Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
= 138 - m. What is the lowest common multiple of n and 44? 440 Let z(f) = 4f2 + 15f + 9. What is the lowest common multiple of z(-6) and 33? 693 Let n = 0 + 2. Suppose -nd + 2m + 0m - 8 = 0, 3d + 2m + 7 = 0. What is the least common multiple of 11 and (6/10)/(d/(-15))? 33 Find the common denominator of -47/32 and 39/(-104)11/(-18). 96 Let o be -2 + -11 - (0 - 4). Let x(s) = s + 8. Let a be x(o). Calculate the common denominator of a/3(-24)/32 and -107/6. 12 Let t be (3 - (-10)/(-4))-24. Let o be 2/t - (-10658)/12. Let v = o + -1719/2. What is the common denominator of v and 30/11? 22 Let v = 401 - 253. Let j = -1032/7 + v. Find the common denominator of j and ((-125)/70)/((-2)/4). 7 Suppose -5s = -3q + 51, q = 3q - 3s - 33. Find the common denominator of ((-51)/q-3)/9 and -151/12. 12 Suppose 0 = g - 0g - 19. Let n = g - 9. What is the smallest common multiple of 6 and n? 30 Let y = 565 - 592. Calculate the common denominator of y and 119/6. 6 Let r be 9/(-15) + (-609)/35. Calculate the least common multiple of 5/1 - (15 + r) and 2. 8 Suppose 163 = w + 151. What is the smallest common multiple of 4 and w? 12 Suppose 65 = -3u - 4k, -2u + 3k - 49 = -0u. Let m = -31 - u. Calculate the common denominator of 59/10 and 62/32 + (-5 - m). 80 Let w = -486093455/125610388 + -6369/315208. Let b = w + 12/797. Let u = b - -77/16. Find the common denominator of -77/48 and u. 48 Let g(l) = -2l*2 - 20l - 11. Let w be g(-8). What is the common denominator of 9 + -9 - w/2 and 40/7? 14 Let c = -6 - -27/8. Calculate the common denominator of c and 47/40. 40 Let k be (1 + -3)/(288/366488). Let z(p) = 40p3 + p2 - p - 4. Let y be z(-4). Let c = k - y. Find the common denominator of 97/20 and c. 180 Let c = 6960077 - 125247775/18. Let p = 1866 - c. What is the common denominator of p and -97/14? 126 Calculate the common denominator of 97/110 and 742/5929 - 12/21. 1210 What is the common denominator of 91/144 and ((-338)/(-3))/(-45 - 11)? 1008 Suppose -l + 5v + 37 = 0, 5v = 2l - 7l + 95. Suppose -2i - 2w = -l, -2i + i = 5w - 31. Calculate the least common multiple of i and 16. 48 Let r = 11581/1716 - -1/858. Calculate the common denominator of 77/162 and r. 324 Let c = 29 + -7. Let n be (-34)/(-7) - 2/(-14 + 0). Let x(b) = b2 - 3b + 8. Calculate the lowest common multiple of c and x(n). 198 Suppose -4 = -v, 2q - v + 1286 = -3v. Let j = q - -1042. Find the common denominator of j/125(-10)/8 and 1/4. 20 Let b(d) = -d2 - 13d + 17. Let t be b(-13). Let k = 37 - t. Suppose 14 = 4x - 18. Calculate the smallest common multiple of x and k. 40 Let x = 7 + 2. Let f be 10187/(-1150)21/x. Let p = f - -3/1150. What is the common denominator of p and 13/4? 12 Let d(h) = -10h - 110. What is the common denominator of d(-7) and 33? 1 Let c = 11665 - 233197/20. What is the common denominator of c and (-22568)/(-6720) + 2/(-30)? 120 Suppose 9f = 23f - 448. Suppose 25o + f = 29o. What is the lowest common multiple of o and 8? 8 Suppose v - 15 = -10. What is the smallest common multiple of 2 and v? 10 Let f = -28 - -146. Calculate the common denominator of 65/22 + -6 + 2 and f/36 - (0 + 1). 198 Let k(r) = 25r - 535. Calculate the smallest common multiple of 44 and k(23). 440 Suppose 0 = -2f - 50 + 2. What is the common denominator of (0 + (-10)/(-4))/(21/(-231)) and 104/f5/6? 18 Let w = 25242 - 17349. Let v = 47477/6 - w. Let n = -54501/22 - -2475. What is the common denominator of n and v? 66 Let h = 2354 + -2321. Calculate the lowest common multiple of 198 and h. 198 Let a(y) be the second derivative of 3y5/10 - 5y*4/12 - 2y3/3 + y2 - y. Let n be a(4). What is the common denominator of 0 + 2 + n/(-12) and -22/3? 6 Let x = -9461/7 - -1358. Let c be (-2)/(-34)(0 - 29). Let b = 127/85 - c. What is the common denominator of x and b? 35 Suppose -520 = -5i + 2j, -173 = -4i + 3j + 243. Suppose i = 5u + 14. Calculate the least common multiple of u and 8. 72 Suppose -5a = 20a - 50. What is the smallest common multiple of 30 and a? 30 Let k = 606 + -8489/14. Find the common denominator of 21/106 and k. 742 Suppose -4s + 5532 = -8s. Let j = s - -8171/6. Calculate the common denominator of j and 22/16 + 2 - 0. 24 Suppose -2h + 16 = -14. Suppose -11u - 400 = -hu. Suppose -v = -6v + u. What is the smallest common multiple of 16 and v? 80 Calculate the common denominator of -17/48 and 1037/171(-1)/(-60). 240 Suppose 5l - 446 = 2229. Suppose -56z - l = -61z. Calculate the smallest common multiple of z and 1. 107 Let l(n) = n3 + 10n*2 - 19n + 34. Let w be l(-11). Let m = 133 - w. What is the smallest common multiple of m and 33? 33 Suppose -4l = l - 20. Suppose -5u + 0u + 49 = -2d, 70 = 5u + 5d. What is the least common multiple of u and l? 44 Let g be (-2)/(-15) + (-206)/(-30). Calculate the common denominator of (-3)/(-6) + 98/(-20) and (g/(-35))/(1/(-22)). 5 Let n = 1028 - 10301/10. Let r be (-33981)/(-360)2 - 4/6. Let v = r - 896/5. What is the common denominator of v and n? 60 Calculate the common denominator of (20/1890)/(21/(-539)) and -131/18. 162 What is the common denominator of -19/12 and 3/(-7) - (1 + (-537)/1596)? 228 Suppose -3 = 3d - 4d. Calculate the smallest common multiple of 50 and d. 150 Let o(a) = -8a + 20. Let w be o(-6). Suppose 7r = w - 26. What is the smallest common multiple of 16 and r? 48 Let c = 966 - 2009/2. Calculate the common denominator of c and 14/47. 94 Suppose -5z + 210 = 3c - 305, 0 = -4c + 20. Calculate the smallest common multiple of 20 and z. 100 Let l = 5524 + -10573/2. Suppose -242 = g + 3j, 5g + 699 + 446 = -2j. Let h = l + g. Find the common denominator of h and -11/6. 6 Find the common denominator of 25/1158 and 5 - (-7 + 20)(-7)/(-27). 10422 What is the common denominator of (4 - -2)/(1732/84 + -13) and 127/72? 720 Suppose 4p = p. Suppose -2b + 14 = -p. Calculate the smallest common multiple of 7 and b. 7 Let i = 18 - -5. Let j be 0 - ((-32)/(-2) - 3). Let x = j + i. Calculate the least common multiple of 8 and x. 40 What is the common denominator of -27/11 and (-8)/(-28) + -18(-12)/56? 77 Suppose 0 = -2p + 9 - 31. Let x = p - -18. Suppose 2l = -5 + 27. What is the smallest common multiple of l and x? 77 Suppose 3d - 50 = -2d. Let v(b) = -b3 - 18b*2 + 19b. Let a be v(-19). Suppose a = -y - 4y + d. What is the least common multiple of 4 and y? 4 Let q = -292409/131010 + -6/4367. What is the common denominator of 7/276 and q? 1380 Suppose -22q + 3p = -21q - 8, 0 = 2q + 3p - 7. Calculate the lowest common multiple of q and 1529. 7645 Suppose -n + 7d - 2d + 170 = 0, -2n - 5d = -310. Suppose 4v + n = 5o, v = -3v. What is the least common multiple of 6 and o? 96 Let w be 7 + 66/(-9) - 20/(-6). Suppose -wc - l = 3l - 14, 2l = 2c. What is the smallest common multiple of c and 20? 20 Let h = -86 + 92. What is the least common multiple of 4/14 - (0 - (-192)/(-14)) and h? 42 Let r = 1802161409035/4323 - 416877492. Let s = 198/131 - r. Calculate the common denominator of 61/24 and s. 264 Suppose 5f - 95 = -2u, 14 = -2u + 4. Let q(d) be the second derivative of d*3/6 - 3d*2/2 - 7d. Calculate the lowest common multiple of f and q(4). 21 Calculate the common denominator of 1 + ((-54)/(-13))/3 and (1/(-7))/(67/(-1206)). 91 Let j(l) be the first derivative of l*3/3 - 2l*2 + 7l + 13. Calculate the lowest common multiple of 6 and j(3). 12 Let j(b) = 15b - 26. Let t(c) = -30c + 53. Let s(q) = 5j(q) + 2t(q). What is the smallest common multiple of 28 and s(4)? 252 What is the smallest common multiple of 15(54/225)/(6/140) and 15? 420 Let z be (-64)/(-3) - (-8)/(-6). Calculate the common denominator of ((-194)/(-12) - 2) + z/(-15) and -34/15. 30 Let l = 67835/8 + -8468. Find the common denominator of l and 43/121. 968 Let l = -86 + 87. Let i = 9 + -5. What is the smallest common multiple of l and i? 4 Suppose -9x + 4577 = -877. Let y = -7267/12 + x. Find the common denominator of y and 61/9. 36 Let h be 4/439 - 3. What is the common denominator of -95/6 and (1(-436)/(-90))/(h/27)? 30 Let y(s) = s + 6. Let o be y(10). What is the least common multiple of 16 and (((-225)/10)/(-9))/(4/o)? 80 Let p(h) = -h*3 - 8h**2 - h	{ "pile_set_name": "DM Mathematics" }
10)/(-6) -2/9 Calculate ((-36)/672)/((-3)/4). 1/14 (2/1)/2-1-5 5 ((-36)/48)/(6/(-40)) 5 Evaluate ((-33)/77)/((-54)/168). 4/3 Evaluate ((-27)/243)/((-1)/6). 2/3 Calculate (184/(-46))/((-2)/2). 4 What is the value of 36/(-216)3/(-2)? 1/4 What is the value of (2/30)/((-6)/(-144))5? 8 Evaluate ((-7)/6)/((-10)/(-30)). -7/2 What is -14/2(-7)/(-14)? -1 What is the value of 7((-144)/(-56))/6? 3 Calculate 8/421/14. 3 Evaluate 2/6159/45. 1 Calculate ((-1)/(-2))/((-15)/30). -1 Evaluate 2/((4/(-6))/(76/798)). -2/7 Evaluate ((-10)/(-1))/((-10)/((-45)/(-9))). -5 Evaluate (2/(-54))/(11/(-66)). 2/9 Evaluate 3((-21)/3)/214. -4 What is (-6)/3(-1)/(24/15)? 5/4 Calculate (54/30)/((-6)/(-27)). 3 Evaluate 10/(-9)(-144)/240. 2/3 What is the value of 18/((-4)/(-1))? 2 Calculate (2/(-10))/((-14)/10). 1/7 What is the value of 9/(-900)-20(-5)/8? -1/8 Evaluate -14/((-12)/3)5. 5 What is the value of 1(5/15)/((-2)/(-6))? 1 Calculate ((-5)/3)/((-1925)/70). 2/33 What is the value of 18/2835-14(-5)/(-2)? -2/9 Calculate (-2)/((-9)/(90/4)). 5 What is the value of (4/6)/((-98)/(-1323))? 9 What is the value of (36/120-4)/(6/40)? -8 What is (-2)/(-8)(-24)/36? -1/6 ((-20)/6)/(14/(-56)8) 5/3 What is the value of ((-28)/28)/(2-1)? 1/2 What is -2-51(-1)/(-2)? 5 (96/600)/(2/5) 2/5 What is the value of (1/(-1)0/(-1))/1? 0 Calculate ((-10)/((-180)/63))/(3/6). 7 What is (-1)/((-18)/(-24))3/(-1)? 4 Calculate (-6)/84-414/2. 2 What is the value of (2/(-3))/((-5)/(-30))1? -4 Evaluate (6/(-4))/((9/(-2))/3). 1 What is the value of (-2)/1(-2)/12-9? -3 What is the value of (-2)/(-10)70/(-42)? -1/3 Calculate (2/1)/(-2)5/(-25). 1/5 5(8/60)/((-65)/15) -2/13 What is ((-2)/(-20))/(2/5)2? 1/2 (((-9)/(-6))/(9/(-4)))/5 -2/15 Calculate 297/(-396)(-22)/(-2). -3/2 Calculate 44/(-33)(-3)/(-36). -1/9 What is the value of (-8)/16(-3)/(-1)? -3/2 Calculate 151((-16)/(-6))/(-8). -5 Calculate (16/(-12))/(32/(-120)). 5 ((7/2)/(-7))/(-2) 1/4 What is the value of 20/(2/(-16)780/(-39))? 8 (-2(-7)/(182/(-4)))/(-2) 2/13 Calculate ((-10)/(-24))/(3511/231). 1/4 -85/(-150)-3 -4/5 2/3(-126)/28 -3 (-36)/27(-45)/10 6 What is ((-68)/153)/((-12)/(-54))? -2 What is the value of (6/(-144)3)/((-3)/(-12))? -1/2 Calculate ((-60)/(-16))/5-4. -3 Evaluate 3/75/15. 1/7 (141/188)/(1/((-20)/18)) -5/6 What is (19/((-950)/40))/((-2)/10)? 4 What is the value of (7/(980/(-8)))/(7/49)? -2/5 Calculate (2/6)/(4/(106)). 5 What is the value of (-144)/(-168)21/3? 6 Calculate ((-6)/8)/((-145)/(-116)). -3/5 What is the value of (-11)/(((-11)/11)/(-1))? -1 What is (-17)/(-2)408/578? 6 What is the value of ((-1)/(-16))/((-71)/(-284))? 1/4 -43/(-16)32/(-48) -1/2 (16/(-42))/(-181/(-21)) -4/9 What is (-2)/(-3(-3)/9)? -2 Calculate 24/1027/81. 4/5 Calculate ((-5)/(-1))/50. 0 ((-5)/(-3))/(((-1400)/(-180))/14) 3 (-1)/1((-1)/(-1))/(-1) 1 (-8)/((-24)/(-1))3-7 7 Evaluate (116/58)/(2/(-4)). -4 ((816/(-1615))/12)/((-2)/(-5)) -2/19 Evaluate ((-2)/3)/(21/(-126)). 4 ((-17)/2)/(-17)6/(-9) -1/3 What is (-2)/(-1(-8)/(-2))? 1/2 6/(-4)((-64)/6)/(-8) -2 Calculate 13/(-20)(-15)/6. 3/8 (-1)/(7/(-63)(-6)/2) -3 What is (-2(-1)/1)/((-6)/(-9))? 3 What is ((-2)/6)/((-62)/558)? 3 Calculate (-5)/(-20)((-8)/5)/(-1). 2/5 Evaluate (24/(-6))/1(-1)/(-2). -2 What is the value of (-1)/(-5)-155/44? -1/4 Calculate (14/70)/(2/(-15)). -3/2 What is (-4)/(-35)20/8? 2/7 What is ((-4)/(-50))/(18/40)? 2/5 Evaluate 8/(2/((-14)/21)). -8/3 (-4)/(-16)(24/5)/6 1/5 What is 612/6040/(-12)? -4 5/14(-32)/40 -2/7 What is (225/10)/92? 5 What is (-2)/(8/162)? -2 33/364 1 What is (165/(-170))/11(-24)/18? 2/17 Calculate 15/9-31/15. -1/3 What is the value of (-2)/74/(-8)? 1/7 Evaluate 1(27/9)/(-6). -1/2 Calculate 236/29510/(-12). -2/3 What is (7/(-126)-21)/7? 1/6 Calculate ((-36)/54)/((5/3)/(-1)). 2/5 Calculate 2/221/(-2). -1 Evaluate 1(-2)/136(-208)/26. 2/17 (15/5)/(39/26) 2 What is the value of (316/84)/(-6)? -2/21 Evaluate -33/632. -2/7 What is the value of ((-24)/3)/450/650? -2/13 What is the value of 3/((-3)/42)? -2 (945/(-675))/((-1)/(-5)) -7 What is (17/14)/((-1)/(-6))? 3 -3((-25)/5)/15 1 Evaluate ((-16)/(-28))/((-5)/(-7)). 4/5 What is (20/(-14))/((-86)/(-301))? -5 Calculate ((-1)/4)/((-8)/32). 1 What is the value of ((-10)/(-90))/((-1)/(-3))0? 0 Calculate ((-240)/9)/(-8)24/(-10). -8 Evaluate 18/6(-4)/(-20)-1. -3/5 What is -10((-27)/(-25))/9? -6/5 Calculate ((-6)/(-156))/(18/117). 1/4 What is (-3)/(-2)16(-5)/150? -4/5 (0/(-11))/(21) 0 Calculate 2/(-3)27/135. -2/15 Calculate ((-6)/(-4))/(9/18). 3 What is (-4(-11)/(-88))/(1/2)? -1 Calculate (-2)/(-4)27/(540/(-40)). -1 What is ((-6)/(-2))/((-21)/7)? -1 What is the value of 2/(2/(-2))1/(-6)? 1/3 What is the value of ((-3)/(-11))/(2/(-4))? -6/11 What is ((4/(-2))/1)/1? -2 What is the value of 3/18(-16)/4? -2/3 Evaluate -310/305. -5 Calculate (-2)/(-2(-4)/(-20)). 5 What is the value of ((-12)/15)/((-7)/((-420)/(-8)))? 6 Evaluate (-8)/1015/600. 0 Calculate ((-14)/(-28))/(-1(-2)/12). 3 Calculate ((-2)/2)/((-5)/15-1). -3 (-15)/6(-192)/(-80) -6 What is the value of 0/((-5)/((-25)/(-5)))? 0 Calculate (3/(-7))/(((-174)/(-8))/(-29)). 4/7 What is the value of (36/10)/(36/(-90))? -9 1(-2)/3(-195)/(-455) -2/7 Evaluate ((-12)/6)/((-117)/(-26)). -4/9 Calculate (150/(-40))/(-3)(-4)/(-10). 1/2 What is 65/(75/20)? 8 Calculate 3/(-3)2/22. -2 What is the value of (-955)/5733/82? -5/4 Calculate 48/321/2-4. -3 Calculate (8/12)/(19/(3078/(-12))). -9 Evaluate (7/4)/(18/(-72)). -7 What is (3125/(-75))/(2/2)? -5 Calculate 22(-3)/((-120)/(-4)). -2/5 What is 43/456-4? -2/19 Calculate 2/212/48. 1/4 What is 3/981/(-36)? -3/4 What is 3/(-7)(-189)/81? 1 ((-2)/(-3))/(200/(-60)) -1/5 Calculate (-10)/44/(-5). 2 What is the value of (1/12)/(-54/(-60))? 1/4 Calculate (-108)/(-180)1/(-1). -3/5 What is the value of 2/(-5)(-2)/(-4)? -1/5 (-1)/(-18)8(-9)/(-2) 2 6/(-26)8/12 -2/13 Evaluate ((-2)/1)/((-4)/((-14)/7)). -1 What is the value of (15/(-130))/((-30)/(-40))? -2/13 Calculate (0/(-5(-18)/30))/1. 0 2/(-4)-358/(-20) -7 ((-72)/1620)/(4/(-10)) 1/9 Calculate (37/42)/(12/3). 1/8 Evaluate ((-3)/(-2))/(27/36)-3. -6 What is the value of 1/((-6)/3)0? 0 What is ((-295)/885)/(2/482)? -4 What is the value of (((-80)/195)/4)/(2/(-3))? 2/13 Calculate (20/(-20))/((-2)/14). 7 3(444/216)/37 1/6 What is ((-7)/(-4))/((-2)/8)? -7 (4/80)/((32/(-60))/4) -3/8 Calculate 3/2(-40)/(-24)-2. -5 (12/16)/(24/1605) 1 Calculate (19/218523)/(26/10). 1/13 8/24(-6)/(-4) 1/2 What is the value of (3/(-15))/(6/20)? -2/3 (-707)/(-101)6/7 6 ((-80)/(-32))/(1/(-2)) -5 What is the value of 203/291/4? 7/4 What is the value of 12/(-63)(-168)/(-224)? -1/7 What is the value of (20/(-105))/((-8)/28)? 2/3 What is (6/7)/(6/16854)? 4/9 Evaluate ((-2)/(-46))/((-44)/88). -2/23 (0/(-6))/(2/2) 0 1(-10)/(-30)-15 -5 What is 2/(-24)(-222)/148? 1/8 What is ((-16)/10)/(-4(-42)/(-60))? 4/7 (54/(-24)-4)/3 3 Calculate 6/(-63)((-70)/6)/5. 2/9 Evaluate 22/69/6. 1 (10(-7)/(-84))/(10/18) 3/2 (((-28)/(-147))/(2/3))/(-1) -2/7 What is (-21)/(1470/56)(-10)/4? 2 What is the value of -3(-10)/(-10)10/6? -5 Calculate (3/3)/(30/(-6)). -1/5 What is the value of (2/5)/((-39)/(-15))? 2/13 What is 17/((-255)/30)(-2)/1? 4 Evaluate 0/((-2)/(-8)4). 0 What is the value of (4/18)/((-360)/216)? -2/15 (10/4)/(145/(-232)) -4 What is the value of (-15)/(-27)12/15? 4/9 What is the value of ((156/(-99))/(-13))/(2/(-3))? -2/11 ((-3)/(21/(-28)))/(-2) -2 What is (421/28)/1? 3 What is the value of (-20)/(-50)10/(-4)? -1 Calculate ((-3)/(-5))/((-156)/(-65)). 1/4 Calculate ((-9)/(-3))/(15/(-30)). -6 Evaluate (((-5)/40)/(-1))/((-8)/(-32)). 1/2 What is ((30/(-8))/(-5))/((-201)/536)? -2 What is the value of (1/3)/((-145)/(-1740))? 4 Evaluate (1/3)/(((-784)/24)/14). -1/7 17/(850/20)5/(-21) -2/21 Evaluate -6(-4)/(-6)44/616. -2/7 Calculate ((-110)/(-275))/(34/(-10)). -2/17 Calculate 10/15(-18)/(-4). 3 What is (3/12-1)/((-1)/(-8))? -2 Calculate (23/138)/(4/(-8)). -1/3 What is 2/1206(-15)/6? -1/4 What is (20/25)/((-44)/10)? -2/11 (((-5)/202)/1)/(-2) 1/4 What is ((-2)/42)/(28/(-84))? 1/7 24/((-40)/(-25)) 5 Calculate (-2)/15(-215)/43. 2/3 (2/9)/((-55)/(-99)) 2/5 Evaluate ((-504)/270)/(-14)18/(-4). -	{ "pile_set_name": "DM Mathematics" }
4sqrt(288)2 - -35(-2 + sqrt(288)))*2. -14400sqrt(2) + 116100 Simplify (3 + ((sqrt(152)2 - sqrt(152))2 + sqrt(152))/(sqrt(72)/(sqrt(9)2)))-4. -24sqrt(19) - 12 Simplify (sqrt(99))2-2 - (sqrt(1100) + 2)*2 - (sqrt(891)-1 + sqrt(891))5. -1302 - 40sqrt(11) Simplify (1(sqrt(1900) + sqrt(1900)12 + sqrt(1900)) - ((sqrt(1900) - sqrt(1900)2)-1 + -3))2. 180sqrt(19) + 17109 Simplify -4 + -4 + ((sqrt(192) + (2sqrt(192))2)-1 + sqrt(192) - (sqrt(192) - (sqrt(192)2 - sqrt(192)))4). -776 Simplify (6(sqrt(77) - (-1sqrt(77) - sqrt(77)))6)/(2sqrt(567) + sqrt(567) - 2sqrt(112)). 108sqrt(11)/19 Simplify -4 + 1 + ((2(sqrt(405) + -1))2 - ((sqrt(405) - (3 + sqrt(405) + (sqrt(405) + -2 + sqrt(405) - sqrt(405)) + sqrt(405) + sqrt(405))) + sqrt(405))2). -108sqrt(5) Simplify -2 + -4 + (0 + sqrt(19))2 + -5 - ((sqrt(931) + 1)2 + 5 + sqrt(931) + 0). -929 - 21sqrt(19) Simplify ((-1sqrt(120))/sqrt(6) + (sqrt(360) + sqrt(360) + sqrt(360)1)/sqrt(8) + sqrt(45))-6. -60sqrt(5) Simplify (3(-2 + -12sqrt(1152))4)2. 27648sqrt(2) + 664128 Simplify (-2(sqrt(19) - sqrt(19)1) + (sqrt(76)-5)2 + (sqrt(19) - (sqrt(1900) + 1)2) + (sqrt(19) + 0)2 + 0)-4. -72 + 76sqrt(19) Simplify (-2(sqrt(1216) + -3(-1 + sqrt(1216)) - (-3 + 1sqrt(1216))))*26. -6912sqrt(19) + 263520 Simplify -6((sqrt(3328) - 2sqrt(3328)) + sqrt(3328))/((sqrt(20)2)/sqrt(5)). 0 Simplify 1(-5 + sqrt(24)/(sqrt(12) + (sqrt(12) - sqrt(300))) + 2 + -4). -7 - sqrt(2)/3 Simplify (-1sqrt(1800)2)/(sqrt(576) + -1(sqrt(576) - (-1sqrt(576) - sqrt(576)))). 5sqrt(2)/4 Simplify 5(4 + (sqrt(17) + (sqrt(17) - sqrt(34)/sqrt(2)))2) + (-3 + 5sqrt(17) + 1)*2. -20sqrt(17) + 534 Simplify (sqrt(425)-12 + (2sqrt(425) + -4)2)-4 + 4. -6860 + 360sqrt(17) Simplify (4sqrt(162) + sqrt(162) + -1)*2 + sqrt(10)/(-1-3sqrt(5) - sqrt(5)). -179sqrt(2)/2 + 4051 Simplify (sqrt(100)/sqrt(80) + sqrt(180)/(sqrt(27)/sqrt(3)))/(2(sqrt(1176)/sqrt(6) - sqrt(4))). 5sqrt(5)/48 Simplify ((sqrt(56)/sqrt(8)-4 + sqrt(7))1 + (sqrt(7)5 - sqrt(7)) + -1 + 1 + 1)2. 2sqrt(7) + 8 Simplify (5 + (-3(sqrt(1088) + (sqrt(1088)-3 - sqrt(1088))) - (0 + 1 + sqrt(1088))))*2. 512sqrt(17) + 69648 Simplify -3 + -4 + (5sqrt(11)-2 - (1 + sqrt(1100))) + -2 + 3. -20sqrt(11) - 7 Simplify -4-2((-2 + sqrt(1584) - sqrt(1584))2 + 2 - (-1 + (sqrt(1584) - (-2 + sqrt(1584))))). 40 Simplify (-2((sqrt(539) - (sqrt(539) - (sqrt(539)-1 - sqrt(539)))) + 2 + sqrt(539) + sqrt(539)1-3 + 2))2. -896sqrt(11) + 34560 Simplify (-1 + 5(sqrt(50) + 3 + -2))2 + -5. 200sqrt(2) + 1261 Simplify 3 + 2 + (sqrt(14)/sqrt(2) + -2 - (3 + (sqrt(175) + sqrt(7))*2)) + 1. -251 + sqrt(7) Simplify (-4sqrt(66)5)/(sqrt(12)/(-1sqrt(2))). 20sqrt(11) Simplify (-5 + -3(sqrt(176) + 0) + sqrt(88)/(-6sqrt(8)1)-2)2. 350sqrt(11)/3 + 13700/9 Simplify ((2sqrt(5) + 5)6 - (4 + sqrt(720)2))6. -72sqrt(5) + 156 Simplify 1 + -1-62sqrt(288) + -3. -2 + 144sqrt(2) Simplify (4 + sqrt(55)/(sqrt(30)/sqrt(6)) + sqrt(176)5)*2 + 0. 168sqrt(11) + 4867 Simplify ((4 + 1sqrt(72) + -5)-5)*2 + -5. -300sqrt(2) + 1820 Simplify 4 + (sqrt(612) - (sqrt(612) + 0))*2 + -5 + ((0 + -1 + sqrt(272))4)*2. -128sqrt(17) + 4367 Simplify (1sqrt(832)2)*2 + sqrt(13) + (0 + sqrt(13))-4 + sqrt(1872)-1. -15sqrt(13) + 3328 Simplify ((sqrt(504) + sqrt(504) + (sqrt(504) - 22sqrt(504) - sqrt(504)))/(sqrt(70)/(sqrt(10) + (-1sqrt(250) - sqrt(10)))))2-1. -7200 Simplify -5 + ((5 + sqrt(175))*2 - (-2sqrt(175) - sqrt(7))*2 - ((sqrt(378)/(sqrt(9) + -2sqrt(9)))/sqrt(6))*2). -659 + 50sqrt(7) Simplify 3 + sqrt(18)/(-1sqrt(6)) + 4(4 + (1sqrt(3))2). -sqrt(3) + 31 Simplify ((((sqrt(170)-14 - sqrt(170)) + sqrt(170))4)/((sqrt(40) - (sqrt(160)/sqrt(4) - sqrt(40))) + sqrt(20)/sqrt(32)))2. 69632/81 Simplify (sqrt(7200) + -1)2 + ((1 + sqrt(450))*2 - sqrt(450)) - (sqrt(550)/(sqrt(11)-4) + -2). -415sqrt(2)/4 + 7654 Simplify (-21-2sqrt(75)-4 + -2)2. 320sqrt(3) + 19204 Simplify (4 + (sqrt(272)-4 + sqrt(272) - sqrt(272)) + sqrt(272) - sqrt(272) - (1sqrt(272) + 3 - sqrt(272)))*2. -32sqrt(17) + 4353 Simplify -5 + ((sqrt(605)/sqrt(11) + sqrt(55) + sqrt(55))-2)/(2sqrt(320)). -5 - 3sqrt(11)/8 Simplify 1 + (sqrt(5) - sqrt(320)-1 - (2 + sqrt(35)/sqrt(7))). -1 + 8sqrt(5) Simplify -1 + ((sqrt(7) + (4sqrt(77))/sqrt(11))4)24. 11199 Simplify (3sqrt(132)/sqrt(4))/(sqrt(12)4) - (4 + sqrt(176) + -2 + -5). -29sqrt(11)/8 + 3 Simplify (sqrt(4) - sqrt(4)-1-3 - sqrt(8)/(sqrt(4)/sqrt(2)))/((sqrt(56)/sqrt(4))/sqrt(7) - 2sqrt(8)). sqrt(2) Simplify 3(sqrt(325) - (sqrt(325) + 0 + sqrt(325) + 0)) - (-6(sqrt(325) + 0)1)2. -11700 - 15sqrt(13) Simplify -1(2(0 + sqrt(1872)) + -5)*24. -30052 + 960sqrt(13) Simplify 1 + sqrt(128) + sqrt(200) + 1 + -3. -1 + 18sqrt(2) Simplify (23(sqrt(153) + 1))*2-6. -33264 - 1296sqrt(17) Simplify (sqrt(288)/(sqrt(12) + (sqrt(300) - (sqrt(300) + sqrt(300)-1))))/(((sqrt(96) - (sqrt(96)2 + sqrt(96) + sqrt(96)))-4)/sqrt(12)). sqrt(3)/72 Simplify (sqrt(504) - -4sqrt(504))/(sqrt(800)-1). -3sqrt(7)/2 Simplify (sqrt(336)/((sqrt(60)-2)/sqrt(10)))/((-2(1sqrt(72) + sqrt(72) - sqrt(72)))/sqrt(9)). sqrt(7)/4 Simplify (3(4 + (sqrt(432) + (0 + sqrt(432))3 - (sqrt(432) + 0 + -3)) + -5))*2. 1296sqrt(3) + 35028 Simplify (-4 + 1sqrt(28)/sqrt(4))2 + 1sqrt(7) + -2 + ((1 + sqrt(7) - sqrt(7))-5)2. -7sqrt(7) + 46 Simplify ((sqrt(304) + 4 - sqrt(304) - sqrt(304))1 + -4)-3. 12sqrt(19) Simplify (1 + sqrt(704)/sqrt(4) + 3 + sqrt(44)/sqrt(4))-5. -25sqrt(11) - 20 Simplify -6-54(((2 + sqrt(171) + 1)*2 - sqrt(171)) + sqrt(171) - (-2sqrt(171)-3 - sqrt(171))). 360sqrt(19) + 21600 Simplify -3(sqrt(2) + (sqrt(8)/sqrt(4) + 0)2 + sqrt(2))4 + (sqrt(128)/sqrt(4) + 5)-6. -48sqrt(2) - 54 Simplify (-3 + 1 + 1sqrt(475) - 1((sqrt(475) + 2 - sqrt(475)) + 0 + sqrt(475)))*2. 16 Simplify -3 + (sqrt(300) + (-1sqrt(300) - sqrt(300)))-3 - ((sqrt(300) + 4 + 2 + sqrt(300))4)*2. -19779 - 3810sqrt(3) Simplify -3 + ((sqrt(136) + (sqrt(136) + (sqrt(136) - -1sqrt(136)) + sqrt(136))4)1)/((sqrt(800) + sqrt(800)2 - sqrt(800))-3). -3 - 17sqrt(17)/60 Simplify 1 + sqrt(52) + -2 + sqrt(52)/(62sqrt(4)). -1 + 25sqrt(13)/12 Simplify -2 + (sqrt(20) + sqrt(5) + 2)2 + (sqrt(160)/(sqrt(4)-2))/sqrt(8). 23sqrt(5)/2 + 47 Simplify (-3sqrt(304) - (5sqrt(76))2)6. -11400 - 72sqrt(19) Simplify sqrt(2448) - (2 + sqrt(2448)) - (0 + sqrt(17)-1) - (((sqrt(340) - (sqrt(340) + (2sqrt(340) - sqrt(340)) + sqrt(340))) + sqrt(340))/sqrt(10))/sqrt(2). -2 + 2sqrt(17) Simplify 53(-2 + (-3 + sqrt(425) + -4 + sqrt(425))*2). -2100sqrt(17) + 26205 Simplify 4(-63sqrt(102))/((3sqrt(294) + sqrt(294) - sqrt(294)) + sqrt(294)). -18sqrt(17)/7 Simplify (2 + sqrt(112)2 + 3 + sqrt(112) + (sqrt(112) - (sqrt(112) + 1)) + 1)*2 + 3. 120sqrt(7) + 1036 Simplify (1(sqrt(170) - 5sqrt(170)))/sqrt(10) + -1 + (sqrt(17) - sqrt(119)/(sqrt(7)3)). -10sqrt(17)/3 - 1 Simplify 4(-1 + (sqrt(396) - (0 + 2sqrt(396))))*25 + -4. 240sqrt(11) + 7936 Simplify (5((sqrt(1331) - (sqrt(1331) + 1)) + 5))*2 + 5 + -4(sqrt(1331) + -1) + sqrt(1331). -33sqrt(11) + 409 Simplify ((3 + (-2sqrt(78)1)/sqrt(6) + 0)4)*2 + -2. -192sqrt(13) + 974 Simplify ((sqrt(2448)-2 - sqrt(2448)) + sqrt(2448))2 + -3 + 5. -48sqrt(17) + 2 Simplify -3(6((2sqrt(108))/sqrt(9) + 4))*2. -6912 - 3456sqrt(3) Simplify -5 + (-1sqrt(684)-3 - (sqrt(684)-1 + -4))2. 192sqrt(19) + 10955 Simplify (-4 + 1 + sqrt(500) + 5(sqrt(5) + sqrt(45)/(-3sqrt(9))) + -2)*2. -400sqrt(5)/3 + 8225/9 Simplify -4(sqrt(1700) - 1sqrt(1700)2 - ((sqrt(1700) - sqrt(1700)-3) + sqrt(1700) + -1)*2). -360sqrt(17) + 170004 Simplify -6(sqrt(180)36 - sqrt(180)) + -4. -612sqrt(5) - 4 Simplify (sqrt(540)-15 - sqrt(540))/((sqrt(5) - (sqrt(5) - (sqrt(5) + sqrt(40)/(sqrt(8)-1 - sqrt(8)))))-3). 24sqrt(3) Simplify ((sqrt(17) + (6sqrt(272) - sqrt(17)) - (sqrt(425)-1 - sqrt(425) - sqrt(425)) - ((sqrt(17) + -1)-1 + sqrt(17) + 1))2)2. -624sqrt(17) + 103444 Simplify (sqrt(34) - sqrt(272)/(sqrt(16)/sqrt(2)) - (sqrt(34) - (-1sqrt(204))/sqrt(6)))/(sqrt(162) - (sqrt(162) + 2sqrt(162))-3). -sqrt(17)/45 Simplify ((2sqrt(84) + sqrt(84) - sqrt(84)) + sqrt(84) + sqrt(84))	{ "pile_set_name": "DM Mathematics" }
Let g(l) = -25n(l) - 6v(l). Give g(4). -46 Let j = 1122 + -1120. Let p(q) be the second derivative of q5/10 - q4/6 + q*3/2 - 3q*2/2 - 4q. Determine p(j). 11 Let c(s) = s*2 - 3s - 5. Let x be c(5). Let g(d) = 12 - 8d + 8d + x + d. Determine g(-12). 5 Let d(l) be the first derivative of 11 - 5/3l3 + 3/4l*4 - 1/20l*5 + 9/2l*2 + 14l. Let k(u) be the first derivative of d(u). Determine k(8). -7 Let b be (-2961)/567 - (-5 + 86/18). Let w(p) = p*3 + 6p*2 + 2p - 8. Let v(l) = -2l3 - 12l*2 - 3l + 17. Let d(u) = -4v(u) - 9w(u). Give d(b). 9 Let o(j) = -6j - 5. Let f(d) = 3d*2 - 5d - 12. Let g be f(5). Let h be 2/(-20)g + (-12)/60. What is o(h)? 19 Suppose -13d - 810 = -22d. Let y(a) = -76 + a - 2a + d. Determine y(0). 14 Let q = -5672 - -5650. Let s(t) = 9t + 204. Give s(q). 6 Let y(n) = 3n - 3. Let f = -172 + 179. Suppose 0 = ft - 61 + 12. What is y(t)? 18 Suppose 24 = -2n + 48. Let y be ((-32)/n)/((10/3)/5). Let r(w) = -w*2 + 4w + 1. Give r(y). -31 Let c(k) = 5k2 - k - 1. Let f(v) = -51v*2 + 35v + 85. Let x(g) = -10c(g) - f(g). Give x(27). -21 Let z be (-16)/88 - ((-420)/(-33))/(-4). Let h(q) = -2q*2 + 25 - 44 + zq*2 - 11. Calculate h(0). -30 Suppose -4l + 2l + 2 = 0. Suppose 2x = -3n + l, 3x + 0 = -2n - 1. Let z(d) be the second derivative of -3d5/10 - d3/6 + 63d. Determine z(n). -7 Let m(c) be the second derivative of -c3/6 + 3c*2/2 - c. Suppose 0 = -4v - w + 42, -7w - 2 = -8w. Give m(v). -7 Let s(r) = 31r - 193. Let f be ((-288)/(-168))/((-14)/(-49)). Calculate s(f). -7 Let q(f) = -1 + f - 1 - 1 + 2f - 2. Let k(a) = a*2 - 4a + 4. Let g be k(4). Calculate q(g). 7 Let n(x) = -x*3 - 10x*2 - 12x - 13. Let u = -2622 + 2613. Give n(u). 14 Let k(i) = -2i + 51. Suppose 0 = 11x + 2913 - 3188. Calculate k(x). 1 Let u(g) = -g*2 + 7g - 9. Let a = -160 - -161. Let n be (a/14-8)/(8/(-84)). Give u(n). -3 Suppose -4l - l = 0. Suppose -o + 13 = 3s - ls, -3 = -o - s. Let i be (o/(-4))/((-47)/12 + 4). Let m(h) = -h*2 + 5h + 1. What is m(i)? -5 Let q be (18 - 17)/((1/4)/(-22 - -21)). Let u(j) = 5j3 + 3j*2 - 2j + 4. Let h(n) = 11n3 + 6n*2 - 4n + 9. Let t(f) = 4h(f) - 9u(f). Determine t(q). 8 Let i(q) be the third derivative of -q*4/12 + 7q*3/6 - 3q*2. Suppose 0 = 4v + 5k + 24, 5v - 2k + 12 = 3v. What is i(v)? 19 Suppose -5f - 4k - 8 = 0, 2f = -3f + k - 23. Let h be (-3)/((-38)/8 - f). Let l(s) = -s*3 + 2s*2 + 6s - 4. Calculate l(h). -12 Let y(o) be the first derivative of 4 + 2 - 231o2 - 4o + 232o2. Suppose 24c = 30c - 18. Calculate y(c). 2 Let l = 937 - 944. Let z(d) = -d2 - 15d - 58. Give z(l). -2 Let t(w) = -5w2 - 20w - 9. Let d(q) = 5q2 + 3q + 21 - 16q - 27 - 8q*2. Let f(u) = -8d(u) + 5t(u). Calculate f(6). -9 Let u be ((-45)/9)/((-3)/27). Let c = -37 + u. Let g(q) = -cq + 12q - 5q. What is g(4)? -4 Suppose 0 = -4u + 12. Let h(v) = 8773v + v*3 - 1 + u - 8768v + 5v2. Let j(y) = 3y3 + y2 + 2y + 1. Let a be j(-1). Give h(a). 5 Suppose -6a + 715 - 721 = 0. Let x(h) = 20h + 22. Let p be x(a). Let z(c) = 10c + 1. Calculate z(p). 21 Let z(q) = q*2 + 4q + 5. Suppose 2869 = 25t + 11794. Let c = 350 + t. Calculate z(c). 26 Let x(g) = -11g*3 + 49g*2 + 11g + 16. Let l(k) = 20k3 - 89k*2 - 21k - 30. Let s(a) = -6l(a) - 11x(a). Give s(5). 29 Let a(h) = -h*2 + 7h + 13. Let m be 10/4192/60. Let y be a(m). Let w(r) = 8r + 5 - y + 11 - 2r2 + r2. What is w(9)? 2 Suppose -122 - 343 = -54t - 33. Let h(g) = g*3 - 7g*2 - 12g - 1. Give h(t). -33 Let l(w) = -2w3 + 6w*2 + 9w - 2. Let x = -784 + 492. Let o = x + 296. Give l(o). 2 Let c = 6364 - 6361. Let d(n) be the third derivative of 0n + 0 - 40n*2 - 1/4n*4 - 7/6n*c + 1/60n*5. Calculate d(6). -7 Let k = -2/12491 + 12539/299784. Let g(c) be the third derivative of kc*4 + 10c*2 + 0c + 1/15c5 - 1/120c*6 + 2/3c3 + 0. Determine g(4). 8 Let f(g) be the third derivative of -g5/30 + g*4/12 + 1371g2. Calculate f(2). -4 Let z(l) be the third derivative of -l4/24 + 71l2. Suppose -199u + 194u = -20. What is z(u)? -4 Let r(q) = 36q + 22. Let n be r(-17). Let g be (-4)/(-10) + n/(-25). Let t(d) = -14d2 + 45d2 + d3 - 8d - gd2 - 6. Calculate t(-8). -6 Let p(v) be the second derivative of -v4/12 - v*3/2 + 3v2/2 + v. Let s = 927 - 930. Calculate p(s). 3 Let n be (21 + 0 + -3)/((-1)/(-2)). Let x be 67/11 + n/(-396). Let u(t) = -t3 + 7t2 - 8t + 5. Calculate u(x). -7 Suppose -28q - 142 = -282. Let r(c) = c - 20. What is r(q)? -15 Let j(g) = g3 - g2 + g - 17. Suppose -56x - 920 = -60x. Let d = x - 230. Give j(d). -17 Let o(m) = 74m + 998. Let g be o(-13). Let t(q) be the second derivative of 1/2q2 + 0q*4 + 0 + gq - 1/20q5 + 1/3q*3. Give t(2). -3 Let q be ((-6)/(-8))/(1/4). Suppose 3u + 2 - 1 = 2v, 0 = qu - 5v - 11. Let h(f) be the first derivative of -f3/3 - 7f*2/2 - 2f - 98478. Determine h(u). 10 Let k(v) = 7v2 + 3v + 1. Let h(m) = 3m2 + m. Let g(a) = 5h(a) - 2k(a). Let p(j) = j3 + 2j*2 - 3j - 10. Let o(q) = 3g(q) - p(q). Determine o(0). 4 Let g(a) = -a. Let m(l) = -13l - 99. Let d be m(-8). Let h(p) = p*2 - p - 16. Let q be h(d). Determine g(q). -4 Let n(o) = 325 + 19o*2 - 17o*3 - 35o*3 - 8 + 51o*3 + 4o. What is n(20)? -3 Let x = -370 - -347. Let d(i) = 9i + 198. What is d(x)? -9 Let z be (7/(-4))/((-2)/(-8)). Let n be 2/17 + (-64)/(-34). Let o(i) = -4i*2 - 52i + 44i + 4in - i2 + 5. Determine o(z). 12 Let c(j) be the third derivative of -j*6/120 - 7j*5/30 - 7j4/12 - j3 + 92j2 - 2j. Let d(q) = q*2 - 9q + 7. Let f be d(5). Determine c(f). 7 Let o(j) = j*2. Suppose 5x = -15 + 5. Let f be (0 + 0)(1 - 2 - x). Give o(f). 0 Let i(k) = -2k*3 + 3k*2 - k + 2. Let c = -5 - -8. Suppose 0 = 15w - 17w. Suppose cq - 6 = -wq. What is i(q)? -4 Suppose 15d - 439 + 484 = 0. Let f(s) = -3 + s*2 + s + 6s - 5s. Determine f(d). 0 Let s(c) = -2 - 9 - 11 + 2c + 20. Let z be (-3 - (-9)/2)/(3/4). What is s(z)? 2 Let q(t) be the first derivative of -t*4/4 - 7t*3/3 + 19t*2/2 + 15t + 454. Give q(-9). 6 Let w(a) be the third derivative of 0 + 2/3a3 - 3a*2 - 1/6a*4 + a. Give w(3). -8 Let x(a) = 2a*3 + 15a*2 + 3a - 22. Let v(j) = -j*3 - 8j*2 - j + 11. Suppose 20 = -36y + 32y. Let h(d) = yv(d) - 2x(d). What is h(-10)? -1 Let r(x) = 2x*2 - 8x - 3. Let b(c) = 2 + 115c2 - 117c*2 + 2c + 6c + 0. Let s(u) = 2b(u) + 3r(u). Calculate s(7). 37 Let t(z) = -5z*3 + 2z*2 + z. Let s(l) = -12 + 16 - l + 11 + 7. Let a be s(18). Let n be 4 - a - (2 + -1). Give t(n). 6 Suppose -281 + 275 = -3u. Let h(q) = 3q + 6q - 2q3 - 10q - 3qu. Let m be (0 - 2)(1 + 0). Calculate h(m). 6 Suppose 23w - 27 = -4. Let y be (2 - 2) + (-5 - w). Let s(f) = f2 + 6f - 8. Calculate s(y). -8 Suppose 93q - 85q - 16 = 0. Let m(f) = 5f + 40. Let t(w) = w + 7. Let o(i) = qm(i) - 11t(i). What is o(-7)? 10 Let q = 42 - 38. Let c(y) = q - 1920y + 1921y + 12. Give c(-19). -3 Let q(m) = -2m*2 - 88m - 255. Let g be q(-41). Let i(j) = j*2 + 10j + 11. Give i(g). 2 Suppose -3r + 12 = z, -5z - 3r + 96 = -6r. Suppose -134 = 29o - z. Let d(p) = p - 1 - 1 - 3. Calculate d(o). -9 Let g(f) = f2 - 4f + 1. Let b(w) = w - 13. Suppose 3r - 6r + 2p + 56 = 0, 5r = 5p + 90. Let q = -3 + r. Let v be b(q). Give g(v). 1 Let f(k) = -k2 - 4k + 7. Let i be f(-5). Let t(h) = -ih + h3 - 2h*2 + 3h - 5h + 3. Let m = -1528 + 1531. Give t(m). 0 Let g(d) be the third derivative of -d6/60 + 2d5/5 + d4/12 - 29d3/6 - 3d*2 + 647. Give g(12). -5 Let u = -43 - -42. Let p = 6 + u. Let w(t) = -2t*3 + 2 + pt*3 - 3t*2 - 4t*3 + 0. Give w(-2). -2 Let b(o) = -7o - 95. Suppose 154p = 133p - 294. What is b(p)? 3 Let z be (-6)/(12/(-34)) - -1. Suppose 0 = -4t + 5p - 38 - 9, -3t - 2p = z. Let b(n) = n*3 + 9n*2 + 6n - 6. Give b(t). 10 Let l(z) = -55z2 - 19z + 214. Let k(p) = -17p2 - 6p + 73. Let o(t) = 13k(t) - 4l(t). Give o(-11). -6 Let f(b) = -2b2 - 2b*3 - 4 + 1 + 0b*2 - 492b + 497b + b3. Let u(x) = 3x - 1. Let p be u(-1). Give f(p). 9 Suppose 111 = -4u + 5m, 2u + 2u + 108 = 4*m. Le	{ "pile_set_name": "DM Mathematics" }
-2.7. Let j = d - 3. Sort o, -5, j. -5, o, j Let v = 2.1 - -13.9. Let d = v - 11. Sort d, -5, 2/7. -5, 2/7, d Let p be 01/31. Suppose p = 3j + 2j - 20. Suppose s - 2 = -j. Put -5, 4, s in increasing order. -5, s, 4 Let u = 3 + -2. Suppose -4o + 11 = 5k, -5k - 3o + 6 + 1 = 0. Put -4, u, k, -2 in descending order. u, k, -2, -4 Let r(t) = t + 2. Let z be r(3). Suppose -116x + 60 = -96x. Put 8, x, z in descending order. 8, z, x Suppose 4x - 7 - 1 = 0. Suppose 0 = 3f - 2n, xn = 9f - 13f. Put -1/11, -1/8, f in increasing order. -1/8, -1/11, f Suppose -364s + 375s + 66 = 0. Sort -2, s, 0. s, -2, 0 Let g(o) = o*3 + 16o*2 + 3o - 179. Let j be g(-15). Suppose 1 - 11 = 5t. Sort t, j, 3, 30 in increasing order. t, j, 3, 30 Let m(o) = -o3 + 19o*2 - o + 22. Let y be m(19). Let i(j) = -j + 11. Let c be i(11). Put 1, y, c in ascending order. c, 1, y Let f = 25106 - 124892/5. Let l = -128 + f. Put -1, 1/18, l in decreasing order. 1/18, l, -1 Suppose 0 = 4o + 5y + 96 - 24, 5o - 3y + 127 = 0. Let g = -22 - o. Let w(b) = -b3 - 2b*2 + 2b + 2. Let h be w(-3). Sort g, 0, h in increasing order. 0, g, h Suppose -181 = -21q + 197. Put -2, q, 2, 1 in increasing order. -2, 1, 2, q Let n = 0.0587 + 5.9413. Put n, 1, -22 in increasing order. -22, 1, n Let d = 753 + -757. Put d, -5, 2, 35 in decreasing order. 35, 2, d, -5 Let o = -0.0274 + -77.9726. Put -2/3, -4, o in descending order. -2/3, -4, o Suppose 62b + 18 = -44. Put -28, -0.2, b in increasing order. -28, b, -0.2 Let s = 4 + -2. Let i(r) = r*3 + 61r*2 + 121r + 177. Let l be i(-59). Put 5, s, l in descending order. 5, s, l Let z = 789 + -790. Put 4, z, -0.1 in increasing order. z, -0.1, 4 Let w = 0.97 - 46.97. Let c = -46.05 - w. Put c, -1/5, 0.3 in increasing order. -1/5, c, 0.3 Let a = 0.11 + -15.11. Let z = a + 28. Let w = z + -8. Put -3/4, -0.4, w in increasing order. -3/4, -0.4, w Let w = 3 + 3. Suppose wv + 15 = v. Let p = 5419 - 5416. Sort 4, v, p. v, p, 4 Let r = 38 - 36. Let p be (r/6)/((-10)/150). Put 0, -1, p in decreasing order. 0, -1, p Suppose 440f - 5 = 435f. Put 9, 2, f, -2 in ascending order. -2, f, 2, 9 Suppose 2k - 1 + 3 = 0. Let j = 552/91 + -77/13. Put 3, j, -2, k in decreasing order. 3, j, k, -2 Suppose 1 = -5n + 26. Suppose -5i - 3l = -6l + 3, -i + l + 1 = 0. Sort i, 0, n, -1 in decreasing order. n, 0, -1, i Suppose 2z = -z + 3v + 33, -5z + 58 = -2v. Let q be (2 - z)/((-4)/(-2)). Let x(j) = -j*2 - 6j + 73. Let l be x(6). Sort 2, l, q in descending order. 2, l, q Let p(a) = -2a3 + 11a*2 + 21a - 9. Let q be p(7). Let f be 6/(-5)q/((-108)/30). Suppose -h = 5b - 1, 9 = 3b - h + 2. Put b, f, -6 in decreasing order. b, f, -6 Let h(b) = -b2 + 6b + 10. Let j be h(7). Suppose 3t - c = c - 11, -jt + c - 13 = 0. Sort t, 3, 0.7 in decreasing order. 3, 0.7, t Let a(x) = -x*2 + x + 51. Let k be a(8). Put -3, k, -7, -1 in decreasing order. -1, -3, k, -7 Let t = -5.4 + 5.19. Let m = t - -3.21. Let c = -1 + -1. Put c, 5, m in ascending order. c, m, 5 Suppose -20 - 4 = -2w - 4y, 2w - 28 = -5y. Suppose 0 = -r - 0r - w. Let l = 0 + 0. Put -3, r, l in decreasing order. l, -3, r Suppose -219v = -228v - 693. Put v, -3, -1, 3 in decreasing order. 3, -1, -3, v Let d(v) = -3v3 + 3v*2 + 7v - 9. Let s be d(1). Let q be 2/4(10 + -2). Let p = q - 7. Put p, 0, s in ascending order. p, s, 0 Suppose -84 = 22p + 6p. Suppose 4s - d - d - 12 = 0, 0 = -5s + d + 12. Let i = s + -1. Put i, 3, p in decreasing order. 3, i, p Let j(q) = q2 - 6q - 2. Let f be j(6). Let p be (-4)/(-10) - (2672/(-120) + 23). Sort 2, p, f in ascending order. f, p, 2 Let c = 35 + -41. Let s = c + 6.2. Sort s, 4, -0.2 in decreasing order. 4, s, -0.2 Suppose 4o + 8 = 5f, 0 = -6f + 8f + 8. Sort 0, o, -1, 3 in ascending order. o, -1, 0, 3 Let r = 0.6073 + -0.0073. Sort r, -0.04, 0.1 in descending order. r, 0.1, -0.04 Let w be ((-7)/((-4060)/(-1024)))/(18/15). Let j = 4/29 + w. Sort 2/13, -3, j in ascending order. -3, j, 2/13 Let q = -95.63 - -95. Let s = q - -0.23. Sort 0.1, s, 0.08, -1. -1, s, 0.08, 0.1 Suppose -10 = -2c, 2x - 4c = -3x - 815. Let w be (x/105 - -2) + 2/(-7). Sort w, 2/3, -0.2 in ascending order. -0.2, w, 2/3 Let x(o) = -2o + 7. Suppose -5l + 15 + 15 = 0. Let s be x(l). Sort 6, -3, s. s, -3, 6 Suppose v + 2n = 3v, -2v + 25 = 3n. Suppose -v = -4q - 5. Put q, -0.3, -2, -3 in increasing order. -3, -2, -0.3, q Let a = -28 - -47. Let k = a - 18.8. Sort 2/13, -1, k, 2 in descending order. 2, k, 2/13, -1 Let g(d) = -4d*2 - 138d - 66. Let b be g(-34). Sort 3, b, 1 in descending order. 3, b, 1 Let u(r) = -r*3 - 5r*2 - 5r - 2. Let n be u(-4). Let p be 1 + (4/10 - n). Suppose 4w + 1 = 21. Sort p, 0, w in decreasing order. w, 0, p Let v = 86 - 84. Let l be v/36-76 + 4. Sort 0, 0.1, l. l, 0, 0.1 Let z = 14 - 15. Let b = -0.3 + -0.2. Let k = 48 - 51. Sort b, z, k. k, z, b Let p = 0.0319 - 0.5319. Put -75, 1, p in decreasing order. 1, p, -75 Let j(n) = n*2 + 37n - 77. Let r be j(-39). Sort 2, 54, r. r, 2, 54 Let f = -0.3 - -0.2. Let t = 39.8 + -11.3. Let h = 28 - t. Sort 3, f, h in decreasing order. 3, f, h Let g = 184/3 - 2030/33. Sort 1/22, -1/3, g in descending order. 1/22, g, -1/3 Let p be 2/4 + 13/(286/(-55)). Sort 2, -4, p, 1 in decreasing order. 2, 1, p, -4 Let u be 6 + ((-116)/8 - -7). Sort u, -4, 3, 4/7 in descending order. 3, 4/7, u, -4 Let w = -274 + 274.05. Sort 3, w, 1 in descending order. 3, 1, w Suppose 0b + 3 = -3b, x - 2b = 8. Sort x, -3, 0, 2 in increasing order. -3, 0, 2, x Let t(l) = l2 + 3l - 3. Let a be t(-3). Suppose -3s = 2s - 10. Suppose -4h - 12 = -sy - 0, 5y = h + 12. Sort a, 7, y in ascending order. a, y, 7 Let u = 3.31 + -3.4. Sort -6/11, -10, u, 0.4 in descending order. 0.4, u, -6/11, -10 Let r = 51 - 40. Let h = 34 - 21. Let v = r - h. Sort -0.1, -5, v in decreasing order. -0.1, v, -5 Let n = 0.2 + 0.1. Let l be (6 - 384/63)/(2/6). Sort l, 1, n, -0.2. l, -0.2, n, 1 Suppose c - 2c = 4f - 11, 2c = f - 5. Suppose -5v - 12 = -2d, 0 = -0v - 4v + 4d. Let j = -30 + 25. Sort c, v, j in ascending order. j, v, c Let d(n) = n2 + 2n - 8. Let c be d(-4). Suppose cl = l + 2. Put 12, -3, l in increasing order. -3, l, 12 Let r(u) = -u3 + u + 5. Suppose -2g = -0g. Let x be r(g). Suppose 2n = -4f - 18, 0n = -xf - 4n - 27. Put f, 2, 5 in increasing order. f, 2, 5 Let o be ((-172)/(-28) - 6) + (-87)/21. Let s = 5 - 3. Let x be -9(-4)/121. Put x, o, s in decreasing order. x, s, o Let l = -521/84 + 25/4. Let n = 17/84 + l. Put n, 6, 0.3 in decreasing order. 6, 0.3, n Let c = 2.7 + -2.3. Let l = 1.3 + -0.3. Put c, 0, l in decreasing order. l, c, 0 Let v = 10.65 + -0.35. Let z = -10.5 + v. Sort -5, -0.4, -4, z in increasing order. -5, -4, -0.4, z Let o = 0.05 + -0.02. Let s = -1.97 - o. Sort s, -8, 2. -8, s, 2 Let h(q) = -2q + 1. Let f be h(-4). Suppose 6 = 3z - f. Let p be 209/55 - (-2)/10. Sort 1, p, z in descending order. z, p, 1 Let j(q) = -5q - 32. Let y be j(-6). Let s be (y - -4)/((-5)/((-50)/4)). Let n be 12 - (0 + (0 - -2)). Put s, 2, n in increasing order. 2, s, n Suppose 17f = 19f + 38. Let i = f + 14. Sort 3/4, i, 4. i, 3/4, 4 Let h = -40 + 46. Let u be (h - 5)(0 + 4). Put u, -3, -7 in increasing order. -7, -3, u Suppose 12 = -3h, 2s = -s - 5h - 26. Put s, 12, -1, 3 in decreasing order. 12, 3, -1, s Let l = -0.001 + -1.059. Let c = -3 - -3.06. Let z = c + l. Sort -5, 2/5, z in decreasing order. 2/5, z, -5 Let z = 124 + -1114/9. Let v(u) be the third derivative of u5/10 - u4/12 + u3/6 - 3u2. Let a be v(1). Put z, 0.5, a in ascending order. z, 0.5, a Let g(q) be the third derivative of -q4/12 - q*3/6 - 13q*2. Let u be g(2). Sort -16, 1, u. -16, u, 1 Let j = 0.352 - 0.252. Put j, -2, -3 in descending order. j, -2, -3 Suppose 2v - 2l + 2 = -4, 0 = 3v + 5l + 25. Sort v, -82, 2 in decreasing order. 2, v, -82 Suppose -25 = -5q + 4z - 8, 0 = -q + 4z + 13. Let p be (-1 - 12) + 30 + -15. Put -2, 0, q, p in decreasing order. p, q, 0, -2 Suppose -18o + 110 = -23o. Sort o, 0, -3, -5. o, -5, -3, 0 Let u = 56 + -236. Let v = u - -179.19. Let i = v - 0.19. Sort i, -1/2, 1/5 in decreasing order. 1/5, -1/2, i Let p be (-5 - -6)/(2/(-2)). Suppose -4w - 12 = 0, -4w - 21 = -	{ "pile_set_name": "DM Mathematics" }
270/3. -(a - 2135)(a - 2)/3 Factor -2f*2 - 580f + 84958. -2(f - 107)(f + 397) Solve -2o2 + 544o + 1096 = 0 for o. -2, 274 Solve 5z2 + 1075620z + 57847919220 = 0. -107562 Factor 5q2 - 352345q. 5q(q - 70469) What is s in -2s5 + 2036s*4 + 53830s*3 + 476592s*2 + 1626840s + 1879200 = 0? -10, -3, 1044 Factor -11n2/2 - 628n + 1267/2. -(n - 1)(11n + 1267)/2 Suppose 3n3/2 - 201n*2/2 - 12189n + 24768 = 0. Calculate n. -64, 2, 129 Factor -5i2 - 120i + 2405. -5(i - 13)(i + 37) Find r such that -3r5 + 12r*4 + 207r*3 + 312r*2 - 528r = 0. -4, 0, 1, 11 Factor s*2/5 + 15722s/5 + 6288. (s + 2)(s + 15720)/5 Factor -2j*3/13 - 254j*2/13 - 10742j/13 - 151290/13. -2(j + 41)2(j + 45)/13 Let c*2/3 + 54838c + 2255404683 = 0. What is c? -82257 Factor -284k3 + 13536k*2 - 158976k - 55296. -4(k - 24)2(71k + 24) Determine n so that 3n*2 - 154917n = 0. 0, 51639 Solve -a*3/2 - 25a*2 + 386a + 868 = 0. -62, -2, 14 Determine g so that -2g5/7 + 1266g*4 - 9821306g*3/7 + 9794730g*2/7 + 19624900g/7 = 0. -1, 0, 2, 2215 Find q, given that 3q5/4 + 102q*4 - 207q*3 + 3q*2/2 + 825q/4 - 207/2 = 0. -138, -1, 1 Factor 5c2/4 - 3105c/2 - 9360. 5(c - 1248)(c + 6)/4 Find a, given that -3a3 - 1671a*2 + 34320a - 173100 = 0. -577, 10 Factor 18b2/7 - 1186b/7 - 3720/7. 2(b + 3)(9b - 620)/7 Determine o so that -2o*2/17 + 18440o/17 + 18442/17 = 0. -1, 9221 Factor -4d2 + 22224d + 22228. -4(d - 5557)(d + 1) Solve 2i5/11 - 100i*4/11 - 672i*3/11 - 4i*2 + 2494i/11 - 1680/11 = 0 for i. -5, -3, 1, 56 Suppose 3w3/8 + 315w*2/8 + 2061w/2 + 3813/2 = 0. Calculate w. -62, -41, -2 Factor d*2 + 851d - 852. (d - 1)(d + 852) Solve 3d*4/7 - 915d*3 + 158166d*2/7 + 177396d/7 - 329160/7 = 0. -2, 1, 26, 2110 Determine j, given that -132j4/7 + 76j*3/7 + 8j*2 = 0. -14/33, 0, 1 Factor -5d*3 + 365d*2 - 6130d - 13760. -5(d - 43)(d - 32)(d + 2) Factor 2v*3/11 + 1976v*2/11 - 2018v/11 - 39560/11. 2(v - 5)(v + 4)(v + 989)/11 Find u, given that -5u*5 - 315u*4 + 2885u*3 + 3195u*2 = 0. -71, -1, 0, 9 Factor -2l*2 - 257704l - 257702. -2(l + 1)(l + 128851) Determine s, given that -3s5/2 + 75s*4 - 2529s*3/2 + 7911s*2 - 11340s = 0. 0, 2, 12, 15, 21 Suppose -2s3 + 82929s*2/2 - 134740s + 62187/2 = 0. Calculate s. 1/4, 3, 20729 Factor 14o4 + 16020o*3 + 4585152o*2 + 1308736o. 2o(o + 572)*2(7o + 2) Determine l, given that -l3/5 + 286l*2/5 - 24064l/5 + 98304 = 0. 30, 128 Determine d so that 3d3/2 + 1059d*2 - 8544d + 17136 = 0. -714, 4 Suppose -g*3/4 + 1341g*2/4 - 667g/2 - 2010 = 0. What is g? -2, 3, 1340 Factor -25d3 + 660d*2 - 5376d + 12544. -(d - 4)(5d - 56)*2 Solve -3f*2/4 + 53109f/2 + 53112 = 0 for f. -2, 35408 Suppose f*2 - 1806986f + 816299601049 = 0. What is f? 903493 Suppose 2l2 - 486l + 4212 = 0. What is l? 9, 234 Determine m, given that 2m4/5 + 58m*3/5 - 2314m*2/5 - 3018m/5 + 28152/5 = 0. -51, -4, 3, 23 Factor 2f2 - 612f - 159264. 2(f - 474)(f + 168) Factor -2o2 + 144o + 2016. -2(o - 84)(o + 12) Factor -4r2/5 - 4348r/5 - 49296. -4(r + 60)(r + 1027)/5 Solve -2j5 - 22j*4 - 86j*3 - 138j*2 - 72j = 0 for j. -4, -3, -1, 0 Find z such that -z*2/2 - 31717z/2 + 31719 = 0. -31719, 2 Let -q*4 - 134q*3 - 1971q*2 + 2106q = 0. What is q? -117, -18, 0, 1 Determine h so that 8h5 - 44h*4 + 60h*3 + 20h*2 - 68h + 24 = 0. -1, 1/2, 1, 2, 3 Factor 2o2/11 + 14700o/11 + 73450/11. 2(o + 5)(o + 7345)/11 Suppose j*5 - 919j*4 + 215239j*3 - 1885085j*2 + 4986800j - 4140500 = 0. What is j? 2, 5, 455 Let 49284n5 + 983904n*4 + 3759364n*3 - 4966264n*2 + 175280n - 1568 = 0. What is n? -14, -7, 2/111, 1 Solve -z*3 - 93320z*2 + 1119867z/4 - 839907/4 = 0 for z. -93323, 3/2 Determine o so that 4o2/5 + 684o/5 - 3056 = 0. -191, 20 Suppose 339p4/7 + 4395p*3/7 - 4902p*2/7 + 24p = 0. Calculate p. -14, 0, 4/113, 1 Suppose -2r4/11 + 6364r*3/11 - 5004962r*2/11 - 91641600r/11 - 414720000/11 = 0. Calculate r. -9, 1600 Determine b so that 75b4 + 86115b*3 + 2038572b*2 - 1672212b + 337200 = 0. -1124, -25, 2/5 What is j in -60j4 + 632j*3 + 1972j*2 + 1808j + 528 = 0? -1, -2/3, 66/5 Factor -2c4/5 - 8612c*3/5 - 9262202c*2/5 + 18550248c/5 - 9279432/5. -2(c - 1)2(c + 2154)2/5 Determine v so that -v4/7 - 59159v3/7 + 59162v*2/7 + 118320v/7 = 0. -59160, -1, 0, 2 Factor 7o2 + 24424o + 3489. (o + 3489)(7o + 1) Factor 2z3/5 + 228z*2/5 + 1728z + 108864/5. 2(z + 36)2(z + 42)/5 Let -5x2 + 230x + 70560 = 0. What is x? -98, 144 Factor -3u3/2 + 225867u*2/2 + 451752u + 451758. -3(u - 75293)(u + 2)*2/2 Find d, given that 2d*2 + 1208d - 94360 = 0. -674, 70 Factor -2r2 - 122200r - 1866605000. -2(r + 30550)2 Determine x so that -2x*2 + 344068x/7 - 98304/7 = 0. 2/7, 24576 Determine b so that 2b5/11 - 1086b*4/11 + 142416b*3/11 + 1371168b*2/11 = 0. -9, 0, 276 Let 2f*3/9 - 1030f*2/9 - 1036f/9 + 688/3 = 0. Calculate f. -2, 1, 516 Suppose -x*4/8 - 7x*3/4 + 187x*2/8 - 56x + 69/2 = 0. Calculate x. -23, 1, 2, 6 Solve 2o2 - 3194o - 3196 = 0. -1, 1598 Factor -4w3/5 + 192052w*2/5 - 2305344192w/5 + 2305152144/5. -4(w - 24006)2(w - 1)/5 Factor 14739o4/2 + 35547o*3 - 68850o*2 - 577500o - 750000. 3(o - 4)(17o + 50)3/2 Factor -5a*2 + 81520a - 332275520. -5(a - 8152)2 What is r in 5r*2 - 347580r + 6040592820 = 0? 34758 Solve 2q3/15 - 266q*2/15 + 1784q/15 - 168 = 0 for q. 2, 5, 126 Factor -t*4/7 + 477t*3/7 - 26814t*2/7 - 14875012t/7 + 1833761064/7. -(t - 218)*3(t + 177)/7 Factor 4f3 + 3084f*2 - 161128f - 334560. 4(f - 51)(f + 2)(f + 820) Suppose -2t*5/5 + 92t*4 - 8866t*3/5 - 2290288t*2/5 = 0. What is t? -56, 0, 143 Determine c so that 1922c*5 - 3840c*4 - 53824c*3 - 88524c*2 - 40546c - 84 = 0. -3, -1, -2/961, 7 Solve -8w3/13 + 73958w*2/13 + 92458w/13 + 18492/13 = 0. -1, -1/4, 9246 Let 3j4 + 384j*3 - 4059j*2 + 11124j - 7452 = 0. Calculate j. -138, 1, 3, 6 Factor 10y3/3 - 710808y*2 + 1421614y/5 - 426484/15. 2(y - 213242)(5y - 1)2/15 Determine j so that j2/5 - 708j - 7084/5 = 0. -2, 3542 Factor -4j3 + 158780j*2 - 1575613632j - 1575772416. -4(j - 19848)2(j + 1) Factor -2t2 - 19228t - 46214498. -2(t + 4807)2 What is q in 6q*4 + 460q*3 + 5450q*2 + 18180q + 18144 = 0? -63, -9, -8/3, -2 Factor 2x4 - 616x*3 + 52652x*2 - 803880x + 3406050. 2(x - 145)2(x - 9)*2 Factor -5j*2 - 1610j + 18315. -5(j - 11)(j + 333) Find t such that -5t3 + 820t*2 - 42025t + 689210 = 0. 41, 82 Factor q*4 - 1486q*3 + 494329q*2 + 42885960q + 832899600. (q - 780)*2(q + 37)*2 Determine o so that -3o*3 - 903o*2 - 18777o - 101277 = 0. -279, -11 Factor 3m3 + 20454m*2 - 204873m - 225324. 3(m - 11)(m + 1)(m + 6828) Suppose 27p*3 - 520740p*2 + 347151p - 57858 = 0. Calculate p. 1/3, 19286 Factor -2v3/11 - 19432v*2/11 - 47200328v/11. -2v(v + 4858)*2/11 Find d, given that -20d*5 - 235d*4 + 1160d*3 + 2725d*2 - 750d = 0. -15, -2, 0, 1/4, 5 Factor y*2/6 - 17y + 420. (y - 60)(y - 42)/6 Factor 3i*2/4 + 1415i + 943. (i + 1886)(3i + 2)/4 Let 8c5 - 404c*4 + 3844c*3 + 11816c*2 + 4896c = 0. Calculate c. -2, -1/2, 0, 17, 36 Determine f so that -4f3/5 - 7888f*2/5 + 197296f = 0. -2090, 0, 118 Factor -t*4 - 48t*3 + 4857t*2 - 18820t + 18612. -(t - 47)(t - 2)2(t + 99) Find a such that -2a5 + 4560a*4 - 2599200a*3 = 0. 0, 1140 Let 5j*4 + 2575j*3 + 2530j*2 - 20620j - 30840 = 0. What is j? -514, -2, 3 Suppose -2n4/3 + 46n*3/3 - 18n*2 - 210n = 0. Calculate n. -3, 0, 5, 21 What is j in -2j2 - 1728j - 50040 = 0? -834, -30 Determine n so that -n*4/4 - 1355n*3/4 - 1349n*2/2 + 2706n = 0. -1353, -4, 0, 2 Find w, given that -2w5/7 + 40w*4/7 + 604w*3/7 + 2320w*2/7 + 2998w/7 + 1240/7 = 0. -5, -4, -1, 31 Determine b, given that 2b5/7 - 652b*4/7 + 1234b*3/7 + 20032b*2/7 + 2592b = 0. -4, -1, 0, 7, 324 Factor w*4/5 - 287w*3/5 - 1473w*2/5 + 3803w/5 - 2044/5. (w - 292	{ "pile_set_name": "DM Mathematics" }
4 = 0. Which is the biggest value? (a) s (b) m (c) -2/3 b Let s(d) = 2d + 10. Let j be s(-6). Let t be 4/20j/(-2). Which is the smallest value? (a) -5/6 (b) t (c) -3 c Let c = 286 + -497. Let l = 311 + c. Let p be (1 + 4)(-8)/l. What is the second biggest value in -0.5, p, 0.4? p Let x be (-2)/5 + 17/5. Suppose xv - 1 = 20. Suppose -3a - z + 8 = 0, -v = -a - z + 5z. What is the third smallest value in -2/7, 1/4, a? a Let s = 41 + -165/4. Let c = -0.03 + 0.33. Let u = -0.1 + c. What is the biggest value in s, u, 1? 1 Let t = -2.8 + 3. Let m = -6/19 + 11/95. What is the second smallest value in 1/2, m, t? t Suppose 0 = 2k + v - 4, 2k - 4v = -k + 17. Which is the fourth biggest value? (a) k (b) -3/7 (c) 0.2 (d) -5 d Let r be ((-54)/(-81))/(2/2 + 1). Which is the smallest value? (a) -1/4 (b) 0.2 (c) r (d) 1.7 a Let l = -3 - 4. Let k = 0.31 + 7.69. Let r = l + k. What is the biggest value in r, 3, 0.3? 3 Let o = 18.4 + -13. Let y = o + -5. Which is the smallest value? (a) 1 (b) 4/3 (c) y c Let o = -8 - -13. Let f = -125.9 - -121. Let m = f + o. Which is the second smallest value? (a) m (b) 1 (c) 2/9 c Let n be 203/196 + 6/(-8). What is the smallest value in -4/5, n, -2/13? -4/5 Let q be ((-30)/(-75))/(1/2). Which is the third smallest value? (a) q (b) 0.2 (c) -0.4 a Let q = 2 - 1. Let n = -48 - -335/7. Which is the third smallest value? (a) q (b) n (c) -0.4 a Let r = -0.56 - 4.24. Let u = r + 0.8. Let h = 0 - 0. Which is the second biggest value? (a) u (b) 0.2 (c) h c Let r be (0 + 3)(6 - 7). Which is the smallest value? (a) -2 (b) r (c) 0.4 b Let w be 447/(-1491)(-1 - -2). Let j = w + 1/71. Which is the second biggest value? (a) -0.4 (b) 4 (c) j c Let n = -0.051 - -1.051. Let t = -0.1 - -0.1. Let b = t - n. What is the smallest value in b, -3, 2/7? -3 Let t = -40 + 22. Which is the third biggest value? (a) 1/2 (b) -2/11 (c) 1 (d) t b Let n = -2 - -3. Suppose -2r + 6r = -2y, -3y - 2r = 4. Which is the third smallest value? (a) n (b) y (c) -1 a Let u = 0.27 - -0.03. Let i = 10 + -19. Let o = i - -9. Which is the third smallest value? (a) u (b) o (c) 3/4 c Let a = -41 - -29. Let g be (a/(-126))/((-2)/(-12)). Let r = 2.7 - 3. What is the second smallest value in g, 0.3, r? 0.3 Let l = 0.03 - -0.07. Which is the second smallest value? (a) -2/39 (b) l (c) 4 b Let i = -2.9 + -0.1. Let z = i - -3.1. Which is the biggest value? (a) 5 (b) z (c) -5 a Let k = -118.6 + 119. Which is the biggest value? (a) -0.1 (b) k (c) 2 (d) -5 c Suppose -4n - n + 8 = -4c, 0 = 5c + 2n - 23. What is the second biggest value in c, 1/14, -5? 1/14 Suppose -3f + 1 = 16. Let m = -6.4 + 6. Let o = 4.6 - m. What is the third smallest value in -3, f, o? o Let u = 0.07 + 0.33. Let w(m) = m3 - 8m*2 + 8m - 2. Let a be w(7). What is the second biggest value in a, u, -2/3? u Let l = 0.15 + -0.05. Let v = l - 0. Let j be (-1)/3 + 2/10. Which is the third biggest value? (a) j (b) v (c) 0.3 a Let a = 52 + -49. What is the second smallest value in 0.6, -0.1, a, 5? 0.6 Let y = -10.9 + 0.9. Let l = -17 - y. Let z = l + 6.5. Which is the third smallest value? (a) 2 (b) 1 (c) z a Let s = 4.51 + -0.51. Which is the fourth biggest value? (a) -0.2 (b) s (c) 1/7 (d) 0.3 a Let i(s) = s*3 - 7s*2 + 5s - 9. Let k be i(7). Let g = -4 - k. Let y be (-4)/g + 1/(-3). Which is the smallest value? (a) 2 (b) y (c) 2/11 b Let c = 10.5 - 10.1. What is the fourth smallest value in -3/5, c, 1, -2? 1 Let b = -56 - -56. What is the third smallest value in b, 0.2, 12? 12 Let c = -3/20 - 9/20. What is the third smallest value in c, 2, 10? 10 Let q = -0.324 - -0.024. What is the third biggest value in q, -5, -2? -5 Let z = 0.4 - 0.1. Let f = z + -0.4. Let t = f + -0.4. What is the second biggest value in t, 2/3, 3? 2/3 Let d be ((-4)/(-8))/(5/6). What is the smallest value in -10, d, -2/7? -10 Let u(l) be the third derivative of l6/120 + l5/12 + 5l4/24 + l3/3 + 9l*2. Let x be u(-4). Which is the third smallest value? (a) -5 (b) 1/4 (c) x b Suppose -t = d + 2 - 12, -5t + d = -32. Suppose 5p - 1 = 3l + t, -5l = -4p + 9. Which is the third smallest value? (a) -0.2 (b) p (c) -1/2 b Let x = -8 + 0. Let r = 6 + x. Let g = -12 - -7. Which is the second smallest value? (a) r (b) g (c) 0 a Let o be (-31)/((-15)/25). Let u = -2 + o. Let h be u28/30 - 2. What is the smallest value in -2, h, 0? -2 Suppose 2g - 4w - 28 = 0, 7w = 3w - 20. Let p be (4 + 0)(-12)/32. What is the smallest value in 0, p, g? p Let r = -7 + 7.07. Let y = 0.06 - r. Which is the smallest value? (a) 0 (b) 4 (c) y c Let j = 201333135/1152280294 + 1/6686346. Let u = 3/835 + -1258/117735. Let l = u - j. Which is the third smallest value? (a) l (b) -4 (c) -3 a Let v = -0.6 + 5.6. Let k(j) = -7j - 119. Let o be k(-17). Which is the third biggest value? (a) o (b) v (c) 3 a Let o = -5.7 + 6. Let q = o + 0. Let h = q + -0.5. Which is the biggest value? (a) -2/21 (b) 1 (c) h b Let t = 12 - 11.6. Let k = 5 - 3. Let r be k/5(-25)/35. Which is the third smallest value? (a) t (b) r (c) 0.3 a Let f = 613/20 + -147/5. Which is the third smallest value? (a) f (b) 5 (c) -1/3 (d) 0.1 a Let u = -67 + 265/4. Let o = 2.5 + 2.5. Let p = 0.7 + 2.3. What is the third biggest value in u, p, o? u Let x = 17/2668 + 1/92. Let v be (-2)/6 - (-46)/696. Let b = x + v. What is the second smallest value in 0.3, b, 1/2? 0.3 Let t = -5/54 + 241/270. Which is the smallest value? (a) t (b) 4 (c) 3/11 c Let z = 0.3 - 0.3. Let t = 62 + -62.3. What is the second biggest value in t, z, 0.2? z Let w be -2 - (-1)/(1 + 0). Let g = 16 - 22. Let k = g + 6.1. What is the second biggest value in -1/3, w, k? -1/3 Let n = -3.7 - 1.3. Which is the third biggest value? (a) 1 (b) -0.2 (c) n c Let p = 9/5 + -8/5. Which is the smallest value? (a) -2/11 (b) p (c) 1 a Suppose 0 = -2g - 11 - 3. Let z = g - -5. Let w be 2 - z/(-1 + 3). Which is the second smallest value? (a) -3 (b) w (c) -0.4 c Let v be (-4)/(-6) - (-5)/(-12). Let d be 9/(-2)(-3)/(-36)4. Which is the biggest value? (a) v (b) d (c) 5 c Let n = -0.063 + 0.163. Which is the third biggest value? (a) n (b) -4 (c) 4 (d) 1 a Let h = -126 - -125.7. Which is the third biggest value? (a) -1 (b) 1/12 (c) h a Let m = -4 - -8. Suppose -mh = h. Let o = -2 + h. Which is the second biggest value? (a) -4 (b) o (c) -2/9 b Let v = 140.06 + -137. Let z = v - 0.06. What is the biggest value in z, -1, 0? z Let w = -41/3 - -454/33. Let q = -0.077 - -0.547. Let v = q - -0.03. Which is the second biggest value? (a) -1 (b) w (c) v b Let c = 3.9 - -1.1. What is the third biggest value in c, -1, -5? -5 Let v = 0.32 - 0.02. Suppose 5h = -2t - 7, -4t = -3h - 12 - 13. Which is the biggest value? (a) v (b) 1/13 (c) h a Let m = 0.17 + 0.23. Which is the smallest value? (a) 3 (b) m (c) -1 c Let b(j) = -j3 + 2. Let g be (-3 + (-2 - -5))/(-1). Let i be b(g). What is the biggest value in i, -0.1, -5? i Let o be 6(-8)/(-60)-5. Which is the third biggest value? (a) -3/8 (b) o (c) -0.1 b Let w = 31.475 - -0.425. Let q = w + -38. Let l = q + 6. What is the third smallest value in 0, 1/4, l? 1/4 Let b(g) = -2g. Let z be b(-1). Let q be (-15)/6z/(-10). Let f be (-11)/3 - (-2)/(-6). What is the second smallest value in -1/2, f, q? -1/2 Let d = 7 + -1. Let n(r) = r3 - 5r*2 - 7r + 1. Let j be n(d). Which is the smallest value? (a) j (b) 4 (c) 0.5 a Let l = 2 - -4. Which is the biggest value? (a) 0.2 (b) l (c) 3 b Let d = -18 - -89/5. What is the smallest value in 2/5, 1, d? d Let y = -4.6 - -1.6. Which is the third biggest value? (a) y (b) 0.1 (c) 4 a Suppose -2c + 4c - 5g = -10, 0 = -3c - 3*g - 15. Let u = 3.9 + -4. Let i = 0.9 - u. What is the second biggest value in i, 0, c? 0 Let g = -15 + 14.6. Which is the third smallest value? (a) 11/2 (b) g (c) 1/5 a Let t = 2 + -1.9. Let s = -3 + -2. Which is the smallest value? (a) t (b) -4 (c) s c Let n be ((-2)/10)/((-12)/(-15)). What is the smallest value in n, -3/4, 0.4? -3/4 Let x be (-4 - -2) + (-28)/(-10). Let s be 36/(-140) - (-2)/5. Let r = -1/91 - s. Which is the third biggest value? (a) r (b) -0.4 (c) x b Let y =	{ "pile_set_name": "DM Mathematics" }
