let i be (-4)/5436. Put 0.5, 15, i, -4 in decreasing order. 15, 0.5, i, -4 Let j be (951/(-18))/1 + 3/6. Let g = -52 - j. Sort -0.3, 21, g in descending order. 21, g, -0.3 Suppose -8w = 24w - 416. Sort 5, w, 7 in ascending order. 5, 7, w Let a = 32.965 - -0.035. Let p = -37 + a. Sort p, -0.3, -0.5, -7. -7, p, -0.5, -0.3 Suppose 2m = -5p + 21, 7 + 5 = 4p. Let a(u) = 2u + 1. Let l be a(1). Let v = l + -6. Sort 0, m, v in increasing order. v, 0, m Suppose -d + 37 - 17 = 0. Sort 1, d, -3 in decreasing order. d, 1, -3 Let y(q) = -q3 - 4q*2 + 4q + 16. Let t be y(-5). Let p = -19 + t. Put p, -0.4, -2/3 in descending order. p, -0.4, -2/3 Let r = 1247 + -1255. Put 5, r, -0.11 in decreasing order. 5, -0.11, r Let y be 0 + -2 + 13 + -3. Let r(o) = -o*3 + 9o*2 - 6o - 11. Let f be r(y). Let i = -100 + 101. Put i, 4, f in ascending order. i, 4, f Suppose -6z = 392 - 1124. Sort z, 2, -1 in ascending order. -1, 2, z Let j = -3.173 + 3.573. Let l be (-12)/9(-6)/10. Put 5, j, l in decreasing order. 5, l, j Let n be 8/3 - 2 - 1. Let y = -0.9 + 0.11. Let x = -0.49 - y. Sort -8, x, n in descending order. x, n, -8 Let p = 0.0127 - -0.0373. Put p, -0.8, 0.5, 4 in descending order. 4, 0.5, p, -0.8 Suppose 2v + 5v + 35 = 0. Suppose 0 = 2j + j - 12. Suppose 6 = 4a - 6. Put a, v, j in descending order. j, a, v Let b = -1144 - -1141. Sort 274, 0.1, 1/7, b in ascending order. b, 0.1, 1/7, 274 Let u = 451.8 + -450. Sort -2, 0.1, u in descending order. u, 0.1, -2 Let l = -65/9 + 1217/171. Put -0.4, 0, l, -5 in descending order. 0, l, -0.4, -5 Suppose 0 = 2p + 3m, 0 = 5p + 15m - 18m. Sort p, -214, 3, 4 in decreasing order. 4, 3, p, -214 Let j = -3583 - -3588. Let o be (-7 + 3)10/8. Put j, -3, -2/19, o in descending order. j, -2/19, -3, o Let h(a) = -a*2 - 10a - 12. Let s be h(-8). Suppose 2f = 3k + 41, -65 = 2k + 3k - sf. Let d = k + 23. Sort 4, d, 1 in ascending order. 1, 4, d Suppose 30 = -75f + 85f. Put f, -1/2, -2/9, -4 in ascending order. -4, -1/2, -2/9, f Suppose -5v - 2j + 3j - 1 = 0, 5j + 25 = -5v. Put -2, 0.5, v, -1/6 in descending order. 0.5, -1/6, v, -2 Let z = -1.215 + 0.215. Put 43, z, 0.1, 3 in ascending order. z, 0.1, 3, 43 Let d(r) = r - 7. Let w be (-2)/1(-36)/24. Suppose -t = -4k - 13, 4k - wk = -t + 8. Let g be d(t). Sort -5, -11, g in increasing order. -11, -5, g Let n = -454 + 451. Let t = -0.2 - 0.3. Sort t, 2, n, 5 in ascending order. n, t, 2, 5 Let l = 6.8 - 1.8. Let g = -0.53 - -1.33. Sort 2/13, g, l. 2/13, g, l Let a be ((-25)/5)/140 - 10/(-35). Sort a, 24, -1, 0.3. -1, a, 0.3, 24 Let f = 13.5 - 13. Let y be -1 + 7 - (-1 - 0). Suppose 4q + y = -u + 2u, -3u - 30 = 5q. Put u, f, 2 in decreasing order. 2, f, u Let t = -18 + 2. Let h = t + 49/3. Let x be ((-3)/2)/((-6)/8). Put h, x, 0.5 in decreasing order. x, 0.5, h Let g = 0.2 + 0.1. Let h(y) = -y*2 + 4y + 3. Let n be h(3). Let k be n/(-4)(-10)/30. Sort -0.1, g, k in descending order. k, g, -0.1 Suppose -5f + 2 = 4r, -3r + 5 = -4. Let n = 4.15 - 3.85. Let m be (-5)/(1 + -3 + 3). Put f, m, n in descending order. n, f, m Let r = -4.25 - -3.75. Sort -1, r, 2, -0.01. -1, r, -0.01, 2 Suppose f + 17 = 6y - 3y, -f = 2. Suppose 15 = yi - 0. Sort i, -8, 0. -8, 0, i Let x = 107 - 110. Let m = 76/99 - 6/11. Sort m, x, -2/7. x, -2/7, m Let s be (-144)/440 - 9/33. Let t = 5.89 + 0.11. Sort t, s, -5 in descending order. t, s, -5 Let c = -75 + 77.7. Let q = c - 3.2. Sort 10, -2, q in descending order. 10, q, -2 Let z(c) = -c2 + 6c. Let g be z(5). Suppose -6m + 9 = 5d - 4m, -2m = -4d. Put g, d, 3 in decreasing order. g, 3, d Let h(u) = -u3 + 5u*2 + 6u + 4. Let f be h(6). Let t(j) = 15j - 14j*3 + 4j*2 + 24j*3 - 13 - 11j*3. Let a be t(6). Sort f, 2, a. 2, f, a Let u be 4/3(-27)/18. Let c(m) = m3 - m2 + 7. Let s be c(0). Let g = s + -2. Put u, g, 2 in descending order. g, 2, u Suppose -3n + 2x - 8 = 0, 5n - 2n = -x - 14. Suppose -443v = -413v - 90. Sort -1, v, n. n, -1, v Let x(q) = q + 1. Let w(i) = -12i - 2. Let h(s) = 2w(s) + 22x(s). Let t be h(10). Sort t, 0, -5 in ascending order. -5, t, 0 Let m = -0.167 + 1.427. Let t = 1.76 - m. Sort -4, t, -0.3 in ascending order. -4, -0.3, t Let u = 907 + -816. Sort 3, u, -1. -1, 3, u Let y be (-11)/18 - 3/(-6). Suppose -57t + 58t - 4 = 0. Sort y, -29, t in ascending order. -29, y, t Suppose -13377 = -22q - 27q. Put q, -3, 2 in increasing order. -3, 2, q Suppose 0p + 22 = p. Suppose 37x + 216 = -52x + 661. Sort x, p, -2. -2, x, p Let b = -30 - -33. Let z = -0.41 + 0.51. Sort b, -0.3, 3/7, z. -0.3, z, 3/7, b Let o = -10.6 + 0.6. Let t = -1 - o. Let q = t + -8.5. Sort 4, 4/9, q. 4/9, q, 4 Let k be (-29)/35 + 2/5. Let s = -25.5 - -25.2. Put 0, s, k in increasing order. k, s, 0 Let m(k) = -28k + 227. Let w be m(8). Sort -23, w, -3 in decreasing order. w, -3, -23 Let f = 441 + -351. Put -0.5, 0.4, f in descending order. f, 0.4, -0.5 Suppose t - 12 = 5t. Let v = -78.954 + -0.046. Let h = 78 + v. Sort h, t, -0.2. t, h, -0.2 Let b be (-17)/(-68)(-6)/15. Let h = -2.5 - -3. Put h, 1/4, -0.2, b in increasing order. -0.2, b, 1/4, h Let k = 1 + -2. Let t be -1 - (k/(-1) - -1). Let g(j) = 11j + 421. Let h be g(-38). Sort 10, h, t in ascending order. t, h, 10 Let l = 2388 + -2467. Put -5, 9, l in increasing order. l, -5, 9 Let u = -494 + 519. Sort -1, -5, 4, u in decreasing order. u, 4, -1, -5 Suppose 5 = 2r - 5. Suppose 0m - 3m = rs + 24, 3s = -9. Sort -0.2, m, 0. m, -0.2, 0 Let u be 477/6 - (-3)/(-2). Let p be (-16)/56 - u/21. Put p, -3, -2 in increasing order. p, -3, -2 Suppose 0 = 30i - 33i - 6. Put 1, i, -6, 5 in decreasing order. 5, 1, i, -6 Let y(j) be the second derivative of -j3/3 + 35j*2/2 + 4j. Let i be y(18). Sort 4, i, -5 in ascending order. -5, i, 4 Let z be 46/4 - 1. Suppose -10 = 27a - 26a. Let w be -2(-2)/a5. Sort z, w, 4 in descending order. z, 4, w Let p(h) = h3 - 20h*2 + 22h - 58. Let n be p(19). Put -5/3, 0.2, n, 0.3 in descending order. 0.3, 0.2, n, -5/3 Let w be 3/(9/21) + -2. Suppose 4o - wm = -19, 2m = -3o + 6 - 3. Let h be 2/(-56) - 4/(-14). Put o, 0.4, h in descending order. 0.4, h, o Let g = -114 + 114.02. Sort -2, 3, g. -2, g, 3 Suppose 3 = -19m - 35. Put -35, 4, m in increasing order. -35, m, 4 Let h = 220 + -223. Sort 3, h, 5, 17 in descending order. 17, 5, 3, h Let n = 0.09 - -3.91. Let i = 37/71 - 401/497. Sort -3/5, 0.3, n, i in increasing order. -3/5, i, 0.3, n Suppose 2h + 4 = h + 5v, -5v - 7 = -2h. Sort -4, -1, 0, h in ascending order. -4, -1, 0, h Suppose -2w + 8 = k, -w - 2 + 6 = 3k. Let p be -2(-2 + (-130)/(-20)). Sort 0.1, k, p in decreasing order. 0.1, k, p Let w = 0.9 - 12.9. Let c = -0.19 - 13.81. Let k = w - c. Sort 4, k, -0.1 in ascending order. -0.1, k, 4 Let n(h) = 16h - 368. Let f be n(23). Suppose -2p + 0p - 2y = 4, -2y = 3p + 2. Suppose 3v + p = -4. Put v, f, -4 in descending order. f, v, -4 Let y be (242/605)/((4/6)/((-25)/3)). Let q = -5 - -9. Suppose qs + h - 5 = 0, h = 2*s - h. Sort -3, s,	{ "pile_set_name": "DM Mathematics" }
the third biggest value in -0.9, -5, 16? -5 What is the second biggest value in 3, 5, 0.9? 3 What is the second smallest value in -102, 1/4, -4? -4 Which is the second smallest value? (a) 0.1 (b) -31 (c) -10 c What is the third biggest value in 2/29, -0.04, 1, -49? -0.04 What is the fourth smallest value in -0.02, -4, 2/5, -1, -1/4? -0.02 Which is the fourth biggest value? (a) 172 (b) -3 (c) 0 (d) -0.5 b What is the fifth biggest value in -3, 0.2, 54, 5, 1? -3 What is the smallest value in -6, 5, 30? -6 What is the biggest value in -27, 0.12, -4? 0.12 Which is the third smallest value? (a) -0.1 (b) 3.7 (c) -2 (d) -0.4 a Which is the smallest value? (a) 2/3 (b) -1/11 (c) 0.09 b Which is the third biggest value? (a) 0.5 (b) -3 (c) 0.076 (d) 0.3 c What is the biggest value in -0.5, 187, -3, -33, 3/7? 187 Which is the third smallest value? (a) 4 (b) -0.3 (c) -4 (d) -1/11 (e) 22 d What is the third biggest value in -4, 0.07, -8? -8 What is the second smallest value in -15, 7, -0.2? -0.2 What is the third smallest value in 29, 4, -0.4? 29 What is the third smallest value in -43, 0.2, -0.05, 3? 0.2 Which is the third biggest value? (a) -0.3 (b) -289 (c) 0.4 b What is the biggest value in -9, 0.2, 1/3, 2/7? 1/3 Which is the third smallest value? (a) 2/7 (b) 3 (c) -16/27 (d) 0 a What is the second smallest value in 12, 5, 1? 5 Which is the fourth biggest value? (a) -1 (b) -2/3 (c) 1 (d) -5/4 d What is the second smallest value in 1.9, 5, 21? 5 What is the third smallest value in -0.1, -2, -55? -0.1 Which is the third smallest value? (a) 2/5 (b) 1/2 (c) -1/3 (d) -1/2 a What is the second smallest value in -1, 23, -1/6, 3? -1/6 Which is the second biggest value? (a) -2/17 (b) -3 (c) 15 a Which is the biggest value? (a) -5 (b) 1.4 (c) -9 b What is the fourth biggest value in -31, 1, 6, -3? -31 Which is the smallest value? (a) -0.1 (b) 1 (c) -9/2 c What is the third smallest value in -0.3, 0.1, 3, -14.03, -1/3? -0.3 What is the fourth smallest value in -4, -5, 1/8, -2/3? 1/8 Which is the second smallest value? (a) 0.13 (b) -1/4 (c) 5 (d) -5 b Which is the second biggest value? (a) 2 (b) 4/3 (c) -126 (d) 3 (e) 1/2 a Which is the second smallest value? (a) 4 (b) -5 (c) -4 (d) 0.14 (e) -1/3 c Which is the fifth biggest value? (a) -1/4 (b) -13 (c) 0.1 (d) 1 (e) -1/2 b Which is the biggest value? (a) 5 (b) 1 (c) 1.6 a What is the third smallest value in -3, -64, 38? 38 Which is the smallest value? (a) 0.08 (b) 5 (c) 18 (d) -5 d Which is the smallest value? (a) -201 (b) 5 (c) 0 (d) -4/3 (e) -2 a What is the second smallest value in 0.002, -2/3, 5? 0.002 What is the second smallest value in -2/15, 2/7, -36? -2/15 Which is the smallest value? (a) 3 (b) -3 (c) 0.01 (d) -1/4 b Which is the biggest value? (a) -3/5 (b) 0.2 (c) -0.5 (d) -2 b What is the biggest value in -0.97, 4, -4, -1/3? 4 What is the biggest value in 68, 3, 0.03, -5, 0.2? 68 What is the second smallest value in -1/3, -0.2007, -0.4? -1/3 What is the fourth smallest value in -0.3, 1, -4/13, -29? 1 Which is the second biggest value? (a) 4 (b) -4 (c) 108 (d) -0.4 a What is the third smallest value in 26/7, 0.04, -2/3, 2/7, -5? 0.04 Which is the fifth biggest value? (a) -0.2 (b) 2 (c) 0.5 (d) -1774 (e) 0.3 d Which is the second biggest value? (a) 0 (b) 12 (c) 2 (d) 6 (e) -2/23 d What is the third biggest value in -1, -0.4, 1/1804? -1 What is the third smallest value in 1, -7, -2, -0.4? -0.4 What is the third biggest value in 0.4, 0.1, -0.3, -102? -0.3 Which is the second smallest value? (a) -0.5 (b) -0.4 (c) 18 b Which is the third smallest value? (a) -1 (b) 3/8 (c) -0.4 (d) 10.32 b Which is the biggest value? (a) 0.5 (b) 1 (c) -1/6 b What is the second smallest value in -1, 1/3, 3, -2, 9? -1 Which is the second biggest value? (a) 4 (b) 16 (c) -1.2 (d) -2 a Which is the third smallest value? (a) 0.4 (b) 1/4 (c) -0.109 (d) -2.1 b Which is the second smallest value? (a) 3 (b) -0.1 (c) 0.04 c Which is the third smallest value? (a) -0.4 (b) -4/5 (c) -1.45 a What is the smallest value in -1/3, -97, 3/5, 2, -1? -97 What is the third smallest value in 5, -3/4, 3? 5 What is the biggest value in 5, -831, -4? 5 Which is the second biggest value? (a) 40 (b) -1 (c) 0.4 c What is the third biggest value in 23, -4, 20, -3, 1? 1 Which is the third biggest value? (a) 2/7 (b) 2/9 (c) 3/2 b What is the second biggest value in 3, 0.06, 2, 0, -3/7? 2 What is the fourth smallest value in -4, -7/71, -5, 0.4? 0.4 What is the biggest value in 1/4, -2, 6, -2/3? 6 Which is the fourth biggest value? (a) -4 (b) -0.1 (c) -0.03 (d) 1 a Which is the smallest value? (a) -4 (b) 34 (c) -13 c What is the second smallest value in -3, -1/3, 3/2, -1/4? -1/3 Which is the biggest value? (a) 0.4 (b) 0.3 (c) -0.008 (d) -7 a What is the second biggest value in 41.4, -0.1, 0.02? 0.02 Which is the fourth biggest value? (a) -3/5 (b) 0 (c) -0.18 (d) 1/6 a Which is the third biggest value? (a) 7 (b) 2 (c) 0 c What is the biggest value in 2, -2.39, 2/3, 0? 2 What is the fifth biggest value in 0.4, 4/3, 1/8, 5, -1? -1 What is the third biggest value in 3, -4673, -0.4? -4673 Which is the second biggest value? (a) -15/7 (b) 1/3 (c) -322 a What is the biggest value in -2/11, 1, 1/4, -1/23? 1 Which is the biggest value? (a) -11 (b) -0.7 (c) -3 (d) 0.2 d What is the third smallest value in 2, -4, -17? 2 Which is the second smallest value? (a) 13 (b) -5 (c) 1/7 c What is the biggest value in -30, -1, -9, -1/4? -1/4 What is the second biggest value in 7, -48/5, -3/5? -3/5 Which is the smallest value? (a) -2 (b) -1875/7 (c) 2/5 b What is the second biggest value in -2/23, -2, -0.1? -0.1 Which is the second smallest value? (a) -4 (b) 7 (c) -86 (d) 2 a What is the third biggest value in 0.2, -0.5, -0.003, -0.2? -0.2 What is the fourth smallest value in -1/3, 1/9, 0, 1/18? 1/9 What is the biggest value in -100, -9, 4, 3? 4 Which is the third smallest value? (a) 12 (b) -7 (c) -2/3 (d) -3 c What is the third biggest value in -0.5, -7, -1/11? -7 Which is the third smallest value? (a) -0.01 (b) -7 (c) 4/7 (d) 2/13 d Which is the third smallest value? (a) -52 (b) 2 (c) 1/2 (d) -1 c Which is the third biggest value? (a) 2/5 (b) -60 (c) 3 (d) 0.5 (e) 0 a Which is the third biggest value? (a) 5 (b) 12 (c) 0.5 (d) 3 d Which is the third smallest value? (a) -70 (b) 3 (c) -0.3 b What is the third smallest value in -5, -0.2, -2/5? -0.2 What is the fourth biggest value in 1/6, 0.2, 0, 1/11? 0 What is the third biggest value in -0.06, 20/17, -0.11? -0.11 What is the fourth smallest value in -1, -4, -8, -7? -1 Which is the biggest value? (a) -4 (b) 0 (c) 2 c Which is the third biggest value? (a) 1/7 (b) -2/181 (c) 1 b Which is the fifth biggest value? (a) 1.2 (b) -2/13 (c) 3/23 (d) -2 (e) 2/7 d Which is the smallest value? (a) -4 (b) -5 (c) -1 (d) -1/2 (e) 2 b Which is the biggest value? (a) 17 (b) -1 (c) 2/17 (d) -2/21 a What is the second smallest value in -59/5, -0.06, 2/3? -0.06 Which is the third biggest value? (a) 3 (b) -1/3 (c) 2 (d) 3.7 c Which is the second biggest value? (a) 5 (b) -2/7 (c) 3 (d) 15/8 (e) -5/7 c What is the second biggest value in -2, 1/3, 7? 1/3 Which is the second biggest value? (a) -31 (b) 0.4 (c) -0.3 (d) -4 (e) 0.15 e Which is the second biggest value? (a) 6 (b) -4 (c) 1 (d) -3 c Which is the third biggest value? (a) -256 (b) -5 (c) -1.1 a Which is the third smallest value? (a) 5/3 (b) 0.1 (c) 0.886 a Which is the third smallest value? (a) 1/4 (b) 7 (c) 1/10 b Which is the smallest value? (a) 0.5 (b) 2 (c) -3 (d) -1 (e) 43 c Which is the second smallest value? (a) 6 (b) -4 (c) -0.16 c What is the third biggest value in 1/2, 2, -0.06, 4.6? 1/2 What is the second smallest value in 2, 347, 0? 2 Which is the fourth smallest value? (a) 4 (b) -4 (c) -2/15 (d) -5 a Which is the third smallest value? (a) 0.4 (b) 2/11 (c) 0.064 a Which is the fourth biggest value? (a) 10 (b) 4 (c) 0.2 (d) -5 d What is the second biggest value in 4, 0.08, 0, -1/2? 0.08 What is the second smallest value in 79, -1, -2? -	{ "pile_set_name": "DM Mathematics" }
ue in 3/4, -3/2, c? -3/2 Let o = -13 + 14. Let t = 6682.4 - 6682. Which is the third smallest value? (a) -0.04 (b) t (c) -0.5 (d) o b Let v = -68 - -99. Let i = v + -31.4. Let s = -11/105 + -7/15. Which is the biggest value? (a) s (b) i (c) 0 c Let k(y) = -172y + 8610. Let g be k(50). Suppose -28 = -4u - 4o, 3u - 5o + 2 = -1. What is the second smallest value in g, 1/4, u? u Suppose -5o = 0, -22 - 27 = v + 2o. Let n be (3/(-21))/(14/v). What is the fourth smallest value in n, 10, -2, 5? 10 Let z = -34.4 + 34. Let l = 22 - 24. Let d be (-1 - -2)(-1)/l. Which is the biggest value? (a) z (b) d (c) -1 b Let k be (18/10)/((-207)/(-690)). Suppose 0 = f - 2h + 5, 3f + 4h = -9 - k. Which is the second biggest value? (a) -3 (b) f (c) 0.7 a Suppose -5n + 27 = -5k - 58, 4n - 81 = 5k. Let s be (-1)/(18/94) + (-350)/(-1575). Let w = -2.1 + -0.9. What is the smallest value in k, w, s? k Let k(u) = 22686u + 2. Let t be k(-1). Let s = t - -907439/40. Let l = -8/5 + s. Which is the third biggest value? (a) 3/5 (b) l (c) 5 b Let f be (0 - 1)(2 + -3). Let r = -0.1 + 0.1. Let k = -10166 + 10165.7. What is the smallest value in r, k, f? k Let t = -0.25 + -0.05. Let g = -3.4 - -3.587. Let w = -4.187 + g. What is the fourth biggest value in 3.5, 1, t, w? w Let l = -19.5 - -20.2. Which is the smallest value? (a) -15 (b) 1/2 (c) 2 (d) l a Let n be (20/(-6))/((-2)/3). Suppose -6s - 22 = ns. What is the third biggest value in -3/4, 30, s, -4? s Let g = 27/200 + -67/200. Which is the third smallest value? (a) -4 (b) 0 (c) -1 (d) -69 (e) g c Let x = -1.06648 + 0.06648. What is the fourth biggest value in 1/2, x, 0.07, 26? x Suppose -2o - 49 = 11. Suppose -20 = 432g - 427g. Let r be g/o - (-80)/(-225). What is the second smallest value in r, -2/5, 2? r Let a be 6/(-8) + (-10385)/(-13020). What is the fourth smallest value in 2/3, 1, 2/7, a? 1 Let q = 145/532 - -1/76. Let y(t) = -31 - 44 + 2t2 + 17t - 2t - 11 + 111. Let k be y(-4). What is the biggest value in -1, k, -0.07, q? q Let j be (1197/(-27))/19 + (-110)/(-6). What is the fourth biggest value in j, -8, 6, 1? -8 Let j be (1/3)/((-4)/6). Let v = -26783.26 + 26783.2. Let h = 2 - 3. Which is the third biggest value? (a) v (b) j (c) 2 (d) h b Let d = -13555/3 + 4519. What is the fourth biggest value in 5, 79, -1, 0.5, d? 0.5 Let a = -0.22 + 1.22. Let r = 0.6 - a. Let p = 118 + -119. What is the second smallest value in r, -1/4, p? r Suppose 5x + 0d - 3d = 119, 33 = x + 4d. Let w(l) = -802l + 10429. Let k be w(13). Let r = -488/7 - -70. What is the third biggest value in x, k, r? r Let k be 2/(-10) - 4/30. Suppose 0 = -l + 2j, 15 = 2l + 3l - 5j. Let u be 4 - (1 - l/(-8)). Which is the biggest value? (a) u (b) 2 (c) k a Let o(u) = u*2 + 2u - 1. Let l be o(1). Let r = -7170 - -7166. Which is the third biggest value? (a) 1/2 (b) r (c) 1.8 (d) l a Let n = -4.8 + -0.2. Let c = 1678 + -1675.286. Let r = 0.286 + c. What is the fourth biggest value in 12, 3/7, n, r? n Let g = -55.27 + 50.27. Which is the biggest value? (a) -1/9 (b) -0.1 (c) -0.5 (d) g (e) 5 e Let j be (-10)/8200/(-1125). Which is the fourth smallest value? (a) 0.077 (b) j (c) 7 (d) 5 c Let m = 3.99 - 3.53. Let r = m - 0.26. Which is the third smallest value? (a) r (b) 2 (c) 35 c Let v = -8.745 - -8.245. Which is the third biggest value? (a) 1/5 (b) -36/13 (c) v b Let g be (2 - 2204/(-80))(-6)/27. Let s = g - -32/5. What is the second biggest value in -2/5, 2, s, -0.1? -0.1 Let i = -73.2 + 76.884. Let h = 0.754 - i. Which is the second smallest value? (a) h (b) 5 (c) 0.1 c Let l = 225.1 - 262.32. Let n = l - 0.78. Let i = -32 - n. Which is the smallest value? (a) 0.3 (b) -2 (c) i b Let p = -5.126 + 0.126. Let j be -1 + -2 - 0 - 20/(-7). What is the fourth smallest value in p, -4, 0.1, j? 0.1 Let b be 75350/100 + 6/4. Let t = b - 750. What is the third biggest value in 2/11, 0.3, -2/19, t? 2/11 Let m = -2/65 - -77/390. Let n = -56 + 227/4. Let v be (-2123)/(-11011) + 22/(-143) + 2/14. Which is the third biggest value? (a) v (b) -2 (c) m (d) n c Let v = -32089/3 + 10696. What is the third biggest value in 2, v, 0.19, 3, 3/5? 3/5 Let t = 9 - -6. Let r = -213939 - -213938.5. Let x = -0.4 + 0.3. Which is the smallest value? (a) r (b) x (c) t a Suppose 442 = 5t + 127. Let d = -70 + t. What is the second smallest value in -1, 1, d, 5? -1 Let m = 362 - 606. Let z = m + 242. What is the smallest value in -6, 0.1, z? -6 Let o = 46973.9 + -46974. Which is the third biggest value? (a) 4 (b) -19 (c) 168 (d) o d Let u be (-2)/(-3) - 68/(-51). Let p = -82 + 80. Let x be p + (22/(-8) - -4). What is the biggest value in u, 5, x? 5 Let g(t) = -39t + 8 - 10 - 56t2 - 2t*3 + 28 - 14t. Let f be g(-27). What is the second smallest value in -1.22, -3, 5, f? -1.22 Let m be -3(1-1)/(-7). Let j be (-2670)/(-45) + -299 + 238. Which is the biggest value? (a) m (b) j (c) -31 a Let k = -14910 - -14909.1. Which is the third biggest value? (a) -8/3 (b) 0.2 (c) 1/6 (d) k d Let z = -249 + 174. Let t = 74.6 + z. Which is the third biggest value? (a) 3/23 (b) 4/3 (c) t c Let o = -8488 - -8472. What is the third biggest value in o, 7/5, 2/13, -5? -5 Let u(m) = -m*2 + 4m. Let j be u(3). Suppose 90 - 22 = 8i - 25i. Let t be i/2 + j + -4. Which is the smallest value? (a) t (b) -5 (c) -16 (d) 5 c Let g = 13792 + -13793. Which is the third smallest value? (a) -0.02 (b) g (c) -6 a Let n = 4.9719 + 0.0281. Let z = -2.8 - -2.4. What is the biggest value in n, z, -5? n Let t = -0.04 - -0.14. Let i = 46 + 178. Let c = i - 221. What is the second smallest value in c, 2/17, t, 5? 2/17 Let o = 2767 + -2770. Let i be -2(2 + (-18)/10). Let j = 5 - 10. Which is the smallest value? (a) o (b) 3 (c) i (d) j d Let x = -3/10 + 4/5. Let o = 0.92 + -0.82. Let n = 14.76 + -13.76. What is the third biggest value in o, n, x? o Let c = -0.9968 - 1.0032. What is the third smallest value in -0.1, c, 0.164? 0.164 Let u = 616 - 617. Let s be 2/(-4)(6 - 8 - -6). Which is the third smallest value? (a) u (b) 3 (c) s (d) -5 a Let l be (410/(-36))/((-50)/758). What is the fourth smallest value in l, 2/7, -3/5, 4? 4 Let f = -836/45 + 94/5. Let h = -228 - -186. Let p = h + 41.9. Which is the smallest value? (a) f (b) 0.5 (c) p c Let y be (3 + (-176)/57)54/(-45). Which is the second biggest value? (a) 0 (b) -0.03 (c) 3/2 (d) -27 (e) y e Let w = 27.8 + -30.8. Let k = -16.5 - -20.42. Let h = k + 0.08. Which is the smallest value? (a) -10 (b) h (c) w a Suppose -100 + 8200 = -15w. Let u be 5/(-7)(-9)/(w/48). What is the second biggest value in u, -0.16, -2? u Suppose -151y = 1076 + 1038. Which is the third biggest value? (a) 0 (b) -0.3 (c) 0.1 (d) y b Let w = 5 + -4.94. Let f = 0.1219 + 4.8781. Which is the third smallest value? (a) -3 (b) f (c) w (d) -5 c Let k = 258.1 + -256.5. Which is the second smallest value? (a) k (b) 2 (c) 4 b Let u = -9 + 6. Let l = 15 - 11. Let f = -275 - -271. What is the second biggest value in l, f, u? u Let w = -18.509 - -22.509. Which is the second biggest value? (a) 1/2 (b) -1 (c) w (d) 0 a Let o = 231.15149 + -0.15149. Which is the second biggest value? (a) o (b) -0.1 (c) 8 c Let l = -0.44 - -1.44. Let w be (-1)/2 - 96/540. Which is the second smallest value? (a) l (b) w (c) -1/5 (d) 0 c Let l = -0.18854 + 1.18854. Which is the fourth biggest value? (a) -3 (b) l (c) 25 (d) -0.1 (e) 3/2 d Suppose 11a - 359 = -348. Let z = 1.11 - -0.89. What is the fourth smallest value in a, 1/5, -3, z? z Let y = -2714 + 2712.2. What is the third smallest value in -39, 2/5, y? 2/5 Suppose 12t + 45 - 393 = 0. Suppose -23g = -tg + 18. Let m be 3/18(1 + 3). What is the smallest value in m, 0, g? 0 Let h = -36.26 + 36.3. Which is the smallest value? (a) -10 (b) -4 (c) h (d) 2/15 a Suppose 3f - 4 = -13. Let c be (50/175 - (-24)/(-35))-2. What is the third biggest value in f, c, -4, -1? f Let x = 18.841 - 18.741. Let s = -0.3 + -0.2. Let m = -2 + 7. What is the smallest value in -4, m, s, x? -4 Let h = -211.13 - -210.73. Let f(y) = y*2 - 2y - 3. Let k be f(3). Which is the smallest value? (a) h (b) 1/10 (c) 5 (d) k a Let	{ "pile_set_name": "DM Mathematics" }
