Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
t g be (-1)/o + 10/6. Let u be m(g). What is the nearest to 2/5 in 1, -4, u? 1 Let n(h) = h*3 - h + 4. Let y(o) = o + 6. Let f be y(-6). Let p be n(f). Let x be (3/(-6))/((-4)/(-8)). Which is the nearest to x? (a) -2/15 (b) -2/5 (c) p b Suppose -2o - 2o = 40. Let a be (-3)/(-15) + (-4)/o. Let z = -288/35 - -39/5. What is the closest to -0.1 in 1, z, a? z Let l = 109/4 + -28. Which is the closest to 2/5? (a) 0.5 (b) l (c) -0.2 a Let i = 56 - 54. Which is the closest to -1? (a) 0.1 (b) -5/4 (c) i b Let p = 0.21 + -0.01. Let g = -0.27 + p. Which is the closest to 0? (a) -3 (b) 1 (c) g c Let i = 24 - 14. Let k = -15 + i. Which is the closest to 2/7? (a) k (b) -2/5 (c) -0.3 c Let g(t) = t3 + 4t*2 + 5t - 3. Let i be g(-4). Let x = i + 70/3. Which is the nearest to 8? (a) -2/11 (b) x (c) -0.4 b Let o = 3.08 + 1.02. Let v = -0.1 + o. Which is the nearest to -0.1? (a) -3/8 (b) -1/4 (c) v b Let m = 4.4 + -4. Let k = -17 + 9. Let z = -3 - k. Which is the nearest to 0? (a) m (b) 0 (c) z b Let t = 0.05 - -0.02. What is the nearest to -0.1 in -2, 2, t? t Let a = -8.7 + -1.3. Let b = 6.3 + a. Let p = -1.3 + b. What is the closest to 1/3 in -2/17, -3, p? -2/17 Let o(y) = -y*2 - 8y - 12. Let u be o(-6). What is the closest to -1 in u, 23, -0.5? -0.5 Let m = 4 + -4.1. Let n(z) = -z*3 + 4z*2 - 3z + 2. Let w be n(3). What is the nearest to m in -0.4, 0.5, w? -0.4 Let y = -13 - -13. Which is the closest to 4? (a) y (b) 1 (c) -3/8 b Suppose 0 = -2p - 6 - 8. Which is the nearest to 1/2? (a) p (b) -3/2 (c) 5 b Suppose y = -2y - 507. Let x = y - -2195/13. Let w = 2.3 + -0.3. Which is the nearest to -0.1? (a) 0.4 (b) x (c) w b Let i = -0.09 + -3.91. Let b = -1/209 + 634/1463. Let u = 0.5 + -0.6. What is the closest to u in -0.1, b, i? -0.1 Let o be 20/32 + 6/(-8). Which is the nearest to -2/7? (a) o (b) 3 (c) -2/5 c Let g = 29 + -32. Let a be (-1)/(-1)(0 - 1). Let y be a + 0 + 78/66. What is the closest to 2/3 in 2, y, g? y Let x = -86 - -257/3. What is the nearest to 0 in x, -8, 0.3? 0.3 Let p = 0 - 0. Which is the nearest to 2? (a) p (b) 1 (c) -6/7 b Let z = -0.6 + 1.2. Let h = -0.4 - z. Let v(t) = -t. Let r be v(-5). What is the closest to -1 in h, 0.1, r? h Let h be (-6)/(-12)(0 + -1). Which is the nearest to 1? (a) -2/17 (b) h (c) -2/13 a Let y = -106.5 + 106. What is the nearest to 0.1 in 0.5, y, -6? 0.5 Let o be (5/(-10))/(1/(-4)). Let v be (1/1 - 7)/(-1). Let n be ((-3)/v)/(1o). What is the nearest to n in -4, 2/11, 0? 0 Let c = 69 + -66. What is the closest to -5/3 in -1, -3, c? -1 Let j = 113/15 - 36/5. What is the nearest to 1/4 in 3, 0.08, j? j Let z be (-22)/(-12) - (-5)/30. Which is the closest to z? (a) -8 (b) 5 (c) 0.5 c Suppose 0z = 4z + 5t + 18, -4t - 8 = 0. Let r = z - -4. Suppose -4p - 8 = -rp. Which is the closest to -2/5? (a) p (b) 2 (c) 0.1 c Let b be 1-3 + (-2 - -4). Let k = 2.93 + -0.13. Let o = -1.8 + k. What is the closest to o in -2/3, -1/6, b? -1/6 Let x = 14.4 - 14. Which is the closest to 2? (a) 2 (b) x (c) 0 a Let q = 0.2 - 1.3. Let g = 79 - 76.9. Let l = q + g. Which is the nearest to -1? (a) 2/11 (b) 0.3 (c) l a Let p = 2.94 - -0.06. Let f = -151 + 151.4. What is the nearest to 1 in -0.5, p, f? f Let d = -513/5 + 103. What is the nearest to d in -2, 3/7, 0.2? 3/7 Let h be (-2)/4 - 469/(-294). Let s = 649/1547 - -2/221. Let m = s - h. What is the nearest to 2 in -2/9, -5, m? -2/9 Let t be (-3 + 3)/(12). Let v = t + 3. Let j = 5.36 + -5.86. Which is the closest to -1? (a) -2 (b) j (c) v b Let u = 0.8 + 0.2. Suppose -3v - 11 = 2h - 0v, -2h - 14 = 4v. Which is the closest to h? (a) u (b) 0.4 (c) -2/15 c Let t = 83.6 + -84. Which is the closest to -1/3? (a) t (b) 2 (c) 0.2 a Let f be (-1)/2 - (-133)/14. Suppose 0 = fy - 10y. What is the nearest to y in 1, -2/3, -5? -2/3 Let n = -975/88 + 126/11. Which is the closest to 0.2? (a) -4 (b) n (c) -5 b Let i = -0.9 - -0.6. Let h be 1/4(-24)/21. Let k = 23/4 + -123/20. Which is the closest to h? (a) i (b) k (c) -5 a Let v = 194 + -189. Which is the closest to 0? (a) 2 (b) v (c) -23 a Let j = 27.2 - 26. Let y = 0.1 - 0.3. Let m = j + y. What is the closest to 2 in -5, -2/17, m? m Let b be (1/8-2)/(119/68). What is the nearest to 0.2 in 2, b, -0.4? b Let p = 360 + -8998/25. Let o be (4/(-10))/(9/270). Let j be (4o/(-32))/6. Which is the nearest to 1/3? (a) j (b) -1 (c) p a Let t = -0.29 - -0.79. What is the closest to 0.1 in t, 0.1, -3? 0.1 Let k = -41.2 - -41. Which is the nearest to 2/7? (a) -1/4 (b) 0.1 (c) k b Let k = -2 - -3. Let w = -1 - -1.2. Which is the closest to w? (a) -0.2 (b) k (c) -2/9 a Let g = 0.2 + -1.2. Let t = g + 1.5. Let k = 64/55 + -15/11. What is the nearest to -0.3 in k, 0.4, t? k Let i = -4.08 - 0.22. Let d = i + 4. Let k = 2 + -3. What is the nearest to 1 in k, -5, d? d Let g = -14 + 14.3. Which is the nearest to 0.1? (a) 0 (b) g (c) -3 a Let c = -3.1 - -16.1. Let k = c - 2. Let u = 7 - k. What is the closest to -1 in 0.2, u, -1? -1 Let f be -2 - (3 - (-40)/(-6)). Which is the closest to -0.1? (a) -3/4 (b) f (c) 0.4 c Suppose 5h - 28 = -2q, 0 = 2h + h - 12. What is the nearest to 1 in 7, -2/23, q? -2/23 Let p be (-8)/141205/(-10). Let l = 69 - p. Let g = 0 + 0. Which is the closest to g? (a) -5/4 (b) l (c) 1 b Suppose 5m + 3t + 11 = 0, -4 = 3m + 4t + 7. Let f = -0.9 + -0.1. Suppose -h + 3 = 2h - 2x, 4h = 3x + 4. What is the nearest to f in h, m, 4? m Suppose -i + 1 = 0, -7 = -3l - 4i + 6. Let x be 11/l + (2 - 5). What is the nearest to 1 in -4, x, -0.1? x Let h = -2.9 + 3. Let f be 6/93 + -5. Let d = 5.9 - 6. Which is the nearest to d? (a) h (b) -5 (c) f a Let n = 4.955 - -0.045. What is the nearest to -4 in 0.1, n, 0.5? 0.1 Let p = -0.02 - -0.02. Which is the closest to p? (a) -1/3 (b) 2/23 (c) -0.5 b Let s = -0.04 + 0.14. What is the nearest to -2 in 2, s, -4? -4 Let l = -0.1 + 0.4. Let h = l - 0.3. Let k be -6 + 1 + 2 + 4. What is the closest to k in 0.3, h, -5? 0.3 Let y be (-4)/(-18) - (-38)/(-90). Let q = -6.1 - -6.4. Which is the closest to 3? (a) y (b) 1/2 (c) q b Let c = 36.37 + 0.63. Let n = c - 38. Let o be 1/(2/(-8)5). What is the closest to n in -2/9, o, 5? o Let g = -3.2 - -3. Let j be (0 + 4/(-12))1. Let w = 0.2 + -0.7. Which is the nearest to j? (a) g (b) 0.3 (c) w a Let n = -19.98 - -20. Let u = n - 0.02. Which is the closest to 0.2? (a) 1 (b) u (c) 5 b Let o be (-1)/(-3)(-30)/(-45). What is the closest to -0.1 in o, -3, 0.3? o Let z = -5 - -5.4. Let q = -2 + 9. Let w = q + -7.1. Which is the closest to -1? (a) z (b) -5 (c) w c Let r = 3.7 + -3.5. What is the closest to -0.1 in -1, 0.1, r? 0.1 Let f = 2.99 + 0.01. Let b = f + -2.7. What is the closest to -2/7 in 1/4, 5, b? 1/4 Let v = 21 + -7. Suppose 2x = 2q + 3x - 18, 0 = -2q - 3x + v. Suppose -5d = -5 - q. Which is the nearest to 1? (a) 1 (b) -1/5 (c) d a Suppose 3h + 12 = -t, 4 = t - h - 0. Which is the closest to 0.2? (a) t (b) 1 (c) -1/3 a Let i = -20/21 + 2/3. Let m = 10.93 + -11. Let v = m - -3.07. What is the nearest to -1 in 2/3, i, v? i Let r = -0.46 + 0.06. Which is the nearest to -1? (a) 4 (b) 0.4 (c) r c Let r = 41/74 + -2/37. What is the nearest to -1/2 in 2, -0.3, r? -0.3 Let i be (-8)/(-4) - 9/5. Suppose -3w + 2 = -2p, -5p + w - 5 = -0w. Which is the nearest to p? (a) 1 (b) 0.1 (c) i b Let r be (2 - -2)1/6. Let u = -0.3 + 1.5. Let l = u + -1.5. Which is the nearest to r? (a) l (b) -2/7 (c) 3 b Let i = -16 + 16.17. Let c = i - 2.37. Let o = c + 0.2. What is the closest to -1 in o, -0.3, 1? -0.3 Let r = -0.114 + -0.086. What is the nearest to 3 in 1, 2/5, r? 1 Let h = -29 - -26.9. Let v = -0.1 - h. Which is the closest to -1? (a) -3 (b) 3 (c) v a Let i(w) = -w3 + 9w*2 + w - 13. Let u be i(9). What is the closest to u in 0, 0.1, 0.2? 0 Let t = 30.6 + -29. Let f = 1.9 - t. Which is the nearest to -0.1? (a) 0.1 (b) f (c) -3/7 a Let c = -7 + 7.1. Let z = -4.09 - -0.09. What is the closest to -1/3 in -0.2, c, z? -0.2 Let f = 0.62 - 0.52. What is the nearest to f in 0.1, 5, 3? 0.1 Suppose 0 = 2d - 0d - o, -o = 2d + 4. Let f be 2/(-4) + 10/12. What is the closest to d in -0.2, f, 0.1? -0.2 Let q	{ "pile_set_name": "DM Mathematics" }
c) - j(c)? -2c3 + c2 + 2c Let q(c) = -59c - 3. Let l(k) = -29k - 2. Determine -5l(y) + 3q(y). -32y + 1 Let h(l) = -l2 + 16l - 9. Let b(x) = -2x2 + 17x - 11. Determine 3b(p) - 4h(p). -2p2 - 13p + 3 Let x = 1290 - 1293. Let k(b) = b3 + b2 + 3b + 4. Let z(a) = -2a*3 - 3a*2 - 8a - 12. Give xz(p) - 8k(p). -2p3 + p2 + 4 Let c(w) = w3 + 3w - 1. Let r be 24/(-18)99/(-44). Let m(s) = -s3 - 4s + 2. Give rc(y) + 2m(y). y*3 + y + 1 Let i(x) = -4x - 4. Let j = -12 + 96. Suppose 2g + 88 = j. Let k(l) = l + 1. What is gi(a) - 6k(a)? 2a + 2 Let h(d) = -1 - 1 - 1 - 2d + 7 - 7. Let z(g) = 5g + 10. What is -11h(o) - 4z(o)? 2o - 7 Let k(q) = -13q - 4. Let h(v) = -20v - 7. Let d(m) = 5h(m) - 8k(m). Let o(b) be the second derivative of -5b*3/6 + 2b*2 - 18b. Give 4d(j) + 3o(j). j Let p(x) = 2x3 + 6x*2 + 4x - 4. Let s(i) = -2i3 - 5i*2 - 3i + 3. Let d(o) = -o*2 + 15o - 44. Let u be d(10). Determine us(z) + 5p(z). -2z3 + 2z - 2 Let z = -70 + 82. Let a(w) = 4w3 - 12w2. Let k = 29 + -30. Let g(j) = -j2. What is ka(r) + zg(r)? -4r3 Let v(d) = d. Let g(z) = z2 - 11z + 104. Calculate 2g(j) + 22v(j). 2j2 + 208 Let q(o) be the third derivative of -o6/120 - o4/24 - o3/6 - 5o*2 + 4o. Let l(z) = 22z3 + 33z + 33. Determine l(g) + 33q(g). -11g*3 Let h(z) = 3. Let b(d) = 3d + 33. Give -2b(w) + 22h(w). -6w Let l(m) = -33m*3 - 12m*2 - 12m. Let z be (-21 - 663/(-34)) + 42/(-4). Let u(n) = -13n3 - 5n*2 - 5n. Give zu(v) + 5l(v). -9v3 Let t = 194 + -195. Let q(i) = i2 + i + 1. Let b(o) = -5o*2 - o - 6. Calculate tb(h) - 4q(h). h2 - 3h + 2 Let b(k) = -3k3 + 7k*2 + 3k - 11. Let a(y) = -2y3 + 4y*2 + 2y - 6. Let h(p) = 5a(p) - 3b(p). Let u(x) = x*3 - 2. Determine -2h(n) - 3u(n). -n3 + 2n*2 - 2n Let b(h) = h2 + h + 1. Let r(x) = x2 + 7x + 7. Let v be r(-6). Let n(k) = 0 + 8 - 3k - 3k - 2k*2 - 4k*2 - 11. Calculate vn(g) + 4b(g). -2g*2 - 2g + 1 Let k(x) = -16x3 - 5x*2 - 5x - 5. Let r = -30 + 22. Let s(u) = -24u3 - 8u*2 - 8u - 8. Determine rk(p) + 5s(p). 8p3 Let t(a) = -a2 - 2. Let c(y) = 37y*2 + 4y - 14. Give -c(o) + 6t(o). -43o*2 - 4o + 2 Let x(m) = 39m + 10 + 35m - 118m + 39m + 4. Let s(w) = w - 3. What is 11s(q) + 2x(q)? q - 5 Let y(w) = 5w + 1 - 7w + 3w. Let l(j) = 0 - 2 - 4j + 0 + 2j. What is 3l(t) + 5y(t)? -t - 1 Let w(y) = 9y + 2. Let x(n) = -18n - 4. Give 5w(u) + 3x(u). -9u - 2 Let f(h) = -7h. Let c(d) = -6d. Suppose s - z = 8, 0 = 5s - 4z - 36. Calculate sf(m) - 5c(m). 2m Let h(a) = -84a + 13. Let p(o) = -21o + 3. Give -2h(m) + 9p(m). -21m + 1 Let p(b) = -3. Let l be (1/2)/(30/(-60)). Let q(y) = y + 1. Determine lp(r) - 2q(r). -2r + 1 Suppose p + 20 = 6p, 5p - 29 = -3l. Let s(h) = h. Let d(m) = 6m + 1. Suppose 0 = 8x + 448 - 440. Calculate ls(a) + xd(a). -3a - 1 Let z(s) = -5s*2 - 9s. Let j = 1175 - 645. Let h(u) = -3u - 532u*2 + ju*2 + 0u. Calculate -11h(f) + 4z(f). 2f2 - 3f Let x(j) = -242j2 - 5j + 7. Let v(p) = p - 1. Determine -6v(m) - x(m). 242m2 - m - 1 Let g(u) = -u3 - 1. Let i(m) = 31m3 - 24m*2 + 8m + 41. Let l(n) = -10n3 + 9n*2 - 3n - 14. Let k(r) = 3i(r) + 8l(r). Calculate -66g(f) - 6k(f). -12f3 Let r(a) be the first derivative of 5/2a*2 - 3a - 5. Let z(d) = 4d - 3. Determine -5r(f) + 6z(f). -f - 3 Let j(b) = 4b*3 + 19b*2 - 16b - 40. Let r(u) = -u*3 - 6u*2 + 5u + 13. What is 6j(a) + 19r(a)? 5a3 - a + 7 Let h(c) = -69c*3 + 5c*2 + 5c - 10. Let r(o) = 68o3 - 4o*2 - 4o + 9. Calculate -4h(u) - 5r(u). -64u3 - 5 Let a(y) = 19y*3 + 13y*2 + 298y + 13. Let z(r) = 9r3 + 6r*2 + 147r + 6. Give -6a(v) + 13z(v). 3v3 + 123v Suppose -368g + 375g = -21. Let n(s) = -6s - 7. Let f(w) = w + 5. Let v(r) = 1. Let o(d) = -f(d) + 4v(d). Give gn(i) + 21o(i). -3i Let n(x) = -9x*2 - 7x - 6. Let q(v) be the first derivative of 8 - 8/3v3 - 5v - 3v2. Determine -6n(g) + 7q(g). -2g2 + 1 Let k(h) be the first derivative of -h2/2 - 12. Let p(z) = 8z. Let c(o) = 9o. Let i(u) = -7c(u) + 6p(u). What is -2i(w) + 33k(w)? -3w Let j(b) = 5b3 + 3. Let m(f) = -f3 - 5f2 + f - 1. Let v(q) = -4q*3 - 15q*2 + 3q - 2. Let d(u) = -3m(u) + v(u). Give -2d(l) + j(l). 7l3 + 1 Let j(t) = 4t + 5. Suppose 15 = 4c + 3. Suppose cp + 2 = -2h + h, -2p - 4h - 8 = 0. Let q(g) = 1 + 2g + 2 + p. Calculate -3j(z) + 5q(z). -2z Let s(g) = -g3 + 2g2 - 2. Let y(i) be the first derivative of -i3/3 + i - 76. Calculate 3s(n) + 6y(n). -3n3 Let x be (-60)/(-75) + 4/(-5). Suppose xs = 5q + 3s - 41, -4s = 2q - 8. Let l(v) = 2v + 7. Let z(a) = -a - 3. Determine qz(n) + 4l(n). -2n - 2 Let r(k) = -5k3 - 6k*2 - 4. Let p(q) = 9q*3 + 11q*2 + 7. Let w = -3 - -7. Suppose -26 = -4l + l - m, -20 = -4m. Determine lr(g) + wp(g). g3 + 2g*2 Let x(v) = 153v + 11. Let j(m) = 154m + 13. Determine -5j(d) + 6x(d). 148d + 1 Let s(c) = 3c + 3 + 7c*2 - 5c*2 + c - 2c. Suppose 4q = -x - 17, 4q - 2x + 4 = 2. Let b(o) = 2o*2 + o + 2. Determine qb(t) + 2s(t). -2t*2 + t Let q(b) = -1243b*3 - 5b*2 + 5b - 5. Let x(j) = -307643j3 - 1238j*2 + 1238j - 1238. Give 1238q(o) - 5x(o). -619o3 Let z be -3(0 - -2)53/53. Let m(l) = -11l + 8. Let i(y) = -10y + 7. Give zi(h) + 5m(h). 5h - 2 Let j = 160 + -154. Let w(b) = -2b - 9. Let c(n) = 0 - 8 - 10 - 8 - 6n. Calculate jc(t) - 17w(t). -2t - 3 Let f(l) = 6l*2 - 3l - 4. Let o(k) be the second derivative of -7k4/12 + k3/2 + 5k*2/2 - 155k. Calculate 6f(r) + 5o(r). r*2 - 3r + 1 Let w(c) = 2. Let y(d) = -16d + 7. Calculate -4w(r) + y(r). -16r - 1 Let c = 465 + -462. Let v(b) = 2b - 1 - 5b + 2b. Let m(r) = -2r - 1. Give cv(j) - m(j). -j - 2 Let i(c) = -6c3 + 2c*2 + 15c - 4. Let j(z) = 17z3 - 5z*2 - 44z + 11. Calculate -8i(m) - 3j(m). -3m3 - m2 + 12m - 1 Let b = -219 - -231. Let l(o) be the third derivative of 0 - 1/3o3 - bo*2 + 5/24o*4 + 0o. Let w(i) = -3i + 1. Calculate -4l(g) - 7w(g). g + 1 Let g(z) = 524z + 20. Let y(f) = 1048f + 37. What is 11g(r) - 6y(r)? -524r - 2 Let g be (1 + -6)/((3 - -3)/6). Let k(x) = 4x - 5. Let u(c) = 3c - 4. Give gk(i) + 6u(i). -2i + 1 Let j(g) = 8g - 20. Let d(c) be the first derivative of c*2 - 5c - 62. Give -9d(q) + 2j(q). -2q + 5 Let r(l) = -5l - 1 + 6 + l. Let c(p) = -5p2 + 10p + 10. Let s be c(3). Let t(z) = 3z - 5. Give sr(o) - 6t(o). 2o + 5 Let b(n) = 12n3 - 10n*2 - 5n - 10. Let m(w) = 2w3 - 2w*2 - w - 2. What is 2b(j) - 11m(j)? 2j*3 + 2j*2 + j + 2 Let m(s) = 7s - 4s - 3 - 8s. Let a(n) = 3n3. Let b be a(-1). Let x be (-6)/(-8) + 280/(-32). Let o(v) = 14v + 8. Determine bo(d) + xm(d). -2d Let f(h) be the second derivative of 0 + 13h + 1/2h2 - 1/6h*3. Let k(t) = -t + 1 + 0t + 1. What is -3f(l) + k(l)? 2l - 1 Let x(n) = 26n2 + 2n - 3. Let p(i) = 29i2 + 3i - 4. What is -5p(y) + 6x(y)? 11y2 - 3y + 2 Let f(h) = -72h3 - 60h - 60. Let a(m) = -9m - 8. Let p be a(-1). Let s(q) = q3 + q + 1. What is pf(c) + 60s(c)? -12c*3 Let h(o) = -o + 7. Suppose 84 = -5w + 99. Let r(b) = b - 6. What is wh(d) + 4r(d)? d - 3 Let r(h) = 3h2 - h - 1. Let o(z) = -z3 + z2 + z - 1. Suppose -1 = -7p - 8. What is pr(n) - o(n)? n3 - 4n2 + 2 Let k be (-69)/21 + 0 + 10/35. Let j(u) = -u2 - 3u. Let w(g) = -4g*2 - 16g. What is kw(q) + 16j(q)? -4q2 Let h(u) = 23u*2 + u + 2. Let l be h(-1). Suppose 26v + l = 34v. Let n(x) = 6x*3 + 4x. Let t(a) = 5a3 + 4a. Calculate vn(p) - 4t(p). -2p3 - 4p Let j(x) = 7x3 - 4x*2 - 6x. Let l(g) = 6g3 - 3g*2 - 5g. Let q(v) = v*2 - 10v + 20. Let y be q(4). What is yl(k) + 3j(k)? -3k3 + 2k Let g(m) = -166m3 - 33m*2 + 11m - 26. Let r(f) = 33f3 + 6f*2 - 2f + 5. What is 2g(n) + 11r(n)? 31n3 + 3 Let q(a) = -6a - 464. Let j(i) = -i - 93. Calculate -11j(u) + 2q(u). -u + 95 Let d(m) = 2m3 + 1 - 2261m*2 - 4m*3 - 2m*3 + 3m*3 + 2260m*2. Let z(p) = 6p*3 + 3p*2 - p - 2. Give -3d(t) - z(t). -3t*3	{ "pile_set_name": "DM Mathematics" }
1090 How many months are there in seventeen sixths of a millennium? 34000 What is 45/2 of a hour in seconds? 81000 What is 19/4 of a millisecond in microseconds? 4750 What is 6117.1971 days in weeks? 873.8853 How many millilitres are there in three fifths of a litre? 600 What is 3/50 of a meter in centimeters? 6 How many millilitres are there in 3/8 of a litre? 375 How many millilitres are there in 1/5 of a litre? 200 How many nanoseconds are there in 1/10 of a microsecond? 100 How many kilograms are there in twenty-one halves of a tonne? 10500 What is eleven halves of a decade in months? 660 How many millilitres are there in 17/4 of a litre? 4250 How many millimeters are there in 1/10 of a centimeter? 1 How many hours are there in 7644683.7 nanoseconds? 0.00000212352325 How many kilograms are there in 5/4 of a tonne? 1250 Convert 7029.161 decades to millennia. 70.29161 What is twenty-six sevenths of a week in hours? 624 How many milliseconds are there in 52.00517 hours? 187218612 Convert 3.01308 millennia to months. 36156.96 How many tonnes are there in 2.008452ng? 0.000000000000002008452 How many nanograms are there in 13/4 of a microgram? 3250 Convert 743.208 millilitres to litres. 0.743208 What is 87.54966l in millilitres? 87549.66 How many grams are there in 3/5 of a kilogram? 600 How many centuries are there in 6/5 of a millennium? 12 What is 7/4 of a century in years? 175 What is 5/8 of a century in months? 750 How many milligrams are there in one tenth of a gram? 100 How many microseconds are there in 267.6339s? 267633900 Convert 39.83541 weeks to microseconds. 24092455968000 How many millimeters are there in twenty-seven halves of a meter? 13500 What is 88.46236 micrograms in tonnes? 0.00000000008846236 Convert 12480.84ml to litres. 12.48084 How many millilitres are there in 36.85668l? 36856.68 How many milligrams are there in 509743.4g? 509743400 How many micrograms are there in 7/2 of a milligram? 3500 How many millilitres are there in 360031.2l? 360031200 What is 0.8047299 weeks in microseconds? 486700643520 How many grams are there in 23/8 of a kilogram? 2875 What is 17857.8 months in centuries? 14.8815 Convert 88.23451 micrometers to millimeters. 0.08823451 How many micrometers are there in 1/4 of a millimeter? 250 What is 548444.6l in millilitres? 548444600 How many nanometers are there in six fifths of a micrometer? 1200 How many nanometers are there in 611.72 kilometers? 611720000000000 Convert 0.8046013 litres to millilitres. 804.6013 What is 31032.06 decades in centuries? 3103.206 What is 49/4 of a year in months? 147 How many seconds are there in 2/21 of a week? 57600 Convert 138086.2 centimeters to nanometers. 1380862000000 What is 1/5 of a century in months? 240 How many micrograms are there in 1/5 of a milligram? 200 How many millilitres are there in 5/4 of a litre? 1250 How many grams are there in 7.288894mg? 0.007288894 What is 5/4 of a kilometer in meters? 1250 How many seconds are there in 1/15 of a hour? 240 How many months are there in 58/3 of a year? 232 Convert 0.4526276 minutes to milliseconds. 27157.656 What is 3446349.9 hours in weeks? 20513.9875 Convert 2.7679641 months to centuries. 0.00230663675 What is 70.10858mg in kilograms? 0.00007010858 What is 6812.806kg in milligrams? 6812806000 How many meters are there in five quarters of a kilometer? 1250 What is 54.59774 litres in millilitres? 54597.74 What is 1/4 of a meter in millimeters? 250 Convert 4096.851 months to years. 341.40425 Convert 7047.657 kilometers to millimeters. 7047657000 What is 13976.01 months in years? 1164.6675 How many milliseconds are there in 0.6657554 days? 57521266.56 What is 5.132976l in millilitres? 5132.976 How many hours are there in 1/6 of a day? 4 How many months are there in 21/2 of a century? 12600 Convert 40860.5 millilitres to litres. 40.8605 What is 11/2 of a century in years? 550 How many micrometers are there in fifteen quarters of a centimeter? 37500 How many nanometers are there in 925264.6cm? 9252646000000 What is 49/5 of a litre in millilitres? 9800 What is nineteen quarters of a gram in milligrams? 4750 How many months are there in thirteen eighths of a decade? 195 Convert 91035.2 seconds to milliseconds. 91035200 How many minutes are there in 11/4 of a week? 27720 What is 11/8 of a microgram in nanograms? 1375 How many grams are there in one twentieth of a kilogram? 50 How many kilograms are there in 76.41617ng? 0.00000000007641617 How many months are there in 7.668261 years? 92.019132 What is one fifth of a millennium in centuries? 2 What is 19/4 of a litre in millilitres? 4750 What is thirteen fifths of a gram in milligrams? 2600 What is 287.589 minutes in microseconds? 17255340000 How many centimeters are there in 12/25 of a kilometer? 48000 Convert 983753.5nm to meters. 0.0009837535 What is 1/16 of a millennium in months? 750 How many decades are there in three fifths of a century? 6 How many months are there in 1/4 of a decade? 30 How many months are there in 5961.552 years? 71538.624 How many meters are there in 712215.4 nanometers? 0.0007122154 How many microseconds are there in 55/2 of a millisecond? 27500 How many minutes are there in four thirds of a week? 13440 How many nanograms are there in 0.6164304g? 616430400 How many meters are there in 73656.93 micrometers? 0.07365693 How many nanoseconds are there in thirty-two fifths of a microsecond? 6400 What is twenty-one fifths of a litre in millilitres? 4200 How many millimeters are there in 0.7919863 micrometers? 0.0007919863 What is 49/4 of a hour in minutes? 735 Convert 351158.3 years to millennia. 351.1583 What is 0.2426601 hours in microseconds? 873576360 What is 29.44879 minutes in milliseconds? 1766927.4 How many microseconds are there in 12/25 of a millisecond? 480 What is 0.8258712 months in years? 0.0688226 What is 1/4 of a litre in millilitres? 250 Convert 6.580543kg to tonnes. 0.006580543 What is 0.7642246 tonnes in grams? 764224.6 What is 7/2 of a litre in millilitres? 3500 How many microseconds are there in five eighths of a millisecond? 625 How many milligrams are there in 62.38475g? 62384.75 What is 10/3 of a week in minutes? 33600 How many seconds are there in five sixths of a minute? 50 What is 3/25 of a litre in millilitres? 120 How many years are there in 1/5 of a decade? 2 What is twenty-six fifths of a millennium in years? 5200 Convert 3.530863 hours to milliseconds. 12711106.8 What is 24037.22nm in centimeters? 0.002403722 How many meters are there in 6/5 of a kilometer? 1200 Convert 101.7124 minutes to seconds. 6102.744 What is 29/2 of a decade in years? 145 What is 21/5 of a tonne in kilograms? 4200 How many months are there in 4894.84 years? 58738.08 What is 63027.75 nanometers in millimeters? 0.06302775 How many millilitres are there in 11/2 of a litre? 5500 How many meters are there in 966.9442nm? 0.0000009669442 What is 2.641766ml in litres? 0.002641766 What is 5/4 of a meter in millimeters? 1250 What is three eighths of a gram in milligrams? 375 Convert 91676.31um to meters. 0.09167631 What is 7.669138 micrograms in tonnes? 0.000000000007669138 How many centuries are there in 7.929159 millennia? 79.29159 How many seconds are there in 1/9 of a day? 9600 How many centimeters are there in nine tenths of a meter? 90 What is 3/32 of a millimeter in nanometers? 93750 How many millilitres are there in 1/4 of a litre? 250 How many nanoseconds are there in 0.1657353 seconds? 165735300 Convert 289.20717 months to decades. 2.41005975 How many years are there in 5/4 of a millennium? 1250 How many decades are there in 3/5 of a millennium? 60 How many seconds are there in 5/4 of a hour? 4500 Convert 7.478421 nanograms to micrograms. 0.007478421 Convert 6.794634 years to months. 81.535608 How many kilometers are there in 589.95 nanometers? 0.00000000058995 How many years are there in one tenth of a millennium? 100 What is four fifteenths of a week in minutes? 2688 What is 58/3 of a century in months? 23200 How many millennia are there in 840215.4 decades? 8402.154 What is 1/4 of a microsecond in nanoseconds? 250 What is 57129.02 seconds in nanoseconds? 57129020000000 What is 3/8 of a milligram in micrograms? 375 Convert 1.020308l to milli	{ "pile_set_name": "DM Mathematics" }
13s3 to the form qs + hs2 + g + zs*3 and give z. 33 Rearrange (-43z*2 - 42z*2 + 36z*2)(-7z + 417 - 213 - 211) to the form vz + h + iz2 + yz*3 and give y. 343 Express -71q - 2q2 + 27q*3 - 57q + 130q in the form n + zq*3 + pq + iq2 and give z. 27 Express (-4o + 6o + 3o)(-o2 + 2o*2 - 3o*2) + 47o*3 + 38o*3 - 28o*3 as qo + fo2 + m + zo*3 and give z. 47 Express -6y*3 - 35y - 31y - 1 - 35y - 28y + 125y + 2y4 as my*2 + zy + ky3 + dy*4 + q and give d. 2 Express (0 - 2 + 3)(a + a + 0a)(2a - 2a - 3a) + (3 + 0 + 0)(-3a2 + 9 - 9) in the form w + sa*2 + ma and give s. -15 Rearrange (-3c + 4c - 4c - 2c*2)(-68 - 45 + 11) to the form zc + g + qc*2 and give q. 204 Express -4b + b + b + (0b + b + b)(6 - 4 - 3) - 2 - b + 2 - 1 + 1 + 2 - 2b + 11b - 2b + 9b as zb + a and give a. 2 Express (-221 + 103 + 111)(2p + 6p - 10p) as s + gp and give g. 14 Express 115v - 283v + 9204 - 9204 in the form u + tv and give t. -168 Express 4 + 1 + 8r + 0 + 3r2 - 8r as a + vr + dr*2 and give d. 3 Express (8d - 4 + 4)(-d + 2d + d + (-3 - d + 3)(-4 - 1 + 3) + (2 - 1 - 2)(0d - 4d - 13d)) in the form w + vd + kd2 and give k. 168 Rearrange (-3 + 3 + j)(1 - 2j - j + 4j + (4j - j - 5j)(115 - 277 + 130)) to nj + p + uj2 and give u. 65 Rearrange (0s*2 + 5s*2 - 3s*2)(s + 0s - 2s) + (-5s3 + 2s3 - s3)(-102 + 35 - 29) to fs*2 + n + ys*3 + rs and give y. 382 Rearrange -6s2 - 12s + 21s - 2 - 10s to the form fs2 + as + o and give f. -6 Express ((1 - 2 - 1)(0 + 0 + 1) - 15 - 1 + 1)(292r2 + 13r*4 - 292r*2) in the form tr*3 + ur + lr2 + n + jr*4 and give j. -221 Express 2w*3 - 4w + 13w2 - 1 + 3w - 16w2 + 12 in the form kw*2 + d + nw + yw3 and give d. 11 Rearrange (0c + 2c - 3c + (1 + 0 + 0)(-3c - 4c + 2c))(51c + 70c2 + 30c*2 - 52c) to the form ac + g + vc*2 + pc*3 and give v. 6 Express 6 - 783c - 6 + 898c as oc + j and give o. 115 Express (2 - 2s - 2)(-3 + 1 + 0) + 20s + 17s - 18s + 2s + 0 + 0 + (-4 + 2 + 0)(0s + 3s - s) + 0 + s + 0 in the form h + is and give i. 22 Express -4 - 2 - 12j3 - 9j*3 + 5j + 7 + 2 in the form nj3 + m + oj*2 + pj and give n. -21 Rearrange 2y - 9 - 60 + 2 + 0y to c + uy and give c. -67 Rearrange 57h*2 + 26 + h + 3h*2 - 23 to gh*2 + x + th and give t. 1 Express 63u3 - 23u*3 - 24u*3 - 19u*3 + 13u*2 in the form j + ru + qu3 + gu2 and give g. 13 Rearrange ((2 - 2 - l2)(3l - 4l + 0l) + l*2 - 3l3 - l2)(-63l + 165l + 33l) to vl + d + il*4 + hl*3 + cl*2 and give i. -270 Express (-d - d + 3d)(2d + 2d - 3d + (-d - 3d + d)(-5 + 3 + 3) - 2d + 0d + 3d)(-5 + 5 + d) in the form id + nd*3 + x + qd*2 and give n. -1 Rearrange (4 - 4 - t)(-3t + 2t + 0t)(46t + 40t + 1 + 121430t2 - 121432t*2) to j + ut + gt4 + ot*3 + ft*2 and give f. 1 Express -6x + 18 - 29 + 13 - 9x in the form ix + d and give d. 2 Express (20 + 24x + 7 - 26)(-2x3 + 2x*3 - 2x*3) in the form kx*2 + yx + hx4 + vx*3 + l and give h. -48 Rearrange -77 + 12 - 21b - 69 + 19b - 36 to z + cb and give z. -170 Express -49 + 89 - 251o - 40 in the form x + so and give s. -251 Express -x - x + x + 52x - 5 - 43x + 4 + (-x + 4x - 5x)(1 + 1 - 5) as o + mx and give o. -1 Rearrange 11x2 - 7x*2 - 11 - 4 + 26x*2 + 13 to sx + px2 + h and give h. -2 Rearrange (-137z*2 - 106z*2 + 844z*3 + 243z*2)(-2 - 2 + 5) to mz + az*2 + u + pz*3 and give p. 844 Express (-3 + 3 - 1)(0 + 0 - 2)((2 - 3 - 1)(-4w + 4w + w*3) + 0 + 4w*3 + 0) in the form q + cw + gw2 + uw*3 and give u. 4 Rearrange (p - 4p + p)(0p - p - 4 - p)(-155p - 95p + 19p) to the form i + np + lp*2 + kp*3 and give i. 0 Rearrange (3q*2 - 2q*3 - 3q*2)(306 - 722 - 128) to z + gq3 + jq*2 + hq and give g. 1088 Rearrange -2g4 + 25g + 10g3 - 17g*3 + 6g*3 + 57g*4 - 26g to the form kg + tg*3 + mg*2 + v + cg*4 and give t. -1 Express (-3t + 2t + 3t)(-1 + 0 - 1) - 35t - 7t - 28t + t + t - 3t as y + lt and give l. -75 Rearrange -45l + 766l + 283l - 97l to the form sl + n and give n. 0 Express 40 + 4w - 3w - 545 in the form mw + r and give r. -505 Rearrange -20i3 - i2 - 3i*3 - 4i*3 + 2 - 63i + 56i to oi*3 + f + xi + ki2 and give o. -27 Express 0a + 13 + 13a - 8a - 13a in the form u + fa and give u. 13 Express (267h + 291h - 98h)(5h2 - 4h*2 + 4h*2) in the form y + wh*3 + lh*2 + nh and give w. 2300 Express 335f2 - 30f + 662f2 - 37f + 68f as mf*2 + l + bf and give m. 997 Rearrange -27601 - 183b2 + 27600 - 86b*2 to the form i + ub*2 + tb and give i. -1 Rearrange (-3z - z + 2z)((3 + 5 - 21)(-3z + z + z) + 6z - 2z - 3z) to the form g + mz2 + nz and give m. -28 Express 67i + 71i - 47i + 1 as fi + z and give z. 1 Express 3o3 - 165o*2 + 18o - o*3 + 867o*2 - 16o + 376o2 as go*2 + bo + so3 + j and give g. 1078 Express (-4x + 4x - 8x)(7x - 1779 + 11x3 + 1779) in the form b + sx*4 + nx*2 + gx*3 + ox and give n. -56 Express (441x + 1124 + 440x - 879x)(-2x2 + 2x*2 - 2x*2) in the form i + bx + yx2 + ox3 and give b. 0 Rearrange -b2 - b*2 - 2b*2 - 2b2 + b2 + 0b2 + (4b - 2b - b)(-5 + 2b + 5) + 3b*2 + 159 - 156 - 10b*2 to n + ob + yb2 and give y. -10 Rearrange (-4c*3 + 2c*3 + 4c*3)(-143c + 371c + 254c + (-2c - 2c + 3c)(-2 + 4 + 1)) to kc*3 + pc*4 + hc + j + bc2 and give p. 958 Express -51i2 + 0 + 2 + i3 - 56i2 - 3i*3 in the form y + ji*2 + hi*3 + gi and give y. 2 Express 45 - 45 - 80b - 111b in the form l + sb and give s. -191 Rearrange 4 - 29 - 14m + 5m3 - 6m*3 - 20m + 35m to jm*2 + k + hm + am3 and give a. -1 Express 7m - 11 - 6 + 0 + 9 in the form tm + d and give t. 7 Express 2269845 - 795v - 2269845 in the form av + c and give a. -795 Rearrange 150 + 2g*3 + 282g*2 + 276g*2 - 555g*2 to cg*3 + kg + xg2 + d and give x. 3 Express 135768n - 193n2 - 135768n as u + qn2 + cn and give q. -193 Rearrange -182v2 + 34v*3 - 2v*2 - 1 - 1 - 17v*3 - v - 19v*3 to the form gv*3 + pv*2 + rv + d and give g. -2 Express (0f - 36f - 72f)(5 + 2f - 5)(0f + 0f + f*2) as bf + jf2 + t + if*3 + qf*4 and give q. -216 Express -32y*2 - 1040y*2 - 1129y*2 + 250y*2 as w + xy*2 + iy and give x. -1951 Express -745z + 763z - 328z as uz + w and give u. -310 Rearrange (0 - 4 + 2)(2c + 3c - c)(-700 - 10c + 700) to the form vc + oc2 + x and give o. 80 Express (-f + 4 - 4)(-7 + 1 + 0) + 7f + 2f + 2f in the form df + b and give d. 17 Express (7o2 + 9o - 9o)(o*2 + 2o - 2o) - o4 + 0o*4 + 5o4 - 11 + o4 + 11 as co3 + qo*4 + jo*2 + h + vo and give q. 12 Rearrange 22o2 - 479o + 7o2 + 479o + (-1 + 1 - 2o)(-o + 3 - 3) to the form bo2 + k + ho and give b. 31 Rearrange 294y2 + 292y*2 + 286y*2 - 10 - 869y*2 - 7y*3 to qy*3 + iy + d + py2 and give q. -7 Express -11k + 209 - 415 + 216 as qk + s and give s. 10 Rearrange (0 + 0 + 10j)(0 + 0 + j)(-j + 5j - 2j)(0 + 0 - 1) - 8j2 - j3 + 8j2 to xj*3 + dj + a + qj2 and give x. -21 Express (-15 + 15 + h)(9h - 4h + 3h) + 2h*2 + 4h*2 - 10h*2 as wh*2 + p + sh and give w. 4 Rearrange -50 + 6n2 - 51 - n3 - 5n*2 + 38n + 102 - 2n4 to the form zn*3 + cn*2 + p + gn + ln4 and give c. 1 Rearrange -41 - 2l*2 + 121 - 3l - 31 - 37 + l*2 to the form gl + wl2 + n and give n. 12 Rearrange (15l - l + 0l)((-1 + 2 - 2)(-4l - l - l) + (-3 + 6 + 1)(4l + 0l - 3l)) to k + gl2 + il and give g. 140 Express (-1 + 0 + 2)(-2v - 3v + 3v)(-77 + 306 - 141) in the form u + sv and give s. -176 Rearrange 3 - 1 + 2 - 16r3 + 5r*2 - 3r - 3 - 2r2 to sr*2 + yr*3 + jr + v and give y. -16 Rearrange -2q3 + 2q*2 + 115 + 2q + 2q4 - 225 + 118 to the form xq*2 + w + nq*4 + lq + aq3 and give a. -2 Express (-480 + 970 - 481 + 3t*2 - 2t)(11t*2 - 10t*2 + 5t**2) a	{ "pile_set_name": "DM Mathematics" }
f -42, -37, -22, 9, 62? d3 - d2 + d - 43 What is the o'th term of 625, 626, 627? o + 624 What is the a'th term of 214, 427, 640, 853, 1066? 213a + 1 What is the q'th term of -2, -8, -30, -80, -170, -312, -518? -2q*3 + 4q*2 - 4q What is the q'th term of -49, -94, -139? -45q - 4 What is the r'th term of 366, 360, 354, 348, 342, 336? -6r + 372 What is the o'th term of 62, 124, 188, 254, 322, 392? o*2 + 59o + 2 What is the a'th term of -20, 30, 128, 280, 492, 770, 1120, 1548? a*3 + 18a*2 - 11a - 28 What is the q'th term of 201, 190, 157, 90, -23, -194, -435, -758? -2q3 + q2 + 202 What is the c'th term of 131, 122, 101, 62, -1, -94, -223, -394? -c3 - 2c + 134 What is the c'th term of 19, 40, 61, 82? 21c - 2 What is the x'th term of 26, 88, 150, 212, 274? 62x - 36 What is the i'th term of 266, 504, 742, 980, 1218, 1456? 238i + 28 What is the u'th term of 385, 787, 1189? 402u - 17 What is the t'th term of -2029, -2030, -2031? -t - 2028 What is the z'th term of 554, 553, 552, 551? -z + 555 What is the k'th term of -34, -66, -98, -130? -32k - 2 What is the f'th term of 26909, 26911, 26913, 26915? 2f + 26907 What is the w'th term of -9, -6, -13, -36, -81? -w3 + w2 + 7w - 16 What is the d'th term of 568, 1130, 1688, 2242, 2792, 3338, 3880? -2d*2 + 568d + 2 What is the x'th term of -48, -217, -508, -927, -1480, -2173? -x*3 - 55x*2 + 3x + 5 What is the v'th term of -32, -71, -112, -155, -200? -v*2 - 36v + 5 What is the y'th term of 1964, 1967, 1972, 1979? y2 + 1963 What is the z'th term of 1209, 1204, 1205, 1218, 1249, 1304? z3 - 3z2 - 3z + 1214 What is the q'th term of -11, -1, 33, 103, 221? 2q3 - 4q - 9 What is the l'th term of -804, -728, -602, -426, -200? 25l2 + l - 830 What is the g'th term of 16220, 32439, 48658, 64877, 81096, 97315? 16219g + 1 What is the k'th term of -1164, -2327, -3490? -1163k - 1 What is the x'th term of 37, 171, 401, 733, 1173? x3 + 42x*2 + x - 7 What is the p'th term of -17, -60, -177, -404, -777? -6p3 - p2 + 2p - 12 What is the s'th term of -421, -445, -481, -529, -589, -661? -6s*2 - 6s - 409 What is the j'th term of 41, 80, 119, 158, 197, 236? 39j + 2 What is the v'th term of -46, -81, -118, -157, -198, -241? -v2 - 32v - 13 What is the s'th term of -134, -138, -146, -158, -174, -194? -2s2 + 2s - 134 What is the l'th term of 252, 1010, 2274, 4044, 6320, 9102, 12390? 253l2 - l What is the x'th term of -56, -108, -158, -206, -252, -296, -338? x2 - 55x - 2 What is the o'th term of 874, 882, 890, 898, 906, 914? 8o + 866 What is the p'th term of 20, 96, 216, 380? 22p*2 + 10p - 12 What is the v'th term of 39, 186, 445, 828, 1347, 2014, 2841? 2v3 + 44v2 + v - 8 What is the o'th term of -1047, -1068, -1111, -1182, -1287, -1432, -1623? -o3 - 5o2 + o - 1042 What is the j'th term of -19, -12, -5, 2, 9, 16? 7j - 26 What is the o'th term of 271, 279, 301, 343, 411, 511? o3 + o2 - 2o + 271 What is the x'th term of 29388, 29390, 29392, 29394, 29396, 29398? 2x + 29386 What is the s'th term of -933, -1873, -2815, -3759, -4705, -5653, -6603? -s*2 - 937s + 5 What is the t'th term of 6, 1, -2, -3, -2? t*2 - 8t + 13 What is the w'th term of -120, -125, -128, -129, -128, -125? w*2 - 8w - 113 What is the y'th term of 54, 57, 60, 63, 66? 3y + 51 What is the n'th term of 130, 261, 392, 523? 131n - 1 What is the p'th term of -46, -47, -56, -79, -122, -191? -p*3 + 2p*2 - 47 What is the n'th term of -1397, -1412, -1451, -1526, -1649, -1832, -2087, -2426? -2n*3 - n - 1394 What is the x'th term of 20, 26, 32? 6x + 14 What is the p'th term of -2, -3, 6, 31, 78, 153, 262? p3 - p2 - 5p + 3 What is the j'th term of -215, -1689, -5693, -13493, -26355, -45545? -211j3 + j2 - 5 What is the h'th term of 52, 94, 136, 178, 220, 262? 42h + 10 What is the j'th term of -39, -66, -93, -120, -147? -27j - 12 What is the d'th term of 62, 61, 60, 59? -d + 63 What is the f'th term of 35, 86, 137, 188? 51f - 16 What is the j'th term of -341, -355, -379, -413, -457, -511, -575? -5j*2 + j - 337 What is the p'th term of 1, -21, -89, -227, -459? -4p3 + p2 + 3p + 1 What is the s'th term of -9, -151, -535, -1281, -2509, -4339? -20s3 - s2 + s + 11 What is the i'th term of -2268, -2285, -2328, -2409, -2540, -2733, -3000? -2i3 - i2 - 2265 What is the v'th term of 51, 85, 151, 255, 403, 601, 855, 1171? v3 + 10v*2 - 3v + 43 What is the r'th term of 12, 59, 138, 249, 392, 567, 774? 16r2 - r - 3 What is the c'th term of 67, 77, 101, 145, 215? c3 + c2 + 65 What is the b'th term of -16, -34, -62, -100? -5b*2 - 3b - 8 What is the v'th term of -31, -197, -649, -1531, -2987? -24v3 + v2 - v - 7 What is the m'th term of -7, -18, -29, -34, -27, -2, 47? m3 - 6m*2 - 2 What is the u'th term of 609, 641, 721, 873, 1121, 1489? 4u*3 + 4u + 601 What is the u'th term of 13, 64, 159, 310, 529, 828, 1219? 2u3 + 10u*2 + 7u - 6 What is the b'th term of 170, 317, 464, 611, 758, 905? 147b + 23 What is the p'th term of -284, -269, -244, -209, -164? 5p2 - 289 What is the g'th term of 203, 805, 1803, 3191, 4963, 7113, 9635, 12523? -g3 + 204g2 - 3g + 3 What is the g'th term of 87, 88, 89, 90, 91, 92? g + 86 What is the d'th term of -2386, -2375, -2350, -2305, -2234, -2131? d3 + d2 + d - 2389 What is the y'th term of 94, 123, 152, 181, 210? 29y + 65 What is the s'th term of -209, -414, -619, -824, -1029, -1234? -205s - 4 What is the l'th term of 4, 0, -4, -8? -4l + 8 What is the q'th term of -15, -24, -33? -9q - 6 What is the b'th term of -42, -77, -114, -153, -194, -237? -b*2 - 32b - 9 What is the h'th term of -50, -73, -96? -23h - 27 What is the x'th term of 51, 42, 33, 24, 15? -9x + 60 What is the a'th term of -712, -1417, -2120, -2821, -3520? a*2 - 708a - 5 What is the g'th term of -1, 0, 23, 80, 183, 344? 2g3 - g2 - 10g + 8 What is the k'th term of -31, -28, -19, -4, 17, 44? 3k2 - 6k - 28 What is the y'th term of -19, -5, 27, 83, 169? y*3 + 3y*2 - 2y - 21 What is the k'th term of 39, 51, 31, -27, -129? -k*3 - 10k*2 + 49k + 1 What is the l'th term of 127, 30, -133, -362, -657, -1018, -1445? -33l2 + 2l + 158 What is the t'th term of -95, -108, -121? -13t - 82 What is the c'th term of -31, -83, -159, -259? -12c*2 - 16c - 3 What is the k'th term of -47, -145, -309, -539, -835? -33k2 + k - 15 What is the o'th term of -156, -171, -186, -201, -216? -15o - 141 What is the f'th term of -1114, -1120, -1126, -1132, -1138, -1144? -6f - 1108 What is the w'th term of 10, 17, 24, 31? 7w + 3 What is the v'th term of -16, -29, -68, -145, -272, -461, -724? -2v3 - v2 + 4v - 17 What is the t'th term of 9, 45, 121, 243, 417, 649? t*3 + 14t*2 - 13t + 7 What is the m'th term of 513, 522, 543, 582, 645, 738? m*3 + 2m + 510 What is the n'th term of -57, -60, -61, -60, -57, -52, -45? n*2 - 6n - 52 What is the v'th term of 72, 78, 88, 102, 120, 142, 168? 2v2 + 70 What is the p'th term of -2, -6, -14, -26? -2p*2 + 2p - 2 What is the x'th term of 50, 36, 24, 14, 6? x*2 - 17x + 66 What is the g'th term of -269, -537, -807, -1079? -g*2 - 265g - 3 What is the u'th term of 158, 161, 164, 167, 170, 173? 3u + 155 What is the y'th term of 10, 33, 68, 115, 174, 245? 6y*2 + 5y - 1 What is the n'th term of -15, -26, -49, -90, -155? -n*3 - 4n - 10 What is the b'th term of 1418, 2840, 4262, 5684? 1422b - 4 What is the s'th term of 8, 8, 2, -16, -52, -112, -202? -s3 + 3s*2 - 2s + 8 What is the d'th term of 1, 8, 35, 94, 197, 356, 583? 2d3 - 2d*2 - d + 2 What is the n'th term of -883, -881, -879, -877, -875, -873? 2n - 885 What is the t'th term of 175, 708, 1597, 2842? 178t2 - t - 2 What is the v'th term of -1276, -1277, -1278, -1279, -1280, -1281? -v - 1275 What is the l'th term of -7, -35, -111, -259, -503, -867, -1375, -2051? -4l3 - 3 What is the v'th term of 16, 12, 6, -2, -12, -24, -38? -v2 - v + 18 What is the q'th term of 53, 83, 111, 137, 161, 183, 203? -q*2 + 33q + 21 What is the j'th term of 11223, 11224, 11225, 11226? j + 11222 What is the w'th term of -181, -188, -197, -208, -221? -w*2 - 4w - 176 What is the q'th term of 409, 395, 357, 283, 1	{ "pile_set_name": "DM Mathematics" }
or b. -3403, -18 Factor -3p4/7 - 175521p*3/7 - 351033p*2/7 - 175515p/7. -3p(p + 1)*2(p + 58505)/7 Solve -27v2 + 1415103v - 314466 = 0. 2/9, 52411 What is b in -b*2/5 - 395136b/5 - 39033114624/5 = 0? -197568 Factor 4t2 - 3824t + 150060. 4(t - 915)(t - 41) Factor -3w2 - 1965w - 25038. -3(w + 13)(w + 642) Factor -p*4 + 8p*3 - 4p*2 - 48p. -p(p - 6)(p - 4)(p + 2) Factor -4v*2 + 28852v - 86520. -4(v - 7210)(v - 3) Solve 5t3 + 8445t*2 + 158550t - 167000 = 0 for t. -1670, -20, 1 Factor w*2/3 - 5012w/3 + 5011/3. (w - 5011)(w - 1)/3 Factor -s2/8 + 4463s/4 - 26769/8. -(s - 8923)(s - 3)/8 Determine c, given that -18c*4 + 4188c*3/5 - 13984c*2/5 + 2676c - 430 = 0. 1/5, 5/3, 43 Determine d so that 5d2 - 75d - 44370 = 0. -87, 102 Determine p, given that 3p3 - 12p*2 - 1188p - 6048 = 0. -14, -6, 24 Factor u*4 + 38u*3 + 521u*2 + 3088u + 6720. (u + 7)(u + 8)2(u + 15) Suppose -4i2/7 - 36640i/7 - 73264/7 = 0. What is i? -9158, -2 Factor 4t4/9 + 6560t*3/9 - 13136t*2/9. 4t*2(t - 2)(t + 1642)/9 Determine d so that -d2 - 867908d - 188316074116 = 0. -433954 Solve i*5/5 + 20i*4 + 1728i*3/5 - 8960i*2 - 200704i/5 = 0 for i. -56, -4, 0, 16 Find m such that -4m2 - 3588004m = 0. -897001, 0 Determine p, given that -4p2 - 5611172p - 5611168 = 0. -1402792, -1 Let -5h3 - 9165h*2 - 4195275h + 4204445 = 0. Calculate h. -917, 1 Suppose 25l4/6 - 785l*3/6 - 3545l*2/3 + 15730l/3 - 1900 = 0. Calculate l. -10, 2/5, 3, 38 Determine v, given that v*5 + 733v*4 - 62145v*3 + 182027v*2 - 180556v + 59940 = 0. -810, 1, 74 Factor c*3 + 6078c2. c2(c + 6078) Factor 4w*4 - 9268w*3 + 6872580w*2 - 1393557372w - 176789305944. 4(w - 801)3(w + 86) Determine d, given that -2d3 - 6484d*2 + 84606d - 78120 = 0. -3255, 1, 12 Determine d, given that 4d5/7 + 9624d*4/7 + 5769544d*3/7 - 23222736d*2/7 + 5865940d/7 + 34848600/7 = 0. -1205, -1, 2, 3 Let -108s2 + 14756s + 5480 = 0. What is s? -10/27, 137 Factor 3t2/5 + 5196t/5 - 62292. 3(t - 58)(t + 1790)/5 Factor 3y4 - 546y*3 + 4197y*2 - 3654y. 3y(y - 174)(y - 7)(y - 1) Find z, given that 8z3/13 - 90z*2 - 35484z/13 + 688 = 0. -26, 1/4, 172 Factor 5h3 - 4060h*2 + 71865h - 321570. 5(h - 794)(h - 9)*2 Factor -5y*4 - 16393440y*3 - 13437227358230y*2 + 26874503896800y - 13437260145125. -5(y - 1)2(y + 1639345)*2 Find t, given that 6t*4/11 + 5188t*3/11 + 3418t*2/11 - 32820t/11 + 10368/11 = 0. -864, -3, 1/3, 2 What is p in p*4/2 - 480p*3 + 1821p*2/2 + 45355p + 143700 = 0? -5, 12, 958 Solve -8g3 - 107646g*2 + 349928g - 80754 = 0 for g. -13459, 1/4, 3 Let -3h2/7 - 1267452h/7 - 133869547692/7 = 0. Calculate h. -211242 Factor 4x3 - 1992x*2 - 8032x. 4x(x - 502)(x + 4) Let -1118h*3 - 17885h*2 + 40296h - 108 = 0. What is h? -18, 3/1118, 2 What is s in -2s2/3 + 16970s/3 - 56500 = 0? 10, 8475 Solve s*2 + 44067s + 176252 = 0 for s. -44063, -4 Let -t*5 - 549t*4 - 7531t*3 - 21879t*2 + 29960t = 0. Calculate t. -535, -8, -7, 0, 1 Suppose -l*4/2 + 169l*3/2 - 2823l*2/2 + 16051l/2 - 14798 = 0. What is l? 4, 7, 151 Determine w so that -3w2/4 - 6495w/4 + 6501/2 = 0. -2167, 2 Determine a so that -a*5/6 + 515a*4 - 789471a*3/2 - 4792590a*2 - 14433606a = 0. -6, 0, 1551 Factor p*3/3 - 223p*2/3 + 11368p/3 + 40368. (p - 116)*2(p + 9)/3 Solve 3f4/2 + 8487f*3/2 - 17025f*2/2 - 110439f/2 - 42465 = 0 for f. -2831, -2, -1, 5 Factor -3b2/5 + 1321047b/5 - 2642082/5. -3(b - 440347)(b - 2)/5 Factor -2b2/7 - 386b/7 + 11880/7. -2(b - 27)(b + 220)/7 Factor -3g3/5 - 30186g*2 - 301851g/5 - 150924/5. -3(g + 1)2(g + 50308)/5 Solve -20y5 - 19028y*4 - 64548y*3 - 79676y*2 - 41720y - 7584 = 0. -948, -1, -2/5 Find t, given that -4t3 + 312t*2 - 4356t - 67392 = 0. -9, 39, 48 Factor -2h2/13 + 3936156h/13 - 1936665507042/13. -2(h - 984039)2/13 Determine z, given that -2z*3/13 - 246z*2/13 + 252z/13 + 496/13 = 0. -124, -1, 2 Factor 2d2/7 + 2678d/7 + 549516/7. 2(d + 253)(d + 1086)/7 Find f such that -2f2/3 + 1346f/3 - 2684/3 = 0. 2, 671 Suppose v*3/4 - 44387v*2/4 - 88777v/4 - 44389/4 = 0. What is v? -1, 44389 Factor -1612v3 - 4812v*2 - 3152v + 48. -4(v + 1)(v + 2)(403v - 6) Let -c*4 + 259c*3 - 14559c*2 + 80469c - 117288 = 0. What is c? 3, 72, 181 Factor 3k2/4 - 20010k + 80037/4. 3(k - 26679)(k - 1)/4 What is s in 85s2/6 + 113s/2 - 2/3 = 0? -4, 1/85 Solve -2q5 + 716q*4 + 5808q*3 + 17504q*2 + 23392q + 11712 = 0. -2, 366 Factor 4q2/5 + 13284q - 199296/5. 4(q - 3)(q + 16608)/5 Find a such that 5a2 - 77085a - 154190 = 0. -2, 15419 Factor 5m3 + 528055m*2 - 1056125m + 528065. 5(m - 1)2(m + 105613) Suppose 25o5 - 7480o*4 + 16370o*3 - 10400o*2 + 1485o = 0. Calculate o. 0, 1/5, 1, 297 Suppose -p*2 - 43254p + 129771 = 0. What is p? -43257, 3 Determine m so that 6m3/11 + 3324m*2 + 55741800m/11 + 111337392/11 = 0. -3046, -2 Factor l*3/7 + 172l*2/7 + 3449l/7 + 3278/7. (l + 1)(l + 22)(l + 149)/7 Solve 3f4/4 + 156f*3 - 4956f*2 = 0. -236, 0, 28 Find a, given that 3a*2 - 71040a - 71043 = 0. -1, 23681 Factor 2n4 + 84n*3 + 1048n*2 + 2736n - 10368. 2(n - 2)(n + 8)(n + 18)2 Factor -8z*3/3 + 10266z*2 - 7698z. -2z(z - 3849)(4z - 3)/3 Solve 2f4/5 - 14f*3 - 76f*2/5 + 144f/5 = 0 for f. -2, 0, 1, 36 Solve 2z4/19 + 242z*3/19 - 5924z*2/19 + 5680z/19 = 0 for z. -142, 0, 1, 20 What is m in -2m3 + 12618m*2 - 19857504m - 139621496 = 0? -7, 3158 Suppose -4j4 + 4476j*3 - 70848j*2 + 282368j = 0. What is j? 0, 8, 1103 Determine n so that -n*2 + 270n + 28431 = 0. -81, 351 Solve -2t5/19 + 254t*4/19 - 6512t*3/19 + 54936t*2/19 - 112896t/19 = 0 for t. 0, 3, 14, 96 Let 5f3 - 651945f*2 + 651930f + 1303880 = 0. Calculate f. -1, 2, 130388 Find h, given that -35h3 + 55390h*2 + 79185h + 23760 = 0. -1, -3/7, 1584 What is k in -k*3/4 + 67k*2/4 + 281k/4 + 213/4 = 0? -3, -1, 71 Determine p, given that 98p2 + 30p - 972 = 0. -162/49, 3 Factor 98q4 - 774844q*3 + 1531811226q*2 - 875130952q + 125009672. 2(q - 3953)2(7q - 2)2 Solve -2h*3/17 + 771068h*2/17 - 74318232578h/17 = 0. 0, 192767 Find w, given that 4w2 - 480w + 10556 = 0. 29, 91 Factor 8c2 - 60297c + 7537. (c - 7537)(8c - 1) Factor 2q2/7 - 11350q/7 - 227800/7. 2(q - 5695)(q + 20)/7 Factor 196i3 - 13356i*2 + 109824i - 241664. 4(i - 59)(7i - 32)2 What is r in -2r*2/17 + 11448r/17 - 34326/17 = 0? 3, 5721 Factor -r*2/5 + 1816r/5 - 51823/5. -(r - 1787)(r - 29)/5 Solve -4s*2 - 176s + 3540 = 0 for s. -59, 15 What is g in -4g2 + 11365g - 14200 = 0? 5/4, 2840 Factor -4n2 + 131820n - 131816. -4(n - 32954)(n - 1) Find d, given that -7d2 - 3006d - 1287 = 0. -429, -3/7 Factor 5p4 - 3590p*3 + 7165p*2 - 3580p. 5p(p - 716)(p - 1)2 Suppose -u5 + 14u*4 + 55u*3 - 56u*2 - 204u = 0. What is u? -3, -2, 0, 2, 17 Factor v*4/2 + 792v*3 - 25856v2. v2(v - 32)(v + 1616)/2 Let -25u4 + 3815u*3 - 27770u*2 + 31780u + 17400 = 0. What is u? -2/5, 2, 6, 145 Determine p, given that 5p4 + 26820p*3 - 26825p*2 = 0. -5365, 0, 1 Factor 3c*3/4 + 189c*2/2 - 7245c/4 + 1716. 3(c - 16)(c - 1)(c + 143)/4 Solve 5z*2 - 1265z - 2550 = 0 for z. -2, 255 Determine b, given that 5b4 + 4270b*3 + 12720b*2 - 38430b - 114885 = 0. -851, -3, 3 Solve -3h2/8 + 35019h/2 - 408776787/2 = 0 for h. 23346 Determine z, given that -5z3/4 - 16855z*2/4 - 3549030z + 3553245 = 0. -1686, 1 Suppose -3y2/5 - 228y + 6948/5 = 0. Calculate y. -386, 6 Let -a*5 - 60a*4 + 423a*3 + 1782a*2 = 0. What is a? -66, -3, 0, 9 Suppose -5i*3/4 + 21190i*2 + 423905i/4 + 84785 = 0. What is i? -4, -1, 16957 Factor -n*4/5 + 29n*3/5 - 258n*2/5 + 608n/5 + 896/5. -(n - 14)(n - 8)2(n + 1)/5 Find y such that 3y3 + 3036y*2 + 771135y + 1530150 = 0. -505, -2 Let y*3/4 + 8441y*2 - 33765y/4 = 0. What is y? -33765, 0, 1 Factor 3m2 - 243m - 246. 3(m - 82)(m + 1) Solve -6c5 - 436c*4/3 - 734c*3 + 1872c**2 +	{ "pile_set_name": "DM Mathematics" }
ify (2 + 0 + 1 + sqrt(637) + 4 + sqrt(637)-1 + 1 + sqrt(637) + 0 + -3 + -1sqrt(637) + 4)*2. 81 Simplify 3(1(sqrt(352)-3 + sqrt(198)-6)/(-2(sqrt(162)2 - sqrt(162)))2)*2. 1100/3 Simplify ((sqrt(75) + 0 + -3 + sqrt(75))1 - (-1 + sqrt(75)2 - -2(sqrt(75) + 1))*2) + 1. -1203 - 30sqrt(3) Simplify (-6sqrt(144)-16)/((sqrt(96) - 1sqrt(96)-1)/sqrt(12)-6). -9sqrt(2) Simplify (-5 + sqrt(11))-6 - sqrt(66)/sqrt(294) - (4(-3 + sqrt(1584) + 1))2. -25378 + 5333sqrt(11)/7 Simplify -3(-4(sqrt(833) + 0)*2 - (sqrt(833)-2 - sqrt(833))-3 - ((6(sqrt(833) - (sqrt(833) + sqrt(833) + 1) - sqrt(833)) - sqrt(833))*2 + 3)). 3465sqrt(17) + 432444 Simplify -6(((1sqrt(750) - sqrt(750)) + sqrt(750) - sqrt(30) - -1sqrt(3000))/(1sqrt(486) + sqrt(54)))*2-1. 245/6 Simplify ((sqrt(36)/sqrt(3))/sqrt(4)1-1 - (4 + sqrt(432) + (sqrt(432) + -1)2 + sqrt(432))2) + -1. -6917 - 193sqrt(3) Simplify (-4(-5 + 2 + -4 + (sqrt(245) - sqrt(245)1) + 2) + -5)*2. 225 Simplify 6(3sqrt(1872)-5 + 2 + 1sqrt(1872) + 4 + sqrt(1872) + 2 + sqrt(1872)-2 + 5). -1080sqrt(13) + 78 Simplify (-4 + (-1 + 1 + sqrt(243) + -3)6 + (-5(2 + sqrt(243)) - ((5 + 3sqrt(243) - sqrt(243)) + sqrt(243))))*2. 1332sqrt(3) + 2341 Simplify -34(-52sqrt(76) - -4(sqrt(76) - (sqrt(76) + 1sqrt(76))))/(-32sqrt(576)). -7sqrt(19)/3 Simplify 5 + 3((5(sqrt(833) - (sqrt(833) - (-1 + sqrt(833)))) - sqrt(833)) + sqrt(833) + 1 + (sqrt(833) + (3(sqrt(833) + 0) - sqrt(833)) - sqrt(833))-4)2. 504sqrt(17) + 22544 Simplify 5(-2 + (-5 + 1sqrt(39)/(-1sqrt(108) - sqrt(3)))-5)*2. 1150sqrt(13)/7 + 131230/49 Simplify -1 + -4(3 + (-4 + sqrt(931) + 4 + 5sqrt(931)-4)2)-3. 4033127 Simplify ((sqrt(931) - -61sqrt(931)) + (sqrt(931) + (sqrt(931) + -2 - sqrt(931)))*25 - ((2 + (1 + sqrt(931) - sqrt(931)))*2 + sqrt(931))2)6. -630sqrt(19) + 27942 Simplify (-1-4sqrt(121)-5-1)/((sqrt(66) + -5sqrt(66)1 + sqrt(66))/(sqrt(96) - (sqrt(96)-1 + sqrt(96) + sqrt(96) - sqrt(96) - sqrt(96)))). -160sqrt(11)/3 Simplify (2(-4sqrt(7)2 + -2))2 - (-5 + (5 + sqrt(14)/sqrt(2))-5). 133sqrt(7) + 1838 Simplify (((0 + sqrt(1216))-5 + -5)-4 - ((sqrt(1216) + -1)-4 + 1 + 2))*2. 4992sqrt(19) + 700585 Simplify (-1 + sqrt(5) + -2sqrt(5) + sqrt(10)/(sqrt(6)/sqrt(3)) + -5 + sqrt(55)/((sqrt(33)-2)/sqrt(3)))2. -12 - sqrt(5) Simplify (-3 + sqrt(5) + sqrt(15)/sqrt(3))-6 + (-5 + -4sqrt(10)/sqrt(2))2 + (-1 + sqrt(5) + 0 + (62sqrt(5))2)6 + 2. 34sqrt(5) + 4439 Simplify (2sqrt(4320))/(4(sqrt(6) - -2sqrt(6)) - sqrt(6)) - -4sqrt(125)1-2. -416sqrt(5)/11 Simplify -1(2 + (sqrt(153) + 2)2 + sqrt(153)) + 1 - (-4 + (-4(-2 + sqrt(153)) + sqrt(153))*2)1. -1595 + 129sqrt(17) Simplify ((sqrt(5929)1)/(4sqrt(112)) - (-3(sqrt(567) + 2) + sqrt(567))1)2. 897sqrt(7)/4 + 635023/256 Simplify ((0 + (-1sqrt(171) - sqrt(171)) - (-1 + sqrt(171)-1)) + ((0 + sqrt(171))-4 - (-5 + sqrt(171)1)))*251 + 1. -1080sqrt(19) + 30961 Simplify -5-4((36sqrt(1053))*21 + -4)-4. -27293440 Simplify (-3 + 4 + sqrt(68) + -1 + 2 + sqrt(68)-1 + -5sqrt(68)1 + sqrt(68))*2. -32sqrt(17) + 1092 Simplify -5(sqrt(196)/sqrt(16) - sqrt(196)2)/(((sqrt(2268) - (sqrt(2268) + 1sqrt(2268))) + sqrt(28))/sqrt(4))1. -35sqrt(7)/16 Simplify ((-1 + sqrt(18))2 - (sqrt(90)-1 + sqrt(90) - sqrt(90))/sqrt(5))2 + 0 + -5-4sqrt(108)/sqrt(6)6. 166 + 324sqrt(2) Simplify (sqrt(544)1 + sqrt(408)/(sqrt(12) - sqrt(108)))/(sqrt(18) + (-1sqrt(18) - sqrt(18)) + sqrt(8)2) + 4. 4 + 7sqrt(17)/2 Simplify (((sqrt(126)/sqrt(2) + sqrt(63))5 + -5sqrt(189)/sqrt(3))/((-2(sqrt(81) - sqrt(81)-2))/(sqrt(900)-1)))*2. 4375/9 Simplify -2 + (sqrt(121)-26-1-4)/(-22sqrt(891) - -2-1sqrt(891)). -2 + 8sqrt(11)/9 Simplify (-44sqrt(56)/sqrt(4))/((sqrt(70)-12)/sqrt(10))6-3. -144sqrt(2) Simplify ((2sqrt(325) + -4 - (0 + -1sqrt(325))) + 5(sqrt(325) + -1 + 4 - sqrt(325) - sqrt(325)) + 3)*22. -560sqrt(13) + 2992 Simplify -5 + ((sqrt(400) - 2sqrt(400))-1 + sqrt(400))/(sqrt(15)/(sqrt(6)/sqrt(2)) + sqrt(25)/(sqrt(15)/sqrt(3))). -5 + 4sqrt(5) Simplify ((6(sqrt(300) + sqrt(3)))2 + sqrt(3))4 + 5 - ((-6(sqrt(15)/sqrt(5))2 - (sqrt(24) + sqrt(24) + sqrt(24) + sqrt(24)-1)/sqrt(8)) + 4). 6sqrt(3) + 52291 Simplify ((-2((sqrt(4752) + 4(sqrt(4752)2 - sqrt(4752)) - sqrt(4752) - sqrt(4752)) + sqrt(4752)))/(5sqrt(144)/sqrt(3))6)*2. 228096/25 Simplify ((sqrt(363) + -2)5 - (-2 + sqrt(363)1)) + 1 - -4(5sqrt(363)-1 + (sqrt(363)-2 - sqrt(363)) + 0). -308sqrt(3) - 7 Simplify (6(sqrt(70) - sqrt(70)-1-3)2)/((sqrt(1000) + -4-1sqrt(1000))-2) + 4. 6sqrt(7)/25 + 4 Simplify 0 + ((sqrt(500)3)/sqrt(10) + 2sqrt(250)/sqrt(5) + sqrt(50))/(sqrt(20)/(sqrt(2)3 - sqrt(2)) - (sqrt(360) - -2sqrt(360) - sqrt(10))). -4sqrt(5)/11 Simplify (6(2sqrt(448)5 + sqrt(448))-4 + 1(-2sqrt(448)-5 + sqrt(448) - (sqrt(448) - (0 + (sqrt(448) + -2 - sqrt(448))))))*2. 8128sqrt(7) + 28903172 Simplify ((1(1sqrt(66)-2 + 4sqrt(66)-2 + sqrt(66)))/(((2sqrt(54))/sqrt(3))/((sqrt(3) + sqrt(12)/sqrt(4))4)))2. 14256 Simplify -5 + (4(5sqrt(128)-4 + (sqrt(128) - (sqrt(128) + -3 + sqrt(128) + -4)) + -4 + -5))*2. 10752sqrt(2) + 903227 Simplify (5sqrt(1029) + sqrt(21)-4-6)/(sqrt(343) + -4(sqrt(343) + 1sqrt(343) - sqrt(343) - sqrt(343)) + 31sqrt(343)). 59sqrt(3)/28 Simplify ((sqrt(513)-2 + sqrt(57))/sqrt(3) - (-5 + sqrt(19) + sqrt(19) + 1)-3) + ((-2sqrt(209) + sqrt(209))-1)/((sqrt(176) + sqrt(11))-2). -12 + 9sqrt(19)/10 Simplify (5((sqrt(15) + (sqrt(15) + sqrt(60) - sqrt(15)))-1 - sqrt(15)21))/((2sqrt(135))/(sqrt(108) - (sqrt(108) - (2sqrt(108) + sqrt(108))))). -75sqrt(3) Simplify ((-3sqrt(130)-5 + sqrt(130) + (-6(-2sqrt(130) - sqrt(130)) - sqrt(130)))/(6(sqrt(360)1-4 + sqrt(360))) + 2)*2. -11sqrt(13)/9 + 6757/1296 Simplify (-41sqrt(85)-52)/(sqrt(20)/(sqrt(4) + (sqrt(4) - sqrt(16)/sqrt(4))) + (sqrt(5) - 4(sqrt(5) - (sqrt(5) - sqrt(5)2)))). -20sqrt(17)/3 Simplify (1(1 + 0 + 4 + sqrt(1700) + 0 + (-1sqrt(1700)-1 - sqrt(1700)) + 2))*2. 140sqrt(17) + 1749 Simplify (-2sqrt(648)-2 - -1sqrt(648)5)/(sqrt(432)/sqrt(2) + -6sqrt(6)2). -9sqrt(3) Simplify 0 + (-1 + -4 + sqrt(125) + -2 + (5 + sqrt(125)-2 - sqrt(125)) + -2)*2. 80sqrt(5) + 516 Simplify 2 + (-5 + (sqrt(1539) - (-5(sqrt(1539) + 1 + sqrt(1539)))2) + 1 + sqrt(1539) + 3)-1. 882sqrt(19) + 153928 Simplify ((sqrt(11) + -1)4 - sqrt(66)/sqrt(6)-3 - (-5 + ((sqrt(11) - (0 + sqrt(891))) + sqrt(11) - (-1 + sqrt(44)))))2. 2816 Simplify (sqrt(77)-1-6 + (sqrt(77) - (-1sqrt(77) - sqrt(77))5))/(sqrt(33)/((sqrt(27)3)/sqrt(9))) + 1. 1 + 51sqrt(7) Simplify (-3 + ((sqrt(1872) + 1)-5 + -4 + (sqrt(1872) + 0 - sqrt(1872)) + sqrt(1872) + sqrt(1872) + sqrt(1872) - (sqrt(1872)-1 + -4 + 5)) + -4)2. 408sqrt(13) + 2161 Simplify 5 + -4 + (3sqrt(130)2 + (sqrt(130) + sqrt(130) + -2sqrt(130) + sqrt(130))-5)/(-23sqrt(490) + sqrt(490)). -sqrt(13)/35 + 1 Simplify ((sqrt(684)-41 - sqrt(684))4 + (6(-3sqrt(95) + sqrt(95) + sqrt(95))/sqrt(5))2 + 0)-4. -2736 + 480sqrt(19) Simplify (2 + ((6(sqrt(9) + sqrt(324) + (sqrt(324) - (-3sqrt(324) + sqrt(324)))))/(sqrt(33)/(-3sqrt(66)/sqrt(6))))*2)6. 3645012 Simplify (-3(-2sqrt(468) + sqrt(468))4)/(sqrt(576)-3 + 53sqrt(4)). -12sqrt(13)/7 Simplify (((-1sqrt(363)-2)2 + -1 + (sqrt(363)2)*2)6 + 0 + 5 + (-2sqrt(363))2 + sqrt(363) + -2)1. 11sqrt(3) + 18873 Simplify ((sqrt(60) - sqrt(4860)-1)6-5)/((sqrt(2940) - sqrt(60))/sqrt(5) + (sqrt(84)/(-1sqrt(7)) - sqrt(12))). -75sqrt(5) Simplify 3 + (sqrt(17)1-6 + -2sqrt(612) + -2(1 + sqrt(612) - sqrt(612))-2)2 + -1. -144sqrt(17) + 5526 Simplify 4 + ((((sqrt(272) + -1 - sqrt(272))3 - sqrt(272)) + 5)-4 + 4 + -4)-6. -96sqrt(17) + 52 Simplify -1-4(-1 + sqrt(1872) + sqrt(1872) + sqrt(1872) + 0 + 0 + -1sqrt(1872) + 3 + 4)2. 1152sqrt(13) + 30096 Simplify sqrt(44)/(sqrt(100) - -2sqrt(100)) + 4 + 5 + (sqrt(44) - 1sqrt(5324)). -299sqrt(11)/15 + 9 Simplify (0 + (-3 + (-3sqrt(231)/sqrt(7))/(-1sqrt(3)-3 + sqrt(3)))-5)2. 225sqrt(11)/2 + 6075/16 Simplify (-1((sqrt(567) + 2 - sqrt(567)) + sqrt(567) + 3 + sqrt(567)))2 + ((sqrt(70)-1-4)/(sqrt(90)-2))*2. 180sqrt(7) + 20665/9 Simplify 3 + (sqrt(13) - (-2*sqr	{ "pile_set_name": "DM Mathematics" }
kilometer in millimeters? 62500 How many milligrams are there in 12/25 of a gram? 480 What is fourty-seven quarters of a litre in millilitres? 11750 How many hours are there in 69107.48 weeks? 11610056.64 How many micrograms are there in 16.41379ng? 0.01641379 What is 13/5 of a litre in millilitres? 2600 What is 9.88083 decades in millennia? 0.0988083 What is 75244.81 weeks in days? 526713.67 How many nanometers are there in 9.046695 meters? 9046695000 What is 32/5 of a microgram in nanograms? 6400 What is 8.504591um in kilometers? 0.000000008504591 How many millilitres are there in eleven quarters of a litre? 2750 Convert 88.10056 litres to millilitres. 88100.56 What is 27/5 of a tonne in kilograms? 5400 Convert 58364.33nm to centimeters. 0.005836433 What is 91.50037 years in millennia? 0.09150037 What is 33/5 of a millennium in months? 79200 How many kilograms are there in 36243.65 grams? 36.24365 How many millimeters are there in 118201.1m? 118201100 Convert 59865.46g to micrograms. 59865460000 How many years are there in 3/5 of a decade? 6 How many millilitres are there in 13.54136 litres? 13541.36 What is fourty-six fifths of a meter in millimeters? 9200 What is 4.698911 millilitres in litres? 0.004698911 Convert 988888.9 millennia to years. 988888900 Convert 120.8521ml to litres. 0.1208521 Convert 7.03234 micrometers to kilometers. 0.00000000703234 How many meters are there in 19.73526 nanometers? 0.00000001973526 What is 21/4 of a litre in millilitres? 5250 How many nanograms are there in 7/8 of a microgram? 875 How many seconds are there in eleven quarters of a minute? 165 What is 39.973122 minutes in days? 0.0277591125 How many years are there in 2898.934 centuries? 289893.4 What is three tenths of a century in decades? 3 What is 6.44063m in kilometers? 0.00644063 How many days are there in 17626960.8 seconds? 204.01575 Convert 1.709991 litres to millilitres. 1709.991 What is thirty-two sevenths of a week in minutes? 46080 Convert 0.0031582 millilitres to litres. 0.0000031582 How many milliseconds are there in three fifths of a minute? 36000 How many millennia are there in 27.250923 months? 0.00227091025 How many millimeters are there in 8396.514 meters? 8396514 What is 9956.251l in millilitres? 9956251 What is 13/4 of a centimeter in micrometers? 32500 What is 29/3 of a century in months? 11600 What is seven halves of a second in milliseconds? 3500 What is 483.2697 millennia in years? 483269.7 What is 2.26085 micrograms in tonnes? 0.00000000000226085 How many years are there in 8/25 of a millennium? 320 What is 43.76722 decades in centuries? 4.376722 How many centimeters are there in 17/4 of a meter? 425 What is 6.552306 litres in millilitres? 6552.306 What is seven eighths of a millennium in months? 10500 Convert 6.817579 years to centuries. 0.06817579 What is 98.97901mm in nanometers? 98979010 How many milligrams are there in six fifths of a gram? 1200 Convert 76682.71 millennia to years. 76682710 How many milligrams are there in fifty-seven fifths of a gram? 11400 Convert 448368.8 microseconds to milliseconds. 448.3688 How many minutes are there in 61.78506 microseconds? 0.000001029751 How many minutes are there in nineteen quarters of a hour? 285 What is 517566.3 tonnes in grams? 517566300000 Convert 0.4707609 millennia to years. 470.7609 What is 6/25 of a millimeter in micrometers? 240 How many milliseconds are there in 1/20 of a second? 50 How many hours are there in 1983.939 minutes? 33.06565 How many decades are there in 2.705391 months? 0.022544925 How many hours are there in 39891.537 nanoseconds? 0.0000000110809825 Convert 73.23202 millilitres to litres. 0.07323202 What is 65.64264us in seconds? 0.00006564264 How many millilitres are there in thirty-one halves of a litre? 15500 Convert 0.4461977 millilitres to litres. 0.0004461977 How many kilograms are there in 8.478614 micrograms? 0.000000008478614 How many microseconds are there in 5/4 of a millisecond? 1250 What is 33724.5174ns in weeks? 0.0000000000557614375 What is twenty-one halves of a litre in millilitres? 10500 How many kilograms are there in thirty-three fifths of a tonne? 6600 Convert 4133.196 days to microseconds. 357108134400000 What is eighteen fifths of a litre in millilitres? 3600 How many hours are there in 41/2 of a week? 3444 What is 21/2 of a decade in years? 105 What is 16.100898 months in years? 1.3417415 How many nanometers are there in 3/8 of a micrometer? 375 What is 19/4 of a kilogram in grams? 4750 What is twenty-seven fifths of a micrometer in nanometers? 5400 How many nanometers are there in 56.74522 meters? 56745220000 What is 61398.73 decades in centuries? 6139.873 How many centimeters are there in 27/4 of a meter? 675 What is 558.491 millimeters in nanometers? 558491000 Convert 3679722.27 microseconds to weeks. 0.000006084196875 How many nanograms are there in fifty-nine quarters of a microgram? 14750 Convert 79808.29 micrograms to kilograms. 0.00007980829 What is 5.17363 litres in millilitres? 5173.63 Convert 11.428128 minutes to days. 0.0079362 What is 41.61508kg in micrograms? 41615080000 What is 8.660632 centuries in millennia? 0.8660632 How many months are there in 1/10 of a millennium? 1200 What is 15.6257ml in litres? 0.0156257 How many milligrams are there in 29/2 of a gram? 14500 What is 20570.13l in millilitres? 20570130 How many millilitres are there in 8.630842 litres? 8630.842 What is 774.9158 nanometers in centimeters? 0.00007749158 How many nanograms are there in 4805.628mg? 4805628000 Convert 863327.1s to minutes. 14388.785 How many months are there in twenty-nine thirds of a decade? 1160 How many seconds are there in 2207.87us? 0.00220787 Convert 257.7745 litres to millilitres. 257774.5 What is 7/6 of a minute in seconds? 70 What is 68667.5mm in kilometers? 0.0686675 What is 6.750915 months in years? 0.56257625 What is thirty-seven fifths of a century in months? 8880 How many millilitres are there in fourty-four fifths of a litre? 8800 What is 11.6457264s in weeks? 0.0000192555 How many millilitres are there in one quarter of a litre? 250 What is fourty-two fifths of a kilogram in grams? 8400 How many litres are there in 959.809ml? 0.959809 What is fourty-eight fifths of a centimeter in millimeters? 96 What is 1/24 of a century in months? 50 What is three fifths of a litre in millilitres? 600 What is 271.0798 millilitres in litres? 0.2710798 What is 3/8 of a century in months? 450 How many millilitres are there in 1592.661l? 1592661 How many milligrams are there in 49865.2 grams? 49865200 How many nanograms are there in 5/4 of a microgram? 1250 What is 316.6382l in millilitres? 316638.2 Convert 772.7901 weeks to nanoseconds. 467383452480000000 What is 6/25 of a kilometer in centimeters? 24000 How many seconds are there in 1/10 of a hour? 360 What is 6/25 of a millimeter in micrometers? 240 How many years are there in 7579.97 centuries? 757997 How many millilitres are there in five eighths of a litre? 625 How many millilitres are there in 6/25 of a litre? 240 How many milliseconds are there in 1/10 of a second? 100 How many meters are there in 950503.6 nanometers? 0.0009505036 What is 70.69383 millennia in decades? 7069.383 What is 5/4 of a litre in millilitres? 1250 What is 325631.5ug in milligrams? 325.6315 How many micrometers are there in 6/25 of a millimeter? 240 What is 97973.71g in kilograms? 97.97371 How many millilitres are there in 7/8 of a litre? 875 How many years are there in thirteen quarters of a century? 325 What is 309.0806 hours in nanoseconds? 1112690160000000 What is 19/4 of a litre in millilitres? 4750 Convert 0.6300843ng to micrograms. 0.0006300843 What is 9293.944km in centimeters? 929394400 What is 6/5 of a milligram in micrograms? 1200 Convert 8414.38ng to kilograms. 0.00000000841438 What is seventeen quarters of a litre in millilitres? 4250 How many micrograms are there in 4015.141 tonnes? 4015141000000000 What is 14.07338 millilitres in litres? 0.01407338 What is 9469.361g in nanograms? 9469361000000 What is 3/10 of a meter in centimeters? 30 How many centuries are there in 246643.4 decades? 24664.34 How many months are there in 6/25 of a millennium? 2880 Convert 620.8398s to minutes. 10.34733	{ "pile_set_name": "DM Mathematics" }
replacement from ifkiiffiiif? 6/55 Two letters picked without replacement from {z: 8, v: 7, x: 2, f: 2}. What is prob of sequence zx? 8/171 Calculate prob of sequence lll when three letters picked without replacement from {t: 2, l: 11}. 15/26 Calculate prob of sequence qa when two letters picked without replacement from gdajadjddadqgjajd. 1/68 Calculate prob of sequence hq when two letters picked without replacement from hhhqhhqhqhhqqh. 45/182 What is prob of sequence sfsc when four letters picked without replacement from {c: 2, s: 4, g: 1, f: 4}? 2/165 Two letters picked without replacement from ifgwiiwigwvwyvf. What is prob of sequence ii? 2/35 What is prob of sequence gst when three letters picked without replacement from pgptssvppgvgvvpgp? 1/510 Four letters picked without replacement from {b: 3, w: 2, g: 1, h: 1, d: 3, u: 1}. What is prob of sequence gwwb? 1/1320 Calculate prob of sequence cis when three letters picked without replacement from ciccvcmmsc. 1/144 Three letters picked without replacement from lxxvxlnxvllxxxxnlvx. Give prob of sequence xnl. 5/323 Calculate prob of sequence cjc when three letters picked without replacement from {j: 3, c: 4}. 6/35 Three letters picked without replacement from ghyyyypyyyyyyygyypy. Give prob of sequence gpg. 2/2907 Calculate prob of sequence fb when two letters picked without replacement from bfbbfffbbb. 4/15 Calculate prob of sequence aq when two letters picked without replacement from nxpnppannxq. 1/110 Calculate prob of sequence qqz when three letters picked without replacement from {t: 2, z: 7, q: 2}. 7/495 Four letters picked without replacement from {g: 5, j: 5, b: 1, r: 3, d: 1}. Give prob of sequence jbgj. 5/1638 Three letters picked without replacement from {n: 1, b: 6, o: 1, q: 2, y: 5, k: 2}. What is prob of sequence qbq? 1/340 What is prob of sequence wgw when three letters picked without replacement from {h: 2, w: 3, e: 1, g: 1}? 1/35 What is prob of sequence tni when three letters picked without replacement from tinkn? 1/30 Four letters picked without replacement from {i: 3, q: 3, x: 1, o: 7}. Give prob of sequence qoix. 3/1144 What is prob of sequence go when two letters picked without replacement from ooogoooooooogooooooo? 9/95 Two letters picked without replacement from {a: 3, b: 1}. What is prob of sequence ab? 1/4 Four letters picked without replacement from yytynynxntsynyntnx. Give prob of sequence tsnt. 1/2040 What is prob of sequence rcr when three letters picked without replacement from rcccrrrrcrrrrrcr? 55/336 Three letters picked without replacement from {o: 4, q: 6}. Give prob of sequence ooo. 1/30 Calculate prob of sequence nzz when three letters picked without replacement from {z: 5, n: 2}. 4/21 Calculate prob of sequence yy when two letters picked without replacement from yggygygyyggggygy. 7/40 Calculate prob of sequence xu when two letters picked without replacement from nuxnxxxn. 1/14 Calculate prob of sequence fff when three letters picked without replacement from {l: 6, f: 7}. 35/286 What is prob of sequence ud when two letters picked without replacement from uuduuauuau? 7/90 Calculate prob of sequence cf when two letters picked without replacement from {c: 1, f: 1, n: 1, g: 2, b: 1, k: 1}. 1/42 Two letters picked without replacement from dcld. Give prob of sequence ld. 1/6 Three letters picked without replacement from uxoosohoswss. Give prob of sequence usx. 1/330 What is prob of sequence sts when three letters picked without replacement from {t: 1, s: 6, h: 4}? 1/33 Calculate prob of sequence il when two letters picked without replacement from lliliilliliii. 7/26 What is prob of sequence ins when three letters picked without replacement from shyyssisniinssnisisy? 1/57 Calculate prob of sequence ubuu when four letters picked without replacement from {b: 3, p: 3, u: 7}. 21/572 Two letters picked without replacement from ssnnnswswnnnsnno. What is prob of sequence ss? 1/12 What is prob of sequence hy when two letters picked without replacement from yuuuhuunuuuuuuu? 1/210 Four letters picked without replacement from temtetyyeyttyyy. What is prob of sequence tymt? 1/273 What is prob of sequence gal when three letters picked without replacement from yiaaaaigiaiiilail? 1/340 Calculate prob of sequence zzj when three letters picked without replacement from jjzzjzjzzzzzjjzzzz. 11/68 What is prob of sequence uuuu when four letters picked without replacement from jjkujkuhkkkjjuukku? 1/612 Calculate prob of sequence fgii when four letters picked without replacement from {g: 4, i: 4, y: 1, f: 7, s: 2, z: 1}. 7/1938 Calculate prob of sequence oqc when three letters picked without replacement from qocccmqmcmycf. 5/858 Two letters picked without replacement from wsswswwswswsssgww. Give prob of sequence ww. 7/34 Calculate prob of sequence nb when two letters picked without replacement from nmbmmbbbnbmbnnm. 4/35 Three letters picked without replacement from ybyglllggglly. Give prob of sequence gll. 20/429 Two letters picked without replacement from ffsr. What is prob of sequence rf? 1/6 Three letters picked without replacement from {t: 2, b: 1, l: 1, y: 2}. What is prob of sequence tbl? 1/60 What is prob of sequence qy when two letters picked without replacement from pyyyq? 3/20 What is prob of sequence bb when two letters picked without replacement from {b: 2, o: 3}? 1/10 What is prob of sequence yib when three letters picked without replacement from {i: 3, g: 3, y: 1, z: 1, b: 1, s: 6}? 1/910 Three letters picked without replacement from {l: 1, u: 1, m: 2, v: 1, a: 1, z: 1}. Give prob of sequence alz. 1/210 Calculate prob of sequence tf when two letters picked without replacement from {f: 2, u: 2, h: 2, g: 1, t: 5, v: 2}. 5/91 What is prob of sequence nv when two letters picked without replacement from {g: 6, x: 1, n: 1, w: 2, v: 9}? 1/38 Two letters picked without replacement from eiqqjjqjenq. Give prob of sequence qj. 6/55 What is prob of sequence vt when two letters picked without replacement from qqqgthtghhttvwwgq? 1/68 Three letters picked without replacement from {w: 9, d: 4, k: 2, b: 4}. Give prob of sequence bwd. 8/323 Calculate prob of sequence zt when two letters picked without replacement from izipitq. 1/42 What is prob of sequence vlv when three letters picked without replacement from lvrvlrtrhprpprplrl? 1/612 Three letters picked without replacement from {s: 2, r: 2, m: 1, b: 1, t: 1}. What is prob of sequence bts? 1/105 What is prob of sequence jj when two letters picked without replacement from jjjjjjjjj? 1 What is prob of sequence mmm when three letters picked without replacement from fmfmmff? 1/35 Two letters picked without replacement from wwrwbwrwr. What is prob of sequence rw? 5/24 Calculate prob of sequence euek when four letters picked without replacement from jeeeajjaeakkauaee. 1/952 Calculate prob of sequence of when two letters picked without replacement from {f: 2, o: 1, k: 1}. 1/6 Four letters picked without replacement from pjjjpp. Give prob of sequence pjjj. 1/20 Calculate prob of sequence cot when three letters picked without replacement from {c: 1, g: 1, t: 3, o: 2}. 1/35 Three letters picked without replacement from jdjdjdjdjjjdj. What is prob of sequence jdj? 70/429 Calculate prob of sequence vzv when three letters picked without replacement from zzzzzzzvzvvzzzzz. 13/560 What is prob of sequence boko when four letters picked without replacement from koyktyb? 0 What is prob of sequence ffff when four letters picked without replacement from ffffii? 1/15 Calculate prob of sequence bnm when three letters picked without replacement from bnbbbbbnmbbbmbmbb. 3/170 What is prob of sequence jv when two letters picked without replacement from {m: 2, v: 1, l: 1, o: 2, j: 2}? 1/28 Calculate prob of sequence jn when two letters picked without replacement from njfjjvfffn. 1/15 Three letters picked without replacement from lexelclllaxclleeee. Give prob of sequence xcc. 1/1224 Three letters picked without replacement from hxxddxpxdrdxx. Give prob of sequence prd. 1/429 Three letters picked without replacement from {x: 2, s: 2, o: 1, y: 1, m: 1, b: 1}. What is prob of sequence sso? 1/168 What is prob of sequence eeee when four letters picked without replacem	{ "pile_set_name": "DM Mathematics" }
rounded to the nearest ten thousand? 9230000 Round -52.866412 to the nearest integer. -53 What is -0.0023622935 rounded to 4 decimal places? -0.0024 Round -171.430782 to the nearest 10. -170 What is -7546168.757 rounded to the nearest 1000000? -8000000 Round 0.000927887244 to seven dps. 0.0009279 Round 0.357623754 to one decimal place. 0.4 Round 98551500 to the nearest 100000. 98600000 Round -387.892216 to the nearest one hundred. -400 What is 0.0071700056 rounded to 2 decimal places? 0.01 What is 0.0000042681333 rounded to seven dps? 0.0000043 What is -11153869 rounded to the nearest 10000? -11150000 Round 0.0000040274855 to 6 dps. 0.000004 Round 59989.431 to the nearest 1000. 60000 What is 22.838966366 rounded to 4 dps? 22.839 What is -0.07092376 rounded to 2 dps? -0.07 What is 2976.0141 rounded to the nearest ten? 2980 Round -0.0000412583754 to seven dps. -0.0000413 Round -18.91009008 to 3 dps. -18.91 What is -1024.32594 rounded to the nearest ten? -1020 What is -5371.3993 rounded to 0 decimal places? -5371 What is -6484.48633 rounded to the nearest integer? -6484 Round 348.157827 to zero decimal places. 348 What is 0.0179959152 rounded to 4 decimal places? 0.018 What is 1292432.68 rounded to the nearest 100000? 1300000 Round 0.326288587 to three decimal places. 0.326 Round -491825651 to the nearest ten thousand. -491830000 What is 1105717.52 rounded to the nearest 1000? 1106000 Round 0.216779952 to 2 dps. 0.22 Round 0.0021240956 to five decimal places. 0.00212 Round 0.003096874987 to five decimal places. 0.0031 Round -1113922321 to the nearest one million. -1114000000 What is -7932802 rounded to the nearest one thousand? -7933000 What is -0.14919417 rounded to 2 dps? -0.15 What is -10.561324292 rounded to one decimal place? -10.6 What is -0.00079891324 rounded to seven dps? -0.0007989 What is 0.010070184 rounded to three decimal places? 0.01 What is 285.5641151 rounded to the nearest one hundred? 300 Round 0.00773647939 to seven decimal places. 0.0077365 What is 0.0004059685891 rounded to seven decimal places? 0.000406 Round -121879451.09 to the nearest 1000000. -122000000 Round 188501.551 to the nearest one thousand. 189000 Round -279.8051667 to the nearest ten. -280 Round -2.2929712 to 2 decimal places. -2.29 What is -1.326729782 rounded to 2 decimal places? -1.33 Round -76.06731591 to one decimal place. -76.1 What is -27.0479833 rounded to one dp? -27 What is -0.760551329 rounded to 1 dp? -0.8 What is 0.55119227 rounded to one dp? 0.6 Round -0.1364729489 to two decimal places. -0.14 What is 22.8470938 rounded to the nearest integer? 23 What is 0.000001014592333 rounded to 7 decimal places? 0.000001 What is -5.935489561 rounded to four decimal places? -5.9355 Round -0.0748458 to 2 decimal places. -0.07 What is 65.1945384 rounded to 1 dp? 65.2 Round -58697185.32 to the nearest 1000000. -59000000 What is 0.280206493 rounded to 4 dps? 0.2802 Round -2382002080 to the nearest 1000000. -2382000000 Round 2.1232206 to four dps. 2.1232 What is 2927.21894 rounded to zero decimal places? 2927 Round -0.00038385572 to 7 decimal places. -0.0003839 Round -0.002660901622 to 7 dps. -0.0026609 Round -0.00003090776689 to 6 decimal places. -0.000031 What is -0.022345973 rounded to four dps? -0.0223 Round -0.16796402453 to 6 decimal places. -0.167964 What is -0.4665533728 rounded to three dps? -0.467 What is -58361227.5 rounded to the nearest one million? -58000000 What is -0.00000151246 rounded to 5 dps? 0 Round -0.0810038102 to 5 dps. -0.081 Round -8617.9431 to the nearest 100. -8600 Round 45863478990 to the nearest 1000000. 45863000000 Round -25975.98674 to the nearest one thousand. -26000 What is 0.000001794981 rounded to six dps? 0.000002 Round 59.704989 to 1 dp. 59.7 Round 0.05705871034 to 5 decimal places. 0.05706 Round 1344308.1058 to the nearest ten thousand. 1340000 Round -0.00117930109 to four decimal places. -0.0012 Round -19.974996 to 0 dps. -20 What is -0.01763895701 rounded to 2 dps? -0.02 Round 0.002999991 to three decimal places. 0.003 Round -0.02611444585 to five decimal places. -0.02611 What is 3570.91547 rounded to the nearest 100? 3600 Round 56.511841 to the nearest 10. 60 What is 0.0002296177184 rounded to seven decimal places? 0.0002296 Round 66.43417213 to the nearest integer. 66 Round -0.508464939 to 4 decimal places. -0.5085 What is 35029.09935 rounded to the nearest one thousand? 35000 What is -2601586.73 rounded to the nearest one hundred? -2601600 What is -1732382840 rounded to the nearest one hundred thousand? -1732400000 Round 17366.574 to the nearest 1000. 17000 What is -13141954.9 rounded to the nearest one hundred thousand? -13100000 What is 1001.5765 rounded to 0 decimal places? 1002 Round -981977.948 to the nearest one thousand. -982000 Round -15033192.73 to the nearest one thousand. -15033000 What is -211.6209556 rounded to three decimal places? -211.621 Round -0.00397643229 to 4 decimal places. -0.004 Round -0.226785745 to 2 dps. -0.23 What is 132.396169 rounded to the nearest ten? 130 Round -0.091997185 to 2 decimal places. -0.09 What is 0.00260862221 rounded to six decimal places? 0.002609 Round 7.3871498 to three decimal places. 7.387 Round 654.19251 to one dp. 654.2 Round 27499.33145 to the nearest one hundred. 27500 Round -286975696 to the nearest one million. -287000000 Round 3657972.26 to the nearest 10000. 3660000 Round 8709.251479 to the nearest ten. 8710 What is 354.82191 rounded to 2 decimal places? 354.82 What is -0.000084305848 rounded to seven decimal places? -0.0000843 What is 0.155420955 rounded to two dps? 0.16 What is -3089.6871 rounded to the nearest integer? -3090 Round 0.01214480154 to three decimal places. 0.012 What is 110.4059455 rounded to three decimal places? 110.406 What is -413512.66 rounded to the nearest 100? -413500 What is -3443348690 rounded to the nearest one million? -3443000000 What is -265227.77 rounded to the nearest 1000000? 0 Round 15867330.28 to the nearest one million. 16000000 Round 0.7336820566 to two dps. 0.73 What is -0.00000062406482 rounded to 7 dps? -0.0000006 What is 4722158.8 rounded to the nearest one million? 5000000 Round -28.95938628 to zero decimal places. -29 What is 1176455.49 rounded to the nearest one hundred thousand? 1200000 What is 53421.4799 rounded to the nearest 10? 53420 Round 45.348271 to one decimal place. 45.3 What is -105297245 rounded to the nearest 10000? -105300000 What is -0.888744461 rounded to two decimal places? -0.89 What is 128401.8334 rounded to the nearest 1000? 128000 What is 88724.7 rounded to the nearest one hundred? 88700 Round 143233.492 to the nearest one thousand. 143000 What is -38.10872146 rounded to one decimal place? -38.1 What is 18.143192 rounded to 0 decimal places? 18 Round -160308725 to the nearest 1000000. -160000000 What is 192.5248379 rounded to 0 decimal places? 193 Round -0.00007743078735 to five decimal places. -0.00008 Round -1.0646755497 to three dps. -1.065 What is 0.0000129791256 rounded to six decimal places? 0.000013 Round 0.00102473401 to 7 dps. 0.0010247 Round -11223743.82 to the nearest 100. -11223700 What is 3788377.8 rounded to the nearest 100? 3788400 What is -0.00016847154 rounded to 5 dps? -0.00017 What is 60993389550 rounded to the nearest 1000000? 60993000000 What is -9409.63659 rounded to zero dps? -9410 Round -38473348 to the nearest one hundred thousand. -38500000 What is 0.025234804 rounded to 5 dps? 0.02523 What is 6076390.44 rounded to the nearest 1000000? 6000000 What is 5808.5005 rounded to the nearest one hundred? 5800 What is 177158.711 rounded to the nearest 1000? 177000 What is 997.00687 rounded to the nearest ten? 1000 Round -682165.7 to the nearest one thousand. -682000 Round 0.0000193006871 to 7 dps. 0.0000193 What is 0.0000681070725 rounded to five decimal places? 0.00007 Round -0.00000705598221 to six decimal places. -0.000007 What is 0.00641070069 rounded to three decimal places? 0.006 What is 9705.1879 rounded to 0 decimal places? 9705 What is 2326.031085 rounded to the nearest one hundred? 2300 What is 77744060 rounded to the nearest one million? 78000000 Round -3290777724 to the nearest one hundred thousand. -3290800000 Round 0.008800997324 to five dps. 0.0088 Round 21130.908	{ "pile_set_name": "DM Mathematics" }
2 - 6a + 28. Determine t(-9). 1 Let b(z) = 210z - 1047. Give b(5). 3 Let l(v) = v3 - 10v*2 - 19v + 248. What is l(9)? -4 Let m(y) = -263y + 530. Calculate m(2). 4 Let o(i) = -145i - 1445. Determine o(-10). 5 Let v(a) = -61a2 + 2a + 2. What is v(-1)? -61 Let m(t) = 4t - 7. Calculate m(3). 5 Let x(y) = -y2 - 22y + 3. Give x(-24). -45 Let p(m) = m*3 - 3m2 + m - 6. Give p(3). -3 Let v(l) = l2 - 6l - 5. Determine v(-4). 35 Let f(v) = -2v*3 - 13v*2 - 3v - 7. What is f(-6)? -25 Let s(v) = v*2 + 13v + 9. Calculate s(-11). -13 Let x(b) = 19b2 + b - 1. What is x(2)? 77 Let y(h) = h3 - 2h - 3. Calculate y(-2). -7 Let r(s) = -2s - 5. Give r(-5). 5 Let n(m) = 2m*2 - 29m - 22. Determine n(15). -7 Let l(s) = -3s + 11. Calculate l(5). -4 Let x(z) = 2z + 14. Give x(-2). 10 Let s(j) = 5j - 4. Give s(0). -4 Let q(m) = -62m*2 + 2m + 1. Calculate q(-1). -63 Let p(b) = -b*3 - 14b*2 - 13b + 12. Determine p(-13). 12 Let t(h) = -h*3 + 12h*2 - 7h - 38. Calculate t(11). 6 Let q(p) = -5p - 8. Give q(-3). 7 Let s(t) = t3 + 6t*2 - 16t + 10. Calculate s(-9). -89 Let j(o) = o*3 - 19o*2 + 6. What is j(19)? 6 Let l(i) = 7i*2 + 20i + 12. What is l(-2)? 0 Let s(t) = t*2 - 24t + 93. What is s(17)? -26 Let z(h) = -h*2 + 4h + 9. Calculate z(6). -3 Let z(r) = -r*3 + 22r*2 - 40r + 7. What is z(20)? 7 Let n(v) = v*3 + 32v*2 - 34v - 21. Give n(-33). 12 Let b(q) = 2q3 - 5q*2 + 2q - 1. Calculate b(3). 14 Let u(n) = n*2 + 2n - 4. Give u(-5). 11 Let u(n) = n*3 - 6n*2 + 8n - 4. Calculate u(3). -7 Let d(j) = -j + 26. What is d(-23)? 49 Let u(b) = -4b - 43. Give u(-10). -3 Let m(t) = -13t + 81. Calculate m(13). -88 Let i(h) = -21h. Calculate i(3). -63 Let d(x) = x2 + 19x + 13. Determine d(-17). -21 Let u(a) = -a*2 + 5a + 2. Determine u(6). -4 Let r(w) = -8w2 + 86w + 21. Determine r(11). -1 Let c(m) = -m*2 + 16m + 13. Calculate c(17). -4 Let b(q) = -q*3 + 2q*2 - 4q + 1. Determine b(4). -47 Let d(f) = -f*2 - 13f + 5. Determine d(-13). 5 Let u(g) = 2g - 3. Give u(-8). -19 Let z(o) = 6o + 12. Determine z(-2). 0 Let a(p) = -3p - 1. Give a(1). -4 Let t(r) = r3 + 23r*2 + 41r - 16. Determine t(-21). 5 Let w(c) = -c*3 + 16c*2 - 16c + 17. Calculate w(15). 2 Let r(v) = -v*3 - 20v*2 + 19v - 39. Determine r(-21). 3 Let l(t) = -t*3 - 4t*2 - 4t - 2. Give l(-5). 43 Let x(z) = -z3 - z2 - 6. Give x(0). -6 Let j(d) = -d + 4. Calculate j(-1). 5 Let w(j) = 6j + 150. Calculate w(-24). 6 Let n(a) = -4a + 46. What is n(11)? 2 Let i(u) = 2u - 11. What is i(6)? 1 Let t(j) = -2j2 + j + 2. Calculate t(2). -4 Let y(b) = -b3 + 17b2 - 17b + 30. Determine y(15). 225 Let t(v) = -v. Calculate t(-8). 8 Let b(n) = -n*3 - 19n*2 - 35n - 16. What is b(-17)? 1 Let s(t) = 2t2 + 6. Give s(0). 6 Let k(c) = -c3 - 2c + 6. Give k(3). -27 Let j(a) = -a*2 + 9a - 2. Determine j(8). 6 Let c(t) = -8t3 + 2t*2 - 2t - 2. Give c(-2). 74 Let p(m) = -m*2 - 29m + 2. Determine p(-29). 2 Let d(r) = -4r3 - r2 + 2r + 1. Determine d(-2). 25 Let m(z) = 13z - 2. Give m(1). 11 Let h(k) = -7k - 8. Calculate h(-4). 20 Let r(u) = -u*3 + 8u*2 + 6u + 17. What is r(9)? -10 Let o(l) = -l*3 - 15l*2 - 25l + 22. Determine o(-13). 9 Let x(z) = -z*3 - 6z*2 + 3z + 11. Calculate x(-6). -7 Let b(a) = -2a3 - 11a*2 - 11a + 7. What is b(-6)? 109 Let z(m) = m*2 + 8m + 2. Give z(-8). 2 Let r(d) = -33d - 498. Calculate r(-15). -3 Let d(v) = v3 - 6v2 + v. Determine d(4). -28 Let c(l) = l2 + l + 28. Determine c(6). 70 Let o(z) = z*3 - 4z*2 - 4z - 11. Determine o(5). -6 Let c(b) = -b*2 + 9b + 6. Determine c(10). -4 Let q(m) = 3m - 8. Calculate q(6). 10 Let k(x) = -x2 + 8x - 9. Determine k(9). -18 Let p(v) = v*3 + 2v*2 + 2v + 14. Determine p(-3). -1 Let n(t) = t*2 - 42t + 332. Determine n(11). -9 Let o(p) = 6p + 25. Calculate o(-13). -53 Let i(u) = -u2 + 13. Determine i(-3). 4 Let m(y) = 4y - 87. What is m(23)? 5 Let t(q) = -5q3 + q2 - q - 1. Determine t(-1). 6 Let l(z) = z3 - 7z*2 - 7z + 3. Calculate l(8). 11 Let m(r) = r*2 + 16r - 12. Give m(-19). 45 Let z(q) = -21q - 167. What is z(-8)? 1 Let s(a) = a3 + 7a*2 + 5a - 12. Give s(-6). -6 Let u(h) = -6h - 68. Calculate u(-15). 22 Let t(y) = 2y + 8. Determine t(-9). -10 Let k(j) = j*3 + 5j*2 - 11j + 9. Calculate k(-7). -12 Let w(t) = -t3 - t2 + 7t + 8. Calculate w(-4). 28 Let d(q) = q2 - q - 22. What is d(0)? -22 Let f(w) = w2 - 10w + 25. Give f(10). 25 Let k(u) = -7u2 - 4u + 1. What is k(-2)? -19 Let l(m) = -m*3 - 19m*2 + 25m + 72. Determine l(-20). -28 Let y(x) = x*2 - 23x + 85. What is y(19)? 9 Let w(j) = j*3 + 31j*2 + 5j + 145. Determine w(-31). -10 Let g(i) = i*3 + 7i*2 - 9i - 9. What is g(-8)? -1 Let r(g) = 7g - 37. Determine r(3). -16 Let b(z) = -31z + 45. What is b(1)? 14 Let d(b) = b*2 - 4b - 3. Give d(-2). 9 Let c(y) = y*3 - 3y2 + y - 1. What is c(3)? 2 Let m(g) = g3 - 6g2 + 12g - 21. Give m(3). -12 Let d(g) = -5g + 13. Calculate d(9). -32 Let d(v) = 2v*2 + 4v. Give d(-3). 6 Let d(x) = -6x + 129. Determine d(23). -9 Let w(x) = 7x - 24. Give w(2). -10 Let i(z) = -40z2 - 3z - 1. What is i(-2)? -155 Let u(g) = -11g2 + 3g. Give u(-1). -14 Let y(q) = 3q3 - 22q*2 + 2q + 16. Calculate y(7). -19 Let y(g) = -g*3 + 12g*2 - 7g - 23. Give y(11). 21 Let i(r) = r*2 - 7r - 13. Give i(10). 17 Let v(g) = -g*2 - 5g - 5. Determine v(-4). -1 Let c(q) = -3q + 146. Calculate c(49). -1 Let t(m) = m2 - 39m + 316. Give t(11). 8 Let s(y) = -19y + 30. Determine s(6). -84 Let o(i) = -i3 + 17i*2 - 59i - 14. What is o(12)? -2 Let p(b) = -b - 4. Calculate p(-10). 6 Let s(r) = -r*3 + 7r*2 - 4r - 6. Calculate s(6). 6 Let u(x) = x*2 + 15x - 11. Calculate u(-16). 5 Let l(a) = -35a + 214. What is l(6)? 4 Let g(x) = x2 + 20x + 81. Give g(-11). -18 Let o(t) = 3t + 50. Calculate o(-11). 17 Let h(j) = -6j. Determine h(2). -12 Let p(n) = -13n + 18. Calculate p(1). 5 Let a(s) = -11s + 13. Determine a(6). -53 Let p(y) = 2y + 9. Give p(3). 15 Let o(m) = m3 + 10m*2 - m - 8. Determine o(-10). 2 Let y(s) = -91s*2 - 3s. Determine y(-1). -88 Let l(d) = -22d2 + d - 1. What is l(1)? -22 Let q(c) = c3 + 5c2 + c + 4. Determine q(-5). -1 Let x(b) = -b2 + 9b + 7. Give x(8). 15 Let u(l) = l2 + 4l - 19. Give u(-7). 2 Let c(r) = -r*2 + 12r - 34. Give c(4). -2 Let r(l) = 7l + 90. What is r(-14)? -8 Let q(i) = 3i + 11. Determine q(-6). -7 Let d(h) = -h*3 - 5h*2 - 4h - 4. What is d(-4)? -4 Let s(j) = j*2 - 2j + 5. What is s(4)? 13 Let b(h) = h*3 + 3h*2 - 6h. Give b(-5). -20 Let c(f) = f2 - 27. Determine c(5). -2 Let t(p) = -p3 - 18p2 - 16p + 21. Calculate t(-17). 4 Let m(d) = -d + 25. Give m(11). 14 Let q(k) = 3k2 + 22k + 9. What is q(-8)? 25 Let c(q) = q*3 - 3q*2 - 4. Determine c(5). 46 Let u(q) = 2q + 12. What is u(-10)? -8 Let n(a) = -a*3 + 6a*2 + 11a - 15. Give n(7). 13 Let j(z) = 6z3 - 3z*2 + 7z - 5. Determine j(2). 45 Let t(o) = o*3 - 3o*2 - 2o + 1. Determine t(2). -7 Let j(c) = -2c2 - 21c - 51. Give j(-6). 3 Let k(x) = 3x2 + 2x - 2. What is k(4)? 54 Let o(z) = -2z2 - 13z + 23. Calculate o(-7). 16 Let k(i) = -i*3 - 5i*2 - 6i - 5. What is k(-4)? 3 Let g(a) = -60a + 1. Give g(-1). 61 Let m(v) = -v2 - 21v - 109. Determine m(-11). 1 Let k(f) = 7f3 - 3f*2 - 5f + 6. Calculate k(2). 40 Let j(y) = 2y2 + 10y + 9. Determine j(-4). 1 Let o(b) = -2b + 7. Give o(3). 1 Let o(d) = -d3 - 4d*2 + 6d - 1. What is o(-5)? -6 Let a(u) = u*2 + 42u - 44. What is a(-43)? -1 Let y(b) = 3b + 22. Determine y(-9). -5 Let m(i) = 3i + 80. Give m(-30). -10 Let o(b) = -5b + 9. Determine o(8). -31 Let u(m) = -m3 - 23m*2 + 24m - 46. Determine u(-24). -46 Let z(d) = -5d + 12. Calculate z(5). -13 Let t(g) = 2g2 - g + 1. Give t(1). 2 Let h(x) = x - 5. What is h(10)? 5 Let u(s) = s2 - 2s - 7. What is u(5)? 8 Let g(r) = -4r - 16. Calculate g(0). -16 Let w(p) = -3p2 + 6p + 8. Give w(-4). -64 Let g(s) = -2s2 + 31s + 1. Determine g(15). 16 Let a(n) = 3n + 15. Determine a(-15). -30 Let h(m) = 21m*2 - m - 1. Calculate h(-1). 21 Let j(o) = 2o**2 + o + 2	{ "pile_set_name": "DM Mathematics" }
67 (base 14) to base 9 -50020 What is -185 (base 13) in base 7? -545 -310 (base 5) to base 13 -62 -34346 (base 7) to base 4 -2020310 What is -e053 (base 15) in base 8? -134340 -304004 (base 5) to base 16 -2697 Convert 2483 (base 9) to base 8. 3501 3300 (base 8) to base 11 1331 What is -25417 (base 9) in base 4? -10023103 What is -14636 (base 7) in base 3? -12121122 What is 3321413 (base 5) in base 7? 330214 What is -12a8 (base 11) in base 7? -4634 Convert -a022 (base 13) to base 16. -55ee Convert 2430034 (base 5) to base 16. b24c Convert -bc8a (base 14) to base 6. -411110 -1240 (base 7) to base 4 -13111 What is 620 (base 14) in base 11? 9a5 18a22 (base 12) to base 10 36026 What is 45133 (base 6) in base 12? 37a9 Convert 15791 (base 10) to base 3. 210122212 What is -25595 (base 10) in base 11? -18259 What is -626a (base 11) in base 16? -2070 What is 114 (base 11) in base 10? 136 Convert -1300 (base 8) to base 4. -23000 -e2 (base 15) to base 16 -d4 21140 (base 8) to base 9 13057 What is -10c3 (base 16) in base 15? -1411 Convert 598 (base 13) to base 4. 33022 What is 3202134 (base 5) in base 15? 10c64 -6a89 (base 11) to base 13 -42cb Convert 3685 (base 9) to base 6. 20422 What is -16213 (base 9) in base 2? -10101101100101 What is 7132 (base 13) in base 16? 3ce5 What is -11110000100101 (base 2) in base 7? -62614 Convert 24014 (base 5) to base 3. 2102011 What is -12a8 (base 15) in base 10? -3983 What is 2323 (base 5) in base 14? 1a2 Convert -472 (base 9) to base 12. -285 Convert 2745 (base 8) to base 9. 2056 -30d (base 15) to base 11 -576 -ab (base 13) to base 7 -261 What is -253 (base 15) in base 5? -4103 410035 (base 6) to base 9 48425 What is 401530 (base 6) in base 13? 11466 11223 (base 5) to base 16 32d 12322131 (base 4) to base 13 cb73 Convert -274 (base 8) to base 5. -1223 What is 1020012022 (base 3) in base 5? 1233300 40155 (base 6) to base 13 2513 4014 (base 5) to base 7 1325 What is -222010 (base 4) in base 11? -2028 861 (base 12) to base 15 56a What is -5909 (base 12) in base 15? -2e30 Convert -2505 (base 8) to base 6. -10125 What is -24a6 (base 11) in base 9? -4424 Convert -403 (base 10) to base 9. -487 Convert -810 (base 11) to base 2. -1111010011 What is -101111001 (base 2) in base 10? -377 What is -362 (base 13) in base 15? -292 Convert 37a (base 15) to base 12. 55a What is -252 (base 14) in base 13? -299 -1202222 (base 3) to base 13 -788 Convert 1111110111 (base 2) to base 10. 1015 Convert -100111001011111 (base 2) to base 15. -5e28 Convert 32200 (base 5) to base 10. 2175 What is -1110022 (base 3) in base 16? -425 Convert -10101001100 (base 2) to base 13. -804 25474 (base 9) to base 16 4306 1060 (base 7) to base 10 385 Convert -10c4 (base 14) to base 8. -5544 Convert -192e (base 15) to base 2. -1010101000100 What is 1211220 (base 3) in base 12? 943 Convert -11251 (base 6) to base 7. -4465 Convert 899 (base 14) to base 16. 6a7 Convert 2e (base 15) to base 3. 1122 -100011101010010 (base 2) to base 16 -4752 -11046 (base 7) to base 14 -1026 -7e (base 15) to base 13 -92 Convert 5357 (base 8) to base 11. 2115 26031 (base 8) to base 7 44625 -10c8 (base 13) to base 10 -2361 Convert 4196 (base 12) to base 16. 1c02 1000101001101 (base 2) to base 6 32301 What is -10001100 (base 2) in base 4? -2030 Convert -34430 (base 5) to base 6. -15310 a0d3 (base 16) to base 8 120323 Convert 240 (base 12) to base 6. 1320 What is 11000001 (base 2) in base 16? c1 -53157 (base 8) to base 15 -6852 -4040 (base 7) to base 11 -1063 What is 4334121 (base 5) in base 3? 10202220100 What is 11260 (base 7) in base 11? 2192 Convert -200220101 (base 3) to base 6. -143444 What is -4c4 (base 13) in base 2? -1101000100 -200 (base 11) to base 2 -11110010 22846 (base 9) to base 4 3232212 Convert -26410 (base 10) to base 3. -1100020011 What is 516 (base 14) in base 7? 2626 What is 22069 (base 11) in base 8? 76423 What is -1111100 (base 2) in base 8? -174 257 (base 10) to base 5 2012 234554 (base 6) to base 8 50046 Convert 1021232 (base 4) to base 3. 20110202 What is -2826 (base 10) in base 5? -42301 b3 (base 12) to base 9 160 -27b (base 16) to base 6 -2535 Convert -23001 (base 5) to base 4. -121122 -5a4 (base 12) to base 7 -2314 What is -1000330 (base 4) in base 9? -5627 Convert -1243322 (base 6) to base 16. -10a42 Convert -3824 (base 9) to base 2. -101100101001 What is 221102200 (base 3) in base 11? 12a25 100101 (base 6) to base 9 11641 -1893 (base 15) to base 16 -14c1 8cd (base 16) to base 14 b6d What is 153100 (base 6) in base 4? 3221130 -952 (base 13) to base 12 -b04 Convert 1023 (base 7) to base 11. 2a8 Convert 101002101 (base 3) to base 2. 1110010111010 Convert 4443 (base 8) to base 15. a5e Convert 23000 (base 4) to base 8. 1300 What is 1141453 (base 6) in base 9? 101276 What is -3588 (base 10) in base 8? -7004 242212 (base 7) to base 6 535431 -1a75 (base 12) to base 10 -3257 Convert 532211 (base 6) to base 8. 124417 -1487 (base 12) to base 11 -1899 What is -1d8 (base 14) in base 12? -282 Convert 3847 (base 12) to base 2. 1100011110111 Convert -223 (base 10) to base 7. -436 -1bbc9 (base 13) to base 11 -38155 What is 100111110100101 (base 2) in base 12? b971 -920 (base 10) to base 14 -49a -112 (base 3) to base 12 -12 -1321 (base 5) to base 2 -11010011 What is 1110000010110 (base 2) in base 9? 10768 1100100 (base 2) to base 12 84 3220 (base 5) to base 11 366 c3e (base 15) to base 4 223013 9192 (base 11) to base 4 2332221 1102123 (base 4) to base 8 12233 What is -1011101110011 (base 2) in base 14? -228b Convert -e17 (base 16) to base 11. -278a Convert -3004 (base 5) to base 15. -1a4 Convert 53354 (base 9) to base 4. 20213110 Convert 638 (base 12) to base 13. 54b What is 141 (base 6) in base 7? 115 Convert -1250 (base 15) to base 12. -2310 -10010202000 (base 3) to base 6 -1154000 Convert b1b5 (base 15) to base 6. 445412 5a61 (base 11) to base 10 7932 Convert 6015 (base 8) to base 6. 22141 What is 115 (base 13) in base 6? 511 What is -515 (base 10) in base 15? -245 What is -1468 (base 12) in base 15? -a8e What is 112200020 (base 3) in base 2? 10100111001010 4b0 (base 12) to base 3 222020 -2160 (base 13) to base 6 -33253 224101 (base 5) to base 3 102000021 Convert 12131 (base 4) to base 5. 3123 2457 (base 13) to base 16 1416 Convert -110010101010 (base 2) to base 8. -6252 What is 194 (base 15) in base 8? 554 What is 610 (base 8) in base 14? 200 2001133 (base 4) to base 8 20137 10948 (base 12) to base 15 6828 -46081 (base 9) to base 13 -10c7b What is -302 (base 10) in base 14? -178 Convert b52 (base 14) to base 6. 14152 Convert 1817 (base 10) to base 2. 11100011001 502 (base 6) to base 2 10110110 Convert 11156 (base 14) to base 11. 29146 353 (base 12) to base 7 1305 224344 (base 5) to base 8 17643 Convert -624 (base 11) to base 4. -23300 What is 13030030 (base 4) in base 9? 44354 1716 (base 8) to base 4 33032 Convert 437a (base 12) to base 5. 214223 What is 312031 (base 5) in base 16? 281a What is 11010000101110 (base 2) in base 16? 342e Convert -147a1 (base 13) to base 3. -1222000222 Convert -141 (base 11) to base 8. -246 What is 1014055 (base 6) in base 11? 33780 Convert -13d (base 14) to base 7. -506 -922 (base 13) to base 16 -60d -449 (base 10) to base 15 -1ee What is 1101111110111110 (base 2) in base 14? 16c34 1101022 (base 3) to base 15 472 What is 723 (base 8) in base 10? 467 -90a (base 14) to base 6 -12114 Convert 3246 (base 8) to base 11. 1308 6152 (base 8) to base 15 e1d What is -228 (base 13) in base 10? -372 What is -10100010000111010 (base 2) in base 16? -1443a 1570 (base 9) to base 16 4ad 4055 (base 7) to base 16 584 Convert -495a (base 11) to base 15. -1dbd What is -1cf (base 16) in base 10? -463 -ad1 (base 16) to base 13 -1350 -1b15 (base 14) to base 9 -6665 214441 (base 6) to base 10 17881 What is -13471 (base 14) in base 3? -2102012102 Convert -10010012 (base 3) to base 9. -3105 203 (base 9) to base 15 b0 Convert -22a (base 11) to base 9. -334 What is -103002213 (base 4) in base 15? -18196 Convert 805 (base 11) to base 7. 2560 -15056 (base 7) to base 6 -31125 What is 17287 (base 9) in base 5? 340110 111211 (base 3) to base 13 229 -2201012 (base 3) to base 13 -b90 -7aa1 (base 12) to base 14 -4d97 Convert -33104 (base 10) to base 15. -9c1e Convert 5503 (bas	{ "pile_set_name": "DM Mathematics" }