) -0.5 (b) 2 (c) v b Let q = -24.1 - -24.6. Let j = 2 + -1. What is the closest to j in 3, q, -138? q Let g = 597 + -596. Suppose 0 = -t + 3z + 11, -t - 5z = -g + 6. Which is the closest to 1? (a) -2.7 (b) 3 (c) 2 (d) t c Let x = 2547 + -10187/4. Which is the closest to 2? (a) x (b) 2 (c) -1174 (d) -2/7 b Suppose 0 = -10n + 11n + 5d + 21, 12 = -3d. Which is the nearest to n? (a) 1/2 (b) -0.02 (c) 12.9 b Let p = -0.0291 + 284.0291. Let q = p + -318. Which is the nearest to 0.1? (a) 1/7 (b) q (c) 2 a Let v be ((-18)/33 - (-632)/(-132)) + 6. Which is the nearest to 6? (a) 0 (b) v (c) 1/12 (d) -2/11 b Let h = 9.7 + -9. Let a = h - 0.3. Let p = 74.59 + -85.59. What is the closest to p in a, 2, -4? -4 Let m = 61 - 182/3. Let h = 59/378 - -7/54. What is the nearest to m in h, 8, -0.3? h Let j = 177.3 - 177.2. What is the nearest to -2/7 in 3, -0.4, -5, j? -0.4 Let k = -0.1759 - 0.0241. Which is the closest to -88? (a) -3 (b) k (c) 4 (d) -5/3 a Suppose -61c + 33 + 28 = 0. What is the closest to c in -1/6, -2/3, -4, -5/2? -1/6 Suppose g - 5n = -n - 16, 5g - 45 = -5n. Let i be g/1421/(-14). Let h = 2098/35 + -299/5. Which is the closest to -4? (a) i (b) h (c) -0.5 c Let c be (-8)/(-10)12/(-24). Let h be 25/104/6. Let j = -1.316 - 0.684. What is the closest to j in h, c, 0.1? c Let l = -3.605 - -3.505. Which is the nearest to 8? (a) -2 (b) -1 (c) l c Let d = 49 - 49.3. Let k = -0.224 + 0.234. Let r = -1.8 + 2. Which is the nearest to k? (a) -2 (b) r (c) d b Let m = -7124.1 - -7124. What is the closest to 3 in m, -3, 11, -2/15? m Suppose 10v = -16 + 46. Let f be (1 - v)(-18)/(-36). What is the closest to f in 1/3, -26, 3/4? 1/3 Suppose -5p + 25 = 0, 0o + 2o - 3p - 37 = 0. Let n be o/39 - (0 + 0). Let w be -22(1062/(-132) + 8). What is the nearest to w in n, 0, 0.02? n Let i be (-2)/(-4) - 28/8. Which is the closest to 2? (a) i (b) -4 (c) 1/6 (d) -22 c Suppose 2 = 2f + 3g, 0 = 2f + 3g - g - 4. Let t = 3596 - 3596.2. Let w be (-3)/(-9) + (-2)/(-3). Which is the closest to 0? (a) t (b) f (c) w a Let s(g) = 2g + 2. Let r be s(-3). Let t = 160/511 - 2/73. What is the nearest to -2 in r, 1, t? r Let h = -15.091 - -15.041. Which is the nearest to h? (a) 4 (b) -0.4 (c) 7 (d) -5/3 b Let f = 93 - 89. Let j = -3.1 + 24.1. Let p = 20.6 - j. What is the closest to -0.1 in p, 0.4, f? p Let s be (-35)/(-10)2/14. Suppose -4n - 216 = -212. What is the nearest to n in 4, 2/7, s? 2/7 Let j = -7.4 - -6.4. Let r(k) be the third derivative of 5k*4/24 + 13k*3/3 - 5k*2. Let l be r(-5). What is the closest to j in l, -0.3, -5? -0.3 Let p = 988 - 990. Let n = 5.9 + -10.9. Which is the nearest to n? (a) p (b) 4 (c) 0.3 a Let r be (-2 + 1/(-2))48/60. Let v = 0.303 - 0.703. Which is the nearest to -1? (a) -1.7 (b) v (c) r b Let n = 51/2 - 25. Suppose 9s = 8s - 3d - 16, 5d = -5s - 10. What is the nearest to 4/3 in -1/2, s, n? n Let v = 18.278 + -0.078. Let t = 17.2 - v. Which is the nearest to t? (a) 0.2 (b) 4/3 (c) 2/3 a Let h(k) = -2k - 29. Let g be h(-7). Let s be 2/18 + g/(-27). Which is the nearest to s? (a) 1/5 (b) -0.2 (c) -3 a Let o = -0.54 + 37.54. Let l = o - 33. Let p = 4 - l. What is the closest to 0 in -0.5, p, -2/5? p Let i = -0.683 - 0.317. Which is the closest to i? (a) 1/2 (b) 4 (c) -0.3 c Let l = 427.1 + -427.3. What is the closest to -11 in 0.1, 2, 0.13, l? l Let i = 351.6536 - 0.1536. Let x = 351 - i. What is the closest to 0.1 in 7, -0.4, x? -0.4 Let d = -2782 + 2782. Let b = 6 - 5.6. What is the closest to -0.1 in b, -45/7, d? d Let g be -9 - ((-61)/5 - 4218/(-3515)). Let z = -1/40 + 11/40. Which is the nearest to 6? (a) -0.1 (b) -0.5 (c) g (d) z c Let l be (2/(29/((-174)/(-36))))/(10/(-18)). Which is the closest to -6? (a) -4 (b) l (c) 4 (d) 0.2 a Let l = 866.91 + -868. Which is the nearest to l? (a) -3 (b) 2/3 (c) 1/3 c Let a = 45.54 + -45.44. What is the closest to 4 in 2, 15, a? 2 Let b = 2721 - 2719. What is the nearest to b in 4/9, 16, 2/5? 4/9 Suppose 0 = -8s + 207 - 199. What is the nearest to s in 0, 22, 2/5, -4? 2/5 Let h = 2.46 - 23.56. Let l = h - -20.9. Which is the closest to 2? (a) l (b) -5 (c) -3 a Let p = 38587 - 192934/5. Let n = 0.4 + -0.8. Which is the closest to n? (a) -1/5 (b) -0.1 (c) p a Let h = -333.3 + 333. Let o = -21.7 - -23. What is the closest to 1 in o, h, -6/11? o Let p = -0.22 + 0.02. Let v = 64 - 43. Let y = v - 20.9. What is the nearest to y in p, -3/17, -2/19? -2/19 Suppose 2g + 3 + 3 = 0. Let z = 451 - 380. Let x = z - 71.1. Which is the closest to -0.1? (a) g (b) -7 (c) x c Let t = 642.7 + -681. Let o = 39 + t. Let w = o + -0.7. What is the closest to w in 3/13, -2, -2/7? 3/13 Let d = -20 + 19.91. Let n = d - -0.022. Let p = n - -11.068. Which is the nearest to 0? (a) -1/3 (b) p (c) -5 a Let z = 209.884 - -0.116. Let y = z - 212. What is the nearest to -0.1 in -40, 0.1, y? 0.1 Let v = 302.5 + 61.5. Let y = v - 367. Let l be (-2)/(-11) + 175/(-539). What is the nearest to 0.1 in 6, l, y? l Let u = -81051 - -405257/5. Let v = 3 + 1. Which is the closest to u? (a) -3 (b) 8 (c) v (d) 0.2 d Let r = 0 - -0.4. Let x = -11.92 + 0.32. Let q = x + 11.5. Which is the closest to 1? (a) q (b) r (c) 4 b Let j = -200.92 - -199. Let l = -2.12 - j. Let g be 2 - 8(-2)/(-6). Which is the closest to 1/3? (a) g (b) l (c) 0 c Let m = -0.2 - -5.2. Let q = 107321 + -107322. What is the nearest to q in -0.3, 0, m? -0.3 Let z(q) = -9q*2 - q - 16. Let g be z(-5). Let o = g - -236. What is the nearest to -4 in 4/7, 0.5, o? o Let z = 38.92 + -39. Suppose -f = 9f - 40. Which is the closest to 0.2? (a) z (b) 3 (c) f a Let h be (224/(-12) - -8)/((-4)/28). Let v = 0 - 0.5. What is the closest to -1 in -2, h, v? v Let l = 568.2 + -653. Let j = l + 84. What is the closest to 2 in -1/10, -2, j? -1/10 Let v = -10.36 + 10.86. Which is the closest to 5.3? (a) v (b) -2 (c) 4 (d) 1 c Let a = -394092 - -394092.5. Let n = -1.3 - 3.7. Let o = -7 - n. What is the nearest to o in a, -3, -0.01? -3 Let n = 0.1 - 1.1. Let y be 2/5 + (-48)/45. Let l(k) = -k2 + 42k + 725. Let s be l(-13). Which is the nearest to n? (a) s (b) y (c) 2 b Let s = -0.019 + -0.981. Suppose -244 = 4f - 5z, -2f = 3f + 5z + 350. Let u be f/5 + (-3)/(-15). Which is the closest to s? (a) u (b) 2/3 (c) -0.3 c Let i be 31(-10)/(-6). Let u = -2448 + 2445. Which is the closest to 0.1? (a) u (b) 4.4 (c) i a Let r = -142/191 + 1190/573. Which is the closest to -29/23? (a) 1 (b) 2/3 (c) r b Let f = 4.9 + -9.6. Let i = f + 4.7. Let m be 3 - (4/6 - (-30)/9). Which is the nearest to m? (a) -5/2 (b) -5 (c) i c Let p = 0.028 - 0.128. Let g be ((-33)/(-414))/114. Let n = g + 814/483. Which is the closest to -0.1? (a) n (b) -4 (c) p c Suppose d = -0d. Let c = 0.8 + 0.2. Let b = -452.4 + 452.1. What is the nearest to b in 4/5, d, c? d Let b = 9 + -13. Let z = -0.8 + 1. Let m = 353149/7 - 50450. What is the nearest to b in z, -3/4, m? -3/4 Let a(l) = l3 + 12l*2 + 20l + 12. Let j be a(-10). Suppose -18z + 36 = -jz. Let d = 211/11 - 19. What is the closest to 1 in z, d, -1? d Let b = 73 + -73.35. Let k = -0.35 - b. Let f = 3.987 - -0.013. What is the closest to k in -3, f, 0.3? 0.3 Let k = 7.7 - 12.7. Suppose 3d - 8d - 15 = 0. Let z = 473/4 - 119. Which is the nearest to d? (a) 0.3 (b) k (c) z b Let x = 3.4 + -0.4. Let f = -21 + 25. Let w be (-6)/2 + (f - (-6)/(-7)). What is the nearest to 0.1 in x, -4, w? w Let k = 1.2578 + -6319.2578. Which is the nearest to 1? (a) 4/5 (b) -2 (c) k a Let z = 233 + -631. Let i = 398.09 + z. Which is the nearest to 2? (a) -1/2 (b) -2/9 (c) i (d) 5/3 d Let z = 0 - -1/5. Let p = -0.3 + 0.2. Let o = -3453 - -3452.9. Which is the nearest to p? (a) o (b) 0.4 (c) z a Let q = 584.84 + -581. Let d = -3.79 + q. Let h = -1 + 2. Which is the nearest to h? (a) 6 (b) d (c) 1 c Let z = -0.95 + 1. Let n = 31.9746 + -30.3746. Which is the closest to z? (a) 0.5 (b) -4 (c) n a Let q = -4.9286 - -1.6286. What is the closest to 25 in q, -1/7, -1/4, 0.5? 0.5 Let s = 1268 + -1265. What is the closest to -120 in -4, s, 5? -4 Let i = 70.94 - 641.94. What is the nearest to 2 in i, 3, -2/5, -1/12? 3 Let x =	{ "pile_set_name": "DM Mathematics" }
/11 = 0. Calculate x. -102448, -1 Suppose 4i4 - 224i*3 - 5304i*2 - 29376i - 24300 = 0. What is i? -9, -1, 75 Let -4z2/5 + 178116z/5 + 356248/5 = 0. Calculate z. -2, 44531 Factor z*2 - 8z - 17145. (z - 135)(z + 127) Factor -j3/2 + 109j*2/2 + 221j/2 + 111/2. -(j - 111)(j + 1)2/2 Factor -5b*3 + 164905b*2. -5b*2(b - 32981) Solve -3f5 + 357f*4 - 13638f*3 + 144402f*2 + 902697f - 1033815 = 0 for f. -5, 1, 41 Factor 4p2/7 + 60p/7 - 232. 4(p - 14)(p + 29)/7 Suppose 4a2 - 1956a - 396088 = 0. What is a? -154, 643 Factor 3o2/2 + 481155o + 77170044675/2. 3(o + 160385)2/2 Suppose 5z*2/3 - 212660z/3 + 2261213780/3 = 0. Calculate z. 21266 Suppose -y*4/5 - 114y*3 - 1128y*2/5 + 4544y/5 = 0. Calculate y. -568, -4, 0, 2 Factor 5b3 - 2955b*2 + 276075b - 273125. 5(b - 475)(b - 115)(b - 1) Suppose 5j*2 - 430j + 7965 = 0. What is j? 27, 59 Let p*5/5 + 52p*4/5 - 200p*3 + 5792p*2/5 - 12912p/5 + 9792/5 = 0. What is p? -68, 2, 6 Factor -4l5 - 284l*4 - 736l*3 + 177744l*2. -4l*2(l - 21)(l + 46)2 Factor 5516o*2 + 33112o + 96. 4(o + 6)(1379o + 4) Determine p so that 2p*3/3 - 747816p*2 + 209710788696p = 0. 0, 560862 Factor g*3 - 6997g*2 + 12243000g - 12236004. (g - 3498)*2(g - 1) Factor -2l2 - 562l - 8480. -2(l + 16)(l + 265) Factor 50r5/7 + 710r*4/7 + 1888r*3/7 + 1408r*2/7. 2r*2(r + 11)(5r + 8)*2/7 Determine b, given that -5b*2 + 314370b - 4941424845 = 0. 31437 Determine y so that -3y5/7 - 600y*4/7 - 84y*3 + 1794y*2/7 + 591y/7 - 1194/7 = 0. -199, -2, -1, 1 Factor l*2/2 - 1619l/2 - 13080. (l - 1635)(l + 16)/2 Find y such that -27y*2 + 358473y + 79662 = 0. -2/9, 13277 Let 121945i4 + 6257040i*3 + 1934010i*2 + 199800i + 6885 = 0. Calculate i. -51, -3/29 Factor -l*3/4 + 955l*2/4 + 1913l/4 + 957/4. -(l - 957)(l + 1)2/4 Solve 20q*5/9 - 144q*4 + 23740q*3/9 - 28400q*2/3 - 2000q = 0 for q. -1/5, 0, 5, 30 Suppose -5t2 + 35130t + 598655 = 0. What is t? -17, 7043 What is p in -4p4 + 6312p*3 + 18988p*2 - 25296p = 0? -4, 0, 1, 1581 Solve o*3/4 + 11757o*2/4 - 67741o - 70680 = 0. -11780, -1, 24 Factor -x*2/4 - 119x/4 - 1335/2. -(x + 30)(x + 89)/4 Determine t so that -3t*3 + 627t*2 + 19827t + 19197 = 0. -27, -1, 237 Suppose w*4/2 + 379w*3/6 + 434w*2/3 - 2w/3 - 248/3 = 0. What is w? -124, -2, -1, 2/3 Determine i so that 2i5/11 + 31158i*4/11 + 155746i*3/11 + 93426i*2/11 - 280332i/11 = 0. -15574, -3, 0, 1 Factor -z*3 - 549z*2 + 80280z. -z(z - 120)(z + 669) Factor -3w2/7 + 10911w/7. -3w(w - 3637)/7 Factor -5b4 + 3660b*3 + 18425b*2. -5b*2(b - 737)(b + 5) Let -6o*4 - 647o*3 - 2358o*2 + 3531o - 520 = 0. Calculate o. -104, -5, 1/6, 1 Suppose -21f2 - 1309104f - 374028 = 0. What is f? -62338, -2/7 What is t in 4t4 + 848t*3 + 11084t*2 - 848t - 11088 = 0? -198, -14, -1, 1 Suppose 176g2 - 2060g + 3000 = 0. What is g? 75/44, 10 Determine c, given that c*2/5 + 3932c/5 + 3865156/5 = 0. -1966 Factor 5g5 - 18180g*4 + 290080g*3 - 1738880g*2 + 4634880g - 4633600. 5(g - 3620)(g - 4)*4 Factor -2v*2/13 + 474244v/13 - 28113421442/13. -2(v - 118561)2/13 Let 2r*4/9 + 6802r*3/3 + 17387552r*2/3 + 571322752r/9 = 0. What is r? -5096, -11, 0 Factor 3q2/2 + 137949q/2 - 68976. 3(q - 1)(q + 45984)/2 Suppose 4b2 + 1747136b + 190780262656 = 0. What is b? -218392 Factor -2q2 + 10984q - 10982. -2(q - 5491)(q - 1) Factor 4r2/3 + 29644r/3 - 19768. 4(r - 2)(r + 7413)/3 Let -2k4/9 + 260k*3/9 - 578k*2/3 + 164k = 0. Calculate k. 0, 1, 6, 123 Suppose -u*2 + 962800u - 231745960000 = 0. Calculate u. 481400 Determine h so that -h*2 - 1012h - 250260 = 0. -582, -430 Determine y, given that -14y5/3 + 1732y*4/3 - 58150y*3/3 + 275648y*2/3 + 27848y = 0. -2/7, 0, 6, 59 Determine i so that -4i4/7 - 8i*3 + 284i*2/7 - 96i/7 - 432/7 = 0. -18, -1, 2, 3 Let 20t4 + 17320t*3 + 17305t*2 + 4325t = 0. Calculate t. -865, -1/2, 0 What is r in 2r5/7 + 368r*4 + 15410r*3/7 + 33356r*2/7 + 30776r/7 + 10256/7 = 0? -1282, -2, -1 Factor 5m5 + 82140m*4 + 337348980m*3. 5m*3(m + 8214)*2 Factor -5q*3/4 - 965q*2 + 40100q - 406000. -5(q - 20)2(q + 812)/4 What is v in 9v4/4 - 105v*3 - 147v*2/4 + 141v/2 = 0? -1, 0, 2/3, 47 Determine n so that 36n4 - 4224n*3 + 21844n*2 - 38280n + 22400 = 0. 5/3, 2, 112 Find s, given that -19s5 - 18s*4 + 970s*3 + 880s*2 - 1911s + 98 = 0. -7, -2, 1/19, 1, 7 Factor 2n3 + 171834n*2 - 1031058n + 1546614. 2(n - 3)2(n + 85923) Solve w*5 + 159w*4 - 161w*3 - 159w*2 + 160w = 0 for w. -160, -1, 0, 1 Solve -33z4 - 1184z*3/3 - 1271z*2 - 872z + 112/3 = 0 for z. -7, -4, -1, 4/99 Solve -2x3 + 30506x*2 - 61006x + 30502 = 0 for x. 1, 15251 Determine a so that 147a3 - 6183345a*2 + 3533304a - 504756 = 0. 2/7, 42063 Let -3r5 - 6603r*4 - 4781118r*3 - 1091206950r*2 + 34598566977r + 35684999409 = 0. Calculate r. -743, -1, 29 Suppose -5v2 + 3660v - 3655 = 0. What is v? 1, 731 Let 2d5/21 + 7894d*4/21 - 4d*3/21 - 15788d*2/21 + 2d/21 + 7894/21 = 0. What is d? -3947, -1, 1 Let 4w2/9 - 2216960w/9 + 307181977600/9 = 0. Calculate w. 277120 Find y such that -y*3/2 + 19225y*2/2 - 28833y = 0. 0, 3, 19222 Find m such that m*3/5 + 12144m*2/5 + 7376265m + 73714082/5 = 0. -6071, -2 Find f such that -3f5/2 + 9135f*4/2 - 6940305f*3/2 - 20875755f*2/2 - 10447020f - 3483864 = 0. -1, 1524 What is p in p*2/5 + 1424p/5 + 2828 = 0? -1414, -10 Factor t*2/12 - 137032t/3 + 18777769024/3. (t - 274064)*2/12 Suppose 4m*3 + 6348m*2 - 19072m + 12720 = 0. Calculate m. -1590, 1, 2 Find f, given that 2f4/11 - 254f*3/11 - 29202f*2/11 + 254f/11 + 29200/11 = 0. -73, -1, 1, 200 Factor 3w2/7 + 337212w/7 + 9475994412/7. 3(w + 56202)2/7 Factor 873842d*4/11 + 80642d*3 + 13270d*2/11 + 50d/11. 2d(d + 1)(661d + 5)*2/11 Factor -4m*3 + 9832m*2 + 4m - 9832. -4(m - 2458)(m - 1)(m + 1) Find l, given that -4l*2 + 8948840l - 5005108584100 = 0. 1118605 Suppose 2r5/15 + 104r*4/5 + 11464r*3/15 - 87444r*2/5 - 5008878r/5 + 10335276/5 = 0. Calculate r. -63, 2, 31 Find i, given that 3i2/5 + 1920i - 28827/5 = 0. -3203, 3 Find c such that 3c4/4 - 93c*3/2 - 261c*2 + 1317c/2 - 1407/4 = 0. -7, 1, 67 Factor 3g4 + 3738g*3 + 1179216g*2 + 9221862g + 8046381. 3(g + 1)(g + 7)(g + 619)2 Factor -2t*2/3 - 10858t - 32572/3. -2(t + 1)(t + 16286)/3 Solve -3d4 + 213084d*3 + 639270d*2 + 639276d + 213093 = 0 for d. -1, 71031 Suppose -155n3/4 - 336585n*2 - 21715n = 0. What is n? -8686, -2/31, 0 Factor y*2/2 - 1111y/4. y(2y - 1111)/4 Suppose -2l5 + 214l*4 - 768l*3 - 5704l*2 - 6592l = 0. What is l? -2, 0, 8, 103 Let -8z5/3 + 29z*4 + 6619z*3/3 - 8802z*2 + 24052z/3 + 1144 = 0. Calculate z. -26, -1/8, 2, 33 Suppose 2x5/11 + 12x*4/11 - 464x*3/11 - 3884x*2/11 + 42x + 352 = 0. Calculate x. -11, -1, 1, 16 Let 46z5 + 67164z*4 - 263352z*3 + 245968z*2 + 23424z = 0. Calculate z. -1464, -2/23, 0, 2 Factor -c*2 - 111c/2 - 81. -(c + 54)(2c + 3)/2 Factor 2d3 + 544d*2 - 20808d. 2d(d - 34)(d + 306) Solve 16q*2/7 + 124772q/7 + 4456 = 0. -7798, -1/4 What is i in -2i2/7 - 4i + 1702/7 = 0? -37, 23 Factor 2w3 - 535366w*2 + 35826826560w + 35827361928. 2(w - 133842)2(w + 1) Factor -w*2/7 + 91390w/7 - 2088033025/7. -(w - 45695)*2/7 Factor 1058z*5 + 9476z*4/3 - 36328z*3/9 - 46160z*2/3 + 3328z + 173056/9. 2(z + 2)3(69z - 104)2/9 Suppose -u4/8 - 2u*3 + 20u*2 + 224u + 480 = 0. What is u? -20, -4, 12 Factor 2w3/7 + 244w*2/7 + 9682w/7 + 17672. 2(w + 28)(w + 47)*2/7 Factor -3w*3 + 234w*2 - 825w - 4662. -3(w - 74)(w - 7)(w + 3) Factor -2q*2/7 + 9244q/7 + 55536/7. -2(q - 4628)(q + 6)/7 Suppose 6b2/11 + 600b/11 - 227406/11 = 0. Calculate b. -251, 151 Factor -d*5 + 4641d*4 + 23230d3. -d3(d - 4646)(d + 5) Factor 5c4 + 100c*3 + 455c*2. 5c*2(c + 7)(c + 13) Find x, given that 3x*5 + 9x*4 - 105x*3 - 117x*2 + 210x = 0. -7, -2, 0, 1, 5 Determine	{ "pile_set_name": "DM Mathematics" }
45? 20 Evaluate (646 + -623 - (32 + -1)) + (0 - (1 + -11)). 2 Evaluate 217 + -204 + (-29 - 1). -17 What is -8 - (4 - (3 + (3 - 0))) - (-525 + 438)? 81 Evaluate -17 + (-1 + 3 - 105) + (801 - 821). -140 What is the value of 4 - -13 - (-54 - (26 - 67) - (1 + -11))? 20 Calculate 6 - -25 - 27 - (-69 - 5 - -7 - -5). 66 What is the value of -23 + (-2 - -3) + 60 + -95 + 22 + -15? -50 Evaluate 10 - (-4 + -6 + -4 + 88). -64 0 + 89 + -6 - ((0 - -14) + 32 + -35) 72 What is the value of 15 - (-10 + -4 + 94 + -83)? 18 Evaluate 177 + -69 + (-138 - -135). 105 Evaluate -14 + (3 - 5) - (54 + -66 - 16). 12 Evaluate 4 + 5 - (6 + -34 - (-41 + 19)). 15 What is the value of 315 - 396 - (-11 - 36)? -34 Calculate 194 + -180 - ((6 - -3) + (-2 - 2)). 9 Evaluate (-3758 - -3703) + 3 + (-13 - (-3 - -1)). -63 What is the value of (65 - 1) + -82 - -16? -2 41 + (-2 + 2 - (17 + -13 + -13)) 50 Evaluate -17 - (-22 - (-9 + 14)) - (7 - (7 + 81)). 91 What is -77 + 77 - 39 - (-26 - -1)? -14 What is -18 + (-6 - (7 - (2 - -13))) + 13 - 70? -73 Evaluate (117 - 91) + -16 - (-1 - 3). 14 What is (-72 - -16) + (-30 - (-47 - -3))? -42 What is the value of (-34 - (-2 + -6)) + (3 - (16 + 3 + -15))? -27 What is the value of -1 - -13 - -3 - (1 + 15 + -35)? 34 62 - (-25 - (-16 + -10 + -14)) 47 What is the value of -65 - (-38 - (-39 + 29))? -37 Calculate -1 - -38 - ((127 - 77) + 37). -50 Calculate -51 - (4 - (25 + 3 + -7) - (-8 - -1)). -41 What is the value of (15 - 0 - 0) + (-230 - (-109 + -158))? 52 -63 + 0 + -8 + (3 - -26) + -11 -53 What is -30 + 52 + -11 - (29 + -1)? -17 What is the value of (121 - 123) + (4 + 2 - 5 - 1 - -26)? 24 What is -31 + 33 + -60 + 43? -15 Calculate (-32 - 1) + (-46 + 43 - (-9 + 23)). -50 Calculate -8 + 7 - (-28 + (4 - (9 - 4) - 9)). 37 Evaluate -13 + 4 + (50 - 18) - 28 - 50. -55 (8 + 17 + -13 - 3) + 2 + -6 5 Calculate (94 - (-53 + 89)) + 28. 86 Evaluate (0 - -115) + 639 + -709. 45 What is (-12 - 5 - (-97 + 1)) + 1 + -8 + 2? 74 What is the value of (44 - (42 + -75)) + -43? 34 What is the value of (-21 - (-2 + (-28 + 11 - -7))) + -35? -44 What is -91 - (-36 - (125 + -84))? -14 21 - 115 - (-232 - -177) -39 What is the value of (92 - 45) + (-8 - -7) - 21? 25 What is -6 - (8 + (21 - 35) - (45 + (-1 - 3)))? 41 Evaluate 9 + (1 - 13 - 9) + 8. -4 Evaluate 23 + (2 + -1 + -7 - 1 - -2). 18 What is 14 + (2 - -3 - (-4 + -12 + -26)) - 2? 59 Calculate 34 + -279 + 136 + 11. -98 Evaluate (-9 - -9) + -18 - 24 - (-13 - -2). -31 Calculate -25 + (43 - (-36 - -61)). -7 Calculate 7 + 8 + -15 + 76 + 2 + -195 + 206. 89 (6070 - 6060) + (0 - (143 - -2)) - -10 -125 What is -69 - (-2 + -2 - (-11 - (3 + 1 + -14)))? -66 What is the value of 11 - (51 + (-1 - -8))? -47 What is -18 - (-17 + 42 + -23 - -5)? -25 What is the value of (4 - 16) + 16 + (-8 + 0 - (3 + -3))? -4 Evaluate -4 + (-21 - (-31 + 10)). -4 Calculate 12 + 27 + -1 + (-33 - 7). -2 Calculate 24 - (15 - (-64 - -108)). 53 Evaluate (-1 - 156 - -61 - (-13 + 1 + 1)) + 8. -77 Evaluate -96 + (29 - (27 + -19 + -2 - -10)). -83 (-68 - (-2 - ((-14 - -1) + 24))) + 6 -49 What is the value of -74 + 75 + (-11 - 7) + -19? -36 What is the value of -1 - 4 - (-36 + 3 + 12)? 16 Evaluate (87 - 14) + -26 + (7 - 13 - 5). 36 What is (-279 - -295) + (13 - -64 - 5)? 88 Evaluate -48 + 7 + -18 + 45 + -9. -23 What is the value of 116 + -109 - (-92 - (8 - -4 - (-7 + 9)))? 109 -4 + 0 + 111 + -142 + -2 + 37 0 What is the value of (-2 + -4 - 1) + (-41 - (-310 + 163))? 99 15 + 19 - 38 - 3 -7 What is 11 + -92 + (13 - 8) + (15 - 8) + -26? -95 What is the value of 6 - -3 - (13 - (8 - (16 - 20)))? 8 -2 + -53 + (42 - (74 + -32)) -55 (-22 + 6 - -9) + (-40 - (1 - 3)) -45 Calculate (-18 - -4) + (-2 - -11) + (-1 - -7). 1 (-4 - -3) + -52 - (298 + -315 - (-11 + 0)) -47 What is the value of -7 - 31 - (-2 + (21 - 44))? -13 What is the value of 12 - (-21 - (24 + 7 + -20))? 44 What is 20 + 0 + -6 - ((-13 - 1) + -103 + 19)? 112 Calculate -1 - (-1 + 0 + 1 - (-572 + 573)) - 2. -2 Evaluate 10 - (10 + 8 + -1 + 72 + -108). 29 0 - ((-6 - (-6 + (-7 - -4))) + 37) - -1 -39 (-5 - ((-9 - 2 - 5) + -13)) + 4 28 What is the value of (-2 - -43) + (39 + -37 - 4)? 39 -146 - (112 + -117 + -130) -11 Evaluate (-5 + 40 - (-20 - -31)) + 21 + -17. 28 -17 + -24 + 110 + 7 + -8 68 Evaluate 37 + (3 - -4) + -28 + (2 - -22). 40 388 + -359 - ((6 - -62) + -5) -34 39 + -3 - (1085 - 1083) 34 Calculate -13 - (33 + 2 - (-729 - -696)). -81 What is -2 - 13 - (-1 - (-15 - -5 - -1))? -23 What is the value of -88 + (8 + 2 - (-11 - -11 - (-9 - -2)))? -85 Calculate 8 + 9 + -8 + -20 + -52. -63 Calculate (-2 - -116) + (9959 - 10032). 41 Calculate 18 - (37 + (30 - 29)). -20 What is -5 + (-10 - (-14 + (-10 - -18))) + -24 + 0? -33 Evaluate 187 + -180 - (6 + 11) - (-1 + -32). 23 What is (0 - -3) + -2 + (-70 - (24 + -84))? -9 What is -113 + -6 + 5 + -2 + (35 + -10 - 10)? -101 What is 6 - (-27 + -38 + 25 + 19)? 27 Evaluate -39 + (4 - 2) + 2 + (-18 - -11) + -2. -44 151 - 175 - (-51 - 6) - -41 74 Evaluate -39 - (-11 - (21 - -5)) - (0 - 74). 72 (49 + -143 - -116) + (-2 - -5 - 109) -84 Calculate -114 + 34 - -103 - (4 + 44). -25 -45 - (-3 + -13 + 7 + 10) -46 (-68 - -94) + (-62 - 29) -65 Calculate (1 - -10) + -61 + -16 - 10. -76 74 + (-29 - (-13 + 68)) -10 Calculate -155 - (-52 - 126) - (83 - (-1 - -1)). -60 -49 - (39 - 56) - -86 54 -17 + 26 + -31 + 34 - -37 49 What is the value of 42 + (-75 - (57 + -171))? 81 -81 - ((-48 - -52) + -62) -23 What is the value of (-4 - 2) + -13 + 76 + -36 + 36? 57 What is the value of 11 - -10 - 3 - (64 - 20) - (2 + -7)? -21 130 + -124 - (108 - (2 + (2 - 10) + 4)) -104 Evaluate (5 - -8) + (-17 + 34 + 12 - 16). 26 -10 + (42 + -2 + -14 - 5) 11 Evaluate (4 - (10 - -2)) + (522 + -498 - (-84 + -1)). 101 Evaluate 13 + (-3 - -1) + -38 + (-9 - -35) + -71. -72 What is (207 + -238 - -85) + (33 - -1)? 88 What is the value of (37 - (-44 + 84)) + 0 + 2 - (50 + 2)? -53 Evaluate 2 + -20 + (15 - -20) + -68. -51 What is (-18 - 14) + 103 - (1 - (-1 + 1) - -3)? 67 What is 38 + -3 + -5 - ((4 - 15) + 2)? 39 Calculate 70 - (-80 - -142) - 103. -95 What is the value of 24 - (35 - 76 - 36)? 101 What is (0 + -1 - (-16 + 13)) + 40 + (-8 - 1)? 33 What is the value of 73 + -17 - (9 - (30 - 2) - 0)? 75 What is -27 - (19 - 44 - -42)? -44 Evaluate (-5 - (145 - -1)) + 14 + (-82 - -83). -136 2 - (3 + -12 + (-32 - -20)) - 5 18 Evaluate (401 + -395 - ((1 - -9) + -1 + -1)) + 12. 10 Calculate (192 - 134) + 43 + -144. -43 Calculate (-30 - 0) + (16 - ((-8 - -35) + (-59 - -44))). -26 What is the value of (6 - ((-10 - 0) + 0)) + (0 - 8) - 41? -33 What is -9 + (8 - 2) + (29 - (2 + -2))? 26 Calculate (8 - -10) + (36 - 34) + -18. 2 What is the value of 54 - (39 + 8 + -32 + (-2 - (7 - 2)))? 46 What is the value of -21 - -36 - (-1 + -3 + 7)? 12 Calculate -102 - ((-55 - -7) + -49). -5 Calculate 6 + (24 - (-19 - -26)) - 15. 8 (31 + -32 - -35) + -31 - (42 - (0 + -1)) -40 What is the value of (-27 - 25) + 52 + 6? 6 17 - (-37 + (-19 - -58) + (1 - 1)) 15 Calculate -29 - (32 - (28 - -10)) - -32. 9 What is the value of -80 + 48 - (-1 - -2)? -33 Evaluate (-5 - -2) + (-116 - (-102 + -40)). 23 What is the value of (2 - (5 - 1)) + (23 + 0 - (-116 - -149))? -12 Calculate -10925 + 10863 - (-70 - 1). 9 What is the value of (13 - 1) + -2 + 0 - (295 - 271)? -14 What is the value of (-1 - (5 + (-33 - -9))) + -59 + 16? -25 What is the value of 149 + 131 + -221 + 16? 75 What is -63 - (145 + -229) - 43? -22 Evaluate -36485 - -36376 - (-108 - -1). -2 Calculate (25 - 13 - (-60 - (16 + -11))) + -13. 64 Evaluate -59 - (2 + (10 - -5 - (3 - 6) - 7)). -72 -1 + -33 - (6 - -12 - (88 - 83)) -47 What is -82 - -103 - (-10 - -13 - (-1 - 3 - -6))? 20 What is (-31 - -28 - 25) + 0 + 78? 50 What is -36 - (53 + -76) - (-1 - 1 - 79)? 68 Evaluate 0 + 6 - -1 - (292 - 288) - (-37 + 15). 25 Calculate (19 + -10 - (7 + -15)) + -91 - (-7 + 0). -67 Evaluate 38 + (1 - (22 + -14 + -8 - 0)) + 2. 41 -8206 - -8158 - (69 + 1) -118 65 + -67 + (-108 - -13) + -15 -112 Evaluate (-6 + -2 - (-13 - 92 - -24)) + 17. 90 Calculate (-1 - -25 - (27 + 4 + -39)) + 8. 40 What is (-273 - -133 - -46) + 86? -8 What is (24 - 42) + -53 + (-82 - -124)? -29 Evaluate -12 + (17 - 40) + 20. -15 What is -58 + 14 + 32 + -14 + -10? -36 Evaluate -94 - (53 + -161 - -56). -42 Evaluate -18 - -32 - (-1 + (-1 - -9)) - 19. -12 Evaluate (-7	{ "pile_set_name": "DM Mathematics" }
ms? 3500 What is 3/10 of a meter in centimeters? 30 What is 79893.95 grams in nanograms? 79893950000000 What is four thirds of a minute in seconds? 80 Convert 476.9458 tonnes to milligrams. 476945800000 What is 7.894222 millennia in decades? 789.4222 Convert 1243209.45 hours to weeks. 7400.05625 How many weeks are there in 1104077.142s? 1.825524375 What is 2.460836 days in hours? 59.060064 Convert 13210.665 months to millennia. 1.10088875 What is 0.5726395cm in millimeters? 5.726395 Convert 66.99314 micrometers to nanometers. 66993.14 What is 4/3 of a hour in minutes? 80 Convert 84.38028 months to years. 7.03169 How many months are there in 42/5 of a decade? 1008 Convert 0.124293 months to decades. 0.001035775 What is one sixteenth of a century in months? 75 Convert 4388.438 litres to millilitres. 4388438 Convert 0.894654cm to millimeters. 8.94654 How many nanograms are there in 0.3033702 milligrams? 303370.2 How many nanoseconds are there in 0.844366 weeks? 510672556800000 How many months are there in 59595.11 centuries? 71514132 How many centuries are there in 7393.657 millennia? 73936.57 What is 7576.028 weeks in hours? 1272772.704 Convert 520037.9 years to decades. 52003.79 Convert 6589.79 litres to millilitres. 6589790 What is 5875.973 millilitres in litres? 5.875973 What is 24059.862 months in millennia? 2.0049885 How many micrometers are there in 21/4 of a centimeter? 52500 How many millimeters are there in 11/2 of a centimeter? 55 What is 7/8 of a centimeter in micrometers? 8750 What is 697950.5 nanometers in kilometers? 0.0000006979505 What is 537.5929um in meters? 0.0005375929 How many kilograms are there in one fifth of a tonne? 200 What is 402048.9 millennia in years? 402048900 What is 5.10279 hours in weeks? 0.03037375 Convert 71540.64 decades to years. 715406.4 What is eighty-one halves of a millennium in decades? 4050 What is 2/15 of a week in seconds? 80640 How many months are there in twenty-five eighths of a century? 3750 What is 3/8 of a week in minutes? 3780 How many kilograms are there in one quarter of a tonne? 250 How many nanoseconds are there in 76.10695 seconds? 76106950000 What is three tenths of a milligram in micrograms? 300 How many decades are there in 1/5 of a century? 2 How many micrograms are there in 0.7661257 grams? 766125.7 How many millimeters are there in 25/2 of a meter? 12500 How many months are there in three tenths of a decade? 36 Convert 425731.9 meters to nanometers. 425731900000000 What is three fifths of a meter in centimeters? 60 What is 5.34744 nanometers in micrometers? 0.00534744 What is 7.3698822s in days? 0.0000852995625 What is fifty-seven halves of a millimeter in micrometers? 28500 What is 79/2 of a litre in millilitres? 39500 Convert 2.202516 minutes to seconds. 132.15096 What is 892.1157 weeks in microseconds? 539551575360000 What is 73.68569l in millilitres? 73685.69 What is 3/10 of a millisecond in microseconds? 300 Convert 2.066304ml to litres. 0.002066304 How many millilitres are there in 3/40 of a litre? 75 What is 46/5 of a millennium in decades? 920 How many months are there in 15/4 of a year? 45 How many years are there in 31/2 of a millennium? 15500 How many nanograms are there in 3/25 of a microgram? 120 What is 7/2 of a millimeter in micrometers? 3500 What is six fifths of a litre in millilitres? 1200 What is seven halves of a millennium in decades? 350 How many months are there in six fifths of a decade? 144 How many milligrams are there in 9546.067g? 9546067 Convert 4635.114ns to microseconds. 4.635114 What is 6/5 of a decade in months? 144 How many millimeters are there in 60.5856km? 60585600 How many tonnes are there in 3.819566mg? 0.000000003819566 How many nanometers are there in 60720.18 millimeters? 60720180000 How many milliseconds are there in three tenths of a minute? 18000 Convert 61839.34 millennia to years. 61839340 What is 38.33157 days in milliseconds? 3311847648 How many nanograms are there in thirteen eighths of a microgram? 1625 Convert 26236.48s to milliseconds. 26236480 How many meters are there in fifty-one eighths of a kilometer? 6375 How many centimeters are there in 54.42258um? 0.005442258 Convert 9.087826 years to decades. 0.9087826 How many milliseconds are there in 59.3439us? 0.0593439 How many days are there in 75086.04 weeks? 525602.28 What is 0.3696493 grams in nanograms? 369649300 How many micrometers are there in 1/10 of a centimeter? 1000 Convert 640153.9cm to millimeters. 6401539 How many millilitres are there in 3/5 of a litre? 600 What is fourty-five halves of a meter in millimeters? 22500 What is 20.4155 weeks in milliseconds? 12347294400 What is 1612.017 decades in millennia? 16.12017 Convert 1065.279978us to weeks. 0.000000001761375625 Convert 2.8726 decades to millennia. 0.028726 What is 41136.45 litres in millilitres? 41136450 What is 1/27 of a day in seconds? 3200 Convert 178250.7m to kilometers. 178.2507 How many milligrams are there in 45/8 of a gram? 5625 How many milligrams are there in 0.3014181kg? 301418.1 How many millimeters are there in 59/5 of a centimeter? 118 How many seconds are there in 31.37556 weeks? 18975938.688 What is 271807.9 decades in centuries? 27180.79 How many centimeters are there in 7/8 of a kilometer? 87500 Convert 8631.711 litres to millilitres. 8631711 Convert 24.94797 decades to months. 2993.7564 What is 3/5 of a milligram in micrograms? 600 What is 1.4760372 hours in days? 0.06150155 How many millimeters are there in twenty-one halves of a meter? 10500 What is 651.4116 millennia in decades? 65141.16 How many millilitres are there in 17/4 of a litre? 4250 How many millimeters are there in thirteen eighths of a meter? 1625 What is seven eighths of a millennium in years? 875 How many decades are there in 6.370694 millennia? 637.0694 How many millimeters are there in twenty-nine halves of a meter? 14500 How many micrograms are there in 742.0822g? 742082200 What is 656771.4l in millilitres? 656771400 How many milliseconds are there in 508.2325 hours? 1829637000 Convert 890940.8 micrometers to kilometers. 0.0008909408 What is 3/40 of a litre in millilitres? 75 How many months are there in one twentieth of a decade? 6 Convert 3.3451 centuries to millennia. 0.33451 What is 6/5 of a millennium in months? 14400 What is 69.97629 minutes in hours? 1.1662715 How many micrograms are there in 13/4 of a milligram? 3250 How many millilitres are there in twenty-one halves of a litre? 10500 What is 922808.2mg in nanograms? 922808200000 What is 5/6 of a day in seconds? 72000 What is 1/10 of a millennium in months? 1200 How many days are there in 18474.6231s? 0.21382665625 What is 13/4 of a meter in millimeters? 3250 How many micrograms are there in 0.554306ng? 0.000554306 What is nine tenths of a kilometer in meters? 900 How many nanometers are there in 15/4 of a micrometer? 3750 Convert 5.066499ml to litres. 0.005066499 How many seconds are there in one quarter of a minute? 15 What is 32/5 of a meter in centimeters? 640 Convert 232.391484s to days. 0.00268971625 How many litres are there in 6.861645ml? 0.006861645 Convert 8989.457l to millilitres. 8989457 Convert 6617.364ns to microseconds. 6.617364 Convert 580.9655 decades to years. 5809.655 How many seconds are there in 8/25 of a hour? 1152 What is 5/8 of a minute in milliseconds? 37500 What is 2/7 of a week in days? 2 What is 8092.12 nanograms in tonnes? 0.00000000000809212 Convert 4.77105 milliseconds to nanoseconds. 4771050 What is 2/75 of a week in seconds? 16128 How many hours are there in 31631.97 days? 759167.28 What is twenty-one quarters of a litre in millilitres? 5250 Convert 81.5887m to centimeters. 8158.87 How many litres are there in 15.36268ml? 0.01536268 How many millilitres are there in 1/5 of a litre? 200 How many millilitres are there in 29/2 of a litre? 14500 How many nanometers are there in 43/2 of a micrometer? 21500 What is five quarters of a day in minutes? 1800 What is one sixteenth of a second in microseconds? 62500 What is 7/4 of a minute in seconds? 105 What is 46.32649 litres in millilitres? 46326.49 How many millilitres are there in 3/40 of a litre? 75 How many microseconds are there in 83.08249 days? 7178327136000 What is 811395.6ug i	{ "pile_set_name": "DM Mathematics" }
Let a be p(-6). Suppose 3x - 34 = -4n + a, -3n = 2x - 38. What is the units digit of (-4)/n81/(-3)? 9 Let i be (-2)/(-4) + 6/4. Suppose r - 5c - 7 = -3r, 0 = -r + ic - 2. What is the units digit of r? 8 What is the units digit of -3 + 6 + 5 + -3? 5 Let r = 4 + 0. Let v(l) = 0 + 3l - 4 + l2 - 4l + 3. What is the tens digit of v(r)? 1 Let q(j) be the second derivative of -j5/60 - j4/24 + j*3/6 - 2j. Let k(g) be the second derivative of q(g). What is the units digit of k(-2)? 3 Let m(y) = -y*3 + 5y*2 + 8y - 9. Let s be m(6). Let t(l) = 2l3 - l2 - 4l + 5. What is the tens digit of t(s)? 3 Let n(z) be the third derivative of -z*5/60 - 11z4/24 - z3/6 - 2z2. What is the units digit of n(-9)? 7 Let r be ((-12)/(-9))/((-2)/48). What is the units digit of r/(-6)3/2? 8 Suppose -5a = 15, 2q + a - 67 = -3q. Suppose -6l = 2k - l - q, 0 = 5l. What is the units digit of k? 7 Let x(a) = 241a - 5. What is the hundreds digit of x(1)? 2 Suppose i - 112 = -2q + 3i, -166 = -3q + 5i. What is the units digit of q? 7 Let n be (370/15)/((-2)/(-3)). Let j = n + -15. What is the units digit of j? 2 Let m = 0 - -38. What is the tens digit of m? 3 Suppose 7t - 6 = 4t. Let j(o) = 2o*2 - o. Let z be j(4). Suppose f = -tm + 10, 3m - 6f = -f + z. What is the units digit of m? 6 Suppose -1 = m - 9. Let n = m + -12. What is the units digit of ((-21)/(-6))/((-2)/n)? 7 What is the units digit of (-10)/35 - 48/(-21)? 2 What is the hundreds digit of 5/(-15)-979? 2 Let o(b) = b*3 - 7b*2 - 4b + 8. What is the tens digit of o(9)? 3 Let g = 2 - 3. Let d = -17 - 10. What is the units digit of (d/(-6))/g-2? 9 Let r = -1 + -2. What is the units digit of r/(-6) - (-39)/2? 0 Let d = 0 + -11. Let g = 51 + d. Suppose 10c - g = 5c. What is the units digit of c? 8 What is the units digit of ((-48)/14)/((-4)/28)? 4 Let d(b) = -b3 - 18b*2 - 18b - 6. What is the tens digit of d(-17)? 1 What is the units digit of (15/(-10))/(6/(-16))? 4 Suppose 3p = -5z + 678 - 9, -1099 = -5p - 3z. What is the tens digit of p? 1 Let a = 452 + -322. What is the units digit of a? 0 Let d(i) = i*3 + 5i*2 - 5i + 8. Let h be d(-6). Suppose -g - 10 = -3s, 3g + 7s = hs + 26. What is the units digit of g? 2 Let h(s) = -s*3 - 7s*2 - 7s - 5. Let g be h(-5). What is the tens digit of (-292)/g - 2/(-5)? 1 Let h(l) = 2l2 - 5l - 3. What is the units digit of h(4)? 9 What is the units digit of 1(-3)/2(-4)/3? 2 Suppose 28o + 292 = 32o. What is the units digit of o? 3 Let h(y) = y3 - y2. Let p(b) = 4b3 - 12b*2 - 6b + 5. Let o(r) = -r + 5. Let d be o(4). Let a(q) = dp(q) - 5h(q). What is the units digit of a(-6)? 5 Let i(v) = -v*3 + 18v*2 + 2. Let g be i(18). Suppose -m - g = 0, 5d + 4m = 38 + 109. What is the tens digit of d? 3 Suppose -x + 1 = -2. What is the units digit of x? 3 Suppose 4p = p + 24. Let t = 5 - p. What is the units digit of 3/2(-14)/t? 7 Let s = -40 - -151. What is the hundreds digit of s? 1 Suppose -2l + l = 3b, 0 = -3l - 4b + 5. Let p be (44/33)/((-2)/(-3)). Suppose la - pa = 10. What is the tens digit of a? 1 Let g = -44 + 83. What is the units digit of g? 9 Let p be 44/(-6)(-3)/2. Let b = p + 23. What is the tens digit of b? 3 Suppose 4s + 8 = -92. What is the tens digit of 69/5 + (-5)/s? 1 Let x = -23 + 61. What is the units digit of x? 8 Let w be (-10)/((-6)/3 - -1). Let p be (-3 + 1)/((-2)/w). What is the units digit of (p/3)/((-2)/(-3))? 5 What is the tens digit of (5 - -2 - 22)24? 7 Suppose 0 = -4b + 93 + 67. What is the tens digit of b? 4 What is the hundreds digit of 2/(-1)(4 + (-314)/4)? 1 Let h = -535 - -806. What is the units digit of h? 1 Suppose -5w = 2a - 0a - 84, 3w - 44 = 2a. What is the units digit of w? 6 Let s(z) = 2z - 6. Let k be s(5). Let q = k + -8. What is the units digit of (-7 - -3)/(2/q)? 8 Suppose -3r = -8r + 100. What is the tens digit of r? 2 Suppose -2t = n - 8, -5n = -5t - 19 - 6. Suppose n = -3b - 0. Let x = b + 5. What is the units digit of x? 3 Suppose i - 2i = -2. Suppose -i = -q + 26. What is the tens digit of q? 2 Let q(z) = z*3 + 7z*2 - 9z - 6. Let m be q(-8). Suppose -4y - m = -10. Suppose -2g - 3b - yb = -4, 4g = 4b + 8. What is the units digit of g? 2 Let a(o) = -2o + 5. Let t be (0 - 3)/((-1)/(-1)). What is the tens digit of a(t)? 1 Suppose -3r - 3c = c + 17, 3c = -15. Suppose -m + 9 + r = 0. What is the tens digit of m? 1 Suppose 0 = 3s + 5g + 73, -2g - 2g + 47 = -s. Let c = -16 - s. What is the units digit of c? 5 Let a(b) = b*2 - 6b + 1. Let n be a(6). Let q = n + 2. Suppose l - qm + 6 = 25, 15 = 5l + 5m. What is the units digit of l? 7 Suppose -12 = -0c - 3c - 3x, 0 = 4x - 4. Suppose ch + 0h = 12. Suppose -t - 5j + 0j + h = 0, 0 = -3j. What is the units digit of t? 4 Suppose -n = -1 + 3. What is the units digit of (n/3)/((-4)/54)? 9 What is the tens digit of 22/(-99) - 760/(-18)? 4 Suppose -3j = u - 0j - 13, 3u - 5j = 95. What is the units digit of u? 5 Let h be -12 - 1 - (5 - 8). Let f = 16 + h. What is the units digit of f? 6 Let l = 62 - -74. What is the tens digit of l? 3 Let o(x) = x*2 + x + 21. What is the units digit of o(0)? 1 Suppose -50q = -46q - 204. What is the tens digit of q? 5 Let m = -6 - -9. Suppose 3n = -2n + a + 18, 0 = -4n - ma + 22. What is the tens digit of (10/n)/((-2)/(-12))? 1 Let v(q) = -3q3 - q2 - 2q. Suppose 7x - 3x - 8 = 0. Let o be v(x). What is the units digit of o/(-18) + 6/27? 2 Let n(f) = -11f*2 + 10f + 1 - 2f3 + 0 + 4 + 3f*3. What is the units digit of n(10)? 5 Let x(q) = q + 12. Let k be x(-9). Let n(o) = 0o*k - 1 - 4o + 2o - 2o*3. What is the units digit of n(-1)? 3 Suppose -2r + 6 = 2g, -2r = -0r + g - 6. Suppose 2i + r = -i. What is the units digit of (3/(-2))/(i/2)? 3 Suppose -6r + 2r + 8 = 0. Let w be 362/8 + r/(-8). Suppose 11 = 4q - w. What is the units digit of q? 4 Suppose -5w + 0w = -20. What is the units digit of w? 4 Suppose o - 2g = 3o - 312, g = -2o + 310. What is the tens digit of o? 5 Suppose -s + 5 = 8. Let j(x) = -4x + 1 - 5 - 4x - x2. What is the units digit of j(s)? 1 Let o(f) = f3 - 7f2 + 6f + 4. What is the units digit of o(6)? 4 Let j = 8 + -5. Suppose f + 8 = jg, f - 14 = -4g - f. What is the units digit of g? 3 Suppose -f - 2x = -199, -4f - 5x + 792 = -x. What is the tens digit of f? 9 Let a = 34 + -9. What is the tens digit of a? 2 Let o be 6(3/(-3))/(-1). Suppose -4g = -5a + 19, 0 = -2g - o + 14. What is the units digit of a? 7 Let k(h) = -2h*2 - h. Let m(y) = 6y*2 + 4y - 1. Let n(t) = 11k(t) + 4m(t). What is the units digit of n(-4)? 8 Let h be ((-16)/3)/46. Let o = h + 29. What is the tens digit of o? 2 Let c = -163 + 248. What is the tens digit of c? 8 Suppose 0 = 2u + 3c - 5, -3u + 4 = 2u - c. Let j be (-1 - -2)(-5)/u. Let g = 6 + j. What is the units digit of g? 1 Suppose -3t + 11 = -4. Suppose -y + 10 = -3y, 0 = 4z - ty - 77. What is the units digit of z? 3 Suppose 19z - 13z = 780. What is the tens digit of z? 3 Let b = 16 + -15. What is the units digit of b? 1 Let i = 233 - 51. What is the units digit of i? 2 Let h = -6 - -2. What is the units digit of (-4)/(h/1443)? 8 Let h = -1 - -1. Suppose 2i - 4v = i - 10, -4i - 3v = -17. Let a = i + h. What is the units digit of a? 2 Let k be 1/(3/2 - 1). Let j = 13 + k. What is the tens digit of j? 1 Suppose 4g + 73 - 25 = 0. What is the units digit of -22/g33? 1 Let l(f) = f*3 - 4f*2 - 7f + 3. Let p be l(5). Let u(k) be the first derivative of k*3/3 + 5k*2/2 - 9k - 7. What is the units digit of u(p)? 5 Let f = 576 + -351. What is the hundreds digit of f? 2 Let d = -42 + 21. Let v = d + 36. What is the tens digit of v? 1 Let u(x) = -x*3 - 7x*2 + x - 3. Let k be u(-7). Let b = k + 14. Suppose 6 = 2i - 3n, -27 - 29 = -bi - 5n. What is the units digit of i? 9 Let j(t) be the first derivative of -t3/3 + 7t*2/2 + 2. Let d be j(7). Suppose di + i = 3. What is the units digit of i? 3 Let x(d) = -d*2 + 7d + 13. What is the tens digit of x(7)? 1 Let t(y) = -19y3 + y2 - 2y - 3. Let p(q) = -94q3 + 5q*2 - 11q - 16. Let o(h) = -2p(h) + 11t(h). What is the tens digit of o(	{ "pile_set_name": "DM Mathematics" }
o the nearest integer? 130 What is 2138 to the power of 1/2, to the nearest integer? 46 What is 18888 to the power of 1/2, to the nearest integer? 137 What is the fifth root of 12812 to the nearest integer? 7 What is 56790 to the power of 1/5, to the nearest integer? 9 What is the third root of 2806 to the nearest integer? 14 What is 2574 to the power of 1/5, to the nearest integer? 5 What is the tenth root of 1089 to the nearest integer? 2 What is 47445 to the power of 1/2, to the nearest integer? 218 What is the square root of 36235 to the nearest integer? 190 What is 1391 to the power of 1/2, to the nearest integer? 37 What is 25295 to the power of 1/2, to the nearest integer? 159 What is 5907 to the power of 1/5, to the nearest integer? 6 What is 63728 to the power of 1/4, to the nearest integer? 16 What is 1359 to the power of 1/2, to the nearest integer? 37 What is the cube root of 1295 to the nearest integer? 11 What is the tenth root of 20117 to the nearest integer? 3 What is 29129 to the power of 1/3, to the nearest integer? 31 What is the square root of 1526 to the nearest integer? 39 What is the square root of 1569 to the nearest integer? 40 What is the sixth root of 4372 to the nearest integer? 4 What is 45566 to the power of 1/5, to the nearest integer? 9 What is the square root of 119160 to the nearest integer? 345 What is 1696 to the power of 1/2, to the nearest integer? 41 What is 473 to the power of 1/2, to the nearest integer? 22 What is the third root of 34316 to the nearest integer? 32 What is the ninth root of 3922 to the nearest integer? 3 What is 2111 to the power of 1/10, to the nearest integer? 2 What is 913 to the power of 1/2, to the nearest integer? 30 What is 184 to the power of 1/10, to the nearest integer? 2 What is 4826 to the power of 1/2, to the nearest integer? 69 What is the third root of 909 to the nearest integer? 10 What is 997 to the power of 1/10, to the nearest integer? 2 What is the third root of 4375 to the nearest integer? 16 What is 120683 to the power of 1/2, to the nearest integer? 347 What is the square root of 42446 to the nearest integer? 206 What is 3713 to the power of 1/7, to the nearest integer? 3 What is the fourth root of 833 to the nearest integer? 5 What is 581 to the power of 1/2, to the nearest integer? 24 What is the eighth root of 3356 to the nearest integer? 3 What is the square root of 1227 to the nearest integer? 35 What is 10028 to the power of 1/3, to the nearest integer? 22 What is 2281 to the power of 1/2, to the nearest integer? 48 What is the square root of 15934 to the nearest integer? 126 What is 1898 to the power of 1/3, to the nearest integer? 12 What is the cube root of 93990 to the nearest integer? 45 What is 4556 to the power of 1/8, to the nearest integer? 3 What is 45689 to the power of 1/2, to the nearest integer? 214 What is 10108 to the power of 1/3, to the nearest integer? 22 What is 3784 to the power of 1/3, to the nearest integer? 16 What is the square root of 145205 to the nearest integer? 381 What is the ninth root of 496 to the nearest integer? 2 What is 70573 to the power of 1/6, to the nearest integer? 6 What is 1761 to the power of 1/2, to the nearest integer? 42 What is 130764 to the power of 1/2, to the nearest integer? 362 What is the cube root of 39142 to the nearest integer? 34 What is the square root of 4466 to the nearest integer? 67 What is the fourth root of 71310 to the nearest integer? 16 What is the seventh root of 238 to the nearest integer? 2 What is the tenth root of 4773 to the nearest integer? 2 What is 853 to the power of 1/2, to the nearest integer? 29 What is the third root of 3544 to the nearest integer? 15 What is the seventh root of 10091 to the nearest integer? 4 What is 12 to the power of 1/3, to the nearest integer? 2 What is 1006 to the power of 1/3, to the nearest integer? 10 What is 7260 to the power of 1/7, to the nearest integer? 4 What is the square root of 2315 to the nearest integer? 48 What is 1049 to the power of 1/4, to the nearest integer? 6 What is the square root of 19892 to the nearest integer? 141 What is 29501 to the power of 1/7, to the nearest integer? 4 What is 871 to the power of 1/2, to the nearest integer? 30 What is the cube root of 19663 to the nearest integer? 27 What is the square root of 11038 to the nearest integer? 105 What is 10849 to the power of 1/10, to the nearest integer? 3 What is 18605 to the power of 1/2, to the nearest integer? 136 What is 8139 to the power of 1/4, to the nearest integer? 9 What is the third root of 67670 to the nearest integer? 41 What is the tenth root of 60155 to the nearest integer? 3 What is 5347 to the power of 1/3, to the nearest integer? 17 What is 3751 to the power of 1/2, to the nearest integer? 61 What is the third root of 5774 to the nearest integer? 18 What is the square root of 78657 to the nearest integer? 280 What is 39987 to the power of 1/2, to the nearest integer? 200 What is the tenth root of 3516 to the nearest integer? 2 What is the square root of 270 to the nearest integer? 16 What is the ninth root of 5664 to the nearest integer? 3 What is 434 to the power of 1/3, to the nearest integer? 8 What is 14719 to the power of 1/10, to the nearest integer? 3 What is the seventh root of 644 to the nearest integer? 3 What is the third root of 4042 to the nearest integer? 16 What is the square root of 6400 to the nearest integer? 80 What is 1315 to the power of 1/2, to the nearest integer? 36 What is 165408 to the power of 1/7, to the nearest integer? 6 What is 232 to the power of 1/2, to the nearest integer? 15 What is the cube root of 705 to the nearest integer? 9 What is the third root of 136298 to the nearest integer? 51 What is 454 to the power of 1/6, to the nearest integer? 3 What is the cube root of 527 to the nearest integer? 8 What is 6422 to the power of 1/9, to the nearest integer? 3 What is 26780 to the power of 1/2, to the nearest integer? 164 What is 6107 to the power of 1/7, to the nearest integer? 3 What is the square root of 702 to the nearest integer? 26 What is the third root of 7718 to the nearest integer? 20 What is the sixth root of 1569 to the nearest integer? 3 What is 1636 to the power of 1/3, to the nearest integer? 12 What is 9728 to the power of 1/2, to the nearest integer? 99 What is the cube root of 13354 to the nearest integer? 24 What is 18462 to the power of 1/2, to the nearest integer? 136 What is 779 to the power of 1/5, to the nearest integer? 4 What is 17875 to the power of 1/2, to the nearest integer? 134 What is 948 to the power of 1/3, to the nearest integer? 10 What is 529 to the power of 1/2, to the nearest integer? 23 What is 194 to the power of 1/3, to the nearest integer? 6 What is 26968 to the power of 1/2, to the nearest integer? 164 What is the cube root of 12386 to the nearest integer? 23 What is 3323 to the power of 1/5, to the nearest integer? 5 What is 837 to the power of 1/2, to the nearest integer? 29 What is the cube root of 4051 to the nearest integer? 16 What is the square root of 16865 to the nearest integer? 130 What is the third root of 4357 to the nearest integer? 16 What is the third root of 1553 to the nearest integer? 12 What is the square root of 42452 to the nearest integer? 206 What is the ninth root of 5245 to the nearest integer? 3 What is 6422 to the power of 1/3, to the nearest integer? 19 What is the square root of 1364 to the nearest integer? 37 What is 27633 to the power of 1/2, to the nearest integer? 166 What is 5925 to the power of 1/6, to the nearest integer? 4 What is 94671 to the power of 1/2, to the nearest integer? 308 What is the cube root of 1444 to the nearest integer? 11 What is 8065 to the power of 1/3, to the nearest integer? 20 What is 1421 to the power of 1/3, to the nearest integer? 11 What is 13437 to the power of 1/2, to the nearest integer? 116 What is 750 to the power of 1/2, to the nearest integer? 27 What is 88368 to the power of 1/9, to the nearest integer? 4 What is the cube root of 3884 to the nearest integer? 16 What is 839 to the power of 1/4, to the nearest integer? 5 What is 2117 to the power of 1/3, to the nearest integer? 13 What is 1550 to the pow	{ "pile_set_name": "DM Mathematics" }
) = -2q + 6. Let y(h) = h - 2. Let c(o) = -4r(o) - 11y(o). Determine tc(j) - i(j). -2j - 3 Let t(d) = -10d - 3. Let s(o) = -32o2 - 491o - 171. Let p be s(-15). Let k(g) = 10g + 3. Give pt(n) - 5k(n). 10n + 3 Let t(g) = -17g2 - 3g - 2. Let h be (6/10 - 102/120)(-29 - -17). Let j(m) = 8m*2 + m + 1. Calculate ht(w) + 7j(w). 5w*2 - 2w + 1 Let k(u) = -3u3 - 3u*2 + 276u + 4. Let q(t) = -t3 - t2 + 139t + 2. Calculate -2k(g) + 5q(g). g3 + g2 + 143g + 2 Let k(p) = -33p3 + 7p*2 + 9p + 20. Let x(g) = -30g3 + 6g*2 + 8g + 19. Give 8k(r) - 9x(r). 6r3 + 2r*2 - 11 Let b(p) = -46p*3 + 77p - 1069. Let m(a) = 9a3 - 14a + 214. Calculate -2b(c) - 11m(c). -7c3 - 216 Let b(h) = -h2. Let d be -1((-155)/(-31) + 1-22). Let i(n) = n*2 + 4. Give di(j) - 2b(j). j2 - 4 Let s(w) = -9w*2 + 43w + 14. Let k(n) = 11n2 - 48n - 16. Let x(a) = 5k(a) + 6s(a). Let l(o) = 17o + 3. Determine -4l(v) + 3x(v). 3v*2 - 14v Let r(v) = 3v + 1. Let j(w) be the third derivative of w3/2 + 172w*2. Let g(k) = -2k + 14. Let b(x) = -3g(x) + 15j(x). Calculate 3b(s) - 7r(s). -3s + 2 Let q(h) = 2h*2 - 2. Let n(p) = -12p*2 - p - 12. What is -n(i) - 4q(i)? 4i2 + i + 20 Let s(o) = 6o*3 - 30o*2 - o - 7. Let w(c) = -4c*3 + 23c*2 + 2c + 9. Determine -3s(p) - 4w(p). -2p3 - 2p*2 - 5p - 15 Let v(m) = -7m. Let b(y) = -267y + 1. Determine -b(h) - v(h). 274h - 1 Let h(m) be the third derivative of 5m4/24 - m3/3 + 2m2 - 10m. Let x = 153 - 150. Let d(v) = -4v + 3. Calculate xd(s) + 2h(s). -2s + 5 Let f(g) be the first derivative of g*2/2 - 1240. Let k(j) = 30j - 2. Give -6f(z) + k(z). 24z - 2 Let p(a) = -2147a - 11. Let r(x) = 3211x + 17. Give -8p(i) - 5r(i). 1121i + 3 Let m(p) = 1 + 143p*2 - 147p*2 - 3. Let u(c) = -5c*2 - 3. Let z(x) = -3m(x) + 2u(x). Let s(n) = -6n*2. Determine 4s(w) + 14z(w). 4w*2 Let x(p) = -5p + 3. Let k = -130 - -126. Let f(h) = -9h + 5. Let l(s) = 3s - 2. Let z be l(3). Calculate kf(n) + zx(n). n + 1 Let j = 3393 - 3396. Let n(t) = -4t - 14. Let z(u) = u + 3. Determine jn(h) - 14z(h). -2h Let w(u) = -316u + 6. Let q(n) = -311n + 5. Calculate 3q(z) - 4w(z). 331z - 9 Let y(z) = -2z*3 + 3z*2 + 2z + 3. Suppose -86o + 108o - 44 = 0. Let u(n) = 6n3 - 150n*o - 155n*2 - 5n + 296n2 - 8. Give 3u(f) + 8y(f). 2f*3 - 3f*2 + f Let u = 3003 + -3006. Let k(w) = 2w*2 + 2w + 3. Let o(j) = j*2 + j + 2. What is uo(f) + 2k(f)? f2 + f Let v(y) = -4y*2 + y - 56. Let m(h) = 23. What is -5m(d) - v(d)? 4d2 - d - 59 Let q(a) = 7a*3 - 6a*2 - 7. Suppose 3i = 16u - 17u + 19, -4i = -5u. Let l(d) = 7d3 - 5d*2 - 6. What is iq(z) - 6l(z)? -7z*3 + 1 Let t = 82 - 46. Let m be (-2)/12 - 7(-6)/t. Let x(s) = -s + 1. Let p(z) = 2z - 3. Calculate mp(u) + 3x(u). -u Let a(v) = 60v + 25. Let b(x) = -29 + 78 + 4x + 2x - 47 - x. Calculate 2a(j) - 25b(j). -5j Let c(w) be the third derivative of -w6/30 + w5/15 + 5w*4/24 + 1011w*2. Let z(q) = -q. Give -c(v) - 4z(v). 4v3 - 4v*2 - v Let m(u) = 3u*3 + 152u - 18. Let h(x) = -2x3 + x2 - 4x + 3. Determine 2h(s) + m(s). -s3 + 2s*2 + 144s - 12 Let b(k) = 17k2 + 2k. Suppose 3186q - 6171 = 3153q. Let m(z) = 1581z2 + 187z. What is qb(r) - 2m(r)? 17r2 Let k be (-7 + (-4)/4)(-1)/2. Let y(p) = 70p + 0 - 75p - k. Let t(u) = -14u - 11. Let m = 12 + -20. Determine my(z) + 3t(z). -2z - 1 Let z(n) be the third derivative of n*5/20 + 5n4/24 + n3/3 + 2471n2. Let c(g) = 2g*2 + 6g + 3. Determine -4c(j) + 5z(j). 7j2 + j - 2 Let u be 37(-28)/(-98). Let y(q) = 5q*3 - 2q2 - 9. Let m(a) be the first derivative of a4/4 - a - 2129. Give um(i) - y(i). i3 + 2i*2 + 3 Let q(j) = 0j*2 - 2j*3 - 3j2 + 3 + j3 - 3j + 6j*2. Let v(n) = 19 + 8n*2 - 56 + 23 - 4n*3 + 2n*3 - 8n + 22. Determine -8q(g) + 3v(g). 2g3 Let v(c) = c2 + 4c - 4. Let g(y) = -y*2 - 5y + 5. Suppose 709u - 706u = -189. Let o be ((-4)/14 - 0) + 234/u. Calculate ov(k) - 3g(k). -k2 - k + 1 Let p(z) = -z2 - z + 1. Let m(r) = -38r3 - 5r*2 - 5r + 5. Let w(y) = 2y3 + 228y*2 - 231y - 120. Let d be w(-115). What is dp(k) + m(k)? -38k*3 Let y(m) = -26m*2 + 4m + 2. Let n(f) = -27f2 + 2f + 3. Give -2n(g) + 3y(g). -24g2 + 8g Let k(b) = 46b + 38. Let c(h) = 23h + 20. Give 5c(l) - 2k(l). 23l + 24 Let j(o) = o - 2. Let u(p) = -p - 1. Suppose 8 + 11 = 11w + 30. What is wj(f) + u(f)? -2f + 1 Let s(i) = -2 - 1 - 2 + 15i. Let r(c) = -7c + 2. Suppose -3o + 10 = -19p + 17p, -p - 9 = 2. Calculate os(d) - 10r(d). 10d Let x(r) = -311r - 1. Let w(o) = -270o - 2. Give 3w(f) - 4x(f). 434f - 2 Let n(s) be the first derivative of -5s*3/3 + 10s - 278. Let q(y) = -6y2 + 11. What is 5n(a) - 4q(a)? -a2 + 6 Let n(i) = i3 + i2 + i + 11. Let y(s) = -31s*3 - 2s*2 + 4s + 59. Calculate -5n(k) + y(k). -36k*3 - 7k*2 - k + 4 Let f(t) = 20t*3 - 17t*2 + 6. Let u(z) = -19z*3 + 12z*2 - 4. What is 3f(y) + 4u(y)? -16y*3 - 3y*2 + 2 Let o(g) = -7g*2 - 6g + 6. Let u(v) = 89v2 + 75v - 85. Let b(p) = -490p2 - 413p + 469. Let n(r) = 5b(r) + 28u(r). Calculate -6n(l) - 35o(l). -7l2 Let s(a) = -46a + 9231. Let r(j) = 34j - 9231. What is -4r(y) - 3s(y)? 2y + 9231 Let g(u) = -3u2 - u - 1. Let m = -463 + 460. Let j be -3m15/27. Let t(x) = -x + 4. Let l be t(0). Let n(p) = 4p*2 + p + 1. What is jg(s) + ln(s)? s2 - s - 1 Let g(s) = s3 + s2 - s + 1. Let i be ((-268)/(-201))/(8/18). Let v(j) = 14j*3 + 8j*2 - 8j + 8. Calculate iv(h) - 24g(h). 18h3 Let j(a) = -a3 + a2 + a + 1. Let i(p) = -7p - 247 + 140 + 101 + 5p3 - 6p*2. Determine -i(y) - 6j(y). y*3 + y Let k(x) = -7x*3 + 9x - 17. Let g be k(3). Let b = g + 173. Let a(q) = -2q2 + q + 7. Let s(v) = 2v*2 - v - 8. Calculate ba(l) - 5s(l). 2l2 - l - 2 Let f(i) = i2 - 256i + 44. Let b(g) = -3g*2 + 511g - 99. What is -4b(o) - 9f(o)? 3o2 + 260o Let q(m) = 2m3 + 8. Let d = 30 - 27. Suppose 0 = 4j - 5p + 144, 5j + dp - 7p + 189 = 0. Let x = j - -33. Let c(b) = -b*3 - 3. What is xc(f) - 3q(f)? 2f3 Let d(k) = -k3 - k*2 - k - 1. Let t(o) = 12o*3 + 10o*2 + 42o + 10. Suppose 0 = -4p + z + 37, -2z = 81p - 76p - 56. Give pd(b) + t(b). 2b*3 + 32b Let z(i) = -20i + 48i*2 - 4 + 46i*2 + 26i - 88i2. Let a(h) = -h2 + 1. What is 4a(x) + z(x)? 2x2 + 6x Let w(k) = 11k3 - 20k*2 + 11k. Let l(b) = 4b + 4b*3 - 1407b*2 + 696b*2 + 704b*2. Determine -17l(u) + 6w(u). -2u3 - u2 - 2u Let l(f) = 9f - 32. Let c(b) = -5b + 16. Let o be ((-650)/195)/((-10)/(-15)). Calculate oc(h) - 3l(h). -2h + 16 Let k(j) be the third derivative of j*3/6 + 2j2. Let m(z) be the second derivative of -z3 + 69z - 792. Calculate k(x) + m(x). -6x + 1 Let u(i) = -i*2 + 7i + 2. Let m(j) = -15j2 + 46j - 24. Determine -m(w) + 6u(w). 9w*2 - 4w + 36 Let w(p) = 406. Let k(z) = -407. Let b(h) = -2k(h) - 2w(h). Let o(m) = -m - 2. Let j be ((-8)/(-6))/((-4)/(-6)). Determine jo(u) + 3b(u). -2u + 2 Let c(i) = -19i. Let s(n) = 1513n + 2. Calculate -5c(k) + s(k). 1608k + 2 Let i(o) = 3o*2 + 77o2 + o2 - 33 + 33o. Let z(u) be the first derivative of -5u3/3 - u2 + 2u + 673. What is -2i(s) - 33z(s)? 3s*2 Let i(n) = 285n*2 + 2n - 6. Let o(z) = 567z2 + 4z - 11. What is 7i(r) - 3o(r)? 294r2 + 2r - 9 Let k(a) = 12a - 4. Let o = 17730 + -17725. Let r(t) = -24t + 9. Give ok(w) + 2r(w). 12w - 2 Let x(m) = m + 2. Let p(j) = -556j - 9. Let s be p(-1). Let b(a) = -274a2 + sa*2 - 274a2 - 3 - a - a3. What is 2b(i) + 3x(i)? -2i3 - 2i2 + i Let c(u) be the first derivative of u2/2 + 1224. Let j(w) = 11w + 1. Determine -4c(h) + j(h). 7h + 1 Let v(q) = 11q*3 + 3q*2 + 3. Let h(u) = -11u - 41. Let t be h(-5). Suppose -25 - 45 = tf. Let r(a) = -21a*3 - 5a*2 - 5. What is fv(l) - 3r(l)? 8l*3 Let p(g) = 75g - 23. Let o(u) = -74u + 16. What is 3o(w) + 2p(w)? -72w + 2 Let x(b) = 6b2 - 16b - 40. Let h be 108/60235/(-141). Let d(m) = m2 - 3m - 8. Give h*x(	{ "pile_set_name": "DM Mathematics" }
ing 1 w and 2 p when three letters picked without replacement from iwppipww? 9/56 What is prob of picking 1 y, 1 t, and 2 d when four letters picked without replacement from {u: 2, d: 2, t: 2, y: 4}? 4/105 What is prob of picking 3 c when three letters picked without replacement from kkkckcckkckkkccc? 1/16 What is prob of picking 1 t and 3 j when four letters picked without replacement from {t: 6, j: 7}? 42/143 Calculate prob of picking 2 c and 1 u when three letters picked without replacement from uuccucuscsuucucuqc. 7/34 Calculate prob of picking 1 b and 1 j when two letters picked without replacement from bjb. 2/3 Four letters picked without replacement from ffsfsgfsfffggj. Give prob of picking 2 f, 1 s, and 1 j. 9/143 What is prob of picking 3 d when three letters picked without replacement from {d: 5, z: 7, c: 2, q: 1, m: 1}? 1/56 Two letters picked without replacement from pwjpwwpww. What is prob of picking 1 w and 1 p? 5/12 Three letters picked without replacement from ffkoofxvxdvx. What is prob of picking 1 o and 2 f? 3/110 Four letters picked without replacement from rrrrrzihhrhqrihzqhr. Give prob of picking 3 h and 1 q. 5/969 Three letters picked without replacement from {e: 3, z: 5, t: 1}. What is prob of picking 1 z and 2 e? 5/28 Three letters picked without replacement from {u: 1, r: 3, q: 2, w: 1, f: 6}. What is prob of picking 1 w and 2 q? 1/286 Three letters picked without replacement from frrm. Give prob of picking 1 r, 1 f, and 1 m. 1/2 Three letters picked without replacement from {p: 1, j: 9, r: 1, k: 5}. Give prob of picking 3 j. 3/20 Three letters picked without replacement from kktakatktktk. What is prob of picking 1 t, 1 a, and 1 k? 12/55 Three letters picked without replacement from {c: 5, x: 4, j: 6, d: 5}. Give prob of picking 1 c and 2 d. 5/114 Two letters picked without replacement from wijjsskiiijisijw. What is prob of picking 1 s and 1 w? 1/20 What is prob of picking 2 h when two letters picked without replacement from xxhhxhhxihh? 3/11 What is prob of picking 2 o and 2 h when four letters picked without replacement from {o: 3, h: 8}? 14/55 What is prob of picking 1 g and 3 r when four letters picked without replacement from gnrffrrnggngg? 1/143 Two letters picked without replacement from {n: 9, i: 1, h: 2, q: 1}. What is prob of picking 1 n and 1 h? 3/13 What is prob of picking 3 g and 1 d when four letters picked without replacement from {o: 6, g: 10, d: 1}? 6/119 What is prob of picking 1 e, 1 c, and 1 x when three letters picked without replacement from xxcxxnxxe? 1/14 Two letters picked without replacement from hkhkhkkhkkhhh. Give prob of picking 2 k. 5/26 Three letters picked without replacement from {s: 4, t: 4, p: 2, c: 2}. What is prob of picking 1 s, 1 p, and 1 t? 8/55 What is prob of picking 1 v and 1 n when two letters picked without replacement from {s: 1, r: 5, u: 1, n: 2, v: 7}? 7/60 Three letters picked without replacement from {n: 2, p: 7}. What is prob of picking 2 p and 1 n? 1/2 Calculate prob of picking 4 u when four letters picked without replacement from {u: 10, v: 8, l: 1}. 35/646 What is prob of picking 1 a and 2 n when three letters picked without replacement from naaaanaaa? 1/12 Four letters picked without replacement from {z: 1, w: 1, t: 2, j: 1, c: 1, x: 1}. What is prob of picking 1 c, 1 j, 1 z, and 1 x? 1/35 Calculate prob of picking 1 y and 2 c when three letters picked without replacement from vmyci. 0 Two letters picked without replacement from waannanhha. What is prob of picking 1 n and 1 a? 4/15 Calculate prob of picking 1 l, 1 p, and 1 j when three letters picked without replacement from {r: 2, p: 1, l: 4, n: 2, j: 3}. 3/55 Two letters picked without replacement from mxxmxmxxxhmmmxx. What is prob of picking 1 x and 1 h? 8/105 Four letters picked without replacement from {q: 2, f: 4, g: 3, e: 4, h: 1}. Give prob of picking 3 g and 1 e. 4/1001 Calculate prob of picking 2 e and 2 w when four letters picked without replacement from {e: 6, u: 3, w: 3, a: 5}. 9/476 What is prob of picking 4 h when four letters picked without replacement from lllllllhlhhhllhl? 1/364 Calculate prob of picking 2 x when two letters picked without replacement from yyxxxxxxzxxxxzxzx. 33/68 Two letters picked without replacement from scchhschggssgst. What is prob of picking 1 t and 1 c? 1/35 What is prob of picking 3 r and 1 a when four letters picked without replacement from rrararrrrr? 8/15 Two letters picked without replacement from {r: 1, i: 14}. What is prob of picking 1 r and 1 i? 2/15 Two letters picked without replacement from kktskkktjtsu. What is prob of picking 1 j and 1 k? 5/66 Calculate prob of picking 2 p when two letters picked without replacement from {p: 16, j: 2}. 40/51 What is prob of picking 1 k and 1 m when two letters picked without replacement from kpmbxpmmbkxbbpxx? 1/20 Two letters picked without replacement from htvgxvthtttxhhht. What is prob of picking 2 h? 1/12 Two letters picked without replacement from {h: 3, i: 5, a: 3, d: 7, m: 1}. What is prob of picking 1 a and 1 d? 7/57 Calculate prob of picking 1 x, 1 q, 1 u, and 1 s when four letters picked without replacement from {q: 2, u: 1, x: 5, s: 2, r: 4}. 20/1001 Calculate prob of picking 1 o and 1 i when two letters picked without replacement from {d: 1, p: 2, i: 1, a: 10, j: 5, o: 1}. 1/190 Calculate prob of picking 4 u when four letters picked without replacement from {k: 2, u: 4}. 1/15 Calculate prob of picking 1 x, 1 b, and 1 g when three letters picked without replacement from xxggbgx. 9/35 Calculate prob of picking 1 p, 1 u, and 1 g when three letters picked without replacement from {i: 2, u: 5, k: 5, p: 2, g: 1, s: 2}. 1/68 Two letters picked without replacement from nxnxxxnnnnnxxnxxnnnx. What is prob of picking 2 x? 18/95 Four letters picked without replacement from {d: 2, q: 3, a: 4}. What is prob of picking 3 a and 1 q? 2/21 Two letters picked without replacement from {p: 11, k: 5}. What is prob of picking 2 p? 11/24 What is prob of picking 1 u and 1 t when two letters picked without replacement from quupkuttku? 8/45 Two letters picked without replacement from {i: 3, e: 4, m: 1, d: 2, x: 1}. What is prob of picking 1 i and 1 x? 3/55 Calculate prob of picking 1 u, 1 m, and 1 a when three letters picked without replacement from {u: 2, p: 1, a: 3, m: 1}. 6/35 Two letters picked without replacement from {m: 1, u: 2, b: 1, i: 3, c: 3, x: 3}. What is prob of picking 1 c and 1 m? 1/26 Calculate prob of picking 2 q and 1 z when three letters picked without replacement from {b: 2, z: 1, k: 1, q: 3}. 3/35 What is prob of picking 1 w, 1 r, 1 n, and 1 i when four letters picked without replacement from wicrnwicxci? 1/55 Calculate prob of picking 3 r and 1 w when four letters picked without replacement from frrrrrrrwrr. 14/55 Calculate prob of picking 2 f and 2 e when four letters picked without replacement from fefffeefeffefefe. 27/65 Calculate prob of picking 1 y, 2 o, and 1 l when four letters picked without replacement from ljpjpojyoyyjppjlj. 3/1190 What is prob of picking 1 l and 1 c when two letters picked without replacement from lcccccccccccclcccc? 32/153 Four letters picked without replacement from {j: 8, b: 3, w: 6, a: 1}. Give prob of picking 3 j and 1 w. 28/255 Calculate prob of picking 1 e and 1 r when two letters picked without replacement from {r: 1, n: 1, m: 2, e: 1}. 1/10 Four letters picked without replacement from {n: 12, c: 5, f: 1}. What is prob of picking 3 c and 1 n? 2/51 What is prob of picking 1 i, 1 a, and 1 r when three letters picked without replacement from {a: 3, h: 2, d: 2, r: 2, i: 1, s: 4}? 3/182 What is prob of picking 1 i and 1 y when two letters picked without replacement from {i: 15, y: 5}? 15/38 What is prob of picking 2 o and 1 d when three letters picked without replacement from godwwwwbowwb? 1/220 Calculate prob of picking 1 q and 1 v when two letters picked without replacement from gqvv. 1/3 What is prob of picking 3 m when three letters picked without replacement from mmmmmmm? 1 Four letters picked without replacement from {t: 8, a: 1, l: 2, b: 1, o: 2}. Give prob of picking 1 b, 2 t, and 1 l. 8/143 Two letters picked without replacement from cccdccccdcccc. Give prob of picking 1 d and	{ "pile_set_name": "DM Mathematics" }