-5 Which is the third biggest value? (a) 7/8 (b) -12/11 (c) -5 c What is the biggest value in -22/3, -0.22, 1.3? 1.3 What is the second biggest value in 0.08, 3, 2/11, 0.04? 2/11 Which is the fourth smallest value? (a) 1 (b) 5 (c) -0.024 (d) 5/3 b Which is the third biggest value? (a) -4 (b) -1 (c) 47 (d) 6/11 b Which is the second smallest value? (a) -4 (b) 1/9 (c) -2 (d) 0.4 c Which is the third smallest value? (a) -17/5 (b) -3 (c) -5 b Which is the second smallest value? (a) -2 (b) 1/12 (c) 0.1 (d) 2/7 b What is the second smallest value in 1, -3/2, 225, -21? -3/2 What is the third biggest value in 0.5, 101, -7? -7 What is the fourth biggest value in -4/3, -3, -245, 0.5? -245 What is the second smallest value in 0, 4/9, 4, -3, -3/2? -3/2 Which is the biggest value? (a) 0.2 (b) -4 (c) 1 (d) 1/43 c What is the fourth biggest value in -7, -5, 3, -0.1, 5? -5 What is the fourth smallest value in 2, -3, -0.12, -2/5? 2 Which is the third smallest value? (a) 0.2 (b) -7 (c) 9 c Which is the biggest value? (a) 1/2 (b) 9 (c) 0.1 b Which is the second smallest value? (a) -0.1 (b) -3/5 (c) -5 (d) -1/3 (e) -3 e What is the third biggest value in 1/3, -2/11, -2/19, 0.4? -2/19 What is the third biggest value in -0.5, -27, -5? -27 What is the third smallest value in 2/9, -0.1, -2, -1/3, 1/480? -0.1 Which is the second smallest value? (a) 12 (b) -3/7 (c) 1/33 c Which is the second smallest value? (a) 0.1 (b) -0.5 (c) -0.4 (d) 1/4 c Which is the second smallest value? (a) 1 (b) 1/4 (c) 6 (d) -6 b What is the third smallest value in -2, -2/5, -657/4? -2/5 Which is the second smallest value? (a) -2/11 (b) -8 (c) -4 c Which is the fourth biggest value? (a) 4 (b) -0.4 (c) -14/23 (d) -2/11 c Which is the third biggest value? (a) 1 (b) 2 (c) 1/2 c Which is the fourth biggest value? (a) -7 (b) 586 (c) 0.3 (d) -2/3 a Which is the smallest value? (a) -245 (b) -1/2 (c) -18/7 a What is the second biggest value in -50/9, 2, -1/24? -1/24 What is the third smallest value in 4, 0.2, -2/23, -2/11, 0.5? 0.2 Which is the biggest value? (a) 71 (b) 4 (c) 2 a What is the third smallest value in 51, 0, -0.3, -0.2? 0 Which is the fourth biggest value? (a) -1/6 (b) 1/9 (c) 4 (d) -5/4 d Which is the second biggest value? (a) -1 (b) -0.4 (c) 0.29 (d) -11 b Which is the second biggest value? (a) 1/17 (b) -1/10 (c) -5 b Which is the smallest value? (a) 5/2 (b) 43 (c) 0.5 (d) -1/5 d Which is the smallest value? (a) 1/13 (b) -5 (c) -0.12 (d) -1/12 (e) -0.2 b Which is the second biggest value? (a) -0.1 (b) -4.8 (c) 2 (d) 1/2 d What is the biggest value in -1/2, 0.551, -0.1, 5? 5 Which is the second biggest value? (a) -430 (b) 5 (c) -5 c What is the second biggest value in 4, 0.54, 14, 2? 4 What is the second smallest value in -4, -0.06, 1/2? -0.06 What is the biggest value in 5/8, 0.3, -5, -2? 5/8 What is the smallest value in -2/21, -1/22, 5, -0.5, 4? -0.5 What is the third smallest value in 0, 159, 13? 159 Which is the third smallest value? (a) -3 (b) 5 (c) 162 (d) -1/9 b What is the smallest value in -3, -81, -1/8, -0.2? -81 What is the third smallest value in 0.4, -117, -2/9? 0.4 Which is the fourth biggest value? (a) 158/3 (b) -5 (c) 2/5 (d) 1/3 b What is the third smallest value in 2/3, -3, 0.2, 2, 2/9? 2/9 What is the third biggest value in -1, -2/15, 0.36? -1 Which is the third biggest value? (a) -3/11 (b) 3 (c) -5 (d) 4 a Which is the fourth biggest value? (a) 0.3 (b) 2 (c) 0 (d) 0.1 (e) 0.15 d Which is the biggest value? (a) -5 (b) 1 (c) -0.4 (d) -9 b What is the second smallest value in 1, 5/2, 2/11, -0.1? 2/11 Which is the third smallest value? (a) 3 (b) 6 (c) 3/7 (d) -1/7 a Which is the second smallest value? (a) 2/9 (b) -3/2 (c) 99 a What is the second biggest value in 5, -200, 3? 3 Which is the second biggest value? (a) 4/33 (b) -0.4 (c) 3 a Which is the smallest value? (a) -3 (b) -4 (c) 2159 b What is the second smallest value in 4, -11, 31, -1? -1 Which is the fourth smallest value? (a) -2/2289 (b) 1/2 (c) 1 (d) 0.1 c Which is the second biggest value? (a) 48 (b) 3 (c) -7 (d) 5 d What is the biggest value in -0.4, -0.3, -0.2? -0.2 What is the second smallest value in 0.3, -5, 1, 4? 0.3 What is the second smallest value in -3, 0, -7, 0.02? -3 What is the fourth smallest value in -6.9, 5, 0, 1/2? 5 What is the fourth biggest value in 0.3, -8, 1/2, -2/11? -8 What is the second smallest value in 5, -37, 2, -4, 1.9? -4 Which is the second biggest value? (a) 16/9 (b) -1/7 (c) -0.5 (d) 3 a Which is the smallest value? (a) -0.4 (b) -5 (c) -1/7 b Which is the third smallest value? (a) -0.5 (b) -58 (c) -14 (d) -0.4 (e) -5 e What is the second smallest value in 0, 27, 4, -2? 0 What is the second biggest value in 1, -0.002, 0.4? 0.4 Which is the second biggest value? (a) -3 (b) 3 (c) 1/6 (d) 1 d What is the smallest value in -2, -1, -36? -36 What is the fourth smallest value in 0.4, -2/17, 5, -87? 5 Which is the third biggest value? (a) 1/9 (b) -0.03 (c) -35 (d) -1/6 d Which is the biggest value? (a) -2 (b) -3/5 (c) -56 b Which is the smallest value? (a) -0.2 (b) 13/6 (c) 0.4 (d) 1 a What is the second smallest value in -3/4, -3, -2, -2/5? -2 Which is the biggest value? (a) 2 (b) 5 (c) -4 (d) -1 (e) -2/9 b What is the biggest value in 1/2, -0.3, 0, -2/3? 1/2 What is the smallest value in 5, -0.4, 279? -0.4 What is the second smallest value in -1, -4, -47, -0.1? -4 Which is the third biggest value? (a) -1/3 (b) -20 (c) -2 b What is the second biggest value in -0.36, -1, 2, -0.5? -0.36 What is the third biggest value in 0.5, -2, -66, -3, 0.2? -2 What is the third smallest value in -0.16, -0.5, 1? 1 Which is the third smallest value? (a) -3 (b) -0.3 (c) -0.5 (d) -183 (e) 0 c Which is the fourth biggest value? (a) 0 (b) -1 (c) -2/9 (d) -0.6 b Which is the third smallest value? (a) -12 (b) -3 (c) 5 (d) 1 (e) -4 b What is the smallest value in -2, -2/7, -7, -3/7? -7 What is the smallest value in -0.61, -4/3, -1/3? -4/3 What is the biggest value in -3, 0.26, -5? 0.26 Which is the second smallest value? (a) 14 (b) -0.15 (c) 3/4 c What is the second smallest value in -0.1, 1/2, -4/5, -138? -4/5 Which is the third smallest value? (a) 0 (b) 4 (c) 496 (d) 1/7 b Which is the third smallest value? (a) 0.2 (b) 3/4 (c) -194 b What is the fourth smallest value in 6, 2/9, 1219, -3? 1219 Which is the third biggest value? (a) -5 (b) 0 (c) 2/9 (d) 1/10 b What is the second biggest value in -0.1, -0.2, -3, 4, 1? 1 What is the smallest value in 218, 2, 0.5? 0.5 Which is the third smallest value? (a) -3/14 (b) 4 (c) 3 b Which is the second smallest value? (a) -2 (b) 2 (c) 0.08 (d) -0.3 (e) -10 a What is the biggest value in -3, 43/5, -19? 43/5 Which is the second smallest value? (a) -1.8 (b) -1 (c) -0.201 b What is the smallest value in -0.4, -11, 0.2? -11 Which is the fifth smallest value? (a) -4 (b) -1 (c) -1.43 (d) -3/2 (e) -2/5 e What is the third smallest value in 4, 50, 5/2, -4/3, -2? 5/2 What is the fourth smallest value in 0.5, 2/7, 38, 3? 38 What is the second smallest value in -5, 4, 1/7, 3.7, 0? 0 Which is the smallest value? (a) 69 (b) -0.3 (c) 7 (d) 0.5 b Which is the second biggest value? (a) -1 (b) -0.1 (c) -28 (d) 2/9 b Which is the second smallest value? (a) -0.5 (b) 5/2 (c) 322.1 b What is the second biggest value in -33, -2, -2/11, 0.4, 2/9? 2/9 What is the second biggest value in 34/15, 4, -9? 34/15 Which is the third biggest value? (a) -2/13 (b) 2/175 (c) 1/7 a Which is the fourth smallest value? (a) 18 (b) 8 (c) -1 (d) -1/2 (e) 1 b Which is the second smallest value? (a) -5/3 (b) 1/9 (c) -0.2 (d) -4/5 d What is the smallest value in 1/4, -4, 0.4, -2? -4 What is the fourth biggest value in -5, -0.43, 3, 4/7? -5 Which is the second biggest value? (a) -2/9 (b) -1.1 (c) 1.9 a What is the third smallest value in 115, 0.01, 0? 115 Which is the third biggest value? (a) 0 (b) -1/112 (c) -1 (d) 2/11 (e) 1/10 a Which is the smallest value? (a) 0.4 (b) -2/5 (c) 1/7 (d) -4/7 (e) 3 d Which is the biggest value? (a) -2/5 (b) -4 (c) 0.14 c What	{ "pile_set_name": "DM Mathematics" }
hat is the remainder when 125 is divided by f? 29 Let h(w) = -1 + 23w - 2 - 8w - 1. What is the remainder when h(4) is divided by 15? 11 Suppose -2 = -s, 0 = -2g + 3s - 8s + 94. Suppose 3v - 3r = v - 16, 0 = 3v + 5r + 43. Let k = v + 26. Calculate the remainder when g is divided by k. 12 Suppose 4i = -i + 20. What is the remainder when 46 is divided by (12/i)/(-3) + 25? 22 Let o(p) = -4p3 - 2. Calculate the remainder when o(-2) is divided by 8. 6 Let k(q) = 11q + 6. What is the remainder when k(2) is divided by 6? 4 Let s be (5/10)/(1/(-4)). Let p be (-1)/s82. What is the remainder when 186/8 - (-6)/p is divided by 13? 11 Let u(q) = 4q2 + 8q + 4. What is the remainder when 29 is divided by u(-3)? 13 Let w = -18 - -20. Suppose 0 = -wd + 3d - 14. Suppose 4g + y - 105 = 0, -24 = -g + 2y - 0. What is the remainder when g is divided by d? 12 Let f(h) = h*2 + 2 - 4 + 12h - 2 + 3. Let m(d) = -d. Let p(b) = -f(b) - 6m(b). Calculate the remainder when p(-3) is divided by 4. 2 Let h be (19 + -4)(-2)/(-2). Suppose 5j - 2c - h = 15, 5j - 4c = 20. Calculate the remainder when j is divided by 5. 3 Let z = -121 - -186. Calculate the remainder when z is divided by 22. 21 Let q(g) = -g*3 + 12g*2 - 12g + 25. What is the remainder when 40 is divided by q(11)? 12 Let y(k) = -k + 3. Let p(z) = -z3 - z2 - 6z - 3. Let r be p(-4). Suppose -4u + r = -19. Calculate the remainder when u is divided by y(-9). 10 Let g = 75 - 122. Let j = -22 - g. What is the remainder when 49 is divided by j? 24 Let c = 25 - 13. Let t = c - 20. Let w = t - -48. What is the remainder when w is divided by 14? 12 Let w = 25 - 14. What is the remainder when w is divided by 3? 2 Suppose -c = 2v - 9, -3c + 3v - 20 = 2c. Calculate the remainder when 10 is divided by ((-28)/(-35))/(c/(-5)). 2 Let r = 6 - 3. Let t = r + -1. Suppose -s - 5c = -22, ts + 2s - 178 = -2c. Calculate the remainder when s is divided by 12. 11 Let p be (-5)/2(-2 - 0). Suppose -5j = -p, -2j - 2j - 41 = -5k. Calculate the remainder when k is divided by 5. 4 Let f be (6/(0 + -1))/1. Let a(q) = q3 + 6q*2 - 5q. Suppose 7i - 3i - 64 = 0. What is the remainder when a(f) is divided by i? 14 Calculate the remainder when -2 + (7 - 3) + 0 + 193 is divided by 50. 45 Suppose 8a - 60 - 172 = 0. Calculate the remainder when 113 is divided by a. 26 Let p be (-8)/(-4) + (-2 - -1). Let j(k) = 40k. Let g be j(p). Suppose -2o + g = 3o. What is the remainder when 15 is divided by o? 7 Let t(h) = 2h + 3. Let m be ((-6)/15)/((-2)/60). Suppose -b + 3b + 3k = m, 4k = -5b + 30. Calculate the remainder when t(4) is divided by b. 5 Let d(q) be the second derivative of q4/12 - q3/2 + q2/2 + 2q. What is the remainder when 20 is divided by d(5)? 9 Suppose 8s + 3 = 11s. What is the remainder when 4 is divided by s? 0 Let y = 0 + 15. What is the remainder when y is divided by 9? 6 Let d(h) = -h*3 - 11h*2 - 10h + 14. What is the remainder when d(-10) is divided by 8? 6 Suppose -v + 2 = -0v. What is the remainder when 2 is divided by v? 0 Suppose 304 = 5m - 6. What is the remainder when m is divided by 16? 14 Suppose -2b = -3b + 3. Suppose 0 = -bf - 2f + 45. Let r(u) = u - 5. Calculate the remainder when 11 is divided by r(f). 3 Suppose -12 = 7a - 5a. Let c = a + 20. Let u(v) = -v*3 - 7v*2 - 3v + 5. Calculate the remainder when u(-7) is divided by c. 12 Let u(s) = -s*2 + 4s + 2. Let k be u(4). Suppose 7z - kz - 5r = 130, 2z - 52 = -2r. What is the remainder when z is divided by 9? 8 Let i be 4/(0 + 2) + -3. What is the remainder when i - 2 - -2 - -28 is divided by (-3)/2112/(-12)? 13 Let s(n) = n*3 - 5n*2 - 23n + 5. What is the remainder when s(9) is divided by 21? 17 Suppose -16 - 9 = -c + 3z, 43 = 2c + z. Calculate the remainder when 36 is divided by c. 14 Suppose -50 = -4g + 6. What is the remainder when g is divided by 4? 2 Let h = -1 + 10. Let i = -55 - -1. Let g = i + 80. What is the remainder when g is divided by h? 8 Let g be ((-195)/(-6))/(2/4). Calculate the remainder when 1 is divided by (26/g)/(2/5). 0 Suppose 37o = 41o - 72. Calculate the remainder when o is divided by 2. 0 Let i(h) = -3h3 - h2 + 1. Suppose -2 = -3j - 4y, j = -j - 5y - 1. Let c be i(j). Calculate the remainder when (-708)/(-27) + 6/c is divided by 7. 5 Let r = -372 - -236. Let s = -83 - r. Let m = 59 - 41. Calculate the remainder when s is divided by m. 17 Suppose -3z + 9z = 252. Let j = z - 28. What is the remainder when j is divided by 5? 4 Suppose -3m + 0m - 2 = -2p, 2p + 2m - 12 = 0. Suppose -pv + 163 = -49. Calculate the remainder when v is divided by 14. 11 Let q(k) = -6k + 13. Let o(r) = -7r + 12. Let f(j) = 4o(j) - 5q(j). Calculate the remainder when f(12) is divided by 2. 1 Calculate the remainder when 51 is divided by (504/98)/(2/7). 15 Suppose -j - 3 + 6 = 0. Let l(v) = 7v - 2. Let g be l(3). Suppose -2w - 5q = -1, 6q = 5w + 2q - g. What is the remainder when j is divided by w? 0 Suppose -2h = 2x - 30, 0h + 4x = -3h + 42. Calculate the remainder when h is divided by 5. 3 Let z = 18 - 6. Suppose 0 = -h + 5h - 88. Calculate the remainder when h is divided by z. 10 Let x = -75 - -146. What is the remainder when 1 + (x + 1 - -4) is divided by 20? 17 Suppose 0 = -0k + k - 14. Suppose g - 38 = 3. Calculate the remainder when g is divided by (-1 + 0)/(-1)k. 13 Let z be 24-12/(-4). Suppose 64 = 4t + z. What is the remainder when 23 is divided by t? 10 Suppose -g + 13 = -2m, -9 = -3g + m + 35. What is the remainder when 27 is divided by g? 12 Let g = 85 - 53. Let t = 55 - g. Calculate the remainder when 44 is divided by t. 21 Suppose -8x + 4h + 29 = -3x, 2x - 4h = 14. What is the remainder when (46/(-8) - -1)-4 is divided by x? 4 Suppose 5d - 548 = i, i + 224 = 2d - i. What is the remainder when d is divided by 22? 21 Suppose 0 = -0m - m + 9. Suppose m = c - 0c. What is the remainder when c is divided by 6? 3 Calculate the remainder when (-382)/(-5) + 3/5 is divided by 13. 12 Let m = 10 - 14. Let d = m + 23. Suppose 2a = -3 + d. What is the remainder when 22 is divided by a? 6 Let a = 35 + -19. Calculate the remainder when 47 is divided by a. 15 Let s(g) = g2 + 2g. What is the remainder when (-1 + 6)/(11/33) is divided by s(-4)? 7 Suppose 23 = d - 2g, 3d - 3g = g + 77. What is the remainder when d is divided by 16? 15 Suppose -5v + 140 = 30. Suppose 3t - v = t. Calculate the remainder when 21 is divided by t. 10 Let c(b) = b2 - 8b - 15. Calculate the remainder when c(16) is divided by 29. 26 Suppose -5m + 19 = -21. Calculate the remainder when 30 is divided by m. 6 Let s(m) = 4 + 0 + 3 - m. Suppose 2q - 15 = -q. Calculate the remainder when q is divided by s(4). 2 Suppose -5j - 11 + 5 = -4s, 0 = -j + 3s - 10. Suppose 0 = -2f - 2g + 6, 0g - g - 3 = -jf. Let u = 4 - -1. What is the remainder when u is divided by f? 1 Suppose -r + 46 = r - 5v, 81 = 5r - 4v. What is the remainder when r is divided by 5? 3 Suppose 3i + 9 - 24 = 0. Suppose -9 - 53 = -ib - 4q, 2b + 5q = 35. What is the remainder when 39 is divided by b? 9 Let i be (24/15)/((-6)/(-15)). Suppose -in + 8n - 84 = 0. Calculate the remainder when n is divided by 6. 3 Suppose -4y + 7y = -9. Let p be (-46)/(-8) + y/(-12). Suppose -u + pu = 20. What is the remainder when 9 is divided by u? 1 Let k be 2/(-1 + -1 - -4). Let r(l) = l*3 - 10l*2 + 9l + 8. What is the remainder when ((-14)/3)/(k/(-3)) is divided by r(9)? 6 Suppose c + 52 = 4w, -2w - 2c + 36 = -0c. Suppose 9 = r - w. What is the remainder when r is divided by 12? 11 Let y be -34/(-18)12. Suppose 2h = 6 + y. Suppose -5t - d + 99 = -5d, -3d = 5t - 92. What is the remainder when t is divided by h? 5 What is the remainder when 93 is divided by (1/((-21)/28))/((-2)/72)? 45 Suppose -3w - 4a + 9a + 62 = 0, 0 = -4w + a + 60. What is the remainder when 40 is divided by w? 12 Let r(n) = n3 - 9n*2 + 9n - 12. Let x be r(8). Calculate the remainder when x(-2)/4 + 7 is divided by 5. 4 Suppose 0 = 5w + 4 - 14. Suppose wn = -10, -y - 5n = 4y + 5. Calculate the remainder when y is divided by (-3)/28/(-6). 0 Suppose n + n = -2. Let q = n - -7. What is the	{ "pile_set_name": "DM Mathematics" }
reatest common factor of 60 and 14460. 60 Calculate the highest common divisor of 11 and 22. 11 What is the greatest common divisor of 230 and 2645? 115 Calculate the greatest common factor of 1943 and 290. 29 What is the greatest common divisor of 190 and 1090? 10 What is the highest common divisor of 1379 and 7? 7 What is the greatest common divisor of 15614 and 74? 74 Calculate the greatest common factor of 70 and 100. 10 What is the highest common divisor of 1694 and 462? 154 Calculate the greatest common factor of 16868 and 4. 4 Calculate the highest common divisor of 96 and 5808. 48 Calculate the greatest common factor of 2869 and 76. 19 Calculate the greatest common factor of 480 and 96. 96 What is the highest common factor of 2448 and 153? 153 Calculate the greatest common divisor of 169 and 559. 13 Calculate the greatest common factor of 75 and 60. 15 What is the greatest common divisor of 36 and 27360? 36 Calculate the greatest common factor of 464 and 1885. 29 Calculate the greatest common divisor of 1305 and 1125. 45 Calculate the greatest common factor of 210 and 30. 30 What is the highest common factor of 60 and 100? 20 What is the highest common factor of 122 and 549? 61 What is the greatest common factor of 3040 and 8? 8 Calculate the greatest common divisor of 204 and 684. 12 What is the highest common divisor of 33 and 21978? 33 What is the highest common factor of 264 and 24? 24 Calculate the greatest common factor of 90 and 49230. 90 What is the highest common divisor of 25998 and 28? 14 Calculate the highest common divisor of 26 and 236. 2 What is the greatest common factor of 188 and 16? 4 Calculate the highest common factor of 6 and 6306. 6 Calculate the greatest common factor of 446 and 22969. 223 Calculate the greatest common factor of 119 and 136. 17 Calculate the highest common factor of 352 and 144. 16 What is the greatest common divisor of 297 and 360? 9 Calculate the highest common factor of 24 and 564. 12 What is the greatest common factor of 6114 and 6? 6 What is the highest common divisor of 16199 and 167? 167 What is the highest common factor of 12463 and 121? 121 Calculate the highest common divisor of 18 and 24. 6 Calculate the highest common divisor of 267 and 356. 89 What is the highest common divisor of 186 and 1023? 93 Calculate the greatest common divisor of 17949 and 31. 31 Calculate the highest common factor of 1975 and 237. 79 What is the greatest common divisor of 66 and 1342? 22 What is the greatest common factor of 13 and 182? 13 Calculate the highest common divisor of 45 and 35. 5 Calculate the greatest common divisor of 231 and 637. 7 Calculate the greatest common factor of 406 and 174. 58 What is the greatest common factor of 39 and 69? 3 What is the greatest common factor of 19 and 2? 1 Calculate the greatest common divisor of 36 and 10596. 12 Calculate the highest common factor of 242 and 2. 2 What is the greatest common divisor of 288 and 396? 36 Calculate the greatest common divisor of 682 and 44. 22 What is the highest common divisor of 104 and 468? 52 Calculate the highest common factor of 288 and 4752. 144 What is the greatest common divisor of 28 and 35? 7 Calculate the highest common factor of 53 and 11. 1 Calculate the greatest common divisor of 92328 and 24. 24 What is the greatest common divisor of 20 and 8? 4 What is the highest common divisor of 120 and 11520? 120 Calculate the greatest common factor of 361 and 3287. 19 Calculate the greatest common divisor of 1173 and 816. 51 Calculate the greatest common factor of 78 and 40638. 78 Calculate the highest common factor of 304 and 784. 16 Calculate the greatest common factor of 21 and 1113. 21 What is the highest common factor of 3 and 2859? 3 Calculate the highest common factor of 152 and 8. 8 Calculate the greatest common divisor of 1614 and 24. 6 Calculate the highest common factor of 105 and 84. 21 What is the highest common divisor of 209 and 1824? 19 Calculate the greatest common factor of 98 and 3402. 14 Calculate the highest common divisor of 2864 and 2. 2 Calculate the greatest common divisor of 265 and 53. 53 Calculate the highest common factor of 1380 and 1196. 92 Calculate the greatest common divisor of 354 and 12. 6 What is the greatest common factor of 2112 and 66? 66 Calculate the greatest common factor of 12 and 34. 2 Calculate the highest common divisor of 33 and 1353. 33 Calculate the greatest common divisor of 1024 and 64. 64 What is the greatest common factor of 51 and 51? 51 Calculate the highest common factor of 133 and 7. 7 Calculate the highest common factor of 320 and 1390. 10 What is the highest common factor of 35 and 70? 35 What is the highest common factor of 16 and 2672? 16 What is the greatest common divisor of 4800 and 50? 50 What is the greatest common divisor of 15 and 205? 5 What is the greatest common divisor of 146 and 16? 2 What is the greatest common divisor of 3481 and 531? 59 What is the greatest common factor of 994 and 213? 71 Calculate the highest common factor of 2394 and 504. 126 Calculate the greatest common divisor of 101 and 7979. 101 What is the greatest common divisor of 8 and 88? 8 What is the highest common factor of 1725 and 1875? 75 Calculate the highest common factor of 110 and 66. 22 Calculate the highest common factor of 50 and 120. 10 What is the highest common divisor of 13 and 4511? 13 What is the highest common factor of 1530 and 54? 18 What is the greatest common factor of 7267 and 338? 169 Calculate the greatest common factor of 14 and 875. 7 Calculate the highest common divisor of 87 and 58. 29 Calculate the greatest common divisor of 1701 and 231. 21 Calculate the highest common factor of 16 and 6. 2 Calculate the greatest common divisor of 264 and 21736. 88 What is the highest common divisor of 273 and 728? 91 Calculate the highest common divisor of 80 and 24. 8 Calculate the highest common factor of 14 and 77. 7 What is the greatest common factor of 14579 and 366? 61 Calculate the highest common factor of 104 and 78. 26 Calculate the highest common divisor of 12717 and 157. 157 What is the highest common factor of 11550 and 14? 14 Calculate the greatest common factor of 187 and 11. 11 What is the greatest common divisor of 119 and 34? 17 What is the greatest common divisor of 14 and 2? 2 What is the highest common divisor of 40 and 2? 2 What is the greatest common divisor of 2728 and 792? 88 Calculate the greatest common divisor of 15580 and 76. 76 Calculate the highest common factor of 26 and 169. 13 Calculate the greatest common divisor of 4 and 178. 2 Calculate the highest common divisor of 16 and 103. 1 What is the greatest common divisor of 6 and 96? 6 Calculate the greatest common divisor of 34 and 4114. 34 Calculate the highest common divisor of 2343 and 639. 213 What is the greatest common factor of 476 and 204? 68 What is the greatest common divisor of 135 and 25? 5 Calculate the greatest common divisor of 70 and 574. 14 What is the highest common divisor of 34 and 697? 17 Calculate the greatest common divisor of 159 and 3. 3 What is the greatest common factor of 296 and 48? 8 Calculate the greatest common factor of 19 and 3173. 19 Calculate the greatest common factor of 98 and 70. 14 What is the highest common divisor of 17 and 111214? 17 Calculate the highest common divisor of 6500 and 50. 50 Calculate the highest common divisor of 1394 and 323. 17 What is the greatest common divisor of 54 and 2295? 27 What is the highest common divisor of 1638 and 126? 126 Calculate the highest common divisor of 63 and 70. 7 What is the greatest common factor of 156 and 132? 12 What is the highest common factor of 374 and 44? 22 What is the greatest common divisor of 56 and 5236? 28 Calculate the greatest common divisor of 1430 and 156. 26 What is the greatest common factor of 132 and 4380? 12 What is the highest common factor of 195 and 2015? 65 Calculate the greatest common factor of 123 and 30. 3 What is the highest common factor of 3729 and 363? 33 What is the greatest common divisor of 28514 and 106? 106 Calculate the greatest common divisor of 153 and 289. 17 Calculate the highest common divisor of 1652 and 1298. 118 Calculate the greatest common divisor of 12	{ "pile_set_name": "DM Mathematics" }
