Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
- 14 - 8 = 0. Let b be (-18)/n(-4)/(-6). Suppose -11 = by - 68. List the prime factors of y. 19 Suppose 0 = -3u - 5c - 50, u - 3c = 3u + 33. Let r be ((-24)/u)/(8/20). List the prime factors of 3 + (r - (4 - 1)). 2 Suppose 3h - 4c - 155 = 0, 4h - 213 = -0h - c. List the prime factors of h. 53 Suppose 5s - 7z + 2z - 440 = 0, 4s + 2z = 328. Suppose w = 5w - s. What are the prime factors of w? 3, 7 Let p(l) = l*2 + 2l - 4. List the prime factors of p(6). 2, 11 Let u = 3 + 7. List the prime factors of 605/25 - 2/u. 2, 3 Let q be 4 + (-1 - 0/1). List the prime factors of 5q4/6. 2, 5 Let y(a) = 5a2 + 2a + 1. Let w be y(-1). Suppose 3c - 4d - d = -22, -3d = wc + 10. Let m = 7 + c. What are the prime factors of m? 3 Suppose -4l - 8 = -0. List the prime factors of (-3)/l(-56)/(-6). 2, 7 Let c be 24/155/2. Suppose 8 = p - 0b - 3b, 60 = cp + 2b. What are the prime factors of p? 2, 7 Let f be 0 + -4 + 1 - 4. Let j(i) = i2 + 3i + 5. List the prime factors of j(f). 3, 11 Suppose -2i - n + 69 = 0, 2i + 5n - 62 = 11. Suppose -k + 3k + 4z = i, -2z - 29 = -k. What are the prime factors of k? 23 Let j = 27 + -25. What are the prime factors of j? 2 Suppose 2c + 4 = -2w, 13 = -0c + c - 2w. Suppose k + a = 2k - 7, 4k = -ca + 63. List the prime factors of k. 2, 3 Suppose 2y + 9 = 5y. Suppose 0 = -4r + 2i - 0i + 34, 3r = 4i + 28. Suppose -5z = 3c + 1, rc - yz = 3c + 55. What are the prime factors of c? 2 What are the prime factors of (-1 + -149)/(((-18)/(-4))/(-3))? 2, 5 Suppose -4j + 0q = 2q + 10, j - 5q = 25. Suppose -3a + 4t = -91 - 69, -2a + 5t + 116 = j. What are the prime factors of a? 2, 3 Suppose a + 2 = -0, -2 = q + 2a. Suppose 2k = k - q. Let h(i) = i3 + 4i*2 + 4i + 2. List the prime factors of h(k). 2 Let m = 205 + 35. What are the prime factors of m? 2, 3, 5 Suppose 5v - 128 = v. What are the prime factors of v? 2 Let d = 3 - 2. Let n(b) = -b - 39 + 10b*2 + 39. What are the prime factors of n(d)? 3 Suppose -5j = 3v - 2v - 9, v - 9 = -3j. Suppose 2q - 29 = 1. Let w = q - v. List the prime factors of w. 2, 3 Suppose 79 = 5w - 2s + 19, -48 = -4w + s. Suppose -102 + w = -5v. List the prime factors of v. 2, 3 Let q(p) = -8p3. Let u be q(-1). Suppose -us + 12s = 160. List the prime factors of s. 2, 5 Let z = 3 - 2. Suppose 3h - 2h = z, -b + 23 = -5h. Suppose 5a = -5, -23 - b = -4d + 3a. List the prime factors of d. 2, 3 Suppose 4h + 150 = 5a, -4a = -h - 0h - 109. What are the prime factors of a? 2, 13 Suppose -3z = -z - 4n - 4, 2n - 6 = -3z. Suppose 0j = -4r + 4j + 64, -zr + 40 = -4j. List the prime factors of r. 2, 3 Suppose -4q - 6 = -5q. List the prime factors of q. 2, 3 Suppose 3a - 24 = -2o - a, 11 = -2o + 3a. Suppose 2b + 2x = 98, ob + b - 107 = 5x. Suppose -d - d = -b. What are the prime factors of d? 2, 11 Suppose -5z - 45 = -2u, -4u + 3z = -0u - 83. Let w = u - -17. What are the prime factors of w? 37 Let b = -10 - -10. Suppose -4y = -by. Suppose 8 = -yt + 4t. List the prime factors of t. 2 Suppose 70 = 3s + 19. Suppose -15 - s = -v. List the prime factors of v. 2 Let f = 740 - 316. List the prime factors of f. 2, 53 Suppose 6x - 7x = -29. List the prime factors of x. 29 Let g(i) = -i*3 - 3i*2 - i - 1. Let y be g(-3). Suppose -7 - 3 = -4d + o, 2d + y = -3o. List the prime factors of 3/d48/9. 2 Suppose 2g = -0g - 4. Let t(m) = -3m*3. Let x be t(g). Suppose 0b + x = b + 5o, -b + 18 = -o. What are the prime factors of b? 19 Let c be (3 + (2 - 3))/(-1). Let p = -35 + 33. List the prime factors of 13 + 2/c + p. 2, 5 Let r be (3 - -53) + (2 - -2). Suppose -m + 3m = r. List the prime factors of m. 2, 3, 5 Let i = 23 - 16. Let c be (-2)/(-2) + 101. Let q = c - i. What are the prime factors of q? 2 Suppose 4h - 32 = -0h. Suppose -r - 3x - h = 0, 3r - 4x = -x + 36. What are the prime factors of r? 7 Let a = 251 + -100. What are the prime factors of a? 151 Let v(b) be the second derivative of 11/20b5 - 1/12b*4 + 1/6b*3 - 3b - 1/2b2 + 0. List the prime factors of v(1). 2, 5 Suppose 3d + 45 = i - 19, 2d + 220 = 3i. List the prime factors of i. 2, 19 What are the prime factors of 928/14 + 14/(-49)? 2, 3, 11 Let h(l) = l*3 - 4l - 3. Let m be h(-2). Let i be m/(-6) + (-14)/(-4). Suppose 0 = -f + ik + 4 + 4, -k + 7 = 2f. List the prime factors of f. 2 Let m be (-20)/50 + 1614/10. Suppose 0 = 6c - m - 67. List the prime factors of c. 2, 19 Let h be (0 - -1)/(1/(-17)). Let w = h + 25. List the prime factors of w. 2 Suppose -4m - 5i - 44 = 0, -3m - 30 = -2i + 5i. Let v be (-22)/m - 3/(-9). Let z = 0 + v. List the prime factors of z. 2 Let d = 42 + -18. Let i be (-2 + 1 - 2)-1. Suppose -ij + j = -d. What are the prime factors of j? 2, 3 Suppose 2p + 0t + 13 = t, p = 4t - 24. Let c be (-2)/p - 130/(-20). Suppose c = a - 2. List the prime factors of a. 3 Let y = 111 - 63. List the prime factors of y. 2, 3 Let w = 42 + -10. Suppose -5t + 28 = y, -3y = -y + 4t - w. List the prime factors of y. 2 Let c = -13 + 23. Suppose -2f = -4t + 46, -4t + c = 4f - 30. Suppose m - 3m = 3j - t, 44 = 5m + 2j. List the prime factors of m. 2, 5 Let x(o) = -16o + 58. What are the prime factors of x(-19)? 2, 181 Suppose -k = 5p - 80, -3k - 3p + 274 = -5p. List the prime factors of k. 2, 3, 5 Let u(o) = -41o. Let q be u(-1). Suppose q = s + 3w, -2s + 3w = 2s - 89. Suppose -5m = -2t - s, 3 = -2m + 5m + 3t. List the prime factors of m. 2 Let u(x) = x. Let f be u(1). Suppose n = 2w + 4n + f, -1 = -3w - 2n. Suppose -2k - 5j = -40, -5j - w = -21. List the prime factors of k. 2, 5 Let j(m) = 11m - 4. Let g be j(4). Let p = g - 25. What are the prime factors of p? 3, 5 Suppose 5i + 24 - 4 = 0. Let r = i + 6. Suppose 0 = -g - ro + 12, -25 = -2g - g + 5o. What are the prime factors of g? 2, 5 Suppose -5a - 2 = -6a. Suppose -5c + 2v + 3 = -1, 0 = -5v - 10. Suppose -24 = -4p + 4j, cj - a = -p + 2j. List the prime factors of p. 2, 5 Let s be (-15)/10(-16)/6. Suppose 20 = sl + 5z + 1, 0 = -l - 3z + 3. List the prime factors of l. 2, 3 Suppose 4g - 14 = -4k + 78, 0 = -5g - 15. Suppose 0 = -3n - 15, 2 - k = -2w + 4n. What are the prime factors of w? 2 What are the prime factors of (-4)/(2 - 60/27)? 2, 3 Let w = 5 - 14. Let u = 9 - w. What are the prime factors of u? 2, 3 Let d(t) = t*3 - 7t*2 - 2. Let u = 6 - -1. Let o be d(u). Let n = o - -12. What are the prime factors of n? 2, 5 Let y(n) = n + 2. Let h be y(-10). Let j = h + 12. Suppose 3q = jr - 51, -24 = -5r + 5q + 41. List the prime factors of r. 2, 3 Let j be -87(-2)/61. Let x = 48 - j. What are the prime factors of x? 19 What are the prime factors of (-42)/14 + 27 + 0? 2, 3 Let n = -10 - -14. Suppose 2v + 128 = nv. Suppose 0 = u + 3u - v. What are the prime factors of u? 2 Let z(r) = r + 5. Let c = -4 + 4. Let f be z(c). Let l(i) = -i*2 + 7i - 2. What are the prime factors of l(f)? 2 Suppose -w - 8 = -9. Let d = w + 14. List the prime factors of (-32)/(-10) - 3/d. 3 Suppose -10 = -3v - 82. Let z = v - -52. List the prime factors of z. 2, 7 Suppose 0 = 3m + 2m + 25. Let v = m - -16. What are the prime factors of v? 11 Suppose -4c + 2f - 16 = 0, 5c + 4f + 2 = 2f. What are the prime factors of ((-15)/c)/((-9)/(-36))? 2, 3, 5 Let k = -43 + 102. What are the prime factors of k? 59 Let h be ((-3)/2 - -2)16. Suppose l - h = -l. What are the prime factors of 2/(l/3)8? 2, 3 Suppose 0 = -2j - j. Suppose -4c - 15 - 13 = j. Let v = 0 - c. What are the prime factors of v? 7 Let m(b) = -6b - 3b*2 + 0 + 4 + 2b*2. Let q be 44/(-8) + (-2)/(-4). List the prime factors of m(q). 3 Let q = -112 - -79. Let l be 2/11 + (-1149)/q. Suppose -5u + 8u = 4h - l, 4h + 5 = -5u. List the prime factors of h. 5 Suppose -2n - 528 = -5p + 2n, 3n = 4p - 423. Let g = p - 77. Suppose -3q + q = -5c + g, 0 = 4c - q - 26. What are the prime factors of c? 7 Let h be (4/12)/((-1)/(-27)). Let c = 6 - 36. What are the prime factors of (-1)/((h/3)/c)? 2, 5 Suppose -4w + 4 = -2w. Suppose 24 = 4b - wb. What are the prime factors of b? 2, 3 Suppose 0 = 2*s - 0 + 8. List the prime factors of ((-16)/(-20))/(s/(-10))	{ "pile_set_name": "DM Mathematics" }
= -5.84296 + -0.14604. What is g rounded to one dp? -6 Let r = 29096 + -29095.99986493. What is r rounded to 6 dps? 0.000135 Suppose 10d = 13d + 39360. Let j be (-1)/(-4 - 52476/d). What is j rounded to the nearest 1000? 3000 Let k = 80948 + -34911. Let c = -68337 + k. What is c rounded to the nearest 1000? -22000 Let q = 82610299737.600000367 - 82610299788. Let j = q - -50.4. What is j rounded to seven decimal places? 0.0000004 Let o = -9 - -9.084. Let n = o + 39.916. Let t = n + -40.49. Round t to one decimal place. -0.5 Let r be (-2 - (0 + -54264))(60 + 456). Suppose 4q + 28497601 = q - 5i, -5q = -5i + 47495935. Let d = r + q. Round d to the nearest one million. 19000000 Let t = 682 + -687.37. Let m = t - 4.85. What is m rounded to the nearest integer? -10 Let c = -8318.989802 - -8319. Let h = -42.017198 + c. Let a = -42 - h. What is a rounded to three decimal places? 0.007 Let h(f) = 22f*3 - 3f*2 + 3f + 22. Let r be h(-4). Round r to the nearest one thousand. -1000 Suppose 2b - 113550 = 4b. Let t be (1 - b/6)/((-33)/44). Let l = -5928 - t. Round l to the nearest 100. 6700 Suppose -2j - 361 = -5q, j + 90 = -5q + 457. Let t = 65 - q. Let x be ((-1126)/t - 2)/((-33)/88). What is x rounded to the nearest 100? -400 Let n = -0.12 + 7.12. Let l = 10 + n. Let g = 16.94 - l. Round g to two dps. -0.06 Let l = -8751.2 - -8025.54. Round l to the nearest 100. -700 Suppose -25 = -w - 4w, 5f + 5w + 5 = 0. Let l be 2/12 + (-107)/f. Suppose lc - 7c + 880 = 0. Round c to the nearest one thousand. 0 Let s = -383308 - -545569. Let o = -162250.39948 + s. Let t = o + -10.6. Round t to 4 dps. 0.0005 Let k(d) = -414801d - 2831. Let f be k(-31). What is f rounded to the nearest one million? 13000000 Let j = 0.2406 - 0.240617696. Round j to 6 dps. -0.000018 Let d = -107147657631.00002902 + 107147659666. Let p = d + -2035. What is p rounded to 5 decimal places? -0.00003 Suppose -5w - 1933600 = 4c, -2299318 = 10w + 2c + 1567882. What is w rounded to the nearest one hundred thousand? -400000 Let r = -42.25 + -11.085. What is r rounded to the nearest integer? -53 Suppose -2o + 3388800 = -5u, 5o + u - 8472000 = 2u. Suppose 0 = 31g - 23g - o. Round g to the nearest 10000. 210000 Let y(n) = -4760n*2 - 190n - 1770. Let g(m) = -680m2 - 27m - 253. Let o(v) = -15g(v) + 2y(v). Let f be o(-11). Round f to the nearest 1000. 82000 Let p = 13460 - 12829.9. Round p to the nearest ten. 630 Let l = 19.02702249 + -19.027. What is l rounded to seven dps? 0.0000225 Let s = -4471.022839 - -4471. Round s to four dps. -0.0228 Let f = -3785 + 3749.19. Let i = f - -34. What is i rounded to the nearest integer? -2 Let l = 122.55 + -123. Let r = 6.85 + l. Let p = r + -6.40000568. Round p to 6 decimal places. -0.000006 Let m = -0.02 + 0.065. Let r = -586 - -586.0457. Let h = r - m. Round h to three decimal places. 0.001 Let t = 0.66 + 2.54. Let s = 2.98 - t. Let k = 0.2199961 + s. Round k to 6 decimal places. -0.000004 Let o = 17727 + -17726.99995392. What is o rounded to four decimal places? 0 Let n = -0.072602 - 0.339828. What is n rounded to three dps? -0.412 Let x = 0.0052 + 479.9948. Let n = -482.555 + x. What is n rounded to one decimal place? -2.6 Let b = 5.663 - -223.037. Let m = -239 + b. Let x = m - -10.2763. What is x rounded to 3 decimal places? -0.024 Let d = -7.002 + 0.102. Let p = d - -7.5. Let j = p - 0.60096. What is j rounded to 4 dps? -0.001 Let x = -28.3 - -205.3. Let w = -749251 - -749427.9522. Let z = x - w. Round z to 2 decimal places. 0.05 Let q = -44603 - -44594.3254. Round q to one decimal place. -8.7 Let c(w) = 10w2 + 17w - 98. Let b be c(19). Let z be (2/3)/((-1)/(-3)). Suppose -zn - p - 2p = -3825, -b = -2n - p. What is n rounded to the nearest 100? 1900 Let k = -249.8 + -19637.2. Let v = -19878.483 - k. Let w = v + -9. What is w rounded to one decimal place? -0.5 Let i = -1076.1568 + 0.1568. Let x = i - -1075.95716. Round x to two dps. -0.04 Suppose -10q + w + 3954180 = -7q, -4q - 2w + 5272230 = 0. Let u = -558059 + q. What is u rounded to the nearest one million? 1000000 Let i = -184.22592 - -184. What is i rounded to three dps? -0.226 Let m = 56.64 - -0.36. Let t = 57.00001808 - m. What is t rounded to six dps? 0.000018 Let s = -88.845 - -206.8. Let t = 120.4 - s. Round t to one decimal place. 2.4 Let q = 19620.000016218 - 19620. What is q rounded to 6 decimal places? 0.000016 Let n = -1.4794 + 3.5103. What is n rounded to one decimal place? 2 Let i = 12116 - 11888.55. What is i rounded to the nearest one hundred? 200 Let x = -5.098293 - -12.81789. Let i = 7.72 - x. What is i rounded to four dps? 0.0004 Let r = 1189.35776 - 1189. Let m = r - 0.4334. Let g = m + 0.074. What is g rounded to four decimal places? -0.0016 Let k = -6660 + 6697.955. Let z = 600 + -562. Let c = z - k. What is c rounded to two decimal places? 0.05 Let v = -35642 - -35641.57725. Round v to 3 dps. -0.423 Suppose 1839p - 1850p + 89661 = 0. What is p rounded to the nearest one thousand? 8000 Let f = 0.3 + -27.5. Let t = 29.033 + f. What is t rounded to 1 decimal place? 1.8 Let g = -219 - -218.02. Let j = g - -0.979999326. Round j to 7 dps. -0.0000007 Let g = -6.68396927 + 6.684. Round g to five decimal places. 0.00003 Let h = -110432 + 60892. Round h to the nearest 10000. -50000 Let t = 31982967893 + -31982456143.200248. Let x = 511743 - t. Let h = -6.8 - x. What is h rounded to five dps? -0.00025 Let i = -1.35 - -1.1. Let k = i + 0.2500575. What is k rounded to 6 decimal places? 0.000058 Let s = 5939 - 7085.4. What is s rounded to the nearest one hundred? -1100 Let b = -25372 + 25341.017. Let t = b + 31. Let q = t + -3.317. What is q rounded to zero dps? -3 Let d = 31.17 + -31.17363. Round d to four dps. -0.0036 Let w = -8945215 + 4420215. Round w to the nearest 100000. -4500000 Let z(y) = -4702y + 8. Suppose x - 36 = -8x. Let m be z(x). What is m rounded to the nearest 10000? -20000 Let s = 366.78 - 363. Let u = s - 2.2. Let r = u + -2.95. Round r to 1 decimal place. -1.4 Let h(v) = 2891v*2 - 4v + 10. Let z(c) = 2c2 + 5c - 9. Let s be z(-4). Let u be h(s). Suppose 35583 + u = -11w. Round w to the nearest 10000. -10000 Let w = -4.9788096 + -42.9206134. Let l = w + 47.9. Round l to 4 decimal places. 0.0006 Let n = 882.9 + -892.4952. Let v = -9.6 - n. Let x = -40.6952 + v. Round x to the nearest integer. -41 Let a be 360/(-42)(-3 - -1)-34097000. What is a rounded to the nearest 1000000? -585000000 Let w = 6.593 + 1.064. Let m = w + -18.78. Let n = m + 0.223. What is n rounded to the nearest integer? -11 Let w = -10048 - -10048.0054732. What is w rounded to four decimal places? 0.0055 Suppose -31 = 5n - 6n - x, 3n - 114 = 4x. Suppose nl - 9601 = 41399. Round l to the nearest 1000. 2000 Let h = 1776182163798 + -1776170016592.000208. Let s = -12147317 + h. Let o = -111 - s. Round o to five decimal places. 0.00021 Let o = 213.52 + -217. Let c = -2.7 - o. Let q = 2.03 - c. Round q to one dp. 1.3 Suppose 3j = 2r + 2470009, 4940015 = -41r + 37r + 5j. What is r rounded to the nearest 100000? -1200000 Suppose -2m + 3641423 = 44215. Suppose -3l + m + 3975052 = 0. Let i = -505448 - l. What is i rounded to the nearest 1000000? -2000000 Suppose 0 = -n + 2. Let j = -7084 + 12544. Suppose -j = 3y - nf, 2f - 3453 = 4y + 3827. What is y rounded to the nearest one hundred? -1800 Let d = -711.8599955741 - -711.86. Round d to seven decimal places. 0.0000044 Let m = -16.46 + 16.29591. Let r = 0.67172 + m. Let s = r - 0.505. Round s to three decimal places. 0.003 Let m(y) = y3 + 67y*2 - 18y - 61. Let t be m(-83). Let z be (-9)/(-12) - (-282361)/4. Let l = z + t. Round l to the nearest ten thousand. -40000 Let v be -137230471/622. Let h = 16147839 + v. Round h to the nearest 1000000. -34000000 Let u be 29 - (-2 + (-4)/(-4)). Suppose uv = 31v - 79. Round v to the nearest ten. 80 Let m = 3877.2 + -3987. Round m to the nearest ten. -110 Let v = 8117.34998 + -8117. Round v to three decimal places. 0.35 Suppose 369x = 341x + 2500372. What is x rounded to the nearest ten thousand? 90000 Let o = 0.75203 - 0.05213. What is o rounded to two decimal places? 0.7 Suppose 3z - 651 = -4y + 6y, 2y = -4z + 854. Suppose 4j + 0*j	{ "pile_set_name": "DM Mathematics" }
9 - 2f4 - 3f*2 + 4 to lf*2 + x + gf*4 + zf + mf3 and give l. -3 Express -15l*2 - 22l*2 - 19l*2 as il + dl2 + v and give d. -56 Rearrange -37a4 + 2 + a2 - 30a4 + 69a*4 + 4a*3 to the form ca*3 + ya*4 + i + sa*2 + ta and give i. 2 Rearrange (s + 3s - 3s + (-4s + 3s - s)(0 + 3 - 2) + 5s - s - 2s)(7 + 2 - 6) to rs + z and give r. 3 Express 10r*2 - 3r*2 - 8r*2 + (0r - 6r + r)(-6 + 3r + 6) + (4r - r - 2r)(0 + 2r + 0) in the form nr + sr2 + y and give s. -14 Rearrange 97m + 51m + 9m to the form sm + i and give s. 157 Express 2c*2 - 80c*2 + 188c*2 in the form s + dc + ac2 and give a. 110 Express 2q*2 - 9 + 2q4 - q2 - 8 + 2q + 2q*3 + 13 in the form tq*2 + f + hq*4 + rq*3 + gq and give t. 1 Rearrange w*4 - 567 - 24w + 564 + 0w4 to the form gw + cw3 + tw*2 + ow*4 + s and give s. -3 Rearrange (-3w + 2w - w)(4 - 1 - 2) - 2w + 27w - 15w to the form l + bw and give b. 8 Express 1 + 16o - 18o - 1 in the form ro + h and give r. -2 Express -89m - 97m + 194m as hm + p and give h. 8 Rearrange -2o*2 + 2 - 2 - o - 2o*2 + o + (1 - 1 + 2o*2)(1 - 5 + 1) - 8 + 8 + 12o2 to vo + co2 + j and give c. 2 Rearrange -36p*2 + 58p*2 + 68p*2 + 4p*2 to zp*2 + x + op and give z. 94 Express (2 - 2 + 2)(1 - x - 1)(-40x - 2x + 14x) in the form ox + a + kx2 and give k. 56 Rearrange -6h + 6h - 13h to the form o + uh and give u. -13 Rearrange (-15g - 23g + 17g)(1 - 2g - 1 + (0g - g + 2g)(2 + 1 - 1) + 3g + 2 - 2) to m + fg + yg*2 and give y. -63 Express 15p*2 + 22p*2 + 177 - 177 as fp + o + hp2 and give h. 37 Express (0m*3 + 0m*3 + 2m*3)(0 + 4 - 3) + 0m3 - 2m3 + m3 - 50 + 50 + 37m3 as km*3 + qm + dm2 + t and give k. 38 Express -5y + 0y - 6y - 8y in the form g + qy and give q. -19 Express 4 - p - 7 + 11 - p + 2p + 0p + (2p - 3p + 0p)(0 - 2 + 1) in the form a + qp and give q. 1 Express (-2 - 1 + 2)(-59 + 26 - 44)(5 - 2q - 5)(2q - 5q + q) in the form nq + dq2 + g and give d. 308 Express m3 + 3 + 4m*3 - 45m + 2m2 + 43m as im2 + gm + w + dm3 and give i. 2 Express -2l*3 - 2 + 0l*3 + 0l*3 - l + 0 as p + wl + jl2 + hl3 and give p. -2 Express t2 + 3t3 + 6t*3 - 3t*3 + 2t*3 in the form ut + at3 + h + lt*2 and give l. 1 Express 12n*2 + 8n*2 - 2n*3 - 22n*2 + 3n*3 - 1 as s + jn + mn3 + zn*2 and give z. -2 Express -d + 2d*2 - 19d*2 + d in the form cd + sd2 + w and give s. -17 Express (-2 - 11h*2 - 13h*3 - 19h*2 + 14h*3)(4 - 2 - 8) as zh + n + lh*2 + dh*3 and give n. 12 Express -k + 17k*2 + k - 23k*2 in the form hk*2 + t + xk and give h. -6 Express (0u + 6u + 4u)((1 + 0 - 2)(0 + 0 + u) + 5u - 4u - 2u) + 1 - u*2 - 1 in the form hu*2 + au + i and give a. 0 Express (4t - 3 - 2 + 3)(0t + t - 4t) in the form nt2 + ht + j and give n. -12 Express 4y - 5y - 4y in the form a + zy and give z. -5 Rearrange (f2 + f2 - 3f2)(-4 - 13 + 23) + 3f2 + 0f2 - f2 to the form uf2 + b + rf and give u. -4 Rearrange 2 + 0 + 107b3 - 109b*3 to jb*3 + db + zb2 + o and give o. 2 Rearrange 4x2 + x2 - 3x2 to r + tx + jx2 and give j. 2 Express -1 - 17w*4 + 8w4 - 1 + 1 + w2 as kw + hw*4 + z + ow*3 + yw*2 and give h. -9 Express 0d*3 - 2d - d + 5d - 2d*3 - 2d*2 in the form hd + yd2 + sd*3 + z and give h. 2 Rearrange -4 + 25f - f*4 + 2f*3 - 42f + 18f to the form hf*4 + x + yf*2 + gf*3 + bf and give x. -4 Rearrange (0l - 3l + 2l)(-1 + 1 - 10l)(-2l + 2l - l) to the form z + dl2 + gl + bl3 and give b. -10 Rearrange -2c*3 - 9c*3 - 2c - 3c + 2c to the form hc2 + jc + zc3 + b and give z. -11 Rearrange -7m*2 + 3m2 + m2 + 6 + 6m2 to om*2 + l + im and give o. 3 Express -4w2 - 6 + 0 - w2 as xw*2 + k + rw and give x. -5 Express (t - 2t2 - 2t + 0t2)(-47t - t - 119t)(2 + 0 - 1) in the form g + dt*3 + lt + pt2 and give p. 167 Express (-8r + r - 8r)(-11 + 11 + 12)(-1 - 2 + 5) as t + wr and give w. -360 Express 16z - 42z - 19z + (0z + 0z + z)(-2 - 1 + 2) as kz + r and give k. -46 Rearrange (-10y*3 - 102y + 102y)(-y - 1 + 1) to d + sy4 + my + gy2 + ay*3 and give s. 10 Express (0f2 + f2 + 0f2)(1 + 2 + 0f - 7f) in the form tf + vf*3 + mf*2 + p and give m. 3 Express -14p - 19p - 2 + 36p in the form zp + f and give z. 3 Express 49y*2 + 1107y - 1107y + (y - y - y)(-y + 0y + 0y) in the form cy2 + ry + u and give r. 0 Express -r*2 + 9r*2 - 5r*3 + 3r*3 + 0r*3 as u + sr + hr3 + jr*2 and give j. 8 Express (2c + 2c - 7c)(7c - c + 3c) + (-5c + 5c + c)(-2 + 2c + 2) - c + 2c*2 + c - 5c + 2c2 + 5c as q + wc2 + kc and give w. -21 Rearrange (2r + 4r - 4r)((-3r + 3r - 2r)(2 + 2 - 2) + (r + 5r + 2r)(-2 - 2 + 5)) to the form or*2 + z + sr and give o. 8 Express -3h2 - 3h*2 + 0h*2 + 2h*2 as gh + ch2 + k and give c. -4 Rearrange (0 + 0 - 4)(k + 0k + k + (-6k + k + 3k)(0 + 1 - 2) - 1 - 3k + 1) to the form ok + t and give o. -4 Rearrange -4s + 19 + s - s - 23 to f + ls and give f. -4 Rearrange -13x + 0x + 3x2 - 4x*2 to the form f + wx*2 + vx and give w. -1 Rearrange 9s4 - 8s*4 + 1 - 8s*3 + s + 5s*3 to ns*2 + js + zs3 + is*4 + x and give x. 1 Rearrange -42n*2 - 31n*2 + 77n*2 - 24n to the form jn2 + d + yn and give j. 4 Express (-4 + 0 + 2)(-4i + 4i - 2i + (-5i + 0i + 6i)(2 + 2 - 2) + i + 3 - 3 + 0 - 2i + 0) in the form di + v and give v. 0 Rearrange 2n + n2 + 3 - 6 + 3 to gn*2 + l + hn and give l. 0 Rearrange (4s + s - 3s)(-s3 + 0s3 - s3) + (s3 + s3 - 3s3)(0s + 31s + 20s) to cs*2 + is*4 + n + ps*3 + ys and give i. -55 Express (13z2 - 13z*2 + 4z*3)(6 + z - 6) - 4z3 + 4z*3 - 2z4 + (z4 - 1 + 6 - 3)(0 - 4 + 6) as tz + sz4 + gz*2 + qz*3 + k and give s. 4 Express (2a - a - 3a)(6a + 4a - 4a)(-2 - 3 + 3) in the form g + sa + xa*2 and give x. 24 Express 126 - 126 + 8u*2 as su*2 + wu + f and give s. 8 Express 2 + 5 - 2f2 - 4 - 1 + f3 + 5f in the form yf3 + of*2 + p + cf and give p. 2 Express -p*2 - 2p + p2 + p2 in the form wp2 + r + ap and give w. 1 Express (-c*2 + 5c - 5c)(2c - 4c + 6c) + 5c*2 - 2c*3 - 5c*2 in the form lc*2 + ic + m + hc3 and give h. -6 Rearrange 4 + 2a4 + a3 + 3a - 4 - 3 + 0a*4 to the form qa*4 + ia*3 + ca + da2 + l and give c. 3 Express (-9h - 25h + 14h)(0h*3 + 0h*3 - 2h*3) in the form l + qh*2 + mh + ph4 + zh*3 and give p. 40 Rearrange (-3 + 1 + 624d - 574d)(-2d + 0 + 0) to the form kd*2 + bd + q and give k. -100 Express (1 - 5 + 0)(-4g*3 - 5g*4 + 4g*3) in the form h + wg*2 + dg*3 + ig + tg4 and give t. 20 Express (4v - 3v + 0v)(-12v - 18v + 16v) as m + dv2 + iv and give d. -14 Rearrange -5h3 - 6 + 4h3 - h3 + 2h to the form kh + s + ah3 + wh2 and give a. -2 Express (3 + y2 - 3)(11 - 10 + 7) in the form d + hy*2 + fy and give h. 8 Express (-16 - 14 + 9)(-2 + 3 - 4)(-u*3 + 1 - 1) in the form bu + zu3 + w + su*2 and give z. -63 Rearrange 2o*2 + 0 - 2 + 4o*4 - 13o*4 to the form qo*3 + xo + b + co4 + mo*2 and give b. -2 Rearrange 8i*2 + 2i + 5i3 - 7i*2 - i to the form ti*2 + hi + gi3 + v and give t. 1 Rearrange (4 - 6 + 3)(-4 + 2 + 4)(-2m*2 + 0 + 0) to the form g + lm + tm2 and give t. -4 Express (-42n + 26n - 64n)(-3n*3 + 5n*3 + 0n*3) in the form on*3 + j + vn*4 + an + gn2 and give v. -160 Express c2 - 2 + 2 + 2c*2 in the form ic*2 + a + xc and give i. 3 Express (3 + 0 + 3)(-4 + 2p2 + 4) + 1 - 1 + p2 in the form y + qp + dp2 and give d. 13 Rearrange 3 - 2 - 2 + i2 to qi + vi*2 + z and give v. 1 Rearrange -3r*2 + 4r*3 + 5r*2 + 3r - 3r - 3r to the form br2 + z + tr*3 + cr and give c. -3 Rearrange 2 + 2x2 - x2 - 4 + 5x*2 to the form mx + f + lx2 and give l. 6 Rearrange -4w*2 + 3 - 5 + 15w**2 + 0 to o	{ "pile_set_name": "DM Mathematics" }
remainder when 153 is divided by 5. 3 What is the remainder when 762 is divided by 707? 55 Calculate the remainder when 298 is divided by 18. 10 Calculate the remainder when 3080 is divided by 257. 253 Calculate the remainder when 609 is divided by 10. 9 What is the remainder when 178 is divided by 46? 40 What is the remainder when 186 is divided by 21? 18 What is the remainder when 135 is divided by 37? 24 Calculate the remainder when 9844 is divided by 159. 145 What is the remainder when 1961 is divided by 27? 17 Calculate the remainder when 151 is divided by 17. 15 What is the remainder when 119 is divided by 20? 19 Calculate the remainder when 110 is divided by 39. 32 What is the remainder when 250 is divided by 29? 18 What is the remainder when 477 is divided by 4? 1 What is the remainder when 105 is divided by 66? 39 What is the remainder when 626 is divided by 198? 32 Calculate the remainder when 896 is divided by 69. 68 Calculate the remainder when 245 is divided by 41. 40 What is the remainder when 4295 is divided by 12? 11 Calculate the remainder when 54 is divided by 45. 9 Calculate the remainder when 349 is divided by 87. 1 Calculate the remainder when 850 is divided by 169. 5 Calculate the remainder when 666 is divided by 33. 6 What is the remainder when 1017 is divided by 14? 9 What is the remainder when 201 is divided by 102? 99 Calculate the remainder when 240 is divided by 72. 24 What is the remainder when 335 is divided by 147? 41 What is the remainder when 1053 is divided by 348? 9 What is the remainder when 338 is divided by 89? 71 What is the remainder when 2903 is divided by 94? 83 Calculate the remainder when 1652 is divided by 87. 86 What is the remainder when 8160 is divided by 22? 20 Calculate the remainder when 370 is divided by 126. 118 Calculate the remainder when 160 is divided by 36. 16 What is the remainder when 4415 is divided by 96? 95 What is the remainder when 121 is divided by 16? 9 What is the remainder when 1205 is divided by 71? 69 Calculate the remainder when 259 is divided by 90. 79 Calculate the remainder when 591 is divided by 27. 24 Calculate the remainder when 329 is divided by 183. 146 Calculate the remainder when 179 is divided by 171. 8 What is the remainder when 588 is divided by 329? 259 Calculate the remainder when 500 is divided by 62. 4 Calculate the remainder when 1377 is divided by 230. 227 Calculate the remainder when 401 is divided by 82. 73 What is the remainder when 1631 is divided by 508? 107 Calculate the remainder when 4120 is divided by 344. 336 Calculate the remainder when 350 is divided by 109. 23 What is the remainder when 57 is divided by 49? 8 Calculate the remainder when 909 is divided by 152. 149 Calculate the remainder when 1038 is divided by 95. 88 Calculate the remainder when 1402 is divided by 377. 271 What is the remainder when 43 is divided by 31? 12 What is the remainder when 1645 is divided by 277? 260 Calculate the remainder when 1050 is divided by 31. 27 Calculate the remainder when 21 is divided by 5. 1 Calculate the remainder when 413 is divided by 141. 131 What is the remainder when 174 is divided by 16? 14 Calculate the remainder when 221 is divided by 74. 73 What is the remainder when 328 is divided by 37? 32 Calculate the remainder when 38 is divided by 20. 18 What is the remainder when 10085 is divided by 104? 101 What is the remainder when 48 is divided by 13? 9 What is the remainder when 352 is divided by 124? 104 Calculate the remainder when 541 is divided by 16. 13 Calculate the remainder when 381 is divided by 105. 66 Calculate the remainder when 298 is divided by 6. 4 Calculate the remainder when 698 is divided by 192. 122 What is the remainder when 207 is divided by 13? 12 Calculate the remainder when 2669 is divided by 15. 14 What is the remainder when 118 is divided by 64? 54 What is the remainder when 693 is divided by 24? 21 What is the remainder when 28157 is divided by 19? 18 Calculate the remainder when 419 is divided by 70. 69 What is the remainder when 333 is divided by 40? 13 Calculate the remainder when 383 is divided by 21. 5 Calculate the remainder when 130 is divided by 9. 4 What is the remainder when 660 is divided by 177? 129 What is the remainder when 284 is divided by 25? 9 Calculate the remainder when 28 is divided by 5. 3 What is the remainder when 642 is divided by 23? 21 What is the remainder when 1589 is divided by 311? 34 What is the remainder when 518 is divided by 29? 25 What is the remainder when 9103 is divided by 253? 248 Calculate the remainder when 240 is divided by 54. 24 What is the remainder when 803 is divided by 195? 23 What is the remainder when 4941 is divided by 112? 13 Calculate the remainder when 295 is divided by 74. 73 What is the remainder when 360 is divided by 119? 3 What is the remainder when 629 is divided by 21? 20 Calculate the remainder when 151 is divided by 67. 17 Calculate the remainder when 955 is divided by 8. 3 What is the remainder when 162 is divided by 68? 26 What is the remainder when 13346 is divided by 142? 140 Calculate the remainder when 105 is divided by 30. 15 Calculate the remainder when 203 is divided by 3. 2 What is the remainder when 347 is divided by 22? 17 Calculate the remainder when 131 is divided by 79. 52 What is the remainder when 467 is divided by 39? 38 Calculate the remainder when 101 is divided by 18. 11 Calculate the remainder when 160 is divided by 54. 52 Calculate the remainder when 143 is divided by 12. 11 What is the remainder when 1961 is divided by 67? 18 Calculate the remainder when 343 is divided by 8. 7 What is the remainder when 1431 is divided by 356? 7 Calculate the remainder when 288 is divided by 36. 0 Calculate the remainder when 6549 is divided by 10. 9 Calculate the remainder when 1679 is divided by 60. 59 Calculate the remainder when 89 is divided by 53. 36 What is the remainder when 463 is divided by 47? 40 What is the remainder when 125 is divided by 38? 11 Calculate the remainder when 132 is divided by 39. 15 What is the remainder when 246 is divided by 31? 29 Calculate the remainder when 1415 is divided by 89. 80 Calculate the remainder when 165 is divided by 67. 31 What is the remainder when 287 is divided by 68? 15 What is the remainder when 1462 is divided by 131? 21 Calculate the remainder when 1165 is divided by 187. 43 What is the remainder when 681 is divided by 76? 73 What is the remainder when 134 is divided by 17? 15 What is the remainder when 122 is divided by 31? 29 What is the remainder when 1196 is divided by 577? 42 Calculate the remainder when 18 is divided by 9. 0 Calculate the remainder when 828 is divided by 165. 3 What is the remainder when 4017 is divided by 41? 40 What is the remainder when 1225 is divided by 602? 21 What is the remainder when 49 is divided by 25? 24 What is the remainder when 12501 is divided by 7? 6 Calculate the remainder when 742 is divided by 8. 6 Calculate the remainder when 838 is divided by 15. 13 Calculate the remainder when 79 is divided by 28. 23 What is the remainder when 1347 is divided by 25? 22 What is the remainder when 982 is divided by 22? 14 What is the remainder when 571 is divided by 88? 43 What is the remainder when 316 is divided by 29? 26 Calculate the remainder when 113 is divided by 30. 23 What is the remainder when 124 is divided by 13? 7 Calculate the remainder when 1053 is divided by 350. 3 What is the remainder when 755 is divided by 27? 26 Calculate the remainder when 94 is divided by 24. 22 Calculate the remainder when 464 is divided by 12. 8 What is the remainder when 1059 is divided by 14? 9 What is the remainder when 658 is divided by 129? 13 What is the remainder when 5612 is divided by 13? 9 Calculate the remainder when 367 is divided by 47. 38 What is the remainder when 474 is divided by 99? 78 What is the remainder when 197 is divided by 40? 37 What is the remainder when 46 is divided by 4? 2 Calculate the remainder when 150 is divided by 17. 14 Calculate the remainder when 222 is divided by 87. 48 Calculate the remainder when 1529 is divided by 51. 50 What is the remainder when 390 is divided by 211? 179 Calculate the remainder when 942 is divided by 41. 40 Calcula	{ "pile_set_name": "DM Mathematics" }
r. 5, s, -2, -4 Let r = 69/2 - 378/11. Sort 4, r, -4. -4, r, 4 Suppose -5r + 8 = -r. Let a be r/3(-1)/2. Let x = 4 + -9. Sort 1/5, x, a in decreasing order. 1/5, a, x Let h be (-14)/10 - 3/5. Sort h, 5, 7, -1 in descending order. 7, 5, -1, h Let z(a) = -a*3 - 10a*2 - a - 10. Let n be z(-10). Put 5, -3, n in ascending order. -3, n, 5 Let h = -0.3 - -4.3. Let y = h - 3. Let d = 1125 + -10127/9. Sort y, d, 1/2 in increasing order. d, 1/2, y Let i(v) = -2v - 3. Let k be i(4). Let s be (-4)/16 + k/20. Let c = 6 - 1. Sort c, -3, s. -3, s, c Let h = -162.02 - -160. Let p = h - -2. Sort 3/7, p, -2 in increasing order. -2, p, 3/7 Suppose -8c + 3c = 0. Sort 1, 5, c in ascending order. c, 1, 5 Suppose 2v + 8 = -2. Suppose h + 3y = -2h - 3, -4y - 12 = 0. Let u be (9/21)/(h/(-7)). Put v, u, 2/3 in increasing order. v, u, 2/3 Let o = -1 - -2. Let x = -0.1 - 2.9. Let v = o - x. Sort 0, v, 3/7 in decreasing order. v, 3/7, 0 Let j(q) = -q*2 - 11q - 8. Let o be j(-10). Let n be 2/o + -3 + 3. Sort -0.1, n, 3 in ascending order. -0.1, n, 3 Suppose -h + 11 = 4k, 3k - 3h + 0 = -3. Let g(s) = 2s - 4s + s + 2s3. Let b be g(1). Sort k, -4, b. -4, b, k Let c = -0.066 + -8.934. Sort c, 3/2, -4, -3/5. c, -4, -3/5, 3/2 Let p be 296/420 - 8/60. Sort p, 0, -5. -5, 0, p Let c(f) = -f2 + 7f + 3. Let h be c(7). Sort -4, -2, h in descending order. h, -2, -4 Let i = -22.6 + 23. Put i, 0.02, 1 in descending order. 1, i, 0.02 Let o = 1.72 + 3.2. Let a = o + 0.08. Put -2/7, a, 2 in ascending order. -2/7, 2, a Suppose 2p + 3y + 1 = 0, -p + 6p = 4y - 37. Sort p, 5, -2 in increasing order. p, -2, 5 Let w = -218 + 215. Sort -12, -4, -5, w. -12, -5, -4, w Let b be (8/(-16))/(2/4). Let m(o) = 3o + 1. Let j be m(-3). Let a = 12 + j. Sort a, b, -2 in decreasing order. a, b, -2 Let o = -2.8 - -7.8. Let a = 4.6 - 5. Sort o, 0.1, a in increasing order. a, 0.1, o Let d = -31/48 + -1/48. Put d, 0.5, 1 in increasing order. d, 0.5, 1 Let h = -75 + 77. Let g = -1.97 + -0.03. Put g, -3, h in decreasing order. h, g, -3 Suppose -6h + 9 = 27. Put h, 3, 0 in decreasing order. 3, 0, h Let s = 20 + -19.7. Put -5, 3/2, s in decreasing order. 3/2, s, -5 Let a be (2/(-3))/((-2)/9). Suppose -6 = -2i + 4. Suppose -ac - it - 7 = 0, c - t = 1 - 6. Put 4, c, 3 in decreasing order. 4, 3, c Let z be 1 + 22/(-12) + 1. Let b = 57.3 + -44. Let o = b - 13. Sort o, z, -2/7. -2/7, z, o Let w = -0.14 - 0.06. Let s = 1 + 3. Sort s, w, 0.1. w, 0.1, s Let f = 340 - 325.3. Let t = f + -15. Sort 0, -0.5, t in increasing order. -0.5, t, 0 Let u(o) = -2o2 + 9o. Let p be u(5). Sort p, 5, -3, 4 in increasing order. p, -3, 4, 5 Let d(g) = g - 3. Let q be d(4). Sort q, 0, -5. -5, 0, q Let p = 61/92 + 2/23. Let v = -33 + 33.5. Let l = -9 + 13. Sort v, p, l in descending order. l, p, v Let s = -16 + 39. Let w = s - 93/4. Put -0.4, w, 0.4 in ascending order. -0.4, w, 0.4 Let w(j) = -j + 6. Let p be w(8). Suppose -5 + 2 = -n. Let o be 5 + 2/2 + -2. Sort p, o, n in descending order. o, n, p Suppose o - 4 = 0, 3z + o + 1 = -4. Let q be (-6)/2 - (-17 + 9). Sort 0, q, z in decreasing order. q, 0, z Let d = -74 - -75. Put 5, -4/7, d, -3 in descending order. 5, d, -4/7, -3 Let u = 0.22 - -0.08. Let a = 211685/33 - 6416. Let z = a + 18/11. Put z, 1/4, u in descending order. z, u, 1/4 Let o = -2 - -5. Let g = 3990 - 19507/5. Let m = g + -89. Sort m, 0.5, o in decreasing order. o, 0.5, m Let h = -4 + 9. Put h, -3/8, 3/4 in decreasing order. h, 3/4, -3/8 Let p = -113.9 - -114. Let n be (0 + (-1)/(-11))2. Sort -2, n, p. -2, p, n Let l(t) = -t*2 + 5t + 6. Let b be l(6). Suppose -6 = -bc + 2c. Put c, 5, -5/4 in descending order. 5, -5/4, c Suppose -2z - p = -8, 6p = 5z + 3p - 42. Let a(g) = -g + 4. Let b be a(z). Suppose 0l + j = -2l - 6, -2l - 5j - 22 = 0. Sort 5, b, l in ascending order. b, l, 5 Let t be -10(-4 + 17/5). Let n be ((-12)/14)/(t/3). Put -2, -1/4, n in descending order. -1/4, n, -2 Suppose 6 - 1 = -f. Let u(g) = -g2 - 8g - 7. Let l be u(-6). Suppose -5v + m + 4m = 20, -2m = -4. Put f, l, v in increasing order. f, v, l Suppose -2x + 15 = -5d, -5d + 12 = -2d + 3x. Let v = 10 + -10.11. Let q = 0.29 - v. Sort q, d, 0.5. d, q, 0.5 Let y = -177 - -353/2. Put 15, y, 0.1, 0.4 in decreasing order. 15, 0.4, 0.1, y Let n = -6 + 5. Let w = -4 - n. Sort 4, 0, w in decreasing order. 4, 0, w Let x be (-78)/((-4)/2)-21. Let g be 1734/x + 1 + 1. Let h = -1/39 + g. Sort -0.1, h, 3 in increasing order. h, -0.1, 3 Let u = 11 + -10.56. Let v = u + -0.04. Let w be 2/(-5) + (-154)/(-35). Put -3/8, v, w in increasing order. -3/8, v, w Let x be 6/(-9)6/4. Sort 3, x, -5 in ascending order. -5, x, 3 Let g be (2/4)/(20/24). Sort -3/2, -2, g in decreasing order. g, -3/2, -2 Suppose 4p - 10 = 110. Let f be (-2)/6(-20)/p. Sort f, 2/5, -0.2 in increasing order. -0.2, f, 2/5 Let z be 10/(-2) - (0 + -1). Suppose -2c = 4r + 16, 2r - 2c - c - 8 = 0. Sort r, -3, z. z, -3, r Let y be -5 - (12/(-3) + 2). Let c = -0.42 - -0.12. Put y, -2, c in decreasing order. c, -2, y Suppose -3w = j - 13, -2w = -j + 2j - 10. Let s be (-174)/(-54) + j/(-18). Sort 1, -8, s in ascending order. -8, 1, s Suppose -2w = 4n - 40, -10 = -2n - 3n. Suppose 4a = -0a + w. Suppose 4k + 0y = 5y - 3, -y - 11 = 5k. Put a, -3, k in decreasing order. a, k, -3 Let y = 1 - -9. Let f = -14 + y. Let q(h) = -h - 3. Let j be q(f). Sort -1/2, -4/5, j in decreasing order. j, -1/2, -4/5 Let f(p) = -2p - 4 + 3p - 2. Let c be f(7). Let i = -8.4 - -8.6. Sort c, i, 5. i, c, 5 Let u = -80.47 + 80. Let h = u - 0.03. Let t = 0.4 + 3.6. Sort h, 3, t in increasing order. h, 3, t Suppose 5h + 12 = a - 8, 0 = -a + 5. Let l(o) = -o*2 - 4o - 2. Let p be l(h). Let y = 2 - p. Sort y, -2/13, 0.1 in decreasing order. y, 0.1, -2/13 Let x = 247/4 - 62. Let b = 59.69 + -60. Let s = -0.09 + b. Sort x, s, 2/5 in ascending order. s, x, 2/5 Let o = 15 + -14. Suppose -4 = m, -2g + 0m = -m - 44. Suppose -3w - 35 + 16 = 4x, -5x = 3w + g. Sort 5, w, o in descending order. 5, o, w Let i be (-2)/8 - (-3)/(-4). Let x be -5 - (-4 - -8 - 4). Sort i, x, 5 in descending order. 5, i, x Suppose -5x + 7r = 2r, 4x = 5r. Put x, 2, -1 in descending order. 2, x, -1 Let r = -1/165 + 502/1155. Sort r, 2/11, 0.2. 2/11, 0.2, r Suppose -5d = -13 - 2. Sort d, -3, -0.3, 1 in decreasing order. d, 1, -0.3, -3 Let x be -2 - ((-140)/(-290))/((-1)/4). Let o = -7 + 2. Sort x, 1/4, o in descending order. 1/4, x, o Let a be ((-155)/3)/(2/6). Let w be a/(-15)42/40. Let n = -45/4 + w. Sort n, -2, 2/3 in descending order. 2/3, n, -2 Let k = -4 + 5. Suppose -2 = 3h + 4. Let l be 2h/((-32)/3). Put l, k, -1/2 in decreasing order. k, l, -1/2 Let y be ((-6)/(-44))/((-6)/8). Sort -3, y, 0.2 in ascending order. -3, y, 0.2 Let w be ((-1)/(-4))/((-6)/8). Let j(x) = x2 + 3x - 6. Let n be j(-5). Sort n, -4/7, w in decreasing order. n, w, -4/7 Suppose 16x = 15x + 2. Sort -0.2, -1/3, x, 5 in increasing order. -1/3, -0.2, x, 5 Let u = 12 - 13. Let r = 6 + -10. Sort r, u, 0 in descending order. 0, u, r Let j = -15/14 - -103/70. Let v = -0.011 - 3.989. Sort -2, v, j in ascending order. v, -2, j Let f = -0.1 - -0.06. Let u = f + 5.04. Sort 1/4, 0.5, u. 1/4, 0.5, u Let q(t) = -t + 8. Let y be q(6). Let x be 106/22 + 16/88. Sort 4, y, x in descending order. x, 4, y Suppose 9 = g - 3. Let a be g/21(-21)/6. Put 1, 5, a in descending order. 5, 1, a Let f = 25 - 23. Put f, 1/10, 13 in decreasing order. 13, f, 1/10 Let h = 35 + -38. Sort h, -7, 0, -4 in ascending order. -7, -4, h, 0 Suppose 0 = m + 1 - 2, 0 = -4x - 4m - 80. Let a = x + 17. Suppose -z = 5l - 5z - 16, 15 = 3l + 3z. Sort l, a, -1 in increasing order. a, -1, l Let m(u) be the first derivative of u4/4 + 7u*3/3 + 7u*2/2 + 2u + 2. Let o be m(-6). Let v = -3 - o. Sort -1, v, 3 in descending order. 3, v, -1 Suppose -3o - 12 - 12 = 0. Put 5, o, 2, 4 in decreasing order. 5, 4, 2, o Let k be (-8)/(-36)1 - 44/(-45). Put -5, k, -0.7 in increasing order. -5, -0.7, k Let y(l) = -l + 2. Let p be y(-4). Let h = p - 3. Suppose t = 2v + hv - 5, 5t = 4v - 25. Sort -2, v, -4. -4, -2, v Let g = -2.08 - -2. Let l = 0.38 + g. Let i = -0.1 - l. Put i, 0.3, -0.2 in descending order. 0.3, -0.2, i Let f = 0.08 + 27.92. Let c	{ "pile_set_name": "DM Mathematics" }
t is 4 + 53? 57 In base 11, what is 21 - -10? 31 In base 9, what is 27 - 0? 27 In base 9, what is -1 + -7323? -7324 In base 4, what is -130 - -332? 202 In base 6, what is 1 - -3042? 3043 In base 6, what is 1 + 320? 321 In base 6, what is -55403 + 4? -55355 In base 9, what is 817 + -4? 813 In base 8, what is 71 - -35? 126 In base 12, what is 4 + -1a? -16 In base 14, what is -79 + -2? -7b In base 16, what is 85 - -a? 8f In base 11, what is 5 - a85? -a80 In base 3, what is -122112 + -12? -122201 In base 13, what is -68c - 1? -690 In base 8, what is -1 - 314? -315 In base 3, what is -110022 - 2202? -120001 In base 8, what is 24 + 23? 47 In base 14, what is -22 - 1d? -41 In base 12, what is 9 + -198? -18b In base 5, what is 141 + -13? 123 In base 2, what is -111 - 1? -1000 In base 15, what is 5 - -3? 8 In base 6, what is -11433 - -4? -11425 In base 10, what is 2586 - 4? 2582 In base 13, what is b26 - 2? b24 In base 7, what is 2403 - -6? 2412 In base 2, what is 10010101110 + -100? 10010101010 In base 6, what is 4 + 1132? 1140 In base 14, what is -9 - -11a? 111 In base 4, what is -2 + -1301002? -1301010 In base 11, what is 16 + -2? 14 In base 7, what is -13315 + 6? -13306 In base 15, what is a1 - -c? ad In base 15, what is 76 + c2? 148 In base 2, what is 100 + -1011100? -1011000 In base 4, what is -2 + 22102? 22100 In base 8, what is -20 + 36? 16 In base 6, what is 12551 + 5? 13000 In base 15, what is a - 6? 4 In base 8, what is -14 - 13? -27 In base 7, what is -42 + -1? -43 In base 15, what is -4 - 175e? -1763 In base 14, what is 1 + c? d In base 9, what is 246 + 1? 247 In base 16, what is -8d - -14? -79 In base 11, what is -29 - -7? -22 In base 13, what is -93a + -6? -943 In base 3, what is -22 + 1020011? 1012212 In base 3, what is -10 - 21? -101 In base 10, what is -46 + 8? -38 In base 2, what is 0 + -101101010? -101101010 In base 12, what is 9 - -33? 40 In base 16, what is -f17 + -3? -f1a In base 11, what is -1 - 39? -3a In base 5, what is -4 - 14? -23 In base 14, what is 0 - 172? -172 In base 13, what is -5b - -4? -57 In base 10, what is 3 - 2060? -2057 In base 4, what is 10 + -10321? -10311 In base 13, what is 135 - 0? 135 In base 8, what is 6667 + 3? 6672 In base 11, what is -88 - 24? -101 In base 3, what is 111 + 2? 120 In base 4, what is -32313 + -13? -32332 In base 16, what is -2cb - 14? -2df In base 11, what is -4 + 374? 370 In base 11, what is 4 + -3a? -36 In base 3, what is -2000112 + 10? -2000102 In base 14, what is -16 - 29c? -2b4 In base 9, what is 2 - 3461? -3458 In base 16, what is 2 + 19c? 19e In base 12, what is 3 - 847? -844 In base 8, what is 4 + -4704? -4700 In base 4, what is -313013 - 3? -313022 In base 16, what is 4 + 320? 324 In base 10, what is 48 - 84? -36 In base 15, what is -8c + 2? -8a In base 5, what is 12 + 2001? 2013 In base 9, what is 1 + 250? 251 In base 5, what is 204 - 4? 200 In base 14, what is 3c - 3? 39 In base 10, what is 57 + 10? 67 In base 7, what is 0 + 24514? 24514 In base 6, what is 1 + 33? 34 In base 2, what is 0 + 100001? 100001 In base 5, what is -21 - 20? -41 In base 10, what is 86 - 0? 86 In base 8, what is -315 + -11? -326 In base 11, what is 219 + -5? 214 In base 6, what is 40423 + -5? 40414 In base 16, what is d6 - 1? d5 In base 13, what is 35 - c? 26 In base 5, what is 33 - -1004? 1042 In base 12, what is -1a7 - 1? -1a8 In base 15, what is 37 + 1? 38 In base 5, what is -1 + 31? 30 In base 4, what is -11 - 1010? -1021 In base 2, what is -1000 + -101111101? -110000101 In base 12, what is 0 + 65? 65 In base 5, what is -114 + -4? -123 In base 8, what is -25 - 21? -46 In base 5, what is 3 + -200? -142 In base 5, what is -114 - 21? -140 In base 8, what is -2 + 41? 37 In base 4, what is -3 - -223? 220 In base 12, what is -5 - -61? 58 In base 4, what is 2012 + -212? 1200 In base 11, what is -5 + 66? 61 In base 15, what is 759 - -8? 762 In base 6, what is -32 - -250? 214 In base 12, what is 200b + 4? 2013 In base 4, what is -130 + 20? -110 In base 4, what is 130 + -20? 110 In base 2, what is 10101101111000 + 100? 10101101111100 In base 12, what is b + -52? -43 In base 7, what is -4 - -6? 2 In base 6, what is -102 + 31? -31 In base 7, what is -5 - 51? -56 In base 16, what is -58 + -d? -65 In base 15, what is -9 + -492? -49b In base 16, what is 0 - fac? -fac In base 6, what is 13 + 5120? 5133 In base 15, what is 3 - 14b1? -14ad In base 6, what is -1 + 1333? 1332 In base 4, what is 2232 - 0? 2232 In base 10, what is -2 - 1214? -1216 In base 10, what is -96 - 10? -106 In base 8, what is 4 + -2? 2 In base 13, what is -1 - -51? 50 In base 9, what is -67 + -1? -68 In base 2, what is 110 + 1010? 10000 In base 13, what is -4a - 4? -51 In base 9, what is -14 - -24? 10 In base 13, what is -59 - 2? -5b In base 12, what is 3 + -23b? -238 In base 15, what is -3 + -b0? -b3 In base 9, what is -14 - -2? -12 In base 10, what is -4 + -532? -536 In base 15, what is -7 - 917? -91e In base 8, what is -14 - 26? -42 In base 12, what is -5 - -28? 23 In base 7, what is 2 + -143? -141 In base 9, what is -105 + -142? -247 In base 6, what is -2024 + -154? -2222 In base 15, what is -24 + 1? -23 In base 10, what is 3 + 60? 63 In base 8, what is 5 + -2766? -2761 In base 15, what is 18 - e? 9 In base 5, what is 11 + -13? -2 In base 10, what is -148 + 3? -145 In base 4, what is 1 - 3303? -3302 In base 3, what is -1 + 1122? 1121 In base 12, what is 2 - 3? -1 In base 9, what is 4 - 163? -158 In base 16, what is 0 + -373? -373 In base 16, what is 5 + 783? 788 In base 3, what is -1 + 1121? 1120 In base 2, what is -1011 - 10? -1101 In base 10, what is -2 - 9427? -9429 In base 11, what is -718 + 2? -716 In base 6, what is 44 - -122? 210 In base 15, what is b + 66? 72 In base 14, what is 2 - -1a6? 1a8 In base 16, what is -4 - -14f3? 14ef In base 14, what is -562 + 4? -55c In base 5, what is -312 - 11? -323 In base 8, what is 166 + -3? 163 In base 12, what is 10b + 4? 113 In base 10, what is 1630 + -4? 1626 In base 9, what is 54 + 114? 168 In base 8, what is 37 - -122? 161 In base 6, what is 2 + 530? 532 In base 12, what is -2b1 - 3? -2b4 In base 7, what is -43 - 3? -46 In base 16, what is -2e + 3a? c In base 10, what is 2 + -155? -153 In base 14, what is c39 + 4? c3d In base 4, what is -1032 + 20? -1012 In base 4, what is -230 - 100? -330 In base 15, what is 9234 - -1? 9235 In base 4, what is -1311 - 3? -1320 In base 11, what is 606 + 3? 609 In base 5, what is 401 - 0? 401 In base 15, what is 594 - 10? 584 In base 12, what is -1b - -13? -8 In base 5, what is 10 - 340? -330 In base 10, what is -5591 + 6? -5585 In base 6, what is 13 + 1014? 1031 In base 12, what is 4 + 6a? 72 In base 5, what is 0 + 2124? 2124 In base 13, what is 653 - -4? 657 In base 6, what is 2 + -140? -134 In base 5, what is 1 - 310? -304 In base 3, what is -121 + -1022? -1220 In base 14, what is -13 - -14? 1 In base 15, what is -76 - -c? -69 In base 12, what is 15 + 6? 1b In base 3, what is -211120 + -2? -211122 In base 15, what is e + 2d5? 2e4 In base 15, what is 7b - 9? 72 In base 3, what is 20 - 111002? -110212 In base 3, what is 201 + -111? 20 In base 15, what is -34 + 6? -2d In base 15, what is -10e + -1? -110 In base 16, what is -5 - -6? 1 In base 13, what is 9 - -48? 54 In base 16, what is 310e + -2? 310c In base 14, what is -5 - -9a2? 99b In base 2, what is -100000111011100 - -10? -100000111011010 In base 11, what is -5 - -87? 82 In base 2, what is -10 - 1000110? -1001000 In base 16, what is -5 - 14? -19 In base 4, what is -102 + -1302? -2010 In base 4, what is 1132 - 203? 323 In base 4, what is 2112 + 133? 2311 In base 11, what is -1 - 2a8? -2a9 In base 15, what is 13 - 1? 12 In base 6, what is 0 - -201? 201 In base 12, what is 4 + -60? -58 In base 4, what is -100 + 3222? 3122 In base 12, what is -2 + -a32? -a34 In base 16, what is 3d + 5? 42 In base 12, what is -1 - -5? 4 In base 4, what is 11 + -11020? -11003 In base 8, what is -6 + -57? -65 In base 16, what is 3c + 6? 42 In base 13, what is 8b - 5? 86 In base 9, what is -637 + -5? -643 In base 15, what is 5 - -10e? 114 In base 11, what is -349 + 4? -345 In base 5, what is -4 - 134? -143 In base 15, what is 3 - -3bd? 3c1 In base 9, what is 4 - -81? 85 In base 14, what is 15b + 5? 162 In base 5, what is -212 -	{ "pile_set_name": "DM Mathematics" }
ase 2, what is 10000001000010110 + -10111? 10000000111111111 In base 8, what is -62734 + -13? -62747 In base 12, what is -34433 - -2? -34431 In base 7, what is 5 + -112250? -112242 In base 10, what is -732051 - -3? -732048 In base 12, what is -3 - 8301? -8304 In base 6, what is -1312 - 1555? -3311 In base 14, what is -8 + -2ba0? -2ba8 In base 16, what is 3 - -1b05? 1b08 In base 5, what is 3 + 211002022? 211002030 In base 16, what is -586 + -2? -588 In base 10, what is -56484 + 1? -56483 In base 15, what is 0 - -15e79? 15e79 In base 3, what is 10201221 - 1111? 10200110 In base 14, what is c5b5 - 5? c5b0 In base 10, what is 5 + 482228? 482233 In base 9, what is 2686 + -47? 2638 In base 10, what is -513351 - -3? -513348 In base 15, what is c + -2066? -2059 In base 4, what is 12000132 + -121? 12000011 In base 13, what is -141bb + -5? -141c3 In base 3, what is 0 + 122112222? 122112222 In base 3, what is -1020212221 - -10? -1020212211 In base 12, what is -3811 - 1? -3812 In base 2, what is 11111100001 + -1100? 11111010101 In base 7, what is 1166 + 233? 1432 In base 8, what is 353 + -540? -165 In base 2, what is -111110001111 + 1101? -111110000010 In base 4, what is 21223 + -332? 20231 In base 3, what is -20221 - -21110? 112 In base 2, what is 101100 + -10100110110010? -10100110000110 In base 6, what is -111241454 - 4? -111241502 In base 7, what is -142344316 - 5? -142344324 In base 14, what is -119c - -2a3? -cd9 In base 15, what is 1 - 178? -177 In base 7, what is -10005 + -13? -10021 In base 15, what is -22 + -4baa? -4bcc In base 3, what is 0 - 100122111? -100122111 In base 6, what is 12533 + -11501? 1032 In base 12, what is -5 + -1544? -1549 In base 7, what is -44 - 333? -410 In base 2, what is 1010011011 + -111000000? 11011011 In base 3, what is -211 + 221221? 221010 In base 2, what is 100110010011 - 10010? 100110000001 In base 12, what is 3 - -2a6744? 2a6747 In base 13, what is 2 + 2a99a? 2a99c In base 5, what is 102134 + -124? 102010 In base 9, what is -135 - 1021? -1156 In base 10, what is 125 - -3446? 3571 In base 8, what is -2 + -123052? -123054 In base 12, what is 426a5 - 5? 426a0 In base 10, what is 6 - -221216? 221222 In base 14, what is d75 - -4a? dc1 In base 15, what is 4 + 46ce? 46d3 In base 14, what is 602a - -18? 6044 In base 16, what is -12b071 + 5? -12b06c In base 8, what is 324427 + 7? 324436 In base 6, what is 21022 - -15? 21041 In base 12, what is 5 + -326466? -326461 In base 12, what is -b42 - 1ba? -1140 In base 9, what is -4 + 406627? 406623 In base 10, what is -60564 - -1? -60563 In base 12, what is -3 - 13b956? -13b959 In base 9, what is 16524 - -4? 16528 In base 12, what is -1 + -5719a? -5719b In base 5, what is -3244 + 2030? -1214 In base 7, what is -4 + -5652266? -5652303 In base 16, what is -279 + -f92? -120b In base 12, what is -a24 + 162? -882 In base 9, what is 6706 + -30? 6666 In base 6, what is -245453 + 33? -245420 In base 14, what is -1 - -5582b? 5582a In base 15, what is 3c + 675b? 6798 In base 14, what is -74 - -256? 1c2 In base 11, what is 5821a + -6? 58214 In base 15, what is -c - -bc2b? bc1e In base 14, what is c61 - 5bc? 683 In base 15, what is 5e0c + b? 5e18 In base 14, what is bcc98 + 0? bcc98 In base 6, what is 1512 - 445? 1023 In base 2, what is -100 - 11011001110100000? -11011001110100100 In base 16, what is 145da - 2? 145d8 In base 6, what is -1 + -115512? -115513 In base 2, what is -101 + 10010001011110111001? 10010001011110110100 In base 15, what is -d4a9c - -6? -d4a96 In base 9, what is -4 - 26321? -26325 In base 5, what is -442304 + -1? -442310 In base 16, what is -13a23 - -1? -13a22 In base 10, what is -3075 + -383? -3458 In base 8, what is 16702 + -3? 16677 In base 12, what is 480a9 - 6? 480a3 In base 3, what is 10012120 - -100? 10012220 In base 7, what is -34101602 + 1? -34101601 In base 12, what is 0 - 2497? -2497 In base 4, what is -1 - -301100012? 301100011 In base 12, what is 11a8 + 18a? 1376 In base 5, what is -10 - -3340214? 3340204 In base 3, what is -10 + -22222121221? -22222122001 In base 5, what is -42 + -202223? -202320 In base 16, what is 27cf - 2? 27cd In base 9, what is -4 + 155422? 155417 In base 15, what is 109 - -d4? 1dd In base 16, what is 23 + -101? -de In base 5, what is -1 + -1344113? -1344114 In base 5, what is -2433 + -443201? -1001134 In base 14, what is 1 - 3090? -308d In base 12, what is 25 - 949? -924 In base 16, what is -69d - 11? -6ae In base 7, what is 5202 - -31? 5233 In base 2, what is -10011010001101110000 - -11? -10011010001101101101 In base 14, what is 17 + -29d4? -29bb In base 13, what is 2223b - 5? 22236 In base 15, what is d22 + 17? d39 In base 16, what is -4 + 5b94? 5b90 In base 10, what is 182 - 2842? -2660 In base 7, what is -2122 + 22? -2100 In base 13, what is 95c + -5? 957 In base 9, what is -24001 + 0? -24001 In base 11, what is 64 + -10593? -1052a In base 16, what is -54 - e2e? -e82 In base 13, what is 1 + -2c9a2? -2c9a1 In base 16, what is -12 + eda? ec8 In base 16, what is -2d59 + -3? -2d5c In base 6, what is -405 - -102? -303 In base 4, what is -22021 - -2303210? 2221123 In base 10, what is -261 - 3431? -3692 In base 10, what is -275 + -118? -393 In base 6, what is 101403 - -200? 102003 In base 12, what is -43 - -2677? 2634 In base 4, what is -11100103 - 102? -11100211 In base 16, what is -12b + 6c? -bf In base 15, what is 2 + 2c2? 2c4 In base 12, what is 241a + 17? 2435 In base 8, what is 37 - 52? -13 In base 3, what is 112000 - 21211? 20012 In base 15, what is 6bd - -3e0? aad In base 14, what is -4 + -1b14? -1b18 In base 4, what is 130310 + 12? 130322 In base 15, what is -1a4b3 - -3? -1a4b0 In base 16, what is 149 - -65? 1ae In base 9, what is 2 + 11023? 11025 In base 10, what is 1 + -15484? -15483 In base 10, what is -860 + 118? -742 In base 3, what is -1001120002 - -1? -1001120001 In base 6, what is -10054 + 35? -10015 In base 11, what is 123455 + 13? 123468 In base 6, what is -150 + -2433? -3023 In base 16, what is -376 - 158? -4ce In base 14, what is -c3 - -3d? -84 In base 7, what is 4255 + 146? 4434 In base 15, what is c + 55a? 567 In base 15, what is -7648 + -59? -76a2 In base 9, what is 237 + 214? 452 In base 13, what is bcba + 1a? c007 In base 16, what is -a + -f1f? -f29 In base 6, what is -2515 - -1504? -1011 In base 9, what is 5 + 1140155? 1140161 In base 11, what is 4099 + 149? 4237 In base 12, what is -9a555 - 4? -9a559 In base 2, what is 11111111110101110 - 10? 11111111110101100 In base 3, what is -1001122212 - -11? -1001122201 In base 10, what is -92 - 7107? -7199 In base 4, what is 10201 - 1000112? -323311 In base 6, what is 1330 + 103152? 104522 In base 2, what is -1001110101 - 100110? -1010011011 In base 10, what is -163223 + -3? -163226 In base 12, what is 3b9 - -106? 503 In base 16, what is -b + a8d? a82 In base 3, what is 1 - -1021102002110? 1021102002111 In base 13, what is -15cc + -13? -1612 In base 16, what is -ff3 - -11? -fe2 In base 8, what is 0 - 1200726? -1200726 In base 7, what is 4 - 6666? -6662 In base 12, what is 5 - 89b07? -89b02 In base 11, what is 2 + -7838? -7836 In base 11, what is -7316 + 20? -72a6 In base 9, what is -4836 - 21? -4857 In base 14, what is b + 1250? 125b In base 7, what is -5 + 333663? 333655 In base 9, what is 17 - 315? -287 In base 13, what is -125b + -11a? -1378 In base 8, what is -1 + 2044055? 2044054 In base 2, what is -11011001 + 1110100000? 1011000111 In base 10, what is -69 + -8774? -8843 In base 11, what is -87 - -40767? 40690 In base 9, what is -703375 + -2? -703377 In base 8, what is -3 + 1137724? 1137721 In base 2, what is -11011011010000 - 0? -11011011010000 In base 4, what is -20 - 123322300? -123322320 In base 12, what is -a2b + 43? -9a8 In base 2, what is 11 + 10111100010011011? 10111100010011110 In base 7, what is 1555 - -155? 2043 In base 8, what is -166 + 101747? 101561 In base 14, what is 334298 + 3? 33429b In base 10, what is 146 + 242? 388 In base 15, what is -3 - -971b? 9718 In base 2, what is 11 - -1100011000010010? 1100011000010101 In base 4, what is -10 + -2212120? -2212130 In base 15, what is 3 - -cc7e? cc82 In base 13, what is -1883 + a? -1876 In base 2, what is 110001001011011101 + -11? 110001001011011010 In base 14, what is -a - 7661? -766b In base 14, what is	{ "pile_set_name": "DM Mathematics" }
jj*(-26)j))42 assuming j is positive. j1330 Simplify ((p/p*15)/pp/p(3/26))/(p(-3/8))(-27) assuming p is positive. p(-2521/104) Simplify (d*(5/3)/(dd*(3/4)d))(4/29)/((d(4/7)/d)/(d/(ddd*(-3)))(d0)(-4/7)) assuming d is positive. d(1388/609) Simplify (((u(3/13)/(u/(u(-12)/u)))(-18))11)(-16) assuming u is positive. u(-567072/13) Simplify (m(-16)/mmm*24(m*(5/13)m)/(m/m(-1/4)))(-25) assuming m is positive. m(-10575/52) Simplify ((y/(y/(y/y0)))/(y*(3/5)/yyy))12y*(-1/2)y*(-5)y*0/yy(y/y(2/7))/y assuming y is positive. y(-909/70) Simplify (((t(3/8)tt12)/(tt(-1)/t)(4/9))(-5))(-2/133) assuming t is positive. t(4975/4788) Simplify ((n(-1))(3/25))(-19)/((n/(n/n*2)nn(3/7))/(nnnn*1n)(-40)) assuming n is positive. n(-35201/175) Simplify ((o*(-28)/(o(oo(5/4)o)/o))/(o*(-8)/(oo(o/o(2/37))/oooo)))(2/55) assuming o is positive. o(-2709/4070) Simplify ((nnn0)(-32)((nn/(n/n(-1)))/n)(-32))18 assuming n is positive. n(-576) Simplify (v*(4/3)/vv/(v/v(1/14)))(1/35)/((vv1)/(vv/v3))(-28) assuming v is positive. v(123497/1470) Simplify (h(1/17)/h*0h*(-2/15)/(hh(h/(h/(hh*(-1/4)h)))/h))(-13/3) assuming h is positive. h(37453/3060) Simplify yyy*(-1/5)/yyyy*(1/4)y(y(2/3))48(y(1/4)/y(2/17))/(y(-1/3))41 assuming y is positive. y(25423/510) Simplify ((h(-2)/(hh(-3)))/((h(-2/3)/h)/hhhh(-6/11)))/((h(3/2)h)50)(-3/11) assuming h is positive. h(1165/33) Simplify ((k(2/7)k)(-29)/(k(-7)/((kk(27/4))/k)))(2/45) assuming k is positive. k(-659/630) Simplify (w(-1))(1/5)w*0w/(ww(4/9))(w*(-5)ww(-2))/(w(-1/3))(-1/31) assuming w is positive. w(-9284/1395) Simplify ((c/c(1/7))/c(c*(-1/4)c)/c)*(-2/37)/((cc1)(-16/7))(-5/11) assuming c is positive. c(-11719/5698) Simplify ((p/(p*1/ppp))2p*(-9)p/p(-14))(1/64) assuming p is positive. p*(1/16) Simplify (nnnn*(8/7)nnn*(1/7)n)/(nn/n(-17)nn(-16)) assuming n is positive. n(23/7) Simplify ((ii/i*(-2/129)i15)(-6))13 assuming i is positive. i(-57070/43) Simplify (jjj*0/jj(-1))(4/11)(j(-2/7))(-5/7)/(j(-4/5)/(((j/j(4/3)j)/j)/jj)) assuming j is positive. j(493/735) Simplify ((z/(zz*15/z)z(z(z*(-14)z)/zz)/z)/((((z/(z/z(-11)))/z)/zz)/zzz(-15)))8 assuming z is positive. z*8 Simplify (((qq*(-7/2))/qq)/(((q/(q*(-2)q)q)/q)/qq)((q(2/7)/q)/q)(-1/5))/(q(5/4)/q6)(-2/185) assuming q is positive. q(-1090/259) Simplify ((vvv7vv(-6))/(v(-2/5)/((v(3/5)/v)/vv)))/((vv7/vv)/v*(5/3)(vv/v(-1/6)v)/v7) assuming v is positive. v(3/2) Simplify ((mm(m/((m/(m/m*5))/m)m)/mmm*7(mm(-2/7))15)37)(-6/31) assuming m is positive. m(-888/7) Simplify (h(-1/2))45/(h(-1))11(h/(hh(3/7)h)hh/(hh(2/5)/hh)h)(2/11) assuming h is positive. h(-8831/770) Simplify (q8/(qq/(q*33/q))q/(((((qq(-33)q)/q)/q)/q)/q)qq(-6/19))(-10/9) assuming q is positive. q(-4730/57) Simplify (((s/s10)/(((ss(-43)s)/s)/s))/(s(-19/3)/(s(-4/7)s)))(16/3) assuming s is positive. s(13696/63) Simplify (r(-1/7)/r)/(r/(r/r(2/11)r))(r(-2/7))(-17)((r/(rrr*(-1)r))/r)*(3/5)r*(-4)/rr(-2) assuming r is positive. r(-1412/385) Simplify ((((x*(-3/10)x)/(x/(x*1x)))(1/4))(6/11))(-1/18) assuming x is positive. x(-17/1320) Simplify ((h/((((h*(4/7)/h)/h)/h)/h)h)/h*0(h0)(-21))/((hh(-2/7)/h)(3/5))(-1/22) assuming h is positive. h(2087/385) Simplify (((t(t/((t*(-1/9)/t)/t))/tt)/((t*(2/7)/tt)/t))/(t(-4)/(t(-1/7)t)))/(t(-1/10)/tttt*5t)(1/9) assuming t is positive. t(5617/630) Simplify ((n*(-1)n)*6(n(-1/3)/n)8)/(nn(2/9)n(-7))(1/3) assuming n is positive. n(-236/27) Simplify (w/w(-1))*(2/139)((w/(w/((w/(www*7/ww))/ww)))/w)/(ww/w*2w)(w(-1/3))(-6/11)/(w(6/5)/(ww(-7))) assuming w is positive. w(-129884/7645) Simplify ((((zz/z1z)/(z/(z/z(-6))))43)(-26))(-12) assuming z is positive. z*107328 Simplify (((lll3)/l(-47))/(ll(ll(1/46)/l)/l)(-2/19))(-33) assuming l is positive. l(-751443/437) Simplify (g/g*39g/(g*8/g))/(gg*23(g/(g/(g*(-1/16)gg)))/g) assuming g is positive. g(-1103/16) Simplify ((xx(x(-1)x)/x)(-9)/((x/(x/x(-1/5)))/x0))/(((x4x)/x(-6))/(x(2/7)x(-4/7))) assuming x is positive. x(-703/35) Simplify ((cc/(c/(c/c(-16)c))c)/(c/(ccc/(c(2/47)/c))c)(c/(cc*1c))/(c/(c/c(2/9))))(-8/17) assuming c is positive. c*(-66784/7191) Simplify ((nnn(-1/14)n)/nn(4/7))(2/11)((n/(n*(-2/7)n))/n)39/(n(-2/7))7 assuming n is positive. n(-1956/77) Simplify (((p/p0)/p)(-41))30/((p/(p5pp)p)/((pp*(-2/13)/pp)/p))(-31) assuming p is positive. p(-1953/13) Simplify (s(-2/3))(-39)(ss*1/sss)/(s3s)(s(2/3))(44/3)((s*(-2/3)s)/s)(2/25) assuming s is positive. s(7813/225) Simplify (((ss/((ss*0/s)/ss)s)(6/5)/((s(-12)/s)/(s/s(-5/2))))(-37))14 assuming s is positive. s(-52059/5) Simplify (r/r(-2/3)rr)34/(r3/(r/(rrr(3/4)rr)))(r1)(-2)(rr*(1/2)r)1 assuming r is positive. r(1421/12) Simplify (c*(-1/18)c/((c*40c)/c))/(cc10cc/(c(-6/11)/c)c) assuming c is positive. c(-10811/198) Simplify ((z(-4)/z)/(z/z(4/3)))(-29/5)/((zzz(-1))(-21)/(z*(-3)(zz(4/3))/zzz)) assuming z is positive. z(242/5) Simplify (r/r(1/4))(-24/11)(r*(-7)/rrrrr)/(r/(r(r/(r*1rr))/rrr))(rrrr(-1/4)r)(-35)/(r2)(-2/51) assuming r is positive. r(-309241/2244) Simplify l*(-7)lll*(2/9)ll(4/3)l*(2/7)((ll10/l)/l(-8))(2/9) assuming l is positive. l(116/63) Simplify (x(-23)x(x/(x/(xx*(-18))))/x(xx(1/8))3)(7/3) assuming x is positive. x(-2051/24) Simplify ((g(1/4)/g(-11)((g*(1/2)/g)/g)/(gg((g/(g/g0))/g)/gg))(-6/13))(-18/11) assuming g is positive. g*(945/143) Simplify ((xx(2/17)/x)/x1)*4(((x/x*(1/5))/x)/xx(-3))40 assuming x is positive. x(-2916/17) Simplify ((u4uu*27)/(uuu(5/6)/u)5)(-4/9) assuming u is positive. u(-274/27) Simplify (y/y(-6)yy(-1/6))/((y(-7)/y)/y6)y*5y*(-1)/yyy(-4)/y(-5) assuming y is positive. y(161/6) Simplify ((i(1/6))(-38))(-13/6)/(i(-1)i/((iii*(-2))/i)i(1/7)/i(-1/5)) assuming i is positive. i(7799/630) Simplify (o/o(-2/43)oo/((oo(35/6))/o)oo)/(o20/o)(-6) assuming o is positive. o(29209/258) Simplify (i1)(-12/7)/(i(2/17)i/(i*0i))(i6/i1)/(i(1/2)/(i/(i(-1/6)i))) assuming i is positive. i(1012/357) Simplify ((r(-8)r(-9))/(r(1/5)/(rr*(-5/4)/rr)))/((rr(-2))(-2/61)/(r(-2/7)/(rr7))) assuming r is positive. r(-220063/8540) Simplify ((u/(u/((u/u*(-1/3))/u)u))22)(-9/2)/((u(-2/5))9)(-26) assuming u is positive. u(-138/5) Simplify ((((k/k5)/k(-6/7))16)(-26))6 assuming k is positive. k(54912/7) Simplify (((gg(-1/2)gg)/g4)/(g(2/11)/(gg*(1/2)g)))/((g2)(1/6)/(g*6/g(g/(gg(-8)))/g)) assuming g is positive. g(412/33) Simplify ((ppp0p)/ppp)*(-21/2)p*(-1)p*(2/13)((p(-5/4)/p)/p)/p(-1/4)(p((pp/p(-1)p)/p)/p)12 assuming p is positive. p(-128/13) Simplify ((o(-1))42)*(-4/5)((o*(1/6)/o)/(o(o*(-11/2)o)/o))(-42) assuming o is positive. o(-602/5) Simplify (u*(-6)u*(2/17)(uu(3/5))/(uu(-1/14)))/((u7u)/u(u5/u)/u)10 assuming u is positive. u*(-125201/1190) Simplify (((ff/f(14/9))/f(2/27))/(((f/(f(-3/7)/f))/f)/((f(-8)f)/f)))49 assuming f is positive. f(-11984/27) Simplify (q/q1)(-1/8)q*(-1)((q/q*7)/q)/q(qq(-2/5))2/((q/q(-1/5))/q0) assuming q is positive. q(-9) Simplify ((y/(y(3/7)/y))47/(y(-1/9))(-2/39))(-34) assuming y is positive. y(-6169402/2457) Simplify ((n/(n(1/11)n))/n*(3/10)(nnnn(-1/25)/nn)/n(-2/41))(-1/47) assuming n is positive. n(-59033/1059850) Simplify ((z0)(-49)/(z(3/8)/(zzz/z6)))/(((z(2/9)z)/zz*1z)/(zz/((zz/z*(2/3)zz)/zzz)z**(3/5))) assuming z is	{ "pile_set_name": "DM Mathematics" }
e units digit of j(k)? 7 Let y(q) = -q*2 - 11q - 13. Let a be y(-9). Suppose -32 = -s - aj, -11 = 3s - s - 5j. What is the units digit of s? 7 Let o(x) = -x3 - 10x*2 + 19x + 9. What is the units digit of o(-13)? 9 Suppose -p - 2 = -0p. Let b be (p/2 - 0)-1. What is the tens digit of -1 - (-1 + b + -11)? 1 Let o(v) = -5v + 8. What is the units digit of o(0)? 8 Suppose 8 = -4v, 3v - 3 = -r + 7. What is the tens digit of r? 1 Suppose -3t = 35 - 89. What is the units digit of t? 8 Suppose -3x = -2 - 4. Suppose 22 = w - xw. What is the tens digit of 2/((4/w)/(-1))? 1 What is the units digit of ((-12)/(-9))/(2/39)? 6 Suppose -4n + 4f + 44 = 0, -1 - 2 = f. What is the units digit of n? 8 Suppose -6 + 14 = -i - 5y, 4i - 4y - 64 = 0. What is the units digit of i/(-8)32/(-6)? 8 Suppose 0 = -3u + u + 26. What is the units digit of u? 3 Let c(o) = -o3 + 7o*2 - 5o + 5. Let s be c(6). Suppose 5v = 19 + s. What is the units digit of v? 6 Let d be (-3)/(-2) - 3/(-6). Suppose 3j - 44 - 10 = 0. Let u = d + j. What is the tens digit of u? 2 Let f be -44 - (0/(-3) + 3). Let m = f - -30. Let z = 27 + m. What is the units digit of z? 0 What is the units digit of (-91)/(-3) + (-16)/(-24)? 1 Let j = -19 - -14. Let h = j - -11. What is the units digit of h? 6 Let q(x) = -x*3 - 2 - 3 + 8x + 4x2 + 2. Let b = 2 - -3. What is the tens digit of q(b)? 1 Suppose 0 = o + 4i - 22, 4o + 2i - 110 = -o. What is the tens digit of o? 2 Let v(d) = d*3 + 2d*2. Let w be v(-2). Let y be (w/1)/(0 + 3). Suppose 0m - 4m + 36 = y. What is the units digit of m? 9 Let d(o) be the third derivative of o6/120 + 2o*5/15 + 7o*4/24 + 5o*3/3 + 3o*2. What is the units digit of d(-7)? 0 Let u(o) = -11o + 4. Let z be u(-4). Let s = -19 + z. What is the units digit of s? 9 Suppose -2o - 4o + 54 = 0. What is the units digit of o? 9 Suppose 3c + 4p = -322, -c + 16 - 105 = 5p. What is the tens digit of 3/4 - c/8? 1 Let b(h) = -24h + 30h + h2 + 0h*2. What is the tens digit of b(-8)? 1 Suppose -4i - 5 = -9i. Let u(l) = -5l - 3 + 13l + 2. What is the units digit of u(i)? 7 Let c(o) = 42o + 3. What is the tens digit of c(1)? 4 Suppose -w + 16 = 3w. Suppose -6z = -3z - 4d - 73, 0 = d + w. Let p = -6 + z. What is the units digit of p? 3 Suppose -7y + 5y + 8 = 0. Suppose -k + 12 = -0k - 5u, 0 = -u + y. What is the tens digit of k? 3 Let x be (-198)/(-4) - (-9)/(-6). Suppose -r + x = 2h + 4, -3h + 4r + 55 = 0. What is the tens digit of h? 2 Let z = -295 - -493. What is the hundreds digit of z? 1 Suppose 0 = -4r - 0 - 4. Let w be -27 - r/26. Let o = 40 + w. What is the tens digit of o? 1 Let u = -53 - -103. What is the units digit of u? 0 Let n be 03/(-9) - -1. Let l be 0 + n + 5 + -2. Let g = -2 + l. What is the units digit of g? 2 Let t(g) be the second derivative of g*3/2 - 3g*2 - g. Suppose 5s - 8 = 3u, 4s + 2 + 2 = 5u. What is the units digit of t(u)? 6 Suppose 0 = -2c + 5c - 51. Let k = 4 + c. What is the tens digit of k? 2 Suppose 4f + 57 = 177. What is the units digit of f? 0 Suppose -85 + 305 = 2w. What is the tens digit of w? 1 Let t(m) = m3 + 6m*2 - 8m - 4. Suppose -4a - 39 + 11 = 0. What is the units digit of t(a)? 3 Let j = -53 + 104. What is the tens digit of j? 5 Let i = -61 + 109. Let y = -21 + i. What is the tens digit of y? 2 Suppose 2i = -3i + 25. Suppose -65 + 280 = in. What is the tens digit of n? 4 Suppose 4s = 1 + 15. Suppose t - 3o = -2o - 5, -so + 8 = -2t. Let n = t + 12. What is the units digit of n? 6 Let k be ((-1)/(-1))/(2/4). Let l(u) = -3u - 3. Let m(b) = -4b - 2. Let p(c) = km(c) - 3l(c). What is the tens digit of p(5)? 1 Suppose t - b = -1, 0b + 4b = 2t + 8. What is the units digit of (38 - t)(-4)/(-12)? 2 Let v = 9 - 6. Suppose r - 2x = 8, 4r + 4x = -0x + 8. Suppose 15 = vt - b, 2t - t = rb + 5. What is the units digit of t? 5 Let v(b) be the first derivative of b*4/4 + 8b3/3 - b2 - 8b - 1. Let f be v(-8). What is the units digit of 1/(f/7 + -1)? 7 Let t(h) = -h2 + 6h - 5. Let o be t(5). Suppose os = s - 2. Suppose 0c + sc = 12. What is the units digit of c? 6 Let y be 22/(-4) - -3. Suppose 5v + yf = -4 + 50, 0 = 3v - 5f - 9. What is the units digit of v? 8 Let h(i) = -i. Suppose 2w - 8q = -4q - 14, 4w + 10 = 2q. What is the units digit of h(w)? 1 Let x(y) be the first derivative of y4/4 + 5y*3/3 + 2y*2 + 7y + 1. What is the units digit of x(-4)? 7 Let j = 12 - 8. What is the tens digit of j/(57/51 - 1)? 3 Suppose -4d + h - 16 + 3 = 0, -2h = -3d - 11. Let r(g) = -g3 - 4g*2 - 2g - 3. Let z be r(d). What is the units digit of (21/z)/(3/(-6))? 7 Suppose 2k + 2k = -8. Let a(t) = -6t - 1. What is the units digit of a(k)? 1 Let f(b) = b + 2. Let a be f(-1). Let t be ((-24)/9)/(1/(-3)). Let x = a + t. What is the units digit of x? 9 Let s = 34 - 11. Suppose -3k + s = 2q, 0 = -4k + 4q - 6q + 32. What is the units digit of k? 9 Let w = 5 - 5. Suppose 6 = 2f, wf + 109 = 5m + 3f. What is the tens digit of m? 2 Let i(b) = -b*2 - 8b - 2. Let r be 0 - -1(-6)/1. What is the tens digit of i(r)? 1 Suppose -5v + 4f + 30 = -f, 2v - 14 = 4f. Let q be (v - 2)(4 - 3). Suppose -qw + 2 + 7 = 0. What is the units digit of w? 3 Let z = 6 + 38. What is the units digit of z? 4 Suppose -t + 4t = 102. What is the units digit of t? 4 Let g = -27 - -48. What is the units digit of g? 1 Suppose -t = t - 22. Let h = -6 + t. Let x = 9 - h. What is the units digit of x? 4 Suppose n + n = 12. Let w(i) = -7 + 14 + 0i + 6i - i2. What is the units digit of w(n)? 7 Let x(w) = -w3 - w*2 - w - 5. What is the tens digit of x(-5)? 0 What is the units digit of 2/(-4)(-69 + 7)? 1 Suppose 0 = 2y - b + 5, -6y + 3y + 4b = 20. Suppose -i + t + 1 = -yt, 4 = -2i - t. What is the units digit of 3(-1 - 2i)? 3 Let a be -2 + 4 + -1 - 0. Let b(m) = 14m. What is the units digit of b(a)? 4 Suppose -5d = 4i - 1197, -10d + 5i + 459 = -8d. What is the tens digit of d? 3 Let o be (3 + -4)(1 + -3). Suppose -3h + 12 = -3, -5h = -oi - 15. What is the units digit of i? 5 Suppose 0 = 2k - q + 42, -2k - 63 = k - 3q. Let i = -13 - k. Let j = i + 1. What is the units digit of j? 9 Let q(k) = -k3 + 7k*2 - 5k - 1. Let y = 12 + -6. Let a be q(y). What is the units digit of 2/a + (-36)/(-10)? 4 What is the units digit of (13 + -11)/((-4)/(-118))? 9 Suppose -4p + 148 = 4o, 4p = -o + 29 + 2. What is the units digit of o? 9 Let u(d) = 11d*2 - 2d - 13. What is the units digit of u(3)? 0 Let y(p) = p*3 + 5p*2 + 2p + 4. Let x be y(-4). Suppose 10u - xu = -108. What is the units digit of u? 4 Suppose -2l = -2p, 4l - 6 = -3p + 5l. Suppose 4g = -3u - 702, -2g - 470 = -u + pu. What is the tens digit of 2/3 + u/(-21)? 1 Let q(b) be the second derivative of 1/3b*3 + 1/4b*4 - 1/2b*2 + 0 - 2b. What is the units digit of q(-2)? 7 Let w(v) be the third derivative of v4/24 - v2. Let g be w(5). Suppose -s = p - 14, -p - 17 - 47 = -gs. What is the tens digit of s? 1 Let m(b) be the second derivative of b3 - 3b*2/2 + b. Let o be m(3). Let k = -11 + o. What is the units digit of k? 4 Let q = 5 + -6. Let x be (4 + 2 + -4)3. Let h = q + x. What is the units digit of h? 5 Suppose -16 = -5k - 1. Suppose -kv = 4c - 3, 2c - 5v = c + 18. Suppose -x + 3b = -26, 2b + 53 = cx - 2b. What is the units digit of x? 1 Let l(w) = -8w. Let y be l(-1). Let o = y + -5. Let r = o + 0. What is the units digit of r? 3 Let w = 181 + -97. Suppose d = -2d + w. What is the tens digit of d? 2 Let x = -134 + 209. What is the units digit of x? 5 Suppose 31 = 3v - 92. What is the units digit of v? 1 Suppose 7q - 147 - 21 = 0. What is the units digit of q? 4 Suppose -6g + 2g - 8 = 4v, v + 26 = -5g. Let s = g + 19. What is the units digit of s? 3 Let c(n) = 4n - 1. Let x be c(1). Suppose -4f + 3f = -x. Suppose -3u - 4 = -2w, -5u - 5 + 0 = -fw. What is the units digit of u? 2 Let p be (-6)/494/3. Let g = -30 - p. What is the tens digit of g? 1 Let c(i) be the second derivative of i4/12 + i3 + i2 + 2i. What is the units digit of c(-7)? 9 Let t = 73 - 1. What is the tens digit of t? 7 Suppose -5u + 13 = -2n, -3*u + u +	{ "pile_set_name": "DM Mathematics" }
e smallest common multiple of 854 and 4392. 30744 Calculate the smallest common multiple of 45 and 126. 630 What is the least common multiple of 141 and 15? 705 Calculate the least common multiple of 2094 and 12. 4188 Calculate the lowest common multiple of 672 and 189. 6048 Calculate the least common multiple of 40 and 144. 720 Calculate the common denominator of -89/225 and -2/45. 225 Calculate the least common multiple of 281 and 27. 7587 Find the common denominator of -51/100 and 67/14. 700 Calculate the smallest common multiple of 62 and 93. 186 What is the common denominator of -139/42 and 71/896? 2688 Calculate the common denominator of -64/57 and 53/12. 228 Calculate the common denominator of -3/3056 and -23/18. 27504 Find the common denominator of -23/468 and -3/4. 468 Calculate the common denominator of 15/16 and -73/30. 240 What is the common denominator of -61/2 and 16/113? 226 Calculate the lowest common multiple of 1528 and 1910. 7640 What is the common denominator of -73/336 and -115/12? 336 Calculate the common denominator of -143/96 and 61/516. 4128 Calculate the lowest common multiple of 688 and 1376. 1376 What is the smallest common multiple of 689 and 89? 61321 Calculate the least common multiple of 45 and 5. 45 Calculate the least common multiple of 44 and 55. 220 What is the lowest common multiple of 1953 and 54? 11718 Calculate the common denominator of -73/104 and 69/2036. 52936 Find the common denominator of -65/168 and -33/4. 168 Find the common denominator of -38/125 and 97/700. 3500 What is the smallest common multiple of 1880 and 2068? 20680 Find the common denominator of 75/2 and 27/380. 380 What is the common denominator of -151/30 and 58/375? 750 What is the common denominator of -119/30 and 77/15? 30 What is the least common multiple of 6 and 819? 1638 What is the common denominator of 36/715 and -4/99? 6435 Calculate the lowest common multiple of 6 and 172. 516 Calculate the least common multiple of 33 and 5922. 65142 Calculate the common denominator of 1/2 and 85/598. 598 What is the least common multiple of 333 and 42? 4662 What is the common denominator of -59/18 and 91/426? 1278 What is the smallest common multiple of 12 and 114? 228 Calculate the least common multiple of 35 and 14. 70 Calculate the smallest common multiple of 57 and 30. 570 What is the lowest common multiple of 44 and 3904? 42944 What is the common denominator of -71/20 and -131/204? 1020 What is the common denominator of -71/68 and -49/20? 340 What is the common denominator of -19/4000 and 5/16? 4000 What is the common denominator of 7/27 and 34/99? 297 Calculate the common denominator of 61/91 and -4/63. 819 Find the common denominator of -27/119 and 23/17. 119 Calculate the least common multiple of 336 and 216. 3024 What is the least common multiple of 2204 and 232? 4408 Calculate the common denominator of 76/93 and -77/120. 3720 Find the common denominator of -55/1004 and -43/8. 2008 What is the least common multiple of 6 and 320? 960 Calculate the lowest common multiple of 207 and 276. 828 What is the common denominator of 123/1540 and -65/2? 1540 What is the common denominator of -34/3 and 71/864? 864 What is the common denominator of -46/301 and 39/11? 3311 Calculate the common denominator of 17/6 and -18. 6 Calculate the smallest common multiple of 448 and 21. 1344 Find the common denominator of 53/510 and -191/510. 510 Calculate the common denominator of -27/11 and -4/995. 10945 Calculate the common denominator of -91/1402 and -35/22. 15422 What is the smallest common multiple of 174 and 84? 2436 What is the least common multiple of 493 and 261? 4437 Calculate the lowest common multiple of 26 and 20. 260 What is the smallest common multiple of 364 and 196? 2548 Calculate the least common multiple of 1445 and 1734. 8670 Calculate the common denominator of -113/354 and -35/3. 354 Find the common denominator of 9/10 and -131/24. 120 Find the common denominator of -16/9 and -5/999. 999 What is the least common multiple of 28 and 216? 1512 Calculate the common denominator of -111/80 and 65/408. 4080 What is the common denominator of 79/220 and 121/50? 1100 What is the smallest common multiple of 47 and 9? 423 What is the common denominator of 161/90 and 26/33? 990 What is the lowest common multiple of 104 and 148? 3848 What is the smallest common multiple of 27 and 1033? 27891 Find the common denominator of -38/115 and -59/9. 1035 What is the least common multiple of 544 and 748? 5984 Find the common denominator of 77/18 and -19/7. 126 Calculate the common denominator of 37/54 and -63/20. 540 Calculate the lowest common multiple of 18 and 30. 90 What is the lowest common multiple of 32 and 136? 544 Find the common denominator of -19/450 and 31/678. 50850 What is the least common multiple of 48 and 368? 1104 Calculate the smallest common multiple of 34 and 126. 2142 Calculate the least common multiple of 7 and 19. 133 Calculate the least common multiple of 5032 and 85. 25160 What is the least common multiple of 2784 and 1044? 8352 Find the common denominator of -143/140 and 31/154. 1540 Find the common denominator of 73/320 and -99/64. 320 Find the common denominator of -109/6 and -79/22. 66 Calculate the common denominator of 16/3225 and -50/129. 3225 What is the common denominator of -25 and -51/701? 701 What is the lowest common multiple of 660 and 330? 660 Calculate the common denominator of -47/256 and 57/100. 6400 What is the smallest common multiple of 224 and 112? 224 What is the common denominator of -8/77 and -40/473? 3311 Calculate the lowest common multiple of 306 and 714. 2142 Find the common denominator of 15/68 and 149/108. 1836 What is the lowest common multiple of 80 and 56? 560 What is the lowest common multiple of 350 and 250? 1750 What is the least common multiple of 30 and 5? 30 What is the least common multiple of 48 and 108? 432 Calculate the lowest common multiple of 200 and 22. 2200 Calculate the common denominator of -70/183 and 45/41. 7503 Find the common denominator of -33/4144 and 75/4. 4144 What is the lowest common multiple of 464 and 116? 464 What is the common denominator of -19/12 and -83/7940? 23820 What is the common denominator of 17/11 and 61/4652? 51172 What is the least common multiple of 16 and 40? 80 Calculate the lowest common multiple of 6 and 753. 1506 Calculate the lowest common multiple of 6 and 224. 672 What is the common denominator of -113/2632 and -36/7? 2632 Find the common denominator of -47/45 and 67/18. 90 Calculate the common denominator of -79/132 and -15/4. 132 Calculate the lowest common multiple of 18 and 2416. 21744 Find the common denominator of -1/982 and -31/20. 9820 What is the lowest common multiple of 4170 and 8? 16680 What is the common denominator of -17/505 and 77/4? 2020 Find the common denominator of -2/187 and 47/21. 3927 Calculate the common denominator of 47/20 and 47/2210. 4420 What is the least common multiple of 350 and 40? 1400 Find the common denominator of -91/1332 and -32/27. 3996 Calculate the lowest common multiple of 10448 and 10. 52240 Find the common denominator of 7/2250 and -17/20. 4500 What is the common denominator of -131/30 and -23/330? 330 Find the common denominator of 163/30 and 38/327. 3270 Calculate the least common multiple of 1160 and 80. 2320 Calculate the common denominator of 31/10 and -119/50. 50 What is the common denominator of 41/9 and 77/23712? 71136 What is the common denominator of -40/21 and -29/33? 231 Calculate the common denominator of -139/72 and -139/120. 360 Calculate the smallest common multiple of 2304 and 576. 2304 Calculate the common denominator of -9/1306 and 1/6. 3918 Calculate the least common multiple of 2 and 6162. 6162 Calculate the smallest common multiple of 403 and 62. 806 Calculate the lowest common multiple of 28 and 36. 252 What is the common denominator of 38/3 and 79/850? 2550 Find the common denominator of 53/274 and -81/2. 274 What is the common denominator of 53/24 and 25/676? 4056 What is the least common multiple of 380 and 1140? 1140 What is the smallest common multiple of 1788 and 20? 8940 What is the common denominator of -3/104 and -47/168? 2184 What is the common denominator of -89/2604	{ "pile_set_name": "DM Mathematics" }
8. Let w(m) = -c(m) - 13g(m). Factor w(s). 2(s + 1)(s + 2043) Let y(s) be the first derivative of -s6/120 - 7s5/60 + s4/3 + 58s2 - 90. Let t(v) be the second derivative of y(v). Factor t(p). -p(p - 1)(p + 8) Let i(y) = 10y*2 + 48y + 44. Let o(d) = d - d - 6d2 + 17d*2 - 12d*2. Let s(t) = i(t) + 6o(t). Factor s(j). 4(j + 1)(j + 11) Let l(m) be the second derivative of -3m6/10 - 33m*5/4 - 419m*4/6 - 454m*3/3 - 140m*2 + 204m - 2. Find h such that l(h) = 0. -10, -7, -2/3 Suppose -3313g2 + 1080g + 1692g3 + 20g*4 - 847g*2 + 312g = 0. Calculate g. -87, 0, 2/5, 2 Let k(b) be the second derivative of -1/45b5 - 2/9b*3 + 45b + 1/9b4 + 2/9b*2 + 0. Let k(m) = 0. What is m? 1 Let x = -42 + 52. Solve -x + 8s + 9s4 - 15s*2 - 2s - 4s4 + 19s - 5s3 = 0. -2, 1 Let m(w) be the second derivative of -w9/15120 + w8/2240 - w6/180 - 7w*4/2 - w - 3. Let u(g) be the third derivative of m(g). Factor u(v). -v(v - 2)*2(v + 1) Let n be (-133)/284 + 23. Factor -6/5y*2 + 3y + 9/5 + 3/5y5 - 18/5y*3 - 3/5y*n. 3(y - 3)(y - 1)(y + 1)*3/5 Factor -13/4s*2 + 117 - 1/4s*3 + 9s. -(s - 6)(s + 6)(s + 13)/4 Let y be ((-11)/((-11)/(-4)))/(1/(-5)). Let j be (-64)/12(-15)/y. Let -4a*5 - 36a*3 + 3a*j + 17a*4 - a - 7a + 28a2 = 0. Calculate a. 0, 1, 2 Let t(l) be the second derivative of -l6/210 - 227l*5/140 - 225l*4/28 - 673l*3/42 - 16l*2 + 43l - 4. Suppose t(k) = 0. Calculate k. -224, -1 Suppose 52 = 5d - 3c, -70 + 36 = -3d + 2c. Suppose 175/2p + 5/4p*d + 6125/4 = 0. What is p? -35 Let y(l) be the first derivative of 5l*6/27 + 94l*5/45 + 71l*4/9 + 212l*3/27 - 49l*2/3 - 34l - 5050. Solve y(o) = 0 for o. -17/5, -3, -1, 1 Suppose 0w - w = -3. Let n be 42/(-20) - (108/243 + (-53)/18). Factor 0 - 2/5v*4 + 0v*w + 0v + nv2. -2v*2(v - 1)(v + 1)/5 Let a be (100/4326 - 6/4)-2. Let ao*3 - 2/9o + 10/9 - 22/9o2 + 4/3o4 = 0. What is o? -1, 5/6, 1 Let b(z) = -z2 + 195z - 2518. Let y be b(14). Factor 7/2q*3 + 27/2q*2 + 6 + yq. (q + 1)(q + 2)(7q + 6)/2 Let g(c) be the third derivative of c5/240 + 97c*4/48 - 65c3/8 + c2 - 115c - 2. Determine k, given that g(k) = 0. -195, 1 Let v(f) = 7f + 5. Let k be v(0). Suppose ks4 - 23s*2 - 24s - 7s2 + 28s*3 - 31s*3 - 2s*4 = 0. Calculate s. -2, -1, 0, 4 Let y(i) = -9980i + 89823. Let d be y(9). What is o in 0o - 6/11o*4 + 0o*d + 8/11o*2 - 2/11o*5 + 0 = 0? -2, 0, 1 Suppose 49q = -29q. Let r(t) be the first derivative of 9/28t*4 + 0t + qt2 + 23 + 1/7t*3. Let r(l) = 0. What is l? -1/3, 0 Let w(f) be the third derivative of 0f*3 - 1/20f*4 + 2 + 31f*2 - 1/50f*6 + 1/20f*5 + 0f + 1/350f7. Factor w(u). 3u(u - 2)(u - 1)*2/5 Suppose -3h = 4l - 5, -3h + 4h = -5. Suppose j - 2i + 36 = lj, -2j - 5i + 26 = 0. Let -jm - 7m + m2 + 2 + 18m = 0. What is m? -2, -1 Let r(p) be the third derivative of p7/8820 - p6/630 - p*5/35 - 3p*4 - 29p*2. Let n(v) be the second derivative of r(v). Factor n(j). 2(j - 6)(j + 2)/7 Let b(s) be the second derivative of -s4/60 + 32s*3/5 + 194s*2/5 - 5s + 390. Factor b(c). -(c - 194)(c + 2)/5 Factor 4 - 30/7m*3 + 26/7m - 32/7m2. -2(m + 1)*2(15m - 14)/7 Factor 40h*2 - 10h*2 - 2304324 + 6072h - 34h2. -4(h - 759)*2 Suppose -37f + 27f + 30 = 0. Determine v, given that -6 - 6 + v2 - 6v + 2v3 - vf - 2v = 0. -2, 3 Let l be (22/112 - (-40)/(-320))80/20. Find z such that -12/7z + lz2 - 2 = 0. -1, 7 Let d(h) be the third derivative of -h5/60 + 221h*4/12 + 443h*3/6 + 12h*2 - 2h. Let d(i) = 0. What is i? -1, 443 Factor -2/9g3 + 20/9g - 16/9 - 2/9g2. -2(g - 2)(g - 1)(g + 4)/9 Let t = 101323/7506 - -4/3753. Suppose 3/4n3 + 99/4n + tn2 + 12 = 0. Calculate n. -16, -1 Suppose -2u = -q - 23, 3u + 13 = 4u - 2q. Suppose uf - 20f + 108 = 0. Solve -16h + fh3 + 0h*4 - 4h*4 + 8h4 = 0 for h. -2, 0, 1 Let y(s) = s2 + 2 + 23s + 0s*3 - 13s*2 - 12s + s*3. Let j be y(11). Suppose 0v*j + 1/2v*3 - 1/2v + 0 = 0. Calculate v. -1, 0, 1 Let r = -79 - -96. Suppose rn3 - n4 - 33n*3 - 3n*4 = 0. What is n? -4, 0 Let y = 7/12 - 1/4. Let u = -7023 - -7023. Suppose uk*2 + 1/6k*3 + y - 1/2k = 0. What is k? -2, 1 Suppose -4s5 + 8s*4 + 820973s*3 - 820873s*3 + 32s*4 - 96s - 40s2 = 0. Calculate s. -2, -1, 0, 1, 12 Let p be (2 - -3)68/238. Let i(s) be the first derivative of -38 - 17/7s2 - 3/14s*4 - 12/7s - ps3 + 2/35s*5. Suppose i(u) = 0. Calculate u. -1, 6 Find q, given that -1704q*3 - 2q*5 + 419q*3 - 1585q*2 - 118q*4 - 217q*4 - 366q - 264q - 3q*5 = 0. -63, -2, -1, 0 Let h(u) be the second derivative of 17u7/1120 - u6/240 - 71u3/6 - u - 8. Let v(x) be the second derivative of h(x). Suppose v(j) = 0. Calculate j. 0, 2/17 Suppose 4i = 4k - 76, 4k + k + i - 107 = 0. Let c be (63/k)/(6/4). Suppose -1/4u + 0 - 1/4u*c = 0. What is u? -1, 0 Let i = -1451146/3 - -483719. Determine g so that -1/3g*2 - ig - 28/3 = 0. -7, -4 Suppose 9s = 45s - 432. Suppose 4l + 10 = 5i, si - 7i = -5l + 10. Factor 0 + 1/3b*i + 0b. b*2/3 Let f(u) = 2u*2 + 7u - 27. Let w be f(-6). Determine c, given that -2c5 + 2c*3 + 2c*4 - 8c*2 + 0c*3 + 7c3 - cw = 0. -2, 0, 1, 2 Find d, given that -10935 + 18787d + 2d*3 - 21622d - 91d2 - 7d*3 - 134d*2 = 0. -27, -9 Factor -209952/11 + 1/11b*3 + 106272/11b - 650/11b2. (b - 324)2(b - 2)/11 Let i be 21((-16)/3 - -7). Suppose 0 = -it - 0t + 140. Solve 5/6v*3 + 4/3 - 1/6vt - v2 - 2/3v = 0 for v. -1, 2 Suppose 186a - 105a - 67a = 0. Factor au2 + 0 - 3/2u*3 + 6u. -3u(u - 2)(u + 2)/2 Factor -635/7s + 1/7s2 + 1266/7. (s - 633)(s - 2)/7 Let y be -1 - ((-81)/27 - 0/1). Factor 0m4 - m + 16m*2 + 0m + 7m3 + 4m*4 - 14m*y. m(m + 1)*2(4m - 1) Suppose i = -4o - 3i + 48, 5i - 28 = -3o. Suppose o = -50l + 54l. Solve -100 - 140a - 14a3 + 7a*4 + 10a*4 - 69a*2 - 18a*l = 0 for a. -5, -2 Let l(r) be the first derivative of -2r*3/51 - 310r*2/17 - 48050r/17 + 224. Factor l(a). -2(a + 155)2/17 Let a = -442 - -449. Factor 3y + 39y - y2 + 21y + ay - 1225. -(y - 35)2 Let b = 86 + -83. Let k = -1100 - -1100. Factor kp*2 + 0 - 1/3p*5 - 2/3p*4 + 0p + 0pb. -p4(p + 2)/3 Suppose 2214p2 - 8 - 1104p*2 - 1120p*2 + 14p*3 - 32p = 0. What is p? -1, -2/7, 2 Factor 56/11q - 490/11 + 2/11q*2. 2(q - 7)(q + 35)/11 Let i = 3908 + -832402/213. Let y = 278/639 + i. Factor -yt*2 + 2/9t*3 - 8/9 - 14/9t. 2(t - 4)(t + 1)*2/9 Suppose -28k + 21k = -56. Let x be (2 + (-6)/(-8) + -2)k. Factor 2o4 - 9o*5 + xo3 - 12 + o4 + 12. -3o3(o - 1)(3o + 2) Suppose -3f + 8 = 4x, -3x + 4x - 3f - 2 = 0. Let a be 0/(x((-18)/(-4) - 3)). Factor ah - 1/6h*4 + 1/6h*2 - 1/6h*3 + 1/6h5 + 0. h2(h - 1)2(h + 1)/6 Let u(l) = 2l2 + 60l + 34. Let w be u(-29). Let t(p) = p - 3. Let r(o) = 4o2 - 144o - 52. Let f(x) = wt(x) - r(x). Solve f(y) = 0. -1, 31 Let r(u) be the first derivative of 32/5u*2 - 31 - 64/5u - 7/10u4 + 4/5u*3 + 2/25u*5. Factor r(x). 2(x - 4)*2(x - 1)(x + 2)/5 Let b(v) be the third derivative of -1/120v*6 - 9v + 0v5 - 1/3v*3 + 0 + 1/8v*4 + 2v2. Factor b(g). -(g - 1)2(g + 2) Let k(x) be the third derivative of -x8/84 - 16x*7/35 - 17x*6/6 - 34x*5/5 - 20x4/3 + x2 + 2. Solve k(r) = 0. -20, -2, -1, 0 Let b = -177756 + 1244332/7. Solve -2/7z3 - bz*2 + 86/7z - 44/7 = 0 for z. -22, 1 Let v(p) be the first derivative of -5p6/6 + 32p*5 - 390p*4 + 4480p*3/3 - 1960p*2 + 1056. Factor v(a). -5a(a - 14)2(a - 2)*2 Let j(p) be the second derivative of 0p*2 + 0p*4 - 10p - 1/50p6 + 0p*5 + 0 - 1/70p*7 + 0p*3. Suppose j(d) = 0. What is d? -1, 0 Find u such that -2/3u*2 + 1090/3u + 0 = 0. 0, 545 Suppose 0 = z + 12z - 897. Let x = -66 + z. Find u such that -3/4u*x + 0 - 1/4u - 1/4u4 - 3/4u*2 = 0. -1, 0 Let f(k) be the first derivative of 324k - 92 + 1/3k3 - 18k2. Factor f(z). (z - 18)2 Let h(f) be the first derivative of 10f + 86 + 15/4f**4	{ "pile_set_name": "DM Mathematics" }
at is 23 + 4.557201? 27.557201 Work out -2885.33 - 1325. -4210.33 What is -952 plus 94.92? -857.08 Add together 24.723883 and 6. 30.723883 What is -3.690669 minus -0.12? -3.570669 What is -30268544.06 take away -0.18? -30268543.88 What is the distance between -49364 and 3.26531? 49367.26531 What is 5 - -18.31579? 23.31579 What is 0.1 minus -2313.6887? 2313.7887 What is 68831778 minus 5? 68831773 Add together 33.34 and -7413. -7379.66 What is the distance between -45956584 and 14.6? 45956598.6 Calculate -15 - 851631423. -851631438 Calculate -2317 + 2300.966. -16.034 -9.478501 - 0.01 -9.488501 Sum 54 and -0.0479931198. 53.9520068802 Work out 287358885 - 0.05. 287358884.95 0.0141073342 - 20 -19.9858926658 Add together -0.16188 and -9.8986. -10.06048 Sum -0.4 and -138.50748287. -138.90748287 3.44+-401074775 -401074771.56 What is -153 - 4749340? -4749493 What is -11258718 + -0.5? -11258718.5 What is -0.11 take away -1505.69765? 1505.58765 Sum 0.2 and -0.07496430447. 0.12503569553 What is 164.748593 - 28? 136.748593 Total of -4610739.314 and -5. -4610744.314 Subtract 9593 from 2855. -6738 -311201 - 57 -311258 What is -2764535 take away 0.02169? -2764535.02169 86.634 - 59396 -59309.366 What is the difference between -2 and 10531170109? 10531170111 What is -1127.6875 - 19.6? -1147.2875 11003+103709 114712 Work out -321504906 + 1. -321504905 Total of -228854 and 0.51. -228853.49 What is the difference between 37205 and -6? 37211 What is -2579.8896 take away -0.07? -2579.8196 What is -113.1 + -2399833? -2399946.1 Put together -0.108 and 0.5373119. 0.4293119 What is the distance between 0.104968 and 44610? 44609.895032 What is -1.2887 minus 38569? -38570.2887 -0.24636 - 202.2 -202.44636 What is 52094 - -0.295109? 52094.295109 Sum 0.3 and 365815. 365815.3 -28571094 - 3 -28571097 -0.37+-0.140642 -0.510642 Calculate 102683095 + 0.4. 102683095.4 Calculate 166.98 - 16581. -16414.02 What is -9519366 - 0.1855? -9519366.1855 Put together -0.640482 and -41. -41.640482 -791 + 0.003696187 -790.996303813 What is 0.4 take away -32231105? 32231105.4 What is -0.0868 plus 5.105? 5.0182 Work out 0.044510615 - 0.19. -0.145489385 4345868 + 732 4346600 What is 13 + 1.41259302? 14.41259302 51296668 + 0 51296668 Sum -0.1 and 178314322.07. 178314321.97 Sum 17470 and 0. 17470 What is -3 - -46458747.2? 46458744.2 What is -0.02 take away 29.3773? -29.3973 Calculate 0.4 + 20.258059. 20.658059 Put together -7 and -2998830.35. -2998837.35 What is 26601.4 plus 0.171305? 26601.571305 What is 4513388 + -6? 4513382 Calculate -0.171 + 39688720. 39688719.829 What is the distance between -3.749 and -9608897? 9608893.251 Add 125577.05 and 1142. 126719.05 6.9 + -277056.3 -277049.4 What is the difference between -106.17845 and 0.3? 106.47845 Total of -15042769910 and -0.2. -15042769910.2 170401947.9 - -0.1 170401948 -33135177+-4 -33135181 What is 0 plus 147.6626? 147.6626 Subtract -0.094 from 7.27671. 7.37071 Subtract 718859.24 from -0.06. -718859.3 Calculate -0.02 - -38398.1779. 38398.1579 -168774 - 0.026509 -168774.026509 What is 63139164 less than 0.034? -63139163.966 Calculate -580468 - 0.482. -580468.482 What is the difference between 973595 and -9.35? 973604.35 What is 0.1397 minus 0.995? -0.8553 Total of -36290 and 92.82. -36197.18 Work out 58019449 + -30. 58019419 Add -874340 and 395. -873945 What is the distance between -0.4 and 13602959? 13602959.4 What is 238472245 less than -209? -238472454 Work out -166836.8 + 1.76. -166835.04 What is the distance between -78309 and 0.03961? 78309.03961 -624961+0.099 -624960.901 What is 1179010.851 minus 0.3? 1179010.551 91 + -0.4470326 90.5529674 Calculate -1004.55 - -0.006572. -1004.543428 Calculate 2.1195421 - -33. 35.1195421 Total of -0.5 and 0.09749082. -0.40250918 What is 0.073172 + 664? 664.073172 What is -3411173.6 less than -0.5? 3411173.1 Work out 0.12766518 + -48. -47.87233482 What is 13278.436 less than 1? -13277.436 What is -30153.0423 minus 0.04? -30153.0823 Total of -451663 and -2613. -454276 What is 0 plus -13229350? -13229350 What is -36411671 take away 0.4? -36411671.4 Add together -0.000022 and -14040. -14040.000022 What is -6.5 take away 330.426041? -336.926041 What is the distance between -8.327380073 and -7? 1.327380073 3+-9398211364 -9398211361 Total of -0.16 and -502256.48. -502256.64 Add 36 and 208929377. 208929413 Work out -802 + -112181. -112983 Add 214.64 and -1351. -1136.36 What is the difference between 49961172 and 4? 49961168 What is 0.1 + 27885045.153? 27885045.253 What is -33332 less than 5? 33337 Work out 0.3815 - 57. -56.6185 Calculate -0.02691 - -60259.9. 60259.87309 What is -0.5 take away -9129416391? 9129416390.5 Sum 148.03 and 0.058452. 148.088452 What is 211354 take away -10.29? 211364.29 What is the distance between 424760768 and -2? 424760770 Subtract 0.4 from -156571272. -156571272.4 Add 10 and -2440015. -2440005 What is 1423 take away -0.02057? 1423.02057 What is -6.3 take away 60412? -60418.3 Calculate -85795449 - -6. -85795443 1.077 + -3.4701 -2.3931 Calculate 0.4 - 52288522. -52288521.6 -23 - 187.87748 -210.87748 Add together 45.2413 and -0.67. 44.5713 Subtract -5269 from -54106. -48837 What is -5922.8 take away -2017? -3905.8 Calculate -0.31 + 1567410. 1567409.69 Sum -0.116 and -151.483. -151.599 What is -872.4051 take away 51? -923.4051 Total of 2.09463 and 13. 15.09463 Work out -10216 - -76007. 65791 What is 4335797035 less than 0.6? -4335797034.4 Total of 0.882446 and 183.9. 184.782446 Work out 1998221 + 0.13. 1998221.13 Work out 40.4174 - 425. -384.5826 Add 4789 and -21390.5. -16601.5 Work out -4 + 1016598069. 1016598065 Subtract -0.131 from -3.4063879. -3.2753879 -0.2 - 19231.0086 -19231.2086 Work out -0.2232 + -212099.8. -212100.0232 What is 907703 - 24? 907679 Put together -22.886918 and -0.33. -23.216918 -6324970 + 0.3 -6324969.7 Work out -0.15679568 - 0.3. -0.45679568 What is 307571 minus 0.03222? 307570.96778 What is -3425.6 - -2086? -1339.6 Work out -0.08247 + 12.591. 12.50853 Calculate 65977472240 - 0.5. 65977472239.5 What is the difference between -0.083 and 78915? 78915.083 215333+-0.373 215332.627 Work out 99374 + 565. 99939 Calculate -79.84449 - -2. -77.84449 Put together 10221.5568 and -1548. 8673.5568 Put together 6547465 and -16. 6547449 What is 52.46575 minus 0.117? 52.34875 Calculate -82684413.66 + 0. -82684413.66 Sum -6275281 and 5. -6275276 What is the difference between -5258 and 0.06192? 5258.06192 What is the distance between -80959 and -62? 80897 Put together -0.0875 and -0.0468552. -0.1343552 -1953 - -1.4443 -1951.5557 Calculate 0.189 - -99397. 99397.189 Put together -423 and 271175.9. 270752.9 Work out 765167 + 121. 765288 Subtract -1 from -751.371725. -750.371725 What is -0.46 take away 43711? -43711.46 What is 12973 minus -230.15? 13203.15 Total of -49458866495 and 2. -49458866493 What is 19314 less than -0.023934? -19314.023934 What is the difference between 191620044 and 1? 191620043 What is -0.03 minus 67788140? -67788140.03 Calculate 102 + -165048.6. -164946.6 What is 852 - 22807? -21955 Sum -17.88 and -1480988.9. -1481006.78 Sum 9683 and -0.08986. 9682.91014 What is -320856 less than -0.037? 320855.963 What is 159.41 minus 1632? -1472.59 Sum 4789212 and -85.9. 4789126.1 What is -11018771 less than -0.3? 11018770.7 Add -52.44 and 774604. 774551.56 What is 0.1788352 + -0.547? -0.3681648 Work out 16573.4 - 3181. 13392.4 23344.0114 - 0.09 23343.9214 Calculate -11.47 + 2133. 2121.53 What is -0.29205023 less than -1.2? -0.90794977 8936.211+1.1 8937.311 What is -177 plus -809.7878? -986.7878 What is -0.3 + -245455.2? -245455.5 Add 8.4 and -2558. -2549.6 Put together -4801.82655 and -0.1. -4801.92655 Work out 508494 + 1668.6. 510162.6 What is 24643 take away -492? 25135 Work out -11.3409 + 1666. 1654.6591 Work out -75.78302 - 262. -337.78302 Total of -238678290 and -0.5. -238678290.5 Put together 669 and -1470.26. -801.26 Work out 15414535 + -19. 15414516 Calculate 22805 - -306. 23111 What is -300075 less than -5.23? 300069.77 10373 - -12803 23176 Work out 760676256 + 0.3. 760676256.3 Calculate -0.4 + -11979855826. -11979855826.4 What is 0.5 - 10667132? -10667131.5 What is -0.4 minus 1.9235703? -2.3235703 Work out 0.08663979876 - 4. -3.91336020124 Put together -3497	{ "pile_set_name": "DM Mathematics" }