mh + 2 + 2 + 4 - y. Determine c(6). -20 Let y(h) = -59 - 199h + 49h + 79h + 79h. Give y(7). -3 Let q = 65 + -63. Let g(y) = 2y*3 - 3y + y - 2 + 9yq - y3 - 6y*2. Suppose 0 = -4n - 4k + 28, -2n = -3n + 4k - 18. Give g(n). 14 Let u(r) = -r*3 - 9r*2 + 7r - 8. Suppose 4d - 46 = 5o - 71, -5o = -3d - 15. Determine u(d). 22 Let p = -10 - -28. Let u = p + -13. Let l(n) be the second derivative of -n*5/20 + 5n4/12 - n3/3 + 3n2/2 + 27n - 1. What is l(u)? -7 Suppose -4 = -3t + 4i, 3t - 176 = -2i - 196. Let z(v) = -v*2 + 5v + 37. Calculate z(t). 1 Let h be 54/(-8) - (-39)/52. Suppose 40 = -5q + 2g, -q - 19 = -2q - 5g. Let m(s) = s + 6. Let w(u) = -u - 6. Let o(a) = qm(a) - 7w(a). Determine o(h). 0 Suppose 63873 = -6w + 63825. Let j(i) = -i2 - 3i + 8. Give j(w). -32 Let u(m) = 47m2 - 4m + 8. Let v(n) = 2n2 + 4n + 8. Let o(p) = u(p) - 3v(p). Give o(-1). 41 Let u(h) be the second derivative of h5/20 - 5h*4/4 + 29h*3/6 - 33h*2/2 - 19h - 18. Determine u(13). 6 Let z be 6/(-16) + 160/(-256). Let w(l) = -19l3 + 5l*2 + 5l + 3. Let s(t) = t3 - t2 - t - 1. Let m(h) = zw(h) - 4s(h). Determine m(1). 14 Let x(z) = z2 - 3. Let v(q) = q2 + 7q - 4. Let k(m) = -m2 - 2m + 8. Let t be k(3). Let s be v(t). Let h be 1 - (-8)/(8/s). Determine x(h). 6 Let c be (-14)/49 + 69/21. Let x(h) = 9 - c - 5 - 6 - h. What is x(-8)? 3 Let z(r) be the third derivative of -r5/120 - r4/12 - 127r3/6 - r2 + 1. Let t(y) be the first derivative of z(y). What is t(-7)? 5 Let w(t) = -589t*2 + 1158t*2 + 5 + 6t - 572t2. What is w(-3)? -40 Suppose -42 = 5f + 18. Let d(h) = -330h2 - 14h + 288h2 - 13 + 41h2. What is d(f)? 11 Let t(a) = a3 + 14a2 - 34a - 30. Let i be t(-16). Let u(z) = 5 - iz - 13 + 7z - 9z + 3z. Calculate u(-4). -4 Let w(q) = -316q + 2. Let t(a) = -146a + 1. Let y(o) = 11t(o) - 5w(o). Determine y(0). 1 Let d(r) be the second derivative of 1/3r3 + 3r + 0 + 0r2. Suppose 25n + 8 = -92. What is d(n)? -8 Let q(u) = 2u3 - 2u*2 + 3u - 3. Let s be 3/(-15) - 741/95. Let y be (-62)/6 + 2/6. Let n = s - y. Calculate q(n). 11 Let l(m) = -3m2 + 12m + 9. Let f(j) = j*2 - 6j - 4. Let c(i) = 5f(i) + 2l(i). Suppose 0 = 23p - 15p. Suppose 12q - 32 + 80 = p. Calculate c(q). 6 Suppose 841 = 31b - 58. Let o(h) = h*3 - 30h*2 + 30h + 11. Calculate o(b). 40 Let j(l) = -l*3 + 9l*2 - 33l + 130. Let k = -12791 + 12798. Calculate j(k). -3 Let v be 5 + -13 - -7 - (0 + -2). Let i(q) = -49q + 1. Give i(v). -48 Let k(h) = 2h2 - h3 - 157 - 4h - 315 + 475. Give k(2). -5 Let u(b) = b2 + 20b - 5. Let q(g) = -g*3 + 23g*2 - 15g - 585. Let w be q(21). Give u(w). -41 Let m(u) = -2u3 - 23u*2 - 15u - 44. Let n be -173 - -169 - 1/214. What is m(n)? 0 Let g(s) = -6 + 9s + 17 + 6s3 - 5s*3 - 3 + 3s + 13s2. Give g(-12). 8 Suppose -l = -3t + 1, 0 = -5l - 2t + 9 + 3. Suppose 0 = -11a + la + 90. Let k(m) = 1 - am + 11m + 0. Give k(-3). -2 Let c(r) be the first derivative of r*4/4 + 26r*3/3 + 153r*2/2 + 11r - 3076. Give c(-17). 11 Let b(v) = 114v2 + 0v + 10 + 6v - 109v*2. Suppose 8n + 42 = 2. Let x(j) = -4j2 - 5j - 9. Let y(o) = nb(o) - 6x(o). Calculate y(-4). -12 Let d(n) be the first derivative of -5/3n3 - n - 3n*2 - 1/4n4 - 13. Calculate d(-4). 7 Let s(l) be the second derivative of -l4/12 + 3l3 - 7l*2/2 + 2l + 49. Determine s(0). -7 Let o(l) = 1 - 18l - 3 - l3 - l3 + 19l + l*2. Let b = 18116 + -18114. Determine o(b). -12 Let s = -96 - 44. Let d = s + 147. Let q(x) = -2 - 3x - x*3 + d + 101x*2 - 108x*2. Calculate q(-6). -13 Let k be (-2)/(4/(-10)) - (78 + -74). Let u(d) = -14 - 5d + 22 - k + d. What is u(5)? -13 Let p(t) = -2t2 - 33t + 2. Let d(z) = 7z2 + 109z + 5. Let q(a) = -d(a) - 3p(a). What is q(-9)? -2 Let o(i) = 316i + 952. Let m be o(-3). Let z(w) = 5w2 - 21w + 3. Give z(m). -1 Let l(g) = g*2 - 40g - 79. Let o(d) = -d*2 + 78d + 3421. Let z be o(-31). Give l(z). 5 Let j(c) = -c + 3c + 20c. Let w(x) = 4x2 + 1 - 22x + 19x - 3x*2 - 10. Let g be w(5). Calculate j(g). 22 Let o(x) be the first derivative of -2x*3/3 + 17x*2/2 + 9x - 282. What is o(9)? 0 Let u(j) = j - 16. Let l = 289 + -294. Let a be 0/1 + -1 - (-7 + l). Give u(a). -5 Suppose -n + 28 = -4h, 6n - 2n + 4h = 172. Let q = n + -40. Let d(o) = -5o - 2 + q + 6 + 1. What is d(4)? -15 Let m be (1 - 0)(-2 + 0). Let y(j) be the first derivative of 9j2/2 + 7485. Give y(m). -18 Let k be -2(-1)/(-3)9. Let r(c) = 6211 - 6214 - c3 - 2c + 8c2 - 14c*2. What is r(k)? 9 Let u = -4070 - -4086. Let k(j) = 2j*2 - 30j - 30. What is k(u)? 2 Let u(l) = -6l + 40. Let t be u(0). Let o(z) = -18z2 - t + z3 + 6z + 9z*2 + 46. Suppose -s = 5p + s - 44, 4p - 5s = 22. Determine o(p). -10 Let r(j) = 958 - 1895 + 947 + 4j. Give r(-13). -42 Let k(a) = a - 7. Let z(w) = w2 - 17w - 60. Let j = 253 + -233. Let f be z(j). Calculate k(f). -7 Let y(o) be the first derivative of 5o2/2 + 20o + 5406. Calculate y(8). 60 Let z be 1/3 - 2/6. Let k(r) = 1391r + 11. Let q(c) = 232c. Let m(i) = k(i) - 6q(i). Calculate m(z). 11 Let m(i) be the third derivative of i7/1680 - i6/45 - 49i5/60 - i2 + 51. Let p(o) be the third derivative of m(o). Give p(3). -7 Suppose 0 = -4m + 2w, m - 2w = -m - 2. Suppose -2v + 9 = m. Let p(u) = -u*2 + 5u + 1. Give p(v). 5 Let k(p) = p*3 + 13p*2 + 14p + 26. Suppose 0 = 3g - 4g + 65 - 77. What is k(g)? 2 Let p = -25 + 20. Let g(z) = 2z - 25z*2 - 12z*2 + 0z + 38z2 + 5. Give g(p). 20 Let q(f) = -9f - 350. Suppose 147u + 2889 = -2697. Give q(u). -8 Let d(z) be the second derivative of -z4/4 - 5z*3/6 - 37z + 2. Give d(-4). -28 Let z(m) = -m - 2 + 1175m2 - 1172m*2 + 6 + 2m*3 - 1. Give z(-4). -73 Let n = 6184 - 6181. Let x(p) be the second derivative of -1/6p*3 - 9p - np2 + 0. Determine x(-6). 0 Let c(a) = a2 + 186a - 1954. Let b be c(10). Let h(x) = -x*3 + 3x*2 + x + 9. What is h(b)? -93 Let b(n) = -32n - 7n2 + 113n*3 + 24n - 1 - 2 - 111n3 + 16n*2. Calculate b(-6). -63 Suppose -5n + 16 = -3n. Let g(c) = -55 + 5c*2 + 16 + 11 + 9c + 17 - 6c2. Determine g(n). -3 Let z = -9231 - -9229. Let c(k) = -56k - 6. Give c(z). 106 Let b(p) = p*2 + 2p - 1. Let j be ((-72)/(-16))/(3/4). Let r(y) = -6y + 34. Let c be r(j). Calculate b(c). -1 Let x(i) = 3i*3 - 11i*2 - 13i - 1. Let q(d) be the second derivative of -d5/20 + d4/2 + d*3 + 2d + 64. Let r(u) = 5q(u) + 2x(u). Calculate r(-7). 19 Let v(y) = -21 + 74y + 102y - 180y. Determine v(-4). -5 Suppose -8f = -2a - 5f - 15, -4a + f - 5 = 0. Let t(y) = -12 + 0 + 9 + 9y + ay2 - y2. Suppose 27 - 3 = 3o. What is t(o)? 5 Let l(b) = -1885 + 946 - 5b2 + 945 - 3b - b*3. Suppose 0t + 2 = 2t. Let o be (-2)/t5/2. Determine l(o). 21 Let l(g) = -9g + 780 - 780 - 17g - 18g. Determine l(-1). 44 Let y(p) = -21 + 17 + 10 - 3p + 8. Give y(12). -22 Let v(g) be the third derivative of -g4/2 + g3/3 - g*2 - 854g. What is v(-3)? 38 Let x = -46 + 39. Let t(a) = 4a2 + 0a - 6 - 6a - 5a*2. Determine t(x). -13 Suppose -2l - 5a - 23 = 0, 3l + 45 = -a + 4a. Suppose 21i + 164 = -4. Let w be (7 - (-21)/(-6))i/l. Let u(f) = -2f*2 + f + 2. Give u(w). -4 Let z(j) = 8j - 15. Let t(o) = -13o + 25. Let d(n) = 14n - 26. Let w(l) = -6d(l) - 5t(l). Let x(v) = 2w(v) + 5z(v). Calculate x(8). 3 Let w be 668/50127/(-4). Let y(n) = -n2. Let f(d) = -6d*2 - 11d - 2. Let v(h) = f(h) - 5y(h). Give v(w). 16 Let w(y) = -5y*3 + 92y*2 + 56y + 13. Suppose 202x - 200x - 3u = 44, 25u + 88 = 2x. Calculate w(x). -6 Let a = 249 + -343. Let c = a + 102. Let s(v) be the third derivative of -v4/24 + 3v*3/2 + 5v2. Give s(c). 1 Let l(w) be the first derivative of -w5/60 - 3w4/8 - w3/3 - 139w2/2 + 186. Let j(m) be the second derivative of l(m). What is j(-6)? 16 Let j(v) = v3 - 46v2 - v + 45. Let o be j(46). Let h(q) be the second derivative of -19q3/3 + q2/2 - 44q. What is h(o)? 39 Let m(o) = 15o - 56. Suppose -v + 0a - 1 = -5a, -3 = -3a. Give m(v). 4 Suppose 5g = 4p - 9p + 25, -14 = -3g - 2p. Suppose	{ "pile_set_name": "DM Mathematics" }
e Suppose h - p - 457 = 22, h + 2p - 491 = 0. Does 23 divide h? True Suppose -o - 739 = -3f, 11f - 980 = 7f + 4o. Is f a multiple of 13? True Let k = 37 - -62. Suppose 0 = -4o - 0o - 4, -4p - 3o + 281 = 0. Let f = k - p. Is f a multiple of 8? False Suppose 0 = 3u - 79 - 11. Let t be -4 + u/5 + 56. Let z = -35 + t. Does 10 divide z? False Let b(l) = 4l + 28. Let x be b(-6). Suppose 0 = xv - v - 405. Does 15 divide v? True Let o = 374 - 266. Does 48 divide o? False Let k = 26 + -18. Suppose 2v - 5z = 4, -2z + 26 = 2v + k. Suppose vg + 52 = 11g. Is g a multiple of 6? False Let i(g) = -10g2 + 3g*2 + 0g*3 + 0g3 + g3. Let w be i(7). Suppose w = k - 10 - 6. Does 11 divide k? False Suppose 2v + v + 447 = b, -1371 = -3b + 3v. Suppose 4o - b = -178. Suppose -t = -o - 22. Does 31 divide t? True Let o(h) be the third derivative of 0h + 3/2h*3 - 10h*2 + 0 + 3/10h*5 - 5/8h*4 - 1/120h*6. Is o(17) a multiple of 16? False Let i be (6/5)/(40/100). Suppose 2q + q - 2m = 401, 3q + im = 411. Does 19 divide q? False Let t be -20(3 - -1)-1. Let a(g) = g3 + 23g*2 - 25g + 5. Let h be a(-24). Let x = t - h. Is x a multiple of 17? True Suppose 3n + 2 = 4n. Let h be 872/36 + n/(-9). Let x = h - 16. Is x a multiple of 4? True Let v(y) = y + 2. Let o be v(3). Suppose -on + 48 = 3k - k, 2n - 4k - 24 = 0. Let t = 47 - n. Is t a multiple of 10? False Suppose x = 2x - 2. Suppose d + xd = -63. Let f = d + 26. Is 3 a factor of f? False Let b = 16 + 5. Is 8 a factor of (-27 + b)(-136)/6? True Let o(y) = 12y - 4. Suppose -5a - 17 = 18. Let v = a + 9. Does 7 divide o(v)? False Suppose -28s + 22s + 26880 = 0. Is 16 a factor of s? True Let r(s) = -37s*3 - 2s*2 + 3s + 5. Does 49 divide r(-3)? False Suppose 2r - 8 = 36. Let h = r + -18. Suppose -2l = -4o + 162, 56 = ho - 2o + 4l. Is o a multiple of 8? False Let y(q) = q*3 - 8q*2 - 10q + 11. Let n be y(9). Suppose nf = 3 - 9, -903 = -3b + f. Is 20 a factor of b? True Let w(p) = -p*3 - 3p + 126. Is w(0) a multiple of 9? True Suppose -2d + 58 = -s - 183, 491 = 4d + s. Is d a multiple of 4? False Let a(n) be the second derivative of -n*5/60 + 5n*4/24 + 7n*3/6 + 2n*2 - 8n. Let j(s) be the first derivative of a(s). Is 11 a factor of j(4)? True Let f = -3795 - -5625. Does 60 divide f? False Suppose -2v + 6x - 11x + 76 = 0, -5x + 132 = 4v. Is v a multiple of 2? True Let h = 27 + -22. Let x(c) = -c3 + 5c*2 + 6c + 3. Is 11 a factor of x(h)? True Let g = -3 - -8. Suppose 4v = m - 20, 0 = -5m - gv + 33 + 17. Is m/(-2)18/(-4) a multiple of 6? False Suppose 9w - 20 = -4z + 4w, -2w + 8 = 0. Let o(l) = -l*3 + 27. Does 3 divide o(z)? True Let o(u) = 3u*2. Let i be o(1). Suppose k + x + x = 19, 4x - 53 = -ik. Let c = 28 - k. Is c a multiple of 9? False Let o(c) = -c2 + 5c. Let m be o(5). Suppose -b + 12 = 2t - 66, m = -4b + 16. Does 7 divide t? False Suppose 5l - 333 = -3i, 2l - 127 = 6i - i. Suppose -2c - 3w + l = 0, 4w = 2c + 3w - 50. Is c a multiple of 9? True Let g = -30 - -3. Suppose 3p + 60 = -3b, 3b + 17 = 4p - 8. Let j = b - g. Does 12 divide j? True Is 73 a factor of 18(2262/(-36))/(-13)? False Suppose -5d + 1725 = -1020. Is 3 a factor of d? True Let z(o) = o3 - 4o2 + o + 2. Let p be z(3). Let n(b) = b3 + 3b2 - 4b - 2. Let c be n(p). Is 13 a factor of -28(c + 2/(-8))? False Suppose i - 7i = 0. Let l(q) be the first derivative of -q*2/2 + 40q - 1. Is 11 a factor of l(i)? False Let o(n) = -n*2 + 6n + 7. Let b be o(7). Suppose -3x + 662 = 5w, 3x + b - 12 = 0. Is w a multiple of 33? False Let k(i) = -i3 + 6i*2 - i + 6. Let t be k(6). Suppose 5y - 8 - 22 = t. Suppose -60 + 12 = -yo. Is 8 a factor of o? True Let i = 63 + 316. Is i a multiple of 5? False Is 67 a factor of (-6505)/(-5) + (-10 - -13)? False Let p be ((-248)/4 - -3) + 3. Let b = -20 - p. Is 12 a factor of b? True Let j be (4 - 6) + (3 - -3). Let l(t) = 2t3 + t2 + t - 2. Let h be l(3). Suppose -3q + 98 = 4u, -2q - ju = -0q - h. Is 11 a factor of q? False Let u(v) = v2 - 3v - 7. Let y be u(6). Suppose -r + j - y = r, -3r + 3j = 21. Is 6 a factor of 2 + (-128)/r + 1? False Does 57 divide (-3705)/(-25)(8 - -7)? True Let g be (-144)/(-78) + 4/26. Suppose -gc = k - 119, -3k + 299 + 74 = 2c. Is 40 a factor of k? False Let v = 94 - 46. Let q = v + -44. Is q a multiple of 2? True Let u be 32 + 2 + 9 + -10. Suppose -5k - 2x + x = -79, 3k - 3x = u. Is k a multiple of 15? True Let x(s) = 57s2 - 11s + 19. Does 11 divide x(2)? False Suppose 5k = 4k - 35. Let v(x) = -10x2 + 18x - 33. Let j be v(3). Let g = k - j. Is 6 a factor of g? False Let t = -30 - -35. Suppose 0 = 3q + 15, -to + 106 = 4q - 174. Does 10 divide o? True Let h(b) = 2b*2 + 10b. Does 8 divide h(-8)? True Suppose 0 = 4m - 2 - 26. Suppose 5 = ml - 6l. Suppose -ly + 82 = 2b - 8, 3y - 63 = -3b. Is 4 a factor of y? True Suppose p - 36 = g, 0p + p - 5g = 20. Does 2 divide p? True Let t = 677 - 406. Let b = -82 + t. Is b a multiple of 49? False Let w(k) = 0k*3 - 3k*3 + 3 + 4k*3 + 0 + 6k*2. Does 3 divide w(-3)? True Suppose -292 = 5a + 3w, 5a + 4w + 0w = -296. Let i = a + 80. Does 4 divide i? True Let q(b) = -b + 23. Let h be q(23). Is 7 a factor of 0 - h - -921/3? True Suppose 0 = -3g + 2f + 75, -3f - 2 + 16 = g. Let x = 131 - g. Suppose 3l = 6, 5q + 5l = l + x. Does 10 divide q? True Let u be 126/26 + (-14)/(-91). Suppose uq - 451 = -11. Suppose 4h = 0, h = 4t - 0t - q. Is 11 a factor of t? True Let l = 20 + -21. Is 6 a factor of (-228)/4(-4)/(-12)l? False Let q(h) = -h - 7. Let v be q(0). Let r be -34(-4)/(v - -3). Is 16 a factor of 1 - (1 + 2 + r)? True Suppose 8 = 18r - 22r. Is (7/1)/(r + 23/11) a multiple of 12? False Let n be ((-60)/18)/(2/(-12)). Suppose -5k - n = 20. Let d = k + 16. Is 5 a factor of d? False Suppose -268 = 18f - 85534. Does 108 divide f? False Let t(n) = 2n3 + n2 - 2n + 2. Suppose 5z - d = -0d + 6, 2d - 10 = -z. Let j be ((-2)/(-2))/(z/4). Is 9 a factor of t(j)? True Suppose 0 = -2m + 8867 - 2819. Suppose -6k = 2k - m. Is 37 a factor of k? False Let c be (-1)/4 + (-97)/(-4). Suppose 2062 - 298 = -21l. Is (-418)/(-7) - c/l a multiple of 20? True Suppose 2j + 98 = -4o, 0j - 103 = 4o + 3j. Let m = o + 24. Suppose -60 = -mw - 4w. Is 10 a factor of w? True Suppose -2x = -x + 2g - 6, -5x = 4g - 18. Is (x/3)/(6/351) a multiple of 6? False Let d = 1405 + -949. Is d a multiple of 33? False Suppose 13 = -5n + 3v, 4n - 1 + 4 = -5v. Is (-5 + 2)/3 + 295 - n a multiple of 28? False Let p be 130/(-8) + (-48)/(-192). Suppose -3s = -6s - 36. Let w = s - p. Does 3 divide w? False Suppose -4k = 59k - 11466. Is 48 a factor of k? False Does 8 divide (-38)/8 + 3 - 8561/(-28)? True Suppose 9139 = -178y + 191y. Is y a multiple of 37? True Suppose 8t - 20 = 3t. Let v be 6/(-2)(-4)/(-6). Does 11 divide (v/t)/((-2)/124)? False Suppose -8y + 4405 = 3o - 13y, 0 = 2o + 5y - 2920. Is 45 a factor of o? False Let z(i) = 3i2 + 9i. Let t be z(-6). Suppose -s = -114 - t. Is s a multiple of 21? True Let p be (-21 + 22)/((3/(-319))/3). Let o = p + 494. Does 7 divide o? True Let m(z) = 335z - 86. Does 69 divide m(4)? False Let q = -216 - -1199. Is 64 a factor of q? False Suppose 5s = -14 - 1, 5b = s + 3363. Is b a multiple of 16? True Suppose -3 + 3 = 2f. Does 11 divide (f - (-2 + 3)) + 37? False Let q be (1/(-2))/(-3 - (-70)/24). Suppose qu - 348 = -0u. Is u a multiple of 29? True Let k(t) = 2t2 - t + 2. Let g(f) = f3 - 6f*2 - 8f + 9. Let c be g(7). Let a be k(c). Suppose 3p - ap = -255. Does 17 divide p? True Suppose 0 = 881x - 882x + 1777. Is x a multiple of 152? False Let c = 101 - 6. Does 5 divide c? True Let c(z) be the first derivative of -z*3/3 + 12z*2 - 11z + 12. Is 9 a factor of c(16)? True Let d(k) = k3 + k2 + 3k - 2. Let x be 42/497/2. Does 10 divide d(x)? False Let o = 1 - -2. Let f(u) = 2u2 + 32u + 54. Let s be f(-15). Suppose -5n + s = -2a, 0 = -6n + 4n + 3a + o. Does 5 divide n? False Suppose -o = -2x - 2, 5x - 4o + 8 + 0 = 0. Suppose x = p - 6p + 190. Suppose 3r - p = -5j, 30 = -j + 6j + 5*r. Is j a multip	{ "pile_set_name": "DM Mathematics" }
b. 4 Suppose 108 = c + 17c. Suppose 0 = 16z + c - 54. Suppose -g = g + 2b - 8, -3g + 5b = 12. Solve 4d - g + 2 = a, -4a = zd - 4 for d. 0 Let c(a) = -2a3 - a2 + 9. Let g be c(0). Suppose -2p = -4x + 2, -3x - g = -5p - 0. Solve 4r - 9 = -3o + 19, pr - 12 = 0 for o. 4 Suppose 5x - 205 = 5p, 0 = 4p + 4x - 0x + 172. Let s = -38 - p. Solve -2 = -sr - 2c - 22, -5 = r - 5c for r. -5 Let y be 18 + -12 + 16. Suppose -2s + y = 4. Let k = 4 - s. Solve 10 = -d + 2q - kq, 4d - 4q + 24 = 0 for d. -2 Suppose 2r = -f + 9, 0 = 5f + 5r - 17 - 13. Solve b - 2b = 2p - 5, 3b = -fp + 12 for p. 1 Let b(i) be the first derivative of 4i*2 + 60i - 25. Let y be b(-6). Solve -2w + 3c = -0c + 11, -y = -4c for w. -1 Suppose -10r - 130 = -5r. Let f be (-178)/r + (-30)/(-195). Solve -4n - 10 = 2k, -3k - f = k - 5n for k. -3 Suppose 0 = -3k - 16 - 119. Let d = k - -47. Solve 0 = 5u - dz - 23, -3 = -u + 2z + 8 for u. 3 Suppose 2r + 5n + 102 - 11 = 0, -4r - 5n = 157. Let u = r - -37. Solve -t + 0t - 7 = -3h, uh - 11 = t for t. 5 Let u be 2/(840/(-108) + 8). Solve 3z = 3m - u, 0z = -2z - 4 for m. 1 Let l = -200 - -228. Solve 0 = -4t - l + 8, t = -4y + 3 for y. 2 Let u = 562 - 554. Solve -5k + 5g + 20 = -0, -k - 3g = u for k. 1 Let g be (-120)/22/(-8). Solve -4 = 2t - 2c + 2, -g = -5t - c for t. 2 Let j(o) = -33o + 4. Let w be j(0). Solve t + 5 = 2t + 2l, -wt + 17 = 5l for t. 3 Let j(p) = 6p*2 + 10p - 1. Let v(u) = u*2. Let l(w) = -j(w) + 4v(w). Let q be l(-7). Let z = -25 - q. Solve -5c - 5r = 15, 0 = zc - 5c + 2r - 4 for c. -2 Let g be (-3)/((36/(-320))/((-15)/(-20))). Solve -5w + 0w + 10 = 2q, 4q - g = 4w for w. 0 Suppose -w + 2w - 11 = -3j, 2w - 10 = -2j. Suppose -25 = wu - 33. Solve -5o - 4i + 4 = -19, -1 = -3o + ui for o. 3 Suppose -24 = 38q - 50q. Solve 3s - 2i = -4, -3s = -i + q - 0 for s. 0 Let g be (-6 - -2)/(8/(-6))1. Solve s - gs = -4m + 10, 2s = -4m - 10 for s. -5 Suppose 2j - 3t - 9 = 35, -j + 5t = -22. Let y = -20 + j. Solve -1 - 10 = -f - yw, -5w + 14 = -2f for f. 3 Let p be -7 - (5/1)/15-21. Solve -4k + 5x + p = 37, k + 2x = 7 for k. -3 Suppose -3h + 7h = -296. Let x = 76 + h. Suppose -3l = -3u + 9, u - 2l = 2u - 3. Solve -5r + 2 = um, r = -xr - 6 for m. 4 Let v(a) = -3a2 - 5a - 13. Let j(c) = 4c2 + 5c + 14. Let y(q) = -2j(q) - 3v(q). Let o be y(-5). Solve 2f - f - 1 = 2w, -2w + 3f - o = 0 for w. 2 Suppose -4y + 41 = -p, -5y - 19 = 2p - 67. Suppose 2l = -4v + y, -2v + 4 = -l + 5. Solve 4h - l + 1 = -5t, 2t - 14 = 5h for h. -2 Suppose -46y = -9y - 185. Solve -y - 3 = 2u - m, u + 4m + 4 = 0 for u. -4 Suppose -2c + 4u + 2 = -2, -c + 2 = -4u. Suppose p - cn = 0, 2 = 5n - 8. Solve 8 = pa, -12 = 2d - 2a - 2a for d. -2 Let o be 0 - -1(-8)/(-2). Suppose 0 = -9i + 15i - 60. Let t = -8 + i. Solve -10 = 5q + 4r, 3q + 2 = tq + or for q. -2 Suppose -180 = 12k - 7k. Let r = -33 - k. Let u(a) = 3a - 10. Let w be u(7). Solve -2m + rc + 17 = -3m, -w = 3m + c for m. -2 Let x be (-18)/30 - 578/(-5)1. Let p = -111 + x. Solve 2d + 0d - 2 = pl, -3d + 19 = 2l for d. 5 Suppose -4d = -5n + 42 - 11, 4n - 2d = 20. Suppose 2h - 5a + na = 20, -5 = a. Solve ho + 1 + 3 = v, 2o - 2 = 4v for v. -1 Suppose 3o = -14o + 238. Solve -2r = -4t + r + o, r + 6 = 2t for t. 2 Let p = 90 - 79. Suppose px - 48 + 4 = 0. Solve -xn + 3z - 5 = n, -n - z = 1 for n. -1 Let k be 29 - ((-4)/1)/(-2). Let u(h) = -11h - 49. Let l be u(-20). Let d = -167 + l. Solve f - 4f = dt + k, -40 = 5f + 5t for f. -5 Suppose 0 = 3x - 0x - 36. Suppose -6 = 9n - xn. Solve h = -no + 1, 0 = -4h + 3o - 2o - 5 for h. -1 Let j be (-72)/108 + (-23)/(-3). Solve 2m - j = o, o + o + 4 = -m for o. -3 Let h be -1 + (8 - 5) - 0/1. Solve -v + 14 = -hd - 1, 20 = -d + 3v for d. -5 Let u = -1560 + 1564. Solve p + 12 = 3x, up + 0p = -5x + 20 for x. 4 Let i(r) = -9r + 23. Let x be i(2). Solve 31 = 2f + xm, 7 = -3m + 22 for f. 3 Let r be -1 - ((-2 - 2) + 0). Let o(m) = 14m - m2 - 4m + 8m - 2m + 36. Let j be o(18). Solve j = 5g + v - 0v - 4, -3v + 12 = -rg for g. 0 Let c be -35 + 40 - 1-7. Solve -3l = 3k - c, -5l - 18 = -2k - 3 for l. -1 Let g(k) = -k2 + 2k + 1. Let t = -40 + 41. Let d be g(t). Solve dw = 2v + v - 7, -3w = 3v + 3 for w. -2 Let w = 6 - 13. Suppose -4u + 2u = -18. Let d = w + u. Solve -v + dv - 22 = -5t, -5v + 5t = 40 for v. -3 Let s = 24 + -7. Let x be (-3 + 9)/(6/9). Let q be (3 + x/(-6))2. Solve 2z - z = 4n + s, -qn - 12 = 0 for z. 1 Let s be 20/3012/2. Let l be (-2)/4s + 36. Solve -5j = -3c + l, -3c - 2j = c - 2 for c. 3 Let d(g) = -g + g*2 + 2 + 0g - 2g2. Let t be d(-2). Suppose t = -4p - 0p + 84. Solve -5a - p = 4b, 0 = 3b - 4a - a - 28 for b. 1 Suppose -137 = 2n - 143. Solve v = -2t - v + 2, 12 = -nv for t. 5 Let k(u) = u*2 + 4u*2 + 0u*2 + 15u*2. Let p be k(1). Solve 4a - 2f + 0f + 12 = 0, 5f - p = 0 for a. -1 Let a be (-56)/(-42)18/8. Solve 2y - f + 8 = 2f, -ay - 2f = -14 for y. 2 Let g(r) = -r*2 + 11r + 8. Let q be g(11). Suppose 2x - 2 - q = -z, -5x - 2z = -25. Suppose -5l - 40 = -9l. Solve -xy - b = l, 2b = 4y + b + 8 for y. -2 Suppose 7n - 4n - 8 = k, -n = 5k + 8. Let q be k/(3/(276/(-284)) + 3). Solve 3h = -5a - q, -a + 5h = 2a + 7 for a. -4 Let g(x) = -x2 + 7x - 9. Let n = -26 + 30. Let h be g(n). Solve 4j = 8, -2a = hj + j - 16 for a. 4 Let c be (112/(-8))/(8 - 10). Let j = -58 - 18. Let v be (-10)/45 - j/18. Solve g - 3u = -2u + c, -vg + 18 = -2u for g. 2 Suppose -13z + 79 - 40 = 0. Solve -5 = -i + 4k, zi + 3k = -12 + 27 for i. 5 Suppose 0 = -5b + m + 31 + 3, -5b = -5m - 30. Let t be 2/(-2)-5-1. Let c = b + t. Solve 4d = 16 - 0, -3d = -cx - 16 for x. -2 Let f be 102/(-153)9/(-1). Solve k - fk - 7 = l, 5 = -3l + k for l. -2 Let c = -80 - -126. Let z = -21 + c. Solve -5g + 5t = -z, g - 3g - 3t - 5 = 0 for g. 2 Let j = -38 + 40. Suppose 3t - j = -4k, 3k - 4 = -2t - 3. Solve -tm + h - 5 = 0, 4m + m = 2h - 15 for m. -5 Let h(l) = -l3 + 7l*2 + 16l + 21. Let t = -38 + 47. Let j be h(t). Solve 2f - y = jf + 3, 0 = 4y + 8 for f. -1 Suppose -20 = u - 6u. Solve -4 = -4h - ua, -3a = 11 + 1 for h. 5 Let v be 84/16 - (-3)/(-12). Let z be ((-6)/3 - 1) + 32. Let r = z - 19. Solve -vh + r = 5b, -5h + 0b + 3b + 34 = 0 for h. 5 Suppose -3g = 2g - 5r - 25, 4g - r - 5 = 0. Suppose gj + 5 = y + 3j, -5j = y - 7. Solve 4q = -3w - w - 20, -5q - yw - 10 = 0 for q. 0 Let o = -32 - -34. Suppose -b = -4m + om + 2, -2b + 2m = 0. Solve bj = -3w + 11, -5j + 4w + 16 = -0j for j. 4 Let i(j) = -j*2 - 12j - 28. Let d(l) = l*2 + 6l - 3. Let b be d(-5). Let p be i(b). Solve pa = 2x, 3x - a + 0a = -5 for x. -2 Let z = -48 - -52. Suppose -a = 4o - 1, -zo - 5a = o - 5. Solve -2b = 3s - 23, s - b + ob - 1 = 0 for s. 5 Suppose 66d - 2d - 320 = 0. Solve 4u - 2l = 3u + 1, -u - dl = 13 for u. -3 Let x = -661 - -672. Solve 0u - 4u = -4z - 4, -2u + 5z = -x for u. -2 Let v be ((-24)/1)/((-12)/(-8)). Let q = -13 - v. Solve 4w + 32 = qc, 2w - 5 = -5c - w for c. 4 Let r be 5 + -2 - (-6 + -4 - -2). Suppose 7j + rj = 126. Solve 3m + 11 = -2o, 0m + j = -m - 4o for m. -3 Let n = 35 - 27. Suppose 1 + n = -f. Let c be (-3)/(-9) + 3/f. Solve -4z - 22 = 2m, 23 = -z - 4m - cm for z. -3 Let h = -7 - -11. Solve 5 = hm + 5s, -5s - 49 + 14 = -4m for m. 5 Suppose 5q - 8 = 7. Let l = -816 - -829. Solve 0u - 15 = 3t - 3u, qt - 2u + l = 0 for t. -3 Let l be ((-40)/(-300))/(2/30). Solve 2h + 5g = 20, 3h + 6 = lg - 2 for h. 0 Let n = -84 + 86. Solve -4s = -3q - 31, 3q = nq - 2s + 3 for q. -5 Suppose 53 = 17a - 32. Solve 4r + 4c = -4, a = -r - 3c - 0 for r. 1 Let b be (-2 + 1)/(17/(-170)). Let u(g) = 12 + 2 + 0g - g. Let v be u(b). Solve f - vd - 14 = 0, 5f + d + 6 = 2d for f. -2 Let l be (-738)/45 - (-2)/5. Let b = 20 + l. Solve -h + 6 = q, q = -bh + 5q for h. 3 Suppose 2b + 2 = 40. Suppose -25 = -4d + b. Solve 3z + d = -0z + w, -5z + 5w - 15 = 0 for z. -4 Suppose -6b = -b - 25. Suppose -q = -3s - 5, -23s + 20s + 20 = 4*q.	{ "pile_set_name": "DM Mathematics" }
11178sqrt(17) + 1004362 Simplify (4(-6(sqrt(300) + 3 - sqrt(300)) - (sqrt(300) - (sqrt(300) + -1 + 2))))2. 4624 Simplify -4 + -1sqrt(21)/sqrt(3)-1 + (5 + 6-2sqrt(7))-5. -29 + 61sqrt(7) Simplify (2(sqrt(80)3)2 - (4(sqrt(80) + -3))*2) + -4. 12 + 384sqrt(5) Simplify 3(sqrt(272) - (sqrt(272) - -4sqrt(272)4) - (-2sqrt(272) + 2))*2. 672sqrt(17) + 159948 Simplify ((sqrt(4455)1 - sqrt(4455))5)/((2sqrt(320) - sqrt(320))-3) + 2. 2 Simplify ((sqrt(20)/(2sqrt(5)) + (sqrt(4) - sqrt(20)/(sqrt(15)/sqrt(3))))/(sqrt(16)/(sqrt(968) - (-1sqrt(968) - sqrt(968)))))*2. 1089/2 Simplify 1(3(sqrt(10)/sqrt(2) + sqrt(5)) + sqrt(5) + (sqrt(5) - (sqrt(45)/(sqrt(9)2) + sqrt(5))*2) - (6sqrt(15)/sqrt(3) + -3)). -33/4 + 2sqrt(5) Simplify sqrt(1053) - (sqrt(1053) + -1sqrt(1053) + 4 + sqrt(1053)) - (-2 + sqrt(52)/sqrt(4) - (sqrt(13) + -1 + 1)). -2 Simplify (-1 + ((sqrt(156)-1 + sqrt(156))2)/(sqrt(96)/(sqrt(16)/sqrt(2))) + 3)*2. 4 Simplify ((sqrt(84) + (sqrt(84) - (sqrt(84) + -6sqrt(84)1 + sqrt(84))))-5)/(sqrt(1200)5-6). sqrt(7)/10 Simplify 6(-2 + 5sqrt(52) + sqrt(13)1 + -1). -18 + 66sqrt(13) Simplify (sqrt(960)/sqrt(6) - sqrt(10)1-1)/(sqrt(4)/sqrt(2)3-5). -sqrt(5)/3 Simplify sqrt(9)/(sqrt(48)3 + sqrt(48)) + -1 + (-4sqrt(3))*24. sqrt(3)/16 + 191 Simplify (sqrt(208) + 3((sqrt(208) - (-1 + sqrt(208))) + sqrt(208)) - sqrt(208)) + 0 + -5(-2(0 + sqrt(208)) - sqrt(208))2. -9357 + 12sqrt(13) Simplify sqrt(156)/(sqrt(12) + (sqrt(48)-2 - sqrt(12))) - ((sqrt(104) + sqrt(104)1)2)/sqrt(8). -17sqrt(13)/4 Simplify (-1-5(-4(2sqrt(931) - sqrt(931)) - 1(1sqrt(931) + sqrt(931))))2. 837900 Simplify (0 + sqrt(1700) + -2)2 - (sqrt(119)/(2sqrt(7)) + -2). -81sqrt(17)/2 + 1706 Simplify -2(-1 + 2(sqrt(475) - 2sqrt(475))). 2 + 20sqrt(19) Simplify 2 + (-5 + sqrt(242)1 + sqrt(242) + (sqrt(242) + 0)-1)*2. -110sqrt(2) + 269 Simplify (-21sqrt(68)2)/(sqrt(256) + sqrt(256) + sqrt(256)-1-3 + sqrt(256)). -sqrt(17)/12 Simplify ((sqrt(1250) - 3sqrt(1250)) + sqrt(50))/sqrt(10) + 5 + (sqrt(15)/sqrt(3) + -2)*2. -13sqrt(5) + 14 Simplify (sqrt(18) + 2sqrt(18)1)/(sqrt(9) - (sqrt(9) - (sqrt(90)/sqrt(360) - sqrt(9)))). -18sqrt(2)/5 Simplify (2(5 + (-6(sqrt(19) - 4sqrt(19)) - sqrt(19)) + ((sqrt(209)-1)/sqrt(11) - -1sqrt(931))))*2. 920sqrt(19) + 40304 Simplify (4 + sqrt(108)6 - sqrt(108))2 + (sqrt(108) + sqrt(108) + -2 + sqrt(108))2. 276sqrt(3) + 2712 Simplify (-2(sqrt(1331) + -1 - sqrt(1331)) - (2 + sqrt(176) - -1sqrt(891)))2 + 0. 1859 Simplify (2 + 2 + 3(sqrt(2) - -5((sqrt(2) - (3sqrt(2) - sqrt(2))) + sqrt(2))) + -3)*2. 6sqrt(2) + 19 Simplify ((sqrt(48)3)/sqrt(4))/((sqrt(66)-5)/sqrt(11)). -3sqrt(2)/5 Simplify ((sqrt(77)1 + sqrt(77) + sqrt(77) + sqrt(77))-6)/(sqrt(132)/(sqrt(108)/sqrt(9) + sqrt(12)))-2. 96sqrt(7) Simplify -3 + ((sqrt(720)2 - sqrt(720)) + sqrt(720) + 5 - sqrt(40)/(sqrt(600)/sqrt(3)))*2. 238sqrt(5) + 14271/5 Simplify ((-1 + sqrt(76) + -4 - sqrt(76) - (sqrt(76) - 1(sqrt(76)1 + sqrt(76)))) + 5)*2. 76 Simplify (-21sqrt(84) - sqrt(84) - 2sqrt(84)2)/(-23(sqrt(12) - (sqrt(24)/sqrt(2) - sqrt(12) - sqrt(12)))). 7sqrt(7)/12 Simplify -3 + -1 + -2sqrt(1584) - ((0 + sqrt(1584))-5 + (-5(sqrt(1584) - (sqrt(1584) + 0)) - sqrt(1584))). -4 + 48sqrt(11) Simplify (4 + -1-2sqrt(1100) + sqrt(1100) + 2 + 1)*2. 420sqrt(11) + 9949 Simplify ((sqrt(120) - 2sqrt(120)-4)/sqrt(5))/((sqrt(160)1 + sqrt(160))/sqrt(5)). 9sqrt(3)/4 Simplify (sqrt(147) - (sqrt(147) + sqrt(147)-1 + sqrt(147) + sqrt(147) + 4) - -5(-1 + sqrt(147)))*2 - (0 + -1(-2sqrt(3))2)-3. -504sqrt(3) + 2397 Simplify -1 + (sqrt(170) - (sqrt(170) + -2sqrt(170)5))/((sqrt(70) - (2sqrt(70) + sqrt(70) - sqrt(70)))/sqrt(7)). -10sqrt(17) - 1 Simplify (-2sqrt(504)-5)/(sqrt(8)/((sqrt(80)/sqrt(4))/sqrt(5))). 60sqrt(7) Simplify ((5(sqrt(77)-1 - sqrt(77))3)/((sqrt(110)2)/sqrt(10) + (sqrt(66)/(sqrt(6) + sqrt(12)/sqrt(2)) - sqrt(11) - sqrt(11))))*2. 25200 Simplify (-3(-2sqrt(13) + sqrt(13))1-5 + 4)2. -120sqrt(13) + 2941 Simplify (sqrt(112) - ((sqrt(112) - ((sqrt(112) - -4sqrt(112)) + -5 - sqrt(112))) + sqrt(112)))2 - (sqrt(693)/(sqrt(11)-4))/sqrt(9). -479sqrt(7)/4 + 1033 Simplify (-5((sqrt(931) - (sqrt(931)-3 + sqrt(931) + sqrt(931) + sqrt(931)))3 + 3))*2. 3150sqrt(19) + 209700 Simplify (((32sqrt(85))/sqrt(5) + 5(sqrt(17) + sqrt(17)-2)-5)6)*2. 588132 Simplify (-2 + -3(sqrt(325) + 0 + sqrt(325)1))2. 120sqrt(13) + 11704 Simplify 6(sqrt(612) - -6-3sqrt(612) - (sqrt(612) + (-5 + sqrt(612))6)). -864sqrt(17) + 180 Simplify ((6sqrt(98)3 - (5 + sqrt(98)2))-4)2. -17920sqrt(2) + 401808 Simplify 4(1 + sqrt(847) + sqrt(847) + 0)2 + 4(sqrt(7)-2 + -1 + sqrt(168)/sqrt(6)). 176sqrt(7) + 13552 Simplify (2 + (1-1sqrt(68))/sqrt(4) + -1(1sqrt(17)-5 - sqrt(833)-2))*2. -40sqrt(17) + 1704 Simplify ((sqrt(12) - -5sqrt(12))/sqrt(2))/(-3sqrt(27)/sqrt(9)). -2sqrt(2) Simplify ((sqrt(15)/(sqrt(25)/sqrt(5)) - sqrt(3)) + -5 + (sqrt(48) - 5sqrt(96)/sqrt(2)))*2. 160sqrt(3) + 793 Simplify (sqrt(98) + 1 + sqrt(98) + -1 + (-1 + sqrt(98)2 - sqrt(98) - sqrt(98)) + 1 + 2 + sqrt(98) + 5)2. 294sqrt(2) + 931 Simplify ((sqrt(20) + 4sqrt(60)/sqrt(3))/sqrt(4) - (-3 + (sqrt(5) - (sqrt(5) + 0)) + -2sqrt(80) + sqrt(5)))*2. 72sqrt(5) + 729 Simplify (-63sqrt(76)-2)/(42sqrt(100)). 9sqrt(19)/10 Simplify (-1 + (6(2 + sqrt(48)) - (-1 + sqrt(3)-2 + sqrt(3) + 2sqrt(432))))2 + -3. 24sqrt(3) + 144 Simplify 3-6((3sqrt(91)2)/(sqrt(63) - sqrt(3087)))*2. -26 Simplify 3((sqrt(252) - (sqrt(252) - (sqrt(252) + -1))*2) + sqrt(252) + 2)44. 48 + 576sqrt(7) Simplify (-3(-2sqrt(209) - sqrt(209))-5)/(sqrt(55)/(sqrt(5)-2) - sqrt(11) - (5sqrt(275) + sqrt(11))). 18sqrt(19)/11 Simplify (sqrt(44)/(sqrt(4) + -5(sqrt(4) + sqrt(36)) - sqrt(4)) + 3)-2. -6 + sqrt(11)/10 Simplify ((sqrt(363)2)2 + sqrt(48) + -1)6. 24sqrt(3) + 8706 Simplify (-3(-3sqrt(77) + sqrt(77)) + sqrt(77))/(sqrt(275)4). 7sqrt(7)/20 Simplify -4 + (sqrt(7) + 1 + sqrt(7))3 + 4 - (0 + (sqrt(7) + 0)-1 + -3). 6 + 7sqrt(7) Simplify (2 + (sqrt(216)1)/(sqrt(504)/sqrt(7)))6. 6sqrt(3) + 12 Simplify (sqrt(432) + 52sqrt(432))/(sqrt(486)-32). -11sqrt(2)/9 Simplify 3 + ((-3 + (sqrt(192) - (-1 + sqrt(192))1))2 - ((sqrt(192) + 0 + sqrt(192))2 + 3 + 5 + sqrt(192) + 1)). -770 - 8sqrt(3) Simplify (-3sqrt(1470))/(sqrt(36)/(sqrt(24)/sqrt(4))). -21sqrt(5) Simplify (-1(sqrt(117) + sqrt(117)-3 + sqrt(117)))/(sqrt(9) + sqrt(9) + sqrt(27)/(sqrt(3) - sqrt(3)-1)). 2sqrt(13)/5 Simplify (-1(-1 + sqrt(75)) - sqrt(75))2-41 + 1. -1203 + 80sqrt(3) Simplify (sqrt(13) + -5)-2 + 1 + (sqrt(104)54)/sqrt(8). 11 + 18sqrt(13) Simplify 4(sqrt(42) + -1sqrt(5082))/(sqrt(48)/(sqrt(8) + sqrt(8) + sqrt(72))). -200sqrt(7) Simplify ((sqrt(88) - sqrt(88)-2)1)/(4sqrt(8)6). sqrt(11)/8 Simplify -4 + 1 + sqrt(13)2 + 4 - -1(-1sqrt(1053) + 0). -7sqrt(13) + 1 Simplify ((sqrt(70) + sqrt(70) + (sqrt(70) + sqrt(70)1 + sqrt(70))5)/((4sqrt(110))/sqrt(11))-6)2. 18207/4 Simplify (sqrt(24) - (sqrt(24) - (sqrt(48)/(1sqrt(2)) + sqrt(24))) - (sqrt(24) + (-2sqrt(48))/sqrt(2)))/((sqrt(48)/sqrt(4) + sqrt(12))-54) + 1. -3sqrt(2)/40 + 1 Simplify -3 + sqrt(242)-1 + (4sqrt(242))*2-4 + -2 + 1. -15492 - 11sqrt(2) Simplify sqrt(2299) + (sqrt(2299)2 - sqrt(2299))*2 + 0 - (3(sqrt(2299) + 1))2 - ((sqrt(2299) + 0 + sqrt(2299) + 2 + sqrt(2299))2 + 1). -39097 - 319sqrt(19) Simplify 2-1(sqrt(12)-2 + 2 + -1)*21. -98 + 16sqrt(3) Simplify ((sqrt(4131)-1 - sqrt(4131))/((4sqrt(21))/sqrt(7))-5)*2. 34425/4 Simplify (4(sqrt(275) + -2(sqrt(275) + -1)))2 + (sqrt(99)22)/(sqrt(9) - (2sqrt(324) + sqrt(324))). -5444sqrt(11)/17 + 4464 Simplify -1(-4 + -4 + -3 + (sqrt(19) + -4)*2 + 4). -28 + 8sqrt(19) Simplify -3(1 + (-2 + sqrt(704))2 + ((-1sqrt(704)-6)2 - sqrt(704)) + sqrt(704)). -78159 + 96sqrt(11) Simplify (3(4 + 2sqrt(180)) - (sqrt(180)-1-4 + -2))*2. 336sqrt(5) + 916 Simplify (1(sqrt(288)-3-1 + 5 + 0 + sqrt(288))3)*2. 4320sqrt(2) + 41697 Simplify -1 + -4(sqrt(35)/(sqrt(700)-2)-2)2. -6/5 Simplify (5sqrt(240)3)/(sqrt(24)/(sqrt(98)5)). 1050sqrt(5) Simplify (5 + ((sqrt(363) - (sqrt(363) + 2))24 - ((-1	{ "pile_set_name": "DM Mathematics" }
ding order. 0.4, -3, a Let k be 0 - 7/((-21)/(-12)). Let b be (-4)/(3 - 0 - (3 + -2)). Let p(u) = u*2 - 7u + 14. Let v be p(5). Sort -1, v, k, b in decreasing order. v, -1, b, k Let d = -136 + 136.05. Let w = 0 + -1.2. Let j = w + 0.8. Sort j, 1/4, d in descending order. 1/4, d, j Let c = -15085 - -15085. Sort 2, -4, 5, c, 6. -4, c, 2, 5, 6 Let u = 0.0357 - -361.9643. Let t = 372 - u. Let o be (1/(-14))/((-2)/(-4)). Sort t, -1/4, o in descending order. t, o, -1/4 Let m = -2566 - -28228/11. Put -2.9, m, 4 in ascending order. -2.9, m, 4 Let h(x) = 56x + 5. Let m be h(0). Sort m, 1/24, -0.01 in descending order. m, 1/24, -0.01 Let n = -451 - -451.127. Let l = 0.073 + n. Let v be -3((-2)/1)/6. Put v, 1/3, l, 1/2 in decreasing order. v, 1/2, 1/3, l Suppose 2y + 5m = 9, -2y + 9 = -m + 18. Let v be 5 - ((-24)/(-14) - (-2)/7). Sort -5, 5, y, v. -5, y, v, 5 Suppose 9 + 25 = 5t + 54. Put t, -20, -107 in increasing order. -107, -20, t Let l = -41 + 44. Suppose 0 = 3f + a - 123, -3f - a + 132 = -la. Let b be 1/2f/49. Put -2/3, b, -1/6 in ascending order. -2/3, -1/6, b Let j = -3.1 + 2.84. Let d = 0.301 - 3.041. Let a = d + j. Sort a, 8, -6 in descending order. 8, a, -6 Suppose 1269 = 18s + 1143. Put s, 6, 1 in decreasing order. s, 6, 1 Let j = -4208 - -4210. Sort -3/2, 0.5, 12, -3, j in descending order. 12, j, 0.5, -3/2, -3 Let j be ((-2)/(-1))/((-126)/84 - 5/(-6)). Put j, 8, -5, -117 in descending order. 8, j, -5, -117 Suppose -6m - 57 - 9 = 0. Let y(w) = -w - 8. Let v be y(m). Suppose -5g - v = -3q, -4g - 2q + q = 16. Sort 4, -5, g in descending order. 4, g, -5 Let g = -34668 - -34664. Sort -5, -436, 4, 1, g in ascending order. -436, -5, g, 1, 4 Suppose 8l - 9l = -4t + 43, -l + 53 = 4t. Let v be 1 - -2t/6. Sort 2, -4, v, 1. -4, 1, 2, v Suppose -v + 4v = 5h + 24, 5v + 2h - 9 = 0. Suppose 22 = -i + 2i + 4b, -4b = -2i - 16. Sort -4, i, v in ascending order. -4, i, v Suppose -2 + 26 = -2x. Suppose 2j - g + 4 = 0, -22j - 12 = -18j - 4g. Put x, -1/9, j in increasing order. x, j, -1/9 Let s = 21 + -10.5. Let t = s - 12.5. Put t, 2, -3, 5 in descending order. 5, 2, t, -3 Let q be (-150)/100(-238)/(-21). Sort 0, -1/5, q, 3, 1 in increasing order. q, -1/5, 0, 1, 3 Let k = -1213 + 1211. Sort 0, -3.7, k in increasing order. -3.7, k, 0 Suppose 3u + 1204 = j - 161, -4u = -3j + 1815. Let s = 461 + u. Put 2, 12, s in ascending order. 2, s, 12 Let x(d) = 9d2 - 8d + 57. Let r be x(5). Let w = -248 + r. Let o be ((-10)/(-4) + -2)8. Sort 5, 3, o, w in decreasing order. 5, o, 3, w Let p = 17004 + -118990/7. Sort 2, p, 0 in descending order. p, 2, 0 Let q(h) = 2h*3 + 6h*2 - 10h - 12. Let g be q(-4). Put 0, g, -3, 2 in ascending order. g, -3, 0, 2 Let y = 1.3 - 0.9. Let z(w) = -5w - 4. Let d be z(-3). Suppose -dl + 21 = -23. Put y, 0.1, l in decreasing order. l, y, 0.1 Let k = 12379/9 + -4127/3. Let v = 18.1 + -0.1. Put -2, v, k in increasing order. -2, k, v Let j(v) = -3v3 - 71v*2 + 269v - 14. Let q be j(-27). Sort -9, -3, -1, q, 0 in ascending order. -9, -3, -1, 0, q Let g(z) = z*3 + 3z*2 - 5z - 1. Let l be g(-4). Let r = 4577 + -4582. Suppose -4h - 10 = 3q, 0 = -5h - 3q - 7 - 4. Sort 5, h, l, r in increasing order. r, h, l, 5 Let w = -59825/153 - -391. Put 2/15, 3, w in decreasing order. 3, 2/15, w Let k = -0.12 - -5.12. Let i be 62/(-310) + 112/10 + 1. Let z be (27/(-60))/(i/10). Put -2/7, z, k in ascending order. z, -2/7, k Let h = 9985 - 9986. Sort -24, h, -92. -92, -24, h Let n = -25652 + 25651. Sort -429, n, -4 in ascending order. -429, -4, n Let f = 77/15 + -34/5. Let a = -1006950 - -1006949.8. Let x = -2.99 - 0.01. Put f, a, x in increasing order. x, f, a Suppose -4n + 12 = 0, 2z + 3n = -29 + 34. Sort 0, 8, z, 3, 6. z, 0, 3, 6, 8 Let b be (-2)/14 + ((-49959)/49)/3. Sort b, -3, -1 in decreasing order. -1, -3, b Let v = -0.159 + -3.841. Let d = -0.1602 + 11.1602. Sort 1, 5, v, d. v, 1, 5, d Let p = 110 + -165. Let s = 50.957 - -1.043. Let l = p + s. Put -0.5, 4, -0.03, l in ascending order. l, -0.5, -0.03, 4 Let u = -32794 + 32793.9. Sort -0.4, 23037, u in decreasing order. 23037, u, -0.4 Let m(s) = s. Let f be m(-4). Let i be 42/36 + (-40)/192-4. Sort i, -91, f in descending order. i, f, -91 Let t = -44 - -40.2. Let q = t + 0.8. Let r = 0.11 - 0.21. Put r, 3, q in decreasing order. 3, r, q Suppose -2q = q - 15. Suppose 4y + 4g = -32, -5g = -3y + 3 + q. Let n = -265.7 + 266. Sort n, y, 3 in decreasing order. 3, n, y Let h = -1.7 - 11.3. Let a = 187 - 192. Sort a, h, -1, -2. h, a, -2, -1 Suppose 3f - 3q = 3, f = -4q - 5 + 1. Let o(u) = 199u - 999. Let i be o(5). Sort -19, f, -2, i. -19, i, -2, f Let u be (-24)/(-14) + 16/(-8). Let n = -380.4 + 381.4. Sort u, -3, n, -5/6 in increasing order. -3, -5/6, u, n Suppose 0 = -3f - 9, 3v + 1007f + 3 = 1008f. Put 46, 3, 4, v in increasing order. v, 3, 4, 46 Let y = 4316 - 4315.3411. Put y, -2/11, 1/10, -1/8 in increasing order. -2/11, -1/8, 1/10, y Let n(h) = 3h + 62. Let l be n(9). Let j = l - 90. Put -5, -3, j, -11 in increasing order. -11, -5, -3, j Suppose -2317q = -2189q. Suppose -5d - 20 = 5i, 20 = -2i - 2i. Suppose -2w = w + 15. Sort 3, d, q, w in decreasing order. 3, d, q, w Let c = 3409 + -3403. Sort -4, -2, -10, 4, c in ascending order. -10, -4, -2, 4, c Let u = 0.191 + -0.418. Sort u, -1/4, -1/9 in ascending order. -1/4, u, -1/9 Let x be ((-48)/(-9))/((-2)/(-60)). Let g be (-1)/(-8) + 5/(x/(-484)). Suppose 4h - 3v = 15, -4v - 2 - 18 = 2h. Sort g, h, 5 in descending order. 5, h, g Suppose a + 3v - 8 = 3, -a + 5v = 13. Let k(q) = 2q*2 + 7q - 4. Let x be k(a). Let m be 3 - (32/(-18) - x/81). Put -1, -2, m in descending order. m, -1, -2 Let a = 523 + -523.2. Let i = 12 - 13. Sort 0.4, a, i, 2. i, a, 0.4, 2 Let t = 1.3548 - -16.3452. Put -3/7, -0.4, 2.1, 1, t in ascending order. -3/7, -0.4, 1, 2.1, t Let s be (-2 - -3)(-2 + 3). Let x be 1 + s + -4 - -8. Let r(o) = 2787o - 19504. Let l be r(7). Sort -3, l, x, 3. -3, 3, l, x Let v(j) = j*3 + 3j*2 + 4. Let a be v(-3). Let i(k) = -4k*2 - 447k - 1302. Let m be i(-3). Put m, a, -1, -3 in ascending order. -3, -1, m, a Suppose -3w = -2s - 99, 0 = -2w + 3w - 2s - 25. Put -4, w, 1.2 in decreasing order. w, 1.2, -4 Suppose 3f - 2 + 11 = 0. Let v be (35/(-21))/((-30)/18). Let g be v/(0 - (-8)/(-32)). Put g, f, 2 in descending order. 2, f, g Let b = -0.3 + 0.1. Let h = 547 + -544. Suppose -25 - 15 = -10k. Sort b, k, h, 2/5. b, 2/5, h, k Let z be (-1)/4 + 138/(-184). Let p = 5 - 2. Let h be 609/(-35) + 0 + p/(-5). Put h, 1, z, -2 in descending order. 1, z, -2, h Let u be 34/(-51) + 17/(-6). Let k = 0.067 - -0.433. Put -1/7, k, u in descending order. k, -1/7, u Let x = 2.1 + -111.1. Let n = x - -112. Let g = -88/111 + -3/74. Sort -0.5, 2, g, n in ascending order. g, -0.5, 2, n Let c(n) = -19n - 71. Let h be c(-4). Sort -2, h, -25. -25, -2, h Let s(g) = -g*3 - 35g*2 - 142g - 2505. Let i be s(-33). Suppose -5t = 2a + 4, 0 = -t - 2t + 5a - 21. Sort i, -5, t. -5, t, i Let b = -127/9 - -14. Let j = 626 + -628. Put -3, 15, b, j in descending order. 15, b, j, -3 Let v = 13166 - 13177. Put 0, -1, v, 4 in descending order. 4, 0, -1, v Let z be (-21)/((-2)/(-10)15/(-2)). Suppose 284 = zn - 18n. Sort -4, -3, n in decreasing order. -3, -4, n Let w = -39/112 + 1/16. Let h = -21.98696 - 0.01304. Put -3, -2/17, h, w in decreasing order. -2/17, w, -3, h Let t = 2.65 - -12.35. Let c = 28 + -8. Let f = t - c. Put f, 2/7, -1/4 in increasing order. f, -1/4, 2/7 Let i = -31 + 28. Suppose 4g + 4o = 20, -2o + 13 = -2g + 5g. Let v = -7 + 3. Sort g, v, i in descending order. g, i, v Let s be ((-7)/(-28))/(102/68). Put -2, s, -199 in descending order. s, -2, -199 Let b(r) = 342r - 3169. Let v be b(9). Put 1/3, v, -5, -1/2 in descending order. 1/3, -1/2, -5, v Let x = 0.47 - 0.37. Let s = 170 + -169.89. Sort -4, s, 4/5, x in decreasing order. 4/5, s, x, -4 Let k = 5 + 3. Suppose a + k - 1 = -3q, 3q = -4a - 1. Suppose 5*j + 10 = -0. Sort j, 4, a, -3 in ascending order. -3, j, a, 4 Let n = -6323.8 - -6325. Put n, -39, 5 in descending order. 5, n, -39 Let t = -6.4 + 6. Let i = -29382 - -29414. Put -1/2, i, t in decreasing order. i, t, -1/2 Let y be ((-1)/12)/(22/66). Let x = -3	{ "pile_set_name": "DM Mathematics" }
.097. Let n = 47 - 47.41. Let m = n + g. Round m to 1 decimal place. 0.8 Let i = 2 + -1.3. Let r = 111289709.69999877 - 111289709. Let n = i - r. What is n rounded to 7 decimal places? 0.0000012 Let r = 338414 - 92414. Suppose -21u + r = -18u. What is u rounded to the nearest ten thousand? 80000 Let p = 6.71 - 7.6. Let y = 16.2 - 18. Let r = p - y. Round r to 1 decimal place. 0.9 Let o(y) be the first derivative of 147y4 - 2y3/3 + y2 + 5. Let p be o(2). Round p to the nearest one thousand. 5000 Let m = -20147137 + 44047137. Round m to the nearest 1000000. 24000000 Let k = -0.059 - 9.741. Round k to 0 dps. -10 Let a = 1834377.81599709 - 1834309.716. Let z = -68.1 + a. What is z rounded to seven decimal places? -0.0000029 Let z be 3(3 - -2)16/(-30). Let l(o) be the second derivative of -o*5/20 - 2o*4/3 + 4o*2 - o. Let b be l(z). Round b to the nearest ten. 10 Let o(s) = -7s*2 + 3s + 8 - 7 - 2s. Let f be o(-5). Round f to the nearest 10. -180 Let r = 59 - 13. Let m = 38.3 - r. Let w = m - -13.8. What is w rounded to the nearest integer? 6 Let m = 0.17 + -0.17055. What is m rounded to 4 decimal places? -0.0006 Let b(n) = n + 55000. Let i be b(0). Round i to the nearest ten thousand. 60000 Let o = 14944875 + -5744875. Round o to the nearest 1000000. 9000000 Let t = 4.0999938 - 4.1. What is t rounded to six decimal places? -0.000006 Let w = 1.397 - 0.521. Let l = -0.014 - w. Let o = l + 0.09. What is o rounded to the nearest integer? -1 Suppose 3a - 20103473 = -3903473. Round a to the nearest 1000000. 5000000 Let l = 0.045 - -0.129. What is l rounded to two dps? 0.17 Suppose -2h - 617 = -3497. Round h to the nearest one hundred. 1400 Let p(d) = 18d. Let i be p(-1). Round i to the nearest 10. -20 Let o = 1.274 - 16.784. Let s = -15 - o. What is s rounded to 1 decimal place? 0.5 Let h = 0.02 - 0.020045. Round h to 5 dps. -0.00005 Let p = -3766 - -5536. What is p rounded to the nearest one hundred? 1800 Let j(d) = -3357d3 + 5d*2 + 14d + 8. Let x be j(12). Round x to the nearest 1000000. -6000000 Let c = 43.9189 + -43.9. What is c rounded to 3 dps? 0.019 Suppose 2u + 200000 = -4q, 0q - 100000 = 2q + 4u. Round q to the nearest ten thousand. -50000 Let r = 9 - 15.2. Let j = r - -6.199938. Round j to five dps. -0.00006 Let q = -143.56 + 142. What is q rounded to 1 dp? -1.6 Let b = -62 - -472. Round b to the nearest 100. 400 Let z = -67.0076 - -67. Round z to three decimal places. -0.008 Let l = -13 - -12.99926. What is l rounded to 4 dps? -0.0007 Let r = 1.9 - 2. Let u = 6667021.09999998 + -6667021. Let x = u + r. What is x rounded to seven dps? 0 Let i = -7 - -7.024. Let u = 7.124 - i. What is u rounded to 0 dps? 7 Let p = -6 + -3. Let b = p + 7.7. What is b rounded to one decimal place? -1.3 Let a = 1327.939974 - 1328. Let o = -0.02 - 0.04. Let c = a - o. Round c to 5 dps. -0.00003 Let p be (-4 + 786/9)6. Let i be (-16440)/(-1)p/6. Round i to the nearest 100000. 1400000 Let m be (16/(-6))/(38/(-285)). Round m to the nearest integer. 20 Let v = -4 - -12. Let q = v - 8.0000012. Let s = 0 - q. Round s to six decimal places. 0.000001 Let i = 24.4 + -4.4. Let y = i + -19.999885. What is y rounded to five decimal places? 0.00012 Let i = 1.87 - -0.13. Let l = 1.9999995 - i. Round l to 7 dps. -0.0000005 Let a = -0.06 - 0.24. Let o = 5.350032 + -5.65. Let k = o - a. What is k rounded to 5 decimal places? 0.00003 Let r = -78.2 + 78.2000391. What is r rounded to 5 dps? 0.00004 Suppose -p - 22 = -0p. Let w be 0 + (p + 0 - 2). Let f = -67 - w. Round f to the nearest 10. -40 Let b = -0.32 - -0.17. What is b rounded to 1 dp? -0.2 Suppose 5b = 4n + 57243 + 92382, n = -5b - 37375. Round n to the nearest one thousand. -37000 Let l = 7.9255 + 0.0445. Let b = l + -8.5. Round b to 1 dp. -0.5 Let y = 115.615 + 6.561. Let v = -0.176 + y. Let x = v - 127.3. What is x rounded to the nearest integer? -5 Let q(p) = -1281p - 8. Let b be q(2). What is b rounded to the nearest 100? -2600 Suppose 0 = 3q - 4q + 21000. What is q rounded to the nearest 10000? 20000 Let n(z) = 4540z2 - 6. Let i be n(5). Let p = i - 42494. Round p to the nearest ten thousand. 70000 Suppose 3w = z - w - 5003, 3z + 3w = 15024. Suppose 3h - z + 152007 = 0. What is h rounded to the nearest 10000? -50000 Let y = -0.1 - 0.6. Let s = y - 0.3. Let q = s - -1.0024. What is q rounded to three dps? 0.002 Let p = 35.3 - 35.2999703. Round p to six dps. 0.00003 Let m = 3 + -2.7. Let c = 1.59 - m. Round c to one dp. 1.3 Let f = 1730.9896 + -1733. Let v = 0.09 + -2.09. Let z = v - f. What is z rounded to 3 dps? 0.01 Let j = 2 - 9. Let d = -3938729 + 3938722.00000028. Let z = d - j. Round z to seven dps. 0.0000003 Let a(v) = -v + 301. Let f be a(0). Suppose -3r + f = 1111. Round r to the nearest one hundred. -300 Let r = -1.4679769693 - 72.5320235207. Let c = r + 74. What is c rounded to 7 dps? -0.0000005 Let l = 1.2 - 1.238. Let z = l + 0.0379959. Round z to 6 decimal places. -0.000004 Let p = -164.903 + 165. What is p rounded to 2 dps? 0.1 Let q(v) = v*2 + v - 166. Let a be q(0). What is a rounded to the nearest ten? -170 Let f = -22.985 - -23. What is f rounded to 2 decimal places? 0.02 Let z = -4 - -6. Suppose -8 = -zn - 0. Suppose -3j = -nj + 14. Round j to the nearest 10. 10 Let t = -196 + 1191. Suppose 0 = -a - 0a. Suppose -5r - 1255 = -k, -k - t = 4r - ak. What is r rounded to the nearest one hundred? -300 Let v = 35 - 34.9999976. What is v rounded to six decimal places? 0.000002 Let q = -0.0208 - 26.6792. Round q to the nearest integer. -27 Let z be 34/3 + 2/3. Let s be (3 - -1)15/z. Suppose -2v = -8, -i + 3i + 20 = sv. Round i to the nearest integer. 0 Let c = 0.002 + -0.0020105. What is c rounded to 6 decimal places? -0.000011 Let c = -1019003 - -1019010.99991. Let p = c + -8. What is p rounded to four decimal places? -0.0001 Suppose 14c - 9c + 70 = 0. Round c to the nearest 10. -10 Let g = 27.06 - 0.06. Let u = -26.9999905 + g. What is u rounded to six dps? 0.00001 Let t = 0.16 - 0.16000133. Round t to seven dps. -0.0000013 Let p = -49.5709 + 49.6. What is p rounded to 3 decimal places? 0.029 Let a = -98.9 + 85. Let g = -29757167.4 - -29757181.3000059. Let f = g + a. Round f to 6 decimal places. 0.000006 Let t = 0.01173 - 0.53104. Let k = t - -0.52. What is k rounded to 4 decimal places? 0.0007 Suppose -5t = -3m - 2t + 5409, 0 = -3m + 2t + 5411. Suppose -2s + 4y - m - 587 = 0, -5y = -5s - 5965. Round s to the nearest 100. -1200 Let n = -658681.99188 - -4.99188. Let l = n - -658677.99999936. Let y = -1 + l. What is y rounded to 7 decimal places? -0.0000006 Let c = 0.8 + -3.8. Let u = c + 3.0152. What is u rounded to 3 decimal places? 0.015 Let h = -33487 + 15087. Round h to the nearest 1000. -18000 Let g = 168.0000045 + -168. What is g rounded to 6 decimal places? 0.000005 Let r = -4 - -7. Suppose rs - s - 4 = 0. Suppose -4d = -5i - d + 494, -sd + 104 = i. What is i rounded to the nearest one thousand? 0 Let l = -3634 + 3637.066. Let v = l + -1.737. Let h = v + -1.27. Round h to two dps. 0.06 Suppose 8788 = 2z - 7212. Let s be (z/6)/(1/2190). Suppose 0 = -0d + 4d + s. What is d rounded to the nearest one hundred thousand? -700000 Let s = 3 - 1. Let w be ((-2250000)/(-28))/s112. Round w to the nearest one million. 5000000 Suppose -261 - 59 = -4l. Let q be l/(-12) - (-4)/6. Let u(x) = 212x2 + 4x - 8. Let j be u(q). Round j to the nearest 1000. 8000 Suppose 2n - 3n + 1755 = 0. Suppose -2p = -2t - 1154, 0t - n = 3t + 5p. Round t to the nearest 100. -600 Let v(q) = -24964q - 3. Let a be v(-2). Suppose -4m + 89769 = 3z - 6m, -2z = m - 59853. Let p = z - a. What is p rounded to the nearest 100000? 0 Let d = 173282.79943 - 173391.8. Let w = d + 109. Round w to 4 dps. -0.0006 Let d = 126 + -20. Suppose 4 = 4t - 3t. Suppose 26 = z + n, -3z + tn + 0n = -d. Round z to the nearest 100. 0 Suppose 4x + 4 = 0, 0 = 2u - 2x - 2x - 60. Suppose -2j + u = -552. Suppose 3l = -j + 9290. Round l to the nearest one thousand. 3000 Let q = -255531556.9999913 + 255531690. Let c = q - 133. Round c to six decimal places. 0.000009 Suppose 2u + u + 9 = 0. Let g be 2/u + 6/9. Suppose 2*x - x - 580 = g. What is x rounded to the ne	{ "pile_set_name": "DM Mathematics" }
vative of -40fy*5 + 2fy3 - 119fy + f + 3y*4 + 2y wrt y? -800fy*3 + 12fy + 36y*2 Find the second derivative of 15b*3 - 4b*2 - b - 47 wrt b. 90b - 8 Find the second derivative of 487h3n*2 - 4h*3n + 6h2n + 4h2 wrt n. 974h*3 Differentiate 4vx2 - 3vy + v - 2x*2y - x*2 + 10xy - 6y wrt x. 8vx - 4xy - 2x + 10y Find the second derivative of 2q5 + 129q*3 - 47q - 4. 40q3 + 774q Find the first derivative of 2m2o - m*2sw - 3msw - 4ms + ow - o - 2sw + 3s wrt w. -m*2s - 3ms + o - 2s Find the third derivative of -45b*4i*3 + 26b*4i + 5b2i*2 + 39bi + i3 wrt b. -1080bi3 + 624bi What is the third derivative of -68n*2y*3 - 264n*2y*2 + ny - 184y3 + 4y*2 - y wrt y? -408n*2 - 1104 What is the third derivative of 15i*5y*2 - 2i*3y*3 + 16i*2y + 3y3 wrt i? 900i*2y*2 - 12y*3 Find the third derivative of -14c*6 - 3c*4 + 36c*2 wrt c. -1680c*3 - 72c What is the third derivative of 128o3qx3z*2 - 9o*3qx3z + 2o2qx2z + 5o2 + 2oqx*3z + ox3z - qxz + 16qz*2 wrt o? 768qx3z*2 - 54qx3z What is the third derivative of -19r3u*3 - 27r*2u*2 - 3ru3 + 4u*2 wrt r? -114u*3 What is the first derivative of -281p*4 - 355 wrt p? -1124p*3 Find the second derivative of -2866r*5 - 2164r wrt r. -57320r3 What is the third derivative of 5i*2w*4 + 5i*2w*2 + iw5 - w4 - 6w2 wrt w? 120i*2w + 60iw*2 - 24w Differentiate -16009q - 9521. -16009 What is the first derivative of -124fs3 + 3f + 1160s3 wrt f? -124s3 + 3 What is the first derivative of -q2 - 1011q - 11050? -2q - 1011 What is the third derivative of 2k6 + 2403k*4n*3 - 122k*2n*3 - 6kn3 wrt k? 240k*3 + 57672kn3 Find the second derivative of 2o*4 + 51o*3 + 7o + 866. 24o2 + 306o What is the second derivative of 115v3 + 7v - 3 wrt v? 690v What is the third derivative of -1528u*6 + 150u*2 wrt u? -183360u*3 What is the second derivative of 4529w*2 - 4304w wrt w? 9058 Differentiate 131r3 + 230 wrt r. 393r2 What is the second derivative of -d2ny + 6d2y*2 + 2dn3y - 10n3y*2 + 59n*3y - n*3 wrt y? 12d*2 - 20n*3 Find the third derivative of -15d*3mt3 - 2d*3mt + 3dmt + 2dt*3 + 3m*2t*3 - 2m2 + t2 wrt t. -90d3m + 12d + 18m*2 Differentiate -5u*4 + 18u*3 + 38 with respect to u. -20u*3 + 54u*2 Find the first derivative of 188z*2 + 405 wrt z. 376z Find the second derivative of 3589o2 - 8791o wrt o. 7178 Differentiate -6506j4 - 15884 wrt j. -26024j*3 What is the third derivative of 5n*6t - 8n4t + n*3t - 2n2t + 26nt wrt n? 600n3t - 192nt + 6t What is the third derivative of -v6 - 1009v*5 - 3v*2 + v - 169? -120v*3 - 60540v*2 What is the third derivative of 264g*3 - 238g*2? 1584 Find the second derivative of 158c4 - c3 - 5c2 + 2398c. 1896c2 - 6c - 10 What is the third derivative of -1315r4 + 2r*2 - 35 wrt r? -31560r Find the second derivative of -2b2mz + 2b*2z*3 + 882b*2z*2 + 2bm - 816mz3 + 2m wrt b. -4mz + 4z3 + 1764z*2 Find the third derivative of 70s*5 - 30s4 - s3 - 8s2 + 74s - 3. 4200s2 - 720s - 6 Find the second derivative of -7780s3y - 1273sy - 2s + 4y wrt s. -46680sy Find the third derivative of -258c4 + 82c*2 wrt c. -6192c Find the third derivative of 19d3i*2q - d*3i*2 - 12d*3q - d*2i*2q - d*2i + 23d2q - i*2 wrt d. 114i*2q - 6i2 - 72q What is the second derivative of -11k4 - 14k*2 - 2k - 59 wrt k? -132k2 - 28 What is the third derivative of 52k*4 - 18k*3 + 173k*2 + 5 wrt k? 1248k - 108 Find the second derivative of -2bu*2v + 4buv2 + 37buv - u*2v*2 - 3u*2v - 13uv*2 wrt v. 8bu - 2u*2 - 26u What is the second derivative of 1082a3o*3 + 174a*3o - ao3 - ao*2 - 13ao wrt o? 6492a*3o - 6ao - 2a Find the third derivative of 1722x*3 + 29x*2 + 11x wrt x. 10332 Find the second derivative of 554p4v - 12pv + 13v wrt p. 6648p*2v What is the second derivative of -18000l2 - 17171l wrt l? -36000 What is the third derivative of -22dm*4 - dm*3 + 242d - 7m4 + 2m*2 wrt m? -528dm - 6d - 168m Find the third derivative of 1755x*6 + 30x*2. 210600x*3 What is the second derivative of -49m*5 - 2m*3 + 6m + 32? -980m3 - 12m What is the derivative of -86r2 - 20r + 6651? -172r - 20 What is the second derivative of 13t*3 + 6t*2 + 2t - 169? 78t + 12 Differentiate -3nr + 120n - 3r2 wrt r. -3n - 6r Find the third derivative of 169x*5 + 96x*2 - 1. 10140x2 What is the derivative of c3 - 22c2 - 15c - 622 wrt c? 3c2 - 44c - 15 Find the second derivative of 44f4 - 930f wrt f. 528f2 Find the second derivative of i2y2 + i2 + 12iy*5 + 50iy + 4y*5 wrt y. 2i*2 + 240iy3 + 80y*3 Find the third derivative of 109s*3v2 + s2v - sv*2 - 8 wrt s. 654v*2 What is the derivative of -2g*3x*2 + 295gx2 + 4x*2 - 89x wrt g? -6g2x*2 + 295x*2 What is the first derivative of 475fz2 - 492z*2 wrt f? 475z*2 Differentiate 135an4 + 19an - 33a - 133 with respect to n. 540an*3 + 19a Differentiate 2gm*2y*3 + 208gmy3 + m2y3 + 33m*2y + 3y3 with respect to g. 2m*2y*3 + 208my3 Differentiate -17c*2 - 4c + 25828 wrt c. -34c - 4 What is the third derivative of 11u*6y - 2u5y - u*3y - 15u2y + 3uy wrt u? 1320u3y - 120u2y - 6y What is the third derivative of -16b*2vy3 + 2b*2y - bvy + 7by*2 - 2by - 2vy3 wrt y? -96b*2v - 12v What is the derivative of -865i - 40 wrt i? -865 Differentiate 29957lx*2 + 4387l - 2x2 wrt x. 59914lx - 4x Find the third derivative of -b*5s - 219b4s + 7b2 + 24bs wrt b. -60b*2s - 5256bs What is the third derivative of -263u3z5 + u3z3 - 76u*3z*2 - 2uz2 wrt z? -15780u*3z*2 + 6u*3 Find the second derivative of 2c*5o*2 + 3768c*4o*2 - 2co2 - 6c - o + 25 wrt c. 40c3o*2 + 45216c*2o*2 Find the third derivative of 1188j*3r*2 + 2j*2r*2 - 18j*2r - 7 wrt j. 7128r2 Find the second derivative of 22d*4 - 5d*2 - 309d. 264d2 - 10 Find the second derivative of m2v*3 + 1630m*2v*2 - 2m*2 + 784mv3 wrt m. 2v*3 + 3260v*2 - 4 Differentiate -4n*3v + 18n3 + 5n*2v + 224v wrt n. -12n*2v + 54n2 + 10nv Differentiate 4dmv*2 - 3dm + 1558dv2 + 11mv2 with respect to m. 4dv2 - 3d + 11v2 What is the third derivative of 523c*3 + 1890c*2 wrt c? 3138 What is the first derivative of 724sw3 + 166w*3 wrt s? 724w*3 What is the derivative of 22128s - 7908? 22128 What is the derivative of 59k3u - 33ku*3 + 2u*3 - 2487u*2 wrt k? 177k*2u - 33u3 What is the second derivative of -7840r*3 - 2116r wrt r? -47040r What is the third derivative of -3t*2v3 - t2 - 1537tv*3 - 16tv2 - 5v*2 wrt v? -18t*2 - 9222t What is the derivative of 946y4 - 689? 3784y*3 Find the third derivative of -17006n*3 + 21523n*2 wrt n. -102036 Find the second derivative of 919g*5o2 + g2o3 + 423go3 + 2go2 + o3 wrt g. 18380g*3o*2 + 2o3 What is the third derivative of -y2z4 + 4974y*2z*3 - 9y*2z*2 - 2yz2 - 2y - 3z2 wrt z? -24y*2z + 29844y2 What is the third derivative of 4418i*3n*2 - 2i*2n*2 - 2i*2 + 17i + 3 wrt i? 26508n2 What is the derivative of -1309p*4 + 116 wrt p? -5236p*3 What is the derivative of -6f*4 - 131 wrt f? -24f*3 Differentiate -7g*2k + 16g2 + 542k wrt g. -14gk + 32g Differentiate -2l*2o*2 + 2l*2 - 115l + 257o with respect to o. -4l*2o + 257 Differentiate -18u3 - 81. -54u*2 What is the third derivative of 2o*4t + 15o3t*3 + 7o3 + o2t3 + 4ot3 - 4o wrt o? 48ot + 90t3 + 42 Find the second derivative of 17b*2n*2 + 195b*2n + 3bn*2 wrt n. 34b*2 + 6b What is the second derivative of -13b4n*2 + 9b*4n - 2bn*	{ "pile_set_name": "DM Mathematics" }