394 + -234. Let c = 163 - n. Solve hx - 2q + 11 = 0, -3x = x - cq + 13 for x. -1 Let l be 1617/154 + (3 + 5/(-10))-1. Solve -15s + 8 = -16s - 3i, -3s - i = l for s. -2 Suppose -4y = 3a - 34 + 6, 4a = 4y. Solve -g = -2h - 4g - 5, -ag = 4h for h. 5 Suppose 3i - 234 = -3b + 306, 4b - 723 = -3i. Let u = -178 + b. Solve -o = c - u, o - 5c + 23 = 4o for o. 1 Let s be 3 + 18/(-2) - (-7 - -8)-31. Solve 3l - l + s = 5t, -3t = l - 15 for l. 0 Let z(y) = -4y*2 + 301y + 256. Let u be z(76). Solve -3c - 13 = -5q, u = 4q + 5c - 12 for q. 5 Let t = -55 - 135. Let v be 38/t + 202/10. Solve 5g + v = d, 8g - 4d + 20 = 3g for g. -4 Let k be 228/380 + (-7)/(-5). Let i be (k/36 - (-1)/6)9. Solve 0 = -2a + 5v + 22, ia = -3v + 4v + 6 for a. 1 Suppose -2z - 2z + 2w - 1626 = 0, -2w = -2. Let p = z + 408. Solve pg + 2 = v, -v + 6v = 0 for g. -1 Suppose 23p = 293 + 6. Solve g = 3u - p, -3u - 6 + 3 = 3g for g. -4 Suppose 3y = -2b + b + 10, -2b = 2y - 24. Let a = 2575 - 2570. Solve 0k = 3k + w + b, ak + w = -21 for k. -4 Let y be (-1 - (-4)/(-3))/((-30)/90). Suppose -16h = -yh - 36. Solve -5x + hl - 27 = 0, 5x = 2l - 13 - 8 for x. -3 Let j be -3 + (-8)/(-20)20. Solve 2t - 3 + 13 = 2m, -m = jt - 5 for m. 5 Let v = -12 - -21. Suppose 0 = a + h + 40 - 38, 4h + 35 = 5a. Solve 0 = -5n - 2f + v + 6, an = -3f + 9 for n. 3 Let o(x) = -x3 + 12x*2 - 8x - 7. Let v be o(11). Solve 5j = -2h - v, 3h = 4j + 4 + 3 for h. -3 Suppose 2f + 12 = 5f. Let a = 86 + -79. Let h(v) = -v*3 + 8v*2 - 9v + 17. Let r be h(a). Solve -fd + 2z - 5 = z, -d + rz = 4 for d. -1 Let w be 48(-270)/(-576). Solve -7v - 3x = 9, 9 = -v + 2x + w for v. 0 Suppose 27h - 31h = -3v + 125, -5v + 155 = 4h. Solve 3z + v = -3u - 2z, -32 = 4u + 3z for u. -5 Let t = 56 - 8. Suppose -c - 11c + t = 0. Solve -4u = b - c, 2u - 2b + 8 = -3u for u. 0 Let h = -6 - -10. Suppose -10 = -z - 4w - 22, 3 = -2z - w. Suppose zj + 8 = 4j. Solve 11 = -c - hy, -c - jy - 10 = c for c. -3 Suppose 2m + 2o = m + 4, 4o + 20 = 5m. Suppose 5p - q = 9, -3p - 3 = 13q - 15q. Solve -mk - 7 = -2t - t, 2k - 1 = -pt for k. -1 Let f be (-1)/((-3)/(-2))138. Suppose -99 = -2d - 3c, 5d - 240 = -c - 4c. Let b be (-10)/d + f/(-9). Solve -m - m = -2z, -3z - b = -m for z. -5 Let w = -17351 - -17354. Solve -2t = u - 4, t - 6t = -wu - 43 for t. 5 Let j = 58 - 58. Suppose j = 5c + 14 - 34. Suppose -2a = 4i - 22, -ci + a = -5i + 7. Solve -2h = -3h - 4q - 9, -12 = iq for h. 3 Suppose -82 = 12o - 214. Suppose 0 = 4x + x - 80. Suppose og - xg = -40. Solve 8 = -ga + 3a - 2h, 5a = -h - 9 for a. -2 Let d(j) = -2j + 4. Let y be d(-7). Suppose -27w + y = -24w. Suppose wc = -c + 35. Solve -2v = 10, 0p + 5 = cp - 5v for p. -4 Let d = 67 + -63. Let y be (((-800)/(-30))/(-8))/(d/(-6)). Solve 2i - 4q - 18 = 0, 4 = -yi - 3q - 3 for i. 1 Let m be 6 + 35/(-7) + 2. Solve 21 = -3k - 5p, 4k - mp - p - 4 = 0 for k. -2 Let h(i) = -2i3 + 46i*2 - 4i + 96. Let u be h(23). Solve 21 = -3w - 5z, -z = -5w - 3 - u for w. -2 Let w be (6 + -3 - -12)39/65. Suppose -4d - 10 = -wd. Solve -4b - b - 4 = -4o, 0 = db for o. 1 Let f be 3/((-4)/(-28)3). Suppose -ft = -10t. Let o = -684 + 687. Solve 0 = 4q - 2y - 8, t = -oy - 2y + 20 for q. 4 Let a = -32 - -18. Let k be (-28)/(-6) - a/(-21). Suppose 4f - 2f = -kf. Solve fz - 4z - 19 = d, -4z - 16 = 0 for d. -3 Suppose 5t + 8 = n + 28, 8t - 18 = 3n. Solve p + 7 = 0, 77u - n = 79u + 2p for u. 2 Suppose -5d - 2m = -5 - 7, 2d = -2m. Let b = -17 - -45. Suppose 0 = 5t - x - b, 3x = -3t + 5t - 19. Solve tj = 2g - 3 - 9, dg = -2j for j. -2 Let p be 1/(12 + (-826)/70). Solve 69 = pc + 2o + 52, 0 = 2c - 4o - 2 for c. 3 Let l = -62 + 53. Let t be ((-87)/l)/(5/15). Let s = 11 + -6. Solve 5c + k - t = 0, sc - 9 = 5k - 4 for c. 5 Suppose 108 = -796v + 850v. Solve h - s = 2s, -4s = -vh for h. 0 Let c = -14668 - -14673. Let j = -2 - -9. Solve 0 + 1 = 4a - 3u, -ca + u - j = 0 for a. -2 Suppose -4h = 4b + 8, 52b - 48b - 32 = 4h. Solve 3r + 110f + b = 105f, -4 = 4r - 5f for r. -1 Let p be -21(7 + (-220)/28). Solve -2v + 0v + p = 4c, -3c - 4v = -16 for c. 4 Let j(x) = 17x + 184. Let r be j(-7). Let p = r - 65. Solve 0y - 2y - f + 12 = p, -f = -y + 3 for y. 5 Let t(o) = -o*3 + 10o*2 + 9o - 16. Let m be t(11). Let p = m - -32. Let l be (-33)/(-2) + 1/p3. Solve 20 = -5r - 2s, -4r = -s - 0s + l for r. -4 Suppose -4o = 148 + 564. Let m = o - -180. Let r be 2/5 - (-8)/5. Solve 2k - rg = 10, -mg + 3g = 3k - 15 for k. 5 Suppose 5y = 3k + 8, 0 = -0k - k + 4. Let o = 0 + 2. Suppose oj + j = 0. Solve -2m = yr - 22, r - 7m + 2m + 22 = j for r. 3 Let b(c) = -c2 - 11c + 434. Let o be b(16). Solve -5y = 4z - 14, 12z - 3 = -oy + 13z for y. 2 Suppose -16 = -4j + f, 5j - 19 = -5f + 6f. Suppose -12 - j = -5w. Suppose wk - 48 = -36. Solve -2r = -5g - r + 5, 0 = -g + kr - 18 for g. 2 Let x = -88 - 67. Let w = -152 - x. Solve 0 = -wv + 5f - 2f + 6, -5f = -v - 6 for v. 4 Let d(k) = -514k + 5656. Let j be d(11). Let q be (58/(-8))/(1/(-4)). Solve -jn = 3v + 23, 4n + 7 = -4v - q for n. -4 Let n(m) = 2m*2 - m + 1. Let h be n(-2). Suppose -24x - 4x + 56 = -0x. Solve i - g - 7 = 4i, h = -5i - xg for i. -3 Suppose -10 = -4w + 22. Suppose wk - 10 = 3k. Suppose ky + 6 = 30. Solve -5z - y = 4a, 0 = 4a - 2a - 3z - 16 for a. 2 Suppose 0 = 2k + 2k. Solve k = 5m + 4x - 6, 2x - 6x + 18 = -m for m. -2 Let y(w) = -w*3 - 2w*2 - 41w + 112w - 75w - 17. Let z be y(-4). Solve -5l + 4d - 2d - z = 0, 5l = -d - 22 for l. -5 Suppose 34q - 3j = 39q + 10, 19 = 4q - 3j. Solve -b = y - 4, 2y - 15 + q = -4b for b. 3 Suppose 0 = -0o - 2o + 38. Suppose -4v - 3 + o = 0. Let z be ((-3)/9)/(2/(-36)). Solve 4a + 14 = -2i, -a = vi - zi - 9 for a. -1 Let l be ((-21)/(-14))/(3/10). Solve -4r + 3r - 9 = -lm, 15 = -5r - 5m for r. -4 Let p = -1851 + 1854. Let w = 5 + -1. Suppose u - wu = -42. Solve -4r - u = 2s, 4 = 5s + pr - 6r for s. -1 Let t = -2059 - -2078. Solve 0 = -2c + 5w + 19, 4c - c + 2w = -t for c. -3 Let d(k) = k3 + 5k*2 - 3k - 18. Let v be d(-2). Solve -2h + s + 4 = v, -2h = -h + 3s - 2 for h. 2 Let q be (16/5 - 4)-5. Suppose 0 = -4b + u + 17, 19 + 1 = -qu. Suppose 15a = -6 + 96. Solve 5r + bg = 2g - 4, r = 5g - a for r. -1 Suppose 0 = -438a + 435a - 165. Let x be a/(-15) - 3/(-9). Solve -4 = -b - 2l, -4b + b = -xl + 18 for b. -2 Let b(z) = -14z + 118. Let d be b(-16). Let c = d - 338. Solve -2i = -5l + 11, i - cl + 18 = 8 for i. 2 Suppose 0u - 255 = -7u - 241. Solve 22t = 17t + 3x + 12, ut + 3x = 9 for t. 3 Let i be 10/2 - (-9 - 11). Solve -i = 5o + 5g - 2g, -2o + 3g = -11 for o. -2 Suppose 13p - 8p = 45. Suppose 0o = o + p. Let r(u) = -u3 - 7u*2 + 18u. Let i be r(o). Solve i = -3z + 5n, -2z + 1 = -4n - 1 for z. -5 Let q = -91 - -193. Let l = -96 + q. Suppose 5s - 45 = -2h, 3s + 0h = 3h + l. Solve 0 = -3p + 3, -4i - 3p = -si for i. 1 Let a(r) = r + 3. Suppose 60 - 55 = 5p. Let z be a(p). Solve j + zb = -2j + 17, 2j + 3b = 12 for j. 3 Let s(f) = f*2 + 10f + 97. Let a be s(0). Suppose -106d = -ad - 72. Solve 4v + 3c - d = 5, -5 = -2v - 3c for v. 4 Let r be 2110 + 82 + -86. Let i be (-24)/r4/(-2). Solve -id + 2a = 6a + 13, -10 = 3d + a for d. -3 Let c be ((-50)/(-6))/(965/579). Solve -3z - 4q - 16 = 19, -2z = -cq - 15 for z. -5 Suppose 4a + 2m - 32 = 0, -2 = a - 3m + 4. Let g(l) = -l - a - 4 + 3. Let b be g(-12). Solve 3h + 2h = y - 15, -5y + 15 = -bh for h. -3 Suppose 7u + 3363 = 1235. Let i = 309 + u. Solve 0 = -ib + m - 6m + 15, -2b + m = -12 for b. 5 Suppose -s = s + 66. Let r = s - -34. Suppose -18 = -4u - t, -4u = 4t - 23 + 11. Solve r = -4l - 4k - 3, 3 = -3l + uk for l. -1 Let w(b) = 3b - 21. Let h = 29 + -22. Let z be w(h). Suppose -3g = 2k - zk, 0 = -4g - 2k. Solve g = -4r + 2q - 24, 4q = -3r + q for r. -4 Let q(j) = -6j3 - j2 + j + 1. Let o be q(-1). Suppose -d = 12d - 52. Solve 5l = o, 5l + d = -g + 4l for g. -5 Suppose -4m + 2p + 50 =	{ "pile_set_name": "DM Mathematics" }
- 4s + 31 = 0, 36f = 38f - 5s + 10 for f. 5 Solve -8 = 9h + 5d, h + 40d - 4 = 37d for h. -2 Solve -3a - 5b - 29 = 0, 304b = -a + 299b + 7 for a. -18 Solve -4b = -4a - 3b, 0 = a + 3b + 13 for a. -1 Solve 2p - 11 = y, -p + 19114y = 19112y - 13 for p. 3 Solve -1122 = -4w + 2m - 1132, -2w - 3m - 9 = 0 for w. -3 Solve 30g - 25g = -k - 1, -10g = 0 for k. -1 Solve 0 = c - 1, 0 = -3n - 389c + 392c + 27 for n. 10 Solve -10 = -2t + g, 5g = 909t - 913t + 20 for t. 5 Solve j + 12 = -x + 6, 2j = -x - 10 for j. -4 Solve 0 = 4r - 2d - 24, 636r - d = 633r + 19 for r. 7 Solve -14p + 10p + 21 = 3y, 3p = -y + 12 for p. 3 Solve 0 = 3u - 8u, -u - u = b + 5 for b. -5 Solve -c - 60 = -5g, g + 5c - 84 = -46 for g. 13 Solve 0 = m - 4, 3m - 4 = 46j - 50j for j. -2 Solve 3t = 3i + 54, -t = -5i + 404 - 430 for t. 16 Solve 2c + 40 = 5k, -4c + 20652 - 20612 = 5k for c. 0 Solve 11f = -2d + 26, -589f + 6 = -592f - 2d for f. 4 Solve 2y = -n + 9, -3n - 28 = 389y - 394y for n. -1 Solve -d + 30 - 29 = q, -3q + 4d - 4 = 0 for q. 0 Solve -38 = 5m - 2b, 171 = -2m - 4b + 151 for m. -8 Solve 202t + 42 = -10n + 404t - 201t, -3t - 39 = 3n for n. -5 Solve c + 26 = -5d, -3046d + 8 = -3048d - c for d. -6 Solve -21c - 7 = -25c + q, -10 = -4c + 2q for c. 1 Solve -18s - 12 = -16s - 4, -3j - 1 = 4s for j. 5 Solve 4r + 95 = -5z, 5r + 72 = -4z - 50 + 37 for r. -5 Solve -4916 - 4910 = -j + 4n - 9862, 28 = -5j + n for j. -4 Solve -6z + 2z - 4j = -11469 + 11429, -4j = 3z - 34 for z. 6 Solve -5l - 2f = 4, 240l - 244l = -3f + 17 for l. -2 Solve -3x - 139 = -f - 140, 5f + 25 = -5x for f. -4 Solve -22q = 22, 4m = -269q + 264q - 25 for m. -5 Solve -3a = 2x - 21, -a + 3x = 6x for a. 9 Solve a - 4m = 23, -5m + 318 = 5a + 328 for a. 3 Solve 0p - 4p - o = 8, -4p + 2o - 83 = -87 for p. -1 Solve 0 = j + 3b + 3, -15 = j - 2b - 22 for j. 3 Solve 0 = -3i - 6 - 9, 57 = -2w - 6w - 5i for w. -4 Solve -62h + 63h = 2v + 22, 2h - h - 4 = 0 for v. -9 Solve -2s + 7i + 12 = 3i, 9i + 8 = -37 for s. -4 Solve 0 = -2b - 4073 + 4067, -4b = -q + 10 for q. -2 Solve 447b - 2g - 16 = 445b, 4b - 2g = 20 for b. 2 Solve -221 + 228 = 4h + m, -7 = -3h + m for h. 2 Solve 16b - 13b = 4k - 16, -4k = -4 for b. -4 Solve -453y = -4x - 448y, -7x + 3y = -3x + 8 for x. -5 Solve 5i - 4g - 33 = 0, 37i - 40i - 4g = -7 for i. 5 Solve -3o - 5k + 6 = -0k, -3 = 4o + 3k for o. -3 Solve 73h - 4l = 75h - 8, 5l = 2h + 19 for h. -2 Solve -4b - 920u + 916u - 20 = 0, -3b = -3u - 15 for b. 0 Solve -15d = -75, -5z - 12d + 7d - 15 = 0 for z. -8 Solve 2v + 0v + 12 = 4h, 4h + v = 6 for h. 2 Solve 10 = 5k, -4q - 58k = -53k - 10 for q. 0 Solve -3y - 4j + 35 = 0, 2y + 501 = 3j + 462 for y. -3 Solve 173i - 3z = 173i, -2 = -i - 4z for i. 2 Solve 2y + 3t = 9, -3y = -5t - 32814 + 32810 for y. 3 Solve 2g + 5x = -22, 5g + 53x - 7 = 56x for g. -1 Solve 2z - 30 = -4q - 92, -5z + 2q = -1 for z. -5 Solve 3g = 3l + 671 - 683, -5l = -2g + 4 for l. -4 Solve -3f - 50 = -27t + 34t, t - f - 10 = 0 for t. -2 Solve 0 = x + 4w + 27, 5w + 39 = 17196x - 17199x for x. -3 Solve 1613x - 3c - 2c + 110 = 1608x, 0 = 2c - 40 for x. -2 Solve 505v - 508v = -l, 2l = -5v - 11 for l. -3 Solve -4d + 60 = 11r, 1436r - 16 = -3d + 1435r for d. 4 Solve -4u = 0, -4276l + 0u + u = -4278l + 3u - 8 for l. -4 Solve 2 = 3z + 2p, 2z - 332 + 319 = p for z. 4 Solve -k - 5u + 16 = 0, 2135u - 2132u - 12 = -3k for k. 1 Solve 12 = 2r + 2y, 16y = 15r + 17y - 146 for r. 10 Solve -107 + 82 = 5i, 2t + 3i = -25 for t. -5 Solve 58i - 2b + 12 = 60i, -16 = 4i - 6b for i. 2 Solve -5z + 6d - 11 = 0, -139z + 144z + 43 = -2d for z. -7 Solve 3a = -3m, -3m - 160a + 155a = 0 for m. 0 Solve h = -2a - 1, -a + 5h = -0 + 28 for a. -3 Solve -779z = 2x - 780z - 5, -2x + 2z = -8 for x. 1 Solve -w = -2l - 10, -l + 9919 - 9942 = -5w for w. 4 Solve 12 = 2f - 2q, -154q = 4f - 152q for f. 2 Solve 0 = -5q - x - 24, -2192q + 16 = -2193q - 3x for q. -4 Solve -40p = -45p + 3i + 24, -32 = 2p + 2i for p. -3 Solve 5l - 12323a + 12327a = 3, 3l + 4a + 3 = 0 for l. 3 Solve -5i = 9a - 14, 4i + a - 141 = -65 - 71 for i. 1 Solve x + 14 = -2b, 14b - 13b - 10 = 8x for x. -2 Solve -d = 3o + 2, -2o = 33d - 36d + 27 for o. -3 Solve -3k = 6b - 30, b - 768k = -763k - 17 for b. 3 Solve i + 12 = 7, 31 = -3g - 5i for g. -2 Solve 14 = -2j + 3u, u = 63j - 66j + 1 for j. -1 Solve 7p + 26 - 25 = -2z, -5p - 2 = z for p. -1 Solve -a - 35 = -5i, 5i + 167a = 163a + 35 for i. 7 Solve -4t - m = -7, -2t + 862m = 857m - 31 for t. 3 Solve 21v - 9j + 25 = -10j, 0 = 5v - 4j - 11 for v. -1 Solve -3k + 555z = 558z - 18, 10 = -k + 3z for k. 2 Solve -48p + 4s + 14 = -46p, -11s = -2p + 35 for p. 1 Solve -9 = 3a, -42a + 19 = -4f - 43a for f. -4 Solve 2q = -14f - 44, -5q + 41 = 3f + 23 for q. 6 Solve 2i - 325 = 11y, i + 192y + 113 = 188y for i. 3 Solve 5f = -4a - 23, -65880a + 65877a - 4f - 16 = 0 for a. -12 Solve -1383m + 1385m - 14 = -4o, 3m - 13 = -4o for m. -1 Solve -16 = 3y + 675b - 677b, -2b = 3y + 8 for y. -4 Solve 23g + 10 = 7g + i, -4i + 40 = 4g for g. 0 Solve -3n = 13o + 26 - 103, -3o = -5n + 5 for n. 4 Solve n + 137 - 117 = 5h, 16n + 68 = -4h for h. 3 Solve -6f + 422 - 410 = 2w, f - 3w - 12 = 0 for f. 3 Solve 3q = 12, -1904d - 5q = -1899d for d. -4 Solve -9a - 11 = -4a - 6k, a + 5k = 4 for a. -1 Solve 2x - 3b - 74 = -53, 0 = 5b + 25 for x. 3 Solve 0 = -5g + 15, 5z + 3 = 2g + 12 for z. 3 Solve -125a + 120a = -n - 11, 2a + 1 = -5n for n. -1 Solve 4s + 4r + 1 - 9 = 0, 11r + 39 = -2r for s. 5 Solve -5m = 2j + 8, -5 + 10 = -2m + j for m. -2 Solve 0 = 5q + l - 20, -247q - l - 16 = -251q for q. 4 Solve -47f + 3s - 60 = -41f, -2s + 22 = -2f for f. -9 Solve -2g + 5u - 147 + 121 = 0, 2 = -g - 3u for g. -8 Solve -4s + 185b = 182b - 21, 0 = -s + 5b + 1 for s. 6 Solve 3j + 3x + 1241 = 1265, 0 = 3j - 5x + 72 for j. -4 Solve -3v = d + 9, 0 = -d + 3v + 179 - 164 for d. 3 Solve -4c - 41 = -3v, 5c = -72v + 52v + 210 for v. 11 Solve 5y - 2f - 45 = 0, -45y + 41y = 4f - 64 for y. 11 Solve 2k + 14 = -5r, -k - 42r + 41r = 1 for k. 3 Solve -5v + 263 = 4b + 318, 0 = -3v + 3 for b. -15 Solve 5q - 2 = -i, -13q + 10q + 5i = -46 for q. 2 Solve -5h = -3x + 19, -h + 157x - 156x - 5 = 0 for h. -2 Solve -2h + 4 = 0, 30h + 2 = 4b + 27h for b. 2 Solve 5y - 6y + 5n = 4y - 40, 3y = -3n for y. 4 Solve 37 = -3g - 4j + 5, -40 = 3g - 4j for g. -12 Solve 28 = 4w + 3x, 17w - 231 = -x - 159 for w. 4 Solve -1734a = 5b - 1730a + 17, -5b + 4 = -3a for b. -1 Solve -380 + 385 = -5m - 5f, 0 = -4m - 5f - 6 for m. 1 Solve -5k = 5i - 5, -i - 2k + 1 = 2i for i. -1 Solve 13x = -5w, -5w - 176x = -173x - 50 for w. 13 Solve -26a + 5z = -24a + 6, 12 = -4a + 5z for a. -3 Solve -3s - 24 = -3q, 91s + 6 = 94s + 3q for s. -3 Solve 20z = 16o + 23z + 31, -4o - 2z - 14 = 0 for o. -1 Solve 5k = -5c, 12c - 8 = -5k + 15c for k. 1 Solve -21 = -2v - 17, 0 = 2h + v + 12 for h. -7 Solve 37w - 32w + c + 1 = 0, 0 = -4w - c for w. -1 Solve 4o - 5n = 7, -4o - 5n + 338 = 321 for o. 3 Solve 4a = 12d - 54 - 22, 30a - 1 = 34a + 3d for a. -4 Solve -3t - 23n + 9 = -26n, 1 = 3t - n for t. -1 Solve -18p + 3o + 78 = 0, -5o - 22 = 66p - 69p for p. 4 Solve 3t - 3 = -u, 2u = -5t + 6052 - 6048 for t. 2 Solve 3y - 59 = 4d, -70 = 14d + 4y + 122 for d. -14 Solve 4g + 16n - 11n = -15, -10n - 30 = 3g for g. 0 Solve 1853u - 1855u + y + 20 = 0, -2u + 8 = 2y for u. 8 Solve 0 = 3j + 5g + 23, -4j - g = -611 + 619 for j. -1 Solve -2i + 5k = 2, 13i - 14i = 2k + 1 for i. -1 Solve v - 316j = -313j - 12, 2v - 3j = -18 for v. -6 Solve -3 = -5f + 3 - 1, 5i - 4f + 74 = 0 for i. -14 Solve 3h + 3s - s + 13 = 0, -84 + 104 = -4s for h. -1 Solve -7 = 3t + v, -5v + 5997 = -2t + 5947 for t. -5 Solve -3l = 12j - 13j + 10, -5l - 35 = 2j for j. -5 Solve 12 = -5v + v, 5v = 5o + 25 for o. -8 Solve 12u = -2o, o + 9u -	{ "pile_set_name": "DM Mathematics" }
))))*2. -3762sqrt(7) + 68968 Simplify (-5(-5 + -4((0 + sqrt(252) - sqrt(252)) + 1))-3)2. 18225 Simplify (-53sqrt(2160)3)/((sqrt(400)/(1sqrt(8)))/(-1sqrt(250))). 2700sqrt(3) Simplify -4 + (sqrt(13) + (sqrt(91)1)/sqrt(7))-6 + 2 - ((-4(2 + sqrt(13)) - (sqrt(52) + 1)) + -4). -6sqrt(13) + 11 Simplify 4(0 + sqrt(1300) + 0 + sqrt(1300) + 5) + sqrt(1300) + -5(sqrt(1300) + 1) + (sqrt(1300) + sqrt(1300)1)*2 + -3 + -2. 40sqrt(13) + 5210 Simplify -4((1 + 0 + sqrt(432) + (sqrt(432) + 0)3 + -1 + sqrt(432) + (sqrt(432) + -1)-5)2 + -3). -88 Simplify ((((4 + 4sqrt(847) - (5 + sqrt(847)4)) + -1)6)*2 + -4)2. 280 Simplify -1sqrt(500) + (sqrt(20) + sqrt(20) + -1sqrt(20) + -3)*2 + (sqrt(80)-2 - sqrt(80)) + -4 + -4. -34sqrt(5) + 21 Simplify -3 + 2 + -5 + (sqrt(208) + (sqrt(208) - (sqrt(208) - (sqrt(208) + -1))) + -2 + sqrt(208) + -5 + sqrt(208)1 + 2 + -2sqrt(208)5)*2. 288sqrt(13) + 7518 Simplify (-3 + -3 + -3-1sqrt(1872) + -4(sqrt(1872) - 1sqrt(1872)) + ((-2sqrt(1872) + sqrt(1872) - sqrt(1872) - sqrt(1872)) + 2)-2)*2. -2160sqrt(13) + 151732 Simplify -3 + -1 + 4 + ((5sqrt(119))/sqrt(7) + 5 + sqrt(1700))2-1. -3850 - 150sqrt(17) Simplify (((sqrt(136) - (sqrt(136) - -6sqrt(136)-2))-1)/(6(sqrt(968) + (sqrt(968)-2 + sqrt(968) - sqrt(968) - sqrt(968) - sqrt(968)) - sqrt(968))) + 2)3. 3sqrt(17)/22 + 6 Simplify -252(sqrt(320) + 1) - 5((1 + sqrt(320)2 - sqrt(320)) + sqrt(320) + 6(-1 + sqrt(320))*2). -9655 + 240sqrt(5) Simplify (-1sqrt(48)/(sqrt(8) - (sqrt(8) + sqrt(88)/sqrt(11))))/((sqrt(243) + sqrt(243)4 + sqrt(243))5). sqrt(2)/270 Simplify (41sqrt(144)6)/(2-1(sqrt(288) + (-3sqrt(288) - sqrt(288)) - sqrt(288))). 3sqrt(2)/2 Simplify ((-2(-2sqrt(7200) - sqrt(7200))4)/(sqrt(40)-1 - 4sqrt(40)/sqrt(4)))2. 11520 Simplify (sqrt(108)/(sqrt(3) + sqrt(6)/sqrt(2) + sqrt(3)))/(3sqrt(192)) + 4 + 0 + (-1sqrt(24)/(sqrt(8)-1) + 2)*2. 145sqrt(3)/36 + 11 Simplify (-55((-42sqrt(125) - sqrt(125)) + sqrt(125)-1 + -4 - (-2 + sqrt(50)/sqrt(90))6))*2. -520000sqrt(5) + 8490000 Simplify (((sqrt(490) - (sqrt(490)-1 - sqrt(490)))-4 - -1(sqrt(490) + sqrt(490) + 1sqrt(490)))/(34(sqrt(5) + 1sqrt(125))))2. 49/32 Simplify ((1(1 + sqrt(847)) - sqrt(847) - sqrt(847) - (2 + sqrt(847))6) + (-62sqrt(847) - sqrt(847)) + 4)2 + 5. 3080sqrt(7) + 338854 Simplify (((sqrt(11) - (sqrt(11) - 2sqrt(539))) + -1)-4 - (sqrt(704) + -4(-2 + sqrt(704)) + -5)2)-2. -176sqrt(11) + 12682 Simplify (sqrt(432) + 4sqrt(432) + -2sqrt(12)6)/(((sqrt(144) + 4(1sqrt(144) + sqrt(144)) + sqrt(144) - sqrt(144)) + sqrt(144))3). sqrt(3)/10 Simplify 2 + ((sqrt(13) - (-5 + 1 + sqrt(13)))5-5 - (sqrt(52)/sqrt(2)1)/((-1sqrt(10))/sqrt(5)))6. -598 + 6sqrt(13) Simplify ((sqrt(80) + sqrt(80) + 3sqrt(80)1 - sqrt(80))/(sqrt(432)/sqrt(6)))/(sqrt(350)/(sqrt(896)/sqrt(8))). 16sqrt(5)/15 Simplify -5 + 3 + sqrt(176) + -3 - (sqrt(11) + (2 + sqrt(11) + sqrt(11))5 + sqrt(66)/(sqrt(24) + sqrt(6)) + -4). -22sqrt(11)/3 - 11 Simplify -2(sqrt(1728)4 + sqrt(1728))-4 + -6(5 + (sqrt(1728) + sqrt(1728) + -3 - sqrt(1728)))*2. -10392 + 384sqrt(3) Simplify (0 + sqrt(39)/(-1sqrt(27)))2 - ((sqrt(130)/(sqrt(30)/sqrt(3)) - sqrt(13) - sqrt(13)) + (sqrt(65) - (sqrt(65) - -2sqrt(65)))/sqrt(5))*22. -2093/9 Simplify (-1 + (5(-2(sqrt(68) - (sqrt(68) - (1 + sqrt(68) + sqrt(68)))) - (5 + 1sqrt(68))))2 + -1)-6. -262338 - 21000sqrt(17) Simplify -5 + (sqrt(425) - (-3 + sqrt(425))) + 1 + ((sqrt(1088) - 1(sqrt(1088) + 0)) + sqrt(1088)1 + 3)2. 48sqrt(17) + 1096 Simplify ((sqrt(49) + sqrt(49) + sqrt(49) + sqrt(490)/sqrt(10))/sqrt(7) + sqrt(28)/(sqrt(4)5) - (sqrt(28) - sqrt(1792)1)/(-2sqrt(64) + sqrt(64)))2. 16807/400 Simplify (1sqrt(171)5)/(((sqrt(1089) - (sqrt(1089) - (sqrt(1089) - sqrt(1089)-1))) + sqrt(9) - sqrt(9)) + sqrt(9)) + -1-5(sqrt(304) + 0). 465sqrt(19)/23 Simplify (4(sqrt(1300) - (sqrt(1300) + sqrt(1300)2 + -4))2)*2 - ((3 + (sqrt(1300) - (sqrt(1300) + -2 + sqrt(1300) - sqrt(1300))2))3)2. -8980sqrt(13) + 321683 Simplify (-4(-5(sqrt(136) - sqrt(136)1) - sqrt(136) - sqrt(136)))/(6(sqrt(392) + (sqrt(392) - (-1sqrt(392) + sqrt(392))))) + 3. 2sqrt(17)/21 + 3 Simplify -6(sqrt(99) + -5 + sqrt(99) + 5 - sqrt(99))2 - (sqrt(132) - (sqrt(132)-1-6 + sqrt(132)))/(-1sqrt(12)1). -594 - 6sqrt(11) Simplify ((442sqrt(1296))/(sqrt(12) + (sqrt(12) - -1sqrt(300)) + -2sqrt(300)))2. 12288 Simplify (sqrt(140)/(sqrt(28)/sqrt(4)) - 1-3sqrt(20))/((sqrt(72)-2)/((sqrt(24) - sqrt(216) - sqrt(24))/sqrt(12))). 2sqrt(5) Simplify -5 + 2 + 5((-5 + sqrt(76) + 0 - (sqrt(76)-11 + sqrt(76))) + 5 + sqrt(76) + 1 + 2)*2. 120sqrt(19) + 1562 Simplify (-5((6(sqrt(16) + sqrt(16) + sqrt(144)))/(2sqrt(72) - sqrt(8)) + 2))2. 600sqrt(2) + 1900 Simplify (1(-1(4 + 2sqrt(567)))2 - (-6(-4-1sqrt(567) - (sqrt(567) - (sqrt(567) - (sqrt(567) + 1 + -3)))))*2) + -5. -181573 - 3744sqrt(7) Simplify (11sqrt(64)5)/((sqrt(2) - sqrt(6)/sqrt(3))3 - sqrt(72)/sqrt(9)). -10sqrt(2) Simplify ((sqrt(51) + (sqrt(51) + -6sqrt(153)/sqrt(3) - sqrt(51)) + sqrt(51))/(sqrt(48)-2 + sqrt(48) - sqrt(48)) + -1 + sqrt(1700) + -2 + 3 + sqrt(1700))2. 28577/4 Simplify (((sqrt(275) - sqrt(275)1) + sqrt(11))-2 + 0 + 5 + 0 + sqrt(275) + -3)2-5. -515 - 60sqrt(11) Simplify (-2sqrt(27)/(-2sqrt(9)) + -4(1 + sqrt(192)) - (2 + (-4 + sqrt(54)/sqrt(2) - -1sqrt(108))))2. 160sqrt(3) + 4804 Simplify -5 + (sqrt(171) + sqrt(171) + -2 + 0)*2-4 + 1 + sqrt(19)-4 + sqrt(931)2. -2756 + 106sqrt(19) Simplify (3(sqrt(70)3 + sqrt(70)))/((sqrt(90)2)/sqrt(9)) + (42sqrt(56))/(sqrt(128)-1 + sqrt(128) - sqrt(128)) + -2. -2 + 4sqrt(7) Simplify (sqrt(176)-1 + -2(sqrt(11) + -3))*2 + ((2sqrt(88) + sqrt(88))-1)/(1sqrt(8)3). -73sqrt(11) + 432 Simplify 4 + ((1sqrt(160) + sqrt(160)/(sqrt(4)3))/(-3sqrt(32) + sqrt(16)/(sqrt(12)/sqrt(6)))-3)*2. 69/5 Simplify ((-4(5sqrt(66)2 - (sqrt(66) - (sqrt(66) + -6sqrt(66)1))))/(((-2sqrt(126))/sqrt(7))/(sqrt(132)/sqrt(11))))2. 2816 Simplify 5(-5 + (sqrt(847)1)2 + -4) + ((sqrt(847) + 3)-4 - (sqrt(847) + (sqrt(847) + 1 - sqrt(847)) + -5)*2). 44sqrt(7) + 3315 Simplify (2sqrt(72)6)*2 + sqrt(72) + (sqrt(72) - (4 + (1sqrt(72) - sqrt(72)))) + 1(sqrt(112)/sqrt(7))/sqrt(2). 14sqrt(2) + 10364 Simplify ((sqrt(1134) + (sqrt(1134) + sqrt(1134) + sqrt(1134)1 - sqrt(1134) - sqrt(1134)))-4 - (sqrt(1134)1 + sqrt(1134))-3)/(sqrt(162)-6 + sqrt(162)4). sqrt(7) Simplify ((sqrt(12) - -2sqrt(12))/sqrt(4) + 2 + -3 + sqrt(3) + -2(-3 + sqrt(147) + 0 + sqrt(147)))*2. -240sqrt(3) + 1753 Simplify 4 + ((-4(sqrt(864) + 4sqrt(864) - sqrt(864)))/(((-2sqrt(240))/sqrt(6) + sqrt(40))/sqrt(5)) + 5)2. 960sqrt(3) + 27677 Simplify (sqrt(6)/(sqrt(2)-2) + -2 + sqrt(243) + (sqrt(3024)1)/(sqrt(7) - (sqrt(7) + 1sqrt(1008) - sqrt(7))))6. -12 + 489sqrt(3)/11 Simplify -4(sqrt(7)2 + -5) + sqrt(448) + -3 - (5sqrt(84)/sqrt(48) - ((sqrt(700) + -1)*2 + sqrt(700) - sqrt(63)-2)). -13sqrt(7)/2 + 718 Simplify 2 + ((1 + sqrt(5) + 2 + sqrt(5))-5 + 4 - (-1 + 4sqrt(5) + sqrt(5) + sqrt(605) + -2)2). -1298 + 86sqrt(5) Simplify ((-2 + sqrt(7)-2 - 1sqrt(112)) + -5(sqrt(567)-1 + -1)*2)-4. 384sqrt(7) + 11368 Simplify (4(sqrt(152) - sqrt(152)-5) + sqrt(152) - -6sqrt(152)-5)/(5sqrt(648)-13). sqrt(19)/27 Simplify ((2 + sqrt(72) + -5 - sqrt(72)) + 5 + -3sqrt(72)/(-1sqrt(4)-3))2. -12sqrt(2) + 22 Simplify -4 + (-6sqrt(204)1)/(-1(-1sqrt(12) - sqrt(12))) + -1(4 + sqrt(68)/(sqrt(4) - 1sqrt(100))). -11sqrt(17)/4 - 8 Simplify ((sqrt(57) - sqrt(684)/sqrt(192))-56)/(256(sqrt(6)/sqrt(2) + sqrt(3))). -3sqrt(19)/16 Simplify (-1sqrt(55)-4)/(sqrt(55)/(sqrt(5)-1)) - -1((-2sqrt(20))/sqrt(4))*24. -4sqrt(5) + 80 Simplify ((-4 + sqrt(128)2)4 - (sqrt(128)1 + 5 + -4))*2 + -1. -1904sqrt(2) + 6560 Simplify ((sqrt(3) - (sqrt(3) + -4)) + -5)*2 - sqrt(21)/(sqrt(7) - 4sqrt(7)) - (4 + ((sqrt(24)/(sqrt(8)-1) + sqrt(3))2 - (1sqrt(3)5)2)). sqrt(3)/3 + 72 Simplify -3-2(sqrt(45)/(1sqrt(9)-3 + sqrt(9)) - ((sqrt(5) - sqrt(405)3 - sqrt(5)) + -2)). 12 + 159sqrt(5) Simplify 2 + sqrt(7) + -2 + -2 + 3 + (sqrt(7) + sqrt(2688)/sqrt(6) - sqrt(35)/((-4sqrt(5) - sqrt(5)) + sqrt(5))). 1 + 41*sqrt(7	{ "pile_set_name": "DM Mathematics" }
is the fourth biggest value? (a) 0.12 (b) 1 (c) -0.16 (d) -15/389 c Which is the fifth smallest value? (a) -2 (b) -0.1 (c) -5/3 (d) 16855 (e) 76/9 (f) 2/7 e Which is the biggest value? (a) 0.02 (b) 915000 (c) -0.1 b What is the smallest value in -5, 3/8, -2/3, -7731, 243, -2/95? -7731 What is the third biggest value in 1, 3, -0.411664? -0.411664 What is the biggest value in 3, -1428, 4, 0.5, 2422? 2422 Which is the second smallest value? (a) -51 (b) -3/8 (c) -0.267 (d) 2/9 (e) -1.5 (f) 3 e Which is the second smallest value? (a) 3 (b) 1195 (c) -0.7 (d) 0.06 (e) -2 (f) 0 c What is the biggest value in 89, -5/6833, 12? 89 What is the second smallest value in -0.2, -275616, 5? -0.2 What is the third biggest value in 4, 12, 7/135, -12, -1? 7/135 Which is the biggest value? (a) 0.04 (b) -0.037 (c) 0 (d) -1 (e) 219 e Which is the fifth biggest value? (a) -2/9 (b) -34 (c) -0.11 (d) 7/17 (e) -5 (f) 1.5 e What is the third smallest value in -2/5, -427/6, -3, -10, -4, 0? -4 Which is the fourth smallest value? (a) -12.108 (b) -0.0643 (c) 2/7 (d) 1 d What is the smallest value in -1/6, 0.5, 2/7, 9/311, 4? -1/6 What is the second biggest value in 0.09, -17/3, 5, -2/19, -1/84, 4, 0.6? 4 Which is the biggest value? (a) -200 (b) 37918 (c) -13 b What is the second biggest value in -3, 0.2, 3/5, -6.3, -658, 4? 3/5 Which is the biggest value? (a) 0.28 (b) -0.06 (c) -0.5 (d) -3 (e) 864 (f) 7 e Which is the second smallest value? (a) -2/3 (b) -2 (c) -2.44 (d) 1/10 (e) -2/9 (f) 3/17 (g) -221 c What is the third biggest value in -58, -0.163, -1019? -1019 What is the fourth biggest value in 0.2, 3, -363, 1, -0.21, 4/5, 5? 4/5 Which is the third smallest value? (a) -61.117 (b) -2/3 (c) -12 b Which is the third biggest value? (a) -10 (b) 2 (c) -78436 (d) 2/19 a Which is the third biggest value? (a) -0.5 (b) 104301 (c) -0.391 a Which is the second biggest value? (a) -2/25 (b) 252.2 (c) -5 (d) 3/2 d Which is the fifth biggest value? (a) -0.06 (b) -3.4 (c) -989 (d) 0.12 (e) -8 c Which is the fifth smallest value? (a) 269 (b) 0 (c) -0.372 (d) -1 (e) -7 a What is the fourth smallest value in 3/2, -2/11, 5, -6, 39867, -8, -3? -2/11 What is the fourth biggest value in 0.1, -0.01485611, -0.5, 0.5, 0? -0.01485611 Which is the biggest value? (a) 1046 (b) -18 (c) -2/59 a What is the second biggest value in -84.6, 0.2, -1345, 2/7, -5? 0.2 What is the second smallest value in -2/17, -29, 0.22, 4, -2/9, -2, -30? -29 What is the seventh biggest value in -2, 2, -98, -1.6, -4, -1/9, -2/5? -98 Which is the fifth smallest value? (a) 3 (b) 55 (c) -6290/3 (d) 0 (e) -1/47 (f) 0.3 a Which is the second smallest value? (a) 3/7 (b) -1 (c) 34.1 (d) -224 b What is the third biggest value in -0.4, -1/5364, 2/3, -23, 1/14? -1/5364 What is the fifth biggest value in -7, -0.1, -1, 9, -2.49, 0.2, -2/7? -1 Which is the biggest value? (a) -0.7 (b) 86 (c) 6 (d) 4/3 (e) -7 (f) 1 b What is the biggest value in 4, 0.2, -13/4313, 5, -0.007? 5 What is the fourth biggest value in 24, 0.021, 3, -51, -2/93? -2/93 What is the third biggest value in -3, 1.9, 14, -1, -17, 2? 1.9 What is the third biggest value in -1, 172, -23, 15? -1 Which is the second smallest value? (a) -0.2 (b) 3 (c) 3/8 (d) -642 (e) 1/27 (f) 0.4 a Which is the fourth biggest value? (a) 0.4 (b) -12644 (c) -4/5 (d) -0.2 (e) 4 c Which is the fifth biggest value? (a) 5 (b) -1/6 (c) 0 (d) -4 (e) -3.1 (f) -2/53 e Which is the third biggest value? (a) 66/7 (b) -0.4 (c) 1373 b Which is the smallest value? (a) -1/15 (b) -0.18 (c) -0.293 (d) 8/9 c Which is the third biggest value? (a) 17 (b) 9 (c) 4/3 (d) -1/90 (e) -2.6 (f) 2 (g) -0.05 f What is the sixth smallest value in 3, -126/11, -2/3, -2/5, 12, 4/3, -52/3? 3 What is the smallest value in 2/7, 3/8, -2, 37, -3, 1/41? -3 Which is the second smallest value? (a) -19/51 (b) 2/7 (c) 4 (d) -33 (e) 7 a What is the second biggest value in -0.04, 5, 231375? 5 What is the third biggest value in 2, 0.4, 1034, 1.7, 157, -0.06? 2 Which is the fifth smallest value? (a) 3/2 (b) -0.1 (c) 0.768 (d) -2/11 (e) -1.4 (f) -6/7 c Which is the smallest value? (a) 1156 (b) 0.0636 (c) -2 c Which is the fourth biggest value? (a) -2/5 (b) -0.9 (c) -2/919 (d) 4/3 (e) 0.04 (f) -2 (g) 1/2 c Which is the biggest value? (a) 26.3 (b) -3 (c) 0.66 (d) -448 (e) 0.2 a Which is the third biggest value? (a) -23/3 (b) -2.03 (c) 499 a Which is the biggest value? (a) -0.052 (b) -1/17 (c) -62 (d) -0.9 (e) -5 a What is the fifth biggest value in 52, -4, -1/2, 16285, 0.4? -4 What is the fourth smallest value in -2/19, -2/7, 0, -1, 144.87, 3? 0 Which is the third biggest value? (a) 0.147 (b) 0.5 (c) 0.1484 (d) 5 c Which is the biggest value? (a) 12/23 (b) -245/6 (c) -5 (d) -2/5 (e) 1 (f) 1/5 (g) 11 g Which is the third smallest value? (a) -620687 (b) 4/39 (c) -0.2 b What is the second smallest value in -3, -756/11, 232, -4, 0.5? -4 What is the sixth smallest value in -1.9, 5, 0.5, -1/7, 2/9, -0.1, 17? 5 Which is the sixth biggest value? (a) -91/3 (b) 0.22 (c) 2/5 (d) 0.32 (e) 0.04 (f) 0.8 (g) 1/4 e What is the fifth smallest value in -11/2100, -3, 1, -1/5, -0.4, 2? 1 Which is the third biggest value? (a) -2/5 (b) 0.5 (c) 3/5 (d) -5 (e) -5437 (f) 3 b Which is the fourth smallest value? (a) -157.1 (b) 2/19 (c) 0.2 (d) -1 (e) -5 (f) 0 f What is the second smallest value in 0.1, -14.496, -2/209? -2/209 Which is the third smallest value? (a) 0 (b) 0.04 (c) -2554 (d) -131 a Which is the fifth biggest value? (a) 7 (b) 0.5 (c) 0 (d) -236758/5 (e) -2/3 d Which is the fifth smallest value? (a) 0.05 (b) -0.9 (c) 5 (d) 21 (e) -0.1 (f) -0.4 (g) -1/4 a Which is the smallest value? (a) -1/16 (b) -19 (c) 19 (d) -4/5 (e) 1/2 (f) 4 b What is the second biggest value in -10/3, -1/5, -11.5, -0.07, 76? -0.07 Which is the second biggest value? (a) 35330 (b) 5 (c) -3 (d) 2/23 b What is the fifth smallest value in 2/39, -90, -0.1, 0.2, 1.01, -9? 0.2 What is the biggest value in -4, -0.659, -0.5, 130.87, 1? 130.87 What is the second smallest value in -2, 2, -12407? -2 What is the fourth smallest value in 7218, -56, 202, 0.1, 0.4? 202 What is the third biggest value in -3, -4, 2387, 0.1, 0.4, -10, 3? 0.4 Which is the third smallest value? (a) 88981 (b) -2/33 (c) 2 (d) -2/11 c Which is the smallest value? (a) -1/22 (b) -649 (c) -0.37 b What is the biggest value in -0.112, 1, 2/29, 0.08, -0.5, -3/4, -335? 1 Which is the seventh biggest value? (a) 3/4 (b) 667 (c) -0.2 (d) 18 (e) 23 (f) -3/5 (g) -2 g What is the second biggest value in 2.58, -51, -1/2, -57, -3/8? -3/8 What is the third biggest value in 4/436069, 0.12, 2? 4/436069 Which is the fourth biggest value? (a) 3.829 (b) 1/2 (c) 0.3 (d) 1/5 (e) 78/11 c What is the smallest value in -116, 1/5, 34361? -116 Which is the biggest value? (a) -2 (b) 2 (c) -0.2 (d) -3/2 (e) -1/2 (f) -9830/21 b What is the biggest value in -6, -6.5, 1.67, -6/121? 1.67 What is the fifth biggest value in -18, -2/11, 51, -8, 11/3? -18 Which is the sixth smallest value? (a) -7/3 (b) -5 (c) 245/18 (d) -8 (e) 2/15 (f) 2/7 c Which is the third biggest value? (a) -0.4 (b) -2/47 (c) 0.3 (d) 1/3 (e) 8 (f) 7.9 (g) 2/7 d Which is the second smallest value? (a) 1/204 (b) 3/5 (c) 613 (d) -4 (e) 4 a What is the second biggest value in 1/175, 11, 4, 3/103, 13? 11 What is the fourth smallest value in -2/3015, 0, 50, -1? 50 Which is the smallest value? (a) -444 (b) -0.4 (c) -2 (d) 0.0184 (e) 0.2 a Which is the third biggest value? (a) -2/16437683 (b) 3 (c) -0.1 c Which is the third biggest value? (a) 2392883 (b) 0.1 (c) 2/49 (d) -0.4 c Which is the biggest value? (a) -1491 (b) -3 (c) -3/5 (d) 0.03 (e) -0.07 (f) -6 d What is the third smallest value in -2/215, -3/7, 5, -4/1909? -4/1909 What is the biggest value in -0.3, 2, -9, 3, -42? 3 What is the sixth smallest value in -0.4, -15, 8, 0.19, 0.2, 249/2? 249/2 Which is the second smallest value? (a) 15 (b) -0.1 (c) 1/4 (d) 0 (e) 0.2 (f) -21/199 b Which is the biggest value? (a) -2/9481 (b) -0.1 (c) -111 (d) 1/10 (e)	{ "pile_set_name": "DM Mathematics" }
ve of -3g4/4 - 74g*2. Give k(v(c)). -18c*2 Let t(c) = -8c + 7. Let z(r) = -7r + 6. Let f(w) = -6t(w) + 7z(w). Let k(y) = -3y*2 - 5y2 + y2. Determine f(k(p)). 7p2 Let j(h) = -11h - 3. Let z(d) = 35d + 10. Let b(q) = 10j(q) + 3z(q). Let v(o) = -31o. Determine b(v(y)). 155y Let d(f) = -f. Let i(o) be the third derivative of -505o*4/24 + 61o*2 - o. Give d(i(v)). 505v Let y(c) = -4c2 + 122c. Let a(v) = 453v2. Determine y(a(b)). -820836b*4 + 55266b*2 Let b(c) = -90c. Let q(s) = -55067s2. Calculate b(q(w)). 4956030w*2 Let u(a) = -2a2 + 6. Let x(l) = l2 - 5. Let o(y) = 5u(y) + 6x(y). Let g(f) = 8f + 8f - 6f - f. Determine o(g(i)). -324i2 Let m(c) be the second derivative of -c3/6 - 11c. Let w(b) = -2b2 - 3. Let v(r) = r2 + 1. Let l(g) = 3v(g) + w(g). What is m(l(k))? -k2 Let h(w) = -65w. Let s(b) = -2396b2 - 2393b*2 + 4788b*2. Give s(h(c)). -4225c*2 Let w(c) = 15c*2 + 411c. Let x(p) = -15p. What is x(w(g))? -225g*2 - 6165g Let u(v) = -1952v + 4. Let b(a) = -2a*2. What is u(b(r))? 3904r*2 + 4 Let r(u) = -7u*2. Let c(j) be the first derivative of 39 + 0j + 5/2j2. Calculate c(r(g)). -35g*2 Let k(z) = z. Let b(a) be the first derivative of -13a*5/40 - 19a*3/3 + 10. Let j(i) be the third derivative of b(i). Calculate j(k(w)). -39w Let q(p) be the first derivative of p*2/2 + 562. Let i(d) = 6d - 27. Determine i(q(u)). 6u - 27 Let a(q) be the second derivative of -q4/8 + 2q*2 + 20q. Let z(c) be the first derivative of a(c). Let b(l) = 1 - 1 + 5l. Determine z(b(p)). -15p Let y(o) = -306o2. Let q(c) = 3609c. Calculate y(q(s)). -3985613586s2 Let p(o) = -2o*2. Let b = 21 + -10. Let m(d) = d + b - 7 - 4. What is p(m(h))? -2h2 Let k(x) be the second derivative of -x5/60 - 55x2/2 - 9x. Let j(g) be the first derivative of k(g). Let o(q) = 33q2. Determine j(o(n)). -1089n*4 Let p(h) = -2h*2. Let l(z) = -71z*2 - 4z. Let s(g) = -7738g2 - 438g. Let d(o) = -219l(o) + 2s(o). What is d(p(w))? 292w4 Let c(t) be the second derivative of -11t*3/6 + 10t - 4. Let f(o) = 2o + 12. Calculate c(f(p)). -22p - 132 Let t(i) = -2i2. Suppose 4l = 2l + 48. Let h = -22 + l. Let s(g) = -4g + 0g + g - hg. Calculate t(s(p)). -50p2 Let a(s) = -14s. Let w(v) be the third derivative of -v4/24 + v3/3 - 4v2. Let h(y) = y - 1. Let i(k) = -2h(k) - w(k). Calculate a(i(l)). 14l Let c(d) = 7d*2 - 7d. Let m(a) = -506a. Calculate c(m(b)). 1792252b*2 + 3542b Let v(f) = -f*2 - 1236 + 1236. Let z(d) = 29d*2. Let p(j) = -72j*2. Let w(y) = 5p(y) + 12z(y). Determine v(w(n)). -144n*4 Let y(d) = -2d. Let x(p) = -3p2 + 4p - 10. Let w(g) be the second derivative of g4/3 - g3 + 7g2 + g. Let q(i) = 5w(i) + 7x(i). What is q(y(v))? -4v*2 + 4v Let a(k) = -13k - 1. Let f(y) = 2y - 4. Let z(w) = 10w - 18. Let u(x) = -9f(x) + 2z(x). Calculate a(u(n)). -26n - 1 Let m(l) = -63l - 57l + l*2 - 61l + 181l. Let c(j) = 3 + 14j - 3. Give m(c(o)). 196o2 Let q(t) = -149t - 22. Let i(v) = -52v - 8. Let n(y) = -17i(y) + 6q(y). Let k(d) = 8d*2. Calculate n(k(z)). -80z*2 + 4 Let h(m) = 2m*2. Let z(y) be the first derivative of -162y*2 + 98. Determine h(z(g)). 209952g*2 Suppose 0 = p - 3p + 10. Let w(j) = 13j - pj - 10j. Let n(d) = 17d*2 + 2d - 2d - 16d*2. Give n(w(c)). 4c*2 Let v(g) = -9g. Let b(a) be the first derivative of 3/2a2 + 0a - 16. Give b(v(m)). -27m Let a(h) = -5h*2 + 3h + 1831. Let z(y) = -2y2. Give a(z(p)). -20p*4 - 6p2 + 1831 Let c(n) be the first derivative of -n2/2 + 8n - 337. Let m(p) = -2p*2. Determine m(c(i)). -2i*2 + 32i - 128 Let g(q) = q. Let p(o) = 236o2 - 79o*2 + 75o*2. What is g(p(v))? 232v*2 Let q(c) = 7c - 3. Let m(g) = 48g - 20. Let n(t) = -3m(t) + 20q(t). Let k(p) = -519p + 519p + 2p2 + p2 - 4p2. Give n(k(x)). 4x*2 Let y(q) = -14q + 3. Let p(t) = 28t - 5. Let l(a) = 3p(a) + 5y(a). Let s(v) = -v2. What is s(l(i))? -196i2 Let x(n) = n2 + 3n + 4. Let p be x(-2). Let v(t) = -73 + 73 - 2t*p. Let b(i) be the second derivative of -4i*3/3 + 2i. Calculate v(b(d)). -128d2 Let l be (1 - 111/15)/((-10)/25). Let p(z) = -14z + 16 + 13z - l. Let o(r) be the third derivative of -3r4/8 - r2. What is o(p(x))? 9x Let q(k) = k - 8k*2 - k. Suppose 5v = 7v - 4. Let d(s) = -5s*v - 6s*2 + 12s*2 - 3s*2. Calculate d(q(g)). -128g*4 Suppose 17w - 21w = -216. Let z(v) = -57v*2 + wv*2 + 40v2. Let i(j) = j2. Calculate i(z(g)). 1369g4 Let n(t) be the second derivative of t4/6 + t - 10. Let z(u) = -11u + 5. Determine n(z(d)). 242d2 - 220d + 50 Let i(s) = -1542s + 8. Let z(u) = 2u. Give i(z(d)). -3084d + 8 Let i(t) = -t. Let a(k) = 20k + 66k2 + 72k*2 - 20k. Give a(i(h)). 138h2 Let m(p) = 102p. Let q(v) = -7v2 + 3v. Let l(t) = 12t2 - 5t. Let z(r) = 3l(r) + 5q(r). Calculate z(m(j)). 10404j2 Let l(b) = 69b + 4. Let u(w) = 14 - 8w + 77w - 4 - 7. Let k(g) = -3l(g) + 4u(g). Let o(x) = 2x2. Determine o(k(s)). 9522s*2 Let k(t) = 120t + 9. Let c(s) = -3s2 - 42. Calculate k(c(d)). -360d*2 - 5031 Let u(b) = 2b*2. Let p(m) = 3763709m. What is u(p(w))? 28331010873362w2 Let s(m) = 34m*2 - 16m*2 - 16m*2. Let x(i) = 56i*2 - i. Determine x(s(t)). 224t*4 - 2t*2 Let p(f) be the second derivative of -3f + 0 + 0f3 + 0f*2 + 7/12f*4. Let h(s) = 0s + 2s - 3s. Calculate p(h(i)). 7i2 Let b(u) = -7u*2 - 6u - 6. Let n(p) = 15p2 + 13p + 13. Suppose 39 = 5h + 9. Let g(v) = hn(v) + 13b(v). Let t(w) = -7w. What is g(t(x))? -49x2 Let a(i) = -10i2. Let k(r) be the second derivative of -r7/1260 - 11r4/12 + 27r. Let y(q) be the third derivative of k(q). What is y(a(h))? -200h4 Let n(k) = -64k + 12. Let g(l) = 26l - 5. Suppose 2x + 68 = 5f, x = 2x + 4. Let y(p) = fg(p) + 5n(p). Let q(m) = 2m2. Calculate y(q(d)). -16d*2 Let u(q) = 2q. Let s(x) = -6 + 8x - 14 + 20. Calculate u(s(r)). 16r Let y(v) be the first derivative of -6v2 - 104. Let b(o) = 4o*2. What is y(b(w))? -48w2 Let f(s) = -1 + s2 + 1. Let x(k) be the second derivative of k*4/24 + 3k*2/2 - 22k. Let j(a) be the first derivative of x(a). Calculate j(f(w)). w2 Let s(a) be the first derivative of -a3/3 - 59. Let t(z) = -5z. What is s(t(r))? -25r*2 Let c(j) = j + 57. Let t(z) = 202z*2. Calculate t(c(n)). 202n*2 + 23028n + 656298 Let b(f) = -36f. Let n(r) be the third derivative of r4/6 + 100r*2. What is b(n(g))? -144g Let r = -16 - -18. Let y(a) = -a*2 - 2a*2 + ra*2 - 4a2. Let d(l) be the third derivative of -l4/24 + 5l2. Give d(y(n)). 5n*2 Let t(y) be the first derivative of -7y*3 - 343. Let g(z) = 8z*2. What is g(t(k))? 3528k*4 Let z(x) = 141x2. Let q(m) be the third derivative of -m5/20 + 4m2 + 40m. Determine q(z(d)). -59643d4 Let u(a) = 6a*2 - 4a - 4. Let b(p) = -11p2 + 5 + 5p + 0 + 4p2. Let r(n) = -4b(n) - 5u(n). Let g(x) = x - x - 4x. Calculate g(r(o)). 8o2 Let x(k) = 11k*2 - 17k. Let b(a) = -12a. What is x(b(h))? 1584h*2 + 204h Let h(d) be the first derivative of -d*2 + 779. Let k(o) be the third derivative of -2o4/3 + o2. Calculate k(h(j)). 32j Let m(g) = 9g2 + 1. Let q(r) be the second derivative of -r4/6 + 4r + 16. Give m(q(b)). 36b4 + 1 Let b(n) = -n2 - n. Let m(y) = 8y2 - 2y*2 + 5y + 0y2. Let z(s) = -10b(s) - 2m(s). Let u(p) = -1 + 1 + 2p*2. Calculate u(z(d)). 8d*4 Let s(z) = -1164z*2 - 2. Let b(q) = 2q. Give b(s(t)). -2328t2 - 4 Let s(h) be the third derivative of 0h + 0h4 - 4h*2 + 0h*3 + 0 - 1/20h5. Let k(v) be the second derivative of v3/2 - v. What is k(s(r))? -9r2 Let m(o) be the third derivative of o4/12 - o2 + 119. Let r(l) = -2l - 10. Give r(m(c)). -4c - 10 Let f(j) = 9j - 5. Let l(t) be the second derivative of 2t3/3 - t2 - 25t. Let x(m) = 2f(m) - 5l(m). Let c(y) = 3y2. Give x(c(q)). -6q*2 Suppose 2a - 2 = -w, 4w - 13a = -11a + 8. Let o(b) be the third derivative of 0b + 0 - 5bw + 0b*3 + 1/24b*4. Let x(r) = -19r*2. Determine o(x(m)). -19m**2 Let f	{ "pile_set_name": "DM Mathematics" }
cement from mmmmmmmmbmmm. 5/6 Two letters picked without replacement from jtdjqjeujjttjjuujje. What is prob of picking 1 d and 1 q? 1/171 Four letters picked without replacement from {m: 3, c: 6, r: 2, t: 4, n: 2}. What is prob of picking 1 r, 2 n, and 1 m? 3/1190 Two letters picked without replacement from tftoqwou. Give prob of picking 1 u and 1 o. 1/14 Four letters picked without replacement from hrfggrhrfgfgggrfcg. What is prob of picking 1 h, 1 c, and 2 g? 7/510 What is prob of picking 2 y when two letters picked without replacement from nnonononnoynnnny? 1/120 Calculate prob of picking 2 i and 2 s when four letters picked without replacement from siisiiiiisii. 12/55 Four letters picked without replacement from {g: 1, c: 3, e: 3, q: 3, n: 1}. What is prob of picking 1 g and 3 c? 1/330 Calculate prob of picking 1 p, 2 o, and 1 z when four letters picked without replacement from zzpppooppppppzzz. 9/364 Calculate prob of picking 2 r and 1 j when three letters picked without replacement from jrrrjrjjjjrrrj. 21/52 Three letters picked without replacement from hhiihihbb. Give prob of picking 2 i and 1 h. 1/7 Calculate prob of picking 1 z and 1 q when two letters picked without replacement from {z: 6, y: 1, h: 3, q: 2, r: 1}. 2/13 Three letters picked without replacement from ygmbmngb. Give prob of picking 1 b, 1 n, and 1 y. 1/28 Three letters picked without replacement from {u: 3, z: 5}. Give prob of picking 3 z. 5/28 Two letters picked without replacement from hhhhhhhhvhhhhhhvhhvh. Give prob of picking 2 v. 3/190 Three letters picked without replacement from {c: 2, p: 7}. What is prob of picking 3 p? 5/12 Four letters picked without replacement from {r: 1, q: 2, c: 4}. What is prob of picking 4 c? 1/35 Three letters picked without replacement from {w: 1, e: 1, p: 1, o: 2}. Give prob of picking 1 o, 1 e, and 1 w. 1/5 What is prob of picking 4 a when four letters picked without replacement from {v: 4, a: 15}? 455/1292 Three letters picked without replacement from {w: 1, u: 1, g: 4, h: 2, z: 1}. Give prob of picking 1 u, 1 w, and 1 g. 1/21 Two letters picked without replacement from brbrinrrv. What is prob of picking 2 b? 1/36 Calculate prob of picking 1 b and 1 r when two letters picked without replacement from {b: 3, v: 3, s: 4, r: 3}. 3/26 Four letters picked without replacement from {s: 5, a: 3}. What is prob of picking 3 s and 1 a? 3/7 Three letters picked without replacement from {q: 1, j: 6, s: 3, m: 6, k: 1}. What is prob of picking 1 q, 1 k, and 1 m? 3/340 Calculate prob of picking 1 r and 2 v when three letters picked without replacement from vvrrrvv. 18/35 Calculate prob of picking 1 n, 1 m, and 1 b when three letters picked without replacement from bmwon. 1/10 Three letters picked without replacement from {t: 4, j: 1, y: 1, k: 4, c: 4, a: 3}. What is prob of picking 1 k, 1 c, and 1 t? 8/85 Two letters picked without replacement from cccccc. What is prob of picking 2 c? 1 What is prob of picking 2 b when two letters picked without replacement from mmmhhbhhhbmbhb? 6/91 Four letters picked without replacement from snmnbqnhnhhb. What is prob of picking 1 h, 1 b, 1 n, and 1 m? 8/165 What is prob of picking 1 z and 1 f when two letters picked without replacement from ofofofzffo? 1/9 What is prob of picking 3 w and 1 y when four letters picked without replacement from uyooowyooytoooy? 0 Two letters picked without replacement from llualauaulupaauu. Give prob of picking 1 p and 1 u. 1/20 Calculate prob of picking 1 j and 1 t when two letters picked without replacement from jjfjfjsjjfftt. 2/13 Calculate prob of picking 1 j and 2 q when three letters picked without replacement from jjqqjjjjjjjj. 1/22 Calculate prob of picking 2 h, 1 e, and 1 v when four letters picked without replacement from {h: 2, e: 1, g: 2, m: 4, v: 1}. 1/210 What is prob of picking 1 j, 1 x, and 2 h when four letters picked without replacement from fjjxxfhhfxx? 4/165 Two letters picked without replacement from {s: 2, x: 4, d: 3}. What is prob of picking 1 x and 1 d? 1/3 What is prob of picking 1 z and 1 x when two letters picked without replacement from xzzxzzz? 10/21 Two letters picked without replacement from {w: 5, n: 5}. What is prob of picking 1 n and 1 w? 5/9 Two letters picked without replacement from peoepppeppe. Give prob of picking 2 e. 6/55 Four letters picked without replacement from gggwygwibbviwy. What is prob of picking 1 w, 1 i, and 2 g? 36/1001 Calculate prob of picking 2 a and 1 j when three letters picked without replacement from {j: 9, r: 4, a: 4}. 27/340 Calculate prob of picking 4 t when four letters picked without replacement from tttztttztttzzt. 30/143 Two letters picked without replacement from oofvykmkfffvym. What is prob of picking 1 k and 1 f? 8/91 Three letters picked without replacement from {l: 10, a: 10}. What is prob of picking 1 l and 2 a? 15/38 Two letters picked without replacement from {p: 1, e: 1, u: 2, o: 4}. What is prob of picking 1 e and 1 o? 1/7 Three letters picked without replacement from {o: 4, d: 2, z: 1, t: 3, h: 5, m: 5}. Give prob of picking 1 o and 2 m. 2/57 What is prob of picking 2 j when two letters picked without replacement from {j: 4, d: 6, e: 10}? 3/95 Three letters picked without replacement from yqqqmramgrgyraqq. Give prob of picking 1 g, 1 q, and 1 r. 3/56 Calculate prob of picking 1 o and 1 w when two letters picked without replacement from yoyoycycw. 1/18 Calculate prob of picking 2 r when two letters picked without replacement from {c: 2, r: 2, e: 1, b: 1, z: 1}. 1/21 Calculate prob of picking 1 k and 1 l when two letters picked without replacement from klllkilikkklkllk. 49/120 What is prob of picking 2 j when two letters picked without replacement from {z: 2, j: 6, a: 3, v: 4}? 1/7 Calculate prob of picking 2 w when two letters picked without replacement from {d: 1, w: 2, y: 1, c: 1, k: 1, l: 1}. 1/21 Calculate prob of picking 1 t, 1 u, 1 s, and 1 y when four letters picked without replacement from {s: 1, h: 11, t: 3, n: 3, u: 1, y: 1}. 1/1615 What is prob of picking 2 k when two letters picked without replacement from {k: 2, b: 1}? 1/3 Three letters picked without replacement from {d: 9, r: 2, q: 7}. What is prob of picking 1 r and 2 d? 3/34 Two letters picked without replacement from {r: 4, w: 7, y: 6}. Give prob of picking 2 w. 21/136 Calculate prob of picking 1 u, 2 g, and 1 n when four letters picked without replacement from {m: 3, u: 1, g: 7, n: 5}. 3/52 Four letters picked without replacement from {k: 2, r: 8, j: 5, i: 4}. What is prob of picking 1 k, 2 r, and 1 j? 70/969 Three letters picked without replacement from {z: 4, q: 1, f: 2, c: 1, v: 3, t: 1}. What is prob of picking 1 f, 1 z, and 1 v? 6/55 Calculate prob of picking 1 w and 1 i when two letters picked without replacement from iiiiiiiiiwiiiiiiiii. 2/19 Three letters picked without replacement from ddfwdkwdwdwwwlfwd. Give prob of picking 1 k, 1 d, and 1 l. 3/340 What is prob of picking 1 m and 1 l when two letters picked without replacement from tmwol? 1/10 Four letters picked without replacement from mmcmcmggcgmmcmmmic. What is prob of picking 2 g, 1 m, and 1 i? 3/340 Three letters picked without replacement from ggggagagggga. Give prob of picking 1 g and 2 a. 27/220 Two letters picked without replacement from ouonpnxc. Give prob of picking 1 p and 1 u. 1/28 Calculate prob of picking 2 v when two letters picked without replacement from {v: 2, r: 1, u: 1}. 1/6 Calculate prob of picking 2 i when two letters picked without replacement from eiiiiiie. 15/28 Three letters picked without replacement from {b: 2, r: 1, v: 8, u: 2, d: 7}. What is prob of picking 2 b and 1 v? 2/285 Calculate prob of picking 2 f when two letters picked without replacement from ebgggegebgggffgeeegg. 1/190 Three letters picked without replacement from xezeeexexeexexexee. What is prob of picking 1 x and 2 e? 55/136 What is prob of picking 1 i, 1 y, 1 u, and 1 x when four letters picked without replacement from {i: 2, y: 1, u: 1, x: 4}? 4/35 Three letters picked without replacement from {a: 1, j: 11, i: 1, r: 1, o: 1}. Give prob of picking 1 r, 1 i, and 1 j. 11/455 Two letters picked without replacement from vvuvu. Give prob of picking 2 u. 1/10 Four letters picked witho	{ "pile_set_name": "DM Mathematics" }
0 for i. -2 Let p be -6(-1 - 2/4). Let j(w) = -w3 - 7w*2 - 2w + 24. Let z be j(-6). Solve 2t + 2g - 12 = z, 0 = -5t + 3t + 5g - p for t. 3 Suppose -4i + 3i - z = 0, 4z = 4i - 16. Suppose 10 = 7o - io. Solve -12 = ov - 4f, 4v - 3f + 8f - 2 = 0 for v. -2 Let u(g) = 2g - 1. Let h be u(-1). Let a = 0 - h. Suppose -2 - 5 = -2i + ao, i = o + 3. Solve -2w + n = 2w + 8, 2w = 2n + i for w. -3 Suppose -m + 5x = -0x + 10, -4m = x - 23. Suppose 3 = -v, -22 = -5o + 5v + 8. Let k be 4/6 - 2/o. Solve -my + 25 = k, r = -0r - 5y + 24 for r. -1 Suppose -4t + t + 102 = 0. Solve c - t = -5o + 4c, 2o + 4c + 2 = 0 for o. 5 Let j be (1 - -1)/(-1 + 3). Suppose 5d = 3b - 2b - 14, -5b = 2d + 11. Let q = j - d. Solve k - 3 = n, 0 = -5n - 4k + q + 8 for n. 0 Suppose a + 8 + 10 = -4o, -2o = -3a + 16. Solve 2v + 0 = -az - 2, 4z - 3v = -32 for z. -5 Let s be (2/6)/(19/57). Let v = 1 - 1. Solve -5g + l + 17 = v, 4g + 2l - s = 21 for g. 4 Let a = -79 - -88. Solve -5l + k = 23, -l - 5k - a = 6 for l. -5 Let j be (-6)/(-15) + 216/10. Let c be 62/j - 4/(-22). Solve -2l = -4r + 6, 2r + 2 = -l - cl for r. 1 Suppose 10d - 29 = 11. Solve 4o = p + 16, dp = o - 2 - 2 for o. 4 Suppose -3k + 9 = -0k. Let m(q) = -3q2 + kq - 2q + 2q*2. Let z be m(1). Solve z = -4u - 4g + 8, 9 = -2u + 5u + 2g for u. 5 Suppose y - 12 = -3y. Let n(c) be the first derivative of -c4/4 + 2c*3/3 + 3c*2/2 + 3c - 5. Let w be n(y). Solve b - f - 11 = -b, 4b = -wf + 7 for b. 4 Let p be (2-1)/(3 - 5). Let g be 6 - (3 + -2)p. Let u be 2 - (1 + (-2)/2). Solve -m - uc - 16 = 3c, 4m = gc + 11 for m. -1 Suppose -a = -4f + 93 - 23, 0 = -2a - 4. Let q = f + -13. Solve 4c - 1 - 2 = 5d, 2d = -qc - 18 for c. -3 Let s = -7 - -12. Solve 5y - 4j + 30 = 0, y + 19 = 4y + sj for y. -2 Let h(x) = x - 2x - x2 + 1 + x3 + 3x. Let k be h(0). Solve 2m - 22 = -5d + 9, -k = 3m - 2d for m. 3 Let p(z) = -z*3 - 7z*2 - 8z - 7. Let t be p(-6). Let r = 42 + -34. Solve 3k + 13 = td, 3k - k = r for d. 5 Suppose 2x + 3 = -5. Let n be (4 - 1) + x + 4. Solve -2v + 5 = 4w + 3v, -w = -nv - 14 for w. 5 Suppose 5n - 20 = 5f, 0n + 8 = 2n + f. Suppose 0 = 2k - 10, -nk = -v + k - 23. Solve -13 = -3w + 5h, 3w - vh = 2h + 8 for w. -4 Let u = -15 + 17. Solve us = 5f, -f + 0 = 2 for s. -5 Let q = 78 + -76. Solve 5z = -2w + 6w + 40, -qz = -5w - 33 for w. -5 Suppose -18 = -3k - 4h, -4k + k = -4h + 6. Suppose -28 = -kj - 4z, -z + 3z - 8 = 0. Solve 0 = 4u + 5i - 6, -3u = -5u + 2i - j for u. -1 Let s = -14 - -23. Let t = s - 3. Solve -4d = -16, -t = -4y + 4d - 34 for y. -3 Suppose 0 = r - 4a + 1 - 2, -2 = -2a. Solve -rh - 21 = -m, 2m + h + 1 = -m for m. 1 Let r(b) = 2b*3 + 3b + 3. Let m(l) = -3l3 - l2 - 2l - 3. Let c(p) = -3m(p) - 4r(p). Let h be c(-4). Solve 5x - 25 = 5w, 5w + 4 = -hx - 1 for x. 2 Let n be (-2 + 0/2)-2. Suppose r = g - 5, -g + 0r + 14 = -nr. Suppose 61 = 3v - 4a, 5v - 2a = 25 + 58. Solve -gd = 3d + 2j + v, -5 = -d - 2j for d. -5 Suppose 0 = -7c + 3c. Suppose 4u - u = 12. Solve 1 = 5x - u, c = -3f + x - 1 for f. 0 Let v be 5 - (-3 - (-2 - 4)). Solve -vm = y - 5m - 8, 0 = 3y + 2m + 9 for y. -1 Suppose t = r + 16, 5r - 4 = -2t + 3t. Let m be (-21)/((-4)/10). Let b = 8 - m. Solve -5u - l = l + t, -2l - b = -u for u. -3 Let b(t) = t + 3. Let q be b(-4). Let u be (q + 4 + -1)4. Solve -2d + 9 = -3j, 5d - 3j - 10 = u for d. 3 Let t = 4 + -4. Solve o - 4q = -23, -5q = -3o - to - 34 for o. -3 Let x = 4 + -2. Solve -16 = 4l - xr, -l + 12 = -4l + r for l. -4 Let n(j) = j*3 + 11j*2 + 9j - 10. Let r = 13 - 23. Let d be n(r). Solve -o + 4 = -v, d = 4v + 2o - 1 - 7 for v. 0 Let q(g) = g + 17. Let z(m) = -m - 17. Let c(y) = -3q(y) - 4z(y). Let w be c(-15). Solve 4n - f - f + 10 = 0, 2n = wf - 10 for n. 0 Let j(d) = -d + 9. Let p be j(6). Solve -2n - 1 = 2u - p, 5u = n - 13 for n. 3 Let s(n) = 5n2 - n. Suppose 0 = -0t - 3t + 3. Let i be s(t). Solve -v - 20 = -5y - 6v, 4y - v + i = 0 for y. 0 Let l be 172/(-6) - (-2)/(-6). Let v = -21 - l. Suppose -vb + 3b + 25 = 0. Solve -5y - 30 = s, 1 = -bs + 3y - 9 for s. -5 Let g(q) = q3 + 3q*2 + 2q + 4. Let d be -3(-2)/(-3) - 1. Let c be g(d). Let o be ((-1)/c)/(6/36). Solve 5n = -3t - 28, -3t + 7 = -on + n for t. -1 Let m = -8 - -12. Suppose 15 = d + md. Solve -o = du + 8, 2 = 3o - 4u - 0 for o. -2 Let a(n) = -n3 + 2n*2 + 3n - 4. Let r be a(2). Solve 7i - ri - 4t = -8, 5t - 10 = -5i for i. 0 Let m = 2 - 0. Let b = m - 2. Solve -2o + bo - y = -9, 3o - 2y = 3 for o. 3 Suppose 14 = -2w - 36. Let j = -5 - w. Suppose -2t + 12 = 2a, -7a + 8a + 2t - 10 = 0. Solve -5g = -2c - j, 3g + 2c + a = -g for g. 2 Let g(m) be the first derivative of -m3/3 + 3m*2 + 7m + 1. Let b be g(6). Solve q - t - 6 = 0, 2t + 2 = q - b for q. 3 Let j(w) be the first derivative of 2/3w*3 - w + 0w*2 + 11/4w*4 - 3. Let l be j(1). Solve -3u + g = -3, -u + l = -6g + 2g for u. 0 Let a be 321/2. Solve 6 = aw - w + 4d, 5w - 6 = -d for w. 1 Suppose -4 = -12v + 10v. Solve -2d = 2b - 2, b - 2d = 4b - v for b. 0 Let j(h) = 2h*2 + 33h + 20. Let a be j(-16). Let c(r) = r - 1. Let g be c(3). Suppose -3b + g = -16. Solve -5n + b + a = -x, 0 = n - 3 for x. 5 Let s(d) = -1 + 2d - 2d + d. Let w be s(4). Solve -4u + 14 = -2b, -2b = wu - b - 8 for u. 3 Let q(c) = -c*3 - 5c*2 - 4c + 4. Let l be q(-4). Solve li - i = 4u + 1, 1 = -3u + 2i for u. -1 Suppose -1 + 3 = o. Suppose -7 = -5y + ox + 9, 5x = 5y - 10. Solve 3m + 8 = 2, -w + 11 = -ym for w. 3 Let u = 7 + -5. Let b = u + 0. Suppose 0 = -bt + 2k + 10, 2t = -3k - 5. Solve 2a - 2x = -2, 3x - 4 = ta + 3 for a. 4 Suppose -g - 3g - 5 = 5a, 5a - 2g - 25 = 0. Solve ao - 7 - 10 = -p, -o + 4 = 0 for p. 5 Suppose y + 3f = 17, -5y + 6f - 2f + 28 = 0. Let b = y + -4. Solve 3z + 3o = bo, 5z = -4o for z. 0 Let m be (0/(3 + -5))/(-2). Suppose m = 3r - 6r + 75. Suppose -u = 4u - r. Solve -5s + 3s + 18 = 5l, us - 18 = l for s. 4 Suppose 3b - r - 16 = 10, 5b = -3r + 20. Solve -2w - 5g = b - 2, -7 = w - 2g for w. -5 Let x be (-1)/(((-6)/(-9))/(-2)). Suppose 0f + 120 = xf. Solve a + 4w = -0a + 24, -5a - 4w + f = 0 for a. 4 Suppose -4l + 9 = -h + l, -4h - 4l + 36 = 0. Let c = -61 - -64. Solve 4q + 5f - 8 = 0, -2q + 0q = cf - h for q. -3 Let i be (-2527)/(-285) - 4/(-30). Solve 3q - 4s + 20 = 0, -4s + 11 + i = -4q for q. 0 Suppose 15p = 56 + 34. Solve -4 = -4n - 4t, 4t - pt = 4n for n. -1 Let p = 14 - 9. Suppose 15 = po - 10. Solve -1 = i - 4r, 2i - 3i - 1 = -or for i. -1 Let x = 1 - -1. Let g be 6/(-3) + (-14)/(-2). Solve -2w + n - 2n = -1, -4n - x = gw for w. 2 Let p be (8/(-3))/((-6)/18). Solve x - p = 4k, 3k + 5x = k - 26 for k. -3 Suppose -5 = -2b + 15. Solve 3x + 2q + 0q - 15 = 0, 2x - b = -q for x. 5 Suppose -4y - 2f = 4, -4y + 2y - 2f = 4. Solve -3c - 2c - 20 = 2p, 5c + p + 15 = y for c. -2 Let n be 6/3 + (-1)/(-1). Suppose -u + nu = 6. Solve -2k - ud + 2d = 5, -2k - 5d = -15 for k. -5 Let j = -6 - -7. Let o = 4 + j. Let q = -6 - -8. Solve qk - 3x = -ox, -2k + 5x = 7 for k. -1 Let z(x) = 1 + 2x - 5x - 2. Let n be z(-1). Suppose 2w - 27 = -1. Solve -4v + 3y = -5 + w, 2y = -v - n for v. -2 Suppose 3n - 2n - 21 = 0. Let x = n + -16. Solve w - 2 = 3t - x, w + 4 = 4t for t. 1 Suppose -2z - 8 = -5i + 4, -5z + 32 = 3i. Solve 2s - 12 = -zg, -4g = -s - 0s for g. 1 Let k be 24/(-12) - (2 - 31). Solve -3u + k = -4v, 22 = v + 5u - 0u for v. -3 Let p(c) = -c3 + c2 + 4c - 1. Let n be p(3). Let q = 12 + n. Suppose 2l + 6 = ql. Solve -j = 6w - w - l, -2w - 7 = 3j for w. 1 Let d(z) = z*2 + 8z + 9. Let k be 1 - (24 - 0)/3. Let o be d(k). Suppose -2n = on - 40. Solve 2s = 3f - 14, -n = s + 2s + f for s. -4 Suppose 8 = 17z - 15z. Solve -c + 4i = -1 + 16, 24 = -zc + 4i for c. -3 Suppose 0c - 26 = -c. Solve -5i = -b - 10, -c = -i + 9b - 4b for i. 1 Suppose -10 = -5n + 5. Suppose -5x + 5y + 5 = -5, -nx - 4y = -6. Solve -1 = -3b - xv + 8, 17 = b - 4v for b. 5 Let w be 405/25 - 2/10	{ "pile_set_name": "DM Mathematics" }
)/(12/105). 88 Let u(i) = i*3 - 4i*2 + 4i - 6. Let r be u(4). Suppose 0 = 3d - 2d - r. Let k(z) = -z*2 - 7z - 6. Calculate the least common multiple of k(-5) and d. 20 Let l = 1/3235 + -274989/45290. Calculate the common denominator of 29/2 and l. 14 Find the common denominator of -57/14 and 12/(-15) - 1371/30. 14 Let v(z) = -2z. Let u(w) = -w2 + 3w. Let c(s) = -2u(s) - 5v(s). Calculate the lowest common multiple of c(-3) and 12. 12 Suppose -4r - 36 = -3t, 4r + 12 = 4t - 3t. Find the common denominator of ((-438)/9)/((-16)/t) and -23/12. 12 Let f(l) = l3 - 6l*2 + l - 1. Let x be f(6). Suppose -52 = -xg + 38. Let m = -8 + g. Calculate the least common multiple of m and 14. 70 Calculate the common denominator of (-59)/5 - (-2)/(-4) and 121/6. 30 Let g(a) = 13a - 2. Suppose 6 + 11 = l + y, -120 = -5l + 2y. What is the lowest common multiple of l and g(2)? 264 Suppose 3 + 2 = -5a. Calculate the common denominator of 36 and 1 + (a - (-33)/12). 4 Let q(b) = 2b + 14. Calculate the lowest common multiple of 12 and q(6). 156 What is the common denominator of (-20)/5 - (-46)/14 and 1/8? 56 Find the common denominator of (-54)/(-48)(-6 + -1) and 5/4. 8 Suppose m = 5m + 5i + 25, 4m = -2i - 10. Suppose m = -3t + w + w + 23, -5w = 5t - 80. Calculate the least common multiple of 7 and t. 77 Let y be (-26469)/(-12) - 1/(-4). Let t = -15500/7 + y. Calculate the common denominator of t and -22/3. 21 Let j(v) = 2v - 1. Let i(d) = -4d3 + d2 - 1. Calculate the lowest common multiple of i(-1) and j(5). 36 Let g = -8 - -16. Calculate the lowest common multiple of 9 and g. 72 Let q be (-3)/(-1)-13 + 0. Calculate the common denominator of -115/12 and q/18 + 1 - 4. 12 Let g = -3584 + 42971/12. Suppose 38 = 4o + 2a, 0o + 3a = 5o - 42. Find the common denominator of g and (3/o)/(2/97). 12 Calculate the common denominator of -7 - -3 - 11/18 and 31/7. 126 Let y(l) = l3 - l2 - 6l + 7. Let k be y(5). What is the common denominator of (-2)/8 - (-235)/36 and k/(6/31)? 18 Suppose -5z - 14 = 4t - 41, 2t - 14 = -2z. Calculate the smallest common multiple of t and 50. 200 Suppose -3f + 2 = -f. Suppose f = -4s + 25. Calculate the smallest common multiple of (-2)/3(-3)/2 and s. 6 Let a = -56 - -76. Suppose 0 = o - 3o + 6. Calculate the lowest common multiple of a and 2o - (2 + 0). 20 Let n = 4642 - 102045/22. What is the common denominator of n and 6/12 - (-210)/(-49)? 154 Let r = -215465/944748 - 2/10269. Calculate the common denominator of r and -97/10. 460 Let l = -204965/7 - -29181. Let b = 201/2 + l. Let t = 133213/16 + -8323. Find the common denominator of b and t. 112 Suppose 8 = k - 3d - 7, 5k - 64 = 4d. Calculate the lowest common multiple of 3/(-2)(-56)/k and 1. 7 Let x = -1/44 + -206/11. Let h = -1 + -3. Calculate the common denominator of x and (-9)/h - 2/(-12). 12 Let u(f) = f*3 + 9f*2 - 2f + 4. Suppose -4r + 48 = 3h - 5r, 0 = -5h - 2r + 69. Let g = -24 + h. Calculate the least common multiple of u(g) and 10. 110 Let i be 10/1685414/(-10). Let b(k) = -594k. Let r be b(9). Let a = i - r. Calculate the common denominator of a and 5/18. 72 What is the common denominator of 57/(-54) - 3 - -3 and 57/20? 180 Let k(c) = c2 - 3c + 7. Calculate the least common multiple of k(3) and 20. 140 Let u(g) = 326g2 - 2g + 1. Let l be u(1). Let z = l + -1221/4. Let p = 4/239 - 11241/478. Calculate the common denominator of p and z. 4 Let n be (13682/(-6))/(696/9). Let h = -3/232 + n. What is the common denominator of h and 127/12? 12 Suppose 9s = 4s + 80. What is the least common multiple of 20 and s? 80 Let c = 225/121 - 5/121. Suppose -2g - 1 = -11. Calculate the common denominator of g and c. 11 Let m = 84 + -754. What is the common denominator of (3/(-4))/(135/m) and -71/14? 126 Suppose -h = -2m - 11, -4h + 5m - 16 = -66. Calculate the least common multiple of 10 and h. 30 Let x = 17 + 6. Let f = x + -7. Calculate the smallest common multiple of f and 14. 112 Let i(j) = 2j + 6. Suppose -38 = -5n + 22. What is the lowest common multiple of i(n) and 11? 330 Let i = -3 + 15. Suppose 2n + 20 = 5p, -2n + 0 = p + 8. Calculate the smallest common multiple of p and i. 12 Suppose 15 + 3 = 2a. Calculate the lowest common multiple of (-6)/a + (-28)/(-6) and 4. 4 Find the common denominator of 77/16 and (3(-776)/300)/(8/(-5)). 80 Let d(o) = -3o + 10. Let b(p) = -2p + 11. Let n(y) = 2b(y) - 3d(y). What is the lowest common multiple of n(6) and 12? 132 Let m(g) = 3g*2 - 4g - 2. Calculate the smallest common multiple of m(2) and 1/4 + 43/4. 22 Suppose -18 = -4s + 6. Suppose s = -2f + 28. What is the lowest common multiple of f and 7? 77 Calculate the common denominator of 151/36 and 2/(-9) - 7/(-70)-5. 36 Let p(b) = -5b + 27. Calculate the least common multiple of 22 and p(3). 132 Find the common denominator of 2022/(-432) + 2/16 and (-265)/30 - 1-1. 18 Let i be (-1084)/(((-12)/33)/(-2)). Let u = 65627/11 + i. What is the common denominator of 13/2 and u? 22 Let j = -3 - -5. Let s be (54/j)/((-9)/(-6)). Let u = 13 + s. Find the common denominator of u and 89/10. 10 Let o = 1416805/119814 - 674/57. Let m = -59383/3153 + o. Find the common denominator of 101/6 and m. 6 Let j = -62 + 87. What is the lowest common multiple of 50 and j? 50 Calculate the common denominator of -56/3 and 24/44 - -2 - 0. 33 Let z = 2/1975 + -61239/13825. Let x = 3413/5 - 695. What is the common denominator of z and x? 35 What is the common denominator of (1/4)/(18/(-1314)) and 17/13? 52 Let r = -11 - -12. Calculate the lowest common multiple of 8 and r. 8 Suppose 3i - 109 = 4i. Let r = 8605/16 + -538. What is the common denominator of i/(-10) + 2 + -1 and r? 80 Let c be (15/10)/(1/2). Calculate the common denominator of -95/2 and ((-14)/4 - -1) + c. 2 Let x = 3 + -1. Suppose s - 5i = -3s + 18, -s + 5i = -12. Suppose xy = -sy + 24. Calculate the smallest common multiple of y and 14. 42 Suppose 0u - 21 = -3u. Let z = -2 - -4. Suppose -zo - 33 = -5o. Calculate the lowest common multiple of u and o. 77 Let n(f) = -f*3 - 2f*2 - f. Calculate the smallest common multiple of 11 and n(-2). 22 Find the common denominator of 33/8 and ((-10)/80)/(2/396). 8 Suppose 0 = 3i - 3 - 0, -3n - 3i + 3 = 0. Find the common denominator of 0 + (278/(-24) - n) and 1 - (-1 + 75/14). 84 Let l = -261/5 + 5416/105. Calculate the common denominator of -71/12 and l. 84 Calculate the common denominator of 15/(-18)(-170)/50 and -25/8. 24 Let t = 0 + 4. Let q = -28 - -37. What is the lowest common multiple of q and t? 36 Suppose 12 = -v + 52. Suppose -u = 3u - v. Calculate the smallest common multiple of 7 and u. 70 What is the common denominator of 16/3 and 2/8171/(-6)? 24 Let v be (-1)/((-26)/(-24) + -1). Let x(d) = d3 - d2 - 2d + 1. Calculate the lowest common multiple of x(2) and ((-9)/(-6))/(v/(-32)). 4 Suppose 4 = -j, 0 = 5a - 5j + 11905 + 5295. Let f = a - -6784. Let d = f - 13291/4. What is the common denominator of d and 71/9? 36 Suppose 0 = -5a + 7a - 40. Calculate the lowest common multiple of a and (-6)/(-4) - (-1)/2. 20 Suppose 2g = 3g - 3. Suppose -gw + 6w = 12. Suppose -1 = -wj + 31. What is the smallest common multiple of j and 18? 72 Suppose -4u = -5u - 2. Let w be (-21)/((-1)/(-1 - u)). Suppose -3x + w = -9. What is the least common multiple of 8 and x? 40 Find the common denominator of 8/17 and 12/88/42. 119 Let a(h) = 3h*3 - h + 1. Calculate the smallest common multiple of a(1) and 11. 33 Let t = 10 + -6. Suppose tz - 24 = z. Calculate the smallest common multiple of 4 and z. 8 Suppose -20 = 4c - 268. Let s = -10 + c. Suppose -2m + s = -4l, l + 7 = 2m + 6l. Calculate the least common multiple of m and 4. 16 Let g = -7339/144 + 439/9. Calculate the common denominator of 61/2 and g. 16 Suppose f = 1 + 3. Let o = -98 + 106. What is the lowest common multiple of f and o? 8 Let y = 5 - 3. Suppose -z = -yz + 8. Calculate the smallest common multiple of z and 18. 72 Suppose 0 = -4d - 4y - 40, 0 = d + 5*y - 14 + 4. Find the common denominator of 2/(-3) + 146/24 and (59/55)/((-6)/d). 132 Let i be ((-3141)/12)/(1/(-4)). Let t be (-4)/18 - i/27. Let c = 350/9 + t. Find the common denomin	{ "pile_set_name": "DM Mathematics" }
t t(r) = r + 3. Let p be t(3). Suppose 225 = -41c + 111 + 196. Solve -15 = -4z - 5b, -z - b = -cb - p for z. 5 Let y(r) = -2r3 + 6r*2 - r + 3. Let t be y(3). Let g = 0 - t. Suppose 15 = -gw + w. Solve j = -z + 5, 0 = -5z + w for j. 2 Suppose 2q + 4o = 20, 16q - 11q - o + 5 = 0. Solve -4w = -ql + l + 15, -l - 12 = 3w for l. -3 Let g = 17 + -8. Let t be 7 + (-8 - (-7 - 4)). Suppose -3 = -tf + gf. Solve 2v = 2j + 2, -v - fj - 9 = 2 for v. -2 Let d(n) = -5n*2 - 36n - 3. Let z be d(-7). Suppose -327i + z = -326i. Let x be 101/(2 + -1). Solve l + 3l = ip - 8, -l = -3p + x for p. 4 Suppose -16j = -12j - 8. Suppose 0 = -16m + 13m - 405. Let l be (-435)/m + (-4)/18. Solve -5 - 3 = -jx + li, -2i = -4x + 16 for x. 4 Let z(r) = 4r - 8. Let v be z(6). Suppose -20i + vi + 12 = 0. Suppose -6a = -ia - 9. Solve 3s + au - 27 = 0, -3s - s + 3u = -1 for s. 4 Let s(z) = 15z2 + z3 + 6z2 + 8z + 17z2 - 47z*2 + 5. Let i be s(8). Suppose 6 = f - it, f - 3f = -t - 3. Solve b = -v, -b - 2v + 1 = -f for b. -2 Let i = 15722 - 15721. Solve -i = -q, 0 = 3f + 33q - 31q - 8 for f. 2 Let k = -31 - 61. Let w = -62 - k. Suppose 3s - s = w. Solve 2v - s = -5g - 3, -v - 3 = -2g for g. 2 Suppose 27 = -w + 4w. Suppose 5z - 2 - 48 = 0. Suppose zk = wk + 6. Solve n = -t - t + 2, k = -2t - 3n for t. 3 Suppose 0 = -2y - 2, -3v + 10 = 3y - 2. Solve j = -vt + 2, 2j = -4t + 7j + 19 for t. 1 Suppose -3a - 134 = -4n - 158, -a + 13 = -3n. Solve ah = 2k - 0 + 6, -3h - k = -12 for h. 3 Suppose 4 = 2f, q + 0f + 2f - 123 = 0. Let i = q - 184. Let m = i + 69. Solve -3y + m = -2s - 2y, 4y + 17 = -3s for s. -3 Let n(a) = 61a - 364. Let f be n(6). Let j be (7 - 2) + 2/(-2). Suppose 0 = 5y - 2u - 21, 0u = -4y - ju. Solve 3b = 3x, -4x + fb - 1 = -y for x. 1 Suppose -17l - 339 + 390 = 0. Solve -21f = 5r - 17f + 21, lf - 3 = 0 for r. -5 Let y = 58 - 50. Suppose -yz + 7 + 9 = 0. Suppose 4a - 4u - 15 = 25, 5u = -25. Solve -o + 28 = al, -4o = zl + l - 27 for o. 3 Suppose 2v = 3n - 269, 5n = v + 506 - 46. Solve -90g + ng + 5m - 40 = 0, 10 = 2m for g. 5 Suppose -48a - 6 = -50a - 4b, 0 = 5a - 3b - 28. Solve 18l = -4u + 23l - 8, 3u = -al + 29 for u. 3 Let t(c) = -c2 - 7c - 2. Let w be t(-6). Let s be 23 + -10 - (w - 1). Suppose 13g = 8g + 5. Solve 4j = -x + 2x - s, -j + g = -2x for j. -3 Suppose 15 = 3x + 2j - 3, -5x + 3j = 8. Solve 2u + x = -z, 15z - 2u + 14 = 20z for z. 4 Let i(w) be the first derivative of 2w*3 + 3w*2 + 30. Let a be i(3). Suppose -11p - 28 = -a. Solve -n = pn - j + 12, -n - 12 = -5j for n. -2 Let p(t) = 8t - 33. Let j be p(4). Let b be 0/(21/(-7)) - (j + -1). Solve 0 = -3r + 9, -r + 17 = 4k - br for k. 5 Let j = 75 + -72. Suppose d - 4 = -js, -2s - 6 = d + 3s. Solve 3 - d = 2n + 2g, 2n - 12 = 5g for n. -4 Suppose 0 = -5o - g + 181, g + 55 = 5o - 124. Let b be -2(-3 - -1)45/o. Solve 0 = -m - m - 10, d - bm - 20 = 0 for d. -5 Suppose 3z + 93 = 6z. Let h = 34 - z. Suppose hq - 13 = -3y + 4y, -2y + 7 = 5q. Solve a - qi + 13 = 0, -a + 2i - 3 - 5 = 0 for a. 2 Suppose 113 - 33 = 16w. Let z be 2 + -1 + 6 + -4. Let y be z/(-4) + (-15)/(-4). Solve -5l + yq = -2, wl + 4q = 15 - 6 for l. 1 Suppose 2230 = -11d - 685. Let w = -261 - d. Solve 2x - 12 = 5u, -4x = 4u - 9x - w for u. -4 Let a be 15 + 1 - (0 - -13)/(-13). Suppose 12i - 7i = 15, -i = -4q + a. Solve 4c - d - 2 = 0, -4c - 5 = qd + 5 for c. 0 Let f(t) = 23t + 15. Let x be f(3). Let r(g) = -25g + 5. Let u be r(-3). Let w = x - u. Solve -3n = -2i + 13, -4i + n + 17 = wn for i. 5 Let p = 6 - 1. Suppose -9f - 15979 = 2f - 16023. Let i be (3/(-1) - -11)/2. Solve 3s - i = 5c, 3c - pc - f = -2s for c. 1 Let i = -161857 - -161861. Let n be (-9)/(-6)4/3. Solve -nv + 1 = -if - 5, 2v + 30 = -5f for v. -5 Suppose 7a + a = 0. Solve 0r + 2r + 2k = 4, 2r - 3k + 21 = a for r. -3 Let a(n) = 3n3 + 10n*2 - 6n - 4. Let j be a(1). Solve 2z - 3p - 14 = 0, 4z + 3p - j - 7 = 0 for z. 4 Suppose 59 = 4v + 5u, -4v + 3u - 665 = -764. Solve -2b = 3d + 12, 2b - 4d - v = -5 for b. 0 Let c = 24340 - 24336. Solve cm - 5b = -22, -45m = -47m + 3b - 12 for m. -3 Let g = -26 + 36. Suppose 4d + 3l + 1579 = -d, 0 = 5d - 3l + 1561. Let r = d + 316. Solve r = -c - 3z, -z = -5c - 6z + g for c. 4 Let t(z) = 3z2 - z - 2. Let s be t(-2). Suppose 3a - s = -a. Let h = 3 - a. Solve -5j = 5l + 25, 0 = -5l + j - h - 1 for l. -1 Let d be (1 - (1 + -2)) + -2. Let k(i) = 16i - 49. Let q be k(14). Let v = q + -166. Solve v = -4f + 2n - 11, d = -f - n + 1 for f. -3 Suppose 5w + 5n = -340, 5w - 5n + 419 = 99. Let h = -61 - w. Suppose -4 = 3j - hj. Solve -5 = -r, jy + 3 + 0 = -r for y. -4 Suppose 3g = 5c + 13, 0c + 30 = -2c - 5g. Let w = 7 + -8. Let o be (-1)/w - (-6 + (-20)/c). Solve -u = -5u - 4, os = -5u - 11 for s. -2 Let y = -53 + 117. Let q = -61 + y. Solve 2g = h + 10, g - 15 = -qh - 2g for h. 0 Suppose -6n + n = -15. Suppose 17b = 13b - 1704. Let w = 430 + b. Solve -2x = j + w, 0x + nx = 2j - 20 for x. -4 Suppose 7c - 11c = 4u + 4, 4c = -2u - 8. Suppose -5x + 42 = ux. Suppose 2j = -x + 12. Solve 17 = -jb - 5i, -b - 3i = -0i + 11 for b. 1 Suppose 5z + 0z - 35 = -5h, 5h = 4z + 8. Let l be 129/h + 7/(-28). Suppose -3p + l = p. Solve 5v = -2m - 28, -3v = -5m - 0m - p for m. -4 Suppose -w + 2 + 3 = 0. Let v = 1324 + -2018. Let j = v + 697. Solve 0 = -3z + j, 6c + w = 4c - 3z for c. -4 Suppose -5i + 11z = 12z - 32, 3z = 3i - 12. Solve 0n + 4d - i = 2n, 0 = 3n - 3d + 3 for n. 1 Let t = -185 + 190. Suppose -4s = t - 25. Solve -2c = 2c + 5a - 31, -5c - sa + 35 = 0 for c. 4 Let m = 396 - 387. Let f be (m + (-10)/5)2. Solve 3 = 2k + 1, -5t + 4k - f = 0 for t. -2 Let c(h) = -49h2 - 6h - 11 + 14h + 48h*2. Let s be c(3). Solve -3r + 5n = 1, -4r - sn = n + 13 for r. -2 Suppose -5w + 10 = -5b, w - 5w - 4b + 24 = 0. Solve 2t + w = 4z, -5z + 18 = -82t + 86t for z. 2 Suppose 4g = -4, 7v + g + 56 = 8v. Suppose 11a + v = 77. Solve 4q = -5p - 8, -3q + a = -4p - 23 for q. 3 Let c(v) = -v*3 + 18v*2 - 18v + 329. Let a be c(18). Solve 3f + 3d + 24 = -0f, 5 = -4f + ad for f. -5 Let t(f) = -1497f - 2972. Let m be t(-2). Solve 6q - q = -j - 33, 2q - m = 4j for j. -8 Suppose -5z + 125 = -n + 4n, -3n = -z - 155. Suppose -n - 106 = 3d. Let o = d + 54. Solve v + 5g + o = 4g, -2 = g for v. 0 Suppose -16f + 120 = -10f. Suppose 0 = 14k - 8 - f. Solve 4c - 3w = kw - 17, 2c - 2w = -8 for c. -3 Let j = 280 + -275. Suppose 7n - 11n = 20, 5n + 45 = jf. Solve -u = b - 1, 0 = u + u + fb - 12 for u. -4 Suppose 5j - 10 = 0, 5b - 3j = -j + 3041. Let r = 611 - b. Let y = -1 + 3. Solve 0 = -yf + 2m + 8, -rf - 3m - 4 - 8 = 0 for f. 0 Let x be 2-1 + 120/30. Suppose -xf = -8f. Solve -3m + 2a = -9, 0 = -fm - m + 4a + 13 for m. 1 Suppose -4b - 6o = -8o + 34, -3b + 2o - 28 = 0. Let r be (-32)/b(-48)/(-64). Solve 4j + rv + 12 = 0, -3v = -j - 4 + 1 for j. -3 Let i be 1(2/(-3))/((-7)/42). Suppose 0 = -iu + 2x + 78 + 20, -5u - 2x + 145 = 0. Let g = -24 + u. Solve -4f = k + 1 + g, 4k - 4f + 16 = 0 for k. -4 Suppose -6v - 14 = -5a - 3v, 2v - 4 = 0. Suppose m + 3s - 2s = -1, s = 5m - 19. Solve -15 = 2r - md, ar - 3r = -5d + 12 for r. -3 Suppose 4k = q - 25, 5q - k - 39 = -9. Let n(a) = 78a - 4444. Let f be n(57). Solve 0 = -3c + fu + 9, qc - 15 = -0c + u for c. 3 Suppose 34 - 10 = -3m. Let j = m - -20. Solve -4t - j = -0t, 4l - 7 = t for l. 1 Suppose 2p + 6 = -s + 5s, 4s + 2p = 26. Let q(d) = -d*2 + 10d - 22. Let c be q(s). Solve 0 = u - v - cv - 5, 5u - 2v + 14 = 0 for u. -4 Suppose 270y - 2 = 269y + 2. Solve -yf = -8f, -4r + 3f + 0f = 0 for r. 0 Let m be (-5 - 1)(-3)/9. Suppose -2j + 12 = -k, -mk - 28 = -10j + 5j. Solve 5u + 2 = d + 4u, -u - 8 = -jd for d. 2 Let g = 397 + -404. Let q(v) = v*2 - 3v - 66. Let x be q(g). Solve 3j = 3p + p - x, -2p + j = 0 for p. -2 Let y(v) = 5v + 118. Let t be y(-19). Let h(s) = 3s2 - 69s + 4. Let m be h(t). Solve -5k + 24 = -3d, -m*k =	{ "pile_set_name": "DM Mathematics" }
5 - 15y*4 - 37y*3 - 9y*2 + 38y + 24 = 0. Calculate y. -12, -2, -1, 1 Solve 10o2 + 532o + 624 = 0 for o. -52, -6/5 Factor -w*2/11 + 1510w/11 + 1511/11. -(w - 1511)(w + 1)/11 Determine y, given that 3y*2 - 9y + 6 = 0. 1, 2 Let -5m2 + 200m + 420 = 0. Calculate m. -2, 42 Solve -f*2/2 + 159f - 25281/2 = 0 for f. 159 Factor -3r3 + 6r*2 + 69r - 180. -3(r - 4)(r - 3)(r + 5) What is a in 3a*2/4 - 19a/4 - 7/2 = 0? -2/3, 7 Factor -5y2 + 1915y + 3850. -5(y - 385)(y + 2) Find r such that -r*2 - 284r - 20164 = 0. -142 Let -2d5/11 - 6d*4 + 366d*3/11 - 526d*2/11 + 228d/11 = 0. What is d? -38, 0, 1, 3 Suppose 11z4/10 - z3/5 = 0. What is z? 0, 2/11 Determine g so that 2g*4/9 - 64g*3/9 + 764g*2/9 - 448g + 882 = 0. 7, 9 What is s in -s*2 - 48s - 572 = 0? -26, -22 Factor -3p2/5 - 66p. -3p(p + 110)/5 Factor 2j3 - 562j*2 + 40310j - 115926. 2(j - 139)2(j - 3) Let -90s4 + 705s*3 + 905s*2 + 355s + 45 = 0. What is s? -1/2, -1/3, 9 Find f such that 5f4 - 70f*3 - 115f*2 + 540f + 900 = 0. -2, 3, 15 Let -2w4/3 + 10w*3/3 + 2w*2/3 - 10w/3 = 0. What is w? -1, 0, 1, 5 What is u in -25u5 - 940u*4 - 2320u*3 - 1570u*2 + 185u + 350 = 0? -35, -1, 2/5 Let -2m5/5 - 16m*4/15 + 2m*3/3 + 12m*2/5 - 8m/15 - 16/15 = 0. What is m? -2, -2/3, 1 Factor -2l2 - 26l - 24. -2(l + 1)(l + 12) Solve -18o4/11 - 76o*3/11 + 10o*2/11 + 28o + 240/11 = 0 for o. -3, -20/9, -1, 2 Determine q so that q*2/6 + 534q + 427734 = 0. -1602 Let o*5/4 + 9o*4/2 - 63o*3/4 = 0. What is o? -21, 0, 3 Factor 3y*4/5 + 396y*3/5 - 1206y*2/5 + 1212y/5 - 81. 3(y - 1)3(y + 135)/5 Let -d*4/2 - 325d*3/2 - 12956d*2 + 40344d = 0. Calculate d. -164, 0, 3 Suppose -2g5 + 18g*4 + 2g*3 - 122g*2 - 168g - 64 = 0. What is g? -1, 4, 8 Determine k, given that k*4/5 + 26k*3/5 + 216k*2/5 + 486k/5 - 729/5 = 0. -9, 1 Suppose 7l4/3 - 1366l*3/3 + 188l*2/3 + 1366l/3 - 65 = 0. What is l? -1, 1/7, 1, 195 Solve 28u4 + 260u*3 + 744u*2 + 640u + 128 = 0. -4, -1, -2/7 Suppose 2q5/3 - 26q*4/3 + 82q*3/3 - 94q*2/3 + 12q = 0. What is q? 0, 1, 2, 9 Factor -5a4 - 5955a*3 - 2358150a*2 - 308095780a + 945671880. -5(a - 3)(a + 398)*3 Let -2s*2/15 - 38s/15 - 12/5 = 0. Calculate s. -18, -1 Determine x so that 2x2/9 - 2x/9 - 4/9 = 0. -1, 2 Factor -1720v3 + 1744v*2 - 454v + 6. -2(2v - 1)*2(215v - 3) Suppose 2r*5 - 2r*4 - 38r*3 + 2r*2 + 180r + 144 = 0. Calculate r. -3, -2, -1, 3, 4 Determine i so that -2i3/3 - 23i*2/6 - 13i/3 + 4/3 = 0. -4, -2, 1/4 Factor -2n4 - 194n*3 - 4400n*2 + 15000n. -2n(n - 3)(n + 50)2 Factor 2x*2 - 154x/13 - 12/13. 2(x - 6)(13x + 1)/13 Factor 4n*4 - 7112n*3 + 3161284n*2. 4n*2(n - 889)*2 What is r in -12r*3 + 16r*2 + 52r + 24 = 0? -1, -2/3, 3 Factor 5a3/3 - a2 - 5a/3 + 1. (a - 1)(a + 1)(5a - 3)/3 Let -4l*3 + 144l*2 - 564l - 1736 = 0. What is l? -2, 7, 31 Determine k, given that k*2 - 291k + 290 = 0. 1, 290 Suppose k*3 - 9k*2 - 34k - 24 = 0. Calculate k. -2, -1, 12 Determine t, given that t*2/7 - 22t/7 + 121/7 = 0. 11 Determine d, given that 5d3 - 55d*2 - 430d + 480 = 0. -6, 1, 16 Factor 7k2 - 32k - 15. (k - 5)(7k + 3) Factor n*2/3 - 61n/3 + 20. (n - 60)(n - 1)/3 Find v such that 5v*3/12 - 71v*2/6 + 259v/3 - 98/3 = 0. 2/5, 14 Factor -28q3 - 248q*2 - 640q - 384. -4(q + 4)2(7q + 6) Factor -3u*5 + 15u*4 - 27u*3 + 21u*2 - 6u. -3u(u - 2)(u - 1)3 Let 2j*5/3 + 26j*4/3 - 20j*3/3 - 260j*2/3 + 6j + 78 = 0. What is j? -13, -3, -1, 1, 3 Factor -22o3 + 432o*2/5 - 408o/5 - 32/5. -2(o - 2)2(55o + 4)/5 Factor -3s*4 + 114s*3 - 216s*2. -3s*2(s - 36)(s - 2) Determine j, given that 2j*4/11 + 10j*3/11 + 16j*2/11 + 8j/11 = 0. -2, -1, 0 Factor 4y2 + 7064y + 3118756. 4(y + 883)2 Solve m2/8 + 1427m/8 + 713/4 = 0. -1426, -1 Factor 2z2/5 - 2z/5 - 12. 2(z - 6)(z + 5)/5 Factor -d3/9 - d2/9 + d/9 + 1/9. -(d - 1)(d + 1)2/9 Let -4u*3 + 16u*2 - 12u = 0. What is u? 0, 1, 3 Suppose 5a3/6 - 35a*2/6 + 35a/6 + 25/2 = 0. What is a? -1, 3, 5 Factor 3n2/7 + 186n/7 + 1431/7. 3(n + 9)(n + 53)/7 Factor 2n4/5 + 112n*3/5 + 1676n*2/5 + 3024n/5 + 1458/5. 2(n + 1)2(n + 27)2/5 Factor -o4 - 12o3 + 139o*2 - 402o + 360. -(o - 3)*2(o - 2)(o + 20) Determine b so that 2b*5/9 - 34b*4/9 - 38b*3/3 - 118b*2/9 - 40b/9 = 0. -1, 0, 20 Factor 5y5 - 115y*4 + 480y*3 - 520y*2 - 400y + 720. 5(y - 18)(y - 2)*3(y + 1) Factor -10q4 - 6q*3 + 64q*2 - 24q. -2q(q - 2)(q + 3)(5q - 2) Factor 3h*2/2 + 1947h + 1263603/2. 3(h + 649)2/2 Factor -2d*2/13 + 32d/13 - 30/13. -2(d - 15)(d - 1)/13 Factor -3d4 + 96d*3 - 1044d*2 + 4320d - 5184. -3(d - 12)2(d - 6)(d - 2) Let 4o*5/5 + 104o*4/5 + 768o*3/5 + 1152o*2/5 = 0. Calculate o. -12, -2, 0 Solve 2p*4/9 + 232p*3/9 + 6490p*2/9 - 13924p/9 = 0 for p. -59, 0, 2 Factor w*3/4 - 54w*2 + 429w/4 - 107/2. (w - 214)(w - 1)2/4 Factor -3s*2 + 33s. -3s(s - 11) What is t in 242t4 + 396t*3 - 168t*2 + 16t = 0? -2, 0, 2/11 Let -8l4/3 + 14l*3 + 478l*2/3 + 106l - 110/3 = 0. What is l? -5, -1, 1/4, 11 Factor 5j2 + 45j + 40. 5(j + 1)(j + 8) Find x, given that x*2 - 17x = 0. 0, 17 Factor -5b3 + 50b*2 + 185b + 130. -5(b - 13)(b + 1)(b + 2) Find h, given that 2h*3/9 + 986h*2/3 + 121360h - 1095200/9 = 0. -740, 1 Determine w so that 28w5 + 132w*4 + 184w*3 + 48w*2 - 32w = 0. -2, -1, 0, 2/7 Factor -x*5/5 + 12x*4/5 - 22x*3/5 - 84x*2/5 - 49x/5. -x(x - 7)2(x + 1)*2/5 Find m such that -2m*2/3 + 106m/3 - 104/3 = 0. 1, 52 What is z in -z*2/4 + 95z/4 - 225/2 = 0? 5, 90 Factor -3t2 - 57t - 210. -3(t + 5)(t + 14) Suppose -11v3/4 - 9v*2/2 + 11v/4 + 9/2 = 0. Calculate v. -18/11, -1, 1 Factor -w*3/3 + 23w*2/3 + w/3 - 23/3. -(w - 23)(w - 1)(w + 1)/3 Factor -2v*2/15 - 4v/3 + 26/5. -2(v - 3)(v + 13)/15 Find v, given that 14v4 + 38v*3 - 12v*2 - 56v + 16 = 0. -2, 2/7, 1 Factor 5s3 - 70s*2 - 255s. 5s(s - 17)(s + 3) Solve -2a*3/3 + 14a*2/3 - 14a/3 - 10 = 0 for a. -1, 3, 5 Factor -2p3/13 - 6p*2/13 + 1008p/13 - 7776/13. -2(p - 12)2(p + 27)/13 Factor p5/8 - p4/2 - p*3 + 5p*2/4 + 23p/8 + 5/4. (p - 5)(p - 2)(p + 1)*3/8 Factor 15l*3 - 50l*2 - 235l + 550. 5(l - 5)(l - 2)(3l + 11) Find u, given that -4u2 + 10328u - 6666724 = 0. 1291 Let -y*3/7 + 2y*2/7 + 31y/7 + 4 = 0. What is y? -4, -1, 7 Solve v*5 - 10v*3 + 20v*2 - 15v + 4 = 0 for v. -4, 1 Let 2b4/7 - 36b*2/7 - 64b/7 - 30/7 = 0. Calculate b. -3, -1, 5 Factor -3c5/5 + 48c*4/5 - 291c*3/5 + 834c*2/5 - 228c + 120. -3(c - 5)2(c - 2)*3/5 Factor -5x*2/9 - 2x/9. -x(5x + 2)/9 Let -f5/7 + f4/7 + 9f3/7 - 5f*2/7 - 16f/7 + 12/7 = 0. What is f? -2, 1, 3 Suppose 2k3/11 - 6k*2/11 - 48k/11 + 160/11 = 0. Calculate k. -5, 4 Determine w, given that 2w5/3 - 26w*4/3 + 6w*3 + 266w*2/3 + 220w/3 = 0. -2, -1, 0, 5, 11 Let 10z4 + 64z*3 + 144z*2 + 128z + 32 = 0. What is z? -2, -2/5 Solve -5u3 + 180u*2 + 380u = 0 for u. -2, 0, 38 Suppose -12c5 + 435c*4 + 1812c*3 - 480c2 = 0. Calculate c. -4, 0, 1/4, 40 Factor -v2 + 109v - 108. -(v - 108)(v - 1) Suppose -5q2 - 50q + 280 = 0. Calculate q. -14, 4 Suppose -2l2/7 + 26188l/7 - 85726418/7 = 0. Calculate l. 6547 Let -5o3/4 - 15o*2/4 + 45o/4 - 25/4 = 0. What is o? -5, 1 Determine u so that 4u2 + 4u - 1368 = 0. -19, 18 Solve 7i4 + 79i*3 - 6i*2 - 316i - 88 = 0 for i. -11, -2, -2/7, 2 Solve 2n4 + 4n*3 - 648n*2 - 4n + 646 = 0. -19, -1, 1, 17 Factor -4r3/3 - 1908r*2 - 681632r + 2050624/3. -4(r - 1)(r + 716)*2/3 Factor -8p*3 - 2p*2 + 288p + 72. -2(p - 6)(p + 6)(4p + 1) Suppose -5r3 + 20r*2 + 140r + 160 = 0. What is r? -2, 8 Find c such that -c*5/8 + 3c4/8 + c3/8 - 7c2/8 + 1/2 = 0. -1, 1, 2 Factor 5a*4 - 40a*3 - 145a*2 + 900a. 5a(a - 9)(a - 4)(a + 5) Factor 4g4 - 5168g*3 + 2503896g*2 - 539172272g + 43538160964. 4(g - 323)*4 Suppose	{ "pile_set_name": "DM Mathematics" }
(b) -2 (c) -2/3 (d) -2/7 (e) 3 c What is the second biggest value in -0.06, 6, -48, 3/5, 5.9? 5.9 Which is the second smallest value? (a) -1.7 (b) -0.09 (c) 781/9 b Which is the fourth biggest value? (a) -0.042 (b) -92 (c) -3/4 (d) 0.11 b Which is the biggest value? (a) -0.3 (b) 277/3 (c) 2 b Which is the second smallest value? (a) -515/6 (b) 0.1 (c) 1.7 b What is the third biggest value in 5, 344, 10/3, 3/4, -2, -0.5? 10/3 What is the biggest value in -1560, 2/17, 3? 3 What is the fourth biggest value in -5, 2/31, 1/5, -2/5, -0.03, 1/11? -0.03 Which is the third biggest value? (a) -330 (b) -0.5 (c) 5 (d) -3 (e) -7/6 e What is the fifth smallest value in 2/3, -2/9, 1/6, 5, -3/580, 52? 5 What is the sixth biggest value in -5.5, 8, 5, -2, -0.1, -4? -5.5 Which is the fourth biggest value? (a) 0.1 (b) 4 (c) 1/7 (d) 4620 a What is the biggest value in -5, 8, 2/5, -1.63? 8 What is the biggest value in 2, -7, 145, -2? 145 Which is the second biggest value? (a) -157 (b) 1349 (c) -4 (d) 2/9 d What is the fifth smallest value in -29, 5, -12, 1, -1, -5? 1 What is the third biggest value in -10, 4997, 0.9? -10 Which is the second smallest value? (a) 3 (b) -8.2 (c) 0.5 (d) 71 c What is the third biggest value in -4.1, 5, 373? -4.1 Which is the fourth biggest value? (a) -2/9 (b) -0.1 (c) 1/64 (d) 2052 a What is the second biggest value in 0.11, -7702, 5? 0.11 What is the second biggest value in -4, 0.3, -0.039, 6/37? 6/37 What is the second biggest value in -1/6, 4, -2/39, -25.62? -2/39 What is the third smallest value in -3, -10, 109? 109 What is the fifth biggest value in 2, -2/11, -15, 0.01, -0.6, -5/6? -5/6 What is the third smallest value in -5, 0.7, -4, 1786? 0.7 What is the biggest value in 4, -158529, 0.1? 4 What is the third biggest value in 0, 2.3, -2/5, -88, 6? 0 What is the biggest value in -5, -0.210908, 2/3? 2/3 Which is the third smallest value? (a) -0.4 (b) 3/10 (c) 2/3 (d) -6 (e) -16 (f) -5 f Which is the second smallest value? (a) -2/125 (b) -4 (c) 68 (d) 1/2 a What is the third smallest value in -3, -1/3, 6/7, 11/2, 17? 6/7 Which is the fourth smallest value? (a) -5 (b) -50 (c) -5/3 (d) -0.1 (e) -1/2 (f) -0.2 e Which is the third smallest value? (a) 3.13 (b) 41.3 (c) -0.4 b Which is the second biggest value? (a) -570 (b) 4 (c) -58 c What is the fourth smallest value in -0.3, 2/405, -0.02, 2/7, 1/2, 3/5? 2/7 What is the third biggest value in -182, -4, -0.4, 18.77? -4 Which is the smallest value? (a) 5 (b) -17207/11 (c) 0.3 b What is the second biggest value in 3, 15/2, 582? 15/2 What is the second biggest value in 3/269, 4/3, -0.14? 3/269 What is the second smallest value in -1/50, 12, -0.2, 0? -1/50 What is the sixth smallest value in -3/10, -4/7, 2/319, -3/2, -5/2, 4/3? 4/3 What is the second smallest value in 0.0362, -4, -1? -1 What is the second biggest value in 5.66, 7, -5? 5.66 What is the third smallest value in 0.5, -1/5, -0.4, -5, 43? -1/5 Which is the second smallest value? (a) 671 (b) 3 (c) -0.1 (d) -1 c Which is the second biggest value? (a) 1 (b) -1 (c) 2217/2 a Which is the biggest value? (a) 5/2 (b) -4 (c) -12.441 (d) 1 a What is the third smallest value in 3/2, 1/8, 4.2? 4.2 What is the biggest value in 116, 1/3, 0.086? 116 What is the fourth biggest value in 0.3, 1, -5.26, -3/7, -4? -4 What is the fifth smallest value in 2/7, 0.5, 0.049, 126, 1? 126 Which is the third smallest value? (a) -2/5 (b) -4289 (c) -6 a What is the fourth smallest value in 1.71, 48, 5, 6? 48 Which is the fifth biggest value? (a) -0.4 (b) 3 (c) 13 (d) -7/6 (e) 0.09 d Which is the fifth biggest value? (a) -1 (b) 4 (c) -2 (d) -12/37 (e) 1/5 (f) -5 c Which is the third smallest value? (a) -1/11 (b) 134 (c) -2/17 (d) 2/13 d What is the fourth biggest value in -5, -40, 0.3, -67, 1? -40 What is the fifth smallest value in -11, 1, -2/3, -51, -5? 1 Which is the second biggest value? (a) 2 (b) 0.1 (c) 67.51 a Which is the third biggest value? (a) 3.6 (b) -5 (c) 31 b Which is the fifth biggest value? (a) -3 (b) -0.06 (c) 0.026 (d) 0.2 (e) 30 a What is the third smallest value in 2/21, 0.5, 5, -7, 3? 0.5 Which is the smallest value? (a) -52 (b) -0.1 (c) 0.3 (d) 2/9 (e) -10 a Which is the biggest value? (a) 118 (b) -0.16 (c) 5 (d) 2/7 a What is the third biggest value in -555, -3/2, 2, 0.2? -3/2 Which is the smallest value? (a) -0.049 (b) 3 (c) -4.9 c Which is the second biggest value? (a) -9 (b) -0.0555 (c) -0.9 c Which is the fifth biggest value? (a) -35 (b) -0.7 (c) -2 (d) 0.2 (e) -1 (f) -2/17 c Which is the third biggest value? (a) 1.5 (b) 0.2 (c) 2 (d) -2 (e) -1.1 (f) -0.1 b Which is the biggest value? (a) -1.2 (b) 390/41 (c) 3 b Which is the third smallest value? (a) 336/19 (b) 0.4 (c) 4.9 a What is the third smallest value in -1, -0.14, 15/13? 15/13 Which is the smallest value? (a) 1 (b) 1.2 (c) -4 (d) -2/2025 c Which is the biggest value? (a) -0.3 (b) -3 (c) 21 (d) 1/13 c What is the third biggest value in 2/7, 104, 4, -2, -4/47? 2/7 What is the second biggest value in -0.1, 3, -1, -176, -3? -0.1 Which is the smallest value? (a) 39 (b) -1/8 (c) 8/9 (d) 5/4 b What is the third smallest value in -25, 9, 19? 19 What is the fifth smallest value in 3, -6, 0.4, -21, 3/2? 3 Which is the second biggest value? (a) 98 (b) 10.83 (c) 0.2 b What is the fourth smallest value in 79, 0.4, -2/3, -2/7, 4.62, 1/2? 1/2 What is the fifth biggest value in 0.013, 0, 3, 0.107, -5? -5 Which is the second biggest value? (a) -240235 (b) -2/15 (c) 2 b What is the smallest value in -1/3742, -0.4, -5? -5 Which is the fourth smallest value? (a) 0.2 (b) -0.3 (c) 15 (d) -0.06 (e) -2/9 (f) 29.4 a What is the third biggest value in -3, 0.6, 6, -9/43, -3/10? -9/43 Which is the second smallest value? (a) 0.6 (b) 0.03072 (c) -3/8 (d) 0.1 (e) 22 b Which is the third smallest value? (a) 4 (b) -5/3 (c) 5231 (d) -4 a What is the third biggest value in -787, -5, 18/5? -787 Which is the fourth smallest value? (a) -0.4 (b) 3/8 (c) -1/4 (d) -22 (e) 2/17 (f) -3.29 c Which is the third biggest value? (a) 3 (b) -0.5882 (c) -1 c What is the smallest value in 4, -2/5, -24, -2/9, -0.3, -792? -792 Which is the fifth biggest value? (a) -13/4 (b) 3/5 (c) 5 (d) 59 (e) 73 a What is the smallest value in -1/2, 7, -49, 5, -5, 0.2? -49 What is the second biggest value in -12/193, 0.022, 3? 0.022 What is the fourth smallest value in 14965, 0.13, -0.2, 2? 14965 Which is the third smallest value? (a) -6 (b) 4/3 (c) -0.47 (d) -12/11 c What is the third biggest value in 0.3, 0, 5/9, 1/7, -8/9, -0.7? 1/7 Which is the smallest value? (a) 0.114 (b) 3 (c) 121 (d) -2 (e) 0 d Which is the biggest value? (a) 4 (b) 1 (c) 1/5 (d) -1/4 (e) -1/3 (f) -3.51 a Which is the fifth smallest value? (a) 906 (b) -5 (c) -1 (d) -3.22 (e) 3/5 a What is the second biggest value in -5, -3, 0, -362, -9? -3 What is the third smallest value in 1.48, 4, -1/5, 183? 4 What is the fourth smallest value in 1/3, 5, -3, 4/33, -2/5? 1/3 What is the third smallest value in 8, -0.02, 5459? 5459 Which is the third biggest value? (a) -0.3 (b) 3601 (c) 2 (d) -18.7 a Which is the third biggest value? (a) 2/11 (b) 6 (c) -6425 (d) -4 (e) -0.4 e Which is the biggest value? (a) 0.5 (b) 16.23 (c) -2/7 (d) 7/4 b Which is the fourth biggest value? (a) -8/41 (b) 2/19 (c) 2 (d) -0.1 (e) 1/4 d Which is the second smallest value? (a) -40 (b) 7 (c) 12 b Which is the third smallest value? (a) -7 (b) 114 (c) -3 b Which is the third smallest value? (a) -1 (b) 15 (c) -1/17 (d) 0.7 (e) -140 c Which is the third smallest value? (a) 1/7 (b) 6 (c) -0.1 (d) -2/5 (e) -0.23 (f) 0.4 c Which is the fifth biggest value? (a) 2 (b) -11 (c) -2/5 (d) 6 (e) -5 (f) 1896 e Which is the second smallest value? (a) 11 (b) 2/7 (c) -2 (d) -3/4 (e) -0.1 d What is the fifth biggest value in 1, -2, 0.1, -5, -31.71, -1/9? -5 What is the third smallest value in 0.05, -14/15, -37? 0.05 What is the biggest value in -4, 1/10, 2/231, -0.2? 1/10 What is the third biggest value in 5, -2/21, -228, 3, 4? 3 Which is the biggest value? (a) -1/3 (b) -5 (c) -0	{ "pile_set_name": "DM Mathematics" }
- 7. Let j = -0.2 - -0.3. Let o be ((-4)/14)/((-4 - 1)/35). What is the nearest to k in j, o, 0.5? j Let n = -179 - -305. Let m = n + -85. Let b = -42 + m. What is the closest to b in -2, 2/15, -1? -1 Let h = -3.227 + -1.773. What is the nearest to 3 in h, 1/2, 2/13? 1/2 Let t = -86609/9 + 9623. What is the closest to 2/7 in t, 23, -3, 4? t Let r = 20124 + -20123.9. Let o = -4 - -2. Let d = o - -1.5. What is the nearest to r in 5, d, 4? d Let y = -0.9 - 0.1. Let n = 402.1 - 402. Let o = 17 + -15. What is the closest to n in y, 2/7, o? 2/7 Let b = 30.3 + -18.1. Let z = -7.2 + b. Suppose 4i = -0i. What is the nearest to -0.04 in i, z, 1? i Let x = 3473 - 3473. Let n be (2/3)/((-10)/(-255)). Which is the closest to x? (a) -0.1 (b) n (c) 0.3 a Let b(u) = -u*3 - 3u*2 - 13u - 42. Let q(c) = c*2 - 17c + 57. Let a be q(12). Let i be b(a). What is the nearest to -3 in 0, -5, i? i Let v(s) = -350s - 5600. Let t be v(-16). What is the closest to 280 in -4, 5/4, -1/5, t? 5/4 Let h = 22.1 + -22. Let k = 51 - 306. Let v = k - -249. Which is the closest to -1? (a) 0.2 (b) v (c) h c Suppose -1 = 2j + 5. Let p(d) = d*2 + 8d + 4. Let y be p(-12). Let g = y - 882/17. Which is the nearest to j? (a) 0 (b) -2/21 (c) g b Let o = 21.37 + -21.27. What is the closest to o in -0.4, 4/5, 60, 0? 0 Let v(r) = r*2 + 455r + 2247. Let h be v(-5). What is the closest to 0 in -0.5, h, -73/2? -0.5 Let j = 3.975 - 4.075. Which is the closest to j? (a) -3/4 (b) 27/13 (c) 5/3 (d) -15 a Let j = -1.29 + -0.21. Let d = j - -1.8. Let z be (-8 + 70/7)/(-1)-2. Which is the nearest to z? (a) -0.4 (b) d (c) 2 c Let j be (212/(-1060))/((-3)/(-5)). Which is the closest to j? (a) -6 (b) -2/9 (c) -11/26 c Let o = -3532 + 3527. What is the nearest to 0 in 7/34, -1, o? 7/34 Let w = 57.31 + -57. Let v = 0.19 + w. Let u(p) = -9p + 48. Let o be u(5). Which is the closest to -1? (a) -4 (b) o (c) v c Let f = -1.57 + 231.57. Let c = f + -230.3. What is the closest to -2 in c, 0, 2/7? c Let z = 19 + -16. Let r be 2 - (476/144 - 1). Let o = r - -5/9. Which is the nearest to 0? (a) o (b) 2 (c) z a Suppose -25 = -2f + 5q, 4f - 3f = -4q - 20. Let x be (-72)/648 + (-763)/99 - -8. What is the nearest to f in x, 2/5, 0.2? x Let i be 6/(-4) + 125/70. Let l = -404 + 246. Let d = 786/5 + l. What is the nearest to i in 4, d, 1/3? 1/3 Let y = -0.2 - -0.3. Let a = -26 + 37. Let j = 1609795 + -1609796. What is the closest to a in -4, y, j? y Let f = 161 - 156.894. Let w = f + -0.106. Which is the closest to w? (a) 0.4 (b) 5 (c) 1 b Let l = -638223/175 + 3647. Let w = l - -103/175. Which is the nearest to -1? (a) -0.1 (b) -5 (c) w a Let j = -7790.03 + 7790. Let n = -0.05 - 1.95. Which is the closest to -1? (a) j (b) -5 (c) n a Let j be (-6 - -4)/(2/302). Let r = j + 298. What is the closest to -0.2 in -0.4, -3, r? -0.4 Let t = 13 + -29/2. Let v = -23 - 57. Let f = v - -80.3. Which is the closest to -1/2? (a) -1/10 (b) f (c) t a Let j = -91687 - -91685. Let u be 6/(-56) - 2/(-8). Which is the nearest to -2/3? (a) u (b) -0.4 (c) j b Let j = -22489/4 + 5623. What is the nearest to -1 in -0.033, 8, j? -0.033 Suppose -10t - 96 = -336. Let m be -3 + 100/t - 7/(-21). Which is the nearest to m? (a) 2 (b) 0 (c) -0.1 a Let y = -359 + 532. Let x = -175 + y. Which is the closest to 0? (a) x (b) 2/3 (c) 0 c Let l(j) = -47j + 141. Let k be l(3). Which is the nearest to k? (a) 0 (b) 0.017 (c) -1 (d) -1/6 a Suppose 3l - 4 = -4o, o - 16 = -o + 2l. Let p = 1.54 + 0.48. Let v = p - 1.92. What is the nearest to v in -6/11, o, 0.4? 0.4 Let o = 1687 - 1691.322. Let g = o + -0.678. Suppose -9 = 3j, 2b - b - 3j - 11 = 0. What is the nearest to 0.1 in b, g, -2? b Let w(r) = -4 + 3 + r + 3r*2 - r. Let z be w(-1). Let k = 49441 + -49443. Which is the closest to k? (a) 8/3 (b) z (c) 2/9 c Let q = -37 + 92. Suppose 53u = qu + 12. Let h(v) = -2v - 16. Let s be h(u). What is the closest to 1.2 in 0.5, s, -5? 0.5 Let b = -119 - -64. Let f = -59.003 - -0.003. Let h = b - f. What is the nearest to -2/7 in 2, -3/2, h? -3/2 Let l = -0.042 - -0.042. Let o = 1.688 + 0.312. Which is the closest to l? (a) o (b) 0 (c) 4/7 b Let k = 195 + -393/2. Let n = -0.09 + 0.39. What is the closest to k in 2, n, 1/2? n Let j = 22 - 13. Let y = -2097 - -2100. What is the closest to j in -2/3, -2/9, y? y Let s = 0.3 - -3.7. Let c = -1 - s. Let g = 7074 - 7075. What is the closest to g in c, 3/4, 0? 0 Let q = 27.59 - 26.59. What is the closest to 0.08 in q, -0.3, -12? -0.3 Let g = 2.95 - -0.05. Let y = -40 - -39.6. Which is the nearest to -6? (a) y (b) g (c) 5 a Let u be ((-2)/4)/(((-49)/(-7))/14). Let j = -10.81 + 10.8. Which is the nearest to j? (a) u (b) -1/5 (c) -4/9 (d) 1 b Let s = 17 + -23. Let z be 18/99 - (-48)/(-22). Let v be s/(-48)z + (-1)/(-12). Which is the nearest to 3? (a) -3/5 (b) 2/3 (c) v b Let p = -0.02 + 0.22. Let m(b) = -b3 + 4b*2 + 2b + 2. Let g be m(4). Suppose 5v - 3x - 9 = -3, v - 5x - g = 0. What is the nearest to v in p, -5, -9? p Let o be 6/(-7) + 1936/1540. Which is the closest to -0.04? (a) o (b) 2 (c) -0.4 c Let p = -78953 + 1342203/17. Let o be 3(-6)/27-1. What is the nearest to p in 0.4, -0.07, o? -0.07 Let y = -46360 + 46355. Let w = 8 + -12. Which is the nearest to 25? (a) y (b) 4/5 (c) w b Let i be -16 + 7362/432 - 9/24. What is the closest to i in -6/7, -3, 3, -2/9? -2/9 Let g = 66 + -860/13. Let x(m) = m3 + 8m*2 + 15m - 3. Let l be x(-3). What is the nearest to g in 23, l, -1? -1 Let r = -1194.1 - -1195.1. What is the closest to 0.1 in 1.4, r, -28? r Let l = -0.3 - 0.2. Let j = -30.08 + 34.08. Let r = -4/13 - -21/26. Which is the nearest to r? (a) -1/7 (b) j (c) l a Let z = -31 + 28.7. Let c = z + 2.36. Let w = c + 1.94. What is the closest to -1/4 in -1/2, w, 0.5? -1/2 Let x = -6 + 11. Let g = 72.57 - 73. Let z = 0.73 + g. Which is the closest to 0.2? (a) -1 (b) z (c) x b Let s = -0.17 + 59.17. Let t = 70 - s. Which is the closest to 2/5? (a) 0.5 (b) t (c) 0.2 a Let k = 28078 - 27924. What is the closest to -1 in 0.17, 2, k? 0.17 Let m(h) = -142h - 991. Let y be m(-7). Let g = 15 - 9. What is the nearest to g in -4, y, 0.05? y Let z = 1566 - 1565.7. Which is the nearest to -26/3? (a) -2 (b) 0.2 (c) -5 (d) z c Let j = 272.917 + -273. Let o = -918.517 - -919. Let r = o + j. Which is the nearest to 1? (a) r (b) -3/7 (c) -3 a Suppose 46f + 640 = 15f - 49f. Which is the closest to f? (a) 0.2 (b) 0.22 (c) -4 c Let c = -9273.9 + 9274. What is the closest to c in -2/3, 3, 74, 0.4? 0.4 Let s = -22984 - -22983.89. What is the closest to 2/7 in 50, 4, -1/5, s? s Let x = -6.03 + 6. Let v = 0.23 + x. Let j = 43.06 - 43.05. Which is the nearest to 0.1? (a) v (b) j (c) 5 b Let s = 892 + -893. Let p be (-4)/(-7) + (-1 - 0). Let w = -225 - -227. What is the nearest to s in 2.7, w, p? p Let g = 36492 + -36493. What is the closest to g in 5/9, 2/17, -4? 2/17 Let m be 28/462 + (-22270)/(-2805). Let g = 0.3 + -0.7. Let d be (-1 - (-9)/12)2. What is the nearest to 1 in d, g, m? g Let l = -167/2 + 1833/22. Let i = 174708.5 - 174709. Let d = 5 - 0. Which is the closest to -1/4? (a) i (b) d (c) l c Let g = -16754.2 - -16754. What is the closest to g in -2/3, -2/219, -15? -2/219 Let f be (-1 + (-30)/(-35))/(2/(-6)). Let z = -56 - -70. Let o = z + -14.1. Which is the closest to f? (a) -3 (b) -4 (c) o c Let w = 4685 + -4678. What is the nearest to -0.14 in 2/15, w, 3? 2/15 Let h be (3/36)/((-10 - -14)(-3)/(-72)). What is the closest to -1 in -2, -0.247, h, -1/3? -1/3 Let k = 48 + -43. Let j = -1.278 - -1.24. Let d = j + 0.038. Which is the nearest to d? (a) 2/7 (b) 4 (c) k a Let f = 1.43 - -437.57. Let l = 427 - f. Which is the nearest to 0? (a) -5 (b) l (c) -2 c Suppose -37 + 13 = -2o. Suppose -9w = -13w + o. Let p be (-3w/27)/((-2)/10). What is the closest to p in 1/6, 0.4, -4/3? 0.4 Let m = 123 - 42. Let f = -82 + m. Which is the nearest to 12/5? (a) 2 (b) f (c) 1/2 a Suppose -5j + 1 + 9 = 5v, 4j = -3v + 11. Suppose -2 + 10 = -4c + 2p, 1 = jc + 3p. Let s be (2 + (5 - 4))/c. What is the closest to 2/7 in -2/11, s, -2? -2/11 Let v = -0.72 + 0.62. Let j be (14/21)/(10/(-6) + -3). Wh	{ "pile_set_name": "DM Mathematics" }
etermine g, given that 8g5 + 24g*4 - 126g*3 + 104g*2 - 24g = 0. -6, 0, 1/2, 2 Solve c*5/4 + 6c*4 + 65c*3/4 + 21c2/2 = 0. -21, -2, -1, 0 Determine z so that -z4/2 - 5z3 + 39z*2/2 - 2z - 26 = 0. -13, -1, 2 Find z, given that 10z5/7 + 76z*4/7 + 18z*3/7 - 160z*2/7 + 8z = 0. -7, -2, 0, 2/5, 1 Solve -x*4 + 33x*3/2 - 63x*2/2 - 320x - 150 = 0 for x. -3, -1/2, 10 Determine b so that 2b4 - 20b*3 + 56b*2 - 48b = 0. 0, 2, 6 Solve 2q3/15 + 1196q*2/15 - 482q + 3624/5 = 0 for q. -604, 3 Factor -3d3 - 105d*2 - 264d + 13068. -3(d - 9)(d + 22)*2 Find v, given that 3v*5 - 12v*4 + 15v*3 - 6v*2 = 0. 0, 1, 2 Suppose 5a*4 + 20a*3 - 90a*2 + 100a - 35 = 0. Calculate a. -7, 1 Let -2w3/9 + 22w*2/9 - 76w/9 + 80/9 = 0. What is w? 2, 4, 5 Solve 3o2 + 129o + 468 = 0. -39, -4 Factor -3b2 - 4221b + 8454. -3(b - 2)(b + 1409) Solve -f*2 - 58f - 841 = 0 for f. -29 Suppose 2p5/19 - 210p*4/19 + 7350p*3/19 - 85750p*2/19 = 0. What is p? 0, 35 Determine f so that -3f*2 + 36f = 0. 0, 12 Factor -12q2 - 3q/4. -3q(16q + 1)/4 Factor 2d*4/13 + 58d*3/13 + 594d*2/13 + 2430d/13 + 2916/13. 2(d + 2)(d + 9)*3/13 Find i such that 4i*4 + 4644i*3 - 4648i*2 = 0. -1162, 0, 1 Factor -2j*4/9 + 14j*3/9. -2j*3(j - 7)/9 Factor 4x2 + 76x - 264. 4(x - 3)(x + 22) Let -9m4/5 - 12m*3/5 + 12m*2/5 = 0. What is m? -2, 0, 2/3 Let 3n*5/5 - 3n*4/5 - 537n*3/5 + 3939n*2/5 - 8106n/5 + 4704/5 = 0. What is n? -16, 1, 2, 7 Find b such that -5b3/4 - 145b*2/4 + 615b/2 - 270 = 0. -36, 1, 6 Factor -2m3/9 - 1874m*2/9 - 1868m/9 + 416. -2(m - 1)(m + 2)(m + 936)/9 Find f such that -4f*5 - 32f*4 - 24f*3 + 32f*2 + 28f = 0. -7, -1, 0, 1 What is k in -2k2 - 698k = 0? -349, 0 Suppose 4t2 + 68t + 120 = 0. What is t? -15, -2 Find g such that 3g2 - 15g - 42 = 0. -2, 7 Let -y*4 - 59y*3 - 490y2 = 0. What is y? -49, -10, 0 Let -x2/4 + 17x/2 - 289/4 = 0. What is x? 17 Factor -3l*4 + 21l*3 - 36l*2. -3l*2(l - 4)(l - 3) Factor 2n*4/7 + 2n*3/7 - 10n*2/7 + 6n/7. 2n(n - 1)*2(n + 3)/7 Factor -4g3/5 - 8g*2/5 + 692g/5 - 264. -4(g - 11)(g - 2)(g + 15)/5 Suppose -3g*3/4 + 69g*2/4 - 513g/4 + 1215/4 = 0. Calculate g. 5, 9 Factor 5h4 + 50h*3 - 115h*2 + 60h. 5h(h - 1)*2(h + 12) Determine a so that -a*2 - 1611a - 1610 = 0. -1610, -1 What is i in 2i3 + 31i*2/2 + 28i - 8 = 0? -4, 1/4 Factor 2w2/17 + 16w/17 - 18/17. 2(w - 1)(w + 9)/17 Factor -2v3/7 + 12v*2/7 + 8v/7 - 48/7. -2(v - 6)(v - 2)(v + 2)/7 Solve -20l*5 + 175l*4 - 435l*3 + 200l*2 + 80l = 0. -1/4, 0, 1, 4 Solve 56q5 + 68196q*4 - 14652q*3 - 43856q*2 - 9744q = 0. -1218, -1/2, -2/7, 0, 1 Factor -2q3 + 460q*2 - 1366q + 908. -2(q - 227)(q - 2)(q - 1) Let -3m*2 + 177m + 756 = 0. What is m? -4, 63 Factor 3f4/2 - 15f*3/4 + 3f*2 - 3f/4. 3f(f - 1)*2(2f - 1)/4 Suppose -3f*3 - 78f*2 + 255f - 174 = 0. What is f? -29, 1, 2 Let q*3 + 3q*2 - 18q = 0. What is q? -6, 0, 3 Factor -2k3 + 64k*2 + 66k. -2k(k - 33)(k + 1) Factor -2b*4/3 - 38b*3/3 - 32b*2. -2b*2(b + 3)(b + 16)/3 Factor -2k*2/11 - 162k/11 - 160/11. -2(k + 1)(k + 80)/11 Factor 4b3/5 + 26b*2/5 + 44b/5 + 16/5. 2(b + 2)(b + 4)(2b + 1)/5 What is c in 2c2/15 + 10c/3 - 20 = 0? -30, 5 Solve -3v2/2 + 1341v/2 - 669 = 0 for v. 1, 446 Factor 2w5/13 + 6w*4/13 - 8w*3/13. 2w*3(w - 1)(w + 4)/13 What is l in -15l*3 - 20l*2 + 20l = 0? -2, 0, 2/3 Solve -2k4/7 + 4710k*3/7 - 2775362k*2/7 + 2761242k/7 + 5541316/7 = 0 for k. -1, 2, 1177 Factor 2f3/5 + 22f*2/5 + 56f/5. 2f(f + 4)(f + 7)/5 Let t4/2 - 11t*3/2 - 2t*2 + 22t = 0. Calculate t. -2, 0, 2, 11 Let -2g4 - 42g*3 - 78g*2 - 38g = 0. Calculate g. -19, -1, 0 Find t such that 5t2 + 230t + 2520 = 0. -28, -18 Factor 3m3 + 816m*2 + 56295m + 109350. 3(m + 2)(m + 135)*2 What is k in 2k*2 - 16k + 24 = 0? 2, 6 Suppose 140g5 - 289g*4 - 409g*3 + 638g*2 + 404g + 56 = 0. Calculate g. -7/5, -2/7, -1/4, 2 Find k such that k*5/6 + 5k*4/6 - 19k*3/3 - 131k*2/3 - 395k/6 - 175/6 = 0. -5, -1, 7 Solve 5r3 - 670r*2 + 1325r - 660 = 0. 1, 132 Factor 2d2 + 44d + 80. 2(d + 2)(d + 20) Suppose k*2/3 - 79k/3 - 582 = 0. What is k? -18, 97 Suppose 4k3 + 28k*2 - 160k - 400 = 0. Calculate k. -10, -2, 5 Factor -3u3 - 33u*2 + 36u. -3u(u - 1)(u + 12) Solve -4j*5 + 80j*4 + 176j*3 + 8j*2 - 172j - 88 = 0. -1, 1, 22 Let -k*3/3 - 10k*2/3 - 7k = 0. What is k? -7, -3, 0 Factor 2n3 - 48n*2 - 18n + 432. 2(n - 24)(n - 3)(n + 3) Determine p so that 5p*5 + 100p*4 + 465p*3 + 650p*2 + 280p = 0. -14, -4, -1, 0 Suppose -28i4 - 176i*3 - 20i*2 + 176i + 48 = 0. Calculate i. -6, -1, -2/7, 1 Let -54h2/5 + 14h/5 + 8 = 0. Calculate h. -20/27, 1 Factor f*4 + 18f*3 + 113f*2 + 276f + 180. (f + 1)(f + 5)(f + 6)2 Let g2/4 + 405g + 164025 = 0. Calculate g. -810 Factor 3w*4/7 + 192w*3/7 + 375w*2/7 + 186w/7. 3w(w + 1)*2(w + 62)/7 Factor -a*3 + 44a*2 - 304a + 576. -(a - 36)(a - 4)2 Solve t4/4 + t3 - 7t*2/4 - 11t/2 + 6 = 0 for t. -4, -3, 1, 2 Factor 2r2/7 - 228r/7 - 230/7. 2(r - 115)(r + 1)/7 Suppose 3l4/4 + 9l*3/2 + 9l*2/4 - 15l/2 = 0. What is l? -5, -2, 0, 1 Factor -20m3/3 + 148m*2/3 - 296m/3 + 32. -4(m - 4)(m - 3)(5m - 2)/3 Solve 3o3 + 15o*2 + 12o = 0. -4, -1, 0 Factor -4m2/7 - 20m/7 - 16/7. -4(m + 1)(m + 4)/7 Factor -2n2 + 8908n/7 - 2544/7. -2(n - 636)(7n - 2)/7 Let 4q*2 + 1156q + 2296 = 0. What is q? -287, -2 Suppose -2c5/9 + 2c*4/9 + 4c*3/3 = 0. What is c? -2, 0, 3 Let -2k*2/11 + 72k/11 - 18 = 0. Calculate k. 3, 33 Suppose f*5/3 - 85f*4/3 + 2155f*3/3 - 5025f*2 + 13680f - 12996 = 0. Calculate f. 3, 38 Factor -3u3 + 66u*2 + 219u + 150. -3(u - 25)(u + 1)(u + 2) Let 30i*5/7 - 192i*4/7 + 402i*3/7 - 312i*2/7 + 72i/7 = 0. Calculate i. 0, 2/5, 1, 2, 3 Let 3c3/8 + 261c*2/8 - 33c = 0. What is c? -88, 0, 1 Find b, given that 3b4/5 + 51b*3/5 - 153b*2 - 1671b/5 - 858/5 = 0. -26, -1, 11 Determine t so that 3t3/2 - 9t*2 + 33t/2 - 9 = 0. 1, 2, 3 Factor 2l4 - 4l*3 - 10l*2 + 12l. 2l(l - 3)(l - 1)(l + 2) Suppose 2r4/5 + 6r*3 + 26r*2/5 - 6r - 28/5 = 0. What is r? -14, -1, 1 Factor 3y4 + 207y*3 + 3978y*2 - 2028y - 474552. 3(y - 9)(y + 26)*3 Factor 3t*3/5 - 78t*2/5 + 363t/5 + 1872/5. 3(t - 16)(t - 13)(t + 3)/5 Factor g3/5 + 7g*2/5 + 2g/5 - 8. (g - 2)(g + 4)(g + 5)/5 Suppose 16j4/9 - 220j*3/9 + 728j*2/9 + 196j/9 = 0. Calculate j. -1/4, 0, 7 Suppose z*5/5 - 59z*4/5 + 58z*3/5 = 0. What is z? 0, 1, 58 What is g in 4g*3/5 + 388g*2/5 + 1920g + 9216/5 = 0? -48, -1 Let -12r5 - 21r*4 + 27r*3 + 39r*2 - 15r - 18 = 0. What is r? -2, -1, -3/4, 1 Determine n, given that -n*4/5 - 4n*3/5 + 2n*2/5 + 12n/5 - 9/5 = 0. -3, 1 Factor -4p2 + 416p - 10816. -4(p - 52)2 Factor -5g*4 - 50g*3 + 515g*2 + 560g. -5g(g - 7)(g + 1)(g + 16) Factor -b*4/2 - 48b3. -b3(b + 96)/2 Factor -p3 + 149p*2 + 302p. -p(p - 151)(p + 2) Factor 6u2/7 + 150u/7 + 396/7. 6(u + 3)(u + 22)/7 Find f, given that 3f5 + 150f*4 + 2139f*3 + 6348f*2 = 0. -23, -4, 0 Determine p, given that -4p*5 + 36p*3 + 16p*2 - 48p = 0. -2, 0, 1, 3 Factor -289l5 - 510l*4 - 157l*3 + 60l*2 - 4l. -l(l + 1)2(17l - 2)2 Solve 2b*4/3 + 80b*3/3 + 944b*2/3 + 960b + 864 = 0. -18, -2 Factor 2p4/11 + 1794p*3/11 - 3596p*2/11. 2p*2(p - 2)(p + 899)/11 Factor 4c*3 + 40c*2 + 64c. 4c(c + 2)(c + 8) Factor -3n*3 + 186n*2 - 2163n + 7056. -3(n - 48)(n - 7)*2 Factor -4i*2/7 - 456i/7 - 12996/7. -4(i + 57)2/7 Factor -k2 - 592k - 87616. -(k + 296)*2 Find m, given that 3m*3 - 24m*2 - 33m + 54 = 0. -2, 1, 9 Solve -2r2 + 78r - 76 = 0 for r. 1, 38 Determine p, given that -4p4/3 + 62p*3/3 - 86p*2/3 + 28p/3 = 0. 0, 1/2, 1, 14 Suppose -4r4 + 40r*3 - 84r*2 - 16r + 112 = 0. What is r? -1, 2, 7 Suppose -5v4 + 35v*3 = 0. What is v? 0, 7 Let 300o**4 +	{ "pile_set_name": "DM Mathematics" }