))? 2 Let t(v) = 37v - 78. What is the tens digit of t(5)? 0 Let l be (1/(-2))/(1/(-38)). Suppose -3q + 4j + l = 0, 0 = -2q + j + 6. What is the tens digit of (-18)/(-1) - (q - -2)? 1 What is the tens digit of 171972/42 + -4 + (-8)/14? 9 Let k = -9 + 19. Suppose 2t = -2r - 0r + k, r - 20 = -4t. Suppose ro = o - 3. What is the units digit of o? 3 Let t be (-70)/15-6 - 1. Suppose 0 = -r - 12 + t. What is the units digit of r? 5 Let n be 64/40 + (-4)/(-10). Let d = -1 + n. Suppose -d = 2r - 13. What is the units digit of r? 6 What is the units digit of (90/48)/(-15)-8552? 9 Suppose 8n = 2n + 12. Suppose i + 3y = 1, ni - 18 - 6 = 5y. What is the units digit of ((-12)/(-21))/(2/i)? 2 Let p be 0 + (4 - (-1 - -2)). Suppose 0 = -2d + pw + 179, 3w + 458 = 4d + 109. What is the tens digit of d? 8 Let m(f) = -2f - 15. Let i be m(-10). Suppose -15 = -ij, 5a - 163 + 27 = -2j. What is the tens digit of a? 2 Suppose 2c - 6 + 2 = 0. Suppose 19 + 1 = 5o, 38 = cp - 3o. Suppose 3h = 89 + p. What is the tens digit of h? 3 Let o = 4 - 1. Let p(t) = 3t + 76. Let w be p(-24). Suppose c - 4 = -oa, -4c + 0a = -wa - 32. What is the units digit of c? 7 Let k = 29 + -26. Let b(w) = 4w*2 - 2w - 3. Let o be b(-2). Let y = k + o. What is the units digit of y? 0 Let i(f) be the first derivative of -f*3/3 + 7f*2/2 + 2f + 6. Let t be i(8). Let g = t + 12. What is the units digit of g? 6 Suppose -4a - 4d - 16 = -0, 3a + 2d + 7 = 0. Let b be (-1 + -41 + 4)/a. Let i = -17 - b. What is the units digit of i? 1 Let p(g) = g*3 - 4g*2 - 10g - 12. Let c be p(6). Suppose 0n - 141 = -2n - 3k, -4n + 5k + 227 = c. What is the tens digit of n? 6 Suppose -8j - 2j + 1490 = 0. What is the hundreds digit of j? 1 Let f = 25 - 21. Let g(o) = o3 + 9o*2 - 12o - 2. Let p be g(-10). Suppose -fv = -2v - p. What is the units digit of v? 9 Suppose 4f - 1848 - 196 = 0. Suppose 5c - 864 = -4u, 3u - f - 137 = -5c. What is the hundreds digit of u? 2 Let j be (-3)/(-2)(-2 + -42). Suppose 0 = 10n + 81 + 169. Let v = n - j. What is the units digit of v? 1 Let d = -3714 - -5387. What is the units digit of d? 3 Let m(r) = -r3 - 14r*2 + 29r + 7. Let u be m(-16). Suppose -5t + 6t - u = -3h, 0 = -h + 5t + 13. What is the tens digit of h? 1 Let c(k) = -2k3 + 7k*2 + 5k + 5. Let y(d) = -d3 + d2 + d + 1. Let o(b) = c(b) - y(b). What is the tens digit of o(6)? 2 Suppose -3s - 2 + 6 = 5c, 4 = s - c. Suppose -20 = -8w + sw. Suppose wt - t - 84 = 0. What is the units digit of t? 8 Suppose -4n = -7492 + 1856. What is the units digit of n? 9 Let q(o) = 436o2 - 10o + 2. What is the hundreds digit of q(-2)? 7 What is the tens digit of (-21)/(-3)1 - 17985/(-15)? 0 Let n = -626 + 931. What is the units digit of n? 5 What is the units digit of 62/(-3) - (-1557 + 1)? 2 What is the tens digit of (-30919)/(-294) + (-5)/(-6)? 0 Let i(t) = -12t2 + 7t - 3 - 3t + 70t2. What is the tens digit of i(1)? 5 Let y(d) = d2 + 22d + 29. Let v be (-20)/25(-110)/(-4). What is the tens digit of y(v)? 2 Suppose -3p + 1 + 2 = 0, -t = -3p + 33. Let l = t - -33. Suppose -2g = -g + 2f - 19, 147 = 5g - lf. What is the tens digit of g? 2 Suppose 0y - 18 = -3y. Let i(n) be the second derivative of n*4/6 - 7n*3/6 - 4n*2 - 12n. What is the units digit of i(y)? 2 Suppose 0 = 108r - 113r + 190. Suppose 0 = -2s + 160 + r. What is the units digit of s? 9 Suppose 12s - 9s - 174 = -3j, 5s - j - 260 = 0. What is the tens digit of s? 5 Suppose 1 + 0 = r, 41 = -4q - 3r. Let f(a) = -a3 - 9a*2 + 16a - 4. What is the units digit of f(q)? 2 Let z be ((-9)/(-11) - 1) + (-8)/(-44). Suppose -156 = -3o - g, 216 = 4o + 4g - zg. What is the units digit of o? 1 Let i = 1260 + -628. What is the hundreds digit of i? 6 Suppose -4g - 4h = -0g - 1748, 0 = -4g - 3h + 1751. What is the hundreds digit of g? 4 Let a = 25 - 23. Suppose -5t = -at - 51. What is the tens digit of t? 1 Let j be 1662/(-3(-8)/12). Suppose -17r + 597 = -j. What is the units digit of r? 4 Let d(v) = v3 + 3 - 14v - 3v + 1 - 3v*2 + 8v. Let z be d(6). Suppose -4c + 94 = l + l, 0 = 3c - l - z. What is the units digit of c? 1 Let h(m) = 0m - 4m + 8m - 5 + 3m + m*2. Let z(v) = 3v - 17. Let w be z(7). What is the units digit of h(w)? 9 Suppose -t + 0b = -b - 11, -4b - 20 = 0. Suppose 14 = 2f - 4w, t = -f - 4w + 1. Suppose -y + 11 = 5l, 18 = 2l - 0y - fy. What is the units digit of l? 3 Let r = 45 + -44. Let v(m) = 11m*2 + 2m. What is the units digit of v(r)? 3 Let b be ((140/16)/(-7))/((-1)/8). Let x(i) = 2i - 11. What is the units digit of x(b)? 9 Let l(y) = y2 + 4y + 1. Let k be (-8 - -1)/(3/(-9)). Suppose 3u - 6u = k. What is the tens digit of l(u)? 2 Let p(i) = i*3 + 20i*2 - 35i + 20. What is the hundreds digit of p(-10)? 3 Let f(z) = z*2 - 16z - 12. Let i(y) = -y*2 + 13y + 22. Let t be i(13). What is the tens digit of f(t)? 2 What is the tens digit of (-1)/(-5 - -2)1422/6? 7 Let z = -12288 - -17495. What is the tens digit of z? 0 Suppose 54 - 2322 = -6d. What is the tens digit of d? 7 What is the hundreds digit of (4 - 11345/(-25)) + 3/15? 4 Suppose 0 = -35q + 30q + 2225. What is the hundreds digit of q? 4 Let b = 16 - -59. Suppose 3p = -0 + b. Let t = p + 6. What is the units digit of t? 1 Let f(j) = -2j*3 - 12j*2 - 14j. What is the units digit of f(-7)? 6 Suppose b = 5k - k + 2163, 2k - 4356 = -2b. What is the hundreds digit of b? 1 Let o = -12 - -8. Let w = o - -7. Let y = 10 - w. What is the units digit of y? 7 Suppose -128 = 6x - 7x. What is the units digit of x? 8 Let r = 1 + 20. Let o = 23 - r. Suppose -2d - 146 = -4q, 4q = q + od + 111. What is the tens digit of q? 3 Let o(y) = -2y + 12. Let x be o(20). What is the tens digit of (-8)/x - (0 - 103/7)? 1 Let z(o) = -o*2 - 1. Let x(r) be the first derivative of -4r*3/3 + 2r*2 - 2r + 4. Let i(j) = -x(j) + 2z(j). What is the units digit of i(4)? 6 Let i = -33 - -53. Suppose 3q - i = -4l, 0l - 4l = -3q - 20. What is the units digit of l? 5 Let v(k) = 2. Let o(a) = 2a + 41. Let d(j) = 2o(j) - 6v(j). What is the tens digit of d(0)? 7 Let i = -99 + 99. Suppose 2n = 2r + 156, 4n + 0r + 3r - 333 = i. What is the tens digit of n? 8 Let x(j) = 2j - 1. Let t be x(2). Let r(p) = -21p - 69. Let y be r(-5). Let f = t + y. What is the tens digit of f? 3 Suppose -f + 125 = -u + 4u, -f - 2u + 124 = 0. What is the tens digit of f? 2 Let f = 2109 + 1533. What is the units digit of f? 2 Suppose 0 = 3n + a - 8, 4a + 20 = 5n - a. Suppose -ny + 82 = -290. What is the tens digit of y? 2 Let z be 0/((-11)/33(7 - 1)). Suppose -5g - 5n + 7n = -315, 3n = z. What is the units digit of g? 3 Let c be 6/(2 + 33/(-15)). Let f = 75 + c. What is the units digit of f? 5 What is the units digit of ((-6900)/(-161))/((-2)/(-28))? 0 Suppose 51 = -4z - 17. Let r(v) = v*2 + 14v - 22. Let o be r(z). Suppose 2p + 6 = 0, -2p - o = -5j + 4j. What is the units digit of j? 3 Let o be 0 + 10 + -5 - 1. Suppose -2x - op = -388, 2p = 11x - 14x + 586. What is the hundreds digit of x? 1 Let i(q) = -732q*3 + 2q*2 - 16q - 26. What is the units digit of i(-2)? 0 Let z = 11 - -4. What is the units digit of z(-2)/(-6)2? 0 Suppose 6 = 3i - 6. Suppose 77 = ia - 563. What is the hundreds digit of a? 1 Suppose -4b - 42 + 38 = 0. What is the units digit of 159/3 + b + -1? 1 Let f(a) = -5a - 29. Let x be f(-7). Suppose 11l - 650 = xl. What is the tens digit of l? 3 Let c(r) = r*3 - 3r*2 - 15r + 9. Let i(l) = l*2 - 1. Let s(p) = -c(p) + 6i(p). What is the units digit of s(10)? 5 Let i = 121 - 19. Suppose 6r = -x + 3r + 31, i = 4x + r. What is the units digit of x? 5 Let a be -34 + (-4 - (0 - 4)). Let j = a + 53. What is the tens digit of j? 1 Suppose 2y - 11y + 45 = 0. Suppose yg = 11g - 882. What is the tens digit of g? 4 Let b(v) = 36v - 28. Let q be b(7). Let f = q - 89. What is the tens digit of f? 3 Let a = 15 + -13. Let u(h) = -4h2 - 13h + 5. Let m(y) = y*2 + 3y - 1. Let l(i) = au(i) + 9m(i). What is the units digit of l(0)? 1 Suppose -m = -2m + 159. Let y = m - 92. What is the tens digit of y? 6 Suppose -2l = -2*i + 168	{ "pile_set_name": "DM Mathematics" }
3 PM? 327 How many minutes are there between 1:49 AM and 4:01 AM? 132 How many minutes are there between 7:38 AM and 4:33 PM? 535 What is 341 minutes before 2:18 PM? 8:37 AM How many minutes are there between 7:59 PM and 7:48 AM? 709 What is 376 minutes after 8:13 AM? 2:29 PM What is 391 minutes before 2:14 AM? 7:43 PM How many minutes are there between 12:49 PM and 1:03 PM? 14 How many minutes are there between 1:54 AM and 11:43 AM? 589 What is 669 minutes after 11:42 PM? 10:51 AM What is 40 minutes after 11:39 PM? 12:19 AM What is 665 minutes before 7:23 AM? 8:18 PM What is 557 minutes after 5:21 AM? 2:38 PM How many minutes are there between 8:51 PM and 4:10 AM? 439 How many minutes are there between 3:15 PM and 1:40 AM? 625 What is 564 minutes before 9:59 AM? 12:35 AM What is 19 minutes after 11:23 PM? 11:42 PM What is 371 minutes before 4:02 PM? 9:51 AM How many minutes are there between 4:10 PM and 4:21 PM? 11 What is 88 minutes before 8:57 AM? 7:29 AM What is 175 minutes before 12:05 AM? 9:10 PM What is 128 minutes after 2:11 AM? 4:19 AM What is 605 minutes before 7:03 PM? 8:58 AM What is 50 minutes before 3:19 AM? 2:29 AM How many minutes are there between 12:51 PM and 12:30 AM? 699 How many minutes are there between 12:31 AM and 12:45 AM? 14 How many minutes are there between 12:27 AM and 8:32 AM? 485 How many minutes are there between 12:18 AM and 12:57 AM? 39 What is 148 minutes after 8:43 PM? 11:11 PM What is 264 minutes after 7:56 PM? 12:20 AM What is 176 minutes before 11:31 AM? 8:35 AM How many minutes are there between 5:26 AM and 8:22 AM? 176 How many minutes are there between 4:04 PM and 11:23 PM? 439 What is 366 minutes after 8:47 AM? 2:53 PM How many minutes are there between 7:03 AM and 4:16 PM? 553 How many minutes are there between 11:58 AM and 6:46 PM? 408 What is 300 minutes before 2:17 PM? 9:17 AM How many minutes are there between 5:56 AM and 6:56 AM? 60 What is 135 minutes after 11:00 AM? 1:15 PM What is 664 minutes after 11:17 AM? 10:21 PM How many minutes are there between 11:00 AM and 12:42 PM? 102 How many minutes are there between 10:38 PM and 1:39 AM? 181 How many minutes are there between 2:27 AM and 7:49 AM? 322 What is 704 minutes before 5:46 PM? 6:02 AM What is 323 minutes after 9:36 PM? 2:59 AM What is 246 minutes after 10:48 AM? 2:54 PM What is 432 minutes before 6:28 AM? 11:16 PM What is 539 minutes before 5:34 AM? 8:35 PM How many minutes are there between 8:30 AM and 10:25 AM? 115 How many minutes are there between 5:44 AM and 4:08 PM? 624 What is 67 minutes after 2:35 AM? 3:42 AM How many minutes are there between 5:11 AM and 7:44 AM? 153 What is 480 minutes before 8:09 PM? 12:09 PM What is 456 minutes before 2:54 PM? 7:18 AM How many minutes are there between 6:03 AM and 4:15 PM? 612 How many minutes are there between 8:12 PM and 10:59 PM? 167 What is 264 minutes after 3:12 AM? 7:36 AM How many minutes are there between 8:00 AM and 10:12 AM? 132 What is 630 minutes after 11:34 PM? 10:04 AM What is 149 minutes before 4:41 PM? 2:12 PM What is 664 minutes after 5:22 PM? 4:26 AM What is 444 minutes before 5:12 AM? 9:48 PM How many minutes are there between 4:44 PM and 4:32 AM? 708 How many minutes are there between 9:58 PM and 1:54 AM? 236 What is 670 minutes before 11:03 PM? 11:53 AM What is 191 minutes before 12:03 AM? 8:52 PM How many minutes are there between 12:22 AM and 10:49 AM? 627 How many minutes are there between 1:10 AM and 12:12 PM? 662 How many minutes are there between 7:36 AM and 1:31 PM? 355 What is 44 minutes after 9:50 AM? 10:34 AM How many minutes are there between 11:16 PM and 1:16 AM? 120 How many minutes are there between 3:55 AM and 10:40 AM? 405 How many minutes are there between 10:08 AM and 6:53 PM? 525 How many minutes are there between 10:18 PM and 2:33 AM? 255 What is 33 minutes before 5:40 AM? 5:07 AM What is 144 minutes after 5:20 PM? 7:44 PM How many minutes are there between 11:47 PM and 8:09 AM? 502 What is 39 minutes before 5:08 AM? 4:29 AM How many minutes are there between 7:39 AM and 8:41 AM? 62 How many minutes are there between 11:47 PM and 10:31 AM? 644 How many minutes are there between 2:21 PM and 2:01 AM? 700 What is 599 minutes after 4:10 PM? 2:09 AM What is 709 minutes before 4:37 PM? 4:48 AM How many minutes are there between 6:08 PM and 5:52 AM? 704 What is 591 minutes after 7:11 AM? 5:02 PM How many minutes are there between 7:30 PM and 12:45 AM? 315 How many minutes are there between 3:32 AM and 11:10 AM? 458 How many minutes are there between 11:45 PM and 2:02 AM? 137 How many minutes are there between 4:44 AM and 3:56 PM? 672 How many minutes are there between 2:18 AM and 10:39 AM? 501 How many minutes are there between 8:30 PM and 4:40 AM? 490 How many minutes are there between 10:57 PM and 7:37 AM? 520 How many minutes are there between 11:27 AM and 4:23 PM? 296 How many minutes are there between 5:38 AM and 1:46 PM? 488 What is 530 minutes before 5:41 AM? 8:51 PM What is 88 minutes after 5:55 AM? 7:23 AM What is 535 minutes after 2:35 PM? 11:30 PM What is 591 minutes after 3:33 AM? 1:24 PM How many minutes are there between 7:35 PM and 12:45 AM? 310 What is 186 minutes before 11:46 PM? 8:40 PM How many minutes are there between 8:55 PM and 3:45 AM? 410 What is 639 minutes before 8:52 PM? 10:13 AM What is 141 minutes after 1:43 AM? 4:04 AM What is 317 minutes after 10:36 PM? 3:53 AM What is 429 minutes after 4:36 AM? 11:45 AM How many minutes are there between 1:52 PM and 12:39 AM? 647 What is 611 minutes after 1:55 PM? 12:06 AM How many minutes are there between 9:28 PM and 3:13 AM? 345 What is 419 minutes after 11:46 AM? 6:45 PM How many minutes are there between 1:41 AM and 9:07 AM? 446 How many minutes are there between 4:22 PM and 3:54 AM? 692 What is 388 minutes before 2:05 PM? 7:37 AM How many minutes are there between 7:06 AM and 12:01 PM? 295 What is 48 minutes before 8:54 AM? 8:06 AM What is 702 minutes before 2:20 AM? 2:38 PM What is 385 minutes after 4:44 PM? 11:09 PM What is 270 minutes before 2:35 PM? 10:05 AM What is 53 minutes before 6:46 PM? 5:53 PM How many minutes are there between 10:28 AM and 4:21 PM? 353 How many minutes are there between 3:00 PM and 8:41 PM? 341 What is 11 minutes before 2:36 AM? 2:25 AM How many minutes are there between 4:08 PM and 10:07 PM? 359 What is 165 minutes after 2:06 PM? 4:51 PM What is 101 minutes before 10:14 PM? 8:33 PM What is 202 minutes after 9:39 AM? 1:01 PM How many minutes are there between 3:14 PM and 2:32 AM? 678 How many minutes are there between 7:16 AM and 6:19 PM? 663 What is 669 minutes after 11:02 AM? 10:11 PM How many minutes are there between 10:53 AM and 11:53 AM? 60 How many minutes are there between 1:31 AM and 11:03 AM? 572 How many minutes are there between 8:33 PM and 5:21 AM? 528 How many minutes are there between 4:58 AM and 8:15 AM? 197 How many minutes are there between 7:26 AM and 9:21 AM? 115 How many minutes are there between 4:43 PM and 4:12 AM? 689 How many minutes are there between 3:06 PM and 2:36 AM? 690 What is 473 minutes before 8:03 AM? 12:10 AM What is 2 minutes after 4:21 PM? 4:23 PM How many minutes are there between 6:41 AM and 11:56 AM? 315 How many minutes are there between 12:02 AM and 2:12 AM? 130 What is 170 minutes before 7:55 PM? 5:05 PM How many minutes are there between 9:00 PM and 3:26 AM? 386 How many minutes are there between 5:20 PM and 2:23 AM? 543 What is 587 minutes after 8:44 AM? 6:31 PM How many minutes are there between 12:17 AM and 12:05 PM? 708 How many minutes are there between 1:21 AM and 9:31 AM? 490 What is 680 minutes before 10:27 AM? 11:07 PM What is 453 minutes after 10:45 AM? 6:18 PM How many minutes are there between 7:53 AM and 11:57 AM? 244 What is 63 minutes before 3:28 PM? 2:25 PM How many minutes are there between 10:09 AM and 8:16 PM? 607 What is 429 minutes before 12:26 PM? 5:17 AM What is 385 minutes after 12:34 PM? 6:59 PM What is 557 minutes after 9:39 AM? 6:56 PM What is 524 minutes after 5:56 AM? 2:40 PM What is 310 minutes after 9:27 PM? 2:37 AM What is 89 minutes before 8:53 AM? 7:24 AM How many minutes are there between 4:03 PM and 12:28 AM? 505 How many minutes are there between 4:22 AM and 8:18 AM? 236 Wh	{ "pile_set_name": "DM Mathematics" }
6 Suppose 0 = -5c + 9c - 156. Suppose -q = 2q - c. What is the tens digit of q? 1 Let b(m) = -m2 + 9m - 4. Let i be b(6). Let g = i - -8. What is the units digit of g? 2 Suppose -5j + 3a = -153, 53 + 33 = 3j + 4a. Suppose 0 = -4u + j + 30. Suppose -4i = -u - 21. What is the units digit of i? 9 What is the tens digit of (47 - -11) + (1 - 2)? 5 What is the units digit of ((-36)/16)/(6/(-176)) + 1? 7 Let c(y) be the third derivative of y5/30 + y4/4 + 2y3/3 - 3y*2. Let g be c(-4). What is the units digit of -11 + g + 2? 3 Let z be (81/36)/((-2)/(-8)). Let q = 7 - z. What is the units digit of (3 - 0) + 1 + q? 2 What is the tens digit of 58/(2 - 0)(-40)/(-40)? 2 Let w(a) be the first derivative of 1/4a4 + a3 + 3 - 2a2 + 5a. What is the units digit of w(-4)? 5 Let c(v) be the third derivative of -1/12v4 + 1/12v*5 + 0 - 1/120v*6 + 2v*2 + 0v + v3. What is the tens digit of c(4)? 1 Let f(l) be the third derivative of -l6/120 - l*5/15 - 5l*4/24 - 2l3/3 - l2. Let n = -10 - -7. What is the units digit of f(n)? 2 Suppose 14 = 8f - 458. What is the tens digit of f? 5 Suppose -11 = 5i - 1. Let u = 12 + i. What is the tens digit of u? 1 Let l(q) = -q*3 + 8q*2 + 11q - 10. Let p be 1 + (6 - 2/(-1)). What is the units digit of l(p)? 8 Let h(v) = -v*3 - 3v*2 + 4v + 3. Suppose -u + 3d + 2d - 8 = 0, -8 = -4d. Suppose 3m = -ut + 2 - 7, 0 = 2t + 2m + 6. What is the units digit of h(t)? 3 Let l(u) = 2u*2 - 3u2 - 2 + 6. Let d be l(0). Let o = 5 - d. What is the units digit of o? 1 Let u = 2 - -1. Let z(n) = -n3 + 2n2 + 2. Let h be z(2). What is the units digit of (u/(-6))/(h/(-28))? 7 Let v be (-6)/27 + (-58)/(-18). Suppose w = -3x + 17, -vw + 1 = 2x - 1. What is the units digit of x? 7 Suppose -2x = -x - 11. Suppose -2t + 6t + 20 = 0, -3t - x = p. Suppose l + 9 = 4d, pd + 5l - 4 = -1. What is the units digit of d? 2 Suppose b + b - p = 124, -4p + 8 = 0. What is the tens digit of b? 6 Let b(q) = q*2 + 8q + 1. Let o be b(-8). What is the units digit of -1(-57o)/3? 9 Let v(t) = -5t - 3. Let y(p) = 2p + 1. Let x(m) = 2v(m) + 7y(m). Let s = 7 + -3. What is the units digit of x(s)? 7 Let o = 10 + -6. Suppose 0 = -4a + 2s + 42, -4s - 4 + 0 = 0. Suppose -m = om - a. What is the units digit of m? 2 Let d be ((3-1)/1)/1. Suppose 4q - 16 = -12. Let w = q - d. What is the units digit of w? 4 Let b(r) = 4r2 + 3r - 6. What is the units digit of b(4)? 0 Let y be (-2)/(-6) + (-122)/(-3). Suppose -y = -4s + 2v + 3v, 10 = s - v. What is the units digit of s? 9 Suppose j + 4j = 0. Suppose -3v + 4 - 22 = j. Let y = -1 - v. What is the units digit of y? 5 Let l(s) = -s3 + 6s*2 - 5s + 3. Let z(q) = 4q2 - 2q + 1. Let y be z(1). Suppose -3 = -4g + yg. What is the tens digit of l(g)? 1 Let s be (-1)/7 + 1/7. Let v(n) = 0n - 2n - n*2 + 15 + 3n. What is the tens digit of v(s)? 1 Let w(v) = 5v2 - 5v + 4. What is the units digit of w(2)? 4 Let j(m) = -m*2 + 9m - 5. Let h be j(8). Let t(z) = z + 4z + hz. What is the units digit of t(1)? 8 Suppose 0 = 5p - 3r - 128, -4r - 40 = 2p - 4p. What is the tens digit of p? 2 Suppose 2s - 4b = 224, 1 + 4 = 5b. What is the units digit of s? 4 Let c(a) be the first derivative of a5/60 - a4/3 - a3 + 1. Let s(z) be the third derivative of c(z). What is the units digit of s(9)? 0 Let o(w) = -w3 + 2w2 - 2w + 1. Let r be o(1). Suppose 0 = s - r - 3. Suppose 0 = -sy + 3 + 6. What is the units digit of y? 3 Suppose v = 3v - 3w - 4, 5w = 2v. Let k(m) = -m3 + 6m*2 - m - 1. Let u be k(v). What is the tens digit of -1 + u + (-4 - -2)? 1 Let o = 44 - 13. What is the units digit of o? 1 Let t be 21/6 + (-1)/2. Suppose tb - 94 = -4w, 3w + b = 2b + 77. What is the units digit of w? 5 Suppose 3 + 53 = 4y. What is the tens digit of y? 1 Let f(t) = 2 + 1 + 0 - 4 - 23t. What is the tens digit of f(-1)? 2 Suppose 0 = -3i + 6i - 138. What is the tens digit of i? 4 Let c(h) = h3 - 2h*2 - 2h - 2. Let w(q) = -3q. Let m be w(-1). Let o be c(m). Let j(u) = 4u3 - u2 + 1. What is the units digit of j(o)? 4 Let p = -8 - -6. Let m(v) = -10v3 - 3v*2 - v. Let d be m(p). Suppose o + d = 6o. What is the units digit of o? 4 Let d be 1 - (-7)/(21/18). Let r = d + 3. What is the units digit of r? 0 Let v(w) = w3 + 2. What is the units digit of v(5)? 7 Let w(v) = v2 - 2v + 6. Let g(y) = -3y + 1. Let s be g(-1). What is the tens digit of w(s)? 1 Suppose y = -4y + 365. What is the units digit of y? 3 Suppose -35 = -4o + 13. Let n = o + -2. What is the units digit of n? 0 Suppose -3t + 24 + 162 = 3z, t = 4z - 268. What is the tens digit of z? 6 What is the units digit of 28 - (2 - 1 - -2)? 5 Let n(m) = -m2 - 7m - 5. Let o be 4/((-1 - -1) + 1). Suppose 0 = -od - t + 3t - 18, 4d + 4t = -12. What is the units digit of n(d)? 7 Suppose 0 = -m - 0m - 8. Let x be (4 - 0)(-2)/m. Let o = 3 - x. What is the units digit of o? 2 What is the tens digit of (-1456)/(-10) - (-2)/5? 4 Let c(k) = k + 1. Let m(x) = -x + 1. Let h(p) = 2c(p) - m(p). Let b = 9 + -7. What is the units digit of h(b)? 7 Let g(f) = 19f*2 - 6f - 2. Let j be g(-4). Let p be j/6 + 12/18. Let o = -39 + p. What is the units digit of o? 6 Let g = 7 + -7. Suppose 0 = -gs - s + 8. What is the units digit of s? 8 Let d(b) = b3 - b2 - 2. Let y be d(2). Let s be 2/(-6) - 10/(-3). Suppose 0 = -yu + 4h, -u - su + 27 = h. What is the units digit of u? 6 Suppose 0 = -k + 4k + 21. Let r(o) = 11 + 2o - 2 - o. What is the units digit of r(k)? 2 Suppose -5x + 247 = -88. What is the units digit of x? 7 Suppose f + 3f = -24. Let x(r) = -r*3 - 5r*2 + 5r - 3. Let l be x(f). Suppose 0 = -p + lg - 3, 3 = -3g + 9. What is the units digit of p? 3 Suppose -b + 61 = 3d, -21 - 24 = -b + d. Let f = -26 + b. What is the units digit of f? 3 Let l(k) = k2 - 5k + 2. Let x be l(4). Let p = 0 - x. Suppose 3z - a = pz + 7, 3a = z - 5. What is the units digit of z? 8 Suppose 10z - 11z = -342. What is the hundreds digit of z? 3 Let y be 5 + 21/(-2). Suppose 0 = -2v + 5r + 81, v + 3r - 125 = -yv. Suppose 2 + v = 5g. What is the units digit of g? 6 Suppose 4f + 42 = -6. What is the units digit of (-4)/16 - 183/f? 5 Let d be (1/1)/(4/12). Suppose 0 = -dl + l + 8. What is the units digit of l? 4 Let h(z) = 2z*3 + 6z*2 - z + 6. What is the units digit of h(-3)? 9 Suppose 2a + 3l - 4l = -32, -a - 3l = 2. Let c(i) = -i - 9. What is the units digit of c(a)? 5 Let i be (2/(-2))/(-1) - -2. Suppose -5n - 3f = -91, -58 = -n - in + 5f. What is the tens digit of n? 1 Let g = 15 - -45. What is the units digit of g? 0 Suppose -5i = -i + 132. What is the tens digit of i1/6-2? 1 Let o = 20 - 14. Suppose o = -0u + 2u. Suppose 6 = -2h, -h - u = 2w - 16. What is the units digit of w? 8 Suppose 5j - 5 = 4j, 3j + 69 = -3b. Let h = -10 - b. What is the units digit of h? 8 Let z be 2/(-8) + (-84)/(-16). Suppose -zb = -3 - 7. Suppose -i = 2c, i - bc + 4 = 4i. What is the units digit of i? 2 Suppose 2 + 3 = p. Let z(r) = 12r2 - pr*2 + 9r2 + 1 + r2 + 2r. What is the tens digit of z(-1)? 1 Suppose 6s - 53 = 223. What is the units digit of s? 6 Suppose 2y = -4d + 124, 5y - 2d = 519 - 149. What is the tens digit of y? 7 Let n(d) = -d*2 - 5d - 3. Let u be n(-5). Let c = 6 + u. Suppose 5o + 2k = 98, -4o = -3o + ck - 30. What is the units digit of o? 8 Let j = 17 + -23. Let a = 16 - j. What is the tens digit of a? 2 Let z = 10 + -12. What is the units digit of 2/4z - -2? 1 Let v = -124 + 220. What is the units digit of v? 6 Let n = -26 + 17. Let y = n - -18. What is the units digit of y? 9 Suppose 0 + 2 = a. Let t = a + 0. What is the units digit of -2 + t + 24/3? 8 Let h(g) = -3g. Let x be h(-1). Suppose 90 = 2b - 2y - 0y, -2b - xy + 90 = 0. What is the units digit of b? 5 Suppose -536 = -12d + 10d. What is the tens digit of d? 6 Let b(v) = 25v - 16. What is the units digit of b(3)? 9 Let b = 3 + -1. Suppose bz = z. Suppose 4r - 2y - 18 = 0, zr + r - 5y = 18. What is the units digit of r? 3 Let t = 0 + -3. Let o = t + 4. Let n = o + 3. What is the units digit of n? 4 Let f(y) = 64y*2 + y + 3. What	{ "pile_set_name": "DM Mathematics" }
*3 + 3w Expand (2m + 2m - 5m)(2m + m - 2m) + (10 - 3 + 0)(3m*2 - 8m*2 + 3m*2). -15m*2 Expand (-p + 2p - 4p)(-3 - 3p + 5 - 4). 9p*2 + 6p Expand (-5s3 + 0s*3 + 0s*3)(1 - 4 + 1) + 0s3 - 2s*3 + 0s3 - s3 - s*3 - 2s*3. 4s*3 Expand (-1 - 3 + 7)(-5h2 + 4h*3 + 5h*2). 12h*3 Expand (l + 1 + 4l*2 - l)(3 - 2l + l + 0). -4l*3 + 12l*2 - l + 3 Expand (3 - 3 + 2n)(-3n - n + 6n) + (-3n*2 + 6 - 6)(1 - 3 + 1). 7n2 Expand 0p*4 + 0p*4 - 4p*5 + (-1 - 4 + 3)(-1 - 2p5 + 1) + 4 - 2p*5 - 4. -2p*5 Expand (3 - 3 + 1)(-2 + 2 + 9p) + 2 - 2p + 4p + 1. 11p + 3 Expand (-3f + 3f + 2f)(-2f - 4 + 4) + f2 + 0f + 0f + (34f - 17f + 15f)(3f - 7f + 3f). -35f2 Expand (26d + 523 - 523)(-2 + 0 + 1). -26d Expand (-2 + 2 + 2p2)(3p - 5p + 3p) + (-1 - 4p + 7p - 5)(-p*2 - 3p*2 + 5p*2). 5p*3 - 6p*2 Expand 2g + 13g + 2 + 26g + (-2 + 3 + 1)(-3g - g + 2g) + 4g + g - 4g. 38g + 2 Expand (-3 + 5 + 1)(2n - 3n + 8n) - 3n + 2n - 3n. 17n Expand (2h2 + h + 5h - 4h)(69h - 57h + 85h - 1). 194h*3 + 192h*2 - 2h Expand 3t3 - 3t*3 - 2t*3 + (-6 + 0 + 1)(0t3 + 3t*3 - 2t*3) - 3 + 3 + 2t*3. -5t*3 Expand (-2c*3 + 0c*3 + 4c*3)(-2 + 2 - 2c) + (c + c + 0c)(-4c*3 + 4c*3 + 2c*3) - 8c*4 - 8c*4 + 4c*4. -12c*4 Expand (-2j - 4j + 5j)(2j - 3j + 0j) + (j - 5j - 3j)(5j - j - j). -20j2 Expand (v4 + 4v*4 - 3v*4)(6v - 3v - v) + 4v5 - v5 - 5v*5 + (-2v + 5v - 4v)(-2v4 - v4 + 2v4). 3v*5 Expand (-2 + 0 + 4)(0q + 0q + q) + (-2 + 0 + 1)(q + q - q - 3 + 3 + q + (-1 + 2 - 2)(0q + 4q - 2q) - 5q + 2q + 2q). 3q Expand (3 - 4 - 1)(q + 0q + q)(-2 + 5 - 1 + (-2 - 4 + 4)(2 - 5 + 1) + 1 + 0 - 2 + 3 - 4 + 4 - 3 - 1 + 0 - 3 + 4 - 2). -12q Expand 2q - 7q + 2q + (0q - q - q)(-4 + 1 + 2) + 7q + q - 2q. 5q Expand (0u - 3u + 4u)(-34u + 10u - 15u). -39u*2 Expand (3r + r*2 - 3r)(-2r + 5r + 0r) + 2r3 + 0 - 2 - r3. 4r3 - 2 Expand d5 - d*5 - 2d*5 + (1 + 3 - 5)(d*5 - 2d*5 + 3d*5) + 2d*5 + 2d*5 - 2d*5 - 10d*4 - 4d*5 - 10d*5 + 8d*4. -16d*5 - 2d4 Expand -1 + b5 + 1 + (b*4 - 4b*2 + 4b*2)(-b - 4b + 3b) - 5b5 + 0b*5 + 4b*5 + 254b*5 - 2b*3 - 250b5 + b3. 2b5 - b3 Expand (-1 + 2v*2 + 1)(-18 - 19 + 16). -42v2 Expand (-2 + 2g*3 - 2g*3 + 2g*3 + (-5g - 2g + 5g)(0g*2 - 4g*2 + 3g*2))(g + 2 - 2). 4g4 - 2g Expand (-6f2 + 2f + 3f2 - f2)(f*3 + 2f*3 - 4f*3). 4f*5 - 2f*4 Expand (p - p - 2p*2)(p + 3p + 2p)(4 - 3 - 4)(4p - 4p + 2p). 72p*4 Expand (3 - 3 - 15)(3s - s2 - 3s)(0 - 2 + 4). 30s*2 Expand (-3 + 0o*2 - 2o*2 + 1)(0o + 3o*2 + 0o). -6o4 - 6o*2 Expand (1 + 1 + 1)(-3 + 3 + 2r + (-6 + 2 + 3)(2r - 5r + 0r)). 15r Expand 0r5 + 0r*5 + 2r*5 + (6r*4 - 3r*4 - 2r*4)(15r + 7r + 3r). 27r*5 Expand (4 + 1 - 3)(-2h + 7h - h) + (-1 + 2 + 0)(-2 + 2 - h). 7h Expand 0n4 - 2n*5 + 0n*4 + (-2n3 + n3 - n*3)(-2n2 + 0n + 0n) + 3n*5 + 6 - 6 + 23n*5 - 20n*4 + 20n*4. 28n*5 Expand (-h + 1 - 1)(3h2 + 1 - 1 + (1 - 1 - h)(2h - 1 + 1)). -h3 Expand 2c - 2c - c2 + (-1 + 2c + 1)(-c + c - 2c) + 0c2 + c2 + 0c*2 + 2 - 2c*2 - 2 - 3c2 + c2 + c*2 + 0c*2 - 3c*2 - 3c*2. -13c*2 Expand ((3 - 3 + 1)(-2 - 2y + 2) - 2y - y + 0y)(-3y + 0 + 0). 15y*2 Expand -10g - 3 + 11g + 0 + (-2g + 1 - 1)(-1 + 2 - 2). 3g - 3 Expand (75 - 13s - 37 - 36)(0 + 0 + 1). -13s + 2 Expand (4b - 3b - 2b)(-41 + 41 + 19b*2). -19b*3 Expand (-2i + 5i - 4i)(-2i + 8i - i). -5i*2 Expand (-1 - 3 + 6)(20 - 4j + j2 - 20). 2j*2 - 8j Expand (-5 + 5 + 2m3)(m - m - 2m) + m4 + 2m*4 - 6m*4 + (-2m2 + m2 - 2m2)(0m2 + 2m*2 - 3m*2). -4m*4 Expand (1 - 3 + 4)(x + 3x - 5x) + (-3 - 1 + 3)(2x - 2 + 2) + 2x + 2x - 3x + 0x - 6x + 2x. -7x Expand (j - j - 2j - j + j - 2j + (j - j + 2j)(-3 + 2 + 0))(-5 + 0 + 4). 6j Expand (1 - 1 + 2q*2)(-1 + 22q + 1). 44q*3 Expand (-3q*3 + 2q3 - q3)(-2q + 2q + 7q*2). -14q*5 Expand (3 + 3 - 4)(-4k + 3k - k)(-3 + 4 + 1). -8k Expand q3 - q2 + q*2 + (2q*2 - 3q*2 + 2q*2)(-2q + 0q + 4q) - q - 2q*3 + q + (q - q + 3q)(4 - 4 - 3q*2). -8q*3 Expand (-4n + 0n + 5n)(2n4 + 3 - 3) + 4 - n5 - 4. n*5 Expand (-m - 1 + 1 - 28m - 20 + 20 + (-m + m + 2m)(-4 + 4 + 2))(4m - 1 - 3m + 0m). -25m2 + 25m Expand (3 + 18 - 7)(-u + 0u - u). -28u Expand (-1 + 6 - 3 + (2 + 2 - 2)(-6 + 2 + 0))(2m - m + m). -12m Expand (70t*3 + 27t*3 - 41t*3)(-t*2 + 2t*2 - 2t*2). -56t*5 Expand (4 - 2p - 4)(p + p + 0p) + (3 - 3 + 3p)(0p + p + 0p) - 5p2 + 4p*2 + 5p*2. 3p2 Expand -a4 + a4 + a4 + (2a2 + 2a*2 - 3a*2)(2a2 + 3a - 3a) + 0a*4 + 0a*4 - 2a*4 - 3a4 + a4 + 0a4 - 5a*2 - a + 2a*4 + 5a2. a4 - a Expand (4 - r - 4)(0r*2 - 5r*2 + 0r*2) - 3r*3 + 2r*3 + 3r3 + (-r2 + 4 - 4)(-1 + 1 - r). 8r*3 Expand 3i + 3i - 4i + (-3 + 7 - 2)(0 + 0 + 2i). 6i Expand (2 + 2 - 2)(-3n2 + n2 + 3n*2) + 8n*2 + 14n*2 - 6n*2. 18n*2 Expand (2 + 3 + 5)(3j5 + 0j*5 - 5j*5). -20j*5 Expand (0n*4 + 2n*4 + 0n*4)(3 + 0 - 1) + 3n2 - 3n*2 + 2n*4 + 2n*4 + 0n4 - n4. 7n4 Expand (-c2 + c - c)(5 - 7 - 5) - 2c2 - c2 + 2c*2 + 2c*2 - 2c + 2c + (-4c + c + c)(c + 0c + c) + 0c2 - 2c*2 + 0c*2. 2c*2 Expand 2y3 - y3 + 0y3 + (5y*3 - 2y*3 - 2y*3)(-38 - 9 + 5). -41y3 Expand (-3 + 4 - 3)(1 + 3 + 0)((1 + 1 - 4)(-f + 0f + 0f) - f + 2f + f). -32f Expand (-4i + 4i + 2i)(-2 - 8 + 3) - 5 + 2i + 5 - i - 3i + 3i + (-3i + 3i - i)(-1 - 5 + 4). -11i Expand (5 + 0 - 4 + (0 - 4 + 3)(4 + 5 - 3))(a3 + a + a3 - a3). -5a*3 - 5a Expand (4 - 4 + c*3 + (-5c + 5c - 2c)(5c*2 - 4c*2 - 2c*2) + 3 - 3 + 3c*3 + 0c3 + c3 + c*3)(-2 - 2c2 + 2). -16c*5 Expand (-4 - 1 + 3)(2m4 + 9m*4 - 6m*4). -10m4 Expand r3 - r5 - r3 - r*5 + 2r*5 - 2r*5 + (-2r*2 - 4r*2 + 3r*2)(-2r3 + 3r*3 - 3r3) - r5 + 3r5 + r5. 7r*5 Expand (7l - 4l + 6l)(-4 + 2l*2 + 4 + 1). 18l*3 + 9l Expand (1 + 4 + 0)(-2j + 4j + j) + 0j + 2j - 5j. 12j Expand (0 + 2i*2 + 0)(2i - 3i + 3i)((4i - 2i - i)(3 + 3 - 3) + 8 + i - 8). 16i*4 Expand (-j + 3j + 0j - 2)(2 - 2 - 3). -6j + 6 Expand (-s + 0s + 0s)(11s - 13s + 31s) + 0s2 - s2 - s*2 - 2s*2 + 6s*2 - 2s*2 + (s - 1 + 1)(4s - 2s + 0s). -27s*2 Expand (g - 3g + 0g)(6 + 3 - 5)(-3 + 0 + 1). 16g Expand (-1 + 1 - 2d)(-2d2 + 4d*2 - 4d*2)(3 + 1 - 2). 8d3 Expand (-6 + 6 - c5)(4 + 0 - 3)(1 + 1 + 1). -3c*5 Expand (-3 - 1 - 5)(0j4 - 5j4 + j4 + (0j2 + 2j*2 + 0j*2)(2j2 - j2 - 2j*2)). 54j*4 Expand (-3 - 1 - 3)(-2s - 4s + 7s) - 2s - 2s + s. -10s Expand -4c5 + 5c*5 + 3c*5 + (-15 + 15 + 9c)(c4 - 5c*4 + 2c*4). -14c*5 Expand (0k*2 + 3k*2 - 2k*2)(-30 - 3k2 + 30). -3k*4 Expand 7p*4 + 6p*2 - 6p2 - p4 - 1 + 1 - 2p4 - 2p*4 + 6p*4 + (-p - p + 3p)(-3p*3 + 0p*3 + 4p*3) + 7p*4 - 4p*4 + 6p*4. 18p4 Expand (1 - f2 - 1)((-2 - 2 + 6)(2f - 2f*2 - 2f) + 0f2 + 3f*2 + 0f2). f4 Expand (-4a3 - a4 + 4a*3)(1 - 6 + 2 - 7a). 7a*5 + 3a*4 Expand (2o*3 + 3o - 3o)(4 - 3 - 2)(-5o*2 + 4o*2 - 5o*2). 12o*5 Expand (-3w - 1 + 1)(6w - 5w + 0w)(-1 + 9w - 7w - 6w). 12w3 + 3w*2 Expand ((3v - 4v - v)(-2v - 4v + 4v) + 0v*2 + 0v*2 + 2v2 + 0 + 2 - v2 + 3v2)(4v2 + 4 - 4). 32v*4 + 8v*2 Expand (2i*3 + 2i*3 - 2i*3)(-1 + 0 + 319i + i2 - 320i). 2i5 - 2i*4 - 2i*3 Expand (-4s + 4s - 23s*2)(-9 + 9 - 2s). 46s*3 Expand -4h*5 - 2h*5 + 0h*5 + (3h*3 + 3h*3 - 4h*3)(-h*2 + 0h*2 + 2h*2) + 3h*5 - 2h*5 - 4h*5. -7h*5 Expand (-1 - 4 + 4)(3 - y - 3) + 2 - 3y - 2 + (2 - 7 + 3)(3y - 4y - y) - 2y + 0y + y + 0 - y + 0 - 19y + 6y + 7y. -6y Expand (4 - 4 + 3b + (-4 + 4 + 2)(b + 3	{ "pile_set_name": "DM Mathematics" }
h is the closest to 1/4? (a) z (b) 0.3 (c) 3/8 b Let l = 2978/15895 - 8/1445. Which is the closest to -1/4? (a) 0.4 (b) 1.5 (c) l (d) 8/15 c Let o be 22/61. Let g = 666652 + -666650. Suppose -2k + 12 = 2. Which is the nearest to 1? (a) o (b) k (c) g a Let l = 44.5 + 20.5. Let f = -64.9 + l. Which is the nearest to -13? (a) 1 (b) f (c) -0.5 c Let x = 4260 - 289675/68. Let n = 81/748 + x. Let c = -32 - -127/4. What is the nearest to c in 4, n, -0.1? -0.1 Let f = -90497/9 + 10055. Let c = 5 + -3. What is the nearest to f in -6, c, 0.3? 0.3 Let i = 5147/15 - 343. Suppose 8z - 624 + 600 = -4z. Let k(g) = -g - 8. Let f be k(-6). What is the closest to i in 2/5, f, z? 2/5 Let s be ((-432)/32)/(47 + -38). Let h = 0.2 - -1.8. What is the nearest to -1 in 6, h, s, 0.11? s Let h be (-2)/(-4) - (-49)/2. Suppose 3n = -2s - 3, 5s - 15n + 18 = -12n. Let o be 1h/(-5) + s. Which is the closest to 2/7? (a) -4 (b) o (c) -0.4 c Let t be ((-756)/2016)/((15/2)/(-5)). What is the closest to t in -1, -0.4, 10? -0.4 Let j = -0.4604 - 0.5396. Which is the closest to j? (a) 2/17 (b) 0.05 (c) -2/3 (d) -3 c Let n(z) = -4z - 73 - 6z - 18z + 5z. Let c be n(-3). Suppose 3u = -4i - u + 16, 4i = 4u. What is the closest to i in -1, -5, c? -1 Let h = -13.95 + 31.95. Which is the closest to -3? (a) h (b) 2 (c) 5/3 (d) 0 d Let m = -30.67 - -31. Let z = 0.53 - m. Let n = 9.8 + -10. What is the nearest to -2 in -1, z, n? -1 Let p(b) = 2b*3 - b + 855. Let n be p(0). Let k be 228/n + 2/(-3). Let r = 0.8 + 2.2. What is the closest to k in -2/17, r, 5? -2/17 Let w be 130/(-325)35/28. Which is the closest to -3? (a) -1 (b) 4/21 (c) w (d) 0 a Suppose 152i - 149i - 363 = 0. Let m = 116 - i. What is the closest to -3/5 in 0.2, m, -4? 0.2 Let v be (-88)/(-33)9/30 - 1. Let u be ((-16)/36)/((-2)/9). Suppose 5y = 3y - u. Which is the closest to y? (a) v (b) -3/8 (c) -0.4 c Let d = 7.84379 + 0.15621. Which is the nearest to 1? (a) 12 (b) 1 (c) d b Let m = -0.997 + -0.003. Let d be (-4 - -3)/(1 - -2). Let l = -12 + 17. What is the nearest to 24 in m, d, l? l Let t = -0.0343 - -0.4343. Let h = -104 + 103. What is the nearest to 1/3 in -0.8, t, h, -5? t Let v = -10.4372 - -0.4372. Which is the closest to v? (a) -2/5 (b) 1/5 (c) 0.1 a Let v = 607 - 1083. Let z = v + 475. Which is the closest to 1/3? (a) 2 (b) z (c) 1.3 c Let x be (-2)/38(-64)/(-32). Which is the nearest to -2? (a) 3 (b) -0.1 (c) 0.05 (d) x d Suppose 3g - 5 = 2g + 3z, -4z = 5g + 13. Let j = -3 + -1. Let r = 2.779 + -2.779. Which is the nearest to -0.1? (a) g (b) j (c) r c Let q = 36479 - 35727. Which is the nearest to 1/5? (a) -1/4 (b) 2 (c) q a Let z = -8.9 + 8.4. Let b be 123/42 + -3 - 1. Let h = b + 283/238. What is the closest to 1 in z, h, 5? h Suppose -3q - 5j + 79 = 0, -107 = -4q + 4j + 9. Suppose -4z = -11z + 63. Let d be z/6q/21. Which is the nearest to 2/5? (a) d (b) -1 (c) 4 b Let k(y) = -3y - 12. Let i = 29 + -35. Let n be k(i). Let j be 4 + ((-15)/n - 2). Which is the nearest to j? (a) 1/4 (b) 1 (c) -2/11 c Let g be 15276/562814/18(-3)/(-2). Which is the nearest to 6? (a) g (b) 4 (c) 0.4 b Let x = -68 + 68.2. Let r = -27 - -26.99. Which is the closest to 0? (a) x (b) 0 (c) r b Let f be (6/(-20))/((-24)/40). Let l(i) = i2 + 17i + 75. Let j be l(-9). Which is the nearest to f? (a) 0.1 (b) j (c) -1/10 a Let m = 13 - 3. Let h = 550 + -540. Let v be (5/m)/((-15)/h). What is the nearest to v in -1, 2/11, -1/6? -1/6 Let r = 27.9 - 148.9. Let k = r - -114.9. Let d = 4.1 + k. Which is the nearest to -59? (a) d (b) -3 (c) 3/7 b Let k = 88 - 83. Let h be 6/k + 108/(-81). Which is the closest to -0.1? (a) -1/5 (b) -5 (c) h c Let m = 2.7 - 1.7. Let h = -86 - -148. Let s = h - 63. Which is the closest to s? (a) m (b) 0 (c) 2/11 b Let a = -3140 + 3171. What is the nearest to 1/7 in -1/3, a, 4, 5? -1/3 Let r = -154/223 - 228113/669. Let f = 342 + r. What is the closest to f in 3/8, -1/11, -4/7? 3/8 Let w = -11 + 11.5. Let z = 33007 + -33007.4. Which is the nearest to -0.1? (a) 195 (b) w (c) z c Let g = 0.5 + -0.3. Let l = g - 0.4. Let q(x) = x*2 + 292x - 1785. Let z be q(6). Which is the closest to -0.1? (a) 4 (b) z (c) l c Suppose 4x - 783 = z + 2z, 0 = -4x + 2z + 786. Let p be (-6)/7126/x. Which is the closest to 2? (a) p (b) -1/5 (c) -1/4 b Let d(y) = -y3 + 8y2 - y - 12. Let w be d(6). Let t = 51 - w. What is the closest to -2/5 in -10, -0.4, t? -0.4 Let m = 1061 - 367. Let s = 685 - m. Let g = -2 + -2. Which is the closest to 0? (a) 0.3 (b) g (c) s a Let v(g) = -g3 - 10g2 + 170g + 11. Let q be v(9). Let o = 20 - 17. What is the nearest to 1 in q, o, 0.4? 0.4 Let q = 1.99 + 0.01. Let n = -0.025 - -0.925. Let p = -0.819 - -0.419. Which is the closest to 1/2? (a) n (b) q (c) p a Let j = 1625.95 + -1626. Let n be ((-4)/(-5))/((-2)/(-10)). Let s = -0.169 + 0.069. Which is the nearest to 1/4? (a) s (b) n (c) j c Let d = 194.51 - 194.71. Let o = -2.8 - -2. What is the nearest to -1 in o, d, 1, -2? o Suppose 26t = 28t + 4q - 170, -2t = -2q - 170. Which is the nearest to 0? (a) t (b) -0.8 (c) -2 b Let h be (-2)/22(-528 - -530). What is the closest to 3 in h, -4, -497? h Let m = 32/9 - 26/9. Let n = -5130 - -5130. Which is the nearest to -0.2? (a) n (b) 0.3 (c) m a Let i = -0.3 - -0.2. Let g = 421/3 + -142. Let h be (407/(-74)4/(-33))/(5/3). What is the nearest to -1 in g, i, h? g Let a = 572.9 - 573. Let j = 1.5 - 1. Let d be 5(-12 + 3). What is the nearest to a in j, d, -1/5? -1/5 Let c be (-1)/(1/(2 + 1)). Let z = 131/178 - 1137/1424. What is the closest to 1 in z, 3/8, c? 3/8 Let u = 3.0073 - 0.0073. Which is the closest to u? (a) -3/8 (b) -3 (c) -0.15 c Let p be (2 - 29) + -1 + -1. Let t = 6124 + -30472/5. Let d = p + t. What is the closest to 1 in d, 5, -2? d Let l = -0.263 + 0.103. Let w = 1.16 + l. What is the nearest to -2/5 in -1, 75, w? -1 Let p = 6.458 + -6.558. What is the closest to p in 2, -4, -2, 0.4? 0.4 Let v = -0.254 - 0.246. Let u = -22.6 + 17.62. Let y = u + -0.02. What is the closest to 0 in y, 0.4, v? 0.4 Let c = -5.46 + 4.987. Let o = c - -0.373. Let z = -0.05 + 0.11. What is the nearest to o in 4, -4, z? z Let h = -2.03599 + 0.03599. Which is the closest to -0.2? (a) -4 (b) h (c) -1/2 (d) -3/7 d Let y = 12192 + -85346/7. Which is the nearest to 27? (a) -8/3 (b) y (c) -0.3 b Suppose 3g + 75 = 27. Let d = -7 - -6.9. Let l = 721 - 719. Which is the closest to d? (a) g (b) l (c) -0.5 c Let n = 29236 - 29235. What is the closest to 6 in n, -2, 35, 2/15? n Suppose 0 = -14w + 114 - 44. Which is the closest to w? (a) 0 (b) -0.4 (c) 1/7 c Let b(p) = -p3 + 13p*2 - 19p - 24. Let w be b(11). Let v be (92/(-8))/(w/14). Let f = v + 18. What is the closest to 3 in -4/5, f, 1? 1 Let v = -17.74 + 14.04. Which is the nearest to v? (a) -1/4 (b) 3 (c) 1 (d) 5/2 a Let g = 1269 + -1206. What is the closest to -1 in g, -0.1, 2/7, -2/17? -2/17 Let n = -0.29 - -0.39. Suppose 1835 = -31r + 1897. Which is the nearest to n? (a) -4 (b) r (c) 2.9 b Let r be 8/24 + ((-56)/15 - -4). Let w = -529 - -527. Which is the nearest to 2/7? (a) 0.2 (b) w (c) -0.3 (d) r a Let d = 4595 - 4595. What is the nearest to d in 6, 7, 3/8, 3? 3/8 Let v = 11486 - 11483. Let o = 0.4 - 1.4. Let i be 6/99(-1 - -4). What is the nearest to v in i, o, 0.3? 0.3 Let y = -3120 - -3129. What is the nearest to -0.018 in -4, -2, y? -2 Let h = 7.8901 + 0.8099. What is the closest to h in 1, 0.1, 1.4? 1.4 Let k be -11 + ((-832)/80)/(-1). Which is the nearest to 0.22? (a) 7 (b) 0.1 (c) k b Let j = 7746 + -7746.006. Which is the closest to j? (a) 1 (b) -0.1 (c) 2/7 b Let s = 0.13065 - 0.03065. What is the nearest to 217 in -2/5, s, -1, -3? s Let c = -45.667 + 45.667. What is the nearest to -1/2 in -2.5, 4, c, 5? c Suppose -17q + 93 = 42. Let h = -14.14 + 14. Let s = h - 0.86. Which is the closest to s? (a) -4 (b) q (c) -1/3 c Suppose 5d - 5a - 20 = 0, -12 = -5d + 4a - a. Suppose -y + 1 + 1 = d. Suppose 18 = -yo - 2v, o + v + 21 = -2o. What is the nearest to o in -1, 0.2, 0.3? -1 Let l = -1017/10 + 102. Let m = -59/30 + l. Suppose 2w = 3k + w + 1, 0 = 4*k + w	{ "pile_set_name": "DM Mathematics" }
- 0.422. Which is the third smallest value? (a) -4 (b) p (c) u b Let p = -58408 + 4205299/72. Let v be 1/2 + (-9)/8. Let n = p - v. What is the second biggest value in 2/13, 2, n? 2/13 Let z = -4 - -3. Let l = -17 - -26. Let j = 5 - l. What is the second biggest value in j, 0.2, z? z Let l = -0.1 + -4.9. Let k = 1 - -4. What is the third biggest value in l, 4/3, k? l Let r = 11 - 12.2. Let c = -1.19 - r. What is the smallest value in 1, 0.3, c? c Suppose 0 = 6f - 2f - 8. Let n = -29 - -21. Let p = n + 13. What is the second biggest value in -3, f, p? f Let s be 1/(-15) - 6/(-30). Which is the biggest value? (a) 3 (b) s (c) 1 (d) 2 a Let v = 86 - 85. What is the third biggest value in 0.5, 11, v? 0.5 Let f = -3.1 + 2.9. Let l(q) = -q*3 + 2q*2 - q + 1. Let j be l(2). Which is the smallest value? (a) -5 (b) j (c) f a Let s = -1 + 2. Let o = s - 0.8. Let h = 0.18 + -0.68. What is the second biggest value in -3, h, o? h Let l = 94 + -91. What is the third smallest value in -2, l, 11? 11 Let k = -0.17 - -11.17. Let j = 11.5 - k. Which is the second smallest value? (a) 4 (b) -2/5 (c) j c Suppose -10 - 25 = -7w. Let i be 2/9 - (-4)/(-18). What is the smallest value in -0.5, i, w? -0.5 Suppose -4p - 11 = -15. Suppose -26 = 3w - 0o - 5o, -2o = 4w. Let h be (1 - 1) + w/(-10). What is the third biggest value in h, 4, p? h Let r = -0.82 - -0.32. Let n = -9246 + 28243/3. Let i = n - 167. Which is the smallest value? (a) i (b) r (c) -0.1 b Let c = 33 + -12. Let q be 124/3 + 14/c. Let b = q + -376/9. What is the third smallest value in 5, -0.3, b? 5 Let p = 18 + -18.1. Which is the smallest value? (a) -9 (b) 4 (c) p a Let v be (-41)/((-8)/2). What is the second smallest value in 0.5, v, -1/21? 0.5 Let y = 4 - -1. Let h be 0/(-2) - 2/(-22). Let p = 0.12 - 4.12. Which is the third smallest value? (a) p (b) y (c) h b Let q = 0.085 + -4.085. What is the third biggest value in 0, -2, q? q Let n = 54.6 + -46. Let t = 9 - n. Which is the third biggest value? (a) t (b) 4 (c) -3 c Let o be 12 + (-2 - 0). Let n(h) = 2h - 23. Let x be n(10). Which is the third smallest value? (a) x (b) o (c) 1/9 c Let l be 1/4 + 10/(-24). Let m = 0.242 + -0.042. Which is the third biggest value? (a) l (b) 4/9 (c) m a Let u = -86 + 54. Let f = 23 + u. Let p = 9.1 + f. Which is the smallest value? (a) p (b) 0.05 (c) 0.4 b Let n = -18 - -18.9. Let u(m) = -m2 - m - 2. Let s be u(-2). Which is the smallest value? (a) 1 (b) s (c) n b Let o be (11/22)/((-2)/(-20)). What is the fourth biggest value in o, -1/14, 1/3, 4? -1/14 Let x(i) = -i - 3. Let m be x(-6). Suppose 2w - 20 = -3w, mw = -5j + 37. Which is the second smallest value? (a) j (b) -2 (c) 1/2 c Let m = 6 - 5.99. Let w = m + 2.99. Which is the smallest value? (a) 5 (b) -0.4 (c) w b Let v be (12/3)/12-6. Let r be -1 + (16/14)/1. What is the smallest value in r, v, -0.2? v Let g = -49 + 48. What is the second smallest value in -5, g, 5, -4? -4 Let j = 0.14 - -0.16. Which is the smallest value? (a) -0.1 (b) -2 (c) j b Let c = -12 - -10. What is the second smallest value in c, -1, 1? -1 Let o be (1 - (5 + -2)) + 0. Let m be o/(-4)(-4)/20. What is the second biggest value in -1/2, 3, m? m Let k = -0.3 + -0.7. What is the third smallest value in 5, 0, k? 5 Suppose -2r = -c + 1, 2r - c - 3 = 4r. Let s = r + 3. What is the third smallest value in s, 5, 4? 5 Suppose 12 = 4h, 0w = w + 3h - 10. Let j = 2.3 - 2. Which is the third smallest value? (a) j (b) w (c) -1/4 b Let k = 18 + -14. Which is the third smallest value? (a) k (b) 3/5 (c) 1 a Let r be (11/(-22))/(10/4). Which is the smallest value? (a) -0.01 (b) r (c) 2 b Let h = 155/636 + 1/159. Which is the third smallest value? (a) -2/3 (b) -4 (c) 5 (d) h d Let o = 6 + -6.2. Let q = o - -0.3. Let a be 0 - 1/(-1 - -2). What is the second biggest value in a, -3/4, q? -3/4 Let h = 0.8 - -0.2. Let p = 2.09 - 0.19. Let c = -0.1 - p. What is the biggest value in c, -0.5, h? h Let r = -0.133 + 0.433. What is the smallest value in -2/7, -5, r, -0.4? -5 Let q be 1(3 + 13/(-5)). Which is the second biggest value? (a) q (b) 4 (c) 1 c Suppose 12l - 72 = -12. What is the third smallest value in -3, l, -2/5, -2? -2/5 Let c = -111 - -115. What is the smallest value in -0.5, c, -8? -8 Let y = -6.5 - -6.6. What is the second biggest value in -1, y, 0.4? y Let a(k) = -k - 14. Let g(p) = p - 10. Let t be g(0). Let o be a(t). Suppose 4v = -4z + 20, 3z - 20 + 5 = 2v. What is the biggest value in z, -5, o? z Suppose 2l - 5y - 9 = -0l, 2l = -2y + 2. Suppose 2w + 2 + l = 0. Which is the biggest value? (a) 2 (b) -4 (c) w a Suppose 4s + 7 = 5i + 29, -5s - 3i = -46. Suppose -s = o + o. Let f = 7 - 4. Which is the smallest value? (a) o (b) -2 (c) f a Let o = 3.06 + -0.06. Which is the second smallest value? (a) 0.3 (b) o (c) 2 c Let u be (-18)/4(-1 + -1). What is the second biggest value in -0.2, -0.5, u? -0.2 Let t = -0.1 - -0.2. Let c = -4.9 + 5. Let k = c + 0.1. What is the second biggest value in -0.4, k, t? t Suppose 5d + 4u = -3 - 2, -5u = -3d + 34. Let r be 16/(-40) - (-14)/60. Which is the biggest value? (a) d (b) -0.5 (c) r a Let u = -15.3 - -0.3. Let a = u + 12. Let h = 0.7 + -4.7. What is the smallest value in h, 3, a? h Let t = 0 + 0.2. Let x = -0.3 + t. Let y = 8.5 + -9. Which is the smallest value? (a) x (b) -3 (c) y b Let m(j) = 2j - 7. Suppose 2t + 0t - 2b - 18 = 0, 5t + 2b = 17. Let n be m(t). Let g be (n - 4) + 2/2. What is the smallest value in -4, g, 0.2? -4 Let d = -4 + 1. Let o = 1 + d. Which is the smallest value? (a) 2 (b) -5 (c) o b Let q(b) = -b + 13. Let f(j) = -3j + 39. Let o(i) = -3f(i) + 8q(i). Let n be o(9). What is the third biggest value in -0.3, n, 0.2? n Let o = 0.9 - 1. Let l = 0.3 + o. Let g = -0.2 + 0. What is the second smallest value in g, l, 3? l Let j = -5 + 29/5. Suppose 3a = 4a - 4. Let q be (15/36)/(2/a). What is the second biggest value in j, q, -4? j Let a = 8 + -7.7. Let k = 5.97 - 6. Let m = 4.03 + k. What is the smallest value in m, a, 2? a Let a be (6/(-20))/(12/(-10)). Suppose -8j = 14 + 2. What is the second smallest value in a, j, -1? -1 Let s = 31/76 + -3/19. Let j = -92 + 87. What is the second biggest value in -2/3, s, j? -2/3 Let n = 0.55 - 0.55. What is the third smallest value in -49, -0.3, n? n Let u = 4 + 5. Let l be 7/u - (-22)/(-33). Which is the second smallest value? (a) 0.5 (b) -2 (c) l c Let s(c) = -5c + c3 + c3 - c3 + 8 + 5c*2. Let q be s(-6). Suppose 4u = qj - 28, -5u = 4j - 0j + 9. What is the biggest value in 0.1, j, -0.3? j Let h(o) = -4o - 51. Let z be h(-12). What is the fourth smallest value in -1, 5, 1/9, z? 5 Let l(x) = x2 - 4x. Suppose 0a + 4a = 2w + 24, 3a = -4w + 7. Let g be l(a). What is the third smallest value in -2/7, g, -5? g Let w = -9 + 8.9. Let n = 0.36 + -0.06. Let c be (27/14 - 2)4. What is the third biggest value in w, n, c? c Suppose -3 = 3w + 5p, -w - 2p - 2 = -0w. Let d = 1.13 - 0.13. Let u = d + 5. Which is the smallest value? (a) w (b) u (c) -0.5 c Let q be (-1 - 27) + 3 + -4. Let n = q - -59/2. Which is the smallest value? (a) n (b) -3 (c) 0.3 b Let o = 0.2 + -0.13. Which is the third smallest value? (a) -5 (b) o (c) 2/5 c Let w(r) = -r + r - r + 0. Let j = -75 + 74. Let i be w(j). What is the second smallest value in i, -0.1, -1? -0.1 Let z = 322/45 + -68/9. Let n = 0.3 + -1.3. Let m = 0.11 + 0.09. Which is the second smallest value? (a) z (b) n (c) m a Let v = 15 - 9. Let p = -1.9 - 1.1. Let d = v + p. Which is the third biggest value? (a) 4 (b) 4/7 (c) d b Let w = 1506/13 + -116. Let p(f) = f*3 + 9f*2 + 9f + 11. Let b be p(-8). What is the second smallest value in b, w, 5? b Let p be 3/3(0 + 4)/(-4). Which is the fourth smallest value? (a) -2 (b) p (c) -1/25 (d) 3/7 d Let i = 138 + -1241/9. Suppose 0 = 48s - 58s - 50. Which is the third biggest value? (a) s (b) 0.4 (c) i a Let p = 2 - 7. What is the smallest value in -0.3, p, 3? p Let t = 17 + -16. What is the biggest value in -0.9, 4, t? 4 Let w = -17 + 12. Let o be 1(-16)/4 - 0. Let n be o/(-18) - (-53)/(-36). Which is the second biggest value? (a) n (b) w (c) 2 a	{ "pile_set_name": "DM Mathematics" }
4/5k + 0 + 134/5k*3 + 22/5k*4 + 128/5k*2 - 8/5k*n = 0. -2, -1, -1/4, 0, 6 Let r = -27 - -36. Factor 6i + 2i - ri - i*2 - 16 - 7i. -(i + 4)*2 Let y be (-1)/3 + (-77)/(-231). Factor 12t + yt3 + 23t*2 + 69t*2 - 16t*2 - 38t + 6t3. 2t(t + 13)(3t - 1) Let l(p) be the first derivative of -94 + 96/5p*2 - 3072/5p - 1/5p3. Solve l(s) = 0 for s. 32 Factor -203/2a*2 + 197/2a*3 - 993/2a - 297 + 1/2a4. (a - 3)(a + 1)*2(a + 198)/2 Let n(z) = -12z2 + 120z + 8. Let i(u) = -19 + 3 + 10 + 40u - 4u*2 + 9. Let r(s) = -8i(s) + 3n(s). Let r(o) = 0. What is o? 0, 10 Factor 130x*2 - 355x - 38x3 + 73x*3 - 40x*3 + 170 + 60. -5(x - 23)(x - 2)(x - 1) Let a(b) = 90b2 + 24650b + 1697468. Let p(g) = -18g2 - 4929g - 339494. Let f(c) = -6a(c) - 28p(c). Find h, given that f(h) = 0. -412/3 Suppose 7c = 11c + 16, 5m + 5c = -5. Factor 42r - 34r - 32r - mr*3 + 7r*2 - 25r*2. -3r(r + 2)(r + 4) Let r(f) be the second derivative of f*4/4 - 632f*3 + 599136f*2 - 1591f. Factor r(j). 3(j - 632)2 Let w(v) be the second derivative of 7v + 5/12v4 + 5 - 1/6v*6 - 1/4v*5 + 0v*3 + 5/42v*7 + 0v*2. Factor w(h). 5h*2(h - 1)*2(h + 1) Let i(v) be the second derivative of -5v - 11/135v*6 + 3 + 1/27v*4 + 0v*3 + 1/18v*5 + 0v*2 + 4/189v7. Determine x so that i(x) = 0. -1/4, 0, 1, 2 Let f(g) be the second derivative of -g5/90 + 133g4/54 - 1357g*3/9 - 2645g*2 - 772g. Factor f(d). -2(d - 69)2(d + 5)/9 Suppose -5l - 4u + 7 = 0, -4l - 9u + 24 = 59. Let -17/3x2 - 4/3x*4 - lx*3 + 11x + 3 = 0. What is x? -3, -1/4, 1 Suppose 0 = -15o + 14 + 16. Find j such that -16j*o - 22j + 18j + 28j + 20j = 0. 0, 11/4 Factor -12z*4 - 141376/3 - 70564/3z*2 + 1096z*3 - 206048/3z. -4(z - 47)2(3z + 4)2/3 Let x = 894/7 + -3555/28. Suppose xo + 1/4o2 + 0 = 0. What is o? -3, 0 Let s(g) be the first derivative of 0g*2 + 0g - 25/9g4 - 1/9g*5 - 1/540g*6 + 29 + 13/3g*3. Let b(w) be the third derivative of s(w). Solve b(d) = 0. -10 Suppose -20n + 62 = 2l - 22n, l - 4n - 34 = 0. Suppose 5m + 4i - l = 0, -m + 4i = 1 + 17. Suppose 5/3zm - 10/3z + 5/3 = 0. What is z? 1 Let h(y) be the first derivative of -y*6/33 - 602y*5/55 - 11549y*4/11 - 134996y*3/33 - 66901y*2/11 - 44402y/11 - 2820. Determine o so that h(o) = 0. -149, -1 Factor 100p - 29 + 2p*4 + 28p*3 - 31 - 40 - 96p*2 + 66. 2(p - 1)*3(p + 17) Let k = -189 + 191. Factor 60x3 + 56x*2 + 9x - kx + 2x*5 + 24x*4 - 7x + 18x. 2x(x + 1)3(x + 9) Let b(z) be the third derivative of -z*6/24 + 59z*5/12 - 1045z*4/8 - 12705z*3/2 - 9102z*2. What is j in b(j) = 0? -7, 33 Let v(t) be the second derivative of 19t*7/98 + 27t*6/35 - 78t*5/35 - 3t*4/2 + 85t*3/14 - 18t*2/7 + 102t + 1. Suppose v(u) = 0. Calculate u. -4, -1, 3/19, 1 Let w = -2/1526187 - -6104758/7630935. Let wm + 4/5 - 4/5m*3 - 4/5m*2 = 0. What is m? -1, 1 Let v(y) be the first derivative of -2y*3/69 - 22y2/23 + 3038. Find c such that v(c) = 0. -22, 0 Let n(q) = q3 - q*2 + 3q - 1. Let v(p) = -55p3 - 1195p*2 - 930p + 270. Let x(b) = 10n(b) + v(b). Factor x(l). -5(l + 1)(l + 26)(9l - 2) Let t(m) = 2m*3 + 141m*2 - 318m + 157. Let o(i) = 9i3 + 567i*2 - 1271i + 629. Let h(c) = 3o(c) - 11t(c). Determine n so that h(n) = 0. -32, 1 Let w(s) be the first derivative of -2/55s5 + 16/11s + 2/11s3 + 49 + 2/11s*4 - 14/11s*2. Suppose w(n) = 0. What is n? -2, 1, 4 Let g(r) = -558r - 46. Let n be g(-8). Factor -40m + 165m + n + 63m + 2m*2. 2(m + 47)*2 Let p = 1421038/5 - 284194. Solve -2/5j*2 + p - 66/5j = 0 for j. -34, 1 Let f be (-20)/(-84)(14 + (-136)/20). Factor 8/7q*3 + 64/7 - fq*2 - 1/7q*4 - 32/7q. -(q - 4)*2(q - 2)(q + 2)/7 Let h(c) = c3 + c2 + c + 1. Let y(o) = 25o*2 - 10o + 5. Let j = -37 - -32. Let g(s) = s*2 + 4s. Let w be g(j). Let m(i) = wh(i) - y(i). Factor m(f). 5f(f - 3)(f - 1) Let k(x) be the first derivative of -64 + 1/42x4 + 0x - 1/7x2 + 4/63x*3. Solve k(g) = 0. -3, 0, 1 Factor -2/15q*2 - 77618/15 + 788/15q. -2(q - 197)2/15 Let x(s) be the third derivative of 0s*3 - 1/54s*4 - 46s*2 - 1/180s*6 + 7/270s*5 + 0s + 0. Factor x(b). -2b(b - 2)(3b - 1)/9 Let a = -1013184 + 1013186. Solve -2/9 - 1/9ga - 1/3g = 0 for g. -2, -1 Let v(q) be the first derivative of -q*4/3 + 2q*3/3 + 7q - 63. Let c(n) be the first derivative of v(n). Suppose c(k) = 0. Calculate k. 0, 1 Let l(a) be the first derivative of -1521a - 1/3a*3 + 39a2 - 202. Factor l(s). -(s - 39)2 Let c(w) be the first derivative of w*4/4 - 191w*3 - 1149w*2/2 - 575w + 2108. Factor c(f). (f - 575)(f + 1)2 Let g be (-2)/3(-1 + (-210)/(-183)). Let m = g - -152/305. Factor 0 + 0p - 2/5p*3 + mp*2. -2p*2(p - 1)/5 Factor 53b - 141b + 88 + 2b2 + 127 - 122b - 7b2. -5(b - 1)(b + 43) Let y(r) be the first derivative of 3r*4/28 - 564r*3/7 + 159048r*2/7 - 19934016r/7 + 454. Let y(q) = 0. What is q? 188 Let h(y) be the second derivative of -y*4/84 - 2y*3/7 + 27y*2/2 + 7389y + 2. Factor h(g). -(g - 9)(g + 21)/7 Let 41/5w*4 - 648/5 - 774/5w + 1/5w5 + 3w*2 + 181/5w*3 = 0. Calculate w. -36, -3, -1, 2 Factor 2/15t*2 - 2752/15 - 550/3t. 2(t - 1376)(t + 1)/15 Let t be (-4)/166 + (-11366)/(-471689). Factor t - 25/4x3 - 13/2x*2 + 1/4x*4 + 0x. x*2(x - 26)(x + 1)/4 Let g(r) = 6r + 9r + r3 - 11r*2 + 11r + 5r2 - 43r + 73. Let l be g(7). Factor -1/2o - ol + 1 - 5/2o*2. -(o + 1)(o + 2)(2o - 1)/2 Factor -80p - 1328p + 83 - 177p - 613 + 15p*2. 5(p - 106)(3p + 1) Find i, given that -6i4 + 0 + 6/5i*5 + 18/5i*3 - 24/5i + 6i2 = 0. -1, 0, 1, 4 Let v(r) be the third derivative of r5/150 - 91r*4/180 - 62r*3/45 + 37r*2. Factor v(s). 2(s - 31)(3s + 2)/15 Determine b so that -60b3 + 14b*4 + 45b*2 + 11b*4 + 419602b - 419612b = 0. 0, 2/5, 1 Let b = -595 + 833. Determine s, given that 8s*3 - 248s + 5s2 + bs - 3s3 = 0. -2, 0, 1 Let m = 17 + 9. Let i be (m/(-39))/((-2)/15). Factor 48d*2 + 42d*4 - 32d + 120d3 - 9d*i + 21d*5 + 26d*4. 4d(d + 2)3(3d - 1) Suppose 261 = 26w - 181. Let d(u) = -2u2 + 34u + 3. Let p be d(w). Let 1/3b4 + 0b + b*p + 0b*2 + 0 = 0. Calculate b. -3, 0 Let w(s) = -217 + 105 - 28s*2 + 49s - 12s + 51s + 4s. Let c(k) = 18k*2 - 61k + 75. Let r(l) = -8c(l) - 5w(l). Let r(m) = 0. Calculate m. 2, 5 Let o(s) be the second derivative of s*4/78 - 71s*3/39 - 146s*2/13 - 546s. Solve o(p) = 0. -2, 73 Suppose -224c - 280 = -1176. Let i(h) be the third derivative of 2/35h*5 + 1/210h*6 + 11/42h*c + 0h + 0 + 4/7h3 - 17h*2. Factor i(k). 4(k + 1)(k + 2)(k + 3)/7 Find c, given that 1/4c2 + 43/4c - 47 = 0. -47, 4 Let -45 + 49j3 - 9j*3 + 117 + 102j + 33j2 - 32j*3 - 5j*3 = 0. Calculate j. -6, -4, -1 Suppose -6y = -25y + 228. Suppose -16 = -4z + 2f, -5z - 5f + y + 8 = 0. Let -9/4x*2 + 3/4x*z + 3/4x*3 - 3/4x + 3/2 = 0. What is x? -2, -1, 1 Let c = -251 - -253. Suppose -5x + 10 = -2n, -2x + cn = -3x - 10. Solve 14/9g*5 + 4/3g*2 + x + 8/3g*4 + 0g - 50/9g3 = 0. -3, 0, 2/7, 1 Let x(r) be the first derivative of 30 + 22r*2 + 4r + 157/3r3 + 81/5r*5 + 99/2r4. Factor x(p). (p + 1)2(9p + 2)*2 Let m be -24(-18)/1728 - 1/(-2). Let s(z) be the second derivative of mz2 + 0 - 1/24z*3 - 20z - 1/8z4 + 1/80z*5. Factor s(v). (v - 6)(v - 1)(v + 1)/4 Let c(l) = 11l*4 + 19l*3 - 15l*2 - 13l + 16. Let h(o) = 6o4 + 2o3 - o2 + o + 1. Let k(x) = -c(x) + 2h(x). Let k(g) = 0. Calculate g. -1, 1, 14 Let z(l) be the second derivative of -l4/30 - 4l*3/3 + 96l*2/5 - 1735l. Solve z(h) = 0 for h. -24, 4 Let c(g) = -3g2 + 3g - 3. Let n(j) = 245j2 - 965j + 770. Let r(t) = 25c(t) - n(t). Factor r(u). -5(8u - 13)2 Let p(g) be the first derivative of -g6/15 + 66g*5/25 + 189g*4/10 + 118g*3/15 - 156g*2 - 1368g/5 + 6766. Find t, given that p(t) = 0. -3, -1, 2, 38 Let z(n) = -2n4 + n3 + n2 + 1. Let g(l) = 21l*4 - 10l3 - l2 + 8l - 11. Let x(b) = 4g(b) + 44	{ "pile_set_name": "DM Mathematics" }
21p - 18. Let d(t) = -5i(t) + 4x(t). Is d(15) a composite number? False Let f(a) be the second derivative of a5/20 - a4/2 + a3/6 - 3a*2/2 + 2a. Is f(6) a prime number? True Let n = 72 + 87. Is n a composite number? True Suppose 841 = 5l + 331. Is (20/(-12))/((-2)/l) composite? True Suppose 5d = -15, 2a + a = -d + 9. Let l be 26/a - 2/4. Suppose -o + 3i = -10, 0i + l = -3i. Is o a composite number? True Let t = 2050 + -1455. Suppose 4n - n - t = -4o, -2o - 3n = -305. Is o a prime number? False Suppose -5r - 4w + 0w = -30, -2w = r - 12. Suppose 0 = 4i - 8, ri = 5d - 6 - 25. Is d prime? True Suppose 2193 = 3u - 3m - 6117, -3m + 8316 = 3u. Is u a composite number? True Suppose -2a = 5c - 1624, 770 - 2059 = -4c - 5a. Is c composite? True Let k(s) = -s3 + 15s*2 + 9s + 7. Is k(15) a composite number? True Let c = 1927 - 1062. Is c a prime number? False Is 4/(-3) - 10150/(-30) a prime number? True Let u(n) = -4n + 8n*2 - 3n*2 + 3 + n. Is u(5) a prime number? True Suppose 3a = 2a + 15. Suppose 2u = -u + a. Suppose -un + 37 + 38 = 0. Is n a prime number? False Is ((-94)/6 - -3)/(6/(-117)) composite? True Suppose q + 0q = 5k - 31, 5k = -q + 19. Let j be 4/q(13 + -1). Is 2/j + 189/4 a prime number? True Suppose 4s + s + 10 = 0. Is (s/(-6))/(6/3654) prime? False Let z = 13 - 9. Suppose 16 = zv - 8. Suppose -81 + v = -5s. Is s a composite number? True Suppose h - 1 - 1 = 0, -3p - 2h + 2233 = 0. Is p composite? False Is (516/(-8))/(3/(-2)) composite? False Let s = -2 + 0. Let o = 21 + s. Is o composite? False Let h = 292 - 157. Let f(a) = 9a - 5. Let z be f(7). Let d = h - z. Is d composite? True Suppose 1590 + 2033 = 3t + 4i, 0 = -3t + i + 3598. Is t a composite number? False Let y = 37 + -52. Let u be 45/(y/(-12)). Is (1 - u)/((-3)/2) prime? False Is 134(4 - (-10)/(-4)) composite? True Suppose 0q = q - 789. Is q composite? True Let h = 5 - -27. Is (56/h)/((-2)/(-8)) a prime number? True Let h = -423 - -1960. Is h a composite number? True Suppose 0 + 6 = 3x. Suppose 7a = 2a - 5l + 115, xl = a - 32. Is a composite? True Suppose 99 = 4i - z, -113 - 6 = -4i - 3z. Let v = i - 12. Is v a composite number? True Let u(y) = 2y*2 - 2y - 7. Is u(-5) composite? False Let v be 9 + -7 - (0 - 2). Let w(g) be the third derivative of g6/60 - g5/12 - g4/24 - g3/6 + 2g2. Is w(v) prime? True Is (-2 - 1) + (-6)/9-3333 prime? False Let t be (-2)/(6/33)-1. Suppose -t - 11 = -b. Is b a prime number? False Let u = 5 + 0. Let q(o) = 3o*2 - o - u + 4o - o. Is q(-4) composite? True Is (-24104)/(-72) + (-4)/(-18) prime? False Suppose -v + 4 = -3. Suppose vq - 3q = 124. Is q a prime number? True Let v(j) = -j. Let a(p) = -52p + 4. Let r(w) = -a(w) + 2v(w). Is r(3) a prime number? False Suppose 5p = 1941 - 36. Is p a prime number? False Is (4/(-6))/((-4)/354) a composite number? False Suppose -15 = -2o - 3o. Suppose 3m + 2m = -10, 2k - 3m - 4 = 0. Let p = k + o. Is p a composite number? False Suppose 0 = -3c - 4h - h + 13034, 5c = 5h + 21790. Is c composite? True Let d = -393 - 135. Is d/(-15) + (-1)/5 a prime number? False Is 568/12(2 + 1) a prime number? False Let a = 26 + 20. Is a prime? False Let y(x) = -5x2 - 7x + 7. Let q(w) = 4w2 + 6w - 7. Let j(f) = -6q(f) - 5y(f). Suppose 2m - 6 = m. Is j(m) a prime number? True Suppose x = n + 237, x = 2n + 336 - 97. Is x prime? False Suppose r = 3r - 14. Let g = 3 + r. Is g a composite number? True Let j(b) = 105b + 8. Is j(3) composite? True Let d = -14 + 25. Suppose 2v - 4j = -9 - d, -25 = -v - 5j. Suppose 4q + q - 455 = v. Is q composite? True Let i be 5 + ((-4)/(-2))/(-2). Suppose -618 = -it + m, 4t - 616 = 3m - m. Is t composite? True Let g(v) = 2v - 12. Let k be g(8). Suppose kn = 2b - 3b + 45, 3b = 2n + 177. Is b a composite number? True Suppose 0 = -2a - 3p + 529, p + p = 3a - 787. Is a a composite number? False Let p be 102/((-9)/(-6) + -1). Suppose 2w + 2w = p. Let m = -26 + w. Is m a prime number? False Suppose -5h = -2o - 3h + 420, -5o = 4h - 1014. Is o a composite number? True Let q(h) = -11h3 + h2 + 2h + 1. Let g be q(-1). Suppose 6r = gr - 1965. Is r composite? True Let k(a) = 15a*2 + 1 - 2a*2 + 0a*2. Is k(-2) composite? False Is ((-502)/(-4))/((-3)/(-6)) a composite number? False Let g be 112/3 - 4/(-6). Let z be (-2)/9 - g/(-9). Suppose -3p = 2k - 155, zk + 383 - 143 = 4p. Is p a prime number? False Suppose -z = -3z + p + 446, -4p = -3z + 659. Suppose z = 3h - 3m, -m + 4m = 6. Is h composite? True Let d(x) be the second derivative of 10x*3/3 + 3x*2 - 3x. Is d(4) a composite number? True Suppose 0n + 4 = -k - 2n, 4k - 4n = 20. Suppose -p + 11 = 2h + kh, 4h + 5p = 7. Let x(j) = 5j + 4. Is x(h) a composite number? False Let j = -4 - -6. Suppose -jz - 70 = a - 235, 0 = 3a + 2z - 479. Is a composite? False Let k = -246 + 533. Is k a composite number? True Suppose -451 = -8d + 1301. Is d composite? True Suppose 0 = -c + 6c - 235. Is c composite? False Let n(p) = p*2 - p. Let k be n(-5). Suppose -f = k - 88. Is f composite? True Let b(c) = c - 1. Let m be b(1). Is m + -1 + (-76)/(-2) a prime number? True Let u be (17 - 18) + 31. Suppose 62 = 4z - uz. Is z composite? False Let o be (-4 - -7)(-14)/(-6). Let j(a) = a2 - 5a - 1. Is j(o) composite? False Suppose u = -2 - 3. Let h be 2085/u2/(-3). Suppose 4a - h = -3l - 29, -3a - 386 = -5l. Is l a composite number? False Let h = -7 - -564. Is h a prime number? True Let n(d) = -4d + 27d2 + 7d - 7d + 2. Is n(3) composite? False Suppose n + 2n = 3i + 393, -234 = -2n - 5i. Is n a prime number? True Let c be 4-6(-125)/4. Suppose r + 3r - c = -2p, 4r = -p + 367. Let a = p + -192. Is a a composite number? False Suppose -4n - 4 = 3k, 0 = -4k + 5n - 10n - 6. Let l = k - -8. Suppose -o - lp = -195, -3p + 2p = 2. Is o prime? False Let s be ((-3)/3)/(0 - -1). Suppose 5 = -5k, 5x - x = -4k. Is (x/1 + -27)s a composite number? True Let f(g) = 25g - 13. Let m(d) = 6d - 3. Let r(q) = -2f(q) + 9m(q). Let k be r(8). Let n = -12 + k. Is n a prime number? True Suppose t - 4d = 35, -5t + 2d - 7d = -250. Is t a composite number? False Suppose v + 49 = d, 2d + 6v - v - 84 = 0. Suppose -3p - 4a - d = 0, 5p + 5a = 3a - 69. Let u = 44 - p. Is u composite? True Suppose -4w - 90 + 1150 = 0. Is (0/3 + w)/1 a prime number? False Let d = 1183 + -174. Is d a prime number? True Let i be 5/(-15) + 22/3. Let j = 9 - i. Suppose 0 = jo - 3b - 32, -37 = -2o - b + 3. Is o a prime number? True Let g(o) = o + 97. Is g(0) a prime number? True Let j = 510 + -272. Suppose -5u + j = -327. Is u a composite number? False Suppose c = -m - 10, 9 = -3c + 2m - 1. Let d(j) = j*3 + 7j*2 + 2j + 10. Let l be d(-7). Is (0 + c/4)l a composite number? True Suppose 0 = -i - 38 + 163. Suppose -2h = -3f + 79, -h + 3h + i = 5f. Is f a composite number? False Suppose 0d = -a + 3d + 18, 2a - 1 = -d. Suppose -c = a - 14. Is c a prime number? True Let f(h) = -6h - 5. Suppose -3g - 13 = 2. Let r be f(g). Suppose -3b = -r - 32. Is b a prime number? True Let j be 0/((2/1)/2). Let c = 7 - j. Let n = c - 0. Is n a prime number? True Let g be 1/(-1)(-33 + 0). Suppose 0 = 3a + 3t - g, 46 = -0a + 4a + 3t. Is a a composite number? False Suppose -5f + 43 = -2. Suppose -y + 3 = -f. Let m = 11 + y. Is m a prime number? True Let w be 2539/3 + 16/24. Let z = -474 + w. Is z a prime number? True Let y be 7/(-1)(-6)/(-7). Let h(k) = -k2 - 13k + 3. Let a be h(-13). Is 1(-20)/ya prime? False Let o(d) = 493d2 - 3d - 1. Let g be o(-2). Suppose -3947 = -4p + g. Is p composite? False Let r(j) = 1 + 5j - 5j + 17j + 5j. Is r(3) a prime number? True Let n be (6/9)/((-4)/(-78)). Let f = 68 - n. Is f prime? False Let r be (4/(-4))/((-2)/46). Let z = 10 + r. Is z prime? False Let o(l) = l + 4. Let m be o(-5). Let d(f) = -33f*2 + 2f + 1. Let h be d(m). Let j = h - -47. Is j a prime number? True Let q = 9 - -146. Is q a composite number? True Let p(n) = -2n - 5n - 18n - 1 - 3n. Is p(-4) composite? True Suppose 208 = 3p - 3y + 8y, 0 = -5y + 10. Let v = p + -35. Suppose -v = -4n - 3z	{ "pile_set_name": "DM Mathematics" }
2i - i - 5v - 18 = 0, -v + 9 = -2i. Let l(w) = -4w - 25. Let z be l(i). Suppose 4b - z = b. Which is smaller: -3/19 or b? -3/19 Let d(s) = 9s + 32. Let w = -165 + 152. Let y be d(w). Which is greater: y or -82? -82 Let p = -0.114 - -2.114. Let h = -59.9 + 82.06. Let g = h - 0.16. Which is smaller: p or g? p Let r = 0.93 + -12.93. Let o = -12.1 - r. Suppose -2z = -6z + 4. Which is greater: o or z? z Let h(v) = -11v2 + 11v2 + v3 - 6v2 - 5v - 2. Let u be h(6). Is u != -32? False Let m(g) = g*2 - g + 2. Let w be ((-3)/(-4))/((-33)/(-88)). Let x be m(w). Let n be 1/(1/x4). Is n greater than -0.14? True Let r = 5946 - 33707. Which is smaller: 0 or r? r Let c(u) = 17u - 1370. Let h be c(72). Is -160 less than h? True Let v be ((-106)/(-88828))/(315/36). Which is bigger: v or 1? 1 Suppose -136 = -5b - 3d, 0 = b + d - 2d - 24. Let t = b - 14. Suppose 150 = -16q + 342. Is q not equal to t? False Let z be 48/10 + (-2)/(-10). Suppose zv + 4u = 0, -3v - u = -v - 3. Suppose 0 = -5o - 11 - v. Which is greater: -4 or o? o Let g = 297.1 + -0.1. Let w = g + -297.2. Which is greater: 8 or w? 8 Let z = -12034 - -13539. Which is greater: 1 or z? z Let s(c) = c*2 - 3c + 42. Let j(o) = -4o. Let n be j(0). Let y be s(n). Let x = -96 + y. Which is smaller: x or -52? x Suppose 0 = -25u - 43520 - 65655. Is u >= 0.1? False Let d be (3 - 1)(26/(-52))/(-1). Is d at least as big as -2/13083? True Let v = 6990 + -27239/4. Let f = -174 + v. Let z = 138 + -133. Which is greater: z or f? f Let b = 3/2060 + -17769/1030. Let n be (-9)/(135/12) + (-48)/(-10). Suppose 0 = -5a - 2l - 86, -78 = 4a - nl + l. Which is smaller: a or b? a Suppose -9m = 3m + 3m - 180. Which is greater: m or 332? 332 Let w = -2 - -1.8. Let p = 1.2 + w. Let v = 3.063 - 1.663. Which is smaller: p or v? p Let a(x) = x*3 - 14x*2 + 7x + 1. Let w be a(9). Let j = 1840 + -2180. Which is greater: w or j? j Suppose 20 = -4r + 14r. Suppose -ry = 5j, j + 3j = 0. Is -2/343 less than y? True Let z = -129 - 164. Let q = 291 + z. Is 93 equal to q? False Suppose 0 = 4k - 33 + 49, 4k - 1667 = q. Is -1683 smaller than q? False Let o be ((-6795)/(-10))/(-9)(35 + -33). Suppose -261 = 4z + 347. Which is bigger: o or z? o Let k be (-66707)/164(-20)/(-5). Is k bigger than -1627? False Let j = -393.9936 - -397. Let i = 0.0064 - j. Which is smaller: 38 or i? i Let u = -442095/13 - -34081. Is 73 greater than u? False Let v = -20.709 + -3347.291. Which is bigger: v or 1? 1 Let t be (-21)/62/5. Suppose 184 - 122 = -62z. Which is smaller: z or t? t Suppose -12 = -q - q. Let n be (-360)/(-54)30/(-25). Let c be (-24)/n - (20/(-4) + 2). Does q = c? True Suppose 0 = -k - 4 + 10, -5k - 1235 = 5a. Are -250 and a nonequal? True Let p be (-13)/(221/255) + 15. Which is smaller: -25/66 or p? -25/66 Suppose 4t + 12 = 0, 5n + 0t = -4t + 158. Suppose n = -w + 32. Let y be ((-3)/9)/(4/(-42))w. Which is smaller: y or -8? -8 Suppose -187x = 144x - 3x - 1633768. Which is smaller: 4982 or x? x Let l = 6740 - 6731. Let f = 2.03 - 0.03. Let s = f - 3. Is l less than or equal to s? False Let u(y) = -y - 5. Let v be u(-7). Let q(g) = g2 - 2g - 2. Let m be q(v). Let z be 1 + 2/1 + m. Is 0 at most z? True Let p(i) = 3i3 - 16i*2 + 4i + 2. Let f be p(6). Is 102 >= f? True Suppose 21 = -5w + 16. Which is smaller: w or 1/1390? w Suppose 5l + 2i - 20 = -78, -2l = -3i + 27. Let c be ((-12)/9)/(l/54). Let o be c/15 - (123/420 - 0). Which is bigger: -1 or o? o Let s = 35476 - 35475.9. Which is bigger: -16069 or s? s Let z be (-15)/(-396)(679/(-350) - -2). Are z and 1 equal? False Let o(n) = -n*2 + 23n + 106. Let u be o(-4). Which is smaller: u or -140/81? u Suppose 3g - 685 = -3z + z, -z + 5 = 0. Let f = -195 + g. Do 30 and f have different values? False Suppose 0 = 22c - 139 - 3843. Suppose 1259 = 36h - c. Is h smaller than 161/4? True Let w = 223 + -222.991. Let k = -0.029 + w. Is k smaller than 0.2? True Let i be -8 - -1 - (-9 + (-1951512)/(-975787)). Are i and 1 non-equal? True Let i be (14910/830 - 18)(-2)/(-6). Let o be (8/(-3))/(2/9). Let v be 3(1 - (-16)/o). Is i bigger than v? True Let f = -13.8368 + -0.1632. Let x = -2 - -1.9. Is x bigger than f? True Let f be (-1107)/861 - (12/(-3) - (-1 + -2)). Which is smaller: 12882 or f? f Suppose -3a + 37 = 4k, -3k + 5a + 19 = -45. Let r(b) = -b - 12. Let v be r(-7). Let m(i) = i*2 + 2i - 3. Let o be m(v). Do k and o have different values? True Suppose 2d = 685 - 1809. Is -557 greater than d? True Suppose -5p + 5o - 85 = 0, -5p - 4o - 29 = 65. Is -284/15 < p? True Let v = -17063/6 + 2844. Which is smaller: v or -752? -752 Let s = 234 + -72. Let q = s - 79. Let a = 8.5 + -8.5. Is a at least q? False Let z = -55 + 58. Suppose 2 = -zj - 67. Let p = -37 - j. Are -12 and p non-equal? True Suppose -1 = 4m - 3m. Let r = -47566/123 - -3096389/3936. Let h = -400 + r. Which is bigger: h or m? h Let p be 24/56 + 10115/(-49). Which is smaller: p or -217? -217 Let g be (73/(-292))/((-1052)/1568). Is g less than 0? False Suppose -b = -2b - 3. Let k = -6 - b. Let g be (k/4)/(294/112). Is 8 at least as big as g? True Let c = 40.39 + -41. Let r = 0.505 + c. Let o = -0.205 - r. Which is bigger: 45 or o? 45 Let g be 0 + -2 - ((-3)/(-1) - 7). Let c be (206 - 0)g/(-4). Is -103 greater than or equal to c? True Let z = 3.78651 - 3.76651. Let c = 0.02 + 1.58. Are z and c non-equal? True Suppose 5c = -4p + 3c, 4c = 3p. Suppose -4l - 3 - 1 = p. Let b = -9.0264 + 0.0264. Is b not equal to l? True Suppose 5m + 5 = 4k - 3k, 0 = -2m - 2. Let s(q) = q3 + q2 + 2q + 4. Let c be s(k). Which is smaller: c or 5/2? 5/2 Let m = -11/14 - -219/154. Let v be -5 + 1 - (-6 - 2). Suppose 0 = -vt - 17 + 25. Are t and m nonequal? True Let g = -35.52 - 296.28. Let s = g + 330. Which is smaller: s or -5/3? s Let w = -2 - -10. Let m be (-4)/w + (-182)/(-4). Let g = -29 + m. Is 16 less than or equal to g? True Let j be (-26786)/6697 - (5 + (22 - 31)). Which is bigger: j or -1? j Let o(z) = 6z2 - 159z - 577. Let g be o(35). Which is smaller: 4827/4 or g? 4827/4 Let n be 12/(-9) - 448/(-84). Let k be (3 + -495)8/6. Let z = -3266/5 - k. Which is bigger: z or n? n Let y = 1 - 4. Suppose -2w - 319 - 63 = 0. Let q = w + 186. Does q = y? False Suppose 13m + 4 = -22. Let d be ((-411)/6 - 2)m/6. Which is smaller: 23 or d? 23 Let z = 26 - 336/13. Let p = -6 - -9. Suppose -py = -3 - 3, 4u - 42 = -5y. Is z greater than or equal to u? False Let z = 54 + -65. Let p = -15 - z. Let l be 9/(-6) - 2/p. Which is bigger: 1 or l? 1 Suppose -k + 2743 = -5g, -1 - 5 = 3k. Let s be g/(-114)2 - (-3)/(-1). Are s and 7 equal? False Let r = 25 - 10. Suppose rk - 11k = -1852. Which is greater: k or 2/7? 2/7 Let h(m) = -m*3 + 12m*2 - 20m. Let q be h(10). Suppose 6t = 3t + 2f + 10, q = -2t - 4f - 20. Is t <= -2.3? False Let n = 35151 + -35141. Which is smaller: n or -39? -39 Let p be (22/10 + -1)6565/21008. Let x be 0/(-3) + -1 + 1. Which is smaller: p or x? x Let u = 270 - 114. Let o = u - 155. Is 24 < o? False Let p = 9733.37 + -9733. Which is bigger: p or -33? p Suppose 2n - 2q = -n + 29, -2q = -2n + 18. Suppose -nt = 441 + 417. Is t equal to -80? False Let w(g) = -4g + 4. Let p be w(3). Let l(m) = 2m2 + 14m - 7. Let i be l(-7). Let o = i - p. Is -3/23 < o? True Let n(u) = 3u3 - 9u*2 + 7u - 6. Let c be n(16). Does 10089 = c? False Let a be ((-326)/10)/(1/10-2). Is a smaller than 52? False Let o(i) = -3i + 2. Let k(r) = -7r + 3. Let h(l) = -4k(l) + 10o(l). Let t be h(8). Let x = t - -105. Are x and -1 equal? False Suppose 4k - 11 - 25 = 0. Suppose -204n - 540 - 2250 = -390n. Which is greater: n or k? n Let y be 3970/(-2865) + 2 + 8/(-12). Is y equal to 0? False Suppose 4s - r = -3r - 758, 4s + r = -763. Let z be 18/(-30) - s/10. Let y be 12/(-7) + 61 + -59. Are y and z unequal? True Suppose 30j - 32j = -216. Let g = j + -26. Is 81 at most g? True Let i be (-3)/(9/109) + (-112)/168. Let j be 24((-9)/2 - -3). Which is smaller: j or i? i Let d = 0.338 - 0.619. Let t = d + 0.471. Do -0.7 and t have the same value? False Let k be 1 - -12*(4 - 56/12). Let y be (-96)/(-51) + (3 + k - -2). Which is greater: y or 0.4? 0.	{ "pile_set_name": "DM Mathematics" }
))/r)r(2/45)(r10)(1/2) assuming r is positive. r*(1259/180) Simplify (((jj*0jj)/j)(2/3))(-31)(jj(1/2)jjj/j(-1))/(j(-1/2))(-21) assuming j is positive. j(-139/3) Simplify (s*4(ss(-2/9))/s)/(s/((s/(s(2/3)s))/s)s)(-3/5)(((s/(ss/s2))/s)/s4)/(s(-1))14 assuming s is positive. s(719/45) Simplify (((w(-2/7)/w)/w)31)(-4/11)(w(w(-1/4)/w)/w)(-5/14)/(w(2/7)/(w/(ww6))) assuming w is positive. w(12275/616) Simplify m*0m*(-1/4)(m*(-1)m)*39((m((m(-2/15)m)/m)/mm)/m)/(m6m)(mm*0m)(28/5) assuming m is positive. m(229/60) Simplify (kk(-5))/(k/(kk(k5kk)/kk))((k/(k/(k(-1/2)/kk)))/k)*45k*0(kk5)/kkkk(kk*(-2/5)/kk)/kk(k*3k)/kk assuming k is positive. k(-509/10) Simplify (w/((w0ww)/w))(2/9)/(w(-1/2)w)*(11/4)((w/(w*5w))(-1/6))(2/55) assuming w is positive. w(-355/264) Simplify (n1/(n/(nn(-5)nn)))/(n(n/(n/((n*(1/4)/n)/n)))/nnnnnn*(-2))(n/n(-1))(1/11)nnn(2/5)n(2/15) assuming n is positive. n(307/660) Simplify (d*(-1/13)d(4/5))(-33)(d(2/7)d)(-22)/((d4d)/d(-4/3)) assuming d is positive. d(-79826/1365) Simplify (o(-42)/o(-2/53))/(o(-2/27)oo(-18)) assuming o is positive. o(-35615/1431) Simplify ((n(-2))30n*6(n/n*(-5/6)n)/nn)/((n/n(1/5))/n3)(-1/11) assuming n is positive. n(-1541/30) Simplify (((t/(t(-7/3)/tt))/t*(-4/11))/(((tt*(-1)t)/t)/t(-1/22)))12 assuming t is positive. t(482/11) Simplify (t(-2/3)/t(-2/9))13/((t(-1))(12/11)t2tt/(t(2/15)/t)) assuming t is positive. t(-4729/495) Simplify (f/(f/f(-1/3)))(3/35)/((fff(-8)f)/((f/(ff/f(-8)))/ff))(f3/(((ff(-2/7))/f)/f))38 assuming f is positive. f(5559/35) Simplify ((((t/t(1/4))/t)(5/9)/(t9t(-1)))(2/39))(-27/2) assuming t is positive. t(293/52) Simplify ((p8/p5)/(p(-2)/(pp/(p/(p/(p(-5)/p))))))(-35) assuming p is positive. p*(-455) Simplify ((o/(oo*(-4/21)))/o(o/o*(1/8))/oo(o(3/5))(22/5))(-46) assuming o is positive. o(-261349/2100) Simplify (r(-4)r(1/2)/r)/((r(3/4)/r)/((r/r*(6/11))/r))(rr/(r/((r(-2/13)r)/r)r)rrr*(-10/7)rr)(-2/21) assuming r is positive. r(-422581/84084) Simplify (((f(1/6)f)/f)/f(ff/f*(1/10)ff)/f)36/(((ff/f0)/f)/(f/f1f)f*7f8) assuming f is positive. f(297/5) Simplify ((b/b(-14))20/(bbb/(bb/((bb/(b((b/(b/(b/b(-11))))/b)/b))/b)b)bbbb)29)(-5) assuming b is positive. b*(-2370) Simplify ((gg(9/4))/(g/g(-8))g3gggg(-1)/gg)/((g2)(-32)/(g*(-2/5)/g(g/g(1/3))/g)) assuming g is positive. g(3691/60) Simplify ((c*(-5/3)c/(c/c(-1/13)))/(c(1/3)/c*(-2/3)))/(c(ccc*(-5/3))/ccc/(cc(6/7)))33 assuming c is positive. c*(-5039/273) Simplify ((ff0)/f(-3))/(ff(-5)f*(-5))((f/(f(-1/2)/f))/(f(1/2)f))42 assuming f is positive. f55 Simplify ((x(1/3))41)(-49)(xxx*(-3/7))/(xx/(x/(x*(-2/3)x)))(xx5)/(((x(-1/7)/x)/x)/x) assuming x is positive. x*(-4622/7) Simplify (rr/(r*(-11/4)/rr)r/r20r(r/(r(-7/6)/r))/r34)(15/2) assuming r is positive. r(-2645/8) Simplify ((hh/(hhh*(-1/9)h))*(-9/8)h(1/10)/(h/h6h))(-26) assuming h is positive. h(-663/5) Simplify ((d(4/9)d/(d*(2/11)d)d)/(d6/d3))/(((dddd(d(((d*3/dd)/d)/d)/dd)/dd)/(d/d*(3/8)))/(ddd1dd)(-7)) assuming d is positive. d(-33353/792) Simplify ((g(3/7)/(g(3/7)/g))/(((ggg/((gg/g*5g)/gg)g)/gg)/(g/g(-5))))/(g(g/g*4)/ggg(-2/15)(g(2/3))(-33)) assuming g is positive. g*(377/15) Simplify ((kk*(-8/3)k)/(kk(k/k*(2/13))/k))/(kk/(k*(-14)k))13 assuming k is positive. k(-7703/39) Simplify ((n(-1))(-2/29)/(n(-3/8)/n(5/4)))(-23) assuming n is positive. n(-9039/232) Simplify (o*(-6)o(-3))(-2/51)(o(3/4)o/(oooo(2/7)))/(((o/o(-1))/oo)/o2) assuming o is positive. o(-563/476) Simplify (((f*(-2/3)f)/(f*(-14)f))/(f(-4))(-23/3))(2/43) assuming f is positive. f(-104/129) Simplify ((((o*(2/57)o)/o)/o)*31(o/o*(-4/13)o)43)(-49) assuming o is positive. o(-2516885/741) Simplify (a20aa*(-3/19)(a(-14)/a)/(a25/a))(2/65) assuming a is positive. a(-138/247) Simplify ((m*15m)(23/3)/(m/m0m)(2/27))(1/5) assuming m is positive. m(3308/135) Simplify (((((qqq(-2/5)/qq)/qqqq)/(((q/(q/q(-1/2)))/q)/qq))22)33)(1/9) assuming q is positive. q(2057/5) Simplify (j/(j*(-1/4)j)jjj(1/7)(j(j/(j1/j)jj)/j)(17/2))/((j(jj3/j)/j)/(j/((jjjj(-1/3))/j)))(8/3) assuming j is positive. j(4565/252) Simplify (b(-2)b)(1/2)(bbbb1b)/(bb(3/8))((b/(b/(bb/((bbb2)/b))))/bb*(4/9)/b)/((bb/(b*(1/5)/b))/bb*(-3/4)/bb) assuming b is positive. b(-173/360) Simplify (s/s(-1))(2/107)/((s(-2/5)/ss)/s(-1))(s*(-6/5)ss(-1/4)/ss)(-34) assuming s is positive. s(15769/1070) Simplify ((((h/h(2/3))/h)/h)/h(-4))(2/13)/(h(-1/4)/(hh(-1/3)/h)h*1(hh(h/(hh4h))/hhhhh)/hh) assuming h is positive. h(-113/156) Simplify ((ss2)/(s/(s9/s)))/(s7/(s3s))(s(-2/3)/s7)/(s(-2/15)/(s(-3/2)/s)) assuming s is positive. s*(-91/30) Simplify (mm/m*(1/4)m(m/(mm*(-1)))/mmm(-5)m/(m(m0m)/m))/(m(-3)/m(-3/5))26 assuming m is positive. m(1223/20) Simplify (v/(v*5/v))/(vv*5/v)((((v*1v)/v)/vv)/v)(-1/17)v(-2)/v(-1/5)(v1v)(14/13) assuming v is positive. v(-497/65) Simplify ((((y/y*(13/3))/(y/(y/(yyy(-6)))))(-2/61))(-2/23))15 assuming y is positive. y(40/1403) Simplify ((o/(o(1/6)/o))(26/3)(o/(o/(o*5oo)))(-45))39 assuming o is positive. o(-34996/3) Simplify (((g/g(-1/4))/g)(-4/15))(-4/17)gg(1/2)g*(-4/7)/g(gg(-2/7))9 assuming g is positive. g(22751/3570) Simplify (f/(f/(ff1)))(26/3)/(ff/(f/f(-3/2)f)ff*(-8)/ff)(f/(f/f(2/5)))43/(f(-1/16)ff/f4ff) assuming f is positive. f(10343/240) Simplify ((bb*(-2)b/(b/(b*(-9)/b))bb0b5)(-30))34 assuming b is positive. b5100 Simplify (g*(2/13)/(gg*(6/23)))/((g/(g/(ggg(-2/23))))/(g(g((gggg/g*33)/g)/g)/gg)) assuming g is positive. g*(-9574/299) Simplify ((o/(oo*(-2/3)o))/(o/(oo(2/23))))45/((oo(-1/5)/o)(-11/5)/((o(-7)/o)/o(2/5))) assuming o is positive. o(-11458/575) Simplify ((d(4/5)/ddd(-16))/(d7/d(3/13)))(2/57) assuming d is positive. d*(-952/1235) Simplify (((n/(nnn(1/16)n))/n)/(nn/n12)n/((n/(n*13/nn))/nn)n(2/57))(-47) assuming n is positive. n(-856105/912) Simplify (k5/(k*(-5/4)/k)((k/((k*(-1)kk)/kk))/k)50)/((k/k(-2))/k*(1/4)kk(-5)k(-2)) assuming k is positive. k(-79/2) Simplify ((i(-2/9))(-46))*(33/4)/(((i(ii(-3))/i)/((i/(((i/i(-1/4)i)/i)/i)ii)/ii))/(ii(2/3))(13/5)) assuming i is positive. i(1121/12) Simplify ((z(2/7)/z*(-1/2))/((z/(zz/((zz(-2/19)/z)/zz)z)z)/(z*(-5)/z)))/(zz*(-3)z6)24 assuming z is positive. z*(-26629/266) Simplify ((o(o/o*(-15/2))/o)/(ooo(-7/3)o)(o(-9))(2/45))45 assuming o is positive. o(669/2) Simplify (h(-4)/(h(-3)/h)h/h*3h(-6))/(h(-3/10)(h(-2/7)/h)/h)(-46) assuming h is positive. h(-4443/35) Simplify (k/(k/(kkk(1/28)kk)))/k41(kkk(5/9))1 assuming k is positive. k(-8671/252) Simplify (((g0ggg)/gg)(-11))(-4/31)(g(2/7)/g)(11/3)/(g/g(2/5))(-29) assuming g is positive. g(61972/3255) Simplify (w(-3)w*(-6)(w/w(-1/4))(-26))/((w(w/(ww/w*2w))/w)/ww(-5/3)ww(w(-2/11)/w)/w6) assuming w is positive. w*(-2221/66) Simplify ((zz1)/(z/(z(-1)/z)z))(-4/9)/((z/(z1z)zzz2)/(zz/(zz(2/5)/z)zzzz/z(2/3)zzz)) assuming z is positive. z(262/45) Simplify ((h(-2/5)/h*(1/2))/(hh*(-2/7)(hhh*(-1/7)hh)/h))(-11) assuming h is positive. h(3443/70) Simplify (v(-3)vv/(vvvv/v*(4/3))(vv(-1))(3/10))/((v(-1/3))(-10)/(v/(vv(-2/7)))(2/7)) assuming v is positive. v(-339/49) Simplify ((q(-3)/qq)/q8(q*(7/5)q)/((q*7q)/q))/((q/(q*2q))*(-18)/(qqq/(q3q)(qq*(-2))/q)) assuming q is positive. q	{ "pile_set_name": "DM Mathematics" }
- 2159t2 + 0 + 6t + 2. What is y(-2)? -3 Let x = 89 - 87. Suppose 0 = 5g + xu + 43, 5u - 14 + 13 = 3g. Let o(w) = -w*2 - 7w - 2. Determine o(g). -2 Let f(u) = u*2 + 6u - 1. Let l be f(-5). Let b(p) be the first derivative of 1 - 4p + 96 - 192 + p2. Determine b(l). -16 Let h(c) = 21c - 160. Let a be h(8). Let u be (-140)/63-36/a. Let z(w) = -2 + 2w - 3w + 2w + 5. Calculate z(u). 8 Let h be ((-13)/3 - (-10)/(-18 - 12)) + 5. Let p(i) be the first derivative of 4i - 6 + 2i2 - hi*3. Give p(4). 4 Let l(q) = -8q - 10q2 - 7q - q*3 - q. Let v be l(-8). Let x(d) = -2d + vd + 2 + 3d. Give x(-6). -4 Suppose -5d - 2n = -4n - 20, 4d - 4n - 4 = 0. Let j(w) = -dw - 2w + 12 + 10w - 3 + 5w. Determine j(-2). -5 Let y(d) = 11d + 71. Let u(j) = 133j + 3053. Let x be u(-23). Give y(x). 5 Let f(j) = -2j*2 + 71j - 30. Suppose 6r = 8r + 15r - 595. Calculate f(r). 5 Let q(g) = -29g*2 + 12g + 21. Let n(m) = -6m2 + 3m + 5. Let l(y) = 9n(y) - 2q(y). Calculate l(-3). 30 Let r(w) = -6 - 2 - 415w + w2 + 830w - 419w. What is r(-3)? 13 Let g(d) = -3d - 4. Suppose -9j + 7579 = 7552. Calculate g(j). -13 Let m be (-2)/(16/(-759)) + 73/584. Let x = 97 - m. Let n(s) = s. Let g(h) = -h - 1. Let w(y) = 2g(y) + 3n(y). What is w(x)? 0 Let y(t) = t2 - 12t - 1. Let l be ((-408)/16)/(6/(-4)). Let v be l + (-2)/414. Calculate y(v). -21 Let l(i) be the second derivative of -4/3i*3 - 13/2i*2 + 224i + 0. Give l(-2). 3 Suppose 119m + 6t = 120m + 11, -4m = -4t + 24. Let l(g) = -g3 + 16g*2 + 106g + 9. What is l(m)? 4 Let k = -306 + 334. Suppose 0 = -kg + 24g + 12. Let a(v) = v - 10. Calculate a(g). -7 Let g(h) = -h2 - h - 2. Let l(o) be the first derivative of -o4/4 - o*3 + 5o*2/2 + 9o - 15. Let n(k) = -4g(k) - l(k). Calculate n(-7). 6 Let p be (-2 - (1 + -11)) + -4. Let z be p/(-7) + 8/14. Let b(l) = -7 + zl - 5l + 4l + 0l. Give b(-9). 2 Let r(k) = -12k - 6 + 1 + 3 + 21k. Let v(y) = 5y - 1. Let u(m) = -4r(m) + 7v(m). Calculate u(3). -2 Let p = 164 - 170. Let r(y) = 13y2 - 13y + 19. Let s(h) = 7h2 - 6h + 9. Let z be 68/6 - 3/9. Let v(o) = pr(o) + zs(o). What is v(11)? -4 Let k(i) = -10i + 58. Let o be k(5). Let n(f) = 10f - 1. Let p(s) = -15s + 2. Let b(m) = on(m) + 5p(m). Calculate b(-2). -8 Let d(l) = -l + 3. Let g be d(-2). Let i(r) = 9 + r2 + 7r - g + 2. Give i(-5). -4 Let l(p) = -178 - 174 - 176 - 2p2 + 8p*3 + 0p - 2p + 529. Give l(2). 53 Suppose 0 = 5f + 4u, -17u = -22u. Suppose -245i + 254i = f. Let s(q) = -q2 + q - 39. Give s(i). -39 Let a(w) = -10w*3 + 16w*2 + 51w + 65. Let b(f) = 3f3 - 5f*2 - 17f - 21. Let l(g) = -2a(g) - 7b(g). Determine l(6). 11 Let r(l) be the third derivative of -l*5/60 + 25l*4/24 + 17l*3/6 + 111l*2 - 9l - 2. Give r(25). 17 Let f(y) = 2y2 - 24y + 15. Let i(x) = -13x + 8. Let g(h) = -5f(h) + 9i(h). Determine g(1). -10 Let z(h) = 2h*2 + 8322h - 5h2 + 2h*2 - 1 - 8317h. Let v be (3/(-6))/((-3)/18). What is z(v)? 5 Let h(n) = -n*3 - 10n*2 - 3n. Suppose 0 = -3w + x + 149, 5w + 2x + 98 = 7w. Suppose 1056m = 1051m - w. What is h(m)? 30 Let m(q) = -11q - 40. Let d be m(-4). Let t(z) = -2z + 1 - 4 + d + 0. Give t(-5). 11 Suppose 10u - 28 = 3u. Let v(h) = 0h + uh - 4h - 2h*2 - h + 2h. What is v(4)? -28 Let j be -11 - (-2 + -19 - -12). Let f(l) be the third derivative of l*4/3 + 39l*2. Calculate f(j). -16 Let g(t) = 8t. Suppose 5p = 42j - 38j - 14, 5j = -2p + 34. What is g(p)? 16 Let p(g) = 2403g*2 - 2g - 2g3 + 5g + 0g3 - 1197g*2 - 1205g*2 + 2. Determine p(3). -34 Let f be (-1)/1 + (-2)/(-2). Suppose -28 = -9l + 35. Let b(a) = -8a3 - 18a + la3 + a2 - 9 + 17a + 1. What is b(f)? -8 Let l = 45 + -42. Let f(j) = 42j + l + 38j - 78j. Suppose 0z = 3z + 6. Calculate f(z). -1 Let a(u) = -2u*2 + 6u + 7. Suppose -2o + 240 = 13o. Suppose 8t + o = 56. Calculate a(t). -13 Let w(a) = 4a*2 - 2a + 4. Let m be 96/(-28) - 63/(-147). What is w(m)? 46 Let m = -693 - -695. Let t(i) = -2i - 6i2 + i3 + 10im - 11 - 6i. Calculate t(-5). 4 Let g = 1098 - 1087. Let q(j) = j*3 - 16j*2 + 6j + 9. Let z(u) = -u*2 - u. Let s(v) = -q(v) + 4z(v). Give s(g). 2 Let y(v) = 327v + 1302. Let w be y(-4). Let q(g) = g3 + 8g*2 + 6g + 13. Give q(w). 49 Let q(s) = -s*3 - 6s*2 - 2s - 3. Let r = -167 + 215. Suppose r = -3i - 5i. What is q(i)? 9 Let o be (-637)/(-49)6/26. Let k(n) = -9n + 6n + 4n*3 - 8n*3 - o + 3n*3. Calculate k(-2). 11 Let h(r) be the first derivative of 7r5/10 - r2/2 + 25r - 10. Let v(q) be the first derivative of h(q). Calculate v(1). 13 Let w(j) = 45j*2 + 36j - 2. Let c(b) = -b*2 + 27b + 123. Let m be c(31). Calculate w(m). 7 Let x(s) = s*2 + 11s + 5. Suppose -43 = -3b + q + 46, 34 = b + 4q. Suppose b + 40 = m. Suppose -m - 29 = 9l. Determine x(l). 5 Let b = 57 - 261. Let v be -8 + b/(-24) + 42/4. Let r(q) = -q2 + 11q - 11. Determine r(v). -11 Let q(y) = -3y + 26 + 6 - y + 4y + 2y. Give q(15). 62 Let c(r) = -r3 + 7r*2 + 13r + 28. Let s be c(9). Let j be (-552)/68 + (-2)/s. Let u(a) = a*2 + 9a + 7. Calculate u(j). -1 Let c(t) be the second derivative of t*3/3 + 7t*2 + 26t. Let o be c(-10). Let r(u) be the first derivative of 3u2/2 + 3. What is r(o)? -18 Let z(o) = -4o - 11. Let u = -5180 - -5175. Give z(u). 9 Let n(v) be the third derivative of v6/120 + v5/6 + v*4/3 - 7v*3/3 + 1960v*2 - 2v. What is n(-9)? -5 Let o(g) = -7g3 + 16g*2 + 3g - 32. Let p(x) = 3x3 - 9x*2 - 2x + 19. Let h(v) = -2o(v) - 5p(v). Calculate h(13). 21 Suppose -5p = -4z + 17, -2z + 3p + 11 = -2p. Let v(i) = -4i*2 + 3i + 1 - 6 + z + 5i2. Suppose -2o = -3 + 13. Determine v(o). 8 Let a(q) = 2q - 12. Suppose 0b - y = 4b - 73, 3b + 2y - 61 = 0. Let z(t) = -t2 + 19t - 21. Let k be z(b). Suppose 0 = 10n - 103 + k. What is a(n)? 6 Let w(n) = n + 11. Let q be (15 - 13)(10/(-5) + -33). Let o be (-10 + 1)/((-6)/(-42)). Let r = q - o. What is w(r)? 4 Let y(i) = -1. Let x(c) = 4c - 8. Let s(q) = x(q) - 12y(q). Let u(g) = g + 1. Let m(l) = -s(l) + 5u(l). Suppose -2 = 2o - 0. What is m(o)? 0 Let d(f) = 2811f + 8 - 2 + 2824f - 5636f. Let t be (1 - 2) + 36/(-6). Let s = 14 + t. Calculate d(s). -1 Suppose 17i + 10i - 11 - 16 = 0. Let z(l) = -6l + 6l + 18l2. Calculate z(i). 18 Let b(r) be the third derivative of r6/120 + r5/60 + r3/3 - 74r2. Suppose 5l - 25 = 10. Let c = l - 7. Calculate b(c). 2 Let p(a) = 2a - 1. Suppose 54n - 47n - 840 = 0. Let u be ((-24)/n)/(2/10). What is p(u)? -3 Let w(g) = -g3 - 55g*2 - 114g - 440. Let z be w(-53). Let a(f) = f*2 + 17f + 51. Calculate a(z). 35 Suppose 153 = 13s - 19s + 5z, -2z + 52 = -2s. Let x(y) = 2y - 25. Determine x(s). -71 Let r(b) = b*3 + 13b*2 + 18b + 17. Suppose 0 = -4v - 2k - 50, 37k - 41k = v + 16. What is r(v)? -55 Let o(r) = r3 - r2 - 1. Let y be 64/704 - ((-5312)/11 - 0). Let z = 485 - y. Calculate o(z). 3 Suppose 3j + 3g = -11 + 8, 5 = -j - 2g. Let c(u) = -58u + 171. What is c(j)? -3 Let w(l) = l*3 + 9l*2 + 3l + 34. Let f(z) = -z*2 - 29z - 63. Let j be f(-27). What is w(j)? 7 Let u(l) = 10l2 + 114l + 52. Let r(v) = -3v2 - 36v - 18. Let i(h) = 7r(h) + 2u(h). Determine i(-24). -22 Let s = -210 + 216. Let k(r) = -r - 1. Let d(t) = -8t - 9. Let f(n) = sk(n) - d(n). Suppose 4j = -0j - 16. Give f(j). -5 Let w(t) = -899t + 1787t - 894t. Let s be -2(1 + -2)2. Let r(f) = f + 1. Let b(c) = sr(c) + w(c). Calculate b(6). -8 Let o(t) be the first derivative of -t*4/4 + 5t3/3 - t2 + 2t + 629. Let v be 4/2(-5)/(-2). Calculate o(v). -8 Let h(p) = -p + 0p - 4 + 0p. Let t be h(0). Let x(s) = -15490s2 + 7736s*2 + 5s + 7755s2 - 1. Calculate x(t). -5 Let i(b) = b2 - 3. Let a(x) = 3x2 - x - 7. Let v(k) = -k2 + 5. Let r be v(-3). Let y(f) = ra(f) + 10i(f). Calculate y(5). -32 Let z(k) be the first derivative of -k*5/60 - 11k4/24 - k3/3 + k*2/2 + 25k + 103. Let a(n) be the second derivative of z(n). Calculate a(-10). 8 Let a = 7 + -1. Let s be (-3)/a + (-18)/4. Let n(v) = 2v3 - 8v*2 + 2v - 12. Let k(d) = -d*3 + 2d**2 - d + 6. Let w(	{ "pile_set_name": "DM Mathematics" }
-140) -4/5 2358/2268 + (8/6 - 212/168) 10/9 Evaluate 120916/(-2812) + 942/22. -2/11 Evaluate 55 - (-57785)/(-1170) - (-4)/18 - 24/4. -1/6 7695/70200 - (27/(-30) + 1) 1/104 Evaluate (3 - 528/160)(-193 + -17). 63 What is (-13)/39 + (9/5 - (234/9)/26)? 7/15 What is the value of (120/(-1260) + 50/84)-2 - 4/14? -9/7 64 + 2306220/(-35815) + (-12)/(-26) 2/29 18 + 13(-1602)/1197 + 10/(-35) 6/19 Evaluate (-362)/329 - (-6)/517(-4499)/1227. -8/7 (4 - 6)1(4745/(-598) - -8) -3/23 What is (52/(-1508))/((-312)/(-12) + -27)? 1/29 Calculate ((-48)/((-2688)/140))/((-9)/6). -5/3 Calculate (-428)/2996147/9 + -2. -13/3 Evaluate (364/5 - -1) + (-103)/463536. 73 (-960)/(-1760) + (-11 - 6/4621043) -24 What is the value of -13 + 37 + (256 - 253)? 27 What is (6/112)/(25 + 90/(-12) - 13)? 1/84 What is (-36)/8(-3)/(-9)(48791/(-291) + 113)? 82 Calculate (192/640)/(-1877/(-84)). 1/55 Evaluate ((-125)/(-10))/((-23000)/(-53360)). 29 What is 1110/(-6)(10980/330 + -36)? 50 ((-8 - 5) + (-2)/((-22)/99))(-12 + 1) 44 Evaluate 2/(-55) + (-270802)/(-323785). 4/5 Calculate 124 + -53 + -48 - 19/(-1). 42 Evaluate (-213 + (-112880)/(-498))/((-2)/(-18)). 123 Calculate (6/7)/(-3) - ((-10 - -10)/(-20))/(-1). -2/7 Evaluate (((-1104)/230)/24)/(68/20-1). 1/17 What is the value of (325/(-15))/((-2055)/(-5343))? -13 Calculate 621/(-54) - 300/((-680)/34). 7/2 What is the value of -72 + 14((-4)/12)/((-231)/(-63) + -3)? -79 What is ((-10413)/(-135) - 4) + (2/24)/(225/(-360))? 73 What is the value of 40/(-286) + (-110)/(-121)? 10/13 What is the value of 2/8(-6)/(-205)(9457/(-147) - -51)? -4/41 Evaluate (-1 - (8 + -5))7482/696. -43 What is the value of 5(-102)/170 + 1/((-8)/116)? -35/2 Evaluate ((-1)/(-12))/(5745/(-1792440)). -26 What is 102/(-6885)1179 - (13 + -30)? -7/15 What is the value of 20/90 - 8066/333 - -97? 73 Evaluate (-45 + (-81380)/(-1768))/(5/8) - (6 - 4). -6/17 Calculate 340/1105 - 2304/52 - -145. 101 Evaluate ((-11065)/3685 - -3)/((-1397)/(-15367)). -2/67 Evaluate (-11796)/(-16711) - (-62)/(-136) - 218/8. -27 What is (-60 - 5200/(-75))/((-1)/(-3))? 28 (-34)/(-30) + 9/(-5) + (-574)/(-840) 1/60 What is 11515/(-343) + (-136)/238 + (-4)/(-28)? -34 (((-110)/(-30)15/30)/11)/((-1)/111) -37/2 Evaluate (-57 - 54 - 33)((-5)/(-18) + 4/18). -72 What is ((-300)/(-105))/(80/105)16/(-2)? -30 What is the value of (1209/(-78))/(6/(-33) - 141/2068)? 62 Calculate (-945)/(-378) - 1274/(-52). 27 What is ((-36/10)/1)/(914/(-4570))? 9 (-4)/19 - 172744/(-2869) 60 What is the value of ((-28)/(-39))/(17628/38194)? 14/9 What is 5/((-24)/160(-225)/54)? 8 51/204(173 - 21) 38 114/(-1083)-193/(-27) -2/9 Evaluate -16 + 23 - (0 - (-1174 + -11)/15). -72 What is 27 + ((-3)/2)/(-38(-132)/13376)? 23 Evaluate 37 - 9179/67 - -38. -62 What is the value of 440/(-60) + (-13)/(-37 - 2) + 84? 77 Evaluate (-1275)/(-4403)-238 + 69. 3/37 ((67596/12943)/(-262))/((-6)/(-28)) -4/43 What is the value of ((-245)/1715)/(1/(-77))? 11 Calculate (22605/765 - 28) + (-10)/6 - 16506/(-714). 23 What is the value of (-1)/72 + 3102/3147120? -2/155 Calculate ((-516)/(-10) + -18)(-5)/2. -84 Evaluate (4 + (-81)/(-54))/((-8)/(-48)). 33 Evaluate (75 + (-45496)/605)/((-17)/(-5) - 0). -1/17 Calculate 11196/228 + (-288)/2736. 49 What is 1202256/(-55660)40/(-18)? 48 What is the value of (0 + -14)(-4032)/(-4704)? -12 Calculate (((-14630)/(-43035))/(-154))/(13/19510/4). -2/151 What is (-10)/(-12)847980/(-16825)? -42 What is 27(-13)/(-819) + (-2068)/88(-8)/(-14)? -13 What is the value of 31/(2232/(-60))(0 - -3)312/180? -13/3 What is ((-20)/26 - 0)(1110 - 1097) + 424? 86 3 - (7980/931)/((-6)/21) - -11 44 What is the value of 8/(-28)6/4 + (111 - (-648456)/(-5740))? -12/5 What is the value of -7 - (-9 - -5((-396)/90)/(-22))? 1 Evaluate (-186)/9 + -25(-86)/215. -32/3 What is (6 - -88)/(530 + -532)? -47 Evaluate (5/75)/(2/6) + ((-60736)/(-520) - 112). 5 Evaluate (-16)/(-8)(774/(-12) + (38 - 26)). -105 Calculate (3 + ((-6)/30 - 4))(-84)/63. 8/5 Evaluate (-28)/42((-234)/180 - 2). 11/5 Calculate (-89784)/(-195048) - (-5)/(35/(-4)). -1/9 -19 - (273/28 - 10)/((-4)/(-224)) -5 What is 10290/(-931) + (-336)/114 + 3 + -2? -13 ((-6)/81-4(-2316)/6176)/(23/2) -2/207 Calculate 26 - (-34 + (171 - 51)). -60 (-191)/(32088/(-2448))(4/(-1) + (-25)/(-50)) -51 Calculate 7 + (-3751)/154 + (45 - (44 + -17)). 9/14 Evaluate 58/11 + 45/(-13200)80. 5 What is the value of 11/(-4) - (-340 - -340)? -11/4 Calculate ((-84)/32)/(117/(-12))((-372840)/455)/(-239). 12/13 Evaluate (-15)/(-50) - (2 - 1364/770). 1/14 What is the value of (0 + 2)9/6 + 44/10736-724? 2/61 Evaluate -1380/(-312)-8(-3)/60. 4/3 Calculate (-138)/16 + 9 - 7/(-56). 1/2 ((-1050)/(-385))/(20/(-1320)-4) 45 Calculate 8/112-102 - -7 - (34 - (-2108)/119). -52 4018/(-1148)(-460)/(-35) -46 What is 154/(-1540)(-20)/1? 2 What is the value of (16/(-5))/((-1296)/(-50) + -8 + -18)? 40 Calculate -95 + 495/316832. -90 What is -2 + 23 + (-163)/((-51345)/(-1350))? -2/7 Evaluate 3256/40 + (532 - 614). -3/5 What is (-3570)/(-54) + (66352/144)/29 + -16? 66 What is (-47736)/(-3510) + 9/(-1)? 23/5 Evaluate 91/(-672)-22 - (-16 + 33 + -14). -1/48 (-84)/(-56) + ((-8)/((-1344)/45))/((-72)/352) 4/21 186 + 16445/(-91) - (-2 - 16/(-7)) 5 Evaluate (-72)/(-96)446/(-12)1/2. -23/4 Evaluate (1/((-2)/78))/(19 + (-29)/((-406)/(-280))). 39 What is 76/12 - (-25805)/(-4095)? 2/63 Evaluate (-111)/12 + (58 + -130)(-2)/16. -1/4 Evaluate (-108)/60(104/7 + -7)7. -99 Evaluate (-320)/(-1024) + 75312/2304. 33 ((21/(-6))/((-15)/(-70)))/(84/36 - 2) -49 What is (-4140)/(-12880)50/(-45)? -5/14 What is (-6)/13 + (-40 - (-399520)/9867)? 2/69 2/(-4)(-1272)/(-20) + (16644/380 - 45) -33 (-275)/(-75)210/(-11165) -2/29 What is (-1834)/(-393)(-498)/84(6 - 15/5)? -83 Calculate (2288/(-6292))/((-13)/(-1144)). -32 2/46(-4416)/(-18768)(1 - 18) -4/23 What is the value of (-665)/3820/(-350)14? 14 Evaluate 432/2900 - 1334/16675. 2/29 (-1887)/(-861) - 48/984 15/7 What is -18(1027/(-78) + 12) + 8? 29 Calculate -2 - 1852/68 - (-440 + 411). -4/17 Calculate (8945/(-725) - -14) + (16/4 - (-319)/(-55)). -4/29 (568 - 551 - (-1 + 12))/(-39) -2/13 What is (-22)/589300/(-49115)? 8 258/(-585) + 52/390 - 151822/2678 -57 (-1)/(231/(-51)) - 3476/9559 -1/7 Calculate 6/(-294) + 200124/6867252. 2/229 Evaluate 5410/50 + (-144368)/1289. -19/5 What is the value of 257 + (-185 - -65 - -7)? 144 What is the value of -48 - 27/(1053/(-2652))? 20 What is the value of 84/(-45)((-1)/(-7))/((-228)/(-3990))? -14/3 What is 225/842552/(-6380)? -15/14 2070/25 + (-7038)/3910 81 What is the value of (-130)/(-4) - (-214560)/(-6705)? 1/2 Calculate 3094/(-182) - (8 + -6 + -49). 30 Evaluate -2188/(-8)(-204 + 203). -47 Evaluate (-411)/(657189/78) - (-93)/1066. 1/26 Evaluate (5 + -1)/(7476/4788 + (-5)/3). -38 What is the value of 16(-189)/216 - -6? -8 Calculate 11 + (((0/1)/4)/3 - (-26676)/(-2432)). 1/32 What is the value of 4 + (1 - 248319/9139)? -6/37 Calculate 1588/1191 - ((-4)/(-14))/(3/21). -2/3 (180/(-765))/(72(-41)/(-8364)) -2/3 0 + -1 - (3255/248)/(-35)52/39 -1/2 (-138)/(-506)(-3 - (-690)/234) -2/143 8908/786 + ((-990)/88 - 1/(-4) - -1) 4/3 Calculate -11 + 112314/427. 1/61 What is (-32 + 29)(-82)/246? 1 What is the value of 18/(-66) + 1520/2508? 1/3 (4/(-70))/((-8)/25)30624/19140 2/7 (2/(-76))/((-7700)/(-14630)) -1/20 Calculate (43/(-6) - (4 + -11))/(167/31062). -31 (0 + 15(-108)/3645)6/4 -2/3 -105 - (((-12)/(-60))/(12/1560) + 0) -131 What is the value of 2464/203 + -45 + 726/22? 4/29 What is (174/30)/(2079/135) - 2/7? 1/11 Evaluate 10/25(4275/(-114))/(-25) + 68/(-105). -1/21 What is the value of 9 - -66 - ((-7 - 11) + 41 + -7)? 59 Calculate (-138)/(-12) - ((-3652)/(-1162))/((-4)/(-14)). 1/2 Evaluate (2515/(-1509))/(5/(-99))1. 33 Calculate (-39930)/(-10890) + (-465)/36. -37/4 Calculate 209448/4625312/72. 2/159 Evaluate 3111/(-35) + 7 - (-17 - (-2574)/154). -8/5 Calculate 0 - (-15)/(-10) - ((-46866)/(-1095))/(12/(-15)). 52 What is 7 - (607/32 - 0 - (173 + -161))? 1/32 ((-855)/63 + 14)/(20286/686) 1/69 Evaluate (-6)/(-4) - ((-203)/(-7) - (-7030)/380). -46 22/55(-35)/(-728)8/(-3) -2/39 Evaluate 371 + 104 + (-765)/9. 56 ((-6920)/2900*-5 - (-8)/116) + 3 15 (4 + 424/16 - 26) + 118/4 34 Calculate ((-8)/14)/((-12016)/(-44	{ "pile_set_name": "DM Mathematics" }
407, x? 407 Let g = -3982 - -3987. What is the second biggest value in 1, 1/4, 3, -0.15, g? 3 Let a = 4664.22 + -4681. What is the biggest value in a, -3, -5, -0.4? -0.4 Let d = 290.5 + -290. Suppose 3c = -3u - 72, -10 = u + 5c - 2. Let k be 4/(-12) - u/30. What is the fourth smallest value in k, d, 3, 2? 3 Let d = 12/37 - 58/407. Let n = 876 - 553. Let u = n - 320. What is the fourth biggest value in d, -1/4, -5/7, u? -5/7 Let p be 3 + -1(2 + -4). Let v be (-35)/(-120)(-18)/42. What is the fourth biggest value in -2, p, v, 0.1? -2 Let f = 87300 + -87299.9. Let r = 2 + -1. Which is the third smallest value? (a) r (b) f (c) -16/7 a Suppose -4r = -3d, 373d + 6 = 2r + 370d. Let y = -0.12 - -0.14. What is the second smallest value in 14, y, r? y Let f = -0.16 + 0.86. Let n = 1.1 - f. Let b = 369 - 372. What is the biggest value in -1/6, b, n? n Let a = 705.0117 - 705. Let t = 0.0917 - a. What is the second smallest value in 3, -10, t? t Suppose -z - 28 = -32. Let w(v) = -v + 1. Let r be w(z). Let d be (2 - 5)/(-33)-2. Which is the third biggest value? (a) 2 (b) d (c) r c Let m = -10782 - -10777. What is the fourth biggest value in 149, -3/8, m, -3? m Let o = -99 - -18. Let j = o - -78. What is the third smallest value in 0.8, j, 1? 1 Let f(d) = d3 + 4d*2 - 10d - 7. Let z be f(-6). What is the smallest value in 5, z, -8? z Suppose 0 = -4f + 4y - 32, 5f = -4y + 11 - 24. Which is the fourth biggest value? (a) 0.2 (b) 2/9 (c) f (d) 0.1 (e) 2/11 d Let u = 93 - -25. Let f = 118 - u. Suppose 0 = -3o + 9, s + 3o = -2 + 5. What is the third smallest value in f, 3, s? 3 Let u = 9.49 + -9.99. Which is the third biggest value? (a) -0.15 (b) 0.4 (c) u (d) 21 a Let g = -8004 + 8014. What is the second biggest value in -1/3, g, -0.3, -7.8? -0.3 Let w(n) = -252n + 3533. Let x be w(14). Which is the fourth smallest value? (a) x (b) 2 (c) 2/5 (d) 1 a Let g(d) = d3 + 6d*2 - 5d - 6. Let t be g(5). Let o be (82/861)/(5110/5112 - 1). Let w = t + o. What is the third biggest value in -2, 3/8, w? -2 Let s = 31331.8 - 31331.3. Suppose -2r + 4 = -0. Let t be (r/28)/((-1)/4). Which is the fourth biggest value? (a) 0.2 (b) s (c) -1 (d) t c Let i = 3330 + -13895/4. Let n = -144 - i. Which is the smallest value? (a) n (b) 2/19 (c) 0.5 (d) -1 d Let x(u) = -22u*2 + 219u + 8. Let t be x(10). Which is the smallest value? (a) -2/27 (b) 0.1 (c) -0.2 (d) t d Let t be (-4)/(-42)(42/(-12) - -5). Let v be (-28)/21-6 + (-4)/1. What is the fourth smallest value in t, 3/2, v, -3/8? v Let f = -8478.6 + 8479. What is the fifth smallest value in 2, 8, 110, 0.1, f? 110 Let l = 2/351 + -56/351. Let t = -116 - -16. Let q = 102 + t. Which is the fourth smallest value? (a) q (b) -1/8 (c) l (d) -1/4 a Let k = 0.9 - 0.4. Let x = -0.2792 - -0.0792. Which is the fourth biggest value? (a) -4 (b) -0.1 (c) x (d) k a Let i = -3381 - -3387. Which is the smallest value? (a) -4/5 (b) -0.177 (c) i a Suppose -16n = -328 + 344. Which is the fourth biggest value? (a) 4 (b) 7/4 (c) -2 (d) n c Let x = -11485 - -11474. What is the third smallest value in x, 1, 7, -0.3, -5? -0.3 Let q = -1264/423 - -1546/423. Let s(y) = -y3 - 4y*2 - 2y - 3. Let r be s(-4). Which is the biggest value? (a) r (b) q (c) -2/13 (d) -0.4 a Let o = -81 + 88. Let n be (-48)/54o - -6. What is the biggest value in n, -0.2, -1/4? -0.2 Let s = -2606 - -2610. What is the third biggest value in 2, -4.1, s? -4.1 Let k = -912.7 + 909.7. What is the biggest value in k, -5, -0.5, -0.1, 32? 32 Let n = 520.2 - 523.2. What is the smallest value in 2/7, -0.4, -0.1, 1/3, n? n Let l = -149 - -149.5. Suppose 5m - 4m + 7 = 0. Which is the smallest value? (a) l (b) m (c) 3/8 b Let a(h) = -12h - 2. Let q be a(-2). Suppose -4r = -2t - 18, 0r + q = 5r - 3t. Let j = -0.67279 - -0.07279. What is the second biggest value in r, j, 2? 2 Let s = 30.67 - 30.37. Which is the second smallest value? (a) -6/19 (b) s (c) 4 b Let y = -0.06 + 5.06. Let r(m) = -64m + 67. Let z be r(1). Which is the second biggest value? (a) y (b) 2 (c) z c Let p = -294/6035 - -2/1207. Let k = p + -227/595. Which is the biggest value? (a) 0.4 (b) 3 (c) k (d) 141 d Suppose -6f + 20 = 4y - 4f, 0 = y - f - 11. Suppose yg - 31 = 25. Let z be 52/g + 1 + 1. What is the third smallest value in -3, z, -1? z Let r = -0.051 + 0.045. Let t = 65.994 - r. Let m = t + -65.7. What is the second biggest value in -3, 5, m? m Let i = 2.0307 - -2.9693. Which is the second smallest value? (a) 12 (b) i (c) 2.7 b Let o = -54877/356785 - 1/27445. What is the second smallest value in -0.3, 2/7, o, -0.31? -0.3 Let t = 215 + -219. What is the second smallest value in t, 23, 1/4, -2, 0.5? -2 Let w be ((-3)/(-9))/((-21)/(-9)). Let m = -1023 + 1023.55. What is the smallest value in -5, m, w? -5 Let h = 295.001 - 295. Let r = h - 7.001. What is the second smallest value in r, -3/5, -4/5? -4/5 Let u = -10 - -16. Let s = -22.7 - -25.7. Let r be 38 + -35 - (5 - -1). What is the third biggest value in u, s, r? r Let y = 21801 + -21800.892. Which is the second biggest value? (a) -5 (b) -0.3 (c) 26 (d) y d Let i be (-7)/115537 + 38/418. Let p = -0.44 + 0.4. Let f = 0.12 + p. Which is the biggest value? (a) -1 (b) 1 (c) i (d) f b Let z = 0.07515 + -409.07515. Which is the biggest value? (a) 0.4 (b) -3 (c) z (d) -0.4 (e) 2 e Let s = 0.542 + -0.942. Let y = 171.1 - 171. What is the smallest value in -2, s, 0.5, y? -2 Let h = -829.8 - -829.4. Which is the third smallest value? (a) -2/7 (b) h (c) -49 (d) -4 (e) -0.03 b Let v = -15 - -15.22. Let l = v + -0.72. Let d = l - -1. What is the third smallest value in d, -2, 7? 7 Let m = -9.8 + -14.6. Let s = 19.4 + m. What is the second biggest value in -0.4, -1/2, s? -1/2 Let v = -72059/20 + 14411/4. Which is the smallest value? (a) 1360 (b) 6/13 (c) v c Let f = -5180/3 - -56998/33. What is the smallest value in 18, 1, f? f Let h = -207.4 - -38.4. Let f = h + 165. What is the biggest value in -3/4, 7, f, -2/3? 7 Let w = 11 - 32/3. Let k = 486/17 - 11681/408. Which is the third smallest value? (a) w (b) -0.1 (c) k a Let j = -0.2969 - -0.5969. Which is the second biggest value? (a) -5 (b) 1/19 (c) j (d) 0.04 b Let f = 1497 + -1496. Let h be (-4)/2 + -9 - -1. What is the biggest value in h, f, 0.3? f Let y be (-1 - (-11)/8)/(684/(-304)). Which is the second biggest value? (a) -0.5 (b) 219 (c) y (d) 0.2 (e) -1/5 d Suppose 0 = 4s - h - 18, 2s - h - 23 = -3s. Suppose -f + 10c - sc + 18 = 0, -3c - 16 = 2f. What is the second smallest value in f, -5, -0.2? f Let l be ((-4)/17)/(-4)-2. Let g = -81.4 - -81. Let j = 0.0233 - -2.9767. What is the biggest value in g, -2/9, j, l? j Suppose 4w + 948 = -4i, 3w + 2w = -2i - 1188. Let d = w + 1664/7. Which is the second biggest value? (a) 2/19 (b) d (c) -6 b Let o = 296.2 - -9. Let i = o - 305. Suppose -5v = -2v. What is the smallest value in 0.5, -5, i, v? -5 Let i = 0.7741 + -0.5741. Which is the second smallest value? (a) 106 (b) 0.4 (c) 5 (d) 4/3 (e) i b Let k = -236.7 - -203. Let n = 34 + k. Let a = 0 - -0.2. What is the second smallest value in n, a, 1, -3? a Let h = -10.84 - -6.24. Let m = 12.2 - 12. What is the third biggest value in h, m, -2/13? h Let a = -2 - -7. Suppose as + 2x = -17, -2s + 2x = 6x - 6. Let v = -1065 + 4261/4. What is the third biggest value in v, s, 1/13? s Let q = -58/5 + 131/10. What is the third smallest value in 3, q, -6, 33? 3 Let m be (-2)/33-1. Suppose -2h - 5q = 143 + 34, -95 = h - 4q. Let v = h - -90. Which is the biggest value? (a) v (b) 2/53 (c) m c Let q = 0.2 + -0.6. Let k = 3.21 + 0.79. Which is the fourth smallest value? (a) -5 (b) q (c) k (d) -0.2 c Let f = -368 + 367.04. Let u = f - -0.46. What is the second smallest value in 276, 1, u? 1 Let y = 1307 + -1187. Let t be (-6750)/(-56) - 1/4. Let n = t - y. Which is the third biggest value? (a) 2/15 (b) n (c) -2/7 c Let c = -13 - -17. Let y = 0.2104 - 1.2104. Let a = 3.04 - 0.04. What is the third smallest value in 0.04, c, y, a? a Let f = 8.59 - 8.52. Let y = -28 - -25. What is the third smallest value in 1/4, f, y? 1/4 Let i = -4106.9 - -4107. Which is the fifth bigg	{ "pile_set_name": "DM Mathematics" }