Let r = -6 + 4. Let v = -2 + r. Which is the nearest to 0.1? (a) -0.5 (b) v (c) 0 c Let p = 3 + -4. Which is the closest to 7? (a) p (b) 2/9 (c) -5 b Let i be ((-5)/2 + 2)-28. Let y = i + -9. Let j = 0.3 - 0.2. What is the nearest to j in y, -3/7, -1? -3/7 Suppose -5k = 3w + 772761, 2k + 618201 = -2k - 5w. Let u = k + 30910907/200. Let g = -4/25 + u. Which is the closest to -1? (a) g (b) -1 (c) -1/3 b Let d = -5.1 + 5.43. Let b = d - 2.23. Let z = b - -2. What is the closest to z in -3, 0.1, 4? 0.1 Let v = -0.61 - 0.39. Which is the closest to 0? (a) 0.5 (b) 0.2 (c) v b Let o = -129 - -130. What is the closest to 2/9 in 27, -0.2, o? -0.2 Let w be 4/3 - 2 - -1. What is the closest to 1 in -2, w, 0.4? 0.4 Let u = -27 - -26.5. What is the nearest to 0 in -0.1, u, -5? -0.1 Let o be (-6)/20 + (-2)/(-4). Let m be (4/(-102))/((-1)/(-3)). Let v = -699 - -703. Which is the closest to -0.1? (a) o (b) v (c) m c Let a be 1((-12)/(-28))/(-3). What is the nearest to -3 in 1/9, a, -1? -1 Let g(n) = n3 + 5n*2 + 5n - 3. Let r be g(-3). Which is the closest to r? (a) 0 (b) 0.09 (c) -2/5 a Let m = 2.5 - 0.5. Let z = 2.2 - m. Let v = 0.1 - -0.9. What is the nearest to v in z, 0, 0.3? 0.3 Suppose -7y + 2y - 20 = 0. Which is the nearest to -10? (a) y (b) -1/4 (c) 5 a Let b(a) = a*3 + 3a*2 + 2a. Let n be b(-2). Let x = n + 3. Let i = -2 - -2. What is the closest to 0 in -0.4, i, x? i Let q = -29 + 28.8. Which is the nearest to q? (a) 0.4 (b) 1 (c) -2/7 c Suppose 8 + 22 = 2l. Let u = l + -10. Let j = 6 - 6.1. Which is the nearest to j? (a) u (b) 0 (c) 0.4 b Let r = -302 + 302.5. Let v(f) = -f2 - 7f - 8. Let i be v(-6). What is the closest to i in 5, r, 1? r Suppose s = 3s. Let k = 0.6 + -0.6. Let i = k + -0.4. What is the nearest to s in i, 0.2, -4? 0.2 Let u = -22 + 17. Let o = -1/7 + -1/7. Let b = -0.2 + -0.1. What is the nearest to -0.1 in b, u, o? o Let m = 0.4 - 0.3. Suppose 5q = -3l - 16, l + 22 = 2q - 7q. Suppose -lp + 7 = 19. Which is the nearest to m? (a) -1/11 (b) p (c) 0.1 c Let q = 39 - 157/4. Which is the nearest to -4? (a) -4/5 (b) -0.5 (c) q a Let r = -0.2 + 0.22. Let s = r - 2.02. Which is the nearest to -0.1? (a) 0.2 (b) -5 (c) s a Let v = -0.08 + -3.92. Which is the nearest to 0.4? (a) -5 (b) -1/6 (c) v b Let d = 8.3 + -11.3. What is the nearest to -1 in d, -0.1, 2? -0.1 Let b be 6 - 117/22 - 4/22. What is the closest to -2 in b, 1, 5? b Let f be (9/(-6) + 3)/6. Suppose -d = -0d + 12. Let j be d/(-4)2/15. What is the nearest to 1 in j, -1/2, f? j Suppose 0 = -2m + r + 2r + 5, -5m - r = -55. Which is the closest to 1? (a) m (b) -3/5 (c) 0.1 c Let r = 16.5 + -17. What is the closest to -0.1 in -0.3, -4, r? -0.3 Suppose 5y - y - 256 = 0. Let v be 0 - 44/y. What is the closest to v in 3, 1/3, 0.1? 0.1 Let r = 0 - -1. Let p be 1/((-1)/(-9)) + r. Let d be (8/p)/((-4)/2). Which is the nearest to 0? (a) d (b) -0.5 (c) 1/5 c Let w = 0.4 + -3.4. What is the nearest to 2/3 in w, 0.3, 1/7? 0.3 Let v = 41 - 39. Which is the closest to 1? (a) -2/9 (b) v (c) 0.3 c Let r = 1.074 + -0.074. What is the closest to r in 1/2, -0.4, 5? 1/2 Let j = 24.1 + -24. Which is the closest to -0.6? (a) -1/5 (b) j (c) 1/7 a Let d = 23 - 22.8. What is the nearest to 0 in 0.5, d, -3/7? d Let l = -0.9 + -2.1. Which is the nearest to -2? (a) 1/10 (b) -0.3 (c) l c Suppose 3f = -3g + 12, 6 = -g - 5f + 30. Let v(s) = s + 6. Let u be v(-5). Which is the nearest to g? (a) -0.4 (b) u (c) -2 a Let n = 59/2 + -31. Let p = 0 + -1. Let y = -0.1 + 1.1. Which is the closest to -1? (a) p (b) n (c) y a Let i = -28 + 111/4. Let a = -0.9 + 0.83. Let p = 0.23 - a. What is the closest to -1/2 in 0.5, i, p? i Let q = -1127/9 - -125. Which is the nearest to q? (a) 0.1 (b) 0.4 (c) 1/3 a Let c = 3.083 - 0.083. What is the closest to 2 in c, -0.1, 4? c Let o = 50/37 - 2/111. Let v = 17/40 - 5/8. Which is the nearest to -2? (a) o (b) v (c) -2/7 c Let d be (4/(-14))/(16/(-28)). Which is the nearest to -0.1? (a) d (b) -0.2 (c) -0.5 b Let p = -0.73 + -4.27. What is the closest to -5 in p, -0.1, 5? p Let j(p) = p*2 - 4p - 6. Let u = 19 - 14. Let k be j(u). Which is the closest to k? (a) -0.4 (b) -1/10 (c) 1/6 a Let w = 9.4 + -9.3. Which is the closest to w? (a) 0.9 (b) -5 (c) 2 a Suppose -v + 12 = 15. Which is the closest to 0? (a) -5 (b) -1 (c) v b Suppose -3l - 3 = 0, -2x - 3x - 2l - 12 = 0. What is the closest to -2/3 in -1/6, -3, x? -1/6 Let y = 95 + -479/5. Let n be (-2)/20 - 4/10. Which is the nearest to -1/2? (a) n (b) y (c) -0.4 a Suppose -4j = -5w + 12, 3j - 4w + 6 = -3. Which is the nearest to 0.2? (a) j (b) 1/2 (c) 0 c Let u = 0 + 0.1. Let q be ((-66)/44)/(54/8). What is the closest to u in 0, 2/13, q? 2/13 Let i = 38.017 - 0.017. What is the nearest to 0 in -0.4, i, 3/5? -0.4 Let w be 2/(-2 - 36/(-15)). What is the closest to -3 in -3, w, -2/5? -3 Let f = -11006681/160 + 68792. Let k be 202/(-64) - (0 + -3). Let z = f - k. What is the closest to z in 3, -0.4, 3/7? 3/7 Let r = 54 - 213/4. Let f be -2(2/4 - -1). Let o = f - -3. What is the closest to o in -2/7, 1, r? -2/7 Let f be (2/6)/((-3)/2). Which is the nearest to -2/9? (a) f (b) 6 (c) -0.5 a Let p be (-4)/(-6)-31. Suppose w + 5 - 1 = 0. Let x be w/(28/1)2. Which is the closest to -1? (a) 3 (b) p (c) x c Let d = -0.24 + -0.06. Let k = 1 - 2. Which is the closest to -0.1? (a) 1 (b) k (c) d c Let g(x) be the first derivative of -1 + 1/2x2 - x. Let u be g(0). Which is the nearest to u? (a) 0 (b) -1/3 (c) -0.3 b Let m(o) = 3o - 20. Let r be m(7). Let w(a) = -a*2 + 6a + 3. Let v be w(6). What is the nearest to 1 in v, r, 3/2? r Let p be (-28)/(-12) - (-6)/(-2). Which is the closest to p? (a) 0.2 (b) -0.3 (c) -4 b Let m = 8 + -6. Let k be 1 + (1 - (9 - m)). What is the closest to -0.4 in -3, -0.4, k? -0.4 Let t = 0.34 + -0.04. Let z = 0.1 + t. Which is the nearest to 1/3? (a) 3/4 (b) -0.2 (c) z c Let w = 18 - 18.2. What is the nearest to 2 in 5, -4, w? w Let c = -0.05 - -3.05. Suppose -2p + 4 - 14 = -2r, 0 = -4r + 5p + 20. What is the closest to 1 in c, r, -4? c Let i = 82 - 250/3. Let u = 0 + -0.1. What is the nearest to u in i, -0.1, -4? -0.1 Let c = -5.3 - -4.9. Let i = -0.2 - -0.1. What is the nearest to 0 in 5, c, i? i Suppose -6z + 5 = -z. Let u be 1z(3 - 1). Let o = -1 - -0.8. Which is the closest to -1? (a) o (b) u (c) -5 a Let n(w) = -3w - 6. Let h be n(11). Let j be h/12 + (-1 - -4). What is the closest to 3 in j, -2, 2? 2 Let d = 59 - 179/3. What is the closest to d in -5, 1, 0.1? 0.1 Let r = 2 + -1. Let x be (13/(-3))/(8/(-24)). Suppose -2 - x = 5q. What is the closest to r in 0.3, q, -0.2? 0.3 Let t = -0.159 - -1.159. What is the nearest to -1 in 0.5, t, 3? 0.5 Let l = 0.43 + -0.03. Let o = -1 - 0. Let b = 49/2 + -24. What is the closest to 2/5 in b, o, l? l Let n = 1.99 + -2. Let r = -1.01 - n. Which is the nearest to -1? (a) r (b) 5 (c) -0.4 a Let o be 2/1212/8. Let f = 0.44 + 0.06. Let t = 0.4 - 0.3. What is the nearest to t in f, o, -2? o Let n = 68 - 38. Let h be 4/20 + (-16)/n. Which is the nearest to h? (a) 1 (b) -5 (c) 5 a Let h = 11 + -6. Let s be (-2)/9 - (-56)/90. Suppose 5q + q - 24 = 0. What is the nearest to s in 0, q, h? 0 Let o = -1 + 1. Suppose -k + 5k + 3r - 1 = 0, -3k - 2r + 1 = 0. Which is the nearest to 1/3? (a) k (b) o (c) -2/17 b Let t be (-96)/(-189) + (-2)/9. Let g be (-4)/22 + 15/264. Let r = -3 - -4. What is the nearest to t in -3/8, r, g? g Suppose 3 = 6f - 5f, -4q - f = -3. What is the closest to q in -5, -2/17, -1/5? -2/17 Let n = -17 - -21. What is the nearest to 0 in 1, -2, n? 1 Let v = -7.8 - -9.8. Which is the closest to -1? (a) 3 (b) v (c) -0.2 c Let z be (4/(-6))/(-6 - 10/(-3)). Which is the nearest to z? (a) 2/13 (b) -0.5 (c) 24/5 a Suppose -3k + 8 = -5k. Which is the nearest to -0.2? (a) 1 (b) 4 (c) k a Let o = 2/383 + -461/14937. Let l = 14/39 + o. Let i = 5 - 3. Which is the nearest to -1/3? (a) l (b) -4 (c) i a Let y = 0.3 - 0.25. Let z = -2.05 + y. Let d = -1.9 - z. Which is the nearest to d? (a) 5 (b) 3/5 (c) 1/6 c Let v be -4 + (-2 - (1 - 3)). Let u = 0.2 - 0.5. Let s = u + 1.3. What is t	{ "pile_set_name": "DM Mathematics" }
433 a factor of 1619853? True Does 202 divide 1298254? True Is 21982 a multiple of 3? False Does 587 divide 4858599? True Is 19 a factor of 1160440? False Is 867043 a multiple of 199? True Is 95 a factor of 422878? False Does 10 divide 124646? False Is 789242 a multiple of 88? False Is 1993717 a multiple of 305? False Does 34 divide 1359014? True Does 4 divide 499857? False Is 256 a factor of 4877824? True Is 14223137 a multiple of 846? False Is 26292 a multiple of 11? False Is 435521 a multiple of 421? False Does 88 divide 1670152? True Is 307766 a multiple of 78? False Does 135 divide 691200? True Is 810560 a multiple of 17? True Is 105264 a multiple of 258? True Does 154 divide 368638? False Is 109 a factor of 314356? True Is 14 a factor of 8307311? False Is 102 a factor of 200532? True Does 19 divide 616728? False Does 28 divide 657025? False Does 9 divide 422777? False Is 70240 a multiple of 160? True Does 16 divide 479664? True Is 227367 a multiple of 85? False Is 85 a factor of 191004? False Is 25004 a multiple of 38? True Is 5215564 a multiple of 20? False Is 39 a factor of 875628? True Does 17 divide 57365? False Is 3 a factor of 3640158? True Is 4864 a multiple of 8? True Is 191 a factor of 3960603? False Does 36 divide 600568? False Is 2 a factor of 10542? True Is 142161 a multiple of 3? True Does 14 divide 16996? True Does 725 divide 1427262? False Is 16440 a multiple of 12? True Is 85 a factor of 198985? True Is 12 a factor of 13127? False Is 1874575 a multiple of 2? False Does 1516 divide 201628? True Is 583377 a multiple of 78? False Is 3 a factor of 62409? True Is 318713 a multiple of 21? False Is 1385193 a multiple of 223? False Is 15 a factor of 263055? True Does 248 divide 3426324? False Is 1415263 a multiple of 361? False Is 544556 a multiple of 31? False Is 11 a factor of 11496146? False Is 2235102 a multiple of 453? True Is 24 a factor of 2197960? False Is 12 a factor of 4923708? True Is 23 a factor of 996475? True Is 13 a factor of 166335? True Does 15 divide 17365? False Does 162 divide 14151834? True Is 3948405 a multiple of 15? True Does 17 divide 7271? False Is 3490527 a multiple of 159? True Is 6199114 a multiple of 12? False Is 35 a factor of 237019? False Is 2008836 a multiple of 63? False Is 4 a factor of 2458007? False Is 241204 a multiple of 173? False Is 535 a factor of 7242295? True Is 745658 a multiple of 21? False Is 1309332 a multiple of 110? False Is 197544 a multiple of 17? False Is 5 a factor of 550767? False Does 16 divide 250254? False Is 120 a factor of 1198440? True Is 1289940 a multiple of 15? True Is 4452130 a multiple of 17? True Is 827131 a multiple of 14? False Is 537 a factor of 934340? False Is 175624 a multiple of 254? False Is 264 a factor of 2623368? True Is 1498109 a multiple of 293? True Does 35 divide 493619? False Does 840 divide 745080? True Is 1164410 a multiple of 265? True Is 79 a factor of 290088? True Is 4519784 a multiple of 4? True Is 58 a factor of 475136? True Is 118 a factor of 166745? False Is 224814 a multiple of 421? True Is 191852 a multiple of 13? False Is 169 a factor of 484998? False Is 40 a factor of 152360? True Does 55 divide 8864515? True Is 38 a factor of 14440? True Is 157575 a multiple of 13? False Is 117 a factor of 6092716? False Is 200 a factor of 11097400? True Is 46288 a multiple of 22? True Does 366 divide 285678? False Is 37 a factor of 87654? False Does 61 divide 173672? False Is 88 a factor of 1241152? True Is 464776 a multiple of 13? True Is 91 a factor of 3143504? True Is 560593 a multiple of 113? True Is 1376505 a multiple of 543? True Is 303474 a multiple of 9? False Is 13 a factor of 192831? False Is 563665 a multiple of 58? False Is 97170 a multiple of 237? True Does 41 divide 2501902? True Is 38254 a multiple of 62? True Is 61397 a multiple of 13? False Does 6 divide 6456480? True Is 13 a factor of 268624? False Does 393 divide 54038? False Is 444 a factor of 1845166? False Is 15096 a multiple of 141? False Is 40307 a multiple of 21? False Does 21 divide 478758? True Is 214 a factor of 918379? False Is 195 a factor of 2434664? False Is 163 a factor of 878722? False Is 10 a factor of 33390? True Is 223383 a multiple of 57? True Is 13019296 a multiple of 786? False Does 609 divide 9481891? False Does 728 divide 2967328? True Does 71 divide 61136? False Is 6 a factor of 12426? True Is 4 a factor of 10108? True Is 29 a factor of 27095715? True Is 254 a factor of 163726? False Is 636 a factor of 693876? True Is 2123974 a multiple of 12? False Is 5332315 a multiple of 199? False Does 93 divide 4036454? False Is 198 a factor of 2397978? True Is 27 a factor of 1024515? True Does 6 divide 1320070? False Does 565 divide 21081214? False Is 46 a factor of 24057? False Does 419 divide 200701? True Is 242498 a multiple of 47? False Is 844054 a multiple of 243? False Is 51 a factor of 125613? True Does 38 divide 607962? True Does 10 divide 14671? False Does 9 divide 160632? True Is 4219500 a multiple of 348? True Is 310 a factor of 21080? True Is 31 a factor of 16968253? True Is 1515439 a multiple of 40? False Does 54 divide 11232? True Is 351270 a multiple of 15? True Is 12797118 a multiple of 21? False Does 302 divide 910228? True Is 3696968 a multiple of 22? True Is 214 a factor of 104374? False Is 47 a factor of 278804? True Is 21 a factor of 19744? False Is 227415 a multiple of 37? False Is 65 a factor of 341575? True Is 244800 a multiple of 17? True Is 455928 a multiple of 484? True Is 2803 a multiple of 5? False Does 56 divide 468135? False Is 200 a factor of 3495600? True Is 1138405 a multiple of 549? False Is 54465 a multiple of 2? False Is 197 a factor of 207638? True Does 44 divide 53821? False Is 424257 a multiple of 447? False Is 21483 a multiple of 231? True Is 15195154 a multiple of 377? False Is 95650 a multiple of 10? True Is 257 a factor of 94811? False Is 380 a factor of 1351316? False Does 17 divide 17144721? True Is 22 a factor of 29043? False Is 278845 a multiple of 604? False Does 52 divide 188490? False Is 102397 a multiple of 214? False Is 77003 a multiple of 170? False Does 476 divide 830352? False Does 27 divide 2159405? False Does 28 divide 1115616? False Is 203454 a multiple of 30? False Is 2 a factor of 64913? False Is 716 a factor of 4204352? True Does 8 divide 2045366? False Does 479 divide 12619255? True Is 45 a factor of 317430? True Does 23 divide 201278? False Is 13245370 a multiple of 16? False Is 1757574 a multiple of 18? True Does 115 divide 1833411? False Is 2871863 a multiple of 32? False Is 1259518 a multiple of 26? True Does 109 divide 195110? True Does 24 divide 13449384? True Is 861648 a multiple of 48? True Is 14 a factor of 819513? False Does 186 divide 778596? True Is 98780 a multiple of 22? True Is 73940 a multiple of 26? False Does 284 divide 560048? True Is 262 a factor of 6756980? True Is 14 a factor of 111097? False Does 9 divide 46523? False Is 4673009 a multiple of 373? False Is 60 a factor of 18498? False Does 88 divide 334136? True Is 208060 a multiple of 226? False Is 228360 a multiple of 11? True Is 68 a factor of 16524? True Is 114 a factor of 245344? False Is 25 a factor of 723533? False Is 68 a factor of 269692? False Does 254 divide 3006400? False Is 104 a factor of 93392? True Is 1028 a factor of 18629416? True Is 67 a factor of 1134116? False Is 32 a factor of 8706679? False Does 224 divide 26215? False Is 292 a factor of 19697770? False Is 907593 a multiple of 46? False Does 3 divide 3290? False Is 10 a factor of 509478? False Is 249 a factor of 2059479? True Is 17 a factor of 434813? False Is 20759953 a multiple of 667? False Does 41 divide 313270? False Is 44 a factor of 1941896? True Does 8 divide 4446488? True Is 12 a factor of 171037? False Is 16 a factor of 1362672? True Is 13554 a multiple of 2? True Is 489 a factor of 1147701? False Does 14 divide 14791952? True Does 50 divide 525300? True Does 107 divide 40553? True Does 144 divide 170432? False Is 78 a factor of 983580? True Is 1278 a factor of 4048496? False Does 35 divide 5668320? True Does 134 divide 686482? True Does 115 divide 5060612? False Does 10 divide 31310? True Is 2746687 a multiple of 19? False Is 32 a factor of 5253?	{ "pile_set_name": "DM Mathematics" }
king 1 y, 1 b, 1 d, and 1 g when four letters picked without replacement from {y: 1, t: 2, b: 1, u: 10, d: 1, g: 3}. 1/1020 Calculate prob of picking 2 t when two letters picked without replacement from {y: 6, t: 13}. 26/57 Calculate prob of picking 1 d, 2 s, and 1 u when four letters picked without replacement from suxmumdumuxuusuxsmu. 2/323 Calculate prob of picking 2 y, 1 e, and 1 z when four letters picked without replacement from {b: 1, y: 2, e: 1, g: 1, z: 1, i: 1}. 1/35 Four letters picked without replacement from srrsrhrsrhssrdjrrrjr. What is prob of picking 2 r and 2 s? 30/323 Three letters picked without replacement from {l: 5, d: 3}. Give prob of picking 3 l. 5/28 Calculate prob of picking 1 p, 1 u, and 1 o when three letters picked without replacement from {u: 5, o: 3, p: 2}. 1/4 Four letters picked without replacement from {r: 7}. Give prob of picking 4 r. 1 Three letters picked without replacement from {p: 1, y: 11, w: 6}. Give prob of picking 2 y and 1 p. 55/816 Calculate prob of picking 1 j and 2 o when three letters picked without replacement from {j: 7, o: 9}. 9/20 Calculate prob of picking 3 t and 1 c when four letters picked without replacement from {c: 2, y: 1, p: 1, d: 1, r: 1, t: 1}. 0 Two letters picked without replacement from {t: 2, s: 5}. What is prob of picking 2 s? 10/21 Three letters picked without replacement from {u: 1, o: 3, m: 1, n: 2, h: 5}. Give prob of picking 1 o, 1 h, and 1 n. 3/22 Calculate prob of picking 4 f when four letters picked without replacement from fffffff. 1 Calculate prob of picking 1 i and 1 j when two letters picked without replacement from {m: 3, j: 7, g: 2, i: 4, s: 3}. 28/171 Calculate prob of picking 1 k and 2 d when three letters picked without replacement from {k: 2, d: 4}. 3/5 Calculate prob of picking 1 u, 1 d, 1 o, and 1 e when four letters picked without replacement from udnudddduoueuunuq. 1/68 What is prob of picking 4 i when four letters picked without replacement from iuiiuiiiuuiu? 7/99 Three letters picked without replacement from cmcccmmc. What is prob of picking 2 c and 1 m? 15/28 Calculate prob of picking 1 k and 2 u when three letters picked without replacement from kuuuuukkiuuuukuku. 55/136 What is prob of picking 2 j when two letters picked without replacement from jjyyjjjjj? 7/12 Two letters picked without replacement from eeecceeceicce. Give prob of picking 1 c and 1 e. 35/78 Calculate prob of picking 1 o, 1 q, and 2 f when four letters picked without replacement from {r: 2, o: 1, q: 1, y: 1, f: 2}. 1/35 What is prob of picking 1 a and 1 l when two letters picked without replacement from lllalllla? 7/18 What is prob of picking 1 d and 1 o when two letters picked without replacement from yydywdyoooxxxyoyyo? 10/153 Two letters picked without replacement from gggddggddgssggsdd. Give prob of picking 1 g and 1 s. 3/17 Three letters picked without replacement from {p: 3, k: 1, e: 1}. What is prob of picking 1 e and 2 p? 3/10 Two letters picked without replacement from shymj. What is prob of picking 2 m? 0 Three letters picked without replacement from xaxaaxma. What is prob of picking 1 m and 2 a? 3/28 Four letters picked without replacement from {x: 5, d: 3, j: 4}. What is prob of picking 3 j and 1 d? 4/165 What is prob of picking 1 z and 2 a when three letters picked without replacement from zzfzzazozaaz? 21/220 Calculate prob of picking 1 u and 1 l when two letters picked without replacement from {u: 2, l: 3, e: 4}. 1/6 Calculate prob of picking 2 n and 1 j when three letters picked without replacement from {j: 2, e: 4, n: 2}. 1/28 Four letters picked without replacement from svttvtvcvvvcvt. Give prob of picking 1 c and 3 t. 8/1001 Four letters picked without replacement from osssoboiorirriozr. What is prob of picking 1 b, 1 i, 1 r, and 1 s? 9/595 Two letters picked without replacement from cflfcleffefxeeffelc. Give prob of picking 2 l. 1/57 What is prob of picking 1 w and 1 o when two letters picked without replacement from {z: 1, w: 1, o: 1, q: 1, t: 2, f: 1}? 1/21 Three letters picked without replacement from yhhywwyyyhyhh. What is prob of picking 1 y and 2 w? 3/143 What is prob of picking 2 a and 1 j when three letters picked without replacement from jjajjjjajj? 1/15 Calculate prob of picking 4 k when four letters picked without replacement from kaaaxakakaaaakxaaky. 5/3876 Four letters picked without replacement from {h: 9, i: 10}. Give prob of picking 2 i and 2 h. 135/323 Four letters picked without replacement from yoomooomouou. What is prob of picking 1 m, 2 o, and 1 y? 14/165 Four letters picked without replacement from svkvwwyyvxxvyk. What is prob of picking 4 v? 1/1001 What is prob of picking 2 i when two letters picked without replacement from {t: 3, j: 3, m: 8, i: 2}? 1/120 Three letters picked without replacement from {i: 5, t: 2}. What is prob of picking 3 i? 2/7 Three letters picked without replacement from lnlnrrcs. What is prob of picking 2 n and 1 r? 1/28 Calculate prob of picking 1 l, 1 x, and 2 w when four letters picked without replacement from wrrkrwzlzkxr. 1/495 Calculate prob of picking 1 v and 1 n when two letters picked without replacement from {v: 14, n: 1}. 2/15 Three letters picked without replacement from hhhhhfffhhfhhfnhhnh. What is prob of picking 3 f? 10/969 What is prob of picking 1 m, 1 g, and 1 j when three letters picked without replacement from {g: 3, f: 1, d: 1, m: 1, j: 1}? 3/35 Four letters picked without replacement from {t: 2, z: 2, o: 1, x: 3, q: 9}. What is prob of picking 1 q, 1 z, and 2 t? 9/1190 Four letters picked without replacement from {g: 1, y: 1, d: 3, z: 7, h: 1}. What is prob of picking 2 d, 1 y, and 1 g? 3/715 Three letters picked without replacement from qofofoofoh. Give prob of picking 2 o and 1 f. 1/4 Two letters picked without replacement from ueeyudyeeeeuddquyu. What is prob of picking 2 d? 1/51 Calculate prob of picking 1 f and 1 x when two letters picked without replacement from {l: 1, f: 2, x: 1, b: 2, i: 1}. 2/21 Two letters picked without replacement from {v: 1, z: 4, f: 2, j: 10}. Give prob of picking 2 j. 45/136 Four letters picked without replacement from nnnnnn. What is prob of picking 4 n? 1 Three letters picked without replacement from {u: 1, h: 4, p: 3, c: 1, k: 4}. Give prob of picking 2 h and 1 k. 12/143 What is prob of picking 2 q and 1 b when three letters picked without replacement from prqrnrpqrnpqrbrqnb? 1/68 Two letters picked without replacement from mmzoz. Give prob of picking 1 m and 1 z. 2/5 Two letters picked without replacement from ddrdrdkrd. Give prob of picking 1 k and 1 r. 1/12 Calculate prob of picking 1 x and 1 d when two letters picked without replacement from jdcpodxc. 1/14 Two letters picked without replacement from hyhqjqt. What is prob of picking 1 q and 1 j? 2/21 Two letters picked without replacement from {f: 2, h: 2, k: 5, g: 1, n: 4}. What is prob of picking 1 f and 1 g? 2/91 Three letters picked without replacement from {m: 4, z: 4, j: 2, w: 4, i: 6}. Give prob of picking 2 w and 1 z. 2/95 Four letters picked without replacement from {g: 4, v: 6, z: 3}. Give prob of picking 2 z and 2 g. 18/715 Calculate prob of picking 1 x and 1 g when two letters picked without replacement from vvwxqgxvvxvv. 1/22 Calculate prob of picking 1 b and 1 i when two letters picked without replacement from iibo. 1/3 Calculate prob of picking 2 k and 1 g when three letters picked without replacement from {f: 3, o: 4, g: 1, h: 1, k: 2, p: 4}. 1/455 Calculate prob of picking 1 q, 2 k, and 1 y when four letters picked without replacement from ylvyyvylkqkrlyyvky. 7/1020 What is prob of picking 1 r, 1 x, and 2 p when four letters picked without replacement from {k: 1, x: 6, r: 2, p: 3}? 4/55 Two letters picked without replacement from tattatztaattttttzat. What is prob of picking 2 z? 1/171 What is prob of picking 1 w and 1 h when two letters picked without replacement from {n: 7, h: 1, w: 5, z: 3}? 1/24 Four letters picked without replacement from tttqqqqtttt. Give prob of picking 3 q and 1 t. 14/165 Calculate prob of picking 1 e and 1 u when two letters picked without replacement from {r: 1, u: 4, e: 3}. 3/7 Three letters picked without replacement from {i: 3, f: 8}. What is prob of picking 3	{ "pile_set_name": "DM Mathematics" }
065523 - 0.1. -0.165523 -1399+-25 -1424 0.3 + 590 590.3 What is 92 take away 0.11? 91.89 -484+54 -430 Calculate 0.1 + -2008. -2007.9 What is -6 + -145095? -145101 Add -61238.8 and 3. -61235.8 Calculate 43 - -390. 433 Work out -0.03 + 2.51. 2.48 Calculate -0.5 + -12.6617. -13.1617 What is -51 + -3.2? -54.2 Subtract -3507 from -0.2. 3506.8 Calculate -0.4 - -384. 383.6 Calculate -349 - -0.15. -348.85 What is 1 minus 1795660? -1795659 What is -0.1 minus 198507? -198507.1 What is the difference between 1 and -7570? 7571 What is the distance between -344 and -3.9? 340.1 0.2009011 - 1 -0.7990989 What is 9 less than 252.6? 243.6 What is -38 minus -4.2? -33.8 Work out -98 - -5494. 5396 Add together -0.1 and -5415. -5415.1 Total of -3 and 0.745826. -2.254174 Work out 6.5 + -80. -73.5 Work out 4.31 - -5. 9.31 What is -1.5 - -0.0523? -1.4477 Calculate -0.9492 + 0.09. -0.8592 Work out 102 + -0.0432. 101.9568 -0.2 - -0.027 -0.173 What is 8994 - -0.4? 8994.4 What is -19 minus 34399? -34418 What is the distance between 0.2 and -0.0546? 0.2546 Work out -0.01596 - 1. -1.01596 What is 16.229 + 0.027? 16.256 3 + 1209439 1209442 Add together -511.34 and 1. -510.34 What is -35 take away -14.5? -20.5 Calculate 1425 + 174. 1599 Calculate -8.1 + -0.12. -8.22 What is -0.074 - 0.0741? -0.1481 5381 + 0.1 5381.1 Sum -29.3031 and -19. -48.3031 Sum 221 and 12.5. 233.5 Calculate -712 - -41.4. -670.6 What is 0.356 + -206.5? -206.144 What is 1 take away 3.286? -2.286 Put together 10 and 146664. 146674 What is 564.9 take away -9? 573.9 -30746 - -0.3 -30745.7 Total of 3.425 and 17. 20.425 Total of 0.416 and 51. 51.416 -10.4 + -201 -211.4 Total of 11.7 and 0.0348. 11.7348 -4 + -288 -292 Add -322 and -19708. -20030 Sum 0.0369 and -0.3. -0.2631 What is -230.8 take away -7? -223.8 What is 127 less than -3? -130 Sum 0.1033702 and 0.2. 0.3033702 What is 52 less than -0.41? -52.41 What is the difference between 467 and -0.95? 467.95 Sum 4880 and 1.6. 4881.6 Calculate 7 + -83.05. -76.05 What is the difference between -0.4 and -13584? 13583.6 6+-2310 -2304 Total of -88.2 and -0.2875. -88.4875 What is 0 minus 4.47? -4.47 Add together -0.3934 and -0.073. -0.4664 Put together -2608749 and -3. -2608752 What is 10.2 take away -2666? 2676.2 Total of 0.3 and -29441. -29440.7 -99 - 0.034 -99.034 Subtract -1 from -370766. -370765 Add -2.18639 and 0.03. -2.15639 Total of -2 and -17.28. -19.28 Calculate 15 - 0.75. 14.25 What is the distance between 1 and 131.038? 130.038 Work out -2.716716 - -0.2. -2.516716 What is 0.03 take away 1.407? -1.377 Calculate -13.6298 + 0.4. -13.2298 What is 1.2766 take away 4? -2.7234 Work out 629 + 0.15. 629.15 -0.06+320730 320729.94 What is 4977 plus 24.5? 5001.5 Calculate -0.1 - -0.128. 0.028 Subtract 0.813 from 1.1. 0.287 Calculate -2803 + 41. -2762 What is the difference between 14.11 and -0.3? 14.41 What is 22.4 less than -3299? -3321.4 Work out 4196 - -0.207. 4196.207 What is 0.87 minus -879? 879.87 What is the distance between 42965 and 4? 42961 What is 10 take away 14? -4 What is 5694 take away 5? 5689 Calculate -98.51 - -0.4. -98.11 Work out 640 + 30. 670 2 - -34.2 36.2 What is 2.44 - 272? -269.56 What is -1.709 less than 6.4? 8.109 What is -17382 + -0.1? -17382.1 Calculate -1179 - -0.3. -1178.7 -3.49+-0.424 -3.914 Subtract -6.08324 from 2. 8.08324 What is -74 + 5.8? -68.2 Add together 1 and -0.391. 0.609 What is -187461 less than -34? 187427 What is -0.2 - -497? 496.8 28.7+0 28.7 Add -165645 and 0.13. -165644.87 Work out 28.17 + 84. 112.17 What is -838876 less than -3? 838873 What is -0.008 less than -0.2276? -0.2196 -0.16 + 2765 2764.84 Add -0.2 and 432. 431.8 What is -4 take away 10826.5? -10830.5 Put together -65 and -7. -72 Put together -53.3 and 457. 403.7 Sum -0.3 and -15098. -15098.3 What is 0 take away 638? -638 Add together 7981 and 84. 8065 What is -1021066 less than 5? 1021071 What is the distance between -17117.3 and -5? 17112.3 Total of 36 and -8. 28 -3 + 5781 5778 0.08+-174406 -174405.92 What is 8 take away -25? 33 1953 + -0.0125 1952.9875 What is 14 plus -59276? -59262 Put together 57 and -6923. -6866 What is -2773 + 1.3? -2771.7 What is the distance between 24 and 1.5? 22.5 Total of 11 and 2.9. 13.9 Calculate -0.031 + -180440. -180440.031 What is 0.04782 minus 0.021? 0.02682 What is 20.3 + 0.8? 21.1 Work out 0.05 - 1883. -1882.95 75.4 + -3 72.4 Total of 1.058 and -0.2. 0.858 Add 4 and -0.0151. 3.9849 Work out -0.03 + 249. 248.97 Calculate 0.5 + 2.7762. 3.2762 Put together -8 and 3541. 3533 Subtract -38323 from -21. 38302 15714+-0.2 15713.8 Put together -340.2 and -19. -359.2 What is -63 minus 0.051? -63.051 What is -47 - 40? -87 What is -23 + 0.06? -22.94 What is -1 take away -0.0435? -0.9565 2168 + -0.3 2167.7 Calculate 4 - 76302.4. -76298.4 Work out -138 - 411. -549 What is the difference between 197 and 0.19? 196.81 What is -1.1 minus -7298? 7296.9 What is -408 + 33? -375 Subtract 50.119 from 115. 64.881 Add -0.1 and 0.1081. 0.0081 Put together 0 and 915. 915 Calculate -0.2009 - 4.7. -4.9009 Add 14 and 51444. 51458 What is 4.914 minus -16.2? 21.114 Calculate 109.6 - -39.9. 149.5 Put together -3 and 27.51. 24.51 What is -2 + -36.025? -38.025 Total of 272 and -1.1. 270.9 Add together 0.1024331 and -0.3. -0.1975669 What is -264458 take away 0? -264458 Subtract -1 from -76151. -76150 Total of 0.45 and -123. -122.55 What is 51023 less than -0.4? -51023.4 What is 725263 plus -0.4? 725262.6 45.3+124 169.3 -748335 - -3 -748332 What is -1.48 minus -233? 231.52 What is -0.03 - 76283? -76283.03 What is 4.7 less than 1.68? -3.02 Subtract 0.1 from -52035. -52035.1 What is the difference between -0.08 and -15073? 15072.92 Add together -44109.9 and -0.5. -44110.4 What is 0.3 minus -117.047? 117.347 252 + -10 242 What is -6404 less than 253? 6657 What is -132995.3 minus -0.5? -132994.8 Put together 2442 and 7. 2449 Work out 0.05 + -8021. -8020.95 What is -26 - 109.28? -135.28 What is the distance between 0.040337 and 3.62? 3.579663 Work out 7 + -0.03935. 6.96065 Work out -1015 + 147. -868 Calculate -216 - 624. -840 Total of 0 and -3.129. -3.129 What is the distance between -0.782 and 84? 84.782 What is 5 less than -0.014329? -5.014329 -37.85 - 5 -42.85 What is 3268 - -0.0638? 3268.0638 What is the difference between -0.5179 and 0.12? 0.6379 Put together 2 and 459336. 459338 What is 2 minus -243? 245 -0.4 - -0.01057 -0.38943 155.34+10 165.34 Total of -190.44 and -3. -193.44 Put together -37 and -0.427. -37.427 What is -0.04262 minus 0.7? -0.74262 What is the distance between 336 and -0.054? 336.054 What is 167 - 0.03? 166.97 Sum -469 and 3554. 3085 -2+-25083 -25085 Calculate -1.171 - -0.5. -0.671 What is -284 less than -5? 279 -0.06 + 0.1614 0.1014 Add 0.4 and 0.59316. 0.99316 Work out -1 - 579789. -579790 What is the difference between 3836 and 122? 3714 Add 2.68 and -121. -118.32 What is -0.8421 less than 2? 2.8421 Add together 485.7 and 216. 701.7 Subtract 0.4 from 191297. 191296.6 Work out -0.4 - -0.0428. -0.3572 0.2 + -1.7 -1.5 What is -0.5 take away 0.00144? -0.50144 What is the distance between 51.61 and 7? 44.61 Add together 538 and 55. 593 Work out -5 - 152.1. -157.1 What is -1.031 - -3.736? 2.705 Work out -891 + -25. -916 What is -0.5 minus 40.964? -41.464 What is -1.5 - 0.0376? -1.5376 Put together -21 and 0.17. -20.83 Add together 1475175 and -1. 1475174 What is -11275 take away -1.1? -11273.9 Subtract -0.15 from -104.27. -104.12 What is the distance between 7 and -10216? 10223 What is -75 less than 301? 376 Work out 31 - 197.22. -166.22 What is -5363 + -4? -5367 0 + -3.8 -3.8 Sum -317849 and 13. -317836 Work out -4 + 0.037. -3.963 Put together 2.7876 and -0.5. 2.2876 What is 152 - -37? 189 Subtract -2.1 from -2830. -2827.9 Work out -0.5 - 14208. -14208.5 Work out -993 - 1. -994 Work out -4.848 - 61. -65.848 -5272.41 + 0.5 -5271.91 Work out 42 + -6.5. 35.5 Add together 0.066 and 0.5. 0.566 What is -1389389 - -1? -1389388 Add together -3 and 2921. 2918 Add together 0.123 and -7. -6.877 Put together -0.25 and -147.1. -147.35 What is -0.371 take away 0.0472? -0.4182 What is the distance between 15.238 and -0.1? 15.338 What is 14919 + 34? 14953 Subtract 106.784 from -0.2. -106.984 Add together -0.13 and 94735. 94734.87 Total of -0.01 and -126.	{ "pile_set_name": "DM Mathematics" }
d derivative of 1/24c4 - 1/60c*6 - 1/84c*7 + 0 - 2c - 2/3c3 + 1/8c5 + c2. Factor t(k). -(k - 1)*3(k + 2)*2/2 Factor -5b*4 + 4b*4 - 4b*3 + 16 + 46b - 30b. -(b - 2)(b + 2)*3 Let n(z) be the first derivative of 2z*5/55 + 4z*4/11 + 12z*3/11 + 16z*2/11 + 10z/11 + 11. Let n(b) = 0. What is b? -5, -1 Suppose b - 13 = -4h, -3h + 11 = 2h - 4b. Suppose -3u4 + u3 - u4 + 5u*h + u - 4u2 + u5 = 0. Calculate u. 0, 1 Let r be (-5)/((-40)/(-12))-2. Find j, given that 6j*2 - 21j*2 - 6j*r + 12j2 = 0. -1/2, 0 Let h(y) = -y3 + 11y2 - 11y - 7. Let c be h(9). Factor co + 3o*3 - 56o - 6o4. -3o*3(2o - 1) Let n(c) be the first derivative of -c6/12 - c5/2 - c4 - 2c3/3 - 10. Suppose n(a) = 0. Calculate a. -2, -1, 0 Let k(u) be the second derivative of u7/273 + u6/65 + u5/65 - u4/39 - u3/13 - u*2/13 + 3u. Factor k(c). 2(c - 1)(c + 1)4/13 Let v(t) be the second derivative of t5/10 - t*3 + 2t*2 + 7t. Let v(i) = 0. What is i? -2, 1 Let u(y) be the first derivative of -y6/6 + y5/5 + y4/4 - y3/3 - 5. Factor u(b). -b*2(b - 1)*2(b + 1) Let v = 91/4 + -22. Let c be (-8)/44 - (-38)/88. Solve vj - 1/4 + cj*3 - 3/4j*2 = 0. 1 Let d(o) be the third derivative of 1/150o6 - o2 + 0o - 1/150o*5 - 1/525o*7 + 0 + 0o*4 + 0o*3. Let d(n) = 0. What is n? 0, 1 What is o in -2/5o*2 + 2/5o + 0 = 0? 0, 1 Let j = -81791/88264 + 1/5192. Let c = -3/17 - j. Determine h, given that -1/4h - 5/4h*2 + ch*4 + 1/2 + 1/4h*3 = 0. -1, 2/3, 1 Let d(q) = 17q*2 - 7q + 12. Let m(n) = -4 + 2n + 0n*2 - 7n2 + n2. Let s(a) = -4d(a) - 11m(a). Suppose s(j) = 0. What is j? 1, 2 Let o = -145/3 + 499/9. What is t in -ot + 154/9t*4 - 146/9t*2 + 98/9t*5 - 8/9 - 34/9t*3 = 0? -1, -2/7, 1 Let v be (-24)/(-10) - (-2)/(-5). Let l = 38 - 32. Factor -2 - l + v + 9w - 3w2. -3(w - 2)(w - 1) Let z = -127 + 391/3. Let -zt*3 + 4/3 + 10/3t - 4/3t2 = 0. What is t? -1, -2/5, 1 Let h(q) be the first derivative of q4/18 - q3/3 + 2q*2/3 - q + 6. Let m(d) be the first derivative of h(d). Suppose m(i) = 0. What is i? 1, 2 Let x = 826/3 - 270. Let -xu - 38/3u2 + 8/3 - 14/3u3 = 0. What is u? -2, -1, 2/7 Let n(u) be the second derivative of u7/294 - u6/210 - u5/70 - 22u. Determine v so that n(v) = 0. -1, 0, 2 Suppose -2/9z*3 - 1/9 + 2/3z*2 + 1/3z*5 - 5/9z*4 - 1/9z = 0. Calculate z. -1, -1/3, 1 Let p(m) be the second derivative of 5m7/84 - 7m6/60 + m5/20 - 13m. Factor p(r). r3(r - 1)(5r - 2)/2 Let b(r) = 4r2 - 30r + 20. Let k(l) = -12l2 + 89l - 60. Let j(d) = 17b(d) + 6k(d). Factor j(y). -4(y - 5)(y - 1) Factor 0 - 1/2m3 + 5/2m*2 - 3m. -m(m - 3)(m - 2)/2 Suppose -13i + 3i = -5i. Let a(r) be the third derivative of 0 - 1/240r*6 + 0r*4 - 1/120r*5 + 0r*3 - 2r*2 + ir. Factor a(f). -f*2(f + 1)/2 Let y(o) be the first derivative of o*4/10 - 3o*2/5 + 4o/5 + 7. Factor y(l). 2(l - 1)2(l + 2)/5 Let r(w) = w - 2. Let k be r(5). Let y(j) be the second derivative of 0j2 + 0 + 1/9j*k + 1/18j*4 + j. Factor y(z). 2z(z + 1)/3 Let d(o) be the third derivative of o7/30 + 19o6/120 + o5/4 + o4/24 - o3/3 + 6o2. Factor d(k). (k + 1)3(7k - 2) Let p(z) be the second derivative of -z5/30 + z3/9 + 8z. Suppose p(u) = 0. What is u? -1, 0, 1 Let f(x) be the first derivative of x4/4 - x3 + 4x - 3. Let c be f(3). Find a such that 3a2 + a2 - a*4 + 3 - 2a*2 - c = 0. -1, 1 Let t(v) = 4v*4 + 4v*3 - 8v*2 + 4v + 4. Let y(a) = -4a4 - 3a*3 + 8a*2 - 3a - 4. Let b(l) = 3t(l) + 4y(l). Factor b(k). -4(k - 1)2(k + 1)*2 Factor -4x + 0 - 4/3x2. -4x(x + 3)/3 Let o(y) be the first derivative of -1/2y*2 + 0y + 2/3y3 + 1 + 1/24y*6 + 1/20y*5 - 1/2y*4. Let h(t) be the second derivative of o(t). Factor h(x). (x - 1)(x + 2)(5x - 2) Factor -1 + p*4 - 1 - 19p3 + p2 + 3p + 16p*3. (p - 2)(p - 1)*2(p + 1) Let t be 1 - 0 - (-84)/(-112). Suppose tr + 0r*2 + 0 - 1/4r3 = 0. Calculate r. -1, 0, 1 Let u(z) be the second derivative of -z8/2240 + z7/280 - z6/80 + z5/40 - z4/12 - 6z. Let f(q) be the third derivative of u(q). Factor f(r). -3(r - 1)*3 Let t be (28/21)/(70/15). Factor -4/7f*2 + 2/7f + t. -2(f - 1)(2f + 1)/7 Let t(l) be the third derivative of -l6/540 - l5/135 + 21l*2. Factor t(k). -2k*2(k + 2)/9 Let g(h) be the third derivative of -h*6/30 - 2h*5/5 - 11h*4/6 - 4h*3 + 16h*2. Factor g(o). -4(o + 1)(o + 2)(o + 3) Let f(d) be the first derivative of -d6/180 + d5/270 + d4/36 - d3/27 + d*2/2 - 1. Let q(a) be the second derivative of f(a). Factor q(k). -2(k - 1)(k + 1)(3k - 1)/9 Factor 13/3n*2 - 28n + 14n3 + 3n4 + 12. (n + 3)2(3n - 2)*2/3 Let f(i) = 2i*2 - 3i. Let q be -7(-1 - (-15)/21). Let u be f(q). Factor 0 - 1/3x*4 - 1/3x*3 + 1/3x + 1/3xu. -x(x - 1)(x + 1)2/3 Let d(f) = -3f*2 + 100f - 90. Let j(v) = v*2 - 50v + 45. Let q(s) = 4d(s) + 7j(s). Suppose q(g) = 0. What is g? 1, 9 Let b be 2/10 + 1/(-5). Let h(u) be the second derivative of 0u2 + b - 1/12u*4 - 1/3u*3 + u. What is q in h(q) = 0? -2, 0 Let j be (1 + 7/(-14))(-6)/(-15). Determine r, given that -2/5 - jr + 1/5r*2 = 0. -1, 2 Let p be 8 - -42/(-2). Determine v, given that -3v5 - 3v3 - v4 - 2v4 - 3v*p = 0. -1, 0 Suppose -2f = -m + 13, 3 - 10 = -4m - f. Let 21/5x*4 + 0 + 3/5x*2 + 3x*m + 9/5x*5 + 0x = 0. What is x? -1, -1/3, 0 Let k(o) be the second derivative of -o*6/57 + 37o*5/190 - 89o*4/114 + 25o*3/19 - 18o*2/19 + 24o. Solve k(z) = 0 for z. 2/5, 1, 3 Let i(w) be the first derivative of 4w3/27 + 4w*2/9 - 1. Factor i(y). 4y(y + 2)/9 Let v = 19 - 56/3. Let b(a) be the second derivative of -1/5a*5 + 0 - 1/15a*6 + a + 1/21a*7 + va3 - a2 + 1/3a4. Solve b(r) = 0. -1, 1 Let c be -8(-6 - (-94)/16). Factor 1/3r2 - 4/3r + c. (r - 3)(r - 1)/3 Let u(p) be the first derivative of 3p*4/4 + 4p*3 + 15p*2/2 + 6p + 5. Find x, given that u(x) = 0. -2, -1 Let j(n) = n*3 - 3n*2 - n + 3. Let m be j(3). Suppose -2/7i*3 + mi + 0 - 2/7i2 = 0. What is i? -1, 0 Let o = -2 + 2. Let y = o - -4. Factor -2q*3 - 2q*2 - 2q*2 + 2q*2 + 2q + 2qy. 2q(q - 1)2(q + 1) Let z be 2(-3)/120. Suppose -4 = -2i - z. Determine t, given that 2/9t*i + 2/9 + 4/9t = 0. -1 What is v in 4/7 + 0v2 + 2/7v*3 - 6/7v = 0? -2, 1 Let n(y) be the second derivative of y6/105 - y5/35 + y*4/42 - 11y. Let n(s) = 0. Calculate s. 0, 1 Let w be -5 - -6 - (-6)/2. Suppose -2/5x + 6/5x*2 + 0 - 8/5x*w + 0x*3 = 0. Calculate x. -1, 0, 1/2 Suppose 0 = 6m - m - 3t - 19, 0 = -5m - t + 7. Let a be (0/(-2 - -5))/m. Suppose 1 - i*3 + 3i + a + 3 - 2 = 0. Calculate i. -1, 2 Let t be (-1)/9-33 - 3. Let z(p) be the second derivative of -3p + tp4 + 4/5p*5 + 0 - 31/15p*6 + 0p*3 + 0p*2 - 5/3p7. What is f in z(f) = 0? -1, -2/7, 0, 2/5 Let u(n) = -n3 + 2n2 + 3n + 3. Let z be u(3). Factor zy - 2y + 2y3 - 3y2 + y3 - y*4. -y(y - 1)3 Let g(j) be the first derivative of j3/3 + j*2/2 + 8. Suppose g(c) = 0. Calculate c. -1, 0 Suppose -25 = -0r - 3r - 5b, -2b + 10 = 3r. Let v(j) be the first derivative of 1 + rj + 0j2 - j4 - 2/3j3. Factor v(k). -2k*2(2k + 1) Let w be 3(-2 - -1)1. Let m be w(-2 - 1)/3. Determine x so that 2/5x2 - 2/5x*m + 2/5x - 2/5x4 + 0 = 0. -1, 0, 1 Let d(b) be the first derivative of -b6/720 + b4/48 + 2b*3/3 - 2. Let q(k) be the third derivative of d(k). Factor q(f). -(f - 1)(f + 1)/2 Let m be 2 + (2 + 2/(-4) - 3). What is d in md2 - 1/4d + 0 - 1/4d3 = 0? 0, 1 Let p(q) be the first derivative of 1/15q*3 + 0q*2 - 1/30q*4 - q + 1/75q*6 - 1/50q*5 + 1. Let s(y) be the first derivative of p(y). Factor s(u). 2u(u - 1)2(u + 1)/5 Suppose 2 + 4 = 3v. Factor i3 - 2i + 0i3 + 2iv + i3 - 2i4. -2i(i - 1)2(i + 1) Suppose -3k + 5 = -4. Suppose 0 = p + kp - 8. Find q such that 3 - 2q2 + 0q*2 + 3q*2 + pq - 2 = 0. -1 Let q be 180/46 + (-24)/(-276) - 4. Find h such that -2/3h + q - 7/3h*2 - 5/3h**3 = 0. -1, -2/5, 0 Le	{ "pile_set_name": "DM Mathematics" }
.2, b, 0.3? -0.2 Let i = -63986/352165 + -4/32015. Let r = 13.5 + 0.5. Let s = 3 + -2.8. What is the nearest to s in r, i, 1? i Let f = 2609.61 + -2632. Let d = -0.39 - f. Let y = d - 23. What is the closest to -0.1 in -3, -3/2, y? y Let o = -38/99 + 3/11. Let n = 159.79 - 159.59. Which is the closest to -1? (a) 4 (b) o (c) n b Let y = -41005 + 41002. What is the closest to 145 in 2/7, 4, y, 5? 5 Let h = -1.5 - -1. Let y be 1277-310/(-150). Let w = 255 - y. What is the nearest to w in h, 0.4, -5? h Suppose 26s - 13 + 65 = 0. Which is the closest to 1? (a) -39/16 (b) 0 (c) s (d) -0.2 b Suppose -266 = -41c - 61. Let g(i) = -i*3 + 4i*2 - 3i + 6. Let u be g(4). Let z be u/9 + 68/(-6). What is the nearest to 0 in c, z, -3/8? -3/8 Let g = 0.8 - -0.2. Let l = 73269 - 73269.2. What is the nearest to -0.3 in g, -4, l? l Let j = -81 + 277. Let d = j + -195.7. Which is the closest to 1? (a) d (b) -8 (c) 1 c Let v = -3001 + 3001.2. Which is the nearest to v? (a) -2 (b) 8 (c) -20/7 (d) -1/4 d Let a = -2673 - -2673.9. What is the closest to 0 in 0.01, a, -0.03? 0.01 Let w = -4329 - -25973/6. Let b be (-1)/(-7) + (-2)/(-14). What is the closest to 0 in b, w, 0? 0 Let z = 64591/6 - 10765. What is the nearest to 4 in z, -120, 2? 2 Suppose -2f - 8 = 2g, 2f = 2g + 2 + 6. Let d = -2/372245 + -372237/1488980. Which is the nearest to 2/7? (a) f (b) 253 (c) d a Let v be (52/8112)/(5/60). Which is the nearest to -5? (a) -3 (b) v (c) 4 a Let k = 0.02014 + 0.07986. Which is the closest to k? (a) 1/8 (b) 2 (c) 0.4 (d) 0.1 d Let n = 16.059 - 16.149. Let d be 14/78 + 10/65. What is the closest to 1/2 in d, 3, 0.1, n? d Let r = -3.9379 - -4.9379. Suppose -2f + 4f = 5y + 17, 4f = 3y + 13. What is the nearest to f in -2/13, 4/3, r? r Let g be 8 - ((-35)/6)/((-68)/102). Which is the closest to g? (a) 0.06 (b) -4 (c) 12 (d) -3 a Let z(k) = -k3 - 2k*2 + 2k - 4. Let p be z(-3). Suppose 35 = -148l + 143l. Let r = -3479 - -3480. Which is the nearest to r? (a) p (b) 1/10 (c) l b Let t = 80.42 - 75.42. What is the nearest to 48 in 0, 1, t? t Let r = -259.9889 + -0.0111. Let k = r - -258. Which is the nearest to -1? (a) -1/15 (b) -0.3 (c) k b Let z be (15/(-80))/(741/38 - 20). Suppose 6 = -m - 2k - 0, -2 = -5m - 2k. What is the closest to 0.1 in z, 0.2, m, -4? 0.2 Suppose 0 + 2 = -p. Let j be (p/(-8))/(11/8). Let y = 0.34622 - 0.84622. What is the closest to 1 in -5, y, j? j Let l = -0.05 + -2.95. Let y = -1.452 - 8.548. What is the closest to y in 0.1, l, -0.4? l Let g be 152/(-16)(-2 - 0). Let y(k) = gk2 + 1 - 13k*2 - 2k - 5k2. Let f be y(0). Which is the nearest to f? (a) 3 (b) -2 (c) 2/9 c Let u = -7 - -3. Let r = 143/12 + -127/12. Which is the closest to 1? (a) u (b) 1 (c) r b Let w = -599 + -843. Let t = w - -1442.5. Let g = -2/145 - 276/1015. Which is the closest to 0.1? (a) -0.1 (b) t (c) g a Let d = -21447 - -21446. Let p = 0.15 + -8.15. Let j = 4 + p. Which is the nearest to -1? (a) 0.06 (b) j (c) d c Let k = -309.6412 + 0.7412. Let w = -309 - k. Which is the nearest to -2? (a) 2/43 (b) 4 (c) w c Let u = -370 - -364. Let r be (-4)/(-12)u/1. Suppose 5n + 2f - 1 - 5 = 0, -12 = -3n - 4f. Which is the nearest to n? (a) r (b) -1/3 (c) 0.2 c Let r = -389 + 472.1. Let k = r + -83. Which is the closest to k? (a) 7.7 (b) -3 (c) 4 (d) -3/4 d Let m = -0.23 + -0.07. Let k = -648955 - -648955.2. Which is the closest to 1? (a) 0.094 (b) k (c) m b Suppose 8r = 12r - 12. Let z be r/(-6) - (3/6 - 0). Let p be (z - -2)14/105. What is the nearest to 1/4 in 2/7, 8, p? 2/7 Let u = -33.6 + 34. Let c = 79494/19 - 4184. What is the closest to -1 in c, u, 0.1, 1? c Let r = 25.938 + -26.338. Which is the nearest to 2/3? (a) -0.1 (b) -7 (c) -64 (d) r a Let d = -1888 - -9438/5. Which is the nearest to d? (a) -37 (b) -1 (c) 0.3 b Let m = -2923 + 2923. Which is the closest to m? (a) 0.5 (b) 4 (c) -0.019 (d) -6 c Let y = -19.13 + 18.63. What is the closest to 2/7 in -1/9, y, 63, -3/8? -1/9 Let u = 56 - 170/3. Let y = -507329 - -507329. Let t be (1 - 0)/14-6. What is the closest to 1 in u, t, y? y Let k be (-5)/(-1)(-6)/10. Let a = -5 - -5. Let m be (30/(-5))/(-36) - 1(-6)/18. What is the nearest to -2 in k, m, a? k Let b = 0.244 + -0.744. What is the closest to -0.15 in 1/9, b, -0.3? -0.3 Let z = 15586.8 - 15587. What is the closest to z in 5, 2, 15, -15? 2 Let f = -182.12 - -181.32. Which is the closest to -29? (a) 0 (b) 0.5 (c) f (d) -2/7 c Let c = 41.78 + -41.68. What is the nearest to 1 in c, 102, 0.6? 0.6 Let i(m) = -m*3 + 8m*2 + 8m + 5. Suppose -5k + 42 = -3. Let g be i(k). Let d be g(1 + (-27)/30). Which is the nearest to d? (a) 1/5 (b) -0.2 (c) -0.5 c Let o = 91 - 90.68. Let x = 0.02 - o. Which is the nearest to -1? (a) 1 (b) 0.05 (c) x c Let d = 4968 + -4975. What is the nearest to -0.1 in 1/9, -0.2, d, -6/5? -0.2 Let x(n) = -6n3 - 57n*2 - 22n + 18. Let f be x(-9). Let i = 0.1 + 0.9. What is the nearest to f in -1/5, -0.1, i? -1/5 Let d = -45687/4 + 11421. What is the closest to 13/3 in -3/2, 0.1, d, 0? 0.1 Let r be (-12)/(-18)3/(-6)2. Let n = 0.03 + -0.1. Let o = n + 3.07. What is the nearest to o in 4, -3, r? 4 Let w = -18130 - -18129. Which is the closest to -80? (a) 2/3 (b) 2/9 (c) w c Let n = 2811 + -2810.9. Let c = -0.3 - 0.7. What is the nearest to 2 in c, n, 2/7, -3? 2/7 Suppose 0 = -v - 3v - h + 28, 2v = 4h + 32. Let l be (v/((-280)/(-21)))/((-1)/5). Let d(j) = -j + 1. Let x be d(l). What is the closest to x in -2, -2/9, -4? -2/9 Let n = -63254.1 + 63254. Suppose -5p + 7 = 5x - x, 0 = -2p + 5x - 17. What is the nearest to n in -0.5, 2, 21, p? -0.5 Let j = 23401 - 23413. Which is the nearest to -1/4? (a) 0.2 (b) 2/15 (c) 0.09 (d) j c Let b = 14246 - 14257. What is the closest to -22 in 0.3, -0.4, b, -1/7? b Let z = -1171/3 - -389. Which is the nearest to 1? (a) z (b) -2 (c) 1.6 c Let i = 0.9853 + 1.0147. Let u = -3 - -3. Suppose u + 1 = -s. Which is the closest to i? (a) 7 (b) s (c) 2 c Let b be -1(-1 + 0)-1. Let j be ((-877)/(-9647))/((-9)/(-66)). What is the nearest to j in b, 4, 9? b Let o = 17260 - 17258. Let i = 10 - 10. What is the nearest to o in i, -0.4, 0.2? 0.2 Suppose 7y = 4y - 9. Let i = 25 + -29. Let m = -619 - -619. What is the nearest to i in -1, y, m? y Let j be (62/20)/((-324)/120). What is the nearest to j in 0, -4, 2? 0 Let t = 140 - 139.97. Let h be (-20)/(-16)(-4)/(-10). Let g = 0.3 - -0.7. Which is the nearest to h? (a) 0.5 (b) t (c) g a Let h = -73.6 + 74.6. Let n be (-39)/(-9) - 4/(-6). Suppose -nd = -2i - 0i - 27, -d = -2i - 7. Which is the nearest to h? (a) 5 (b) i (c) 0 c Let x be (378/(-98))/((-9)/(-21)). What is the closest to 0 in x, 2, -1? -1 Let f = 57 + -240. Let v = f - -191.9. Let o = v - 8.7. What is the nearest to -5 in -3, o, 0.4? -3 Let d = 17.5 + -18. Suppose 0 = -3y - 2n + 22, -2y - 1 = -n - 4. Suppose -5k = -2k - 4u - 2, -yk = 2u - 10. What is the nearest to k in 3, d, 2? 2 Let j be 18(-29)/(-2233) + ((-2)/(-1))/(-14). What is the nearest to 1 in -3/4, -2, j, 36? j Suppose -350k = -300k + 250. What is the nearest to -1/5 in -8, k, -10, 4/7? 4/7 Let w = -8 - -19. Let l = w + -10.7. Let x = 326 + -324. Which is the closest to -0.2? (a) -3/5 (b) l (c) x a Let v = 78194 - 78194. Let q be 4/(-3) - (-5 - -4). What is the nearest to q in 3/11, -3, v? v Let j be 48/(-14) + (-3 - -6). Let q = 5.972 + -2.972. What is the nearest to 1 in -9, j, -2/11, q? -2/11 Let i = 2 + 0. Let o = 0.0177 + -2.0177. Which is the closest to o? (a) -0.4 (b) i (c) 1 a Let w = -6378 + 6333. What is the nearest to -1 in w, -0.1, 0.1? -0.1 Let s = 3024 - 3023.6. Suppose u = 3*u - 48. What is the nearest to 0.2 in s, 2/9, u? 2/9 Let y = 186 - -134. Let r = y + -323. What is the nearest to 0.2 in r, -5, -13, -0.5? -0.5 Let g = 235.76 - 16.46. Which is the closest to 0.1? (a) g (b) 0 (c) -1/3 (d) -1 b Let h = -19.3 - -19.7. What is the nearest to -1/2 in -5, h, -0.03, 0.05? -0.03 Let s = 7.6 + -65.6. Let t = s + 55.7. Let b = t - -2.5. What is the closest to -5 in b, 0.1, -5/3? -5/3 Let r = -53 + 691/13. Let t = 3.4 + -8.8. Let g = 4.4 + t. Which is the nearest to g? (a) 0.3 (b)	{ "pile_set_name": "DM Mathematics" }
many milliseconds are there in 3/25 of a minute? 7200 How many millilitres are there in nineteen quarters of a litre? 4750 Convert 60983.53g to micrograms. 60983530000 How many years are there in 27/2 of a millennium? 13500 How many hours are there in 427330.26 seconds? 118.70285 What is thirteen quarters of a litre in millilitres? 3250 What is 2356.8549 months in years? 196.404575 How many millilitres are there in seventy-seven fifths of a litre? 15400 Convert 43.41013 hours to nanoseconds. 156276468000000 What is 61/4 of a kilogram in grams? 15250 What is 0.3532484ng in kilograms? 0.0000000000003532484 What is 21503979.9 seconds in days? 248.88865625 What is 460320.84s in hours? 127.8669 What is 15/4 of a litre in millilitres? 3750 How many microseconds are there in 62.15812 weeks? 37593230976000 What is 4.701873 litres in millilitres? 4701.873 Convert 3.025081 millennia to years. 3025.081 What is eleven halves of a gram in milligrams? 5500 How many grams are there in 831755.3kg? 831755300 What is three eighths of a meter in millimeters? 375 How many centuries are there in 24.077541 months? 0.0200646175 What is fourty-two fifths of a kilometer in meters? 8400 How many nanograms are there in 6/5 of a microgram? 1200 How many seconds are there in 795.0299ns? 0.0000007950299 How many millimeters are there in 11/2 of a centimeter? 55 How many years are there in 0.8491372 decades? 8.491372 How many kilometers are there in 131.6371 meters? 0.1316371 How many minutes are there in four fifteenths of a week? 2688 What is 33/5 of a millennium in decades? 660 What is nine tenths of a minute in milliseconds? 54000 What is 13/5 of a litre in millilitres? 2600 What is 44/5 of a microgram in nanograms? 8800 What is 1.939724 meters in millimeters? 1939.724 How many days are there in 258.719697 milliseconds? 0.0000029944409375 What is 85526.05um in meters? 0.08552605 What is 44/5 of a gram in milligrams? 8800 How many millimeters are there in 51.27916 kilometers? 51279160 What is 1.688963um in centimeters? 0.0001688963 How many milligrams are there in 25.8411ng? 0.0000258411 What is three eighths of a millennium in years? 375 What is 15/4 of a millennium in decades? 375 How many nanoseconds are there in 37/5 of a microsecond? 7400 What is eleven quarters of a millennium in months? 33000 How many kilograms are there in 3/25 of a tonne? 120 What is 0.6505571ml in litres? 0.0006505571 What is 0.8381906 millilitres in litres? 0.0008381906 How many months are there in 5/8 of a millennium? 7500 How many millennia are there in 83581.34 years? 83.58134 Convert 12773.87 years to decades. 1277.387 What is 7/2 of a millisecond in microseconds? 3500 What is three tenths of a week in minutes? 3024 What is 12/25 of a gram in milligrams? 480 What is 1/5 of a litre in millilitres? 200 What is 5/4 of a centimeter in micrometers? 12500 How many litres are there in 421251.8 millilitres? 421.2518 How many nanometers are there in thirty-two fifths of a micrometer? 6400 What is 8.426986 nanometers in micrometers? 0.008426986 How many micrometers are there in thirty-three fifths of a millimeter? 6600 How many milligrams are there in 797.0785g? 797078.5 How many micrometers are there in seventeen quarters of a centimeter? 42500 How many nanoseconds are there in 0.2587377us? 258.7377 How many millimeters are there in 129361.9m? 129361900 How many meters are there in 225811.6um? 0.2258116 What is 7/4 of a litre in millilitres? 1750 What is 1/4 of a century in years? 25 How many nanograms are there in one fifth of a microgram? 200 How many millimeters are there in seven halves of a meter? 3500 How many months are there in 74.77665 centuries? 89731.98 How many micrometers are there in one fifth of a millimeter? 200 What is 846.9069 decades in months? 101628.828 How many minutes are there in 4681.416s? 78.0236 How many nanoseconds are there in 64/5 of a microsecond? 12800 What is 0.7135276 milligrams in kilograms? 0.0000007135276 What is 35671.34 millennia in years? 35671340 How many seconds are there in ten ninths of a day? 96000 How many centuries are there in 25.970718 months? 0.021642265 What is 3/10 of a kilogram in grams? 300 What is 70147.53 kilometers in micrometers? 70147530000000 How many nanometers are there in 21/4 of a micrometer? 5250 What is 3/25 of a millennium in months? 1440 How many hours are there in 3/8 of a day? 9 Convert 2549.379ns to minutes. 0.00000004248965 Convert 33223.8mm to meters. 33.2238 How many micrograms are there in 3.283765ng? 0.003283765 What is three tenths of a litre in millilitres? 300 Convert 49072.31 decades to centuries. 4907.231 What is 23510.06ms in nanoseconds? 23510060000 How many millilitres are there in 11/2 of a litre? 5500 What is 1/10 of a meter in micrometers? 100000 What is 17/4 of a milligram in micrograms? 4250 What is 8.818346 micrometers in millimeters? 0.008818346 Convert 38228.71um to millimeters. 38.22871 What is 8/25 of a minute in milliseconds? 19200 How many micrograms are there in 9.383733 nanograms? 0.009383733 What is 43/2 of a decade in months? 2580 Convert 496807.9 centuries to millennia. 49680.79 What is one quarter of a tonne in kilograms? 250 What is 1/4 of a decade in months? 30 What is twenty-three thirds of a millennium in months? 92000 What is twenty-one fifths of a centimeter in micrometers? 42000 Convert 818.3576 decades to months. 98202.912 How many millilitres are there in seventeen quarters of a litre? 4250 How many weeks are there in 1877696.1 hours? 11176.7625 Convert 1.516275l to millilitres. 1516.275 What is 75/2 of a kilogram in grams? 37500 What is 0.7587327 kilometers in nanometers? 758732700000 How many months are there in fifty-five thirds of a century? 22000 What is 68899.959 nanoseconds in hours? 0.0000000191388775 How many grams are there in 1/10 of a tonne? 100000 What is 0.6928204 grams in tonnes? 0.0000006928204 How many millilitres are there in 1/20 of a litre? 50 How many millilitres are there in 15/4 of a litre? 3750 What is six fifths of a minute in seconds? 72 What is 3073.11 kilometers in centimeters? 307311000 Convert 2315704.2us to minutes. 0.03859507 What is 6/25 of a millennium in decades? 24 What is 75962.82ms in minutes? 1.266047 What is three fifths of a micrometer in nanometers? 600 Convert 0.9884522nm to micrometers. 0.0009884522 What is 1528120.5 months in decades? 12734.3375 How many millilitres are there in 0.2289382 litres? 228.9382 How many centuries are there in 1/5 of a millennium? 2 Convert 0.659763 kilograms to milligrams. 659763 How many micrometers are there in seven sixteenths of a centimeter? 4375 What is 8.996772ng in tonnes? 0.000000000000008996772 Convert 212465.8 nanometers to kilometers. 0.0000002124658 What is fifteen quarters of a litre in millilitres? 3750 What is three fifths of a centimeter in millimeters? 6 Convert 586541.7 days to hours. 14077000.8 Convert 1486177.2ns to days. 0.000000017201125 Convert 0.1927754 millilitres to litres. 0.0001927754 What is 17254.52 seconds in nanoseconds? 17254520000000 What is two sevenths of a week in days? 2 What is twenty-nine fifths of a hour in minutes? 348 How many meters are there in three tenths of a kilometer? 300 How many milliseconds are there in 7090.285 hours? 25525026000 How many meters are there in 5/8 of a kilometer? 625 What is nineteen quarters of a micrometer in nanometers? 4750 How many millilitres are there in 6/25 of a litre? 240 What is 1/5 of a microgram in nanograms? 200 What is 3/40 of a litre in millilitres? 75 What is 3369.2 centimeters in micrometers? 33692000 How many minutes are there in thirteen ninths of a day? 2080 What is seven halves of a hour in minutes? 210 What is 0.0222337 litres in millilitres? 22.2337 How many nanometers are there in 1/10 of a millimeter? 100000 Convert 45.03336 years to millennia. 0.04503336 What is nineteen quarters of a century in years? 475 What is five sixths of a millennium in months? 10000 How many millimeters are there in seven halves of a centimeter? 35 How many centimeters are there in 3/50 of a kilometer? 6000 How many decades are there in 25/2 of a millennium? 1250 How many micrometers are there in five eighths of a centimeter? 6250 What is 0.2	{ "pile_set_name": "DM Mathematics" }