ing v is positive. v(-299/60) Simplify ((l(-1/2)/l)/((ll(-3/4))/l))(-34) assuming l is positive. l(51/2) Simplify (w(-1))(-43)w/(w/w*(-4/7))w/(ww/(w/w6)w) assuming w is positive. w(248/7) Simplify (k/((k/k(-2/9))/k)((k((k*(3/5)k)/k)/kk)/k)/k)/(k(-2/7)kk)21 assuming k is positive. k(-1603/45) Simplify (a(-1/3))(-1/45)/(a(-1/5)a(-3)/a) assuming a is positive. a(568/135) Simplify q*(2/3)(q/(q*(-2)/q))/qq/(q/(qqqq(-3/7)q)q)q*(-7)qq assuming q is positive. q(26/21) Simplify (i/i(1/3))29/((i/(ii*0)i)/i)0 assuming i is positive. i(58/3) Simplify y/(y/(yy/(y((y/(y/y*(2/7)))/yy)/y)))yyy4yyy(yy*1y)(-3/7) assuming y is positive. y(66/7) Simplify z/z*6z*(-3/5)zzz*4z/z(-2/5) assuming z is positive. z(9/5) Simplify p*3p(1/5)/p assuming p is positive. p(11/5) Simplify (g*(-6/5)g)/ggg*9g((g/(g(-1/5)g))/g)/g(-3) assuming g is positive. g12 Simplify (xxx(-2/3))(3/20)((xx*6/xx)/x)/(xx/(xx(-2/5))) assuming x is positive. x(24/5) Simplify qq/(qq*(-42))qqqq/((q43/q)/q)q assuming q is positive. q7 Simplify (y/(y/y(-2/11)))*(-19)(y(-1/4))(-12/5) assuming y is positive. y*(223/55) Simplify (i/(ii*(-4/7))i/i(9/5))(-17/2) assuming i is positive. i(68/35) Simplify (z(-2/53)z)/((((z/((z(-1/37)z)/zz))/z)/z)/z) assuming z is positive. z(7717/1961) Simplify r(2/11)r*(-8)r assuming r is positive. r(-75/11) Simplify ((q(-10)q)/(q(6/13)/q))43 assuming q is positive. q(-4730/13) Simplify (j1j)(4/23) assuming j is positive. j(8/23) Simplify ((qq1q)/(qq/q(-6)q))(-1/12) assuming q is positive. sqrt(q) Simplify z(1/38)/z11 assuming z is positive. z(-417/38) Simplify b(1/36)/(b(2/5)b) assuming b is positive. b(-247/180) Simplify ((k/(kk*(-1)k)k)11)(4/39) assuming k is positive. k(44/39) Simplify g(3/10)g(-1/2)/g assuming g is positive. g(-6/5) Simplify (f8)(-6/19) assuming f is positive. f(-48/19) Simplify (v2)*(-15)(v*(-2)v)/vv/((v/(vv*8))/v)v assuming v is positive. v*(-21) Simplify ((jj*(-2)jj)/(j((j/(j(-1/4)/j))/j)/j))/(j(-4/5)/(j(j(5/2)j)/j)) assuming j is positive. j(81/20) Simplify w(1/5)w(-4)w*(-4)w4 assuming w is positive. w(-19/5) Simplify (((s/s*(-1/2))/s)/sss)(2/21) assuming s is positive. s(1/7) Simplify ((d0)(-46))(-50) assuming d is positive. 1 Simplify (g(2/3)/(gg6))(-26) assuming g is positive. g(494/3) Simplify j(5/2)/(jj(-2/9)/j) assuming j is positive. j(49/18) Simplify (((s2/s)/s)(2/63))(-27) assuming s is positive. 1 Simplify a(-1/4)/(aa*(2/5)/a)a/(a/a*(-1/2))aa/a(-2/13) assuming a is positive. a(261/260) Simplify (s7ssss0sss)/(sss/s*(-2/3)ss/(s(-2/15)s)s) assuming s is positive. s(36/5) Simplify j(-4/9)/(jj/j*(-5))(j/j*(-2)j)(-35) assuming j is positive. j(-1327/9) Simplify (z(-10))(-11/3) assuming z is positive. z*(110/3) Simplify (r(rrr/(r/r(-3/7)))/r)(-4/29) assuming r is positive. r*(-44/203) Simplify s(s*(-33)/s)/ss/(sss(6/25)) assuming s is positive. s(-881/25) Simplify o*(1/17)/oo/o*(16/5)oo assuming o is positive. o(-97/85) Simplify ((tttt*17t)/t)/t5 assuming t is positive. t15 Simplify (i5/(i(-1/3)/i))(-37/5) assuming i is positive. i(-703/15) Simplify i6/i(13/2) assuming i is positive. 1/sqrt(i) Simplify j*(-23)/jj4 assuming j is positive. j(-20) Simplify (f/f*(4/7))/(ff(-14)) assuming f is positive. f(94/7) Simplify u*(-21)u/((uu/(uu(-5/12)))/u) assuming u is positive. u(-245/12) Simplify ((o(-1/2))(-27))8 assuming o is positive. o108 Simplify (n/(n/n*(-3/28)n))/(n/(nn32n)) assuming n is positive. n*(893/28) Simplify p/((pp/p*(-4/13)p)/p)p(-6) assuming p is positive. p(-95/13) Simplify j(-1/3)j(-15) assuming j is positive. j(-46/3) Simplify (gg(2/3))/(g/g3) assuming g is positive. g(11/3) Simplify (k/(((k/(k(2/5)k))/k)/k))/(k/k4) assuming k is positive. k(32/5) Simplify (c/(c((cc/((c((c/(c/(cc*(-12))))/ccc)/cc)/cc))/c)/cc)c)(-2/11) assuming c is positive. c(18/11) Simplify (p/(pp/p*(-2/7)p))/(p*(1/14)p) assuming p is positive. p*(-47/14) Simplify (((mm(-1/2))/m)(17/4))44 assuming m is positive. m(-187/2) Simplify x(x/(xx*(-14/5)))/x(x/(x*31x)xx)/x assuming x is positive. x(-136/5) Simplify t1/(t/t*(1/8))(t*2t)(-18) assuming t is positive. t(-431/8) Simplify f(1/4)/(f(-1/7)fff)(fff*(6/7))/(f/(ff(4/7))) assuming f is positive. f(23/28) Simplify (mmm(-6/7))(-14) assuming m is positive. m(-16) Simplify (g5)(-28) assuming g is positive. g(-140) Simplify ((g/g*2)/gg)(4/7)/(g2)(-6/7) assuming g is positive. g(8/7) Simplify (a30)(-13/5) assuming a is positive. a*(-78) Simplify (g/(gg(-6/5)))/g(-16/7) assuming g is positive. g*(122/35) Simplify (tt*8t(3/2))/(t/t(-1/6)ttttt(-3)/t) assuming t is positive. t(28/3) Simplify ((j(-4/5)jj)/((((jj*8)/j)/j)/jj))9 assuming j is positive. j(-261/5) Simplify w*(1/3)ww(2/11)w*(-1/2)ww(-3) assuming w is positive. w(-65/66) Simplify (k(1/5)/(k/k(-8)k))/(((k/(kkkk/k(-1/3)k))/k)/kkk/(k/k(-1))) assuming k is positive. k(-52/15) Simplify (c(-1))7/(c*0c/(cc1)cc) assuming c is positive. c(-8) Simplify (h/(hhh0h))(15/2)/(h(-1/2)h(h*(1/4)/hh)/hh) assuming h is positive. h(-63/4) Simplify (nn*0/nn)(1/3)/(n6/n(-2)) assuming n is positive. n(-23/3) Simplify k12/k(4/3) assuming k is positive. k(32/3) Simplify (n(-20)n)/(nnn(-2/99)n) assuming n is positive. n*(-2176/99) Simplify (j/((jjjj(2/5))/j))(-26/3)((j/(j((j/j*(-2))/j)/j)j)/j)(1/19) assuming j is positive. j(3443/285) Simplify (gg/(g/g0)gg)6/(g(-6)/(g/g7)) assuming g is positive. g18 Simplify (q(-2)q*2q)7 assuming q is positive. q7 Simplify a*3aa/a3a/a*(-1/5)a/(a/(aa6aa)) assuming a is positive. a(61/5) Simplify (z(z/z*(-1)z)/z)(2/57) assuming z is positive. z(2/19) Simplify ((t(1/3))(-10))(-30) assuming t is positive. t100 Simplify (p/p*(-2/9)p)(-6/11) assuming p is positive. p(-40/33) Simplify (q*(-27)q)/(q/(qq(-7/5)/q)) assuming q is positive. q(-142/5) Simplify ((ll(2/3))40)(-10/9) assuming l is positive. l(-2000/27) Simplify k*18/((((kk/k*(-3/2))/k)/k)/kk) assuming k is positive. k(33/2) Simplify ((y(2/7))(-30))50 assuming y is positive. y(-3000/7) Simplify (a(-2/3)/aa(-7))(17/5) assuming a is positive. a(-442/15) Simplify (q(-1)/(q/(qq*(-2/13))q))/(q(-2/7)/q)(-4/19) assuming q is positive. q(-4192/1729) Simplify (x/x(-3/7)xxxx/((xx/x(-5)x)/x))3 assuming x is positive. x(-33/7) Simplify ((ii/i4)/i(-3/7))(2/35) assuming i is positive. i(-22/245) Simplify m(1/10)(m*(-4)mm)/m assuming m is positive. m(-29/10) Simplify (((uu*(-8))/u)/uuuu(u/(u/(uuu(u/u*(-6/5)u)/uu)))/u)/(u(-2/13)uu6) assuming u is positive. u(-497/65) Simplify (r(1/5)/(rrr(2/21)))/((r0rr)/(rr*8r)) assuming r is positive. r*(641/105) Simplify qq/(qq(-7/6)/q)(q/(qq/((qq*(-2/45))/q)))/qq assuming q is positive. q*(191/90) Simplify (zzz25)4 assuming z is positive. z108 Simplify ((bb/b*(3/4)b)/(b*1bbbb))4 assuming b is positive. b(-11) Simplify (n(-6)/nn/(n/(n/(n*(-2/11)nn)))n)(-13) assuming n is positive. n(975/11) Simplify (((vv/(v/v1v)vv)/v)1)(11/9) assuming v is positive. v(22/9) Simplify (n(-2/79))(4/3) assuming n is positive. n(-8/237) Simplify z/z*8zz/z(9/5) assuming z is positive. z(-34/5) Simplify (ii*(1/2)iii(-8/3))26 assuming i is positive. i(65/3) Simplify u(-4)uuu(-3/2)u*(3/2)uuu*(-4)u assuming u is positive. u(-3) Simplify o(-5/2)/((o(o/(((o(4/7)oo)/o)/o))/o)/o) assuming o is positive. o(-27/14) Simplify (r(-8)/r(4/11))(-3/5) assuming r is positive. r(276/55) Simplify y/y(-1/5)y/y*5(y1)26 assuming y is positive.	{ "pile_set_name": "DM Mathematics" }
1431340 divided by 38286268. 5 Divide -5798852268 by -2. 2899426134 Calculate -495 divided by 6911. -495/6911 -205370 divided by 1143 -205370/1143 Divide 7436858 by 23. 7436858/23 What is -2 divided by 269955824? -1/134977912 What is 114658 divided by -327? -114658/327 304 divided by -272275 -304/272275 -1 divided by 3131352 -1/3131352 Calculate -62889297 divided by -35591. 1767 Calculate 80435072 divided by -8. -10054384 Divide -981727 by 3. -981727/3 Divide -1539 by 17298. -171/1922 Divide 36665600 by 85. 431360 Calculate 32395183 divided by 5. 32395183/5 -12454420 divided by 566110 -22 What is 89897940 divided by 4? 22474485 What is -18419408 divided by 107? -172144 Divide -264927 by 477. -88309/159 Calculate -68557035 divided by 22852345. -3 What is 2414734 divided by -5? -2414734/5 What is -787 divided by -34362? 787/34362 Divide 14777 by -330. -14777/330 What is 71466318 divided by -18? -3970351 What is -1523245 divided by 22735? -67 What is 271940633 divided by 4? 271940633/4 Calculate 208047160 divided by 52011790. 4 Divide -186266424 by -46566606. 4 19796373 divided by 733199 27 17800794 divided by 1618254 11 -496 divided by 1401454 -248/700727 8251411 divided by 9 8251411/9 Calculate 24664264 divided by -284. -86846 7242 divided by -359 -7242/359 Divide 129347376 by -6. -21557896 Calculate 121166910 divided by 93. 1302870 Calculate 496811918 divided by 5. 496811918/5 41742 divided by -119 -41742/119 Calculate -3 divided by -8392194. 1/2797398 Divide -23 by -170371. 23/170371 What is 78200 divided by -575? -136 Divide -4774290 by 430. -11103 Divide -4473585 by -801. 5585 What is -638906 divided by -129? 638906/129 16716 divided by 365 16716/365 -536 divided by 59 -536/59 Calculate 109 divided by 4029191. 109/4029191 473975 divided by -444 -473975/444 What is -8135603 divided by 11? -8135603/11 -76 divided by 125004 -19/31251 18592345 divided by -28915 -643 Divide 20772000 by -23080. -900 Calculate -7785 divided by -47925. 173/1065 What is 2406340 divided by 4? 601585 Divide 1362 by 184009. 1362/184009 Calculate -6915790 divided by -3457895. 2 Divide -34136648 by -3. 34136648/3 What is 98942 divided by -20? -49471/10 What is 0 divided by -95285799? 0 Calculate 13180724 divided by 2. 6590362 Calculate 1297 divided by -16195. -1297/16195 What is 225797172 divided by 212? 1065081 What is 0 divided by 3180066? 0 6998 divided by 12014 3499/6007 Calculate 625 divided by -21901. -625/21901 Divide 284139636 by 5052. 56243 -23923097 divided by -187 127931 What is -743 divided by 95819? -743/95819 Calculate -713601 divided by -3. 237867 Divide -57881685 by 29607. -1955 Calculate -9756000 divided by 3600. -2710 Calculate -147942912 divided by 309504. -478 Calculate 169502 divided by 7. 169502/7 What is -133615 divided by 4211? -133615/4211 What is -69890117 divided by -41? 1704637 What is -673485608 divided by -233768? 2881 Calculate -1141 divided by -6903. 1141/6903 What is 20458 divided by 338? 10229/169 Calculate 1196496 divided by 4. 299124 Divide 61 by -1508582. -61/1508582 Calculate 53726280 divided by 8340. 6442 Divide 8507950 by 48. 4253975/24 8575338 divided by 2858446 3 Calculate 3 divided by -14301275. -3/14301275 Divide 44966220 by 230596. 195 561407970 divided by -1421286 -395 Divide -23335186 by -98047. 238 Calculate -2 divided by -11305955. 2/11305955 Divide -11889856 by 2972464. -4 Calculate -43 divided by -192703. 43/192703 Calculate -7324 divided by -652. 1831/163 20 divided by 1332944 5/333236 Divide 338816280 by 159. 2130920 What is -3 divided by -13108924? 3/13108924 Calculate -303090 divided by 34. -151545/17 Divide -19512603 by 5. -19512603/5 2499 divided by -83138 -2499/83138 -980015788 divided by 4 -245003947 What is -188991114 divided by 974181? -194 Divide 1320662 by -25. -1320662/25 -304608 divided by -214 152304/107 Calculate 7499925 divided by 3. 2499975 -64072119 divided by 4 -64072119/4 What is 91843332 divided by 195828? 469 What is -520050042 divided by -6? 86675007 Divide -230302 by 14. -115151/7 Calculate -814897235 divided by -5. 162979447 What is 488010571 divided by 181? 2696191 -23 divided by 785303 -23/785303 What is -1 divided by -31190562? 1/31190562 What is 38114472 divided by 4? 9528618 What is -16415495 divided by -955? 17189 Calculate 50 divided by 372517. 50/372517 Divide -203443471 by 8449. -24079 13396980 divided by -13396980 -1 Calculate 66728203 divided by -66728203. -1 -21200613 divided by 3 -7066871 3 divided by 11074576 3/11074576 What is 18626596 divided by 4656649? 4 -1380875 divided by 46 -1380875/46 152259360 divided by 2537656 60 15558 divided by -2518 -7779/1259 77199359 divided by 708251 109 Divide 509 by -101694. -509/101694 Calculate 3 divided by 285431324. 3/285431324 What is -6860 divided by 405? -1372/81 221444758 divided by 110722379 2 Divide -665300649 by 5. -665300649/5 What is -164652678 divided by -9? 18294742 Divide -25382640 by 6345660. -4 Calculate 5 divided by 191290. 1/38258 464553472 divided by 128 3629324 Divide 14 by -1675404. -7/837702 What is 0 divided by -87700200? 0 Calculate -59951652 divided by 19983884. -3 -378496 divided by -32 11828 What is -95 divided by 80180? -1/844 What is 468268400 divided by 68? 6886300 -46466208 divided by 1 -46466208 Divide 15329853 by -15329853. -1 Divide -4 by -167012639. 4/167012639 201935730 divided by 7706 26205 Divide -753468429 by -90681. 8309 What is -1242000 divided by 368? -3375 What is 38908272 divided by -2711? -14352 Calculate 752416288 divided by -104. -7234772 Divide -3260847 by 10. -3260847/10 What is -39354 divided by 550? -19677/275 What is 813568360 divided by 162713672? 5 638704 divided by 16 39919 What is 1 divided by -13945581? -1/13945581 Calculate 23154576 divided by 6. 3859096 What is -41271140 divided by -41271140? 1 Divide -148220200 by -29644040. 5 -574 divided by -31744 287/15872 What is 151032 divided by -75516? -2 What is 43225380 divided by 1200705? 36 What is 338068 divided by -15? -338068/15 What is -81372569 divided by -3371? 24139 140994 divided by -1372 -10071/98 What is 10165820 divided by -1? -10165820 Calculate 153687955 divided by -23. -6682085 What is -51628671 divided by 24273? -2127 Calculate -7592457 divided by 3. -2530819 What is 163 divided by 8768? 163/8768 Calculate -5 divided by -20699691. 5/20699691 Calculate 547745644 divided by -46. -11907514 140 divided by 15754 70/7877 What is -91942585 divided by -2626931? 35 -10 divided by 12675614 -5/6337807 Divide 21 by -158918. -21/158918 What is 619749 divided by -68861? -9 What is -4377 divided by -22925? 4377/22925 Calculate 21 divided by -946280. -21/946280 Divide 115956682 by -1. -115956682 Calculate 6 divided by 65290971. 2/21763657 What is 11 divided by -8146822? -11/8146822 Calculate 15390 divided by 10703. 15390/10703 -130019584 divided by -9 130019584/9 What is -407936718 divided by -135978906? 3 54092472 divided by 24 2253853 Calculate -1556388973 divided by 4. -1556388973/4 What is 0 divided by 4553364? 0 What is 80829561 divided by 237? 341053 What is 7795 divided by -285? -1559/57 Calculate 119436 divided by -8. -29859/2 What is -98631759 divided by -3? 32877253 Calculate -4 divided by -1203097. 4/1203097 Calculate 58107401 divided by 58107401. 1 5195741 divided by -13 -5195741/13 -269 divided by 64596 -269/64596 What is 3702567 divided by 1234189? 3 What is -103871565 divided by -4779? 21735 What is -106770417 divided by -3? 35590139 10279710 divided by -13986 -735 What is 87223 divided by 2583? 87223/2583 Calculate 78907770 divided by 549. 143730 What is -2548886 divided by 98? -1274443/49 Calculate -1 divided by -316794954. 1/316794954 Divide 1155942 by -149. -7758 Calculate 376 divided by -42815. -376/42815 Divide -1512841 by 18227. -83 -88320074 divided by -1 88320074 -10478470 divided by 28 -5239235/14 What is 16 divided by -73177? -16/73177 Calculate 44723000 divided by -31945. -1400 Calculate -54036 divided by 773. -54036/773 265888095 divided by 1595 166701 What is 27598962 divided by 3? 9199654 Divide -504072 by 29. -504072/29 What is -37960312 divided by -2? 18980156 -2881217 divided by -14 2881217/14 What is 13206577 divided by -13206577? -1 289 divided by 722905 289/722905 Calculate -257 divided by -24719. 257/	{ "pile_set_name": "DM Mathematics" }
0w - gw = -80. What is the tens digit of w? 1 Let r be (-10)/55 - (-4)/22. Suppose -5k + 8k - 54 = r. What is the tens digit of k? 1 Let b be 2094/78 + 4/26. Let l = -15 + b. What is the units digit of l? 2 Suppose -5w = -x - 9, 4x + w + 9 = -6. Let m = 8 + x. Suppose -5z + 11 = -mz. What is the units digit of z? 1 Let y(k) = -k*2 - 2k + 17. Let l be y(-7). What is the units digit of l3/12-8? 6 Let p(u) = 17u + 17. What is the units digit of p(4)? 5 Let i(f) = -f + 109. What is the hundreds digit of i(0)? 1 Suppose 45 = 3d + 2d. Let k(r) = r3 - r2 + r + 1. Let a(w) = 2w*3 + 5w*2 + 13w - 9. Let u(j) = -a(j) + 3k(j). What is the units digit of u(d)? 3 Let r(w) = -6w + 11. Let j(d) = -7d + 11. Let x(y) = 2j(y) - 3r(y). What is the units digit of x(5)? 9 Let c(q) = -2q*2 + 10q + 1. Let p be c(8). Let r = p - -98. What is the units digit of r? 1 What is the units digit of (-2)/6 + 171/27? 6 Suppose 5 = 3q + 3x + 2x, -18 = -4q - x. Suppose -2z + 47 = 2z - qf, z = f + 11. Suppose -z = -s - 2. What is the units digit of s? 6 What is the hundreds digit of 8688/36 + 2/3? 2 What is the hundreds digit of (43 + -44)(-1)/((-2)/(-320))? 1 Suppose -2v + 11 = v + m, 0 = -2m - 8. Suppose 9 = -vb - 1. Let a = 4 + b. What is the units digit of a? 2 Let w(i) = -i3 + 4i*2 + 5i + 6. Let l be w(5). Suppose 0 = -2t + lv - v + 89, 10 = -2v. What is the units digit of 6/(-4)t/(-6)? 8 Let j(n) = 14n - 1. What is the units digit of j(1)? 3 Suppose 3d + 5i - 3i - 72 = 0, 5d - 113 = -i. What is the tens digit of d? 2 Let w(c) = c3 - 4c2 + c - 3. Let q be w(4). Let u(v) = v2 + 2v - 1. What is the units digit of u(q)? 2 What is the units digit of 3 + 0/((-4)/(-1)) + 1? 4 Let b = -17 - -7. What is the units digit of (40/(-25))/(2/b)? 8 Suppose 3b - 198 = -3b. What is the tens digit of b? 3 Let h(a) = a. Let s be h(-1). Let w = 15 - s. What is the units digit of w? 6 Suppose 0 = -9r + 8r + 62. Let u = r - 33. What is the units digit of u? 9 Let c be -12 + 03/6. Let s = 17 + c. Suppose -sw + 27 = 2. What is the units digit of w? 5 Let a = 5 + 4. What is the units digit of a? 9 Suppose -18 = -2q + 4q. Let o = 31 + q. What is the tens digit of o? 2 Suppose -4k = -0k - 672. What is the units digit of k? 8 Let x be (4 - 8)3/(-2). What is the units digit of (16/2)/(x/15)? 0 Let h(r) = -r*2 - 1. Let l(v) = -6v + 3 + 5v2 - 3v*2 + 0. Let c(p) = -3h(p) - l(p). What is the units digit of c(-7)? 7 Let p = 7 + 2. Let s(x) = x*3 - 10x*2 + 13x - 12. What is the units digit of s(p)? 4 Let a(r) = 4r2 + 25r - 5. What is the tens digit of a(7)? 6 Let j(z) = 0 - 2 + 0z + 10z. What is the tens digit of j(2)? 1 Let j(h) = h*3 + 10h*2 + 8h - 6. Suppose k = o - 8 - 5, 2o = -2k - 10. What is the units digit of j(k)? 3 Let p(g) = 13g3 - g2 - 2g. Let k be p(2). Let d = -45 + k. What is the units digit of d? 1 Suppose -6 + 23 = i. Suppose -i - 7 = -b. Suppose -b = -4p + 24. What is the units digit of p? 2 Suppose -171 = -8u + 925. What is the units digit of u? 7 Suppose 84 = 2x + x. What is the units digit of x? 8 Let w(m) = -2m. Let x be w(1). What is the units digit of (-3)/(-2) - (-1)/x? 1 Let x = 6 + -4. What is the units digit of 2 + (3 - 1) + x? 6 Let y be (-2)/(-6) - (-3)/(-9). Suppose i + i = y. Suppose w + i = 5. What is the units digit of w? 5 Let i be (0 + (2 - 4))-2. Suppose 4j - 60 = -j. Suppose iy - j = -0y. What is the units digit of y? 3 Let w(n) = n - 4. Let c be w(0). Let x = c - -6. Suppose -29 = -5u + k, u + 2k - 7 = -xu. What is the units digit of u? 5 Let j be -2 + -2(-2)/(-4). Let h be (-48)/j + 2/(-1). Let a = -10 + h. What is the units digit of a? 4 Let i be (4-1 - -2) + 4. Let h be 27/(-4)2i. Let j = -18 - h. What is the units digit of j? 9 Let n = 7 - -18. Suppose -n = -2c + 3. What is the units digit of c? 4 Let p = -260 + 470. Suppose p = 2n + 3n. What is the units digit of n? 2 Let j = 21 - -1. Let p = 40 - j. Suppose -3l + p = -3c, 28 = 2l + 3c + 11. What is the units digit of l? 7 Let f(d) = -d*2 + 5. Let x be f(0). Let a = 6 - x. What is the units digit of a? 1 Let k be -12/2 - 2. Let b be k/((-9)/6 + 1). Suppose 5v = m - bm + 90, 4v = 16. What is the units digit of m? 4 Let t(z) = -2z*2 + 6 - 1 + 3z + 3z2. What is the units digit of t(-4)? 9 Suppose 4c + 5i + 7 = -1, 4c - 3i - 24 = 0. Suppose 5d - d - 106 = -m, 0 = -cd - 3m + 84. What is the tens digit of d? 2 Let s(c) = -7c2 - 2c - 1. Let y be s(-1). Let g = 11 + y. Suppose 0 = -4z + m + 27, gm - 25 = -5z + 15. What is the units digit of z? 7 Let y(n) = -3n*2 - 8n - 10. Let o(h) = -3h2 - 7h - 9. Let f(z) = -5o(z) + 4y(z). What is the units digit of f(-3)? 3 Let o(x) = -x*2 - 7x - 2. Let r be o(-6). Suppose -2l - 6 = rv, l + 11 = -l - 5v. What is the units digit of l? 7 Suppose -3h + 4r + 864 = h, -4h = r - 854. What is the units digit of h? 4 Suppose -2h + 0h = -4. Let r be h - (-5 + (1 - -1)). Suppose 0 = rj - 23 - 12. What is the units digit of j? 7 Let x(z) = 6z + 3. Let j(t) = -t2 - t + 1. Let i(d) = j(d) - x(d). Let h be i(-7). What is the units digit of 4/(8/3 + h)? 6 Let d be (-3 - 1)/((-7)/14). Suppose d = v - 9. What is the tens digit of v? 1 Let c(d) = -d2 + 7d - 5. Let w be c(6). Let h be w + (0 - 1) + 5. Suppose -5o - 1 = 4, 2o - 8 = -hz. What is the units digit of z? 2 Suppose 9t - t = 3128. What is the hundreds digit of t? 3 Suppose 21j - 14j - 1148 = 0. What is the tens digit of j? 6 What is the tens digit of 604/20 + 2/(-10)? 3 Suppose 3v - 251 = -0v - 5n, 158 = 2v + n. What is the units digit of v? 7 Suppose -6 = -3n - 3c, -2c - 1 = -n + 2n. Suppose nw + 116 = 11. What is the units digit of (-182)/w - 2/3? 8 Suppose -2x + 13 = 1. What is the units digit of (x/(-9))/(10/(-195))? 3 Let v(j) = j3 + 4j*2 + 3j + 4. Let h = 4 - 7. Let u be v(h). Suppose uz = -1 + 13. What is the units digit of z? 3 Let h(q) = 3q - 1. Let y be h(3). Let v be (-4)/12 - y/(-6). What is the units digit of (5/15)/(v/33)? 1 Suppose 0 = -q - 0l - 5l + 46, 4l = -5q + 125. Suppose 2m = -m + q. What is the units digit of m? 7 Suppose -x + 60 = 3x. What is the units digit of x? 5 Suppose -m = -2 + 4. What is the tens digit of -39(m/3 - 0)? 2 What is the units digit of (-12)/84 - (-491)/7? 0 Let c = 578 - 367. What is the tens digit of c? 1 Suppose 5n + 220 = 9n. What is the units digit of n? 5 Let f = -11 - -14. Suppose -p + 18 = f. What is the units digit of p? 5 Suppose 0t = 2t - 426. What is the tens digit of t? 1 Suppose 0l - 3l + 9 = 0. Suppose 5 = -2j + lj. What is the units digit of j? 5 Let f = 52 - 24. Suppose -4k - k = -4s - f, -5k + s + 22 = 0. Suppose -3 = -kh + 1. What is the units digit of h? 1 Suppose -7z + 64 = -3z. What is the tens digit of z? 1 Let q(r) = -r2 - 9r + 4. Let b be q(-9). What is the tens digit of (-145)/(-11) - b/22? 1 Let w(r) = -r - 1. Let z be w(8). Suppose -12 = 5t + 63. Let s = z - t. What is the units digit of s? 6 Suppose -4o = -5 - 11. Suppose -5c - 19 = -d, -od + 7d = 2c + 18. Suppose h - 4k - 19 = 0, -26 = -dh - 5k + 29. What is the tens digit of h? 1 Let y(g) = -g3 - 7g*2 + 7g - 3. Let b be y(-8). Suppose -bu - 9 = 6. What is the units digit of 3 + -1(-1 - u)? 1 Suppose 0 = -5p - 3z + 12, -3z = -5p - 5z + 8. Suppose 31 = 4s + 4h - 1, 4h - 37 = -5s. Suppose -m = p, 6 - 5 = a + sm. What is the units digit of a? 1 Suppose -c - 2 = z - 1, 2c + 4z + 2 = 0. What is the units digit of 1 + 1 + c - -11? 2 Suppose -6 = 2z + z. Let n(x) = -2x - 2. What is the units digit of n(z)? 2 Let s = 137 - 110. What is the tens digit of s? 2 Let b = -24 - -55. What is the tens digit of b? 3 Suppose -2z + 129 = 2x + z, x = 5z + 45. Suppose 0 = -3a + 6v - 5v + x, 0 = 2a - 2v - 36. What is the tens digit of a? 2 Suppose -g + 21 = 3g - 5z, -4z = 4g - 12. Suppose -gd = 3b - 97, 4 = 2b - 2. Suppose 2w + 15 = -5j, -d + 7 = 3j. What is the units digit of w? 5 Let b = -3 + 12. What is the units digit of b? 9 Suppose -5t - s = -305, -5t + 3s + 305 = 2s. What is the units digit of t? 1 Let y(r) = -3r - 3 - 5r2 - r3 + 7r2 + 6r. Suppose -6*x	{ "pile_set_name": "DM Mathematics" }