t d = 6 + o. Suppose -4g + 3g = m + 85, -dm - 358 = -2g. Which is smaller: -87 or m? m Let m(g) = -g*2 - 10g - 11. Let t be m(-8). Let x be ((-3)/t)/(6/(-60)). Is x at least 7? False Suppose 0 = -53q + 44q - 36. Let x be ((-2)/q)/(0 + 6/(-316)). Which is smaller: x or -25? x Let r be (12/(-14))/(135/(-6)). Let g = -279576 + 279577. Which is bigger: r or g? g Let h be 5(-5)/50((-6)/10 - 0). Which is smaller: h or -45/2? -45/2 Let f = 0.106 - 0.275. Let h = 0.109 + f. Let q = -14 + 16. Which is greater: q or h? q Let f be 16 - (-41)/((-594254)/231908). Which is bigger: 1 or f? 1 Suppose 2i = 20 - 70. Let x be (i + 22)16/69. Which is smaller: -2 or x? -2 Let q = -2265 + 4175. Let l be q/(-30) - 2(-2)/6. Is l at most as big as -64? False Suppose -5t - 29 = -2r - 50, t = -2r + 9. Suppose -z - 3 = -2v, -4z = -rv + 3v + 3. Is -3 at least as big as z? False Let t = -192314/39 - -4932. Does 1 = t? False Suppose -2a = -4h - 20, 3a + 9h - 52 = 4h. Which is bigger: a or -2/273? a Suppose 257y + 4h = 254y + 3934, -1303 = -y - 3h. Which is bigger: 1319 or y? 1319 Suppose -188429 = 139a + 3808. Is a at least as big as -1380? False Suppose 1472 = 28i - 20i. Is 184 at most as big as i? True Let n(p) = p*2 - 5p - 43. Let t be 18/27(-1 - 11). Let b be n(t). Let w = b + -62. Is w at least -3/50? False Let j = -96943 - -1841513/19. Is -21 <= j? False Let z be (-2 - (-6)/2) + (-8608)/7878. Let w = -1/101 + z. Let f = 101/156 - w. Are 1 and f equal? False Let w(a) = -a3 - 14a*2 + 16a + 10. Let t be w(-15). Let y be (t/35)/1(-132 + 0). Is y <= 20? True Suppose 25 = 5w, -2u = w - 6w - 13. Let t = 9 + u. Let x = -15 + t. Which is greater: x or 14? 14 Let x = 0.1297 + -1.1097. Let f = 1.3 + -1.48. Let b = x - f. Which is bigger: -4 or b? b Let w be (-9)/(-2)((-8)/(-12) + 0). Suppose 2j + 19 = -wj + 3y, -3y - 16 = 2j. Is j less than -27/5? False Let g be (-8164)/(-2704) - (-3)/(-12) - 2. Which is smaller: g or -200? -200 Let v = -12098/35 + 398051/1155. Let u = v - 1/15. Which is bigger: 0.01 or u? 0.01 Suppose 147420 = 13p + 127p. Which is smaller: 0.1 or p? 0.1 Suppose -37 = -2x - n, 3x - 3n - 15 = 2x. Suppose g - x = 4g. Let l be (1 - 4)(-4)/g + -1. Is 5 at least l? True Suppose -294o - 263o + 142o - 11620 = 0. Let x(u) = -u2 - u. Let y be x(-6). Which is greater: o or y? o Let b = -457 + -235. Let v = 704.88 + b. Let j = 13 - v. Is -1 less than or equal to j? True Let u = -17.93 + 22.93. Which is greater: u or -0.729? u Let i(x) = x2 - 22x - 42. Let b be i(-2). Let z be b - (117/22 + 1). Are z and 1 unequal? True Let r be (-3)/(-4) + (-621)/132 + 4. Let h be 2/3 - (-1261)/(-330). Let w = h - r. Is -2 less than or equal to w? False Suppose -25c = c - 1092. Let x be (4/((-32)/(-6)))/(c/56). Let u = 9722/81 + -120. Does u = x? False Let i(g) = 14g + 24. Let h be i(-2). Let s be (14/(-4) + 3)/((-2)/h). Which is smaller: s or 4/13? s Suppose 2u + 111 - 119 = -2o, -4o = u - 4. Is o less than or equal to -5/494? False Let w = 1.507 - 0.507. Is w greater than or equal to -2/2299? True Let t be (-21416)/(-4)(-18)/405. Let n = 238 + t. Which is greater: 0 or n? n Suppose 158 = -3f + 254. Suppose 0 = fs - 5 - 27. Which is bigger: s or -2/493? s Let d be (-80)/20 - (-672)/170. Let w = 46/255 + d. Which is smaller: w or -94? -94 Suppose 2d = -5g + 6, g + 2d + 2d = 12. Let m = -226.9 - -224. Let c = m + 3. Is c at least as big as g? True Let c be 1810/900 + 3576/(-17830). Is c greater than 0? False Let f = -2919.89 + 2920. Which is bigger: f or 134? 134 Let y = -119822/212583 + 108/191. Is y bigger than 0? True Suppose 4z - 4 = 64. Suppose 3f - 103 = -4l, 2f + 56 = -2l + 5l. Let m be 2 + (l/33)/((-4)/(-87)). Is z <= m? False Let o = -480.263 + 480. Let z = -0.208 - o. Is 0 greater than or equal to z? False Suppose 4 = -j + 5j. Let h be -4 - (2 - j(-7)/(-1)). Which is greater: h or 1/12? h Let n(s) = 35s*3 - 6s*2 + 17 - 3s - 36s3 - s. Let z be n(-5). Let g(t) = t2 - 12t + 1. Let r be g(z). Which is bigger: r or 3/28? r Let a = -821 - -533. Let z be (96/a)/((-1)/(-303) + 0). Is z bigger than -101? False Let c = -7.2 + 0.2. Let t be (-2)/(-6) + 4540/(-30). Let r = -1055/7 - t. Which is bigger: c or r? r Let w = -144 + -1370. Are w and -1513 equal? False Let y be (-2655)/(-45) - (-10 + 9). Is y != 139? True Let r be 292/6((-1575)/(-10))/21. Which is smaller: 366 or r? r Let j = -3054/11 - -276. Let k = 493 + -494. Which is smaller: k or j? j Let t = 2207 - 2020.9. Let v = t - 194. Are 1 and v unequal? True Let c(r) = -52r + 12 + 5 + 73 + 106. Let z be c(6). Are z and -116 nonequal? False Suppose -23h + 90 - 21 = 0. Suppose -21 = -hy - 75. Which is bigger: y or -13? -13 Let b be -29 - -16 - 554/(-5). Which is bigger: b or 98? 98 Suppose 0 = 2s + 5j - 175, 75 = 5s - j - 430. Suppose 2a + 0h + h + s = 0, 4h = 0. Suppose 197w - 190w + 357 = 0. Which is smaller: w or a? w Suppose -2007i + 2023i = -31328. Which is smaller: -1957 or i? i Let b = 205 - 85. Let q = -626 - -745. Which is greater: b or q? b Let a be -7(2 + 520/72 + (-6)/27). Is -67 at least as big as a? False Let a = 70761 + -288867/4. Which is greater: a or -1455? -1455 Suppose -115o = -91o - 432. Suppose 3x - b = 30 + 44, 2b = x - 28. Which is bigger: o or x? x Let k be 9/(-6) - 25/14-1. Let x = -10 + 12. Suppose 7p + 5 = xp. Which is bigger: k or p? k Let o be (-1456)/484 + -1 - -4. Suppose 0 = -4z + 2s + 34, -6s + 2s = 12. Suppose 3 = -zx - 4. Which is bigger: x or o? o Let o(p) = -p3 + p + 2. Let g be o(-3). Let u = g - 20. Let d be u + 0 - 0 - (13 - 13). Is 7 not equal to d? True Let i = -17.63 - -19.33. Is i less than or equal to 11/10? False Suppose 16 = 2g + 4c, -5c + 10 = 4g - 7. Let j be (6/(-12))/((-4)/(g - -42)). Suppose 3k - 8 = 10. Which is smaller: j or k? j Let o = -17705.92 - -17706. Let s = 12 - 36. Is o greater than s? True Let z(s) = 3s2 - 74s - 57. Let p be z(25). Let m be 258/(-10)(-37 - p). Is 130 at least m? True Let i = 548.38 - 548.18. Let t = -60 + 3. Is t greater than or equal to i? False Let g be (-5 + 27/6)/(2/(-4)). Let c be -22 + g - (-423114)/(-516). Let l = -823 - c. Is l < -1? False Suppose -287m = m + 62m - 350. Is m greater than -2/85? True Let r be 740/2368(-1)/(-5)3. Which is smaller: -3 or r? -3 Let n = 5277 - 8176. Is -1 <= n? False Let z = 665.066 + -665. Let u = z + 1.834. Let t be 4/18 - (-39)/(-54). Which is bigger: u or t? u Let l be (-143 - -213)((-2)/4 + 1). Let v be 4/l((-5)/226)/(-1). Which is bigger: -1 or v? v Let t(k) = k*2 + 17k + 75. Let n be t(-7). Suppose 2h = 3q + n, 0 = 5q - 8q - 3h. Is q equal to 6/133? False Let u = 163.7 - 162. Let c = u + -1.74. Let b = 10 - 5. Is b bigger than c? True Suppose 5x + 15 = 0, j + 650x = 651x + 38. Which is smaller: 80 or j? j Let x = -403/18 + 45/2. Let v(l) = -l*2 + 14l - 7. Let i be v(13). Suppose 3f - it - 18 = -3t, 0 = -5f - 5t - 20. Which is smaller: x or f? x Suppose 0 = -352g + 354g - 76. Let v(n) = -n + 38. Let l be v(g). Which is smaller: 1/23 or l? l Let r be (-1 + 44/40)4. Let s = -147 + 178. Which is smaller: r or s? r Suppose 0 = 3t - z - 42, -4z + z = -t + 6. Suppose 0 = -2a + a + t. Let r be (-7)/(-26)a/21. Which is smaller: 0 or r? 0 Let q = 1350.13 - 1286.4. Let w = -0.27 - q. Let j = 1 + 0. Is w greater than or equal to j? False Let r = -2161 + 616. Is -1545 at least as big as r? True Let j = 0.04 + -2.04. Let r = -86323 - -86323.44. Which is smaller: r or j? j Let r be (2 - 3)11 + 2. Let y be -10r/225(-64 - 1). Let f = -2 + 3. Which is bigger: y or f? f Suppose 28n - 11n = -34. Suppose 0 = -u - 4, 2u = -5v + 5u + 37. Suppose -vf + 4m = -1, 2f - m + 2 = 3m. Is f smaller than n? False Let a = 139054252/4991 + -27861. Is -0.2 less than or equal to a? True Suppose -4m - 86 + 352 = f, -2m - 272 = -f. Is f less than 4? False Let i = 147 - 1181/8. Let n = 20 - 34. Let m be n/(-56) - 2/8. Is i bigger than m? False Suppose -25x + 24x + 24x = 2x. Which is greater: x or -138? x Suppose -c - 5 = -9. Let x(b) = -189b - 24. Let o be x(c). Let g be 1-38/o. Which is greater: g or 0? g Suppose 0 = 2f - 0*f + 4. Let t be -10 - (5 + -6 - (-5 -	{ "pile_set_name": "DM Mathematics" }
/100)/(56/40). 3/7 What is the value of ((-15)/21)/(7/14372/(-217))? 5/6 What is (2480/(-775))/(-43/30)? 8 What is the value of -813/117015? -4/3 Evaluate (-7)/890/(-315). 1/4 What is the value of (5/(-2))/(1/(-3))36/189? 10/7 Evaluate 39/185901120. 6/13 What is the value of ((-18)/(-4))/(-1629/928)? -9 What is the value of 24/(-54)(-1)/((-20)/15)? -1/3 What is (-318)/(5(-13)/390-12)? -27 What is the value of ((-18)/(-36))/(85/(-20))? -2/17 Evaluate 1/3(-459)/(-51). 3 What is ((-44)/(-33))/((-8)/(-6))3/7? 3/7 What is the value of (((-390)/25)/(-6))/((-17)/85)? -13 Evaluate ((-67)/268(-112)/10)/2. 7/5 What is the value of (12/(-90))/(46/207)? -3/5 23/115(-15)/9 -1/3 -8(-35)/(-520)-13 7 What is ((-4)/(-13))/(-2)(399/42)/19? -1/13 (2/(-10))/(20/50)44/2 -11 Evaluate ((-74)/148)/((-1)/(-2)). -1 What is (-2)/(-8)(-8)/3(-1512)/378? 8/3 What is 2(-226/(-24))/1? 11 (-4)/((2424/303)/(((-2)/(-1))/(-1))) 1 Calculate (-1)/((-18)/(-396)11)71. -14 What is 1/(-4)((-98)/119)/(-7)-2? 1/17 ((10/(-14))/((-9)/21))/((-10)/(-126)) 21 What is (-12)/(-8)682/93? 11 (39/(-91))/((-4)/((-32)/8)) -3/7 Evaluate ((-210)/(-980))/(12/16)1-7. -2 Evaluate (-1)/(-3)((-1824)/36)/38. -4/9 What is (6/148)/(848/(-512))? -2/37 What is 52/(-36)(-198)/(-11)-1? 26 (-17)/(-765)-65(-10)/195 2/27 What is the value of (((-315)/(-14))/(-15))/((-10)/12)? 9/5 Calculate 5/(-50)42/645. -6 7/2(-16)/((-90)/30) 7 (27/9)/(215/(-80)) -8 What is ((-32)/(-304))/(14/266)? 2 Calculate (((-1)/(-9))/((-2)/(-24)))/(1/12). 16 What is the value of (111/(-3996))/((-42)/72)? 1/21 What is (-48)/90(-42)/56? 2/5 What is the value of (12/32)/((3/(-18))/((-58)/(-1044)))? -1/8 What is 2/(((-1)/(-1))/(-16)4)? -8 Evaluate -176(-48)/15368/(-14). -22/7 What is ((2/(-4))/(-1))/(117/(2028/(-52)))? -1/6 ((-42)/273)/((-260)/507) 3/10 What is the value of 48/(56/(-7))4/(168/(-7))? 1 Evaluate ((-6)/4)/(318/1696). -8 What is the value of (4176/720)/((4/(-30))/(8/12))? -29 What is 234/5210/(-15)? -3 What is the value of ((-3)/(-10))/(303/(-202))? -1/5 Calculate (-63)/(-28)(-24)/(-36). 3/2 What is the value of (40/420)/(129/(-602))? -4/9 Evaluate ((-112)/4)/(-2)(-825)/(-1155). 10 5488/198(-3)/(-4)1 18 What is the value of ((-78)/(-65))/(-3(-12)/90)? 3 Evaluate 4/(-24/16). -8 What is the value of (18/(-54))/(4/(-204))? 17 (-38)/83655-12(-4)/8 -15 What is 9/(-9)(-928)/(-32)? -29 (-14)/(-12)2132/(-1232) -1/4 What is (-22)/(1916/(-10059))? 21 What is the value of ((-395)/(-237))/(1/(-3))? -5 Calculate 6/((18/(-36))/(5/(-4)))-1. -15 (-11)/(-3)(-58)/(-319)(-3)/8 -1/4 What is (-15)/2(-35)/(945/(-54))? -15 What is the value of 9/(-42)(-34)/(990/220)? 4/7 Calculate 60/1003/(108/(-30)). -1/2 ((-2)/45)/((910/(-70))/(-130)) -4/9 Calculate (-131)/(1/(63/(-18))). 13 Calculate 2(26/(-156))/(10/(-24)). 4/5 Calculate ((-8)/10)/((-210)/315). 6/5 What is ((-47)/423)/((-187)/(-153))? -1/11 Evaluate (-2)/(-23)14/(-84)-6. 2/23 What is (-22542)/110525/(-30)? 17 Calculate ((-1932)/(-252))/((6/(-1))/18). -23 Calculate (-7)/(56/12)-1(-7)/(-21). 1/2 17/(-51)360/(-12) 10 What is the value of (-39)/(-12)(-1070)/(-2782)? 5/4 Calculate (-40)/(-5)63/722/343. 2/49 Evaluate (-114)/1482((-4)/(-3))/(-4)-6. -2/13 What is ((-5)/20)/((15/3)/120)? -6 Evaluate (-1)/((-7)/(-315)5)6/6. -9 What is 1404/4212(-1)/(-4)? 1/12 Calculate (270/12)/9(154/55)/14. 1/2 Calculate -410/(-16)12/(10/(-5)). -15 Calculate 10/(-66)90/50. -3/11 What is the value of ((-15)/1)/((-12)/(-264)22)? -15 Calculate (-8)/6(-144)/(-384). -1/2 What is ((-4)/70)/((-31)/(1302/3))? 4/5 ((-3)/(126/4))/((-51)/1224) 16/7 (285/114)/(1/((-76)/(-10))) 19 (45/2520)/(2/4) 1/28 What is the value of 22/(-33)((-135)/(-6))/(-9)? 5/3 (25/700-21)/(6/(-104)) 13 What is the value of ((-18)/12)/((-420)/(-40))? -1/7 What is (-9)/(495/(-40))(-275)/50? -4 What is ((-1)/((-1)/5))/((245/14)/7)? 2 What is the value of 9/((-99)/(-77))-1? -7 What is the value of (-2(-9)/72)/((-3)/(-204))? 17 Evaluate ((-207)/(-483))/(12/7). 1/4 -4(-18)/(-168)-7 3 -2(504/21)/240 -1/5 What is 22/4(-5220)/(-23925)? 6/5 What is (-5(-4)/(-20))/((-5)/550-10)? -11 (634/3804)/(10/(-6)) -1/10 What is (4696/10566)/(2/(-90))? -20 What is the value of (-55)/(-385)7/5? 1/5 What is (4/(-6)1/4)/(349/3141)? -3/2 Evaluate -8416/(-128)((-16)/(-6))/2. 14 What is (((-80)/25)/4)/(2/10)? -4 Calculate 21/(-5)(-840)/252. 14 (273/195)/((-6)/(-5)) 7/6 (12/2)/(716/(-168)) -9 What is -10((-240)/(-144))/(4/3615)? -10 (((-248)/16)/(-31))/((-2)/207) -5/7 Evaluate (-31)/(279/18)3. -6 Calculate (263/(-1326))/(3/3). -1/17 What is (72960/342)/160-127/2? -18 201((-34)/119)/((-8)/(-14)) -10 What is (5/12)/5((-912)/90)/19? -2/45 What is the value of ((-4)/(-19))/((-1740)/(-870))? 2/19 Calculate ((-2)/(-7))/((-126)/117648/(-15)). 5/6 Calculate 15(-9)/(-1530)-11. -3/34 What is the value of 3/(-2)29/(-7917)26? 1/7 Evaluate (25/105)/((155/15)/(-31)). -5/7 What is the value of 2877/(-15344)1/(9/4)? -1/12 (-20(-3)/128)/(39/(-52)) -5/8 ((-2)/(-28))/(6/(-144)4) -3/7 (-52)/(-156)12/(-1) -4 What is the value of 8/(-28)(-15)/(-8)(-188)/(-235)? -3/7 Evaluate 10(-8)/(-124)(-6)/4. -5 Evaluate 2(-63)/108-3. 7/2 What is the value of (30/(-8))/(13(-3)/(-26))? -5/2 (((-12)/15)/2)/(((-272)/(-760))/17) -19 Evaluate (-39)/((118/236)/((-3)/18)). 13 Calculate (-15)/3-4(-4)/(-160). 1/2 (24/81617)/(2-1) -1/4 ((-1)/(-2))/(528/(-5280)) -5 Evaluate 5/(50/(-20))-6. 12 What is (5/3)/(-60(-10)/4680)? 13 What is the value of 7/77/(7742/(-28))? -2/79 What is (-250)/375-31/(-30)? -1/15 Calculate 6/(-5)(-780)/468. 2 What is the value of (2/(64/168))/(6/16)? 14 What is 317/((-204)/(-44))? 11 What is the value of 7/(-7)-120/(-16)? -5/4 (-484)/726(-11)/((-11)/(-30)) 20 What is (4/42)/(38/(-513))14/(-4)? 9/2 What is the value of 675/81(-12)/(-150)1/(-32)? -1/48 Evaluate (15/(-20))/(((-3834)/(-9))/(192/12)). -2/71 ((-335)/(-670))/((-6)/20)3/(-1) 5 Evaluate 51/(-3264)-641(-1)/(-19). 1/19 Calculate 84/63(-1)/(1/(-6)). 8 Evaluate (8/(-184)-23)/((-4)/(-10)). 5/2 What is the value of 95/135105/5? 7 Evaluate (1316/(-141))/((-35)/30). 8 What is the value of (198/(-792))/(((-2)/(-20))/(4/5))? -2 Calculate 36/108(-135)/25(-10)/2. 9 Calculate (27945/(-46))/(-81)4/2. 15 (40/375)/(41/(-10))3 -4/5 Calculate (-5)/(-3(52/(-12))/(-13)). 5 What is (2/(-5))/(16/20)(-156)/(-26)? -3 Calculate (4/(-8))/(2/10(-205)/902). 11 (-10(-84)/(-39200))/((-6)/(-5)) -1/56 What is ((-635)/(-127))/((-50)/12)? -6/5 What is the value of (64/768)/((-3)/2)? -1/18 What is (-1740)/1044(1/(-1))/5? 1/3 What is the value of 9/((55/825)/((-2)/18))? -15 Calculate ((-9)/(-36))/(-124/6). -1/16 What is ((-66)/12)/(7/14)? -11 Calculate ((-2)/(-88))/(87/(-348)). -1/11 What is the value of ((96/(-3))/8)/((-528)/154)? 7/6 Calculate ((-33)/99)/((-2)/(-84)-2). 7 ((-2)/(-7))/((-3264)/2856) -1/4 What is (17/170-5)/2? -1/4 1837/222-6 -18 Evaluate 7/((-504)/(-150))7/(-70)4. -5/6 Evaluate (-3)/((-154)/92427-11). -2/3 Calculate (-25)/(((-715)/13)/11). 5 Evaluate (57(-8)/192)/(21/(-168)). 19 What is ((-2)/(-5))/((-48)/60)(-32)/(-1)? -16 (10(-5)/(225/6))/((-64)/(-384)) -8 What is the value of 4/(((-96)/30)/(-16))1? 20 What is 3/((-4)/1(-21)/((-420)/100))? -3/20 What is the value of 107/(-1926)4/4-12? 1/9 What is (-725)/(-225)273/(-9)? -29 Evaluate 18171/13464/18. 3 (9/(-10)2)/((-2)/((-540)/27)) -18 (-1824)/106414/921/(-36) 14/9 Calculate ((1610/(-69))/(-35))/((-2)/15). -5 Calculate ((-592)/6660)/((-4)/30)6/92. 1/23 What is the value of ((105/28)/(-5))/(10/((-1920)/198))? 8/11 Evaluate ((-6)/(-9))/((-72)/108). -1 6/(16/(2688/(-72))) -14 What is ((-30)/(-14))/(604/1120)? 10 Calculate (113/339)/(-13/(-81)). 9 What is -24-1324/(-468)1/(-2)? 8 (-376)/(-235)(-90)/27 -16/3 Calculate ((-80)/70(-5)/30)/((-620)/(-434)). 2/15 ((1092/(-143))/(-21))/(1/11) 4 Evaluate (-22/(-6))/((-256)/(-96)). 1/4 What is the value of ((-1)/(-2))/((308/(-55))/(-14))-1? -5/4 (111/(-4))/((-594)/528)96/(-64) -37 ((-16)/20)/(17/255) -12 What is the value of (-6)/(-3)(2580/(-24))/(-43)? 5 What is the value of ((1/(-1))/4)/((-48)/3648)? 19 Calculate (-15)/12108/(-30)(-4)/(-1). 18 Calculate 6/((-2)/(-2))3*32	{ "pile_set_name": "DM Mathematics" }
7b3 - 35/9b*2 - b + 1/54b*4. Factor g(r). 2(r - 1)(r + 35)/9 Let l = 95/2184 + -1/39. Let z(o) be the third derivative of 0o*3 + 6o*2 - 1/784o*8 + 0o + 0o6 + 0 - 1/70o*5 + 1/245o*7 + lo*4. Factor z(k). -3k(k - 1)3(k + 1)/7 Suppose -k = -4g + 36, g + 4k = 2k. Let h be (-3 - (-28)/g)/(0 - -1). Solve -1 - hp*3 + 3/2p + 0p2 = 0 for p. -2, 1 Determine a, given that 22/7a*2 - 86/7a + 8/7a3 + 20/7 = 0. -5, 1/4, 2 Let j(o) = -5o + 3. Let m be j(1). Let y be (-1)/(-2) - 3/m. Factor -2 + t - 2t2 + 3t*2 + 0 - yt. (t - 2)(t + 1) Let s(a) be the second derivative of a6/6 + 5a*5/4 - 10a*4 + a - 3829. Factor s(x). 5x*2(x - 3)(x + 8) Let o(s) be the second derivative of s5/20 - 3s*4/8 + 81s*2/2 - 95s. Let m(n) be the first derivative of o(n). Solve m(k) = 0 for k. 0, 3 Suppose 1813a - 12698 = -1048a - 1254. Solve -12/5p3 + 2/5p*a + 0p*2 + 44/5p + 6 = 0. -1, 3, 5 Let q be (1 + 30/12)/((-11613)/(-2844)). Determine u, given that -58/7u + 20/7 - qu*2 = 0. -10, 1/3 Determine x, given that -842518x*2 - 108 + 60x + 30x3 - 240x - 3x4 + 842479x2 = 0. -1, 6 Let b(j) be the third derivative of j7/840 - 31j6/120 + 961j*5/40 - 14j4/3 - j2 - 25j. Let k(u) be the second derivative of b(u). Factor k(w). 3(w - 31)*2 Factor 8181s - 8431s - 5s*2 - 237 - 243. -5(s + 2)(s + 48) Let z(c) be the third derivative of -1/840c*7 + 0c + 0 + 0c4 + 1/160c*6 + 0c*5 + 27c*2 + 0c*3. Find m such that z(m) = 0. 0, 3 Let x(o) be the first derivative of -169o*7/210 - 13o*6/9 - 5o*5/6 + 13o*3 - 92. Let b(y) be the third derivative of x(y). Factor b(z). -4z(13z + 5)*2 Suppose a - 5c = -9, -5a - 7 + 6 = -3c. Suppose 25r2 - 27r*2 + 3 - a = 0. What is r? -1, 1 Let n(f) be the third derivative of -15/2f*3 + 0 + 5/4f*4 - 22f*2 - 1/12f*5 + 0f. Factor n(g). -5(g - 3)2 Suppose -i - 23 = -5o, 40o = 42o + 4i - 18. Let y(a) be the second derivative of 13a - 1/21a4 + 0 + 1/21a*3 + 1/70a*o + 0a*2. Factor y(q). 2q(q - 1)2/7 Let o(n) = n3 + 2n*2 - 14n - 1. Let x(p) = p*4 + 11p*3 - 122p*2 + 354p - 389. Let c(m) = 5o(m) - x(m). Factor c(a). -(a - 6)(a - 2)*2(a + 16) Factor 1195v - 542 + 2270 - 128v2 + v3 - 571v - 5v*3. -4(v - 6)(v + 2)(v + 36) Suppose 5k = -g + 1025, -g + 1035 = 5k + 2g. What is t in 25t - 232t3 + 24t + 216t3 + 3t - kt2 = 0? -13, 0, 1/4 Let s(h) = -3h*2 + 50h + 533. Let g be 6 + -4 + -3 + 6. Let w(y) = -4y2 + 51y + 534. Let f(a) = gs(a) - 4w(a). Factor f(k). (k + 23)*2 Let b(t) = 3t - 108. Suppose 89x - 1147 = 58x. Let q be b(x). Solve -1/5lq - 9/5 - 3/5l + l*2 = 0. -1, 3 Suppose 3y + 2s - 4 = 0, 3s = -0y + y - 5. Let h = 309447/3580 + -168/895. What is g in -3/2 + 9/8g*3 - 273/8g*y + hg*4 + 63g*5 - 27/2g = 0? -1, -1/2, -2/7, -1/4, 2/3 Let x = 5429/703 + -276/37. Let s(q) be the first derivative of 6 - 2/95q5 - 22/19q*3 + xq*4 + 40/19q*2 - 32/19q. Let s(i) = 0. Calculate i. 1, 4 Suppose 74 = -6t + 10t - 2a, 0 = 5t + 5a - 115. Let d be ((-13)/((-2925)/t))/((-4)/(-110)). Factor du + 2/9u3 + 10/9 + 14/9u*2. 2(u + 1)*2(u + 5)/9 Factor 2/9z3 + 52/9z*2 + 46/3z + 0. 2z(z + 3)(z + 23)/9 Let t = 7459/26546 + -12/1021. Let s(j) be the second derivative of -5j + tj4 + 0 - 49/130j*5 + 8/13j*3 + 4/13j*2. Solve s(m) = 0. -2/7, 1 Let z(l) = -2l*2 - 5l - 6. Let f be z(-2). Let j be (-1)/((-16)/(-12))f. Factor 4q3 + q4 - q*2 + 2q3 - q5 + 4q3 - 9qj. -q2(q - 1)2(q + 1) Let p(y) be the second derivative of y7/210 + y6/50 - 9y5/25 - 7y*4/3 + 16y*3/5 + 288y*2/5 + 16y - 22. Let p(u) = 0. Calculate u. -4, -3, 2, 6 Let q(x) be the third derivative of -13x5/150 - 9x*4/20 + 8x*3/3 + 91x*2 - 3. Factor q(j). -2(j - 1)(13j + 40)/5 Let h(r) be the second derivative of 1075/12r4 + 1/84r*7 + 0 + 882r*2 - 3/5r*6 - 87r + 413r3 + 201/40r*5. Let h(l) = 0. Calculate l. -2, 21 Suppose -5f = -5c + 10, 3f + f - 2c = 2. Suppose -2m = fr - 37, -3r - m = -23 - 12. Factor 2b4 + 7b - 15b3 + 4b*2 - 12b + 3b4 + rb*2. 5b(b - 1)3 Let p be 4/141687/8676. Let x(m) be the second derivative of -4/3m2 + pm*4 - 36m + 1/30m5 - 4/9m3 + 0. Suppose x(q) = 0. What is q? -2, -1, 2 Let u(i) be the first derivative of -i2 + 2i + 84 - 19/6i*3 - 3/10i*5 - 7/4i4. Determine k so that u(k) = 0. -2, -1, 1/3 Let x(i) be the first derivative of -i6/150 - i5/75 - i4/120 + 2i2 - 5i + 48. Let c(p) be the second derivative of x(p). Factor c(g). -g(2g + 1)*2/5 Let v = -49598/51 - -16544/17. What is u in -5/6u*3 - 1/6u*4 + 0 - 4/3u*2 - vu = 0? -2, -1, 0 Factor -699/2 - 3/2p2 + 11187/8p. -3(p - 932)(4p - 1)/8 Let -2c*3 + 23696c - 10808c - 11878c - 896 - 112c2 = 0. What is c? -64, 1, 7 Let l(u) be the first derivative of -18u*3 + 1731u*2/4 - 24u - 7510. Factor l(c). -3(c - 16)(36c - 1)/2 Let r(c) = -25c*4 + 1625c*3 - 7300c*2 + 10700c - 5200. Let k(a) = 2a4 - 125a*3 + 561a*2 - 823a + 400. Let u(b) = -40k(b) - 3r(b). Factor u(j). -5(j - 20)(j - 2)*2(j - 1) Let r(c) be the second derivative of -c*4/48 + 37c*3/4 - 12321c*2/8 - 192c. Find j such that r(j) = 0. 111 Let f(p) = p3 - p2 + 1. Let i(h) = -4 + 80 - 104h + 72h*2 + 5h*3 - 24h - 21h3. Let n(o) = -4f(o) - i(o). Determine q so that n(q) = 0. 5/3, 2 Let i(c) be the first derivative of 0c + 0c*2 + 2/63c*3 - 1/3c*4 + 26/105c*5 - 54. Factor i(o). 2o*2(o - 1)(13o - 1)/21 Let h = -277444/7 + 39637. Let -hd - 3/7d*2 - 18/7 = 0. What is d? -3, -2 Let u = -718 - -720. Find d such that 150d*u + 45d - 68d2 + 363d - 79d2 + 13872 = 0. -68 Let j(r) = -50r + 1505. Let l be j(30). Let a(s) be the third derivative of -s*2 + 5/84s*4 + 0s + 2/7s3 + 0 + 1/210s*l. Solve a(w) = 0 for w. -3, -2 Factor -30/7t - 3/7t2 + 72/7. -3(t - 2)(t + 12)/7 Let n(i) be the third derivative of 3i*7/140 - 17i*6/240 + 7i5/120 + i4/48 + 1537i2. Factor n(w). w(w - 1)*2(9w + 1)/2 Find l, given that -4l*4 - 40l*3 - 19l*3 - 660l*2 - 40 + 40 - 1400l - 37l3 = 0. -14, -5, 0 Let o(l) be the first derivative of 11l*4/6 + 7l*3 - 36l*2 - 88l - 264. Let c(y) be the first derivative of o(y). Factor c(k). 2(k + 3)(11k - 12) Factor -37749w*2 - 1332 + 75482w*2 - 37758w2 + w3 - 408w. (w - 37)(w + 6)*2 Let c = 983 + -981. Let p(y) be the first derivative of -1/5y*5 - 6 - 1/3y*3 + 0y + 1/2y4 + 0y*c. Determine g so that p(g) = 0. 0, 1 Let v be 22 + 2-1 + (-12)/6. Solve -5s - 17s*2 - vs*2 + 15 - 2 + 22 + 5s3 = 0. -1, 1, 7 Let t(r) be the first derivative of -r6/57 + 12r5/95 + 8r*4/19 + 4r*3/57 - 15r*2/19 - 16r/19 - 1199. Solve t(a) = 0. -1, 1, 8 Let r(f) = 41f - 248. Let l be r(6). Let t(p) = 505p*2 - 570p + 65. Let i(v) = -23v2 + 26v - 3. Let o(u) = lt(u) - 45i(u). Factor o(h). 5(h - 1)(5h - 1) Let o(l) be the first derivative of -104/9l*3 + 0l - 32 + 1/6l4 + 0l*2. Factor o(j). 2j*2(j - 52)/3 Let b(r) = 0 + 53r + 1135r*3 - 164 + 4r*2 - 1136r*3. Let s be b(3). Factor -sx - 2x3 + 5/4 + 1/4x*4 + 9/2x*2. (x - 5)(x - 1)*3/4 Factor 45/2p*3 + 0 + 1/2p*5 + 0p - 25p2 - 6p4. p2(p - 5)2(p - 2)/2 Let k(r) = -r*3 + 2r*2 - 3. Let h = -66 + 68. Suppose -9 = 6i - 5i + hq, -2i + q = -2. Let g(v) = v + 1. Let n(y) = ik(y) - 3g(y). Solve n(d) = 0. -1, 0, 3 Let g(h) = -4h4 - h3 - h*2 - 2. Let o(a) = -13a4 + a3 - 8a2 + 2a - 6. Let v(i) = -3g(i) + o(i). Let v(u) = 0. What is u? 0, 1, 2 Let z be (-29)/(290/(-20))1. Let b(h) be the second derivative of 0hz + 1/6h*3 + 14h + 0 + 1/24h4. Let b(q) = 0. Calculate q. -2, 0 Suppose -399 = 58d - 65d. Determine u, given that 3u*2 - 28u + 47 - d + 3u2 = 0. -1/3, 5 Let a(o) be the first derivative of -1/6o*3 - 1/4o*2 + 1/2o + 1/8o4 + 55. Factor a(l). (l - 1)2(l + 1)/2 Let o be 64 + -60 - -911. Suppose 22u + 369 - 369 - 44u - ou + 5u2 = 0. Calculate u. 0, 25 Let m(r) be the first derivative of r5/20 - 39r*4/16 - 31r*3/3 - 21r**2/2 +	{ "pile_set_name": "DM Mathematics" }
r: 3, e: 2, f: 4, s: 1}. Give prob of sequence sre. 1/165 Three letters picked without replacement from ylyyyybyy. Give prob of sequence lyy. 1/12 Calculate prob of sequence uuck when four letters picked without replacement from ukxcwuuwuwcwcuccw. 5/2856 Four letters picked without replacement from rrfrnffrffrnrnrrn. Give prob of sequence rffr. 1/51 Calculate prob of sequence asz when three letters picked without replacement from {z: 4, a: 5, s: 2}. 4/99 What is prob of sequence scu when three letters picked without replacement from {c: 1, y: 2, s: 1, z: 1, u: 2}? 1/105 Four letters picked without replacement from {h: 2, l: 3}. What is prob of sequence hllh? 1/10 What is prob of sequence il when two letters picked without replacement from {i: 7, l: 2}? 7/36 Three letters picked without replacement from bfjfkebkfeaefbe. Give prob of sequence jak. 1/1365 What is prob of sequence pppp when four letters picked without replacement from {r: 3, a: 3, p: 8, t: 1, l: 3}? 7/306 What is prob of sequence fofo when four letters picked without replacement from {z: 7, f: 11, o: 2}? 11/5814 Two letters picked without replacement from {l: 7, a: 2, n: 4}. Give prob of sequence an. 2/39 Four letters picked without replacement from {o: 1, k: 3, y: 1, q: 5}. Give prob of sequence kqqq. 1/28 Calculate prob of sequence tep when three letters picked without replacement from pebebcpjpctce. 3/572 Calculate prob of sequence ddd when three letters picked without replacement from {d: 3, i: 3}. 1/20 Calculate prob of sequence ppgp when four letters picked without replacement from ppgbgpgbpi. 1/70 Two letters picked without replacement from {g: 2, j: 1, o: 4, m: 3}. What is prob of sequence gj? 1/45 What is prob of sequence lv when two letters picked without replacement from {g: 3, e: 1, l: 1, v: 1, o: 1, h: 5}? 1/132 Four letters picked without replacement from yryywyywwwyyyy. What is prob of sequence rywy? 12/1001 Two letters picked without replacement from {g: 5, f: 1, v: 4, r: 4, h: 1, o: 3}. What is prob of sequence ho? 1/102 Calculate prob of sequence uu when two letters picked without replacement from {u: 4, i: 2}. 2/5 Two letters picked without replacement from {i: 1, j: 5, f: 3, r: 2, t: 6}. What is prob of sequence ji? 5/272 Calculate prob of sequence tn when two letters picked without replacement from gpgpntgggnjg. 1/66 Four letters picked without replacement from {g: 2, b: 1, i: 4}. Give prob of sequence iigg. 1/35 Four letters picked without replacement from {o: 1, q: 2, b: 2, v: 1, c: 1, r: 2}. Give prob of sequence orbb. 1/756 Two letters picked without replacement from {z: 2, b: 1, v: 1}. What is prob of sequence vb? 1/12 Calculate prob of sequence qyal when four letters picked without replacement from qlfafqyl. 1/420 Two letters picked without replacement from {c: 4, j: 1, a: 6}. What is prob of sequence ja? 3/55 What is prob of sequence onu when three letters picked without replacement from {u: 4, o: 1, n: 2}? 4/105 Calculate prob of sequence ff when two letters picked without replacement from fdffdffd. 5/14 Calculate prob of sequence ipqi when four letters picked without replacement from qqiyqiqiiqiqqyipiihp. 98/14535 What is prob of sequence ce when two letters picked without replacement from crcirercccrcc? 7/156 Calculate prob of sequence wlcb when four letters picked without replacement from {c: 1, b: 2, w: 1, l: 1}. 1/60 Two letters picked without replacement from {k: 3, s: 5}. What is prob of sequence ks? 15/56 Two letters picked without replacement from nbrzmnrknmnbbbz. Give prob of sequence mb. 4/105 Two letters picked without replacement from bbpzwwv. What is prob of sequence bb? 1/21 Calculate prob of sequence uqu when three letters picked without replacement from rcqqffuqrffcdu. 1/364 Calculate prob of sequence try when three letters picked without replacement from rytgygg. 1/105 What is prob of sequence jc when two letters picked without replacement from {h: 3, c: 2, b: 1, j: 1}? 1/21 What is prob of sequence mmm when three letters picked without replacement from mmm? 1 Two letters picked without replacement from {o: 7}. Give prob of sequence oo. 1 Three letters picked without replacement from sjfsjg. Give prob of sequence ssg. 1/60 Three letters picked without replacement from {l: 3, p: 1, w: 3, h: 3, e: 6, j: 1}. Give prob of sequence pjl. 1/1360 Three letters picked without replacement from {u: 4, v: 6}. What is prob of sequence uvv? 1/6 Two letters picked without replacement from qkqkqqqqqqkqqqqq. What is prob of sequence kq? 13/80 Two letters picked without replacement from {q: 5, l: 11}. What is prob of sequence qq? 1/12 Four letters picked without replacement from {m: 10}. Give prob of sequence mmmm. 1 Three letters picked without replacement from kgkkkgkgkkkkkk. What is prob of sequence kkg? 55/364 Calculate prob of sequence ai when two letters picked without replacement from zviidzzzzazai. 1/26 Calculate prob of sequence qkh when three letters picked without replacement from hkhhkhhhhkhhkhhhqkhh. 7/684 Calculate prob of sequence vvv when three letters picked without replacement from {v: 6}. 1 What is prob of sequence mu when two letters picked without replacement from {o: 2, u: 5, b: 4, m: 4}? 2/21 Calculate prob of sequence eer when three letters picked without replacement from {e: 2, g: 2, b: 1, u: 2, z: 1, r: 1}. 1/252 What is prob of sequence gggb when four letters picked without replacement from kgbggkkk? 1/280 Calculate prob of sequence bbb when three letters picked without replacement from {k: 5, b: 4, n: 4, e: 3}. 1/140 What is prob of sequence ev when two letters picked without replacement from {e: 4, d: 1, v: 1, l: 8, t: 6}? 1/95 Three letters picked without replacement from {k: 1, y: 1, j: 1, r: 3, e: 1}. Give prob of sequence ekr. 1/70 Four letters picked without replacement from {t: 2, p: 7, l: 1, g: 9}. Give prob of sequence tpgg. 7/646 What is prob of sequence dhq when three letters picked without replacement from rhdqrqrhqrhhh? 5/572 Calculate prob of sequence ah when two letters picked without replacement from aagaqaaqhqqhaaqh. 7/80 Four letters picked without replacement from {l: 3, v: 7, q: 2, g: 3, n: 1, y: 1}. What is prob of sequence vnlv? 3/1360 Three letters picked without replacement from {d: 1, h: 2, z: 1}. Give prob of sequence hzh. 1/12 Three letters picked without replacement from eneeeeeeerqrqqnere. Give prob of sequence qqr. 1/272 Four letters picked without replacement from kkkkhkkkkkkkkkk. What is prob of sequence hkkk? 1/15 Two letters picked without replacement from {h: 1, v: 6, w: 1, l: 2, d: 2}. What is prob of sequence ww? 0 What is prob of sequence zzb when three letters picked without replacement from {b: 2, z: 8, a: 9}? 56/2907 Calculate prob of sequence nbn when three letters picked without replacement from {b: 2, n: 2, y: 2}. 1/30 What is prob of sequence sns when three letters picked without replacement from ssnsnnnnssnn? 7/66 Calculate prob of sequence iw when two letters picked without replacement from {i: 1, w: 11}. 1/12 Two letters picked without replacement from {b: 11, u: 2, g: 5, i: 1}. What is prob of sequence bb? 55/171 Two letters picked without replacement from alqllqqqmqulmuamq. What is prob of sequence au? 1/68 Two letters picked without replacement from ddyby. What is prob of sequence yd? 1/5 Calculate prob of sequence jhh when three letters picked without replacement from {v: 1, j: 4, h: 6}. 4/33 Two letters picked without replacement from {y: 5, r: 7}. What is prob of sequence yr? 35/132 What is prob of sequence ig when two letters picked without replacement from ilg? 1/6 Three letters picked without replacement from {i: 7, a: 7}. Give prob of sequence aia. 7/52 Four letters picked without replacement from {u: 5, m: 5}. Give prob of sequence muum. 5/63 Four letters picked without replacement from {a: 1, v: 4, n: 2, j: 8}. Give prob of sequence aaaa. 0 Calculate prob of sequence dz when two letters picked without replacement from ddddzddddz. 8/45 Four letters picked without replacement from {p: 4, c: 3}. What is prob of sequence pccp? 3/35 Calculate prob of sequence ckt when three letters picked without replacement from ppcpptppppckkt. 1/273 Two letters picked without rep	{ "pile_set_name": "DM Mathematics" }
6.8 What is 0.1538611757424 plus 0.5? 0.6538611757424 Subtract 3 from 829.3293547358. 826.3293547358 Work out -56.9752472 - 182. -238.9752472 What is -3 plus -88643128726? -88643128729 9.5127198 - -571 580.5127198 Total of 9413050588051 and -4. 9413050588047 Sum -254932320626128 and 0.4. -254932320626127.6 What is the distance between 0.14038 and -24541126797? 24541126797.14038 Work out -106.285 - -0.852704445. -105.432295555 Work out 330695 + -8420010. -8089315 0.156 + -1813286327 -1813286326.844 What is -0.0648782 less than 54499? 54499.0648782 Put together 23929987431 and 12. 23929987443 Add together -1838 and 3844469073. 3844467235 What is -19154090923 take away -0.041? -19154090922.959 Calculate -31 - 767960636. -767960667 What is 206406806 plus 38021? 206444827 What is 8786.99231 minus 437.3? 8349.69231 Work out -0.3 + 18116604643919. 18116604643918.7 Work out 1.898 + 20793.215817. 20795.113817 What is 18879.5 plus 120.5082274? 19000.0082274 Work out 0.49 + 56773593514. 56773593514.49 Add 0.02315696483 and -0.0417. -0.01854303517 What is -0.1 minus -1895526560163? 1895526560162.9 What is 1.46921 minus 2808.85556? -2807.38635 Add together 0 and -845885405610. -845885405610 Calculate 12.1 - -1311954502038. 1311954502050.1 2436942141+49453 2436991594 Put together 1144745880654.93 and 0.03. 1144745880654.96 Put together -15846.189 and 15327. -519.189 What is 238512718 - -385? 238513103 Work out -0.385 + -136612.52618. -136612.91118 What is -3338896169 plus 0.473? -3338896168.527 What is 28450.432036 less than -1883? -30333.432036 Work out -127181 + -1410073. -1537254 What is 984.9932 take away 228019? -227034.0068 What is the distance between 210.888897 and -6907.2? 7118.088897 Subtract -35758110 from -19.58611. 35758090.41389 Add together 0.1206093624 and -0.0134302. 0.1071791624 Calculate 1965 - -122610305. 122612270 Subtract 3929533953 from -0.1054. -3929533953.1054 Add together -2.56 and 138014418912. 138014418909.44 Total of 430 and 9.79822852. 439.79822852 What is 1 plus 2687775.04952? 2687776.04952 2610+26119.92 28729.92 Put together 1225907.915 and 219. 1226126.915 What is -1742 minus 8651739426? -8651741168 What is 1749.9628 minus 59.615? 1690.3478 Add together 19896.61333 and 0.001. 19896.61433 What is -193656483 plus -8544? -193665027 Put together -17255.171373 and 10065. -7190.171373 What is -63361250209829 plus -0.05? -63361250209829.05 Add together -331 and 834237108. 834236777 Add together 122551042 and -73410.27. 122477631.73 Calculate 2 + 75744322647967. 75744322647969 What is 49028411648 take away 282? 49028411366 What is 4 + -11945544165181? -11945544165177 Subtract -4367526 from -14746. 4352780 -2201926184+-84.26 -2201926268.26 What is 8501 + -73377490.2? -73368989.2 What is the distance between -2105587047 and 0.012144? 2105587047.012144 What is 727298342707 minus -0.02? 727298342707.02 What is 4.71839 less than -0.036242? -4.754632 What is -48930.6979 take away -0.04956? -48930.64834 Calculate 126510.07 - -16377. 142887.07 -0.2 + 8321823.6911 8321823.4911 -4892662431773 - 0.4 -4892662431773.4 What is the distance between -16831911 and -2021.6058? 16829889.3942 What is 2905166 less than -48689925? -51595091 What is 387430 - -459780? 847210 What is -0.1 + -1061955595601? -1061955595601.1 -0.35893074+5596205 5596204.64106926 -1580363262 - -0.245 -1580363261.755 What is -217008646 - 1512636? -218521282 Total of -310437 and -0.560496501. -310437.560496501 Calculate 6116143790948 + -276. 6116143790672 20.6483464+119 139.6483464 What is 0.0312991 less than -2624.991? -2625.0222991 What is 1727374605579 - -231? 1727374605810 0.31488378556+-0.3 0.01488378556 -1765417485+0.091 -1765417484.909 Put together 0.4 and -24326476.1776. -24326475.7776 What is -13 plus 10769365233.9? 10769365220.9 What is 93113413 minus 0.113192? 93113412.886808 What is the distance between 57.2111066966 and -51? 108.2111066966 Calculate -84874.0128 - -24626. -60248.0128 What is the difference between -8281636 and 0.10471912? 8281636.10471912 What is -0.5 plus 0.2560601621? -0.2439398379 Subtract 13403417965 from 1202. -13403416763 Calculate 49454473 - -0.8549153. 49454473.8549153 445540449371.09 - -3 445540449374.09 What is 23252.2 minus -1704.307? 24956.507 Work out -0.1465 + -12478567433. -12478567433.1465 1.29329+-1850.58767 -1849.29438 What is 1606.3 take away -277760.025? 279366.325 What is 46.7722 + 174703? 174749.7722 Put together -214188 and 12.9753. -214175.0247 What is the distance between -71352 and 17.085169? 71369.085169 -132107 - -762860 630753 What is the difference between 1786133686 and -37399? 1786171085 Calculate -85223077434 - -76. -85223077358 Sum 0.044004038341 and -7. -6.955995961659 -0.4 - -377716400732 377716400731.6 What is -3768 minus -31.32257227? -3736.67742773 2.098 - 3619845367 -3619845364.902 What is -137.55 plus -12.62947855? -150.17947855 Add 54309232.316 and 1654. 54310886.316 Put together -938.48039 and -21550. -22488.48039 What is 1882328208 minus 0.58105? 1882328207.41895 What is 27231.322 - 0.439? 27230.883 What is -54175658448721 take away 0.3? -54175658448721.3 What is -0.26 less than -623228632961? -623228632960.74 Add together -12879536937620 and -5. -12879536937625 Calculate 318080393126 + -2.4. 318080393123.6 What is -2 take away 387.99277973316? -389.99277973316 Put together -5028 and -1064046838. -1064051866 Add -9.441603 and 92.97. 83.528397 What is the distance between 3.660236815525 and -3? 6.660236815525 What is -0.422 take away 155650811? -155650811.422 -54632279375 - -8852 -54632270523 Add together 0.3 and -16539729778.6. -16539729778.3 Calculate 2031559331461 - -3. 2031559331464 What is -40423 + -5434.2? -45857.2 Calculate 0.1 + -4970804796145. -4970804796144.9 -21908 - 7.054269981 -21915.054269981 Put together -4.1 and -30115730960. -30115730964.1 Add -0.3 and -26700458347754. -26700458347754.3 -2931.6402802 - -0.2 -2931.4402802 Subtract 3240 from -4212744.78. -4215984.78 Total of 17.98 and -14117706939. -14117706921.02 What is the difference between -179582.6 and -24592? 154990.6 What is the distance between 0.7182418593 and 2.7? 1.9817581407 Put together -4246518.1 and 6331. -4240187.1 Work out -0.0575350363045 - 21. -21.0575350363045 6777114.967586 + 9 6777123.967586 -59545995360 - 17 -59545995377 Calculate -7643 + 721.46915. -6921.53085 Subtract -5112.63534 from 487. 5599.63534 Sum 0.009 and 5120850553.1. 5120850553.109 Put together 0 and 152463.022283. 152463.022283 Add -0.077464199 and 0.14303. 0.065565801 What is 732584923846 take away 0.3? 732584923845.7 -27297.07 - 48589.1 -75886.17 Calculate 8 - 105.3647944052. -97.3647944052 1 - 156.41946401012 -155.41946401012 What is -3728.1691549 - 0.18? -3728.3491549 What is -0.8 plus -8278457335? -8278457335.8 Sum 11.1995836 and 0.642. 11.8415836 What is 14590 take away -2696222120? 2696236710 What is 8.4 minus 55937019778? -55937019769.6 Calculate 14.8 + 637545694968. 637545694982.8 Work out -20769374132944 + -4. -20769374132948 Add together 358494003918 and -0.37. 358494003917.63 Work out 1.1577 + 186592.9. 186594.0577 What is -15453807.04 plus -45.7? -15453852.74 Add together 3205057501 and 66. 3205057567 Work out -1.92283786 + -764.742. -766.66483786 Sum 24696040669475 and -17. 24696040669458 What is 2.1547 less than 3590423? 3590420.8453 -14433.0607477+0.5 -14432.5607477 What is -3 - 8329955.2483106? -8329958.2483106 What is -3376.2 + 16.79587? -3359.40413 What is -7 + -0.063548544276? -7.063548544276 11.3931 - -119423119 119423130.3931 Subtract 5406488987 from 263. -5406488724 What is 25706289380433 less than 5? -25706289380428 What is 2614 minus 0.0835307729? 2613.9164692271 Calculate 6892066305 - 0.14. 6892066304.86 Calculate -217 + 594536.962. 594319.962 What is -137353730711 - -3? -137353730708 What is -498067483 + -13063? -498080546 What is -120642 less than -1248290? -1127648 What is 15.5 - -1.437650928? 16.937650928 Add together 4.609 and -19643558. -19643553.391 What is 5542 + 175240439? 175245981 0.1+2732042060357.82 2732042060357.92 Add together -7.31698014 and -0.0613528. -7.37833294 What is 1.91301891698919 take away -0.5? 2.41301891698919 Put together -706822874347 and -23. -706822874370 Work out -730.445142 - -4540. 3809.55485	{ "pile_set_name": "DM Mathematics" }
1 Collect the terms in -1409122v2 + 2818219v*2 + 21v*3 - 1409097v*2. 21v*3 Collect the terms in 507o - 255o - 212o. 40o Collect the terms in -4l + 53l3 - 821l*2 + 2 - 54l*3 + 4l - 1. -l*3 - 821l*2 + 1 Collect the terms in 0 - 20731y*2 + 10375y*2 + y + 10339y*2 + 4 - 4. -17y*2 + y Collect the terms in 22593373b*2 - 22591290b*2 + 45b - 45b. 2083b*2 Collect the terms in -204 - 183 - 29r*2 + 388 - 42r*2 - 91r*2. -162r*2 + 1 Collect the terms in -952 - 182x + 1834 - 882 + 403x - 198x. 23x Collect the terms in 99c + 3 - 4155c3 - 3 + 3642c*3. -513c*3 + 99c Collect the terms in 32716 - 32716 + 9669d2. 9669d*2 Collect the terms in 2042 - 1369653n + 1369652n - 1020 - 1022. -n Collect the terms in 145u*2 + 4238u*2 - 101u*2. 4282u*2 Collect the terms in -472 + 934 - 462 + 105067d*2. 105067d*2 Collect the terms in -13181v*2 + 33192v*2 + 11070v*2. 31081v*2 Collect the terms in -43646p*3 - 30p + 12p + 8p + 10p. -43646p*3 Collect the terms in 140296x + 139947x + 4x*3 - 280243x. 4x3 Collect the terms in 25704q - 135 - 12857q - 12850q. -3q - 135 Collect the terms in 369f*2 - 2f + 2f - 1352f*2 - 2573f*2. -3556f2 Collect the terms in -3697826 - d3 - 3697816 + 5d3 + 7395636. 4d*3 - 6 Collect the terms in -27673b - 41b2 - 12291b + 19b2. -22b*2 - 39964b Collect the terms in -462 - 3w3 + 987 - 16w*2 + 10w*2 - 525. -3w*3 - 6w*2 Collect the terms in -281907y*2 + 141528y*2 + 141235y*2. 856y*2 Collect the terms in -697 + 4265s - 5500s + 697. -1235s Collect the terms in -1301v - 1823v + 136 - 136. -3124v Collect the terms in 3145 + 3130 + 3137 - 5k + 7k - 9412. 2k Collect the terms in -185 + 6z - 200 + 565 - 193. 6z - 13 Collect the terms in 1 - 1 - 1825062s + 1820680s. -4382s Collect the terms in -1028j + 6j3 + 2194j*2 + 19j*3 + 1028j - 2194j2. 25j*3 Collect the terms in 5l - 16l - 564l*2 + 56 + 563l*2 + 11l. -l*2 + 56 Collect the terms in 23590 - 11800 - 11790 - 3585g. -3585g Collect the terms in -36548y - 136 - 6737y - 132 + 268. -43285y Collect the terms in 59630m2 - 3m - 29814m2 - 3789m*3 - 29816m*2. -3789m*3 - 3m Collect the terms in 17306b - 34619b + 17307b + 2b*2. 2b*2 - 6b Collect the terms in 148058n + 8264n - 12770n. 143552n Collect the terms in 534564 - 534564 - 17447a. -17447a Collect the terms in 7257051q2 - 12q - 7257048q2 + 12q. 3q2 Collect the terms in -2 + 44799848c - 2c2 + c2 - 44799848c. -c*2 - 2 Collect the terms in -3480q + 3477q - 3q*2 + 15 + 2q*2 + 0q2 + 15. -q2 - 3q + 30 Collect the terms in -20n*2 - 46423751n + 46423751n. -20n*2 Collect the terms in 10v*2 + 12 + 255661223688v - 12 - 255661223688v. 10v*2 Collect the terms in -241818696261f + 4f2 + 241818696261f. 4f2 Collect the terms in 6164079 + 4a + a3 - 6164079. a3 + 4a Collect the terms in 1026b + 102b3 - 63b*3 + 101b*3. 140b*3 + 1026b Collect the terms in -11514 - 131w2 + 11514 + 964w*2. 833w*2 Collect the terms in -184 - 13v*2 + 411 - 229 + 16v*2 + 22v*2. 25v*2 - 2 Collect the terms in -1848019a - 2974368a + 1476767a. -3345620a Collect the terms in -3b + 4029b2 + 3b - 1677b2 + 6081b*2. 8433b*2 Collect the terms in 205531 + 205528 + 24o*3 - 411059. 24o*3 Collect the terms in -837j*2 + 88j*2 + 2j*3 - 355j*2 + 2j. 2j3 - 1104j*2 + 2j Collect the terms in -10063n - 10081n + 40345n - 10125n - 10078n. -2n Collect the terms in 33d - 28d + 9d - 3d*2 + 10d + 3d3. 3d*3 - 3d*2 + 24d Collect the terms in -401j3 - 4 + 4 + 93j*3 - 400j*3. -708j*3 Collect the terms in 43 + 30 + 32 - 68n - 105. -68n Collect the terms in -9y - 186 - y*3 - 3y*3 + 5y - 11y2 - 5y. -4y3 - 11y*2 - 9y - 186 Collect the terms in 257468z2 + 1 - 128614z*2 - 128719z*2. 135z*2 + 1 Collect the terms in -23088z + 10772z + 12287z. -29z Collect the terms in -98017080184l*2 + 8l*3 + 98017080184l*2. 8l*3 Collect the terms in 614j*2 - 1193j*2 + 0 - 87j + 0 + 576j2. -3j*2 - 87j Collect the terms in 6 - 5 + 51u2 - 68u*2 - 1 + 52u*2. 35u*2 Collect the terms in 448c + 448c + 456c + 455c + 454c - 2730c + 456c. -13c Collect the terms in 8871o + 8o3 - 9 + 28 - 19. 8o*3 + 8871o Collect the terms in -3403998p3 + 1702004p*3 + 1701995p3 + 13. p3 + 13 Collect the terms in 3409u3 - 1047u*3 - 1052u*3 - 1314u*3 + 0 + 0. -4u*3 Collect the terms in 1 - 14871p - 1 - 8616p. -23487p Collect the terms in 497d3 + 171386d*2 - 85d - 171386d2. 497d*3 - 85d Collect the terms in -40f3 + 33416f*2 - f + f. -40f*3 + 33416f*2 Collect the terms in -574v - 1046v2 + 1032v*2 + 574v. -14v2 Collect the terms in -84j*2 + 41j*2 - 14508j + 45785j + 40j*2. -3j*2 + 31277j Collect the terms in 2523320681 + 145w3 - 2523320681. 145w*3 Collect the terms in 9w*3 + 14w*3 - 14w*3 + 4w*3 + 263w - 463w + 200w. 13w3 Collect the terms in 40d - 62d + 20d - 88. -2d - 88 Collect the terms in 11680u - 5454u - 13 - 5547u. 679u - 13 Collect the terms in 5z + 4 + 1 + 0 - 6z2 - 2z*2. -8z*2 + 5z + 5 Collect the terms in 5093k + 107k*2 + 92k*2 - 178k*2 - 5093k. 21k2 Collect the terms in 0r + 0r3 - 6 + 29 + r3 + 34 - 322r2 + r. r3 - 322r2 + r + 57 Collect the terms in -141 + 141 - 3851623g*3 + 3851838g*3. 215g*3 Collect the terms in 2089342h + 1571942h + 314603h. 3975887h Collect the terms in -v - 46058618 + 138175828 - 46058596 - 46058614. -v Collect the terms in 376321663 - 188160835 - 188160828 + i3. i3 Collect the terms in 60w*3 + 16w*3 + 662w*3 + 113w*3 - 731w*3. 120w*3 Collect the terms in 462639m - 462639m - 232m*3. -232m*3 Collect the terms in 25r*2 - 2 + 2 + 1834787304r - r*2 - 1834787304r. 24r2 Collect the terms in -9w - 5439 + 19w + 10953 - 5514 + 8w. 18w Collect the terms in -1 + 1 - 3634s + 1514s - 4346s. -6466s Collect the terms in -3b*3 + 3526b - 10511b - 2b*3 + 3652b + 3333b. -5b*3 Collect the terms in 3443o*2 - 53536o*2 - 2o*3 - 73o*2 - 79090o*2 + 2o. -2o3 - 129256o*2 + 2o Collect the terms in 99940n + 10697n + 6545n + 26227n. 143409n Collect the terms in -982k*2 + 742k*2 + 4490k*2 - 4 + 4 - 3k. 4250k2 - 3k Collect the terms in 220663r - 110315r - 110348r - 147r*2. -147r*2 Collect the terms in 36262x - 69446x + 33173x. -11x Collect the terms in 33698495s + 33698576s - 67397071s - 6s3. -6s*3 Collect the terms in 15a*2 - 47a*2 + 32a*2 - 16a*3 - 730a*3. -746a*3 Collect the terms in 11178l - 24156l + 11715l. -1263l Collect the terms in -j2 - j - 73927326 + 73927312 + j. -j2 - 14 Collect the terms in -28403x*3 - 27732x*3 + 56836x*3. 701x*3 Collect the terms in -646 - 259 - 323 - 6g*3 + 1228. -6g*3 Collect the terms in -131v - 93v - 299v*2 + 224v + 71v2. -228v*2 Collect the terms in -3121a*3 + 67 - 110 + 43 + 586a*3. -2535a*3 Collect the terms in -6b*2 + 164465562044b + b*2 - 164465562044b. -5b2 Collect the terms in 3v2 + v2 - v*2 - 3v*2 - 68018v*3. -68018v*3 Collect the terms in -5b*2 + 69490857b - 69490857b. -5b*2 Collect the terms in -615408845573t*2 - 5t*3 + 615408845573t*2. -5t*3 Collect the terms in 532t + 515t - 2080t + 531t + 532t. 30t Collect the terms in 3924491h - 10h2 - 3924491h + 34h2 - 15h*2 - 16h*2. -7h*2 Collect the terms in 178598f + 116079f - 172858f + 237670f. 359489f Collect the terms in 908 - 3q3 - 809 - 13q*3 + 15q3. -q3 + 99 Collect the terms in 1 - 1354w - 1 - 404w + 2162w - 405w. -w Collect the terms in 4x3 + 3941176x - 7882351x + 3941175x. 4x3 Collect the terms in 2l*2 + 2l*2 - 6l*2 - 64 - 304l. -2l2 - 304l - 64 Collect the terms in 71z + 10z + 23z - 21z - 4. 83z - 4 Collect the terms in 36 + 74i*2 + 226i*2 + 65i*2. 365i*2 + 36 Collect the terms in 0h*3 + 14 + 0h*3 + 0h*3 - 4h*3 - 364h - 16. -4h3 - 364h - 2 Collect the terms in	{ "pile_set_name": "DM Mathematics" }
h that -k*5 + 5k4 + k3 - 41k2 + 72k - 36 = 0. -3, 1, 2, 3 Suppose p*4/9 + 4p3/9 - p2 - 4p = 0. What is p? -4, -3, 0, 3 Factor 3p*2/5 + 450p + 84375. 3(p + 375)2/5 Solve -3c*2 - 27c - 60 = 0 for c. -5, -4 Suppose 3f3/5 + 108f*2/5 + 252f + 960 = 0. Calculate f. -16, -10 Factor -f*3/6 + 8f*2/3 - 27f/2 + 21. -(f - 7)(f - 6)(f - 3)/6 Suppose r*5/2 - 11r*4/2 + 3r*3 + 22r*2 - 20r = 0. What is r? -2, 0, 1, 2, 10 Factor -16129i2/2 - 508i - 8. -(127i + 4)2/2 Suppose -4j*3 - 12j*2 + 144j - 128 = 0. Calculate j. -8, 1, 4 Factor -3o3/7 + 12816o*2/7 - 18249984o/7 + 8662659072/7. -3(o - 1424)3/7 Factor 4k*5 + 32k*4 + 69k*3 - 7k*2 - 98k. k(k - 1)(k + 2)(2k + 7)*2 Suppose 4f*5 - 16f*4 - 24f*3 + 16f*2 + 20f = 0. Calculate f. -1, 0, 1, 5 Factor -3u3 - 165u*2 + 12u + 660. -3(u - 2)(u + 2)(u + 55) Determine u so that u2/4 - 55u/2 = 0. 0, 110 Find l, given that -2l2/11 + 10464l/11 - 13686912/11 = 0. 2616 Suppose -3l2/5 + 108l/5 = 0. Calculate l. 0, 36 Let 2m5/5 + 20m*4 + 1432m*3/5 + 4508m*2/5 + 3174m/5 = 0. What is m? -23, -3, -1, 0 Determine k, given that -4k2 + 15592k - 15194404 = 0. 1949 Solve -i*2 + 5i = 0 for i. 0, 5 Factor 2w2 - 14w/3 + 4/3. 2(w - 2)(3w - 1)/3 Determine b so that 9b*5/5 + 12b*4 - 534b*3/5 + 576b*2/5 + 837b/5 - 324/5 = 0. -12, -1, 1/3, 3 Find j such that -2j4/13 - 12j*3/13 + 44j/13 - 30/13 = 0. -5, -3, 1 Factor -4h4 - 14448h*3 - 13060984h*2 - 26078640h - 13032100. -4(h + 1)2(h + 1805)2 Determine i so that -i3/3 + 22i2/3 + 47i/3 + 8 = 0. -1, 24 Factor 4y3 + 16y*2 + 20y + 8. 4(y + 1)2(y + 2) Find h, given that -28h2 + 20h + 8 = 0. -2/7, 1 Factor 25s4/8 + 40s*3 + 143s*2 + 96s + 18. (s + 6)*2(5s + 2)2/8 Let 5t*3/2 + 20t*2 - 5t/2 - 20 = 0. What is t? -8, -1, 1 Factor w*3/3 + 46w*2 + 1792w + 40960/3. (w + 10)(w + 64)2/3 Determine k, given that 18k*3 + 3k2 = 0. -1/6, 0 Let -s5/6 + s*4/3 + 4s3/3 + s2/3 - 7s/6 - 2/3 = 0. Calculate s. -1, 1, 4 Factor 2n*4/3 + 640n*3/3 + 16852n*2 - 103040n/3 + 51842/3. 2(n - 1)2(n + 161)*2/3 Suppose -2b*4/11 - 192b*3/11 - 6720b*2/11 - 102400b/11 - 576000/11 = 0. Calculate b. -36, -20 Determine l, given that 3l3 - 23l*2 - 10l + 16 = 0. -1, 2/3, 8 Factor 2x2 + 366x + 1080. 2(x + 3)(x + 180) Find a, given that 3a2/7 + 5646a/7 + 2656443/7 = 0. -941 Find b, given that -b*2 - 120b + 244 = 0. -122, 2 Determine z, given that 12z2 - 574z - 96 = 0. -1/6, 48 Solve -2n3/13 - 232n*2/13 - 456n/13 = 0 for n. -114, -2, 0 Factor 5j3 + 720j*2 + 25185j - 53290. 5(j - 2)(j + 73)*2 Factor -2g*2 - 854g - 852. -2(g + 1)(g + 426) Let u5/2 - u4 = 0. Calculate u. 0, 2 Factor 8q2 - 646q - 162. 2(q - 81)(4q + 1) Factor s2/3 - 1634s/3 + 667489/3. (s - 817)*2/3 Factor 2h*3 + 64h*2 + 370h + 500. 2(h + 2)(h + 5)(h + 25) Find n, given that -n3/3 + 22n*2/3 = 0. 0, 22 Solve -4418n*4/9 - 1598n*3/3 + 8452n*2/9 + 248n/3 + 16/9 = 0. -2, -2/47, 1 Factor -w*2 - 4w + 21. -(w - 3)(w + 7) Solve -2i*4/7 + 6i*3/7 + 68i*2/7 + 96i/7 = 0. -3, -2, 0, 8 Suppose -21k5/4 - 180k*4 - 1569k*3/4 - 531k*2/2 - 48k = 0. Calculate k. -32, -1, -2/7, 0 Suppose -3d2 - 5520d - 2539200 = 0. Calculate d. -920 Determine l, given that 2l4/11 + 32l*3/11 + 58l*2/11 + 28l/11 = 0. -14, -1, 0 Suppose 2s2 - 180s - 2222 = 0. What is s? -11, 101 What is q in 3q2 - 12 = 0? -2, 2 Suppose 4g*5 - 28g*4 - 172g*3 - 68g*2 + 264g = 0. Calculate g. -3, -2, 0, 1, 11 Solve -12m2 + 20m - 25/3 = 0. 5/6 Determine a so that 5a2 + 15a - 900 = 0. -15, 12 Suppose 3n3/2 + 24n*2 + 96n = 0. What is n? -8, 0 Solve -3t3 - 864t*2 + 1737t - 870 = 0. -290, 1 Suppose u*2 - 290u + 21025 = 0. Calculate u. 145 Solve -b*5 + 39b4 + b3 - 39b2 = 0. -1, 0, 1, 39 Determine g so that 3g*5 - 21g*3 - 6g*2 + 36g + 24 = 0. -2, -1, 2 Find a such that 3a5 + 81a*4 - 174a*3 + 6a*2 + 171a - 87 = 0. -29, -1, 1 Factor 3d2 + 78d - 168. 3(d - 2)(d + 28) Suppose -2f3/11 - 28f*2/11 - 98f/11 - 72/11 = 0. Calculate f. -9, -4, -1 Determine k, given that 5k2 + 265k = 0. -53, 0 Suppose -5d2 + 330d - 325 = 0. What is d? 1, 65 Factor -36u3 + 820u*2 - 1976u - 480. -4(u - 20)(u - 3)(9u + 2) Suppose -2a3/17 + 2288a*2/17 + 4582a/17 + 2292/17 = 0. Calculate a. -1, 1146 Suppose l*2/2 - 37l + 1369/2 = 0. Calculate l. 37 Find x, given that -3x3 + 6x*2 + 24x = 0. -2, 0, 4 Factor c*3 - 8c*2 + 19c - 12. (c - 4)(c - 3)(c - 1) Factor -y*3 + 6y*2 - 11y + 6. -(y - 3)(y - 2)(y - 1) Factor -3k5/7 + 6k*4/7 - 3k*3/7. -3k*3(k - 1)*2/7 Factor 2g*2/7 + 1104g/7 - 158. 2(g - 1)(g + 553)/7 Factor -o*3/6 + 59o*2/2 - 3481o/2 + 205379/6. -(o - 59)*3/6 Factor 40l*2 - 5044l + 504. 4(l - 126)(10l - 1) Determine g so that -3g*2/2 - 33g - 60 = 0. -20, -2 Determine z so that -4z5 + 404z*4/3 - 4724z*3/3 + 7028z*2 - 21472z/3 - 9680/3 = 0. -1/3, 2, 10, 11 Determine h, given that -20h5/3 - 68h*4 - 100h*3 + 1148h*2/3 - 160h - 48 = 0. -6, -1/5, 1 Solve -2s2 - 476s - 28322 = 0. -119 Suppose u*5/5 - 81u*4/5 + 2184u*3/5 - 19604u*2/5 = 0. Calculate u. 0, 26, 29 Factor -3s*5 + 243s*4 - 4545s*3 - 15123s*2 - 15624s - 5292. -3(s - 42)2(s + 1)*3 Factor -3b*4 + 6b*3 + 39b*2 + 30b. -3b(b - 5)(b + 1)(b + 2) Let x*2/4 - 3x - 7 = 0. Calculate x. -2, 14 Factor 2b2 + 270b - 272. 2(b - 1)(b + 136) Factor -v*2/3 - 8v - 23/3. -(v + 1)(v + 23)/3 Factor -3a*3 + 150a*2 - 687a + 540. -3(a - 45)(a - 4)(a - 1) Suppose 2t*5/3 - 43t*4/3 + 217t*3/3 + 187t*2/3 - 121t = 0. Calculate t. -3/2, 0, 1, 11 Determine s so that -s*5/4 + 2s*4 - 25s*3/4 + 19s*2/2 - 7s + 2 = 0. 1, 2 Factor -3g2 - 1008g + 1011. -3(g - 1)(g + 337) Factor 2i2/3 + 428i/3. 2i(i + 214)/3 Suppose m*4 + 10m*3 + 9m*2 - 52m + 32 = 0. Calculate m. -8, -4, 1 Factor -4g2 - 59232g - 219276864. -4(g + 7404)2 Determine k so that -k3/2 - 213k*2/2 + 429k/2 - 215/2 = 0. -215, 1 Factor 28p3 + 4p*2. 4p*2(7p + 1) Determine y so that -3y*3 - 354y*2 + 1083y - 726 = 0. -121, 1, 2 Suppose 5n4/8 + 13n*3/8 - 51n*2/8 + 43n/8 - 5/4 = 0. Calculate n. -5, 2/5, 1 Let 32q5/7 + 40q*4 + 404q*3/7 + 68q*2/7 - 116q/7 - 4 = 0. What is q? -7, -1, -1/4, 1/2 Solve 3c2 + 7242c + 4370547 = 0. -1207 Determine i so that i*4 - 12i*3 - 14i*2 + 12i + 13 = 0. -1, 1, 13 Factor -w*2/4 - 5w/4. -w(w + 5)/4 Determine g, given that 2g*4 + 25790g*3/3 + 12315202g*2 + 5877085518g - 11770598948/3 = 0. -1433, 2/3 Find q, given that 4q4/9 + 14q*3/9 + 2q*2 + 10q/9 + 2/9 = 0. -1, -1/2 Factor 3i4 - 6i*3 - 3i*2 + 6i. 3i(i - 2)(i - 1)(i + 1) Suppose -49t5/4 - 77t*4/4 + 33t*3/2 + 13t*2 + 2t = 0. What is t? -2, -2/7, 0, 1 Factor 4j4/3 - 124j*3/3 + 1276j*2/3 - 1452j. 4j(j - 11)*2(j - 9)/3 Factor g*5 - 5g*4 - 9g*3 + 13g*2 + 28g + 12. (g - 6)(g - 2)(g + 1)3 Suppose k2/2 + 9k/2 + 4 = 0. Calculate k. -8, -1 Determine b so that b4/5 + 2b*3/5 - 9b*2/5 - 18b/5 = 0. -3, -2, 0, 3 What is q in -3q2 + 3996q - 1330668 = 0? 666 Factor b*2 - 36b + 324. (b - 18)*2 Factor -3x*3/5 - 18x*2/5 - 24x/5. -3x(x + 2)(x + 4)/5 Find u, given that -u4 - 4u*3 - 6u*2 - 4u - 1 = 0. -1 Factor 2q5/7 + 320q*4/7 + 20480q*3/7 + 655360q*2/7 + 10485760q/7 + 67108864/7. 2(q + 32)5/7 Find h, given that 5h*4 + 110h*3 + 475h*2 - 110h - 480 = 0. -16, -6, -1, 1 Factor y*4/6 + 23y*3/3 - 205y*2/6 - 125y/3. y(y - 5)(y + 1)(y + 50)/6 Factor g2/6 + 17g/6 + 12. (g + 8)(g + 9)/6 Solve 3w*3/5 + 294w*2/5 + 579w/5 + 288/5 = 0. -96, -1 Find k such that 2k5 + 9k*4 + 5k*3 - 30k*2 - 52k - 24 = 0. -2, -3/2, -1, 2 Factor d*3 - 11d*2/2 - 7d/2 + 3. (d - 6)(d + 1)(2d - 1)/2 Suppose 8a*5 - 476a*4 + 1144a*3 - 220a*2 - 456a = 0. Calculate a. -1/2, 0, 1, 2, 57 Find q, given that 2q5 - 8q*4 - 2q*3 + 8q2 = 0. -1, 0, 1, 4 Determine h, given that -h2/4 + 7*h/4 - 5/2	{ "pile_set_name": "DM Mathematics" }
b - c, b - 25 = -4f for f. 5 Let b = -3 + 3. Let u be b/(1/(1 + -2)). Solve -s - s - 2n + 4 = u, -n - 2 = 3s for s. -2 Let g be ((-2)/124)/((-4)/12). Solve i - 19 = -5o - 5, 3o - i = g for o. 2 Let r be 1 - (9/(-3) + 4). Solve r = -4a - 9 + 1, n = -2a - 7 for n. -3 Let w be 4/32 + (-46)/(-16). Suppose -wm = -10m + 14. Suppose 3i - l - 17 = 0, -4i = -3l - 8 - 18. Solve j = -p + m, 3p = -ij - 0p + 6 for j. 0 Suppose 3y + h - 2h - 2 = 0, -h = 5y + 2. Suppose -2m + 2 = -2j, yj = 2j - 4. Solve 0 = -3q - 15, -2n - mq = q + 24 for n. -2 Suppose 3o + q = 9, 3q + 13 = o - 0. Solve -u = -3, -5f - u + ou - 29 = 0 for f. -4 Let m(d) = d*2 - 8d + 7. Let n be m(7). Solve -2k + l = -15, n = -2l - 2l - 20 for k. 5 Let r be (-1 - 2) + 7/1. Solve -5v = 4z - 4, -2z + v = -6z + r for z. 1 Suppose 0f = -f + 2. Solve -d - 2l - 8 = 0, -fd + 16 = 3d - 4l for d. 0 Let q be 4 + (0 - (2 - 4)). Let s = 6 - q. Solve -p + 0p - 4 = 2h, s = -p for h. -2 Let u be 5/(4/(1 + 3)). Let v(l) = -l*2 + 8l - 8. Let w be v(6). Solve 3p = -3y - y - 35, -wp + 5y + u = 0 for p. -5 Let o = 41 + -33. Let h = 8 - 5. Solve 4p = -v + 16, -v + o = 2p - hv for p. 4 Let j = -3 - -8. Suppose r - 3 = -5k + 3, 2k = jr + 24. Solve ka - 9 = -5x + 3a, -x + 5 = 3a for x. 2 Suppose 0i = -5i + 10. Let p be (-1)/4 - 18/(-8). Suppose 0a + 22 = pa. Solve ig + 3f + a = 0, -f = 4g - g + 6 for g. -1 Let f = 6 + -4. Suppose -4t - 4i = -4, -3i + 22 = 4t - 8i. Solve -fu + 11 = -u - 2q, 2 = -tu - q for u. 1 Suppose -5 - 7 = -3p - 3v, 5v = p - 10. Suppose p = 5j - 10. Solve 2i - 18 = -4z + i, 3z - ji = 21 for z. 5 Let b = 14 + -12. Solve 1 = -4f + y, by - 2 = -5f - 0f for f. 0 Suppose 71 = 5s + 71. Solve x + w + 3w + 4 = s, 2x - 5w - 18 = 0 for x. 4 Let b(i) = i3 + 7i*2 + 7i + 9. Let p(t) = t*3 - 6t*2 - 6. Let z be p(6). Let n be b(z). Solve -3h - 24 = -4j, -4 = j + h - n for j. 3 Suppose -6z + 3z + 3 = 0. Solve 4j = 4p, 2p + z + 2 = -j for p. -1 Let q(o) = 6o2 + 3o - 2. Let x be q(2). Suppose -3k = -m + x, 0m - 18 = 2k - m. Let b be (-1)/(4/k)8. Solve b = 2y - 4l, 0 = 5y + 5l + 27 - 2 for y. 0 Let d = -26 - -29. Solve 8w + 3v - 37 = dw, 0 = -5w - 2v + 33 for w. 5 Suppose 0 = 3m - 6 - 0. Suppose s - 2k - 10 = -m, -2k + 6 = 0. Let a be 2/7 + 290/s. Solve 5n + g = -2g + 30, a = 2n + 3g for n. 3 Suppose 4w - w = 39. Let k be w + (1 + 2 - 0). Solve 2t = 4u + 21 - 1, t - k = 4u for u. -3 Let c(z) = z*3 - 7z*2 - 8z - 9. Let x be c(8). Let d = -5 - x. Let n(o) = -2o - 3. Let l be n(-2). Solve -3p = 2y - 1, dp = -5y - l + 7 for y. 2 Let j = 1 + 1. Let l(r) = -r3 + 2r*2 + 2r + 1. Let o be l(j). Let d = o - 2. Solve -2g + du = 17, -5u + 35 = -3g - 2g for g. -4 Let m = 6 - 1. Let s = 6 + -10. Let q be (-3 - s)/(1 - 0). Solve -q = mi + 2w - 10, 3i - 15 = 2w for i. 3 Let y(n) = -n3 - 10n*2 - n - 8. Let l be y(-10). Solve k + 1 = 3z, -5z = lk + 15 - 2 for k. -4 Let l be 165/30 - (-1)/(-2). Let g be (4/(-8))/(2/(-12)). Solve gs - lz = s - 4, -4z = 5s + 10 for s. -2 Let w(d) = d*2 - 2d - 4. Let h = -3 + 1. Let p be w(h). Solve -4v - pg - 4 = 4, 2v - 2g = 4 for v. 0 Let a be (-2)/(-2(-3)/(-12)). Let f(v) = -v2 + 2v + 6. Let b be f(-6). Let o be (b/(-2))/(18/24). Solve 0 = -ai + 4u + o, -3i + u = i - 16 for i. 3 Suppose -q + s = -4s - 13, 5s = 4q - 97. Let t be 5 - (1 + -2)-2. Solve -q = 4z + tp, -2p = 3z - 6z - 4 for z. -4 Suppose 0 = -65n + 63n + 50. Suppose -4 = -2m + 3m. Let o be (-1)/4 + (-1)/m. Solve -3y - n = -5f - oy, -3f - 14 = 4y for f. 2 Suppose -3f + 94 = 16. Solve 4r = -4w + 3w - 12, f = -3r - 5w for r. -2 Suppose -4k - k - 70 = 0. Let c = 21 + k. Let n(u) = -u*2 + 8u - 3. Let x be n(c). Solve -2w - 3f + x = -3w, -16 = 4w + 4f for w. -4 Suppose -4w - 73 = -5a - 7w, 39 = 3a + 3w. Let h = a - 9. Suppose 6r = r + 20. Solve -2i = -h, 2i = rz + i for z. 1 Let r = 10 + -7. Let b(f) = -f*r + 2 - f + 5f*2 - 3f*2 + f. Let n be b(2). Solve 7 = u - nm, 0 = -2u + 2m + 5 + 1 for u. -1 Let q(y) = y3 - y2 - 4y + 3. Suppose -4r = -0r - t - 13, r + 3t = 0. Let j be q(r). Solve o + 0o + 4u = -j, 2o + 2u = -6 for o. -1 Suppose 0 = -2h + 5 - 1. Let a be 11/(-11)(0 - 0). Suppose a = -2r + r + 12. Solve -4y = 21 - 1, -g + r = -hy for g. 2 Suppose -36 = -5w - 4a, 6w + 5a = 3w + 32. Suppose 0 = -2j + j + 22. Solve 0g = -3x - 2g + j, -wx + 1 = -3g for x. 4 Let d(z) = -z*3 + 5z*2 - 2z + 3. Let y be d(3). Let c be (-1)/5 - (-108)/(-10). Let b = -11 - c. Solve 3m + y = -bu + 5u, -4u - 3m = -12 for u. 3 Let s be (-21)/68/(-1). Let m = -19 + s. Solve 0 = -y - 3h + m, 3y + 5h + 5 - 24 = 0 for y. 3 Suppose 3 = -t + 7. Suppose 0 = 7l - tl. Suppose ly + 8 = 4y, 5o = y + 8. Solve -h - 4x - 11 = x, 3x + o = 4h for h. -1 Let k(u) = -u3 + 7u*2 + 2u - 9. Suppose 0 = -5d - 25, -5g + 2d - 7d = -10. Let t be k(g). Solve 3v = f + 4 + 4, -tf = 2v - 28 for f. 4 Suppose -24 = -4i + 4t, 0t + 22 = 5i - 3t. Let r(s) = 2s - 2. Let o be r(i). Solve 0 = ow + 5a - 5, 0a + 8 = 2w + 2a for w. 5 Let v(m) = 2m3 - 2m*2 - 3m + 3. Let i be v(2). Solve -2d - 3d - 3z = -13, -29 = -id + z for d. 5 Suppose 0z = 5z - 70. Solve 5h + s - z = 0, 3h - 10 = -h - 2s for h. 3 Let k be 7 + -4 + -19. Let m(f) = -f*3 - 6f*2 + 4. Let i be m(k). Solve 2r - g + 5 = 0, r - g + i = 2 for r. -3 Let d = 7 - 11. Let w be d/(-18) + 25/9. Suppose -2 = 2g, 15 = -4f - 5g + 102. Solve 0 = -3b + 4a + f, -b + a = -wb + 8 for b. 5 Suppose 5k + 5n = 30, -8 = -n - n. Suppose -3p - kp + 65 = 0. Let b be p + (0 + -1)1. Solve -2r - 28 = -4g, -11 - b = 2r - 3g for r. -4 Let b be (-6 - -7)/((-2)/(-30)). Let j = 11 + b. Solve -g = c + 6, 2c + c + j = -5g for c. -2 Let j(y) = -22y - 10. Let z(q) = -7q - 3. Let a(v) = 5j(v) - 16z(v). Let x be a(2). Let p = x + 2. Solve -2s + 3o + 20 = 0, -5s + po + 24 = 3o for s. 4 Suppose -6q + 2q - 5y = -7, 4y - 2 = -2q. Solve -18 = 5u - qa + 14, -5u = 5a for u. -4 Suppose -14l = -7l - 21. Solve -o = 2b - 4 - 2, lb - 3o = -9 for b. 1 Let d be 15-2(-2)/(-4). Let v be 1/((-9)/d)6. Solve 4r + 20 = 4u, 4u + 5r + v = 3r for u. 0 Let y(r) = 4r3 - 1. Let o be y(1). Solve -5s = 2n + 17, 3n + os + 3 = -0 for n. 4 Suppose 0 = -2q + 3q. Let y(j) = j3 - 3j*2 + 3j - 7. Let k be y(3). Solve q = -kc + 4d - 16, -c - 3d + 6 = -1 for c. -2 Let z(l) = l3 - 11l*2 + 11l - 4. Let v be z(10). Suppose 4d - vd + 8 = 0. Solve -3n + 22 = -do, 0 = 2o + 3n - 1 + 3 for o. -4 Let a = -140 - -140. Solve a = -2u + 2n + 8, -n - n - 11 = -5u for u. 1 Suppose -5n = 1 + 4. Let x be n(-3 + -1 + 2). Solve -x = z + 5g, 2g = -3g for z. -2 Let i(r) = -r*3 - 19r*2 + 20r + 2. Let u be i(-20). Solve -2a - ut = 18, -28 = 4a - 2a + 4t for a. -4 Suppose j = -2j + 6. Suppose 0 = -0a + a - n - 2, ja = 5n + 10. Solve -3g + 5s + 12 = a, -5g + g + s = -16 for g. 4 Suppose 3z = -0k - 3k + 3, -3z - 5k - 1 = 0. Let v be -2 + -2 + 1 + 2. Let w be v/1-1 - -18. Solve -5n + n - zc + w = 0, 0 = 3n + 3c - 15 for n. 4 Let c = -3 + 6. Suppose n = -cn. Solve -4v + 4 = -4l, -l + nv = v + 3 for l. -2 Let o(x) = -x*3 + 6x*2 - 4x - 5. Let h be o(5). Let s = -3 - -6. Suppose -k - 8 + h = -u, u = -sk - 4. Solve -5l = -ug + 20, 0 = g + 5l + 3 - 1 for g. 3 Suppose -i + 7 = w, w + w + 16 = 4i. Solve s = x - 1, -4x + 5s = -ix + 13 for x. 3 Suppose 6 + 135 = -3m. Let j be m/(-9) + 4/(-18). Solve 3f + f + r - 8 = 0, jf - 25 = -5r for f. 1 Suppose 2 + 6 = 2o. Solve -20 = -4y + od, -2d - 2d = 2y + 14 for y. 1 Let h(n) = -n*2 + 12n - 15. Let v be h(9). Solve 4c - v = 0, -2z - 2c - 15 = -7c for z. 0 Suppose 3p = 4h + 19, -3p - 4h = -7 - 4. Suppose 21 = 2o - 3w, -po = -o - 5w - 37. Solve oi = -0k - 5k - 7, 0 = -4i - 2k for i. 1 Let x(n) = -n3 - 2n*2 + n + 6. Let v be x(-3). Solve -2r + 4 + 0 = -2w, 3w + 3r = v for w. 1 Suppose 0 = -o - 2c + 17, 0c + 24 = 2o + 2c. Suppose 3j - o = 8. Solve -h - 22 = jv, 27 = h - 5v + 9 for h. -2 Suppose 0 = 7h - 10h + 9. Solve r - 4 = -2*f	{ "pile_set_name": "DM Mathematics" }
terms in 5d3 + 8d*3 - 5d*3 - 13d*3 - 15d*3. -20d*3 Collect the terms in -196q*2 + 9 + 1 - 10. -196q*2 Collect the terms in 35b*2 - 16b + 10 + 16b. 35b*2 + 10 Collect the terms in -547110 - 12j3 - j2 + 547110 + j*2. -12j*3 Collect the terms in 2892n*3 - 929n*3 - 955n*3 - 920n*3. 88n*3 Collect the terms in 293604c*3 - 282c - 293612c3 + 282c. -8c3 Collect the terms in -205g - 207g - 183g + 157g - 61g. -499g Collect the terms in 36 + 128y - 36 + 125y + 122y - 378y. -3y Collect the terms in -49x + 50x + 7x - 3x. 5x Collect the terms in -166p*2 + 25p - 50p + 25p + 2. -166p2 + 2 Collect the terms in -36659t - 36660t - 36747t + 110067t. t Collect the terms in q2 + 253 + 24 + 311. q2 + 588 Collect the terms in 2164z*3 - 4345z*3 + 2109z*3. -72z*3 Collect the terms in -97y*2 - 19 - 26y*3 - 30y2 + 19 + y3. -25y3 - 127y*2 Collect the terms in 434411 + 7c*3 - 434411. 7c*3 Collect the terms in 28z*2 - 273 + 33 + 240. 28z*2 Collect the terms in 11677 + 2m*2 - 5820 - 5857. 2m*2 Collect the terms in 9f + 17355f3 + 12f - 21f. 17355f*3 Collect the terms in 9a*3 - 11a*3 - 11a*3 + 8a*3. -5a*3 Collect the terms in -10c*3 + 34 - 3c*3 + 11c*3 - 816. -2c*3 - 782 Collect the terms in -11894y + 6720y + 5968y. 794y Collect the terms in 765669t*3 - 382834t*3 + 33 - 382833t*3. 2t*3 + 33 Collect the terms in 102n + 17n2 - 55n - 47n. 17n*2 Collect the terms in 19b*2 + 19b*2 + 14b*2 - 68b*2 + 17b2 + 6. b2 + 6 Collect the terms in 528x2 + 218x*2 + 412x*2 - 405x*2. 753x*2 Collect the terms in 454z + 56 - 917z + 464z. z + 56 Collect the terms in -149 - 159 + 4p2 + 466 - 158. 4p*2 Collect the terms in 16081p - 2p2 + 16080p - 32161p. -2p*2 Collect the terms in 117o*3 + 145o*2 - 41o*3 + 149o*2 + 146o*2 - 435o*2. 76o*3 + 5o*2 Collect the terms in -999a - 271a - 1280a. -2550a Collect the terms in -27w*2 + 2w - 2w - w2 - 26w*2. -54w*2 Collect the terms in -27k*2 - 11k*2 + 0k*2 - 7k*2. -45k*2 Collect the terms in -7070847i*2 + 5i - 5i + 7070850i*2. 3i*2 Collect the terms in -4l + 3l + l + 48l*2 - 2l*2. 46l*2 Collect the terms in 184q*3 + 88q*3 - 274q*3. -2q*3 Collect the terms in 3 + 1 - 4 - 1868n*2. -1868n*2 Collect the terms in 1636 + 0x - 547 - 542 - 3x - 547. -3x Collect the terms in 646v - 646v + 1135v2. 1135v*2 Collect the terms in 804f - 2 + 6 - 3. 804f + 1 Collect the terms in 28t - 61t + 28t - 2t + 15t + 11t. 19t Collect the terms in -3d2 - 74492 - 9d*2 + 74492. -12d*2 Collect the terms in 11745c*2 - 5885c*2 - 5862c*2. -2c*2 Collect the terms in -46m*2 + 12m*2 + 8m*2 + 9m*2 + 12m*2. -5m*2 Collect the terms in -8n*2 - 298n*3 - 294n*3 + 606n*3. 14n*3 - 8n*2 Collect the terms in 74 + 220 + 80 - 374 + 12y. 12y Collect the terms in -1304a*3 + 30 - 1319a*3 - 30. -2623a*3 Collect the terms in -358m - m*3 + 233m + 285m. -m3 + 160m Collect the terms in 985u + 180 - 493u - 491u. u + 180 Collect the terms in 124047z - 2z2 - z3 - 124047z. -z*3 - 2z*2 Collect the terms in -311 + 64b + 310 - 35b. 29b - 1 Collect the terms in 56200g2 - 56210g*2 + 4g - 4g. -10g*2 Collect the terms in 13o*3 + 450 - 450 + 487o*3. 500o*3 Collect the terms in 2j*2 + 23 + 17j - 17j + 0j. 2j2 + 23 Collect the terms in 8950d + d*2 - 17891d + 8941d - 2d2. -d2 Collect the terms in 22l3 - 47l*3 + 32l*3 + 40l*3. 47l*3 Collect the terms in 130g*2 + 9g*2 + 69g*2. 208g*2 Collect the terms in 2819b + 2313b + 697b - 417b. 5412b Collect the terms in -3 + 3 + 4 - 123s - 4. -123s Collect the terms in 36h - 6h*2 + 55h - 91h. -6h*2 Collect the terms in 1042364354 - 1042364354 + 17k*2. 17k*2 Collect the terms in 130 - 3a - a + 4a - 8a + 6a. -2a + 130 Collect the terms in 525 - 115w - 525 - 98w. -213w Collect the terms in 17u + 74u3 + 2 - 17u. 74u3 + 2 Collect the terms in -128a*3 - 142a*3 + 273a*3. 3a*3 Collect the terms in 3m2 - m3 - 2m3 + m2 - 4m*2. -3m*3 Collect the terms in 117x*2 - x + 101x*2 + 180x*2. 398x*2 - x Collect the terms in -50457 + 29j*2 - 7j*2 + 50457. 22j*2 Collect the terms in 22 + 8k*3 - 20k*3 + 31 - 53. -12k*3 Collect the terms in -6 - 35a*2 - a + 16a*2 - 21a*2 - 16. -40a*2 - a - 22 Collect the terms in 247x - 556x - 13x*2 + 310x + 47x2. 34x*2 + x Collect the terms in 44r*3 + 246r*3 + 2602r*2 - 5204r*2 + 2602r*2. 290r*3 Collect the terms in 4u*3 - 21097914u + 21097914u. 4u*3 Collect the terms in 2759i + 2756i - 10990i + 2752i + 2725i. 2i Collect the terms in 68y*3 - 44y*3 - 125y*3 - 70y*3. -171y*3 Collect the terms in -119w - 540w + 31w - 363w. -991w Collect the terms in 2r2 + 128 - 91r*3 - 2r*2 - 128. -91r*3 Collect the terms in 9g + 22g + 5g - 47g + g + 15g. 5g Collect the terms in -307255 + 307255 + 197o*3. 197o*3 Collect the terms in -3j*3 + 101903 + 6j*2 - 203805 - 5j*2 + 101902. -3j3 + j2 Collect the terms in -v*3 + 3v*3 - 4v*3 + 19v*3. 17v*3 Collect the terms in -3r*3 + 4r - 4r + 5r*3 + 4r*3 + 5r. 6r3 + 5r Collect the terms in 588t + 546t - 1143t. -9t Collect the terms in 44b3 - 20b*3 - 36b*3. -12b*3 Collect the terms in -115 + 43 + 72 + 10c*2. 10c*2 Collect the terms in -47q*3 - 551152 + 551152 + 43q*3. -4q*3 Collect the terms in -30507s + 15249s + 15246s. -12s Collect the terms in -101g*3 - 111g*3 + 517g*3 - 105g*3 - 109g*3 - 107g*3. -16g*3 Collect the terms in -26c + 54c3 + 26c - 67c3. -13c*3 Collect the terms in 4 - 13 + 20 + 14 - 9g*2. -9g*2 + 25 Collect the terms in 1535c - 808c + 356c + 1390c. 2473c Collect the terms in 16871 - o*2 - 2756o - 16871 + 2756o. -o2 Collect the terms in 0 + 26v*2 - 28v*2 - 3. -2v*2 - 3 Collect the terms in 1145s - 621s - 501s. 23s Collect the terms in 2519 - 1253 - 1266 + 9n*2. 9n*2 Collect the terms in -4 + 1 + 0 - 2 - 6a*3 - 8a*3. -14a*3 - 5 Collect the terms in -5u2 - u2 + 5u2 + 24u - 4u2 + 3u*2. -2u*2 + 24u Collect the terms in -40w + 6w - 63w - 4w + 2. -101w + 2 Collect the terms in -313f + 166f + 49f*2 + 151f. 49f2 + 4f Collect the terms in -9x2 - 15x - 12x2 + 18x*2 - 4x*2 + 15x. -7x2 Collect the terms in -5v - 896v2 + 1792v*2 - 9v*3 - 895v*2. -9v3 + v2 - 5v Collect the terms in -5 + 6 + 0 + 13x. 13x + 1 Collect the terms in -18z*2 - 39820z + 39820z. -18z*2 Collect the terms in 1 + 802b*3 + 3b - 592b3 - 3b. 210b3 + 1 Collect the terms in -3 + 843349c*2 + 3. 843349c*2 Collect the terms in -5 + 12s + 17s + 1 - 3s. 26s - 4 Collect the terms in -4255n*2 + 2122n*2 + 2127n*2. -6n*2 Collect the terms in -4 - 7422c*2 - 7423c*2 + 14837c*2. -8c*2 - 4 Collect the terms in 359y*2 - 201y*3 - 741y*2 + 382y*2. -201y*3 Collect the terms in 111 - 480 + 111 + 148 + 54m*3 + 110. 54m*3 Collect the terms in -16025l*2 + 16039l*2 - 15 + 15. 14l*2 Collect the terms in -29o - 2 + 15o + 3 + 16o - 7155o2. -7155o*2 + 2o + 1 Collect the terms in -3m2 + 6799 - 6805 + m2. -2m*2 - 6 Collect the terms in 533z + 21z3 + 265z - 252z - z3. 20z*3 + 546z Collect the terms in -5q2 - q2 - 409 + 59 + 2q*2. -4q*2 - 350 Collect the terms in -87617d*3 + 175219d*3 - 87593d*3. 9d*3 Collect the terms in 31 - 91 + 28 + 2b + 32 - 2b3. -2b*3 + 2b Collect the terms in 381099746 - 381099746 + 8f2. 8f*2 Collect the terms in -12z - 3539z3 + 19z - 7z. -3539z*3 Collect the terms in 67x + 51x - 49x + 68x + 141x. 278x Collect the terms in -p + 96222 - 96222 - 129p*3 + p. -129p*3 Collect the terms in 47315951i - 20i3 - 47315951i. -20i3 Collect the terms in 11 + 13 + 9 + 5w + 0w + 0. 5w + 33 Collect the terms in 3r2 - 1922 + 3904 + 0r*2 - 1982. 3r*2 Collect the terms in -12c*2 - 5c*3 + 17c*2 - 3c*2. -5c*3 + 2c**2 Collect the te	{ "pile_set_name": "DM Mathematics" }
= 5r2 + 2r - 3. Let i(w) = -11w2 - 3w + 7. Let a(z) = -9g(z) - 4i(z). What is a(-7)? -8 Let f(v) = -v + 1. Suppose -4g + 125 = g. Suppose 2 = -3x - g. Let z be 6/9 + 33/x. Calculate f(z). 4 Let m(g) = -g. Let k(y) = -y + 3. Let l(s) = -k(s) + 5m(s). Determine l(-7). 25 Let v be (-4)/6 + (-25)/(-15). Let q(m) = 6m + 7 - v - 5m2 + 6m*2. Determine q(-6). 6 Let o(w) be the third derivative of 0w - w*3 + 0 + 1/4w*4 - 1/60w*5 - 3w*2. Determine o(4). 2 Let k(c) = 2c + 3. Suppose -3s - d = 9, -2s - 8d + 4d = 16. Calculate k(s). -1 Let n(y) be the first derivative of 2y3/3 + 1. Suppose 3 + 11 = -7j. Give n(j). 8 Let a = 15 - 16. Suppose 3c = -4z + 29, 8 = 5z - 3c - 35. Let m(g) = 3 - 3g3 + g2 - 4 + zg*3. Calculate m(a). -5 Let t be 0/31/3. Let l(v) = t + 0 + 10v. Calculate l(-1). -10 Let g = 6 - 7. Let h(t) = 13t2 - t. Determine h(g). 14 Let q(k) = -4 + 6 - k2 + 1 + 2 + k. Let l be 2/(-4)(3 - 3). Give q(l). 5 Suppose 8 = -p - 3z, 5p = -0p + 4z + 36. Let n(q) = 4q + 0q + q - 1 - pq. What is n(-1)? -2 Let i = -26 + 16. Let h be (i/6)/(6/(-18)). Let l(n) = -n + 4. Determine l(h). -1 Let y(p) = -p*3 + 7p*2 + 8p + 2. Suppose 0h + 3w + 17 = 4h, -4w - 12 = -4h. What is y(h)? 2 Suppose 8j - 5j - 3k = 6, 0 = 5k + 10. Let o(l) = -l2 - l + 4. Calculate o(j). 4 Let p(v) = -v3 - 7v*2 + 7v - 8. Let y be p(-8). Suppose 0 = 5j + 3k - 6, 3j - k = 3k + 21. Let x(r) = -r + 3 + 0r + 2rj - r3 + 0r. What is x(y)? 3 Let s(u) = u2 + 5u + 5. Let w(y) = -2y2 - 7y - 7. Let o(h) = 7s(h) + 5w(h). Determine o(1). -3 Suppose -4f + 1 - 10 = -3g, 2f + 12 = 4g. Suppose 4h + gk = -9, 0h - 3 = 5h + k. Let y(u) = 2 + h + 2u - 2. Calculate y(4). 8 Suppose -5z + 4v + 45 = -0v, -4z = -2v - 30. Let q(a) = a*3 - 6a*2 + 4a - 3. Give q(z). -8 Suppose 270 = -9d + 4d. Let l be d/(-10) - 2/5. Let r(s) = -s*3 + 5s2 - 7. Give r(l). -7 Let q(k) = -k2 - 2k - 2. Let a be (-5)/5 + 3/1. Suppose 2r - 4 = a. Suppose d + r = -0d. Calculate q(d). -5 Let b(k) = -k - 3k + 5k - k2. Suppose 0 = -5o + x + 10, -4x - 8 = 3o + 9. Suppose 4h - o = a - 0, -3h - 6 = -3a. Give b(a). -6 Suppose 0r + 4r = 0. Suppose r = -2f + 3f - 1. Let d(t) be the first derivative of t4/4 - t2/2 + t - 1. Determine d(f). 1 Let m(v) = 2v + 1. Let w be 49/1416/14. Suppose wh = -17 + 5. Give m(h). -5 Let u be (-1)/22-1. Let w(v) = -3v3 + 4v*3 - 6v*2 - u + 6v - 7v. Determine w(6). -7 Let c(i) = 175i - 352i + 175i. What is c(-3)? 6 Let k(l) = l*2 - l - 5. Suppose -3t - 1 = -f, -2t - t - 3f = -3. Let d be 2 + t + 0 + 2. Calculate k(d). 7 Suppose 112s + 6 = 114s. Let c(m) = -2m2 + 5m - 4. Determine c(s). -7 Let a(o) = o*3 - 12o*2 - 2o - 5. Let i(v) = -2v3 + 25v*2 + 4v + 10. Let g(z) = 13a(z) + 6i(z). Give g(6). -17 Let r(i) = i + 2. Suppose 2l - 2n - 2 = -0l, 5l = 2n + 14. Suppose -v + lh = 7, h = -2v + 2 + 11. Suppose -y + 0 - 1 = -vc, -1 = y - 2c. What is r(y)? 1 Let u(x) = -x2 - 1. Let t(z) = -4z*2 + 0 + 0z2 + z2 - 2z + 2. Let n(h) = -t(h) + 2u(h). Calculate n(3). 11 Let j(u) = -14u - 29. Let s(m) be the second derivative of 5m*3/6 + 5m*2 + 3m. Let a(b) = -6j(b) - 17s(b). Calculate a(3). 1 Let f(d) = -d*3 - 7d*2 - d - 8. Let y be f(-7). Let c(l) = 6l*2 - 1. Calculate c(y). 5 Let y(i) be the second derivative of 3i5/20 - i4/4 - 2i2 - i. Let m(n) = -13n*3 + 12n*2 - n + 16. Let w(r) = 2m(r) + 9y(r). Determine w(4). 4 Let f(o) be the third derivative of -o6/120 + 3o*5/20 - 3o*4/8 + 5o3/6 + o2. Suppose -4t + 273 = 241. Calculate f(t). -3 Let o(q) = q3 - 7q2 + q - 7. Let h be o(7). Suppose r - 4 + 1 = h. Let f(t) be the third derivative of -t5/60 + t4/6 - t3/3 + t*2. Give f(r). 1 Let j(f) = 3f*3 - 3f2 - 1. Let y(t) = -t2 + 2 + 7t3 + 2t*2 - 4 - t - 6t*2. Let d(m) = -5j(m) + 2y(m). Determine d(5). -9 Let j = 3 + -1. Let s(v) = -28v + v*j - 2 + 28v. Determine s(-2). 2 Let y(v) = v*2 + 5v - 1. Suppose 2r - 2k - 1 = 1, 2r - 14 = -2k. Suppose rq + 8 = -4h, q - 5h = 26 + 2. Let s be (2/q)/(6/(-54)). What is y(s)? 5 Let l(v) be the first derivative of -v5/20 - v4/4 + v3/2 + v2/2 + 6v + 1. Let i(n) be the first derivative of l(n). Give i(-4). 5 Let f(m) = 5m3 - 18m*2 - 9m + 11. Let a(w) = -3w3 + 12w*2 + 6w - 7. Let j(x) = -8a(x) - 5f(x). What is j(-5)? -9 Let f(y) = -y*2 + 10y - 4. Suppose -2h - 14 = -3u, 4u - 30 + 6 = 4h. Let p(z) = z - 1. Let r(x) = hp(x) + f(x). What is r(5)? 5 Let j = -19 + 21. Let v be (4 - 3) + (-3)/(-1). Let p(y) = -y3 + 3y*2 - 2 - vy*2 + 3. Determine p(j). -11 Let q = -22 - -47. Suppose 0 = -5o + n - 0n + 5, 2o + 5n + q = 0. Let h(m) = -18m - 4 - 16m + 43m - 10m. Calculate h(o). -4 Let s = 0 - 6. Let k(l) = 5l - 4. Let h(d) = d - 1. Let i(m) = 9h(m) - 2k(m). Give i(s). 5 Let s(l) = -3l2 + 7l - 5. Let x(t) be the third derivative of t5/60 - t4/8 + t*3/2 + 5t*2. Let o(b) = 2s(b) + 5x(b). Give o(0). 5 Suppose c = -h + 3, -5h + 0c = 2c - 18. Let d(i) = -7i2 - 1. Let a(u) = 6u*2 - u + 1. Let z(g) = -6a(g) - 5d(g). Determine z(h). 7 Let c(s) be the first derivative of 5s*2/2 + s - 1. Suppose 5o = 20, -3o = 4w - 18 + 2. What is c(w)? 6 Let j(k) = -k*2 - 2k + 1. Let i(n) = -3n - 14. Let f be i(-5). What is j(f)? -2 Let y(x) be the second derivative of -x6/120 + x5/30 + x4/24 + x3/6 + 5x*2/2 - 5x. Let r(s) be the first derivative of y(s). What is r(2)? 3 Let m = 4 - 2. Let k(j) = m + 2j + j2 - 1 - 4j. Calculate k(2). 1 Let x(f) = -3f + 3. Suppose 4u + 2d + 16 = 0, 3u + 10 = -4d - 12. Let b = 2 - u. Determine x(b). -9 Let n(x) be the first derivative of -x3/3 - 3x2/2 - 3. Let u be n(-4). Let y(h) = h + 8. Determine y(u). 4 Let y(m) = m3 - 5m2 + 6m - 3. Let f = -24 + 35. Suppose 0 = 3g - 1 - f. Suppose -4x + 16 = 0, -2x - 12 = -l - gx. What is y(l)? 5 Suppose -1 = f - x, 2x + 2 = -5f + 25. Let n(j) = -fj - 4 + j + j + 0j. Let a(p) = 3p + 1. Let o be a(-2). What is n(o)? 1 Let c be 6/(-4) - 28/(-8). Suppose -3z = 3x - 6, -3x = -7z + cz + 18. Suppose zd - 2 = d. Let r(a) = -6a + 1. Determine r(d). -5 Let s(k) = -2k3 - 2k*2 + 2k + 6. Let l(d) = 2d3 + 2d*2 - 2d - 5. Let c(v) = -7l(v) - 6s(v). Calculate c(1). -3 Let m(j) = 5j2 - 5j + 9. Let w(f) = -2f2 + 3f - 4. Let p(k) = 3m(k) + 7w(k). Calculate p(-6). -1 Let z(k) = k*3 + 3k*2 + 2k. Let d(y) = 8y - 3. Let t be d(3). Suppose -3s - 3 = t. Let h be ((-3)/4)/((-2)/s). Determine z(h). -6 Let h(c) = -2c3 + 4 + 14 - 10 + 12c2 + c3 - 12c. What is h(11)? -3 Let p(j) = 3j + 5. Let q(f) = 7f + 13. Let a(g) = -5p(g) + 2q(g). Calculate a(6). -5 Let t(r) = -r + 10. Let p = -11 - -11. Determine t(p). 10 Let j be -1(-4 + 3) - 4. Let c(l) = -6l2 - 6l + 4. Let m(b) = 9b2 + 9b - 6. Let o(y) = -7c(y) - 5m(y). Calculate o(j). -16 Let k = -10 - -5. Let p(c) = c*3 + 13c*2 + 11c - 10. Let h(q) = q*3 + 12q*2 + 10q - 9. Let u(x) = 7h(x) - 6p(x). Give u(k). 2 Let o(n) = n - 1. Let z be o(2). Let g(y) = 1 - 14y + 15y + z + y*2. What is g(-3)? 8 Let k(r) = -4 - r + 3r - 4r2 + 8r*3 - 1. Let j(x) = -15x*3 + 7x*2 - 4x + 9. Let m(n) = -6j(n) - 11k(n). Let w = -9 + 8. What is m(w)? -1 Let c(g) = g*3 - 6g*2 + 2g - 4. Let i be 1/4 - 10/40. Suppose iq - 12 = -2q. Determine c(q). 8 Let c(a) = -a*3 + 4a*2 - 5a + 4. Let x be (-42)/(-28) - (-3)/2. Determine c(x). -2 Suppose -2k - 5i = -k + 13, 4k - 4i + 4 = 0. Let b(z) = -z*3 - 2z*2 + 4z - 1. Give b(k). -4 Let r(x) = -x*3 - 2x*2 - 4x + 1. Suppose 5q - 5 = 5o + 5, 2q = 4o + 10. Let p(m) = m3 + m2 + 3m - 1. Let b(j) = or(j) - 4p(j). Give b(2). 1 Let i(j) = j3 + 3 - 4 - j + 1. Let s(z) = z3 - z2 - 2z + 2. Let a be s(2). Give i(a). 6 Suppose 3 = -i - 1. Let w(a) = 3a2 - a2 - 10 + 3a + 14 - a2. Calculate w(i). 8 Let o(i) = i2 + 5i - 2. Let j(f) = -5f + 6 + f*3 + 5f + 2f2 - 10. Let r be j(-2). Give o(r). -6 Let n = -1 + 4. Let q(h) = 5h - 9. Let v(s) = -s + 2. Let x(u) = u - 5. Let t be x(-4). Let w(d) = tv(d) - 2q(d). Calculate w(n). -3 Let w(y)	{ "pile_set_name": "DM Mathematics" }
1685c2 + 2c*3 - 2 - 3c*4 - 1686c*2 + 3375c*2 as z + jc*2 + kc*3 + nc + ic4 and give i. -3 Rearrange ((w - 3w + 4w)(-5 + 0 - 1) + 5w + 0w - 3w)(2 - 2 + 2w)(16w + 0 - 4w - 3) to the form cw3 + tw*2 + q + lw and give t. 60 Express (-3 + 4 + 1 - j*2)(-j - 6j + 12j)(357 + 17j - 177 - 177) in the form yj3 + p + aj*2 + dj*4 + zj and give y. -15 Express -485a + a3 + 285a + 4 + 250a + 1 in the form ma*2 + n + ha*3 + ua and give m. 0 Rearrange -119 + 163 - 44 + 27445z to rz + i and give r. 27445 Express -1181a - 1185a + 623a - 566a - 778a as y + la and give l. -3087 Express (44m2 - 148m*2 - 102m*2 + (0 + 0 - 3m)(2m + 0m + 0m))(11m - 11m + 4m*2) as rm*4 + um*2 + g + xm + hm3 and give r. -848 Express 3w + 6 - 3w2 - 2w*2 - 6w*3 + 0w*2 - 3w*2 - 4 as uw + iw2 + x + mw*3 and give x. 2 Rearrange (5 - 2 - 4)(3167p + 3137p - 4925p) + (-3p - 3p + 4p)(0 - 1 - 1) to the form j + np and give n. -1375 Express -417l - 178l - 22l + 27l - 409l as p + zl and give z. -999 Express ((-3 - 3 + 5)(-5 + 3 + 3) + 6 - 1 - 1)(4 - 4 - 2w) + (449w + 696w - 156w)(2 + 4 - 5) as s + mw and give m. 983 Express 3t3 + 29t - 4t2 - 36151 + 72304 - 36151 in the form ht*2 + p + qt*3 + ct and give p. 2 Express (-4g + 3g + 2g)(-5 - 4 + 4) + 154 + 14g - 154 - 1 + 1 - g + (-2 + 1 + 0)(-4g + 0g + 2g) + 327 + 56g - 327 in the form kg + n and give k. 66 Express -7 - 2835 - 2p + 3p + 232 in the form sp + d and give s. 1 Rearrange (-4 + 2 + 7)(7 - 7 + b + (1 + 4 - 3)(-b - 2b + b))(-190 - 91 + 400) to w + yb and give y. -1785 Express (2j - 3j + 2j)(3j*3 - 711j + 218j + 515j) in the form wj + yj*2 + vj*4 + sj*3 + i and give v. 3 Express (-26s*2 + 24s*2 - 25s*2)(-12 - 6 + 3)(5s + 3s - 3s) in the form js2 + m + ks*3 + qs and give j. 0 Rearrange 57g - 20g - 452g2 + 19g + 473g2 to jg + c + bg2 and give b. 21 Express -394g*2 - 1 + 859g*2 - 462g*2 - 25g as xg + qg*2 + f and give x. -25 Express (-4p*2 + 4p2 + p3)(p - 3p + 0p) + 41p*4 + 414p*3 - 411p*3 + 81p*4 in the form zp*2 + dp*3 + tp + h + yp4 and give d. 3 Express 2379852 + 35593i - 2379852 in the form s + ji and give j. 35593 Rearrange (-81r + 315 - 315)(2 - 12 - 5) to the form wr + f and give w. 1215 Express (-h*2 + 3h2 - h2)(-36h + 20h - 52h + (1 - 1 - 3h)(-1 + 2 + 1) + 2h + 4 - 4 + 12h - 5h + 14h) as ah3 + sh + uh2 + p and give a. -51 Express 2i - 3i - 2i + (1 + 0 - 3)(-15 + 13i + 15) - 6i - 2 + 10i - 2i in the form x + yi and give y. -27 Express 2x2 + x2 - 5x*2 + (4x - x - 5x)(11x + 12x - 10x) + (3x*2 + 0 + 0)(1 - 8 + 6) in the form b + ox + gx*2 and give g. -31 Express -2y*2 - 10y*3 + 26y*3 - 12y*3 + 0y*3 + 1882y - 6y3 in the form t + iy*3 + ry + uy2 and give r. 1882 Rearrange (171t + 1195t + 229t + (0 - 4 + 3)(-4t + 4 - 4))(3t*2 - 4t*2 + 2t*2) to b + jt*2 + dt + ct3 and give c. 1599 Express (-14 + 4u*2 + 14)(-12u + 684u + 382u - 48u)(4 + 1 - 2)(5u - 3u + 0u) as qu*4 + b + ju*3 + vu + au2 and give q. 24144 Express 32 - 798r*2 + 19 + 25 - 76 as or*2 + d + br and give o. -798 Rearrange 83 + v + 291v2 + 284v*2 + 283v*2 + 2v*3 - 1149v*2 + 286v*2 to the form ov*3 + n + lv + mv2 and give l. 1 Rearrange -14z*2 + 185z + 10z2 - 294z*2 - 1 - 184z to the form xz + tz*2 + s and give t. -298 Express 1 + 3419p*2 + 2334p*2 + 4 - 3 - 7228p*2 in the form zp*2 + wp + l and give l. 2 Express (-2z + 3z*3 + 2z)(z + 2z - 2z) + 14165z + 11z4 - 14165z + 103 in the form dz + hz*4 + cz*3 + oz*2 + q and give h. 14 Express 0x + 2x + 0x + (0 + 4 - 5)(x - 2 + 2) + 210x - 24x + 298x as yx + l and give y. 485 Rearrange (-5o*3 + 5o3 + o4)(-93 + 259 + 98 + 347)(-2 - 4 + 4) to the form so + po*4 + ko*2 + mo*3 + q and give p. -1222 Express (-28 - 8j + 28)(-8 + j + 8 + (-2 - 2 + 6)(j - 3j + 0j) + (-1 + 1 - 2j)(-1 - 1 + 4) - 4 + 4 - 4j) in the form dj*2 + m + xj and give m. 0 Rearrange -3m - 4m + 130 - 19m2 - 132 + 3m + m to the form v + xm2 + hm and give x. -19 Express 3h3 + 2h*3 - 2h3 + (h3 - 2 + 2)(1 + 0 + 2 + (-1 + 1 - 1)(-1 - 1 + 1) + 180 + 131 - 347 - 1 + 4 - 4) as rh3 + qh + xh2 + n and give r. -30 Express q + 1054 - 564 + 1150 + 793 + 497 as w + cq and give w. 2930 Express -1 - 1 - 46j3 + 8j4 + j2 - 7j - 10j - 9j + 25j as xj3 + ij*4 + tj*2 + w + aj and give i. 8 Rearrange (63p - 103p - 341 + 41p)(2p2 - 7p*2 + 2p*2) + (6p*2 - 4p*2 - 3p*2)(2 - 2 - p) to wp + vp*3 + fp*2 + g and give f. 1023 Rearrange (4t - t + 0t)(6 - 3 - 1) - 159t - 361 - 90t + 251t to z + ot and give z. -361 Rearrange 593086u + 3u*3 - 296528u - 9u2 - u4 - 296546u to the form iu + yu*2 + ju*3 + f + hu*4 and give i. 12 Rearrange -27f*2 + 2258 - 4080 + 2039 to the form cf*2 + i + af and give c. -27 Express (p*2 - 7 + 7)(50 - 21 + 111 + 156)(9p + 5p - 2p) as up + g + np*2 + xp*3 and give x. 3552 Rearrange 0b*2 + 221b*2 + 0b*2 + (-2 - 2 + 11)(-2b2 + 3 - 3) + 4b*2 - 2b*2 + 2b - 3b2 to the form qb*2 + i + cb and give q. 206 Rearrange -287 - 6n3 + 287 + 979n - 9n3 to the form hn*3 + on + pn2 + s and give o. 979 Rearrange -71p*2 + 9 + 1842p - 3685p + 1842p to the form t + kp2 + yp and give k. -71 Express (-1 - 3 + 3)(-m - m + 4m)(0 + 0 - 2m*3)(-126 + 1893 + 1126)(1 + 0 - 3) as dm*3 + hm*4 + ym*2 + w + om and give h. -23144 Rearrange (-1773 + 2236 - 6601 - 6029 - 6256)(-4f*4 + 2f4 - f4) to pf4 + qf*2 + b + if + mf3 and give b. 0 Express 329b - 104b - 92b - 118b - 17b*2 as d + vb + rb2 and give r. -17 Rearrange (-3 + 5o + 3 + (-2 - 1 + 1)(-113o - 58o + 75o))(-3 + 4 + 5 + (-6 + 3 + 1)(3 - 3 - 2) + 1 - 5 + 2) to yo + t and give y. 1576 Express (-1 + 1 + w)(-303w - 4650w - 2265w) in the form iw + u + sw2 and give s. -7218 Rearrange -254r - 69r3 + 68r*3 + 321r + 2 to the form kr2 + a + fr*3 + qr and give a. 2 Express -d*4 - d + 438d*3 + 23 - 442d*3 - 5d*2 - 28 as a + kd*3 + xd*2 + md + pd4 and give m. -1 Express -45q*2 - 1374296q + 1374296q + (-4q + 2q - q)(q - 4q + 2q) as p + xq + fq*2 and give f. -42 Rearrange -24i*2 + 51i*2 - 12i*2 + (103 - 28 - 41)((-i + 0i - 4i)(-2i + 2i - 2i) + 3i2 + 0i2 - i2) to the form li2 + c + ji and give l. 423 Rearrange (0 + 0 + 2a)(3a - a - a + (11a - 2a + 0a)(-2 - 6 + 3)) - a2 + 0a*2 + 6a*2 to qa + h + ta2 and give t. -83 Express -126c + 187c - 6 + 70c*2 - 29 - 61c in the form z + oc + ic*2 and give o. 0 Rearrange 6461t*2 - 274140 + 274140 + 2t*3 to mt*2 + r + xt*3 + yt and give r. 0 Rearrange (-3r2 + 5r*2 + 4r*2)((-8 - 4 - 18)(r + 0r + 2r) + 2r - 2r - 2r) to yr + ur*2 + q + vr*3 and give v. -552 Rearrange ((6 - 3 - 4)(3 + 3 - 4) - 1 + 0 + 0 + (-4 + 1 + 1)(2 - 1 + 0))(-4x + 4x - x)(35 - 102 + 31)(-1 - 1 + 0) to o + ix and give i. 360 Express (-5 + 4 - 5)(95 - 9 + 61)((-1 + 2 + 2)(1 - p - 1) + 0p + 2p - p) in the form g + xp and give g. 0 Rearrange 9b*4 - 317b + 2 + 166b + 8b*2 - 9b*2 - 2b*4 + 189b - 2b3 to the form o + ub*2 + xb*3 + vb + rb4 and give u. -1 Rearrange 0a - 5a2 - 231a*3 + 21a*2 + 34a*3 - 46a*3 - a to the form oa*3 + ra*2 + ba + w and give b. -1 Rearrange (510b - 36 + 11 + 26)((-b + 2b + 0b)(3 - 5 - 1) + 5b + 0b - b) to the form h + db + nb2 and give d. 1 Express -f2 - 41f*3 + 1051f - 1630f + 578f in the form zf + k + jf*3 + xf*2 and give z. -1 Express -527l + 11 + 527l + 49l*3 - 24l*3 + 81l*3 in the form ql + rl3 + x + gl*2 and give x. 11 Express 844x + 1862x - 288x + 1164x in the form rx + u and give r. 3582 Rearrange 91 + i*2 + 70i*3 - 67i*3 - 676 - 3i*2 + 3i*2 to the form xi*3 + yi*2 + ti + r and give r. -585 Express (4n3 + 3n - 4n3 + 2n*3)(1368 + 17777 + 3765 + 3965) as mn*3 +	{ "pile_set_name": "DM Mathematics" }
gf + 10 = 14 for f. -2 Let h be (80/(-60))/(2 - (-12)/(-9)). Let u be (5 - h) + 5 + (-8)/2. Suppose 0 = 3d - 0d. Solve d = 4m + 8 + u for m. -4 Let u be (528/22)/8 - 28/(-4 - -2). Solve -27p + u = -91 for p. 4 Suppose n = 5, 22n = 4g + 25n - 107. Solve -gj + 2 = -21 for j. 1 Let h(k) be the first derivative of -3k*2 - 3k + 29. Let y be h(-1). Suppose ym - 2m - 2 = -4w, -2w = -m + 2. Solve w = -3z - 1 + 13 for z. 4 Let w = -264 - -278. Suppose -u + 24 = w. Solve 9 = -k + uk for k. 1 Suppose 5z - 3m - 48 = -0m, -z - m + 16 = 0. Suppose -4c + 6a + 101 = 59, -c + 4a = -28. Solve c = -10g + zg for g. 0 Let s(n) = -2n2 - 95n + 706. Let m be s(-54). Let t be (0 + 0)/(0 + -3). Let k(h) = -h*2 + h + 16. Let u be k(t). Solve 0 = mj + u + 4 for j. -5 Let u(f) = -f*3 - 20f*2 + 46f + 2. Let b be u(-22). Let c be 541/(-7) + (-12)/b. Let a = c - -81. Solve -21 = am - 1 for m. -5 Let d = 29 + -20. Suppose -3r = 3c - d, -r + 5c + 0 = -3. Suppose rw + a = 13, -a = w - 3 - 4. Solve -2g = wg - 15 for g. 3 Let n = -8056 - -8061. Solve -no = 32o + 222 for o. -6 Suppose 23y - 159 = -67. Suppose 55 - 67 = -ym. Solve -4c + m = -9 for c. 3 Suppose t - 24j + 30j = 15, -26 = -3t + j. Solve -t = -14p - 23 for p. -1 Suppose -50n + 129 = -21. Suppose -3a - 3w = -3, -10 = a - 4w - 26. Solve -u - nu = -a for u. 1 Suppose -15 = -0c + 3c + 3m, 4c = m. Let l(t) = 38t + 42. Let f be l(c). Solve -19 + f = -3x for x. 5 Suppose -4y + 3y + 1145 = 5g, -687 = -3g - 3y. Suppose -26 = -15d + g. Solve 13 = -6t - d for t. -5 Let o be (4 - (-10)/(-5)) + 0 + -3. Let c(n) = -1. Let j(r) = 3r + 17. Let i(w) = oj(w) - 4c(w). Let p be i(-5). Solve -2l - p + 8 = 0 for l. 3 Let k(w) = w*2 + 136w + 1614. Let n be k(-13). Solve 20 = -nr + 95 for r. 5 Suppose 0 = -7j + 4j + 417. Let p = j - 137. Solve -p + 0 = -2m for m. 1 Suppose 10t + 129 = 139. Let k(w) = 17w*2 - 3w + 2. Let s be k(t). Solve -3r + s - 4 = 0 for r. 4 Let h be (3/(-3))/(2/(-4)). Let p be 1 + (21 - 10 - (4 - -4)). Suppose 0 = -3o - pb - 6, -5o = -4o - hb - 8. Solve -2y = oy for y. 0 Suppose 3t + 6 = 2t. Let n be 4/t(-3)/(1/(-1)). Let k be 48/9 + n + 8/12. Solve 2o - 6 = ko for o. -3 Let h(k) = 25k*3 - 71k*2 + 10k - 37. Let w be h(3). Solve 2m = -37 + w for m. -4 Suppose -17n + 219 = 32. Solve 0 = -na - 38 + 16 for a. -2 Let w(h) = -h3 - 3h*2 + 9h + 22. Let i(r) = -r3 + r2 - r + 2. Let z be i(2). Let c be w(z). Let x = -44 + 50. Solve 2 = -ck - x for k. -4 Let o(t) = 3t. Let i be o(1). Let m(z) = -3z3 - 9z - 10 + z*2 + 2z*3 - i + 11z*2. Let u be m(11). Solve 3j + 3 = u for j. 2 Suppose -4v - 2u = -226, -2v - 6u + 2u + 116 = 0. Let y = -49 + v. Suppose d = -j + 2, 3j + 2 = yj + d. Solve -3m - 2m - 20 = j for m. -4 Let t(x) = -2x*3 - 16x*2 + 2x - 126. Let q be t(-9). Solve -18 = -9d + q for d. 4 Suppose -2r = 5b - r - 85, b = 3r + 17. Suppose -25a = -24a - 8. Suppose 3l = -2j + 14, -3j + 3l = -aj + b. Solve -9 - j = 5v for v. -2 Let p(b) = b*3 + 18b*2 + 17b + 2. Let v be -11 - 7/(14/(-6)). Let r(n) = -n*2 - 8n - 17. Let a be r(v). Let j be p(a). Solve 0 = -jy - 0y + 8 for y. 4 Let q = 183 - 153. Suppose -20k + q = -14k. Solve 0 = -c + 1 - k for c. -4 Let y be (24/(4 + -8))/(8 + -10). Let s be 2(-1)/(3 - 1). Let z = 7 + s. Solve -y = -t - z for t. -3 Let f = 317 - 88. Let c = f - 226. Solve 0 = -ci - 19 + 25 for i. 2 Suppose -f - 10 = -0f + 5w, 4f - 2w - 26 = 0. Suppose -95 = fz + 100. Let o = 42 + z. Solve -5i - 7 = o for i. -2 Let u(v) = -19v - 99. Let m be u(-22). Suppose 10o + 69 = m. Solve o = -8z - 7 for z. -4 Let i(r) = -r3 - 8r*2 + 4r + 5. Let q be i(-7). Let m = q + 76. Suppose a = 3w + m, -5w + 6 + 2 = 2a. Solve -2u = -wu for u. 0 Let t(l) = 3l*3 + 10l*2 + 2l. Let z be t(-3). Suppose 5q = -zb - 0 + 2, 4b = -4. Solve -h + 0h = -q for h. 1 Let q be 6 - (-13 - 5)/(-6). Solve -qd + 2d + 13d = 0 for d. 0 Suppose 2i - 3 - 7 = 0. Let a(r) = 30r2 - r + 1. Let p be a(1). Suppose -10 - p = -4l. Solve -3g + l = -ig for g. -5 Let v be -5(6 - 5) + 6. Let p be 4 + (7 - 5)v. Suppose -4m = -2 - p. Solve -mf + 6f = 12 for f. 3 Suppose 82a - 22080 = 2a. Solve -273i = -ai + 6 for i. 2 Let w be 215/12900/(1/(-1)). Solve w = 22b - 4b + 36 for b. -2 Suppose 103z = -994 + 994. Let f(r) = 6r. Let v be f(2). Suppose k = -k + v. Solve zb - 3b = -k for b. 2 Let j(v) = 11v3 + 56v*2 - 18v - 12. Let b be j(-7). Let a = -909 - b. Solve -11c = -ac - 4c for c. 0 Suppose 2i = -10j + 5j - 1040, 4i + 638 = -3j. Let m = j - -215. Solve 0 = 5b - mb + 16 for b. 4 Let t be (-45)/(-4) + 39/52. Let v = -8 + 5. Let o = 5 + v. Solve -ob - t = -4 for b. -4 Let d be 1/20 - (-372453)/6540. Solve -20n + dn = -74 for n. -2 Let w = 4718 + -4016. Solve -715r = -wr - 91 for r. 7 Suppose -454 = -5x - 4k, 2 = x - 5k - 112. Solve -40 = 9z - x for z. 6 Let r be ((1/(-2))/(10/(-220)))/1. Let o be (395/(-35) + r)/((-1)/7). Solve oy = -2y + 12 for y. 3 Let o = 277 + -369. Let b = -73 - o. Solve 5z = 4 - b for z. -3 Let r(l) = -7l - 23. Let b be r(-4). Suppose -2x + bj + 13 = -15, -2j + 4 = 3x. Solve -c = xc for c. 0 Suppose 3w + l = 5, 5l - 3 = 2w - 6w. Suppose 629k = 636k - 14. Solve 20 = ki + wi for i. 5 Let h(r) = r - 10. Let q be h(13). Suppose -qx + 3d + 1 = 4, 31 = 4x + 3d. Solve xt - 8 = 2t for t. 4 Let y(j) = j*3 - 2j*2 - 3j + 4. Let d be y(3). Let r(h) = 6h + 5 - 21h + 14h. Let b be r(-10). Solve -b = z + dz for z. -3 Let x(d) = -d*3 - 3d*2 - d - 3. Let r be x(-2). Let k be (r/(-2 + -3))/((-3)/(-9)). Solve -13c - 30 = -kc for c. -3 Suppose -92 = -2q - 3x, -4x = -4q - 2x + 184. Suppose q - 54 = -i. Solve 0 = iw + 14 + 2 for w. -2 Let g be ((-12)/10)/(1/(-10)). Let a = 126 - 128. Let b be (-2 - 2 - a)/(-1). Solve -g = 5v - b for v. -2 Let q be 1/(-1 + 0)-1. Let a be 2 + q(2 - 1). Suppose 67 = -10009c + 10014c - 3z, -3z = c - 53. Solve -au - 8 = -c for u. 4 Suppose 5v = 5x + 860, -v - 70 = 5x - 206. Solve vj = 170j + 16 for j. -4 Suppose 3o + 5o = 64. Let k(u) = -u*3 + 9u*2 - 6u - 16. Let w be k(o). Let b = -36 + 39. Solve -bh = -wh + 15 for h. -5 Let p be 21/(-12)-28. Suppose m = 2x + p, -2 + 5 = -x - 5m. Let o = x - -17. Solve -24 = 4q - o for q. -5 Let u be ((-84)/4 - -12) + 4. Let i(r) = r2 + 2r + 2. Let j be i(-2). Let n be j/(-65)u - 48/(-26). Solve 4 - n = 2g for g. 1 Suppose 456 = 151l - 132l. Solve 19z = -lz + 172 for z. 4 Suppose -428 = -4m - 4v, -256 = -2m + 5v - 56. Solve 0 = -12k - 3k - m for k. -7 Let d be 2/(-10) - (75 + -92)/(5/3). Solve 12n = 2 + d for n. 1 Suppose 1 + 2 = x. Let r be 2/7(1 - (-55)/22). Suppose xz + 0z = h - r, 4z + h - 1 = 0. Solve z = -s + 2s - 2 for s. 2 Let s = 47 - 47. Suppose -o - 14 = -3a - s, 5a + 4o - 12 = 0. Solve -af = 3f for f. 0 Let k(r) = -r3 + 10r*2 + 25r - 27. Let i be k(13). Let m be 22/i + ((-287)/(-19) - -1). Solve m + 4 = -4l for l. -5 Suppose -3q - 4b - 7 = 0, 5q - 7 = -b - 13. Let l be (36/(-108))/(q/18). Solve li = 2i + 20 for i. 5 Let f(i) be the second derivative of -10i3/3 - 93i*2 + 13i + 7. Let u be f(-10). Solve -u + 18 = 2p for p. 2 Let k(m) = -16m*2 - 4m - 1. Let x be k(-2). Let f = -52 - x. Solve fg + 1 = -9 for g. -2 Suppose -10113 - 37432 = -257d. Solve 9a + 28a = d for a. 5 Let g(d) be the third derivative of -5d4/24 + 13d*3/2 + 43d*2. Let b be g(7). Solve -b = x - 1 for x. -3 Let m = 18763 - 18763. Solve -6d + 17d - 44 = m for d. 4 Let l(q) = 2q*3 - 12q*2 + 106q - 739. Let f be l(8). Solve 386d + 105 = fd for d. -5 Suppose 2w + 56 = 3o - 61, -4o - 2w + 156 = 0. Solve -32b + ob - 21 = 0 for b. 3 Let x(g) = -g*2 + 292. Let y be x(17). Solve 0 = yt + 5 - 11 for t. 2 Let u be (-10 - 0)(-905 - -896). Solve -74n - 48 = -un for n. 3 Let w(g) = g - 8. Let x = 35 - 22. Let n be w(x). Suppose 2r - 4o = 18, nr - 3o + 4o = 12. Solve -j - 8 = rj for j. -2 Let w be (-6)/(-10) + (-56)/(-40). Suppose wi - d = -3d, -4d - 27 = -5i. Suppose 2a - 4p - 4 + 2 = 0, 24 = ia + p. Solve -5u + a = 2 for u. 1 Let u(m) = 2m + 16 + 5 - 6 -	{ "pile_set_name": "DM Mathematics" }
Simplify ((d/d*(2/3))/dd)3 assuming d is positive. d Simplify ((r2r)(-4/3))(-47) assuming r is positive. r188 Simplify (mmm2)/(m(-1/12)/mmm)(m(-1/4)/m)(-8/15) assuming m is positive. m(15/4) Simplify (d6/(((d/d(3/7))/d)/d))45 assuming d is positive. d(2340/7) Simplify a(-1/11)aa/a*(-2/15)a assuming a is positive. a*(502/165) Simplify ((gg(-13/4)/g)/g)(-13) assuming g is positive. g*(221/4) Simplify (zz*(-3/14)zz)(-3/34) assuming z is positive. z(-117/476) Simplify (xx*5x)/(x/((((x*1/x)/x)/xxxx)/x)x)x*(2/3)x/((xx/x1)/x) assuming x is positive. x(20/3) Simplify (q(-3/11))(13/7) assuming q is positive. q(-39/77) Simplify (p(-1))(-50) assuming p is positive. p50 Simplify ff/(ff6)fff/(f*(2/29)/f)f assuming f is positive. f*(-2/29) Simplify (vv*(-4))/vvv(3/5)(v*(2/3)/vv)/(v/(v*(-2)v)) assuming v is positive. v(-56/15) Simplify (a(1/4))*(-2/41)(a/(a/(a(a(3/5)/a)/a)))/(a(aa/(a/(a/a5a)a))/a) assuming a is positive. a(1061/410) Simplify n(-12/11)nnn(-11) assuming n is positive. n(-111/11) Simplify (w*(-2/5)w)*(-39)(w(2/5))(1/18) assuming w is positive. w*(-1052/45) Simplify (yy/(yy(-5/3))yyyy(2/15)/yy)/(((y(y/(y/(y/(y6y)))y)/yy)/y)/(((y/(yyy*(-6/7)yy)y)/y)/yy)) assuming y is positive. y(303/35) Simplify (m35m)/m(-3/13) assuming m is positive. m(471/13) Simplify v*(3/11)v(-12/11) assuming v is positive. v(-9/11) Simplify (j*(2/9)j(-1)/j)/((j(-3/7)/j)/(jj/j(-2/11))) assuming j is positive. j(1270/693) Simplify (h/(hhhh2))7 assuming h is positive. h(-28) Simplify (k/((k(1/27)/k)/k))/k7 assuming k is positive. k(-109/27) Simplify ((ii/((i9/i)/iii))/i(ii/(i/(i(-1/15)/ii)))/i)(-17) assuming i is positive. i(2057/15) Simplify (b(2/3))(-3/2) assuming b is positive. 1/b Simplify ((i/(((i(2/11)/i)/i)/i))/i6)(4/9) assuming i is positive. i(-32/33) Simplify d(-5/2)/d(-19) assuming d is positive. d(33/2) Simplify k/k1kk/(k/((k/k*0)/kk))(((k/k(1/4))/kk)/k)9 assuming k is positive. k(-1/4) Simplify (r/((r*2r)/r))*(-16)((r*(3/8)/rr)/r)/(r/r(-3/11)) assuming r is positive. r(1241/88) Simplify l*(2/17)/ll/((l(l/l(3/7))/l)/l)lll(l/l(-4/5))/lll(1/12)l assuming l is positive. l(45907/7140) Simplify (i(-13))(6/17) assuming i is positive. i(-78/17) Simplify (ww(-1)/w)/w(w/w(1/11))/w assuming w is positive. w(-23/11) Simplify c/c*(-1/4)cc(-2/21)c(c/c3)/(c(-6)/c) assuming c is positive. c(685/84) Simplify (hh8)(-2/117) assuming h is positive. h(-2/13) Simplify (g/(g/(g3g)))13/((g/((g8ggg)/g))/(g/(g*(-1/10)/ggg))) assuming g is positive. g(611/10) Simplify ((iii/(i(-1/9)/i)i)/i(-4))/(i0/i)(-10) assuming i is positive. i(-8/9) Simplify ((jj10jj)/(j7j))/(j(j2/j)/jjj)(-3/35) assuming j is positive. j(184/35) Simplify (z8/zz(-8/3))37 assuming z is positive. z(481/3) Simplify ((g(-1)/g)(2/9))(10/19) assuming g is positive. g*(-40/171) Simplify (g(g/(g/g*7))/gg)/g2 assuming g is positive. g6 Simplify ((jj/(j/(j(j(-1/3)/j)/j)))/j)(-37)/((jjj*(1/5)j)/j(-3)) assuming j is positive. j(647/15) Simplify ((((i/i*(2/9))/ii)/i)/i(1/9))14 assuming i is positive. i(-14/3) Simplify (g/g3(g(-1/6)/g)/gg)/((g(-7)/g)/(g/(((g6/g)/g)/g))) assuming g is positive. g(17/6) Simplify o6/oooo(o(o/(o/(o8/o))o)/o)/oo((oo/o(1/4))/o)/oo8 assuming o is positive. o(95/4) Simplify (t6/t(-1/4))(-14) assuming t is positive. t(-175/2) Simplify h(5/4)/(h/(((((h(-4)h)/h)/hh)/h)/h))(h/h(-2))/(h/(hh/((h/(hh5h)h)/h))) assuming h is positive. h(17/4) Simplify j(-1/7)/jj/j*(2/15)j(-4)/j0 assuming j is positive. j*(-449/105) Simplify (kk*(-2)k)*(-17) assuming k is positive. 1 Simplify (ccc0/cc)/c(cc*0/ccc)/c assuming c is positive. c2 Simplify (ss/s(-1))(6/5)(((s1s)/s)/s)(-7/2) assuming s is positive. s(18/5) Simplify ((q*(1/9)/q)/qqq/q(-12))(3/23) assuming q is positive. q(109/69) Simplify (u7u)(-2/5) assuming u is positive. u(-16/5) Simplify k5/(k/(k(-5/4)/k))(k(-1/10)/k)/k5 assuming k is positive. k(-87/20) Simplify (kkk(-13)k(k/k(-3))/k)(-4/33) assuming k is positive. k(28/33) Simplify (o15)(-13) assuming o is positive. o(-195) Simplify ((l/l(2/5))/l)36l(-2/29)/(l(-4)/l) assuming l is positive. l(-1373/145) Simplify (o/(o/((o/(o/o(-1)))/oo)))(1/6) assuming o is positive. o(-1/6) Simplify r3((r*(-2/33)r)/r)/r assuming r is positive. r*(64/33) Simplify ((xx*7)/x)/xxx/x(-5)(xx/x(2/9))(-41) assuming x is positive. x(-539/9) Simplify ((y8y)/(y/((y/(y*(7/3)y))/yy)))/(y/((y(y/(y/(yy/(y(2/3)/y))))/yy)/yy))(2/91) assuming y is positive. y(223/39) Simplify q/q(-1/10)q/q*(1/2)q assuming q is positive. q(13/5) Simplify (i0)*(26/3)(i/(i/(i/((((i/(i*0i))/i)/i)/i))))(2/15) assuming i is positive. i(8/15) Simplify (f*(2/7)/(ff8))(-6) assuming f is positive. f*(366/7) Simplify (d/(dd/(d(d(2/23)/d)/d))d)(-2/143) assuming d is positive. d(42/3289) Simplify (ll(13/3))/lll(-2/17) assuming l is positive. l(266/51) Simplify vvv/(v((v/(v*(-2/29)/vvvv))/v)/v)v(4/5)(v*(-1/2)v)(3/34) assuming v is positive. v(56943/9860) Simplify (ff/(f(-1/6)ffff))(-23) assuming f is positive. f(253/6) Simplify (ppp(-5/6))(-11) assuming p is positive. p(-77/6) Simplify ((tt*(-3))/((t(t*(-6)/t)/tt)/t))(-1/28) assuming t is positive. t(-5/28) Simplify (rr(3/8))/(r4/rrr) assuming r is positive. r(-29/8) Simplify (l2l)/(l/(ll/(ll*(-2/13))))(l*(1/6)ll)(-5/2) assuming l is positive. l(-353/156) Simplify (((oo/(o*(-1/4)o))/o)(5/6))11 assuming o is positive. o*(55/24) Simplify ((vvv(-1/5)v)/v)(1/2) assuming v is positive. v(9/10) Simplify ((q(-2/5))(-1/3))25 assuming q is positive. q(10/3) Simplify ((m*(-2/17)m)/mm)/((mm/(m/((m*(-2)m)/m))m)/m)m8/((m(2/9)/m)/m) assuming m is positive. m(1784/153) Simplify (q(-1)q(-2/11))/(q2/q)37 assuming q is positive. q(-420/11) Simplify ((oo(o/(o(-3)o))/o)(5/11))15 assuming o is positive. o(300/11) Simplify (v(-3/8)v(1/5))(-2/75) assuming v is positive. v(7/1500) Simplify ((o/o0)/oo)*(-4/29)oo(-2)o11 assuming o is positive. o(286/29) Simplify pp(3/2)/pp*(-1/3)(p/(p*(-2/5)p))40 assuming p is positive. p(103/6) Simplify g*2/(gg*3gg)g*9g(4/7) assuming g is positive. g(39/7) Simplify (l(6/11)/l)/(l/l(3/8)l)l/(l*(-1)ll)ll(-6) assuming l is positive. l(-623/88) Simplify ((xx(-2/9))(-12))(-26) assuming x is positive. x(728/3) Simplify (g16)(2/97) assuming g is positive. g(32/97) Simplify (l(-4)l(4/5))/(l/(l/l0))8 assuming l is positive. l(-16/5) Simplify (w(-3)w*(1/5)w)/(w(2/3)/((w/(((w/w(-6))/w)/w))/ww)) assuming w is positive. w(-97/15) Simplify (ww*(-3/5)/wwww18)50 assuming w is positive. w970 Simplify (i4)(-4/15) assuming i is positive. i(-16/15) Simplify (((t/(t(t/(t/(ttt(2/3)))t)/t))/t)/t)*(-1/10)(t*1t)(5/3) assuming t is positive. t(19/5) Simplify t*(-1)/(tt(t(-4)tt)/tt)(t(2/7))(-8) assuming t is positive. t(-23/7) Simplify ((dd(2/3))(-5/2))(-6/19) assuming d is positive. d(25/19) Simplify ((hh/(h(-6)h))/h(6/17))(2/35) assuming h is positive. h(226/595) Simplify (z(-3/8)/z(3/5))(-10) assuming z is positive. z*(39/4) Simplify (a(a/a*11)/aa)/(a/(a*(-1/11)a)) assuming a is positive. a(-100/11) Simplify (((q/q(-3/7))/qq)/q(1/3))(-2/27) assuming q is positive. q(-46/567) Simplify k7k*(2/7)kkk((k(-3)/k)/k)/kk/((k*(-6)k)/k) assuming k is positive. k(79/7) Simplify (z(-3)z(-10))/((zz(1/4))/z)15 assuming z is positive. z*(-67/4) Simplify vvv/(vv*(2/7))v/v*(-1/2)vv(-1/7)/vvv(10/3) assuming v is positive. v(311/42) Simplify (b1)15b*1bbb/b**(-4) assuming b	{ "pile_set_name": "DM Mathematics" }