ird biggest value? (a) s (b) -4 (c) -2 b Let o(a) = 3a - 7. Let u be o(4). Suppose 1150 = 5m - 310. Let n = 3214/11 - m. What is the smallest value in n, 4, u? n Let z = -2/4865 + 20628/973. Let l = z - 104/5. What is the second smallest value in -1/2, l, -4, 4? -1/2 Suppose -3p = -5f - 9 + 4, -5f - 5 = -2p. Let i be -1 - (-3)/((-6)/(-4)). Let g be 1/(i/82). What is the biggest value in g, -1/3, p? g Let r = -1.4 - -1. Which is the second smallest value? (a) r (b) -1/2 (c) 10 a Let j = -3.09 - -3.09. Which is the smallest value? (a) -1 (b) 3 (c) j a Let b = -15 + 21. Suppose 5o - bj = -j, j + 4 = -o. Let s = 0.04 + 0.26. What is the third smallest value in s, 0.2, o? s Let v = -1741/78 - -133/6. What is the second biggest value in 5, v, -0.1, -3/4? -0.1 Let d(j) = -11j + 142. Let n be d(13). What is the third smallest value in -4, -0.4, n, 34? -0.4 Let t = 22 + -22. Let l = 1.4 + -10.8. Let i = 9 + l. What is the third smallest value in -5, i, t? t Suppose -3861 = 3v - 3w, -1797 = -5v - w - 8208. Let o = 3778/3 + v. Let y = o + 24. Which is the third smallest value? (a) 4 (b) -4 (c) y a Suppose -2n + 50 = -4g, 40 = -2g - 11n + 7n. Which is the second biggest value? (a) 4 (b) g (c) 0.2 c Let o be ((-1)/(-12))/(12/813). Let z = 7/15 - 13/60. Which is the second biggest value? (a) 0.1 (b) z (c) o c Let w = 6.0373 - 0.0373. What is the smallest value in -12, -1/7, w? -12 Let t = -0.37 - 1.91. Let z = -0.28 - t. Let g be -2(2 - 14/6). Which is the third smallest value? (a) z (b) -0.2 (c) g a Suppose -3i - 2 = -8, 0 = 3l - 5i + 10. Let n be 1595/145 + 108/(-10). Which is the second biggest value? (a) l (b) n (c) -1/2 a Let g = -502 - -399. Which is the fourth smallest value? (a) -2 (b) -1/3 (c) 0.2 (d) g c Let q(k) = -k3 + 8k*2 - 9k + 19. Let f be q(7). Let x = 0 + -5. Which is the biggest value? (a) -1 (b) f (c) x b Let f be 5/(-3)((-604)/(-80) + -8). Which is the second smallest value? (a) 1 (b) f (c) -2/3 (d) -24 c Suppose -6m = -m. Let g = -17560 + 105725/6. Let r = g - 61. Which is the second biggest value? (a) m (b) -3 (c) r c Let m = 5.75 - 4.86. What is the smallest value in m, -2/7, 2/7? -2/7 Suppose 0 = 3i + 3z - 27, 0 = i + i + 4z - 28. Which is the smallest value? (a) 0.03 (b) i (c) -1 c Let k = -0.63 - -1.03. What is the second biggest value in k, -3, 0.2, -25? 0.2 Let p = 437 - 427. Which is the biggest value? (a) 1 (b) -2 (c) p c Let g = 4 - 36. Let q = 28 + g. What is the biggest value in 0.1, q, 1? 1 Let w be 14/(-7)((-21)/(-10) + -2). Which is the third smallest value? (a) 2 (b) w (c) 1 (d) 5 a Let t = 345 - 347. What is the third smallest value in t, -48, -0.1, 5? -0.1 Let v = 1.5 - 1.2. Let k = -163 - -1469/9. Which is the second smallest value? (a) v (b) -5 (c) k c Let s be (-16 + -2)/3 - -9. Let c = -5.06 + 0.06. What is the biggest value in 3/5, c, s? s Let n(m) = -5m - 14. Let y be n(-6). Let f = 0.3 + 0. Which is the second smallest value? (a) f (b) y (c) -2 (d) -0.1 d Let l = -0.5 - -2.5. Let v = 1.97 - l. Let a = v - -0.03. What is the second biggest value in a, -2/5, -2? -2/5 Let n = -16055/36 + 1783/4. Which is the second biggest value? (a) -6 (b) 1 (c) 4 (d) n b Let h = 12 + -6. Let m = h - -11. Let j = -13 + m. Which is the second smallest value? (a) j (b) -3/2 (c) -3 b Let k = 8 - 12. Let b be (-4 + 1)(-14 - -13). Suppose bj = -2 - 1. What is the second smallest value in j, k, -3? -3 Let b = 2/2383 - 30989/11915. What is the third biggest value in -0.2, b, 2, -2/3? -2/3 Let r be (-3 - 1) + 620/(-1050)-7. Let p = -12 - -7. Which is the biggest value? (a) r (b) p (c) 0.5 c Let n be (-4)/(-3)(9 - 136/16). What is the smallest value in -3, -0.4, -6, n? -6 Let r = -0.5 + -5.9. Let p = 6.7 + r. Which is the second smallest value? (a) -1/3 (b) p (c) 2 b Let w = -17 + 30. Let s = 10 - w. Let n = 50.97 + -51. What is the third smallest value in 5, n, s? 5 Let u = 225 - 224.7. Which is the biggest value? (a) u (b) 0.01 (c) -4 a Let f = 57.25 - 57.75. Let i = 0.5 - -3.5. Which is the smallest value? (a) i (b) f (c) -2/19 b Let p(v) = -6 + 3 + v - 7. Let x be -4((-5)/(-4) - 3). Let h be p(x). Which is the second smallest value? (a) 0.5 (b) h (c) 5 a Let v = 4.36 - 3.86. Which is the smallest value? (a) v (b) -1/94 (c) -1/4 c Let b = 0.16 - -16.84. Let f = -12 + b. Let l = 22 - 19. What is the smallest value in f, -4, l? -4 Let x = 2/2663 + -2669/7989. Let p = 71/85 + -4/17. What is the second smallest value in p, -0.05, x? -0.05 Let i = 22 - 22.74. Let g = i - -1.04. Let d be 26/(-40) + (-1)/(-4). What is the second biggest value in d, g, 1? g Let s = 110 + -107.91. Let v = s + -0.09. Let w = -41 - -40.7. What is the biggest value in 5, w, v? 5 Let p = -34 + 7. Let b = -26.5 - p. What is the smallest value in 0.1, b, 0? 0 Let k = 7 - 6. Let w = 1.9 + 0.1. Which is the smallest value? (a) w (b) k (c) -0.5 c Let k = 0.15 + -16.15. Let f = k - -21. Let m = 3.97 + 0.03. Which is the third smallest value? (a) f (b) 1/4 (c) m a Let p = -16.36 + 16.76. What is the third biggest value in 50, 5, p? p Let s be 0/3 + (-118)/(-205). Let f = -1/41 - s. Let v = -13/8 - -83/56. Which is the third biggest value? (a) v (b) 0.4 (c) f c Let k be (0 - 12)3/9. Let r = 15 - 14. What is the biggest value in r, k, 1/7, 0.1? r Let c = 1.6 + -1.19. Let m = c - 0.71. What is the biggest value in m, 3/4, 1.3? 1.3 Let n(g) = 12g*3 - 6g + 3. Let l be n(2). Let j = l - 85. What is the third smallest value in 2/7, j, -2? j Let t = -80.06 + 80. Which is the second smallest value? (a) -0.5 (b) t (c) -4 (d) -0.3 a Let o = 485 + -489. What is the second biggest value in 0.2, o, -1, 2/3? 0.2 Let w be 0/(((-32)/(-80))/(2/(-10))). Which is the third biggest value? (a) -1 (b) 3/5 (c) w a Let x = 0.106 - 2.846. Let d = x + 0.24. Let l = d - -2.7. Which is the third smallest value? (a) -0.4 (b) l (c) -2/3 b Let q = 25.2 - 24.8. Which is the fourth smallest value? (a) q (b) -3 (c) 3/2 (d) -2/13 c Let m = -1.44 + 0.44. Let w = 0.2 + 0.1. Let i = w - 0.8. What is the second biggest value in 4, m, i? i Let t = -497 - -493. Which is the second biggest value? (a) -2/17 (b) t (c) 0.288 a Suppose -3v + 3 = -0v. Let s be v/(3/(12/(-164))). Let c = 77/205 - s. What is the second smallest value in -4, -5, c? -4 Let f = 10434.041 + -10439. Let a = 0.041 - f. What is the third biggest value in a, 0.5, -0.3, 1? 0.5 Let w(r) = r*3 + 2r*2 + r - 10. Let b be w(-2). What is the third biggest value in -2/11, b, 0.3? b Let t = 23 + -27. Let u be (-16)/10 + -3 - t. Which is the third smallest value? (a) 2/13 (b) u (c) -2/7 a Let d = 119.6 + -186.56. Let m = 67 + d. What is the fourth smallest value in m, -2/3, 0.1, -3? 0.1 Let u = 15.4 - 7. Let p = -24 + 16. Let s = u + p. Which is the second smallest value? (a) -0.1 (b) -0.3 (c) s a Let y = 37/6 - 59/10. Which is the third smallest value? (a) 0.2 (b) y (c) 2 c Let x = -211 + 211.14. Let h = -18.46 + 21.6. Let r = h - x. Which is the biggest value? (a) r (b) 1/2 (c) 5 c Let a be -2 - (24/(-13) + 0). Let v be ((-6)/(-9))/(17/(408/(-64))). What is the smallest value in v, -2/5, a, -11/4? -11/4 Suppose 0 = -2452y + 2448y + 4. Which is the fourth smallest value? (a) -0.07 (b) -4/11 (c) 4 (d) y c Suppose 11j + 6 = 17j. What is the smallest value in j, 0.15, -10, 0.1? -10 Suppose 2 + 4 = -j. Let m = 83 - 83.1. What is the fourth smallest value in -3, 1, j, m? 1 Let k = -35.044 + 0.044. Let f = k - -30. What is the biggest value in 2, 11, f? 11 Suppose -18 = 83p - 89p. Let j = 3 + -3.2. Suppose -5u + 4o - 14 = 3, 3u - 3o + 12 = 0. What is the second biggest value in u, p, j? j Let y = -49 + 49.5. Suppose -2h = -0h. Let w be -1 + h + -1 - -5. Which is the third biggest value? (a) w (b) y (c) -5 c Let d = 181560386235395/20472 - 8868717575. Let t = d - -4/853. Let j = -21/8 + t. What is the second smallest value in j, 5, 0? 0 Let r = -0.148 - 0.352. Let x(y) = -y2 + 3y + 3. Let v be x(3). Which is the third smallest value? (a) v (b) r (c) -0.08 a Let r = -516 - -519. Which is the fourth smallest value? (a) 15 (b) -2/11 (c) -3 (d) r a Let p = -0.9 - -1.	{ "pile_set_name": "DM Mathematics" }
and 78. 6 Calculate the highest common factor of 2967084 and 6620. 1324 What is the highest common factor of 2671780 and 128928? 316 Calculate the highest common factor of 110789040 and 1296. 48 Calculate the highest common factor of 255671 and 2956421. 3601 Calculate the greatest common factor of 4227 and 42429. 3 Calculate the highest common divisor of 3626 and 476834. 2 What is the greatest common factor of 28054 and 4087252? 2158 Calculate the highest common factor of 237146 and 55302. 26 What is the highest common factor of 5715 and 135090? 45 What is the highest common divisor of 943590350 and 1425? 475 What is the highest common divisor of 173448 and 6336? 792 What is the greatest common factor of 1914295 and 28809? 97 What is the highest common divisor of 55 and 26501365? 55 Calculate the greatest common factor of 6235 and 5931979. 1247 What is the greatest common divisor of 2023 and 141281? 7 Calculate the highest common divisor of 58788 and 77916456. 828 Calculate the greatest common divisor of 1020 and 435794490. 510 What is the greatest common divisor of 3120 and 7962006? 78 What is the greatest common factor of 10290650 and 2610? 290 What is the highest common factor of 1540219 and 13559269? 8903 Calculate the greatest common divisor of 309995 and 6895. 35 What is the greatest common factor of 117951 and 66? 3 Calculate the greatest common divisor of 3099 and 34751153. 1033 Calculate the greatest common factor of 886262 and 146. 2 Calculate the highest common divisor of 63580 and 1613249. 187 What is the highest common factor of 83246968 and 18232? 344 What is the greatest common factor of 19468 and 12733956? 628 What is the highest common factor of 13749429 and 79253? 1933 Calculate the greatest common factor of 3937 and 3070987. 127 What is the highest common factor of 13224 and 1925832? 696 Calculate the highest common divisor of 30003750 and 27432. 6858 What is the highest common divisor of 128 and 10733728? 32 Calculate the highest common divisor of 270 and 12492915. 15 Calculate the greatest common divisor of 2075856 and 16992. 2832 Calculate the greatest common divisor of 4920 and 321528. 24 What is the highest common divisor of 55042 and 193778? 754 Calculate the greatest common factor of 26122940 and 4. 4 Calculate the greatest common divisor of 129114 and 1365261. 2391 What is the highest common divisor of 59081940 and 207000? 4140 What is the highest common factor of 142 and 234365746? 142 What is the highest common divisor of 22168656 and 252? 36 Calculate the greatest common factor of 2001 and 139548. 87 Calculate the greatest common factor of 847 and 471584069. 121 Calculate the highest common divisor of 12171303 and 663. 51 Calculate the highest common divisor of 1102178 and 295834. 2618 What is the greatest common divisor of 508 and 51913028? 508 What is the highest common factor of 70859 and 1947? 59 What is the highest common factor of 8404448 and 979? 89 What is the highest common divisor of 352 and 9098452? 44 Calculate the greatest common factor of 18666886 and 28. 14 Calculate the greatest common factor of 2898 and 4408203. 69 What is the greatest common divisor of 27298817 and 35? 7 Calculate the greatest common factor of 3091405548 and 14. 14 What is the highest common factor of 28 and 31103732? 4 Calculate the highest common factor of 2356 and 7022647. 589 What is the highest common factor of 84071402 and 41? 41 What is the greatest common divisor of 1624 and 81527152? 56 Calculate the highest common divisor of 599288 and 740968. 184 What is the highest common factor of 648 and 495624? 24 Calculate the greatest common divisor of 243478476 and 699. 699 Calculate the greatest common factor of 6493986 and 24582. 1446 What is the greatest common divisor of 1287 and 369165225? 429 Calculate the highest common factor of 1499341 and 869. 79 What is the highest common divisor of 51373 and 1631406? 1253 Calculate the highest common factor of 8 and 3504370. 2 What is the highest common factor of 3719316 and 1082412? 3372 Calculate the greatest common factor of 269475236 and 16. 4 Calculate the greatest common factor of 12955891 and 2717. 247 What is the greatest common divisor of 17893 and 178147? 29 What is the greatest common factor of 96 and 862644? 12 Calculate the highest common factor of 847633 and 279. 31 What is the greatest common factor of 535711 and 3131? 31 Calculate the highest common factor of 949222 and 163242. 6046 What is the greatest common divisor of 4439489 and 12403? 157 What is the highest common divisor of 1458 and 566757? 81 What is the greatest common factor of 1598 and 121133194? 1598 Calculate the greatest common divisor of 507 and 30033328. 169 What is the greatest common divisor of 14048 and 5831237? 439 What is the greatest common divisor of 717 and 994957? 239 Calculate the greatest common divisor of 95224618 and 86. 86 Calculate the highest common factor of 21 and 300973533. 21 What is the greatest common factor of 51 and 837641? 17 Calculate the greatest common factor of 24 and 488637696. 24 Calculate the greatest common divisor of 9468 and 1258396614. 4734 What is the greatest common factor of 533849 and 218051? 7519 What is the greatest common divisor of 81 and 1079334? 9 Calculate the highest common factor of 41260710 and 30. 30 What is the highest common factor of 621 and 247155516? 621 Calculate the greatest common divisor of 12912220 and 310. 10 What is the highest common factor of 7751 and 1079666? 23 Calculate the highest common factor of 24318 and 4741002. 126 What is the highest common factor of 29665 and 1050345? 85 Calculate the highest common factor of 897 and 1136109. 39 What is the highest common divisor of 210121 and 133? 19 Calculate the highest common factor of 987432823 and 3901. 3901 Calculate the greatest common factor of 108 and 204548. 4 Calculate the greatest common divisor of 360522033 and 2883. 2883 Calculate the greatest common divisor of 1320 and 218855280. 120 What is the highest common factor of 2386 and 318416472? 2386 What is the greatest common divisor of 665595 and 225? 45 What is the greatest common factor of 4388 and 140560? 4 Calculate the highest common factor of 18 and 357588342. 18 Calculate the greatest common divisor of 6557 and 166498. 83 Calculate the greatest common divisor of 3216893 and 153. 17 Calculate the greatest common divisor of 1654139 and 7697. 179 Calculate the greatest common factor of 944 and 30256144. 944 What is the highest common factor of 7139 and 15499? 11 Calculate the highest common factor of 13534 and 6903451. 101 Calculate the highest common divisor of 392 and 37595446. 98 What is the highest common factor of 121905 and 324765? 315 Calculate the highest common factor of 1537 and 175460846. 1537 Calculate the highest common divisor of 546 and 3629821. 13 Calculate the greatest common factor of 461779560 and 3960. 3960 What is the highest common divisor of 293275 and 1550? 25 Calculate the highest common divisor of 3818 and 2130122. 46 What is the highest common divisor of 85407904 and 386? 386 What is the greatest common divisor of 78270358 and 3076? 1538 Calculate the greatest common divisor of 57 and 15699795. 57 What is the highest common factor of 736720 and 1780? 20 What is the highest common factor of 1970651 and 1784? 223 Calculate the highest common divisor of 1131 and 5811143. 13 Calculate the greatest common divisor of 3822 and 2621697. 39 What is the highest common divisor of 2648359895 and 12470? 6235 Calculate the highest common divisor of 42040775 and 26950. 1225 What is the highest common factor of 12 and 31085322? 6 Calculate the highest common divisor of 234112164 and 572. 572 Calculate the greatest common factor of 255069 and 2613. 201 Calculate the greatest common divisor of 37 and 972915. 37 What is the greatest common factor of 416934796 and 148? 148 Calculate the highest common divisor of 48160 and 2311890. 70 What is the greatest common divisor of 1037 and 1660526? 17 Calculate the highest common factor of 63797481 and 40392. 1683 What is the highest common factor of 19280475 and 28575? 225 Calculate the highest common factor of 84522240 and 2610. 2610 Calculate the greatest common factor of	{ "pile_set_name": "DM Mathematics" }
3, cu + 7 = -4w. Solve 6 = -t + 3t + wg, -g = -4t - 8 for t. -1 Suppose 0 = w + 18 - 31. Let a(f) = -8f + 107. Let j be a(w). Solve -11 = jc - 0c + s, -4c = 2s + 18 for c. -2 Let a = 74207 - 74192. Suppose 4l = -5d + 10, 7 = 2l + 2d + 1. Solve 4f - 24 + 3 = -lj, 5f = 2j - a for j. 5 Suppose 27h + 18h - 550 = -10h. Solve -12x = -hx, 0 = -3z + 4x + 15 for z. 5 Let i = 719 + -232. Let r = 503 - i. Solve 0 = 3l + 4o + 3, -l + 3o - 4 = -r for l. 3 Suppose 1258o = 1297o - 117. Solve h - oh + 3n - 25 = 0, 4n = -h + 15 for h. -5 Let h = 13172 + -13167. Solve -hw - 4y = 27 - 22, y = 4w + 4 for w. -1 Let z = 14 - 10. Suppose -9x - 5 = z. Let k be (x - -1) + (-2)/(-1) + 2. Solve q - 2q - 3b = -5, -4q = -kb - 20 for q. 5 Let k = -26 - -28. Suppose -k = -2y - 0y, 4b - 3y - 13 = 0. Suppose -w + 2 + b = 0. Solve -5f + 3a - 5 = 0, -2f - 3a + wa - 11 = 0 for f. 2 Let o be 0/6 + (-4)/(-1) - -5. Suppose -od - 9d = -468. Solve 2m - 6m + 2h = d, 0 = -5m + 4h - 37 for m. -5 Suppose 70 + 353 + 52 = 95n. Solve 0 = nx + 30, 3x + 14 = 42j - 43j for j. 4 Let t be (106/212)/((-1)/(-12)) + 0 + -5. Solve 4b + t = -3y, 4y + 1 = b + 5y for b. -4 Let o(k) = 2k3 + 7k*2 - 13k + 8. Let u be o(1). Solve -4t - 12 = 2z, -2z + 9t = ut - 24 for z. 2 Let y = -10252 + 10280. Solve y = -4b + 4c, -2b - 5c = -b - 23 for b. -2 Let k(j) be the first derivative of 1/2j*2 + 7j + 13. Let z be k(-3). Solve -22 = zb - 5t, 0 = -3b - 2t - 0t - 5 for b. -3 Suppose 2n - 23n + 1764 = 0. Suppose 17u = -n + 679. Solve 3l - 4t - 3 = 0, 4l + 8t - u = 3t for l. 5 Let w = -3 + 9. Let a be (-79)/(3002/988) + 26. Solve m - 3r + 2r + 1 = a, -4m + 3r - w = 0 for m. -3 Let b be (-1 - 1)(-23 - -22). Let o(j) = 3j - 1. Let m be o(2). Solve mw = d - 5, -5w - bd - 11 - 9 = 0 for w. -2 Let z be (-882)/(-90) + 4/(-5). Solve -2w + 12n - 2 = zn, 4w = -3n + 32 for w. 5 Suppose 231o = 247o + 31 - 223. Solve -5g + 13 = -15m + 13m, 5g = 3m + o for g. 3 Let k(j) = j*3 - 3j*2 - 3j - 4. Let g be k(4). Let a be (-21526)/10 - 7/(-175)-10. Let n = 2158 + a. Solve ns + 12 = w, s = -gw + 4w + 9 for w. -3 Let x(l) = -l*2 - 14l - 46. Let v = 59 - -60. Let d = v - 127. Let n be x(d). Solve s - 6 = ni - 1, 2s - 5i - 10 = 0 for s. 5 Let y(q) = q2 - 18q - 15. Let i be y(11). Let t = i + 172. Let c = t - 78. Solve 4u + 6a - 3a + c = 0, -3a + 6 = 0 for u. -2 Let q be 32/12 + 5 + (30/(-5))/(-18). Solve -2p = -b - 13, -8p + q = -11p - 4b for p. 4 Let c be (2 - (-5)/(-2))/((-2)/12). Solve -v = -c, g + 1 = -3v + 11 for g. 1 Suppose w = -2p - 2p + 6, 6 = p - 2w. Let n(v) = -2v2 + 4v*2 - 6v*2 + 5v + 3vp. Let o be n(4). Solve ol = 4a - 2a + 2, 4a + 14 = 3l for a. -5 Let c = -39 + 39. Let q be (-30)/100 - 198/(-60). Solve 2b + qr + 21 = 0, -4b = -5r - c - 13 for b. -3 Let a(d) be the second derivative of d4/12 + d3 + 8d2 - d - 7. Let p be a(-6). Solve -18 = -2g + 3y, y - p = 5y for g. 3 Let t(g) = 3g3 - 5g*2 + 6g + 7. Let x be t(4). Let u = x - 107. Let c be 362/12 + (8 - 294/u). Solve -4i + 5r = c - 4, -2r = -4 for i. -4 Suppose -46t - 331t + 136t = 335t. Solve t = 3u + 9, 5l + 4u + 33 = -4 for l. -5 Suppose -7c + 10c + 6 = 0, -4 = -3m + 2c. Solve 1 = s - n, ms - 3n + 9 = s for s. 3 Suppose 158z + 86 = 402. Let f(l) = -l3 - l2 + l + 32. Let x be f(0). Solve -5i = -3v + 34, -4v + zi + 2i + x = 0 for v. 3 Let o(w) be the third derivative of -w*4/12 - 11w*3/6 - 6w*2. Let m be o(-7). Suppose -4t - m = -11. Solve -2p - h = -6p - 13, 3h = -tp - 3 for p. -3 Suppose 11o + 18o - 10o = 1083. Solve 3a = -ox + 60x + 15, 0 = -4x - 24 for a. -1 Let r(g) = -3g*3 - 65g*2 + 22g + 2. Let h be r(-22). Solve j - 12o = -9o + 10, ho = -4j - 30 for j. -5 Let r(f) = 7f2 - 29f - 2. Let o(j) = 12j2 - 57j - 5. Let t(l) = -3o(l) + 5r(l). Let s be t(26). Solve 3i + 7 = -2v, -sv = 4i + 6 + 1 for i. -3 Let v be (-75)/(-20)((-38)/(-6) - 5) + -1. Solve -vt - 3q - 19 = 0, 2q + 3 = 1 for t. -4 Let g = 337 - 333. Suppose -4 = 2i, 6i - gi + 4 = -3c. Solve -d + 13 = -3h, c = 2h - 6h + 3d - 14 for h. -5 Let c(r) = -r*2 + 15r + 95. Let l be c(-9). Let x = 126 + l. Solve 3i = xm + 8i, -5i - 20 = 0 for m. 4 Let s be 0/(-2)(-21 + 20). Suppose s = -3i - g - 1 - 4, -10 = -4i + 2g. Solve -2y = -2c + 2, -4y - 3c + 2c + 11 = i for y. 2 Let b(c) = -252c + 4. Let l be b(1). Let m = l - -257. Solve -3u + m = -3s, 5u - 13 - 10 = s for s. 2 Let n(l) = -2l*3 - 41l*2 + 25l + 87. Let t be n(-21). Solve 3d = -a - t, -5d - 5 = 5a - 0a for d. -1 Let q be (3 - 16/6)/(20/180). Let g be (6 + -3)40/3. Suppose 5b + qb = g. Solve 2p - by + 21 = 4p, p - 13 = -3y for p. -2 Let t be (-6)/2 + 375/(-150) + 17/2. Solve 28 = -2c - 5s - 7, -15 = ts for c. -5 Let m be (-6)/4(-30)/9. Suppose -54l + 62 = -23l. Suppose -3j = -5g + 10 - m, -4j - lg = -28. Solve t + 6 = o - 6o, o + 22 = jt for t. 4 Let k be 4 + 212/(-4). Let y be 7/21(-12)/k. Solve n = -2n - 3q + 9, n - yq = 3 for n. 3 Suppose 76j = 434 + 1390. Solve 4s = -2y + j, -5y + 4y = -5s + 23 for s. 5 Let j = -283 + 268. Let k = 19 + -7. Let m be -5(k/j)/2. Solve -2h - 5l + ml - 4 = 0, -5h - 10 = -l for h. -2 Let v(z) = -166z - 2312. Let g be v(-14). Solve l - 7a + 8a + 7 = 0, a + g = -2l for l. -5 Let v = -22 - 8. Let o = v - -32. Suppose 2a - 19 = -5n + 43, on - 26 = -2a. Solve 3s + 3 = -0s - 4j, -3s - n = j for s. -5 Let f be (387/(-215))/(2/(-30)) - -8. Solve 0 = -5q + 3c - f, 3q + c = -2 - 5 for q. -4 Let v be 87/4 - ((-893)/(-76) - 12). Solve 2s + v = -3s - 3t, 0 = 3s + t + 14 for s. -5 Suppose -10n + 24 = -36. Let x(c) = 2c*2 - 5c - 3. Let m be x(-5). Let f be n/15 - m/(-45). Solve -2j = -3l + 5, -fj + l + 7 = 3j for j. 2 Suppose 39g = r + 43g + 15, -13g = 2r + 60. Solve 3l + 4m = -r, 49l + 5m + 18 = 52l for l. 1 Suppose u = 28u - 459. Suppose -a + u = 12. Solve ag + 0 = f - 3, 2f = 4g for f. -2 Let q = 17534 + -17534. Let k(g) = -g. Let b be k(-2). Let j be (1 - 2)-12 - (11 + -11). Solve -2z + 5v - j - b = 0, q = -2v + 4 for z. -2 Suppose 3l + 5 = 4l + 5b, -15 = 3b. Suppose -2u - 2x + 0x = 0, 4u - l = 2x. Solve 0c + 4c - 3k = -u, -4k = -4c - 4 for c. -2 Let j be 7/(147/224) + 6/(-9). Solve -4n = 4c + 7 + 1, -j = -5n for c. -4 Let g = 43 + -39. Suppose -gc + 436 = 4s, c = -5s - 2c + 537. Let x be 5/(-2) + s/30. Solve -d + 2o = 6 + x, -13 = d - 4o for d. -1 Suppose -5d = 7f - 8f - 20, 19 = 3d - 2f. Solve -3r + d = 4x, 5r - 8r + 3 = x for x. 0 Let d(o) = -166o + 2170. Let c be d(13). Solve 3h + 28 = 23l - 19l, -l - c = 4h for h. -4 Let o = 22 + -20. Suppose -2l - 36 = -6l. Suppose -2p = lp. Solve p = -0w + ow + c + 10, -15 = 3w - 4c for w. -5 Let x be (-10)/(640/(-144)) + (-2)/8. Let t be (-11)/((-1)/21). Suppose -xw = -d + t, -4d + 32 = -4w - 36. Solve -2l + d = i, 2l - 5 = 5 for i. 2 Let a(h) be the third derivative of -h4/24 + h3/2 - 13h2. Let b be a(-2). Suppose 0 = bg + 21 - 66. Solve l = d - 3d + g, -l - 3d = -12 for l. 3 Suppose -2l + 10 = -4a, -91l + 89l + 3 = -5a. Solve 2r = 6r - y + l, -4y = 3r for r. -4 Suppose -2 = -2o - 4y, 5o - 27 = 6y - 5y. Suppose ov + 3 = 4w + 8, 5v = -3w + 40. Solve -4g - 4h = -h + 2, 0 = -3g - 4h - v for g. 1 Suppose z - 8 = -3z. Suppose -10419 - 786 = 27a. Let f be (166/a)/(2 - (-132)/(-65)). Solve zi = 3u + f, -2u + 4i + 24 = -6u for u. -5 Let u(r) = r2 - 3r - 3. Let s be u(-1). Suppose -k + 3 - s = 0. Let f = 134 - 131. Solve 2n + kg + 6 = -2n, 9 = fg for n. -3 Let p = -475 - -451. Let g be (3/(-4))/(129/p - -5). Solve -h + 6l = gl, -5h - 4l - 24 = 0 for h. -4 Let r be (-3 - 1)110/(-88). Solve -5d - 25 = 0, 6d + 40 = -rb + 2d for b. -4 Suppose -356 = -4f - 4i, -i = f - 4f + 259. Let d = -87 + f. Solve -5s = -p + 9, -3p - 2s + s - 5 = d for p. -1 Suppose 3b - 2m - 15 = -1, 8b + 3m - 4 = 0. Solve -3s - 5q + 6 = -bq, -5s = 4q - 10 for s. 2 Suppose 3o = -2i, -3i + i = -2o. Let f be 1(20 + 5) - o. Solve -5h + a = -4a - f, -4a = 3*h -	{ "pile_set_name": "DM Mathematics" }
+ 1. Let x be o(1). Let g = -108 - x. What is g rounded to the nearest 10? -80 Let o = -0.2 - -0.3. Let m = -0.096 + o. What is m rounded to three decimal places? 0.004 Let v be -150((-3)/5 + 3). What is v rounded to the nearest 100? -400 Let s = 291239 + -1073239. Round s to the nearest 10000. -780000 Let o be (1/2)/((-4)/293043). Round o to the nearest one hundred. -1200 Let s = -6 + 0. Let m = 5.931 + s. What is m rounded to two dps? -0.07 Suppose -b = -4i - 49260 - 94744, 4i + b + 143996 = 0. Round i to the nearest 10000. -40000 Let h = 14 - 6. Let i = h - 7.99864. What is i rounded to 4 decimal places? 0.0014 Let a = -1317390.1 + 11575253.1. Let l = a + -10257751.00069. Let v = l - 112. What is v rounded to 4 dps? -0.0007 Let l = 2736 + -2452.8. Let x = l + -242. Let o = x - 45. Round o to 0 dps. -4 Let s = -588101 - -283913. Let k = s + -9695812. What is k rounded to the nearest 1000000? -10000000 Let v = 146256 - 146256.76963. Let d = v + 0.77. What is d rounded to 4 dps? 0.0004 Let y = 74.9 + -13.9. Let q = -60.99939 + y. Round q to 4 decimal places. 0.0006 Let v = 0.4938 - -51.9262. Let s = v + -53. What is s rounded to one dp? -0.6 Let l = 0.3679 - -0.0311. Let z = l - 0.39899827. Round z to 7 dps. 0.0000017 Let s = -2 + 2.1. Round s to the nearest integer. 0 Let f = 4258 - 6038. What is f rounded to the nearest 100? -1800 Suppose 0 = -4i + 2f - 34, 0 = i - 4f + 14 + 12. Let b be ((-2)/(-4))/(i/24). Let r be (-3493)/(-14) + (-1)/b. What is r rounded to the nearest 100? 300 Suppose -1235 = -9x + 34. What is x rounded to the nearest 10? 140 Let q = 112 + -241. Let s = 113.3 + q. Let i = s + 15.69911. What is i rounded to four decimal places? -0.0009 Let f = -27 + 17. Let i be -13265/f. Suppose c = -4z - 483, -i = 2z + c + 78. What is z rounded to the nearest ten? -120 Let c = -1951544567 - -1951544476.2555751. Let q = c + 83.744427. Let r = 7 + q. Round r to 6 dps. 0.000002 Let a = 0 + -5. Let t(c) = 3159c - 5. Let b be t(a). Round b to the nearest 1000. -16000 Let c = 0.051 + -0.0554. Round c to 3 dps. -0.004 Let l be (10 + 5)/(3/(-20)). What is l rounded to the nearest one hundred? -100 Let b = 0.1 - 0.08. Let r = 8.98 + b. Let q = 9.00000074 - r. Round q to 7 decimal places. 0.0000007 Let d(b) = -b3 - 5b*2 - 6b - 2. Let o be d(-4). Let y = o + -6. Let f be (y - 2080)(-175)/(-28). Round f to the nearest 10000. -10000 Let u = 9412.1199952 + -9411.12. Let r = 1 - u. What is r rounded to six dps? 0.000005 Let i = 1.3 + -0.7. Let t = i - 0.59992. Round t to 5 dps. 0.00008 Let l = -1 + -1.5. Let a = -2.445 - l. Round a to 2 dps. 0.06 Let k = 100 + -100.000162. Round k to five dps. -0.00016 Let f = -96 - 60. Let g = -170.8 - f. What is g rounded to zero decimal places? -15 Let y = -125.303 - -79.02. Let t = 46 + y. Let n = 11.583 + t. What is n rounded to zero decimal places? 11 Let t = 24565316246 + -24565316202.990318971. Let x = 0.009730029 - t. Let k = -43 - x. What is k rounded to 5 decimal places? -0.00005 Let f be -2(1 + (-82503 - -3)). Suppose -2b - 110002 = -d, -3b + d - f = 2d. What is b rounded to the nearest 10000? -60000 Let m = 4449521641169959 + -4449521623125604.21500129. Let h = m + -18044540.785. Let c = 186 + h. What is c rounded to seven decimal places? -0.0000013 Let h = -1.87 - -1.87000128. Round h to seven decimal places. 0.0000013 Let r = 508 - -21849. Let q = r - 22358.3331. Let b = -1.34 - q. What is b rounded to 3 dps? -0.007 Let n = -0.6188 + -241.8012. Let f = 238 + n. Let j = f - -4. Round j to one dp. -0.4 Let q = -1.45 + -12.75. Let c = q - 119.8. Let i = c + 133.47. Round i to one decimal place. -0.5 Let h = -39924802 - -39924750.000071. Let i = 8.9 - 60.9. Let f = h - i. Round f to 5 dps. 0.00007 Let o = 55 + -29. Let l = -13 - o. Let q = l - -38.9999977. Round q to 6 dps. -0.000002 Suppose 0 = 2z - 1443015 + 38671. Suppose -7302172 = -2s - z. Let o be s + -2 + 0 - -2. What is o rounded to the nearest 1000000? 3000000 Let j = 10 + -10.09. Let s = j + 0.37. Round s to one decimal place. 0.3 Let m = -1.3 + 1.32. Let b = 0.020008 - m. What is b rounded to five dps? 0.00001 Let o = -7 - -9. Suppose -5a + 3f - 159988 = 0, -3a - 2a - 160008 = of. Round a to the nearest 10000. -30000 Let t be (-3)/(-12) - 28002/8. Let f be (t/(-3))/(4/12). What is f rounded to the nearest one thousand? 4000 Let d = 398.99999807 + -399. Round d to 7 dps. -0.0000019 Let p(g) = 7999999g2 + 2g + 1. Let j be p(3). Suppose l + 2b = -4l + j, -3l + 43200002 = -2b. What is l rounded to the nearest 1000000? 14000000 Let q = -0.32 + -1.78. What is q rounded to one decimal place? -2.1 Let m = -2.01 - -0.01. Let u = -2.00000003 - m. Round u to seven dps. 0 Let u = 301.3 + -281. Let z = 82.7 + u. Let h = z - 101.98. Round h to one decimal place. 1 Let t = -0.524362 + 0.754379. Let m = 0.23 - t. Round m to 5 dps. -0.00002 Let r = -241 - -241.0143. Round r to 2 dps. 0.01 Let z = -12 - -20. Let s = -8.00048 + z. Round s to four decimal places. -0.0005 Let l = 35897 - 35868.194. Let z = -29 + l. What is z rounded to 2 dps? -0.19 Let u be (0 - 0)/(6/(-2)). Suppose 3o - 2o + 3970 = u. Let j = -2320 - o. What is j rounded to the nearest one hundred? 1700 Let b = -1.2 + 1.1956. What is b rounded to 3 dps? -0.004 Let g(r) be the first derivative of 4r2 - 4r + 3. Let y be g(5). Suppose -5z + y = 241. Round z to the nearest ten. -40 Suppose 4j + 159 = 7j. Let g = j - 38. What is g rounded to the nearest ten? 20 Let v(t) = -1401t - 6. Let f(u) = u*3 + 4u*2 - 5u - 6. Let s be f(-5). Let c be v(s). What is c rounded to the nearest one thousand? 8000 Let i be (40/(-6))/((-4)/66). What is i rounded to the nearest 10? 110 Let d = -15 + 19. Suppose di - 1459 = 101. What is i rounded to the nearest one hundred? 400 Let p = -206225312.7867304 - -206225164. Let w = -0.2033696 + p. Let r = -149 - w. What is r rounded to three dps? -0.01 Let n = 178 + -108. Let w = n - 69.9843. Round w to 3 decimal places. 0.016 Let l = 25340 - 25273.057. Let z = 10 + -77. Let g = z + l. Round g to two dps. -0.06 Let y = -1583.383 - -1585. Let a = -1.6 + y. Round a to two dps. 0.02 Let b = -0.28 + 1.12. Let c = b + 14.36. Round c to 0 dps. 15 Let z(q) = 699q*2 + 32q + 40. Let t be z(-20). Round t to the nearest 10000. 280000 Let t = 51 - 50.08. Let i = 46.92 - t. Let x = i - 46.000027. What is x rounded to 5 decimal places? -0.00003 Let n = -0.39 - -1.68. Let v = -1.4 + n. Round v to one decimal place. -0.1 Let n = -38 + 23. Let s = n - -20.7. Round s to 0 dps. 6 Let y = -1 - 5. Let c(j) = -1736j3 - 4j. Let k be c(-6). Let i be (0 - (-136)/y)k. What is i rounded to the nearest one million? -9000000 Let z = -19092 - -38176. Suppose -3o = 3a + 33009, 3a = 2o + z + 2907. Round o to the nearest 10000. -10000 Let q = 0.619 - 0.265. Round q to 2 dps. 0.35 Let b = -55 - -237. Let j = b + -182.0000154. What is j rounded to 6 decimal places? -0.000015 Suppose -j + 3j = 6. Let p be 2160002/9 + 8/(-36). Let t be 50/(j/p-1). What is t rounded to the nearest 1000000? -4000000 Let s(u) = -8u*2 - 15u - 23. Let d(k) = -3k2 - 5k - 8. Let w(b) = -11d(b) + 4s(b). Let y be w(6). Suppose -yv + 180 = 40. Round v to the nearest 100. 100 Let m = -375.59 - -350.58989. Let f = m + 25. What is f rounded to 4 dps? -0.0001 Let v = 96 - 68. Let b = 24.4 - v. Round b to zero decimal places. -4 Suppose -15 = -6o + o. Suppose -4q - 200317 = oh, h + 3 = -0h. Let k = q - -31077. Round k to the nearest 10000. -20000 Suppose -4i + 13 = 3s, 6i - 46 = 3i + 5s. Suppose -3 - i = -5o. Suppose -oa + 109 = -3a. Round a to the nearest ten. -110 Let w = 5 + -5.00000022. Round w to seven decimal places. -0.0000002 Let n = -189.7 - -202. Let u = n - 12.299889. Round u to 5 decimal places. 0.00011 Let t(d) = -d3 + 13d*2 + 3d - 15. Let w be t(13). Suppose b - 5b = w. Let j(s) = -4s - 1. Let l be j(b). Round l to the nearest 10. 20 Suppose 4h + 0h - 12000 = 0. Let f be (-2 + -12)1h. What is f rounded to the nearest ten thousand? -40000 Let l = 0.0365 - 76.4365. Let y = l + 98. Let w = y - 21.5999903. What is w rounded to six decimal places? 0.00001 Let z = 6 + -4. Let q = z - 48. Let h = q - -43.9. Round h to 0 dps. -2 Let y = 12	{ "pile_set_name": "DM Mathematics" }
16 divide v? True Suppose -2u - 3u + 675 = 0. Suppose -7f + 2p = -4f - 52, -3f - 2p + 68 = 0. Suppose -u + f = -5j. Does 6 divide j? False Suppose 0 = 2l + 283 + 481. Let i = 467 + l. Is i a multiple of 16? False Let f be -3 - 7/((-35)/15). Suppose -5j + fj = j. Does 5 divide 133 + j + 1 + (-12 - -15)? False Does 26 divide 687 + 0 - ((-6 + 3 - -6) + -3)? False Let n(l) = l3 - 7l*2 - 9. Let m be n(7). Does 28 divide 131/(-2)-14 + m? False Let v = 4485 - -2498. Does 120 divide v? False Let m = 5864 + 20840. Does 13 divide m? False Suppose 113k - 105101 - 204470 = -41987. Is k a multiple of 32? True Suppose 4z + 4g - 44 + 8 = 0, -z + 9 = 5g. Suppose 0 = zo - 1450 + 361. Is 9 a factor of o? False Let q be (-5498)/(-8) + 29/(-116). Let n = 1227 - q. Does 41 divide n? False Let f = 50 + -54. Let c be (-1)/4 + (-201)/f + -1. Let p = c - 38. Is 3 a factor of p? False Suppose -28 = -4f - o + 4o, f + 3o = 22. Does 21 divide (-73)/(-3) + 15/(225/f)? False Suppose -3z - 38603 = -5v + 13569, -4v + 3z + 41734 = 0. Is v a multiple of 9? False Suppose -3x + 7 = 2u - 0, -6 = -u + x. Is 7 a factor of 16/20 + 3126/u? False Suppose 0 = -4f + 7f + 11160. Let z be (-310/(-18))/(70/252). Is f/36z/(-4) a multiple of 11? False Suppose 0 = -8h + 9h - 4q - 15895, 0 = 3h - 5q - 47720. Is h a multiple of 11? False Suppose 86 = c + 3b, b + 161 = 4c - 118. Suppose 5t = -321 + 66. Let n = t + c. Is 10 a factor of n? True Let a(x) = -x*3 - 4x*2 - 6x + 2. Suppose 9d - 612 = -0d. Let r = 65 - d. Does 11 divide a(r)? True Let o = 566 - -933. Let i = 2675 - o. Does 49 divide i? True Let p(w) = w*2 + 10w + 2. Let k(y) = -3y2 - 20y - 3. Let z(d) = -2k(d) - 5p(d). Let i be (51/6)/((-1)/(-2)). Does 18 divide z(i)? False Let r = -9631 + 18423. Is r a multiple of 28? True Suppose -39 = 5a - 259. Suppose -3d - a + 140 = 0. Is d - 36 - 1/((-2)/284) a multiple of 34? False Let h(n) = 107n - 453. Is h(24) a multiple of 15? True Suppose 140 = -4y + 292. Is 27 a factor of y1 - (4 + -4)/2? False Suppose 0 = 5l - 27v + 30v - 55527, -4l + v = -44442. Is l a multiple of 95? False Let d be (-489)/(-7) + 0 + (-212)/(-1484). Suppose -dq + 64q = -1410. Is 22 a factor of q? False Let z be 2 - (671 + 2 - -4). Let b = 247 + z. Let x = -239 - b. Does 9 divide x? True Suppose -7m = -4m - 6. Suppose 0l - 42 = ml. Let t = 34 + l. Is 10 a factor of t? False Let b = -1452 + 10102. Is 23 a factor of b? False Suppose 1 = -q, -m - 3q = -3m + 1923. Suppose 0 = b + 5, -3f - m = -6f + 3b. Is 63 a factor of f? True Let w(f) = f*3 - 13f*2 - 15f + 11. Let y be w(14). Let g be -1 + y/(-5) + 66/165. Suppose g = -6s + 304 + 320. Is 26 a factor of s? True Let l = -13949 - -21845. Does 141 divide l? True Suppose -7y + 5y = 12. Let u = y + 24. Let i = u - -36. Does 9 divide i? True Let i(u) = 63u*2 - 35u - 1073. Is i(-16) a multiple of 45? True Suppose -2k + 9 = -j - 44, 0 = -k - 3j + 44. Does 32 divide 64/(147/k + -5)? True Is 102/2907 + (-32142)/(-171) a multiple of 5? False Let h(i) = 72i2 - 168i + 132. Is 79 a factor of h(22)? True Let z = 14807 - 810. Is 30 a factor of z? False Let v = -403 - -1244. Let z = v + -238. Is z a multiple of 28? False Let r = 26308 + -11220. Is 82 a factor of r? True Let n(y) be the third derivative of -y5/60 + y4/8 + 11y3/6 + 63y*2. Is n(3) even? False Let v(g) = 3g*2 + 95g - 740. Does 62 divide v(-56)? True Suppose 4v + 36 = 3s, 3s + 0v + 4v - 12 = 0. Let a(o) = 3o*3 - 23o + 19o - 4o*3 - s + 7o*2. Is a(5) a multiple of 14? False Suppose -6s - 3 = -9. Does 4 divide ((-195)/10 + -10)/(s/(-2))? False Let n(x) = -5x2 - 15x - 2. Let o be n(-7). Let k = 259 + o. Is 29 a factor of k? False Let g = 31320 + -21893. Is g a multiple of 11? True Let c = -85 - 287. Let u = -332 - c. Is 5 a factor of u? True Let j(g) = 2g3 + 12g*2 - 19g + 8. Is 3 a factor of j(-5)? True Suppose 18k - 84809 - 414151 = 0. Is k a multiple of 72? True Let s = 3712 + -3752. Suppose 3m - 122 = 4m. Let w = s - m. Is 41 a factor of w? True Suppose -3h + 40 = -5f, 0f + 5h = 3f + 8. Let d(t) = t*2 + 7t + 12. Let p be d(f). Suppose -129 - p = -5m. Does 7 divide m? False Let v(n) = n3 + 5n*2 - 5n + 10. Let q be v(-6). Suppose qg + 1 = 21. Suppose 4k - gw - 224 = -w, -2k + 4w + 112 = 0. Is 13 a factor of k? False Suppose -5f + 25 = -2v, -4f + 5v = -34 - 3. Suppose -h + 30 + 35 = -5k, fh - 5k = 245. Does 30 divide h? True Let y(p) = p*3 + 7p*2 - 11p - 14. Suppose 112 = -3h - 2z, -3z + 96 = -4h - 42. Let f be -6 - ((-4)/(-5) - h/(-45)). Is y(f) a multiple of 17? False Let r be (-1)/(-6) - (7 + 7592/48). Suppose 5d = -0w - 5w - 570, -4d + w = 471. Let b = d - r. Is b a multiple of 3? True Let s(u) = 6u2 + 182u - 862. Is 25 a factor of s(-42)? False Let d(n) = -23n3 - 10n*2 - 24n + 19. Is 19 a factor of d(-5)? False Suppose 11l - 1167 = 406. Is 3 a factor of l? False Suppose 0 = -f + 5f - 8. Let a(z) = 17z2 - 2. Let j be a(f). Suppose j = 3v - 174. Is 8 a factor of v? True Suppose 5w = -3f + 1950, -2w + 552 = -4f - 228. Is w a multiple of 11? False Suppose 2x = -8, 64 = -2z - 2z + x. Is 23 a factor of (183/9)/(z/(-153))? False Let w = 94 + -181. Let s = -85 - w. Suppose 0 = 4k - sk - 42. Does 10 divide k? False Suppose 0 = -118m + 154978 + 949502. Does 12 divide m? True Suppose -2j - 4q = -0j - 22, 3j - 29 = -5q. Suppose 2y - 2w = -0w + 146, jy - 2w = 219. Suppose -68c - 160 = -yc. Is 8 a factor of c? True Suppose -2j = -2o + 816, -j = -6j - o - 2052. Is (66(-7)/(-105))/((-2)/j) a multiple of 41? True Let h be -37 + 40 + (-1 - -1). Suppose -hv + 2056 = 322. Is v a multiple of 25? False Suppose -3g = -2g - 3. Suppose -gm - 4n = n - 45, 0 = -4n. Suppose mb = 11b + 644. Is b a multiple of 35? False Let k(p) be the third derivative of 2p4 - 3p*3 - 8p*2. Let l be k(-3). Does 25 divide 2/(-9) - 24336/l? True Let a be (-4610)/14 - 2/(-7). Suppose 0l - 2l = -1138. Let w = l + a. Is w a multiple of 24? True Let n(h) = -h3 - 20h*2 + 78h - 48. Does 58 divide n(-30)? True Is 34 a factor of 7 - -9304 - 245/(-49)? True Suppose 4m + 4f = -1248, 0 = -3m + f - 683 - 273. Let c = m - -382. Is c a multiple of 13? True Let z(u) = u2 - 9u - 68. Let t be z(-5). Suppose -5n + 2n = -30. Suppose tj - 298 + n = 0. Is 12 a factor of j? True Is 9 a factor of ((-2886)/444)/(3/(-7830))? True Let p(r) = 1369r*3 - 11r + 26. Is 44 a factor of p(2)? True Is (94/(-6))/((-88)/32208) a multiple of 61? True Let b(k) be the first derivative of 1/4k4 - 6 + 5k + 1/3k3 - 5/2k*2. Is b(2) a multiple of 4? False Is ((24/14)/1)/((-63)/25955496-56) a multiple of 7? False Let g = 2078 + -1384. Suppose -g = 13o - 2319. Is o a multiple of 12? False Let k be ((-24)/15)/((-4)/20). Let z(g) = 38g + 45. Does 23 divide z(k)? False Suppose -3s = 4o - 20, 0s + o = 3s - 10. Suppose sy + y = 2340. Is y a multiple of 36? True Let u(m) = m3 + 12m*2 - 8m + 6. Let n(z) = z*3 + 4z*2 - 3z - 1. Let t be n(-5). Let d be u(t). Let s = d + -82. Is 22 a factor of s? False Let p = 1 - -2. Suppose f = pf - 42. Suppose -43 - f = -4o. Does 8 divide o? True Let w = -5683 - -5929. Is w a multiple of 3? True Suppose 21 = 5c + 4u, 2c + 2c - 2u = 22. Suppose -4w + 3r = -2441, w - 120 - 503 = cr. Does 16 divide w? True Suppose -5v - 61838 = -2s - 8v, -4v = 3s - 92755. Is s a multiple of 11? False Let y = -78 + 30. Let n = y - -52. Suppose 4x = -nu + 120 + 644, u + 2x - 190 = 0. Does 13 divide u? False Suppose 5n + 2l = -2, 2 = -3n + 4n - 2l. Suppose n = 7y - 854 + 105. Is y a multiple of 28? False Let h be -3 + 1 + (-5 - -665). Suppose -4y + h = 10y. Does 9 divide y? False Suppose 267236 + 77694 = 364a + 12962. Does 8 divide a? True Let p(a) = 2a*3 + 17a*2 + 9a + 10. Let l be p(-8). Suppose -2m + 5s + 849 = 0, 4m - ls - 839 = 883. Is m a multiple of 20? False Let l be 1 + 3 + (-9)/((-72)/1408). Let x = -120 + l. Is 7 a factor of x? False Let w(r) = 4r2 - 388r + 773. Is w(97) a multiple of 44? False Suppose 5g = 3g - 8150. Is ((-5)/(-25))/((-5)/g) a multiple of 27? False Let h be 5 + ((-5)/5 - -166). Sup	{ "pile_set_name": "DM Mathematics" }
+ 4f - 16. Calculate the remainder when m(-6) is divided by 40. 28 Let j(k) = k2 + 2k + 7. Let p be j(-6). Let w = 41 - p. Calculate the remainder when 57 is divided by w. 7 Let g(s) = s*3 + 12s*2 + 11s - 4. Let h be g(-11). What is the remainder when 76 is divided by (h - -3) + 28 + -1? 24 Let m = 490 + -457. Let i be (8/(-12))/(2/(-9)). Suppose -iw + 14 = 5t - 67, -4t + 75 = -w. What is the remainder when m is divided by t? 15 Calculate the remainder when 0 + -183(-5)/15 is divided by 3. 1 Let f(c) = 5c2 + 3c - 2. Let p(l) = -9l2 + 3l. Let z be p(2). Let x = z + 42. Calculate the remainder when f(-3) is divided by x. 10 Let l be 114/2137. Let s(a) = 13a3 + a2 - 3a + 2. Calculate the remainder when l/(-4)4/(-3) is divided by s(1). 12 Let w = 27 + -23. Suppose -5a + 28 = -wu - 72, 5a + 2u = 70. What is the remainder when a is divided by 10? 6 Let g be (-6)/(-3)-1 - -6. Suppose -1 - 125 = -3s. What is the remainder when s/8 + (-1)/g is divided by 2? 1 Suppose 4h - 3m - 483 = 1871, 4m + 1762 = 3h. What is the remainder when h is divided by 16? 14 Suppose 0 = n + 2q - 35, 4n + 4q - 166 + 42 = 0. Calculate the remainder when 49 is divided by n. 22 Let z be (1/3)/(5/30). Suppose -4y = 16, 0 = 3s + s - zy - 100. Let d = -14 - -80. What is the remainder when d is divided by s? 20 Suppose -505 = 12z - 17z. Suppose -8l + z = -7l - 4g, -5l = -g - 543. Calculate the remainder when l is divided by 14. 11 Suppose 0g - 5g = -2d + 25, -2d + g = -29. Suppose -6p = -4p + 236. Let n = 177 + p. What is the remainder when n is divided by d? 14 Suppose m = -t + 81, -5m - 3t + 413 = -2t. Calculate the remainder when m is divided by 22. 17 Suppose -2r = 7r - 540. Let w = r - 35. Calculate the remainder when 70 is divided by w. 20 Suppose -57h + 68h = 836. Calculate the remainder when h is divided by 13. 11 Let f(s) = -s*3 - 5s*2 - 2s - 7. Let n be f(-5). Suppose nx + 1 = 19. What is the remainder when 27 is divided by x? 3 Let q = 593 - 582. What is the remainder when 153 is divided by q? 10 Let h(m) = m2 - 23m + 4. What is the remainder when 11 is divided by h(0)? 3 Let a(b) = -b*2 - 3b + 12. Let d be a(5). What is the remainder when (-210)/d16/3 is divided by 7? 5 Let q = 4 + -4. Suppose z + 2p - 113 = 0, -z - 5p - 7 + 117 = q. Suppose 5m - z = -0m. Calculate the remainder when m is divided by 13. 10 Suppose -127 - 53 = -12m. Let s(i) = 16i - 2i + 4 - 3. What is the remainder when s(2) is divided by m? 14 Let f(x) = x. Let m(y) = -5y2 + 4y + 2. Let a(c) = 3f(c) - m(c). Let u = 74 + -44. What is the remainder when u is divided by a(2)? 14 Let m(d) = 8d*3 - 136d2 + 10. Let p(h) be the third derivative of h5/60 - h*4/8 - 7h3/6 + h2. What is the remainder when m(17) is divided by p(5)? 1 Suppose -2 = 3n + 7, 0 = 3r + n + 6. Calculate the remainder when 17 + -20 - 1/((-1)/91) is divided by 19 + (-1)/r + -2. 16 Let n be (-4)/36/(-4). Suppose 7d = nd + 130. What is the remainder when (16/(-20) - -5)/(12/140) is divided by d? 23 What is the remainder when (-210)/8(-324)/243 is divided by 9? 8 Let z(s) = 9s - 9. Suppose -6f + 2f + 396 = 0. Suppose 5p - 3i = i + f, 0 = -p - 4i + 39. Calculate the remainder when z(11) is divided by p. 21 Let x(p) = p + 4. Let t be x(5). Suppose 3h + 28 = k, 0 = k + h - t - 7. Let f = 2 + 34. What is the remainder when f is divided by k? 17 Let o(q) = -q2 - 3q + 12. Let z be o(-5). Suppose -zl - 16 = -6l. What is the remainder when 17 is divided by l? 1 Let z = 65 + -59. Suppose zf - 10f + 572 = 0. Calculate the remainder when f is divided by 18. 17 Suppose l = -5j + 35, -2l = 4j - l - 29. Suppose -ju = -29 - 31. Let s(v) = 28v2 + 2v - 1. What is the remainder when s(1) is divided by u? 9 Suppose -2a - 74 = -4a. Let y = -25 + a. Calculate the remainder when 42 is divided by 45/4 - 3/y. 9 Suppose -y - 5k + 36 = 0, 2y - k - 10 = 29. What is the remainder when 93 is divided by y? 9 Suppose -3j = 5w + j - 567, -3w = 5j - 348. What is the remainder when w is divided by 8? 7 Let l(p) = p*3 - 4p*2 - 4p + 6. Let w be l(4). Let t = w + 18. What is the remainder when -10(-21)/(-210) - (-32 + 1) is divided by t? 6 Let x = 2080 + -1483. What is the remainder when x is divided by 43? 38 Suppose -4x - 35 + 303 = 0. Let g = -970 + 982. What is the remainder when x is divided by g? 7 Let h = 10 + -112. Let i = 134 + h. Calculate the remainder when i is divided by 17. 15 Let o(l) = l + 17. What is the remainder when 61 is divided by o(-1)? 13 Suppose 6b = 16b - 790. What is the remainder when b is divided by 30? 19 Let o(v) = -v*3 - 7v*2 - 11v - 7. Let n be o(-6). Suppose 9 = -a + n. What is the remainder when 26 is divided by a? 12 Suppose -2j = -10 + 6. Suppose 3w = -4q + 61, -3q = 2w + jw - 44. What is the remainder when 31 is divided by q? 15 Let l = -11 - -16. Let h be l + (-6 - (-4)/1). Suppose 3s + hb + b - 35 = 0, 0 = s - b - 21. Calculate the remainder when 67 is divided by s. 16 What is the remainder when 194 is divided by (2 + -3)((-2 - 2) + -30)? 24 Let b(c) = -24c*2 - 2c*3 + 3 - 23c*2 + 4c + 44c2. What is the remainder when 52 is divided by b(-3)? 16 Suppose 0 = -y - 2r + 11, -3y + r = -5 - 56. What is the remainder when 374 is divided by y? 13 Let j = 91 - 56. Suppose -1 = -2c + 11. Let x = c + 6. Calculate the remainder when j is divided by x. 11 Suppose -u - u + 5h + 31 = 0, 3u - 3h = 24. What is the remainder when u + -5 + (-100)/(-1) is divided by 11? 10 Suppose 3d + 4p - 12 = 0, -4p - 16 = -4d - 6p. Calculate the remainder when 23 + (-2 + 4 - -2) is divided by d. 3 Suppose -8 = -4i + 8. Suppose 0h - 3b = 3h, -h - ib = 0. What is the remainder when 3/((-9)/(-114) + h) is divided by 13? 12 Let m(v) = -v3 + 11v*2 + 7v + 20. Let k be m(12). Let y = -32 - k. Let w(z) = -z*2 + 9z + 2. Calculate the remainder when w(4) is divided by y. 6 Suppose 133 = -16a + 23a. Calculate the remainder when 95 is divided by a. 0 Let v(u) be the first derivative of -u*4/4 + 5u*3/3 - 2u*2 + 2u - 1. Suppose 3l - 61 = -55. Calculate the remainder when 23 is divided by v(l). 5 Let t(o) = o - 1. Let n be t(4). Suppose -19 = -nl - 1. Suppose f + 24 = 3k + lf, -4k = -5f + 3. What is the remainder when 4 is divided by k? 1 Suppose -3j + 12 = -3. Calculate the remainder when ((-10)/(-20))/((-2)/(-16)) + j is divided by 2. 1 Let j(k) = -14k + 8. Let l be j(4). Let s be (-2)/7 - l/21. Suppose q - 270 = -sq. Calculate the remainder when q is divided by 23. 21 Let b(v) = -v3 + 25v*2 - 26v - 17. Let h be b(24). Let c = 94 + h. Let a = -96 - -211. Calculate the remainder when a is divided by c. 28 Suppose 7q + 1840 = 30q. Calculate the remainder when 717 is divided by q. 77 Suppose 2u + 3q = -11, 11 = -3u - 3q + 2. Let z = -11 - 2. Let c = u - z. Calculate the remainder when 29 is divided by c. 14 Suppose 3y - 191 + 35 = 0. Let c = -26 + 45. Calculate the remainder when y is divided by c. 14 Let t(b) = -b2 + 7b - 1. Let p be (3 - -1)(-9)/(-6). Let a be t(p). Suppose -4g + ag = 5. What is the remainder when 8 is divided by g? 3 Let i(f) = 4f + 6. Let y be i(6). Suppose -r = 4r - y. Suppose -6k + r = -0k. What is the remainder when 3 is divided by k? 0 Let n = 0 + 6. Let j(q) = 3q*2 + 94q + 792. Calculate the remainder when j(-15) is divided by n. 3 Suppose 3o = -5l + 35, -o = -3l - 0l + 35. Calculate the remainder when 11/((-11)/(-57)) - (1 + 1) is divided by l. 5 Suppose -244 = 80l - 84l. Calculate the remainder when 604 is divided by l. 55 Let u be 31/(-2)(-9 + 7). Suppose u = -4l + 287. What is the remainder when l is divided by 28? 8 Let q be 1 - (-1 + -8 - -4). Let z(l) = l*2 - 4l - 3. Calculate the remainder when 42 is divided by z(q). 6 Let d be 32/(-18) + 62/(-279). What is the remainder when 4/(-6)5-3 is divided by (d + 30/(-9) + 3)-3? 3 What is the remainder when (-2 - -11)/(18/12) is divided by 1 + 6 + (19 + -5 - 16)? 1 Let w be (-1)/((4/(-2))/(-20)). What is the remainder when 19 is divided by w/(-1) - (-20)/(-5)? 1 Let m(b) be the third derivative of 11/12b*4 + 1/3b3 + 0 - b2 + 0*b. What is the remainder when m(1)	{ "pile_set_name": "DM Mathematics" }
t*2 - 2at3 + 1132385at2 - 3421q wrt q? 2at*3 - 2316at2 - 3421 Find the first derivative of l3 - 53l*2 - 1755l - 39843449. 3l2 - 106l - 1755 Find the third derivative of 576bx*4 - 8954bx3 + 10bx2 + 15b - x*4 + 1722x*2 + 96x wrt x. 13824bx - 53724b - 24x What is the third derivative of 103923273y3 + 7272625y*2 + 18y wrt y? 623539638 Find the third derivative of -69553422t4 + t3 - 416t*2 - 401t + 35. -1669282128t + 6 What is the derivative of 50756t - 12102875 wrt t? 50756 What is the second derivative of -628756z5 - z3 - 8125041z? -12575120z3 - 6z What is the third derivative of q*5 - 6678838q*4 + 4q*2 - 617q - 262 wrt q? 60q2 - 160292112q Find the third derivative of 831903846n5 + 44144n*2 + 338n wrt n. 49914230760n2 Find the second derivative of -445144287c*2 - 144298942c wrt c. -890288574 Find the second derivative of i*3 - 27223956i*2p - 3ip + 3072303i + 12 wrt i. 6i - 54447912p What is the first derivative of -489w*2 - 2082w + 11583623? -978w - 2082 Find the first derivative of -2993jn2 - 2328jnx - n*2 - 216nx + 2n + 649x + 1 wrt j. -2993n*2 - 2328nx Differentiate o3 - 595022o + 205252940 wrt o. 3o2 - 595022 Find the first derivative of p4u - 302p4 + 1952pu - 6584438u + 4 wrt p. 4p3u - 1208p3 + 1952u Find the second derivative of -33713r3 + 2068r*2 + 10r - 21725973. -202278r + 4136 Differentiate 2l*3 + 12039l*2 + 259l + 31832400 wrt l. 6l2 + 24078l + 259 What is the derivative of 8k4 - 19k*3 - 38k*2 + 40k - 252466276 wrt k? 32k3 - 57k*2 - 76k + 40 What is the second derivative of 53809284dq*2 - 2dq - 173d + q*2 - 1024148q wrt q? 107618568d + 2 Find the second derivative of 78i*4 + 182584i*2 + 14159i + 616. 936i2 + 365168 What is the first derivative of -126v*3y + vy - 8202v - 29y - 14645 wrt v? -378v*2y + y - 8202 What is the third derivative of 54100h2j*6 + 24h*2j*3 + 5h*2j2 + h2j - 9257hj2 + 3hj wrt j? 6492000h*2j*3 + 144h*2 Find the first derivative of -1435b*2 - 6719bf3 - 2f*3 + 8f*2 - 5f + 23686 wrt b. -2870b - 6719f*3 What is the third derivative of 3358927n*6 - 1473n*2 - 1819n wrt n? 403071240n3 Find the second derivative of c5 - 422770c4 - c3 - 3620c + 526. 20c*3 - 5073240c*2 - 6c What is the second derivative of -185584220s2 - 24157224s + 1 wrt s? -371168440 What is the third derivative of 14658375a4 + 2a*3 - 731898418a*2? 351801000a + 12 Find the second derivative of -13f4 - 1778493f*3 - 119385099f. -156f2 - 10670958f Find the third derivative of 5911kp*3 - 7kp2 + 25k + 99p3 - 2p*2 - 92 wrt p. 35466k + 594 Find the second derivative of -5c5 + 100c*4 + 559c*3 + 1174784c + 2 wrt c. -100c3 + 1200c*2 + 3354c Differentiate 472i3l*2p + 5345878i3l + 3129i2l*3p + 2i2l*3 with respect to p. 472i*3l*2 + 3129i*2l*3 What is the third derivative of 142325697f*3q*2 - 36f*2q*2 + 2f*2 + 151fq2 + 6fq + 4q*2 wrt f? 853954182q*2 Find the second derivative of -275211444k*3 + 158229482k wrt k. -1651268664k What is the second derivative of 2d*2qr + 3306763d*2q + 15d2r - 2d2 - dqr - 40dq + 18d - 7qr - 29q - 2 wrt d? 4qr + 6613526q + 30r - 4 Differentiate -2dfk + 9715df - 647103dk - 2d - 54fk - 2k - 1 with respect to f. -2dk + 9715d - 54k Find the third derivative of 28041027o3 + 22564298o*2 wrt o. 168246162 Find the third derivative of -16f*4j - 3f4 + 108f*3j - 172f3 - 2f*2 - 4fj - 11j - 13701 wrt f. -384fj - 72f + 648j - 1032 Find the second derivative of -3810y4 - 178y*3 + 21853y + 16. -45720y2 - 1068y Find the second derivative of -11381938b3 - 2b + 2939784 wrt b. -68291628b What is the third derivative of 1253421i*5s - 27i4s + 2i2s + 12i2 - 2is + 902i - 1 wrt i? 75205260i2s - 648is What is the second derivative of 531c3w - 194c3 - 3c*2w + 2cw - 2063421w - 2 wrt c? 3186cw - 1164c - 6w What is the derivative of 52486341m*4 - 26048766? 209945364m*3 Find the second derivative of -5q*3 - 582904q*2 - 42q + 273793. -30q - 1165808 What is the derivative of 46x*4 + 32543x*2 - 12363493? 184x*3 + 65086x Find the first derivative of 330272627j2 + 10030289 wrt j. 660545254j What is the first derivative of 2h3 + 6985465h*2 + h - 85346812 wrt h? 6h*2 + 13970930h + 1 What is the derivative of 12036h2 - 280h - 66495627 wrt h? 24072h - 280 What is the derivative of 3856667jv + 5530055v wrt j? 3856667v Differentiate -89895j*2 - 5105j - 1363121551 with respect to j. -179790j - 5105 Find the second derivative of -25676368j*2t3 + j2t + 4j*2 + 3jt - 2t - 13994 wrt t. -154058208j2t What is the derivative of 4fv*2w + 485fv*2 + 22fvw*2y + 3fw - 4114677v2y + vw2 - 146vw + 3 wrt y? 22fvw*2 - 4114677v*2 Differentiate -4727240o*4v + 2ov*2 - 85v*2 + 3v - 6120 with respect to o. -18908960o3v + 2v2 What is the third derivative of -6267549a*4 + 1731754a*2? -150421176a Find the second derivative of m*3s - 2m3v*2 - 106m3 + m2sv - 20m2v + 1557msv2 + 5msv - 2ms - 51mv*3 + 2sv wrt v. -4m*3 + 3114ms - 306mv Differentiate -27790o*2w + 178709337o2 + 5ow - 81w wrt w. -27790o2 + 5o - 81 Find the second derivative of -20211153a4 - 27428059a wrt a. -242533836a2 Find the second derivative of -33039f*4 - 2034f*3 + 14861267f. -396468f2 - 12204f Differentiate -1708063b3 + 9b*2 + 298998479 with respect to b. -5124189b*2 + 18b What is the third derivative of 650385v3w*3 - 13v*3 - 351007v*2w*3 - 74vw3 wrt v? 3902310w*3 - 78 Find the second derivative of 35646126a*2 - 28119167a wrt a. 71292252 What is the first derivative of 197a2 - 4497ac3 + 2c*3 + 99142 wrt a? 394a - 4497c3 Find the second derivative of 24y*4 - 2287750y*2 + 7340566y. 288y2 - 4575500 Find the third derivative of -20b*3g + 560558b3r + 44b2gr - 549b*2r + 2bgr + 4br + 2gr + g - 2 wrt b. -120g + 3363348r What is the derivative of 322617134a*2k*3n - 63742a2k*2 + 14a*2 + 5ak3 - ak*2 wrt n? 322617134a*2k*3 What is the second derivative of 57j*4 - 113j*3 - 4j*2 - 1464j - 3003? 684j2 - 678j - 8 What is the second derivative of -611j3p*2 - 2202j*3 - 98425jp2 + 31jp wrt j? -3666jp2 - 13212j What is the third derivative of -9078441q3 + 5040946q*2 wrt q? -54470646 Find the third derivative of -63720333k*4 - 9k*2 + 391k + 44 wrt k. -1529287992k What is the first derivative of -666066fj2w*2 + 251fj2 + 2j*2 - 5jw2 - j - w2 - w + 38033 wrt f? -666066j*2w*2 + 251j*2 What is the first derivative of 13054753n - 31714457 wrt n? 13054753 Find the first derivative of 8043118b2 - 6260731. 16086236b Find the first derivative of -624ox*3 - 1988ox + 9x*3 + 9x*2 + 21 wrt o. -624x*3 - 1988x What is the second derivative of -284954381a5 + 240883251a? -5699087620a3 What is the third derivative of -92510157a*3b*2 - 2a*2b - 48324324b2 wrt a? -555060942b*2 What is the second derivative of 41307g*2l*2 + 5g*2l - 105g2 + 23gl5 - 274gl + g wrt l? 82614g*2 + 460gl3 What is the third derivative of 25196778v6 + v2 - 63v - 13912 wrt v? 3023613360v*3 What is the second derivative of 336x*5 + 995790x*4 + 12x + 8311003? 6720x3 + 11949480x2 Find the third derivative of -z6 + 1344403z5 - 1463993z*2. -120z*3 + 80664180z*2 Find the second derivative of -3y*4 + 4586637y*3 - 20562440y. -36y2 + 27519822y What is the second derivative of 2062k4 + 2069k*3 - 2278663k wrt k? 24744k2 + 12414k Find the second derivative of 2245r4 - 2r*3 - 79r*2 + 22302570r wrt r. 26940r2 - 12r - 158 What is the second derivative of -169260y4 + 34y*2 - 28328360y wrt y? -2031120y2 + 68 Find the third derivative of -8682436k*3 + 17571632k**2 wrt k. -52094616 Different	{ "pile_set_name": "DM Mathematics" }