993454. 8941086 What is the least common multiple of 4191 and 46724? 195820284 What is the least common multiple of 57030480 and 3240? 57030480 Calculate the smallest common multiple of 277952 and 2423394. 77548608 What is the smallest common multiple of 30402 and 4464? 7539696 What is the least common multiple of 10313864 and 60? 154707960 Calculate the least common multiple of 79512 and 84474874. 1013698488 Calculate the smallest common multiple of 50805 and 3494255. 31448295 Find the common denominator of -109/21409050 and -44/39. 21409050 What is the common denominator of 32/129 and -83/1644234? 1644234 What is the common denominator of 115/45472 and -9/294177856? 2059244992 Calculate the smallest common multiple of 171 and 55162. 9432702 Calculate the common denominator of -4/7874207 and -41/16984. 62993656 Find the common denominator of 59/880 and 47/5621935. 89950960 What is the lowest common multiple of 16845 and 176030? 593045070 Calculate the common denominator of -104/3178455 and 89/112517307. 562586535 Calculate the common denominator of -133/134700252 and 71/246. 134700252 Calculate the smallest common multiple of 157029015 and 254298. 314058030 Calculate the common denominator of -7/24436434 and -107/137412. 146618604 Calculate the common denominator of 43/645792 and 109/541632. 16790592 What is the smallest common multiple of 14 and 2001992008? 14013944056 What is the lowest common multiple of 63 and 13269558? 278660718 Calculate the common denominator of -56/5195 and -29/14831. 77047045 Find the common denominator of 53/9104 and 137/3147708. 12590832 What is the lowest common multiple of 29862 and 661941? 3971646 Calculate the smallest common multiple of 5994076 and 1012. 5994076 Calculate the least common multiple of 591645414 and 3. 591645414 What is the common denominator of -167/20467200 and -121/29120? 143270400 What is the common denominator of 55/34548 and -23/1868? 16133916 Calculate the common denominator of 8/9325015 and 2/18055. 214475345 Find the common denominator of 95/56 and 17/745220. 1490440 What is the smallest common multiple of 220209 and 4056? 297722568 What is the least common multiple of 1393 and 11235? 2235765 Find the common denominator of 109/193842 and -113/1699722. 205666362 Calculate the common denominator of -49/42971137 and -19/121. 472682507 What is the smallest common multiple of 99 and 174879? 1923669 Calculate the smallest common multiple of 2832 and 12738048. 751544832 Calculate the common denominator of -57/6105128 and -79/784. 598302544 Calculate the smallest common multiple of 5077890 and 540. 10155780 What is the common denominator of -139/121704 and 103/697032? 7667352 Calculate the smallest common multiple of 882683 and 266. 12357562 Calculate the smallest common multiple of 10 and 4298065. 8596130 What is the common denominator of -53/27 and 23/305962? 8260974 What is the common denominator of 119/96534036 and 133/25530? 482670180 Find the common denominator of -25/220387 and 39/29711. 89697509 What is the smallest common multiple of 90 and 4161033? 41610330 Find the common denominator of 31/16 and 73/2347786. 18782288 Find the common denominator of -109/3408 and -63/12514744. 75088464 What is the common denominator of 179/46080 and 29/2988? 3824640 Calculate the common denominator of -9/147841190 and -173/84. 887047140 Find the common denominator of -117/169640 and 19/1955. 66329240 What is the common denominator of -71/21333650 and 63/4266730? 21333650 Calculate the common denominator of -191/10320 and -61/182965. 8782320 What is the common denominator of 151/10770 and -49/6228291? 62282910 What is the common denominator of 113/13720 and 57/135800? 6654200 Find the common denominator of 27/4404995 and 28/4955. 4404995 What is the common denominator of 33/13559036 and -107/40? 135590360 What is the smallest common multiple of 68123 and 366? 24933018 Find the common denominator of 49/2347722 and 119/474. 2347722 Calculate the least common multiple of 1441600 and 45050. 1441600 Calculate the smallest common multiple of 179684 and 348. 539052 What is the smallest common multiple of 33879530 and 10? 33879530 What is the common denominator of -85/4812544 and 49/156407680? 312815360 Calculate the lowest common multiple of 526779 and 2926550. 26338950 What is the lowest common multiple of 3929040 and 223416? 113942160 What is the common denominator of -13/50072498 and -9/50072498? 50072498 Calculate the smallest common multiple of 42075 and 2010. 5638050 Calculate the common denominator of 1/103943 and 99/2078860. 2078860 Calculate the smallest common multiple of 6396 and 4485. 735540 What is the common denominator of -129/40820 and -119/919392? 59760480 What is the smallest common multiple of 30 and 30051322? 450769830 What is the smallest common multiple of 47319892 and 10508? 3359712332 Calculate the common denominator of -41/58605 and 18/331. 19398255 What is the least common multiple of 130848 and 1357548? 10860384 What is the smallest common multiple of 4996448 and 12? 14989344 Calculate the smallest common multiple of 231 and 128438541. 128438541 Calculate the least common multiple of 595988 and 4916901. 19667604 Calculate the common denominator of -77/123892 and -37/8. 247784 Calculate the common denominator of -9/36450656 and 23/14. 255154592 Find the common denominator of -5/84612 and -19/13200. 8461200 Calculate the least common multiple of 25226985 and 30272382. 151361910 Find the common denominator of -85/252 and 55/38028. 798588 What is the smallest common multiple of 287459 and 31? 8911229 Calculate the common denominator of -71/20 and 87/157804. 789020 What is the common denominator of 61/7704 and 49/372? 238824 Calculate the common denominator of -28/655947 and 33/583064. 5247576 What is the least common multiple of 1304762665 and 5? 1304762665 What is the smallest common multiple of 2 and 44646898? 44646898 What is the lowest common multiple of 10 and 282494136? 1412470680 Calculate the common denominator of -71/279 and 4/29075. 8111925 What is the common denominator of -65/3034028 and 49/65990109? 263960436 What is the common denominator of -101/2664 and 61/19271376? 19271376 Calculate the common denominator of -89/63772110 and 7/7085790. 63772110 Find the common denominator of -53/120 and 71/7313724. 73137240 Calculate the common denominator of 53/10 and -47/121000. 121000 What is the common denominator of 87/1018 and -77/17452? 8883068 Find the common denominator of 12/35 and -27/1078025. 7546175 Calculate the least common multiple of 63 and 53190774. 53190774 What is the common denominator of -193/69322800 and 35/82? 69322800 What is the lowest common multiple of 645875 and 6071225? 30356125 Calculate the least common multiple of 107775 and 11184650. 100661850 What is the common denominator of 63/24622232 and 53/2204976? 147733392 Calculate the smallest common multiple of 1690 and 830232. 53965080 Calculate the common denominator of -37/15367 and 23/289091. 403860127 What is the common denominator of 85/8 and 167/24484110? 97936440 Find the common denominator of -157/66 and -71/1329276. 14622036 What is the smallest common multiple of 190 and 42320? 804080 Calculate the lowest common multiple of 200 and 29200. 29200 Calculate the smallest common multiple of 8437 and 14787760. 162665360 What is the common denominator of -49/12503937 and -34? 12503937 Find the common denominator of 137/224802 and -5/13394. 8317674 What is the common denominator of -34/161 and 65/12551238? 12551238 What is the least common multiple of 335196930 and 35610? 335196930 What is the lowest common multiple of 22825803 and 182? 45651606 Calculate the smallest common multiple of 8727180 and 1540. 8727180 What is the least common multiple of 38791980 and 3232665? 38791980 Calculate the common denominator of 12/3653569 and -58/796029. 142489191 Calculate the least common multiple of 4615328 and 121456. 4615328 Calculate the least common multiple of 7789260 and 54. 70103340 What is the common denominator of 41/15745 and 67/3055? 204685 What is the common denominator of -49/6453774 and 57/24308? 12907548 Calculate the common denominator of -59/12930 and 47/68102310. 68102310 What is the smallest c	{ "pile_set_name": "DM Mathematics" }
2 Differentiate -5133d2 - 3618. -10266d Find the second derivative of -164o2 - 554o wrt o. -328 Differentiate -4mtv3 + 13mt - 4tv + 2t + v*3 - 3 wrt v. -12mtv*2 - 4t + 3v2 Find the third derivative of -285b*3hr3 - b3hr - bhr3 - 2bhr*2 - 23br2 wrt r. -1710b*3h - 6bh What is the third derivative of -3271t6 - 644t*2 + 3t wrt t? -392520t3 Find the second derivative of 14f*3 - 171f*2 - 10976f. 84f - 342 What is the second derivative of 87u*3 + 2u*2 - u - 10? 522u + 4 Differentiate -387bcm - 8bm - 15b with respect to c. -387bm Differentiate 15g3oq - 4g*3 + 56g*2q - 2oq - 2o with respect to o. 15g*3q - 2q - 2 Find the second derivative of -2o*2s*2 + 5o*2s - 53os*2 + 7os wrt s. -4o*2 - 106o Differentiate -3d2w*2 + 7059d*2 - dw - 95w2 with respect to w. -6d*2w - d - 190w What is the third derivative of 2g*4 - 42g*3u*2 + 69g*2u2 + u2 wrt g? 48g - 252u*2 Find the third derivative of 4l*4w2 + l4w - 5l*3 + 3l*2w*2 - 3l - 71w2 wrt l. 96lw2 + 24lw - 30 Differentiate 2a*4 - 625a*3 + 4381 with respect to a. 8a*3 - 1875a2 What is the second derivative of -p4 - 62p3 + 58p*2 + 10086p wrt p? -12p2 - 372p + 116 What is the derivative of -7g3 + 2gz + 154z - 1 wrt g? -21g2 + 2z What is the third derivative of 4o3p*3z*2 + 25o*3z*2 - 2o*2p*3z + 2o2pz2 - 68op3 wrt o? 24p*3z*2 + 150z*2 Differentiate -7v*2z*3 - 8v*2 - 4v - 490z3 - 67 wrt z. -21v*2z*2 - 1470z*2 Find the third derivative of -547u*4 + 2u*3 - 437u*2. -13128u + 12 Find the third derivative of 1808g3w - 17g2w + gw - 2w wrt g. 10848w What is the second derivative of 12530o*2 + 4o - 77 wrt o? 25060 Differentiate 3l4 - l3t + 4t + 29 with respect to l. 12l*3 - 3l*2t What is the third derivative of 9d5y + d*5 - 5d*3y + 94d2 + y wrt d? 540d*2y + 60d2 - 30y What is the second derivative of 4f3g*2q*2 + 2f*3 + 2f*2 + 35fg2q*3 + 2gq3 + 49g wrt g? 8f3q*2 + 70fq3 Find the second derivative of -44tx3y*2 - 22tx3y + 2tx*2 - 17txy*2 + 2xy - 2 wrt y. -88tx3 - 34tx Find the third derivative of 188g*4 - 10g*2 - g wrt g. 4512g Differentiate -31anu + 7au3 + 67nu3 + 5nu2 wrt a. -31nu + 7u*3 Find the third derivative of -2h*3v*3 - 105h*3v*2 - 4h*2v*2 - 6hv3 wrt h. -12v*3 - 630v*2 What is the third derivative of -1068i*3 + 6i*2 + i + 10? -6408 Find the second derivative of -229g*4 + 4g*3 - 2g*2 - g - 190. -2748g*2 + 24g - 4 Find the second derivative of 411h3m*2n - 2h3mn - hmn - 2m*2n - 114m2 + 4n wrt h. 2466hm*2n - 12hmn What is the third derivative of -17o*6 + 2o*4 - 4o*2 - 93o? -2040o3 + 48o Find the second derivative of 3942w2 - w + 2328. 7884 Find the third derivative of -8c*6t*3 - 10c*3t*3 - 5c*2 + 2t*3 - 4 wrt c. -960c*3t*3 - 60t*3 What is the second derivative of 3842q*3 + 867q? 23052q Find the third derivative of -3d*3v*3 - 52d3 - d2v3 + 275d*2v*2 wrt d. -18v3 - 312 What is the third derivative of -n5 - 634n3 + 1666n*2 - 1 wrt n? -60n*2 - 3804 What is the third derivative of 4b*4 + 4b*3 + 2b*2 - 219 wrt b? 96b + 24 Find the second derivative of -28h5 - h2y + 3hy + 4y wrt h. -560h*3 - 2y Find the first derivative of 40q3z + 371q3 + 3qz3 + z3 wrt z. 40q*3 + 9qz2 + 3z*2 Differentiate 4d*2 - 30d - 267. 8d - 30 What is the derivative of -1664go + 1512g - o*2 - 1 wrt o? -1664g - 2o What is the third derivative of 3o*5z*3 + 763o5 + o2z3 + 5o*2z*2 + o wrt o? 180o*2z*3 + 45780o*2 Find the first derivative of 53n*3 + 2n*2 - 5n - 2360 wrt n. 159n2 + 4n - 5 What is the third derivative of -3258b3k2 + b3k + b2 + bk*2 + 10379b wrt b? -19548k2 + 6k What is the derivative of 970cg*2 + 7cgr*2 - 222g*2r*2 - 2gr2 + 6 wrt c? 970g*2 + 7gr2 What is the third derivative of 2m*2v*3 + 2m*2v*2 - 45m*2v - 4mu*2v3 + u2 + 4uv*3 wrt v? 12m*2 - 24mu2 + 24u Find the third derivative of -571h4 - h2 - 191. -13704h What is the second derivative of 6r4 - r2u*2 - 5r*2ux - 7ru2 - 30x - 2 wrt r? 72r2 - 2u*2 - 10ux What is the derivative of -12134sv - v + 487 wrt s? -12134v Differentiate 3p3 - 1616p*2 + 2p + 19221. 9p2 - 3232p + 2 What is the third derivative of 98gk*4 + 2gk3 + gk*2 - 3gk + 46k wrt k? 2352gk + 12g Find the third derivative of -276m*4 - 2m3 + m2 + 7m. -6624m - 12 What is the third derivative of 557s3 - 152s*2? 3342 What is the second derivative of -2o*2v*2w + 195o2v*2 + 6o*2vw - o2v - 7vw - 2v wrt v? -4o*2w + 390o2 What is the third derivative of 850d*3i*2 - 32d*2i*2 + 5i wrt d? 5100i2 What is the third derivative of -1683w*4 + 3w*3 + 11420w*2 wrt w? -40392w + 18 Find the third derivative of 2l3p + 17l3 - 70l*2 + lp wrt l. 12p + 102 What is the third derivative of 2k*3m + 8753k3 + 23k*2m - 2km - 214k wrt k? 12m + 52518 What is the third derivative of 3375i6 + i2 - 636i - 3 wrt i? 405000i3 What is the second derivative of -370i*3u2 - i3 - 121iu*2 - 2 wrt i? -2220iu2 - 6i Differentiate 2m2s - 35ms - 9m + 7s + 43 wrt m. 4ms - 35s - 9 What is the first derivative of -2b*3h - 24bh*2 + 2bh + 34h*2 wrt b? -6b*2h - 24h2 + 2h Find the second derivative of 60ou*2 - 142ou wrt u. 120o Find the third derivative of -14c2o4 + c2o3 - 3c*2o*2 - 363c*2 - 30co4 wrt o. -336c*2o + 6c2 - 720co What is the derivative of -1378ow2 - 4w*2 - 160w wrt o? -1378w2 Find the first derivative of -1451m*2 + 916. -2902m What is the first derivative of -t*3 + 517t*2 + 281? -3t*2 + 1034t Find the second derivative of -nw3 - 3nw + 7w*3 - 3w*2 - 138w wrt w. -6nw + 42w - 6 Find the third derivative of -344h*6s*3 + 7h*6s - 188h2 - hs*3 + 5s*2 wrt h. -41280h*3s*3 + 840h*3s What is the third derivative of -7i2q*3 + 11i*2q*2 + 14iq4 - 21iq wrt q? -42i*2 + 336iq Differentiate 674n + 379 wrt n. 674 What is the derivative of 7j4 - 7j*3 + 73? 28j*3 - 21j*2 What is the third derivative of 4496k*6 - 11k*2 + 91k? 539520k3 What is the derivative of m3x - m*3 - 7m*2 + 130x wrt x? m*3 + 130 Find the third derivative of 20b*3w*2 - 2b*3w - 6b2 - bw*2 - 24bw wrt b. 120w*2 - 12w Differentiate -1875tz + 14z + 36 with respect to t. -1875z What is the third derivative of -6465f3n*3 - 2f*3n - f*3 - 10fn2 - 69f wrt n? -38790f3 Find the first derivative of -31q*3y*2 + 55q*3 - 21qy4 - q + 4 wrt y. -62q*3y - 84qy*3 Find the third derivative of -154vx4z - 13vx*2z - v + x*2z + 2xz wrt x. -3696vxz Find the first derivative of 10qsw + 2qw*3 + 56qw - q - 441sw3 - 20sw2 wrt q. 10sw + 2w*3 + 56w - 1 What is the second derivative of -2158g2uy + g2u + guy - g + 2u - 1283y wrt g? -4316uy + 2u What is the third derivative of 377a*4 - 630a*2 wrt a? 9048a What is the third derivative of -680c3 + 1261c*2 wrt c? -4080 What is the second derivative of 2aq5 - 32aq3 - 196a - q wrt q? 40aq*3 - 192aq Find the second derivative of -1260y*5 - 644y wrt y. -25200y3 Find the third derivative of -1973r*5 - 3r*3 - 3r*2 + 18r - 4. -118380r2 - 18 Differentiate -2a*3y*2 + 11a*3 + 2a*2 - 65ay2 wrt y. -4a*3y - 130ay Find the third derivative of 2g5st2 + 3g*5st + 2g*2st - 2g*2s + g*2 + 6gst*2 wrt g. 120g*2st2 + 180g*2st What is the second derivative of 707k*3p*2 + 44k*3p - 2k2p wrt p? 1414k3 What is the second derivative of 29b*3v - 58b2v*2 - 2bv2 + 2b + v + 581 wrt b? 174bv - 116v2 Differentiate m4x*2 - 172m*4 - 2m - 38x2 - 5 wrt m. 4m*3x**2 -	{ "pile_set_name": "DM Mathematics" }
n - 99n)(4n - 7 - 2n + 5). -262n*2 + 262n Expand (0v2 + 4v2 - v2)(0v + 0v + v)(11 - 1 - 68). -174v3 Expand (-13 + x4 + 13)(1 + 5 - 1)(-5 + 2 + 1). -10x*4 Expand (5q*3 - 2q*3 - 2q*3)(-2q + 6q - 2q) + (2q*2 - 2q2 - q2)(-3q*2 - 7q*2 + 2q*2 + (4 - 2q - 4)(3q - 2q - 3q) + 0 - 2q2 + 0). 8q*4 Expand (-322g + 783g - 202g)(2 + 0g - 2g2 - 1 + 2g). -518g3 + 518g*2 + 259g Expand 3a - 2a*3 - 3a + (-4a - 2a + 5a)(a*2 + 4a*2 - 4a2) + a3 + a - a + 0 + 0 + 12a3. 10a*3 Expand (-1075 + 1075 + 7g - 3g4)(-9g - 6g + g). 42g5 - 98g*2 Expand (25z*2 - 398z*2 + 48z*2)(-2z - 1 + 1)(z + 0z + 0z). 650z4 Expand (4k - 3k + 2k)(-8 + 8 - 42). -126k Expand (-s - 1 + 1)(-2 - 4 + 1) + 2 + s - 2 + 0s + 2s + 0s - 5s + 4s - s + (-2 + 2s + 2)(1 - 1 + 2) + 1 + 4s + 9 - 7. 14s + 3 Expand 1 + r*5 - 5r*5 + 3r*5 - 12r*4 + 9r*5 + 12r*4 + (-1 + r + 1)(-r + r - 2r4). 6r*5 + 1 Expand (20 - 43 - 27)(6c2 + 7c*2 - 6c*2) + (-2c + c + 2c)(-4c + c + 4c) + c*2 - 2c*2 + 3c*2. -347c*2 Expand (3k - 2k - 2k)(0k*4 + 3k*4 + 0k4) - k5 + k3 - k3 + (-4k + 4k - 2k)(k*4 - 2k*4 + 4k*4). -10k*5 Expand (-4 - w + 4)(-6949 - 28w + 6949). 28w*2 Expand -3r - 2r3 + 3r + (r - 2 + 2)(-2 - 2r2 + 2) + (-1 - r2 + 1)(-4 + 2r + 4) - 236r3 - 53r*3 + 33r*3. -262r*3 Expand (16 + 10 + 22)(-5 + 5 - 19l3). -912l*3 Expand (2g + 3g - 6g)(-5g2 + g2 + g2) + g2 - g2 - g3 + (-2g2 + 0 + 0)(-11g - 10g + 11g). 22g*3 Expand (3c4 - c4 + c*4)(-19c + 0 + 0) + (-3 + 5 - 4)(-c*5 - 2 + 2) - 5c5 + c5 + 3c5. -56c*5 Expand (-10 + 2 + 1)(6 - 6 - 4q). 28q Expand (4y2 + 0y + 0y)(-4 + 0 + 2 + (3 - 1 - 3)(-3 - 3 + 4) - 3 + 6 - 1)(9 + 3 - 4)(-10 + 1 + 2). -448y*2 Expand (-80p + p - 48p)(6 + 0 - 2). -508p Expand (0w2 - w2 - w*2)(2 + 0 + 0)(60 + 88 + 45). -772w*2 Expand (0z*2 + 0z*2 - 2z*2)(z - 5z + 2z) + 5587 - 37z2 + 36z*2 - 611z*3 - 5585. -607z3 - z2 + 2 Expand (-k + 4 - 4)(-71 - 63 + 37) + (-1 + 5 - 2)(4k + 3k - 4k). 103k Expand ((5 - 5 - 1)(-1 - 3 + 5) + 1 - 1 - 1)(-6 - 22 + 7)(10m + 4 - 4). 420m Expand (-3 + 3n + 3)(2 - 2 + n3) + 15n*4 - 3n*4 + 2n*4. 17n*4 Expand (5806y - 2967y - 2987y)(-1 - 1 + 0). 296y Expand 1491 - 88x - 1491 + (-7 + 5 + 6)(2x + x - 4x). -92x Expand (33w - 33w + w2)(-3w2 - 3w*2 + 4w*2). -2w*4 Expand (-2j*2 + 0j + 0j)(-2j + 2j*3 + 7j + 0j3) - 2j*5 + 4 - 4. -6j*5 - 10j*3 Expand (8 + 1 + 5)(-3t + t + 0t)(0 + t + 0 + (-t - t + 0t)(7 - 2 - 3))(0 - 2 + 5). 252t2 Expand (5x*4 - 2x4 - x4)(-1 + 2x + 1) + 92x3 - 92x*3 - 8x5 + 2265 - x3 - 3x2 - 2265 + 2x*5. -2x5 - x3 - 3x2 Expand (0 + 0 - 3)((-6o + o + 4o)(3 - 2 + 0) - 189o + 4 - 5 + 186o)(4 - 1 - 2). 12o + 3 Expand (-2o - 4o - 2o)(o + 2o - o)(-18o - 16o + 0o). 544o3 Expand 2f2 - f2 - 3f2 + (-f + 0f - f)(-f - f + 0f) - 2f2 - f + f - 2f2 + f2 - 3f2 - 14f + 14f + 1 - 2f*2. -6f*2 + 1 Expand (3a - 3a - a2)(0a2 + a2 + a2) + (25a*3 - 365a + 365a)(-12a + 4a - 9a). -427a*4 Expand -126 - 34i*4 + 129 + 25i*4 + 4i*4 - 2i*4 - 3i*4 + (3i*3 + 2i*3 - 4i*3)(-3 - i + 3). -11i4 + 3 Expand (-2y + 2 - 2)(3 - 1 + 0) + 0 - 2 - 1482y + 1223y. -263y - 2 Expand (-5 - 87l - 43l - 48l)(2l4 + 2l*4 - 5l*4). 178l*5 + 5l*4 Expand (-2 + 7 - 2)(11 + 3 - 1 - p)(p - 2p + 2p + (4p - 3p - 3p)(-3 + 4 + 0) + 3 - 3 + 4p). -9p2 + 117p Expand (1 + 6 - 1)(g4 + 4g4 + g4 - g + g + g4 + g4 - 4g4 + 5g*4 + (4g2 + g3 - 4g2)(0 + g + 0)). 60g4 Expand (2 - 5 + 5)(-3 + 1 + 1)(-4 - 1 + 2)(4o2 + 3o*2 - 4o*2). 18o*2 Expand (-4x + 0x + 0x)(0 + 10 + 4 + (4 - 5 + 2)(-2 - 4 + 4))(0x*4 + 3x*4 - 4x*4). 48x*5 Expand 2 + u - 2 + (-5 + 3 + 3)(-2u + 5u - u) + (2u - 2u + 3u)(5 - 3 + 2). 15u Expand ((0o - 3o + 2o)(-3 - 2 + 4) + 0o + o - 4o)(-362 + 182 - 193 - 223). 1192o Expand (-s2 - 2s*2 + 0s*2)(-4s2 + 3s*3 + 4s*2)(1 - 7 - 15). 189s5 Expand (0 + 5 - 2)(5 + 2 + 8)(3k + k - k). 135k Expand (-5o - o + 7o + 2)(-72o2 + 35o*2 - 21o*2 - 63o*2). -121o*3 - 242o*2 Expand ((-1 + 3 + 0)(3 - 2 - 2) - 3 - 2 + 4)(-1 + 1 + 2i*2) - 4i*2 - 3i*2 - 11i*2. -24i*2 Expand (1 - 1 + 2)(3r2 - 4r*2 + 0r2) - r2 + 4r2 - 4r*2 + 14 - 2r - 23r2 + 4r*2 + 17r*2. -5r*2 - 2r + 14 Expand (-5h2 - 2h*2 - 2h*2)(2h2 - 2h*2 + 2h*2) + (-2h*3 + 2h*3 + 7h*3)(-3h - h + 3h). -25h4 Expand (-3i - 7i + 2 - 17i)(4i*3 - 3i*3 - 4i*3) + 2i*4 + 4 - 4. 83i*4 - 6i*3 Expand (5o - o - 3o)(-o - o + 5o)(4o3 + 2 - 2 + (-o - 1 + 1)(5o2 + 8o*2 + 6o*2)). -45o*5 Expand 0m*5 + 0m*2 + 2m*2 + 2m*5 + (-5 + 4 - 1)(3m - 3m + 4m5 + (1 - 2m - 1)(-2m2 + m4 + 2m2)). -2m*5 + 2m*2 Expand (-94p + 53p + 69p)(3p + 3 - 3) - p*2 + 2p2 + p2. 86p2 Expand -3f*2 + 2f*2 + 2f*2 + (0f - f + 6f)(4f + 5 + 2 - 4). 21f*2 + 15f Expand (-2 + v2 + 2 + (-v2 + v - v)(2 + 3 - 3))((4v + 0v - 2v)(v*2 + 4 - 4) + 0v3 - v3 + 3v3)(-1 - 1 + 4). -8v5 Expand -c5 - 4c*3 + 4c*3 + (0c2 + c2 + 0c2)(-c*3 + 0c3 - c3) - 3c5 - 4c*5 + 6c*5 - 3c*5 - 5c*5 + 6c*5 - 60c*5 - 116 + 116. -66c*5 Expand ((-2x*2 - x + x)(-x + 0x - 4x) + 0x3 - x3 - x3)(21x2 + 169x - 169x). 168x*5 Expand -543r - 22r2 + 543r - 3 + 2r2 + 3 + (-2r + 0r + 0r)(0r - 2r + r) - 2 - 2r*2 + 2 + 3r - 3r - r2. -21r*2 Expand (-2a + 3a - 3a)(4a*4 - 3a*4 - 2a*4) - 369a*4 + 519a*4 - 6a*5 + 8a*5. 4a*5 + 150a*4 Expand (0n*2 + 2n*2 - 3n*2)(-3 - 2 - 1) + 0n - n2 + 0n + (8n2 - 2n2 + n2)(5 - 1 - 3) + 0n*2 - 3n2 + n2. 10n2 Expand (12 + 23 + 18)(0 - 7h2 + 1 + 4h*2). -159h*2 + 53 Expand (11 - 2g - 3 + 9)(-6g - 4g - g)(g*3 - 2g*3 + 0g*3). -22g*5 + 187g*4 Expand (3l - 2l + 0l)(-l + 2l + 7l + (-2l + 2 - 2)(-5 + 3 + 3))(-4l2 + l2 + 0l*2). -18l*4 Expand (3 - 4 + 0)(0 - k + 0) + (-4 + 0 + 0)(-9k - 71 + 71). 37k Expand (o - 3 + 3)(-o - 1 + 1) - 497o2 + 310o*2 + 278o*2. 90o2 Expand (16 - y2 - 1 - 13 + 48y)(1 - 2 - 4)(-2y2 - y2 + 0y2) + y4 - 2y*4 + 3y*4. -13y*4 + 720y*3 + 30y2 Expand (m3 - 51m + 51m - 10m2)(1 - 1 + m). m*4 - 10m*3 Expand -2z*4 + 1 - 1 + (5 - 1 - 2)(-5z3 + 5z*3 - 3z*4) - 6z3 - z3 + 5z3 + 3z*4. -5z*4 - 2z*3 Expand (121x + 192x - 12x)(-4x*2 + 1 + 1 + 2x*2). -602x*3 + 602x Expand (-4 + 1 - 2)(4i - 3i - 8i) - i + 3i + 2i. 39i Expand (-3y*2 + 4y - 11y2 + 8y*2)(1 - 2y3 - 1). 12y*5 - 8y*4 Expand 15v*2 - 3v*4 - 798 + 798 + (6 - 3 - 1)(-18v4 + 13v*4 - 19v*4). -51v*4 + 15v*2 Expand (12f + 7f + 6f)(-f - 2f + 0f) + (14f + 4f - 2f)(4 + 3 + 2f - 5). -43f2 + 32f Expand (9 - 116 + 79087a - 79089a)(3a*2 + 2a*3 - 3a*2). -4a*4 - 214a*3 Expand (-6o*2 + 15o*2 - 6o2 + o3)((-3 - 1 + 2)(3 - 3 + 1) + (4 + 2 - 7)(4 - 5 + 0))(-8o2 + 14o*2 + 7o*2). -13o*5 - 39o*4 Expand (4y*2 + 106 - 106)(-3y - 5y - 4y) + (-2y + 2y + 2y*2)(6y - 3y - y) + 0y2 - y3 + 0y2 - y2 + y*2 + 2y*3. -43y*3 Expand (6 - 5z*4 - 6)(1 - 1 + z) + z*3 + 2z5 - z3 + (61z3 + 21z*3 - 28z*3)(0z + z2 + 0z) - 4z3 - z5 + 4z*3. 50z*5 Expand (0 + 0 - 2w)(2w - 4w - w)(60w - 10 + 10). 360w*3 Expand (2y - 2y - 2y)(-47y*2 - 26y*2 + 15y*2 - 107y*2) + 27y - 12y3 - 27y. 318y3 Expand (3 - 4 + 6d + 3)(1381 - 40d - 1381). -240d2 - 80d Expand (34 - 8 - 206 - 111 - 16)(6q - q - 2q). -921q Expand (-3d + 2d + 4d)(156d2 - 11452d + 11452d)(-2 + 0 + 3). 468d3 Expand (-w - 3w - 2w)(2 - 2 + 3w3) + 3w*3 - 9w*4 - 3w*3. -27w*4 Expand (-9o*4 + 0o + 0o)((o - o - 5o)(-1 + 0 - 1) + o - o - 2o). -72o**5 Ex	{ "pile_set_name": "DM Mathematics" }