. Which is the third biggest value? (a) -12 (b) 0 (c) g a Let n = 20.8531 + 0.0469. Let u = 21.4 - n. Which is the third biggest value? (a) 5 (b) -0.5 (c) u b Suppose 2q - 71h - 14 = -75h, -3q + 3h - 24 = 0. Which is the fourth smallest value? (a) 2/7 (b) -0.5 (c) 86 (d) q (e) 3 e Let u = 0 - 0.04. Let s = u - -0.44. Let t be (-312)/1496 - (4074/(-238) + 17). Which is the second smallest value? (a) s (b) t (c) -3/5 (d) 5 b Let v = -2284.51 - -2300. Let m = -2.51 - v. What is the smallest value in m, -4, 2? m Let r = 13813 - 14622. What is the third biggest value in -1/10, r, -1? r Let m = -673 + 672.476. Let i = -0.024 - m. Let k = 4.93 - -0.07. Which is the third smallest value? (a) i (b) -0.1 (c) -3/4 (d) k a Let f = 0.038 - 30.038. Suppose 149i - 93i = 280. Which is the fourth smallest value? (a) 3 (b) f (c) i (d) 2/19 c Let o = -1901 + 1571. Which is the fourth biggest value? (a) o (b) -1.3 (c) -2 (d) 5 a Let g = 17401 - 17400.7. Let o = -8.6 + 9. Which is the fourth smallest value? (a) -3/7 (b) o (c) -11/5 (d) g b Suppose j = 3a + 25, -5a - 61 = j - 22. What is the second biggest value in -2.8, a, 0.1? -2.8 Let b = -11.94 - -12. Let j be (393/297)/((-8)/(-12)). Let s = j - 13/6. What is the third smallest value in 2/25, b, s? 2/25 Let j = -12.594 - 0.106. Let o = j + 12.5. Which is the fourth smallest value? (a) 2/11 (b) 3 (c) o (d) 2 b Let v = 7562 + -37812/5. What is the fourth biggest value in -26/3, -3/4, -0.5, v? -26/3 Let u = 8.953 - 8.453. What is the second biggest value in -0.1, 8.82, -2, u? u Let t = -2/415 + 1674/2905. Let s = 1920/7 - 17455/63. Let g = s + 28/9. Which is the third smallest value? (a) g (b) -0.06 (c) t c Let m = -17526 - -17531. Which is the second biggest value? (a) -113/3 (b) -4 (c) m (d) 4 (e) -0.5 d Let j = -263 - -262. Let y be 1 + (2 - j) - (-204)/(-54). Which is the second biggest value? (a) -5 (b) -0.21 (c) y (d) 0 d Let v = 438.9 + -438.9. Which is the second biggest value? (a) -2/9 (b) v (c) 0.5 (d) 0.7 (e) -3 c Let h = 27.078 - 0.078. Let y = 22 - h. Let z = -0.13 - -11.13. Which is the third biggest value? (a) y (b) 2 (c) 0.1 (d) z c Let s = 87.3 + -87.7. What is the third biggest value in 2, 4, 2/7, s, -5? 2/7 Let k(w) = w3 - 57w*2 + 64w - 519. Let h be k(56). Which is the smallest value? (a) -0.2 (b) -0.5 (c) -2/3 (d) h (e) 0 d Let y = -139.00256 + 0.00256. What is the fourth biggest value in -0.4, 2, -3/2, y? y Let t = -2179 - -28323/13. Let l = 13 - 9. Suppose lu + 0 = 12. Which is the second smallest value? (a) -3 (b) 0.5 (c) t (d) u c Let f be -1 + 84 - -3190/(-57). Which is the fifth smallest value? (a) -2 (b) -0.3 (c) f (d) -0.2 (e) 1/3 c Let i = 4.2761 + -0.2761. Suppose 2k + k + 17 = -5l, 0 = -k - 5l - 19. Which is the third smallest value? (a) k (b) -6/17 (c) i c Let p = -4.04282 - -0.04282. Which is the third smallest value? (a) p (b) 3 (c) 0.56 b Let y = 26.4 + -12.6. Let x = -2.175 - -13.975. Let o = y - x. What is the biggest value in o, -23, -1? o Let s = 384 - -155. Let z = -539.3 + s. Which is the biggest value? (a) 5 (b) z (c) 1/4 (d) -4 a Let f = -7658 + 7533. What is the third smallest value in -0.02, f, 4/3? 4/3 Let l = 17290 + -17289.6. Which is the second biggest value? (a) 3/115 (b) -0.2 (c) -2/11 (d) l a Let z = 3 + -2. Let n = -216 - -216.0204. Let l = 5.0204 - n. Which is the biggest value? (a) z (b) l (c) -4 (d) -1/5 b Let b be (7/(-14))/(4/8) - -17. Let n = 3 + 2. What is the second biggest value in b, n, -2/9? n Suppose 2 = -5z - 4y - 14, -4z - 11 = 5y. Let o = 3/22 + -65/154. Which is the biggest value? (a) 0.5 (b) -5 (c) o (d) z a Let b = -81 - -74.6. Let l = -2.4 - b. Let t be 8/21 + 6/(-9). What is the fourth biggest value in 2/13, t, -0.4, l? -0.4 Let v = 2.364 - 0.244. Let w = v + -1.92. Which is the smallest value? (a) -5 (b) 0.5 (c) w a Let f = 1234/11 - 112. Let y = -60 - -60.1. What is the second biggest value in y, f, 1/2, 0.09? f Let s = -465 - -464.95. Which is the fifth biggest value? (a) -5 (b) -6 (c) s (d) 0.2 (e) 2 b Suppose -162 = 39g - 396. Let q = -14.95 - -15. What is the smallest value in q, g, -2/11? -2/11 Let q = -7087/88 + 890/11. Which is the biggest value? (a) 5 (b) -4 (c) q (d) 1 (e) -7 a Let g = 6004 - 5999. What is the fourth smallest value in g, -3, -48, 2? g Let n(t) = 3t + 91. Let q be n(-8). Let j = 25 - 21. Which is the third biggest value? (a) 3/7 (b) q (c) j (d) -2 a Let o be (-9 - (-311)/35)10/4. What is the fifth smallest value in 3, 5, o, 2/7, 5/3? 5 Let z = 0 - 1. Let k = 9.168 - 8.368. What is the biggest value in k, z, 0.5? k Let w = 152.7 + 5.3. Let g = w - 207.9. Let v = g - -53. Which is the third biggest value? (a) -0.2 (b) v (c) 1/10 a Let p be (-2)/9 + (-579)/(-945) - (-775)/(-2325). Which is the smallest value? (a) -0.7 (b) p (c) 0.2 (d) 1/3 (e) -3/2 e Let y = 6680 + -6675. Which is the third biggest value? (a) 0 (b) y (c) -59 (d) -3/2 (e) -53 d Let q(l) = 3l2 - 2. Let j be q(-2). Let r = -96 - -107. Suppose -c - 22 = -5m, 2c - 2m + r = -1. What is the third smallest value in 1, c, j? j Let d = 11621 + -11626. Which is the second biggest value? (a) d (b) -0.2 (c) -207 a Suppose -6 = -2l - l. Suppose 0 = -lm - 4p - 2, 3m - 2p - 5 = -6p. Let d = 349 + -347. What is the smallest value in -4, m, d? -4 Let m = -0.06 + -0.94. Let l be (-20)/56(2/3)/((-20)/(-24)). Which is the second biggest value? (a) 3 (b) l (c) m b Let i be ((-1)/((-16)/(-12)))/(-3). Suppose -6w + 11 = -1. Suppose g + wg = -m - 37, 4m = -16. Which is the second smallest value? (a) g (b) 0.1 (c) i b Let h = 45.7 - -9.3. Let s = 50 - h. Which is the smallest value? (a) -2/41 (b) s (c) -2 b Let t = -33.2 + -3.8. Let s = 48.6 + t. Let r = s + -12. Which is the smallest value? (a) 5 (b) 2/9 (c) r c Let b = -177/1034 + -1/94. Let p = 734 - 343. Let a = 387 - p. What is the second smallest value in 1/3, b, a? b Let q be (6/(108/(-26)))/(1/(-291)). Let d = q + -419. Let n = -3 + 3.5. What is the third smallest value in n, d, 2? 2 Let q = -77.36 - -77.76. What is the third smallest value in 7, -1/3, -2/1073, q? q Let o be 4/(-6) - 38/(-30). Let k be ((-10502)/295)/(4(-1)/(-5)). Let w = 45 + k. Which is the second smallest value? (a) 3 (b) w (c) o (d) -1 b Let a = 0.5309 + -0.2309. What is the second smallest value in -2, a, 2, -3.2? -2 Let v = -61/33 - -24/11. Suppose 4p + 11 = 3. Let b(n) = n*2 + n - 2. Let x be b(p). What is the second biggest value in v, x, 3/2? v Let k be ((-2)/4)/(333/(-3182)) + 4/18. Which is the fourth biggest value? (a) -0.096 (b) 4 (c) k (d) -4 d Let p be ((-69)/6 - -11)(0 + (-14)/(-189)). Which is the second biggest value? (a) p (b) 2 (c) -1 (d) -2 a Let v = -32.77 - 5.13. Let r = -38 - v. Which is the fourth biggest value? (a) 2 (b) -7 (c) -3/2 (d) r b Suppose -15t = -34t - 155 + 41. Let g = 84 + -1262/15. Which is the third smallest value? (a) t (b) -1/11 (c) g (d) 0.3 b Let a = 20 + -71. Let x = a - -19. Let k = -35 - x. What is the second smallest value in 4, k, 1? 1 Let s be -150/(-575) - 1138/(-138). Which is the fifth smallest value? (a) 1 (b) s (c) -1/5 (d) 3/8 (e) -2/9 b Let o(d) = -2d - 2. Let a be o(-2). Suppose 0y - aj = -2y, 4y = 2j + 6. Let z = 13549 - 13548.5. What is the second smallest value in 2, 3/7, z, y? z Let k = 758 - 765.21. Let f = k - 24.49. Let n = -32 - f. Which is the second biggest value? (a) 4 (b) n (c) -2 b Let h = -30097.202 + 30070. Let s = h + 0.202. Let x = -6 - -4. Which is the biggest value? (a) x (b) 0.4 (c) s b Let b = 19057 + -19061. What is the second smallest value in 0.03, -48/5, b? b Let b = 144107/15 - 9607. What is the second smallest value in b, -3/2, -148? -3/2 Let y = 6607 - 6609. Which is the smallest value? (a) -57 (b) -1/4 (c) y a Let n = -3.48 - 11.52. What is the second smallest value in n, -0.2, -1/8? -0.2 Let h be (-3)/244/3. Let u = -1/21142 - -5287/31713. What is the second biggest value in h, -0.3, u? -0.3 Let q = -3.06 + 0.06. Let z = 1 + q. Let j = 4.235 - 4.035. Which is the fourth smallest value? (a) -2/9 (b) z (c) -0.2 (d) j d Let g = -1.67 + 1	{ "pile_set_name": "DM Mathematics" }
*2 - 13s + 11. Suppose 0 = 4h - 8, -2h + 5h - 45 = -3b. Let m be t(b). List the prime factors of (-105)/(-2) + m/22. 53 Let h(g) = -g + 1. Let r(m) = 24m + 9. Let l(z) = -36z - 13. Let n(i) = 5l(i) + 8r(i). Let w(s) = 6h(s) - n(s). What are the prime factors of w(-2)? 5, 7 Let d be (-1796)/(-16) + (-3)/(-4). Suppose 0p + p + 3w - d = 0, 1 = -w. List the prime factors of p. 2, 29 Let b(x) = 150x - 1 - 155x - 4x*2 - 1 - 13x*3. List the prime factors of b(-1). 2, 3 Suppose -5 = -5w + 5. Let o be (-8)/(-2)2/w. Suppose 44 = 5y - 4j, -5y - oj = -98 + 22. List the prime factors of y. 2, 3 What are the prime factors of (10 - 13) + 1(-2 - -451)? 2, 223 Suppose u - 5w - 198 = 125, 2 = 2w. Let a = u - 185. Suppose 4g + 189 = 5h, -3h + g - 6g = -a. List the prime factors of h. 41 Suppose -5t = -10t - 845. Let j = 279 + t. List the prime factors of j. 2, 5, 11 Let g(k) = -k*2 + 20k - 197. Let c be g(17). Let o(w) = -19w - 7. Let m be o(5). Let i = m - c. What are the prime factors of i? 2, 11 Suppose 0 = u - 2, 4o - u + 1780 = 3u. Let l = -294 - o. What are the prime factors of l? 149 Let t(z) = -22z + 22z + 10z*2. List the prime factors of t(-3). 2, 3, 5 List the prime factors of 2452 + (-25)/(75/(-24)). 2, 3, 5, 41 Suppose -3g + i - 133 = 0, -3g + 5i = -4g - 39. Let l = g + 79. Suppose 5h = 100 + l. List the prime factors of h. 3 Let y(s) = -3s + 6s + 3s + 2 - 2s + s*2. What are the prime factors of y(-10)? 2, 31 Suppose 16 = 28b - 20b. Suppose -2g = 4, -5y + 88 = bg - 128. What are the prime factors of y? 2, 11 Let n be 21 + (-5)/(15/(-9)). Suppose w + n = 3w. List the prime factors of w. 2, 3 Let o = 22 + -15. Suppose 2g + o + 16 = i, 0 = g + 2i + 14. Let m = -9 - g. What are the prime factors of m? 3 Suppose 0 = 5c - c. Suppose 5t - 8p = -3p + 240, 5t + p - 270 = c. List the prime factors of t. 53 Let h(f) = f*3 + 2f*2 - 3f. Suppose 6d - 3d = 6. Let t be h(d). Suppose t = -y + 3y. List the prime factors of y. 5 Let m(s) = -s3 - 14s*2 + s + 19. Let p be m(-14). Suppose -147 = -5z + 4g, 0g + 4g - 123 = -pz. List the prime factors of z. 3 Let d = 1161 - 739. Suppose b = 4r + 85, r - d = -4b - 31. What are the prime factors of b? 97 What are the prime factors of (78/(-2))/(1260/(-114) - -11)? 3, 13, 19 Let b = 1 + -14. Let m(c) = c*2 - 14c - 15. Let p(g) = -2g2 + 15g + 16. Let h(s) = -3m(s) - 2p(s). List the prime factors of h(b). 2, 13 Suppose -369 = -5x + 1971. List the prime factors of x. 2, 3, 13 Let w = -8410 + 12959. What are the prime factors of w? 4549 Let h(g) = -g3 - 19g*2 + 15g - 13. Let z be h(-22). Let i = -786 + z. List the prime factors of i. 17, 19 Suppose 2p = 2m + 2290, -p - m + 77 + 1058 = 0. List the prime factors of p. 2, 3, 5, 19 Suppose 4w = 8, -l + w - 40 + 236 = 0. What are the prime factors of l? 2, 3, 11 List the prime factors of 2/(82467/(-16497) - -5). 3, 13, 47 Let a be (27/(-12))/(3/8). Let x be 12(0 + (-3)/a). Suppose 0 = -xm + m + 195. List the prime factors of m. 3, 13 Suppose 0 = 2k + k - 6. Suppose 2s + 2b = k, 5b + 13 = -0s - 2s. List the prime factors of s. 2, 3 Let s(u) = -7u*2 - 2u - 4. Let h(x) = 8x2 + x + 4. Let y(j) = -4h(j) - 5s(j). Let c be y(-3). What are the prime factors of 18/(-1)(c - 16)? 2, 3 Let o(l) = -30l3 + l + 1. Suppose -j + 3 = -t, 4t - 2j + 6j = 4. Let c be o(t). Suppose 2d - c = 2. List the prime factors of d. 2 Let u = -19 - -23. Let l(z) = 0 - 6z - 7z2 - z3 - 5 + uz. List the prime factors of l(-7). 3 Let k = 765 + -436. List the prime factors of k. 7, 47 Let m = 6 - 4. Let h(o) = 2o - 3. Let l be h(m). List the prime factors of 464/(-32)(-3 - l). 2, 29 Let q(f) = -13f - 17f + 49f - 17 - 17f. Let r be q(11). Suppose 0 = -j + 9 - r. What are the prime factors of j? 2 Suppose d = -3a + 75 + 19, 68 = 2a - 2d. Let s = a - -42. What are the prime factors of s? 2, 37 Let r(v) = -v2 - 8v - 7. Suppose 0 = 3f - 9 + 24. Let m be r(f). List the prime factors of 4/m-2-15. 3, 5 Suppose 0 = -34u + 40u - 2388. What are the prime factors of u? 2, 199 Let v = -3 - 9. Let i be v/(-16)(-16)/(-6). Suppose -iz - q = 3z - 54, 18 = z + 2q. List the prime factors of z. 2, 5 Let j(g) = -7g*3 + 2g*2 + 2g + 1. Let u be j(-1). Suppose 3h = -3k - 33, -2h = -2k + u + 2. Let f = 41 + h. What are the prime factors of f? 3, 11 Suppose -2w + 4w = 5g - 1954, -4g + 5w = -1570. List the prime factors of g. 2, 3, 5, 13 Let v(t) = -11t + 4t - 2t*2 - 9 - 3t*2 + 2t*3 - 3t*3. Let l be v(-5). Suppose 52 = 2d + 4f, d + 3f - l = -f. What are the prime factors of d? 2, 13 Suppose -2s + s + 4 = 0. Suppose 0l - 20 = sl. Let p = 15 + l. List the prime factors of p. 2, 5 Let z = -11 - -11. Suppose 2q - 7q = z. Suppose -5y + 58 = 3b, 2y + 65 = 3b - qb. What are the prime factors of b? 3, 7 Suppose -14483 - 3451 = -7i. List the prime factors of i. 2, 3, 7, 61 Let h(u) = -u2 - 1. Let b(a) = -a3 + 24a*2 - 56a - 34. Let s(i) = -b(i) + 5h(i). What are the prime factors of s(27)? 83 Suppose -55u = -45u - 6070. What are the prime factors of u? 607 Suppose 0 = -3k - 6k + 3672. What are the prime factors of k? 2, 3, 17 Let p(u) be the first derivative of 11u*2/2 + u + 12. List the prime factors of p(1). 2, 3 Suppose 2g - 204 = -4t, 2g = 23t - 20t + 190. What are the prime factors of g? 2, 7 Suppose 2974 = 2k + 1098. List the prime factors of k. 2, 7, 67 Suppose -5x - 1175 = -p - 5232, 4x = 5p + 3254. What are the prime factors of x? 811 Let a(d) = -d + 12. Let l be a(6). Let j be -2(-5)/(-10) + l. Suppose 3q = 2v - 0q - 10, jv = 2q + 14. What are the prime factors of v? 2 Let q = 15 + 207. List the prime factors of q. 2, 3, 37 Let d be (-6 + 8)(-20)/2. List the prime factors of (-2772)/d + 4 + (-46)/10. 2, 3, 23 Let y(l) = -2l + 3. Let t(a) = 4a - 4. Let c(g) = -3t(g) - 5y(g). Let h = 4 + -12. List the prime factors of c(h). 13 Suppose -12r + 622 = -10r. Suppose -55 = 4z - r. List the prime factors of z. 2 Suppose 18r = 10260 + 6642. List the prime factors of r. 3, 313 Let a(c) = 32 - 17c + 6 - 3 - 11c. List the prime factors of a(-7). 3, 7, 11 Let r(s) be the first derivative of s4/4 - s3 - s2/2 + 6s - 3. Let k be r(5). Let j = 74 - k. List the prime factors of j. 23 Suppose 0 = -16d + 6357 + 4843. List the prime factors of d. 2, 5, 7 Suppose 2t - a = 1705, -16t + 17t + 4a - 875 = 0. What are the prime factors of t? 3, 5, 19 Let y(k) = k3 + 9k*2 - 21k - 2. What are the prime factors of y(-9)? 11, 17 Suppose 0k + 3k = 135. Let l = k - 117. Let f = l - -104. List the prime factors of f. 2 Let s(m) = m*2 + 4m - 7. Let q(y) = y*3 + 3y*2 - y + 2. Let c be q(-4). List the prime factors of s(c). 53 Let w be -3 - (-10)/4 - 1045/10. Let s = 26 - w. List the prime factors of s. 131 Let v = 819 + -445. List the prime factors of v. 2, 11, 17 Let p = 1101 + -636. List the prime factors of (p/45)/(1/3). 31 Suppose 30u - 2403 - 177 = 0. What are the prime factors of u? 2, 43 Suppose b + 20 = 5b. Suppose 0 = bg - 3g - 328. List the prime factors of g. 2, 41 Let f be ((-2)/6)/(4/(-24)). Let i be f(140/8 - 2). Suppose -i = -5n + 144. List the prime factors of n. 5, 7 Let k(u) = -u3 + 12u*2 - 10u - 8. Let i be k(11). Suppose -ix - 139 = -13. What are the prime factors of 44/33x/(-4)? 2, 7 Let g(m) = -18 + m*2 + 9m + 14 + m*3 - 2m - 15m2. List the prime factors of g(14). 2, 47 Let k = -239 - -316. What are the prime factors of k? 7, 11 Let m = -316 + 724. What are the prime factors of m? 2, 3, 17 Suppose -2699 = -8r - 683. List the prime factors of r. 2, 3, 7 Let w(k) = k*2 + 4k - 10. Let b be w(-6). Suppose 0 = s + b - 5. What are the prime factors of 64 - (3 + s + -4)? 2, 31 Suppose 2403v - 2418v + 52920 = 0. What are the prime factors of v? 2, 3, 7 Suppose 0 = -3u - z + 32, 0 = -4u + 2z - z + 52. Let a be 206/3 + 4/u. Suppose o + 20 = a. What are the prime factors of o? 7 Suppose 4l + 1 = -3s, -2l + 0l + 3s + 13 = 0. Suppose 218 = v - 2x - 3x, 5v - lx - 1182 = 0. What are the prime factors of v? 2, 7, 17 Let f(q) = -27*q + 6. Let b be f(4). Let v = b - -212. What are the prime	{ "pile_set_name": "DM Mathematics" }
- 35. -9j2 - 4 Collect the terms in 5462w*2 + 145w - 5459w2 - 5 + 5 + 0. 3w*2 + 145w Collect the terms in 21p3 + 4p - p + 2p3 - 14p*3 - 10p*3 - 3p. -p*3 Collect the terms in 65633 + 64463t*2 - 65633. 64463t*2 Collect the terms in 93u*2 - 35 - 400u*2 + 33 + 412u*2. 105u*2 - 2 Collect the terms in -1170y + y*2 - 20 - 3y*2 + 207y. -2y2 - 963y - 20 Collect the terms in 210a - 4018 + 2018 + 2000 + 5a. 215a Collect the terms in 5558h - 6522h + 43744h + 31303h. 74083h Collect the terms in 4128 - 17277 + 4129 + 4896 - 10o + 4124. -10o Collect the terms in -2305k + 902k - 106k2 + 1403k. -106k2 Collect the terms in 644 - 177 - 38h - 153 - 2h3 - 154 - 160. -2h*3 - 38h Collect the terms in 0w2 - 6124w - 2w3 + 2w*2 + 17126w + 23069w. -2w*3 + 2w*2 + 34071w Collect the terms in 13n3 + 5116325610215624n*2 - 5116325610215623n*2. 13n3 + n2 Collect the terms in 661344g3 + 131g - 131g - 662847g*3. -1503g*3 Collect the terms in 14q*2 - 336q*2 + 0q*2 - 35q*2. -357q*2 Collect the terms in 2758l*3 - 660l*3 - 2161l*3. -63l*3 Collect the terms in 3 + 5583y*2 - 5327y*2 - 5. 256y*2 - 2 Collect the terms in -4w*3 + 11w*3 + 12w + 87w2 + 62w*2 - 149w*2. 7w*3 + 12w Collect the terms in 177q2 - 531q*2 + 2451q + 173q2 - 2451q + 177q2. -4q*2 Collect the terms in -863g*2 - 667g*2 + 1530g*2 + 172g*3. 172g*3 Collect the terms in 32842r - 32866r + 17r*3 + 7r*3 - 27r*3. -3r*3 - 24r Collect the terms in 194062o + 40 - 91 + 51. 194062o Collect the terms in -1453y2 + 3 + 452y*2 - 3 + 500y*2 + 504y*2. 3y*2 Collect the terms in 200c - 494c - 4 - 3c*3 + 53 + 248c + c*3. -2c*3 - 46c + 49 Collect the terms in 72f3 - 21f*3 - 51 - 24f*3 - 16f*3 - 41 + 92. 11f*3 Collect the terms in -325q + 207q + 38q + 60q. -20q Collect the terms in 40l + 100l - 140l - 20l*2 - 147l*2. -167l*2 Collect the terms in 4150d*2 - 2056d*2 - 2d - 1100 - 2096d2. -2d*2 - 2d - 1100 Collect the terms in -76h + 59 + 156h + 55 - 78h - 114. 2h Collect the terms in 8a + 9 - 24a + 2a2 - 8 + 147a + 477a. 2a*2 + 608a + 1 Collect the terms in 2m - 89m*2 + 3540m*3 + 118m*2 - 3536m*3. 4m*3 + 29m*2 + 2m Collect the terms in 7865g - 3192g - 4578g. 95g Collect the terms in -249311k + 62334k + 62332k + 62324k - k*3 + 62321k. -k*3 Collect the terms in 34 - 11 - 192563o - 23. -192563o Collect the terms in 23059 - 23059 + 14002l - 14006l. -4l Collect the terms in 58b + 18b - 26b + 95b + 23b + 11b*2. 11b*2 + 168b Collect the terms in j*2 + 60 + 0j*2 - 4j*2 + 20j*3 - 19j3. j3 - 3j2 + 60 Collect the terms in -174 - 109t - 115t + 458t - 116t - 121t. -3t - 174 Collect the terms in -2h*2 + 354 - 191 + 32 - 195. -2h*2 Collect the terms in 5 + 2727844m - 16 + 7 + 2727872m - 5455729m + 4. -13m Collect the terms in -24y*2 + y + 40y*2 - 391 + 544y*3 - 16y*2. 544y*3 + y - 391 Collect the terms in -409a*3 + 1247a*3 - 414a*3 - 429a*3. -5a*3 Collect the terms in 119u*3 + 58u*3 - 41u*3 + 23303 - 23303 + u. 136u*3 + u Collect the terms in 7829143u*2 + 7829511u*2 - 15658661u*2. -7u*2 Collect the terms in -736n*3 - 100n*3 - 140n*3 + 20n*3. -956n*3 Collect the terms in -867i + 178i + 288 - 145 - 654i - 144 - 208i + i2. i2 - 1551i - 1 Collect the terms in -2844557y2 - 2844566y*2 + 5689122y2 - 145. -y2 - 145 Collect the terms in 26d3 + 345799d*2 - 691599d*2 + 345799d*2. 26d3 - d2 Collect the terms in -111w2 + 375w*2 - 69w*2 - 128w*2 - 72w*2. -5w*2 Collect the terms in 12q*3 + 13q*3 - 94 - 59 - 119 + 323 - 51. 25q*3 Collect the terms in 21r*3 + 25r*3 + 17848r + 17842r - 35690r. 46r3 Collect the terms in -b - 1412b*2 - 7 + 9 + 9 - 778b*2. -2190b*2 - b + 11 Collect the terms in -3 + 62i*2 - 13 - 73i*2 + 44i*2 - 2i. 33i2 - 2i - 16 Collect the terms in 63 + 118g3 + 2g + 63 - 104 - 2g - 24. 118g*3 - 2 Collect the terms in -92f*3 - 13 - 779f + 296f3 + 778f. 204f3 - f - 13 Collect the terms in -781862g*3 - 6321211g*3 + 2g*2 + 931799g*3 - 4. -6171274g*3 + 2g*2 - 4 Collect the terms in -34c + 868 + 33c + 1682. -c + 2550 Collect the terms in 14766s - 1265s + 14885s - 3523s. 24863s Collect the terms in -304 - 9p2 - 106 - 113 + 523 - 11p*2. -20p*2 Collect the terms in 2150953q2 + q3 + 2q3 - 2150959q*2. 3q*3 - 6q*2 Collect the terms in 600665b - 9 + 9 + 79308b. 679973b Collect the terms in -2325q3 - 6360q*3 + 677q*3. -8008q3 Collect the terms in v3 - 4077v + 1954v + 2123v - 45v*3. -44v*3 Collect the terms in -110s + 8042021s2 - 8041994s*2 + 110s. 27s2 Collect the terms in -69g - 70g - 49g - 55g + 233g. -10g Collect the terms in 102o*2 - 26o*2 - 792o - 74o2 - 1 + 1 - 251o. 2o2 - 1043o Collect the terms in -389604701509 + 6d3 + 389604701509. 6d*3 Collect the terms in -764x*2 + 764x*2 + 6242421942x*3 - 6242421947x*3. -5x*3 Collect the terms in -22 - 218h - 13h + 20 - 229h + 0h2 - 3h*2 + 149h. -3h2 - 311h - 2 Collect the terms in 0m2 + 1 + 0m*2 + 210649m*3 - 210579m*3. 70m*3 + 1 Collect the terms in -628v*2 - 1438v*2 + 285v*2. -1781v*2 Collect the terms in 1723y*3 - 852y*3 - 869y*3 + 683y. 2y3 + 683y Collect the terms in -7452n2 + 132n*3 + 3721n*2 - 126n*3 + 3731n*2. 6n*3 Collect the terms in -177u + 70 - 16u2 + 90u - 43 + 87u. -16u*2 + 27 Collect the terms in -29933d + 28249d + 73607d. 71923d Collect the terms in -33 - 110p*3 - 37 - 220p*3 + 85p*3 + 71. -245p*3 + 1 Collect the terms in -9 - 3763x*3 + 9 - 2757x*3 + 2081x*3. -4439x*3 Collect the terms in 4u - 20043 + 19214 + 33966 + 48721. 4u + 81858 Collect the terms in 2453p + 1713p + 1379p. 5545p Collect the terms in 0 - 5 + 84b*2 - 213b*2 - 1 + 147b*2 + 6. 18b*2 Collect the terms in 580m*2 - 1746m*2 + 584m*2 + 585m*2 - 10m*3 + 45m*3 - 13m*3. 22m*3 + 3m2 Collect the terms in s - s2 + 5087s3 + 6075s*3 - 11855s*3. -693s3 - s2 + s Collect the terms in 247y3 + 677y*3 - 932y*3. -8y*3 Collect the terms in 161568u - 2 - 80790u - 80777u. u - 2 Collect the terms in 2j2 - 8j*2 + 209j*3 + 206j*3 + 6j*2 + 103j*3. 518j*3 Collect the terms in 0f*2 - 310f - f*3 + 24f + 0f2 + 100f + 84f. -f3 - 102f Collect the terms in -67l + 252l - 5l - 43l - 138l. -l Collect the terms in -72572c*2 - 8c + 8c - 58727c*2. -131299c*2 Collect the terms in -1 + 12 - 27 + 16 + 93001r*2. 93001r*2 Collect the terms in -42b*2 + 959804 + 958429 - 1918233. -42b*2 Collect the terms in 291m - 43 - 37 + 108 - 28. 291m Collect the terms in -1786i*2 - 1479i*2 + 3373i*2. 108i*2 Collect the terms in -553968217 - 102z - 18z + 553968217. -120z Collect the terms in 45097 + 2o - 24o + 23o. o + 45097 Collect the terms in 269340 + 12n + 926n2 - 269340. 926n*2 + 12n Collect the terms in -68s2 + 104s*2 + 15s*2 - 52s2. -s2 Collect the terms in 188i3 + 3i - 720i3 + 466i*3 - 3i. -66i3 Collect the terms in 19699s + 0 + 1 - 59121s + 19695s - 1 + 19728s. s Collect the terms in -7o*2 + 84o - 44o + 10o*2 + 189 - 42o. 3o2 - 2o + 189 Collect the terms in -30z - 23z + 64z - 119 + 204 - 85. 11z Collect the terms in 8141o3 + 9300o*3 + 104o*2 - 17439o*3. 2o*3 + 104o*2 Collect the terms in -6u - 35057u2 + 2u + 4u. -35057u*2 Collect the terms in 97m*3 - 12m*3 + 70m*3 - 10m*3. 145m*3 Collect the terms in -168j*2 - 55j*2 - 183j*2 - 99j*2 + 477j*2 - 177j*2. -205j*2 Collect the terms in 21561y*2 + 6455y*2 - 2874y*2. 25142y*2 Collect the terms in -2 + 2 - 34807y - 78588y. -113395y Collect the terms in -334139u3 + 334143u*3 + 13761u - 13761u. 4u*3 Collect the terms in -93066 + 93066 + 505j*3 + 711j*3. 1216j*3 Collect the terms in 26590j*3 - 51706j*3 + 26229j*3. 1113j*3 Collect the terms in -14u + 14u*3	{ "pile_set_name": "DM Mathematics" }
t c(p) = -p*3 + 8p*2 + 3p - 23. Let l be c(8). Let h be (l/(-2) - 1)/3. What is the third biggest value in -4, y, h? -4 Let z = -4802 + 4813. Which is the second biggest value? (a) 1 (b) -0.4 (c) z (d) -2 (e) 0.4 a Let f = 359.4 - 405. Let w = -47.6 - f. What is the third biggest value in 0.3, w, 5? w Let h = -3.5 - 0.5. Suppose -5w - b - 17 = -1, -2w = 5b + 11. Let t = -13.873 + 13.623. What is the biggest value in w, h, t? t Let z = 899.23 - 905. Let j = z - -2.77. Which is the smallest value? (a) 1 (b) j (c) -0.3 (d) -1.3 b Let f = -891 - -892. Which is the second biggest value? (a) f (b) -13 (c) 2 (d) -1/10 (e) 3/8 a Let b = -11452 - -11450. What is the fourth biggest value in -2/141, b, 0.2, 1? b Let m = 3.579 - 3.569. Which is the second biggest value? (a) 1/3 (b) 3 (c) m (d) 0 a Let v = -16.63 - -16.83. Let s = -0.6 + 0.2. Let i = v + s. What is the fourth biggest value in i, -2/15, -3/4, 0.5? -3/4 Let x = -13995361/77 + 181778. Let a = 216/11 - x. What is the smallest value in a, -1/4, -10? -10 Let k = -9970.991 + 9971. What is the biggest value in -80, -5, k, 4? 4 Let i = 724.0529 + -724. Which is the biggest value? (a) i (b) -1/4 (c) 0 a Suppose -10 = -4z - 3v, 4v - 2v - 3 = z. Let g = 6.6 + -6.1. Let x be (1 - 2/(-6))/((-8)/(-30)). Which is the smallest value? (a) 0.4 (b) z (c) x (d) g a Let f = -14120 + 14150. Which is the third smallest value? (a) -0.4 (b) f (c) 6/17 b Let l = 33.71 - 33.21. What is the fourth biggest value in -1, 2, 6, l? -1 Let z = 1601 - 142491/89. Suppose 0 = -3g - 3n - 12, -5g - 914n = -912n + 8. What is the third biggest value in 3/8, 2, z, g? g Let v = 17032.6 + -17033. What is the second biggest value in v, 10, 1/76? 1/76 Let b = -1.42 - 0.28. Let u be (1287 - 1293)1/33. What is the third biggest value in u, -3, b? -3 Let w = 0.2949 + -0.2949. Which is the second smallest value? (a) 0.4 (b) w (c) 1.2 (d) -0.21 b Let w be (-1020)/(-48) - (2 + 20). Let j = 2 + -1. Which is the fourth biggest value? (a) 3/4 (b) -4 (c) j (d) w b Let w = -149.35 - -144.35. Which is the smallest value? (a) w (b) -2 (c) 4964 a Let r = 4 - -2. Suppose -4u + l = rl - 26, -5l + 10 = 0. Let x = 189.5 + -189. What is the second biggest value in 1/5, x, -0.3, u? x Let g = -13651.4 - -13651. Which is the third biggest value? (a) -5/3 (b) 1/6 (c) g (d) -0.34 (e) -0.5 c Let y = -6.5 + -28.5. Let h = -29 - y. What is the second biggest value in -3/7, h, 0? 0 Let g = 0.7889 - 0.3889. Which is the fourth biggest value? (a) 0.17 (b) g (c) -5 (d) -130 d Let g(z) = z*2 - 21z - 34. Let f be g(23). Let v(d) = -11d + 16. Let y be v(f). Which is the smallest value? (a) y (b) -0.4 (c) -2 a Suppose 8 = -3i - 7. Let q = -14.61 - -16.5. Let x = 1.59 - q. What is the second biggest value in -3/7, x, i, -4? -3/7 Let f be 2 + -4 - (8 - 6 - 3). Let p = -143.02 + 143. What is the second biggest value in p, f, 2, 3? 2 Suppose 0 = 3j - 2j - 3, -4p + 4j = -48. Let k be -3 + (-6)/(-6) - (-8)/16. Which is the smallest value? (a) p (b) k (c) -0.3 (d) 0 b Suppose 0f = 3f - 12. Let i be (1 + (-24)/30)/((-1)/(-5)). Let u = -1 - -0.9. Which is the biggest value? (a) -1/4 (b) f (c) u (d) i b Let f = -1207.4 - -1211. Which is the third biggest value? (a) 2/7 (b) -2/3 (c) f b Let o = 1 + 0. Let x = -24 - -23. Let s = -1140 + 1140.05. Which is the third smallest value? (a) s (b) o (c) x b Suppose 8q - 3q - 2n = -25, q + 5 = 2n. Let k = -67 + 71. Which is the fourth biggest value? (a) k (b) 1 (c) -0.3 (d) q d Let a = 1737 - 1732. Let y be ((-30)/(-63))/(-5)(-35)/5. Let o = 0.5 + -0.53. What is the third biggest value in o, y, a, -5? o Let z(w) = -6w*2 - 166w + 59. Let i be z(-28). Which is the fifth smallest value? (a) -0.4 (b) 1/15 (c) 3/5 (d) i (e) -5/4 d Let j be (128/126)/2 - 20/225025. Which is the second smallest value? (a) j (b) -9 (c) 6 (d) -1 d Let v = -1339/30 + 647/15. What is the second biggest value in v, 3/2, -32? v Let u be (-1 + (-24)/8)/(6 - 3). Let a be 3 + ((-26)/(-10))/(-1). What is the smallest value in u, 1/2, a, -10? -10 Let l = -0.1 - 0.1. Let u = 366.48 - 366.53. Suppose -2v + 4v = -4. What is the second biggest value in v, 5, u, l? u Let n = -24 + 78. Suppose 0h - 162 = -3h. Let k = h - n. Which is the third smallest value? (a) 3/5 (b) k (c) -4 a Suppose 47s - 4313 = 7625. What is the biggest value in 5, 1/3, s? s Let c(m) = m*3 + 9m*2 - 138m + 11. Let y be c(8). Let w = -2.35 + -0.65. What is the second smallest value in 0.02, w, -0.3, y? w Let q be (-8 - -2)/((-3)/2). Let d be -85 + q(3 + -4). Which is the smallest value? (a) 2/9 (b) d (c) -0.2 b Let j = 29/150 + -1579/150. Which is the second smallest value? (a) j (b) -0.08 (c) -2/15 c Let u = 275 + -274.971. Let w = u - 0.129. What is the second smallest value in 2/5, 2/13, -2/3, w? w Let f = -0.27 - 94.73. Let k = f - -98. Suppose 3y + y = -76. What is the third biggest value in k, y, -1? y Let k = -83 - -65.4. Let g = -17.5 - k. What is the second biggest value in 0.4, 1/4, g? 1/4 Let m(n) = -2n2 - 4n + 6. Let q be m(-5). Let i be (15/(-2))/(10/q). Which is the second biggest value? (a) -3 (b) -0.1 (c) i b Let p = 0.52253 - 0.02253. What is the second smallest value in 45, p, -0.02? p Let u = 2.2184 + -0.2184. Which is the second biggest value? (a) 3 (b) 0.039 (c) u c Let a = -698 - -265. Let c = a - -433.1. What is the second smallest value in -2, c, 2, 5? c Suppose 0 = 2k + 4w - 10, 0 = 5k - 0k - 5w + 50. Let h = 2530.7 - 2531.2. Which is the second biggest value? (a) -3 (b) h (c) k (d) -2/3 d Let q = 39 - 8. Suppose -90 = 5c - 3b, 3c - 4b + 34 = -q. What is the smallest value in -5, -1, c? c Let r = -1104 - -1104. Suppose t = 3f + 106, -t + 179 = -5f + 3t. Let x be (-2)/(-5) - (-9)/f. Which is the biggest value? (a) 2/7 (b) r (c) x a Let v = -37/2 + 19. Let r = -0.22 - 135.78. Let y = 135.6 + r. What is the biggest value in v, -2, y? v Let q = -104.8046 + -0.1954. Let x = -0.05 + -0.35. What is the third smallest value in -0.1, q, x? -0.1 Let y = -321.2549 - 0.7451. What is the biggest value in 3, -2/11, y? 3 Suppose -5k + 45 = 5v, 5v - 11 + 16 = 5k. Which is the third smallest value? (a) 38 (b) 0.1 (c) 2/11 (d) -7 (e) v c Let j = -1118.08 + 1100. Let k = 18 + j. What is the third biggest value in k, -5, -2/11? -5 Let t(i) = -4i2 - 6i + 4. Let d be t(-2). Let k be (-15)/(-25)(d + (-10)/(-6)). Which is the third biggest value? (a) -1/6 (b) -0.13 (c) k a Let r be (-1)/(-2) - (0 - 14/(-7)). Let o = -0.3 + 2.3. What is the smallest value in 0, r, 1, o? r Suppose 3y + 2s = -2y + 99, -y = s - 18. Let b = -1049 - -1047. What is the third biggest value in -0.3, b, -5, y? b Let t = -30265 - -30315. Which is the smallest value? (a) 1 (b) t (c) -0.09 (d) -5 (e) 0.1 d Let t = -622.87 + 626. Let w = t - 2.8. Let k = w - -5.67. Which is the biggest value? (a) -0.5 (b) k (c) 1/6 b Let f = 23711 + -687617/29. What is the fifth smallest value in -0.1, 1/4, 16/3, -4, f? 16/3 Let g = 2.58 - 2.88. Let f = 81/2 - 39. What is the fourth biggest value in g, 1/4, 1/10, f? g Let y = -1.0615 - 2058.9385. What is the second smallest value in y, 0.1, 5? 0.1 Let q = -0.21033 + 1.21033. Which is the second smallest value? (a) 0.0948 (b) q (c) -0.2 a Let s = -0.0307 + -0.6033. Let n = 1.134 + s. Which is the third smallest value? (a) 5 (b) n (c) -8 (d) -5 b Let j = 2967 - 2967.1. Which is the third biggest value? (a) j (b) -2/19 (c) 4 (d) 3 a Let v = 3341 + -6685/2. Let w(r) = -r - 6. Let n be w(-6). What is the third biggest value in v, n, -5, -2/15? v Let p = -0.2 + 0.3. Let i = -45820 - -45819.6. Suppose 2c - 2z = 14, z + 1 = -c + 4. What is the smallest value in c, i, 0.2, p? i Let n = 398087.5 + -398087. Let q = -78 + 112. What is the second biggest value in q, -4, n? n Let q = 0.3 - 0.1. Let i = 1 - 0. Let g be (-23/(-54))/((-19)/(-342)). What is the third smallest value in i, -2/15, q, g? i Let t = 185.6 - 186. Let y = 93 + -89. Suppose -yf + 8 = -12. Which is the second smallest value? (a) 4 (b) f (c) 1/4 (d) t c Let k = 9.21 - 0.21. Let j = 39875.5 + -39875. What is the smallest value in 0.2, k,	{ "pile_set_name": "DM Mathematics" }
w - 3 + 236w - 696w. Calculate 6r(j) + 17v(j). -2j - 1 Let w(l) = -5l3 + 4l*2 + 3l + 49. Let f(t) = -2t3 + 2t*2 + 2t - 2. Calculate 2f(j) - w(j). j3 + j - 53 Let t(j) = -3j2 + j2 - 2 + 5j3 + j3. Let p(c) = c3 - 1. Suppose 16 = 6l - 4l. Let k be 26/(-7) + l/(-28). Determine kp(f) + t(f). 2f3 - 2f*2 + 2 Let n(y) = y. Let t(m) = -5m + 3. Let w(o) = -27o + 17. Let h(d) = 11t(d) - 2w(d). Calculate 2h(x) - n(x). -3x - 2 Let z(f) = 6f - 251. Let h(m) = 4m - 126. What is 5h(q) - 3z(q)? 2q + 123 Let m(y) = -2 + 9y3 + 488y - 489y - y3. Let a(o) = 7o*3 - o - 2. What is -6a(t) + 5m(t)? -2t*3 + t + 2 Let r be (2 + 2)/(0 - -2). Let o(y) = -2y + 6. Let l be o(-4). Let b(q) = -5q + 5q*2 - lq*2 + 5qr. Let i(j) = -j2 - j. Give -3b(h) + 15i(h). -3h2 Let v(y) = 2y*3 - 4y*2 + y. Suppose 5a = -5j + 275, -28 = -j + 2a + 15. Let r be (-3)/12 + (j/4)/3. Let t(o) = -o3 + o2 - o. Give rt(b) + v(b). -2b*3 - 3b Let q(f) = 7f3 - 3f*2 - 3. Let x = 757 - 759. Let j(t) = 8t*3 - 2t*2 - 2. Give xq(d) + 3j(d). 10d*3 Let l(w) = w. Let z = -35 + 43. Let i(v) = -28v - 1 + zv + 10v + 9v. Determine i(h) + 3l(h). 2h - 1 Let f(l) = l2 - 13l - 1. Let a(b) = 4b2 - 51b - 6. Give -2a(t) + 9f(t). t*2 - 15t + 3 Let w(m) = -26m2 - 2m - 10. Let t(j) = 9j2 + j + 4. What is 11t(c) + 4w(c)? -5c*2 + 3c + 4 Let r(c) = -2c3 + 5c*2 + 4c + 5. Let j(o) = -o*2 + o - 1. Give -5j(t) - r(t). 2t3 - 9t Let y(i) = -3i - 19. Let o(w) = -w - 3. Let j(u) = -4o(u) + y(u). Let h(r) = r - 8. Calculate 5h(n) - 6j(n). -n + 2 Suppose 2t + 0t - 18 = 0. Suppose -5x - 40 = -tx - 2s, 4x = -5s + 34. Let a(n) = 21n*3 + 4n. Let g(z) = -4z3 - z. What is xg(h) + 2a(h)? -2h*3 - 3h Let d(a) = -2a3 + 2a*2 + 108a - 5. Let u(n) = 5n3 - 6n*2 - 325n + 14. Give -8d(h) - 3u(h). h*3 + 2h*2 + 111h - 2 Let o(j) = -26j2 - 24j + 16. Let g be -6 + 2/(-6) + 60/18. Let y(x) = 5x2 + 5x - 3. What is go(s) - 16y(s)? -2s2 - 8s Let g(o) = -2o2 + o. Let u(d) = 300d*2 - 4d. What is 4g(x) + u(x)? 292x*2 Let x(g) = 15g - 8g + 0g - 4. Let h(z) = -3z2 + 7z. Let s be h(3). Let y(i) = -8i + 5. What is sx(v) - 5y(v)? -2v - 1 Let n(u) = -u*3 - 2u*2 + 110u - 13. Let h(l) = 3l3 + 6l*2 - 329l + 37. Determine -6h(w) - 17n(w). -w*3 - 2w*2 + 104w - 1 Let z(w) = -10w2 - w - 13. Let m(y) = -7y*2 - y - 9. Let r be (4/14)/(1/14). Suppose -2 = -ru + 18. Determine uz(f) - 7m(f). -f*2 + 2f - 2 Let f(a) = 7a - 4a - 25 + a2 + 18. Let y be f(-4). Let r(i) = i3 - i2 - i + 1. Let l(h) = h3 + h*2 + h - 1. Determine yl(s) - 3r(s). -6s*3 Let w(k) = -2k3 + k2 - 1. Let y(r) = 3r2 - 65. What is -w(d) + y(d)? 2d*3 + 2d*2 - 64 Let h(p) = 8p + 13. Let s(t) = -11t - 14. Determine 4h(z) + 3s(z). -z + 10 Let m(i) = -13i - 1489. Let z(l) = 4l + 495. Give -2m(q) - 7z(q). -2q - 487 Let i(v) = 2v + 5. Let w(b) = 8 - 29b + 35b - 1 + 8. Determine -11i(r) + 4w(r). 2r + 5 Let p(j) = -9j2 - 2j - 2. Suppose -3t - 7 = -31. Let g(r) = -14r*2 - 3r - 3. What is tp(c) - 5g(c)? -2c2 - c - 1 Suppose -5m + 5w - 20 = 0, -2m + m - 9 = -2w. Let x(u) = -u. Let c(h) = -h + h + h - 4 + 4. Calculate mx(t) - 5c(t). -6t Let v(m) be the second derivative of m*4/4 - 5m*3/6 - 2m*2 + 345m. Let s(b) = -7b2 + 11b + 9. Calculate 4s(h) + 9v(h). -h*2 - h Let y(l) = -3l - 5. Let p(v) be the third derivative of -v5/10 + v4/12 + v*2. Let z be p(1). Let f(x) = 0 + 2 + 2x + 2. Calculate zy(u) - 5f(u). 2u Let d(q) = 9q + 5. Let a(y) be the third derivative of -1/3y3 - 1/6y*4 + 0y + 8y2 + 0. Determine 5a(p) + 2d(p). -2p Let q(a) = -11a + 11. Let c(u) = -u2 - 3. Let b be c(0). Let h(y) be the second derivative of -5y*3/6 + 5y*2/2 + 12y. Determine bq(s) + 7h(s). -2s + 2 Let m(k) = -k2 - 1. Let v(u) = -37u*3 - 4u*2 - 4. Calculate 20m(q) - 5v(q). 185q3 Let w(u) = -u2 - 3u - 6. Let m(q) be the first derivative of -2q*3/3 - 3q*2 - 11q - 116. Determine 4m(p) - 7w(p). -p*2 - 3p - 2 Let u(s) = -4s + 2. Let d(y) = -y + 1. Suppose 3t + 7 + 8 = 0. Let x = 2154 - 2153. What is td(b) + xu(b)? b - 3 Let y(g) = -g*2 - 1. Let k(x) = -54x*2 - 63. What is 3k(v) - 189y(v)? 27v*2 Let x(n) = -2n - 4. Let a(k) = -13k2 + 7. Let w(z) = -6z*2 + 3. Let b(o) = 3a(o) - 7w(o). Let r be b(-1). Let d(p) = 1. Calculate rd(i) + x(i). -2i - 1 Let o(a) = 3a*2 - 27a. Let d(q) = -3q2 + 27q. Give 3d(s) + 4o(s). 3s2 - 27s Suppose -55 = 70u - 69u. Let j(d) = 5d3 - 6d*2 + 6. Let p(m) = 45m*3 - 55m*2 + 55. What is uj(b) + 6p(b)? -5b3 Let y be (-4)/14 - (-60)/(-35). Let l(z) = z2 + 2. Let s be l(y). Let c(a) = -26a3 - 17. Let p(g) = 9g*3 + 6. Determine sc(n) + 17p(n). -3n*3 Let m(w) = -2w + 5. Let l(i) = -12i + 24. Calculate 2l(y) - 11m(y). -2y - 7 Let r(a) = -54a2 - 6a + 16. Let f(z) = -18z2 - 2z + 5. What is 7f(m) - 2r(m)? -18m2 - 2m + 3 Let t(f) = -f*2 - 3f - 2. Let q(a) = 3a2 - 18a - 38. What is -q(x) + 6t(x)? -9x*2 + 26 Let z(c) = 11c2 + c - 1. Let q(b) be the first derivative of b2/2 - b + 3. What is -q(m) + z(m)? 11m2 Let y = 106 - 108. Let u(x) = x2 + 4x - 1. Let r(w) = -w2 - 2. Let k(a) = a2 - a + 3. Let t(d) = 3k(d) + 4r(d). Give yu(i) - 3t(i). i*2 + i - 1 Let x(m) = 3m - 3. Let l = -381 + 388. Let t(r) = 5r - 7. What is lx(i) - 3t(i)? 6i Let c(l) = l3 + l2 + l - 1. Let h(w) = 2 - 2 - 2w2 - 2w + 1 + 0w2. Let t = -59 + 13. Let d = t + 48. What is dc(r) + h(r)? 2r3 - 1 Let j(b) = 13b*3 + 2b*2 - 2b + 29. Let k(p) = -14p3 - 3p*2 + 3p - 31. What is 3j(d) + 2k(d)? 11d3 + 25 Let f(v) = -6v + 3. Let p(y) = -3y + 2. Let j(s) = -2f(s) + 5p(s). Let n = 15 - 9. Suppose n = -3q - 6. Let o(z) = 6z - 9. Calculate qo(r) - 9j(r). 3r Let m(k) = 1121k2 + 133k. Let u(d) be the first derivative of -17d3/3 - d2 + 415. Give -2m(i) - 133u(i). 19i*2 Let a(f) = -7f - 4. Let q(z) be the second derivative of -z*3 - 5z*2/2 + 3z + 130. What is -5a(d) + 6q(d)? -d - 10 Let z(o) = -4o - 11. Let w(j) be the first derivative of 0 - 22j + 7 - j*2 + 17j. Calculate -7w(b) + 3z(b). 2b + 2 Let l(z) be the first derivative of z4/4 + z3/3 - 1393. Suppose 2i = -2i + 156. Let s = -21 + i. Let v(u) = -10u*3 - 9u*2 + u. Give sl(n) + 2v(n). -2n*3 + 2n Let u(z) = 5z + 1. Let g(c) = -35 + 0c + 36 - 4c + 9c. What is 4g(v) - 3u(v)? 5v + 1 Let f(g) = -3g*3 - 4g*2 + 4g. Let q(s) = 7s3 + 7s*2 - 7s. Let r = -224 + 231. Give rf(c) + 4q(c). 7c3 Let s(b) = -b2 + b + 1. Let h(p) = 5p*2 - 196p - 6. Give h(q) + 6s(q). -q2 - 190q Let a(p) = 5p - 6. Let n(v) = -v3 + 18v*2 - v + 17. Let t be n(18). Let i(u) = u - 1. Determine ta(q) + 4i(q). -q + 2 Let m(o) = -180o - 10. Let z(d) = -61d - 3. Calculate 3m(i) - 10z(i). 70i Suppose -1 = -5x - 6. Let w(s) = -s2 + 1. Let n(f) = -2 + 29f - 27f + 3 - 4f*2 + 4. Determine xn(c) + 6w(c). -2c*2 - 2c + 1 Let u(t) = 5t2 + 8t - 5. Let p(f) = 4f2 + 7f - 4. Calculate -6p(z) + 5u(z). z*2 - 2z - 1 Let x(i) = -i + 1. Let r(c) = -16c + 32. Let p be (-4)/(160/(-1288)) + 4/(-20). Calculate px(l) - r(l). -16l Let x(b) = -2b + 2. Let l(q) = -630q + 1008. Calculate -l(h) + 504x(h). -378h Suppose -23 - 13 = -3f. Let z(o) = 15 + f - 32 + 13o. Let d(g) = 84g - 32. Give 5d(b) - 32z(b). 4b Let y(w) = -36w*2 + 21w - 21. Let z(d) = -d*2 - d + 1. Calculate 2y(u) + 42z(u). -114u*2 Let f = -23 - -27. Let b(q) = -3 - fq*3 - 7q*2 - 6q*3 + 7q*3. Let y(i) = 4i*3 + 8i*2 + 4. Determine 6b(d) + 5y(d). 2d*3 - 2d*2 + 2 Let a(o) = 674o - 2. Let p(y) = -449y + 1. Calculate -5a(q) - 8p(q). 222q + 2 Let y be 5/(40/(-24)) - (1 + -5). Let c(z) = 5z + 1. Let n(t) = -t. Let f(k) = yc(k) + 4n(k). Let r(p) = 3p + 1. Calculate 4f(l) - 2r(l). -2l + 2 Let j(n) = 4n - 3. Let v(x) = 5x - 3. Let c(r) = -4r - 75. Let l be c(-18). What is lv(q) + 4j(q)? q - 3 Let i(u) = -3. Let j(p) = -45p - 108. Give 108i(n) - 3j(n). 135n Let x be ((-12)/3	{ "pile_set_name": "DM Mathematics" }
rt(475)))*2. -120sqrt(19) + 133619/16 Simplify ((sqrt(84)/sqrt(12) + sqrt(7))3-26 + (sqrt(105)/(sqrt(9)/sqrt(3)))/((-1sqrt(60))/sqrt(12) - sqrt(5)))*2-3. -441525/4 Simplify (1(6sqrt(1331)-1-21 - (sqrt(1331) + -4 + (sqrt(1331) + 2 - sqrt(1331)) + sqrt(1331) - (sqrt(1331) - (3 + -1 + sqrt(1331))))))2. 133100 Simplify -4 + ((42sqrt(156))/sqrt(12) + 0 - (-1 + sqrt(637) + (0 + sqrt(13) + -2 - sqrt(13)) + sqrt(13))2). -845 + 56sqrt(13) Simplify -3 + sqrt(119)/(sqrt(28) + sqrt(1792) + sqrt(7)) + 6(sqrt(136) + 2(sqrt(136) + (sqrt(136)5 - sqrt(136)) - sqrt(136)))/sqrt(8). -3 + 1027sqrt(17)/19 Simplify ((1sqrt(6)-6 - (sqrt(6) - (2sqrt(384) + sqrt(384))))/(1(sqrt(2) + (sqrt(64)/sqrt(4))/sqrt(8)))-5 + -3)2. 255sqrt(3) + 21711/4 Simplify (4(-3sqrt(88)2 + sqrt(88)))/(5(-1sqrt(128) - sqrt(128))) + -2. -2 + sqrt(11)/2 Simplify (5(sqrt(99) - -2sqrt(99)) + sqrt(99) + 4-2sqrt(99))/(3-1sqrt(324)) + -5. -5 - 4sqrt(11)/9 Simplify (-1sqrt(4455) + sqrt(55) + (sqrt(660)1)/sqrt(12))/((sqrt(99) + -2-1sqrt(99) - sqrt(99)) + (-51sqrt(99) - sqrt(99))). 7sqrt(5)/12 Simplify (4-3(sqrt(156) - (sqrt(156) - ((sqrt(156) - sqrt(156)-1-5 - sqrt(156)) + sqrt(156)))))/((-1sqrt(108)3)/(sqrt(9) - -1sqrt(81))). -64sqrt(13) Simplify (-1(-4 + sqrt(3)))2 + (sqrt(3) - sqrt(21)/sqrt(28) - sqrt(3))2 - (sqrt(324)/(sqrt(12)-1))/(sqrt(144)1). -31sqrt(3)/4 + 79/4 Simplify ((sqrt(2058) + (sqrt(2058) - 3sqrt(2058)) - sqrt(2058))42)/(5sqrt(42)/(-3sqrt(112))). 1344sqrt(7)/5 Simplify (1(5 + sqrt(1539) + sqrt(1539)-3))2 - (sqrt(19) + -6(0 + sqrt(19)) + 2sqrt(304))2. -180sqrt(19) + 6010 Simplify -6(-5 + (3sqrt(720) + sqrt(720) - sqrt(720))*2 + sqrt(5)) + 3(-2 + (sqrt(720) - (-4 + sqrt(720)))). -38844 - 6sqrt(5) Simplify (0 + -1sqrt(1053)-2 + (sqrt(78)2-2)/(sqrt(6) - (-1sqrt(96) - sqrt(6))))*2 + 4. 35188/9 Simplify (6(sqrt(525) - (sqrt(525) + sqrt(525) + -1sqrt(525)6 + sqrt(525))))/(-6-1sqrt(300)-1). -2sqrt(7) Simplify (5(2sqrt(175) + 1 + -5 - (-3 + sqrt(175) + 3 + 2)))*2. -1500sqrt(7) + 5275 Simplify (((sqrt(170)2 - sqrt(170))-4 - sqrt(170)12)-2)/(-1(sqrt(10) - (sqrt(10) + sqrt(10)2-3) - sqrt(10) - sqrt(10))-6) + -1 + 1. sqrt(17)/2 Simplify (-3 + -2 + sqrt(19)26 + (sqrt(19) - (sqrt(228)1 - sqrt(228))/sqrt(12))4 + 1 + -1)2. -160sqrt(19) + 4889 Simplify (((sqrt(204) - -1sqrt(204) - sqrt(204))2 + sqrt(204) + sqrt(204))/(sqrt(4)-14))/((sqrt(192)-1 - sqrt(192))1-4). -sqrt(17)/64 Simplify (-1-1(sqrt(68) + sqrt(17)))2 + 1 + 4 + -2sqrt(17) + sqrt(17) + -3 + -4. -sqrt(17) + 151 Simplify -1(((sqrt(72) + sqrt(72) + 2sqrt(72))/sqrt(8) - ((sqrt(90)/(2sqrt(10)) - sqrt(9)) + sqrt(9)))/(sqrt(243)4))2. -49/1728 Simplify -1 + (-2 + (1 + sqrt(1300))2 - (-1(1 + sqrt(1300)) + sqrt(1300))) - (sqrt(364) - 5(sqrt(364) + sqrt(364)2 + sqrt(364) - sqrt(364)))/(sqrt(28)1). 34sqrt(13) + 1299 Simplify 6-6(1(4 + (-2sqrt(11))2) - (-4 + (sqrt(1331) - (sqrt(1331) - -2sqrt(1331))))*2). 6336sqrt(11) + 190512 Simplify (sqrt(98) + -2 + sqrt(98) + -2 + -1)2 - ((sqrt(8)/(sqrt(32)/(sqrt(48)/sqrt(6))))2 + -3). -140sqrt(2) + 418 Simplify (((sqrt(450) - -2sqrt(450)1)/sqrt(9))/((-1-5sqrt(70))/sqrt(7)) + 0)2. 9/5 Simplify -5 + (3sqrt(77)-2 + sqrt(77)11 + sqrt(77))/(sqrt(21)/sqrt(3)-5 + (sqrt(252) - (-2sqrt(252) + sqrt(252) + sqrt(252)))) + -1. -4sqrt(11) - 6 Simplify (-16(sqrt(7) + sqrt(63)/sqrt(9))-5 + ((-2 + -5 + sqrt(448))4)*2)-1. -7952 + 1732sqrt(7) Simplify ((sqrt(96)-2 + (sqrt(6) - (sqrt(6) - sqrt(12)/sqrt(2) - sqrt(6))-1))/((2sqrt(21))/sqrt(7) + (sqrt(15)/sqrt(5) + sqrt(3))-3))2. 8 Simplify (2 + -1 + ((-1 + sqrt(1700) + 2)4 + -3 + sqrt(1700) + -1 + 1 + sqrt(1700))*2)-5. -306010 - 600sqrt(17) Simplify (3sqrt(75) + 5 - (sqrt(75) + -3 + sqrt(75) + sqrt(75))-4)2 - (2((sqrt(75) + 1 - sqrt(75)) + 3)-1)2. -1050sqrt(3) + 16860 Simplify ((sqrt(364)/(sqrt(56)/sqrt(8)2))/(sqrt(216)/(-5sqrt(6))))*2. 325/36 Simplify 1(4 + (sqrt(1216) - (-2sqrt(1216))2))-6 + (sqrt(1216) - (-3sqrt(1216) + -2 - sqrt(1216))2 - (3(sqrt(1216)-1 - sqrt(1216)) - sqrt(1216))). -112sqrt(19) + 9700 Simplify (sqrt(57)/(sqrt(12)/(sqrt(4)1 + sqrt(4))) + 0 + (-4sqrt(475) - (sqrt(684) + -2)))6-2. -24 + 288sqrt(19) Simplify (-3 + sqrt(7) + 1)2 - 44sqrt(7) - 3(2 + sqrt(847)3). -119sqrt(7) + 5 Simplify -3 + (sqrt(363)5 - sqrt(363))1 + (sqrt(300) - (-1 + sqrt(300)) - sqrt(300))*266. -676sqrt(3) + 10833 Simplify -6((sqrt(153) - -2sqrt(153) - sqrt(153)) + sqrt(34)/sqrt(2) + -3 + (41sqrt(85))/sqrt(5))-55 + -4. -454 + 1650sqrt(17) Simplify 4(-3-6sqrt(8)/sqrt(2))/(sqrt(8)/(-1sqrt(4)) + sqrt(2) + sqrt(2) + sqrt(32)-1) + 0. -24sqrt(2) Simplify -2(sqrt(75) - (sqrt(75) + 2 + sqrt(75)))*2-4 + sqrt(108)3 + sqrt(108) + -2 + 2. 184sqrt(3) + 632 Simplify 4(-6(1sqrt(171) + sqrt(171) + -1 - sqrt(171)-24))2-1. -2462544 + 8640sqrt(19) Simplify 4 + (2 + sqrt(675) + sqrt(675) + -1 - (sqrt(108)/sqrt(4) + sqrt(27))23-1). 30sqrt(3) + 329 Simplify -4(((-4(-1sqrt(2736) - sqrt(2736)) - sqrt(2736)) + 1)2 - (sqrt(1539) + -4 - 3sqrt(171))*2). -536196 - 672sqrt(19) Simplify ((sqrt(24)/sqrt(32) + (sqrt(144)/sqrt(6))/sqrt(8))1)2 + (sqrt(3) + sqrt(75)-2 - (sqrt(300) + 2sqrt(300))2) + -4. -10789/4 - 9sqrt(3) Simplify 0 + (-4(sqrt(128)-2 + -3 + sqrt(128)-1 + 0))2 + -4 + -2-1(2sqrt(128))*2. 2304sqrt(2) + 19596 Simplify (-2sqrt(1539) + 2 - ((sqrt(1539) - (1 + sqrt(1539) + -4))2 + sqrt(1539))) + 1 - (sqrt(57)/(sqrt(243)2 + sqrt(243)) - (sqrt(475)13)*2). -730sqrt(19)/27 + 4269 Simplify (-2(sqrt(450)1 + sqrt(450)) - -1sqrt(450)2)/((-1-1sqrt(80) + sqrt(80))/(sqrt(88)/(sqrt(11)2))). -3sqrt(5)/2 Simplify (sqrt(968) + -1)*26 + (sqrt(24) - (sqrt(24) - -1sqrt(600)))/(sqrt(12)1-2). -523sqrt(2)/2 + 5814 Simplify (((-2sqrt(363) - sqrt(363))3)/(sqrt(44) + sqrt(44)1))/(sqrt(192)-1 + sqrt(3)-1-2). 3sqrt(11)/8 Simplify (sqrt(540)/sqrt(12) + -3 + sqrt(5)-6 - (5 + (sqrt(245) - (sqrt(245)-2 + sqrt(245) + sqrt(245))) + -4))2. 80sqrt(5) + 516 Simplify (((-3(-1 + sqrt(171) + -5))2 - (sqrt(171) + 1sqrt(171)-2 + -5)2) + 4)2. -708sqrt(19) + 3342 Simplify ((-6sqrt(175)/sqrt(5)-3-5)/((1sqrt(3500) + sqrt(35))/(-2sqrt(245))))*2. 7938000/121 Simplify (1(sqrt(18) + (sqrt(18) - sqrt(144)/sqrt(32)) + sqrt(18)))/(sqrt(36)/sqrt(1944)) + 4. 4 + 45sqrt(3) Simplify (1(5(sqrt(77) + -2sqrt(77)) - (sqrt(77) + sqrt(77) + (sqrt(77) - 2sqrt(77)3)))5)/((sqrt(784)-3)/((sqrt(42)/sqrt(6) + sqrt(7) + sqrt(7))5)). 25sqrt(11)/2 Simplify (6(sqrt(91)26 - -2sqrt(91)3))/(((-1sqrt(1764) - sqrt(1764)) + sqrt(1764))/(sqrt(28)/(sqrt(20)/sqrt(5)))). -18sqrt(13) Simplify (sqrt(650) + -2sqrt(650)-3 + sqrt(650) + sqrt(650) + sqrt(650) + (sqrt(650) - (-3sqrt(650)2 - sqrt(650) - sqrt(650))))/(-3-2sqrt(18)-5). -19sqrt(13)/18 Simplify 36((-3(0 + sqrt(75)))*2 + sqrt(162)/sqrt(6) + (sqrt(3) - (sqrt(3)1 + 1))*2)-4. -48672 - 216sqrt(3) Simplify (2(-2 + sqrt(7)) + (sqrt(7) - (sqrt(7) + 1sqrt(700))2))-5 - (((sqrt(70) - sqrt(70)2)-3)/(1sqrt(40)))2. -15sqrt(7) + 16957/4 Simplify (-6(sqrt(171) + sqrt(171)-3 + sqrt(171))-1-5)/(-2(sqrt(900) + sqrt(900)-1) - 2sqrt(900)5). -3sqrt(19)/10 Simplify 2 + -6(-2sqrt(1372)-33 + 3(sqrt(1372) + 0) + 3 + 1)*2. -3630406 - 14112sqrt(7) Simplify (5 + ((sqrt(1700) - (sqrt(1700) + sqrt(1700)1 + -2 + sqrt(1700))) + sqrt(1700) - (sqrt(1700)2 + -3 + sqrt(1700))) + -1(3 + -2sqrt(1700))6)2. -1280sqrt(17) + 108864 Simplify (2 + -1(-1 + sqrt(425) - sqrt(425)) - (1sqrt(272) + sqrt(17) + 3 + 0 + sqrt(17)))*2. 612 Simplify 1 + ((sqrt(99) - (sqrt(99)3 + sqrt(99))1 - (sqrt(99) + sqrt(99)-12))/(sqrt(108)/(sqrt(3) + sqrt(9)/(sqrt(15)/sqrt(5)) + sqrt(3))))2. 100 Simplify -4((-3(5 + -1sqrt(80)))*2 + sqrt(50)/sqrt(10) + 2 + sqrt(605) + -4). -3772 + 1392sqrt(5) Simplify (1 + (-2(sqrt(784)3 - (sqrt(1225) + sqrt(1225)2 + sqrt(1225))))/(((sqrt(504) + sqrt(504)2)/sqrt(12))/(2sqrt(12)/sqrt(2))))2. 64sqrt(7)/3 + 7177/9 Simplify ((-4sqrt(200) + 2 - (-5sqrt(200)1 - sqrt(200)))-16)2-4. -115776 - 11520sqrt(2) Simplify ((2sqrt(128) + -5)-2-1 - (-5 + sqrt(128)*-4	{ "pile_set_name": "DM Mathematics" }
))-5 + sqrt(208))2). -65sqrt(13) + 243 Simplify ((sqrt(209) + (sqrt(209) - (sqrt(209) + 1sqrt(209)4)) + sqrt(209) + sqrt(209))/sqrt(11))*2 + 1sqrt(1900) + -1. 18 + 10sqrt(19) Simplify -5(-5(53sqrt(684) - (sqrt(684) - (-1 + sqrt(684) + sqrt(684) + 1sqrt(684) + sqrt(684)))))*2. -27702125 + 27000sqrt(19) Simplify (2(2sqrt(152))/sqrt(8) - (sqrt(133) - (sqrt(133) + sqrt(133) + sqrt(133) + sqrt(133)13))/sqrt(7))*2. 1539 Simplify (-3 + -2 + 1sqrt(272)2)25. -400sqrt(17) + 5565 Simplify -5 + (sqrt(17) - sqrt(272)) - (-1 + sqrt(425)) - sqrt(187)/((sqrt(121) + (sqrt(121)-3 - sqrt(121)))/sqrt(11)). -23sqrt(17)/3 - 4 Simplify (-1sqrt(78)-4-5)/(sqrt(726) - -2sqrt(726)6). -20sqrt(13)/143 Simplify -4 + (0 + (sqrt(396) - (-1sqrt(396) - sqrt(396))))*2 - (-2 + -4 + 2sqrt(396) + sqrt(396) + sqrt(396))*2. -2812 + 288sqrt(11) Simplify (sqrt(243)/sqrt(9))/sqrt(9)-26-5. 60sqrt(3) Simplify 1((sqrt(6) + (sqrt(6) - sqrt(216)/sqrt(4)))/(sqrt(18)2))*2-5. -5/12 Simplify ((sqrt(66) - (sqrt(66) + (sqrt(66) - (sqrt(66) + sqrt(66) + -2(sqrt(66) - sqrt(66)1)))))/sqrt(3))/(-1(sqrt(121)/(3sqrt(11)) + sqrt(11))). -3sqrt(2)/4 Simplify -2sqrt(10)/sqrt(2) + 4 + -2sqrt(405) + 0. -20sqrt(5) + 4 Simplify (sqrt(2662)-1)/sqrt(2) - (sqrt(121) - (2(sqrt(121)-1 + sqrt(121)) - sqrt(121) - sqrt(121)))/sqrt(11). -14sqrt(11) Simplify (-4(sqrt(68)/sqrt(4) + sqrt(17)) + -4 + (sqrt(17) - (2 + sqrt(17))) + (4sqrt(204)4)/sqrt(12))2. -96sqrt(17) + 1124 Simplify 2(sqrt(152)-2-1)/(sqrt(392) + (sqrt(392) - sqrt(392)2) - sqrt(392)). -4sqrt(19)/7 Simplify -3 + ((sqrt(539)4 + 0)1)2. 8621 Simplify -5(sqrt(42)/sqrt(6)5 - (sqrt(875)/sqrt(5))2). -25sqrt(7) + 875 Simplify ((1((sqrt(612) - sqrt(17)) + 1) + (2 + 4sqrt(17))6)-1)*2. 754sqrt(17) + 14466 Simplify 6((sqrt(242) - (-2(sqrt(242) + (sqrt(242) - sqrt(242)-1)))2) + sqrt(242) + (sqrt(242) + sqrt(242)3)-3). -52272 - 660sqrt(2) Simplify (-5 + sqrt(40)/sqrt(5) - (2(2 + sqrt(200)) + sqrt(200)))2. 504sqrt(2) + 1649 Simplify ((-2(sqrt(432) + 1) - sqrt(432)) + sqrt(432))24 - (sqrt(432) + -1sqrt(432) + 3 + 5). 384sqrt(3) + 6920 Simplify (-6(3sqrt(2057)-2 - sqrt(2057)) + 4 + 5)2-5. -18143145 - 41580sqrt(17) Simplify (0 + (0 + sqrt(720))-2 - 1sqrt(720)-2)*2. 0 Simplify -4 + ((-1 + 2sqrt(2) + (sqrt(288) - (sqrt(288) - (1 + sqrt(288)))))*2 - ((sqrt(10) - (sqrt(10) - sqrt(40)/sqrt(4)-3))/sqrt(5))*2). 370 Simplify (((sqrt(175) - (-2 + sqrt(175))-5) + 4(sqrt(175) + 0))-4)*2. -16000sqrt(7) + 281600 Simplify (sqrt(153)/(2sqrt(576)) - (sqrt(153) + (sqrt(153) - sqrt(153)12))/sqrt(9)) + 0. sqrt(17)/16 Simplify sqrt(304) + sqrt(304) + (-1 + sqrt(304)-3)*2 - ((sqrt(152) + sqrt(152)-3)/sqrt(8) + -5). 34sqrt(19) + 2742 Simplify sqrt(13) + -6(sqrt(13) + sqrt(1300))*2 + 0 - sqrt(156)/(sqrt(72)/sqrt(486)). -9438 - 8sqrt(13) Simplify (-3 + (-2sqrt(224))/(sqrt(968)1))*2. 24sqrt(7)/11 + 1201/121 Simplify ((sqrt(26) - (sqrt(2600)5 + sqrt(26)))/sqrt(2) + 2 + sqrt(13) + 4sqrt(13) + -1)*2. -90sqrt(13) + 26326 Simplify (((sqrt(1377) + 1)56 + 4)-4)2. 293760sqrt(17) + 19847296 Simplify (sqrt(156)-5)/((sqrt(189)/sqrt(7) - sqrt(27))/sqrt(9) + sqrt(3))-2. 20sqrt(13) Simplify 66(-2sqrt(91))/sqrt(7)-4. 288sqrt(13) Simplify (-4 + 3(sqrt(44) + sqrt(11)) + sqrt(11) + sqrt(11) + 4 + sqrt(11)-1)*2 + ((sqrt(22) - sqrt(22)-1)-5)/(sqrt(2) - (sqrt(72)/sqrt(4) + sqrt(2))). 10sqrt(11)/3 + 1100 Simplify (-2(sqrt(84)-1)/sqrt(4))/((sqrt(192)/(sqrt(24)/sqrt(3)))/sqrt(8)). 2sqrt(7) Simplify 3 + -2(sqrt(95)/(sqrt(15)/sqrt(3)) + sqrt(19))5. -20sqrt(19) + 3 Simplify -2 + (sqrt(22)/(sqrt(8)/(sqrt(12)/sqrt(3))) + 2sqrt(11)-1-1)2. 97 Simplify 5((1 + (sqrt(128) - 2sqrt(128)))2 + sqrt(128) + sqrt(128) + 3 + 4). 680 Simplify (11sqrt(891)6-5)2-3. -2405700 Simplify (sqrt(52)/sqrt(72))/(sqrt(2) - (sqrt(128) + sqrt(128)5)). -sqrt(13)/282 Simplify ((sqrt(240) - -2sqrt(240))/sqrt(10) + -2sqrt(864))/((sqrt(72) - sqrt(72)3)3 + sqrt(72)). 3sqrt(3)/5 Simplify (-3-2sqrt(84)-2)/((1sqrt(120))/sqrt(10) + (sqrt(48) - -1sqrt(48))). -12sqrt(7)/5 Simplify ((sqrt(448) - (sqrt(448) + sqrt(448)-2 + sqrt(448) + sqrt(448) + sqrt(448))) + 1 - (1 + 2sqrt(448)) - (sqrt(448) + -1 + 3 + 0))*2. 128sqrt(7) + 7172 Simplify (2-5(sqrt(128) - (1 + sqrt(128) + (sqrt(128) - (sqrt(128) + 2)))))2. 100 Simplify 2 + (-2 + sqrt(144)/sqrt(3) + sqrt(768) + 2)2. 1202 Simplify -6(-1sqrt(425))*2 + sqrt(425) + (-2sqrt(425)2 + sqrt(425))2 + (sqrt(425) + -5 + sqrt(425) + 3 + sqrt(425) + -5)2. -205sqrt(17) + 5149 Simplify (sqrt(54)/(-1sqrt(9)))/((sqrt(27)/sqrt(3))/sqrt(3)) + -5. -5 - sqrt(2) Simplify 2 + ((sqrt(55)/(sqrt(15)/sqrt(3)) - sqrt(11)) + (-2sqrt(1584))*2)-64. -152062 Simplify -2 + (sqrt(44) + (sqrt(440)-2 - sqrt(440) - sqrt(440))/sqrt(10))*2 - -4(sqrt(44) - (sqrt(44) - sqrt(264)/sqrt(6))-2). 8sqrt(11) + 394 Simplify (sqrt(120)/(1sqrt(45)))/((sqrt(12) + sqrt(300))12). sqrt(2)/36 Simplify ((-3sqrt(2112) + sqrt(2112) - sqrt(2112))-6)/((sqrt(275)1 - sqrt(275) - sqrt(275))2). -72sqrt(3)/5 Simplify (sqrt(80) + (-4 + sqrt(80)3 - sqrt(80)) - (sqrt(80) + -1 + sqrt(80) + -1 + sqrt(80) - sqrt(80)))2-5. -420 + 80sqrt(5) Simplify -1 + sqrt(891) + (1 + sqrt(891))2 - (sqrt(704) + -2)-4. 59sqrt(11) + 883 Simplify (sqrt(1872)-2)/(sqrt(324) + (sqrt(324)-2 - sqrt(324)) + sqrt(324)) + 2. 2 + 4sqrt(13)/3 Simplify (-4 + sqrt(1573) + sqrt(1573) + 1 - ((sqrt(1573)2 + sqrt(1573))-5 - sqrt(1573)))*2. -1188sqrt(13) + 509661 Simplify (sqrt(392)/(2sqrt(7)) - (sqrt(56)-21 - sqrt(56)))/(6sqrt(8)-35). -7sqrt(7)/180 Simplify (-3 + (sqrt(363) - (sqrt(363) + -1 + -2)))2 - (6(0 + sqrt(363))*2 + (sqrt(363) - (sqrt(363) + -1 + -1))). -2180 Simplify (1(sqrt(192) + 4) - sqrt(192))*2 + -4 + 5(-3 + sqrt(3)). -3 + 5sqrt(3) Simplify 6(-3 + -2(-2 + sqrt(432))). -144sqrt(3) + 6 Simplify -2 + (-2 + -5 + -1sqrt(68))21. 115 + 28sqrt(17) Simplify -2((sqrt(15)/(sqrt(5)-2 - sqrt(5)) - (sqrt(3) - ((sqrt(30)3)/sqrt(10))*2)) + -1). -52 + 8sqrt(3)/3 Simplify -3(0 + (sqrt(5) + -1 - sqrt(5)) + (sqrt(5) - (sqrt(5) - (sqrt(5) + (sqrt(5) + sqrt(5)2)-3)))). 3 + 24sqrt(5) Simplify (sqrt(17) - (sqrt(170) - sqrt(170)3)/sqrt(10))2 - (sqrt(17) - (-2 + (sqrt(119)/sqrt(7) - sqrt(17)))) - (2(sqrt(17) + -3)*2 + -1sqrt(833)). 18sqrt(17) + 99 Simplify ((sqrt(468) + -1)3 - (sqrt(468) - -1sqrt(468) - sqrt(468) - sqrt(468))1)*2 + -1. -108sqrt(13) + 4220 Simplify (5 + -3-1sqrt(1088) + 3 + -1)-4. -96sqrt(17) - 28 Simplify (((sqrt(112) - sqrt(7)) + -1)*2 - sqrt(70)/(sqrt(40)/sqrt(4))) + -3(sqrt(7) - (sqrt(7) - (-1sqrt(28))2)). -20 - 7sqrt(7) Simplify (-1sqrt(1500)-4)/(sqrt(30)/(sqrt(1440)-1 + sqrt(10)))-1. 440sqrt(5) Simplify (-1 + (sqrt(85)/(sqrt(35)/(sqrt(42)/sqrt(6))) - ((sqrt(1377)3 - sqrt(1377)) + -2)))*2. -34sqrt(17) + 4914 Simplify (4 + sqrt(704)2-1)*24. -512sqrt(11) + 11328 Simplify (4 + sqrt(72) + -3 + sqrt(72) + 4 + sqrt(72)3 + 3)*2. 480sqrt(2) + 1864 Simplify (((sqrt(468) - (4 + -2sqrt(468))) + 1)3)*2. -972sqrt(13) + 37989 Simplify 1((-53(sqrt(65) + sqrt(65) + -1sqrt(65) - sqrt(65)))/(sqrt(5) - sqrt(40)/sqrt(2) - (sqrt(5) - (-1sqrt(20)/sqrt(4) - sqrt(5)))))2. 0 Simplify (((1sqrt(171)-1 + sqrt(171) - sqrt(171)) + sqrt(171) - (sqrt(171) + sqrt(171)-11))/(sqrt(90)/sqrt(90) - (sqrt(9) - 2sqrt(9)1)))2. 0 Simplify (6(sqrt(500) - (sqrt(500) - (sqrt(500) - (-4 + sqrt(500) + 2) - sqrt(500))))-2)2. -5760sqrt(5) + 72576 Simplify 0 + (51sqrt(76) - sqrt(76))*2 + 2 + 0 + 3. 1221 Simplify (-1 + sqrt(833) + 1 + 4 - 4(1 + sqrt(833))4)2 + 0. 2520sqrt(17) + 187569 Simplify sqrt(15)/(sqrt(10)/sqrt(2)4 + sqrt(5)) + sqrt(21)/(3sqrt(21)/sqrt(3)). 8sqrt(3)/15 Simplify (((sqrt(405)-2 + -5)1 - (4 + 1 + sqrt(405) + sqrt(405) + sqrt(405) - sqrt(405)-24))2)*2. 9360sqrt(5) + 274180 Simplify 5 + 6(sqrt(500)-1)*2 + 1. 3006 Simplify 5 + 4(sqrt(48) + sqrt(240)/sqrt(5))-3. -96sqrt(3) + 5 Simplify ((3 + sqrt(128) + sqrt(16)/sqrt(128) + 2)-3)2. 1485sqrt(2)/2 + 11601/8 Simplify (sqrt(1250) + sqrt(1250)-4 - sqrt(1250))/(2sqrt(10)4). -5sqrt(5)/2 Simplify (sqrt(315) - (1sqrt(315) - sqrt(315))5 -	{ "pile_set_name": "DM Mathematics" }
to the nearest one thousand. 6000 Let t = 6176 + -6176.02829. What is t rounded to two dps? -0.03 Suppose 201593580 = 4n + 5k, -k + 44068041 = 2n - 56728749. Suppose 0 = -i - 2i + n. Suppose -3t + 6300535 + i = 0. Round t to the nearest one million. 8000000 Suppose 4m - 1 = 3, 2m - 8 = -3f. Suppose 4r + 3s = -3733 + 12021, fr - s = 4154. Suppose -4w + 6555 - r = 0. Round w to the nearest 100. 1100 Let h = -42.34 - -42. Let b = h - -0.339986. What is b rounded to 5 decimal places? -0.00001 Let d = 3929.988 - 3941. Let r = -11 - d. Let w = -0.0120086 + r. Round w to 6 dps. -0.000009 Let v = 52.88 - 53. Let u = v - -0.120045. Round u to five decimal places. 0.00005 Let d = -138 - -137.998125. Round d to five dps. -0.00188 Let z = 206 - 205.9999992. What is z rounded to 7 decimal places? 0.0000008 Suppose 44b = 52b + 2760. Round b to the nearest ten. -350 Suppose 4b = 5b - 163. Suppose 3p = -4l - l + 423, 2l = 5p + b. Suppose -3a = -5y - 5a - l, 0 = y + 3a + 9. What is y rounded to the nearest ten? -20 Let i = -1.4 + 1.4. Let k = 0.9 - i. Let l = k + -0.90002. Round l to five dps. -0.00002 Let q be (-67 + -3)/(8/(-800)). What is q rounded to the nearest 1000? 7000 Let f be -9209991 + (-28 - -27). Round f to the nearest one hundred thousand. -900000 Let q = -149.69999469 + 149.7. Round q to six decimal places. 0.000005 Let r = -15 - -30. Let u = r - 13.5. Let y = -1.49905 + u. Round y to four dps. 0.001 Let d(z) = 3110z - 5. Let a be d(7). Let y be (a/(-9))/((-2)/(-6)). Let v be (-5 + y)(-5)/(-3). Round v to the nearest 1000. -12000 Let j = -880.0846 - -880. Round j to 3 dps. -0.085 Let k(m) = -5976m*2 + 7m + 7. Let v be k(-7). Let p = v - 4407134. Round p to the nearest one million. -5000000 Suppose -16r - 45265 = -5h - 11r, 3h = -5r + 27135. Round h to the nearest one hundred. 9100 Let a = 0.22 + 9.78. Let v = a - 26. Let t = 17.8 + v. Round t to 1 decimal place. 1.8 Let f = -143 - -142.9758. What is f rounded to two dps? -0.02 Let c = 3 + -4. Let i = c + 6. Suppose -iz = -0z - 220000. Round z to the nearest ten thousand. 40000 Let h = -184.67 - -194.5. Let s = h - 9.7807. Round s to 3 dps. 0.049 Let k = 12813932211 + -12813933108.0000777. Let y = -897 - k. Round y to 5 decimal places. 0.00008 Let m = -11.038189 - -10.09811. Let g = 0.79 + 0.15. Let y = g + m. What is y rounded to five dps? -0.00008 Let q = 108.8 - 108.80007928. What is q rounded to 5 decimal places? -0.00008 Let y = -16653 - -15882.7. Round y to the nearest ten. -770 Suppose -4o + 5u - 15 = 13, 0 = 3o + 3u + 48. Let i = -8 - o. Suppose -w + 4w = is + 14843, -2w + 3712 = -s. Round s to the nearest one hundred. -3700 Let i(v) = -2v - 1. Let z be i(-3). Suppose 2s - 21185 - 9027 = 3b, -75480 = -5s - zb. Round s to the nearest 1000. 15000 Let j(x) = 44x + 10 - 5x2 + 49x - 101x. Let w be j(5). What is w rounded to the nearest ten? -160 Let r = 19043 - 61859. Let j be r(-4)/(-12)-202. Suppose 3a + j + 1917068 = b, 0 = 2a + 8. Round b to the nearest 1000000. 5000000 Let w = 267.7906 - 268. Let m = 45.79 - 46. Let a = m - w. Round a to four dps. -0.0006 Let h = -45493520008874 + 45493504812176.9200178. Let x = -15196695 - h. Let j = x - 2.08. What is j rounded to six decimal places? -0.000018 Let b(z) = 28311z*2 - 4z + 8. Let u be b(-4). What is u rounded to the nearest 10000? 450000 Let d = -1291 + 2157. Let a = -865.633 + d. Round a to 2 decimal places. 0.37 Let b = -5476.997281 + 5477. What is b rounded to 4 dps? 0.0027 Let c = 10138 + 4492. Round c to the nearest one thousand. 15000 Let t = 78.1000331 - 78.1. What is t rounded to five decimal places? 0.00003 Let r be (20/(-3))/((-16)/(-180240)). What is r rounded to the nearest 1000? -75000 Let g = 99798.561 + -90435.82213. Let x = -8936.738599 + g. Let t = x - 426. What is t rounded to five dps? 0.00027 Let g = -890 + 845.28. Let u = g - -40.1. What is u rounded to zero dps? -5 Let i = 4.1 - 3.99. Let m = 21601.91 - 21602.02000036. Let g = m + i. What is g rounded to 7 decimal places? -0.0000004 Let s = -0.21 + 0.210045. What is s rounded to six decimal places? 0.000045 Let b = 345621 + -345611.50085. Let c = b - 9.5. Round c to four decimal places. -0.0009 Let v = -0.342 + -305.458. Round v to the nearest ten. -310 Let m = -80.2026 + 80.3. What is m rounded to two dps? 0.1 Let b = 20.6 - 10.95. Let m = b - 10. Let v = -0.01 - m. What is v rounded to 1 decimal place? 0.3 Suppose 0 = 4c + 3r - 35 - 70, -4c = r - 99. Let j = 139 + -127. Let y be (c/18)/(2/j). What is y rounded to the nearest ten? 10 Suppose -5o + 6o = 5, -5a - 77399975 = 5o. Round a to the nearest one hundred thousand. -15500000 Suppose 2q = 5l - l - 14198, -5q - 3545 = -l. Round l to the nearest one hundred. 3600 Let n be -5 - (6237/(-3) + 6). Round n to the nearest 100. 2100 Let k = -146437 + 146448.0017. Let f = -14 + 3. Let o = f + k. Round o to three dps. 0.002 Let d(y) = 116y2 - 49y - 235. Let b be d(-71). Round b to the nearest 10000. 590000 Let w = -6.09 - -6. Let c = w + 0.02. Let b = -3.33 + c. What is b rounded to the nearest integer? -3 Let i = -3 + 6. Suppose -iz = 4n - 14, -z + 2z = n. Suppose -np - 4188900 = -1628900. Round p to the nearest 100000. -1300000 Let h = 0.6 + -85.6. Let y = -80.7 - h. Let d = -4.164 + y. What is d rounded to two decimal places? 0.14 Let r = -3 - -8. Suppose 6l - 1220 = rl. Round l to the nearest one hundred. 1200 Let h = -4630.006506 - -4630. What is h rounded to 3 decimal places? -0.007 Let v = 1 - -11.3. Let j = v - 12.2999891. Round j to 6 decimal places. 0.000011 Let p = -27025 - -27063.254. Let v = 0.046 + p. What is v rounded to the nearest ten? 40 Let a(r) = 6155r2 - 9r + 58. Let j be a(-58). Round j to the nearest one hundred thousand. 20700000 Let w(x) = x*2 - x + 3. Let h be 2/12 - (-4)/(-24). Let u be w(h). Let b(l) = -7779l*2 + 2l + 5. Let p be b(u). What is p rounded to the nearest 100000? -100000 Let y = -1 + 4. Let a be (4/y)/((-3)/9). Let b be (-125000)/(-1 - 2 - a). What is b rounded to the nearest ten thousand? -130000 Let m = 33767 - 32787.99. Let b = 979.349987 - m. Let f = b + -0.34. What is f rounded to five decimal places? -0.00001 Let g = 0 - 9. Let z be 1013952400/g. Round z to the nearest 100000. -3700000 Let c = -11 - -16. Suppose l = 3r - 6012, 5l + cr = -19978 - 10002. Round l to the nearest 1000. -6000 Let o = -0.8 - 199.2. Let l = -199.813 - o. What is l rounded to two decimal places? 0.19 Let b = 21.85 + -21.8499992965. Round b to seven decimal places. 0.0000007 Let d be (-4)/(-10) + 69126/20-8. Round d to the nearest one thousand. -28000 Let o = 3.44 + -16.24. What is o rounded to 0 dps? -13 Let c = -191197223.59999865 + 191197217. Let h = 22 - 15.4. Let v = h + c. Round v to 7 decimal places. 0.0000014 Let y = -20933.9790128 - -20934. Let j = y - 0.021. Round j to six dps. -0.000013 Let b = 0.105 - 0.204. Round b to 1 dp. -0.1 Suppose -16 = 5j - 11. Let d be ((-471)/9 + j)(-9375)/(-2). Round d to the nearest ten thousand. -250000 Let x = -1201.28 - -1176. Let a = x + 26. Round a to one decimal place. 0.7 Let w be ((-352)/24)/(8/636). Round w to the nearest one hundred. -1200 Let q = -9 + 11. Suppose 2n - 12 = -u, qu = 6u - 4n + 12. Suppose ux + 86 = x. Round x to the nearest ten. -90 Let u = 66.7 + -7.7. Let q = u - 59.00000032. What is q rounded to 7 dps? -0.0000003 Let k = 370 - 369.999999093. Round k to 7 decimal places. 0.0000009 Suppose -2a = 5l - 1792, -4a + 2l + 2707 = -a. Let b = -225 - a. Let v = b + 3126. Round v to the nearest 100. 2000 Suppose 0x - x + 3g + 160909 = 0, -g = 2x - 321790. Suppose 0 = -c - 0 + 2. Suppose x = -cp - 1639103. What is p rounded to the nearest one million? -1000000 Suppose 819 = 3f - 3969. Let q be 1206/(-2 - f/(-796)). Suppose -719994 = -3l + 3r, 4r = l + r - q. What is l rounded to the nearest one hundred thousand? 200000 Let y = 11.288 + -0.188. Let c = -11.011 + y. Round c to 2 dps. 0.09 Let g = -150042 - -84894. Let v = g - -122048. What is v rounded to the nearest one thousand? 57000 Let r = 520 + -519.433. Let m = -0.57 + r. What is m rounded to 4 decimal places? -0.003 Let c = 32033 - 2873. Suppose -36k + 2631422 + 2450338 = 0	{ "pile_set_name": "DM Mathematics" }
inder when 7 is divided by u? 3 Suppose 3l - 88 = 254. Suppose 5g - 2g - l = 0. What is the remainder when g is divided by (-79)/(-6) + (-2)/12? 12 Let y(x) = -x2 - 9x + 5. Suppose 0 = -5h - 4g + 2 + 2, -g + 1 = 2h. Suppose -3u = -h - 21. Calculate the remainder when y(-7) is divided by u. 5 Suppose -112 - 36 = -2d. What is the remainder when d is divided by 15? 14 Calculate the remainder when 23 is divided by (-5)/(-2)(-14 + 20). 8 What is the remainder when (-28 + 12)3/(-4) is divided by 7? 5 Let d(l) be the second derivative of -l5/4 + l4/6 + l3/6 + l2 - 2l. Let i be d(2). Let k = i - -60. Calculate the remainder when k is divided by 11. 10 What is the remainder when 35 is divided by ((-234)/(-27))/(8/3 - 2)? 9 Let l(b) = -b*2 - 9b - 9. What is the remainder when 14 is divided by l(-7)? 4 Let b = 2 - 0. Suppose -3 = -bp + 23. Calculate the remainder when 38 is divided by p. 12 Let u(h) = -2h + 2. Let c be u(-1). Suppose 2x - 25 = -cg + 39, 3g - 12 = 0. What is the remainder when 95 is divided by x? 23 Let m = 17 - 11. What is the remainder when 29 is divided by m? 5 Suppose -6w + 4w = -16. Calculate the remainder when 12 is divided by w. 4 Let m(i) = 17i + 1 + 4i - 3i. Let l(f) = 2f2 + 5f - 2. What is the remainder when m(1) is divided by l(-4)? 9 Calculate the remainder when (0 + (-10)/4)-10 is divided by 7. 4 Suppose -v + 146 = -0v. Suppose a + 48 = 2g, a - 5a = 5g - v. Calculate the remainder when 76 is divided by g. 24 Let j be (-10)/(-6)(5 + -2). Suppose -jt = 5w - 140, 2w = 9t - 4t + 77. Calculate the remainder when w is divided by 11. 9 Suppose -g = -3g + 28. What is the remainder when 26 is divided by g? 12 Suppose 17x = 18x - 36. Calculate the remainder when 139 is divided by x. 31 Let d(l) = -l - 7. Let o be d(6). Let s = o + 91. Suppose -s = -u - u + 5v, v = 2u - 94. What is the remainder when u is divided by 17? 15 Let s(r) = r*3 + 7r*2 - 4r - 5. What is the remainder when s(-7) is divided by 6? 5 Let m = -31 + 54. Calculate the remainder when m is divided by 8. 7 Let o = 15 + -32. Let u = o - -30. What is the remainder when 23 is divided by u? 10 Let k(m) = m*2 + 2m - 3. Let h be k(-3). Let z(t) = t3 + t2 - t + 7. Let y = -16 + 27. What is the remainder when y is divided by z(h)? 4 Let x(h) = -44h + 1. Suppose -6g - 5 = -g. Calculate the remainder when x(g) is divided by 23. 22 Suppose 106 = 3x - 74. What is the remainder when x is divided by 18? 6 Suppose 2b + 99 = 5b. Let i = b - 21. Calculate the remainder when (-17)/(-1 - 2/(-4)) is divided by i. 10 Let k be (-2)/(-3) - 30/(-9). Let q be (18/k)/((-5)/10). What is the remainder when (q - -7)/(2/(-38)) is divided by 10? 8 Let l be (-1)/6 - 95/(-30). Suppose -d - 4d = -lb - 48, -3d + 40 = b. Calculate the remainder when 34 is divided by d. 10 What is the remainder when 8/52 + (-802)/(-26) is divided by 12? 7 Let y = -6 + 16. Calculate the remainder when y is divided by 6. 4 Let c = 36 + 7. Calculate the remainder when 168 is divided by c. 39 Let u be (6/(-4))/((-39)/104). Suppose 2l = uv + 28, v + 8 = 4l + 5v. Calculate the remainder when 17 is divided by l. 5 Let j = -21 - -37. Let x(m) = -m*2 + 1. Let a be x(-2). Let i = 6 - a. What is the remainder when j is divided by i? 7 Suppose r + 4m + 8 = 0, 0 = -3m + 8m + 15. Calculate the remainder when 42 is divided by (54 - 2)/r - -2. 12 Let g = -1 - -1. Suppose 0u - 4u + 8 = g. Suppose 2s = 3b + 72, 7s - 4b = us + 180. What is the remainder when s is divided by 19? 17 Suppose 5c - 10 - 5 = 0. Suppose -cl = -3 - 30. Calculate the remainder when 20 is divided by l. 9 Suppose -c + 0c + 3 = 0. Suppose 0 = cl, -55 + 1 = 2m + 3l. What is the remainder when 41 is divided by (-384)/m - (-4)/(-18)? 13 Calculate the remainder when 28/(-98) + (-326)/(-14) is divided by 6. 5 Let b = -18 + 26. Let y(q) = q2 - 2q + 5. What is the remainder when y(4) is divided by b + (1 - 1 - 1)? 6 Suppose z + 28 = -z. Let a = -12 - z. What is the remainder when a is divided by 1? 0 Let s(t) = -t*3 + 4t*2 + t - 1. Suppose -2d + 4 = -d. Suppose -8l + 16 = -dl. What is the remainder when s(l) is divided by 2? 1 Suppose -2g = 0, -2q - 5g - 2 = -3g. Let y(b) = 3b2 + 1 + b + b2 + b2. What is the remainder when 14 is divided by y(q)? 4 Suppose -o - 2o + 4w = -101, -5o - 5w = -145. Calculate the remainder when o is divided by 17. 14 Let q(v) = v2 - 6v - 9. Let f be q(7). What is the remainder when 12 is divided by (0 + f)/(4/(-14))? 5 Let g = 8 + 5. What is the remainder when 50 is divided by g? 11 Suppose -2k + 110 = -2z, -k + 42 + 13 = -5z. What is the remainder when 109 is divided by k? 54 Suppose 4l - 65 = -9. Calculate the remainder when 65 is divided by l. 9 Suppose 5k - 298 - 12 = -5l, k - 3l = 78. What is the remainder when k is divided by 17? 15 Let g = 21 + -20. Suppose -5u + u + 28 = -4b, u - 3b - g = 0. Calculate the remainder when 36 is divided by u. 6 Let i = 7 + 8. What is the remainder when 57 is divided by i? 12 Let s = -40 - -53. What is the remainder when s is divided by 7? 6 Suppose 0 = 15i - 3i - 240. Calculate the remainder when i is divided by 6. 2 Suppose -o = -7 - 15. Calculate the remainder when ((-33)/o)/((-6)/28) is divided by 5. 2 Let y(k) = -5k - 2k + 2k - 8 + 4k. What is the remainder when 4 is divided by y(-10)? 0 Let s be ((-4)/5)/((-2)/10). Suppose 5m + 2 = sr, -2r - r = 3m - 15. What is the remainder when 65 is divided by 1(88/2)/m? 21 Let q(u) = 6u - 14. Let t be ((-8)/(-3))/(4/6). What is the remainder when 27 is divided by q(t)? 7 Suppose -s = 3s - 60. Let m(f) = -6f + 27. Calculate the remainder when m(-10) is divided by s. 12 Let b(s) = -s*3 - 4s*2 - s - 1. Let d be b(-4). Suppose 0m - 30 = -dm. Suppose 7z - 81 = 115. What is the remainder when z is divided by m? 8 Suppose 4b - 19 - 109 = 0. Suppose -2p = 3p + 30. Let m(n) = -3n - 7. What is the remainder when b is divided by m(p)? 10 Suppose -4j + 2j - 5c + 3 = 0, j = -3c + 1. Calculate the remainder when j is divided by 2. 0 Suppose -22 = 2z - 2j, 5j = -5z + 1 - 26. Let h = z + 18. What is the remainder when 28 is divided by h? 8 Let z(i) = -2i + 2. Let m be z(-6). Let l = 33 - m. What is the remainder when 73 is divided by l? 16 What is the remainder when 3000/44 + (-4)/22 is divided by 35? 33 Let c = 3 - -6. What is the remainder when (-2)/c - (-40)/18 is divided by 1? 0 Let n be ((-9)/6)/3-2. Calculate the remainder when (-2 - n) + -2 + 28 is divided by 13. 10 Suppose 0 = -2k - k + 18. Suppose -5b - 8 = -23. Calculate the remainder when k is divided by b. 0 Suppose -18y + 8y + 60 = 0. Calculate the remainder when 16 is divided by y. 4 Let h(l) = l*3 - 12l*2 + 2l. Calculate the remainder when 118 is divided by h(12). 22 Let r(i) = -7i + 62. Let s(v) = v2 + 2v - 7. Calculate the remainder when r(-3) is divided by s(5). 27 Let f be (4 + (-3)/1)0. Let o(v) = v - 9. Let x be o(f). Let i(t) = -4t - 9. What is the remainder when i(x) is divided by 14? 13 Suppose 5y - b - 229 = -3b, -4b = -4y + 200. Calculate the remainder when y is divided by 16. 15 Suppose -5d = o + o + 12, 0 = 5d - 5o + 40. Let c be -4(-2)/d6. Let v = c - -34. Calculate the remainder when 65 is divided by v. 21 Let r be 117/4(-4 - -12). Suppose 5v + 54 - r = 0. Suppose -u + 3x + v = 0, 2u - 4x = -u + 118. What is the remainder when u is divided by 22? 20 Suppose 110u + 104 = 123u. What is the remainder when 30 - (0 + 2/(-2)) is divided by u? 7 Suppose -4f - 17 = -2g + 211, 0 = -5g - 4f + 514. Calculate the remainder when g is divided by 36. 34 Suppose -2m = -6m + 292. Suppose -2g = -4u + 74, -u + 24 - 4 = g. Calculate the remainder when m is divided by u. 16 Suppose -5y = -95 - 95. Calculate the remainder when y is divided by (5/(-10))/(3/(-78)). 12 Let o(c) = -c2 + 9c - 2. Let k be o(8). Let v be 22/k - 1/(-3). Suppose 0 = vb + 8 + 12, -b - 45 = -4j. What is the remainder when j is divided by 4? 2 Let r = -27 + 59. Suppose -3z - 2y + 26 = -0y, -4z - 2y = -r. What is the remainder when 11 is divided by z? 5 Let x = 2 - -3. What is the remainder when 14 is divided by x? 4 Let s(d) = d3 - 7d**2 +	{ "pile_set_name": "DM Mathematics" }
+ (-4 - (-2 - -1)). Solve 2f + mu + 3 = 12, -1 = -u for f. 3 Let l be 2 - ((4 - 4) + 4). Let y be 3/(-6)l(-5 - -8). Solve 4o = -ya - o + 8, -4o + 4 = 0 for a. 1 Let x = -297 - -297. Solve 3y + v - 3 = 0, -2y - v + 0v + 2 = x for y. 1 Suppose 546 - 537 = m. Solve 3h = -p + h + 3, -3p - 2h = -m for p. 3 Suppose 2 = m - 2. Let x be 4/(-26) - (-965)/(-65). Let p be (0 - 10/x)6. Solve 5f + 0f + pz + 25 = 0, -mf = -2z + 20 for f. -5 Let o(j) be the third derivative of j4/24 + 19j*3/6 - 16j*2. Let k be o(-17). Solve 3 = -f - 4i - 17, -3f + ki = 4 for f. -4 Let o(y) = -y*2 + 11y + 10. Let i be o(11). Suppose -iv = -13v + 15. Solve 4p - p = -2t - 12, -7 = -4p + vt for p. -2 Let j = 9 + -9. Suppose 0 = t - jt - 20. Solve g + 3 = m + 2, -5g = t for m. -3 Let z be (-2)/3483/(-14). Solve 2j - 19 = -2j - 3l, 0 = 2j - 5l + z for j. 1 Let c(s) = -19s2 - 2s - 1. Let b be c(-1). Let t be ((-8)/6)/(6/b). Solve tp = -3w + 5, 2w = 6w + 20 for p. 5 Suppose -142 = -8x - 126. Solve -3l + 10 = -r - 6l, r - x = l for r. -1 Suppose 6z = 4z, 4m = -4z + 76. Let s be 3/5 - (-2)/5. Solve 0 = 5l - 3c + m, -4c - s = 3l - 7 for l. -2 Let p(u) = 4u*3 + 2u*2 - 2u + 1. Let d be p(1). Suppose 3i = -2x, 5i + d = -5x + 10. Suppose 3c + x = 4c. Solve -4g = 4, 2f = -0f + g - c for f. -2 Let v be (-8)/(-3) + 18/(-27). Let b be (-2 - -5)(v - -1). Solve 0 = 3g - 3o - b, g + 7 = -4o - 0 for g. 1 Let f(m) = -m2 - 3m - 6m + 2 + m. Let p be f(-8). Let k be 6p/((-6)/(-1)). Solve -2q + 5s - 3 = kq, 0 = -s + 3 for q. 3 Let d be (-49)/28 - (-9)/12. Let b be 2/11 + ((-4)/22 - d). Let t = 4 + -1. Solve 2u - tx = -b, -4u = x - 6 + 1 for u. 1 Let f(m) = m*3 - 7m*2 - 8m. Let d be f(8). Suppose 5r + 6 - 11 = d. Solve -4o = 3l + r + 3, o = 3l - 1 for l. 0 Let v be (-51)/3 + (-3 - -2). Let b = v - -20. Solve 2j = 0, bq - 4j + 2 + 0 = 0 for q. -1 Suppose -10 = -3n - 4v - 1, 0 = n - 4v + 13. Let m be n/(5/(-170)2). Solve -3o + 1 = -h, -o - m = 3h - 4 for o. -1 Let c(a) be the third derivative of a5/60 + 11a*4/12 + 23a*3/3 - 2a*2. Let h be c(-21). Solve -j + 2m = -9, 5j - m = 4m + h for j. 1 Let g = -749 - -753. Solve -y - 4u = 17, u + 1 = gy + 18 for y. -5 Suppose -83 = 2a - 0a + 5s, -5s = -a - 4. Let y = 29 + a. Solve y = 5c - 5w - 10, c + 4 = -3c - 2w for c. 0 Let p be 3/8 + 3094/112. Solve 4q = 5z + 4 + p, -2z = 4q - 4 for q. 3 Let k(f) = -2f2 + 17f - 11. Let y be k(7). Let q = 20 - 14. Let j be (1 - 1)/(q + -4). Solve 3z - 20 = l - j, 5z - y = -3l for l. -5 Let r = 28 + -22. Suppose p = -p + r. Suppose 4h - 3 = 4y - 31, -py + 26 = 2h. Solve 4q + 4k = 16, 0k - y = -q - 5k for q. 3 Let m be (-73)/5 + 6/10. Let p = -9 - m. Suppose -5j = -pg - 35, 42 = 5j + 5g - 3g. Solve -i + j = -2d, -3i + 9 = -4d - 5 for i. -2 Let p be (-3)/(-5) - (-561)/(-85). Let z(h) = -2h - 7. Let i be z(p). Solve -ik + 24 = -4q, 2q = -k - 2q for k. 4 Let q = 779 - 774. Solve -qz + r = -1, 16 = 3r + 4 for z. 1 Suppose 89 = 8q + 17. Solve 2i + 15 = -3i, 2i = 3c + q for c. -5 Let b be (-16)/(-80) - (-64)/5. Suppose -2j = -5h + b, 6h - 11 = -5j + 4h. Solve -5g = -5r, -2g - 5r = j - 15 for g. 2 Suppose t + t + 19 = 3o, 0 = -3t - 2o + 4. Let x be t - (-1 + 4/(-4)). Solve -3y - 6 = 4d, 0 = -xy - 2y - 3d - 5 for y. 2 Let w(c) = -6c2 + 31c - 8. Let x(k) = k*2 - k + 1. Let n(p) = -w(p) - 5x(p). Let m be n(26). Solve 0o - o = 3t - 13, mo = -2t + 4 for t. 5 Suppose -10 = -4p - 2. Suppose -s = 4b, -3s + 7b - 16 = 3b. Let c be 1(-1)/s4. Solve 4x - 4t = 0, t - p = 2x - c for x. -1 Suppose 82u = 672 + 66. Solve n - 6 = r, 5n - u = -3r + r for r. -3 Let b(i) = 9i + 82. Let d be b(-9). Solve 4y - 13 = -u, 2u + d = -u - 2y for u. -3 Suppose 0 = -4k + 22 - 6. Suppose 2d + 3d - 12 = -l, -3l + 4 = -d. Let v be -2l/(-20) + (-1152)/(-90). Solve -o - kt - 17 = 0, -t = 5o - v + 41 for o. -5 Let s = 132 - 130. Let y = -68 - -114. Let w = y - 33. Solve -sl = -7l + 10, -w = 3a - 5l for a. -1 Let v(b) = -44b - 216. Let f be v(-5). Solve -4 = 3z + l, -6l = fz - 3l - 3 for z. -3 Let v = -688 - -693. Let h = -1 - -1. Solve -31 = 4m - 5w, -vm - 5w + 0 - 5 = h for m. -4 Suppose 46 = 4g + 6. Suppose 34 = 4z + g. Let s(l) = -l2 + 7l - 2. Let j be s(z). Solve -9 = 3i, 2i = 2k - jk for k. 3 Let g = -133 - -75. Let x = g - -62. Solve -xq - s + 16 = 3s, 0 = 3s - 3 for q. 3 Let n be (3 - 2 - 1)/(-1). Let k(j) = j3 - j2 + 5. Let y be k(n). Solve 4w = -yc + 7, 8c = 4c + 2w - 10 for c. -1 Let h(v) = -30v - 5. Let l be h(-2). Let d = 77 - l. Let c = d + -17. Solve -2a + 28 = -5p - ca, -5p = -2a + 23 for p. -5 Suppose h - 5h + 12 = 0. Let q be 1(h - 1 - -1). Solve n - 3u = -q, -4n + 3 = 2u + 1 for n. 0 Let x(m) = m2 + m2 - m - 2m2 + m2. Let r be x(0). Let b be (-6 - -12) + -1 + 0. Solve 0 = w + bu + 7, 0 = -ru - u - 1 for w. -2 Let m(j) = -j*2 - 4j*2 + j + 4j*2 - 19 - 12j. Let l be m(-8). Solve -14 + 34 = 5g - c, lg = -2c + 5 for g. 3 Let m = -159 + 169. Suppose h + m = -5f, -h + 4f - 3 = -4h. Solve 4o - d + 10 = 0, -23 = ho + 2d + 2d for o. -3 Suppose -m = 0, -3t - 7 + 16 = -4m. Let p(c) = 5c - 7. Let o be p(t). Solve -2h - o = 2w - 28, 0 = 2h - 3w + 5 for h. 5 Suppose -5f + 25 = 5a, -3f + 23 = 1904a - 1905a. Suppose -6v = -4v - 36. Solve -5s - f + v = 4k, 2s + 5k = 18 for s. -1 Let l be (60/(-9))/10 + 142/6. Solve 5m = -3 + l, -4v + 28 = 3m for v. 4 Let g = 720 - 716. Solve 4u = -16, 2f + gu - 2 + 8 = 0 for f. 5 Let c = -1232 - -1238. Solve 3a = 6r - r + 9, 2r = 2a - c for r. 0 Let f(d) = d*2 - 154d. Let q be f(0). Let j = 3 - 1. Solve q = m + jr - r - 6, -5m + 4r = 15 for m. 1 Suppose -43 = -15y + 62. Solve -20 = -4c + 4u, -5u = 5c + y - 2 for c. 2 Suppose 0 = -b - 7. Let r(y) = -y - 5. Let c be r(b). Let g(i) = 26i + 55. Let p be g(-2). Solve x + 0x - 5 = 0, -cv - px + 25 = 0 for v. 5 Let l = 93 - 31. Suppose 7 = -3b - l. Let o = 27 + b. Solve -4x + 2m = -o + 10, -15 = 4x + m for x. -3 Let p be ((-24)/18)/(5/(-15)). Solve 0 = 5w + 5h - 11 - p, -2h = -w + 3 for w. 3 Let j be (-8)/(-6) - (-66)/18. Solve jl + u - 2 = 0, 5l = 5u - 7 - 3 for l. 0 Let n(w) = w*3 + 3w*2 - 2w - 4. Suppose 0r + 2r = 4d + 6, -2r - 18 = 4d. Let a be n(d). Solve -3u + 10 = 2b, -ab - 2b + 4u = 0 for b. 2 Suppose 6c = 2c + 20. Suppose -q - 81 = -3u - cq, 2u - 4q - 34 = 0. Let j(h) = h*2 + 1. Let i be j(-2). Solve -3p = -5f + u, -5f + ip + 28 = 3 for f. 4 Let y(z) = -3z + 49. Let s be y(16). Suppose n + 16 = -0n + 4w, 2n + 2 = 2w. Suppose nc - 10 = 2. Solve -3u = k - s, ck - 3 = u - 0 for u. 0 Let r(q) = 6q - 9. Let j be r(2). Suppose y + 18 = jl, -2y + 2 = l - y. Solve 2u + 2i - 13 + l = 0, 6 = 3u - 3i for u. 3 Let o = -21 - -37. Suppose -d + o = 12. Solve 2c + 4 = -3i + 23, 3c - 27 = -di for c. 5 Let v(w) = -w*3 + 19w*2 + 19w + 22. Let q be v(20). Solve -6c + 2c - 2o + 18 = 0, qc - 3o = 13 for c. 5 Let v = -951 + 956. Solve -8 = -2b + 3a, -5b + 7a = va - 20 for b. 4 Let i(g) = -3 + 3g2 + 2g - 8 + 5 + 0g2. Let j be i(-3). Let n = -3 + 5. Solve -12 = -5a + p + 3p, -5p = na + j for a. 0 Suppose -3y + 9 - 3 = 0. Suppose 5 = j - y. Suppose -jf = -8f. Solve 4m + c = -fc - 3, m = -2c - 6 for m. 0 Let x be (4 + 3/(-1))0. Suppose -4f = p + 3p + 8, x = 5p + f - 6. Solve 0 = r + c - 4c + 5, -4 = 3r + pc for r. -2 Let g be 10(77/(-14) + 6). Solve -4v + 2v = -t - 10, -2t - g = v for t. -4 Let d = -50 - -54. Solve 6 = -2k + 4z, -5k = -dk - z for k. 3 Let o be -26(-5)/(-60) - -6. Solve -og - 4a + 26 = 2, -4g = -4a - 12 for g. 4 Suppose 30 = 3o + 5j, -2o - 2j + 26 = 2o. Solve 2q + q - 12 = 0, 2t + 22 = oq for t. -1 Let i be 36/(-27) + 4/34. Solve -4x - 26 = -it - 2x, 14 = t - 3x for t. 5 Suppose 3i - 4m = 5, 4i - 15 = -0m - 3m. Let c be 4 - (9/(-3))/i. Solve 5q + c = 5z, -q - q - 3z = 22 for q. -5 Let i be ((-2)/3)/(-12/12). Suppose -5f - 5 = 4z - z, -2z - if - 6 = 0. Solve a + 4a = -zl - 5, 3l - 32 = 4a for l. 4 Let c = -429 + 432. Solve -cv + 4n =	{ "pile_set_name": "DM Mathematics" }
ng 1 d and 1 m? 10/51 Calculate prob of picking 1 m, 1 w, and 1 s when three letters picked without replacement from ppwspmwwmp. 1/20 What is prob of picking 1 z, 2 t, and 1 c when four letters picked without replacement from {z: 4, f: 1, t: 2, c: 2, m: 5}? 8/1001 Calculate prob of picking 1 u and 1 f when two letters picked without replacement from ffffffffufu. 18/55 What is prob of picking 1 e, 1 m, and 1 n when three letters picked without replacement from {m: 1, e: 1, n: 1, y: 3, h: 1}? 1/35 Three letters picked without replacement from bjrbwwssbqbwsbb. What is prob of picking 1 j, 1 q, and 1 w? 3/455 Three letters picked without replacement from {f: 7, a: 9, r: 3}. What is prob of picking 1 f, 1 r, and 1 a? 63/323 Two letters picked without replacement from {w: 5, t: 8, u: 5, n: 1}. What is prob of picking 1 u and 1 w? 25/171 Two letters picked without replacement from {m: 2, o: 10, d: 4}. What is prob of picking 1 m and 1 d? 1/15 Three letters picked without replacement from {i: 2, b: 18}. What is prob of picking 3 b? 68/95 What is prob of picking 1 q, 1 p, and 1 k when three letters picked without replacement from gkbbvpqp? 1/28 Calculate prob of picking 3 z when three letters picked without replacement from zzqzzzzqqzq. 7/33 Calculate prob of picking 3 h when three letters picked without replacement from uuhuhh. 1/20 Two letters picked without replacement from bbbfbfhhm. What is prob of picking 1 f and 1 h? 1/9 Four letters picked without replacement from lidlidlli. Give prob of picking 2 i and 2 d. 1/42 What is prob of picking 1 u and 2 k when three letters picked without replacement from uukukukukkukkkuuuk? 27/68 What is prob of picking 1 k and 1 i when two letters picked without replacement from {i: 1, k: 2}? 2/3 Calculate prob of picking 1 n and 2 v when three letters picked without replacement from {a: 2, v: 4, n: 2}. 3/14 What is prob of picking 2 f when two letters picked without replacement from {f: 3, x: 2, w: 3}? 3/28 Three letters picked without replacement from fgzbccfczzzczfd. Give prob of picking 1 c, 1 f, and 1 z. 12/91 Calculate prob of picking 1 i and 1 o when two letters picked without replacement from wowsoowsowi. 4/55 Three letters picked without replacement from hhhckzp. Give prob of picking 2 k and 1 z. 0 What is prob of picking 1 v, 1 m, and 2 g when four letters picked without replacement from kovkkvvgvmggv? 3/143 Calculate prob of picking 3 y when three letters picked without replacement from {d: 2, t: 8, y: 5}. 2/91 What is prob of picking 2 m and 1 w when three letters picked without replacement from {w: 3, m: 13}? 117/280 What is prob of picking 1 w and 1 u when two letters picked without replacement from {w: 1, q: 3, u: 2, v: 1, l: 6}? 1/39 Calculate prob of picking 1 r and 1 t when two letters picked without replacement from {t: 1, l: 1, r: 1}. 1/3 What is prob of picking 2 v when two letters picked without replacement from hhhzhvhvhvhhvh? 6/91 Four letters picked without replacement from {f: 2, d: 3, j: 4, o: 3, s: 1, x: 3}. Give prob of picking 1 s, 1 o, and 2 j. 9/910 Three letters picked without replacement from {x: 3, u: 3, n: 1}. What is prob of picking 2 x and 1 n? 3/35 What is prob of picking 3 d when three letters picked without replacement from {n: 2, d: 9}? 28/55 Calculate prob of picking 1 g and 1 n when two letters picked without replacement from {n: 8, u: 4, g: 5}. 5/17 Calculate prob of picking 2 h when two letters picked without replacement from {h: 8, w: 4, t: 4}. 7/30 Calculate prob of picking 3 a when three letters picked without replacement from {y: 5, b: 3, a: 1}. 0 Two letters picked without replacement from ikkt. What is prob of picking 1 i and 1 k? 1/3 Four letters picked without replacement from {l: 3, y: 7}. What is prob of picking 1 y and 3 l? 1/30 Four letters picked without replacement from {t: 3, r: 3}. Give prob of picking 3 r and 1 t. 1/5 What is prob of picking 1 y, 1 e, and 1 r when three letters picked without replacement from eyxnrera? 1/14 What is prob of picking 3 b when three letters picked without replacement from bbbxxb? 1/5 Four letters picked without replacement from vkkrrrkkrrrgvvrkrv. Give prob of picking 1 r, 1 v, and 2 k. 16/153 Calculate prob of picking 2 p when two letters picked without replacement from puupv. 1/10 Calculate prob of picking 2 a and 1 f when three letters picked without replacement from aoaofaxax. 1/14 Three letters picked without replacement from {l: 9, j: 7}. What is prob of picking 3 l? 3/20 Three letters picked without replacement from aoeeeeoooeeeeeeeeeoe. What is prob of picking 2 e and 1 o? 91/228 What is prob of picking 1 c, 1 x, and 1 p when three letters picked without replacement from {f: 6, p: 2, c: 1, r: 3, s: 2, x: 4}? 1/102 Calculate prob of picking 1 z and 3 j when four letters picked without replacement from {z: 1, j: 3, w: 3, k: 4}. 1/330 Calculate prob of picking 1 o and 2 k when three letters picked without replacement from {z: 10, o: 1, v: 1, c: 3, k: 2, x: 1}. 1/816 Four letters picked without replacement from {n: 1, b: 2, i: 3, h: 1, m: 4}. Give prob of picking 1 b, 1 h, and 2 m. 2/55 Three letters picked without replacement from hhhbibihibi. Give prob of picking 2 i and 1 h. 8/55 Calculate prob of picking 1 h and 3 f when four letters picked without replacement from hfffhhhfhh. 4/35 What is prob of picking 2 t when two letters picked without replacement from tzxxxxxxxtzx? 1/66 Four letters picked without replacement from {p: 5, m: 2, n: 3, w: 1, a: 7, u: 2}. What is prob of picking 1 w and 3 a? 7/969 Four letters picked without replacement from ggggggagggggggg. Give prob of picking 1 a and 3 g. 4/15 What is prob of picking 1 t and 1 b when two letters picked without replacement from ttntntb? 4/21 Three letters picked without replacement from {a: 16, b: 2}. Give prob of picking 2 b and 1 a. 1/51 Four letters picked without replacement from {c: 1, s: 12}. Give prob of picking 4 s. 9/13 What is prob of picking 1 y and 1 n when two letters picked without replacement from yennelnnyylenun? 6/35 Calculate prob of picking 1 x and 1 j when two letters picked without replacement from {j: 1, d: 1, u: 1, x: 3, c: 1}. 1/7 What is prob of picking 2 a and 1 j when three letters picked without replacement from {j: 11, a: 2}? 1/26 What is prob of picking 2 e and 1 d when three letters picked without replacement from {d: 8, e: 4, y: 1, v: 7}? 4/95 Two letters picked without replacement from {y: 7, w: 3, c: 5, v: 1}. What is prob of picking 2 w? 1/40 What is prob of picking 1 s and 1 w when two letters picked without replacement from {u: 1, w: 1, s: 1}? 1/3 Calculate prob of picking 3 w and 1 r when four letters picked without replacement from {w: 3, r: 3}. 1/5 Two letters picked without replacement from {m: 3, v: 3, q: 3, z: 1, j: 1}. Give prob of picking 1 z and 1 v. 3/55 What is prob of picking 1 r, 1 j, and 1 s when three letters picked without replacement from {r: 2, j: 4, s: 1}? 8/35 Four letters picked without replacement from nmmrzvvrvrvvxmvzvm. Give prob of picking 1 v, 2 r, and 1 x. 7/1020 What is prob of picking 1 g and 1 y when two letters picked without replacement from {y: 5, t: 1, b: 1, g: 2, r: 1}? 2/9 What is prob of picking 1 q, 1 a, 1 r, and 1 x when four letters picked without replacement from {a: 1, x: 4, q: 2, r: 1}? 4/35 Four letters picked without replacement from {r: 4, o: 2, h: 1, c: 3, i: 2}. What is prob of picking 1 r, 2 c, and 1 i? 8/165 Calculate prob of picking 1 r, 1 g, and 2 d when four letters picked without replacement from {s: 2, r: 2, v: 5, f: 2, d: 2, g: 1}. 2/1001 Four letters picked without replacement from ddddll. What is prob of picking 4 d? 1/15 What is prob of picking 1 l, 2 j, and 1 v when four letters picked without replacement from {l: 1, j: 4, s: 2, v: 1, i: 1}? 1/21 Two letters picked without replacement from ydxnv. Give prob of picking 1 v and 1 d. 1/10 Four letters picked without replacement from lllll. Give prob of picking 4 l. 1 Four letters picked without replacement from ddiiaaaadiai. What is prob of picking 4 i? 1/495 Four letters picked without replacement from nnnlknnnkknnkknnlkn. What is prob of picking 3 k and 1 n? 55/969 Two letters picked without replacement from {y: 2,	{ "pile_set_name": "DM Mathematics" }
r. 1 Express -5 - 1236q + 2 + 2 + 1242q as t + rq and give t. -1 Express 2r*4 + 2r*2 + 1461 - 3r + 4r - 1451 in the form n + br*3 + yr*2 + ar + zr4 and give y. 2 Rearrange (12v + 43 - 43)(5 + 6 - 3) to cv + k and give c. 96 Rearrange -1 - 5l2 - 14l*3 - 6l - 23l4 - 1 + 20l*4 + 6l*2 to u + bl*2 + rl + ml3 + sl*4 and give b. 1 Express (14x - x + 11x)(-4x2 + 3x*2 + 0x*2)(-6x + x - 2x) as bx4 + ux*2 + y + hx*3 + ix and give b. 168 Express (0 - 2 + 10 + 2 - 1 + 0 + (2 - 5 + 2)(-3 - 3 + 4) + 1 - 1 - 1 - 1 + 0 + 2)(-8s2 - 5 + 5) as ns*2 + h + xs and give n. -88 Rearrange -6q3 - 3q*3 - 78q*2 + q + 76q*2 to mq + b + rq2 + kq*3 and give m. 1 Rearrange (1 - 2p - 1)(1 + 5p*2 - 1) - 43 - 4p*2 + 72p*3 + 47 + 4p*2 to the form zp*2 + lp + jp3 + n and give j. 62 Rearrange (0t*2 + 164t - 186t + 2t*2)(5t - 2t + 1 - t)(-3 - 1 + 2)(-t - 2t + 0t) to pt2 + at*3 + w + ct + ot4 and give a. -252 Express -y - 105 + 54 + 51 in the form ry + q and give q. 0 Express 220q2 - 445q*2 + 221q*2 - 14q in the form zq + i + aq*2 and give a. -4 Rearrange (3x*4 - 5x4 + x3 - 5x3)(-6 + 3 + 4) + x*4 + 3 - 3 to the form hx*4 + p + yx + kx2 + cx*3 and give c. -4 Rearrange -312g*2 + 92g*2 - 345g*2 - 233g*2 + 147g*2 to o + fg + ag2 and give a. -651 Express -2d*4 - 3d2 - d3 + 3d4 + 40d + 36d - 54d in the form ud3 + gd*4 + ad*2 + qd + w and give q. 22 Express 10r + r - 7r + 1 - 39r + 87r - 47r + (r - 2r + 2r)(2 - 4 + 4) + 0r + 4r - 3r as mr + o and give o. 1 Rearrange f*4 - 3f*4 - 6f + 3 - 2f3 - 61f*2 - 5f + 12f + 17f*2 to the form kf*3 + yf + j + cf4 + if*2 and give y. 1 Rearrange -10p*2 - 11p*2 - 31p*2 + (-p - 3p + 3p)(3p - 3p - p) + 2p2 - 5p2 - p2 to ap2 + y + op and give a. -55 Rearrange (-24 - 15 + 28 + 2k)(1 - 5k2 - 3 + 8k*2) to the form mk + o + gk2 + nk*3 and give m. -4 Rearrange -3878t*3 + 5 + 1938t*3 + 36t - 5 + 1938t3 to pt*2 + nt*3 + h + wt and give n. -2 Rearrange (-5z + 4z + 4z)((1 - 2 + 3)(-1 - 1 + 1) + 1 - 7 + 4 - 2 + 1 + 2)(-106 + 15 - 27)(-4 + 6 + 0) to fz + q and give f. 2124 Express -h*2 + 0h*2 + 3 + 4h + 2h2 - 21h in the form v + ph + xh*2 and give x. 1 Express 1 + 2 - 3 - 196g*2 - 307g*2 as l + qg + jg2 and give q. 0 Express -18 - 12 + 47y - 13 - 43y - 71 as v + qy and give q. 4 Express (19q2 + 73q - 73q)(-1 + 1 - q)(-2q - 1 + 1) as oq2 + tq + hq4 + sq*3 + r and give h. 38 Rearrange (-35 - 71 - 1)(-2 + 2 + 2f) + (-f - 4 + 4)(-1 + 1 + 4) to mf + p and give m. -218 Rearrange 34 + l - 351l*2 + 353l*2 - 4 to the form jl*2 + x + kl and give x. 30 Rearrange (3 - 7 + 6 + 10v)(-2v + 5v + v)(2v - 2 + 2) to the form wv3 + i + fv*2 + lv and give f. 16 Express 40x4 - 113x*4 + 39x*4 - 2 + 2x + 37x4 - 5x*2 in the form v + dx*4 + wx*2 + mx + yx3 and give d. 3 Rearrange -2g - 80g2 + 8 + 29g - 27g to d + kg*2 + lg and give k. -80 Rearrange 242x3 - 115x*3 - 124x*3 - 19x to q + lx3 + zx*2 + wx and give q. 0 Rearrange (-2k + 8k - k)(-1 - 1 - 3)(3 - 2k - 3) to the form n + ak + lk2 and give l. 50 Rearrange c - 187 + 10 - 172 - 23 - 72 to the form v + qc and give q. 1 Rearrange 5u2 + 9636u - 10 - 3u2 - 9632u to the form lu2 + qu + b and give b. -10 Rearrange -11 + 27b + b3 + 10 + 10b*2 + 11b - 9b2 to the form v + zb*2 + lb + xb3 and give z. 1 Rearrange (2c*2 + 0c + 0c)(378 - 10 + 46) to the form bc2 + a + rc and give b. 828 Rearrange (-2o2 + 6922 - 6922 - 328o)(0 + 1 + 0) to the form jo + x + ao2 and give a. -2 Express (5y*2 + 14 - 3 - 22y*2 - 9y*2)(-3y + 5y - 4y) as iy + sy2 + ny*3 + u and give i. -22 Express -1861s - 667s + 12 - 20 + 8 in the form x + ms and give m. -2528 Express -2 - 22 + 7 - 2b3 + 17b*2 + 19 in the form i + mb*3 + xb*2 + pb and give m. -2 Rearrange 9k - 7 + 3 + 2 + 4 to the form r + fk and give f. 9 Rearrange 129p - 142p*2 - 143p + 10p to w + dp + vp2 and give d. -4 Rearrange (3w*2 - 2w2 + w2)(-95 - 3w - 12w + 92) to the form rw*3 + c + bw + yw2 and give y. -6 Rearrange 315p*2 - 57651p + 57651p to qp + up2 + l and give u. 315 Express 188 + 187 + 190 - 25x - 563 as s + yx and give y. -25 Express 0k - 2k + 2k - 131k2 as s + lk*2 + xk and give l. -131 Express 13o2 - o + 12o*2 - 32o*2 + 10o*2 - 2 in the form h + bo + so2 and give h. -2 Express 45n*4 - 191n*4 - 182n + 5n3 - 2 + 182n in the form c + ln + qn*4 + rn*2 + fn*3 and give l. 0 Rearrange s + 2 + 10s*4 + 2 + 10s*4 - 22s*4 - 2s*3 to gs*3 + fs + ws2 + m + rs*4 and give f. 1 Rearrange (4 - 3 - 2)(-243d + 247d - 6 - 68) to id + j and give i. -4 Rearrange -374s + 318 - 318 to ms + l and give m. -374 Rearrange (-419 + 13k + 419)(-2k*2 - 3 + 3)(-4k + 2k + 3k - 6) to b + nk*2 + wk*3 + sk*4 + dk and give n. 0 Express -21j - 22j + 1 + 45j as n + gj and give g. 2 Express 21y - 13y + 1 + 2y2 - 35y*3 - 15y3 - y2 - 7y in the form my*3 + jy*2 + qy + o and give q. 1 Express (3 - 2 + 3)(-2l - 6l + l + (-3 + 3 - 2)(-2 - 2l + 2) + (0l + 0l - 2l)(3 - 2 + 0)) in the form ul + o and give u. -20 Express 4l2 + 2448 + 9l*2 - 2448 - 14l as cl + jl2 + k and give j. 13 Rearrange -1 - s4 + s*3 + 2s*2 + 4451s - 4459s + 2s*4 + 4 to the form xs*4 + as*2 + os*3 + f + ks and give o. 1 Rearrange (23 - 23 - 54s3)(-4s + s - s) + 0s*4 - 2s*4 + 4s*4 to the form ts*3 + h + us*2 + bs + gs4 and give g. 218 Rearrange 1581j*2 - 21j + 15j + 6j to the form v + bj2 + lj and give b. 1581 Express -3 - 71u - 9 + 2u*3 - 3u + 74u + 12u*2 as d + zu + ju2 + mu*3 and give j. 12 Rearrange -4k - 2k + 4k - k + 1 - 1 - 5k + 4k - k + (2 - 3 + 0)(k + 0k + k) + 2138 - 2138 + 74k to the form nk + q and give n. 67 Rearrange (9 - 29 + 6)(-6y + 4y + y) + 3 + 1 + 20y - 3 - 1 to oy + x and give o. 34 Express -37s*3 - 2s - 56s3 + 164s3 + s2 in the form xs + ks*3 + g + ns*2 and give x. -2 Rearrange (-3n*3 + 6n*3 - 5n*3)(-33n - 33n - 87 - 33n + 103n) to the form w + on2 + cn*4 + fn + kn3 and give c. -8 Rearrange (4908o - 4908o - 2 + 67o*3)(-3 + 2 + 0) to the form yo3 + po + g + uo2 and give y. -67 Rearrange (-38 + 38 - 71r)(1 + 3 + 3) to cr + h and give c. -497 Express (-2 - x + 2)(1 - 1 + 2) - 1142x + 1238x + 3723x in the form kx + b and give k. 3817 Rearrange (5y - 2y + 0y)(5y - 101 - 51 - 4y) to the form w + zy*2 + ny and give z. 3 Rearrange (-6d2 + d2 + 4d*2)(-21d + 12d - 25d + (2 + d - 2)(2 - 4 + 3) + 4d - 4d + 11d) to kd*2 + i + rd + ld3 and give l. 22 Express (-2q - 3q2 + 2q)(-5 + 1 + 5) + (-1 - 2 + 6)(-8q2 - 4q*2 + 3q*2) as cq*2 + fq + m and give c. -30 Rearrange 1 - 16a - 16a - 2 - 3 - 16a2 - 2a*3 + 34a to the form x + qa3 + da*2 + va and give d. -16 Rearrange 5d + 61d*2 - 29d*2 - 29d*2 + 2 - 16d*2 - 2d*4 to ad + xd2 + k + sd*4 + ld*3 and give s. -2 Rearrange -153f - 2f3 + 4f*3 + 12061 - 12062 to gf*2 + wf*3 + kf + x and give k. -153 Express 2b - 3b + 5b + (0 - 1 - 1)(2b - 2b + 4b) + 13b - 21b - 5b as mb + n and give m. -17 Express (3 - 3 + 1)(-2 + 1 + 17304y - 16932y)(2y + y*2 - 2y) in the form cy3 + d + my*2 + jy and give m. -1 Express 2i + i3 + 6 - 32i*4 + 5i - 4 - 6i in the form ri*4 + u + ki*2 + ai*3 + yi and give r. -32 Express (-y + 3y - 3y)(-3 - y2 + 3) + 31y*3 - 11y*3 + 10y*3 in the form ny*3 + t + sy + cy2 and give n. 31 Rearrange 4 - 11g*2 - 4 + 44g*2 + 5 + 9g*2 to mg*2 + ng + j and give j. 5 Rearrange 2162w + 2w*2 + 11 - 2162w to the form nw + zw*2 + p and give z. 2 Rearrange -11821 + 11823 - 42b3 + b4 + b - 7b3 - 3b to nb + kb*3 + sb*2 + ob*4 + f and give o. 1 Express -21u3 + u2 - 33u + 23u*3 + 0u4 + u4 - 32u - 3u*4 in the form i + zu	{ "pile_set_name": "DM Mathematics" }