= -3q. Is q a composite number? True Suppose g = -g + 4. Let w(k) = 14k*2 + 2k - 1. Is w(g) a composite number? False Let n(x) be the first derivative of 110x3/3 - x2 + 2x + 4. Let s be n(2). Suppose 3h - s = 3o, o - 200 + 56 = -h. Is h a composite number? True Suppose 3h - y = 49 + 22, 0 = -h + y + 27. Suppose -5k + 177 = h. Is k a composite number? False Suppose 0 = 2o - 465 - 251. Is o composite? True Let o be (-175)/2 - 2/4. Let t = -57 - o. Is t a prime number? True Suppose 0 = 2g - 2z + 10, z - 2 = -g + 1. Let l be -1(g + 3 + 4). Let s(d) = 7d2 + 7d + 5. Is s(l) prime? False Let u be (-2)/10 - (-52)/10. Let t(s) = -s*3 + 4s*2 + 5s + 1. Let k be t(u). Is (-124)/(-6) - k/(-3) composite? True Is (-3558)/9(-9)/6 composite? False Let a = 176 + 131. Is a prime? True Suppose -2f = -0f. Suppose f = -2v + 190 + 142. Is v a composite number? True Let s(r) = r*2 - 4r + 2. Let d be s(4). Suppose 2v + dv - 20 = 0. Suppose -4i = -vb + 55, 4b + 4i = -0b + 80. Is b a composite number? True Let c be 24/14 + 4/14. Suppose ca - 4s - 58 = 0, -2s + 252 = 4a + 86. Is a prime? False Suppose -5u + 3i - 13 = 0, 0 = 5u + i + 2 + 27. Let o = 3 + u. Is ((71 + o)/(-3))/(-1) a composite number? False Let b be 4/(-14) + (-114)/(-7). Suppose -s - c - 5 = -2s, -4s + 2c + b = 0. Suppose -sh + 0h + 159 = 0. Is h prime? True Let l = 5097 + -8060. Let d = -1649 - l. Suppose -a + 0j + 325 = 3j, 0 = 4a + 5j - d. Is a prime? True Let h(l) be the third derivative of 31l5/30 + l4/24 + l*3/6 - 2l*2. Let z be h(-1). Suppose 4k - 166 = -k + y, 2k + 4y - z = 0. Is k prime? False Let t(o) = -o*2 - 6o + 2. Suppose 2d = 2b - 18, 4d - 3 = 2b - 33. Let p be t(d). Suppose -25 = -3q + pk + 36, 4q - 4k = 80. Is q prime? False Let c = 293 - 182. Suppose -2x = -4d - 0d + 16, -d - 10 = 3x. Suppose -4i + 33 - c = -df, 4f - 2i - 132 = 0. Is f prime? True Suppose -3l = 4n - 1643, -3l + 106 + 1542 = 5n. Is l a prime number? True Let t(s) = 27s2 - 9s - 19. Is t(-7) a prime number? True Let j = -6 - -14. Suppose -2w - 2o = -j - 0, 2w - 5o = 43. Is 57/w + (-1)/3 a prime number? False Let w = 2 + -2. Suppose wy = 2y + 40. Let q = y - -57. Is q a composite number? False Let n(g) = -11g3 + 18g*2 + 29g + 1. Let m(b) = -7b3 + 12b*2 + 19b + 1. Let k(h) = 8m(h) - 5n(h). Let s be k(7). Is ((-3)/2)/(s/(-52)) prime? False Suppose -12666 = -9o + 7305. Is o prime? False Let z(x) = 6x*2 + 3x + 5. Let o be (8/(-10))/(1/5). Is z(o) a prime number? True Suppose 3f + 132 = -f. Let w = f - -52. Is w prime? True Let j(a) = -4a*2 + 5a + 2. Let p be j(5). Let w = p - -104. Is w prime? True Let n(m) = m*3 - 3m*2 + 2. Let x = -5 - -8. Let r be n(x). Suppose -2i + rg = i - 71, -5i + g + 109 = 0. Is i composite? True Let d(j) = -5j. Let c be d(-1). Suppose -41 = cz - 196. Is z composite? False Suppose 5z - 22 = 13. Suppose -2m + 9 = -z. Let u(a) = -a + 18. Is u(m) a composite number? True Suppose -5547 = -3p + 2754. Is p prime? True Suppose 4d = -16, -2u - 1940 = -3d - d. Let f be (-4)/(-10) - u/5. Suppose 6l - f = 2l. Is l prime? False Suppose 5o - 5l - 18495 = 0, 4o - 2l - 12496 - 2290 = 0. Is o composite? True Let y(q) = -q*3 + 5q*2 + 6q + 3. Let k be y(6). Suppose 0h + 12 = kh. Suppose -ho + 140 = -136. Is o composite? True Let q = -47 - -19. Let i = -8 - q. Suppose 2x = -i + 490. Is x composite? True Suppose 2a = 4a + 6. Let j(x) = 2x2 - x2 + x + 4 - 4x. Is j(a) a prime number? False Let g(d) = 6d2 - 7d - 6. Is g(-11) prime? True Let x = 1 + 8. Suppose -g + 4g = -i - x, -g + i = -1. Let s(z) = -27z - 3. Is s(g) prime? False Let t = -524 - -757. Is t a composite number? False Let w = -54 - -253. Is w composite? False Let v be (1/(-2))/(4/(-56)). Let m = 46 + v. Is m composite? False Suppose 0 = 7w - 2w - 25. Suppose 2f + 1574 = wc + 113, -4 = -2f. Is c a composite number? False Let n = 37 - 16. Suppose -4k = s - 0s - 27, -n = -k - 5s. Suppose 2u - 35 = -q, ku - 3u - 65 = -4q. Is u prime? False Let a(g) be the second derivative of 3g - 1/2g*3 + 7/12g*4 + 4g*2 + 0 - 1/20g*5. Is a(6) composite? True Let l = 208 - 190. Suppose -2w - 132 = -518. Suppose t - 21 = -m + l, 5m - w = -3t. Is m a composite number? True Suppose -42 - 218 = -4d - 4f, 2d - 130 = 4f. Let s = d + -24. Suppose -4z + 5x = -0z - 197, z = 4x + s. Is z prime? True Suppose c = -57 + 202. Is c prime? False Let o = 1501 - 600. Is o a composite number? True Suppose -4u - 5d = -5949, 4d - 20 = -0d. Is u prime? True Let t(f) = -f - 7. Let n be t(-11). Suppose -s - 169 = nk, -2k + 2s = -k + 40. Let x = k + 61. Is x prime? True Let v(t) = t3 - t2 + t - 3. Let h be v(-5). Is (-2)/4 + h/(-4) a prime number? False Let t(p) = -7p + 3. Let x be t(-6). Let u = -10 + x. Is u a composite number? True Suppose 0u = 3u + 12. Is 522/14 - u/(-14) prime? True Let d(u) = 5u3 - 2u*2 + 3u - 3. Let m = -6 + 8. Is d(m) prime? False Let q be 141/(-2)-11. Let o = 338 - q. Suppose 0 = 3u + s - 155, 0u + o = 5u + s. Is u prime? True Let f(m) = 315m*2 + 2m - 5. Is f(2) a composite number? False Let v be ((-10)/25)/(2/10). Let c be 45/((-1 - v) + 0). Suppose -c = -3s - 0s. Is s a prime number? False Let x(s) be the second derivative of 23s3/6 + s2/2 + s. Is x(2) composite? False Suppose -2k + 1832 + 1091 = 5u, 1466 = k - 2u. Let w = k + -923. Is w composite? False Suppose -2i - 208 = -0b + 2b, -4b = -4i + 384. Let h = 61 + b. Let z = 14 - h. Is z prime? True Let z = 5 - 4. Suppose 2t - z = 1. Is (53/1)/(t/1) prime? True Let r = 3 - 1. Suppose -6n = -rn - 76. Suppose -q + 2q = n. Is q composite? False Let z(s) = -7s + 2. Let m be z(2). Let u be 474/4m/(-18). Is (7 + -6)/(1/u) prime? True Suppose -190 = -5t - 4d, 0 = 2t - 3t + 3d + 19. Suppose -i - n - 4n = -6, -t = -3i + n. Is i a composite number? False Suppose h + 54 = 2u - 0h, -u = 2h - 27. Is 30165/u - (-6)/(-27) prime? True Is 1960 + (-15)/5 - -4 prime? False Let b(i) = -i3 + 4i*2 + 4i + 4. Let k be b(5). Let p be (k - -1)/(-3 - -4). Is 18 + p + 2/2 a prime number? True Suppose m - 5 = 0, 5f - 3f - 4m - 628 = 0. Suppose 0 = -w - 2w + f. Let o = w + -69. Is o a composite number? True Let p = -5 - -10. Suppose -3j - pr = 19, 6r + 14 = -2j + 2r. Is ((-1)/j)/((-1)/(-921)) a composite number? False Let h(w) = w2 - 2w + 709. Is h(0) a prime number? True Let r be (-1)/(-4) + (-6215)/(-20). Suppose -2p + 154 = g - r, -3g = p - 235. Suppose f + 4b - p = -3f, -b - 296 = -5f. Is f composite? False Let y = -11 + 76. Is y composite? True Suppose -8x = -3187 - 3357. Is x a prime number? False Suppose -t - 4h - 6 = 0, 2t = -3h - 10 + 3. Is 37/(1t/(-2)) composite? False Let r(w) = 7w2 + 6w + 4. Let y be 2/(-6) - 5/(-15). Suppose -2u - 6 = y, 0n = 4n - u + 17. Is r(n) prime? True Suppose 3o - 5o = -1082. Is o a composite number? False Let m be (-2 + 16/6)-3. Let r(o) = 4o2 - 3o - 1. Is r(m) prime? False Let u(n) = 3n3 - 2n*2 - 7n + 11. Is u(4) prime? False Suppose -2n + 6n - l - 840 = 0, 5l + 20 = 0. Is n composite? True Let b(s) = 39s*2 - 5s + 3. Let i(g) = -39g2 + 6g - 4. Let j(q) = 5b(q) + 4i(q). Is j(-1) a prime number? False Suppose 0 = -2l + 5o + 604, o = 2l - 0o - 620. Let v = l - 165. Suppose -2u + v = -287. Is u a prime number? False Suppose -5f + 1886 = -854. Suppose 0 = -3c - 0c + 5w + f, -5c = -2w - 945. Is c composite? False Let r = -8 + 10. Suppose -5x - 15 = 0, -733 = -ri - 3x - 0x. Is i a composite number? True Suppose -f = -1 - 0. Let y = -3 - -6. Is f/y - 136/(-6) composite? False Suppose 14 = 3m + 44. Let q(v) = -v*2 - 14v - 5. Is q(m) prime? False Is -28(4 - 621/12) prime? False Let q(v) = -v. Let l(o) = 26o - 1. Let d(f) = l(f) + 6q(f). Suppose -h = -4h + 6. Is d(h) prime? False Suppose -2j + 3901 = -x, 10x - 5835 = -3j + 6x. Is j a prime number? True Is -93(1 + (-4)/3) a composite number? False Let f(y) = -123y*3 + 4y*2 + 2. Is f(-3) a prime number? True Is 16672/10 + 5 + (-8)/(-10) prime? False Suppose -z = 18 - 61. Suppose -271 = 3w - z. Let f = w - -127. Is f prime? False Suppose -2*m	{ "pile_set_name": "DM Mathematics" }
m(v) = -2v + 1. Let i(t) = qu(t) + m(t). Give i(1). -5 Let o(x) be the first derivative of 312 - 2x + 3x*2 + 7/3x*3 + 1/4x*4. What is o(-6)? -2 Let r(h) = -13h*3 + h. Suppose -9 = -6l + 63. Let i = -111 - -113. Suppose iz = -l + 10. Determine r(z). 12 Let a(k) = k3 - 5k*2 - k - 1. Suppose 2t = 4h - 20 + 10, -4 = -h - t. Suppose -hg + 229 - 214 = 0. Calculate a(g). -6 Suppose 5u = -147 + 127. Let j(v) = 4v*2 - 3v - 2. Let k(x) = -5x2 + 2x + 3. Let i(o) = -6j(o) - 5k(o). Determine i(u). -19 Let t(b) = 15b2 + 6b - 3. Let f(q) = 3q2 + 5q - 3. Let y(d) = -7f(d) + 6t(d). Determine y(-1). 71 Suppose 17a - 212 - 734 = 6. Let l(n) = 8n - 456. Give l(a). -8 Let o(d) be the second derivative of -d*4/12 - 2d*3/3 + 4d*2 - 17d. Let c be ((-576)/60 + 12)/((-2)/5). Give o(c). -4 Let o(s) = 300s - 4201. Let y be o(14). Let x(k) be the third derivative of -k5/30 - k4/24 - 4k*2. Determine x(y). -1 Let w(k) = 4k - 3. Let r be w(3). Let o(g) = 7g2 + 14g + 16. Let s(q) = 30q2 + 57q + 68. Let f(p) = -17o(p) + 4s(p). What is f(r)? -9 Suppose 36n + 42 = 39n. Suppose 3o - 5f + 15 - 4 = 0, 2o + n = 5f. Let k(q) = oq2 + 0q*2 - 2q + q - 11q2. Calculate k(1). -9 Let b be (0 - 2/4)16. Let w(y) = 70371y - 140744y + 6 + 70376y. Calculate w(b). -18 Let s(d) be the first derivative of d3/3 + 8d*2 + 10d - 1236. Give s(-15). -5 Suppose 0 = -3k + 3, 11s + k = 15s - 4783. Let z(w) = 9w*2 + 1198w + 13 + 9 + w*3 - sw - 5. What is z(-9)? -1 Let f(n) be the first derivative of -7n4/4 + 2n*3/3 - 3n*2/2 - 4n + 2580. What is f(-1)? 8 Suppose -7x = -12 + 5. Suppose -x = 5z + 4. Let q(n) = -22n - 1. Calculate q(z). 21 Let y(j) = 14j + 94. Suppose -381l - 9 = m - 379l, -3m - 3l - 24 = 0. What is y(m)? -4 Let a(g) = 7g3 - 3g*2 - 3g - 1. Let z(w) = w*2 + 49w + 78. Let l be z(-38). Let t = l + 339. Give a(t). -8 Suppose -18f - 137 - 35 = -28. Let l(c) = -c3 - 10c*2 - 20c - 21. Determine l(f). 11 Let p(l) be the third derivative of -23l4/24 + 2l*3 - 2l*2 - 1576l. Determine p(-1). 35 Suppose -9k + 5 = -2v - 4k, 0 = -5v - 5k + 40. Suppose -3r + 24 - 137 = vf, -2f + 4r = 40. Let a = 24 + f. Let u(w) = 3w - 1. Calculate u(a). 5 Let s(f) = -f*3 + 13f*2 - 28f - 26. Let m = 29598 + -29588. Give s(m). -6 Let u(q) = q*2 + 15q - 9. Let b be -5 + -4 + -6 + 757 + -6. Let m = b + -750. What is u(m)? -23 Let p(c) = -968c - 6 - 871c - c*3 + 1856c + 4c2. Calculate p(7). -34 Let h be (177/1416)/((-2)/(-32)). Let u(l) = 0 - 4l + 0. Give u(h). -8 Let i(r) = -44r3 + 18r*2 + 43r - 7. Let h(v) = -21v3 + 9v*2 + 20v - 3. Let q(p) = 21h(p) - 10i(p). What is q(7)? 35 Let q(f) be the third derivative of -5f4/6 - f3/6 - 11f*2 + 2f. Suppose n = 35n - 34. Calculate q(n). -21 Let a(s) = 37s*2 + 121s - 176. Let n(w) = -5w2 - 16w + 25. Let v(f) = 2a(f) + 15n(f). Give v(6). -1 Let x(v) = 2 + 3v - 5 - 3. Suppose -79 = 4b + u - 0u, 76 = -4b - 4u. Let o(k) = -2k*3 - 40k*2 - k - 16. Let j be o(b). Give x(j). 6 Let n(h) be the second derivative of -1/3h*3 + 0 + 1/2h*2 - 5/6h*4 + 89h. Suppose 0 = -3w + 4i - 3 - 10, 2w + 6 = 2i. Give n(w). -11 Let n(g) = 3g2 + 86g - 41. Let o be -8 - ((-24)/42 + (-1057)/(-196)4). Calculate n(o). -12 Let r(s) = s3 - 11s*2 - 12s + 13. Let q(c) = 5c + 89. Let v be q(-15). Suppose -3f = 3d - 42, 3f - 2d - 46 + v = 0. Give r(f). 13 Let z(j) = 7j + 78. Let f be z(0). Suppose -5c = -93 + f. Let s(w) = -w - 2. Calculate s(c). -5 Suppose 5p - 3f - 34 = 0, -1 = -2p + f + 13. Suppose -q + p = 3q. Let t(r) = 9 - 7 + 3r2 - rq - 3r2. What is t(0)? 2 Let q(x) be the first derivative of -x4/4 - 4x*3 - 11x*2/2 - 3x + 3. Suppose -269j - 88 = -270j. Let i be (-1)/4 + (-946)/j. Calculate q(i). -3 Let x(k) = -k*2 + 0k*2 - 5k*2 + 2k*2 - 10k - 171 + k*3 + 164. Calculate x(6). 5 Let f(g) = 11g*2 + g - 4. Let z(v) = 29v*2 + 3v - 13. Let s(r) = -8f(r) + 3z(r). What is s(4)? -19 Let s = 18 - 16. Let i(d) = -3d + 12. Determine i(s). 6 Let x = 11 + -16. Let n(z) be the third derivative of z6/120 + z5/10 + z4/12 - 2z*3/3 + 3z2 + 43881. Give n(x). 11 Let b(x) = -x3 - 34x2 + 154x + 73. Let d be b(-38). Let g(u) = 2u3 + 8u*2 + 2u - 1. Calculate g(d). 11 Let v = -551 - -550. Let l(s) be the second derivative of -s5/20 - s4/12 + 7s. Give l(v). 0 Suppose -48 = -l - l. Let s = l - 28. Let i(q) = q2 + 6q + 5. What is i(s)? -3 Let f(h) = h*2 - 4. Let k be f(0). Let l(w) be the first derivative of 9 + 1/4w4 + w3 - 5/2w2 - 3w. What is l(k)? 1 Let y(x) = x*3 - 6x*2 - 8x + 7. Let m(o) = o*3 + 3o*2 + 5o + 3. Let b(f) = -f + 4. Let z be b(6). Let r be m(z). Let c be -1 - -3 - (-8 - r). Give y(c). 0 Let i(j) = 21j2 + 10j + 19. Let h(n) = 4n2 + n + 3. Let s(x) = -5h(x) + i(x). Suppose q - 6q = 15. What is s(q)? -2 Let p(v) = -v3 + 8v*2 - 10v - 2. Let x(i) = -i*2 - i - 1. Let j(o) = 2o*3 + 5o*2 + 4o + 5. Let s be j(-2). Let r(a) = sx(a) - p(a). What is r(8)? 9 Let l(q) = -8q + 43. Let u = 18807 + -18807. Calculate l(u). 43 Let d(o) = -341o + 1. Let b(i) = 625i - 2. Let m(h) = 6b(h) + 11d(h). Suppose -a = -0a + 35. Let k be 33/7 - 10/a. Give m(k). -6 Suppose 0 = o - 8o - 7. Let y be (-1 - -4) + 0 + o. Let b(a) = -2ay + 7a + 2 + 6a + 3a*2 - 5a. Determine b(-4). -14 Let r = -398 - -293. Let s be 10/r7 + (-17)/(-3). Let d(y) = -y2 - 6. Determine d(s). -31 Let w(a) = -a3 + 6a*2 - 3a - 6. Suppose -o - 3n = -25, 3n - 25 = -2o + 4. Determine w(o). 14 Let g(l) be the third derivative of 1/12l*4 + 1/60l*5 + 0l - 31l2 + 1/3l*3 + 0. Determine g(-3). 5 Let b(t) = -4t + 18 + 0t + 22. Let w(a) = 4a*2 + 577a - 67838. Let j be w(-221). Determine b(j). 4 Let f(c) = c*2 + 145c - 906. Let s be f(6). Let h(g) be the first derivative of -5/2g2 - 33 + sg. What is h(-4)? 20 Let g(x) be the first derivative of x*5/20 - 3x*4/4 + 2x*3 - 5x*2 + 16x - 44. Let j(w) be the first derivative of g(w). Calculate j(8). 22 Let g(b) = -53 - 346b + 1050b - 349b - 352b. Calculate g(19). 4 Let u(v) = -3v2 - v. Suppose 0 = r - 85 - 176. Let h = r + -260. What is u(h)? -4 Suppose -3t + 4k + 38 = 0, 2397k + 9 = 4t + 2400k. Let v(d) = -30d + 174. Calculate v(t). -6 Let f(k) = -15k - 181. Let j = -11903 + 11891. Determine f(j). -1 Let a = 3837 - 7673/2. Let j(h) be the second derivative of -ah3 + 25h - 1/2h2 - 1/12h4 + 0. What is j(-6)? -19 Let s(j) be the first derivative of -j4/4 - 20j3/3 - 11j*2 - 49j - 6884. Determine s(-19). 8 Let h(m) = -m*2 + 8m - 4. Let a = 30 + -24. Let v(c) = c*3 - 6c*2 + c + 1. Let t be v(a). Suppose f + t = 2f + i, 3i = -f + 9. Give h(f). 8 Let o(y) = 12 - 2 + 19y - 14y. Let r(v) = -2v - 5. Let t(i) = 3o(i) + 7r(i). Determine t(6). 1 Let w = 11398 + -11416. Let r(j) = -2j - 7. Determine r(w). 29 Suppose 2s = 3v + 19, 3v + 38 = 3s + 14. Let r(w) = -7 + 7 + 8 + sw. Let j(y) = 12y + 16. Let k(q) = 3j(q) - 7r(q). Give k(-6). -14 Let f be 18/3((-7)/(147/(-28)))/2. Let g(j) = j*3 - 4j*2 - j - 2. What is g(f)? -6 Suppose 2v - 6 = 2i, -5i - 3v - 10 + 3 = 0. Let r(k) = 6k*2 + 6k + 3. Calculate r(i). 15 Let q(a) = a + 12. Let g(z) = -3z - 46. Suppose -3 = 8n - 19. Suppose -4l - 3y = 39, -l + 3y - 27 = -ny. Let m be g(l). Calculate q(m). 2 Let l(z) be the third derivative of -z*5/60 + 3z4/8 - z3 - 91z2. Let r be l(8). Let o(s) = 5s - 12. Give o(r). -2 Let s(m) = -9m3 + 2 + 7m + 20 + 10m3 - 17m*2 + 10m*2. What is s(5)? 7 Let p(a) = -2a*2 - 3a + 1. Let n(h) = -23h2 - 85h - 1. Let z(q) = n(q) - 10p(q). What is z(-18)? 7 Let k(m) = -10m*3 + 219m*2 + 18m + 89. Let y be k(22). Let s(z) = 121z3 - z2 - z. Calculate s(y). 119 Let p be ((-1564)/(-119))/(2/7). Let z(s) = -s2 + ps - 55s + 15s - 2. What is z(3)? 7 Let o(z) = 3z2 - 2z. Let f(l) = 3l2 - 2l. Let r(v) = -3f(v) + 4o(v). Let w = -7962 - -7964. Give r(w). 8 Suppose 29 + 37 = -6t. Let d = t + 7. Let h(j) = 5j. Let c(l) = -4l. Let v(f) = 6c(f) + 4h(f). Calculate v(d). 16 Let r(z) = -3z*3 - 89z*2 + 121z - 101. L	{ "pile_set_name": "DM Mathematics" }
2 + 3u + 0 = 0. 0, 6 Let j be (-10)/25 - 289/15. Let o = -58/3 - j. Factor -oz4 + z + 5/3z*2 + 1/3z*3 + 0. -z(z - 3)(z + 1)2/3 Let a be 4 + (2 + 0)-4. Let c(s) = -8s2 - 13s - 9. Let d(j) = -j*2 - j - 1. Let i(p) = ac(p) + 36d(p). Factor i(n). -4n(n - 4) Let j = -1/18 - -2/9. Let y = -425/2 + 213. Factor yl - jl2 - 1/3. -(l - 2)(l - 1)/6 Let i(k) be the second derivative of 5k4/12 + 20k*3/3 + 75k*2/2 - 9k - 2. Factor i(z). 5(z + 3)(z + 5) Let m = -85/14 + 15/2. Let n be ((-132)/(-56))/11(15 + -15 + 4). Factor 2/7l + 0 + nl4 - ml*3 + 2/7l*2. 2l(l - 1)2(3l + 1)/7 Factor 4/7o - 2/7o2 - 2/7o*3 + 0. -2o(o - 1)(o + 2)/7 Let k(d) = -d*2 + 8d + 14. Let o be k(10). Let a be (-18)/12 - (-2 + (-1)/o). Factor ax2 - 2/3 - 1/3x. (x - 2)(x + 1)/3 Let h(x) be the third derivative of -x7/630 - 2x*6/45 - 53x*5/180 - 31x*4/36 - 4x*3/3 + 185x2. Factor h(f). -(f + 1)2(f + 2)(f + 12)/3 Let q(n) be the first derivative of -9n4/20 + n3 + 6n*2/5 - 12n/5 - 38. Factor q(l). -3(l - 2)(l + 1)(3l - 2)/5 Let o(c) = -3c2. Let p(l) = 11l*2 - 22l + 23. Let d(v) = -20o(v) - 5p(v). Determine q, given that d(q) = 0. -23, 1 Suppose 5k = 2k + 4k. Let w = 0 + k. Factor 0o + w - 2/9o2. -2o2/9 Let f(r) be the third derivative of r9/1350 - r*8/252 + 37r7/4200 - r6/100 + 11r5/60 - 8r*2. Let y(d) be the third derivative of f(d). Factor y(a). 2(4a - 3)2(7a - 2)/5 Let x be (2 + -3)/(5/(-30)). Let k(w) = -2w*2 - 12w - 18. Let y(q) = 4q2 + 24q + 36. Let g(t) = xy(t) + 11k(t). Factor g(s). 2(s + 3)2 Determine m so that 3/2m*2 + 816m + 110976 = 0. -272 Let o(g) be the first derivative of -21/2g2 + 5 - 18g*5 + 129/4g*4 + 6g - 8g3. What is f in o(f) = 0? -2/5, 1/3, 1/2, 1 Factor -6u*3 - 40/3u*2 - 26/3u - 4/3. -2(u + 1)2(9u + 2)/3 Let h be (4/(-6))/((-16)/543). Let 3/2z - hz*2 - 3/4 = 0. Calculate z. 1 Let x(p) be the first derivative of 2p*6/3 + 8p5/5 + p4 - 33. Find b, given that x(b) = 0. -1, 0 Factor -25q2 - 32q - 9q2 + 23q*3 - 25q*3. -2q(q + 1)(q + 16) Let i(x) be the first derivative of -x8/12600 + x7/6300 + x*6/1350 - 5x*3/3 + 2. Let a(y) be the third derivative of i(y). Factor a(n). -2n*2(n - 2)(n + 1)/15 Let 0 + 0j + 7/4j3 + 3/2j*2 + 1/4j4 = 0. Calculate j. -6, -1, 0 Let n(o) be the third derivative of o5/20 + o*4/4 - 4o3 + o2 - 2o. Factor n(j). 3(j - 2)(j + 4) Determine f so that 3f*4 - 68 + 10f*2 + 17f*2 - 15f*3 + 74 - 6f - 15f = 0. 1, 2 Let o = -1183/9 - -1213/9. Factor -oz*2 + 4/3 + 2z. -2(z - 1)(5z + 2)/3 Let i(m) be the third derivative of -m9/4032 - m8/2240 - 7m*3/3 + 4m*2. Let d(u) be the first derivative of i(u). Factor d(f). -3f*4(f + 1)/4 Let o(h) be the first derivative of h*6/3 + 3h*5/10 - 7h4/6 - h3 + 2h2 - 30h + 26. Let k(s) be the first derivative of o(s). Factor k(c). 2(c - 1)(c + 1)*2(5c - 2) Let z = 6119/1916 + 27/479. Factor 11/4o*2 + 1/2 + zo. (o + 1)(11o + 2)/4 Let b(a) = a*3 + 7a*2 + 4a + 2. Let o be b(-6). Factor -8u4 + 8u*5 - 4u*5 + ou*2 - 4u - 6u2. 4u(u - 1)3(u + 1) Let r be 7/21 - 147/9. Let z be 4/64/r-8. Let -zm + m3 + 0m*2 + 0 + 1/3m*4 = 0. Calculate m. -2, 0, 1 Factor 34/5z + 32/5 + 2/5z2. 2(z + 1)(z + 16)/5 Suppose 2o - 7s - 28 = -12s, -2s = 2o - 16. Let a be (-6)/o-4(-2)/(-15). Let at2 + 0 - 4/5t*3 + 0t = 0. What is t? 0, 1 Let b = 116 + -125. Let z be 0 + 1 - (-7)/b. What is s in 8/9s - 2/9s*4 + 4/3s*2 - 16/9 - zs*3 = 0? -2, 1, 2 Let g(y) be the first derivative of 3y*5/5 + 63y4/4 - y3 - 63y2/2 + 5. Factor g(m). 3m(m - 1)(m + 1)(m + 21) Let o(v) be the first derivative of 5v*4 + 632v*3/3 + 2432v*2 - 2048v + 86. Factor o(h). 4(h + 16)2(5h - 2) Let b = -29181 + 29184. Factor 1/4n + 0 + 3/4nb - 3/4n*2 - 1/4n*4. -n(n - 1)*3/4 Let l = -21 + 24. Suppose 0 + 12 = lt. Factor -tg3 + 2g*3 + 20g*2 - 8g - 6g3. -4g(g - 2)(2g - 1) Let z(p) be the first derivative of -p4/2 - 5p*3/6 + 7p*2/4 + p + 86. Suppose z(a) = 0. What is a? -2, -1/4, 1 Let -16/7f + 0 + 20/7f2 + 6/7f*3 - 8/7f*4 - 2/7f*5 = 0. Calculate f. -4, -2, 0, 1 Let -12/5o + 2/5o2 - 14/5 = 0. What is o? -1, 7 Let p = 13 + -10. Suppose pr = 2o - o + 16, 3r = 3o + 24. Find j, given that 12j*3 - 99j*r + 39j*4 - 2j*5 + 77j5 = 0. 0, 2/5 Let w(h) be the first derivative of h6/24 - h5/20 - h4/8 - 488. Factor w(o). o*3(o - 2)(o + 1)/4 Let l(z) = 2z + 13. Let s be l(11). Let y = s - 24. Factor -5n2 - yn*2 + 7n - 8 + n + 14n2. -2(n - 2)*2 Let o(g) be the third derivative of -16g*7/525 - 2g*6/15 + 31g*5/150 + 11g4/30 + g3/5 - 5g2 - 12g. Solve o(a) = 0. -3, -1/4, 1 Suppose -22/7i3 + 0 + 22/7i - 2/7i2 + 2/7i*4 = 0. Calculate i. -1, 0, 1, 11 Determine p so that -2/13p*3 + 0 - 8/13p*2 + 8/13p + 2/13p4 = 0. -2, 0, 1, 2 Suppose -2q + 0q = -6. Factor -3 - 4c - qc2 + 4c*2 + 3c - c. (c - 3)(c + 1) Let p = 49 + -46. Factor -2v*p - 2v + 2v + 20v*2 - 24v*2. -2v*2(v + 2) Let d(p) be the third derivative of p*5/120 - 31p*4/48 - 11p*3/2 - 19p*2 + 5. Factor d(j). (j - 33)(j + 2)/2 What is n in -1/2n4 - 40n*2 + 0 - 32n - 17/2n3 = 0? -8, -1, 0 Suppose -118k = 49k - 334. Factor u3 - u - 3/2 - 1/2u*4 + ku*2. -(u - 3)(u - 1)(u + 1)2/2 Suppose -6m + 4m = -6. Suppose -5t + my = -136, 5t = 2t + 2y + 82. Factor -10g3 + 16g*2 - 26 + t - 8g + 2g4. 2g(g - 2)2(g - 1) Let y(m) be the second derivative of -m*4/6 - 13m*3/3 - 12m*2 - 101m. Factor y(i). -2(i + 1)(i + 12) Suppose -40/7r2 + 48/7r + 2/7r4 + 4/7r*3 + 0 = 0. What is r? -6, 0, 2 Let d(h) be the first derivative of 2h*3/3 + 24h*2 - 50h + 11. Factor d(c). 2(c - 1)(c + 25) Let o be (-515)/9975 + 6/9. Let k = o - 2/133. Let -6/5 + 3/5i + ki2 = 0. What is i? -2, 1 Let a(n) be the third derivative of n6/105 + 17n5/210 - 4n*4/21 - 5n*3/21 + 553n*2. Suppose a(m) = 0. Calculate m. -5, -1/4, 1 Solve 4l*4 - 16912 - 26l2 + 8456 - l5 + 8424 + 11l3 - 64l = 0 for l. -2, -1, 4 Let n(x) = -x*2 + 7x - 2. Let g be n(6). Suppose 268y + 2y*g - 268y + 2y5 = 0. Calculate y. -1, 0 Factor -2/19v*3 + 0 + 6/19v*2 + 8/19v. -2v(v - 4)(v + 1)/19 Let c(u) = -u2 + u. Let g(a) be the third derivative of -2a*5/15 + 17a*4/24 - 25a*3/6 - 4a*2. Let f(q) = 28c(q) - 4g(q). Factor f(k). 4(k - 5)*2 Let d = 984223/5 + -198904. Let t = -2053 - d. Let 12/5s + ts2 + 0 - 12/5s*3 = 0. What is s? -1/3, 0, 3 Let g(h) be the second derivative of 16/3h*3 + 32h*2 + 1/5h*5 + 0 - 7/3h*4 + 17h. Factor g(p). 4(p - 4)2(p + 1) Let c(j) = -3j - 39. Let q be c(-13). Let u(o) be the third derivative of -1/60o*5 + qo + 6o2 + 1/8o*4 + 0 - 1/3o*3. Factor u(r). -(r - 2)(r - 1) Let p(u) = 8u3 - 190u*2 - 8u + 199. Let r(o) = 9o3 - 190o*2 - 9o + 202. Let w(s) = 4p(s) - 3r(s). Let w(z) = 0. What is z? -1, 1, 38 Factor 32/5a - 18/5a*2 + 8/5. -2(a - 2)(9a + 2)/5 Suppose -3h + 16 + 8 = 0. Let z(s) = 4s - 32. Let w be z(h). Find r, given that -4/5r + 0 + wr*3 + 6/5r*2 - 2/5r*4 = 0. -2, 0, 1 Let p(k) be the first derivative of -10/3k + 25 - 14/9k3 + 1/3k*4 - 14/3k*2. Factor p(u). 2(u - 5)(u + 1)(2u + 1)/3 Let s = -34326/77 + 4910/11. Factor -sc*2 + 24/7c - 32/7. -4(c - 4)(c - 2)/7 Let n = 78 - 77. Let g be (-8 + 4 - -8) + (n - 3). Find w such that 1/2w + 0 + 1/2w*g = 0. -1, 0 Let w(b) = 7b*5 - 17b*4 + 39b*3 - 28b*2 + 11b - 3. Let k = -18 + 19. Let a(o) = -o5 - o4 - o*3 - o + 1. Let c(h) = kw(h) + 3a(h). Factor c(q). 4q(q - 2)(q - 1)*3 Let x = 81 + -79. Suppose -4 = 3d - 2t, 0 = -xt + 1 + 9. Factor 72/7nd - 24/7n + 2/7. 2(6n - 1)*2/7 Let y(t) = 3t5 + t4 + t + 3. Let h(o) = -16o5 - 5o4 - o3 - o*2 - 5o - 16. Let b(v) = 2h(v) + 11y(v). Factor b(p). (p - 1)*2(p + 1)*3 Suppose 7o*2 - 23o*3 + 2o*3 + 6o*2 - 2o = 0. Calculate o. 0, 2/7, 1/3 Suppose 432 + 3/2g3 + 39g*2 + 288g = 0. Calculate g. -12, -2 Suppose -t - t	{ "pile_set_name": "DM Mathematics" }
base 5? 31421402 Convert 223022103 (base 4) to base 8. 531223 -3ba84 (base 15) to base 9 -321457 What is 154444230 (base 7) in base 12? 35b0863 311023010222 (base 4) to base 14 1bcbb3c -12403 (base 6) to base 13 -b13 Convert cfb (base 16) to base 3. 11120002 Convert -158320 (base 9) to base 3. -11222100200 -a4a8 (base 14) to base 16 -6ed4 aaa3 (base 13) to base 9 35566 What is 20114314 (base 6) in base 5? 121214201 -221849 (base 10) to base 16 -36299 What is -2678763 (base 10) in base 16? -28dfeb What is 21222210220202 (base 3) in base 14? 7c807c Convert -17bc20c (base 13) to base 10. -7766745 Convert 15371324 (base 8) to base 15. 49c89c Convert -259575b (base 14) to base 10. -18109109 Convert 440072 (base 9) to base 7. 2142215 Convert 122b595 (base 12) to base 11. 2001422 121220000 (base 4) to base 12 508a8 What is -23c458c (base 13) in base 15? -e99c1d Convert 2322131221 (base 5) to base 9. 10823166 What is -1000000110000010010 (base 2) in base 11? -171302 Convert 666441 (base 8) to base 16. 36d21 Convert -1c9890 (base 14) to base 3. -1221002022121 -222133351 (base 6) to base 12 -1421257 Convert -201214414 (base 5) to base 12. -32959b Convert 998194 (base 11) to base 16. 184b24 What is 1733036 (base 8) in base 4? 1323120132 What is 22010002110211 (base 3) in base 6? 232232421 What is -284322 (base 11) in base 4? -1230220031 Convert -333351532 (base 6) to base 13. -133a300 What is -63558 (base 13) in base 15? -38000 What is 12107 (base 14) in base 3? 2020111121 Convert -101110001001001110001 (base 2) to base 4. -11301021301 Convert 42003204 (base 7) to base 4. 31131331221 Convert -9691 (base 15) to base 10. -31861 What is 342102230 (base 5) in base 3? 2212011202200 What is dca660 (base 15) in base 11? 5a31826 What is 1010011100110101 (base 2) in base 6? 530101 Convert -21112022202210 (base 3) to base 4. -33101003322 What is 554562 (base 8) in base 11? 118332 What is 2120220121 (base 3) in base 11? 35322 What is -12587 (base 14) in base 4? -22333023 Convert -12e81 (base 16) to base 2. -10010111010000001 What is -913db (base 15) in base 11? -294574 11211102220102 (base 3) to base 9 4742812 Convert -100004440 (base 6) to base 5. -412240043 What is -1012002031 (base 4) in base 13? -a0753 What is 105740 (base 9) in base 12? 30769 Convert -10000001010110100 (base 2) to base 15. -14953 Convert -22885a (base 12) to base 10. -554182 -2550532 (base 6) to base 8 -417170 53154 (base 15) to base 6 5352054 Convert -1614614 (base 8) to base 10. -465292 -62011304 (base 7) to base 3 -100202010212112 Convert 12e9 (base 16) to base 13. 2285 What is -7877078 (base 9) in base 4? -100030001330 What is 1111111101000000 (base 2) in base 5? 4042334 77034b (base 12) to base 6 104242135 540266 (base 7) to base 11 6450a What is -203222321131 (base 4) in base 12? -316b391 Convert 1536a87 (base 11) to base 8. 12020616 Convert 203125 (base 14) to base 9. 2032105 What is 312768 (base 9) in base 10? 185795 What is 1352243 (base 8) in base 5? 44211430 -11101101101000100011 (base 2) to base 16 -eda23 Convert 1175310 (base 8) to base 5. 40420334 Convert -a20577 (base 13) to base 15. -4e74ea What is -91085 (base 13) in base 5? -31244410 Convert -3111031322 (base 5) to base 6. -344002513 Convert -60031465 (base 8) to base 16. -c03335 What is 3d5 (base 16) in base 14? 501 -607624 (base 8) to base 12 -98104 Convert 1901665 (base 11) to base 3. 20001202022212 66540653 (base 7) to base 2 10101111001101001000011 What is -10004403234 (base 5) in base 14? -1442577 What is -12312331120 (base 4) in base 6? -102311544 Convert -120212100201 (base 3) to base 10. -312274 -15102247 (base 8) to base 7 -41153331 50c07 (base 15) to base 14 6933a What is 61160025 (base 7) in base 6? 301033243 What is 5a169 (base 11) in base 6? 1505235 6306216 (base 7) to base 9 1375400 164415 (base 11) to base 7 2110425 What is 2894b (base 15) in base 13? 47438 Convert 233370 (base 8) to base 4. 103123320 Convert 4537653 (base 8) to base 11. 76a174 -26290 (base 11) to base 10 -37609 What is -4be36 (base 15) in base 2? -111011010010001010 11132303 (base 5) to base 15 1e553 Convert -1251033 (base 7) to base 11. -101a3a -220222212 (base 3) to base 11 -12765 5ab2a (base 13) to base 16 28b0e Convert -2120d (base 16) to base 5. -13320233 What is 605140 (base 7) in base 10? 102634 -11120202121110 (base 3) to base 10 -2436033 54307 (base 13) to base 14 3d60b What is -8a072 (base 11) in base 7? -1052342 What is 1102022331 (base 4) in base 13? ba273 64261325 (base 7) to base 14 a21d15 -1392449 (base 11) to base 3 -11111102000202 What is -613062 (base 7) in base 16? -1977c What is 8978 (base 10) in base 14? 33b4 What is -25833052 (base 9) in base 8? -60406614 What is -331c3 (base 15) in base 3? -22020210010 15d32d (base 14) to base 16 bb0fd Convert -32a52 (base 15) to base 11. -aaa20 Convert b779 (base 14) to base 11. 21875 What is 1111010111010010001 (base 2) in base 8? 1727221 -48187 (base 14) to base 6 -3434255 What is 103243440 (base 5) in base 11? 285712 47933 (base 12) to base 15 1d850 Convert -792018 (base 12) to base 15. -28264e Convert 128bbb1 (base 14) to base 11. 505a575 What is 3346 (base 15) in base 9? 15813 Convert 11012332032 (base 4) to base 6. 44412210 -1110100200 (base 3) to base 14 -a656 What is -2092cb (base 15) in base 2? -101111010010111000110 31462626 (base 7) to base 9 5020720 Convert -1089658 (base 10) to base 11. -684749 What is -21301130 (base 4) in base 14? -10832 -134885 (base 10) to base 13 -4951a 12022120101 (base 3) to base 7 614065 -196213 (base 10) to base 12 -95671 Convert -34423 (base 5) to base 3. -10102011 -100000110011010011101 (base 2) to base 7 -12064442 Convert 3543401 (base 7) to base 4. 1231111010 Convert -304800 (base 10) to base 4. -1022122200 Convert -3201266 (base 8) to base 4. -3100022312 -13372 (base 11) to base 7 -106421 Convert 205613 (base 15) to base 5. 343140433 What is -587a85 (base 12) in base 14? -290b9b Convert -8d63b1 (base 14) to base 7. -55651111 26324422 (base 7) to base 4 21030110323 Convert -109a0b4 (base 12) to base 7. -36054235 128736 (base 14) to base 9 1172180 What is 24411510 (base 6) in base 3? 1110120222220 What is -353437 (base 9) in base 12? -a2b81 Convert -122010022011 (base 3) to base 15. -69ccd What is 30ea91 (base 15) in base 2? 1000111000010011010001 11001022112210 (base 3) to base 11 123a651 Convert -112021202333 (base 4) to base 2. -10110001001100010111111 Convert 300110211 (base 4) to base 14. 521b7 What is 359425 (base 10) in base 4? 1113300001 Convert -433011324 (base 5) to base 4. -13002111231 -11216650 (base 9) to base 8 -24610606 What is -15369 (base 13) in base 3? -2001001200 What is -10101100111101111001010 (base 2) in base 9? -11587660 What is -202001311221 (base 4) in base 6? -515110133 What is 3566703 (base 8) in base 2? 11101110110111000011 What is 135520202 (base 6) in base 2? 1010101010001100001010 -5013303 (base 6) to base 14 -61a99 -133301410 (base 5) to base 15 -d6dc0 What is d8c73b (base 15) in base 12? 3557792 32000002 (base 4) to base 16 e002 100101010111100100 (base 2) to base 9 252856 What is b8605 (base 14) in base 8? 1546415 Convert -4074295 (base 10) to base 8. -17425467 What is 150503 (base 12) in base 5? 42300420 Convert 15318 (base 9) to base 11. 7955 Convert -10608a (base 11) to base 16. -294af What is 8adb (base 15) in base 16? 7310 -325b2 (base 14) to base 4 -131300100 What is 417b30 (base 13) in base 5? 342443020 Convert 1765201 (base 8) to base 2. 1111110101010000001 Convert 24131202 (base 5) to base 7. 1621564 111011000021 (base 3) to base 11 167495 13054513 (base 7) to base 6 41301454 Convert -200223 (base 10) to base 14. -52d79 Convert 110232 (base 7) to base 3. 222111220 Convert -41452416 (base 7) to base 14. -66c80d -40001535 (base 6) to base 2 -100010001011110100011 Convert -2303341422 (base 5) to base 14. -97a1a8 -55541 (base 8) to base 14 -874d What is 113915 (base 10) in base 6? 2235215 696a5 (base 14) to base 6 5255321 What is -4350145 (base 6) in base 11? -138726 117998 (base 12) to base 7 2256203 23613 (base 13) to base 9 107726 Convert 23032313 (base 5) to base 15. 40c8d 99187 (base 14) to base 13 cc9a8 What is 41002037 (base 8) in base 7? 133352633 Convert 8e19 (base 16) to base 10. 36377 What	{ "pile_set_name": "DM Mathematics" }
value in 2, -0.1, 0.4, 0.08, 4? 0.4 What is the smallest value in -0.5, -196, -2/9? -196 Which is the second biggest value? (a) 0.9 (b) -5/4 (c) -0.4 (d) 2/11 d Which is the third smallest value? (a) -1/2 (b) -2/3 (c) 71 c What is the third smallest value in -1/7, -3, 2/19? 2/19 What is the biggest value in -17, -0.03, 1? 1 What is the second biggest value in 0.69, -22, 0.3? 0.3 What is the smallest value in 1/33, -2/5, -2/55? -2/5 Which is the biggest value? (a) -1/2 (b) -15 (c) -2 a Which is the fourth smallest value? (a) 5 (b) 1.9 (c) 14 (d) -7 c Which is the second biggest value? (a) -0.3 (b) -1 (c) -11 (d) 4/3 a What is the second biggest value in -2/7, 1021, 3/4? 3/4 What is the smallest value in 3, -2, -115? -115 What is the third biggest value in 4, 26.77, -2? -2 What is the third biggest value in 1/125, -3, -2/5? -3 What is the biggest value in -0.4, -1.5, -8, 2/11? 2/11 Which is the third biggest value? (a) 2/13 (b) -79 (c) 62 b What is the fifth biggest value in 4, 14, -5/4, -0.33, -2/3? -5/4 Which is the fourth biggest value? (a) -4 (b) 1 (c) -0.06 (d) -2 a What is the fifth smallest value in -3/2, -13, -2, 0.1, 1/3? 1/3 Which is the second smallest value? (a) -1 (b) 2/5 (c) 14/17 (d) -5 a What is the second smallest value in 0.092, -2/471, -0.2? -2/471 Which is the second smallest value? (a) 4 (b) -420/17 (c) 2 c Which is the second smallest value? (a) -1/85 (b) 136 (c) -4 a Which is the second smallest value? (a) -3/4 (b) 1/3 (c) -4 a What is the fourth smallest value in -2/11, 128, -4, -2? 128 What is the second biggest value in 0, 2, -26? 0 What is the biggest value in 0.2, 4, 1.56? 4 Which is the biggest value? (a) 3/4 (b) 4 (c) 1/7 (d) 0.02 (e) 0.2 b What is the biggest value in 6, -0.3, 2/5? 6 What is the third smallest value in -2/9, 2, -0.3, -1.8? -2/9 What is the third biggest value in -2, 0.1, 12? -2 What is the smallest value in -3, -0.175, -1/35? -3 What is the third biggest value in -630, 3, -3? -630 What is the third biggest value in 1/46, -5, -4? -5 What is the smallest value in 69, -4/25, 5, 0.3? -4/25 Which is the fourth smallest value? (a) -3 (b) 1 (c) 19 (d) 0.2 c What is the second smallest value in 0.2, -2/7, -2/29, 4? -2/29 Which is the third smallest value? (a) 0.4 (b) -11/3 (c) 2 c What is the second smallest value in 23, -0.1, -2? -0.1 What is the second smallest value in 0, -6, 2/17, -0.07, 2/3? -0.07 Which is the second smallest value? (a) -1/3 (b) -1/7 (c) -2 (d) 15 a Which is the second biggest value? (a) 3 (b) 1 (c) -1/9 b What is the third smallest value in -1, 4, 2/117? 4 What is the third smallest value in 1, 12, 0.1, 19? 12 Which is the smallest value? (a) -0.3 (b) -59 (c) 0 b What is the second smallest value in 0.5, -0.1, -4/5, -288? -4/5 Which is the second smallest value? (a) 15 (b) -0.1 (c) 2 c What is the second smallest value in -0.1, -2, 2, 0.1? -0.1 What is the second smallest value in -0.5, 5, 0.1, 0.3? 0.1 Which is the second smallest value? (a) 3 (b) -0.1 (c) -74 (d) 2 b Which is the biggest value? (a) -0.2 (b) -0.07 (c) 5 c Which is the second smallest value? (a) 315 (b) 2/3 (c) -5 b Which is the biggest value? (a) -46 (b) -31 (c) 1/2 c What is the fourth smallest value in -3, -1, 2, 0.4, -3.6? 0.4 Which is the biggest value? (a) 0.131 (b) -3 (c) 1 (d) 5 (e) 0 d What is the third smallest value in -2/7, -4, 2/35? 2/35 What is the second biggest value in -3/2, 4/5, 0, 1/5, -4? 1/5 What is the fourth biggest value in -0.3, -0.15, 4, -2/9? -0.3 What is the biggest value in -74, 3, -5? 3 Which is the second biggest value? (a) -0.4 (b) 0.61 (c) -2 (d) 1/4 d Which is the third biggest value? (a) 1 (b) -15 (c) 0.1 b What is the biggest value in 0.2, 2/3, -2, 2? 2 Which is the second smallest value? (a) -6 (b) -640/3 (c) -3 a What is the fourth biggest value in 0.4, 2, 12, 0.2? 0.2 What is the second smallest value in 28, -2/7, -0.5? -2/7 Which is the smallest value? (a) -0.4 (b) -4 (c) -829 c What is the fourth smallest value in 152, -0.5, -2, 0.2? 152 What is the second biggest value in 106, -2/21, -0.03? -0.03 Which is the third smallest value? (a) 5 (b) -2/7 (c) -3 (d) 0.05 d Which is the third smallest value? (a) 0.3 (b) 6 (c) 0.2 (d) -5 (e) 0.6 a Which is the fourth biggest value? (a) -4 (b) -2 (c) 0.66 (d) -0.3 a Which is the third smallest value? (a) -1.4 (b) -0.04 (c) 5 (d) 0.3 d Which is the second biggest value? (a) 0.1 (b) 15 (c) -0.4 a Which is the third smallest value? (a) 1 (b) 0 (c) -58 a What is the fourth biggest value in -0.5, -2.2, 4, 0? -2.2 Which is the second smallest value? (a) 1 (b) 1.3 (c) -0.04 a What is the second biggest value in 134.2, 0, 2/5? 2/5 Which is the third biggest value? (a) 1 (b) 6 (c) 25/8 a Which is the second biggest value? (a) -0.3 (b) 1.9 (c) 3 b Which is the fourth biggest value? (a) -2 (b) -0.5 (c) -0.1 (d) 0.08 a What is the fourth smallest value in 1, -11, -1/3, -1/13? 1 What is the smallest value in -0.6, -0.3, -22.4? -22.4 Which is the biggest value? (a) 0.519 (b) 4 (c) -0.5 b What is the third smallest value in -35, -4, -5? -4 What is the fourth smallest value in -2/11, 4, -18, 3, 4/7? 3 Which is the third smallest value? (a) 2/3267 (b) 1 (c) -4 (d) 3 (e) 1/2 e What is the third biggest value in 2/11, -66, 1? -66 What is the biggest value in 193, 2/11, -0.5? 193 Which is the third smallest value? (a) -3 (b) -8 (c) -2/5 (d) -4 a Which is the third smallest value? (a) 2 (b) 0 (c) 5 (d) 0.1 (e) -140 d Which is the third biggest value? (a) 5 (b) -2/3 (c) 0.6 (d) 0.048 (e) 1/8 e Which is the fourth biggest value? (a) 1/5 (b) -25 (c) -0.3 (d) 30 b Which is the second biggest value? (a) -6 (b) 10 (c) 4 (d) 0.4 (e) 3 c Which is the third smallest value? (a) -2/7 (b) -0.09 (c) 9 c What is the fourth biggest value in -0.12, 5, 2, 0? -0.12 Which is the third biggest value? (a) 2/7 (b) -22 (c) 1 (d) -2 (e) 5 a What is the third smallest value in 1, 313, 1/3? 313 What is the smallest value in 15, 40, -4, 2? -4 What is the second biggest value in -2/9, -95, -5? -5 Which is the smallest value? (a) 0.3 (b) -11.7 (c) -5 b What is the third biggest value in 0.23, -1/4, 0, 4/3? 0 Which is the fourth biggest value? (a) -0.6 (b) -3 (c) 1 (d) 0.7 b What is the second biggest value in -5, -1, -308, -0.2? -1 Which is the third biggest value? (a) -4 (b) 65 (c) 5 (d) -7/5 d Which is the second biggest value? (a) -2 (b) -22/7 (c) 0.4 (d) 5 c What is the fifth biggest value in 2/3, -4, 0.03, 6, 0.5? -4 Which is the third smallest value? (a) 0.4 (b) 88 (c) 4 (d) -5 c Which is the second biggest value? (a) 2/3 (b) -0.04 (c) -82 b What is the fourth biggest value in 1937, 1/4, 5, 1? 1/4 What is the third biggest value in -0.5, 0.3, 1, 429? 0.3 Which is the second smallest value? (a) 10 (b) 0.06 (c) 1/7 c What is the third biggest value in 0.4, 2/17, 5, 2? 0.4 Which is the third biggest value? (a) 4 (b) 1 (c) 2/3 (d) 5 (e) 2 e What is the third biggest value in -74, -3/4, -9? -74 What is the second biggest value in -9.2, 0.1, -4? -4 What is the fourth biggest value in -2/5, -4, -0.3, -6.2? -6.2 Which is the biggest value? (a) -0.06 (b) -4 (c) -1.8 a What is the second biggest value in -2/13, 6, -15, 5/4? 5/4 Which is the third biggest value? (a) 2/3 (b) 0.31 (c) -3/2 c What is the third smallest value in 1/6, 9, -20, -2? 1/6 Which is the third biggest value? (a) 5 (b) -9 (c) -3 (d) 4 (e) 2 e What is the fourth biggest value in 2, -248, 0, -4? -248 Which is the smallest value? (a) -0.079 (b) -1/10 (c) 7 b Which is the third biggest value? (a) 17 (b) 1 (c) -1 (d) 5 b Which is the fourth biggest value? (a) -2 (b) 2/39 (c) 0 (d) 0.4 a What is the fourth biggest value in 33, -2, -0.4, 2/3? -2 What is the biggest value in -1, 1.6, 4? 4 What is the second biggest value in 2/3, -5, 3.8? 2/3 Which is the fourth smallest value? (a) 1/3 (b) 1/4 (c) 8 (d) 3/5 c Which is the second biggest value? (a) -5 (b) -8 (c) 0.4 a Which is the second smallest value? (a) 0 (b) -22 (c) 44 a Which is the second biggest value? (a) -0.2 (b) 2 (c) 1 (d) -2/15 (e)	{ "pile_set_name": "DM Mathematics" }
5726027 a prime number? False Is 10743098789 prime? True Is 6102217973 prime? False Is 258797565641 prime? True Is 13011127313 prime? False Is 15637215161 a composite number? False Is 2137925407 composite? False Is 2258360147 composite? False Is 4261064141 a prime number? True Is 4722299837 a composite number? False Is 66951004031 a composite number? False Is 1787050417 composite? True Is 9148087163 composite? True Is 21246053 a prime number? True Is 4875846343 prime? False Is 135224039 prime? True Is 662912833 prime? False Is 963350743 a composite number? True Is 114524567021 a prime number? True Is 680389873 composite? True Is 6795327211 a prime number? True Is 56008628197 a composite number? True Is 329090297 prime? True Is 7444379329 prime? True Is 399672869 prime? True Is 51276991 a prime number? False Is 769522801 a prime number? False Is 214460711 prime? False Is 42901808501 a prime number? True Is 25106081239 composite? False Is 264383563 prime? True Is 178819579 a composite number? True Is 35279528227 a prime number? True Is 22633260311 prime? False Is 81848886809 a prime number? True Is 19709303591 a composite number? True Is 543677089 a prime number? True Is 1918359731 composite? True Is 22844757679 composite? False Is 116833939291 composite? False Is 1184012773 a composite number? True Is 1075421951 a composite number? False Is 4551191 prime? True Is 9596535499 composite? True Is 7958598041 composite? False Is 43140281 prime? True Is 2653683617 composite? True Is 1239104903 prime? False Is 15727323533 a composite number? True Is 276943561 prime? False Is 31440048883 prime? True Is 37891839431 a composite number? True Is 1411858771 a prime number? True Is 3935309113 prime? False Is 1231983395 a prime number? False Is 41241349 a prime number? False Is 21616554977 a composite number? True Is 12006716521 prime? True Is 5372745643 a prime number? True Is 11653933957 a prime number? True Is 2092310338 a prime number? False Is 11895665147 composite? True Is 99158843435 a composite number? True Is 61586908331 a prime number? False Is 7621311011 composite? False Is 2896597826 composite? True Is 294281412199 a prime number? False Is 4591690813 a composite number? True Is 7318906919 composite? False Is 220235600147 composite? False Is 123635208293 composite? False Is 4991195831 composite? False Is 23591138293 a prime number? False Is 11053096289 composite? False Is 709829833 a prime number? True Is 607870903 prime? True Is 3358860059 prime? False Is 2844655507 a prime number? False Is 15025670909 composite? False Is 1956755509 a composite number? False Is 146338613507 a composite number? False Is 680675189 a prime number? False Is 1338225887 prime? False Is 38355526511 a prime number? False Is 16308359 a composite number? False Is 94798586534 prime? False Is 5811783947 composite? True Is 26655993499 prime? True Is 22896304329 prime? False Is 8492510461 prime? False Is 133169473 a prime number? True Is 490825903 a prime number? False Is 777965491 composite? True Is 1030251317 a composite number? True Is 427899205439 composite? False Is 704148839 a prime number? False Is 13683587531 prime? True Is 938721209 a prime number? True Is 54924485906 composite? True Is 3875569109 a prime number? False Is 51670372499 a composite number? False Is 167204209 a composite number? True Is 11774174219 a composite number? False Is 996875137 a prime number? True Is 28624734043 a composite number? False Is 623194979 a composite number? True Is 47465797 prime? True Is 98621939147 a prime number? False Is 718602062 a composite number? True Is 62395266491 composite? True Is 52590579737 a composite number? True Is 74684363941 a composite number? True Is 4128210739 a composite number? False Is 294338635 a prime number? False Is 2941392383 prime? True Is 1091748971 composite? False Is 900751541 a prime number? True Is 528452227 a prime number? True Is 9329512343 composite? True Is 110742312143 prime? True Is 11452975643 composite? False Is 29858862823 a composite number? True Is 280184519 composite? False Is 15492795443 prime? True Is 613430791 composite? False Is 44641804633 prime? True Is 9103626001 prime? False Is 75106721 composite? True Is 2426642819 composite? False Is 1585612673 a composite number? False Is 917522117 composite? False Is 42304324042 a composite number? True Is 16871650513 a prime number? True Is 8433696371 a composite number? True Is 18618496733 composite? False Is 116439680923 prime? False Is 9446989 a prime number? True Is 249104729 prime? True Is 600432401 prime? False Is 5283614227 prime? False Is 320415437 a prime number? False Is 9040825531 a composite number? False Is 67156687893 prime? False Is 344727353 prime? False Is 7288635383 a composite number? False Is 2001011413 a prime number? False Is 784500641 a composite number? True Is 21822949697 prime? True Is 18842055149 a prime number? True Is 59936034559 a composite number? True Is 2791966 a composite number? True Is 984852179 a composite number? False Is 21748283 prime? False Is 49913837 a prime number? True Is 31580008591 a prime number? False Is 1586778569 a composite number? False Is 2463336451 a composite number? True Is 367582769 prime? False Is 481136879 a composite number? False Is 41665096327 a composite number? False Is 3245140847 a composite number? True Is 80781947 a prime number? False Is 10230484753 composite? True Is 3332036399 composite? False Is 14159595679 a composite number? True Is 40652407637 a composite number? False Is 202159583 composite? False Is 34915500277 prime? False Is 1222664713 a prime number? False Is 109600123259 prime? False Is 795976957 a composite number? True Is 17052264283 composite? True Is 585263687 a composite number? False Is 72221135757 composite? True Is 217161907 a prime number? False Is 32232443 composite? False Is 1000290271 a prime number? True Is 1050366847 a composite number? True Is 77149057 a prime number? True Is 468249973 composite? True Is 66494893 composite? False Is 50857436783 a prime number? False Is 589593373 a prime number? True Is 2656948703 a prime number? False Is 13008140177 prime? True Is 4216796137 composite? False Is 46130886337 prime? False Is 45639013913 a prime number? True Is 587174257 composite? False Is 1340487877 prime? True Is 66342257 a prime number? True Is 519746677 prime? True Is 8304997937 a prime number? False Is 1389191333 prime? False Is 7228997837 a composite number? False Is 8195279903 a prime number? False Is 162535493 a composite number? False Is 306587741 a composite number? True Is 79840775243 a composite number? False Is 8561074069 prime? False Is 7959147949 a composite number? False Is 32438887331 composite? True Is 5237831047 prime? True Is 71007375979 a prime number? False Is 58385859349 composite? False Is 614179849 prime? True Is 3924651421 composite? True Is 4304775191 a composite number? False Is 19282981213 prime? True Is 413984359 a composite number? False Is 61954053347 prime? True Is 669072863 composite? False Is 29256578609 a composite number? False Is 412674797 a prime number? True Is 3405496603 a prime number? True Is 4029842461 a prime number? False Is 6482108302 prime? False Is 5211803279 prime? False Is 205780567 a prime number? True Is 129360771143 composite? True Is 26847656977 a prime number? True Is 1178912591 composite? False Is 1634475883 a prime number? True Is 2470309087 composite? True Is 177977159 prime? False Is 7141157741 prime? True Is 26969338457 prime? True Is 57739601 a prime number? True Is 89875598971 prime? True Is 37716144839 prime? False Is 410715727 composite? False Is 1133559142 a composite number? True Is 2282615431 composite? False Is 6822076097 composite? False Is 3837255482 composite? True Is 262845887 prime? False Is 32671877927 a prime number? False Is 7100106953 a composite number? False Is 279549179327 a composite number? True Is 1161430477 composite? False Is 4759658117 a composite number? False Is 12099690439 prime? True Is 100426369 prime? True Is 608230495 a composite number? True Is 2628769139 composite? False Is 11928758287 composite? False Is 29254658999 a prime number? True Is 751513687 a prime number? False Is 26041760269 a composite nu	{ "pile_set_name": "DM Mathematics" }
+ -2. -6 What is the value of (3 - -1) + -6 + -3? -5 Calculate -10 + 1 - (-4 + -5). 0 (-7 - -9) + -5 - 0 -3 Calculate 4 - 2 - (-1 + 1 + -2). 4 Evaluate (-2 - (18 - 16)) + 5 + 0. 1 Calculate 10 + (-5 - -2) - 5. 2 Evaluate -1 + (3 - 5 - -2) + 1. 0 (4 - (15 + -3)) + (19 - 16) -5 Calculate 4 - (0 + 7 + (2 - 6)). 1 What is -3 + (5 - 7) + 6? 1 (-8 - -16) + (-1 - 5) 2 Evaluate 5 + (0 + 3 - 0) + -3. 5 Calculate -9 - (-2 + 1 - (53 - 47)). -2 What is (3 + -1 - -6) + -3? 5 7 + -3 - 5 - -1 - -3 3 Calculate -4 + 10 + -12 - -10. 4 Evaluate 0 + -21 + 8 - -14. 1 What is the value of -2 + -5 + 6 + -4? -5 What is the value of -4 + -8 + 4 + 14 - 5? 1 Calculate 6 - (2 + 3 + -11 + 8). 4 What is -5 - (4 - 13) - (-1 + 0)? 5 Evaluate -6 + 6 + 6 + -1. 5 What is the value of (-9 - (-6 - -8)) + 11? 0 What is 10 - (12 + (-11 - -5))? 4 Evaluate 3 + (1 - 3) + -4. -3 What is 7 + (0 - 14) + 7? 0 Calculate -1 - (1 - (3 - 5)). -4 What is the value of -3 - (0 + (5 - 2))? -6 What is the value of 4 + 7 + -7 - (2 - -2)? 0 1 + (1 - 0) - (11 + -14) 5 Evaluate 6 - ((4 - 1) + -2). 5 What is 2 + -1 + 13 + -21? -7 What is the value of -5 + 3 + 1 + 3 + -2? 0 What is the value of 5 + -2 + (4 - 9)? -2 Evaluate -2 - 1 - -3 - 2. -2 Calculate 3 - 2 - (-2 - -1) - 5. -3 (2 - (3 - 3)) + -4 - -1 -1 (9 + -6 - (-2 + -2)) + -4 3 (6 - (5 - 1)) + -6 -4 What is 7 - 1 - (-11 - (17 + -28))? 6 Calculate -11 + (1 - 2 - (-29 - -22)). -5 Evaluate (0 - -2 - -10) + (-2 - 1). 9 Evaluate -1 - (-15 - (-1 - 11)). 2 What is the value of 59 + -57 - (4 + 1)? -3 What is the value of 3 + (7 + -5 - -2) - -1? 8 What is -13 + (18 - 7) - 0? -2 What is the value of 5 + -1 - (-4 - -1 - -4)? 3 (2 - -4) + 1 + -7 + 5 5 What is 100 + -93 + (-4 - 0)? 3 What is the value of (-28 - -34 - (1 + 0)) + -3? 2 What is 0 + -3 - ((20 - 32) + 6)? 3 Evaluate 14 - 1 - (5 + 2). 6 Calculate -5 + (-4 + 7 + 2 - 2). -2 Calculate (-13 - -6 - (-10 + 0)) + 1. 4 Evaluate 5 + (-1 - 3 - 1) + 3. 3 Calculate 0 - (-6 - -6 - -3) - -5. 2 Evaluate -8 - -10 - (-1 + (-4 - -10)). -3 Calculate 7 + (-9 - -2) - -2. 2 What is -5 + (2 - (-3 - -2)) + -2? -4 What is (1 - -16) + -9 + 1 + 1? 10 What is 3 + -2 - (4 - (2 - 1))? -2 Calculate 5 - (6 + 6 + -4). -3 What is the value of 1 - 1 - (2 + -2)? 0 Evaluate 10 + (-14 - -8) + -7. -3 What is 8 + -8 - 7 - -11? 4 What is the value of 2 - (1 - (-2 + 2))? 1 What is the value of (-9 - -8) + -1 + (1 - 0)? -1 0 + 6 - 8 - (1 - 1) -2 Calculate (-9 - (-3 + -1)) + 4. -1 Evaluate -1 - -3 - (4 + -6 + 8). -4 What is the value of 1 + 0 + -4 + 8? 5 What is the value of 6 - (-3 - (-2 + -5))? 2 Calculate (-9 + 6 - 0) + 3. 0 Evaluate -1 + (3 - (-3 + 4)) + 2. 3 (1 - 1) + -3 + 2 -1 Calculate 11 - 0 - ((-1 - -5) + 2). 5 What is -1 - (4 - (2 + 3 + -4))? -4 Evaluate (-54 - -51) + (-1 - -3). -1 -41 + 49 + (0 - 2) 6 What is the value of -1 + (-2 - (3 + (-14 - -4)))? 4 Calculate (7 - 5) + 0 - (1 + -1). 2 (-7 - -4) + -5 + (2 - -2) -4 What is -1 + (-1 - 1) - 3 - -2? -4 Calculate 4 - (3 + -4 + 0). 5 What is -2 + 3 + -4 + -2? -5 What is the value of (-4 - -1 - -3 - -2) + 0? 2 Calculate 3 - (-7 - -16 - 6). 0 What is the value of (0 - 1) + (4 + -8 - -7)? 2 (-9 - -1) + (-53 - -56) -5 Evaluate -14 + -9 + (6 - -12). -5 Evaluate (2 + -2 - 1) + -1 + 2. 0 What is the value of (34 - (7 + 20)) + 3 + 1? 11 Calculate 2 + (-3 - (7 + 0)) + 3. -5 What is the value of -6 + -3 - (-2 - 0)? -7 Evaluate 18 + -22 + 8 + 0. 4 What is 12 - 8 - (14 + -4)? -6 Calculate 6 - 1 - ((-3 - -13) + -1). -4 What is (-5 - (-3 + -2)) + 3? 3 What is 5 - (9 + -8 - (-6 + 1))? -1 -5 - (-1 - (8 + -4)) 0 Evaluate (-2 - 1) + 2 + 13 + -7. 5 Evaluate 4 + (5 - 1 - (7 + -2)). 3 What is the value of 6 - ((10 - 3) + 8)? -9 What is the value of -1 + 5 + 0 + 1 + -5? 0 What is the value of -4 + -4 + 7 - 1? -2 Evaluate 1 + -2 + 0 + 2. 1 (0 - ((-2 - -1) + -3)) + -2 2 Calculate 9 + 4 + -4 + -5. 4 What is 3 + 1 - (2 - (-8 + 3))? -3 5 - (-4 + 1 + -4 + 14) -2 What is -2 + 7 - (-5 + 5)? 5 What is the value of 0 - (-7 + -4 + 8)? 3 What is the value of -1 - ((13 - 13) + -7 + -3)? 9 1 - (9 - (2 - 1 - -6)) -1 What is the value of 1 - 2 - (4 + -1)? -4 5 + -8 + 6 + -9 -6 Evaluate 4 + (-4 - -7 - 11). -4 Calculate -22 - (-17 - 4) - (7 - -1). -9 What is 6 + -1 + (-8 - -4)? 1 Calculate 6 + -9 + 1 + 1 + -1. -2 Calculate -19 + 32 - (17 - 5). 1 Calculate -11 - (9 - (-2 + 20)). -2 (0 - (4 + -5) - 8) + 0 -7 What is the value of -2 + 0 + (2 - -3) - -1? 4 What is the value of 2 + 3 + 1 + -4? 2 What is -10 - -19 - 5 - 5? -1 Calculate -4 + 7 + -6 + 3. 0 What is (18 - 12) + (2 - 6) + 0? 2 (4 - (5 - (5 - 2))) + -5 -3 What is (0 - 0 - -2) + (7 - 10)? -1 Calculate -36 - -36 - (4 - 0). -4 -6 - (-19 + -4 + 12) 5 What is the value of 10 + -2 - (43 + -33)? -2 What is -6 - -2 - ((-14 - 0) + 11)? -1 -1 + (3 + 10 - 5) 7 What is 4 - (0 + -4 + 3)? 5 What is the value of -5 + -3 + (2 - -5)? -1 What is the value of 6 - (-3 + 6) - (-3 - -4)? 2 What is the value of -158 + 157 - (1 - -1)? -3 8 - 10 - (-13 - (-3 - 1)) 7 -8 + 7 - (-5 - -1) 3 Calculate (0 - (-4 + 4)) + -5. -5 What is the value of -6 + (5 - 3) + 9? 5 (14 - 14) + -1 + 6 5 Evaluate -6 - ((2 - 2) + (-12 - -6)). 0 What is 6 + 0 + (8 - 8)? 6 What is 5 - (5 + 7 - 3)? -4 What is (-2 - 0) + (-20 - -11) + 11? 0 Calculate 6 - (-3 + 9 + 2). -2 What is the value of 11 + -18 + (-1 - 2 - -16)? 6 What is the value of 0 + 8 + -5 + -9? -6 Calculate (-14 - (-5 + 1)) + 8. -2 4 + 1 - (-11 - -17) -1 Calculate 0 + 3 + 1 + -7 - -4. 1 -2 + (-1 - 4) + 10 3 Evaluate -77 + 80 + (-3 - 1 - 1). -2 What is the value of 0 - (4 - (-1 - -9))? 4 What is (-4 + 10 - 8) + 3? 1 Evaluate -5 + 12 - 1 - 0. 6 What is the value of 9 + (3 - 7) - 4 - 4? -3 Evaluate 3 + (5 - 5) - 2. 1 What is (10 - 6) + -4 - -6 - -2? 8 What is the value of (-9 - -4 - (-1 - 2)) + -1? -3 -1 + 5 - (1 - (1 - 8)) -4 Evaluate -13 + (-9 - -5 - -12). -5 What is the value of -3 + (66 - 54) + (1 - 3)? 7 Evaluate 2 + -6 - (3 + -4 + 1). -4 Evaluate -5 - (-10 + (3 - 3)). 5 -7 - (7 + 1 - (-3 - -16)) -2 Evaluate 19 + -10 + 0 + -2. 7 Evaluate -5 - (3 + 2 + -11). 1 Evaluate -21 - (5 + -16) - (-2 + 0). -8 Calculate 4 - (6 - (-5 + 4)). -3 What is -1 + -8 - (123 + -137)? 5 (6 - 1) + 0 + -3 2 Calculate 7 + -1 - (-31 + 15 - -23). -1 2 - 1 - (29 + -23) -5 What is -11 + 17 + -6 + -6? -6 Evaluate -10 + 3 + 3 + 7. 3 What is the value of 8 + (3 - 8 - -3)? 6 1 - (8 - (-2 + 5)) -4 (-1 - 1) + -5 + (3 - -2) -2 Calculate 4 + 5 + 1 + -13 - 1. -4 What is the value of 2 + 1 + (-1 - -4 - 3)? 3 Evaluate -3 + 3 + 2 + -3. -1 What is (-4 - -8) + -11 + (5 - -9)? 7 What is the value of (2 - (-2 + 2)) + 0 + -7? -5 What is 3 + (-12 + 8 - -6)? 5 4 + 1 + -19 + 19 5 What is the value of 4 + (0 - (5 - 6))? 5 -2 - -1 - 3 - (13 + -18) 1 What is the value of 0 + -1 - (-3 - 3)? 5 Calculate -4 - (1 + (6 - 9 - 10)). 8 -6 + 14 + -6 + -7 -5 What is 13 + -12 + (1 - 1)? 1 Calculate -18 + (-17 - -39) - (2 - 0). 2 What is 1 - 0 - (24 + -10 + -16)? 3 What is -9 + 6 + -3 - (-4 - -2)? -4 What is the value of -9 + 4 + 2 - (0 - -1)? -4 -3 + (-8 - -8) + -1 - -4 0 Evaluate -3 - (0 + 6 + (-3 - 7)). 1 Evaluate (-28 - -33) + (-1 - 5). -1 Evaluate (1 - 0 - -1) + 0. 2 Evaluate -7 + (2 - 1) + 5. -1 1 + -5 + 7 + -4 -1 What is 1 + (-2 - -2 - (7 - 3))? -3 Calculate (-4 - (0 + 4)) + 8. 0 Evaluate (5 - 5) + (5 - 1). 4 Calculate 1 - (-4 - (-2 + -2 + -3)). -2 Calculate -4 + (1 - 4) - -6. -1 What is -3 + 2 + (3 - 2)? 0 Calculate 4 + -6 + (-4 - -5) - 4. -5 Evaluate (-6 - (22 - 12)) + 8. -8 What is -4 + -2 + -2 + -5 + 9? -4 (-2 - -3) + -2 + 1 0 -4 - ((-1 - -1) + -3) -1 Evaluate -2 + (4 - 3) + 3. 2 What is 4 - 3 - (-2 + -1 + 3)? 1 Evaluate 2 + (-5 - (3 + -3)) + 4. 1 -1 - ((-7 - -17) + -5) -6 Calculate -1 - (3 - 2 - -3) - -3. -2 What is -2 + 11 - (111 - 112)? 10 -5 + (3 - -5 - 5) + 2 0 What is the value of -7 + 0 + -10 + 15? -2 -2 + -1 - (-17 - -13) 1 Calculate -45 + 52 - (1 - -10). -4 What is the value of -12 + 10 + (-2 - 0 - -6)? 2 What is -1 + 5 - (45 + -40)? -1 What is the value of 5 - -1 - 10 - (1 - 4)? -1 (-5 - -2) + (2 - 7) -8 What is the value of (-3 - 1) + (10 - 7) + 4? 3 -1 + 1 + -2 + 5 3 Evaluate -27 + 23 - ((-6 - -1) + 0). 1 What is the value of (-4 - -6) + (-1 - (3 + -2))? 0 Evaluate 18 + -3 + -6 + 4 + -5. 8 Evaluate 3 - 3 - (1 + 0). -1 What is -2 - (1 + -4) - (-1 - -4)? -2 Calculate 7 - 5 - -1 - 0. 3 Evaluate -2	{ "pile_set_name": "DM Mathematics" }
- 0 - -2. 12 Let c = 2347 - 63326/27. Find the common denominator of c and 41/321. 2889 Find the common denominator of -4/105 and 795/(-63)(85/100)/17. 420 Suppose y - 36 = -2p + 3, -3y + p + 96 = 0. What is the common denominator of -14 and (-1437)/264 + (-6)/y? 8 Suppose 3w - 2 = -2s, 4s - 4 = w - 14. Let a = 55 - 55. Suppose a = y - 5z, -3 = -5z + wz. Calculate the smallest common multiple of y and 2. 10 What is the common denominator of -23/6 and 782/(-224) + 52/(-91)? 48 Suppose 4g = -g + 55. Let v = -5 + g. Suppose -v = 2q - 5q. Calculate the smallest common multiple of q and 2. 2 Let c = 20 + 34. Calculate the least common multiple of 36 and c. 108 Let y = -13975171057559 + 124784302512317074/8929. Let f = y + -15609. Let g = f - -848239/71432. Find the common denominator of g and -21/2. 8 Let k(w) = 2w3 - 3w*2 - 3w + 4. Calculate the smallest common multiple of 60 and k(3). 660 Let u = 418/3 - 144. Find the common denominator of u and (-339)/210 - 4/(-10). 42 Let v = 8 + -6. Suppose 4w + 9 = 3o, -vo = o + 4w - 33. Suppose 3t = -2t + 50. Calculate the lowest common multiple of o and t. 70 What is the common denominator of -101/176 and 306/44 + ((-42)/6 - -4)? 176 Let a be 158/444 - 4/24. Let u = a + -1663/185. Find the common denominator of (6/(-9))/(2 - 408/207) and u. 5 What is the least common multiple of 776/6 - 6/(-9) and 20? 260 Let t(n) = 3n3 + 3n*2 - 5. Let i be t(-3). Let h = i + 87. What is the least common multiple of h and 32? 224 Let i = -329255670 + 1372008396199/4167. Let p = i - 21/926. Calculate the common denominator of p and 87/20. 180 Let q = -50813/72 - -707. What is the common denominator of q and 67/240? 720 Let c = -11 + 19. Suppose -4y + 56 = 5g, -2g + 36 = 4y - c. What is the smallest common multiple of y and 6? 18 Let h = 1851/376 - 14/47. Let t = -62177/120 + 2578/5. What is the common denominator of t and h? 24 Suppose 12 + 4 = n. Let o be ((-12)/(-8))/(((-18)/(-8))/3). Suppose -1 = -l, -oy - 2y = -l - 167. Calculate the smallest common multiple of n and y. 336 Suppose -3b + 2403 = 3a, 396 = b + 2a - 402. Calculate the least common multiple of 10 and b. 4020 Let m be ((-2)/(-4))/((-14)/1848). Let q = 101 + m. Suppose -4i = -5 - q. What is the least common multiple of 5 and i? 10 What is the common denominator of 29/135 and 2779/210 - 7 - 9? 270 Let t = -20/153 + -383/306. Find the common denominator of -45/14 and t. 238 Let w = 6241 + -149731/24. What is the common denominator of w and -121/40? 120 Let x = 174 - 244. Let p = x + 88. What is the least common multiple of p and 9? 18 Suppose 3 = -10o + 113. Calculate the common denominator of 2/((-176)/(-30))(-17 + o) and 115/18. 198 Let d(n) = n3 - 5n*2 + 5n + 14. What is the smallest common multiple of 48 and d(10)? 2256 Let l(g) = g*3 + 5g*2 + 5. Calculate the lowest common multiple of l(-5) and 181. 905 Let u = -203 - -205. Calculate the least common multiple of u and 90. 90 Calculate the smallest common multiple of 28 and 1070/80 + -13 + (-5306)/(-16). 2324 Suppose 9 = 3s - 0. Suppose sr + r = -2x + 62, 0 = -2x - 10. Calculate the lowest common multiple of 28 and r. 252 What is the common denominator of -5 - (-1 - (-1)/54-308) and -53/12? 108 Calculate the smallest common multiple of (-2 - (-55)/(-10))/((-5)/40) and 60. 60 Let s = -3/1241 - -31091/27302. Let k = -34085/12 - -2837. What is the common denominator of s and k? 132 Let f = -5432 + 5393. Let d = -44 - -480. Calculate the common denominator of d/(-154) - (-2)/7 and f. 11 Let g(i) = -i + 10. Let t = -113 - -212. What is the smallest common multiple of 2/9 - (-869)/t and g(5)? 45 Let u be 757910/3696 + (-14)/(-77). Let y = 1395/7 - u. What is the common denominator of y and 161/30? 120 Suppose 5f - 80 = -20. Let r(g) = -g. Let a(s) = s - 1. Let v(m) = -4a(m) - 5r(m). What is the smallest common multiple of f and v(4)? 24 Let d(n) = -n3 + 5n*2 - 3n - 1. Let x be 2/(-11) - (-138)/33. Let o = 41 + -30. Calculate the least common multiple of d(x) and o. 33 Suppose 0 = 3h + h - 8. Suppose 4o - 3f = 35, -hf = 3f + 5. Calculate the lowest common multiple of o and 4. 8 Suppose 9 = x - 4l, -3x = 4l - 0l - 27. Let o be (6/x)/(1/(-6)). Find the common denominator of 212/(-54)6/o and 43/11. 99 Let f = 32 - 17. What is the smallest common multiple of ((-30)/(-4))/(-108/(-320)) and f? 30 Let m be (6/9)/(872/300). Let j = m + -3986/3597. What is the common denominator of j and 145/24? 264 Suppose 0 = -2x + 3 - 13, -5l - x + 105 = 0. What is the least common multiple of 254 and l? 2794 Suppose b + o - 43 = -2o, -2o = 8. What is the smallest common multiple of b and 65? 715 Let a(g) = 3g + 2. Suppose 4q - 87 = -l, 0 = 3l - 0l + 3. Calculate the least common multiple of q and a(6). 220 Let u(a) = -a2 + 12a + 48. Calculate the lowest common multiple of u(14) and 50. 100 Let d(h) = h - 1. Let f be d(3). Suppose -5p + fp = -42. What is the smallest common multiple of p and (-1)/(11/(-22))? 154 Let s be 4/10 + 1211/35. Suppose -z - s = -3l, -z = -3l + l + 24. What is the smallest common multiple of 11 and l? 11 Suppose 2o + 2184 = -2688. Let x be -3(-3 - o/(-9)). What is the common denominator of x/(-220) - 10/(-55) and -31/18? 180 Suppose 12x + 96 = 444. Suppose -5o = 15, -2o + x = 5g - 30. Calculate the least common multiple of 5 and g. 65 Calculate the lowest common multiple of 22 and 8/(-124) - (-24000)/93. 2838 Let a be (-4)/(-3)(-2 + -1). Find the common denominator of (-38)/(-18) + -11 and 1/a + (-1385)/(-180). 9 Let m = 16 + -7. Calculate the lowest common multiple of 27 and m. 27 Let r = -34 + 50. Let d = r - 7. Calculate the least common multiple of d and 6. 18 Suppose 16 = 3y + 2d, 0y = 2y + 3d - 4. Let i = -2 + 4. Suppose 2s = i + 2. Calculate the lowest common multiple of s and y. 8 Suppose 12x - 7x - 230 = 5o, 58 = x - 4o. What is the lowest common multiple of 36 and x? 252 Suppose 2u + 18 - 48 = 0. Let q = -2894 + 2895. Calculate the lowest common multiple of u and q. 15 Let f(g) = 3g2 - 36g + 132. Calculate the least common multiple of 12 and f(10). 72 Let t be 63380/3270 - (-1)/3. Let j = t + 15/436. Find the common denominator of 73/8 and j. 8 Suppose -3o + 58 = 2w, -3w = -3o - 6w + 57. What is the lowest common multiple of (66/3 + -1)/(63/42) and o? 140 Let p = 34 - 25. Suppose 0 = -pb + 10b - 6. What is the least common multiple of b and 4? 12 Let f = -20 + 16. Let o be (f + 0)/(-4)3. What is the lowest common multiple of 6 and (3/o)/((-2)/(-6))? 6 Suppose -65j + 101 = -419. Let b(k) = -k2 - 4k - 1. What is the smallest common multiple of j and b(-3)? 8 Let f(j) be the third derivative of j*5/60 - 5j*3/6 - 16j*2. What is the smallest common multiple of 3 and f(3)? 12 Let k = 38 - 16. Suppose 0 = 4x + w - 45, -x + 23 = 5w - 12. What is the smallest common multiple of k and x? 110 Let i = -15 - -27. Let b(q) = q2 - 137q - 692. Calculate the smallest common multiple of i and b(-5). 36 Let i(a) = -9a3 - 4a2 + a + 1. Let x be i(1). Let b(h) = h2 + 12h + 19. What is the smallest common multiple of b(x) and 92? 184 Suppose 5f = 3f + 68. Let n = -24 + f. Calculate the least common multiple of 96/n + 24/60 and 8. 40 Let h(a) = 26a*3 - 7a*2 + a. Calculate the lowest common multiple of 18 and h(3). 1926 Let u be ((-12)/15)/(4/(-10)). Suppose 0c + 6 = c - 3l, 5l + 13 = uc. What is the lowest common multiple of 9 and (10/15)/(1/c)? 18 What is the common denominator of 33/12(1-35)/(-5) and 388/(-5)(-1)/8? 20 Let z = -224795/18 - -12494. Find the common denominator of -19/156 and z. 468 Let l = -8883/4 + 2208. Find the common denominator of 59/36 and l. 36 Let o = 3/7001 - -61509/3500500. Find the common denominator of -19/10 and o. 500 Let s = -507717445/320748 + 15/53458. Let n = 1584 + s. What is the common denominator of 53/88 and n? 264 Let c = 1/6986 - 15485/111776. Find the common denominator of c and 19/96. 672 Suppose 3n - 6 - 26 = -5y, 0 = -4n + 5y + 31. Suppose 7t = nt - 52. Let p = 17 - 7. What is the least common multiple of p and t? 130 Let w = -22 + 35. Suppose 7m + w = 48. Suppose -3l + 36 = 3b - 0l, -b + 4*l = -7. What is the smal	{ "pile_set_name": "DM Mathematics" }