3 for g. 0 Let h(x) = 4x - 1. Let s be h(1). Solve 0u - u - 4w = 9, 4w = -3u - s for u. 3 Let a(k) = k3 + 5k*2 - 8k - 9. Let r be a(-6). Suppose -5p = 0, -3p + 8 = m + r. Solve 0 = 5f + 3n + 26, -mf + 0n - 28 = 4n for f. -4 Let l = 15 + -12. Solve 8 = -2f - ls, -3s + 4 = -2f - 5s for f. 2 Let y be -8(1 - (-33)/(-12)). Suppose 2u - 4 = -y. Let w = u - -8. Solve wx = -4o - 6, 5o + 15 = 5x - 10 for o. -3 Let s(c) = -c*3 - 2c*2 + 2c. Let i be s(-3). Let g = -13 - -20. Solve 4m - 2l + g = -i, 3l = 3 for m. -2 Suppose -11 = -4c + 65. Suppose 5l = 6 + c. Solve -lu = 5, 5d + 4u = -24 + 5 for d. -3 Let q be (-9)/4 + 2 - 261/(-36). Solve 0 = -2i + 3y + 3, -2y - q = -0i - 3i for i. 3 Let r(m) = m2 - m + 2. Let x be r(3). Let n(f) = f3 - 7f*2 - 7f - 4. Let k be n(x). Solve 2p + kh - h + 3 = 0, 4p = h + 15 for p. 3 Let r(l) = 2l - 1. Let y be r(3). Solve -2n - 6 = -yn - 3d, -5d = -n - 28 for n. -3 Let w = -2 + 5. Let n be (-8)/(-6) + 4/6. Let t(q) = 2q2 + 2. Let g be t(n). Solve g = 2j, wj - 40 = 5p - j for p. -4 Suppose -2o + 0 + 8 = 0. Suppose 27 = -og - 13. Let m be 2/g - (-52)/10. Solve 2p = -t - 10, -p - 3t = -8t + m for p. -5 Let r be (4 - 3)/(2/(-6)). Let y = r - -4. Let g be 1 - (-2)/(1 - 0). Solve -4b + g = 3t - b, -4t - 3b - y = 0 for t. -4 Let t(q) = -q2 - 7q - 7. Let h be t(-5). Let a = h + -3. Suppose k - 10 = 4g, 5k - 2g - 18 - 14 = a. Solve 5v - k = b + 3v, 0 = -4b - 3v - 2 for b. -2 Let g = -6 + 6. Solve g = 5b - 0n - 4n - 40, 4b - 11 = -n for b. 4 Let i(z) = 3z + 2. Let x = -11 - -11. Let r be i(x). Solve -9 = 5t + rh, -2t - 6 = -4h + 12 for t. -3 Let i be 1 - (14 + -16 - (0 + 1)). Solve -4r - 4z = i, 4r - 21 = 5r - 4z for r. -5 Suppose -x + 4f = -2 + 11, 4x = f + 9. Solve 4m - 5v = -2v + 11, x = -3v for m. 2 Let m(i) = -i2 + 16i - 23. Let n be m(14). Solve -3y - 12 = 5g, ny + 3 = -4g - 17 for y. -4 Let i be 4 - -52/(-5). Solve -5n = -3d + 5d + 30, 2 = -3n + id for n. -4 Let a(h) = h*3 - 4h*2 + 5. Let u = -4 + 8. Let m be a(u). Suppose -3w = -2g - 8, 0g = mw + 2g + 8. Solve 4x = 4q + 12, -4x = 5q - wq - 30 for x. 5 Suppose -2d + 4u + 8 = 0, 3d + 5u - 2u + 6 = 0. Suppose dp - 2 = -p. Solve pf + 3t + 2 = 0, 20 = 3f - 5t - 15 for f. 5 Suppose -3n = -3y + 2n - 5, 0 = 4y + 2n - 28. Let u = 0 - -1. Let g = y - u. Solve l + 4 = 4t, 2l - 8 = gt - 2l for t. 2 Let l(k) = -k*2 + 3k - 2. Let g be l(2). Let a be -2 + 9 - (4 + -1). Let q be 0/(2/a-2). Solve 5y = p - 12, q = 2y - 3p - gp - 3 for y. -3 Let o(g) = g - 13. Let u be o(13). Let q = 0 - u. Solve -4h - h = 15, 3p - 3h - 12 = q for p. 1 Let m(x) = x*3 - 7x*2 - 10x + 1. Let q be m(8). Let j be (-1 + -1)q/10. Solve 12 = -4y - 8, -jc = 2y - 5 for c. 5 Let g = 5 - -21. Suppose d - 5j + 12 = 0, -d - 8 + g = 5j. Solve 4u - 3 = -dm, -3u - m + 3m = 19 for u. -3 Suppose 18 = 3l - p - 2p, 3p + 8 = -2l. Suppose 0 = -m + 4i + 16, 2i - 6i = -2m + 16. Solve 0 = -4w - b - 17, 3w = lb - mb + 1 for w. -3 Let c be (0 + -9)1/3. Let i be 6/c + 1 - -3. Solve v + 2z = -2z, 5v = iz for v. 0 Let y(a) = a3 + 6a*2 - 7a - 4. Let n be y(-7). Suppose -4d = 26 + 10. Let q = n - d. Solve 3i - 1 = 2j, -4j - 24 - q = 3i for j. -5 Suppose 20m - 16m = 12. Solve -p = -mz + z + 1, -2p - 5z - 2 = 0 for p. -1 Let k be (12/(-9))/((-1)/30). Solve 5d + w = -4w - k, -32 = 5d + 3w for d. -4 Let t = -4 - -7. Let d(s) = s + 3. Let i be d(-5). Let f be 34/10 - i/(-5). Solve 0 = -k + tv - 12, -fv = -6k + k - 24 for k. -3 Suppose -5p - 7 = -32. Suppose -pz = -z. Solve -h - 2 = -2j, 2h - j + z + 4 = 0 for h. -2 Suppose 3g = 3w, -2w + 2g = -4w. Solve 2r - 10 = -2f, -3r + 8r - 15 = w for f. 2 Suppose 4j + j = 5, -3j = -5h - 3. Suppose -2a + 16 + 8 = h. Solve 4v = a, -3m + 5v = m + 11 for m. 1 Let v(j) = -j3 - 14j*2 - j - 7. Let l be v(-14). Solve -lk = p - 2k - 20, 4k - 37 = -5p for p. 5 Let l be (-1)/(4/(-16)) - -1. Suppose -3p = -4w + 40, -p + 3p - 34 = -2w. Solve 2s = -lj + 1 + w, 4j = -s + 10 for j. 2 Suppose 0 = 4f - 11 + 3. Suppose 3u = -3b + 30, -u - 2b + f = -3b. Solve -2n - 17 + u = -a, 4n + 7 = -a for n. -3 Let x = -8 + 4. Let a be (-8)/(5/(10/x)). Solve 2k + aj - 5 = k, 5j = 4k + 1 for k. 1 Let w = 4 - 1. Let y be 0 - (-1 + 2 + -4). Solve -wk + g + 2 = 0, 4k + 2g + 10 = -yg for k. 0 Let y be 2 + (-4)/(-16)4. Solve 12 = -3z - yq, -4q - 6 = -z + 10 for z. 0 Let j(k) = k2 - 5k - 7. Let w(u) = u + 1. Let g(t) = j(t) + 5w(t). Let v be g(5). Solve -4a + 5h - 21 = 10, 5a - h + v = 0 for a. -4 Suppose -3w + 26 = -w + 4o, 2 = -2o. Let k be 22/(-11)(0 - 1). Solve 3t - 12 = -3n, -7t - w = -2t - kn for t. -1 Let t = 96 + -94. Solve ta = -5f + 1, 0 = -2f - 2f - 2a for f. 1 Let w(l) be the second derivative of l*4/12 + 4l*3/3 + 3l*2/2 - l. Let r be w(-8). Solve 3u - 7 = -5p, -ru = u + p - 15 for u. 4 Suppose -2s - c + 2c = 15, -2s - 5c = -15. Suppose 5k = 5i + 35, 0k - i = -5k + 35. Let r = s + k. Solve 3w = rg - 19, 4w + 0g = 4g - 28 for w. -5 Let g(p) = 41p*2 + p. Let x be g(-1). Let b = -26 + x. Let r = 9 - -4. Solve -2h - 5f + b = -r, -f = -3h - 2 for h. 1 Let f = -9 - -12. Let j be f/(-15) - 78/(-15). Solve y - 5q - 20 = -0y, -jy + 2q = 15 for y. -5 Let k be 8/(-12)(-11 + -1). Let y be (-23)/(-2) + 4/k. Let r be (-16)/(-6) + 4/y. Solve -rc - 20 = -4m, 2c + 2m = -3m + 2 for c. -4 Let g be 1 - (2 + -1 - 1). Let v(o) = o*2 + 2o. Let h be v(-2). Let l be 0/(h/3 - g). Solve -2i = l, 0 = 2m - 0i - 3i + 4 for m. -2 Suppose 4w + 1 = -5s - 6, -3w - 6 = 3s. Let j be -7((-6)/7)/s. Let d be ((-5)/(-15))/((-2)/(-12)). Solve 2y - dg + j = y, -y + 3g = 10 for y. 2 Let a be -10(2 - 4/(-10)). Let k = a + 35. Solve 4p - k = 3s, -2p = 2p + 4 for s. -5 Let o = 28 - 22. Solve -t = 5z - 22, 3z - o = t + 4 for z. 4 Let x = -2 + 2. Suppose -3p - n + 2 = -2, 4p + 2 = -5n. Suppose -3m = -pm - 2. Solve mu + 13 + 3 = -4k, u - 3k - 17 = x for u. 2 Let k be (7 - (1 - 0)) + 5 + -5. Solve 2z = 4f - 32 + k, 0 = 3z + 2f + 7 for z. -5 Let w(g) = -5g + 13. Let v(s) = 11s - 26. Let h(a) = 4v(a) + 9w(a). Let q be h(8). Solve -qb + d + d = 19, -3b + 5d = 19 for b. -3 Let h be (-50)/(-15)(-3)/(-2). Suppose -2s + 27 = 2s + 3j, -3j = -15. Let u be (h - s) + 0 + 0. Solve -uz - 5x = -0z + 8, -4z = -5x + 16 for z. -4 Suppose 2a = -x + 32, 3x - 6x - 12 = 0. Let p be (a/15)/(9/60). Let k = p - 5. Solve -3y = -0b + b + 11, -4y + 7 = -kb for b. -5 Suppose -5w = -3k - 11 - 0, -32 = -4k - 5w. Solve 2v + 4x = -2, -kx = 2v + v for v. 1 Let x = 28 - 17. Let m be 46/x - (-10)/(-55). Suppose mc + 24 = 4t, -t + 4c + 15 = -3. Solve -tu - 26 + 7 = 3p, 0 = -u + 5p + 23 for u. -2 Let b = -14 + 21. Suppose -bn + 13 = -1. Solve nd - 5d = -i, -i - 2d = -5 for i. 3 Let s(j) = -j2 + 5j + 17. Let m be s(7). Solve 3n = -mc - 5 - 7, n = -5c - 4 for c. 0 Suppose -2g + 536 = f, 3g - 206 = f + 608. Let m be ((-26)/(-3))/(12/g). Let h be (-1)/4 - m/(-12). Solve -2v + h = -4z, 23 = -2v - 5z - 6 for v. -2 Suppose 0 = 2m - 3m + 3. Suppose 0y + 12 = my. Let q be (-3)/1y/(-3). Solve -i = qk + 13, -3 = 4i + 17 for k. -2 Suppose -5u + 8 = -3u. Suppose -3y + u = -g - 6, 2y + 5g - 1 = 0. Solve 6s - 3s + y = 3m, 4m - 5s = 9 for m. -4 Let z = -10 + 12. Let c be z - (-3 - (-2 - -1)). Let h = 2 + -2. Solve 5s - 3q + 28 = h, -4s - cq = 11 + 5 for s. -5 Suppose 0 = -2w + u - 1, 5u = -2w + 3w - 22. Let h = w - -5. Solve -5r - 1 + 0 = 3y, 0 = 2r + 2y - h for r. -2 Suppose 7h - 2h - 2 = 2g, 4 = g. Solve 0 = -2r - 2r + 5q + 12, -4r + hq + 12 = 0 for r. 3 Let c = -110 + 166. Suppose 0 = -4m + 20, 8 = 3l + 5m - c. Solve -4h = t + l, -2t + 14 = -2h - 0t for h. -4 Let c be (3 + -24)/(-3) - 3. Suppose co + 1 = 9. Solve 4b + 4 = 4l, 0 = -4l + 2b + 10 + o for l. 5 Let h = 9 - -13. Solve -3r + 2p = h, -r - 24 = -4p - 0p for r. -4 Let y(k) = 21k2 - k + 1. Let q be y(1). Solve -2u = -z + 5 - 16, 3u = 3z + q for z. -3 Let s(q) = q - 3. Let f be s(5). Suppose 3a - 18 = fa. Solv	{ "pile_set_name": "DM Mathematics" }
309? -1290 What comes next: -140, -494, -1092, -1940, -3044? -4410 What comes next: 7254, 7250, 7242, 7224, 7190? 7134 What is the next term in -212862, -425723, -638584, -851445, -1064306? -1277167 What is the next term in 393, 279, 159, 33, -99, -237, -381? -531 What is next in 19, 113, 361, 841, 1631? 2809 What is the next term in -544, -3097, -7352, -13309, -20968? -30329 What comes next: 45204, 45195, 45186, 45177, 45168? 45159 What is the next term in -870, -949, -1014, -1059, -1078, -1065, -1014? -919 What comes next: 47798, 47793, 47786, 47777, 47766, 47753, 47738? 47721 What comes next: 3593, 14372, 32333, 57476? 89801 What is the next term in 1177, 2333, 3497, 4675, 5873? 7097 What comes next: 35, 89, 179, 305, 467? 665 What comes next: -5092, -10190, -15288? -20386 What comes next: 705, 1280, 1855, 2430, 3005, 3580? 4155 What comes next: 15, 5, -31, -105, -229? -415 What is next in 6466, 25679, 57638, 102343? 159794 What is next in 3134, 5958, 8782, 11606, 14430? 17254 What is next in 14308, 57175, 128618, 228637, 357232? 514403 What is next in 8031, 16076, 24121, 32166, 40211? 48256 What comes next: 1637, 3277, 4917, 6557, 8197? 9837 What is next in -55, -419, -975, -1723? -2663 What comes next: -1221, -4874, -10965, -19494, -30461, -43866, -59709? -77990 What comes next: -5293008, -5293010, -5293012, -5293014, -5293016, -5293018? -5293020 What comes next: 116, 16, -148, -376, -668? -1024 What is next in 608, 958, 1308, 1658? 2008 What comes next: -19581, -39170, -58759, -78348? -97937 What is next in -99, -249, -403, -561, -723, -889, -1059? -1233 What is next in 1284748, 2569497, 3854246, 5138995, 6423744, 7708493? 8993242 What is next in 349, 688, 1027, 1366? 1705 What comes next: -1820, -7367, -16638, -29633, -46352, -66795? -90962 What is the next term in 6251, 6101, 5951, 5801, 5651, 5501? 5351 What is the next term in -827, -670, -429, -122, 233, 618, 1015, 1406? 1773 What is the next term in -14510, -14511, -14512? -14513 What is next in -544, -1097, -1646, -2191? -2732 What is the next term in 15895, 31774, 47653? 63532 What is next in -207, -1034, -2481, -4548? -7235 What comes next: -33058, -33053, -33050, -33049, -33050, -33053, -33058? -33065 What is the next term in -39678, -39674, -39670, -39666? -39662 What comes next: 2855, 5720, 8599, 11498, 14423? 17380 What comes next: 732, 3296, 7568, 13548, 21236? 30632 What is next in -206262, -206257, -206248, -206235, -206218, -206197? -206172 What is next in 71261, 71254, 71247? 71240 What is next in -7339, -7349, -7359, -7369, -7379, -7389? -7399 What comes next: 11925, 11890, 11857, 11826, 11797, 11770, 11745? 11722 What is the next term in 126, 163, 176, 153, 82, -49, -252, -539? -922 What comes next: 19469, 19463, 19459, 19457, 19457? 19459 What is the next term in 59324, 118645, 177966, 237287, 296608, 355929? 415250 What is next in 792, 3141, 7050, 12519, 19548, 28137? 38286 What is next in -7099667, -14199334, -21298999, -28398662, -35498323, -42597982? -49697639 What comes next: 1519, 3049, 4579, 6109, 7639, 9169? 10699 What is the next term in 806, 1505, 2204, 2903, 3602? 4301 What is next in 1420, 2782, 4014, 5050, 5824, 6270, 6322, 5914? 4980 What is the next term in -230, -899, -2010, -3563? -5558 What is the next term in -64, -191, -370, -583, -812, -1039, -1246, -1415? -1528 What is next in 4714, 9477, 14240? 19003 What is next in -59, -41, -5, 49, 121, 211, 319? 445 What is the next term in 1518491, 1518493, 1518495, 1518497? 1518499 What is next in -1896, -1868, -1840, -1812, -1784, -1756? -1728 What is next in -43547, -43470, -43271, -42890, -42267, -41342, -40055? -38346 What is next in 5537, 5644, 5823, 6074, 6397, 6792, 7259? 7798 What is next in 2409, 1581, -663, -5031, -12231, -22971? -37959 What is the next term in 1066819, 1066817, 1066813, 1066807, 1066799, 1066789, 1066777? 1066763 What is next in 146600, 146519, 146440, 146363, 146288, 146215? 146144 What comes next: 287064, 287069, 287074, 287079, 287084? 287089 What comes next: -39688, -39690, -39692? -39694 What comes next: -2512, -4685, -6844, -8983, -11096, -13177, -15220, -17219? -19168 What is the next term in -467, -933, -1405, -1883, -2367? -2857 What comes next: 199, 979, 2363, 4351? 6943 What is next in -155246, -155248, -155250, -155252? -155254 What is next in -143041, -143040, -143039, -143038, -143037, -143036? -143035 What is the next term in -3497, -3558, -3667, -3836, -4077, -4402? -4823 What comes next: 8737, 8739, 8741, 8743, 8745? 8747 What is the next term in 549, 514, 467, 402, 313, 194, 39, -158? -403 What is next in 1400, 2846, 4292, 5738, 7184? 8630 What comes next: 110748, 221498, 332248? 442998 What comes next: -76, -129, -138, -85, 48, 279? 626 What is next in -38, 24, 116, 220, 318? 392 What is next in -202166, -404327, -606486, -808643, -1010798? -1212951 What comes next: -2809, -5620, -8431? -11242 What comes next: -59203, -59175, -59147, -59119? -59091 What is the next term in 2440, 4894, 7348, 9802, 12256? 14710 What comes next: 1685, 3334, 4975, 6608, 8233? 9850 What is the next term in 6793, 13598, 20403? 27208 What is the next term in -905, -3415, -7599, -13457, -20989, -30195? -41075 What comes next: 45, 317, 1007, 2319, 4457, 7625, 12027? 17867 What is the next term in 50, 110, 212, 362, 566, 830, 1160, 1562? 2042 What is the next term in 81636, 81627, 81608, 81573, 81516, 81431, 81312? 81153 What is the next term in -94, -58, -22, 14, 50? 86 What is the next term in -1787015, -1787011, -1787005, -1786997, -1786987, -1786975, -1786961? -1786945 What comes next: -474, -842, -1218, -1608, -2018? -2454 What is the next term in 573, 2336, 5279, 9402? 14705 What is next in 17, 122, 393, 908, 1745, 2982, 4697, 6968? 9873 What comes next: -29263, -58536, -87811, -117088? -146367 What comes next: -42063, -42046, -42029, -42012, -41995, -41978? -41961 What is the next term in -431242, -862514, -1293788, -1725064, -2156342? -2587622 What is next in 27001, 54064, 81125, 108184, 135241, 162296, 189349? 216400 What comes next: -81058, -81062, -81066, -81070? -81074 What is the next term in 89907, 89909, 89911, 89913, 89915? 89917 What is the next term in 102207, 102200, 102185, 102162? 102131 What comes next: -361, -2774, -9327, -22090, -43133? -74526 What is the next term in -3857, -3968, -4079? -4190 What is the next term in 42359, 84713, 127067? 169421 What is next in 1550, 3337, 5124? 6911 What is next in 1510, 1645, 1868, 2179? 2578 What is next in -1334, -2643, -3930, -5195, -6438? -7659 What is the next term in 46846, 46844, 46842, 46840? 46838 What comes next: -1607, -1666, -1789, -2006, -2347, -2842, -3521? -4414 What is next in 10705, 10647, 10543, 10387, 10173, 9895, 9547? 9123 What comes next: 420, 854, 1286, 1716, 2144? 2570 What comes next: -16034, -16054, -16108, -16214, -16390, -16654, -17024, -17518? -18154 What is next in -686, -1172, -1976, -3092, -4514, -6236, -8252, -10556? -13142 What is next in 608, 1192, 1778, 2366, 2956? 3548 What is next in -122, -1083, -3638, -8561, -16626, -28607? -45278 What comes next: -635374, -635375, -635376, -635377, -635378, -635379? -635380 What is the next term in 362, 580, 784, 968, 1126? 1252 What is next in -622, -736, -846, -952, -1054? -1152 What is the next term in -14064, -56284, -126654, -225174, -351844? -506664 What comes next: 4858, 4957, 5056, 5155, 5254? 5353 What is the next term in -413, -437, -435, -395, -305? -153 What is next in 34005, 136014, 306035, 544074, 850137, 1224230, 1666359, 2176530? 2754749 What comes next: 81508, 163013, 244514, 326011, 407504? 488993 What comes next: 142538, 142540, 142542, 142544, 142546, 142548? 142550 What comes next: -9793, -19648, -29495, -39328, -49141, -58928? -68683 What is next in -586, -579, -556, -511, -438, -331? -184 What is the next term in -405187, -405181, -405177, -405175? -405175 What is next in 128522, 257046, 385570, 514094, 642618, 771142? 899666 What comes next: -102, -364, -852, -1608, -2674? -4092 What is the next term in -2655, -5170, -7705, -10266, -12859? -15490 What is next in 352, 765, 1174, 1579? 1980 What comes next: -614, -698, -800, -926, -1082? -1274 What comes next: -43, 24, 133, 284, 477, 712? 989 What comes next: 19163, 38324, 57	{ "pile_set_name": "DM Mathematics" }
Which is the smallest value? (a) l (b) -2/7 (c) u b Let k = 0.09 + -0.03. Let p(t) = -t*3 - 4t*2 + 6 - 6 - 7t*2 - 2. Let n be p(-11). What is the third smallest value in k, n, 0.4? 0.4 Suppose -3x = -2q + 1 - 4, -x = -2q - 5. Let h = -15.7 - -15. Let g = -0.2 - h. What is the second biggest value in q, 1, g? g Suppose 2m = -5 - 3. Let n = -55 + 221/4. Let l = 31209 + -31208.7. What is the second smallest value in n, l, m? n Let i = 209585/9 + -23287. Which is the third biggest value? (a) -0.09 (b) 1/3 (c) i (d) -249 a Let m be ((-16)/18)/(2 + -4). Let u = -19397 - -19396.6. Which is the smallest value? (a) -1/2 (b) u (c) m a Let i = 2181 + -2180. Which is the third smallest value? (a) 2 (b) -1 (c) -3/19 (d) i d Let k(m) = 2m - 7. Suppose 0 = -6j - 15j + 84. Let o be k(j). Which is the biggest value? (a) 0.1 (b) 2/7 (c) o (d) -13 c Suppose 92 = 11u + 59. Let x = 177/4 - 44. What is the third smallest value in -3/2, x, u? u Suppose 2p + 208 = -6p. Let m be 13/(p/(-48))6/(-56). Let j = m + 61/21. Which is the third biggest value? (a) 0.2 (b) 0 (c) -1/4 (d) j b Let v be 2/4 - 14/16. Let u = -302077 + 302053. What is the second smallest value in 3, v, -0.2, u? v Let m(s) = 3s - 42. Let u be m(18). Let t be (-1)/(-4 + 54/u). Which is the biggest value? (a) -3 (b) -10 (c) t c Let l(n) = 6n - 27. Let i be l(5). Suppose -2m = -ic - 129, -140 + 8 = -2m + 4c. What is the third smallest value in -0.1, -2, m? m Suppose 112u - 112 = 108u. Let o be (12/u)/((-80)/(-70)). Let t = -1 + 3. Which is the third smallest value? (a) t (b) o (c) 3 (d) -3/8 a Let g be 1 + -1 + 5-1. Let h = 25727 - 25382.91. Let t = h + -344. Which is the second smallest value? (a) -0.4 (b) g (c) -4 (d) t c Let l be (-40)/(-360) + 13/(-36). Which is the second biggest value? (a) 4/5 (b) l (c) 1/9 c Let z be 80/1872 + 2/(-13). Let r = 0.36 + -0.36. Let n = r + 11. What is the second biggest value in z, n, -2? z Suppose 0 = -5i - 3w - 13, -4w + 0 - 4 = 0. Let j = 2.4 + 10.6. Let u = -13.05 + j. What is the biggest value in u, 4, i? 4 Suppose -93i = -61 - 125. Which is the third smallest value? (a) -4 (b) i (c) 3/319 b Let o = 87 + -88.78. Let v = o - -1.58. Let n = 8.6 - 8. What is the second biggest value in 3/4, 5, v, n? 3/4 Let o(d) = -21d - 5. Let m be o(-2). Suppose 4x - 11 = m. Suppose -8k - 44 = 3k. What is the biggest value in x, k, -3? x Let v = 0.1 - 0.4. Let i be 5/(-1 - 0) - (-105 + 103 - -2). Which is the third smallest value? (a) i (b) -1/22 (c) v b Suppose -4p - 6 + 6 = 0. Let h = 0.021 - 27.021. Let v = -190 + 379/2. Which is the fourth smallest value? (a) h (b) p (c) 0.2 (d) v c Suppose 0 = -x + 7x + 78. Let u = -913.03 + 918. Let v = -0.03 - u. What is the smallest value in v, 0, x? x Let k = 4210 + -4212. What is the second smallest value in 4, k, 1, 1/7, 8? 1/7 Let r = 2.137 + -7.137. What is the fifth biggest value in -1/2, 1, 5, r, -14? -14 Let u be ((-4)/(-48))/(108/(-16) - -6). Let r = -61 + 43. Let w = r - -18.07. Which is the smallest value? (a) w (b) u (c) 0 b Let q = 590.9 + -592.9. Which is the biggest value? (a) q (b) 5 (c) 0.2 (d) -253 (e) 1/6 b Let s = 410440/117 + -3508. Which is the smallest value? (a) -1 (b) -4 (c) s b Let s be (-3)/(5/((-165)/(-297))). Let p be 997((-3)/(-15) + 0). Let t = p + -200. What is the third biggest value in s, t, -5? -5 Let s = 0.12321 - -1.27679. What is the fourth smallest value in -0.3, -5, -0.8, s, 1? 1 Let q = 0.62 + -11.62. Suppose 12 = -22s + 19s. Let z be -1 + 7 + s - 0. Which is the second biggest value? (a) q (b) -2 (c) z b Let o = -2151.9 - -2151.7. Which is the fourth smallest value? (a) 7 (b) 0.01 (c) -0.1 (d) o (e) -0.05 b Suppose -8y = -10y - 2. Let m be y((-880)/(-2340) - (-2)/(-9)). Which is the fourth smallest value? (a) 5 (b) 2 (c) m (d) -4/5 a Suppose 29g - 27g - 6 = 0. Suppose -2n + c = 10, n - 6 = gn + c. What is the smallest value in -0.4, n, -1, 25? n Let w be (-6)/(-10) + (-222)/(-30). Suppose -3n + w = -n. Suppose 4g - 3 = -3y, g + 18 = -3y + ng. Which is the biggest value? (a) 5 (b) 0.5 (c) y a Let q(k) = -4k2 + 12k - 1. Let l be q(3). Which is the third smallest value? (a) 3 (b) -0.3 (c) -57/2 (d) l b Suppose -25 = -g + 6g. Let j = 35 - -38. Suppose 29b = 14 + j. What is the smallest value in g, 3/7, b? g Let v = -3074 + 3072. Which is the third biggest value? (a) -0.066 (b) -3 (c) 2/5 (d) v (e) -1/7 e Let g = -13459 + 13458. What is the biggest value in -210, -6, g, -2? g Let o be (92/(-92))/((-10)/6). What is the fifth smallest value in 0.054, o, 1/6, 1/7, 0.1? o Let g = 31.73 + -32. Let f = 1.52 + -1.25. Let j = f + g. Which is the third biggest value? (a) -0.4 (b) -2/7 (c) j a Let v(o) = -2o3 - 9o*2 - 61o - 230. Let i be v(-4). Let w be (-4)/(-2) - 8/10. What is the second smallest value in 0, i, w? 0 Suppose -10o + 24 = -6o. Let t be 7/(-2)o/(-28). What is the second biggest value in 1/4, t, 0, -1/6? 1/4 Let g = -9135 + 9132. Which is the smallest value? (a) g (b) 32 (c) -0.014 a Suppose r - 4 = 3b, -3 = -r + 2b + 1. Suppose -47z = -42z - 5v + 15, 0 = -rz + v - 15. What is the second smallest value in 3, -0.5, 3/8, z? -0.5 Suppose 5k - 1532 = -312. Suppose -2i - 142 = k. Let u = i + 1353/7. Which is the third smallest value? (a) u (b) 0.1 (c) 4 c Suppose 32y - 3z - 31 = 34y, -3y = 5z + 50. Which is the second biggest value? (a) y (b) -1/2 (c) 1 (d) -0.07 d Let t = -750 + 746.92. Let i = t - -7.08. Which is the second smallest value? (a) 0 (b) -1 (c) i (d) 1/4 a Let w = -433.91 + -82.99. Let k = w + 517. Which is the third biggest value? (a) -4 (b) k (c) -3 (d) 3/5 c Let z = -0.16 - 1.04. Let i = -1.2 - z. Suppose 4w + r = -42, 6w - 19 = 7w - 4r. What is the second smallest value in w, -1, i? -1 Let p = -907.6 + 905.6. What is the third smallest value in -5, -5/2, p, 2/3, 0.2? p Suppose 20j - 18j + 16j = -90. What is the second smallest value in 0.5, j, 1313? 0.5 Let h = -11 + 13. Let p = -6956 + 6951. Let x = 4.09 + -0.09. Which is the third biggest value? (a) p (b) -3 (c) h (d) x b Let t = 155 - 371. Let w = t + 222. Which is the fourth biggest value? (a) -0.2 (b) -2/13 (c) -1/3 (d) w c Let r = -5741 + 5737. Let m = -1661/9 + 185. Which is the third smallest value? (a) m (b) r (c) -2/9 a Let x = 5 - 8. Let g = -1043.9 - -1044.4. Which is the third smallest value? (a) 3/17 (b) g (c) x b Let s = 1054 - 1011.3. Let v = -3.3 - s. Let u = -45 - v. Which is the smallest value? (a) u (b) -0.2 (c) -5 (d) 2 c Let q = 925 - 933. Let p = 0.3 - -0.7. Let k = 0.55 + -0.95. Which is the biggest value? (a) p (b) k (c) q a Let y = 547 + -547. Let x be (-12)/54 - (-3)/((-1026)/(-40)). What is the second smallest value in x, 1, y, 0.3? y Let t = -29414 + 29414.07. Which is the second biggest value? (a) 4 (b) t (c) 0 (d) -1 (e) 14 a Let n = -281/408 - -3/136. Let j = -70.7 - -23.7. Which is the third smallest value? (a) -4/5 (b) n (c) j b Let h = -1.0282 + 1.1282. Which is the fifth biggest value? (a) -0.1 (b) -2 (c) 4/3 (d) 9 (e) h b Let x = 3.78 + -10.78. Let r(y) = -2y + 14. Suppose 0 = z + 1 - 10. Let h be r(z). Which is the biggest value? (a) -0.1 (b) h (c) x a Let x(i) = 2i2 - 2i - 4. Let m be x(-2). Let n be (m - 8)1/2. Suppose 10v - 32 - 18 = n. What is the third biggest value in -2/7, -3, v? -3 Let s be 27/2 + (-4)/6. Suppose -2g = -5z - 6, 0 = g - 2z + 5z - 25. Let t = s - g. Which is the third smallest value? (a) t (b) -2 (c) 3/7 c Suppose 7z - 2z - 27 = r, -5z + 45 = 5r. Which is the second biggest value? (a) r (b) 4 (c) 561.9 b Let t be (-112)/2805/(-21). Let w be -4(-4 + 3)/6. Which is the fourth biggest value? (a) -0.4 (b) w (c) t (d) 4 a Let z = 58.444 - 2.444. What is the third biggest value in 4/5, 6, z? 4/5 Suppose -19n - 2r = -18n - 8, 111 = 2n + 23r. Which is the second smallest value? (a) -4.4 (b) n (c) -5 (d) 0.1 a Let f = -1127/15 - -374/5. Which is the third smallest value? (a) -0.5 (b) f (c) -1/29 c Let r be 6/1(-7)/14 + -1. What is the biggest value in 0.2, r, 2/11, -4/15? 0.2 Let r be 1034 - 1034 - -4*(0 + 1). Which is	{ "pile_set_name": "DM Mathematics" }
3t3 + 27t*2 + 2146t - 17361. Give b(8). -1 Let p(b) = 5b3 + 8b*2 - 10b + 4. Calculate p(-6). -728 Let q(v) = -43v - 1764. Calculate q(-58). 730 Let d(t) = -t3 + 588t*2 - 313t + 531286. Determine d(589). 8 Let d(s) = 13541s - 3033184. Determine d(224). 0 Let d(s) = 11s*3 - 3s*2 + 21s - 180. Calculate d(5). 1225 Let u(k) = k*3 + 18k*2 + 28k - 139. Determine u(-16). -75 Let i(p) = -9p2 - 1314p - 40686. Determine i(-102). -294 Let i(l) = -l*3 + 45l*2 + 38l + 19994. Calculate i(53). -464 Let y(t) = -2791t - 203647. Give y(-73). 96 Let i(p) = -p2 - 3826p - 22943. Give i(-6). -23 Let q(v) = 234778v + 3521679. Calculate q(-15). 9 Let m(y) = -538505y - 38772366. Give m(-72). -6 Let y(c) = -701c2 + 316809c + 19444. What is y(452)? 8 Let c(q) = -q*2 + 16005q + 738295. Give c(-46). -51 Let a(r) = -72234r - 2022564. Calculate a(-28). -12 Let m(n) = -n2 - 17501n + 7765419. Determine m(433). -3 Let b(u) = -12u3 - u2 + 59u - 58. Give b(1). -12 Let l(a) = -435a3 + 3a*2 + 2968a - 2971. Determine l(1). -435 Let a(u) = -2u2 + 6929u - 5667225. Determine a(2141). 2 Let r(d) = 37902d - 189501. What is r(5)? 9 Let y(n) = -n3 - 123n*2 + 517n + 1069. Calculate y(-127). -74 Let x(f) = -8f3 - f2 - 6554f - 6554. What is x(-1)? 7 Let d(p) = -p*3 + 551p*2 - 9122p + 23292. What is d(534)? -204 Let l(s) = -s*3 + 5732s - 28545. Give l(5). -10 Let o(d) = d*2 + 122486d - 2695151. What is o(22)? 25 Let a(j) = 69j2 + 3962j - 2334. Give a(-58). -14 Let i(n) = 59n2 - 171n + 580. Give i(4). 840 Let k(l) = 8l2 - 197l - 221. Calculate k(23). -520 Let y(q) = -31q3 - 3q*2 - 890q + 1804. Calculate y(2). -236 Let x(f) = 743f - 67302. What is x(91)? 311 Let z(w) = -4w*3 + 2w*2 - 69w + 149. Determine z(6). -1057 Let u(o) = -293o - 21323. Give u(-74). 359 Let f(j) = -4j*2 - 470505j - 6115898. Determine f(-13). -9 Let u(r) = -r*3 + 29r*2 - 900r + 27660. Give u(30). -240 Let g(z) = 338z + 5641. Determine g(-16). 233 Let b(j) = j2 - 2263j - 151331. Calculate b(-65). -11 Let d(v) = 332v3 - 3v*2 - 11v + 13. Calculate d(1). 331 Let n(f) = -2f3 + 15f*2 - 430f + 2960. Determine n(7). -1 Let f(d) = 19d2 - 271d - 31181. Calculate f(-34). -3 Let s(k) = -284k3 + 6k*2 + 24k + 23. Calculate s(-1). 289 Let c(a) = 2a3 + 479a*2 + 245a + 1687. What is c(-239)? 253 Let h(o) = -40o2 - 69o - 6. Determine h(-1). 23 Let a(l) = l*2 - 3027l + 12099. Determine a(4). 7 Let n(f) = -f*2 + 44f - 461. What is n(15)? -26 Let s(i) = i*3 - 10i*2 - 100i + 63. What is s(16)? -1 Let h(g) = 180g2 - 1824g + 235. Determine h(10). -5 Let k(r) = 23953r - 215151. Determine k(9). 426 Let n(z) = -209133z - 104775629. What is n(-501)? 4 Let b(m) = 7454m - 141647. Calculate b(19). -21 Let d(q) = -97246q - 97239. What is d(-1)? 7 Let p(o) = -2o3 - 244o*2 - 1594o + 1893. What is p(-115)? 53 Let o(p) = 113632p + 795439. Give o(-7). 15 Let b(o) = -8900o - 4921694. Determine b(-553). 6 Let g(b) = b*3 + 6b*2 - 53b - 142. Give g(7). 124 Let c(q) = 13q3 + 171q*2 + 268q - 133. Calculate c(-10). 1287 Let i(l) = 1271l2 - 2569l + 2. Calculate i(2). -52 Let g(v) = -367v3 - 451v*2 + 906v - 3. Calculate g(2). -2931 Let v(h) = 195h + 995. Calculate v(-7). -370 Let l(s) = 24s - 5921. Determine l(153). -2249 Let r(m) = 738m - 6470. Give r(9). 172 Let f(s) = 332s - 5286. Calculate f(15). -306 Let l(a) = -2a3 - 66a*2 - 1617a + 21361. Give l(9). 4 Let v(f) = 1679f + 114221. Give v(-68). 49 Let o(d) = 8d*3 + 668d*2 - 338d - 213. Give o(-84). -45 Let i(x) = x*3 + 110x*2 - 356x - 19. Give i(-113). 1902 Let p(y) = -1291753y + 1291773. What is p(1)? 20 Let b(n) = -464n + 4273. What is b(10)? -367 Let f(y) = -11y2 + 45y + 113. Determine f(6). -13 Let l(d) = d*3 - 3121d*2 - 56495d + 123. Determine l(-18). -3 Let k(p) = 2p3 - 9p*2 + 17p + 134. Calculate k(8). 718 Let q(f) = 145f2 - 1801f + 3498. What is q(10)? -12 Let k(x) = -17x3 + 121x*2 + 4x - 125. What is k(7)? 1 Let y(o) = -o*2 + 26o + 709. Determine y(34). 437 Let u(g) = -3g3 - 154g*2 + 1832g + 22. What is u(10)? -58 Let d(h) = 208929h + 417828. Determine d(-2). -30 Let d(r) = 20564r - 14579878. Determine d(709). -2 Let h(z) = -8z2 - 695z - 3849. Calculate h(-81). -42 Let b(t) = -t*2 + 294t - 2154. What is b(9)? 411 Let f(g) = -3g2 - 2g - 346. Calculate f(12). -802 Let c(i) = -i*3 - 37i*2 - 172i - 474. What is c(-32)? -90 Let q(h) = 4h2 - 1307h - 7999. What is q(-6)? -13 Let v(m) = 573m2 + 10310m - 86. Calculate v(-18). -14 Let k(f) = f*2 - 700f + 115341. What is k(266)? -103 Let a(p) = 25p + 304. Calculate a(-16). -96 Let l(z) = -2z*3 + 268z*2 - 8977z + 485. Calculate l(69). 2 Let v(h) = -h*3 - 74h*2 - 1265h + 97. Calculate v(-49). 2057 Let g(q) = -3335q + 57434. What is g(17)? 739 Let y(z) = 2z*3 - 9z*2 + 269z + 1302. Give y(-5). -518 Let q(a) = -23a2 - 2697a - 336. What is q(-117)? 366 Let p(c) = 57c + 4520. Give p(-79). 17 Let a(b) = b3 + 24b*2 - 218b - 4159. Give a(-27). -460 Let r(j) = 728j2 + 722j - 11. What is r(-1)? -5 Let o(g) = -g*3 + 48g*2 + 4g - 5719. What is o(46)? -1303 Let r(u) = 11622u + 15805947. Calculate r(-1360). 27 Let o(s) = -19709s - 315737. Determine o(-16). -393 Let g(v) = 2v2 - 32425v + 8. What is g(0)? 8 Let k(m) = 917170m + 5503030. What is k(-6)? 10 Let g(i) = 2i*3 + 15i*2 - i + 62. Calculate g(5). 682 Let v(d) = 31d*2 - 3206d + 10604. Give v(100). 4 Let t(m) = -65952m - 2901867. Give t(-44). 21 Let l(s) = s2 + 243s - 2803. Give l(11). -9 Let b(l) = 13l2 - 2761l - 15886. Calculate b(218). 28 Let d(z) = z*3 - 10z*2 - 40z - 51. What is d(14)? 173 Let p(b) = -b*2 - 241b - 10230. What is p(-55)? 0 Let x(i) = -6i3 - 602i*2 - 189i + 1157. What is x(-100)? 57 Let w(g) = 46369g + 324590. Give w(-7). 7 Let m(r) = 57r*2 - 12426r + 24857. What is m(2)? 233 Let a(v) = 2v3 - 802v*2 - 2439v + 6343. Determine a(404). 283 Let g(z) = -744538z + 1489184. What is g(2)? 108 Let p(z) = -25458z + 712818. Determine p(28). -6 Let p(j) = j*3 + 67j*2 + 156j + 5946. What is p(-66)? 6 Let b(u) = u*3 - 757u*2 + 26613u + 19444. Determine b(720). 4 Let s(d) = -d*3 - 55d*2 + 75d - 2126. Calculate s(-57). 97 Let p(o) = -231o - 37835. Determine p(-164). 49 Let v(r) = 5r*3 + 358r*2 - 123r + 3103. Give v(-72). 1591 Let q(g) = -607g2 + 23103g - 1401. Calculate q(38). 5 Let h(c) = 474c2 - 41238c - 25. Determine h(87). -25 Let y(l) = 48l3 - 2256l*2 - 5l + 45. What is y(47)? -190 Let i(c) = 12302c - 246029. Calculate i(20). 11 Let v(f) = 9748f + 8646468. Calculate v(-887). -8 Let d(g) = 56g2 - 89g - 771. What is d(-3)? 0 Let g(l) = 19l2 - 107l - 1204. Determine g(-10). 1766 Let m(v) = 50v + 313. Calculate m(103). 5463 Let x(n) = n3 + 260n*2 + 5220n - 4107. Calculate x(-238). -299 Let h(f) = -31335f + 1002715. What is h(32)? -5 Let y(m) = 132m - 35032. Determine y(265). -52 Let o(u) = u*3 + 29u*2 - 52u - 7. What is o(-21)? 4613 Let s(u) = 156u - 17861. Give s(113). -233 Let r(y) = y3 - 61y*2 + 1232y - 8165. Calculate r(23). 69 Let s(h) = -10h2 + 2387h + 2422. Determine s(-1). 25 Let m(a) = -6a3 - 156a*2 - 38a - 903. Determine m(-26). 85 Let g(d) = 14226d - 796699. Give g(56). -43 Let s(z) = -17z*3 - 12z*2 + 101z - 298. Calculate s(4). -1174 Let w(u) = 14890u + 74357. Determine w(-5). -93 Let c(l) = -2253l + 13637. Calculate c(5). 2372 Let w(k) = -3k2 - 306k + 408. Determine w(0). 408 Let q(x) = -61068x + 366192. Determine q(6). -216 Let w(n) = 29n + 3233. Determine w(-7). 3030 Let z(c) = c*3 + 114c*2 - 1833c - 5271. Give z(-128). -23 Let l(j) = -j*3 + 80j*2 + 1609j - 133556. Determine l(79). -204 Let q(o) = 113440o - 567206. Calculate q(5). -6 Let z(o) = -6217o - 161570. Give z(-26). 72 Let d(u) = u*3 - 16u*2 + 4633u - 115800. What is d(24)? 0 Let l(a) = -339a - 13720. Give l(-40). -160 Let i(k) = 9k*2 - 372k - 1411. Determine i(45). 74 Let a(w) = w*3 - 2w*2 - 130w + 78. Give a(-11). -65 Let u(d) = -7d3 - 3d*2 - 57d + 139. What is u(2)? -43 Let n(s) = 69	{ "pile_set_name": "DM Mathematics" }
f 3? False Let b = -803 + 972. Is b a multiple of 3? False Let j(f) = 60f2 + 23f + 1. Is 99 a factor of j(-5)? True Suppose -2q - 2m + 1570 = -6m, 0 = 4q + 4m - 3080. Is 25 a factor of q? True Let r(d) = 148d + 171. Is 11 a factor of r(12)? True Let v(b) = b*2 + b - 91. Let k be v(0). Let o = -21 - k. Is 7 a factor of o? True Suppose 2r - 6 = -0, 3r - 9 = 2w. Suppose -4x + 58 = x + 3m, m + 4 = w. Is x a multiple of 4? False Let q(x) = -2x3 + 25x*2 + 19x - 22. Does 50 divide q(11)? True Let i(c) = 14c + 7. Let t(h) = -13h - 6. Let p(r) = 5i(r) + 6t(r). Let a be p(5). Does 6 divide (a + 12)/(-1 + 0)? False Suppose 871 = 2t + 4j - 2743, t - 3j - 1782 = 0. Does 113 divide t? False Let n(m) be the second derivative of 1/20m*5 + 11/12m*4 + 5/6m*3 - 7m + 0 - 6m2. Is 13 a factor of n(-10)? False Let g(z) = -64z*3 + 12z*2 + 2z + 4. Is 5 a factor of g(-2)? True Suppose -12u + 50 = -17u. Let h be (6/(-4))/(3/(-160)). Let c = u + h. Is 18 a factor of c? False Suppose 5q + 125 + 55 = 0. Is 4 a factor of ((-68)/132 + 2/11)q? True Suppose 12l = 17l + 470. Let z = -76 - l. Is 3 a factor of z? True Suppose 7n = -304 + 682. Is n even? True Let x = 10 + -7. Suppose -xm - 2m = -10. Suppose -ma - 215 = -6a - b, -4b = a - 65. Is 19 a factor of a? False Let c = -3342 - -3769. Is c a multiple of 20? False Suppose 5z - 23 = 12. Suppose 3n - 99 = q, -3n - 122 = -zn - 2q. Does 16 divide n? True Let l(m) = 714m*3 + 5m - 5. Does 3 divide l(1)? True Suppose -19j = -779 - 13699. Does 47 divide j? False Let p(d) = d3 + 4d*2 - 7d - 6. Let w be p(-5). Suppose 8 = -wk - 32. Let z(y) = -5y + 2. Is z(k) a multiple of 26? True Suppose -4c + 15 = -5n, 0 = -4c - c - 5n + 30. Let h = c + -1. Suppose -5i + 3v + 152 + 118 = 0, 4i - hv - 224 = 0. Does 19 divide i? False Suppose -3y = 3b + 3, 2b = y + 4b + 1. Let j be (y - -3)(9 - -2). Does 7 divide 33/j + 106/4? True Suppose -7y + 683 = -1424. Suppose 4m - y = -5. Is m a multiple of 13? False Let v(k) = 27k - 75. Suppose -3w = -s, w = -4s - 3w + 32. Is 13 a factor of v(s)? False Does 91 divide (-20)/15 + (-820)/(-3)4? True Let c = 3183 + -1637. Is 47 a factor of c? False Suppose -u + 0d = -5d - 168, -u - 3d + 200 = 0. Suppose 4q + 76 + u = 0. Let r = q + 98. Is r a multiple of 14? False Let u(l) = 3l - 47. Is u(25) a multiple of 4? True Suppose 15 = 4h - 3i, -i = 5h - 0i + 5. Is -2 - h - (-49 + 16) a multiple of 31? True Suppose 668 = 3s + 2b + 246, -4b = -3s + 416. Suppose 0 = -4m - 8 + s. Is 14 a factor of m? False Suppose 5u = -5 - 15. Let i be 1(2 - (93 + u)). Let w = -45 - i. Does 17 divide w? False Does 71 divide 262 - (0 - (3 + 1 - 1))? False Let n(y) = 2y3 - 7y - 1. Let b be n(3). Suppose 2f = -3s + 91, -2f = -4s - b - 52. Is 10 a factor of f? False Let x(h) = -h*3 + 3h*2. Let b be x(5). Let k be 540/b(-10)/(-2). Does 14 divide (k + -2)(-2)/4? True Let y be ((-119)/21)/(((-2)/9)/2). Suppose -z + o = -2o - y, 5o - 295 = -5z. Is 18 a factor of z? False Suppose -103y = -87y - 29664. Does 6 divide y? True Let h = -687 + 1264. Is 11 a factor of h? False Suppose 2k - 818 = -16r + 12r, 5k = -4r + 821. Is 17 a factor of r? True Let k be 1 + -6 - (4 + -1). Let h(q) = -q3 + 12 - 9q*2 + 5q + 2q2 + 3q. Is 3 a factor of h(k)? True Let d(i) = 2i - 6. Let v be d(4). Suppose 0 = vr - 3r, 3r + 24 = -4c. Does 26 divide ((-52)/c)/((-2)/(-6))? True Let u = -1322 - -2237. Is 32 a factor of u? False Let f(s) = 12s - 399. Is f(44) a multiple of 14? False Suppose 2d = 0, 4k - 2d = -6 + 114. Let r be k33/9. Suppose -3b + i + 27 = 0, 3b = 3i - 5i + r. Does 2 divide b? False Let u = -10 - 16. Let j = u + 32. Does 2 divide j? True Suppose -m + y + 14 = 0, 5m - y = y + 55. Suppose -1 = 4t - m. Suppose -tv + 222 = 3v - 2h, 2h = -5v + 238. Is 13 a factor of v? False Suppose 3j = 4w + 5j - 260, 0 = w - 5j - 65. Suppose 3v + 5m - 269 = 0, m + w = v - 30. Is v a multiple of 31? True Let w(y) = -y3 + y2 + 5y - 7. Is w(-5) a multiple of 30? False Let x be (2 + -1 - (-5 - -3)) + -223. Does 17 divide (x/6 - 0)(-3)/2? False Let k = 1373 - 1042. Does 18 divide k? False Suppose 1 = 3h - 14. Suppose -hx + x = 0. Does 24 divide (-1 - (x + 1))-36? True Suppose 252r - 4400 = 248r. Does 20 divide r? True Let a be (-23)/(-4) + 12/48. Let h be (-18)/7(-28)/a. Is 6 a factor of 9/(-4h/(-64))? True Let o = 1220 - 680. Is o a multiple of 12? True Let a be ((-78)/8)/(3/(-72)1). Suppose 2y = 2t - 4t + a, 0 = -y. Is t a multiple of 10? False Is 88 a factor of (-6)/14 - (-4 + (-47898)/42)? True Let y = -18 - -20. Suppose t = yt - 678. Does 23 divide (-2)/(-3) - t/(-9)? False Let z = 726 + -458. Is 14 a factor of z? False Let p(u) = -u*2 - 6u - 4. Let o be p(-4). Suppose -i + 38 = -3r - 3, -or + 149 = 3i. Suppose 0 = q - i - 21. Is q a multiple of 20? False Let k(h) = -h2 - h + 10. Suppose 3 = -o - 0. Let v be o - 1 - (-16 - -12). Is 10 a factor of k(v)? True Let b(j) be the third derivative of j7/315 + j6/240 - j5/60 - j4/24 - 3j*2. Let p(r) be the second derivative of b(r). Is p(2) a multiple of 12? True Let i be (-1)/(-5) + 245/25. Is 18 a factor of 16/i(-1215)/(-18)? True Let y(h) = h*2 - 13h + 14. Let j be y(12). Suppose 49 = ja - 133. Is a a multiple of 13? True Let o(f) = -4f2 + f2 - 1055f + 2f*2 + 1036f + 8. Is 5 a factor of o(-19)? False Let b(x) = -29x - 40. Let y be b(7). Let n = -127 - y. Is 29 a factor of n? True Suppose -64w + 66w + 4p - 480 = 0, 0 = w - 3p - 225. Is 78 a factor of w? True Let g = -21 + 31. Suppose go = 8o + 10. Suppose 0 = 5t - 2f + f - 163, -4t + 113 = of. Is t a multiple of 5? False Suppose -u + 3w = w + 11, 4u - 4w = -44. Let n = -12 - u. Let f = n + 13. Is f a multiple of 4? True Let f(z) = -2z2 - 88z + 58. Does 50 divide f(-17)? False Let o be 1(1 - 3) + 1. Is (-4 - (o - 3)) + 18 a multiple of 4? False Let w(i) = i3 - 2i*2 - 2i. Let f be (-14)/(-5) - (-6)/30. Let g be w(f). Is 6 a factor of 2/g(29 - -7)? True Let n = -1154 + 2275. Does 19 divide n? True Let f = -15 - -21. Suppose x - 4x = p + 2, -3p - f = -5x. Does 10 divide (1 - p - 4) + 21? True Let b(y) = 3y3 - 3y*2 + 5y + 4. Does 24 divide b(4)? True Let z(a) be the second derivative of -a*4/12 + 13a*3/3 - 21a*2/2 - 17a. Is z(15) a multiple of 13? False Let r be 0 + (-12)/4 + -1. Let w be 146(6/3)/r. Let f = -39 - w. Does 13 divide f? False Suppose -6p - 265 - 71 = 0. Let n = 82 + p. Is n a multiple of 21? False Is 937 - (6 + -22 + 8) a multiple of 27? True Is 15 a factor of 1 + 4 + 0 - -190? True Suppose 2j + 12 = 26. Let i(u) = 21u - 55. Is 10 a factor of i(j)? False Let o(t) = -t*3 + 13t*2 - 17t - 1. Let k be o(11). Let p = 60 + k. Is 15 a factor of p? False Let a(s) = s*2 + 10s - 9. Let k be a(-11). Suppose -6 - 4 = 5u - 2q, -2u = -kq + 4. Let r(v) = 5v2 + 4v + 2. Is 8 a factor of r(u)? False Let i(g) = 10g3 + g2 + 2g + 1. Let r be i(-1). Let d be ((-2)/6 - 0)/(8/72). Is 6 a factor of (-24)/(r/(-15)d)? True Let r(t) = 23t - 91. Does 5 divide r(62)? True Let a(u) = -u*3 + 4u - 3. Let w be a(2). Let m be 0 - ((-3 - w) + 1). Does 2 divide (2 + m)/(14/70)? False Suppose 39b = 61b - 77946. Is 14 a factor of b? False Let c = 437 - -194. Does 17 divide c? False Let g be 1460/44 - 3/(66/4). Let s = 66 - g. Does 11 divide s? True Suppose -4620 = 7r - 11r - 4b, 3r - 3b - 3447 = 0. Is 12 a factor of r? True Let q = 274 + -218. Is 7 a factor of q? True Suppose 43 = 13n - 74. Suppose 0 = -12r + nr + 108. Is r a multiple of 13? False Let a(g) = -32g - 40. Suppose 4 = -2d - 6. Let i(t) = 13t + 16. Let f(y) = da(y) - 12i(y). Is 16 a factor of f(14)? True Suppose -2718 = -7o + 2833. Is o a multiple of 72? False Let q(d) = -2d3 + 4d*2 - 3d + 2. Let m be q(2). Let g(k) = -2k + 7. Let x be g(-3). Let h = x + m. Is 4 a factor of h? False Let f = -18 + 57. Let a = f - 15. Let m = a + -4. Does 13 divide m? False Let n be 16/7 - 14/49. Let t be n + (2 - (-8)/(-4)). Suppose -tp = 5l - 70, 0l = 3p - 4l - 82. Is 15 a factor of p? True Let k(g) be the third derivative of 11g6/120 - g5/60 - 2g**3/3 - 1	{ "pile_set_name": "DM Mathematics" }
5. Is i4/(-8)-8269 a prime number? True Let v(c) = 44543c2 - 31c + 19. Is v(-3) composite? True Suppose 0 = -22a + 25a - 198003. Is a prime? False Suppose 4z = -4z + 131512. Suppose 4q - 5u - z = 0, -6q + 12338 = -3q + 5u. Is q a prime number? True Let v = -6511 - -11253. Is v prime? False Suppose 2q = 110 - 18. Is (-110914)/(-6) - (q/6 + -7) composite? True Suppose 0 = 60i - 5049202 - 3289418. Is i composite? False Suppose -4i + 5y + 21 + 39 = 0, -4i + 60 = -4y. Let h(n) = 45n - 6. Let d be h(i). Suppose -d = -0s - 3s. Is s prime? True Is (-300464)/(-178) + 13 a prime number? False Let m = -53 - -57. Suppose 5k - 11111 = -3c + 2382, -3c = -3k - 13533. Suppose -mf = -10f + c. Is f prime? True Suppose -5j = -7j - 8, -5s - j + 186 = 0. Let o(r) = -r*3 + 39r*2 - 8r + 51. Is o(s) a composite number? True Let y(g) = 22g - 44. Let v be y(2). Suppose -p + 1317 + 34 = v. Is p a composite number? True Suppose 0 = -33a - 74586 + 187281. Let l(u) = -2u - 7. Let t be l(-6). Suppose -2m = td - 2563, 3m + 2d - a = 424. Is m prime? True Suppose 0 = 9a - 2a. Suppose -p - 2 = 0, a = -3j - 2j - 3p + 4529. Is j a composite number? False Suppose 11f = 33 + 55. Suppose 50q = fq + 13188. Is q a prime number? False Let t = 1459444 + -401853. Is t prime? False Suppose 5g = -v - 3v + 14547, 5v = 2g - 5832. Suppose 2w + g = 337. Is (-5)/(5/2) - w prime? False Let z(k) = 10 + 9 - 6 + 3k - k + 124k*2. Is z(7) composite? True Let h(x) = -2x*2 + 3x + 17. Let s be h(-3). Let a(c) = -26c - 7. Is a(s) a prime number? False Suppose -2061v + k = -2062v + 1036675, -3k = 4v - 4146706. Is v a composite number? False Let t be 9/(-12) - -2(-14028)/(-32). Let c = t - 226. Suppose 242 = 2s - c. Is s a composite number? True Let k(w) = 36w - 175. Let i be k(5). Let a = 1872 - i. Is a prime? True Is 244/183(-3)/(-16)867572 prime? False Let j(r) = r*3 + 18r*2 + 14r - 22. Let q be j(-17). Let y = 594 + q. Is y composite? True Let g = -303985 + 696638. Is g composite? True Suppose 129763 + 294233 = -60l + 72l. Is l composite? True Suppose 2086331 + 472731 = 22v. Is v composite? True Suppose -2k + 7 = -d, 6k - 4k + 2d = 4. Suppose 5p - 5w - 5585 = -7w, kp + 3w = 3342. Is p composite? True Let u(h) = -16h3 - 15h*2 - 127h - 721. Is u(-13) composite? False Suppose 3u = 511 + 650. Let z = 324 - 562. Let o = u + z. Is o a prime number? True Let x(v) = 17v*2 + 112v - 74. Is x(39) prime? False Let p(m) = 48m2 + 4m + 291. Is p(-16) composite? True Let j be 156/36 + (-4)/(-6). Suppose -jp - 7193 = -5b - 2013, -b = 2p - 1051. Is b composite? True Let t(u) = 11u*3 - 2u*2 + u + 2. Let j be t(-1). Is (20973/6)/((j/(-2))/36) a composite number? True Suppose -3h + 35 = -16. Suppose -hq + 6q = -29183. Suppose -8948 + q = -5k. Is k a prime number? True Let m = 6515 + 45494. Is m a composite number? False Suppose -236 + 816 = 5v. Let u = 3599 + -3550. Let h = v - u. Is h a prime number? True Let u be (-35)/(-14)(-8)/30-6. Let v be 8 - (u + 1) - (-1 - 13). Suppose -vt + 267 = -14t. Is t a composite number? False Suppose 86h + 39604 = 89h - 5q, -5h + q = -65992. Is h a composite number? True Let a be (-6)/42/(-3). Suppose 238 = -4o + 2q + 390, q = -3o + 99. Is 8277(a/(-4) + o/60) a prime number? False Let y(t) = 17t*2 - 466t + 6958. Is y(15) composite? False Is (137180 - ((4 - 9) + 6))1 a prime number? False Suppose -5y - 261 = 2q, -2y - 90 = -2q - 2q. Let i = y - -63. Let z = i - -211. Is z a prime number? True Suppose -2n + 5n = -1022173 + 2512000. Is n composite? False Suppose 3v - v - 2448 = 0. Let q = v + -575. Is q prime? False Is (-212)/(-212)(-40954)/(-4)2 a prime number? True Let h(f) = 20f - 1876. Let s(n) = 7n - 625. Suppose 7j = 5j - 12. Let l(y) = jh(y) + 17s(y). Is l(0) a composite number? False Let w = 33247 - 13975. Suppose 0 = -2g - 4f + 19278, 2g - 2f = -0g + w. Is g a composite number? True Suppose 5971884 = 10g + 8g - 1469514. Is g composite? False Let x = 24 - 73. Let a = x - -52. Suppose 5j - al = 1576, j = 2l - 6l + 329. Is j a prime number? True Suppose 199y + 60007021 - 266517480 = 0. Is y a composite number? False Let k(d) be the first derivative of d3/3 - 13d*2/2 - 26d + 9. Let j be k(15). Is (-4 + 6)3674/j a prime number? False Let n(u) = 103u*3 + 27u*2 + 15u. Let v(x) = -51x3 - 13x*2 - 8x - 1. Let o(d) = -2n(d) - 5v(d). Is o(7) prime? False Suppose 2d = 3h + 20486 + 124382, 3d + h = 217291. Is d prime? True Let l(q) = q - 1. Let z be l(7). Let i be (34/z)/1 - (-4)/(-6). Suppose x = ij - 14, 30 = 3x - j + 2. Is x a prime number? True Let q(x) = -33x*2 + 5 + 3 + 31x*2 + 3x*3 + 2x. Let a be q(7). Is (-3 - -8 - 4)a prime? True Let r = -103407 - -239285. Is r composite? True Suppose -11j + 4 = -7j. Suppose 0 = p - j, 12 = f + 3p + 6. Suppose 0i + 5i + 12647 = 4v, i + 9488 = fv. Is v composite? False Let w = -1929709 - -3421638. Is w composite? False Suppose -12x + 99120 = 12924. Is x prime? False Let x(d) = -d2 + 10d - 14. Let o be x(8). Suppose -ok = -k. Is 686 - (-3 + 4 + k) prime? False Suppose 0 = -2k - 90. Let h = -45 - k. Is -4 - ((h - 5) + -2776) a composite number? False Suppose 5v - 66935 = 3q + 24579, -q - 3 = 0. Is v prime? True Suppose 2f - 25968 = -4v, -3f + 5v + 51897 = f. Let j = -9145 + f. Is j composite? False Suppose -50047 = -5f + 6s - 10s, -s - 30018 = -3f. Is f prime? True Let v = -70 - -77. Suppose -m - 28164 = -vm. Suppose -5o = -a - 5040, -m + 648 = -4o - 2a. Is o prime? True Suppose -3f = 3n - 120813, 30 = -155n + 150n. Is f a prime number? True Is (172 - 343898)/(0 + 8)-4 prime? True Suppose 114u - 135u = -487767. Is u a prime number? True Suppose -2j = -3z - 25, 2j + 5 = 4z + 35. Suppose 5p + jg - 40730 = 0, 2p - 21703 = -5g - 5414. Is p composite? False Suppose 5g - 75 = -30. Suppose 3 + 6 = -gd. Is (-2 - d)/(-4 - (-23673)/5919) composite? False Let b(u) = -u3 + 2u. Let m(l) = -5l - 13. Let i be m(-3). Let a be b(i). Is a/2 + 14707/7 a composite number? False Let u(x) = 186x + 4 + 21 - 12x + 14x. Is u(8) a composite number? True Suppose -6z = 5u - 3z - 12, -7 = -4u - 5z. Let v(t) = -718t + 5. Let l be v(u). Let q = -708 - l. Is q prime? False Suppose -26y + 342 = -17y. Is 38/y - (296 + 2)-4 composite? False Let p(j) = -231j - 35. Let f(z) = z*2 - 2z - 19. Suppose 5n = 5r + 45, 6 = -2n - 6r + 2r. Let o be f(n). Is p(o) a composite number? True Let h(f) = 52f + 21. Let i be h(-6). Let v be i(-2 + 0)/(-4 + -2). Let u = v + 404. Is u prime? True Let g(j) = j3 - 6j*2 + 3j + 8. Let w be g(5). Let z(a) = 737a2 + 2a + 5. Let m be z(w). Suppose 4h - k - m = 0, 2k + 0 = -2. Is h a composite number? True Suppose 0 = 9h + 239829 - 367972 - 1400336. Is h a composite number? False Let g = 56691 + -20044. Is g a prime number? False Let x(k) = -2 - 66 - 34 + 11 - 18k. Is x(-19) a composite number? False Suppose 0 = -47v + 1523562 + 99536. Let l = v - 18851. Is l prime? True Let d(o) = 2o*3 - 24o*2 + 18o - 20. Let g be d(11). Is g/(-96) - 33043/(-3) a composite number? True Suppose 5x + 16 = 2u, -4u + x = -5u + 1. Let n(j) = 60j3 + 3j*2 - j - 2. Let h be n(u). Let k = 2979 - h. Is k composite? True Suppose 0o - 3o = -4y + 933, 3o - 3y = -936. Let m be 21(-2)/((-12)/o). Let n = 22 - m. Is n composite? False Let m = 9155 + 3600. Suppose -m = -12l + 20209. Is l a prime number? False Suppose 0 = -6y + 58 - 10. Suppose -5h + 16 = -2n, 5h - 2n - y = 4h. Suppose -hm = -4i - 3170, 6340 = m + 3m + 5i. Is m a prime number? False Let s(r) = -167r - 63. Let n(u) = u - 2. Let j(z) = -n(z) - s(z). Is j(6) a prime number? True Let o(p) = -91363p - 1888. Is o(-3) composite? False Suppose 6m - 33q - 272679 = -28q, q = 3m - 136344. Is m a prime number? False Let r(q) = 8 - q2 + 4q*3 - 65q + 85q - 24q. Let m = 7 + -2. Is r(m) prime? True Is 72421/15(8 + 7) a composite number? False Suppose 5j - 2037 = -c + 857, 2c + 3j - 5774 = 0. Suppose -c = 3f + 1319. Let z = -604 - f. Is z composite? False Let o be (-20)/25 - (-540)/50. Is 4/o + 4285/7527 prime? True Suppose -4*k	{ "pile_set_name": "DM Mathematics" }
2 + 15o + 2. Let y be m(-15). Solve -y = -d - d for d. 1 Suppose -5b + 8 = -b. Let n = 16 + -8. Solve -2s - n = bs for s. -2 Let d(t) = t + 7. Let p be d(-6). Let a = -18 + 21. Solve -2r = p - a for r. 1 Suppose -4j - 1 = z - j, -4j = 3z - 12. Solve -5f - z - 12 = 0 for f. -4 Let z be (-38)/(-12) + 13/(-78). Let t be (0/z)/(-2 - -3). Solve -5 = c - tc for c. -5 Let s = -30 + 30. Solve s = k + k for k. 0 Let t = 4 - -1. Solve -t = 2c + 3 for c. -4 Let z = -26 - -41. Solve -3d = z - 0 for d. -5 Suppose 4a - 3l - 12 = 0, l - 1 = 3a - 5. Let f(v) = v2 + 4v + 4. Let i be f(-3). Let y be 1(a + 0/i). Solve 4 = k - y for k. 4 Suppose 73 = 5d - 12. Suppose 2v = 3v + 5x - d, 13 = 5v + x. Solve -m = -vm + 4 for m. 4 Let o(i) = -i3 - 4i*2 + 4i - 3. Let d be o(-5). Let p = -50 + 53. Solve y = -dy + p for y. 1 Let z(y) = -y3 - 12y*2 - 20y + 2. Let h be z(-10). Solve hu - 12 = -u for u. 4 Let y be (-1)/(-1)(-1 - -1). Solve y = -3n + n - 2 for n. -1 Suppose 0 = g + 5q + 12 + 3, 4q = -4g - 12. Let y be 7 + (g/3)/1. Suppose -2n - y = -2r - 1, 0 = 3n - 12. Solve -2i = -ri - 15 for i. -3 Let l = 11 + -7. Solve -u + 15 = lu for u. 3 Let q(u) = 2u + 23. Let s be q(-10). Solve -s = -3f + 6 for f. 3 Suppose -3r - 12 = -6r. Let d(h) = h*2 - 2h - 7. Let t be d(r). Solve -c - 2 + t = 0 for c. -1 Let z(i) = i*3 - 4i*2 - 3i - 6. Let h be z(5). Let d(s) = s*2 - 4s + 2. Let l be d(h). Solve k = -3 - l for k. -5 Let q = -37 - 15. Let p be q/(-12) + (-1)/3. Suppose 3f = -12, -pd + 2 = -2d + f. Solve 5o = -d + 18 for o. 3 Let x be ((-8)/18)/((-2)/9). Suppose 3 + 3 = 3h. Solve hf = -xf - 4 for f. -1 Let b = -15 + 20. Solve -3 = bl - 4l for l. -3 Suppose 5p = -2c + 9, -c + 0c + 3p - 12 = 0. Let j be (c/(-1) - 2)/(-1). Let r = 4 + j. Solve 0y - ry = -15 for y. 5 Let k = -118 + 121. Solve 0 = -kj - 2j + 15 for j. 3 Suppose 3r = 59 - 14. Solve -f = 2f - r for f. 5 Let t = 1 + -2. Let b(d) = 4d*2 + d + 1. Let a be b(t). Suppose -c + 3p - 6 = 4c, -2p + 4 = -4c. Solve c = -aj - j for j. 0 Let s(l) = 4l + 2. Let y be s(2). Let w be 9/(-15) - (-166)/y. Solve a + w = -3a for a. -4 Let q(c) = c*3 - 8c*2 + 8c - 9. Let a be q(7). Let f = -2 - a. Solve f = 6s - 2s - 8 for s. 2 Suppose -4 = x + 1. Let g = x - -13. Solve 0 = 2m - 0m - g for m. 4 Let q(r) = r - 9. Let o be q(11). Solve 0a + a + o = 0 for a. -2 Suppose -3d + 0d = -27. Solve 2g = -g - d for g. -3 Let v be 3/90 - -4. Suppose 12 = 3d - 0d - 2f, 12 = -vf. Let j = d + -2. Solve jh = h for h. 0 Let x = -47 - -63. Solve -x = -3y - y for y. 4 Let v(s) = -s + 7. Let c be v(4). Solve -cp + 4 = -5p for p. -2 Let o(f) = 45f - 11. Let s(y) = -22y + 5. Let i(k) = 6o(k) + 13s(k). Let u be 2/(-5 - (0 - 3)). Let t be i(u). Solve 4r - t = r for r. 5 Let r(q) = -q - 6. Let a be r(-9). Solve -3u + a = -3 for u. 2 Suppose 2c + c = -f + 5, 2f = 2c + 2. Suppose -t + 75 = 4t. Let x be (-37)/(-7) - 2/7. Solve xp + t = fp for p. -5 Let x(g) = g - 3. Suppose 2p + 4r = 14 - 0, 4r + 1 = 3p. Let t be x(p). Let s be (1 - t) + 4 + 7. Solve -4d + 0 = -s for d. 3 Let v be ((-4)/10)/(1/(-5)). Solve 3j - v = -8 for j. -2 Let a = -140 - -141. Solve 0 = -3o + 2 + a for o. 1 Let w be 3 - (-2 + 0)1. Suppose 4k = -2r + 14, -2k + 5r + 1 = -0. Solve ku - w = 4 for u. 3 Let c = 16 + -16. Solve c = 3x + 3 + 9 for x. -4 Let w = 19 + -16. Solve -4g + wg = 3 for g. -3 Let i = 20 - 20. Solve 0c + c - 5 = i for c. 5 Let y = -64 + 68. Solve 0x = yx - 4 for x. 1 Suppose -3t - 16 = -7t. Solve -td + 6 + 10 = 0 for d. 4 Suppose -4 = w - 2n, -9 = 3w - 0w - 5n. Suppose -w - 2 = -x, -38 = -5a + 3x. Suppose -6m + 3i = -4m - 10, -3i = 6. Solve a = mb - 0b for b. 5 Let g = -25 - -28. Solve gk = k - 8 for k. -4 Suppose -w - 11 = -4k, -11 = -w - 2w + k. Suppose -wx + 3 = -17. Let y = 7 - x. Solve -yz = z + 16 for z. -4 Let m be (-4 + (-27)/(-6))8. Solve 4o + 0o = -m for o. -1 Let u(v) = -4v - 5 + 2v + 2v - v. Let l be u(-10). Solve 2 = 3a - la for a. -1 Let y = -7 + 10. Suppose 0 = 2f - 3f + y. Solve fx = -x for x. 0 Suppose 0 = -h - 0h. Suppose q - 3 = -h. Suppose -3y + q = -v - 0v, 4 = 4y. Solve 3 = 3d - vd for d. 1 Let j(q) = -q + 1. Suppose -4 - 2 = 3v. Let k be j(v). Suppose -kw = -12 - 0. Solve -2d = -wd for d. 0 Suppose -6s = -5s. Let p = 7 + -1. Let o = -12 - -15. Solve sv - ov = p for v. -2 Let u(c) be the third derivative of -c4/12 - 4c*3/3 - 3c*2. Let v be u(-5). Solve 0 = -3s + 2s - v for s. -2 Suppose 2 = u - 3. Suppose u = 4a + 1. Suppose -3v + 27 = -0v. Solve 5t = -v - a for t. -2 Let k = 0 - -28. Suppose 0 = -3a + 3j + 48, 3a - 4j - 18 - k = 0. Solve 5v - 2 = a for v. 4 Suppose -16 = -2u + 4a, -2u = -7u + 4a + 28. Solve -c + 5 = uc for c. 1 Let c(b) = 6b2. Let a be c(-1). Solve d = -d + a for d. 3 Let t be (-40)/(-260) - (-308)/26. Solve 2c = -2c + t for c. 3 Suppose -15 = 3t - 4t + 2z, -4z = 3t - 5. Suppose -3x + 5m + 35 = 0, -x - 4x = 5m - 45. Solve x = -2o + to for o. 2 Let i(j) = 2j3 + 1. Let f be i(1). Solve -l - f = -4 for l. 1 Let a be 9/12 + 77/4. Solve 3o + a = -2o for o. -4 Let c(g) = -g2 + 4g. Let u be c(4). Suppose r + u = 4. Solve -r = -3m + 11 for m. 5 Let v(p) = -8p*3. Let q be v(-1). Suppose -4l + 15 = 3. Solve h - q = -lh for h. 2 Let k be 2 - (4 + -2)/(-1). Suppose -3q = -kq + 5. Solve -qj - 3 = 2 for j. -1 Suppose -2s - 3s + 10 = 0. Let g be (-10)/428/(-5). Solve -s = 4b - g for b. 3 Suppose -5r + 30 = 3u, 0r - 5u + 20 = 5r. Let z = r + 16. Solve h = -4h + z for h. 5 Let f = -1 + 1. Let n be -11 + (5 - 2). Suppose nb = -fb. Solve 2o + 6 + b = 0 for o. -3 Suppose 0 = -6j + 3j. Solve jy + 20 = -5y for y. -4 Suppose -14 = -3g + w, 0 = -0g - g + 5w + 28. Solve 20 = h + gh for h. 5 Let y be (-12)/(-30) - (-4)/(-10). Let a be y + 2 + (2 - 3). Let v = a + 2. Solve -vh = h for h. 0 Let o(f) = f2 - 7f - 5. Let k be o(8). Let h(v) = -v*3 - v + 0v*k - 5 + 3v*2 + 3. Let q be h(2). Solve q = 3i - 0i + 6 for i. -2 Let d(z) = -z - 1. Let u be d(-7). Let b(p) = -p2 - 13p - 8. Let t be b(-12). Solve -tq + 2 + u = 0 for q. 2 Let s = 12 - 3. Solve -sa = -10a for a. 0 Let v = 6 - 1. Suppose 0i + 10 = vi. Solve 0 = 7m - im for m. 0 Let x(g) = g3 + 6g*2 + 6g + 10. Let y be x(-5). Solve -20 = -5m + y for m. 5 Let r be 3/12 - 310/(-8). Suppose -9 + 27 = 3c. Suppose -r = -5m + c. Solve -1 = -2n + m for n. 5 Let k be 1 + 2-1 + -1. Let m be 4k(-2)/8. Solve 4f + m = 2f for f. -1 Let x = 18 - 16. Solve -3n = -10 - x for n. 4 Suppose -3t = 12, -3k + 2t + 0t + 17 = 0. Suppose -kn = -8n. Suppose v - 6v = n. Solve v = 2s + 4 - 10 for s. 3 Let d be (-18)/(-8) + 3/(-12). Solve -r - dr - 3 = 0 for r. -1 Suppose -6 = h - 0h - 2s, 5h + 3s = -30. Let w(j) = -j3 - 7j*2 - 7j. Let o be w(h). Solve 0 = 2x - ox for x. 0 Suppose 0 = 3m - 5 - 1. Suppose mw + 5 = 15. Solve -wu = -1 + 16 for u. -3 Suppose -9 = -3f, -f - 26 = -5r + 1. Suppose -5t + 3y = -73, -2y = -3t - 0y + 44. Suppose 3s = -2 + t. Solve -o = -so - r for o. -2 Suppose 0 = -2d - 8l + 3l + 10, 4l - 8 = 3d. Solve d = 2h - 1 + 11 for h. -5 Let f(h) = h - 5. Let q be f(0). Let z = 7 - q. Solve -4t - z = 4 for t. -4 Let n = 93 + -91. Solve -o - no - 3 = 0 for o. -1 Suppose -1 = -2g - 0o + 3o, -o = -3g + 5. Solve 2r = -g + 6 for r. 2 Let f = 8 - 5. Suppose 0 = 3v - 6, q + 7 = 3v + v. Let l be 4q + 1 + 1. Solve a + l = fa for a. 3 Suppose 5n - 28 = g, -5n + 3g = 7 - 41. Suppose 4k - 4m = -40, -2k + 2 = -nm + 37. Let v = k + 5. Solve h + 4h + 15 = v for h. -3 Suppose 2r - 4n = -10, 3n - 20 = -0r - r. Suppose 4c = -12, 4j - 3c - 2 = -r. Let f be 3 + j/((-9)/(-3)). Solve 0 = -fl - 0 - 10 for l. -5 Suppose 2q - 3q = -32. Suppose 6y - q = 2y. Suppose -2g + 6g = y. Solve 0 = gk + k + 15 for k. -5 Let m(o) = -o - 2. Let h be m(-5). Solve 1 + 2 = -ha for a. -1 Let q(h) = 5h + 37. Let b be q(-7). Solve 0 = bk - 7k - 20 for k. -4 Suppose 2m + 0m = u - 6, -3u - 3m - 9 = 0. Let o(g) = ug2 - 4 + g2 - 3g + 2g. Let n be o(3). Solve -4f + 2 = -n for f. 1 Let k(j) = 2*j - 11. L	{ "pile_set_name": "DM Mathematics" }
7v = 3o - 97, -4v + 140 = 4o. Suppose -7n = -o + 4. Suppose -ns = s - 474. What is the tens digit of s? 7 What is the tens digit of -20(-17)/255 - 58756/(-6)? 9 What is the hundreds digit of 6/(90/126381) - 2/5? 4 Suppose 3i = s + 15557, 42s - 39s = 4i - 20746. What is the units digit of i? 5 Let s be -187(-6 + 6 + -11). Suppose l + v = s, -l + 2081 = -9v + 4v. What is the units digit of l? 1 Let r(o) = -27o - 48. Let p be r(2). Let j = 119 - p. What is the hundreds digit of j? 2 Let j(p) = -p3 - p2 + p + 1. Let h(v) = -26v*3 + 6v*2 - 4v - 12. Suppose 12n = 5n - 7. Let r(w) = nh(w) - 6j(w). What is the units digit of r(2)? 8 What is the ten thousands digit of 17910 - (-10 + 9)7? 1 Let d be (-4)/((-2)/(-4)(-11 + 10)). Suppose -dy + 3846 = 286. What is the tens digit of y? 4 Let o(q) = q2 + 13q + 16. Let w be o(-12). Suppose -wm - 1308 = -2u, 2u - m - 1305 = 2m. What is the hundreds digit of u? 6 Suppose 29338 = 12x + 418. Let w = x + -1333. What is the thousands digit of w? 1 Suppose -21f = 10f - 124. Suppose -884 = -fr - b, -4b = 3r - 4r + 221. What is the tens digit of r? 2 Let f(s) = -477s + 3225. What is the thousands digit of f(0)? 3 Suppose -25t = -34t + 171. Suppose c = -5, 5d + tc - 16c - 2990 = 0. What is the hundreds digit of d? 6 Let k(a) = a3 + 7a*2 + 2a - 2. Suppose -16 = -4v - 116. Let i = 20 + v. What is the units digit of k(i)? 8 Suppose w - 11864 = -2q, 2w + q - 9900 = 13807. What is the hundreds digit of w? 8 Let k = -41 + 48. Let m = k + -3. Suppose -85 = -n - ms, -2s = n - 0n - 77. What is the units digit of n? 9 Suppose 7f = 3f + 480. Let u = f + -23. What is the units digit of u? 7 Let d = -536 + 540. Suppose 0 = 14w - dw - 10370. What is the hundreds digit of w? 0 Let o(s) = 241s3 - 4s*2 - 47s + 71. What is the tens digit of o(5)? 6 Let a = 0 - -4. Let d be ((1 - -1) + 2)6/a. Suppose dx - x = -2u + 175, 2x = -5u + 406. What is the units digit of u? 0 Suppose -45k = -47k. Suppose k = 14w - 6w - 3296. What is the units digit of w? 2 Let m(n) = -n3 - 46n*2 + 48n + 77. Let j be m(-47). Let w be 0 - -2 - (3 + -2). What is the units digit of (w - -157) + 1012/j? 2 Suppose -5371 = -9m + 4889. Suppose m = -40h + 55h. What is the tens digit of h? 7 Suppose 1089 = -6m + 3m. What is the units digit of -1 + 0 + 3 + (-4 - m)? 1 Let h = 3948 + 5098. What is the tens digit of h? 4 Let m = 12116 - 5661. Suppose -1919 + m = 6u. What is the tens digit of u? 5 Suppose 0 = 3h - 6h - 24. Let g(d) = -d3 - 10d*2 - 12d + 8. Let j be g(h). What is the hundreds digit of (104/j)/(0 - (-1)/(-33))? 1 Let a(h) = -5h3 - 2h*2 + 9h - 10. Let g be a(9). Let c = 2116 + g. What is the units digit of 3 + (4/6)/((-9)/c)? 3 Let r = 2327 + 2307. What is the tens digit of r? 3 Let u(i) be the third derivative of 19i6/360 + 19i*5/120 + 11i*4/8 - 37i*2. Let v(n) be the second derivative of u(n). What is the tens digit of v(5)? 0 Let c = 59 + -52. Let b(j) = -2j + c + j*2 - 2j + 5 - 3. What is the units digit of b(11)? 6 Let y be -15 + 616/42 + (-5695)/(-3). Suppose 12t + y = 13670. What is the hundreds digit of t? 9 Let c(z) = -657z - 69. What is the tens digit of c(-9)? 4 Let i be ((-10)/(-5) - -2)/((-1)/(-326)). Suppose 9u + 1774 = -i. Let l = 574 + u. What is the hundreds digit of l? 2 Let j be ((-4)/(-10))/((-1)/(-40)) + -3. Suppose -jg = -1745 - 1271. What is the tens digit of g? 3 Let v = 16475 - 16126. What is the hundreds digit of v? 3 Suppose 0 = -12d - 3649 - 2507. Let t be 1 - -21/2. What is the tens digit of (-2)/(t + (-5)/((-1275)/d))? 7 Let t(h) be the first derivative of -3h2 - 68h - 38. What is the units digit of t(-12)? 4 Suppose h = 5k + 3698, -1 + 29 = 7k. What is the tens digit of h? 1 Suppose 85663 = 4b + 3b - 64746. What is the units digit of b? 7 Suppose -53562 = -14h + 106080. What is the hundreds digit of h? 4 Let w = -57 + 155. Let q = 45 + w. Suppose 5y - 4y - 2p = 32, 4y - 5p - q = 0. What is the tens digit of y? 4 Suppose 0h - 1008 = 2h. Let r = -145 - h. What is the tens digit of r? 5 Suppose -2z + 2n = -80600, -5z - n = 5067 - 206549. What is the thousands digit of z? 0 Suppose 2 = 2k, 0 = -3l - k + 48292 - 7215. What is the thousands digit of l? 3 Let p = 634 + 656. What is the hundreds digit of (-1)/2 - p/(-4)? 3 Let g = -211 + 314. Suppose j - 101 + g = 0. What is the units digit of ((-938)/(-9) - -7) + j/9? 1 Suppose 36647 + 18905 = 4y. Suppose 35b - 7b - y = 0. What is the units digit of b? 6 Let g(h) = -17h2 + 23 - 3h + 61h2 - 25h*2. What is the tens digit of g(6)? 8 What is the units digit of 7761(4 + -3) - -14? 5 Suppose -2p + 1 = -3q + 7, 5q = -3p + 10. Suppose -3f - f + 4c = p, f = -3c. What is the tens digit of 120/(-3)(0 + -4 + f)? 6 Suppose 5s - 20 = 0, -x + 3x + 8 = 4s. Suppose 2u - z = 1202, 366 + 1426 = 3u + xz. What is the tens digit of u? 0 Suppose -4z = -12, 4q + z - 1 - 10 = 0. Suppose 687 = v + qk, -3k - 5 + 17 = 0. What is the hundreds digit of v? 6 Suppose 18999 = -0b + 3b + 4z, 2z + 25288 = 4b. What is the hundreds digit of b? 3 Suppose -3r = 4n + 17, 2r + 2n = -22 + 12. What is the tens digit of ((-13)/r)/(31/3999)? 5 Suppose -309233 = -48j + 9775. What is the units digit of j? 6 Let y = -2225 + 3849. What is the tens digit of y? 2 Let m = 345 - 347. What is the units digit of -1 + -1 + (m - (-672 + 3))? 5 Suppose -4470 = -3w - 3w. Suppose -5n - m + 938 = 0, -w = -4n + 5m - 4m. What is the hundreds digit of n? 1 Let v(a) = -a*3 - 3a*2 + 27a - 2. Let u be v(-7). Suppose 0 = b - x - 486, u = -3x - 4. What is the hundreds digit of b? 4 Suppose -27m + 169018 = -0m - 65855. What is the units digit of m? 9 Suppose -4b + 113p - 115p = -68, -4b = 3p - 70. Suppose 29 - 5 = -4z. Let y = z + b. What is the units digit of y? 0 Suppose -12881 = -3f - 2m, 54f - 5m = 49f + 21435. What is the hundreds digit of f? 2 Suppose 0 = -4b - 2q + 28806, -3q + 13549 = 5b - 22456. What is the units digit of b? 4 Let z = -234 - -208. What is the tens digit of -203z/6? 6 Let t be (-23 - -25) + -2 + -1 + 3. Suppose -th - 2u = -698, 2u + 258 = 2h - 440. What is the tens digit of h? 4 Let p(k) = -3k - 5. Let i(y) = 2y + 3. Let t(x) = -9i(x) - 4p(x). Let w be t(-8). What is the units digit of w + 0 - (3 + 2)? 6 Suppose -3r - 2p + 73173 = 0, -187r + 5p = -186r - 24408. What is the units digit of r? 3 Suppose 124w + 32w = 29w + 3580638. What is the ten thousands digit of w? 2 Let f be 2441(1 + 0). Let x(u) = -82u + 92. Let w be x(3). Let m = w + f. What is the units digit of m? 0 Suppose d - 3f - 18243 = 0, -5f - 230 = -210. What is the hundreds digit of d? 2 Let h be 4/6(-2 + 28/8). Let r(s) = 6s3 + 4s*2 - 5s + 3. Let n be r(h). Suppose 2z = 4d - 28, -5z = -7z + n. What is the units digit of d? 9 Let g = -85190 - -161865. What is the tens digit of g? 7 Let y = 5797 - -4093. What is the tens digit of y? 9 Suppose 0 = -14p - 4p + 104236 + 236918. What is the ten thousands digit of p? 1 Let d = 33890 + -10487. What is the tens digit of d? 0 Let b(r) = 75r3 - r2 + 39r - 263. What is the thousands digit of b(6)? 6 What is the hundreds digit of (-11 - (-475)/38)/(156278/78136 - 2)? 5 Let d(p) = 10p - 25. Let c be d(4). What is the tens digit of 5387/c + 9 - 4/30? 6 Suppose -2w + 4w = w. Suppose -4o = 0, -z + 2 = -wo + o. Suppose 0 = -9f - zf + 715. What is the units digit of f? 5 Let f be 11/(33/6) + 70/2. Suppose f = 4w + 33. What is the hundreds digit of w/(-4) + (-5993)/(-52)? 1 Suppose 3x = 2o - 0 - 2, 2o = -2x + 12. Let c be (-6 + x + -98)1. Let a = -46 - c. What is the units digit of a? 6 Let d(r) = -3r*3 - 2r*2 - 2r - 381. Let w(m) = -10m3 - 6m*2 - 6m - 1144. Let c(y) = -16d(y) + 5w(y). What is the tens digit of c(0)? 7 Suppose 0 = 64u + 8704 - 91072. What is the units digit of u? 7 Let k = 589 - 586. Suppose -3n - 2n + 65 = -5f, 0 = kn - 5f - 41. What is the tens digit of n? 1 Let l(t) = t*2 + 5t - 33. Suppose 0 = -4k + 3v + 54, -2v = 4k - 4v - 56. What is the units digit of l(k)? 7 Let x be ((-3)/(-3))/(-1 + 280/278). Suppose -3b + 6*b = 201. L	{ "pile_set_name": "DM Mathematics" }
+ 3q + 19. Is n(-3) a multiple of 11? True Let x(g) = 0g*2 - 2g*2 - 2g + g + 3g2 - 16. Let p = 311 - 317. Is x(p) a multiple of 26? True Let v(w) = -2w*2 + 5w + 4. Suppose -14 = -3p + 1. Let c be v(p). Is (-1 + 16/(-6))/(1/c) a multiple of 7? True Suppose 4d + 30840 = 2b, 5b - 44350 = -2d + 32774. Does 16 divide b? True Let t(i) = 345i + 37. Is t(13) a multiple of 133? True Let w(x) = x*2 - 4x + 7. Let c be w(-18). Suppose -9s - c = -2239. Suppose 3h = 4t - s, 5t + 4h - 182 = 42. Is t a multiple of 16? True Suppose 0f + 2f = -s - 6, s + 18 = -5f. Let l(p) = 6p2 + 2p + 7. Let a be l(f). Let q = a - -9. Does 13 divide q? True Let u(a) be the second derivative of 25/2a2 + 10/3a*3 - 1/12a*4 + 0 + 24a. Is u(21) even? True Let j be (-14(-3)/(-8))/((-15)/(-40)). Is 66 a factor of 10020/8 + (-21)/j? True Let y(b) = -3b - 13. Suppose -3k + 5w + 5 = -33, w - 26 = -5k. Let c be y(k). Let s = c + 136. Is 9 a factor of s? False Let f(n) = -2n + 87. Let y be f(3). Let q = 30 + y. Is 24 a factor of q? False Suppose -80604 + 2196 = -99z. Is z a multiple of 21? False Suppose 0b + 8b = 0. Suppose b = w + 2j + 1 + 7, -4w = 5j + 20. Let m(z) = -4z + 50. Is 5 a factor of m(w)? True Let a = -613 - 625. Let d = 1775 + a. Does 19 divide d? False Suppose -4h = -3s - 79, -2h - 6s = -s - 33. Suppose -32 = -m - 2j, -m + h = m - 5j. Is m a multiple of 2? True Let h(y) = -26y + 81. Let r be h(3). Suppose -4q + rz = 1362 - 4262, -q = -4z - 712. Does 26 divide q? True Let a(n) = -11n - n - 7n - 8 + 30n. Let r be a(4). Suppose ru + 42 = 37u. Does 6 divide u? True Is (-240941)/(-153) - (7 + (-390)/54) a multiple of 7? True Let w(p) = 218p + 3. Does 15 divide w(9)? True Let c be 138/115(-20)/(-6). Let h(y) = y*3 - 4y*2 + y + 1. Let k be h(c). Suppose -ki + 46 = -149. Is 9 a factor of i? False Let r(g) = g*3 - 2g*2 - 2g + 9. Let b be r(2). Let v(n) = n*3 - 3n*2 + 6n - 5. Is 15 a factor of v(b)? True Let x be 30/(2 - 4) - 3. Let j be 4/x - 112/63. Is 4 a factor of j/(-3) - 804/(-36)? False Let w(k) = -28k - k2 - 59 + k2 + 20 + 3k*2. Is 11 a factor of w(18)? True Let u be (-8)/3-2128/784. Let y(o) = o3 + o + 5. Let i be y(0). Suppose 1 = -ub - 5, -iw = 4b - 28. Is w a multiple of 8? True Suppose 88 = -33k + 41k. Let j(r) = r*2 + 8r - 65. Is 8 a factor of j(k)? True Let k = 33195 + -31372. Is 2 a factor of k? False Let o be (1 - 57/(-9))87. Let j = -404 + o. Does 8 divide ((-4)/12)/((-3)/j)? False Let o be 4 - 1 - 5 - 22. Suppose 168l - 181l = 56680. Does 11 divide l/o - 2/3? False Suppose -5k + 413244 = -14p + 15p, -5k + 3p = -413268. Is k a multiple of 87? True Let n be ((-4)/(-1))/(9/9). Let g(f) = -5f + 10. Let r be g(n). Let y = 39 + r. Is y a multiple of 29? True Let d be 4/(-2) + 3 + 2. Let t = 3 - d. Suppose -u - 2u + 27 = t. Is u even? False Let f(h) = -h*2 - 16h + 68. Let t = -48 - -28. Let d be f(t). Is 10 a factor of 4 - d/(-32)-264? False Suppose -113c = -116c + 15. Suppose -1162 = -cs - 2n, -3s = 5n - 548 - 134. Does 26 divide s? True Suppose 3u - 135 = 450. Suppose 5f + u = 25. Let r = f + 118. Is 14 a factor of r? True Let b(x) = 84x + 20. Let r(i) = -17i - 4. Let j(l) = -2b(l) - 11r(l). Suppose 4f = 7f - 18. Does 7 divide j(f)? False Let v(d) = 498d + 6990. Is 42 a factor of v(17)? True Let s(q) = 705q*2 - 45q + 459. Does 57 divide s(10)? True Let r = 29 + 130. Suppose 2v - r = 3p, -26 = -2v + 2p + 128. Is 26 a factor of v? False Let g(w) = -w*2 + 34w - 76. Let m = -373 + 389. Is g(m) a multiple of 9? False Suppose 3u - 16056 - 49369 = 30500. Is u a multiple of 12? False Let a = 2 - -1. Suppose -417 = -3z - 4x, a = 3x - 6. Suppose -24 = r - z. Does 12 divide r? False Let b(g) = -3g2 - 567g + 584. Is 180 a factor of b(-78)? False Let r be (5 - 4)/(5/935 + 0). Let o = r - -92. Is o a multiple of 14? False Suppose -2568 = -10h + 1922. Suppose -w + 19v + h = 20v, 2v - 451 = -w. Does 15 divide w? False Suppose -8z = 6 - 46. Let f(o) = 22o - 3. Is 8 a factor of f(z)? False Let b be -8 + (1 - 0)/(17/(-51)). Is (-2)/11 + (-3962)/b a multiple of 17? False Let f = 10 + -7. Suppose 0 = fc - 1 + 61. Does 11 divide (4 + -2)-1055/c? True Let z = -93 + 250. Suppose 7 - z = -10l. Let m = l + 8. Is m a multiple of 23? True Let h be ((-3)/(-6))/((-1)/(-6)). Suppose -28 + 1 = -hi. Let c(t) = t3 - 10t*2 + 12t - 3. Is c(i) a multiple of 12? True Let z be 1 + -6 - (-19 + 10). Suppose 3r - 211 - 38 = -m, -2r = -zm - 180. Is 12 a factor of r? True Let c be (215/(-15))/((-1)/18). Suppose -796 = -2b - c. Let w = -146 + b. Is 14 a factor of w? False Suppose -12z + 9z = -414. Suppose 14w - 12w = z. Suppose 3a + 125 = n, -3n = 5a + w - 374. Is n a multiple of 20? False Let y be (45/12)/((-12)/(-80)). Is 27 a factor of (y + -9)/(96/(-52) - -2)? False Let b be 517/(-66) + 2 + 2/(-12). Is (2665/30)/(-13)b a multiple of 20? False Let z be 5/(-30) + 2/12. Suppose z = -3c + 6c + 2h - 135, -5c - 3h = -224. Let s = 1 + c. Is 13 a factor of s? False Let v = -167 + 172. Suppose -3d + 984 = vn, 3d - 24n - 984 = -26n. Does 48 divide d? False Let a(z) = 12z + 24. Let b be a(-6). Let i = b + 51. Is (5/i)/((-10)/(-810)) a multiple of 27? True Suppose -4a - 18 + 82 = 0. Suppose 0 = -8n + an - 2040. Does 51 divide n? True Let h be ((-598)/(-8))/((-4)/(-16)). Let i = 2101 + -2313. Let d = i + h. Is d a multiple of 41? False Does 10 divide 8152 + -1 + (-517)/47? True Suppose -4t = -4y - 47604, 203y - 23820 = -2t + 208y. Is t a multiple of 16? False Let p(w) = -467w - 805. Is 7 a factor of p(-13)? False Let u(r) = -5r2 - 247r - 38. Does 24 divide u(-11)? False Let g be ((-169)/(-52))/(1/(-8)). Is 19 a factor of 2/(-6)(g + -1855)? True Let t = -3068 - -3228. Is 40 a factor of t? True Let n(s) = 6s - 62. Let u be n(12). Suppose 0 = -4m - u + 110. Is 2 a factor of m? False Suppose 4h - 29656 + 5713 = 3w, 3w = -3. Is h a multiple of 133? True Suppose 5k - 15 = 2w, -3w - 7 - 5 = 3k. Let f(z) = 16z + 7. Let d(c) = 14c + 5. Let l(j) = 5d(j) - 4f(j). Is 2 a factor of l(k)? False Let r(x) = -515x - 3354. Is r(-18) a multiple of 17? True Let d(j) = 2j - 20. Let z = 65 - 55. Let b be d(z). Suppose b = 3o - 94 - 176. Is 15 a factor of o? True Let s be (-2945)/(-76) - -61/(-8). Suppose m = s + 112. Does 10 divide m? True Let r(s) = -s*3 - 7s*2 - 43s - 527. Is 26 a factor of r(-17)? True Let d(c) = -c*2 - 4c + 34. Let z be d(-8). Let a(y) = 33yz - 9y*2 - y + 63y*2. Is a(-1) a multiple of 22? True Let s = 286 + -282. Suppose -sp - b - 400 = -6p, 4p - 800 = 4b. Does 9 divide p? False Let x(o) = -6o*3 - 6o*2 - 22o - 62. Let z be x(-5). Suppose 1 = g, -5h + 861 = -g - z. Does 11 divide h? False Let a = 115 + -111. Is 18((-160)/(-15) - a) a multiple of 15? True Let g(d) = -26d + 16. Let f be (-1 - -1)(-23)/46. Is 3 a factor of g(f)? False Suppose -253 = -l + 9i - 4i, 5i + 521 = 2l. Let m = 474 - l. Does 49 divide m? False Suppose 18648 + 420 = 7q. Suppose -6l = -q - 1926. Does 27 divide l? False Let w be 2(1/(-1) + 844). Suppose -w = -q - 555. Is q a multiple of 39? True Suppose 17j = 22j - 1860. Let x = -295 + j. Does 9 divide x? False Let k = -3725 + 6309. Does 3 divide k? False Let d(t) = 381t + 4817. Is d(-12) a multiple of 3? False Let k = 123 + -297. Let d be 24((-9)/(-72))/(2/(-204)). Let v = k - d. Does 33 divide v? True Let i be (4/(-3))/(2 - 32/12). Suppose -204 = -5b + 2q, 1 + i = q. Suppose b = 4j - 30. Is j even? True Let q(i) = i3 + i2 - i + 17. Let j be q(0). Suppose 4k + 15k = 2k. Suppose kw = w - j. Is w even? False Let a = -2 + -1. Suppose -27130 = -2v - 27136. Is 3 a factor of v - (1 + (a - 16))? True Let b(v) = -71v - 416. Does 9 divide b(-12)? False Suppose -132 = -9k - 2k. Suppose -kr + 2725 + 371 = 0. Let u = -114 + r. Does 24 divide u? True Suppose -9k = -5k - 4r - 24264, -18201 = -3k + 4r. Is k a multiple of 47? True Is -10329312/(-36)42/18 a multiple of 23? True Suppose 11m = -2m - 2210. Let j = -131 - 123. Let r = m - j. Does 12 divide r? True Let u(v) = 8v3 + 14v*2 + 6v - 12. Let l(d) = 3d3 + 5d*2 + 2d - 4. Let s(t	{ "pile_set_name": "DM Mathematics" }
y(j) = -8j + 384. Calculate 5o(f) - 3y(f). -f - 192 Suppose 4l - 20 + 4 = 0, 3v - 18 = -3l. Let g(i) = -9i - 3. Let t(b) = b - 11. Let s(f) = 5. Let p(d) = 9s(d) + 4t(d). Give vg(y) + 5p(y). 2y - 1 Let r(k) = 48k - 33. Let q be -1 + 3(-1 - -2). Let u(w) = 7417 - 3708 - 3707 - 3w. What is qr(d) + 33u(d)? -3d Let c(w) = -w + 2. Let f(o) = 95 + 87 - 9o - 239 + 78. Determine -21c(l) + 2f(l). 3l Let b(c) = c + 1. Let q(z) = -10z + 5. Let s(k) = -17k + 5. Let f(h) = -5q(h) + 4s(h). Determine 5b(d) + f(d). -13d Let a(r) = 246r - 4. Let m(i) = -2i - 1. Determine a(v) - 5m(v). 256v + 1 Suppose 0 = -5c - r + 17, -2c + 17 = 3r - 6r. Let n(x) = 25x - 6 - 45x + 16 + 22x - 9. Let w(u) = 3u + 1. What is cn(v) - 3w(v)? -v + 1 Let p(m) = -m - 3. Let u be p(-3). Suppose u = 4r - 0r - 28. Let x(j) = j*2 + 24j - 42j + 17j. Let c(n) = 2n2 - 2n. Calculate rx(v) - 3c(v). v*2 - v Let r = -7 - -1. Let z(o) = -7o + 1. Let n be ((-6)/4)/((-9)/30). Let k(y) = 47 - 8y - 24 - 22. Determine nk(t) + rz(t). 2t - 1 Let d(j) = -24j2 + 6j + 6. Let a(w) = w*2 + 29403w - 29402w + 6 - 5 - 2w*2. What is -6a(f) + d(f)? -18f2 Let g = -24 + 68. Let l(k) = 0 - 4 + 48k - gk. Let i(s) = -s + 1. What is 7i(y) + 2l(y)? y - 1 Let q(f) = 33f + 5. Let i(h) = -11h - 2. What is -7i(o) - 2q(o)? 11o + 4 Let x(u) = u + 1. Let o be (-35)/(-7)-1 - -8. Let m(n) = -7n - 2. Calculate om(p) + 6x(p). -15p Let h(v) = -3v*2 + 4v - 5. Let d(b) = 10 - 77b - 1 + 74b + 7. Let u be d(4). Let y(n) = 6n2 - 7n + 9. Determine uy(q) + 7h(q). 3q2 + 1 Let f(g) = 3g2 + 7. Let a(n) be the second derivative of -n4/4 - 3n2 + n. Let z be (1 - 3)(-312/9 + 2). What is zf(v) + 5a(v)? -3v*2 - 2 Let h(b) = 6b + 2. Let i = -29 + 18. Suppose -6 = -35v + 36v. Let o(c) = -3c - 1. Give io(a) + vh(a). -3a - 1 Suppose -4s - 7 - 10 = -m, 0 = -s + 5m - 9. Let q be (-10)/(-4) - 9/6. Let h(b) = 3b2 - 6b + 4. Let z(y) = y*2 - y + 1. Determine qh(t) + sz(t). -t2 - 2t Let d(t) = -114t3 - 2t*2 + 4t - 6. Let x(a) = 341a3 + 5a*2 - 11a + 17. Give -11d(p) - 4x(p). -110p3 + 2p*2 - 2 Let p(h) = 30h + 8. Let j(a) = 29a + 9. Give 5j(d) - 6p(d). -35d - 3 Let m(u) = u2 + u + 1. Let a(h) = h3 - 35h2 - 37h + 32. Let y be a(36). Let n(r) = -6r2 - 6r - 4. Determine ym(i) - n(i). 2i*2 + 2i Let g(w) = w2 - w + 1. Let x(d) be the third derivative of d3 - 1/4d4 + 0d + 18d2 + 0. Give 6g(s) - x(s). 6s2 Let i(x) = x3 + 7x*2 - 13x + 14. Let m(h) = h*3 + 6h*2 - 11h + 12. Let o(j) = -6i(j) + 7m(j). Let k(v) = 2v3 + 2v. Determine -2k(t) + 6o(t). 2t3 + 2t Let p(h) be the first derivative of h*2 + 17h + 155. Let a(w) = w + 8. Determine -5a(f) + 2p(f). -f - 6 Let w(i) = -4i3 - 11i*2 + 9i + 27. Let q(j) = 2j3 + 6j*2 - 5j - 14. Give 5q(n) + 3w(n). -2n3 - 3n*2 + 2n + 11 Let v(b) = -15b3 - 21b*2 + 37b + 10. Let y(w) = 10w3 + 15w*2 - 25w - 7. Calculate 5v(z) + 7y(z). -5z3 + 10z + 1 Let t(j) = j*2 + 7j + 10. Let k(s) = -s*2 - 7s - 11. What is -4k(z) - 5t(z)? -z*2 - 7z - 6 Let x(z) = 12z - 2. Let j be x(2). Let k = j - 29. Let w(h) = 2h + 2. Let u(p) = -10p + 1 - 4p + 15p. Calculate ku(a) + 4w(a). a + 1 Let n(p) = -4p*2 + 2p*2 - 2p*3 - 105p + 99p. Let y(u) = -u2 - u. Determine n(w) - 4y(w). -2w3 + 2w*2 - 2w Let r(s) = 3s3 + 8s2 - s2 + 6s - 4s3. Let u = 18 + -12. Let j = u + -12. Let i(n) = n3 - 6n2 - 5n. What is ji(g) - 5r(g)? -g3 + g2 Let t(x) = x*2 - x - 1. Suppose -74c = -185 - 259. Let k(n) = -5n2 + 6n + 4. Calculate ct(p) + k(p). p2 - 2 Let y(q) = q3 - q2 + 3. Let n be y(0). Let b(u) = 7u + 7. Let o(c) = c + 1. Let h(x) = 3b(x) - 24o(x). Let s(j) = -2j - 3. Determine nh(a) - 4s(a). -a + 3 Let l(a) = a2 - a + 68. Let v(t) = 4t*2 - 2t + 206. What is 7l(m) - 2v(m)? -m*2 - 3m + 64 Let s = 244 - 239. Let r(g) = 6g - 9. Let n(u) = -7u + 10. What is sr(z) + 4n(z)? 2z - 5 Let u(t) = 63t*2 - 14t. Let g(w) = -22w2 + 5w. Give 8g(s) + 3u(s). 13s2 - 2s Let b(h) = 2h3 + 3h2. Let c(p) = -p - 10. Let l be c(-9). Let u(i) = -i2. Suppose -102 = 6g + 102. Let a = 31 + g. What is au(r) + lb(r)? -2r*3 Let j(z) = 2z*2 + z - 2. Suppose 1 + 1 = d. Suppose -2f = -f - d. Let m be j(f). Let n(h) = 6h - 2. Let b(x) = x. Determine mb(u) - n(u). 2u + 2 Let n(y) = -8y - 12. Let v(u) = u + 1. Let p = 41 + -42. Let z be (5 + p)25/10. Determine zv(d) + n(d). 2d - 2 Let i(y) = -6y*3 + 4y*2 - 5y. Let o(n) be the second derivative of n5/4 - n4/4 + 2n3/3 + 5n - 6. Determine -4i(a) - 5o(a). -a3 - a2 Let u(y) = -8y3 - 2y + 43. Let n(s) = -19s3 - 4s + 88. Calculate -2n(q) + 5u(q). -2q3 - 2q + 39 Let r(u) = -2u3 - 4u*2 + 4. Let t = -19 + 22. Let s(y) = -3y*3 - 3y*2 + 3. Give tr(g) - 4s(g). 6g*3 Let x(k) = -35k - 56. Let n(o) = 30o + 55. What is 5n(t) + 4x(t)? 10t + 51 Let b(a) be the second derivative of -a*3/6 - 6a. Let p be (-2 + -124)1/(-2). Let w(z) = 29z - pz + 31z. Determine 5b(q) - 2w(q). q Let z be 80/(-35) + (-4)/(-14). Let w be 1 - 1 - z/1. Let d(h) = 2h + wh - 5h + 4h. Let f(c) = -6c. Give 9d(n) + 5f(n). -3n Suppose -2m - 7 = -m. Let w(b) = 2b*3 - 4b - 3. Let y(j) = -6j + 141. Let z be y(24). Let c(a) = -4a*3 + 8a + 7. Give mw(i) + zc(i). -2i3 + 4i Let z(y) = -11y + 1. Let h(l) = -13l + 2. Determine 2h(w) - 3z(w). 7w + 1 Let t(b) = 12b*3 - 6b*2 - 2b - 2. Let d(q) = 60q3 - 31q*2 - 11q - 11. What is 2d(x) - 11t(x)? -12x3 + 4x*2 Let l(m) = -7m*3 + 7m*2 - 4m + 11. Let s(v) = 4v3 - 4v*2 + 3v - 6. What is 6l(o) + 11s(o)? 2o3 - 2o*2 + 9o Let g(q) = -6q2 + 4q + 8. Let m(l) = 2l2 - l - 3. Calculate -3g(i) - 8m(i). 2i*2 - 4i Let m(o) = -2o - 2. Let b(u) = 4u + 4. Let h be (-2)/(-2) + 75 + -89. What is hm(n) - 6b(n)? 2n + 2 Let k(u) = -4u*2 - 7u - 6. Let d(h) = -1 - 2 - 2 + 6. Let j(s) = -6d(s) - k(s). Let t(a) = -3a*2 - 5a. Calculate -5j(c) - 7t(c). c*2 Let w(c) = -2c*2 + 3c - 2c2 + 1133 - 1131. Let i = -2 + 0. Let j(y) = 9y*2 - 6y - 5. What is ij(z) - 5w(z)? 2z2 - 3z Let n(j) = -3j3 - 17j*2 - 6j + 20. Let p be (-2 + (-27)/2)2. Let m = 25 + p. Let c(h) = -h3 - 6h*2 - 2h + 7. Determine mn(y) + 17c(y). y*3 + 2y - 1 Let s(b) = 3b2 + 4b. Let q(y) be the third derivative of y*5/15 + 5y*4/24 + 148y*2. What is 4q(f) - 5s(f)? f2 Let g be (-5 - -4) + 1 + -6. Let h(n) = -5n*3 + 9n*2. Let p(y) = 4y*3 - 8y*2. Calculate gp(k) - 5h(k). k3 + 3k*2 Let b(z) = -71z + 29. Let l(d) = 35d - 13. What is -4b(n) - 9l(n)? -31n + 1 Let g(k) = 4 + 246k2 - 3 - 253k*2. Let w(t) = 8t*2 - 1. Let d = -20 + 14. What is dw(u) - 7g(u)? u2 - 1 Let n(f) = -f - 1. Let j(v) be the second derivative of 2v*3/3 + 10v*2 - 9v. Let a be j(-6). Let y(z) = 6z + 4. Let l = -6 - -5. Give an(u) + ly(u). -2u Let f(k) = -21k - 9. Suppose 5c - 6 = 9. Let q(a) = -5 + c - 3a - 2a. Let g = 7858 + -7867. Give gq(y) + 2f(y). 3y Let l(f) = -4f - 6. Let y(i) = i + 1. Let t be 14/(-28)-22. Suppose b + t = 0, -1 = 3k + 5b + 6. Let x be (-1)/(-2) - 9/(-2). Give kl(o) + xy(o). o - 1 Let q(m) = 253m - 8. Let a(f) = 507f - 14. Give 4a(c) - 7q(c). 257c Let a(d) = 3d + 2. Suppose 9y = -7 - 56. Let f(g) = 8g + 6. Determine ya(l) + 2f(l). -5l - 2 Let p(n) = 673n. Let g(i) = 2490773i. Give -2g(l) + 7403p(l). 673l Suppose -s = 5u - 2s - 8, 0 = -3u + 5s + 18. Let f(t) = -2t + u - t - 5t - 5. Let v(q) = q + 1. Suppose -l - 1 = 5. What is lv(h) - f(h)? 2h - 2 Let r(u) = 7u. Let n(i) = -i3 - 4i*2 - 9i - 31. Let x be n(-6). Let j = 99 - x. Let m(a) = 0a - 4a - 2a. Give jm(h) + 3r(h). -3h Let y(p) = 10p3 - 3p*2 - 7p. Let z(s) = -29s3 + 8s*2 + 22s. What is 8y(m) + 3z(m)? -7m3 + 10m Let s(r) = r*2 + 22r + 106. Let m be s(-8). Let j(u) = 7u3 - u. Let q(l) = -8l*3 + l. Give mq(x) - 7j(x). -x3 + x Let t(k) = 254k*2 - 38k - 10. Let z(b) = b*2 - 5b - 1. Calculate -t(a) + 8z(a). -246a*2 - 2a + 2 Let r be (-	{ "pile_set_name": "DM Mathematics" }
4/11 + 2/11v - 2/11vh = 0. -1, 2 Let m(t) be the third derivative of -t6/24 - 5t5/18 - 5t*4/18 - 8t*3/3 - 12t2. Let l(u) be the first derivative of m(u). Solve l(o) = 0. -2, -2/9 Let v(n) be the first derivative of n4/4 - 4n3/3 - 15n*2/2 + 18n - 106. Determine y, given that v(y) = 0. -3, 1, 6 Let w(z) be the first derivative of 32/27z3 - 4/9z*2 - 4/45z*5 - 5/6z*4 + 0z + 5/27z6 + 12. Solve w(u) = 0 for u. -2, 0, 2/5, 1 Let h be (-96)/352 + 31/33. Factor 0 - hp*2 + 2p. -2p(p - 3)/3 Let q = 57306 - 57270. Suppose qd3 - 8d*2 + 40/3 - 124/3d = 0. Calculate d. -10/9, 1/3, 1 Let u(i) be the second derivative of 0 - 2/105i7 + 0i*2 - 1/5i*5 - 2/15i*4 + 0i*3 - 8/75i*6 + 15i. Factor u(y). -4y2(y + 1)*2(y + 2)/5 Let k(b) = b*2 - 6b + 6. Let m be k(3). Let y be ((-2)/m-39)/(-1). Find z such that -2z*3 - 4z*2 - y + 2z - z*4 + 4z4 + 27 = 0. -1, -1/3, 1 Let q(c) = -c2 + c + 1. Let s(t) = -52t2 - 2t + 2. Let z(d) = -4q(d) + 2s(d). Factor z(w). -4w(25w + 2) Suppose -30 = -2o - 4o. Let p be ((-1)/(-5) - 0)/(2/o). Let pa*3 + 0a*2 + 1/4a*4 + 0a + 0 = 0. Calculate a. -2, 0 Let z(n) = 48n3 - 20n*2 + 2n. Let o(v) = -47v3 + 18v*2 - 3v. Let x(g) = 2o(g) + 3z(g). Solve x(c) = 0. 0, 12/25 Let z(k) be the third derivative of 0 - 1/4k5 + 0k - 250/3k3 - 25/4k*4 - 35k*2 - 1/240k*6. Determine u so that z(u) = 0. -10 Suppose 9h = 5v + 11h - 8, -8 = -3v - 2h. Solve -2/9g5 + 0g*2 + v - 4/9g*4 + 0g + 2/3g3 = 0. -3, 0, 1 Factor 27g*2 - 47g*2 + 144 - 16g + 368g. -4(g - 18)(5g + 2) Let l(u) = -8u2 + 40u + 4. Let q be l(5). Factor 0 - 3/4i2 - 1/2i + 0i3 + 1/4i*q. i(i - 2)(i + 1)2/4 Solve 1/2r + 37/8r3 + 11r*2 + 0 - 129/8r*4 = 0. -2/3, -2/43, 0, 1 Factor 2/7a*2 + 12168/7 + 312/7a. 2(a + 78)2/7 Let i = -28 + 32. Suppose 3f + 2 = if + 4x, f - 5x - 2 = 0. Factor -1/3 + 1/6v*f - 1/6v. (v - 2)(v + 1)/6 Let x(d) = 2d*3 - 9d*2 - 11d + 21. Let g be x(5). Let q be g + 11 + ((-1)/(-4) - 2). Let qo3 - 1/4o + 3/4o2 - 1/4o*4 - 1/2 = 0. What is o? -1, 1, 2 Let -3/4x - 13/2x2 + 4x*4 + 0x*3 + 5/2 + 3/4x5 = 0. Calculate x. -5, -1, 2/3, 1 Let f(u) be the second derivative of u7/189 + 7u6/135 - u5/45 - 13u*4/9 - 7u*3/3 + 15u*2 - 299u. Let f(d) = 0. What is d? -5, -3, 1, 3 Factor 5i - 18 + 20i*2 - 6 + 5 - 11 + 5i*3. 5(i - 1)(i + 2)(i + 3) Let h(c) be the second derivative of -c*4/78 + 33c*3/13 + 100c*2/13 + 9c - 26. What is i in h(i) = 0? -1, 100 Let j(o) be the second derivative of -o7/5880 - o6/420 - 11o5/840 - o4/28 + 2o*3 + 12o. Let y(c) be the second derivative of j(c). Factor y(k). -(k + 1)(k + 2)(k + 3)/7 Let l(r) be the third derivative of r*5/60 - 32r*3/3 - 62r*2. Factor l(m). (m - 8)(m + 8) Let g(x) be the first derivative of 3x5/5 - 93x*4/4 - 242. Solve g(u) = 0. 0, 31 Let i(v) = -4v - 1. Let f be i(-7). Let z = -23 + f. Find h such that -6h5 + 7h*5 + 5h*z - 3h*4 = 0. -2, 0 Let f be 140/(-14) + -1 - -14. Factor 8/3 - 4/3x*f - 4x*2 + 4/3x*4 + 4/3x. 4(x - 2)(x - 1)(x + 1)2/3 Suppose -27l - 20 = -74. Factor 5/2 - 15q - 10q*3 + 45/2q*l. -5(q - 1)*2(4q - 1)/2 Let z = 99 - 86. Determine s, given that -4s*2 + 0 + 3s*2 - 4 - 2s*2 + zs = 0. 1/3, 4 Factor 2r + 12r + 6 + 0r2 - 21r + r*2. (r - 6)(r - 1) Let h = -27 - 171. Let o = 399/2 + h. Determine j so that -oj + 1 - j2 + 2j*3 - 1/2j*5 + 0j*4 = 0. -2, -1, 1 Let w = 43691 - 218447/5. Find d, given that 6/5d - 1/10d3 + 0d*2 - w = 0. -4, 2 Let n(o) = 7o*2 + 3o + 3. Let m(p) = -64p2 - 28p - 28. Let v(a) = 3m(a) + 28n(a). Factor v(x). 4x2 Let t = 8579/10730 - -1/2146. Factor -2/5 + tw - 4/5w3 + 2/5w*2. -2(w - 1)(w + 1)(2w - 1)/5 Suppose -16p + 27p - 22 = 0. Suppose -20s*3 - 8s*2 - 30 - 7s*p - 5s*4 + 30 = 0. What is s? -3, -1, 0 Let u be 14/(-5)(-260)/104. Let x(z) be the third derivative of 2z2 - 1/280z*u + 0 + 0z*3 + 1/96z*6 + 0z - 1/96z4 - 1/240z*5. Factor x(h). -h(h - 1)*2(3h + 1)/4 Suppose -25y + 50y = 100. Let m(r) be the first derivative of 0r*3 + 0r - 1/5r2 + 3/10r*y + 3 + 4/25r*5. Factor m(z). 2z(z + 1)2(2z - 1)/5 Let t = -149 - -597/4. Factor -tb*4 + b + 0 - 1/4b3 + b2. -b(b - 2)(b + 1)(b + 2)/4 Let x(v) be the third derivative of v7/1050 + v6/300 - 7v5/300 + v4/30 - 43v2. Factor x(w). w(w - 1)*2(w + 4)/5 Let r be (450/(-270))/(5/(-6)). Let -8/7u + 10/7u*3 - 2/7u*4 + 16/7 - 12/7ur = 0. Calculate u. -1, 2 Let s(n) be the third derivative of n8/448 - n*7/56 - 3n*6/80 + 2n*2 - 91n. Suppose s(k) = 0. Calculate k. -1, 0, 6 Let s be 3/11 + 6/(-22). Let h(i) be the first derivative of 1/3i6 - i2 + si*4 - 4/5i*5 + 4/3i*3 + 3 + 0i. Find x such that h(x) = 0. -1, 0, 1 Let g(l) = -l. Let x(o) = -4o2 - 116o. Let a(f) = 12g(f) - x(f). Solve a(t) = 0. -26, 0 Let b(o) = -5o - 27. Let v be b(-6). Let y(s) be the second derivative of 4/9sv + 1/24s*5 + 0 + 1/3s*2 + 17/72s*4 + 3s. Find h such that y(h) = 0. -2, -1, -2/5 Let q(w) be the second derivative of w*5/30 - 11w*4/18 + 32w*3/9 - 28w*2/3 - 43w. Let q(s) = 0. What is s? 2, 7 Solve 1/4u2 - 1/2 + 1/4u = 0 for u. -2, 1 Let x(j) be the third derivative of 17j7/420 + 37j*6/240 + 23j5/120 + j4/16 - 8j2 + 5j. Factor x(c). c(c + 1)2(17c + 3)/2 Find i such that 1476i*3 - 72i*4 + 63i*2 - 400 + 3680i - 4669i2 - 3318i*2 = 0. 1/6, 1/3, 10 Let v(n) = -n. Let g(o) = 2o*4 - 26o*3 + 66o*2 + 149o - 196. Let f(r) = 2g(r) - 10v(r). Factor f(q). 4(q - 7)2(q - 1)(q + 2) Let m be (((-182)/147)/13)/((-480)/14). Let b(n) be the third derivative of -8n*2 + 0 + 0n*4 + 0n + 0n3 + mn5. Factor b(j). j2/6 Let z = -3456 + 6915/2. Factor 3n - 3n*3 + 0 - 3/2n*4 + zn*2. -3n(n - 1)(n + 1)(n + 2)/2 Factor -2n*3 - 14n*2 - 26n + 3n3 + 5 + 28n - 3n3 + 9. -2(n - 1)(n + 1)(n + 7) Let l(q) be the first derivative of 2q5/65 + 2q*4/13 - 2q*3/3 - 40q*2/13 + 96q/13 - 80. Determine u, given that l(u) = 0. -4, 1, 3 Let n(s) be the third derivative of s7/315 + s6/90 - s5/30 - s4/9 + 4s3/9 - s2 - 15s. Suppose n(k) = 0. Calculate k. -2, 1 Let g(t) be the third derivative of -t*6/18 + 7t5/30 - t4/3 - 4t3/3 + 6t*2. Let k(s) be the first derivative of g(s). Factor k(q). -4(q - 1)(5q - 2) Let z be (-2 - -18) + 0 + 3. Suppose 5a + 4b - 4 - z = 0, 7 = a + 2b. Factor -3p*2 + 3 - 17p + a - 4 + 12p. -(p + 2)(3p - 1) Let j(a) = 147a*2 + 741a + 33. Let u(k) = 588k2 + 2964k + 131. Let w(z) = -11j(z) + 3u(z). Solve w(t) = 0 for t. -5, -2/49 Let v(b) = 9b3 - 8b*2 - 11b - 6. Let d(l) = 19l3 - 16l*2 - 20l - 12. Let r(a) = 4d(a) - 9v(a). Factor r(n). -(n - 3)(n + 1)(5n + 2) Let q be (-9 + 9)(9/(-6) - -1). Let g(m) be the third derivative of 1/390m5 + qm*4 + 0m*3 + 1/780m6 + m2 + 0m + 0. Factor g(z). 2z*2(z + 1)/13 Let s(z) be the third derivative of -1/525z7 + 0z + 1/60z4 - 3z*2 - 1/300z*6 + 1/150z*5 + 0z*3 + 0. Let s(h) = 0. What is h? -1, 0, 1 Suppose 92c - 10 = 90c. Let d(k) be the second derivative of -1/90k*c - 5k + 1/54k4 + 2/27k*3 + 0 + 0k*2. What is s in d(s) = 0? -1, 0, 2 Let b(l) be the second derivative of -2l*7/21 + 4l*6/15 - 2l - 15. Find k such that b(k) = 0. 0, 2 Let q = -9/188 - -1531/564. Suppose qk - 2/3k*3 - 16/3 + 4/3k*2 = 0. Calculate k. -2, 2 Suppose -386 = 3t - 119. Let g = 359/4 + t. Determine n so that 1/4n3 - gn*2 + 3/4n - 1/4 = 0. 1 Suppose 0 = -3o + 4x - 5x + 23, 2x = 3o - 26. Let h be (1/(-4))/(3/o) + 1. Factor 1/3z*2 + 0 + 1/3z*3 - 1/3z - hz4. -z(z - 1)*2(z + 1)/3 Let b(m) be the third derivative of m9/16632 - m8/9240 - m7/2310 + m3/6 + 14m2. Let n(l) be the first derivative of b(l). Factor n(z). 2z*3(z - 2)(z + 1)/11 Solve 0 + 16/3m*2 + 0m - 2/3m4 + 14/3m*3 = 0. -1, 0, 8 Suppose 5w - 1292 = 123. Let f = 1983/7 - w. Factor 0 - 2/7y3 + 2/7y*5 + 2/7y*4 - fy*2 + 0y. 2y2(y - 1)(y + 1)*2/7 Let o(q) be the thi	{ "pile_set_name": "DM Mathematics" }
2z3 + 2z3 - 5 - z3. Let x be i(-4). What are the prime factors of ((-135)/(-6))/x-2? 3 What are the prime factors of 4/26 + (-362)/(-13)? 2, 7 Let c = 63 + -40. Suppose -4h + 20 = 0, -3h + c = -2r - 10. What are the prime factors of 3/(r/(-4))6? 2 Suppose 3z - 15 = 42. List the prime factors of z. 19 What are the prime factors of 219/12 - 1/4? 2, 3 Suppose 0 = -21d + 8d + 1378. List the prime factors of d. 2, 53 Let t(b) = -b*3 - 6b*2 - b + 4. Let d be t(-6). Suppose -f = -3f - d. Let r(c) = c*2 + 2c - 7. List the prime factors of r(f). 2 Let w(u) = -u*2 + 13u - 4. Let s be w(12). Let c = 18 + s. What are the prime factors of c? 2, 13 Let i be (-1 - -2)7 + -2. Suppose 5b = 3t + 34, -4b - 4t = t - i. List the prime factors of b. 5 Let p(i) = i - 11. Let l be p(11). Suppose lk = 4b + 4k - 132, -b - 5k + 13 = 0. List the prime factors of b. 2, 19 Let r(i) = 43i*3 + 7i*2 - 2i - 11. Let w(p) = -21p3 - 4p*2 + p + 6. Let o(q) = -6r(q) - 11w(q). List the prime factors of o(-1). 2, 7 List the prime factors of -3(-12)/(-9) - (1 - 132). 127 Let v be ((-6)/5)/((-6)/20). Let l = 34 + -10. Suppose -vb + 0 = -l. What are the prime factors of b? 2, 3 Suppose -f - 2f = 0. Suppose fp + 3 = p. What are the prime factors of p? 3 Let c(h) = -6h + 9. What are the prime factors of c(-6)? 3, 5 Suppose 0 = -6i + 2i. Suppose -3m + 3j = -im - 3, 0 = 3m + 5j + 37. Let k = m - -19. What are the prime factors of k? 3, 5 Suppose 63b = 59b + 112. What are the prime factors of b? 2, 7 Suppose 2u - 3z = -12, -2u - 3u - 5z - 30 = 0. Let n = u - -10. Suppose 20 = 4i - n. What are the prime factors of i? 2, 3 Let u = -9 - -12. What are the prime factors of (-2)/(2/(-9)u)? 3 Let t(p) = -p*3 + 4p*2 + p - 2. Let y be t(2). Suppose -13o + yo = -75. List the prime factors of o. 3, 5 Let r(c) = 12c - 20. List the prime factors of r(8). 2, 19 Let u(r) = 7r3 - r2 + 6r - 10. Let j(k) = -6k3 + 2k*2 - 6k + 9. Let v(w) = 6j(w) + 5u(w). What are the prime factors of v(5)? 2, 3 Let f(u) = u*2 + 1. What are the prime factors of f(-2)? 5 Suppose -3r = -4i + 31, -3i - 3r = -5i + 23. Suppose 0h + iu - 24 = 2h, 87 = -5h + u. What are the prime factors of (-174)/h + (-2)/3? 3 Suppose 0 = -5s + 4g + 131, 0 = -0g - g - 4. List the prime factors of s. 23 Let w(r) = r3 - 3r*2 + 3r. Let z be w(2). Let h = -1 - -7. Let d = h - z. List the prime factors of d. 2 Let j = 82 - 55. What are the prime factors of j? 3 Suppose 3j = -4h + 48 + 89, 0 = -h - j + 34. List the prime factors of h. 5, 7 Let p be 9 + (-6)/((-6)/3). List the prime factors of p - (-6)/(-9)-3. 2, 7 Let n(g) = 2g*2 + 6g - 7. Let r be n(-6). Suppose 3v - r = -11. List the prime factors of v. 2, 3 Let r(x) = 4x3 - x2. Let z be r(1). Suppose zo - 4v - 4 - 2 = 0, -5o + 45 = 5v. Let m = o + -4. List the prime factors of m. 2 Let z(t) = t*2 - 2t + 1. Let m be z(-2). Suppose 2n - m = -1, -3n = 3v - 45. List the prime factors of v. 11 Suppose -4g = 4g - 448. List the prime factors of g. 2, 7 Suppose 5q - 3 = 2. Suppose 15 + q = -4z. What are the prime factors of 8/10(-70)/z? 2, 7 List the prime factors of (1441/33)/((-1)/(-3)). 131 Let k = 21 + -13. Let z(s) = s*2 - 6s - 2. Let t be z(k). Suppose t = -5b + 69. What are the prime factors of b? 11 List the prime factors of 5968/16 - (1 - -1)1. 7, 53 Let f(t) = t3 + t2. Let x be f(0). Suppose xw + 3w - 33 = 0. List the prime factors of w. 11 Let p(a) = -3a3 + 4a + 1. List the prime factors of p(-3). 2, 5, 7 Suppose 2p - 41 = 31. List the prime factors of p. 2, 3 What are the prime factors of 7/(35/370) + (2 - 1)? 3, 5 Let a(v) = v2 - 8v + 8. Let t be a(6). Let n = 8 - t. List the prime factors of n. 2, 3 Let z be (1/1)/(1/5). Suppose -zh + 32 = 2w + 6, h = 3w - 5. List the prime factors of w. 3 What are the prime factors of (2 - -63) + 12 - 3? 2 Let y be 4/1 + (-3)/3. Suppose -yb + 48 = b. Suppose 2o - 10 = -l - 0o, -o + b = 4l. List the prime factors of l. 2 Let p = -5 + 8. Suppose -g + 1 = -p. List the prime factors of g. 2 Let z(w) = w + 2. Suppose -5d = 0, -6d + 10 = 5v - 3d. Let h be z(v). List the prime factors of 23/h + 3/12. 2, 3 Let j(c) = -2c - 1. Let p be j(-3). Let v(i) = i - 5. Let u be v(p). Suppose 5w - z - 38 = u, -2z - 8 = -2. List the prime factors of w. 7 Suppose 6n = 9 + 3. Suppose 0 = no - o - 2. List the prime factors of o. 2 Suppose -3 - 1 = -2j. Let s(m) = -m - 4. Let i be s(-7). Suppose -jl - 51 = -7l + a, l - i = 2a. What are the prime factors of l? 11 Let m(q) = -q2 + 12q - 9. List the prime factors of m(8). 23 Suppose -4k = 20, 2m - 9 = 4k + 17. Suppose -27 = -5y + m. List the prime factors of y. 2, 3 Suppose -20 = -3l + 2n, -2l - n - n = 0. Suppose -4x = -5z - 106, -4x + 112 = x + lz. What are the prime factors of x? 2, 3 Let r be 31/3 + 3/(-9). What are the prime factors of (-3 - -1)(-65)/r? 13 Let q(z) = 2z3 - 3z*2 + 3z - 2. What are the prime factors of q(3)? 2, 17 Suppose t + 3 = -5m + 5, 3m = -5t - 12. Let l(a) = -4 + 0a*2 + 1 - 5a + a*2. List the prime factors of l(t). 3, 7 Suppose -158 = -4f + 202. List the prime factors of f. 2, 3, 5 Let p be 6 - 5 - -125. Suppose -10 = -4y + 2. Suppose -a + 4r = -p, 9a - 79 = 4a + yr. What are the prime factors of a? 2, 7 Suppose -2w + 15 = 3w. Suppose -wp + 40 = -53. List the prime factors of p. 31 Suppose -3 = -3f, i - 5i - 3f = -419. Suppose -4v = -2v - i. What are the prime factors of v? 2, 13 Let n be 12/(-10)(-15)/6. Suppose -nq + 2 = 8. What are the prime factors of q/(-7) - 225/(-21)? 11 Suppose 4h + 2w = 64, w = -2h - 3w + 32. What are the prime factors of h? 2 Let b = 4 - 4. Suppose -5w + 70 = -bw. List the prime factors of w. 2, 7 Let g(k) = k + 1. Let r(c) = -4c - 5. Let s(v) = -3g(v) - r(v). List the prime factors of s(6). 2 What are the prime factors of -613/(-2) - (1 - 3)? 41 Let d(z) = -z3 + 7z*2 + 9z - 5. Let x be d(8). Suppose r + 2f = -xf + 45, 0 = -3r - 3f + 123. Suppose 10i - 5i - r = 0. List the prime factors of i. 2 Let x = -1 - -5. Let c = 11 - x. What are the prime factors of c? 7 Let j(n) = 9n2 + 7n - 26. Let g(p) = 5p2 + 4p - 13. Let a(w) = 7g(w) - 4j(w). Let y be a(0). Let m = 20 - y. What are the prime factors of m? 7 Suppose g = -2 + 1. Let l = 3 + g. Suppose 5 = lq - 3i - 13, -3i + 12 = 3q. List the prime factors of q. 2, 3 Let l(o) = -o*2 + 10o - 10. Let f be l(7). Suppose 2i - 4i = -4. Let s = f - i. What are the prime factors of s? 3 Suppose 109 = -3y + 2y. Let d = 153 + y. List the prime factors of d. 2, 11 Let c(b) = -4b - 1. What are the prime factors of c(-5)? 19 Suppose 0 = 2w - 4, -2t + 3w - 161 = -7t. What are the prime factors of t? 31 Suppose 0 = -2m + 2n + 62, -7n - 60 = -2m - 6n. What are the prime factors of m? 29 Let b = 176 - 85. List the prime factors of b. 7, 13 Suppose v = 3i - 168, 2v = 4i - 5 - 219. What are the prime factors of i? 2, 7 Suppose -2f = 2b + 2, 5f = 5b + 2f + 21. Let l(h) = -3h2 + 3 - 2 + 2h*2 - 7h. What are the prime factors of l(b)? 13 List the prime factors of ((-475)/20)/(1/(-4)). 5, 19 Let k(t) = 186t2 + 6t + 5. What are the prime factors of k(-1)? 5, 37 Let j = -24 - -47. Suppose 0l = -l + j. List the prime factors of l. 23 Let q(x) = -3 - x2 + 5x + x + 1. List the prime factors of q(4). 2, 3 Let h(r) = 10r2 + r + 1. Suppose -7 = 2p + 3. Let y = p - -4. What are the prime factors of h(y)? 2, 5 Let l(s) = -7s + 9. What are the prime factors of l(-4)? 37 Let o(u) = u2 - 26u + 70. What are the prime factors of o(32)? 2, 131 Suppose -3x - 2p - 7 = 1, -x + 3p = 21. What are the prime factors of (-1 + -20)10/x? 5, 7 Suppose 5h - 10 = -0. What are the prime factors of h? 2 Let n(h) = 6h2. Let w(k) be the third derivative of -k5/60 - k4/8 - k3/6 + 2k2. Let l be w(-2). List the prime factors of n(l). 2, 3 Suppose 47 = -3t - 2o, 0 = -2o + 3o + 1. Let x = 1 + -4. Let r = x - t. List the prime factors of r. 2, 3 Let g = -2 + 32. Suppose -g - 50 = -5f. What are the prime factors of 9/(-2)*f/(-6)? 2, 3 Let c = -134 + 384. List the prime factors of c. 2, 5 Let	{ "pile_set_name": "DM Mathematics" }