ultiple of 19305 and 533. 791505 What is the common denominator of 169/16002 and 31/1778? 16002 What is the common denominator of 4/1395 and 199/840? 78120 Find the common denominator of -5/45388 and 53/19452. 136164 Find the common denominator of -19/21627 and 89/36. 86508 What is the common denominator of -103/3952 and 125/1248? 23712 Calculate the common denominator of -51/28684 and -51/40. 286840 What is the common denominator of 37/5256 and 95/292? 5256 What is the common denominator of 139/646038 and -39/10? 3230190 What is the lowest common multiple of 236376 and 162? 2127384 What is the common denominator of -179/60 and -19/759? 15180 What is the lowest common multiple of 2048 and 7168? 14336 Find the common denominator of 62/905 and 1/6697. 33485 Calculate the smallest common multiple of 70 and 2248. 78680 Calculate the common denominator of -111/400 and 53/5800. 11600 What is the lowest common multiple of 53655 and 21? 53655 Calculate the common denominator of -127/120 and -10/569709. 22788360 Calculate the smallest common multiple of 56466 and 420358. 3783222 Calculate the common denominator of 101/1032 and -20/6321. 50568 Find the common denominator of 13/1323 and 151/18774. 394254 What is the common denominator of -61/11868 and 103/233404? 700212 What is the least common multiple of 17710 and 129030? 903210 Find the common denominator of -25/29756 and -41/10. 148780 What is the common denominator of -17/1078 and 59/336? 25872 What is the smallest common multiple of 12438 and 45? 62190 Find the common denominator of -121/216 and 137/11700. 70200 What is the common denominator of -49/24 and -27/59104? 177312 Calculate the common denominator of -87/4222 and 57/86. 181546 What is the common denominator of -1/564 and 9/4? 564 Calculate the common denominator of -40/60333 and -47/4368. 965328 Calculate the common denominator of 73/652 and -197/2070. 674820 Calculate the common denominator of 35/529 and 95/110354. 2538142 Find the common denominator of -107/2408 and -59/63. 21672 Calculate the least common multiple of 5350 and 35. 37450 Calculate the common denominator of -107/50 and 73/10005. 100050 Calculate the common denominator of -51/1438 and -37/174. 125106 Calculate the lowest common multiple of 114 and 66253. 397518 Calculate the common denominator of 61/3474 and -17/18. 3474 Calculate the common denominator of 101/2352 and 97/980. 11760 What is the common denominator of 16/581295 and -111/140920? 4650360 Calculate the common denominator of 32/219653 and -32/189. 5930631 What is the common denominator of -43/72 and 75/754? 27144 What is the least common multiple of 245110 and 2? 245110 Find the common denominator of -121/30 and 53/1428. 7140 What is the lowest common multiple of 75750 and 6060? 151500 Calculate the common denominator of 25/428622 and -49/9. 1285866 What is the smallest common multiple of 5880 and 1540? 64680 What is the lowest common multiple of 5376 and 768? 5376 What is the smallest common multiple of 11930 and 2386? 11930 Find the common denominator of 137/102 and -5/20774. 62322 Find the common denominator of 125/52374 and 155/78. 680862 Calculate the lowest common multiple of 50013 and 400104. 400104 Find the common denominator of -5 and 56/67135. 67135 What is the common denominator of -119/1476 and -28/13? 19188 What is the lowest common multiple of 77926 and 6632? 311704 What is the smallest common multiple of 6 and 1413? 2826 Find the common denominator of -71/720 and 79/716. 128880 What is the common denominator of 43/37530 and 23/6255? 37530 Find the common denominator of 117/157150 and -52/141435. 1414350 Calculate the common denominator of -93/280 and 7/4965. 278040 What is the lowest common multiple of 86386 and 188? 172772 Calculate the least common multiple of 10854 and 18. 10854 What is the common denominator of -31/2442 and -79/234? 95238 Calculate the lowest common multiple of 5853 and 325817. 977451 What is the common denominator of 43/125382 and -109/36? 752292 Calculate the least common multiple of 13364 and 1508. 387556 What is the lowest common multiple of 197 and 13? 2561 Calculate the common denominator of -125/6066 and -101/2255204. 20296836 What is the common denominator of 53/103760 and -83/10? 103760 Find the common denominator of 22/20007 and 11/306. 680238 What is the least common multiple of 2 and 93856? 93856 Calculate the lowest common multiple of 5091 and 129. 218913 Calculate the lowest common multiple of 309108 and 3. 309108 What is the least common multiple of 462 and 65604? 65604 What is the least common multiple of 45 and 138069? 690345 Find the common denominator of -95/38136 and -81/14528. 305088 Find the common denominator of 82/124815 and 40/583. 1372965 What is the lowest common multiple of 1122 and 3630? 61710 Calculate the least common multiple of 200401 and 11. 2204411 Calculate the smallest common multiple of 1938 and 94. 91086 What is the least common multiple of 57 and 44403? 44403 Calculate the least common multiple of 477 and 34715. 312435 Find the common denominator of -11/156 and -7/97656. 97656 What is the common denominator of -73/43232 and 43/784? 302624 What is the common denominator of -105/1194154 and 38/117? 10747386 Calculate the lowest common multiple of 8502 and 2028. 221052 Calculate the common denominator of 7/47000 and 163/7050. 141000 Calculate the common denominator of 87/10544 and -71/83034. 664272 Calculate the least common multiple of 17490 and 295740. 3253140 What is the common denominator of -23/2605 and 93/70? 36470 Find the common denominator of -85/84212 and 63/64. 1347392 What is the smallest common multiple of 13992 and 12? 13992 Find the common denominator of -139/684 and 23/10080. 191520 Calculate the least common multiple of 166302 and 18478. 166302 Calculate the common denominator of -169/495264 and 63/16. 495264 Calculate the common denominator of 29/2090 and -11/228285. 5022270 Calculate the least common multiple of 1070 and 16850. 1802950 Find the common denominator of 61/87372 and -12. 87372 Find the common denominator of 50/21 and -76/4773. 33411 Calculate the common denominator of -29/16074 and 157/570. 80370 Calculate the least common multiple of 65 and 14195. 184535 Calculate the smallest common multiple of 124 and 484. 15004 What is the least common multiple of 133 and 18240? 127680 What is the common denominator of 79/25390 and 65/15234? 76170 What is the common denominator of 173/510 and 73/1347? 228990 What is the least common multiple of 21537 and 595857? 1787571 What is the common denominator of -33/3232 and -87/16? 3232 What is the least common multiple of 1016 and 3? 3048 Calculate the smallest common multiple of 28 and 23659. 662452 Calculate the least common multiple of 216839 and 6. 1301034 What is the common denominator of 149/4068 and 21/422? 858348 Calculate the common denominator of 113/192 and 1/14016. 14016 What is the lowest common multiple of 25116 and 2898? 75348 What is the common denominator of 31/1683 and 105/578? 57222 What is the common denominator of -3/6304 and 79/22? 69344 What is the common denominator of -62/299135 and -93/598270? 598270 What is the lowest common multiple of 119709 and 26602? 239418 Calculate the smallest common multiple of 31600 and 540. 853200 What is the lowest common multiple of 419742 and 351? 5456646 Calculate the lowest common multiple of 424 and 15900. 31800 Calculate the common denominator of -113/42354 and -79/14118. 42354 What is the least common multiple of 145585 and 105880? 1164680 What is the least common multiple of 924 and 237930? 475860 Calculate the common denominator of -13/178228 and -83/16. 712912 Calculate the least common multiple of 411069 and 1578. 822138 Find the common denominator of -85/95054 and -99/32. 1520864 What is the smallest common multiple of 1024 and 64? 1024 What is the smallest common multiple of 20 and 1534? 15340 Calculate the smallest common multiple of 11150 and 466. 2597950 What is the common denominator of 11/1710 and 25/278388? 1391940 What is the common denominator of 68/23265 and -113/46530? 46530 Calculate the common denominator of 25/11834 and 41/427. 82838 What is the smallest common multiple of 418 and 337592? 371351	{ "pile_set_name": "DM Mathematics" }
- 268). 16860b3 Expand -8f*4 + 20 - 20 + (-2 + 2 + 1)(-5f4 - 3f*4 - 4f*4) + 5f - 5f + 6f*4 - 3f + 3f + f4 + (f2 - 1 + 1)(0f + 0f - 2f2). -15f*4 Expand (-24y + y - 23y)(2y - 5y + 2y)(-2 - 4y3 + 5 + 8y*3). 184y*5 + 138y*2 Expand -13o*2 - 13o*2 + 2 + 21o*2 + (-o + 2o - 3o)(o - 2o + 3o). -9o2 + 2 Expand (-1702 - 1494 + 409 - 210)(0u + 2u + 0u). -5994u Expand (5k2 - 5k*2 + 3k*4)((-4 + 2 + 7)(3 + 2k - 3) + 2k + k - 5k + (4k - 3k + 0k)(0 + 0 - 1) - 5k + 3k + 0k). 15k*5 Expand (4 - 4 - 3u)(0 - 5 - 1) + 495 - 495 + 21u. 39u Expand -193t4 + 648 - 648 + t4 - 3t + 3t + (-t3 + t3 - 2t3)(0t + t + t) + 3t*4 + 0t*4 - 4t*4 + (-2t + 6t - 3t)(-t2 + t2 - 2t*3). -199t*4 Expand (1516y*2 - 2097y*2 - 2y + 7350y2)(y*2 + 18 - 18). 6769y*4 - 2y*3 Expand (-7d + 2d + 0d)(d - 2d + 0d) + (1 - 16d - 10d + 28d)(3d + 0 + 0). 11d2 + 3d Expand (2 - 1 + 3)(-3 - 9 - 13)(-6v + 4v + v)(-3 + 3 + v4). 100v*5 Expand (-47 - 35 - 77)(-35o + 18o + 34o3 + 17o). -5406o3 Expand (-4n - 4n + 6n + 61n - 13 + 13 + (4n + 3n - 5n)(1 + 3 - 3))(2 + 0 - 4). -122n Expand (-1 - 2 + 12)(-2 - 1 + 8)(-7f + f + f)(1 + 5 - 4). -450f Expand (5 + 0 - 3)(3s + 1 - 1)(-1 - 1 + 1)(-1 - 3 - 8)(-18 - 16 - 28). -4464s Expand 11q2 - 11q*2 + 14q*2 + (-15q - q - 24q)(-5 + q + 5). -26q2 Expand (-2i - 1 + 9 + 0)(0 + 4 - 2)(-2i + i + 0i + 3i - 6i + 4i + (0i - i + 0i)(-2 + 2 - 1) + 3 - 3 + i + (-1 - 1 + 5)(12 - 12 - 24i)). 280i2 - 1120i Expand (-410x4 - 191x*4 - 1055x*4)(2 - 1 - 3). 3312x4 Expand -6n*4 + 0n*4 + 0n*4 - 6n*4 + 2n*4 + 2n*4 + (-2n + n + 4n)(-4n3 - 3 + 3) + 0n4 - n4 + 2n4. -19n*4 Expand (-3r*3 - 4r*3 + 2r*3)(-25 + 11 - 13)(-r + r - 12r). -1620r4 Expand (1 - 423z - 1 - 121z)(14 + 6 - 5). -8160z Expand -2c + c + 3c + (0 + 1 - 2)(-2c - 2c + 3c) + c + 0c + c + 90438 - 90438 + 27c - 3c - c + 0c + 5c - 2c - 2c. 29c Expand (-6 + 6 + 5r*2)((3 - 2r - 3)(4 - 2 - 4) + 1 - 1 + 2r - 178r - 55r - 218r). -2225r3 Expand 21x - 12x3 - 21x - x*5 + (-2x*3 + 0x + 0x)(66x - 66x - 344x2). 687x*5 - 12x*3 Expand (2v - v + 0v)(3 + 2v - 3) + (3v - 3v - 3v)(-74 + 84 + 75)(-4v + 7 - 7)(-4 + 6 - 3). -1018v2 Expand 12i*3 + 6i*3 + 6i*5 - 20i*3 + (2 + 1 - 2)(-i5 - i5 + 3i5) + (0i - 5i + 0i)(-628i*3 + 628i*3 + 10i*4 - 1). -43i*5 - 2i*3 + 5i Expand 141q2 - 216q*2 + 159q*2 + 5q*2 - 6q*2 + 3q*2 + (5q - 5q + 5q)(0q + 0q - 2q). 76q2 Expand (-5w*2 + 3 - 3 + (0w + 2w + 0w)(2w - 1 + 1))(0 - w + 0)(-309w - 139 + 139). -309w*4 Expand (1 - 3 + 3)(-1 + 0 + 0)(-12916j + 6288j + 4420j). 2208j Expand (434b + 408 - 408)(0b2 - b2 + 0b2) - 19b*2 + 33b*2 - 5b*3 - 11b + 13b. -439b*3 + 14b*2 + 2b Expand 2z5 - z5 + z5 + (z4 - 3z*4 + 0z*4)(2z + 0z + z) - 3z5 + 3z5 + z5 + (z*3 - 2z*3 + 0z*3)(59z - 59z + 10z2). -13z*5 Expand (-41h - 185h + 61h)(-2 - 1 + 1) + 5 - 5 - 3h. 327h Expand (4w - 17 + 17)(62w - 538w - 17w). -1972w2 Expand (-38o - 16o + 11o)(94 - 94 + o3)(0o - 3o + o). 86o5 Expand (-17 + 50y + 18 - 29y + 2y - 5y + 2y + y - 3 + 3 + (2y - 1 + 1)(1 + 1 - 1))(2 - 2 + 5)(2y + y - 4y). -115y2 - 5y Expand (-7 + 2 - 4)(2h - h + 0h)(0 + 3h2 + 0) + h3 - 2h*3 + 0h*3. -28h*3 Expand (0 + 1 + 1)(2b - 3b + 2b) + 30 - 14b - 30 + (-2b + 0b + 5b)(-6 + 1 + 11) - 2b + b + 3b + (-3 - 2b + 3)(3 - 5 + 4). 4b Expand 2i*3 + i - i + (-3i*2 + 2i*2 - 2i*2)(-i + 0i + 3i) + 3i3 + 4i*3 - 3i3 - 2 + i3 + 2. i*3 Expand (104m + 184m4 - 104m)(-2 + m + 4 + m + (-1 - 6 + 1)(-2m + 5m + 2m)). -5152m*5 + 368m4 Expand (-a2 - 3a4 + a2)(3 - 3 + 4) + 17a4 - a + a + 0a*4 + 2a*4 + 0a*4. 7a*4 Expand -85 + 88 - 7s + 2s4 + 2s*2 + s + (0 + 0 - 5)(8s2 + 3s*4 - 8s*2). -13s*4 + 2s*2 - 6s + 3 Expand (-2 - 2m + 4 + 0m)(m4 - 3m4 - m4 + (-98 + 98 - 72m)(0m3 - 3m3 + m3)) + 232m3 - 103m*5 - 232m*3. -385m*5 + 282m*4 Expand (9z*2 - 4z*2 + 5z*4 - 7z*4)(801 + 1049 - 1499)(5 - 3 - 1). -702z*4 + 1755z*2 Expand 3l - l + 0l + (-2l + 2l + 2l)(-25 - 50 - 257). -662l Expand ((1 + 2 - 1)(-5 + 3 + 5) + 8 - 2 - 1)(0 + 0 + 1)(i - i + 7i*3)(-3 + 3 - 2i2). -154i*5 Expand (111n*3 - 72n*3 - 88n*3)(55 - 31 - 12 - 3n - 28). 147n*4 + 784n*3 Expand (0y*3 + 0y3 - y3)(-28 - 193 + 61)(208y - 208y - 67y2). -10720y*5 Expand -109f*2 + 355f*2 + 190f2 - f3 + (4 - 4 - 4f2)(2f + 4 - 4) + 0f3 + f3 + 0f3. -8f*3 + 436f*2 Expand b - b + b + (-3b - b + 5b)(-3 + 1 + 4) - 17 + 28 + 222b - 16. 225b - 5 Expand (-1 - 2s + 1)(9s - 6s - 2s + 2) + (0s*2 + 7s*2 - 6s*2)(15 - 9 + 9). 13s2 - 4s Expand (-5v + 5v + 3v)(3 + 2v - 3)(0v2 + 2v2 - v2)(2v + 0 + 0)(1 + 0 + 1) + (-952 + 952 - 49v*2)(-v*3 + 5v3 + v3). -221v5 Expand (0 + 0 + 425004i - 424063i)(-2i2 + 2i2 + i2). 941i3 Expand (4r - 5r + 3r)(-3 + 6 - 2) - 2 + 2 + r + 1544r - 36862 + 36862 + 2r + 1 - 1. 1549r Expand (1 - 1 - 2)(-m + m - 2m*2) + 7m*2 - 2m*2 - 3m*2 + 37m - 13967 - 36m + 13999 + 8m*2. 14m*2 + m + 32 Expand (-1121j + 1121j + 157j*2)((0 - 1 + 0)(-2 + 6 - 3) + 4 + 1 + 0 + (-2 + 1 + 0)(-1 - 1 + 3)). 471j2 Expand (23 - 4m*3 - 23)(6m - 2m - 3m) + (-511m - 503m + 955m)(3m*3 - 1 + 1). -181m*4 Expand (13 - 2 + 8)(-6 + 3 + 1)(2364z - 1690z + 530z). -45752z Expand (-4u*2 + 0u*2 + 2u*2)(7 - 1 - 4)(4u - 188u + 83u). 404u3 Expand (-h4 + 18 - 18)(-h + 3h - 2 - 1) + (2 - 2h*2 - 2)(9h3 - 3h*3 + 2h*3). -18h*5 + 3h*4 Expand (19n*3 + 2n*3 - 45n*3)(n*2 - 4n2 + n2)(-3 - 10 - 7). -960n*5 Expand (-706 + 20o + 706)(0o2 + o2 + 0o2) + 169o - 87o + o3 - 90o. 21o3 - 8o Expand (-g + 6g - 3g + ((-2g + 2g + 2g)(3 - 5 + 3) + 5g + 3g - 6g)(-4 + 12 + 3))(-13g + 7g + 12g). 276g2 Expand (26u + 11u - 9u)(u - 4u - 6u + (-u + 0 + 0)(-3 - 2 + 0)). -112u2 Expand (13 + 14 + 10)(-2y + 86y - 2 + 35y). 4403y - 74 Expand (0c2 + 0c2 - c4)(-1962 + 5884 + 2518c - 1962 - 1960). -2518c5 Expand (3 + 1 - 2)(110u - 55u*2 - 110u) - 31u2 - 7u + 12u - 5u. -141u2 Expand ((2 - 5 + 6)(-22 + 16 + 7) + 1 + 3 - 5)(-1 + 1 - 2u). -4u Expand (14 - a3 - 9 - a3)(172a2 + 127a*2 - 268a*2). -62a*5 + 155a*2 Expand (417 - 241 + 87)(0 + m + 0 + 2m - 4m + 6m + 2m - 2m + m + (-m + m - 2m)(3 + 0 - 4) + (-3m - 4m + 3m)(-4 + 3 + 0)). 3156m Expand 0k2 - 5 - k2 + k + 7 + (-k + 0 + 0)(-2 - 2 + 1)(6 + 4 - 8)(-4k + 3k + 39k). 227k*2 + k + 2 Expand (-4x + 4x - 2x)(-3x*3 + 3x3 + x3) - x*4 + 3x*3 - 3x*3 + (98x*2 + 267x - 267x)(3x2 + 1 - 1). 291x*4 Expand (5 - 3 - 1)(-i*2 + 0i + 0i) + 3i2 - i2 - 3i2 + (-2 - i + 2)(-541i + 845i - 446i + (-4 - i + 4)(1 - 2 + 3)). 142i2 Expand (1 - 2 + 2)(-111 + 276 + 517)(-13o + 9o - 12o). -10912o Expand (-1 - 6 + 5)(-2 + 470y + 310y*2 - 470y). -620y2 + 4 Expand (-23h*2 + 5h*3 + 23h*2)(-259 + 259 - 28h) - 9h*4 - 6 + 6. -149h*4 Expand (383k*2 + 40k*2 + 51k*2)(-k - 2k - 6k). -4266k3 Expand (14g + 17g + 5g)(97g*2 + 2529 - 2529) + 0 + 3g*3 + 0. 3495g*3 Expand (-6i2 - i2 + 4i2 + (-i + 0i - i)(-5i + 0i + 3i))(-1 - i3 + 1) + 6i*5 - 3i5 - i5 - 1593i5 + 29i*5 - 483i*5. -2046i*5 Expand (97 - 8 + 95 + 107)(-u + 5u - 6u + (5u - 3u - u)(-4 + 3 - 2)). -1455u Expand (60 - 60 - 24k)((4 - 3 + 1)(5k + 2k + 3k)(-3 + 0 + 0) + 2 - 2 - k + (-2k + 2k - k)(0 - 3 + 5)). 1512k2 Expand (58 + 107 - 124)(-5 - 1 + 21x + 10x - 7x + 3x). 1107x - 246 Expand (3615q - 11143q2 - 3615q)(2q - 3q - 3q)(-4q + 2q + 3q). 44572q4 Expand 4i*2 - 2i*3 - 4i*2 + (10 - 4 - 20)(4i - 16 + 16)(31i2 + 33i*2 - 50i*2). -786i**3	{ "pile_set_name": "DM Mathematics" }
ctor -549t5 + 547t*5 - 16t*s + 6t*4 - 14t*2 - 18t*3 - 4t. -2t(t + 1)*3(t + 2) Let f = 9486 - 9481. Let b(x) be the third derivative of 1/20xf + 0x*4 - 2/3x*3 + 27x*2 + 0 - 1/120x*6 + 0x. Let b(y) = 0. What is y? -1, 2 Find m, given that 136/5m + 8 - 42/5m*4 + 512/5m*3 - 934/5m*2 = 0. -1/7, 1/3, 2, 10 Let m = -31490 - -31492. Let p(a) be the second derivative of -1/3a*3 - 1/6a*4 - 15a + 0 + 6am. Let p(x) = 0. What is x? -3, 2 Let p be (1/(-15))/(942/(-785)). Let i(x) be the third derivative of 0x*3 + px*4 + 1/180x*5 + 0 + 0x + 12x2. Let i(k) = 0. Calculate k. -4, 0 Let t(b) = -b3 - b2 + 3b - 6. Let w(y) = -4y3 - 1380y*2 + 314664y - 24018014. Let o(l) = 6t(l) - w(l). Factor o(x). -2(x - 229)*3 Let z be 0 - (32 - ((-6)/(-6) - 5)). Let t be 112/(-10)60/z. Factor 43/3l*2 + 56/3l*4 + 1/3 + tl + 16/3l5 + 73/3l3. (l + 1)3(4l + 1)*2/3 Suppose 0 = -19y + 77820 - 77820. Let r(t) be the third derivative of y + 0t4 + 0t*5 + 0t*3 - 34t*2 + 0t - 1/1050t7 + 1/600t6. Factor r(i). -i3(i - 1)/5 Suppose 2/9q*3 - 536/3q - 44q2 - 1616/9 = 0. What is q? -2, 202 Let k(y) = -3y*2 + 73y + 20. Let q be k(25). Let a be (5 - (-156)/q)-2. Solve -6/5l - al3 - 6/5l*2 - 2/5 = 0. -1 Suppose 3p = -0q + 5q + 40, 3p + 64 = -8q. Let b(c) be the first derivative of -35/3c3 - 5 + pc*2 + 0c + 5/4c4. Factor b(z). 5z*2(z - 7) Let y = 261341 - 261341. Factor 3/8j2 + 27/4j + y. 3j(j + 18)/8 Let g(n) be the first derivative of -3n4/16 - 19n*3/2 - 303n*2/8 + 105n - 734. Factor g(m). -3(m - 1)(m + 4)(m + 35)/4 Let t = -749 + 166. Let g = 586 + t. Factor 4h*g - 28/3h*2 + 8/3h + 0. 4h(h - 2)(3h - 1)/3 Let d(k) be the second derivative of -k7/8820 - k6/140 - 17k5/420 - 9k4/4 + k3/6 - k - 5. Let u(s) be the third derivative of d(s). Factor u(b). -2(b + 1)(b + 17)/7 Let j(f) be the second derivative of 2f6/15 - 24f*5/5 + 28f*4 - 160f*3/3 - 2f - 414. Factor j(q). 4q(q - 20)(q - 2)2 Suppose 771n + 1952n = -561n - 2912 + 12764. Let 0 + 22/17u + 6/17u*n - 4u*2 = 0. Calculate u. 0, 1/3, 11 Let x = 1/132564 + 198845/132564. Determine m so that 9/4m*3 + 3/4m*2 - xm - 3/4m5 - 3/4m*4 + 0 = 0. -2, -1, 0, 1 Let c(k) = -6k - 3. Let v be c(-5). Suppose -37 = -4b - 5w, -5b - 3w + 3 = -v. Find h, given that 12h2 + 5h3 + h2 - bh2 - 15h = 0. -3, 0, 1 Let a(u) be the third derivative of -u*6/180 - 7u*5/30 + 8u*4/3 + 115u*3/6 - 53u*2. Let x(d) be the first derivative of a(d). Factor x(p). -2(p - 2)(p + 16) Suppose 96o - 276 = 87o - 60o. Let r(y) be the second derivative of 3 + 0y2 + 2/21y*o + 3/70y*5 - y + 1/21y*3. Suppose r(p) = 0. What is p? -1, -1/3, 0 Let f(w) be the second derivative of -3w*5/40 + 3w*4/8 + 34w*3 + 189w*2 - 3630w. Find h, given that f(h) = 0. -9, -2, 14 Let a(u) be the third derivative of 0 - 98u2 - 18/5u*3 - 7/8u*4 + 0u + 1/100u5. Determine x, given that a(x) = 0. -1, 36 Let k(h) be the first derivative of 15h*4/8 - 41h*3 + 321h*2/4 - 45h + 3335. Factor k(a). 3(a - 15)(a - 1)(5a - 2)/2 Let r(x) = 86x4 + 153x*3 + 90x*2 + 2x + 3. Let p(c) = -343c4 - 617c*3 - 359c*2 - 8c - 11. Let a(o) = 3p(o) + 11r(o). Factor a(y). -y(y + 1)2(83y + 2) Let a(w) be the second derivative of 3w*4/4 + 191w*3/6 + 91w*2 + 2w + 359. Factor a(t). (t + 1)(9t + 182) Let j(v) = -120v3 + 770v*2 + 44830v. Let w(h) = -7h3 + 46h*2 + 2637h. Let b(i) = -2j(i) + 35w(i). Factor b(x). -5x(x - 31)(x + 17) Let q(b) be the third derivative of b6/840 + 3b*5/280 - 5b*4/7 - 11b*3/6 - 271b*2. Let g(d) be the first derivative of q(d). Factor g(c). 3(c - 5)(c + 8)/7 Let b(v) = -26v + 187. Let p be b(6). Determine a so that 0a - 5a - p - 2a2 + 41 - 3a*2 = 0. -2, 1 Suppose -49 = -4b - 9. Factor 2u2 - 2u*2 + 19 - b - 3u*2 + 6u. -3(u - 3)(u + 1) Factor -142/7x3 + 0 - 40/7x + 1424/7x2. -2x(x - 10)(71x - 2)/7 Let t(v) = v3 - 3v*2 - v + 7. Let l be t(3). Factor 5a*2 - 8a*2 + 6a*4 + 0a*4 - a - 3a*3 - 7a*l. -a(a + 1)*3 Find o, given that 35 + 173/6o*2 + 359/6o + 25/6o3 + 1/6o4 = 0. -15, -7, -2, -1 Let q(t) be the first derivative of -t5/5 + 5t4/4 - 8t*3/3 + 2t*2 - 2319. Factor q(k). -k(k - 2)*2(k - 1) Let z be 45/(-63) - 4/((-2128)/779). What is r in 15/2 + zr2 - 33/4r = 0? 1, 10 Let n(f) be the third derivative of -f6/540 - f5/27 + 211f4/108 + 220f*3/27 + 2f*2 - 227f + 2. Determine j, given that n(j) = 0. -20, -1, 11 Let x = -283467 + 283467. Factor 1/3t3 + xt*2 + 0 + 0t. t*3/3 Let s(o) = 9o*3 - 15o*2 + 20o + 12. Let k(n) = 10n3 - 13n*2 + 20n + 12. Suppose 0 = 8i + 49 - 9. Let g(u) = is(u) + 4k(u). Solve g(w) = 0. -2/5, 2, 3 Factor -9a*2 + 1223a - 107a4 + 59a*4 + 57a*4 - 92a*3 - 1131a. a(a - 1)(a + 1)(9a - 92) Factor -126/19t3 + 1978/19t - 332/19 - 2904/19t2. -2(3t - 1)2(7t + 166)/19 Let c(g) be the second derivative of -g9/3024 + g8/1344 - g4/12 + 3g - 3. Let p(y) be the third derivative of c(y). Determine k so that p(k) = 0. 0, 1 Factor -842/13p + 0 - 2/13p*2. -2p(p + 421)/13 Let o = -484 - -487. Let 45k*5 - 40k5 - k4 + 3k3 + 11k*4 + 2ko = 0. What is k? -1, 0 Let t(v) be the third derivative of -v7/210 - v*6/30 + 13v*5/6 - 125v*4/6 + 125v3/2 + v2 + 484v. Factor t(d). -(d - 5)2(d - 1)(d + 15) Let x(i) be the first derivative of -29 - 4i*2 + 52/3i*3 + 2/3i6 + i4 - 32i - 4i*5. Let x(b) = 0. Calculate b. -1, 1, 2, 4 Let z(h) be the second derivative of -2h*6/15 + 380h*5 - 451250h*4 + 857375000h*3/3 - 101813281250h*2 - 3920h. Let z(k) = 0. Calculate k. 475 Let 1/3q2 - 37/3q + 12 = 0. What is q? 1, 36 Factor 20m2 + 9m - m*4 + 6m2 - 162 + m2 - 5m3 + 20m*2 - 8m2. -(m - 3)2(m + 2)(m + 9) Determine b so that 29/3b3 - 88 + 1/3b*4 + 158/3b*2 + 76/3b = 0. -22, -6, -2, 1 Factor -3/2 - 1/6o2 + 5/3o. -(o - 9)(o - 1)/6 Let n be -6 + 11/3(-130)/(-78). Let f(j) be the second derivative of 0j5 + 0 - nj*4 + 9j + 1/45j6 + 1/3j*2 + 0j*3. Factor f(o). 2(o - 1)*2(o + 1)*2/3 Suppose 4w + z = 2w + 2, 0 = -2z + 8. Let m be (-6 - (-78)/12)/(w/(-8)). Factor -11 - 3 + 4 + 12r - m + 2r*2. 2(r - 1)(r + 7) Suppose -k - 3u - 4 = 0, 0u = -5k - 3u + 4. Factor -5q*k - 1 + 15448q + 16 - 15458q. -5(q - 1)(q + 3) Let -50/7v*4 + 0 - 6/7v - 130/7v3 + 58/7v*2 = 0. Calculate v. -3, 0, 1/5 Let d(o) = 4o*2 + 16o - 556. Let t be d(10). Let a(k) be the first derivative of -1/28kt - 16/7k - 4/7k2 + 1/3k*3 - 23. Solve a(b) = 0. -1, 4 Let w be 2 + (-17481)/36 - 2/12. Let c = w + 485. Factor 5/4 + 0f - cf2. -5(f - 1)(f + 1)/4 Suppose 23093/3t*3 - 16224 - 95786/3t*2 + 40352t + 308/3t4 + 1/3t*5 = 0. Calculate t. -156, 1, 2 Let o(t) be the first derivative of 3/4t*4 - 397953t + 55 - 153t3 + 23409/2t*2. Factor o(b). 3(b - 51)*3 Let p(m) = 29m*2 + 7666m + 2933780. Let k(z) = 4z2 + z. Let r(a) = -6k(a) + p(a). Suppose r(h) = 0. Calculate h. -766 Let r be 43/2418(-38)/(-228). Solve 0 + 0c*2 + rc*3 - 3/2c = 0 for c. -1, 0, 1 Determine f, given that -52f + 4/3f*2 - 816 = 0. -12, 51 Let b(j) = 5j*2 - 36j - 62. Let s be b(-17). Let p = s - 1993. Factor 5/4f3 + 25/4 - 25/4f*p - 5/4f. 5(f - 5)(f - 1)(f + 1)/4 Let h(q) = 7q*2 + 294q - 3. Let z(o) = -31o2 - 1176o + 13. Let r(g) = -26h(g) - 6z(g). Solve r(p) = 0. 0, 147 Let b be 0/(6/2) + 3. Suppose -2g - 5w + 16 = 0, 2w = 5g - 3w - 40. Suppose -9k + 16k2 + k - gk - 4kb = 0. Calculate k. 0, 2 Let h(v) be the first derivative of -v5/5 - 13v*4/2 - 232v*3/3 - 432v*2 - 1152v - 6264. Factor h(s). -(s + 4)*2(s + 6)(s + 12) Let d = 354 - 350. Let m be (1 - (11/2 - d))-6. Factor 9/8o4 + 9/8o - 3/8o5 - 3/4o*2 - 3/8 - 3/4o*m. -3(o - 1)*4(o + 1)/8 Determine q, given that 30/11q5 + 628/11q*3 + 174/11q - 236/11q4 + 36/11 - 632/11q*2 = 0. -2/15, 1, 3 Find m such that 23m*2 - 153m + m*2 + 153m + 44768m5 - 44728m*5 + 28	{ "pile_set_name": "DM Mathematics" }
d. What is k(q) + 2x(q)? -3q*3 + 15q Let f(u) = -u*3 + 3u*2 + 3u. Suppose -5a = 2z, 0a = 5z + 2a - 42. Let y(o) = -2o*3 + 5o*2 + 5o. What is zf(m) - 6y(m)? 2m3 Let t(l) = -l3 + 5l*2 + 4l + 3. Let h(x) = -x*3 + 4x*2 + 3x + 3. Suppose -r + 30 = -5a, 5r = 5a + 6r + 20. Give ah(y) + 4t(y). y*3 + y - 3 Let c(j) = -60j + 5. Let a(v) = -122v + 9. Determine -6a(h) + 11c(h). 72h + 1 Let j(k) = 143k3 + 4k*2 + 4k. Let o(g) = -714g3 - 21g*2 - 21g. What is 21j(h) + 4o(h)? 147h3 Let u(j) = 263j + 3. Let w(v) = -3420v - 38. Give -38u(c) - 3w(c). 266c Let a(z) = 2z3 + 17z*2 + 10z + 7. Let y(t) = -t*3 - 9t*2 - 5t - 4. Calculate 6a(d) + 11y(d). d*3 + 3d*2 + 5d - 2 Let d(o) be the first derivative of -7o2/2 - 6o + 769. Let j(f) = f + 1. Determine -d(z) - 3j(z). 4z + 3 Let f(m) = 6m + 20. Let n(j) = -10j - 42. Calculate -13f(a) - 6n(a). -18a - 8 Let r be ((-36)/(-21))/(3/((-21)/2)). Let m(z) = -6z*3 + 8z*2 + 5z + 5. Let y(q) = 7q3 - 9q*2 - 6q - 6. Determine rm(w) - 5y(w). w*3 - 3w*2 Suppose 0 = -5l - 2j - 0 - 8, -12 = 4l + 3j. Suppose 0 = -ly + y. Suppose yp = -p - 1. Let n(i) = -2i - 1. Let x(a) = -a. What is pn(m) + 4x(m)? -2m + 1 Let a(j) = -9j + 8j - 2j*3 - 2j*3 + 5j*3. Let q be (-107)/(-6) + 6/36. Let c(p) = -21p*3 + 18p. Suppose 2t - 4t + 2 = 0. What is qa(w) + tc(w)? -3w3 Let k(g) = -5g*2 - 4g. Let w = 38 - 36. Let y(l) = -l. Let m(s) = s*2 - 3s. Let h(f) = -m(f) + 4y(f). Calculate wh(o) - k(o). 3o2 + 2o Let c(h) = -39h - 21. Let k(f) = -f - 2. Give -2c(q) + 22k(q). 56q - 2 Let j(h) = 11h + 25. Let d(s) = 4s + 7. Determine 7d(a) - 2j(a). 6a - 1 Let n(s) = -3s - 7. Let t be (0/(-5))/4-1. Suppose h - 1 = o, to - 3h - 39 = 4o. Let y(i) = 3i + 8. Give oy(v) - 7n(v). 3v + 1 Let d(b) = -10b2 + 6b - 17. Let m(y) = -9y2 + 4y - 12. Let f(r) = -3d(r) + 4m(r). Let u(c) = 11c2 + 4c - 5. Give -5f(w) - 3u(w). -3w2 - 2w Let i(r) = 2. Let m(d) = -d*2 + 9. Let x(n) = 17n*3 - 2n*2 + n. Let g be x(1). Suppose 0 = -3y - 12, 5y = 5b - 24 - g. Calculate bm(t) - 18i(t). -4t2 Let n = -9 - -11. Let c(l) = -l2 - l2 - 2l - 3 - 2l2 - nl. Suppose -29t + 10t + 57 = 0. Let g(f) = -f*2 - f - 1. Give tg(a) - c(a). a*2 + a Let b(n) = -n - 10. Let w(p) = p - 2. Give b(v) - 4w(v). -5v - 2 Let t(a) = 2. Let n(d) = -3d*3 - 2d*2 - 15. Calculate -n(g) - 6t(g). 3g3 + 2g*2 + 3 Let k(b) = -12b*2 - 13b. Let c(o) = o*2 + o. Let j = 131 + -125. Determine jk(q) + 78c(q). 6q*2 Let m(v) = 0 - 1 + 0 - 2v + v. Let w(g) = -8g - 2. Let x(p) = -8p - 1. Let i(b) = -5w(b) + 4x(b). Give i(f) + 5m(f). 3f + 1 Let v(l) be the first derivative of -l*3 + 7l*2/2 + 4l - 143. Let i(o) = 5 - 5o2 + 11o - 5 + 6. What is -5i(u) + 8v(u)? u*2 + u + 2 Let r(j) = -2j*3 + 5. Let a(p) = 20p*2 + 10 - 20p*2 + 616p*3 - 618p*3 - 4. Determine 5a(m) - 6r(m). 2m*3 Let z(c) = 10c*3 - 6c*2 - 6c. Let v(h) = 3353 - h2 - h + h3 - 3353. Suppose 33w - 31w + 2 = 0. What is wz(d) + 6v(d)? -4d3 Let m(k) = -59k*2 - 8k - 8. Let g(d) = 20d2 + 3d + 3. Suppose -311 = -41r + 17. Give rg(s) + 3m(s). -17s*2 Let c(k) = 5k*2 - 4 + 342k - 342k. Let u(o) = 4o*2 - 4. What is 3c(h) - 4u(h)? -h2 + 4 Let b(d) = -208840d*3 - 460d*2 - 460d + 460. Let l(s) = -1365s3 - 3s*2 - 3s + 3. Give 3b(v) - 460l(v). 1380v3 Let d(s) = -4s*2 - 45s + 42s + 19 - 22. Let b(o) = 20o*2 + 16o + 16. Suppose 3a + 5 = -4, 5x = 3a - 6. Calculate xb(g) - 16d(g). 4g*2 Let u(g) = -3g + 1 - 2g + 0 + 0g. Let s(z) = z. Suppose 120 - 109 = -11a. What is as(y) - u(y)? 4y - 1 Let j(c) = 2c*3 + 4c2 - c + 3. Let w(v) = v2 + 1. Suppose -3f - 12 = 3h - 0, 4f = 2h + 2. Determine fj(g) + 3w(g). -2g3 - g2 + g Let h = -44 - -5. Let r = h - -36. Let f(c) = c2 + 1. Let a(j) = 4j*3 + 3j*2 + 3. Determine rf(p) + a(p). 4p3 Let g(f) = 61f + 7. Let n(z) = -60z - 8. Determine 7g(k) + 6n(k). 67k + 1 Let b(m) = -1 - 64m2 - 69m*2 + 129m*2 - 17m*3 - 3. Let r(n) = 69n*3 + 15n*2 + 15. Determine -15b(t) - 4r(t). -21t*3 Suppose -2q - 4 = -0. Let t(x) = -2. Let m(i) = i - 4i + 0i + i + i + 3. Calculate qm(n) - 3t(n). 2n Let q(y) = y + 4 - 2y + 0y. Let c(x) = 1. Let n(h) = h - 6. Let d be n(8). Suppose 0 = -do - 10. Give oc(r) + q(r). -r - 1 Let i = 19 - 18. Let u = i - -2. Let c(r) = -4 - ur + 5r + 1 - 4r*2 - 5r. Let m(t) = -t*2 - t - 1. Calculate -c(w) + 3m(w). w2 Let g(b) = b3 + 6b2 + 3b + 12. Let h be g(-6). Let f = h + 8. Let l(w) = 9 - 2 - 9. Let n(c) = c - 8. Give fn(k) - 9l(k). 2k + 2 Let y(x) = x2 - x - 17. Let m be y(5). Let p(r) = -9r*2 + 7r + 1. Let v(w) = 5w2 - 4w - 1. What is mp(f) + 5v(f)? -2f2 + f - 2 Let r(a) = a + 7. Let q be r(-11). Let j = -2 - q. Let f(z) = -8z*2 - z + 5. Let h(v) = 4v*2 - 12v*2 + 6v*2 + 1. Determine jf(o) - 9h(o). 2o*2 - 2o + 1 Let u(w) be the first derivative of 3w4/4 + 3w + 1. Let y(c) = 19c2 - 6c*3 - 19c*2 - 1 - 4. Suppose 12 + 3 = 3f. Calculate fu(a) + 3y(a). -3a3 Let k(y) = -2y + 6. Let w(l) = -2l + 1. Calculate k(v) + 3w(v). -8v + 9 Suppose 0 = -20s + 9s + 11. Let f be (0 + -1)/((-1)/4). Let l(t) = 2t3 - 1. Let g(q) = -q3. Give fg(a) + sl(a). -2a3 - 1 Let x(s) = 10s*2 + 9s + 2. Let m(p) = 18p2 + 17p + 4. Determine -6m(n) + 11x(n). 2n2 - 3n - 2 Let p(v) = 10v3 + 7v*2 + 7v - 7. Suppose -4d = g + g + 14, 0 = 2g - 5d + 14. Let w(a) = 7a*3 + 5a*2 + 5a - 5. What is gw(f) + 5p(f)? f*3 Let c(d) = -2d*3 - 7d*2 - 5d - 94. Let j(m) = 3m3 + 11m*2 + 8m + 141. Calculate 8c(w) + 5j(w). -w3 - w2 - 47 Let f(u) = 80u3 + 35. Let o be (2 + -3 + 7)13/26. Suppose o - 38 = z. Let g(y) = 9y3 + 4. Determine zg(k) + 4f(k). 5k*3 Let q(t) = 0t*2 - 4t3 + 4 - t2 + 4t2 - 7. Let c(x) = -4x*3 + 4x*2 - 4. What is -3c(m) + 4q(m)? -4m*3 Let g(y) = -7y*3 + 5y*2 + 6y - 6. Let o = 2274 - 2261. Let a(k) = -14k3 + 11k*2 + 13k - 13. What is og(c) - 6a(c)? -7c3 - c2 Let j(k) = 249k - 9. Let l(n) = 124n - 4. Determine -3j(g) + 7l(g). 121g - 1 Let h(k) = -k + 2. Suppose 5n = -17 - 38. Let g be (6 + n)(1 - 2). Let q(r) = 11. Let t(v) = -v + 11. Let z(f) = gt(f) - 4q(f). What is 22h(m) - 4z(m)? -2m Let q(w) = 278w*2. Let l(n) = 108142n*2. Determine -5l(v) + 1946q(v). 278v*2 Let v(j) = 5j*3 + 5j - 3. Suppose -31r + 15 = -34r. Let s(u) = -8u3 - 7u + 4. Give rs(l) - 7v(l). 5l3 + 1 Let w(y) be the second derivative of -5y4/4 + y2/2 + 12y + 2. Let k(d) = 3d + 0d - 3d - 3d2. Determine -11k(u) + 2w(u). 3u2 + 2 Let k(x) = x2 - x - 1. Let f(m) = 3m3 - 8m*2 + 9m + 8. Calculate -3f(s) - 24k(s). -9s3 - 3s Let s(f) be the third derivative of 5f4/12 - 5f*3/3 - 2f2 - 9. Let p(a) = a2 - a + 1. Determine -10p(m) - s(m). -10m*2 Let y(z) = -z + 2. Let b(u) = -u + 2. Let s(k) = -3b(k) + 2y(k). Let v(o) = -1. Let l = 280 + -279. What is ls(d) + v(d)? d - 3 Let u be (1 - -2)3/9-9. Let h(z) = -z*2 - 2z - 1. Let k(v) = -4 + 4v - 4v - 5v2 - 9v. Give uh(f) + 2k(f). -f*2 + 1 Let l(g) = 31g*3 - 2g*2 + 27. Let d(i) = 16i3 - i2 + 12. Give -9d(k) + 4l(k). -20k3 + k2 Let w(u) be the third derivative of -u4/6 - 4u*3 + 69u*2. Let p(m) = -2. What is 24p(b) - 2w(b)? 8b Let y(q) = 3q3 - 10q*2 + 1. Let d(c) = -3c*3 + 10c*2 - 1. What is -3d(a) - 4y(a)? -3a*3 + 10a*2 - 1 Let u(s) = -4s*3 - 3s - 3. Let w(h) = -9h3 - 7h - 7. Let a = -141 - -148. What is au(d) - 3w(d)? -d*3 Let v(p) = -12p*2 + 10p - 1. Let g be v(1). Let w(z) = -17z2. Let x(n) = 6n*2. Give gw(m) - 8x(m). 3m*2 Let a(m) = 5m + 28. Let r(q) = -4q - 31. Give 3a(o) + 2r(o). 7o + 22 Suppose -3m + 6 = -6m. Let o(c) = 2c - 2. Let s(t) = -6t + 7. Determine ms(r) - 7o(r). -2r Let z(j) = -j3 + 10j2 + 27. Let u(p) = p3 - 9p2 - 28. Determine -7u(x) - 6z(x). -x3 + 3x2 + 34 Let p(m) = -m2. Let c(d) = 16d3 + 6d*2 - 3d. Determine c(i) + 6p(i). 16i*3 - 3i Let	{ "pile_set_name": "DM Mathematics" }
hout replacement from oohoooohhoo? 56/165 Two letters picked without replacement from {w: 3, s: 2, e: 1, u: 10, b: 1}. What is prob of picking 1 u and 1 w? 15/68 Four letters picked without replacement from {u: 12, e: 1, f: 6}. What is prob of picking 1 u, 2 f, and 1 e? 15/323 Three letters picked without replacement from gggggygyggggggy. Give prob of picking 3 g. 44/91 Four letters picked without replacement from {i: 4, a: 1, e: 5, b: 1, u: 2, z: 2}. What is prob of picking 1 z, 1 u, and 2 e? 8/273 Four letters picked without replacement from {h: 2, x: 1, k: 4, i: 4, o: 3}. Give prob of picking 3 i and 1 h. 8/1001 What is prob of picking 1 o, 1 b, and 1 c when three letters picked without replacement from {t: 1, c: 1, b: 2, l: 1, o: 1, m: 1}? 2/35 Four letters picked without replacement from {w: 7, b: 6}. Give prob of picking 3 b and 1 w. 28/143 What is prob of picking 4 o when four letters picked without replacement from {o: 9}? 1 Three letters picked without replacement from {z: 1, i: 3, w: 6, n: 1, x: 4}. Give prob of picking 3 w. 4/91 What is prob of picking 2 a when two letters picked without replacement from {y: 1, a: 4, z: 2}? 2/7 Three letters picked without replacement from {u: 1, j: 5, b: 1, p: 3, c: 2, d: 1}. Give prob of picking 1 c, 1 p, and 1 j. 15/143 What is prob of picking 2 i when two letters picked without replacement from hhhhvihihhvhh? 1/78 Calculate prob of picking 1 n and 1 u when two letters picked without replacement from uqnqnnuqq. 1/6 Four letters picked without replacement from wwbwwbbwbbbbwwwwwwbb. What is prob of picking 2 w and 2 b? 132/323 Four letters picked without replacement from lbllbtllbbtblbllbl. Give prob of picking 2 l and 2 t. 1/85 Three letters picked without replacement from {s: 2, r: 1, t: 2, z: 2, g: 1}. Give prob of picking 1 t, 1 s, and 1 r. 1/14 What is prob of picking 1 f, 2 w, and 1 z when four letters picked without replacement from {w: 4, l: 7, z: 5, f: 3}? 15/646 What is prob of picking 1 g and 2 y when three letters picked without replacement from {s: 2, p: 3, i: 1, g: 2, y: 4}? 3/55 Two letters picked without replacement from {z: 4, g: 2}. What is prob of picking 2 g? 1/15 Calculate prob of picking 1 o, 2 w, and 1 u when four letters picked without replacement from {w: 5, o: 1, f: 3, n: 3, u: 4, z: 1}. 2/119 Three letters picked without replacement from zjpzizziziijzjzb. What is prob of picking 1 j, 1 p, and 1 i? 3/140 What is prob of picking 1 l and 2 a when three letters picked without replacement from {a: 7, l: 4}? 28/55 Two letters picked without replacement from ttvvttvmnttuy. What is prob of picking 2 t? 5/26 Three letters picked without replacement from tttzztztzt. What is prob of picking 3 t? 1/6 Four letters picked without replacement from {l: 4}. What is prob of picking 4 l? 1 Three letters picked without replacement from {z: 2, s: 4, j: 4}. Give prob of picking 1 s and 2 j. 1/5 Two letters picked without replacement from {a: 3, q: 5}. Give prob of picking 1 q and 1 a. 15/28 What is prob of picking 2 l when two letters picked without replacement from ulzrclzzrgzlzrlrr? 3/68 What is prob of picking 2 u and 2 m when four letters picked without replacement from zuumzuummmu? 2/11 Two letters picked without replacement from {w: 7, a: 2, h: 3}. Give prob of picking 2 a. 1/66 Calculate prob of picking 2 e and 1 g when three letters picked without replacement from geiiegkkigikgki. 4/455 Calculate prob of picking 2 t when two letters picked without replacement from {u: 3, h: 6, t: 6}. 1/7 What is prob of picking 1 o and 3 s when four letters picked without replacement from ddsopdsppssppnopbd? 2/765 Four letters picked without replacement from {l: 4, u: 7}. What is prob of picking 1 u and 3 l? 14/165 Calculate prob of picking 3 l when three letters picked without replacement from {l: 3, f: 3, i: 2, w: 1, d: 1, k: 8}. 1/816 What is prob of picking 1 n, 1 r, and 1 w when three letters picked without replacement from wwnarnwwxaawe? 5/143 What is prob of picking 3 n when three letters picked without replacement from ononnno? 4/35 Three letters picked without replacement from nssnhnnhhscchsh. Give prob of picking 1 c, 1 s, and 1 n. 32/455 Three letters picked without replacement from otottti. Give prob of picking 1 o, 1 t, and 1 i. 8/35 What is prob of picking 2 d when two letters picked without replacement from {d: 4, o: 16}? 3/95 Calculate prob of picking 3 w when three letters picked without replacement from jjjwjjjjwjjjwwjdw. 1/68 Two letters picked without replacement from {e: 1, w: 2, k: 2, y: 1}. Give prob of picking 1 y and 1 w. 2/15 Four letters picked without replacement from dddsds. What is prob of picking 4 d? 1/15 What is prob of picking 2 e and 1 z when three letters picked without replacement from {e: 7, o: 4, z: 5}? 3/16 Calculate prob of picking 2 p, 1 d, and 1 i when four letters picked without replacement from ruuipkpuipipdurppp. 7/340 Calculate prob of picking 1 z and 1 q when two letters picked without replacement from cziiq. 1/10 Calculate prob of picking 1 y, 1 q, and 1 c when three letters picked without replacement from {j: 1, c: 1, q: 1, y: 2, v: 1, z: 1}. 2/35 Three letters picked without replacement from {q: 3, d: 1, l: 4}. What is prob of picking 2 l and 1 d? 3/28 Four letters picked without replacement from ygoyumummoomoumm. Give prob of picking 1 y, 2 m, and 1 u. 9/182 Calculate prob of picking 3 j when three letters picked without replacement from juuujuuuujuuijuuuiju. 1/114 What is prob of picking 1 l and 1 g when two letters picked without replacement from lggllgglllgllllllll? 70/171 What is prob of picking 1 w and 3 c when four letters picked without replacement from {q: 1, c: 2, w: 4, y: 7, f: 3}? 0 Calculate prob of picking 3 z when three letters picked without replacement from zazdzziiaagdzzzzdi. 7/102 What is prob of picking 1 y and 1 p when two letters picked without replacement from {y: 1, p: 2, g: 2}? 1/5 What is prob of picking 1 g and 1 x when two letters picked without replacement from axsaaaaagaaaxaaggaa? 2/57 Three letters picked without replacement from {z: 2, e: 1, m: 2}. Give prob of picking 1 e and 2 z. 1/10 What is prob of picking 1 a and 1 z when two letters picked without replacement from {a: 10, z: 2}? 10/33 Three letters picked without replacement from {x: 2, a: 4, g: 3, c: 2}. What is prob of picking 1 a and 2 g? 4/55 Three letters picked without replacement from {q: 5, j: 3, d: 2}. Give prob of picking 1 j and 2 q. 1/4 What is prob of picking 1 g and 2 b when three letters picked without replacement from {x: 1, g: 3, j: 1, v: 6, u: 3, b: 4}? 3/136 What is prob of picking 2 u and 1 i when three letters picked without replacement from usuiuiumt? 1/7 What is prob of picking 3 m when three letters picked without replacement from {d: 1, m: 14}? 4/5 Two letters picked without replacement from jqnnnnfjnnnbnnnjfnn. What is prob of picking 1 q and 1 b? 1/171 Calculate prob of picking 1 x and 1 z when two letters picked without replacement from {m: 1, z: 1, w: 1, u: 2, h: 1, x: 2}. 1/14 What is prob of picking 2 p when two letters picked without replacement from {f: 5, p: 5}? 2/9 Two letters picked without replacement from {x: 4, s: 2, a: 5}. What is prob of picking 1 x and 1 s? 8/55 Calculate prob of picking 2 q when two letters picked without replacement from {q: 2, j: 3}. 1/10 Three letters picked without replacement from {m: 3, i: 2, p: 2, g: 1, e: 2, b: 10}. What is prob of picking 1 m and 2 b? 9/76 What is prob of picking 1 d and 1 z when two letters picked without replacement from dddzzz? 3/5 Three letters picked without replacement from xppxxdx. What is prob of picking 2 p and 1 d? 1/35 What is prob of picking 4 o when four letters picked without replacement from ovooooovxovvyovyvv? 7/306 What is prob of picking 1 i and 2 r when three letters picked without replacement from ssuuxururxrruxsrsxis? 1/114 What is prob of picking 1 t and 1 v when two letters picked without replacement from {w: 3, v: 5, k: 3, t: 2}? 5/39 Calculate prob of picking 1 k, 1 l, and 1 s when three letters picked without replacement from {l: 4, s: 2, k: 5}. 8/33 What is prob of picking 3 i when three letters picked without replacement from {t: 2, i: 7, z: 6}? 1/	{ "pile_set_name": "DM Mathematics" }
2 + 138o. Factor q(l). -2(l - 1)(l + 1)(13l + 2) Let f be 4/35(-1725)/(-230). Let fj*3 + 0 - 10/7j*4 + 4/7j*2 + 0j = 0. Calculate j. -2/5, 0, 1 Let i(c) be the first derivative of c*6/6 - 43c*5/20 + 133c*4/16 - 7c*3/3 - 34c*2 - 16c + 64. Factor i(n). (n - 4)*3(n + 1)(4n + 1)/4 Let 13/4o2 + 3 - 13/4o*3 + 13o - o4 = 0. Calculate o. -3, -2, -1/4, 2 Let c(d) be the third derivative of -d6/600 + d*5/60 + 17d*4/120 - 7d*3/10 + 334d*2. Factor c(s). -(s - 7)(s - 1)(s + 3)/5 Let a(d) be the third derivative of -d7/126 - d6/6 - d5 - 2d*2 - 5d. Factor a(b). -5b2(b + 6)*2/3 Let r(u) be the first derivative of -2/21u*3 - 23 + 2/7u*2 + 0u - 3/14u4. Factor r(z). -2z(z + 1)(3z - 2)/7 Let u = -226 - -304. Let m be 82/26 + (-6 - (-456)/u). Factor -32/5c*2 + 96/5c + 12/5c4 - 64/5 - 16/5c*m - 2/5c*5. -2(c - 2)*4(c + 2)/5 Suppose -5h - 2u = -23, -6 = -2h + u - 5u. Suppose -4k + r = -hk + 7, -k + 4r = 13. What is a in ak + 0 - a + 1/2a*2 - 1/2a4 = 0? -1, 0, 1, 2 Let k(c) be the second derivative of -c5/25 + 7c4/5 + 128c + 2. Factor k(v). -4v2(v - 21)/5 Let q be 4 - -1 - 1049/210. Let o(r) be the third derivative of 0r + 2/21r*3 - 4r*2 + 1/28r*4 + 0 + qr*5. Factor o(c). 2(c + 1)(c + 2)/7 Let w(p) = -4p*4 + 24p*3 - 116p*2 - 8p - 16. Let r(s) = -s4 - s2 - s - 2. Let g(k) = -8r(k) + w(k). Factor g(n). 4n*2(n - 3)(n + 9) Determine h, given that -24/7h - 3/7h4 + 12/7 + 9/7h*2 + 6/7h*3 = 0. -2, 1, 2 Let m be -22 + 20 - (-7 + 1). Let a(y) be the second derivative of -my + 0 - 1/60y6 + 1/24y*4 - 1/20y*5 + 0y*2 + 1/6y*3. What is j in a(j) = 0? -2, -1, 0, 1 Let c(o) = -3o*2 - 18o - 18. Let s(h) = -3h2 - 17h - 18. Let i(w) = -4c(w) + 3s(w). Find x, given that i(x) = 0. -6, -1 Let j be ((-2)/(-3))/((-532)/147 + 4) + -1. Determine f so that -jf2 + 3f - 3 = 0. 2 Let u(z) = -17z2 - 35z - 11. Let h(v) = -84v2 - 174v - 54. Suppose 0 = -4r - 2r + 84. Let c(j) = ru(j) - 3h(j). Determine q, given that c(q) = 0. -2, -2/7 Suppose 0q = 21q - 84. Solve -423kq + 0 + 421k4 + 0 - k5 = 0. -2, 0 Let l be 15/12 - 276/240. Let m(i) be the second derivative of 1/6i4 + 0 + 7i + 1/3i3 - i2 - li*5. Factor m(b). -2(b - 1)*2(b + 1) Factor 4/3x2 + 0 - 140/3x. 4x(x - 35)/3 Suppose 6 = -2g, -229x + g + 11 = -225x. Factor 50/13 + 2/13b*x + 20/13b. 2(b + 5)2/13 Let n(i) be the second derivative of 1/2i*2 + 0 + 1/24i*4 + 8i - 1/4i3. Solve n(k) = 0 for k. 1, 2 Let n(w) be the first derivative of -4w*3/9 + 46w*2/3 - 120w - 376. Determine g, given that n(g) = 0. 5, 18 Let y(m) be the third derivative of -m5/20 + m4/8 + m*3/3 - 6m*2. Let o(b) = 48b*2 - 48b - 33. Let p(r) = -2o(r) - 33y(r). Factor p(i). 3i(i - 1) Let a(z) be the first derivative of z*4/10 - 78z*3/5 + 231z*2/5 - 46z + 118. Factor a(n). 2(n - 115)(n - 1)2/5 Let d(y) be the second derivative of y5/18 + 47y4/54 + 5y*3/9 - 3y*2 + 254y. Let d(j) = 0. Calculate j. -9, -1, 3/5 Let c(t) be the first derivative of -4/9t3 + 0t + 1/3t4 + 4/15t*5 + 9 - 2/3t*2. Factor c(k). 4k(k - 1)(k + 1)*2/3 Let j(s) be the second derivative of 4/3s*4 + 10/3s*3 - 3/5s*5 + 0 + 14s - 4s2. Factor j(z). -4(z - 2)(z + 1)(3z - 1) Suppose 0 = 58h + 18h. Find m, given that 6/7m*3 + 4/7m*2 + h - 2/7m = 0. -1, 0, 1/3 Suppose -150 = -40b + 34b. Suppose -38q - b = -43q. Determine r, given that -4/5r4 + 0 + 0r - 2r3 + 4/5r*2 + 2r*q = 0. -1, 0, 2/5, 1 Let m = -259456094/57157695 - 2068/56313. Let h = -2/435 - m. Factor 2y*2 + 8/7 + hy. 2(y + 2)(7y + 2)/7 Let a(l) = -l - 9. Let m be a(-9). Let b(x) be the second derivative of m + 1/54x*4 + 5x + 2/27x3 + 1/9x*2. Find o such that b(o) = 0. -1 Factor 6g*2 + 17/2g + 3. (3g + 2)(4g + 3)/2 Determine z so that 2/13z*2 - 54/13z - 2/13 + 54/13z3 = 0. -1, -1/27, 1 Suppose 2z - 4 = -18. Let p be (1/(12/(-9)))/(z/28). Factor 1/5l + 0 - 1/5l*p - 1/5l*2 + 1/5l*4. l(l - 1)*2(l + 1)/5 Let s be (-30)/(-135) - 82/6(-4)/24. Suppose 0 + 5r - 15/2r2 - sr*5 + 15/2r*4 - 5/2r3 = 0. What is r? -1, 0, 1, 2 Let u(m) be the second derivative of m4/48 + 47m3/12 + 2209m*2/8 - 174m. Solve u(s) = 0 for s. -47 Let r = 39 - 30. Factor ry2 + y3 - 2 - 4y - 7y2 + 3y. (y - 1)(y + 1)(y + 2) Suppose 0 = 6z + 428 + 1756. Let g be (z/21)/13 + (3 - 1). Factor -2n - gn2 + 0. -2n(n + 3)/3 Let c(a) be the third derivative of 1/12a*3 + 0a - 1/480a6 + 3a*2 + 1/80a*5 + 5/96a*4 - 1/840a*7 + 0. Find o, given that c(o) = 0. -1, 2 Let n(p) = -3p - 36. Let i be n(-8). Let b be 210/(-60)i/7. Factor 3q + bq2 + 3/4q*4 + 15/4q*3 + 0. 3q(q + 1)(q + 2)*2/4 Let m(c) be the first derivative of -5c*4/4 - 25c*3 + 85c*2 + 584. Factor m(p). -5p(p - 2)(p + 17) Let v be (-84)/(-17) - 25(-28)/(-175). Factor -2/17s*3 + v + 8/17s - 4/17s2. -2(s - 2)(s + 2)2/17 What is r in 378r + 10r3 - 8r*3 + 1800r - 132r2 = 0? 0, 33 Let l = -1/4291 - -34337/38619. Factor -lq*2 - 2/9q*3 - 8/9q + 0. -2q(q + 2)2/9 Let z(f) be the third derivative of f5/270 + f*4/9 - 45f*2. Suppose z(d) = 0. Calculate d. -12, 0 Let n(i) be the first derivative of -5/4i*4 + 11 - 5i + 5/3i3 + 5/2i*2. What is l in n(l) = 0? -1, 1 Let x(l) be the second derivative of 0 + 0l*2 + 4/45l*5 + 19l + 2/189l7 + 0l*3 - 8/135l*6 + 0l*4. Factor x(q). 4q*3(q - 2)*2/9 Determine p so that 3p*2 + 1/2p*4 + 5/2p*3 + 0p + 0 = 0. -3, -2, 0 Suppose -4f + 3f = 8. Let o be f/(-6) - 10/(-60). Suppose 0n - on*2 + 0 - 3/2n*3 = 0. Calculate n. -1, 0 Let z = 2085 + -2082. Let k(p) be the second derivative of 0 + 0p*z - 2/3p*4 + 0p*2 - 11p - 2/15p6 + 3/5p*5. Find f such that k(f) = 0. 0, 1, 2 Let b be (-22)/(-8) + (-1)/(-4 - 0). Let g be (-1)/(-5)(b - 1). Factor 0j - g + 2/5j*2. 2(j - 1)(j + 1)/5 Suppose -3d = -11 - 4. Let 29x5 + 25x*2 + 64xd - x2 - 159x3 - 90x*4 + 12x - 12x5 = 0. Calculate x. -1, -2/9, 0, 1/3, 2 Let r = 61 - 41. Let l be 4/5r/8. Factor -3hl - 15/2h*3 + 3 + 15/2h. -3(h - 1)(h + 1)(5h + 2)/2 Let r(v) = -v5 + v4 - v*2. Let w(b) = -2b*5 + 14b*4 - 12b*3 - 22b*2 + 16b. Let c = 30 - 31. Let f(k) = cw(k) + 6r(k). Factor f(i). -4i(i - 1)*2(i + 2)*2 Suppose 0 = -13f + 55 + 10. Suppose -20b3 + 2b*4 - 3b*2 + 12b*3 - fb*4 + 2b = 0. What is b? -2, -1, 0, 1/3 Let q(w) be the second derivative of 1/8w3 - 1/48w*4 + 0w*2 + w + 0. Suppose q(c) = 0. What is c? 0, 3 Factor 46n*2 - 1 + 457n - 14n3 - 254n + 9 + 3n3 - 255n. -(n - 2)*2(11n - 2) Suppose 4 = -13c + 14c. Suppose -cu = -5u. Determine r, given that u - 1/5r*2 - 1/5r = 0. -1, 0 Let g(r) be the second derivative of -r7/5040 - r6/720 + 11r3/3 + 11r. Let d(h) be the second derivative of g(h). Let d(t) = 0. What is t? -3, 0 Let h(t) be the first derivative of 2t6/3 - 32t*5/5 + 13t*4 + 88t*3/3 - 64t*2 - 128t + 886. Suppose h(c) = 0. What is c? -1, 2, 4 Let v = -357 - -1799/5. Let i = 18/5 - v. Solve -ig2 - 121/5g*4 + 0 + 44/5g*3 + 0g = 0. 0, 2/11 Let l(g) be the third derivative of 0g + 0 - 1/315g*7 - 1/90g*6 - 11g*2 + 1/9g*3 + 0g*5 + 1/18g4. Solve l(i) = 0 for i. -1, 1 Let n(x) be the second derivative of x7/42 + 11x6/15 - 5x*5 + 26x*4/3 + 42x + 3. Find r, given that n(r) = 0. -26, 0, 2 Let t(k) be the first derivative of -k*6/3 - 6k5/5 - k4 + 65. Factor t(q). -2q3(q + 1)(q + 2) Let s = 644 - 639. Let z(v) be the second derivative of -2/9v*3 - 1/45v*6 + 0v*2 - 1/5v*s + 2/63v*7 + 7/18v*4 + 0 - v. Suppose z(j) = 0. What is j? -2, 0, 1/2, 1 Let l = -149 - -153. Let g(y) be the first derivative of 8/21y*3 - 3/7y*4 + 0y + 0y2 - l. Determine h, given that g(h) = 0. 0, 2/3 Let j(k) be the first derivative of 3k5/40 - k4/2 - k*3/4 + 3k*2 + 17k - 17. Let l(q) be the first derivative of j(q). Factor l(z). 3(z - 4)(z - 1)(z + 1)/2 Suppose -3v + 82 = 7. Suppose -4h + v + 63 = 0. Suppose 8c + 4c - 10c + 70c3 - 50c*4 - hc**	{ "pile_set_name": "DM Mathematics" }
rivative of 485576932av - 12447a + 2417 wrt v? 485576932a Find the third derivative of -166398694c3 + 371c*2 - 16c + 166. -998392164 Find the third derivative of 4594109u5 + 7u*3 + 5u*2 + 2683970u + 2 wrt u. 275646540u2 + 42 Find the third derivative of -87i*6 - 228784i*3 - 973256574i*2. -10440i*3 - 1372704 What is the third derivative of 17q*4 + 198538q*3 - 1290517q*2 wrt q? 408q + 1191228 What is the second derivative of 671404101hl*2 - 3609599hl + 37h wrt l? 1342808202h Find the third derivative of -747824cq3 - 11396cq2 + 41c + 39q4 + 26q*2 wrt q. -4486944c + 936q Differentiate -116690qw + 272q + 241w + 167016 with respect to w. -116690q + 241 What is the derivative of 138746355kv*3 + 2kv2 + 2kv + 2654984v*3 - 49v wrt k? 138746355v3 + 2v*2 + 2v What is the second derivative of -16a2fo + 94059a*2f - a*2o - a*2 + 3ao + 772a - 2fo - 10f - 24 wrt a? -32fo + 188118f - 2o - 2 What is the second derivative of -1043j*5 + 5575j3 + j2 + 133752990j wrt j? -20860j*3 + 33450j + 2 Find the second derivative of -10521198v2 - 127712861v wrt v. -21042396 Find the third derivative of 3495424c2k3 + c2k2 + 58c*2 - ck3 - k3 + 3k2 + 42 wrt k. 20972544c*2 - 6c - 6 What is the second derivative of 6303537r2 + 262r - 3251 wrt r? 12607074 What is the second derivative of -k*4v*2 + 4397837k*2v*3 - 8kv3 + 2kv2 - kv - v*3 - 30139 wrt k? -12k*2v*2 + 8795674v*3 Find the second derivative of 334732nv3 + 34nv2 + 9366700nv wrt v. 2008392nv + 68n Find the first derivative of -2005573r2 + 7r + 11524785 wrt r. -4011146r + 7 What is the third derivative of 4fv4 - 2fv3 + 27043fv2 + 740f - 2343v4 + 109v*3 wrt v? 96fv - 12f - 56232v + 654 Find the third derivative of -84719523j*4 - 2j*3x + 22j2x + 2j2 - 8jx - j - 2039x - 9 wrt j. -2033268552j - 12x What is the first derivative of 218b4 - 2b*3 + 184366b + 176835787 wrt b? 872b3 - 6b*2 + 184366 What is the third derivative of 17231704g*2z*3 + 3g*2z*2 + 36g*2z - 468064gz*2 + 2z*3 wrt z? 103390224g*2 + 12 What is the second derivative of -346868233c*5 - 94796050c wrt c? -6937364660c3 Differentiate 181i*2m + 8609i2 + 16349im - 5m - 808 wrt m. 181i2 + 16349i - 5 Find the third derivative of -7l5 + 63004l*4 + 13893042l*2 wrt l. -420l*2 + 1512096l What is the second derivative of -59637760g2 - 254893g wrt g? -119275520 Find the third derivative of 61cpt3u - 4cpt2 - 78ct3u - 2c + 337pt2u - 2pt + 3pu - p + 268t3u wrt t. 366cpu - 468cu + 1608u Find the third derivative of 2c4p - 467342c4 + 2c*2p - cp + 4615255c - 2p wrt c. 48cp - 11216208c Find the second derivative of u*3x*2 - 2u*3 + 2u*2x + 46218u2 - 12775959ux3 - 65 wrt x. 2u*3 - 76655754ux What is the first derivative of -2706495g*2 + 3g + 16190629 wrt g? -5412990g + 3 Find the third derivative of -268043955j*3 - 93841640j*2. -1608263730 What is the second derivative of -2655157b*2 - 5569b + 18 wrt b? -5310314 What is the third derivative of -1186576n2y*3 + 2345n*2y*2 - 1377ny2 - 18y*3 wrt y? -7119456n*2 - 108 Find the first derivative of 85550203v - 95741104 wrt v. 85550203 What is the first derivative of 12785618l3 + 24446525 wrt l? 38356854l*2 Find the second derivative of -1160u*4 + 4551u3 - u2 - u + 34695514. -13920u2 + 27306u - 2 What is the first derivative of -549296494k - 19913054 wrt k? -549296494 What is the derivative of 14lm - 7309626l + 44288m wrt m? 14l + 44288 What is the second derivative of 17479295v4 - 29092018v? 209751540v2 Differentiate 3301294x + 11989920. 3301294 What is the second derivative of -8cop3 + cop2 + cop - 196co + 142cp - 61944op2 wrt p? -48cop + 2co - 123888o Differentiate -kz*4 + 98715091kz2 + 122305513k with respect to z. -4kz*3 + 197430182kz What is the derivative of -37943087g*2 + 61005335 wrt g? -75886174g Find the second derivative of -37149944y3 + 5y*2 - 480308709y wrt y. -222899664y + 10 What is the third derivative of 121234657a*5 + 69555115a*2? 7274079420a*2 What is the third derivative of 116349182m3 + m2 - 43m - 25566? 698095092 Differentiate 3377647a*4v*2 - 7201095v*2 wrt a. 13510588a*3v*2 Differentiate 585556669j*3 - 1394286373 wrt j. 1756670007j*2 What is the derivative of 4lo3v - 5lo + 27o3v - 15o3 + 7091o*2 - ov + 10776v wrt v? 4lo3 + 27o*3 - o + 10776 What is the second derivative of -87b*2t*2 - 10747b*2t - 57858bt*2 + 1022bt - 2t*2 wrt t? -174b*2 - 115716b - 4 Find the third derivative of -213t4 + 6934t*3 - 257t*2 - 2t + 1039. -5112t + 41604 Find the third derivative of -90x*5 + 310458x*3 + 10954392x*2. -5400x*2 + 1862748 Find the second derivative of 93179441s*2 - 8s - 1470939 wrt s. 186358882 Find the second derivative of -102711979i2 - 331181i - 179 wrt i. -205423958 Find the second derivative of -245611636sv*4 - 83s + 131v + 4751 wrt v. -2947339632sv2 Find the first derivative of 5jy2 + 17375jy + 588828495j - 6y2 - 119y wrt y. 10jy + 17375j - 12y - 119 What is the third derivative of -16514904g3n6 + g3n2 + 7g*3n + 126g2 - 196gn2 wrt n? -1981788480g*3n*3 Find the third derivative of -1739z*6 - 1804z*4 - 3519z*2 + 2416z + 1. -208680z3 - 43296z Find the third derivative of 47851r4 - 2681r*2 - 922. 1148424r What is the second derivative of 117b3s*2 + 127302b*3 + 1846b*2s*2 - 155b*2s + 8s2 wrt s? 234b*3 + 3692b2 + 16 What is the second derivative of -o2z2 - 9o*2z - 2o2 + 2o - 4z3 - 65856z*2 - 4z + 26105 wrt z? -2o2 - 24z - 131712 Find the third derivative of -4323b4f + 2b4 + b3f - 74b3 + 2757b*2f + 983f wrt b. -103752bf + 48b + 6f - 444 What is the third derivative of 141977962t*3 + 10t*2 - 546664 wrt t? 851867772 What is the first derivative of 304809933ay2 - 14y*2 + 957y - 350 wrt a? 304809933y2 Find the second derivative of -11805713hn2 - hn - 11630786h wrt n. -23611426h What is the second derivative of -247w3 + 914962w*2 + 706364897w? -1482w + 1829924 Find the third derivative of 10536265f*3 + 15936095f*2 wrt f. 63217590 Differentiate -7937125z - 2630489. -7937125 Differentiate -7x2 + 2790565x - 11029892 wrt x. -14x + 2790565 What is the derivative of -1779oqt*2 + 5939oq + 2o + 40772qt*2 + 795qt wrt o? -1779qt2 + 5939q + 2 Find the third derivative of 195513401f4 - f3 - 291f*2 + 23f - 20 wrt f. 4692321624f - 6 What is the second derivative of -6387y*3z*3 + 686y*3z - 402y3 + 2y*2z + 1824yz*3 wrt z? -38322y*3z + 10944yz What is the third derivative of 1181042949j4 - 2722774j*2 + 93j? 28345030776j Differentiate 98728k*3nu + 418k*3n + 22k3 + k2u - 5k2 + 8k + nu + 3u - 69 with respect to n. 98728k3u + 418k3 + u Differentiate -3gs - 67736779g + 12902678s2 wrt s. -3g + 25805356s Find the third derivative of -4b*2m*3u*2 - 2b*2mu2 + 2b*2m + 47b2u*2 + 4b*2u - 2bm*2u - 1286bu*3 + 17889250m*3u*3 wrt m. -24b*2u*2 + 107335500u*3 Find the second derivative of 9591d*2f*5 - 462d*2f*3 + 26186228d*2 - 3df + 3 wrt f. 191820d*2f*3 - 2772d*2f What is the first derivative of 14359k2m - 8331245k2 + 80m*2 wrt m? 14359k*2 + 160m What is the second derivative of 65w4 - 2122w*3 + 5w*2 - 2237764w - 2 wrt w? 780w2 - 12732w + 10 What is the third derivative of 21116a3y*2 + 404a*3 - 22a*2y + 657833y2 wrt a? 126696y2 + 2424 Find the second derivative of -i3s - 15i*3 + 54147i*2 - 4642i + 118s - 3 wrt i. -6is - 90i + 108294 What is the third derivative of -15921087r3 + 89991211r2? -95526522 Find the second derivative of -f4 - f*3 - 1477124f*2 + 9056f + 14314. -12f2 - 6f - 2954248 What is the third derivative of -16202gm*3 + 17g*m + 199	{ "pile_set_name": "DM Mathematics" }
= 0. -63, -3, -1/3 Let j = 189 - -4. Find y such that -100y2 + 432y - 404y3 - 40y*5 - 131y - jy - 276y*4 + 40 = 0. -5, -1, -2/5, 1/2 Let z be 11/(-121)0 + (-3)/(-12). Let n(g) be the second derivative of 27/2g2 + 0 + 3g*3 + 5g + zg4. Solve n(p) = 0 for p. -3 Factor -18/5g + 33/5g2 - 3. 3(g - 1)(11g + 5)/5 Determine l, given that -4/3 - 44l3 - 524/3l + 527/3l2 = 0. -1/132, 2 Let n(d) be the second derivative of -3d*4 - 2d*3 - 2 - 1/5d*6 + 0d*2 + 11d - 9/14d7 + 81/20d*5. Let n(s) = 0. Calculate s. -2, -2/9, 0, 1 Suppose -1726 + 921 = 45w - 895. Suppose 0f - 3/5f*4 + 0 + 0f*3 + 3/5f*w = 0. What is f? -1, 0, 1 Let o(a) be the second derivative of 1/11a*3 + 1/22a*4 - 63a + 0a2 + 0. Solve o(z) = 0. -1, 0 Let y(b) be the first derivative of -187 - 28/11b - 13/11b2 + 2/33b*3. Factor y(k). 2(k - 14)(k + 1)/11 Factor 59/2r + 1/2r4 - 27/2r*2 - 3/2r*3 - 15. (r - 6)(r - 1)*2(r + 5)/2 Let p(t) be the third derivative of -245t2 + 0t*4 - 1/60t*6 + 1/168t*8 - 1/35t*7 + 0t*3 + 0 + 1/10t*5 + 0t. Factor p(a). 2a2(a - 3)(a - 1)(a + 1) Let m(v) be the first derivative of v*3/18 - 2v*2 - 26v/3 + 4632. Factor m(h). (h - 26)(h + 2)/6 Let n be ((-159710)/(-55) - 5)/(9/(-6)). Let q = -1928 - n. Determine w so that 2/11w*4 + 90/11w*2 - 26/11w*3 - 500/11 + qw = 0. -2, 5 Let l(j) be the first derivative of j*4/18 - 4j*3 + 260j*2/3 - 6800j/9 + 2228. Factor l(g). 2(g - 34)(g - 10)*2/9 Let s = 1445 - -303. Suppose -8 = -1752f + sf. Factor 3/2p + 0 + 21/4pf. 3p(7p + 2)/4 Let d = -335657 - -335657. Solve -34/7q4 + 34/7q*2 + 8/7q - 8/7q5 + 0 + dq*3 = 0 for q. -4, -1, -1/4, 0, 1 Factor -9/4s + 0 - 1/4s4 + 9/4s*2 + 1/4s*3. -s(s - 3)(s - 1)(s + 3)/4 Suppose 0c + 2c = -5y - 256, 4c = -4y - 200. Let g = y + 55. Solve s4 + 12 + 11s*3 - 12 - 14s*g = 0. 0, 3 Suppose 13p - 15 = 8p. Let -2 + 10 - 4k*p + 21k + 16k2 - 41k = 0. Calculate k. 1, 2 Suppose c + 16 = -4v, -4879v = -4880v + 3c + 48. Solve 0z - 2/3z*3 - 4/3z*2 + v = 0. -2, 0 Suppose 0 = 16s + 2s - 55494. Solve 5i*5 - 8i*2 + 7i*5 + 16i*4 - si*3 + 3063i3 = 0 for i. -2, -1/3, 0, 1 Let p(q) be the second derivative of -q4/24 - 487q3/12 - 363q*2 + 4303q. Let p(t) = 0. Calculate t. -484, -3 What is n in -336235n4 + 92n*2 - 94n + 36n3 - 106n + 96 + 4n5 + 336207n4 = 0? -2, 1, 3, 4 Let z(a) = -a3 + 10a2 - 2a - 9. Let b be z(2). Let j(t) be the first derivative of -16/9t3 - 4/3t - 10/3t2 + b. Determine s, given that j(s) = 0. -1, -1/4 Let b(t) = -3t*3 + 32t*2 - 75t - 10. Let u be b(7). Determine y so that -4/5y2 + 8/5y*u + 0 - 2/5y*3 + 0y + 6/5y5 = 0. -1, 0, 2/3 Suppose -2y - 3i + 67 = 16, -3i - 96 = -5y. Let u(q) be the second derivative of 1/5q*3 - 1/30q*4 + yq + 0 - 2/5q2. Factor u(l). -2(l - 2)(l - 1)/5 Let y = 131647/70 + -5642/3. Let k(t) be the second derivative of 1/30t*3 + 0 + 0t*6 + 0t*2 + 0t*4 - 1/50t*5 + yt*7 + 18t. Solve k(v) = 0 for v. -1, 0, 1 Let c be ((-18)/7)/((-2200)/(-35) + -65). Factor 1/5 + 9/5m2 - 4/5m*3 - cm. -(m - 1)*2(4m - 1)/5 Let 35/3u - 1/3u4 + 4 + 3u*3 + 11u*2 = 0. What is u? -1, 12 Let z be 5/(-6) + (-26631)/54 + -5. Let w = z - -2498/5. What is a in 0a*4 + 0a*2 + 0a + wa5 + 0 - 12/5a*3 = 0? -2, 0, 2 Let m be 625/3600 - ((-32)/36 - -1). Let o(z) be the first derivative of -mz*2 + 1/8z - 1/24z3 + 1/32z4 + 7. Factor o(n). (n - 1)2(n + 1)/8 Let s(w) be the third derivative of 2w*7/105 - 3379w*6/180 + 94865w*5/18 + 33088w*4/3 + 8836w*3 - 235w*2 - 16. Suppose s(g) = 0. What is g? -1/2, -1/3, 282 Suppose v - 33 = -3t, -t - 34 = -4v + t. Factor v + 9z + 3/2z2. 3(z + 2)(z + 4)/2 Let q = -3 + 3. Suppose q = p - 2p + 2. Factor 5u3 + 7u*3 - 5u4 + u4 - 8up. -4u*2(u - 2)(u - 1) Suppose 387 = 15r + 357. Suppose 156a + 9a*r + 332 - 3a*4 + 72a*2 + 6a*3 - 248 = 0. Calculate a. -2, -1, 7 Let y(l) be the third derivative of -7/15l*3 + 0 + 2l*2 - 2/15l*4 - 1/150l*5 + 48l. Factor y(g). -2(g + 1)(g + 7)/5 Let r(c) be the first derivative of -c3/15 - c2/2 + 66c/5 + 1399. Factor r(d). -(d - 6)(d + 11)/5 What is p in 160 - 16/3p - 2/3p*2 = 0? -20, 12 Let j(i) = -2i*3 + 377i*2 + 188i + 193. Let t be j(189). Factor -7 + tm2 - 5/2m - 1/2m3. -(m - 7)(m - 2)(m + 1)/2 Let c be -1 + (66 - (2 - 0)). Suppose -125l*3 - 5l*4 + 10l*2 + 0l*4 + cl*3 + 67l*3 = 0. What is l? -1, 0, 2 Let z = -478 - -10886/23. Let m = z + 455/92. Suppose 1/4y - my4 + 0 - 3/8y*3 + 3/8y*2 = 0. Calculate y. -2, -1/2, 0, 1 Let m(d) be the third derivative of 0d - 1/8d4 - 2 + 1/60d*5 - 21d*2 - 3d*3. Suppose m(v) = 0. What is v? -3, 6 Let l(s) be the first derivative of 240s + 27s3 + 3/20s*5 + 98 - 114s*2 - 51/16s*4. Let l(p) = 0. What is p? 4, 5 Let t(w) be the first derivative of 0w - 26/7w3 - 3/28w*4 - 507/14w*2 + 9. Factor t(m). -3m(m + 13)2/7 Let f(m) be the third derivative of 0 + 2m*3 + 1/20m*5 + m - 1/2m*4 + 9m*2. Factor f(c). 3(c - 2)*2 Let b be ((-13)/(-10))/((-234)/(-30)). Factor -1/2l + 2/3 - bl2. -(l - 1)(l + 4)/6 Let p(d) be the third derivative of -d*5/60 - 23d*4/24 + 13d*3 - 1695d*2 + 1. Factor p(b). -(b - 3)(b + 26) Let t(g) be the first derivative of 2g3/9 + 40g*2 + 2400g + 3857. Suppose t(b) = 0. What is b? -60 Let y = 85 + 6. Factor -13 + 5 + 2h2 - yh + 91h. 2(h - 2)(h + 2) Let n = 834 - 828. Let b be ((-3)/5)/(((-621)/n)/23). Determine s so that -2/3s*2 + 4/15 - bs - 4/15s3 = 0. -2, -1, 1/2 Let u(f) be the third derivative of -28f*2 + 1/9f*3 - 2/315f*7 + 0 + 1/15f*5 + 1/360f*6 + 0f - 11/72f4. Solve u(i) = 0. -2, 1/4, 1 Let s(z) = -3z*3 + 8z*2 - 13z + 6. Let m = -68 - -35. Let v(o) = -16o3 + 41o*2 - 66o + 30. Let r(d) = ms(d) + 6v(d). Solve r(b) = 0. 1, 2, 3 Let u(r) = r*3 - 242r*2 - 4. Let h(x) = -8x*3 + 1936x*2 + 34. Let j(s) = -6h(s) - 51u(s). Let j(t) = 0. Calculate t. 0, 242 Determine t so that 0 + 27t + 3/4t3 + 15t*2 = 0. -18, -2, 0 Let k be 1/3(-198)/(-6). Suppose 14 = -4y + ky. Solve -2/23z + 2/23z*y - 4/23 = 0 for z. -1, 2 Let p be (2586/(-15))/((-17)/(-85)). Let j = -4302/5 - p. Factor jb + 1/5b2 + 16/5. (b + 4)2/5 Let b(a) = -7a*2 - 100a - 750. Let d(q) = -3q2 - 56q - 375. Let x(u) = 2b(u) - 5d(u). Let x(o) = 0. Calculate o. -75, -5 Let h(r) be the second derivative of -r*4/3 + 140r*3 - 22050r*2 - r - 1886. Factor h(c). -4(c - 105)*2 Suppose -9y + 6y - 2c + 185 = 0, -3y + 186 = 3c. Let -3h2 + 27h2 + h3 + 100h + 11 - 5h*3 + y = 0. Calculate h. -2, -1, 9 Let a = 772 + -761. Factor -au*2 - 10u*2 + 0u + 19u2 - 10u + 100. -2(u - 5)(u + 10) Let b(o) be the first derivative of -o6/240 - o5/40 - o4/32 + o3/12 + o*2/4 - 64o - 23. Let g(y) be the first derivative of b(y). Factor g(c). -(c - 1)(c + 1)(c + 2)*2/8 Let p(j) be the second derivative of 2j - 1/25j5 + 4/5j*3 + 36/5j*2 + 3 + 1/75j*6 - 11/30j*4. Factor p(r). 2(r - 3)*2(r + 2)2/5 Let x(y) be the third derivative of -y5/210 - 71y4/28 - 212y*3/21 + 3y*2 - 50y - 4. Factor x(s). -2(s + 1)(s + 212)/7 Let k(h) = 4h2 - 3h*2 + 1 + 3h*3 - 2h*3. Let c(o) = -8o*3 + 6o*3 - 6 - 20o - 18o2 + 29o. Let d(b) = c(b) + 6k(b). Factor d(l). l(2l - 3)2 Let -31a*4 - 553a + 35a4 - 7a - 588 + 72a2 + 48a*3 = 0. Calculate a. -7, -1, 3 Let g be -21 + (-494)/(-26) + (-3)/(9/(-8)). Factor -g + 1/6t*2 - 1/2t. (t - 4)(t + 1)/6 Let v(q) = 6q*2 - 1066q - 140. Let f(c) = c*2 - 213c - 30. Let u(d) = 14f(d) - 3v(d). Solve u(w) = 0. 0, 54 Let o = -742226 + 742230. Suppose 2/3z5 - 16/3z*3 + 14/3z + 0z4 + 4z*2 - o = 0. What is z? -3, -1, 1, 2 Let m = -2/107 + 328/6099. Let u(j) be the second derivative of 0j*2 + 18j + 0 + mj3 + 5/114j*4. Factor u(l). 2l(5l + 2)/19 Suppose 86f - 208688 = -8566. Suppose 11b - f = -2283. Factor 8/3j + 34/3j*3 + 37/3j*2 + 3jb - 4/3. (j + 1)2(j + 2)(9j - 2)/3 Determine h so that -716/7h**4 - 43	{ "pile_set_name": "DM Mathematics" }
- x*3 - 30 - 4x*3 + 30 wrt x. -30x + 42 Suppose 6j - 41 = 25. What is the first derivative of -jw*2 + 8 - 615w + 615w wrt w? -22w Let r(n) be the third derivative of -n7/35 + n5/3 - 27n2. Find the third derivative of r(y) wrt y. -144y Let j(q) = -3q2. Let c(s) = 208s*2 - 214s. Let b(k) = -c(k) - 4j(k). Find the second derivative of b(v) wrt v. -392 Let z(i) be the first derivative of 334i6/3 + i2/2 - 585i - 287. Find the second derivative of z(b) wrt b. 13360b*3 Let g(d) = 919d*4 - 4d + 809. Let v(n) = 1837n4 - 7n + 1617. Let s(c) = 7g(c) - 4v(c). What is the first derivative of s(z) wrt z? -3660z3 Let j(a) be the second derivative of 68a7/21 + a6/30 + 29a4/12 + 124a. What is the third derivative of j(d) wrt d? 8160d2 + 24d Let z(c) be the third derivative of 33 + 1/24c4 - 1/2c*3 + 0c - 7/60c5 + 2c*2. Differentiate z(l) with respect to l. -14l + 1 Find the first derivative of -3 + 12 - 14 - 7 - 18 - 301v wrt v. -301 Let h(p) be the first derivative of 6p7/7 - p4/2 + 74p3/3 + 153. Find the third derivative of h(m) wrt m. 720m*3 - 12 Let w(z) = 46z*3 - 5z*2 + 9z - 72. Let r(d) = -133d3 + 13d*2 - 26d + 216. Let b(q) = -6r(q) - 17w(q). What is the second derivative of b(o) wrt o? 96o + 14 Let f be (-6)/(15/(-10)1). What is the second derivative of -6bf - 7b + 3b4 - 6b*4 - 6b wrt b? -108b2 Find the third derivative of -3d*3 + 3d*2 + 27d*4 + 2d*3 - 16d*2 + 4d*2 + 4 + 136d*4 wrt d. 3912d - 6 Let c = -5 + 56. Let q be (-6)/(-211). Find the second derivative of ci + 0i*3 - 53i - 12i5 + 0i*q wrt i. -240i*3 Find the third derivative of 101d*2 + 9d*3 + 109030 - 109030 wrt d. 54 Suppose -3f - f = -44. What is the second derivative of 4r + 13r*4 + 11r*3 - fr*3 wrt r? 156r*2 Let y(t) = 41t*3 - 3t*2 - 3t + 28. Let s(n) = -40n3 + 2n*2 + 2n - 27. Let b(i) = 3s(i) + 2y(i). Differentiate b(v) with respect to v. -114v2 Suppose s = -0o + 3o + 16, o + 3 = 0. Let y = s + -5. Find the third derivative of -7n*4 + 12n*4 - 5n*y + 3n*2 wrt n. 120n Let h(g) be the first derivative of 112g3/3 - g2/2 - 45g - 107. What is the second derivative of h(r) wrt r? 224 Let z be 675/(-30)((-2)/10 + -1). Differentiate 31l*3 - 27l*3 + 19 + zl*3 + 7 with respect to l. 93l*2 Suppose 0 = 4l - 5d + 6, l + 6d - 5 = 4d. Let i be (-3 - -9) + 0 + -2. Find the first derivative of -1 - 6 - 8y*2 + l - iy*2 wrt y. -24y Let j be (-3)/(66/(-7)) + 174/957. Let v(z) be the second derivative of 0 + 7z + 0z*4 + jz*2 + 0z*3 + 1/2z*5. Find the first derivative of v(f) wrt f. 30f*2 What is the second derivative of 274w*3 - 31w*4 + 0w - 274w3 - 2 - 6w wrt w? -372w2 Let q be (6/2)/((-9)/(-12)). Find the first derivative of -q + 13f - 14f - 5 wrt f. -1 Let g(y) be the second derivative of 79y*5/20 - 89y*2/2 - 41y - 2. Differentiate g(h) wrt h. 237h2 Let z be ((-2)/(-4))/((-3)/(-24)). Let p(f) = f + 10. Let c be p(-5). Find the third derivative of -o2 + o4 + 2o*2 + 2o*4 - co*z wrt o. -48o Let k(y) = y*3 + 5y*2 - 3y + 7. Let n be k(-5). What is the derivative of -344 + 8p4 + np*4 + 337 wrt p? 120p*3 Let f(c) be the second derivative of -59c*4/4 + 17c*3/2 + 2c*2 + c + 42. Find the second derivative of f(r) wrt r. -354 Suppose 2l + 8 = -0l - 4w, -2w = -4l + 14. Differentiate -4r - 5 + l - 3 wrt r. -4 Let r be (-2)/4-8 + (2 - 4). What is the second derivative of 2vr + 2 - 3v*2 + 14v + v*2 + 48v*3 wrt v? 288v Let q(o) be the third derivative of 11o8/112 - o7/105 + 8o*4/3 + 155o*2. Find the second derivative of q(m) wrt m. 660m*3 - 24m*2 Let z = -10 - -12. Differentiate -29 + 4g*2 - 14g*z - 37g + 37g wrt g. -20g Suppose -7c + 5c + 9 = y, -5y = 5c - 35. Suppose 0 = -yq - u + 104, -2u = -10 + 2. What is the derivative of -p*2 + 0p*2 - 19 + q wrt p? -2p Let z(v) be the third derivative of -v*7/210 + 49v*6/60 - 43v*3/2 + 382v*2. What is the first derivative of z(a) wrt a? -4a*3 + 294a*2 Let v(o) = 71o*3 - 6o*2 + 6o + 17. Let g(n) = 142n3 - 13n*2 + 13n + 32. Let k(a) = -6g(a) + 13v(a). Find the first derivative of k(d) wrt d. 213d2 Let a be (-90)/1868/(-10). Find the third derivative of -12t2 + 39t5 + t2 - at5 wrt t. 300t2 Let h(o) be the second derivative of o4/6 + 3o3/2 + 171o*2 + 215o + 1. What is the derivative of h(v) wrt v? 4v + 9 Let s(t) = -t - 6. Let x be s(-9). Let b(i) be the second derivative of 0 + 2/3i*x - 3i - i*2. Find the first derivative of b(p) wrt p. 4 Suppose 2m - 20 = -4v, 4m - m = 4v. What is the third derivative of -vs*2 + 3s*2 - 7s*2 + 7s*4 - 4s*2 wrt s? 168s What is the first derivative of -94d4 - 18 + 7 - 28 wrt d? -376d*3 Suppose 118 - 2218 = -7a. What is the third derivative of -300 - 13s5 + a + s2 wrt s? -780s*2 Let b(g) = -2g - 14. Let s be b(-8). Let n(f) be the first derivative of -7f + 2f5 + 2 - f5 - 2f2 + sf*2. Differentiate n(c) wrt c. 20c3 Let i(s) be the second derivative of -s6/3 - 2s5/5 + s4/6 - 119s*2/2 - 116s. What is the third derivative of i(n) wrt n? -240n - 48 Let h = 39 - 37. What is the second derivative of 3t + 3t - ht*4 + 10t*4 + 0t wrt t? 96t2 Let x(u) = -u3 + 9u*2 + 2u - 15. Let m be x(9). Find the second derivative of -49s - m + 30s*3 + 52s - 3s2 + 3s*2 wrt s. 180s Let i be 10/1122/20. Find the first derivative of 3 + 17 - 2 + ih3 wrt h. 36h*2 Let o be (-3)/(6/(-4)) - -12. What is the first derivative of 11d*2 - 17 + od*2 - 7d*2 wrt d? 36d Let f be (-10)/(-5) + -2 + -1. Let i(m) = -m - 1. Let b(v) = 5v2 - 17v - 4. Let t(a) = fb(a) + 4i(a). Find the second derivative of t(o) wrt o. -10 Let j(v) be the first derivative of v*5/5 - 4v*3/3 - 12v + 4. Let n(f) be the first derivative of j(f). Find the second derivative of n(a) wrt a. 24a Find the second derivative of 3o*5 + 12o*2 + 3o*2 - 160 - o + 9o*2 - 3o*2 wrt o. 60o*3 + 42 Let g(v) = 12v*3 - 3v*2 - 2v + 10. Let y(n) = 34n3 - 8n*2 - 5n + 29. Let t(o) = 8g(o) - 3y(o). Find the second derivative of t(m) wrt m. -36m Let k(f) be the second derivative of 23f*7/21 - 7f*4/12 - 2f - 96. What is the third derivative of k(b) wrt b? 2760b2 Let v(o) be the third derivative of 17o*5/6 + 5o*4/8 - 3o*2 + 6o. What is the second derivative of v(b) wrt b? 340 Let w(x) be the third derivative of -419x5/60 - 31x4/24 + x3 - 4x2 - 33x. Find the second derivative of w(h) wrt h. -838 Suppose -6m + 17 = -19. What is the third derivative of 5y*m - 87y*4 + 87y*4 + 10y*2 wrt y? 600y*3 Find the third derivative of 2000g*2 - 2032g*2 + 148g*3 - 54g*3 wrt g. 564 Suppose 3p = 9, 2 = -4t - p - 3. Let i be 1 + (t - -2 - -2). Differentiate 0 - i - 3z + 5z with respect to z. 2 Let v(z) be the first derivative of -508z*5/5 - 601z*2/2 + 601. Find the second derivative of v(m) wrt m. -6096m*2 What is the third derivative of 3u*6 + 66u*3 - 30u*3 + 10u*6 - 38u*3 + 99u*2 wrt u? 1560u*3 - 12 Let r(b) be the first derivative of -565b*4/4 - 205b*3 - 265. Find the third derivative of r(u) wrt u. -3390 Let d(m) be the third derivative of 64m*7/105 - 25m*3/6 - 2m*2 + 9. Find the first derivative of d(p) wrt p. 512p3 Let y(a) = a3 - 5a2 + 10a - 4. Let i be y(4). What is the second derivative of 19w - 22 - iw*5 + 9 + 13 wrt w? -400w*3 Suppose 2 = 2b - 4b. Let d be (b - 1)/(6/(-15)). What is the second derivative of -5x + dx2 - 2x*2 + 5x + x wrt x? 6 Let l(p) be the third derivative of -41p4/24 + 7p*3/2 - 22p*2. Let w(q) = 20q - 11. Let d(f) = 2l(f) + 5w(f). Find the first derivative of d(t) wrt t. 18 Suppose v - 2v + 4y = -25, -15 = 3y. Find the first derivative of -v - 6 - 2 - 5 + 22z*4 wrt z. 88z*3 Let l(a) be the second derivative of 107a*5/10 - 25a3/2 + a2 + 104a + 1. Find the second derivative of l(b) wrt b. 1284b Let w(m) be the first derivative of -m8/280 + m6/40 + 7m*3/3 + 2. Let q(s) be the third derivative of w(s). Find the third derivat	{ "pile_set_name": "DM Mathematics" }
7? 1079026 What is next in 2062327, 4124690, 6187057, 8249428, 10311803, 12374182? 14436565 What comes next: 8240, 16196, 24154, 32114, 40076, 48040? 56006 What comes next: 70, -71, -740, -2207, -4742? -8615 What is next in 234382, 937514, 2109394, 3750022? 5859398 What is the next term in -18517, -37462, -56407, -75352, -94297, -113242? -132187 What is the next term in 1096750, 2193514, 3290276, 4387036, 5483794, 6580550, 7677304? 8774056 What is the next term in 3713, 14922, 33617, 59798, 93465, 134618? 183257 What comes next: 1677, 6440, 14271, 25170? 39137 What comes next: -56432104, -56432107, -56432110, -56432113, -56432116, -56432119? -56432122 What is the next term in 28575049, 57150098, 85725147, 114300196, 142875245? 171450294 What is next in 5092340, 5092384, 5092428, 5092472, 5092516? 5092560 What is next in -27, -1, 185, 651, 1517, 2903? 4929 What is the next term in -632, -342, 482, 2116, 4836, 8918, 14638? 22272 What comes next: 878247, 3513033, 7904367, 14052255, 21956703, 31617717, 43035303? 56209467 What comes next: 26499, 53324, 80477, 107958? 135767 What comes next: -10639, -47301, -109989, -198703? -313443 What is next in -101035, -202032, -302989, -403906, -504783, -605620? -706417 What comes next: -51563, -107574, -163585? -219596 What is the next term in 4882, 9854, 14816, 19774, 24734, 29702, 34684? 39686 What comes next: 536775, 537757, 539401, 541713, 544699, 548365, 552717, 557761? 563503 What is next in 100842, 100752, 100516, 100056, 99294, 98152, 96552, 94416? 91666 What is next in -35128, -35645, -36162, -36679, -37196, -37713? -38230 What comes next: 12890, 24667, 36444, 48221? 59998 What is next in 27946963, 27946976, 27946999, 27947038, 27947099, 27947188, 27947311, 27947474? 27947683 What is next in 498154, 498169, 498184, 498199? 498214 What is the next term in 81965, 162982, 243999, 325016, 406033? 487050 What is the next term in -13485, 27078, 94673, 189294, 310935? 459590 What is the next term in 1438181, 1438181, 1438193, 1438229, 1438301, 1438421, 1438601? 1438853 What comes next: -1631, -3314, -6119, -10046, -15095, -21266, -28559? -36974 What is next in 298332065, 298332064, 298332063, 298332062, 298332061? 298332060 What is next in 1606989, 3213888, 4820775, 6427644, 8034489, 9641304, 11248083? 12854820 What comes next: 1067, 2038, 3009? 3980 What comes next: 1133, 5637, 15181, 31439, 56085, 90793? 137237 What is the next term in 23421, 46867, 70309, 93747, 117181, 140611, 164037? 187459 What is the next term in 4618, 4499, 4070, 3175, 1658, -637, -3866? -8185 What comes next: -74959, -149956, -224995, -300076, -375199, -450364, -525571? -600820 What comes next: -15737, -62953, -141641, -251801? -393433 What comes next: -12775, -13734, -16329, -21376, -29691, -42090, -59389? -82404 What comes next: 1296, 5116, 11508, 20490, 32080, 46296, 63156? 82678 What is the next term in 178993, 178791, 178477, 178057, 177537, 176923, 176221? 175437 What is next in -2805, -10719, -23889, -42303, -65949, -94815? -128889 What is the next term in -143257, -286185, -429113, -572041, -714969, -857897? -1000825 What comes next: 22623, 90426, 203411, 361578, 564927, 813458, 1107171? 1446066 What is the next term in -672622, -672617, -672612? -672607 What is next in -272104, -544478, -817150, -1090114, -1363364, -1636894, -1910698? -2184770 What is the next term in -6117, -26159, -62599, -117921, -194609, -295147, -422019, -577709? -764701 What is next in -1844, -4384, -8630, -14594, -22288, -31724, -42914, -55870? -70604 What is the next term in 5791051, 5791043, 5791035, 5791027, 5791019, 5791011? 5791003 What is next in 29692, 62469, 95246, 128023, 160800, 193577? 226354 What comes next: 70873, 70872, 70863, 70840, 70797, 70728, 70627? 70488 What is the next term in 53605076, 107210152, 160815228, 214420304? 268025380 What comes next: 50610, 101167, 151632, 201963, 252118? 302055 What is the next term in 4718859, 9437721, 14156581, 18875439, 23594295? 28313149 What is next in 419, 476, 47, -868? -2269 What comes next: 82810, 82575, 82340, 82105? 81870 What is the next term in -1822082, -7288325, -16398726, -29153285? -45552002 What comes next: 31403763, 62807527, 94211291, 125615055, 157018819? 188422583 What is the next term in -200645, -206944, -213241, -219536, -225829? -232120 What is the next term in 17023788, 17023756, 17023702, 17023626, 17023528? 17023408 What is the next term in 5983246, 11966497, 17949748, 23932999, 29916250, 35899501? 41882752 What comes next: -3825609, -7651216, -11476823? -15302430 What is next in -2337482, -2337489, -2337496, -2337503? -2337510 What comes next: -18549, -47953, -77357, -106761, -136165? -165569 What is next in 1449, 2901, 4369, 5859, 7377, 8929, 10521, 12159? 13849 What is next in -18011, -72084, -162205, -288374, -450591? -648856 What is the next term in 2225, 8951, 20181, 35915, 56153? 80895 What is the next term in -307, -822, -1633, -2824, -4479, -6682? -9517 What is the next term in -10373, -83939, -283755, -672947, -1314641, -2271963, -3608039, -5385995? -7668957 What comes next: 25232623, 25232631, 25232653, 25232695, 25232763, 25232863, 25233001? 25233183 What comes next: -272638445, -272638442, -272638439, -272638436? -272638433 What comes next: 9069, 7458, 5847, 4236, 2625, 1014? -597 What is next in -3686305, -3686325, -3686359, -3686407, -3686469, -3686545, -3686635? -3686739 What is next in 21965392, 21965378, 21965356, 21965326, 21965288, 21965242, 21965188? 21965126 What is next in -95121, -95173, -95265, -95403, -95593? -95841 What comes next: -45906, -183740, -413452, -735036, -1148486, -1653796, -2250960, -2939972? -3720826 What comes next: 51377, 103962, 156547, 209132? 261717 What comes next: 190711, 381275, 571553, 761401, 950675, 1139231? 1326925 What is the next term in 5715, 11406, 17073, 22716? 28335 What is the next term in 784, -6, -1390, -3422, -6156, -9646, -13946, -19110? -25192 What is the next term in -69295729, -69295725, -69295721, -69295717, -69295713? -69295709 What comes next: 771926, 771927, 771902, 771839, 771726? 771551 What comes next: 3685, 4202, 5585, 8266, 12677, 19250, 28417, 40610? 56261 What comes next: 3512, 14032, 31558, 56090, 87628, 126172? 171722 What is the next term in 46561, 46618, 46713, 46846? 47017 What is next in 22621, 93040, 210391, 374662, 585841, 843916, 1148875, 1500706? 1899397 What comes next: 61, 159, 277, 397, 501, 571, 589? 537 What is next in -12872878, -51491500, -115855868, -205965982? -321821842 What is the next term in 14906, 14905, 14894, 14879, 14866? 14861 What is the next term in 11711, 9846, 7981, 6116, 4251? 2386 What is next in 310587, 310619, 310651? 310683 What is next in 29541, 29505, 29469, 29433? 29397 What is the next term in 417725, 417716, 417707? 417698 What is the next term in 9560677, 9560680, 9560683, 9560686, 9560689? 9560692 What is next in -5735340, -11470652, -17205964, -22941276? -28676588 What is the next term in -594, -4197, -13648, -31761, -61350, -105229, -166212, -247113? -350746 What is the next term in 194224864, 388449726, 582674588, 776899450? 971124312 What is the next term in -246809831, -246809825, -246809817, -246809807, -246809795? -246809781 What is the next term in -36880, -42661, -48456, -54271, -60112? -65985 What is next in -3541, -4411, -5281? -6151 What comes next: 1039, 2095, 3113, 4093, 5035? 5939 What comes next: 39708, 158639, 356788, 634155, 990740? 1426543 What is next in 57048, 226602, 509192, 904818, 1413480, 2035178? 2769912 What is the next term in 555419, 1110842, 1666265? 2221688 What comes next: 4818, 9678, 14556, 19452, 24366? 29298 What is the next term in 2494, 1941, 1026, -245, -1866, -3831, -6134, -8769? -11730 What is the next term in 125598, 251199, 376798, 502395, 627990, 753583? 879174 What is next in -4173, -8957, -14361, -20385? -27029 What is next in 20903, 21148, 21401, 21668, 21955, 22268, 22613? 22996 What is the next term in -34810, -46409, -58008, -69607, -81206, -92805? -104404 What is the next term in -398, -826, -1300, -1850, -2506? -3298 What is next in -2540, -3746, -4900, -6002, -7052? -8050 What is the next term in 4552, 18126, 40800, 72616, 113616, 163842, 223336? 292140 What comes next: 1021, 1146, 1347, 1624?	{ "pile_set_name": "DM Mathematics" }
smallest value? (a) -2 (b) 98/2409 (c) 0 (d) -2/5 (e) -4 (f) 2 (g) -21 f What is the second smallest value in 942/83, 5, 11/1619? 5 What is the biggest value in -0.2, 4.6, -1, 1/32, -3, -0.67? 4.6 Which is the second biggest value? (a) -3 (b) -2056.6 (c) 0.053 a What is the biggest value in 883, 3/4, -5/4, 2.323? 883 What is the third smallest value in -14, 0, 225365? 225365 Which is the fifth smallest value? (a) -2/15 (b) 3/5 (c) 0.06 (d) 0.5 (e) -551 (f) 4 (g) -4 d What is the second biggest value in -5, 59, 699173? 59 What is the second smallest value in -5, -1/4, -3/5, 2, -110.2, -0.9? -5 What is the third smallest value in 3/4, -769, 4.1, -5/9? 3/4 Which is the second biggest value? (a) -20 (b) -272195 (c) 18 a Which is the second biggest value? (a) 2/7 (b) 0.4 (c) -17 (d) 4 (e) -3 (f) 1/41 b Which is the fourth smallest value? (a) -0.2 (b) -6 (c) -13330 (d) 0.4 (e) -40 a Which is the third biggest value? (a) 4816 (b) -0.3 (c) -0.0392 b What is the third biggest value in -0.067, -120, 2, -291/8? -291/8 Which is the third smallest value? (a) -2 (b) 1 (c) -0.1 (d) 2 (e) -6/7 (f) 334 c What is the sixth smallest value in -28, 4/7, -4, -183/7, -0.1, 28/3, 5? 5 What is the third biggest value in 5, -0.5, -4/11, 2/17, 0.3, 922? 0.3 Which is the third biggest value? (a) -0.5 (b) 0.174 (c) 4 (d) -7.282 (e) -1/3 e Which is the fourth smallest value? (a) -15/4 (b) -7524.4 (c) 2/3 (d) 2 (e) 3/5 c Which is the second smallest value? (a) -25 (b) 2 (c) 7 (d) -13797 a What is the fifth smallest value in 3018, -0.0842, 4, -2/7, -1/8? 3018 Which is the third smallest value? (a) 0 (b) 0.4 (c) -2/57 (d) -15 (e) 34/7 (f) -0.3 (g) 2 c What is the second smallest value in 5/3, 308528, -2? 5/3 What is the third biggest value in 37, -2, 4550.01? -2 What is the fourth biggest value in 40296.07, 4, 3/4, 3? 3/4 Which is the fourth smallest value? (a) 986 (b) -6/37 (c) -4 (d) 4 (e) -0.2 (f) -4/15 b Which is the second biggest value? (a) -1 (b) -0.4 (c) 13 (d) -92705 (e) 0.1 e What is the third smallest value in 4/7, -3, 3/7, 7/1438, 2, 0? 7/1438 What is the second biggest value in 0.51, -6/13, 5, -0.5, 0.3, 1/8? 0.51 Which is the fifth biggest value? (a) 2/5 (b) -5 (c) 2254832 (d) -1 (e) 5 (f) 2 d What is the second smallest value in -6.8, 88, -7, -6/25, -2, -0.1? -6.8 Which is the third biggest value? (a) 2/25 (b) -17 (c) -1/11 (d) -2/21 (e) 33/4 (f) -2 c Which is the seventh biggest value? (a) 1/71 (b) -5 (c) -2/13 (d) 1 (e) -0.5 (f) -4 (g) 0.09 b What is the smallest value in 337, -3/358, -16, 0.2? -16 Which is the second biggest value? (a) 0.1 (b) 11.33 (c) 29 (d) -0.65 b What is the third smallest value in -3/34, 102, 5272? 5272 What is the fifth smallest value in 1/5, 7762, -1, 13, -0.5, -2, 0.3? 0.3 Which is the fifth smallest value? (a) -3/5 (b) -26 (c) 77 (d) 0.1 (e) 0.2 (f) -2/87 e Which is the smallest value? (a) -81/5 (b) -4663 (c) 1/4 (d) 1 (e) -3 (f) -0.3 b Which is the fifth biggest value? (a) 1/2 (b) 56.7 (c) 3 (d) -5 (e) -0.0154 d Which is the second smallest value? (a) -0.1 (b) 4/75 (c) 34643 b Which is the fifth biggest value? (a) 2/341 (b) -1/8 (c) 67/2 (d) 1/7 (e) -4 (f) -2 f Which is the fourth smallest value? (a) -1/5 (b) 0.3 (c) 11 (d) -2.433 c Which is the fourth biggest value? (a) 0.6 (b) 220 (c) -0.66 (d) -1.02 (e) 4 c Which is the smallest value? (a) 21 (b) 6/31 (c) 1.1688 b What is the biggest value in 3/1816, 1/6, 4, 0, -5, 50? 50 Which is the second smallest value? (a) 651293 (b) 13 (c) -2 b What is the second smallest value in -2/7, 4.7, 5, 1241? 4.7 Which is the second smallest value? (a) 580 (b) -24 (c) -1 (d) 7 c Which is the second biggest value? (a) -4 (b) 0.1 (c) -204 (d) -442/179 d What is the seventh biggest value in -2/5, 0.07, 2, 2226, 0, -0.2, 4/7? -2/5 What is the fourth biggest value in -78/5, 4/5, -1.499, 1/6? -78/5 Which is the second smallest value? (a) -8/5 (b) -6192 (c) 2 a Which is the biggest value? (a) -4/5 (b) -0.5 (c) -5/2 (d) 1 (e) 0.5 (f) -56 (g) 6 g Which is the third smallest value? (a) -1 (b) 610 (c) 1/1264 b Which is the second biggest value? (a) 0.3 (b) 74 (c) 9383/4 b What is the sixth smallest value in -5, 5/6, -0.5, -2/5, 0.22, -0.03913? 5/6 Which is the third smallest value? (a) 1 (b) 171 (c) 8 (d) 0.4 (e) -1 (f) 0.2 d Which is the biggest value? (a) -4 (b) -0.5 (c) 0.3 (d) 609 (e) -2/3421 d What is the third smallest value in -3/851, -0.5, -1.23, 2/7? -3/851 Which is the third biggest value? (a) -4 (b) -2/3 (c) 0.073 (d) -0.62301 b What is the third smallest value in 234/19, -2/173, -1/6? 234/19 What is the fifth biggest value in -1/3, 7, -3/5, 123.2, -0.2, -2, -2/9? -1/3 Which is the smallest value? (a) 30.01 (b) 2/3 (c) -99 (d) 2/13 (e) 0.4 (f) 0.5 c Which is the smallest value? (a) -331325 (b) 3/2 (c) -2/11 (d) 63 a What is the third biggest value in -61, 4/53, 222/43? -61 Which is the sixth smallest value? (a) 1 (b) 0.5 (c) -0.8 (d) -2204 (e) -4 (f) -1/37 a What is the fourth smallest value in 1/6, 90/20531, -5, -2? 1/6 Which is the third biggest value? (a) -28 (b) -7272 (c) -33 (d) 13 c Which is the third biggest value? (a) 2 (b) 0 (c) -1/7 (d) 6/151 (e) 75 (f) -15 d Which is the smallest value? (a) 1/4 (b) -1.561135 (c) -28 c What is the fifth smallest value in -0.1, 0.1, 3, -3, -1/7162, -25? 0.1 Which is the fourth smallest value? (a) -0.1 (b) 0.4 (c) 1/2 (d) -0.111 (e) 0 (f) -0.458 (g) -3 a Which is the smallest value? (a) -2 (b) -2235 (c) -218 b What is the fourth smallest value in -42, -2, 4, 0.3, -4460? 0.3 Which is the second biggest value? (a) 678692 (b) 0.1 (c) 1/19 b What is the third biggest value in -9, -1/2, 623059.5? -9 What is the third smallest value in 3.5, 0.2, -5, 635? 3.5 Which is the third biggest value? (a) -3 (b) 5 (c) -1/3 (d) 1/2 (e) -2 (f) 1076/13 (g) -3/7 d What is the smallest value in -0.1, 20, -7/2, -14/13, 1/3, -1/2? -7/2 What is the fifth smallest value in -0.035, 4, 1, -1/3937, -2? 4 Which is the fourth biggest value? (a) 1/6 (b) -15 (c) 2928 (d) -0.3 (e) 3 d Which is the second smallest value? (a) 0.1 (b) 176/115 (c) -4 (d) -16 c Which is the third smallest value? (a) -33785 (b) -1 (c) -0.05 (d) 5 (e) 113 c What is the fifth biggest value in -2/17, -4, 1/548, -3, 30? -4 What is the second biggest value in 2/63, -2994/433, -2/7? -2/7 What is the second smallest value in -0.7, -10, 0.1, -6/13, 5, -2/143? -0.7 What is the fifth biggest value in -2/9, 14.1, 0, 0.286, 0.19? -2/9 What is the second biggest value in -42, -67160, -2/7? -42 What is the third biggest value in -74.1, 2, -0.06, -3/143? -0.06 What is the fourth biggest value in 0.2, -12, 1/1225, -14? -14 What is the sixth smallest value in 0.5, -1.65, 2237, 2, 4/3, -2? 2237 Which is the smallest value? (a) -0.3 (b) 5 (c) 6/235 (d) -3 (e) -0.798 d Which is the second smallest value? (a) 8670 (b) -3.8 (c) -2/3 (d) 0.05 (e) 0 c Which is the second smallest value? (a) -96/10967 (b) -1340 (c) -1 c What is the second biggest value in 2, -11, 23184/11, -0.06? 2 Which is the third biggest value? (a) -0.472 (b) -212 (c) -92 (d) -1/4 c What is the fourth biggest value in 5, 101.3, -626, -0.3, 0? -0.3 Which is the fifth biggest value? (a) -39 (b) -19 (c) 4/17 (d) -1/52 (e) 1/7 a What is the sixth biggest value in 4, 1233.3, 0.1, 5.7, 0.5, -3? -3 What is the fourth biggest value in 1/14, -3/4, -10859.9, -0.4? -10859.9 Which is the third smallest value? (a) 2 (b) 6900 (c) 17 (d) 1 c What is the second smallest value in 9, 1, -4/15, 5/6, 44, 0? 0 What is the second biggest value in 40, -276, 3, -2/9, -0.496? 3 What is the second smallest value in -0.1, -29/3, 0.0001544? -0.1 What is the second smallest value in 15027, -4, -3, -5, -0.13? -4 Which is the smallest value? (a) -0.01 (b) 25 (c) 12 (d) 3 (e) 0.5 (f) 5/86 a What is the third smallest value in 0.58, 1/4, 64/5, -5? 0.58 Which is the smallest value? (a) 9.2249 (b) 5/3 (c) -6 c What is the second biggest value in -0.056, -6, 4/9, -83/26, -1/5? -0.056 Which is the biggest value? (a) -2.5 (b)	{ "pile_set_name": "DM Mathematics" }
= 1146 - 1146.1. Let v = 4.5 - 4. What is the nearest to m in 3, -0.4, v? -0.4 Let v = 10294.14 + -10192. Let i = -54.9 + -47.1. Let u = v + i. Which is the nearest to -0.1? (a) u (b) -2/19 (c) -1 b Let k be (3/6)/(1/2). Let l = -219 + 221. Suppose -v - 13 = lr - 6r, -5r - v = -5. What is the closest to k in -0.12, 1/4, r? 1/4 Let r = 5/621 + 409/621. Let h = 0 - 5. Which is the nearest to r? (a) h (b) -4 (c) -0.05 c Let x = -31 - -82. Let f = x - 51. Let u = -5 + f. Which is the nearest to 0? (a) 0.3 (b) u (c) -0.4 a Let b = 32.4 - 22.4. What is the nearest to b in 1.5, 0, -2? 1.5 Let j = -4 + 4. Let f = 96.02 - 95.92. Suppose 3i = -i + 20. What is the closest to j in f, i, 0.2? f Suppose -3s - 2 = -5s. Let f = 53 + -53.1. Let y = 2 - 5. Which is the nearest to 0.1? (a) y (b) f (c) s b Suppose 4j - 354c - 26 = -356c, -5c + 35 = 0. Let n = 8 + -12. What is the nearest to n in j, 1/2, -0.2? -0.2 Let h be ((-162)/243)/(2/9). Let z = -165.7 + 173. Let n = z - 7. What is the closest to n in 0.3, h, 3? 0.3 Let n = 1108.1 - 1181.1. Which is the nearest to n? (a) -2/5 (b) 6 (c) 0.2 (d) -3 d Let v = 2.2 - 2.5. Let r = 92 + -79.1. Let t = 13 - r. Which is the closest to t? (a) 2/7 (b) v (c) -11 a Suppose -3i = -2j + 14, -8 = -2j - i + 14. Which is the nearest to j? (a) -2 (b) 0.6 (c) 0.2 b Let g = -6 + 5. Let y = -25102 + 25102. Which is the nearest to 2? (a) y (b) g (c) -3 (d) 0.1 d Let a = 241.8 - 243.8. What is the nearest to a in -1/6, -321, -1/3? -1/3 Let g = 0.06406 - 0.56406. What is the closest to 0.1 in -1/5, -4, g, 9? -1/5 Suppose 817 = 4s + 4r - 827, s = 3r + 395. Let l = s + -2846/7. Which is the closest to -2? (a) 11 (b) 0 (c) l b Let b = 3.66 - 3.86. Let i = -17638/9 - -1960. What is the nearest to -1 in i, b, 3, -2/9? -2/9 Let m = -0.4 - -0.5. Let c = -317 + 139.3. Let i = c - -178. What is the closest to m in -1/3, -1, i? i Let j = -0.21 + -7.79. Let v = -45.2 - -45.5. Which is the closest to j? (a) -0.5 (b) -5 (c) v b Let w = 2/61 + -65/122. Let t = 3.09009 - 2.09009. Which is the nearest to t? (a) -12 (b) -2/11 (c) w b Let u = 16.6 - 17. Let q = 361 + -257. Let x = q + -103. What is the nearest to x in u, 1, -2/7? 1 Let t = 0.0633 - -0.0367. Suppose 7y - 24 = y. Let g be (y - (-30)/(-9))/6. Which is the nearest to t? (a) g (b) 4/9 (c) -2/9 a Let l = -3081 - -3082. What is the nearest to l in 1, 1/11, 1/15? 1 Let p be 95/(-570) - (-5)/4202. Which is the closest to 2/5? (a) -4 (b) -3 (c) p (d) -349 c Let d be (-7)/12(160/28 - 6). Let w be (-588)/(-105) - (-24)/(-15). Which is the nearest to -4? (a) -3 (b) d (c) w a Let k = -0.08 + -0.07. Let m = k + -0.35. Let f be 2/(-8) + (-49)/28. What is the closest to -1/4 in m, 0.1, f? m Let m = 29 - 32. Let b = 5.45 - 0.45. Let y = -9 + b. What is the nearest to 0 in m, -12, y? m Let v(r) = -2r + 3. Let n be v(-1). Let u be n/25 + (-28)/(-10). Let w be (((-10)/(-3))/(-10))/((-2)/u). What is the nearest to 2/3 in -5, -3/8, w? w Let g = 17/7 + -95/42. Let i = -477.76 - -475.76. Which is the nearest to 2/7? (a) -5 (b) i (c) -3/8 (d) g d Suppose 2q + 2 = q, 0 = -2n - 5q - 8. Let b = n - 4/3. Let z = -244.2 - -244. What is the nearest to b in z, -4, 3? z Suppose 13f = 7 + 6. Let p = 49.09 - 49. Which is the nearest to f? (a) 3 (b) 1/4 (c) p b Let y(h) = 9h + 143. Let g be y(-16). Let f be (9/4)/(-1) + (-12)/16. Which is the closest to -2/21? (a) f (b) 0.2 (c) g b Let m be (-1620)/(-243)(-1)/(-8). Let r be ((-15)/55)/((-3)/4). Let s = r - 30/143. Which is the closest to 0? (a) -8 (b) m (c) s c Let j = -6995 + 7021. Suppose -2r = -2x + 2, 3r = x - 4 + 9. Which is the nearest to 0? (a) j (b) -3 (c) x b Let x = -1636 + 96522/59. Which is the closest to 0? (a) x (b) 0.1 (c) 23 a Let s = -6279 - -6278. What is the nearest to -2 in 3/2, 14, -2/13, s? s Let i = -0.3 - 0. Let r = 13876 + -13880. Which is the nearest to r? (a) 1/30 (b) 0 (c) i c Let d = -20439 - -20369. What is the closest to 0.04 in -1, 2, -2, d? -1 Let t = -2008 + 1349. Let x = t - -659.04. Let z(i) = -i3 + 7i*2 - 7i + 7. Let m be z(6). Which is the nearest to m? (a) x (b) 2/5 (c) 3 b Let g = 76.47 - 74.67. Which is the closest to -1/4? (a) 35 (b) g (c) -2 c Let w = 22795.7 - 22796. Which is the nearest to -1.3? (a) -3 (b) w (c) 0.2 (d) -4 b Let h = 2128 + -4257/2. Which is the nearest to -11? (a) h (b) 1/4 (c) -1.9 (d) -4/9 c Let r be (-544)/(-112) - 3/(-21). Suppose 0 = 2z - 0w + 2w - 10, 0 = -z + rw - 13. What is the nearest to 1 in 4/29, -4, z? 4/29 Suppose -3d + 3f = 12, -32d + 33d + f + 2 = 0. Which is the nearest to -1/4? (a) 3 (b) d (c) 18 b Let f be 3 - (1 - (0 + 1298/26)). Let i = 52 - f. Let m = 10.1 - 10. What is the nearest to 0 in i, m, 0.5? i Let o = 338 - 338.5. Which is the closest to 1? (a) 12 (b) o (c) 4 (d) -1/3 d Let o = -551 - -555. Let w be (-56)/171 - 4/(-18). Which is the closest to w? (a) -5 (b) o (c) 1 c Let w(r) = 19r - 1461. Let t be w(77). Which is the nearest to t? (a) -0.5 (b) -5 (c) -1/9 (d) 5 c Let g = -0.1 - 0.1. Let k be (-3)/20(-18 + (-308)/(-14)). What is the nearest to g in -4, k, -2/9? -2/9 Let v = 82.01 - 0.01. Let q = 4436 - 4514. Let g = v + q. Which is the closest to -1/2? (a) 1 (b) -1/8 (c) g b Let l be 2 - (-8)/(-3) - 416/(-12). Let s = -30 + l. Let y be 3 + 364/(-176) + s/(-22). What is the nearest to -1/5 in -2/7, y, 0? -2/7 Let v be ((-3)/(-15)-3)/1. Let f = 117 + -168. Let r = 55 + f. What is the closest to -0.1 in r, v, -1? v Let n = 2.6 + -2.5. Let u = -0.761 + 0.261. What is the closest to n in 0.5, u, -0.4? 0.5 Let r = -5085/31 + 40649/248. Suppose -2g + 2 = w + w, 0 = -4g - 16. Which is the closest to 1? (a) r (b) -5 (c) -2/27 (d) w c Let p = -16.18 - -15.38. Which is the nearest to -1? (a) p (b) -0.2 (c) 4 (d) 45 a Let m = 30/203 + 4/29. Let y = 4.268 - 0.268. What is the closest to m in -8, y, 1, -1/11? -1/11 Let f(d) = -11828d + 153736. Let x be f(13). Let g be 4 + 0/(-2 - -1). Let o be (g/110)/((-1)/5). Which is the closest to -1? (a) x (b) 0.3 (c) o c Let b = -14252/23 + 620. Let n = b - -53/46. What is the nearest to -0.1 in n, 2/7, -5/2, -3? 2/7 Let y = -30 - -14. Let f be (-12)/y + 9/(-12) + 0. What is the nearest to f in -0.2, -5, 14/5? -0.2 Let m(n) = 36n + 223. Let t be m(-6). Let d = -21 - -20.7. What is the closest to -2 in t, d, 1? d Let f be 0 - (-1 - 7/(-9)). Let z be ((-110)/165)/((-4)/6). Let q = 1.07 + -0.87. Which is the closest to z? (a) f (b) q (c) -0.3 a Let y = 12056 + -12055. What is the closest to 0 in -1/10, y, 0.2, -219? -1/10 Let r = 718 + -717.8. Let l = -137 - -136. Let q = 3 + -2. Which is the nearest to q? (a) r (b) 2/17 (c) l a Let q = 32.6 + -31.6. Let b = -1/80 - 63/80. What is the nearest to q in -0.4, b, 0.3? 0.3 Suppose 5s - s + 5l = 3, s = -l + 1. Let y = 3487/17 - 205. What is the closest to s in y, 6, 0.4? 0.4 Let o = 0.7 + -3.7. Let r = 0.12989 + -0.72989. Which is the nearest to 1? (a) -2/7 (b) o (c) 3/7 (d) r c Let q(o) = -37o - 1591. Let g be q(-43). Which is the closest to -1? (a) 2/5 (b) g (c) -1/4 (d) 1.8 c Let f = 0.039 - -34.961. Let j = -35.4 + f. Let l = -48.1 - -47.9. Which is the nearest to -3? (a) l (b) j (c) 0.3 b Let s = -42 - -41.9. Let r = -11446/3365 + 1/673. Let i = -19/5 - r. Which is the closest to 2? (a) s (b) i (c) 2 c Let t = -2499 + 2498.6. Which is the closest to 1/6? (a) 2/13 (b) t (c) -2/3 a Let c = -836 - -837.1. What is the nearest to -0.1 in -0.4, -5, 9/5, c? -0.4 Let d = 0.1 - 0.3. Let x = -13/3620 + -6941/83260. What is the closest to -1/2 in 0.3, d, x? d Let a = 1163 - 1067.9. Let f = -95 + a. What is the nearest to 0.1 in -1/6, 0.04, f? f Suppose -4r = r - 25. Let x be (r/10)/(-2(14 - 0)). Let a = -1/8 + x. What is the closest to 1/2 in 2, 5, a? a Suppose 0 = 68q - 386 + 114. Which is the nearest to 0.1? (a) -5/3 (b) q (c) -4 a Let l(z) = -2z*3 - 5z*2 + 56z - 11. Let u be l(4). Which is the nearest to 3? (a) 17 (b) -2 (c) u c Let d = -6.9 + 7.1. What is the nearest to 2/13 in d, -2, -3/7, 3? d Let k = 300 - 3902/13. Let b be (-23)/5 + 4/(-10). Let q = 7 + b. What is the nearest to 4 in k, q, 1/4? q Suppose -15 =	{ "pile_set_name": "DM Mathematics" }
4, -2/17, 0, 2, 4 Put -4, -14076, 3, -5 in decreasing order. 3, -4, -5, -14076 Sort 0, -92, -2, 2 in decreasing order. 2, 0, -2, -92 Sort 5, -75, -703, -5 in ascending order. -703, -75, -5, 5 Put 1/4, -5, 0.1, -3/2, 3, 4/9 in decreasing order. 3, 4/9, 1/4, 0.1, -3/2, -5 Put 207, 91, -3, 0.01 in decreasing order. 207, 91, 0.01, -3 Sort 0, 2, -361605 in increasing order. -361605, 0, 2 Sort 5, 3.364, -2/7 in increasing order. -2/7, 3.364, 5 Put -1/25, -0.4, -13, -1.6 in increasing order. -13, -1.6, -0.4, -1/25 Sort 0.5, -2, 158, 3, 0.2 in ascending order. -2, 0.2, 0.5, 3, 158 Put 24.01, 235, 2/13 in increasing order. 2/13, 24.01, 235 Put -5, 0, 5, -2549, 4 in descending order. 5, 4, 0, -5, -2549 Sort -5, -2, -18, 4. -18, -5, -2, 4 Sort -86, -3, 2140, 2 in descending order. 2140, 2, -3, -86 Sort 3, -127, 2, -4, -9 in decreasing order. 3, 2, -4, -9, -127 Put 3/5, -16, -124/9 in descending order. 3/5, -124/9, -16 Put 3, -3, -29, 1 in ascending order. -29, -3, 1, 3 Put 2, -1274, 6 in descending order. 6, 2, -1274 Put 2, 5, 13, 16 in decreasing order. 16, 13, 5, 2 Sort 1, 1044, 0, -11 in decreasing order. 1044, 1, 0, -11 Sort -27, -236, 5, 3, 4 in increasing order. -236, -27, 3, 4, 5 Put -4, -759, 0, -5, 1 in decreasing order. 1, 0, -4, -5, -759 Sort 2, -0.037, 178, 1/8, -3 in descending order. 178, 2, 1/8, -0.037, -3 Sort -2, 3, 2, 1, -1 in increasing order. -2, -1, 1, 2, 3 Put 2, 880, -5, -4 in descending order. 880, 2, -4, -5 Put -148, 4, 0, 43, -3 in decreasing order. 43, 4, 0, -3, -148 Sort -5, -6, -96 in increasing order. -96, -6, -5 Sort -9388, -5, 2, 0, -4 in increasing order. -9388, -5, -4, 0, 2 Sort -23977, -3, 4, 13 in increasing order. -23977, -3, 4, 13 Sort 3, 5, -6343, -4 in descending order. 5, 3, -4, -6343 Sort -0.09, 0.1, 0.04, 9 in ascending order. -0.09, 0.04, 0.1, 9 Put -3, 3, 166, 28, 1, 2 in ascending order. -3, 1, 2, 3, 28, 166 Sort 25, -16422, 0 in increasing order. -16422, 0, 25 Put -4, -328, -24 in descending order. -4, -24, -328 Sort -5, -4, -1, 7096, 31, 2. -5, -4, -1, 2, 31, 7096 Sort -4, 23, -8/7, -5, -14/9 in descending order. 23, -8/7, -14/9, -4, -5 Sort 6, 2, 942, -29 in increasing order. -29, 2, 6, 942 Sort -6, 9, -778, -2. -778, -6, -2, 9 Sort 2, 2648, 27 in descending order. 2648, 27, 2 Sort 62, 1, -111 in decreasing order. 62, 1, -111 Sort 83, -5, -164, 4. -164, -5, 4, 83 Sort 3492, 3, 2, 8, 0 in decreasing order. 3492, 8, 3, 2, 0 Sort 21, -2, 2, 4, 13. -2, 2, 4, 13, 21 Sort -244, -3, -12/7, -5. -244, -5, -3, -12/7 Sort -30, -1, 0, -25, 1, 2 in descending order. 2, 1, 0, -1, -25, -30 Sort -872, 64, -6, 0 in ascending order. -872, -6, 0, 64 Put 1/24, 1/7, 156 in descending order. 156, 1/7, 1/24 Put -1/3, -19.5, 0.5, -3/2 in ascending order. -19.5, -3/2, -1/3, 0.5 Put 7880, 74, 3, -5 in ascending order. -5, 3, 74, 7880 Sort 0, -0.0013, -1 in ascending order. -1, -0.0013, 0 Sort 0, -26724, -1 in increasing order. -26724, -1, 0 Sort 40205, -2, 3, 12 in decreasing order. 40205, 12, 3, -2 Put -122, -0.3, 117/5 in increasing order. -122, -0.3, 117/5 Sort 139, 2, 10, -1, 3 in decreasing order. 139, 10, 3, 2, -1 Sort 4, -5, 67, 0.01 in decreasing order. 67, 4, 0.01, -5 Put 0, 646, -8 in decreasing order. 646, 0, -8 Put 1, -13557, -3 in descending order. 1, -3, -13557 Sort -2/9, -0.2, -4, 0, -0.062. -4, -2/9, -0.2, -0.062, 0 Sort 16, -4061, -1, -10. -4061, -10, -1, 16 Sort -3, 937, -2, 1, -1, 4. -3, -2, -1, 1, 4, 937 Sort 0.02, 20, -0.07581, 4. -0.07581, 0.02, 4, 20 Put -2/9, -184, 2054 in increasing order. -184, -2/9, 2054 Sort -133/5, -1, 1, -4, -2/5, 0.3 in decreasing order. 1, 0.3, -2/5, -1, -4, -133/5 Sort 7, 4, 1, 3, -1. -1, 1, 3, 4, 7 Sort 13, 0, -2, 6, 4, -30. -30, -2, 0, 4, 6, 13 Sort -3, 0.205, 12/13, 5 in decreasing order. 5, 12/13, 0.205, -3 Sort -20, -2, -596 in ascending order. -596, -20, -2 Sort 0.1, -2464, 0, -2 in increasing order. -2464, -2, 0, 0.1 Sort -20, -5, -2, -1, 1 in descending order. 1, -1, -2, -5, -20 Put 0.1, -2, -0.4, -356, 4/7 in decreasing order. 4/7, 0.1, -0.4, -2, -356 Sort 27, -19643, 0.4 in decreasing order. 27, 0.4, -19643 Sort -3, 156, -43 in increasing order. -43, -3, 156 Put -0.3, -0.274, -19 in decreasing order. -0.274, -0.3, -19 Put -0.1, -431, 8, 1/3, -1/7 in descending order. 8, 1/3, -0.1, -1/7, -431 Sort 16, -4, 15, 2, -5, -28 in descending order. 16, 15, 2, -4, -5, -28 Sort -1, -5, 29, -41 in descending order. 29, -1, -5, -41 Sort 37, -1/4, -50/121 in decreasing order. 37, -1/4, -50/121 Put -1/4, -15, 1/6, 1, 0.1, 2 in decreasing order. 2, 1, 1/6, 0.1, -1/4, -15 Put -1, -30, 4390 in increasing order. -30, -1, 4390 Put -28, 2, -8, 1, -3 in descending order. 2, 1, -3, -8, -28 Put 0.4, -1, -31, 18, 5.2 in ascending order. -31, -1, 0.4, 5.2, 18 Sort 1, -2, -1/4, -51, 11/6 in descending order. 11/6, 1, -1/4, -2, -51 Put -1/8, -1484, -13, 0.3 in decreasing order. 0.3, -1/8, -13, -1484 Put 3, 4, -3, 5, 8, 0 in descending order. 8, 5, 4, 3, 0, -3 Sort 879, 324, -3 in descending order. 879, 324, -3 Sort -1/2, 0.2, 2/41, -2/3 in decreasing order. 0.2, 2/41, -1/2, -2/3 Put 77, 1.29, -0.4, 2/15 in descending order. 77, 1.29, 2/15, -0.4 Sort -9, 2, 4, 0, -34. -34, -9, 0, 2, 4 Sort -3, -0.13108, 3/4 in decreasing order. 3/4, -0.13108, -3 Sort 251, -205, -1 in increasing order. -205, -1, 251 Sort -2, 3, 11, 4, -4, 13 in decreasing order. 13, 11, 4, 3, -2, -4 Sort 0.2, 2/11, -1.33, 4, -2, 3. -2, -1.33, 2/11, 0.2, 3, 4 Sort 9, 1, -5, 435. -5, 1, 9, 435 Sort -2/11, 5, 28, -1 in decreasing order. 28, 5, -2/11, -1 Sort -1, -1/3, 8, -0.1, 5/6, 4854 in increasing order. -1, -1/3, -0.1, 5/6, 8, 4854 Put -4, 2, -0.06234 in descending order. 2, -0.06234, -4 Sort 1, 29, -16 in descending order. 29, 1, -16 Sort 3, -1.9994, -0.2 in descending order. 3, -0.2, -1.9994 Put 20, 0.04, -1/7, -0.16, 2/9, -1 in ascending order. -1, -0.16, -1/7, 0.04, 2/9, 20 Sort -1/7, -0.73, -27, -6 in decreasing order. -1/7, -0.73, -6, -27 Sort 2/9, 2, -5, -0.051, 4, 1 in decreasing order. 4, 2, 1, 2/9, -0.051, -5 Sort -2, -3, 3, -1, 1, -5126 in increasing order. -5126, -3, -2, -1, 1, 3 Sort -5, -43, 22, 11 in decreasing order. 22, 11, -5, -43 Sort -21, 1, -4, 11557 in descending order. 11557, 1, -4, -21 Sort 0.2, -52, 93 in descending order. 93, 0.2, -52 Sort 23, 8, 1, -90, -4, 3 in decreasing order. 23, 8, 3, 1, -4, -90 Sort -4175/4, 2, -3, -1 in decreasing order. 2, -1, -3, -4175/4 Sort 1, 3919, 13, -1. -1, 1, 13, 3919 Sort 1.7, 0.001, -0.08 in descending order. 1.7, 0.001, -0.08 Sort 7, 4/9, 1/9, 1, 10.9. 1/9, 4/9, 1, 7, 10.9 Sort -0.1558, 0, 4, 3 in ascending order. -0.1558, 0, 3, 4 Sort -33, 9, 57, 1 in ascending order. -33, 1, 9, 57 Put 0, -1.64, -0.8, 2/7 in increasing order. -1.64, -0.8, 0, 2/7 Sort 5, -1/8, -2/3, -4, -5, 6/11 in decreasing order. 5, 6/11, -1/8, -2/3, -4, -5 Put 440, 4/7, 8 in ascending order. 4/7, 8, 440 Put 5/21, -9/2, 0.12, 3 in descending order. 3, 5/21, 0.12, -9/2 Sort 23, 1/10, 2, 14 in increasing order. 1/10, 2, 14, 23 Put -2, 465, 4, 12, -4, 1 in descending order. 465, 12, 4, 1, -2, -4 Put -4, -13156, 1 in ascending order. -13156, -4, 1 Put 5, 6, -15866, 1 in descending order. 6, 5, 1, -15866 Put 2, -5, 659, -11 in decreasing order. 659, 2, -5, -11 Put -5, -3, 7, 3, 56 in descending order. 56, 7, 3, -3, -5 Sort 5, -5005, -4 in decreasing order. 5, -4, -5005 Put 1, -1168, 2, -2, -4 in descending order. 2, 1, -2, -4, -1168 Sort -407, -14/9, -0.1 in increasing order. -407, -14/9, -0.1 Put -5, -3, 3, -290 in increasing order. -290, -5, -3, 3 Sort -4, -1/9, 0.4, -12, -0.4, 2/51. -12, -4, -0.4, -1/9, 2/51, 0.4 Sort 5, 44, -4, 4, 9, 1 in descending order. 44, 9, 5, 4, 1, -4 Sort 2, -0.5, -4.1715 in descending order. 2, -0.5, -4.1715 Sort -5, -1, 4, 104, 36 in ascending order. -5, -1, 4, 36, 104 Put 2, -3, -61, 60, 3, 0 in ascending order. -61, -3, 0, 2, 3, 60 Sort -1046/3, -4, 1 in ascending order. -1046/3, -4, 1 Put -5, 6, 0.1, 38, 1/5 in increasing order. -5, 0.1, 1/5, 6, 38 Sort 140174, -1/6, -0.2. -0.2, -1/6, 140174 Put 4, -1, 0.1, 0.04268 in decreasing order. 4, 0.1, 0.04268, -1 Sort 40, 0, 25, -4, -1 in increasing order. -4, -1, 0, 25, 40 Sort -340, -33, 0, -1 in increasing order. -340, -33, -1, 0 Put 5, 3/7, 1, 6818, -0.5, 0.3 in decreasing order. 6818, 5, 1, 3/7, 0.3, -0.5 Put -198/7, 0.2,	{ "pile_set_name": "DM Mathematics" }