Let v(s) be the third derivative of -s*5/20 + 4s*2. Let x(i) = -1735 + 864 - 29i + 871. Calculate x(v(t)). 87t2 Let w(b) = 4622b - 2296b - 2314b. Let u(j) = 4j. Give w(u(a)). 48a Let h(i) = -2i + 3 - 3 - 2. Let u = -345 - -344. Let k(t) = t - 1. Let n(o) = uh(o) - 3k(o). Let a(c) = -2c*2. Determine a(n(d)). -2d*2 + 20d - 50 Let f(i) be the second derivative of -23i5/15 + 21i2/2 + i - 13. Let m(s) be the first derivative of f(s). Let j(b) = b2. Give m(j(y)). -92y4 Let k(z) = -5z. Let o(x) = -13758561x2. Calculate o(k(l)). -343964025l*2 Let c(p) = -p. Let w(l) = -721l*2 - l + 91179. What is c(w(x))? 721x*2 + x - 91179 Let t(s) = 155s - 429s + 274s - 133s2. Let r(v) = -11v. Determine t(r(k)). -16093k2 Let c(n) = 1073121n + 2. Let j(p) = -6p2. Calculate c(j(b)). -6438726b*2 + 2 Let y(v) = -v. Let f(x) = -6x + 26159. Give y(f(q)). 6q - 26159 Let i(o) = 20o*2 - 8o*2 + 4o*2 - 7o*2. Let f(u) = -9u + 2. Determine i(f(g)). 729g2 - 324g + 36 Let f(j) be the first derivative of 4j3 + 329. Let c(b) = 30b + 24. Let w(p) = p + 1. Let d(s) = -c(s) + 24w(s). Give d(f(n)). -72n2 Let a(m) be the third derivative of m4/12 - m*2. Let n(f) be the second derivative of 0f*2 + 3 + 24f - 2/3f3. What is n(a(q))? -8q Let z(l) = 107l2 - 66l - 1. Let d(y) = y - 39. Calculate d(z(b)). 107b2 - 66b - 40 Let u(w) = 2w2 - 89w - 1. Let z(b) = 297b. What is u(z(a))? 176418a*2 - 26433a - 1 Let d(s) = s*2. Let u(g) = -7g*2. Let t(n) = 4n*3 - 2n*2 - 2n - 3. Let b be t(-2). Let h(v) = bd(v) - 6u(v). Let r(m) = -89m2. Give h(r(j)). 23763j*4 Let l(r) = -2r*2 + 411r. Let o(z) = z*2 + 3383z - 6760z + 3377z. Calculate l(o(n)). -2n4 + 411n*2 Suppose 2c = 7c + 9c. Let h(k) be the third derivative of c + 22k2 + 0k + 0k3 + 23/24k*4. Let t(o) = o. What is h(t(d))? 23d Let x(r) = 2r. Let a(u) = -154179u - 43. What is x(a(n))? -308358n - 86 Let i(p) = 2336p. Let d(x) = -321523427 + 321523427 - x*2. Determine i(d(g)). -2336g*2 Let i(c) = -238394c. Let s(x) = -44x. Calculate s(i(z)). 10489336z Let y(n) = -797n2. Let b(x) = -81x*2 - x + 24. Determine b(y(m)). -51451929m*4 + 797m2 + 24 Let k(f) be the third derivative of f5/60 + 284f2 + 2. Let g(v) = -958v. What is g(k(z))? -958z2 Let u(r) = -2r*2 + 2r - 51. Let m(y) = -6872y + 13689y - 6815y. Calculate u(m(a)). -8a*2 + 4a - 51 Let q(m) = 272m - 67m + 164m + 222m. Let s(c) = 2c2. Give q(s(n)). 1182n*2 Let u(k) = -1343k*2 - 44k - 2. Let x(y) = -3y + 41. Determine x(u(j)). 4029j*2 + 132j + 47 Let u(o) = -6o2. Let d(j) be the second derivative of -23 - 11/6j*4 + 0j*2 - j + 0j*3. Determine u(d(f)). -2904f4 Let q(g) be the second derivative of g4/3 + 2g2 - 1795g. Let w(p) = -2p2 - 25p + 25p. What is q(w(b))? 16b*4 + 4 Let l(w) = 12w. Let a(b) = -12b + 14 - 12 + 18b. Determine a(l(z)). 72z + 2 Suppose 2b + 0z = 2z, 4b = z. Let n(y) = -2 + 2y + b + 1. Let j(u) = 3u2 - 4. Let s(h) = -17h*2 + 22. Let g(t) = 11j(t) + 2s(t). Give n(g(i)). -2i*2 - 1 Let n(p) be the second derivative of -17p*4/12 - 228275p. Let l(q) be the second derivative of -3q4/2 + q. What is l(n(f))? -5202f4 Let z(t) be the third derivative of -t4/4 - 2186t2 - t. Let h(o) = 1308o*2. Give h(z(m)). 47088m*2 Let v(l) = l + 1. Let s(n) = 63n + 28. Let b(a) = -s(a) + 28v(a). Let p(o) = -1472 + 0o*2 + 2917 - 3o*2 - 1445. Calculate b(p(f)). 105f*2 Let n(q) = -12q. Let m(h) = 26h2 + 20h. Let j(v) = -14v - 11v*2 + 20v + 19v2. Let s(z) = 10j(z) - 3m(z). What is s(n(r))? 288r*2 Suppose -b = -0b - 2. Let i(j) = -782 + 782 - 3j2 - 3j*b. Let u(d) = 4d. Give i(u(k)). -96k2 Let j(d) = 975911 - 975911 + 2d*2. Let h(a) = 28a. Give h(j(p)). 56p2 Let w(a) = 9a + 3383. Let d(y) = 17y2. Give w(d(z)). 153z*2 + 3383 Let v(q) = q. Let n(s) = 3s. Let b(p) = -n(p) + v(p). Let z(c) be the first derivative of 3c3 + 4c*3 - 2c*3 - 10 - 3c*3. What is z(b(k))? 24k*2 Let s(z) be the second derivative of -65z*4 - 1110z + 3. Let k(p) = -3p. Determine s(k(i)). -7020i*2 Let o(t) = -5t*2. Let b = 84 + -71. Let x(k) = -13 + 3k2 - k2 + 2k2 - 13k. Let c(n) = -2n2 + 6n + 6. Let j(q) = bc(q) + 6x(q). What is j(o(r))? -50r4 Let j(n) = 2n*2. Let o(g) = -4793223g - 1. What is o(j(a))? -9586446a2 - 1 Let a(f) = -2f*2. Let w(m) = -288282 - 4m + 144129 + 144105. Give a(w(c)). -32c2 - 768c - 4608 Suppose -16r = -13r + 6. Let x be r/4 + 133/14 - 0. Let p(z) = 21z2 - 13z*2 - xz*2. Let q(i) = -3i*2. What is q(p(u))? -3u*4 Let z(k) = -2k*2 + 2k + 2. Let c(r) = 2r2 - r - 1. Let j(l) = 2c(l) + z(l). Let g(t) be the second derivative of -7t4/4 + 2t. What is g(j(o))? -84o4 Let x(h) = 46 + 43 + 3h - 89. Let l(y) = 24y + 3y - 2y. Give l(x(d)). 75d Let j(t) be the second derivative of 0 + 1/60t5 + 0t*3 + 17/2t*2 + 0t*4 - 14t. Let y(k) be the first derivative of j(k). Let c(w) = -w. Give c(y(i)). -i*2 Let c(x) = -2x*2 + 36x + 519. Let h(u) = u. Determine h(c(m)). -2m2 + 36m + 519 Let k(n) be the second derivative of n4/3 - n2 - 81n. Let t(x) = 1. Let s(p) = -k(p) - 2t(p). Let c(u) = -9u. What is s(c(q))? -324q*2 Let v(c) = -100c*2 + 283c*2 - 99c*2 - 87c*2. Let z(p) = -2p - 86. What is z(v(m))? 6m2 - 86 Let t(v) be the third derivative of -13v*5/5 - 2118v*2. Let q(z) = 3z + 6. What is t(q(k))? -1404k2 - 5616k - 5616 Let a(w) = w*2 - 94w - 1. Let s(j) = -2j + 695. What is a(s(v))? 4v*2 - 2592v + 417694 Let o(r) be the third derivative of -r*4/8 + 347r*2. Let y(g) = -2g + 36. Give y(o(w)). 6w + 36 Let g(v) = 4v*2. Let r(f) = 14f + 367. Let j(c) = 5c + 116. Let t(q) = 11j(q) - 4r(q). Determine t(g(o)). -4o*2 - 192 Let l(n) be the second derivative of 13n*4/12 + 3408n + 1. Let v(b) = -113b - 3. What is v(l(s))? -1469s*2 - 3 Let j(v) = -21v + 2v - 7v - 3v + 5v. Let t(q) = -3q. Calculate j(t(k)). 72k Let f(y) = -307y2. Let m(h) = -20230h. Determine f(m(p)). -125640640300p2 Let w(g) be the second derivative of -8g*3/3 + 4g. Let t(c) = 15c2 + 20c + 10. Let k(z) = -z*2 - 2z - 1. Let h(q) = 10k(q) + t(q). Give h(w(j)). 1280j*2 Suppose w - 5 = 3n + 2, -4n = w. Let s = w - -24. Let z(d) = sd + d + 2d + 5d. Let v(a) = a*2. Give v(z(x)). 1296x*2 Let g be (-6)/(-1)7/6. Suppose 2k - 126 = -gk. Let h(y) = -30 + 7y + k + 16. Let r(c) = -3c. What is r(h(a))? -21a Let u(m) = -375017m*2. Let p(y) = -61y. What is p(u(w))? 22876037w2 Let j(f) = -16f + 5f - 34f. Let m(x) be the second derivative of -x*3/3 + 130487x. Determine m(j(o)). 90o Let n(s) = 385s2. Let i(g) be the first derivative of g2/2 - 2731. Calculate i(n(r)). 385r2 Let l(a) be the first derivative of a3/3 + 6616. Let s(t) = 522t + 2. Determine s(l(m)). 522m2 + 2 Let c(r) = -3976957r. Let q(n) = n. Calculate q(c(u)). -3976957u Let f(p) = -p. Let y(k) = -2405k + 311. Give y(f(b)). 2405b + 311 Let c(j) = 12j2 - 55. Let p(o) = -o2 + 5. Let v(r) = c(r) + 11p(r). Let h(k) = -367k*2. Give v(h(n)). 134689n*4 Let u(x) = 6209x*2. Let d(g) = 4193g. Calculate d(u(j)). 26034337j2 Let a(k) = -k2 - k - 15397. Let j(o) = -110o*2. Determine a(j(g)). -12100g*4 + 110g*2 - 15397 Suppose -3j - 21 = -10j. Let l(t) = -11t - 1 - j + 4. Let d(i) = i + i + 6i - 5i. What is d(l(n))? -33n Let l(v) be the first derivative of -5v*2/2 - 5807. Let t(u) = -12u*2 + 6u. What is t(l(b))? -300b2 - 30b Let a(t) = 5t2 + 3. Let m(o) = 49o - 5. Let x(b) = 29b - 3. Let c(n) = -3m(n) + 5x(n). Calculate c(a(v)). -10v2 - 6 Let j(v) be the second derivative of v4/12 - v*3/3 + 3v*2/2 - v. Let u be j(0). Let h(q) = 2q + uq - 11q - 7q. Let t(o) = -2o. Determine t(h(x)). 26x Let n(k) = -113k*2. Let o(p) = -5p*2 + 4p - 4. Let r(s) = s + 8s2 - 3 - 2s + 4s - 11s*2. Let j(i) = 3o(i) - 4r(i). Give j(n(x)). -38307x*4 Let t(u) = 2u*2 - 296. Let c(x) = -259x - 338. Calculate c(t(a)). -518a2 + 76326 Let g(x) = -19x. Suppose 3t - 4b = 3510, -1535 - 805 = -2*t	{ "pile_set_name": "DM Mathematics" }
u + 4u + 4u. u Expand (-1 + 1 + 3)(-f - 2f + 2f). -3f Expand (q5 - 4q*5 + 2q*5)(1 - 3 + 4 - 6 + 4 + 1 + 0 - 1 + 0 + (-3 + 2 + 0)(0 - 2 + 0) - 4 - 2 + 5 - 3 + 2 - 1). q5 Expand ((-g + g - 2g)(3 + 2 - 3) + 2g - g + 0g)((7 + 1 - 1)(-4 + 0 + 2) + 0 + 2 - 3). 45g Expand (0 + 2 + 0)(4 + 4x - 4) - x + x - 2x + (1 - 3 + 4)(-2x + 3x + x). 10x Expand (17 + 14 - f - 11)(2 - 3 + 0)(0 - 2 + 0). -2f + 40 Expand (3 - 4 + 2)(5a - a - 2a) + 6a - 2a - 2a - 4a + a + 5a + 3a - 6a + 4a. 7a Expand (1 + 1 - 4)(0q - 2q + q) - 3 + 3 + 2q + (-q + 2q + q)(2 - 2 - 1) - 2q - 4q + 5q - 1 + 1 - 2q + 3q + 2q - 6q - q + 4q - 2q. -q Expand (-3 + 3 + 3)(0p + p + 0p + (2 + 0 - 4)(-2p + 0p + p) - 3p + 0p + 4p). 12p Expand (x - 2x*2 - x)(8 + 2x - 8 - x + 2x + 0x + 2x - 3x + 0x + (-2 - 1 + 1)(-2x + 5x - x)). 4x*3 Expand (-4 + g + 4)(g - g + 3g)(4g - 3g - 2g + (-4 + 3 + 7)(6g - 2g - g)). 51g3 Expand (1 - 4 + 1)(4x2 + 5x + 12x - 8x). -8x2 - 18x Expand (-13 + 29 - 33h - 18)(5h3 - 3h*3 + 0h*3). -66h*4 - 4h3 Expand (b2 + 5b2 + 0b*2 + (-4b + 0b + 3b)(-b + 2b - 3b))(5b + 3b + 3b). 88b3 Expand (l2 - 3 - 3 + 3 + l)(5l + 6l - 6l). 5l3 + 5l*2 - 15l Expand (-7j3 + 6j*3 + 20j*3)(0j - 3j + j) + (-j*2 + 2j - 2j)(3j2 - j2 - j2). -39j*4 Expand (4 - 4z - 4)(-4z + z + 2z + (1 + 1 + 0)(-2z - 3 + 3)) - 5 + 2z*2 + 5. 22z2 Expand (-u2 - u2 + u2)(5 - 5 + 7 + 3 + 3 - 4 - 2 - 2 + 5 + (1 - 4 + 4)(2 - 2 - 2)). -8u2 Expand (2a*2 + 4a*2 - 4a*2)(391 - 391 - 10a + (1 + 0 + 0)(-2a - 1 + 1)). -24a*3 Expand (4 - 4 + 1)(-k2 - k2 + 3k2)(-2 + 2 + 3k3). 3k*5 Expand (1 + 1 + 5i - 4i)(4 - 5 + 16i - 22i). -6i2 - 13i - 2 Expand (3r + 15r - 14r)((0r + 2r - r)(-3 + 2r*2 + 3) - 2r3 + r3 + 3r3). 16r*4 Expand (2i4 - i4 - 4i4)(-2i - 3i + 3i) - 2i5 - i5 + i*5. 4i*5 Expand 2 - 10h - 1 + 18h + (2h + 2h - 2h)(-2 + 0 + 0). 4h + 1 Expand (-8 + 10 - 12)(z + 5z - 5z)(-3z3 - 2z*3 - 2z*4 + 3z*4). -10z*5 + 50z*4 Expand 0v - 2v - 1 + 4v + 2v + 4v + 3v + (1 - 1 + 2)(0 + 0 + 2v) - v + 3v - v. 16v - 1 Expand (3l + 0l - 4l)(-3 + 2 + 4)(-4l2 + 8l2 + l2 + l). -15l3 - 3l*2 Expand (0s + 2s - s)(5s3 - 4s*3 - 3s*3) + 2s*2 - 2s*2 - 2s*4 + (-s + 2s + 0s)(5s3 - 3s*3 - 3s*3). -5s*4 Expand (-2 + 7 - 2)(0w - 7 - 3w + 8). -9w + 3 Expand -3o*3 + 5o - 5o + (o2 + 0o*2 + 0o*2)(2o - 3o - o) - o*3 + 0 + 0 + 37o*2 - 37o2 + o3 - o. -5o3 - o Expand (-4v*3 + 4v*3 + 3v*3)(1 + 1 + 2)(-2v + v + 3v). 24v*4 Expand (6u*2 - 2u2 - u2)(-4 + 2 + 5)(2 + 0 - 5). -27u2 Expand (-3q5 + q4 - q*4)(-7 + 2 + 3) - q*5 + 0q5 - q5 + 3q4 - 3q*4 + 3q*5. 7q*5 Expand (-2r + 2r + 3r)(-r2 + 3r2 - r2 + (1 - 6 + 4)(0r*2 + 0r2 - r2) + r*2 + 0 + 0 - 4r*2 + 2r*2 + 0r*2). 3r*3 Expand (-24 - 15g + 24)(3 + g - 3). -15g2 Expand (t2 + 3t2 + t + 0t*2)(-2t + 1 - 1). -8t*3 - 2t2 Expand (o3 - 23o + 23o)(-5 + 5 - 3). -3o*3 Expand (3x - 5x + 3x)(0x + 5x - x - x + 1 - 1 + 1 - 1 - x + (-5 + 3 + 1)(3x + x - 3x) - 1 - 2x + 1). -x2 Expand 1 - 1 - q2 + (2q2 + q2 + 2q2)(-6 - 2 + 3) - 2q + 2q*2 + 2q. -24q2 Expand (0m*2 + 2m2 - m2 + 5m2 - m2 - 3m*2 + (2m + 2m - 5m)(-6m + 4m + m) - 3 + 3 + 2m2 + 0 - m2 + 2 - 3)(0m*2 + 4m2 - m2). 12m4 - 3m*2 Expand 0n*3 + 0n3 + n5 + (-2n - 2n + 3n)(-6n4 - 7n + 7n). 7n*5 Expand (0 + 2 - 1 - 1 - 2 + 4 + (-3 - 3 + 5)(1 - 2 + 2))(-5o*5 + 3o*5 + 3o*5) - 2o*5 + 6o*5 + 5o*5. 10o*5 Expand (-2x + 5x + 2x)(2 - 1 + 0 + 0 + 4 - 5 - 3 + 4 + 1 - 5 - 1 + 4 + 0 + 2 + 0 + (0 - 4 + 2)(1 + 1 - 1) - 14 + 1 - 5). -90x Expand (-3u2 + u2 + 0u2)(-6 + 2 + 2) - 2u2 + 1 - 1 + 2 + 2u - u + u*2 + 0u2 - u2 - 6u2 + 5u2. u2 + u + 2 Expand (-9 - 6 + 4)(-1 - 5m - m + 2m + (m - 3 + 3)(0 - 2 + 0)). 66m + 11 Expand (-2l2 - l2 + 2l2)((-2 + 1 + 3)(-1 - 2 + 2) + 3 + 5 + 0). -6l*2 Expand (-1 + 6 - 6 + (-3 + 3 + 2)(4 - 1 + 1))(3 - 2 - 2)(0 + 3v + 0). -21v Expand (-6m - m + 2m)(-5 + 1 + 5)(0 + 2 + 1)(-m + 2m + m). -30m2 Expand (-128 + 128 - a)(-2a - 1 - 4 + 4). 2a*2 + a Expand (4 + 2 - 1)(6j - 4j + 3j). 25j Expand (1 - 2p4 - 1)(-4 + 0 - 2)(1 + 1 - 1)(0p + 4p + 4p). 96p*5 Expand (4a*3 - 2a3 - a3)(-4a + 0a + 5a) + 5a4 - a4 + a4. 6a*4 Expand (0v*2 - 3v*3 + 2v*3 + 3v*2)(-1 + 2 + 1). -2v3 + 6v*2 Expand (2l - 6l + 3l)(4 - 4 + 1)(-2l + 0l + 4l) + l2 + 0l*2 - 2l*2 + (2 - 2 + 2l)(-5l + 3l + l). -5l*2 Expand (4w*2 + 2w*2 - 4w*2)(-3w + 17w + 2w)(-w - 3w + w). -96w*4 Expand (1 + 0 + 1)(-1 - 1 + 4)(0c3 + c3 + 2c3). 12c*3 Expand (-4q*2 - 477q + 477q)(-2 + 1 - 1) + 2q - 2q - 2q2. 6q*2 Expand (-3s*3 + 2s*3 + 2s*3)(2s - 26s + 0s) + (-2s*2 + 2s*2 - 2s*2)(-2s2 - s2 + 5s2) - s4 + 2s4 + s4. -26s4 Expand (-m3 + 0m2 + 0m*2)(-m*2 - 5m*2 + 4m*2) + 112m + 48m5 - 112m + 3m - m5 - 3m. 49m5 Expand (-b2 + 0b*2 + 0b*2 + (2b + 2b - 2b)(b + 5b - b))(-7b - 2b3 + b3 + 3b). -9b5 - 36b*3 Expand -3s*4 + 4s*4 - 3s4 + (s3 + 0s3 + s3)(-4s - 3s + 3s) - 2s*4 + 2s*4 - 2s*4 + 0s*4 + 4s*4 - 2s*4. -10s*4 Expand (17a*3 - 18a*3 - 10a*3)(-3a2 - 2a*2 + 4a*2). 11a*5 Expand (-2z + 2z - z)(-6z4 + 13z*4 - 6z4). -z5 Expand (7 - 14 + 8)(0w - 3w + w). -2w Expand -2k3 - 1 + 1 + (-3k + 2k + 0k)(-1 + 1 + k2) + 5k - 3k3 - 5k + (k*2 + 2k*2 + 3k*2)(4k - 4k - 2k). -18k3 Expand (w4 - 5w4 + 3w*4)(-1 - 1 + 3) + 7w4 - 10w*4 - 29w*4. -33w*4 Expand -2p*2 + 4p*2 + 3p*2 + (0 - 1 + 2)(4p - p - p)(-p - 2p + 5p). 9p2 Expand (26 - 20 + 149)(0 - 2o + 0)(-3 - 1 + 2). 620o Expand 10y4 + 5 + y - 5 - y4 - 2y2 + 2y*2 - 2y4 + y3 - y3 + (-y2 + y - y)(2y - 2y2 - 2y) + 0y4 + 3y4 - y4. 11y4 + y Expand (0 - 4 - 8)(-6y3 + 3y*3 - 6y*3). 108y*3 Expand 6h - 6h - 3h*2 + (-4 + 4 + h)(5h + 4h - 5h) + 0h2 + h2 + h*2. 3h*2 Expand 0h*4 + 4h*4 - 2h4 + h4 - 4h + 4h + (-3h + 4h - 4h)(h3 - h3 - h*3). 6h*4 Expand 2m3 + m3 - 2m3 + (4 + m - 4)(-10m2 - 3m*2 + 14m*2). 2m*3 Expand (-4 + 4 - 2q)(5q + 4 - 4q - 3). -2q*2 - 2q Expand (-5n3 + 6n - 6n)(5 - 5 - 2n)(-2n + 2n + 2n). 20n5 Expand (2 - 2 - f2)(25f*2 - 2f - 8f2 - 13f*2) + 6f4 - f4 - 2f4. -f4 + 2f*3 Expand (2 - 4 + 4)(-8g - 3g + 2g)(2 - 4 + 0). 36g Expand ((-2q - 1 + 1)(5q*3 - q + q) + 5q*4 - 7q*2 + 7q*2)(0 + 3 - 4). 5q4 Expand (-4 + 0 + 1)(g + 3g - 6g)(g - g + g2). 6g*3 Expand (4x*3 + 5x*3 - 4x*3)(-1 - x*2 + 1) + (0x - x - x)(3x*4 - 5x*4 + 0x4). -x5 Expand ((-4n - 3n + 5n)(8n - 5n + n) - n*2 + n - n)(2n2 + 0n*2 + 0n*2). -18n*4 Expand (-1 + 1 + 2f*3)(-f*2 + 3f*2 + 3f*2). 10f*5 Expand (-3b + 3b + 2b)(-b - 3b + 2b)(0 - 2b + 0 + (0 - 1 + 3)(3b + 2b - b)). -24b3 Expand (-39o*2 - 1 + 1 + (o - 2o - o)(-5o + 3o + o))(-5o + 3o + 3o). -37o*3 Expand (5f*3 - 2f3 - f3)(-45f - 11f + 5f). -102f4 Expand -3t + 2t + 0t + 3t + 0t + 0t + (3 - 1 - 4)(2t - 5t + t) + 0t - 5t + 18t. 19t Expand (-103g + 103g - 36g3)(0g - 2g + 0g). 72g*4 Expand (3 - 2w*2 - 3)(2w - 2w - 2w2) + 0w*2 + 2w*4 + 0w2 + 0 + w4 + 0. 7w4 Expand (g2 + 0g2 + g2)(6 - 4 + 0 + (-4 + 5 + 0)(-2 - 2 + 3) + 0 - 1 + 0 - 2 - 2 + 5). 2g2 Expand (0c*3 + 4c*3 - 2c*3)(3 - 7 + 2) + 4c3 - 3c*3 + 2c*3 + (2c2 - c2 + 0c2)(-2c + 1 - 1) - 51c + 51c - 4c*3. -7c*3 Expand (0w*2 + 0w2 + w2)(-w - 7 + 6 + 0). -w3 - w2 Expand 2w*2 + 12w*2 - 12w*2 + (4w - w + w)(0 - 1 + 0)(-3 + 3 - 2w). 10w*2 Expand (2 - 4 + 1)(-5 + 4 + 4)(-6 + 3 + 4)(n*2 - n	{ "pile_set_name": "DM Mathematics" }
7 is divided by 95. 92 Calculate the remainder when 7670443 is divided by 273943. 39 Calculate the remainder when 89292 is divided by 919. 149 Calculate the remainder when 3416939 is divided by 142. 135 What is the remainder when 120431197 is divided by 3364? 3361 Calculate the remainder when 432126877 is divided by 2963. 2957 What is the remainder when 51263781 is divided by 771? 762 What is the remainder when 15776610 is divided by 2781? 2778 What is the remainder when 840312 is divided by 210076? 8 What is the remainder when 3360284 is divided by 1392? 1388 Calculate the remainder when 660825 is divided by 110135. 15 Calculate the remainder when 24847 is divided by 12286. 275 Calculate the remainder when 99768529 is divided by 769. 7 What is the remainder when 26545 is divided by 5273? 180 Calculate the remainder when 308342 is divided by 44048. 6 Calculate the remainder when 476278 is divided by 3354. 10 What is the remainder when 1199610 is divided by 284? 278 What is the remainder when 1712756 is divided by 30? 26 What is the remainder when 134055 is divided by 1667? 695 What is the remainder when 570824 is divided by 10192? 72 Calculate the remainder when 220749 is divided by 8828. 49 Calculate the remainder when 241733 is divided by 1845. 38 What is the remainder when 1178757 is divided by 2286? 1467 Calculate the remainder when 1006152 is divided by 2417. 680 What is the remainder when 31248 is divided by 9920? 1488 What is the remainder when 461509 is divided by 41897? 642 Calculate the remainder when 275426 is divided by 564. 194 What is the remainder when 56440 is divided by 1026? 10 What is the remainder when 495750 is divided by 247856? 38 What is the remainder when 247803 is divided by 17006? 9719 What is the remainder when 79271870 is divided by 4403990? 50 Calculate the remainder when 1301377 is divided by 12899. 11477 What is the remainder when 5045321 is divided by 1205? 1191 What is the remainder when 102124 is divided by 110? 44 What is the remainder when 4051875 is divided by 900? 75 What is the remainder when 612330 is divided by 305967? 396 Calculate the remainder when 12568062 is divided by 6054. 6012 Calculate the remainder when 86297652 is divided by 5. 2 Calculate the remainder when 135719419 is divided by 32. 27 Calculate the remainder when 149594 is divided by 1026. 824 Calculate the remainder when 2297227 is divided by 636. 631 Calculate the remainder when 2545517 is divided by 115705. 7 What is the remainder when 50375484 is divided by 191? 189 What is the remainder when 388183797 is divided by 31? 30 Calculate the remainder when 8186931 is divided by 23. 12 What is the remainder when 31379526 is divided by 114? 0 Calculate the remainder when 855048901 is divided by 54. 49 What is the remainder when 50030 is divided by 2419? 1650 Calculate the remainder when 21574805 is divided by 2721. 2717 What is the remainder when 10004 is divided by 111? 14 Calculate the remainder when 5940296 is divided by 1485063. 44 What is the remainder when 44565 is divided by 1147? 979 Calculate the remainder when 125163 is divided by 567. 423 What is the remainder when 103879 is divided by 2814? 2575 What is the remainder when 315527 is divided by 2585? 157 What is the remainder when 313345508 is divided by 745? 743 Calculate the remainder when 56357223 is divided by 11. 10 What is the remainder when 374773 is divided by 888? 37 What is the remainder when 77586 is divided by 77516? 70 What is the remainder when 3334826 is divided by 691? 60 What is the remainder when 11028 is divided by 4222? 2584 What is the remainder when 560682 is divided by 79763? 2341 What is the remainder when 5017722 is divided by 389? 11 What is the remainder when 6489057 is divided by 44? 25 Calculate the remainder when 59200743 is divided by 2223. 30 Calculate the remainder when 56157 is divided by 182. 101 Calculate the remainder when 281890 is divided by 3277. 68 What is the remainder when 423981 is divided by 532? 509 What is the remainder when 48709460 is divided by 19? 15 What is the remainder when 132236 is divided by 66110? 16 What is the remainder when 6889880 is divided by 8? 0 Calculate the remainder when 697546 is divided by 348756. 34 Calculate the remainder when 694330 is divided by 28. 14 Calculate the remainder when 1212701 is divided by 1212584. 117 Calculate the remainder when 1560090 is divided by 15. 0 What is the remainder when 1097152 is divided by 8432? 992 What is the remainder when 20984543 is divided by 150? 143 What is the remainder when 215132788 is divided by 3842? 3840 What is the remainder when 242408 is divided by 48481? 3 What is the remainder when 2494265 is divided by 647? 80 Calculate the remainder when 11518845 is divided by 396. 393 Calculate the remainder when 5622 is divided by 2493. 636 Calculate the remainder when 46954 is divided by 3604. 102 Calculate the remainder when 15391626 is divided by 641313. 114 What is the remainder when 111663 is divided by 4449? 438 Calculate the remainder when 20876 is divided by 10333. 210 What is the remainder when 980859 is divided by 14010? 159 What is the remainder when 9915 is divided by 337? 142 Calculate the remainder when 399633 is divided by 399599. 34 What is the remainder when 187561232 is divided by 40? 32 What is the remainder when 1974198 is divided by 53355? 63 Calculate the remainder when 1242158 is divided by 155253. 134 Calculate the remainder when 14280912 is divided by 7140439. 34 Calculate the remainder when 3541638 is divided by 885390. 78 Calculate the remainder when 108213 is divided by 53975. 263 What is the remainder when 287834 is divided by 2482? 2404 Calculate the remainder when 151398888 is divided by 1487. 1470 What is the remainder when 193870212 is divided by 2461? 15 Calculate the remainder when 5054127 is divided by 10. 7 What is the remainder when 172958 is divided by 171651? 1307 Calculate the remainder when 49549977 is divided by 936. 9 Calculate the remainder when 67219418 is divided by 248. 10 What is the remainder when 212224 is divided by 70411? 991 Calculate the remainder when 566955 is divided by 31445. 945 What is the remainder when 29644120 is divided by 48? 40 What is the remainder when 613843 is divided by 107? 91 What is the remainder when 1607192 is divided by 17? 12 Calculate the remainder when 771131 is divided by 22680. 11 What is the remainder when 162928 is divided by 2625? 178 What is the remainder when 4129541 is divided by 587? 583 Calculate the remainder when 2432105 is divided by 54. 53 Calculate the remainder when 1565998 is divided by 307. 298 What is the remainder when 396111 is divided by 3634? 5 Calculate the remainder when 4367674 is divided by 144. 10 What is the remainder when 4025603 is divided by 35? 8 What is the remainder when 3650248 is divided by 178? 2 Calculate the remainder when 8095254 is divided by 460. 174 Calculate the remainder when 19735 is divided by 6301. 832 Calculate the remainder when 119140605 is divided by 32. 29 What is the remainder when 147175 is divided by 49004? 163 What is the remainder when 340200 is divided by 7210? 1330 What is the remainder when 2435576 is divided by 12? 8 Calculate the remainder when 48742788 is divided by 23. 15 What is the remainder when 116772 is divided by 1162? 572 What is the remainder when 132592 is divided by 22022? 460 What is the remainder when 284300 is divided by 2383? 723 What is the remainder when 6150974 is divided by 403? 388 What is the remainder when 218307 is divided by 16786? 89 Calculate the remainder when 79270481 is divided by 435. 431 Calculate the remainder when 524824867 is divided by 2442. 2437 What is the remainder when 36951 is divided by 5219? 418 Calculate the remainder when 2077012 is divided by 6700. 12 Calculate the remainder when 178507 is divided by 4247. 133 What is the remainder when 7476195 is divided by 48? 3 Calculate the remainder when 891866 is divided by 35. 31 What is the remainder when 718792619 is divided by 42? 41 What is the remainder when 924066 is divided by 1624? 10 Calculate the remainder when 2713765 is divided by 5527. 8 Calculate the remainder when 456 is divided by 441. 15 Calculate the remainder when 411474	{ "pile_set_name": "DM Mathematics" }
nd the third derivative of o(h) wrt h. 846 Let o be 4/18 - 70/(-9). Suppose -6 - 3 = -u - 2k, -u + 3k = 6. Find the second derivative of -8mu - 11 + 11 + om wrt m. -48m Let q(t) be the first derivative of t4/4 + 50t*3/3 - 878t - 858. What is the derivative of q(f) wrt f? 3f2 + 100f Let t(w) = -w*2 - 8w + 6. Let u be t(-8). Suppose 0q - 4q - 3j + u = 0, 3q = 3j + 15. Differentiate -2v*2 - qv2 - v2 - 4 + 0 with respect to v. -12v Let x(f) = -25f*4 - 7. Let o(r) = -56r - 26r4 + 56r - 6. Let y(k) = -6o(k) + 7x(k). Find the first derivative of y(i) wrt i. -76i3 Let h(y) = -y3 + 13y - 3y + 0y + 5. Let c(u) = -11u - 6. Let a(p) = 5c(p) + 6h(p). What is the second derivative of a(i) wrt i? -36i Suppose 2r = -3r + 10. Suppose -3k + 3 = -3. Differentiate -5m*2 + 3 + rm*2 + 0m*k - 5 wrt m. -6m Let b(f) be the third derivative of 11/120f6 + 0f*4 + 0f*3 + 0f - 8f2 + 3/20f*5 + 0. Find the third derivative of b(l) wrt l. 66 Let l(c) = 320c*2 - 26c - 731. Let j(x) = -161x2 + 14x + 365. Let o(g) = 11j(g) + 6l(g). Find the second derivative of o(w) wrt w. 298 Let l(b) be the first derivative of 11b6 - 2b*5/5 - 209b*3/3 + 58. Find the third derivative of l(r) wrt r. 3960r*2 - 48r What is the derivative of -16r2 - 22r*2 - 274 - 162r*2 wrt r? -400r Let t(x) be the third derivative of 81x7/70 + 169x*3/3 + 21x*2 - 2. Differentiate t(y) with respect to y. 972y*3 Let u(a) be the first derivative of 4a*4 - 87a - 32. Find the first derivative of u(q) wrt q. 48q2 Let k(f) be the third derivative of 0 - 1/12f*4 + 0f + 1/12f5 - 6f*2 + 0f*3. Find the second derivative of k(l) wrt l. 10 Let x = -12 + 16. Let b be 1x + (8 - 10). Find the second derivative of -2o2 - 4o*4 + 2o*2 - 6o + 0ob wrt o. -48o2 Let b(n) = n3 + 2n2 + n - 1. Let q(z) = 123z*3 + 270z*2 + 39z - 39. Let y(o) = -78b(o) + 2q(o). Find the third derivative of y(k) wrt k. 1008 Suppose 7i - 2i - 17 = 2x, x = -i + 9. What is the third derivative of -16n*4 + 38n*2 + 7n*x + 13n*4 wrt n? 96n Let p(i) be the second derivative of 5i8/56 - 59i6/15 - i4/12 + 25i3/6 - 98i + 1. What is the third derivative of p(s) wrt s? 600s3 - 2832s Let t be -8((-7)/2 + 3). Let o be ((-2)/4)/((-2)/t). Find the second derivative of -6h - 3h3 + 1 + h - o wrt h. -18h Differentiate -746 - 760 + 1520 - 255c3 wrt c. -765c*2 Suppose -7m = -9m + 30. Find the second derivative of -2978g + 2988g + mg*4 + 17g*4 + 14g*4 wrt g. 552g*2 Let l(g) = 214g*4 - 184g*2 - 5g - 5. Let n(y) = -213y4 + 185y*2 + 6y + 6. Let x(o) = 6l(o) + 5n(o). Find the third derivative of x(r) wrt r. 5256r Let o(m) = m3 - 3m*2 - m - 7. Let l be o(4). What is the first derivative of -l + 5p*4 + 13 + 6 wrt p? 20p*3 Let r(h) = 815h*3 - 35h*2 + 413. Let b(o) = 407o*3 - 15o*2 + 207. Let a(d) = -7b(d) + 3r(d). Find the first derivative of a(g) wrt g. -1212g*2 Let x(g) = -94g*4 - 12g*2 - 8. Let t(a) = 95a*4 + 10a*2 + 7. Let d(w) = -4t(w) - 3x(w). Find the third derivative of d(v) wrt v. -2352v Let c(h) = -22h2 - 5h + 25. Let z be 16/(-32)110. Let o(a) = 11a2 + 3a - 12. Let x(g) = zo(g) - 3c(g). What is the first derivative of x(d) wrt d? 22d Let i be (-4)/(((-8)/2)/4). Suppose -iv - 11 = -5r + 4, 3v = 0. What is the second derivative of -b*3 + 4b*3 - 8b - b*3 + 2b*r wrt b? 24b Let s(p) = -7 + p*2 + 8 - 2p*2 + 3. Let n be s(0). What is the derivative of 21i*2 - 21i*2 + 2i*n + 2 wrt i? 8i*3 Differentiate 56 + 41p - 17 + 25 wrt p. 41 Let m(g) = -g4 - g2 + g - 2. Let p(y) = 3y4 + 22y3 + y2 - 2y - 4. Let l(r) = 2m(r) + p(r). What is the third derivative of l(z) wrt z? 24z + 132 Find the second derivative of 2s - s - 13 + 59 + 6s4 - 7s*3 wrt s. 72s*2 - 42s Let o(t) = t - 7. Let h be o(4). Let l(q) = -q*2 + q + 1. Let r(z) = 4z*2 - 2z + 1. Let m(a) = hl(a) + 3r(a). Find the second derivative of m(c) wrt c. 30 Let l(m) = -17m2 + 35m. Let f(z) = 17z2 - 35z. Let d(b) = -6f(b) - 4l(b). What is the second derivative of d(g) wrt g? -68 Suppose x = -8x + 252. Let q be 3/6 - (-30)/4. Find the third derivative of xw*2 - 13w*2 - qw*2 + 9w*5 wrt w. 540w*2 Find the first derivative of 446 - 10c + 10c + 821c*2 + 35 - 34 wrt c. 1642c Let x(f) = -398f2 + 257. Let o(i) = 8i*2 - 1. Let m(j) = -3o(j) - x(j). Differentiate m(g) wrt g. 748g Let y(t) = -3t*3 + 3t*2 + 3t - 16. Let j(p) = 4p3 - 3p*2 - 2p + 17. Let o(z) = -3j(z) - 2y(z). Find the first derivative of o(w) wrt w. -18w2 + 6w Suppose 0u - 5u - 45 = 0. Let q = 14 + u. Find the second derivative of 4o5 + 5o - 2o + 0o*q wrt o. 80o*3 What is the derivative of 243 - 287 - 393 - 258u*2 wrt u? -516u Let u(r) = 5r - 84. Let h(d) = 16d - 253. Let w(m) = -2h(m) + 7u(m). Differentiate w(n) with respect to n. 3 Let y(d) = -38 + 28 - d*2 - 4d + 2d2. Let l be y(6). What is the third derivative of -11h*5 - 5h*2 + 0h*5 + lh2 - h2 wrt h? -660h2 Let f(x) = -x2 - 2x - 1. Let u be f(-1). Suppose z - 5 + 1 = u. Find the third derivative of -4 - 5m3 + 0 + z + 2m*2 wrt m. -30 Let t(r) = -255r*3 - 5r*2 - 10r - 846. Let l(n) = 127n3 + 3n*2 + 6n + 423. Let o(u) = -5l(u) - 3t(u). Find the first derivative of o(p) wrt p. 390p2 Let p(c) be the first derivative of -c5/15 - 3c*3 - 13c*2/2 + 22. Let r(k) be the second derivative of p(k). Differentiate r(l) with respect to l. -8l Find the third derivative of -20j6 - 14j*6 - 19j*2 - 7j*6 + 7j*6 wrt j. -4080j3 Let h(f) = -f2 + 1. Let a(u) = -150u2 - 54u - 3. Let w(c) = a(c) + 3h(c). What is the second derivative of w(z) wrt z? -306 Find the third derivative of 7r - r + 24r3 + 10r2 + r4 - 2r - 15r*2 wrt r. 24r + 144 Let i(v) = -321v2 + 2v + 255. Let n(h) = 1285h2 - 7h - 1025. Let x(w) = 11i(w) + 3n(w). What is the second derivative of x(r) wrt r? 648 Let j(o) = 1236o3 + 10o*2 + 15o - 514. Let d(n) = 619n3 + 6n*2 + 9n - 257. Let h(q) = -5d(q) + 3j(q). What is the derivative of h(k) wrt k? 1839k2 Let x(s) be the first derivative of s7/140 + 13s*4/8 + 34s*3/3 - 15. Let m(z) be the third derivative of x(z). Differentiate m(u) wrt u. 18u*2 Let z(j) = -11j*4 - 87j*3 + 6j*2 - 6j + 229. Let q(l) = 13l4 + 89l*3 - 7l*2 + 7l - 228. Let s(r) = 6q(r) + 7z(r). Differentiate s(o) wrt o. 4o3 - 225o*2 Let j(q) be the second derivative of 5q4/12 + q3/6 - q*2/2 + 73q. Differentiate j(v) with respect to v. 10v + 1 Suppose 5z + 9 = 29. Find the second derivative of 14nz - 10n4 - n3 - 21n - 12n*2 + 12n*2 wrt n. 48n*2 - 6n Let u be -1 - (-7 + 2 - -2). Suppose 6m - 2m + x - 11 = 0, -ux - 2 = 0. What is the second derivative of p + 9p*3 + 0p - 16pm wrt p? -42p Let h(c) = 390c - 860. Let n(g) = 1956g - 4298. Let a(b) = 16h(b) - 3n(b). Differentiate a(y) wrt y. 372 Let u be (15/(-20))/((-3)/12). Find the first derivative of -3 - 6r3 + 7r*u + 7 wrt r. 3r*2 Let n = -17 - -21. Let c be (10 + -1)n/12. Find the first derivative of -d*2 + cd*2 - 10d*2 - 3 wrt d. -16d Let c(g) be the second derivative of 2g4/3 + 7g*3/3 + 75g*2/2 - 197g. What is the derivative of c(o) wrt o? 16o + 14 Let s(n) be the first derivative of 75n*4/4 - 10n*3/3 - 2n - 227. Find the third derivative of s(b) wrt b. 450 Let b = 90 - 68. Find the third derivative of 29q2 + 4 - 9 - bq*5 + 5 wrt q. -1320q*2 Let s(n) be the first derivative of 13n*2/2 - 158n + 352. Find the first derivative of s(z) wrt z. 13 Let n(z) be the first derivative of 11z6/6 + 18z*5/5 + 85z*3/3 - 6z - 212. What is the third derivative of n(o) wrt o? 660o2 + 432o Let j(t) = t6 - t3. Let k(y) = -49y6 + 2y*3 - 30y*2. Suppose -14r = -8 + 22. Let w(f) = rk(f) - 2j(f). What is the third derivative of w(v) wrt v? 5640v3 Let t(q) be the first derivative of -69q*6/2 - 30q*2 + 246. Find the second derivative of t(l) wrt l. -4140l*3 Let f(p) = p - 1. Let g be f(1). Let s be (g/(-4))/(1-1). Differentiate 1 + 0	{ "pile_set_name": "DM Mathematics" }
2212220021 Convert -11102122200 (base 3) to base 8. -252274 Convert -15640660 (base 7) to base 14. -2b8c30 What is -322232030111 (base 4) in base 6? -1305534245 What is 11011010011111111 (base 2) in base 5? 12034441 -132310332100 (base 4) to base 16 -7b4f90 What is 68764 (base 11) in base 13? 36330 Convert -108cc6 (base 14) to base 2. -10001001010001111110 What is 18a739 (base 11) in base 3? 112212001211 Convert 18b4c (base 16) to base 11. 6a037 What is 12714577 (base 8) in base 14? 54543d Convert -1010000101010011010101 (base 2) to base 4. -22011103111 Convert 121220021101000 (base 3) to base 11. 5084473 What is 10023031032 (base 4) in base 9? 2047306 What is -233312325 (base 6) in base 11? -2510975 What is 1119da8 (base 15) in base 7? 205662611 What is -1131141 (base 7) in base 16? -22b00 4b591 (base 16) to base 13 aa625 What is 1b75a2 (base 12) in base 10? 489866 45734 (base 9) to base 7 154612 What is 47502 (base 9) in base 8? 76012 Convert -3c559 (base 13) to base 2. -11011100101000110 29ea00 (base 16) to base 15 393d55 Convert -124344010 (base 5) to base 14. -122831 11003c4 (base 13) to base 2 10011110101001110110001 Convert -4203541 (base 7) to base 4. -1323122221 200948 (base 10) to base 9 335575 What is 3649b65 (base 13) in base 4? 1000100111300 193c9 (base 15) to base 16 13fc8 What is 146025 (base 9) in base 5? 10332230 What is -562560 (base 7) in base 12? -49646 -16272256 (base 8) to base 10 -3765422 -3761465 (base 11) to base 14 -c20552 Convert 3112030032 (base 4) to base 16. d630e 1120002112 (base 3) to base 10 30686 4020a3 (base 11) to base 10 646979 What is 1225716 (base 8) in base 4? 1102233032 Convert 11302232 (base 6) to base 4. 1111203230 Convert -82690a (base 12) to base 14. -3b2b7c Convert 11541442 (base 6) to base 15. 74e12 Convert -3231037 (base 8) to base 15. -121384 What is -443206 (base 7) in base 14? -205ad Convert -3046155 (base 8) to base 14. -16da33 What is 1680235 (base 9) in base 5? 220012132 What is 103204252 (base 6) in base 11? 1044546 What is 13062116 (base 7) in base 13? 32951c Convert -ca923 (base 15) to base 16. -9d0ec What is -75274 (base 11) in base 4? -122232121 10110001000010111100100 (base 2) to base 5 2441121234 Convert 7efb (base 16) to base 8. 77373 Convert 14855711 (base 9) to base 7. 120024160 What is 131324410 (base 5) in base 2? 10011111001001001111 Convert 1010000000011111010 (base 2) to base 13. b6355 What is -4046317 (base 9) in base 14? -401d3b What is -56c67 (base 15) in base 14? -72908 -3591795 (base 11) to base 15 -838079 What is 56628 (base 16) in base 12? 150920 What is 17697b (base 12) in base 7? 3306632 -12215253 (base 7) to base 8 -4136003 -22111102100 (base 3) to base 7 -1264413 Convert 291320 (base 13) to base 16. f4b7d Convert -1a26bb (base 13) to base 9. -1218652 -21643 (base 10) to base 16 -548b What is -26412623 (base 7) in base 2? -1001001111101100110110 Convert 2311211023 (base 4) to base 15. ea58a Convert -220002201210 (base 3) to base 16. -73d10 Convert -11a632 (base 13) to base 16. -673df Convert 236d34 (base 14) to base 12. 4a4256 What is 32122122 (base 4) in base 16? e69a What is -353241 (base 6) in base 14? -b1c5 Convert 2782206 (base 10) to base 8. 12471776 -111102021021 (base 3) to base 11 -170466 -112103100 (base 4) to base 5 -10410334 Convert 294664 (base 16) to base 2. 1010010100011001100100 What is -12202110200 (base 3) in base 7? -651300 What is -520359 (base 10) in base 12? -211173 What is -69620 (base 12) in base 2? -100010011000111000 -76682 (base 9) to base 16 -c6ad Convert -31011222223 (base 4) to base 7. -41110105 Convert -122037 (base 9) to base 7. -424522 149270 (base 10) to base 6 3111022 -9c021 (base 14) to base 11 -239584 Convert 666b (base 12) to base 9. 16462 -6254436 (base 9) to base 2 -1100110000000111100110 Convert -577237 (base 8) to base 13. -6b437 -f9de4 (base 16) to base 5 -230222320 Convert -2534256 (base 7) to base 6. -11010423 What is -2105301 (base 8) in base 6? -15555413 What is -316058 (base 13) in base 12? -47897b -982bd0 (base 14) to base 7 -61551550 What is 525622 (base 7) in base 9? 147567 What is 50a8b (base 15) in base 8? 763022 What is -983bb (base 13) in base 7? -2224404 Convert -1100110100100 (base 3) to base 11. -450153 Convert 167457 (base 10) to base 8. 507041 What is -2fc79 (base 16) in base 7? -1443366 What is 43212306 (base 7) in base 10? 3683973 Convert -2843a (base 12) to base 9. -84631 -543102 (base 8) to base 11 -114677 What is -11211001000 (base 3) in base 5? -11013142 255262 (base 7) to base 8 134564 -153522 (base 13) to base 15 -a480c Convert -33522707 (base 8) to base 11. -41030a1 -291a47 (base 11) to base 3 -212012011001 Convert 441244051 (base 6) to base 11. 45102a3 Convert 1100000111110010110111 (base 2) to base 3. 12222102220221 -89d41 (base 14) to base 13 -b9409 What is -322432203 (base 5) in base 3? -2120210211212 What is 2211321101 (base 4) in base 11? 424582 -573911 (base 10) to base 13 -1712c0 What is -8f58 (base 16) in base 11? -25630 Convert -3612316 (base 7) to base 10. -457036 What is -b8a3 (base 12) in base 8? -47473 Convert -1111011111001011 (base 2) to base 14. -19191 Convert 12102333023 (base 4) to base 6. 55213455 112103b (base 12) to base 14 6148b5 35167716 (base 8) to base 14 1036bb8 What is 3434013242 (base 5) in base 13? 17a3a56 Convert 131313122 (base 4) to base 10. 122330 Convert -915949 (base 10) to base 2. -11011111100111101101 13981 (base 16) to base 2 10011100110000001 Convert 8e7ad (base 15) to base 10. 453988 Convert -120624 (base 8) to base 13. -15a9b What is -1ce13d (base 16) in base 11? -1082a99 88398 (base 11) to base 12 62272 Convert -1011000110000010011 (base 2) to base 4. -1120300103 Convert -10320133023 (base 4) to base 13. -35a786 Convert -10010021211 (base 3) to base 13. -21c79 53a19 (base 11) to base 3 10222120202 Convert -322111313 (base 4) to base 11. -1535a3 What is -253283 (base 10) in base 12? -1026ab 24243042 (base 5) to base 4 313220321 Convert -4336592 (base 10) to base 9. -8138615 -324514 (base 8) to base 2 -11010100101001100 Convert 103200022 (base 4) to base 8. 234012 What is 2272412 (base 9) in base 11? 76a160 What is 2042256 (base 8) in base 10? 541870 Convert 673344 (base 8) to base 14. 5ca56 Convert -1a8de (base 15) to base 6. -1503532 -10202310 (base 4) to base 2 -100100010110100 5bc7 (base 14) to base 6 202151 -4df07 (base 16) to base 12 -1348b3 What is 3631677 (base 8) in base 15? 14a2e2 -11122040 (base 5) to base 11 -67a20 What is -106517 (base 10) in base 16? -1a015 What is 2420022211 (base 5) in base 10? 5626556 Convert -1424142113 (base 5) to base 14. -6d5111 19554 (base 15) to base 4 110010130 -12012212111200 (base 3) to base 2 -1010100100111100010100 What is 1242 (base 11) in base 2? 11001010011 What is -102101022000 (base 3) in base 13? -7ac73 What is 5a110 (base 14) in base 15? 4518a Convert a88ada (base 14) to base 2. 10101110001111101101000 What is 210202221021 (base 3) in base 2? 1101000101000111101 -20898 (base 16) to base 6 -2505000 62754 (base 14) to base 4 321331312 What is 10483 (base 9) in base 10? 6960 -310c6e (base 15) to base 7 -25550351 -14611151 (base 8) to base 2 -1100110001001001101001 Convert 409363 (base 12) to base 5. 224331022 What is -33023030 (base 5) in base 4? -1011010022 110000211111 (base 3) to base 11 151a06 Convert -71324 (base 8) to base 12. -15018 What is -21221010 (base 3) in base 10? -5781 Convert -20212201222 (base 3) to base 11. -92805 -32278 (base 15) to base 4 -212313110 Convert -10010101011100001 (base 2) to base 10. -76513 Convert 2534737 (base 9) to base 4. 11101033033 -1a69041 (base 11) to base 4 -31102011111 What is -39cc1c (base 13) in base 14? -285d73 Convert 8b883 (base 14) to base 12. 144363 What is 524421 (base 7) in base 12? 443b0 Convert -36818 (base 9) to base 11. -17635 What is 1077407 (base 9) in base 4? 2032102102 -56c12 (base 13) to base 3 -22000202222 What is -39009 (base 11) in base 15? -11876 Convert 23975 (base 10) to base 15. 7185 What is -223511a (base 13) in base 7? -155122011 What is 44060505 (base 8) in base 13? 1c63a89 What is 144928 (base 10) in base 6? 3034544 What is 1010111010001011110 (base 2) in base 9? 604318 -12430523 (base 7) to base 2 -100010100101111011110 Convert -1111	{ "pile_set_name": "DM Mathematics" }
Let i = -27 + 36. Suppose -3b + b = 0. Which is greater: i or b? i Let b be 4/(-11)2/4. Let j(d) = -d*2 + 5d + 2. Let c be j(4). Let h be (c/(-21))/(1/(-1)). Is h < b? False Let x = -319 + 5103/16. Suppose 2u - 3u + 5d = -21, -2u - d = 2. Which is smaller: u or x? x Let f be -5112/30. Let a(l) = l. Let d be a(-5). Do d and f have the same value? False Let z be 9/4(0 + -4). Suppose 30 = 5j - 2j. Let r be z/j4/(-6). Does 1 = r? False Let r = 163.9 + -164. Suppose -i = -1 - 3. Let g be ((-4)/6)/(i/(-30)). Which is smaller: r or g? r Let d(j) be the third derivative of j*4/24 - 5j*3/6 + 4j*2. Let t be d(3). Let q = 7/4 + t. Are 0.1 and q equal? False Let v be 2/(-4)288/(-18). Suppose 5f - 23 = -v. Which is smaller: f or 4? f Suppose -5l = 3m + 19, 5l - 2m + 5 - 1 = 0. Suppose -5a + s - 3s = 4, s = -3a - 2. Suppose -2n - 4 + a = 0. Is n <= l? True Let q be 1/(-1) - (0 - 1). Which is bigger: 2/5 or q? 2/5 Let j(v) be the second derivative of 2v + 1/2v2 + 0 - 1/12v*4 - 1/6v*3. Let f be j(-2). Which is smaller: f or -1/7? f Suppose -8d = -3d - 90. Suppose p - 30 = -4q - p, 5q = 4p + d. Which is bigger: q or 7? 7 Let f(m) be the third derivative of m6/120 + m5/60 + m4/24 - m3/6 + 2m2. Let z be f(0). Which is smaller: z or -3? -3 Suppose -3x = 5l - 10, l - 5x = 2l - 24. Let y(b) = -2b*3. Let q be y(1). Is q bigger than l? False Let l be (-4)/(-6) + 60/(-117). Let k = -5/52 - l. Suppose 5o - 7 = -4h, 3o + 1 = -2h + 4. Is k <= o? False Let r = -10.3 - -10. Let d = -0.3 - r. Which is smaller: -0.1 or d? -0.1 Let u = 9/7 + -31/35. Are u and -1 equal? False Suppose -3b - 2 = 2l, 37 = -5b + 3l + 2. Let w = b + 7. Is w greater than 3? False Suppose -2z + 7z = 0. Let x be (1 + 2 - 6) + z. Which is smaller: x or -1? x Let r = 661 + -677.11. Let m = r - -16. Let k = 0.06 + m. Is -2/5 less than or equal to k? True Let u = 0.2 + 0. Let z = -1.7 + 1.7. Is z at most u? True Let n = 671/8 + -84. Suppose 4h = -5g + 21, -15h + 13h - 22 = -4g. Which is greater: n or h? n Let d = -9.02 - -9. Is d <= 1/4? True Let a be 189/(-9)(-1)/(60/(-3)). Are 0 and a nonequal? True Suppose -3w + 5b + 9 = 0, -w - w - 4b = -6. Suppose -5u + w = -4u. Suppose j = uc + 2c + 5, 0 = j. Which is smaller: -3/2 or c? -3/2 Let h be -4 + 657/(-7) + -4. Let n = h - -102. Which is bigger: n or 2? 2 Let h(k) = -k*2 - 10k - 4. Let x be h(-6). Suppose 0 = -4i - 5o - 43, 5i + 0i - 5o = -x. Let q = 9 + i. Is 3 greater than q? True Let p = -13.9 + 14. Which is bigger: -2/13 or p? p Let u = -7 + 9. Suppose -ud - 14 + 4 = 0. Let g(j) = 2j + 5. Let i be g(-5). Is i greater than d? False Let t = -34 + 38. Which is greater: 34/13 or t? t Let b = 4104149 + -110799146/27. Let c = b - 477. Which is smaller: c or 1? c Let g be 6/(-9) + 21/(-9). Let h = g + 2. Which is greater: -2 or h? h Suppose -4w + 3i = -w + 48, 2i + 13 = -w. Let r be (-4)/(-10) + 21/w. Is -2 != r? True Let h(l) = -l - 8. Let p be h(-5). Which is greater: -4 or p? p Let d = -17 - -18. Is d less than -2/15? False Let i = 14 + -5. Let f = i + -7. Which is greater: 0.9 or f? f Suppose 4g - 4x + 28 + 4 = 0, 2g + 17 = 3x. Let r = -18 - -10. Which is greater: r or g? g Let r be (3/(-2))/((-6)/32). Let q = -13 - -20. Which is bigger: r or q? r Let k = -19 + 3. Do -17 and k have the same value? False Let x = 61/130 - -2/65. Let n = -8 - -5. Which is bigger: x or n? x Let a = 4 - 2. Let l = a + -5. Let p = l + 5. Which is greater: p or -1? p Let n(w) = -2w2 + 5w. Let a be n(4). Let p be 10/(-72) - 3/a. Let y = -1.4 - -2.4. Which is smaller: p or y? p Let f(v) = -v*2 - 9v - 4. Let u(x) = x*2 + 10x + 5. Let i(z) = -5f(z) - 4u(z). Let p be i(-4). Is p at least as big as -3? False Suppose 15f = 12f - 6. Are f and 1 equal? False Let g be 930/9 + -1. Which is bigger: 0 or g? g Let i = -3.1 + 3. Let s = -0.3 - i. Let x be 3 + -1 + 1 + -4. Which is smaller: s or x? x Let o = 9 - 1. Which is smaller: -0.1 or o? -0.1 Suppose 4k + 5 = 3i - 10, 2k = -3i + 15. Let w = k - -2. Is w less than 2/3? False Let c be -7 + 10 - 3(-9)/(-6). Do -4 and c have the same value? False Let f = 16 + -17. Which is greater: 1/31 or f? 1/31 Suppose -28 = -2d + 5k, -7d - 2k + 8 = -3d. Suppose -l - d = 3l + 4p, -5p = 20. Suppose 0 = 7h - h - 12. Is h != l? True Let h be -2 + 1 + 3 + 0. Let f be (0 + -3)(-4)/3. Suppose fb + 12 = -4a, b = -ha + 5a - 11. Which is smaller: a or 3? a Let j = -17/21 - -1/7. Which is bigger: 9 or j? 9 Let r(s) = -s*2 + s. Let i be r(2). Let k be 2/(-5)20/(-4). Let b = i + k. Which is greater: -2/9 or b? b Let q be 8(-1)/(-6)-1. Let j(r) = r*2 + 2r - 4. Let o be j(-3). Which is bigger: q or o? o Let y = 11 - 8. Let n = 0.171 + -1.141. Let g = 0.03 - n. Do y and g have the same value? False Let y = 4.2 - 4.3. Is y <= 24? True Let s = 11 - 16. Let i = 2 - s. Suppose 3n = in. Which is bigger: -2 or n? n Let x = -11 + -1. Let f = x + 20. Which is bigger: f or 1? f Let h(n) = n2 + n + 1. Let j(p) = p3 + p*2 + 8p + 1. Let b(l) = -4h(l) + j(l). Let f be b(2). Let t = -1 + f. Which is greater: t or 2/5? 2/5 Let l = 2 - 2. Let v = 6041/9 + -671. Is v < l? False Let t be (0 - 1/(-5))9. Let s = -41/20 + t. Let d = -2 + 3. Does s = d? False Let h = -37 + 36.8. Which is greater: 0.1 or h? 0.1 Let v(b) = b*3 - 4b*2 - 4b + 5. Let f be v(5). Suppose -3s - 2s = -f. Is 4/3 bigger than s? False Let d = 6.2 - 0.2. Let m = -16 + 13. Is m at least as big as d? False Let j be 86/(5 - (-1)/(-1)). Is 21 greater than j? False Let r(d) = -3d + 2. Let h be r(2). Let a be -2 + ((-8)/2 - (1 + -5)). Which is smaller: a or h? h Let h be ((0/(-1))/(-3))/1. Suppose a + 0 - 2 = h. Suppose 4f + 0 - 4 = 0. Is f at least as big as a? False Suppose 0 = 3r - 3 - 9. Suppose -3s - 2u - 4 = 0, -2s + r = -4u + 2u. Which is bigger: s or 8? 8 Let o = 24 + -26.6. Let h = 0.4 - o. Let u = h - 2.8. Is u != 2/7? True Suppose 4b + 0z = -3z + 21, 0 = -5b - z + 18. Suppose -f - bf = 0. Is f at most as big as 3? True Suppose 5t - 3t = 0. Let a be (-8)/18 + (-527)/(-1530). Which is bigger: t or a? t Let h = 144 - 149. Is h equal to -5? True Let m = -5 - -6. Is -1/21 less than or equal to m? True Let r(w) = w2 - 17w - 10. Let s(j) = j. Let i(c) = r(c) + 2s(c). Let p be i(15). Which is smaller: p or -11? -11 Let o(a) be the third derivative of 7a4/6 + a3/6 - 3a2. Let x be o(1). Let m be -11 - (-31)/x. Which is greater: m or 0? m Let c be 20/6 + (-8)/24. Let b be (-2)/(-6)c + -2. Are -0.06 and b equal? False Let x be 6/15 - (-323)/(-690). Let b = -3/46 + x. Is 1 equal to b? False Suppose 0 = -6i + 10i + 8. Let z(m) = 3m + 6. Let j be z(-4). Let k be 3/(i/j3). Is k greater than or equal to 2? True Let k = 85 - 197. Let i be 4/14k/72. Which is smaller: i or -1? -1 Let y = -11 - 1. Let i be (-2)/(-25)(-6)/y. Which is smaller: i or 0? 0 Let k = 134/3 - 45. Suppose 3c - 2 = 5c. Which is bigger: k or c? k Let s = 0.09 + -1.69. Let h = 0.45 + -0.05. Let g = h - s. Do g and -0.1 have different values? True Let b = -95 - -180. Let h = b + -2633/31. Which is greater: h or 1? 1 Let f = 5198/17 + -306. Are -1 and f nonequal? True Let q = -6 + 5.7. Let c = q + 0.2. Is c < 1? True Let q be (-9 + -1)(-7)/(-14). Let x be (6/(-5))/(12/45). Let i = q - x. Are 0 and i equal? False Let g be 3(-2)/(-6) - -181. Let z be (-2)/7 - (-80)/g. Let d(x) = x3 - 4x*2 - 6x + 5. Let q be d(5). Which is bigger: q or z? z Suppose -1 = 3p + 4i, 31 = 3p - 9i + 5i. Suppose -pg + 0 = -10. Are 2 and g unequal? False Let d = -5 + 11. Suppose -5o + 4o = -2m + 3, -d = 2o + 2m. Suppose f + 3 = -0. Is o at most as big as f? True Let m be (-3 - 15/(-6))/((-1)/8). Which is greater: 8 or m? 8 Let x(w) = w2 + 5w + 1. Let q be x(-5). Suppose -7 = 2b - 3b. Let t be 3/84 - 2/b. Is t smaller than q? True Let a = 1 + -0.88. Let d = -0.02 + a. Are d and 4/3 nonequal? True Let h(l) = l*2 + 4l - 7. Let j be h(-5). Let a be -4 + (64/(-12))/(-2). Is j less than a? True Let w = -2/121 + 494/605. Let v be (1 + -9)/4 - -3. Is v less than w? False Let q = 40 + -23. Let j = q + -10. Let r = -6 + j. Which is smaller: -1/4 or r? -1/4 Let z = -3.24 + 0.24. Let l = -13/	{ "pile_set_name": "DM Mathematics" }
her 75 and -2808.574. -2733.574 What is 0.60199 plus 205.121? 205.72299 What is -0.07 minus 6785747760? -6785747760.07 What is -3 + 0.34684763? -2.65315237 What is 0.27721638 - 232? -231.72278362 Subtract 1456 from -13619. -15075 What is -0.062 take away 142968? -142968.062 Sum -1 and -15828814824. -15828814825 What is -17.50763 minus 7889? -7906.50763 What is the distance between -0.07 and 557245271? 557245271.07 What is the difference between -364981 and 15.13? 364996.13 -2.823 + -52960 -52962.823 What is 4 take away -2704214.9? 2704218.9 What is -3521 less than -0.0116? 3520.9884 What is 15221973 - -0.08? 15221973.08 Work out 0.24 - 50.7396. -50.4996 What is 0.2 plus 45726319? 45726319.2 Add -0.088 and 9.5108155. 9.4228155 What is -3 - 28419764? -28419767 What is the distance between 11.82 and -24498? 24509.82 78+0.167489 78.167489 What is the distance between -0.03019 and -103587? 103586.96981 Add -235.66002 and 113. -122.66002 Work out 304341165 + -27. 304341138 Total of -0.1 and -74192537. -74192537.1 Add together 9965 and -4.3236. 9960.6764 What is -96290 less than 357? 96647 What is the difference between -0.0507 and 10760599? 10760599.0507 What is -2315 - 20.25125? -2335.25125 -3.10501394 - -0.1 -3.00501394 Total of 16.4 and -131.58. -115.18 Calculate -0.12 + -16.76935. -16.88935 What is -1440509850 less than 2? 1440509852 Work out -1088940 + 0.51. -1088939.49 What is 49 minus -543.1536? 592.1536 Put together 37 and -3336769. -3336732 What is 4670479765 plus 6? 4670479771 Work out -52016 + 1053.011. -50962.989 Add 87766 and -59156. 28610 What is -87 less than -179286? -179199 What is -0.54 less than -82715? -82714.46 Calculate -95.70259735 + 5. -90.70259735 Sum -0.5 and -463963246.3. -463963246.8 What is the distance between -116616 and -586221? 469605 Subtract -0.1 from -2151465.446. -2151465.346 What is 0.0440709 take away -10.41? 10.4540709 What is 11669.4 plus -20.4? 11649 Sum -9 and 152.454488. 143.454488 What is 3.5 + 348697291? 348697294.5 Calculate -2.4 + 8081647. 8081644.6 Add together 43864472 and 5. 43864477 What is the distance between 80141.08 and -0.3? 80141.38 What is 1713 plus 910268.2? 911981.2 What is -0.38578 less than 2675? 2675.38578 1068374728 - -0.08 1068374728.08 What is -0.3 + -104945957? -104945957.3 Total of 180558 and -324. 180234 What is -17.9290201 take away 174? -191.9290201 What is the difference between 28.751511 and 4? 24.751511 Put together 3 and -0.171305207. 2.828694793 Sum -462464.36 and -2. -462466.36 -6435.8623+205 -6230.8623 What is -176 minus -130719? 130543 What is the distance between 0.421 and -881276? 881276.421 Calculate -0.35 + 13777789. 13777788.65 What is 0.33655 plus -0.0123? 0.32425 Calculate -18 - 158229578. -158229596 Sum -403616 and 12.08. -403603.92 What is 24612.1 + 61? 24673.1 What is -23410888 minus -0.065? -23410887.935 Calculate 6530927339.9 - 5. 6530927334.9 What is the distance between -338859.1 and 273? 339132.1 Work out 0.01 - -1066298. 1066298.01 What is 5.32379 plus 497.7? 503.02379 4035616+11.57 4035627.57 What is -292280604 minus -0.34? -292280603.66 What is -4520679.378 + 3? -4520676.378 84 + 23698 23782 Add -77 and -54. -131 What is 16.31614 plus -1.649? 14.66714 Work out 17 + -751.9735. -734.9735 Work out 0.819 + 0.09066. 0.90966 What is -5145 minus 195849? -200994 What is the distance between 81850 and 17532.1? 64317.9 Sum 0.1 and 75263753. 75263753.1 What is the distance between 4267020030 and 2? 4267020028 Add together 0.03766707 and 0.7. 0.73766707 -56915 - 6043 -62958 Calculate 0.00659216 + 1.1. 1.10659216 Total of 9.6249 and -1411. -1401.3751 -0.392+15.4046 15.0126 Total of 961 and 48753663. 48754624 What is -4901 + 109715? 104814 Add -5.1268 and -0.057. -5.1838 Put together 3.2 and 273625. 273628.2 What is the distance between -2.451 and -6.04? 3.589 Add -580.93 and 17.40648. -563.52352 Subtract 2564037.6 from -0.4. -2564038 Calculate -1164 - -31.3246. -1132.6754 What is -959.3166 less than -11? 948.3166 Total of -0.438 and -0.11453789. -0.55253789 What is 26243375 less than -3? -26243378 Add -0.5 and -46182034110. -46182034110.5 Calculate 6419160.432 - 5. 6419155.432 29 + 6224195 6224224 Calculate -0.38785929 + -39.1. -39.48785929 Put together -3.4 and -7. -10.4 Subtract 2624742 from 0.037. -2624741.963 5061496385 + -5 5061496380 What is 0.19 minus -359430813? 359430813.19 What is -1.21 take away 10628.1799? -10629.3899 What is -853 minus -0.283079? -852.716921 Add together 89285.9859 and 1.6. 89287.5859 What is -233 minus -6563? 6330 5239246372+0 5239246372 186.8979 - 4 182.8979 What is -4761026607 less than 0.1? 4761026607.1 Work out -281 + -19465043. -19465324 8352342 + -4361 8347981 What is the difference between 2.76 and -3253.21178? 3255.97178 -5.71 - 0.832 -6.542 Sum -123792729 and 81. -123792648 What is 498.7448 less than 0.119? -498.6258 What is 5776 minus -2543? 8319 Sum 29 and -528268. -528239 10+-8391900 -8391890 Sum 76154059 and -1. 76154058 Calculate -13943707 + 11. -13943696 Calculate 317.1 + 84.61. 401.71 Add 17278890 and 470. 17279360 Subtract -181765299.6 from -0.4. 181765299.2 Work out 19525364 + 0.4. 19525364.4 Add together -59772.156 and -5. -59777.156 What is 0.2 - -321501727? 321501727.2 Sum -0.08 and -14591.508. -14591.588 -7.24573 - 292 -299.24573 Calculate -322064.4121 - 3. -322067.4121 Add together 0.1 and 152774861. 152774861.1 Subtract 3770968 from -58. -3771026 What is -45606885 take away 27? -45606912 Subtract 1651 from 12290. 10639 Calculate 311654.98 + 0.455. 311655.435 1.325 - 0.0442 1.2808 What is the difference between 36151657 and -0.17? 36151657.17 Calculate -0.123 + 75287. 75286.877 Calculate -11152 - 382.3. -11534.3 Add 583663.26815 and 0.1. 583663.36815 Calculate -2.859 + -34.466. -37.325 What is -6674 + 32.592? -6641.408 Calculate 1.37102 + -0.0108. 1.36022 Subtract 81 from 42502.38. 42421.38 Add together -1719.67 and 0.0631. -1719.6069 What is 7505.798 - -9.7? 7515.498 Calculate 0.3 - -191536901. 191536901.3 3025.709 + 351 3376.709 Sum 14524689 and -3.85. 14524685.15 Sum -182 and -23.2893. -205.2893 Work out 279.4 - 281375. -281095.6 Work out 5 - 2524112. -2524107 243826444 - 1 243826443 Put together 12 and 10686.46001. 10698.46001 What is 52302 take away 34874? 17428 What is -102166394 less than -6? 102166388 What is 150.02641 take away -2? 152.02641 What is 40311618 less than -3.1? -40311621.1 Total of -162.16 and 229.8. 67.64 What is the distance between -3772.905 and -0.1? 3772.805 What is -985822 take away -413? -985409 Total of 99 and 15466.586. 15565.586 Calculate 3.1196 - -1415. 1418.1196 Total of 1 and -27412087. -27412086 What is 11387.2 less than 0.10928? -11387.09072 Put together -629.07 and 10.91. -618.16 What is 5 plus 465.1423029? 470.1423029 Add together 18626413.9 and -147. 18626266.9 What is the distance between 9340420 and 0.47? 9340419.53 Work out 784756 + -0.3862. 784755.6138 What is -108340.68 - 7? -108347.68 Put together 92 and -40326.4. -40234.4 0.3+612400.3 612400.6 What is -0.25 less than -2191367? -2191366.75 Add together 2 and 1.90759638. 3.90759638 Calculate -1 - 34800115. -34800116 Work out -7645 - 10002.52. -17647.52 What is 1 minus -2141615? 2141616 Add -211.6227981 and 2. -209.6227981 -0.1 - 987.8881 -987.9881 Work out -98701.92 + 6. -98695.92 What is the distance between -3 and 86331649? 86331652 -2 + 280271002 280271000 What is 7434 + 35.7? 7469.7 What is 12389.4 less than -945? -13334.4 Calculate -0.098 - 181832. -181832.098 Put together -7 and -1.151437483. -8.151437483 Calculate -13.1 - 0.00064. -13.10064 Subtract -0.34298 from 340829. 340829.34298 Sum -6.06 and -48102.1. -48108.16 3 + 12567381 12567384 What is the difference between 72184 and 1.4? 72182.6 66.151 + 0.307 66.458 What is the distance between 28046391 and 0? 28046391 Add 2.8750287 and 3. 5.8750287 What is 203756 - -13? 203769 Work out 0.5 + -2719782298. -2719782297.5 Calculate -3241 + -1.461. -3242.461 What is -666.3 minus -0.135? -666.165 Total of 2378429 and 66414. 2444843 What is -0.022 take away -47619970? 47619969.978 Put together 409571 and 67. 409638 What is 0.26 + -0.0471195? 0.2128805 Add together -2170.84072 and 0. -2170.84072 Add together -13641227448 and -1. -13641227449 What is -0.13 less than 1	{ "pile_set_name": "DM Mathematics" }