-18o. Is c greater than o? False Suppose 154y - 3442 = 562. Which is smaller: -2/115 or y? -2/115 Let h = -16106 + 27009763/1677. Which is smaller: 1 or h? h Let b be (-3)/(-6 - -3)0. Let j = 714 - 22129/31. Let t = j - 61/186. Is b at least t? True Let b = 205 + -347. Let z = 3453 - 3596. Does z = b? False Let b = 4341 + -620761/143. Which is smaller: 1 or b? b Suppose 3x - 18 = -12, 4x = -k - 2. Is k greater than -83? True Suppose 4n - 31 = -8i + 3i, 4i - 32 = -5n. Let h(y) = 2y2 - 5y - 12. Let m be h(n). Which is smaller: 3/295 or m? m Suppose 5t + 3r - 364 = 0, -37r = 2t - 34r - 151. Which is smaller: t or 62? 62 Let t = 134.43 + -133.43. Which is greater: 1346 or t? 1346 Let x = -739.266 - -740. Let b = 1.466 + x. Which is bigger: -1/2 or b? b Let t(u) = -381u*3 - 6u*2 - 14u + 4. Let b be t(-3). Let x be ((-41192)/b - 4/(-1))/2. Which is smaller: -1 or x? -1 Let b(h) be the first derivative of h*2 + 27h + 173. Let r be -10 + (0 - -2 - 1). Let f be b(r). Which is smaller: f or 7? 7 Let p = -150 + 141. Let v be -5 - ((-330)/p)/(-1). Are 33 and v equal? False Let a be 5 - (-8806)/(-2037) - (-4)/18-3. Let z = 0.3 + -0.5. Is z < a? True Let l = 155 + -155.77. Let q = l + 0.87. Do -22 and q have the same value? False Let l be ((-10)/1925)/(41/(-451)). Does l = 0.294? False Let f be 362 - (2 - 2)/(-6 + 5). Let t = 298 - f. Which is smaller: t or -66? -66 Suppose -x + 179 = -2m, m - 49 = 5x - 134. Let i be -2 - 11/(132/m)-14. Is i at least -106? False Let o = 0.313 - 0.373. Is o bigger than 1124? False Suppose 2k - 30 = -4f, 2k - 4f - 15 = 7. Suppose 0 = ks - 17s + 564. Is s equal to 141? True Let k(g) = -4g + 13 - 1 + 12 + 0. Let q(s) = -s3 + 7s*2 - 4s - 6. Let i be q(6). Let y be k(i). Which is bigger: 10 or y? 10 Let c be (1/4)/(-9 - 525/(-60)). Suppose 4y = -y - 20, -5r + 2545 = 5y. Let s = r - 6664/13. Is s < c? False Suppose -2 = 2u - 0. Suppose 9758 + 2227 = 51h. Suppose 10c + 225 = h. Does c = u? False Let z be -66 + 31/99. Let f be ((-5)/(90/12))/((-1)/z). Let v = -53 - f. Which is bigger: -13 or v? v Let t = 1519 + 142. Suppose -72c + 61c - t = 0. Is c bigger than -153? True Let u(l) = 3l3 - l2 + 5l - 7. Let y be u(3). Suppose -6x + 7x - y = 0. Suppose x = -17c + 7c. Is -10 less than or equal to c? True Let k = 514271/55 + -9350. Do 1 and k have the same value? False Let u = -45515 - -45578. Let i be 16/(1 - 9/12). Are u and i non-equal? True Let w = -196 + 166. Let r be 5/w-35 - 1/(-3). Which is smaller: 5 or r? 5 Suppose 22587 = -58f - 26307. Let o = f - -803. Do -0.2 and o have the same value? False Let o(j) = j*2 + 59j + 713. Let r be o(-17). Is r >= 0? False Let u(a) = -a*2 - 12a - 20. Let c = 19 + -29. Let q be u(c). Suppose qn - 18 = -9n. Is 2 greater than or equal to n? True Let s be (-531432)/1858248 + ((-4)/(-10))/(28/20). Which is bigger: 0 or s? 0 Let y be 4 - (-4)/(-8)-10. Suppose -j - 13 = 4z, 6j - 3j + y = -2z. Let x be j2/((-4)/214). Are 106 and x equal? False Let b be ((-2280)/15)/(-19) + 11982/(-1501). Is b at least as big as -1? True Let j be (5 - 2495/500)/(70/25025). Are j and 3 non-equal? True Let y(j) = 12j2 + 509j - 125. Let o be y(-40). Is -1286 bigger than o? False Suppose -5m = 3b + 6355, 1 = 2m - 1. Let g = b - -27532/13. Is -0.1 < g? False Let q(i) = 18i*3 + 7i + 12. Let h be q(-2). Let a = 191 + h. Is a != 45? False Let q be 20/(-6)(-4320)/(-2400). Let z = 0 - -1. Let s be 1(z + 0) + -6. Which is bigger: s or q? s Let t be (-2 + 2 - -2)1. Let c = 228250 - 228250.55. Is c less than t? True Let v(a) = -2a + 28. Let s be v(13). Let l(c) = -5c + 13c*s + 4 + 9c*2 - 8. Let n be l(-1). Which is smaller: 24 or n? n Let w = 2.9 + -3.9. Let a = -39 + w. Let s = a + 42. Which is bigger: -1/3 or s? s Let j = -161 - 153. Let h = -313.99 - j. Which is greater: h or 1/8? 1/8 Let x be -10(-13 + 7 - (-2541)/(-35)). Are 781 and x nonequal? True Let d(j) be the second derivative of 7j3/6 + 42j*2 + 3j + 2. Let z be d(-12). Which is smaller: z or -4/127? -4/127 Suppose 4p - 2 = 18. Let n be 4715/105 - 12/(-126). Let b be 18/n + 208/p. Is 41 greater than b? False Let s be 03/20723. Is 99/152 at most s? False Let d be 2/12(-4233)/510. Let u = -55/12 - d. Let c be 0 - (-2)/(2/(-3)). Which is greater: u or c? c Let w(o) = 5 + 4045o2 - 4093o2 - o3 + 160o - 5 + 49o + 35. Let u be w(-52). Suppose 4c + 8 + 68 = 0. Is c at most as big as u? True Let k be (-1)/(2/(-8)) - (-7 - 6287130/(-571554)). Which is smaller: k or -1? -1 Let v(a) be the second derivative of -a4/12 - 4a*3/3 + 9a*2 - 9a. Let p be v(-8). Suppose 5d + p - 3 = 0. Which is smaller: -26/9 or d? d Let r(i) = 0 - i - i2 + 2 - 5i - 19. Let y(q) = q. Let t(s) = r(s) - 5y(s). Let g be t(-9). Is g smaller than 3/2? True Let h = -147/20 + 31/4. Let z be (-344619)/279 + (-1 - -1). Let t = z + 1235. Which is greater: h or t? h Let c = -132333 - -5293053/40. Are -6 and c equal? False Let t(h) = -10h - 119. Let q(w) = -w*2 + 8w - 19. Let r be q(8). Let j be t(r). Is j bigger than 70? True Let d = 0.23 + -0.03. Suppose -62y - 1997 = 854 + 311. Which is smaller: y or d? y Suppose 4j - 2z = 3j + 3, j - 5z = 3. Suppose n = x + 4, n - jx - 1 = x. Let l(a) = -500a + 1499. Let w be l(3). Do w and n have the same value? False Let r = 3773 - 3023. Is 4 <= r? True Let r(a) = a2 + 29a - 339. Let u be r(-37). Which is bigger: u or -15? -15 Let l = -0.331 + -23.669. Let p = 2 - l. Is p > -1? True Let x(p) = p*3 + 15p*2 - 74p - 278. Let z be x(-17). Which is greater: 409 or z? 409 Let l = -12872/32105 + 6/6421. Let y = 732/7 - 18356/175. Which is smaller: y or l? l Let g(k) = 23k + 5119. Let d be g(-72). Which is bigger: d or 3464? 3464 Let f be (-4)/((-70)/66 - (-240)/(-880)). Let s = 27 + -39. Let h be (-1)/(10/s) + 2. Which is smaller: f or h? f Let p = -681570947 + 1093921323104/1605. Let m = 7/321 - p. Is m less than or equal to 28? False Let q = 13 - 8. Let x(p) = -2 - 4 - 2p*2 + 0 + 4p + 8p2 - 7p2. Let b be x(q). Is b smaller than -6? True Let q = -129868 + 906128/7. Is -421 >= q? True Let c = 53.6 + -202.6. Which is smaller: c or -6? c Let j = 0.06203 - 0.06203. Which is smaller: 365/6 or j? j Let l be (11 + 19668/(-36))/(20/6 + -3). Is l bigger than -1605? False Let v(n) = -n2 + 121n + 917. Let r be v(-8). Which is bigger: -104 or r? -104 Let m = -68 - -98. Let h = m + -54. Suppose 2i + 3s = -14 - 30, 0 = -4i - s - 98. Are i and h nonequal? True Let g = -3191692/505 + -426/101. Let v = g + 6268. Is -57 > v? False Let j(t) = -18t2 + 3t - 29. Let i be j(-8). Let b = i + 8474/7. Which is smaller: b or 5? 5 Let u = 44 - 42. Suppose -4 = -4d, -uc - 3d - d + 36 = 0. Suppose 0y - 2y + 28 = -2w, 0 = -5w + 15. Which is greater: c or y? y Suppose -7s = -41 + 13. Suppose 3a + 12 = 6z - sz, -5a - 20 = -5z. Is 0.01 equal to z? False Let k = 257 - 179. Let a = k - 76. Is 7/6 less than or equal to a? True Suppose -3r - 5w - 65 = -8r, -5w = -r + 29. Suppose -9l + 7395 = 7341. Is r less than l? False Let u be (18/144)/((-741)/(-1902)). Let o = 5/19 - u. Let q(c) = 2c3 - 2c*2 + c. Let d be q(1). Which is smaller: d or o? o Let h be (12 - 7) + (-163)/4. Let m = 96 - 131. Is h not equal to m? True Let o be (0 - 1 - -2) + -25. Let h be 8/o + (-21)/(-9). Let s be 1-3 + (-63)/(-21). Which is smaller: h or s? s Let t(k) = 82k + 257. Let d be t(6). Let i = d + -748. Is 8/83 at most i? True Let a be (-21)/36(58 + 10). Let i = a - -39. Suppose 3 = -j - 2j. Is i bigger than j? True Let q(h) = h3 - 12h*2 + 8h + 7. Let d be q(4). Let i = -6249 - -6249.4. Is i at most d? False Suppose -5j - 330 = -5k, -32 = -81j + 77j. Is k bigger than -37? True Let r = 8.5 - 1.8. Let v = r - 8.5. Let f = 2/15 + -19/30. Which is smaller: v or f? v Let t(y) = y*3 + 4y*2 - 41y - 88. Let q be t(-2). Let k = -178588/415 - -841/83. Let p = k - -422. Is p != q? True Let s = 468.4 + -172.4. Is s less than or equal to -6? False Let n = 418 + -420. Let a be 6 + (n - (-8 - -11)). Let o = -11.6 + 10. Which is bigger: o or a? a Let d be 238/3(114/12 - 8). Which is greater: 126 or d? 126 Let n be (-1(-4 + 5))/((-1)/2). Suppose 0 = -8*t - n	{ "pile_set_name": "DM Mathematics" }
4 + 2p*2 + p + 13p*4 + 0 to gp*2 + yp*3 + n + cp*4 + tp and give c. 26 Express (-1348t - 1166t - 2 - 268t)(-t - t + t) as yt2 + rt + o and give y. 2782 Express -6b - 4b*2 - 2 + 8b - 5b + 7b*2 + 1 in the form tb*2 + f + db and give t. 3 Rearrange -3u + 9 - 9 - 4u - 2u + 4u + (1 - 1 + 1)(3 - u - 3) + 2 + 8u - 2 + 3u - u + 0u to x + nu and give n. 4 Express 9746c*2 - 9746c*2 - 46c*3 + (2c + 0c + 0c)(-2c2 - c2 - c*2) in the form sc + r + bc2 + nc*3 and give r. 0 Rearrange -z + 8z - 74z2 - 7z to the form dz + yz*2 + s and give y. -74 Express (4 + 16 - 11)(7l2 - 12l*2 - 4l*2 + (3l*2 - 2l*2 - 3l*2)(-1 + 1 + 2)) as ul2 + o + sl and give u. -117 Rearrange -328a + 355a - 1103a to the form v + wa and give w. -1076 Rearrange (0z2 - z2 + 2z*2)(14 + 10 - 3)((-3z - 2z + 3z)(-5 + 4 + 2) - 4z + 3z - 2z) to the form dz2 + b + nz*3 + jz and give n. -105 Rearrange -k*2 + 4k*2 - 6k*2 - 3 - 180k + 179k to the form o + yk*2 + jk and give j. -1 Express (3u + u - 2u)(137 - 3u + 135 - 271) + (-4u - 4u + 6u)(1 - 1 + 3u) in the form i + gu + fu2 and give g. 2 Express -3b + 1032b2 + 1065b*2 - 2049b*2 in the form lb*2 + rb + t and give r. -3 Rearrange -101607 + 4g3 + 30g*2 - g + 101607 to a + qg + ig2 + zg*3 and give z. 4 Rearrange -532 + 3x - 3x + 8x - 10x + x to p + dx and give p. -532 Express 2y - 2y - 2y2 + 6 + (2y - 7y + y)(-y - y + 0y) + 5y*2 - 6 + 6 in the form dy + qy2 + u and give d. 0 Express -12o3 - 2 + o4 - o - o - 12o3 + 8o*3 - 17o*3 as yo*3 + do*4 + w + bo*2 + ho and give d. 1 Express 0a2 - a2 + 0a*2 + (-1 - 1 + 6)(-5a + 3a + a)(-6a - 29a + 6a) as wa2 + q + pa and give w. 115 Rearrange 3a + 41a*3 - 13a*3 - a + 2 - 2a*4 + 10a*4 - 26a3 + a2 to the form xa2 + s + wa*3 + ca + va4 and give s. 2 Rearrange (-6l4 + l4 + 4l4)(-61 + 20 - 91) to the form ul + xl*4 + z + vl*3 + yl*2 and give x. 132 Express -11h*2 - 7 + 7 - 7h*2 as g + uh + dh2 and give d. -18 Rearrange -170v2 + v3 + 341v2 + 8 - 15v - 171v2 to the form xv + jv2 + w + nv*3 and give x. -15 Rearrange -16f - 27 + 27 + 0f + 5f - 4f + 2f - f - 2f + (-3 - 1 + 2)(0f - f - f) + 3f - 2f + 0f - 4f + 8f + f to the form t + bf and give b. -6 Express 2 + 0f*3 + 4f2 - f3 - 14f2 + 12f + 6f3 - 9f in the form df2 + vf + i + cf3 and give v. 3 Express -152 + 72 + 80 + 298i in the form yi + d and give y. 298 Rearrange (1 - 4v - 1)(-13v - 7v - 26v) + 2v2 - 4v2 + v2 to q + nv + hv*2 and give h. 183 Express -5z - 10 - 79z2 - 19 + 26 + 0z + 6z in the form nz*2 + uz + r and give n. -79 Rearrange -25r + 16r*2 + 11r - 18r2 - 27r*2 - 7r to lr2 + z + pr and give l. -29 Rearrange (1 - w - 1)(-48 - 26 - 6)(5w3 + 2w*3 - 5w*3) to the form gw*3 + bw*4 + uw + r + qw2 and give b. 160 Express 96 + 15g*3 - 4g*4 - 3g*4 - 96 - g as ug + hg2 + jg*4 + b + pg*3 and give b. 0 Express ((-2 + 0 + 0)(-5u + 6u + 8u) - 1 - u + 1)(-19 + 4u2 + u + 41 - 31) in the form ju*2 + vu + h + lu3 and give j. -19 Rearrange (-3 + 1 + 6)(2w - 6w + 3w)(-23w + 53w + 109w) to the form j + iw*2 + cw and give i. -556 Rearrange (132p3 + 278p*3 - 124p*3)(2 + 2 - 3) to the form x + ip + qp*2 + gp*3 and give g. 286 Express -201k*2 - 322k + 416k2 - 217k*2 in the form lk*2 + r + gk and give g. -322 Express 10t2 - 2t*2 + 2 + 5t*3 - 3t*2 - 3t*3 - 4t as qt + b + gt*3 + kt*2 and give b. 2 Express (0 + 0 - 3)((4 + 2a - 4)(5a - a - 3a) + 2a2 - 3a*2 + 0a*2 - 11 + 11 - 4a*2 + 4a - 4a + 6a*2) in the form f + ka*2 + ca and give k. -9 Rearrange -1679u + 1684u - u2 + 11 + u2 + u*4 to iu*2 + cu + o + zu4 + hu*3 and give z. 1 Express (3v - 7v - 2v)((-2 + 3 + 1)(0 + 0 - v) + 0v + 3v - 5v + v + v - v) in the form sv + gv2 + z and give s. 0 Rearrange -10339 + 10337 + 10b - 37b + (3b + 5b - 4b)(-3 + 4 + 1) to y + qb and give q. -19 Express -3 + 95f + 3 - 119f - 1157f in the form b + nf and give n. -1181 Rearrange -111l + l2 + 6 + 111l + 2l4 - l3 + 0 to the form u + tl*2 + sl + dl4 + yl*3 and give s. 0 Rearrange v + 42 - 2v*4 - 47v*3 - 46v*3 - 47v*3 + 136v*3 to sv*3 + hv*2 + mv + q + jv4 and give q. 42 Express -6l*2 + 185l*2 + 84l*2 + 33l*2 in the form bl*2 + s + ql and give s. 0 Express -412l2 - 1028l*2 - 265l*2 in the form bl*2 + dl + i and give b. -1705 Rearrange -19m4 + 1536m*3 - 1536m*3 + (0m2 + m3 + 0m2)(2m - m + 3m) to am + fm*3 + hm*4 + v + ym*2 and give h. -15 Rearrange (-7f + f + 13f)(-2f - 2f + f + (-5f + 3f - 4f)(5 - 4 + 1)) to pf2 + q + yf and give p. -105 Rearrange -20z2 + 94z*3 - 20z*2 + 8z*2 + 28z*2 to jz*3 + hz*2 + iz + v and give h. -4 Express w + 3w + w + (2w + w + 7w)(9 + 0 - 2) as y + lw and give l. 75 Rearrange (5c - 415c2 + 420c*2 + c)(-14c - 6 + 6) to mc*3 + i + oc*2 + sc and give o. -84 Express 3z - 5z - 2z - 411z*2 + 4z in the form vz + b + uz*2 and give u. -411 Rearrange 35 - 4f*2 + 63 - 95 - 2f - 3f3 - 3f*2 to o + zf*2 + df*3 + bf and give b. -2 Rearrange (65m2 - 65m*2 - m + 2m*3 + (-3m + 2m + 3m)(4m*2 + 0m*2 + 0m*2))(1 - 5 - 1) to qm + s + zm*2 + im*3 and give q. 5 Express -1 + 373l + 3l4 - 6l4 - l3 - 371l + l4 + 31l*2 in the form yl*4 + kl + ul3 + v + wl2 and give w. 31 Express (-u3 + 2u2 - 2u*2 + (-u + 4u - u)(5 - 5 + u2))(1626 - 1626 + 144u) as ou + ru3 + w + bu*4 + du*2 and give b. 144 Rearrange (4 + 4 - 6)(2s - 2s - 2s2 + (3s + 0s - 5s)(2s + 1 - 1)) + (-3s + 3s - s*2)(15 + 3 + 196) to the form h + ws2 + ks and give w. -226 Rearrange -532y2 - 339y*2 + 449y*2 - 1088y*2 to the form py*2 + ry + u and give p. -1510 Rearrange -553 - 4v2 + 546 + 3v*2 + (4v - 2v + 0v)(3v + 0v - 2v) + v - v + 2v2 to the form a + pv*2 + qv and give a. -7 Express -7l3 + 6l*3 - 5l*3 - 11 as wl*3 + fl + i + tl2 and give i. -11 Rearrange (-66 + 71 - 6f - 29f)(2f + 3f - 3f) to bf + gf2 + j and give b. 10 Express 74f - 31f + 36f as qf + z and give q. 79 Rearrange -1430w*3 + 2865w*3 + 186 - 2w - 1434w3 to u + gw*3 + yw + cw2 and give y. -2 Rearrange (97o + 76o - 37o)(o + 4 - 4) + (-2o - o + o)(-1 + o + 1) to the form so*2 + y + qo and give s. 134 Express 75z3 - 13z*4 - 14z*2 - 74z*3 + 15z*2 - 14 in the form nz*4 + oz*3 + rz + h + xz2 and give x. 1 Express -2o3 - o4 - 41 + 3o2 + 74 - 2o - 35 in the form ro2 + k + to*3 + vo + ho4 and give t. -2 Express (32 + 10b*2 - 32)(-5b + 121 - 121)(4b - b + 0b) as rb3 + jb*4 + vb + w + zb2 and give j. -150 Rearrange 1398 - 1398 - 53f to uf + q and give u. -53 Rearrange (-8n + 54 + 26n - 20n)(28n - 14n - 15n) to the form p + an + dn2 and give a. -54 Express -j3 + j*3 + 19j*3 + (2 + 0 - 1)(-j*3 + 0j*3 + 0j*3) as vj*3 + b + rj*2 + hj and give v. 18 Express -5a + 2a*4 + a + 3a3 - a2 + 6 - 4a2 + 2a2 + a2 as va + la*2 + ia*3 + ta*4 + w and give i. 3 Express -72a*2 + 5a + 3 + 74a2 + 9a + 4a as ga + k + ma2 and give k. 3 Rearrange -4s + s*4 + 5s*2 - 7s*2 + 1 - s + 4s to the form zs3 + ls*4 + h + gs + os2 and give h. 1 Express -74w*3 + 4w + 2w + 81w*3 - 4w + 2w2 in the form fw*3 + j + gw*2 + nw and give f. 7 Rearrange (-72k - 529k - 80k)(3 - 1 + 2) to n + ck and give c. -2724 Express -2 + 131y - 94y + 2 + 196y in the form b + oy and give o. 233 Express 3 - 3 - 2z + (z + 5z + 0z)(0 - 4 + 0) + 2z + 27 - 27 in the form i + rz and give r. -24 Rearrange 170z + 320z + 42z + 82z to the form a + cz and give c. 614 Rearrange (2154 - 2154 + 176c)(-5c2 + c2 + 3c*2)(-2c - 2 + 2) to qc*2 + jc*4 + xc*3 + nc + p and give j. 352 Express 1 + 2m - 6m - 11m - 20 + 12 as cm + n and gi	{ "pile_set_name": "DM Mathematics" }
s -3/10961? True Is 9/10582 not equal to 0? True Is 105123 != 105125? True Is -109264 at least -109265? True Which is smaller: -21870 or -21875? -21875 Is 1 at most 990/703? True Are 1092798 and 1092798 nonequal? False Which is greater: 56 or -914? 56 Which is smaller: -34151 or -307370/9? -307370/9 Which is bigger: -312492 or -0.2? -0.2 Which is smaller: 1078 or 18? 18 Is 18580 at least 18576? True Are 282819 and 282818 unequal? True Which is smaller: 1/3 or -235376/3? -235376/3 Do 0 and 78/575 have the same value? False Which is greater: 1 or -1/1513170? 1 Which is smaller: 3/55885 or -0.2? -0.2 Does -8/94623 = 0? False Are -6809 and -6746 nonequal? True Which is bigger: 29110 or 29112? 29112 Which is smaller: 5/132997 or 1? 5/132997 Which is smaller: 2.27 or -129? -129 Which is bigger: -104 or 1861.5? 1861.5 Which is greater: 3846 or -27? 3846 Is -77524 smaller than -77529? False Which is greater: -63569 or -63576? -63569 Is -1540/2223 < -1? False Which is bigger: -160.01 or 2? 2 Which is greater: -0.32935 or -0.5? -0.32935 Is 102237 at most as big as 102240? True Which is smaller: 103 or 1439? 103 Which is bigger: -1 or 4/18829? 4/18829 Is -1828 > -1906? True Which is bigger: -15451 or -15460? -15451 Which is smaller: 4568 or 4588? 4568 Do 40701/19 and 2143 have the same value? False Which is smaller: -2/81069 or 0? -2/81069 Which is greater: -49/2078 or -1? -49/2078 Is 71541 <= 71543? True Is 0 <= 19/2276? True Do -222993 and -222993 have the same value? True Which is smaller: 1891/23 or 83? 1891/23 Are -2 and -749/724 unequal? True Is 229834 != 919335/4? True Which is smaller: 0.05 or 243645? 0.05 Is -29071 less than -44? True Is -1214 smaller than -1207? True Is -1656 > 30? False Which is smaller: -1605836 or -0.1? -1605836 Which is bigger: -2 or 60895? 60895 Which is greater: -6 or 15872? 15872 Which is bigger: -2/7 or 5/579? 5/579 Which is greater: 3 or -190535? 3 Which is smaller: 6201 or 6198? 6198 Which is smaller: -101/3 or 23/4? -101/3 Which is smaller: -38 or -11/932? -38 Are -0.076216 and 1 unequal? True Are -800325 and 0 equal? False Which is smaller: -7 or -93521? -93521 Is 3107481 smaller than 3107482? True Which is greater: 6/499969 or -1? 6/499969 Is -1 greater than or equal to -8/575681? False Which is bigger: -54741 or -54749? -54741 Which is smaller: 114926 or 2/9? 2/9 Which is bigger: 20/14841 or 0? 20/14841 Is -1/14 at least -43429? True Which is smaller: 11 or -56/1675? -56/1675 Do 53362 and 53360 have the same value? False Which is bigger: -108 or -3486? -108 Is 3/8 greater than 2914? False Is -6/384917 less than -1? False Which is bigger: 672976 or 672979? 672979 Is -0.1 != -325/199? True Do 1.5293 and 18 have different values? True Is -176538/5 smaller than -35309? False Which is smaller: 48446/187 or 260? 48446/187 Does -20/11 = -20381? False Is 0 <= 158/12793? True Is 470 <= 916? True Is -1 at least -93/10073? False Are 1 and 9/145237 unequal? True Which is bigger: 3236 or 3222? 3236 Which is bigger: 192 or -1612? 192 Which is smaller: -8306 or -5? -8306 Is 2/7 smaller than 5/3806? False Is 884035 > 884038? False Which is greater: -1851 or -679? -679 Which is greater: -1207/24 or -50? -50 Which is bigger: -4126 or -4114? -4114 Are -779 and -780 unequal? True Does 1.4 = -975/53? False Which is greater: 127 or -9613/6? 127 Is 41626 > 41571? True Is 602479/5 > -1? True Which is bigger: -12367112 or 1? 1 Is -37521 not equal to -150079/4? True Are 5 and -3/885275 unequal? True Does 469288 = 469289? False Which is smaller: -3/228661 or 1? -3/228661 Which is greater: 460 or 19? 460 Which is bigger: -73 or -8973? -73 Is 367511 at most as big as 367511? True Are 240650 and 240648 non-equal? True Which is bigger: -459/3710 or 1? 1 Is -9 less than or equal to -2393? False Which is greater: 2/48389 or 1? 1 Which is greater: 11 or 2213/209? 11 Which is smaller: -45/2 or -219/14? -45/2 Which is greater: -583 or -903? -583 Which is smaller: 99045 or 99027? 99027 Which is smaller: -100.48 or -2/3? -100.48 Which is smaller: 0.0933 or -31? -31 Which is smaller: -1 or 803? -1 Do -31513 and -94535/3 have different values? True Which is smaller: 1 or -67/20612? -67/20612 Which is bigger: 4/130951 or 2? 2 Do -80 and -6921/85 have different values? True Is -61271 smaller than -61272? False Which is smaller: 1/1062572 or 0? 0 Is 4135 at most as big as 4140? True Are 400/249 and 1 non-equal? True Which is smaller: 3 or -48661? -48661 Is -2/68759 != 1? True Which is smaller: 0 or -2268/9127? -2268/9127 Which is greater: 34 or -89? 34 Is 2/5323781 greater than or equal to 0? True Which is greater: 240/12443 or 0.3? 0.3 Which is smaller: 217/1128 or 0.2? 217/1128 Is 0 greater than -2535887? True Which is smaller: -7694 or -7704? -7704 Which is greater: 88/10073 or -1? 88/10073 Is 1/4 bigger than -3471? True Are 169/16210 and 0 unequal? True Which is greater: -253156 or -253161? -253156 Are 65216 and 6 equal? False Which is bigger: -21944/9 or -2437? -2437 Do 650 and 28 have different values? True Is -103123 less than -103125? False Is -89.199 >= -2? False Which is greater: 24/1357 or 1? 1 Is 951 != 966? True Which is greater: 4.5235 or 1.4? 4.5235 Which is smaller: -23736 or -142415/6? -23736 Is 199902/127 less than or equal to 1574? False Is 179030 <= 179039? True Which is greater: -17012 or -17023? -17012 Is 1 less than 29/10524? False Is 594/151 equal to 5? False Which is smaller: -9/24304 or 1? -9/24304 Which is greater: 16379 or 16388? 16388 Is 6938 at most 6877? False Is -1031281 at least -1031281? True Which is bigger: -1 or 33/3932? 33/3932 Which is greater: 51 or 50? 51 Is -15270 at least -15277? True Which is smaller: -0.3 or 197727? -0.3 Which is greater: -39189/49 or -799? -799 Which is smaller: -35883 or -35894? -35894 Which is greater: -644/1881 or 1? 1 Which is smaller: 29 or 413? 29 Which is greater: -0.1 or 1941447? 1941447 Which is smaller: -18 or 6885.2? -18 Is 0 less than 2086/33? True Which is smaller: 2 or 2059/2218? 2059/2218 Which is bigger: 14300 or 14303? 14303 Which is bigger: -4213 or -67421/16? -4213 Which is smaller: -0.240211 or 1/7? -0.240211 Is -398884 >= -398884? True Which is bigger: 16288 or 48868/3? 48868/3 Is -794 at least as big as -7145/9? False Which is bigger: 4739 or 123223/26? 123223/26 Is -1/4 at least 87779? False Which is greater: 1307759 or 1307758? 1307759 Which is smaller: 0 or 50/28133? 0 Do 1 and -23/88273 have the same value? False Which is greater: -634 or 0.0355? 0.0355 Is -2/5 > -391650? True Which is bigger: 2/9 or -177829? 2/9 Are 1937/2 and 970 equal? False Is -8/5055 less than or equal to -1? False Which is smaller: 138/2495 or -2/7? -2/7 Is 332527 greater than or equal to 332527? True Which is bigger: -97941/5 or -19589? -97941/5 Which is smaller: -1 or -24/70423? -1 Which is smaller: 22/17 or -2251? -2251 Which is bigger: 2.4 or 4/237181? 2.4 Is 581/480 at most 1? False Is -0.25 > -39755? True Are 0 and -1/698603 equal? False Are -682155 and -0.3 nonequal? True Which is smaller: 12344 or 12343? 12343 Which is smaller: 23767 or 23765? 23765 Which is smaller: 0.2 or 1368? 0.2 Is -51 != -49/113? True Is -517 greater than or equal to 81? False Which is smaller: 8 or 1285/159? 8 Is -1765 bigger than -2089? True Is 16204 less than or equal to 243046/15? False Which is smaller: -650 or -520? -650 Which is smaller: 43 or 1865/42? 43 Is 367241/8 smaller than 45905? False Is -75/120668 > -1? True Which is greater: 90962 or 90961? 90962 Which is greater: -1 or -4/6257143? -4/6257143 Which is greater: -52891 or -52888? -52888 Is 1137 less than or equal to 0.5? False Is 14629 at least as big as 14640? False Which is smaller: 6659 or 2/103? 2/103 Is -417836 greater than or equal to -417833? False Are 34/3829 and 1 nonequal? True Which is smaller: 2 or -125892? -125892 Is 41 > -2047? True Is -11200/17 bigger than -660? True Which is greater: 2/11822809 or 0? 2/11822809 Is -76115/2 smaller than -38058? False Which is smaller: 0 or -24/12265? -24/12265 Is -194024 <= -194025? False Which is bigger: 9/17725 or 1? 1 Is -134 equal to 32? False Is -1366115/11 equal to -124192? False Which is bigger: -1183/37 or -31? -31 Is 250063 bigger than 250065? False Is 2263942 bigger than 2263942? False Is	{ "pile_set_name": "DM Mathematics" }
vided by u. 6 Let w(t) = -t*3 - 7t*2 - 7t + 9. Suppose -16p + 176 = -8p. Calculate the remainder when w(-8) is divided by p. 19 Let r = -4 - -7. Let x be ((-93)/(-3))/((-2)/8). Let w = x - -127. What is the remainder when w is divided by r? 0 Let j(c) = c*3 + 4c*2 - 6c - 1. Let f be j(-5). Suppose -5 - 63 = -fv. What is the remainder when 47 is divided by v? 13 Let o = -619 + 929. What is the remainder when o is divided by 52? 50 Let r = 10 + -8. Let i be (3 + 0)/33. Let x(m) = 2m - 2. Calculate the remainder when x(i) is divided by r. 0 Let o be 3 + -1 + (-13)/13 - 4. Calculate the remainder when (-9)/(-27) + (-281)/o is divided by 19. 18 Let m(t) = -t3 + 5t*2 + 2t. Suppose 2a = 3a + 5. Let s = 10 + a. Calculate the remainder when m(s) is divided by 3. 1 Suppose 2t - 78 = 50. Let c be (t/80)/(2/50). Let v = c + -13. What is the remainder when v is divided by 4? 3 Suppose -6g + 1298 = 1238. Calculate the remainder when 867 is divided by g. 7 Calculate the remainder when (5/(100/32))/((-4)/(-100)) is divided by 6. 4 Let g(b) = 2b - 1. Suppose -4d - 3 = 25. What is the remainder when (68/10)/(d/(-35)) is divided by g(4)? 6 Let d(h) = -h*2 + 5h + 7. Suppose 3l + z = 97, 0 = 5l + 4z - 149 - 15. What is the remainder when l is divided by d(5)? 4 Let z = 2169 - 2159. Calculate the remainder when -49(2 - 6/2) is divided by z. 9 Let q(z) = z*3 - 7z*2 + 3z - 3. Suppose -238 + 356 = 2p. What is the remainder when p is divided by q(7)? 5 Let p(s) = s2 + 45s + 404. What is the remainder when p(-11) is divided by (4/5)/((-2)/(-40))? 14 Let n(r) = -r + 1. Let f be n(-10). Let i = 21 - f. Suppose 3c - i = 5, -3v = 4c - 101. Calculate the remainder when 134 is divided by v. 26 What is the remainder when (6 - 576/(-27)) + 4/6 is divided by 23? 5 Suppose -5c - 25l + 22l = -277, -5c + 278 = 2l. Let x = 32 - 13. Calculate the remainder when c is divided by x. 18 Let j(q) = 6q - 6 + 4q - 1 - 6q. Calculate the remainder when 2/4 + 98/4 is divided by j(4). 7 Let y(a) = -a3 - 6a*2 - 5a. Let v be y(-5). Suppose -x + v + 4 = 0, -3j + x = -47. Let t = -1 + j. What is the remainder when t is divided by 10? 6 Suppose -82v - 1782 = -104v. Suppose -3h + 29 = -7. Calculate the remainder when v is divided by h. 9 Suppose 0 = -26g + 449 - 59. What is the remainder when 110 is divided by g? 5 Let t(w) = -6w - 4. Let n be t(-2). Let u be 22/n + 7/28. What is the remainder when 2 - (-3 + -18)/u is divided by 3? 0 Suppose -5l = -4q - 19, -2l - 17 = -5l + q. Let u(h) = 7h + 2h + 0h3 - 9 + h3 - lh*2. Calculate the remainder when u(6) is divided by 5. 4 Let q(t) = 16t + 91. Calculate the remainder when 405 is divided by q(-5). 9 Let k be (-14)/211-9. Suppose -ka = -8 - 10. Suppose -x - 4b = -18, 54 = ax + 5b - b. What is the remainder when 71 is divided by x? 17 Let h = 588 + -572. What is the remainder when 511 is divided by h? 15 Suppose 11v + 9v = 2560. What is the remainder when v is divided by 43? 42 Suppose -6f + 401 = -379. What is the remainder when f is divided by 58? 14 Suppose p = 2p - 66. Suppose 11d - 140 = 47. Calculate the remainder when p is divided by d. 15 What is the remainder when (6/(-3))/(2/(-945)) is divided by 79? 76 Suppose 0 = g - 2d - 5 - 22, -2d = 0. Let x = -52 + 14. Let n = 53 + x. What is the remainder when g is divided by n? 12 Suppose -2s = s - 96. Let k = -9 - -18. Calculate the remainder when s is divided by k. 5 Suppose -16 = -k - 18. Calculate the remainder when 29 is divided by k - (-1 + -43). 7 Let u be ((-12)/(-15))/((-1)/(-5)). Suppose uv - 9 = 207. What is the remainder when v is divided by 15? 9 Let z = -1334 + 1356. Suppose 5i - n - 23 = 0, -19 = -5i + 2n + n. What is the remainder when z is divided by i? 2 Suppose -2m - 5u + 19 = 0, 6u - 29 = -2m + 3u. What is the remainder when 505 is divided by m? 21 Let j(k) = -2k + 12. Let o be j(0). Let w(v) = -2v + 17 - 20 + o. Calculate the remainder when 79 is divided by w(-9). 25 Suppose 26 - 62 = -2z. Suppose -130 = -4d - z. What is the remainder when d is divided by 6? 4 Let k = 46 - 23. Let g be (-12)/10(-15)/6. Suppose -2b + 14 = 2u, 2b = -b + g. Calculate the remainder when k is divided by u. 5 Let p(n) = n*2 - 9n - 6. Let v(x) = -3x + 12. Let w(k) = 1. Let z(d) = -v(d) - w(d). Calculate the remainder when z(6) is divided by p(10). 1 Let a = 1699 + -1664. Calculate the remainder when 98 is divided by a. 28 Let u = 13 + 2. Suppose 5q - 90 = -u. Let i = -6 + q. What is the remainder when 33 is divided by i? 6 Let v(y) be the third derivative of y*6/120 + 11y*5/60 + 3y4/8 + y3 + 2y2 - 25y. What is the remainder when 29 is divided by v(-10)? 13 Suppose 3 = 2k + 37. Let n be 1 - (k - (1 - 4)). Let a = -9 + n. What is the remainder when 23 is divided by a? 5 Let s be 125/175 + (-2)/(-7). Let o = 20 + s. What is the remainder when 40 is divided by o? 19 Suppose 10z - 521 = 459. Suppose -4g + 61 = -39. What is the remainder when z is divided by g? 23 Let o(c) = -c2 - 15c - 18. Suppose 4n = 5n + 14. Let q be o(n). What is the remainder when 22 is divided by q(-4)/8 - -11? 9 Let x = -101 - -21. Let o = 149 + x. What is the remainder when o is divided by 18? 15 Let x = 194 + -72. Calculate the remainder when 240 is divided by x. 118 Suppose -24 = -i + 28. Calculate the remainder when (0 + 206/(-4))(0 + -2) is divided by i. 51 Calculate the remainder when 6 is divided by (-126)/(-21) + 1(-2 + -1). 0 Suppose 2d - 17d = -585. Suppose d = -23k + 26k. Calculate the remainder when 24 is divided by k. 11 Let g = 219 - 41. What is the remainder when g is divided by 38? 26 Suppose 0 = l - 5l + 144. Suppose -5i = -3v + 50, -i + l = 2v - 3i. Suppose 0o + 3o - 114 = 0. What is the remainder when o is divided by v? 18 Suppose 5o = -5f + 45, -2o = f - 4 - 9. Let b = 1 + f. What is the remainder when 4/681/b is divided by 3? 0 Let o = 5 + -8. What is the remainder when 67 is divided by (-53)/o - ((-4)/(-3))/(-1)? 10 Suppose z - 2l = -0l + 25, -3l + 78 = 4z. Suppose -11 - 77 = -11m. Calculate the remainder when z is divided by m. 5 Suppose 3f = -m + 53, -m + 2f = -0f - 63. Calculate the remainder when m is divided by (-2 + 7)32/10. 11 Suppose -2y + p = -25, y + 0 = p + 15. Let u = y - 13. Let c(t) = -10t - 4. Calculate the remainder when c(u) is divided by 7. 5 Let v = 4 + 18. Let y = -5 + 1. Calculate the remainder when v is divided by y(-5 - (-3)/1). 6 Let l = 2 + 3. Suppose v - 2v = 0. Suppose -lp = -vp + 5u - 385, 2u = -p + 80. Calculate the remainder when p is divided by 19. 17 Suppose q + 22 = -3z + 96, 2q + 5z - 147 = 0. Calculate the remainder when q is divided by ((-36)/(-5))/(-2123/(-2415)). 35 Let h(l) = -l3 - 11l*2 + 13l + 12. Let w be h(-12). Suppose -2u = -wu - 28. What is the remainder when 55 is divided by u? 13 Let g = 63 - 45. Suppose d = 2x + 55, 2287 = 44d + 5d + 4x. What is the remainder when d is divided by g? 11 Let p(l) = -l*2 + 9l + 3. Let n = 2844 + -2832. What is the remainder when p(5) is divided by n? 11 Let r(l) = -57l + 725. What is the remainder when r(10) is divided by 25? 5 Suppose 0 = -3u + 155 + 1. Let l(t) = -t*3 - 10t*2 - 4t - 4. Let y be l(-10). Let q = 54 - y. What is the remainder when u is divided by q? 16 Let f = 58 - 28. Calculate the remainder when (96/f)/((-4)/(-70)) is divided by 15. 11 Let h be 230/15 - 2(-4)/12. Calculate the remainder when 5 is divided by (-14 + h)/(0 + (-4)/(-10)). 0 Let q be 4/10 - 128/20. Let i(x) = -x3 - x2 - 4. What is the remainder when i(-4) is divided by (10/(-4))/(q/36)? 14 Let a = -495 - -507. Calculate the remainder when 237 is divided by a. 9 Suppose 0 = -5c - 25, 4c + 120 + 17 = k. Calculate the remainder when k is divided by 66. 51 Let i(v) = -v2 + v - 1. Let w(g) = -6g*2 + 3g + 7. Let l(n) = -4i(n) + w(n). Calculate the remainder when 15 is divided by l(0). 4 Let b(p) = -4p3 - p2 + 3p + 2. Let o = 586 + -415. Suppose 4m = o + 209. Calculate the remainder when m is divided by b(-2). 23 Let t(c) = c - 4. Let y be t(4). Let g(w) = 25 - 7 + 11 + w + 2. Calculate the remainder when g(y) is divided by 11. 9 Let x(i) = -3 + 2 + 2*i - 1	{ "pile_set_name": "DM Mathematics" }
is the next term in 2127, 8523, 19181, 34101, 53283? 76727 What comes next: 97, 740, 2485, 5884, 11489? 19852 What is the next term in 95038, 380156, 855358, 1520650, 2376038? 3421528 What comes next: 1941, 2115, 2291, 2469, 2649, 2831, 3015? 3201 What is next in -461, -1533, -3327, -5849, -9105, -13101, -17843? -23337 What is next in -117, -261, -437, -639, -861, -1097, -1341, -1587? -1829 What is next in -80207, -80237, -80267, -80297, -80327? -80357 What is next in -3653, -3653, -3657, -3665, -3677, -3693, -3713? -3737 What is next in -22323, -22324, -22327, -22332, -22339? -22348 What is next in 1715, 3401, 5055, 6677? 8267 What is next in 5166, 5621, 6090, 6579, 7094? 7641 What is next in 1085, 964, 775, 524, 217, -140, -541, -980? -1451 What comes next: -686, -657, -614, -551, -462, -341, -182, 21? 274 What comes next: 57, 142, 223, 300, 373? 442 What comes next: 38232, 152920, 344068, 611676? 955744 What is next in 459, 945, 1459, 2001, 2571, 3169, 3795? 4449 What comes next: -5560, -5617, -5674, -5731? -5788 What is next in -1474, -2657, -3840, -5023? -6206 What is the next term in 110, 229, 326, 395, 430, 425? 374 What is the next term in -21, -48, -93, -156, -237, -336, -453? -588 What comes next: -16443, -32875, -49297, -65703, -82087? -98443 What is the next term in -1897, -3734, -5571? -7408 What comes next: 67860, 135710, 203560, 271410, 339260, 407110? 474960 What comes next: -55, -99, -245, -553, -1083, -1895, -3049, -4605? -6623 What is next in 10676, 42816, 96390, 171404, 267864, 385776? 525146 What comes next: 20569, 41134, 61699, 82264, 102829? 123394 What is next in -6303732, -6303730, -6303726, -6303720, -6303712, -6303702, -6303690? -6303676 What comes next: -95230, -190459, -285688, -380917, -476146, -571375? -666604 What comes next: -4519, -4517, -4515, -4513, -4511? -4509 What is the next term in -18, 11, 196, 615, 1346? 2467 What comes next: 10329, 10338, 10361, 10404, 10473, 10574, 10713? 10896 What is the next term in -24162, -24147, -24116, -24063, -23982? -23867 What is the next term in 208313, 208295, 208265, 208223, 208169, 208103? 208025 What is the next term in -124, -582, -1346, -2416, -3792, -5474, -7462? -9756 What comes next: 105243, 420966, 947171, 1683858, 2631027? 3788678 What is the next term in -15751, -15791, -15903, -16123, -16487, -17031, -17791? -18803 What comes next: 9120, 9144, 9168, 9192, 9216? 9240 What is next in -769167, -769163, -769157, -769149, -769139, -769127, -769113? -769097 What comes next: 6536, 13408, 20306, 27242, 34228, 41276, 48398, 55606? 62912 What comes next: -1802, -7197, -16186, -28769, -44946, -64717, -88082? -115041 What is the next term in -3373, -3039, -2705, -2371? -2037 What is the next term in 37279, 37280, 37281, 37282? 37283 What comes next: 941, 1778, 2601, 3404, 4181, 4926? 5633 What comes next: 50980, 101963, 152946, 203929? 254912 What comes next: 76, 628, 2132, 5062, 9892, 17096, 27148? 40522 What is next in -143064, -143066, -143068? -143070 What is next in 5221, 20877, 46971, 83503, 130473, 187881, 255727? 334011 What comes next: 1480, 2942, 4388, 5818? 7232 What is next in 37, 31, 3, -47, -119, -213, -329? -467 What is next in 411, 1630, 3653, 6474, 10087, 14486, 19665? 25618 What comes next: 387829, 775702, 1163573, 1551442, 1939309, 2327174? 2715037 What is the next term in 4253, 8454, 12603, 16700? 20745 What is next in -2923, -3057, -3189, -3319, -3447? -3573 What comes next: -6769, -6762, -6755, -6748, -6741, -6734? -6727 What is the next term in 267, 611, 975, 1359? 1763 What comes next: -135, -152, -181, -228, -299, -400? -537 What is next in -252, -482, -712, -942? -1172 What comes next: -1790, -1817, -1844, -1859, -1850, -1805? -1712 What is next in 12040, 24092, 36144? 48196 What is the next term in 39428, 39463, 39544, 39689, 39916, 40243, 40688, 41269? 42004 What is the next term in 47470, 94941, 142412, 189883, 237354? 284825 What is next in 2467, 4699, 6925, 9145, 11359, 13567? 15769 What is next in 206, 564, 1076, 1742, 2562, 3536, 4664? 5946 What comes next: -18260, -73047, -164358, -292193? -456552 What is the next term in 44634, 44635, 44630, 44613, 44578, 44519, 44430? 44305 What is next in -1433295, -2866590, -4299885? -5733180 What comes next: -57699, -115396, -173093? -230790 What comes next: -9511, -9755, -10419, -11713, -13847? -17031 What is next in 2863053, 2863052, 2863051, 2863050? 2863049 What is next in 94838, 94829, 94820, 94811? 94802 What is the next term in 10631, 10637, 10645, 10655, 10667, 10681? 10697 What is the next term in 26400, 26396, 26390, 26382, 26372, 26360? 26346 What is the next term in -28295, -28277, -28259? -28241 What is the next term in -521, -1067, -1641, -2243, -2873, -3531, -4217? -4931 What comes next: -1411, -3316, -6491, -10936, -16651, -23636, -31891? -41416 What is the next term in -7862, -15719, -23570, -31415, -39254, -47087, -54914? -62735 What is next in -152, -68, 16, 100? 184 What comes next: 5, -135, -601, -1555, -3159, -5575? -8965 What comes next: -340, -648, -936, -1210, -1476, -1740, -2008, -2286? -2580 What is the next term in 49, -8, -137, -368, -731, -1256, -1973, -2912? -4103 What is next in -212, -1261, -3002, -5429, -8536, -12317? -16766 What is the next term in 32270, 32272, 32274, 32276? 32278 What comes next: -249, -176, -39, 174, 475, 876, 1389? 2026 What is the next term in 380576, 380575, 380574? 380573 What is next in 6305, 25149, 56549, 100499, 156993? 226025 What is next in -139, -628, -1347, -2290, -3451, -4824, -6403? -8182 What is next in -20489, -20468, -20433, -20384? -20321 What comes next: 109, 284, 459, 634, 809, 984? 1159 What is the next term in -435, -1713, -3811, -6717, -10419, -14905, -20163? -26181 What is next in 5979, 11860, 17753, 23664, 29599, 35564? 41565 What is the next term in 108521, 108522, 108523, 108524, 108525, 108526? 108527 What is next in 13009, 52039, 117091, 208165, 325261? 468379 What comes next: 29403, 58809, 88215, 117621, 147027, 176433? 205839 What comes next: 4380, 4364, 4322, 4242, 4112, 3920? 3654 What comes next: 152, 126, 84, 26, -48, -138? -244 What comes next: -958189, -1916380, -2874571, -3832762, -4790953, -5749144? -6707335 What is the next term in 158802, 317604, 476406, 635208? 794010 What is the next term in -662, -2788, -6332, -11294, -17674, -25472? -34688 What is the next term in 380, 940, 1500? 2060 What is next in -2437, -2444, -2451? -2458 What comes next: -2539, -4748, -6957? -9166 What comes next: -1510, -1514, -1520, -1534, -1562? -1610 What is the next term in 5640, 5488, 5336? 5184 What comes next: 53, 131, 201, 257, 293, 303? 281 What is the next term in -21, -30, -41, -54, -69, -86, -105? -126 What comes next: -254, -761, -1524, -2543, -3818, -5349, -7136? -9179 What is next in 118, 98, 62, 4, -82, -202, -362, -568? -826 What is the next term in 17818, 35660, 53524, 71410, 89318, 107248, 125200? 143174 What is the next term in -445, -470, -487, -490, -473, -430, -355? -242 What comes next: 11, 6, -17, -58, -117? -194 What is next in 481016, 481015, 481014? 481013 What is the next term in -178671, -178616, -178465, -178170, -177683? -176956 What is next in 11708, 23411, 35114, 46817, 58520? 70223 What is the next term in -2181, -4298, -6387, -8436, -10433? -12366 What is the next term in 62203, 124404, 186605, 248806? 311007 What is next in 42, 189, 438, 789? 1242 What is the next term in -648, -646, -714, -888, -1204, -1698, -2406? -3364 What is the next term in 558605, 558604, 558603? 558602 What is next in 56, -23, -162, -361? -620 What comes next: -1002, -3972, -8910, -15810, -24666, -35472, -48222? -62910 What is next in 11524, 11548, 11572, 11596, 11620, 11644? 11668 What is next in -2, -93, -288, -629, -1158, -1917? -2948 What is next in 107, 506, 1583, 3674, 7115, 12242? 19391 What is the next term in -10, -26, -40, -52? -62 What comes next: 1682, 6760, 15252, 27182, 42574, 61452, 83840, 109762? 139242 What comes next: -79800, -159598, -239396, -319194, -398992, -478790? -558588 What is the next term in 914, 876, 822, 758, 690? 624 What is the next term in -5418, -5424, -5432, -5442, -5454, -5468? -5484 What is the next term in -44667, -89328, -133991, -178656? -223323 What is the next term in 3	{ "pile_set_name": "DM Mathematics" }
1, a: 2, p: 1, w: 2, j: 1, y: 1}. Give prob of picking 1 p, 1 e, and 1 a. 1/28 Four letters picked without replacement from {r: 18, z: 2}. Give prob of picking 4 r. 12/19 Two letters picked without replacement from {h: 2, i: 1}. Give prob of picking 1 h and 1 i. 2/3 Two letters picked without replacement from {g: 1, e: 1, r: 2, i: 1, p: 2, l: 2}. Give prob of picking 1 i and 1 p. 1/18 Calculate prob of picking 1 c, 1 l, and 1 t when three letters picked without replacement from {c: 1, t: 1, y: 1, j: 1, p: 2, l: 1}. 1/35 Three letters picked without replacement from {r: 2, z: 1, c: 1, b: 1}. What is prob of picking 1 c, 1 b, and 1 z? 1/10 Four letters picked without replacement from {n: 4, v: 7}. What is prob of picking 3 n and 1 v? 14/165 Two letters picked without replacement from {a: 1, b: 5, o: 1, t: 3}. What is prob of picking 1 a and 1 t? 1/15 Two letters picked without replacement from ecpupppuepeututteeut. What is prob of picking 2 p? 1/19 Three letters picked without replacement from {p: 13, o: 5}. Give prob of picking 1 o and 2 p. 65/136 Calculate prob of picking 3 f and 1 y when four letters picked without replacement from {y: 7, f: 6}. 28/143 Four letters picked without replacement from {i: 10, z: 9}. What is prob of picking 4 z? 21/646 What is prob of picking 3 e and 1 v when four letters picked without replacement from veeveveeerverev? 8/39 Two letters picked without replacement from {c: 2, n: 1, k: 2, l: 1, e: 1, y: 1}. What is prob of picking 1 c and 1 k? 1/7 Calculate prob of picking 3 u when three letters picked without replacement from hhuhhuuh. 1/56 What is prob of picking 1 m, 1 l, and 1 s when three letters picked without replacement from anlmsseaemes? 3/110 Two letters picked without replacement from bddttdddbbdb. What is prob of picking 2 d? 5/22 Calculate prob of picking 1 n and 2 e when three letters picked without replacement from {o: 2, e: 11, n: 7}. 77/228 Three letters picked without replacement from zfffufufzuuzf. Give prob of picking 1 f and 2 z. 9/143 Three letters picked without replacement from {o: 3, j: 3, e: 12}. Give prob of picking 1 o and 2 e. 33/136 Two letters picked without replacement from {n: 3, m: 1, u: 7, b: 2, z: 5}. What is prob of picking 1 m and 1 u? 7/153 Four letters picked without replacement from bbbnbbnnnnbnnnbbnbnn. What is prob of picking 3 n and 1 b? 99/323 Two letters picked without replacement from dzzzzd. What is prob of picking 2 d? 1/15 Three letters picked without replacement from {k: 1, a: 2, f: 2, b: 1}. Give prob of picking 2 a and 1 k. 1/20 Four letters picked without replacement from ykzyzzkkykkky. What is prob of picking 2 y, 1 z, and 1 k? 108/715 Two letters picked without replacement from mvvgmvmmvmmivvq. What is prob of picking 2 m? 1/7 Two letters picked without replacement from {f: 1, k: 11, x: 6, m: 1, a: 1}. Give prob of picking 1 x and 1 m. 3/95 What is prob of picking 2 l and 1 c when three letters picked without replacement from {e: 8, l: 4, c: 5}? 3/68 Three letters picked without replacement from pdyftfpiyfiyydp. Give prob of picking 2 i and 1 p. 3/455 Three letters picked without replacement from {h: 11, j: 9}. What is prob of picking 3 j? 7/95 Calculate prob of picking 1 w, 1 e, and 1 t when three letters picked without replacement from inenwitnniwwan. 3/364 What is prob of picking 2 k and 1 x when three letters picked without replacement from {x: 1, k: 2, z: 2, w: 4}? 1/84 Two letters picked without replacement from {x: 3, s: 1}. What is prob of picking 2 x? 1/2 Calculate prob of picking 2 s when two letters picked without replacement from {s: 2, x: 5, n: 1, h: 4, t: 5, m: 3}. 1/190 What is prob of picking 1 n and 1 e when two letters picked without replacement from {e: 5, n: 13}? 65/153 Two letters picked without replacement from {n: 3}. What is prob of picking 2 n? 1 What is prob of picking 2 d when two letters picked without replacement from {g: 2, d: 2, b: 1, f: 1, l: 3, z: 9}? 1/153 Three letters picked without replacement from mmgymgxgii. What is prob of picking 1 y, 1 m, and 1 x? 1/40 What is prob of picking 1 z, 2 i, and 1 b when four letters picked without replacement from {t: 3, z: 1, b: 8, y: 1, i: 6}? 10/323 What is prob of picking 4 m when four letters picked without replacement from smmmmmmmmmmmsmmmmmsm? 28/57 Three letters picked without replacement from xxhxxhhhxthhtxhxhxx. Give prob of picking 3 x. 28/323 Calculate prob of picking 1 a and 1 w when two letters picked without replacement from awaaaaaaaaaaa. 2/13 Three letters picked without replacement from {n: 1, u: 1, y: 8, l: 9}. What is prob of picking 2 l and 1 u? 12/323 Two letters picked without replacement from {r: 8, z: 3}. What is prob of picking 2 z? 3/55 What is prob of picking 2 x and 1 i when three letters picked without replacement from {o: 4, i: 1, x: 3}? 3/56 What is prob of picking 1 a and 3 f when four letters picked without replacement from {a: 3, f: 4}? 12/35 Two letters picked without replacement from twu. What is prob of picking 1 t and 1 w? 1/3 Calculate prob of picking 1 m and 1 g when two letters picked without replacement from {h: 7, y: 1, n: 4, g: 3, m: 4}. 4/57 Four letters picked without replacement from qqyyyqy. What is prob of picking 3 q and 1 y? 4/35 Calculate prob of picking 1 b, 2 l, and 1 r when four letters picked without replacement from {l: 2, m: 4, z: 2, p: 1, r: 2, b: 1}. 2/495 Three letters picked without replacement from {y: 1, f: 11, d: 8}. Give prob of picking 2 f and 1 y. 11/228 Two letters picked without replacement from {a: 2, r: 1, q: 1, g: 3, w: 5, x: 8}. What is prob of picking 2 w? 1/19 What is prob of picking 3 b and 1 y when four letters picked without replacement from {r: 1, b: 4, y: 9}? 36/1001 Two letters picked without replacement from {z: 2, u: 6}. What is prob of picking 1 u and 1 z? 3/7 Calculate prob of picking 2 v, 1 m, and 1 f when four letters picked without replacement from cvvvjcmffqc. 1/55 Four letters picked without replacement from {v: 5, h: 3, t: 3, n: 1, m: 7}. What is prob of picking 1 h, 1 n, and 2 t? 3/1292 What is prob of picking 3 d when three letters picked without replacement from fuuududfufdudduu? 1/56 What is prob of picking 1 b, 1 c, 1 a, and 1 q when four letters picked without replacement from gqbggaccbggb? 2/165 Calculate prob of picking 2 a when two letters picked without replacement from aaa. 1 Three letters picked without replacement from {i: 1, g: 3, k: 1, o: 4, m: 3, d: 3}. Give prob of picking 1 d, 1 o, and 1 k. 12/455 Four letters picked without replacement from cvcaqeleaaecqceellaa. What is prob of picking 1 v, 1 c, and 2 q? 4/4845 Calculate prob of picking 1 z and 1 c when two letters picked without replacement from czzozzcyvo. 8/45 Three letters picked without replacement from hhhhhhhjhhhh. What is prob of picking 3 h? 3/4 Three letters picked without replacement from llllddddlll. Give prob of picking 3 d. 4/165 Two letters picked without replacement from theccvq. What is prob of picking 1 v and 1 e? 1/21 Two letters picked without replacement from {x: 5, b: 14}. What is prob of picking 1 b and 1 x? 70/171 Four letters picked without replacement from {x: 3, y: 1, n: 1, z: 2, c: 3}. Give prob of picking 2 y, 1 x, and 1 z. 0 What is prob of picking 1 r, 2 l, and 1 d when four letters picked without replacement from {y: 1, r: 1, l: 2, j: 2, d: 1}? 1/35 What is prob of picking 1 u and 1 o when two letters picked without replacement from {u: 5, o: 7}? 35/66 Three letters picked without replacement from wwmwwmwmmwwwwm. What is prob of picking 2 m and 1 w? 45/182 Calculate prob of picking 1 a and 2 d when three letters picked without replacement from dacdsdaaaajjdjj. 6/91 Two letters picked without replacement from bxbsbbnm. What is prob of picking 1 s and 1 x? 1/28 What is prob of picking 2 e when two letters picked without replacement from vcvvrvemvevycye? 1/35 What is prob of picking 2 x and 1 k when three letters picked without replacement from {q: 1, k: 1, n: 7, e: 2, x: 4, o: 3}? 1/136 What is prob of picking 1 s and 1 c when two letters picked without replacement from ppccspelpeclpep? 1/35 What is prob of picking 2 s and 2 o when four letters picked without replacement from {s: 5, o: 13}? 13/51 C	{ "pile_set_name": "DM Mathematics" }
is the hundreds digit of 440927167? 1 What is the ten millions digit of 265908211? 6 What is the millions digit of 23056532? 3 What is the tens digit of 20798849? 4 What is the thousands digit of 7323932? 3 What is the thousands digit of 164316179? 6 What is the hundred thousands digit of 405229236? 2 What is the ten thousands digit of 143738929? 3 What is the millions digit of 61717980? 1 What is the tens digit of 17863405? 0 What is the hundreds digit of 243137379? 3 What is the hundreds digit of 5979198? 1 What is the hundred thousands digit of 968966793? 9 What is the hundred millions digit of 3230509083? 2 What is the thousands digit of 205408332? 8 What is the tens digit of 215228408? 0 What is the hundred thousands digit of 2920093636? 0 What is the hundred thousands digit of 45936271? 9 What is the units digit of 854376828? 8 What is the hundred thousands digit of 1231918383? 9 What is the hundreds digit of 174408133? 1 What is the ten thousands digit of 15196734? 9 What is the hundred thousands digit of 397747580? 7 What is the ten thousands digit of 53919002? 1 What is the billions digit of 1077483500? 1 What is the hundreds digit of 155066727? 7 What is the hundreds digit of 2596366430? 4 What is the hundred thousands digit of 32496798? 4 What is the hundred millions digit of 747635136? 7 What is the thousands digit of 12581182? 1 What is the units digit of 5370853346? 6 What is the hundred thousands digit of 26188456? 1 What is the hundred thousands digit of 120581527? 5 What is the ten thousands digit of 37801193? 0 What is the thousands digit of 61713025? 3 What is the units digit of 2867285653? 3 What is the hundreds digit of 4436763332? 3 What is the thousands digit of 2386422691? 2 What is the hundred millions digit of 917503371? 9 What is the hundreds digit of 47823132? 1 What is the ten thousands digit of 42134957? 3 What is the thousands digit of 8557683309? 3 What is the tens digit of 126726843? 4 What is the units digit of 662437585? 5 What is the hundreds digit of 4144430? 4 What is the ten millions digit of 2331350845? 3 What is the units digit of 24953017? 7 What is the tens digit of 562386948? 4 What is the hundred thousands digit of 98713540? 7 What is the tens digit of 6934725121? 2 What is the millions digit of 155181331? 5 What is the ten thousands digit of 513191214? 9 What is the units digit of 5284651057? 7 What is the tens digit of 586082713? 1 What is the tens digit of 207102493? 9 What is the units digit of 20995614? 4 What is the ten millions digit of 89414540? 8 What is the hundred thousands digit of 33826195? 8 What is the ten thousands digit of 689657076? 5 What is the hundreds digit of 617405118? 1 What is the hundred millions digit of 145012300? 1 What is the tens digit of 22276774? 7 What is the tens digit of 941019769? 6 What is the hundreds digit of 83076666? 6 What is the ten thousands digit of 3789298071? 9 What is the millions digit of 935011168? 5 What is the hundreds digit of 4855150004? 0 What is the hundred millions digit of 1007531716? 0 What is the hundred thousands digit of 57801820? 8 What is the ten millions digit of 60185252? 6 What is the ten thousands digit of 49679829? 7 What is the ten thousands digit of 296379079? 7 What is the hundred thousands digit of 6464653326? 6 What is the ten thousands digit of 32926504? 2 What is the hundred thousands digit of 480612901? 6 What is the millions digit of 2109154642? 9 What is the tens digit of 4344648872? 7 What is the units digit of 721500274? 4 What is the tens digit of 446260457? 5 What is the millions digit of 183759102? 3 What is the tens digit of 47542366? 6 What is the ten millions digit of 122355942? 2 What is the thousands digit of 399866499? 6 What is the ten millions digit of 689012343? 8 What is the hundreds digit of 352830124? 1 What is the tens digit of 2412424655? 5 What is the units digit of 1523306600? 0 What is the hundreds digit of 189831287? 2 What is the hundreds digit of 198570101? 1 What is the hundreds digit of 13077094? 0 What is the thousands digit of 2934952534? 2 What is the hundred thousands digit of 154043979? 0 What is the thousands digit of 49477935? 7 What is the hundreds digit of 43814128? 1 What is the tens digit of 326104750? 5 What is the hundred millions digit of 306371533? 3 What is the hundred millions digit of 7146201975? 1 What is the tens digit of 1436216217? 1 What is the hundred thousands digit of 205776204? 7 What is the hundred thousands digit of 50625052? 6 What is the tens digit of 2114792741? 4 What is the ten millions digit of 20531342? 2 What is the units digit of 6933883535? 5 What is the hundred thousands digit of 543148391? 1 What is the millions digit of 27948059? 7 What is the hundred thousands digit of 116916385? 9 What is the thousands digit of 48204206? 4 What is the thousands digit of 557208475? 8 What is the ten millions digit of 397489660? 9 What is the units digit of 5296092789? 9 What is the ten thousands digit of 73748743? 4 What is the ten thousands digit of 49742697? 4 What is the tens digit of 380145248? 4 What is the ten thousands digit of 1702176199? 7 What is the hundred thousands digit of 1671662458? 6 What is the millions digit of 42811597? 2 What is the ten millions digit of 377570008? 7 What is the ten millions digit of 1634386008? 3 What is the hundreds digit of 49682768? 7 What is the hundreds digit of 58006149? 1 What is the hundred thousands digit of 76642839? 6 What is the units digit of 16225364? 4 What is the ten millions digit of 86427948? 8 What is the hundreds digit of 36111619? 6 What is the hundred millions digit of 5465163925? 4 What is the ten millions digit of 4304793035? 0 What is the tens digit of 332152819? 1 What is the hundred thousands digit of 1854919401? 9 What is the units digit of 107114389? 9 What is the millions digit of 24819207? 4 What is the hundred thousands digit of 30975679? 9 What is the ten millions digit of 81643018? 8 What is the millions digit of 5760551065? 0 What is the millions digit of 127372469? 7 What is the units digit of 279033873? 3 What is the millions digit of 298857227? 8 What is the hundreds digit of 21299782? 7 What is the units digit of 1487912237? 7 What is the tens digit of 6137456? 5 What is the units digit of 134123022? 2 What is the ten thousands digit of 19917466? 1 What is the hundreds digit of 1870675? 6 What is the units digit of 135989881? 1 What is the tens digit of 161246753? 5 What is the ten thousands digit of 31782436? 8 What is the tens digit of 1020061240? 4 What is the millions digit of 48477622? 8 What is the ten thousands digit of 1291264397? 6 What is the hundreds digit of 2639931? 9 What is the billions digit of 6723864782? 6 What is the thousands digit of 503383173? 3 What is the millions digit of 5159289169? 9 What is the ten thousands digit of 65678191? 7 What is the tens digit of 7076625? 2 What is the ten thousands digit of 28409486? 0 What is the thousands digit of 29268960? 8 What is the units digit of 324306316? 6 What is the millions digit of 1121180635? 1 What is the tens digit of 328288690? 9 What is the hundreds digit of 1025568692? 6 What is the units digit of 1057856580? 0 What is the thousands digit of 204341376? 1 What is the hundred millions digit of 969921178? 9 What is the hundreds digit of 1705218513? 5 What is the hundred thousands digit of 265179726? 1 What is the hundred thousands digit of 2509682356? 6 What is the units digit of 224063285? 5 What is the millions digit of 121994253? 1 What is the thousands digit of 56180132? 0 What is the thousands digit of 73402973? 2 What is the hundred millions digit of 1055600368? 0 What is the hundred thousands digit of 55516228? 5 What is the tens digit of 24400531? 3 What is the thousands digit of 38928064? 8 What is the hundreds digit of 236401965? 9 What is the millions digit of 1175075447? 5 What is the millions digit of 44032136? 4 What is the ten thousands digit of 163100206? 0 What is the thousands digit of 1827236264? 6 What is the thousands digit of 50763001? 3 What is the units digit of 1322981398? 8 What is the hundred thousands digit of 145457410? 4 What is the millions digit of 66235190? 6 What is the ten thousand	{ "pile_set_name": "DM Mathematics" }
-1/4 in p, l, i? p Let r = -281 + 281.3. Which is the closest to 1? (a) r (b) 0.8 (c) 1 (d) 3 c Let z = 0.163 - -0.837. What is the closest to -11 in 4, z, 3? z Let v(w) = -w*3 - 4w*2 + 12w - 1. Suppose 12 = -2q + 3l, -2q + l + 12 = -4q. Let r be v(q). What is the nearest to 0.1 in 0.2, r, 0.04? 0.04 Let u = 13.2 - 13.2. What is the nearest to u in 0.1, 12, -3, 0? 0 Let s = 2143/3392 + -31/53. Let y = s - 155/576. Let i be ((-1)/(2 - 1))/1. Which is the nearest to -3? (a) -0.5 (b) y (c) i c Suppose 26 = p + 21. Let s be (1 - 16/10)1. Which is the closest to 4? (a) p (b) s (c) 2 a Let y = -18710 + 94222/5. Let t = y - 134. What is the nearest to -1 in 2/7, t, -5? 2/7 Let s be 3 + 0 - (-55)/5. Let v(l) = -l + 15. Let j be v(s). Let t = -6 + 5.7. Which is the closest to 0.1? (a) j (b) -5 (c) t c Suppose -3 = -o + p, 4o + 3p - 5 = -14. Let s = 2.5 + -3. Let b = -166/7 + 167/7. What is the closest to o in b, -1, s? b Let d = -4 + 8. Let u be (-160)/(-25) + (-5 - 1). Which is the closest to 1/9? (a) d (b) 1/7 (c) u b Let x be (-12)/(-260) - 3/15. Let p = 93 + -88. What is the nearest to x in 0.4, -3, p? 0.4 Let y = 13 + -78. Let r = 68.1 + y. Let o = r - 3. What is the closest to 1 in 5, o, -1? o Let u = -0.24 - 51.76. Let y = 49 + u. What is the closest to 1 in y, 7, 1/5? 1/5 Let f = -0.35 - -78.35. Let h = 75 - f. Let q = -21 - -43/2. Which is the closest to 0? (a) 0.2 (b) h (c) q a Let m = -2/43 + 116/645. Let n = -81 - -77. Which is the closest to 0.3? (a) m (b) -2/19 (c) n a Let s(o) = o3 - 3o*2 + 3o - 1. Let v be s(2). Let g = -2/11533 + -11529/23066. Which is the nearest to g? (a) 2 (b) v (c) -1 c Let k(p) = -4p + 4. Let f(r) = -1. Let m(z) = 2f(z) + k(z). Let d be m(1). Let x be -3 + (-2)/12 + 3. Which is the closest to d? (a) -5 (b) -2/13 (c) x c Let p = -146 + 147. Which is the nearest to -0.1? (a) -1 (b) -33 (c) p a Let z = 28.6 - 28.8. Suppose -3c + 6c = -h + 4, -14 = 2h - 5c. What is the nearest to 3 in h, z, 3? 3 Let v = 1122 + -1174.1. Let x = 52 + v. Which is the nearest to 2/7? (a) 3 (b) x (c) 1/4 c Let m = -352601/5 + 520794772/7385. Let k = -2/211 - m. Which is the nearest to 1? (a) k (b) 1 (c) 0 b Let r = 5.3 - 1.3. Let m = 81 + -78. What is the nearest to m in 0.1, r, -1? r Let o = -6.7 - -7. Let l = 295 - 295. Let f = 9.4 - 9.3. Which is the nearest to f? (a) o (b) 2/13 (c) l b Let m(o) = -o - 6 - 3 - 9 + 4. Let h be m(-15). Suppose -2 - 4 = 2d, -3u - 15 = 5d. What is the closest to h in u, -0.4, 4? u Let o = -6 + 6.4. Let p = 2 + -5. Let m = 64 - 64.1. What is the nearest to m in -0.4, p, o? -0.4 Let q = 0.1614 + -0.0214. What is the closest to -2 in q, 4, 1? q Let i = -22 - -26. Suppose 2f = -i, 3j + 9 = 2j - f. Which is the nearest to -1/3? (a) -0.5 (b) j (c) 5 a Let n = 39 + -39.3. Let q(d) = d*2 - 5d + 2. Let g be q(5). Let i be ((-68)/9)/(-4) - g. Which is the closest to -1? (a) n (b) -3/4 (c) i b Let y = -9.69 + 10.69. Which is the nearest to -3? (a) y (b) 2 (c) -5 c Let z = -9.21 + 8.91. What is the closest to -2/3 in 0.3, z, -3? z Let f = -0.04 + -0.16. Suppose -24 = 4n + 2n. What is the closest to f in -0.1, n, -1/9? -1/9 Let m = 0.27 - -0.01. Let w = m - 0.28. Let r = 1 + -1.1. Which is the closest to r? (a) w (b) -0.4 (c) -0.3 a Let r = 153/40 - 21/5. Let p = 0.63 + -0.23. Let z = 63 - 191/3. Which is the nearest to z? (a) r (b) 0.1 (c) p a Let u = -0.2 + 0. Let h = -8.9 + 9. Let g be (2/4)/(4/12). Which is the closest to h? (a) 1/2 (b) u (c) g b Let x = 5.8 + -1.8. Let i = x - 3. Which is the nearest to i? (a) -0.5 (b) 2/5 (c) 0.3 b Suppose 2c = -c. Let q be (-1)/(c + 1/(-16)). Let t be 2/8 - (-4)/q. What is the closest to t in 1, 0.2, 5? 0.2 Let t = 1.5 - 2.1. Let q = -0.8 - t. What is the nearest to q in -4, -3, 1/4? 1/4 Let p(b) = b3 + 6b*2 - 5b - 3. Let o be p(-3). Suppose 0 = -5j - 15, a - 2j = -4a - o. Let v = -3.9 + 4. What is the nearest to v in 4, a, 1? 1 Let c = -3.3 + 3. Let u = 0.2 - 0.2. Let o = -86 + 87. What is the closest to -2/11 in o, c, u? c Let l = -3320 - -3320. Let u be (-14)/12 + 1/1. Which is the nearest to l? (a) 0.5 (b) -4 (c) u c Suppose -15a + 10a - 5 = -5v, 0 = -13v - 52. Let m = -124/195 - 2/65. What is the nearest to 0 in a, m, 1? m Let f be (4/6)/((-1)/18). Let m be (-8)/f3/5. Let n = -33/5 + 7. Which is the closest to m? (a) n (b) 5 (c) -0.3 a Let n be (-4)/(-6)18/24. Let b = 677/315 + -53/7. Let h = b - -56/9. What is the closest to n in h, 7, 1? h Let q be 27/(-3)3/6 - -3. Which is the closest to 9? (a) 3/4 (b) q (c) 5 c Let k = -68.97 - -72. Let r = -0.03 + k. Let i = -453/7 + 65. Which is the nearest to -2? (a) i (b) -0.2 (c) r b Let n = 508 + -513. What is the closest to -0.1 in 0.3, 1/4, 0.01, n? 0.01 Let m = 1189 - 1189.5. What is the closest to -0.6 in -3/4, 9, m? m Let s = 0.264 - 4.264. Which is the nearest to -1? (a) 3 (b) -4/3 (c) s b Let w = 10 + -6. Let o(y) = -4y + 4. Let h be o(0). Suppose -4n + 24 = -0j - hj, 0 = -3j + wn - 20. Which is the closest to -0.2? (a) j (b) 3 (c) 2 c Suppose 66 = -5x + 3i, 3x + i = -4i - 26. Which is the closest to 2? (a) -4 (b) x (c) -0.2 c Let r = 124.8 - 125. What is the nearest to 0.8 in r, -0.4, 3/7? 3/7 Let t = 66 + -71. Suppose s + 2l = -9, 7l + 29 = 4s + 2l. Let o be (-3)/t - (s + 0). Which is the closest to 2? (a) 0.1 (b) -0.1 (c) o a Let h = 0.299 + 17.401. What is the closest to -0.1 in 5, 0.4, h? 0.4 Let i = -472 + 478. Which is the closest to -1? (a) -0.4 (b) 4 (c) -2 (d) i a Suppose 3x + 24 = 3h, -4x + 0x = -20. Let v = 10 - h. Let p = -27 + 25. What is the closest to 1/2 in -0.5, v, p? -0.5 Let n = -0.254 - 3.746. What is the nearest to -1 in -5, n, -3/5? -3/5 Let i = -1.1 + 5.1. Let b = -5.969 - 0.031. Let h = i + b. What is the closest to h in 0.2, -2/5, -0.5? -0.5 Suppose -2l + 3p - 42 = 0, 0 = -5l - 0p + 4p - 98. Let r be 42/(-16) + l/48. What is the nearest to 1 in -2/5, r, -18? -2/5 Let m(n) = n2 - 3n - 3. Let z be m(6). Let h = z + -16. Let g be h(22/6 - 3). What is the closest to -2 in 0.1, -1/2, g? g Suppose 6k = k + 5. Let g be (k/(-2))/(3/292). Let c = g - -48. What is the closest to c in 1, 1/2, -3? 1/2 Let h be (-10)/(10 + (3 - 9)). Which is the closest to -2? (a) h (b) 8 (c) 1/9 a Let u = 1178 + -8250/7. Which is the closest to -0.1? (a) u (b) -2 (c) -1 (d) 3 a Let j = -445 - -444. Which is the closest to j? (a) 1/7 (b) 5 (c) -1 (d) -2 c Let b = 0 + -2. Let x = -1557/140 - -9/28. Let w = 427/40 + x. What is the closest to b in 2, 2/9, w? w Let j = -1.087 - -0.287. Let g = 0.2 + -0.3. Which is the nearest to g? (a) j (b) -2 (c) -1 a Suppose -41 + 16 = 5c. Let n be (2/(-30))/(c/15). Let y be (-26)/(-42) - (-4)/(-14). What is the closest to 2/5 in y, n, 1? y Let r = -0.1 - 0.4. Let w be (-1946/(-20))/(-1). Let j = w + 58. Which is the nearest to -1? (a) j (b) r (c) 1/4 b Let n = -1.5 + 1.26. Let s = n - 0.06. Let p be (375/(-150))/((-30)/8). Which is the closest to p? (a) 2/3 (b) 0 (c) s a Let m = 1822 + -1819.049. Let v = -0.049 - m. Suppose 0 = 4n - 2o + 4, n + 3o = 5n + 4. Which is the nearest to n? (a) -0.5 (b) 4/3 (c) v a Let j = 367/3 + -124. Let g be (10/(-25))/((-20)/30). Which is the closest to 0? (a) g (b) j (c) -3 a Let s = 0.08 + -5.08. Suppose 0 = 9r - 64 + 46. What is the closest to 0.2 in s, -3, r? r Let s be (-1)/(15/6 + -2). Let p(t) be the second derivative of -t3/6 + 2t*2 - 5t. Let d be p(6). What is the closest to d in -1, s, 4? s Let y = -0.39 + 0.399. Let o = 0.009 - y. Which is the closest to -3? (a) -2/3 (b) o (c) -0.3 a Let q = 3/8 - -1/8. Let i = -120 + 119.9. What is the nearest to i in q, 0.3, -2? 0.3 Let t = 154.6 - 170. Let v = t + 15. Which is the nearest to -1? (a) -1 (b) v (c) 0.5 a Let h = 0.8 + -0.7. Let f = h - -0.1. What is the closest to 0.3 in -2, 0.3, f? 0.3 Let g = 0.0089 + 4.9911. What is the closest to 0 in -0.1, -2, g, 1? -0.1 Let n = -0.7 + 0.4. Let p = 11 - 10.8. Let l = 0.18 - p. What is the nearest to -1/4 in l, 2/5, n? n Let i(w) = -w*3 + 5w*2 - 4w + 21. Let n be i(5). Let v = 0.1 + 0.3. Let k(x) = 2*x + 29. Let o be k(-14). Which is the nearest to n?	{ "pile_set_name": "DM Mathematics" }
iple of 26? False Let y = 42 - 26. Is (-2)/(y/(-50))4 a multiple of 19? False Let b(t) = t2 - 3t + 7. Is b(8) a multiple of 29? False Let c(o) = 5o2 - 4o + 4. Let v be c(6). Suppose 7s = 2s + v. Does 18 divide s? False Suppose 0q - 2q = 18. Let v = q + 11. Suppose j = vj - 17. Is j a multiple of 11? False Suppose -3j + 311 = 131. Let c(m) = 3m3 + 2m*2 - 3m. Let g be c(2). Let o = j - g. Is o a multiple of 9? False Suppose z - 3h + 93 = 0, 5h = -0z - 3z - 279. Let j = 180 + z. Is 29 a factor of j? True Suppose 4c + 0z + z = -36, 4z + 36 = -4c. Let x(p) = -p*3 - 8p*2 + 7p - 7. Does 5 divide x(c)? False Let a(x) = -x*3 - 2x*2 + 10x + 13. Is 26 a factor of a(-6)? False Let x(f) = f*2 - 8f - 9. Let k be x(9). Let r = k - -2. Suppose 4u = -g, -5g = -ru - 2u - 72. Is g a multiple of 6? True Suppose -n = z - 1, -2n - 2n + z - 6 = 0. Let j = n + 53. Is j a multiple of 18? False Suppose -3c + 10 = 5n, -4c + 6 = 2n + n. Suppose nx - 8 = -2x. Suppose -23 = -5f + x. Does 3 divide f? False Let g = 21 + -15. Suppose n = 4n - j - 11, 2j = -2n - g. Does 14 divide 14 - n(1 + -2)? False Suppose 0 = 5k - 7k + 18. Is k a multiple of 9? True Let y = -1 + 3. Let w be (-11)/(y/24). Let a = w - -22. Is a a multiple of 9? False Let c(i) = 2i2 + 4i + 4. Is 26 a factor of c(-6)? True Let f = -33 - -81. Is 16 a factor of f? True Let b = 632 - 350. Is 44 a factor of b? False Suppose -3z - 169 = 134. Let b = z + 143. Suppose 178 - b = 4g. Does 17 divide g? True Let v(s) = -s*3 - 7s*2 - 7s - 2. Let h be v(-6). Suppose -4d + 154 - 2 = -4i, -3i = hd - 166. Is 10 a factor of d? True Suppose 7h = -8h + 150. Is h even? True Let u(g) = -g*3 - 31g*2 + 29g - 34. Is u(-32) a multiple of 31? True Suppose -16x = -18x + 150. Is 6 a factor of x? False Let a be -1(-2)/2-1. Let u = a - -11. Suppose 2g = -3b + 56, -2g = -4g - u. Is b a multiple of 11? True Let k be -3 - (-11 - (0 - 3)). Suppose -207 = w - 5w - kl, -111 = -2w - 5l. Is 11 a factor of w? False Is 6 a factor of 74/6 + 4/(-12)? True Does 53 divide (-15)/204 + 321? True Let k = 111 + -58. Suppose -j = -10 - k. Is 21 a factor of j? True Does 19 divide (-6)/((56/(-1386))/(4/6))? False Let a(y) = -6y*3 + 5y*2 + 7y - 4. Let v(m) = -m3 + m2 + m - 1. Let z(n) = -a(n) + 5v(n). Is z(2) a multiple of 3? True Let j = -33 + 72. Does 13 divide j? True Let r(o) = -o3 - 13o*2 + 7o - 11. Does 29 divide r(-14)? True Suppose -g = 3n + 313, g - 305 = 3n - 0g. Let o = -71 - n. Does 23 divide o? False Suppose -3n - 80 = -7n. Is 10 a factor of n? True Let a(c) = 3 + 2 + 1 + 2c*3 + 7c*2 + 5c - c*3. Is a(-6) a multiple of 6? True Let o = 4 - 0. Let h = -43 - -67. Suppose -om + 0m + h = 0. Is m a multiple of 6? True Suppose -120 + 0 = -4q. Is q a multiple of 6? True Suppose 3p - 7p = 4. Let r = 14 - p. Is 5 a factor of r? True Let r(p) = p - 7. Let j be r(5). Is 24 a factor of 101/2 - 1/j? False Suppose 0 = -h - 2n + 14, -4h + 3h + 29 = 5n. Is 12 a factor of (-488)/(-20) - h/10? True Let j(w) = -4w + w2 - 6 + 2w + 7. Does 7 divide j(5)? False Suppose -f + 8 = 3f. Does 8 divide (-162)/(-10) - f/10? True Let n(d) = 5d*2 - 2d - 2. Does 14 divide n(-3)? False Let c be -1 - -4 - (-71 + 0). Let j = -39 + c. Is j a multiple of 15? False Suppose -5p + 105 = -3j + j, 5p - 70 = -5j. Suppose 5 = 3i - p. Does 8 divide i? True Let t(b) = -b3 + 3b*2 + 5b + 1. Suppose -s = -2k - 0s + 12, -5k + s + 24 = 0. Let c be t(k). Let x(m) = m3 - 5m*2 + 6m - 3. Does 9 divide x(c)? True Suppose 2 = -2m + v, m - v = 2v + 4. Is 8 a factor of ((-40)/(-25))/(m/(-20))? True Let f(y) = -y + 0y3 + 2y + y*3. Suppose -2 = -4p + 6. Is f(p) a multiple of 9? False Let p(l) be the third derivative of -3l4/8 + 11l*3/6 + 6l*2. Does 13 divide p(-6)? True Let s(g) = -36g + 22. Is 31 a factor of s(-8)? True Let g(m) = m*2 + 4. Let u be g(0). Suppose -91 = -uw + 53. Does 14 divide w? False Let l(w) = w*3 - 5w*2 + 1. Let h be l(5). Suppose t - 342 = -5q, -3t + 5 = -h. Suppose -d + 2d = -5j + q, d = -j + 12. Does 8 divide j? False Let b = -97 - -69. Let g be (-2202)/(-54) - (-2)/9. Let j = b + g. Does 13 divide j? True Let o = 6 + -3. Suppose 7 = om - 5. Suppose 2p + m = -0p, 3p + 100 = 2f. Is 13 a factor of f? False Let b be (-6 - -3)(-10)/6. Is 46/(-5)(0 - b) a multiple of 23? True Let o be (-33)/3 + 3 + -2. Let d be (1 - -14)(-18)/o. Let j = d - -5. Is j a multiple of 16? True Let f = -1 - -1. Let m = f - -8. Is m a multiple of 4? True Let b(x) = x3 + 3x*2 - 2x + 1. Let u be b(2). Let w = u + -9. Is w a multiple of 3? False Let x(p) = p*3 + 13p*2 + 10p - 7. Is x(-12) a multiple of 6? False Let a(r) = -r2 - r. Let u(h) be the third derivative of -h5/20 - 7h4/24 - h3/2 - 2h*2. Let f(g) = 2a(g) - u(g). Does 7 divide f(-8)? False Let f(u) = u*3 + 5u*2 - 7u - 2. Let i be f(-6). Let l = i - 1. Does 2 divide l? False Let o(h) = -h*3 - 6h*2 - 6h + 1. Let x be (-56)/(-26) + 6/(-39). Suppose -j + 4j + 11 = 4m, 4j + xm = -22. Is 4 a factor of o(j)? False Suppose -2h + 3r + 10 + 1 = 0, -3h + 3r + 18 = 0. Let f = h + -4. Is (-3)/(-4)(33 + f) a multiple of 16? False Let q(g) be the second derivative of -g5/20 + g3/6 + 7g*2 - 2g. Is q(0) a multiple of 7? True Let t = -2 - -2. Suppose ts + s = 27. Suppose 4k - s = k. Is 9 a factor of k? True Let n = -65 - -112. Is n a multiple of 17? False Suppose -8 = -4y - 32. Let r(b) be the third derivative of -b6/120 - b5/10 - 7b4/24 - b3/3 + b*2. Is r(y) a multiple of 11? False Suppose j + 2 = -t - 4, 0 = -3t + 2j - 8. Let q(i) = 3i*2 + 4i - 6. Does 21 divide q(t)? False Let d be ((-10)/(-6))/(1/6). Suppose 2n + 3b - d + 3 = 0, 3n = 5b + 1. Suppose 5h + 3k - 84 = 0, 4h + 21 - 75 = nk. Is h a multiple of 12? False Suppose -5x + 38 - 3 = 0. Suppose 93 = -4s + xs. Is 14 a factor of s? False Let o(x) = -x + 25. Does 7 divide o(6)? False Let v be (3 + -2)/(1/17). Suppose 0 = -3z - v + 68. Is 9 a factor of z? False Let a be 5/((-10)/6) + 6. Suppose -2i + a + 57 = 0. Is 11 a factor of i? False Let q be (-10)/(1 - (0 + 2)). Let b = 28 - q. Is 9 a factor of b? True Let l = 8 - 13. Is (l - -3)27/(-3) a multiple of 15? False Let y = 726 + -418. Does 29 divide y? False Suppose 3w + 12 = x, 5w - 33 = 5x - 103. Is x a multiple of 7? False Let n(o) be the first derivative of o3/3 + 5o*2/2 + 6o - 3. Does 14 divide n(-8)? False Suppose -w = -4w + 36. Is 2 a factor of w? True Suppose m = -3p, -2m - 2m = 5p. Let l = p - -2. Does 2 divide l? True Suppose 5b + 17 = 3s, -4s + 2s + 5b + 13 = 0. Suppose -2u = -s, -d - 4u + 3 = -48. Does 11 divide d? False Suppose 2q - 5 + 1 = 0. Does 23 divide ((-46)/(-8))/(q/8)? True Let r = -3 - -3. Let m be (-6)/(-3) + 3/(-1). Does 13 divide (0 - -27) + r + m? True Let f = 3 - 0. Let h = 3 + f. Does 4 divide h/27 - (-34)/9? True Let a(x) = -7x - 2. Let p be a(-2). Is -3(920/p)/(-5) a multiple of 13? False Let l(h) = 3h - 2. Let p be l(2). Let o = -4 - -5. Is (p/(-8))/(o/(-32)) a multiple of 6? False Let p(g) = g + 5. Let z be p(6). Suppose 4 = 5y - z. Is 3 a factor of y? True Suppose 544 - 220 = 9y. Is y a multiple of 18? True Let a be 1(3 + 26) - 2. Suppose 16 + a = o. Does 14 divide o? False Suppose 5 = -0d + d. Suppose -5w - 12 - 8 = -5v, -4w = -dv + 21. Suppose f = vf - x - 142, 0 = 2f - x - 70. Is 12 a factor of f? True Let q(r) = -r*3 - 3r*2 + r + 4. Is 18 a factor of q(-5)? False Let u be -7(-3)/(4 - 1). Let o be u + (-2 - (1 + 0)). Suppose -93 = -oj - 21. Is j a multiple of 6? True Let p(h) = 0h + 1 + h + 1. Let d be (-1 + -2)(1 + -3). Is 3 a factor of p(d)? False Let d(r) = 2r - 8. Let n be d(7). Let o be (-263)/(-5) + n/15. Suppose -a + o = 5b, 5a + 3b - 196 = b. Does 19 divide a? True Suppose 0 = -4l + v + 420, 4l + 4v = 228 + 172. Does 15 divide l? False Let o(x) = -2x2 - 2x + 230. Does 23 divide o(0)? True Let h be 204/105/2. Suppose h = 2b - b. Is b a multiple of 17? True Let q(r) = -r*2 - 3r + 2. Let h be q(-3). Suppose hz + 2p + 2p = -4, -3z + 6 = 2p. Suppose 0 = zy - 11 - 53. Does 8 divide y? True Let p(u) = u*2 + 6u +	{ "pile_set_name": "DM Mathematics" }
t(12)) + sqrt(12))/(-4sqrt(64)) + ((sqrt(3072))2 - sqrt(1536)/sqrt(8)). -145sqrt(3)/16 + 3072 Simplify -6(-4 + (sqrt(242) - ((1sqrt(242))*2 + -2))-2 + 3) + 4. -2870 + 132sqrt(2) Simplify (-4(-2sqrt(6912) - sqrt(48)))/((sqrt(864) - (sqrt(864) - 4sqrt(864)-1)) + 3(-1sqrt(864) + sqrt(864))). -25sqrt(2)/6 Simplify (5(-5 + sqrt(1728) + -2) + ((1 + sqrt(48))-5 - sqrt(48)) + sqrt(48) + sqrt(2352)1)2. -10240sqrt(3) + 50752 Simplify (-1(-5 + -1 + sqrt(245) + sqrt(245) + -5 + sqrt(245) + 1 + -4)-3-6)2. -190512sqrt(5) + 777924 Simplify (sqrt(63) - sqrt(189)/sqrt(3)6)/(sqrt(9)-22)5 - (sqrt(84) - (sqrt(84)-2 - sqrt(84))3)/(3sqrt(432)). 205sqrt(7)/36 Simplify (3(6(sqrt(2880) + 0 - sqrt(2880)) + (sqrt(2880) - (-3sqrt(2880) + -4)) + -2))2. 3456sqrt(5) + 414756 Simplify 2(2 + (sqrt(84) + (sqrt(84) + (-5(sqrt(84) + -1sqrt(84) - sqrt(84)) - sqrt(84)) + sqrt(84) - sqrt(84)) - sqrt(84))/(-5sqrt(28)) + -4). -4 - 2sqrt(3) Simplify ((1((sqrt(22) - (sqrt(22) + sqrt(88)-4)) + sqrt(22) + sqrt(22)))/(-1sqrt(33)/sqrt(3)3) + 1)2-5. -1045/9 + 100sqrt(2)/3 Simplify 3 + (sqrt(15)/(1sqrt(3)) + sqrt(10)/sqrt(8))*2 - (((sqrt(405) - -3sqrt(405)) + sqrt(5) - (0 + sqrt(5))-3) + 4). -40sqrt(5) + 41/4 Simplify (1(sqrt(378)/sqrt(6) + 0 + -1(sqrt(14)/(sqrt(32) - sqrt(2)) + sqrt(7) + sqrt(7))))*2. 28/9 Simplify ((sqrt(228) - (sqrt(228)-1 + sqrt(228)) - sqrt(228) - sqrt(228))-5 - 3(sqrt(228) + sqrt(228)2))/(-5-1sqrt(432)). -2sqrt(19)/15 Simplify (-1 + (-4(sqrt(5000) + 1 + 4) - 4(-2(0 + sqrt(5000)) + sqrt(5000))))2. 441 Simplify ((sqrt(891) + 3 + sqrt(891)-2 + sqrt(891))5 + -5-2(sqrt(396) - (0 + sqrt(396))))2. 225 Simplify -5(-4(sqrt(1053) + sqrt(1053) + 1 + sqrt(1053) + -4)2 + (sqrt(52)/(sqrt(4)-2) - (sqrt(13)-2 + -2))). -6495sqrt(13)/2 + 189710 Simplify -4 + sqrt(2736) + sqrt(2736)-1 + (sqrt(19) + sqrt(19) + (sqrt(19) - (sqrt(19) + 1)))1 + ((3sqrt(171)1)/(sqrt(9)-12))*2. 2sqrt(19) + 151/4 Simplify (sqrt(40)/(2sqrt(2)))/(sqrt(30)/sqrt(3)2 + sqrt(10)) - (1 + sqrt(200) + sqrt(200) + 0 + 4)*2. -825 - 1199sqrt(2)/6 Simplify ((sqrt(100)24 - sqrt(100))/((-2sqrt(22) - sqrt(22))/sqrt(11)))/(((-2sqrt(110) + sqrt(110) - sqrt(110))-2)/(sqrt(88)/sqrt(2))). -7sqrt(5)/6 Simplify (-2((sqrt(832) - (sqrt(832) - (sqrt(832) - (sqrt(832) + 2)1) - sqrt(832))) + -1 + (sqrt(832) + sqrt(832)-2)6 + 2))*2. 320sqrt(13) + 83204 Simplify (1 + 5 + ((1sqrt(13) + -3)2 - ((-2sqrt(104) + sqrt(104))2)/sqrt(8)) + -2)*2. -16sqrt(13) + 212 Simplify ((5 + (-6(0 + sqrt(931)) - sqrt(931)) + 5 + 4)3)*2-3. -1237005 + 37044sqrt(19) Simplify 3(sqrt(48)5)23 - (5(3sqrt(3))*2 + ((sqrt(3) - -3sqrt(3))2)2). 10473 Simplify 3 + (sqrt(20)-4-4)2 + 3 + (-5 + sqrt(5) + 1 + 4 + sqrt(180))2. 5371 Simplify 5 + ((4 + sqrt(16)/((sqrt(24) + sqrt(24)-3)/sqrt(3))2-4)3)2. 288sqrt(2) + 437 Simplify 5(((-1 + sqrt(44))5 - 1sqrt(2156))2 - ((sqrt(176)-1 - sqrt(176)) + 4)). 240sqrt(11) + 985 Simplify (sqrt(121)-3-2-11)/(5(sqrt(11) - (sqrt(22)/(-1sqrt(2)) + sqrt(11)) - (sqrt(11) + -3-1sqrt(11) + sqrt(11)))). 3sqrt(11)/10 Simplify 3 + 45-3(((sqrt(156)-1 - sqrt(156)) + sqrt(156))/sqrt(12))*25 + 4. -3893 Simplify -5(4 + ((-5 + 5(6(sqrt(1100) + sqrt(1100)1) + sqrt(1100) + sqrt(1100) + 0 + 4))-6)2). -970240520 - 3780000sqrt(11) Simplify ((sqrt(76)2 + -2 + (sqrt(76) - (1 + sqrt(76)))-4 - (-1sqrt(114)/sqrt(6) + (-2sqrt(228))/sqrt(12)))3)2. 252sqrt(19) + 8415 Simplify (((sqrt(66) - 2(sqrt(66) - sqrt(66)2)) + sqrt(66) + sqrt(66) + -2sqrt(66)1)/(1sqrt(24) + (sqrt(6) - sqrt(18)/sqrt(3)1)))*2 + 1 + 3. 115/4 Simplify (1((sqrt(70) + sqrt(70)-1 - sqrt(70)) + sqrt(70)) + (sqrt(70) - (sqrt(70) + -1sqrt(70)1 + sqrt(70))))/(-4sqrt(60)/(sqrt(6)-1)5). 0 Simplify (1(0 + sqrt(1100))2 - (3 + sqrt(99) - sqrt(11))4) + ((sqrt(539) - -1sqrt(539))-1 - (sqrt(539)-1 + 1))2. 6sqrt(11) + 1628 Simplify (2 + 1(sqrt(128) + 0) + sqrt(1800)-2 + 4)*2-6. -32664 + 3744sqrt(2) Simplify (sqrt(13) + -1 + -4)-1 + 2sqrt(325)-2 - ((sqrt(390)/sqrt(160))/sqrt(3) + 5 + -4). -85sqrt(13)/4 + 4 Simplify (2sqrt(99)2)/(sqrt(9) + -1sqrt(576) + sqrt(9)) - (sqrt(11) + 0 + sqrt(704) + 1 + 0). -29sqrt(11)/3 - 1 Simplify ((-23sqrt(114) + sqrt(114))-5-3)/(4sqrt(60)/sqrt(10)6-5). 5sqrt(19)/8 Simplify ((5(-2sqrt(228) + sqrt(228)) - (sqrt(228) - -65sqrt(228) - sqrt(228)))/(-12sqrt(1200)-5))*2. 931/400 Simplify -2 + (-3sqrt(960))/(sqrt(12) + (sqrt(1728) - (sqrt(1728) - sqrt(1728)3)) + sqrt(12)) + -2. -4 - 6sqrt(5)/19 Simplify ((4 + (2(-6sqrt(171) + sqrt(171) - sqrt(171)))/((sqrt(90)-2)/sqrt(10)))5)*2. 1200sqrt(19) + 17500 Simplify ((4sqrt(243)1 - sqrt(36)/(sqrt(24)/sqrt(2))6) + (sqrt(825)5)/(sqrt(11)-13 + sqrt(11)))*2. 3675/4 Simplify (-5 + (-3sqrt(1125)1)/(sqrt(576)1) + -5)*2. 75sqrt(5)/2 + 7525/64 Simplify ((sqrt(147)-2 - sqrt(147))/sqrt(7) - (sqrt(105)2)/sqrt(5))/(2sqrt(363)11)-3. 15sqrt(7)/22 Simplify ((sqrt(77)11 + sqrt(77))23)/(2sqrt(539) + sqrt(11) + sqrt(99)5) + 4. 2sqrt(7)/5 + 4 Simplify ((sqrt(108) - -1sqrt(108)3) + sqrt(108) + -1 + 2sqrt(108) + 1 + 5 + sqrt(108) + 2 + 3)2. 960sqrt(3) + 7012 Simplify -3(-2 + (sqrt(108)3-6)2) - (3 + 1 + sqrt(108) + -4)3. -104970 - 18sqrt(3) Simplify (sqrt(1300)-14 + (-5sqrt(1300)-1 - sqrt(1300)) + -5 + 4 - -6((sqrt(1300) - (sqrt(1300) + 4(sqrt(1300)-1 + sqrt(1300))) - sqrt(1300)) + 2)6)2. -51120sqrt(13) + 1689841 Simplify (1 + sqrt(1377) + 1 + -1 + 5)*2 + 2 + sqrt(833) + 1 + (sqrt(833) - 3sqrt(833)-2). 164sqrt(17) + 1416 Simplify (sqrt(1053)3)23 + 3 + (-6-6sqrt(1053)-3)2 + -5. 12310621 Simplify 5(-63(sqrt(91) + 2sqrt(91)-2 + (sqrt(91) - (sqrt(91) + sqrt(91) + -4-2sqrt(91))) + sqrt(91))/(5(sqrt(252) + -2sqrt(252)) - sqrt(252)))*2. 7865/4 Simplify (sqrt(198)5)/(3sqrt(11)-2) + (((sqrt(550) - sqrt(22))/sqrt(11) + sqrt(128) + 2 + sqrt(2) + sqrt(2))-6)2. 4027sqrt(2)/2 + 14256 Simplify (3 + -1 + (-2 + -2 + sqrt(1539) - (sqrt(1539) + 4 + sqrt(1539)1)))2. 108sqrt(19) + 1575 Simplify ((sqrt(208) - -2sqrt(208))2 + sqrt(13))2 + -3 - ((sqrt(13) + -2)*23 + 0 + sqrt(1872)). 2sqrt(13) + 3690 Simplify (5(5sqrt(85)-1 - (sqrt(85) - -4((sqrt(85)2 + sqrt(85) - sqrt(85)) + sqrt(85)))))/(sqrt(225)/sqrt(5) + (sqrt(245)-1 - sqrt(245) - sqrt(245))). 5sqrt(17) Simplify -5 + 3(1sqrt(84)16)/(-5(sqrt(432)-2 + sqrt(432)) - sqrt(432)) + 5. 3sqrt(7)/4 Simplify (-66sqrt(243))/(sqrt(1089) - sqrt(1089)2 - sqrt(9) - (sqrt(45)/(sqrt(5)-1) + sqrt(9))). 9sqrt(3) Simplify 0 + ((sqrt(325) + sqrt(325)-4)-6-3 - (1 + (3 + sqrt(325))3)). -285sqrt(13) - 10 Simplify (0 + (2sqrt(99) - (-1sqrt(121))/sqrt(11)))2 + -1 + ((-2(sqrt(88) + -1sqrt(88)))/(-3sqrt(8)/sqrt(4)))*2. 538 Simplify ((-2(1 + sqrt(1539) + sqrt(1539)) + 1sqrt(1539)-4 + -2 - -6(sqrt(1539) + sqrt(1539)-1)24) + 3)*2. 144sqrt(19) + 98497 Simplify 3(-1sqrt(475) + 4)*2-6 + (sqrt(76) + -4(sqrt(76) + 0) - (sqrt(190)-2-5)/sqrt(10)). -8838 + 704sqrt(19) Simplify (-1(sqrt(55) + sqrt(220)/sqrt(4) + sqrt(55))-6)/(sqrt(99)/(sqrt(324) + sqrt(324)2)) + 2. 2 + 324sqrt(5) Simplify (sqrt(224) + sqrt(224)14 + sqrt(224))/(sqrt(768)/sqrt(6)) - (3 + (sqrt(140)22)/sqrt(5)). -5sqrt(7) - 3 Simplify (36(-2(0 + sqrt(612)) + (sqrt(612) - (sqrt(612)-1 + -1))) + -2)26 + -1. 1535 Simplify (2sqrt(2112) - 1sqrt(132))/(-4(sqrt(12) + sqrt(48) + (sqrt(72)/sqrt(4))/sqrt(6) + sqrt(3)))2. -7sqrt(11)/8 Simplify (sqrt(324)-33-1)/((sqrt(720)2)/((sqrt(10) + (sqrt(10) - 2sqrt(10)))-1 - sqrt(10))). -27sqrt(2)/4 Simplify 0 + ((2sqrt(88)3 - sqrt(88))/(sqrt(40)/(sqrt(25)/sqrt(5))) + 4-1(3 + 1 + sqrt(11)))*2. -32sqrt(11) + 267 Simplify ((2sqrt(2400)-4)/(sqrt(72) - (sqrt(72)1 - sqrt(72)) - (sqrt(8) + sqrt(32))-6))*2 + 1. 6547/147 Simplify (-5 + -2((sqrt(468) - (-1sqrt(468) + 1)) + -2))-3 + -4. -7 + 72sqrt(13) Simplify (4(sqrt(48)/sqrt(2) + sqrt(24) - sqrt(24)) - sqrt(96)/(sqrt(4) + sqrt(36)/sqrt(9)))/((sqrt(48) - (-1sqrt(384))/sqrt(8))/((sqrt(16) + sqrt(4))2)). 21sqrt(2)/2 Simplify 5(sqrt(288) + -1) + 0 - (sqrt(10) + sqrt(640))/(sqrt(5) + 2sqrt(20)). -5 + 291sqrt(2)/5 Simplify (1	{ "pile_set_name": "DM Mathematics" }
e -242 = -3b - b - 5a, 122 = 2b + xa. Suppose -b = -3y + 81. Does 8 divide y? True Let x be (-8)/(-10) + 3785(-144)/(-200). Suppose 18j - 10846 - x = 0. Does 59 divide j? False Suppose 15s - 122808 = -48468. Let i be s/(-70)(-20)/(-6). Let o = -130 - i. Is 10 a factor of o? False Let v be (-1)/(-5) + (-59)/(-5). Let w be (8 - 0)/(13 - v). Let o(t) = -t + 18. Is 10 a factor of o(w)? True Suppose 2y - 1614 = 4v, -v + 146 = -4y + 560. Let i = -234 - v. Is 12 a factor of i? True Let h(q) = -5q - 18. Let z = 172 + -192. Does 7 divide h(z)? False Suppose -67x + r - 162850 = -70x, 3r = -3x + 162864. Does 50 divide x? False Let l = -26 + 31. Suppose s - 2 = -x, -s + l = -2x - 3. Suppose -m = -4 - 1, sy + 5m - 249 = 0. Does 25 divide y? False Let n be (-3)/4(-7)/((-7)/12). Let i(c) = -c3 - 6c*2 + 8c + 5. Let h be i(n). Does 23 divide 4 - ((-4)/2 - h)? False Suppose -14 = 2k + 3w - 1, 0 = -2k + 3w + 17. Let c be (3 - (k - -2)) + 242. Let n = c + -88. Does 13 divide n? False Suppose 3u = 9p - 13p + 10485, -5p - 13918 = -4u. Does 12 divide u? False Let f = -22 + 0. Let r = f + 25. Suppose 2x - 89 = -4q + 113, 0 = 4q + rx - 207. Is 17 a factor of q? False Let r be -4 + 4 - 4/((-4)/3). Suppose 0 = 2h - 0j - 5j + 10, -3h - rj = -27. Suppose 5o - hk + k - 60 = 0, 3k = -4o + 79. Is 8 a factor of o? True Let u(h) = -h*3 + 3h*2 + 6h - 1. Let p be u(7). Let q be (16/12)/1213. Let l = q + p. Does 12 divide l? False Suppose -3q - 96993 = 51h - 56h, -3q = 3h - 58239. Is 28 a factor of h? True Suppose 0g - 10g + 20 = 0. Let t = 1 + g. Is -201(-4)/(-2)(-1)/t a multiple of 18? False Suppose -4r = 50 - 158. Let w(i) = -i2 + 26i + 29. Let v be w(r). Is -1(-39)/v2 a multiple of 39? True Suppose 5k - 15 = -3l, -1 = 4k - 4l - 13. Does 4 divide k/162/6? False Let b(s) = s3 + 29s*2 - 27s - 32. Let h be b(-28). Suppose -f = -g + 819, -3g + 4f + h = -945. Does 38 divide g? False Let a be 37636/(-16) + (-5 - (-126)/24). Let w = -1287 - a. Is w a multiple of 71? True Suppose 20724 + 20517 - 7851 = 42d. Does 14 divide d? False Let d be 6/1(-3)/(-6). Suppose dq - 69 = 12. Suppose 0 = -2n - q + 91. Is 16 a factor of n? True Let g(h) = 5h2 - 11h - 116. Let i be g(-7). Let z = 1193 - i. Does 21 divide z? True Let i(x) = x*3 + 8x*2 + 10x + 15. Let v be i(-6). Let a = v + -79. Let s = 163 + a. Is 12 a factor of s? False Suppose -635 - 1734 = -23m. Suppose 0 = 2t + 4w - 70, -t + 16 = -5w - 47. Let k = m + t. Does 18 divide k? False Suppose 0 = -47f + 34179 + 19113 + 24540. Is 12 a factor of f? True Let n(a) = -26a + 24. Let w be n(-6). Suppose -wq - 220 = -185q. Is q a multiple of 4? True Suppose -o + 4g + 10 = 0, 0 = -4o + 3g + 1 + 39. Let d = o + 30. Let y = d + -33. Does 2 divide y? False Let l = -13951 - -18197. Is l a multiple of 2? True Suppose -4c = 4b - 41564, -b + 41579 = -166c + 170c. Is c a multiple of 23? True Let g be (-21)/(-4 + -3) - (-2 - 2). Does 54 divide ((-5508)/(-119))/(1/g)? True Suppose 52l - 53l - 4 = 0. Let w = -3140 - -1778. Is 22 a factor of l/(40/w) - 8/(-10)? False Let i(g) = -5g*2 - 7g + 22. Let a be i(-8). Let n = a - -1355. Is n a multiple of 19? False Let m(t) = -490t + 110. Let o(k) = -44k + 9. Let v(q) = -4m(q) + 45o(q). Let l be ((-7)/3)/((-2)/(-6)). Does 21 divide v(l)? True Let y(j) = 50j2 - 13j + 16. Suppose -3z - m - 1 = -5, 0 = 5z + 5m. Is y(z) a multiple of 46? False Let f(s) = s3 - 9s*2 + 7s + 8. Let l be f(8). Let t be 12/((0 - l) + 1). Suppose 0 = tu - 11u - 199. Is 22 a factor of u? False Let b = -7383 - -13447. Is b a multiple of 63? False Is -2 + (-529235)/(-28) - (-42)/56 a multiple of 225? True Let z(s) = s*3 + 43s*2 - 159s + 50. Is z(-23) a multiple of 13? True Let n be (12/(-8))/((-21)/112). Suppose -nw + 4w = 3h - 466, -5w - 25 = 0. Is 21 a factor of h? False Let l = 688 + 478. Let m = l - 528. Does 29 divide m? True Suppose 1134 - 40890 = -12b. Is b a multiple of 11? False Let k be (-13)/26(-1194 + 0). Is 11 a factor of (1 - -5(-6)/30) + k? False Let r be (35/40)/((-1)/(-56)). Is (-7)/(r/(-21)) - -555 a multiple of 18? True Suppose 0 = 3s - 5i + 3 - 7, 8 = 2s + 2i. Let z be (16/10)/(1/5) - s. Suppose 0 = zf + 4t - 112, -2t - 5 = -1. Does 4 divide f? True Let l = 2542 - 2536. Let s = -14 + -25. Does 8 divide s(-4 + 22/l)? False Suppose -4c + 4p = -12, -5p = -0c + 5c - 45. Suppose co - o = 5s - 20, -s = 4o - 9. Suppose 165 - s = 8i. Is i a multiple of 6? False Let b be 8 + -442 + (61)/(-2). Let g = b - -739. Let u = g - 208. Is 9 a factor of u? False Let z(i) = 3i*3 + 3i*2 - 38i + 468. Is z(12) a multiple of 42? True Suppose 389p - 166518 = 378p. Is p a multiple of 11? False Suppose -39y = -42y + 18. Let i(r) = -y - 636r + 22 + 635r. Is i(-7) a multiple of 12? False Let k = 269 - 270. Suppose -5g - i = i + 200, 0 = g + i + 43. Does 55 divide (351/54)/(k/g)? False Let t be 14 + -2 + -1(-3 - 2). Suppose tn - 20n = 483. Let i = -17 - n. Is 22 a factor of i? False Let u(v) = -11v - 2. Let s be u(-3). Let r = s + -62. Let p = r + 129. Does 19 divide p? False Let b = -19401 - -30927. Does 102 divide b? True Suppose y + l + 4 = 0, -2y + 4 = y - 5l. Let r be -5 - 3/y-2. Is 64/(2 - (-12)/r) a multiple of 18? False Suppose -23z + 12z - 1870 = 0. Is 1804/10 + -1 + 68/z a multiple of 15? False Let h be 12(-2)/96. Is (133)/(31/h + 2) a multiple of 33? True Suppose -4w - 4f + 7 = 31, 5w = 2f - 2. Suppose -4i + 46 = -5p - 40, 5p + 50 = -5i. Is 18 a factor of (-270)/w + p + 11? False Let r(l) = -8l*3 - 23l*2 - 63l + 81. Let g(b) = -3b3 - 8b*2 - 21b + 27. Let z(k) = -11g(k) + 4r(k). Is z(8) a multiple of 23? True Does 24 divide (-4 - -116)/8(1916 + 16)? True Let v(k) = k2 - 3k - 16. Let o be v(6). Suppose -5b = -5q - b - 638, ob = -q - 136. Is 13 a factor of ((-62)/155)/(1/q)? True Does 4 divide 10/(-3) - (-22 + (-30226)/3)? False Let z be (2 - (-24)/(-15)) + (-426)/(-10). Let p = -38 + z. Suppose -4x = -2x + 2a - 8, -20 = pa. Is x a multiple of 3? False Is (616/126)/(-11) + (-3919)/(-9) - 3 a multiple of 9? True Suppose -r + 29 = 25. Suppose -rl - 19 + 445 = f, 2f = 5l + 813. Does 69 divide f? True Suppose 5s = -5q + 13108 - 4408, -s = 5q - 1724. Does 218 divide s? True Let m(b) = b3 - 16b*2 + 21b + 8. Let k be (1 - 2)/((-2)/4). Let i be ((-3)/k)/((-5)/50). Is m(i) a multiple of 38? False Let g(u) = -7u - 83. Let n be g(6). Does 50 divide (336/20)/(-7)n? True Let q = 155087 - 86519. Does 56 divide q? False Suppose 13n - 4m = 14n, 4m = n - 8. Suppose -nu = 3k - 3481 - 548, -3k = -3u + 3027. Suppose -6t = t - u. Is 24 a factor of t? True Let h be (24/15)/(2/(-5)). Let w be (287/(-28))/(1/h). Let z = w + -5. Is 9 a factor of z? True Let n(x) = 722x - 1521. Is n(8) a multiple of 115? True Let f be (-3 + -2 + 2)(-7)/(-21). Is 7 a factor of 8/(-3)(-345)/(-10)f? False Let h(p) = -p3 + 7p*2 + 2p - 9. Let c be h(7). Let l = 1252 + -692. Suppose 3q + 700 = 5x, -cq = -0x + 4x - l. Is 19 a factor of x? False Is 8/((-176)/77)((-12410)/14 + -1) a multiple of 18? False Suppose 4m - 5p - 34086 = 0, -11m + p = -7m - 34062. Is 66 a factor of m? True Let u(p) = -1170p - 976. Does 22 divide u(-2)? True Let l(j) = 203j + 2132. Is l(18) a multiple of 8? False Let n = 435 + 299. Let g = n - 354. Suppose k = 6k - g. Is 38 a factor of k? True Suppose -11w - 622 = -2239. Let u(p) = -7p - 8. Let g be u(-6). Suppose w + g = j. Is j a multiple of 13? False Let s(v) = -29v + 439. Let p be s(15). Suppose -1413 = -3t + 9o, 0 = 2t - po - 269 - 663. Is t a multiple of 22? False Let d(l) = -l*3 - 9l*2 + 28l + 389. Does 19 divide d(-21)? False Suppose 1138 = -49d + 3098. Let p = 272 + d. Is 12 a factor of p? True Let n(z) = 12z - 444. Let g be n(30). Let l be 2/3(-966)/(-4). Let i = g + l. Is 7 a factor of i? True Let m(i) = 11i - 147. Let o be m(15). Suppose 0 = ob - 9580 - 5936. Does 35 divide b? False Let g = 195 + -190. Suppose -c + 2 = 0, -5h + 0c + 1060 = gc. Does 14 divide h? True Suppose -4o = -16, -2k - 2194 = -4k - 2o. Let z = k + -594. Does 25 divide z? False Let b(k) = -84 + 48k + 43k - 6*k -	{ "pile_set_name": "DM Mathematics" }
- 95. Suppose -b = c + 3c + 18, 3b + 2c + 14 = 0. Calculate the remainder when z is divided by (b + (-8)/16)12/(-3). 9 Let v = -4926 - -1389. What is the remainder when v/6(48/18)/(-4) is divided by 36? 33 Let f = 0 + 3. Suppose -fl = 5r - 627, 2l - 192 = l + 4r. Calculate the remainder when l is divided by 23. 20 Suppose -28k + 35k = 161. Suppose 3t - 77 + k = 0. Suppose -3i = -3m + t + 3, -5m + 33 = -3i. What is the remainder when 15 is divided by m? 3 Let l be (204/8)/((-2)/1). Let r(o) = -66o - 9. Let q be r(l). Suppose s - m = 321, -4m + q = -0s + s. What is the remainder when s is divided by 54? 51 Calculate the remainder when 1308 + 529/(-23) - 0 is divided by 267. 217 What is the remainder when 7950 is divided by 70/(-14) - (405/(-21) - 4/(-14))? 12 Let g(c) = c*2 + 9c + 45. Calculate the remainder when 3615 is divided by g(-11). 64 Suppose 0 = -5d + 38 - 8. Suppose 0 = -dt + 73 + 53. Let l = t + -6. Calculate the remainder when 88 is divided by l. 13 Suppose -114p + 115p - 246 = 0. Suppose 6a = -p - 246. Let v = a - -90. What is the remainder when 53 is divided by v? 5 Suppose -5l = -2x - 1197, 3x + 1193 = 961l - 956l. Calculate the remainder when l is divided by 61. 58 Let j = -8 + 11. Let y = -5243 - -5254. Let d = j + y. Calculate the remainder when 55 is divided by d. 13 Let r = 5027 + -4817. Calculate the remainder when r is divided by 101. 8 Let p = 416654 - 416641. Let d be (-2)/2(-11 - 1). What is the remainder when (-4)/(0 + (-1)/d) is divided by p? 9 Suppose 2w - 3u - 40 = -2w, w - 9 = u. What is the remainder when 504 is divided by w? 10 Suppose 0 = -14l + 12l - 196. Let c = 20 - l. What is the remainder when c is divided by 60? 58 Let m = 3064 + -2844. What is the remainder when m is divided by 47? 32 Let u(r) = 247r - 1931. Calculate the remainder when u(9) is divided by 42. 40 Let z = 51 + -27. Calculate the remainder when 7084/(-2277) - 856/(-9) is divided by z. 20 Let p(i) = -2i - 32. Let b be p(7). What is the remainder when 24 is divided by 3/(-4)(b + 34)? 6 Suppose 3o + 0o = 42. Suppose -5f + 5c = -4f - 110, -2f = 5c - 115. What is the remainder when f is divided by o? 5 Let a(k) = k*3 + 32k*2 + 152k + 37. What is the remainder when a(-16) is divided by 12? 9 Let s = 105 + -96. Suppose sb + 3 = 102. Let r = -59 + 99. Calculate the remainder when r is divided by b. 7 Let n(k) = -k2 + 20k - 31. Let i = -12 + 20. What is the remainder when n(i) is divided by 28? 9 Let g(j) = -j + 73. Suppose 52d - 161 = 45d. Calculate the remainder when 248 is divided by g(d). 48 Suppose -2d = 2d - 1710 + 1594. Let x be -1(-9)/632. Let v = -33 + x. Calculate the remainder when d is divided by v. 14 Suppose 0 = -20w + 30w + 7w - 4063. What is the remainder when w is divided by 90? 59 Suppose 0 = 7t - 4t - 21. Let f be 3730/(-35) - (-9)/(-21). Let d = 117 + f. What is the remainder when d is divided by t? 3 Suppose -38f + 1984 + 3336 = 0. Calculate the remainder when f is divided by 81. 59 Let o = 1279 - 1113. Calculate the remainder when o is divided by 47. 25 Calculate the remainder when 879 is divided by (37/((-1665)/(-30)))/((-15600)/7803 + 2). 12 Suppose -19 = 4j + 1. Let o be (42/35)/(2/j). Calculate the remainder when (-12)/(9/o) - -12 is divided by 6. 4 Let w(h) = 2h*2 - 8. Let k(b) = 3b + 102. Let c be k(26). Suppose -10l - c = -20l. What is the remainder when w(6) is divided by l? 10 Suppose 189 = -7y + 7077 - 84. What is the remainder when y is divided by 64? 12 Let x(w) = 5w + 156. Calculate the remainder when x(-16) is divided by 393/10 + (-21)/70. 37 Let c = -155 + 157. Let u(i) = i*3 - 8i*2 + 9i + 1. Let m be u(7). Suppose -5y + m = -0y. What is the remainder when y is divided by c? 1 Let h(q) = 18 + 511q3 + 3q - q*2 + 2q - 512q3. Calculate the remainder when 53 is divided by h(0). 17 Suppose 35g + 138g = 4215 + 789509. Calculate the remainder when g is divided by 27. 25 Suppose 27f = 32f - 35. Suppose 6u = fu - 21. Suppose 0 = 5g - 4i - 2, 2i - 2 = 4g - 6. What is the remainder when u is divided by g? 1 Suppose -m + 2 = -6. Let f(v) = 5v*2 - 43v - 1. Let i be f(13). Let t = -254 + i. What is the remainder when t is divided by m? 7 Let v be ((-1)/3)/(2/12). What is the remainder when (24/(-9) - v)192/(-8) is divided by 11? 5 Let j be (1(-2)/5)/((-1)/10). Suppose -7 = jy + 5, 5x - 310 = -5y. Suppose 0 = -5d - 0d + x. What is the remainder when 35 is divided by d? 9 Suppose -4j - 2 = -6, 0 = -2l + j - 331. Let g = l - -345. Suppose 4m - 262 = -3c, -2c - 3m = m - g. Calculate the remainder when c is divided by 17. 14 Suppose -2t + 406 = 3q - 7t, 0 = -q + t + 132. Let g = q + -122. Calculate the remainder when 47 is divided by g. 2 Let a = 526 + -492. Suppose -789 = -53h - 153. What is the remainder when a is divided by h? 10 Suppose 7100145 = 426a + 2034472 - 3616633. What is the remainder when a is divided by 13? 10 Suppose -4o + 4n = -252, -n = -3o - 5n + 168. Let d = -94 + -49. Let q = 167 + d. Calculate the remainder when o is divided by q. 12 Suppose 0 = 13s + 76s + 3s - 55476. What is the remainder when 1218 is divided by s? 12 Let l = 2956 + -2777. Calculate the remainder when l is divided by 91. 88 Suppose -100g + 101g = 6. Let l(z) = -z + 2. Let k be l(8). Let m(q) = -q - 3. Calculate the remainder when g is divided by m(k). 0 Let b = -980 - -1274. What is the remainder when b is divided by 138? 18 Suppose 26910 = 2480w - 2246w. Calculate the remainder when w is divided by 141/4 + 4/(-16). 10 Let i be -25/20 + (-14)/4. Let l(d) = -13d - 19. Suppose -2k + 5v + 44 = 0, -v - 9 = 5k - 65. Calculate the remainder when l(i) is divided by k. 9 Suppose 24932 = 81r - 42379. What is the remainder when r is divided by 163? 16 Let c = 147 + -147. Suppose c = 6q + q - 63. Calculate the remainder when 40 is divided by q. 4 Let y(i) = -403i + 10001. Calculate the remainder when y(20) is divided by 29. 27 Let t(a) = 6a*2 + 1735a - 6717. Let g = -17 - -82. Calculate the remainder when g is divided by t(-293). 21 Suppose -22u = -59 - 7. Suppose 3l - 32 = -2s - l, 2 = l. What is the remainder when -2 - (-7)/(7/s) is divided by u? 1 Suppose -18 = -31a + 28a - 2c, -4c = 5a - 34. What is the remainder when 153 is divided by a? 1 Let l = 1382 + -1359. What is the remainder when 999 is divided by l? 10 Let k(l) = 2l - 16. Let f be k(11). Suppose -n - 76 = -fn - j, 3n = 5j + 68. Calculate the remainder when 55 is divided by n - ((-20)/6 - (-2)/6). 17 Let h(o) = -9o - 4. Let n be h(-1). Suppose nw - 83 = 97. What is the remainder when 207 is divided by w? 27 Let p be 2 + 5948/(-44) + (-8)/(-44). Let q = p + 193. What is the remainder when q is divided by 16? 12 Suppose 0 = -q + 2q + 7. Let r be (12/q)/((-11)/(693/6)). Calculate the remainder when 2/((r/(-321))/(-3)) is divided by 36. 35 Let o = 77 + -57. Let m = 25 - o. Suppose mb + 11 = -l, 6l + 3b - 33 = l. What is the remainder when 43 is divided by l? 7 Let k(v) = 21v2 + 29v - 29. What is the remainder when k(1) is divided by (-126)/(-12)((-10)/6 - -3)? 7 Let u(k) = -3k + 670. Calculate the remainder when u(32) is divided by 573. 1 Let g = -15122 + 15226. What is the remainder when 779 is divided by g? 51 Suppose -759 = -29d + 40d. Let t = -35 - d. What is the remainder when t is divided by 27? 7 Let u be (-2)/(-2)(-39 - -37). Calculate the remainder when 26 is divided by ((-3)/4)/((-140)/64 - u). 2 What is the remainder when 81 is divided by 75 - 77 - (-3 - 127)/2? 18 Suppose 27l = -14l + 10865. Calculate the remainder when l is divided by 88 - (7 - (-16)/(-2)). 87 Suppose 0 = 119s - 137515 - 73591. What is the remainder when s is divided by 37? 35 Suppose 2t = 5l - 112, -l = -t + 4l - 46. Calculate the remainder when 67 is divided by 8/(-36)6 - 616/t. 3 Let b(f) = f*3 - 5f*2 + 11f - 18. Let m be b(4). Suppose -g + 23 = 6a - 2a, 0 = -2g - m. What is the remainder when 117 is divided by a? 5 Let q(z) = 83z - 502. Calculate the remainder when 555 is divided by q(7). 2 Let u be (((-18)/5)/(-1))/((-2)/10). Calculate the remainder when 13/(585/u) - (-404)/10 is divided by 14. 12 Let j(s) = -1 + s - 2*s -	{ "pile_set_name": "DM Mathematics" }