t derivative of j*2/2 + 3j - 157. Suppose 5m + 24 = 3u, -1 = 2m + 5. Let x(o) = -o - 4. Calculate ux(k) + 4d(k). k Let a be (2 - 2 - 18/6) + 16. Suppose af - 30 = -173. Let l(h) = 21h3 - 11h. Let q(x) = 11x3 - 6x. What is fq(n) + 6l(n)? 5n3 Let c(n) = 11n*2 - 194n - 2. Let m(w) = -28w2 + 484w + 6. Calculate -18c(q) - 7m(q). -2q2 + 104q - 6 Let q(c) = 4c2 + 3c - 13. Let u(z) = 245z. Let i(m) = -72m. Let p(f) = -17i(f) - 5u(f). What is -3p(a) - q(a)? -4a*2 + 13 Let i be (-2)/((-4)/94) - 2. Let a = -45 + i. Let r(q) = -3 + a + 4q - 4 + 11. Let o(h) = 5h + 5. Determine -5o(f) + 6r(f). -f - 1 Let t = -7 + 16. Let a be 40/(-48) - (-2838)/36. Let x(d) = -142d + ad + 62d. Let s(o) = 3o. What is tx(b) + 4s(b)? -6b Suppose -4r = -33 - 23. Suppose o - r = -20. Let d(x) = -13 + 6 - 7x + 7. Let c(k) = -13k. Calculate oc(z) + 11d(z). z Suppose z = -5s + 218, 12z = 2s + 16z - 80. Let u(g) = -2g + 46. Let b(v) = 2. Calculate sb(o) - 2u(o). 4o - 4 Suppose w = 5i + 15 + 2, -19 = -3w - i. Let j(s) = -17s*3 - 7s*2 - 7s - 9. Let o(k) = -8k3 - 4k*2 - 4k - 5. Calculate wo(z) - 4j(z). 12z3 + 1 Let i(p) = -2p - 22. Let x(a) = 1779a + 26092. What is -3558i(q) - 3x(q)? 1779q Let n(z) = -4917z3 - 21z*2 + 7z - 7. Let j(r) = -3278r3 - 15r*2 + 5r - 5. What is -7j(b) + 5n(b)? -1639b3 Let z(s) = -4. Let g(t) = t - 44. Suppose -3c + 41 = 2y, 4y - c + 3c = 78. Let u = 52 - y. Let j be (u/(-11))/((-6)/8). Determine jg(x) - 44z(x). 4x Let y(d) = -2d2 + 10d + 3. Let k(j) = 35j2 + 30j + 6. Let a(i) = -13i2 - 3i. Let t(f) = 3a(f) + k(f). Let p = -44 + 31. Calculate py(s) + 6t(s). 2s*2 - 4s - 3 Let k(h) = 28h2 - 6h + 150. Let o(s) = -11s2 + 3s - 76. Give 3k(f) + 7o(f). 7f2 + 3f - 82 Let v(k) = k*2 + k - 14. Let c(p) = 3281p*3 - 772p*2 - 772p + 10808. Determine c(w) + 772v(w). 3281w*3 Let k(d) = -512d*2 - 4d + 2. Let y(c) = 501c2 + 5c - 2. Calculate 5k(p) + 4y(p). -556p2 + 2 Let j(f) = 12f - 6. Let o be (36/16)/((-3)/(-8)). Let r(t) = -9 + 1 - 4 + 1 + 10. What is or(z) - j(z)? -12z Let o(x) = 94x + 11. Let h(y) = 88y + 11. Calculate 4h(i) - 3o(i). 70i + 11 Suppose n - 13 = -4s + 2n, 2s = 3n + 19. Let t(x) = -x - 6x - 4x - xs - x2. Let y(k) = -k2 - 4k. Calculate 4t(w) - 11y(w). 3w2 Let t(s) = -12s*3 + 16s*2 - 3s - 3. Let k(d) = 12d3 - 20d*2 + 3d + 6. Give 4k(v) + 5t(v). -12v3 - 3v + 9 Let x(b) = 4b2 + 6 + 6b + 3 - 3 - 4. Let w(q) = -3q2 - 5q - 1. Let p(g) = g*3 - 22g*2 - g + 19. Let i be p(22). Calculate iw(o) - 2x(o). o2 + 3o - 1 Let u(n) = -2n2 + n - 1. Let r(o) = -15o*2 + 2o + 77. What is r(h) - 7u(h)? -h2 - 5h + 84 Let z(j) = -87j3 - 6j*2 - 1. Let k(y) = 58y*3 + 4y*2 + 1. Let f(n) = 187n + 6926. Let b be f(-37). Give bk(r) + 5z(r). -29r3 - 2r*2 + 2 Let c(n) = -48n + 147n - 94n. Let s(p) = -9p - 1. What is -11c(o) - 6s(o)? -o + 6 Let s(c) = -28c + 403. Let f(k) = -76k + 1008. Give -5f(r) + 12s(r). 44r - 204 Let s(j) = j*2 + 2j + 3. Let q(n) = -2n2 + 17n - 12. Calculate q(h) + s(h). -h*2 + 19h - 9 Let j(z) = -35z + 4. Let v(d) = 33d - 6. Let a(w) = 65w - 13. Let t(l) = 3a(l) - 7v(l). Determine 3j(g) - 4t(g). 39g Let u(f) = -8f2 + 8f + 45. Let m(i) = -i - 11. Calculate 4m(o) + u(o). -8o*2 + 4o + 1 Let a(i) = -2i2 - 2i - 2. Let k(x) = -x + 179x2 - 93x*2 - 85x*2. Determine -a(y) - 4k(y). -2y2 + 6y + 2 Let o(n) = 2n + 1515. Let z(p) = -p + 2. Calculate -o(k) + z(k). -3k - 1513 Let d(s) be the first derivative of -31s3/3 + 4s + 3777. Let q(g) = -495g2 + 63. Calculate -63d(a) + 4q(a). -27a2 Let b(k) be the second derivative of k5/20 + k*3/3 + 3779k + 4. Let o be ((-84)/4)/((-3)/2). Let r(u) = -u. Determine or(h) + 6b(h). 6h3 - 2h Let c(g) = -70g. Let q(x) be the third derivative of 7x*4/24 - 980x*2. What is -2c(l) - 21q(l)? -7l Let g(k) = 10k - 3. Let h(u) = 30u - 11. Determine 14g(z) - 4h(z). 20z + 2 Let p(o) = -o2 - o - 1. Let b = 21068 - 42131/2. Let g(r) be the second derivative of 0 + 7/6r*3 + 26r + br2 + 1/2r*4. Determine -g(c) - 5p(c). -c*2 - 2c Suppose -2s = 4d - 12, -31s + 24 = -d - 36s. Let i(m) = -15m3 + 4m*2 + 4m. Let p(l) = 4l3 - l2 - l. Determine di(k) + 22p(k). -2k*3 + 2k*2 + 2k Let d(t) = t*2 + t + 1. Let z(r) = 5r*2 + 4r + 4. Let b = 14 + -2. Suppose 189 = -5w + 5g + 609, -5 = -5g. Let o = 82 - w. Calculate bd(j) + oz(j). -3j*2 Let o(d) = -2d3 + d2 + 3d. Let q(k) = -15k*3 - 38k*2 + 12k - 2. Determine 5o(g) - q(g). 5g*3 + 43g*2 + 3g + 2 Let x(m) = 13132m. Let a(d) = 4379d. What is -14a(u) + 5x(u)? 4354u Let h(a) be the first derivative of -4a*2 - 4a + 1056. Let g(z) = -9z - 3. Give 4g(x) - 3h(x). -12x Let t(n) = n + 4. Let p(d) = -21d - 42. What is p(l) + 2t(l)? -19l - 34 Let m(u) = -18u - 35. Let f(s) = 5s + 10. Let a(v) = -21f(v) - 6m(v). Let c(t) be the second derivative of t3/6 - 27t. Calculate -3a(p) + 8c(p). -p Let b(r) = 71r3 - 5r*2 - 5r. Let y(x) = 1064x3 - 76x*2 - 76x. Let o = -8559 + 8564. What is oy(l) - 76b(l)? -76l3 Let s = -917 + 915. Let t(l) = 6l - 3. Let c(a) = -23a + 13. Determine sc(d) - 9t(d). -8d + 1 Let i(j) = -3j + 2. Let o be (4 - 5)/(-8 + 12)-8. Let m(a) = -a + 1. Let h(v) = v - 1. Let w = 8 - 5. Let y(f) = om(f) + wh(f). Determine -3i(g) - 8y(g). g + 2 Suppose -170s + 178s - 24 = 0. Let a(z) = 2z3 + 8 - 8z - 54z2 - 2z*3 + 48z*2 - 7zs. Let w(m) = m3 + m*2 + m - 1. Give -a(b) - 6w(b). b*3 + 2b - 2 Let v(p) = -p*2 + 3p - 3. Let m(z) = -8z - 10z - 17z - 35 - 17z + 50z + 37. Let y(g) = -g2 + 6g + 3. Let q be y(6). What is qm(d) + 2v(d)? -2d2 Let d(f) = 54f - 19032. Let u(i) = -19i + 6344. What is -6d(l) - 17u(l)? -l + 6344 Suppose -1307n - 1272n = -2542n - 185. Let o(q) = -3q2 - 5q - 7. Let p(b) = -1 + 0b - 2 - 2b - 2b2. What is np(x) - 2o(x)? -4x*2 - 1 Let p(j) = -5j*2 + 533j - 67. Let t(q) = -3q2 + 356q - 42. What is -5p(u) + 8t(u)? u*2 + 183u - 1 Let l be -2((-178)/4 + 2) + 3. Let q = -90 + l. Let g(v) = v3 - 4v - 2. Let t(h) = 2h3 - 5h - 3. Calculate qt(s) + 3g(s). -s*3 - 2s Let s(b) = -9b2 - 3b + 4. Let t(u) be the first derivative of -3u3 - 2u*2 + 5u + 960. Give -4s(l) + 3t(l). 9l2 - 1 Let m(t) be the first derivative of -89t*4/4 - 5t*3/3 - 5t*2/2 - 5t + 4027. Let s(g) = 3337g3 + 188g*2 + 188g + 188. Give -188m(o) - 5s(o). 47o3 Let z(w) = -4w*3 - 2w*2 + 1628w. Let p(r) = 17r3 + 9r*2 - 6511r. Calculate 2p(l) + 9z(l). -2l3 + 1630l Let r(l) be the second derivative of 17l5/20 + l4/6 + l2 + 161l - 3. Let n(s) = 17s3 + 3s*2 + 3. Determine -2n(d) + 3r(d). 17d*3 Let s(p) = 5p*2 - 3p + 93. Let a(d) = -15d2 + 8d - 269. Let v(h) = 3a(h) + 8s(h). Let f(n) = -n*2 - 16. What is -9f(c) + 2v(c)? -c2 + 18 Let j(u) = 2u*2 + u - 2. Suppose -w = -4n - 11, 4w + 0n - 63 = -3n. Suppose -wp = -2p - 65. Let i(o) = 2o*2 + o - 3. Determine pi(l) - 6j(l). -2l*2 - l - 3 Let p(j) be the first derivative of -3/2j*2 + 2j*3 - 3j - 35. Let r(l) = -4l2 + 2l + 2. Determine -5p(d) - 8r(d). 2d2 - d - 1 Suppose 2o - 8 = -2c, 0 = 2c - 239o + 238o + 7. Let z(j) = 3j2 - 2j - 3. Let f(y) = y*2 + y + 1. Calculate cf(n) - z(n). -4n2 + n + 2 Let f(s) = 61s - 19s - 4 + 17 - 45s. Let p(n) = 16n - 66. Calculate -11f(r) - 2p(r). r - 11 Let m(h) = -h3 - 6h*2 + 10. Suppose 103o = -39o + 36o + 1802. Let f(q) = -3q3 - 17q*2 + 29. Calculate om(l) - 6f(l). l3 - 4 Let a(y) = -2y*3 - 2y*2 + y + 1. Let q(l) = 82l*3 + 3l*2 - 7l - 2. Calculate 2a(c) + q(c). 78c3 - c2 - 5c Let k(y) = -4y*2 + 2y. Let g(f) = f*2 - 34f + 2f2 + f2 + 31f. Calculate 4g(j) + 6k(j). -8j2 Let c(u) = -u2 + 1. Let m(q) = -2q*3 + 18q*2 - 34q - 13. Let d be m(6). Let b(x) = -27x2 + 4. Calculate db(j) + 4c(j). 23j*2 Let s(r) = 5r*2 + 5r - 8. Let d be -3(-2)/(-24) + -13 + (-1540)/(-80). Let w(a) = -5a*2 - 6a + 9	{ "pile_set_name": "DM Mathematics" }
-34 Is 5 less than or equal to 592/169? False Is -39/76 less than -2? False Is -144 less than or equal to -142? True Is -1 greater than 32140? False Which is smaller: -108 or -653/6? -653/6 Is -1/23 less than -1? False Is 11/9 > -1? True Is 288 at most as big as -0.054? False Which is bigger: 617/5 or -0.1? 617/5 Is 246 less than or equal to 246? True Do 43 and -14 have the same value? False Is 469 smaller than 469? False Is 103 greater than 103? False Is -1/10 less than 475? True Which is smaller: 1/15426 or -1? -1 Which is bigger: 255/8 or 0.2? 255/8 Is -1/786 <= 0? True Which is smaller: 3759/4 or 940? 3759/4 Is 108 less than 109? True Which is smaller: 1 or 41/150? 41/150 Which is bigger: 300/13 or 22? 300/13 Which is greater: 0.1 or 69.03? 69.03 Is -206 bigger than -271? True Which is bigger: 50/9 or 52? 52 Which is smaller: -54/371 or 0? -54/371 Which is smaller: 23.029 or -1/4? -1/4 Is 0.064 at most as big as 4? True Do -2271 and -2273 have the same value? False Which is smaller: 9 or -653? -653 Which is greater: -1464 or -1466? -1464 Is -2/9311 > -1? True Are 577 and 7494/13 unequal? True Is -4 at most as big as -25/7? True Are 169 and 169 nonequal? False Is 3 smaller than -6/13? False Which is bigger: 108 or 81? 108 Which is smaller: 7/1122 or -1? -1 Does -5 = 50? False Which is bigger: -1 or -20/787? -20/787 Which is greater: 43 or 47? 47 Which is smaller: -208 or -209? -209 Is 40/63 at most as big as 0? False Is 121 at most 2814/23? True Which is greater: -2/5 or -10701? -2/5 Which is smaller: 1347 or 1349? 1347 Which is smaller: -160 or -156? -160 Which is smaller: 2/35803 or 0? 0 Which is greater: 138 or 135? 138 Which is smaller: -17 or -5? -17 Which is bigger: -5 or -73/14? -5 Is -9/52 at most as big as 1? True Which is greater: 2 or 242/145? 2 Which is bigger: -820 or -6/19? -6/19 Are -80 and -71 nonequal? True Is 0 < -15226? False Which is smaller: -26/21 or -2? -2 Is 2874 at most 2875? True Which is greater: 4 or 298/25? 298/25 Is 0 >= 50/1091? False Which is smaller: 0 or 4/477? 0 Which is smaller: 2 or 597/14? 2 Is -1/559 at least -1? True Which is bigger: -3/3686 or 0? 0 Is 1 at most 2/49? False Do 635 and 635 have the same value? True Which is bigger: -70 or -5.4? -5.4 Is 3852 less than or equal to 34678/9? True Is -20240 <= -20239? True Is 3/193 bigger than 1? False Is 41209 >= 41210? False Is 1 smaller than -2/155? False Is -23/6 less than -3? True Which is smaller: 484 or 417? 417 Which is bigger: -123/40 or -3? -3 Which is smaller: 452 or 453? 452 Is 1 greater than 2/21879? True Which is smaller: -1/159 or 0? -1/159 Which is greater: -2/279 or 0.05? 0.05 Is -16/1137 at least 0? False Which is greater: -130/71 or -3? -130/71 Is -2842 at least as big as -2843? True Which is smaller: -0.1 or -1/1061? -0.1 Is 73 at most as big as 74? True Is -1/219 smaller than 0? True Which is greater: 2.6 or -5? 2.6 Is -0.5 bigger than -1/196? False Which is smaller: -407/28 or -3/4? -407/28 Does -31 = -91/3? False Is -50 < -0.35? True Which is bigger: 7461 or 2? 7461 Which is smaller: -0.1 or 74/13? -0.1 Is 0.1 greater than 0.63? False Which is bigger: -2/15 or 41? 41 Is 37 > 41? False Which is smaller: 1 or 1/17? 1/17 Which is smaller: -3340 or 0.05? -3340 Which is smaller: -7764 or -7765? -7765 Is 0 at least -21/41? True Do -131 and -135 have the same value? False Is -10 <= -11? False Is 13/112 bigger than -1? True Which is greater: -216/5 or -44? -216/5 Which is bigger: -1 or 104? 104 Which is greater: 764/13 or 60? 60 Are 1/258 and -1 non-equal? True Are -18/19 and -23 equal? False Are -3/4352 and -1 unequal? True Are 1 and 81/764 equal? False Is 7/2797 at least as big as -1? True Is 2 != 0? True Is -3/2 greater than or equal to -58/17? True Is 35779 smaller than 35779? False Is 22813 >= 22813? True Which is smaller: 31/7 or 4? 4 Which is bigger: -63 or -65? -63 Is -43 less than 17/6? True Which is smaller: 1/7 or -1? -1 Is 25/639 at most -1? False Are 53 and -29 non-equal? True Is -5/6 < 336? True Is 25 > 185/7? False Which is smaller: 0 or 2/303? 0 Is 2716 less than or equal to 2717? True Which is smaller: -7/46 or -17? -17 Is 51 <= 50? False Is -4379 > -4378? False Are 21 and 18 non-equal? True Are 1 and 18/2317 unequal? True Do 7310 and 7308 have different values? True Is 6 at least 0.018? True Do -127 and -0.3 have the same value? False Which is smaller: 4738 or 4734? 4734 Is 12 bigger than 168/13? False Do 65 and -136/3 have different values? True Do 2 and 61/10 have the same value? False Which is smaller: -2/9 or -40? -40 Is -14 less than or equal to -314/21? False Is 0 at least 3/188? False Do 0 and -0.363 have the same value? False Which is greater: 779 or 778? 779 Which is bigger: 173/77 or -1? 173/77 Which is greater: 1 or -4/61? 1 Does 1640 = 1640? True Is -11695 not equal to -11697? True Is -567 > -566? False Which is smaller: -2 or -2396? -2396 Which is smaller: -46 or -45? -46 Is -2513 less than or equal to 0? True Is 12 at most -7? False Is -14 greater than 1? False Which is bigger: -132 or -137? -132 Which is smaller: 0.3 or 0.261? 0.261 Is 3.1 at most 8? True Which is smaller: -94 or -81? -94 Are 1245 and 1248 unequal? True Which is bigger: -5/3 or -4? -5/3 Which is smaller: -498 or -502? -502 Is 70 smaller than 78? True Which is smaller: 0 or 3/778? 0 Is -1155 smaller than -1156? False Which is smaller: 3 or -116? -116 Is 0.1 at most -187? False Are -33 and 2/257 non-equal? True Which is greater: 0 or -3/59? 0 Is 1 smaller than 6/4403? False Which is bigger: -363 or -366? -363 Is -1779 equal to -1779? True Is -0.00032 greater than 1? False Is -524 greater than -1571/3? False Is -109 equal to -1648/15? False Is 1 at least 3/68? True Is -1.6232 less than 1/4? True Which is smaller: 1/3 or -0.082? -0.082 Which is bigger: 4 or -73? 4 Which is smaller: -1/5 or -656/7? -656/7 Is 1419 >= 1418? True Which is smaller: 19/145 or -1? -1 Are -378 and -377 equal? False Which is smaller: 3/4708 or 1? 3/4708 Are 47 and 228/5 unequal? True Which is smaller: -925 or -2/3? -925 Which is bigger: 33 or 13? 33 Is 0 smaller than 1? True Is -1001 bigger than -1001? False Are 0 and 14/13 non-equal? True Is -11 >= 1629? False Which is bigger: -18 or -20? -18 Which is greater: 15 or 113? 113 Which is bigger: 6/295 or 1? 1 Which is smaller: 2/5377 or -1? -1 Which is smaller: 95/9 or 12? 95/9 Which is smaller: -10 or -0.1? -10 Which is smaller: 1 or 2/9733? 2/9733 Is -5982 at most -5981? True Is -10459/6 < -1744? False Are 0 and -4/37 nonequal? True Which is smaller: -13 or 23? -13 Do -10412 and -10411 have different values? True Are -2711 and -1 equal? False Which is greater: 7/4 or -29/5? 7/4 Is 753 at most 754? True Which is smaller: -18 or 2/7? -18 Are 4.7 and 0 nonequal? True Which is greater: -0.1 or 9/8? 9/8 Is -324 less than or equal to -324? True Which is greater: 2/733 or -1? 2/733 Is 13 less than or equal to -37? False Which is bigger: 1/3344 or 1? 1 Which is smaller: -2/9 or 273? -2/9 Which is greater: 31/1062 or -1? 31/1062 Is 0 less than 21/239? True Which is bigger: -43/234 or -1? -43/234 Is 2 bigger than -4/845? True Which is smaller: -2417/4 or -605? -605 Is -1/2 at most -2225? False Do 49 and 47 have the same value? False Which is smaller: -622 or -3108/5? -622 Which is bigger: -149 or 0.1? 0.1 Is -237 at most as big as -1903/8? False Is 30 less than 625/21? False Is 25/4 smaller than 2/9? False Which is smaller: -1/18 or -7.1? -7.1 Which is smaller: -2 or 0.036? -2 Which is bigger: 1 or -2066? 1 Is 0 at most as big as 0.024? True Is -217/13 >= -18? True Is -41 < -38? True Is 6 not equal to 16? True Do 29 and 29 have the same value? True Is -4 > 182? False Is -0.62 less than -0.06? True Is -2/479 at most -1? False Is -4523 at least -4521? False Is 570 != 571? True Is -118 at most 10? True Which is smaller: 1 or -118/371? -118/371 Which is greater: -312 or -311? -311 Is 81/5 equal to 15? False Is 1 greater than or equal to 3/905? True Are 909 and 909 nonequal? False Is 4 >= -40.2? True Which is smaller: -30 or 22? -30 Which is smaller: 41/183 or 0? 0 Which is bigger: -290 or -285? -285 Are 2/5 and 1.53 nonequal? True Is 1/7 less than -0.076? False Is 19 smaller than 19? False Is 6836 greater than 6835? True Is 180 at	{ "pile_set_name": "DM Mathematics" }
(sqrt(108)/(-1sqrt(6)))/sqrt(6). -sqrt(3) Simplify sqrt(343) + (sqrt(343) - 2sqrt(343)) + -3. -3 Simplify 6(sqrt(76)/sqrt(4) + sqrt(19) + -3)1. -18 + 12sqrt(19) Simplify (sqrt(65)2)/sqrt(5) + -1. -1 + 2sqrt(13) Simplify (sqrt(133) - 3sqrt(133)-1)/sqrt(7). 4sqrt(19) Simplify 4 + (-2 + -1sqrt(13) + 2)2. 17 Simplify -6(5 + 1 + sqrt(19)) + 2. -34 - 6sqrt(19) Simplify (-3sqrt(114)-6)/(sqrt(6) - sqrt(96)6). -18sqrt(19)/23 Simplify (-5(0 + sqrt(245)) + -5)*2 + -2. 350sqrt(5) + 6148 Simplify ((sqrt(242)1)/sqrt(11))/(sqrt(275)-2 - sqrt(11)). -sqrt(2)/11 Simplify (-4-5sqrt(52)/(sqrt(4) - -4(sqrt(4) + sqrt(8)/sqrt(2))))2. 5200/81 Simplify ((sqrt(65)/sqrt(5) + -4)-3)*2. -72sqrt(13) + 261 Simplify (-4 + sqrt(2)-1 + sqrt(2))2 + (sqrt(18)1)*2. 34 Simplify 3(sqrt(143) + (-1sqrt(143) + sqrt(143) - sqrt(143)) + sqrt(143) + sqrt(143))/sqrt(11). 6sqrt(13) Simplify (-3sqrt(1375) - sqrt(55))/(2(sqrt(25)/sqrt(5) + sqrt(5)) - sqrt(5) - sqrt(5) - sqrt(5)). -16sqrt(11) Simplify (-4sqrt(98))*2 + 0. 1568 Simplify (((sqrt(1584) + 1 - sqrt(1584)) + -5 - sqrt(1584)) + sqrt(1584) + -1(-3 + sqrt(1584)))*2. 24sqrt(11) + 1585 Simplify 4(-5 + sqrt(209)/sqrt(176)). -20 + sqrt(19) Simplify (-3 + 1 + sqrt(242))2. -44sqrt(2) + 246 Simplify (sqrt(63)/sqrt(28))/(sqrt(27) - (sqrt(27) + sqrt(135)/sqrt(5))). -sqrt(3)/6 Simplify (sqrt(84)/(sqrt(12) - (-2sqrt(96))/sqrt(8)) - (sqrt(847) + 1)-5)*2. 1660sqrt(7)/3 + 193117/9 Simplify (sqrt(225)/(sqrt(25)/sqrt(5)) + sqrt(45))/sqrt(144). sqrt(5)/2 Simplify -3((sqrt(3) - (4((sqrt(12))*2 - sqrt(3)) + sqrt(3))) + sqrt(3)). -15sqrt(3) + 144 Simplify (-2(sqrt(112) - sqrt(112)-1)2 + ((1 + (0 + sqrt(112) - sqrt(112)))2 - sqrt(112)))-6. 24sqrt(7) + 5370 Simplify ((sqrt(80) + 2sqrt(80))/sqrt(10))2. 72 Simplify (-2 + sqrt(567)-2 - (2(1 + sqrt(567)) - sqrt(567)))2. 216sqrt(7) + 5119 Simplify (2sqrt(396)4 - sqrt(396))*2 + sqrt(396). 6sqrt(11) + 19404 Simplify (sqrt(600)2)/(sqrt(3)-25). -2sqrt(2) Simplify -1((sqrt(1100)-4)*2 + -4). -17596 Simplify sqrt(28)/sqrt(4)1 + 5. sqrt(7) + 5 Simplify 1((sqrt(208) + 0)2 + sqrt(208) - sqrt(13))6. 18sqrt(13) + 1248 Simplify (2sqrt(70)-2)/sqrt(10). -4sqrt(7) Simplify ((sqrt(117) + sqrt(117)-4 + sqrt(117) + sqrt(117))3)/sqrt(9). -3sqrt(13) Simplify (-5sqrt(200)-23)*2. 180000 Simplify 6(sqrt(176) + -1)*2. -48sqrt(11) + 1062 Simplify 2sqrt(76)1. 4sqrt(19) Simplify -3 + (sqrt(3) - sqrt(108)). -5sqrt(3) - 3 Simplify (sqrt(1960)2)/(-1sqrt(32)/sqrt(4)). -14sqrt(5) Simplify (1 + sqrt(17))6 + -1 + sqrt(17) + 0. 5 + 7sqrt(17) Simplify (sqrt(612) + -3sqrt(612)-1 + sqrt(612) + (sqrt(612) - (sqrt(612) + 1)-1))*2. 84sqrt(17) + 29989 Simplify 5-5((0 + sqrt(5) + -1)*2 + -1). -125 + 50sqrt(5) Simplify ((1 + sqrt(19))*2 + -4)-4. -64 - 8sqrt(19) Simplify sqrt(228)/sqrt(108) + 3 + -2sqrt(19). -5sqrt(19)/3 + 3 Simplify -2(sqrt(272)-54)*2. -217600 Simplify (sqrt(17) + -1 + -4)-6. -6sqrt(17) + 30 Simplify -5(((-1sqrt(153))/sqrt(9))2 + 5). -110 Simplify -1(6sqrt(2)1 - (sqrt(8) + (sqrt(8) + sqrt(8) + 0 - sqrt(8))))*2. -8 Simplify (sqrt(84) - ((sqrt(84) + -2sqrt(84)2 - sqrt(84)) + sqrt(84)))/sqrt(12)2. 8sqrt(7) Simplify (1sqrt(605) + sqrt(605) - sqrt(45)-4)2. 5780 Simplify sqrt(405)/sqrt(9) - (3 + sqrt(5)-1). -3 + 4sqrt(5) Simplify (sqrt(2299)1 + 4sqrt(76))2. 6859 Simplify (sqrt(7) - (sqrt(7) + (sqrt(7) - sqrt(63))))2-5 + 4 + sqrt(112) + ((sqrt(28) + 1)-2 - sqrt(28))2. 28sqrt(7) + 120 Simplify 1 + sqrt(99)/(sqrt(9)-2). -sqrt(11)/2 + 1 Simplify (1(sqrt(1008)/sqrt(7) - sqrt(9))/sqrt(3))*2. 27 Simplify (2sqrt(96))/(sqrt(108)-2). -2sqrt(2)/3 Simplify ((sqrt(114)-2 + sqrt(114) + sqrt(114))1 + sqrt(114) + sqrt(114) - sqrt(114))/(sqrt(60)/(sqrt(10)2)). 2sqrt(19) Simplify ((0 + sqrt(162) - sqrt(162) - sqrt(162)) + sqrt(2) + sqrt(686)/sqrt(7))*2. 2 Simplify -5 + (4 + 1 + sqrt(5))3. 3sqrt(5) + 10 Simplify (-2(sqrt(5) - (2 + sqrt(5))6))2. 480sqrt(5) + 1076 Simplify sqrt(3)-64 + sqrt(18)/(sqrt(6)-4). -97sqrt(3)/4 Simplify (1 + sqrt(17) + 1 - (((sqrt(17) + (sqrt(153) - sqrt(17)))4 - sqrt(17)) + sqrt(17)))2-3. -6183 + 132sqrt(17) Simplify (0 + sqrt(50))2 + -2. 48 Simplify (6(-2sqrt(102)-2)/sqrt(6))*2. 9792 Simplify ((sqrt(133) + 1sqrt(133) + sqrt(133))/sqrt(7) - sqrt(19) - 1sqrt(76))2. 0 Simplify (1(sqrt(432) + (sqrt(432) - 5(sqrt(432) - (sqrt(432) + 0 - sqrt(432))))) + -2)2. 144sqrt(3) + 3892 Simplify 2((2 + -3 + sqrt(11))-3)*2. -36sqrt(11) + 216 Simplify sqrt(320)/sqrt(4) - (sqrt(5) + (sqrt(55)/(sqrt(22)/sqrt(2)))*2). -5 + 3sqrt(5) Simplify 5 + (1 + sqrt(32))*2 + sqrt(14)/sqrt(63). 25sqrt(2)/3 + 38 Simplify (-6(sqrt(204)/sqrt(6) - sqrt(34)) + sqrt(34))/(-3sqrt(72)). -sqrt(17)/18 Simplify (sqrt(143)/(sqrt(33)/sqrt(3)))2 + (2 + sqrt(39)/sqrt(3))2. 4sqrt(13) + 30 Simplify (sqrt(1539) - (sqrt(1539) - (sqrt(1539) - (3 + sqrt(1539))))) + (2 + sqrt(19))1. -1 + sqrt(19) Simplify (sqrt(2299) + -4sqrt(2299))2-5. -103455 Simplify 3sqrt(117)/(sqrt(27)/sqrt(3))-64. -72sqrt(13) Simplify (-5(-4 + sqrt(468) + sqrt(468) + -1))2. -3000sqrt(13) + 47425 Simplify (-1sqrt(11)3 - (-5 + (sqrt(33)/sqrt(3))*2))-5. 30 + 15sqrt(11) Simplify 4 + (-1sqrt(28)1)2. 32 Simplify 4 + -1 + (sqrt(1331) + 0)-2. -22sqrt(11) + 3 Simplify (sqrt(84) + -6(2sqrt(84) + sqrt(84) + sqrt(84)))/(-3(sqrt(36)/sqrt(3) + sqrt(12) + sqrt(12))). 23sqrt(7)/9 Simplify (5(5 + sqrt(1100) + (sqrt(1100) + 1)-1))2. 400 Simplify (461sqrt(1900))*2. 1094400 Simplify sqrt(605)4 + -2. -2 + 44sqrt(5) Simplify 6-5sqrt(18). -90sqrt(2) Simplify -2(-3 + (sqrt(468) - (sqrt(468) - (-5 + sqrt(468)))2)). -12sqrt(13) + 56 Simplify (sqrt(6480)-4)/sqrt(9). -48sqrt(5) Simplify sqrt(7) + sqrt(14)/sqrt(2) + 2 + -3(sqrt(28)/sqrt(4))2. -19 + 2sqrt(7) Simplify (sqrt(153)/(sqrt(576) + -2sqrt(576) - sqrt(576)))2. 17/256 Simplify 5 + (2 + sqrt(192))2. 32sqrt(3) + 201 Simplify (sqrt(99)/(sqrt(9) - 2sqrt(9)) + -4)-3. 3sqrt(11) + 12 Simplify -2(-1sqrt(448) + sqrt(7)). 14sqrt(7) Simplify ((-3sqrt(2)5 + 2)3)2. -540sqrt(2) + 4086 Simplify (-53sqrt(228) + sqrt(228) - sqrt(228) - sqrt(228))/(1sqrt(48)). -8sqrt(19) Simplify -1sqrt(152)/sqrt(8) + ((sqrt(152)1)/sqrt(8))*2. -sqrt(19) + 19 Simplify 3sqrt(6)/sqrt(2) + sqrt(27) + 1. 1 + 6sqrt(3) Simplify 0 + sqrt(272) + -1. -1 + 4sqrt(17) Simplify (sqrt(320) + (sqrt(320) + 1)*2)-6. -1926 - 144sqrt(5) Simplify -3 + 2sqrt(245). -3 + 14sqrt(5) Simplify -4 + (sqrt(891) - (1 + sqrt(891))). -5 Simplify -1sqrt(500) + 0 - sqrt(500). -20sqrt(5) Simplify (sqrt(1872)-2 + -3)2 + (sqrt(1872) + 0)2 + -5. 144sqrt(13) + 9364 Simplify (sqrt(189)-6)/sqrt(7). -18sqrt(3) Simplify (((sqrt(65) - (sqrt(65) + (2sqrt(65) - sqrt(65))))/sqrt(5) - sqrt(13)) + -5)*2. 20sqrt(13) + 77 Simplify (sqrt(88)/sqrt(4)-1 + sqrt(22))/sqrt(11) + -1. -1 Simplify (sqrt(60) + sqrt(120)/sqrt(2))/sqrt(12) + 2 + (sqrt(5) - sqrt(45))2 + 2 + 4. 2sqrt(5) + 28 Simplify (sqrt(75) + sqrt(75)33 + sqrt(75) + sqrt(75))*2 + sqrt(75)2-2. -20sqrt(3) + 10800 Simplify (-2(-1 + (sqrt(700) - (3sqrt(700) - sqrt(700)))))*2. 80sqrt(7) + 2804 Simplify sqrt(170)/(sqrt(20)/(sqrt(2) + sqrt(6)/sqrt(3))) + 5. 5 + 2sqrt(17) Simplify (sqrt(847) - ((-1 + sqrt(847))5)*2)-2 + 3. -1122sqrt(7) + 42403 Simplify 3(sqrt(847) + sqrt(847) + 1 + (sqrt(28)/sqrt(4))*2 + -3 + -5). 66sqrt(7) Simplify sqrt(500)5. 50sqrt(5) Simplify ((sqrt(45) + (sqrt(45) - -6sqrt(360)/sqrt(8)))/((sqrt(126)/sqrt(2))/sqrt(7)))2. 320 Simplify (sqrt(170)-1-5)/((-2sqrt(70))/sqrt(7)). -5sqrt(17)/2 Simplify (5(sqrt(700) + -2) + 3)*2. -700sqrt(7) + 17549 Simplify (sqrt(117) + -11sqrt(117))/(5sqrt(27)/sqrt(3) + sqrt(9)). 0 Simplify (sqrt(432) + sqrt(432) + (sqrt(432) - (sqrt(432) + 0)) + -1)2 - 1sqrt(432)-2. -24sqrt(3) + 1729 Simplify (sqrt(1080)1 + sqrt(1080) + sqrt(1080))/(sqrt(10) + 2(sqrt(10) - 1sqrt(10))). 18sqrt(3) Simplify -5sqrt(48)2. -40sqrt(3) Simplify (sqrt(968)2)/(1sqrt(28)/sqrt(7)). 22sqrt(2) Simplify (((sqrt(21) - (sqrt(63)/sqrt(3) - sqrt(21))) + sqrt(21))-1)/(sqrt(84)/(sqrt(48)/sqrt(4))). -2sqrt(3) Simplify ((sqrt(2448) - 2*sqrt(2448)) + sq	{ "pile_set_name": "DM Mathematics" }
= -136 - g. Solve -7 = im + 8 for m. -3 Suppose 6u - u = 65. Suppose 0 = -5a + y + 21, -5a - 179 + 198 = y. Solve -ul = -al - 9 for l. 1 Let i be (-2 - (-48)/8) + (147 - -2). Solve 54n = i + 63 for n. 4 Suppose 5z = -25 + 5, -2i - z = -6. Suppose 0 = 2d + 3n, -id = -0n - 3n - 21. Solve v = -dv for v. 0 Let o be (-72)/(-6) + -9 - 1(-2 - 0). Solve -42 = ow - 7 for w. -7 Suppose -3u = 2u - 20. Suppose f = uf. Suppose 3b + fb = 6. Solve -4o + 2 = -b for o. 1 Let j(v) = 1. Let b(p) = 19p - 2. Let n(z) = b(z) - 3j(z). Let a be n(1). Let s be (-8)/a + 32/7. Solve -w + 0w = -s for w. 4 Suppose -214k = -116k - 1176. Solve -158 + 146 = -kg for g. 1 Let m(a) = -17a - 80. Let x(c) = -11c - 53. Let q(p) = 5m(p) - 8x(p). Suppose 4t + 15 = -13. Let w be q(t). Solve -w = -5v + 7 for v. 2 Let d(g) = -5g*2 - 5g - 5. Let l be d(-2). Let n be 17/(-2) - (l/2)/(-5). Let s = -10 - n. Solve s = j - 3j for j. 0 Let v(d) = 14d + 42. Let i be v(-3). Suppose i = -2t + 6t - 24. Solve tx = -0x - 12 for x. -2 Let r = 152 - 166. Let v be (-208)/r - 2/(-14). Solve vc + 2 = 16c for c. 2 Let j = -6139 - -6139. Solve 4i - 23 + 39 = j for i. -4 Let a(z) = -z3 + 12z*2 + 45z + 39. Let k be a(12). Solve -574f + kf = 20 for f. 4 Suppose -v - 2i + 13 = 0, 4i - i = v + 7. Suppose 992j = 987j + v. Solve 0 = -5w - 6 + j for w. -1 Suppose 5z - 328 = -328. Let i(q) = q*3 - 15q*2 - 17q + 22. Let h be i(16). Solve z = -hl + 10l + 4 for l. -1 Let p(y) = 4y - 5. Let s(a) = -11a + 14. Let h(w) = -8p(w) - 3s(w). Let f be h(6). Suppose -671 = -271m + 142. Solve fz - z = -m for z. -1 Let f(m) = m*3 - 16m*2 - 37m - 10. Let y be f(18). Let u = y + 37. Solve -u + 23 = 7g for g. 2 Suppose 5s - 5t = -5, 24 = 3s + 5t - 13. Solve sp = -16p - 160 for p. -8 Let w(z) = -z + 2. Let l = 1 + -5. Let a be w(l). Suppose 42h + 12 = 3n + 39h, 0 = -5n + 2h + 8. Solve n = 2j + a for j. -3 Let q be 188 - (-2)/(-10)40. Solve 11b - q = -19b for b. 6 Let m = -40 - -67. Suppose 4z - 190 - 1078 = -b, 3z - 3b = 966. Let q = 325 - z. Solve 4k + q - m = 0 for k. 5 Let k be (4/(-10))/(6/3603). Let y(v) = -4v*3 - 32v*2 + 3v + 38. Let p be y(k). Solve -p - 2 = 8c for c. -2 Let d(l) = -4l*2 + 109l - 635. Let h be d(18). Solve 54 = -22f + hf for f. 6 Suppose -4t + 19 + 1 = 0. Let k = -2396 + 2395. Let u be (t + (-5)/1)/k. Solve -5x + 3x = u for x. 0 Suppose 4g - 4 = 0, 28 = -4m - 5g - 399. Let f = -143 - m. Let w be -3 + -1f/5. Solve wv + 4 = -0 for v. -1 Suppose 0 = 420a - 412a - 32. Let i be -3 - 3/(3/(-23)). Suppose 3z + z = 3z. Solve -af + z = -i for f. 5 Let h(b) = b3 + 79b*2 - 39b - 3078. Let j be h(-79). Let z = 15 - 3. Let s = 6 - 3. Solve -sp + j = -z for p. 5 Let s be 0(4/(-6))/(120/180). Solve -69g + 101g + 192 = s for g. -6 Let s(d) = 103d + 1032. Let c be s(-10). Solve 48w + c = 46w for w. -1 Let p(l) = 6l - 51. Let h be p(10). Suppose m = 4m - 3c, c - 2 = 0. Solve -3 + h = -my for y. -3 Suppose -4z + 5z + 4 = 0. Let h be z/(-18) + (87/(-27) - -6). Suppose -x + hx = -7x. Solve xq - 4 = -4q for q. 1 Let x be 0 + -11(0 - 1) - (-324 - -316). Solve -xc + 102 = -2c for c. 6 Let k(x) = 36x2 - 2 + 116x*3 + 0x - x - 112x3 - 34x*2. Let y be k(1). Solve -7 = 10n - yn for n. -1 Suppose -3i = -7 + 13. Let y be (1 - i)39/3. Let r = -29 + y. Solve -7x = -2x - r for x. 2 Suppose 6 = 15d - 16d - 3k, 2 = -d - k. Suppose -p - 3z = 2, p - 21z + 18z - 10 = d. Solve ph - 2 = -6 for h. -1 Let s be ((-2)/4)/(1/(-4)) + 127. Let b = s + -131. Let d be b((-3 - -4) + -5). Solve -g - g = d for g. -4 Let o = -40575 - -40581. Solve 0 = -3z + 12 + o for z. 6 Let j(a) = 2a2 - 26a - 55. Let f be j(16). Let o = 45 - f. Solve 5p + o + 11 = 0 for p. -3 Suppose 0 = -2o - s + 195, -8s = 15o - 18o + 245. Solve 0 = -oc + 100c - 15 for c. 3 Suppose 3459x = 3465x - 36. Solve -xc + 10c - 16 = 0 for c. 4 Let l be (1/5)/(74/1850). Suppose w - 7 + 0 = 0. Solve -w = -lj - 2 for j. 1 Let c(p) = -2p + 22. Suppose 12 = -3z - 5j, j + 23 + 19 = -5z. Let r be (z/(-2))/((-20)/(-40)). Let u be c(r). Solve -x + 5 - u = 0 for x. 1 Suppose 89k + 2376 = 46k + 65k. Solve 0 = kw - 109w - 2 for w. -2 Let r(n) = 3n + 11 - 14n + n2 + 2n. Let q be r(8). Suppose qb - 5 + 18 = 5u, 0 = -4u - 5b + 3. Solve 2 = -w - u for w. -4 Suppose -15m + 8m - 6804 = 0. Let q = -954 - m. Solve 0 = 9p - 9 - q for p. 3 Suppose -4t = 15w - 13w - 6020, -2t + 8w = -3028. Solve 0 = -5k - t + 1486 for k. -4 Let y(m) = 79m - 158. Let s be y(2). Let u(c) be the second derivative of 2c3/3 - 8c. Let g be u(2). Solve s = -2r + 4r + g for r. -4 Let p = 4251 - 4223. Solve -48 = pw - 52w for w. 2 Let s = 5672 - 5639. Solve 6p + s = -5p for p. -3 Suppose 26g - 12g - 9775 = -9g. Solve 94t - g = 9t for t. 5 Suppose 40845 + 857 = 29t. Solve t = 5r + 1478 for r. -8 Let a(z) = 304z + 2401. Let d be a(-7). Solve -dy = -279y - 18 for y. -3 Let l(c) = -c*3 + 24c*2 - 190c + 1831. Let b be l(10). Solve b = -3r + 1328 for r. -1 Let i be 16/14 + 1/(-7). Let j be 2 - i - 144/(-18). Let g be 3(6/j + 1). Solve gp = p + 8 for p. 2 Let m(q) = -2q*2 - q + 41. Let u be m(0). Let b(g) = 5g*2 + 4g + 8. Let v be b(-3). Let f = v - u. Solve 3h + h = f for h. 0 Let i(m) = 13m + 15. Let r be i(-1). Let j be -12((-17)/(-6))/(-17)r. Solve -6 - 2 = jn for n. -2 Let b(d) be the second derivative of 5/6d*3 + 0 + 0d*2 - 11d. Let j be b(1). Solve -5 = 5g + j for g. -2 Let m = 85 + -82. Suppose -16 = -w - mz, 20 = -w + 4z + 1. Let o be (-2w)/(30/(-75)). Solve -op = -0p + 25 for p. -5 Let x(c) = -c*3 - 9c*2 + 9c - 15. Let k be x(-10). Let z be (-4 + 39/6)(-6)/k. Let i be (-11 + -1)z/(-6). Solve -3b - 9 = -ib for b. 3 Suppose -7p + 42 = -4p. Suppose -9u + pu - 20 = 0. Suppose 2l + 8 = ul + 2b, l + 4 = 3b. Solve -8 = 2f - l for f. -3 Let r be ((-6)/(-96)4)/((-17)/(-748)). Solve 133 = -8k - rk for k. -7 Suppose 0p + 27 = 2p + 5a, 2p - 12 = -2a. Let t(l) = l3 - 3l*2 - p + 1 + 23l - 20l. Let q be t(2). Solve -q = -c - 7 for c. -5 Let s(r) = r2 + 3r - 11. Suppose -5 = 3w + 2w, -8 = -y + 2w. Let o be s(y). Let b = -40 + o. Solve 0 = -bn - 1 - 11 for n. -4 Suppose -9p - 14 = -16p. Suppose pt = 5l - 135 + 399, 0 = l + t + 57. Let y = -52 - l. Solve 0 = -2h - yh for h. 0 Let x = -13937 + 14088. Solve -3s - 130 + x = 0 for s. 7 Let u(o) = -3o*3 - 5o*2 + 10o + 2. Let f be u(3). Let a = f + 106. Solve 4 = 2r + a for r. -4 Let f = -194 - -209. Suppose 5m = -0m + f. Solve m = -3w - 6 for w. -3 Suppose 6c + 55c = 17080. Solve -103d + 143d = c for d. 7 Let z be (1 - 7)(-8)/(-24)2. Let t be -1 + (12/16)/((-1)/z). Solve b + 1 = t for b. 1 Let h(q) = -4q2 - 8q - 12. Let f be h(-5). Let x = f + 72. Suppose 0 = 4r + o - 12, 2r + 3o + 2 + 2 = x. Solve n - r = -0 for n. 4 Let p be (1 + 0)/(8/24). Let h be ((-1)/p)/((-175)/(-45) + -4). Solve 4v - hv = 0 for v. 0 Let q be (-3)/(2/(-1) - -1). Suppose -4s = 4, 5v + s - 63 = 11. Suppose 88 = vk - 137. Solve qb = -2b - k for b. -3 Let y be ((-1)/(2/4))/(67/(-67)). Let w be 8/61/(y/(-3)). Let g be 0 - w/(-2) - -4. Solve 7 + g = 2k for k. 5 Let a = -360 - -352. Let t be (-12)/a + (-2 - 7/(-14)). Solve 5v - 28 + 3 = t for v. 5 Let v be 0/(21) - 0. Let s = -289675 + 289677. Suppose 0 = -5n - u + 13, 0n + 2n + 3u - 13 = 0. Solve 4y + n + s = v for y. -1 Let w(n) = -5n - 10. Let x be 5/((-220)/(-8)) - (-35)/(-11). Let r be w(x). Solve -ru - 20 = -u for u. -5 Let z(w) = w3 + 6w*2 + 215w + 1050. Let n be z(-5). Solve 9h + 58 - 130 = n for h. 8 Let t(r) = 2r*2 - 5r - 17. Let k(z) = -z*3 - 6z*2 + 6z + 2. Let n be k(-7). Suppose 0 = nb - 5b - 24. Let v be t(b). Solve 2d - 7d = v for d. -5 Suppose 3w + 24 = 2r - 17, -4r - 4w = -32. Let n = -14 - -17. Suppose nd = 15, -d - 1 = k - 2d. Solve -kq - 7 = r for q. -5 Let n be -2(205/82)/(2/(-20)). Solve -53o + n = -43o for o. 5 Let t = -4109 - -4191. Solve -t = 12n - 10 for n. -6 Let o(c) = c2 + 7c + 6. Let u be o(-2). Let f(v) = -v*3 - 3v*2 + 6v + 5. Let t be f(u). Let d be 63/27 + t + 77/3. Solve 3k - d = 8k	{ "pile_set_name": "DM Mathematics" }
= 4c2. Determine i(y(n)). 576n*4 Let b(k) = -95 + 2k + 95. Let v(y) = 15y + 4. What is b(v(o))? 30o + 8 Let r(v) = 6v. Let i = -2021/3 + 674. Let b(u) be the first derivative of 0u*2 - 2 + 0u - iu3. Determine r(b(n)). -6n*2 Let w(b) = -49b. Let h(q) = 187q2 + q. Calculate h(w(r)). 448987r*2 - 49r Let t(v) = -5v2. Let j be 18 + 1/44. Let h = 122 - j. Let d(m) = -2m2 - 103 + h. Give t(d(f)). -20f*4 Let i(f) be the third derivative of -5f*4/8 - 131f*2. Let g(b) = 31b. Give i(g(s)). -465s Let r(b) = -2b*2. Let g(a) = 413244a*2. Determine r(g(m)). -341541207072m*4 Let x(j) = 10j*2. Let i(q) = 132949q. Determine i(x(f)). 1329490f2 Let x(l) = -3l + 46. Let g be x(14). Let u(y) be the third derivative of 10y2 - 7/24y*g + 0y*3 + 0y + 0. Let t(c) = -3c. Determine t(u(h)). 21h Suppose -t + 6t = 30. Let g(s) = -6 + 0 + t - 4s. Let z(b) = 2b2 - b. Let a(j) = 7j*2 - 3j. Let i(k) = -2a(k) + 6z(k). Determine i(g(v)). -32v2 Let z(x) = -3x*2. Let o(j) be the second derivative of -23j4/12 + j2 - j - 21. Calculate z(o(w)). -1587w4 + 276w*2 - 12 Let j(k) = 7 - 5k2 + 0 - 3 - k2 - 4k. Let s(f) = -5f*2 - 3f + 3. Let w(z) = 3j(z) - 4s(z). Let a(r) = -10r. Calculate w(a(u)). 200u*2 Let f(v) = -4v. Let q(l) = -16789l + 1. Determine f(q(b)). 67156b - 4 Suppose d = 3 - 1. Let o(q) = 2 - 2 + 4qd. Let s(n) be the first derivative of n3/3 - 11. Determine s(o(i)). 16i*4 Let i(x) = -159x. Let r(o) = 64o - 191o + 65o + 61o. Calculate r(i(b)). 159b Let j(y) = -37y - 2. Let x(t) = -100 + 11t + 100 - 6t - 3t. Calculate x(j(i)). -74i - 4 Let b(w) = 2w. Let f(r) = -3r*2 + 106028r. What is b(f(v))? -6v2 + 212056v Let r(z) = 35z + 7. Let v(f) = 24f + 5. Let m(k) = -5r(k) + 7v(k). Let s(a) = 6a - 2a - 3a. What is s(m(q))? -7q Let z(p) = -6p2. Let s = 48 + -15. Let t(f) = -35f + 64f - sf. What is t(z(l))? 24l2 Let d(h) = -13486h. Let x(s) = 28s2. What is d(x(k))? -377608k*2 Let t(w) = -2w - 3. Let f(u) = 0u + 2u - 4u + 4u + 0u. Give t(f(v)). -4v - 3 Let t(a) = -356a. Let i(s) = -18s + 1 + 11s + 5s - 1. What is t(i(j))? 712j Let t(n) = -7n. Let i(h) be the first derivative of 0h2 - 4/3h*3 + 0h - 7. Calculate i(t(b)). -196b2 Let w(s) = 3s*2 + 10s. Let d(k) = -5k2 + k2 + 4k*2 - 5k*2. Give w(d(u)). 75u*4 - 50u*2 Let c(a) be the third derivative of 0a - 4a2 + 1/20a*5 + 0a*4 + 0 + 0a*3. Let n(j) = 2j*2. Determine c(n(u)). 12u4 Let i(x) = x2 + 2x + 1. Let n(q) = -107q*2 + 12q + 6. Let b(z) = -6i(z) + n(z). Let k(j) = -2j. Calculate b(k(m)). -452m2 Let q(l) = 22l*2 + 2l - 2. Let j(s) = 86s2 + 9s - 9. Let g(v) = 2j(v) - 9q(v). Let x(z) = 3z2 + z2 - 6z*2. What is x(g(b))? -1352b*4 Let s(n) = -2n*2. Suppose -19 = -28w + 27w. Let y(q) = -5 + 2 + wq + 3. Calculate s(y(x)). -722x2 Let n(u) = -2u + 538. Let b(i) = -570 - 15i + 7i + 570 + 10i. Calculate n(b(q)). -4q + 538 Let j(r) be the first derivative of -r*3 - 852. Let m(k) = k - 1. Let d(z) = 12z - 20. Let g(x) = d(x) - 20m(x). Calculate j(g(h)). -192h*2 Let a(g) = 2g. Let z(i) = 10i3 + i2 + i + 1. Let p be z(-1). Let b = p + 14. Let c(r) = b - 5 - 4r + 0. Calculate c(a(u)). -8u Let i(y) be the first derivative of 25 + 3/2y*2 + 0y. Let f(n) = -10n. What is f(i(x))? -30x Let j(g) = 143g2 + 91g*2 - 281g*2. Let s(i) = 10i*2. Calculate j(s(x)). -4700x*4 Let r(m) be the third derivative of -7m*6/72 + 8m*3/3 - 18m2. Let v(f) be the first derivative of r(f). Let t(z) = -z2. Give t(v(q)). -1225q4 Let o(r) = -6r + 2r + 5r. Let b(q) = -13q. Let t(p) = 3p. Let d(g) = -2b(g) - 9t(g). Let a(z) = 3d(z) + 5o(z). Let f(v) = -14v. Calculate f(a(u)). -28u Let d(l) = 1007l. Let b(z) = 19z*2 - 3. Calculate d(b(m)). 19133m*2 - 3021 Let k be ((-18)/(-63))/((-1)/((-7)/1)). Let h(o) = -5o*2 + 6o + 14ok - 12o*2. Let i(b) = 2b. Give i(h(z)). -6z2 + 12z Let m(t) be the first derivative of t*3/3 + 228. Let a(k) = -17k*2 + 2. What is a(m(r))? -17r*4 + 2 Let u(i) = 5i. Let w(p) = -6601p2. Calculate w(u(t)). -165025t*2 Let v(g) = 3g. Let d(s) = 21s + 2s*2 - 31s - s*2 - 16s. What is d(v(k))? 9k2 - 78k Let x(y) = y - 489. Let a(v) = -8v2. Give a(x(b)). -8b*2 + 7824b - 1912968 Let d(f) = f*2 - f. Let v(z) = 16z*2 - 3z. Suppose 0 = -9s + 11s - 6. Let u(n) = sd(n) - v(n). Let c(g) = -g. What is c(u(x))? 13x*2 Let n(a) = -2a. Let s(t) be the third derivative of 0t + 1/3t*4 + 0t*3 - 10t*2 + 0. Determine n(s(d)). -16d Let c(w) = -55w. Let o(y) = -y. Let u(a) = c(a) - 44o(a). Suppose -12 = 3j - 5t - 3, -6 = -2t. Let k(v) = 6v - 5v - jv. Determine k(u(s)). 11s Let m(f) = 13f*2 - 5f. Let w(b) = 32b2 - 12b. Let y(g) = 12m(g) - 5w(g). Let t(z) = 16z + 21z - 35z. What is y(t(a))? -16a*2 Let y(f) = 3f. Let x(u) = -2u. Let q(k) = 14x(k) + 6y(k). Let g(n) be the second derivative of n4/2 + n + 21. Determine g(q(b)). 600b*2 Let f = 6 + -1. Suppose -l + 0l + d = -7, 5l = -fd - 15. Let o(t) = -4t2 - lt*2 - 2t*2. Let h(r) = r. What is o(h(q))? -8q*2 Let j(m) = 2m*2 + 1541. Let x(n) = -385n*2. Give j(x(o)). 296450o*4 + 1541 Let x(h) = -22h + 229 - 229. Let v = 10 + -7. Let d(b) = vb - 3b - b + 3b. What is d(x(g))? -44g Let i(l) = -674 + l - 583 + 950. Let d(j) = -3j. Determine i(d(m)). -3m - 307 Let r(p) = p*2 - 6p + 9. Let f be r(5). Let g(v) be the third derivative of 7/60v5 - 8v*2 + 0 + 0v*3 + 0v + 0vf. Let u(a) = -2a. Give u(g(n)). -14n2 Let z(h) = -h2 + 6h - 1. Let g be z(5). Let m(x) = gx2 + 8x2 + x2. Let i(l) be the first derivative of -l*2 + 30. Give i(m(j)). -26j*2 Let x(u) = -6u*2 - 3u - 3. Let t(s) = -5s2 - 2s - 2. Let d(k) = -3t(k) + 2x(k). Let p = 5 + -5. Let f(a) = pa + 2a + a. What is d(f(y))? 27y2 Let s(d) = 3d - 16. Let x(o) = 26837o + 1. What is x(s(n))? 80511n - 429391 Let m(k) be the second derivative of -k*4/12 - 61k - 1. Let b(a) = 284a. Determine m(b(n)). -80656n*2 Let f(p) = -3p - 1419. Let l(b) = -6b2. Calculate l(f(t)). -54t*2 - 51084t - 12081366 Let w(b) = -7b2. Let f(a) = -2601a. Calculate w(f(v)). -47356407v2 Let a(u) = -u2. Let i(p) be the third derivative of p5/120 - p3 - p2. Let v(s) be the first derivative of i(s). What is a(v(y))? -y2 Let y(s) be the third derivative of 0 + 0s + 0s3 - 1/8s*4 - 2s*2. Let n(u) = -2u*2. Give n(y(g)). -18g*2 Let z(u) be the third derivative of -21u*4/4 - 2u2 - 7. Let h(y) = y2. Determine h(z(o)). 15876o2 Let d(m) = -2m. Let h(c) = -3c - 27. Let o be h(-11). Let u(k) = -8k - 6k2 + ok + 2k. Calculate u(d(s)). -24s*2 Let x(p) = -49p*2. Let n(g) = 403g - 198g - 209g. Determine x(n(v)). -784v2 Let r(m) = m2. Let o(q) = 7285080q. Calculate o(r(s)). 7285080s2 Let o(p) be the first derivative of -17p*2/2 - 47. Let s(x) = x. Let f(b) = -3b*2 + 2b. Let d(g) = f(g) - 2s(g). Give o(d(y)). 51y*2 Let x(n) = -6n. Let m(z) = -375z2 + 70z. Let f(k) = 22k2 - 4k. Let g(p) = -35f(p) - 2m(p). What is g(x(h))? -720h2 Let v(f) = -4f + 23. Let c(d) = d - 7. Let j(g) = -6c(g) - v(g). Let l(u) = -5u. Determine l(j(s)). 10s - 95 Let y(s) = -117188s*2. Let w(p) = p. What is y(w(n))? -117188n*2 Let b(a) = -a - 5. Let w(o) = 1. Let l(g) = -2b(g) - 10w(g). Let r(y) = -45y. Let c(t) = 9t. Let v(u) = -21c(u) - 4r(u). Determine v(l(x)). -18x Let r(x) = -9x2. Let k(c) be the second derivative of 2c*3/3 - 2c. Give k(r(g)). -36g2 Let f(r) = -r. Let q(t) = -20t - 347. Let p(d) = -6d - 115. Let h(j) = -7p(j) + 2q(j). Determine h(f(a)). -2a + 111 Let g(v) = 1652222v. Let m(l) = -3l*2. Calculate g(m(j)). -4956666j2 Let u(v) = -v2. Suppose 77 + 40 = 9o. Suppose -3b - 4y - 3 + 65 = 0, y = -4b + 74. Let a(d) = bd - 11d - od. Give a(u(f)). 6f*2 Let v(x) = 45x. Let j(u) = 2970u2. Calculate j(v(i)). 6014250i*2 Let y(p) = 9116p*2. Let u(k) = -8k - 1. Calculate y(u(w)). 583424w2 + 145856w + 9116 Let x(w) = -w. Let s(r) = -2r. Let g(v) = -4s(v) + 3*x(v). Let o(m) =	{ "pile_set_name": "DM Mathematics" }
p - 88p + 62, 0 = 2b + 5p - 16. Sort 4, -149, 2, b. -149, 2, 4, b Suppose 62s + 36 + 93 = 19s. Sort -5, s, -34, 2 in increasing order. -34, -5, s, 2 Suppose -6r = -52 + 64. Let d = 189 + -187. Put -12, r, d, -4 in increasing order. -12, -4, r, d Let t(j) = -j*3 - 36j*2 + 36j - 35. Let v be t(-37). Suppose 40 = -vd + 2. Put d, -5, -1, -4 in increasing order. d, -5, -4, -1 Let j be 55/(-110)1/(-4). Put j, -42, 1, 2 in increasing order. -42, j, 1, 2 Let w = -29408.034 - -29408. Sort 1/2, 3, -0.04, -1, w. -1, -0.04, w, 1/2, 3 Let z = -24.299 + 25.199. Let y = 2.1 + -2. Sort 1, z, 4, y in increasing order. y, z, 1, 4 Let v be -3 - 10(-18)/90. Suppose 3h - 2o - 6 - 22 = 0, -4o = 2h + 8. Put 0, v, h in ascending order. v, 0, h Let k be (-4 + (-4 - -4))/(-2). Suppose -kt - 3t - h - 13 = 0, 4h + 18 = -3t. Let l be ((-3 + 6)/(9/12))/t. Sort -5, l, 1, 5 in decreasing order. 5, 1, l, -5 Let z = 5952 - 5957. Put -0.3, -55.9, z in ascending order. -55.9, z, -0.3 Suppose -9l + 7 = -17l - 1. Sort l, -2, 5/286. -2, l, 5/286 Let v = -19233 + 19235. Put 1, v, -1, 0, 3 in increasing order. -1, 0, 1, v, 3 Let q = -5.97896 + 2.97896. Suppose 4a + 3r = 4r - 3, 0 = -5a + 3r - 2. Let m be a/(-3) - (1 - 1). Put -2, q, m in decreasing order. m, -2, q Let b be 1(2/8 + 647/4). Let l = -157 + b. Sort l, -2, 3. -2, 3, l Let m = -145 + 242. Let t = 97.2 - m. Let c(d) = -d + 1. Let k be c(1). Sort t, k, -4, -5 in decreasing order. t, k, -4, -5 Let f = 0.2 - 0.123. Let k = -25.953 + 26. Let o = f - k. Put -0.3, -3, o in increasing order. -3, -0.3, o Let r = -2.21 - -232.21. Let g = 229.5 - r. Put -11, g, -4/3 in increasing order. -11, -4/3, g Suppose 15 = 3z + 3. Suppose -970 = 5y + 4p, 0 = -5y - 4p + 7p - 970. Let k = y - -197. Put k, 1, z, -1 in descending order. z, k, 1, -1 Let q(x) = -x + 9. Let p be q(8). Suppose 365 = 227w - 316. Let k be 30/4(-16)/(-24). Sort p, w, 2, k in descending order. k, w, 2, p Suppose -661 = -24h - 733. Sort 11, h, -2 in decreasing order. 11, -2, h Let t = 26.041 - 24.461. Sort 2, -2, 10/3, t in descending order. 10/3, 2, t, -2 Let b = -3489 + 3564. Put b, -3, -2, 1 in ascending order. -3, -2, 1, b Suppose 4j + 161 = b, -6b = -b - 5. Suppose 0x - 3c = -2x - 1, -5c = -5x. Put j, x, 5 in descending order. 5, x, j Let j = -14922 + 14922.7. Sort j, 0.428, 0.2 in decreasing order. j, 0.428, 0.2 Let c = -1992/11 + 33853/187. Sort 1, -1/25, -2/19, c in descending order. 1, -1/25, c, -2/19 Let l(t) = -64t + 704. Let r be l(0). Let n = r + -5635/8. Let o = -4.3 - -4. Put n, o, -6.8 in descending order. o, n, -6.8 Suppose 0 = m + 4m - 10. Suppose 13 = mg + 3. Let q = 3486 + -3482. Put g, -2, -1, q in descending order. g, q, -1, -2 Let m = -2 + 6. Suppose 251k = -93k - 238k + 11k + 3426. Put m, 3, k, 0.2 in decreasing order. k, m, 3, 0.2 Let n be (-3 - -2)(-28)/(2 + 2). Let d be (n/(-14))/((-44)/24 + 2). Sort 3, d, 4 in decreasing order. 4, 3, d Let d be (32/(-48))/(36/172152). Sort 0, 4, d in increasing order. d, 0, 4 Suppose 3m = 4a + 17, 0 = 2a + 111m - 110m + 1. Let x = -103/21 - -32/7. Sort a, 2, x, -5/2 in increasing order. -5/2, a, x, 2 Suppose 0 = -4p - k - 15, 939 = 3p - 2k + 942. Sort p, -14, 4, 27, 3 in increasing order. -14, p, 3, 4, 27 Suppose -7u + 756 = 5u. Suppose -5y = -68 + u. Sort y, 41, -1 in decreasing order. 41, y, -1 Let y(g) = -2g - 21. Let k be y(-12). Suppose 5v + 8h - 10h + 12 = 0, -2v + h = 5. Sort k, v, 5 in descending order. 5, k, v Suppose 3l - 6 = 0, -53 = -5p + 2l - 52. Sort p, 3, 4, 10. p, 3, 4, 10 Let m be ((1020/96)/17)/((-13)/(-104)). Suppose -2s - 4z - 6 = 0, -5s - 3 - 3 = z. Let t = 0 + -4. Put s, m, 4, t in decreasing order. m, 4, s, t Let p = 432 + -429. Let u = -28 - -6. Put 2, p, u in ascending order. u, 2, p Let x = -242.26 + 219.26. Put -2, -0.08, x in decreasing order. -0.08, -2, x Let f = -0.128 - 0.067. Let c = -0.105 + f. Put -30, -1, c, 0 in ascending order. -30, -1, c, 0 Let s = 139.28 + -55.28. Sort s, 4, -2/21, -5. -5, -2/21, 4, s Suppose -2o - 2t + 2 = -4o, 4o - 3t = 1. Suppose os = -0s. Suppose -5x + 5871l = 5868l + 6, 12 = x - 5l. Sort 5, s, -2/11, x in descending order. 5, s, -2/11, x Let h = -4.02 + 4. Let w = 0.5303 - 0.2303. Sort -5/4, w, 1.6, h in descending order. 1.6, w, h, -5/4 Suppose -44q + 199 = 1079. Suppose k - 78 + 73 = 0. Sort -2, 4, q, k in decreasing order. k, 4, -2, q Suppose -147 + 432 = -19j. Suppose 11 - 96 = -5x. Let w = 16 - x. Put w, 4, j in increasing order. j, w, 4 Let j = 0.2 + 0.3. Let z = 122490 - 857431/7. Let f = 0.3 - 0.1. Sort z, f, j, -1/4 in ascending order. -1/4, z, f, j Let t = -20607 - -20604. Sort -13, 5, 2, t, -1. -13, t, -1, 2, 5 Let m = -7962 + 7964. Put -32, m, 3 in decreasing order. 3, m, -32 Suppose 50x + 51x = 357x - 1280. Put -4/3, -5, 557, x in descending order. 557, x, -4/3, -5 Suppose 0 = -673d + 791d - 4720. Put d, 5, 0, -1, 97 in ascending order. -1, 0, 5, d, 97 Let t be 9((-143)/(-165))/13. Put t, 0.4, -0.1, 2, -176 in decreasing order. 2, t, 0.4, -0.1, -176 Let n be (9 - 16/8) + (3 - (-48)/(-4)). Sort -7, 1, -3, 14, n in increasing order. -7, -3, n, 1, 14 Let y = -296.67 - -287.67. Sort 5, y, 37 in descending order. 37, 5, y Let x = -2.2 + 2.5. Let l = 1094 - 1089. Sort -1, x, l, 4. -1, x, 4, l Let l = -0.5155 + -0.4845. Sort 1, 33, l in descending order. 33, 1, l Let a = 842 - 843. Let g = 10 - -9. Let k = 93/5 - g. Put a, 3/7, k in ascending order. a, k, 3/7 Let i = -53 + -277. Let j = i + 315. Sort -1/2, -5, j. j, -5, -1/2 Suppose 5a + 21 = -2m, -5m + 6m = -3a - 12. Sort 5, 25, m in decreasing order. 25, 5, m Let x = 0.8906 + -22.8906. Put 1/5, x, -3.2 in decreasing order. 1/5, -3.2, x Suppose 2y = 7 + 3. Let s(q) = 11q - 70. Let n(t) = 4t - 23. Let w(z) = -17n(z) + 6s(z). Let u be w(-15). Sort u, -4, y in ascending order. -4, u, y Let j be -1(1 + 4-1). Suppose jx - f - 7 = 3f, -f - 16 = 4x. Let s = 185.95 - 190.95. Put -0.1, x, s in descending order. -0.1, x, s Suppose 0 = -v + 5s + 9, 3 = -2s - 1. Suppose -26 = 4h + 3t, -65h + 3t = -66h - 11. Sort 9, h, v, -2 in descending order. 9, v, -2, h Suppose -2u + 5 = -5l - 41, -3u + 17 = -l. Sort 7822, -4, 5, u in decreasing order. 7822, 5, u, -4 Let t be (56/6)/((-62)/(-12) - 5). Suppose -q - 3o + 3 = 0, 55q - tq = -o - 19. Sort -6, 2/7, q in descending order. q, 2/7, -6 Let h = -8.07149 + 0.07149. Put h, -83, 4/3 in decreasing order. 4/3, h, -83 Suppose -22 = -150y + 161y. Let x(s) be the second derivative of -s4/12 + 2s*3 + 8s*2 + 9s. Let q be x(12). Sort y, 1, q in descending order. q, 1, y Let j be (4/(-10))/(3/(-25))108/72. Suppose 0 = i + 2h + 10, -4h - 8 = 4i + 20. Put i, j, -2 in descending order. j, -2, i Let g = 2 - 4. Let d = 216 + -215.456. Let b = d + 3.456. Sort 5/4, b, 1, g. g, 1, 5/4, b Let c(f) = f*3 + 7f*2 + 4f - 10. Let t be c(-6). Suppose -70h = m - 75h - 25, -m - th = 3. Sort -1/5, -4/7, -2/9, m in ascending order. -4/7, -2/9, -1/5, m Suppose 4z = -5v + 4v - 3, v = -3z + 1. Suppose -6r + 53 = -v. Put 1, -4, r in descending order. r, 1, -4 Let b = 20 + -18. Suppose -2k = -k - 4q + 11, 0 = bk - 2q - 2. Sort 2/13, -1/5, k in ascending order. -1/5, 2/13, k Suppose 3 = b + 3. Let x = 2472 - 2475. Sort 1, b, -2/29, x in decreasing order. 1, b, -2/29, x Let c = -115 + 88.6. Let a = c - -27.4. Put 1/8, 2/3, a in ascending order. 1/8, 2/3, a Let d(g) = -369g - 1848. Let h be d(-5). Sort 5, -2, h, -20, 0 in descending order. 5, 0, -2, h, -20 Suppose 13 = -4m + b, -2b = 4m + m + 13. Let x be (-12)/(-2) + 18/9. Let f be 0/x + 2/4. Sort m, 2/3, f. m, f, 2/3 Let m = -1 - -1.4. Let o = 5364343/35 + -153210. Let p = o + -284/5. Put 5, p, -3, m in increasing order. -3, p, m, 5 Let o = -3/1105 + 2231/7735. Sort -0.1, 0.2, o. -0.1, 0.2, o Let c(b) = -b*2 + 10b - 12. Let d = -142 + 150. Let j be c(d). Suppose -4x + 6 = 4y - 3y, -3y - 3x + 9 = 0. Sort 0, y, -13, j in descending order. j, y, 0, -13 Suppose 23m = 24m + 3. Let k be 3736/(-20) - 20/(-25). Let c = k - -188. Put m, 6, c in ascending order. m, c, 6 Let n = -228 - -390. Let h = 166 - n. Let j = -11 + 7. Sort h, j, 0 in increasing order. j, 0, h Let z(o) = 440o + 18922. Let	{ "pile_set_name": "DM Mathematics" }
-2w + 3u = -3. Let j(f) = -9f - 5. Let b(n) = 5 - 2 + 4n - 1. Give wj(o) + 7b(o). o - 1 Let o(v) = 309v - 14. Let y(g) = -100g + 5. Determine 2o(s) + 7y(s). -82s + 7 Let g(s) = -6s - 25s + 8s + 30 - 8s - 9s. Let r(n) = n - 1. Determine g(a) + 30r(a). -10a Let r(b) = -6b3 + 3b*2 + 3b. Let c be 5-1(15/(-25) - 0). Let j(f) = -c + 3 + 11f3 - 5f - 7f2 + 2f*2. Give -3j(t) - 5r(t). -3t*3 Let c(u) = -8u*2 + 2. Let g(n) = 23n2 + n2 - 23n2. Determine -c(i) - 2g(i). 6i2 - 2 Let f(l) = 3l - 8 - 6l - 6l + 4l. Suppose 0 = -5c + 13 + 57. Let u(j) = -c - 6j + 8 - 3. Determine 7f(s) - 6u(s). s - 2 Let k(d) be the second derivative of d3/6 + 3d*2/2 + 15d. Let z be ((-18)/(-45))/(3/(-255)). Let v(x) = 6x + 17. Give zk(m) + 6v(m). 2m Let c(g) = -g*2 + g - 2. Let z(o) = 4o*2 - 3o - 53. Determine -3c(s) - z(s). -s2 + 59 Let z(m) = 9m. Let o = -4 - -21. Let w(u) = 26u. Suppose -4g + 3g = -50. Let y = -56 + g. Give oz(i) + yw(i). -3i Let z(b) = b*2 - b + 1. Let y(x) = -2x*2 + 2x - 2. Let w be 0 + -7 + 6 - 4. Give wz(l) - 2y(l). -l2 + l - 1 Let q(t) = -t + 6. Let a = 66 - 72. Let h(n) = n3 + 7n2 + 9n + 17. Let u be h(a). Let d(f) = -f + 1. Determine uq(i) + 3d(i). -2i - 3 Let a(p) = -p3 + p + 1. Let k(o) = -11o*3 + 3o*2 + 3o + 3. Determine 3a(y) - k(y). 8y*3 - 3y2 Let q(w) = w2. Suppose 4u + 3x + 7 = 0, 4x = -3u + 7x. Let r(z) = -8z*2 - 2z + 1. Calculate ur(k) - 6q(k). 2k2 + 2k - 1 Let a(h) = -22h2 + 3h - 69. Let y(w) = -35w2 + 4w - 103. Determine -8a(t) + 5y(t). t*2 - 4t + 37 Let g(j) = -9. Let a(x) = -x - 8. Let l(b) = -5a(b) + 4g(b). Suppose 4w - 47r = -49r + 20, r - 17 = -3w. Let d(z) = 6z + 5. Calculate wl(o) - 6d(o). -o - 2 Let z(g) = 8g*3 + 4g*2 + 5g. Let p(c) = 15c3 + 7c*2 + 9c. Let u(q) = -q*2 + 7q - 16. Let a be u(2). Give ap(f) + 11z(f). -2f3 + 2f*2 + f Let c(z) = -4z*3 + 27z*2 + z - 6. Let d(h) = -5h*3 + 28h*2 + h - 7. Give 7c(v) - 6d(v). 2v*3 + 21v*2 + v Let t = 9 - 6. Suppose -3z - 3 = 0, 0n + tz + 1 = n. Let d(a) = 3a3. Let r(i) = -3i*3 - 5i3 + i3. What is nr(l) - 5d(l)? -l*3 Let n(f) = -4f + 1. Let z be (-15)/3 + 3 - -4. Let c(l) = 21l - 5. Let i be 2/(4/21) - (-2)/4. Calculate in(o) + zc(o). -2o + 1 Let g(b) = 5b2 + 3b + 1. Let c be (-8 - (-10 + -8)) + -11. Let k(s) = s*2 + s. Give cg(u) + 2k(u). -3u2 - u - 1 Let l(w) = -w - 2. Let a(p) be the first derivative of p2/2 + p + 29. Give -2a(v) - l(v). -v Let i(b) = -12b*3 + 2b*2 - 3b - 3. Let j(w) = -w - 1. What is -i(c) + 3j(c)? 12c*3 - 2c2 Let z(o) = o3 - o2 + o. Let c(s) be the second derivative of s5/5 - 5s4/12 + s3/2 + 2s*2 - 214s + 2. Give -c(b) + 5z(b). b3 + 2b - 4 Let r(b) = -b*2 - b + 4. Let k = -6 + 11. Let t be ((-2)/k)/((-12)/120). Let p(u) = 5u*2 - 3u*2 + 5u*2 - tu*2 - 11 + 3u. Give -6p(j) - 17r(j). -j*2 - j - 2 Let t(w) = -22w2 + w - 1. Let s(m) = -m3 - 2. Calculate s(d) - t(d). -d*3 + 22d*2 - d - 1 Let o(a) = 4a - 2. Suppose -d + 4 = 2d + 5b, 4b + 15 = -5d. Let u(t) = 9t - 5. Suppose -k = -0 + 5, 4s + 4k = -8. Calculate do(h) + su(h). -h - 1 Let n(r) = -r - 2. Let g be (-4)/10 + (-17)/(-5). Let z(o) = -3. Let i(s) = 7. Let j(k) = 4i(k) + 9z(k). Calculate gj(u) + n(u). -u + 1 Let k(w) = -15w3 - 9w*2 - 17w - 5. Let a(v) = 10v3 + 6v*2 + 11v + 3. Calculate 8a(l) + 5k(l). 5l3 + 3l*2 + 3l - 1 Let f(j) = -3j3 + 2j - 4. Suppose -7h + 34 = -4b - 9h, 5h = -4b - 19. Let k(u) = 8u*3 - 7u + 11. Determine bf(y) - 4k(y). y*3 + 6y Let k(f) = f3 - 1. Let v(h) = -h3 + 2h2 - 6h + 3. Give 3k(s) + v(s). 2s*3 + 2s*2 - 6s Let z(b) = -24b3 - 11b*2 + 2. Let h(i) = -13i*3 - 6i*2 + 1. Let y(q) = -7h(q) + 4z(q). Let l(f) = 6f*3 + 3f*2 + f. Give -2l(p) - 3y(p). 3p*3 - 2p - 3 Suppose 0 = -2t - 23 + 7. Let u(h) = -2h*2 + 3h. Suppose w - 5 = -3. Let n(v) = 3vw + 8v - 3v2 - 6v*2. Give tu(l) + 3n(l). -2l2 Let h(k) = -k2 + k + 1. Let l(j) = 5j2 + 9j + 2. Determine 4h(g) - 2l(g). -14g2 - 14g Suppose v - 129 + 123 = 0. Let n(y) = -8y - 4. Let u(a) = 9a + 5. What is vn(b) + 5u(b)? -3b + 1 Let x(s) = -2s + 526. Let z(d) = -4d + 790. What is -8x(n) + 5z(n)? -4n - 258 Let z = -2 + 1. Let f be (2 - 0) + (60/6)/(-5). Suppose 6y - 14 - 10 = f. Let m(o) = o. Let s(a) = a3 + 3a. Give ym(t) + zs(t). -t*3 + t Let u(v) = -6v*2 + 9v + 4. Let j(t) = 7t2 - 10t - 5. Determine 3j(l) + 4u(l). -3l2 + 6l + 1 Let b(d) = -d + 1. Let o(u) = -194u + 2. Determine -3b(w) + o(w). -191w - 1 Let j be (66/12)/((-1)/2). Suppose 5d - 2c + 8 = 6, 0 = 5c + 20. Let m(k) = -3k + 2. Let f(n) = 16n - 11. Determine df(w) + jm(w). w Let k(t) = -t*2. Let h(p) = 12p*2 + 17p + 23. Let a(r) = 2r2 + 3r + 4. Let f(c) = 34a(c) - 6h(c). What is -f(w) - 3k(w)? 7w*2 + 2 Suppose 0 = 4p - 19 + 43. Let s(q) = 15q2 - 4q + 4. Let w(r) = 7r2 - 2r + 2. Determine ps(c) + 13w(c). c*2 - 2c + 2 Let z(m) = -583m2 + 5m - 5. Let r(x) = -291x2 + 2x - 2. Calculate 5r(o) - 2z(o). -289o2 Suppose 0 = -103k + 115k - 72. Let x be 6/(-27) + 155/9. Let u(w) = -2w*2 + 6w - 6. Let f(i) = 6i2 - 17i + 17. Give kf(h) + xu(h). 2h2 Let t(r) = -r2 - 4r - 4. Let u(l) = 150l - 49l - 52l + 3 - l2 - 56l - 10. Suppose 0 = 2q - 7 + 15. Calculate qu(k) + 7t(k). -3k*2 Let k(i) = -i. Suppose -17d + 25 = 42. Let b(m) = 6m. What is db(c) - 5k(c)? -c Let t(u) = 2u*2 - 3u - 3. Let o(k) = -2k2 + 4k + 2. Give -4o(w) - 3t(w). 2w2 - 7w + 1 Let j(w) = -4w3 - 274w + 281w + 6w*3 - 2w2. Let a = 18 - 16. Let i(q) = -qa + 6q + q3 - 5q + 3q + 0q. What is -5i(b) + 3j(b)? b3 - b2 + b Let p(v) = -9v2 - 14v - 8. Let x(l) = -5l2 - 8l - 4. Give 3p(k) - 5x(k). -2k2 - 2k - 4 Suppose 0 = -7g + 4 + 17. Let p(l) be the third derivative of 1/24l*4 - 1/3l*3 + 0l + 0 - 2l2. Let o(y) = -y + 3. Determine go(k) + 4p(k). k + 1 Let h(m) = -6m + 2. Let l(k) = 16k - 7. Let z(x) = -11h(x) - 4l(x). Let b(g) = -g - 1. Calculate 5b(o) + z(o). -3o + 1 Let z(c) = 4c + 16. Let w(a) be the second derivative of a*3/6 + 3a*2/2 + 4a. Suppose 24 = 16k - 232. Give kw(x) - 3z(x). 4x Let u(l) = 9. Let h(i) = 2i - 35. Let j(s) = h(s) + 4u(s). Let k(v) be the second derivative of v3/6 - v2/2 - v. Calculate j(r) - 3k(r). -r + 4 Let g(a) = 257a*3 - 4a*2 + 4a. Let h(s) = -50373s3 + 783s*2 - 783s. Calculate 783g(z) + 4h(z). -261z3 Let g(u) = -u + 4. Let z(v) = 11. Let d(s) = -24. Let j(x) = -6d(x) - 13z(x). What is 2g(a) - 11j(a)? -2a - 3 Let u(c) = 3c2 + 1. Let i(q) = -7q*2 + 2q + 2. Give i(n) - 2u(n). -13n*2 + 2n Let p(x) = x*2 + 8x + 163. Let f(v) = -v - 1. Determine 6f(z) + p(z). z2 + 2z + 157 Let h(b) = -5b + 6. Let d(z) = 9z - 11. Let u(q) = -10q + 35. Let f be u(3). Determine fh(r) + 3d(r). 2r - 3 Let v(x) = 91x2. Let t(n) = 35n*2 - 77n*2 - 17 + 33n*2 + 17. Determine 21t(b) + 2v(b). -7b2 Let i(h) = -h3 - 3h2 - h. Let d(f) = -10f*3 - 18f*2 - 8f. Calculate -d(y) + 6i(y). 4y*3 + 2y Let x(w) = -2w + 2. Let o(k) = -85k + 5. Determine o(i) - 2x(i). -81i + 1 Let a(c) = -68c3 + 17c*2 - 9c + 17. Let r(u) = -23u3 + 6u*2 - 3u + 6. What is 6a(q) - 17r(q)? -17q3 - 3q Let i be (-88)/(-28) + 2/(-14). Let v(y) = -5y2 + 4 - i - 2 - 2. Let h(d) be the second derivative of d4/6 + d2/2 + d. Calculate 7h(c) + 3v(c). -c2 - 2 Let v(r) = -2r*3 + 7r*2 - 7r. Let b(n) = 3n3 - 8n*2 + 8n. Calculate 5b(y) + 6v(y). 3y3 + 2y*2 - 2y Let m(s) = s*2 - 3s + 3. Let r be m(6). Let k(l) = -3 + 4 + 15l - 34l + rl. Let d(t) = -2t - 1. Determine -6d(a) - 5k(a). 2a + 1 Suppose 4j - 67 = 3z - 73, 5j + 5z + 25 = 0. Let m(r) = 1 + 0 - 2 - 1 + r2 + r. Let n(k) = -2k*2 - 2k + 4. Determine jn(u) - 5m(u). u*2 + u - 2 Let b(m) = 1065m*2 + 6. Let w(l) = 6l*2 - 1. Determine b(u) + 6w(u). 1101u2 Let v(c) = -2c*2 - 43c - 52. Let x(s) = s*2 + 20s + 26. Calculate 4v(h) + 9x(h). h*2 + 8h + 2	{ "pile_set_name": "DM Mathematics" }
n 0.4, 0.2, -1/3? 0.4 What is the closest to 0.1 in 5.2, 1/4, -0.2, 4? 1/4 Which is the nearest to 5? (a) -2/5 (b) 0 (c) -17 b What is the nearest to 1/4 in -0.17, -0.5, 5, -1/6? -1/6 What is the nearest to -5 in 9, 3, 0.5, -0.9? -0.9 What is the closest to -1 in -0.4, -125, -1/3, 3/8? -0.4 What is the closest to -3 in 5, -0.1, 2/7, 4/7? -0.1 What is the nearest to 1 in 0.059, -0.4, 2/7? 2/7 What is the closest to -6 in 1/7, -2/7, -2/5? -2/5 Which is the nearest to -0.2? (a) 0 (b) -52 (c) 0.3 (d) 0.1 a What is the closest to 0.5 in 3/8, 0.02, 3/2, 0.26? 3/8 What is the nearest to -0.2 in -0.03, -1/4, 2/11? -1/4 What is the closest to 1 in -23, -1, -2? -1 What is the closest to -1 in -2/3, 0.7, -41? -2/3 Which is the nearest to 3? (a) 0.1 (b) 2/27 (c) -0.2 a Which is the nearest to -0.2? (a) -14 (b) -0.5 (c) -4 (d) 0.4 b What is the nearest to -1 in 2/7, -178/7, -0.4? -0.4 Which is the closest to 1/2? (a) 0.04 (b) -0.1 (c) 11/7 a Which is the nearest to 0.3? (a) -4 (b) -0.1 (c) 1/3 (d) -1/2 c What is the closest to 1/4 in 6, 0.1, -0.03, 0.2? 0.2 What is the closest to -3/5 in 3, -4, 0.4, 3/7? 0.4 Which is the nearest to 3? (a) 0.1 (b) -2 (c) 1 (d) -5 c Which is the nearest to 0? (a) -4 (b) -0.1 (c) 1 (d) 2/9 b Which is the closest to -2? (a) 2/13 (b) -0.1 (c) -0.5 (d) -0.4 c What is the nearest to -1 in 116, 1, 0? 0 What is the nearest to 0.1 in -2/7, 47, 2, 4? -2/7 What is the closest to -0.2 in -5, -4, 0, -15? 0 What is the closest to 2/13 in 2, 4, 151/7, -1? -1 Which is the nearest to 0.1? (a) 0.3 (b) -2 (c) -0.5 (d) 0.09 d Which is the closest to 0.2? (a) 2/3 (b) -2/5 (c) 5 (d) -1 a What is the closest to 1 in 4, -1/4, 3, 0.12? 0.12 What is the nearest to 1 in 0, -10, -3/4? 0 Which is the nearest to -0.7? (a) -0.3 (b) -3/11 (c) -13 a Which is the closest to 32? (a) -2/11 (b) 2 (c) 31 (d) -5 c Which is the nearest to -29? (a) 2/5 (b) -2/15 (c) -4 (d) -1/3 c Which is the closest to 0.2? (a) -1/2 (b) -3 (c) -0.1 (d) 11 c Which is the nearest to 1? (a) -0.13 (b) -4 (c) 5 (d) -2/7 a What is the nearest to 2 in -2/23, -5, -2, 1/2? 1/2 What is the closest to -1/4 in 3/2, -33/2, 0.01, 1? 0.01 Which is the closest to 0.2? (a) 3 (b) 58 (c) 2/19 (d) 1/3 c Which is the nearest to -22/7? (a) 2 (b) -1 (c) -1/3 b Which is the nearest to 2? (a) 3/7 (b) -17 (c) -5/6 a Which is the nearest to 0? (a) -2/73 (b) 0.2 (c) 3 (d) -0.5 a Which is the nearest to 1? (a) -1/13 (b) -0.09 (c) -0.4 (d) -1 a Which is the nearest to -0.1? (a) -1/4 (b) 1 (c) 4 (d) 6/5 a What is the nearest to -14 in 0, -0.4, -1, -0.054? -1 Which is the nearest to 0.1? (a) 0.4 (b) 0.3 (c) -2120 (d) -0.4 b What is the closest to 0.3 in 3/7, -8/3, 0? 3/7 What is the nearest to -1/8 in -4, -1.3, 57? -1.3 What is the nearest to 15 in 1, -1.3, 0.2, 4? 4 Which is the closest to 0.1? (a) -0.072 (b) -2 (c) -1 a Which is the nearest to 2/9? (a) 2/39 (b) -2/11 (c) 0.2 (d) -2/3 c Which is the closest to -2? (a) -2/3 (b) 4/7 (c) 36 (d) -5/6 d What is the closest to -1 in -0.4, 3, 0.1, -256? -0.4 What is the nearest to 2 in 4, 0.5, -10.2? 0.5 What is the nearest to -3/2 in 2/3, -2/9, 136? -2/9 Which is the nearest to 0.2? (a) -153/7 (b) -0.2 (c) -2/5 (d) 4/9 d What is the nearest to 22 in 0.5, -0.5, 0.02? 0.5 Which is the closest to -2/47? (a) 1/4 (b) 3 (c) -1/7 c Which is the closest to -1? (a) 4 (b) 1 (c) -2 c What is the nearest to 1/2 in -0.4, -2/11, 2, 0? 0 What is the nearest to 1 in 0.1861, 5, 2/13? 0.1861 What is the closest to 23 in -0.4, 29, 3/4? 29 Which is the closest to 10/93? (a) -1/2 (b) 6/5 (c) -3 a What is the nearest to -1/2 in -2, 2, -46? -2 Which is the nearest to -0.07? (a) -0.3 (b) 0.4 (c) 0.3 (d) -0.4 a Which is the closest to 0? (a) -1/7 (b) 1/2 (c) -14/5 (d) 4 a Which is the nearest to 1? (a) -2/15 (b) 10 (c) 3 (d) -3 a Which is the nearest to -3? (a) -1 (b) 3/5 (c) 22/5 (d) 2/15 a Which is the nearest to 2? (a) 0.1 (b) -0.1 (c) 61 (d) 3 d Which is the closest to 4/5? (a) -0.1 (b) -0.4 (c) 0.2 (d) -5 c What is the closest to 2 in 2, 2/11, -189? 2 What is the nearest to 0 in 3/7, 2, 27? 3/7 What is the closest to 5 in -0.5, 2/5, -4/9, 0? 2/5 What is the nearest to -0.16 in 2/9, -2/9, -6, 3? -2/9 What is the nearest to 0 in -2, -6, 0.15? 0.15 What is the nearest to 8 in -1, 0.1, -0.2? 0.1 Which is the nearest to 1? (a) -20 (b) -4 (c) 1 (d) -0.4 c What is the nearest to 1 in -8/5, 17, 2? 2 What is the closest to -1 in -0.5, 0.2, -0.26? -0.5 Which is the closest to -1? (a) 2/7 (b) 0.021 (c) 2 (d) 2/3 b What is the closest to 14 in -2/3, 5/6, -1/5, -5? 5/6 What is the nearest to -4/3 in -1/4, 4, 2/9, -3? -1/4 Which is the nearest to 0? (a) -4/7 (b) -0.5 (c) -3/5 (d) 181 b Which is the nearest to 0.2? (a) 4 (b) 0.7 (c) -0.8 (d) -3/2 b What is the closest to -2 in -0.4, -878, -1/4? -0.4 What is the nearest to 0.1 in -2/17, -0.01, -28? -0.01 What is the nearest to -3642 in -1, -5, 5? -5 Which is the nearest to 3/8? (a) 1/7 (b) -1/5 (c) -12/5 (d) 2 a What is the closest to -0.1 in -0.18, 5/4, 5, 3? -0.18 Which is the closest to -4/5? (a) 0.1 (b) 2/3 (c) -9 a What is the nearest to -0.1 in 1/23, 0, -6/19? 0 What is the nearest to 0.0503 in 0.2, -5, 2, -4? 0.2 Which is the closest to 1? (a) 0.1 (b) 10 (c) 5 (d) 33 a Which is the closest to 0? (a) -89 (b) 82 (c) 0 c Which is the closest to -1? (a) 0.1 (b) 1/4 (c) 3/2 (d) -0.5 d What is the nearest to 0 in -0.2, -33, 5? -0.2 Which is the nearest to 0.2? (a) 2 (b) 0.24 (c) 2/7 (d) -3 b What is the closest to -0.1 in 0, -2/5, -1.4, 3? 0 What is the nearest to -2 in 2, -0.04, 1/6, -1/4? -1/4 Which is the closest to 2/7? (a) -0.3 (b) -2 (c) 1/2 (d) 12 c Which is the closest to -2/3? (a) -10/3 (b) 2/13 (c) -8.5 (d) -8/3 b What is the nearest to 8 in -5, 0, -3, -0.4? 0 What is the closest to 0.1 in 5, -0.4, 2, -0.5? -0.4 What is the nearest to 2/7 in 0.263, 5, 1/5? 0.263 What is the closest to -1 in 0.08, 4/9, 1/9? 0.08 What is the closest to -1 in 3, 0.5, 67? 0.5 Which is the nearest to -0.1? (a) -2/17 (b) 1/2 (c) -14 a What is the closest to -311 in 4/9, -0.3, 0.07, 0.2? -0.3 What is the nearest to -2/7 in 7/6, 7/3, 3? 7/6 Which is the closest to 544? (a) 3 (b) -14 (c) -3/7 a What is the closest to 2/13 in 1, 4, 0, -0.3? 0 What is the nearest to -3/4 in 0.2, 2/5, 0.33? 0.2 What is the nearest to 2/5 in -2.5, 2, 0.3? 0.3 What is the nearest to -12/11 in 5, -0.5, -1/5, -1? -1 What is the closest to -3/4 in 0.1, 7, 2/45? 2/45 Which is the closest to 0? (a) -1/4 (b) -79 (c) -2 (d) 4 a What is the nearest to 1/3 in -1/2, -3, -5/2, 0? 0 Which is the nearest to 0? (a) 11/4 (b) 5 (c) 0.1 c What is the closest to -0.1 in 0.5, -0.3, 3, -209? -0.3 Which is the closest to -0.1? (a) -3 (b) 3 (c) 0 (d) -5 c Which is the closest to 2? (a) -6 (b) -4 (c) -0.7 c What is the nearest to -1/3 in -7, -5, -2/13, -3? -2/13 What is the closest to -71 in -0.4, 5, -3, -1/2? -3 Which is the nearest to -1/2? (a) -3 (b) 3/11 (c) -9 (d) -19 b Which is the closest to 1? (a) 0.1 (b) -2 (c) 5 (d) -2/17 a Which is the nearest to -2/19? (a) -0.4 (b) 4 (c) 2/25 c What is the closest to -1 in -2/7, 2/5, -2, -2/5? -2/5 Which is the closest to -9? (a) 0.3 (b) 1 (c) -4 (d) -0.3 c What is the nearest to 1 in 3, -5, 0.5, -2/11? 0.5 Which is the nearest to 9/2? (a) 0.4 (b) 2/13 (c) 0.6 c What is the closest to -3 in -0.3, 2, 0, 7? -0.3 Which is the nearest to 0.1? (a) -2/3 (b) 14 (c) -24 (d) 0.09 d What is the closest to 1.1 in 0.5, -0.8, -0.2, -1/4? 0.5 What is the nearest to 2 in 0.5, 44, 3? 3 Which is the nearest to 0? (a) 2/5 (b) 1 (c) 6 (d) 10 a What is the closest to 0 in -0.03, -5, 1/5, -1? -0.03 Which is the closest to 2? (a) 5 (b) -5 (c) -46 a What is the closest to 0.3 in 4, -0.2, -12/5, -15? -0.2 What is the nearest to 9 in 2/15, 0.5, 3, -11? 3 Which is the nearest to 0.383? (a) 0.4 (b) -2/7 (c) 0.3 (d) -6/11 a Which is the nearest to 2/7? (a) 0 (b) 186 (c) 2/3 (d) -3 a Which is the nearest to 5? (a) 3 (b) -1/11 (c) 0.19 a Which is the nearest to -1? (a) 5 (b) 0.2 (c) 0.07 (d) 0.4 c What is the nearest to -1 in -0.9, 0.4, -7? -0.9 What	{ "pile_set_name": "DM Mathematics" }
e 0 = g - 4i + i + 6, -si = -12 for g. 3 Let v = 229 + -152. Let b = 102 - v. Let u(q) = q*2 - 2q - 3. Let l be u(-2). Solve 5z + j = -0j + 21, -z + lj = -b for z. 5 Let a(m) = -m2 - 7m - 2. Let l be a(-5). Solve -h + f = 0, -2h - 5f - l - 6 = 0 for h. -2 Let j(c) = -2c3 - 10c*2 + 5c + 29. Let q be j(-5). Solve 3x = -3m - 9, x + q = m + 1 for x. -3 Let o = 660 - 655. Solve -4d = 3b - 1, -4b + 9b + od = 0 for b. -1 Suppose -62a = -54a. Solve -4d = 5p + 30, ap = 5d - p + 23 for d. -5 Let j = 17 - -3. Let g = -8 - -13. Let p be (3 + -1 - 3)(-30 + 27). Solve h = pt - j, -3h - h = 3t + g for t. 5 Let v(r) = -r3 - 6r*2. Let a be (-18)/(-15)(-5 - 0). Let m be v(a). Solve -2b = 2t + 6, b = -mb + 2t - 3 for b. -3 Let w(g) = -g*3 - 7g*2. Let x be (1/(-3))/(8/(-96)). Let o be -4 + (-4)/(x/3). Let i be w(o). Solve 2k - 6 = 0, ik + 4k - 10 = s for s. 2 Let m(k) = 11k3 + 0k - 7k3 - k. Suppose -3i + 1 = -2. Let l be m(i). Solve lf + 7 = -0b - 2b, -5f - 17 = -2b for f. -3 Let g be -25 + 21 - (-6 + 2). Solve -3j - 2s = 1, -2 = -gs + s for j. 1 Suppose c + k - 8 = -0k, 0 = -5k + 20. Solve -5l = -2y - cl + 2, -y - 1 = -l for y. 3 Let q be 2550/315 - (-2)/(-21). Solve -10 = -5j, -4j + qj - 18 = -2z for z. 5 Let v = -666 + 668. Solve -4p + 12 = 0, 10 = -s + vp + 1 for s. -3 Suppose -12 - 48 = 5f. Suppose -4z = 2z - 6. Let p be f/(z/2 + -2). Solve -a = -3j - 8, 3a + j = -8 - p for a. -4 Suppose 9z + 93z = 306. Solve 3m + 2s + 5 = 0, zs + 14 = 2m - 0m for m. 1 Let k be 1-3(-91)/39. Suppose k = 2s + 13. Let v be (-10)/s - (-6)/(-18). Solve 0z - 2z = vq - 1, -3 = 3q + 3z for q. 3 Suppose 32f - 34f = 50. Let s = -23 - f. Solve -4w + 4x - 4 = 0, 5w - sx - 1 = x for w. 2 Let j(w) = -w3 + 4w*2 - 3w. Let g be j(3). Let c be (g/((-12)/(-3)))/(-2). Suppose 3h - 4h + 13 = c. Solve -3x - h = -2k, -x + 4k - 1 = -0x for x. -5 Let n(v) = -v*3 - 23v*2 + 26v + 61. Let x be n(-24). Solve 3o + 3l - 6 = -0, -2l + x = 5o for o. 3 Let k(a) = 2 - a*2 - 1 + 3 + 4a. Suppose 27z = 47z - 80. Let w be k(z). Solve -r - 1 = -3x, 2x + 0 = 3r - w for r. 2 Let x(l) = l2 + 39l + 224. Let j be x(-7). Let n be (-6)/8 - (-1)/(-4). Let p be 0 - (-3 - -2) - n. Solve 5g = 4f - 10 - 10, j = g - pf + 4 for g. -4 Let d = 388 + -379. Solve -a + 4a - d = -3t, -2t = -a + 6 for a. 4 Suppose 281 - 92 = 3y. Let j = 68 - y. Solve 3t = 4z - 4 - 0, -5t - 30 = jz for z. -2 Let h be (108/30)/(3/(-10)). Let f be (h - -11)/(2/(-8)). Let u(s) = 2s*3 - 6s*2 - 8s + 4. Let g be u(4). Solve -fa - 4 = -p, 0p - gp - 22 = 3a for a. -2 Let j be ((-10)/(-25))/(1/5). Suppose d - g = 5, g = jd + d - 5. Solve ds = -4s - 3i - 5, 4 = -2s - 2i for s. 1 Let t(c) = c*2 - 6c - 2. Let g be t(6). Let k be -1 + 6 + g - (2 - 2). Solve z - 7 = ks, 2z + 2 = -4s - 4 for s. -2 Suppose 6x + 36 = 66. Solve xs - 3a = 4, 5s + 0a = -5a + 20 for s. 2 Suppose -9n + 235 = 199. Solve 5s + 15 = nz - 5z, 2s + z + 3 = 0 for s. -4 Suppose 0 = 6h - h + 20. Let c be (3 - (3 + h)) + -2. Solve 4l - cl + 4f - 14 = 0, 2f - 17 = -3l for l. 5 Let q(l) = 3l + 5. Let s be q(-2). Let w be (-14 - -17)/(s/(-1)). Solve wy = 3h + 6 - 15, 5h - 3y - 15 = 0 for h. 3 Let f(n) = -6n*2 - n + 10. Let a be f(0). Solve 2x = -4c - a, c + 4c + 14 = -4x for c. -2 Let w(l) = -14l + 50. Let g be w(3). Solve -s - 3 = 4u, 0 = 3s - gs - 2u + 3 for s. 1 Let v(d) be the third derivative of d4/12 - d3/2 + 5d2. Let g be v(3). Solve 4w - 2 + 6 = 2s, -3w - g = -3s for w. -1 Let f be (9 + 1)/((1 - 6) + 4). Suppose -t = 5q - 9, -t = -2t - 4q + 6. Let k = t - f. Solve -h = 2v + k, h - 10 = v + 4v for v. -2 Let p = -399 - -399. Solve -14 = 5w - v, p - 5 = 5v for w. -3 Let t = 70 + -60. Solve -t = -5n, 3b + 0 = -n - 13 for b. -5 Let u(p) = p*3 + 25p*2 - p - 18. Let h be u(-25). Solve -2a - h = -3a + 2i, -4a - 4i - 20 = 0 for a. -1 Let h be (-1)/(1/16-1). Let p = h - 14. Solve -2s - r - 5 = -2, ps + 4r + 6 = 0 for s. -1 Let v = 61 - 59. Solve 14 = -5m + vr, -3m = m + 4r for m. -2 Let b(y) be the second derivative of -y*3/6 + 4y*2 - 7y. Let r be b(6). Solve 4j - 3 = rw - 1, -3j = 3w - 6 for j. 1 Suppose 480d - 477d = 12. Solve 0 = -3s - 0c - 4c - 2, -dc - 6 = 5s for s. -2 Suppose -25 = -15w + 35. Solve -10p + 2b = -12p - w, -3p = 5b + 2 for p. -4 Let q = 243 + -374. Let n = -128 - q. Solve 3y = -nb, -5y - 2 = -b - 14 for b. -2 Suppose 2s = -f - 0s + 3, -f + 3s = -3. Suppose 4v - 4 = -4d, 3v = 2v - fd - 3. Solve -4g = 12, vt + g = 11 + 1 for t. 5 Suppose 3q = 3, -4s + q = -0q + 85. Let n be -3(-3 + s/(-9)). Suppose -i + 2 = 2f, -5i = 2 + 8. Solve l + ft = -1 - n, 2t - 1 = 3l for l. -1 Let s(c) = 3c*2 + 116c + 80. Let m be s(-38). Solve -n + 11 = 2b, -mb + 0n + 18 = -2n for b. 5 Let i = 1049 + -1045. Solve 5c + ih + 8 = 26, 3c = -3h + 12 for c. 2 Let h(u) = -u*2 + u + 4. Let t be h(4). Let r be (-1)/(-4) + 58/t. Let c = 13 + r. Solve -f - i - c = 2i, -4i = 8 for f. 0 Let x(f) = f2 + 25f + 157. Let t be x(-13). Solve 3o - r = -t, 2o + 5r = -10 - 2 for o. -1 Let l = -2 + 1. Let z = l - -1. Suppose z = b - 3b + 8. Solve 2t = -bo - 8, 3o - 6o - 2t = 4 for o. -4 Let z = -37 + 42. Suppose -142 = -f - 4f + 4j, -10 = -zj. Solve 0 = 2l - 7l + 3r - f, r = -5l - 10 for l. -3 Suppose -5x = v - 0v - 8, -v - 4 = -x. Let f be 17 + v + 2 + -1. Suppose 0 = -3s + f - 4. Solve a + 4 = -2q + q, -sa = -4 for q. -5 Suppose -5z + 3l = 366, -5z - 6l = -11l + 370. Let i = -71 - z. Solve 3 = -5c - 4k + i, 3c - 5k = -16 for c. -2 Let n = -29 + 6. Let a = -22 - n. Solve m - a = 5v, 0 = 2m + v + 3v + 12 for m. -4 Let f(n) = -n3 - n. Let r be f(-1). Let b = 72 + -69. Solve 3v = bw - 0 - 3, -rw - 2 = -4v for w. 3 Suppose 0 = y - 2. Suppose -n = -4g - 2n + 13, 0 = -2g - yn + 14. Let k be 4 - (0/(-1))/g. Solve 2d = -2, 2h = 2d + 2 + k for h. 2 Let f = 63 + -63. Let y(s) = -s*3 - 2s*2 + 2s. Let o be y(f). Solve 0 = -5l + p + 7 - 31, l - 5p = o for l. -5 Let q = 7 - -14. Let v(j) = 9j - 16. Let p be v(2). Suppose -pd + d = -5b + q, -12 = 2d - 4b. Solve -2m = -4f - 3m - 16, 0 = -f - dm + 11 for f. -5 Let v = -882 - -882. Solve 2o = -2c, 5o - 7o + 3c - 25 = v for o. -5 Let m = 1207 + -1203. Solve -5 = 5o + 5z, -mz = -4o - 0z - 4 for o. -1 Let t = -800 - -804. Solve -3m - 6b - 8 = -7b, 0 = tm - 2b + 10 for m. -3 Let t(i) = 7i + 27. Let k be t(-3). Let b be (-1 - 0) + (-4)/((-8)/k). Solve n - 4n + q + 10 = 0, -bn - 4q + 16 = 0 for n. 4 Let n be 12/12(3 + 1). Let k be (-54)/n(-32)/24. Solve 2s - 16 = -4w, -2s - 2w - 3w + k = 0 for s. 4 Let l = -241 + 245. Solve -l = -3q + 2k - 1, 5k = 3q - 12 for q. -1 Let n(q) = -q2 + 7q + 4. Let l be n(7). Let r(u) = -u3 + u2 + 15u - 7. Let v be r(4). Solve w + li = 21, -w - i = -vw - 1 for w. 1 Let d(x) = 6x - 6. Let y be d(1). Solve -5p = 3b - 3, -5b - 8 = 4p - yp for b. -4 Suppose 17b - 15b = -18. Let g(u) = -2u*2 + 4u + 3. Let v be g(-2). Let t = b - v. Solve 20 = -n - 3y - 0, tn + y = -25 for n. -5 Let m(s) = s*2 + 3s - 38. Let z be m(5). Solve -5k - 6 + 46 = -5h, -h = zk - 1 for h. -5 Suppose -4q = -7q + 63. Let z = q + -7. Let h = -10 + z. Solve -4x = -hb, -4x - b - b = -12 for x. 2 Let l = -211 + 215. Solve 5o - lg = -2g - 31, 3 = g for o. -5 Suppose 15 = 3h - 39. Suppose -2y - h = -5k, -2 = -0y - 2y. Suppose z + 9 = 5u, -4u - 1 + 7 = -2z. Solve -4t - 5f = -3 - z, 4t = 2f + k for t. 1 Suppose 5g = -3c + 92, -c + 34 = 5g - 50. Let s = -9 + 11. Suppose -sd + 12 = 2d. Solve -do + 6 + 3 = r, 4o - g = 0 for r. -3 Let m(a) = -13a - 76. Let p be m(-6). Solve -5h = -pv - 3v - 40, -v = -5h + 20 for v. -5 Let u = -247 + 251. Suppose 63 + 72 = -3j. Let n be 10/j - 4/(-18). Solve ns - uw = 4s, 3w - 4 = -2s for s. -4 Suppose 5z - 27 - 18 = 0. Let c(h) = h - 9. Let v be c(z). Solve -5t + 4 = l, -l - 2t + 4 = -vt for l. 4 Let r(c) = -c - 24. Let i be r(-26). Solve -4j + 3w + 3 = 0, -w = -ij + 2w - 3 for j. 3 Suppose -73y + 70y + 12 = 0. Suppose 4t - t - 5 = -y	{ "pile_set_name": "DM Mathematics" }
-73 + -14? -87 In base 15, what is 5 + 16? 1b In base 4, what is 22 + 3012? 3100 In base 15, what is 172 - 4? 16d In base 7, what is -1 - -43? 42 In base 16, what is -1 - 3f? -40 In base 10, what is 2 + 423? 425 In base 6, what is -34000 - 0? -34000 In base 13, what is 16a + -26? 144 In base 15, what is -5 - -22? 1c In base 7, what is -32 - 0? -32 In base 2, what is -10 - -101001? 100111 In base 14, what is 2 - -26? 28 In base 8, what is -7170 + -4? -7174 In base 5, what is -13301 - 4? -13310 In base 13, what is 3 - 670? -66a In base 3, what is -2 - -11220? 11211 In base 4, what is 22 + -32? -10 In base 2, what is -101 + 1111? 1010 In base 14, what is 0 - -4? 4 In base 3, what is 2 + -1000? -221 In base 9, what is 4 + 47? 52 In base 3, what is 12 + 1221? 2010 In base 7, what is -55 + -14? -102 In base 2, what is -1 + 111111? 111110 In base 5, what is 30 + -1? 24 In base 8, what is 37 - -5? 44 In base 4, what is 21 + 2133? 2220 In base 16, what is -2 + -2ea? -2ec In base 8, what is 600 + -10? 570 In base 12, what is -1 - -50? 4b In base 6, what is 0 + 255? 255 In base 10, what is 577 + 5? 582 In base 16, what is -55 + -8? -5d In base 5, what is -422 - 2? -424 In base 9, what is 65 - -40? 115 In base 9, what is 4 + -118? -114 In base 15, what is -cdc - 1? -cdd In base 12, what is -10 + 31? 21 In base 8, what is -236 + 75? -141 In base 5, what is -1104234 - 2? -1104241 In base 11, what is -442 - -2? -440 In base 5, what is 1 + 2423? 2424 In base 2, what is 1011011 + 1111100? 11010111 In base 9, what is -381 + 0? -381 In base 3, what is 21 - 122? -101 In base 4, what is -11 - -1110? 1033 In base 11, what is -2 - -9? 7 In base 7, what is -24 - -23? -1 In base 14, what is 49 + 1c? 67 In base 14, what is -26d - -3? -26a In base 6, what is -3311 - 1? -3312 In base 3, what is 11 + 10212? 11000 In base 3, what is -201211 + -1? -201212 In base 7, what is 145 - 1056? -611 In base 13, what is 93 + -2? 91 In base 7, what is -113 + 122? 6 In base 3, what is 2212 + 10? 2222 In base 12, what is 1b1 - 5? 1a8 In base 16, what is -3 - ec? -ef In base 8, what is -1 + 15? 14 In base 11, what is 5 + 115? 11a In base 8, what is -344 - 4? -350 In base 10, what is -2 + 16? 14 In base 12, what is -16 - -30? 16 In base 8, what is -520 + -7? -527 In base 10, what is -94 - 1? -95 In base 10, what is 65 - 11? 54 In base 11, what is -2a + -8? -37 In base 7, what is 21313 - 0? 21313 In base 16, what is 3bd + -2? 3bb In base 11, what is -149 + 5? -144 In base 11, what is -133 - -5? -129 In base 5, what is -111 + 20? -41 In base 7, what is -5 + -263? -301 In base 16, what is 0 - -9a8? 9a8 In base 13, what is 6 + 3? 9 In base 4, what is 30312 + -1? 30311 In base 16, what is 43 + 0? 43 In base 14, what is -11 - -122? 111 In base 7, what is -3 + 25? 22 In base 8, what is 26 + -213? -165 In base 16, what is -b + 37b? 370 In base 4, what is 333213 + 0? 333213 In base 7, what is -2 - -1220? 1215 In base 7, what is 10 - -1263? 1303 In base 9, what is 3 + -15? -12 In base 11, what is -5 + -465? -46a In base 2, what is 110010011 - -10? 110010101 In base 14, what is -2 - -56? 54 In base 8, what is 130 - -10? 140 In base 15, what is -1 - -59d? 59c In base 15, what is -5 - -6e2? 6dc In base 15, what is 8 - -ca? d3 In base 8, what is -5653 - 4? -5657 In base 2, what is -110010101 - -11? -110010010 In base 11, what is 33 + -5? 29 In base 2, what is -101 + -10001? -10110 In base 8, what is -7 - 1622? -1631 In base 4, what is 10 - -102? 112 In base 9, what is -3461 - -4? -3456 In base 10, what is 2 - 194? -192 In base 10, what is 3 - 51? -48 In base 15, what is 0 + -b5? -b5 In base 2, what is -110010 + -101? -110111 In base 14, what is d1 - 25? aa In base 13, what is 4 + 60? 64 In base 8, what is 77 + -3? 74 In base 13, what is 1 - -88? 89 In base 5, what is -24311 - 1? -24312 In base 12, what is 9 + 2? b In base 8, what is -13 - 33? -46 In base 5, what is -4 - 214? -223 In base 3, what is -12 - 12021? -12110 In base 16, what is -3 + 2? -1 In base 6, what is 511 - 24? 443 In base 16, what is 3 - 3? 0 In base 7, what is 15 + -5? 10 In base 7, what is 1 + 56? 60 In base 2, what is 110000110 - 101? 110000001 In base 4, what is 2020 - -332? 3012 In base 13, what is -2 - -16? 14 In base 7, what is 3150 - -11? 3161 In base 7, what is -21 + 5? -13 In base 10, what is 12 - -84? 96 In base 4, what is 1103 - -1? 1110 In base 14, what is -c - -c? 0 In base 3, what is 21 - -2? 100 In base 6, what is -12 - -1124? 1112 In base 12, what is -2 - 4842? -4844 In base 14, what is 0 + -357? -357 In base 6, what is 52 + 110? 202 In base 3, what is -100212 - -100? -100112 In base 14, what is 98 + -3? 95 In base 2, what is 10 - 1000101? -1000011 In base 3, what is 12 - 121012? -121000 In base 5, what is 12 + -24? -12 In base 5, what is -13112 + -3? -13120 In base 8, what is 2 - -43? 45 In base 10, what is -17 + -5? -22 In base 13, what is -916 + -9? -922 In base 10, what is -8 + 49? 41 In base 2, what is -1010 - -101? -101 In base 8, what is 2116 - -4? 2122 In base 2, what is -101 + -100010011? -100011000 In base 6, what is -2 + -231? -233 In base 3, what is 1 - 1112012? -1112011 In base 14, what is -1350c + 3? -13509 In base 16, what is 1 - -4? 5 In base 12, what is 317 - -2? 319 In base 5, what is 4 + -24104? -24100 In base 9, what is 20 - 30? -10 In base 12, what is -3 + 4? 1 In base 4, what is 0 + 222330? 222330 In base 9, what is -753 + -3? -756 In base 6, what is 3 + 124? 131 In base 7, what is 24 + 101? 125 In base 15, what is -d6 - 12? -e8 In base 5, what is 10 + 10? 20 In base 5, what is -111 + 10? -101 In base 16, what is -1 - 30? -31 In base 5, what is 2302 + 0? 2302 In base 3, what is 2220 + -10? 2210 In base 12, what is 671 + 1? 672 In base 5, what is 1 + -2033? -2032 In base 7, what is -10462 + 6? -10453 In base 12, what is 28 + -97? -6b In base 6, what is -253 + -4? -301 In base 12, what is -134 + b5? -3b In base 7, what is -13512 - 1? -13513 In base 7, what is 250 - 0? 250 In base 14, what is -1 - 14c? -14d In base 2, what is -1010 - 100100? -101110 In base 5, what is -2 + 3102? 3100 In base 11, what is 20 + -85? -65 In base 2, what is 111110 + -11? 111011 In base 4, what is 1302 - 12? 1230 In base 15, what is -246 - 0? -246 In base 12, what is 897 - 3? 894 In base 4, what is 11 - 21? -10 In base 5, what is 2 + 202? 204 In base 5, what is -1 - -243431? 243430 In base 14, what is -5 + 12d? 128 In base 9, what is -23345 + 1? -23344 In base 11, what is 45a - 8? 452 In base 13, what is 0 + -2b? -2b In base 2, what is 10 + -1001001011? -1001001001 In base 12, what is 88 + -29? 5b In base 14, what is -4a - 1? -4b In base 16, what is 4 - -3? 7 In base 16, what is -f4a + 5? -f45 In base 2, what is -110 + 100110? 100000 In base 12, what is 3a + -5? 35 In base 12, what is 3217 + -5? 3212 In base 10, what is -2 + 81? 79 In base 13, what is 1a - -34? 51 In base 14, what is 1 - 46? -45 In base 10, what is 2 - -503? 505 In base 4, what is -33 + 30? -3 In base 2, what is -1101011 - -1000100? -100111 In base 2, what is -1000101 + 11? -1000010 In base 16, what is -2 - -32? 30 In base 9, what is 140 + 13? 153 In base 14, what is -525d - -3? -525a In base 10, what is -2689 - -2? -2687 In base 14, what is -2 + 99? 97 In base 11, what is 546 + -2? 544 In base 15, what is 83 - -58? db In base 3, what is 0 - 111111? -111111 In base 16, what is -16d + 7? -166 In base 5, what is 2242 + 10? 2302 In base 15, what is 5 - 2243? -223d In base 2, what is -1000101 + 110001? -10100 In base 14, what is -4ac - 1? -4ad In base 16, what is -223a - 5? -223f In base 9, what is -33 - 180? -223 In base 4, what is -2 + 112? 110 In base 6, what is -35 + 3054? 3015 In base 14, what is 2 - 17a? -178 In base 2, what is 1 - 1010000111? -1010000110 In base 15, what is 2 + -143? -141 In base 6, what is 424 - 20? 404 In base 6, what is 2 + -45? -43 In base 6, what is -430 - -11? -415 In base 10, what is 24510 - 2? 24508 In base 12, what is 99 - 1? 98 In base 11, what is -4 + 41? 38 In base 6, what is 10 + -112? -102 In base 12, what is -466 + 0? -466 In base 6, what is -100 - 2? -102 In base 2, what is -1 + 101001000011? 101001000010 In base 7, what is 235 - 10? 225 In base 4, what is 133212 + 0? 133212 In base 2, what is -10111001010 - 1? -10	{ "pile_set_name": "DM Mathematics" }
ative of 23m4w - 215087m3w - 7mw + 3m - 387w - 47 wrt m. 276m2w - 1290522mw What is the second derivative of 12g4 + 82854g*2 + 2310019g wrt g? 144g2 + 165708 What is the derivative of 3aly*2 - 103al - 7ay - 2a - 270627ly*2 - 2y + 22417 wrt y? 6aly - 7a - 541254ly - 2 What is the second derivative of -2363450u2 - 6824721u + 2? -4726900 Find the third derivative of -66317878k3 + 73467381k*2. -397907268 Find the first derivative of 98692i*2 + 2i + 5887325. 197384i + 2 What is the derivative of -7672k*2x - 42564980k2 + 35kx - 6x wrt x? -7672k2 + 35k - 6 What is the third derivative of -2v4 - 30559468v*3 + 369355v*2 + v + 112? -48v - 183356808 What is the second derivative of 154m2r*2 - 6m*2r - 147m2 - 5mr - 470713r*2 + 404 wrt r? 308m*2 - 941426 Find the third derivative of -2509686jn3z*2 + 10jn3 + jn*2z*2 + 3676jnz*2 - 360jnz + 2n2z*2 wrt n. -15058116jz2 + 60j What is the second derivative of 226190277q5 + 315702543q? 4523805540q3 What is the first derivative of 12905761fm + 2f - 146148129m wrt f? 12905761m + 2 What is the derivative of -73959g + 8860907? -73959 What is the third derivative of -232668c*3px2 - 185c*3p + 86749c2 - 163cpx*2 wrt c? -1396008px2 - 1110p Find the second derivative of -3668626o5 - 1435o - 109. -73372520o3 Find the first derivative of -2dt2 + 2dt - 30294100d - 15149391t2 - 3 wrt t. -4dt + 2d - 30298782t What is the second derivative of 141g*2k*3 - 163g*2ks - 10620009g*2s*2 + 36g*2s - 12gk*3s2 + k3s wrt s? -21240018g*2 - 24gk3 Differentiate 3i*3 - 1048407i*2 + 10626641 with respect to i. 9i*2 - 2096814i Find the third derivative of -730309213c5 + 3224c*2 + 43c - 182 wrt c. -43818552780c2 Find the second derivative of 22j*5 + 24685422j*4 - 3019597j - 140. 440j3 + 296225064j*2 What is the third derivative of -1277845fu4 + fu*3 - 94fu2 + 15fu - 14f + 36u4 + 2u + 24 wrt u? -30668280fu + 6f + 864u Find the third derivative of -1577f2t*3 + 3f*2 + 41ft3 - 13501ft2 + 140t*3 + 278t*2 wrt t. -9462f*2 + 246f + 840 Find the third derivative of 43797778m6 + 986088m*2 - 2m - 3. 5255733360m3 Find the second derivative of 8l*2n*2 - 718590l*2n + 140395ln*2 - 3n*3 + 2n*2 - 2n wrt n. 16l2 + 280790l - 18n + 4 Differentiate -3285448s*2 + 8264987 with respect to s. -6570896s What is the third derivative of -14751303h3x*2 - 9h*3 + 185096156h*2x*2 wrt h? -88507818x*2 - 54 Find the second derivative of 70288866j*2 - 118253j - 106 wrt j. 140577732 What is the third derivative of -17457137u3 + 16645088u*2? -104742822 Differentiate 728h*4 - 26h*3 - 279h*2 - 35799627 wrt h. 2912h*3 - 78h*2 - 558h Find the second derivative of 2719g3i - 12040g3 - g2 + 650743gi - 445g wrt g. 16314gi - 72240g - 2 What is the first derivative of -128x*2 + 682868x + 113999781 wrt x? -256x + 682868 What is the derivative of -22079c*2u + 2c2 + 428cu + 456773159u wrt c? -44158cu + 4c + 428u What is the first derivative of 18h4 + 10h*3p + 2868h2p - 34107p - 69 wrt h? 72h*3 + 30h*2p + 5736hp Find the first derivative of 142445897m - 60952401 wrt m. 142445897 Differentiate 9083211cp - 8531319c with respect to p. 9083211c What is the third derivative of -105k*5 + 3k*4 - 2375k*3 + 1529571k*2 wrt k? -6300k*2 + 72k - 14250 Find the third derivative of -1411671221s6 - 33s*2 + 1337183. -169400546520s*3 What is the second derivative of -4188241c*5 + 2893c + 1564? -83764820c3 What is the third derivative of 1939450g*4h + 14620g2 - 2gh - 65g - 2h wrt g? 46546800gh What is the first derivative of -63823399s - 9645127 wrt s? -63823399 What is the second derivative of 139gk*3y + 3143gk*2y*2 - 2gy2 - 16g - 2183k3y*2 - 2912k*3y wrt y? 6286gk*2 - 4g - 4366k3 Differentiate 168486ox3 - 2ox + 64735722o - 350x wrt x. 505458ox2 - 2o - 350 Find the third derivative of 591812b2o3 - b2o2 + 515b*2 + 2bo3 + 13o*3 - 1259 wrt o. 3550872b*2 + 12b + 78 What is the third derivative of 62961073co*3u*3x - 5co*2u*3 - 321co2u - 3734cou3x + 2cox wrt o? 377766438cu3x What is the third derivative of -209632067d3 + 11496d*2 + 4d + 366? -1257792402 Find the second derivative of 1148663o3s*2 + 2o3 - o2s2 - 7957o*2s - 2972os - 3s2 wrt s. 2297326o*3 - 2o*2 - 6 Differentiate -2815794c*4 + 17693609 with respect to c. -11263176c*3 What is the second derivative of 17s*3 - 15358s*2 - 9904283s wrt s? 102s - 30716 Find the second derivative of 19371373w*2z*3 - 13wz3 - 110912wz2 - z3 + 2z wrt w. 38742746z3 Differentiate 13l*4 + 39664215l*3 + 87331904 with respect to l. 52l*3 + 118992645l*2 Differentiate -95192v*2 + 1645v + 291245543 wrt v. -190384v + 1645 Find the second derivative of 15917360np2u*2 - np*2u + 13npu + np - 5nu*2 + nu - 1097p2u - 345p2 wrt u. 31834720np2 - 10n Find the second derivative of 2184562s3 + 2s*2 - 23593334s. 13107372s + 4 What is the derivative of 424219692o - 192637890? 424219692 Find the third derivative of c*4 - 190017739c*3 + 5324c*2 - 1850 wrt c. 24c - 1140106434 What is the second derivative of -8332698z3 - 2z*2 + 10z + 73392? -49996188z - 4 Find the first derivative of 11t*2z + 9786788t2 - 4348tz - 14t + 3z wrt z. 11t*2 - 4348t + 3 What is the derivative of -2771w2 + 5940w + 150567980 wrt w? -5542w + 5940 Find the third derivative of c2d*3 + 181c*2d*2 + 127c*2 - 2cd3 - 36cd2 + 6192870d*3 wrt d. 6c*2 - 12c + 37157220 Differentiate 5o2s - 6769o2 - 8277os - 41635o + 144s wrt s. 5o*2 - 8277o + 144 Differentiate 367444574j3k - 271881781j3 with respect to k. 367444574j*3 Find the second derivative of -15561403d*2v*2 + 2dv2 - 2925dv + 476v*2 wrt d. -31122806v*2 Find the second derivative of -5169741h*4 - 6h*3 - 2h + 37639907. -62036892h2 - 36h Find the third derivative of 22655331r3x*3 + 2r*2x*3 - 50r*2x*2 + 2019rx + 1 wrt r. 135931986x*3 What is the second derivative of -26677h*2u*3 - 16h*2u - 3h2 + 7hu3 - h + 100u*2 + 617u wrt u? -160062h2u + 42hu + 200 Differentiate 106793178cu*3 + 12172u*3 + 59u - 2 with respect to c. 106793178u3 Find the first derivative of -93154202s - 218934778 wrt s. -93154202 Find the first derivative of -4j2 + 286013j - 501588. -8j + 286013 What is the first derivative of -296942785x*3 + 230363294 wrt x? -890828355x*2 What is the second derivative of -523902102g*3n2 - g3n - 317994g*3 - 2gn + 2n - 2 wrt n? -1047804204g3 Find the third derivative of 4020061r*3 + 531r*2 - 1961r + 9 wrt r. 24120366 Differentiate 173i3 + 2600i*2 - 5i - 62510074 wrt i. 519i2 + 5200i - 5 Differentiate 80926316d + 13300841 with respect to d. 80926316 Find the third derivative of 20368c*2p*3 + 57c*2p*2 + 6c*2p + 11cp*3 + 2cp2 - 2p*3 - 4248p wrt p. 122208c2 + 66c - 12 Find the second derivative of 125958553d2 - 17267546d wrt d. 251917106 What is the second derivative of 199i2k*3 - 1016i*2k*2 - 72i*2 - 2ik - 33296k - 2 wrt k? 1194i2k - 2032i2 What is the derivative of -711944528d - 551284599? -711944528 Find the second derivative of -3532522a2b + 22ab - 8a + b + 1356 wrt a. -7065044b What is the third derivative of -11k4 + 768325k*3 - 35k*2 + k - 409? -264k + 4609950 What is the derivative of -1243963075f3 + 1075334571 wrt f? -3731889225f*2 What is the second derivative of 47280319cr2 + 2168043cr + 3c wrt r? 94560638c Differentiate 267hy3 - 3hy2 + 8hy - 28h - 393335y3 - 2y with respect to h. 267y3 - 3y*2 + 8y - 28 What is the second derivative of 1222s5t + 176s3t*2 - 805st2 - 2s - 26t2 + 1 wrt s? 24440s*3t + 1056st*2 Find the third derivative of -924152d**6 - 2	{ "pile_set_name": "DM Mathematics" }
of picking 1 g and 1 x when two letters picked without replacement from {x: 1, g: 1, c: 1}. 1/3 Four letters picked without replacement from {l: 2, j: 8, t: 1, d: 4}. What is prob of picking 1 t, 2 l, and 1 d? 4/1365 Three letters picked without replacement from {i: 5, j: 1, z: 7, x: 5}. What is prob of picking 1 j and 2 x? 5/408 Three letters picked without replacement from {i: 3, f: 1, s: 5, a: 5, b: 2}. Give prob of picking 1 f and 2 s. 1/56 Calculate prob of picking 1 s and 3 a when four letters picked without replacement from aaasaaaaaas. 28/55 Three letters picked without replacement from qpqp. What is prob of picking 1 p and 2 q? 1/2 Two letters picked without replacement from {e: 2, r: 2, v: 1, b: 4, a: 9, m: 2}. Give prob of picking 1 e and 1 m. 2/95 What is prob of picking 1 h and 2 n when three letters picked without replacement from {n: 14, h: 4}? 91/204 Three letters picked without replacement from {y: 9, q: 4, o: 1, r: 4, b: 2}. Give prob of picking 2 q and 1 r. 2/95 What is prob of picking 1 t, 2 m, and 1 v when four letters picked without replacement from {s: 2, j: 1, v: 1, m: 2, t: 1}? 1/35 Calculate prob of picking 2 g and 1 m when three letters picked without replacement from gggmgmgmmgmg. 21/44 Two letters picked without replacement from {x: 1, t: 6, v: 1, l: 3, p: 3}. Give prob of picking 1 v and 1 t. 6/91 Two letters picked without replacement from zgggznglzggggnngggz. Give prob of picking 1 l and 1 z. 4/171 What is prob of picking 2 e and 1 s when three letters picked without replacement from efeeeffeeeesees? 18/91 Two letters picked without replacement from kzztjxt. Give prob of picking 1 k and 1 j. 1/21 Two letters picked without replacement from {h: 1, a: 1, v: 1, f: 1, w: 1}. What is prob of picking 1 h and 1 f? 1/10 What is prob of picking 4 d when four letters picked without replacement from {m: 10, d: 8, u: 1}? 35/1938 Four letters picked without replacement from vwvwvwuuwvw. Give prob of picking 3 w and 1 u. 2/33 What is prob of picking 1 z and 1 n when two letters picked without replacement from wpwzcqn? 1/21 Four letters picked without replacement from mvvvmbmmmmbbbmebmbm. Give prob of picking 1 e and 3 v. 1/3876 Four letters picked without replacement from zoiplpfppzozlfzpzflf. What is prob of picking 2 o, 1 f, and 1 i? 4/4845 Three letters picked without replacement from {n: 8, i: 1, t: 5, j: 5, g: 1}. Give prob of picking 1 i and 2 j. 1/114 Calculate prob of picking 2 i and 1 n when three letters picked without replacement from {n: 5, i: 9, t: 2}. 9/28 Three letters picked without replacement from ddggggggddggdgdddd. Give prob of picking 1 d and 2 g. 27/68 Four letters picked without replacement from {w: 8, f: 5, p: 4, k: 2}. What is prob of picking 1 p, 1 f, and 2 k? 5/969 Two letters picked without replacement from tsttytssytsnyyft. What is prob of picking 1 n and 1 t? 1/20 Calculate prob of picking 2 s when two letters picked without replacement from {h: 11, s: 3}. 3/91 Three letters picked without replacement from {p: 1, h: 1, q: 2, e: 1}. Give prob of picking 2 q and 1 e. 1/10 Calculate prob of picking 2 p when two letters picked without replacement from {p: 11, u: 1}. 5/6 Four letters picked without replacement from lolloo. Give prob of picking 2 o and 2 l. 3/5 What is prob of picking 2 o and 1 a when three letters picked without replacement from {o: 2, j: 1, v: 1, a: 1}? 1/10 Three letters picked without replacement from ssqsuqssuuuq. Give prob of picking 2 s and 1 u. 2/11 What is prob of picking 2 y and 1 c when three letters picked without replacement from cyymcyy? 12/35 What is prob of picking 1 a, 1 h, and 1 j when three letters picked without replacement from hjxxkajjhjjxj? 6/143 Three letters picked without replacement from {d: 1, z: 1, b: 1, u: 1, y: 1}. Give prob of picking 1 b, 1 z, and 1 u. 1/10 Two letters picked without replacement from ojyjjjyot. What is prob of picking 2 j? 1/6 Three letters picked without replacement from fnnooffnnsnfn. Give prob of picking 2 n and 1 f. 30/143 Calculate prob of picking 1 z, 1 i, and 1 k when three letters picked without replacement from zbzvizbbvgzzzik. 12/455 Four letters picked without replacement from {f: 6, y: 4}. Give prob of picking 4 f. 1/14 What is prob of picking 1 u and 2 z when three letters picked without replacement from {k: 5, z: 3, u: 3}? 3/55 Two letters picked without replacement from gajjltot. Give prob of picking 1 j and 1 t. 1/7 What is prob of picking 3 b when three letters picked without replacement from {g: 3, v: 6, b: 4}? 2/143 Calculate prob of picking 2 l and 2 r when four letters picked without replacement from llrlrrr. 18/35 Calculate prob of picking 1 r and 1 j when two letters picked without replacement from nomrrkkjnmko. 1/33 What is prob of picking 1 e and 1 x when two letters picked without replacement from {x: 5, e: 11}? 11/24 Two letters picked without replacement from {b: 1, m: 1, r: 1, y: 1, p: 1, c: 2}. Give prob of picking 1 p and 1 y. 1/21 Four letters picked without replacement from jjjjjcjqkjqjjj. What is prob of picking 1 q, 1 c, and 2 j? 90/1001 Three letters picked without replacement from vzvvvz. Give prob of picking 1 v and 2 z. 1/5 What is prob of picking 1 y and 1 e when two letters picked without replacement from {y: 3, z: 2, i: 5, e: 1, p: 1}? 1/22 What is prob of picking 1 p and 2 i when three letters picked without replacement from {i: 7, p: 2}? 1/2 Two letters picked without replacement from bbbbbb. What is prob of picking 2 b? 1 What is prob of picking 1 d and 2 g when three letters picked without replacement from xcrcxgrxxgdxccngxncx? 1/380 Calculate prob of picking 2 o when two letters picked without replacement from {w: 2, o: 2, x: 1, j: 1, e: 2, n: 1}. 1/36 Four letters picked without replacement from {d: 1, g: 4, q: 2, i: 4, z: 5}. Give prob of picking 2 z and 2 g. 3/91 Calculate prob of picking 1 m and 2 u when three letters picked without replacement from ummuuum. 18/35 Two letters picked without replacement from ieemieineimmnem. What is prob of picking 1 n and 1 m? 8/105 Two letters picked without replacement from {r: 4, y: 3}. What is prob of picking 1 y and 1 r? 4/7 Two letters picked without replacement from {y: 1, q: 4, t: 1, d: 5, g: 3}. What is prob of picking 1 y and 1 d? 5/91 What is prob of picking 1 r and 1 o when two letters picked without replacement from wwffofwowwowwfqowrfw? 2/95 Three letters picked without replacement from njfjqjfifjqfqjfq. Give prob of picking 1 i, 1 q, and 1 n. 1/140 Two letters picked without replacement from {k: 1, o: 8, y: 1, s: 1, t: 1, m: 4}. Give prob of picking 1 y and 1 s. 1/120 Calculate prob of picking 1 l and 1 h when two letters picked without replacement from cccgglgcghg. 1/55 What is prob of picking 1 e and 2 c when three letters picked without replacement from {e: 2, c: 3}? 3/5 What is prob of picking 2 e when two letters picked without replacement from bbleeblebelb? 1/11 Four letters picked without replacement from ivviiiviviqiiqvviv. Give prob of picking 2 i and 2 q. 1/85 What is prob of picking 2 j when two letters picked without replacement from {z: 1, l: 1, q: 1, n: 2, j: 4, o: 3}? 1/11 Three letters picked without replacement from pzpmszvsw. Give prob of picking 1 v and 2 s. 1/84 What is prob of picking 1 n and 1 o when two letters picked without replacement from {h: 1, y: 1, o: 2, j: 1, d: 3, n: 3}? 6/55 Three letters picked without replacement from pmprvprrvpcccr. What is prob of picking 2 r and 1 c? 9/182 What is prob of picking 2 g when two letters picked without replacement from ggssggqgqqs? 2/11 Four letters picked without replacement from {q: 1, x: 2, h: 2}. Give prob of picking 4 q. 0 Two letters picked without replacement from xxxxxhxxxxb. Give prob of picking 1 x and 1 b. 9/55 Calculate prob of picking 3 y when three letters picked without replacement from ysyllylyysesyyeygysl. 7/95 What is prob of picking 1 p, 1 s, and 1 n when three letters picked without replacement from pnkrsnn? 3/35 Calculate prob of picking 1 o, 1 l, and 1 n when three letters picked without replacement from {o: 1, j: 3, q: 2, n: 4, l: 3, w: 2}. 12/455 Calculate prob of picking 2 d when two letters picked without replacement from {d: 5}. 1 Calculat	{ "pile_set_name": "DM Mathematics" }