s the cube root of 67990 to the nearest integer? 41 What is the cube root of 8766 to the nearest integer? 21 What is the square root of 5775 to the nearest integer? 76 What is the fourth root of 788 to the nearest integer? 5 What is 4286 to the power of 1/5, to the nearest integer? 5 What is the cube root of 21957 to the nearest integer? 28 What is 4795 to the power of 1/10, to the nearest integer? 2 What is 5056 to the power of 1/7, to the nearest integer? 3 What is the cube root of 2275 to the nearest integer? 13 What is 41885 to the power of 1/7, to the nearest integer? 5 What is the third root of 33805 to the nearest integer? 32 What is the square root of 373 to the nearest integer? 19 What is the square root of 27622 to the nearest integer? 166 What is the fifth root of 2185 to the nearest integer? 5 What is 9514 to the power of 1/2, to the nearest integer? 98 What is 19952 to the power of 1/10, to the nearest integer? 3 What is 152424 to the power of 1/2, to the nearest integer? 390 What is the third root of 20137 to the nearest integer? 27 What is the fourth root of 1542 to the nearest integer? 6 What is 1349 to the power of 1/2, to the nearest integer? 37 What is 540 to the power of 1/9, to the nearest integer? 2 What is 2215 to the power of 1/9, to the nearest integer? 2 What is 58822 to the power of 1/5, to the nearest integer? 9 What is 4874 to the power of 1/3, to the nearest integer? 17 What is the ninth root of 57278 to the nearest integer? 3 What is 1859 to the power of 1/5, to the nearest integer? 5 What is the third root of 7228 to the nearest integer? 19 What is 2281 to the power of 1/3, to the nearest integer? 13 What is the square root of 732 to the nearest integer? 27 What is the cube root of 806 to the nearest integer? 9 What is 39265 to the power of 1/2, to the nearest integer? 198 What is 22797 to the power of 1/4, to the nearest integer? 12 What is the sixth root of 7221 to the nearest integer? 4 What is the fifth root of 1170 to the nearest integer? 4 What is 9482 to the power of 1/8, to the nearest integer? 3 What is the cube root of 12242 to the nearest integer? 23 What is the fifth root of 111947 to the nearest integer? 10 What is 63399 to the power of 1/3, to the nearest integer? 40 What is the cube root of 16934 to the nearest integer? 26 What is the cube root of 3684 to the nearest integer? 15 What is the cube root of 66 to the nearest integer? 4 What is 500 to the power of 1/2, to the nearest integer? 22 What is the fifth root of 15613 to the nearest integer? 7 What is 548 to the power of 1/6, to the nearest integer? 3 What is the cube root of 103155 to the nearest integer? 47 What is the tenth root of 665 to the nearest integer? 2 What is the cube root of 618 to the nearest integer? 9 What is the third root of 30437 to the nearest integer? 31 What is the square root of 37901 to the nearest integer? 195 What is the sixth root of 8503 to the nearest integer? 5 What is the third root of 29698 to the nearest integer? 31 What is the cube root of 11958 to the nearest integer? 23 What is 3861 to the power of 1/8, to the nearest integer? 3 What is 672 to the power of 1/7, to the nearest integer? 3 What is the cube root of 7439 to the nearest integer? 20 What is 1247 to the power of 1/3, to the nearest integer? 11 What is the sixth root of 2811 to the nearest integer? 4 What is 8275 to the power of 1/3, to the nearest integer? 20 What is the square root of 51008 to the nearest integer? 226 What is the tenth root of 51862 to the nearest integer? 3 What is 13181 to the power of 1/3, to the nearest integer? 24 What is the third root of 424 to the nearest integer? 8 What is the eighth root of 699 to the nearest integer? 2 What is the cube root of 88282 to the nearest integer? 45 What is the seventh root of 5114 to the nearest integer? 3 What is 857 to the power of 1/3, to the nearest integer? 9 What is the square root of 150232 to the nearest integer? 388 What is the square root of 22512 to the nearest integer? 150 What is the square root of 6276 to the nearest integer? 79 What is 7118 to the power of 1/3, to the nearest integer? 19 What is the fifth root of 501 to the nearest integer? 3 What is 4618 to the power of 1/5, to the nearest integer? 5 What is 403 to the power of 1/2, to the nearest integer? 20 What is 5970 to the power of 1/2, to the nearest integer? 77 What is 5227 to the power of 1/8, to the nearest integer? 3 What is the sixth root of 47369 to the nearest integer? 6 What is 4151 to the power of 1/10, to the nearest integer? 2 What is 426 to the power of 1/2, to the nearest integer? 21 What is 7234 to the power of 1/2, to the nearest integer? 85 What is 665 to the power of 1/3, to the nearest integer? 9 What is the cube root of 1583 to the nearest integer? 12 What is the ninth root of 4625 to the nearest integer? 3 What is the cube root of 9480 to the nearest integer? 21 What is 4946 to the power of 1/2, to the nearest integer? 70 What is 70561 to the power of 1/7, to the nearest integer? 5 What is the square root of 8705 to the nearest integer? 93 What is 3965 to the power of 1/2, to the nearest integer? 63 What is the ninth root of 14732 to the nearest integer? 3 What is 2010 to the power of 1/3, to the nearest integer? 13 What is the square root of 67054 to the nearest integer? 259 What is the fifth root of 11543 to the nearest integer? 6 What is the cube root of 580 to the nearest integer? 8 What is 3335 to the power of 1/2, to the nearest integer? 58 What is 1567 to the power of 1/3, to the nearest integer? 12 What is 6648 to the power of 1/2, to the nearest integer? 82 What is 11545 to the power of 1/3, to the nearest integer? 23 What is the cube root of 216 to the nearest integer? 6 What is the cube root of 24146 to the nearest integer? 29 What is the ninth root of 5297 to the nearest integer? 3 What is the cube root of 18741 to the nearest integer? 27 What is the square root of 132983 to the nearest integer? 365 What is the cube root of 1050 to the nearest integer? 10 What is the square root of 107414 to the nearest integer? 328 What is the square root of 9722 to the nearest integer? 99 What is the fourth root of 1596 to the nearest integer? 6 What is the cube root of 55681 to the nearest integer? 38 What is the cube root of 491 to the nearest integer? 8 What is 2551 to the power of 1/8, to the nearest integer? 3 What is the fifth root of 23207 to the nearest integer? 7 What is the square root of 9767 to the nearest integer? 99 What is 3706 to the power of 1/10, to the nearest integer? 2 What is the square root of 1115 to the nearest integer? 33 What is the tenth root of 48374 to the nearest integer? 3 What is the square root of 444 to the nearest integer? 21 What is 84029 to the power of 1/2, to the nearest integer? 290 What is 590 to the power of 1/3, to the nearest integer? 8 What is the square root of 55236 to the nearest integer? 235 What is 3281 to the power of 1/2, to the nearest integer? 57 What is 5673 to the power of 1/3, to the nearest integer? 18 What is the third root of 10104 to the nearest integer? 22 What is 7930 to the power of 1/8, to the nearest integer? 3 What is 470 to the power of 1/2, to the nearest integer? 22 What is the seventh root of 41019 to the nearest integer? 5 What is the square root of 20193 to the nearest integer? 142 What is the tenth root of 58467 to the nearest integer? 3 What is the cube root of 5726 to the nearest integer? 18 What is 2124 to the power of 1/2, to the nearest integer? 46 What is 5093 to the power of 1/6, to the nearest integer? 4 What is the third root of 26378 to the nearest integer? 30 What is the cube root of 2718 to the nearest integer? 14 What is 1485 to the power of 1/2, to the nearest integer? 39 What is 1241 to the power of 1/2, to the nearest integer? 35 What is the third root of 55492 to the nearest integer? 38 What is the cube root of 770 to the nearest integer? 9 What is 10433 to the power of 1/3, to the nearest integer? 22 What is the square root of 23020 to the nearest integer? 152 What is 22627 to the power of 1/6, to the nearest integer? 5 What is 3879 to the power of 1/2, to the nearest integer? 62 What is 19550 to the power	{ "pile_set_name": "DM Mathematics" }
4 What is the value of (3/12)/(68/(-16))? -1/17 Evaluate ((18/(-5))/3)/(6/(-20)). 4 What is 1/(-15)(-80)/(-24)? -2/9 Evaluate (56/42)/((-4)/(-1)). 1/3 (1/3)/((-34)/(-510)) 5 What is the value of ((-1)/(-1)-2)/(-4)? 1/2 (4/12)/((-10)/90) -3 Evaluate 2/12-12. -1/3 Calculate (4/8)/(1/1)12. 6 What is 1/(-5)(-14)/(-35)-5? 2/5 Calculate (-1)/(-5)13. 3/5 What is ((-33)/(-66))/((-2)/(8/18))? -1/9 (40/(-15))/(10/(-15)) 4 Evaluate ((-4)/12)/((-5)/75). 5 What is 1/(1/((-3)/12-4))? 1 Calculate 6/(-30)(-6)/(-3). -2/5 1/2(-384)/48 -4 Calculate (17/(-170))/(1/(-4)1). 2/5 ((-2)/(-6))/((-15)/90) -2 What is the value of 0(-2)/(-2)24/(-48)? 0 Calculate (-2(-2)/16)/((-1)/(-4)). 1 3/(14/(140/(-6))) -5 ((-22)/(-198))/((-5)/15) -1/3 ((-84)/(-105))/(40/(-25)) -1/2 What is the value of (-1)/7(-24)/8? 3/7 What is (448/384(-3)/(-7))/(-1)? -1/2 What is the value of (023/(-6))/1? 0 What is (4/42-3)/(4/8)? -4/7 Calculate 55/44-61/(-5). 3/2 (((-585)/(-6))/13)/(23) 5/4 (9/(-33))/(108/24) -2/33 What is (28/350)/((-4)/5)? -1/10 Calculate ((6/3)/2)/(-1). -1 Evaluate (4/4-1)/(-5)-3. -3/5 Calculate -1(-18)/(-4)(-20)/15. 6 What is (64/(-200))/(6/15)? -4/5 What is 18/(-60)(-40)/15? 4/5 What is the value of 215/434/(-10)? -2 What is the value of (1/(-5))/((-9)/(-9)-1)? 1/5 What is ((-1)/3)/(((-63)/28)/(-9))? -4/3 5(-7)/525-10 2/3 22/(-44)-11 1 What is ((-1)/5)/(((-10)/(-1))/(-50))? 1 Evaluate (10/(180/6))/(1/(-21)). -7 What is 16/8(-1)/1? -2 Calculate (3/150)/((-2)/(-2)). 0 Calculate (-8)/6(-30)/140. 2/7 What is the value of (12/32)/(5/20)? 3/2 What is the value of (-18)/4-32/9? 3 Calculate (-15)/210-1411. 11 Evaluate (6(-1)/(-7))/(42/196). 4 (1/(-4))/((-3)/1205) 2 Calculate 2/(-14)2/(-1). 2/7 Evaluate 3/(-27)(-4)/2. 2/9 What is (-126/24)/(3/7)? -7 Evaluate (-9)/184(-2)/(-8). -1/2 What is the value of (10/4)/(8/(-16))? -5 What is ((-19)/(532/(-6)))/((-2)/(-4))? 3/7 ((16/(-3))/8)/((-8)/3) 1/4 36/(-432)(-16)/6 2/9 Calculate ((-24)/(-6))/(4/5). 5 What is (-1)/((-3)/3)4/(-1)? -4 Evaluate 4/(8/(-3))70/42. -5/2 Evaluate 4/(-42)((-112)/24)/(-2). -2/9 What is 2(12/16)/(-3)4? -2 Calculate 6/12(-1)/(-3). 1/6 Evaluate (-48)/121/(-12). 1/3 What is the value of 49(-2)/(-18)? 4 Evaluate 92/(-3)(-3)/12. 3/2 ((-2)/16)/(3/(168/(-49))) 1/7 ((-1)/((-10)/(-16)))/((-3)/15) 8 What is ((-2)/(-4)3)/((-15)/90)? -9 ((55/15)/11)/((-11)/(-3)) 1/11 ((-4)/(-180)-6)/((-2)/(-3)) -1/5 Calculate 3/((-238)/516/4). -3/7 What is the value of (-10)/(-24)1/(3/(-6))? -5/6 Calculate (-1)/(((-14)/4)/((-3)/3)). -2/7 What is the value of (21/14-1)/9? -1/6 (-1)/363/(-3) 7 What is the value of (4/(-6))/((16/(-3))/(-4))? -1/2 Evaluate ((-3)/21)/((-1)/(-6)). -6/7 Calculate ((-6)/15)/(9/90). -4 Evaluate ((-1)/(-4))/(165/792). 6/5 (-4)/(-114)-2112/168 -1/19 What is (8/(-88))/((-4)/22)-8? -4 21/(-3)90/(-378) 5/3 Evaluate (((-72)/3)/(-12))/(-2). -1 Evaluate (-183/(-18))/(6/(-16)). -8 What is the value of ((-2)/(-5))/(28/105)? 3/2 What is (4/((-24)/3))/((-1)/8)? 4 What is (3/(-16))/((-6)/6)? 1/2 Evaluate 1/((-25)/(-10))(-10)/2. -2 What is (44/(-22))/(-2(-2)/6)? -3 Evaluate 51/344/(-15). -2/5 Evaluate (7(-16)/(-1176))/(3/(-7)). -2/9 What is ((8/2)/12)/((-5)/(-20))? 4/3 What is the value of 5((-6)/(-56))/(5/(-4))? -3/7 3155/45 5 Evaluate 35/2195/(-15). -5 What is the value of (4/(-66))/(1/3)? -2/11 What is (((-252)/(-30))/7)/((-27)/(-180))? 8 What is the value of (6/15)/(-2(-4)/40)? 2 What is the value of (3/(-108)-10)/((-65)/(-39))? 1/6 Evaluate 147/21((-6)/(-3))/(-2). -7 (1/40)/(-2) 0 Evaluate 3(1/2)/(567/84). 2/9 What is (3/2)/((189/(-36))/(-7))? 2 What is (-47)/4710/(-18)-3? -5/3 Calculate 8/10(1035/234)/(-23). -2/13 ((-1)/21)/(7/(-2)) 1/7 ((-2)/((-12)/(-3)))/(3/(-24)) 4 What is the value of (3/(-14))/(16/56)? -3/4 What is (6/14)/((152/8)/(-133))? -3 Calculate ((-2)/(-8))/(1/2)2. 1 Evaluate ((-24)/(-9))/(-8)2. -2/3 What is 0/(24/((-24)/4))? 0 ((-96)/216)/((-10)/9) 2/5 Evaluate 6/(-8)(-128)/96. 1 Calculate (34/54)/(4/36). 2 What is the value of ((-575)/46)/(30/(-12))? 5 What is 3/(-3)((-306)/(-27))/17? -2/3 Evaluate 4/(40/15528/(-64)). -2/11 What is the value of -2((-18)/9)/(41)? 1 Evaluate 17/(-17)3/(-1). 3 Evaluate (((-2)/(-4))/(2/(-4)))/1. -1 (-4)/(-16)72/(-234) -1/13 36/4(-6)/(-18) 3 Evaluate ((-3)/(-66))/((-20)/(-80)). 2/11 What is the value of (-10)/(-12)(-174)/(-290)-14? -7 Evaluate (630/20)/7(-2)/(-3). 3 What is the value of (60/18)/101? 1/3 Calculate (5(-36)/135)/((-52)/6). 2/13 What is the value of 1/3(-6)/(-11)? 2/11 -41/(-12)9 3 Evaluate ((-9)/(-12))/(15/(-60)). -3 (3/12)/(17/(-816)-12) 1 Evaluate (6/8)/(57/(-19)). -1/4 What is the value of (0/17)/(4/(-8)4)? 0 Calculate (-2)/124/(-3). 2/9 What is (2/(-11))/(56/112)? -4/11 Evaluate (82/(-1435))/(2/10). -2/7 (-5)/20-4(-9)/(-63) 1/7 What is the value of 36/78(-7)/21? -2/13 -1(-4)/(-32)-2 1/4 What is the value of ((-120)/36)/((-4)/6)? 5 20/2(-61)/(-61) 10 Evaluate ((-7)/(-105))/((-7)/(-63)). 3/5 (-55)/(-66)1/5 1/6 What is (-5)/2(208/300)/13? -2/15 Evaluate 1/((-3)/(2/(-2)-1)). -1/3 Calculate ((-1)/2)/((-35)/42). 3/5 (-15)/5(-50)/225 2/3 What is the value of 8/(12/(-3))(-30)/(-30)? -2 ((-32)/4)/(((-54)/(-9))/6) -8 (31/(2604/8))/((-8)/(-7)) 1/12 Calculate (-3)/5275/165. -1 0/(-7)2/(8/1) 0 What is ((-6)/(-9))/(1/3)? 2 Calculate ((-32)/(-28))/((-18)/63). -4 (8/2)/(-4)4 -4 Evaluate 2/(((-12)/75)/((-6)/15)). 5 Evaluate (12/(-12))/((-1)/8). 8 What is the value of (9/(-36))/(1/20)? -5 What is (1/(-3))/((7/3)/7)? -1 Evaluate 5-2(-46)/(-92). -5 Calculate 21/(-30)(-64)/112. 2/5 What is the value of 2/((-4)/10)(-22)/22? 5 Evaluate (-1)/(-12)(-12)/(-4). 1/4 (-102)/17(-1)/69 2/23 What is (12/(-80)4)/(1/(-5))? 3 What is ((-6)/(-4))/(5/(30/(-21)))? -3/7 What is the value of (-1)/((-7)/(-112)8)? -2 What is (((-9)/(-3))/(-24))/(6/(-8))? 1/6 Calculate (6/1893)/(27/126). 4/9 What is 4((-14)/52)/(-7)? 2/13 What is the value of ((-12)/(-21))/((-20)/14)? -2/5 ((4/(-18))/(-2))/((-6)/(-45)) 5/6 Evaluate ((-14)/4)/(46/92). -7 ((-2)/24)/(1/(-2)) 1/6 What is the value of (-40)/101/(-4)-1? -1 (-8)/(-66)-481/216 -2/11 Calculate ((-21)/28)/(1/(-12)). 9 What is the value of (-2)/(-4)0/((-9)/(-3))? 0 What is the value of 0/(13/((-13)/2))? 0 What is the value of 432/90(-15)/(-12)? 6 Evaluate ((-76)/57)/(6/27). -6 What is -94/(-124)? 3/4 Calculate (8/(-14))/(1/(-7)). 4 Calculate (-65/(-90))/(7/(-126)). -6 What is the value of ((-384)/(-240))/(3/(-15))? -8 Evaluate ((15/117)/(-5))/(2/(-12)). 2/13 Evaluate (-26)/(-13)(-3)/271. -2/9 Calculate (4/(-4))/(14/4). -1 Calculate ((-2)/(-60)4)/((-59)/590). -4/3 1/(-10)335/134 -1/4 What is (-16)/(-48)15/(-10)? -1/2 What is ((-50)/(-100))/(2-1)? -1/4 What is the value of -1(-10)/(-105)6/(-4)? 1/7 ((-3)/(-21))/(7(-3)/(-63)) 3/7 653/(-30) -3 Evaluate (-3)/22/3. -1 Evaluate (7/7)/((-2)/4). -2 What is 2(-6)/(-12)-1-1? 1 Evaluate ((-2)/(-8))/((-5)/10). -1/2 What is ((14/12)/(-7))/((-83)/(-1245))? -5/2 What is the value of ((-18)/4)/((-15)/20)? 6 (16/(-48))/(6/(-18)) 1 What is ((-5)/20-4)/((-1)/(-3))? 3 What is ((-45)/(-10)24/306)/3? 2/17 Calculate 27/(-6)(-3)/(-18). -3/4 What is the value of (10/(-6))/((15/(-3))/15)? 5 What is the value of (6/(-5))/((-45)/150)? 4 What is the value of 2/1(-3)/(-39)? 2/13 (-3)/4(-1192)/3129 2/7 What is the value of (-2)/1818/3? -2/3 Evaluate 3/(-7)68/102. -2/7 Calculate 0/(-1)91/(-273). 0 ((-4)/(-55))/((-40)/100) -2/11 What is the value of ((1/1)/1)/((-1)/(-1))? 1 (5/((-490)/56))/((-4)/14) 2 What is (-9)/(27/(-2))-6? -4 Calculate ((-20)/6)/((-52)/(-78)). -5 ((-2709)/(-42))/(-43)20/6 -5 What is the value of ((-2)/(-6))/((-1)/9)? -3 What is the value of (-10)/(-2)(-3)/(-3)? 5 What is the value of (-2)/(-4)6/(-36)3? -1/4 Evaluate 42/(-12)-6. 4 What is 122/244(-4)/(-2)? 1 (8/6)/(2(-14)/(-7)) 1/3 What is the value of ((-21)/(-84))/((-1)/3)? -3/4 ((-6)/(-35))/(11/((-220)/(-12))) 2/7 Calculate 8/((-32)/10)(-18)/15. 3 What is (-693)/(-132)4/3? 7 Evaluate 45/15((-4)/(-6))/(-2). -1 What is (139/(-442))/(3/4)? -2/17 Evaluate (-9)/(-12)(-40)/15. -2 Calculate 1/(-12)13/((-52)/6). 1/8 Calculate 4/(12(-4)/(-36)). 3 Calculate -2-26/(-6). -4 50/(-40)*(-8)/5 2 Evaluate (286/	{ "pile_set_name": "DM Mathematics" }
-3. -828sqrt(11) + 15 Simplify -3 + (sqrt(1260) - (-3sqrt(1260) + sqrt(1260))-3)/(6-5(sqrt(7) + sqrt(112))). -3 + sqrt(5)/5 Simplify ((-1sqrt(300) - (2sqrt(588) + sqrt(588))) + (0 + sqrt(192) + -3 - (1 + -2sqrt(192))))2. 224sqrt(3) + 2368 Simplify ((sqrt(98)11 + -1 - 4((sqrt(98) - ((-2sqrt(98) - sqrt(98)) + -3 - sqrt(98))) + sqrt(98))) + -5 + 2)*2. 5152sqrt(2) + 52098 Simplify ((2 + sqrt(1700))56 + -6(-5 + sqrt(1700)2))*2 + 3. 32400sqrt(17) + 558903 Simplify 1 + ((3(sqrt(76) - (sqrt(76) - (sqrt(76) + 1sqrt(76) + 2) - sqrt(76))) - -1(1 + sqrt(76))5)1)2 + 1. 616sqrt(19) + 15019 Simplify -5 + (-2 + 1(-4 + 3-2sqrt(153) + ((sqrt(153) + -1 + sqrt(153))-1 - ((2sqrt(153) - sqrt(153)) + sqrt(153))-6)))*2. -120sqrt(17) + 2468 Simplify (2sqrt(2600) + sqrt(2600) + sqrt(2600) - sqrt(416)3)/((2sqrt(2016))/(sqrt(7) + 1sqrt(14)/sqrt(2))). 7sqrt(13)/3 Simplify (((2sqrt(448))/sqrt(8) - sqrt(56))/(-2sqrt(1152) + sqrt(1152)) + 0 + 3 + sqrt(126)/sqrt(2))21. 35sqrt(7)/2 + 9871/144 Simplify (sqrt(2448) - (1 + sqrt(2448) + 5)2 - (-6(-1 + sqrt(2448) + sqrt(2448)) + sqrt(2448))) + 2 + ((-1 + sqrt(2448) + 5)-5)2. 2400sqrt(17) + 59112 Simplify 5(-3 + ((3(3sqrt(85))/sqrt(5))2 + -3)-6 + 3). -41220 Simplify -6((4 + sqrt(175) + sqrt(175) + 0)2 - ((sqrt(175) - sqrt(175)-1)*2 + 0) - -6(1 + sqrt(175))6)-6. 1872 + 9360sqrt(7) Simplify (sqrt(66)/(sqrt(539) - (sqrt(539) - sqrt(539)2))-6)/(4sqrt(8)-1-3). -sqrt(3)/56 Simplify sqrt(85)/(sqrt(225)/sqrt(5) - sqrt(5))-5 - (sqrt(119)/(sqrt(14)/sqrt(2)) + (-1sqrt(204) + sqrt(204))/sqrt(12))4. -13sqrt(17)/2 Simplify (-6((sqrt(612)-2 - sqrt(612))-5 + -3 + 4 + (sqrt(612) - (sqrt(612) + sqrt(612) + 2 + sqrt(612) + 0 - sqrt(612)) - sqrt(612)) + -1)2)*2. -44928sqrt(17) + 14894208 Simplify 3(4 + ((sqrt(1053) + 1)-4 + sqrt(1053))*2 + 2(sqrt(1053)-1)2 + (sqrt(1053) - 2(sqrt(1053) + (sqrt(1053) - sqrt(1053)-1)))2). 648sqrt(13) + 113784 Simplify ((2 + sqrt(432)3 + -4(sqrt(432) - sqrt(432)-1) + -5)-6 + -3)*2. 10800sqrt(3) + 389025 Simplify (-2sqrt(85)-2)/(sqrt(720) - (sqrt(720)-1 - sqrt(720) - sqrt(720))) + -4(sqrt(17) + (sqrt(17) - 2sqrt(1700))) + 4. 4 + 865sqrt(17)/12 Simplify ((sqrt(95) + sqrt(95)-4)-3 + 5(sqrt(95) - (1sqrt(95) + sqrt(95)) - sqrt(95) - sqrt(95)))/(sqrt(245)2-3 - (3-2sqrt(245) + sqrt(245))). 6sqrt(19)/7 Simplify (4 + (sqrt(171) - (1sqrt(171)3 + sqrt(171)) - (sqrt(171) + sqrt(171)21))/(sqrt(900)-2-5 + sqrt(900))-1)*2. 24sqrt(19)/55 + 48571/3025 Simplify -1 + (((sqrt(456) - -44sqrt(456))/sqrt(12))/(sqrt(288) + (sqrt(2) - (sqrt(18)2)/sqrt(9)) + sqrt(2)))2. 5347/144 Simplify (2 + -4(sqrt(432) + 53sqrt(432)) + 6(sqrt(432) + (sqrt(432) + (sqrt(432) - (-1 + sqrt(432))) + sqrt(432))-2 + sqrt(432) + -5 + sqrt(432) + 1))*2. 57120sqrt(3) + 2117956 Simplify (3 + -3((sqrt(1088) - (-4 + 3sqrt(1088))) + 4 - (-2 + 4(sqrt(1088)1 + sqrt(1088) + sqrt(1088)))))*2. -18144sqrt(17) + 1919961 Simplify ((sqrt(2268) + (0 + sqrt(2268))6 + sqrt(2268) + sqrt(2268) + (sqrt(2268) - (6sqrt(2268)-2 + sqrt(2268))) + -3 + sqrt(2268)-1 + -5)5)2. -144000sqrt(7) + 22681600 Simplify ((sqrt(468) + 5(sqrt(468) + -2sqrt(468)) + sqrt(468) + sqrt(468))/((2sqrt(45))/sqrt(5)))/(2sqrt(16)/(sqrt(980)/sqrt(5) - sqrt(4))). -3sqrt(13) Simplify -5 + -3((1sqrt(833)4 - (-4 + sqrt(833) + -1))-5)2. -564155 - 15750sqrt(17) Simplify -1 + (2(-1 + sqrt(243) + -2 + -4(sqrt(243) - (3 + sqrt(243)))))*2 + -2 + 4. 648sqrt(3) + 1297 Simplify (sqrt(1008) - (sqrt(1008) - (-4sqrt(1008) + sqrt(1008))) - sqrt(1792)4)/(5sqrt(400)-1-6). -sqrt(7)/6 Simplify 6(((sqrt(38)/sqrt(2)-6)2 + -3)-3 + 4(1 + sqrt(931) + -1)). -12258 + 168sqrt(19) Simplify -2(1sqrt(756)-2 - (-2-1sqrt(756) + sqrt(756)))/(sqrt(48)/(sqrt(4) - (sqrt(4) - (sqrt(4) - 2sqrt(36))))). -150sqrt(7) Simplify (-2(1 + sqrt(245) + 4 - (-2 + (sqrt(245) + -1 - sqrt(245)))))2 + (0 + 2 + -5 + sqrt(245) + -1)2. 392sqrt(5) + 1497 Simplify ((sqrt(396) - 1sqrt(396)-4)/(sqrt(11) - (sqrt(11) + (sqrt(33)-2)/sqrt(3))))/((51sqrt(1452) + sqrt(1452) + sqrt(1452) - sqrt(1452))-5). -sqrt(3)/132 Simplify (-5 + ((sqrt(637) - (sqrt(637) - -3sqrt(637) - sqrt(637))) + 4 + sqrt(637) - sqrt(637)))*2 + ((-51sqrt(91) + sqrt(91))/((sqrt(49)2)/sqrt(7)))*2. 28sqrt(13) + 2601 Simplify -3 + (((sqrt(22) + -1sqrt(22))-5)/(sqrt(55)/(sqrt(20)/sqrt(4))))*2 + (5 + 3 + sqrt(2) - (-1sqrt(72))*2) + -3. -70 + sqrt(2) Simplify 5(1 + 5 + sqrt(637)2 - (51sqrt(637) - (sqrt(637) - (sqrt(637) - -2sqrt(637))-3)))2. 2940sqrt(13) + 156245 Simplify (3(-4 + (sqrt(396) - -4(2 + sqrt(396)))-6 + (1 + -2sqrt(396) + sqrt(396) - (sqrt(396) + (sqrt(396) - sqrt(396)-2) + sqrt(396) + 4))))22. 427680sqrt(11) + 9292338 Simplify ((sqrt(4400) - sqrt(4400)-1)*2-6 + (-5 + sqrt(539)1 - -5(2sqrt(539) + sqrt(539)))2)-5. -162045 + 5600sqrt(11) Simplify 4 + 6(-1(-5 + sqrt(68)-1 + sqrt(68)))*2 + 4 + -3 + (-5(sqrt(68) - (-2 + sqrt(68))))*2. 255 Simplify -31(51(sqrt(1152)-2 - sqrt(1152)))/(((sqrt(240) + -2sqrt(240))/sqrt(10))/(1sqrt(294) - sqrt(294) - sqrt(294))). 3780sqrt(2) Simplify (-4 + -2 + (4 + sqrt(2736) + sqrt(2736))-1 + (sqrt(171)/sqrt(1089) - sqrt(19)) + sqrt(1539) + -4 + sqrt(19))*2. 4592sqrt(19)/11 + 534740/121 Simplify -2 + (-5 + sqrt(500)-1-2 + 5 - ((sqrt(500) + -3 - sqrt(500))*23 - ((sqrt(500)-2 + -3)2 - sqrt(500)))). 130sqrt(5) + 1980 Simplify 6((sqrt(3645) - (sqrt(3645) + -1))2 + sqrt(3645) + 5 + (sqrt(3645) - (4 + sqrt(3645) + 3)2))-5 + -3. 9720sqrt(5) + 110637 Simplify (4(sqrt(240) + (sqrt(240)3 + sqrt(240) - sqrt(240) - sqrt(240)) + sqrt(240) + sqrt(240)))/(-4(sqrt(5) + sqrt(1620))) + -2. -2 - 20sqrt(3)/19 Simplify ((sqrt(4608)-1)/(-3sqrt(200)))/((sqrt(4) + (sqrt(120)/sqrt(3))/sqrt(10))/(3sqrt(162))). 54sqrt(2)/5 Simplify 2(((-3sqrt(432))2-1 - -3-2sqrt(432))-1 + 1). 144sqrt(3) + 7778 Simplify 4 + 2sqrt(175) + sqrt(175) + 0 + sqrt(175)1 - -6(sqrt(175) - (3sqrt(175))*2)-5. -130sqrt(7) + 47254 Simplify ((sqrt(500)-1-5 + -2)3)*2 - (-66-2(sqrt(500) + sqrt(500) + 1 + sqrt(500)))*2. -23220648 - 312840sqrt(5) Simplify (1 + -2sqrt(612) + (sqrt(612) + -3)5 - (sqrt(612) + -1sqrt(612)-2 - (-3 + 2sqrt(612)))1)*2. -408sqrt(17) + 2737 Simplify ((sqrt(20) - sqrt(20)4)-3 + sqrt(2000)2)/(sqrt(12)/((sqrt(30)/sqrt(5))/sqrt(2))3). 29sqrt(5)/3 Simplify ((-2 + (-2 + sqrt(1331) + -1)-5 + -3 + -3)-6)2. -27720sqrt(11) + 1199664 Simplify (sqrt(13) + 2 + -5 - (-3sqrt(39))/sqrt(3))-4 - (sqrt(52) + sqrt(4212)3 + sqrt(4212))/(sqrt(4)-11). 12 + 21sqrt(13) Simplify ((-4(-3sqrt(2057) - sqrt(2057))2 - 2((sqrt(425) - (sqrt(425) + 5 + sqrt(425))) + -5 - sqrt(425) - sqrt(425) - sqrt(425))) + 1)*2. 16464sqrt(17) + 2612729 Simplify -3((3((2 + sqrt(468))2 + sqrt(468)))2 + -1 + (3-3sqrt(468) - sqrt(468))). -114153 - 3708sqrt(13) Simplify 3 + (3 + -4sqrt(72)5 + sqrt(72) + 3(sqrt(72) - (sqrt(72) + 2sqrt(72))) + sqrt(72) + -1)*2 + -3. -576sqrt(2) + 41476 Simplify -6(5 + sqrt(136)/(sqrt(512) + sqrt(512) + (sqrt(512) - -5sqrt(512)) - sqrt(8) - sqrt(8)) + 1) + 3. -33 - 3sqrt(17)/31 Simplify ((sqrt(132) + sqrt(132)1 + sqrt(132))-1 - -4(sqrt(132) - (sqrt(132) - -3sqrt(132))))/(sqrt(768)6 + sqrt(12) + 53sqrt(12)). -15sqrt(11)/64 Simplify (sqrt(1980)1 + -1sqrt(2695) + sqrt(55))/((-2sqrt(110)-6)/((sqrt(1210)-2 - sqrt(1210)) + sqrt(10))). 0 Simplify (((0 + sqrt(99))-3)2 + (1 + sqrt(99) + 2)2)1 + (2sqrt(99) + -5 - sqrt(99)) + sqrt(99) + -2 + 3. 24sqrt(11) + 995 Simplify (-5 + (3 + -2 + (0 + -1 + sqrt(637) - sqrt(637) - sqrt(637)) + sqrt(637) - (3 + sqrt(637) + 1 - (sqrt(637) + (sqrt(637) + 2 + sqrt(637))3))))2. -252sqrt(13) + 22941 Simplify (-5 + (-2sqrt(637) + -2)2)6-135. 810 + 2520sqrt(13) Simplify ((sqrt(136) + sqrt(136) + 1sqrt(136)-4)23)/((sqrt(8)-1 + sqrt(8))3 + sqrt(16)/sqrt(2)3). -4sqrt(17) Simplify ((0 + sqrt(1216) + -2 + sqrt(1216) + sqrt(1216) + 1 + 0)-1)*2-6. -65670 + 288sqrt(19) Simplify 4((-5 + (sqrt(304) - sqrt(304)1) + sqrt(304))-1-2)2-5. -26320 + 3200sqrt(19) Simplify (1 + (sqrt(114) + (sqrt(114)-1-5 - sqrt(114)) - -1sqrt(114)*5)/(	{ "pile_set_name": "DM Mathematics" }