r) be the first derivative of -r*2 - 400. Let i(s) = 774s*2 + 11. Let q(u) = 155u*2 + 2. Let d(w) = 2i(w) - 11q(w). Calculate p(d(y)). 314y*2 Let a(i) = 4 - 3 - 2 - 18i. Let j(y) = 4y2 - 102y + 12. Let w(v) = 12v2 - 289v + 34. Let q(k) = -17j(k) + 6w(k). Calculate q(a(r)). 1296r2 + 144r + 4 Let u(o) = 250o2 + 347o*2 - 596o*2. Let r(q) = 152q. What is r(u(m))? 152m2 Let u(f) = -6 - 5 + 4 - 63f + 4 + 2. Let c(l) = 31l2. Calculate c(u(d)). 123039d*2 + 3906d + 31 Let q(b) be the second derivative of 0b2 + 203b - 1/3b3 + 0. Let f(c) = 11c. Calculate q(f(r)). -22r Let l(w) be the third derivative of 3w*2 + 0w*4 - 1/60w*5 + 0w*3 + 7w + 0. Let c(x) be the second derivative of x3 + x2 - 3x. What is l(c(t))? -36t*2 - 24t - 4 Let g(m) = m*2 + m + 8. Let h be g(0). Let o(t) = 45 - 45 + ht. Let n(y) = -7y + 5. Let b(i) = -10i + 7. Let v(j) = 5b(j) - 7n(j). Give o(v(c)). -8c Let p(q) be the second derivative of 5q*3 - 78q - 4. Let a(x) = 2x2 + 61x. Determine a(p(h)). 1800h2 + 1830h Let u(m) = 4m2. Let l(o) be the first derivative of -o3/6 + 42o - 63. Let w(x) be the first derivative of l(x). What is w(u(z))? -4z2 Let v(w) = -2468w. Let z(l) = 33621l. What is v(z(b))? -82976628b Let l(s) = -202s2. Let f(c) = -8c*2 + 34c - 34. Let q(g) = -g*2 + 4g - 4. Let w(i) = 4f(i) - 34q(i). Give w(l(p)). 81608p4 Let u(p) = -20p. Let n(w) = -6731w2 + 318w + 636. Let y(j) = -106j2 + 5j + 10. Let q(o) = 5n(o) - 318y(o). What is u(q(i))? -1060i2 Let a(z) = -11385073z*2. Let u(y) = -10y*2. What is a(u(b))? -1138507300b*4 Let t(o) be the second derivative of -28o + 1/6o3 + 0o*2 + 0. Let f(x) = 2x. Let r(v) = f(v) - 3t(v). Let i(s) = 45s*2. Calculate r(i(u)). -45u*2 Let s(k) be the third derivative of -31k*7/1008 - 23k*5/15 + 74k2. Let r(u) be the third derivative of s(u). Let g(m) = -m2. Give g(r(h)). -24025h2 Let u(q) = q2. Let k = 2305 - 2305. Let v(t) be the third derivative of -8t*2 + kt*3 - 1/30t*5 + 0t + 0 + 0t4. Determine v(u(p)). -2p*4 Suppose -4d + 26m + 198 = 23m, 0 = -d + 5m + 41. Let r(y) = -49 + 19y - d + 100. Let s(c) = 4c. What is s(r(u))? 76u Let n be (-3744)/(-252) + ((-30)/(-14) - 2). Let x(s) = -ns + 3s + 1 + 4 - 25s - 7. Let g(c) = 3c. Determine x(g(r)). -111r - 2 Suppose -118 = -18r - 41r. Let m(u) = 0u - ru + u - 12u*2 + u. Let v(t) = 3t. Calculate m(v(i)). -108i2 Let p be -2(2/(-4))/(4/8). Let q(s) = 1. Let l(d) = 32d + 160. Let x(c) = pl(c) - 320q(c). Let b(f) = -3f*2. Calculate x(b(t)). -192t*2 Suppose 14 = 10n - 6. Suppose 0 = 4p - np + 4, -3v = 5p - 44. Let d(a) = -15 - 3a2 - v + 33. Let y(o) = -14o. What is d(y(i))? -588i2 Let l(y) = -3501y*2. Let d(t) = -4t - 21. Let w(z) = 39z + 203. Let u(x) = -58d(x) - 6w(x). What is u(l(j))? 7002j2 Let a(d) = d2 - 28. Let h(m) = -1159m2 + 168. Let q(k) = -6a(k) - h(k). Let v(c) = -c*2. Calculate q(v(x)). 1153x*4 Let y(c) = -34c. Let b(h) = 909194h. Give b(y(g)). -30912596g Let h(p) = -p. Let w = -34 - -56. Suppose y - t - w = 55, -y + 3t = -75. Let b(o) = -o + 157 - 79 - y. Determine h(b(r)). r Let v(u) = -24u - 258. Let o(i) = -995i. Calculate o(v(c)). 23880c + 256710 Let x(w) = -819w - 816w - 816w + 2452w. Let p(k) = -1895k2. Calculate p(x(m)). -1895m*2 Let t(k) = 2k*2. Let c(q) = -1585q - 476q - 615q. What is c(t(d))? -5352d2 Let f(d) = 28981d*2 - 58045d*2 + 29019d*2. Let y(o) = 5 - 4 - o - 1. Calculate y(f(z)). 45z*2 Let w(z) = 286z*2 + 77z - 77. Let s(b) = 15b2 + 4b - 4. Let h(o) = 77s(o) - 4w(o). Let x(m) = -18120m + 18120m - 5m2 + 19m*2. Calculate x(h(j)). 1694j*4 Suppose -2r + 0 = 2f + 4, 2r + 4f + 12 = 0. Let u(p) = 4p2 - p2 - rp2. Let a(w) be the first derivative of -2w*3 - 260629. Determine u(a(b)). 36b*4 Let z(y) = -34y*2. Let x(t) = 571 - 4t - 1209 + 3t + 639. Determine z(x(f)). -34f*2 + 68f - 34 Let r(s) be the second derivative of s*3/6 - 3s. Let f(t) = t + 3. Let a(w) = -23w2 + 5w + 15. Let z(b) = a(b) - 5f(b). What is z(r(u))? -23u*2 Let l(t) = 21 - 14 - 5 - 33t. Let s(u) be the first derivative of u*4/6 - u - 9. Let v(y) be the first derivative of s(y). Give l(v(z)). -66z*2 + 2 Let z(v) = 13v. Let t(s) be the second derivative of -47s4/3 + 2006s. What is t(z(d))? -31772d2 Let y(b) = -30149b*2 + 11b - 22. Let g(d) = 6032d2 - 2d + 4. Let t(p) = -11g(p) - 2y(p). Let x(l) = -3l. Determine x(t(f)). 18162f*2 Let a(h) be the second derivative of 193h*3/6 + 578h - 1. Let z(l) = 23l2. Calculate a(z(n)). 4439n*2 Let m(p) = -2p + 8. Let w(k) = -257804k. Determine m(w(i)). 515608i + 8 Suppose -2g + 10u - 6 = 8u, -5g = -2u. Let j(h) = 6h2 - 2 + h2 + g + h*2. Let n(s) = 8s*2. Determine n(j(v)). 512v*4 Let s(l) = 326l + 1. Let t(w) = 17w2 + 1628w + 5. Let f(b) = 5s(b) - t(b). Let p(a) be the first derivative of 2a*3/3 - 1. Give f(p(v)). -68v*4 + 4v*2 Let l(a) = 2a - 7. Let j(f) = -3044f2 + 2992f*2 + 0 + 0. Give j(l(g)). -208g*2 + 1456g - 2548 Let a(g) = -31g2 - 8g. Let k(m) = 1242m2 + 322m. Let u(w) = -161a(w) - 4k(w). Let d(f) = -38f. Calculate d(u(t)). -874t*2 Let q(f) = 9 - 12 - f - 18 + 21. Let i(g) = 2g - 18. Give i(q(y)). -2y - 18 Let b(s) = -6s*2. Let g(m) = 1823918m. What is b(g(k))? -19960061224344k2 Let h(y) be the second derivative of -y4/4 + 52y. Let o(x) = -34x2 - 49x*2 + 30x*2. Give o(h(k)). -477k4 Let s(u) = -u2 - 2u - 2. Suppose 3h + 1 = -5. Let n(k) = -3k2 - 7k - 7. Let d(i) = hn(i) + 7s(i). Let c(a) = 0 + 31a - 2 + 0 + 2. Give c(d(o)). -31o*2 Let w(p) = -36p*2. Let y(l) = 51l*2 + 35l*2 - 25l*2 - 22l*2. Calculate w(y(u)). -54756u*4 Let f(k) = -390k*2 + 4. Let g(u) = -57u + 6u + 38u + 12u. Calculate f(g(m)). -390m*2 + 4 Let q(j) = 45j*2 - 1649j + 17. Let f(c) = -8c2 + 275c - 3. Let m(l) = -34f(l) - 6q(l). Let h(a) = 2a. Determine h(m(o)). 4o*2 + 1088o Let o(r) be the second derivative of 19/3r3 + 0 - 27r + 0r2. Let x(s) = -s2. Give o(x(l)). -38l*2 Let c(s) be the second derivative of -1079s*4/4 + 13s - 126. Let f(w) = -w*2. Give f(c(m)). -10478169m*4 Let r = 33 - 31. Let k(b) be the first derivative of -162 + 84 + 82 + rb*2. Let c(g) = -3g*2. What is k(c(m))? -12m*2 Let y(u) = -2u*2. Let t(p) = -245p*2 + 165425. Give t(y(a)). -980a*4 + 165425 Let n(r) = -72r - 5. Let p(d) = 57d + 4. Let s(l) = 4n(l) + 5p(l). Let a(m) be the third derivative of m4/3 + 3m*2. What is s(a(y))? -24y Let q(k) = 15k + 12k - 2 - 31k. Let o(p) = -16p*2. Let n(b) = -14b*2. Let t(z) = -7n(z) + 6o(z). Give q(t(s)). -8s*2 - 2 Let z(a) = 597a*2. Let m(i) = -6i*2 + 5932i. Give m(z(n)). -2138454n4 + 3541404n*2 Let k(t) be the first derivative of -7t*2/2 + 5675. Let v(r) = 1943r*2. Determine k(v(b)). -13601b*2 Let c(h) = h. Let q(g) = -83696813g. Calculate c(q(f)). -83696813f Let w(i) = 1759403i. Let q(c) = 144c2. Determine w(q(k)). 253354032k*2 Let c(s) = 16s. Let o(b) be the second derivative of 2/3b3 + 0 + 0b*2 + 30b. Give c(o(x)). 64x Let x(u) = 2u + 170. Let d(a) = 18a + 15a + 22a - 33a. Determine d(x(w)). 44w + 3740 Let d(w) = w3 - 6w*2 - w + 43. Let t be d(4). Let p(f) = -f - 18f + 11f + tf. Let j(n) be the first derivative of 2n3/3 + 2. What is j(p(y))? 2y*2 Let w(y) = 3y*2 + 993495. Let g(j) = -j. Calculate w(g(v)). 3v*2 + 993495 Let r(d) = 4d*2. Let q(g) = 10g + 82. Let n be q(-8). Let f(w) = 131 - 141 - 4wn + 2w*2. Give r(f(k)). 16k*4 + 160k*2 + 400 Let n(s) = -s + 3. Let b(y) = 9y*2 + 5y + 142. Let a(q) = -b(q) - 5n(q). Let k(v) be the first derivative of a(v). Let p(w) = 2w. What is k(p(h))? -36h Let x(z) be the second derivative of 0z*2 + 2z - 1/12z4 - 10 + 0z*3. Let b(a) = -3a + 3a - 5a. Calculate b(x(t)). 5t2 Let r(c) be the second derivative of -5c*3/6 - c - 83. Suppose 2x - x = 2. Let z(a) = 3a - 3a + xa. Calculate r(z(h)). -10h Let m(l) = 244l + 232l - 650l + 217l. Let z(h) = -7h*2. What is z(m(p))? -129	{ "pile_set_name": "DM Mathematics" }
5t + f = -h + 22. Is t prime? True Let u(m) = 3m*2 + 2m + 1. Let h be u(2). Suppose 3l - 36 = -3z, 0 = -z - 6l + 4l + h. Is z composite? False Let z = 633 + -442. Is z a prime number? True Let y = -429 + 1540. Is y composite? True Suppose 2v - 846 + 116 = 0. Is v prime? False Suppose -1461 = -2n - n - 2i, 4n + 5i = 1948. Is n prime? True Let w(a) = a - 4. Let p be w(6). Suppose -t + pt = -188. Let z = -133 - t. Is z a composite number? True Let l = 71 + -129. Let b = l - -89. Is b prime? True Suppose -2l + 4 = -2, -3l - 314 = -w. Is w a composite number? True Is 926 - 8/(24/15) a prime number? False Let n be 3 - 2 - 13. Is 33 - (n + (3 - 3)) composite? True Let s = 1 + 3. Let v be 22/(-12) + s/(-24). Is (75 - 1)(-1)/v composite? False Let v(w) = -w*3 - 4w2 - w + 7. Let r(t) = -t2 - 4t. Let d be r(-5). Is v(d) a prime number? True Suppose -3f + 2212 = f. Is f prime? False Let t(g) = 2g3 - 15g*2 + 11g + 13. Is t(10) a composite number? True Let t = -6 - -14. Suppose 0 = -3c + 13 + t. Is c a prime number? True Suppose -2r + 4u - 1393 = 3r, 2r + 552 = -u. Is (-22)/(-99) + r/(-9) prime? True Suppose 3c - 13 = -2g, 5c - 20 = -5. Let f be (-20)/(-6) + g/(-6). Is (f/6)/(2/148) a prime number? True Let t(b) = 242b3 - 2b*2 + 6b - 6. Is t(2) composite? True Let w(b) = 67b2. Is w(1) prime? True Let i(g) = g - 23. Let s be i(16). Is s/(2/(-26)1) prime? False Let b(t) be the first derivative of 25t3/3 - t2 + 2t - 2. Let d be b(2). Suppose -5j - d + 253 = 0. Is j a composite number? False Let m(f) be the second derivative of 7f5/10 - f4/6 - f*3/3 + 2f. Let i be m(-2). Let w = i + 193. Is w prime? False Let i(s) = 13s2 + s - 1. Let u be i(4). Suppose -5f + u + 204 = 0. Is f a composite number? False Let x(g) = -5g3 - 3g*2 + 6g + 3. Is x(-4) a composite number? False Suppose -17 = -5b - 4h + 55, -4b - 5h = -63. Suppose 5m = 2m + b. Suppose mj + 406 = 6j. Is j prime? False Suppose 930 = 2w - v, -2w + 472 = -w - 4v. Let j = w - 21. Is j a composite number? False Let h(a) be the third derivative of -a5/60 + a4/4 + a3/3 - a2. Is h(5) a composite number? False Let x be (0 + 2)/(-2)1. Suppose 5d + 4 = -3q - 3, 2d = -q - 3. Is 1/(x - d) - -64 prime? False Suppose 11 + 5 = 4w, -2o - 8 = w. Let x(d) = -4d*3 + 2d - 4d2 + 11 + 6d - 4 + 3d3. Is x(o) prime? True Let f(x) = -x + 6. Let i be f(3). Suppose 4t = 5t - i. Suppose 0 = -tp - 25 + 82. Is p prime? True Suppose c + 107 - 1230 = 0. Is c prime? True Let l(i) = -i*3 - 16i*2 - 11i - 19. Suppose 0 = 4s + 19 + 45. Is l(s) prime? True Suppose -7y + 29565 = -2y + 2a, -y - 5a + 5936 = 0. Is y a prime number? False Let c be 88 + 0 - (4 - 3). Suppose c = 4n - 225. Suppose 0 = -5x + 2i + 101, 3x - 3i - n = -x. Is x prime? False Is 3/1 + (10 - -76) a composite number? False Let f(r) be the third derivative of r6/120 - r5/10 - 13r4/24 - 2r*3/3 + 3r*2. Is f(9) a prime number? False Suppose 0 = -0a - 5a - 15. Is -119(-1)/((-3)/a) composite? True Let c = -4 + 5. Is (178/(-1))/((-2)/c) composite? False Suppose -4p - 2w = -10360, 2427 + 5356 = 3p - 5w. Is p prime? True Suppose 0s + 1149 = s - 2j, s - 5j = 1146. Is s a composite number? False Let f(p) = -p3 + 18p*2 + 4. Is f(17) prime? True Let d = 7 + -5. Is d-31-1 composite? True Let r = -2032 + 3503. Is r prime? True Let a(p) = -p. Let v be a(-2). Let x be -355((-6)/(-10) + -1). Suppose 2t - x = 4f, -2t - 3f = vt - 317. Is t prime? False Let m(d) = -6d + 2d*2 + 11d + 16d2 + 5d*2. Let k be m(5). Suppose k = 4i + 5s + 117, -s = 3i - 376. Is i composite? False Is -1 + 3243 + -1 - 0/(-5) prime? False Let j(y) = -y3 - y2 + 2. Let x be j(0). Is -79(x - 4)/2 composite? False Let c(a) = -a3 + 7a*2 + 8a - 8. Let f = 13 + -7. Let q be c(f). Is (q/6)/((-2)/(-3)) prime? True Let c(o) = -36o + 1. Let w(h) = 2h - 4. Let y be w(-4). Let v = y + 8. Is c(v) a prime number? False Suppose -4v = -3c - 34 + 8, 4c + 33 = 5v. Let q(g) = g*3 + 3g*2 + 3g + 2. Let o be q(c). Suppose o = -0n - 3n + 93. Is n a composite number? False Let s(m) be the first derivative of m*2/2 - m + 1. Let d be s(3). Is 52 - 2/d-1 composite? False Let b(m) = 18m + 8. Let h = -8 - -15. Is b(h) prime? False Let o(r) = -r3 - 4r*2 + 2r - 1. Let x be o(-7). Suppose x = 3b - 7b. Is (b/(-6))/(1/14) a prime number? False Let v be -4 - (-1)/(3 + -4). Let o = -3 - v. Is (-8)/o(-196)/16 prime? False Let v = -7 + 5. Is 81 - 2 - -1 - v a composite number? True Suppose -26 = d - 5x, -d + 2d + 24 = 4x. Is d/56 - (-1782)/14 a prime number? True Suppose 1519 = 9p - 1082. Is p prime? False Let n = 11 + -36. Let p be (2/(-5))/((-5)/n). Is 22 - (0/2)/p a composite number? True Suppose 0 = -2f + m + 71, -m = -5f - 3m + 191. Is f composite? False Suppose -3d - 2d = -25. Suppose dy - 92 + 657 = 0. Let w = y + 164. Is w a prime number? False Let x = 96 + -43. Is x a prime number? True Let c = -12 + 22. Is c a prime number? False Let z(q) be the first derivative of 1/4q*4 + 2 + 5/3q*3 + 0q - 7/2q2. Is z(-5) a prime number? False Suppose 3u - 4a - 10 = 14, 5u + 5a - 40 = 0. Let l be ((-16)/u)/(0 - -2). Is 993/12 - l/4 a prime number? True Suppose 2c - 556 - 534 = 0. Is c a prime number? False Suppose -6n = -2n - 232. Is n a prime number? False Let a(i) = 2i - 4. Let h be a(3). Is 2322/42 - h/7 a prime number? False Suppose 4j + 0j + 8 = 0. Is (j133/(-2))/1 composite? True Let s = 2174 + 942. Is s/7 - 12/84 a composite number? True Let g be -10(12/3)/(-8). Suppose -3c - 2p + 22 = 0, -2p + 25 + 5 = 5c. Suppose -3o = 1 - c, 102 = q + go. Is q composite? False Suppose 5613 = -0d - d. Is (-8)/28 + d/(-21) a prime number? False Let r(x) = -31x + 4. Is r(-3) prime? True Is (1 + -308)(-4 + (-1 - -3)) prime? False Is 1/(3290/(-1097) + 3) composite? False Let k = -13 + 1. Is (-16)/6117/k a prime number? False Let h(t) = t + 2. Let j(p) = -2p - 2. Let r be j(-4). Let m be h(r). Suppose -d = 4n - 145, -m + 39 = n + 2d. Is n a prime number? True Let r(b) = b*2 + 6b - 18. Is r(5) a prime number? True Let i(t) = -t*3 - 3t*2 - 5t - 1. Let l(a) be the first derivative of -a*4/4 - 5a3/3 - a2 + 4a + 2. Let d be l(-4). Is i(d) prime? False Let q(m) = 7m + 1 - 6m + 8m. Is q(6) composite? True Let g(n) = -4228n3 + n2. Is g(-1) a prime number? True Let d = -16 - -8. Let o(j) be the second derivative of j4/12 + 4j*3/3 + 7j*2/2 - 4j. Is o(d) a composite number? False Suppose -2m - 5f + 9 = 0, -2m + 0f = f - 5. Suppose 4j - 209 = -3h, 0j - mj + 102 = 4h. Is j a composite number? False Suppose 4 = -2j - 2h, 0 = 4h - 4 + 16. Let w(l) = 18l + 1. Let m be w(j). Let p = m + 4. Is p composite? False Let o(j) = -j - 2. Let f be o(-6). Suppose -20 = -v - 5x + 1, -fv - 5x + 39 = 0. Let h(n) = -n*2 + 11n - 5. Is h(v) composite? True Let j = 146 - 67. Is j prime? True Let o = 0 + 4. Suppose oz - 2 - 18 = 0. Is (-2)/z + (-172)/(-5) a prime number? False Suppose 7u - 6u = 839. Is u a prime number? True Let y(j) = -2604j3 - j2 + j + 3. Is y(-1) a composite number? True Suppose 5k + 46 - 9705 = 4d, 3d - 1928 = -k. Is k a composite number? False Suppose -5s + 5i = -2340, -3i + 674 = 3s - 748. Is s prime? False Is (-102460)/(-6) + 1/3 a prime number? True Let j(k) = -k2 + 7k - 18 + 18. Let f be (-10)/36/(-4). Is j(f) a composite number? True Is 342/4 + (-2)/(-4) composite? True Let w(q) = 121q. Is w(1) prime? False Let i = -6 - -7. Suppose z = i + 2. Suppose -99 = zl - 6l. Is l a prime number? False Let f = -28 - -47. Let s = -10 + f. Is s composite? True Let o = 92 - 169. Let m = 39 + o. Let n = 1 - m. Is n a composite number? True Let a(l) be the second derivative of -13l3/6 + 8l*2 + 4l. Is a(-13) composite? True Let l = 204 - 304. Let p = 115 - l. Is p prime? False Let o = 4444 - 2397. Is o a composite number? True Let h(u) = u + 1. Let z be h(3). Is z/(-20) + 386/5 a prime number? False Suppose -515 = 2g + 3g + 5j, g + 3j = -97. Let i = 248 + g. Suppose 572 = 4p - 2a, -p + 2a + i = -1. Is p a prime number? False Let t(c) = -2c - 6. Suppose 0*o = -o - 4. Let z be t(	{ "pile_set_name": "DM Mathematics" }
) = -i*3 + 20i*2 + 101i - 95. What is g(24)? 25 Let g(m) = 2m3 + 37m*2 - 103m + 31. Give g(-21). -11 Let b(i) = -7i + 252. Calculate b(35). 7 Let t(z) = 50z - 9282. Calculate t(186). 18 Let f(d) = d*3 - 12d*2 - 29d - 11. Determine f(13). -219 Let s(x) = 7x2 - 6x - 16. What is s(-3)? 65 Let u(w) = 4w2 + 11w + 24. Give u(-8). 192 Let g(b) = 6b2 - 216b + 34. Calculate g(38). 490 Let n(j) = 3j2 + 14j - 23. What is n(-6)? 1 Let w(v) = -179v + 36. Give w(1). -143 Let m(d) = d3 - 28d*2 + 120d - 585. What is m(24)? -9 Let a(j) = 2j2 + 868j + 46743. Calculate a(-63). -3 Let l(d) = d*2 + d - 114. Give l(-11). -4 Let w(l) = -16l*2 - 1326l + 186. Calculate w(-83). 20 Let y(a) = -a*3 + 92a*2 + 158a + 2908. Determine y(94). 88 Let x(o) = 45o2 - 486o - 660. Calculate x(12). -12 Let j(f) = -3f3 - 214f*2 + 364f - 46. Determine j(-73). 27 Let z(a) = a*2 + 143a + 2762. Calculate z(-23). 2 Let f(j) = 6j3 + 318j*2 + 3j + 145. Calculate f(-53). -14 Let n(a) = a*2 - 5a + 21. What is n(7)? 35 Let c(o) = o*3 - 2o - 57. Give c(0). -57 Let c(u) = 2000u + 116010. Give c(-58). 10 Let d(v) = 1336v - 98870. Calculate d(74). -6 Let n(q) = 2q2 + 186q + 2028. What is n(-80)? -52 Let z(o) = 930o - 9295. Give z(10). 5 Let n(l) = l2 + 24l - 131. What is n(-39)? 454 Let v(y) = y*3 + 48y*2 - 11y - 585. Calculate v(-48). -57 Let y(s) = -2s3 - 25s*2 + 4s + 26. Give y(-11). -381 Let i(v) = -75v + 29. Calculate i(1). -46 Let m(r) = 424r - 2184. Determine m(5). -64 Let v(w) = 894w + 7136. What is v(-8)? -16 Let c(b) = 9b*2 + 43b + 2. Determine c(-5). 12 Let s(w) = -w*3 + 50w*2 - 302w + 38. Give s(43). -5 Let d(h) = -h*2 + 7h + 422. Determine d(-17). 14 Let l(g) = 2225g + 24465. Give l(-11). -10 Let c(o) = 5o + 293. Calculate c(9). 338 Let k(w) = w*2 + 17w - 73. What is k(-21)? 11 Let m(t) = -4t2 - 2t + 25. What is m(-4)? -31 Let b(i) = 257i - 1497. Determine b(6). 45 Let d(u) = 4u*2 - 14u + 16. Determine d(3). 10 Let y(z) = z*3 - 7z*2 - 54z + 45. Calculate y(11). -65 Let b(h) = -81h + 364. Give b(4). 40 Let s(y) = -2y*2 + 80y - 232. Calculate s(37). -10 Let i(a) = -2a2 - 111a - 150. Give i(-55). -95 Let j(b) = -145b + 1033. Give j(8). -127 Let o(a) = a2 + 32a + 77. Determine o(-32). 77 Let i(c) = -5c2 - 120c - 123. What is i(-24)? -123 Let w(h) = h*3 - 24h*2 - 61h - 45. Give w(26). -279 Let n(m) = -93m - 582. Calculate n(-11). 441 Let w(m) = 3m*3 + 41m*2 + 61m + 23. Give w(-12). 11 Let x(y) = 2y2 - 60y + 406. Determine x(10). 6 Let v(r) = -4r2 - 16r + 41. Determine v(2). -7 Let u(v) = -v*3 + 36v*2 + 53v + 359. Give u(38). -515 Let o(x) = 7x3 + 7x*2 + 2x - 8. Calculate o(-4). -352 Let h(l) = l*3 - 29l*2 - 60l - 86. Give h(31). -24 Let p(g) = -2g2 - 1300g - 5174. Give p(-4). -6 Let h(j) = -99j2 - 98j + 1. Give h(1). -196 Let c(x) = 3x2 - 10x - 33. Determine c(4). -25 Let v(a) = -2a3 - 37a*2 + 23a + 28. Calculate v(-19). -48 Let d(a) = 240a - 1439. Give d(6). 1 Let i(u) = -578u + 3467. Give i(6). -1 Let k(y) = y*2 - 304y + 8637. Calculate k(32). -67 Let m(z) = 126z + 1190. What is m(-9)? 56 Let x(m) = 4m*2 - 119m + 98. What is x(29)? 11 Let z(w) = -9w2 + 103w - 66. Give z(9). 132 Let y(d) = -d*3 + 166d*2 - 1112d - 135. Determine y(159). 24 Let w(n) = 138n + 904. Calculate w(-7). -62 Let d(t) = 2t*2 + 214t - 10662. Calculate d(37). -6 Let i(r) = 301r - 1370. Give i(5). 135 Let d(u) = u2 + 68u + 1100. Give d(-46). 88 Let q(t) = 983t - 11800. What is q(12)? -4 Let i(x) = -40x - 4505. What is i(-113)? 15 Let x(o) = 3o3 + 210o*2 + 9o + 640. Calculate x(-70). 10 Let n(d) = -d*3 + 92d*2 - 353d + 80. Calculate n(88). -8 Let w(u) = -u*3 - 8u*2 - 9u - 6. Calculate w(-5). -36 Let j(c) = -c*2 + 328c + 987. Determine j(-3). -6 Let x(f) = -2f3 + 11f*2 - 14f - 16. What is x(7)? -261 Let a(g) = -9g - 276. Calculate a(-25). -51 Let f(d) = -1125d + 6757. Give f(6). 7 Let s(g) = -10g2 - 3753g - 3753. Calculate s(-1). -10 Let v(c) = -c*3 - 50c*2 + 3c + 136. Calculate v(-50). -14 Let k(o) = 13o + 89. Determine k(-23). -210 Let s(i) = 59i + 468. Determine s(-8). -4 Let x(v) = -2v2 - 214v - 1756. Determine x(-98). 8 Let k(p) = -p*2 + 95p - 566. Determine k(89). -32 Let v(n) = n*3 - 7n*2 - 261n + 8. Determine v(20). -12 Let m(f) = -4f + 55. Determine m(15). -5 Let f(n) = n3 - 18n*2 - 361n - 35. What is f(-12)? -23 Let s(t) = -6t2 - 74t + 179. Calculate s(-15). -61 Let m(j) = -j*3 + 20j*2 + 69j - 349. Calculate m(22). 201 Let r(j) = 35j2 - 52j - 6. Give r(2). 30 Let o(p) = -571p - 5696. Determine o(-10). 14 Let q(h) = -18h*2 + 6h + 1. What is q(3)? -143 Let b(t) = 15t + 49. What is b(-10)? -101 Let q(d) = -d3 - 24d*2 - 29d - 715. Give q(-24). -19 Let v(a) = -a*3 + 99a*2 + 183a + 2025. Determine v(101). 106 Let z(b) = b*3 - 99b*2 - 142b + 4214. Calculate z(100). 14 Let r(u) = 1385u - 11081. Determine r(8). -1 Let l(b) = b2 - 141b - 748. Calculate l(-5). -18 Let o(v) = 232v - 486. What is o(2)? -22 Let f(j) = -j3 - 7j*2 - 13j - 6. Give f(-6). 36 Let q(h) = -10h2 + 127h - 364. Calculate q(3). -73 Let y(h) = 2h3 - 5h*2 - 4h + 18. Determine y(-4). -174 Let i(q) = -33q + 376. Determine i(12). -20 Let l(b) = -b3 - 7b*2 + 7b + 25. Determine l(-2). -9 Let r(k) = -52k2 - 526k - 40. What is r(-10)? 20 Let r(q) = 5q3 + 14q*2 - 14q - 57. Calculate r(-2). -13 Let w(n) = 6n + 465. Calculate w(-80). -15 Let f(b) = 17b*3 + 6b*2 - 24b + 27. What is f(2)? 139 Let m(h) = h*3 - 27h*2 + 52h - 4. What is m(23)? -924 Let v(g) = -12g - 523. Give v(7). -607 Let h(g) = -9g - 33. Give h(-2). -15 Let r(l) = -328l - 11479. Calculate r(-35). 1 Let d(z) = 4z*3 - 57z*2 + 33z + 86. Determine d(13). -330 Let p(d) = 379d - 6832. What is p(18)? -10 Let b(m) = -37m - 893. What is b(-25)? 32 Let a(r) = 3r2 - 3r - 24. Determine a(-5). 66 Let o(k) = -k*3 - 14k*2 - 8k - 70. Determine o(-14). 42 Let i(w) = -107w - 142. What is i(-8)? 714 Let v(q) = -3q*3 + 10q*2 + 17q - 46. Calculate v(5). -86 Let u(x) = -x + 9. Give u(-16). 25 Let n(t) = t*3 + 3t*2 - 20t + 17. What is n(-7)? -39 Let u(q) = q*3 + 5q*2 + 18q + 39. Determine u(-3). 3 Let t(r) = -4r3 + 80r*2 + 90r - 125. What is t(21)? 1 Let m(l) = 7l3 - 222l*2 - 61l - 66. Give m(32). 30 Let u(s) = -30s + 994. What is u(34)? -26 Let m(f) = -f2 - 8f - 40. Calculate m(-15). -145 Let i(r) = r*3 - 20r*2 + 87r - 48. Determine i(14). -6 Let d(h) = -2h3 - 790h*2 - 5424h + 3104. Calculate d(-388). 0 Let q(x) = 52x - 8106. Give q(156). 6 Let j(q) = 17q - 90. Give j(-12). -294 Let f(p) = 184p - 2921. Determine f(16). 23 Let t(c) = -8c*3 + 57c*2 - 16c + 64. Calculate t(7). 1 Let z(s) = 38s2 - 532s + 49. Give z(14). 49 Let d(k) = -k*3 - 23k*2 - 75k - 180. Calculate d(-19). -199 Let j(v) = 110v - 3049. Determine j(28). 31 Let q(r) = -22r*2 + 195r + 32. Determine q(9). 5 Let h(p) = -p*3 + 35p*2 + 39p - 34. Determine h(36). 74 Let b(w) = -8w2 + 8w + 4. Give b(8). -444 Let d(o) = 3o3 - 16o*2 + 3o + 21. Determine d(4). -31 Let l(g) = g*3 + 196g*2 + 80g - 22424. Calculate l(-195). 1 Let i(g) = -8g2 + 271g + 41. Calculate i(34). 7 Let t(r) = 17r2 + 4r - 7. Calculate t(0). -7 Let t(y) = 281y - 2427. Calculate t(8). -179 Let a(q) = -66q + 24. Determine a(-3). 222 Let y(q) = q*2 - 37q - 135. Calculate y(43). 123 Let g(p) = -2p2 + 122p - 6. Determine g(64). -390 Let m(t) = -4t2 + 236t + 1308. What is m(64)? 28 Let s(c) = -4c2 - 89c - 175. Calculate s(-20). 5 Let z(f) = 20f + 429. What is z(-22)? -11 Let w(y) = -110y + 1536. Give w(13). 106 Let g(t) = -126t + 852. What is g(7)? -30 Let f(r) = 21r - 118. Calculate f(10). 92 Let t(r) = -134r - 1633. Calculate t(-12). -25 Let g(n) = -n3 + 9n2 + 435. Give g(12). 3 Let y(n) = -n2 - n + 103. Calculate y(10). -7 Let o(u) = 19u2 + 3142u - 1983. What is o(-166)? 9 Let n(u) = -u + 118. What is n(39)? 79 Let s(h) = h*2 - 627h - 2518. What is s(-4)? 6 Let j(o) = -o*2 - 33o - 104. Determine j(-40). -384 Let v(u) = 12*u +	{ "pile_set_name": "DM Mathematics" }
ase 5) to base 9 17687554 681297 (base 10) to base 16 a6551 What is 295b5 (base 15) in base 14? 36624 What is -103b60 (base 16) in base 3? -2000001020010 What is 744911 (base 10) in base 9? 1354738 966730 (base 12) to base 11 1382679 1829596 (base 12) to base 6 255523510 What is -211200220012 (base 3) in base 12? -196695 7650a (base 11) to base 9 178341 -11000100110110100110 (base 2) to base 6 -25140530 -3312220 (base 4) to base 13 -7252 Convert 4414004033 (base 5) to base 9. 18813622 1125998 (base 10) to base 11 6a9a85 What is 7205569 (base 11) in base 5? 11224332424 -11a488 (base 11) to base 2 -101110010010001110 30074a (base 12) to base 14 156614 Convert -2788625 (base 9) to base 16. -176c4e -101010111110011101001 (base 2) to base 8 -5276351 Convert 10100101100111100111 (base 2) to base 8. 2454747 Convert -12ca48 (base 13) to base 5. -104102104 What is 1020120112120 (base 3) in base 11? 411579 Convert -2775652 (base 8) to base 9. -1426230 Convert 20220343 (base 6) to base 16. 8d267 -1291991 (base 10) to base 5 -312320431 Convert 2087585 (base 9) to base 5. 241332310 8084a4 (base 15) to base 12 2063a3a Convert -222221122100 (base 3) to base 12. -216b83 -11111011001000001011 (base 2) to base 3 -1221021000000 What is -3844391 (base 10) in base 6? -214222035 5411541 (base 6) to base 14 6cd93 Convert 419457 (base 10) to base 11. 267165 29113f (base 16) to base 5 1142111031 103344334 (base 5) to base 11 288083 68372 (base 13) to base 9 318002 Convert 124121030 (base 7) to base 15. a620db What is -2a59989 (base 11) in base 2? -10011111111010011000010 Convert 246480 (base 11) to base 9. 652821 Convert a84900 (base 12) to base 9. 5007130 17229 (base 16) to base 4 113020221 -92a831 (base 11) to base 2 -101101100100000111101 Convert 319945 (base 12) to base 13. 215bac Convert -22200122021111 (base 3) to base 6. -242553321 11033323320 (base 4) to base 7 14460432 What is 1172a4 (base 13) in base 10? 415705 -64113062 (base 7) to base 15 -7247c5 66591 (base 15) to base 5 40402021 Convert -2135244 (base 6) to base 15. -216c1 Convert 412024412 (base 5) to base 16. 198a04 Convert -2173496 (base 11) to base 12. -13396b6 What is 173c013 (base 15) in base 5? 13311224033 Convert -22120100102 (base 3) to base 6. -3340445 Convert -744296 (base 12) to base 2. -110111111010010010010 4144452 (base 6) to base 14 53184 What is -1001010110011011001000 (base 2) in base 4? -21112123020 Convert 212100000211100 (base 3) to base 6. 1121443313 What is 11214330 (base 5) in base 12? 4a6a7 Convert -61526 (base 10) to base 11. -42253 -10100202202 (base 3) to base 16 -1027a -1e234d (base 16) to base 11 -1129a31 What is -a3829a (base 13) in base 15? -505cd9 What is -765053 (base 11) in base 15? -1920b1 Convert -305946 (base 11) to base 3. -220221110020 What is -322763 (base 8) in base 11? -7417a What is -5ee7b1 (base 16) in base 13? -1399cc3 What is -2805365 (base 9) in base 4? -11313302111 Convert 10011011010010111011101 (base 2) to base 8. 23322735 -415ab (base 12) to base 3 -11100022112 241e55 (base 15) to base 8 6456557 What is 16a1755 (base 12) in base 3? 22211020021202 Convert 208568a (base 13) to base 11. 5648745 27200 (base 15) to base 3 20100220200 22012224 (base 7) to base 4 13030112103 What is 7a4f2 (base 16) in base 10? 500978 Convert 1463550 (base 7) to base 12. 98100 What is 159900 (base 10) in base 9? 263306 Convert -a5794a (base 13) to base 3. -21021202100020 Convert -3407470 (base 9) to base 6. -103204013 Convert 123444213 (base 5) to base 7. 5115260 What is -41124 (base 12) in base 16? -14b6c 9c1502 (base 13) to base 9 6840155 What is 343371 (base 8) in base 2? 11100011011111001 -519382 (base 12) to base 13 -35b09a -11022332120 (base 4) to base 11 -84659a Convert -104131322 (base 6) to base 15. -2717b2 13c235 (base 13) to base 5 110434342 What is 2917c4 (base 13) in base 14? 1c1835 Convert -12373624 (base 8) to base 11. -1609424 Convert 23c8b0 (base 14) to base 15. 1931d1 Convert -1244102 (base 5) to base 8. -60506 What is -11201010210 (base 3) in base 5? -10431220 Convert -420304001 (base 5) to base 2. -110100110000001110010 311a22 (base 15) to base 8 10717307 Convert -29714 (base 11) to base 10. -42123 Convert 1653216 (base 8) to base 15. 9775a What is 10310442 (base 5) in base 14? 24235 Convert 522292 (base 15) to base 12. 1384132 What is -1110220 (base 3) in base 14? -56d Convert -2377720 (base 10) to base 16. -2447f8 520262 (base 8) to base 9 282204 What is -1889254 (base 14) in base 10? -12164618 Convert -c30cc4 (base 14) to base 6. -352504204 What is -a11637 (base 11) in base 6? -54513320 -11010011110100110010101 (base 2) to base 3 -111001122100221 -2809a (base 14) to base 13 -36043 Convert 20223110131 (base 4) to base 8. 10532435 -103401 (base 10) to base 16 -193e9 What is -10205431 (base 6) in base 14? -7a1d1 b4d3 (base 15) to base 3 1221102200 What is 2208475 (base 12) in base 13? 1460477 Convert -439702 (base 12) to base 4. -10012032302 What is -10a0bd (base 15) in base 14? -169167 What is 13010321 (base 4) in base 8? 70471 What is 21012120222210 (base 3) in base 7? 44361435 What is 124342312 (base 5) in base 15? c428c Convert 6302c (base 15) to base 12. 1317b9 -2020220122212 (base 3) to base 14 -232d1c What is 4004212 (base 6) in base 7? 1410563 Convert 22380c (base 14) to base 10. 1162292 What is -3f12d (base 16) in base 10? -258349 -c1ca4 (base 14) to base 11 -299318 What is 231b7 (base 12) in base 5? 3000224 Convert -1298737 (base 10) to base 2. -100111101000100110001 145405023 (base 6) to base 8 13542007 What is 350a00 (base 16) in base 14? 666a76 -105854 (base 10) to base 7 -620420 20020102202012 (base 3) to base 5 1322042213 Convert 143585 (base 9) to base 14. 240b0 Convert -367668 (base 11) to base 13. -174673 What is 133330013 (base 4) in base 9? 218408 What is 26a77 (base 15) in base 2? 11110001111010110 Convert -1cceb1 (base 15) to base 2. -101011000011010000011 Convert -902c11 (base 13) to base 9. -6262621 What is -337008 (base 9) in base 11? -1287a3 5774656 (base 10) to base 9 11771304 Convert 100210102002010 (base 3) to base 4. 103312212210 Convert -238a36 (base 13) to base 5. -204110310 What is 657a07 (base 14) in base 15? 47e4b9 -4250f (base 16) to base 12 -11123b What is 11001110110110100 (base 2) in base 8? 316664 Convert -4525214 (base 8) to base 4. -10222222030 -4525501 (base 8) to base 4 -10222231001 -22b537 (base 14) to base 6 -41212021 -1006003 (base 7) to base 9 -202181 1365665 (base 10) to base 3 2120101100012 What is 11000330303 (base 4) in base 12? 53492b Convert -1076566 (base 8) to base 5. -33404022 Convert -3a6 (base 16) to base 12. -65a 335265 (base 14) to base 3 10021112211122 862184 (base 9) to base 12 209111 -1cc045 (base 13) to base 9 -1347627 Convert 165863 (base 9) to base 15. 206b0 -208c5c (base 15) to base 6 -53105053 Convert 245346 (base 8) to base 3. 11022012102 Convert -4522e (base 15) to base 11. -140211 381021 (base 9) to base 6 4534331 What is 1973072 (base 10) in base 8? 7415520 Convert 626220 (base 7) to base 3. 12110220010 What is -4535105 (base 8) in base 15? -1939c3 Convert 240535324 (base 6) to base 10. 4522948 Convert -2712751 (base 8) to base 12. -307489 What is 17a2e (base 16) in base 15? 1da44 -14653052 (base 7) to base 13 -3a3b89 Convert -220031032 (base 4) to base 9. -270814 What is 10a867 (base 11) in base 9? 286541 Convert -201324443 (base 5) to base 2. -11000101010010111011 -12012012021 (base 3) to base 16 -18f3a b38104 (base 16) to base 3 211010200010200 What is 529234 (base 10) in base 4? 2001031102 What is -210311011323 (base 4) in base 3? -200011111200200 What is -ba9476 (base 14) in base 6? -343330052 -38bbc (base 16) to base 11 -149655 Convert 253e25 (base 15) to base 3. 10100200210222 -7060288 (base 9) to base 14 -6dc219 Convert -dc2613 (base 15) to base 2. -101000000000011011000101 -c81da (base 14) to base 3 -220120000012 -e497b (base 15) to base 7 -6104633 What is 162011 (base 8) in base 15? 1246c Convert 7241a (base 13) to base 8. 620334 What is -e9576e (base 16) in base 6? -1303433314 Convert 1a1988b (base 13) to base 7. 133003251 What is -49601 (base 10) in base 15? -ea6b What is -1894b8 (base 15) in base 11? -747492 1001101001011101100 (base 2) to base 5 40104030 Convert -4876	{ "pile_set_name": "DM Mathematics" }
- 4g + g, -uk + 58 = 5g. Let d = k - -48. Is d a composite number? True Let f(b) = -42b + 1. Let n(d) = d*3 + 5d*2 - 4d + 7. Let o be n(-6). Is f(o) a composite number? False Let a(c) = -c*2 - 2c + 2. Let r be (-2)/(-1) - (-10)/(-2). Let j be a(r). Let z(g) = -15g. Is z(j) a composite number? True Let x(m) = 8m*2 + 3m - 7. Is x(-8) composite? True Let y = 0 - -3. Let b(a) = 14a + 12. Let l(i) = -15i - 11. Let v(s) = yl(s) + 2b(s). Is v(-8) a prime number? True Let o(s) = -10s + 7. Let x be o(10). Let j = 118 - x. Is j prime? True Let j(p) = -p + 13 + 0p + 3 - 3. Let h be j(9). Suppose 0 = 4s - hu - 1000, -5s + 3u + 1256 = 4u. Is s composite? False Let k(i) = -i3 - 4i*2 + 5i. Let m be k(-5). Suppose 3d - 37 + 13 = -3w, -2d = -w + 14. Suppose m = -4u + 3o + 53, u - 3u + w = 4o. Is u prime? True Let w(s) = -69s*3 + 2s*2 - 2s - 1. Is w(-2) a composite number? False Is 1/1(-4 + 383) a composite number? False Let l = 5242 - 1457. Is l a composite number? True Let c = -1 - -3. Suppose -cu + i = 6, -4i + 5 + 16 = -5u. Let t(f) = -34f3 + 2f*2 - 1. Is t(u) composite? True Let k(q) = 2q*3 - 3q*2 + 4q - 2. Let w be k(2). Suppose 0x = 5x - w. Suppose xh = -h + 57. Is h prime? True Let d(o) = 2o*2 + 0o*2 - 5o*3 - o + 6o*3. Let s be d(1). Is 31/s - 2/4 composite? True Suppose y - 5i = 326, i + 992 = 2y + y. Is y a composite number? False Let b(c) = c - 6. Let z be b(6). Suppose z = -5a - 0 + 20. Suppose -2g - 2g + 224 = an, 0 = 2n + 3g - 113. Is n a prime number? False Let q be 0 + 226 + 6/3. Suppose 3f - 4b = -0f + 166, 0 = 4f - 4b - q. Is f a prime number? False Is ((-15)/(-4) - 3) + (-22045)/(-20) composite? False Let h(f) = 52f + 1. Suppose -2o + 3o + 8 = 0. Let v = o - -9. Is h(v) a prime number? True Suppose 3a - a - 6 = 0. Suppose 3l = -l + ao + 8, -4l + 5o + 8 = 0. Is 3/1 + 256/l composite? False Suppose 2d + 1117 = w + 4d, 5w - 5580 = -5d. Is w composite? True Let t(w) = -w*3 - 5w*2 + 5w - 10. Let f be ((-3)/(-6))/(2/(-28)). Is t(f) a composite number? False Let q(z) = z + 4. Let k be q(0). Is (410/15)/(k/30) a composite number? True Let f = -407 + 100. Let h = f - -181. Let k = 181 + h. Is k composite? True Let u(t) = -t*2 + 12t - 10. Let x be u(11). Let i = x + 1. Is ((-10)/(-4))/(i/44) prime? False Is (-2)/(-5) - 8169/(-15) prime? False Let o be 1 - ((-4)/(-4) - -2). Is 238/4(-4)/o prime? False Let r = -445 - -752. Is r composite? False Suppose -5n + x = -1, 2n = -2n + x + 1. Suppose t - 6 + 3 = 0. Is 60 + 2 + t + n a prime number? False Suppose k = -k + 6. Suppose -o - 8 = ko. Let y(j) = -93j - 3. Is y(o) composite? True Suppose 20 = 5i, -i = -f + 1093 + 880. Is f composite? True Let n be -1 + 2/(1 - -1). Suppose -b = -nb + 4u - 115, 256 = 2b - 5u. Is (-2 + -1)/((-3)/b) composite? True Let k be (-3)/(1/(-4 - -1)). Suppose 3i - n + 4n = 798, 0 = 3n - k. Is i a prime number? True Let s = -175 + 298. Is s a composite number? True Let f be ((-8)/3)/((-3)/63). Suppose 138 = 2y - f. Is y prime? True Let m = 12 - 27. Let b = -10 - m. Suppose 0 = ba - 235 - 190. Is a a composite number? True Let q be ((-8)/(-4))/((-2)/(-5)). Suppose -316 = -9t + qt. Is t a prime number? True Is 4/(-14) - 970/(-14) prime? False Let t(q) = q + 6. Let w be t(0). Let z be -18/w3. Let h = z + 10. Is h a prime number? False Let o(p) = p*3 - 6p*2 - 5p - 9. Let t be o(7). Suppose 2d - 523 = -tn, d + 2n + 257 = 2d. Is d prime? False Let n(x) = 4x2 - x - 1. Let v be n(-3). Let o = -38 - -65. Let m = v - o. Is m a composite number? False Let a = -230 + 409. Is a prime? True Let l = -3 + 7. Suppose 3r - 5u = 7r + 4, -2r = 4u - l. Is 65/(-2)(r - -4) a composite number? True Let c = 2 + 1. Suppose -ch - 5 + 23 = 0. Let t(w) = w*3 - 5w*2 - 5w + 7. Is t(h) composite? False Suppose 75g = 70g + 1465. Is g a prime number? True Let b = 140 + -46. Is b a prime number? False Suppose 2i + 9 = -i. Is 6/((-1)/i2) composite? True Let n(m) = 6m2 - 3m*2 + 69m*3 - 4m*2 + 1. Let j be n(1). Let f = j - 30. Is f a prime number? False Let k(o) = -4o - 5. Let u be k(-6). Suppose -y - u = -l + 29, -102 = -2l - 4y. Is l composite? True Let a be -3 - 0 - 9/(-6)6. Let t be (2/4)/((-2)/4). Is 2/(a/(-39)t) a prime number? True Suppose -4m + m - 1242 = 0. Let c = -223 - m. Is c composite? False Suppose z + 1 - 3 = 0. Let l(g) = -4 + 2g - g*z + 226g*3 + 3 - 63g3 + 0. Is l(1) a prime number? True Let y(z) = z2 - 3z - 9. Let a(w) = w2 - 3w - 9. Let h(p) = 5a(p) - 6y(p). Let l be h(7). Let m = l + 56. Is m a prime number? True Let c(f) = f*2 - 2f - 5. Suppose 2x + 3x = 20. Let g be c(x). Suppose m - 4m + 138 = -gj, 0 = -2m + 3j + 95. Is m prime? True Suppose -14f + 15f = 4. Suppose -3u = -fv - 1241, -4v - 1009 = -4u + 647. Is u a composite number? True Is -555(-4 + (-68)/(-12) - 2) a composite number? True Let q = 3774 - 181. Is q a prime number? True Suppose 0m - 4033 = -4m - 3j, 0 = -m - 4j + 1005. Is m a composite number? False Let h be (-5)/(-2) - 1/2. Let g = h + 1. Suppose -g = 3v, 2v - 184 = -5p + v. Is p a composite number? False Suppose -5u + 620 = 5p, -u = -20p + 25p - 128. Is u a composite number? True Let t = -39 - -97. Is t composite? True Let a = -27 + 11. Let f be 4/(-18) + 418/18. Let p = a + f. Is p composite? False Let j = 1168 + -725. Is j prime? True Suppose -3n = -o + 322 + 893, -2o + 4n + 2432 = 0. Suppose -o = -4s + 10. Is s prime? True Let u be -3(-1)/(-3)-5. Suppose 2n - n - 4 = 2y, y = -un + 20. Is 51/n + (-4)/(-16) composite? False Let s(p) = 1309p - 6. Is s(1) prime? True Let o = 152 - 59. Let y = o + -58. Is y prime? False Let s(f) = -1 + 0f + 4f + f - f. Is s(5) composite? False Suppose 9i - 20i = -32417. Is i composite? True Let o(l) be the first derivative of 4l3/3 - 7l*2 + 11l - 7. Is o(9) a composite number? True Suppose -k + 5c + 198 = 0, 3c = 4k - 0k - 843. Let m = 23 + k. Suppose m = 4f - 4i, 0 = -f - 5i + 25 + 10. Is f prime? False Suppose 3l + 2l = 235. Suppose 0 = -n + 6 + l. Is n a composite number? False Is -2(-3729)/6 + (-16)/(-4) composite? True Let g(w) = -w*2 - w + 65. Let z be g(0). Let n = -34 + z. Is n a prime number? True Let l = 798 + -561. Is l a prime number? False Let g = 3033 - 2078. Is g a prime number? False Suppose 3p = 5m - 31151, m - 2p - 4497 - 1736 = 0. Is m composite? False Is (-1 - 2) + 2 + 204 a prime number? False Let g(q) = -q*3 - 6q*2 + 3q + 6. Suppose 0 = -3k - 12 - 9. Let z be g(k). Suppose z = p + 3. Is p a prime number? True Suppose -4s = 3l - 2, -3s - 2l = s - 4. Let k(z) = -z3 + 4z*s - 12z*2 - 9z + 2 + 3z + 1. Is k(-8) prime? False Let z = 0 - -5. Suppose -5l + 4l = 3. Is -11zl/3 prime? False Let x(w) = w2 + 11w - 3. Let v be x(-9). Is 7/v + 200/6 prime? False Let i be (-38)/(-14) - 8/(-28). Suppose -5o = -iv - 150, -5o - 4v + 92 = -58. Suppose -25 = -b + o. Is b a composite number? True Let j be (40/16)/((-2)/(-4)). Let v(q) = 13q2 + 2q - 6. Is v(j) composite? True Let u = 101 - 57. Let d = u + -66. Let l = 41 + d. Is l a composite number? False Suppose -2l - 18 = 4z - 6, l + z = -6. Let u be ((-6)/2 - -2)/(-1). Is 36 + l/(u - 3) a prime number? False Suppose 2m + 2m = 20, -3i + 4m + 4 = 0. Let n be (-1)/(-1) + 16 - 1. Is 396/n + 2/i prime? False Let f(i) = i*2 + 7i - 1. Let s be f(-7). Let a(g) = -35g + 2. Is a(s) composite? False Suppose -4g + 2178 = f, -g - 1641 = -4g + 3f. Is g prime? False Let j = 0 - -5. Suppose 0l - jl = 40. Is 262/3(-12)/l composite? False Suppose -4a = 2b - 2a + 6, -2a = 4. Is (47 + b)/(20/170) a prime number? False Let p(o) = o3 - 7o*2 + 6o + 3. Let z(x) = 2x + 2. Let g be z(2). Let l be p(g). Suppose h - lf = 38, 2f - 7f = -3h + 94. Is h prime? True Is 62/(((-4)/5)/(-2)) prime? False Let w = 149 - 70. Is w a composite number? False Let v(f) be the second derivative of f5/20 - f4/6 - f3/2 - 7f2/2 - f. Let s(n) = -n2 - 5n - 1. Let j be s(-3). Is v(j) a composite number? False Let k(x) = x3 + 4x*2 - 5x + 3. Let b be k(-5). Suppose -4i = -i - bp - 192, 0 = -5i + 2p + 329. Is i composite? False Suppose	{ "pile_set_name": "DM Mathematics" }
ing b is positive. b*(-1532/3267) Simplify ((jj/(jj(-1/2)))(-11)/((j/j(2/5))/j)(-46))/(j(j/(j/j*(-6)))/jj*3(j0/j)20) assuming j is positive. j*(-119/10) Simplify (bbb(-3)bb(-9/2)b*25b34)16 assuming b is positive. b*872 Simplify (((cc3/c)(-18/13))35)(-4/21) assuming c is positive. c(360/13) Simplify (((f/(f/f(-9)))/f)/(f*(-10)ff))(-5)(f/(f*2/f)ff/f(1/12))/((ff(-2/7))/f7) assuming f is positive. f(1529/84) Simplify (q27)*(-28)((q*20/qq)/q)/(qq/(q(qq/(q/q(19/4)))/q)) assuming q is positive. q(-2933/4) Simplify (((c(-2/9)c)/c)*28/((cc*(-24)/ccccc)/cc*(6/11)c))(-11/4) assuming c is positive. c(-655/18) Simplify ((g/(gg(-3/25)))/(((gg*3g)/g)/g))/(g*(-16)g23/g) assuming g is positive. g(-222/25) Simplify ((zz(2/23)z/(z/z*(-2/5))z)/(z(-1/4))(2/7))/(z(-3/4)/(z/z(-3/11))(z(2/7))36) assuming z is positive. z(-230393/35420) Simplify ((qq/(q/q8))/(((q(2/7)q)/q)/q)q*(-5/8)qq/q5q)(1/6) assuming q is positive. q(397/336) Simplify (((u/(u/(u/u*(1/3))u))/u)(2/37))22(u(-1/15)/((uu/(u/u(-2/7)))/u))(30/7) assuming u is positive. u(-3518/5439) Simplify (x/(x/x(-4)))/(((xx(-4/5))/x)/x)x/x*(2/7)x*(-5)/x((((xx(-1/2))/x)/x)(-6/5))(-9/8) assuming x is positive. x(-2663/280) Simplify (b6/b(-2))(14/3)/((b(-3)bb5)/(b(bb0/b)/bb)(1/6)) assuming b is positive. b(69/2) Simplify ((f21)(-1/54)/(f*(-14)f(-22)/f))(-20) assuming f is positive. f*(-6590/9) Simplify xx*(-4)x*1(x(-1)/x)(-1/5)(x/x(-2/5))16/(x(-2/7)x)(-43) assuming x is positive. x(1803/35) Simplify (w*(-2)www(-6)/w)(5/2)/((w0)2/((w/((ww(-2))/w))/w)(-40)) assuming w is positive. w(-195/2) Simplify (x3x/x6)3/(((x*(5/4)x)/x)/(xx/x(1/7)x))(-5/11) assuming x is positive. x(-2073/308) Simplify (ppp/(p/(p/p(-1/7))))/(p(-5)/p)(p/p(-2)p)/(p/((p/p*(-1/5))/ppp))(p(-1/6)/p(-5))/(p*(-8)/pp(2/19)) assuming p is positive. p(112003/3990) Simplify www*6w((((w(-1/5)/w)/w)/w)/ww)/w(w(-2/7))(-28)(ww(-2/3)www(-4))(-11) assuming w is positive. w(467/15) Simplify w3/((ww(-1)w)/w)w(w*(-3/4)w)/ww8(w*2w)*(-4)(w(-2))40 assuming w is positive. w(-323/4) Simplify (((g(-7/6)/(g/g15))(1/4))(2/163))(-39) assuming g is positive. g(-1001/652) Simplify (a/(a(2/11)/aaa)a(-3))15((a/a(-1/4))(-1/52))(-2/17) assuming a is positive. a(-928145/19448) Simplify (y*(5/2)yy((y*(22/9)/y)/yy)/y)/(y*26yy)11 assuming y is positive. y(-5455/18) Simplify ((d/d1d*(1/8))/(dd*(-4/3)dd3))/(d/(d/d(1/2))d(3/2))31 assuming d is positive. d(-1573/24) Simplify (((((x8x)/xx)/((x14/x)/x))/(x3x(1/6)x))(-17/6))48 assuming x is positive. x(2924/3) Simplify (g(-1)g)/gg*(-5/3)(g/g(2/5))34g(1/3)gg(2/17)/gg*(1/2)/(gg/g*(-3)gg) assuming g is positive. g(5959/510) Simplify ((s0s)/(s*(2/11)s))(-43)/((s4/(ss(-3)s))/(ss(3/7)ss/s(3/2))) assuming s is positive. s(731/154) Simplify ((j(-12)/(jj/(j/j*11jj)))/((j(3/16)/j)/j(-5)))(-4/9) assuming j is positive. j(419/36) Simplify (w(-3)/(w/(www(1/4)w)ww))(1/6)/(((w1w)/(w/w(-3)))/((www/w(-1/3))/ww/((w*(-1)w)/w))) assuming w is positive. w*(47/8) Simplify ((j/(j/(((j/(((jj*20)/jj)/jjj))/j)/j)))*(-28)(j/((jj(-7)jjj)/j))/jjj/j(-12/7))(-1/10) assuming j is positive. j*(-2281/35) Simplify (((nn*(2/17))/nn)/n(1/3))/(n/n(-2)n/(n/(n(2/9)/n))nn)(n(4/3)/(n/n(-1/2)))/(n*(-2)n/(n*4n)) assuming n is positive. n*(733/306) Simplify ((((j(j/(jj/(jj(j/((j/((jj/(j((j((jj(-4/11))/j)/j)/j)/j)j)/j))/j))/j)))/jj)/(jj(-6)/j))47)(7/3))(-40) assuming j is positive. j(-1645000/33) Simplify (h/(h(2/29)h)hh(hh(-3/10))/h)/(h(-2/27)/h(2/21)) assuming h is positive. h(98677/54810) Simplify (kk/k*(2/15)k(2/3))(-20)(kk*(1/12)kk(1/5)kk)50 assuming k is positive. k(327/2) Simplify ((nn/((n/n(-17))/n))(-5/3)/(n(n(3/26)n)/nn(6/11)/n))(41/3) assuming n is positive. n(285401/858) Simplify ((aaa(-4/9)a)/aaa/(a(aa/((a*(1/5)a)/a))/a)a11/(aa(-6)))29 assuming a is positive. a(23171/45) Simplify (y(1/4)/(yy((y/y(-3))/y)/y))/((y(-2)/y)/yyyy(1/5))((yy/(yy*(2/17)/y)y)/y(3/2))(1/4) assuming y is positive. y(-1091/680) Simplify (z0z)/(z0z)z(-7)z*4z((zz(-1/5))/(z4/z))3 assuming z is positive. z(-43/5) Simplify ((y*(-1/3)yy(4/5))/((y/(y/(y/(yy*5)y)))/y2))/((y(2/5)y)(-1/31))(-1/11) assuming y is positive. y(38171/5115) Simplify (z2/z(-2/3))(-26)/(zz/((zz3)/z)(z*(4/9)z)/z((zz(-2/7))/z)/(z/z6)) assuming z is positive. z(-4630/63) Simplify (u(-6/11)/(uu1)u8/u(-2))/((u(2/15)/(u(5/4)u))/(u8/u(-4))) assuming u is positive. u(14237/660) Simplify ((((x/x1)/(x/(x/x(-3/2))x))/((x*(-1)/x)/(xx(x/x(4/7))/x)))(-42))1 assuming x is positive. x(-165) Simplify ((w(-7)ww(-1/7))/(www(3/2))(1/37))(23/4) assuming w is positive. w(-74313/2072) Simplify (oo/(oo/(o/o11))o(-1/2))(12/7)o6(o/((oo9/o)/o))/o(oo(2/11))12 assuming o is positive. o(-64/11) Simplify ((w(-8)/w6)/((w1w)/w)(-4/15))/((((w/(w(6/5)w))/w)/w(-3))/(w/(ww(-2/3)))(-44)) assuming w is positive. w*(-658/15) Simplify (((qq*9/qq)/q(8/9))/(q(-3/5)q)(-11))(-2/13) assuming q is positive. q(-1216/585) Simplify (g(5/7))16/(g/(g(-2)/g)g*(6/5)g) assuming g is positive. g(183/35) Simplify ((a(-35)a)/a(-30)aaa*(-7/3)a/a*(-4/5)aa)(-1/15) assuming a is positive. a(8/225) Simplify (((((c/(cc/c(-20)))/c)/c15)21)(-40))39 assuming c is positive. c1212120 Simplify (((c/(c/(cc/c(-4))))/(c/(c(-2/17)/c)c)(c(1/6)cc)(-7/9))(1/22))(-1) assuming c is positive. c(-1099/20196) Simplify ((xx*(-2/3))/(xx*(-2/3)x))/((x/x(-4))/x(-1/10))(xx*0xx(-1/2)x)38 assuming x is positive. x(889/10) Simplify (ccc*(1/4)c)*(-1/9)c(4/9)/c(2/11)(c(-1/6)/(cc/c*(1/2)))/((cc(-2/19)/c)/c(2/9)) assuming c is positive. c(-10817/7524) Simplify (j/j39)/(j/j*(-1))(j/(j*(-18)j))/j(23/4) assuming j is positive. j(-111/4) Simplify ((c*22c)/(c*8c)(cc*19/cc)(2/3))(1/12) assuming c is positive. c(41/18) Simplify ((u/(u(-5/2)u)u10)/(u8/u)43)(-25/3) assuming u is positive. u(14425/6) Simplify (t(4/9)ttt16t(t(4/9))(-23))(7/6) assuming t is positive. t(581/54) Simplify (w(1/2)/(w/(w(ww(-2/3))/w)))/(w1/w)(-15/8)w/w*(-1/3)w*4w(w(-1))33 assuming w is positive. w(-161/6) Simplify (bbb(-4)b*(-6/7)b)*(-3/41)((bb3)/b(3/8))/(b(-1/2))35 assuming b is positive. b(48815/2296) Simplify (((o/(oo*16))/(oo/(oo/o(2/5))))/(o(8/9)/o(-18)))(-1/11) assuming o is positive. o(1588/495) Simplify ((l(-36)/l(-4/17))/((l(-2/7)/l)/l)(-11/4))(-2/9) assuming l is positive. l(1112/119) Simplify ((l(-2/15)/((ll*(1/3))/l)(lll/(((l*(-2)l)/l)/l)l)/((l/((l/l(-1/7))/l))/l))(-42))(-4/5) assuming l is positive. l(5608/25) Simplify ((h/(hh*(2/5))hh)(7/11)h*(-2/5)h0)/((h(1/4))9/((h6/h)/h(-2/3))) assuming h is positive. h(2663/660) Simplify (i/(i/(ii6ii))ii(3/2)i*(-1/10)i(2/3))/(i(-8)/(i*6i)i3/i(-7/3)) assuming i is positive. i(326/15) Simplify (p(-10)/(p/(pp(-4))))24/((pp(-1/3)p)(-17))(-47) assuming p is positive. p*(-5003/3) Simplify (mm*(-3/7)m/(m/m13))/(m(-31)/mm(-37)) assuming m is positive. m(578/7) Simplify ((v(1/9))39v(-10)/(v/v6))(36/11) assuming v is positive. v(-24/11) Simplify (((b/b*6b3)(-1/3))(-27))3 assuming b is positive. b*(-54) Simplify (w/(ww/w(-10)))49/(((w*(2/77)w)/ww)/w)(-44) assuming w is positive. w(-3765/7) Simplify (((j(1/3)/jj)/j)40/(((((j/j(1/7))/j)/j)/j)/j(-1/2)))/((j/j0)(-27))44 assuming j is positive. j*(48845/42) Simplify (ppp/p*(12/13))/p	{ "pile_set_name": "DM Mathematics" }
sqrt(130))-4 + sqrt(130))/sqrt(10) + (-1 + sqrt(117) - (sqrt(13) + 1 + 2 + sqrt(13))). -6sqrt(13) - 4 Simplify (sqrt(78) - 1-1sqrt(78))/(sqrt(6) - sqrt(378)/sqrt(7)). -sqrt(13) Simplify ((sqrt(252) - (1 + sqrt(252) + -1))4 + -2)2. 4 Simplify (5(sqrt(1800)-2 + sqrt(18)))/(sqrt(324) + sqrt(324) + 1(2sqrt(324) - sqrt(324) - sqrt(324))) + -2. -95sqrt(2)/12 - 2 Simplify 1(sqrt(931) + (sqrt(931) + -3)2 + sqrt(931) + (1(sqrt(19) + (-2 + sqrt(19) - sqrt(19))) - sqrt(19) - 6(0 + sqrt(19))))*2. -352sqrt(19) + 9260 Simplify -4((-3(sqrt(891) + -1) + 5 + sqrt(891) + sqrt(891) + 1sqrt(891) + sqrt(891))2 + (sqrt(891) - (1 + (1 + sqrt(891) - sqrt(891) - sqrt(891))2))5). -1116sqrt(11) + 14040 Simplify (sqrt(4235) + sqrt(4235)-1)/((sqrt(60) - (sqrt(1500) + sqrt(60)) - sqrt(60))/sqrt(12)) + 1. 1 Simplify 5(sqrt(3)-2 + 2 + ((sqrt(12)/sqrt(4) - sqrt(3)) + sqrt(3))-6)5. -200sqrt(3) + 50 Simplify -6((1sqrt(99) + -2)2 + -4(sqrt(11) - (-2(sqrt(44) - sqrt(11) - sqrt(11)))2)). -618 + 96sqrt(11) Simplify (((sqrt(17)-4 + -1)-6 + (-2 + sqrt(17) + -3)5)-5)*2. -27550sqrt(17) + 366450 Simplify 0 + ((sqrt(45) - -2sqrt(2880))/(sqrt(63)/(sqrt(7)-2 - sqrt(7)) - sqrt(9)) + -5)*2. 255sqrt(5)/2 + 13405/16 Simplify (((sqrt(130) - (sqrt(130) + sqrt(130)-1 + sqrt(130)))1 - sqrt(130))-4)/((sqrt(250)2 + sqrt(250) + sqrt(250) - sqrt(250))2). 2sqrt(13)/15 Simplify 3(-4 + sqrt(720) + 2 - sqrt(720)) + 5 + 1. 0 Simplify (-2sqrt(104)-4 - ((2sqrt(104) - sqrt(104) - sqrt(104))2 + sqrt(104)))/(2sqrt(8)1 + sqrt(8) - (sqrt(800) - -2sqrt(800))). -7sqrt(13)/27 Simplify 6(sqrt(150)/(sqrt(30)/sqrt(3)))/(sqrt(3) - -3sqrt(3)4 - sqrt(3)). sqrt(5)/2 Simplify 6(-3 + 6(5sqrt(91)1)/sqrt(7)). -18 + 180sqrt(13) Simplify (0 + sqrt(171))-2 - (sqrt(133)/(-2((sqrt(112) - sqrt(7)) + sqrt(7))))2. -6sqrt(19) - 19/64 Simplify (sqrt(24) - (sqrt(24) + -4sqrt(864) + sqrt(864)))/(-5sqrt(48)). -9sqrt(2)/5 Simplify -3 + (1sqrt(7) + -1 - (2 + sqrt(567))). -8sqrt(7) - 6 Simplify (-5-2sqrt(119))/(sqrt(175)2). sqrt(17) Simplify -2(0 + sqrt(1872)) - (sqrt(1872) + 0)2-5. -24sqrt(13) + 9360 Simplify (-4((sqrt(242) + -1)3 - sqrt(242)) - -26(sqrt(242) - (sqrt(242) + -1)))2. -4224sqrt(2) + 16064 Simplify (sqrt(152)/((-3sqrt(96) + sqrt(96))/sqrt(12)))2 - ((1sqrt(38))/sqrt(2) - (sqrt(475) - (sqrt(475) - sqrt(475)-2)2)). -17081/4 + 4sqrt(19) Simplify (3 + sqrt(684)2 + sqrt(684) + sqrt(684) - (0 + 0 + sqrt(76))2)6. -438 + 144sqrt(19) Simplify (sqrt(20) + 2 + -2 + sqrt(25)/(6sqrt(15)/sqrt(3) + sqrt(5)))2. 1125/49 Simplify (sqrt(405) + 1 + 1 + sqrt(405) + sqrt(405) + (sqrt(405) + 2 - sqrt(405)) + -4)2. 3645 Simplify (-3(-4 + sqrt(425)) - (-3 + (2 + sqrt(425) - sqrt(425)) - sqrt(425)))2. -260sqrt(17) + 1869 Simplify ((5 + 4 + (sqrt(11)-1 + -2 - (sqrt(11) + sqrt(33)/sqrt(3))2)-5)4)*2. 15200sqrt(11) + 115776 Simplify (-1(0 + -1 + sqrt(275) + (sqrt(275) + (sqrt(275) + 2 - sqrt(275)))-1))*2. 9 Simplify ((sqrt(720) + 1 + sqrt(720) + 1 - (sqrt(720) + 0 + -5 - sqrt(720)))-3)*2. 3024sqrt(5) + 26361 Simplify (((sqrt(147)2 - sqrt(147)) + 1 - sqrt(147))-4-4)2. 256 Simplify (sqrt(18) + -3 + sqrt(162)/sqrt(9) + sqrt(18) - (-1 + sqrt(648))) + 0. -9sqrt(2) - 2 Simplify (sqrt(294)/sqrt(7))/sqrt(6) + -3 + (sqrt(7) - ((sqrt(7) - sqrt(28)/sqrt(4)) + -2 + sqrt(7)) - (sqrt(112) - sqrt(7))*2-5). sqrt(7) + 314 Simplify (6sqrt(720)1 + sqrt(15)/(sqrt(9)/sqrt(3)) + sqrt(5) + -1 + -4)*2. -740sqrt(5) + 27405 Simplify ((sqrt(1088) - (2 + -4sqrt(1088) - sqrt(1088))) + -1 + (sqrt(1088)-2 + sqrt(1088) + 1 - (-2 + -1 + sqrt(1088) + sqrt(1088))))*2. 48sqrt(17) + 9793 Simplify (3(2sqrt(125) + -4) + -3 + 2)*2. -780sqrt(5) + 4669 Simplify (4 + (-1 + 2sqrt(500) + 1)2)1. 2004 Simplify (-2sqrt(5) + -4)6 - sqrt(55)/((sqrt(44)1)/sqrt(4)). -13sqrt(5) - 24 Simplify (-2 + (((sqrt(3)-3 - sqrt(3)) + -4)2 - (sqrt(192) + 4)2))4. -584 - 128sqrt(3) Simplify (-61sqrt(133) + sqrt(133) - (sqrt(133) - sqrt(133)1)2)/((sqrt(1008) + sqrt(1008)1)-2). 5sqrt(19)/48 Simplify (sqrt(2) - (sqrt(50)/sqrt(5))/sqrt(5))*2 + (sqrt(98)3)*2 + (-6((sqrt(216) - sqrt(216)2) + sqrt(216)))/sqrt(12). 882 Simplify (sqrt(104) + (sqrt(104) - sqrt(104)22) + sqrt(104) - 1sqrt(104)-3)/(-3-3sqrt(72)). 2sqrt(13)/27 Simplify ((4 + (sqrt(847) + 1 - sqrt(847)))3 + 2 + 2)2. 361 Simplify ((sqrt(704) + 1)3)*2 - 6sqrt(11)16. 108sqrt(11) + 6345 Simplify (3(sqrt(170) + (sqrt(170) - sqrt(170)3))-4)/(1-1sqrt(490)). -12sqrt(17)/7 Simplify ((1 + -1 + -61sqrt(425) + -2)6)*2. 4320sqrt(17) + 550944 Simplify -5 + 5(5(sqrt(99) + -3sqrt(99)) + sqrt(99))/(-1sqrt(1089)). -5 + 45sqrt(11)/11 Simplify 4 + ((1 + 4-1(-3sqrt(1331) + sqrt(1331)))-2)2. 704sqrt(11) + 340744 Simplify (6(-1 + (sqrt(2057) - sqrt(2057)-2)-3) + -1)2. 8316sqrt(17) + 5998261 Simplify (sqrt(110)1-4 + sqrt(110) + 2(sqrt(110) + -2sqrt(110) + sqrt(110) + sqrt(110)))/(-3sqrt(60)/sqrt(6)-6). -sqrt(11)/18 Simplify -4 + (-4sqrt(64)-2)/(sqrt(648)-16). -4 - 8sqrt(2)/27 Simplify 5 + (sqrt(75) + -3 + 1sqrt(75) - ((sqrt(75) - (sqrt(75) + 0 + -2)) + sqrt(75)))*2 + 4. -50sqrt(3) + 109 Simplify (((sqrt(833) - (sqrt(833) + 3))5 - -3(sqrt(833) + 2)) + 0)*2. -378sqrt(17) + 7578 Simplify (5 + -3(sqrt(76) + 1) + sqrt(76))2 + (-3 + 2sqrt(19) + sqrt(19) - (-2 + sqrt(76)/sqrt(4)))*2-5. -77 + 4sqrt(19) Simplify ((sqrt(343) - (sqrt(343) + sqrt(343)1)-2) + 3 + sqrt(343) + -3)2. 12348 Simplify 0 + (-5(2 + sqrt(1300)))*2 + 1. 1000sqrt(13) + 32601 Simplify (-4(-1 + -1 + sqrt(833) - sqrt(833) - (sqrt(833) + sqrt(833) + 0)-4)3)2. -32256sqrt(17) + 7677504 Simplify (-4 + (-2sqrt(48) - sqrt(48)) + -3 + sqrt(384)/(sqrt(896)/sqrt(7)))2. 154sqrt(3) + 412 Simplify -2 + (2sqrt(490)/sqrt(10))/(sqrt(448) + sqrt(448)-3 + sqrt(448) + sqrt(448) + sqrt(448) + sqrt(7)). -2 + 2sqrt(7)/9 Simplify (sqrt(104) + 1-2sqrt(104) - sqrt(104)26)/(-4(sqrt(1152) - (sqrt(1152)2 + sqrt(1152) + sqrt(1152) - sqrt(1152)))). -13sqrt(13)/96 Simplify (sqrt(1584) + 1)2 + -5 + -3sqrt(1100). -6sqrt(11) - 3 Simplify (sqrt(14) + (sqrt(350) + (sqrt(350) - 2sqrt(350) - sqrt(350)) - sqrt(350)) + sqrt(2016)2)/(-6-1sqrt(448) + sqrt(448)) + 3. 15sqrt(2)/56 + 3 Simplify ((2 + sqrt(2057))1 - (-4 + -1 + sqrt(2057)))2. 49 Simplify 3(-1 + sqrt(432) + -1 - ((sqrt(363) - (1 + sqrt(363))) + sqrt(363))-3)2. -1350sqrt(3) + 18300 Simplify -5 + ((-61sqrt(300))2 - ((-4 + sqrt(300) + -1)2 - sqrt(300) - sqrt(300))). 120sqrt(3) + 10470 Simplify sqrt(684) + -2 + (sqrt(684)-2)2 - ((sqrt(1539) + 2)2 + 0). -30sqrt(19) + 1191 Simplify ((1sqrt(304) - sqrt(304)) + 3 - sqrt(304) - ((sqrt(304) - (sqrt(304) + -1)) + 4))*2 + 3. 16sqrt(19) + 311 Simplify 5(5 + (-6-6(sqrt(1377) + 1))2). 116640sqrt(17) + 8929465 Simplify 5(sqrt(125) + (-1 + sqrt(125) - sqrt(125))-6 - (sqrt(125) + 2(sqrt(125) + -3)))2. -1200sqrt(5) + 3220 Simplify (-4(-2 + -3((sqrt(25)/(sqrt(15)/sqrt(3)) - sqrt(5)) + (sqrt(605) - sqrt(605)-1 - sqrt(605)))))2. 2112sqrt(5) + 87184 Simplify 0 + (((62sqrt(104) + sqrt(104) - sqrt(104))2)/((sqrt(288) - (sqrt(288) - sqrt(288)13 - sqrt(288))) + sqrt(288)))2. 208/25 Simplify 6((sqrt(605) - (-5 + 0 + sqrt(605)) - (-2 + sqrt(605) + 1))*2 - (1 + sqrt(605)2 + (sqrt(605) + 1)6)2). -228768 - 8184sqrt(5) Simplify ((sqrt(288) - (4 + -1sqrt(288))) + sqrt(288) + sqrt(288) - -4sqrt(288)1 - 6(-1 + (sqrt(288) - (1 + sqrt(288)))))*2. 1536sqrt(2) + 18496 Simplify -3(-5((-6(sqrt(5)1 + sqrt(5)) + sqrt(5))*2 - (sqrt(15)/sqrt(3) + 2)) + -4). -15sqrt(5) + 9057 Simplify 0 + (sqrt(396) - 4sqrt(396))2 + (sqrt(44) + -2)2. -8sqrt(11) + 3612 Simplify (sqrt(198)/sqrt(144)4)/(sqrt(176) + (sqrt(176) - (sqrt(176) + sqrt(176)2-4)) - sqrt(176)). sqrt(2)/32 Simplify (sqrt(2299) + -2sqrt(2299))*236 - (sqrt(380)/((sqrt(10) - sqrt(10)-2) + sqrt(10)))/(sqrt(16)/(1sqrt(8))). -sqrt(19)/4 + 41382 Simplify -3(1 + (-2(sqrt(55)/(sqrt(25)/sqrt(5)) + sqrt(55)/sqrt(5) + 3 + sqrt(11)))2). -1299 - 216sqrt(11) Simplify -1(sqrt(1584) - (sqrt(1584) - (sqrt(1584) + -2 - sqrt(1584))))21 + 3. -1 Simplify (sqrt(13) - sqrt(52)) + 2 + (sqrt(156)/sqrt(3))**2	{ "pile_set_name": "DM Mathematics" }
l - 1911 - 5801 - 118 = 98l for l. 87 Solve -1281o - 488o = 1239o - 670o - 156646 for o. 67 Solve -45j + 107j = 60j + 59j + 3876 for j. -68 Solve -969x - 13328 = -1933x + 1160x for x. -68 Solve 785f + 1058 = 739f for f. -23 Solve -411 = -9769f + 9806f + 255 for f. -18 Solve 764h - 489 = 666h - 3233 for h. -28 Solve 5225079u - 5225037u + 1386 = 0 for u. -33 Solve 1839 = -105u - 926 - 1120 for u. -37 Solve -3169r - 27400 = -85414 - 52901 for r. 35 Solve 1283g + 53864 + 2604 = 2474 - 31967 for g. -67 Solve 367v + 254332 = 798v - 4227v for v. -67 Solve -2066l = 2062l - 4132l - 88 for l. -22 Solve -31491 = 1534c + 6859 for c. -25 Solve 105r + 8r + 1695 - 1388 + 2066 = 0 for r. -21 Solve -366393 + 364281 = -48z for z. 44 Solve 1320y - 132756 = -111636 for y. 16 Solve 1073r + 140585 = 142r - 3604r for r. -31 Solve 2792j - 96084 = -2860j for j. 17 Solve 0 = 26259g - 26238g + 1239 for g. -59 Solve 67013w = 67526w + 17442 for w. -34 Solve 36026v - 18194v - 18031v - 12452 + 33148 = 0 for v. 104 Solve -3429q = -1036q - 45467 for q. 19 Solve 0 = 60685p - 54606p - 133738 for p. 22 Solve 244d - 118 = -235d + 361d for d. 1 Solve 17990 - 26309 = -1143y + 28257 for y. 32 Solve -626d - 232487 = -12814d + 1022877 for d. 103 Solve -514t - 802t + 150740 = 395t + 398835 for t. -145 Solve 3y + 11637 + 6094 = -258y - 2627 for y. -78 Solve 4391l + 1661l + 126664 = -121468 for l. -41 Solve 0 = -255v - 292438 + 284278 for v. -32 Solve -275851s = -275836s + 765 for s. -51 Solve 0 = 1140m - 86735 + 114095 for m. -24 Solve -124f - 16786 = 166f - 72f for f. -77 Solve -11939r = -11417r - 18270 for r. 35 Solve 8944 = -14994h + 14822h for h. -52 Solve 878b = -397b - 10229 - 12721 for b. -18 Solve -589l - 7586 + 7599 + 31204 = 0 for l. 53 Solve -941w + 820w = 3507 + 365 for w. -32 Solve 0 = 1888486q - 1887700q - 54234 for q. 69 Solve -114210 + 10470 = 3705k for k. -28 Solve -103t = 805649 - 800911 for t. -46 Solve -333g - 900 = 624 + 6468 for g. -24 Solve -246r + 3669 + 639 = 1602 for r. 11 Solve -4219y + 30599 - 132339 = 164057 for y. -63 Solve -24883 = 607q - 5296 + 19261 for q. -64 Solve -198n - 1560 = 664n - 21386 for n. 23 Solve 15m + 32 - 27 = -79m + 99 for m. 1 Solve 199x + 288x = -1907x + 4788 for x. 2 Solve -48b - 10893294 + 10895310 = 0 for b. 42 Solve -164o - 967o + 187o = 1365o + 191647 for o. -83 Solve -486h + 9270 + 7433 = -2737 for h. 40 Solve -963879 = 113n - 955630 for n. -73 Solve 4514w + 724w = 15714 for w. 3 Solve -1522i + 2033 = -1629i - 3103 for i. -48 Solve 9943 = 5264z - 156706 - 143927 for z. 59 Solve -1041v + 17313 = -842v for v. 87 Solve -68446 = 74t - 64154 for t. -58 Solve 2488g + 1873 = 951g + 1191g - 203 for g. -6 Solve 0 = 5s - 47 - 66 + 93 for s. 4 Solve 78t - 5660 = -4724 for t. 12 Solve 89j + 2064j = 25131 + 67448 for j. 43 Solve 34339 - 5043 = 1364r - 19808 for r. 36 Solve -1672u - 1744u + 188u = 7864 + 5048 for u. -4 Solve 6320 = 7815y + 7699y - 15830y for y. -20 Solve 285j + 227j + 574j + 28236 = 0 for j. -26 Solve -13776r + 11901r + 7927 = 2302 for r. 3 Solve -22h + 129h + 136h = 667 + 62 for h. 3 Solve -21x + 484 = 37x - 792 for x. 22 Solve 6854q = 6855q - 5 + 7 for q. -2 Solve 11l - 15340 = -14790 for l. 50 Solve 0 = -2739h + 917h - 3617h - 560217 for h. -103 Solve -1277d + 11320 = -33024 - 7580 - 2987 for d. 43 Solve 68z + 1174 = z - 18 + 53 for z. -17 Solve 2305669b + 220 = 2305658b for b. -20 Solve -551d = -31d + 116d - 20605 + 4705 for d. 25 Solve 0 = 2441d - 2587d - 5110 for d. -35 Solve -140b - 221b = 349b - 134b - 28224 for b. 49 Solve 45629 = 604g + 14221 for g. 52 Solve 141x + 381 = -888 for x. -9 Solve 232i + 202i - 14656 = 110i - 134i for i. 32 Solve -1788m = -1740m - 1264 + 304 for m. 20 Solve -10883 = 564v + 6601 for v. -31 Solve -1561p - 641246 = -747394 for p. 68 Solve -45676i + 91469i - 45708i + 6035 = 0 for i. -71 Solve -2399 = -44532w + 44426w + 2159 for w. 43 Solve 14158v = 14137v - 273 for v. -13 Solve 5712 = -20j - 69j - 13j for j. -56 Solve -7838k + 213225 - 414796 = 621419 for k. -105 Solve -448p + 249p = 328 + 3851 for p. -21 Solve 5643v = 11306v - 5625v - 456 for v. 12 Solve -674498 = 18571n - 10728n for n. -86 Solve 0 = 52v + 68227 - 67395 for v. -16 Solve -2861o = -3357o + 6944 for o. 14 Solve -85n - 1383 - 336 = 28n + 654 for n. -21 Solve 1647n = 899n + 76296 for n. 102 Solve -595351l + 111370 = -594056l for l. 86 Solve -67 + 30 + 31 = -30u - 36 for u. -1 Solve 17628 = 48v + 131v - 23v for v. 113 Solve 45n - 507 + 1176 + 298 + 968 = 0 for n. -43 Solve 774 = -83n - 6447 for n. -87 Solve 2661a + 45933 - 6445 + 5749 = 0 for a. -17 Solve 429y - 200y + 36608 = -475y for y. -52 Solve 128o - 216 = -6o + 186 for o. 3 Solve 55a + 3248 = -57a + 4a + 166a for a. 56 Solve -198589 - 54388 = -1884o + 8003o + 120282 for o. -61 Solve 0 = -4090d - 24744 - 32516 for d. -14 Solve 425w + 1306w - 119391 = -610w for w. 51 Solve -8n = 59n + 26n + 4304 + 1741 for n. -65 Solve 0 = 371z - 7850 - 4037 - 2211 for z. 38 Solve 431u + 29864 = -146u - 28404 + 10954 for u. -82 Solve -27401 = 2345j - 1828j for j. -53 Solve 354j - 40j - 4j + 1786 = -4414 for j. -20 Solve -2w + 7004 - 6734 = 3w for w. 54 Solve 1004q - 310 = 2037q - 1002q for q. -10 Solve 570633i = 570688i + 2695 for i. -49 Solve -90v + 473v = -4468v - 119105 - 7021 for v. -26 Solve 16v - 1196 = 4v + v - 15v for v. 46 Solve 622c - 435c + 722 + 2078 = 327c for c. 20 Solve 118r - 238r - 993 = 447 for r. -12 Solve -4655 = -2838566l + 2838661l for l. -49 Solve -13249 = 1200o + 67151 for o. -67 Solve -28b + 3419 + 2314 = -88b - 87b for b. -39 Solve -20u = -268u + 21134 + 2426 for u. 95 Solve 1102x = 1857x - 7661x - 234804 for x. -34 Solve 0 = 714s - 72163 - 51983 + 40608 for s. 117 Solve -804a + 8285 = 3112 - 26987 for a. 40 Solve -109478 = 4072f - 386374 for f. 68 Solve 200l + 343l + 44240 = 211l - 228l for l. -79 Solve 0 = 1942v - 5464v + 4668 + 18962 + 18634 for v. 12 Solve 0 = 6694m - 6656m - 532 for m. 14 Solve 421i - 11796 - 7311 + 7114 - 5268 = 0 for i. 41 Solve -4940 = 750a - 1738a for a. 5 Solve 495 = -520894j + 520883j for j. -45 Solve -233s + 1535 = -36s - 41 for s. 8 Solve 8475 = 14a + 157a - 781 + 1219 for a. 47 Solve -4355 = -44o + 1775 - 3006 for o. 71 Solve 3422 + 6498 = -410d - 6070 for d. -39 Solve 1906327g - 1906294g = -1555 + 3964 for g. 73 Solve -873p = 3079 + 475 - 62 for p. -4 Solve 141l - 9396 + 3333 = 0 for l. 43 Solve -89032 = 2179p + 165911 for p. -117 Solve 1104i + 116251 = 32347 for i. -76 Solve -136p - 706 - 23 - 769 - 2038 = 0 for p. -26 Solve 628k - 5348k - 299219 + 60917 = -307k for k. -54 Solve -269a - 255664 = -862a - 2771a for a. 76 Solve 387g + 6563 = -4991 - 3926 for g. -40 Solve -47g - 266g - 484g - 5926 = 29142 for g. -44 Solve 694 = -41w - 205 - 331 for w. -30 Solve 290x + 139x + 1578 = -1425 for x. -7 Solve 70j + 265j + 9135 = -274j for j. -15 Solve -65856m + 65790m = 660 for m. -10 Solve 59c = -139c - 288c - 383c - 6083 for c. -7 Solve -2359c + 2802c + 278460 = -3977c for c. -63 Solve 190m = -9764 + 834 for m. -47 Solve -78h = 154605 - 152421 for h. -28 Solve 2137s + 1956s = 3476s + 617 for s. 1 Solve -4419 + 4942 = 360k + 11323 for k. -30 Solve -390b = 216b - 11514 for b. 19 Solve 19h - 631 = -56h + 21h + 17 for h. 12 Solve 1678t - 3538t = 2455t + 11736 + 9839 for t. -5 Solve 0 = 78616f - 78932f + 5056 for f. 16 Solve 306314i - 1890 = 306279i for i. 54 Solve -157800 = 12086a - 14716a for a. 60 Solve 24662 + 13608 = 334t + 194 for t. 114 Solve -1550x + 5737x - 212640 - 75034 + 90885 = 0 for x. 47 Solve -7487790q = -7487794q - 48 for q. -12 Solve -2644s - 1970s = 32288 + 169439 - 44851 for s. -34 Solve 21s - 41s - 15s = 1470 for s. -42 Solve -16v + 1876 = 105v + 424 for v. 12 Solve 0 = 1105l + 431 + 8641 + 30708 for l. -36 Solve 5885o - 8422o = 126850 for o. -50 Solve 6335t - 6642t = 26709 for t. -87 Solve -2t = -18t + 269 - 1149 for t. -55 Solve -1013h + 4166*h - 60629 - 141163 = 0 for h. 64 Solve 2	{ "pile_set_name": "DM Mathematics" }
2 + -3). Is 7 a factor of (-3)/(-1)(-9)/v? False Let n(b) = 24b*2 + 2b + 2. Is 8 a factor of n(-1)? True Let c be 0/(-3) + 2 - 7. Let y be (2 + c/2)-8. Suppose -y = -o + 1. Is 5 a factor of o? True Suppose 6x = 17x - 1584. Does 10 divide x? False Suppose -7 + 2 = -5q. Is (q - (-4)/(-2)) + 55 a multiple of 12? False Let c = 18 + 32. Does 3 divide c? False Let t be 2/(-9) + 8344/126. Suppose -r + 2 = -1. Suppose -t = -ry - 0. Is y a multiple of 11? True Suppose 97 + 287 = 4x. Is x a multiple of 8? True Let y(h) be the third derivative of h6/120 - h5/60 - 5h4/24 + 4h*2. Does 14 divide y(4)? True Let o be (-3248)/(-42) - 4/(-6). Let x = o - 29. Is x a multiple of 37? False Let f be -2 - 6(-6)/4. Suppose fi = 6i + 13. Is 5 a factor of i? False Suppose 208 + 56 = 4h. Is h a multiple of 22? True Let i = -2 - -4. Suppose 0f = 3f - 99. Suppose -iz = z - f. Is 11 a factor of z? True Suppose 2u + 5r + 21 = -u, -2u + r = 27. Is (-29)/(-2) + (-6)/u a multiple of 4? False Let g = 19 + -13. Is (-77)/(-6) - (-1)/g a multiple of 9? False Let d(a) = 9a*2. Is 9 a factor of d(-1)? True Suppose -c - 3c - 4 = 0. Is 13 a factor of -2 + c/(3/(-84))? True Let s = 19 + -13. Is 2s6/9 a multiple of 6? False Suppose 510 = -5g + 15g. Does 11 divide g? False Suppose 3r = 2u + 5r, 0 = 5r + 20. Let z be (4/6)/(u/12). Suppose -4g = -12, -2p = zg + g - 71. Is 13 a factor of p? False Let r(y) = 7y*2 - 6. Is 13 a factor of r(5)? True Suppose 0 = -5y + y + 3k + 246, 0 = 3y - 3k - 186. Does 5 divide y? True Suppose 3i - 4i = 0. Suppose 5b + 2c = -ic + 246, 0 = 3b - 5c - 129. Suppose 3a + 2q - 6q - b = 0, 2a - 4q - 36 = 0. Is a a multiple of 5? False Suppose -2i = 3 + 9. Let o(k) = -k*3 - 7k*2 - 7k - 5. Let f be o(i). Let n = 13 - f. Does 6 divide n? True Suppose 0 = i + i + 30. Let y be (i - 1)3/(-6). Suppose 0 = 3u - y - 52. Is u a multiple of 10? True Let t be 36/(-30)(-40)/6. Let n(u) = -10u - 1. Let p be n(-2). Let q = t + p. Is q a multiple of 10? False Suppose -5g + 5p + 290 = 0, 2g = -0p + 4p + 126. Let x = g + -17. Is x a multiple of 12? True Let u be (-36)/2(-77)/14. Suppose 3j = -18 + u. Is j a multiple of 10? False Suppose 532 = 4v - 8. Is 9 a factor of v? True Let l = 20 - 7. Let i = 21 + l. Is i a multiple of 11? False Let c = 22 - 1. Is 7 a factor of c? True Suppose 4f = 4p - 12, 5p = -4f + p - 4. Is 18 a factor of f/(-5) + (-108)/(-5)? False Suppose 2c = 3i - 21, -c = 3i + 4c. Suppose -if + 219 = 39. Is 12 a factor of f? True Let a be (-7)/(-14)(2 - 0). Let j(d) = 0d + 27d*2 + 1 + d - 3d. Is j(a) a multiple of 13? True Suppose 0c - c = -6. Suppose n - cn = 70. Is (-32)/n + (-4)/14 a multiple of 2? True Let x(v) = -8 - v*2 + 8 + 2v. Let f be x(5). Does 14 divide 5((-102)/f - 0)? False Suppose 5j = -o + 19, -4j + 0o = o - 16. Suppose jr - 87 = -v - 2v, -v = -r + 35. Does 16 divide r? True Suppose -4i + 5 = -7. Suppose 2f - in - 39 = 0, 0 = -5f + n - 5n + 86. Is 9 a factor of f? True Let u(d) = -d2 + 24d - 27. Does 27 divide u(15)? True Let y(s) = -3s3 + s2 - s - 2. Let h = 4 - 6. Is 12 a factor of y(h)? False Let c(a) = a2 - 3a - 4. Suppose -4r = 5j + 42, -3j = -r + j - 21. Let z be r/(-2) - 5/(-10). Is 12 a factor of c(z)? True Is 3 a factor of 3/2(-80)/(-12)? False Let u(n) = -2 - 5n - 9n + 4 + 3. Is 25 a factor of u(-4)? False Suppose 11 = 3j - 31. Let y = j - -26. Does 13 divide y? False Suppose -16q + 48 = -14q. Is q a multiple of 24? True Suppose i - 39 - 12 = 0. Does 4 divide i? False Let a(w) be the first derivative of w5/60 + 7w*4/24 + 2w3/3 + w2/2 - 1. Let n(j) be the second derivative of a(j). Does 15 divide n(-9)? False Let r = 3 + 9. Let h be r3(-3)/(-18). Suppose -3t + 36 = -h. Is 14 a factor of t? True Is 7 a factor of (-4 - -3)/(192/196 - 1)? True Suppose 0 = -5z - 23 + 63. Let j = z - -21. Does 10 divide j? False Let w(v) = v*3 - 4v*2 - v - 5. Is w(5) a multiple of 4? False Let s = 8 - 4. Suppose j + 0i = -i + 149, -si = -j + 169. Suppose -j = -4t - 33. Is 11 a factor of t? False Suppose 8j = 7j + 4. Does 18 divide ((-202)/j)/((-16)/32)? False Let p be (-14)/(-63) + 104/18. Let o(l) = -l*3 + 16l - 3. Let d(z) = 2z3 - z2 - 33z + 6. Let j(i) = pd(i) + 13o(i). Is j(-8) a multiple of 15? True Suppose -n - 4 = 2n - 4p, -5n + 5p - 10 = 0. Let u(s) = 4s2 + 9s - 1. Does 9 divide u(n)? True Suppose 5l - 9l = -12. Suppose 49 = lc - 35. Is c a multiple of 13? False Let t(n) = -n3 - 5n*2 + 4n - 10. Does 10 divide t(-7)? True Suppose -5b - 45 = -125. Is b a multiple of 8? True Suppose -5l = 26 + 24. Let f be ((-10)/(-4))/((-5)/l). Suppose fn - 2j = 39 + 16, 2n - 1 = 5j. Is n a multiple of 13? True Suppose 0 = -5k + 4d - 5, -3d + 2d + 4 = -4k. Does 21 divide (k - 4/(-10))-45? False Let m(y) = -y + 3. Let x be m(-7). Suppose -2l = -x + 54. Let r = -8 - l. Is 6 a factor of r? False Let j(b) = -4b + 0b - 2b + b*2 + 4. Let c be j(5). Is 1/(-1) - (-24 - c) a multiple of 14? False Suppose -4v = -5w - 560, 0 = 4v - 0v - 4w - 556. Does 9 divide v? True Let j(o) = 3o3 + o2 + 2o. Let a(p) = -2p - 6. Let q be a(-4). Let w be (-3)/(q/((-8)/6)). Does 16 divide j(w)? True Does 5 divide 125/10 - 3 - 3/(-2)? False Let r(s) = -s + 2. Let o be r(0). Suppose 2a = on - 34, -n = -5n - a + 73. Does 9 divide n? True Let j(h) = 18h2 + 2h - 1. Does 4 divide j(1)? False Suppose -2i + 90 = -60. Is 15 a factor of i? True Let i = 58 + -30. Let f be (-187)/(-4) + (-1)/(-4). Let w = f - i. Does 19 divide w? True Let o(d) = 5d - 7 - 1 - 2d. Does 3 divide o(6)? False Let f = 289 + -169. Suppose -4s = -j + 9, 3s + 2s - f = -5j. Is 7 a factor of j? True Suppose -952 = -3h - 11h. Does 21 divide h? False Let n be (-6)/(-15) - (-9)/15. Suppose -3z + n = -m, -2z = 4m - 2m - 14. Suppose 5j - 32 + z = 0. Is j a multiple of 3? True Let y be 1 + 84 + (-2 - -2). Suppose -2l - 3l + y = 0. Does 8 divide l? False Let l = -3 + 3. Suppose 4b - 2 = s, 0s + s - 2 = l. Suppose -b = -h + 5. Is h a multiple of 3? True Let d = -10 + -1. Let a(k) = -k*3 - 12k*2 - 13k - 4. Does 18 divide a(d)? True Let p = -18 + 28. Suppose 13w = pw + 78. Is w a multiple of 7? False Is 6 a factor of 4 + (-1 - (-11 + 4))? False Let y(p) = p + 14. Let q be y(0). Let m be (-8)/2(-49)/q. Is 86(m/4 - 3) a multiple of 11? False Let i = -16 + 8. Let j = i - -6. Is 11 + (4 + j - 1) a multiple of 9? False Let g(f) = f + 5 + 3f - 6 + 4. Let w be g(-2). Is 16 a factor of ((-26)/w)/(1/5)? False Suppose 48 + 40 = 4h. Let o(r) = 4r - 3. Let k be o(2). Suppose h = 3l - 2z, kl + z = -3z. Is l a multiple of 4? True Let p = -3 - -3. Suppose o = 2m + 16, o - m - 15 + 0 = p. Does 8 divide o? False Let w be -3 + 4 + -3 - -4. Let d(o) = -o + 1 - 5 - w. Is d(-11) a multiple of 5? True Suppose 2n - 3g - 14 = -5g, -5n - g + 51 = 0. Does 3 divide n? False Is -14(-2)/413 a multiple of 5? False Let k(m) = m*3 + 5m*2 - 7m + 2. Suppose -24 = 7b - 3b. Is k(b) a multiple of 7? False Suppose -5v - 2w + 31 = 0, -2v = 5w - 0 - 4. Is (166 - 2)v/14 a multiple of 24? False Suppose 0 = -4c - t + 97, 15 = -7t + 2t. Let u be 24/10 + (-10)/c. Suppose uk - 19 = 9. Is k a multiple of 7? True Suppose 0 = 5h - 209 + 634. Let o = h - -160. Is o a multiple of 23? False Let p(g) = -2 - 2g3 + 2 - 4g*2 + 4g - 5. Is 11 a factor of p(-4)? False Let j(m) = m*2 - m + 1. Let z be 19/(-4) - 1/4. Let b be j(z). Suppose 3y + 3v = 3, 7v - 2v = y - b. Does 3 divide y? True Suppose -2 = -4s + 2. Is s + -1(-34 - -2) a multiple of 11? True Let y(a) = -a3 + 6a*2 - 5a + 2. Let c(x) = -x*2 + 8x + 4. Let s be 3/(-6) + (-17)/(-2). Let f be c(s). Is y(f) a multiple of 7? True Let s be (-1)/(-2) + (-21)/(-6). Suppose -3x - 6 = -sx. Let h(i) = i*3 - 6i*2 + 5i - 5. Is h(x) a multiple of 13? False Let f(c) be the first derivative of -c*3/3 - 7c*2 - 9c + 4. Is f(-8) a multiple of 13? True Suppose 5g - 1 - 6 = 2a, -g - 3a + 15 = 0. Suppose 51 = 2k + 3k - 2b, gb = -k + 17. Is k a multiple of 3? False Let b be (-22)/(-8) + (-1)/(-4). Suppose bq = 12 - 3. Suppose 0 = 2t - qd - 17, 0 = -2t + d - 4d + 35. Does	{ "pile_set_name": "DM Mathematics" }
be o(5). Solve -wg = bx - hg, -x = -3g - 8 for x. 2 Let z(l) = -l*3 - 4l2 + l - 6. Let d be z(-5). Let y = d + -9. Let j(v) = v2 - 2v + 4. Let c be j(-5). Solve -h + c = yk + 10, 0 = h - 4 for k. 5 Let m = -12 - -10. Let c = -2 - m. Solve b + 2b - 4t + 2 = c, 3b + t + 7 = 0 for b. -2 Let s be (18/15)/((-6)/(-15)). Solve -18 = sf + 3u, 5f + u = 3u - 23 for f. -5 Let a = 6 - 8. Let t be 16/6 + a/(-6). Solve -s = ty - 14, -4y + 11 = -y + 4s for y. 5 Let i be 8/(16/(-9))-2. Solve -o - 5v + 29 = 0, o + 2v = v + i for o. 4 Let p = 32 + -32. Solve f - 3i = 4f + 18, -2f + 3i + 8 = p for f. -2 Let o = 6 - 6. Suppose o = 5u - 30 - 40. Let f be 2/(5/(15/6)). Solve -4t - u = -2a, f = 2t + a + 2 for t. -2 Let t = -3 - -7. Suppose 4q + h - 16 = 0, 3q + 2q - 41 = th. Suppose 0 = 5d - 2 - 48. Solve -5g - qm + 9 = -2m, -4g + d = m for g. 3 Let v(b) = -2b2 + 5b - 3. Let k be v(3). Let x be k/12/(-4). Solve xm - 5f = -25, 4m + 0f + 12 = -4f for m. -5 Suppose -3i - 2 = -4i. Let r(t) = -t*3 + 7t*2 - 2t - 8. Let y be r(6). Solve p + ip = c + 11, 5c = 2p - y for p. 3 Let u(y) = y2 - 5y + 5. Let f be u(5). Let z be (4/(-6))/((-20)/30). Solve fc - z = 2r + 22, r + 16 = 4c for r. -4 Let j(r) = -r3 - 4r*2 - 2r - 4. Let s be j(-4). Let q = -9 + s. Let p be (-4 - -2 - -1)q. Solve n + 4 = -n - 2m, 5n - pm + 20 = 0 for n. -3 Let g(v) = -3v - 35. Let w be g(0). Let j be (-56)/w - 4/(-10). Solve a - 3y - 25 = jy, 3a - 4y - 31 = 0 for a. 5 Let d(r) = -r2 + 7r - 2. Let c be d(6). Solve 0 = 4a + co, -6 = -5a - 0o + o for a. 1 Suppose 0 = -a + 5, -7p - 5a = -3p - 81. Solve 0 = 5w + 3t - 7, 4w - p = 2w - 4t for w. -1 Let d be (-1)/(-1(-5)/(-10)). Solve -dy - 10 = 0, -l + 5 = -0y - 2y for l. -5 Let j = 9 + 9. Solve 3g + 4w + j = 0, 2w - 10 = -g + 6w for g. -2 Let i be (-2)/(-3)((-30)/(-4) - 3). Solve -4o - 23 = -ip, -2p - o + 12 = -3o for p. 1 Let a = 0 + -1. Let o be (a + (-3)/(-2))10. Suppose -10 = -oc + 10. Solve 0 = -5z - cw + 18, -12 = -4z - 0z - 2w for z. 2 Let h be 2 + 1 + 1(-9 + 10). Let u = 96 - 40. Suppose 4n = 9 - 25, 4i = 2n + u. Solve hl = -3k - 5, 0k = -2k + 5l + i for k. 1 Let w(p) = -p2 - 16p + 41. Let y be w(-18). Solve 3g - 3j + 6 = 0, yj = -g - 3 - 5 for g. -3 Suppose -c - 18 = 2c. Let d = -6 - c. Solve dm + 11 = -4m + o, 0 = -4m + 3o - 1 for m. -4 Suppose 0 = c + 3d - 10, 0c = 5c + d - 36. Suppose -4s = 5a - cs - 28, 4s + 9 = a. Let b = a + -3. Solve -5w + by + 1 = 0, -5 - 1 = -3y for w. 1 Let g(c) = -c*2 + 17c + 22. Let t be g(18). Solve -2q = 2m, -5m + tq - 2q + 14 = 0 for m. 2 Suppose 2 = o - 2o, 3g - 17 = 4o. Solve -gp + 10 = 2q, -20 = 5p - 2p - 4q for p. 0 Let z(x) = -x2 + 6x + 2. Suppose 4p + 26 = 2k, -k + 11 = -5p - 14. Let n be z(k). Let c = 11 - n. Solve 5l = 15, cd + 3l + 11 = -d for d. -4 Let m(x) = 4x - 3. Let b be m(1). Solve 2i + 5r = b, 5i - 5r + 9 = -6 for i. -2 Let s = -13 - -35. Solve -2d + 4r - s = 0, -4 = 2r - 3r for d. -3 Suppose -2u - 8 = 6. Suppose -11 = n - 0n. Let b = u - n. Solve -bv + 5o = -6v + 12, -4v + o + 2 = 0 for v. 1 Let q(m) = m + 15. Let b be q(-10). Solve l = 2g + 10, -bl + l + 4g + 20 = 0 for l. 0 Let q = 244 - 135. Suppose 3c = -7i + 2i + q, -4 = 2c. Solve 0l + 2l - 3g + 13 = 0, i = -4l + 5g for l. -2 Suppose 2x - 4x = -24. Solve 0 = 5r - 2a + 17, 3a = -5r - 0r - x for r. -3 Let d be 6/27 - (-428)/18. Suppose 0u = 2u - d. Solve 2k + 3r + r + u = 0, 4r = k for k. -4 Suppose -5r + 6 = -3u, -2r - 3 = 4u - 7u. Solve 2n - 5m + 19 = -7, um = -4n for n. -3 Let p be 1 + (0 - (-6)/(-2)). Let z(w) = 2w2 + 2w. Let c be z(p). Solve cf - 12 = -5m + 4m, -20 = 2m - 3f for m. -4 Suppose -2 = -n + 1. Let u(a) = -a3 - 7a*2 + 3. Let p be u(-7). Let f = 5 - p. Solve 5i = -nq + 8 + 32, fq = 10 for i. 5 Let g(l) = 3l - 1. Suppose t = 2 + 1. Let u be g(t). Solve -3w + x + u = -2, -4w + 4x = -8 for w. 4 Let d(t) = -t*3 + 15t*2 - t + 19. Let h be d(15). Solve -2 = l + k, 0 = -5l + 4k - h - 15 for l. -3 Let x(b) = b2 + 6b - 3. Let s be x(-7). Suppose -2r + 2l - 30 = -sr, 3r - 4l - 24 = 0. Solve -2z + c = 3c - r, -5c + 6 = -z for z. 4 Suppose 25m + 35 = 32m. Solve 0 = -2z - 4v + 24, -mz + 13 = 4v - 17 for z. 2 Let i be (-2 + 0)(-8)/16. Suppose 4n + i - 13 = 0. Solve -f = -4y - 1, -4f + ny = -8 + 4 for f. 1 Let l(a) = a2 + 2a - 5. Let g be l(-4). Solve -25 = 5t + k, g + 2 = -k for t. -4 Suppose 13z = 9z + 16. Solve 5 = -t - 5g, 2t = -3g - z + 1 for t. 0 Let f(s) = -s + 3. Let b be f(3). Let m be b + -1 + -4 + 5. Let p be 2/5 + 26/10. Solve 5k + 14 = -x, -px + 4k + 0k + 15 = m for x. 1 Let x(m) = m*2 + 3m - 3. Let a be x(-4). Let k(q) = 0 + a + q - 2 - 2q. Let z be k(-4). Solve -2 = 2v, 0 = -2s + 7s - zv - 28 for s. 5 Let h(d) be the second derivative of -2d + 0 - 2d2 - 1/2d*3. Let f be h(-7). Solve 3 = -3u, 2l + l + f = -2u for l. -5 Suppose -5j - 5n = -10, -j + 3n = -0j - 10. Solve 2d + 10 = jz - z, 4d + 8 = 0 for z. 2 Suppose l = -0 + 4. Solve 4v - 20 = lu, -6 = -v + 2u + 4 for v. 0 Let z = -5 - -3. Let r be (20 - (z - -4)) + 1. Let c(j) = j*2 + 4j. Let t be c(-5). Solve 5x = -to - 15, -4x - r - 1 = -4o for x. -4 Suppose -4l - n + 13 = -l, 18 = 4l + n. Solve t - 3t = 0, 0 = lj - 5t + 10 for j. -2 Suppose -2i - 3i = 855. Let m be i/(-33) + (-8)/44. Solve -3z - 4t - 19 = 0, -z - mt = -5z - 15 for z. -5 Suppose 3m = -3c + 30, -5c + 4m = -10c + 50. Suppose -8 = -b + 3. Let n = 11 - 6. Solve ni - 2i - b = 2h, -4i - 2h + c = 0 for i. 3 Let l(m) = -m3 + 3m*2 + 4m + 5. Let y be l(4). Solve 3r - 31 = 5p + yr, 6 = -3p + 3r for p. -5 Suppose 4 = -13z + 14z. Solve -4i = -i + 3b + 9, -b = zi for i. 1 Suppose 53 = 3o - 22. Solve -8c + o = 3u - 4c, 4u + 4c - 28 = 0 for u. 3 Suppose 0i = -i - 3. Let f be i/(-6) + (-15)/6. Let j = -2 - f. Solve j = 4h - 0h + 8, s + h + 6 = 0 for s. -4 Let o(r) be the second derivative of -r4/12 - 5r*3/6 + 2r*2 + r. Let c be 38/(-8) + 2/(-8). Let h be o(c). Solve -13 = z + hg, -4z - 4g - 2 = 2 for z. 3 Let p = -5 + 2. Let v = -2 - p. Let w be 0/(1 - 0)v. Solve -2o + 5r - 3 = w, -3o - 4 - 3 = -5r for o. -4 Let k = 41 - 37. Let t be (-2)/3(2 - 17). Let f be t/k(4 - 2). Solve -4v - 14 = -q, q - fv - 25 = -4q for q. 2 Let n(f) = 13f2 - f - 2. Let q be n(-1). Solve -33 = 2a - 5m - 6, 3m - q = -3a for a. -1 Let m be 12 + (3/(-3))/((-1)/(-4)). Solve -3q + 1 + 4 = -5t, 2q - t = m for q. 5 Let h(g) = 2g3 - 3g*2 + 2g + 2. Let n(l) = -2l. Let a be n(-1). Let z be a/10 - (-18)/10. Let c be h(z). Solve -4s + c = -4m + 3m, s - 9 = -3m for m. 2 Suppose -2k = -c + 20, 4k + 37 + 3 = 5c. Let w be (-26)/k - (-8)/20. Solve -wq = 3, 0 = -2g + 2q + 2q for g. -2 Let w be (4 + 1 - 1) + -2. Solve 0 = v + wa - 6a - 12, 5a = -15 for v. 0 Let h(d) = d - 1. Let n be h(5). Suppose -3y - 13 = -5v, 0 = -0v + 5v + 3y - 37. Solve -14 = r - vx, r = nx - 3x - 2 for r. 1 Suppose u + 2 = -3g - 3u, 17 = 2g - u. Suppose -5p + g = 2t, 5t + 3p = -p + 15. Solve -2y + y - tf = 2, y - 2f - 3 = 0 for y. 1 Let n = 17 - 16. Solve i + n = -3q, -4i - 2q - 3q - 4 = 0 for i. -1 Let h = 4 - 1. Solve 0l - l - 9 = -5g, -1 = g - hl for g. 2 Suppose -i - 3i + 12 = 0. Solve 0 = 3d - s - 2, d - 4s - 22 = -i for d. -1 Let s = -12 - -18. Suppose -x + s = -2w, -3w + 2 + 4 = 0. Let p = -2 - -6. Solve -5o = -3o - pc, -3o - x = -c for o. -4 Suppose -t = t + 2u - 16, 5u = 3t. Suppose -7 - 41 = -4f + 2g, -tf = -3g - 58. Solve -v = -2m + f, m + 3v + 2v = -15 for m. 5 Let f be (-24)/(-10) - (-2)/(-5). Suppose 4 = fz - 0z. Suppose -7 + 0 = -2p - s, 4p - 10 = zs. Solve pj + j = 5d - 15, d + 2j = 3 for d. 3 Let t = -1 + 5. Solve 3f - tw = 9, -5f + 2w + 7 = -8 for f. 3 Let m be (2 + 3)(-6)/(-10). Let z be (5/m)/(2/6). Suppose -zy + 3f = -35, 2y = 3f - f + 18. Solve 7 = -4i + a + 3, 3i + ya = 16 for i. 0 Let c = -10 - -12. Let o(h) = 3h*2. Let r be o(1). Suppose 3n - 7 = -2t, rn - 3t - 9 = n. Solve -ca = 2b + a + 9, -a = 3b + n for	{ "pile_set_name": "DM Mathematics" }
= 2w + 3w - 25. Suppose 14 = -2m + wt + 33, 5m = 5t + 25. What is the third derivative of 2cm + c - 2c4 - c2 - c wrt c? -48c Let s(q) be the first derivative of 0q*2 + 0q*5 - 1/2q*6 + 0q*4 - 1 + 0q - 4/3q3. Find the third derivative of s(h) wrt h. -180h*2 Find the third derivative of -11y*2 + 16y*2 - 9y*5 + 33y*2 - 15y*5 wrt y. -1440y*2 Find the second derivative of -9v*5 - 11v - 2v5 - v5 + 2v*5 wrt v. -200v*3 Let l(i) = 35i*3 - 29i*2 - 7i - 7. Let k(m) = 18m3 - 14m*2 - 3m - 3. Let f(t) = 7k(t) - 3l(t). What is the third derivative of f(y) wrt y? 126 What is the third derivative of 13j2 + 7j*2 + 15j*3 - 50j*3 + 23j*3 wrt j? -72 What is the third derivative of 3g*4 - 12g*4 + 7 - 7 - 13g*2 wrt g? -216g Let f(n) = -2n + 1. Let b be f(-1). What is the derivative of bd - 2d + 1 + 2 - 4 wrt d? 1 Let o be -7 - (1 + -1)/(-3). Let z = -2 - o. What is the second derivative of zd - 2d - 4d - d*4 wrt d? -12d2 Let q(n) be the second derivative of -n6/2 + 3n2/2 + 14n. What is the first derivative of q(k) wrt k? -60k3 Let n be (8 + 2)/2 - 0. Suppose -np + 5v - 6 = -36, 2p = -5v - 2. What is the derivative of y4 - 5y*4 + 3y*p + 2 wrt y? -4y*3 Suppose 2p + 6j - 3j - 17 = 0, 2p - 5j - 9 = 0. Differentiate 217s2 - 217s2 - s4 - p wrt s. -4s3 Let i(h) be the second derivative of -7h*5/20 - 7h*2/2 + 6h. What is the derivative of i(u) wrt u? -21u2 Let n(c) be the second derivative of -2c*7/21 + 5c*3/6 - 20c. Find the second derivative of n(j) wrt j. -80j3 Find the second derivative of 15w*3 - 9w*3 + 4w*3 - 10w wrt w. 60w Let r(x) be the first derivative of 0x*3 + 0x*4 + 0x*5 + 6 - 5/6x*6 + 0x + 5/2x2. What is the second derivative of r(t) wrt t? -100t*3 Let v = 1 - -4. Find the second derivative of d + 4 - vd - 4 - 3d4 wrt d. -36d2 Let a(v) = v2 + v. Let b(h) = -5h2 - 3h + 11. Let y(q) = -3a(q) - b(q). Differentiate y(k) with respect to k. 4k What is the second derivative of -3p - 70p*4 - 69p*4 + 139p*4 - 7p*5 wrt p? -140p*3 Suppose 0 = 3r - 0 - 6. Let t = 5 - r. Differentiate -1 + s + t + s wrt s. 2 Let l(x) = 9x2 + 72x. Let t(r) = 6r2 + 48r. Let q(y) = -5l(y) + 8t(y). What is the second derivative of q(i) wrt i? 6 Let o(s) be the first derivative of -3s4 + 3s*2/2 - 13. Find the second derivative of o(r) wrt r. -72r Let f(i) be the third derivative of -i8/840 - i5/60 - i*3/6 + 3i*2. Let w(c) be the first derivative of f(c). Find the second derivative of w(m) wrt m. -24m*2 What is the first derivative of 3m + 7m - 5m + 7 + 2m wrt m? 7 Let w(s) = s3 + 2s - 3. Let r be w(2). Let m = r + -7. What is the second derivative of 5 + t*m + 3t*2 - 5 - 3t wrt t? 8 What is the third derivative of -9f5 + 9f*5 - 5f*6 + 2f2 - f6 wrt f? -720f3 What is the third derivative of 3j*2 + 4j*5 + 15j*5 - 4j*5 wrt j? 900j*2 Suppose -y = 4m - 1, 2m = 2y - 0y - 2. What is the derivative of -d + 3d - 3 - y + 6 wrt d? 2 Suppose -6 + 2 = -2y. Suppose 2s = -0s + y. What is the first derivative of -2 + s - 2a*2 - 1 wrt a? -4a Let l(k) be the first derivative of k*2/2 - 9k - 12. What is the first derivative of l(r) wrt r? 1 Let t(h) be the first derivative of h8/1680 + h4/12 - 7h3/3 - 2. Let u(y) be the third derivative of t(y). Find the first derivative of u(m) wrt m. 4m3 Let x(g) = -g3 + 4g2 + 2g - 4. Let i(o) = -o3 - o2 + o + 1. Let q(c) = -4i(c) - x(c). What is the second derivative of q(l) wrt l? 30l Let f(l) = l*3 + 2l*2 + 4. Let p be f(-3). Let i = p + 10. What is the second derivative of 2r*4 - ir*4 + r - 2r wrt r? -36r2 Let z(w) be the third derivative of w4/24 - w3/2 - w2. Let m be z(6). Find the third derivative of 2a*3 + 2a*2 + 0a*m + 0a2 wrt a. 12 Let t(c) be the third derivative of c8/84 - c6/24 + c5/30 - c4/12 - c2 + c. Find the third derivative of t(j) wrt j. 240j2 - 30 Suppose 0 = 3d - 1 - 8. Find the first derivative of -3u + 0u + d - 3 - 1 wrt u. -3 Suppose 3v = 2g + 5, 4g + 5v + 28 - 73 = 0. Find the second derivative of -gm2 - 10m - 2m + m wrt m. -10 Suppose 20 = 5f, 5f - 3f - 4 = -4u. Let y be 7 + 3u/1. Find the first derivative of 4r2 - 8r*2 + y - 2 wrt r. -8r Find the third derivative of z - 8z4 - 5z + 53z2 + 5z*3 + 4z wrt z. -192z + 30 Let l(j) = -j + 1. Let t be l(-2). What is the second derivative of -tb + 0 + 5b2 - 1 + 1 wrt b? 10 Let a be -2(-2 + 1 + -3). Suppose 2o + 2o = a. Find the second derivative of p*4 - 2p*o + 2p*2 + p wrt p. 12p*2 Suppose -4a = -2z, 10z - 5z = 5a + 10. Suppose -z = -5w + 6. Find the second derivative of -c + 0c*3 + 0c*3 - wc*5 wrt c. -40c*3 Suppose -4z - 1 + 21 = 0. Find the third derivative of -n*3 + 4n*3 + zn*2 - 3n*3 - 2n*3 wrt n. -12 Let l(v) be the third derivative of -13v*5/20 - 5v4/24 - v3/2 + 47v2. What is the second derivative of l(t) wrt t? -78 Let j = 10 + -8. Find the second derivative of -7o*4 + 2 - j + 4o + 6o4 wrt o. -12o*2 Let i be (5 - (-1 - -2)) + 0. Suppose -7 - 3 = 2s, 5s + 37 = in. What is the derivative of 0j3 - 2 + 3j3 - jn wrt j? 6j2 Let d(k) be the first derivative of 2 - 3/2k*4 + 0k + 0k3 - 2k*2. Find the second derivative of d(g) wrt g. -36g Let x(k) be the third derivative of 0 + 0k + 0k*4 + 1/30k*5 - 4k*2 - 1/6k*3. Find the first derivative of x(j) wrt j. 4j Let v(m) = -m3 + m2 + m + 1. Let d(x) = -8x3 - 7x*2 + 4x + 4. Let t(o) = d(o) - 4v(o). What is the third derivative of t(f) wrt f? -24 Let p(o) be the first derivative of -o5/5 - 2o*3/3 - 6. Find the third derivative of p(j) wrt j. -24j What is the third derivative of 3n4 - 2n*2 - 4n*4 + 6n*2 wrt n? -24n Find the third derivative of -14h5 + 54h*2 + 9h*5 - 23h*2 wrt h. -300h2 Let k(b) = -b3 - b*2 - b - 1. Let v(y) = -5y*3 - 4y*2 - 4. Let z(m) = 4k(m) - v(m). What is the second derivative of z(i) wrt i? 6i Suppose 12 = k + 4p, -5k + 19 - 7 = 4p. Let m = k - -2. What is the second derivative of 0b5 + mb + 0b5 - b5 wrt b? -20b3 Let v(a) be the third derivative of -a9/15120 - a5/40 - a4/12 - a*2. Let f(w) be the second derivative of v(w). What is the derivative of f(i) wrt i? -4i*3 Let z = -27 - -38. Let u = z - 8. What is the derivative of 5n - 3 - 1 - 4n + u wrt n? 1 Suppose -4h + 3 = -t - 10, 5h - 20 = 5t. Suppose i - hi + 24 = 2x, -x = 2i - 20. Find the second derivative of -6d - d + 2d5 + id wrt d. 40d3 Let c(n) be the first derivative of 0n + 2 + n*2 + 0n*4 + 0n*5 + 1/6n*6 + 0n*3. Find the second derivative of c(o) wrt o. 20o3 Let d(j) = j4 + j*2 - 1. Let p(g) = 7g4 + g2 + 4g - 1. Let i(q) = d(q) - p(q). What is the second derivative of i(f) wrt f? -72f2 Let z(p) = -p3 - 4p2 + 5p + 6. Let h be z(-5). Find the second derivative of d*4 - hd*4 + 2d + 3d4 + 2d wrt d. -24d2 Let v(x) be the second derivative of -x + 0 - 3/2x*2 - 2/3x*3. Differentiate v(c) wrt c. -4 Let a be 6 - ((-2 - -3) + 3). Find the third derivative of 28c*a - 25c2 + c5 - 2c5 wrt c. -60c*2 Let f(c) = -2c*2 - 10c + 48. Let j(n) = -5n2 - 20n + 97. Let k(l) = 13f(l) - 6j(l). What is the derivative of k(r) wrt r? 8r - 10 Find the second derivative of 2s + 6s - 8s*4 - s wrt s. -96s*2 Let x(s) be the second derivative of 2s6/15 + s3/3 - 4s. What is the second derivative of x(v) wrt v? 48v*2 Let c(m) be the second derivative of 0m*7 - 3m - 3/56m8 + 0m*2 + 0m*5 + 0m*3 + 0m*6 + 1/12m*4 + 0. Find the third derivative of c(v) wrt v. -360v3 Let r(l) = l3 + l*2. Let o(i) = 3i*3 - 5i*2 + 3i. Let j(k) = o(k) + 5r(k). Find the second derivative of j(b) wrt b. 48b Suppose -2w - 13 = 3j, 6j - 3w + 6 = 2j. Let a be ((-3)/j)/((-2)/(-6)). Find the second derivative of -2q*a + 3q + 2q - 4q wrt q. -12q Let o(l) = -l2 + 3l + 3. Let t be o(3). Find the third derivative of 4c2 - 6c*2 - 3c*3 + 6c*t wrt c. 18 Let n be (4 + -1)3/(-9). Let v be (-1 - 0 - n)	{ "pile_set_name": "DM Mathematics" }
, 82, 47, -12? -b*3 + 2b + 103 What is the b'th term of -208, -416, -624, -832? -208b What is the o'th term of 1330, 2689, 4062, 5455, 6874? o3 + o2 + 1349o - 21 What is the w'th term of -436, -1758, -3968, -7072, -11076? -w*3 - 438w2 - w + 4 What is the b'th term of 0, -1, -4, -9, -16? -b2 + 2b - 1 What is the q'th term of 95, 93, 91? -2q + 97 What is the p'th term of -13, -9, -5, -7, -21, -53, -109? -p*3 + 6p*2 - 7p - 11 What is the z'th term of 64, -40, -220, -482, -832, -1276, -1820? -z*3 - 32z2 - z + 98 What is the o'th term of 76, 81, 100, 139, 204? o3 + o*2 - 5o + 79 What is the v'th term of 933, 909, 869, 813, 741, 653? -8v2 + 941 What is the n'th term of -477, -472, -463, -450, -433, -412, -387? 2n*2 - n - 478 What is the d'th term of 8435, 8432, 8429? -3d + 8438 What is the b'th term of -27, -24, -17, -6, 9? 2b2 - 3b - 26 What is the u'th term of 58, 141, 236, 349, 486? u*3 + 76u - 19 What is the p'th term of 0, 5, 8, 9, 8? -p*2 + 8p - 7 What is the y'th term of 7, 13, 31, 67, 127, 217, 343, 511? y*3 - y + 7 What is the w'th term of 52, 123, 258, 469, 768? 2w*3 + 20w*2 - 3w + 33 What is the o'th term of 42, 96, 150, 204? 54o - 12 What is the v'th term of 449, 419, 369, 299, 209, 99, -31? -10v2 + 459 What is the w'th term of -88239, -88237, -88225, -88197, -88147, -88069, -87957? w3 - w*2 - 2w - 88237 What is the t'th term of 455, 460, 465? 5t + 450 What is the t'th term of -282, -281, -280? t - 283 What is the h'th term of -111, -446, -997, -1758, -2723, -3886, -5241, -6782? h3 - 114h2 + 2 What is the r'th term of 20, 4, -24, -70, -140? -r3 - 9r + 30 What is the f'th term of 11, 16, 17, 8, -17? -f3 + 4f2 + 8 What is the r'th term of 161, 169, 185, 215, 265, 341? r3 - 2r2 + 7r + 155 What is the u'th term of -13, -33, -69, -127, -213, -333, -493? -u*3 - 2u*2 - 7u - 3 What is the a'th term of -13, 62, 269, 674, 1343, 2342? 11a3 - 2a - 22 What is the a'th term of 44, 99, 152, 203, 252, 299, 344? -a*2 + 58a - 13 What is the h'th term of 104, 153, 204, 257? h*2 + 46h + 57 What is the k'th term of 82, 85, 86, 85? -k*2 + 6k + 77 What is the w'th term of -2, 7, 30, 67, 118, 183? 7w2 - 12w + 3 What is the z'th term of 597, 1198, 1797, 2394? -z*2 + 604z - 6 What is the m'th term of -1256, -2511, -3766, -5021, -6276, -7531? -1255m - 1 What is the b'th term of 311, 616, 921, 1226, 1531, 1836? 305b + 6 What is the l'th term of 2306, 2302, 2298, 2294, 2290? -4l + 2310 What is the z'th term of 13, -5, -59, -167, -347, -617? -3z*3 + 3z + 13 What is the o'th term of 135, 277, 427, 585, 751, 925? 4o2 + 130o + 1 What is the v'th term of -14, -20, -26, -32? -6v - 8 What is the z'th term of 77, 148, 215, 278, 337, 392, 443? -2z*2 + 77z + 2 What is the n'th term of 4, -3, -10? -7n + 11 What is the z'th term of -3941, -3942, -3943, -3944, -3945, -3946? -z - 3940 What is the b'th term of -3441, -3440, -3439? b - 3442 What is the v'th term of -73, -145, -217, -289? -72v - 1 What is the i'th term of -17, -21, -15, 7, 51, 123, 229, 375? i3 - i2 - 8i - 9 What is the f'th term of -10, -12, 2, 38, 102, 200, 338, 522? f3 + 2f*2 - 15f + 2 What is the t'th term of 91, 189, 287, 391, 507, 641, 799? t*3 - 6t*2 + 109t - 13 What is the h'th term of -3, -12, -43, -108, -219, -388, -627, -948? -2h3 + h2 + 2h - 4 What is the x'th term of 198, 148, 68, -42, -182, -352, -552? -15x2 - 5x + 218 What is the u'th term of -32, -39, -50, -65, -84? -2u2 - u - 29 What is the z'th term of 87, 345, 775, 1377, 2151, 3097, 4215? 86z*2 + 1 What is the h'th term of 42, 52, 68, 90, 118? 3h2 + h + 38 What is the z'th term of 150, 294, 436, 576, 714, 850? -z2 + 147z + 4 What is the k'th term of 5, -3, -21, -55, -111? -k3 + k2 - 4k + 9 What is the n'th term of 18, 23, 30, 39, 50? n*2 + 2n + 15 What is the d'th term of 1338, 1338, 1340, 1344, 1350? d*2 - 3d + 1340 What is the y'th term of -109, -221, -345, -487, -653, -849? -y*3 - 105y - 3 What is the l'th term of -142, -576, -1300, -2314, -3618, -5212? -145l2 + l + 2 What is the b'th term of 38, 52, 82, 134, 214, 328, 482? b3 + 2b*2 + b + 34 What is the h'th term of 102, 124, 160, 210, 274, 352? 7h2 + h + 94 What is the m'th term of 128, 131, 136, 143, 152, 163? m2 + 127 What is the p'th term of 75, 85, 103, 129? 4p2 - 2p + 73 What is the x'th term of 120, 199, 216, 141, -56, -405, -936, -1679? -5x3 - x2 + 117x + 9 What is the z'th term of 49, 35, 21, 7? -14z + 63 What is the l'th term of 18, 104, 236, 408, 614? -l3 + 29l*2 + 6l - 16 What is the l'th term of 333, 334, 335, 336, 337, 338? l + 332 What is the v'th term of -39, -84, -147, -222, -303? v*3 - 15v*2 - 7v - 18 What is the t'th term of 45, 66, 87, 108? 21t + 24 What is the k'th term of -156, -140, -108, -54, 28, 144, 300? k3 + 2k*2 + 3k - 162 What is the q'th term of 52, 106, 160, 214? 54q - 2 What is the n'th term of 474, 475, 476? n + 473 What is the p'th term of -9, -19, -49, -111, -217, -379? -2p*3 + 2p*2 - 2p - 7 What is the k'th term of 19, 56, 93, 130? 37k - 18 What is the x'th term of 940, 942, 944? 2x + 938 What is the l'th term of -100, -242, -384, -526? -142l + 42 What is the v'th term of 75, 124, 215, 354, 547, 800? v3 + 15v*2 - 3v + 62 What is the a'th term of -247, -2016, -6821, -16180, -31611? -253a3 + 2a + 4 What is the c'th term of 127, 175, 261, 391, 571, 807? c*3 + 13c*2 + 2c + 111 What is the a'th term of 10, 28, 48, 64, 70, 60? -a*3 + 7a*2 + 4a What is the v'th term of 39, 345, 1187, 2835, 5559, 9629, 15315? 45v3 - 2v*2 - 3v - 1 What is the p'th term of -548, -554, -562, -572, -584, -598, -614? -p*2 - 3p - 544 What is the a'th term of 5, 9, 15, 23, 33? a*2 + a + 3 What is the k'th term of 107, 106, 101, 92, 79, 62? -2k*2 + 5k + 104 What is the j'th term of -328, -428, -528, -628, -728, -828? -100j - 228 What is the j'th term of -44, -84, -124, -164? -40j - 4 What is the m'th term of 136, 141, 146, 151? 5m + 131 What is the s'th term of -25, -56, -115, -208, -341, -520, -751, -1040? -s3 - 8s2 - 16 What is the r'th term of 2533, 2532, 2531? -r + 2534 What is the m'th term of -180, -175, -156, -117, -52, 45? m3 + m*2 - 5m - 177 What is the i'th term of 213, 206, 189, 156, 101? -i3 + i2 - 3i + 216 What is the i'th term of -175, -141, -107, -73, -39, -5? 34i - 209 What is the p'th term of -193, -195, -199, -205, -213, -223, -235? -p*2 + p - 193 What is the y'th term of -59, -113, -167, -221, -275, -329? -54y - 5 What is the v'th term of 79, 80, 83, 88, 95, 104, 115? v*2 - 2v + 80 What is the t'th term of 28, 50, 66, 76, 80, 78? -3t2 + 31t What is the z'th term of 42, 120, 208, 312, 438, 592? z3 - z2 + 74z - 32 What is the d'th term of -1804, -3621, -5440, -7261, -9084? -d2 - 1814d + 11 What is the o'th term of -245, -490, -735? -245o What is the q'th term of 5, 5, 19, 59, 137, 265, 455? 2q*3 - 5q2 + q + 7 What is the a'th term of -90, -99, -118, -153, -210? -a3 + a*2 - 5a - 85 What is the j'th term of 39, 61, 85, 111, 139, 169? j*2 + 19j + 19 What is the z'th term of -16, -50, -136, -298, -560, -946? -4z3 - 2z2 - 10 What is the o'th term of 670, 664, 650, 622, 574, 500? -o3 + 2o2 - 5o + 674 What is the f'th term of -1262, -1258, -1256, -1256, -1258, -1262? -f*2 + 7f - 1268 What is the i'th term of 17, 29, 39, 47, 53? -i*2 + 15i + 3 What is the g'th term of 351, 702, 1053, 1404, 1755, 2106? 351g What is the f'th term of 992, 1000, 1014, 1034, 1060? 3f*2 - f + 990 What is the u'th term of 7100, 14197, 21294, 28391, 35488? 7097u + 3 What is the r'th term of -41, -58, -91, -146, -229? -r*3 - 2r*2 - 4r - 34 What is the f'th term of 1698, 6809, 15326, 27249, 42578, 61313, 83454? 1703f2 + 2f - 7 What is the v'th term of 51, 99, 145, 189, 231? -v*2 + 51v + 1 What is the c'th term of -1075, -1076, -1077, -1078, -1079, -1080? -c - 1074 What is the g'th term of -333, -334, -343, -366, -409, -478, -579, -718? -g*3 + 2g*2 - 334 What is the f'th term of 86, 169, 252, 335? 83f + 3 What is the a'th term of 0, 7, 12, 9, -8, -45? -a*3 + 5a**2 - a - 3 What is the o'th term	{ "pile_set_name": "DM Mathematics" }
(-9). -1/6 Evaluate (03/(-9))/((-4)/2). 0 Calculate 15/(-225)5-1. 1/3 What is the value of ((-8)/5)/(100/(-125))? 2 ((-20)/10)/(6/(-45)-3) -5 What is ((-48)/(-128))/((-2)/23)? -1/8 Calculate (9/6)/(41/(-246)). -9 What is the value of ((-4)/(-42))/(-1(-4)/(-24))? -4/7 8/2(6/5)/(-6) -4/5 (32/(-16))/((-2)/(-8)) -8 (-5)/(-15)(-24)/(-6) 4/3 What is (6/252)/(1/6)? 1/7 What is the value of (-5)/(5/(-2))(-23)/276? -1/6 Calculate (42/7)/(-6)20/4. -5 What is 54/(-400)(-10)/(-4)? -1/8 What is 136/855/2? 4 3/(36/(-4))48/(-136) 2/17 Calculate (-9)/222/(-561)-34. -6 (1/(-9))/(-43/54) 1/2 What is ((-1)/(-4))/(95/1140)? 3 Calculate 58/(1120/21). 3/4 Calculate 98/108(-10)/8. -5/6 What is (1/(-18))/((-3)/9)2? 1/3 (174/203)/(7/((-147)/24)) -3/4 What is the value of (-2450)/(-1960)(-3)/(3/4)? -5 What is ((-8)/20)/(-21/(-10))? -2 What is ((-24)/56)/((-30)/7)? 1/10 Calculate 2/(56/(-4))7/(-2). 1/2 Evaluate (-1)/((-30)/70)2/42. 1/9 What is the value of (6/16(-2)/(-3))/(-1)? -1/4 Evaluate -5(-11)/(-176)-8. 5/2 Evaluate 1/(-1)3/(-21). 1/7 Evaluate (-8)/(-4)65/(-26). -5 What is the value of (2/(-5))/((-1)/2)? 4/5 Calculate -11(-27)/99(-14)/(-6). 7 Calculate (1/(-1))/((-34)/68). 2 What is the value of (2/2)/1(-8)/(-20)? 2/5 What is the value of ((-2)/(-42))/(36/(-1176)-14)? 1/9 Calculate (14/7010/(-2))/7. -1/7 What is (45/(-135))/(3/4)? -4/9 What is the value of 2/7(-49)/(-42)-2? -2/3 Calculate ((-6)/(-2))/((510/(-40))/(-17)). 4 What is (-3)/(-118)-4? -2/3 (5/(-5)4)/1 -4 Evaluate (-60)/(-25)50/20. 6 Calculate ((-2)/12)/(2(-1)/3). 1/4 What is the value of (4/(4/(-2)1))/(-2)? 1 Evaluate ((676/(-585))/26)/(2/(-10)). 2/9 Evaluate (-15)/(-6)(-6)/(-3). 5 What is ((1-4)/4)/(1/(-5))? 5 What is the value of (-4(-10)/(-32))/(-5)? 1/4 1/(-3)(-138)/(-23) -2 What is ((-60)/(-100))/((-2)/(-30))? 9 What is (33/12)/(495/120)? 2/11 What is the value of (-4)/((76/42)/(-1))? 4 What is the value of 7/(-2)(-44)/154? 1 What is the value of (45/3)/(24/8)? 5 What is the value of 0/((-32)/8)-1? 0 ((-3)/54)/((-2)/8)3 2/3 What is the value of ((45/10)/9)/((-5)/10)? -1 Evaluate -255/50. -1 What is (-4)/10(-15)/24? 1/4 What is (((-112)/(-63))/4)/4? 1/9 What is (36/(-8))/((-312)/(-32))? -6/13 ((-8)/2)/((-100)/(-50)) -2 Evaluate 1/(-4)-22. 1 Evaluate (18)/(73/(-73)). -8 ((-34)/(-102))/(1(-1)/(-15)) 5 What is (32/28)/((-56)/(-28))? 4/7 Calculate ((-6)/15)/(-4(-1)/(-30)). 3 Calculate -4(-1)/80/2. 0 Calculate (((-9)/7)/(-9))/((-5)/(-10)). 2/7 Evaluate (2/9-3)/((-48)/16). 2/9 What is (-4)/70(-85)/(-17)? -2/7 What is the value of (-3)/(-18)4-3? -2 (-4)/(-2)(-15)/(-10) 3 What is (-3)/(-3)(90/5)/6? 3 What is the value of (4/8)/(((-6)/3)/(-1))? 1/4 (-12)/(-10)(-2)/(-28)-10 -6/7 Evaluate (2(-6)/12)/(-5). 1/5 ((-3)/(-2))/((-30)/(-20)) 1 What is (6/(-5))/((-44)/(-110))? -3 Evaluate (-5)/(-75)5-3. -1 35/(-112)(-2)/(-5) -1/8 What is the value of (48/8)/((-42)/(-4))? 4/7 Calculate 24/112-4. -2/7 What is ((-7)/14)/(2/(-8))? 2 What is -32-21/4? 3 What is the value of ((-2)/27)/((-100)/225)? 1/6 Calculate 1(5/20)/1. 1/4 What is the value of 1/5-9115/(-23)? 9 Evaluate 1(-5)/151-12. 4 Calculate (-5(-5)/(-125))/(3/(-5)). 1/3 What is ((-3)/4)/((-351)/(-78))? -1/6 What is (-10)/(-8)(-92)/23014? -7 Evaluate ((-17)/51)/((-7)/(-3)). -1/7 Evaluate -1((-90)/(-12))/15. -1/2 What is the value of ((-84)/(-9114))/((-3)/(-21))? 2/31 (273/(-117))/(1/3) -7 (-1)/(-2)(6/1)/(-12) -1/4 Evaluate (-2)/3(-12)/108. 2/27 What is 2/329/(-58)? -1/3 ((-4)/4)/(2/6) -3 What is ((-3)/13)/((-9)/(-6))? -2/13 Calculate 2/10-2(-260)/52. 2 (-10)/6(-84)/350 2/5 -10(15/15)/((-20)/16) 8 What is (3/(-28))/(-18(-22)/(-462))? 1/8 Calculate ((-7)/(-4))/((-46)/184). -7 What is the value of (4/10)/(48/(-200))? -5/3 Calculate (-4)/(-30)95. 6 What is the value of (8/100)/((-2)/(-10)2)? 1/5 Evaluate ((-1)/(9/6))/(10/(-60)). 4 Calculate 0/(((-2)/(-4))/((-2)/4)). 0 What is (-24)/8(-4)/126-6? -4/7 Evaluate 40/(-12)(-13)/(-130). -1/3 Calculate (-30)/(-5)(-40)/30. -8 What is ((-8)/(-10))/((-8)/40)? -4 Calculate 80/((-48)/(-6))6/(-135). -4/9 Evaluate ((-6)/3)/(3/3-1). 2 ((-6)/4)/((-69)/(-46)) -1 222/(-11)(-2)/(-4) -2 Evaluate (16/18)/((-272)/204). -2/3 What is 1(-12)/6(-10)/(-4)? -5 What is the value of 56/604/(-5)? -2/5 (-15)/(-2)4(-1)/6 -5 ((-8)/42)/(1/(9/(-6))) 2/7 What is the value of (3/20)/(67/134)? 3/10 Evaluate (12/20)/(-3)(-5)/6. 1/6 Evaluate (3/15)/((-4)/((-36)/(-9))). -1/5 11/(847/33)-7 -3 Evaluate (4/8)/((-5)/10). -1 What is the value of (3/4)/((-48)/(-160))? 5/2 Evaluate (-8)/64/48-3. 1/3 What is the value of -719/(9310/(-20))? 2/7 (-8)/6-10(-18)/(-48) 5 What is (98/63)/73/(-4)? -1/6 ((-3)/44)/((-1)/(40/(-5))) -6/11 Calculate (-2)/((-16)/(-32)(-36)/(-1)). -1/9 What is 15/(-3)-1(-3)/5? -3 Calculate ((-6)/9)/((-48)/(-18)). -1/4 3/(1/(-48)-49) 4 ((-5)/(-2))/(315/(-210)) -5/3 What is 2/7(-49)/(-84)? 1/6 Evaluate (3/(-3))/(238/136). -4/7 Calculate ((-2)/(-1))/(140/70). 1 What is the value of 1/(-2)(0/12)/3? 0 Evaluate -10(-4)/180-6. -4/3 What is (-6(-7)/(-126))/((-1)/3)? 1 What is (((-442)/52)/17)/(14/4)? -1/7 What is the value of 9/(-12)(-4)/(-9)? -1/3 Evaluate 2(-3)/(-3)(-80)/40. -4 What is the value of -214/7050/4? -5 27/(270/(-40))-1 4 What is (-4)/(6/(-2)(-2)/(-3))? 2 Calculate 1(-10)/3204. -1/8 Evaluate (7/((-28)/20))/(-1). 5 What is the value of 308/(330/(-15))2/20? -7/5 (0/(-23))/(22/2) 0 Calculate 11-1(-6)/(-6). -1 Calculate (-6)/9(-3)/10. 1/5 1/(-15(-6)/(-12)) -2/15 8/245/80 1 What is the value of (3/(-15))/((-2)/24-2)? -6/5 Calculate ((-4)/(-4)-5)/(-1). 5 What is 5-27/14? -5 What is the value of 1/((-24)/(-32)26)? 1/9 What is ((-4)/5)/((-1)/(15/114))? 2/19 0/(-2)(-4)/(-60)5 0 (-21)/(-196)-7(-3)/(-6) -3/8 (20/30)/(2-1) -1/3 What is the value of ((-1)/((-18)/(-27)))/6? -1/4 Calculate (64/64)/(1/(-8)). -8 Evaluate (4/75)/(222/(-555)). -2/15 144/8(-12)/(-42) 2 Calculate ((-2)/(-4))/(3/(-12)). -2 Calculate (-6(-1)/(-9))/(2/24). -8 Calculate ((-3)/5)/((-171)/38). 2/15 Evaluate (-112)/980(-5)/((-20)/(-28)). 4/5 (0/(-10))/((-5)/5) 0 Evaluate (48/40)/((8/5)/4). 3 (26/117)/((-2)/(-54)3) 2 Calculate (-14)/7(-1)/81. 1/4 Evaluate (6/(-3))/((-4)/6). 3 Evaluate (-31)/((2430/36)/(-5)). 2/9 Evaluate (4/8)/1(-6)/(-3). 1 What is ((2/1)/6)/((-24)/36)? -1/2 (2/(-2))/((9/6)/3) -2 0710/(-140) 0 Calculate (-11/1)/(140/(-168)). 6/5 Calculate (-5)/201012. -5 (2/((-12)/(-2)))/((-3)/(-18)) 2 Evaluate -21(1/5)/((-9)/15). 7 Evaluate ((-2)/4)/((-3)/(-2)). -1/3 Evaluate ((-144)/(-84))/(2/7). 6 What is the value of (15/(675/(-18)))/((-3)/(-30))? -4 (-1)/2(-24)/(-90) -2/15 What is the value of ((0/(-1))/2)/1? 0 ((-2)/85)/((-17)/85) 2/17 What is the value of (-10(-1)/8)/((-16)/(-64))? 5 What is (22/(-385))/((-1)/15)? 6/7 What is (-30)/75(-15)/(-6)? -1 What is the value of 2/(-712/6)? -1/7 Calculate 3/4-12(-20)/630. 2/7 What is (-24)/9(-6)/(-4)? -4 Evaluate 23/161(-8)/(-4). 2/7 1/(((-18)/(-2))/63) 7 Calculate ((-9)/(54/15))/((-1)/4). 10 Calculate 0/((234/6)/(-13)). 0 ((-28)/(-245))/((-3)/(-15)) 4/7 What is the value of ((0/14)/(4/(-2)))/1? 0 Calculate ((-4)/(-10)-3)/((-135)/(-900)). -8 Calculate (3/(-2))/((-36)/(-48)). -2 What is ((-3)/1)/(15/3)? -3/5 ((-8)/((-1800)/27))/(2/10) 3/5 (-2(-2)/(-4))/((-3)/(-3)) -1 What is the value of 3/(-15)10/6? -1/3 Calculate ((-6)/10)/((-1)/10). 6 What is (5/15)/((-9)/6)? -2/9 Calculate ((-295)/59)/(10/(-2)). 1 What is the value of (2/(-7))/(-2)2? 2/7 What is the value of 36/(-72)(-2)/(-2)? -1/2 Evaluate (-39)/6(-13)/((-2535)/(-15)). 1/2 What is the value of 7/(14/(-3))-2? 3 What is the value of ((-183)/(-244))/(15/(-16))? -4/5 What is the value of (-2)/(26/36)? -6 What is the value of 37/(185/(-60))(-1)/(-4)? -3 Calculate (2/(-12))/(127/1778). -7/3 What is the value of (81/(-90))/(6/(-4))? 3/5 Calculate (11/(-99)1)/((-1)/(-3)). -1/3 Calculate (39/26)/(78/(-8)). -2/13 (3/123)/(9/(-8)) -2/3 Evaluate (-4)/432/(-8). 4 Calculate (-6)/((-72)/(-6))2. -1 ((-27)/(-12))/1(-52)/(-39) 3 1/2(-10)/9-9 5 What is 1/(-2)-43/(-36)? -1/6 Evaluate (4/12)/((-5)/45). -3 What is (9/(-14))/((-18)/21)? 3/4 2/(-10)32/9 -2/15 Calculate 84/12(-2)/(-35). 2/5 What is the valu	{ "pile_set_name": "DM Mathematics" }