f w*3/6 + 9w*2 + 4w. Determine a(h). 8 Let t(x) = x*2 + 3x - 4. Suppose -3j = -2 - 1. Let q be 5/3(14/14 - 7). Let i be j/36q/4. What is t(i)? 6 Let h = 7 + -2. Suppose 833 = 2z - hl, -2l = 3z - 4l - 1277. Let s(y) = -2y + 429 - z. What is s(3)? -6 Let o(n) be the second derivative of 1/3n4 + 31n + n*2 - 1 - 1/20n*5 + 1/2n*3. Determine o(4). 14 Let v(h) = -2h + 6. Let x(c) = 24c2 - 8c + 23. Let b(u) = 4v(u) - x(u). Give b(-1). -23 Let n(j) = -2j + 1. Let i be n(-6). Let v(h) = 2h3 + 28h*2 - 68h - 38. Let r be v(-16). Suppose 39 = -ik - r. Let d(l) = l2 + 4l + 2. Calculate d(k). 7 Let w(l) = 28l - 118. Let j(g) = 2g*2 + 157g - 2480. Let i be j(-92). Calculate w(i). -6 Let s(t) be the third derivative of t5/60 - t4/6 - t*3/2 - 2t2. Let i be -5 - (-8)/((-32)/(-300)). Let y = -67 + i. Calculate s(y). -6 Let u(w) = w3 + 5w2 - 9w - 41. Suppose 92348x - 26 = 92364x + 54. Calculate u(x). 4 Let x(g) = 50 + 35 + 15g2 + 49 + 3g - 142. Determine x(2). 58 Let p = -25 + 29. Suppose 2q = 3d + 49, q + q - pd = 44. Suppose 18 - 2 = -y + 4i, -5y - 4i = q. Let j(f) = -f*2 - 10f - 7. Determine j(y). 9 Suppose 46 - 325 = -93g. Let p(j) = 4j*2 - 7j - 1. What is p(g)? 14 Suppose n - 5 = -2q, -88 + 57 = -5n - 4q. Let x(g) = -7g + 11. What is x(n)? -38 Let h(c) be the third derivative of c*5/20 + 9c*4/8 + 17c*3/3 + 2015c*2. Determine h(-7). -8 Suppose -s - 4 - 9 = 2l, 12 = -3s + 3l. Let q(i) be the first derivative of -47 - 7/2i2 + 4i - 1/3i3. Give q(s). 4 Let r(z) = -23z - 40. Let g(k) = 12k + 20. Let d(x) = -11g(x) - 6r(x). Let m be d(-3). Let n(l) = -l2 - l + 1. What is n(m)? -5 Let y(f) = -f2 + 13. Let x be y(-4). Let t be ((-24)/9)/4 - 8/(-3). Let r(b) = -2b*t + 4b*2 + b + 0b2 - 4 + 5. Give r(x). 16 Let v(s) = -s3 - 24s2 - 115s - 38. Let p be v(-6). Let m(g) be the second derivative of 38g + 1/2g*3 - 1/3gp - g2 + 0. What is m(2)? -12 Let z be -2 + 3 + -3 + 1. Let y(r) = 743r - 2229r + 750r + 745r. Calculate y(z). -9 Suppose 4r - 126 = -3r. Suppose rm = 5m - 65. Let i(g) = g - 5. Give i(m). -10 Let u(o) be the second derivative of o*4/12 - 4o*3/3 + 3o*2/2 + 14o. Let k(i) = -6i + 6. Let y be k(-12). Suppose -4z + y = 9z. Determine u(z). -9 Let n(u) = u3 + 16u*2 - 33u + 32. Let z be (5 - ((-702)/65 - -17))/((-2)/(-30)). Determine n(z). -22 Let z = -22 - -22. Suppose -3w = -6, 2x + 6 = 5w - zw. Let k(g) = 1 + 3g - 4g - x - 6. Give k(-6). -1 Let o(m) = -7592 + m + 15164 - 7616 - m*3 + 25m2. Determine o(25). -19 Let m(u) = 19 - u2 + 20 + 14 + 33 - 106 + 11u. Calculate m(4). 8 Let w(o) = o3 + 31o*2 - 6o - 179. Let m be w(-31). Let h(r) = r*2 - 12r + 35. Let v be h(m). Let d(f) = f + 26. Give d(v). 26 Let r(f) = 3129f2 + 9 - 1559f*2 + 3f - 1569f2. Let a = 8 + -14. Determine r(a). 27 Let h(i) = i2 - 12i + 15. Let k be (17/(136/24))/(6/22). What is h(k)? 4 Let k(g) = -3g - 2. Let s = -3276 + 3357. Let h(d) = d3 + 10d*2 + 11d + 8. Let f be h(-7). Let j = f - s. Determine k(j). 7 Suppose -2j + 10 = -5l, -4j + 13 + 7 = 4l. Let p(y) = -4 - y - 21 + 19 + y*3. Give p(l). -6 Let q = -151 - -152. Let s(i) = 78i - 3. Determine s(q). 75 Suppose -14q = -1284 + 178. Suppose 8 = -29i - q. Let h(g) = -1 + 2 + g + 0. Give h(i). -2 Suppose 0 = -c - 2a + 17, 2c + a = -3c + 76. Let v(m) be the third derivative of cm*2 + 0m*3 + 0 + 0m + 3/8m4. Give v(1). 9 Suppose -2p - 5b + 3 = 1, -5p = -3b + 88. Let t(x) = x3 + 15x*2 + 15x + 33. What is t(p)? 19 Suppose 2z = -43 + 55, -w - 4z + 18 = 0. Let t(v) = v*2 + 9v + 3. Determine t(w). -15 Let s be 9/(135/6)(-50)/5. Let o be -3 + -4 + (-8)/s. Let i(z) = -z3 - 4z*2 + 4z - 2. Calculate i(o). 3 Let r(c) = 3c3 - 42c*2 + 99c. Let o be r(11). Let m(a) be the first derivative of -a*3/3 - 5a + 14. What is m(o)? -5 Let s(k) = 11k2 - 5 + 83k + k*3 + 14k - 139k. Give s(3). -5 Suppose -o = 15 - 22, -32 = -4x - 4o. Let v(f) = -f + 3f + 2 - 4. Calculate v(x). 0 Let q(t) = t + 3. Let m be q(-5). Let d(z) be the second derivative of z4/12 + z2/2 + 4z + 1896. Determine d(m). 5 Let u(w) = 0w + 3w + 9w2 + 5410939 - w + w3 - 5410936. Let l be (3/4)/(2/(-24)). Give u(l). -15 Let a(f) be the first derivative of f*3/3 - 6f*2 + 31f - 1151. Calculate a(5). -4 Let j(p) = p*2 - 7p + 4. Let v = 362 - 359. Suppose 3q + c = q + 19, -50 = -5q - vc. Calculate j(q). 4 Let m be (-15)/(-20)(-1240)/186. Let r(q) = -q*2 - 13q - 7. Give r(m). 33 Let c = -374 - -380. Let n(d) = 25d + 14. Let h(r) = 18r + 9. Let y(b) = 7h(b) - 5n(b). Give y(c). -1 Let s(x) be the first derivative of 3x2/2 + 33x - 21. Let r(m) = -40m2 + 157m. Let i be r(4). Calculate s(i). -3 Suppose -29f = 7738 - 7767. Let g(c) = 56c3 + c2 + 2c - 3. Give g(f). 56 Suppose -4o - 49 = -3c, 24o = 28o + 3c + 7. Let p(x) = x*2 - 16x - 169. Give p(o). -8 Let t(g) be the second derivative of 0 - g*2 - 219g - 1/6g3. What is t(-1)? -1 Let f(v) = v2 - 16v + 22. Suppose 0 = -4l - k + 39, 7l - 39 = 2l + 2k. Suppose 83 - 218 = -lo. Give f(o). 7 Let p = -75 + 82. Suppose -pi + 6 = -57. Let a(c) = -ic + 6c*2 + 2c - 7c2 - 5. What is a(-5)? 5 Suppose 0 = 2t - 0p + 5p - 18, 0 = 3t - 3p - 48. Let v be (-114)/22 + (-2128)/154 + t. Let z(w) = 2w - 7. What is z(v)? -17 Let f = 8293 - 8290. Let g(j) = -j3 + 7j*2 + j - 2. What is g(f)? 37 Suppose -3z + 5b + 25 = 0, 5b + 25 = z - 0b. Suppose -6k + k - 25 = z. Let u(r) = r*2 + 3r + 5. Calculate u(k). 15 Suppose 0 = -5m - 2g + 13, m + 2m + 5g - 4 = 0. Let u(w) be the third derivative of -w4/24 - w3/2 + 266w2. What is u(m)? -6 Let d(s) = 4 - 13s - 25 + 25s - 13s. Let l be d(-18). Let v(w) be the second derivative of w*3/6 - 2w. Determine v(l). -3 Let z = 2088 - 2088. Let n(a) be the third derivative of -a5/60 + a4/12 + a*3 + 5a2. Determine n(z). 6 Let b(a) = a2 + 13a + 14. Let r be b(-11). Let c(u) = 9u + 68. Calculate c(r). -4 Let z = 18 + -11. Let u(h) = -1 + 1 + h*3 + 8 + zh*2 + 6h. Calculate u(-6). 8 Let v = -2955 - -2953. Let i(p) = p3 - p2 - 2p - 2. What is i(v)? -10 Suppose -4v - 62 = -6v. Let c(x) = x2 + 218x*3 - 217x*3 + 2 - 29x + vx. Determine c(-2). -6 Let d = 192 - 188. Let j(g) = 26g - 6g + 0g + g*2 - d - g - 9g. Give j(-10). -4 Let n = 4680 + -4681. Let o(z) = 56z. Determine o(n). -56 Let i be ((-116)/(-290))/(0 - 2/(-50)). Let m be (4 + -9)4/i. Let t(k) be the first derivative of -2k2 - 2k + 1. What is t(m)? 6 Let n(c) = -c*2 - 4c. Let i(m) = -m*2 + 7m - 3. Let f be i(7). Let t be n(f). Let z(o) = o*3 + 7o + 0o3 - 8o - 4 - 2o2. What is z(t)? 2 Let d(h) = 4h*2 + 8h + 23. Let i(m) = -m*2 + m + 1. Let f(q) = d(q) + 3i(q). Calculate f(-5). -4 Let m(r) = -21r3 - 4r*2 + 20r*3 - 55 + r + 54 - 3r. Suppose -3s - 2 = 4n, -6n + 2n + 4 = 0. Calculate m(s). -5 Suppose -3 = -5h + 4f, -34 + 13 = -4h - 3f. Let b(i) = -i*3 + 4i*2 + 3i - 7. Let d(m) = -3m + 19 + 2m - 18. Let y(z) = -b(z) - 3d(z). Calculate y(h). -5 Let j(x) = -4x - 2. Let h(t) = t*3 + 16t*2 - 54t + 61. Let b be h(-19). Let z(n) = 0 + 3 - 2. Let c(i) = bz(i) + j(i). Determine c(2). -6 Let r(x) = 3x*2 - 3x - 7. Let i be 25/(525/(-6)) + (-122)/14. Let a(w) = -7w2 + 6w + 15. Let t(f) = ir(f) - 4a(f). Calculate t(-2). 1 Suppose -24g = -5g + 19. Let k be -8 - g - (-1 - 8). Let n(c) = 7c2 - 3c*3 - 3c2 + c3 - 2c. What is n(k)? -4 Let g(o) = -208 + 644 - 477044o - o*2 + 476997o. Determine g(8). -4 Let o(m) be the second derivative of 5m4/12 - 4m*3/3 + 13m*2/2 - 8m + 42. Calculate o(2). 17 Let v(t) be the second derivative of -t*3/3 - 4t*2 + 4t. Suppose -3i - 20 = -4n, 2i + 3n = 7n - 12. Let x be (-1)/((-4)/4212/i). Determine v(x). 6 Suppose -4x + 63 = -3x. Let w be 150/40 - 5 - (-783)/12. Let f(q) = -4 + xq2 - 6q - wq2 + 0. Calculate f(-3). 5 Let y(k) be the third derivative of 3k6/40 + k5/15 - k4/12 - k3/6 - 565k2 + 2. What is y(1)? 10 Let w(z) be the first derivative of 2z*3/3 + 5z*2 + 24z - 4186. Calculate w(-7). 52 Let t(y) = -y*2 + 5y +	{ "pile_set_name": "DM Mathematics" }
2 * -6429. -1285.8 What is -0.678 times -1.75? 1.1865 -1.092427 times 0.1 -0.1092427 -2457512 -294900 What is the product of -550 and 4.8? -2640 Product of 4 and -966.56. -3866.24 Multiply -2833 and -0.18. 509.94 Work out -0.016 -5199. 83.184 9273.782 18547.56 Product of 4 and 28.7. 114.8 Product of -5 and -755355. 3776775 Product of -20 and 9007. -180140 Work out 21121 6. 126726 3-2460 -7380 8.182020 16523.6 -0.1 times 490181 -49018.1 What is -104 times 3.396? -353.184 -6589 times 0.268 -1765.852 -29-3567 103443 Product of -12.71 and -2823. 35880.33 -262-4 1048 15.4 times -98 -1509.2 What is the product of -0.255404 and 2? -0.510808 What is the product of -1 and 8.2088? -8.2088 Product of 0.2 and -115.733. -23.1466 Multiply 2144 and 0.326. 698.944 8.65 times -34.5 -298.425 Calculate -0.7109.43. -76.601 What is the product of -1 and -25082? 25082 Product of -0.5 and 181.74. -90.87 What is -9390 times 5? -46950 3505.21 1515.63 Work out 2 * -0.04148. -0.08296 13 times 31.085 404.105 0.5 times -1006354 -503177 What is -43 times 79? -3397 What is the product of 0.0571 and 60.6? 3.46026 -3.690.073 -0.26937 Product of -18.92 and -0.12. 2.2704 Calculate 1.4-12213. -17098.2 Work out 1.9 * -7161. -13605.9 What is the product of -16.8 and 10.29? -172.872 964283-0.5 -482141.5 Calculate -6588.30.2. -1317.66 22174 * -434 -9623516 -0.6440809 -264485.4 Multiply -5.69 and -3568. 20301.92 Calculate 01.601. 0 What is the product of 11490 and -30? -344700 What is the product of 0.2 and 79537? 15907.4 90975 * 34 3093150 Work out 936356 * 2. 1872712 Calculate -4.894. -451.2 1 times -83103 -83103 Calculate -0.0512747. -637.35 What is the product of -97.5 and -849? 82777.5 What is -0.2 times 41650? -8330 Work out -19.5 * -409. 7975.5 1525.3-0.8 -1220.24 Multiply -5 and 165462. -827310 Work out 0.6 -12.63. -7.578 -0.06478 * -41 2.65598 Calculate -0.0962-140. 13.468 Product of 61.5 and 4.6. 282.9 2910 times -333 -969030 Work out -26.04 2.34. -60.9336 -22310-4 89240 -247 6.866 -1695.902 -1758973 -527691 Product of -373 and 539. -201047 What is the product of -80.7 and 0.085? -6.8595 Product of 1.16 and 4067.8. 4718.648 What is -0.0196 times -9? 0.1764 Work out -5746 4. -22984 196052 times 3 588156 0.3 times 47.336 14.2008 -15838.9 * 0 0 -2333 times 29.1 -67890.3 Multiply 15 and 16.2. 243 What is -95.39 times -1? 95.39 Calculate 0.2153-0.1. -0.02153 What is -2.44 times 35.1? -85.644 Calculate -0.1-1.45843. 0.145843 2 * 104684 209368 Calculate -9445326. -3079070 What is the product of -420260 and 6? -2521560 527-0.03519 -18.54513 0.063 times -5162.8 -325.2564 -7536 times 15 -113040 What is 80.8 times -7.6? -614.08 Work out -0.38683 * 0.1. -0.038683 Multiply -0.4 and 0.055917. -0.0223668 What is the product of 116710 and 3? 350130 Product of -0.06896 and 0.5. -0.03448 313297 39891 What is -0.3933 times 52? -20.4516 Calculate 80242-5. -401210 What is -80840 times 3? -242520 Calculate -1318.1. -1061.1 Multiply 2 and -4972. -9944 Work out -4.03 0.01. -0.0403 1209 times 4.8 5803.2 23809 times -0.8 -19047.2 -13232570.4 -529302.8 What is the product of 1073 and -3.5? -3755.5 What is -0.2 times 53578? -10715.6 What is the product of -2026006 and -0.5? 1013003 Multiply 0.3 and 14236. 4270.8 What is -105195 times -0.3? 31558.5 0.04 times 10465 418.6 Calculate 53715. 8055 Multiply -114048 and 4. -456192 What is the product of -0.04 and -2302? 92.08 What is the product of -8 and -1926.29? 15410.32 Product of -2 and 14867. -29734 Calculate 1031999. 319990 -2.2 times 352 -774.4 Calculate -0.06939.3. -2.7117 Multiply 278.2 and -0.18. -50.076 Calculate -34.6-183. 6331.8 What is the product of 59.487 and 5? 297.435 What is the product of 0.04 and -158.3? -6.332 Calculate 5873.11-8. -46984.88 0.5 * 27184.5 13592.25 317 times 17080 5414360 -0.31217489 -365246.7 1 298 298 What is 0.13864 times 38? 5.26832 Multiply -0.06618 and -1. 0.06618 Multiply 0 and 379. 0 Work out -1.6 * -81684. 130694.4 0.5 times 317442 158721 Multiply 7 and -3.608. -25.256 0.22801-52 -11.85652 Multiply 1.5 and 708. 1062 What is -0.0597 times 0.4005? -0.02390985 -897 times 0.01 -8.97 -0.4 times 57.496 -22.9984 -6 times 7490 -44940 -0.02 -21.646 0.43292 10849 * 0.5 5424.5 284.872 times 0 0 Work out -1.05 * 41.5. -43.575 What is -10170 times 82? -833940 -0.01 times 593333 -5933.33 What is -0.032 times -727.4? 23.2768 Multiply 74 and 14. 1036 Calculate -627810.1. -6278.1 What is -0.3 times -157507? 47252.1 Multiply -56532 and 1. -56532 -6 144.6 -867.6 Calculate 9410821. 941082 Multiply 0.0065 and -5.9. -0.03835 Calculate -534535. -172675 Multiply -0.016616 and 4. -0.066464 2076 times -7 -14532 -0.13284 -11.088 Calculate -472362. -292826 0.29 times -1.1 -0.319 Product of -28346 and 0.1. -2834.6 Work out 356 * -311. -110716 -0.684090 -2781.2 Work out 10 -21058. -210580 What is the product of 0.1 and 2.9473? 0.29473 7 times 1632.9 11430.3 Product of -1 and -35186. 35186 0.1 * 2372 237.2 Multiply -469 and 76.6. -35925.4 -0.4046 times 3.2 -1.29472 What is the product of 4 and -4973? -19892 753130 234750 What is 5 times -19222? -96110 What is -287.1 times 0.06? -17.226 What is -0.65 times -12.9? 8.385 What is the product of 204424 and -0.5? -102212 -729628 times -3 2188884 Multiply 0.4 and -603824. -241529.6 What is the product of -1049 and -26? 27274 1378.65 6893 Product of -5.01495 and -0.3. 1.504485 1665-0.039 -64.935 -0.045 -2824 127.08 Product of -22846.8 and -0.5. 11423.4 0.047179 times 0.047 0.002217413 Work out -1 * -19.1013. 19.1013 Multiply 70760 and 0.18. 12736.8 What is -0.02 times -47.48? 0.9496 0.021 * 12094 253.974 What is the product of 1034 and 32? 33088 Product of -358 and -59. 21122 -0.031260478 -37814.34 What is -0.3 times -815954? 244786.2 Calculate -0.444390.4. -0.177756 Work out -17 * 1029. -17493 What is the product of 0.5 and 7413.6? 3706.8 Multiply 1191 and 56. 66696 What is -32 times -38.9? 1244.8 Product of 7925 and -1.7. -13472.5 Work out 40 * -3.55. -142 Work out 40.7 * -90. -3663 What is the product of -0.0708087 and -7? 0.4956609 Product of -0.5 and -40.2562. 20.1281 Product of 3.199842 and 1. 3.199842 -5244351 times 0.3 -1573305.3 What is -204.69 times -6? 1228.14 0.8 times 91.9 73.52 -0.3117559 -35267.7 What is 8537 times 12.5? 106712.5 What is the product of 15 and 2.306? 34.59 -0.2 times -8695 1739 -1 408762 -408762 Product of 17.1 and -2.59. -44.289 -149 times -13 1937 Multiply -231760 and 0.08. -18540.8 Calculate 40305. 20150 3.28 -0.366 -1.20048 What is 1.42 times 23? 32.66 What is -55 times 389.81? -21439.55 Calculate 6.16-13. -80.08 Calculate 821.526. 172.208 -0.3 times 84 -25.2 Work out 106 * -41. -4346 Work out 3 * -3431.7. -10295.1 56287 * -0.32 -18011.84 -1156.953 * -0.4 462.7812 Calculate 7.54-716. -5398.64 Multiply -1 and -297079. 297079 4 times -114 -456 What is the product of 0.0373 and 0? 0 What is -0.5 times -0.112785? 0.0563925 -1.8848-10.3 19.41344 Product of -0.0313 and 0.011. -0.0003443 Work out -32.3 * 82. -2648.6 What is the product of 0.1 and -3.205? -0.3205 What is -51009 times -3? 153027 Multiply 0.396 and -0.2763. -0.1094148 Product of 0.1 and -111.82. -11.182 Product of 0.12 and -7993. -959.16 -12 * -117310 1407720 -13.5-0.4182 5.6457 718.6 times 0.07 50.302 Work out -0.3 -0.023022. 0.0069066 What is the product of 3 and 39082? 117246 Product of -8710 and -0.17. 1480.7 What is the product of 10 and 2.292? 22.92 What is -0.35216 times -1? 0.35216 Calculate -0.91808107. -98.23456 Work out -0.267 -980. 261.66 What is -9272.4 times 0.4? -3708.96 -6405.1-3 19215.3 Multiply -664 and -0.4. 265.6 -105739.4 times 0.4 -42295.76 Calculate -19-1680.6. 31931.4 -0.4 * -0.066 0.0264 Calculate 8.6822. 190.96 What is 0.2 times -1210? -242 4.114 16.44 What is 1 times -58.81? -58.81 Multiply 23990 and -7. -167930 What is the product of 4864 and -1.5? -7296 What is 0.11 times 0.01526? 0.0016786 4147.8-0.52 -2156.856 What is the product of 4555 and -227? -1033985 Multiply -1 and -1245.2. 1245.2 What is the product of -960 and 0.114? -109.44 What is 3291.6 times -0.2? -658.32 What is 22.7 times -0.0863? -1.95901 Multiply -0.4 and -899545. 359818 Calculate 60194. 24076 Work out -0.32 * 8774. -	{ "pile_set_name": "DM Mathematics" }
w. 55 Solve -350k - 5775 = -154k + 79k for k. -21 Solve 0 = -681s - 269s - 506s + 48048 for s. 33 Solve 292665q - 292508q = 6955 + 267 for q. 46 Solve -153c - 644 - 1860 = 1474 for c. -26 Solve -5903z = -5906z + 3 for z. 1 Solve -581y + 4682 + 15329 + 11817 = -1017y for y. -73 Solve 454p + 924 = 370p for p. -11 Solve -38569n - 108450 = -36400n for n. -50 Solve -51 - 1 = 16119t - 16132t for t. 4 Solve 148y + 12727 + 3775 = -75y for y. -74 Solve 1773g - 2790g - 2534g = -156594 - 35160 for g. 54 Solve 74904 + 15705 = -1390q + 16939 for q. -53 Solve 11795 = 40888o - 40551o for o. 35 Solve -6362162i + 6362296i + 11926 = 0 for i. -89 Solve 0 = -49322t + 50821t + 134910 for t. -90 Solve 81b = 66b + 38b - 255 + 1037 for b. -34 Solve 2384a = -6630 - 12442 for a. -8 Solve 45995u = 46289u - 28224 for u. 96 Solve 41346l = 41296l - 1000 for l. -20 Solve 26l - 291 = 84l + 637 for l. -16 Solve 2074r + 102715 = -52640 - 49971 for r. -99 Solve -91n - 3927 + 4564 = 0 for n. 7 Solve -3280u + 126269 = 1947u + 4486u for u. 13 Solve 0 = 37125i - 30378i + 65307 + 116862 for i. -27 Solve -302t = -606t + 299t + 270 for t. 54 Solve 0 = -1178j + 10003 - 10522 - 19065 - 22824 for j. -36 Solve 4167g - 3645 = 3924g for g. 15 Solve -426g + 226g - 1446 = 282g for g. -3 Solve 3248403v - 3248472v = -414 for v. 6 Solve 0 = 975s - 46343 - 28732 for s. 77 Solve -199u - 151373 + 11252 - 4419 = 1261u for u. -99 Solve 281023 - 127125 + 695082 = -15436b for b. -55 Solve 20622 = -516m + 414m - 440m - 931m for m. -14 Solve 3437x - 55114 = -39x + 234x for x. 17 Solve 46w - 26w + 374 = 42w for w. 17 Solve -314z + 82z + 10593 = 945z for z. 9 Solve -148787 = -3083b + 160940 - 106249 for b. 66 Solve -163b - 496b = 173b - 22891 + 7083 for b. 19 Solve -212l - 1346 - 1017 = 921 - 952 for l. -11 Solve 0 = -32v - 370v + 73v + 13818 for v. 42 Solve 11n + 9216 = -123n + 6n for n. -72 Solve -3162l + 68742 + 32442 = 0 for l. 32 Solve 248328 + 45160 = 2822b for b. 104 Solve 1941t + 1189t + 39289 = 1150t + 199669 for t. 81 Solve 14998 = 1037t + 138401 for t. -119 Solve 0 = 1232g + 702g + 71558 for g. -37 Solve 496h + 10565 = -906h - 35701 for h. -33 Solve -712510p = -712648p + 15180 for p. 110 Solve 82z - 414 - 677 + 139 = 14z for z. 14 Solve -420f - 471f + 1037f - 7446 = 0 for f. 51 Solve -96z + 184z - 174z = 3612 for z. -42 Solve -6029l + 196691 = -345919 for l. 90 Solve -975r - 101303 = -24278 for r. -79 Solve 877b + 1069b = 577b - 17238 + 810 for b. -12 Solve -30p + 16p - 9840 = -51p - 203p for p. 41 Solve 1918r = 94191 - 318597 for r. -117 Solve 359u + 25627 = 42500 for u. 47 Solve -5514l + 5532l + 324 = 0 for l. -18 Solve 48t + 26271 = -369t - 157t - 22519 for t. -85 Solve -60912 = -2762x + 15474 + 36856 for x. 41 Solve 2195 = 217n + 230 - 4111 for n. 28 Solve 160a - 1151 + 3444 + 2308 = -3399 for a. -50 Solve -1462981m = -1463024m + 3182 for m. 74 Solve 1966a + 508a - 7724 = 284a + 16366 for a. 11 Solve -4523x - 131562 - 49709 = 13218 for x. -43 Solve 101792 + 302161 = 7024q + 38705 for q. 52 Solve 266y + 2271y + 64311 = -1246y for y. -17 Solve -556f + 14006 = -20466 for f. 62 Solve -147c + 14329 + 377 = 627c for c. 19 Solve 0 = 2562y + 971y + 67063 + 102521 for y. -48 Solve 5884 = -86t - 120t - 90 for t. -29 Solve 137m + 418m = 4409m + 3373m + 72270 for m. -10 Solve -347s - 3424 = 9567 - 4316 for s. -25 Solve 61829r = 61779r + 650 for r. 13 Solve 1027g - 1137g - 7150 = 0 for g. -65 Solve 0 = 43m + 142m + 278 - 2683 for m. 13 Solve 3000 = 178r + 161r - 264r for r. 40 Solve -2754a + 38260 = -595a + 125a + 1716 for a. 16 Solve -1582b - 140b = -80934 for b. 47 Solve -1095 = -97h - 8h + 27h + 2883 for h. 51 Solve 0 = 71262n - 71271n + 477 for n. 53 Solve -44f + 1280 = -398f - 13072 + 192 for f. -40 Solve -1641i = 1922i - 1247i - 4632 for i. 2 Solve -3294l = 29064 - 134472 for l. 32 Solve -456 - 236 = 8l - 29l - 167 for l. 25 Solve -12q + 2213q - 505q = -47895 - 62345 for q. -65 Solve -1717b + 1627b - 9936 - 1554 = -3920b for b. 3 Solve 4064q - 1204 = 3978q for q. 14 Solve -496x + 573 + 2828 = -2974 - 3545 for x. 20 Solve -44278d + 418 = -44297d for d. -22 Solve -14448 + 4484 = -175z - 13z for z. 53 Solve 1093h + 28841 = 3702 for h. -23 Solve 3600 = 25385485i - 25385405i for i. 45 Solve 219y - 7797 = 8847 for y. 76 Solve -582d + 705d + 7101 = -1019d + 68769 for d. 54 Solve 0 = 4564b - 4552b - 384 for b. 32 Solve -100741a - 19932 = -100590a for a. -132 Solve -1612r - 20r + 145160 = 3003r - 815r for r. 38 Solve 41 + 32 + 27 = 25j for j. 4 Solve 0 = -3703k + 4k + 620k - 89291 for k. -29 Solve -49300x = -49399x + 2871 for x. 29 Solve -4059 + 519 - 4416 = 512q + 151q for q. -12 Solve 80v - 72v - 232v = 244v + 17316 for v. -37 Solve 47n - 41n + 694 = -70n - 826 for n. -20 Solve 0 = 1544z + 184145 - 119297 for z. -42 Solve -291a = 141a + 177a - 151a + 23816 for a. -52 Solve 0 = 109369u - 110795u + 39928 for u. 28 Solve -17208 = -337l + 8741 for l. 77 Solve 0 = 2227o - 1989o + 10312 + 2302 for o. -53 Solve -7105 = -4265f + 18485 for f. 6 Solve 5689n - 5270n = 52794 for n. 126 Solve 7117l - 103578 = -473662 for l. -52 Solve 2670h - 743h - 695h - 52682 = 735h for h. 106 Solve 6265a - 6444 - 14968 = 5861a for a. 53 Solve 1006v = 306v + 499v - 11055 for v. -55 Solve 369f = -5675f + 2945f - 4323f - 103908 for f. -14 Solve 2085q = -1580q + 43980 for q. 12 Solve 0 = 816053d - 815863d - 13110 for d. 69 Solve -38u = 1367 - 1451 + 1680 for u. -42 Solve 38552 = -2470t - 52838 for t. -37 Solve 1044 = 349286h - 349315h for h. -36 Solve 0 = 5853o - 2094o - 287388 - 35886 for o. 86 Solve 16508 - 15700 - 8996 = 89v for v. -92 Solve -739a + 202954 = 197781 for a. 7 Solve -7456k + 17682k - 476222 = 134190 + 197442 for k. 79 Solve -41498c - 24075 = -83086c + 41267c for c. 75 Solve -3328x - 19220x = -305687 - 1950391 - 179106 for x. 108 Solve -304039 - 789488 = -10827a for a. 101 Solve -110157 - 17209 = 3308s + 4954 for s. -40 Solve 1770y + 274749 = 131379 for y. -81 Solve 21908k + 1178248 = 2904k for k. -62 Solve 1744u = 1537u - 828 for u. -4 Solve -22427 - 14543 = -922k + 4520 for k. 45 Solve 76896 = -2998n + 328879 + 32354 + 96409 for n. 127 Solve -819y + 25256 = -7965 - 5910 - 9190 for y. 59 Solve 0d - 119d + 2389 + 573 = -13 for d. 25 Solve 58224j = 58131j + 2325 for j. 25 Solve 0 = 78i - 124i + 417i - 16324 for i. 44 Solve -75z - 46434 = 25z - 43634 for z. -28 Solve -327q + 8784 = -7428 - 14853 for q. 95 Solve 24 = -31v + 15v + 40v for v. 1 Solve 229649 + 180880 = 2976a + 136737 for a. 92 Solve 0 = -4642l + 113117 + 181239 - 104034 for l. 41 Solve -548s - 535s + 657s + 92229 = 873s for s. 71 Solve 0 = -68245q + 69445q + 118800 for q. -99 Solve -1145a = -1395a - 8000 for a. -32 Solve 348x - 4738 + 5953 = 12693 + 4878 for x. 47 Solve -5774306n = -5774315n + 414 for n. 46 Solve 36b - 91b = 238b + 4981 for b. -17 Solve 220l = -10157 + 7297 for l. -13 Solve -402l + 161l = -194l + 2021 for l. -43 Solve -616q - 24252 = 4700 for q. -47 Solve 91066 = -7800l - 181934 for l. -35 Solve 117369 = -408p + 103497 for p. -34 Solve -509u - 74u + 7642 + 95 + 22579 = 0 for u. 52 Solve 4784 = -1963r + 2055r for r. 52 Solve 2172w - 7239w = 999w + 169848 for w. -28 Solve 58g - 3055 = -2127 for g. 16 Solve -83069 - 21951 + 7945 = -858z - 907z for z. 55 Solve -89s - 132s - 31s + 19895 = -79s for s. 115 Solve -183p - 415 = -366p + 166p + 758 for p. 69 Solve -4518y - 4350 - 285537 = 161913 for y. -100 Solve -4566 = 263m + 7719 - 3606 for m. -33 Solve 5026 = -196m - 3156 - 3330 + 2300 for m. -47 Solve 1474h + 635 = 1459h - 115 for h. -50 Solve 82060 + 25641 = 17581f - 32947 for f. 8 Solve -10015 = 1909x + 11801 - 4635 for x. -9 Solve 1527c - 1514c - 358 = 188 for c. 42 Solve 4806x = -4815x - 4811x + 14439x + 413 for x. -59 Solve 0 = 180700q - 180712q + 336 for q. 28 Solve -324745 = -105540g + 102505g for g. 107 Solve -15b + 190 + 289 - 344 = 0 for b. 9 Solve 9092 + 7618 + 805 = -202j + 2971 for j. -72 S	{ "pile_set_name": "DM Mathematics" }
823. What is the third smallest value in l, -2/7, 0.3? l Let u = 103 + -200. Let t = u + 141. Which is the smallest value? (a) 5 (b) t (c) -3 c Let m = -37887.7 - -37887.4. Let g = -223/180 + -1/90. What is the second smallest value in g, m, 4? m Let v = -2 + 2.5. Let b = -2.7018 - -2.65. Let i = b + 0.0518. What is the third smallest value in v, i, -3, -2? i Let g = -277.2 - -277. Let u = 114.988 + -116. Let t = 0.012 + u. What is the fourth smallest value in 6, -3, g, t? 6 Let q = 380/7 - 1513/28. What is the fifth smallest value in q, 4, -0.1, 5, 0.89? 5 Suppose -738340 = 10c - 738300. Let a = 4 - 2. Let j = 1 + a. What is the second smallest value in j, c, 3/4, -0.3? -0.3 Let n = 60.2 - 15.9. Let z = n + -44. Let h = 1 - -3. Which is the third biggest value? (a) h (b) 0.1 (c) z b Let i = 7699 + -7385. What is the smallest value in i, 0.1, -5? -5 Suppose 71n - 74n = -3. Suppose -w - 2l + n = 0, w - 5l = -w - 16. Which is the biggest value? (a) -0.1 (b) -0.02 (c) w (d) 2 d Let i = -11493 + 22983/2. Suppose x = 5x + 8. Let j = x + 5/2. What is the third biggest value in -0.4, j, i? i Let w = 1097/36 - 121/4. Let r = -479/45 + 56/5. Let p = r - w. What is the second biggest value in -1, p, -5, -0.5? -0.5 Suppose 90b = -2h + 91b + 1, 0 = 2h - 3b - 3. What is the third smallest value in 123, h, -2, -2/5? h Let b = -11761/14720 - 3/2944. Let f be (2 - 52/27)6. What is the biggest value in -4, f, b? f Let f = -194/719 + 2659/7190. Let l = 0.7 + -0.56. Which is the third smallest value? (a) 1 (b) 2/3 (c) l (d) f b Let j = -36.13 - 0.07. Let r = j + 6.2. What is the second biggest value in -2, r, 0? -2 Let p = 8.025 - 8.315. What is the fourth smallest value in -5, p, 0.4, 1/4? 0.4 Suppose 40n + 269 = 469. Which is the fourth biggest value? (a) -1/5 (b) -1/2 (c) -0.016 (d) -2 (e) n b Let u = 2094 + -2093. What is the fourth smallest value in 0, -2, u, 0.5? u Let p = 3322 - 3323. Which is the biggest value? (a) -3/4 (b) -2 (c) -4.02 (d) p a Let o = 7 + 2. Suppose -13p + 8 = -op. Suppose 0 = -py + 4t + 6, -y + 3t = 4y - 8. Which is the third biggest value? (a) -3 (b) y (c) 0.2 a Let c = 4785 + -4789. What is the fifth smallest value in c, -3, 2, 1/16, -1? 2 Let v = 14699 + -14700. Which is the third biggest value? (a) -0.344 (b) v (c) -2/7 (d) 5 a Let z = -10012 - -10009. Which is the second biggest value? (a) 0.7 (b) -5 (c) 4 (d) 5/12 (e) z a Let y = -10.5 - -11. Let h = 78.85 + -80. Let d = h - -0.95. What is the biggest value in -0.1, 1/6, d, y? y Let k = -3277/390 + 215/26. What is the third biggest value in -3/4, 35, k? -3/4 Let f = 12 - 51. Let o = f - -51. Let a = -654 + 651. What is the fourth biggest value in 2, a, o, -1/4? a Let g be (-2)/(-8) + ((-2)/(-33))/((-760)/57). Which is the second biggest value? (a) 0 (b) g (c) 1 b Let a = 1464 - 1461. Let y be 6/27 + (-80)/252. What is the smallest value in -3/2, y, a? -3/2 Let x be ((-104)/(-6) + 2/1)/((-178)/5073). What is the second biggest value in 9, x, -0.4? -0.4 Let k be 5 - ((-40)/8 + 5) - (2 + 201). Which is the second smallest value? (a) k (b) -1 (c) -3/8 (d) 1 b Let p = 1.031 + -0.031. Let u = -0.65 + -47.35. Let q be 1406/7733 - 1/((-66)/(-56)). What is the third smallest value in q, u, p? p Let o be (-3 - 28/(-12))(-8 - 2394/(-297)). What is the second smallest value in -1/3, -8, o? -1/3 Suppose 15g - 18g + 18 = -x, 2x - g + 16 = 0. Let p = 7.8 - 7.6. What is the third smallest value in 0, p, x, 1? p Let k = -0.1 + -0.9. Let d = 11 - 10.95. Let t = d - 0.15. Which is the biggest value? (a) t (b) k (c) -4 a Suppose 3 = 5y + 13. Let d = -1549 + 2853. Let p = -1308 + d. What is the third smallest value in y, 1, p? 1 Suppose -3 = 2q - 5q. Let g = 111 - 112.4. Let r = g + 1.6. Which is the smallest value? (a) -1 (b) r (c) q a Let s be (3/(-5))/(140/(-525)). Which is the fifth smallest value? (a) s (b) -4 (c) 3 (d) 10 (e) 0 d Let s = 11437 - 11581. Which is the third smallest value? (a) s (b) -27 (c) 2/7 c Let o = -3.98848 + -0.01152. Let g be (-1)/(-6) - (-1)/3. Which is the third biggest value? (a) g (b) 9 (c) o c Let l = -20129 - -20129.2. Let f = 0 + 6. What is the smallest value in f, -0.2, l? -0.2 Let y be 0/(4 + -2 - 1). Let b = 1.15 - -0.35. Let t = 5.5 - b. What is the second biggest value in t, 0.7, y? 0.7 Let r = 4 + -7. Suppose -4c - 4 = -46u + 50u, 0 = c + 4u - 11. Let v = -2.7 - -0.7. What is the second smallest value in c, -10, v, r? c Let c be ((-6 - -1)/20)/((-10)/24). Let i be 5/2((-18)/4 + 5). What is the smallest value in c, -5, 0.5, i? -5 Let z(m) = 2m*3 - 4m*2 - 4m + 5. Let s(x) = 8x - 94. Let c be s(12). Let o be z(c). Suppose -5v = -18 - 7. What is the third biggest value in -2, o, v? o Let y = 0.45 - 0.05. Let m = 1452 + -1452. What is the fourth smallest value in -9/2, y, -1, m? y Let j = -2 - -2.2. Suppose -5y = -4h + 15, -3h - 6y + 3y = 9. Let x be 7 + (-75)/10 + h. What is the third biggest value in 9, 0, x, j? 0 Let m = -10 - -5. Let b = 0.0685 + 102.9315. Let t = b - 103.16. What is the third biggest value in -0.5, m, -3, t? -3 Let j = 0.2 + -0.4. Let s = -337/205 + 214/205. What is the third smallest value in -74, s, j? j Let c = 150.92947 + 0.07053. Let w be -1(0 + 4/2). What is the biggest value in c, 3, w? c Let u(d) = d*3 - 11d*2 - 80d + 6. Let j be u(16). Which is the biggest value? (a) -6 (b) j (c) 1/4 b Let l = 219.18 - 219.18. What is the biggest value in l, -11/5, -1, -9? l Suppose 2j + 8 = 0, -2g + 50 = -j - 8. Let t be 6/g - (-7 + (-476)/(-36)). Which is the biggest value? (a) t (b) 0.1 (c) -18 b Suppose -4 = 7i - 11. Let f be (0 - i)/((-21)/84). Let p be (-1)/(-1) - (-3 - -30). Which is the third smallest value? (a) p (b) f (c) 3 b Let v = -2.548 + 2.128. Which is the third biggest value? (a) 1 (b) 3/2 (c) v c Let f = -242.36 + -1.64. Let m = f - -246. What is the third smallest value in -2/3, m, 4, 3? 3 Let j = 5 + -2. Let i = 262.2 + -266.2. What is the third smallest value in -0.6, i, j, 1/4? 1/4 Let o = 25013 + -25016. Which is the fourth smallest value? (a) 5 (b) -0.05 (c) 0.3 (d) -0.01 (e) o c Let l be 8/(-6) - (3 + (-14455)/2550). Let f = 21/17 - l. Which is the third biggest value? (a) f (b) 0 (c) 1/4 a Let i = -495 - -441.6. Let s = -912 - -965. Let x = i + s. Which is the biggest value? (a) x (b) 2/3 (c) 2 (d) 3/7 c Let y = 6 + -5. Let m be (-6)/4 - 555/(-30). Let a be 5/(0 + y) + m + -19. What is the biggest value in -6, -3, a? a Let j = 42 + -42.075. Let h = -0.125 + j. Let s = 6 - 3. Which is the second biggest value? (a) s (b) -3 (c) h c Let j = 316.99 - 314. Let m = 2.01 + j. What is the biggest value in 3, m, 2? m Let l = -129655.4 + 129648. Let j be (-4 - -6) + 1-1. Which is the second biggest value? (a) j (b) l (c) 3/5 c Let u = -0.4 - -0.3. Let g = -94084.3 + 94084. Which is the third biggest value? (a) u (b) 0 (c) 9/4 (d) g a Let a = 50 + -31. Suppose ai - 10i = -297. What is the third smallest value in i, -3, 1? 1 Let i = -9/2 - -21/4. Let t = -37 + 37. Which is the second smallest value? (a) -0.4 (b) i (c) t c Let z = -7649 + 7648. What is the second biggest value in -12, z, -2/9, 75, 0? 0 Suppose 8 = 4b - 20. What is the second biggest value in -4, -2/5, -8, b, -2? -2/5 Let x = -6910 + 6909.99. Which is the second biggest value? (a) x (b) -5 (c) 3/2 (d) 0.42 d Let w = 0.07 + -0.27. Let p = -4360 - -4344. What is the smallest value in p, w, -3, -0.4? p Let g = -1098 - -1096. What is the third biggest value in -2/67, -0.1, g, 3? -0.1 Let i = -188.634 + -0.366. Let k = i + 188.9. Let m = 2 + -2.3. Which is the smallest value? (a) 2/13 (b) k (c) m c Let i = 0.9583 - -4.0417. Let r be (-1 - 0) + (-10)/(-7). Suppose -5 = -t - 1. Which is the fourth biggest value? (a) i (b) r (c) -3/5 (d) t c Let i = 2 + 0. Let u be (i - (-4 + 3)) + -1. Let t = 152/405 + 2/81. Which is the second biggest value? (a) u (b) t (c) 1/3 b Let j be (-4 + 1)(-7)/14. Let z = 3/15016 - 120143/75080. What is the second smallest value in -2/9, z, j? -2/9 Let o be (2/22)/(192/(-384)). Which is the smallest value? (a) 0.289 (b) 2/13 (c) o c Let d = -0.16 + 61.16. Let g = 57 - d. Let k = -6.7	{ "pile_set_name": "DM Mathematics" }
4997? 3t2 + 7t + 124921 What is the s'th term of -404, -821, -1254, -1709, -2192, -2709, -3266? -s*3 - 2s*2 - 404s + 3 What is the m'th term of 22017, 44036, 66055, 88074, 110093, 132112? 22019m - 2 What is the q'th term of -878, -900, -958, -1070, -1254, -1528, -1910? -3q3 - q - 874 What is the r'th term of -165767, -165763, -165757, -165749, -165739, -165727? r2 + r - 165769 What is the x'th term of -27, -89, -235, -501, -923, -1537, -2379, -3485? -6x3 - 6x*2 - 2x - 13 What is the f'th term of 5197934, 5197934, 5197936, 5197940, 5197946, 5197954? f*2 - 3f + 5197936 What is the r'th term of 14840, 29682, 44524? 14842r - 2 What is the m'th term of -32322, -129452, -291336, -517974, -809366, -1165512? -32377m2 + m + 54 What is the d'th term of -3019, -2982, -2943, -2902? d2 + 34d - 3054 What is the x'th term of -125, -359, -819, -1619, -2873, -4695? -19x3 + x2 - 104x - 3 What is the c'th term of 91, 239, 423, 643, 899, 1191? 18c*2 + 94c - 21 What is the v'th term of -1094, -2162, -3230, -4298? -1068v - 26 What is the f'th term of -18500, -18502, -18504? -2f - 18498 What is the b'th term of -110, -224, -356, -518, -722? -2b3 + 3b*2 - 109b - 2 What is the k'th term of 421, 1748, 3961, 7060, 11045, 15916? 443k2 - 2k - 20 What is the m'th term of 132, 1143, 3868, 9165, 17892? 143m3 - m2 + 13m - 23 What is the j'th term of 5672, 5665, 5658? -7j + 5679 What is the y'th term of -1101, -2207, -3305, -4389, -5453? y3 - 2y*2 - 1107y + 7 What is the o'th term of -759, -6144, -20759, -49218, -96135, -166124, -263799? -769o3 - o2 + o + 10 What is the x'th term of -221, -213, -207, -209, -225, -261, -323, -417? -x3 + 5x*2 - 225 What is the h'th term of 291, 1125, 2505, 4431, 6903? 273h*2 + 15h + 3 What is the a'th term of 2623, 5256, 7889, 10522, 13155? 2633a - 10 What is the n'th term of 161, 1266, 4265, 10106, 19737, 34106, 54161? 158n3 - n2 + 2n + 2 What is the i'th term of -122, -738, -1766, -3206, -5058, -7322, -9998? -206i*2 + 2i + 82 What is the c'th term of 1375, 1371, 1365, 1357, 1347, 1335, 1321? -c*2 - c + 1377 What is the g'th term of -448, -523, -598, -673, -748? -75g - 373 What is the f'th term of 472, 423, 374, 325, 276, 227? -49f + 521 What is the r'th term of 20479, 40955, 61431, 81907? 20476r + 3 What is the w'th term of 796, 1588, 2380, 3172, 3964? 792w + 4 What is the j'th term of -599, -1504, -2409, -3314, -4219? -905j + 306 What is the k'th term of 538, 786, 1034, 1282, 1530? 248k + 290 What is the g'th term of -14378, -57695, -129890, -230963, -360914? -14439g*2 + 61 What is the h'th term of -84, -556, -1342, -2442, -3856? -157h*2 - h + 74 What is the v'th term of 740, 734, 728, 722? -6v + 746 What is the p'th term of 72, 326, 744, 1308, 2000, 2802? -3p3 + 100p*2 - 25p What is the c'th term of -203, -421, -665, -935, -1231, -1553, -1901? -13c2 - 179c - 11 What is the q'th term of 154, 313, 504, 745, 1054, 1449, 1948? 3q3 - 2q*2 + 144q + 9 What is the i'th term of 332, 2136, 6966, 16334, 31752, 54732? 252i3 + i2 + 37i + 42 What is the g'th term of -103678, -103673, -103668, -103663, -103658, -103653? 5g - 103683 What is the s'th term of -1916, -1996, -2070, -2138? 3s*2 - 89s - 1830 What is the h'th term of -961, -1016, -1061, -1096? 5h2 - 70h - 896 What is the n'th term of 7186, 14371, 21556, 28741? 7185n + 1 What is the m'th term of 144, 148, 134, 96, 28, -76, -222, -416? -m3 - 3m*2 + 20m + 128 What is the d'th term of 23177, 46354, 69531, 92708? 23177d What is the i'th term of -20, -8, 20, 70, 148, 260? i3 + 2i2 - i - 22 What is the x'th term of 4680, 9371, 14060, 18747, 23432? -x2 + 4694x - 13 What is the i'th term of -70329, -140671, -211013, -281355, -351697? -70342i + 13 What is the a'th term of -193, -94, 55, 242, 455, 682, 911? -2a3 + 37a*2 + 2a - 230 What is the t'th term of 295, 454, 613, 772? 159t + 136 What is the n'th term of 4192, 4193, 4194, 4195? n + 4191 What is the m'th term of 15239, 122126, 412251, 977234, 1908695, 3298254, 5237531? 15270m3 - m2 - 30 What is the b'th term of -16363, -16209, -15951, -15589, -15123, -14553, -13879? 52b2 - 2b - 16413 What is the d'th term of 2271, 4534, 6797, 9060, 11323, 13586? 2263d + 8 What is the t'th term of -1753, -1782, -1823, -1876, -1941, -2018? -6t*2 - 11t - 1736 What is the b'th term of -26038, -52025, -78012, -103999, -129986, -155973? -25987b - 51 What is the g'th term of -1291, -1153, -1015? 138g - 1429 What is the k'th term of -5303, -21233, -47787, -84965? -5312k2 + 6k + 3 What is the p'th term of -61, -119, -177? -58p - 3 What is the z'th term of -5938, -23840, -53668, -95416, -149078, -214648? z3 - 5969z*2 - 2z + 32 What is the r'th term of -1826, -1392, -946, -482, 6, 524, 1078? r*3 + 427r - 2254 What is the z'th term of -548546, -548540, -548536, -548534, -548534, -548536? -z*2 + 9z - 548554 What is the d'th term of 484, 972, 1480, 2008, 2556, 3124, 3712? 10d2 + 458d + 16 What is the a'th term of -768523, -768527, -768533, -768541, -768551, -768563, -768577? -a2 - a - 768521 What is the d'th term of -31403, -62806, -94207, -125606? d2 - 31406d + 2 What is the l'th term of 2300, 2349, 2428, 2537? 15l*2 + 4l + 2281 What is the a'th term of 5384, 21508, 48382, 86006, 134380, 193504? 5375a2 - a + 10 What is the c'th term of 661107, 661117, 661127, 661137, 661147? 10c + 661097 What is the c'th term of 301, 1156, 2561, 4516, 7021? 275c2 + 30c - 4 What is the t'th term of -1073, -2083, -3093, -4103? -1010t - 63 What is the q'th term of -292, -297, -310, -331, -360, -397, -442? -4q*2 + 7q - 295 What is the c'th term of -111942, -447768, -1007480, -1791078, -2798562? -111943c2 + 3c - 2 What is the g'th term of -14193, -28427, -42661, -56895, -71129, -85363? -14234g + 41 What is the f'th term of -1439, -2809, -4177, -5543, -6907, -8269? f2 - 1373f - 67 What is the n'th term of -27344, -54682, -82020, -109358, -136696, -164034? -27338n - 6 What is the h'th term of -154103, -154116, -154143, -154190, -154263, -154368, -154511? -h3 - h2 - 3h - 154098 What is the b'th term of 5447, 5565, 5761, 6035? 39b2 + b + 5407 What is the v'th term of -358, -512, -666? -154v - 204 What is the f'th term of -173, -237, -301, -365? -64f - 109 What is the h'th term of -193, -164, -135, -106? 29h - 222 What is the d'th term of -3, -303, -795, -1473, -2331? d*3 - 102d*2 - d + 99 What is the p'th term of 17475, 17506, 17557, 17628, 17719, 17830? 10p*2 + p + 17464 What is the v'th term of -1523, -1426, -1329? 97v - 1620 What is the v'th term of 321, 339, 409, 555, 801, 1171, 1689, 2379? 4v3 + 2v*2 - 16v + 331 What is the a'th term of -20907, -83627, -188157, -334497, -522647, -752607, -1024377? -20905a2 - 5a + 3 What is the h'th term of 139, 250, 349, 430, 487, 514? -h*3 + 118h + 22 What is the g'th term of 1522766, 1522764, 1522762, 1522760, 1522758, 1522756? -2g + 1522768 What is the w'th term of 2934, 5849, 8748, 11625, 14474, 17289? -w3 - 2w*2 + 2928w + 9 What is the a'th term of -23180, -23207, -23234, -23261, -23288? -27a - 23153 What is the r'th term of 12494, 12491, 12488, 12485, 12482, 12479? -3r + 12497 What is the v'th term of 15757, 15752, 15747, 15742, 15737? -5v + 15762 What is the n'th term of -79, -159, -239, -319, -399? -80n + 1 What is the i'th term of 807, 662, 289, -426, -1597? -19i3 - 12i + 838 What is the t'th term of 7035, 14071, 21107, 28143? 7036t - 1 What is the p'th term of 140394, 280795, 421198, 561603, 702010, 842419, 982830? p2 + 140398p - 5 What is the y'th term of 357, 701, 1047, 1395, 1745, 2097, 2451? y*2 + 341y + 15 What is the o'th term of -356, -1402, -3122, -5504, -8536, -12206, -16502? 2o3 - 349o*2 - 13o + 4 What is the q'th term of -798, -3174, -7134, -12678, -19806, -28518, -38814? -792q2 - 6 What is the a'th term of -37885, -37889, -37895, -37903, -37913? -a2 - a - 37883 What is the w'th term of -40448, -40451, -40458, -40469, -40484, -40503, -40526? -2w*2 + 3w - 40449 What is the j'th term of -294, -617, -980, -1377, -1802? j*3 - 26j*2 - 252j - 17 What is the i'th term of 3388, 6	{ "pile_set_name": "DM Mathematics" }
385 = 0. What is r? 5, 1354 Factor 338f2/5 - 5044f + 94090. 2(13f - 485)2/5 Factor d2/5 - 51d/5 + 112. (d - 35)(d - 16)/5 Let w*3 + 8118w*2 + 16491705w + 65836996 = 0. What is w? -4057, -4 Suppose 25k2 + 2187165k - 874870 = 0. What is k? -87487, 2/5 Factor j*4/2 + 609j*3/2 - 3j*2/2 - 1825j/2 + 609. (j - 1)*2(j + 2)(j + 609)/2 Factor u4 - 294u*3 - 889u*2 - 594u. u(u - 297)(u + 1)(u + 2) Let -9f*5/7 + 47f*4/7 + 125f*3/7 - 75f*2/7 - 116f/7 + 4 = 0. Calculate f. -2, -1, 2/9, 1, 7 Find p, given that -p*3 + 9005p*2 - 161847p + 727947 = 0. 9, 8987 Suppose 25z4 - 1034480z*3 + 10701074900z*2 + 8561522000z = 0. Calculate z. -4/5, 0, 20690 Suppose 6o4/11 + 2688o*3/11 + 73866o*2/11 + 403032o/11 + 30168 = 0. Calculate o. -419, -22, -6, -1 Factor -3i2/7 + 306i/7 + 14520. -3(i - 242)(i + 140)/7 Factor a*3/6 + 1529a*2/6 + 431119a/6 + 11338717/2. (a + 169)*2(a + 1191)/6 Solve 3k5/2 + 57k*4/2 + 321k*3/2 + 123k*2/2 - 1638k - 2646 = 0. -7, -6, -2, 3 Solve -12q5 + 15144q*4 + 167805q*3 + 293925q*2 + 175647q + 34371 = 0. -9, -1, -1/2, 1273 Let 28i3 + 680i*2 + 2852i + 760 = 0. Calculate i. -19, -5, -2/7 Solve 5i2 + 41250i - 82520 = 0 for i. -8252, 2 Factor 5c4 - 4200c*3 + 16735c*2 - 12540c. 5c(c - 836)(c - 3)(c - 1) Determine n so that 2n5 - 234n*4 - 514n*3 + 4578n*2 - 6688n + 2856 = 0. -6, 1, 2, 119 Solve 2b4 - 8572b*3 - 60074b*2 - 120188b - 68688 = 0. -4, -2, -1, 4293 Factor 5d2 + 99450d. 5d(d + 19890) Suppose -28n5 - 13476n*4 + 334924n*3 - 201436n*2 - 735648n - 185840 = 0. What is n? -505, -1, -2/7, 2, 23 Factor -o*2/4 + 240o - 2871/4. -(o - 957)(o - 3)/4 Find q such that -q2 + 6378q = 0. 0, 6378 Suppose -55b5 - 78b*4 + 731b*3 + 618b*2 - 136b = 0. What is b? -4, -1, 0, 2/11, 17/5 Factor 2p5 + 5672p*4 + 4027116p*3 + 8037224p*2 + 4015778p. 2p(p + 1)*2(p + 1417)*2 Let -3v*4 + 46716v*3 - 242751330v*2 + 422297406300v - 7109130037875 = 0. What is v? 17, 5185 What is l in 9l2/2 - 739556l - 164346 = 0? -2/9, 164346 Factor -5o2 - 45720o. -5o(o + 9144) Determine k, given that -168k3 - 513k*2 - 495k - 150 = 0. -10/7, -1, -5/8 Factor -3a5/5 - 438a*4/5 + 1449a*3. -3a*3(a - 15)(a + 161)/5 Find r, given that 108r*5 + 16272r*4 + 469659r*3 - 11318091r*2 + 3733257r - 310005 = 0. -83, 1/6, 15 Factor 2g2/5 + 1308g + 19602/5. 2(g + 3)(g + 3267)/5 Suppose -2t2 + 460t - 22922 = 0. What is t? 73, 157 Solve 2o3/3 + 46o*2 + 554o - 1802/3 = 0. -53, -17, 1 Find a such that 3a2 - 8499a + 8496 = 0. 1, 2832 Find j such that j*3/4 - 942j*2 + 889245j - 3541924 = 0. 4, 1882 Factor -2m3 + 23842m*2 - 71067040m + 71043200. -2(m - 5960)2(m - 1) Solve -2n2/3 - 14482n/3 + 4828 = 0. -7242, 1 Factor -q*3/5 - 67787q*2/5 - 67784q/5 + 135572/5. -(q - 1)(q + 2)(q + 67786)/5 Solve -4i5/3 - 49i*4/3 + 424i*3/3 + 1741i*2/3 + 136i = 0 for i. -17, -3, -1/4, 0, 8 Suppose 5c4 - 105c*3 + 220c*2 + 900c = 0. Calculate c. -2, 0, 5, 18 Factor -n*3 + 679n*2 + 116582n. -n(n - 821)(n + 142) Determine w so that 22119w3/5 + 22113w*2/5 - 44244w/5 + 12/5 = 0. -2, 2/7373, 1 Factor 2f3 + 356f*2 - 6082f + 24444. 2(f - 9)(f - 7)(f + 194) Factor 4s*3/7 + 4476s*2 - 62676s/7 + 31340/7. 4(s - 1)2(s + 7835)/7 Determine v, given that -27v5 + 21087v*4 - 63054v*3 + 27928v*2 + 62304v - 49792 = 0. -1, 4/3, 778 Factor -113569y3/10 - 2293959y*2/2 + 68073y/10 - 101/10. -(y + 101)(337y - 1)*2/10 Solve -3p*3/5 + 7233p*2/5 - 893928p + 26339460 = 0 for p. 31, 1190 Find z such that -17z5 - 63140z*4 - 70515z*3 + 118820z*2 + 14852z = 0. -3713, -2, -2/17, 0, 1 Find v, given that -22v3 - 47v*2 + 764v + 105 = 0. -7, -3/22, 5 Factor -2g3/3 - 3952g*2/3 + 15832g/3 - 5280. -2(g - 2)2(g + 1980)/3 Factor s*2/3 - 1874404s/3 + 878347588804/3. (s - 937202)*2/3 Find c such that 5c*3 - 415c*2 - 19345c + 1678635 = 0. -63, 73 Factor -4w2/3 - 376w - 79040/3. -4(w + 130)(w + 152)/3 Factor -5m4 - 655m*3 - 19420m*2 + 41500m. -5m(m - 2)(m + 50)(m + 83) Find j such that -2j5/13 + 1442j*4/13 + 7242j*3/13 + 13054j*2/13 + 10160j/13 + 2904/13 = 0. -2, -1, 726 Let -2r2 - 48r - 270 = 0. What is r? -15, -9 Find x such that 9x3/2 - 46982x*2 + 323559x/2 - 62622 = 0. 4/9, 3, 10437 What is f in 3f5/5 - 84f*4/5 + 12f*3/5 + 1650f*2 + 23313f/5 + 15162/5 = 0? -7, -2, -1, 19 Factor -m*3 + 16130m*2 - 145089m. -m(m - 16121)(m - 9) Determine k so that -k*2/4 + 20519k - 421029361 = 0. 41038 Factor 2a2 + 126584a - 253176. 2(a - 2)(a + 63294) Find n such that 3n5 - 1062n*4 + 11424n*3 - 36090n*2 + 25725n = 0. 0, 1, 5, 343 Factor -5q2 - 3807660q - 724913733780. -5(q + 380766)2 Factor x2/9 - 19964x/3 + 99640324. (x - 29946)*2/9 Let 5v*5 + 445v*4 + 9200v*3 - 31740v*2 = 0. Calculate v. -46, 0, 3 Solve -3u*3 - 6330u*2 - 25272u = 0. -2106, -4, 0 What is o in -2o5/5 + 512o*4/5 - 1360o*3 + 5268o*2/5 + 130194o/5 + 117612/5 = 0? -3, -1, 9, 242 Factor r*3/4 + 122637r2/4. r2(r + 122637)/4 Factor -2d*4 + 22298d*3 + 200790d*2 + 602478d + 602532. -2(d - 11158)(d + 3)*3 Determine q, given that 35q*5/2 - 1585q*4/2 + 8555q*3 - 2380q*2 = 0. 0, 2/7, 17, 28 Factor 4v*3/3 - 5732v*2/3 + 45664v/3 - 30400. 4(v - 1425)(v - 4)*2/3 Factor 64585d*2 + 2518805d - 390. 5(d + 39)(12917d - 2) Factor -2c*3/5 - 16482c*2/5 - 6793056c - 6789760. -2(c + 1)(c + 4120)*2/5 What is f in -3f*2/7 - 867f + 298224/7 = 0? -2071, 48 Factor m*3 + 1247m*2 + 352191m - 23309055. (m - 55)(m + 651)2 Determine x so that -5x*5 + 4650x*4 - 1099565x*3 + 8574600x*2 - 17001680x = 0. 0, 4, 461 Factor -3b3 + 27594b*2 + 27603b - 55194. -3(b - 9199)(b - 1)(b + 2) Determine n so that n3 - 83n*2 + 1056n + 29952 = 0. -13, 48 Suppose 2a4/3 - 104a*2/3 - 64a = 0. Calculate a. -6, -2, 0, 8 Solve 3n3/5 - 3831n*2/5 + 243456n + 737280 = 0 for n. -3, 640 Find o such that -381o5 + 3804o*4 - 6417o*3 - 19914o*2 + 22548o + 360 = 0. -2, -2/127, 1, 5, 6 Determine z so that 2z5 + 104z*4 - 4z*3 - 208z*2 + 2z + 104 = 0. -52, -1, 1 Solve -2t3/7 - 480t*2/7 = 0 for t. -240, 0 Let -82g*3/5 - 20g*2 + 2042g/5 - 372 = 0. Calculate g. -6, 1, 155/41 Factor -c*2/6 + 59c/6 - 434/3. -(c - 31)(c - 28)/6 Factor -1936l*3/3 - 5291176l*2/3 - 240505l/3 - 911. -(l + 2733)(44l + 1)2/3 Determine q so that -q3 - 1746q2 - 88764q - 1145144 = 0. -1694, -26 Find n such that 3n5/5 + 990n*4 + 59121n*3/5 + 250878n*2/5 + 432576n/5 + 235872/5 = 0. -1638, -4, -3, -1 Factor -3y5/8 + 117y*4 - 18333y*3/8. -3y*3(y - 291)(y - 21)/8 Solve 2s*2/7 - 1314s/7 - 7956/7 = 0. -6, 663 Find f such that -20f5 + 172980f*4 - 374112485f*3 + 373982760f*2 - 93484880f = 0. 0, 1/2, 4324 Suppose -2c2/3 + 254c/3 - 1484 = 0. Calculate c. 21, 106 Factor 3g3/7 - 2874g*2/7 - 11532g/7 - 11544/7. 3(g - 962)(g + 2)2/7 Suppose j3 + 29j2 - 865j - 893 = 0. Calculate j. -47, -1, 19 Factor 4b3 - 37408b*2 + 448464b - 1344960. 4(b - 9340)(b - 6)*2 Factor 2h*2/13 + 82h/13 - 4884/13. 2(h - 33)(h + 74)/13 Solve -4j5 + 27578j*4/5 + 113398j*3/5 + 11064j*2/5 = 0. -4, -1/10, 0, 1383 Solve 2j*2/7 - 6316j/7 + 100544/7 = 0. 16, 3142 What is j in 3j4 + 588j*3 + 11430j*2 - 87276j + 75255 = 0? -173, -29, 1, 5 Solve s*2 - 159s + 2898 = 0 for s. 21, 138 Factor s*2/4 + 7317s/2 + 7316. (s + 2)(s + 14632)/4 Factor 5r*2 - 1928460r + 185947898580. 5(r - 192846)2 Factor -2y*2 - 20812y + 124944. -2(y - 6)(y + 10412) Determine a so that 3a4 - 199a*3/3 + 464a*2 - 832a - 4096/3 = 0. -1, 64/9, 8 Suppose -3z3 + 1482459z*2 - 183141131784z + 183139649328 = 0. What is z? 1, 247076 Factor -2a2/7 + 136a/7 + 6666/7. -2(a - 101)(a + 33)/7 Determine h so that -h*5/2 - 423h*4/2 + 1505h*3 = 0. -430, 0, 7 Factor 4b*4 + 112b*3 - 2696b*2 + 15792b - 26460. 4(b - 7)2(b - 3)(b + 45) Factor -2j*2/13 + 215782j/13 - 647328/13. -2*(j -	{ "pile_set_name": "DM Mathematics" }
. 10 Solve 5f - 4d = -27, -651f = -650f + 15d - 42 for f. -3 Solve -3h - 23 = -8478a + 8482a, -2h + 3a + 13 = 0 for h. -1 Solve 3p + 21 - 45 = 5g - 16 - 35, -g + 7 = -p for p. -4 Solve 59c - 2g - 179 = 63c - 129, 5c - 4g = -30 for c. -10 Solve -4r + 16 = -172u + 169u, 4u = 5r - 22 for u. -8 Solve -487j + 26 = -18a - 480j, 5a - 2j + 3 = -4 for a. -3 Solve -6v = 6f - 3f + 9, 27 - 2 = 3v + 13 for f. -11 Solve -2v = -3q - 9, 4v - 68 = 52378q - 52382q for v. 12 Solve 0 = 1653i - 1657i + 4v - 16, -11 - 25 = 9i + 2v for i. -4 Solve 39 = -2a + 5a - s, -8031 = 3a - 4s - 8079 for a. 12 Solve 4d + 6 = 3k, 102k - 7908d + 7905d = -50k - 894 for k. -6 Solve -4y - 412w + 29 = -194w - 213w, 15 = -9y + 4w + 4 for y. 1 Solve -343s - 28 = -680s + 340s - 4i, 0 = 9s - 5i - 2i + 64 for s. -4 Solve 5b - 3 = 3o - 8, 7o - 2 = -3b - 5 for o. 0 Solve -9 = 9072w - 9075w, 4w - 41 = -k for k. 29 Solve -3s + 92x + 296729 = 297168, -x = -5 for s. 7 Solve -5y = -u - 88, -y + 1417u = 1405u - 879 for y. 3 Solve 9m - 12m = 100j - 2515, 0 = 2j - 2m - 40 for j. 25 Solve 303 = 6l - 5714b + 5717b, -250 = -5l - 5b for l. 51 Solve 0 = 12l - 4f + 88, -l - 5 = -1290f + 1292f for l. -7 Solve 0 = 18875p - 18876p - 3m - 47, 5p = 2m - 184 for p. -38 Solve 0 = -177a - 3w + 312, -145a - 14 = -148a + w + 6 for a. 2 Solve 217564y = -3l + 217562y - 6, -3y + 13 = -l for l. -4 Solve -p - 183446 = 5y - 3p - 183721, 0 = -5y - 10p + 215 for y. 53 Solve -121 = 2l - 37y + 39y - 97, -21 = 3y for l. -5 Solve 0 = -743v + 1483v - 744v - 12, 5v = 7b - 50 for b. 5 Solve 6k = -4i - 34, -k = -5i - 883305 + 883271 for k. -1 Solve -3k = -26z - 93, 3z - 229 = -k - 233 for z. -3 Solve 4l + 18j + 30 = 2l, -10j - 2 = -4l - 15j for l. 3 Solve -2g + 3g - 992n + 988n = 50, -7g = -0n + 5n + 46 for g. 2 Solve 173895i - 4 = 173894i, 7w - 2i - i - 44 = 0 for w. 8 Solve -7k - 37 = -4m - 8, 4k + 38 = -2m for k. -7 Solve 4q + 56 = -2657n + 2653n, 0 = 5q - 4n + 12 + 13 for q. -9 Solve 1158h = -2n + 1157h - 8, 0 = -2n + 2h - 14 for n. -5 Solve -4y = -3w - 12, 5w - 102414 = 5y - 102434 for w. -4 Solve -l - 8 = -3y, 185y + 59 = -5l + 219y for l. -5 Solve 10p + 5n + 9 = -4 + 5 - 47, 0 = 7p - 5n - 89 for p. 2 Solve 0h - h - 1320 = 4l - 1328, 26 - 2 = 7l + 3h for l. 0 Solve 4q + 2l + 8 = 0, 2l = 7q + 2239 - 2225 for q. -2 Solve -o = 4x - 2o - 5, 4o + 908 = 37x + 846 for x. 2 Solve h + 8p - 10p - 21 = 0, 5h + 451 = -77p - 314 for h. 1 Solve 4p = 2v - 32, 259p + 155 = 264p + 5v for p. 5 Solve 4g - 132 = -4t, 4t - 3g = 5t - 4g + 21 + 4 for t. 4 Solve 31 = 4q - 3w, 2w + 1886 = 3q + 1862 for q. 10 Solve -5u - 3z - 89 + 54 = -3u, 5 = -u + z for u. -10 Solve 3h + 4 = -8b, 0 = -14b + 4h - 11h + 11h - 0 + 30 for b. 1 Solve -y + 27 = -0f + 4f, -2f - 9444y = -9449y + 3 for f. 6 Solve 2n = -4f + 7 - 17, 0 = -5n - 4f - 1 for n. 3 Solve 3a = -v - 16, -18a + 20v - 201 = 19v - 70 for a. -7 Solve -9 = -2509f + 2506f - 2u, -4u + 15 = 5f for f. 3 Solve -x + 5w + 79 = 0, 25x - 269 = 22x - 16w + 33w for x. -1 Solve 58w + 3m = 57w - 3 - 23, 3m - 10 = -w + 4m for w. 1 Solve 2k + y = 57 + 15 - 85, -2k + 17 = -5y for k. -4 Solve -79c + 40c + 35c = 2i - 20, 11c - 41 = -2i for c. 3 Solve -3u + 187 = 130l - 135l, 4l + 86 = 2l + 4u for l. -35 Solve -5j = -2r + 117, -893 + 781 = -2r + 6j for r. 71 Solve 6a + 5f - 16 = 7a, 3a - 44f = -42f - 35 for a. -11 Solve -6i = 2422l - 2420l - 44, 4l = -5i + 46 for i. 6 Solve -3z - 3w - 5297 = -2575 - 2623, -3z - 74 = -2w for z. -28 Solve 0 = 11m + 3x - 111, 649 - 592 = 5m + 3x for m. 9 Solve -7y - 43 = -2t, -5y - 57t - 183 = y - 3y - 67t for y. -1 Solve -4y + 55280 = o + 55315, 0 = -3y + 5o - 9 for y. -8 Solve 8u = -4o - u + 416 - 362, 39 = 5o - 3u for o. 9 Solve -2z = -5y + 402 - 443, 883 = -446z + y for z. -2 Solve -j + 24 = -86h + 84h, 4j + h - 72 = 6 for j. 20 Solve 1357y + u - 7 = 1358y, -5y + u - 33 = -3u for y. -5 Solve -2n + 2v - 34 = 0, 5n - 17019v + 16913v + 1903 = 0 for n. 1 Solve -150 = 4w + 11s, 315s - 313s - 47 = w for w. -43 Solve 18t + 3c - 224 = 14t, -1352t + 1365t - 4c = 783 for t. 59 Solve -5r + 9p = 2p + 9p + 4p - 127, 0 = 2r - 12p + 194 for r. 5 Solve 59t - 63t = 2k + 14, 24k + 4t = 8 for k. 1 Solve -6r - 29y - 31y = -56y - 62, r - 17y = -25 for r. 9 Solve 2629t - 2624t - 5k = 15, -5t = -6k - 13 for t. 5 Solve 126 = a + 3h + 123, a = -4h + 1 for a. 9 Solve 104 = 5p + 4v, 113p + v - 13 = 115p for p. 4 Solve -5f = -5r - 14 - 86, -964f - 36 = -965f + 5r for f. 16 Solve -3k = 2c - 49, 837c - 832c = -266k + 5034 for c. -4 Solve 2d + 18 = -2v, -156v - 2d = -155v + 18 for v. 0 Solve 2q + 36 = q + p, 6426773 = -27p + 6427691 for q. -2 Solve 0 = v + 2j, 391937j - 391934j = -3v - 3 for v. -2 Solve j + 0j + 2 = -0j - 1, 4b - 3j = 3j + 10 for b. -2 Solve 2y = -5w - 34, w = -33y + 15358 - 15430 for w. -6 Solve -3k = -6x - 15, 5x - 50 + 64 = -122k + 124k for k. -3 Solve -4x - 7 = o, 18o = -15182x + 15186x - 50 for x. -1 Solve 4n - 240 = 2j - 6j + 4, 0 = -j + 33n + 129 for j. 63 Solve 2s + z = -15, 461z + 462z + 35 = -5s - 454z + 1374z for s. -10 Solve 5w + 106955t + 25 = 106956t, 0 = 3w - 3t - t + 15 for w. -5 Solve 0 = -2h - 3v - 33, -266h - 263h - 5v = -534h - 20 for h. -9 Solve 0 = -3c - 0c + 9, 5c = 713t + 6c - 2c + 3457 + 111 for t. -5 Solve 182k = 4b + 178k + 136, 3k + 270 = -8b - 24 for b. -36 Solve 5y - 43v = -12v + 2, 1807y - 1811y - 46 = -v for y. -12 Solve -6t = -18v - 198, 38t + 71 = -5v + 42t - 26 for v. -5 Solve -3n - 4d - 13 = 0, 4n - 1302d + 654d - 20 = -644d for n. 1 Solve 28 = -4u + 5s, 5u - 23 + 2 = 2s - 14 - 8 for u. 3 Solve 0 = -4u - 4i - 40, 40u = 22u + 6i - i - 111 for u. -7 Solve -5i - 4w - 110 = 0, -19w + 18w - 32 = 10i - 11i for i. 2 Solve -2i - 4z - 720 = -714, -3z + 63 = 24i for i. 3 Solve 9 = 2h + 94f - 95f, 66f - 216 = -3h for h. 6 Solve 8h - 785v + 395v = -395v + 5, -2h + 4v = 9v - 5 for h. 0 Solve 0 = -3r - 3k - 30, 256r = 260r - 3k + 61 for r. -13 Solve -409f = 3x - 429f - 77, -20 - 4 = 4x + 5f for x. -1 Solve 4h + 153 - 309 = 4q - 5q - 154, 0 = -h - 3q + 6 for h. 0 Solve -3m - 999v + 97 = -1003v, -4m - v + 123 = 0 for m. 31 Solve l + 28p + 648 = 0, 9 + 103 = -2l - 3l - 11p + 7p for l. -4 Solve -59y + 58y + 5 = o, -12y - 8y + 52 = -4o for y. 3 Solve -5f = 2u - 279 + 313, 51 = -3u + f for u. -17 Solve 3f - 85 = -1813h + 1860h, 4h + 5 = f for h. -2 Solve -15d + 149 = -4a - 20d + 42d + 34d, 343a - 344a = 2d - 22 for a. 16 Solve -2c - 4 = -a, 237996 = 10a + 4c + 238028 for a. -2 Solve -169630f + 169627f - 48 = -d, 3d = -2f - 43 for d. -3 Solve -57t - 3v - 129 = 0, 26t - 22t - v + 63 + 30 = 113 for t. -1 Solve -9n - 20 = -29n + 24n, 28 = w - n for w. 23 Solve -541 = 18m - 4h + 486 - 415, 2m + h - 34 = -102 for m. -34 Solve -67360i - 5a - 3 = -67359i, i - 3a = -43 for i. -28 Solve -t + l - 33719 = 6l - 33654, -2t + 8l - l + 74 = 0 for t. -5 Solve 92g - 2c = 2120, -4c = -3g + 14 + 63 for g. 23 Solve -343s + 174s + 3 = -172s - 3z, 2z - 9 = 5s + 7 + 24 for s. -6 Solve 113u - 121u + 5q + 68 = 0, 0 = -q + 4 for u. 11 Solve 0 = 50r - 52r - 39l - 52, 2l + 16 = 2r + 7l for r. 13 Solve 19 = -j + 2j - q, -59j - 139 = -10q + 11q for j. -2 Solve 48v = 51v - c + 5, -2c = 22v + 130 for v. -5 Solve -4r = 4n - 12, 81558r - 9 = 81555r - 4n for r. 3 Solve 1246 = 32q + 26a + 1058, -q = a - 7 for q. 1 Solve 20j - 6j = 4f + 3j + 7j + 68, -2j + 51 = 15f for f. 1 Solve 0 = 5i + 2m - 58, 4i + 123 = 4m + 68 + 107 for i. 12 Solve -375q = 2u - 1422, -4q = -5939u + 5941u + 62 for u. -39 Solve -154v + 75 + 15 = 5u - 159v, -5u + 170 = -21v for u. 13 Solve -6 = -4u + 6a, -6596u = -6597u - 4a - 15 for u. -3 Solve 3v - 2n = -8, -677v + 921n = 922n + 4067 for v. -6 Solve 3k = 5z - 183, -k - 13 = -z - 8 + 30 for z. 39 Solve 43l = -3b + 46*l	{ "pile_set_name": "DM Mathematics" }
0.00000168877 What is 12/25 of a millimeter in micrometers? 480 Convert 7.055058 millimeters to kilometers. 0.000007055058 How many microseconds are there in twenty-nine fifths of a millisecond? 5800 What is five quarters of a meter in centimeters? 125 How many centimeters are there in 7.471689 millimeters? 0.7471689 What is 91.50111 milliseconds in minutes? 0.0015250185 Convert 8638.977 months to years. 719.91475 How many minutes are there in thirteen quarters of a hour? 195 What is 36.3888 millilitres in litres? 0.0363888 What is 155775.5 milligrams in grams? 155.7755 How many litres are there in 59.14836ml? 0.05914836 What is 24843.16 grams in tonnes? 0.02484316 What is 898680.3 centuries in years? 89868030 What is 7/2 of a meter in millimeters? 3500 How many millimeters are there in one fifth of a meter? 200 How many micrometers are there in 7/2 of a millimeter? 3500 Convert 370.7288 millilitres to litres. 0.3707288 How many millilitres are there in eighteen fifths of a litre? 3600 Convert 47.2678 nanograms to milligrams. 0.0000472678 What is 968.187l in millilitres? 968187 Convert 2046.224 centuries to decades. 20462.24 What is 7108839.99 seconds in weeks? 11.754034375 What is 11/10 of a kilogram in grams? 1100 How many millilitres are there in 8812.591l? 8812591 What is fourty-two fifths of a minute in seconds? 504 Convert 237.7132ml to litres. 0.2377132 How many millilitres are there in 3/40 of a litre? 75 How many years are there in 356768.8 decades? 3567688 How many kilograms are there in 3/5 of a tonne? 600 What is three fifths of a litre in millilitres? 600 What is 15/4 of a decade in months? 450 Convert 2.354856 millilitres to litres. 0.002354856 What is 13/4 of a litre in millilitres? 3250 What is 3/10 of a gram in milligrams? 300 What is 3.379268 years in decades? 0.3379268 What is 6/5 of a millennium in years? 1200 How many milligrams are there in three tenths of a gram? 300 How many grams are there in 27623.2t? 27623200000 How many milliseconds are there in six fifths of a minute? 72000 What is three fifths of a microgram in nanograms? 600 What is thirteen quarters of a gram in milligrams? 3250 What is 985.8795 nanometers in kilometers? 0.0000000009858795 What is 869.3203 millennia in centuries? 8693.203 What is one fifth of a millimeter in micrometers? 200 Convert 6.373732 nanometers to micrometers. 0.006373732 What is one fifth of a litre in millilitres? 200 How many days are there in 522.50625 minutes? 0.3628515625 What is six fifths of a centimeter in micrometers? 12000 What is 7972.316 grams in micrograms? 7972316000 Convert 0.9106817 litres to millilitres. 910.6817 What is 45/8 of a kilometer in meters? 5625 What is 37/2 of a litre in millilitres? 18500 How many millilitres are there in 31/5 of a litre? 6200 How many millilitres are there in eleven quarters of a litre? 2750 What is twenty-nine fifths of a millisecond in microseconds? 5800 How many hours are there in thirty-one sixths of a week? 868 What is 43/2 of a kilometer in meters? 21500 How many millilitres are there in 3185.42 litres? 3185420 What is 0.4875735 millennia in centuries? 4.875735 How many grams are there in 8.359202 tonnes? 8359202 How many minutes are there in 21/5 of a week? 42336 How many seconds are there in 68/3 of a hour? 81600 How many millilitres are there in one quarter of a litre? 250 What is one tenth of a centimeter in micrometers? 1000 What is 1/4 of a century in months? 300 Convert 99.35643ns to milliseconds. 0.00009935643 What is 44.7955ng in micrograms? 0.0447955 How many millilitres are there in 24596.05l? 24596050 Convert 2.447778 kilograms to milligrams. 2447778 What is one twentieth of a litre in millilitres? 50 What is 3/8 of a litre in millilitres? 375 How many millimeters are there in 3/5 of a centimeter? 6 How many weeks are there in 10865.64213ms? 0.000017965678125 How many seconds are there in 1/4 of a hour? 900 How many minutes are there in 0.7199272 weeks? 7256.866176 Convert 7023.921 nanoseconds to minutes. 0.00000011706535 How many minutes are there in seven quarters of a hour? 105 What is 55033.04 nanometers in kilometers? 0.00000005503304 How many micrometers are there in 13/5 of a centimeter? 26000 How many micrometers are there in eighteen fifths of a centimeter? 36000 How many nanograms are there in 43/4 of a microgram? 10750 What is 3/5 of a millennium in months? 7200 How many kilometers are there in 160.9986nm? 0.0000000001609986 How many micrometers are there in 4.494839nm? 0.004494839 Convert 27912.91 litres to millilitres. 27912910 Convert 6.037496kg to tonnes. 0.006037496 How many months are there in 45.82513 years? 549.90156 Convert 872027.6 micrometers to millimeters. 872.0276 Convert 161728.2l to millilitres. 161728200 What is 0.2537842 millilitres in litres? 0.0002537842 Convert 545378.5 minutes to microseconds. 32722710000000 How many millilitres are there in 0.8519911 litres? 851.9911 How many days are there in 8/7 of a week? 8 How many grams are there in 3691.746 tonnes? 3691746000 What is 847.5532 milligrams in nanograms? 847553200 What is 12/25 of a litre in millilitres? 480 How many years are there in 34/5 of a millennium? 6800 What is 0.5061338ml in litres? 0.0005061338 What is 67/5 of a microgram in nanograms? 13400 Convert 53.9804 seconds to nanoseconds. 53980400000 What is twenty-five halves of a meter in millimeters? 12500 What is 57.2065 grams in kilograms? 0.0572065 What is seven eighths of a litre in millilitres? 875 Convert 79.23296 litres to millilitres. 79232.96 What is twenty-one halves of a litre in millilitres? 10500 How many millilitres are there in 2.684796l? 2684.796 Convert 767.9123 litres to millilitres. 767912.3 How many millilitres are there in 1/20 of a litre? 50 What is 386.2989 micrograms in grams? 0.0003862989 How many seconds are there in 3/16 of a hour? 675 What is 4/7 of a week in days? 4 What is 17961.38442s in weeks? 0.02969805625 Convert 0.8614045ml to litres. 0.0008614045 Convert 119.7860832us to weeks. 0.000000000198059 What is 3/25 of a centimeter in micrometers? 1200 What is fifteen quarters of a century in months? 4500 What is 34/5 of a litre in millilitres? 6800 How many millilitres are there in sixty-nine halves of a litre? 34500 What is 15/16 of a century in months? 1125 How many centuries are there in 989.2004 decades? 98.92004 Convert 411.3288l to millilitres. 411328.8 What is five quarters of a milligram in micrograms? 1250 What is thirteen fifths of a meter in millimeters? 2600 Convert 45.82376 millilitres to litres. 0.04582376 How many millennia are there in 13.95212 years? 0.01395212 What is twenty-eight thirds of a hour in seconds? 33600 What is 0.7762216 centuries in years? 77.62216 How many months are there in seven quarters of a millennium? 21000 What is 933.8176 micrograms in milligrams? 0.9338176 What is 1/4 of a microgram in nanograms? 250 How many microseconds are there in seven quarters of a millisecond? 1750 How many grams are there in 272.8108kg? 272810.8 What is 3/8 of a litre in millilitres? 375 How many millilitres are there in one tenth of a litre? 100 How many hours are there in five quarters of a day? 30 Convert 32478.73 weeks to milliseconds. 19643135904000 How many minutes are there in 254080.05 nanoseconds? 0.0000042346675 How many millilitres are there in 1/10 of a litre? 100 Convert 0.6135427 weeks to hours. 103.0751736 How many months are there in 11/2 of a century? 6600 How many millimeters are there in 219425.2 centimeters? 2194252 What is 0.2272142 nanometers in meters? 0.0000000002272142 How many millilitres are there in 3741.711 litres? 3741711 How many nanoseconds are there in thirteen quarters of a microsecond? 3250 Convert 4.864325cm to meters. 0.04864325 What is 0.150443 days in nanoseconds? 12998275200000 What is twenty-one halves of a tonne in kilograms? 10500 How many microseconds are there in 1/20 of a second? 50000 How many centimeters are there in seven quarters of a meter? 175 What is thirteen quarters of a centimeter in micrometers? 32500 How many microseconds are there in 26/5 of a millisecond? 5200 What is fourty-four fifths of a millisecond in microseconds? 8800 What is 41/2 of a meter in millimeters? 20500 Wha	{ "pile_set_name": "DM Mathematics" }
/(-36)). 3, 5, 59 Let p(q) = q*2 + 28q + 57. Let y be p(-26). Let u(f) = -93f - 4. Let a(k) = -31k - 1. Let v(h) = 8a(h) - 3u(h). What are the prime factors of v(y)? 3, 53 Let d = 7382 - -48293. What are the prime factors of d? 5, 17, 131 Suppose -c = -3u + 44635, 440c = -2u + 443c + 29745. List the prime factors of u. 2, 3, 5, 31 Let h(k) be the first derivative of 16k2 - 409k - 146. What are the prime factors of h(44)? 3, 37 Let k(p) = -2p2 - 2p + 4. Let i be k(-2). Suppose 2c + v = -ic + 2, 0 = 3v + 6. Let o(x) = 2x*3 - 3x*2 + 6x - 3. List the prime factors of o(c). 13 Suppose 111y = -171y + 2898960. List the prime factors of y. 2, 5, 257 Suppose 0 = 12y + 256y - 9188721 - 14195351. What are the prime factors of y? 2, 43627 List the prime factors of (-3 - -21)/(-108) + (-1293988)/(-24). 2, 3, 4493 Suppose -8w + 9w - 102 = -2x, 4w = 4x + 348. Suppose -5i + 32 - 7 = 0. Suppose -it + w = -53. List the prime factors of t. 29 List the prime factors of -17763(-32)/48(-2)/(-4). 31, 191 Let k be 4/(-18) + -1304/(-72). Suppose kr - 1737 = 174. What are the prime factors of r? 3, 7, 13 Suppose 26c - 179143 = 348345. List the prime factors of c. 2, 317 Let y = 47255 - 24355. What are the prime factors of y? 2, 5, 229 Suppose 4w = 4p - 44592, -p - 5w - 4343 = -15473. What are the prime factors of p? 3, 5, 743 Let k = 53074 + -21239. List the prime factors of k. 5, 6367 Let p(a) = -143a + 4. Suppose 52c - 4 = 56c. Let g be p(c). Let y = g + -5. List the prime factors of y. 2, 71 Suppose 0 = 5b + i - 198908, 5b - 4i = 132876 + 66017. List the prime factors of b. 7, 5683 Let i(q) = 63q*2 + 2q - 3. Suppose 4v = -2j + 44, -5v = -7v + 10. Suppose 0w = 12w - j. What are the prime factors of i(w)? 2, 31 Suppose -2p + 14 = -82. Let m = 84 - p. List the prime factors of m - (3/2)/(21/(-28)). 2, 19 Let t = 16 + -14. Let u(l) = -8 - 2 + l2 - 2 + t. What are the prime factors of u(-12)? 2, 67 Let h = 100505 + -51773. List the prime factors of h. 2, 3, 31, 131 Let n(r) = -19r + 3. Let j(z) = -20z + 2. Let p(w) = 5j(w) - 4n(w). Let y be p(-1). Suppose f + y = 201. List the prime factors of f. 179 Let m = 36 - 34. Let a be ((-3)/m)/((-2)/(-4)). What are the prime factors of 198 + (-1 - -2) + a? 2, 7 List the prime factors of 555/(-6105) + (356908/(-11))/(-2). 16223 Suppose -38g - 9300 = -50g. Suppose 27j + g = z + 22j, -2j + 3056 = 4z. What are the prime factors of z? 3, 5, 17 Let q be (-76921)/(-117)-3 - (-1)/3. Let a = -658 - q. What are the prime factors of a? 2, 3, 73 Let i = 19090 + -2779. What are the prime factors of i? 3, 5437 Let h(z) = -69z + 416. Let i be h(6). Suppose -4515 = -5d + 4q + 3696, -5d + 8203 = -iq. List the prime factors of d. 11, 149 Suppose 3s - 16556 - 30945 + 14264 = 0. List the prime factors of s. 3, 1231 What are the prime factors of (-343)/336-7856 + (-3)/((-9)/(-2))? 3, 11 Let v = 587 + -1571. Let l = 1492 + v. What are the prime factors of l? 2, 127 Suppose -5u - 4v + 15959 = -154687, -4u + 136476 = -7v. What are the prime factors of u? 2, 113, 151 List the prime factors of (407/74)/(3/2364). 2, 11, 197 List the prime factors of ((-56091)/(-6) - 0)50/175. 2671 Suppose -a = -44 - 32. What are the prime factors of 25403/a - (-1)/(-4)? 2, 167 Suppose 3k + 135 - 105 = 0. List the prime factors of 2880/100 + (-2)/k. 29 Let u be -2 + 4 + -3 + 1. Suppose 2q + u = 4h - 2, 3q + 5h = -25. What are the prime factors of (19/2 - 0)(-3 - q)? 19 Let r be 1-13(0 + 2/(-2)). Suppose -4s - 10 = 3p + 2p, 3s = -p - r. List the prime factors of p. 2 What are the prime factors of (61321/26)/(2/28)? 7, 53, 89 Let z = -1610 + 5169. List the prime factors of z. 3559 What are the prime factors of 4/3086551? 2, 17, 173 Suppose 32g - 313104 = -16g. List the prime factors of g. 11, 593 Let v(b) = 21b2 + 1332b - 16. What are the prime factors of v(-70)? 2, 2411 Let f(h) = -2h2 - h + 2. Let a be (-5)/(-15)0/(-1)1. Let o be f(a). Suppose 3w - 3p = -p + 108, -4p + 88 = ow. List the prime factors of w. 2, 19 Let m(x) = 5x3 + x2 - x. Let k = 30 - 29. Let v be m(k). Suppose -3p + vp - 28 = 0. List the prime factors of p. 2, 7 Suppose 3m + 18361 = 4l - 25505, 2l - 21966 = -4m. What are the prime factors of l? 3, 23, 53 Suppose 2r + 2k = -84, 0 = r - 19k + 16k + 34. What are the prime factors of 15/(2/(-10)10/r)? 2, 3, 5 Suppose 125i - 1986363 = 1534012. List the prime factors of i. 28163 Let k be (-423)/(-188)(-4)/(-3). Suppose 4g - 3139 = -2b - b, -5b - kg + 5250 = 0. List the prime factors of b. 3, 13 Let g = 93 - 93. Let i = g + 493. What are the prime factors of i? 17, 29 Let u(v) = 18v + 87. Let a(r) = 39r + 175. Let t(s) = 4a(s) - 10u(s). List the prime factors of t(-42). 2, 419 Let n(z) = z3 - 20z*2 - z + 23. Let s be n(20). Suppose 13u - 2780 = su. What are the prime factors of u? 2, 139 Suppose 15n = 4881 + 37344. What are the prime factors of n? 5, 563 Suppose 691l = 607l + 4573128. List the prime factors of l. 2, 163, 167 Let c = -10249 + 38529. What are the prime factors of c? 2, 5, 7, 101 Let q(w) = -111w + 15. Let d be q(4). Let x = d + 1425. What are the prime factors of x? 2, 3, 83 Let n be -6((-11)/2 - -5). Suppose -4s = 4y - 8, -ny - 3s = 2y - 6. Suppose q + 339 = 2z - yz, 5q = 5z - 845. List the prime factors of z. 2, 5, 17 Let b = 47 - 32. Let s be 30/25b/(-2). List the prime factors of -2 - -2 - -3(-222)/s. 2, 37 Suppose 0 = -6f - 1754 - 316. Let r = f + 530. List the prime factors of r. 5, 37 What are the prime factors of (9 + 12/(-1))/(1/(-2109))? 3, 19, 37 Suppose 0 = 5v - 2j - 174, v + v - 84 = -4j. Let i = v + -54. Let t = i + 79. List the prime factors of t. 61 Let i = 7115 + -1736. What are the prime factors of i? 3, 11, 163 Let w = 97711 - 57775. What are the prime factors of w? 2, 3, 13 Let a = -2533 - -2501. Let k(l) = -8l. Let c be k(-5). Let u = c - a. List the prime factors of u. 2, 3 Let j = 658 - 413. Suppose -3v + 506 = 2s, -3v + s + 258 = -j. List the prime factors of v. 2, 3, 7 Let o(r) = -70r + 13. Let z(w) = 211w - 38. Let n(a) = 8o(a) + 3z(a). What are the prime factors of n(1)? 3, 7 Suppose -2p - p + 38921 = 1043. List the prime factors of p. 2, 59, 107 Let j(b) = b*2 - 2. Let f = 15 - 13. Let a be j(f). List the prime factors of (4/(-16))/(a/172)-2. 43 Suppose -10m - 362700 = -25m - 24m. What are the prime factors of m? 2, 3, 5, 31 Let m(d) = d2 - 32. Let f be m(-8). What are the prime factors of (-8)/(-2) - (f - 99)? 71 Let m = 114 - 65. Let y = m + -45. Suppose -2d + 3q - 5q = -128, -4q = -yd + 232. What are the prime factors of d? 61 Suppose -2j + 17401 + 1571 = -5b, 4j + 4b = 38028. What are the prime factors of j? 3, 3167 Suppose 3t + 5g = -148, 150 - 54 = -2t - 4g. Let s = -47 - t. What are the prime factors of (-6)/s((-204)/2)/1? 2, 17 Suppose -32 = -4k + 5i, -2i + 16 = 4k - 3i. Suppose -82 = -ka + 98. What are the prime factors of 1a + (-36)/9? 2, 7 Let h be 1 + (-1 - 0) - 40. Let s be (50/h)/((-1)/(-12)). List the prime factors of (-4 + 16)/((-1)/s). 2, 3, 5 Let u = 435 - 177. Let l = u - 189. List the prime factors of l. 3, 23 Let s(w) = -74w + 546. What are the prime factors of s(-45)? 2, 3, 17, 19 Let a(q) = -2q - 53. Let l be a(6). Let r = l - -255. List the prime factors of r. 2, 5, 19 Let b(x) = 45x2 - 391 - 22x*2 - 7x*2 - 15x*2 + 23x. List the prime factors of b(-59). 1733 List the prime factors of 1/(-3)(-44 + -12559). 4201 Let c(b) = -11b*2 - 37b + 1. Let x be c(-9). Let y = -184 - x. List the prime factors of y. 373 Let m = -12 - -21. Suppose 0 = mx - 8x. Suppose -o + 3n + 54 = x, -o - 3n + 75 = n. What are the prime factors of o? 3, 7 Let d = -362 - -645. Suppose d = g - 4c, g - 2c + 92 = 373. What are the prime factors of g? 3, 31 Suppose 5c - 3388 = c - 2n, -2c + 2n + 1694 = 0. Let i = -6 + c. What are the prime factors of i? 29 Suppose -8h + 23h - 369943 = -26h. What are the prime factors of h? 7, 1289 Let f(s) = -s3 - 13s*2 - s - 10. Let r = -1 + -12. Let d be f(r). Suppose dh - 45 = -2m + 5m, -3m + 91 = 5h. What are the prime factors of h? 17 Suppose -6*k + 26 =	{ "pile_set_name": "DM Mathematics" }
+ 76899z3 - 11522z*2 + z - 26 wrt z? -900z*2 - 24z + 461394 Find the first derivative of 620m2r + 23mr*2 + 18022r*2 wrt m. 1240mr + 23r*2 Find the first derivative of -161059x*2 + x + 84004 wrt x. -322118x + 1 Find the third derivative of -103v5 + 517v*3 + 1856v*2 - 144v wrt v. -6180v2 + 3102 What is the derivative of -i2n - 36744i2 + 2in - 387387n wrt i? -2in - 73488i + 2n Find the third derivative of -24966l3 + 3415l*2 - 2 wrt l. -149796 Differentiate 506119o + 532531 wrt o. 506119 Differentiate -41154dv - 8924d wrt v. -41154d What is the second derivative of 197699l3z - 2l3 - l2z + 2lz + 182l - 7z + 2 wrt l? 1186194lz - 12l - 2z What is the derivative of -19727b3 - 3b - 41180? -59181b2 - 3 Find the second derivative of 74is2t - 2ist + 11is + 91i + 996s2t - 8s2 + 21st - 5t - 2 wrt s. 148it + 1992t - 16 Find the third derivative of 2f*2l*2z - 849f2lz3 + f2lz - fl + 18l2z*3 + 3797l*2z*2 - 2l*2 wrt z. -5094f*2l + 108l2 Find the first derivative of -17188ck3w*2 + ck*3 + 285ck2 - k3 + 5k*2 + 5w*2 wrt w. -34376ck3w + 10w Find the third derivative of -12244z*5 + 4z*4 - 4z*3 - 133451z*2 + z + 2. -734640z*2 + 96z - 24 What is the derivative of -3821l4 + 2l*2x - 10402x wrt l? -15284l*3 + 4lx What is the third derivative of -170473l*4 - 4l*3 + 2l*2 - l + 54145? -4091352l - 24 What is the second derivative of -y4 - y3 + 6714y2 - 29853y + 2 wrt y? -12y2 - 6y + 13428 Find the second derivative of 742238q3 + 4q + 15594 wrt q. 4453428q What is the first derivative of -s3 + 2s*2 - 75260s + 1114096 wrt s? -3s2 + 4s - 75260 Find the second derivative of -4f4u - 2f4 - 2921f*2u - 7fu - 8101u wrt f. -48f*2u - 24f2 - 5842u What is the third derivative of -605g3p*2 - 18g*3ps2 + 3g*2ps2 + 2gp2s*2 + 451gp2s wrt g? -3630p2 - 108ps2 Differentiate -m2 + 42735m - 56812. -2m + 42735 What is the second derivative of -73i*4 - 10i*3 + 4i*2 + 217i + 300? -876i2 - 60i + 8 What is the derivative of 156312o3 + 289092? 468936o*2 What is the first derivative of 2907qy2 - 10qy + 73980q wrt y? 5814qy - 10q Find the second derivative of -44317k*5 - 2006k + 4 wrt k. -886340k3 Find the third derivative of -1297411v*4 - 2v*2 - 1229v + 211 wrt v. -31137864v Find the first derivative of -57733w - 32147. -57733 What is the derivative of 5893r4 + r3 + 43239 wrt r? 23572r*3 + 3r*2 What is the third derivative of -394d*6 + 3d*5 - 2d*2 + 140902d + 2 wrt d? -47280d3 + 180d*2 What is the second derivative of -5c*5 + 108c*3y*2 + 249c*2x - 23658cxy2 - 33c wrt c? -100c3 + 648cy2 + 498x What is the third derivative of 2z5 + 14z*4 + 98z*3 + 110z*2 - 6z? 120z2 + 336z + 588 Find the third derivative of -3h4w + 282126h4 + h3w - 22h2w - 4h2 - 29hw - 31w wrt h. -72hw + 6771024h + 6w What is the second derivative of 17918l2 + 182l + 250 wrt l? 35836 What is the second derivative of -5607n4 + 345n*2 - 2n - 1239896 wrt n? -67284n2 + 690 What is the first derivative of -11x*4 - 3x*3 - 298x*2 - 895779? -44x*3 - 9x*2 - 596x Find the third derivative of 169255b3 + 5171b*2 + 8 wrt b. 1015530 What is the third derivative of 1013825z*4 + 32z*2 + 935z + 2? 24331800z Find the third derivative of 2992o4 + o3 - o*2 - 1618 wrt o. 71808o + 6 Differentiate 61846b2 - 108923 wrt b. 123692b Find the third derivative of -106c3kot*3 - 11c*3t*3 + 6c*3t - cot*2 - kot2 - 31k - ot3 wrt t. -636c*3ko - 66c*3 - 6o What is the derivative of 2t4 + 81016t*3 + 17t*2 - 4397267? 8t*3 + 243048t*2 + 34t Find the second derivative of 238715g2 + 134551g. 477430 What is the first derivative of ox4 - 4902ox2 + 37916o wrt x? 4ox*3 - 9804ox Find the second derivative of -3gx3 + 3819gx2 + 259423gx - 5x*2 + 2x wrt x. -18gx + 7638g - 10 What is the first derivative of 359361u + 493358? 359361 Differentiate -2q3 + 21853qz - 808017z with respect to q. -6q2 + 21853z Differentiate -2137p3s3 - p3 + 59p2 - 140ps3 - 2p + 24 with respect to s. -6411p3s*2 - 420ps2 What is the second derivative of -18i*3mp + 2i*3p*2 + 2i*3p + 278748i2m*2p*2 + 2im2 + 3imp wrt p? 4i3 + 557496i*2m*2 Differentiate -47885q*2 - 61082. -95770q Find the third derivative of 42081y4 - 2y*2 - 11125. 1009944y Differentiate 22510fjn + 2fj + 58jn - 2n + 42 with respect to f. 22510jn + 2j What is the second derivative of -100z*4 + 80z*3 + 102246z wrt z? -1200z2 + 480z What is the second derivative of -14i3 + 111613i*2 + 120965i wrt i? -84i + 223226 Find the second derivative of 8028v*3 - 3v*2 - v + 105369. 48168v - 6 Find the third derivative of 103400rs*4 - 7rs2 - 19rs + s2 + 11 wrt s. 2481600rs Find the third derivative of 19u*4 - 611u*3 + 70741u*2. 456u - 3666 What is the first derivative of -2945138l3w4 + l3 + 70l2 - 35l - 217 wrt w? -11780552l3w*3 Find the second derivative of 18mo3x*2 - 13mo3x + mo3 + 9mo2x - 4mx - 10o3x2 + o3x + 3o*2x + 644x2 wrt x. 36mo3 - 20o*3 + 1288 What is the second derivative of 18fno*2 + 228fno - 2fn - 5fo2 + n2o2 - 37n*2 + no*2 wrt o? 36fn - 10f + 2n2 + 2n Differentiate -1550723i - 1406988. -1550723 What is the third derivative of -13u*4 + 185u*3 + 45334u*2 wrt u? -312u + 1110 Differentiate -411486j3 - 500403 wrt j. -1234458j*2 Differentiate -2w*4 + 68w*3 - 52w*2 + 5w + 5764966 wrt w. -8w3 + 204w*2 - 104w + 5 What is the second derivative of 2c5u*2 - 46051c*3u*2 - 4592cu2 + 149u*2 wrt c? 40c*3u*2 - 276306cu2 Differentiate 34x*2 + 9341x + 514573 wrt x. 68x + 9341 What is the second derivative of 1840330cl4 - 713cl + 3l + 375 wrt l? 22083960cl*2 What is the third derivative of 35v*4z - 4v4 - 2v*3z - 119v3 + 10v*2 + 13002z wrt v? 840vz - 96v - 12z - 714 Differentiate -49a2b + 22137ab*2 - 31039b*2 with respect to a. -98ab + 22137b*2 Differentiate -1110676x*3 + 2624990 wrt x. -3332028x*2 Differentiate 210774i - 787830 with respect to i. 210774 What is the first derivative of 22kt - 337k - 55094t + 2111 wrt t? 22k - 55094 Find the second derivative of -4jv3 + 3jv - 279j - 264673v3 + 104v wrt v. -24jv - 1588038v What is the first derivative of -31hmrv3 + hrv3 + 60hv3 - 9hv + 5341mr - rv*2 + r wrt m? -31hrv*3 + 5341r What is the first derivative of -b*2g + 4b2 + 1000bg + 2b - 158603g wrt b? -2bg + 8b + 1000g + 2 What is the third derivative of 40o*5 + 55o*3r*3 + 2494o*2r*2 + 2o*2r + or3 + 2or wrt o? 2400o*2 + 330r*3 Find the third derivative of -1050h*3o*3 + 21085h*2o*3 + ho*3 wrt h. -6300o*3 Find the third derivative of -110350j4 + j2 + 14398. -2648400j Find the second derivative of 10u*5 + 10834u*4 + 59u - 12075. 200u3 + 130008u*2 What is the third derivative of 12d*4 - 11675d*3 - 224d*2 - 497 wrt d? 288d - 70050 Find the third derivative of ls4 - 475ls3 - 23ls2 - 337ls + 3s*4 wrt s. 24ls - 2850l + 72s Differentiate 4o*3 - 1056o*2 - 2o - 39390 wrt o. 12o2 - 2112o - 2 What is the third derivative of -5207b5 + 14186b*2? -312420b*2 Find the third derivative of 5047p*5 - 45p*2 - 563p. 302820p2 What is the second derivative of 1030323b*2q - 282b - 3174q wrt b? 2060646q Find the third derivative of -839k*5 + 6k*4 - 2k*3 - 5k*2 + k + 2205 wrt k. -50340k*2 + 144k - 12 Find the first derivative of -115759r + 326940. -115759 What is the third derivative of -528h*3p*3 + 398h*3p*2 + 2h*3 + 2h*2p*3 - 3h + 65p3 wrt p? -3168h*3 + 12h*2 + 390 Find the third derivative of -2j*5 - 4262j*3o*2 + 203j*2o*2 - 249jo2 - 1 wrt j. -120j*2 - 25572o**2	{ "pile_set_name": "DM Mathematics" }
e m + 5h + 116 = -3m, -3m - 92 = 5h. Calculate the least common multiple of -61/(2 + -3) and (-172)/m + -1 + 5/6. 42 Find the common denominator of (-722)/540 + -10 + 1 + 377/39 and -35/864. 4320 Suppose 3o + 57 = 3y, 4o + 4y + 70 = 2y. Find the common denominator of 27/8 and o/12 + 3/1242237. 552 Suppose 3w - 108 = -5g + 115, -2w = -2g - 138. Let a = w - 125. Find the common denominator of 25/21 and -1 + 291/a-3 - -1. 42 Suppose g + 0g + 1 = -5v, 0 = -4g + 5v + 21. Suppose -gb = -5 - 19. Calculate the common denominator of b and 10 - 4465/160. 8 Let z = -212979259643/10438890534 - -2381406/127487. Let j = z + 3/4549. What is the common denominator of 11/2 and j? 18 Suppose -5m + 9m = 24. Let r = 27 + 12. What is the least common multiple of m and (30/(-8))/(r/(-104))? 30 Let g(l) = 4l - 2 + 3 + 4l + 3. Let k be g(5). Suppose -3i = -k - 1. Calculate the lowest common multiple of i and 1. 15 Suppose -y + 64 = f + 2y, -4f = -2y - 214. What is the lowest common multiple of 297 and f? 1485 Suppose -6q + 9q = 24. Let g(w) = -2w2 + 12w. Let b be g(q). Calculate the least common multiple of 1 - b - (-2 - -2)/5 and 6. 66 Let r(m) = 3m3 - 223m*2 + 87m - 258. Calculate the smallest common multiple of 176 and r(74). 704 Suppose -30 = 2t - 4z, 2t - 3z = -2t - 55. Suppose -2d + 1 = 5, 3k - d = -70. Let q = t - k. Calculate the smallest common multiple of q and 2. 22 Suppose 15f - 76 - 59 = 0. Let r(p) = p*2 - 6p - 13. Calculate the smallest common multiple of r(f) and 12. 84 Let b(s) = -s*2 - 197s + 402. Calculate the lowest common multiple of b(2) and 8344. 8344 Let b = -95377913/587027 - -1/251583. Let j = -1254/7 - b. Calculate the common denominator of j and (7/(-14))/((-4)/(-146)). 12 Let k(o) = o*3 + 14o*2 + 47o - 6. Suppose -275p + 14 = -277p. What is the lowest common multiple of 14 and k(p)? 56 Let w = -5672/27 + 6287/30. Find the common denominator of w and -29/900. 2700 What is the common denominator of (-2 - 63/(-24))(-1512)/(-360) and 35/1404? 2808 Let u(k) = -95k - 21. Let o be u(-10). Let h = o - 8371/9. Find the common denominator of 9/5 and h. 45 Let h(z) = -399z + 4790. What is the least common multiple of 6 and h(12)? 6 Let o(j) = 956j - 16. Let n be o(11). Suppose -6d = -2d - n. Calculate the common denominator of d/1078 + 3/7 and 49/6. 66 Let n(z) = -1 - 6 - 6z2 + 9z*2. Let m(h) = 5h + 77. Let l be m(-16). What is the lowest common multiple of n(l) and 32? 160 Suppose -2k - 315 = 2z + 205, -1016 = 4z - 2k. Find the common denominator of 13/30 and ((-206)/(-10))/(z/(-40) + 2). 210 Suppose 2s = -4g + 7 + 9, 4s + 2g = 38. Let z(b) = -2 - 5b - b3 + 2b - 87b2 + 84b*2. Calculate the lowest common multiple of z(-3) and s. 70 Let p = 17801/234 + -903/13. Let g = -2741/952 - -141/34. Calculate the common denominator of g and p. 504 Let g = 39 + -37. Suppose gf - 1309 = -5z - 0f, z = 5f + 251. Let y = z - 793/3. Find the common denominator of y and 39. 3 Let q be -2926/(-26) + 5. Let w = 12943/156 - q. Find the common denominator of w and (1/25)/((-4)/(-190)). 60 Let z = 8425/588 + -208/49. Calculate the common denominator of 163/180 and z. 180 Calculate the lowest common multiple of 13 and 7 - (-7 + -2) - (6 + -1). 143 Let t be (-1)/(-54)(-47601)/(-171). Let c = -40/171 - t. Calculate the common denominator of (-171)/(-150)(-15)/6 and c. 180 Suppose -2o + 4a + 11028 = 0, -2o - 2o = a - 22083. What is the common denominator of 145/102 and o/(-14535) + (-6)/(-57)? 102 Suppose -16f + 13f + 3s + 6 = 0, -5f - 4s = 17. Find the common denominator of 52/9 and f/(-7 - (-294)/48). 63 Suppose -82d - 62d + 2016 = -123d. What is the lowest common multiple of 146 and d? 7008 Let k = -1042631/30780 + 3179/95. What is the common denominator of k and 131/594? 3564 Let v be (-20126)/(-28) + 140/(-28). Let w = v + -713. Calculate the common denominator of -71/12 and w. 84 Let d = -9853/870 + 370/29. Let z be (-1 + 3)/(1/173). What is the common denominator of d and (-10 - -12) + z/(-48)? 120 Find the common denominator of 61/1770 and (-14)/(-21) + 2345/(-210). 1770 Suppose 2t + 3q = 6, 6t + 2q - 15 = t. Suppose 0 = 5c + 2h + 3 - 81, -2h = tc - 46. Calculate the smallest common multiple of 12 and c. 48 Suppose 3c + 5r - 107 = 0, -4c + 193 = c + r. Suppose -10s = -c - 111. Calculate the least common multiple of (-3)/(-35/s) and 16. 48 Let x be (0 - (3 - -9))-1. Suppose h = 5h - x. Suppose 0 = c + 3, -3 = -4w - 2c + 7. Calculate the smallest common multiple of h and w. 12 Find the common denominator of 3808/(-168)(-6)/15076 and -41/4. 15076 Let j(i) = -i*3 - 7i*2 - 3i - 18. Let m be j(-7). What is the common denominator of -23/20 and 1122/(-388) + 14/(14/m)? 1940 Let o = -4949162 - -232601729/47. Let m = o - -373819/658. Let f = m + -373. Calculate the common denominator of f and -5/56. 56 Let o be 3 + -8 + 3 + 1. What is the lowest common multiple of 2 and (o - (3 + -2))11/(-2)? 22 Let k(t) = 191t3 + t2 + 6t - 6. Calculate the least common multiple of 76 and k(1). 3648 Let y = -4640/7 - -27007/42. Find the common denominator of 30/11 and y. 66 Let b(y) = 659y*2 + 9y + 6. Let x be b(-7). Let c = x + -773723/24. Find the common denominator of (-2 + (-132)/(-20))(-5)/22 and c. 264 Suppose 3m - 316 = -5k + 829, 2m - 763 = -3k. What is the lowest common multiple of m and 40? 760 Let f = 14911103681/44 + -338872558. Let g = -16163 + f. Calculate the common denominator of 119/6 and g. 132 What is the common denominator of (40 - (-498)/(-12))(-1 - 146/(-27)) and (-6)/(-4)(-7)/10? 180 Let n = 27/4408 - -324559/1705896. Calculate the common denominator of 17/81 and n. 3483 Suppose -114s = -117s - 3m + 567, -5m + 363 = 2s. What is the lowest common multiple of 14 and s? 1358 Suppose 282 = j - b, -5j - 2771b + 1410 = -2766b. Calculate the lowest common multiple of j and 3. 282 Let k = 356 - 362. Calculate the common denominator of 5/k(1 + (-64)/(-24)) and 4/54(-130)/4. 54 Let s be (3/(-4))/((-66)/440). Suppose -3v - 104 = -4t - sv, -68 = -3t - 4v. What is the lowest common multiple of t and 11? 308 Let h = -1303/40 + 141/5. Let l = -272 + 68. What is the common denominator of h and 4 + (l/(-56))/3? 56 Suppose -3z = 298 - 856. Suppose -11f + 17f = z. Suppose 5m + 2i - 3i = f, -4i = 4m - 44. Calculate the lowest common multiple of m and 4. 28 Let x(s) = -s*2 - 15s - 15. Let b be x(-14). Let c be 38/(-57)18/(-4). Find the common denominator of b/((-3)/(-1) + (-5)/c) and -35/2. 4 Let u = -133 - -295. Let n = u + -102. Calculate the smallest common multiple of 20 and n. 60 Suppose 3i - 2x + 5x = 0, x = -2. Let d = 65 - 45. Suppose iu = d - 8. What is the lowest common multiple of 30 and u? 30 Let r be (4 + (-21)/4)/(3/(-12)). Suppose -3h - 183 = -4y, ry + h - 109 = 134. Calculate the common denominator of -22/3 and 10/(-56) - y/(-112). 12 Let k = -9/11500 - -119461/189750. Let i = -28888 + 693203/24. Find the common denominator of i and k. 264 Let w = -185581837/584 + 317777. Find the common denominator of 21/16 and w. 1168 Let n = -101803/12 + 8477. Find the common denominator of -37/33 and n. 132 Let n(k) = 48k2 - 48k - 48. Let q(d) = 7d + 2. Calculate the smallest common multiple of q(6) and n(-1). 528 Let k(d) = 291d - 4646. Calculate the lowest common multiple of k(16) and 8919. 89190 Let q(m) be the first derivative of m3/3 + m2/2 - 2m - 1. Calculate the lowest common multiple of ((-7)/(-3))/(27/1622/4) and q(-4). 140 Suppose 0 = -a + 2 + 43. Suppose -3h = 2h - a. Calculate the lowest common multiple of h and 2(4/8 - -3). 63 Let j(v) = 3v + 3. Let w(x) = -1. Let h(z) = j(z) + 4w(z). Let m be h(0). Calculate the common denominator of -14/11 and 30/21(-6 - m). 77 Suppose 4n + 468 = -4u, -7u - 114 = n - 3u. Let a = -111 - n. Calculate the lowest common multiple of a and 53. 371 Let k = -144061/17514 + 14/1251. Find the common denominator of k and ((-14)/(-34))/(660/(-1650)). 238 Let s = -269/4 + 66. Find the common denominator of s and (-3)/(-4)(-45)/(-130)12. 52 Suppose -3g + 1460 = -5b - 1648, -3*g = 12. Let t = -1837/3 - b. What is the common denominator of -21/17 and	{ "pile_set_name": "DM Mathematics" }
git of -4 + (-4 + 836/v)-3? 1 Let q = 1459 + -817. What is the tens digit of q? 4 Let c = -1130 + 1956. What is the hundreds digit of c? 8 Let v = 25 - 16. Let u be (13 - v)/((-1)/(-3)). Suppose 0x - u = -x. What is the units digit of x? 2 Suppose 5h - 5z = 3250, 7z + 2604 = 4h + 2z. What is the tens digit of h? 4 Suppose 5q + 672 = 12q. What is the units digit of q? 6 Suppose -2f - 4 = -12. Suppose -fw + 101 + 71 = 0. What is the units digit of w? 3 Suppose 0 = 8i - 48i + 46560. What is the hundreds digit of i? 1 Suppose u = -o - 3o + 84, -2u = 3o - 188. What is the tens digit of ((-480)/u)/((-2)/10)? 2 Suppose 50 = 3x + 2d, 2x + 2d + d - 25 = 0. What is the tens digit of x + -23 + (0 - -55)? 5 Let t(n) be the third derivative of -n5/60 + n4/4 + n*3 + 2n*2. What is the tens digit of t(5)? 1 Suppose 3q + z + 891 = 5q, -1354 = -3q - 2z. Suppose -3v = -11v + q. What is the units digit of v? 6 Suppose -f - 4 = -m, -m = -2m + 2f + 4. Suppose 0 = -h + 4u - 3 + 26, 20 = -mu. What is the units digit of h? 3 Let n(a) = 4252a*2 - 103a - 102. What is the thousands digit of n(-1)? 4 Let v(i) be the second derivative of -i*4/12 + 11i*3/3 - 3i*2 + 22i. What is the hundreds digit of v(13)? 1 Let a = 920 + -613. Suppose -3t = 13 - a. What is the units digit of t? 8 Let q(g) = -269g + 3. Let v be q(-1). Suppose 2c - 4j - v = 0, -5j = -4c + 2c + 274. What is the hundreds digit of c? 1 Suppose 0 = -3o - 5l + 6938, 57o - 5l = 58o - 2326. What is the units digit of o? 6 Suppose z = -3z + 12. Suppose -3k - 6 = zw + 3, 3k = -5w - 9. What is the units digit of (4/k)/(13/(-195))? 0 Let p = -4 + 0. Let j(x) be the third derivative of -x5/60 - 5x4/24 - x3/6 - 4x2. What is the units digit of j(p)? 3 Let d(w) = 48w*2 + 12w + 27. What is the hundreds digit of d(-4)? 7 Suppose 0 = -5s + 138 - 8. Suppose -4u - 131 = -5v, -2u + 3u - 82 = -3v. Suppose -vc + sc = -51. What is the tens digit of c? 5 Let f(i) = -29 - 38i + 78 - 29 - 25. What is the tens digit of f(-2)? 7 What is the hundreds digit of 980 + -5 + 13/1? 9 Let b(p) = -p2 - 12p + 11. Let t be b(-11). Suppose -3w + t = -23. Suppose 0 = m + w - 44. What is the units digit of m? 9 Let c be 3/(-6)6 - 282/(-3). Suppose 2d = 3a - 0a - 47, -4a - 3d = -c. What is the units digit of a? 9 Let b(d) = -d3 - 3d*2 + 7d + 14. Let x be b(-4). Suppose -xg - 7 = -4n + n, -2n + g = -5. What is the units digit of n? 3 Suppose -4f + 2b = -978, -10f + 6f - 2b + 998 = 0. What is the units digit of f? 7 Suppose -8r = -4r + 224. Let z be 0 - (0 - r)-1. Suppose -2l = -6l + z. What is the tens digit of l? 1 Let l = 102 + -51. What is the units digit of l? 1 Let y(c) = -12c - 10. Let k(r) = r - 1. Let x(f) = -5k(f) + y(f). What is the units digit of x(-3)? 6 Let q(p) = p2 + p. Let k = -6 + 6. Let m be q(k). Suppose 2u = 16 - m. What is the units digit of u? 8 What is the hundreds digit of (1 + -3)/(-38/6492)? 5 Let c be 1968/(-18)-13. Let k = -203 + c. What is the units digit of k? 5 Let g = -7 + 1. What is the tens digit of 12/(-18) - 214/g? 3 Suppose 3t - 2p - 476 - 195 = 0, 2t = 4p + 442. Suppose -2j - t = -4q + 119, j = 5q - 427. What is the units digit of q? 5 Let x = 2135 - 1000. What is the tens digit of x? 3 Let v(u) = 13u2 + 6u - 6. Let x be v(4). Suppose 4m - 262 = -2l + l, -x = -l + 5m. What is the units digit of l? 6 Let k(m) = 58m - 396. What is the units digit of k(8)? 8 Let t be (-6)/(2 - 0/4). What is the units digit of (-1 + (-114)/9)t? 1 Let b(w) = -w + 8. Let a be b(6). Suppose ar + 5y = 33, -4y + 48 = 2r + 2r. What is the units digit of 2/9 - (-79)/r? 9 Suppose -3g + 2o + 29 = -123, -2g = -2o - 100. Let n = 124 - g. What is the units digit of n? 2 Suppose -46767 = 26h - 194941. What is the units digit of h? 9 Let p(o) = -o2 - 95o - 118. What is the units digit of p(-26)? 6 Let z(r) = -r*2 - r - 4. Let f be z(-3). Let i = 13 + f. Suppose 60 = -g + ig. What is the units digit of g? 0 Suppose 2i + 9 = 3i. Let g be 6/27 - (-628)/i. Suppose 0 = 5v - 0v - g. What is the tens digit of v? 1 Suppose 4q + 170 = -62. Let x = q - -34. Let d = 46 + x. What is the units digit of d? 2 Let i(x) = 3x - 8x - x3 - 52 + 5x2 + 50. What is the units digit of i(3)? 1 Let m(g) = -g + 36. Let c be m(-11). What is the tens digit of (6/2 + -5)/((-1)/c)? 9 Let d(j) = -j2 - 5j + 1. Let h be d(-6). Let v(m) = 75m*2 + 5. Let y(i) = 75i*2 + 4. Let p(o) = hv(o) + 6y(o). What is the units digit of p(1)? 4 Suppose -3o + 2 = -7. Suppose -311 = -3a + a - op, -158 = -a - 2p. Suppose a - 13 = 5w. What is the units digit of w? 7 Let j be ((-2)/4)/(1/(-6)). Suppose -3c = s + 3, s - 3c = -s + j. Suppose 5z - 278 = -4g, -4z - g - 6 + 224 = s. What is the units digit of z? 4 What is the hundreds digit of -6 + 28581/9 - 16/(-12)? 1 Let n = -681 - -1033. Let x = 501 - n. What is the hundreds digit of x? 1 Let o(w) = -7w*3 + 52w*2 - 55w + 61. Let y(p) = -4p3 + 26p*2 - 28p + 31. Let m(c) = 3o(c) - 5y(c). What is the units digit of m(25)? 8 Suppose 0 = 29m - 164076 + 43378. What is the hundreds digit of m? 1 Let j(i) = -27i3 + i2. Let s be 0 + (-1 - -3) + 3. Suppose -2c + c = 5l + 3, 2c - 9 = sl. What is the units digit of j(l)? 8 Let b(f) = -3f - 5 + 4f + 0f. Let i be b(9). What is the units digit of (3 - 5/2)i? 2 What is the tens digit of 331/2 + (-4)/8? 6 Let r(y) = 2y2 + 17y - 48. What is the hundreds digit of r(-23)? 6 Suppose 2c + 4q - 3852 = 2q, 0 = 5c - 3q - 9630. What is the units digit of c? 6 What is the units digit of 369/((-189)/(-28))? 8 What is the units digit of 130/(-13)(-22 + (6 - 3))? 0 Suppose -3h - 68c + 809 = -73c, 0 = -5c - 5. What is the hundreds digit of h? 2 What is the units digit of 4111 - (-12 + 5 - -4)? 4 What is the units digit of (-488)/(-22) + 82/(-451)? 2 Suppose -2110a = -2107a - 10530. What is the units digit of a? 0 Let h = -416 - -824. What is the units digit of h? 8 Let z(h) = 13h2 - 32h*2 + 12h2 - h3 - 4 + 11h2 + 2h. Let b = -7 + 10. What is the units digit of z(b)? 1 Let v be 1/(4/(12 + 0)) + -9. What is the units digit of (-55)/(-1) + v/3? 3 Let r be -1 - (-1)/((-4)/4 - -2). Suppose r = -w - 46 + 55. What is the units digit of w? 9 Suppose -2y + 47 = 15. Let d(n) = 13n - 88. Let l be d(13). What is the tens digit of l/12y/3? 3 Let r = 4547 - 2728. What is the thousands digit of r? 1 Suppose -o = -3x + 58, -5x + 2o + 148 - 51 = 0. Suppose 0 = 4f - x - 69. What is the tens digit of f? 2 Let u = 221 + -144. Suppose 0 = 5m - 98 - u. What is the units digit of m? 5 What is the tens digit of 1812 - 6/(-4)168/(-63)? 0 Suppose -3q - 2q = w + 23, -3q - 7 = 4w. Suppose -5v - 18 = -wv. Let t(p) = 2p*2 + 7p + 1. What is the tens digit of t(v)? 3 Suppose 44t = -53t + 590051. What is the tens digit of t? 8 Let x(i) = 77i + 227. What is the units digit of x(11)? 4 Let a be 4 + (-5 - -4)57. Let c = a + 111. What is the units digit of c? 8 Suppose 3y - 3k = 1662, 2y + 0y - 3k = 1111. What is the tens digit of y? 5 Let q be ((-3)/2)/((-3)/10). Suppose 2r - 44 = -3z, 0 = r - 5r - qz + 84. What is the units digit of r/6(-6)/(-8)? 2 Suppose -22b + 23b + 199 = 5p, 4p + 3b = 144. What is the tens digit of p? 3 Let y(u) = u2 + 5u + 4. Let v be y(-5). Suppose -vk - 13 - 35 = 0. Let n = k + 29. What is the units digit of n? 7 Suppose -1013 = 2a - 47. Let p = a - -699. What is the units digit of p? 6 What is the hundreds digit of (3/4)/((-594)/(-3156912))? 9 Let p be -58(4 - (1 + 4)). Let l = p + 28. What is the tens digit of l? 8 Let s be 3/(-9)(-8 - -2). Let d be (-35)/s(-136)/85. What is the units digit of d/(-154) + 1170/22? 3 What is the units digit of (-2 - 3148/(-10)) + (-54)/(-45)? 4 Let b(z) = -z3 + 3z*2 - z + 3. Let p be b(3). Suppose 2s - 13 + 13 = 0. What is the units digit of p + s - 26/(-2)? 3 Let t(u) = 24u2 + 7u - 41. What is the thousands digit of t(-16)? 5 Let c = 47 + -1. Suppose -5g - c = 454. Let z = -56 - g. What is the units digit of z? 4 Suppose 0 = -r + 3 - 0. Suppose -2t = 2j - 232, -3t + 459 = t + r*j. What is the hundreds digit of	{ "pile_set_name": "DM Mathematics" }
1 wrt c? 10120c3y What is the derivative of -51l + 184? -51 What is the third derivative of q4 - 20q*3t*3 + 9q*3 - 3q*2 + 37qt3 wrt q? 24q - 120t3 + 54 Find the second derivative of -2hu2w - 2huw2 + hw*2 - 133u*3w2 + u2w2 + 3uw2 - 2u - 6w wrt u. -4hw - 798uw2 + 2w*2 What is the third derivative of 4812n*4 - 2378n*2 wrt n? 115488n Differentiate -331p2u - 23p2 + 4pu - 3p + 1 with respect to u. -331p2 + 4p Find the third derivative of 24b6 + 53b*5 + 29b*2 - 109b. 2880b3 + 3180b2 What is the third derivative of -r4uy + 3r4 - 11r*3u + 3r3y - r*2 - 9ru + 9uy wrt r? -24ruy + 72r - 66u + 18y Find the first derivative of -132du2 - 2du + 2d + 20 wrt u. -264du - 2d Find the second derivative of -1883r*3 + 343r - 2. -11298r What is the first derivative of 4892g*3 + 401? 14676g*2 What is the third derivative of 5m*5 - 3m*4 - 14m*2 - m wrt m? 300m*2 - 72m Find the second derivative of -n*5 + 100n*3 + 455n wrt n. -20n3 + 600n What is the second derivative of -7im*4 + 12im3 + im - 509i - 9m*4 - m wrt m? -84im2 + 72im - 108m*2 What is the first derivative of -2or2v*3 - 32orv*3 - 2r*2v*3 - 57rv3 wrt o? -2r*2v*3 - 32rv3 What is the first derivative of 106n*4 + 3n*2 - 360 wrt n? 424n*3 + 6n Find the first derivative of -596bh*3 + 13h*3 + 14 wrt b. -596h*3 Find the third derivative of -8735m*6 - 1860m*2 - 2m wrt m. -1048200m3 Find the second derivative of 9j*3z*2 - 8j*3 + 47j*2z*2 + 3j*2 - 12j - 3z2 + 3z wrt z. 18j3 + 94j*2 - 6 What is the second derivative of -4pt3 - 26pt - 5p - 2t5 + 8t*3 wrt t? -24pt - 40t*3 + 48t What is the second derivative of -2c3d*3 + 2c3 - c2d - 64cd3 + 2cd wrt d? -12c*3d - 384cd Find the second derivative of -20f2k*3 - 14f*2 - 5fk2 + 579k*3 wrt f. -40k3 - 28 Differentiate -g2 - 58g - 34 wrt g. -2g - 58 Find the third derivative of 117h3 - 80h*2 - 4. 702 Find the third derivative of 428u*3 - 254u*2. 2568 Find the first derivative of 6008y + 9730. 6008 Differentiate 14q4 + 24q*2 + 214 wrt q. 56q*3 + 48q Differentiate -50gi*3 + 21gi2 + 725i*3 with respect to g. -50i*3 + 21i*2 What is the third derivative of -129l*3 + 42l*2 wrt l? -774 What is the second derivative of -32248l*2 - 15532l? -64496 Find the second derivative of -2x3 - 27x*2 + 9x + 2. -12x - 54 Differentiate 1074m + 339 wrt m. 1074 What is the second derivative of 2257s5 + 1529s? 45140s3 What is the third derivative of -93uw4 - 2uw2 - 7u wrt w? -2232uw What is the derivative of -3260q4 - 4023? -13040q*3 Find the third derivative of 1447f*3o2 + f3o - 11f*2o*2 - fo*2 + 23f wrt f. 8682o2 + 6o What is the third derivative of 124g3i*2mr3 - 2g*3imr + 2g3r*2 + gi*2mr3 - 10gi2mr2 - 2i*2mr2 + 2i*2mr wrt r? 744g*3i*2m + 6gi*2m What is the third derivative of -3c4 + 420c*3 + 1071c*2 + c? -72c + 2520 What is the third derivative of 369a5 - 2a*4 + 5a*2 - 50a wrt a? 22140a2 - 48a What is the third derivative of -4676x3 - 4551x2? -28056 Find the second derivative of s3v + 37s*3 - 20s*2v - 2s2 - 9sv + 22v + 2 wrt s. 6sv + 222s - 40v - 4 Find the third derivative of 3h3op2 + 269h*3p*2 - 2h*2op2 + 24h*2p + 10hop2 wrt h. 18op2 + 1614p*2 What is the third derivative of 266x*4 + 170x*2 + 2 wrt x? 6384x What is the second derivative of 804u3 - 2u*2 - 1794u? 4824u - 4 Differentiate 361s*4 + 2s*3 + 5s*2 + 418. 1444s*3 + 6s*2 + 10s Find the first derivative of -2uz*2 + 4uz - 288u + 5z2 wrt z. -4uz + 4u + 10z Differentiate 145j - 299 with respect to j. 145 What is the derivative of p*2x*2 + 72p*2 + 2px2 + 9x*2 - 1 wrt x? 2p*2x + 4px + 18x Differentiate -68l*4no - 8lno - 5lo*3 - 33no3 + 5n wrt l. -272l3no - 8no - 5o*3 Find the third derivative of 9206t*4 - 772t*2 wrt t. 220944t What is the derivative of -1254l - 1453? -1254 Find the second derivative of 7dn3v*2 + 11dnv*2 - dv + n*3v - 9 wrt v. 14dn*3 + 22dn What is the third derivative of 10d*2n*3s - 2d2n*2s - 3d2n*2 - dn*2s*2 + 8dns*2 - 5n*4s + 11n3s*2 - 13ns2 wrt n? 60d*2s - 120ns + 66s2 What is the second derivative of 2w*5 + 965w*4 + 3703w wrt w? 40w3 + 11580w*2 What is the derivative of 3212i*2p - 55i2 + i - 15 wrt p? 3212i*2 What is the second derivative of -16p*4t + p*4 + 2p*2t - 13pt - 11p wrt p? -192p*2t + 12p2 + 4t Find the third derivative of -178g3q*3 + 3g*3q*2y - 2g2q*3y - g*2qy + 2g*2y - 57qy wrt g. -1068q3 + 18q*2y Find the second derivative of -46fm*3w*2 + fm*3 + 3m*3w + 6m3 - w2 + 3w wrt w. -92fm*3 - 2 Differentiate 29o*3q*3 - 2o*3q + 1449o3 wrt q. 87o*3q*2 - 2o*3 What is the second derivative of -615s*4 + 8s + 19 wrt s? -7380s2 What is the derivative of -2m*3w*4 - 4m3 - m2w - m2 - 166w*4 + 61 wrt w? -8m*3w3 - m2 - 664w3 Find the first derivative of -3a*3 + 3a - 1484 wrt a. -9a2 + 3 Differentiate -6tw2y - 4tw*2 + 282twy + 13tw - 4t + 6w*2 with respect to y. -6tw2 + 282tw Find the second derivative of f3m*2 - 162f*3 - 192f*2m*2 + 2f*2 - 3m wrt m. 2f3 - 384f*2 Find the third derivative of 2i*6 + 11i*3k*2 - 4i*3 - 7i*2 + 6ik2 wrt i. 240i*3 + 66k2 - 24 Differentiate o2v2 + 157o*2 + 37v*4 wrt v. 2o*2v + 148v3 What is the second derivative of 78w*4 - 2w - 54 wrt w? 936w2 Find the second derivative of -182i*2 - 36i wrt i. -364 What is the third derivative of 1008k3 + k2 - 181k? 6048 Find the third derivative of 238n4 - 2n*3 - 291n*2. 5712n - 12 What is the second derivative of 6k3 + 23k*2 + k + 209? 36k + 46 What is the third derivative of 2v6 - 2988v*5 + 502v*2 + v? 240v*3 - 179280v*2 Differentiate 6318m + 13349 wrt m. 6318 Find the second derivative of 5c3n - 115c3y - 2cy - 3ny + 51n - 1 wrt c. 30cn - 690cy Find the second derivative of 9ck2n*3 + 27ck2n - 2ckn2 - 272cn3 + k5n - kn3 + 2kn2 wrt k. 18cn3 + 54cn + 20k*3n What is the second derivative of -253d2 + 6d + 34 wrt d? -506 What is the derivative of 2m2o - 204m2 - 6mo4 + 14o*4 wrt o? 2m*2 - 24mo3 + 56o*3 Find the third derivative of 626az3 + az*2 + 2az + 63a wrt z. 3756a Find the third derivative of -15190q*3 - 19334q*2. -91140 Find the third derivative of 60d*4 - 103d*3 - 1790d*2 wrt d. 1440d - 618 What is the second derivative of 2i4 + 1147i*3 + 1132i? 24i2 + 6882i Differentiate -105a2j*3 - 2a*2 + 2aj2 - 5885j*3 with respect to a. -210aj3 - 4a + 2j2 What is the second derivative of -58q*3w*2 + 3q*3 - 50qw2 + 2q wrt q? -348qw*2 + 18q Find the second derivative of -h*3n*3 - 2h*3n - 785h3 + 241hn2 wrt n. -6h*3n + 482h Find the third derivative of 206g*3r3 - g2r3 - 3g*2r - 13r wrt g. 1236r3 Find the third derivative of -c2n4 - 28c*2n + 523kn*4 - 2kn3 - 2k + 38n2 wrt n. -24c*2n + 12552kn - 12k Find the second derivative of 270o*2 + 273o wrt o. 540 What is the second derivative of 541a5 - 3a + 67? 10820a3 What is the derivative of -5095y*3 - 2330? -15285y*2 What is the second derivative of -134s*2 - 421s? -268 What is the derivative of -454br*2 - 1651bv3 + r2v + rv3 wrt r? -908br + 2rv + v3 Find the second derivative of 373k*5 + 201k - 2. 7460k3 Find the third derivative of -4385m*3 + 1615m*2. -26310 What is the third derivative of 1227n*3wz - 2n*3w + 3n3z - 2n2w + 1544n2z - 2w wrt n? 7362wz - 12w + 18z Find the second derivative of -65c*2r*2 + 3c*2rz + 10c*2 - 2c + 4r2z + 3rz wrt r. -130c2 + 8z What is	{ "pile_set_name": "DM Mathematics" }