2. Let b(y) = y*3 - 9y*2 + 9y - 2. What is the least common multiple of b(8) and i? 6 Let s = 19 - 3. Let j be 2/9 - s/72. Let o(a) = -a3 + a2 + a + 11. What is the smallest common multiple of o(j) and 9? 99 Let r = 245521/8050 + 2/4025. Let j = 2000 - 18058/9. What is the common denominator of j and r? 18 Let v = 2/8605 - 20997/3442. What is the common denominator of v and -107/12? 60 Let q = 3830257/172 - 22269. What is the common denominator of q and -67/20? 860 Let y be 3 - (-4 + (-322611)/(-57255)). Let j = y - 3/1735. Let u = -135511/12 - -11284. Find the common denominator of j and u. 132 Find the common denominator of 7 + -8 + (-2)/10-3 and 56/11. 55 Find the common denominator of -29/52 and (3 + 0)/(-9) + 7650/12744. 3068 Suppose 5a - 269 = 2y - 44, 0 = y + 2a + 108. Let h = 13534 + -135219/10. Find the common denominator of y/(-8)(-2)/(-2) and h. 20 Suppose -2c + 54 = -2i, 4c + 23i = 21i + 138. Calculate the lowest common multiple of 186/9 + (-4)/6 and c. 160 Suppose 3s + 11 = 29. What is the least common multiple of s and 4? 12 Calculate the common denominator of 16/21 and 336238/47334 - (-1 + 8). 483 Let s(c) = -11c + 15. Calculate the lowest common multiple of 20 and s(1). 20 Let o(p) be the third derivative of -p6/120 - p5/20 - 3p2. Let v be o(-2). What is the common denominator of -19/10 and -2 - (-2)/(v/43)? 10 Suppose 2f - 6f + 48 = 0. Suppose 4n + p - 17 - 46 = 0, -n = 3p - 13. Calculate the least common multiple of f and n. 48 Let q = -1/450 + -1057/225. Calculate the common denominator of q and ((-10)/(-275))/(4/(-85) - 0). 110 Find the common denominator of (-346)/(-192)1 - (-3)/(-9) and -101/60. 480 Let k(r) = 3r. Let c(p) = 11p - 1. Suppose 0 = -0d - 3d + 36. Let f(t) = dk(t) - 3c(t). Calculate the lowest common multiple of 4 and f(2). 36 Let b = -5273/20 + 515/2. What is the common denominator of -47/30 and b? 60 Suppose 4g = -0g + 8. Suppose -r - 3r - 5z = -8, 0 = gz. Suppose -ry - 2 = 4p - 12, p = -y + 4. What is the least common multiple of p and 8? 8 Let x(k) = -31k*2 - 219k - 10. Calculate the lowest common multiple of 11 + 2 - (2 - 0) and x(-7). 44 Let c = 316955 - 53248277/168. What is the common denominator of -115/48 and c? 336 Suppose -m + 39 = -3g, 5m + g - 247 = 3g. What is the lowest common multiple of m and 9? 153 Let x be ((-801938)/75)/((-24)/30). Let g = x + -13364. Find the common denominator of 62/27 and g. 270 Suppose a = 5r - 67 - 20, 2r - 3a - 27 = 0. What is the lowest common multiple of 90 and r? 90 Let v = 2677/6 + -53483/120. Calculate the common denominator of v and 8/55. 440 What is the lowest common multiple of 30/6 - (10 - 27) and 108? 1188 Find the common denominator of -7/22 and (62/4)/(604/4). 3322 Let m be 2/(-4)218. Calculate the common denominator of m/180(-110)/8 and 79/22. 132 Calculate the common denominator of (1/136)/((-54)/(-2196)) and -11/12. 204 Suppose -140 = -3j + 139. Let g = j - 83. Calculate the lowest common multiple of 6 and g. 30 Let k = -4590/13 + 101383/286. What is the common denominator of k and (154/6)/(744/(-36) - -14)? 220 Suppose 20y - 19y = 410. Let g = y - 1. What is the common denominator of 13/6 and (-6)/(-15) + g/(-110)? 66 What is the least common multiple of 7/(105/120) - (1 + -1) and ((-4)/(-6))/(2/12)? 8 Let s = -2191 - -777807/355. Let h = 25931/2840 - s. Find the common denominator of h and -54/11. 88 Suppose -5p = d - 6d + 45, 0 = 4d + 3p - 36. What is the smallest common multiple of 54 and d? 54 Suppose -u - u + 20 = 0. Let j(h) be the second derivative of -h*5/20 + 11h*4/12 - 4h*3/3 - 5h*2 + 6h. What is the least common multiple of j(10) and u? 10 Let c = -159189/16120 + 1/4030. Let y be (-16491)/(-432) + (-3)/(-9). Let i = y - 681/16. What is the common denominator of i and c? 72 Let l be (-1)/2 - 18120/945. Let i = 149/7 + l. Calculate the common denominator of i and -125/6. 18 Let z(b) = -2b2 - 6 - b + b2 - 8b. Calculate the least common multiple of z(-6) and 93/6 - (-4)/8. 48 Let i = -30 - -74. What is the smallest common multiple of i and 40? 440 Let l = 719 + -267. Let y = -5365/12 + l. What is the common denominator of ((-84)/(-30))/((-18)/(-20)) and y? 36 Let n = -3234 + 77633/24. What is the common denominator of n and 3/160? 480 Let v = 579 - 1675/3. Find the common denominator of v and 87/16. 48 Let j be 5 - 12/4 - 2. Suppose j = q + 13 - 8. Let z = q - -14. What is the lowest common multiple of z and 1? 9 Let n = -46477/10 + 4643. Let z = -2/1293 - -6902/3879. Calculate the common denominator of z and n. 90 Suppose 4g = -2u + 6 + 6, -26 = -5g + 3u. Suppose o = -2o + 12. Suppose 5s - o = gs. Calculate the least common multiple of s and 7. 28 Suppose a + 153 = r + 2r, 0 = -2a + 2r - 290. Let q = a + 81. Let w = -40 - q. What is the least common multiple of 11 and w? 220 Let f = -24 - -35. What is the smallest common multiple of f and 3/18 + 325/30? 11 Suppose -2m - 2j = -6j + 18, 5m - 3j + 24 = 0. What is the common denominator of (-45)/(-33)2/m and (-112)/(-24)27/(-12)? 22 Suppose 2058f = 2052f + 162. Calculate the least common multiple of 540 and f. 540 Suppose 188 = 3x + 20. What is the lowest common multiple of 88 and x? 616 Let f be ((-70)/(-15))/(4/6). Suppose 3x = fx - 4. What is the lowest common multiple of 22 and -6 + 7 - (x + -16)? 176 What is the common denominator of 51/44 and (7/(-28))/(-3 + 494/166)? 88 Suppose -3k - 3 = 0, -3o - 49k + 46k = -213. What is the lowest common multiple of 180 and o? 360 Suppose -4m - 40 = -4s, 2s = -3s - 3m + 66. Find the common denominator of 2 - (855/s)/3 and (25/(-24))/(3/(-12)). 12 Let h = -397293/7 - -3041739/56. Let z = 2450 + h. Calculate the common denominator of z and (-1)/(1/48) - 2. 8 Let q = 167 - 150. Suppose q - 53 = -2k. Calculate the least common multiple of k and 10. 90 Suppose 0 = 38f - 697 + 241. What is the smallest common multiple of f and 80? 240 Suppose 4o - 827 - 1273 = 0. Calculate the smallest common multiple of 5 and o. 525 Suppose -2c = -0c - 2o - 512, -4c + 1024 = 5o. Suppose 3n - c = -4r, -3r + 0n = n - 192. What is the least common multiple of 4 and r? 64 Let x(d) = -d2 - 5d - 4. Let w be x(-4). Suppose 28g - 30g + 20 = w. Let m = -2 + g. Calculate the least common multiple of m and 6. 24 Suppose -7u = -2u - 10. Let b be (-2)/(u - 153/75). Calculate the common denominator of 95/6 and 11/(-22) - b/(-7). 42 Let p = 2351 - 28231/12. Find the common denominator of p and 39/2. 12 Let s(j) = -27j - 173. What is the least common multiple of s(-9) and 63? 630 Let z = 2598 + -28532/11. Calculate the common denominator of z and 55/4. 44 Let f(w) = -9w + 71. What is the smallest common multiple of f(2) and 3? 159 Let l = 9020 + -108347/12. What is the common denominator of l and 1/92/(-4)? 36 What is the common denominator of -1 - 78/(-4) - (2 - (2 + -2)) and ((-29)/(-4))/(-7 - -1)? 24 Let x = 464777/462 + -7032/7. Calculate the common denominator of x and -139/66. 66 Calculate the lowest common multiple of -36/36 + (-181)/(-2) and 18. 90 Let w be (-2540)/(-641) + 20/(-5). Let q = -24896/19871 + w. Find the common denominator of q and 13/10. 310 Suppose -106 = -5b - 2p, 0 = 5b - b - 3p - 94. Let y = -10 - -22. Calculate the lowest common multiple of b and y. 132 What is the common denominator of 246/324 - (-1)/(-1) and 1/(-6)148/(-10)? 270 Let f = -3 - -4. Let c(a) = -3a*2 - 129a + 271. Calculate the smallest common multiple of c(-45) and f. 1 Suppose 10 = 2i, 4k - 245 = 6i - 3i. Let d be k/(-39) - 2/6. Find the common denominator of d/8 + 7-2 and -79/6. 12 Suppose -8g + 490 = -3g. Let a(n) = n + 17. Calculate the lowest common multiple of a(-13) and g. 196 Let o(k) be the second derivative of -k5/20 + k4/3 + 5k*3/6 + 2k*2 - 4k. What is the lowest common multiple of 12 and o(5)? 12 Let y = 38/909 + -37043/9090. What is the common denominator of -86/21 and y? 210 Let t = 24 + -66. Let v = -32 - t. What is the least common multiple of 14 and v? 70 Let m = -14 - 35. Let c = -41 - m. Calculate the least common multiple of 2 and c. 8 Let o = -17 + 47. Let p = 31 - o. What is the smallest common multiple of p and 2? 2 Let	{ "pile_set_name": "DM Mathematics" }
) - (-4 + -4)? 23 Calculate 14 + -8 - (0 + 14). -8 What is (12 + -2 - -1) + -8? 3 What is 57 + (-32 - (17 + -29 + 0))? 37 Calculate (-8 - 3 - (25 + -12)) + (5 - 3). -22 Evaluate -12 + 5 + 0 + 6 - 7 - -17. 9 7 - ((-9 + 16 - 1) + -21 - -8) 14 11 - (56 + -24) - -27 6 Calculate 4 - (10 - -6 - -8) - -8. -12 (-18 - -11 - 2 - -16) + -37 -30 Calculate -29 - (-10 + (-6 - -9) - 4). -18 Calculate -1 - (1 - -15) - (-138 + 137) - -10. -6 What is the value of -4 + (-22 - -39) + 1 + -7 + -8? -1 Calculate (7 + -2 + 2 - 3) + -6. -2 Calculate 0 - (0 - (-11 + 13 + 12)). 14 17 - (-28 - -20 - (0 + -1)) 24 What is 21 + -40 - (-13 + 9)? -15 What is the value of (-9 - -28) + -13 + 1? 7 What is (5 - (-3 + 3)) + 0 + -3? 2 Evaluate -6 + (17 - 9) + 4. 6 What is 2 - -24 - (-9 + (-1 - -1 - -7))? 28 -16 - (7 - 0 - 13) -10 Evaluate -186 - -160 - (0 + -5). -21 What is the value of -10 + -2 - (5 - 1 - 4)? -12 What is the value of (4 - 5) + 6 + (1 - -8)? 14 What is 9 - ((-4 - -3) + (-3 - -13))? 0 0 + 5 + (7 - 9) + -5 -2 Evaluate 4 + -1 + 3 - 1 - (-1 + 3). 3 What is 0 - -3 - (-2 - -26 - 24) - 2? 1 23 - 6 - -5 - (-2 - -10) 14 What is the value of 16 - (1 + -3 + 1 - (9 + -13))? 13 What is -199 - -207 - (2 + -10)? 16 Evaluate 244 + -229 - (4 + 26). -15 (-21 - (-12 - -13)) + 34 12 Evaluate (1 - -10) + (-309 - -300). 2 8 - ((3 - 4) + 3 + 7) - -3 2 Calculate -108 + 90 + (-9 - (-3 - 4)). -20 What is the value of (12 - (15 - -1)) + 2? -2 What is 12 - (10 + -7) - 17 - -15? 7 Calculate -7 + 10 + -9 - -9 - (-3 - 9). 15 Evaluate 11 - (7 + -11 + 13). 2 What is -12 - (-8 - -5) - 2? -11 (-5 - (0 + -9)) + -1 - (7 - -9) -13 3 + 2 + -5 - (15 + -4) -11 What is the value of -6 + 7 + 17 + -36? -18 -18 + -1 + 1 + -1007 + 1020 -5 What is the value of (-9 - -10 - 4) + 9 - -5? 11 (7 - -2 - -21) + -19 11 What is the value of -11 + (4 - 0 - -6)? -1 (-4 - -4) + (-8 - -16) + (5 - 7) 6 What is 405 + -405 + 16 + -1? 15 What is the value of -34 - -5 - 23 - -38? -14 28 + (5 + -10 + 12 - 18 - -16) 33 What is the value of (-12 - (2 + -8) - -16) + -17? -7 -10 - (53 + -49 + (-42 - (0 - 1))) 27 Calculate 12 + (-18 - (-17 - -8)). 3 Evaluate 6 - 16 - -19 - (0 - 4). 13 Evaluate (9 - 4) + 2 + (-3 + 5 - 23). -14 Evaluate 10 + (22 - (10 - -6)). 16 What is 15 + -13 + 0 - (9 + 0) - 21? -28 What is (-6 - -13) + 2 + -6? 3 Evaluate 3 - (-12 + 33 - 34). 16 Evaluate (2 - (15 + (17 - 33))) + -15. -12 What is 14 + -3 + 5 + -2? 14 What is -519 - -548 - (-2 + -1)? 32 What is (-7 - (-8 + 3 + 0)) + 23? 21 What is -10 + (3 - (13 - (1 - -15)))? -4 Calculate -4 - (1 + (0 - -8) - (516 - 511)). -8 Calculate -8 - (15 + 6 - 12 - 15). -2 Evaluate 0 + -12 + 12 + 2 + -2. 0 Calculate 8 + 0 - (-19 + (-27 - -11) + 30). 13 What is the value of 8 + 2 + 0 + -436 + 406? -20 (-54 - (28 + -52)) + 36 6 Calculate (2 - 16 - (-51 - -43)) + 1 + 23. 18 What is 28 - 32 - -7 - (2 - 14)? 15 Calculate -5 + 32 - (1 + 6) - -4. 24 Evaluate (-8 - (10 + -23)) + -3 + 1 + 7. 10 What is (-24 - (22 + -40)) + -1 + 3? -4 Evaluate -10 + 2 + 22 + -4 + -3 + 5. 12 Evaluate -11 + (7 - -4) + -6. -6 Calculate (-2 - (1 - 2)) + 44 + -47. -4 What is 9 - -1 - (99 + -103) - 39? -25 -2 - (-7 - (14 - 28)) -9 What is (5 - -2) + -2 + -13 - (4 + -4)? -8 What is the value of 10 + 17 - 35 - (0 - 20)? 12 -21 - (-14 - -36 - 2 - (0 - -11)) -30 Evaluate -6 - (5 - (-3 - -13)) - (1 + 1). -3 (6 - (4 + 5)) + -8 + -5 + 5 -11 6 + 17 + (-6 - 29) -12 Evaluate (4 - 9) + (-11 - -8) + 16 + 3. 11 -40 + 10 + 20 - (0 - -11) -21 Evaluate -1 + (-6 - -13) + -24 + 4 + 3. -11 What is (6 - (-11 + 13) - (-5 - 1)) + -49? -39 What is the value of -1 - 7 - ((-38 + 9 - -16) + -15)? 20 Calculate 0 + -12 - (-24 + -10 + 37). -15 What is -379 + 383 + (-1 - 2)? 1 What is (2 - 3 - -1) + 7 - (-637 + 651)? -7 Calculate 6 + (-15 - (2 + -10)) - 11. -12 What is -3 + -14 - (-3 - (17 - 13))? -10 5 + 3 - (-8 + 6 + 4) 6 Calculate -21 + 1 + -9 + (-7 - -14). -22 Calculate (-2 - 21 - (-2 + -3)) + 3. -15 Evaluate 127 - 119 - (-19 - -2). 25 What is the value of (-29 - -1) + -4 + 2 + (-670 - -675)? -25 (59 - 81) + 6 + -2 -18 Evaluate -120 + 119 + (1 - -18). 18 Evaluate 19 - (46 + -18) - 3. -12 What is the value of 14 + 12 + -29 - -15? 12 0 - (6 - 9) - 15 -12 (3 - (1 + -4 + 6)) + (49 - 68) -19 What is (15 - 35) + 15 + (1 - -19)? 15 Evaluate 18 + -12 + -1 + -7. -2 Calculate 12 - (-30 + (8 - 0)). 34 (-1 - -17) + -195 + 197 18 (-485 - -470) + (2 - 4 - -18) 1 Calculate (0 + -2 - 4) + (-41 - -27). -20 Calculate 5 - 0 - (-7 - (11 - (-14 - -20))). 17 Evaluate (1 - 8) + 13 - -3 - 0. 9 What is 10 + (3 - 34) + 19? -2 What is the value of (-23 - (-43 - -15)) + (10 - -1)? 16 (-7 - (6 + -22)) + -8 - -9 10 Calculate 5 + (-7 - 2) + -3 + 2 + 3. -2 What is the value of (72 - 70) + 0 + -10 - -6 - -8? 6 What is 4 + (3 - 1) - (-6 - (-13 - 9))? -10 Calculate 7 - ((7 + -3 - -15) + 8 + -9). -11 -9 - (33 - (-1 + 14)) - -11 -18 (17 - 20) + (4 - 13 - (-6 + 0)) -6 Calculate 3 + (4 - 15) + -6. -14 What is 18 + (-24 - -16 - 9)? 1 What is the value of -22 + 14 + 20 + -18? -6 What is -1 + -15 - (195 + -218)? 7 Evaluate 51 - (61 + -39 - -3). 26 (0 - 24) + (-254 - -259) -19 What is 32 + (-6 - (12 - 3) - (-12 + 9))? 20 4 + -14 - (-193 + 183) 0 What is -3 - 20 - (-52 - -35)? -6 What is -6103 - -6099 - (-2 + -11 + -1 + 0)? 10 What is (1 - (-14 + 37)) + 12? -10 15 - (-6 + (1 - -10)) 10 3 + (-1 - 15) + 2 -11 Evaluate 1 + 2 + -9 + 3 + 229 + -224. 2 Calculate 19 + 81 + -34 + -42. 24 Calculate (6 - (-9 - -2)) + -7 + 15. 21 5 + -4 + 5 + 2 - (-16 - -31) -7 What is the value of -36 - (24 - 40 - -9 - (1 + -2))? -30 Calculate -32 + (0 - -11) + -1 + (43 - 43). -22 5 - 13 - (-4 - (3 + (-8 - -4))) -5 What is the value of (-35 - 0) + -141 + 162? -14 Evaluate -12 + 5 + (-2 - -43) + 3 + -8. 29 What is the value of 7 + (8 - -1 - (19 - (7 - 5)))? -1 -1 + (33 - (-6 + 27)) 11 Evaluate 23 + -1 + (166 - 201). -13 Evaluate (-78 - -72) + 4 + -4. -6 14 - 9 - (-21 - (-32 - 4)) -10 What is (-9 - -1) + 12 + -8 - (4 + 5)? -13 What is the value of (0 - (-1 + -10)) + (-127 - -110)? -6 What is -7 + -5 + 10 + 0 + 0 + 8? 6 Evaluate -3 + (0 - (2 + 4 + -8) - 4). -5 Calculate -4 + -1 + 11 + (8 - (1 - -8)). 5 Calculate -12 - -10 - -12 - (3 + -4 - 12). 23 Calculate 6 - (1 - 3 - (-4 - (4 + -5))). 5 Calculate (2 - 0) + 4 + -4 - (-23 + 41). -16 What is -86 + 66 + (2 - -2)? -16 What is the value of (2 - 7) + 2 + (5 - 0) + -6? -4 Evaluate 2 + (-27 - -22) + 26. 23 What is (-5 - -7 - -13) + -32? -17 What is 21 + 0 + -5 + -7 + (-7 - -8)? 10 Evaluate (18 - 24) + -11 + 8. -9 What is 1 + ((-5 - -3) + 1 + -3 - -1)? -2 -42 - (66 + -100) - (2 + -1) -9 What is the value of -324 + 327 + (-1 - -5)? 7 Calculate 3 - (-16 + 7 - -6). 6 Calculate 9 - (5 - 2) - (0 + -4). 10 What is 16 - (-7 - -2 - -9) - (13 - 6)? 5 Calculate -2 - (37 + (-5 - 15)). -19 Evaluate (20 + 10 - 13) + (3 - 6). 14 -12 - (24 - (92 - 20)) 36 What is the value of 38 + -2 - (87 - 43)? -8 Calculate 3 + -1 + 7 + 309 + -325 - 4. -11 Calculate -2 - -6 - (-93 - -90). 7 What is the value of -7 + (28 - 7) + (22 - 31)? 5 Evaluate 1 + 6 - ((-1 - 7) + -5 + 13). 7 Calculate 12 - (-12 + (28 - 13)). 9 (50 - 42 - 19) + 8 -3 (7 - (0 - (-11 - -9))) + -13 + -15 -23 Calculate -2 + (-15 - 0) + (7 + 2 - 6). -14 (10 - (-6 - (-5 + -7))) + -14 + 3 -7 (85 + -90 - (-1 - 2)) + -4 -6 -6 + -2 + (-20 - ((-67 - 5) + 18)) 26 What is the value of -13 + 2 + (15 - (-50 - -30))? 24 Evaluate -12 + (2 + 0 - (7 + (-10 - -4))). -11 What is the value of 3 + -1 + (9 - -15 - 14)? 12 -22 - (-10 - -1) - -22 9 What is 1708 + -1679 - (1 - -40)? -12 Evaluate -5 + 15 + -1 + -11. -2 Calculate -15 - (22 + -42) - -5. 10 Calculate 4 + (-4 - -12 - 6) + -13 + -1. -8 Evaluate 0 + -8 - (13 + -6 + -3). -12 What is -17 - (-27 - (-37 - -17))? -10 What is 2 - -2 - (-1 + -12 + 20)? -3 What is the value of -3 - 10 - -10 - -7? 4 -6 - -4 - (-29 + (-10 - (-7 - 10))) 20 What is the value of 0 - (4 + -1) - (-13 + 14)? -4 Evaluate 24 - (47 - (3 + 13)). -7 What is the value of 4 - -4 - (2 - (1 + -7))? 0 What is 5 - (7 - 5) - (-16 + -2 - -22)? -1 Calculate (24 - (1 + 6)) + -41. -24 What is the value of 45 + (18 - 84) + (-1 + 1 - 1)? -22 What is (-152 - -151) + 5 + (-1 - -1)? 4 What is the value of -8 - ((3 - 0) + 11)? -22 Evaluate (4 - -1 - (0 + -4 - -4)) + -6. -1 Evaluate -27 - ((-59 - -39) + 12 + -1). -18 What is (-30 - (38 + -88	{ "pile_set_name": "DM Mathematics" }
-572769300 rounded to the nearest one million? -573000000 What is -81246.98 rounded to the nearest ten thousand? -80000 What is -164207690 rounded to the nearest 1000000? -164000000 What is 0.0001366681 rounded to seven dps? 0.0001367 Round 7441.75 to the nearest one hundred. 7400 Round 0.0044868776 to four decimal places. 0.0045 What is -9.28938 rounded to zero decimal places? -9 Round -366.1723 to zero dps. -366 What is -0.34139983 rounded to 4 dps? -0.3414 Round 10824.9357 to the nearest 10. 10820 What is -16006400 rounded to the nearest one million? -16000000 Round 0.8018388 to 3 decimal places. 0.802 Round 8.745071 to one dp. 8.7 What is 5933.119 rounded to the nearest one hundred? 5900 Round 7.76818 to one decimal place. 7.8 What is -0.01987044 rounded to two dps? -0.02 What is -0.053837 rounded to three decimal places? -0.054 Round 84071.7 to the nearest 1000. 84000 What is -139001000 rounded to the nearest one hundred thousand? -139000000 Round 0.1888335 to 4 decimal places. 0.1888 What is -1294.101 rounded to zero decimal places? -1294 What is -50298460 rounded to the nearest one million? -50000000 What is -202283700 rounded to the nearest one hundred thousand? -202300000 What is -0.0000002209751 rounded to 7 decimal places? -0.0000002 What is -23.9356 rounded to one dp? -23.9 Round -736340.1 to the nearest ten thousand. -740000 What is -17043500 rounded to the nearest one million? -17000000 What is -48170071 rounded to the nearest one hundred thousand? -48200000 What is 0.31837372 rounded to three dps? 0.318 What is -1582250400 rounded to the nearest one hundred thousand? -1582300000 Round -15485000 to the nearest one hundred thousand. -15500000 Round -1041.6814 to the nearest one hundred. -1000 Round 915.6139 to the nearest integer. 916 Round 25845.7 to the nearest 100. 25800 Round -343.251 to 0 dps. -343 What is -175704000 rounded to the nearest one hundred thousand? -175700000 What is 0.00000647478 rounded to 6 decimal places? 0.000006 Round -2.105092 to 1 decimal place. -2.1 Round -34241894 to the nearest 1000000. -34000000 Round 5.780796 to three decimal places. 5.781 What is -0.0000681085 rounded to five decimal places? -0.00007 Round -0.0172698 to 4 dps. -0.0173 Round -0.0000019436 to six decimal places. -0.000002 What is -0.263043 rounded to 2 dps? -0.26 Round -0.00003098631 to seven decimal places. -0.000031 What is -0.00000080484911 rounded to seven dps? -0.0000008 Round -44693.01 to the nearest 1000. -45000 What is 56.6646 rounded to the nearest integer? 57 Round 0.00004184458 to 6 dps. 0.000042 What is 14310090 rounded to the nearest one million? 14000000 Round 3345023000 to the nearest 1000000. 3345000000 What is 0.0191573 rounded to four decimal places? 0.0192 What is -5.133024 rounded to the nearest integer? -5 What is 339.60445 rounded to one dp? 339.6 What is -10.602388 rounded to one dp? -10.6 Round 183401.26 to the nearest one hundred. 183400 Round -0.02728 to one dp. 0 What is -0.00000052682 rounded to five decimal places? 0 What is -225.8433 rounded to the nearest integer? -226 What is 11848650 rounded to the nearest one hundred thousand? 11800000 Round -0.0008131502 to 7 dps. -0.0008132 What is -1902.389 rounded to 0 decimal places? -1902 Round -7.63252 to the nearest integer. -8 What is -0.00007667 rounded to six decimal places? -0.000077 Round -86.426544 to 1 dp. -86.4 What is 0.0049102 rounded to three decimal places? 0.005 What is -0.0038021 rounded to four decimal places? -0.0038 Round -20.75121 to the nearest integer. -21 What is 1865837.9 rounded to the nearest 100000? 1900000 What is -0.01750664 rounded to five decimal places? -0.01751 What is 0.005542119 rounded to four dps? 0.0055 Round -0.0009855681 to five dps. -0.00099 Round 9.74526 to two decimal places. 9.75 Round -0.00000025533936 to 7 decimal places. -0.0000003 What is -1582.286 rounded to the nearest 100? -1600 Round -0.0042345302 to 4 dps. -0.0042 What is 2.72517 rounded to three decimal places? 2.725 Round -3.936217 to 0 dps. -4 What is 0.14610776 rounded to 5 dps? 0.14611 What is 104665.13 rounded to the nearest 1000? 105000 What is 5.399922 rounded to three dps? 5.4 What is -0.00002212286 rounded to seven decimal places? -0.0000221 Round 282837.9 to the nearest one thousand. 283000 Round 37188500 to the nearest 100000. 37200000 What is -18138.86 rounded to the nearest one thousand? -18000 What is -93842.37 rounded to the nearest one thousand? -94000 What is 0.00001489963 rounded to 7 dps? 0.0000149 What is 224560300 rounded to the nearest one million? 225000000 What is -0.01019613 rounded to 2 decimal places? -0.01 What is 0.02101422 rounded to 5 decimal places? 0.02101 Round -6462.6 to the nearest 100. -6500 Round -2.797521 to three dps. -2.798 What is -53070600 rounded to the nearest 100000? -53100000 Round 217.1894 to the nearest 10. 220 Round -0.0000105302 to 7 dps. -0.0000105 What is -4034565 rounded to the nearest 100000? -4000000 What is -714.3736 rounded to the nearest ten? -710 What is 0.03393057 rounded to three dps? 0.034 Round 0.000486526 to 4 dps. 0.0005 Round 6378.197 to the nearest one thousand. 6000 Round -20061.7 to the nearest 100. -20100 What is -0.00000520142 rounded to seven dps? -0.0000052 What is 129883 rounded to the nearest one thousand? 130000 Round 2621830 to the nearest 10000. 2620000 What is -3178.59 rounded to the nearest one hundred? -3200 What is 0.0000286991 rounded to 7 decimal places? 0.0000287 Round -407.2309 to the nearest one hundred. -400 Round -0.005589957 to three dps. -0.006 Round -32909.698 to the nearest one thousand. -33000 What is 4.7964 rounded to 1 decimal place? 4.8 What is -2213137500 rounded to the nearest one million? -2213000000 Round 0.1441833 to 4 dps. 0.1442 What is -0.0001175851 rounded to 7 dps? -0.0001176 Round 0.04469 to 3 decimal places. 0.045 Round -0.00987419 to 4 decimal places. -0.0099 What is 0.00001290712 rounded to six decimal places? 0.000013 What is -0.001670387 rounded to four dps? -0.0017 What is 0.0000076171374 rounded to 6 dps? 0.000008 What is -22.02991 rounded to the nearest integer? -22 What is -0.1848145 rounded to 3 dps? -0.185 Round 0.000038373506 to 6 dps. 0.000038 What is -0.002813319 rounded to 3 dps? -0.003 Round -265336.4 to the nearest 10000. -270000 Round 0.0056691 to five decimal places. 0.00567 What is -11758140 rounded to the nearest 10000? -11760000 What is -0.0139814 rounded to four dps? -0.014 Round -815.3733 to the nearest integer. -815 Round -20032100 to the nearest one million. -20000000 What is -0.01195627 rounded to 4 dps? -0.012 Round 4898080 to the nearest ten thousand. 4900000 What is -0.01615899 rounded to 4 dps? -0.0162 What is 0.000014689 rounded to seven decimal places? 0.0000147 What is 0.19296115 rounded to three decimal places? 0.193 What is 0.0000635751 rounded to five decimal places? 0.00006 Round 7066.191 to the nearest 1000. 7000 What is -6347000 rounded to the nearest one million? -6000000 Round -7337.2599 to the nearest one thousand. -7000 Round 0.00312937 to 5 decimal places. 0.00313 What is 663857.5 rounded to the nearest one hundred thousand? 700000 Round -0.0368239 to 2 decimal places. -0.04 Round -0.0000500306 to six dps. -0.00005 What is -0.04001773 rounded to two dps? -0.04 What is -0.491887 rounded to zero dps? 0 Round -0.0059416 to 3 dps. -0.006 What is -0.0000737053 rounded to 5 decimal places? -0.00007 What is -1012850 rounded to the nearest ten thousand? -1010000 Round 483.19828 to the nearest 10. 480 What is 1.896546 rounded to 1 dp? 1.9 What is -0.164752 rounded to 1 decimal place? -0.2 Round -374.0912 to the nearest 100. -400 Round -0.00446685 to five decimal places. -0.00447 What is 675975 rounded to the nearest 100000? 700000 Round 49720.68 to the nearest ten thousand. 50000 Round 993.38 to the nearest 10. 990 Round 1799900 to the nearest one hundred thousand. 1800000 What is 0.00246852 rounded to 4 dps? 0.0025 What is 104.4281 rounded to zero decimal places? 104 Round 93232.34 to the nearest ten thousand. 90000 What is 4.18326 rounded to the nearest integer? 4 What is -0.00134585 rounded to four dps? -0.0013 What is -0.0001879102 rounded to 7 decimal places? -0.0001879 Round 0.000093433 to seven dps. 0.000	{ "pile_set_name": "DM Mathematics" }