m(w) + nx(w)? -3w Let o(i) = -3i - 5 + 7 - i + i + i. Let w(q) = -3q + 1. What is 3o(y) - 4w(y)? 6y + 2 Let y(s) = -3s2 + 2s - 1. Let r = 23 + -21. Suppose -5q + r = 7. Let t(a) = a2 + 1. Determine qy(u) - 2t(u). u2 - 2u - 1 Let b(l) = -5l3 + 9l - 6. Let d(x) be the first derivative of -16 + 0x3 - 7/2x*4 + 13x*2 - 17x. Determine -17b(a) + 6d(a). a*3 + 3a Let q(m) = -m + 1. Let p(f) = 2f + 3. Let a be p(-2). Let x be (-4 + a)(-1)/(-1). Let t = x + 3. Let d(s) = -5s + 4. Calculate td(y) + 9q(y). y + 1 Let v(n) = n2 + n + 1. Let y be (7/4 - 2)4/1. Let f(h) = 1. Calculate yv(l) + 3f(l). -l*2 - l + 2 Let r(k) = 4k*3 - 5k*2 - 5. Let i(z) = 12z*3 - 16z*2 - 16. Let f(h) = -2h*3 + 34h*2 + 37h - 34. Let o be f(18). Calculate or(p) + 5i(p). -4p3 Let v(f) be the first derivative of f2/2 + f - 67. Let a(y) = -40y - 36. Calculate 2a(u) + 72v(u). -8u Suppose -2v - 14 = -2i, 10v - 11v = -2. Let m(q) = 7q*3 + 5q*2 - 3q*2 + 9q + 7q2. Let c(l) = 3l*3 + 4l*2 + 4l. Give ic(a) - 4m(a). -a*3 Let b(f) = -f + 1. Suppose -2h - 12 = 5i, -104i = 2h - 101i + 4. Let r(t) = 5t + 4. Calculate hb(d) + r(d). d + 8 Let g(l) = -5l + 2. Let v = -24 - -27. Let a(s) = 0s + 12s - vs - 3. What is -3a(z) - 5g(z)? -2z - 1 Let d(a) = 4a2 + 7. Let x(p) = p2 + 2. Let n be 14 + -3 - (-15)/(-3). Give nd(c) - 21x(c). 3c2 Let r(l) = 112l - 49. Let k(o) be the second derivative of -7o3/3 + 3o*2 + 43o. What is 49k(j) + 6r(j)? -14j Let v be 33 + -2 + (-14)/(-1). Let j(d) = 54d. Let z(a) = -a. Determine vz(q) + j(q). 9q Let r(d) = 3d3 + 2d - 1. Let f(g) = 3g3 - 5g*2 - 20g + 2. Let z(q) = -q*3 + 4q*2 + 17q - 2. Let p(l) = -4f(l) - 5z(l). What is 4p(o) + 10r(o)? 2o3 - 2 Let m = -5 - 0. Let k(t) = -7t2 - 5. Let x(v) be the first derivative of -v3 - 2v + 84. What is mx(s) + 2k(s)? s2 Let l(t) be the first derivative of -9t*4/4 + 7t*3/3 - 2t*2 - 333. Let i(b) = -5b*3 + 4b*2 - 2b. Calculate 5i(c) - 3l(c). 2c3 - c2 + 2c Let t(v) = 118v2 - 4v - 4. Let j(b) = -16165b2 + 549b + 549. Calculate -4j(w) - 549t(w). -122w2 Suppose 0 = -4n + 8, -5w - 4n + 5 = n. Let t(a) = 2a - 1 - 3a + 0a. Let q(v) = v + 1. Determine wq(j) - 2t(j). j + 1 Let b(z) = 2209z*2 - 7z - 7. Let n(w) = -1104w2 + 4w + 4. Give 4b(x) + 7n(x). 1108x2 Let h(q) = -4q2 + 3. Let p(o) = -o2 - 18o + 7. Let m(f) = -f2 - 21f + 8. Let y(s) = -6m(s) + 7p(s). Calculate -h(u) + 5y(u). -u2 + 2 Let v(a) = 5a*3 - 4a*2 + 8a. Let i(c) be the second derivative of 11c5/20 - 3c*4/4 + 17c*3/6 - 83c. Give 4i(o) - 9v(o). -o*3 - 4o Let i(v) = -2975v2 + 1050v. Let w(d) = -3d2 + d. Calculate i(s) - 1050w(s). 175s2 Let y(t) = 2t*3 - 2t - 5. Let b be 5 + -4 - (-8)/(-2). Let r(m) be the second derivative of -m5/10 + m3/2 + 3m2 + m + 1. Calculate by(k) - 2r(k). -2k*3 + 3 Let z(s) = -406 + 221 - s + 196. Let a(y) = -1. What is -22a(i) - 2z(i)? 2i Suppose -2n = -4h, -4n + 7 - 43 = 4h. Let f(a) = -15a2 - 6a + 6. Let j(b) = -29b2 - 11b + 11. Determine nj(r) + 11f(r). 9r2 Let l(d) = -3d*3 + 34d*2 - 4d + 2. Let s(z) = -7z3 + 66z*2 - 9z + 5. Give -5l(f) + 2s(f). f*3 - 38f*2 + 2f Let n(f) be the second derivative of -133f3/6 - 49f*2/2 - 8f. Let w(i) = -11i - 4. Give -4n(l) + 49w(l). -7l Let x(t) = -1359t - 1. Let a(r) = 1. What is a(z) + x(z)? -1359z Let x(h) = -h*3 + 6h + 1. Let o be x(-2). Let n(y) = -y*2 - 8y + 3. Let j(k) = k*2 + 4k - 2. Determine on(i) - 5j(i). -2i2 + 4i + 1 Let j(l) be the second derivative of l*4/3 + 5l*3/6 + 2l*2 + l + 9. Let h(s) = 3s*2 + 4s + 3. Calculate -6h(c) + 4j(c). -2c2 - 4c - 2 Let j(r) = r. Suppose -10 = -4d + 10, -2k + 5d - 19 = 0. Suppose 3o + 5a = 0, ka - 2a = -o. Let l(q) = oq + q - 2q. Calculate 3j(f) + 6l(f). -3f Let w(m) = -5m - 3. Let l(y) = 6y + 3. Let k(j) = 68j - 473. Let v be k(7). Calculate vl(g) + 4w(g). -2g - 3 Let d(h) = 3h3 + 5h + 10. Let c(a) = -4a3 - 5a - 8. What is 5c(i) + 4d(i)? -8i3 - 5i Let r(d) = -4d2 - 30d - 13. Let i(f) = 2f2 + 15f + 5. Calculate -9i(w) - 4r(w). -2w2 - 15w + 7 Let y(l) = -4l2 + 2l - 3. Suppose 0 = -6s + 3s + 6. Let g(j) = 6js + 4j*2 - 1 - 11j*2. Determine -3g(i) + y(i). -i*2 + 2i Let o(c) = c*3 - 2c*2 + 2c + 5. Let w(i) = i3 - i2 + 2i + 4. What is 2o(v) - 3w(v)? -v3 - v2 - 2v - 2 Let d = -663 + 637. Let u(b) = -5b3 - b2 - 3. Let j(w) = 21w*3 + 4w*2 + 13. Give du(c) - 6j(c). 4c*3 + 2c*2 Let i(j) be the second derivative of -2j*5/5 + 2j*4/3 - 9j*2/2 + 4j. Let r(q) = 15q3 + 17 + 9q*2 - 23q2 - q2. Calculate 11i(c) + 6r(c). 2c3 - 2c*2 + 3 Let c(w) = 442586w*3 + 8582w. Let q(a) = 619a3 + 12a. Determine 6c(u) - 4291q(u). -613u3 Let u(n) be the first derivative of 2n*3 - 17 - 3/2n*2 + 6n. Let m(b) = -2b2 + b - 2. What is 17m(f) + 6u(f)? 2f*2 - f + 2 Let a(t) = -2t + t - 3 - 3 + 5. Let x(l) = 2l - 3. What is -2a(y) + x(y)? 4y - 1 Let y(a) = -a3 + a2. Let x(u) be the first derivative of -7/4u4 + 3 + u3 + 0u2 - 3u. Let f be -1 + -8((-9)/4 - -2). What is fx(p) - 5y(p)? -2p*3 - 2p*2 - 3 Let b(r) = -2r*2 + 4r. Let q be 4 + -2 + 6 - 3. Let g(m) = -4m2 - 17m + 14m + qm*2. Give -3b(c) - 4g(c). 2c*2 Let j(p) = -105p*3 + 25p*2. Suppose -3r + 9d - 4d = -6, 0 = 5d + 15. Let h(n) = -13n*3 + 3n*2. Give rj(c) + 25h(c). -10c*3 Let m(l) = -30l*2 - 3l + 4. Let x(u) = 30u2 + 4u - 5. Give 4m(h) + 3x(h). -30h2 + 1 Let t(m) = -7m*2 + 4m + 2. Let q = -764 - -767. Let r(s) be the first derivative of s - 4/3sq + 7 + s2. Calculate 5r(i) - 3t(i). i2 - 2i - 1 Let p(l) be the first derivative of l*2/2 + 10l - 3. Let c be p(-7). Let h(f) = c - 9 + 4. Let i(s) = s*2 + s + 18. Give -18h(d) - 2i(d). -2d*2 - 2d Suppose -a - 3 = 5. Let w(r) = -8 - 4r2 + 10r*2 - 10r*2 + 0r2. Let y(t) = -t2 - 3. Calculate ay(f) + 3w(f). -4f2 Let s(h) = -7h*2 - 156h + 2. Let q(m) = 24m2 + 467m - 7. Determine 4q(t) + 14s(t). -2t2 - 316t Let m(u) be the third derivative of 7u4/24 - 4u3/3 + u2. Suppose -37 = 10y + 23. Let s(v) = 3v - 2v + 0v - 1. Calculate ys(d) + m(d). d - 2 Let s(w) = 2 + 24 - w - 22. Let m(z) = -1. Give -2m(n) - s(n). n - 2 Let h(t) be the second derivative of t5/20 - t4/8 + 6t2 - 2t. Let f(v) be the first derivative of h(v). Let z(c) = -6c2 + 5c. Give -5f(n) - 3z(n). 3n2 Let f(y) = -169y. Let p(l) = 10l. Suppose -2s = d + 9, 0 = 5d + s - 19 + 37. What is df(o) - 52p(o)? -13o Let a(q) = 11q2 - 148q - 17. Let m(c) = 5c2 - 75c - 8. Give 6a(h) - 13m(h). h*2 + 87h + 2 Let n(b) = -b*2 + 8b + 2. Let r(m) = -2m. Determine -n(y) + 4r(y). y*2 - 16y - 2 Let w(f) = 14f + 38. Let k(j) = j - 1. What is -5k(y) - w(y)? -19y - 33 Let j(p) be the first derivative of -p3 + 2p2 - 4. Let y(b) be the second derivative of -b4/3 + 5b3/6 + 6b. Determine -5j(d) + 4y(d). -d*2 Let k(c) = 2544c - 10. Let q(i) = -1273i + 4. Calculate -2k(f) - 5q(f). 1277f Let o(z) = -1. Let u(n) = -n + 7. Let j(k) = -6o(k) - u(k). Let s(h) = -4h - 4. Calculate 4j(i) - s(i). 8i Let f(d) = -11d + 3. Let o(r) = 210r - 56. Let q = -1378 + 1381. Calculate qo(g) + 56f(g). 14g Let t(x) = -81x*3 + 33x*2 + 33x + 33. Let j be (22/(-3))/(6/(-27)). Let y(n) = -5n3 + 2n*2 + 2n + 2. Determine jy(q) - 2t(q). -3q3 Let n(x) = -x2 - 1. Let k(i) = i3 + 2i2 + 2. Let v(y) = -y3 + 9y2 - 26y + 49. Let r be v(6). Calculate rk(w) + 2n(w). w*3 Suppose 3b - 36 = 5y, 0 = -b - 5y - 10 + 2. Let r(h) = -2h3 + 29 - bh - 34 - h*3. Let w(d) = -5d*3 - 11d - 8. Determine 8r(o) - 5w(o). o*3 - o Suppose 3y - 2c - 4 = -2y, -4c - 8 = -4y. Suppose 5q = -5 - y. Let m(f) = -f2 + 1. Let j(a) = 8a*2 - a - 6. Give qj(l) - 6m(l). -2l*2 + l Let f(c) = 1 + 14c - 5c2 + 2c*2 + 4c*2 - 4 - 3c*2. Let l(j) = -4j - 3j + j2 - 2j + 2. Give -5f(x) - 8l(x). 2x2 + 2x - 1 Let g(d) = -6d*2 + d	{ "pile_set_name": "DM Mathematics" }
m Collect the terms in 2u3 - u + u3 + 3310 - 3u - 3078. 3u3 - 4u + 232 Collect the terms in -3f - 2066030f*3 + 2045921f*3 + 3f. -20109f3 Collect the terms in -1217h*2 - 1257h*2 - 1202h*2 - 1214h*2 + 6106h*2 - 1214h*2. 2h*2 Collect the terms in 3469 - 7199n - 126n - 3469. -7325n Collect the terms in 51159082 + 1481d2 - 51159082. 1481d*2 Collect the terms in -19s*3 + 182s*3 + 1545s*2 - 3091s*2 + 1546s*2. 163s*3 Collect the terms in 70258830z + 70258784z - 140517613z. z Collect the terms in 82 + 47 - 105 + 48a - 51a. -3a + 24 Collect the terms in 4031642p - 6 + 6 - 2015838p - 2015825p. -21p Collect the terms in -4948431n*3 - 4948390n*3 + 9896809n*3. -12n*3 Collect the terms in 158 - 257949y + 155 - 313. -257949y Collect the terms in 37824q + 1 + 51859q + 223107q + 1345q. 314135q + 1 Collect the terms in -375d + 4d*3 + 30958 + 2d*3 - 30958. 6d*3 - 375d Collect the terms in 5j - 485j - 281j + 15j - 17j. -763j Collect the terms in 93y2 + 130y*2 + 92y*2 - 184y*2 + 2y - y. 131y2 + y Collect the terms in -3632984s*2 + 7265788s*2 - 3632801s*2. 3s*2 Collect the terms in 558v - 14 + 567v - 14 - 1129v - 21. -4v - 49 Collect the terms in -2b*2 - 13741b + 6b2 - 12937b - 15 + 14 - 6b2. -2b*2 - 26678b - 1 Collect the terms in 12 + 150p - 105p*3 - 3 - 51p*3 - 34p*3. -190p*3 + 150p + 9 Collect the terms in 162g2 + 86374665g*3 - 79g*2 - 86374666g*3 - 83g2. -g3 Collect the terms in 2h2 - 14h*2 - 45187585h + 45187582h. -12h*2 - 3h Collect the terms in -6481f + 2183f + 2203f + 2161f. 66f Collect the terms in -610248588248z*2 + 338z*3 + 610248588248z*2. 338z*3 Collect the terms in 15566784 + 6408g - 15566784. 6408g Collect the terms in c - 206616 + 257729 - 990015. c - 938902 Collect the terms in -1377k*3 + 107 + 108 + 698k*3 - 215 + 675k*3. -4k*3 Collect the terms in 644336091131 + 68s - 644336091131. 68s Collect the terms in 9y - 5y + 99181 + 12y. 16y + 99181 Collect the terms in 281251i*2 + 439i*3 - 281252i*2 + 1112i*3. 1551i3 - i2 Collect the terms in -6p + 61p - 17p + 28p - 55p - 4p. 7p Collect the terms in 1173180a*3 + 187331a*3 - 6097179a*3. -4736668a*3 Collect the terms in -142467n - 2n3 - 10n*3 + 11n3. -n3 - 142467n Collect the terms in 13929407d - 27858800d + 13929326d + 2. -67d + 2 Collect the terms in 2c + 697 + 616 - 40 - 2c + c2. c2 + 1273 Collect the terms in 0g*2 + 2g*2 + 86931g*3 - 86933g*3 + 3385. -2g*3 + 2g*2 + 3385 Collect the terms in -5473i*2 - 3i*3 - 5408i*2 + 11016i2 - i3. -4i3 + 135i*2 Collect the terms in 3 + 59m*3 - 666089m*2 + 666073m*2 - 9m*3. 50m*3 - 16m*2 + 3 Collect the terms in 1376x + 9907x + 1151x + 5851x + 5649x + 2. 23934x + 2 Collect the terms in -89 - 91 - 10720056u + 180 - u*3 + 10720056u. -u*3 Collect the terms in 115296 + 121p*2 - 115296 + 124p*2 + 22p*2. 267p*2 Collect the terms in 96331 - 96331 - 19088q. -19088q Collect the terms in -3x*3 - 3x - 76x2 - 243x*2 + 319x*2 + 3x - 4x3. -7x*3 Collect the terms in 3 - 10199348i*2 + 0 + 10199335i*2. -13i*2 + 3 Collect the terms in 21w + 18w + 16w - 98w + 8w. -35w Collect the terms in -148g*2 + 608g*2 - 156g*2 + 152g*3 + 2g - 156g2 - 148g*2. 152g*3 + 2g Collect the terms in 3h - 31h + 29454 - 7h. -35h + 29454 Collect the terms in -70h2 - 63h*2 + 298h*2 - 83h*2 - 67h*2. 15h*2 Collect the terms in -20a + 114 + 22a - 328a*3 + 30 + 4a*2. -328a*3 + 4a*2 + 2a + 144 Collect the terms in -9229t - 2t*2 + 4654t + 4980t. -2t*2 + 405t Collect the terms in -1123v + 1123v - 21129v3. -21129v*3 Collect the terms in 14050716k*2 + 14051038k*2 - 28101753k2. k2 Collect the terms in 4 - 24484j - 24 + 12 + 10. -24484j + 2 Collect the terms in -8 - 7 - 919d + 17 - 2 + 0. -919d Collect the terms in -210 + 51 + 3f3 - 469f + 469f. 3f*3 - 159 Collect the terms in 37l*3 - 3l + 2l + 90l*3 - 3l*2 - 22l*3. 105l*3 - 3l*2 - l Collect the terms in -17332a*2 - 18368a*2 + 35709a*2 + 4. 9a*2 + 4 Collect the terms in -4l + 4l + 10554l*2 + 3051l*2. 13605l*2 Collect the terms in -13674h + 7892h - 1 + 7188h. 1406h - 1 Collect the terms in 2977879q*3 + 2977933q*3 - 5955792q*3. 20q*3 Collect the terms in 85 - 95 - 28a - 3a + 12. -31a + 2 Collect the terms in 489a - 621a*2 + 1867a*2 - 627a*2 + 493a - 617a2 - 982a. 2a2 Collect the terms in -408651g + 121 - 17759g - 121. -426410g Collect the terms in -208945o2 - 208980o*2 + 417801o*2. -124o*2 Collect the terms in 620y*3 - 313y*3 + 1066y*3. 1373y*3 Collect the terms in -19w*3 - 2w*3 + 5w*3 + 546w - 546w + 46w*3. 30w*3 Collect the terms in 120j*3 + 991 + 946j*3 - 990. 1066j*3 + 1 Collect the terms in -5 + 7s*2 + 2 + 2 - 12 - 15s*2. -8s*2 - 13 Collect the terms in -99 + 32 + 36 + 29 - 258p - 11p. -269p - 2 Collect the terms in 42 - 11036s2 - 42 - 98944s*2. -109980s*2 Collect the terms in -811490005f + 24 + 811490005f - 15 + 8f*2. 8f*2 + 9 Collect the terms in -11741d*3 + 35300d*3 - 11703d3 - d2 - 11757d3 + d2. 99d*3 Collect the terms in -12q - 12q + 16q - 4156 - 23q. -31q - 4156 Collect the terms in 21 + 17h + 2 - 7h + 0h + 0h + 2h2. 2h*2 + 10h + 23 Collect the terms in -11u + 5 - 184 - 64 - 82 + 27. -11u - 298 Collect the terms in 4245k - 12622k + 4194k + 4179k. -4k Collect the terms in 106k + 108k + 120k + 1632k3 + 112k - 446k. 1632k*3 Collect the terms in -6138b + 785b - 223 + 454 - 231. -5353b Collect the terms in a*2 - 293961a + 587930a - 293970a. a*2 - a Collect the terms in -318 + 32r + 84 + 79 + 81 + 74. 32r Collect the terms in -15810f*3 + 3946f*3 + 3944f*3 + 3972f*3 + 3945f*3 - 7f*2 + 7f*2. -3f*3 Collect the terms in -72l*2 - 3l - 65l + l + 148l*2 - 30l - 74l2. 2l*2 - 97l Collect the terms in -96m - 98m - 100m - 96m + 565m - 165m. 10m Collect the terms in 212610u*2 - 106267u*2 - 106338u*2. 5u*2 Collect the terms in -155 + 385 + 470j + 236. 470j + 466 Collect the terms in -55670 + 14f - 55625 - f + 20f + 111295. 33f Collect the terms in -82h2 + 0 - 15631h + 15631h + 0. -82h*2 Collect the terms in -6540888b*2 - 6540887b*2 + 19622671b*2 - 6540884b*2. 12b*2 Collect the terms in 0 - 1 - 1096k*3 - 5k + 1 + 1132k3. 36k*3 - 5k Collect the terms in -26w - 110808 + 60w + 29w + 110808. 63w Collect the terms in -3u2 - 924484u + 462254u + 462230u + 2u2 - u2. -2u*2 Collect the terms in -8z*3 + 107z*3 + 481z + 426z - 907z. 99z3 Collect the terms in 766033l + 765963l - 1526985l. 5011l Collect the terms in 8z - 6z - 752 - 847 - 497. 2z - 2096 Collect the terms in 1412 + 33t2 - 1270 - 142. 33t*2 Collect the terms in -5 + 1 + 4 + 38699895g*2. 38699895g*2 Collect the terms in -619 - 597 + 6623q*2 + 1216. 6623q*2 Collect the terms in 928149 + 928249 - 4v - 1856398 + 16v2. 16v*2 - 4v Collect the terms in 504749 - 504749 - 93n. -93n Collect the terms in -284l3 + 0l*2 - 3l*2 + 554l*3 - 135l*3 - 132l*3. 3l*3 - 3l*2 Collect the terms in 29 + 1208h + 2721h + 14h. 3943h + 29 Collect the terms in -3287q + 1611q + 1859q. 183q Collect the terms in 20u*2 - 18u2 + 3157139 - 1578571 - u2 - 1578568. u*2 Collect the terms in 848042p*2 - 112267p*2 + 390772p*2 + 515069p*2. 1641616p*2 Collect the terms in 34916r*3 - 21178r*3 - 13727r*3. 11r*3 Collect the terms in 188j*3 + 21j*2 + 10j*2 - 189j*3 + 6j2. -j3 + 37j2 Collect the terms in -221902u + 221902u + 366u*2. 366u*2 Collect the terms in 190559b - 488206b - 630774b. -928421b Collect the terms in -2249h - 2249h + 8977h - 2239h - 2245h. -5h Collect the terms in -9631 + 28900 - 9639 + 1279g - 9632. 1279g - 2 Collect the terms in -128t*2 + 2955t*3 + 126t*2 - 5899t*3 + 2954t*3. 10t*3 - 2t*2 Collect the terms in -26 + 42 - 15 - 5s + 31 - 12 - 19. -5*s + 1	{ "pile_set_name": "DM Mathematics" }
x, -2s = 3k + 11. Is 2 bigger than s? False Let r(c) = -c3 + c2. Let f(u) = -3u2 + 2u - 1. Let m(l) = -f(l) - 3r(l). Let b be m(1). Which is greater: b or 3? 3 Suppose 2p = 3p - 4. Suppose -3v - p = t, -v = v + 2t + 4. Which is greater: -2/13 or v? -2/13 Let j be 70/4096/10. Are j and 17 nonequal? True Let x = 1/133 - 3/38. Let n = 20 - 19. Do x and n have the same value? False Let v = -1 + 1. Let d = 253 - 1261/5. Which is greater: d or v? d Let u be (13 + -14)(-3 - 1). Suppose -2f + 8 = -uf. Is -5 >= f? False Suppose -12 = -4z + 2c, -3z + 2c = -5z + 12. Let x(q) = -q + 1. Let y be x(z). Suppose -1 - 3 = 2v. Which is greater: y or v? v Let x be (3/(-4))/((-3)/12). Let g = 5 - x. Is 3/2 >= g? False Let s = -0.02 - -1.02. Let t = -2 - 0. Which is bigger: s or t? s Suppose -60 = -c - 3c. Let t be 6/c - 39/60. Is 1 at most t? False Let q = 2 - -9. Let g be (1 + -2)-3 + -3. Which is greater: q or g? q Let s be (3 - 2)/((-2)/(-4)). Suppose sv + 1 = -3. Which is smaller: -1 or v? v Let c = -4.4 - 3.7. Let w = 8 + c. Is w at least -4? True Let p(x) = x*3 + 4x2 - x - 4. Let w be p(-4). Is w greater than -1/3? True Let n be 26/(-30) - (-10)/15. Are -0.1 and n unequal? True Let p = 8201/5865 + 2/1173. Is p != 1? True Let y = 47 + -139/3. Which is smaller: y or -3/10? -3/10 Let w be (-8)/28 - (-37)/7. Let f be 1/w - (-19)/(-20). Is f at most as big as -1? False Let h = 53 - 53.049. Which is bigger: 2/7 or h? 2/7 Let q = 2 + -3. Is q at least -1/13? False Let n = -8 - -5. Let i be 5/(-6) - n/6. Let u(r) = -r2 - 7r. Let o be u(-7). Which is bigger: i or o? o Let h(c) = -c3 + 2c - 1. Let k = 1 + 0. Let m be h(k). Suppose 2a = -3a + 5j + 15, -5a - 3j - 17 = 0. Which is greater: a or m? m Let m(b) = b3 + 4b*2 - 3b + 9. Let t be m(-5). Suppose 0 = -2n - 2n - 12. Are t and n equal? False Let r = 3 - 2. Let z = -4 - 0. Let q be -1 - z/(48/10). Which is bigger: r or q? r Suppose -s - 66 + 61 = 0. Is -3 >= s? True Let n(i) = -i*3 - 9i*2 - i - 9. Let f be n(-9). Let j be (-21)/9 - 2/(-6). Is f smaller than j? False Suppose k = -3u + 6, 2u - 3u - 8 = -3k. Suppose -kx = -6x. Which is smaller: 2/5 or x? x Let h = -147 - -147.2. Is -0.016 <= h? True Let a(c) = 4 - 5c + 13 + 2c + 2c. Let s be a(14). Which is bigger: s or 5? 5 Let i(q) = q*2 - 6q - 2. Let b be i(6). Let z = -19 + 88/5. Is z greater than or equal to b? True Let c be 241/(-5) + 0 + (-60)/(-300). Which is smaller: c or 1? c Suppose 3y + 3k = -12, 3y - 2y - 2 = 2k. Let j be (y + (2 - 1))1. Let c be ((-2)/12)/(1/2). Which is bigger: c or j? c Let m(c) = c*2 + 8c + 3. Let p be m(-6). Is -10 at most p? True Let k(z) = -z*2 - 7z + 11. Let y be k(-8). Which is bigger: y or 7/4? y Let l = -7 - -2. Let j = 11/2 + l. Let x = -1 + 1.2. Which is smaller: j or x? x Let r(m) = -m*3 - 6m*2 + m + 5. Let f be r(-6). Which is smaller: f or 3? f Let s be 12/(-42)1-4. Which is smaller: s or 2? s Let x = 15.93 - 16. Let u = 55.67 - 52.6. Let m = u + x. Which is bigger: 1 or m? m Let c be (0 - -1) + 4 + -3. Suppose -2l + c = -0. Let q = 1/143 - 23/143. Are l and q nonequal? True Let k = -0.1 + 0.2. Which is smaller: 4 or k? k Suppose 28 = 3k + 10. Which is greater: 5 or k? k Let j = 1 - 0.4. Let p = 0.5 - j. Is 2/7 <= p? False Let j = 7 - 29. Let t = -15 - j. Are t and 2 non-equal? True Suppose 1 = -2d + 9. Let k = -4 + d. Are k and 1 equal? False Let o = 16 - 9. Suppose -3r - 3t + 15 = -2r, -2r + 3t = 15. Which is bigger: o or r? o Let s(j) = -5j + 51. Let l be s(10). Which is smaller: -10/37 or l? -10/37 Let l = -16 - -15. Which is greater: -6/19 or l? -6/19 Let d(k) = -k*2 - 3k. Let p be d(-3). Let x be (-2)/(-4) + 33/(-6). Let m be (x/(-10))/((-2)/4). Which is greater: m or p? p Let r be ((-18)/27)/((-2)/(-3)). Is r greater than or equal to 1/50? False Let a be 18/(-3)(-2)/4. Let z be a/(-3)(3 + -2). Is 6 at most z? False Let g = -48 + 48.1. Is -4 less than or equal to g? True Let u = -0.01 - 0.14. Let b = u - 0.05. Is b not equal to -0.1? True Suppose -9 = 3f - 6f. Suppose 4d + u = -4 + 1, 5d + fu = 5. Which is greater: -1 or d? -1 Let m = 3 - 4. Let i be 19/(-35) + 1/7. Are m and i non-equal? True Let d = 187/21 + -4/7. Which is greater: 8 or d? d Suppose f = -3 + 5. Let t be -26(3/6)/1. Let k = t + 27/2. Which is smaller: k or f? k Suppose -p = -0b - b, 4p + 5b - 45 = 0. Let z be 16/(-40) + (-216)/10. Let g be z/(-4) - 2/4. Is g > p? False Let v = -64 + 442/7. Is v less than or equal to -1? False Let f = -61/20 - -19/5. Which is greater: 0 or f? f Let s = -2/39 - 31/156. Is 18 smaller than s? False Suppose x - 1 = -4t - 5, 3t = x - 3. Suppose -u + 15 = -4n, 6 = -2n + 3u - 9. Let i = 3 + n. Is i >= x? True Suppose 37 = 4u - 5u. Is u bigger than -37? False Let r = 9.7 - 10. Let z = r - -0.2. Is z greater than or equal to 2? False Let l be (-4 - (-34)/8) + (-213)/836. Which is bigger: l or 0? 0 Suppose 3t = 2m + 3, 0m + 2m - 2t = -2. Which is bigger: 2/21 or m? 2/21 Let q = -17 + 16.8. Is q >= -7/3? True Let m be ((-45)/12)/(2/8). Let j be (4 - 1)10/m. Let g be ((-1)/j)/(6/12). Which is bigger: 1/6 or g? g Let s = 17 + -14. Suppose 0 = g - 5q - 7, 3q + s = 2q. Which is smaller: g or -9? -9 Suppose -2g = s + 1, -2s - 3 + 1 = 5g. Which is smaller: g or 37? g Let g(y) = -y*2 - 9. Let o be g(0). Is -9 less than o? False Let h(c) = -c - 7. Let j be h(-5). Let x = j - -4. Let q be (4/3)/(x/3). Which is greater: 0 or q? q Let a = -35 + 24. Let x = a + 11.2. Let l = -0.1 - -0.3. Is x not equal to l? False Let y = -7 + 8. Let l be (-348)/(-336) - 2/7. Is y smaller than l? False Suppose -11 = -4f + 1. Suppose -fk + 12 = -5k. Is k equal to -6? True Suppose b + 4 = 2. Let q be b - (-4)/2 - 0. Suppose q = -2t + 6t. Is 0 not equal to t? False Let w = 245 - 1011/4. Is w at most as big as -9? False Let z = 3 + -2. Let p be (-4)/(12/9) - -2. Is p < z? True Let d = 7.1 - 6.47. Which is greater: -2/3 or d? d Let q = 0.071 + -5.071. Is q < -0.2? True Let p be (-2)/5 + 1368/3520. Is p >= -1? True Let n(j) = -j*2 - 10j + 2. Let b be n(-8). Are b and 18 equal? True Let v = 0.178 + -4.018. Let k = v + -0.16. Is k at most as big as -1/5? True Suppose -3k = -5i - 32, -21 + 3 = -2k + 5i. Let y be k/10 + (-12)/30. Let g = -42/11 + 188/55. Is g <= y? True Let q(z) = 34z. Let n(c) = c2 + 9c - 9. Let j be n(-10). Let s be q(j). Suppose 3x - 5y + s = 0, 3 + 27 = -5x + 3y. Do x and 1 have the same value? False Suppose 3d = -2d + 35. Suppose 4c = t - 1, 3c + 1 = d. Let x be 3/t - 1/(-15). Which is bigger: -5 or x? x Suppose 465 = 42r - 39r. Is r at most 155? True Let w = -2.9 + 3. Let z = 0.3 - 0.4. Let o = z + w. Which is smaller: o or -2? -2 Suppose 0 = b - 2m + 10, -m + 0 = b - 2. Let v be (b - 0/1)/5. Are v and 0 unequal? True Let q be 6/5 + 2/(-10). Let u = 12 - 4. Let m be (30/u)/3 - 1. Do m and q have the same value? False Let t be 15/27 - 2/6. Let x = 37/2 + -19. Is t at most x? False Let a(n) = n2 + 2n. Let h be a(-2). Let m = 129/70 - -1633/1260. Let c = -26/9 + m. Is c >= h? True Let d = -91.286 + 1.336. Let j = 92 + d. Let n = j + -0.05. Is n >= -1/4? True Suppose -10h = -5h + 5. Which is smaller: -3/14 or h? h Let d = -8 - -7.84. Let x = -0.25 - d. Let i = 0.01 - x. Is 1 bigger than i? True Let u = -383/3 + 8773/69. Do 0 and u have the same value? False Suppose s + 2 = -s. Let u be s-42/(-36). Is u at most as big as -1/4? False Suppose 0 = 5c - 3u + 2, 3c - 3u - 2 = 2u. Which is greater: -2/23 or c? -2/23 Suppose 3m - 3 = -6. Which is greater: -1/18 or m? -1/18 Let n(l) = l + 10. Let u be n(-12). Which is smaller: -1 or u? u Suppose 2d = 4d - 16. Is 7 > d? False Let o(b) = -1 + 3b - 3b - b*2 + 3b. Let j be 2/(-6) + 21/9. Let a be o(j). Is 2/13 greater than a? False Suppose 5j = 2w - 39, 0w - w + 9 = j. Which is smaller: w or -2/5? -2/5 Let v be -4 - 1 - (3 - 7). Which is greater: 4/21 or v? 4/21 Let i = 12 - 12.2. Let c(f) = 2f2 + f + 1. Let p(l) = -l2 + l. Let n(a) = -c(a) - 3p(a). Let x be n(4). Which is smaller: i or x? x Let a = 4 + -4. Let p = 1 - a. Let z = p - 2. Is z <= -1? True Let q be ((-12)/9)/(1/(-12)). Suppose 0 = k - i - 4, 3k + i + 3*i + q = 0. Is 0 g	{ "pile_set_name": "DM Mathematics" }
p*4pp13)(-5/13) assuming p is positive. p(-890/117) Simplify ((c(2/9)/(c(4/19)/c))/(c(2/25))(3/16))(-1/17) assuming c is positive. c(-34087/581400) Simplify ((b0/b)(-3)/((b7b)/(bb(-6/7))))/((bb*(-1/3)b)(4/5))22 assuming b is positive. b(-718/21) Simplify ((l(-1))(-35))(-1/10)/((l*4l2/l)/((l/l(1/3))/l)(-27/2)) assuming l is positive. l(-4) Simplify ((f/f(-11))/f2(f3/f)47)(-47) assuming f is positive. f(-4888) Simplify (((c(c*(-16)/c)/c)/cc)/(c/(cc/(c/c(6/17)c)c))(c/c*(-2/5)c)/c12)41 assuming c is positive. c(-91471/85) Simplify ((i1i)13/(i/(i/(i(-3)/i))i(6/7)))/((i(-12)/i)/(i*3i))(-9/10) assuming i is positive. i(969/70) Simplify (k*(-1/4)k/k(-2/7))(1/23)/((kk3kk)/(k/k4)(kkkk/(k/k(-2/7)))/((kk(-1/3))/k)) assuming k is positive. k(-23189/1932) Simplify (n*(18/5)nn(-1/49)(nn/n13)(-25))(3/32) assuming n is positive. n(205491/7840) Simplify ((g(-2/23)gg/g(-6)g)/((g*17g)/(g/((g*(-4/3)gg)/gg))))(-2/27) assuming g is positive. g(1208/1863) Simplify (a/(a/(a*(-2/7)a)))/aa/a(-2)a(a/(aa*(-1))a)*(1/9)(a/(a/a(1/2)))(2/73)/((a*(-2/11)/aaa)/(a(-6)/a)) assuming a is positive. a(-195677/50589) Simplify (oo*(2/9)oo2/oo)*14(o*(2/3)/oo)(-24/5)/(o(-6)o((o*5o)/o)/o) assuming o is positive. o(2561/45) Simplify ((a(-2/9))(6/17)/(a/(a(7/5)a)a(7/4)))(10/9) assuming a is positive. a(-437/918) Simplify ((((n1n)/n)/n)(4/7)(nn/(n/(n(-1)/n)))(3/5))/(n(2/7)/(n3n))(1/10) assuming n is positive. n(-8/35) Simplify ((z*(-8/9)z(z/(z/(z/z(2/25))z))/z)/(z(7/6)/z(-5/3)))(-42) assuming z is positive. z(11977/75) Simplify oo(-5)o*4/oo(oo*(-1)o)*(-20)(o(8/7)/((o/((o/o(-10/9))/o))/o))(-4/25) assuming o is positive. o(-32068/1575) Simplify (p/p18)/(p/p(4/41))(p(-1/7)p)/p49 assuming p is positive. p(-18955/287) Simplify (a/((((a*(-2/17)a)/a)/a)/a))/aaa*(-3/23)(((aaa*(-1/51)a)/aa)/a)/(a(-1/5)a) assuming a is positive. a(24443/5865) Simplify p(1/5)/p*(-2/9)(p(-6/7)/p)/(p/(p7p))(pp(-6)p)/(pp(1/3))(p*(-2)p)(-45/4) assuming p is positive. p(14467/1260) Simplify ((h/(h*19/h)h)/(h*27h)h/(h(1/11)h)h(-1/7))(-3/4) assuming h is positive. h(5109/154) Simplify (x2/(x/((x(-7)/x)/x)))/(xx*(1/6)x(x/x(-8))/xx)x5x*4x*(-3)/xxxxx/(xx*(-2/11))x assuming x is positive. x(-659/66) Simplify ((r(-3/13)/(r/r(-19)))/(r2/(rr(rr(-17))/r)))(3/4) assuming r is positive. r(-363/13) Simplify (x8xx(-4/9)(xxx*13x)/(x((xx/x*(-6)x)/x)/x))(-2/45) assuming x is positive. x(-298/405) Simplify ((uu(-2)/u)/u6)(-1/32)/(u(2/7)/uu*5/uu)(-18) assuming u is positive. u(2167/28) Simplify ((l(-2))(2/43))*(30/7)((l/l1)46)22 assuming l is positive. l(-120/301) Simplify (ii6ii)/iii(-3/2)i*(3/4)/(ii*3)i*(4/11)i*(-2)i*4i6 assuming i is positive. i(555/44) Simplify ((dd(d/d*(2/5))/dd)*1/((d/(dd/(d*(-2/9)/d)))/(dd(4/5))))/((d/d(-2/3))/d*(3/7)ddd/(d*(-5)/d)dd(1/12)) assuming d is positive. d(-5921/1260) Simplify (v(-24)/(vv(v/(v/((v/v13)/v)))/vv)(v(-7))(-10))(-2/51) assuming v is positive. v(-38/17) Simplify (z(-5)(z/z*(4/7))/zz)*(-20)(z/((z/(zz(-4)))/z))/(z/(z/(z/z(-2/17))))(z(-1/4))(-49) assuming z is positive. z*(47867/476) Simplify ((o/(oo/((o/(((o/o*(-8))/oo)/oo))/o))oo8o*(2/11)oo(-2/9))(12/7))(-6/13) assuming o is positive. o(32/1001) Simplify (((u/(u(uu0)/u))/u)0(uu/(u/u(-1)))(-48))/(u(-1/4)u*(1/3)(u0)(-1/62)) assuming u is positive. u(-1/12) Simplify (c/(c/c(-1/4))c)11cc/(ccc/((cc/c*2)/c)c)cc*(-7)c((c/(c/(cc*(-3/4)/c)))/(c/(cc(-2/3)/c)))(-2/45) assuming c is positive. c(193/540) Simplify (m(2/43))*(1/18)(mm(5/4))(-46) assuming m is positive. m(-80107/774) Simplify d(1/32)/d(-18/7)(d(-31)/d)(-21/4) assuming d is positive. d(38215/224) Simplify (((c(-2/3)/cc)/ccccc/c(-3)ccccc*(-3/4)(cc(-4)c)/c)13)40 assuming c is positive. c(8710/3) Simplify (a/(a/a1))*(-2/11)/(aaa(-6/7)a*(-1))((a/(a/(a/(a*(10/3)/a))))/(a/(((aa*(1/2))/aa)/a)))12 assuming a is positive. a(-1719/77) Simplify (jj(-1/3))(-8/7)/(j/(jjj(2/5)j))*(-17/6)((jjjj(-1/4))(-1/28))(-2/41) assuming j is positive. j(-37181/4920) Simplify (((z/(z/(z/(z/(z/z(-4)))zz)))/z)/(z(-6)/zz)(zz(1/2))(1/10))/((z0)(-2/61)/(((zz(-5)zz)/zz)/z(-9))) assuming z is positive. z(383/20) Simplify ((hh(-3)h)(-3/10))(-6/11)(((hh*(-3))/h)/(hh/(h*(2/3)hh)))/((h/(h/h8))/hh(-7)) assuming h is positive. h(-412/165) Simplify ((ll(3/20)l)*(-11/3)(ll20l)/lll(10/3))(-1/8) assuming l is positive. l(-349/160) Simplify (((j(-3/11)j)/j)(-7/8)(j/((j((jjj/(j/j11))/j)/j)/j))/((j(-31)j)/j))(-3/4) assuming j is positive. j(-5607/352) Simplify ((u/(u/u(18/7)))/(u/(u/u(2/15)))uu*(-1/6)u(-4/23)/u)(10/11) assuming u is positive. u(307/161) Simplify (f(-2/13)/(ff/(f/(fff(6/5)f)f)f))/(f*(1/3)f/(f/(f*(2/5)/f))f)(ff*0f)(-4)/(f1f)(11/8) assuming f is positive. f(-13133/780) Simplify ((rr(-8))(16/3)/(rr/(r/(rr(-2/19))))(-3))(-33) assuming r is positive. r(19844/19) Simplify ((f/(f*(-1/5)/f)f/((f(f/(f8f)ff)/f)/f))/(f(-2/7))(7/4))/((f*(-1/5)f/(f/(f/f(-1/5))))/(f2)37) assuming f is positive. f(837/10) Simplify ((k(kk/(k/(kk(-1/2)kk)))/k)/k)/(k(-44)k)(k/k(2/31))(-18/5) assuming k is positive. k(13061/310) Simplify ((u(7/4)/u)/(u/(u/u(-6))u))(5/6)/((u(4/7)u)/(u/u3))26 assuming u is positive. u(-14795/168) Simplify (((bb*13b)/b*(-4))/((bb/(bbb(-4/7)))/(b/(b/b29))))(-11) assuming b is positive. b(-3652/7) Simplify (((p/(p*(-11)pp))/p)/p)(-2/33)(p16)(-26) assuming p is positive. p*(-13744/33) Simplify ((aa/(a/a*(-1/6))a(1/3))/(a(-1)a4a))/((a(-1/2)/a)(9/7)a1/a(-1/14)) assuming a is positive. a(-83/42) Simplify ((c/(c(c*(-2/11)cc)/c))/(c/(c/(c/((ccc(1/6)c)/c)))c))39/((cc(-8))/(c/c4c))(-16/7) assuming c is positive. c(-5673/154) Simplify (((((t/t3)/ttttt)/t)/tt)/(tttt(1/7)t))/(t0)36(t(-6)t*(2/7))/((tt*1)/tt)7 assuming t is positive. t(-167/7) Simplify ((ff0)(-34/5)/(((f/(((f/f(2/7))/fff)/ff))/f)/(f(-4/13)/f)))(-5/3) assuming f is positive. f(2909/273) Simplify (u(-2/17)/(uu/(u/u(-1)u)u))/(u1/u(-3/5))u*(3/2)uu5uuuu2u(-4/7) assuming u is positive. u(12151/1190) Simplify j/(jjj*3/jj)j6(j(2/5))(-36)(jj*(-2/13)j/(jjjj6j)j)(21/5) assuming j is positive. j(-2759/65) Simplify (((r(-12)rr(-10/7))/(rr/r(1/3))(5/3))(-25))32 assuming r is positive. r(766400/63) Simplify (c7c/(c/c(-1/6)))(-31/4)/((c(-1/4))(3/10)c*(4/5)ccc*(-7)c) assuming c is positive. c(-2981/60) Simplify (((k(2/11)k)/k)/((k(6/7)/kk)/k)(k(k/(k*(2/5)/k))/k)/kk/(k/(k0/k)))/((k/k(-6))/kk(-4)k5/(k/(k/k(2/7)))) assuming k is positive. k(-2614/385) Simplify ((k(1/3)/kk)(2/119))(-9/11)((((k/(kk(1/4))k)/k)/k)/k)(8/3)/(k(-1/3))(1/9) assuming k is positive. k(-210911/35343) Simplify k/k*(1/3)kk(-6)k/k*(-1/2)k*(-1/5)((k/k0)(-38))9 assuming k is positive. k(-10351/30) Simplify (z1/z(-6/7))*(-22/3)/((zzz/(z/(z/z(-2/3))))/(z/((z/z(-1/6))/z)))(-1/20) assuming z is positive. z(-11321/840) Simplify ((j(2/7)j/(j*1/j))/(j(j1/j)/j)(-2/13))/((j*(-1/3)/jj(-1/4))/(j(-1)/j(2/9))) assuming j is positive. j(415/252) Simplify (p/(pp6)p*3pppp5ppp/(p(-3/5)/p))/(p(-1/7)/p*(-1)(p/p0)(2/3)) assuming p is positive. p(848/105) Simplify (l(-1/7))*19l*36l(l/l(-1/4))/ll assuming l is positive. l*(995/28) Simplify (((m/(m/(mm*(1/7)))m/((m*(2/9)m)/m)m)/((mm/(mm/m(-11)))/(mm(1/5))))(7/4))(1/26) assuming m is positive. m(4763/46	{ "pile_set_name": "DM Mathematics" }
. -14, 0, 3, 4, 35 Sort 12.5, 3, 2 in ascending order. 2, 3, 12.5 Sort 3, 5, -1, 1/2. -1, 1/2, 3, 5 Put 231, -17, -2 in increasing order. -17, -2, 231 Put -2/17, 82, 2, -0.3, 0.01 in decreasing order. 82, 2, 0.01, -2/17, -0.3 Put 1, 5, -1, -10 in increasing order. -10, -1, 1, 5 Put 1/12, 8, -0.2 in increasing order. -0.2, 1/12, 8 Sort -7, 5, 7, 4 in increasing order. -7, 4, 5, 7 Sort 5, -1, -23, -2 in ascending order. -23, -2, -1, 5 Put -7, -5, 3, -6 in decreasing order. 3, -5, -6, -7 Sort -30, -5, 0 in ascending order. -30, -5, 0 Sort 55, 1, 0 in ascending order. 0, 1, 55 Sort 0.17, -3, 2/11, -18 in decreasing order. 2/11, 0.17, -3, -18 Put -12, -8, 1, -1 in increasing order. -12, -8, -1, 1 Put 2, -1, 193 in descending order. 193, 2, -1 Sort 1/3, -4, -9. -9, -4, 1/3 Sort -685, 4, -3 in ascending order. -685, -3, 4 Sort 0, -537, -1 in descending order. 0, -1, -537 Put 5, 2, -2, 28, 1 in ascending order. -2, 1, 2, 5, 28 Sort -5, 2, 0, -1 in descending order. 2, 0, -1, -5 Sort -1, 4, 6, -6 in descending order. 6, 4, -1, -6 Sort -41, -3, -4, 5 in descending order. 5, -3, -4, -41 Put -0.5, 13, -1/5 in decreasing order. 13, -1/5, -0.5 Sort 1, 8, -2, -185, 5 in increasing order. -185, -2, 1, 5, 8 Sort 79/2, -3, -5 in descending order. 79/2, -3, -5 Sort -3, -6, -17, 3 in decreasing order. 3, -3, -6, -17 Put 5, 3, -4, 35, -3 in decreasing order. 35, 5, 3, -3, -4 Put -0.2, -4, 4/13, 0.5 in decreasing order. 0.5, 4/13, -0.2, -4 Put 189, 0, 1, -4, -7 in descending order. 189, 1, 0, -4, -7 Put -2.7, -1/3, 3, -0.3 in descending order. 3, -0.3, -1/3, -2.7 Put 3, 181, 1, -1 in decreasing order. 181, 3, 1, -1 Sort -0.3, -0.5, -1, -10. -10, -1, -0.5, -0.3 Sort -36, 5, 4, 55 in ascending order. -36, 4, 5, 55 Sort -20, -31, 3 in increasing order. -31, -20, 3 Sort -5, 4, -4, 3, -24 in decreasing order. 4, 3, -4, -5, -24 Put 0.1, 1, 9/7 in ascending order. 0.1, 1, 9/7 Sort -1, 9.9, 3 in increasing order. -1, 3, 9.9 Put 35, 6, 1, -3 in increasing order. -3, 1, 6, 35 Sort -6, 5, 1, -5. -6, -5, 1, 5 Put -19, 3, -4, -0.2, 4/7 in descending order. 3, 4/7, -0.2, -4, -19 Put 1/4, -0.8, 1, 5 in descending order. 5, 1, 1/4, -0.8 Sort -3, 4, -1601 in descending order. 4, -3, -1601 Sort -1/3, -1, 14, 10 in descending order. 14, 10, -1/3, -1 Put 4, -25, -1 in descending order. 4, -1, -25 Put -3, 3, 2/993 in descending order. 3, 2/993, -3 Sort 0, 1, -2, 39 in ascending order. -2, 0, 1, 39 Put -6, 4, 9, 0, 2 in ascending order. -6, 0, 2, 4, 9 Sort -15, 1, -35 in decreasing order. 1, -15, -35 Put 2, -1/3, 2.1, 38, -3 in decreasing order. 38, 2.1, 2, -1/3, -3 Sort -231, 20, 0. -231, 0, 20 Put 13, -1.3, 0 in decreasing order. 13, 0, -1.3 Sort 2, 3, -7, -2, 4. -7, -2, 2, 3, 4 Put -2/9, 9, -0.17, 0, -5 in decreasing order. 9, 0, -0.17, -2/9, -5 Put 4, -5, -3, 78 in descending order. 78, 4, -3, -5 Put -20, -4, -3, 51 in ascending order. -20, -4, -3, 51 Sort -1, 3, 4. -1, 3, 4 Sort -6, 5, 1, 6, -0.4 in descending order. 6, 5, 1, -0.4, -6 Sort 4, -38, 0, 3, 5 in ascending order. -38, 0, 3, 4, 5 Sort -6, -2, 4, 386 in decreasing order. 386, 4, -2, -6 Sort 6, 2, -14, 7, -5 in descending order. 7, 6, 2, -5, -14 Put -6, 1/4, 1/11, -0.5 in descending order. 1/4, 1/11, -0.5, -6 Sort -4, -1/27, -8, 1/5 in descending order. 1/5, -1/27, -4, -8 Put 2, -3, -33, -11 in increasing order. -33, -11, -3, 2 Put 97.8, 0.3, -1 in ascending order. -1, 0.3, 97.8 Sort 110, 3, -4, 1 in descending order. 110, 3, 1, -4 Sort 10, -3, -4 in increasing order. -4, -3, 10 Sort 86, -27, -3. -27, -3, 86 Put 9, 1, 20 in ascending order. 1, 9, 20 Put -3, 1, 2, 0.2 in decreasing order. 2, 1, 0.2, -3 Sort -8/9, 0.03, -0.4, 1 in ascending order. -8/9, -0.4, 0.03, 1 Put 0.05, 1, 5, 2/7 in decreasing order. 5, 1, 2/7, 0.05 Sort -2/15, -1/3, 1.5 in ascending order. -1/3, -2/15, 1.5 Sort 4, -608, -4/3, 0, 3 in decreasing order. 4, 3, 0, -4/3, -608 Put 2/15, 0.73, 0.06, 1/4 in decreasing order. 0.73, 1/4, 2/15, 0.06 Sort 0.1, -2, -3/4, 36/11 in descending order. 36/11, 0.1, -3/4, -2 Sort 1, 83, -3, 0 in ascending order. -3, 0, 1, 83 Put -3, -15, 0, 1, -2 in ascending order. -15, -3, -2, 0, 1 Sort -4, 36, -44 in descending order. 36, -4, -44 Sort -1, 6, -2, -3, 11. -3, -2, -1, 6, 11 Sort 1, -9, 417 in increasing order. -9, 1, 417 Sort 2/101, -1, -16. -16, -1, 2/101 Put 5, -8, -6, -7 in increasing order. -8, -7, -6, 5 Sort 9, 0.06, 3/4, 3 in descending order. 9, 3, 3/4, 0.06 Put -2, -6, -4, -8 in decreasing order. -2, -4, -6, -8 Put 194, -4, 0, -2, -1 in ascending order. -4, -2, -1, 0, 194 Put 60, -3, 0 in increasing order. -3, 0, 60 Sort 4, 9, -3, -5. -5, -3, 4, 9 Sort -4, 6, -2, -3 in descending order. 6, -2, -3, -4 Sort -2, -2573, -1 in ascending order. -2573, -2, -1 Sort 0.64, 0.21, 0.3 in increasing order. 0.21, 0.3, 0.64 Sort -4/5, -2, -21 in descending order. -4/5, -2, -21 Sort 18, -28, -1/3 in descending order. 18, -1/3, -28 Put 9912, 2, -5/2 in descending order. 9912, 2, -5/2 Sort 5, 0, 4, -4 in ascending order. -4, 0, 4, 5 Put -3, 2, 4, 0 in descending order. 4, 2, 0, -3 Put 42, -2, 5, 1 in decreasing order. 42, 5, 1, -2 Put -5, -2, -402 in decreasing order. -2, -5, -402 Sort -1, 0.2, -4, 46 in descending order. 46, 0.2, -1, -4 Sort -3, 3, -5, 18 in descending order. 18, 3, -3, -5 Put 37, 3, 0, 26 in decreasing order. 37, 26, 3, 0 Put 0, -17, 4, 2 in descending order. 4, 2, 0, -17 Put 92, 6/7, 3 in decreasing order. 92, 3, 6/7 Put 0.5, -4, -2/9 in decreasing order. 0.5, -2/9, -4 Sort 7, 0.11, 3 in decreasing order. 7, 3, 0.11 Sort -4, -3/4, 1/10, -2, -0.1 in descending order. 1/10, -0.1, -3/4, -2, -4 Put -17, -3/4, 0.3, -1/6, 0.2 in decreasing order. 0.3, 0.2, -1/6, -3/4, -17 Sort 4, 11, 8 in ascending order. 4, 8, 11 Put -5, -242, 1, -2, 3 in descending order. 3, 1, -2, -5, -242 Sort 0, -1, 2, -2, 0.005 in descending order. 2, 0.005, 0, -1, -2 Sort -5, 12, -1, 4 in decreasing order. 12, 4, -1, -5 Sort 0.3, -2/11, -5, -1 in ascending order. -5, -1, -2/11, 0.3 Sort -1.1, -2, -76, -3/7 in decreasing order. -3/7, -1.1, -2, -76 Sort -2, 3, 1/5, 789 in decreasing order. 789, 3, 1/5, -2 Sort 0, 410, 4 in decreasing order. 410, 4, 0 Put -5/4, -0.2, 0.5, 5, -3 in increasing order. -3, -5/4, -0.2, 0.5, 5 Sort 3, 1, -0.3, -0.15 in descending order. 3, 1, -0.15, -0.3 Sort 5, 2/7, -1, 0.2, -1/20. -1, -1/20, 0.2, 2/7, 5 Sort -0.2, 2, -1.5, -3/5, -200/3 in decreasing order. 2, -0.2, -3/5, -1.5, -200/3 Sort -1, -7166, -3, 1. -7166, -3, -1, 1 Sort 4/7, -24, 2 in increasing order. -24, 4/7, 2 Put -1, 5, -1197, 0 in decreasing order. 5, 0, -1, -1197 Put 1/3, -11, 9/13 in ascending order. -11, 1/3, 9/13 Sort -1/5, -4.3, -0.5, -2. -4.3, -2, -0.5, -1/5 Sort 1, 0.2, 6, 0.19. 0.19, 0.2, 1, 6 Sort -4, -2, 82, -1 in decreasing order. 82, -1, -2, -4 Sort -4, -15, -78, -5 in descending order. -4, -5, -15, -78 Sort -1/8, -4, -8, -3 in ascending order. -8, -4, -3, -1/8 Put -3, 5, 2, -2, 728 in decreasing order. 728, 5, 2, -2, -3 Sort 2/63, 6, 1/7 in decreasing order. 6, 1/7, 2/63 Put 4, -7, 1, 0, -4 in decreasing order. 4, 1, 0, -4, -7 Sort -5, 0, 8, 1/8, 0.3 in decreasing order. 8, 0.3, 1/8, 0, -5 Sort 2/3, 15, -35 in ascending order. -35, 2/3, 15 Sort -3, 5, 11, -14, -2. -14, -3, -2, 5, 11 Put 1/2, 5/4, -0.4, -4 in descending order. 5/4, 1/2, -0.4, -4 Put -129, 5, -3/4 in descending order. 5, -3/4, -129 Sort -1, -3, 10, 2/37. -3, -1, 2/37, 10 Sort -4, -34, 4 in decreasing order. 4, -4, -34 Put -5, -13, -2, 1, -0.07 in ascending order. -13, -5, -2, -0.07, 1 Sort -23/5, 0.2, -7, -1/11 in descending order. 0.2, -1/11, -23/5, -7 Put 1, 7, -1, 0 in ascending order. -1, 0, 1, 7 Put -136, -3/14, 0, -5 in increasing order. -136, -5, -3/14, 0 Put -18, -0.1, 0.1 in decreasing order. 0.1, -0.1, -18 Put -2, -5, 30, 3 in ascending order. -5, -2, 3, 30 Sort -2/5, 2.38, -3 in decreasing order. 2.38, -2/5, -3 Sort 2, -4, -5, 0.04 in descending order. 2, 0.04, -4, -5 Put 83, 1/3, 0.4, -5 in ascending order. -5, 1/3, 0.4, 83 Put -1/6, -64, 0.1 in ascending order. -64, -1/6, 0.1 Sort -4/5, 3, -17.5. -17.5, -4/5, 3 Sort -10, 1, -5. -10, -5, 1 Sort 13, -3, -1, -4, -5. -5, -4, -3, -1, 13 Sort 2/9, -0.043, 1.4. -0.043, 2/9, 1.4 Put -0.1, -0.3, 268, 0.2 in ascending order. -0.3, -0.1, 0.2, 268 Sort -7, 17, -0.3, -1/8 in increasing order. -7, -0.3, -1/8, 17 Sort -2.	{ "pile_set_name": "DM Mathematics" }
30n + 126 = -16n. Suppose -np + 19 = -4p + 3l, -5l = -5p - 5. Determine u, given that 18/11 + 2/11u*p + 12/11u = 0. -3 Let u(b) = b5 + b4 - 1. Let l(k) = -k*5 - 8k*4 + 12k*3 - 10k*2 + 3k + 2. Let y be (-37)/(-13) - (-112)/728. Let d(f) = yl(f) + 6u(f). Factor d(a). 3a(a - 3)(a - 1)3 Let t(a) be the second derivative of -a5/20 - 6a*4 - 216a*3 + 244a + 7. Factor t(p). -p(p + 36)2 Let m(n) = 37n*2 - 819n + 40782. Let u(w) = 20w2 - 410w + 20390. Let o(x) = 6m(x) - 11u(x). Solve o(q) = 0. 101 Factor 174243/8 + 3/8d3 + 172797/8d - 1443/8d2. 3(d - 241)*2(d + 1)/8 Let g(m) be the first derivative of 3/5m2 + 25 + 1/6m*3 - 1/60m*4 - 20m. Let o(k) be the first derivative of g(k). Factor o(i). -(i - 6)(i + 1)/5 Let u be (3 + 60/(-28))/((-75)/(-35)). Let 12/5q - 14/5 + uq2 = 0. Calculate q. -7, 1 Suppose 5u - 10 = r, 3 + 13 = -4u. Let t be 3/(-4)(80/r - 0). Factor -8m2 - 7m*2 - 2m*3 - 9m*2 + 20m*t. -2m*2(m + 2) Let s be (((-425)/(-840))/17 - 6/(-63))(-512)/(-160). Suppose -3j = k - 6, 6j - 20 = -5k + j. Find p, given that -98/5 - 6p2 - sp*k - 126/5p = 0. -7, -1 Let b(l) = 2l - 4. Let o(f) = -f + 3. Let t(w) = 3b(w) + 4o(w). Let z(u) = u2 + 27u + 6. Let q(n) = -44t(n) + 4z(n). What is m in q(m) = 0? -3, -2 Let w(d) = 7d4 - d2. Let t(g) = -152g*4 - 12g*3 + 38g*2 + 12g - 18. Let p(l) = -2t(l) - 44w(l). Suppose p(y) = 0. Calculate y. -1, 1, 3 Let x(f) be the second derivative of f*4/10 + 5f*3 + 252f*2/5 - 986f. What is h in x(h) = 0? -21, -4 Factor 648/11m - 3888/11 - 24/11m*4 - 2/11m*5 - 18/11m*3 + 540/11m*2. -2(m - 3)*2(m + 6)3/11 Let m(d) be the first derivative of -d3/15 + 69d2/5 - 81d - 1171. Factor m(z). -(z - 135)(z - 3)/5 Factor -4595t + 4765t - 170t*3 + 59t*2 - 1499t*2 - 6t4 + 1445 + t4. -5(t - 1)(t + 1)(t + 17)2 Determine f, given that -1639f + 5f2 - 112 + 1669f + 32 = 0. -8, 2 Suppose -4u = 8x - 0u - 36, 18 = 5x + 2u. Find z such that x - 22/9z*2 - 8/9z + 2/3z3 = 0. -1/3, 0, 4 Let w = -345 - -350. Factor 7 + 8c + 0c3 - 66c2 - c3 + w + 65c2. -(c - 3)(c + 2)*2 Let g be 6/81105/56. Let m(q) be the second derivative of 0 - 21q + gq*3 - 1/6q*2 - 1/24q*4. Factor m(f). -(f - 1)(3f - 2)/6 Let j(c) be the second derivative of -40c - 1/10c3 + 0c*4 - 1/5c*2 + 1/100c*5 + 0. Factor j(b). (b - 2)(b + 1)*2/5 Let s = 2975 - 1740. Let q = -2455/2 + s. Factor 0 + qi - 3/2i3 - 6i*2. -3i(i - 1)(i + 5)/2 Let p(t) = -14t2 - 9962t - 4979. Let g(s) = -124s2 - 89656s - 44810. Let n(h) = 3g(h) - 26p(h). Factor n(v). -4(v + 1244)(2v + 1) Let m(z) = 4z3 + z2 - z. Let c(a) = 6a3 + 62a*2 - 2a. Let g(p) = c(p) - 2m(p). Factor g(q). -2q*2(q - 30) Let n(p) be the first derivative of 2p3/9 - 97p*2/3 - 2153. Factor n(x). 2x(x - 97)/3 Solve 30752/23 + 26/23o*3 + 3232/23o*2 + 100936/23o = 0 for o. -62, -4/13 Find v such that 0 - 464/9v2 + 26912/9v + 2/9v3 = 0. 0, 116 Let h(s) be the third derivative of s6/40 + 33s*5/20 - 73s*4/8 - 105s*3/2 + 5038s*2. Factor h(n). 3(n - 3)(n + 1)(n + 35) Let b = -9 - -11. Let l(i) be the first derivative of -8/3i3 - 18 + 43/12i*4 - 2i*5 + 7/18i*6 + 2/3i*b + 0i. Suppose l(f) = 0. What is f? 0, 2/7, 1, 2 Let a = 628115 + -3140569/5. Let -a - 42/5k3 - 37/5k + 2/5k4 + 7/5k*5 - 68/5k*2 = 0. Calculate k. -1, -2/7, 3 Let j(v) be the third derivative of 16/135v*6 + 45 - 176/9v*4 + 0v + 479/135v5 + 121/3v*3 + 1/945v7 + v2. Determine t, given that j(t) = 0. -33, 1 Let y(p) = p*2 - 13p + 3. Let a = -62 + 75. Let z be y(a). Factor 20x + 4x*4 - 8x*4 + 3x*4 - 65x*z - 20x*2 - 24x*4. -5x(x + 1)(x + 2)(5x - 2) Solve 46/15h - 2/15h*4 + 0 - 94/15h*2 + 10/3h*3 = 0. 0, 1, 23 Let x(j) be the first derivative of -151 - 108j*2 + 2916j + 4/3j3. Solve x(a) = 0. 27 Let m be 4/(-7) + (-162)/(-14). Let n be (-96)/144 + m/3 + 1. Suppose -2c*n + 8c*3 - 6c + 13c3 + 9c*2 - 7c*4 - 15c*5 = 0. Calculate c. -1, 0, 2/5, 1 Let c be 0/(-1) - (-12)/(-1 + 5). Suppose 3d + 4j + 6 = -4, 2j + 10 = d. Factor -2bc + 2b + 10bd + 2b - 4b3. -2b(b - 2)(3b + 1) Let n be 8/2 - (-4)/82. Let q = n + 10. Factor 12g2 - 10g*2 + qg*4 + 40g*3 + 12g*2 + 21g*2 + 10g. 5g(g + 1)*2(3g + 2) Let y(b) be the second derivative of -b4/16 - 601b*3/2 - 1083603b*2/2 - 1825b. Find g such that y(g) = 0. -1202 Let x(c) = -163c2 - 81c - 638. Let o(q) = -140q2 - 80q - 636. Let m(w) = 7o(w) - 6x(w). Factor m(h). -2(h + 13)(h + 24) Let q(o) be the second derivative of o*6/30 + 29o*5/20 + 35o*4/2 + 2o - 1301. Factor q(i). i*2(i + 14)(i + 15) Let m(p) be the first derivative of -5p*3/12 - 333p*2/8 + 67p/2 + 2370. Factor m(w). -(w + 67)(5w - 2)/4 Let g(q) be the second derivative of -3q5/140 + 9q*4/28 + 81q*3/14 + 405q*2/14 - 55q - 3. Factor g(k). -3(k - 15)(k + 3)2/7 Let k(y) be the first derivative of -y3/15 - 87y2/5 - 344y/5 + 6581. Factor k(g). -(g + 2)(g + 172)/5 Suppose 35 - 87 + 40 = -4b. Let a(v) be the second derivative of 0 + 2v2 + 1/3v*b - 5v - 1/6v4. Determine g so that a(g) = 0. -1, 2 Let a(d) = -14d*2 + 322d - 1758. Let k(g) = 165g2 - 3865g + 21100. Let p(j) = 35a(j) + 3k(j). Determine h, given that p(h) = 0. 6, 59 Let p(d) be the third derivative of 1/30d5 - 1/210d*7 - 62d*2 - 1/540d*6 - 1/6d*3 + 1/216d*4 + d + 0 + 1/3024d*8. Find g such that p(g) = 0. -1, 1, 9 Factor -2/9y*2 + 92/9y + 94/9. -2(y - 47)(y + 1)/9 Let a be (-3)/(-4 - 26/(-8)). Factor 10ya + 16y*3 - 11y4 - y4 - 32y2. -2y*2(y - 4)*2 Suppose z - 3a = 217 + 8, -3z - 3a = -663. Let n = z - 222. Suppose -2/5m + 2/5m*3 + n + 0m2 = 0. Calculate m. -1, 0, 1 Let j(x) be the first derivative of x4/42 + x*3/21 - 6x*2/7 - 15x - 182. Let q(t) be the first derivative of j(t). Suppose q(i) = 0. What is i? -3, 2 Let u(k) = -31k - 744. Let q be u(-24). Let a(x) be the third derivative of 20x*2 + 0x + q + 0x4 + 1/12x*5 - 5/6x*3. Factor a(t). 5(t - 1)(t + 1) Let m = 6519535/7 - 931362. Factor -1/7c*3 + 0 + 1/7c*2 - mc*4 + 1/7c. -c(c - 1)(c + 1)*2/7 Factor 20g + 11g2 + 336g*3 + 389g*3 - 5g*2 + 2g*4 - 737g*3. 2g(g - 5)(g - 2)(g + 1) Factor -5f*2 - 381f + 246 + 460 + 161f - 246. -5(f - 2)(f + 46) Let y(d) be the second derivative of 1/21d*7 - 4/3d*3 + 0 - 11/6d*4 + 152d - 1/15d6 - 9/10d*5 + 0d*2. Factor y(o). 2o(o - 4)(o + 1)*3 Let s(m) be the first derivative of -14m*5/5 - 1101m*4/2 - 614m*3/3 + 1101m*2 + 628m + 347. Solve s(c) = 0 for c. -157, -1, -2/7, 1 Let 784a2 - 641a*2 - 6a3 + a3 + 1902a2 = 0. What is a? 0, 409 Let c(n) be the third derivative of n9/48384 - n8/5376 - n5/15 - 7n3/6 - n2 - 3n. Let r(p) be the third derivative of c(p). Factor r(b). 5b*2(b - 3)/4 Let w(i) = -i*3 - 40i*2 - 361i + 8. Let j(k) = 3k3 + 121k*2 + 1083k - 28. Let r(t) = 10j(t) + 35w(t). Find q, given that r(q) = 0. -19, 0 Let m(u) be the first derivative of -u6/18 + u5/5 - u4/4 + u3/9 + 4048. Factor m(d). -d*2(d - 1)3/3 Let w(a) be the second derivative of a6/15 - a*5/10 - 18a*4 - 560a*3/3 - 832a*2 - 335a. Factor w(m). 2(m - 13)(m + 4)*3 Let a = 184865 - 1293989/7. Determine t so that -24/7 - 9t*2 - at - 3/7t4 - 24/7t*3 = 0. -4, -2, -1 Let o(y) = 43 + 0y*2 + 2177y - 19y2 - 2147y - 13y3. Let j(k) = -4k*3 - 6k*2 + 10k + 14. Let q(i) = -7j(i) + 2o(i). Factor q(d). 2(d - 2)(d + 1)(d + 3) Let j(q) be the second derivative of -8q + 0q3 + 2 - 9/8q*5 + 1/3q*6 + 0q*2 + 5/12q*4. Factor j(h). 5h*2(h - 2)(4h - 1)/2 Let y(l) be the first derivative of l*4/3 - 34l*3/3 + 60l*2 + 37l - 74. Let a(w) be the first derivative of y(w). Solve a(q) = 0 for q. 2, 15 Let c(y) be the second derivative of -y*6/10 - 3y5/10 + y4 + y*3 - 9y*2/2 - 220y + 2. Let c(q) = 0. Calculate q. -3, -1, 1 Let t(h) be the first derivative of -h3/3 + h2/2 + h + 12. Let j(w) = 4w3 + 20w*2 + 4w + 4. Let m(x)	{ "pile_set_name": "DM Mathematics" }
to 0.1? (a) i (b) 1/8 (c) g (d) 4 b Let m = 0.2 - 0.2. Let f = -5 + m. Let o = 0.136714 + -0.136714. What is the closest to o in 2, f, 0.5? 0.5 Let n = -275 + 1928/7. Let x be (-14)/(-2) - (-4 + -2(-8 - -5)). Let f = 3.95 + 0.05. Which is the closest to f? (a) x (b) n (c) 0.03 a Let c = 27199.7 + -27200. Let x = -1.89 - -1.8. Let u = x - -0.1. What is the nearest to 0.1 in u, 5, c? u Let y be -2 + ((-31)/(-5) - 84/28) + -2. Let k = 2.98 + 0.02. What is the closest to -2 in k, 0.5, y, 0.4? y Let k = -2126/15 + 7538/45. Let j = k - 455/18. Which is the closest to j? (a) -3 (b) -5/4 (c) 0.3 c Let u = -2 + 6. Let t = -628/415 - -11/830. What is the nearest to -2/5 in t, u, 0.5? 0.5 Let n = 2.5773 - -0.4227. What is the nearest to -24 in 2, 3/13, n? 3/13 Let u be -3(5 - (-116)/(-18)) + -4. Suppose 2k - 7 = -27. Let q be (2/k)/((-40)/75). What is the closest to u in -5, q, 2? q Let g = -48527/17646 - -1/35292. Which is the nearest to 1? (a) -8 (b) -3/2 (c) g b Let s = -67 + 67.1. Let r = 7.338 + -7.838. What is the closest to 1 in r, 0.5, 5, s? 0.5 Let o = 0 - -4. Let w = o + -1. Let z = -2/8645 + -3456/8645. Which is the nearest to z? (a) -6 (b) -3 (c) w b Suppose 4s - 5 = -s. Let w = 109/480 - 63/160. Which is the nearest to s? (a) 3 (b) 1/10 (c) w b Let h = -4 + 6. Let y = 3 + -3. Let n = -10268/3 - -3423. Which is the closest to y? (a) n (b) 4 (c) h a Let t(s) = -s*2 + 3s - 2. Let j be t(4). Let b be j/4(-10)/(-30). Let r = 2367.5 - 2367. What is the nearest to b in -0.3, 0.2, r? -0.3 Let g be (1(-12)/6)/(-2). Let i = -644.1 + 644. What is the closest to -30 in 5, g, i? i Let i = -84674/3 + 28225. Let g = -0.04 - -0.24. What is the nearest to i in g, 0.5, 2/9, -2? 2/9 Let r be (-130)/(-325)4470/4. Which is the nearest to 0.1? (a) 0 (b) r (c) 0.3 a Let n = -6058 + 6061. What is the nearest to -0.1 in -0.5, -0.1, n, 4? -0.1 Suppose 0g = 3g + 24. Let z be ((-2)/(-2))/(g/(-144)). Suppose 3s + 12 = z. What is the closest to 2/3 in 3/7, s, -3? 3/7 Let w = 137458/7 - 19637. Which is the nearest to -2? (a) -2 (b) w (c) -4/37 (d) -0.1 a Let x = 57.5177 + 0.4823. What is the nearest to 5 in -4, 0.2, x? 0.2 Let y be 1 + 3 - (-12)/(-2). Let p be (-286)/(-26) + (-1004)/92. Which is the nearest to 0.1? (a) -0.3 (b) y (c) -0.4 (d) p d Let u be -18(-1 - (-36)/8). Let q be u/(-36) - (-1)/4. What is the closest to 0 in 0, 5, q? 0 Let d = 78 + -83. Let r = -2/189 - -8/27. Suppose 0 = 3u - 8u + 10. What is the nearest to r in 3, u, d? u Let z(o) = o2 + 3o + 1. Let m be z(-3). Let v = 205 - 208. Let g be (-3)/3 + 21/v. Which is the nearest to 0? (a) g (b) m (c) -1/8 c Let d = -18822 + 18801. What is the closest to -0.19 in d, -3, 2/7? 2/7 Let p = 4726.8 + -4727. What is the closest to -5 in p, 18, -2? -2 Let x be 12/(-63)2261/102 + -1 + 5. Let d = 1249/10 - 125. Which is the nearest to x? (a) -1 (b) d (c) 5 b Let s = -1458 - -1459. What is the nearest to 1/11 in 2/17, s, -4? 2/17 Let v = 4.9168 - -0.0832. Let y = 7 + -6.2. Which is the nearest to -0.1? (a) -1/6 (b) y (c) v a Let y = -0.391 - -114.891. Let o = y - 114. Which is the nearest to 0.1? (a) o (b) 4 (c) -1/4 c Let f be ((-7)/((-560)/12))/(15/(-25)). Which is the nearest to -5/3? (a) -3/10 (b) -2 (c) f (d) -4 b Let u = -3 + -6. Let s = -0.24 + 0.74. Let x = -1/482 - 479/1446. What is the closest to x in 4/5, s, u? s Suppose -19 = 57m - 76. What is the closest to m in -3/2, -2/3, 0, -16? 0 Let h = 29.81 - 30.01. Let g = -5 + 9. Let v be 3/(6/g) - 0. What is the closest to h in -4, 0, v? 0 Let p = 3552.5 + -3552. What is the nearest to -3/4 in -5/7, 6, p, 2? -5/7 Let j be ((-60)/(-45) - 2)1. Let a(i) = i*3 - 7i*2 + i - 8. Let h be a(7). What is the nearest to j in -5, h, -0.4? -0.4 Let l = 11.22 - 12.7. Let x = l + -0.52. Let f = -2/9 - -19/45. What is the closest to 1 in f, -2/23, x? f Suppose 167j = -139j - 5202. Let g = 3/4 + -5/4. What is the closest to g in -1, -4, j? -1 Let d = 797 - 797.1. Which is the nearest to d? (a) 2/3 (b) 27 (c) 1/4 c Let w = -6168 + 6168.8. Let o = -629/4 - -747/4. Let x = -30 + o. Which is the closest to x? (a) w (b) 4 (c) 1/3 c Let f = -78/343 + -69/343. Which is the nearest to 10? (a) -0.4 (b) f (c) -0.088 c Let b = -5 + 5.4. Let l(u) = -11u - 182. Let t be l(-10). Let d = t - -427/6. What is the nearest to -0.2 in d, 3, b? b Let f = -33564 + 33563.495. What is the closest to f in 0, 1/2, 3? 0 Let p = 0.1 - -0.9. Let z = -12.48973 - -8.48973. What is the closest to p in 0, 12, 1/2, z? 1/2 Let v = 102/7 - 491/14. Let i = v + 21. What is the closest to 7 in -1/5, i, 0.1? i Let w = 2.3 - 0.3. Let a = -1.9 + w. Let g = -590232/5 - -118046. What is the closest to g in a, -0.06, 4? -0.06 Suppose 3c + 32j = 36j - 9, 4j = 12. What is the nearest to c in -1/12, -0.06, -1/8, -3? -0.06 Let j = 0.6 + 1. Let v = -41.9 + 29.4. Let z = v - -12.4. Which is the nearest to -0.2? (a) 2/9 (b) j (c) z c Let p = -3.318 + 3.118. What is the nearest to 0.2 in p, 2/5, 0.29, -3? 0.29 Let n = 2.336 + -1.036. Let u be (20/(-5))/2 + 2. Which is the nearest to -1/2? (a) -0.3 (b) n (c) u a Let m = 48 + -49.22. Let i = -5.68 + m. Let s = i + 7.2. What is the nearest to 0.1 in 0, 5, s? 0 Suppose -3q = 2q - 3c, -4q + 3c = 3. Suppose 11 = 2m - q. Suppose 0 = 5i + 10, -m = 3o + 3i + 2. What is the nearest to o in -4, 0.4, 5? 0.4 Let u = -3902 + 3900. Which is the nearest to 0.4? (a) 8 (b) u (c) -4/9 c Suppose 1131 = 35y + 1096. Suppose -5z - 65 = -5i, -i + 49 = -3z + 4i. What is the closest to -2/3 in y, -3, 4, z? y Let o = -0.04 + 54.04. Let i = -46 + o. Let g = i - 13. What is the closest to 2/5 in -5/3, -4, g? -5/3 Suppose 2m + 6 = 16. Let x = -725/287 + -160/41. Let h = x - -239/35. Which is the nearest to 0.04? (a) h (b) m (c) 2/7 c Suppose 0 = 2g + k + 69, 60 = -2g - 6k + 8k. Which is the nearest to -5/6? (a) 0 (b) g (c) -0.5 (d) 1.1 c Let z = 11 + -16. Let h = -4.94 - z. Suppose -3i - 5d - 19 = -i, 4d = -20. Which is the closest to 2/5? (a) h (b) i (c) 2/3 c Let x = -51801/77701 - -1/233103. Let c = -2 - -2.1. Let h = -1/2 + 1/14. What is the closest to c in h, -0.5, x? h Let s = -2 + 3. Suppose 4n - v = -129 + 112, -2v = 5n + 18. Which is the nearest to s? (a) 4/3 (b) 0.1 (c) n a Let f be -2 + 10/2 - 1. Let z = 173 + -173. Let j be ((-3)/15)/(2 + -1) + z. Which is the nearest to f? (a) j (b) -1 (c) -3 a Let p = -0.1 - 0.2. Let m be ((280/(-21))/(-8))/((-5)/(-6)). Suppose 1 = t - 5x, -3x - 2x + m = 2t. Which is the nearest to t? (a) -0.4 (b) p (c) 3 b Let l = 59 + -54. Let m = -1.239 + 0.239. What is the closest to 1 in l, m, 2/15? 2/15 Let z(x) = 2x*3 - 56x*2 + 46x + 216. Let n be z(27). Which is the nearest to 1? (a) 4/3 (b) -5 (c) -10 (d) n a Let h(z) = 2z + 54. Let f be h(-27). Suppose f = 20i - 13*i - 7. Which is the nearest to i? (a) 4 (b) -61 (c) -0.2 (d) 0.1 d Let s = 0.1896 - -0.1104. What is the nearest to 3 in -2/113, 3/4, s? 3/4 Let p = -3756 + 3759. Which is the nearest to -1? (a) 2 (b) -18 (c) 2/21 (d) p c Let c = -0.8089 + 0.9089. What is the nearest to c in -2/5, -1, -1/3, -71? -1/3 Let u = -3.0704 + 2.8404. Which is the nearest to u? (a) -5 (b) -0.3 (c) 1/8 (d) -2/7 d Let g = 16238.7 + -16239. Which is the closest to -2? (a) -0.026 (b) -1/4 (c) g (d) 0.09 c Let s = 128/205 + -1/41. Let i = 125 - 189. Let h = -65 - i. Which is the nearest to 1? (a) s (b) h (c) 1 c Let v = -2.0283 + 1.1983. Which is the closest to -1? (a) 21 (b) v (c) -0.3 b Let d = 0.0239 + 0.0761. Let g be (-1)/(-4 + 6 - 11/2). Which is the closest to g? (a) -0.3 (b) 3 (c) d c Let h = 232 - 1620/7. Let n = 8113.8 - 8114.3. Let l = -0.2 + -0.1. Which is the nearest to l? (a) h (b) -5/2 (c) n c Let k = -953/36 + 105/4. Let j = -788 + 792. Which is the nearest to 0.04? (a) j (b) 0 (c) k b Let h be (52402/(-210))/(-19) - 13. Which is the closest to -0.1? (a) h (b) -0.4 (c) 0.1 (d) 0.5 c Let x = -1.4 + 1.9. Let p = 10005 + -10002. Which is the closest to -1/5? (a) x (b) p (c) -1 (d) -0.4 d Let m = 1.4 + -1.328. Let t = m - 3.072. What is the closest to 1.2 in 3, -0.5, t? -0.5 Let s = 2655.4 - 2697. Let w = 19 - 61. Let o = s - w	{ "pile_set_name": "DM Mathematics" }
(z*(-3/5)z)/z)/z)(zz*(-5/4)zz)/((z/(zzz(1/3)z))/z)((zz(-1))(18/7))(-23) assuming z is positive. z(281/60) Simplify (i10/(i(9/10)i)(i*(-1)i)/(ii10))(-39) assuming i is positive. i(1131/10) Simplify (q(-1/2)/(q/(q/q6)))/(q(-3/5)qqqq(-5)q)((q/q(-6)q)/q(2/7))/(q/q(2/5)q(-6)/q) assuming q is positive. q(129/14) Simplify ((c(-5/4)/(cc*(-1/2))(ccc/c*(3/2)c)(-50))(-17))15 assuming c is positive. c(129285/4) Simplify ((l*8l)*(12/11)((l/l*(-3/13))/l)/(lll(-4)))(43/2) assuming l is positive. l(74089/286) Simplify (a(-2/37)a(9/5))/(a(-1/8)/(a*42a)) assuming a is positive. a(66409/1480) Simplify ((((h(-1/3))(-2/15))25)47)(-10) assuming h is positive. h*(-4700/9) Simplify (ss*34s/s(-1/16))/(s(3/38))(-7/6) assuming s is positive. s(10991/304) Simplify (s/(s*5/s)ss5/ss(ss(1/4))(-5))/(s*5(s*(-1/3)s)/ss5/(s2/s)) assuming s is positive. s(-143/12) Simplify ((zz*(1/3)z)/(z/(z*(-3)/z))(z/(z(2/15)/z))(31/2))27 assuming z is positive. z(3546/5) Simplify ((ppp*(-2/11)pp(-20))/((p/(p/(pp*(-5/4))))/pp19))32 assuming p is positive. p(-12296/11) Simplify ((g(-3/5)/(gg(-4)))/(((g/(ggg(1/2)/g))/gg)/g(-1/3)))/((g/g(-2))49)49 assuming g is positive. g(-216013/30) Simplify (s/s(1/4))*(-26)s/(s/(s/s*(2/13)))s*(2/7)((s/s*4)/(ss/s*(-1/4)))/(ss*(1/3)(s/((s0/s)/s))/s) assuming s is positive. s(-29431/1092) Simplify ((m(2/11)/m)(-3/20)(m/m(1/6))/(m(-4/9)mm))(10/3) assuming m is positive. m(-1187/594) Simplify ((n(-1))(-1/7)((nn(-10)nn)/n)(-29))(-18) assuming n is positive. n(-29250/7) Simplify ((ll/l(-1/2))(-22)/(l*(-2/9)l/l(2/21)))/((l(-2/17))(-1/2))(-17/5) assuming l is positive. l(-17477/315) Simplify (f/(f(-4/5)/f)ff(2/15))(-20/3)(f(fff*(2/13)f)/ffff(-1)/ffff)20 assuming f is positive. f(11332/117) Simplify w*3/ww(w5w)/ww(-3)ww(-3/7)w*5ww6/ww*4/www(3/4) assuming w is positive. w(597/28) Simplify (((m0/m)9/(m(-7)/(mm*(-1/4)m)))(6/7))(-2/21) assuming m is positive. m(1/49) Simplify (i1)*(2/25)/(ii/(i/i*(2/7))ii4i)i5i/(i/(i/i*(-7)))i(i/(((i/i(-5)i)/i)/i)i)/(i2i) assuming i is positive. i(139/175) Simplify ((h(-2/9)h(h*(-2/9)h)/h)/(h*(-1/4)hh/(hh*(2/9)h)))/((h2/h)(-40))21 assuming h is positive. h(30277/36) Simplify (w/(w/w*6))/ww/w*(-3/8)(w(-43))(-2/83) assuming w is positive. w(4921/664) Simplify j/j(-13)j(-2/95)jj50/((j/j16j)/j) assuming j is positive. j(7598/95) Simplify (s2s4)(4/11)/((ss(-1))(2/59)/((ss(-3/7)/s)/ssss(4/7))) assuming s is positive. s(256/77) Simplify (yy(2/23)yyy/(y*5/y)yy8yy(1/22))(-22/7) assuming y is positive. y(-5127/161) Simplify ((ww(2/3))/w)/w4w1/((w(-2/7)/w)/w)(w*3/wwww*2)/((((w/(ww(-1/7)))/w)/w)/(w/w(-2))) assuming w is positive. w(227/21) Simplify ((w/(((w/((w1/w)/w))/w)/w))/ww)(-2/63)/(ww/(w(1/3)/w))(-17)(w(-3)w4)(-2/121) assuming w is positive. w(345208/7623) Simplify ((j(-3)/j(-1))/(j3j/(jj/(j/j*(-5))j)))/((j/j*(-2/7)j)/(j/((jj/((jj(-3/2))/j))/j)))27 assuming j is positive. j(-1557/14) Simplify (w(10/7)/(((w/((w/w*13)/w))/ww)/w)(w/w(-8))(-37))44 assuming w is positive. w(-106128/7) Simplify ((((s/s(5/4))/ss(s(-1/8)ss)/s)/((s/(sss/s0sss))/s)(-1))(-32/5))38 assuming s is positive. s(6536/5) Simplify (v5/(v6v))/(v(2/5)/v(-4))(v(-1/2))39/(v/(v/(vv(-1))))(3/25) assuming v is positive. v(-259/10) Simplify (((pp*(-13)/ppp)/p(1/3))/((pp*(-17)p)/pp(2/11)))8 assuming p is positive. p(1184/33) Simplify (t(-12)/tt)/(t*15t)t/t32t(-4/5) assuming t is positive. t(-299/5) Simplify (a/(a(a(-1/2)a)/a)((a/(aaa(-1)a)a)/a)/a)/(a(-6)a*(3/5))((aaa*(2/5)a)(-7))1 assuming a is positive. a*(-199/10) Simplify ((gg*(-4)g(1/2))/(g/g(-1))*(-22))/((g(g/g(1/3))/g)28)9 assuming g is positive. g(-253/2) Simplify (g(-2))35/(g*(-1/2)/(g/(ggg(-1/6))))g*(-1/6)/ggg(1/3)(((gg1)/g)/g)2 assuming g is positive. g(-421/6) Simplify ll*13/ll*(-7/9)/ll/(l/l*(5/6))l(-23) assuming l is positive. l(-197/18) Simplify (((ii(i*(1/3)/i)/ii)/i*(-4/9)(i(i/i(-1)i)/i)(-5/14))(-7/11))(-3/22) assuming i is positive. i(89/1452) Simplify l(-3/5)/(l(-3)/l)(l(1/3))5((l/(ll/(ll/(l/(l/(l/l*(-2))))))l)/l(-2/5))/(l(-2/5)/l)(-39) assuming l is positive. l(-752/15) Simplify ((((a*(-2/13)a)/a)*(-12)/(aa(-4/7))(-43))(1/36))(-2/107) assuming a is positive. a*(-205/19474) Simplify ((dddd*(-2)d)*(-42)(d/(d/d(-3/5)))22)(1/5) assuming d is positive. d(-486/25) Simplify (((v/(v*15/v))/(vv/v(-3/19)))/(v(-2/19)/v)(-50))(-1/35) assuming v is positive. v(1338/665) Simplify ((z(-23)(z/z(1/68))/zz)/(z(1/19))1)45 assuming z is positive. z(-1282995/1292) Simplify ((c(-1))41)*34/(cc*(11/3)cc(6/7))(-4/15) assuming c is positive. c(-438562/315) Simplify ((u(2/3))(-2/83))(-21/4)((uu(-4/7)uu)/((u/u(3/7))/u))/(u(1/4)/uu(2/7)) assuming u is positive. u(7915/2324) Simplify (q(-3/7)/q6)*(35/6)qq/(q(1/2)/q)qq/(q/q(-1/6))q*(2/11)q6 assuming q is positive. q(-1847/66) Simplify (t(tt(-6/23))/t)(-7)/(t*(4/17)t(-28)) assuming t is positive. t(8833/391) Simplify (y(1/2)/y(2/7)(y(2/7)y)41)/((y(-2/5)y(1/7))/(((yy/(y/y0))/y)/y(1/2))) assuming y is positive. y(1844/35) Simplify (z1z/z(-1/9))/(z/(z/((zz*(1/2))/zz)))*(-3/20)((z(-2/3))(-6/5))49 assuming z is positive. z(14953/360) Simplify (l(-42)/l(-1/5)(l/l(-20))/(l40/l))25 assuming l is positive. l(-1495) Simplify (((cc1)/c)(-12)/(c(-1/8)/c)(-1/93))(1/19) assuming c is positive. c(-2979/4712) Simplify ((www2/w)(-1/24)/(ww/w(-3/2))(-24/7))9 assuming w is positive. w(855/8) Simplify (n/(n/n(-5/3))nn(-10)(nnn*(-2/3)n)(-5/2))(3/14) assuming n is positive. n(-99/28) Simplify (c(1/3)/c*8(ccc/(((c/(cc(-2/5)))/cc)/c)cc)(1/2))/(c(-1/8)/cc/c(-1/9)c)(-31) assuming c is positive. c(9253/360) Simplify ((aa1)(-9/4)a*(-1)/aa4)/(a4a(-1/2)/a)(1/14) assuming a is positive. a(-75/28) Simplify z(1/2)/(zz/(z/z*(-8)))z*(1/6)/(zz*(-2/17))((z/z*(-2/11)zz)/zz/z8)/(z(-2/7)z(-1)) assuming z is positive. z(12770/3927) Simplify ((z/z(-2))/z(z*(-4)z)/z(z/(z(1/12)/z))/z(-7))/((z0)(-22)(z/(z*(-1/2)zz))29) assuming z is positive. z(257/12) Simplify ((((n0)(-7))(-38))(12/5))35 assuming n is positive. 1 Simplify (((((uu*5)/uu)/u)/u)/(u(uu*(-4/3))/u))/((u/(uu*(-2)u)u)/u4) assuming u is positive. u(19/3) Simplify (((o/(o(-2/49)o))/o)/(oooo(-4/19)o))/(o/(o*(-6/7)/o)o(19/3)) assuming o is positive. o(-38932/2793) Simplify (s*21((s/s*(-30)s)/s)/sss*(14/11)(s/s(-5/2))/s)(-5/2) assuming s is positive. s(-6135/44) Simplify ((j(1/17))*(-26)(j(-3/5)/j)(4/31))(-6) assuming j is positive. j(27444/2635) Simplify ((x/x(4/11))(2/31)/(x(5/2)/(x(-4/13)/x)))(3/44) assuming x is positive. x(-100185/390104) Simplify ff/((fff/f(1/8)f)/f)ff*(1/5)f(f/(f/(fff(-2/3)))f)/(ff(-3/2))(((f*(1/13)f)/f)/ff(-1/6))(5/7) assuming f is positive. f(12303/3640) Simplify ((q(-2/7))4(q/q1)/q(2/3))/((qq/(qq(1/2)))(3/19)q2/qq/(q(1/5)/q)) assuming q is positive. q(-18707/3990) Simplify (u/(u*17u))*(9/5)(u/((u/u*(-16))/uu)u)15 assuming u is positive. u(-1278/5) Simplify ((nn*(-2/5))/nn*(5/2)n*(-4/5)n23)(-22) assuming n is positive. n(-2673/5) Simplify r/r3r/r(-2/19)(r(-2/5))(1/94)((r1rr)/rrr)/(rr/(rr/(rr/((r*(5/6)/r)/r))))r(2/7)/(r/r(-2/7)r) assuming r is positive. r(-55339/26790) Simplify ((i(-3/19)i/(iiii(21/5)))/(iii(1/2))(5/12))(-28) assuming i is positive. i*(118097/570) Simplify	{ "pile_set_name": "DM Mathematics" }
Suppose -4t + 10 = p, 4t - 20 = p + 2t. Let y(d) = -8d - 9. Let j be y(p). Suppose -5u - g + j = 3g, 48 = 4u + g. What are the prime factors of u? 11 Let c = 2619 + -16. List the prime factors of c. 19, 137 Suppose 262 = f + 5h - 19, 3h + 1321 = 5f. What are the prime factors of f/30 - (-18)/135? 3 Let g(z) = -164z - 30. What are the prime factors of g(-3)? 2, 3, 7, 11 Suppose -5k + k = -8. Suppose 0 = -6f + 3f - 6, -2m + k = 4f. Suppose mv - 5 - 35 = -5u, -3v = -2u - 44. List the prime factors of v. 2, 3 Suppose 16l + 1272 = 24l. Let d = -54 + l. What are the prime factors of d? 3, 5, 7 Suppose d = -z + 1256, 4z - 4d - 1912 = 3128. What are the prime factors of z? 2, 17, 37 Let n = 44 + -44. What are the prime factors of n/9 + (91 - 1)? 2, 3, 5 Let g = -19 - -16. Let y(b) = 17b2 - 9b - 15. What are the prime factors of y(g)? 3, 5, 11 Let g(i) = -i + 3. Let u be g(6). What are the prime factors of 5148/54 + ((-2)/u)/1? 2, 3 Suppose 0 = 3z - 46 - 44. Let d be (-38)/12 + 5/z. What are the prime factors of ((-26)/d)/((-2)/(-6))? 2, 13 What are the prime factors of (-2)/5-10 - -305? 3, 103 Let t(l) = l*2 - 12l - 25. Let s be t(12). Let m(r) = r*2 + 22r + 48. What are the prime factors of m(s)? 3, 41 Let x(c) = -c*3 + 2c*2 - c - 1. Let j be x(2). Let l(s) = -5s + 2. Let d be l(j). Let k = d + -5. List the prime factors of k. 2, 3 Let z = 31 - 30. Let l be (2 + -5)(-2 + z). Suppose 0 = lu + 2x - 162 - 46, -u + x + 66 = 0. What are the prime factors of u? 2, 17 Let o(s) = s2 - 7s + 6. Let t be (-642)/22 - (-4)/22. Let k = -21 - t. List the prime factors of o(k). 2, 7 Let d(b) = -34b2 + 3b - 1. Let c(o) = 34o2 - 3o + 1. Let n(t) = -4c(t) - 5d(t). What are the prime factors of n(2)? 131 What are the prime factors of (-10)/(4 + (-868)/216)? 2, 3, 5 Let v = -301 + 311. Let n be (-598)/6 - (-1)/(-3). List the prime factors of (5/v)/((-2)/n). 5 Let y be (19/((-19)/(-18)))/((-4)/6). Let m = y + 89. What are the prime factors of m? 2, 31 Let s be (-2)/8 - 51/(-12). Let m(i) = i*2 + 13i - 11. Let c be m(10). Suppose 3x = sx + j - 45, -j = -5x + c. List the prime factors of x. 2, 11 Let f = -555 - -1152. List the prime factors of f. 3, 199 Suppose 0 = -2h - 2b - 256, -4b + 3b + 124 = -h. List the prime factors of 18((-1590)/h + (-4)/14). 2, 3, 37 Let s = -16 - -17. Let y be -2 - s - 0 - -11. What are the prime factors of (-12)/y-54? 2, 3, 5 Let r(q) = -q + 16 - 2q - 23. Let t be r(-4). Suppose tx = -0x + 90. List the prime factors of x. 2, 3 Let g(v) = 4v + 5. Let p be g(4). Suppose 0o - 2o + p = -y, 29 = 3o - 2y. Suppose -50 = -3j + o. List the prime factors of j. 3, 7 Let k be 04/12 + 0. Suppose k = 5r - 6r + 37. Suppose j + 3j - 75 = c, -c - r = -2j. What are the prime factors of j? 19 Let f(x) = -362x - 29. List the prime factors of f(-3). 7, 151 List the prime factors of 101236/36 - ((-51)/27 + 2). 2, 19, 37 Suppose -18w + 14w = 2m - 1572, -3w = 3. What are the prime factors of m? 2, 197 Let p = 9 - -134. Let t = 25 + p. List the prime factors of t. 2, 3, 7 Let z(g) = -26g + 41. List the prime factors of z(-14). 3, 5 Let l = -81 + 81. Let m = -1 - -6. Let y = m - l. What are the prime factors of y? 5 Suppose 7f - 9f = -88. Suppose 0 = -2t + 168 + f. List the prime factors of t. 2, 53 Let q(b) = -3b*2 + 14b - 5. Let l be q(4). Suppose -5u = a - 82, 2u + 314 = -la + 6a. List the prime factors of a. 2, 3, 17 Let h(m) = 5m - 26. Let c be h(6). Let y(p) = 4p*3 - 6p*2 + 6p - 2. What are the prime factors of y(c)? 2, 7, 13 Suppose 0 = -s + 22 + 10. List the prime factors of s. 2 Let v(m) = 3m - 6 + 0 - 2 + m2 - 3. List the prime factors of v(-11). 7, 11 Suppose 0 = -8i + 4i + 2p + 10442, i + 5p = 2638. List the prime factors of i. 3, 13, 67 Let w(i) = -19i3 - i2 - 42i - 10. List the prime factors of w(-6). 2, 5, 431 Let g = 10 - 6. Let d = 82 - 72. What are the prime factors of g/(-10)(-80 + d)? 2, 7 Let a = -8 + 16. Suppose 8 = 4l - a. Let k = 3 + l. List the prime factors of k. 7 Let x(j) = 1325j*2 + 2j - 13. List the prime factors of x(2). 11, 13, 37 Suppose 0 = 3l - 0l - 4f + 5, f + 1 = 0. Let s = -1 + l. List the prime factors of 4199/169 - s/26. 5 Let h = -214 + 300. Let r = -23 + h. List the prime factors of r. 3, 7 Suppose 0 = -2a - 4 - 2. Let f be (-6 - a) + 3 - -4. Suppose 0 = y - r + 3r - 32, -119 = -fy - 5r. List the prime factors of y. 2, 13 Let w = 17 + -12. Suppose 0 = 5n - 2m - 22, 5n + wm = 2n + 7. List the prime factors of (-57)/(-2) + (-2)/n. 2, 7 Let r(s) = 2s2 + s - 1. Let u be 1 - ((-2 - -1) + -2). Suppose 0l - 8 = ul. List the prime factors of r(l). 5 Suppose 2x - 57 = 45. Suppose xg - 624 = 47g. List the prime factors of g. 2, 3, 13 Suppose 5s = 2s + n - 37, -2s + n - 25 = 0. Let m be 15/2 + (-18)/s. Suppose -2w + 105 = -m. What are the prime factors of w? 3, 19 Suppose 3j + 5 = -7, -4d + 5j = -36. Suppose -dm = x - 74, 4x + x + 3m = 438. List the prime factors of x. 2, 3, 5 Let w = 55 + -15. Let t = w + -66. Let n = t + 51. What are the prime factors of n? 5 Let c be 57/95(-10)/2. What are the prime factors of 47 + -9 + 4 + c? 3, 13 Suppose -4z + 5l = -0z - 18, -2z = 4l + 4. Let t be -22 + (-6 - -3) + z. What are the prime factors of 3 - (t + 2 - 2)? 2, 13 Let l(h) = -4h3 - 12h*2 - 3h + 7. What are the prime factors of l(-5)? 2, 3, 37 What are the prime factors of 1/(-5) + 24492/60? 2, 3, 17 Suppose 712 = 2k + 5i, -k + 4k - 1068 = 5i. Suppose 3h = -2h + 3j + k, -274 = -4h - 3j. List the prime factors of h. 2, 5, 7 Let p = 214 + -43. Let o = -111 + p. List the prime factors of o. 2, 3, 5 Let l(r) be the second derivative of r5/10 + r4/12 - 5r*3/6 + 7r*2/2 - 3r. What are the prime factors of l(3)? 5, 11 Suppose 3y - 6q + 7q = 3669, 0 = 3q + 9. What are the prime factors of y? 2, 3, 17 Let n = 59 - -13. Suppose -4 = u + 39. Let b = n + u. What are the prime factors of b? 29 Let n = 3 - -1. Suppose -19 = -nm + 17. List the prime factors of m. 3 Let v(l) = l2 + 5l + 17. Let r be v(-7). Let o = r - -2. List the prime factors of o. 3, 11 Suppose 0 = -3z - 17 + 2, -z = 3w + 5. Suppose w = -9n + 12n - 384. List the prime factors of n. 2 Suppose -3a = 4s - 1301, -3a + 407 = 5s - 1220. What are the prime factors of s? 2, 163 Suppose 17v + 2072 = 24v. What are the prime factors of v? 2, 37 Let x(o) = -o*3 - 3o*2 + 6o. Suppose -21 = 3t - 6. List the prime factors of x(t). 2, 5 List the prime factors of 31 + 0 + (-54 - -545). 2, 13, 19 Suppose -113 = -5g + 427. Suppose -2j + 118 = t, 0 = 2t - t + 4j - g. List the prime factors of t. 2 Let s(p) = p*2 - 2. Let x be s(2). Suppose 0 = -xy + 4y - 18. What are the prime factors of y? 3 Let p(k) = 2k + 24. Let s be p(-5). Suppose 32 = 2j + s. List the prime factors of j. 3 Suppose 4h + h - 2o - 37 = 0, -5h = -4o - 39. Let s(t) = 11t2 - t3 + 9t + 1 - 5t*2 - t. List the prime factors of s(h). 2 Let q(r) = 13r2 + 33 - r2 - 12r + r2 + r3. What are the prime factors of q(-14)? 5 Let p(o) = -30o. Let t be p(-2). Suppose 6k - t = 2k. Suppose 5 + k = 2s. List the prime factors of s. 2, 5 Let f(m) = -4m*2 + 8m + 15. Let l(v) = v*2 - v - 1. Let c(s) = -f(s) - 2l(s). Suppose 0 = 7w - 6w - 6. List the prime factors of c(w). 23 Suppose -5g + 4 = -16. Suppose go - q - q + 112 = 0, 3q - 28 = o. List the prime factors of (-1 - 0)/(-1) - o. 29 Let l(v) = v3 - 17v*2 + 20v + 35. Let h be l(16). Suppose 3t = -3k + 231, 3t + h = 5k - 278. What are the prime factors of k? 2, 19 Let z(j) = 2 + 7j + 5j2 + 1 - j3 + 7j. Let l be z(7). Suppose 3d = -0x - lx + 39, -5 = 5x. List the prime factors of d. 2, 7 Suppose -5a + 3s + 1958 = 0, 0s + 5s = -5. List the prime factors of a. 17, 23 Let f be (-4)/21/(-2). Let d = 2 + f. Suppose -o - 2 = -3y - 25, -3y + 69 = do. List the prime factors of o. 23 Suppose 0 = -o + 3s + 4305, 0o - 5o - 4s + 21487 = 0. List the prime factors of o. 3, 1433 Let q = 316 + -189. What are the prime factors of q? 127 Suppose 44 = 3u + 2w, 4u - 2w - w = 87. Suppose -u = -m + 3s, m + 2*s - 4 = -m. List the prime factors of m. 2,	{ "pile_set_name": "DM Mathematics" }
-27y + 242. Let g be j(9). Let t be b(g). Round t to the nearest ten. 90 Suppose 7p - 10p + 5a - 859920025 = 0, -p = -5a + 286640025. Round p to the nearest 1000000. -287000000 Let c = 53.17 + -10.47. Let q = c - 359.7. Let v = q - -316.99999841. Round v to seven decimal places. -0.0000016 Let z be ((-859814)/4)/((-20)/40). Let f = z - 943573. Let o = f + 6913666. What is o rounded to the nearest 1000000? 6000000 Let u be (11 + 1)(-4 - 21/(-7)). Let z(s) = 2s2 + 9s - 9. Let d be z(u). Let b = d - 366. What is b rounded to the nearest ten? -200 Let h = 350 - -297. Let z = -420 + h. Let b = z - 214.9. Round b to the nearest 10. 10 Let u = 113.0259 - 0.0259. Let a = -112.9999853 + u. What is a rounded to five decimal places? 0.00001 Let v = 2354.4562 + -2354. What is v rounded to 2 dps? 0.46 Let r = 3.03 - -0.07. Let g = 2.4 + r. Let l = -5.401 + g. What is l rounded to 2 decimal places? 0.1 Let z = 0.632 - 0.404. Let h = 0.0838 - z. Round h to two decimal places. -0.14 Let z be -2399((-2)/(-5))/((-17)/85). Suppose -1158 = -14k - z. Round k to the nearest one hundred. -300 Let i = 2266606426 + -2266606545.0000027. Let g = i + 119. What is g rounded to 6 dps? -0.000003 Let g(j) = -4274j - 1796. Let s be g(131). What is s rounded to the nearest 10000? -560000 Let z = 0.32143 - 0.340733. Round z to 3 decimal places. -0.019 Let s = 562.07585 + -561.8. Round s to 2 decimal places. 0.28 Let d = 31096 + -31095.99946409. Round d to 4 decimal places. 0.0005 Let t = 10082.03656 + -10082. What is t rounded to three dps? 0.037 Let m = -75642 + 75641.999967081. What is m rounded to five dps? -0.00003 Let l = -0.668 + 0.6147. What is l rounded to 2 dps? -0.05 Let v = 9973.110142 - 9973. Let y = 0.11 - v. Round y to five decimal places. -0.00014 Suppose 176 = -2n - 14. Let q be (-2)/(-5) + (-10425927)/n. Suppose -364253 = 3f + q. What is f rounded to the nearest 10000? -160000 Let o = 47135 + -47135.0031189. Round o to 5 dps. -0.00312 Let l be (-4)/((-32)/60)(-37664)/(-33). Let h = -14380 + l. Round h to the nearest one hundred. -5800 Let c = -8855.0015629 - -8855. What is c rounded to 3 decimal places? -0.002 Let g = -6355861.10400072 + 6356106.104. Let m = g + -245. Round m to six decimal places. -0.000001 Let s = -1.8395342 + -0.0965208. Let b = -1.94 - s. Round b to four dps. -0.0039 Let n be -5 + (26/39)/((-2)/(-27)). Suppose -300933 - 190267 = 4i + l, -nl = -5i - 614000. What is i rounded to the nearest ten thousand? -120000 Let i = -3241.985830232 + 0.985984932. Let o = i - -3241. What is o rounded to 5 decimal places? 0.00015 Let b(q) = q3 - 3q*2 - 25q + 88. Let s be b(4). Suppose -2r - 30019995 = 2k - 3k, k = sr + 60039995. What is r rounded to the nearest one million? -15000000 Let o be 11443508400/640 + (-1)/(-8). Suppose -14r - o = 35011518. What is r rounded to the nearest 1000000? -4000000 Let w = 735 - 709.74. Let a = -27.103 - -1.103. Let s = a + w. Round s to 1 dp. -0.7 Let j = -0.1351 - -0.1348773. Round j to 4 decimal places. -0.0002 Let z(n) = -n2 - 5041n*3 - 4 - 4n - 1 + 4 - 3n2. Let r be z(-1). What is r rounded to the nearest one thousand? 5000 Let g = -2473 - -2473.000019504. Round g to 5 dps. 0.00002 Let y = 3.95 - 3.3. Let i = -110020.650035 - -110020. Let u = i + y. Round u to five dps. -0.00004 Let q = -5158 + 5157.9986168. Round q to 3 dps. -0.001 Suppose 8y = -33683 - 8728 + 5907. What is y rounded to the nearest one thousand? -5000 Let d(c) = 9c - 950. Suppose 1 = y - 4b, -1 = 2y + 3b - 14. Let q be (4 - (y - 1))1/(-2). Let l be d(q). What is l rounded to the nearest one hundred? -1000 Let p = -4949 - -14550. Suppose 2l - 3l + p = -2h, l + 14399 = -3h. Round h to the nearest one thousand. -5000 Let k = 15.6983 - 12.84677. Let h = 1649 - 1651.85. Let y = h + k. What is y rounded to four dps? 0.0015 Suppose -2t + t - 5 = 0, -5d - 3t = -983199985. Suppose -14h + 6h = -d. Round h to the nearest one million. 25000000 Let y = -80 - -96. Let v be -2(3288/y + -8). What is v rounded to the nearest one hundred? -400 Let k = -6.37 + 6.4075. Let h = k - 0.093. What is h rounded to 2 dps? -0.06 Let q = 28962 + -28963.5549. Let c = -1.548269 - q. Round c to three dps. 0.007 Let b be 2220/75 - (1 + 21/(-15)). Suppose 22s = -bs + 11180. Round s to the nearest 10. 220 Let x = 5009.86 - 8283.57. Let f = x - -3273.50999868. Let g = 0.2 + f. Round g to seven dps. -0.0000013 Let s = 292131.00661 + -291752.006610675. Let l = 379 - s. What is l rounded to 7 dps? 0.0000007 Let t(h) be the first derivative of -h2/2 - 34h - 11. Let j be t(28). Let u = -48 - j. What is u rounded to 0 decimal places? 14 Let j = -0.8749 + 0.765. Round j to two dps. -0.11 Let n = 395.74 + -394. Let t = n - 1.73982. What is t rounded to 5 dps? 0.00018 Let u = -67.24 + 69. Let n = 0.56 - u. Let b = n + 1.2035. What is b rounded to two dps? 0 Let m = -15893 - -15893.000044164. Round m to 5 decimal places. 0.00004 Let n = 31.536 - 31.5360026147. What is n rounded to 7 decimal places? -0.0000026 Let p = 651.63 + -649. Let u = p - 2. Let z = u + -0.6300029. Round z to seven dps. -0.0000029 Let z = 612.85 - 609. Let p = -3.84999326 + z. Round p to seven decimal places. 0.0000067 Let p = 1600332 - 1600337.3355116. Let r = p - 0.0644284. Let n = r + 5.4. What is n rounded to 5 dps? 0.00006 Let q = -29.73 + 0.73. Let n = -29.00000057 - q. What is n rounded to six decimal places? -0.000001 Let x = -97.0357 + 97. Let n = 0.0356861 + x. Round n to 6 dps. -0.000014 Let a(k) = -2k + 47. Let p be a(16). Suppose 4h + h - p = 0. Suppose -d = -z + 3980003, -d = -0 + h. What is z rounded to the nearest 100000? 4000000 Let t = 168.7 + -566.66. Let b = 406 + t. Round b to 0 dps. 8 Let f be 1392120 + 27/(-216) + 79/(-8). Round f to the nearest 100000. 1400000 Let l = -4332 - -4397.89. Let n = 65.37 + 0.63. Let w = n - l. What is w rounded to 2 decimal places? 0.11 Let j = -1.38 - -0.18. Let d = j - -0.63. Let h = 0.517 + d. What is h rounded to 3 dps? -0.053 Let w = -105 + 104.59. Let k = w - 0.02. Let v = k + 1.13. What is v rounded to the nearest integer? 1 Let l = -59318 + 59369.279. Round l to 1 dp. 51.3 Let w(s) = -12s - 19. Let u(m) = -13m - 20. Let f(b) = -5u(b) + 6w(b). Let y be f(-5). Let c = y - -38. What is c rounded to the nearest 10? 60 Let f = -0.04656 + -0.59564. What is f rounded to one decimal place? -0.6 Let q be ((-3)/9)/((-2)/60). Let n be (q - 3) + 1592979/3. Round n to the nearest 100000. 500000 Let g = 345 + -343.1161. Round g to two dps. 1.88 Let h = 513.7099941673 + -513.71. Round h to seven decimal places. -0.0000058 Let s = -0.7261 - -0.676. Let q = s + 0.049987. What is q rounded to 5 dps? -0.00011 Let j = 6769 + -1989. Let u = j - -57220. What is u rounded to the nearest 100000? 100000 Let a = -205.9829 + 206. Let f = 0.0171229 - a. What is f rounded to six decimal places? 0.000023 Let a = -0.206 - 149.794. Let k = -8.6558 - 141.1872. Let s = k - a. What is s rounded to two decimal places? 0.16 Let y = -118.8293 + 0.1793. What is y rounded to the nearest ten? -120 Let a = 367 + -22. Let o = 4433 + -4817.4. Let u = a + o. Round u to the nearest 10. -40 Let u(g) = 18g + 9. Let m be u(9). Let a = 370 - m. Let t = a - 350. What is t rounded to the nearest 10? -150 Suppose 68l = 73l - 390690. Let h be (-12)/(-5) + (-4)/10. Suppose hx + l = 924138. What is x rounded to the nearest 10000? 420000 Let p = 287163 + -595550. Let l = p - 170613. What is l rounded to the nearest 10000? -480000 Let y(v) = v*2 + 32v - 153. Let t be y(-36). Let r(f) = 553350f + 150. Let k be r(t). What is k rounded to the nearest one million? -5000000 Let q = 112180662.33442 - -24911682.67197. Let s = q + -137091151. Let u = 1194 - s. What is u rounded to four dps? -0.0064 Let b = 21217.0000037279 + -21217. Round b to seven dps. 0.0000037 Let p(g) = -5 + g3 - 6g + 3g + 5g*2 + g. Let c be p(-5). Suppose 4x - cs + 20440005 = 0, 2x = 4s + 5831469 - 16051473. Round x to the nearest 100000. -5100000 Let r = -14.82946258 - -14.83. Round r to 5 dps. 0.00054 Let i = 1443.330738 + -0.020738. Let z = -1460 + i. What is z rounded to the nearest integer? -17 Let x(f) = -f3 - 16f*2 - 4f + 38. Let v = 12 + -29. Let b be x(v).	{ "pile_set_name": "DM Mathematics" }
9. Let f = -45 + m. Round f to 5 decimal places. -0.00002 Let j = -324447 - -510589. Let c = j - 186142.0200078. Let f = c - -0.02. Round f to six decimal places. -0.000008 Let g = -13.77 - -14. Let x = 0.2361 - g. Round x to 3 decimal places. 0.006 Let b = 90.3366 - 150.24396. Let f = 61.607 + b. Let o = -1.7 + f. Round o to four decimal places. -0.0004 Suppose -3c = 2i + 16 + 272, 2c + 192 = -3i. Round c to the nearest one hundred. -100 Let j = 0.4 - 0.2. Let u = j + -0.3. Let d = u + 0.09999998. Round d to 7 dps. 0 Let b = -102.8 - -90. Let g = 169.2075 + -156.40803. Let d = b + g. Round d to four dps. -0.0005 Let a = -1.3 - -0.1. Let r = -0.2 - a. Let w = -1.00001 + r. What is w rounded to five decimal places? -0.00001 Let s(j) be the second derivative of j*4/12 - 2j3/3 + j2/2 + j. Suppose 0 = -r - r + 8. Let h be s(r). What is h rounded to one decimal place? 1 Let g = -72205 - -196704. Let o = g - -15501. What is o rounded to the nearest one hundred thousand? 100000 Let n = -0.051 - -0.0507. Round n to 3 decimal places. 0 Let n = -0.3983 - 49.8317. Let p = -104 + 154. Let s = n + p. Round s to one decimal place. -0.2 Suppose 5r - 22407240 = 61592765. Suppose 3z = -g + r, -g + 11200002 = 2z + g. What is z rounded to the nearest one million? 6000000 Let x = 66 - 65.971. Round x to 2 decimal places. 0.03 Let k = 5 + -5.000003. Round k to six decimal places. -0.000003 Let w = 22255 - 4179. Let l = w + -108076. Round l to the nearest 100000. -100000 Let y(s) = -346941s*2 + 18s - 17. Let a be y(7). What is a rounded to the nearest 1000000? -17000000 Let v = -197.3 - -208. Let z = 10.771 - v. What is z rounded to two decimal places? 0.07 Let b(s) = -3s3 + s2 + s. Let c be b(-1). Suppose -5j + 3j - 120002 = -5n, cn - 71999 = -j. Round n to the nearest 10000. 20000 Suppose 16776 = -4h - 41520. Let z be (h/8)/((-2)/16). Suppose -17431 = 4s - 5d + z, s + 4d = -7996. What is s rounded to the nearest 1000? -8000 Let z = 1870 + -1870.0000909. What is z rounded to 5 decimal places? -0.00009 Let v be 6 - -3 - (-1)/(-1). Suppose 4s = vs - 32. What is s rounded to the nearest ten? 10 Suppose -25583963 = -2h + o, 0 = -3o + 12 + 3. Let k be h/(-104) + (-4)/26. What is k rounded to the nearest 10000? -120000 Suppose c + 2t - 34008 = 0, -c - 3c + 5t + 136006 = 0. Suppose -a = -0a - x - c, -4a - x + 135996 = 0. Round a to the nearest 10000. 30000 Let l = 4.36 - -260.64. Let q = 266.17 - l. What is q rounded to 1 decimal place? 1.2 Let r(m) = m*3 + 10m*2 + 11m + 12. Let i be r(9). Suppose 0 = -3d + 4w + w + 990, -5d - 5w = -i. Round d to the nearest 100. 300 Let m = -1448.71 + -727.24. Let a = 2223 + m. Let i = a + -48. What is i rounded to 1 dp? -1 Let p = 133.7065698 + -133.67. Let u = p + -0.9365178. Let k = u + 0.9. Round k to 5 dps. 0.00005 Let w(a) = -9a3 + 5a*2 - 4a + 2. Let g be w(4). What is g rounded to the nearest 100? -500 Let s = -0.005 - -0.067. What is s rounded to 2 decimal places? 0.06 Let f = -0.134465 + 0.08446. Let r = 0.05 + f. What is r rounded to five decimal places? -0.00001 Let n(i) = 1939i2 - i. Let o be n(-1). Suppose -4p + 5r = 260015, p - o + 66931 = -3r. What is p rounded to the nearest ten thousand? -70000 Let j = -16 - -16.009. Round j to 3 dps. 0.009 Let u = -0.24972 + 0.25. Round u to four dps. 0.0003 Let x = 17238 - 17131.198. Let w = x + -107. Round w to 2 decimal places. -0.2 Let u = 160.0000396 + -160. What is u rounded to five decimal places? 0.00004 Let i = 32 + -32.0000004. Round i to 6 decimal places. 0 Suppose 31417366 + 19182649 = -2i - 5g, -i + 4g - 25299988 = 0. What is i rounded to the nearest 1000000? -25000000 Let n = -8 + 13. Let q = n + -5.55. Round q to one decimal place. -0.6 Let p be 8100002/(-5) - (-10)/25. Round p to the nearest one hundred thousand. -1600000 Let n = -0.009389364 - -10.009389164. Let g = 10 - n. Round g to six decimal places. 0 Let y(u) = 84u*2 - u. Let h be y(1). Let d = 52 + 1131. Suppose c + h = d. Round c to the nearest 1000. 1000 Let a = 21213158 - 11513158. Round a to the nearest 1000000. 10000000 Let x = -1.6859 - -0.0409. Let f = -0.6 - 1. Let m = f - x. Round m to two dps. 0.05 Let w = -0.15 - -0.18. Let u = -0.0299993 + w. Round u to six dps. 0.000001 Let l be (-28 - -4)/112500. What is l rounded to the nearest 1000000? 0 Let u = 18.26 + -18. Let r = -591922.2600044 - -591922. Let x = r + u. Round x to 6 dps. -0.000004 Suppose 0 = 3o + 3 + 3. Let i be 1o/4-10. Suppose -5t - 2d = 4298, 0 = -it + 2d + 1127 - 5429. What is t rounded to the nearest 100? -900 Let g = -0.074 + -31.926. Let z = 32.000051 + g. Round z to 5 dps. 0.00005 Let z = 5902222 - 5902219.000013. Let i = z + -3. Round i to five decimal places. -0.00001 Let x = 2 - 1. Let d = -1.00156 + x. Round d to four dps. -0.0016 Let y = -50.5 + -10.5. Let q = y + 55.9. Round q to the nearest integer. -5 Suppose -33 = -8m + 39. What is m rounded to the nearest 10? 10 Let r = -4 - -5. Let a be (-10)/(3/153r). Round a to the nearest 100. -500 Let r be (-760)/((-28)/16 + 2). What is r rounded to the nearest one hundred? -3000 Let d = 137 - 143.57. Let w = -0.37 - d. What is w rounded to the nearest integer? 6 Suppose -4s + 2s - 6 = 0. Let j be (1 - (2 + s)) + -602. What is j rounded to the nearest one thousand? -1000 Let w(s) be the first derivative of s2 - 5s + 3 + 55/3s3. Let u be w(5). Round u to the nearest one hundred. 1400 Let a = 25.69 - 26. Let x = a + 1.26. What is x rounded to 1 decimal place? 1 Let n = -146 + 45. Let i = -43 - n. Round i to the nearest 10. 60 Let f = -3.745461 - 61.384564. Let x = -64.93 - f. Let y = x + -0.2. What is y rounded to 5 decimal places? 0.00003 Let v = -7389.00900055 - -7389.609. Let l = v + -0.6. Round l to 7 decimal places. -0.0000006 Let r = 0.078 - 0.0779748. Round r to 6 decimal places. 0.000025 Suppose -4u = 2u + 129564. Let d = -11594 - u. Round d to the nearest 10000. 10000 Let w = 281 + -396. Let v = w + 115.00141. Round v to 4 decimal places. 0.0014 Let r = -15.2628 + 16.863. Let q = -1.6 + r. What is q rounded to 4 dps? 0.0002 Let w = 2.96 - 3. Let l = -4.04 - w. Let t = 3.999962 + l. Round t to five dps. -0.00004 Suppose -3p - p = -12. Suppose pf = 2f - 10. What is f rounded to the nearest 100? 0 Let s = 6.3 + -23.81. Let y = -13 - -30. Let h = s + y. Round h to 1 dp. -0.5 Let j = -17.5757821 + 8.57578246. Let k = j + 9. What is k rounded to seven decimal places? 0.0000004 Suppose -2g + 16176 = -3o, 4o + 5g + 22842 - 1297 = 0. Round o to the nearest one thousand. -5000 Let d = 23 - 22.9816. What is d rounded to three decimal places? 0.018 Let b = -0.07 - 4.93. Let o = -10 - b. Let h = o - -4.999997. What is h rounded to five dps? 0 Suppose 3x + 276 = -g - 2x, -3g + 2x = 743. What is g rounded to the nearest ten? -250 Let n = -11.8 - -12. Let r = n + 0.2. Round r to 1 dp. 0.4 Let u = 0.26 - 0.25999958. What is u rounded to seven decimal places? 0.0000004 Let u = 0.04 + -0.34. Let g = -0.04 + -2.86. Let w = u + g. Round w to the nearest integer. -3 Let v = -367 + 369.94. What is v rounded to 1 decimal place? 2.9 Let c = 97.000246 + -97. Round c to five decimal places. 0.00025 Let z = -137159 + 137159.0900028. Let t = 0.09 - z. What is t rounded to 6 decimal places? -0.000003 Let g = -1.683 - -1.91. Round g to 2 decimal places. 0.23 Let o = -0.233 - -0.232889. What is o rounded to 5 dps? -0.00011 Suppose 1674997 = 5l + g, 0 = -4l + 2l - 2g + 669994. What is l rounded to the nearest one hundred thousand? 300000 Let o(c) = -12638c + 3. Let d be o(-4). Let x = d - 95555. Round x to the nearest ten thousand. -50000 Let x = -3.56 + 3.5599853. Round x to six decimal places. -0.000015 Let y = -130.3 + -9.7. Let w = y + 256. Let u = w - 110.1. Round u to zero dps. 6 Let q = 15.9999998 - 16. What is q rounded to 7 dps? -0.0000002 Suppose 24080495 = 5s - 2m - 13454064, 4m = -8. Let r be -3 + 2 - 5301382. Let z = r + s. What is z rounded to the nearest 1000000? 6000000 Let b be 1-46/(-8). Suppose bc - 2r = -21910, 4r + 409 = -c - 6871. Round c to the nearest 1000. -7000 Let l = -23 - -58. Let z = -605.9 + 574. Let p = z + l. Round p to the nearest integer. 3 Let y = 28 + -64. Let r =	{ "pile_set_name": "DM Mathematics" }
ommon factor of 85 and t. 17 Let i(a) = 2a - 4. Let t be i(3). Suppose tu = 10, o = -o + 2u + 30. What is the greatest common divisor of o and 40? 20 Suppose 26w - 4932 = 1438. What is the highest common factor of w and 21? 7 Suppose -1842 = -25x + 4108. What is the greatest common factor of x and 42? 14 Suppose 0 = 3o + 148 - 400. Suppose -4a + o = s, -4a - 76 = -0s - s. Calculate the greatest common factor of s and 10. 10 Suppose p - i - 616 = 840, -2i = 0. Let x = p + -1040. What is the greatest common factor of 52 and x? 52 Let d(u) = 2u3 - 73u*2 - 32u - 61. Let n be d(37). Calculate the highest common factor of 527 and n. 31 Let i be (-1)/4 + 60/(-16). Let h(k) = 5k2 + k - 1. Let r be h(i). Let u = -2233 + 2248. Calculate the highest common factor of u and r. 15 Suppose y + 3z - 69 = 0, -2y + 94 = -z - 4z. What is the highest common factor of 399 and y? 57 Suppose -45 = -2r - 5b, 50 = -2r + 5r + 4b. Let x(h) = 10h*2. Let a be x(1). Calculate the greatest common factor of r and a. 10 Suppose 151 - 596 = 4u - q, 4u - 2q = -442. Let j = u - -121. What is the highest common factor of 135 and j? 9 Suppose 138 = 4p - 5v, 2p - v = 89 - 23. Suppose 12 = -2x - 5f, 5x - 2f - 15 = 13. What is the greatest common factor of x and p? 4 Suppose -i = 2w + w - 2, 8 = 3w + 4i. Suppose w = -24c + 13c + 22. What is the greatest common factor of c and 2? 2 Let r(z) = 12z2 + 3z + 2. Let m be r(3). Let k(h) = 1 + 3 - 3h - 2 + 0. Let p be k(-5). What is the highest common factor of p and m? 17 Let r(c) = -3c*2 + 111c - 9. Let n be r(36). What is the greatest common divisor of n and 90? 9 Let b be -3(0 + 10/(-3)). Let v = 70 - 59. Suppose -6z - 100 = -vz. Calculate the highest common factor of b and z. 10 Let n(j) = -j2 - 10j - 12. Let c(s) = -2s2 - 19s - 23. Let d(l) = -4c(l) + 7n(l). Let t be d(-5). Calculate the highest common factor of 12 and t. 3 Let l(k) = -2k + 6. Let d be l(-5). Let p(c) = -5c*3 + 4c2 - c + 6. Let m be p(3). Let o = 80 - m. What is the greatest common factor of o and d? 16 Let w(v) = v3 - 2v + 6. Let t be w(0). Let f = -58 - -111. Suppose u - f = -11. What is the greatest common divisor of u and t? 6 Suppose -44 = -2n - 2d, -3n + 0d + 69 = 4d. Suppose 6g = 3g + j + 21, -2g + n = j. What is the greatest common factor of g and 2? 2 Let b be 108/6321/(-3). Let z be ((-28)/8)/(-7)b. Let p be ((-222)/(-18))/((-2)/z). What is the highest common factor of p and 74? 37 Let y(b) = 2b*3 - 13b*2 - 5b - 1. Let d be y(10). Suppose -9r + 1214 = -d. What is the greatest common factor of r and 23? 23 Let v = 852 - 831. Calculate the greatest common divisor of 12 and v. 3 Let o = 13 + 27. Let b be 119/15 + (-65)/(-975). What is the highest common divisor of o and b? 8 Suppose -2v + 5g - 92 = 0, 0 = 2v - 2g + 2 + 78. Let m = v - -140. Let z = 20 - 7. What is the greatest common factor of m and z? 13 Suppose -39 + 15 = -6i. Let z be -1 - (3 - 4 - i). Suppose -5u - zc + 129 = 0, -u + c = -4u + 83. Calculate the greatest common divisor of 319 and u. 29 Suppose -2d - 8 = 2n, 8d - 1 = -2n + 3d. Let p(g) = g*2 + 10g + 23. Let h be p(n). What is the highest common divisor of h and 6? 2 Let l be (2/4)/((-12)/(-3456)). What is the greatest common divisor of 16 and l? 16 Let o = -11 + 10. Let m = o + 12. What is the highest common factor of m and 121? 11 Let q = -112 - -53. Let t = q + 7. Let b = t + 79. What is the greatest common factor of 9 and b? 9 Let k(d) = d*3 + 7d*2 - 10d + 9. Let l be k(-6). What is the highest common factor of 75 and l? 15 Let g be ((-2)/5)/(7/210). Let k(p) = p*3 + 13p*2 + 10p - 9. Let x be k(g). What is the greatest common divisor of 10 and x? 5 Let x be (-1)/(-2) + (-1212)/(-24). What is the highest common factor of 34 and x? 17 Let u(q) = -3q - 7. Let m = -17 - -6. Let r be u(m). What is the highest common factor of 104 and r? 26 Let b be 4/(-1 + 5) + 5. Suppose ba - 4t + 4 = 2a, a + 5 = 3t. Calculate the highest common divisor of 5 and a. 1 Suppose q - 4y = -4, 4 = 3q - y - 3y. Suppose qc + 124 = 188. What is the highest common factor of 1 and c? 1 Suppose 50m - 22213 = -6713. What is the highest common divisor of 10 and m? 10 Suppose 18 = u - p, -3p = 5u - 7p - 87. Let c be 2/(2(-1)/4). Let d be (-10)/c-2-1. Calculate the highest common factor of u and d. 5 Let a(s) = 2s2 + 7s - 14. Let c be a(-7). Suppose c = -w + 163. What is the greatest common divisor of 16 and w? 16 Suppose -4h + 189 = 4d - 3h, -3d - 5h = -163. What is the highest common divisor of 115 and d? 23 Let d(q) = 2q*2 - 4q + 1. Let f be d(3). Let k be -1 + 2 + 7 + f. Let m = 4 + k. What is the greatest common factor of m and 57? 19 Suppose 6h - 123 = 3h. Let z = h - 21. What is the greatest common factor of 60 and z? 20 Let y = -1 + 63. Let k = -56 + y. Calculate the greatest common factor of 4 and k. 2 Let x be (78/(-12)2)/(3/(-6)). What is the highest common divisor of 26 and x? 26 Let n = 25 - -85. Let i be (-4)/(5/(-75)6). What is the greatest common factor of n and i? 10 Suppose 0 = -2s - 7 + 3. Let q = s - -6. Suppose 0 = 2r - h - 59, -2r = h + h - 50. Calculate the greatest common divisor of r and q. 4 Suppose 1 = -5p - 179. Let m = p + 92. Suppose -4y = -2y - 16. What is the highest common factor of y and m? 8 Let b(y) = -y + 12. Let u be b(0). Let w = u - 7. Suppose 0 = -4x + 3o + 453, -wx + 0x - o + 590 = 0. Calculate the greatest common divisor of x and 13. 13 Suppose 0 = -31h + 44h - 104. Let z(v) = v*3 - 2v*2. Let w be z(4). Calculate the greatest common factor of w and h. 8 Let h = 16 - 11. Suppose 0 = -5d + m + 355, 0 = hm + 8 + 17. Calculate the greatest common divisor of d and 14. 14 Let k be 6/(8/((-16)/(-3))). Suppose 0 = -5h - 2w + 147, kh - w = -3w + 118. What is the greatest common factor of 58 and h? 29 Let f(m) = 5m - 2. Let x be f(1). Calculate the greatest common factor of 27 and x. 3 Let k = -1387 - -1417. Suppose 3j = 82 + 98. Calculate the highest common divisor of k and j. 30 Suppose -14l - 920 = -37l. What is the highest common divisor of l and 8? 8 Suppose 7a = 2a. Suppose 2u - 4 + 5 = -5r, a = 3u - 2r - 8. Suppose -4d - 2s = -u, 4s = -0s - 12. What is the greatest common divisor of 6 and d? 2 Let b(u) = u - 4. Let t be b(9). Suppose 5r + 122 = 2y, ty - 45 = 3r + 241. Suppose -w + 160 - y = 0. Calculate the greatest common factor of 13 and w. 13 Let m(i) = 0i - 10i2 + 11i*2 - 6i + 7. Let k be m(6). Suppose 3v + k = -w, 3w = -v + 1 + 2. What is the greatest common factor of w and 2? 2 Suppose -4b - 2r + 104 = 2, 2r - 6 = 0. Calculate the highest common factor of 216 and b. 24 Let g = 1288 - 232. What is the highest common divisor of 33 and g? 33 Suppose 0 = -4g + 12, -13 + 1 = -3j + g. Suppose 4h - j + 1 = 0. Let l = -9 + 11. Calculate the greatest common factor of l and h. 1 Suppose -617 = -5w - 137. Let l(q) = 5q*2 - q. Let k be l(1). Suppose -57 = -3x + u, -kx = x - 2u - w. What is the greatest common factor of x and 144? 18 Let g(l) = 14l - 58. Let f be g(11). Calculate the highest common factor of 12 and f. 12 Suppose 3c - 42 + 6 = 0. Suppose -r + 12 = 33. Let y = r + 105. What is the greatest common factor of y and c? 12 Let i = -663 + 743. What is the greatest common factor of 5 and i? 5 Let z = -15 - -15. Suppose z = -4f + f - 3, 2k + 4f = -30. Let g = 29 + k. Calculate the highest common factor of g and 80. 16 Suppose 60 + 140 = 373h - 369h. Let r(b) = 149b*2 + 1. Let a be r(-1). Calculate the greatest common factor of h and a. 50 Let g = 663 - 513. What is the highest common factor of 325 and g? 25 Suppose 0 = -f + 5r - 1, 2f + r + r - 10 = 0. Suppose 0 = fk + 3b - 90, 0k + b = -4k + 94. What is the highest common factor of k and 12? 12 Let r(f) = -2f - 4. Let c be r(-5). Let h be 3(0 - ((-5)/15 - 1)). What is the highest common factor of h and c? 2 Suppose 812 + 1840 = 12t. What is the greatest common divisor of 39 and t? 13 Suppose 3 + 0 = 3h - 3t, -5t = -3h - 5. Let y(w) = 45w - 33. Let l be y(h). Calculate the greatest common factor of l and 24. 24 Suppose -24 = -186b + 184*b. Calculate the great	{ "pile_set_name": "DM Mathematics" }
, 0 = 3r + 2u - 122484. Is r a multiple of 11? True Let i = 255 + 49. Let d be i((-60)/(-48) + 2/(-8)). Suppose z + z - d = 0. Is z a multiple of 13? False Suppose a - 135 = -4a. Let q be ((-9)/a)/((-1)/(-33)). Let n = 41 + q. Is n a multiple of 18? False Let i(p) = -p*2 + 1. Let c be i(0). Suppose 11 = n - c. Suppose -ns + 7s = -100. Does 10 divide s? True Let z = -3690 + 6090. Does 20 divide z? True Let n(u) = -775u - 1961. Does 23 divide n(-7)? False Suppose 6 = -3a, 4a - 7485 = 5g - 18283. Suppose -35c + 33c + g = 0. Is 13 a factor of c? True Suppose -17 = -f + 28. Let l = f + 47. Let u = l + -77. Does 5 divide u? True Let x be 0 - (-5 - -1 - 413). Let s = -89 + x. Is 8 a factor of s? True Let d be 0 + -5 + 7 + 3. Suppose -du + 3b = -b - 220, -u - 3b = -25. Is u a multiple of 3? False Suppose 4k + 4x - 8424 = 0, 10506 = -442k + 447k - x. Is 4 a factor of k? False Suppose -113220 = -24i - 13i. Does 102 divide i? True Let y(f) = 221f + 84. Let v(g) = 73g + 29. Let j(x) = 17v(x) - 6y(x). Does 46 divide j(-5)? True Suppose -5h + 15 = -50. Let u(y) be the first derivative of -y3/3 + 7y*2 + y - 11. Does 3 divide u(h)? False Let a = -41847 + 43329. Is 13 a factor of a? True Suppose -2o - 5n = -35, 3o + 0n = -2n + 36. Suppose 3g - 455 = -og. Let z = -2 + g. Is 12 a factor of z? False Let q = 42057 + -23278. Is q a multiple of 22? False Suppose 5x + 215 = 5p, -189 + 11 = 4x - p. Let k be 78/27 + 8/(-9). Does 6 divide (29 - (k - 0))(-120)/x? True Let s(i) = -51i + 3626. Is 10 a factor of s(14)? False Is 14 a factor of ((-145168)/215)/((-2)/10)? False Suppose 3g - 652 = -655. Let t(q) = 74q2 + 4q + 4. Is t(g) a multiple of 37? True Suppose -5i - 3z = -z - 37, -4i - 5z = -33. Suppose -700 = -iv + 1484. Is 39 a factor of v? True Is 17 a factor of (-7 + (5 - (-7)/14))-5542? True Let c = -176 - -176. Suppose -u - 5n + 568 = c, -12n = -16n - 16. Is u a multiple of 17? False Let c(r) = -r3 + 13r*2 - 13r + 20. Let m be c(12). Let j = m - -10. Suppose 4o - j - 66 = 0. Does 21 divide o? True Suppose -639t = -786t + 559776. Is 16 a factor of t? True Let m(a) = -91 - 4a*2 + 5a + 10a + 5a*3 - 3a*3 - 14a2 + a2. Is m(11) a multiple of 11? False Suppose -111 = -2f - 3z - 37, 0 = -2f - 4z + 70. Let y = f - 39. Does 19 divide (-245)/(-5) + y + -4? False Let f(q) = -5q + 9. Let r be f(0). Suppose -33o + 576 = -ro. Is 4 a factor of o? True Let j = -37 - -34. Let l be j/(-1) + -5 - -38. Suppose -a = -107 - l. Is 23 a factor of a? False Is 20 a factor of 60/(-2 - 3)((-3068)/12 - -7)? False Let f = -10188 - -19356. Is 25 a factor of f? False Let i(w) = 3w2 - 8w + 5. Let x be i(11). Suppose 55c = 57c - x. Suppose 4a + 158 = 3f, -4f - 5a + c = -f. Does 11 divide f? False Let r be (-10)/2 + (141 - (-1)/(-1)). Let t be ((-696)/(-32))/(1/(-4)). Let v = t + r. Does 11 divide v? False Let f be (2253/6 + (-1)/2)/1. Suppose 5i - 3i + 174 = q, -2q - 5i = -f. Is 15 a factor of q? True Let c(k) = -189k - 20. Let v be c(-3). Let t = 842 - v. Is 31 a factor of t? False Suppose -4x = -x - 174. Let o = x + -94. Let v = 45 + o. Does 2 divide v? False Let p(x) = -x*3 - 3x*2 + 2. Let j be p(2). Let i = 24 + j. Is 13 a factor of (1 - 7)/(i/(-39))? True Suppose -c + 39 = -8. Let a = 51 - c. Suppose 4f + 2h = 54, 0f + 2h + 74 = af. Is f a multiple of 16? True Let z be 7542/(-42) + (-9)/21. Does 28 divide (-21)/9(-19)/((-95)/z)? True Is 86 a factor of 407654/10 - 3003/2145? True Let r(x) = -2x*2 - 251x*3 + 26 + 44x - 44x - 25. Is r(-1) a multiple of 25? True Suppose 10o + 18o = 140. Suppose 0 = -oc - 3k + 4018, 5c - 3263 = 2k + 775. Is c a multiple of 31? True Let y(q) = 9q*2 - q - 5. Let i = 56 - 53. Let l be y(i). Let g = l + -36. Is g a multiple of 37? True Let n = 37076 - 25736. Does 18 divide n? True Suppose 61z = 14z - 32z + 1723464. Is 101 a factor of z? True Let t(u) = 48u - 49. Let k be t(15). Suppose -2w = 3j - 1260, 4w - 5j - 1849 - k = 0. Is w a multiple of 21? True Let r = -11 + 17. Let x be 3/r + (-875)/(-2). Suppose -s + x = 4d - 3s, 2d + 3s = 231. Is d a multiple of 19? False Let a be -3 + (-40)/(-12) - 62/(-3). Let u be (-1 - a/(-3))/2. Suppose ux = 4o - o - 222, 0 = -o + 4x + 65. Does 11 divide o? True Let t(i) = -1278i - 35. Let d be t(-9). Suppose -14x + d = -3499. Is 11 a factor of x? False Suppose 12d = 33d - 4061 - 68998. Is 71 a factor of d? True Suppose 0 = 3f + 5x - 5 + 4, 5f - 19 = -4x. Suppose 0 = -2k + fk - 3350. Suppose 256 = 2q + 2m, -k = -4q - q + m. Is 47 a factor of q? False Suppose 0 = 4o + 5q - 6351, q = 9o - 13o + 6339. Is 24 a factor of o? True Let h(f) = -13f + 15 + 10 + 244f2 - 15 + 16. Is 16 a factor of h(2)? True Suppose 4w - p - 1989 - 2452 = 0, 4p + 2210 = 2w. Is 3 a factor of w? False Suppose 0 = 3z - 6z + 43470. Suppose 0f = -23f + z. Does 18 divide f? True Let o(w) = -2w - 72. Let y be o(-29). Let p(h) = h2 + 6h + 41. Is p(y) a multiple of 3? True Suppose 9482 + 4675 = 33a. Let h = a - -489. Is h a multiple of 18? True Let x(f) = -456f - 357. Is x(-2) a multiple of 2? False Let d(c) = c*3 + 16c*2 - 3c + 26. Suppose -25 - 38 = 5r - 2b, 2r = -2b - 14. Is 31 a factor of d(r)? False Is ((-5)/1)/(65/(-91)) + 159 a multiple of 23? False Let m(k) = -k*2 + 20k - 28. Let o be (-2)/(-3)(-120)/(-75)15. Is m(o) a multiple of 9? True Let g be (-330)/(-132) - (-2 - 5/(-2)). Is 240/g + 1 + -1 + -1 a multiple of 5? False Suppose -2m - 5d = -4d - 10528, m - 5264 = 3d. Is m a multiple of 9? False Let i(y) = -757y - 26. Is 4 a factor of i(-2)? True Let w(t) = -t - 4t + t*3 + 0t + 20t2 - 9t - 7t + 27. Is w(-17) a multiple of 23? False Let j(l) = -43 - 6l2 + 66 - l3 - 16l + 20l*2. Let p be j(12). Let k = p - 54. Is 3 a factor of k? False Let r(f) = -f + 34. Let d be r(30). Suppose -280 - 609 = -2u - 3m, dm = 12. Suppose 2v = 4v - u. Is 23 a factor of v? False Let g(t) = 2208t + 318. Is g(29) a multiple of 18? True Is (-1042)/6(16 - (55 + -30)) even? False Suppose 0 = -5u + 8u - 5l - 22951, -6l = 5u - 38180. Does 10 divide u? False Suppose 0 = -3x - 8x + 924. Suppose u - 29 - 10 = -2r, x = 2u + r. Does 4 divide u? False Let c(o) = 5o*2 - 14o - 28. Let u be c(-3). Let z = 333 + u. Is z a multiple of 49? True Let a be 1 + (-3 - 0) - -4. Suppose 0 = 2w + 8, -ay - 3 = y + 3w. Suppose 378 = yl + 4l. Does 11 divide l? False Suppose 7164 = -20t + 22t - 4i, -i - 3589 = -t. Is t a multiple of 31? True Suppose 79d = 76d + 2y + 46654, 5d = -4y + 77764. Does 14 divide d? False Let v = -42 + 44. Is ((-21)/v)/72744/(-21) a multiple of 7? True Let v = 14965 - 7546. Is 50 a factor of v? False Is 16 a factor of 2421099/42 - (-2)/15-10? False Let l(q) = -7q3 + 52q*2 + 19q + 167. Is l(-11) a multiple of 11? False Let c be (-5 - (-38)/34) + 2/(-17). Is (-32)/12531/c a multiple of 5? False Let u = 37474 - 8248. Does 29 divide u? False Let c = -251 - -255. Is 2 a factor of 1/c - (3 + (-1041)/12)? True Does 9 divide (-44)/77 + (-342060)/(-70)? False Let x = -71 + -442. Let w = 432 - x. Is w a multiple of 15? True Suppose m - 3k = 259, m = 5k - 17 + 268. Is 30 a factor of (2-4)/(1353/m - 5)? False Let g = -674 - -1276. Let s = -305 + g. Does 33 divide s? True Let u be (-8)/681 + 132/(-34). Does 8 divide (0 + u)/(2 - (-1026)/(-510))? False Let g be ((-546)/15)/(4/20). Let z(r) = r3 - 4r - 10. Let q be z(7). Let u = g + q. Is 26 a factor of u? False Let t be 17/7 - (-3)/(-7). Suppose 3u = 3b + tb - 2534, -2b + u = -1013. Is 7 a factor of b? False Let j = 3338 + -202. Does 49 divide j? True Let n be ((-3)/(-2))/((-9)/(-1506)). Let j = 282 - n. Is j a multiple of 10? False Let d be 0 + (-171)/(-2) + 1/(-2). Let z = d + -12. Suppose -2r = 5j - 595, j + 2r - z = 54. Is j a multiple of 25? False Suppose 0 = 3n - 3276 - 708. Suppose 21s = 5s + n. Does 2 divide s? False Suppose 4r + 20 = 0, -4c + 35 = -3r + 8. Suppose 2x + cf + 216 = 3x, 0 = -5x - 5f + 1040. Does 77 divide x? False Suppose 0 = -o + 4z + 36373, 9o - 7o = 3z + 72751. Does 7 divide o? False Let v be (3 - 2)/((-1)/(-7)). Suppose 6z = vz - 112. Suppose -2*p + p	{ "pile_set_name": "DM Mathematics" }