o. What is prob of picking 1 c and 1 q? 5/153 Calculate prob of picking 2 j when two letters picked without replacement from jkjbbkijbssfk. 1/26 What is prob of picking 1 r and 1 y when two letters picked without replacement from yyfry? 3/10 Three letters picked without replacement from {v: 6, y: 3, k: 1, x: 9}. Give prob of picking 3 v. 20/969 Two letters picked without replacement from qllqll. Give prob of picking 2 q. 1/15 Three letters picked without replacement from {h: 1, k: 1, v: 4, b: 4}. What is prob of picking 2 b and 1 v? 1/5 Calculate prob of picking 1 s, 1 w, and 1 p when three letters picked without replacement from dpswxswcd. 1/21 Four letters picked without replacement from {w: 3, j: 2, g: 2, o: 1, r: 1, c: 3}. Give prob of picking 1 g, 1 r, 1 o, and 1 j. 4/495 Four letters picked without replacement from rjuirixuerir. What is prob of picking 1 u, 1 j, 1 x, and 1 e? 2/495 Calculate prob of picking 1 d, 1 v, and 2 g when four letters picked without replacement from {v: 2, d: 4, h: 2, g: 2}. 4/105 Three letters picked without replacement from {p: 2, w: 2}. Give prob of picking 2 w and 1 p. 1/2 Two letters picked without replacement from tldllkuktlludklkbt. What is prob of picking 1 d and 1 l? 4/51 Two letters picked without replacement from pspssisqropsosq. Give prob of picking 2 q. 1/105 What is prob of picking 2 d and 1 k when three letters picked without replacement from ddkddk? 3/5 Three letters picked without replacement from {q: 1, d: 8, a: 11}. What is prob of picking 1 q and 2 d? 7/285 What is prob of picking 1 t and 2 p when three letters picked without replacement from twpbepmt? 1/28 What is prob of picking 1 z, 1 u, and 1 x when three letters picked without replacement from xxukzuzuzzzzxu? 18/91 Two letters picked without replacement from {z: 4, h: 3, y: 2, f: 2}. Give prob of picking 1 z and 1 y. 8/55 What is prob of picking 1 b and 1 s when two letters picked without replacement from {h: 7, s: 2, b: 3, i: 8}? 3/95 Three letters picked without replacement from {u: 1, z: 2, b: 2, j: 1}. What is prob of picking 1 b and 2 z? 1/10 Four letters picked without replacement from kkjkkjkkkjkkkjkkkkk. What is prob of picking 4 k? 455/1292 Four letters picked without replacement from ccicciicci. Give prob of picking 2 i and 2 c. 3/7 Calculate prob of picking 1 p and 1 l when two letters picked without replacement from {p: 2, v: 2, h: 6, z: 1, f: 6, l: 1}. 2/153 What is prob of picking 1 i and 1 w when two letters picked without replacement from {o: 2, w: 2, d: 1, b: 7, u: 4, i: 4}? 4/95 Four letters picked without replacement from wywwwyywiwy. Give prob of picking 1 i and 3 y. 2/165 Three letters picked without replacement from {v: 2, s: 11}. Give prob of picking 1 s and 2 v. 1/26 Two letters picked without replacement from {h: 10, t: 10}. Give prob of picking 2 t. 9/38 What is prob of picking 1 z and 1 q when two letters picked without replacement from gqz? 1/3 Three letters picked without replacement from {t: 2, d: 17}. What is prob of picking 1 t and 2 d? 16/57 Calculate prob of picking 1 x and 1 l when two letters picked without replacement from yblxbmbbblmylsb. 1/35 Calculate prob of picking 2 g, 1 c, and 1 d when four letters picked without replacement from gdgdgggggdgggjgdcgd. 55/646 What is prob of picking 1 s and 3 p when four letters picked without replacement from spncssnpnpnspsnp? 5/182 Four letters picked without replacement from {a: 1, d: 5, w: 3}. What is prob of picking 3 d and 1 w? 5/21 Two letters picked without replacement from ejeurmrrurju. Give prob of picking 1 e and 1 j. 2/33 What is prob of picking 2 s and 1 e when three letters picked without replacement from sureses? 6/35 Two letters picked without replacement from eeeaeeeaaeeeeee. What is prob of picking 2 a? 1/35 Two letters picked without replacement from gjsskigli. What is prob of picking 1 g and 1 j? 1/18 Calculate prob of picking 2 k and 1 m when three letters picked without replacement from kkkmkkmkkkkkmkk. 198/455 What is prob of picking 2 g and 1 t when three letters picked without replacement from {c: 2, g: 4, t: 1, s: 4}? 2/55 Calculate prob of picking 3 a and 1 v when four letters picked without replacement from aaaaaavavaaaaaaaaaav. 8/19 What is prob of picking 1 v and 1 p when two letters picked without replacement from {v: 2, p: 4, u: 2, g: 2}? 8/45 Calculate prob of picking 3 c when three letters picked without replacement from {c: 11, o: 3, n: 1}. 33/91 Calculate prob of picking 2 q when two letters picked without replacement from dqpdqp. 1/15 What is prob of picking 3 y when three letters picked without replacement from yyyyyppyyyppypypypy? 220/969 Two letters picked without replacement from cpqeqpbpbppuq. What is prob of picking 1 b and 1 u? 1/39 Two letters picked without replacement from {g: 6, m: 3, o: 4, r: 1}. What is prob of picking 1 r and 1 g? 6/91 Two letters picked without replacement from uuzuuuuuuuuzzzuuuuu. Give prob of picking 2 u. 35/57 Four letters picked without replacement from {q: 4}. Give prob of picking 4 q. 1 Two letters picked without replacement from kokklokekoekoello. What is prob of picking 2 l? 3/136 Three letters picked without replacement from qbbhgbhbghbbqhvh. What is prob of picking 2 b and 1 q? 3/56 Calculate prob of picking 3 b and 1 u when four letters picked without replacement from {y: 1, n: 1, t: 1, u: 1, b: 3}. 1/35 Two letters picked without replacement from {r: 1, l: 2, f: 2, j: 1, o: 4, p: 5}. Give prob of picking 2 l. 1/105 Four letters picked without replacement from {w: 2, s: 9}. Give prob of picking 1 w and 3 s. 28/55 Two letters picked without replacement from vttvvlvvllvv. What is prob of picking 1 t and 1 l? 1/11 What is prob of picking 1 r and 2 f when three letters picked without replacement from {g: 4, r: 8, u: 1, f: 2}? 8/455 Two letters picked without replacement from rrrgevrevrnqvrgvq. What is prob of picking 1 r and 1 e? 3/34 Two letters picked without replacement from {p: 7, c: 2, e: 1}. What is prob of picking 2 p? 7/15 Two letters picked without replacement from cncnnccccnnncn. Give prob of picking 1 n and 1 c. 7/13 Three letters picked without replacement from {x: 5, s: 4, i: 3, u: 4, o: 3}. What is prob of picking 2 o and 1 x? 5/323 What is prob of picking 1 m and 1 p when two letters picked without replacement from {y: 4, p: 3, m: 1}? 3/28 Two letters picked without replacement from {l: 2, q: 1}. What is prob of picking 1 q and 1 l? 2/3 Three letters picked without replacement from {f: 2, e: 1, b: 2, u: 3, n: 6}. What is prob of picking 1 e, 1 f, and 1 u? 3/182 Calculate prob of picking 2 v, 1 z, and 1 l when four letters picked without replacement from {l: 1, v: 4, z: 2}. 12/35 Two letters picked without replacement from {i: 4, e: 3, m: 1, h: 2}. Give prob of picking 1 m and 1 i. 4/45 Two letters picked without replacement from {v: 3, b: 4}. Give prob of picking 2 b. 2/7 Two letters picked without replacement from {w: 5, b: 5, h: 1}. What is prob of picking 1 b and 1 w? 5/11 What is prob of picking 1 k and 2 l when three letters picked without replacement from {k: 4, l: 2}? 1/5 What is prob of picking 1 b and 1 j when two letters picked without replacement from {b: 3, j: 15}? 5/17 Three letters picked without replacement from {f: 9, m: 1, l: 4, d: 1}. What is prob of picking 3 f? 12/65 What is prob of picking 4 g when four letters picked without replacement from ggffbbgdg? 1/126 What is prob of picking 1 z, 1 k, and 2 e when four letters picked without replacement from zehkjueehzuh? 2/165 Calculate prob of picking 1 t and 1 n when two letters picked without replacement from nttxt. 3/10 Three letters picked without replacement from ffffnnfffffff. Give prob of picking 1 f and 2 n. 1/26 Three letters picked without replacement from {q: 3, k: 2, t: 4, i: 2, x: 7}. What is prob of picking 1 i and 2 x? 7/136 Two letters picked without replacement from {p: 4, x: 1, t: 2}. Give prob of picking 1 p and 1 x. 4/21 Four letters picked without replacement from {l: 4}. What is prob of picking 4 l? 1 Four letters picked without replacement from {n: 1, b: 9, v: 1, y: 1}. Give prob of picking 1 y, 2 b, and 1 n. 4/55 What is prob of picking 2 n when two letters picked without replacemen	{ "pile_set_name": "DM Mathematics" }
n + 6 - 5. Let i(c) = -c*3 + 4c*2 + 2. Give i(q) + 2o(q). q*3 + 2q*2 - 2q Let c(p) = -8p + 290. Let h be c(36). Let o(s) be the first derivative of -9 + 0s*3 + 0s + 0sh - 1/4s4. Let k(x) = -x2 - 1. Determine -k(a) - o(a). a3 + a2 + 1 Let b(z) = -z - 2. Let f(x) = -3x - 6. Let i(y) = -y3 + 7y*2 - 6. Let w be i(7). Let l be ((-3)/2)/((-6)/68). Determine lb(c) + wf(c). c + 2 Let r(z) = -4z + 14. Let q(b) = b + 3. What is 6q(w) - r(w)? 10w + 4 Let a(y) = -3y - 2. Let q(j) = 50j + 35. Let i be 6 + -8711/(-33). What is ia(x) + 2q(x)? -5x Let p(k) = -6k3 - 31k*2 + 23k. Let h(r) = 5r3 + 31r*2 - 20r. What is 7h(z) + 6p(z)? -z*3 + 31z*2 - 2z Let m(j) = -9j + 33. Let v(b) = b - 4. Let i = -86 - -183. Suppose -5u - 25 = 4x + i, 2x + 3u = -60. What is xv(t) - 4m(t)? 3t Let s(g) = -60g - 17. Let n(x) be the third derivative of -5x4/6 - x3 + 363x2. Calculate 17n(m) - 6s(m). 20m Let u(q) = 15q + 21. Let m(g) = 8g + 11. Let d(p) = -11m(p) + 6u(p). Let y(h) = 649 + 5h - 316 - 319. Determine 8d(o) - 3y(o). o - 2 Suppose -3h + 3c = 12, 5c - 9 - 16 = 0. Let u(x) = x2 + 1. Let b(r) be the third derivative of -r5/12 - r4/12 - r3/6 - 8r2. Give hb(i) + 3u(i). -2i*2 - 2i + 2 Let d(i) = -19i3 - 12i - 27. Let h(x) = -9x3 - 5x - 13. Let y(f) = 4d(f) - 9h(f). Let q(p) = -p*3 + p - 2. Give 9q(u) + 2y(u). u3 + 3u Let s(d) = 2. Let w(j) = j + 4. Let q be w(0). Let i(g) = g + 3. Let l(a) = qs(a) - 2i(a). Let z(x) = -x + 1. What is -l(c) + 3z(c)? -c + 1 Let p be ((-12)/(-3))/(8/(-28)). Let m(u) = 20u2 + 14. Let l(f) = -f3 - 7f2 + 6f - 13. Let a be l(-8). Let g(i) = 4i2 + 3. Give am(d) + pg(d). 4d*2 Let t(r) = -r. Let o(p) = -2p + 35. Determine o(u) - t(u). -u + 35 Let j(i) = 9i3 + 3i*2 + 4i + 4. Let s(f) = -8f3 - 2f*2 - 4f - 3. What is -3j(x) - 4s(x)? 5x3 - x2 + 4x Suppose -6w + s - 12 = 0, 4w + 84s - 87s + 8 = 0. Let a(q) = 0 + 4q3 - q2 - 2 + 3q*2. Let t(k) = 5k*3 + 3k*2 - 3. Determine wt(x) + 3a(x). 2x*3 Let s(r) = 4r + 5. Suppose 2u = -3m - 266 + 276, 4m + u - 20 = 0. Let f(b) = -4b - 6. Let j = -11 + 16. Calculate jf(h) + ms(h). 4h Suppose -20q + 18q = -12. Let c(z) = 5z*3 - z - 2. Let g(o) = -4o*3 + o + 1. What is qg(d) + 5c(d)? d3 + d - 4 Let a(t) be the first derivative of -7t*2/2 - 4t - 1725. Suppose 3n + 0n + 18 = 0. Let g(r) = -8r - 5. Determine ng(h) + 7a(h). -h + 2 Let v(q) = -4q*2 + 60q - 4. Let i(j) = -20j2 + 239j - 17. Give -2i(u) + 9v(u). 4u2 + 62u - 2 Let t(l) = -5l + 7. Let m(a) = -3a + 2a - 3 + 1 + 4. Let x(z) = 2z - 3. Let j(f) = -3m(f) - 4x(f). Give 7j(p) - 6t(p). -5p Let x(w) = 3w*3 - 2w*2 + 4. Let h(y) = 3y*3 - 3y*2 + 4. Let g(p) = 2h(p) - 3x(p). Let v(r) = -14r*3 - 21. Calculate 21g(f) - 4v(f). -7f*3 Let q(w) = 104w*2 + 10w - 287. Let k(o) = -20o2 - 2o + 57. What is -11k(j) - 2q(j)? 12j2 + 2j - 53 Let j(d) = 45d2 + 17d - 64. Let m(q) = 9q2 + 3q - 13. What is -2j(t) + 11m(t)? 9t2 - t - 15 Suppose 4u = 44 + 152. Suppose 3n = -5t - 162 + u, -5n = -4t - 120. Let v(p) = 35p3 - 25p*2. Let a(f) = -3f*3 + 2f*2. Give ta(c) - 2v(c). 5c*3 Let p = 713 - 707. Let h(g) = -7g*2 - 5g + 5. Let a(y) = y*2 + y - 1. Calculate ph(b) + 30a(b). -12b*2 Let l(v) = -22v - 38. Let j be l(-2). Let y(x) = x - 7. Let h(a) = a - 1. Determine jh(w) - y(w). 5w + 1 Let x(q) = q*2 + 7q + 2. Let d(w) be the second derivative of w*4/6 + 13w*3/6 + 5w*2/2 + 627w. Determine -2d(p) + 5x(p). p*2 + 9p Let v(k) = -1. Let p(g) = -3g + 3g + g. Let s(l) = 10 - 65l - 62l + 130l. Let c be s(-3). Give cv(y) - 2p(y). -2y - 1 Let h(w) = -3w2 - 5w - 3. Let j(y) = y*2 + y + 1. What is h(b) + 4j(b)? b*2 - b + 1 Suppose -6b + 2 = -7b, 4b + 29 = 3h. Let x(k) = k2 + 6k - 7. Let g(f) = -2f - f - 4f*2 + 5 - f + 3f*2. Give hg(p) + 5x(p). -2p*2 + 2p Let u(k) = -169692k - 2133. Let o(j) = 478j + 6. Calculate 711o(p) + 2u(p). 474p Let p(f) = -f3. Let o(x) = 6x*2 - 6. Let j(k) = o(k) - 2p(k). Let i(t) = 19416t + 7t*2 - 7 - 19416t + 2t3. What is 5i(w) - 6j(w)? -2w3 - w2 + 1 Let i(p) = 13p - 4. Let s(n) = 64n - 20. Determine 16i(u) - 3s(u). 16u - 4 Let h(t) = 114t*2 + 2t. Let v(a) = -29184a2 - 513a. Calculate 1026h(j) + 4v(j). 228j2 Let i(y) = -107. Let r(w) = w + 3. What is -i(o) - 2r(o)? -2o + 101 Let u(i) = 19i + 5. Let j(d) = 56d + 14. Determine -6j(r) + 17u(r). -13r + 1 Let s(c) = 5c3 - 2c + 3. Let t(f) = 4f3 - 2f + 5. Determine -6s(m) + 4t(m). -14m3 + 4m + 2 Let u(j) = 17j - 11. Let w(f) = -5f + 3. Let l(o) = -2u(o) - 7w(o). Let n(t) = -t*3 - 2t - 2. Let k be (-10)/4 - 2/(-4). What is kl(x) - n(x)? x3 Let w = 998 + -994. Let x(n) = n2 - n - 1. Let k(h) = -4h*2 - 4h - 2. Calculate wx(i) - k(i). 8i2 - 2 Let k(j) = j3 + j*2 - j - 1. Suppose 78 = 37o + 4. Let z(y) = y*2 - 2y - 2. Calculate oz(f) - 2k(f). -2f3 - 2f - 2 Let k(y) = -y + 1. Suppose -q - 5g = -3, 5q + 2g - 15 = 6g. Let n(v) be the third derivative of -v4/24 + v3/3 - 13v2. Determine qk(f) - 2n(f). -f - 1 Let f(w) = -2w + 0w - w. Let u = -7 - -5. Let j be (-11)/(15/(-5) + 2). Let b(v) = -16v. Determine jf(i) + ub(i). -i Let l(v) = 3v3 - 5v + 3. Let z(k) = -2k2. Let s(m) = -m3 + 6m*2 + m. Let x(b) = -s(b) - 3z(b). Suppose 0 = -2d - 1 - 1. Determine dl(f) + 5x(f). 2f*3 - 3 Let q(v) = 3v2 + 1. Let c be q(1). Let z(j) = j2 + 6j - cj + j2 + j3. Let h(d) = 70d3 + 9d*2 + 9d - 136d3 + 71d*3. Give -2h(o) + 9z(o). -o3 Let w(b) = -8b + 264. Let s(i) = 2i. Determine -5s(k) - w(k). -2k - 264 Let y(c) = -11c - 199. Let k(g) = -2g - 2. Give 6k(i) - y(i). -i + 187 Let p(o) be the first derivative of -o*4/4 - 4o3/3 + o2/2 - o + 161. Let q(a) = -a*3 - 3a*2. Give -3p(c) + 4q(c). -c3 - 3c + 3 Let s(b) = -31b2 + 24b + 82. Let j(x) = -10x2 + 7x + 27. Give 7j(q) - 2s(q). -8q2 + q + 25 Let x(o) = o. Let n(l) = -10l + 1. Let t be (-20)/(-100)(0 - 10). What is tx(k) + n(k)? -12k + 1 Let r(n) = -2n + 6. Let u(l) = -2l + 5. Suppose 21t - 16t + 60 = 0. Let k be (13 + t)14/2. What is ku(w) - 6r(w)? -2w - 1 Let m(z) = 7z*3 + 26z*2 + 4z - 8. Let u(n) = 12n3 + 52n*2 + 7n - 15. Calculate 7m(c) - 4u(c). c*3 - 26c*2 + 4 Let n(u) be the first derivative of 5u*4/4 + 5u*2/2 - 6u + 76. Let d(b) = b - 1. What is -6d(c) + n(c)? 5c*3 - c Let b(r) = r. Let o(u) = -264u + 3 - 3 - 260u + 530u. Let f(w) = 4w - 6. Let i be f(4). Give ib(x) - 2o(x). -2x Let p(m) = 7m - 12. Let y(d) = 8d - 13. Give -7p(n) + 6y(n). -n + 6 Let h(l) = 432l - 1. Let k(n) = -432n + 1. Give -5h(d) - 6k(d). 432d - 1 Let r(u) = -u2 + 2u2 + u2 - 3u - 3u + 3. Let k be 1 + 0 - -7(-14)/49. Let c(b) = b2 - b + 1. Calculate kr(y) + 4c(y). 2y*2 + 2y + 1 Let m(j) = -j - 1. Let a(q) = -17. Let y(i) = -48. Let r(l) = 17a(l) - 6y(l). What is -2m(h) - 4r(h)? 2h + 6 Suppose 5s - 3w + 54 = 2s, -3w = -s - 20. Let b(x) = -11x - 26. Let g(r) = 4r + 9. Calculate sg(n) - 6b(n). -2n + 3 Suppose 0 = -3y - 2 - 7. Let b = -4 + 3. Let q(i) = 2i*2 + 3i + 3. Let f(z) = -z - 1. Determine bq(d) + yf(d). -2d2 Suppose 3b + 4y - 6 = 0, 5y + 15 = -0y. Let p(n) = 3n*3 + 6n*2 + 6. Let q(r) = 4425r*2 + 3 - 4424r*2 - 2. Give bq(f) - p(f). -3f3 Let y(c) = 4c*2 + 2c - 2. Suppose -238q + 227q + 154 = 0. Let n(d) = -9d2 - 5d + 5. Calculate qy(h) + 6n(h). 2h2 - 2h + 2 Let a(u) be the first derivative of 3u2/2 - 3u - 184. Let h(d) = d - 1. Let f(b) = b - 1. Let v(g) = -6f(g) - h(g). Calculate -9a(w) - 4v(w). w - 1 Let j(t) = -t2 + t. Let p(u) = u2 - 3u - 1. Let i(r) = 4j(r) + 3p(r). Let c(n) = -2n2 - 6n - 4. Determine 4c(m) - 6i(m). -2m2 + 6m + 2 Let x(r) = r + 1. Suppose 0 = -4305l + 4295l + 30. Let s(j) = j + 1. Let h be ((-2)/(-3))/(4/(-12)). Let f = h + 0. What is fs(b) + lx(b)? b + 1 Let q(t) = -7t3 - 11t*2 - 5t - 5. Let i(x) be the third derivative of x6/15 + x5/5 + x4/4 + x3 + 10*	{ "pile_set_name": "DM Mathematics" }
Express -2t + 4t + 2t + 2t as pt + i and give p. 6 Express -3i - 1 + 7i3 - 1 + 3i - 2i as wi*3 + hi + l + oi2 and give w. 7 Rearrange (0 - 3 + 5)((2 + 0 - 3)(v - 3 + 3) - 4v + v - v)(3v*2 - 2v*2 - 2v*2) to the form xv + a + mv3 + pv*2 and give m. 10 Express -15 + 11 + 4j + 4 in the form n + mj and give m. 4 Rearrange -3n2 + 80 - 84 + n2 - n to wn + q + zn*2 and give z. -2 Express -17h - 76 + 76 in the form ah + v and give a. -17 Rearrange 131i + 5 - i*2 + 124i - 255i to the form ti*2 + di + l and give l. 5 Rearrange (2n + 3 - 3)(-1 + 5 - 3) + (-4n + 2n - n)(4 - 1 + 1) to the form f + dn and give f. 0 Express (-1 + 3v + 2v + 2)(-5 + 3 + 1)(2 - 2 + 2v) in the form q + cv*2 + iv and give c. -10 Rearrange 14j + 8j - 24j + 8 + 18 to the form sj + m and give s. -2 Express 2b2 + 5b*2 - 9b*2 + 69 - 7 as mb + hb2 + t and give h. -2 Rearrange -7 + 1 + 6 - 7m*2 to y + bm*2 + hm and give b. -7 Express -1 + 2u3 - 3u*3 + 667u + u*2 - 665u in the form p + wu2 + ou*3 + gu and give o. -1 Express (-5 + 5 - 2b)(-10b - 1 + 8b - 1) as db + y + hb*2 and give h. 4 Express (3 - 2 - 4)(-4 + 0 + 2)(18 + 16d - 18) as cd + u and give c. 96 Rearrange -m3 - 3m + 50m2 - 94m*2 + 1 + 47m*2 to g + im*3 + qm + fm2 and give q. -3 Express -1 + 9y - 2y + 7 in the form gy + j and give j. 6 Rearrange 8 + 66g2 + 0 - 8 to t + xg*2 + zg and give x. 66 Rearrange 10c2 - 3c*2 + 2c*2 + (-3c + 4c - 2c)(-2c - 4 + 4) to the form pc2 + xc + g and give p. 11 Express (0i - 2i + i + (2i + 4 - 4)(-2 + 0 + 0))(0 - 4 + 2) in the form li + q and give l. 10 Express -6u2 - u3 - u3 + u2 as ku*3 + bu*2 + d + qu and give b. -5 Rearrange (0 + 0 + 1)(2 + 6v - 47v - 62v) to the form uv + w and give w. 2 Rearrange 0t*4 - 2t*4 + 0t*4 + (-2t*3 + 3t*3 - 2t*3)(63t + 12t + 16t) to yt*4 + gt*3 + bt + o + kt2 and give b. 0 Rearrange (-1706 + 1706 - 118i - i*2)(-4i + i + i) + 0 + 0 + i3 to the form g + ki*2 + bi + si3 and give k. 236 Express -2r*2 + 10r + 9r - 4r*3 + 3r*2 + 1 + 7r*3 as c + ur + dr3 + vr*2 and give v. 1 Rearrange (-2 - 3 + 4)(h + h - h) + (-3 + 0 + 5)(h - 2 + 2) to the form ch + l and give c. 1 Rearrange 1 + 20 - u*3 + 1 + 3u*2 - 2u*3 - 3u*2 - 2u*3 - 3 + 3 + (6u*2 - 2u*2 - 2u*2)(4 - 4 - 2u) to ru + du2 + l + au*3 and give d. 0 Express -3u*4 + 3u*3 + 2u*3 + 0u*3 - 6u*3 + 1 in the form mu + iu2 + c + wu*3 + lu*4 and give l. -3 Express (3 - 4 + 0)(-53 - 96 + 294)(-1 - x + 1) in the form o + rx and give r. 145 Express (-2 + 2 - 1 + (-4 - 3 + 2)(-1 + 3 + 0))(4f3 - 2f3 - f3) as df3 + if*2 + zf + h and give d. -11 Express -3a3 + 6 - 2a2 + a2 + a*3 in the form la + da3 + ca*2 + v and give v. 6 Rearrange (-3 + 3 + 2y*3)(2y + 2 - 2) + (3 - 3 - y)(-4y3 + 2 - 2) to ay*3 + zy + gy4 + py*2 + u and give g. 8 Rearrange -2 + 2 + 536i*2 - 385i*2 to the form di*2 + si + r and give d. 151 Express (-2 + 0 + 0)(6d + 6d + 3d + 4 - d - 4 - 3d - 3d + 5d + (-3 + 2 - 1)(-3d + d + 3d)) as ad + v and give a. -22 Rearrange 10k - 1 - 5k - 6k to d + mk and give m. -1 Express 4 - g + 0 + 4g*2 - 2 + 3 as xg*2 + pg + i and give i. 5 Rearrange -7a3 + a2 + 0a*3 + 6a*3 + 2a + 0a to the form t + fa*3 + ka + la2 and give f. -1 Rearrange (2o + 0o - o)(80o - 26o - 27o) + 2o*2 - 3o + 3o to x + to*2 + jo and give t. 29 Express (0 - 4 + 0 + (5 - 1 - 2)(-2 - 2 + 3))(0b + 0b - b) as o + mb and give m. 6 Rearrange (5j3 + j3 - j*3)(j + 2j - 4j) + j*4 + 4j*3 - 4j*3 to kj*2 + z + bj*4 + oj + tj3 and give b. -4 Express 2r*3 + 3r - 1 - 2r3 + r3 as gr*3 + qr + or2 + h and give h. -1 Rearrange (q - 3 + 3)(20q - 33 + 33) to the form s + oq + hq2 and give h. 20 Rearrange 47 - 47 + 2u to the form t + vu and give v. 2 Rearrange (-c + 2c*2 - c + c)(-56c - 16c + 4c) to bc*2 + r + yc + vc3 and give b. 68 Express 6 + 2w - 2w3 - 3w + 13 - 21 as r + aw2 + zw*3 + kw and give r. -2 Express 0m + m + 7m*2 + 10m*2 - 6m*2 in the form gm + nm2 + r and give n. 11 Express (z - 2z + 0z)(-17 + 10 - 20) as az + i and give a. 27 Express -i2 - 2i*4 - 2i*3 - 1029 + 1029 in the form c + ti*3 + pi*2 + mi*4 + yi and give p. -1 Rearrange -2j2 - j + j - 4j*3 + 2j*3 to v + bj*3 + zj + tj2 and give t. -2 Rearrange (-1 - 10 - 1 + (0 - 2 + 1)(0 - 1 + 0))(-2x + 2x - x)(-4 + 4 - 4) to the form q + cx and give c. -44 Express -5m + 125m3 - 63m*3 - 63m*3 as fm + xm2 + om*3 + j and give o. -1 Rearrange (-3 + 3 - 2)(-3 + 8 - 2)(2p*3 + 2p*3 + 0p*3) to the form tp + q + lp2 + yp*3 and give y. -24 Express (-6o*3 + 2o*3 - 3o*3)(1 + 1 - 4) + o*3 + 0o*3 - 3o*3 as ao + mo2 + so*3 + x and give x. 0 Express (2b - 3b + 3b)(-5b + 18 - 5 + 3b + 3b - 2b - 3b + (0 + 3 - 5)(-3 + 3 - b) + 0b - 2b + 3b - 4b - b + 3b) as xb2 + jb + s and give j. 26 Express (m + 0m - 3m)(36m*3 + 29m*3 - 70m3) + (m - m + m2)(4 - m2 - 4) in the form o + um*2 + hm*3 + cm*4 + qm and give c. 9 Express -17u2 + 3u + 9u2 + 4u2 - u3 + 5u2 in the form h + wu + nu3 + mu*2 and give n. -1 Express 44j - 22j - 20j - 57 as nj + v and give v. -57 Rearrange 6j - 4j + j - 7j + 4j + 24j + 2j + 2 - 2 + (5 - 3 - 4)(-3j + 4j - 2j) to sj + a and give s. 28 Express 2r2 + 5 - r4 - 75r*3 + 2r + 75r3 in the form tr*3 + nr*4 + cr + b + gr2 and give g. 2 Rearrange (3p*2 - 3p2 + p2)(-5p + 2p + 2p)(-3p - 3p - 8p) to the form cp3 + jp + rp2 + np*4 + v and give n. 14 Express (-1 + 1 + 2)(-3g + 53 - 30 - 26) in the form fg + m and give m. -6 Express 1 - 1 - f + 2f as u + af and give u. 0 Express -12s2 - 11s*2 + 4s*2 in the form x + vs + os2 and give v. 0 Express 5o4 - o3 + 0o4 - o + 4 + 3o*3 - 6o*4 in the form wo + fo4 + h + po*2 + qo*3 and give q. 2 Rearrange 3 + 2q3 - q3 - 6q2 + 13q*2 - 2 to the form yq*2 + uq + lq3 + g and give l. 1 Express 47 - 47 - 36j - 90j in the form n + qj and give q. -126 Express 15d + 22d - 9d in the form o + ad and give a. 28 Express -4 - p*2 + 7 - 2p*4 - 78p - 2p3 + 79p in the form up + ap*2 + k + xp*3 + lp*4 and give k. 3 Rearrange -21 - 16i*2 + 7 + 1 + 11 to zi + m + li2 and give m. -2 Express 0 + 0 - s3 + (2s + s - s)(-2 - 1 + 1)(-395s - 8s*2 + 395s) in the form n + ms2 + ds*3 + as and give d. 31 Rearrange 35 - 66 + 25m + 31 to the form ym + k and give y. 25 Rearrange -2z - z - 6z4 + z2 + 4z4 to xz + sz4 + rz*2 + jz*3 + h and give r. 1 Express 0r*4 - 3r*2 - 4r4 + r2 + 2 - 3r3 + 3r*4 in the form ur*4 + x + br*3 + tr*2 + jr and give t. -2 Rearrange 1 + 4b3 + 6b*3 - 12b + 27b3 + 10b - b*2 to the form p + rb*3 + ub*2 + ib and give p. 1 Rearrange (3 + 4 + 14)(-2 + 5 - 2)(-3i + 5i - i) to the form s + ai and give a. 21 Rearrange -3 + 3 - 3w*2 + (2w*2 + 2w*2 + 4w*2)(1 + 1 + 0) + w - w - 2w2 to rw + y + nw2 and give n. 11 Rearrange 8 - 5 - r + r3 - 5 to yr*3 + wr + z + ur2 and give w. -1 Express ((3 - 3 - 1)(-s - s + 0s) + (5s - 2s - 2s)(2 + 2 - 5))(-12 + 12 - s*2) as v + qs*2 + ls + zs3 and give z. -1 Express (0 + 0 + 2)(-h - 3h + 2h) + (2 + 0 - 4)(-h + 2h + h) + 5 + 2h - 5 + h - 7h - 2h as w + bh and give w. 0 Rearrange -286y2 + 573y*2 + 4y - 1 - 288y2 to the form gy*2 + k + hy and give k. -1 Rearrange -n*4 - 7n3 + n3 - 10 + 2n4 - 3 to fn*2 + yn*4 + dn*3 + kn + z and give d. -6 Rearrange (3 + 4 - 6)(-3w*4 - 2w*4 + 7w4) - w4 - 2w4 + 0w*4 + 9w*4 - 7w*2 + 7w*2 to iw*3 + u + xw*2 + vw*4 + qw and give v. 8 Express 62j - 63j - 1 + 0j3 + 42j*4 + 0j*3 as sj + gj4 + dj*2 + rj3 + h and give s. -1 Express -h4 + 0h3 + 5h3 + h3 - 2 - 2h3 as wh*4 + sh + fh2 + p + zh3 and give z. 4 Rearrange 1 - k - k	{ "pile_set_name": "DM Mathematics" }
et m(o) = -o*2 + 107o + 7. Let a(n) = n*2 - 106n - 6. Calculate 7a(q) + 6m(q). q*2 - 100q Let w(y) = y*3 + 1. Suppose -4d - 5 = d. Let k(a) = a*3 + 7a - 1. Let t(q) = q*3 + q + 1. Let l(u) = dk(u) + 4t(u). What is l(p) - 5w(p)? -2p3 - 3p Let y(r) = 95r3 + 35r. Let m(q) = -8q3 - 3q. Let w be (-156)/16 + 9 + (-9)/4. Determine wy(l) - 35m(l). -5l3 Let f(r) = -9. Let x(l) = -19. Let b(o) = -5f(o) + 2x(o). Let q(z) = -8. Let p(v) = 7b(v) + 6q(v). Let w(g) = 2g - 9. Give -18p(d) - 2w(d). -4d Let d(w) = w2 + 1. Let g(p) = 2p*2 - 9p - 15. Let b be g(8). Let m = 42 - b. Let c(q) = q*2 - 1. Calculate mc(j) + d(j). 2j2 Let k(w) be the second derivative of w3/6 + w2/2 + 16w. Let y(v) = -v*3 - 10 + 5 - 2v + 3. Determine 2k(s) + y(s). -s3 Let j(b) be the second derivative of b5/20 + b4/12 - 521b. Let c(y) = -4y3 - y2 + y. Determine c(m) + j(m). -3m*3 + m Let h(f) = 2f*3 + 85f*2 + 4f. Let b(p) = 2p3 + 87p*2 + 3p. Give 3b(u) - 2h(u). 2u3 + 91u*2 + u Let n(d) = 30d*2 + 1. Let v(j) = 325j*2 - 55j - 55. Let k(h) = 12h2 - 2h - 2. Let l(w) = -55k(w) + 2v(w). What is -7l(z) - 2n(z)? 10z2 - 2 Let o be -13 - -10 - (4 - 1)-2. Let r(m) = 2m + 3. Let b(s) = -5s - 8. Let l(w) = ob(w) + 8r(w). Let y(h) = 4h + 2. Determine l(v) - y(v). -3v - 2 Let k(y) = -20y2 - 17y + 9. Let h(q) = 11q2 + 8q - 5. What is 5h(d) + 3k(d)? -5d2 - 11d + 2 Let v(n) = -2n3 - 6n*2 + 3n + 6. Let h(y) = 2y3 + 5y*2 - 3y - 5. Let l = 496 - 501. Determine lv(t) - 6h(t). -2t3 + 3t Let o(z) = z*2 + z + 6. Let v be o(-3). Let m be v/(((-16)/24)/((-1)/3)). Let a(f) = -2f - 2. Let q(b) = -2b - 3. What is ma(t) - 4q(t)? -4t Let r(p) = -2096p2 + 14. Let s(t) = 3145t*2 - 22. Determine -8r(n) - 5s(n). 1043n*2 - 2 Let k(x) = -805x + 92. Let f(v) = -3 + 56v - 11v - 8v - 21v + 10v. Determine 92f(s) + 3k(s). -23s Let t(g) = 0g - 25 - 14g - 6g. Let l be 96/168 + 38/7. Let h(p) = -5p - 6. What is lt(z) - 25h(z)? 5z Let b(r) = -7r*3 - 5r*2. Let u(f) = f + 15. Suppose -h - 2 = 17. Let s be u(h). Let n(j) = 6j*3 + 4j*2. Determine sb(q) - 5n(q). -2q*3 Let g(h) = 366h - 8. Let j(t) = 6220t - 140. Calculate -35g(b) + 2j(b). -370b Let a(k) = 3k2 - 13k - 5. Let v(b) = 3b2 - 13b - 4. Determine 6a(g) - 7v(g). -3g2 + 13g - 2 Let f(s) = -6s2 - 16s - 3. Let b(x) = -14x2 - 32x - 8. Calculate -2b(v) + 5f(v). -2v2 - 16v + 1 Let z(f) = 2f2 - 4f + 2. Let i be (1/4-6)/(27/(-18)). Suppose 0 = -w - 2, -j + w = -4j + i. Let o(q) = -q + 1. What is jz(k) - 2o(k)? 2k2 - 2k Let s(b) = -3b. Let w(x) = 689x. Give -6s(d) - w(d). -671d Let p(i) = 8i + 4. Let a(s) = -s - 1. Let c be ((-296)/40 + 7)-10. Give ca(d) + p(d). 4d Let o(z) = z + 1. Let n(j) = -287j2 + 35j + 35. Determine -n(t) + 35o(t). 287t*2 Let d(k) = -11k*2 + 10k + 27. Let n(s) = -8s2 + 11s + 26. Determine -2d(o) + 3n(o). -2o2 + 13o + 24 Let r(o) = -o*3 - o. Suppose -152 = -2d - 3k, 2d + 5k - 152 = 8k. Let u = d + -80. Let v(z) = 2z3 + 4z - 2. Determine ur(j) - v(j). 2j*3 + 2 Let a be 433/9. Suppose -2z - 1 = -5. Let s(j) = -zj2 - 6j*3 + 0j + 0j + 1 + 11j*3. Let c(v) = -14v*3 + 5v*2 - 3. Calculate ac(d) + 11s(d). -d3 - 2d2 - 1 Let z(f) = -f2 + 5f + 4. Let a(r) be the second derivative of r3/6 + r2/2 - 28r. Let u be (-9)/(-27) - (-4)/6. What is uz(s) - 5a(s)? -s*2 - 1 Let v(r) = 6r*2 - 3r. Let p(i) = 7i2 - 2i. What is 4p(w) - 3v(w)? 10w2 + w Let v(k) = 11k*2 + 52k - 34. Let d(b) = 5b2 + 26b - 15. Give 13d(q) - 6v(q). -q*2 + 26q + 9 Let c(f) = -17f3 - 6f*2 + 4f - 4. Let q(u) = 34u3 + 13u*2 - 7u + 7. Give 7c(w) + 4q(w). 17w3 + 10w*2 Let a(f) = -3f*2 - 9f + 3. Let p(u) = 2u2 + 5u - 2. Let l(i) = -i - 3. Let m be l(-6). Suppose md + 2d = 3y, d - 2 = y. What is yp(j) - 3a(j)? -j2 + 2j + 1 Let i = -18 + 30. Let h(p) = -34p + ip - 4 + 21p. Let d(r) = r + 5. Suppose 0 = -f - 0 + 5. What is fd(q) + 6h(q)? -q + 1 Let m(w) = -508w + 11. Let t(q) = 102q - 2. What is 2m(z) + 11t(z)? 106z Let t = -1049 - -1057. Let g(w) = -15w2 + 5w. Let a(f) = -5f2 + 2f. Calculate ta(z) - 3g(z). 5z2 + z Let j(p) = 5p. Let x(g) = 864g + 1. Give -4j(u) - x(u). -884u - 1 Let t(b) = b3 + b + 2. Let f(z) = -44z + 2z3 + 1 + 25z - 1 + 2 + 20z. Determine -4f(a) + 5t(a). -3a*3 + a + 2 Let s(c) = 4c - 2. Let m = 36 - 36. Let a be 2(2 - (m - -3)). Let v(n) = -9n + 4. What is av(h) - 5s(h)? -2h + 2 Suppose 0 = i - 2k + 3, -4i + 4k = i + 9. Let s(u) = u + 1. Let p(l) = 10l - 1052 + 359 + 350 + 349. Give ip(c) + 6s(c). -4c Let x(o) = 8o2 + 5o. Let t be (-7)/(-49) + (-153)/(-7). Suppose 2q + 26 = t. Let n(v) = 4v*2 + 2v. What is qx(r) + 5n(r)? 4r2 Let r(s) = -19s*3 - 7s + 7. Let x(v) be the third derivative of -v6/20 - v4/12 + v*3/3 + 97v*2. Give 2r(y) - 7x(y). 4y*3 Let u(k) = k + 4. Let j(x) = -11x - 17. Let v = 15 + -21. Let o(r) be the first derivative of -r*2/2 + 3. Let i(n) = vo(n) + j(n). Give 2i(w) + 9u(w). -w + 2 Let w(i) = 148i + 7. Let z(x) = 99x + 5. Determine -5w(m) + 7z(m). -47m Let w(f) = f3 + 2f*2 - 2. Let x(d) be the second derivative of -3d*5/20 - 5d*4/12 + 5d*2/2 - 59d. Calculate -5w(p) - 2x(p). p*3 Let n(x) = 37x*2 - 4x - 11. Let q(o) = -12o2 + o + 4. Calculate 4n(y) + 11q(y). 16y*2 - 5y Let q(d) = -97d2 - 6d + 2. Let w(k) = -286k2 - 17k + 6. What is -11q(b) + 4w(b)? -77b2 - 2b + 2 Let i(t) = t*2 + 7t + 5. Let w be i(-7). Let l(j) = -3 + 1 + w + j. Let m(o) = -o - 3 + 3 - 2. Calculate -2l(k) - 3m(k). k Let c(k) = -k*3 - 2k*2 - 1. Let j(l) = -4l*3 - 7l*2 + l - 2. Let g = 427 + -425. What is gj(a) - 7c(a)? -a3 + 2a + 3 Let y(z) = 2z + 2. Let h(d) = d - 3d - 9d + 10d - 1. Let w(x) = -x*3 + 9x*2 - 10x + 12. Let j be w(8). Determine jy(m) - 9h(m). m + 1 Let j be (-3 - (0 + (-1)/(-2)))2. Let x(p) = -11p + 9. Let k(c) be the first derivative of 3c2 + 0 + 7c + 1 - 12c. Give jk(h) - 4x(h). 2h - 1 Let m(t) = t2 + t + 1. Let v(b) = -b3 + 3b2 - 38b - 1. Give -m(l) + v(l). -l*3 + 2l*2 - 39l - 2 Let t = -78 - -80. Let b be (-3)/2(8/t + -2). Let x(l) = -2l + 1. Let s(g) = g. Calculate bs(q) - 2x(q). q - 2 Let f(j) = -3j3 + 2j*2 + 3j - 2. Let c(s) be the third derivative of -s6/30 + s5/30 + s4/6 - s3/2 + 178s2. Give 2c(u) - 3f(u). u3 - 2u*2 - u Let u(f) be the first derivative of 9f*2/2 - 9f + 1086. Suppose -16 + 1 = -5b. Suppose 19 = -bq + 4. Let t(w) = 4w - 4. Determine qt(i) + 2u(i). -2i + 2 Let n(t) be the third derivative of t*4/8 + 23t*3/6 - 145t*2. Let a(w) = -w - 8. Give 17a(v) + 6n(v). v + 2 Let q(i) = 6i*2 + 7i + 5. Suppose -30s - 25s - 275 = 0. Let y(l) = 3l2 + 4l + 3. Determine sy(v) + 3q(v). 3v2 + v Let k(i) be the second derivative of i5/5 + i4/3 - 2i3/3 + i2 - 91i. Let j(r) = -8r*3 - 7r*2 + 7r - 4. Give 4j(x) + 7k(x). -4x3 - 2 Suppose n + 5i - 23 = 0, 0i - 20 = -4n + 4i. Let j(w) = -nw - 3w + 9w. Let o(y) = -5y. Determine -7j(a) + 3o(a). -a Let g(v) = 19v*2 - v + 6. Let u(o) = -35o*2 + 2o - 11. What is -11g(s) - 6u(s)? s*2 - s Let u(i) = 21i + 27. Let n(r) = -3r - 4. Let y(l) = 27n(l) + 4u(l). Let o(t) = -9t. Let s(p) = -p - 15. Let b be s(-19). Give bo(g) + 11y(g). -3g Let t(g) = -9g*2 - 78. Let i(l) = 7l*2 + 76. What is 5i(c) + 4t(c)? -c2 + 68 Let w(i) be the third derivative of i3/6 + 32i*2. Let h(g) = 2g + 4. Determine -h(f) + 5w(f). -2f + 1 Let q(w) = w*3 + 5w + 5. Let i(p) = p*2 + 6p. Let a be i(-7). Let h(d) = -ad3 + d - 7d - 6 + 6d3. Determine -4h(l) - 5q(l). -l3 - l - 1 Let x(j) = -j + 1. Let o = 3 - 2. Let y(c) = 1025c + 3c2 + 7 + 1029c - 2058c. What is oy(k) - 5x(k)? 3k*2 + k + 2 Let b(i) = 2i. Let t(h) = -2h + 3. Determine b(k) - 4t(k). 10k - 12 Let m(u) = -6u + 5. Let l(a) = -3a2 - 8a + 9. Let o be l(1). Let g(n) = n + 1 - 1 - 1. Calculate om(w) - 11g(w). w + 1 Let c(t) = 9t3 + 4t*2 + 38t - 4. Let f(w) =	{ "pile_set_name": "DM Mathematics" }
1/19 -267 divided by 14 -267/14 2130 divided by 6 355 Divide -450 by 75. -6 What is 37734 divided by -2? -18867 1272 divided by 6 212 Calculate -355 divided by -6. 355/6 Calculate 12375 divided by -99. -125 Divide 10 by 5. 2 What is 3825 divided by 3? 1275 What is 4185 divided by 155? 27 What is 66880 divided by 5? 13376 What is -275 divided by -11? 25 What is -3048 divided by -2? 1524 What is 7340 divided by 4? 1835 Divide 721 by -7. -103 Divide 720 by 5. 144 -7 divided by -510 7/510 Divide -39 by -11. 39/11 8690 divided by 2 4345 84 divided by 2 42 What is 390 divided by 65? 6 -8140 divided by -1628 5 What is 92 divided by 2? 46 Calculate 1888 divided by 944. 2 Calculate 550 divided by -50. -11 Divide 291 by 6. 97/2 Divide -4 by 2357. -4/2357 Divide 286 by 30. 143/15 Calculate 4 divided by 258. 2/129 Divide -594 by -1. 594 Divide 9936 by -1104. -9 Calculate -2730 divided by 78. -35 -93 divided by -22 93/22 Divide -11966 by 2. -5983 Calculate 60 divided by 10. 6 -2 divided by -18 1/9 9253 divided by 487 19 What is -1504 divided by 47? -32 What is -1 divided by -13? 1/13 What is 64 divided by -46? -32/23 -5952 divided by 93 -64 What is -378 divided by -63? 6 Calculate -15288 divided by 3822. -4 Calculate -20 divided by -633. 20/633 -1221 divided by -111 11 What is -2 divided by 18? -1/9 What is 49 divided by -85? -49/85 Calculate 678 divided by -1. -678 Calculate -6518 divided by -5. 6518/5 Calculate 812 divided by -2. -406 Calculate 303 divided by 8. 303/8 What is -2574 divided by -39? 66 -1 divided by -71 1/71 Divide 35 by -646. -35/646 -792 divided by 264 -3 Divide 20140 by -5. -4028 488 divided by -4 -122 837 divided by 3 279 Calculate -11 divided by -731. 11/731 Calculate -24 divided by 8. -3 What is -12 divided by -72? 1/6 What is -55 divided by -5? 11 6566 divided by 938 7 Calculate -13 divided by -4. 13/4 -2 divided by -47 2/47 Calculate 1422 divided by -3. -474 -137 divided by 6 -137/6 What is 1671 divided by -3? -557 223 divided by 1 223 What is -1233 divided by -3? 411 Divide -103 by -103. 1 What is 2 divided by -284? -1/142 Divide 6 by -145. -6/145 Calculate 3888 divided by 1296. 3 Divide -858 by -1. 858 Calculate -273 divided by 11. -273/11 What is -2600 divided by 200? -13 Divide 2329 by -1. -2329 -9207 divided by -33 279 What is 991 divided by -991? -1 Calculate 930 divided by 30. 31 Calculate 45 divided by -4. -45/4 Calculate 116 divided by 4. 29 Divide 2 by -2791. -2/2791 598 divided by -26 -23 Calculate 5 divided by -2710. -1/542 Divide 13 by -6. -13/6 What is 3 divided by -26? -3/26 What is 504 divided by -42? -12 What is 2 divided by -67? -2/67 Divide -51 by 5. -51/5 -2410 divided by 241 -10 Calculate 3102 divided by -11. -282 4 divided by 3970 2/1985 Divide 4196 by 1049. 4 Calculate -1 divided by 6. -1/6 Divide -1953 by -3. 651 Calculate -4266 divided by 18. -237 Calculate 1978 divided by 17. 1978/17 Divide -93 by 3. -31 -7672 divided by -1 7672 Divide 4 by 582. 2/291 What is 249 divided by -5? -249/5 Calculate 2 divided by -479. -2/479 What is 6696 divided by -6? -1116 What is 0 divided by -11? 0 What is 5248 divided by 6? 2624/3 Calculate -336 divided by -2. 168 Divide -75 by -1. 75 -22547 divided by 1 -22547 What is 3364 divided by -4? -841 What is -17552 divided by -1? 17552 What is -12616 divided by -4? 3154 Calculate -32 divided by -24. 4/3 What is 5 divided by 337? 5/337 -1552 divided by 8 -194 What is -90 divided by -32? 45/16 Divide 48 by -3. -16 What is -351 divided by -5? 351/5 4018 divided by -5 -4018/5 Calculate -805 divided by -3. 805/3 -10 divided by -10 1 What is -1626 divided by 271? -6 What is -124 divided by 6? -62/3 -10580 divided by 5 -2116 4452 divided by 212 21 -25 divided by 74 -25/74 -37916 divided by 2 -18958 What is 51260 divided by 5? 10252 Calculate 8064 divided by 12. 672 Calculate -7001 divided by -3. 7001/3 What is 24 divided by 1? 24 -1980 divided by -165 12 239 divided by 36 239/36 -368 divided by 16 -23 What is 55 divided by 55? 1 What is -10581 divided by -4? 10581/4 Divide -19038 by 2. -9519 2 divided by 286 1/143 4 divided by 52 1/13 Divide -25590 by -3. 8530 Divide -3744 by -312. 12 Divide -993 by 6. -331/2 22318 divided by -3 -22318/3 Calculate -2 divided by 1771. -2/1771 352 divided by -44 -8 -915 divided by 11 -915/11 -1 divided by 2903 -1/2903 Calculate 55250 divided by 5. 11050 Calculate 41 divided by -194. -41/194 Divide -4 by -2438. 2/1219 Calculate 128 divided by 32. 4 -882 divided by 14 -63 What is 715 divided by 10? 143/2 Calculate -70 divided by 6. -35/3 -1 divided by 129 -1/129 Divide 8549 by 83. 103 1117 divided by 1 1117 6176 divided by -4 -1544 What is -5 divided by 7523? -5/7523 Calculate -93 divided by 31. -3 What is 196 divided by -28? -7 What is 159 divided by -49? -159/49 What is -5736 divided by 717? -8 Divide 105 by 5. 21 92 divided by 13 92/13 Divide -1476 by -2. 738 What is -1242 divided by 414? -3 Calculate 55 divided by 20. 11/4 Divide -316 by 39. -316/39 Divide 0 by 20. 0 1535 divided by 5 307 What is -270 divided by 5? -54 73230 divided by -5 -14646 Divide 0 by -279. 0 What is -1596 divided by -228? 7 What is 129 divided by 33? 43/11 5074 divided by 2 2537 Calculate 184 divided by -4. -46 13227 divided by 2 13227/2 Divide -2500 by 500. -5 1238 divided by -2 -619 Divide -2 by 1602. -1/801 -957 divided by 12 -319/4 -13 divided by 11 -13/11 374 divided by -11 -34 Calculate 99 divided by -2. -99/2 What is 366 divided by -3? -122 What is 125 divided by -5? -25 What is -7 divided by -1012? 7/1012 Divide 3 by 59. 3/59 What is 308 divided by -11? -28 What is 40 divided by -2? -20 What is -24 divided by -4? 6 319 divided by -319 -1 5835 divided by 5 1167 What is 3321 divided by -27? -123 What is 3 divided by -6? -1/2 What is 5229 divided by -1743? -3 What is 7208 divided by -901? -8 Divide 120 by 24. 5 Divide 0 by -34. 0 Divide 83 by 5. 83/5 Calculate -60 divided by -5. 12 Calculate 1148 divided by 3. 1148/3 What is -2849 divided by -407? 7 -3 divided by 775 -3/775 -71 divided by -56 71/56 105 divided by -46 -105/46 5 divided by -346 -5/346 Divide 11130 by -5. -2226 Calculate -6468 divided by -3. 2156 What is 2 divided by -692? -1/346 Divide 84 by -28. -3 Divide -140 by -35. 4 What is 27 divided by -9? -3 Calculate 176 divided by -1. -176 -1176 divided by -3 392 -225 divided by 5 -45 4 divided by -538 -2/269 Divide -7 by 143. -7/143 -104 divided by 52 -2 What is -14319 divided by -9? 1591 Divide -3025 by -5. 605 What is 5 divided by -31? -5/31 What is 7 divided by -183? -7/183 Divide 0 by 32. 0 What is -450 divided by 225? -2 Divide 15016 by -3754. -4 -2 divided by -31 2/31 What is -180 divided by -30? 6 Divide 2 by -3488. -1/1744 Divide 984 by 328. 3 Calculate 61 divided by 61. 1 Calculate -1 divided by 125. -1/125 Calculate -264 divided by -4. 66 Calculate -858 divided by 26. -33 Divide -102 by 34. -3 What is 936 divided by -156? -6 Calculate -23065 divided by 5. -4613 Calculate -4 divided by 111. -4/111 Divide 2 by 374. 1/187 Divide 0 by -18. 0 Divide -65 by -13. 5 -16 divided by -72 2/9 Divide -10854 by 3. -3618 What is 94 divided by -94? -1 Divide -2 by -50. 1/25 Calculate -3 divided by 375. -1/125 Calculate -9047 divided by -5. 9047/5 1848 divided by -616 -3 -2 divided by -2 1 What is -26 divided by 3? -26/3 Divide 66 by 22. 3 What is 36 divided by -65? -36/65 Divide 4 by 2. 2 31540 divided by 4 7885 -18 divided by -465 6/155 Calculate -2871 divided by 3. -957 What is 884 divided by -221? -4 696 divided by 2 348 Divide 0 by 812. 0 Calculate 33663 divided by -2. -33663/2 Divide 1 by -319. -1/319 Calculate -140 divided by 10. -14 -58 divided by 121 -58/121 What is 0 divided by -71? 0 Calculate -847 divided by -121. 7 What is -425 divided by 3? -425/3 -1366 divided by 2 -683 2499 divided by -1 -2499 What is 3798 divided by -3? -1266 -304 divided by 6 -152/3 Calculate -4 divided by -67. 4/67 Divide -129 by 24. -43/8 Divide -1750 by -175. 10 Calculate 154 divided by -7. -22 Divide -826 by 2. -413 What is 55998 divided by 6? 9333 What is 678 divided by 2? 339 Divide -1832 by -458. 4 Divide 1598 by -34. -47 Calculate 3933 divided by 3. 1311 41024 divided by -4 -10256 What is -520 divided by -130? 4 Calculate 16062 divided by -6. -2677 75 divided by -25 -3 Calcul	{ "pile_set_name": "DM Mathematics" }
d8 assuming d is positive. d(39/4) Simplify (u/(u(u/u*(-2/7))/u))/uu*(2/9)u(2/3)/((u6u)/u) assuming u is positive. u(-403/63) Simplify f1f*(-3)f*6/(ff(-3/4)) assuming f is positive. f(15/4) Simplify (f/f13)/(f(4/3)/f) assuming f is positive. f(-37/3) Simplify (y(-2)/y)*5(y/(y(y/(yy*(2/7)yy))/y))(-4) assuming y is positive. y(-197/7) Simplify ((t/t(-2/3))/(tt/t7))/((t0t)/(t8t)) assuming t is positive. t(44/3) Simplify (u(2/3))*(-10/11)u/u*(-1)u*(2/19)u assuming u is positive. u(1567/627) Simplify i(1/3)iii/(i/((i/(i/i1)i)/i))((((i/i(-2/5)i)/i)/i)/i)7 assuming i is positive. i(-13/15) Simplify (nn(-15/2))/n(-21) assuming n is positive. n(29/2) Simplify a(-7)a*0a assuming a is positive. a(-6) Simplify (((x(-1/4)/x)/x)/x)/xx1 assuming x is positive. x(-13/4) Simplify bbb(-1/38)bb/((bb/b(-1/20))/b) assuming b is positive. b(1111/380) Simplify m*(16/7)m(12/11) assuming m is positive. m(260/77) Simplify ((cccc/c(1/2)c)(-31))(-47/4) assuming c is positive. c(13113/8) Simplify p(-2/35)/p(13/5) assuming p is positive. p(-93/35) Simplify (t(-20))(3/10) assuming t is positive. t(-6) Simplify s/s47s(-48) assuming s is positive. s(-94) Simplify ((aa*(5/6))/((aa/((aaa*0/a)/a)aa)/a))(-2/41) assuming a is positive. a(7/123) Simplify l7l(((l/(l(2/9)/ll))/l)/l)/lll*(-1/7)l(l/(l(l/l*8l)/l))/l assuming l is positive. l(859/63) Simplify (v/(v/v(-1))v/(vv(10/11)))(1/2) assuming v is positive. v(-21/22) Simplify o(-12)/(o/(o*(2/21)/o)o) assuming o is positive. o(-313/21) Simplify (c(-12/13)/c)(-3/7) assuming c is positive. c(75/91) Simplify ((o*0o)/o(-3))/(o(-3)/o(o/o(5/3))/oo) assuming o is positive. o(26/3) Simplify b(5/18)b(2/3) assuming b is positive. b(17/18) Simplify f(3/5)/((f(-22)f)/f) assuming f is positive. f(113/5) Simplify ((b1)27)34 assuming b is positive. b918 Simplify (u(-1)/u)*39u6/u(-2) assuming u is positive. u(-70) Simplify (p(-23)/p)(-9) assuming p is positive. p216 Simplify (t/((tt(-29)/t)/t))/ttt(11/6) assuming t is positive. t(197/6) Simplify (v(-4/5)/((v/(v/v(-4)))/vvv))(-25) assuming v is positive. v(-55) Simplify b/(b/b(-23))b(-19) assuming b is positive. b(-42) Simplify tt(-11/6)/tt(-38) assuming t is positive. t(-239/6) Simplify (f(-2/5))(-35) assuming f is positive. f14 Simplify c/c(-2/5)c5 assuming c is positive. c(32/5) Simplify ((ww*(-3/11)w)/w)/ww(2/11) assuming w is positive. w(-1/11) Simplify k(-2/87)/(kk(k/k(3/28)k)/k) assuming k is positive. k*(-7103/2436) Simplify (((f/(f(f/(f*(-2/13)/f))/ff))/f)/ff)35 assuming f is positive. f(-1435/13) Simplify ((a(-4)a)/a*4)/((aa*9a)/((a(-3/4)/a)/a)) assuming a is positive. a(-83/4) Simplify g*13g*(-1/3)g assuming g is positive. g(41/3) Simplify (g(-1))*(-46)g1/g9 assuming g is positive. g38 Simplify x(-8)x(-5/4)x*(-5/2)/(xx*(-4)x) assuming x is positive. x(-39/4) Simplify (f(2/3))*(-14)(f/(f/(ff(-1/3))))(-28) assuming f is positive. f(-28) Simplify (l/l(2/3))(-35)/(l6l/((l*(2/3)/l)/ll)) assuming l is positive. l*(-19) Simplify f/(f/(f/(ff*(1/8))))f/((f/f*(1/3))/f)(f/f1)/((((f(-1)/f)/f)/f)/f) assuming f is positive. f(149/24) Simplify (n/((n7/n)/n))/n*(-1/14)(n/(nnn*(-2/5)n))(4/21) assuming n is positive. n(-127/30) Simplify o*5/(oo*(-10))ooo*(-6)/oo(o(o/(o/((o/o*(-4))/o)))/o)/oo assuming o is positive. o14 Simplify (p/(p/(p/p(-1/4))p)p)*(1/2)p*3p(-4) assuming p is positive. p(-3/8) Simplify (zz(2/9))(-27)/(z(4/7)z(-1/8)) assuming z is positive. z(-1873/56) Simplify fff*(2/7)/ff(-42) assuming f is positive. f(-285/7) Simplify (j1)(-40)/(j(-2/7)/(j/j(2/7))) assuming j is positive. j*(-39) Simplify gg/(gg(1/13))g/g(3/19) assuming g is positive. g(436/247) Simplify l*8lll/(l*(5/4)/l)(l/(ll8)l)/l0 assuming l is positive. l(15/4) Simplify ((b(-7)/b)/b)/b(11/5) assuming b is positive. b(-56/5) Simplify y(-14/5)/(y/(yy(2/3))) assuming y is positive. y(-32/15) Simplify u/u(2/35)uu12 assuming u is positive. u(488/35) Simplify ((hh/h(-1/3))1)(-50) assuming h is positive. h(-350/3) Simplify ((ddd(-7)/d)/(d(4/3)/d))26 assuming d is positive. d(-494/3) Simplify (v(4/5)/v(2/9))(-8) assuming v is positive. v(-208/45) Simplify u*(-2)(u/(u*6/u))/u(uuu(2/7))(14/11) assuming u is positive. u(-45/11) Simplify m/m(-3)m(m/(mm(-3)/mmm))/mmmmm(-1/2)m(m/(mm(4/5)))/m assuming m is positive. m(77/10) Simplify (((aaa2)/a)0)*(-4/21) assuming a is positive. 1 Simplify (j/(jjj/((j(1/2)j)/j))j)(-7/4)/((jj*(3/2)jjj)/(j/((jjj*1)/jj))) assuming j is positive. j(-53/8) Simplify ((b(-1/34)/b)/b)/(b(-6/19)/b) assuming b is positive. b(-461/646) Simplify (n*(-3/5)nn(-2)n)/(((nn(-2/7))/nn)/(n/(n(1/4)/n))) assuming n is positive. n(61/140) Simplify m/((m*(-1/2)m)/m)(m/((m(-2/21)/m)/m))/m assuming m is positive. m(151/42) Simplify (g(-2/3))(-24/7)g*(-2/3)/gg1 assuming g is positive. g(34/21) Simplify (i/(ii(-2/5)ii)i)/i*(2/7)(ii/(i(-1/4)/i))(-7/4) assuming i is positive. i(-3681/560) Simplify b/((b/(b(2/5)b))/b)bb/((b*(4/9)/b)/b)(b(1/3))(-8/11) assuming b is positive. b(2828/495) Simplify (z/z6)(-1/41) assuming z is positive. z(5/41) Simplify (v(5/4))(1/5) assuming v is positive. v(1/4) Simplify ((q(2/5))(-49))15 assuming q is positive. q(-294) Simplify (c/c(6/7)c/((c(-4)/c)/c)c)(-1/9) assuming c is positive. c(-19/21) Simplify (tt(1/5))(7/3)/(t10t(-7/5)) assuming t is positive. t(-29/5) Simplify b*(-4/3)b*(-1)b*(-8)b0 assuming b is positive. b(-31/3) Simplify (kkk*(-14)k*(4/3)k)(15/2) assuming k is positive. k(-145/2) Simplify ((q/(q/q*(3/2)))/((qqq12)/q))(-36) assuming q is positive. q414 Simplify (r(-2/7)r(2/5))/(r1)(-1/78) assuming r is positive. r(347/2730) Simplify (n/n1)(-27)/(n*3n/(n*(-4/7)n)) assuming n is positive. n*(-25/7) Simplify (mm/(mm/(((m/m(-7))/m)/m))mm/(m/m(2/33)))(-40) assuming m is positive. m(-9320/33) Simplify (zz3)/z(-12/7) assuming z is positive. z*(40/7) Simplify ((j/((((j/(jj*(-1/4)))/j)/jj)/j))/j)*(-1/10)/(jjj(2/3))22 assuming j is positive. j(-7061/120) Simplify (gg/(g*(2/51)g))16 assuming g is positive. g(784/51) Simplify x*(13/5)(xx(1/12)xx)/x assuming x is positive. x(281/60) Simplify ss*(-5/4)/sss/s5s assuming s is positive. s(-13/4) Simplify y(-30/7)/(y/y*(-28)y) assuming y is positive. y(-240/7) Simplify z(-16)((z(-2/61)/z)/zzz)/z assuming z is positive. z(-1039/61) Simplify (l/((l(-2)/l)/l))/l(1/4)l*(-6)l(-2)/l assuming l is positive. l(-17/4) Simplify (hh(-1/4)h*(2/9))/(hh*(-2/3)(h/((h5/h)/h))/h) assuming h is positive. h(131/36) Simplify (((uu(-8))/uu)/u)/u0 assuming u is positive. u(-8) Simplify t4/(t/(t(-13)t)) assuming t is positive. t(-9) Simplify (q2)(1/15)(qq/(qq*3)q)/q2 assuming q is positive. q(-43/15) Simplify ((o*(2/9)/oo)/(o/(ooo*(-5/2))))/(oo*(-2/3)oo/o(-2/7)) assuming o is positive. o(-491/126) Simplify (i4/(i/(ii*4i)))/(i/(ii5)i/i*(-2/9)iii) assuming i is positive. i(88/9) Simplify (i/(i/(i/i(5/2))))(-3) assuming i is positive. i(9/2) Simplify (d(-3)/(d/(d(-6)/d)))/(d(2/5))(3/8) assuming d is positive. d(-223/20) Simplify (z6zzz(-1/7))/((((zzz/(z/(z/((zz*6)/zz))z)z)/zz)/z)/zz5/z) assuming z is positive. z(69/7) Simplify ((h/((h(4/3)/h)/h))/(h(-6)/h))/((h/(h0/h))/(h(-8)h)) assuming h is positive. h(-1/3) Simplify yy*6yyyy(2/15) assuming y is positive. y(152/15) Simplify (((f(2/65)f)/f)/f)(-8) assuming f is positive. f(504/65) Simplify (n(-5)/(n/n7n))/((n(n(nn/(nn(4/7)/n))/n)/nn)/nnnn*(-5/3)) assuming n is positive.	{ "pile_set_name": "DM Mathematics" }
2 What is (7 - (-3 - (-17 - -8 - -5))) + -7? -1 (4 - -4) + (-4 - 2) - 0 2 What is (7 - (34 + -2) - (-11 + -2)) + (-2 - 29)? -43 Evaluate -1499 - -1550 - (55 - 0). -4 What is the value of (-59 - -66) + 9 + -6 - (1 - -61)? -52 Calculate 13 + (2 + 71 - (56 - 63 - (8 - 23))). 78 What is the value of 6 + -22 + (-18 - -41 - -21)? 28 Evaluate 2 + -2 + 42 + 32 + (-102 - -64). 36 What is the value of 5 + ((-13 - -5) + -5 - (4 - -1))? -13 What is the value of -6 - (-6 + (0 - (-6 + 11))) - -28? 33 Evaluate -25 - (-7 + 23 - 104). 63 What is the value of (-1592 - -1520) + -5 + -39 + 2? -114 -80 + 146 + -55 + (-1 - -3) 13 Evaluate -20 + (-1325 - -1452 - (-19 + -2)). 128 What is -201 + -48 + (160 - 24)? -113 What is the value of (-9 - -5 - 64) + 498 + -484? -54 Evaluate 116 - (20 - -51) - 33. 12 What is the value of (-33 - -6) + -3 + (10 - 12) + 7? -25 Evaluate -60 + 44 + 29 + (68 - -9) + 4 + 1. 95 What is the value of (41 - 0) + (-374 - -383 - (-1 - -5)) + -5? 41 What is -14 - (30 + (60 - -21 - -16))? -141 -20 + (46 + -9 - (1 - 0)) 16 44 + 1 + 25 + -34 + 20 + (-13 - 6) 37 Calculate 28 + (-39 - -18) + 34. 41 Evaluate 147 - ((102 - 189) + 216). 18 What is 2 - 34 - (-73 - -35)? 6 -4 + (-13 - -10) - (18 - 17 - -18) -26 Calculate (-20 - -22 - -32) + -49. -15 Calculate (0 + -3 + -9 - (34 + -53)) + 21. 28 What is the value of -10 + -17 + -1 + (28 + -12 - 13)? -25 What is the value of 64 - (-7 + (6 + 20 - (-12 + (32 - 6))))? 59 Calculate -7 - (-12 + 7 - -17 - 44). 25 Evaluate -29 - 0 - (-38 + 8). 1 Calculate -25 + (-40 + 11 - -4) - 6. -56 Calculate 0 + (-5 - -3) + -3 + (-74 - -80). 1 Calculate -26 + -40 + (-19 - 4) + 37. -52 1 + 0 + -32 + 41 + -13 - (2 + 15) -20 What is 63 + (-52 + -56 - -52)? 7 Evaluate 19 + (-9 + -14 - 22) - (7 + 0). -33 Calculate 36 - 4 - (30 - 36). 38 Calculate (-18 - 0) + -33 - -29. -22 What is the value of -175 + (-56 - -163) - (-9 + 1)? -60 Evaluate -71 + (-119 - (-12 + -194)). 16 What is the value of (-1244 - -1083 - (0 - 24)) + (8 - (-1 - -3))? -131 -176 + 85 + -112 + 68 -135 What is the value of 8 + -20 - (-3 - -8 - (90 - -16))? 89 17 + (1 - -7) + (-73 - -162) + -218 -104 Calculate (7 - (8 - -5)) + (-2 - -69 - (-101 - -94)). 68 Evaluate 2 + (-10 - -25 - 11) + 11. 17 What is the value of (-66 - (0 - -2)) + (-87 - -18 - -66) + 14? -57 Calculate -58 + 9 + 6 + 7 + (-1 - 1) - 7. -45 What is 44 + (28 - 43) + 54? 83 Evaluate -20 - (15 + -2 - (105 - 31)). 41 What is the value of -61 + 35 + -1 + 25? -2 Calculate 63 + 0 - (1 - 25 - (47 + -64)). 70 What is the value of 47 + -79 + 33 + -62? -61 1 + -28 - (-108 - -290 - 149) -60 What is the value of 4 + -28 + (-1 - -6 - -6) - -62? 49 (60 - 43) + 20 + -23 14 What is 66 - (22 - (-46 + (55 - -1)))? 54 What is the value of 0 - -15 - ((-18 - -96) + -100)? 37 Calculate -69 + -7 + (57 - 43). -62 Evaluate -3 - (-9 - (-52 - (-7 + 8 + 3))). -50 Evaluate 6 + -2 + -7 - 13 - -100 - 15. 69 What is 920 + -946 - (2 - 26)? -2 What is the value of (-186 + 337 - 186) + (-1 - -4 - 1)? -33 What is the value of 13 - -10 - (-38 + 23 + 99)? -61 Calculate 24 + (-20 - 64) - -57. -3 -12 - (33 - (19 + -12 + 5)) -33 Evaluate 32 - -17 - 52 - -8. 5 Calculate -6 + -12 + 82 + -13 + 18 - -15. 84 What is (-45 - 3) + (47 - -10 - 44)? -35 Evaluate (4 - -7 - -5 - 3) + (8 - -17 - 14). 24 -27 + 23 + (70 - 79) -13 What is the value of -205 + (108 - -95) - (-79 - 1)? 78 Calculate 59 - (-16 + -14 + 75 + -30). 44 Calculate -8 + -63 - (-1870 - -1766). 33 Evaluate (11 - 20) + 97 + -40. 48 What is -13 + 3 + (-91 + 86 - (-50 + 3))? 32 What is the value of -52 + (-33 + -2 - -62) - 85? -110 What is 36 + (22 - 4) + -82? -28 Evaluate (-101 - -60) + -8 + 4 + -7. -52 What is 32 + (97 - 111) + 0 + 17? 35 What is (18 - (-1 + 11)) + (9 - 4) + 2 + -30? -15 Calculate -53 + 18 + 15 - (0 - 50). 30 -5 - (-108 + 116 + (5 + -7 - 6)) -5 (-31 - 20) + (20 - (-1 + 8)) - 10 -48 What is the value of (-1 - -20) + (52 - 5 - -4 - 116)? -46 Evaluate (1 - 5) + 5 - -7 - (-88 - -52). 44 What is -68 - (-30 + 0 + 14 + 16) - -13? -55 What is the value of 25 - 30 - (-149 + 66)? 78 -8 - (-28 + 5 - (4 - 15)) 4 What is (2 - 67) + (-3908 - -3911)? -62 What is the value of -33 - -6 - (-50 - -57)? -34 What is the value of (-4 - 1 - (8 - 5)) + 51 + 77 + -99? 21 Calculate 61 + (-5 - (-7 + 13) - 6) + 29. 73 What is (-14 + 1 - (-139 - -133) - 1) + 34? 26 Calculate -78 - -109 - 61 - (-103 + -1). 74 5 + 2 + (36 + (14 - (48 - 17)) - 18) 8 What is 90 + (-176 - -55) + (-93 - -1)? -123 What is the value of 1 + ((-4 - -9) + -1 - 53) - (620 - 632)? -36 Calculate -128 - -63 - (-81 - -33). -17 What is -1 - (-10 + (29 - 6) + -12 + 26)? -28 Calculate (-50 - -29 - -115) + -71. 23 -4 + -27 + 13 + (94 - 47) 29 What is 211 - 177 - 82 - (24 - -1)? -73 What is the value of (-40 - 35) + 97 - -58? 80 What is the value of 27 + 37 + -58 - -101? 107 (121 - (98 - 42)) + -16 49 (2 + -3 - -42) + (-8791 - -8786) 36 (2 - 5) + (10 + (1 - 4) + 6 - 51) -41 What is the value of 17 - (-11 + (13 - -37)) - 10? -32 Calculate -19 - (29 - -22 - -12). -82 What is -32 + 174 + -156 + 16 + 2? 4 Evaluate -3 + (-6 - (-2 + -1)) + (-43 - (-20 - 17)). -12 -4 + (37 - 9) - 11 - (8 + -1 + 55) -49 What is -30 + (-14 - (-5 + -20) - -2)? -17 Evaluate 45 - 21 - ((7 + -8 - -6) + -1). 20 Evaluate ((-20 - -6) + 40 - -29) + (1 - 1) + 3. 58 What is (77 - 38) + (5 - 19)? 25 Evaluate -6 - -16 - 6 - (93 + -100 + (-1 - 11)). 23 Evaluate 6 + (60 - (7 + -20 + 14)) + (-5 - -4). 64 What is -51 + (-29 - -160) + -55? 25 Calculate (-123 - -35 - -43) + 80. 35 Evaluate 60 + 6 + -48 - (-5 - 1). 24 14 + -25 + -67 + -3 + (6 - 5) - 13 -93 (70 - 16) + (-4 + 2 + 14 - 25) 41 What is the value of -111 + -3 - (-4 + -13 + 4 - (-69 - -64))? -106 What is the value of -6 + 8 + -1 + -4 - (120 + -277 + 174)? -20 Calculate -59 + (60 - -36 - 41). -4 Evaluate 14 + -23 + 14 - (52 + -1). -46 Evaluate -4 - -27 - (-7 - ((17 - 32) + 15)). 30 Evaluate -17 - ((-691 - -685) + 35 + 1). -47 -22104 + 22190 + (0 - 0 - (-4 + 1 - -15)) 74 What is the value of (1 - (3 + -3)) + 4 + 50 + (-270 - -263)? 48 -14 + 13 - (25 - -34) -60 -45 - (-23 + 1) - (15 + 13) -51 Evaluate 55 + (-13 - (-37 + 18 - -18)). 43 Calculate (-7 - (-33 - (17 - 26))) + -93. -76 Evaluate -108 + (-30 - -3) + (11 - -3 - -1) + 14. -106 What is the value of 1 - (39 - (87 - 45)) - (102 - (1 + -1))? -98 Calculate -6 + -2 + -67 - 13 - -37. -51 Calculate (73 - 22) + -37 - (0 - 16). 30 Calculate -36 + (-216 - -117) - -209. 74 Calculate (-19 - -8) + (-8 - (-7 + (-3 - (-7 - 4)))). -20 -9 + -29 + -32 + 50 - (16 + 0) -36 What is the value of 12 + -56 + (12 - (-14 - (-23 - 15)))? -56 39 - (24 - -1) - 36 - -103 81 Calculate (142 - (-5 + 146)) + 149. 150 What is the value of 11 + -2 - (24 - (1 + 13 + -10))? -11 -8 - (16 - (-16 + 6 - -21)) - 1 -14 What is 3 + (113 - 118) + (-2 - -1) - 53? -56 Evaluate -112 - -219 - 176 - -100. 31 Calculate 69 - (-2 + (21 - 9) + 8). 51 What is -31 - 21 - -47 - ((0 - -3) + (10 - 14))? -4 What is the value of -6 + (39 - 4) + 35? 64 Evaluate (3048 - 3035) + -2 + -73. -62 What is 20641 + -20742 + (17 - 1)? -85 What is the value of -15 - (11 + 10 - (8 - -3))? -25 13 - (0 + 52 + 56 + 47 + -113) -29 -10 + 2 + (10 - 22) + -8 + 24 - -82 78 What is 75 + (-73 - (-98 - -99))? 1 3 + (6 - 1 - 38) -30 What is the value of 32 + (24 - (-9 - -1 - (-42 - -22))) - 11? 33 What is -88 + (-11 - -12 - -19 - (-8 - -46))? -106 What is (170 - 175) + (0 - 6) + (21 - 1)? 9 Calculate (34 - (18 - -17)) + -39. -40 -25 - 0 - (156 - 171) -10 What is 209 - (16 + -66 - -179)? 80 Calculate -1 + 18 - 1 - (767 + -766) - -13. 28 (-70 + 1 - (-75 - (17 + -93))) + 13 -57 -23 + -2 + 3 + (1 - 1) + 87 + -82 -17 59 + (-45 - (104 + -70)) -20 399 + -487 - (5 + -95) 2 Calculate (15 - (29 - -10 - 55)) + (-7 - -1). 25 Calculate 136 + (-94 - -117 - 43). 116 Evaluate -6 + (51 - (40 - -44)). -39 What is -197 + 62 + (7 - -2) + 0 + -1 + 7? -120 Evaluate 98 + 27 + (-278 - -23). -130 What is (-58 - 11) + (177 + -153 - (-1 + 13))? -57 (0 + (-2 - -1) - 7 - (26897 - 26900)) + -1 -6 What is 3 + -3 + (-3324 - -3230)? -94 13 + 81 + -49 + 3 + -1 47 What is the value of 13 + (61 - (-72 + 123) - ((-90 - 0) + -1))? 114 Calculate (-1 - 8) + (83 - (22 + -40 + -8 + 25)). 75 Calculate 96 + -112 - (-35 + (11 - 6)). 14 Evaluate -48 + 19 + 20 + -28 + (2 - 3). -38 Evaluate 87 - (	{ "pile_set_name": "DM Mathematics" }
.045. What is a rounded to 6 dps? -0.000004 Let i = 415 + -414.9803. Let w = -0.18 - -0.2. Let x = w - i. What is x rounded to three decimal places? 0 Let v = -83.097 - -83. Let m = 0.096906 + v. What is m rounded to five decimal places? -0.00009 Let l be (-18)/(-15)(-20)/(-6). Suppose 2g = 3i + 35, -18 = -lg - 3i + 7. Let t be 2/g - (-1)/(-5). Round t to four dps. 0 Let z(f) = -f + 2. Let l be z(2). Let p be 18/21(7 + l). Let t be 210/(-4)(-16)/p. Round t to the nearest 100. 100 Let j = -61 - -42. Let q = j - -19.00000013. Round q to 7 decimal places. 0.0000001 Suppose -5a = 3j - 33, 2a - 5j - 7 = -0a. Suppose -3d = -5h - 6d - a, -5h - d - 2 = 0. What is h rounded to the nearest 100? 0 Let w = -496 - -241. Let p = -257.06 - w. Let m = p + 2.7. Round m to 1 decimal place. 0.6 Let a(u) = -2u3 + 11u*2 - 11u + 3. Let f be a(8). Let g be 9/3 + f + 2. Round g to the nearest one thousand. 0 Let k = -0.072 + 0.0846. Round k to 3 decimal places. 0.013 Let z = 10.49999844 + -10.5. What is z rounded to seven dps? -0.0000016 Let o = 316 - 317.43. Let f = 2.44 + o. What is f rounded to one dp? 1 Let p = -269.00326 - -269. Round p to four decimal places. -0.0033 Let n = 0 - -4. Let r = n + -4.00024. Round r to four decimal places. -0.0002 Let y = -3 + 2.1. Let z = y - -1.6. What is z rounded to the nearest integer? 1 Let w = 18693676 - 12803439. Let j = w - 3163243. Let z be j/27 + (-2)/(-9). Round z to the nearest 10000. 100000 Let m = 3912169 + -3914595.3385. Let w = m - -2427.34850103. Let d = 1.01 - w. Round d to 7 decimal places. -0.000001 Let m = 13 - 12.93. Let r = m + -0.086. Round r to three decimal places. -0.016 Let f be 491-1(-3 + 1412). Let j = 6291819 + f. Round j to the nearest 1000000. 6000000 Let h = 125549 - 125548.810009. Let v = h - 0.19. What is v rounded to five dps? -0.00001 Suppose -2j + 11 = a, 5j + 5a - 41 = -1. Suppose w = ji - 4i + 570005, -4w + 1710020 = 3i. Round i to the nearest one hundred thousand. 600000 Let q = 0.218 + 0.032. What is q rounded to one dp? 0.3 Let g = -1584.6523 - -1583. Let h = g + 1.66. Round h to three dps. 0.008 Let n = -139 - -143.92. What is n rounded to the nearest integer? 5 Let b = -82.4 + 68. Let a = 1.4 + b. Let r = a - -12.99954. What is r rounded to four dps? -0.0005 Suppose 16315 = a + 4a. Suppose 0 = -0v - v + 1863. Let d = a - v. Round d to the nearest 100. 1400 Let g = -0.114 + 0.024. What is g rounded to 2 decimal places? -0.09 Let b = -18.68 + 19. Round b to 1 decimal place. 0.3 Let l = -0.058 - -0.0580092. Round l to six dps. 0.000009 Let s(a) = -13468a*2 - 10a + 2. Let j(l) = 8l - 1. Let b be j(1). Let z be s(b). Round z to the nearest 100000. -700000 Let u = -67 - -66.03. What is u rounded to 1 decimal place? -1 Let f = -149 + 262. Let l = -113.79 + f. What is l rounded to 1 dp? -0.8 Let o(u) = u - 1. Let y be o(-3). Let b = -5 - y. What is b rounded to the nearest integer? -1 Let k = 0.49 + -0.81. Round k to one dp. -0.3 Let q = 0.082 - -56.918. Let f = q + -57.00132. What is f rounded to four decimal places? -0.0013 Let h(b) = -29b*3 - 5b*2 + 8b - 4. Let x be h(6). What is x rounded to the nearest 1000? -6000 Let p be (-17000)/(1 + (-327)/330). Round p to the nearest 100000. -1900000 Let k = -490782946.20000146 - -490782964. Let y = -17.8 + k. Round y to seven dps. -0.0000015 Let b = 0.0423 + 2.7277. Let u = -0.47 + b. Let r = -3 + u. What is r rounded to 1 dp? -0.7 Suppose 6p - 41 - 529 = 0. Round p to the nearest ten. 100 Suppose -27 = l - 0g + 3g, 85 = -5l - 5g. Let z be (-2)/l + 2279998/12. What is z rounded to the nearest one hundred thousand? 200000 Let o = -1183932512 + 1183932310.9999919. Let h = o - -201. What is h rounded to 6 dps? -0.000008 Let w(v) = -7v + 2. Let s be w(-9). Suppose 2k + 35 = -s. What is k rounded to the nearest ten? -50 Let d(k) = -265305k*2 + 9k + 8. Let g = -20 - -13. Let q be d(g). What is q rounded to the nearest one million? -13000000 Let x = -3 + 56. Let p = -52.9999979 + x. Round p to six decimal places. 0.000002 Suppose 0 = r - 3c + 615, -5c - 4857 = 5r - 1682. Round r to the nearest 100. -600 Let j = 71 + -71.43. Round j to one decimal place. -0.4 Let m = -171.7288 - -171.5288007. Let u = m - -0.2. What is u rounded to 6 decimal places? 0.000001 Let t(b) = 6 - 3 + 0 - 199b. Let o be t(-5). Suppose -802 = 4h + o. What is h rounded to the nearest 100? -500 Suppose -2073 = -8o + 919. What is o rounded to the nearest 10? 370 Let o = -2.093 - -1.98. Round o to 2 dps. -0.11 Let u(b) = b*3 + 5b*2 - 4b + 1. Let l be u(4). Let z = -233 + l. What is z rounded to the nearest ten? -100 Let m = -17.48 - -17.45004. Let s = -0.03 - m. Round s to five dps. -0.00004 Let m = -0.46944 - 789.25056. Let j = 775.7207 + m. Let b = -14 - j. Round b to three decimal places. -0.001 Suppose 0 = 4t - 8t + 468000. What is t rounded to the nearest 10000? 120000 Let g = -10 + 4. Let b = g - -6.000001. Round b to six decimal places. 0.000001 Let j be 100/15 + (-2)/(-6). Let d(b) = -47b3 + 3b*2 - 4b + 2. Let s be d(j). What is s rounded to the nearest 10000? -20000 Let m = -4 + 6. Let p be (234375/m)/(6/(-256)). What is p rounded to the nearest one million? -5000000 Let f be -5704 - (-4 - (1 - 1)). What is f rounded to the nearest 1000? -6000 Suppose -3h - 4q + 7 = -2h, 3h + q = 10. Let i be (2 + -26)(-3500)/h. Round i to the nearest 10000. 30000 Let f be (-9)/(-6)(-16)/6. Let i = f - -6. Suppose -h + ih + 470 = 0. What is h rounded to the nearest one hundred? -500 Let m = 1145256 + -385256. What is m rounded to the nearest one hundred thousand? 800000 Let b be -1 + 2/((-8)/(-2740)). Suppose b - 4642 = -5w + 2p, -5p - 20 = 0. What is w rounded to the nearest 100? 800 Let l = 107.99728 - 108. What is l rounded to 4 dps? -0.0027 Suppose z = -1, -4 = 3c + 2z - 2. Let j = c + 3. Suppose jr = r - 7400. Round r to the nearest 1000. -4000 Let j = 1.7 + -1.672. Round j to two decimal places. 0.03 Let z = -1.8 + 3.7. Let y = z + -14.9. Let u = -13.52 - y. What is u rounded to one dp? -0.5 Suppose 3b + q = -10935317, -6b = -3b + 3q + 10935321. Let s be 24180422/4 + 1/(-2). Let n = b + s. Round n to the nearest 1000000. 2000000 Suppose 6n + 5c + 140 = 2n, -124 = 3n - c. Let m be 6/5 + 8/n. Suppose -m = q - 5, 0 = v + 2q - 30008. What is v rounded to the nearest 10000? 30000 Let i be 2/(-5) + (-65)/25. Let h be 0 + i/3 - -6. Suppose -2d + 4m = 928, 5d - hm = d - 1850. Round d to the nearest one hundred. -500 Let j = -14.96 - -1.66. What is j rounded to the nearest integer? -13 Suppose 5m - 7 = t + 9, -3t + 4m - 4 = 0. Suppose -ts - 275 = s. Round s to the nearest 10. -60 Let b = -84 + 83.9999937. What is b rounded to 6 dps? -0.000006 Let c = 4.28 + -0.28. Let s = 97620632.0000001 - 97620636. Let i = s + c. What is i rounded to 6 decimal places? 0 Let o = 8 + -6. Suppose ov + 1 = 3, 4x - 90000081 = -v. Suppose 0 = 5a + 4h + x, -5a - 2h = -0a + 22500010. Round a to the nearest 1000000. -5000000 Let z = 0.06 + 6.94. Let b = 7.043 - z. What is b rounded to 2 dps? 0.04 Let l = 10943140 + -10943191.9999953. Let z = 52 + l. Round z to six dps. 0.000005 Let j = -0.7 + 0.58. Let g = j + 0.119968. What is g rounded to five decimal places? -0.00003 Let a = 41.9942 - 42. Round a to three decimal places. -0.006 Let k = -190.11 + 192. Let v = k - 1.7. Round v to one decimal place. 0.2 Let v = -76.2 - -87. Let f = 0.25063792 + 10.54935598. Let q = v - f. Round q to six decimal places. 0.000006 Let i = -181.5 + 78. Let x = -80 - i. Round x to 0 dps. 24 Let d = 26.99912 - 27. What is d rounded to 4 dps? -0.0009 Suppose 5q - 3767103 = -767108. Let w be q/3 - (-6)/18. What is w rounded to the nearest one million? 0 Suppose -8 - 1 = -3u. Suppose -3b = 6, -uj - 2j - 1658 = 4b. Round j to the nearest one hundred. -300 Let h(p) = -p2 + 7p - 8. Let t be h(6). Let s be (t/6)/(4/(-60)). Suppose 50 + 68 = sv - b, 3b = v - 18. What is v rounded to the nearest 10? 20 Suppose -17242 = -9i + 26228. Round i to the nearest 1000. 5000 Let b = 1396 - 992. Round b to the nearest 10. 400 Suppose 2h = 4*h - 164000. Round h to the nearest ten thousand. 80000 Let d = -2069802430.19047 - -2069764506. Let h	{ "pile_set_name": "DM Mathematics" }
3d - 5262, 5d - 6578 = 2p. Suppose -2i = -f - d, 0 = -i - 3f + 147 + 518. Is 82 a factor of i? False Let x = 654 - 666. Does 84 divide (88/x)/(-11)252? True Is (3 + 30/(-6 + 0))-2243 a multiple of 149? False Let w(g) be the second derivative of -389g*3/3 - 5g*2 + 36g. Let u be w(-5). Is 2/5 + u/50 a multiple of 13? True Let y(s) = s + 11. Let f be y(-8). Suppose -d + f = 6. Does 12 divide (-9)/6164/d? False Suppose -138g + 137g + 17457 = s, 34896 = 2g - s. Is 277 a factor of g? True Suppose -3g = -4m, m - 13 = 5g + 4. Is 0 + (-2 - g) - 3-83 a multiple of 39? False Suppose 5w + 4i = 118020, -4w + 127316 = -5i + 32859. Is w a multiple of 13? True Suppose -n - 66825 = -28n. Suppose 33l - 33 = n. Does 19 divide l? True Let l = -462 - -618. Let h = l - -36. Is h a multiple of 16? True Let l(r) = 6r2 - 8r + 6. Let i be l(3). Let a be (i/60)/((-2)/(-501)). Let u(q) = q2 - 15q + 7. Does 2 divide u(a)? False Let t = 1832 + 4361. Does 14 divide t? False Suppose -5v + 1037 = -d, 2v - 311 - 96 = 3d. Is v a multiple of 8? True Suppose 0 = -4x + 4k + 1372, 374 - 1064 = -2x + k. Suppose 9j - j + 1360 = 0. Let c = x + j. Is c a multiple of 20? False Let o(l) = -l3 + 24l*2 - 42l - 337. Is 54 a factor of o(17)? True Suppose -f - f + 14f - 392712 = 0. Does 77 divide f? False Suppose 0 = -5l + 5m - 290, -5m - 67 = l + 3. Suppose 65s = 70s + 30. Is 9 a factor of s/(25/l)? True Let j(q) = 2q*2 - 56q - 49. Suppose 45w - 551 = 26w. Is 7 a factor of j(w)? False Let l(u) be the first derivative of 79u4/12 - u3/3 - 10u*2 + 3. Let f(d) be the second derivative of l(d). Is 39 a factor of f(1)? True Suppose 10j + 3j + 1209 = 0. Let m = j + 97. Is 3 a factor of (0 - (-183)/12) + (-1)/m? True Let u be (-18 + 23)/(2/14). Let q = u + -33. Is (83/q)/((-20)/(-40)) a multiple of 31? False Let v(l) = 924l - 396. Is v(6) a multiple of 44? True Let r = -806 - -380. Let q = -248 - r. Is q a multiple of 7? False Suppose -33 = 11y - 8y. Let n(v) = -2v2 - 24v + 13. Let m be n(y). Suppose 0 = -40k + mk + 120. Does 3 divide k? True Suppose -5f = 3144l - 3142l - 398485, 5 = l. Is 63 a factor of f? True Suppose 0 = 6x - 1526 - 1126. Let b = -303 + x. Does 7 divide b? False Let x be (2/6)/(1/(-3))-52. Let r = x + -94. Let k = r + 85. Does 7 divide k? False Let v = 237 + -676. Let j = v - -803. Does 26 divide j? True Suppose -m + 393 = -2z - 691, 3m - 3260 = 2z. Does 34 divide m? True Let q(i) be the first derivative of 13i4/8 + 5i*3/6 - 21i*2/2 + 6. Let o(d) be the second derivative of q(d). Is o(6) a multiple of 19? False Let l = -272 + 542. Is 30 a factor of l/(-24)16/(-3)? True Let n(w) = -51 + 9w2 + 22w2 + w2 + 13w - 10w*2. Is n(3) a multiple of 21? False Let y = 1388 - 942. Suppose l + 11x - 6x = y, -5l - 2x = -2138. Does 17 divide l? False Suppose 0 = -4f + r + 9865, 6576 = 4f - 4r - 3268. Is 9 a factor of f? False Let n(s) = -2s3 - 6s*2 + 14s + 33. Let c = -86 + 81. Does 19 divide n(c)? False Let l = -37 - -54. Suppose -25d + 24 = -ld. Is 54 a factor of d/452 - 24290/(-75)? True Let n(o) be the first derivative of -o4/4 - 4o*3/3 + 15o*2/2 - 38o - 182. Is 49 a factor of n(-8)? True Suppose -4q = -u + 29 + 49, -4q + 4u - 84 = 0. Let i = q - -3. Let s = 24 - i. Is 10 a factor of s? True Suppose 2n = p + 17949, -14p = -4n - 17p + 35903. Does 25 divide n? True Suppose 45 - 270 = -3k + 5j, 2k - 131 = -3j. Let h(d) = 8d + 1. Let p be h(-6). Let l = k + p. Does 23 divide l? True Let p(y) = y*2 + 15y + 65. Let n be p(-12). Let l = 50 - n. Suppose 2a + 228 = la. Is a a multiple of 10? False Let i = 12408 - 8000. Is i a multiple of 46? False Let p = 94 + -92. Suppose 523 = 5o + 3w - 71, -o - pw = -123. Does 18 divide o? False Let s be 0 + -6 - -8 - -14. Is (-41)/(((-2)/s)/((-3)/(-6))) a multiple of 41? True Let a(j) = 12j*2 - 17j - 10. Let k be a(8). Suppose k = 5g + 162. Does 4 divide g? True Let q be ((-304)/20)/(1/5). Suppose 3s + s + 274 = 2m, 2s = -4m + 598. Let c = q + m. Is c a multiple of 9? False Let x be (5/3 + 77/(-66))-4. Is 3 a factor of (9/x - -5)316 - -1? True Let o = 180 - 29. Suppose -3v = -o - 185. Is v a multiple of 7? True Let o(r) = 7r3 + 4r*2 + 40r - 370. Is o(10) a multiple of 16? False Suppose -5z + o = -1963, o + 0o = -2z + 781. Suppose 60d - z = 52d. Does 3 divide d? False Suppose 1571 + 7767 = 6t - 21316. Does 13 divide t? True Let j(a) = -2a3 - 19a*2 + 8a - 9. Let i be j(-10). Suppose -g - 420 = -2t, -1 - i = 3g. Let o = t - 36. Is 14 a factor of o? False Let r be 353 - (40/15 + -3)3. Suppose 0 = 5g + 2f - 1131, -r = -2g - 5f + 111. Is 25 a factor of g? True Let u(c) = -c3 + 10c*2 + 22c + 9. Suppose 0 = -w + 4y + 23, -2w + 37 = -0w - 5y. Let h be u(w). Is 13 a factor of -1 + 15/13 - (-16880)/h? True Suppose 3t - 2778 = v + 479, -t - 3v + 1069 = 0. Does 3 divide t? False Suppose -v = 19z - 22z + 1, -2v - 3z = -16. Is 4 a factor of (-111176)/(-260) - (-1 - (-3)/v)? True Let n = -292 + 296. Suppose -4x + 2v + 3164 = 0, -nv - 889 = -x - 105. Is x a multiple of 36? True Let k(a) = -9 - 2a - a - 16 + 4a. Let h be k(14). Let z = h - -71. Does 14 divide z? False Let g be (-1)/(-2)01. Let n(p) = 17p*2 - 113p - 30. Let k be n(9). Suppose go - 5o = 2v - k, 5v - 854 = 2o. Is 34 a factor of v? True Let p(n) = 2n + 15. Let f be p(-6). Let k(v) = -5v. Let i be k(f). Does 27 divide (i/(-12))/(7/756)? True Suppose 2w - 10w = -72. Let a(t) = t3 - 10t*2 + 7t + 18. Let r be a(w). Suppose u + rz - 32 = 4z, 5z = 5u - 115. Is 5 a factor of u? True Let m(a) = 7a2 + 37a - 23. Does 37 divide m(-29)? False Let x be -1(3 - (-3 + 13)). Let z(g) = g3 - 6g*2 - 7g + 2. Let u be z(x). Suppose a - 37 = -3w, ua + 8 = 2w - 14. Does 4 divide w? True Let t be 2-5(-9)/((-225)/(-1940)). Suppose -5n = -3a - 1264 + 331, 4n + 5a = t. Does 16 divide n? False Let r(z) be the third derivative of -23z*4/24 + 47z*3/3 - 7z*2 - 2. Is 36 a factor of r(-10)? True Let j = 17 - 2. Suppose -5 = -2x + 4s - j, -2x + 5s - 13 = 0. Suppose -q - x = -41. Does 8 divide q? True Let k(r) = r3 - 12r*2 + 21r + 11. Let i be k(10). Is 11 a factor of 37420/i + 20/14707? True Let v(w) = -6w - 12. Let g be v(4). Let d = 71 - g. Is d a multiple of 14? False Suppose -3j = 3x - 17019, -2x - 15j = -10j - 11361. Is x a multiple of 29? False Let n(j) = 41j3 + j2 + 234j - 26. Does 49 divide n(11)? False Let i(a) = 3a*2 + 61a - 147. Let l be i(-27). Let k = l + -383. Does 8 divide k? False Let y(l) = 230l2 - 5l - 284. Does 44 divide y(-8)? True Suppose -3i + 3p = -0p + 72, -5p = 2i + 27. Let t be (2 + i/9)-6. Suppose 0 = ty + y - 2z - 114, 2z + 76 = 2y. Does 13 divide y? False Let m = 299 + -122. Let d = -133 + m. Is d a multiple of 22? True Let l = 36769 + -21402. Is 11 a factor of l? True Does 10 divide (-5 + -2)(-174120)/140? False Does 195 divide ((-1864)/12)/((-242)/99825)? False Let j(q) = -4q*2 - 5q + 1. Let n be j(8). Does 25 divide (2 + -1 - n)(-1 - -2)? False Suppose 0 = -3b + 27 + 285. Suppose 4i - 126 - b = -n, 5n = -10. Is i a multiple of 2? True Suppose -4128 = -37q + 29q. Let j = 980 - q. Is j a multiple of 45? False Let r(f) = f*3 - 22f*2 - 19f - 9. Let t = 30 - 7. Let p be r(t). Let c = 143 - p. Is 10 a factor of c? True Is (-12 - (-84)/18)-732 a multiple of 44? True Let r = -387 - -396. Suppose -2181 = -rd + 7269. Does 21 divide d? True Let z(p) = -30p + 8. Let q = -19 - -36. Let c = -20 + q. Is z(c) a multiple of 22? False Suppose 8o - 4786 = 2h - 51208, 3o = -3h + 69753. Is h a multiple of 87? False Let b(m) = 538m*2 + 791m - 6267. Is b(8) a multiple of 13? False Suppose 1857 = 4h + 3i - 17563, 0 = 5h + 2i - 24275. Is 117 a factor of h? False Let c = 6301 - 5160. Is 18 a factor of c? False Is 202/1919 + 6876/19 a multiple of 8? False Let x(j) = j + 23. Let h(l) = -l*3 + 4l*2 + 12l - 2. Let b be h(6). Let v be 7/(-21) + (b - 74/(-6)). Does 6 divide x(v)? False Suppose -14k - 11k + 1396626 = 41*k. Is 26 a factor of k? False Does 96 divide 108/((54/(-3645))/(8/(-10)))? False Let p = 5919 - -824. Is 67 a fac	{ "pile_set_name": "DM Mathematics" }
t replacement from {m: 2, i: 4, e: 3}. What is prob of sequence eme? 1/42 Calculate prob of sequence ss when two letters picked without replacement from {s: 2, w: 4, t: 2}. 1/28 What is prob of sequence ve when two letters picked without replacement from vvehyyvv? 1/14 What is prob of sequence bg when two letters picked without replacement from guiuciubguzuubuug? 3/136 What is prob of sequence zezl when four letters picked without replacement from {z: 6, e: 2, l: 10}? 5/612 Four letters picked without replacement from {m: 6, p: 2, h: 7, c: 2, s: 1}. What is prob of sequence cpcm? 1/3060 Three letters picked without replacement from kkfffkikikfkfkff. What is prob of sequence ffi? 1/40 Calculate prob of sequence gdd when three letters picked without replacement from gdbkdgxk. 1/84 Calculate prob of sequence te when two letters picked without replacement from {j: 2, e: 1, w: 1, t: 2, l: 1}. 1/21 Two letters picked without replacement from {d: 3, j: 9, i: 2, y: 2}. Give prob of sequence yy. 1/120 Four letters picked without replacement from {j: 4, m: 2, s: 2, w: 7, b: 2}. Give prob of sequence sbbj. 1/3570 What is prob of sequence jj when two letters picked without replacement from kjjkkkkj? 3/28 Calculate prob of sequence hhh when three letters picked without replacement from {h: 5}. 1 What is prob of sequence sg when two letters picked without replacement from {f: 3, y: 2, s: 1, g: 1}? 1/42 Calculate prob of sequence is when two letters picked without replacement from ipjpjgpgsggs. 1/66 Calculate prob of sequence xbx when three letters picked without replacement from {b: 1, x: 2, c: 1}. 1/12 What is prob of sequence ww when two letters picked without replacement from wcwcwwwwwwwccwwwwc? 26/51 What is prob of sequence ttou when four letters picked without replacement from {u: 2, o: 3, j: 1, v: 1, r: 1, t: 4}? 1/165 Calculate prob of sequence vvy when three letters picked without replacement from {f: 6, x: 2, v: 9, y: 1}. 1/68 What is prob of sequence saaw when four letters picked without replacement from {a: 3, w: 3, s: 6, y: 6}? 1/680 Three letters picked without replacement from {h: 1, z: 3, b: 3, d: 1, m: 11}. What is prob of sequence bdm? 11/1938 Calculate prob of sequence eze when three letters picked without replacement from {y: 5, e: 4, z: 5}. 5/182 Three letters picked without replacement from ruuktkuxuuruuuuuuyru. Give prob of sequence kku. 1/285 Four letters picked without replacement from {z: 5, o: 9}. Give prob of sequence ozoz. 60/1001 Four letters picked without replacement from {f: 10}. What is prob of sequence ffff? 1 What is prob of sequence bb when two letters picked without replacement from kkkkbkbkkkb? 3/55 Calculate prob of sequence pp when two letters picked without replacement from {q: 2, p: 4}. 2/5 Three letters picked without replacement from xqxwxoqxo. What is prob of sequence owx? 1/63 Two letters picked without replacement from {o: 2, i: 4}. What is prob of sequence oo? 1/15 What is prob of sequence qcc when three letters picked without replacement from cqqccqccqcccccqc? 55/336 What is prob of sequence ioi when three letters picked without replacement from mmmommmymiiommmm? 1/840 Calculate prob of sequence qoq when three letters picked without replacement from {q: 2, z: 1, o: 1}. 1/12 Calculate prob of sequence lj when two letters picked without replacement from {j: 4, e: 4, n: 4, x: 5, l: 1, i: 2}. 1/95 Three letters picked without replacement from kwkwwkkkkkkkkkwwwk. What is prob of sequence kkk? 55/204 Two letters picked without replacement from {i: 3, r: 5, e: 1, j: 1, h: 1}. Give prob of sequence ji. 3/110 Three letters picked without replacement from {k: 2, a: 5, g: 4}. What is prob of sequence aag? 8/99 What is prob of sequence mmm when three letters picked without replacement from {m: 5}? 1 Three letters picked without replacement from mjwhjjrpppw. What is prob of sequence jwm? 1/165 Three letters picked without replacement from {e: 4, y: 2}. What is prob of sequence eey? 1/5 What is prob of sequence rq when two letters picked without replacement from {e: 10, r: 1, y: 4, q: 2}? 1/136 What is prob of sequence in when two letters picked without replacement from eheerenhiehq? 1/132 Calculate prob of sequence kz when two letters picked without replacement from zxkkauxaakzkaa. 4/91 What is prob of sequence uzuu when four letters picked without replacement from {u: 1, k: 3, z: 1}? 0 Two letters picked without replacement from lslzylsllllllll. Give prob of sequence lz. 11/210 Two letters picked without replacement from {c: 10, w: 2, u: 1, d: 1, x: 5, y: 1}. Give prob of sequence ud. 1/380 Two letters picked without replacement from {p: 1, w: 1, s: 6, x: 4, j: 4}. What is prob of sequence ws? 1/40 What is prob of sequence hp when two letters picked without replacement from {f: 2, o: 2, p: 6, h: 8}? 8/51 Two letters picked without replacement from {t: 1, n: 5, g: 2, u: 3, m: 1}. Give prob of sequence tm. 1/132 Three letters picked without replacement from vbrvvvbbr. What is prob of sequence bbb? 1/84 Four letters picked without replacement from {p: 3, q: 5, y: 1, t: 3}. Give prob of sequence tptq. 1/132 What is prob of sequence oxh when three letters picked without replacement from {n: 2, o: 5, h: 11, x: 1}? 55/5814 Four letters picked without replacement from cvccvpqccsqqcp. Give prob of sequence qqsp. 1/2002 What is prob of sequence fpr when three letters picked without replacement from {r: 1, f: 2, p: 1}? 1/12 Three letters picked without replacement from {r: 2, a: 2, b: 2}. Give prob of sequence bra. 1/15 Calculate prob of sequence lil when three letters picked without replacement from kllkikklk. 1/84 Calculate prob of sequence qu when two letters picked without replacement from pkpqukunujjuuuk. 1/35 Three letters picked without replacement from {i: 2, r: 3, y: 10}. Give prob of sequence irr. 2/455 Two letters picked without replacement from {x: 8, u: 5}. What is prob of sequence uu? 5/39 Two letters picked without replacement from batautotaaaoaabotlao. What is prob of sequence ub? 1/190 Calculate prob of sequence ffu when three letters picked without replacement from {q: 4, u: 8, f: 4}. 1/35 Calculate prob of sequence gg when two letters picked without replacement from {m: 3, g: 6, x: 4}. 5/26 Four letters picked without replacement from pxxpxxprpxrxprpsp. Give prob of sequence xxpx. 1/68 Two letters picked without replacement from ibbtbbsj. Give prob of sequence bj. 1/14 Two letters picked without replacement from {h: 4}. What is prob of sequence hh? 1 What is prob of sequence gyt when three letters picked without replacement from {t: 1, e: 1, o: 2, m: 4, g: 1, y: 3}? 1/440 Four letters picked without replacement from {b: 4, p: 3}. Give prob of sequence bppp. 1/35 What is prob of sequence lql when three letters picked without replacement from qqqqlqqqqqlq? 1/66 What is prob of sequence dgd when three letters picked without replacement from {g: 3, h: 5, d: 3}? 1/55 What is prob of sequence es when two letters picked without replacement from {s: 2, g: 2, e: 1}? 1/10 Three letters picked without replacement from hhcchdhhcchhphh. Give prob of sequence pcc. 2/455 Two letters picked without replacement from {a: 1, j: 2, r: 1}. Give prob of sequence rj. 1/6 Calculate prob of sequence wwff when four letters picked without replacement from wfwff. 1/10 Four letters picked without replacement from rreeuuurerr. What is prob of sequence ueer? 1/88 Two letters picked without replacement from {f: 8, h: 5}. Give prob of sequence hf. 10/39 Two letters picked without replacement from bobzrorbbozrbrrbi. What is prob of sequence ro? 15/272 Two letters picked without replacement from {q: 4, j: 3, f: 1, g: 2, b: 2}. What is prob of sequence bf? 1/66 What is prob of sequence cv when two letters picked without replacement from zccvv? 1/5 Four letters picked without replacement from sylvvyyssyoosy. What is prob of sequence sylo? 5/3003 Four letters picked without replacement from {d: 5, y: 1, w: 1, r: 3, m: 2}. Give prob of sequence yymr. 0 Three letters picked without replacement from {n: 8, a: 1, p: 1, h: 1, d: 1, z: 2}. What is prob of sequence hzz? 1/1092 What is prob of sequence jt when two letters picked without replacement fro	{ "pile_set_name": "DM Mathematics" }
- 3. What is the remainder when x(-2) is divided by 24? 21 Suppose -5h - 4 + 19 = 0, 3h = 5f - 1. Let v = -8 + 5. Calculate the remainder when (4/v)/(3/(-9)) is divided by f. 0 Let a(n) = -n2 + 25n + 12. Calculate the remainder when a(7) is divided by 29. 22 Suppose -g + 42 + 33 = 3b, -4b - 4g + 108 = 0. Let d = 161 + -67. What is the remainder when d is divided by b? 22 Suppose -3y = 2i - 5, -4y = -i + y + 22. What is the remainder when 3/7 + 4(-179)/(-28) is divided by i? 5 Let w(g) = 9g*2 - g + 1. Suppose -5s + 2s + 6 = 0. Suppose 2 = 4x - s. Calculate the remainder when 17 is divided by w(x). 8 Let w(o) = o3 + o2 + 1. Let c be 0-21/(-4). Let g be w(c). Let d(f) = 11f2 + f. What is the remainder when 34 is divided by d(g)? 10 Suppose -b - b + 12 = 0. Let n(m) = m + 2. Let c(z) = -4z - 1. Calculate the remainder when n(b) is divided by c(-1). 2 Suppose -3t = -l + 47, 5l = 3t - 0l + 31. Let x = 19 + t. What is the remainder when 5 is divided by x? 1 Let c = -14 - -16. Let f(w) = -6w - 4. Calculate the remainder when f(-6) is divided by 43/4 - c/(-8). 10 Let b(c) = c - 1. Let g be b(2). Suppose o - g = 1. What is the remainder when ((-4)/(-6))/(2/6) is divided by o? 0 Let f(u) = 2u + 1. Let b(j) = j + 1. Let q(r) = 3b(r) - 2f(r). Calculate the remainder when 10 is divided by q(-2). 1 Calculate the remainder when (-6)/(-4) + (-23)/(-2) is divided by 3. 1 Suppose 2h - 5x = 3h - 48, -3x = 4h - 124. What is the remainder when h is divided by 15? 13 Let x = 0 + 2. Suppose 0 = -2t - xt + 16. Suppose to - 32 = 24. What is the remainder when o is divided by 5? 4 Let o(c) = -c*2 - 26c - 6. What is the remainder when o(-11) is divided by 32? 31 Suppose 0 = -2p + 2 + 2. Suppose -po - 82 = -4o. What is the remainder when o is divided by 14? 13 Suppose -9 = y + 5. What is the remainder when 13 is divided by (y/21)/((-2)/21)? 6 Suppose -5i + 5b = -60, 0i = 3i + 3b - 30. Let f be (-2)/(-9) + (-152)/36. Let q = f - -34. What is the remainder when q is divided by i? 8 Suppose 35 - 154 = -7f. What is the remainder when f is divided by 3? 2 Let s = 30 - -8. Calculate the remainder when 227 is divided by s. 37 Suppose -7 - 29 = -2m. Suppose -m = s - 4s. What is the remainder when 17 is divided by s? 5 Suppose a - 5a + 30 = 2p, -4p + 90 = 2a. Calculate the remainder when 73 is divided by p. 23 Let a = 10 - 5. Suppose 0 = k - 3f + 37, -2k - 68 = -af + 8. Let l = k - -63. What is the remainder when 58 is divided by l? 18 Suppose -4v = -62 - 14. Suppose -25 = -4r - r. What is the remainder when v is divided by r? 4 Let p = 21 - -40. Let n = -42 + p. Calculate the remainder when n is divided by -14(-3)/61. 5 Suppose b - 2g + 18 = g, -4b = 4g - 8. Let r(h) = 2h*2 - 4. Let i be r(b). Calculate the remainder when 30 is divided by i/1 - -12. 14 Suppose -2 = -a + 10. What is the remainder when 19 is divided by a? 7 Suppose 4h - h - 9 = 0. Let d be h + -2 + (-3)/(-3). What is the remainder when d18/84 is divided by 10? 8 Suppose 0 = 4i + 5l - 182, i + 2l - 47 = -0l. What is the remainder when i is divided by 11? 10 What is the remainder when 109 is divided by ((-4)/(-6))/((-12)/(-666))? 35 Suppose -3m - 2n + 6n + 47 = 0, -4n + 4 = 0. What is the remainder when 185 is divided by m? 15 Let g = 8 + -13. Let v = -5 - g. Suppose -3c + vc = -27. Calculate the remainder when c is divided by 4. 1 Let p be 3/(-4) + 42/24. Calculate the remainder when 3 + (40 - (0 + p)) is divided by 15. 12 Suppose -v + 1 = -2l, 0 = -l + 5l + 12. What is the remainder when (-5)/(16/v + 3) is divided by (4/2 + -3)-13? 12 What is the remainder when (-12)/8112/(-3) is divided by 29? 27 Let x(k) = 2k*2 - 5k. Let g be x(5). Let c = 81 + g. Suppose -4b + 90 = -c. What is the remainder when b is divided by 13? 10 Let i be 47 - 2/(2/(-3)). Suppose i = 2p + 8. Calculate the remainder when 62 is divided by p. 20 Let x = 127 - 95. Calculate the remainder when 63 is divided by x. 31 Let c(a) = -4a2 - 5a - 4. Let j be c(-3). What is the remainder when (-120)/j + (-2)/(-10) is divided by 4? 1 Let n be 1 + 1 - 26-1. Suppose -2t - 21 + 3 = -4l, 4l - 4t - n = 0. Let a(c) = 2c*2 - 2c - 2. Calculate the remainder when 4 is divided by a(l). 0 Let y(o) = -o + 1. Let g(r) = -r*2 + 2r + 2. What is the remainder when y(-1) is divided by g(2)? 0 Let u be -8(-3)/(-2 + -1). Let a(r) = r3 + 8r*2 - 6r - 10. Let o be a(u). Let v = -26 + o. Calculate the remainder when v is divided by 5. 2 Suppose -9 + 3 = -3w. What is the remainder when 7 is divided by w? 1 Let q = 178 - 93. Suppose -5k = -0k - q. What is the remainder when 49 is divided by k? 15 Let z(r) = r2 - 3r + 4. What is the remainder when (-50)/(-15)(-114)/(-4) is divided by z(7)? 31 Let v = -63 - -138. What is the remainder when v is divided by 20? 15 Let s = 18 - 8. What is the remainder when 37 is divided by s? 7 Suppose -5n = 5p - 1050, -7n - 5p = -8n + 234. Calculate the remainder when n is divided by 43. 42 Suppose -2d = 5o - 17, 3o - 5d - 1 = 3. Calculate the remainder when 5 is divided by o. 2 Let c(o) = o*2 + 8o - 6. Let z be c(-9). Suppose -2y = zy - 15. What is the remainder when (4 + -51)(2 - y) is divided by 24? 23 Let z(j) = j3 - 6j*2 + 9j. Let a be z(6). Suppose 4f = a + 2. What is the remainder when 27 is divided by f? 13 Let m be 2/(-8) - (-2)/8. Suppose 2c = 0, 2y - 5c - 15 - 93 = m. Let w = -15 + y. Calculate the remainder when w is divided by 10. 9 Let r(f) = -42f + 2. Let t be r(-2). Suppose 0 = 5h + 1 - t. Calculate the remainder when 49 is divided by h. 15 Let s = 7 - 10. Suppose 7b + 9 = 4b, -2b - 66 = -3k. What is the remainder when 34 is divided by -3 + (-2 - s) + k? 16 Let r(g) = g + 23. What is the remainder when r(-9) is divided by 3? 2 Suppose -5r + 4 = -4r. Calculate the remainder when 16 is divided by r. 0 Suppose 0 = 26c - 23c - 63. What is the remainder when c is divided by 11? 10 Suppose 0l = -2l + 4. Suppose o = -2y - ly + 121, 0 = -o - 3. What is the remainder when y is divided by 8? 7 Let a = 84 - 75. Let m(x) = -3x + 4. Let u be m(-4). Suppose h - 2h = -u. Calculate the remainder when h is divided by a. 7 Calculate the remainder when 5(-3)/((-6)/16) is divided by (1/(-2))/(2/(-56)1). 12 Suppose -6t - 45 = -11t. Calculate the remainder when 13 is divided by t. 4 Suppose -2o - 3q + 0q = -15, 0 = -o - q + 8. What is the remainder when 25 is divided by o? 7 Suppose -258 = -3g + 3l, -g - 4g + 430 = -l. What is the remainder when g is divided by 45? 41 Let o = 2 + -1. Let d(x) be the second derivative of 2x3 + x2/2 - 4x. What is the remainder when 24 is divided by d(o)? 11 Let l = 7 + 20. Let c = l - 11. Let v = 30 - -17. What is the remainder when v is divided by c? 15 Let z(p) = -2p2 + 3p. Let f be z(3). Let j = f + 33. What is the remainder when 95 is divided by j? 23 Let x = -6 + 9. Suppose -2l = xv - v - 190, 3v = -12. Calculate the remainder when l is divided by 25. 24 Let k = 32 - 19. Calculate the remainder when k is divided by (-69)/(-9) - 2/(-6). 5 Suppose 30 = n + 3m, 3n + 3m - 70 = -2m. What is the remainder when n is divided by 6? 3 Let b be (-52 - -2)(-40)/25. Let g = b - 46. Suppose -6q = -q + 3p - 262, 4p = q - g. Calculate the remainder when q is divided by 17. 16 Let b = 49 + -17. Let l = b - 21. Calculate the remainder when 32 is divided by l. 10 Suppose -2p + 4i - 5i = 5, 3p + 3i + 15 = 0. Calculate the remainder when p + 6 + (0 - 0) is divided by 4. 2 Let s(l) = 2l2 + 2l - 1. What is the remainder when s(1) is divided by 1? 0 Suppose 12n = 7n + 50. Calculate the remainder when 28 is divided by n. 8 Let g(q) = 9q - 10. What is the remainder when g(4) is divided by 14? 12 Let v = -18 + 28. What is the remainder when 26 is divided by v? 6 Suppose 0 = 3s - 18 + 6. What is the remainder when 10 is divided by (s/3)/(2/6)? 2 Suppose -3o + 452 = -9v + 4v, 0 = 2v - 5o + 196. Let m = 133 + v. What is the remainder when m is divided by 12? 9 Suppose 8b - 27 = 5b. What is the remainder when 41 is divided by 7-6(-3)/b? 13 Let w = 26 - 11. Suppose 0 = -3n + w. What is the remainder when n is divided by 2? 1 Let j =	{ "pile_set_name": "DM Mathematics" }
Determine n, given that n*5 - 1413n*4 - 4245n*3 - 4247n*2 - 1416n = 0. -1, 0, 1416 Factor -4n3/7 + 172n*2 - 4764n/7 + 3564/7. -4(n - 297)(n - 3)(n - 1)/7 Factor 3f*2/2 + 63867f/8 + 7983/4. 3(f + 5322)(4f + 1)/8 Factor 3o*2/5 - 18687o + 93420. 3(o - 31140)(o - 5)/5 Factor -51l2 + 510414l - 60048. -3(l - 10008)(17l - 2) Factor 2z*3 - 3164z*2 + 68882z - 377520. 2(z - 1560)(z - 11)*2 Factor -16680o*4 + 16676o*3 + 4o*2. -4o*2(o - 1)(4170o + 1) Factor -d*2 + 278d + 1128. -(d - 282)(d + 4) Factor 2x*5/13 - 976x*4/13 - 9910x*3/13 - 24900x*2/13. 2x*2(x - 498)(x + 5)2/13 Factor -2k*2/3 + 193900k/3 - 4699651250/3. -2(k - 48475)2/3 Determine u so that -35u*5 + 5295u*4 - 11835u*3 - 12695u*2 + 4470u = 0. -1, 0, 2/7, 3, 149 Let 2j2/9 + 3658j/9 - 18340/9 = 0. What is j? -1834, 5 Find m, given that -5m2 - 6070m + 79755 = 0. -1227, 13 Find j, given that 4j5 + 3246j*4 - 204751j*3/4 + 71297j*2 - 105015j/4 + 5789/2 = 0. -827, 1/4, 1, 14 Factor 4p3/3 + 1088p*2/3 + 76112p/3 + 287296/3. 4(p + 4)(p + 134)2/3 Factor v4/4 + 159v3/4 + 297v*2 - 755v. v(v - 2)(v + 10)(v + 151)/4 Find b, given that -2b*5 - 732b*4 - 67682b*3 - 124464b*2 + 737464b + 794976 = 0. -182, -4, -1, 3 Factor -y*2/3 - 34256y - 880105152. -(y + 51384)*2/3 Factor 4a*2 + 32136a + 64545156. 4(a + 4017)2 Factor 4v*2 - 540v + 11664. 4(v - 108)(v - 27) Solve -4l2 - 72l + 76 = 0 for l. -19, 1 Solve -3n5 - 3546n*4 + 28494n*3 - 78468n*2 + 85653n - 32130 = 0 for n. -1190, 1, 3 Factor 8c3 - 321c*2 + 1836c + 24300. (c - 18)(c + 6)(8c - 225) Find g such that -4g*4 + 1136g*3 - 9980g*2 + 22048g - 13200 = 0. 1, 2, 6, 275 Factor -g*3/4 + 185g*2/4 + 162g - 21483. -(g - 186)(g - 21)(g + 22)/4 Factor -158a2/7 - 356a/7 - 80/7. -2(a + 2)(79a + 20)/7 Determine d, given that -3d*3 + 1002d*2 - 6813d - 17658 = 0. -2, 9, 327 Factor w*3 - 16w*2 - 715w - 4598. (w - 38)(w + 11)2 Find q, given that 16q*2/5 - 13766q/5 - 1722 = 0. -5/8, 861 What is n in -1670n4/7 + 3348n*3/7 - 1686n*2/7 + 8n/7 = 0? 0, 4/835, 1 Find v such that -2v5/3 - 16v*4 - 254v*3/3 - 80v*2 + 544v/3 = 0. -17, -4, 0, 1 Factor 2v3 + 63726v*2 + 63720v - 127448. 2(v - 1)(v + 2)(v + 31862) Factor 5o*3 + 14405o*2 - 115560o. 5o(o - 8)(o + 2889) Determine z so that z3/8 + 10z*2 - 19241z/8 - 2415 = 0. -184, -1, 105 What is f in -f*3/4 - 113f*2/2 - 4967f/4 - 12019/2 = 0? -202, -17, -7 Suppose j*4 - 49j*3 - 103j*2 + 49j + 102 = 0. What is j? -2, -1, 1, 51 Factor 5n5/2 - 5n*4 - 415n*3/2 + 210n*2 + 4410n. 5n(n - 7)*2(n + 6)2/2 What is i in i4/8 - 5i3/8 - 73i*2/8 + 245i/8 + 147 = 0? -7, -3, 7, 8 Suppose -6r3/7 - 170r*2/7 - 484r/7 + 400/7 = 0. What is r? -25, -4, 2/3 Solve -4j4 - 142020j*3 - 568036j*2 - 710028j - 284008 = 0. -35501, -2, -1 Factor -2m4 - 121m*3 - 1606m*2 + 6784m - 6144. -(m - 2)(m + 32)2(2m - 3) Let 4s*3 + 100768s*2 - 201548s + 100776 = 0. Calculate s. -25194, 1 Suppose -z*3/5 + 2606z*2/5 + 44591z/5 = 0. Calculate z. -17, 0, 2623 Suppose -3m3 - 214791m*2 - 3844705200m - 3844490412 = 0. What is m? -35798, -1 Factor -4k3/3 + 52130k*2/3 + 26066k/3. -2k(k - 13033)(2k + 1)/3 Let -8d5/7 - 578d*4/7 - 1256d*3/7 + 298d*2/7 + 1264d/7 + 40 = 0. What is d? -70, -2, -1, -1/4, 1 Factor -4u4 - 1284u*3 - 19520u*2. -4u*2(u + 16)(u + 305) Let -3q*3 - 13599q*2 + 54432q - 54444 = 0. Calculate q. -4537, 2 Solve 2i2/25 - 15552i/25 + 124288/25 = 0. 8, 7768 Find q such that 5q4 - 2370730q*3 + 374687554500q*2 - 19738790137475000q - 78961155702500000 = 0. -4, 158050 Factor v*2/8 - 4v + 15/2. (v - 30)(v - 2)/8 Determine y, given that -2y*2/3 - 3895936y/3 - 1897289664512/3 = 0. -973984 Suppose 4j3 + 356j*2 + 700j + 348 = 0. Calculate j. -87, -1 Solve -2a5/5 + 32a*4 + 17388a*3/5 + 448592a*2/5 + 3625766a/5 = 0. -23, 0, 149 Suppose -24n2/5 + 202n/5 + 126/5 = 0. Calculate n. -7/12, 9 Factor 2z2/3 + 3700z/3 - 14896. 2(z - 12)(z + 1862)/3 Factor 3u3 + 141u*2 - 600u + 612. 3(u - 2)2(u + 51) Factor -2q3/13 - 70q*2/13 - 684q/13 - 2016/13. -2(q + 6)(q + 8)(q + 21)/13 Determine k, given that 3k*3 + 36k*2 - 189k - 810 = 0. -15, -3, 6 Factor 3o4 - 17856o*3 + 26551866o*2 + 53157312o + 26587587. 3(o - 2977)2(o + 1)*2 Factor -4p*3 + 556992p*2 + 1113996p + 557000. -4(p - 139250)(p + 1)*2 Find a such that -49a*3 + 2919a*2 - 1656a + 236 = 0. 2/7, 59 Solve r*5 + 10r*4 - 101r*3 - 542r*2 + 1792r + 7840 = 0 for r. -14, -4, 5, 7 Determine u so that 2u2/17 + 1192u/17 - 340554/17 = 0. -807, 211 Suppose 45d2 + 24085d + 166390 = 0. What is d? -4754/9, -7 What is k in -24642k4/5 + 5361744k*3 + 1932256k*2/5 + 34816k/5 = 0? -4/111, 0, 1088 Factor -4t3 - 10068t*2 - 7293852t - 1156496076. -4(t + 219)(t + 1149)*2 Find v such that -2v*2/7 - 232v/7 - 810 = 0. -81, -35 Factor y*3/6 + 58103y*2/3 + 38735y/2. y(y + 1)(y + 116205)/6 Factor -3w2/5 - 207912w/5 - 3602283312/5. -3(w + 34652)2/5 Find a, given that 2a*5/7 - 1074a*4/7 + 62172a*3/7 = 0. 0, 66, 471 Factor 2w*2/3 + 36w - 6048. 2(w - 72)(w + 126)/3 Suppose -32s5/3 - 1328s*4 - 1958s*3 + 3686s*2/3 - 164s = 0. What is s? -123, -2, 0, 1/4 Solve a*5/6 + 35a*4 + 5512a*3/3 - 35a*2 - 3675a/2 = 0 for a. -105, -1, 0, 1 Solve 11250t5/7 - 281850t*4/7 - 277492t*3/7 + 2200t*2 - 208t/7 = 0. -1, 0, 2/75, 26 Suppose 3j5/7 + 237j*4/7 - 3723j*3/7 + 16767j*2/7 - 23328j/7 + 10044/7 = 0. Calculate j. -93, 1, 6 Factor -2x2 - 16140x. -2x(x + 8070) What is k in 4k2 - 423568k + 1694208 = 0? 4, 105888 Factor 343u4/8 - 16678571u*3/4 - 7148001u*2/2 - 1021145u - 97252. (u - 97252)(7u + 2)3/8 What is q in -q3 - 8598q2 - 18489996q - 36945608 = 0? -4298, -2 Find n such that 4n3/5 - 156n*2/5 - 2756n + 13932/5 = 0. -43, 1, 81 Solve -3y3 + 9630y*2 - 7728075y = 0 for y. 0, 1605 Determine v, given that -20v3/7 + 512v*2/7 + 1948v/7 + 696/7 = 0. -3, -2/5, 29 Factor z*4/6 + 145z*3/6 + 1339z*2/6 - 495z/2. z(z - 1)(z + 11)(z + 135)/6 Factor 28k*3 - 4516k*2 - 230608k + 66256. 4(k - 202)(k + 41)(7k - 2) Factor 5404i2 + 37776i - 364. 4(i + 7)(1351i - 13) Factor -3n*2 + 723n - 34650. -3(n - 175)(n - 66) Factor 5l3/6 - 13295l*2/6 + 8817875l/6 + 8857805/2. 5(l - 1331)2(l + 3)/6 Solve 4s5 + 16s*4 - 5164s*3 - 121576s*2 - 958080s - 2217600 = 0 for s. -15, -14, -4, 44 Solve -h*2/6 + 1346h/3 - 1792 = 0. 4, 2688 Factor -6m3 + 1239m*2 - 1839m - 1230. -3(m - 205)(m - 2)(2m + 1) Solve -4y5 - 227y*4 - 363y*3 + 1229y*2 + 1039y - 330 = 0 for y. -55, -3, -1, 1/4, 2 Find t such that -2t3/9 - 408274t*2/9 - 2315083694t + 2315129058 = 0. -102069, 1 Factor -2n3 - 442n*2 + 4280n + 32200. -2(n - 14)(n + 5)(n + 230) Factor t3 - 2347t*2 - 14109t - 21177. (t - 2353)(t + 3)2 Suppose -4p*2 + 12586312p - 9900953110084 = 0. What is p? 1573289 Determine j so that -3j3 + 64350j*2 - 345141216j + 690025056 = 0. 2, 10724 Find p, given that -p*5 + 20p*4 + 231p*3 + 826p*2 + 1252p + 696 = 0. -3, -2, 29 Factor m*2/3 + 1586m. m(m + 4758)/3 Factor -l4 - 4002l*3 - 5346648l*2 - 2395202400l - 14179598208. -(l + 6)(l + 1332)3 Factor -5d*5 + 6215d*4 - 18615d*3 + 18605d*2 - 6200d. -5d(d - 1240)(d - 1)3 Find m, given that 2m*4/7 + 39m*3/7 + 136m*2/7 + 3m/7 - 180/7 = 0. -15, -4, -3/2, 1 Determine a so that 2a2/13 - 6814a/13 + 524 = 0. 1, 3406 Factor 2a3 - 4474a*2 + 141240a - 264600. 2(a - 2205)(a - 30)(a - 2) Let -i3 + 61i*2 + 74i - 744 = 0. Calculate i. -4, 3, 62 Factor -3u4 + 439392u*3 - 878772u*2. -3u*2(u - 146462)(u - 2) Suppose 3l*4/4 - 1158l*3 + 843939l*2/2 + 97181532l - 229185289377/4 = 0. Calculate l. -319, 621 Factor -2w2 + 116120w + 232248. -2(w - 58062)(w + 2) Factor -2o2/7 - 208o + 23808/7. -2(o - 16)(o + 744)/7 Determine f, given that -f*4 - 5853f*3/2 - 4260175f**2/2 + 32	{ "pile_set_name": "DM Mathematics" }
-q. Let h(o) = 3o - 1744. Let j(m) = m - 19. Let z(f) = h(f) - j(f). Determine z(x(s)). -2s - 1725 Let o(y) be the second derivative of -y*4/12 + 24y - 1794. Let j(v) = -5 - v + 61 - v. Give o(j(z)). -4z2 + 224z - 3136 Let w(n) = 3 + 18130450n - 18130450n + 51n2. Let m(b) = -8b*2. Calculate m(w(q)). -20808q*4 - 2448q*2 - 72 Let m(s) = 26073481s*2. Let o(b) = -2b*2. What is m(o(t))? 104293924t*4 Let n(r) = -2r + 57414637. Let d(m) = 2m2. Calculate n(d(o)). -4o*2 + 57414637 Let p(u) = -7u. Let l(y) = -794y + 851y - 4 + 4. What is p(l(k))? -399k Let k(l) be the second derivative of 17l*4/6 - 942l. Let n(v) be the second derivative of -v*3/3 - 2v. Calculate k(n(g)). 136g2 Let j = 572 + -162. Suppose j = 5t - 5r + 2r, r - 246 = -3t. Let w(c) = -33c - 24c + tc. Let h(z) = 2z2. Give w(h(a)). 50a2 Let x(n) = -n2. Let j(d) = 2d - 131425051. Determine j(x(g)). -2g*2 - 131425051 Let w(v) = 5102v + 15. Let s(f) = 8f + 3. Determine w(s(d)). 40816d + 15321 Let m be 36/27(-2)/(4/(-3)). Let h(y) = -my*2 - 234 + 234. Let d(o) = -49o. Give d(h(r)). 98r2 Let s(w) = 28w*2 + 10 - 82w*2 - 19w*2 + 28w*2 + 44w2. Let q(g) be the second derivative of g4/6 + g. Give q(s(d)). 2d4 - 40d*2 + 200 Let x(g) = 4812g*2. Let d(v) = -2v*2 - 329. Determine d(x(b)). -46310688b*4 - 329 Let u(s) = -689s + 329s + 356s. Let f(g) = -122g2. Determine u(f(o)). 488o*2 Let a(k) = 17k - 2. Let z(y) = 59y - 7. Let p(h) = 7a(h) - 2z(h). Let q(o) = 526o*2. Give q(p(j)). 526j*2 Let g(w) = 1836w. Let v(s) = 5s2 + 4s - 12. Let n(a) = -6a2 - 5a + 15. Let f(r) = 4n(r) + 5v(r). Calculate f(g(j)). 3370896j2 Let x(c) = -c + 1552909. Let v(j) = -8j. Calculate x(v(m)). 8m + 1552909 Let n(z) = -2z. Let g(t) be the first derivative of 187t3 + 1452. What is n(g(m))? -1122m*2 Let v(r) = -4r + 2. Let c(f) be the second derivative of -5f3/6 + 3f*2 + 8f + 2. Let w(d) = 4d - 5. Let m(h) = -5c(h) - 6w(h). Give v(m(y)). -4y + 2 Let o be 1 + (4/(-12))/((-1)/3). Let v(r) = r - r + 6r - or. Let b(h) be the third derivative of -5h4/24 - 6h*2. Calculate v(b(m)). -20m Let l(m) = -4m. Let z(u) = -7803635u. What is z(l(n))? 31214540n Let s(h) = 2h*2. Suppose 185u - 189u + 12 = 0. Let z(t) = -10 - 15 + 26 - ut + 2t. Determine z(s(r)). -2r*2 + 1 Let l(u) = 509u*2. Let t(b) = 74b - 35b - 41b. Calculate t(l(d)). -1018d2 Let o be 140/15(-4392)/(-48). Let f(h) = -846h - oh + 1697h. Let s(d) be the first derivative of 2d*3 + 1. What is f(s(b))? -18b2 Let d(t) be the third derivative of -t5/30 - t*2. Let s(a) = -18848 + 11a + 37662 - 18813. What is s(d(k))? -22k2 + 1 Let g(y) = -3y. Suppose 30o - 506o + 754 = -99o. Let c(v) be the second derivative of -2/3v*3 + 0v*o + 0 - 12v. Calculate c(g(t)). 12t Let l = 217 - 215. Let q(o) = 4379o - 4379o + ol. Let p(w) = -156w. Give q(p(t)). 24336t2 Let o(s) = 2. Let y(x) = -7x + 4. Let c = 11 - 9. Let j(n) = cy(n) - 4o(n). Let g(i) = -2i2. Give j(g(d)). 28d*2 Suppose -g = -4f + 715, -431 = -3f + 4g + 89. Let k(l) = fl2 - 3 + 3 - 191l*2. Let r(c) = 9c. What is r(k(o))? -99o2 Let d(s) = 8s*2. Let l be ((-16)/153 - 56/476)(-14 - -8). Let a(u) be the first derivative of -14 + 0u + 0u*2 + lu*3. Determine d(a(c)). 128c*4 Let w(v) = -22v. Let d(g) = -4 - 2g + 2 - 3g*2 + 7g*2 + 0. Let f = 211 - 208. Let q(y) = -5y*2 + 3y + 3. Let x(i) = fd(i) + 2q(i). Calculate w(x(m)). -44m2 Let n(k) = -10k2. Let p(i) be the second derivative of -i3/3 - 2i + 5308. Give p(n(g)). 20g*2 Let f(i) = 218i*2. Suppose -49q + 310 + 229 = 0. Let b(m) = -35m2 + 11m*2 + 11m*2 + qm*2. What is f(b(t))? 872t*4 Let j(z) = 3z. Let d(i) = -75i2 - 103i - 9. Determine d(j(r)). -675r2 - 309r - 9 Let r(k) = -k + k + k2. Let p(b) = -b2 + 5b + 9. Let v(q) = 168q*2 - 770q - 1386. Let h(a) = -924p(a) - 6v(a). Calculate r(h(i)). 7056i4 Let s(a) = -30698a. Let u(j) = -26183j + 2. Calculate u(s(g)). 803765734g + 2 Let m(b) = 2b. Let n(l) be the third derivative of -l4 - 56l*2 - 879 + 879. What is m(n(x))? -48x Let y(j) = -1689j2. Let q(c) = -1057c. Calculate q(y(t)). 1785273t2 Let r(w) = 624w - 1. Let p(y) = 42y2 - 59y. Determine p(r(z)). 16353792z2 - 89232z + 101 Let i(u) = 4791 - 4791 + 3u - 5u*2. Let h(x) = 3x*2 - 2x. Let t(p) = 6h(p) + 4i(p). Let q(k) = -25k2. Determine q(t(g)). -100g*4 Let m(s) = 3024s - 1508s - 2 - 1510s. Let c(t) = 24t. Give m(c(h)). 144h - 2 Let i(q) = 376q - 200q - 2 + 2 - 174q. Let y(d) = 3d*2 + 107d. Give i(y(g)). 6g2 + 214g Let z(m) be the third derivative of 0m3 - 4m*2 + 0m + 0 - 1/8m4. Let q(o) = -10500 + 10500 + 2o. What is z(q(j))? -6j Let v(u) = -296 + 160 - 24u*2 + 136. Let f(g) = -15g. Calculate v(f(h)). -5400h2 Let q(c) = -38c. Let t(r) = -2012r. What is t(q(n))? 76456n Let z(a) = 528a2. Let j(w) be the first derivative of -4w*3/3 + 2316. Calculate j(z(c)). -1115136c*4 Let r(q) = -19q. Let l(o) = 2 + 14o2 - 15o2 - 1 + o3 - 2o3 + 2o. Let h be l(0). Let z(g) = 2 - 1 - 2g2 - h. Give z(r(u)). -722u*2 Let r = -151 - -153. Let u(d) = -36d*2 - 386d + 386d + 9d*r. Let y(f) = 2f. Determine u(y(z)). -108z2 Let f(h) = 3496h - 3496h - 4h*2. Let l(i) = -36i*2 - 16i + 16. Let a(s) = 0s2 + 7s*2 - 3 + 10s - 7s. Let k(q) = 16a(q) + 3l(q). Give f(k(m)). -64m4 Let n(j) = j2 + 6j + 14. Let z(b) = 27b*2 + 54b + 126. Let q(i) = -18n(i) + 2z(i). Let c(v) = -246v2 - 1. Determine q(c(f)). 2178576f*4 + 17712f2 + 36 Let m(k) = k2. Let q(n) be the first derivative of 7n - 1/3n*3 + 0n2 + 47. Calculate q(m(f)). -f4 + 7 Let d be (4/(-8))/((-2)/4). Let l(f) = 2f - 1 + d. Let k(r) = 11r*2 - 6r*2 + 10r - 10r. What is l(k(q))? 10q*2 Let g(o) = 318o*2. Let a(k) = 4k*2 + 4k - 34. Calculate a(g(z)). 404496z4 + 1272z*2 - 34 Let c = -441 - -443. Let t(s) = 0s + cs - s. Let k(p) = -50p*2. What is t(k(w))? -50w*2 Let g(i) = -3658i. Let y(j) = -2j + 6. Let b(m) = -2m + 4. Let x(v) = 3b(v) - 2y(v). Calculate g(x(w)). 7316w Let r(m) = -2129637m*2. Let v(h) = -6h. Give r(v(p)). -76666932p2 Let c(h) = 377h - 195h - 140h. Let i(p) = 53p2. Determine c(i(d)). 2226d*2 Let c(g) = -3g. Let w(y) be the first derivative of 2y3/3 - y2/2 + 277y - 3210. Give c(w(t)). -6t2 + 3t - 831 Let a(c) be the second derivative of -18c4 + c. Let k(n) = -207 + 207 - 129n*2 + 65n*2 + 66n*2. Give a(k(f)). -864f*4 Suppose -11y + 15y - 296 = 0. Let i(g) = yg - 33g - 40g. Let b(a) = -21a - 8a + 5a - a. What is i(b(t))? -25t Let w(h) = -945445h2. Let p(s) = 8s*2. What is p(w(o))? 7150929984200o*4 Let v(l) = 811l*2 - 1. Let x(p) = -91p*2 - 79p*2 + 335p*2 - 80p*2 - 80p*2. Give v(x(m)). 20275m*4 - 1 Let n(x) be the first derivative of -109x5/60 + x2/2 + 7x + 57. Let c(l) be the second derivative of n(l). Let v(f) = 2f. Determine c(v(p)). -436p2 Let z(x) = 23x*2 - 12x*2 + 1225 - 1225. Let l(o) = 222o*2. Calculate l(z(s)). 26862s*4 Let j(f) = -4f - 16261. Let t(a) = -18a. Calculate j(t(d)). 72d - 16261 Let h(q) be the third derivative of q*5/30 + 1632q*2. Let g(y) = 269y + 1. Give g(h(z)). 538z2 + 1 Let f(x) = 3x*2. Let s(j) = 14j*2 + 3. Let w = -96 - -40. Let d(y) = 266y*2 + 56. Let c = 28 - 25. Let o(h) = cd(h) + ws(h). Give o(f(a)). 126a*4 Let b(f) = 2f + 1226818 - 1226818. Let j(c) = -1878c2. Determine b(j(q)). -3756q*2 Let k(a) = 8a. Suppose 0 = -h - 282 + 997. Let f(w) = -hw - 5 + 691w + 5. Calculate f(k(b)). -192b Let x(m) = -309m*2 + 9m - 18. Let b(u) = -137u2 + 4u - 8. Let r(o) = 9b(o) - 4x(o). Let t(w) = 5w + 5 + w2 - 1 - 4. Calculate t(r(s)). 9s*4 + 15s*2 Let g(f) = -31f + 262f - 3f*2 - 231f. Let w(j) = 17j2. What is g(w(q))? -867q*4 Let p(y) = -233927y. Let m(o) = -729o. What is p(m(f))? 170532783f Let z(y) = 2y - 1. Let h(a) = -684a - 70. Let x(p) = -137p - 14. Let q(u) = 3h(u) - 16x(u). Let k(n) = -q(n) - 14z(n). Let j(c) = -c. Calculate k(j(s)). 168*s	{ "pile_set_name": "DM Mathematics" }