1/5, d, u. -1/5, d, u Let t(b) = -2b - 4. Let w be t(-3). Let g = 131 + -126. Sort -4, g, w in descending order. g, w, -4 Let p = 8.99 + -8.79. Sort -0.6, -0.11, p in descending order. p, -0.11, -0.6 Let h be (6/99)/(2/(-3)). Let k be ((-8)/(-6))/((-2)/3). Let q = -0.3 + 0.4. Sort q, k, h. k, h, q Let l = 1 + -0.7. Suppose 6h - 60 = 4h. Let v = h - 28. Sort l, v, -0.2 in descending order. v, l, -0.2 Let z be 5/((-80)/(-76)) - 4. Let x = -3 - -2.8. Let q = x + 0. Sort q, 3, z. q, z, 3 Let v = -4.198 + 0.198. Sort 3, 5/6, v, 0.09 in decreasing order. 3, 5/6, 0.09, v Suppose 6 = -4l + 82. Let f = 1288 + -1285. Put f, 4, l in increasing order. f, 4, l Suppose 0 = -k + g - 2, g + 10 = 4k + 3g. Let q be k/(-1)-2 - 2. Let h be (q(-2)/6)/(-1). Sort -3, 2, h in decreasing order. 2, h, -3 Let q be 196/(-396) - (-12)/44. Sort 4/5, q, 3/7, -29 in ascending order. -29, q, 3/7, 4/5 Let s(a) = a*3 + 12a*2 + 6a + 72. Let k be s(-12). Sort -6, -3, k, 3 in ascending order. -6, -3, k, 3 Let i be 317/(-11) + 8/(-44). Let b = i - -24. Let u = 2 + 2. Put b, u, 0.4 in descending order. u, 0.4, b Let m = -4 - 0. Let n = 103 + -91.9. Let c = -11 + n. Sort 0.5, m, c in decreasing order. 0.5, c, m Let w = -664 + 671. Sort 3/8, 0, w, 8 in decreasing order. 8, w, 3/8, 0 Let k be -4 - 2/(0 + -1). Let y = k - 1. Let a = 220 + -225. Put a, 4, y in ascending order. a, y, 4 Let y = -0.0688 - -5.0688. Suppose z - 4z = 2a - 17, -5z = 2a - 19. Put -5, a, y in descending order. a, y, -5 Let m = -797.9 - -798. Put -1, m, 1, -6 in ascending order. -6, -1, m, 1 Suppose 2m + 98 = -3z - z, 2m + 100 = -3z. Let d = -48 - m. Suppose 3y = 5n - 0y + 22, 4y - 14 = -n. Sort -5, d, n. -5, n, d Let d = -0.0199 + 0.3199. Put 5, d, 0.04 in ascending order. 0.04, d, 5 Let v be 3/((-34)/4 + -2). Let a be ((-6)/4)/((4/8)/1). Put a, -2, v, 2 in descending order. 2, v, -2, a Let v(w) = -4w - 16. Let r be v(-5). Let h = -6 - -11. Put h, 7, r, -2 in increasing order. -2, r, h, 7 Let z = 749 + -749. Sort z, 2, -1, 4 in ascending order. -1, z, 2, 4 Suppose 3v + 24 = -3r, 2r - 2v = -r - 34. Let x be 2/6-110/r. Sort x, 2/13, -3. -3, 2/13, x Let x = -97 - -57. Let z = x + 63. Sort -0.1, 1, z, 1/8 in descending order. z, 1, 1/8, -0.1 Let b = -8 + 5. Let j = 11 + -9. Suppose 5f = 2f + 12. Sort b, j, f in increasing order. b, j, f Let s(y) = y3 - 4y*2 - 5y + 4. Suppose -2l - 12 = -5l, 28 = 2q + 3l. Let h be (2/q)/(6/120). Let f be s(h). Put f, -3, 5 in increasing order. -3, f, 5 Suppose 0 = g + 4 - 6. Let h be (-242)/(-14) - (-8)/(-28). Suppose 0 = -2c + 3j + h, -5c = -3c + j + 3. Sort 0, g, c in increasing order. 0, c, g Let n = 45 + -41. Let h be 20/(-225) - n/30. Let x be -2 - (1 + (-10)/4). Put h, x, -1 in decreasing order. h, x, -1 Let u = -4837/20 + 965/4. Put u, 1/5, 2/17, 59 in decreasing order. 59, 1/5, 2/17, u Suppose 0 = x - 4m - 8, 3m + 1 = x - 7. Let h be (4/8)/((-1)/(x/3)). Put 1, h, 1/2 in descending order. 1, 1/2, h Let a be (5 - (-52)/(-10))-5. Sort 4, a, -4, 9 in decreasing order. 9, 4, a, -4 Suppose 2p = -4b + 5 + 11, -17 = -3b + p. Put -2, -9, -3, b in ascending order. -9, -3, -2, b Suppose 0 = -2i + 4 - 0. Suppose 0 = -5a - 5z, 0 = 4a + z + 4z + 5. Put i, -14, a in increasing order. -14, i, a Let k be (9 + -12)(1 + 0). Put -2/5, k, -69 in descending order. -2/5, k, -69 Let d = 98 + -104. Let c = -3 - -5. Let l = c + d. Sort -2, 0.3, l in descending order. 0.3, -2, l Let s be (9/6)/(33/(-44)). Sort 14, 3, s, -5 in descending order. 14, 3, s, -5 Let t = 29.8 + -21. Let j = 0.2 + t. Let h = j - 9.4. Put h, 0.4, 1/3 in increasing order. h, 1/3, 0.4 Suppose -4d = -3d + 4. Let m be ((-16)/12)/d-3. Let l(t) = -t - 7. Let v be l(-7). Sort m, v, 1 in decreasing order. 1, v, m Let s(b) = -b2 + 11b + 16. Let m be s(12). Let u be 2/m40/4. Sort 1, 3, u in increasing order. 1, 3, u Suppose 3y - 28 = -4y. Let s be 528/(-1020) + y/34. Let j = 0.2 + -2.2. Sort 1, j, s in ascending order. j, s, 1 Let y = 573 - 552.7. Put -4, -0.1, y in decreasing order. y, -0.1, -4 Suppose -5j = 5q + 10, -3j + 6j + 11 = -4q. Suppose -jw = 5g + 110, 3g - 2 = 4. Sort w, 3, 2, -5 in descending order. 3, 2, -5, w Let n be (-2)/4(-1 + -13). Suppose 0 = 11d - 25 - 19. Suppose -5h - n = -dg, -3g + 8g = -2h - 16. Sort g, 0, 2. g, 0, 2 Let v = -6.7 + 10.7. Sort 2, 1, 2/33, v in decreasing order. v, 2, 1, 2/33 Let r(g) = -g*2 + 11g - 51. Let y be r(12). Put -0.3, y, -2/13 in ascending order. y, -0.3, -2/13 Let g be 4 - -1(-4)/4. Suppose -i + i = gi. Let s = -5 + 9. Sort i, -3, s in descending order. s, i, -3 Let n be -3 - (-4 - (-12)/10). Let q be (-5)/(-10)(-4)/(-10). Sort n, q, -3, 0. -3, n, 0, q Suppose -2y + 3u + 6 = 0, -5y - 2u - 2 = -17. Let m = 15 - 16. Sort -2, m, y. -2, m, y Let l = -4031 + 4027. Let u = 0.05 + -0.45. Sort u, 13, l, -5 in descending order. 13, u, l, -5 Suppose -5d + 0d + 15 = 0. Let m be (2/d)/(143/(-39)). Sort -4, -0.1, m in increasing order. -4, m, -0.1 Suppose 4y - 22 = -6. Let v = -43 + 45. Let l be ((2/7)/(v/14))/2. Put y, l, 5 in decreasing order. 5, y, l Suppose -2 = y, -2i = -5i - y + 13. Suppose -2 = -7w + iw. Put 16, -5, w in increasing order. -5, w, 16 Let h be 8-124/48. Sort -3, -42, h in decreasing order. -3, h, -42 Suppose -f - 2j = -15, 0 = -2f + j - 0j + 5. Suppose -15 = fw - 6s + s, 0 = 2w - s + 6. Sort 3, 0, 2, w in increasing order. w, 0, 2, 3 Let t = 0.11 - 2.71. Let s = -1.43 - 0.97. Let w = t + s. Put w, 7/5, 4 in descending order. 4, 7/5, w Let v = 82.4 - 82.4. Put v, 1, 4/5, -5 in decreasing order. 1, 4/5, v, -5 Suppose -13 = -2z - 3n, 2z = 4n + 5 + 1. Suppose -3u = 2m - 6u - 11, zu + 14 = -m. Sort m, -3, 20 in ascending order. -3, m, 20 Let z be 113/4 + (-151)/604. Put z, 1, -5, -2 in increasing order. -5, -2, 1, z Let j = -0.084 + 0.284. Put -1/2, 1/3, j, 3/2 in decreasing order. 3/2, 1/3, j, -1/2 Let p be 3/2 + (-35)/30. Let g = -56 - -60. Sort p, 2, g in decreasing order. g, 2, p Let o = -80 - -34. Let m = -46.1 - o. Sort -2, -0.2, m in increasing order. -2, -0.2, m Suppose -5w = -0w - 105. Suppose -10 = -19b + 14b. Sort -1, w, b in decreasing order. w, b, -1 Let c = -353843758/531 + 666372. Let x = c - -12/59. Let m = -2.11 - -4.11. Sort m, 1, x. x, 1, m Suppose 0h - h + 5 = 0. Suppose -hp + 27 = -5l - 3, -p = -5l - 26. Suppose 0 = 3c + 17 + p. Sort -3, c, -5. c, -5, -3 Suppose -1 = 2r - 3r. Let n(h) = -h3 + h2 + 53h + 19. Let z be n(8). Put 2, z, r, -2 in increasing order. z, -2, r, 2 Let c(z) = 3z + 5. Let l be c(-5). Let s be (3/(-6))/(1/l). Suppose -3 = so - 13. Put o, -3, 5 in ascending order. -3, o, 5 Let x = -17 + 12. Let l be 15/((-10)/4). Sort -3, l, x in descending order. l, -3, x Suppose u = 2u - 5j - 1, 5 = 5u - 4j. Let t(g) = 113g - 1247. Let n be t(11). Put 0, n, u, -2 in ascending order. n, -2, 0, u Let h = -7 - 10. Let x = -83 + 81.75. Let i = x + 6.25. Sort i, 2, h in descending order. i, 2, h Let s be 1 + -5 + 1 + 1. Suppose -30 = -0f + 5f. Let b be ((-8)/(-4))/((-4)/f). Put s, b, 5 in descending order. 5, b, s Let a = -164 - -165. Sort a, 22, -1/5 in decreasing order. 22, a, -1/5 Suppose -3f = -24f + 84. Sort 2, -5, f in decreasing order. f, 2, -5 Let c = 46 - 50. Put c, 13, 4 in descending order. 13, 4, c Let l = 61.2 + -60. Let y = -0.9 + l. Sort 4, y, -8 in ascending order. -8, y, 4 Suppose 14v - 10v - 30 = -w, 0 = 5v + 2w - 33. Suppose m + 0 + 2 = 3b, -2 = 2m - 5b. Put v, m, 0, 1 in ascending order. 0, 1, m, v Suppose 0 = 3i - 6 + 6. Let d be -5 - i/(3 + -3 - 2). Put -0.88, 2/11, d in increasing order. d, -0.88, 2/11 Let k = -25041.97 - -25244. Let v = k - 231.9. Let f = -30 - v. Put 0.2, -1/3, f in descending order. 0.2, f, -1/3 Suppose 3m + 4 = -2p - 0, m - 8 = 4p. Let t = -14 - -11. Sort -5, t, -30, m in ascending order. -30, -5, t, m Let w be (-84)/(-130) + 42/273. Let g = -7 - -4. Sort -5, w, g. -5, g, w Let j(b) be the third derivative of -b4/12 - 4b*3 - 9b*2. Let q be j(-13). Let k be 4/(q/(-4 - -3)). Put -5, 4, k in ascending order. -5, k, 4 Suppose -4u = 4r, -2u - 2u - 14 = -3r. Let j be 2(u + 1)/(-2). Let h be ((-57)/(-76))/(j/(-4)). Sort 2, h, -4. -4, h, 2 Suppose -4s = -5*a + 10	{ "pile_set_name": "DM Mathematics" }
, 3. -4825, -5, -3, -1, 3 Sort 15, -5, 0.4, -2/5, 0.07. -5, -2/5, 0.07, 0.4, 15 Sort -5, -2, 7, 5566 in descending order. 5566, 7, -2, -5 Sort -2, -13, 10.746 in descending order. 10.746, -2, -13 Put -9/95, 2/11, -0.5, 1, -275 in descending order. 1, 2/11, -9/95, -0.5, -275 Put 0, 5, 26, 4, 11, 0.02 in increasing order. 0, 0.02, 4, 5, 11, 26 Sort -0.5, -5, 646, 1, -1, 0.5 in increasing order. -5, -1, -0.5, 0.5, 1, 646 Put -29280, -5, 5 in descending order. 5, -5, -29280 Sort -3, -2274, 0, -21, 2 in increasing order. -2274, -21, -3, 0, 2 Put -4, 4, -5, 95, 2 in descending order. 95, 4, 2, -4, -5 Sort -2/9, -19, 1, -20, -1/3, 2/9 in descending order. 1, 2/9, -2/9, -1/3, -19, -20 Put -14, 15, 0.013 in descending order. 15, 0.013, -14 Sort 0.172, 5, -3, 1.8, -1 in ascending order. -3, -1, 0.172, 1.8, 5 Sort 3, 182490, 5 in ascending order. 3, 5, 182490 Sort 17913, 4, 120. 4, 120, 17913 Sort -2, -18, 12.3, -2/5 in decreasing order. 12.3, -2/5, -2, -18 Put 4, 96424, 3 in descending order. 96424, 4, 3 Sort 1, 2, 234 in increasing order. 1, 2, 234 Put 85, -2, 539 in descending order. 539, 85, -2 Put 38, 4, -3, -149 in decreasing order. 38, 4, -3, -149 Put -1/14, -3/7, 1/8, -1, -0.14 in ascending order. -1, -3/7, -0.14, -1/14, 1/8 Put -1.3, 0.651, -1/10 in ascending order. -1.3, -1/10, 0.651 Put 8, -10, -24, -5, 1 in ascending order. -24, -10, -5, 1, 8 Sort -1.9, -0.11, -45, 0.5, 3. -45, -1.9, -0.11, 0.5, 3 Put -1940, 3, 1 in ascending order. -1940, 1, 3 Sort -2, 2, 203, 512 in descending order. 512, 203, 2, -2 Put 189, -3, 22, 2 in increasing order. -3, 2, 22, 189 Put 3, 272, -529, -0.3 in descending order. 272, 3, -0.3, -529 Put -648, -237, 4 in decreasing order. 4, -237, -648 Sort 2, 94, 16014 in descending order. 16014, 94, 2 Put -15, 1, 5, 3, 2 in decreasing order. 5, 3, 2, 1, -15 Put -119, 13, 2, -2, 8, 3 in descending order. 13, 8, 3, 2, -2, -119 Put 3071, 5, -1, -4 in decreasing order. 3071, 5, -1, -4 Put -1/4, 1/14, 1, -0.3, -132 in increasing order. -132, -0.3, -1/4, 1/14, 1 Sort 36.4, -2/131, 3 in ascending order. -2/131, 3, 36.4 Sort -50, -90, -2, 1 in decreasing order. 1, -2, -50, -90 Sort 24, 0, -1, 0.02, -0.1. -1, -0.1, 0, 0.02, 24 Sort 2/3, 7, -6/11, -5/3, -71, -1/4 in decreasing order. 7, 2/3, -1/4, -6/11, -5/3, -71 Sort -9, 1226, -4/7. -9, -4/7, 1226 Sort 11, 63, -140/17 in ascending order. -140/17, 11, 63 Sort 5, -3, 0, 3, -5, -1590 in increasing order. -1590, -5, -3, 0, 3, 5 Sort -0.3, 4.9, -33384 in decreasing order. 4.9, -0.3, -33384 Sort -1, -4414, 3, -5, -4, 0. -4414, -5, -4, -1, 0, 3 Sort 712.2, -5/3, -2 in descending order. 712.2, -5/3, -2 Sort -0.4, -8/5, 3, 105, -1. -8/5, -1, -0.4, 3, 105 Sort -90, 3, 2009 in descending order. 2009, 3, -90 Sort 9, -4, 128, 5, 2, 0 in ascending order. -4, 0, 2, 5, 9, 128 Sort 4, -11818, 5, 2. -11818, 2, 4, 5 Put 0.04, -0.6, 7/9, -2, -2/17 in decreasing order. 7/9, 0.04, -2/17, -0.6, -2 Sort -23, 53, 0. -23, 0, 53 Sort -1/6, -14, 0.4, -27/13 in ascending order. -14, -27/13, -1/6, 0.4 Put 3, -44, 30, -2, -3, 0 in decreasing order. 30, 3, 0, -2, -3, -44 Sort 1/6, -13, 56, -3/7, -0.2 in increasing order. -13, -3/7, -0.2, 1/6, 56 Sort 2/7, 1277, -0.04, -22 in increasing order. -22, -0.04, 2/7, 1277 Sort 0.1, 1/9, -1/6, 22, -2.4 in increasing order. -2.4, -1/6, 0.1, 1/9, 22 Sort -4, 4, 3, -3, -5 in descending order. 4, 3, -3, -4, -5 Put -0.04, -34, -6, 0.4 in descending order. 0.4, -0.04, -6, -34 Sort -0.01, -0.4, -3/5, -4, -2, 5 in ascending order. -4, -2, -3/5, -0.4, -0.01, 5 Sort -1, 2, 5, -2, -102 in descending order. 5, 2, -1, -2, -102 Sort 5, -1, -55, -54, 0, 6. -55, -54, -1, 0, 5, 6 Sort -2, -165992, 0 in ascending order. -165992, -2, 0 Sort 831, -11, 4 in descending order. 831, 4, -11 Put -5, 0.2, 2, 1.5, -0.7 in descending order. 2, 1.5, 0.2, -0.7, -5 Put 3, 2, -80, -3 in descending order. 3, 2, -3, -80 Put -3, -26, 1, -5, 12, 3 in ascending order. -26, -5, -3, 1, 3, 12 Sort 1, -47, -21, -9 in ascending order. -47, -21, -9, 1 Put -6, -1, -243, -4 in descending order. -1, -4, -6, -243 Sort 0, 17, -6, -4, 4, -3. -6, -4, -3, 0, 4, 17 Put -0.3, -0.18232, 2, 0.2 in decreasing order. 2, 0.2, -0.18232, -0.3 Sort 8/35, 91, 0.1, 3/2 in descending order. 91, 3/2, 8/35, 0.1 Put -16, 210, -43 in ascending order. -43, -16, 210 Put -10, 507, -11 in ascending order. -11, -10, 507 Sort 6, 2/15, 947, -2/5. -2/5, 2/15, 6, 947 Sort -1, 21, 5, -3, 0.1, 2/27 in descending order. 21, 5, 0.1, 2/27, -1, -3 Sort 25, -247, -2 in descending order. 25, -2, -247 Put 5, -182, -3, 4, 6, -1 in descending order. 6, 5, 4, -1, -3, -182 Sort 93337, -2, -5, -4, 5 in decreasing order. 93337, 5, -2, -4, -5 Put 123, -4, 2, -202 in descending order. 123, 2, -4, -202 Put -29136, 0.2, 3/2 in decreasing order. 3/2, 0.2, -29136 Sort 2/5, -2, 2, 2/9, -0.1, -197 in increasing order. -197, -2, -0.1, 2/9, 2/5, 2 Sort 5, -34, 0, 1, -2 in ascending order. -34, -2, 0, 1, 5 Put -1/1354, -5, 1, -1/4, -3/5, 0 in descending order. 1, 0, -1/1354, -1/4, -3/5, -5 Put -2, -0.3, 1/4, 0, -0.34857 in descending order. 1/4, 0, -0.3, -0.34857, -2 Sort 2, 4, -252, 7, 3, -4 in increasing order. -252, -4, 2, 3, 4, 7 Put -7814, 4, 2, -5, -7 in descending order. 4, 2, -5, -7, -7814 Put -45, -12/11, -4, 5, 1 in increasing order. -45, -4, -12/11, 1, 5 Put -145, -3, 7, 5, -4 in decreasing order. 7, 5, -3, -4, -145 Sort -4, 8/101, 0, 7 in increasing order. -4, 0, 8/101, 7 Put -11, -429, 12, 4 in decreasing order. 12, 4, -11, -429 Sort -1, 4, 11, -254 in decreasing order. 11, 4, -1, -254 Sort 34, 1, 0.228, 3 in ascending order. 0.228, 1, 3, 34 Sort 3.4, 3, 8/7, -3/2, 1/3, -2. -2, -3/2, 1/3, 8/7, 3, 3.4 Put 5, -3, -4, 480 in increasing order. -4, -3, 5, 480 Sort -49327, -0.15, 0.1. -49327, -0.15, 0.1 Sort 800.39, -2/11, -4, 1/4 in descending order. 800.39, 1/4, -2/11, -4 Sort -47, 21, -4, -8, -2 in descending order. 21, -2, -4, -8, -47 Put -53, -1, -3, -5, 1 in increasing order. -53, -5, -3, -1, 1 Put -1, -17, 3, -62 in descending order. 3, -1, -17, -62 Put -4, -73, 8281 in decreasing order. 8281, -4, -73 Put 0.8, -5, 303, 5, -0.06 in descending order. 303, 5, 0.8, -0.06, -5 Sort 3, -8, 0, 144, 1, -5 in descending order. 144, 3, 1, 0, -5, -8 Sort 3, 9307, 5, -11. -11, 3, 5, 9307 Sort -13, 152, 5, -30. -30, -13, 5, 152 Put -92, -59, 0, 30, -1, 4 in descending order. 30, 4, 0, -1, -59, -92 Put 0.01, -4, 35/4, -13 in decreasing order. 35/4, 0.01, -4, -13 Sort -3/5, 21, -0.003 in ascending order. -3/5, -0.003, 21 Sort -5, 4, -1, -11, -227. -227, -11, -5, -1, 4 Put -1/5, -1, 4/11, -0.3, 0 in ascending order. -1, -0.3, -1/5, 0, 4/11 Sort 4, -22, 44 in descending order. 44, 4, -22 Put 8, -1306, -2 in increasing order. -1306, -2, 8 Sort 0.06, 3, -0.2, 1/7, -1/3. -1/3, -0.2, 0.06, 1/7, 3 Put -2, -3, 28, 554, 3, -4 in decreasing order. 554, 28, 3, -2, -3, -4 Sort 0, 753, 5/3 in ascending order. 0, 5/3, 753 Sort 0.01, 0, 2/11, -0.06, -4, -44 in decreasing order. 2/11, 0.01, 0, -0.06, -4, -44 Put 0.4, 147, -1.7 in decreasing order. 147, 0.4, -1.7 Put -20, 3, -5.4 in decreasing order. 3, -5.4, -20 Put -45, 658, 8 in increasing order. -45, 8, 658 Put -58, 4, -4, -60, 2 in descending order. 4, 2, -4, -58, -60 Sort -2/7, -1/2, 30, 46 in increasing order. -1/2, -2/7, 30, 46 Sort -4, -0.5, 8/31, 4, -1, -2/17. -4, -1, -0.5, -2/17, 8/31, 4 Sort -2/7, -204, -6, 68, -0.3 in increasing order. -204, -6, -0.3, -2/7, 68 Sort -48, 1, -4, 8, -335 in increasing order. -335, -48, -4, 1, 8 Sort -0.2, -2, 1/181, 23 in decreasing order. 23, 1/181, -0.2, -2 Sort -3.54, -2, -19. -19, -3.54, -2 Sort 2, -188, 27 in increasing order. -188, 2, 27 Sort -3, 17, -315, -4, 16 in decreasing order. 17, 16, -3, -4, -315 Put -5, 61, 1014 in decreasing order. 1014, 61, -5 Sort 5, 6, -1529 in ascending order. -1529, 5, 6 Put 2/11, -2, -3.04, -0.2, 6/11 in descending order. 6/11, 2/11, -0.2, -2, -3.04 Sort 8, 4, 2, -1, -19 in descending order. 8, 4, 2, -1, -19 Sort -130, -1, 1, 206 in increasing order. -130, -1, 1, 206 Sort 893, 209, 1, -5 in ascending order. -5, 1, 209, 893 Sort 22, 2/3, -455. -455, 2/3, 22 Put 3, -10, -1/3, 33, 10 in descending order. 33, 10, 3, -1/3, -10 Sort -0.7, -1/2, 0.425, -4 in increasing order. -4, -0.7, -1/2, 0.425 Sort -3, 3/4, -1, -543 in descending order. 3/4, -1, -3, -543 Sort	{ "pile_set_name": "DM Mathematics" }
alculate u(h(i)). 602i2 - 4i Let s(r) be the second derivative of -r5/120 + r3/3 + 2r. Let w(g) be the second derivative of s(g). Let h(m) = 2m - 6m + 3m. What is h(w(y))? y Let u(h) = 53h. Let x(f) = 20f. Give x(u(n)). 1060n Let d(y) be the third derivative of -y7/1260 - y4/4 + 9y*2. Let i(p) be the second derivative of d(p). Let o(j) = -j. What is o(i(r))? 2r2 Let b(j) = j. Let m(z) be the third derivative of -z5/60 - 4z2. Give b(m(q)). -q2 Let c(v) = -2v*2. Let i = -24 + 27. Let r(w) = 3 - 3 + 2w - iw. Determine r(c(l)). 2l*2 Let m(i) be the first derivative of 2i*2 - 1. Let t(c) = -2c. Determine t(m(o)). -8o Let t(a) be the first derivative of 0a + 0a2 + 4 - 1/3a*3. Let f(d) = 2d*2. Determine f(t(b)). 2b*4 Let n(m) = -2m2. Let b(k) = -k2 + 3k2 + 0k*2. Determine b(n(t)). 8t4 Let i(d) be the third derivative of -d7/1260 + d*5/12 + 3d*2. Let s(j) be the third derivative of i(j). Let x(z) = -3z*2. Give s(x(g)). 12g*2 Let a(t) = -6t*2. Let w(n) = 1. Let v(l) = l + 6. Let y(m) = v(m) - 6w(m). What is a(y(b))? -6b2 Let j(t) = 2t*2 - 2t. Let w(c) = -c*2. Let y(q) = j(q) + 3w(q). Let h(b) = -b*2 - b. Let r(z) = 2h(z) - y(z). Let f(n) = -5n2. Calculate f(r(a)). -5a*4 Let p = 0 - -3. Let t(f) = pf + f - 3f. Let b(u) = 2u*2 + 3u2 - u2. Determine t(b(n)). 4n2 Let v(n) = 181n. Let z(c) = -6c. What is v(z(g))? -1086g Let h(z) be the second derivative of -3z4/4 + 10z. Let g(c) = -c. Give h(g(x)). -9x2 Let u(r) be the first derivative of -2r*3/3 - 24. Let k(s) = 2s. Determine k(u(w)). -4w2 Let s(k) be the third derivative of k4/4 + k3/3 + 6k*2. Let u(m) = -m. Give s(u(w)). -6w + 2 Let v(u) = -u - 4. Let d be v(-8). Let s(h) = 2 + 2 + h - d. Let k(o) be the second derivative of o4/12 + o. Determine k(s(i)). i2 Let k(c) = c*2 - 18c - 2. Let s(f) = -f2. Determine k(s(q)). q4 + 18q2 - 2 Let z(c) = 23c. Let a(j) = 4j. Determine z(a(m)). 92m Let l(u) = 2u. Suppose -2g + 4 + 0 = 0. Let c(h) = -gh + 0h + h. Calculate l(c(d)). -2d Let z(x) = x2. Let h(v) = -3v + 0v + 0v - v. What is z(h(p))? 16p2 Let i(w) = 4w. Let q(p) = -4p - 3. Let f(r) = -7r*2 + 2. Let a be f(-2). Let y(h) = 17h + 13. Let c(z) = aq(z) - 6y(z). What is c(i(j))? 8j Let w(d) = 7091d*2. Let a(j) = 8j. What is w(a(k))? 453824k2 Let n(w) = w2. Let j be 3/(-9) + (-140)/(-15). Let x(c) = jc + 4c2 - 7c*2 - 9c. Give n(x(o)). 9o4 Let v(d) = -5d*2 - 30d. Let w(f) = -3f. What is w(v(b))? 15b*2 + 90b Let d be (-1)/(2/(-21 + 3)). Let c(x) = 5x - 2. Let s(r) = 21r - 9. Let p(q) = dc(q) - 2s(q). Let w(f) = f. Determine w(p(h)). 3h Let i(z) = -2z - 2z2 + 3z*2 + 2z. Let s = -8 - -12. Let k(w) = sw2 - 2 + 2. Calculate i(k(q)). 16q4 Let w(h) be the third derivative of -h4/24 - h*3/3 + 4h*2. Let s(b) = 11 - b + 3b + 2b. Let g(f) = -4s(f) - 22w(f). Let q(r) = -r2. What is g(q(n))? -6n*2 Let b(n) = n - n - 10n*2. Let k(s) = -2s. Give b(k(u)). -40u2 Let u(h) be the second derivative of -h4/12 - h. Let o(m) be the third derivative of -m5/30 - 93m*2. What is o(u(y))? -2y4 Let l(o) = -o2 - 4o. Let q be l(-3). Let m(x) be the second derivative of 1/12x*4 + 0x*q + 0 + 2x + 0x2. Let w(p) = 2p*2. Determine m(w(c)). 4c*4 Let y(v) = 4v*2. Let s(w) = -242 + 242 + 4w. What is s(y(c))? 16c2 Let h(y) be the first derivative of 0y - 5/2y2 + 4. Let v(a) = -2a*2. What is v(h(j))? -50j2 Let l(k) be the third derivative of -k5/30 + 2k2. Let g(u) = 4u*2 + 3. Let q(v) = -9v*2 - 7. Let s(o) = -14g(o) - 6q(o). Give s(l(x)). -8x4 Let l(q) be the third derivative of -q5/20 - 6q2. Let b(f) = -3f. Give b(l(i)). 9i2 Let o(j) = 2j - 21. Let d(i) = -3i2. What is d(o(c))? -12c*2 + 252c - 1323 Let s(z) = z*2. Let l(f) be the third derivative of 0f + 0 + 0f3 + 5/24f4 + f2. Calculate l(s(j)). 5j2 Let n(w) = -2w2 - w2 + 4w2. Let j(l) be the first derivative of 2l*2 - 12. What is j(n(v))? 4v2 Let c(d) be the third derivative of -d4/24 + 2d2. Suppose 1 = 2m + j - 0, -4 = -5m - 2j. Let a(o) = o*m + o - o + 3o*2. Calculate a(c(y)). 4y*2 Let j(m) = -5m*2 + 3m*2 + 3m*2 + 0m*2. Let d(h) = -12h. What is j(d(i))? 144i2 Let l(h) = 6h*2. Let y(v) = 13v - 3. Determine y(l(k)). 78k2 - 3 Let h(y) = -2y. Let z(r) = 0 + 2r2 - 2 + 0 + 1. Calculate z(h(g)). 8g2 - 1 Let i(w) = -w2. Let a(k) = -48k2. What is a(i(t))? -48t*4 Let a(f) = -3f - 5f - 3f + 9f. Let u(n) = -n + 2n*2 + n. Calculate u(a(y)). 8y2 Let z(m) be the first derivative of m3/3 + 1. Let x = 4 - -2. Let t(n) = xn - 3n + 0n. Determine t(z(y)). 3y*2 Let s(j) be the second derivative of -2j + 0 + 0j2 - 1/6j*3. Let v(k) = -2k*2. Determine s(v(q)). 2q*2 Let d(p) = 7 - 5 - 2 + 2p*2. Let c(z) = -16z*2. Give d(c(j)). 512j*4 Let k(u) = 4u. Let z(m) = 485m - 485m + 6m2. Determine k(z(x)). 24x*2 Let a(v) = 3v. Let u(g) = 28g - 2. Give a(u(l)). 84l - 6 Let n(q) = -55q. Let c(s) = -s2. Determine c(n(t)). -3025t*2 Let a(b) = -2b*2. Let f(l) = -2837l*2. What is f(a(q))? -11348q*4 Let b(r) = 6r - 4. Let d(j) = -17j + 11. Let c(w) = -11b(w) - 4d(w). Let g(a) = 21a. What is g(c(l))? 42l Let s(w) = -68w*2. Let n(h) = -10h. Give n(s(l)). 680l2 Let w(m) be the second derivative of -m3/2 + 4m. Let s(j) = 2j2 + 4j*2 - 3j*2. Calculate w(s(a)). -9a*2 Let b(l) = 10l*2. Let t(q) = 5q*2. Give t(b(r)). 500r*4 Let m(j) be the third derivative of 0 - 2j*2 + 0j*4 - 1/20j*5 + 0j*3 + 0j. Let s(d) = d*2. Determine m(s(h)). -3h*4 Let p(i) = -3i. Let f(k) = -6k - 3. What is p(f(x))? 18x + 9 Let n(w) = -3w. Let u(h) = 2h*2 - 995h. Determine n(u(a)). -6a2 + 2985a Let f(h) be the first derivative of -h3/3 - 4. Let t(o) be the third derivative of o5/30 + 2o2. Calculate t(f(r)). 2r4 Let j(t) be the first derivative of t4/24 - 5t2/2 + 2. Let o(p) be the second derivative of j(p). Let x(s) = -5s*2. Give o(x(b)). -5b2 Let j(k) = -k2 + 10023k - 10023k. Let b(p) = -28p. Calculate b(j(n)). 28n*2 Let q(l) = -34l*2. Let h(r) = 33r*2. Determine h(q(d)). 38148d*4 Let z be (10 + -6)(-3)/(-6). Let m(t) = 7t - 4t + z - 2. Let k(i) = 2i2. What is k(m(j))? 18j*2 Let b(n) = 2n*2. Let a(j) = -2j*2 + 5j. Let c(f) = 3f2 - 7f. Let r(l) = -l*2 + 6l + 11. Let v be r(8). Let t(w) = vc(w) - 7a(w). Calculate b(t(k)). 2k4 Let p(c) = c2 - c2 - c2. Let n(b) = b2 - 7b - 4. Let y be n(8). Let z(k) = -k - yk + 2k. What is z(p(g))? 3g2 Let t(b) = -14b*2 + 39b*2 - 21b2. Let r(l) = -l2. Determine r(t(i)). -16i4 Let a(m) = 3m*2. Let c(z) = 362z*2. Calculate a(c(x)). 393132x*4 Let w(k) = 4k. Let i(o) = -8o + 5. Let y(q) = q. Let n(f) = -i(f) - 2y(f). Let g(b) = 7b - 6. Let s(j) = -5g(j) + 6n(j). Determine w(s(d)). 4d Let r(o) = 61o - 1. Let h(b) = -75b. Determine r(h(f)). -4575f - 1 Suppose k - 7 + 1 = 0. Let f = k - 4. Let a(u) = -u2 + 5u*2 - 3u*f + 0u*2. Let y(b) = -2b*2. What is a(y(m))? 4m*4 Let c(f) = -f. Let z(j) = 9j - 5. Let i(h) = 13h - 7. Let k(q) = 5i(q) - 7z(q). What is c(k(o))? -2o Let m(g) = 3g2 - 5g*2 + 4g2. Let w(z) = z2 - z*2 - 5z*2. Give w(m(s)). -20s*4 Let u(r) = 7r. Let z(h) = 113h. Give z(u(w)). 791w Let c(d) = d. Let u be 2-32/3. Let j = -2 - u. Let a(q) = q*2 - 4q*j + 7q*2. Give a(c(v)). 4v2 Let m(u) be the second derivative of u4/12 + u. Let z(a) be the second derivative of a*3/3 + 7a. Give z(m(g)). 2g2 Let w(j) = -j. Let a(q) = -5q*2 - 2q. Let s(k) = -81k2 - 33k. Let m(u) = -33a(u) + 2s(u). Give w(m(t)). -3t2 Let j(h) = -17h*2 - 6h + 8. Let q(y) = -18y2 - 5y + 6. Let a(c) = -3j(c) + 4q(c). Let l(x) = 2x. What is a(l(f))? -84f*2 - 4f Let o(n) = 2n2 + 6. Let v(f) = -2f*2 - 7. Let a(y) = 7o(y) + 6v(y). Let g(r) = -2r*2. Calculate a(g(k)). 8k*4 Let d(k) = -4k*2 + k + 0k - k. Let j(g) = 2g. Determine j(d(v)). -8v*2 Let l(i) = i - 21. Let g(w) = 2w. Determine l(g(d)). 2d - 21 Let x(z) = -3z*2 + 3z**2 + 2	{ "pile_set_name": "DM Mathematics" }