st 100000? -3400000 Let t = -4514 + 4513.9999993082. What is t rounded to seven dps? -0.0000007 Let a = -299.39525 - 26054064.60475. Let p = a + 26054339.000021. Let d = 25 + p. What is d rounded to 5 decimal places? 0.00002 Let c be -3 + 0 + 17 - -2. Let k = -12 + c. Suppose -2y - t + 300005 = y, 3t + 399985 = ky. Round y to the nearest 10000. 100000 Let c = 28715 - 28777.915. Let m = 0.085 - c. Let d = 63.00000037 - m. Round d to 7 dps. 0.0000004 Let o = 71855 - 23853. Suppose 4l - 22282 = o. Suppose -t - 371 = -l. Round t to the nearest 1000. 17000 Suppose 3g - 3 + 3 = 0. Suppose -4n - 12 = g, 3n + 110 = i - 260. What is i rounded to the nearest 10? 360 Let t = -45 - -65. Let z be (216/t)/((-1)/5)-1. Round z to the nearest ten. 50 Let i(k) = -k*3 + 4k*2 + 5k + 2. Let g be i(5). Suppose 0 = 7h + gh + 792000. Round h to the nearest 10000. -90000 Let u = 36863.985013 + -36864. What is u rounded to four dps? -0.015 Let w = 3084443.99917 + -3084431. Let r = w + -13. What is r rounded to four dps? -0.0008 Let x = 4.6 + -4.6681. Round x to 3 dps. -0.068 Let i = -126.25 - -7.95. Round i to the nearest 100. -100 Let g = 499.2 - 499.200002839. Round g to 7 dps. -0.0000028 Let f = 0.01 + 29.99. Let h = -29.99999998 + f. Round h to seven dps. 0 Let k = 843287.237 - 842801. Let h = k - 487. What is h rounded to 1 decimal place? -0.8 Suppose 2o + 176 = -s, -2s + 83 = -3o + 2o. Let l = o + -91. Round l to the nearest ten. -180 Let x = -2408 - -2408.5805. Let g = x + -0.6. Round g to three dps. -0.02 Let w = -425 - -424.9999664. Round w to 6 decimal places. -0.000034 Let q(d) = -122003d + 2. Let n be q(-2). Suppose 3c - 243984 = 4g - c, 4g + n = -2c. Round g to the nearest ten thousand. -60000 Let r(k) = -k3 - k + 2. Let h be r(1). Suppose -s - 161 = c + 1439, h = -2c - 3s - 3200. Let i be (11/(-4))/((-8)/c). What is i rounded to the nearest 100? -600 Let d be ((-23)/(115/100))/(3/834). What is d rounded to the nearest 100? -5600 Let m = -0.19 - -0.24. Let x = m - 0.01. Let r = x - 0.0512. What is r rounded to three dps? -0.011 Let b = 43826.680056 + -43827. Let z = b - -0.32. What is z rounded to five dps? 0.00006 Let d = -1886286 - -4424840. Let i = d - 2538554.1099989. Let x = 0.11 + i. Round x to six decimal places. 0.000001 Let h be ((-5)/(-2))/((-4)/(-24)). Let a = h - 14. Let z be (13/(-26))/(a/152). Round z to the nearest ten. -80 Let b be (-40)/15 - (-2)/3. Let j be (20000/(-24))/(b/2040). Suppose j = -6i + 5i. What is i rounded to the nearest 100000? -900000 Let n = 626 + -626.04848. What is n rounded to 3 dps? -0.048 Let o = -1055.99998189 + 1056. Round o to six decimal places. 0.000018 Let t = 0.267002344 + -0.267. What is t rounded to seven dps? 0.0000023 Let h(s) = -2753s. Let v(q) = 2754q + 1. Let l be (-8)/6(-63)/14. Let u(z) = lh(z) + 4v(z). Let w be u(2). Round w to the nearest ten thousand. -10000 Let y be (-1)/(12/8). Let q(l) = -6702l*3 + 4l*2 + 8. Let h be q(y). Round h to the nearest one hundred thousand. 400000 Let q = -3044807.7466365394027 - -0.6166368194027. Let s = -3044807 - q. Let w = 0.13 - s. Round w to 7 decimal places. 0.0000003 Let l(s) = 156254s*2 + 383s + 29. Let z be l(-21). What is z rounded to the nearest 1000000? 69000000 Let m = -2526.07 + 2649.5. Round m to the nearest ten. 120 Let j = 48.664 - 49. Let m = 1.2672 + -0.0932. Let l = m - j. Round l to 1 decimal place. 1.5 Let z = 340222 - 194482. What is z rounded to the nearest 10000? 150000 Let m(t) be the first derivative of t3/3 + t2 - 72t - 4. Let g be m(0). What is g rounded to the nearest 10? -70 Let k = -226607340 - -226607447.999719. Let r = 108 - k. Round r to 5 decimal places. 0.00028 Let f = 277.85299 - 307.853. Let d = -30 - f. Round d to four dps. 0 Let g = -543585 + 543576.000102. Let y = -9 - g. Round y to five decimal places. -0.0001 Let t = 72 - 71.248. What is t rounded to two decimal places? 0.75 Let f = 33.126 + -0.226. Let i = 46 + -28. Let o = f - i. What is o rounded to the nearest integer? 15 Let t = -11.3 - -11.89. Let d = -2.71 - t. Let n = -3.2 + d. Round n to zero decimal places. -7 Let b = 34.12 - 34. Let v = 0.12000082 - b. Round v to seven decimal places. 0.0000008 Let r(a) = a2 + a + 85000. Let i be r(0). Let d be (-7)/9 + 1 - 176/(-99). Suppose do = 3o + i. What is o rounded to the nearest ten thousand? -90000 Let m = 2696954 - 2696955.949873. Let s = -1.95 - m. Round s to 5 dps. -0.00013 Let p = -42.299 + 0.299. Let d = 16289555 + -16289512.999977. Let z = d + p. Round z to 5 dps. 0.00002 Let p = 0.2312 + -1241.2312. Let w = 1240.999301 + p. Round w to 4 decimal places. -0.0007 Suppose -8w + 5w + 297 = 0. Let b be (-18)/w - (19030002/11)/(-1). Round b to the nearest one hundred thousand. 1700000 Let v = -745 - -745.1316. Let k = v - 0.159. Round k to three dps. -0.027 Let x = 405 - 413.04. Let u = x - -8.0400401. What is u rounded to 6 decimal places? 0.00004 Let t = 32 - 23. Let u = t + -9.1. Let a = 0.09999916 + u. Round a to 7 dps. -0.0000008 Let s = -0.82 - -0.55. Let z = 0.08 - -0.234. Let v = z + s. What is v rounded to 2 dps? 0.04 Suppose 3w - 5q + 35 = 0, w + 18 = -5q - 7. Let s = w - -18. Suppose 4t + t + 1 = sx, -5t + 13 = 4x. Round t to the nearest 10. 0 Let j = 57.080444 - -0.920416. Let m = -58 + j. Round m to 4 dps. 0.0009 Let w(x) = x*3 - 7x*2 + 4x + 16. Let d be w(6). Suppose -4b = -3 - 465. Suppose -dt + b = -3. Round t to the nearest 100. 0 Let u = -1145.7 + 1196. Let a = -54 + u. Let c = a + 3.669. What is c rounded to two dps? -0.03 Let s = -1748920 - 36646004. Let n = 38394653.00203 + s. Let d = -271 - n. What is d rounded to 4 dps? -0.002 Let m(h) = -1960h2 - 81h + 113. Let p be m(33). Round p to the nearest one hundred thousand. -2100000 Let c(q) = 11342q2 - 5q - 33. Let k be c(-23). What is k rounded to the nearest 1000000? 6000000 Let f = 80486.3 - 80486.38400142. Let i = f + 0.084. What is i rounded to seven dps? -0.0000014 Let u = -169.999035 - -170. What is u rounded to four dps? 0.001 Let u = 3821803 - 1521803. Let v be 3 - (-2)/(2/1). Suppose 0 = g + vg - u. What is g rounded to the nearest 100000? 500000 Let n = 0.05759 - 904.25759. What is n rounded to the nearest ten? -900 Let a = 7541071.9739 + -7541536. Let h = a - -464. What is h rounded to 3 decimal places? -0.026 Suppose 4783 = 28q - 7341. Round q to the nearest 10. 430 Suppose -89m - 228048 = 4b - 85m, 3m = b + 57004. Round b to the nearest ten thousand. -60000 Suppose 0 = -12a + 9a - 11377689. Let p = 6462563 + a. What is p rounded to the nearest one hundred thousand? 2700000 Suppose -4246 = -5g - 321. Suppose -k + 215 = -g. What is k rounded to the nearest 10000? 0 Suppose -10c + 232800 = -22c. Round c to the nearest 1000. -19000 Let a be (-2061)/(12/(-66)). Let d = -77 - a. Round d to the nearest one hundred. -1200 Let f = 62.657 - 65.36. Let a = 11.003 + -11. Let o = f + a. Round o to zero dps. -3 Let i be 52/65 + (-16)/(-5). Suppose 0 = -4s - b + 469159 + 210841, 5s - 850000 = -ib. What is s rounded to the nearest one hundred thousand? 200000 Let a = 70.51 + -69.90953. Let h = -0.03 + 0.63. Let d = a - h. What is d rounded to four decimal places? 0.0005 Let z = -50 + 83. Let d = z - 33.0086. Round d to 3 dps. -0.009 Let t = -2015.1989 - -2015. Round t to two dps. -0.2 Let d(p) = 22p*3 - 7p*2 + 15p - 27. Let y be d(5). What is y rounded to the nearest one thousand? 3000 Let r = -10.94 + 11. Let v = -20 - -19.81. Let x = v - r. What is x rounded to one dp? -0.3 Let c = -1.8 - 0.8. Let u = 6.8 + c. What is u rounded to 0 dps? 4 Let r = -2679362699.9999911 + 2679362850. Let v = 150 - r. What is v rounded to 6 dps? -0.000009 Let f(b) = -b*3 - 7b*2 - 8b - 8. Let d be f(-6). Let o be 4/(-8) + 14/d. Suppose op + 90 = p - 2t, p = 3t - 57. What is p rounded to the nearest 10? -50 Let p = 242.4 - 242.3998477. Round p to five dps. 0.00015 Let v(u) = 4376u - 8. Let w be v(8). Suppose 0 = q + 6q + w. Round q to the nearest ten thousand. -10000 Let c = -12261070.923749 - -12261076. Let o = 5.0262 - c. Let f = -0.05 - o. Round f to 5 decimal places. 0.00005 Suppose 1102 = 6x + 6082. What is x rounded to the nearest one thousand? -1000 Let a = -23	{ "pile_set_name": "DM Mathematics" }
+ -21. Let o be (-2 - -2) + -3 - 1. Determine ol(z) + qi(z). z*3 + z Let h(k) = 2k*3 + 2k*2 + 4k + 2. Let g be (-2)/(-4 + (0 - -3)). Let y be g + -4 - -4 - -2. Let m(t) = -t3 - t2 - t - 1. What is ym(b) + h(b)? -2b*3 - 2b*2 - 2 Let d(i) = 7i3 - i2 + 11i + 6. Let r(m) = -6m*3 - 10m - 5. Let a(o) = 5d(o) + 6r(o). Let y(u) = u*2 + u. What is a(q) + 5y(q)? -q*3 Suppose -2m + 0m - 6 = 0. Let c(w) = 10w + 2. Let k(r) = -r. Let j(u) = c(u) + 6k(u). Let b(y) = 5y + 2. Determine mb(s) + 4j(s). s + 2 Suppose 2x - 66 = -x. Suppose 2m = m + x. Let k(n) = 7n - 15. Let y(c) = -2c + 4. Calculate my(g) + 6k(g). -2g - 2 Let m(b) = -3b*3 + 3b*2 - 8b. Let y(t) = -2t3 + 2t*2 - 5t. Determine -5m(s) + 8y(s). -s3 + s2 Let m(n) = -9n - 4. Let z(j) = 9j + 5. What is 6m(t) + 5z(t)? -9t + 1 Suppose -5z - 2 = -7z. Let k(b) = b3 - b2 + 1. Let t(v) = -2v*2 + v + 1. Determine zt(g) - k(g). -g3 - g2 + g Let u(z) = 37z - 2. Let n(x) = 73x - 4. Calculate 3n(j) - 5u(j). 34j - 2 Let b(t) = 32t3 + t2 - 4t. Let c(z) = 31z3 + z2 - 3z. What is -3b(l) + 4c(l)? 28l3 + l2 Let m(h) = -10h + 26. Let n(x) = -x3 + 4x*2 - 2x - 1. Let r be n(3). Let b(v) = rv + 0v + 5 + 0 - 4v. What is -16b(k) + 3m(k)? 2k - 2 Let p(i) = 1. Let x(a) = 2a + 8. Calculate -8p(l) + x(l). 2l Let x = -12 - -17. Suppose xj - 3j = 8. Let l(m) = -2m + 1. Let p(b) = -3b + 1. What is jp(a) - 5l(a)? -2a - 1 Let s(r) = 3r + 2. Let h(g) = -g. Give 6h(d) - s(d). -9d - 2 Let b(n) = -5n*2 + 4n - 4. Suppose -2c = c - 15. Let v(p) = 5p*2 - 5p + 5. What is cb(w) + 4v(w)? -5w2 Let j(l) = 8l - 1. Let y(v) = 15v - 3. Let x = -10 - -5. Let q(f) = xj(f) + 3y(f). Let o(u) = -14u + 11. Calculate -3o(d) - 8q(d). 2d - 1 Let u(x) = -x2 - x - 7. Let k(c) = 1. What is -3k(m) + u(m)? -m*2 - m - 10 Let f(t) = 4t*2 - 2t + 1. Let y(b) = 7b - 27 + 22 + 2b - 17b2. Let h = -12 - -21. What is hf(v) + 2y(v)? 2v*2 - 1 Let d(h) = -496h2 - 2 + h3 + 496h2 - h. Let i(j) = j2 + 1. Calculate d(r) + 2i(r). r*3 + 2r*2 - r Let t(m) = -m - 3. Let g(r) = 21r - 6 + 21r - 45r. Determine -2g(a) + 5t(a). a - 3 Let s(p) = 14p3 - 23p*2 - 9p + 11. Let r(h) = -5h3 + 8h*2 + 3h - 4. Determine -11r(z) - 4s(z). -z*3 + 4z*2 + 3z Let p(o) = o*2 - o. Let r(j) = -2j*2 - 3j - 1. Calculate 6p(l) - r(l). 8l*2 - 3l + 1 Let u(p) = -p*3 + 2p. Let o be u(-2). Let y(a) = -2a3 + a2 - 4a + 4. Suppose -10 = -3i - 4. Let q(h) = 2 + 0h - 1 + h - ih. What is oq(v) - y(v)? 2v3 - v2 Let j(i) = -i. Let w(r) = -3r - 22. Determine -5j(a) + w(a). 2a - 22 Let r(f) = 2f2 - 5f - 2. Let h be 23/(-3) - (-34)/51. Let x(o) = 4o2 - 9o - 3. Calculate hr(a) + 4x(a). 2a2 - a + 2 Let b(w) = w2 + w. Let g = 0 + 0. Let t be 0 - (g + -1 + 2). Let h(v) = 33v - 31v + 0v*2 + 4v*2. What is th(q) + 2b(q)? -2q*2 Let i(w) = -9w*2 - 5w + 5. Let n(r) = 9r2 + 4r - 4. What is 5i(o) + 6n(o)? 9o2 - o + 1 Let c(z) = z2 - 8z + 6. Let n(o) = o + 13. Let v be n(-8). Let h be c(v). Let d(t) = -3t2 - 2t. Let s(p) = 13p2 + 9p - 1. Give hd(b) - 2s(b). b2 + 2 Let a(f) be the first derivative of -f4/2 + f*2 + f + 8. Let r(p) = p + 1. Give a(h) - r(h). -2h*3 + h Let o(a) = 11a*2 + 6a + 2. Let p(q) = -33q2 - 17q - 5. Give 11o(g) + 4p(g). -11g2 - 2g + 2 Let k(n) = -n - 7. Let g(b) = 6. Let l be 1/((-4)/(-12)9/(-21)). Give lg(m) - 6k(m). 6m Let u(n) = -n + 1. Let m(o) = -3o - 1. Let h(w) = -m(w) + 2u(w). Let y(q) be the first derivative of h(q). Let f(j) = -2j - 2. What is -f(v) - 3y(v)? 2v - 1 Let k(h) = 9h + 4. Let c(f) = 8f + 3. What is -5c(n) + 4k(n)? -4n + 1 Let p(k) = -21k3 + 24k*2 + 24k + 24. Let r(h) = 4h3 - 5h*2 - 5h - 5. Determine -5p(w) - 24r(w). 9w3 Let v(j) = -120j - 2. Let o(z) = -121z - 3. Determine 2o(t) - 3v(t). 118t Let u(k) = -5k3 + 2k*2 - 8k + 3. Let o(a) be the first derivative of a4/2 - a3/3 + 3a2/2 - a + 2. Give -8o(j) - 3u(j). -j3 + 2j*2 - 1 Let g = -2 + 3. Let x(z) = -g + 0z + 2 + 0z + z. Let o(k) = -4k - 3. Give -2o(d) - 7x(d). d - 1 Let y = -15 - -19. Let l(n) = -n*3 + 5n*2 - 2n. Let i be l(y). Let k(z) = 5z3 - 3z*2 - 3. Let w(j) = -14j*3 + 8j*2 + 8. Determine ik(t) + 3w(t). -2t*3 Let q(v) = 4v*2 + 12v + 3. Let s(b) = 9b2 + 25b + 6. Calculate 7q(y) - 3s(y). y*2 + 9y + 3 Let i(l) = l. Let g(s) = 9s. Let f be 7 + (-5 + -1)/1. Determine fg(v) - 6i(v). 3v Let t be ((-13)/(-39))/(1/(-3)). Let y(m) = m3 + m2 + m - 1. Let u(n) = -12 + 2 + 8n3 + 5n*2 + 5n*2 + 10n. Determine tu(q) + 10y(q). 2q3 Let l(h) = -1. Let x = 18 + -12. Let y(i) = -1 - i + xi - 4i. Determine -l(n) + y(n). n Let v(w) be the second derivative of -w5/20 + w2/2 - 2w. Let r(a) = -14. Let i(y) = 3. Let u(t) = 9i(t) + 2r(t). Calculate u(o) + v(o). -o*3 Let p(q) = -2q*3 - 2q + 1. Let m(a) = -11a3 - 11a + 6. Determine -6m(b) + 34p(b). -2b3 - 2b - 2 Let c(x) = -x3 - x2 + x. Let n(a) = -8a3 + 8a. What is 6c(q) - n(q)? 2q*3 - 6q*2 - 2q Let b(h) = 6h + 1. Let l(y) = 7y + 2. Determine -5b(z) + 4l(z). -2z + 3 Let w(q) = 15q + 2 + 19q - 44q + 15q + 5q*2. Let n(z) be the first derivative of -4z*3/3 - 2z*2 - z + 1. What is 4n(v) + 3w(v)? -v2 - v + 2 Let p = 44 - 45. Let o(t) = -3t*3 - 6t*2 + 4t + 4. Let j(a) = a*2 - a - 1. What is po(c) - 4j(c)? 3c*3 + 2c*2 Let n(m) = -6m - 2. Let d(q) = -4q + 5. Let r(f) = 5f - 6. Let g(s) = -6d(s) - 5r(s). Let z = -48 - -43. Calculate zg(a) + n(a). -a - 2 Let d(b) = 10b*3 + 5b*2 - 5b - 5. Let x(u) = u3 - u2 + u + 1. Determine d(s) + 5x(s). 15s3 Let t(p) = p2 + p - 2. Let l(k) = k*2 + k - 3. What is -3l(b) + 5t(b)? 2b*2 + 2b - 1 Let b(j) = -1. Suppose -2z + 4 = -2d, 4z - d - 8 = 2d. Let x = -4 - -7. Let h(o) = o - 3o + o - x + 2. Calculate zb(r) - 2h(r). 2r Let w(o) = o*2 - 2o. Let j(a) be the second derivative of -a*4/4 + 5a*3/6 - 10a. Determine 2j(r) + 5w(r). -r*2 Let m(x) = 5x - 6. Let r(k) = -6k + 23. Let h(v) = v + 2. Let n(q) = 5h(q) - r(q). What is -9m(l) + 4n(l)? -l + 2 Let l(d) = -4 - 2 - 2d + 4. Let v(o) = -o - 1. Determine -2l(m) + 3v(m). m + 1 Suppose 2a = -3b - a + 12, 5b - 5a = 0. Suppose bk - k = -9. Let y(g) = 2g2 - 11g + 11. Let w(j) = j*2 - 5j + 5. Determine kw(t) + 4y(t). -t*2 + t - 1 Let t(o) = 3o*3 + 44o2 + 5. Let d(f) = -f3 - 15f2 - 2. Give 11d(x) + 4t(x). x3 + 11x*2 - 2 Let r(y) be the second derivative of 5y3/2 - y2 + 41y. Let w(j) = 16j - 2. Let p(a) = -8a + 1. Let k(n) = -11p(n) - 6w(n). What is -11k(m) - 6r(m)? -2m + 1 Let g(p) be the third derivative of 0p + 0 - 1/24p*4 - 2/3p*3 + 10p*2. Let h(t) = -3t - 11. What is -8g(o) + 3h(o)? -o - 1 Let y(v) = 6v - 1. Let d(g) = 6g + 1. Let t(k) = 5k + 1. Let b(f) = 6d(f) - 7t(f). Determine 2b(j) - y(j). -4j - 1 Let z(w) be the third derivative of -w4/8 - 5w*3/6 + 13w*2. Let f(m) = -1. Calculate 6f(q) - z(q). 3q - 1 Let n(x) = -7x + 2. Let a(o) = -13o + 4. Let i(m) = 4m - 9. Let b be i(5). Calculate bn(h) - 6a(h). h - 2 Let x = 18 + -31. Let r be (2 + -1)(1 - 1). Let j(d) = 6 + 2 - 5d - d*2 + rd. Let q(w) = -2w2 - 11w + 17. What is xj(n) + 6q(n)? n2 - n - 2 Let i(z) = -z3 - z*2 - z + 1. Let o(m) = 11m*3 - 2m*2 - 2m + 2. Determine 2i(f) - o(f). -13f*3 Suppose -9 - 3 = -3x. Suppose -15 = -n - xn. Suppose -nr + 66 = 12. Let o(g) = -g. Let k(v) = v*3 - 9v. What is ro(y) - 2k(y)? -2y3 Let l(p) = -27 + 3p - 2p + 34. Let y(q) = -2q - 11. What is 8l(d) + 5y(d)? -2d + 1 Let r(v) = -v2 - v - 1. Let d(x) = 2x*3 + 12x*2 + 12x + 12. Let p be 24/918/(-4). Give pr(a) - d(a). -2a3 Let i(g) = -3g + 2. Let q(y) = 4y + 1 - 4 - 2 + 3y. Give -5i(d) - 2q(d). d Let h(s) be the first derivative of 1 + 4s + 5/2s*2. Let d(g) = -g - 1. What is -4d(k) - h(k)? -k Let x(u) = 7u2 - 3u + 3. Let w(k) = -182k2 + 77k - 77. Give -6w(p) - 154x(p). 14p2 Let v(k) = -25k*3 + 20k*2 - 20k + 20. Let s(b) = b3 - b2 + b - 1. Determ	{ "pile_set_name": "DM Mathematics" }
- 17. Solve -c + 3a = -i, -5c + a = -0c + 1 for c. -1 Suppose 162 = 9g - 6g. Let a be ((-4)/12)/(-1)g. Solve -n + a = 4v - v, 0 = n + 4v - 23 for n. 3 Suppose 10o - 14o + 120 = 0. Suppose 5x = -o + 145. Let i(n) = n2 - n - 2. Let c be i(-2). Solve 4a - p = 2a - 13, x = -ca + p for a. -5 Let g be (4/(-10))/((-10)/100). Suppose 5w = -gv + 23, -4v + 12 = -v + 2w. Solve 3f - 3h + h = 2, -2f = -vh - 4 for f. -2 Let r(v) = v*3 + 4v*2 - 5v + 4. Let i be r(-5). Suppose -5u - 2 = -22. Suppose -ud - 2 = -18. Solve h - 3 = iw + 4h, 4 = -w - dh for w. 0 Let c(m) = -8m - 8 + 10m - 1. Let v be c(6). Suppose -vz = -z. Solve z = 5f + 4u + 7 - 2, 5f - 5u + 50 = 0 for f. -5 Let h = 468 - 468. Solve h = -3i - 0c + c + 10, -c = 4 for i. 2 Let o be (-50)/(-30)((-11)/(-5) - 1). Solve 0 = 2b - o, -4n - 2b = n - 22 for n. 4 Suppose 0 = -6a + 24. Solve l + ar = 18, 5l + 4r - 12 + 2 = 0 for l. -2 Suppose 5i = 2l - 0l - 35, 0 = 2i - l + 13. Let k(m) = -m*3 - 8m*2 + 8m - 6. Let a be k(i). Solve -2u - 4x = u - 23, 0 = au - 5x + 22 for u. 1 Let x(g) = -g*2 + 9g - 3. Let c be x(8). Suppose -r = -3i + 5i - 2, -r + c = 5i. Solve r = 2p - 2f + 6, -3p = p - 2f + 6 for p. 0 Let q = 1 + -7. Let i(g) = 2g*2 + 7g + 14. Let x be i(q). Suppose 5j - 54 = -4w, 3j + 4w - x = -j. Solve 0 = 4s + 2c, s + 0c - j = 2c for s. 2 Suppose 2m = -2j + 4, 7j - 6j - 2 = 4m. Solve -k - 3 = 4b, b = k + jb for k. 1 Suppose -15m = -17 - 58. Solve -3u = 5c + 7 - 20, mu + 20 = 0 for c. 5 Suppose -5k - 3z + 42 = -0, -25 = -3k - 2z. Let v be k - (2 + (3 - 4)). Let h = v - 5. Solve -hi = -d - 16, -3i = -2d - 12 - 5 for i. 5 Let g = 18 - 6. Suppose -6 = -3v + g. Solve 5p - 2x = 10, -v = 3p - 2p - 2x for p. 4 Let y = -63 + 63. Suppose -5m + 3z + 13 = y, -5z - 10 + 3 = -m. Solve -s + 2 = 0, -2s + 18 = 5u + ms for u. 2 Let r = -441 - -444. Solve -2z + 11 = f, -rz - f = 2f - 21 for z. 4 Let m be -2-21/(-4). Let f be (m/(-2))/(2/(-32)). Let v = f - -9. Solve 0 = 4k + 3i - 8, -3k + 20 = -i + v for k. 5 Let y(w) = -w + 3. Let c be y(-5). Suppose -g - 3g + c = 0. Solve 3f = -2o - 1 + g, -2f - 3o = 6 for f. 3 Let g be (1 + (-1)/3)/((-3)/(-9)). Solve gj = 4z - 8, -5z + 2j = 3 - 14 for z. 3 Suppose -8r - 65 = 5t - 3r, 3t + 43 = r. Let m be ((-3)/2)/(7/t). Solve 2z = -2a + 16, -2a - 3a = -mz for z. 5 Let s = -8 - -6. Suppose 2g - 3p = g - 13, 15 = -3g + p. Let k be (s/g)/((-4)/(-104)). Solve -13 = 4n - 2v - v, 2n = -5v - k for n. -4 Let m(g) = -7g + 55. Let n be m(15). Let u = n + 54. Solve uz - j - 7 = 0, 4j = -5z + 9z - 4 for z. 2 Suppose 4z + 8 - 52 = -4a, 5z + 3a = 45. Solve 0 = 2u - 7u - d - z, -4d - 4 = 0 for u. -1 Let f(c) be the second derivative of c4/12 + c3/6 - 5c. Let l be f(-1). Solve -2j - 10 = 4u, 2u + 3j = -lj + 5 for u. -5 Let d be (-12)/6 - 4 - (-22)/2. Solve da + 8 + 7 = 0, -2r + 4 = -2a for r. -1 Let u = 22 + -12. Let a = 14 - u. Suppose 4f - 20 = -3v, -5f + a - 2 = -2v. Solve -fz + z + 1 = 3r, 2r = -3z - 4 for r. 1 Suppose 4o = 4a + 36, 8o - 11 = 5o - a. Solve 0 = -n - s - o, 3n + 0 = -2s - 14 for n. -4 Suppose t = -0 + 6. Suppose -4y + 6y - 6 = 0. Suppose -ya + 10 + 5 = 0. Solve r - 2r = ab - 18, t = b - r for b. 4 Suppose 3x - 38 = l + l, -4l - 48 = -4x. Let u(i) = 5i + 6i + 4i + 9 - i2. Let m be u(x). Solve 4k + 4c - c = m, 22 = 4k + 2c for k. 5 Let a(s) = -s3 + 10s*2 - 6s - 19. Let x be a(9). Solve -2o = -b, 2o = 4b - 2o - x for b. 4 Let l = 61 - 35. Suppose -2 = 2p - l. Solve -4g - p = n - 2n, -2g = 6 for n. 0 Let z = -797 + 799. Solve -10 = 4w - 2n, -10n - 10 = -zw - 12n for w. 0 Let q be 2(228/57)/((-16)/(-6)). Solve -c = 0, qg = -3c + 5c for g. 0 Let m = -1001 - -1003. Solve mr - 2q = -4, 2q - 6q = 5r - 26 for r. 2 Let v = 24 + -37. Let l = -35 - v. Let r be ((-16)/(-3))/(l/(-33)). Solve d - 5k + r = 4d, -4d - 32 = -4k for d. -4 Suppose 2k + 1035 = 1049. Solve -5z = 3u + 4 + k, -3u + 17 = -2z for u. 3 Let m be (-314)/(-6) - (-2)/(-6). Suppose y = 3y - m. Suppose -5d + y + 54 = 0. Solve w + w - 4c = -d, -w - 5 = -c for w. -2 Let h(u) = -u*3 + 10u*2 + u - 6. Let r be 92/3 + 4. Let c be h(r). Let l = c + 36. Solve 0 = 5w - 5t + l, 16 = -2w + 3t - 5 for w. -3 Suppose -d - 4n - 37 = -103, n - 54 = -d. Let m = -44 + d. Solve 5a = -4s + 12, 0s + m = 4a + 2s for a. 0 Let y = -121 + 134. Solve -2w = -h - 7, -5h - y = 3w - 2w for h. -3 Let r = 963 + -961. Solve 4k - 9k + 15 = -3j, -rk = -j - 5 for k. 0 Let l be (-14)/(-105) + 516/180. Solve 3m + 11 = j, lj - 7 = m + j for m. -3 Suppose 0 = o - 5o - 24. Let t be 1/(-2) - 27/o. Solve -2a + 2m - 4 = 0, tm - m - 2 = 5a for a. 2 Let m = 417 - 413. Solve 3 = mz - 4y - 1, 0 = 2z + y + 1 for z. 0 Suppose -118j + 330 = -52j. Solve -4h - 3 = 3g - 2h, -jh + 18 = -g for g. -3 Let u = 38 - 30. Let n be (-3 + 0)/((-6)/u). Solve c = a - 2c - 11, 3c = -na - 16 for a. -1 Let a = 10 + -4. Let g(j) = j2 - 5j - 6. Let p be g(a). Solve -k = 2z + k, p = 2z + 4k + 2 for z. 1 Suppose 0 = -g - 4c - 10, 0 = 5g - 4c + 1 + 1. Let n be 0/((-3)/(-6)g)1. Solve 0 = 2y + 3d + 17, 4y + ny + 3d + 19 = 0 for y. -1 Let i(o) = o - 6. Suppose -4c + 3a = 4 - 18, 2c - 4a = 12. Suppose 8 = -cn + 3n. Let x be i(n). Solve xg = -2g - 4p + 24, p = 3 for g. 3 Let h be (64/(-96))/((-2)/15). Solve -2 = 2c - 4f, 5c - f = -hf + 9 for c. 1 Suppose -2 = -5d + 13. Solve -dm + 3v = 12, -4m = 2v - v - 4 for m. 0 Suppose -7 = -2i + 4i + 5g, 3i - g = 15. Suppose -2f = ij + f - 19, -3f = -4j + 13. Solve -5h - 5 = 0, -jh - 10 = -4a - 2h for a. 2 Let d be 2052/266 - (-4)/14. Solve p + 1 = 0, -p = 4z - d - 3 for z. 3 Let l(h) be the first derivative of 2h2 + 54h + 24. Let n be l(-13). Solve -2x - x - 4 = 5r, 0 = -nr - 3x + 2 for r. -2 Let a be ((-12)/10)/(90/(-225)). Solve t + ap = 3t - 5, 0 = 4t - 3p - 13 for t. 4 Suppose 2z - 7 = -v, 5v - 4z = -0v + 21. Solve 3u = vj + 10, 2j + 3j + 15 = 4u for u. 5 Let y be ((-30)/(-18))/((-6 + 7)/3). Suppose -15 = c - 6c. Solve -19 = j - ch, -j + 0j - yh = -21 for j. -4 Let x(j) = 3j*2 - j. Let c be x(1). Let a be (-56)/252 - 2/(-9). Let h be (-10)/(-4)(c + a). Solve 21 + 6 = r + 5o, -3o + h = -5r for r. 2 Let g(h) = h2 + h - 12. Let i be g(-4). Solve -n - 2p + 4 = i, -6n - 4p + 20 = -n for n. 4 Suppose 0 = 3w - 7w + 4. Let a(x) = 4x2 - x + 1. Let d be a(1). Suppose -j - 5i = j + 14, 0 = di + 16. Solve -w = -r - jq - 4, q + 1 = 0 for r. 0 Let r(s) = 2s2 + 55s - 87. Let w be r(-29). Solve wq + 3c + 16 = q, c + 3 = -2q for q. 1 Let w = -113 - -113. Solve w = a + 5l, 2a + 11 = -0a + l for a. -5 Let q = -543 + 550. Solve -2x = 3c - q, -4c = 2x - 1 - 11 for x. -4 Let a be 27/(-45) - (-2)/(-5). Let d be (a + (-14)/6)27/(-18). Solve dy - 1 = 3l, y = -l + 4y + 1 for l. -2 Let y = 26 + -21. Suppose 2g = -yr - 1, 8 = 5g + 3r + 1. Suppose gt = -5v + 38, v + 2v - 12 = 0. Solve -15 = -5i - 5f, -3i + 0f + t = -2f for i. 3 Let z be (-6)/(0 - -3) - -4. Suppose -5p = 4h - 54, -zh + 37 = 4p - 5h. Solve -5l = -2c + p, l - 10 = -4c + 10 for l. 0 Suppose 18r - 180 = -27r. Solve -4h = -2j + 14, rj + j - 11 = 2h for j. 1 Let s be 2 + 5/(4 - -1). Suppose sl = 0, l + 10 = 2i - 0l. Solve iw = -2o - 7, 4w + o - 3o = -2 for w. -1 Let c = -450 + 454. Solve -4v = -5d, -cd + 5v = -0d for d. 0 Suppose -52 = 4s - 3n, 3s + 4n + 48 = s. Let y = s + 22. Suppose 2x + 2a = 20, 6x - 3a = 2x + 40. Solve p = -i + yp + x, -2p = -5i + 4 for i. 0 Let p = -3 - -3. Suppose -f + 6 = f, 2f + 6 = 3r. Suppose -4h + y = -2y - 23, 21 = rh - y. Solve -o + 25 = -4m, p = hm - 2m + o + 10 for m. -5 Suppose 5r + 25 = 5d, -8d - 4r - 10 = -7d. Solve 5f - dz = -14, -4f = 4z - 0z for f. -2 Let d(z) = 4z + 25. Let x be d(-6). Solve 4w = -m - 8, -m + 4w = -7 - x for m. 0 Suppose 6s + 2 = 4s + 4q, 0 = 2s - 3q + 1. Solve -2 = -t - 2x, -t - s + 3 = -4x for t. 2 Suppose 6c = -3c + 45. Suppose 0 = 4m - 16, cm - m - 16 = -5p. Solve p = i + 3i + o - 18, -2o + 20 = 4i for	{ "pile_set_name": "DM Mathematics" }
nearest integer? 26 What is 1753 to the power of 1/7, to the nearest integer? 3 What is the square root of 92661 to the nearest integer? 304 What is the tenth root of 39618 to the nearest integer? 3 What is the square root of 104 to the nearest integer? 10 What is the square root of 4722 to the nearest integer? 69 What is the square root of 275 to the nearest integer? 17 What is the square root of 62925 to the nearest integer? 251 What is 428 to the power of 1/3, to the nearest integer? 8 What is the third root of 2025 to the nearest integer? 13 What is the third root of 8869 to the nearest integer? 21 What is 987 to the power of 1/2, to the nearest integer? 31 What is the third root of 1316 to the nearest integer? 11 What is 8310 to the power of 1/2, to the nearest integer? 91 What is 18786 to the power of 1/6, to the nearest integer? 5 What is the cube root of 101562 to the nearest integer? 47 What is the third root of 4793 to the nearest integer? 17 What is the ninth root of 2383 to the nearest integer? 2 What is 23879 to the power of 1/3, to the nearest integer? 29 What is 3003 to the power of 1/2, to the nearest integer? 55 What is the square root of 16449 to the nearest integer? 128 What is the square root of 65777 to the nearest integer? 256 What is the cube root of 82692 to the nearest integer? 44 What is 39633 to the power of 1/3, to the nearest integer? 34 What is the ninth root of 6283 to the nearest integer? 3 What is the third root of 920 to the nearest integer? 10 What is the square root of 485 to the nearest integer? 22 What is the square root of 2884 to the nearest integer? 54 What is the eighth root of 4082 to the nearest integer? 3 What is the square root of 21004 to the nearest integer? 145 What is 751 to the power of 1/4, to the nearest integer? 5 What is the tenth root of 2101 to the nearest integer? 2 What is 3521 to the power of 1/2, to the nearest integer? 59 What is the square root of 7842 to the nearest integer? 89 What is 1136 to the power of 1/6, to the nearest integer? 3 What is the third root of 73769 to the nearest integer? 42 What is the square root of 3195 to the nearest integer? 57 What is the tenth root of 313 to the nearest integer? 2 What is 1193 to the power of 1/2, to the nearest integer? 35 What is 1810 to the power of 1/2, to the nearest integer? 43 What is 1167 to the power of 1/3, to the nearest integer? 11 What is the fourth root of 84825 to the nearest integer? 17 What is the cube root of 4628 to the nearest integer? 17 What is the eighth root of 24351 to the nearest integer? 4 What is the cube root of 43395 to the nearest integer? 35 What is 99 to the power of 1/2, to the nearest integer? 10 What is the cube root of 506 to the nearest integer? 8 What is 5083 to the power of 1/3, to the nearest integer? 17 What is 769 to the power of 1/2, to the nearest integer? 28 What is the square root of 3004 to the nearest integer? 55 What is 84579 to the power of 1/5, to the nearest integer? 10 What is 46779 to the power of 1/2, to the nearest integer? 216 What is the ninth root of 149 to the nearest integer? 2 What is 1124 to the power of 1/2, to the nearest integer? 34 What is the third root of 145759 to the nearest integer? 53 What is 2237 to the power of 1/7, to the nearest integer? 3 What is the sixth root of 2460 to the nearest integer? 4 What is the third root of 30068 to the nearest integer? 31 What is 918 to the power of 1/2, to the nearest integer? 30 What is 10398 to the power of 1/7, to the nearest integer? 4 What is the third root of 6797 to the nearest integer? 19 What is the cube root of 1039 to the nearest integer? 10 What is 36518 to the power of 1/2, to the nearest integer? 191 What is 8597 to the power of 1/2, to the nearest integer? 93 What is 6544 to the power of 1/5, to the nearest integer? 6 What is the square root of 15245 to the nearest integer? 123 What is 1126 to the power of 1/10, to the nearest integer? 2 What is 149767 to the power of 1/5, to the nearest integer? 11 What is 295 to the power of 1/3, to the nearest integer? 7 What is 982 to the power of 1/5, to the nearest integer? 4 What is the eighth root of 2575 to the nearest integer? 3 What is 7173 to the power of 1/2, to the nearest integer? 85 What is the square root of 67510 to the nearest integer? 260 What is the fourth root of 6208 to the nearest integer? 9 What is the square root of 4214 to the nearest integer? 65 What is the square root of 11086 to the nearest integer? 105 What is the ninth root of 144066 to the nearest integer? 4 What is 65356 to the power of 1/2, to the nearest integer? 256 What is the third root of 11985 to the nearest integer? 23 What is 1495 to the power of 1/6, to the nearest integer? 3 What is the square root of 16156 to the nearest integer? 127 What is the third root of 7083 to the nearest integer? 19 What is the third root of 1629 to the nearest integer? 12 What is 58377 to the power of 1/2, to the nearest integer? 242 What is the third root of 1177 to the nearest integer? 11 What is the tenth root of 1350 to the nearest integer? 2 What is the eighth root of 41112 to the nearest integer? 4 What is the square root of 2937 to the nearest integer? 54 What is the third root of 8025 to the nearest integer? 20 What is the square root of 5491 to the nearest integer? 74 What is the square root of 1888 to the nearest integer? 43 What is the cube root of 4874 to the nearest integer? 17 What is the tenth root of 14561 to the nearest integer? 3 What is 4024 to the power of 1/8, to the nearest integer? 3 What is 970 to the power of 1/3, to the nearest integer? 10 What is the tenth root of 244 to the nearest integer? 2 What is 1277 to the power of 1/6, to the nearest integer? 3 What is the square root of 881 to the nearest integer? 30 What is the seventh root of 667 to the nearest integer? 3 What is the tenth root of 27596 to the nearest integer? 3 What is 24667 to the power of 1/8, to the nearest integer? 4 What is the third root of 137067 to the nearest integer? 52 What is 116059 to the power of 1/3, to the nearest integer? 49 What is 3805 to the power of 1/3, to the nearest integer? 16 What is the cube root of 81190 to the nearest integer? 43 What is 25569 to the power of 1/4, to the nearest integer? 13 What is the fifth root of 32786 to the nearest integer? 8 What is the sixth root of 416 to the nearest integer? 3 What is the ninth root of 20594 to the nearest integer? 3 What is the third root of 1921 to the nearest integer? 12 What is the cube root of 2714 to the nearest integer? 14 What is the third root of 40326 to the nearest integer? 34 What is the square root of 2206 to the nearest integer? 47 What is 14934 to the power of 1/2, to the nearest integer? 122 What is 1028 to the power of 1/9, to the nearest integer? 2 What is 520 to the power of 1/8, to the nearest integer? 2 What is 461 to the power of 1/3, to the nearest integer? 8 What is 1470 to the power of 1/3, to the nearest integer? 11 What is the third root of 386 to the nearest integer? 7 What is the square root of 67807 to the nearest integer? 260 What is the cube root of 18200 to the nearest integer? 26 What is the third root of 24261 to the nearest integer? 29 What is 2826 to the power of 1/3, to the nearest integer? 14 What is the sixth root of 14201 to the nearest integer? 5 What is the sixth root of 32038 to the nearest integer? 6 What is the tenth root of 19997 to the nearest integer? 3 What is the square root of 908 to the nearest integer? 30 What is 39528 to the power of 1/2, to the nearest integer? 199 What is the square root of 64082 to the nearest integer? 253 What is the tenth root of 292 to the nearest integer? 2 What is 7168 to the power of 1/2, to the nearest integer? 85 What is the third root of 49844 to the nearest integer? 37 What is 9527 to the power of 1/5, to the nearest integer? 6 What is 9107 to the power of 1/2, to the nearest integer? 95 What is the third root of 30974 to the nearest integer? 31 What is the tenth root of 6471 to the nearest integer? 2 What is 4238 to the power of 1/2, to the nearest integer? 65 What is 17415 to the power of 1/2, to the nearest integer? 132 What is the seventh root of 52080 to the	{ "pile_set_name": "DM Mathematics" }
110 (base 2) to base 7 4416542 -2467846 (base 12) to base 14 -d2d410 Convert 424257 (base 13) to base 14. 2c55ac Convert 24430132 (base 6) to base 14. 164b68 What is c2128 (base 16) in base 4? 3002010220 -240363 (base 11) to base 10 -381098 22020110201012 (base 3) to base 12 15720b8 What is -113000333001 (base 4) in base 12? -202b629 51389 (base 13) to base 12 70332 657a58 (base 11) to base 13 2a9c80 Convert -47118 (base 9) to base 5. -2001240 What is -1875a9 (base 11) in base 8? -1062734 What is 4111346 (base 7) in base 16? 77b58 What is 99db (base 16) in base 11? 27657 446644 (base 7) to base 2 10011010101110000 Convert -25144777 (base 8) to base 9. -11408360 Convert -1fe8d (base 16) to base 13. -4764c What is -212011011102 (base 3) in base 16? -6f440 Convert 4587b5 (base 15) to base 3. 20020122022122 What is 796201 (base 10) in base 12? 324921 What is 32253524 (base 6) in base 8? 3513134 Convert -3420244 (base 12) to base 10. -9995092 Convert b50a04 (base 14) to base 2. 10111010011101110011100 Convert 11010010011101011 (base 2) to base 14. 2b3ab Convert 163703 (base 10) to base 13. 59687 Convert 66221325 (base 7) to base 11. 3234041 What is -4b155 (base 15) in base 7? -2016335 What is 294397 (base 11) in base 8? 1601620 -124402 (base 11) to base 9 -328046 110120100201210 (base 3) to base 10 6679632 Convert 101101100010110111 (base 2) to base 14. 4bdb1 -d7676 (base 15) to base 7 -5543604 131042124 (base 5) to base 4 2131011112 What is -a73b5 (base 12) in base 3? -102011211002 What is 1646685 (base 9) in base 4? 3133312310 Convert -2100202120 (base 3) to base 16. -b592 Convert 19830f (base 16) to base 9. 3127433 -32013106 (base 8) to base 3 -110211120021011 -2200021012101 (base 3) to base 8 -5332130 Convert -33204130 (base 5) to base 11. -187455 Convert -63383 (base 11) to base 13. -33016 Convert -276c8 (base 14) to base 13. -35439 Convert 64535 (base 15) to base 10. 318425 What is 16051b6 (base 12) in base 14? 84b762 What is -53623 (base 10) in base 8? -150567 -798491 (base 13) to base 3 -12102001000212 213356242 (base 7) to base 6 1133415344 What is -3811106 (base 9) in base 11? -1197329 2201443401 (base 5) to base 8 22000011 What is -111100022 (base 4) in base 15? -1abd5 22154120 (base 6) to base 5 132341402 What is 312353 (base 8) in base 5? 11304114 6433762 (base 10) to base 3 110002212110111 What is 141514 (base 9) in base 10? 86440 Convert -31121133110 (base 4) to base 16. -3597d4 What is -5169b (base 12) in base 14? -2aab5 Convert 24b150 (base 12) to base 14. 118844 Convert -3c894 (base 13) to base 14. -2d528 What is -4809a (base 13) in base 2? -100000001101101011 768005 (base 14) to base 15 54544b 5ba790 (base 12) to base 9 2721710 What is 841810 (base 10) in base 16? cd852 -2752551 (base 8) to base 9 -1411738 2b397 (base 12) to base 14 18351 What is -210121021 (base 4) in base 6? -3110041 Convert 2013e1 (base 16) to base 2. 1000000001001111100001 Convert -1257248 (base 10) to base 6. -42540332 163427 (base 8) to base 2 1110011100010111 Convert -424255 (base 9) to base 8. -755036 What is -3a608 (base 13) in base 5? -11434200 -1440411030 (base 5) to base 8 -16516556 2ec92 (base 15) to base 13 53b64 What is -415334 (base 9) in base 5? -30343201 What is 12100200200210 (base 3) in base 8? 12672355 Convert -3425634 (base 8) to base 2. -11100010101110011100 -10110111000 (base 3) to base 10 -68148 3440 (base 11) to base 16 11a9 What is -1438b61 (base 12) in base 14? -779329 Convert 184926 (base 10) to base 5. 21404201 What is -211011002132 (base 4) in base 9? -20254252 What is 361651 (base 8) in base 12? 5b7a1 What is 4b1aa2 (base 14) in base 16? 27591e 7a7370 (base 13) to base 10 2900638 -236246 (base 11) to base 10 -374303 102210112212110 (base 3) to base 9 12715773 What is 6876642 (base 9) in base 4? 32022031313 -1000100001001000000011 (base 2) to base 12 -8b8197 Convert 154005 (base 7) to base 13. 10983 What is 302040344 (base 5) in base 8? 4462734 -403382 (base 9) to base 11 -153380 What is 102010002221 (base 3) in base 5? 24000104 What is -22110101100 (base 4) in base 16? -294450 What is 50415113 (base 7) in base 12? 14a0312 Convert 8777957 (base 10) to base 9. 17458075 a48752 (base 13) to base 11 2197614 Convert 1eb8d3 (base 16) to base 3. 10210021212012 -5473 (base 9) to base 11 -3039 Convert -20111100122 (base 3) to base 7. -1041461 -1a8d7 (base 14) to base 12 -33165 221044021 (base 6) to base 9 7423274 -100d1 (base 16) to base 6 -1224213 Convert -11212122011 (base 3) to base 5. -11032322 What is 26411075 (base 8) in base 5? 3002343114 1030411222 (base 6) to base 13 2365217 What is -35480 (base 10) in base 7? -205304 Convert 7760289 (base 10) to base 2. 11101100110100110100001 What is 18cdc8 (base 14) in base 16? d70a4 -405a58 (base 11) to base 4 -2133031210 Convert -1863715 (base 9) to base 14. -1d327d What is -1100001001101011001111 (base 2) in base 14? -5ccbb9 What is 102555231 (base 6) in base 3? 10102102211101 4270b5 (base 13) to base 7 16145516 Convert -2444604 (base 7) to base 4. -1030213020 What is -4c56a0 (base 16) in base 10? -5002912 2343241123 (base 5) to base 8 24615415 Convert 2100011032 (base 4) to base 12. 24563a Convert 102113331010 (base 4) to base 16. 497f44 Convert 14412143 (base 7) to base 10. 1364534 Convert -117132 (base 13) to base 9. -702783 11001011001111101111001 (base 2) to base 10 6659961 What is 3224120 (base 5) in base 3? 2210022201 -2010407 (base 9) to base 12 -4370ba Convert 160625 (base 10) to base 15. 328d5 Convert -33512333 (base 6) to base 12. -4126a9 What is 43031154 (base 6) in base 8? 4644416 Convert -31323333212 (base 4) to base 11. -2076010 Convert -21003402 (base 5) to base 13. -605ab -2203205 (base 9) to base 10 -1183334 1311a5 (base 15) to base 6 31340045 101100101101110111010 (base 2) to base 14 2a1dc6 -110000010101010110010 (base 2) to base 5 -401140134 62654 (base 10) to base 7 350444 Convert 452503 (base 15) to base 11. 195323a What is -204c5a (base 14) in base 13? -2c1917 222222220222 (base 3) to base 16 81bba -391462 (base 15) to base 13 -74b3b5 What is -100111100101001100000 (base 2) in base 16? -13ca60 -1201121111 (base 3) to base 8 -102273 What is -143602 (base 7) in base 12? -14074 -81017 (base 12) to base 4 -220323103 Convert -26413751 (base 8) to base 14. -ad9a41 Convert -aecd6 (base 16) to base 9. -1311134 -1111010100010110000 (base 2) to base 11 -313126 What is 101000110101101011110 (base 2) in base 13? 37b14c What is 2218301 (base 9) in base 15? 1889e7 Convert 38105 (base 15) to base 14. 493b3 -3510405 (base 6) to base 12 -88405 Convert 10001110010001011111 (base 2) to base 13. 175330 -87777 (base 13) to base 6 -5130540 342415 (base 7) to base 15 130b4 What is -12112331012 (base 4) in base 3? -10010200112112 -3240a (base 11) to base 5 -3001304 643304 (base 7) to base 5 12033001 -24712 (base 14) to base 8 -256154 a3526 (base 13) to base 3 112220000202 Convert 381b98 (base 13) to base 2. 101001000101111110100 What is 27c157 (base 13) in base 10? 969118 12a1 (base 12) to base 5 32022 -2748c (base 16) to base 2 -100111010010001100 43443324 (base 5) to base 15 760e4 Convert -331433222 (base 5) to base 7. -15132410 -1124551 (base 7) to base 9 -234257 -2534232 (base 7) to base 14 -87789 -65110052 (base 7) to base 4 -111022223030 40bb2 (base 13) to base 2 11100011000011000 -110001020 (base 3) to base 10 -8781 -201012112202 (base 3) to base 6 -12034032 What is -5522245 (base 7) in base 2? -10100101100000001011 What is 46dab (base 14) in base 11? 108936 Convert -424755 (base 9) to base 7. -2102114 What is -313021202 (base 4) in base 13? -7ba82 Convert 242224 (base 8) to base 11. 57479 Convert -1187852 (base 11) to base 8. -7667462 What is -12b22 (base 13) in base 10? -34842 Convert 7b495 (base 12) to base 10. 164849 What is 13303311 (base 4) in base 15? 9729 Convert 1011011011000110111011 (base 2) to base 11. 17659a1 What is aa8189 (base 13) in base 7? 46065421 767b94 (base 13) to base 15 3a101b Convert -a2a228 (base 13) to base 9. -7120161 What is -6e63c (base 15) in base 8? -1260227 202a0 (base 14) to base 13 292a1 What is 2221210200 (base 3) in base 16? e340 What is 41ab1 (base 12) in base 16? 150e5 What is 95ce5 (base 16) in base 6? 21052433 7055617 (base 8) to base 4 13011	{ "pile_set_name": "DM Mathematics" }
))(0 + 0 - 1 + (67 + 58 - 44)(5 + 7 - 4)) to the form ho + i and give h. -1294 Express 51h + 17 + 74h - 153h in the form y + fh and give f. -28 Rearrange -23b - 2 + 24b - 3424b*3 - 2b*2 + 3432b*3 to the form v + db + nb3 + xb*2 and give v. -2 Express (7322 + 1872 + 1502)(0z2 + 3z*2 + 0z*2) in the form k + bz*2 + lz and give b. 32088 Express -11 + 16g - 8g - 3g3 - 10g - 40g2 + g4 + 13 as sg + tg4 + k + bg*3 + zg2 and give t. 1 Express -f2 + 6414f + 6398f - 12812f + 1661f*3 - 1 in the form kf + m + zf3 + bf*2 and give k. 0 Express 144g*4 - 9g - 8g3 + 1 + 147g*4 - 4g2 + g2 - 288g4 in the form rg + mg2 + pg*3 + i + zg*4 and give r. -9 Rearrange 136j - 12973j + 3032j to the form pj + k and give k. 0 Express 1077k - 77272 + 77272 as ak + b and give a. 1077 Rearrange (2o - 2o + 6o)(104 - 119 + 99)(-5 + 5 + 7 + (5 - 2 - 1)(0 + 0 + 1) - 3 + 4 - 2) to bo + r and give b. 4032 Rearrange 9 - 41 - 27 + 4 - 42 - 21s to p + ts and give p. -97 Rearrange -339q3 - 50q - 93q + 2q*2 + 141q to kq2 + t + vq + fq3 and give v. -2 Express -648m2 + 373 + m3 - 1579 + 648m2 - 882 in the form n + lm + tm2 + am*3 and give a. 1 Express 35 - 5 - 29 - 2 - 34o*3 + 3o*2 as no + t + fo2 + wo*3 and give t. -1 Express -31z*3 - 154z*3 - 48 + 49 - 115z*3 - 5z*2 in the form jz*2 + yz + oz3 + f and give f. 1 Express (2 - 4 + 1)(-c + c - c) + 3 - 2c - 3 + (-464c + 226c - 168c)(1 + 4 - 4) - 5c + 4c + 3c in the form qc + r and give q. -405 Express 128o*3 - 29o*3 - 151o*2 - 36o*3 - 35o*3 - 27o*3 + o - 5 as go*3 + io + ao2 + p and give p. -5 Express (1746 + 31k - 1746)(8k - 2k - 2k + (1 + 2 - 2)(-5k + 3k + 0k)) as sk + o + uk*2 and give u. 62 Rearrange (-11s + 3s + 9s)(6 + 3 + 0)(18 - 52 + 11) + 4s + 0s - 2s to gs + h and give g. -205 Rearrange -1890w2 - 430w*2 - 917w*2 + 42w*2 - 789w*2 to lw + gw2 + b and give g. -3984 Express -82 + 53 - 2z*2 - 115z + 20 + 3z2 as r + mz + yz2 and give r. -9 Rearrange (-2d*3 - 3d*2 + 5d*2 - 4 + 1)(-1118372 + 1118241 + d - 4d) to hd*3 + bd + sd4 + ld*2 + q and give b. 9 Rearrange 3z - 49z4 + 29z*4 + 2z*3 - 2z - 3 + 6z4 - z2 to the form wz*2 + gz + sz3 + f + bz*4 and give s. 2 Express (36 - 36 - 5g)(-15g*3 + 52g*3 + 147g*3) - 3g*4 - 3g*4 + 5g*4 as mg*3 + sg*4 + rg*2 + tg + y and give s. -921 Express (546c - 902c + 1504c)(-3c2 + 4c*2 + 6c2 - c2)(-3c - 3c + 5c) as dc3 + kc*4 + ac + yc2 + u and give y. 0 Express 2d - 10 + 13 + d*2 - 5716d*3 + 5752d*3 in the form td*2 + v + wd*3 + id and give v. 3 Rearrange (2b3 - 3b*3 - 2b*3)(-49b + 28b + 207b)(2 + 2 - 5) to a + pb3 + cb*4 + db*2 + ub and give p. 0 Rearrange -437z + 116z - 2125z - 583z + 245z to rz + l and give r. -2784 Rearrange (k + k - 3k)(4 + 0 - 3) - 1 + 1 - 3k + 838 - 4575k - 921k - 419 - 419 to nk + m and give n. -5500 Rearrange -1518 + 2i + i2 + i3 + 1523 - i2 - i2 to the form ci*3 + d + pi*2 + ui and give c. 1 Express (85g + 224g + 255g)(-1 + 1 - 3 + 2 - 1 + g) in the form ig2 + y + cg and give i. 564 Express -106t2 + 26 - 101t*2 + 205t*2 - 562t - 26 in the form nt + o + yt*2 and give o. 0 Rearrange (1 + 2 - 1)(3p - 6p + p) - p - p + 3p - 38523p - 1 + 45221p - 1 + 7 to mp + l and give l. 5 Rearrange w*2 - 162w*2 - 863w*2 + 116w*2 - 1 to the form rw + q + vw2 and give v. -908 Rearrange (2 - 2 + 5g)(-4 + 4 - 2g)((0g + 2g + 0g)(-4 + 5 + 1) - 4g + 2g + 3g - 134 + 480g + 134) to jg + lg2 + cg*3 + z and give z. 0 Rearrange 9 + 40t*3 - 3t + 26t3 - 40t*3 + 29 + 41 to the form it*3 + jt*2 + xt + k and give x. -3 Express -1 + 1 - l + (3141l + 2658 - 2658)(3 + 1 + 0) - 2l - 1 + 1 - 4 - 2l + 4 as ol + n and give o. 12559 Express (-33 + 36 - 23 + (-1 + 4 - 5)(-1 + 3 + 0) - 3 + 3 - 2)(0i - 4i + 7i) in the form a + hi and give h. -78 Express 23 - 103x*3 - 53x*3 + 169x*3 in the form n + lx*2 + fx + tx3 and give t. 13 Express -871v + 1775v + 953 - 905v as y + xv and give x. -1 Rearrange -1574u + 2711u + 5621u to lu + z and give l. 6758 Express 39j - 108j + 33j + (-3j - 5j + 0j)(-3 + 0 + 5) + (3j - 3j - 2j)(-1 - 1 + 0) as qj + b and give q. -48 Rearrange -2v - 7v - 22 + 12v + 24 + 3v - 85v*2 to the form av + t + ov2 and give o. -85 Express 15 + 1 - 59 + 23 + 18 + 9436m*2 + m in the form hm*2 + i + dm and give i. -2 Express 15f2 + 11 - 21f*2 + 14757f - 14762f + 12f*2 in the form af*2 + wf + g and give a. 6 Express 16 + 30a - 17 - 14 + 74 + 78 in the form ha + l and give l. 137 Express -5582u2 - 1475u*2 + 1 - 7836u*2 - 8u + 8u in the form m + wu*2 + tu and give w. -14893 Express -32 - 2z2 + 2 - 26 + 12z - 3 + 11 in the form xz2 + m + oz and give o. 12 Express -51i4 - 22i*4 - 6i*3 - i + 3i + 3i3 + 1 - i3 as hi*2 + z + fi*3 + ki*4 + si and give h. 0 Rearrange -363k - 398k - 24728k2 + 761k to s + mk + vk*2 and give v. -24728 Rearrange 1443a - 506a + 72a - 4 - 433a to la + o and give l. 576 Rearrange (0h3 - 5h*3 + 2h*3)(1434 - 1249 + 45h + 4h) to r + oh4 + yh + lh3 + qh*2 and give l. -555 Rearrange (0y + 7y - 3y)(1 - 1 + y2) + (-6923 + 91y*3 + 6923 + 0y + 0y)(8 - 13 - 23) to wy3 + zy*2 + i + ry and give w. -2544 Express 17w2 + 8 - 6w*2 - 9w*2 + 540w - 1109w - 23 as a + jw*2 + nw and give j. 2 Rearrange (-g + 3g - 3g)(5 + 1 - 4) - 1361g + 398g + 672g to the form w + lg and give l. -293 Express -94384y - 23y2 + 28y*2 + 94432y - 2 in the form n + my + hy*2 and give n. -2 Express 306o + 9o2 - 1 + 661o2 + o2 - 2o3 - 301o as jo + mo*2 + ro*3 + t and give m. 671 Express 1543533 - 16157a - 1543533 in the form da + t and give d. -16157 Rearrange -331y*2 - 113y*2 - 119y*2 - 100y*2 to ry + ny2 + f and give n. -663 Express (h2 + h - h)((-3 + 6 + 1)(h - 3h + h) + 3595h - 893h + 455h) as ih*2 + xh + p + jh3 and give i. 0 Rearrange -792 - 180 + 82 + 12j + 285 to the form v + nj and give n. 12 Rearrange (-269539 + 269539 - 11862m)(-3m2 - m2 + 3m2) to the form zm*2 + y + tm*3 + cm and give z. 0 Express -140d - 151d*3 + 10 + 137d + d*2 - 28 + 145d*3 in the form ud + pd3 + bd*2 + y and give y. -18 Express 31j - 8 - 18j + 38j + 2 + 26j as m + fj and give f. 77 Rearrange -1 + 2021x + 1889x - 4480x to y + ux and give u. -570 Express (45 - 12t - 45)(-2 + 1 + 2)(-7102t + 31322 - 15666 - 15656) as at + f + gt*2 and give g. 85224 Express -29 - 16 + 4 + 41 + 9762d in the form j + kd and give j. 0 Express (250 + 24 + 20)(g + g - 3g) - 41 + 41 + 6g in the form sg + a and give s. -288 Express -2d*3 - 2d - 47 - 23 + 973 - d*2 - 148 as cd*2 + vd*3 + j + ad and give a. -2 Express (-6s + 2s - 2s)((1 + 2 - 4)(3 - 3 + 1) + 1182 + 70 - 9) in the form ms + j and give m. -7452 Express -507r - r2 + 381r*3 - 384r*3 + 414 + 505r + 3r4 in the form fr*4 + i + hr*2 + lr + xr3 and give l. -2 Express 834y + 2y3 - 387y - 4y2 + 13y*2 - 411y in the form ny + ty*3 + w + ay*2 and give n. 36 Express 276v - 278v - v4 + 11v*3 - 3 + 2v*2 + 0v*4 in the form t + dv*4 + bv*3 + ov + pv2 and give p. 2 Express (2 - 5 + 9)(2g + 3g - 6g) - 3g - 15g + 47g - 53 + 16g as h + lg and give l. 39 Express -22 - f - 73f + 8f*2 + 22f + 3f2 + 23 as xf*2 + w + vf and give x. 11 Rearrange (1501j + 1428j - 199j)(0j + 2j + 3 - j) to the form s + hj + gj*2 and give h. 8190 Express -15m*3 + 436m*2 - 629m*2 + 18m*3 + 3m*4 in the form rm*4 + z + nm*2 + lm + pm3 and give n. -193 Express (2 - 2 - 1)(5 - 5 - q)(4815q + 275q2 - 267q*2 - 6045q) in the form d + hq2 + tq*3 + wq and give h. -1230 Express 25 + 27z2 - 25 - 25z*2 - 50z + 26z2 as tz*2 + hz + d and give t. 28 Express 359w3 - 4w*4 - 1483w*2 + 1458w*2 - 362w*3 - w + 2 in the form qw**	{ "pile_set_name": "DM Mathematics" }
h) = 6h + 1. Let w be g(7). Let o = -38 + w. Suppose -n + 9 - o = 0. Put 3, n, 0, -5 in increasing order. -5, 0, 3, n Let z(a) = a3 + 7a*2 + 8a - 6. Let g be z(-4). Suppose 5 = -5n - g. Sort n, -5, 5, 32. -5, n, 5, 32 Let a = -0.08626 - 0.71374. Let m be 0/(-2) - (-4)/5. Sort m, -0.05, a in ascending order. a, -0.05, m Let m be -834 - ((96/(-10))/8)/(3/(-10)). Put m, -4, -3 in decreasing order. -3, -4, m Let x = 12800.9 + -12801. Sort x, 279, 2/5 in decreasing order. 279, 2/5, x Let s = 0.2 - -14.4. Let k = s - 11.6. Sort 4/3, 6, k in ascending order. 4/3, k, 6 Let x = -0.1 + 0.1. Let o = -42.615 - 0.365. Let l = o + 43. Sort -2, 1/5, l, x in ascending order. -2, x, l, 1/5 Let m(g) = g - 20. Suppose -13 + 3 = 2y. Let u be m(y). Let b = 25 + u. Put b, -1, 5 in descending order. 5, b, -1 Let d = -5 - -11. Let v be d/12 + 4/(72/(-33)). Let y = 0.2 + -3.2. Put 4/3, v, y in decreasing order. 4/3, v, y Let f = 0.46 + -0.56. Let a = -0.4 - f. Suppose -2t = 13 - 15. Sort 0, t, a in descending order. t, 0, a Let j = 91 - 60. Suppose -p = 5m - j + 53, -4m = -2p + 12. Put 2, m, -5 in decreasing order. 2, m, -5 Let r = 7.7 + -8.1. Let w be 5 - (-2 - (-1 - 4)). Suppose 3 + w = -5x. Sort r, x, -0.5. x, -0.5, r Let u = 76889/9 + -8543. Put u, -2, 1248 in increasing order. -2, u, 1248 Let w = 4423 + -4428. Sort 51, 0.3, w, -3, -2. w, -3, -2, 0.3, 51 Let c(m) = -m3 + 30m*2 + 63m - 6. Let s be c(32). Let f be s/(-10) - -1010/(-125). Sort 2, f, -7, -5. -7, -5, 2, f Let x = -13.7 - 0.3. Let q = 55 + x. Let z = -26 + 21. Sort q, -0.1, z in decreasing order. q, -0.1, z Let z = 161 + -152. Suppose -z - 6 = -15c. Sort c, 3, -6, -4 in ascending order. -6, -4, c, 3 Let j be (2 + 40/(-5))/(-2). Let o be 14j(-2 + (3 - 2)). Let s = o - -85/2. Put s, 0.15, -0.4 in decreasing order. s, 0.15, -0.4 Let y = 51558/7 + -7365. Let x = -107 + 63. Put x, y, -1/6 in ascending order. x, -1/6, y Let a = -559 + 558.8. Let i = -3.03 - -0.03. Let d = i - 2. Sort 4, d, a. d, a, 4 Suppose -18s - 66 = -29s. Suppose 11u - 34 = -su. Put u, -1, -5 in descending order. u, -1, -5 Suppose 8a + 349 + 627 = 0. Let z = 120 + a. Suppose -5d + 6 + 9 = -5k, 4k - 2d = -12. Sort z, 8, k in decreasing order. 8, z, k Suppose -4c + 36 + 132 = 0. Let m = -48 + c. Let g be 5m/(-15) - 1. Sort 2, 19, g in ascending order. g, 2, 19 Let x = 27 - 27.45. Let o = x + -0.05. Let g = -1 - 6. Sort g, -3, o in decreasing order. o, -3, g Let y(j) = 13j + 430. Let m be y(-32). Let v be -5 - (-4 - 0/7). Put v, m, 5, 3 in ascending order. v, 3, 5, m Let f(n) = 5n + 17. Let k be f(-4). Let a = 53 + -52.56. Let z = a + -2.44. Sort k, 2/3, z in increasing order. k, z, 2/3 Suppose -172 = 5o + 268. Let a = 21 + o. Let g = 200/3 + a. Sort 4, 0.2, g, 0.3 in descending order. 4, 0.3, 0.2, g Suppose 10t = 3n + 122, n + 15t - 29 = 12t. Let h = 5 + 0. Suppose -b = -0b. Sort b, n, 2, h. n, b, 2, h Suppose 4u - 6 = 3s - 0, 4s + 8 = -u. Suppose 0 = -16d + 283 + 101. Let c be (-26)/6 + (-16)/d. Sort 1, s, c, 2 in descending order. 2, 1, s, c Let z(f) = 12f - 1. Let c be z(-2). Let t be c/(-21) + 8/56. Let y = -10.9 + 11.3. Sort -1/4, y, t in descending order. t, y, -1/4 Let s = -49/3 - -16. Let n = 1231 + -1230.6. Sort n, 3, s. s, n, 3 Let w(r) = r*3 + 12r*2 + 16r - 48. Let p be w(-10). Sort 22, -2, -3, p in descending order. 22, -2, -3, p Let s = 241586 + -241585.6. Let a = -0.07 + -3.93. Put a, 2, -19, s in descending order. 2, s, a, -19 Suppose -531n - 115 - 49 = -490n. Put -8, -5, -2, n, -3 in descending order. -2, -3, n, -5, -8 Suppose 0 = -4l + 5x + 16, 5l - 19x - 61 = -23x. Suppose lc + 37 = 19. Sort c, 4, -1, -18 in descending order. 4, -1, c, -18 Let l = -7104 - -7107. Put -1/2, l, 0.5, 0.3, -6/131 in ascending order. -1/2, -6/131, 0.3, 0.5, l Let s(j) = -2j3 + 15j*2 - 20j + 4. Let c be s(6). Sort -4, 1, c, 7 in decreasing order. 7, 1, -4, c Let o be -6 - (-6)/4110/33. Sort o, 2, -3, 39, 0. -3, o, 0, 2, 39 Suppose 20q = -5n + 17q + 1597, n - 3q = 323. Put -4, 3, n, 5 in decreasing order. n, 5, 3, -4 Suppose -106h - 80h - 320 = -26h. Sort h, -10, 4/5, -1/3, 5/2 in descending order. 5/2, 4/5, -1/3, h, -10 Suppose 4k = f + 13, -f - 4k - 1 = 4. Suppose -10u - 5s = -14u + 16, 2u + 5s - 8 = 0. Let o = 0 + 2. Sort u, o, f in ascending order. f, o, u Let m = 26.962 - 28. Let d = m - -1.1. Let l = 2.062 - d. Put l, 0.2, -5 in decreasing order. l, 0.2, -5 Suppose -3h = -3z - 9, -5h + 30 = 8z - 10z. Suppose 0c = c + 5. Put 11, c, h in descending order. 11, h, c Let a(y) = y3 + 16y*2 - 55y + 38. Let x be a(-19). Sort -4, -53, -17, x. -53, -17, -4, x Suppose 0 = 3831z - 3833z - 118. Let y be 45/(-20) - (-2)/8. Sort z, -1, y, 5 in increasing order. z, y, -1, 5 Let w(t) = -82t2 + 6t - 5. Let u be w(1). Let n = -411/5 - u. Sort -1, 0.3, 3, n in descending order. 3, 0.3, -1, n Let u = -0.06091 + 1.06091. Sort 0, 1/6, u, 1/14, -1 in decreasing order. u, 1/6, 1/14, 0, -1 Let c = 107/217 + -2/31. Let l = 15 - 11. Let i = l + -2. Sort c, 0, i. 0, c, i Suppose -5c + 6 = 1. Let n be (4/(-6))/((-1)/(-6)). Let x = 3 + 0. Sort n, c, x. n, c, x Let r = 1782 + -1782.011. Sort 0.5, 1, r, -0.2, 2. -0.2, r, 0.5, 1, 2 Suppose 5u - 2c - 45 = 3c, -2u + 33 = -5c. Suppose uw + 19 = 27. Let p be (4 + -3)/(-4 - (-15)/2). Sort p, w, -1, 0 in ascending order. -1, 0, p, w Let i(u) = -2u*3 - 20u*2 + 48u + 2. Let o be i(-12). Sort -4, o, -165 in descending order. o, -4, -165 Let v = 1133 - 1114. Sort 2, -5, v in descending order. v, 2, -5 Let r = 2.25 + -2.25. Sort 2/9, 3/16, -2, r, 2/3. -2, r, 3/16, 2/9, 2/3 Let b be 2/286 - 6/3520. Sort 1, -6, -1, b, 2. -6, b, -1, 1, 2 Let y = 3442 + -3535. Sort 4, y, -5/2, 3. y, -5/2, 3, 4 Suppose 5l + 858w = 857w - 2, 10 = 3l - w. Sort l, 0, -3, 21, -4 in descending order. 21, l, 0, -3, -4 Let f be (2 + 1)3 - 1. Let x = 722 - 725. Let y be (-1 - x/(-3))/((-22)/(-55)). Sort y, -4, -2, f in descending order. f, -2, -4, y Let y be (-8)/(6/(-4) + 1). Suppose -u = 3u - y. Let j = -5.4 + 1.4. Put j, u, -11 in decreasing order. u, j, -11 Let w be ((-1)/4)/(52/520)2. Sort 4, -2, -4, 21, w in ascending order. w, -4, -2, 4, 21 Let t = -7073 - -7106. Let f be 0 + -1 - (0 + 0). Sort f, 0, 1, t in decreasing order. t, 1, 0, f Let q = 313.8 + 18.2. Let d = 335 - q. Sort 12, d, -5, 0.4. -5, 0.4, d, 12 Let i = 14323 + -14298. Put 1, i, -79, 5 in descending order. i, 5, 1, -79 Let u = 338/25 + -336/25. Let m = -17 - -8. Let w be 0 + m/(-11) + -1. Sort w, u, 0.1 in increasing order. w, u, 0.1 Suppose -3m - 55 = -2t, 3t = 4m + 5t + 50. Let j = 136 + -134. Suppose 0 = -jy + 3h - 9, 5h = 4y + h + 8. Sort y, m, -1, -2. m, -2, -1, y Let q(l) be the second derivative of -5l4/12 - 4l3/3 - l2/2 - 11l - 1. Let t be q(-2). Put 0, t, -2, 3 in decreasing order. 3, 0, -2, t Let q = -1 - -2. Let b = 10.61341 + 1.38659. Sort -0.02, b, q. -0.02, q, b Let m be (-6)/(-27) + (-3)/((-3672)/(-452)). Let h = m + -23/306. Put 152, h, -1 in decreasing order. 152, h, -1 Suppose 0 = -9r + 4r + 15. Let f be -2 - (-10 + 1) - r. Suppose fb - 5b = 9. Sort -2/3, 3/5, b. b, -2/3, 3/5 Let q(l) = 3l*2 + 125l + 1218. Let x be q(-26). Let d(m) = m*3 + 11m*2 - m - 7. Let h be d(-11). Sort h, 2, -3, x in descending order. h, 2, -3, x Let f = -17/301 - 16/43. Put -2/15, f, -0.06, -23 in decreasing order. -0.06, -2/15, f, -23 Suppose 4i = -5z - 51, 44z = 7i + 40z. Sort i, -9, 3, -81 in ascending order. -81, -9, i, 3 Suppose -h - 1 - 10 = 0. Let v(n) = -n*2 + 48n + 449. Let q be v(56). Put h, -1, q in decreasing order. q, -1, h Let i = 342 - 339. Let h = 154 + -122. Sort i, -0.5, h, 5. -0.5, i, 5, h Let q = -6.6734 - -4.6734. Sort -0.06, 0.9, -14, -4, q in descending order. 0.9, -0.06, q, -4, -14 Let f be ((-1)/228)/((-4)/(-8)). Let n = 15891 - 15891.5. Sort f, 4, n, -1/5. n, -1/5, f, 4 Suppose 3 + 1 = 4t. Let u = -3 - t. Let c be ((-4)/u + -1)-1. Sort -1, 4, c. -1, c, 4 Let w = 53.7511 - -0.0489. Let j = -53.6 + w. Let i be (-2 - (-62)/28)*-2. Sort i, 3/7, j, 5. i, j, 3/7, 5 Let g = 11 + -6. Let q = 0.48248 + -0.88248. Put g, q, -0.1, -1.5 in ascending order. -1.5, q, -0.1, g Let q be (46/10)/((-8)/(17 - 9)). Sort 1, -0.1, q, -3. q, -3	{ "pile_set_name": "DM Mathematics" }
ut replacement from zdb. What is prob of sequence zd? 1/6 Two letters picked without replacement from ttoo. Give prob of sequence oo. 1/6 Three letters picked without replacement from {k: 1, w: 1, g: 1, r: 2}. Give prob of sequence grr. 1/30 Calculate prob of sequence yw when two letters picked without replacement from {w: 3, y: 6, l: 6}. 3/35 Calculate prob of sequence glig when four letters picked without replacement from {a: 2, g: 2, y: 1, l: 2, b: 1, i: 1}. 1/756 What is prob of sequence ar when two letters picked without replacement from jaakjskaaaaarjrab? 1/17 Calculate prob of sequence nnk when three letters picked without replacement from dnnnkeknnkdknnnkke. 7/102 Two letters picked without replacement from {v: 3, o: 2}. Give prob of sequence oo. 1/10 Calculate prob of sequence qhhy when four letters picked without replacement from bsshsbsyhssxsq. 1/12012 Calculate prob of sequence wwwh when four letters picked without replacement from whhwhhhhhhwh. 1/220 Two letters picked without replacement from {o: 2, c: 1, x: 4, d: 3}. What is prob of sequence dd? 1/15 What is prob of sequence jzz when three letters picked without replacement from {j: 1, o: 1, z: 2}? 1/12 What is prob of sequence dp when two letters picked without replacement from lvblbvvdpbqb? 1/132 What is prob of sequence nqn when three letters picked without replacement from {v: 7, q: 2, n: 5}? 5/273 Two letters picked without replacement from ocwfoowckwc. What is prob of sequence kf? 1/110 Calculate prob of sequence pa when two letters picked without replacement from {s: 1, p: 1, a: 1, q: 1, t: 1}. 1/20 Two letters picked without replacement from wewewwpwwpppopwe. What is prob of sequence op? 1/48 Two letters picked without replacement from eegtghogog. What is prob of sequence ge? 4/45 Three letters picked without replacement from {u: 1, c: 2, f: 1, v: 1}. Give prob of sequence ccu. 1/30 Two letters picked without replacement from {p: 1, i: 1, o: 2, w: 8, l: 2, d: 3}. Give prob of sequence dp. 3/272 Two letters picked without replacement from {u: 2, e: 1, v: 7}. What is prob of sequence ue? 1/45 What is prob of sequence ge when two letters picked without replacement from {e: 4, f: 2, g: 3, b: 2, k: 2, v: 3}? 1/20 Calculate prob of sequence nss when three letters picked without replacement from {s: 2, y: 4, n: 6}. 1/110 What is prob of sequence kvdd when four letters picked without replacement from {l: 2, i: 3, r: 3, v: 1, d: 3, k: 3}? 1/1820 Four letters picked without replacement from {o: 1, j: 2, y: 1, p: 1, b: 2, u: 2}. What is prob of sequence bbyo? 1/1512 What is prob of sequence aaa when three letters picked without replacement from {v: 11, w: 1, a: 7}? 35/969 Two letters picked without replacement from {o: 1, d: 4, w: 2, l: 2}. Give prob of sequence wo. 1/36 What is prob of sequence wbb when three letters picked without replacement from {w: 3, b: 3}? 3/20 What is prob of sequence no when two letters picked without replacement from {n: 1, o: 1, a: 4, u: 9}? 1/210 Three letters picked without replacement from pfypddyqqyyqsdy. What is prob of sequence fqd? 3/910 Two letters picked without replacement from {d: 1, l: 3, m: 2, p: 4, z: 6}. What is prob of sequence mm? 1/120 Four letters picked without replacement from {j: 7, s: 9}. What is prob of sequence sjss? 21/260 Calculate prob of sequence qii when three letters picked without replacement from iiq. 1/3 Three letters picked without replacement from ddjjmdmd. Give prob of sequence jjm. 1/84 What is prob of sequence wz when two letters picked without replacement from ocwfcbz? 1/42 Four letters picked without replacement from rrrurrrjuujrrrjrrj. What is prob of sequence rrjr? 11/204 Calculate prob of sequence ibbb when four letters picked without replacement from iiibbibiiebci. 7/715 Three letters picked without replacement from {s: 5, v: 3, k: 3, u: 6}. Give prob of sequence kuk. 3/340 Calculate prob of sequence snnb when four letters picked without replacement from {b: 2, s: 2, n: 4}. 1/35 What is prob of sequence ehhr when four letters picked without replacement from {h: 4, e: 2, c: 1, r: 1, a: 1}? 1/126 What is prob of sequence phh when three letters picked without replacement from {h: 7, p: 2}? 1/6 Two letters picked without replacement from {z: 4, m: 2, h: 2, y: 2, j: 3}. What is prob of sequence yy? 1/78 Three letters picked without replacement from {d: 18, c: 2}. What is prob of sequence ddd? 68/95 Calculate prob of sequence bu when two letters picked without replacement from ttzuuutbyuuuybyz. 1/20 Two letters picked without replacement from {m: 3, r: 8, e: 5}. Give prob of sequence me. 1/16 What is prob of sequence aaaa when four letters picked without replacement from {x: 1, n: 4, e: 1, a: 4}? 1/210 Four letters picked without replacement from oqqoqlwqw. What is prob of sequence qloq? 1/126 Calculate prob of sequence uruy when four letters picked without replacement from uruuyrruyyyy. 1/66 Two letters picked without replacement from {e: 2, w: 1, i: 1, l: 2}. Give prob of sequence iw. 1/30 What is prob of sequence dg when two letters picked without replacement from {d: 3, j: 2, m: 4, g: 1}? 1/30 What is prob of sequence ddl when three letters picked without replacement from dld? 1/3 Two letters picked without replacement from {v: 5, e: 3}. What is prob of sequence ee? 3/28 What is prob of sequence xxi when three letters picked without replacement from iixi? 0 Three letters picked without replacement from {a: 9, p: 8, j: 2}. Give prob of sequence ajj. 1/323 What is prob of sequence uj when two letters picked without replacement from zjzjzzzyzjyuzj? 2/91 Calculate prob of sequence rr when two letters picked without replacement from {l: 4, r: 2, d: 6}. 1/66 What is prob of sequence rr when two letters picked without replacement from {y: 3, r: 7}? 7/15 Four letters picked without replacement from ddpp. What is prob of sequence dpdp? 1/6 Calculate prob of sequence sp when two letters picked without replacement from {o: 2, g: 1, s: 5, p: 4, i: 3, c: 5}. 1/19 Three letters picked without replacement from zyzzyyyyyyyzzy. What is prob of sequence yyy? 3/13 What is prob of sequence fjso when four letters picked without replacement from zzzzojjzfsjzz? 1/5720 Three letters picked without replacement from {d: 12, w: 6}. What is prob of sequence dwd? 11/68 Two letters picked without replacement from ppmmpmppkpmikp. What is prob of sequence ip? 1/26 Three letters picked without replacement from {e: 1, z: 2, a: 2, d: 7}. What is prob of sequence zaz? 1/330 Two letters picked without replacement from fttjjttjtffaftj. Give prob of sequence aj. 2/105 Four letters picked without replacement from afyyyafyb. Give prob of sequence ybyf. 1/126 Four letters picked without replacement from {f: 6, c: 2}. Give prob of sequence cfff. 1/7 Two letters picked without replacement from jffwfjf. What is prob of sequence ff? 2/7 What is prob of sequence xwx when three letters picked without replacement from wjxxwxqxxclqwjqqcx? 5/272 What is prob of sequence yy when two letters picked without replacement from ywywyyywwwyoywywyww? 4/19 Two letters picked without replacement from sfqmfspdd. What is prob of sequence pq? 1/72 Calculate prob of sequence mwxi when four letters picked without replacement from {m: 1, w: 2, z: 1, i: 2, x: 3, h: 3}. 1/990 Calculate prob of sequence wt when two letters picked without replacement from wwvpvwvpvltpw. 1/39 Four letters picked without replacement from sszsssxzxxssszlxsx. Give prob of sequence slzs. 1/340 Four letters picked without replacement from {j: 1, z: 2, t: 1, v: 13, n: 3}. Give prob of sequence nztj. 1/19380 Calculate prob of sequence la when two letters picked without replacement from {a: 3, l: 2}. 3/10 Four letters picked without replacement from {y: 2, z: 5}. What is prob of sequence yyzz? 1/21 Four letters picked without replacement from {b: 3, k: 7, s: 3, g: 4, p: 2}. What is prob of sequence spbp? 1/5168 Two letters picked without replacement from oleedesdkdle. Give prob of sequence oe. 1/33 Four letters picked without replacement from {o: 1, s: 3, c: 3, x: 2, n: 3, z: 2}. Give prob of sequence nncc. 3/2002 Calculate prob of sequence gh when two letters picked without replacement from {h: 3, v: 2	{ "pile_set_name": "DM Mathematics" }
j (b) x (c) 4 a Let i = -0.39 + -0.01. Let n be (-1)/(-4) + 804/304 + -3. Which is the nearest to 1? (a) i (b) 1/7 (c) n b Suppose 2o = 3w - 7, -4w + 3 = w + o. Let d = -88 - -93. Suppose df + 25 = 0, -4g - f = -3g. Which is the closest to w? (a) g (b) 0.1 (c) -2 b Let n = 2388/7 - 341. What is the nearest to -0.2 in 1/5, -6, n? n Let q = -174.9 - -175. What is the nearest to -3/10 in -3/5, -3, q? -3/5 Let i = 1 + -1.2. Let m = -60 - -67. Let g be (-11)/m-3 + (-6)/(-21). What is the nearest to i in g, -1/7, -5? -1/7 Let k = -2.664 - -1.664. Let f = 0.4 + -0.3. Let g = -0.9 - f. What is the nearest to g in -0.5, k, -2? k Let d = -189.7 + 189.5. Which is the nearest to d? (a) -4 (b) -11 (c) -4/7 c Let a be 1120/210 - (8/3)/(-4). What is the nearest to -0.2 in -6/7, 2/3, a? -6/7 Let m be (-1070)/(-440) + 6/8 - 3. Which is the closest to -2/7? (a) 3/5 (b) 0.5 (c) 0.1 (d) m c Let f be 3/9 + (-2)/(-12). Let y = -505/6 + 84. Let a = f + y. What is the nearest to 1 in 0.3, a, -2? a Let g be (-1 - 18/(-21))/1. Let l = -263.3 + 263. What is the nearest to g in -2, 5, l? l Let v be (-2)/4 - 65/6. Let j = v - -11. Let p = -1124 + 1123.6. Which is the nearest to 5/4? (a) p (b) j (c) 0 c Let y = 63 - 312/5. Let i = -38.92 - -34.92. Let o = -3 - -1. Which is the nearest to y? (a) 2/11 (b) i (c) o a Let l = -0.8 + -0.2. Let m = 974/7 + -139. Which is the closest to l? (a) -2/7 (b) -0.5 (c) m b Let v = 4.8 - -2.2. Let r = 0.3 - -7.7. Let u = r - v. What is the closest to u in 0, 1, -1/3? 1 Let u = -1566 + 1562. What is the closest to -5 in u, -3/56, 0.2? u Let z = -7 + 7. Let x be (56/163/21)/(-1). Which is the nearest to z? (a) -0.09 (b) x (c) -2/7 a Let g = -126.942 + 127. Let s = 5.058 - g. What is the closest to 3/2 in 0.7, s, 0.2? 0.7 Let m = 81.09 + -81. Let b = -0.01 - m. What is the nearest to 0.3 in -0.4, 2/3, b? 2/3 Let x = 0 + -0.2. Let j = -0.1 - x. Let i = 1410 - 12692/9. Which is the nearest to 1? (a) 2 (b) i (c) j c Let o = -4.4 - -5.4. Which is the closest to o? (a) -1 (b) -6/7 (c) 0.3 c Let z be (2 - 0) + (9 - 13). Let h be z/5 + 2/(-20). Let u be 7/(-6) - 10/(-15). What is the closest to u in -0.3, h, 0.3? h Let z = -66 - -62. Which is the nearest to 3? (a) z (b) 1/6 (c) 0.1 (d) 1/2 d Let m = -829/2635 + 24/85. Which is the closest to -2/5? (a) 5 (b) -1 (c) m c Let x = -780.6 - -833.21. Let y = 53 - x. Let p = y - -0.01. Which is the nearest to 0.1? (a) p (b) 5 (c) -1/10 c Let j = 2 + -1.7. Let y = -1 + 4. Let q be (6/9)/(-16(-3)/54). What is the closest to q in y, 0.1, j? j Let q = -297 + 292. Which is the closest to 0.3? (a) q (b) 0 (c) -10/9 b Let w = -3/14 - 9/7. Let j = -27.82 - -9.868. Let s = j - 0.048. Which is the nearest to -2/5? (a) w (b) -1 (c) s b Let j = 91/123 + -3/41. Let x(w) = -w2 - 39w + 1026. Let k be x(-57). Let a = 0.3 - 0.4. What is the nearest to k in a, j, -2/27? -2/27 Let t = -262 - -262.1. Which is the nearest to -5? (a) t (b) -5 (c) 0.3 b Let l = 112.8 + -117.8. Let q be (5/4)/(-5) + 0. Which is the nearest to 6? (a) l (b) -0.4 (c) q c Suppose -y + 43 = 47. Which is the closest to 29? (a) 0.2 (b) 1/8 (c) -5 (d) y a Suppose -5y + 2y + 14 = b, y = -5b. Suppose 8p = 7p + 3d + 12, -5p = -2d - 8. What is the nearest to p in 2/15, -4, b? 2/15 Let b = 45.6 - 45.5. What is the nearest to 6 in 0.2, b, 0.5? 0.5 Let y = -3.1 - -0.1. Suppose -2s + 7 = 4t - 25, -5s + 8 = t. Let z be -1 - 27/(-204) - (-6)/t. Which is the closest to y? (a) -1 (b) -0.2 (c) z a Let j be 2/(-5) + 16/20. Let p(h) = -h + 10. Let z be p(7). Let v be (6/(-9))/(1/z). Which is the nearest to j? (a) 2/7 (b) v (c) -2/13 a Let y = -144 - -142. What is the closest to 0 in -5, -3, y? y Let m = -243 + 243. Let h be -1 + -2(-2)/12. Which is the closest to 0? (a) m (b) 2 (c) h a Let j = 1153 - 1152.6. What is the closest to 1/4 in -3, -0.2, 19, j? j Let a = -1974 + 1975. What is the nearest to -3 in 0.5, a, -3/5, 6? -3/5 Let n = 359 + -611. Let u be (-1)/(-4) + 119/n. Which is the nearest to u? (a) -0.5 (b) -5 (c) -4 a Let s(h) = -1. Let r(z) = z - 23. Let y(q) = r(q) - 4s(q). Let p be (-16 + 1)-3. Let a be y(p). What is the closest to 0.3 in -0.3, -3/7, a? -0.3 Let w = -282.944 + 279. Let t = -0.056 + w. Let x = -0.1 + 0.1. Which is the nearest to 1/16? (a) 1 (b) x (c) t b Let v = 0.5 + -0.5. Let k = 419 + -329. What is the closest to -1 in k, v, 1/3? v Let r be (-12)/(-14) - -1 - 2. Let z be (3 - 0)156/(-36). Let l be 1/(-2)0/z. Which is the closest to l? (a) -2 (b) r (c) -1 b Let l(j) = 2j*2 - 26j - 20. Let s be l(14). Let i be (-1)/(4/(-24)-3s). What is the closest to i in -0.5, -3/2, 0.5? -0.5 Let k = -90.4 + -6.6. Let z = 98.06 + k. Let d = z + -0.06. Which is the nearest to -1? (a) 1/3 (b) -3/2 (c) d b Let c be 4(-1 - 18/(-8)). Suppose -2a - 3f = -a - 12, 3a + 20 = cf. Let n be (-2 - a)(-4)/(-16). What is the nearest to -2 in n, 0.2, 0? n Let v = -4.65 - 0.35. Let y = 11/20 + -3/4. Let r = -27/4 - -33/4. Which is the nearest to 1? (a) y (b) v (c) r c Suppose 864 = -6i - 3i. Let n be 8/(-21) - (i/42)/(-8). Which is the nearest to n? (a) -2/7 (b) 0.1 (c) 4/7 a Suppose 93x - 64x = -87. What is the closest to 0.06 in 0.09, -1/8, x? 0.09 Let l be 7 + (-10 - -12)-2. Let h be (4/14)/(9/21). Which is the nearest to h? (a) 5 (b) -0.2 (c) l b Let y = -1591 + 1588. Which is the closest to 1/4? (a) y (b) -0.82 (c) -1/4 c Let r = -0.1 + -0.2. Let n = r + -0.7. Which is the nearest to 0? (a) -2/9 (b) n (c) -0.2 c Let q(o) = 3o*3 + o - 1. Let d be q(1). Suppose 0z - d = z. Let p = 68 - 68.1. Which is the closest to -1? (a) z (b) p (c) 0.4 b Let l = -149.4 - -149.9. Which is the nearest to 2? (a) 0.4 (b) -0.1 (c) l c Let l be ((-4)/10)/(11/(-121)). Let q = -188/45 + l. Which is the closest to 0? (a) q (b) 0 (c) 5 b Let r = 1740 - 1742. Which is the closest to -1? (a) 0.1 (b) r (c) -0.4 c Let x be ((-2)/(-30))/(2/4). Let h = 0.727 + -0.767. Which is the closest to -0.1? (a) x (b) 4 (c) h c Let i be (-8)/44 - 42/11. Which is the nearest to 1? (a) 1 (b) 0.07 (c) i a Let z be 3/10(-4)/3. Let f = -5.04 - 0.26. Let n = f + 5. What is the nearest to -0.1 in n, 0.5, z? n Let y = 274.01 + -274. Let z = 7.7 + -8. Which is the closest to -1? (a) z (b) -0.5 (c) y b Let m = 1339 + -1358. Which is the closest to -1/2? (a) -1 (b) 1 (c) m a Let x(o) = -o2 - 6o. Let p be x(-3). Suppose 0 = t, -t = 3g - 2t - p. Suppose -j = 4j + 10. Which is the closest to 0? (a) j (b) g (c) 5 a Let g = -21.261 - -21.1. Let f = -0.039 + g. What is the nearest to -2/3 in -3, f, -14? f Let c be -10 - ((-35 - -4) + 9). Let j be ((-8)/(-18))/(28/(-6)). What is the nearest to c in -0.2, j, 2/5? 2/5 Let v = -4.0423 + 0.0423. What is the closest to 5 in -2/13, -5, v? -2/13 Let g = -1403.5 - -1404. Which is the nearest to 0? (a) 4/43 (b) 1/10 (c) g a Suppose 0 = -2x + 8 + 2. Let g(f) = 3f - xf + 0f2 + 5f*2 + 3f. Let n be g(-1). What is the closest to -1 in n, -1, -3/2? -1 Suppose d + 686h = 691h - 12, -d = -h + 4. Which is the nearest to -2? (a) -0.5 (b) 0.1 (c) d c Let h be ((-288)/20)/(-6) + -2. Let b = h + -11/15. What is the nearest to b in 0, -3, 0.2? 0 Suppose -36 = 3u - 4t, -t = -4t. Let z = u + 12. Let a = 1 - 6. What is the nearest to 1/4 in a, z, -3? z Let f = 14.6 + -7.7. Let v = -2.9 + f. Which is the nearest to -0.1? (a) 0 (b) v (c) 2 a Let v = -635.8 - -636. What is the closest to 1 in -0.3, -3, 2, v? v Let h = -3459/2 + 1728. Which is the closest to 1/4? (a) -5 (b) -5/6 (c) -0.1 (d) h c Suppose 4u + 7 - 3 = 0. Let j be (0/(-3) - u) + 4. Suppose 12 = -jm + 2. Which is the closest to 0.1? (a) -1/2 (b) 0.5 (c) m b Suppose -5p - 4 + 19 = -5l, -3p = -l - 7. Let r = -0.168 - -1.168. What is the nearest to -2/7 in l, -2/13, r? -2/13 Let k = -75/76 + 14/19. Which is the nearest to 0? (a) -51 (b) 0.2 (c) k b Let y = 5/69 - -59/138. Let z be -11/(-2)2. Let m be ((-7)/(-14))/(6/(-4) - 1). Which is the closest to m? (a) z (b) y (c) 2/5 c Let r = 1/610 + -1227/4270. What is the nearest to r in -0.5, -9, 2? -0.5 Let q = -1.22 - -3.22. Which is the nearest to -6/7? (a) -0.3 (b) -1 (c) q b	{ "pile_set_name": "DM Mathematics" }
904 + 2106 = -430j. Calculate b(j). 37 Let a = 26675 - 26680. Let x(l) = -2l*3 - 9l*2 + 4l + 7. What is x(a)? 12 Let c = -11030 - -11038. Let y(n) = 14n - 114. What is y(c)? -2 Suppose -2g - c = -20, 4g = g + 2c + 44. Let x be (-5 - g/(-6)) + (8 - 3). Let l(q) = -2q2 + 4q - 4. What is l(x)? -4 Let i(n) = n3 - n2 - n - 8. Let s(m) = 156m - 1204. Let f be s(8). Let h = 58 + -102. Let k = f + h. Calculate i(k). -8 Let r(a) = 2a*2 - 40a*2 - 3 + 40a*2 - 4a - 8a2. Determine r(-1). -5 Let b(m) = 9 + 4m - 2 - 2m. Suppose 2f + 4 = -3x, 13f + 6 = 9f - 5x. Let h be (4/12)/(f/(-18)). Determine b(h). -5 Let t(q) = 38q + 491. Let l be (130/15)/(6/18-2). What is t(l)? -3 Let i = -2188 + 2184. Let j(m) = -m*3 - 4m*2 + 7m + 22. Determine j(i). -6 Suppose 3b = i - 19, 2i + b + 13 = 4i. Let n(g) be the third derivative of -g6/120 + g5/20 + g4/24 - 110271g*2. What is n(i)? -12 Let l(n) = -n - 1. Let o be 1 - 13/(-3) - 610/(-915). Let s(i) = 14i - 11 + 0 + i*2 - 3i*2. Let q be s(o). What is l(q)? -2 Let u(g) = -12g*2 + 22 - 2g - g*3 + 3g*2 - 10g*2 + 2g*2 - 15g. Calculate u(-16). 38 Let l(s) = 4s3 - s2 - s + 2. Suppose 0 = 92i - 64i - 1008. Let q(p) = -p2 + 36p + 1. Let k be q(i). Determine l(k). 4 Let x = -14782 - -14810. Let a(z) = 7z - 191. Calculate a(x). 5 Let u(c) be the second derivative of c5/10 - c4/12 + c3/2 + c2/2 + 3372c. Determine u(3). 55 Let q(p) = p + 1. Suppose -15 = 5k, -5b - 37 = k - 104. Suppose -b = -4w + 2w. Give q(w). 8 Let d(x) = -4x + 17x + 24 + 14x - 12x + x*3 + 8x*2. Calculate d(-6). 6 Let h(s) be the second derivative of -5/6s*3 + 0 - 3/2s*2 - 1/6s*4 + 3s. Suppose 0f = -5f - 4w - 43, w = 2f - 1. What is h(f)? -6 Let z(a) = -5a - 2 - 7a - 21a + 25a*3 + 65a - 20a. Let g(d) = 4d3 + d2 + d - 1. Let q(t) = -6g(t) + z(t). Calculate q(5). 9 Let o(n) = -7n*2 + 3n - 15. Let a(c) = 61c2 - 26c + 128. Let j(x) = 4a(x) + 35o(x). Let p be 2 + -2 + 0/(-3). Calculate j(p). -13 Let q(p) = 8p + 39. Let n be ((-45)/(-12) + -3)(-168)/(-63)-3. Calculate q(n). -9 Let f(i) = i3 - 7i*2 + 2i - 1. Let p(h) = 7 + 68h2 + 14h - 142h2 + 73h*2. Let o be p(14). Give f(o). 13 Let r be 16/(-9) + (10/45 - 0)/(-1). Let x(p) = -6p*2 + 5p + 14. Calculate x(r). -20 Let c(i) = i*3 - 17i2 + 2. Let n(q) be the second derivative of -q5/20 - 7q4/12 - 4q*3/3 + 5q*2/2 - 10q. Let b be n(-6). Give c(b). 2 Let q(u) be the first derivative of 0u - 1/2u*2 - 295. What is q(-2)? 2 Let s = -11 + 12. Let x(c) = 4138c - 2068c - 3 - 2069c. Calculate x(s). -2 Let m(y) = 2y - 16. Let h be 5/151/(3/531). Suppose 0 = 15n - h - 31. What is m(n)? -4 Suppose -4p + g = -10, g = -2p - p + 11. Suppose -4l - 2i + 3 = 1, l - 23 = 4i. Let a(b) = 4 + 0b2 + 0bl - b3 + b2 + b2. What is a(p)? -5 Suppose -228h - 22 = -206h. Let o(d) = -7d + 12. What is o(h)? 19 Let d(p) = -p3 - 17p*2 + 34p - 25. Let j be d(-19). Let k(m) = -jm2 - m - m3 - 6 + 51m*2. Give k(0). -6 Let i(k) be the first derivative of -2k3/3 + k2 - 33k - 7523. Calculate i(5). -73 Suppose 0 = 3i - 4g - 21, g - 9 = -331i + 327i. Let z(h) be the second derivative of -h4/6 + h3/2 + h2 - h. What is z(i)? -7 Let y(m) = -3m - 5. Suppose 25694 = -4g + 33g. Let a = g + -880. Give y(a). -23 Let j(r) = r*3 + 52r*2 - 161r + 223. Let i(n) = -7n2 - 129n - 627. Let d be i(-11). Determine j(d). 3 Let i = -1915 - -2905. Let p be 2/(-11) - i/(-121). Let q(l) = l*3 - 9l*2 + 9l - 7. Calculate q(p). 1 Let a(c) = c*3 - 6c*2 - c - 1. Let n be (0/(-6))/(0 + 1). Suppose 3 + n = b, -b - 312 = -3v. Let m = 111 - v. Determine a(m). -7 Let h(a) = 35a - 245. Let l be h(-6). Let z = 456 + l. Let o(q) = -24q2 - q + 1. What is o(z)? -24 Let r(h) be the third derivative of h6/40 - h4/24 - h3/6 - 2443h2. Suppose -3z = -6z + 6, 4z - 8 = 2t. Suppose -c + tc = 1. Calculate r(c). -3 Let n = -86 - -77. Let c(q) = -4q - 10. Let i(h) = -3h - 8. Let s(p) = -2c(p) + 3i(p). Give s(n). 5 Let v(b) = 9b2 - 14b - 14. Let k be v(7). Let j(d) = -326 + 4d + 0d + k. What is j(-2)? -5 Let y(a) be the second derivative of -a*4/6 + 2a3/3 - a2 + a. Suppose 931g + 43 = 5629. Determine y(g). -50 Let g = 1001 - 999. Let j(f) be the second derivative of 4f*3/3 - 2f*2 - 2f. Let q(u) = -7u + 3. Let x(i) = 4j(i) + 5q(i). What is x(g)? -7 Suppose 3p = 0, -4x - 2p = -4p - 20. Let u(r) = 4r*2 - 11r - 81. Let a(f) = 13f2 - 33f - 272. Let o(g) = 3a(g) - 10u(g). Determine o(x). 24 Suppose 2y - 268 = -44. Let j(i) = 23 - yi - 110i + 220i. Let a(z) = -z + 12. Let q(k) = 7a(k) - 4j(k). Give q(13). 5 Let d be (-6)/(-4)(-16)/(-24). Let z(j) be the third derivative of j5/15 + j3/6 + j2 + 25. What is z(d)? 5 Let q(m) = 210m - 102m + 58 - 98m. Determine q(-6). -2 Let f(l) = -l*3 + 2l*2 - 3l + 4. Suppose -6r - 58 = -4r. Suppose s - 12 = 4k - 0k, 0 = 3s + 3k - 111. Let j = r + s. Determine f(j). -14 Let y(m) = 50m + 459. Let h be y(-9). Let r(k) = 7k*2 - 6k - 21. Let t(i) = 6i2 - 6i - 21. Let v(n) = 5r(n) - 6t(n). Determine v(h). -6 Let m = -4 - -4. Let p(z) be the second derivative of -1/6z3 + 11/2z*2 + 22z + 0. Give p(m). 11 Let y(m) = m - 15. Let v be (-8)/(-10)(-3 - (-3)/6). Let k(s) = 41s + 82. Let a be k(v). Give y(a). -15 Let t(n) be the first derivative of -9n2/2 + 83n - 682. What is t(9)? 2 Let c = 15 - 9. Suppose -4g + 19g = 75. Let l(t) = gt - 47t*2 + 0t + 1 + 1 - t*3 + 52t*2 + 6. Calculate l(c). 2 Let f = -1 + 4. Let w(p) = 3p - p*2 - 4p + 8p2 + pf - 6. Suppose -667 = 97l + 97l + 691. Determine w(l). 1 Let k = -29 + 17. Suppose -3i - 8q + 12q + 6 = 0, -2q = 0. Let u be (20/k - i/(-3))7. Let l(s) = -s - 9. Give l(u). -2 Let c(b) = b*2 + 26b - 61. Suppose 0 = 2p + q + 378 - 323, 0 = -2p + q - 57. Give c(p). -5 Suppose -2t - j = -8, -t - 2j = -2 + 1. Suppose a - 1 = -tg + 9, 4g - 8 = -4a. Let z(r) = 3r*2 - 5r. Give z(g). 2 Suppose -3l = 5v - 303, 4v - 3v = 3l - 285. Suppose 17i = 23i - l. Suppose 4o = 3o + 4, -i = -2t - o. Let g(r) = -r + 5. Give g(t). -1 Suppose 0 = 12w - 14w - f + 3, 0 = -2w + 3f + 7. Let d(v) = -4vw + 2v2 + v2 - 4 - 11v - 18v + 37v. Determine d(8). -4 Let h(p) be the first derivative of -p3/3 - 3p*2/2 + 3p + 4. Suppose 2i + 124 = 2f, 68 = -f + 2f + 5i. Let u be ((f/(-7))/(-9))/((-2)/10). Give h(u). -7 Let f = 245 - 231. Let m(c) = 35 - f - 23 + 2c + c2. Determine m(-3). 1 Let h(f) = -f2 + f - 13. Let m be (8/35 - (-320)/(-400)) + (-201)/(-21). Calculate h(m). -85 Let f(g) = g2 + 5g + 3. Let u be f(-3). Let v(o) = 49o2 - 7o - 49. Let x(a) = -53a2 + 8a + 53. Let b(i) = 13v(i) + 12x(i). What is b(u)? -7 Let t = 174 + -472. Let x = t - -303. Let r(y) = 8y - 2. Determine r(x). 38 Suppose 0b + 2b = b + 2. Let j(x) = -7x*3 + 2x*2 - 2x + 2. Give j(b). -50 Let x(g) = 105g3 - g2 - g - 1. Let s(t) = -61t + 4147. Let m be s(68). Give x(m). -106 Let d(q) = -3q2 + 15q + 2. Let u(b) = -b*2 + 5b + 1. Suppose 13m = -0 - 104. Let k(c) = mu(c) + 3d(c). Calculate k(2). 4 Suppose -4d = 2o + 2o - 56, 2d - 4o = 4. Let g(u) = -8 - du + u + 6u + 13. Give g(6). -13 Let m(n) = 5n2 + 6n - 7. Let q(z) = -6z2 - 8z + 9. Let y(r) = 4m(r) + 3q(r). Suppose 2t = 5d - 12, 3d - 3t = -t + 8. Determine y(d). 7 Let y(i) = 3i + 0i - 288 - 294 + 640. What is y(-27)? -23 Let i(y) = -y*3 + 15y*2 + 16y - 8. Let j = 2395 + -2379. What is i(j)? -8 Let r(b) = 64b - 5. Let l(q) = -13q + 1. Let u(v) = 11l(v) + 2r(v). Let i(a) = 14a + 97. Suppose -49 = 6k + k. Let h be i(k). Determine u(h). 16 Let s(j) = -j*3 + 19j*2 - 5j + 98. Suppose -2194 = -135o + 371. What is s(o)? 3 Let u = 4066 + -4075. Let y(h) = h3 + 10h*2 + 10h + 3. Calculate y(u). -6 Let m = 4259 + -4264. Let n(b) = b*3 + 6b*2 + 17b + 51. What is n(m)? -9 Let f = -40 - -45. Let n(b) = -2b + 5 - 3 - f + 5. Let l = -46 - -50. Give n(l). -6 Let p(l) = -2l + 89. Let z(b) = -b + 445. Let g(h) = -11p(h) + 2z(h). Determine g(4). -9 Let l(y) be the second derivative of -y4/6 - y2/2 - 113	{ "pile_set_name": "DM Mathematics" }
(-10)-5). -1/4 Calculate ((-3)/(-6))/((-8)/112). -7 What is the value of 1-6130/45? -4 150/(-200)(-8)/6 1 What is (-9)/(-6)(-2)/(-1)? 3 What is the value of 20/(-6)(-702)/(-234)? -10 What is the value of ((-11)/495-5)/((-4)/(-12))? 1/3 What is the value of ((-468)/6318)/(-1(-1)/(-3))? 2/9 What is the value of (-12)/6644/(-8)? 1 What is (8/10)/(-11(-14)/(-35))? -2/11 What is (-1)/2(-266)/133? 1 What is 20/(-4)48/30? -8 Evaluate ((-5)/10)/(1/((-2)/1)). 1 Calculate ((-49)/49)/((-5)/(-4)). -4/5 Evaluate 16/2492/28. 3/7 What is the value of 9/(-14)24/(-36)? 3/7 What is the value of (6/5)/((-2)/(-5))? 3 What is the value of 425/1702(-2)/65? -2/13 (-115)/(495/(-198)) 6 What is the value of -2(-12)/(-18)8/(-64)? 1/6 Evaluate 2/(-6)(-3)/((-24)/(-8)). 1/3 What is (368/92)/((-6)/(-1))? 2/3 What is the value of (-2)/3(-6)/(-24)? -1/6 Calculate 1(-6)/813. -2/9 Evaluate (-2(-2)/(-10))/(18/(-45)). 1 Evaluate ((-4)/(-12))/(3/(-27)). -3 What is 1/2(-4)/(-28)-4? -2/7 (-2)/(44/(-10))18/(-30) -3/11 Evaluate (-116)/(-87)1-3. -4 Calculate (-6)/(-3)1/10. 1/5 What is the value of 11/(-22)(-4)/(-1)? -2 34/(-34)-23/2 3 Calculate (-4)/(-8)-18. -4 Evaluate 678/(-565)5/(-51). 2/17 Evaluate 4(-18)/2415/9. -5 What is the value of (-12)/((-128)/16)? 1/4 Calculate ((-1)/(-3))/(63/(-1296)-8). 6/7 What is the value of ((-9)/(-3))/(((-378)/(-12))/(-21))? -2 Calculate (21/((-210)/(-8)))/(14/20). 8/7 What is (-5)/44/(-1)? 5 What is the value of 24/(-30)10/(-4)? 2 What is the value of ((-5)/(-350)18)/(12/20)? 3/7 ((-11)/22)/(1/2) -1 204/(-34)2/(-6)-2 -4 Evaluate 5/2(-40)/25. -4 Evaluate ((-70)/(-42))/((-16)/(-12)). 5/4 19/(-38)(12/(-33))/1 2/11 Calculate (14/18)/((-35)/(-15)). 1/3 What is the value of (6/30)/((-2)/10)? -1 Evaluate 90/2252/(-4). -1/5 Calculate 1/((-12)/(-10))(-40)/100. -1/3 What is (-2)/2416/4? -1/3 Evaluate 2(-4)/6(-36)/(-64). -3/4 What is the value of (2/(-8))/((-25)/75)? 3/4 Calculate 6/23/((-9)/5). -5 Evaluate (-2)/(-3)(-52)/208. -1/6 Calculate (((-36)/(-4))/(-45))/(12). -1/10 What is -5(-7)/35-4? -4 Evaluate (-2)/(-10)(-12)/12. -1/5 Evaluate ((2-9)/(273/(-26)))/(-2). -6/7 Evaluate (30/3)/(2/(-1)). -5 (48/((-12)/1))/(-4) 1 What is the value of (2/(-1))/(6/(-12))? 4 What is the value of (-3(-20)/(-45))/(12/(-3))? 1/3 (-21)/35-15 3 (-8)/2(-4)/8-5 -10 What is ((4/10)/2)/(144/(-90))? -1/8 What is the value of ((-8)/(-36))/((-2)/(-18))? 2 What is the value of ((-141)/(-188))/(9/(-2))? -1/6 What is the value of (1(-6)/(-9))/((-3)/9)? -2 Evaluate ((-140)/(-1715))/((-2)/(-7)1). 2/7 ((-4)/(-10))/(((-3)/(-5))/3) 2 What is ((-4)/20)/(2/(-4))? 2/5 Calculate 0/(-3(-16)/24). 0 What is the value of ((-2)/((-4)/(-6)))/(36/(-8))? 2/3 Calculate (-12)/10(-10)/9015. 2 Calculate ((20/(-65))/4)/(7/14). -2/13 What is the value of 4/2(-51)/153? -2/3 What is the value of (2/(-110))/((-1)/5)? 1/11 (3/(-2))/((-1)/(56/147)) 4/7 Evaluate (-150)/(-45)30/25. 4 What is (1/232/(-8))/2? -1 Evaluate ((-4)/2)/((-54)/6). 2/9 Evaluate 2/(-6)2/(6/6). -2/3 ((-14)/84)/((-2)/(-2)) -1/6 What is (-2)/5(-130)/13? 4 (10/4)/(130/260) 5 Evaluate ((-28)/(-140))/((-1)/(-2)). 2/5 What is -1((-55)/(-30))/(-11)-1? -1/6 Evaluate (-1)/(-2)(-1)/(-15)-6. -1/5 Evaluate (-1)/((-1)/(-1)(-165)/(-22)). -2/15 What is (8/(-6))/(15/(-45))? 4 6/(-4)(-976)/(-366) -4 Evaluate 2/(-70)5(-2)/3. 2/21 Calculate ((-24)/9)/(4/6). -4 What is (2/6)/(1(-7)/(-21))? 1 Calculate -1(-20)/8-2. -5 Calculate (-29)/1168/(-2). 1 Evaluate (47/56)/(3/6). 1 Evaluate (-3)/2(-3)/(81/(-12)). -2/3 What is (-3)/(13/1)? -1 What is the value of ((-2)/201)/((-12)/(-10))? -1/12 Evaluate (4/(-3))/(-6(-1)/9). -2 Evaluate (-48)/(-8)(-2)/6. -2 Evaluate (-2)/2-2(-239)/(-5975). 2/25 What is the value of -6(-8)/(-60)10/(-12)? 2/3 What is the value of ((-4)/(-12))/(24/(-9))? -1/8 Calculate ((3168/80)/33)/(2/15). 9 (-1)/(6/44)(-6)/4 11 Evaluate 43/(-129)18/(-1). 6 Calculate (-270)/271/(-2). 5 Calculate ((-10)/(-10))/(7/(-7)). -1 What is the value of ((04/32)/4)/4? 0 (((-8)/2)/8)/(8/32) -2 What is the value of (2/4)/((-4)/(-24))? 3 ((-2)/16)/((285/(-90))/19) 3/4 What is (-12)/(-8)(1-1)/3? -1/2 Calculate (-84)/(-36)(-126)/(-49). 6 Calculate ((-60)/3)/52/8. -1 Calculate 3/((-18)/(-4))(-90)/180. -1/3 Calculate (33/(1485/(-60)))/((-68)/(-6)). -2/17 What is the value of ((-3)/(-6))/((-1)/41)? -2 What is the value of (((-30)/5)/(6/4))/(-6)? 2/3 Evaluate (-11)/(176/(-40))12/(-10). -3 What is the value of 5/25(-45)/18? -1/2 What is the value of ((-1)/2)/(6/12)? -1 Evaluate 1(-12)/(-84)7/1. 1 Calculate (-6)/(-2)3/((-18)/(-10)). 5 What is the value of 30/453/(-12)6? -1 Evaluate (18/32)/((-33)/(-44)). 3/4 0/191/(-4) 0 What is (-4)/(-1)(225/(-20))/9? -5 Calculate ((-6)/9)/((-31)/(-186)). -4 Calculate (80/160)/((-2)/(-36)). 9 Evaluate ((-6)/5)/((-45)/50). 4/3 What is 6/453(-3)/(-6)? 1/5 What is ((-114)/(-171))/((16/(-3))/1)? -1/8 0/(3/(-9)3) 0 What is (-5)/225(-72)/8? 1/5 What is the value of (-22)/((-33)/(-3))10/(-4)? 5 What is the value of (320/(-24))/(1/(-2))? 5 12/24(-4)/6 -1/3 Evaluate (-83/(-24))/((-2)/(-10)). 5 What is the value of (-5(-2)/(-4))/(39/(-78))? 5 Evaluate -238/64. -3/4 Calculate (-2)/(-6)(-4)/10. -2/15 What is -3((-5)/40)/(6/6)? 3/8 3/(-7)(-80)/(-480) -1/14 Calculate ((-36)/8)/(-9)-6. -3 32/(-336)42/9 -4/9 Calculate ((-21)/(-7))/(-3)-1. 1 What is the value of (-4)/7(35/7)/(-10)? 2/7 What is the value of 22/((20/4)/(-5))? -4 Calculate 52/(-286)11/(-1). 2 4/1839/52 1/6 Calculate ((-2)/(-13))/(448/728). 1/4 Calculate 9/(-15)70/213. -6 What is the value of (144/9(-6)/(-12))/(-1)? -8 Calculate (2/(-6))/((-6)/(-108)-2). 3 36/(-32)(-10)/30 3/8 Calculate ((-12)/(-2))/(105/30-2). -6/7 Evaluate (-30)/20(-2)/3. 1 What is the value of ((-12)/(-36))/((-65)/30)? -2/13 What is the value of ((-8)/(-50))/(116/290)? 2/5 What is 4(-11)/(-792)-4? -2/9 What is the value of (-5)/(-6)(-11)/((-220)/12)? 1/2 Evaluate 4/12(-3)/123. -1/4 Evaluate (15/(-25))/(6/(-4)). 2/5 ((5/2)/(-5))/(75/1050) -7 Evaluate (-53)/53-6(-4)/6. -4 What is the value of ((-2)/3)/((-16)/(-96))? -4 ((-19)/76)/(1/(-20)) 5 Calculate (8/3)/(((-70)/(-15))/(-7)). -4 Evaluate 18/158/((-48)/2). -2/5 Calculate (-3(-1)/3)/(3-1). -1/3 What is (35/(-18))/780/200? -1/9 (36/(-54))/((-4)/(-18))3 -9 Calculate 2/(-2)42/14. -3 Evaluate ((-2)/3)/((-21)/((-42)/4)). -1/3 What is 25/108/4? 5 Evaluate 4/(-91)84/(-24). 2/13 14/(-20(-11)/(-22)) -7/5 5/((-125)/10)5 -2 What is the value of ((-4)/(-6))/((1235/15)/(-19))? -2/13 What is the value of (-61/(-6))/((-4)/(-2))? 1/2 (-24)/(-7)(-32)/(-192) 4/7 What is the value of (4/(-14))/((-42)/294)? 2 Evaluate 27/(-18)1/(-1). 3/2 What is the value of ((-22)/(-55))/(184/40)? 2/23 Evaluate ((-1)/(-2))/(-23/4). -1/3 What is the value of 6/860/15? 3 What is the value of (-16)/(-20)4/(-8)? -2/5 Calculate 4/9(-2)/(-48)6. 1/9 -2((-49)/14)/(-7) -1 What is the value of 5/((-35)/7)-4? 4 Calculate 5/(-110)-41. 2/11 What is 0(21/(-6))/7? 0 What is the value of (27/((-9)/(-1)))/(-1)? -3 Evaluate (8/(72/27))/(6/(-2)). -1 Calculate 112/(-112)4. -3/7 Calculate 2/(-2)(-5)/55. 1/11 What is (20/(-15))/(156/(-18))? 2/13 Calculate ((-8)/6)/(256/(-384)). 2 Evaluate (4/7)/(8/((-24)/(-6))). 2/7 What is the value of (-3)/(-2)(-88)/220? -3/5 Calculate (-1)/19/(-9). 1 8/6-27/(-56) 1/3 What is (11/(-66))/((-1)/4)? 2/33 What is the value of (2/15)/(24/40)? 2/9 Calculate 21-1(-36)/108. 7 What is (-1152)/(-144)(-7)/8? -7 What is the value of (10/(-4))/(((-6)/6)/(-2))? -5 What is (9(-3)/54)/((-1)/4)? 2 Calculate (108/(-81))/(4/(-21)). 7 (0/(-5))/((-3)/(9/(-6))) 0 Calculate (-1)/(-2)(-6)/(-9)3. 1 (3(-8)/(-60))/((-18)/10) -2/9 Evaluate (6/18)/(8/(-48)). -2 Evaluate 4/1212/12. 1/3 (52/(-65))/((-2)/(-10)) -4 Calculate (11/((-22)/5))/2. -5/4 What is (2/1)/(13/(650/20))? 5 What is the value of (-6)/((108/8)/9)? -4 28/(-14)(-2)/4 1 What is the value of (21/(-21))/(2/((-8)/2))? 2 What is the value of (2(-6)/(-10))/(45/75)? 2 Calculate (8/14)/(160/1680). 6 What is the value of 4(-44)/(-22)1/(-2)? -4 What is (16/392)/(-23/(-42))? 2/7 What is the value of (((-14)/(-210))/(2/6))/1? 1/5 What is the value of 9/(-30)-235/(-7)? -3 15/1401-4	{ "pile_set_name": "DM Mathematics" }
(b) 0 (c) 4/3 b Let x be (-8)/14 + (-4)/(-14). Let d = -8 + 6. What is the second smallest value in d, -5, x? d Let s = 11 - 20. Let f = s - -8. What is the smallest value in 0, -0.1, f? f Let k = 0.1 - -3.9. Let l = 0.16 - -1.84. Which is the third biggest value? (a) -0.2 (b) l (c) k a Let v be (-81)/(-12) + (-1)/(-4). Let n be (-1)/((14/8)/v). Which is the biggest value? (a) 1/8 (b) n (c) -0.1 a Suppose 27 = 2z - 5z. Let v = -9 - z. What is the second smallest value in 0.4, -0.4, v? v Let d be -1 + 4 - 18/5. Let r = -6 + 10. What is the third smallest value in -1, d, r? r Let y = 3 + -6.6. Let f = y + -1.4. Which is the second smallest value? (a) -2 (b) f (c) -0.4 a Let l be (-182)/(-70) + (-4)/(-10). Let t = 1 - 1. What is the second biggest value in 1, l, t? 1 Let u = 4.93 - -0.07. Let g = 1.2 - 0.3. Let w = 0.8 - g. What is the biggest value in 0.3, w, u? u Let u = 47/2 + -24. What is the biggest value in -0.4, u, 1/3? 1/3 Let t be 6/(-24) + (-38)/(-88). Suppose 3r = r - 6. What is the smallest value in r, 2/5, t? r Let x = -9.3 - -7.3. Let d be 0 - (6/(-4) - -2). What is the third smallest value in x, 0.2, d? 0.2 Let f(n) be the first derivative of -n3/3 + n2/2 - 2n - 8. Let o be f(0). Suppose -i + 4 = -0. Which is the biggest value? (a) -2/5 (b) o (c) i c Let w be 2/(-10) - (-52)/10. Let z = 134 + -533/4. Which is the third biggest value? (a) z (b) 2/13 (c) w b Let x = 2 + -2. Let s be (-10)/25 - (-78)/120. Let h = -1 - 0. Which is the third biggest value? (a) x (b) h (c) s b Let z = 6.96 + -7. Let m = -3.04 - z. Let d = -9 + 4. Which is the second smallest value? (a) m (b) 2/9 (c) d a Let q = -4.1 + 4. Let z = 4/5 - 22/15. Which is the second biggest value? (a) q (b) z (c) -1/5 c Let f(x) = x - 1. Let u be f(7). Let w be ((-22)/(-3))/(2/u). Let q = 43/2 - w. What is the second biggest value in -5, q, 2/7? q Let g = 4.7 + 0.3. Let k be ((-15)/18 + 1)6. Let o = -0.3 + -0.7. What is the biggest value in k, g, o? g Let c = 32 - 28. What is the third biggest value in -5, c, 1/9? -5 Let d = 21.4 - 21. Which is the second smallest value? (a) 2/3 (b) -2 (c) d c Let x = 0.68 + -0.18. What is the second smallest value in x, 4, -1/6? x Let r be 2/7 - 810/(-56). Let q = r - 15. Let m = 2 - 3. What is the second biggest value in q, m, 4? q Let u = 0.92 - 5.92. Which is the fourth smallest value? (a) u (b) 4 (c) 2/35 (d) -4 b Let w be (-2 - 1/(-2))2. Let f be (-3)/((-54)/57) + w. What is the third biggest value in 1/5, f, -0.1? -0.1 Let p = 8 - 8.5. Suppose 45 - 145 = -5k. Let v be (-6)/k10/(-15). What is the second biggest value in p, v, 2/5? v Let z = 52 + -54. Which is the biggest value? (a) z (b) 0 (c) 3/7 (d) -2/5 c Let a = -2 - -2.2. Let x = -9/25 - -67/325. What is the smallest value in a, x, -1? -1 Let z be 20/40 - (-6)/(-4). What is the third smallest value in z, -2, 1/3, -1/24? -1/24 Let p = -2/121 + 252/605. Let z = -0.44 - -0.14. Let u = 3417/13 + -263. What is the smallest value in p, u, z? z Let z = -4.9 + 6.9. What is the smallest value in 6, 1/5, z? 1/5 Let q = -28 + 20. Let s = 6 + q. Let m = 0.8 - 4.8. Which is the smallest value? (a) s (b) 3 (c) m c Let m be 4/(-3)15/(-170). Suppose -3r + 24 = 2j, j - 3j = 2r - 16. Suppose 3v = 1 + r. Which is the second biggest value? (a) m (b) 1 (c) v b Suppose -2u - 12 = 2y - 7y, -5u = -5y. Let p = u - 9. Which is the third biggest value? (a) p (b) -2/3 (c) -4 a Let j = 1/79 - 244/553. What is the second biggest value in j, -5, -0.1? j Let r = -4 + 3.5. Let w = r - -0.3. Which is the third biggest value? (a) 4 (b) w (c) 0.2 b Let j = -155 - -158. What is the smallest value in 3/4, j, 1, 2/3? 2/3 Let p = 0.04 - 0.44. Let x be (2/2)/(6/(-4)). Let l = 5 - 4.8. What is the biggest value in p, x, l? l Let h = -0.06 - -0.36. Let i = h + 4.7. Let j = 2.4 - -0.6. Which is the second smallest value? (a) -0.4 (b) i (c) j c Let g = 1.022 - 0.022. What is the smallest value in g, -1/2, -8? -8 Let u = 0.3 - 0.1. Let o be 10/(-3) - (-2)/(-3). Which is the biggest value? (a) -0.2 (b) u (c) o b Let b = -0.049 + -6.951. What is the third biggest value in b, 0, -2? b Let t = -4 - -3.8. Let p = t - 0. Which is the biggest value? (a) -0.5 (b) 4 (c) p b Suppose 4d - d - 12 = 0. Which is the third smallest value? (a) -5 (b) 2.2 (c) d c Let x = -0.5 - -3. Let a = x + -2. Let q = 3 - 2.9. What is the biggest value in a, q, -1? a Let i = 4.14 - 0.14. Which is the third smallest value? (a) 2 (b) i (c) -0.1 b Suppose -4d = -d. Suppose 3k = -dk + 12. What is the biggest value in -0.4, -0.5, k? k Let x = -1071 + 3274/3. Let w = -2 - -23. Let o = w - x. Which is the third biggest value? (a) 0 (b) o (c) 1/2 a Let o = -5 - -6. Let q = -0.8 + -0.2. Let w = q + o. What is the second smallest value in 0.2, -0.5, w? w Let u = -8 + 8.04. Let j = -1.96 - u. What is the second biggest value in -0.2, j, -1/4? -1/4 Suppose 25 = -3h + 4h + 4r, -h = -5r + 20. Which is the biggest value? (a) 2 (b) -2/15 (c) h c Let q = 3 - 3.1. Let w = q - -0.2. Let u = 5 + -1. What is the biggest value in -5, w, u? u Let q = 86.8 - 87. What is the fourth biggest value in 0.5, -1/7, q, 9? q Let g be ((-8)/(-60))/(2/10). Which is the second biggest value? (a) -3/7 (b) -0.2 (c) g b Let b = 23 + -38. Let k be (b - 0)(-2)/6. What is the third biggest value in k, -5, 1? -5 Let i(b) = 2b + 4. Let c be i(-3). Let f = c + 7. What is the second smallest value in 2, f, -4/5? 2 Let p = -9 - -14. Let l = 0.04 - -0.24. Let h = -0.02 - l. Which is the second biggest value? (a) p (b) h (c) -2 b Let l(s) = -11 + 9s - 2s - 5s - 3s. Let z be (21)/(1/(-4)). Let r be l(z). What is the third biggest value in 4/7, -0.1, r? r Let l = 5 + -2. Let u = 3.2 - l. Which is the biggest value? (a) u (b) 3/4 (c) 0.4 b Let o(k) = k + 2. Let y be o(-3). Let r be (-1)/y - 1 - -5. Let t = -195 + 192. Which is the smallest value? (a) r (b) 0.2 (c) t c Let u be -1(-1)/(-2)8. Let d = -0.66 + -4.34. Which is the smallest value? (a) 0 (b) d (c) u b Suppose -86 = -3s - 4l, -2s + 3l + 88 = -2l. Let v = 137/4 - s. Let d = 0.2 - 0. What is the third biggest value in d, v, -1? -1 Let v = 7 + -7.2. Let q = v + 0.2. Let r = -10/13 + 31/91. Which is the third biggest value? (a) r (b) q (c) 0.2 a Let o be -5 + 0 + 7 + -7. Let r = 11/40 - 1/40. Which is the third biggest value? (a) o (b) -3 (c) r a Let f = 2 - 0. Let z be 1/28 - 3/(-12). Let l = 1.3 + 1.7. Which is the biggest value? (a) z (b) l (c) f b Let z = 1250 + -17513/14. Let o = 10/7 + z. What is the third biggest value in -0.1, o, -1/4? -1/4 Let b = -1.4 + 0.5. Let k = b + 1. Let z = 8 - 3. What is the second smallest value in k, z, -3? k Let r = -0.06 - -0.16. Which is the biggest value? (a) 1/3 (b) 1 (c) 2/3 (d) r b Let y = 5 + -2. Suppose 5k - 15 = 5m + 10, 0 = ym - 9. Let u be 6/9(-6)/k. What is the third smallest value in u, 0.4, -2/11? 0.4 Let d = 1.5 + -4.5. Let p be (1/6)/((-3)/9). What is the second biggest value in p, d, 1/4? p Let v be 12/(-27) + 2/3. What is the second smallest value in 1/4, 1, v? 1/4 Let j = -149/56 - -16/7. Which is the smallest value? (a) 2/11 (b) 4 (c) j c Let s be (190/(-57))/(2/(-3)). Which is the third biggest value? (a) -4.5 (b) -2 (c) s a Let j be (16/24)/((-1)/(-3)). Let n be (2/(-30))/(j/(-6)). What is the second smallest value in -0.3, 0.3, n? n Suppose -r = 3r + 24. Let x = -14 + 35. Let m be (14/x)/((-22)/r). Which is the third smallest value? (a) m (b) 3 (c) -2/9 b Let n = -9.2 + 9. Let r = n + -0.6. Let m = r + 0.6. What is the second biggest value in m, -1/7, -0.1? -1/7 Let y = 3/20 + -1/40. Suppose 0t + 2 = 2t. Let p = 168 - 166. Which is the second smallest value? (a) t (b) y (c) p a Suppose 0g = -4g - 492. Let o = -987/8 - g. Let a be 13/26 + ((-21)/(-9) - 3). What is the second biggest value in -0.2, a, o? -0.2 Let u = -13 - -18. Let y be (-334)/(-1950)4/(-3). Let f = -2/325 - y. What is the third biggest value in f, u, 1? f Let v = -2 + 2.2. Let d be (-2 + 28/10)/2. What is the third biggest value in -4, v, d? -4 Let z(s) = -5s*3 - 2s*2 + 1. Let y be z(1). Let n be y/(-4)(-6 - -8). What is the biggest value in 0.5, n, -2/11?	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.