+ 7)(-u + u + u))(-1 - 2 + 0) to the form a + mu and give m. -15 Express -l2 - 8l*3 + l + 3l*3 + 4l*3 as cl + s + gl3 + yl*2 and give y. -1 Rearrange ((-1 + 4 - 1)(2 - 3s - 2) - 3s - 1 + 1)(-1 + 1 + 2) to zs + v and give z. -18 Rearrange 0b2 + 6b*2 - 2b*2 + 11b*2 to wb + t + db2 and give d. 15 Express h3 + 4h*4 + 260h - 3 - 258h + 2h*4 as gh*4 + ch + q + yh3 + fh*2 and give c. 2 Rearrange ((3o - 6o + 2o)(-1 + 2 + 1) - 15 + 9o + 15)(-3o + o + o)(-4 + 4 - o2) to the form so*4 + jo*3 + io + f + do2 and give s. 7 Rearrange -18o*4 - 6 + 2o4 + o3 - 2o2 + 17o*4 - 3o + 2 to the form go + mo*4 + jo*2 + lo*3 + v and give l. 1 Express -9y + 12y - 11y*2 - 3y in the form ay + dy*2 + m and give d. -11 Express -n - n + 0n + (n + 6n - 4n)(2 + 2 - 2) + 21 + 8n - 21 in the form o + hn and give h. 12 Express (-2 + 2 + 2p*2)(-2 - 3 + 6) - 5p + 3p - 2p2 + p2 - p2 - 3p*2 - 4p*2 as d + qp + jp2 and give j. -7 Express (1 - s - 1)(1 + 0 + 1) + 799 - 3s - 799 as b + ws and give w. -5 Rearrange 2c + 54c*3 - 2c + c*2 - 51c*3 to sc*3 + g + tc + vc2 and give t. 0 Express 11m - 10m - 5m - 4m in the form g + pm and give p. -8 Rearrange -q*2 - q - 6q*3 + 6q*3 + 2q - 4q3 to the form c + iq + wq3 + pq*2 and give i. 1 Express -4a3 + a4 - 4a + 5a - 2 - 2a - a in the form qa*2 + u + oa + ma3 + na*4 and give u. -2 Rearrange -d - 14d - 6d + d + 2 - 2 + (-2 - 4 + 5)(0d + 3d - 4d) + 0d + 4d - 2d + d - 4d + d + d - d - d to the form rd + p and give r. -20 Rearrange -3x + 8x*2 + 5x + 153x3 - 78x*3 - 80x*3 to ix*3 + dx*2 + jx + b and give i. -5 Rearrange -3 + 15k4 - 76k*3 + 76k*3 + 0k4 - k4 - k4 + (0 + k2 + 0)(k2 + 0 + 0) to the form h + qk + zk2 + xk*4 + yk*3 and give z. 0 Rearrange -33l - 47l + 8l to bl + x and give b. -72 Express 2w + 118w3 - 85w*3 - 82w*3 in the form vw + uw2 + c + dw*3 and give c. 0 Express -4 - 2l*4 + 50l*2 - l + 2l*3 - 26l*2 - 26l*2 in the form fl*4 + ql*2 + il*3 + pl + y and give p. -1 Express (z*2 + 3z*3 - 2z*3 + 13z*3)(-2 - 2 + 3) as rz + kz*3 + dz*2 + b and give r. 0 Rearrange 2h - 2h + h - 1 to ph + q and give p. 1 Express -2p + 10p + p - p as qp + m and give q. 8 Rearrange 7z*3 - 6z3 + z3 - 2 - 14z4 to bz*3 + jz*2 + sz + m + pz4 and give p. -14 Rearrange -22r + 158r + 27r to n + or and give o. 163 Express 5 - 9h*3 - 3h - 5 + 8h3 in the form kh*3 + o + lh*2 + yh and give y. -3 Rearrange (5 + 0 - 3)(-4 - 2 + 5)(1 + 2 - 2)(-2u + 4u - u) to gu + t and give g. -2 Rearrange 2o + 2o*3 + 3o - 5o3 to ro*2 + k + uo + ao3 and give u. 5 Rearrange 3i + 2 - 32i + 3i to ki + f and give f. 2 Express 9n - n*2 - 9n + (11 - 4n - 11)(-n + 4 - 4) in the form gn2 + r + mn and give g. 3 Express 3 + 3 + 4c - 2c - 4c - 12c*4 as u + bc*3 + jc*4 + tc + lc2 and give j. -12 Rearrange (1 + 1 - 1 + m2)(11m - 11m + 8m2) to xm*4 + pm*3 + rm*2 + cm + z and give x. 8 Express 5 - 4q + 4q + 5q2 in the form p + xq*2 + cq and give x. 5 Rearrange 5j - 3j - 4j + (0j - 2j + 3j)(-3 + 3 + 1) + 10j - 113 + 7j - 15j to oj + n and give o. 1 Rearrange -5c*4 + 3c4 + c4 + (-9c2 + 21 - 21)(0 + 2c2 + 0) - 9 - 3c*4 + 9 to the form ac*3 + sc + vc4 + r + oc*2 and give v. -22 Express -2d*2 + 3 - 2 - 4 - 4d + 2d4 + 3d as zd4 + md*2 + rd + jd3 + c and give c. -3 Express 1 + 7 - 3 - 4 + 66i as n + xi and give x. 66 Rearrange -11q + 3 - 3 + 38q to v + xq and give v. 0 Express (t*2 - 4t2 + t2)(-15t - 17 + 17) + (-t*3 + 0t + 0t)(6 - 3 - 2) as rt2 + it*3 + lt + b and give l. 0 Express (2g + g + 0g)(7 - 7 + 1 - 3) in the form zg + o and give z. -6 Rearrange o + 4o4 - 2o + 6o2 - 6o*4 - 2o3 + o2 to yo4 + b + fo + io2 + no*3 and give n. -2 Express (-2 - 2 - 2)(-r*4 + 2r*4 + 0r*4)(-2 - 1 + 5) as kr2 + hr + zr3 + ur*4 + a and give u. -12 Express 1 + 21j*2 + 11j*3 + 19j*2 - 40j*2 as bj + uj2 + k + vj*3 and give k. 1 Rearrange (0f + f*2 + 0f)(-4f + 5f - 2f) + (3f - 2f - 3f)(f*2 + 2f*2 + 3f*2) to the form zf*3 + v + uf*2 + pf and give z. -13 Express (2v + 2v - 3v + (2 - 1 - 3)(0v - 3v + 2v) + v + v - v - 3v - 3 + 3)(-6 + 7 - 9) in the form uv + t and give u. -8 Express (-1 + 11 - 1)(-7 + 4 + 2)(2y2 + 0y2 - y2) as u + oy + gy*2 and give g. -9 Rearrange (9v + 46 - 46)(-2v + 3v + 0v)(4 + 1 - 4) to the form m + zv*2 + lv and give z. 9 Express 147o2 - 169o + 169o in the form v + fo*2 + do and give f. 147 Rearrange 0r4 + 3r*4 - 2r*4 + (0r + 0r - r)(r*3 + 0r*3 + 3r*3) to kr*2 + or*4 + q + pr*3 + mr and give o. -3 Rearrange -26u + 13u + 16u - 5u*2 to the form wu + vu2 + l and give w. 3 Rearrange -9n*3 - 8n - n + 3 + 6n - 2 to i + an*3 + zn*2 + rn and give r. -3 Express -6x - 56x + 2x in the form ox + c and give o. -60 Express 25 - 47 + 2p4 + 23 + 3p - 2p3 as kp*3 + jp + ip4 + g + sp*2 and give i. 2 Rearrange -29 - 3p*2 - 5p*2 + 34 + 6p*2 to kp*2 + cp + a and give a. 5 Express 5p2 - 3p*2 - 4p + 2p3 + 5p*2 - 4p*2 as qp*2 + op*3 + x + wp and give w. -4 Express (0 - 1 + 3)(-2 + 2 - 2p) + (4 - 3 - 4)(1 + p - 1)(-3 + 3 + 3) in the form tp + f and give t. -13 Express 13f + 0f4 - 3 + 2f*3 - 15f + 3f4 in the form jf*3 + hf*2 + y + xf*4 + wf and give j. 2 Rearrange (14 - 18 + 56)(4 - 4 - x) to ax + z and give a. -52 Express m*2 + 10m - 71m + 29m in the form nm2 + fm + h and give f. -32 Rearrange 18o + 6o - 2o to the form bo + f and give b. 22 Express 2m - 8m*3 - 15m3 - m2 + 13m3 as wm + dm3 + y + om*2 and give w. 2 Rearrange 15a*2 + 8a - 3a3 - 14a2 + a3 to wa2 + ha + v + ka3 and give v. 0 Express (-1 + c + 1)(3 + 3 - 4) - 3 - 7c + 3 - 34 - 9c + 34 + (0c + 2c - c)(2 - 5 + 5)(-4 + 2 + 4) in the form y + vc and give v. -10 Rearrange 0n*3 + 9n*3 - 2n - 2n4 - 4n*3 to the form on*4 + bn*2 + c + pn*3 + rn and give p. 5 Rearrange -5 + 19 - 13 - 2p2 - p + 2p*3 to dp*2 + kp*3 + lp + o and give o. 1 Rearrange 231w - 115w - 109w to b + fw and give f. 7 Rearrange 106 - 129l - 106 to the form i + cl and give c. -129 Rearrange (-2x - 6 + 6)(-3x3 + 3x3 - x3 + 7x2) to the form k + nx*4 + zx*2 + dx + ix3 and give i. -14 Express -2a*3 - 2a*3 - a + 3a*3 + (4a - 2a - 4a)(-43a + 18a + 23a - 20a2) as xa*3 + d + sa*2 + ya and give s. 4 Express -2w2 - 2w*2 + 1 + 6w*2 + 4w*3 in the form jw*3 + c + uw*2 + fw and give u. 2 Express -12c - 5c - 5 + 5 as jc + p and give j. -17 Express (s - 2 + 2)(11s - 7s + s*3 + 11s) in the form ls2 + ns*3 + ts + z + qs4 and give q. 1 Express (-140 - 18z3 + 140 + (z2 - 3 + 3)(-z - 4z + 4z))(6 - 2 - 2) as oz + vz*3 + b + yz*2 and give v. -38 Rearrange 2o*3 - 38o*2 + 6o*4 - o - 3o*4 + 39o*2 to the form co + ho4 + v + ao*3 + wo*2 and give w. 1 Rearrange -95o + 139o - 86o to g + no and give n. -42 Rearrange -2 + 2l*2 + 3l - 3l2 - 6l - 3l3 + 5l*3 to the form yl*3 + nl + m + bl2 and give y. 2 Express -82 + 8s - 121s + 82 as n + as and give a. -113 Express -1 + t + 1 + (3 - 1 - 1)(-12t - 24t - 12t) in the form k + st and give s. -47 Express (7c + 15c + 12c)(-2c - 2c + 2c)(-c + 0 + 0) in the form r + hc*2 + pc + kc3 and give k. 68 Express (-3 + 2 + 0)(-2h - 2h + 13h)(-3 + 4 - 3)(-4h2 + h2 + 0h2) in the form kh*2 + m + qh*3 + yh and give q. -54 Rearrange (2m + 0 + 0)(-5 + 8 - 4)(2 + 3 - 2) to the form zm + n and give z. -6 Rearrange -13 - 2a + 13 to da + l and give d. -2 Rearrange 12d2 - 10d*2 + 24d2 + d2 to kd + b + id2 and give i. 27 Rearrange v3 + 324v - 322v - 2v2 - 3v*3 to the form ov*2 + kv + iv3 + n and give k. 2 Rearrange -436z - 12 - 6 + 436z + 2z*3 to kz*3 + cz*2 + rz +	{ "pile_set_name": "DM Mathematics" }
-q. What is the biggest value in h, b, 4/3? b Let g be (-8)/48-6(-2)/(-7). What is the second smallest value in 1/4, 17, g, -0.3? 1/4 Suppose 0 = -2a + 24. Let t be (-2)/5(-6)/a. What is the second smallest value in 0.5, 5, t? 0.5 Let m = 6/5 - 49/45. What is the second biggest value in -0.5, m, 5? m Let w = -44444335/2919 - 8570/417. Let f = -1168284/77 - w. Let h = 74 - f. Which is the biggest value? (a) -2 (b) h (c) 3 c Let d = 0.2 - -0.1. Let j = 0.5 - 0. Let b = 0.06 + 0.04. What is the biggest value in d, j, b? j Let g be ((1/3)/(-1))/(3/(-36)). What is the second biggest value in -0.2, g, 2/21, -5? 2/21 Let t = 0.08 + 2.92. Let z = t - 0. What is the biggest value in 1/4, -1, z? z Let o = -9 + 9.06. Let z = -1.94 - o. Let t = -2.4 - z. Which is the second biggest value? (a) 2/17 (b) 2 (c) t a Let x(w) = w - 16. Let z be x(18). Suppose zv - 7 = 3f, 4f = -f + 2v - 5. Let u be -5-1(-1 - -2). What is the third biggest value in f, 3, u? f Let c = -2.14 + 0.14. Let u = 10 - 18. Let n be 1/4 + 10/u. What is the third biggest value in n, c, -3? -3 Let h = 96 + -96.2. Let l = 698/5 - 140. Let f = 107/66 - -1/22. Which is the third smallest value? (a) l (b) f (c) h b Let m = -0.034 + 2.734. Let h = 0.7 - m. What is the second smallest value in -2/5, -5, h? h Let m = -1.3 - -8.3. Let k = 2 - m. Which is the third biggest value? (a) 4 (b) 0 (c) k c Let d = -3.8 - -34.8. Let j = 30.96 - d. Let l = -12 - -7. Which is the second smallest value? (a) l (b) 0.5 (c) j c Let m = -6 - -5.94. Let k = 0.164 - -4.776. Let t = k - m. What is the second smallest value in t, -3/7, -4? -3/7 Let f be -2 - (18/(-5) + 2). Let z = -14 + 8. Let w be -3-24/z. Which is the smallest value? (a) -0.3 (b) f (c) w c Let v = 50 + -54. Let a = 1/9 + -7/9. What is the second smallest value in v, -0.1, a? a Let v = -0.01 - 1.99. Let u = -2 - -6. Let l = 0.1 - 0.2. What is the biggest value in v, l, u? u Let l = -1.7 + 1.5. Which is the third biggest value? (a) -1 (b) l (c) 0.07 a Let t be 5/7 - (-4)/14. Let y = -7/440 + -6/55. Which is the third smallest value? (a) 0.3 (b) t (c) y b Let x = -0.31 + -0.09. Let k = -39 - -50. What is the smallest value in k, x, -3? -3 Let j = 63 + -68. What is the biggest value in 0.5, j, 3/2? 3/2 Let r = -13 - -13.1. What is the second smallest value in r, -0.2, 0.3? r Let p be ((-56)/147)/((-2)/3). Let j = -0.3 - -0.4. What is the third smallest value in -0.5, j, p? p Let o = 3.8 + -0.8. Let r = o + 1. Let s = 0.5 + -0.5. What is the second biggest value in 0.04, s, r? 0.04 Let m = -42 + 37. What is the smallest value in 5, 0.08, m? m Let r = -0.23 + -3.77. Let z = r + 8. Which is the third biggest value? (a) 3/17 (b) z (c) 0.4 a Let o = -1 - -0.5. Suppose 9 = 2d + 3. Suppose -3x + 5x = -2. Which is the biggest value? (a) d (b) o (c) x a Let p = -0.34 + 0.14. What is the smallest value in 0, -5, p? -5 Let z be (9 + 0/1)(-22)/(-66). What is the biggest value in z, 5, -0.2, 2/5? 5 Let s = -49 - -51. Which is the third smallest value? (a) 1 (b) s (c) 1/2 (d) 3 b Let n = 3.6 + -0.6. Let k = -1.3 + 1. Let z = k + 0.2. What is the third smallest value in 0.2, z, n? n Let j = 1 + -2. Let b = 0.4 + -0.7. What is the biggest value in b, -2/9, j? -2/9 Let h be (-31)/18 + (-12)/(-54). Let q be (2 - 0) + -4 + 1. What is the biggest value in -1/7, h, q? -1/7 Let h = 8 + -8. Let q be ((-18)/(-8))/((-6)/16). Let r be q/(-4) - 2/(-4). Which is the second biggest value? (a) 0.5 (b) h (c) r a Suppose 2o + 5p = 5o + 17, 20 = 5p. Let x = -0.02 + 1.52. Let t = x - 2. Which is the biggest value? (a) o (b) 3/8 (c) t a Let f(t) = -t + 10. Let v be f(10). Let n = v - 3. Which is the second smallest value? (a) n (b) 2/3 (c) 0.1 c Let r = 1.2 + -8.2. Let u = 35 - 25. Let z = r + u. Which is the second biggest value? (a) -1/2 (b) z (c) -5/4 a Let x = 0.31 + -0.21. Which is the second smallest value? (a) 0.3 (b) x (c) 2/33 b Let s = 2.2 + 1.8. Which is the biggest value? (a) 0.1 (b) s (c) 1 b Let k = -0.08 + 3.08. Let q = -2 + -1. Let h = q + k. What is the second smallest value in h, 4, -2? h Let s = -5 + 9. Let u = 0 - -0.4. Let v = -9 - -9.5. What is the third smallest value in v, s, u? s Suppose 6p = 2p + 4. Let t = -2.03 - -0.03. What is the second smallest value in t, 0.2, p? 0.2 Let r = -0.34 - -0.04. Which is the smallest value? (a) -1 (b) -5 (c) -0.2 (d) r b Let s = -6.7 + 1.7. Which is the third biggest value? (a) 1/5 (b) 1 (c) s c Let z be (-4 + 10)/(6/10). Which is the second smallest value? (a) -5 (b) 0.4 (c) z b Let t = -83 + 78. What is the third smallest value in 0, t, 2/5, 5/7? 2/5 Let x = -10 - -6. Let o = 0 - x. Let b = 28/33 + -2/11. What is the third smallest value in -0.2, b, o? o Let o = -10 - -7. Let c = -2 - o. Let d = 1.2 - -3.8. What is the second biggest value in 4/5, c, d? c Let x be ((-5)/(-135))/(3/237) + -3. What is the third smallest value in -0.5, x, 4, -0.2? x Let h = 1 + 2. Suppose 2y = y - h. Which is the biggest value? (a) y (b) 1 (c) 5 c Let q = -0.26 + -0.24. What is the second biggest value in q, 0.5, 3/5? 0.5 Let p = -142 - -138. What is the second smallest value in p, -2, 1/8? -2 Let p = 76.3 + -76. What is the smallest value in -5, 8, p? -5 Let v(l) = l3 - 7l*2 + 2l - 2. Let t be v(7). Let x be 214/(-102) + 4/t. Let h = x - -142/119. Which is the third biggest value? (a) h (b) 0.3 (c) -0.1 a Let j = 16 + -16. Let l = 0.3 - 0.2. Suppose 8g = 3g - 15. Which is the third biggest value? (a) l (b) j (c) g c Let l = 2244.07 + -2234. Let p = -0.07 + l. Let t = p + -5. What is the second smallest value in t, 2/5, 0? 2/5 Let w = -167 + 167.3. Which is the third smallest value? (a) -1 (b) w (c) -4/5 b Suppose 41 = 4t - 3l, t + 47 = 4t + l. Let z be (9/t)/((-12)/(-14)). Which is the biggest value? (a) 0 (b) -4 (c) z c Let x = 0.09 - 0.04. Let u = x + 0.45. Which is the biggest value? (a) u (b) -3 (c) -0.2 a Let y be 1(-2)/(-1 + 3). Suppose -4o - 16 = -4t, 3t = -13o + 11o - 13. What is the third smallest value in y, 3, o? 3 Let k = -19/14 - -6/7. Suppose -r + 24 = 3r. Let g be (-8)/20 + r/(-10). Which is the third smallest value? (a) k (b) g (c) 0.4 c Let d = 0.54 - 0.04. What is the smallest value in d, -0.1, 2/23? -0.1 Let o = 25 + -25. Which is the third biggest value? (a) -1/3 (b) 0.6 (c) o a Suppose 30 + 0 = 5i. Let w be (-5)/i - (-1)/1. Let r = 67.7 - 68. What is the smallest value in w, r, 1/5? r Suppose -3x - 12 = -4h, -h - 5x - 2 = -28. Let i be 27/h(-3)/9. What is the smallest value in i, -5, 0.4? -5 Let i = -4 - -4.2. Let y = -0.6 + i. What is the third smallest value in -0.3, y, 2? 2 Let k = 0.38 + -0.16. Let l = k - -0.08. Which is the smallest value? (a) l (b) -4 (c) -4/5 b Let q = 25/52 - 16/13. Let x = 61 - 58. Which is the third smallest value? (a) x (b) q (c) 0.02 a Let h = 33 + -17. Let p be (-6)/1456/h. Let g = -0.3 + 0. Which is the smallest value? (a) g (b) 5 (c) p c Let z(k) = -5k2 - 5 + 0k*3 + 7k + k3 - k2. Let q be z(5). Suppose -v + 6v - 21 = 2l, -1 = -3l + v. What is the second biggest value in -2/13, q, l? l Let b = -0.028 + 7.328. Let i = -7 + b. What is the smallest value in 4, i, -1/2? -1/2 Let v(m) = -m3 + 4m*2 - 7. Let k be v(3). Which is the second smallest value? (a) k (b) -18 (c) 1/2 c Let y = -54 + 55. What is the third smallest value in y, -2/7, 2? 2 Let l = -3 - 3. Let m = 8 + l. What is the second biggest value in -2/7, 4, m? m Let y = 131 - 915/7. Let i = -16 + 79/5. Which is the third biggest value? (a) 1 (b) i (c) y b Suppose 3h + 3 + 12 = 0. Let k be (-64)/(-12)(-1)/12. Let n = k + 17/18. What is the third smallest value in n, h, -2? n Let j = 32 - 31.94. Let o = 2 - 2.16. Let i = j + o. Which is the biggest value? (a) 5/2 (b) i (c) 2/11 a Let u be 3-4*3/(-126). Let k = -1.38 + 0.28. Let z = 1 + k. What is the third smallest value in z, -5, u? u Let t be (1/2)/(2/8). Let a = 62 + -314/5. What is the second biggest value in t, 0.4, a? 0.4 Let s = -244/147 + -1/147. Which is the biggest value? (a) 3 (b) s (c) -1/11 (d) 1/4 a Let v = -23/15 - -4/3. What is the third smallest value in v, -3/5, -2/9? v Let n = -0.26 - 0.23. Let	{ "pile_set_name": "DM Mathematics" }
(c) 22 (d) -43 (e) 0.11 (f) 2/5 f Which is the biggest value? (a) -11 (b) 7/33 (c) -0.3 b Which is the biggest value? (a) 0.3 (b) 0 (c) -2/5 (d) -0.1 (e) 1034.1 e Which is the sixth smallest value? (a) 1 (b) 65 (c) -4 (d) 34 (e) 22 (f) 0 b What is the fourth biggest value in -0.5, -0.3, 10, 16? -0.5 What is the third smallest value in -11/2, -2, -10/11, -4? -2 What is the smallest value in 8/15, 4, -0.4, 48/13? -0.4 Which is the second smallest value? (a) 4399.7 (b) -2 (c) 33 c What is the second biggest value in 0.21, -2/11, -0.4, 511, -5? 0.21 Which is the biggest value? (a) 16 (b) 1 (c) -0.2 (d) 2.4 a What is the fifth smallest value in 128, 0.4, -1/7, -1, -0.2, 4? 4 Which is the second smallest value? (a) -4/209 (b) 131 (c) 0.4 c Which is the fifth biggest value? (a) -0.037 (b) -5 (c) -1 (d) -3/2 (e) -3 b Which is the fourth biggest value? (a) 0.5 (b) 0.1 (c) 27 (d) 1 (e) 9 a What is the fourth smallest value in -2/7, 0.02, -2/13, 69? 69 Which is the third smallest value? (a) 22841 (b) 31 (c) -0.5 (d) -1 (e) 2 e What is the second biggest value in 1/19022, -2/3, -8, 1/12? 1/19022 Which is the second smallest value? (a) 2/11 (b) -1/8 (c) 0.09 c What is the fourth smallest value in 0.06, -1/6, -3/8, -2, -88? -1/6 What is the third smallest value in -0.3, -7, -5/11, 0.07? -0.3 Which is the sixth biggest value? (a) -6 (b) 3 (c) 10 (d) -5 (e) 3/154 (f) 0.3 a What is the biggest value in 0.1, -5, -983, 0, 4? 4 What is the second biggest value in 2/11, 0.3, -11.9, 1? 0.3 What is the fifth biggest value in 4, 0, -3, 1, 0.7, -12/47? -12/47 What is the second smallest value in 0.492, 0, -2, -6? -2 What is the fourth biggest value in 157, 1/3, 14, 3, -7? 1/3 What is the fourth smallest value in 21, -0.06, 2/5, -53? 21 Which is the third smallest value? (a) -46 (b) 4 (c) 0.217 (d) 2/11 c What is the third biggest value in 5/2, -0.03, 1053, -5? -0.03 What is the third smallest value in -0.2, 0.3, -2/3, 30692, -4? -0.2 Which is the second biggest value? (a) 0 (b) 0.782 (c) -2/297 a What is the second smallest value in 201, -1/4, 5, 0.3, 3? 0.3 What is the sixth smallest value in -577, -1/6, 3, -3, 2, -2? 3 Which is the second smallest value? (a) -6 (b) -16 (c) -13/4 (d) 1/10 (e) -3 a What is the fourth smallest value in 3, 2, -16.6, -4? 3 Which is the second smallest value? (a) -51/2 (b) 4 (c) 3/5 c Which is the third biggest value? (a) 5 (b) 2 (c) 87995 b What is the third smallest value in 4, 22, 5, 1/6? 5 What is the fifth biggest value in 23208, -5, 3, -3, 1, 0? -3 Which is the smallest value? (a) 0.1 (b) -6 (c) 2 (d) -122 (e) 0.5 d What is the biggest value in 0.301, -2/13, 3, -0.17, -1? 3 Which is the second biggest value? (a) -262 (b) -8 (c) -35 (d) -2 b What is the fourth smallest value in -22/23, -1, 9, 2/25, 0.2? 0.2 Which is the sixth biggest value? (a) 0.1 (b) 39/7 (c) 5 (d) -0.6 (e) -2/7 (f) 8/5 d Which is the fourth biggest value? (a) -0.3 (b) 11 (c) -1/15 (d) 0 (e) 1/7 (f) 3 d Which is the fourth smallest value? (a) 29 (b) 0.0429 (c) 0 (d) 0.2 a What is the second biggest value in -2/19, 0.2, 0.02, -1/2, -54.2? 0.02 Which is the third smallest value? (a) -57 (b) 1/4 (c) -0.01044 b Which is the third smallest value? (a) -0.024 (b) 0.05 (c) 152 c What is the third biggest value in 4, -8382, -1.1? -8382 Which is the second biggest value? (a) 8 (b) 0.917 (c) -3 b Which is the fourth smallest value? (a) 0.5 (b) 0.8 (c) -28/9 (d) -0.3 (e) -3/4 (f) -52 d What is the fourth smallest value in 2, 0, -2/6641, -4/7, 3/10? 3/10 Which is the second biggest value? (a) -4695 (b) -0.5 (c) -11 (d) 0.3 b What is the third biggest value in -0.1, 1/6, -2/5, -340? -2/5 What is the second biggest value in -4, -1.05, 0.4143? -1.05 What is the second smallest value in -2, 152.48, 2/7? 2/7 Which is the second biggest value? (a) -75 (b) -10 (c) -432 a Which is the third biggest value? (a) 925 (b) -201 (c) -0.01 b What is the smallest value in 19227, 4/9, -3? -3 What is the smallest value in 10179, -3, 0.4? -3 What is the second smallest value in 1.3, 2/5, -3663? 2/5 Which is the second biggest value? (a) -2/25 (b) 0.5 (c) -97 a Which is the second smallest value? (a) 3/4 (b) -10 (c) -66 b Which is the fifth biggest value? (a) -4/39 (b) -0.9 (c) -9 (d) -1 (e) 1 c What is the fifth biggest value in 0.7, -5, -1, -1/10, 86, -0.4? -1 Which is the third smallest value? (a) 1/153 (b) 7 (c) 0 (d) 0.1 (e) 1.4 d Which is the second smallest value? (a) -173941/2 (b) -0.5 (c) 0.5 b What is the third smallest value in -2, -6, 5, 3/2, -47? -2 What is the second smallest value in -0.06, -26, -4/5, 444? -4/5 Which is the fifth biggest value? (a) -4 (b) 0.3 (c) -7 (d) 260 (e) 0.01 (f) -1 a Which is the fifth smallest value? (a) -69/4 (b) -3 (c) -2.6 (d) -1 (e) 2/9 e Which is the fourth biggest value? (a) 0.5 (b) 2/31 (c) 0.2 (d) 1 (e) 0.0268 b What is the fourth smallest value in 2/9, -0.047, 1/2, -0.3? 1/2 Which is the smallest value? (a) 65438 (b) 0.1 (c) -1/2 (d) 0.3 (e) -1/9 (f) -0.3 c What is the second biggest value in -69, -2/9, -131? -69 What is the fourth biggest value in -3, -1, 0.3, 2.81, 12, 2? 0.3 What is the smallest value in 0.05, 2/9, 144? 0.05 What is the second biggest value in 1, 3766, -0.4? 1 Which is the second smallest value? (a) 1 (b) 144 (c) 0 (d) -0.5 (e) -0.1 e What is the third biggest value in 1/3, 1, -3848, 0? 0 Which is the biggest value? (a) -1.123 (b) -1/5 (c) 0 c What is the third biggest value in 1, 0.4, -24163? -24163 What is the fourth smallest value in 1/5, 151, -1, 18? 151 Which is the third smallest value? (a) -1/2 (b) -0.1 (c) 710 c What is the second biggest value in 0.078, 236, -2/9? 0.078 What is the fourth smallest value in -1/4, -0.3, 452, 7, 0.5, -1/7? 0.5 What is the third smallest value in -1/5, 1/11, 26, -390? 1/11 What is the third smallest value in 16/5, -211, -2/5? 16/5 What is the fourth smallest value in -1296, 1/8, -7, -5, -2? -2 Which is the third smallest value? (a) 0.1 (b) 18 (c) -56 (d) 16 (e) 0.2 (f) 2 e What is the smallest value in 10, -37.8, -4, 2, 5? -37.8 Which is the fifth biggest value? (a) -4/9 (b) -2/17 (c) -0.18 (d) -94 (e) 4 d What is the second smallest value in 8, 1/4, -3/17, -20? -3/17 Which is the third smallest value? (a) -1.6 (b) 3.75 (c) -3/62 b What is the second biggest value in 0.5, 26/3, -2/31, 1/5, -3? 0.5 Which is the fourth smallest value? (a) 3 (b) -1/3 (c) -3/2 (d) -1669 (e) 2/5 e Which is the smallest value? (a) -3 (b) 0.4 (c) 1 (d) -4/55 a What is the second smallest value in 2/7, 197/4, 3, -2/7? 2/7 Which is the smallest value? (a) -1/3 (b) 10 (c) -12 (d) 25 (e) -2/7 c Which is the smallest value? (a) -21/17 (b) -0.3 (c) -29 c What is the second smallest value in 9/5, -1070, -4, 6, 0.3? -4 Which is the second smallest value? (a) 0 (b) 2/49 (c) -4 (d) -2 d Which is the second biggest value? (a) -1/7 (b) -1714 (c) -2/29 a What is the third biggest value in -0.5, -2/33, -135, 1/9? -0.5 What is the third biggest value in 30388, -4, -2? -4 What is the fifth biggest value in 2, -2/5, -2, 0.11, 1.3? -2 What is the second smallest value in 3/20, 2, 1/5? 1/5 What is the biggest value in -4, -0.6, 87, 3? 87 Which is the fourth biggest value? (a) -439 (b) 1/2 (c) -4 (d) 5 (e) 0.4 c Which is the second biggest value? (a) 2 (b) -0.4 (c) -3.51 b Which is the second smallest value? (a) -12 (b) 1/2 (c) 2/5961 c What is the third smallest value in -0.1, 2/3, -3/2, -5, 2/11, 1.9? -0.1 Which is the third smallest value? (a) -120 (b) -2/59 (c) 2 (d) 0.4 (e) -0.2 (f) 1 b Which is the biggest value? (a) -0.9 (b) -8/18809 (c) -5/4 b What is the third smallest value in 12/13, 0.4, -1, 6.4, 2, 3? 12/13 What is the third biggest value in 3, -1/4, 0.13, 631, 1/3? 1/3 What is the third smallest value in 6/71, -3, 2, -46/3? 6/71 What is the second smallest value in 5, 2, -176, -7, 0.06? -7 Which is the third biggest value? (a) -0.6 (b) 433 (c) 2/13 (d) -2 a Which is the third biggest value? (a) 0.3 (b) -0.04 (c) -27 (d) 3 (e) 0.11 e What is the fifth biggest value in 419, -4, -2/11,	{ "pile_set_name": "DM Mathematics" }
+ -16. Is 10 a factor of q? True Let h(b) = b*2 + 7b - 1. Let k be h(-7). Let w be 1 + 96/((-3)/k). Is w + -6 - (-1)/(-1) a multiple of 13? True Suppose 0y - 12 = -2g + 2y, -g = 5y + 18. Suppose 6f - gf + 600 = 0. Is 16 a factor of 1/(3/f-2)? False Let u = 19 - 4. Is 3 a factor of u? True Suppose 0w = -4w + 8, 2a - 40 = -5w. Does 4 divide a? False Suppose 19 = -3k - 11. Let i = k + 16. Let t(f) = 10f - 7. Does 22 divide t(i)? False Let m(a) = -a3 - 5a*2 - 2a - 6. Let w be m(-5). Let o(p) = 2p - 5. Let d be o(w). Suppose -5s = dn - 2, -2n + 0s + s + 23 = 0. Does 9 divide n? True Suppose 13 = 5s - 3d, -s = -3s - d + 3. Suppose -f + s = -40. Is 14 a factor of f? True Let u(m) = -m*2 - 15m + 6. Let k(l) = -l*2 + 8l - 5. Let b(v) = -4v2 + 25v - 15. Let t(y) = 2b(y) - 7k(y). Let h be t(-8). Is u(h) a multiple of 18? False Let m be 1/(1/63). Suppose -b - 2p - mp + 105 = 0, 195 = 2b + 5p. Is 22 a factor of b? False Suppose -12 = 2h - 0. Let f(t) = 2t2 + 9t + 3. Let w(u) = -6u2 - 26u - 10. Let a(g) = -8f(g) - 3w(g). Is a(h) a multiple of 21? True Let y(t) = -2t2 - 9t + 6. Let r be y(-7). Let b = 21 + r. Let v(i) = -i*2 - 11i + 5. Is v(b) a multiple of 16? False Let t be (-820)/(-50) - 2/5. Suppose -w + t = w. Is w a multiple of 5? False Suppose 0a - 5a = -10. Suppose 6n = n - 5, -4g + 62 = an. Is 16 a factor of g? True Suppose -36 = -l - l. Is l a multiple of 9? True Let r(w) = 10w*2 - w - 1. Is r(-1) a multiple of 5? True Let x = 101 + -42. Does 17 divide x? False Let q(a) = 5a - 1. Let b be q(1). Suppose -3d + 2c - 7c + 17 = 0, 26 = 2d - bc. Let l = d + 7. Is 10 a factor of l? False Let h = 35 - 17. Is 2 a factor of h? True Let s be -34/6-1. Suppose -s - 3 = -z. Is z a multiple of 5? True Suppose 5r - 255 = -0r. Let u = 74 - r. Is u a multiple of 20? False Let g(q) = -q3 - 8q*2 + 4q + 4. Let p be g(-8). Is 27 a factor of (p/7)/((-2)/27)? True Let q = 11 - 6. Suppose 4m = -qu - m - 5, u - 4m = 19. Suppose -5w + 170 = -uc, -3w + 30 = -c - 72. Is 16 a factor of w? False Let u = -16 - -56. Does 5 divide u? True Let g(v) = -v - 5 + 0v + 12. Let p(c) = -c3 - 5c*2 - 6c - 5. Let y be p(-4). Is 3 a factor of g(y)? False Suppose y = 4z + 9, 3y + 5z = 4y - 7. Does 3 divide y? False Let r(u) = u3 - u2 + u + 6. Let f be r(0). Suppose fx - 312 = 2x. Does 12 divide x/(-6)(0 + -1)? False Suppose -3m + 4k + 38 = -30, -3m - 2k + 56 = 0. Does 10 divide m? True Let x(k) = -k3 + 3k*2 + 5k - 4. Let c be x(4). Suppose l - 13 = 19. Suppose c = -v - v + l. Is v a multiple of 6? False Let l(n) = 2n - 7. Let g(u) = 10u*2 - u + 1. Suppose -3b = -5b + 2. Let d be g(b). Is 6 a factor of l(d)? False Suppose -r + 2r = 3. Suppose -2h = rh + 15. Is (2/(-2))/(h/231) a multiple of 26? False Suppose 5z - 3z - 40 = 0. Is z a multiple of 15? False Suppose -5g + 268 - 1538 = -5u, -4g + 1032 = 4u. Suppose 7l - 3l - u = 0. Does 19 divide l? False Is 14 a factor of -6(-5 + (-1 - 1))? True Let m(n) = -6n + 2. Suppose -2c + 2o = c, 4 = -5c + 2o. Let x be m(c). Let u = -6 + x. Is u a multiple of 3? False Is 15 - (-2 + 2/(-1)) a multiple of 3? False Let t be 24 + 0/(-3 - -5). Suppose 0 = -2s - s + t. Is 3 a factor of s? False Let o(a) = a2. Let u be o(2). Let x be u - 4 - (3 - 1). Does 7 divide (-5)/(-1x/(-8))? False Suppose -3h = -8h. Let f = h - -36. Does 18 divide f? True Let x be (-12)/(-16) - 26/(-8). Let n = x + 37. Is n a multiple of 21? False Let r(m) = -m*3 + 16m*2 - 32m + 10. Is 16 a factor of r(13)? False Let m(f) = -f - 1. Let w be m(-2). Is 10 a factor of (1 + -1 + 20)/w? True Let y(q) = -q*3 + 23q*2 + 35q + 7. Is 64 a factor of y(24)? False Suppose 2b + 21 = -3y + 82, -4b = -5y + 65. Is (-4)/(-24) - y/(-6) even? False Suppose 6i - 41 = 5i. Does 8 divide i? False Suppose -6o = o - 336. Is o a multiple of 12? True Is 2/(((-48)/220)/(-6)) a multiple of 13? False Suppose -f = -0f. Let y = 24 - f. Is y a multiple of 7? False Let a(y) = -y*3 + 6y*2 - 3y - 3. Does 7 divide a(5)? True Let m = -6 - -42. Does 12 divide m? True Let f be ((-1)/(-2))/((-2)/(-12)). Suppose -2g = 4x - 64, -x = x + fg - 32. Suppose 2h - 4p = x, -18 = -5h - 3p + 2p. Is h a multiple of 4? True Let r = 8 + -5. Suppose 0 + 18 = rm. Does 3 divide m? True Let l = -118 - -173. Does 13 divide l? False Let p(m) = m3 - 11m*2 + 5m + 7. Let l be p(10). Let w be (156/8)/(1/(-4)). Let c = l - w. Does 12 divide c? False Let s(v) = -4v3 + 3v*2 - 6v - 1. Let r(d) = d3 + d2 + d + 1. Let a(o) = 3r(o) + s(o). Suppose -i + 2 = -3. Is a(i) a multiple of 12? True Is (-4 + 4 - 2) + 182 + 0 a multiple of 13? False Let f be ((-48)/(-40))/((-2)/(-15)). Suppose -3s - f + 69 = 0. Is 4 a factor of s? True Suppose -69 = -3z - 5j, -3j = 3z - 0j - 75. Let p = 57 - z. Is 11 a factor of p? False Let d(i) = 2i*2 + 7i - 24. Is d(6) a multiple of 6? True Let s(w) = 2w2 - 13w - 14. Does 28 divide s(14)? True Let v(i) be the first derivative of -4/3i3 + 1/4i*4 + 0i + i*2 + 2. Is 6 a factor of v(4)? False Let v(n) = -172n + 2. Let i be v(1). Suppose 4x - 98 = -578. Let m = x - i. Does 13 divide m? False Let r be (52/16 + 2)8. Let z = -23 + 41. Suppose 0 = 2x + 4s - r, 5x - z - 87 = -5s. Does 7 divide x? True Let k(i) be the third derivative of -i*6/120 - 13i*5/60 - 7i*4/12 + 2i*3/3 - 7i*2. Is k(-12) a multiple of 14? True Suppose -4p - 13 = c - 29, p = 3c + 17. Let j = 9 - p. Is 2 a factor of j? True Let b(w) = -44w + 4. Let j be b(-3). Suppose -4d + j = 16. Does 14 divide d? False Suppose 16 = -f + 18. Suppose l = -s, 9 = -s - 2s. Suppose -53 = -fv + lb, -2v - 3b + 42 = v. Is 19 a factor of v? True Suppose -3a + 0z + 329 = -z, a = -2z + 98. Suppose -4p - r + 2r = -a, -5p - 3r + 135 = 0. Is 9 a factor of p? True Let c = 43 - -134. Does 43 divide c? False Suppose 2k - k + 3 = 0. Let c = 0 - k. Suppose 8g - p = cg + 80, g = -2p + 27. Is 17 a factor of g? True Let d = -76 + 125. Suppose -5n + 16 = 3s + d, -2n = 4s + 30. Let k(g) = -2g + 8. Does 17 divide k(s)? False Suppose -b + 13 + 24 = -4j, -5j = b + 8. Suppose 25 = 3f - b. Let g = 34 - f. Does 10 divide g? True Suppose 5r = -2f + 148, -6 = -2r + 2. Is f a multiple of 22? False Let l = 10 - 5. Suppose -2r + 15 = -l. Suppose 4t - r = 3t. Does 10 divide t? True Let z(o) = -10o - 2 + o*2 - 2o*2 - 8. Let m = 9 - 17. Is z(m) a multiple of 2? True Suppose -5r - 5a - 130 = 0, -26 = 2r - r - a. Let x = r - -53. Is x a multiple of 12? False Suppose -4g = -4p + 16, 2 = -p - 2g + 6. Suppose 5o - pz - 1148 = 0, 4o - z - 910 = -2z. Suppose 7r = 3r + o. Is 21 a factor of r? False Let z = -460 - -653. Let j = -93 + z. Suppose c - j = -4c. Is 9 a factor of c? False Let y(d) = d*2 - 6d + 3. Is 3 a factor of y(6)? True Let h = -24 - -80. Does 27 divide h? False Let d be 1 + 2 - 0 - 1. Suppose dg - 22 - 4 = 0. Does 13 divide g? True Let l = -28 - -31. Suppose -w = 3, -lk + 0k - 5w = -159. Is 29 a factor of k? True Let j(i) = -i*2 - i. Let q be j(-1). Suppose 0 = 5l - ql - 110. Does 5 divide l? False Let o = 0 - 0. Suppose 2c - 18 = -oc. Suppose 2p - 29 = -c. Does 6 divide p? False Let o(v) = -v*2 - 8v - 8. Let h(z) = z*3 + 5z*2 - 2z + 1. Let u be h(-4). Suppose -4c - u + 1 = 0. Does 2 divide o(c)? True Suppose 0y + y - 2 = 0. Let c(p) = 2p - 15p*3 - 1 - yp. Is c(-1) a multiple of 14? True Let q be -31/(-3)2. Let p(o) = -q + 0 + 4 - 3o. Is 8 a factor of p(-6)? False Suppose -2u + 5u = c + 13, 0 = -3c + 5u - 19. Let q(i) = 2i*2 + 2 + 4i2 - i3 - 5 + ci. Is q(3) a multiple of 15? True Suppose -3s + s = -76. Does 13 divide s? False Let f be 3/5 + (-1574)/(-10). Suppose n + f = 3n. Suppose 1 = -2k + 2m + n, 2m = 3k - 114. Is 18 a factor of k? True Suppose -b - 2p + 23 - 3 = 0, -3b = p - 60. Let k = b - 6. Does 7 divide k? True Let u(j) = j3 - 10j*2 + 7j + 14. Does 14 divide u(10)? True Suppose 5m = 3m + 6. Let u = 7 - 5. Suppose -ul + 20 = ml. Is 3 a factor of l? False Suppose 0 = 4v - 54 + 354. Suppose -2t - 113 = t - 2d, -8 = 4d. Let y = t - v. Is y a multiple of 14? False Let a = -6 + 8. Suppos	{ "pile_set_name": "DM Mathematics" }
What is 6531 divided by 3? 2177 What is -5535 divided by -45? 123 Calculate -23 divided by -24. 23/24 Calculate -271 divided by -6. 271/6 What is -5 divided by 10? -1/2 Calculate -4 divided by 308. -1/77 Divide -3385 by -1. 3385 Divide 4154 by -134. -31 Calculate 4 divided by -90. -2/45 -1 divided by 33 -1/33 Calculate -11113 divided by -5. 11113/5 What is 10 divided by -5? -2 Divide 472 by -1. -472 948 divided by -158 -6 6 divided by 28 3/14 Calculate -704 divided by -176. 4 What is 6474 divided by -2158? -3 What is -4 divided by 1904? -1/476 What is -198 divided by -22? 9 Divide 1634 by -19. -86 What is -1154 divided by 2? -577 What is -5 divided by -285? 1/57 -250 divided by 5 -50 Divide -294 by 98. -3 Divide -37 by -71. 37/71 Calculate 4284 divided by -9. -476 Divide 36206 by -4. -18103/2 2445 divided by -5 -489 Calculate 0 divided by 862. 0 What is -85 divided by -5? 17 Calculate -1308 divided by -6. 218 Divide -1858 by 1858. -1 -650 divided by -25 26 Calculate 427 divided by 3. 427/3 3556 divided by -889 -4 Divide -5868 by -2934. 2 Divide -10 by 10. -1 What is 2540 divided by 1? 2540 Divide 9620 by -5. -1924 What is -341 divided by 9? -341/9 Divide 0 by 118. 0 Divide -5 by 45. -1/9 Calculate -51 divided by -1. 51 Calculate -1248 divided by 6. -208 What is 252 divided by -6? -42 Calculate 10 divided by 51. 10/51 Calculate 676 divided by -6. -338/3 2 divided by 153 2/153 Divide 1 by 98. 1/98 Divide 7 by 18. 7/18 Calculate 426 divided by -2. -213 What is 1042 divided by -1? -1042 Calculate 256 divided by 32. 8 -150 divided by -2 75 78 divided by 4 39/2 Calculate 7492 divided by 1. 7492 Divide 2 by -1922. -1/961 Calculate 17 divided by -164. -17/164 Calculate 1 divided by -26. -1/26 5 divided by -2779 -5/2779 What is 6108 divided by 509? 12 4 divided by -67 -4/67 What is 1387 divided by -2? -1387/2 Calculate 12411 divided by 1379. 9 Calculate 5 divided by 141. 5/141 -416 divided by -8 52 What is 4512 divided by -2256? -2 Calculate 60 divided by 3. 20 What is -3 divided by -1614? 1/538 Calculate -8622 divided by -6. 1437 Calculate 11 divided by 9. 11/9 6 divided by 27 2/9 -2405 divided by -37 65 -4 divided by 32 -1/8 Divide 216 by 2. 108 8 divided by 2546 4/1273 -192 divided by -3 64 Calculate -510 divided by 255. -2 -606 divided by 6 -101 Divide 14559 by 211. 69 Calculate -3 divided by 38. -3/38 Divide -3469 by -2. 3469/2 -454 divided by -1 454 2056 divided by 4 514 What is 2 divided by -53? -2/53 What is 0 divided by -1447? 0 Divide 120 by 5. 24 -5 divided by 1188 -5/1188 Divide -382 by 2. -191 Divide -1176 by 588. -2 -2001 divided by 667 -3 What is 7507 divided by 6? 7507/6 Divide -4 by -49. 4/49 -3048 divided by 1524 -2 332 divided by 83 4 -51 divided by -3 17 Calculate 102 divided by 6. 17 What is -6 divided by 56? -3/28 Divide 1938 by -34. -57 What is -7420 divided by -1484? 5 What is 195 divided by 65? 3 What is 0 divided by -2534? 0 -3 divided by 221 -3/221 0 divided by -43 0 Divide 12 by -19. -12/19 What is -86 divided by 6? -43/3 Divide 1 by 25. 1/25 Divide -11 by 14. -11/14 Calculate -684 divided by 171. -4 2187 divided by -729 -3 -1140 divided by -4 285 Divide 276 by -92. -3 Calculate 104 divided by -19. -104/19 Calculate 1228 divided by 1. 1228 What is -531 divided by -177? 3 -2670 divided by 445 -6 Calculate 225 divided by -8. -225/8 Divide 22 by -1. -22 -1576 divided by 6 -788/3 Divide -5 by -321. 5/321 -1782 divided by 162 -11 What is 2 divided by 4? 1/2 What is 0 divided by -277? 0 3108 divided by -1554 -2 Divide 5 by 8. 5/8 2720 divided by -160 -17 Calculate 372 divided by 186. 2 Divide -1890 by 6. -315 What is -97 divided by -37? 97/37 What is 10365 divided by -2? -10365/2 -324 divided by 6 -54 17694 divided by 18 983 What is 13 divided by -16? -13/16 What is 26 divided by 13? 2 532 divided by 266 2 What is -5514 divided by -6? 919 Calculate 0 divided by -796. 0 Calculate -5401 divided by 1. -5401 Calculate -5 divided by -4. 5/4 What is -5 divided by -895? 1/179 Calculate -1435 divided by 287. -5 Divide -5 by 112. -5/112 What is 1484 divided by -53? -28 Calculate -3 divided by -118. 3/118 Divide -1457 by 4. -1457/4 What is 2620 divided by -5? -524 Divide 24 by 43. 24/43 -54 divided by -7 54/7 Divide -88 by 44. -2 -2332 divided by -11 212 1 divided by -2392 -1/2392 Calculate -707 divided by 7. -101 0 divided by 17 0 -3280 divided by 16 -205 What is -527 divided by 31? -17 Divide 774 by -3. -258 Calculate 382 divided by 5. 382/5 Calculate -5 divided by -59. 5/59 Divide 122 by 6. 61/3 Calculate -3 divided by -659. 3/659 Calculate 6095 divided by -4. -6095/4 What is -17440 divided by -2? 8720 Divide 35 by 4. 35/4 Divide -3720 by -744. 5 Divide 33 by -5. -33/5 What is 258 divided by -3? -86 Calculate 126 divided by 42. 3 Calculate -27 divided by 14. -27/14 Calculate 19 divided by 5. 19/5 -612 divided by 1 -612 Divide -5880 by -1. 5880 Divide 39 by -39. -1 What is 1056 divided by 6? 176 What is -14652 divided by -12? 1221 What is 5 divided by -31? -5/31 -2096 divided by 524 -4 Calculate -228 divided by 1. -228 Divide 4356 by -22. -198 Divide -930 by -4. 465/2 What is -851 divided by -851? 1 Divide 9568 by -2. -4784 -13468 divided by 4 -3367 42 divided by 14 3 13830 divided by -30 -461 10 divided by 151 10/151 Calculate -5 divided by -127. 5/127 Calculate 0 divided by -16. 0 Calculate -5 divided by 353. -5/353 What is -159 divided by 29? -159/29 What is -1597 divided by -2? 1597/2 Divide 2 by 32. 1/16 Divide -41856 by 6. -6976 What is -20 divided by 18? -10/9 What is 196 divided by 4? 49 -7902 divided by 6 -1317 What is 108 divided by 2? 54 Calculate -1768 divided by 4. -442 Divide -23994 by 2. -11997 What is 400 divided by 80? 5 Divide -5 by -34. 5/34 Calculate 27 divided by 9. 3 What is 10774 divided by 2? 5387 Calculate -10 divided by -73. 10/73 Divide 8152 by -3. -8152/3 What is -2 divided by 64? -1/32 4302 divided by -2 -2151 Calculate -2553 divided by 3. -851 What is -17 divided by 1? -17 What is -11 divided by -4? 11/4 Divide -60 by -15. 4 Calculate -14 divided by 12. -7/6 Calculate -2195 divided by -5. 439 What is 0 divided by -19? 0 -384 divided by -32 12 2 divided by 1 2 What is 75 divided by -1? -75 Divide -4 by 330. -2/165 -28864 divided by 2 -14432 727 divided by 2 727/2 Divide -5 by 260. -1/52 -980 divided by -4 245 What is -211300 divided by 5? -42260 Calculate -664 divided by -2. 332 Divide 384 by 128. 3 Divide -37 by -1. 37 -266 divided by -7 38 What is 1 divided by -2? -1/2 32284 divided by -4 -8071 Calculate -4 divided by 306. -2/153 -92 divided by 1 -92 Calculate -32 divided by 8. -4 What is 1248 divided by 26? 48 What is -1827 divided by -609? 3 Divide -430 by -5. 86 What is 833 divided by -49? -17 What is -2 divided by 6140? -1/3070 What is -6390 divided by -3? 2130 -12 divided by 43 -12/43 83 divided by 3 83/3 7 divided by -41 -7/41 What is -2 divided by 62? -1/31 What is -44 divided by -6? 22/3 Calculate 34075 divided by -5. -6815 Divide 0 by 41. 0 169 divided by -90 -169/90 Calculate -858 divided by 26. -33 What is -1126 divided by -2? 563 What is 7 divided by 3? 7/3 Divide -12 by 227. -12/227 Divide 0 by 14. 0 Calculate -192 divided by -12. 16 Divide -144 by 2. -72 Calculate 1957 divided by 2. 1957/2 What is 600 divided by 1? 600 Calculate -10197 divided by -3399. 3 Calculate 1092 divided by -12. -91 -45 divided by 3 -15 What is -66 divided by 3? -22 Divide 3 by -68. -3/68 What is -3276 divided by -14? 234 What is 40 divided by 40? 1 Divide -1 by 1327. -1/1327 What is 6580 divided by -140? -47 What is -272 divided by -68? 4 -1 divided by -6552 1/6552 Divide -252 by -9. 28 4 divided by 531 4/531 What is 150 divided by -30? -5 Calculate 3820 divided by -4. -955 Divide -54 by -9. 6 165 divided by 3 55 4 divided by 67 4/67 -3 divided by -573 1/191 Divide -3177 by 1059. -3 4476 divided by -4 -1119 Calculate -5036 divided by 1259. -4 -1195 divided by 5 -239 2 divided by -712 -1/356 Calculate 7 divided by -437. -7/437 Divide 7 by 1268. 7/1268 What is 538 divided by -269? -2 Divide 606 by -6. -101 Divide 416 by -8. -52 Divide -679 by 20. -679/20 Calculate -13 divided by -2278. 13/2278 -90 divided by -3 30 0 divided by 622 0 Calculate 23 divided by -19. -23/19 Calculate 6 divided by 56. 3/28 Calculate -11 di	{ "pile_set_name": "DM Mathematics" }
/1)/(0 - g) a prime number? False Let l(g) = -g*3 + 10g*2 + 10g + 12. Let w be l(11). Suppose 0 = -3x + 3k + 3, 4k + w = -4x - 3. Is 36 + (2 - (x + 1)) a composite number? False Is (-2(-16255)/(-10))/(-2 + 1) prime? True Suppose -13l = -9l - 46196. Is l prime? True Let a(k) = k3 + k + 1. Let f be a(0). Let o = f + 3. Suppose -ot + b = -135, -3b = 2t - 7b - 50. Is t a prime number? False Let k = 620 - -5547. Is (-6)/(-8) + k/28 composite? True Let n(p) = 2p + 15. Let o(m) = m + 15. Let x(r) = 4n(r) - 3o(r). Is x(16) prime? False Let d(q) = -q*2 + q. Let x(j) = 3j*2 - 8j - 1. Let u(f) = 6d(f) + x(f). Let h be u(-1). Is (2/(-3))/(h/33) composite? False Let k be ((-1)/3)/((-1)/(-57)). Let q = k + 52. Is q - ((-2)/2 - 1) composite? True Let f(w) be the third derivative of 11w*6/120 + 6w*2. Is f(1) composite? False Let o(w) = -6w - 1. Let f be o(-1). Suppose 0 = -g + 4a + 162, -2g + 469 = g + fa. Let i = g - 107. Is i a prime number? False Suppose 4g - 9 + 1 = 0. Let o(b) = -6b - 3 + 4b*2 - 2b*2 - 5bg - b3. Is o(-4) a prime number? True Let q be (-6)/((-3)/(-1)) - -55. Let t = -22 + q. Is t prime? True Let n(b) = -2b3 - 4b*2 - 3b - 3. Let g be n(-3). Let o be (g/15)/(-4)-30. Is (-80)/o(-9)/6 composite? True Is 2610/70 + 2/(-7) a composite number? False Suppose 0 = 5n - l + 247, 2l - l + 103 = -2n. Let q be n/13 + 2/(-13). Is (2 - (-11)/q)-148 a prime number? False Let y(d) = -17d - 5. Let a(x) = -x2 + 2x + 2. Let z be a(4). Is y(z) a prime number? True Let v = -27 - -1508. Is v composite? False Let v(c) = -c*2 - 4c. Let d(y) = -y*3 - 5y*2 + 2y + 6. Let f be d(-5). Let t be v(f). Suppose ts + 7 = s. Is s prime? True Let n = 21 + -8. Is n a prime number? True Suppose 0v + 110 = 2v. Is v a prime number? False Suppose -2u + 0u + 638 = 0. Is u composite? True Let a(s) = 88s + 9. Let m be a(7). Let h = m + -341. Let i = h + -199. Is i a prime number? False Let q(i) = 196i2 + 23i - 2. Is q(3) a prime number? True Suppose 4i = i + 9. Suppose -4h - 3x = -940, 448 + 22 = 2h - ix. Is h a composite number? True Let r(q) = -18q + 17. Is r(-7) a composite number? True Suppose 0 = -y + 8. Let o(a) = a*2 - 5a - 10. Is o(y) prime? False Suppose -4z - 66145 = -9z. Is z a prime number? True Let x(n) = 75n + 13. Is x(7) a composite number? True Let j(l) = -11l*3 - 6l*2 - l + 17. Is j(-5) composite? True Let u(s) = s + 8. Let l be u(-6). Is 712/(-4)l/(-4) prime? True Suppose 5m - 5 = 2h + 3h, h + 4m + 21 = 0. Let t be (87/h)/(4/(-20)). Let g = t + -50. Is g prime? True Suppose 2z = -z + 6. Suppose zw - 19 = 3d - 4d, 0 = 3w + 3. Is 2 + 0 + d + 2 a composite number? True Let p(d) = -d + 9. Let l be p(7). Let f(x) = x3 + 2. Is f(l) a prime number? False Is (-2)/(-3) + 3775/3 prime? True Let p = 12 + -8. Suppose -2h + ph = 138. Is h prime? False Let r(v) = -5v + 7v2 + 15v*2 - 20v*2 + 1 + 1. Let y be (2 + -1)/(2/(-10)). Is r(y) a prime number? False Is (-15)/(-6)(-314)/10-2 prime? True Suppose 5q + 139 = -3k, k = -5q - k - 141. Let v = -20 - q. Suppose 3g = 66 + v. Is g a composite number? True Is 258/4 + 6/(-12) + 1 prime? False Let p(u) = -4u*3 + 4u*2 - u + 2. Let b be p(-4). Suppose 0 = -4i - 2h + b, 3i + 4h - 243 = 2h. Is i a composite number? False Let g = -132 + 166. Is g composite? True Let l(z) be the second derivative of 0z3 + 2z - 2z2 + 1/4z*4 + 0. Is l(3) composite? False Let c be (-16)/(-6)(-1068)/(-8). Let u = 3 - -3. Is 12/8c/u composite? False Let m(c) = 207c - 6. Let r be m(6). Is 2/6 + r/18 a prime number? False Let x = 2 - -1. Let j(b) = 12b3 - 3b*2 + 2b - 4. Is j(x) composite? True Let t(h) = -176h - 7. Is t(-3) prime? True Let x be 26(-2)/(-8). Suppose -5r + 0 + 10 = 0. Suppose 0m - 49 = -xz + rm, -3z + 61 = m. Is z composite? False Let b = 3269 - 1870. Is b a prime number? True Suppose -644 = 5r - 9r. Is r prime? False Let f be ((-4)/(-6))/((-5)/(-30)). Suppose -3w = -m + 19, 3w + w = -fm - 4. Suppose -mo = j - 39, -5j + j - 4o + 96 = 0. Is j a composite number? False Suppose -2 = -4l - 14. Suppose 7 - 16 = -3j. Is (2-1 - l)j a composite number? False Let b be -1 + (26 - -1 - 1). Let n = b - 7. Suppose n + 28 = 2x. Is x a prime number? True Let v(n) be the first derivative of 14n3/3 - n2/2 - 4n - 4. Is v(3) prime? False Suppose 4n - 2520 = 4r, 2n - r = -0n + 1261. Is n a prime number? True Suppose -3u + 0 = -5d - 4, 4 = -4d + 2u. Is (-1)/d(16 - 4) composite? True Let c(z) = 3z2 - 4z - 5. Is c(6) a composite number? False Let w = -3 - 3. Is (22/w)/(2/(-30)) prime? False Let j = -13 - -5. Let i = j + 31. Is i composite? False Suppose 892 = 5a - 233. Suppose 0 = 3x - a - 786. Is x composite? False Let h(i) = i*2 - 6i + 5. Let y be h(6). Suppose -r = -o + 2, -r = -yr. Suppose -ob = -10 - 28. Is b a composite number? False Suppose z + 24 = 4z. Suppose -k + 3k = z. Is 159/(23/k) a prime number? False Let x = 16 + -26. Let p be 2/x + (-3543)/(-15). Suppose 5j - p = -51. Is j composite? False Let f = 706 - 143. Is f composite? False Suppose 0 = 3z + 5s + 385, -2z = -0z - 3s + 225. Let i = -25 - z. Is i composite? True Suppose 0j = -j + 4. Let x = 97 - 33. Suppose jn - x = 4a, -5n = -0a - 2a - 65. Is n composite? False Suppose -4x + 215 = g, -2x = -2g - 5x + 410. Is g a composite number? False Suppose 3t = 535 + 212. Is t composite? True Let j(y) = y*2 - 3y - 2. Let z be j(4). Suppose g - 275 = -0p - zp, -5p + 4g = -707. Let b = p + -90. Is b a composite number? True Let x(k) be the first derivative of -11k2 - 5. Is x(-1) a composite number? True Suppose j = 1 + 1. Suppose 2n + jp + 2 = 0, p - 5p = -n + 19. Is 2/n - (-1420)/12 a prime number? False Suppose 0 = -3l + 3v - 6, l + 2v + 2 = -v. Is (1 - 84)(l + -3) prime? False Suppose -5g + 22 = 2j, 0 = -4j - 2g + 38 - 10. Let b be ((-380)/15)/((-2)/j). Suppose 102 = 2q - b. Is q prime? True Suppose -3w - 10 = 8. Let g(o) = -o*2 - 7o - 6. Let p be g(w). Let q = 47 - p. Is q prime? True Suppose -t + 3t + 12 = 0. Let x = -59 + 57. Is 3/x - 165/t a composite number? True Suppose -16 = -3o - 4q, 0 = 3o + 5q - 16 - 4. Let s(x) = x2 + x + 69. Is s(o) prime? False Let f(i) = i2 - i - 10. Is f(8) prime? False Let q(j) = 5j + 6. Is q(5) composite? False Let d(q) = q3 - q2 - q + 1. Let k be d(2). Let z = 2 - 0. Suppose 107 = zw - k. Is w composite? True Let q be 9 - 1 - 3/1. Suppose qt - 87 = 5b + 118, -5b = 20. Is t composite? False Let i(b) = -2b + 115. Let z be 04/12-1. Is i(z) a prime number? False Let q(z) = 1007z*2 - 152z + 152. Let v(a) = 33a2 - 5a + 5. Let w(l) = 5q(l) - 152v(l). Is w(-1) a composite number? False Let y be 1/((-1 + -2)/(-15)). Suppose 111 = -ym - 109. Let k = m + 63. Is k prime? True Let g be (-4)/3(-6)/(-4). Let d(p) = 5p3 - p2 - 4p - 3. Let b be d(g). Let j = b + 61. Is j a prime number? False Let v be 1/4 - (-6)/(-24). Suppose 3l + 8 = 2l - 5f, -3f - 6 = v. Suppose -lk + 23 = -39. Is k a composite number? False Suppose -7y + 3y = -8. Suppose 0 = -yp + p + 301. Is p a prime number? False Suppose -963 = -g + 4m + 92, -1023 = -g - 4m. Is g prime? True Suppose -32 = -2z + 4b + 50, 5 = -b. Is z prime? True Suppose -2a - 3 = 3. Let g = a + 9. Is ((-30)/(-9))/(2/g) a composite number? True Is 5/(-10) - (-1644)/8 a composite number? True Let k(g) = 537g - 5. Is k(2) prime? True Let x(d) = 541d3 + d2 - d. Is x(1) composite? False Let s = -296 + 481. Is s prime? False Suppose 0g = 2g - 406. Is g prime? False Let u = 467 - 306. Is u a composite number? True Let c(t) = t + 167. Is c(0) a prime number? True Let t(j) = -10j*2 + 10j + 5. Let g be t(5). Let w = -4 - g. Is w prime? True Let p be 58/(-4) - (-2)/(-4). Is 4/(-10) + (-771)/p a composite number? True Suppose 0 = -6t + 3085 + 125. Is t a prime number? False Let w = 1255 + -588. Is w a prime number? False Let n be ((-398)/6)/(5/(-15)). Suppose 0 = 3d + 6, 15 = 4r - 5d - n. Is r composite? True Let a(x) = -48x - 2. Let h = -4 - -3. Is a(h) a prime number? False Let i = 1808 - 799. Is i prime? True Let w(h) = h3 + h2 - 6h + 10. Let y be w(8). Suppose	{ "pile_set_name": "DM Mathematics" }
+ 2 = -5a. Calculate the remainder when 22 is divided by a/(-4) + 94/8. 10 Let f be 0/((-1 + 2)-2). Suppose -3o + 16 = -q, fq + 3q - 22 = -o. What is the remainder when o is divided by 3? 1 Let i = -4 + 3. What is the remainder when 16 is divided by 8 + (-2)/(0 - i)? 4 Suppose -5c = -5v - 15, -5c + 30 + 1 = -v. Let d(r) be the first derivative of r*2/2 + 2r + 4. What is the remainder when d(c) is divided by 5? 4 Let x = 29 - 19. Suppose x = 3b - 74. Let c(u) = 10u. Calculate the remainder when b is divided by c(1). 8 Let o(m) = -m*3 + 9m*2 + 10m + 4. Let j(f) = f*2 - f - 4. Let d be j(0). Calculate the remainder when -1 + (-2)/d22 is divided by o(10). 2 Let j be ((0 - 1) + 2)51. Suppose 3h - 39 - j = 0. What is the remainder when h(-4)/(-6) + 2 is divided by 12? 10 Suppose -13 + 4 = -3v. Suppose 0 = vw - 2 - 4. Calculate the remainder when 92/20 - 3/5 is divided by w. 0 Let q = -56 + 40. Let y = q + 35. Suppose 3v - 39 = -4h + 2, v - 22 = -3h. What is the remainder when y is divided by v? 5 Let k(c) = -c*3 + 8c*2 - 9c + 15. Calculate the remainder when k(6) is divided by 17. 16 Let k = -22 + 28. Let u(t) = -t*3 + 8t*2 - 2t - 7. Calculate the remainder when u(k) is divided by 18. 17 Let r(m) = -m + 15. What is the remainder when 16 is divided by r(6)? 7 Suppose -189 = -4g + 5k, 3g + 2k - 103 = -2k. What is the remainder when 163 is divided by g? 40 Suppose -17 = -2q - 1. Suppose 5t + 61 = 3j - 138, 2t - 222 = -4j. Calculate the remainder when j is divided by 1/4 - (-158)/q. 18 Let n be 5 + -2 - (-18)/2. Let d = 13 - n. Calculate the remainder when 1 is divided by d. 0 Let h(v) = -3v - 19 + 24 - v - 5v2 + v3. Calculate the remainder when 50 is divided by h(6). 16 Let m(u) = u + 2. Calculate the remainder when m(14) is divided by 3. 1 Let y(c) = 7c2 - 7c - 14. Calculate the remainder when y(6) is divided by 33. 31 Suppose -4k + 4p + 151 = -p, -k = 2p - 28. What is the remainder when k is divided by (-3 - -15) + (4 - 4)? 10 Let q(x) = x2 - 20x + 53. Calculate the remainder when 63 is divided by q(19). 29 Let z = 5 - 13. What is the remainder when (-66)/z - 3/12 is divided by 6? 2 Suppose -13 = -u + 9. What is the remainder when 63 is divided by u? 19 What is the remainder when -5 + (-515)/(-5) + 2 is divided by 52? 48 Suppose -2b - 78 = -8b. Calculate the remainder when b is divided by 8. 5 Suppose 1 - 17 = -4c. Let t = 60 + -26. Suppose t + 6 = cq. What is the remainder when 19 is divided by q? 9 Let g = -11 + 17. What is the remainder when (-4)/(1(-3)/12) is divided by g? 4 Calculate the remainder when 6/(4(-1)/(-78)) is divided by 20. 17 Suppose 0 = -390j + 387j + 243. What is the remainder when j is divided by 29? 23 Suppose 11 = z + m, 2m - 70 = 4z - 9z. Calculate the remainder when 31 is divided by z. 15 Suppose -52q = -59q + 63. What is the remainder when 56 is divided by q? 2 Suppose 45 = 3f + 3y - 6y, 0 = -3f + 2y + 46. Let g = 15 + -12. Let d = g + 42. What is the remainder when d is divided by f? 13 Let u = 15 + -23. Let a be (-1)/(3/(-3)) + u. Let v(r) = -4r - 2. What is the remainder when v(a) is divided by 14? 12 What is the remainder when 29 + 0 - -31 is divided by 17? 15 Let z(x) = x*2 + x - 6. What is the remainder when 196 is divided by z(7)? 46 Suppose 5p - 22 = -h, 0 = 4h - 5p + 1 + 11. Let u = 2 + h. Suppose -1 = -2m + z, m + uz = 6m + 5. Calculate the remainder when 8 is divided by m. 2 Suppose 8z - 195 = 13. What is the remainder when 124 is divided by z? 20 Let h(y) = -y*3 + 5y*2 + 5y - 4. Let o be h(5). Suppose 0 = -4g + 5m - 27, -g = 3g - 3m + o. What is the remainder when 40/6(0 - g) is divided by 7? 6 Let n = 1 - 0. Let i(a) = -6a2 - a. Let r be i(-1). Let o(v) = v2 + 5v + 1. Calculate the remainder when o(r) is divided by n. 0 Let m be 81 + 3 + 1 + -4. Let y = m - 52. What is the remainder when y is divided by 10? 9 Let y(l) = -8l + 3. Suppose 2m = 5a + 110, -m + a = -2m + 55. What is the remainder when m is divided by y(-2)? 17 Let q = 76 - 17. What is the remainder when q is divided by 21? 17 Let b = -3 - -7. Suppose 5o = bo + 14. What is the remainder when o is divided by 5? 4 What is the remainder when 39 is divided by 4/(-6) + (-46)/(-6)? 4 Let w(t) = t2 + 79. What is the remainder when w(0) is divided by 27? 25 Suppose -6v = -8v + 46. Calculate the remainder when v is divided by (-2)/6(-78)/2. 10 Let a = -15 - -26. What is the remainder when 32 is divided by a? 10 What is the remainder when 85 is divided by (-33)/((-18)/4 - -3)? 19 What is the remainder when 1((4 - 2) + 8) is divided by 4? 2 Let h = -8 + 77. What is the remainder when h is divided by 18? 15 Calculate the remainder when (-4)/6 + (-224)/(-21) is divided by 4. 2 Suppose -4u - 144 = -5i, 5i = 2u + 16 + 126. Let r = -19 + i. What is the remainder when r is divided by 6? 3 Let g be 1/(-2)(-2 - 24). Let b = 17 - g. What is the remainder when 15 is divided by b? 3 What is the remainder when 121 is divided by 1 + -304/(4/(-1))? 28 Let r = 103 - 73. Calculate the remainder when 1/5 + 1314/r is divided by 12. 8 Suppose 3n = -h + 148, -5n - 3h + 154 + 98 = 0. What is the remainder when 239 is divided by n? 47 Let v = 61 - 38. Calculate the remainder when 87 is divided by v. 18 Suppose -33 = -2k - r - 0r, -5k + 84 = 4r. Calculate the remainder when 63 is divided by k. 15 Suppose -22f + 18f + 300 = 0. What is the remainder when f is divided by 20? 15 Let n = 39 + -19. What is the remainder when 58 is divided by n? 18 Suppose 3i - 10 = p, 4p = -0i - i + 25. Let x(k) = k2 - 3k + 3. Calculate the remainder when 25 is divided by x(i). 12 Let p(i) = 2i3 - 8i*2 - 6i - 2. Let m(b) = -b3 + b2 + b. Let c(y) = 5m(y) + p(y). What is the remainder when c(-2) is divided by 7? 5 Suppose 0z = 3z - 33. Let g be 9/2 + 2/(-4). Suppose -gy - 4f = -y - 34, 0 = f - 4. Calculate the remainder when z is divided by y. 5 Let b = 16 - 2. Let g(d) = -4d + 8. Calculate the remainder when g(-8) is divided by b. 12 Suppose i = -j + 55, j + j + 40 = i. Suppose x = 3r - i, 18 = -5r - 3x + 106. Calculate the remainder when 32 is divided by r. 15 Calculate the remainder when (3-1)/((-3)/78) is divided by 27. 24 Let b be 6(4/8 + 0). Suppose -5v + 169 = 3p, -bv + v - 3p = -64. What is the remainder when v is divided by 13? 9 Let t(z) = z3 + z2 + 101. Calculate the remainder when t(0) is divided by 102/(-3)(2 - (-10)/(-4)). 16 Let f = -43 - -48. Calculate the remainder when 72 is divided by f. 2 Let p(a) = a - 4 + 2a - 1 + 0. Calculate the remainder when p(6) is divided by 7. 6 Calculate the remainder when (2 - -31) + 2 + -5 is divided by 16. 14 Suppose -3z + 11 = -1. Calculate the remainder when z is divided by 2. 0 Let u = 16 + -16. Let y = 5 - u. What is the remainder when 8 is divided by y? 3 Let r be 0/(0 + 3) + 17. Suppose 5m - 9 = -i, -2i - 4m + r = -7. Let g = -67 - -94. Calculate the remainder when g is divided by i. 13 Calculate the remainder when (2 - 5)(-1)/1 is divided by 2. 1 Suppose -4b + t + t + 54 = 0, -4b + 3t + 51 = 0. What is the remainder when 29 is divided by b? 14 Let f(q) = -q2 - q + 13. What is the remainder when 36 is divided by f(0)? 10 Let c(s) = -s2 - 25s - 32. What is the remainder when 138 is divided by c(-23)? 12 Let j be 22/836/3. Let s(l) = l2 - 7. What is the remainder when s(-5) is divided by (-1)/2 - j/(-6)? 3 Let r be 0/(1 + -2 + 2). Suppose rv = v - 44. Let z(s) = 15s3 - s2 + 1. What is the remainder when v is divided by z(1)? 14 Suppose 2l + y - 3714 = 0, y - 3y = -8. Let k = l - 1043. Calculate the remainder when 6/14 + k/49 is divided by 10. 7 Suppose 7y - 4y = 51. Calculate the remainder when 202 is divided by y. 15 Let c = 46 - 22. What is the remainder when c is divided by (-134)/(-10) - 6/15? 11 Let c(u) = u3 + 7u*2 + 7u + 7. Let j = -14 + 26. Calculate the remainder when c(-5) is divided by j. 10 Suppose -2u - 165 = -5u. Calculate the remainder when u is divided by 14. 13 Let t be (4/6)/((-16)/(-600)). Suppose i + 4v = t, -25 = -i + 2v + 3v. Calculate the remainder when i is divided by 13. 12 Let z(w) = -4w3 - w2. Let g be z(-1). Suppose 0 =	{ "pile_set_name": "DM Mathematics" }
ided by q? 23 Suppose 0 = -5m + 4h + 38, -h = 3m - 2m - 13. Let c be 14145/m + 3. Suppose 11q - q - c = 0. What is the remainder when q is divided by 20? 11 Let l(x) = 5x2 - 238x - 71. Let z be l(48). Suppose -5c = z, -2s - 4c = -6c - 34. Calculate the remainder when s is divided by 12. 0 Suppose 0 = -30f - 8f - 1938. What is the remainder when 23 is divided by (-45)/f + 42/357? 0 What is the remainder when 1130 is divided by 552/5 - (-18 - 1748/(-95))? 30 Let d be (-90)/(-4)918/(-81). Calculate the remainder when 153 is divided by (-14)/8 - d/20. 10 Let b = -581 + 2155. What is the remainder when b is divided by 67? 33 Suppose -s + 3l = -29, 5l + 1 + 4 = 0. Suppose 4i = 2i + s. Calculate the remainder when (-72)/(-216) + (0 - (-124)/6) is divided by i. 8 Suppose 19z + 15743 = 99z - 1457. What is the remainder when 1089 is divided by z? 14 Let x(c) = c3 - 10c*2 - 16c + 275. What is the remainder when 1197 is divided by x(7)? 13 Let z be (-706)/3396/(-24). Suppose -891 = 34w - z. Let n = 18 - 0. Calculate the remainder when w is divided by n. 16 Let w = 20902 + -20874. What is the remainder when 727 is divided by w? 27 Let y = -254 + 2202. What is the remainder when y is divided by 15? 13 Let m(v) = v*2 - 38v + 2. What is the remainder when 632 is divided by m(38)? 0 Let m = -673 - -3106. Calculate the remainder when m is divided by 5. 3 What is the remainder when 1292 is divided by ((-1232)/10)/(6/(-15)) - (-7)/1? 32 Let w = 24 + 5. Let c = -3136 - -3168. Let p = c + w. Calculate the remainder when p is divided by 21. 19 Let o = 80997 + -80700. Let y(c) = -5c. What is the remainder when o is divided by y(-5)? 22 What is the remainder when 297 is divided by (1 + (-14)/8)/((-30)/1000 + 0)? 22 Let s(d) = 4d*2 - 5d + 44. Calculate the remainder when s(7) is divided by 27. 16 Let c = 229 + -107. Let v be 18(-141/(-12) - 1). Calculate the remainder when c is divided by ((-2)/v)/(-5(-8)/(-1860)). 29 Let t(q) = -14q*3 + 26q*2 + 92q + 10. Suppose -7 = 3p + 2u - 4, -2p + 2u = -8. What is the remainder when t(-2) is divided by 135/12 + p/(-4)? 9 Suppose 0 = -4o + k + 42, k = -3o + 41 - 6. Let s(d) = d + 10. Calculate the remainder when 292 is divided by s(o). 19 Suppose -m = -3m + 34. Let o = -2152 - -3080. Suppose 0 = 35n - o - 717. Calculate the remainder when n is divided by m. 13 Let x(f) = -f*3 + 10f*2 - 18f + 8. Let t be x(7). What is the remainder when 82 is divided by 87/t + 1/((-3)/(-27))? 10 What is the remainder when (-148)/(-10) + (-25)/(-124 - 1) is divided by 5? 0 Let w(z) = z*3 - 10z*2 + 20z + 31. Let s be w(15). Suppose s = 49b - 33b. Calculate the remainder when b is divided by 23. 22 Let p = 2393 - 1359. Suppose 29l - 7l = p. Calculate the remainder when 184 is divided by l. 43 Let a(q) = 0 + 9 - 3 + 29q. Calculate the remainder when a(5) is divided by (14/5)/((-326)/(-1630)). 11 Let a(n) = 2339n + 11798. Let t(r) = 2r2 - 7r - 7. What is the remainder when a(-5) is divided by t(6)? 11 Suppose 2x - 113 = x. Suppose -4p + 2p + 109 = 5k, 5k - x = -4p. Let d = 88979 + -88813. What is the remainder when d is divided by k? 19 Let o(s) = s*3 - 16s*2 - 17s + 15. Suppose 5g - 2d = -387, -g - 95 = -2d + 6d. Let p = 134 + g. What is the remainder when p is divided by o(17)? 10 Let h(f) = -f*2 - 54f + 5481. What is the remainder when 282 is divided by h(51)? 30 Suppose 3l = 5c - 1207, 972 = 4c - 5l + l. Calculate the remainder when 974 is divided by c. 18 Let r(j) = -44j + 581. Calculate the remainder when r(13) is divided by (-3)/(-1)7/21. 0 Let t = 18760 - 10083. What is the remainder when t is divided by 10? 7 Let y = -3125 - -7091. What is the remainder when y is divided by 64? 62 Suppose 25f = 38f - 11861 - 7574. What is the remainder when f is divided by 217? 193 Let u(b) = 26b - 27. Let h be u(24). Let d = -417 + h. What is the remainder when d is divided by 26? 24 Let v = -20 + 33. Calculate the remainder when v is divided by (-10)/6015(5 + -3) - -7. 1 Let y(l) = -l3 + 10l*2 + 3l - 25. Let s be (-3)/(63/(-60)). Let u be y(s). Suppose u = -4w + 49. Calculate the remainder when 43 is divided by w. 10 Suppose -17d + 12d + 47867 = -9s, -2d = 2s - 19158. Calculate the remainder when d is divided by 20. 17 Suppose 17i - 210 = -6. What is the remainder when 547 is divided by i? 7 Suppose -12820 = -7h - 4182. Suppose k + 217 = h. Calculate the remainder when k is divided by 17. 14 Calculate the remainder when (-287355)/(-735) + (-10)/(-245) is divided by 56. 55 What is the remainder when (1278/710)/((-3)/(-9055)) is divided by 24? 9 Let d(w) = 10w*2 - 42w + 21. Let n be d(10). Let a = -583 + n. What is the remainder when a is divided by 4? 2 Let r(o) = o*2 + 221o - 8610. Calculate the remainder when 2896 is divided by r(34). 16 Let z(b) = -5b3 + 34b*2 + 8b + 21. Suppose -5f + 84 + 421 = 0. What is the remainder when f is divided by z(7)? 17 Suppose 0 = -2t + 3f + 2f - 135, -f = 4t + 237. Let n = -13 - t. Suppose -25 = -o - 13. Calculate the remainder when n is divided by o. 11 Suppose 141 = 3j + 4i, 19 = 4i - 5. What is the remainder when 69 is divided by j? 30 What is the remainder when (-56448)/(-135) + 34/(-90) is divided by 106? 100 Let l be (2/(20/(-6)))/((-2)/10). Suppose s = 5j + 30, -21 = -5s + lj + 41. What is the remainder when (-1)/(-4) + (-1550)/(-40) is divided by s? 9 Suppose b - 5w - 24 = 19, 2b - 62 = 4w. Suppose 181h - 120h + 5907 = 94h. What is the remainder when h is divided by b? 18 Suppose -53u - 50u - 36u = -38503. What is the remainder when 8857 is divided by u? 270 Let w be 10((-65)/25 - -3). Let k be (w/6)/(2/9). Suppose -26 = -2r - kr + 2q, 0 = -r - 3q - 5. What is the remainder when 5 is divided by r? 1 Calculate the remainder when 367 is divided by (0 + -15)(-36)/27. 7 Let j(b) be the second derivative of b4/12 - 2b*3 + 5b*2/2 - 41b. Let k be j(12). Suppose 70 = kr - 0r. What is the remainder when 137 is divided by r? 11 What is the remainder when (-10740)/(-48)5/((-150)/(-48)) is divided by 48? 22 Suppose 5q - 128 = 4p, 10q + 43 = 11q + 5p. Calculate the remainder when q is divided by 11. 6 Let k(m) = m*3 + 12m*2 - 42m - 473. What is the remainder when k(-10) is divided by 58? 31 Suppose 5v = -y + 254, 0 = 2y - 3 - 5. Suppose -15 = -m + 11. Let u = -12 + m. What is the remainder when v is divided by u? 8 Let u(n) = 2n2 - n - 41. Let b be u(5). Suppose -180 = -bz - 5s, 3z - s = -3s + 142. What is the remainder when z is divided by 19? 12 Let k(l) = -3 + 0 - l - 1 + 2l*2 - 2. Let a be k(-2). Suppose -28 = ab - 92. Calculate the remainder when 31 is divided by b. 15 Suppose -8y - 3z = -4y - 227, 133 = 2y - 5z. Suppose 7 = j - 4. Suppose -50 = 6l - jl. Calculate the remainder when y is divided by l. 9 Calculate the remainder when (((-33)/4)/(-11))/(2/376) is divided by 57/388/3 - -5. 6 Suppose 5w = 6w - 4. Suppose -wp + 359 = -753. Suppose 5r = 347 + p. Calculate the remainder when r is divided by 21. 20 Let k = 203 - 163. Suppose 2b + 4z = k, 4z - 30 = -4b + 50. Calculate the remainder when 56 is divided by b. 16 Let a = 409 + -406. Suppose -v + am = -6, v - 5m = -4v + 40. What is the remainder when 29 is divided by v? 2 Let y(z) = 2z*2 + 3z - 18. Let f(n) = n*3 - 13n*2 + 4n - 60. Let t be f(13). Calculate the remainder when y(t) is divided by 18. 14 Suppose 319 + 17 = 7d. Suppose f - 2l = d, -6f + 3l = -f - 268. Calculate the remainder when 166 is divided by f. 54 Suppose d - 28 = -0d. Suppose -413 + 51 = -2q + 84. What is the remainder when q is divided by d? 27 Suppose 5a = 3a + 88. Suppose -4v + 162 = 2x, 5x - 260 = -5v + 160. Let y = x - a. What is the remainder when y is divided by 11? 10 Let p(g) = g*2 - 114g + 2041. Suppose 2y - 59 = 61. Suppose -4z = -3r - r - y, 0 = -4z - 4r + 20. Calculate the remainder when p(22) is divided by z. 7 Suppose 891f - 192 = 887f + 2b, 141 = 3f - 2b. Calculate the remainder when 558 is divided by f. 48 Let n = 1231 - 1139. What is the remainder when n is divided by 26? 14 Suppose 4g - 4 = 8. Suppose 4j + 79c = 84c + 62, -47 = j + 5*c. Calculate the	{ "pile_set_name": "DM Mathematics" }
on divisor of z and d? 37 Suppose k - 31 = -3w, -2k - 41 = -3k - 5w. Suppose -12o = -360o - 159o + 77064. What is the highest common divisor of o and k? 8 Suppose 11w + 10 = -78. Let b(a) = a*2 - 8a - 48. Let i be b(w). Calculate the highest common divisor of i and 60. 20 Suppose -3o - 5u - 13 = -4o, 3o - 90 = -2u. Let z = o + 14. Calculate the highest common divisor of 18 and z. 6 Let j(z) = -366z*3 - 6z*2 - 13z - 8. Let p be j(-1). What is the highest common factor of 5 and p? 5 Let k(u) = 2u - 4u + 4u + 1 + 13. Let q be k(-11). Let x be (-9)/(108/(-64))(-18)/q. What is the greatest common divisor of 60 and x? 12 Let r be (31 + -34)/(2/(-14)). Calculate the highest common factor of r and 4410. 21 Let x(l) = 27l + 464. Let k be x(-12). Calculate the greatest common divisor of k and 1155. 35 Let h(y) = 6y*2 - 9y - 70. Let w be h(7). What is the highest common factor of 207 and w? 23 Let j be 189/(-441)28/(-6). Suppose -5x + jn + 136 = 0, -x + n = -2 - 24. Calculate the greatest common divisor of 602 and x. 14 Let y = -9257 + 10473. What is the greatest common divisor of 1088 and y? 64 Suppose -54 = 6z + 3z. Let m be (82/z)/((-2)/6). Let v = 45 - m. Calculate the greatest common factor of v and 4. 4 Let o be 246/8 - (-5)/4. Let g be 5 + o/(-40) + 258/10. What is the highest common factor of g and 30? 30 Let i be 124/32 + 20/160. Suppose -v + 83 = -b, -4v + 2b + 324 = -0b. Suppose 299 = 5s + v. What is the highest common factor of s and i? 4 Let i(q) = -7q + 59. Let z(p) = 14p - 118. Let f(m) = -5i(m) - 2z(m). Let v be f(14). What is the greatest common divisor of v and 3? 3 Suppose 0 = -80f + 74f + 662 - 182. Let u(g) = g3 - 4g*2 - 4g + 5. Let i be u(5). What is the greatest common divisor of f and i? 10 Suppose -51r + 61 + 8507 = 0. Calculate the highest common divisor of r and 357. 21 Let r be (2 - -1)(-1)/((-3)/(-30)). Let q be (1 + (-345)/r)(1 - -1). What is the highest common factor of q and 50? 25 Suppose 1826y = 1885y - 206972. What is the greatest common divisor of 4 and y? 4 Let h(f) = -f2 - f. Let d be h(2). Let m = 50 + d. Let b = -36459 - -36467. What is the highest common factor of b and m? 4 Let t = 15199 - 12479. What is the highest common divisor of 30 and t? 10 Suppose 11h = 16h, 4h - 5 = -g. Suppose -3s = -3q, g + 15 = s + 3q. Calculate the greatest common factor of 65 and s. 5 Suppose -16w + 5640 + 12536 = 0. Let q = -672 + w. What is the greatest common factor of 29 and q? 29 Let s(x) = x*2 - 14. Let t be s(4). Suppose tk - z - 51 = 3k, -90 = 2k - 2z. Let f = -33 - k. Calculate the greatest common divisor of f and 3. 3 Let g be -7(92/28 + -4). Suppose 4a + y = 142 + 145, -ga + 358 = 2y. What is the highest common factor of a and 9? 9 Let d(k) = k3 + k2 - k + 19. Let g = 23 - 23. Let q be d(g). Let s = 569 + -531. What is the highest common divisor of s and q? 19 Let x = 2 - -80. Let t(z) = -40z + 8. Let g be t(-8). Calculate the highest common factor of x and g. 82 Let j be 6/(-2)11/(-11). Let u = 45 + -31. Suppose -ul = -l - 156. What is the highest common factor of j and l? 3 Suppose -3j - 128 = -i, -2i + 5i + 3j = 372. Let f be (8/3)/((-1)/(-3)). Let o be (-1792)/(-36) - f/(-36). What is the highest common divisor of i and o? 25 Let c(j) = 116j - 3311. Let x be c(33). What is the greatest common factor of x and 3243? 47 Suppose -20n + m - 188 = -24n, -2n = 2m - 88. Calculate the highest common factor of n and 136. 8 Let v = -12177 + 17459. Calculate the greatest common factor of 2224 and v. 278 Let x = -2 - -3. Let b be (285/21 + -11)/(3/141). What is the highest common factor of x and b? 1 Let b = 38926 + -38707. Calculate the greatest common divisor of b and 174. 3 Let l(i) = -7i3 - 9i*2 + 3i + 4. Let o be l(-2). What is the highest common divisor of 1278 and o? 18 Suppose u = 3a - 1646 - 424, -2a = 5u - 1363. What is the greatest common factor of 13 and a? 13 Let u be 5 - ((-32331)/15 + 112/80). Calculate the greatest common divisor of u and 17. 17 Suppose -m + 9m = -0m. Let l be 35 + m(-2)/(-4). Let k be 6/l - 1 - 48/(-5). Calculate the greatest common divisor of 45 and k. 9 Let z = -13 + 25. Let n(x) = 3140x - x*2 - 14 - 3123x - 1. Let v be n(z). Calculate the highest common divisor of 315 and v. 45 Let i = 171 + -84. Suppose -2n = 5d - 125, -4d = 7n - 8n - i. What is the highest common factor of 575 and d? 23 Suppose -4 - 4 = -2g. Let s(a) = 6a2 - 4a + 10. Let n be s(g). Let c = 86 - 76. What is the greatest common factor of n and c? 10 Suppose 4j = -5g + 6652, -402j + 4g + 3274 = -400j. Calculate the greatest common factor of 513 and j. 57 Let g be (2 - ((-472)/(-16) + -9))(-694 - 4). What is the greatest common factor of g and 37? 37 Let b = -26 - -27. Let t be (b + 20)(-2 + (2 - 1)). Let n = 24 - t. What is the highest common factor of n and 30? 15 Let v(m) = -m2 - m + 33. Let x be v(-6). Suppose 0 = -3j - 4o + 128, -xj + 2o = -6j + 130. Calculate the highest common factor of j and 484. 44 Let g be (-64630)/(-92)14/5. Suppose 11p = 1443 + g. What is the highest common divisor of 62 and p? 62 Suppose 58z - 566 = -225z. Let j = -19 - -38. Calculate the greatest common factor of z and j. 1 Let l(p) = -p*2 + 77. Let b be l(0). Suppose 2w - x + 550 = -910, w - 5x + 712 = 0. Let r = w + 739. Calculate the highest common divisor of r and b. 7 Let k be (2 - 1)(50 - -10). What is the greatest common divisor of 3090 and k? 30 Let z = -1 - -12. Let h be -4((-581)/(-4))/(-7). Let q = 105 - h. What is the highest common divisor of z and q? 11 Let l = -15498 + 15828. Suppose -237 = -3h + 123. Calculate the highest common divisor of l and h. 30 Let a = -918 - -312. Let m = -549 - a. What is the greatest common factor of m and 19? 19 Let c(q) be the first derivative of 2q + 20 + 1/3q3 + q2 - 11/2q4. Let z be c(-1). Calculate the highest common divisor of z and 161. 23 Let w(u) = 4u*3 - 3u*2 + 7u - 3. Let g be w(3). Let y = -67 + g. Calculate the highest common divisor of y and 96. 32 Suppose 0 = 16o - 9638 + 9062. What is the highest common factor of 1602 and o? 18 Let w(a) = a3 + 23a*2 + 13a + 84. Let l be w(-22). Let s = 374 + l. Calculate the highest common divisor of s and 16. 16 Suppose -3q = -4r - 19 + 4, 3r = 9. Suppose 0 = qz + 12 - 3. Let m be ((-9)/6)/(z/4). What is the greatest common divisor of m and 6? 6 Let i be 125 - (1 - 1). Suppose -a - 4g + 9 = 0, -2a + 16 = -a - 3g. Let s be (-2 - a)(-20)/i. What is the highest common factor of s and 48? 12 Suppose 0 = g - 22 - 146. Let b be ((-42)/35)/((5/100)/(-1)). What is the highest common divisor of b and g? 24 Suppose 0 = -4o - 3a + 70 - 22, o + a = 9. Let i be (-1)/3 + (-100)/(-3). Suppose 0 = -2s - i + 89. Calculate the greatest common factor of o and s. 7 Suppose 2t = 11t - 3t. Suppose -37v + 43v - 90 = t. What is the highest common factor of 165 and v? 15 Suppose 4t + l - 521 = 0, l - 1 = -4. Let h = t - 102. Suppose -2f - j - h = -3f, -4j = f - 24. Calculate the highest common divisor of f and 196. 28 Let s(f) = f2 - 47f + 18. Let x be s(47). Suppose -v = q - 43, 0 = -2q - 7 - 3. Calculate the highest common divisor of x and v. 6 Let n be ((-9)/(-9))/((-1)/(-4)). Let r be 6/n - (-30)/(-20). Let v be (r + -24)8/(-16). What is the highest common divisor of v and 4? 4 Suppose 0 = -34j + 24j + 200. Suppose 240 = jq + 4q. Let n = -54 + 94. Calculate the highest common divisor of n and q. 10 Suppose b - d - 246 = 2d, -4b - 5d = -950. Suppose s = 2x - 58, 4s = -5x + 84 + 74. What is the highest common divisor of x and b? 30 Let l = -37361 + 37916. What is the greatest common divisor of l and 720? 15 Let v = 25803 - 19099. What is the greatest common divisor of v and 48? 16 Let s be (-45)/(-6)(-43)/((-1935)/972). What is the highest common divisor of 540 and s? 54 Let f(o) = -o3 - o2 + o + 92. Let r(t) = t2 + 9t - 70. Let g be r(-14). Let n be f(g). What is the greatest common divisor of n and 322? 46 Let z(p) be the second derivative of p3/2 + p2/2 + 30p. Let b be z(6). Let j = 110 + 23. What is the highest common factor of j and b? 19 Suppose 3z + 198 = 5*g, 186	{ "pile_set_name": "DM Mathematics" }
4/3 + 3k*3 - 44k*2 - 4832k. What is the second derivative of p(o) wrt o? -30o + 400 Let n(h) be the first derivative of 7h*3/3 + 131h*2 + 1043h + 2353. Find the first derivative of n(c) wrt c. 14c + 262 Let s(r) = r4 + r3 + r2. Let y(p) = 604p*5 - 3p*4 - 3p*3 - 3p*2 + p - 373. Let c(n) = -3s(n) - y(n). Find the second derivative of c(u) wrt u. -12080u3 Suppose 3v + w = 6w + 31, 12 = v - 2w. Find the third derivative of -6 + 8r + 5r*2 - 54r*5 + 6 - 6r*v wrt r. -3240r*2 Differentiate -67w*3 + 67w*3 + 70w*4 - 1398 + 1763 + 8w + 1767 wrt w. 280w3 + 8 Suppose 0 = -5l + f + 13, -3l + 4f + 3 = f. What is the first derivative of -22o3 - 89 - 12o*3 - 91o*l wrt o? -375o*2 Let r(l) = -3111l*2 + 363l - 5. Let w(k) = -3111k2 + 367k - 6. Let d(p) = 6r(p) - 5w(p). Find the second derivative of d(y) wrt y. -6222 What is the third derivative of -17 + 154f3 + 21f*3 + 394f*3 + 3 - 62f*2 + 64f2 + f4 wrt f? 24f + 3414 Find the third derivative of -13t*3 - 8 - 288t*4 - 13t*3 + 2t*2 - 3t*3 + 340t*4 - 8t wrt t. 1248t - 174 What is the second derivative of 3258223n*2 + 3 - 3258223n*2 + 16 + 115n - 7250n4 wrt n? -87000n*2 Let i(j) be the second derivative of 45/2j*3 - j - 16 + 3/10j*6 - 1/20j*5 + 1/6j*4 + 0j*2. Find the third derivative of i(h) wrt h. 216h - 6 Find the second derivative of -1666g - 323g*2 + 558g - 2268g + 3176g2 wrt g. 5706 Let q(j) = j2 + 2. Let x be q(-2). Differentiate xw + w + 28 - w + w - w2 wrt w. -2w + 7 What is the derivative of 1211 - 1301q3 + 1389q*3 - 235 - 255 + 1135 wrt q? 264q*2 Let r(f) = f - 15. Let w be r(15). Suppose -5h + 11 + 19 = w. What is the third derivative of 3x6 - 13x*2 - 30x*h - 14x2 + x2 wrt x? -3240x3 Let a = -19 + 23. Suppose -64 = -ai + 4. Find the second derivative of 26f4 - if + 2 - 3f4 - 2 wrt f. 276f*2 Let v(y) be the second derivative of -1/4y*5 - 1/6y*3 + 1/15y*6 - 29/12y*4 + 8y + 5 + 0y2. What is the third derivative of v(x) wrt x? 48x - 30 Let s be 28/20 + 9/15. Find the third derivative of -7h2 + 55h*6 + 5h*s - 9h*6 - 3h*5 + 7 + 27h*6 + 5h*5 wrt h. 8760h*3 + 120h*2 What is the third derivative of 1650050i - 2i6 - 1650050i - i*6 + 1993i*2 - 357i*3 wrt i? -360i*3 - 2142 Let q = 622 + -611. What is the second derivative of 35d + 2 + 19d2 - 6d*3 + qd*2 - 12d*2 - 12d*2 wrt d? -36d + 12 Let j(f) = 167f4 - f3 - 682. Let n(l) = 2l4 + l3. Let u(r) = j(r) + n(r). What is the derivative of u(o) wrt o? 676o3 Let b(x) be the third derivative of 3379x*5/60 - 5761x*4/24 - 43x*2 - 25. What is the second derivative of b(z) wrt z? 6758 Find the first derivative of -6893 + 101 + 3433 - 6846 + 3469t*2 wrt t. 6938t Let c be 10 + 1 + -5 + 2. Let r be c(1 + -1 - -2). Find the first derivative of -14j*3 + r + 4j*3 + 7j*2 - 7j*2 wrt j. -30j*2 Suppose -h + 11h = 220. Suppose -5q - 6q + h = 0. Find the third derivative of 33p3 - 28p*3 - 4p*q + 26p*3 wrt p. 186 Let i(f) be the second derivative of -52f + 0f4 + 0 + 53/2f*2 + 0f*3 - 3/20f*5. What is the derivative of i(z) wrt z? -9z*2 Let v(o) = 3275o*4 + 15o*3 + 5o*2 - 3773. Let b(p) = 1637p*4 + 9p*3 + 3p*2 - 1886. Let d(t) = 5b(t) - 3v(t). Differentiate d(g) with respect to g. -6560g*3 What is the first derivative of 4235p*2 - 201p - 3612 + 101p - 4258 + 99p wrt p? 8470p - 1 Let f = -11 - -5. Let g(i) = -145i*2 + 65. Let l(n) = 72n*2 - 34. Let v(c) = fg(c) - 13l(c). Differentiate v(p) wrt p. -132p Suppose -7y = -2y + 20y. Let k(m) be the first derivative of -14/5m*5 - 17/3m*3 + 29 + 0m + ym4 + 0m*2. Find the third derivative of k(x) wrt x. -336x Let a(v) be the second derivative of 0v5 + 0v*2 - 11/2v*3 - 1/30v*6 - v - 20 + 1/6v*4. Find the second derivative of a(w) wrt w. -12w*2 + 4 Find the first derivative of 1462 + 1283 + 1432 - 520 - 123d*2 - 247d + 125d2 wrt d. 4d - 247 Let j(c) be the second derivative of 2c6/15 + 157c*5/10 + 107c*3/6 - 9c*2/2 - 4843c. Find the second derivative of j(a) wrt a. 48a2 + 1884a Find the second derivative of 908j + 1768j*2 - 905j + 3455j2 + 372 wrt j. 10446 Suppose 415 = 5l + 5t, -4 - 12 = -4t. What is the second derivative of -6i2 - 44i + li - 2i3 + i3 wrt i? -6i - 12 Let s = 115 + -104. Find the first derivative of 25f - 21f + s + 8 - 82f wrt f. -78 Let y be (8/(112/(-7)))/(2/(-24)). What is the second derivative of 0f4 - 277f + yf4 + f3 + 8052f*2 - 8052f*2 wrt f? 72f*2 + 6f Let q(v) be the first derivative of 453v3 - 118v + 728. What is the first derivative of q(y) wrt y? 2718y Let n(u) = -u3 + 4u*2 - 6u + 8. Let q be n(2). Find the second derivative of -154 + qw3 + 154 - 83w - 47w3 wrt w. -258w What is the third derivative of 145 + 482r3 + 327r*3 + 1087r*3 - 23 - 2r*2 - 143r*3 wrt r? 10518 Suppose 0 = -126i + 124i + 122. Find the second derivative of -9050f*2 + 26f*3 + 9050f*2 + if - 1 wrt f. 156f Let h(u) = -11547u + 10152. Let k(x) = 11575x - 10152. Let n(l) = 9h(l) + 8k(l). Differentiate n(g) wrt g. -11323 Let y = -284 - -291. Let v = 5 + 0. What is the third derivative of -4q*2 + 45q*v + yq*2 - 66q*5 wrt q? -1260q*2 Let n(i) = -4814i + 6072. Let d(v) = 964v - 1214. Let u(a) = 16d(a) + 3n(a). Differentiate u(r) with respect to r. 982 Let s(p) = 2p*2 + 17p - 143. Let r be (-1)/((2/2 - 3)/2). Let n(f) = 2f. Let u(b) = rs(b) - 4n(b). Differentiate u(t) wrt t. 4t + 9 Let p(d) be the third derivative of 0d - 1/6d*3 - 7 - 1/40d*6 + 2d*2 + 19/60d*5 + 1/6d*4. What is the second derivative of p(q) wrt q? -18q + 38 Let x(p) be the third derivative of -3365p9/168 + 19p5/4 + p4/12 - p*3/3 - 4031p*2. Find the third derivative of x(r) wrt r. -1211400r*3 Suppose -2k = -7 - 3. Suppose -4o - k = -29. What is the first derivative of -ou + 3u - 5 - 9u wrt u? -12 Find the third derivative of 554l3 - 383l*3 - 3 - 83l*2 + 1017l*3 wrt l. 7128 Let r(v) be the third derivative of -7/60v*5 + 0 + 92v*2 - 49/6v*4 + 0v + 0v3. Find the second derivative of r(f) wrt f. -14 Let k(d) be the third derivative of d9/168 + 5d8/56 + d7/30 - 432d5/5 + 2d*2 + 403. Find the third derivative of k(g) wrt g. 360g*3 + 1800g*2 + 168g Suppose 19a = 12a + 28. Differentiate -75g3 + 50g*4 + 43g*4 + a + 19 + 76g*3 with respect to g. 372g*3 + 3g*2 Let y(k) = 4k - 2. Let a = 98 + -94. Let h be y(a). What is the first derivative of 15 - hf3 + 14f*2 - 29f*2 + 15f*2 wrt f? -42f*2 Find the third derivative of -85h*5 - 80 - 113 + 68h*5 + 12h*3 - 2h*2 - 64h*3 + 0h*2 wrt h. -1020h*2 - 312 Differentiate 5312 - b + 220558b*3 + b - 220566b*3 + 262b*4 wrt b. 1048b*3 - 24b*2 Let l be 183/(-27) - 10/45. Let o be l/((-63)/160) + (-8)/(-36). Find the first derivative of -5 - o - 9i - 2i wrt i. -11 Let h be (-1 - 33/9)-51. Let d = h + -118. Find the third derivative of 239n4 - dn*4 - 117n*4 - 18n*2 wrt n. 48n Let h(p) be the second derivative of 634p7/21 - 115p*4/4 - 2p*2 + 2655p. What is the third derivative of h(d) wrt d? 76080d2 Let p(k) = -2k*2 - k. Let o = 245 - 248. Let i(m) = 93m*2 + 3m - 122. Let d(c) = op(c) - i(c). What is the derivative of d(f) wrt f? -174f Let i(n) = -68n2 + 69n - 909. Let b(a) = 17a2 - 17a + 227. Let o(y) = -9b(y) - 2i(y). Differentiate o(z) wrt z. -34z + 15 Let m(z) be the first derivative of -1639z*3/3 + 2672z*2 + 1199. What is the second derivative of m(y) wrt y? -3278 Let v be -30(5 + (-115)/25). Let u be 2 + 22/26 - v/78. Find the first derivative of -36z - 21 + 36z - 4 + 2zu wrt z. 6z*2 What is the third derivative of -3101y - 340y2 - 3125y - y*4 + 6226y - 31y3 wrt y? -24y - 186 Suppose 3i - i + u - 2 = 0, -2u - 5 = i. Differentiate -24 - 14 + 34ni + 6 wrt n. 102n2 Let n(o) = -o3 - 5o2 - o - 1. Let k(q) = -275q*4 + 5q*3 + 25q*2 + 5q - 515. Let s(u) = k(u) + 5n(u). Differentiate s(m) with respect to m. -1100m**3 Let g(j)	{ "pile_set_name": "DM Mathematics" }
third derivative of -2875847p6 - p2 + 167p - 1024? -345101640p3 Find the third derivative of ft*4 + 6ft3 - 538ft2 - 4ft - 472t5 + t3 + 4 wrt t. 24ft + 36f - 28320t*2 + 6 Differentiate -410b*2 - 304b + 454870. -820b - 304 What is the third derivative of 2n*4 - 1862335n*3 - 10n*2 + 102716n? 48n - 11174010 What is the derivative of 140768j + 182792? 140768 What is the second derivative of -4g5 + 243g*4 + 17g*3 + 3g + 607? -80g3 + 2916g*2 + 102g Differentiate -1623482j4 + 883654 wrt j. -6493928j*3 Find the second derivative of 206a*3j - 2a3 - 2a*2j - 84a2 - 2aj - 6122a - 7j wrt a. 1236aj - 12a - 4j - 168 What is the derivative of -347h*3ir3 + 65h*3ir2 + 3h*3r*3 + 2h*3r*2 - 1377h*3r - 6h2r wrt i? -347h3r*3 + 65h*3r*2 What is the third derivative of 4847g*3o*2 - 162g*3 - 39861g*2o*2 + 7go2 wrt g? 29082o*2 - 972 What is the derivative of 14804c*3 + 25c*2 + 2c - 4447838 wrt c? 44412c2 + 50c + 2 What is the second derivative of 27906y2 - 3y - 3745 wrt y? 55812 Find the second derivative of 81698bv*2 + 9bv - v - 555 wrt v. 163396b What is the second derivative of -3065sz*3 - 124sz - 59z*4 + 648z wrt z? -18390sz - 708z2 What is the second derivative of 2l*5 - 103216l*4 - 41667l + 19 wrt l? 40l3 - 1238592l*2 Find the second derivative of -284o*2p*2 - 4o*2p + 10o2y*3 - 4op2y*3 - 2op2y*2 + 22op2 - 2p*2y*3 - 75y*3 wrt o. -568p*2 - 8p + 20y3 Differentiate -272200m*2 + 10237. -544400m What is the third derivative of 656794v3 + 686583v*2? 3940764 What is the third derivative of 44774tx4 - 102tx2 - 21t - x*3 - 2x*2 + 2x wrt x? 1074576tx - 6 Find the first derivative of 14551l - 17856. 14551 What is the third derivative of 2c*3d*5 - 24c*3d*2 + 2985cd5 - 637d*2 wrt d? 120c*3d*2 + 179100cd2 Find the second derivative of 964b*3p*2 - 336b*3p + 4bp*2 + bp + 37b + 11p*2 wrt b. 5784bp2 - 2016bp Find the first derivative of 88455v*3 + 62993. 265365v*2 What is the second derivative of 6p*4 + 42p*2q - 11551p + q wrt p? 72p*2 + 84q What is the third derivative of -62385o3 - 3889o*2 - 79o wrt o? -374310 Find the first derivative of -8bu*3 + 161bu2 - 55b - 320u3 - 51u*2 + u wrt b. -8u*3 + 161u*2 - 55 Find the second derivative of 38904l*3 - 9l*2 - 181640l wrt l. 233424l - 18 What is the second derivative of -18g*3il - 633g3 + g2 + gil - gi - 2gl + 3l - 125 wrt g? -108gil - 3798g + 2 Find the first derivative of -5272408q + 402572. -5272408 What is the second derivative of 6401j*3 + 2j*2 + 93j - 13? 38406j + 4 Find the second derivative of -1058o*3q*2 + 45000o*3 - 3o*2q*2 - 4oq - 7q*2 wrt q. -2116o*3 - 6o*2 - 14 What is the second derivative of 1086x*4 - 1957x*2 - 3132541x wrt x? 13032x2 - 3914 Find the second derivative of -63u*4 + 883u*3 - 44509u wrt u. -756u2 + 5298u Find the first derivative of h*2 - 1681h - 7307. 2h - 1681 Find the third derivative of 72295f*4 + 2f*2 - 160f + 1 wrt f. 1735080f What is the derivative of 39o*4 - 1432o*2 - 300433 wrt o? 156o*3 - 2864o What is the derivative of -33h2 - 3hm - 393h + 190326m wrt h? -66h - 3m - 393 Differentiate -23246t*2w2 + w2 + w - 4537 wrt t. -46492tw*2 Find the third derivative of -26074f*3 - 5217f*2 + f wrt f. -156444 What is the third derivative of 188q*5 - 4547q*3 + 1888q*2 - 53q wrt q? 11280q2 - 27282 Find the second derivative of 25g*5 + 71g*3 + 4g*2 + 135854g. 500g3 + 426g + 8 Find the second derivative of -31572k4 + 579k + 6. -378864k2 What is the second derivative of 2102i*4 + 164i*2 + 229017i wrt i? 25224i2 + 328 Find the second derivative of 206158v*4 - 2v*2 - 13993v - 1 wrt v. 2473896v2 - 4 Find the third derivative of 34f*3m*3 + 26f*3m2 + f3m + 3f*2m*2 + 303f*2m + 3491m4 + m wrt m. 204f*3 + 83784m What is the derivative of -658az*3 - 25az - 495a - 13 wrt z? -1974az*2 - 25a Differentiate -6g2o + g*2 + 311go - g + 4o - 6978 with respect to g. -12go + 2g + 311o - 1 What is the third derivative of 25665d3v*4 - 2d*3v - 76d3 + 20d*2v*2 + dv*5 - 12v wrt v? 615960d3v + 60dv*2 Differentiate 5572r + 152144 wrt r. 5572 Differentiate -2t3 + 34343t*2 - 5t + 1169679. -6t2 + 68686t - 5 Find the second derivative of 1227302q2x + 9qx - 2q + 707x - 12 wrt q. 2454604x What is the third derivative of 1472863v*3y + 2v3 + 3v*2y - 484165vy wrt v? 8837178y + 12 What is the second derivative of 3j*5r - 11343j4r + 15j - 353r - 3 wrt j? 60j3r - 136116j2r What is the second derivative of 2333130x2 - 2520959x? 4666260 What is the third derivative of 98a2x*5 - 7407a*2x*4 - 192a*2x*2 + 368ax2 + a wrt x? 5880a*2x*2 - 177768a*2x What is the third derivative of 261z4 - 4353z*3 - 2982293z*2? 6264z - 26118 Find the second derivative of -2d2j*2y*2 + 17058d*2j - 2djy + j2y*2 + 9129j*2 - jy*2 wrt j. -4d*2y*2 + 2y*2 + 18258 What is the derivative of -117930q + 109183? -117930 What is the third derivative of -12409m4 - 20m3 - m2 - 29m - 541? -297816m - 120 What is the third derivative of -20d4n - 296d4 - 2d*3n - d*2n - 4d2 - 8645n wrt d? -480dn - 7104d - 12n Differentiate -t*2 - 24860t + 176423 with respect to t. -2t - 24860 Find the second derivative of 1538d*3i*2 - 420d*3 + 3614di2 + 3di - 12d - 2i - 1 wrt d. 9228di2 - 2520d Find the third derivative of 46418l3 + 33959l*2 - 8l wrt l. 278508 What is the third derivative of 2827115st*3 - st*2 - 9137s - t*2 wrt t? 16962690s Find the third derivative of -20105k2w*3 - 3k*2 - 3kw3 + 3994kw2 wrt w. -120630k*2 - 18k What is the second derivative of 55l3 + 145l*2 - 12288l? 330l + 290 What is the derivative of -4996y*2 + 45372? -9992y What is the second derivative of 11i5r + 3346i4r + 3ir - 85r + 3 wrt i? 220i*3r + 40152i2r What is the derivative of -45036cu - 22994c wrt u? -45036c Find the third derivative of 14641x3y + 5x3 + 936x*2y + 13x2 + xy - 1 wrt x. 87846y + 30 Find the second derivative of -29v*4z + 921v4 - 32v + 526z wrt v. -348v*2z + 11052v2 Find the second derivative of 63h*5 + 528h*2 - 22h + 176 wrt h. 1260h3 + 1056 Find the third derivative of 2063561w*3 + 3w*2 + w - 1046. 12381366 Find the first derivative of -14711p*4 + 44929. -58844p*3 What is the derivative of -3m*2 - 1509m + 29553? -6m - 1509 Find the third derivative of -7n*6 - 39n*4 + 47n3 - n2 - 32206n wrt n. -840n*3 - 936n + 282 What is the second derivative of -9b5d + 702b4d - bd + 38246b wrt b? -180b3d + 8424b2d Differentiate 47ot*2 - 94ot - 2o - 58506t2 - t wrt o. 47t*2 - 94t - 2 Differentiate -3609a3 + 32a - 1650559. -10827a2 + 32 What is the first derivative of -95804ms2 + 3s*2 - s + 821 wrt m? -95804s*2 Differentiate 46046t*4 - 63740 with respect to t. 184184t*3 What is the second derivative of -5a*5t*3 - 336a*2t3 + a2 + 10at*3 - 519at wrt a? -100a*3t*3 - 672t3 + 2 What is the derivative of -n3 + 3936n2 - 2n + 247311? -3n2 + 7872n - 2 What is the third derivative of 5a3c*2r - 2027a3 + 2a*2c2 - a2r + 2a*2 + 202c*2r wrt a? 30c2r - 12162 Find the second derivative of -4f5 + f4 + 879f*2 + 2705f - 7 wrt f. -80f3 + 12f*2 + 1758 Find the third derivative of -413101h4 - h2 - 257h - 630 wrt h. -9914424h What is the derivative of -71100g3k2 - g3k - 588578g*3 wrt k? -142200g*3k - g*3 What is the third derivative of -455308a*4 - 364760a*2 wrt a? -10927392a What is the third derivative of -19w3y*4 - 4598w*3 - 415wy6 - w + 2y*2 wrt y? -456w*3y - 49800wy*3 What is the third derivative of 9614hx4 - 2h - 7x3 + 75098x*2 wrt x? 230736h*x - 42 What is the	{ "pile_set_name": "DM Mathematics" }
- r. Round l to 2 decimal places. 0.08 Suppose 1 = 2o + 4a - 3, -5a = -5. Suppose ob + b + 25699999 = -p, 5p + 128500001 = b. Round p to the nearest one million. -26000000 Let q = 6 + -9. Let k = q - -2.976. Let a = -0.182 + k. Round a to 2 dps. -0.21 Let l = -4.5 + 63.5. Let f = 59.000244 - l. Round f to 4 decimal places. 0.0002 Let x be -1 - (-4 + (0 - -192)). Let g = 12 + x. Round g to the nearest 10. -180 Let r be ((-2 - 1)-12217)/(9/(-12)). Let j = -26368 - r. Round j to the nearest 10000. 20000 Let u = -36.29 + 22. What is u rounded to the nearest 10? -10 Let b be -1(20/5 - 4). Suppose 7x - 8x = b. Round x to six decimal places. 0 Let j(m) = -26m - 3. Let h be 15/(-12)(7 - -1). Let x be j(h). Suppose 0 = -s + 1917 - x. What is s rounded to the nearest one hundred? 1700 Let q = 492.001364 + -492. What is q rounded to 4 dps? 0.0014 Let l(o) = -10o*2 - 6o + 22. Let a be l(17). Round a to the nearest one hundred. -3000 Let c = 23 - 22. Let v(u) = 806668u + 8. Let h(p) = 1. Let n(m) = cv(m) - 12h(m). Let b be n(3). What is b rounded to the nearest one hundred thousand? 2400000 Let x = 2.36645 - 2.335. Round x to two dps. 0.03 Let p(j) = -928j + 583. Let a be p(4). What is a rounded to the nearest one hundred? -3100 Let s = 562.6625 - 0.2625. Round s to the nearest ten. 560 Let i = -339 - -372. Suppose -2z - w = -5, 0w - 4w = -2z. Suppose 3c - zs = -20, 3c = 8c - 3s + i. What is c rounded to zero dps? -6 Let f = -94 - -269.7. What is f rounded to the nearest 100? 200 Suppose 204m + 492000 = 220m. What is m rounded to the nearest 10000? 30000 Let a(s) = -8396s*2 - 8s + 4. Suppose -3y + 3k - 15 = 0, 0 = -4y + 4k + k - 16. Let l be a(y). Round l to the nearest 100000. -700000 Let i = 0.77155 + -0.77. Round i to 3 dps. 0.002 Let d = -17.967 - 0.033. Let l = -8935 - -8916.972. Let z = l - d. Round z to two decimal places. -0.03 Let x(m) = -6610m2 + 19m - 90. Let i be x(10). Round i to the nearest 10000. -660000 Let c be 12/(-6) - 14/(-2). Suppose 9s + 1240 = cs. Round s to the nearest one hundred. -300 Let m = -28 - -27.1. Let n = m + 0.89971. Round n to 4 decimal places. -0.0003 Let v = -2264.34 - -2262. What is v rounded to one dp? -2.3 Let k(b) = -b*3 - b. Let m(s) = 10161s*3 + 5s*2 + 7s - 4. Let i(u) = -6k(u) - m(u). Let d be i(4). Round d to the nearest 100000. -700000 Let i = 40 - 49.5. Let a = i - -6. Let m = a - -3.33. What is m rounded to 1 dp? -0.2 Let m be 43(-3)/18. Let n be m - -2811. Suppose 3w - w = n. What is w rounded to the nearest ten? 90 Let d = -57 + 60. Suppose -y - 180001 = -5u, -2u + dy - 16679 = -88682. What is u rounded to the nearest ten thousand? 40000 Let n = -0.41 - -0.38. Let k = -0.0300003 - n. Round k to 6 decimal places. 0 Let o = -4.8 - 22.2. Let m = 4 + o. Let p = 22.947 + m. Round p to 2 decimal places. -0.05 Let v = 0.0295 - 1.3685. Let x = v - -1.338998957. What is x rounded to seven dps? -0.000001 Let s(z) = 1547z*2 + 11z + 2. Let o be s(-4). Round o to the nearest 10000. 20000 Let h(f) = 8097f - 433. Let o be h(-11). What is o rounded to the nearest 10000? -90000 Let y = -0.101 + 40.101. Let w = 39.99777 - y. What is w rounded to four dps? -0.0022 Suppose -32y + 335500 = -27y. What is y rounded to the nearest one thousand? 67000 Let z(p) = -399041p - 16. Let l be z(-2). Let i = l - -811934. What is i rounded to the nearest 100000? 1600000 Let p(d) = 65d2 - 6d - 111. Let u be p(-7). What is u rounded to the nearest one hundred? 3100 Let y = -497 + 494.67. Let v = y - -2.2. Let i = v - -0.130067. What is i rounded to 5 dps? 0.00007 Let q(g) = 11418g + 36. Let p be q(-2). What is p rounded to the nearest 1000? -23000 Let u = -8.30155 - 0.00545. What is u rounded to the nearest integer? -8 Let y = 1.629854 + -1.633. What is y rounded to four decimal places? -0.0031 Let f = 1.26 + -1.06. Let u = 0.05 + -4.05. Let x = u + f. Round x to 0 dps. -4 Let z = 1.85 + -1.7. Let a = z + -7.65. What is a rounded to 0 decimal places? -8 Let x = 13.20009204 + -13.2. What is x rounded to 5 decimal places? 0.00009 Let v be (9/(-2))/9-14. Let l be 1876/v10/(-4). Round l to the nearest 100. -700 Let o = -0.426403 + -297.866597. Let q = -298 - o. Let r = q + -0.023. Round r to 1 decimal place. 0.3 Let c = 159.696708 - 159.7. What is c rounded to three decimal places? -0.003 Let q be (-19)/38-44. Suppose 0d - qd = 96560000. Round d to the nearest one million. -12000000 Let m = 91 + -17.9. Round m to the nearest ten. 70 Let j = 18.3599189 - 18.36. What is j rounded to 5 dps? -0.00008 Let q = 8 + 11. Let i = -6 + q. Let z = 13.00024 - i. Round z to four decimal places. 0.0002 Let a = -128 - -186. Let s = a - 37. Let p = s + -20.9875. What is p rounded to three decimal places? 0.013 Let y = 338841 - 338801.00135. Let r = 6.2 + -46.2. Let q = y + r. Round q to four decimal places. -0.0014 Let u = -7 - -11. Suppose 436466 = ud - 2974858. Suppose 0 = 3k - d - 557169. Round k to the nearest one hundred thousand. 500000 Let w = -132 - -132.0000082. What is w rounded to 6 decimal places? 0.000008 Let g = 2643260 - 6271260. Round g to the nearest 100000. -3600000 Let o = 18.4 + -16. Let s = -5421262 - -5421264.399977. Let d = s - o. What is d rounded to five decimal places? -0.00002 Let q = -686.95 + 695. Round q to one dp. 8.1 Let v be 150/((-1)/(-175)5/14). What is v rounded to the nearest ten thousand? 70000 Let z(h) = 20696h + 32. Let y be z(8). What is y rounded to the nearest ten thousand? 170000 Suppose 2t - 1657 = -3g, -2t + 5t - 1108 = -2g. What is g rounded to the nearest 100? 600 Let n = 171756.494962 - 171612.495. Let j = n + -144. Round j to 4 decimal places. 0 Let f(n) = -86n2 + 19n - 33. Let c be f(-17). What is c rounded to the nearest 1000? -25000 Let b = -5.98 + 6. Let u = b - 0.02. Let m = u - -0.0176. Round m to 3 decimal places. 0.018 Let s = 5956.0000011546 - 5956. What is s rounded to 7 dps? 0.0000012 Let c = 2145 + -3121. Let b = 975.99597 + c. What is b rounded to three decimal places? -0.004 Let x(t) = -94t2 - 4t - 1. Let i be x(7). Let b = 1565 - i. Round b to the nearest 1000. 6000 Let l = 1800000 + -196000. Round l to the nearest one hundred thousand. 1600000 Let g = -0.8028 + -33.2422. Let o = -0.045 - g. Let i = 34.065 - o. Round i to 2 dps. 0.07 Let v = 660 + -670.925. Let t = -11 - v. Round t to two decimal places. -0.08 Let k = -4.9 - -21.6. Let b = 17 - k. Let f = b + -0.300044. Round f to 5 dps. -0.00004 Let r(l) = -6l - 11. Let z(s) = 5s + 10. Let q(n) = -6r(n) - 7z(n). Let p be q(0). Let f be (46 - -2) + 2 + p. Round f to the nearest 10. 50 Suppose 7 = 4j + q - 5, 0 = 3j - 5q + 14. Suppose 129599998 = 4v - jn, -2v + 4n = -0n - 64799996. What is v rounded to the nearest one million? 32000000 Let j = -80 - -28. Let h = 52.00000232 + j. Round h to 7 dps. 0.0000023 Let p = 3.608264 - 3.61. What is p rounded to four dps? -0.0017 Let u = 1417.7 - 1488. Round u to the nearest 10. -70 Let d = 802151791529022 - 802151587957255.9999983. Let o = d - 203571734. Let q = 32 - o. Round q to seven decimal places. -0.0000017 Let m = 156 + -188.9. Let h = m - -37. Let y = 4.10097 - h. Round y to 4 dps. 0.001 Let s(c) = c*2 + 11c - 9. Let o be s(-12). Let a be (-300000 - -2) + o + -5. What is a rounded to the nearest 100000? -300000 Let d = -5 + 5. Suppose -5c + 18 = -2y, d = -5y - c - 2 + 11. Let x be 204004/(-8)2 + y. What is x rounded to the nearest ten thousand? -50000 Let m = -16.4 + 12. Let u = 4.39 + m. Round u to 1 decimal place. 0 Let x = 57545487 + -86155487. Round x to the nearest one million. -29000000 Let a = -729 + 690.5. Round a to the nearest 10. -40 Let f = -18.39281 - -20.292813. Let m = 1.9 - f. What is m rounded to 5 dps? 0 Let c(j) = 21777j2 + 20j + 67. Let v be c(-3). What is v rounded to the nearest ten thousand? 200000 Let h = 21.6073 - 21.7. What is h rounded to 2 dps? -0.09 Let t(i) = -i*2 - 3i + 6. Let m be t(-4). Suppose -mj - 16 = -6j. Suppose d + 4v - 15174 = 1314, 0 = 3d - jv - 49512. Round d to the nearest 1000. 17000 Let k = 528640 - 528639.2000096. Let s = k - 0.8. What is s rounded to 6 dps? -0.00001 Let a(r) = -67r + 5. Let q(i) = -66i + 6. Let s(l) = -3a(l) +	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.