rt -1, 4, 3, -24, -41. -41, -24, -1, 3, 4 Put 5, 3, -373, 0, 14, -4 in ascending order. -373, -4, 0, 3, 5, 14 Put -2, 2.3, -5/3, 0.052 in descending order. 2.3, 0.052, -5/3, -2 Sort -23, 21645, -5 in decreasing order. 21645, -5, -23 Sort -1, -204, 2, 0, 25, -5. -204, -5, -1, 0, 2, 25 Sort -3, 211, -5125 in descending order. 211, -3, -5125 Put 30, 38, -5, -4, 4, -17 in increasing order. -17, -5, -4, 4, 30, 38 Sort -2, 1, 8, 64, 5. -2, 1, 5, 8, 64 Put 2, 0, -18, -992 in descending order. 2, 0, -18, -992 Put -5, -3, -184, -4, 3 in decreasing order. 3, -3, -4, -5, -184 Put 4, 1503, 583, -3 in descending order. 1503, 583, 4, -3 Put -4, 32, 58/9, 0.3, -2/5 in decreasing order. 32, 58/9, 0.3, -2/5, -4 Put -0.8, -4, -0.069, -0.77, 0 in descending order. 0, -0.069, -0.77, -0.8, -4 Put -0.5, -2, -1, 1/2, -1.4 in decreasing order. 1/2, -0.5, -1, -1.4, -2 Sort 4, -6, -4, -9, -813 in descending order. 4, -4, -6, -9, -813 Sort 0, -46, -25, -2, 4 in ascending order. -46, -25, -2, 0, 4 Put 13569, -0.5, 0.4, -2 in decreasing order. 13569, 0.4, -0.5, -2 Sort -1, -0.2, -75.117 in descending order. -0.2, -1, -75.117 Sort 3, -338, -32, 4, 0, -2 in increasing order. -338, -32, -2, 0, 3, 4 Sort 5/8687, -2/5, -2/13 in increasing order. -2/5, -2/13, 5/8687 Put -1, 74, -0.4, 0.3, 18 in ascending order. -1, -0.4, 0.3, 18, 74 Put -4, -210/13, 1/34 in ascending order. -210/13, -4, 1/34 Sort -0.5, -0.1, 0.3, -2/9, 1321 in ascending order. -0.5, -2/9, -0.1, 0.3, 1321 Put -3, -9, 5, 17, -6 in descending order. 17, 5, -3, -6, -9 Put -103071, -4, -8 in decreasing order. -4, -8, -103071 Sort 8, -56, 133, 1 in descending order. 133, 8, 1, -56 Put -5, 79, 1, -38 in decreasing order. 79, 1, -5, -38 Sort -26, 2, 1505 in descending order. 1505, 2, -26 Sort 0.244, 2/5, 8, -2/21 in descending order. 8, 2/5, 0.244, -2/21 Put 0.1, -4, -1/6, 0.08, -2, -87 in decreasing order. 0.1, 0.08, -1/6, -2, -4, -87 Put 5, 135, -119, -2, 3 in descending order. 135, 5, 3, -2, -119 Sort -144, 24, -1/5, -3, 0 in decreasing order. 24, 0, -1/5, -3, -144 Put 3, 135, 864 in decreasing order. 864, 135, 3 Put -0.7, 24/25, -1/5 in increasing order. -0.7, -1/5, 24/25 Sort -5, -0.07, 2767 in decreasing order. 2767, -0.07, -5 Sort -4, -41, -2, -3, 1865. -41, -4, -3, -2, 1865 Sort -4, 2, 0, 6, 40. -4, 0, 2, 6, 40 Put -2, 4, -2/3, 0, -3, -9.5 in increasing order. -9.5, -3, -2, -2/3, 0, 4 Sort -1, -8, 1097, 4, -2 in descending order. 1097, 4, -1, -2, -8 Put -13, 11, -7, 5 in decreasing order. 11, 5, -7, -13 Sort -198, 5, 0.04, 1, -4 in decreasing order. 5, 1, 0.04, -4, -198 Put -411, -14, 9, 0 in ascending order. -411, -14, 0, 9 Sort 43, -22, 716. -22, 43, 716 Sort 1, 9, 5, 2, -8. -8, 1, 2, 5, 9 Put -1/3, -2623, 1, -0.2 in decreasing order. 1, -0.2, -1/3, -2623 Sort -5, -12, -4, 0, 2 in ascending order. -12, -5, -4, 0, 2 Put 13.212, 5, -6 in increasing order. -6, 5, 13.212 Sort 4, 1, 2, -9, -219 in descending order. 4, 2, 1, -9, -219 Put -1, -5, -16, 2, -1373, -3 in decreasing order. 2, -1, -3, -5, -16, -1373 Sort -45, 1, 218 in ascending order. -45, 1, 218 Sort 0.03, 14, -1985. -1985, 0.03, 14 Put -231, -18, -15 in ascending order. -231, -18, -15 Put -6007, 27, -11 in decreasing order. 27, -11, -6007 Sort 4, 1726, 1, 2, -3, 18 in decreasing order. 1726, 18, 4, 2, 1, -3 Put -20, 5, -59, -2, -5 in decreasing order. 5, -2, -5, -20, -59 Sort -2, -8.16, -3, 3/2 in decreasing order. 3/2, -2, -3, -8.16 Put -2, 4, 948, 7 in increasing order. -2, 4, 7, 948 Put 5, -93, 609, -1 in ascending order. -93, -1, 5, 609 Put -3, 19, -1, -4 in increasing order. -4, -3, -1, 19 Put -0.1, -23, -0.4, 49, -4, -2 in ascending order. -23, -4, -2, -0.4, -0.1, 49 Sort -1, -136, -228 in increasing order. -228, -136, -1 Put -16, 154, 2 in ascending order. -16, 2, 154 Put -0.2, -0.09, 1/4, 55, 1.1, 0 in ascending order. -0.2, -0.09, 0, 1/4, 1.1, 55 Sort -25844, 2, -5, -4 in decreasing order. 2, -4, -5, -25844 Put -62, 3, 6, -6 in descending order. 6, 3, -6, -62 Put -5, -0.18, -64, 4, -2/7 in increasing order. -64, -5, -2/7, -0.18, 4 Sort 41, 3, 661, -5 in decreasing order. 661, 41, 3, -5 Sort -5, -245, -82, 4 in ascending order. -245, -82, -5, 4 Put -1, 5, -7, -130, 4 in ascending order. -130, -7, -1, 4, 5 Sort 2, -5, 37407, 1, -2, 5. -5, -2, 1, 2, 5, 37407 Sort -129, -1, 29, 7, -3 in descending order. 29, 7, -1, -3, -129 Sort -3477, -3, -4, 1. -3477, -4, -3, 1 Put -4, -7, -1, 9, 39 in descending order. 39, 9, -1, -4, -7 Put 0, -5, 5, 27, 82 in decreasing order. 82, 27, 5, 0, -5 Put -6, -560, -2, -11 in descending order. -2, -6, -11, -560 Put 18, -3552, 0.4, 5 in ascending order. -3552, 0.4, 5, 18 Sort -4, 839, -3, 5, -2 in increasing order. -4, -3, -2, 5, 839 Put 650, -3, 8, 12, 4 in ascending order. -3, 4, 8, 12, 650 Put -0.47, -14, 7 in decreasing order. 7, -0.47, -14 Sort -83, 8, -3, 1, 0. -83, -3, 0, 1, 8 Put -7, -21, -0.11, 0 in decreasing order. 0, -0.11, -7, -21 Sort -5, 4, 3, -11, -7, -146 in decreasing order. 4, 3, -5, -7, -11, -146 Sort -0.5, 434, 2/7, -5, -3 in decreasing order. 434, 2/7, -0.5, -3, -5 Sort 4, 1077, 2, 0, -4 in descending order. 1077, 4, 2, 0, -4 Sort 0.2, -2, -2/13, -1, 1, -0.0879 in increasing order. -2, -1, -2/13, -0.0879, 0.2, 1 Put -3, -91, 0.009 in decreasing order. 0.009, -3, -91 Sort -4, -2, 0.03, -129, -0.2, 2/11 in increasing order. -129, -4, -2, -0.2, 0.03, 2/11 Put -0.1, 5, -4, -1, -144/31, -2/5 in descending order. 5, -0.1, -2/5, -1, -4, -144/31 Put 5, 3/2, 0.75, 0.186, 3 in decreasing order. 5, 3, 3/2, 0.75, 0.186 Sort 124, 2, 0.1, 1.1, -1/18 in descending order. 124, 2, 1.1, 0.1, -1/18 Sort -5, 721, -1, 7, -7, 2 in increasing order. -7, -5, -1, 2, 7, 721 Sort 0.4, 0.1, -2/9, -8, -0.1, 7 in ascending order. -8, -2/9, -0.1, 0.1, 0.4, 7 Put 1, -5, 12, 15, 2 in ascending order. -5, 1, 2, 12, 15 Put 5, 15, -3.6, 1, -22 in increasing order. -22, -3.6, 1, 5, 15 Put 2, -4, 1, -2, 91, -11 in ascending order. -11, -4, -2, 1, 2, 91 Put -1, -21, -2, 89 in descending order. 89, -1, -2, -21 Put 2, -6, -8, -2, -76, -4 in decreasing order. 2, -2, -4, -6, -8, -76 Put -1/3, -23, -4/1105, 0, 5 in ascending order. -23, -1/3, -4/1105, 0, 5 Put -6, -5, 15, 518 in decreasing order. 518, 15, -5, -6 Sort 365, -0.2, 2.5 in ascending order. -0.2, 2.5, 365 Sort -51, 931, 3, 5, -3 in descending order. 931, 5, 3, -3, -51 Put -23, -5, 5, -25, 1, -2 in ascending order. -25, -23, -5, -2, 1, 5 Sort -0.3, 4, 2, 4/75, -1/13, 5 in increasing order. -0.3, -1/13, 4/75, 2, 4, 5 Put 0.15, -0.1, 21 in descending order. 21, 0.15, -0.1 Sort 8, 443, -3, 15, -1, 1 in ascending order. -3, -1, 1, 8, 15, 443 Put -2/13, -13, 3, 0.3, 2/17, 251 in descending order. 251, 3, 0.3, 2/17, -2/13, -13 Sort 1, -0.35, 1/2, -0.3, 0.2 in decreasing order. 1, 1/2, 0.2, -0.3, -0.35 Sort 26, -3, -2, 5, -4 in increasing order. -4, -3, -2, 5, 26 Sort -0.41, 1/32, 0, 66 in decreasing order. 66, 1/32, 0, -0.41 Put -2/467, -0.5, -0.2, 2 in increasing order. -0.5, -0.2, -2/467, 2 Put 211779, 2, 1 in decreasing order. 211779, 2, 1 Sort -0.28, 0.3, 230 in decreasing order. 230, 0.3, -0.28 Put 2/3, 0.1, 182/11, -0.032 in increasing order. -0.032, 0.1, 2/3, 182/11 Sort 5, -11, 79 in decreasing order. 79, 5, -11 Put 6, -1612, 0 in increasing order. -1612, 0, 6 Sort 3/17, -2/5, -2/15, -3/2, 20 in decreasing order. 20, 3/17, -2/15, -2/5, -3/2 Put 14, 53, 2/23 in ascending order. 2/23, 14, 53 Sort -3, -3/7, -301934 in ascending order. -301934, -3, -3/7 Sort 2559, 5, -4, 1. -4, 1, 5, 2559 Put -24, 5, -4, 4, -1, -2 in descending order. 5, 4, -1, -2, -4, -24 Sort 0.2, -0.3, 1476. -0.3, 0.2, 1476 Put 295, -7, -136 in increasing order. -136, -7, 295 Put 1, -0.4, 0.3, -136 in descending order. 1, 0.3, -0.4, -136 Sort -3, -15, 0, 532 in decreasing order. 532, 0, -3, -15 Sort 16, -5, 2, 183 in ascending order. -5, 2, 16, 183 Sort 3, -1, 312104. -1, 3, 312104 Sort -1052, -63, 0, 2 in descending order. 2, 0, -63, -1052 Sort -13, 3, 3.98, 5. -13, 3, 3.98, 5 Sort 2, -3.47, 66 in decreasing order. 66, 2, -3.47 Put -21, 18, 111 in descending order. 111, 18, -21 Sort 4, 83, -2, 3 in descending order. 83, 4, 3, -2 Sort 1/8, -5, -0.1, 111, 0.4, -2/7 in descending order. 111, 0.4, 1/8, -0.1, -2/7, -5 Sort -4174, -1, 13, 0, 2 in increasing order. -4174, -1, 0, 2, 13 Put 0.2, -5, -0.036, 2/3, 1,	{ "pile_set_name": "DM Mathematics" }
-2)/4). What is the tens digit of 15/c + (-1 - 0)? 1 Let t(u) = 2u2 + 7u + 11. Let m(a) = -a*2 - 3a - 5. Suppose -8 = 5f + 2. Let p(z) = ft(z) - 5m(z). What is the tens digit of p(3)? 1 Suppose -3t = 4q + 18 + 52, -t + 78 = -5q. Let c = -9 - q. What is the units digit of c? 7 Let j(v) = v*3 - 5v*2 + 10v + 6. What is the hundreds digit of j(6)? 1 Suppose 2w + 16 = -5u, -u + 0 - 6 = -w. Let l be 1u/(1/(-1)). Suppose -3v + 6 = r - 25, 0 = 5v - lr - 63. What is the units digit of v? 1 Suppose -2v = -4, m = -4v + 6v + 58. What is the units digit of m? 2 Let c be 15 + (2 - (2 + 0)). Let k(a) = a3 + a2 + a + 2. Let f be k(0). Suppose -fb - 3b = -c. What is the units digit of b? 3 Let k(c) = -4c - 16. Let m(n) = n + 5. Let v(t) = 2k(t) + 7m(t). What is the units digit of v(-3)? 6 Let i be -2 + (27 + 0)/3. Suppose -2d + 19 = -i. What is the tens digit of d? 1 Let a(z) = -z3 + 4z*2 + 5z + 1. Let q = 25 - 21. What is the units digit of a(q)? 1 Suppose -8 = 2y - 6y. Suppose yj = -3j + 140. What is the tens digit of j? 2 Let t be 2/(-5) + 8/20. Suppose 2v + f - 15 = t, 4v - 3f - 42 = -f. What is the units digit of v? 9 What is the units digit of (-2)/(-5) - (-504)/15? 4 Let h(t) be the second derivative of t5/120 + t4/2 - t3/6 + 2t. Let l(z) be the second derivative of h(z). What is the units digit of l(-5)? 7 Suppose 17b + 34 = 18b - 4s, -10 = -2s. What is the units digit of b? 4 Let f = -16 - -10. Let r be (0 + 9)(-2)/f. Suppose 5l = -rn + 5n - 28, 4l - 10 = -2n. What is the units digit of n? 9 Let q(r) = 7r2 + 6r + 9. What is the units digit of q(-2)? 5 Let k(n) = -60n3 + 2n*2 + 2n + 1. Let f be k(-1). Suppose 4i = -3s + 48, -4s - 3i = -f + 4. What is the units digit of s? 2 Let p be 90/(-24) - (-2)/(-8). What is the tens digit of 8/((-7)/2 - p)? 1 Let d(l) be the first derivative of l*4/4 - 2l*3 + 3l*2/2 - 9l + 1. Let f be (6/(-15))/(2/(-30)). What is the units digit of d(f)? 9 Let l(d) = d*3 - 7d*2 - 9d + 6. Let c be l(8). What is the units digit of c - (-1 - (2 + 20))? 1 Suppose 90 = 4f + 5a - 23, 4f + 4a - 116 = 0. What is the units digit of f? 2 What is the units digit of (-65)/(-7) - 14/49? 9 Suppose -v - 7 = 2c, 5c + 2v - 6v = -24. Let m = 10 + c. What is the units digit of m? 6 What is the units digit of 81/35 + 3? 8 What is the tens digit of 20(-1)/10-5? 1 Suppose -c - 2j = -71, 0c - 355 = -5c + 4j. What is the tens digit of c? 7 Let l = -7 + 44. What is the units digit of l? 7 Let s = 18 + -11. Let t = s + -1. Suppose -ty + y = -35. What is the units digit of y? 7 Suppose -2h + 25 = 3i - 85, -192 = -5i + h. What is the tens digit of i? 3 Suppose -3l + 38 = -2l. Suppose 2m = 4j + l, 4j + j = -m + 54. What is the tens digit of m? 2 Let c = -10 - -13. Suppose -ck + 52 + 20 = 0. What is the tens digit of k? 2 Suppose 2z = -0z + 2l + 20, -l - 22 = -3z. Suppose 0 = 2x - zx + 12. What is the units digit of x? 3 Let z = -23 - -27. Suppose -s - 3s + zk + 172 = 0, -3k = 2s - 106. What is the tens digit of s? 4 Let h be (-39)/9 - 1/(-3). Let x(a) = 5a + 5. Let q be x(h). What is the units digit of (-8)/(-5) - 6/q? 2 Suppose -4k - 4l + 2 = -6, -l = 4k - 17. Suppose -96 = -9n + kn. What is the units digit of n? 4 Suppose -n = -2n + 20. Suppose 5s + n = s. What is the units digit of (-1 - s) + 1 + 3? 8 Suppose -35 = -4y + 5i, -4y - 4i = -0 - 8. Suppose 100 = yz - 0z. What is the tens digit of z? 2 Let w = 43 + -32. What is the units digit of w? 1 Suppose -4q - 1 + 7 = -p, -3p + 12 = 3q. Suppose -8 = -4o + po. What is the units digit of o? 4 Suppose h = 2h - 6. Suppose -3z = k - 24, -4z - h = -2k - 28. What is the units digit of z? 7 Let j(g) be the first derivative of g*4/3 + 2g*3/3 - 3g*2/2 - 5g + 2. Let k(c) be the first derivative of j(c). What is the tens digit of k(2)? 2 Suppose 5z - 175 = -3q + 2q, 0 = -4q - 20. Suppose z = 2h + h. Let y = h - 7. What is the units digit of y? 5 Suppose 3b - 22 = 14. What is the tens digit of b? 1 Let f = -6 - -1. Let l = f + 1. Let j(s) = s2 + s - 2. What is the units digit of j(l)? 0 Let s(f) be the second derivative of -f4/12 - f3/6 + f2/2 + 2f. Let l(c) = -2c*2 - 6c + 5. Let k(t) = l(t) - 4s(t). What is the units digit of k(1)? 1 Let f(c) = 2c*3 - 2c2 + 3. What is the units digit of f(2)? 1 Let y(n) be the second derivative of -n4/12 - 7n3/6 - 6n. What is the units digit of y(-5)? 0 Let g(x) = -x. Let m(o) = -16o - 1. Let l(v) = 3g(v) - m(v). What is the units digit of l(1)? 4 Let i(q) be the first derivative of q3/3 - q2 + 4q - 3. Let f be i(6). What is the tens digit of 1/(-4) - (-399)/f? 1 Let y be (-5 + 2)/(-1 + 2). Let b(m) = -m - 4. Let n be b(y). What is the units digit of (-8)/(-3) - n/3? 3 Suppose 4 = 3f - a + 1, -3a = 9. Suppose -79 + 31 = -4g - 5r, -3r = f. What is the tens digit of g? 1 Suppose -15z + 45 = -915. What is the units digit of z? 4 Let m(h) = -h3 - 9 - 3h - 3h2 + 2 - 5h*2 - 5. What is the tens digit of m(-8)? 1 Let i be 44/16 + (-2)/(-8). Suppose 0 = -h + 5u + 23, -ih - 8 = h + 5u. Suppose -2a - 2t = t - 11, ht = 2a - 29. What is the units digit of a? 0 Let x(i) = i*3 + 13i*2 + 13i + 10. Let j be x(-12). Let u(w) = -22w. What is the units digit of u(j)? 4 Let x be (-50)/156/(-4). Suppose xq = 135 - 25. What is the units digit of q? 2 Let j(u) = -u2 - 8u + 2. Let y(b) = -b - 8. Let w be y(-4). Let c be j(w). Suppose 4k - 6k + 3q + c = 0, q = -4k + 8. What is the units digit of k? 3 Let r(b) = 6b - 1. Let n be r(1). Suppose -4h = -nz - 11, -3h - 13 = 3z + h. Let o = z - -4. What is the units digit of o? 1 What is the tens digit of -1 - (-5 + (4 - 92))? 9 Let y(i) = 9i*2 - 2i + 1. Suppose -6o = -7 + 1. What is the units digit of y(o)? 8 Let m = 25 + -11. What is the units digit of m? 4 Let h = -2 + 7. Let u(l) = 2l + 4. What is the units digit of u(h)? 4 Let g(o) = 11o + 8. What is the units digit of g(7)? 5 What is the tens digit of 72 - 0/(-2 - 3)? 7 Let h(z) = 5z*2 - z + 7. What is the units digit of h(-6)? 3 Let l(g) = g - 1. Let k be l(6). Suppose -p + 3o = -18, -ko + 1 = 6. What is the tens digit of p? 1 Let k(w) = -6w*2 - w. Let i = 0 + -1. Let y be k(i). Let g = y + 6. What is the units digit of g? 1 Suppose 0 = a + a - 32. Suppose d - a = -2. What is the tens digit of d? 1 Let f(v) be the first derivative of -1/3v*3 - 3v + 2 - 3v2. What is the units digit of f(-5)? 2 Let r(i) = -i3 + 6i*2 - 4i - 1. Let l be r(4). Suppose -3s + 15 = 0, -b + 3b = -5s + 35. What is the units digit of b(27/l - 1)? 4 Suppose p - 3 = 0, 0 = -2w - 4p - 50 + 184. What is the units digit of w? 1 Let f(c) = 11c2 + 27c + 5. Let o(y) = -5y2 - 13y - 3. Let k(v) = -2f(v) - 5o(v). What is the units digit of k(-5)? 5 Let n = 38 + -12. What is the tens digit of n + 7/(28/(-8))? 2 Suppose 5w - 454 = 301. What is the hundreds digit of w? 1 Let f(u) = -u - 6. Let r be f(-6). Suppose k - 19 + 1 = r. What is the units digit of k? 8 Let v = -11 + 16. Let c be (-2)/((-1)/(-3)-2). Suppose -ch + 14 = v. What is the units digit of h? 3 Let w(c) = -109c3 - c2 - c + 1. Let g be w(1). Let u = -25 - -17. What is the tens digit of g/u + 2/8? 1 Let q be (-5 + 3)(-1)/1. Let y be (q/3)/(2/(-3)). What is the units digit of y/((-2)/(-2)-1)? 1 Suppose 3m = 7m - 3h + 215, 2h - 106 = 2m. Let b = m - -99. Suppose 4l - 5 = 5o - b, 3o - 10 = -4l. What is the units digit of o? 6 Suppose -v + 0v + 4y = -65, -3v + 222 = -3y. What is the tens digit of v? 7 Let a be 3 + 1 - (-2)/(-1). Let d be (4 - -8)2/4. Suppose -aw = -4h - 6, w + 0 = -h + d. What is the units digit of h? 1 Let y(t) be the first derivative of 1 + 3t2 - 2t - 1/3t3. What is the units digit of y(3)? 7 Let o(n) = -5n + 1. Let w be 1/(-3) + (-32)/12. Let p be o(w). What is the units digit of (-4)/p + 9/4? 2 Let l(t) = 5t2 - 4t - 21. Let m(n) = n*2 - n - 4. Let i(k) = 2l(k) - 11m(k). What is the units digit of i(2)? 4 Suppose 3 - 11 = 4x. What is the tens digit of (-5 - -1)/(x/5)? 1 What is the hundreds digit of (-18)/24 + 543/82? 1 Let h be 0 + 3/((-3)/(-4)). Suppose 3u = -7	{ "pile_set_name": "DM Mathematics" }
Let m = 45 + -48. Let d(b) = 5b + 2. Let t(p) = 1 - 2p + 6p + 0p. Give md(l) + 4t(l). l - 2 Let h = -11 - -13. Suppose -2l = l. Let k(r) = l + 3 - h + r. Let q(g) = 6g + 4. Calculate 4k(y) - q(y). -2y Let p(t) = -7t + 1. Let d(g) = -1. Let c be (-32)/(-24) - 2/(23). Determine cp(s) + d(s). -7s Let l(k) = -k*2 + 5k. Let z be l(5). Let n(b) = 2 + z + b - 1. Let a(c) = -3 + 6 + 5c + 2. Determine 2a(o) - 9n(o). o + 1 Let d(o) = o - 4o + 2o + 0o. Let g(q) = 13q + 5. Let r(n) = -27n - 11. Let f(x) = 13g(x) + 6r(x). Give 5d(h) + f(h). 2h - 1 Let r(v) = -6v - 1. Let a = 8 - 9. Let l(t) = t. Give ar(g) - 3l(g). 3g + 1 Let i(m) = -m3 - m2 - m. Let n(a) = -a*3 - a. Calculate 2i(l) - 3n(l). l3 - 2l*2 + l Let x(c) = -16c + 14. Let s(w) = 3w - 3. Calculate -28s(o) - 6x(o). 12o Let q(j) be the second derivative of j*3/6 - 16j. Let f(p) = -8p. Calculate -2f(n) - 14q(n). 2n Let q = 10 - 3. Let b(x) = -x - 6. Let n(j) = -1 + j + 7 + 1. Suppose 2i - 2d + 12 = 4i, 3i = 5d + 18. Determine in(r) + qb(r). -r Let o(k) = -5k*2 - 2k + 7k2 - 15k + 12k2 + 17. Let j(g) = -5g*2 + 6g - 6. Determine 17j(q) + 6o(q). -q*2 Let o(l) = 15l*2 - 2l + 15. Let d be 0(-2)/24-4. Suppose dm - 3m = -18. Let f(z) = 8z2 - z + 8. What is mo(y) - 11f(y)? 2y*2 - y + 2 Let j(x) = 4x*2 - 15x + 2. Let k(d) = 5d2 - 14d + 3. Calculate 3j(p) - 2k(p). 2p2 - 17p Let a(y) = -y*3 + 10y*2 - 22y + 1. Let m be a(6). Let n(z) = -5z - 2. Let d(f) = 1 + 11f + 0 + 3. What is mn(u) + 6d(u)? u - 2 Let t(h) = 5 + 0 - 4h + 2h. Let f(u) = u - 2. Suppose -4v - 58 + 18 = 0. Give vf(g) - 4t(g). -2g Suppose 0 = -3x - 3c + 7 + 2, x + 4c - 18 = 0. Let u(k) = -3k - 2. Let p be u(x). Let t(r) = -p - 6 + 10 - 7r. Let o(i) = -4i. What is 10o(b) - 6t(b)? 2b Let j(x) = x + 8. Let w be j(0). Suppose 8 = -4h + wh. Let l(d) = -2d + 1. Let k(f) = -2f. What is hl(v) - 3k(v)? 2v + 2 Let z(w) = -w - 1 + 4w + 2w. Let x = 82 - 79. Let g(o) = -6o + 3 + 6 - 3 - 4. Give xg(a) + 4z(a). 2a + 2 Let b(t) = -3 - 2t + 3t + 3 - 1. Let w be (2/6)/((-2)/(-42)). Let g be (-26)/w + (-2)/7. Let u(q) = -5q + 2. Determine gb(x) - u(x). x + 2 Let f(t) = -t + 1. Let j(k) = -29k2 + 3k - 3. Give -3f(s) - j(s). 29s*2 Let b(z) = -7z*3 - 5z*2. Let w = 5 + -1. Let d be (-27)/(-6)w/3. Let q(y) = y*2 + 5y*3 - 2y*3 - 2y*3. Determine dq(k) + b(k). -k3 + k2 Let h(w) = -6w3 - 8w*2 - 11w - 5. Let i(p) = -3 + 4 - 3 - 3p2 - 2p*3 + 0 - 4p. What is 3h(u) - 8i(u)? -2u3 - u + 1 Let w(u) = -4 - 4u*2 + 0 - 3u + 6u2. Suppose -2j - 36 = 2j. Let c(o) = -4o*2 + 7o + 9. Determine jw(x) - 4c(x). -2x2 - x Let s(o) = o3 - o2 + 7o. Let d(p) = p*3 + 4p. Determine 7d(k) - 4s(k). 3k3 + 4k*2 Let j(d) = -18d - 3. Let z(o) = o + 1. Determine j(u) + 3z(u). -15u Let p(a) = -11a + 1. Let c(y) = 12y - 2. Calculate -2c(k) - 3p(k). 9k + 1 Let j(f) = -f2 - 20f - 27. Let a be j(-18). Let t(l) = -3l2 - 4. Let z(s) be the first derivative of -7s*3/3 - 9s + 1. Give at(v) - 4z(v). v*2 Let a(b) = 4b + 2. Let w(d) = -4d + 2d + 2d - d. Suppose 0 = -5o - 2 - 3. Calculate oa(k) - 5w(k). k - 2 Let r(f) = -2f. Let p(v) = -7v + 90 - 90. Calculate -2p(j) + 9r(j). -4j Let u(y) = -7y + 3. Let g(t) = -50t + 20. Calculate -3g(v) + 20u(v). 10v Let o(w) = w*3 - 1. Suppose 0 = -2j - 5 + 3. Let b(p) be the third derivative of p6/24 + p5/60 - p*3/3 - 3p*2. Give jb(v) + 4o(v). -v3 - v2 - 2 Let u(s) = 12s*2 - 6s - 6. Let f(q) = -24q2 + 13q + 13. What is 6f(g) + 13u(g)? 12g2 Let o(g) = 13g*3 - 19g*2. Let m(r) = -3r*3 + 5r*2. Calculate -9m(z) - 2o(z). z3 - 7z*2 Let i(h) = 11h + 0 - 8h2 + 14h*3 - 3 - 2. Let f(b) = -9b*3 + 5b*2 - 7b + 3. Let s be (-33)/2210/(-3). Determine si(c) + 8f(c). -2c*3 - c - 1 Let y(v) = -4v + 1. Suppose -r + 13 = 2a, r = -a - 4r + 20. Let n(p) = p. Let d(o) = an(o) + y(o). Let l(h) = h + 2. Determine -3d(m) + 2l(m). -m + 1 Let l(u) = u3 - 6u*2 + 6u + 5. Let g(r) = r*3 - 7r*2 + 7r + 6. Let a be 41/(-7) - 5/35. Determine ag(v) + 7l(v). v*3 - 1 Let h(a) = -58a - 2. Let c(g) = 57g + 2. What is 5c(o) + 4h(o)? 53o + 2 Let q(r) = -19r + 5. Let a(b) = b + 1. Determine 4a(n) - q(n). 23n - 1 Suppose 0 = 2p + 4 - 2, 13 = -3t + 5p. Let s be 4/3 - t/9. Let x(u) = 2u2 - 9u - 3. Let v(d) = d*2 - 4d - 1. Give sx(h) - 5v(h). -h*2 + 2h - 1 Let o(q) = -2q + 3. Let f(v) = -v2 + 3v - 4. Let k be (-9)/6(-56)/21. Calculate ko(n) + 3f(n). -3n*2 + n Let v(u) = u. Let x be v(7). Let c(a) = a - 17 - xa - 4a2 + 2a*2 - 9a. Let w(k) = -10 + 2 + k - k*2 - 8k. Calculate 6c(z) - 13w(z). z*2 + z + 2 Let y(x) = x - 6. Let b(o) = o - 11. Calculate -3b(k) + 5y(k). 2k + 3 Let x(s) = -2s2 + 3s + 5. Let h(j) = 5j2 - 10j - 14. Determine 4h(b) + 11x(b). -2b2 - 7b - 1 Let j(w) = w. Let t(f) be the third derivative of f5/60 - f3/6 + 175f2. Let u(m) = m3 - 3m*2 - 5m + 5. Let x be u(4). What is xt(o) - j(o)? o2 - o - 1 Let q(m) be the third derivative of m5/60 + m4/12 - 8m*2. Let j be (-4)/(-10)(-7 - -2). Let i(z) = -2z. What is jq(b) - 2i(b)? -2b*2 Let o(r) = 4r*2 + 3r - 3r + 7. Let v(c) = -7c*2 - 13. Suppose m - 44 = 5m. Calculate mo(w) - 6v(w). -2w2 + 1 Let j(f) = -3f. Let r(v) = 14v + 28v - 30v. What is 21j(w) + 5r(w)? -3w Let u(a) = 7a3 + 5a - 5. Suppose -2h - 10 = 0, -19 - 11 = -5j + h. Let z(s) = 4s3 + 3s - 3. Determine jz(m) - 3u(m). -m3 Let g(q) = -q2 - q + 1. Suppose 6a - 4a + 2 = 0. Let u(r) = -r3 + r2 + r. Give ag(w) - u(w). w3 - 1 Let u = -11 - -11. Let v(x) = ux - 3 + 7x - 8x. Let a(r) = 2r + 8. What is 3a(b) + 8v(b)? -2b Let v(j) = -j - 1. Let o(f) = -60f - 66. What is 2o(a) - 132v(a)? 12a Let r(x) = 5x2 - x - 1. Let m(b) = 9b*2 - 2b - 2. Give 4m(t) - 7r(t). t*2 - t - 1 Let d(a) = -3a3 + a2 - 2a - 2. Let m(v) = 7v3 - v2 + 5v + 5. Calculate -5d(j) - 2m(j). j3 - 3j2 Let m(v) = -v2 + v. Let b(x) = 5x2 - 6x. Give b(j) + 6m(j). -j2 Let x(s) = 2s*2 + 4s - 4. Let o = -43 - -38. Let q(h) = -2h2 - 5h + 5. Determine ox(w) - 4q(w). -2w2 Suppose -11a = -3a + 16. Let y(k) = 4k2 - k. Let d(h) be the first derivative of h3 - 1. Calculate ay(v) + 3d(v). v*2 + 2v Let s(a) = -8a3 - 4a + 5. Let q(b) = -b*3 - b + 1. Let u(x) = x + 15. Let r be u(-11). Suppose -4n = 3m - 38, -rn = n - 25. Give mq(v) - s(v). 2v*3 - 2v + 1 Let t(k) = -19k2 - 7. Let i(j) be the third derivative of 13j*5/60 + 5j3/6 - j2. Calculate -7i(p) - 5t(p). 4p2 Let f = 81 - 74. Let m(l) = -2l*3 - 5l*2 - 7l + 7. Let x(q) = 2q3 + 4q*2 + 6q - 6. Calculate fx(a) + 6m(a). 2a3 - 2a*2 Suppose 0 = -4c + c + 15. Suppose a + 2a - r - 7 = 0, 2r - 10 = 0. Let g(u) = 2u2 + 2u - 4. Let p(q) = -3q2 - 3q + 5. Determine ap(y) + cg(y). -2y2 - 2y Let p(a) = -5a + 3a + 1 + 4a + a. Let i(f) = -f2 + f + 1. Give 2i(d) - p(d). -2d2 - d + 1 Suppose 0 = 3j - j - 2. Let z be 0/(-1 + j - 1). Let w(h) = -1 - 1 + 14h + 4 + zh. Let f(d) = d. Determine 12f(p) - w(p). -2p - 2 Let i(v) = 3v2 + 4v + 7. Let m be (-120)/(-16)(-3 + 1). Let y = m - -12. Let w(r) = 2r*2 + 2r + 4. Give yi(f) + 5w(f). f*2 - 2f - 1 Let k(t) = -4t + 8. Suppose 2c - 1 = c - 4r, r = c - 11. Let f(q) = q - 2. Give cf(g) + 2k(g). g - 2 Let i(w) = -6w*3 - 2w*2 - 2. Let j(h) = -5h3 - h2 - 1. Let a = -32 + 36. Give aj(s) - 3i(s). -2s3 + 2s2 + 2 Let h(l) = l2 - 1. Let u(w) = -8w2 - w + 4. What is 6h(m) + u(m)? -2m2 - m - 2 Let u(l) = -l + 2. Let j(n) be the second derivative of n3/3 - 2n*2 - 2n. Let b(d) = d*3 + 5d*2 - 7d + 7. Let r be b(-6). What is ru(g) + 6j(g)? -g + 2 Let s(l) = l3 - l2 - l. Let w(a) = 3a3 - 3a*2 - a - 14. Determine -s(i) + w(i). 2i*3 - 2i*2 - 14 Let v(g) = -6g*3 - 6g*2 - 5g + 5. Let p(o) = -o3 - o2 - o + 1. Calculate -5p(s) + v(s). -s3 - s2 Let w(t) = -t2 + 8t + 1. Suppose -8l + 33 = -111. Let k(b) = -b. Give lk(a) + 2w(a). -2a*2 - 2a + 2 Le	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.