alue in -2, h, 12? h Let o be 2/((-70)/(-51)) - 2. Let q = o - 2/35. Let y = 9.9 - 9.5. What is the smallest value in -0.9, q, y? -0.9 Suppose 13l + 164 = 17l. Let t = 37 - l. Let n = 8 - 7. Which is the third biggest value? (a) n (b) t (c) -0.2 b Let g be 2/3 - 1810844/(-6). Let n be g/(-1360) - (-1)/(-5). Let j = -222 - n. Which is the biggest value? (a) 0.4 (b) j (c) 5 c Let q = 49/12 + -10/3. Let n = 114.12 + -113.72. Which is the third smallest value? (a) q (b) -0.4 (c) n (d) 3 a Let a(x) = 4x + 29. Let j be a(-8). What is the second biggest value in 4, 2, -5, j? 2 Let k = -27.2 - -3.2. What is the third smallest value in 1, -3/5, k? 1 Let h = -6.85 - 0.15. Let l = 2.7 + 0.3. Let z = h + l. Which is the second biggest value? (a) z (b) 4 (c) 0.5 c Let j = -94 - -178. What is the second biggest value in 0, -5, j? 0 Let x = -1520 - -1519. Which is the biggest value? (a) 1 (b) x (c) -60 a Let n(w) be the third derivative of -w4/12 - 7w*3/6 - 5w2. Let z be n(-8). Let u = z - 5. What is the third smallest value in -0.03, u, 2/11? u Let p = 914 + -5483/6. What is the biggest value in 4, p, -28, 2? 4 Let k = -867 + 14733/17. What is the smallest value in k, -1, 1/3? -1 Let v = 136 + -111.3. Let h = -25 + v. What is the third smallest value in 3, -3, h? 3 Let w = -916 - -917. What is the smallest value in w, -1, -1/2, 0.4? -1 Let g = -82/3 - -26. Let i = -54.64 - -56.64. What is the fourth biggest value in -3, i, 0.3, g? -3 Let z = -0.357 + 4.467. Let w = -0.11 + z. Let t(l) = l2 + 79l + 1375. Let p be t(-26). Which is the third smallest value? (a) -1 (b) w (c) p b Let n be (-5 - (-188)/28)/(2/(-21)). Let j be ((-4)/n)/((-8)/12). Which is the third smallest value? (a) j (b) 0.6 (c) 2 c Let c = 43/15 - 3. What is the second smallest value in c, -2, 0.1? c Let n = 284 - 284.5. What is the biggest value in -5, n, -677? n Let g = 997 - 996.9. Let q = 2/211 - 233/2321. Which is the second smallest value? (a) q (b) -1 (c) g (d) -0.1 d Let w = -274 - -275.4. Let t = 0.39 + 3.21. Let s = t + w. Which is the second smallest value? (a) 0.1 (b) 0.2 (c) s b Let m = -4/15 - 2/5. Which is the second smallest value? (a) m (b) 38 (c) 1 c Let s be 52/(-65)(-1)/4. Let t = -0.1 + 8.1. Let d = 13 - t. What is the third biggest value in d, 3, s? s Let i be (-2)/6 - (0 + 0/1). What is the third smallest value in i, -4, 4, 26? 4 Let v = 0.2553 + -0.1583. What is the second biggest value in -3, -0.2, v? -0.2 Let t = 47/5 + -277/30. Let i = 0.82 + -11.82. Which is the second smallest value? (a) i (b) -3 (c) t b Let h = -4 + 19. Let m = h - 10.9. Let z = m + -4. Which is the second biggest value? (a) 2 (b) -1 (c) z c Let u = 0.01 - 3.01. Suppose -5s + 3l - 140 = -2l, -2s + 5l = 47. Let w = s - -30. Which is the smallest value? (a) w (b) u (c) 2 b Let m = 62 + -101. Let j = m + 39. Which is the second smallest value? (a) -5 (b) -4 (c) j b Suppose -4u + 4p = -5u + 77, -3p + 186 = 3u. Let n = u - 59. Which is the third smallest value? (a) n (b) -3/5 (c) 0.4 (d) -1 b Let r be 335/300 + 5/(-4). Let m = -75/2 - -369/10. Let w(h) = 2h2 - 1. Let k be w(-1). What is the third smallest value in m, r, k? k Let p = -80 - -51. Let k = p + 25. Which is the biggest value? (a) -8 (b) k (c) -2 c Let q = -415.7 + 414. Which is the third biggest value? (a) q (b) 1/8 (c) -0.2 a Suppose -n - 2j = 11, -4j - 42 = 4n + 10. Let k be (9/(-6))/(n/6). Let i = 49 + -53. Which is the biggest value? (a) i (b) k (c) -3 b Let s = -349 + 349. Let l = 7 + -10. What is the third biggest value in -1, -2, l, s? -2 Suppose -17m = -15m + 132. Let u be (-4)/24 - (-2 - -1)/m. Which is the third biggest value? (a) u (b) 3 (c) -6 c Let w = 11.36 + -10.3. Let t = 2.94 + w. Which is the second biggest value? (a) t (b) 2/5 (c) -0.2 b Let d = 0.55 - -2.15. Let p = d + -13.7. Let u = 11.2 + p. Which is the smallest value? (a) -2 (b) 2/5 (c) u a Let s be ((-2)/(-6))/(20/(-90)). Which is the third biggest value? (a) 57/4 (b) -0.5 (c) 4 (d) s b Let k be 14/4 + (-2)/4. Let o(l) = 3l3 + 2l*2 + 9 - 8 + 4l - 4l3 + 0l*3. Let j be o(k). Which is the third biggest value? (a) 2/9 (b) 2 (c) j a Let i = 0.1026 - -45.8974. Which is the third smallest value? (a) i (b) -5 (c) 0.5 a Let k = 0.16 + -0.46. Let o = 0.72 + 3.98. Let s = k - o. What is the second smallest value in 1/5, s, 5? 1/5 Let o = -0.2 + 0.1. Let t = -5.09001 - -0.11301. Let c = t + -0.023. What is the second smallest value in c, -7, o? c Let o = 673.4 + -673. What is the smallest value in o, 9/4, -0.2, 0? -0.2 Let c = -607/2 - -303. Suppose n + 36 = -5s, 0 = 4n - 5s + 22 - 3. What is the third biggest value in -3/5, c, n? n Let s = -91 + 86.63. Let l = 4.4 + s. Which is the biggest value? (a) -3 (b) l (c) 3 c Suppose -5f + 12 = l, -2f - 10 = -3f - 4l. Which is the second biggest value? (a) f (b) -13 (c) 4 (d) 2/9 a Let h be (-1)/4 + (-22)/(-24). Let n = -46 - -35. Let r = n - 0. Which is the third biggest value? (a) -0.4 (b) r (c) h b Let q be (-1 - (-2 - 576))(-4)/60. Let o = -193/5 - q. Which is the biggest value? (a) 2/11 (b) 0 (c) o a Let h(d) = -d3 - 13d*2 - 37d - 4. Let q be h(-5). Which is the second biggest value? (a) 2/21 (b) q (c) 19 a Let m = 76 + -76. Let i = 0.9 - -7.1. Let n = i - 3. What is the third biggest value in m, -0.06, n? -0.06 Let k be ((-2)/20)/(2/(-5)). Let u(m) = -m*2 - 21 + 11m + m*3 + 13m*2 - 3m*2. Let w be u(-7). Which is the second smallest value? (a) k (b) -0.5 (c) w c Let k = -50272/117249 + -6/2299. Let v = 1/357 + k. Let w be 1/(-9) + 8/72 + 2-1. Which is the second smallest value? (a) -0.1 (b) v (c) w b Let d = -1236 + 2483/2. What is the second biggest value in -0.3, d, -4? -0.3 Let f be (-2163)/570 + 4 - 14/133. Which is the fourth biggest value? (a) -5 (b) 2/13 (c) f (d) -0.4 a Let r be (-14)/(-12)1/7. Which is the second smallest value? (a) r (b) 11 (c) -5 a Let k = 0.145 + 0.055. Let m = -0.1 - -0.1. What is the third biggest value in 1/9, k, m? m Let f = -4.1 - -3.8. Let o = -44/15 + 138/5. Let n = 364/15 - o. What is the third biggest value in f, -6, n? -6 Let h be (-12/7)/((-16)/28). Let u = -63 - -66. What is the fourth smallest value in h, -2, -0.3, u? u Let w = -105 - -106. What is the third smallest value in -1, 3/8, -0.01, w? 3/8 Let x = -250 - -260.1. Let q = 2.1 - x. Let g = q + 7.5. Which is the third smallest value? (a) 0.5 (b) g (c) -4 a Suppose 2z = -4m + 10, -5z = -3z - m. Let s be (z/(-3))/((-3)/(-20)). Which is the third biggest value? (a) 0 (b) -2 (c) s (d) -4 c Let i = 4.9 - -0.1. Let v be 12/(-8)8/(-6). Let o be ((-1)/(-12))/(v + 20/(-8)). Which is the smallest value? (a) -0.2 (b) o (c) i a Let n = 100 - 102. What is the fourth smallest value in -1.2, n, -0.5, -0.4? -0.4 Suppose -7 = -5j + 28. Let p be ((-3)/24)/(j/(-28)). What is the third smallest value in -0.2, p, 5? 5 Let g(x) = 13x - 1. Let v be g(1). Let f = 2.87 - 3.27. What is the third biggest value in f, 0.4, v? f Let g = 24 - 18. Let s(b) = b2 - 7b + 10. Let z be s(g). What is the smallest value in 2, -5, z? -5 Let t = -1.938 - -1.978. What is the third biggest value in t, 4/5, -1/14, -0.4? -1/14 Let m = 36 - 86. Let n = m + 452/9. Which is the smallest value? (a) n (b) 7 (c) 0.3 a Let s = 64 - 60. Let j be (-2 + 26/s)(-4)/(-42). Which is the second smallest value? (a) -0.8 (b) j (c) -5 a Let d = -3014 - -2995. Which is the third smallest value? (a) d (b) 4 (c) 11 c Let t = -699 + 706. What is the biggest value in -23, 2/9, t? t Let s = 49 + -30. Let v = s + -14. Which is the third smallest value? (a) v (b) 2 (c) -1/8 a Let x = 3.4 + -6. Let j = -1.6 - x. What is the third smallest value in -2/11, 3, j? 3 Let n be -1(-2)/12 - (-4)/12. Which is the second biggest value? (a) 6 (b) 1/4 (c) n c Suppose -17 = -12y - 5. Let k be 2/(-2)5/(-20). What is the smallest value in y, k, -1.3? -1.3 Let d be (-12)/(-15)*1/8. Let n = 7.505 + -0.505. Which is the third smallest value? (a) n (b) d (c) -0.2 a Let w = -0.82 + 0.32. Which is the third smallest value? (a) w (b) 1/22 (c) -4 b Let w be (-252)/52 - 2/13. Let l be (6/156)/(-4 - 68/(-16)). Wh	{ "pile_set_name": "DM Mathematics" }
*3 + 2y Let c(g) = 16g. Let l(f) = 11f. Let q(h) = -5c(h) + 7l(h). Let a(v) = 20v. Calculate 5a(o) + 32q(o). 4o Suppose d + 5 = 3q, -3d - 2 = -q - 3. Suppose 0 = -5i - 2 + 12. Let g(u) = 4u*2 - 2u - 1 + u - 2ui. Let y(h) = -h2 + h. What is qg(c) + 2y(c)? 2c*2 - 2 Let y(o) = -o + 5. Let h(l) = -3l + 9. Determine 3h(p) - 5y(p). -4p + 2 Let g(t) = t2 - 1. Let d(b) = -b3 - 2b*2 + 1. Let i = 5 + -1. What is ig(j) + 2d(j)? -2j*3 - 2 Let a(v) = -13v + 32. Let m(x) = 2x. Give -a(f) - 6m(f). f - 32 Let d(s) = s*3 + 4. Let k(y) be the first derivative of y - 41. Determine -d(q) + 4k(q). -q3 Let u(h) = h3 + 5h2 - 5h + 5. Let m(t) = 6t3 + 24t*2 - 24t + 24. Determine 5m(p) - 24u(p). 6p3 Let c(t) = -5t*2 - 4t - 9. Let m = 3 - -4. Let k(q) = -2q2 - 2q - 4. Give mk(h) - 3c(h). h*2 - 2h - 1 Let i(a) = 6a - 4. Let t(m) = 6m - 3. Give 3i(y) - 4t(y). -6y Let r be 2/8 - (-6)/8. Let h(m) = -m3 + m2 + 1. Let o(x) = 7x*3 - 7x*2 - 5. Calculate ro(i) + 5h(i). 2i*3 - 2i*2 Let c(h) = -13h + 1. Let q(a) = a - 1. Give -c(s) + q(s). 14s - 2 Let y(u) = -u. Let n be y(-3). Let a(w) = -3 - w + n - 3 + 6w. Let o(v) = v - 1. Calculate a(s) - 3o(s). 2s Let g(v) = 91v2 + 5v. Let d(b) = -136b2 - 7b. Determine 5d(j) + 7g(j). -43j2 Let r(u) = 5u*2 + 2u - 2. Let y(q) = 14q2 + 7q - 7. What is 7r(l) - 2y(l)? 7l2 Let w(k) = -4k*3 + 2k*2 - 1. Let x(b) = 17b*3 - 8b2 + 5. Let t(u) = -u2 + 12u + 15. Let o be t(13). What is ox(n) + 9w(n)? -2n*3 + 2n*2 + 1 Let p(v) = -4v - 55. Let h(i) = -2i - 28. What is 7h(k) - 4p(k)? 2k + 24 Let f(r) = -2r2 - r + 1. Let b(a) = 8a*2 - 6 + 0a*2 + 2a*2 + 253a - 247a. Calculate 3b(l) + 16f(l). -2l*2 + 2l - 2 Let j(w) = 2w3 + 8w*2 - 11w + 2. Suppose 2q - 5q = 3x, 5q + 4x = -3. Let l(m) = m3 + 3m*2 - 4m + 1. Calculate qj(k) + 8l(k). 2k3 + k + 2 Let t(j) = 5j - 1. Let q(k) = 5k. Calculate 3q(x) - 4t(x). -5x + 4 Let r(b) = -73b - 7. Let f(o) = -49o - 5. Determine 7f(j) - 5r(j). 22j Let s(h) be the second derivative of h3/6 + h. Let x(b) = -b - 1. What is -s(z) + x(z)? -2z - 1 Let i(q) = q3 + q2 + q. Let z(v) = 8v2 + 3v - 3. What is -3i(y) + z(y)? -3y*3 + 5y2 - 3 Let o(d) = -7 - d + 5 + 3 + d3. Let b(c) = 4c3 - 3c + 3. Give -2b(g) + 6o(g). -2g3 Let s(y) = y3 - y2 - y + 1. Let m(q) = q2 + 3q. Determine m(b) + s(b). b*3 + 2b + 1 Let c(f) = -7f3 - 2f*2 - 6f + 6. Let i(j) be the first derivative of -15/4j4 - 13/2j*2 - 4/3j*3 - 2 + 13j. Give -13c(o) + 6i(o). o*3 + 2o*2 Let l(h) = 7h*3 + 5h*2 - 5h. Suppose -2d - 4 = 0, -3s + 0d - 8 = d. Let i(t) = 3t*3 + 2t*2 - 2t. Determine sl(o) + 5i(o). o3 Let r(w) = -w - 1. Let s = 3 + -1. Let o(m) = m2 + 5m + 6. Let x be o(-4). Let f(v) = x + 1 - s. Calculate -f(j) - r(j). j Let n(d) = 5d + 5. Let t(y) = 3y + 2y - 2y + 1 + 1. Calculate -2n(b) + 5t(b). 5b Let h(t) = -2t - 4. Suppose 7k = 18 + 3. Let x(q) = 4q + 7. Calculate kx(g) + 5h(g). 2g + 1 Let o(u) be the third derivative of 1/30u5 + 1/24u*4 + 0 + 3u*2 + 0u - 5/6u3. Let w(i) = -i2 + 1. Determine o(t) + 3w(t). -t*2 + t - 2 Let o(i) = -8 - 16i + 2 - 10i + 12i. Suppose -28 = 3l + 4c, 6c - 3c + 27 = -3l. Let h(p) = 5p + 2. What is lh(t) - 3o(t)? 2t + 2 Let l(u) = 11u + 25. Let z(y) = -5y - 12. Calculate 6l(q) + 13z(q). q - 6 Let i(m) = 87m + 4. Let o(r) = -43r - 2. Give 6i(v) + 13o(v). -37v - 2 Let w(n) = n*3 - 9n*2 - 9n. Let r(b) = b3 - b2 - b. What is -18r(t) + 2w(t)? -16t3 Let u(l) = -2l*2 + 5l + 1. Let d = -2 + -3. Let z(y) = -2y2 + 3y*2 + 2y*2 - 2y*2 - 2y. What is dz(b) - 2u(b)? -b*2 - 2 Let k(a) = 3a. Let c be k(1). Let g(p) = -4 + cp + 4 + 6 + 2p. Let f(b) = 4b + 5. Determine -6f(r) + 5g(r). r Let q(o) = -o2 + 3o + 5. Let x(f) = f*2 - 3f - 6. Suppose 4 = 7h + 46. Determine hq(n) - 5x(n). n2 - 3n Let u(q) = 1. Let k(v) = 2v2 - 4v - 3. Determine k(a) + 2u(a). 2a*2 - 4a - 1 Let k(s) be the second derivative of -7s4/12 - 5s3/6 + s2/2 - s. Suppose -10 = -6n + 20. Let c(o) = -11o*2 - 8o + 2. Determine nc(y) - 8k(y). y*2 + 2 Let n be 1/(2 - (-1)/(-1)). Let u(g) = 1. Let r(m) = -3 + 2m + 11 - 3m. Suppose s - 4y + 5y + 2 = 0, -8 = -2y. Determine nr(l) + su(l). -l + 2 Let h be (4/6)/(2/3). Let s be 1 - -1 - (-1)/1. Let t(f) = -1 - sf + 0f + 4f. Let q(u) = -6u + 7. Determine hq(w) + 5t(w). -w + 2 Let k(n) = n - 3. Let j be (-4)/(-5)(-30)/12. Let d be 18/14 + j/7. Let v(t) = 1. Determine dv(p) + k(p). p - 2 Let o be (-1)/(-2((-9)/3)/66). Let y(z) = -26z*2 + 21z. Let n(q) = 5q2 - 4q. Determine on(l) - 2y(l). -3l2 + 2l Let h(c) = -c. Let w(i) = 2i + 1. Give 5h(d) + 2w(d). -d + 2 Let d(y) = -2y - 1. Let h(c) = 3c + 1. Give -4d(b) - 3h(b). -b + 1 Let y(j) = 17j*2 - 2. Let t(l) = 34l*2 - 5. Calculate 2t(n) - 5y(n). -17n*2 Let b(u) = 2u + 4. Suppose -2l - 9 - 6 = 5j, 4l - j = 3. Let a(v) = 6 + 4 - 2v - 15 + l. What is -4a(t) - 5b(t)? -2t Let w(x) be the first derivative of -x2/2 + 2x + 7. Let u(q) = q - 3. Calculate -3u(d) - 4w(d). d + 1 Suppose 5u = 5h + 30, h - 3h + 4u = 16. Let r(p) be the first derivative of 3p4/4 + p2 - 4p + 2. Let x(n) = -1. Calculate hx(o) + r(o). 3o*3 + 2o Let l(q) = -5 + 5q + 4q*2 - 3q*2 - 5q*2. Let r = -6 - -15. Suppose 2j = -3 + r. Let s(n) = 2n2 - 3n + 3. Give jl(g) + 5s(g). -2g2 Let h(y) = 3 + y - 6 + 1. Let f(j) = j - 1. Determine 5f(q) - 2h(q). 3q - 1 Suppose 0s = -2s - 16. Let p(t) = -2t - 2. Let r(d) = -5d - 6. Determine sp(b) + 3r(b). b - 2 Let w(p) = p*2 - 1. Let m(a) = 7a*2 - 1. Let q be m(-1). Let f(x) = -15x*2 + 4x*2 + q + 4x*2. Give -f(i) - 6w(i). i*2 Let j(y) = -231y. Let d(a) = -a. Calculate -198d(n) + j(n). -33n Let p(o) be the second derivative of -o3/6 + o2/2 - 3o. Let s be 2/(-7) - (-64)/28. Let u(r) = 3 - 4r - 3 + 3. Give su(v) - 6p(v). -2v Let i(s) be the first derivative of s3/3 - 3s*2/2 - 2s - 4. Let z(k) be the first derivative of i(k). Let n(x) = -x + 2. Give 6n(t) + 4z(t). 2t Let s(p) = 2p*2 + 4p + 4. Let x(h) = 12h2 + 11h + 11. Let i(w) = -11w2 - 11w - 11. Let d(o) = -6i(o) - 5x(o). Give 4d(z) - 11s(z). 2z2 Let a(z) = 8z + 12. Suppose j + 9 = -2c + 3c, -2c - 3j - 7 = 0. Let s(q) = 3q + 4. What is ca(t) - 11s(t)? -t + 4 Let h(c) = -c3 - c2 + c - 1. Let m = 9 - 7. Let j(i) = -2i*3 - 3i*2 + 3i - 3. Give mj(f) - 6h(f). 2f3 Let i(d) = -2d + 3. Suppose -3t - a = -11, 5a = -5t + t + 22. Let x(p) = -p + 2. Let q be 120/(-28) - 2/(-7). Calculate qx(c) + ti(c). -2c + 1 Let a(t) = t*2 + t - 1. Let w(d) = -5d*2 - 8d + 8. Give -6a(l) - w(l). -l2 + 2l - 2 Let y(t) = t*2 + 1. Let n(h) = 12h*2 + 3h + 20. Let a(o) = -8o2 - 2o - 13. Let v(j) = -8a(j) - 5n(j). What is 2v(c) - 7y(c)? c*2 + 2c + 1 Let z(d) = d*3 + 2d2 - 1. Let u = -20 + 22. Let w(f) = f3 + 3f2 - 2. Give uw(o) - 3z(o). -o3 - 1 Let s(o) = -5o*2 - o + 6. Let y(i) = -4i*2 + 2i + 8. Let g(h) = -8h2 + 5h + 17. Let x(l) = 3g(l) - 7y(l). Calculate -3s(t) - 4x(t). -t*2 - t + 2 Let a(h) = 11h*2 - h + 1. Let j(w) = 5w*2. What is 2a(u) - 5j(u)? -3u*2 - 2u + 2 Let y = 8 - 4. Let k(h) = h + 4h3 + 10 - 4 + yh. Let s(g) = g*3 + g + 1. Give k(t) - 6s(t). -2t3 - t Let d(y) = -y + 4. Let o(s) = 3s - 9. Let f(w) = 3w + 2w2 - w2 + 0w2 + 4 - 7. Let k be f(-3). Give ko(b) - 7d(b). -2b - 1 Let o(s) = 5s - 8. Let z(i) = i - 1. Let x(j) = 8j - 10. Let f(p) = -x(p) + 5z(p). What is 8f(h) + 5o(h)? h Let s(b) = -8b*2 + 5. Let x(o) = -20o*2 + 12. What is 12s(f) - 5x(f)? 4f*2 Let u = -8 + 10. Let w(s) = -5 - 17s*u + 9 + 9s*3 + 6s*3 + 6s*2. Let h(j) = -4j*3 + 3j*2 - 1. Determine -22h(a) - 6w(a). -2a*3 - 2 Let k(o) = o - 6. Let d(x) = 2x - 12. Let w(z) = 6d(z) - 13k(z). Let b(n) = -3. Let y(c) = 1. Let m(f) = -b(f) - 4y(f). Determine -11m(v) - 2w(v). 2v - 1 Let a(q) = q*2 + 6q - 3. Let s(g) = -3g2 - 19g + 10. Determine 7a(o) + 2s(o). o*2 + 4o - 1	{ "pile_set_name": "DM Mathematics" }
s digit of a? 7 Suppose 6l = l + 15. Suppose -18 = -d + lk, d + 3k = -d + 81. What is the tens digit of d? 3 Let l(i) = -i + 6. Let k be l(-3). Let c(s) = 21s*2 - 2s + 1. Let n be c(1). Let y = k + n. What is the tens digit of y? 2 What is the hundreds digit of (-92 + 11 + -2)-50? 1 Let q = -602 + 1239. What is the units digit of q? 7 Let z(t) = 7t - 16. Let r be z(5). Let h = r + 62. What is the units digit of h? 1 Suppose 0 = 13r - 8r - 15, r = 5w - 12222. What is the tens digit of w? 4 Suppose -1829 = -4z - 5h, 4z - 1819 = -2h - h. Suppose 153 + z = 4f. Suppose -5n = 5a - 240, -5n + f = -2n - 4a. What is the tens digit of n? 4 Let z(p) = 269p*2 + 5p - 2. What is the tens digit of z(1)? 7 Suppose 0 = -11w + 5w + 174. Let z = 256 - w. What is the hundreds digit of z? 2 Suppose 3u - 5a - 1215 = 0, -2u - 23a = -21a - 810. What is the tens digit of u? 0 Suppose 0 = -3l - l - 12. Let a be l - -44 - 12. Let j = 63 - a. What is the units digit of j? 4 Suppose 388y - 391y + 2i + 13410 = 0, -y + 4471 = -i. What is the tens digit of y? 6 Let z(b) = -30b + 258. What is the hundreds digit of z(-23)? 9 Suppose 2o - 9o = 14. What is the units digit of 81 + o + (4 - -2)? 5 Let z be (-33 - 2)/5(1 + 0). What is the units digit of (-1)/z + (-13273)/(-91)? 6 Let r be (3 - -36)8/12. Suppose -n = -3u + 10, -4u - u + 4n + r = 0. Suppose 4j + 9 + 3 = 0, -5j + 37 = uq. What is the tens digit of q? 2 Suppose 854 = 4g + 3n, 2g + 3g - 3n - 1081 = 0. What is the hundreds digit of g? 2 Let x(m) = m*2. Let s(c) = 2c*2 - 17c - 42. Let z(r) = -s(r) + 3x(r). What is the units digit of z(-18)? 0 Let m = -298 + 578. What is the units digit of m? 0 Let g be 3(0 - 1) - -6. Suppose 0d + 3b = -d + 37, 0 = gd + 5b - 99. Suppose -r + 5r - d = 0. What is the units digit of r? 7 Suppose -28 = -10q + 32. What is the hundreds digit of ((-172)/10)/(q/(-60))? 1 Suppose -4a + 2 = -18. Suppose 0 = -5g - t - 38, -ag - 4t - 23 = 9. Let p(r) = -6r + 14. What is the units digit of p(g)? 2 Let d(r) = -47r + 47. Let t be d(-13). Suppose -3z - n = -504, -n + 180 + t = 5z. What is the units digit of z? 7 Let g(k) = -k*2 - 7k. Let m be g(-7). Suppose 5d - 6 + 1 = m. Suppose d = w - 33. What is the tens digit of w? 3 Suppose -z - 13 = 5a, 20 = 5z - 8z + 4a. Let p = 56 + z. What is the tens digit of p? 4 What is the units digit of 1-1061((-255)/(-5))/(-17)? 3 Suppose 0x - 10 = -2x. Suppose -91 = -3k + x. What is the tens digit of k? 3 Suppose -5k + k - 13 = -5s, -s + 18 = -3k. Let g(q) = -3q - 4. Let p be g(k). Suppose -2i + p = -51. What is the tens digit of i? 3 Let v = 241 - 259. Suppose -2a = -a + 23. Let x = v - a. What is the units digit of x? 5 Suppose -4c - 12 = 0, 0 = p - c + 2c - 886. What is the tens digit of p? 8 Suppose 42u + 2685 = 43u - 5j, 5337 = 2u + j. What is the hundreds digit of u? 6 Suppose 5z - 6422 + 457 = 5b, 0 = -5z - 5b + 5945. What is the thousands digit of z? 1 Let z(i) = i*3 - 3i2 - i. Let u = 9 + -6. Let n be z(u). Let p = 0 - n. What is the units digit of p? 3 Let q(v) = -v2 - 3v + 14. Suppose -1 + 9 = s. Let k be q(s). Let w = -44 - k. What is the tens digit of w? 3 Suppose -2o - 7591 = -5h, 4h - 8h = -5o - 6066. What is the tens digit of h? 1 Suppose 1390 = 5w + 2k, 0k - 3k = 4w - 1112. What is the hundreds digit of w? 2 Suppose 4n - 4151 = -5k - 0k, k = -3n + 828. What is the hundreds digit of k? 8 Let i(l) = -10 + 26l + 11 + 32 - l*2. What is the hundreds digit of i(20)? 1 Suppose -j = 4g - 5g - 8, -3j = 4g - 3. Suppose -jm = -8m + 267. What is the units digit of m? 9 Suppose 3y = 0, 2s + y = -2s + 6288. What is the units digit of s? 2 Let u be 18(0 - (1 - 0)). Let x = u - -24. Suppose 5 = 3g + 4f - x, 26 = 5g - f. What is the units digit of g? 5 Let r(t) = 4t2 + 4t - 14. Let u(w) = w*3 - 6w*2 - 4w - 17. Let z be u(7). What is the tens digit of r(z)? 6 Suppose a - w - 12 = 0, w + 20 = -4w. Let j(c) = 12c - 16. What is the tens digit of j(a)? 8 Let h = 1314 + -782. What is the hundreds digit of h? 5 Let t be (-1)/((-3)/(-2)) - (-9730)/15. Suppose 165 = 3r - t. What is the hundreds digit of r? 2 Let y = 10 + -85. Let o = y - -133. What is the tens digit of o? 5 Let n be 2 - (1 - 1) - 10/(-5). Suppose -115 = -nc + f + 4f, 0 = 3c - f - 100. What is the tens digit of c? 3 Let r be -2 + 24/9 - 13/(-3). What is the tens digit of 176/5 + r/(-25)? 3 Suppose -597p + 579p = -30690. What is the tens digit of p? 0 Let m(l) = -l*3 - 10l*2 - 8l + 12. Let x be m(-9). Suppose 4v = -5i - 26, -5i + xv = -i + 27. What is the units digit of (-16)/i(2 - -1)? 8 Let z = 941 - 564. What is the hundreds digit of z? 3 Suppose 0 = 7x - 51450 + 13048. What is the units digit of x? 6 Let c(t) = -t*2 + 56t - 133. What is the units digit of c(27)? 0 Let i = 12 - -5. Let u = i - 18. What is the units digit of ((-88)/16)/(u/10)? 5 Let s(b) = 9b - 3b - b + 8 + 2b3 + 4b - 7b2. What is the hundreds digit of s(6)? 2 Suppose 0l + 3l - 15 = 0. Suppose 3h + 3 = -12, 0 = -lg + h + 45. What is the units digit of (g/4 - 12)/(-1)? 0 Let t = -73 - -77. What is the units digit of t? 4 Let o = 118 + -6. Suppose -9p + 11p = o. What is the tens digit of p? 5 Suppose -2953 - 1359 = -4b. What is the thousands digit of b? 1 Let z(l) = l + 23. Let f be z(-13). What is the units digit of ((-8)/f)/((-4)/710)? 2 Let y(i) = 35i - 263. What is the units digit of y(15)? 2 Let i be (-24)/48 - 14/4. Let b(h) = -8h + 0 + 2 - 8. What is the tens digit of b(i)? 2 Let k be (4/(-16)0)/(-1). Let y = 78 - k. What is the units digit of y? 8 Let v = 19 + 29. Suppose 10x - v = 2x. What is the units digit of x? 6 Let g = 713 + -102. What is the tens digit of g? 1 Suppose 2b + 6 = 2w, 4b - 2w = -16 + 2. Let h(q) = 6q - 38. Let j be h(8). What is the units digit of (-90)/b + j/20? 3 Let f(s) = -6s - 3 + 3s + 4s - 3. Let d be f(6). Let u = 18 + d. What is the tens digit of u? 1 Suppose 61 = 10p - 14779. What is the tens digit of p? 8 Let x(c) = 322c2 - 2c - 28. What is the units digit of x(-3)? 6 Let i = -30 - -26. Let s be 2 - (-8)/(i/(-1)). What is the units digit of -27((-26)/6 + s)? 9 Let o(k) be the first derivative of -6 + 11/2k*2 + 2k. What is the units digit of o(2)? 4 Let c = -238 - -269. What is the units digit of c? 1 Suppose 44 = 8j + 12. Suppose -5t = 2c - 1156, -2c = 4t - jc - 914. What is the hundreds digit of t? 2 What is the hundreds digit of 2/(-5) + 0 + 381297/105? 6 Let n(i) = i + 35. Suppose -8 = 6x - 44. Suppose 4 + x = -g. What is the units digit of n(g)? 5 Let h(y) be the third derivative of y5/40 - y4/2 - 2y*3/3 + 9y*2. Let k(b) be the first derivative of h(b). What is the units digit of k(11)? 1 Suppose 5r + 2w - 625 = 0, -25w + 23w = r - 133. What is the hundreds digit of r? 1 Let k = 1 + 2. Suppose z - k = -15. Let t = -8 - z. What is the units digit of t? 4 Let f(d) = d2 + 8d - 9. Let r be f(-8). Let k(y) = 2y2 + 9y - 21. What is the units digit of k(r)? 0 Let s = 965 - 480. What is the tens digit of s? 8 Let u = 2083 + -992. What is the tens digit of u? 9 Let f = 2866 + -1611. What is the tens digit of f? 5 Let b(a) = -2a3 + 23a*2 - 27a + 37. Let w(y) = y*3 - 11y*2 + 13y - 18. Let o(d) = 2b(d) + 5w(d). What is the tens digit of o(9)? 8 Let q(x) = -2x3 + 5x*2 + 3x + 4. Let k = 9 - 5. Let j be q(k). What is the units digit of (-104)/j + (-2)/8? 3 Let v be (2 - (-4)/2)(-6)/(-4). What is the units digit of -6(-10)/8v? 5 Let c = 59 - 13. Suppose -3n - 62 = c. What is the tens digit of (128/6)/((-24)/n)? 3 Let a = -9 + -4. Let w = -11 - a. Suppose -15 = -wj + 39. What is the tens digit of j? 2 Suppose h + 135 = 2j - 37, 93 = j - 4h. Suppose 8w = 9w - j. Suppose g = 5f - 127, w = 5f - 2f - 5g. What is the units digit of f? 5 Let v be ((-8)/(-18))/(68/306). Suppose 0 = 4x + 3f - 5, -4f + 4 = 5x - x. Suppose xm + 2u - 4 = 4u, vm = -u + 16. What is the units digit of m? 6 Let q(y) = -2y + 15. Let h be q(7). Let m(c) = 5c2 + 2c + 2. Let p be m(-2). Suppose -n + p = 5a - h, -4n = a. What is the units digit of a? 4 What is the hundreds digit of ((-5	{ "pile_set_name": "DM Mathematics" }
+ l + 1. Give -2j(u) + r(u). -21u*3 + 2u2 - 1 Let w = -85 + 90. Let k(z) be the third derivative of z5/60 - 3z2. Let b(a) = 2a*2 + 1. Calculate wk(n) - 2b(n). n2 - 2 Let h(f) = 4f*2 - 8f - 5. Let p(v) = v*2 - v - 1. Determine h(m) - 3p(m). m*2 - 5m - 2 Let m(h) = -11h2 + 14h + 14. Let o(s) = -4s2 + 5s + 5. Calculate -3m(k) + 8o(k). k*2 - 2k - 2 Let n(c) = 6c - 22. Let p(v) = -v. Calculate -n(x) - 3p(x). -3x + 22 Let h(g) = -g2 - g. Let r(d) = -7d*2 - 8d - 1. What is -4h(u) + r(u)? -3u*2 - 4u - 1 Suppose -31 + 6 = 5x. Let a be 1/2(1 + -1). Let h(u) = -7 - 5u + au + 4u. Let z(r) = r + 6. What is xh(l) - 6z(l)? -l - 1 Let d(f) = -5f*2 - 2f + 4. Let m = 43 + -23. Suppose 2h = -3h + m. Let a(x) = 6x2 + 2x - 5. Let z be 4/(232/40 + -5). Give ha(y) + zd(y). -y*2 - 2y Let f(g) = -2 - g + 3 + 2g - g2. Let p(t) = -t3 - t2 - t + 3. Suppose 8 = 5b - q, -2b = 2b + 2q + 2. Determine bp(w) - f(w). -w*3 - 2w + 2 Let u(z) = 2z2 - 7z - 11. Suppose -3v - 10 - 23 = 0. Let x(w) = w2 - 4w - 6. Determine vx(n) + 6u(n). n*2 + 2n Let s(m) = m*2 - 4m + 1. Let c(j) = 19j + 5j*2 + 7j - 9 - 5j. Let r(n) = n2 + 5n - 2. Let f(o) = -2c(o) + 9r(o). Give 3f(a) + 2s(a). -a*2 + a + 2 Suppose -5m - 1 + 14 = l, 5l - 5m - 5 = 0. Let z(i) = i*3 - i. Let s(u) = 5u*3 + 2u*2 - 3u - 1. What is lz(o) - s(o)? -2o*3 - 2o2 + 1 Let v(x) = x3 + 7x2 + 9x - 1. Let j be v(-5). Let o = 13 + -6. Let z(m) = -om - 2m + 3m - 4. Let n(s) = s + 1. Calculate jn(t) + z(t). -2t Let r(c) be the third derivative of c4/24 + c3/6 - 18c*2. Let s = 3 + -4. Let n(x) = 3x + 5. Determine sn(f) + 5r(f). 2f Let v be 13(-3 - -1). Let c(i) = 2i*3 - 6. Let x = -76 + 12. Let r be 2/10 - x/5. Let t(y) = 4y*3 - 13. Determine rc(g) + vt(g). 2g*3 Let z(n) = -7n - 2. Let r(h) be the first derivative of -4h2 - 3h - 26. What is 5r(i) - 6z(i)? 2i - 3 Let u(p) = 13p - 7. Suppose 2q - 34 = -22. Let d(j) = -7j + 4. Suppose -z + 4z - 33 = 0. Calculate qu(i) + zd(i). i + 2 Let h(r) = -6r. Let z(q) = -29q + 65q - 34q. Calculate 2h(t) + 5z(t). -2t Let f = 10 - 8. Let p(n) = -1 + 0n2 - 4n*f + 0n*2 + 3n*2. Let s(r) = -6r*2 - 5. Determine 5p(u) - s(u). u*2 Let f(d) = 2d + 3 + 0 + 0d + 9d. Let o(y) = -34y - 10. Let m(p) = 7f(p) + 2o(p). Let q(t) = 22t + 2. Calculate -12m(j) + 5q(j). 2j - 2 Suppose b = -9 + 11. Let n(t) = -t - 1. Let w(h) = -h + 1. Determine bn(r) + 2w(r). -4r Let p(a) = a + 1. Let n(c) = -7c2 - 12c - 6. Let r(m) = -n(m) - 6p(m). Let t(g) = 0g2 - g2 + 2g2 - 5g - 7g2. Give 5r(d) + 6t(d). -d2 Let u(s) = 3s + 45. Let q(v) = 4v + 45. What is -4q(p) + 5u(p)? -p + 45 Let x(i) = -2i*2 - 2i2 - 30 + i3 + 31 + 3i2. Suppose -17 = h + 5f, -3h = -4h - 2f - 5. Let z(w) = 3w*3 - 4w*2 + 4. Give hz(a) - 12x(a). -3a3 Let l = -3 + 5. Let h(q) = -q2 + 2q - 2. Let y(b) = -6b + 8b + 25b - 12b2 + 11 - 38. What is ly(m) - 27h(m)? 3m2 Let r(g) = -g2 - 1. Let y(c) = -8c2 + 5. Calculate 5r(b) + y(b). -13b2 Suppose -2f = -2 + 4. Let z(j) = -3j3 - 12j*2 - 12j - 12. Let k(h) = h*2 + h + 1. Determine fz(g) - 12k(g). 3g3 Let p(w) = w2 - 2w + 4. Let l(x) = 6x*2 - 8x + 21. Let z(t) = -6t2 + 7t - 21. Let a(m) = 3l(m) + 2z(m). Determine 2a(r) - 11p(r). r*2 + 2r - 2 Let a(q) = q + 4. Let w(d) be the third derivative of -d4/24 + d3/6 - 17d2. Give -a(t) + 4w(t). -5t Let g(f) be the third derivative of -f6/30 + f3/3 + 36f*2. Let v(z) = 9z*3 - 5. Determine -10g(k) - 4v(k). 4k*3 Let y(c) = 8 + 0 + 4c*2 + 0c*2 - 7c3 - 6. Let s(o) = -o3 + o*2. What is -6s(u) + y(u)? -u*3 - 2u*2 + 2 Let o(f) = 4f - 3f2 + 4 + 5f*2 + 4f*2. Let v(m) = -13m*2 - 9m - 9. Calculate -9o(x) - 4v(x). -2x2 Let z(h) be the second derivative of -5h*3/6 - 2h*2 + 6h. Let w(g) = 4g + 3. Calculate 4w(y) + 3z(y). y Let m(x) = -x3 - x2 - x + 1. Let u(n) = 36n*3 + 34n*2 + 34n - 34. Calculate 204m(b) + 6u(b). 12b3 Let b(m) = m - 5. Let a be 2/(-4)(-2)/(-1). Let i(t) = -t - 1. Let x be 7/2 + (-1)/2. Let l(z) = z + 2. Let d(n) = xi(n) + 2l(n). Give ab(u) - 3d(u). 2u + 2 Let l(p) = -1. Suppose -1 = 3q - 7. Let d be (-1)/q - (-2)/4. Let n = 2 - d. Let t(y) = 2y - 4. Calculate nl(w) - t(w). -2w + 2 Let x(i) = 15i*3 - 11i*2 - 11i + 11. Let s = 14 + -17. Let u be (s/5)/((-2)/20). Let w(y) = -8y3 + 6y*2 + 6y - 6. Calculate ux(a) + 11w(a). 2a3 Let y(s) = -s3 - s2 - s + 1. Let n(l) = -5l*3 - 5l*2 - 6l + 5. Give n(c) - 6y(c). c3 + c2 - 1 Let w(s) = 37s*3 + 3s + 14. Let k(g) = 12g3 + g + 5. Calculate -11k(b) + 4w(b). 16b*3 + b + 1 Let w(i) = 24 - 24 + 6i. Let j(b) = -5b. What is -5j(o) - 4w(o)? o Let i(d) = 2d - 6. Suppose 0 = 4m - 3n + 1, 0 = -3n + 9. Let u(s) = -1 + m - 5 + 3. Give i(f) - 6u(f). 2f Let k(v) = 4v + 11. Let a(h) = 5h + 12. Determine 6a(q) - 7k(q). 2q - 5 Let c = 14 - 10. Let s(i) = 4 + 4i - 2 + 4i - ci. Let y = 2 - 1. Let h(m) = m + 1. What is ys(n) - 2h(n)? 2n Let x(m) = 2m3 + 6m + 6. Let a(i) = 2i3 + 5i + 5. Suppose 11 = -3z - 4k, 5k = -2z - 2 - 3. Let t be z/(0 - (-3)/3). Determine ta(c) + 4x(c). -2c3 - c - 1 Let g(b) be the second derivative of b3/6 + b. Let w(l) = 2l. Let o = -284 - -281. Give og(m) + 2w(m). m Let g(t) = -7t2 - 6t - 38. Let m(p) = 6p2 + 5p + 37. What is 5g(j) + 6m(j)? j2 + 32 Let h(w) = -w. Let x(r) = -r - 1. Let a(v) = v2 + 11v + 9. Let y be 10/(-3)(10 - 7). Let d be a(y). Calculate dh(c) + 2x(c). -c - 2 Let h = -19 - -15. Let k(o) = o + 1. Let a(n) = 9n + 14. Let c(u) = -a(u) + 5k(u). Let p(q) = 2q + 5. Give hc(v) - 7p(v). 2v + 1 Let i(c) = 2. Let q be (-35)/(-49) + (-2)/(-7). Let l(f) = -f3 + f2 - 1. Give qi(g) + 2l(g). -2g3 + 2g*2 Let h(i) = -36i*2 + 21i. Let t(o) = -5o2 + 3o. What is 2h(p) - 15t(p)? 3p2 - 3p Let l(u) = 6u3 + 2u - 3. Let a(r) = -7r3 - r + 4. Determine -5a(d) - 6l(d). -d3 - 7d - 2 Let b(t) = -7t. Let w(s) = 190s. What is -80b(j) - 3w(j)? -10j Suppose 147 = -4f + 3g, 146 = -4f - 0g + 2g. Let t(v) = v*3 - 9v + 9. Let b(h) = h - 1. Determine fb(m) - 4t(m). -4m3 Let i(y) = 4y*2 - 4y + 2. Let o(d) = 9d2 - 9d + 4. Give -13i(g) + 6o(g). 2g2 - 2g - 2 Let f(r) = -r*2. Let j = -26 + 27. Let k(o) = -2o - 2. Calculate jk(i) + f(i). -i2 - 2i - 2 Let n(j) = 2. Let q = 0 + 0. Let k = q - -2. Let z(g) be the second derivative of -g3/6 + g2/2 - 14g. What is kz(u) - n(u)? -2u Let b(n) be the second derivative of n3/2 + n2/2 - 12n. Let x(d) = -5d - 2. Calculate -7b(z) - 4x(z). -z + 1 Let w(v) = 6v. Suppose -3z + 5p = 0, 5z + 3p = -0z + 34. Let c(q) = -4q. What is zw(i) + 8c(i)? -2i Let y(k) = 3k*3 + 2k - 2. Let h(i) be the third derivative of -13i6/120 - 3i*4/8 + 3i*3/2 + 6i*2. Calculate -2h(t) - 9y(t). -t3 Let j(g) = 19g*2 - 9. Let i(x) = -5x*2 + 2. What is 9i(t) + 2j(t)? -7t*2 Let a(j) = -2j + 1. Suppose 0 = 7v - 10v. Suppose 9s - 4s - 10 = v. Let k(m) = -m*3 + 3m. Give sk(r) + 3a(r). -2r3 + 3 Let v(w) = -w2 + w - 7. Let a(l) = -1. Determine -6a(o) - 2v(o). 2o*2 - 2o + 20 Let x(i) = -i2 - i. Let z(v) = v2 + 9v - 8. Let u be z(-10). Let w(c) = c2 - 2c. Calculate ux(d) - w(d). -3d2 Let s(o) = o - 3. Let p(g) = g2 + g + 1. Calculate -2p(a) + s(a). -2a*2 - a - 5 Let r(w) be the third derivative of 0 + 1/6w*3 + 0w - 13/24w4 + w2. Let z(h) = 10h - 3h - 10h. Calculate 2r(v) - 9z(v). v + 2 Let j(a) = -3 + a + 3 + 1. Let s = 3 + -9. Let o(t) = t*2 + 9t + 7. Let i(c) = c*2 + 10c + 7. Let y(v) = 3i(v) - 4o(v). Give sj(w) - y(w). w2 + 1 Let x(c) = c3 - 5c*2 - 7c + 8. Let v be x(6). Let d(l) = 2l2 + 2 - l + 0 - 3l*v. Let o(k) = -2k*2 - 2 + 0k*2 + k + 3k*2. Give -6d(j) - 7o(j). -j2 - j + 2 Let k(n) be the first derivative of -n4/4 - n3/3 - n2/2 + 1. Let g(y) = 7y*3 + 6y*2 + 7y + 1. Calculate g(z) + 6k(z). z3 + z + 1 Let l(z) = z2 + z + 2. Let y(r) be the second derivative of 1/12r*4 + r	{ "pile_set_name": "DM Mathematics" }
1 e when three letters picked without replacement from giieiigiigeiiegie? 3/85 Two letters picked without replacement from {u: 1, n: 2, i: 4, s: 1, z: 1, p: 3}. What is prob of picking 2 i? 1/11 Four letters picked without replacement from jvjylclvvjbyjvyyvyjv. What is prob of picking 2 j and 2 v? 10/323 Calculate prob of picking 3 z when three letters picked without replacement from {z: 7}. 1 Three letters picked without replacement from {d: 5}. What is prob of picking 3 d? 1 Calculate prob of picking 3 w when three letters picked without replacement from {p: 1, v: 5, w: 5}. 2/33 Calculate prob of picking 1 e and 1 v when two letters picked without replacement from eiiyev. 2/15 Calculate prob of picking 1 p and 1 z when two letters picked without replacement from {h: 2, z: 1, p: 1}. 1/6 Calculate prob of picking 2 q and 1 p when three letters picked without replacement from {c: 2, l: 2, p: 3, d: 1, o: 1, q: 3}. 9/220 Three letters picked without replacement from {l: 1, j: 2, q: 6, m: 2, i: 5, x: 1}. Give prob of picking 1 j and 2 i. 1/34 Four letters picked without replacement from ghhhhhhhhhhhhhhhhhh. Give prob of picking 1 g and 3 h. 4/19 Four letters picked without replacement from ajjjattaaajtttjttjj. What is prob of picking 2 a and 2 t? 35/646 Two letters picked without replacement from {y: 1, j: 2, t: 9, n: 1}. What is prob of picking 2 t? 6/13 Calculate prob of picking 2 l, 1 s, and 1 r when four letters picked without replacement from {o: 2, s: 6, z: 1, l: 2, r: 7, e: 1}. 7/646 Two letters picked without replacement from yyysyuyyuysuyyy. Give prob of picking 1 y and 1 s. 4/21 Calculate prob of picking 1 q, 1 d, and 1 u when three letters picked without replacement from {x: 2, q: 4, d: 2, u: 6, s: 1}. 48/455 Three letters picked without replacement from {h: 5, s: 2, v: 4, i: 8}. What is prob of picking 1 h and 2 s? 5/969 Three letters picked without replacement from xninisxnnxnnsu. What is prob of picking 2 s and 1 u? 1/364 What is prob of picking 1 n and 1 h when two letters picked without replacement from jhnzzhhjhz? 4/45 Three letters picked without replacement from {q: 2, e: 5, p: 2, v: 2, i: 1, f: 2}. Give prob of picking 1 e and 2 q. 5/364 What is prob of picking 2 n when two letters picked without replacement from {n: 7, t: 3, k: 4, s: 5}? 7/57 What is prob of picking 1 m and 1 w when two letters picked without replacement from {k: 4, m: 1, w: 2, o: 4}? 2/55 What is prob of picking 2 y when two letters picked without replacement from {y: 3, s: 13}? 1/40 Two letters picked without replacement from {s: 5, z: 1, l: 1, t: 1, f: 2, q: 6}. What is prob of picking 1 l and 1 q? 1/20 Four letters picked without replacement from {g: 7, u: 4}. What is prob of picking 3 g and 1 u? 14/33 What is prob of picking 3 n when three letters picked without replacement from {j: 8, n: 5}? 5/143 What is prob of picking 3 p when three letters picked without replacement from {p: 5, s: 3}? 5/28 Three letters picked without replacement from dgdggdggggggggg. What is prob of picking 3 g? 44/91 What is prob of picking 1 i and 2 s when three letters picked without replacement from iiiiiss? 1/7 Two letters picked without replacement from hhhkhkh. Give prob of picking 1 k and 1 h. 10/21 Calculate prob of picking 1 y and 1 k when two letters picked without replacement from wcyyycyyk. 5/36 Three letters picked without replacement from wjozwqzjzqhqhw. What is prob of picking 1 o, 1 j, and 1 w? 3/182 Two letters picked without replacement from {z: 1, f: 3, o: 4, i: 5, w: 1}. Give prob of picking 1 f and 1 i. 15/91 Four letters picked without replacement from {o: 2, t: 1, y: 2, e: 1, h: 1}. What is prob of picking 1 h, 1 t, and 2 y? 1/35 Calculate prob of picking 2 g when two letters picked without replacement from gidgiiggg. 5/18 Four letters picked without replacement from wncjccnwwcncw. What is prob of picking 4 w? 1/715 What is prob of picking 2 z when two letters picked without replacement from ooogzzogo? 1/36 What is prob of picking 1 y and 2 v when three letters picked without replacement from {v: 2, y: 4, j: 1, h: 4}? 4/165 Two letters picked without replacement from kkzkzwke. What is prob of picking 1 w and 1 k? 1/7 Three letters picked without replacement from {e: 4, f: 5, s: 6, g: 5}. Give prob of picking 1 e and 2 g. 2/57 What is prob of picking 1 m and 1 l when two letters picked without replacement from {a: 1, l: 3, m: 1}? 3/10 Four letters picked without replacement from {s: 3, v: 8, c: 5}. Give prob of picking 1 v and 3 s. 2/455 Calculate prob of picking 1 g and 1 o when two letters picked without replacement from {o: 1, g: 1, v: 1, w: 1, r: 1}. 1/10 Two letters picked without replacement from {g: 6, r: 10, h: 2}. What is prob of picking 2 h? 1/153 Calculate prob of picking 1 m, 2 i, and 1 l when four letters picked without replacement from {l: 2, v: 2, m: 6, n: 3, k: 3, i: 2}. 1/255 Three letters picked without replacement from {m: 2, x: 3, q: 15}. Give prob of picking 1 x, 1 m, and 1 q. 3/38 What is prob of picking 2 u and 1 z when three letters picked without replacement from {u: 5, k: 2, z: 8}? 16/91 Three letters picked without replacement from {m: 3, q: 4, r: 1}. What is prob of picking 1 r and 2 q? 3/28 What is prob of picking 2 x when two letters picked without replacement from {f: 2, z: 3, x: 3, h: 10}? 1/51 What is prob of picking 2 n when two letters picked without replacement from {n: 14, w: 1, b: 5}? 91/190 What is prob of picking 2 i when two letters picked without replacement from biii? 1/2 Two letters picked without replacement from gwssssw. Give prob of picking 2 w. 1/21 What is prob of picking 2 z and 2 k when four letters picked without replacement from zzzzzkk? 2/7 Two letters picked without replacement from iiijjhjjiiiiiijh. Give prob of picking 1 i and 1 h. 3/20 Two letters picked without replacement from {i: 1, m: 4, j: 2, h: 2}. What is prob of picking 1 j and 1 i? 1/18 Three letters picked without replacement from rxdrrrrrcxdrldlxdrl. What is prob of picking 1 r, 1 x, and 1 c? 8/323 What is prob of picking 2 m and 2 i when four letters picked without replacement from xmmmmixxxi? 1/35 Calculate prob of picking 1 v and 2 s when three letters picked without replacement from {h: 2, v: 4, s: 7}. 42/143 Two letters picked without replacement from tqvtdtqtqqqqqqq. Give prob of picking 2 q. 12/35 Calculate prob of picking 1 i and 1 u when two letters picked without replacement from {d: 3, x: 2, u: 1, i: 4}. 4/45 Three letters picked without replacement from qqqggbqqqgggq. Give prob of picking 1 q and 2 g. 35/143 Three letters picked without replacement from oogooogggoogoooooo. Give prob of picking 3 o. 143/408 Calculate prob of picking 2 i and 1 c when three letters picked without replacement from {c: 3, i: 7}. 21/40 Calculate prob of picking 2 a and 1 v when three letters picked without replacement from {m: 1, s: 4, t: 1, v: 1, a: 2, g: 3}. 1/220 What is prob of picking 1 q and 1 h when two letters picked without replacement from qyygcqqqyhy? 4/55 Calculate prob of picking 1 d and 1 u when two letters picked without replacement from fduffddudfffuufdfdf. 8/57 Calculate prob of picking 1 v and 1 a when two letters picked without replacement from janlnav. 2/21 Three letters picked without replacement from wwjqqmmjwmmggmg. Give prob of picking 1 g, 1 w, and 1 q. 18/455 What is prob of picking 2 g and 1 p when three letters picked without replacement from pggpg? 3/5 Calculate prob of picking 1 t and 1 c when two letters picked without replacement from fcvvfkcckkktck. 4/91 Three letters picked without replacement from {c: 1, h: 2, m: 1, q: 5, k: 1}. Give prob of picking 1 c and 2 h. 1/120 Calculate prob of picking 1 m, 1 i, and 2 r when four letters picked without replacement from iidrormimi. 4/105 Calculate prob of picking 2 m when two letters picked without replacement from {l: 2, m: 4}. 2/5 Calculate prob of picking 2 a when two letters picked without replacement from {a: 2, e: 4, h: 2}. 1/28 Four letters picked without replacement from zrkjttkjijrtikttijt. Give prob of picking 1 z, 1 r, 1 k, and 1 j. 2/323 Calculate prob of picking 1 i, 2 c, and 1 v when four letters picked without replacement from {p: 5, v: 3, i: 1, c: 3}. 1/55 F	{ "pile_set_name": "DM Mathematics" }
68 + v. Let i = 4.05 + -0.05. Which is the second smallest value? (a) i (b) 5 (c) o a Let x(v) = -367v3 - v2 + 4v - 4. Let t be x(1). Let p be ((-42)/t)/(45/100). Let s = p + -2/23. What is the third smallest value in 6, -1/5, s, 0.5? 0.5 Let y be -2(-1)/2 + -5. Let q = -7 + 5. Let t = -0.8929 - -0.5929. Which is the third biggest value? (a) t (b) y (c) q b Let u be -1 + 8 + (-3321)/486. Let g = 27/4 - 263/36. Which is the second smallest value? (a) g (b) u (c) -8 a Let m = -388 + 388.018. Let q = -0.038 + m. Let l be 2/(-8) + (-42)/(-40). Which is the third smallest value? (a) 3 (b) l (c) q a Suppose -122 = -60y - 122. Suppose 0 = 5g, -2h + 2 = 4g - 2. Which is the third smallest value? (a) h (b) -2/57 (c) 0.2 (d) y c Let z(d) = 4d - 30. Let y be z(8). Let m be (6/18)/(y + -1). Let x = 0.1 + 0. Which is the second smallest value? (a) m (b) x (c) -10 b Let s = 267 - 265. Suppose 45 = 3j - 3v, 66j + sv = 63j + 25. Let p be (9/4)/3-2. Which is the second biggest value? (a) 0.2 (b) j (c) p a Let q = -7 - -7.1. Let x = q - -0.2. Let n be (-3 + 14/8)/(-1 + -4). Which is the smallest value? (a) -2 (b) n (c) x a Let i be 21/(-9)1212/7070. Let q = -4509885/664 + 6792. Let p = q + 1205/27224. What is the smallest value in p, i, -2? -2 Let x be -4(-18)/(-8) + 8801/975. Which is the third smallest value? (a) -53 (b) x (c) -4/5 b Let w = 4228 - 4227.8. Let t = 0.27 - 0.13. Let u = 0.54 - t. Which is the third smallest value? (a) u (b) 1/2 (c) 6/7 (d) w b Let l be -3 - (3/(-9))/(1/(-21)-7). Suppose -14 = 5f + 6. Let i = -86 - -432/5. What is the fourth biggest value in -0.4, l, f, i? f Let o = -20/201 - 69305/402. Let y = o - -173. Let j = 5 + 0. What is the third smallest value in j, y, -3, -0.3? y Let h = -1057 + 763. What is the third smallest value in -6/11, h, -1? -6/11 Let w = -1293 - -1297. Which is the smallest value? (a) 5 (b) w (c) -10/13 c Let s = 2.3442 - 2.2442. Which is the third smallest value? (a) 1.7 (b) s (c) -24 a Let h = 21.6 - 24.704. Let m = h + 0.104. Which is the second biggest value? (a) m (b) -1 (c) -5 (d) -1/9 b Let z = 14399 - 158390/11. What is the smallest value in z, 2, 65/31? z Let d = -3326/63 - -963/7. Let v = d + -85. What is the fourth biggest value in v, 95, 1/2, -0.5? -0.5 Let k = -131/30 - -25/6. Let z = -1.01 - -1.42. Let n = -0.01 + z. Which is the third biggest value? (a) n (b) 0.3 (c) -2/13 (d) k c Let z be 4/(-2) - 28/(-13). Let y = 30 + -34. Let s = 173/4 - 43. Which is the third biggest value? (a) z (b) 2/3 (c) y (d) s a Let h = -623 - -315. Let z = h - -310. Let q = 0.09 - 0.04. Which is the third biggest value? (a) q (b) z (c) -1/3 c Let h = -74065.4 - -74065. Let l = -0.31 - -0.3. Which is the second smallest value? (a) h (b) 2/7 (c) l (d) 0.12 c Let c = 642 + -420. Let w = -4216/19 + c. Suppose 5a + 5o - 55 = 0, -31 = -a + 33o - 38o. What is the fourth smallest value in w, -4, -0.3, a? a Let y = 10.2 - 10. Suppose 1 = 3z + 2b, -5z - 266b + 6 = -267b. What is the biggest value in z, -3/11, y, 0.1? z Let f = 6991 - 48942/7. Which is the second biggest value? (a) -4 (b) f (c) -1/6 (d) 0.5 c Let k(v) = 3v*2 - 213v + 141. Let l be k(70). Which is the smallest value? (a) 0.3 (b) l (c) -0.2 b Let x = -2.91 - -3. Let r = x - -2.91. Let b = 0.053 + -4.053. What is the fourth biggest value in b, -2, 4, r? b Let k = -22.6 - -30. Let f = k - 7.7. Let a = -0.55 + 0.65. What is the third smallest value in f, 6, a? 6 Let z = 3848 - 19317/5. Let t = -16 - z. What is the third smallest value in -3, t, -0.07? -0.07 Let v = 162 + 391. Let j = v - 553.1. What is the second smallest value in -2, -0.26, 0.5, j? -0.26 Let m = -129 - -71. Let q = m + 53.2. Let u = q - -1.8. What is the second biggest value in 0, u, -1, -5? -1 Let m = 10 + -10.5. Let g = 41 - 25. Let n = g + -16.07. What is the biggest value in 1/3, m, n? 1/3 Let s = -10.799 + 10.899. Let q be (-2 + (-21)/(-12))6. Let f = 3 - 15/4. Which is the third biggest value? (a) -1 (b) f (c) q (d) s a Let a = -26102 + 17098. Let m = a + 62777/7. Let b = m + 36. What is the biggest value in -0.8, b, -2? b Let s = 3136 + -3135. Which is the second biggest value? (a) s (b) -5/16 (c) 2/3 (d) 4 a Let c = -7.703 - -9.703. Let f = 45.94 + -40. Let x = -0.06 - f. What is the second biggest value in c, 0.5, -1/3, x? 0.5 Let i = -42.15 + 41.65. What is the third smallest value in 2, i, 38.29? 38.29 Let b = 742 + -299. Let w = -443.5 + b. What is the third smallest value in w, 0, 0.09, -5? 0 Let k = 1065.298 - 1063.298. Let a = -1 - -0.9. What is the third biggest value in k, -1, a, 5? a Let h = -2566 + 5141/2. What is the biggest value in h, -2, -5? h Let y = -316/1881 + -34/627. Which is the second biggest value? (a) 1.038 (b) -0.4 (c) y c Let p = 18851/2 + -9424. What is the fifth biggest value in 31, p, -5, 0.2, -4? -5 Suppose -32y + 25y = 63. Let v be -4 + (36/y - -13). What is the second smallest value in v, -4, 3, -0.3? -0.3 Suppose -5s = -5i - 60, 0 = -s + 4s - i - 30. Let j = -821 - -828. Which is the second smallest value? (a) 2 (b) s (c) j c Let s = -4372.96 - -4373. Which is the biggest value? (a) -1/3 (b) 50 (c) s b Let w = 59/3 - 18. Suppose -2 = 480p - 478p. Let z = -4 + 11. Which is the third biggest value? (a) w (b) p (c) z (d) 0.5 d Let u be (-15)/(-13) - (-10 - -11). Let m = -10.366 - -0.366. Which is the third smallest value? (a) -5 (b) 1/2 (c) u (d) m c Let g = -14.235 - -3.235. Which is the third smallest value? (a) -2/7 (b) g (c) 5 c Let m = 5263 - 5262.8. What is the third smallest value in m, -957, -3? m Suppose 9d + 3x + 99 = 0, -5d - 284x + 287x - 13 = 0. What is the biggest value in 1/61, 4/5, d? 4/5 Let v = -0.512 - -259.012. Let m = v - 258. Which is the third smallest value? (a) -2 (b) -4 (c) 5 (d) m d Let j = -3048 + 3049. Which is the fifth biggest value? (a) j (b) 2/7 (c) -0.14 (d) 1/8 (e) 0.7 c Let w(l) = -l3 + 29l*2 - 77l - 14. Let q be w(26). Suppose q - 8 = -4s. Let g = -0.1 + 0.1. Which is the biggest value? (a) s (b) -2 (c) 1 (d) g c Let m = 3.3098 - 0.3098. What is the biggest value in 0, m, -131? m Let n = -4364 - -4364.3. What is the third biggest value in -0.057, -1, n, -0.3? -0.3 Let g = -2013769/115 - -17511. What is the biggest value in 6, 0.2, g? 6 Let h(r) = 6r*2 - 12r - 17. Let w be h(-2). Let d be (-54)/(-2) + 0/(-1). Let y = w - d. Which is the smallest value? (a) -4 (b) 5 (c) y a Let m = -703.45062 - -0.05062. Let i = 703 + m. Which is the second biggest value? (a) i (b) -1 (c) -0.28 (d) 1/2 c Let v = 890 - 615. Let n = v - 275.06. What is the second biggest value in 0, n, -0.2? n Suppose -d + 15 = 3z - 4d, -z = d + 5. Suppose 5n - 7 - 8 = z. Let q be 2/(-12) + 1 + n/(-9). Which is the second biggest value? (a) -5 (b) 2 (c) q c Let f = 1/20 - -1/12. Let q = -25751 + 25743. Which is the third biggest value? (a) -4 (b) q (c) f b Let p = 13.01 + -7.5. Let g = p + -5.91. Which is the third biggest value? (a) 3/8 (b) 3 (c) -4/7 (d) g d Suppose 3g + 15 = 170x - 173x, -37 = 5g + 3x. Which is the third smallest value? (a) -5 (b) g (c) 0.09 (d) -4 d Let m = 0.75048 - 0.28048. What is the second smallest value in 0.03, m, 2, -4/7, -0.2? -0.2 Suppose -756w = -738w. Which is the third biggest value? (a) w (b) -5 (c) 363 b Let f = 0.3 - -1.7. Let w(h) = 77h - 6929. Let y be w(90). Which is the third biggest value? (a) 0.11 (b) f (c) y a Let i = -24.23 - -0.23. Let h = -0.4468 + -0.0532. What is the second biggest value in h, -1, i? -1 Let x = -117163 + 117161. Let p = -0.6 - -5.6. Which is the biggest value? (a) x (b) p (c) 1/8 (d) 2.3 b Let j be (-36)/204(1 - (-31)/(-39)). Let q = j - 2/17. Let k = -7.1 - -7. Which is the biggest value? (a) q (b) 0 (c) 4/5 (d) k c Let r = -13510 - -13502. Which is the smallest value? (a) r (b) 0.3 (c) 27 (d) 0.2 a Let v = 2/373 + 365/1492. Let i = 1.12 - 9.12. Which is the third smallest value? (a) i (b) -5 (c) v c Let i be ((-28)/10 - -3) + 77/(-110). Let k = 0.916 + -17.956. Let d = k - -0.04. What is the biggest value in 5, i, -2, d? 5 Suppose -l - t - 148 = -4l, -3l - 5*t = -124. Let k = -1	{ "pile_set_name": "DM Mathematics" }
)/(y - (-2)/(-3)). Sort 0, j, -3 in descending order. 0, -3, j Let a = -4.9038 + -0.0962. Let s = 96487/9 - 10768. Let j = s + 47. Sort -1, a, j in decreasing order. j, -1, a Suppose 6o = 4g + 103 + 71, -2o = 2g - 38. Put o, -6, -5, 2 in descending order. o, 2, -5, -6 Let o = -363 + 501. Let q be 3/(-2) + (1023/o - 6). Sort -0.12, q, -0.4. -0.4, -0.12, q Let v = 12 + -15. Suppose 5t + 608 - 643 = 0. Sort 1, v, -5, t in descending order. t, 1, v, -5 Let c = 16953 + -16954. Let g be 22/(-8) - (1 - 3). Sort c, -1/9, -2/11, g in descending order. -1/9, -2/11, g, c Let w = 24265.4592 + -24266. Put 3/4, 0.4, 0, w in decreasing order. 3/4, 0.4, 0, w Suppose 5p = h + 20, -5p = 4h + 10 + 20. Sort 2/13, h, -5, 5, 2 in increasing order. h, -5, 2/13, 2, 5 Suppose -692b + 798b = 2968. Put 3, 13, 1, b, 0 in increasing order. 0, 1, 3, 13, b Suppose 30 = 4j - 2s, 4s - 3s = 5j - 30. Sort 0, -12, 1, j in increasing order. -12, 0, 1, j Let u = -22.911 - -16.911. Sort 6/11, -1, 0.5, u, 3/7. u, -1, 3/7, 0.5, 6/11 Suppose 4h - 5 = 15. Let z(u) = u. Let f be z(h). Let t be (-1)/(-2)(0 - 2). Put f, t, 4 in decreasing order. f, 4, t Let t(r) = -16r - 1. Let l be t(-3). Suppose 0 = 428m - 398m + 120. Put 5, 1, l, m in descending order. l, 5, 1, m Let o be -4 + (2 - (-2 + -2)). Suppose 68 = 42h - 58. Put -3, o, h, 6 in increasing order. -3, o, h, 6 Let s be 33/39 - (-4)/26. Let b be ((-36)/24)/(-5 - (-43)/8). Sort s, 2, b, -5. -5, b, s, 2 Suppose -644 + 1582 = -134d. Put -2, d, 159, 2 in descending order. 159, 2, -2, d Let n be (28/105)/((-150)/375). Sort n, 3, -1982. -1982, n, 3 Let z be (-3 - -12)(-3 + (-35)/(-15)). Let j be z/9(-39)/52. Put -1/3, j, 6 in descending order. 6, j, -1/3 Let k = -4.274 + 3.774. Suppose 4 + 2 = -c. Let n = -5 - c. Put 0, -0.1, n, k in decreasing order. n, 0, -0.1, k Let b = -3983 + 3980. Sort -5, 1/4, 2, b, -2 in ascending order. -5, b, -2, 1/4, 2 Let a = -1.6 + 2. Let p = -10 - -10.8. Let q = -38/119 + 104/1071. Sort q, a, -0.5, p. -0.5, q, a, p Suppose 20 = 70d - 26d + 152. Sort 2, 4, -4, d, 3. -4, d, 2, 3, 4 Suppose -23j + 4 = -25j + 5n, 3 = -j + 3n. Let y be 32/(-24)j/(-4). Let h(t) = 4t + 1. Let v be h(-1). Sort y, 3, v in descending order. 3, y, v Let x = -14003 + 14006. Sort x, -12, -1/4 in ascending order. -12, -1/4, x Let l = 2 - 1.97. Let d = l - 0.31. Let h = 0.18 + d. Put -0.5, h, 0 in ascending order. -0.5, h, 0 Let w = -419 + 467. Let j = w + -48. Put j, 4, 0.2 in increasing order. j, 0.2, 4 Let a = 6029 + -6016. Sort 4/9, -4/3, a in increasing order. -4/3, 4/9, a Suppose -336 = -73g + 94g. Sort 1, 10, g. g, 1, 10 Let u = 0 - -1. Let n be (u/(-1))/(1 + (-10)/15). Let d(r) = -r*3 - 9r*2 + 10r - 4. Let y be d(-10). Put n, y, -42 in increasing order. -42, y, n Let c = 7789.01 - 7867. Let q = 78 + c. Sort -3, 0, 5, q. -3, 0, q, 5 Let i = 3.057 - 0.057. Suppose 340 = 9k - 4k. Let b = -77 + k. Put 0.5, i, b in decreasing order. i, 0.5, b Let z be (-296)/(-42)(-60)/136 + -5. Let x = -116/17 - z. Sort 1, -1, x, 0.4. -1, 0.4, 1, x Let a be (-1)/(-4) + 114/24. Suppose 0 = 2y - an - 7 + 30, n = 3. Let q be (1/2)/((-20)/(-120)). Sort q, y, 1. y, 1, q Let q be (12/(-36))/(-3 + 2)-21. Suppose 0w + 2w + 2 = 0. Let r be (-89)/12 - q - w/(-4). Put -0.4, 4/5, r, 2/13 in descending order. 4/5, 2/13, -0.4, r Let u = 13.3 + -13. Let c = -1.1 + 85.1. Let b = c - 83.9. Sort b, -1/4, u, 0.2 in decreasing order. u, 0.2, b, -1/4 Let j = 11.8 + 2.3. Let b = 1.1 - j. Sort -2/3, 5, -1/11, b in increasing order. b, -2/3, -1/11, 5 Let c = -271.4 - -208. Let n = -63.3 - c. Sort n, 2/11, 1, -13 in decreasing order. 1, 2/11, n, -13 Let j be (-60)/(84/(-7)) + 139. Put -4, j, 4 in decreasing order. j, 4, -4 Suppose -1578m = -1575m + 3, -2c = -3m - 69. Sort -4, 4, 0.3, c in increasing order. -4, 0.3, 4, c Let m(t) = -t3 - t2. Let r be m(-1). Let s(y) = 5y2 + 465y + 1794. Let x be s(-89). Put r, x, -1 in decreasing order. x, r, -1 Let v = 4.0963 + -4.3963. Let m = 0.35 - -0.05. Sort v, m, -1, 8 in descending order. 8, m, v, -1 Suppose 4v - 148 + 142 = 5b, 3v + 3 = 0. Suppose 2l + 4l + 6 = 0. Put 0, b, l, 4 in decreasing order. 4, 0, l, b Suppose 2a = x - 5 - 2, 5a = x - 22. Put -462, -1, a in descending order. -1, a, -462 Let u be ((-28)/(-21))/((-72)/1026). Suppose -2j + 3j = -2. Sort -3, u, j in ascending order. u, -3, j Let m(u) = -u - 8. Let n be m(-6). Let v = -9709 + 9706. Sort v, n, 0.1, 1. v, n, 0.1, 1 Let h be ((-6)/(42/35))/(1 - 2). Let s be ((-8)/h)/((0 - -4)/20). Suppose 5j + 9 + 1 = 0. Put s, 0, j in decreasing order. 0, j, s Let o = -0.0348 - 338.9652. Let b = -334 - o. Let w = 0.09 + -4.09. Sort 1, b, -0.2, w. w, -0.2, 1, b Let q be 42/12 - ((-5)/4 + 6/(-24)). Put 6, -2, 3, q, -5 in descending order. 6, q, 3, -2, -5 Let q be -785((-72)/(-4680))/(1-1) - 12. Let k = 0.1 + 0.1. Put -0.1, k, q, 1/3 in descending order. 1/3, k, q, -0.1 Let w = -0.03 + -0.47. Let q = -236 - -236. Put q, w, 24 in decreasing order. 24, q, w Suppose -s = 2u + 13, -4u + 3u - 11 = 2s. Suppose -7o + 4 = 4z - 6o, 4z - 24 = 4o. Suppose 67k - 65k = z. Put 2, 4, s, k in descending order. 4, 2, k, s Let x = -21.64 + 22. Let v = x + 0.04. Let a be (-255)/30 + 5/2 + 4 + 4. Put -0.1, -4, a, v in decreasing order. a, v, -0.1, -4 Let d = -405.5 + 402.5. Sort 14, d, -5, -1/3, -0.4. -5, d, -0.4, -1/3, 14 Suppose 5h = n - 13, 4h + 49n + 20 = 53n. Sort -10, 0, 1, h, 5 in decreasing order. 5, 1, 0, h, -10 Let h = 3 - -2. Suppose -hn = -23n + 36. Put 5, n, -25 in decreasing order. 5, n, -25 Let z = 14749 + -14751. Sort z, 5, -7, 54, -5. -7, -5, z, 5, 54 Suppose 0 = -12y - 111479 + 111443. Let i = 5 - 0. Put i, y, 11, 4 in increasing order. y, 4, i, 11 Suppose 2l = 9 - 3, -3j + 30 = -2l. Sort 3, j, -3, 2, -13 in decreasing order. j, 3, 2, -3, -13 Let v be (3/(-5))/((-522)/(-16530)). Sort v, 28, 4. v, 4, 28 Let a = -56 - -281/5. Suppose j - 31 = -5i - 20, 0 = 2j - i + 11. Sort a, -1/2, 0.5, j in descending order. 0.5, a, -1/2, j Let y = -10 + -7. Let v = -6244 - -6243. Put v, y, 4 in ascending order. y, v, 4 Let g = 6855.1 - 6855. Sort g, -1, -5, 13/5. -5, -1, g, 13/5 Suppose 3o + 50 = 5h - 9h, -2o - 37 = -h. Let v be (-6 - 0)(-2)/(-14 - o). Let w(z) = -11z + 1. Let l be w(1). Sort v, 4, 0, l in increasing order. l, 0, v, 4 Let z = -249 + 781. Let u = -534 + z. Let j be 2/7 - (-16)/(-154). Sort j, 14, u in ascending order. u, j, 14 Let y = -7613.1 - -8016. Let h = y - 403. Sort 3, h, -1. -1, h, 3 Let w = 3.342 - 2.942. Sort 2/9, -0.2, -3, 0.08, w. -3, -0.2, 0.08, 2/9, w Let i = -3682 - -3676. Sort 1/5, -4, 0.8, i in decreasing order. 0.8, 1/5, -4, i Let c = -207.4 - -31.4. Let k = c - -175.8. Sort 0.012, k, -0.1. k, -0.1, 0.012 Let x = -0.16129 - -0.11129. Sort -2, 0.18, x in increasing order. -2, x, 0.18 Suppose -7m - 25 = -2m + 5b, 0 = 4m - 5b - 34. Let s be (14/(-10) - 0) + 2. Sort -4, m, s, -2/11 in decreasing order. m, s, -2/11, -4 Let w = -225.94 + 226. Let c = 7.8 + -7.83. Put -3, c, 1/7, w in decreasing order. 1/7, w, c, -3 Suppose -2j - k + 1 = -3, 0 = k. Let o be 0((-1232)/(-770) - (-6)/(-10)). Sort j, o, -157, 3 in decreasing order. 3, j, o, -157 Suppose 2i - 3b + 26 = 2b, -4b + 10 = 2i. Suppose -22 = w - 10t + 3t, 390 = -5w - 5t. Sort 3, w, -5, i. w, -5, i, 3 Let h = 20452/21 - 974. Let g = -25/44 - 2/11. Sort -1, g, h. -1, g, h Let t(i) = -11i + 161. Let d be t(15). Sort d, 27, 5 in decreasing order. 27, 5, d Suppose -3a - 5y = 628, -5a = 3y - 8y + 1100. Let u = a + 216. Put u, 1, -0.4, 0.12 in decreasing order. 1, 0.12, u, -0.4 Let w(u) = 7u*2 + 2u. Let f be w(-1). Suppose z = m + 6z - 32, -fz - 94 = -2m. Let i = m + -39. Sort -5, 1, -2, i in descending order. i, 1, -2, -5 Let v(y) = 139y - 839. Let c be v(6). Sort -4, c, -14, 4, -2 in decreasing order. 4, -2, -4, c, -14 Let w be 0/((-42)/(-6)) - ((-298)/(-148) - 2). Sort -2/11, w, -0.5, -14 in descending order. w, -2/11, -0.5, -14 Let a be 36/(-63) - 143/(-91). Sort a, -1/8, 0.127 in decreasing order. a, 0.127, -1/8 Suppose 221*d + 359 + 746 = 0. Put 2450, -2, d in descending order. 2450, -2, d Let j = -1366 - -1364.9. Let r = -41/28 - 1/28. Put r, j, -4/5 in increasing order. r, j, -4/5 Let t(s) =	{ "pile_set_name": "DM Mathematics" }
t is the next term in -25, -37, -51, -67? -85 What is the next term in -194, -386, -576, -764, -950, -1134? -1316 What comes next: 518, 1041, 1564? 2087 What is the next term in -9, -30, -63, -108, -165? -234 What is the next term in 73, 129, 171, 193, 189, 153, 79, -39? -207 What is the next term in 2533, 2541, 2563, 2605, 2673? 2773 What is next in -66, -246, -550, -978, -1530, -2206? -3006 What is the next term in -30, -29, 6, 93, 250, 495, 846? 1321 What comes next: 210, 441, 672, 903, 1134, 1365? 1596 What is the next term in -438, -878, -1318, -1758? -2198 What comes next: -1009, -2014, -3007, -3982, -4933, -5854? -6739 What is next in 137, 284, 433, 584, 737? 892 What is next in 9, 46, 107, 192, 301, 434, 591? 772 What comes next: -51, -39, -15, 27, 93, 189? 321 What comes next: -396, -444, -490, -534, -576? -616 What is the next term in 142, 591, 1348, 2413? 3786 What is the next term in -510, -517, -536, -573, -634? -725 What comes next: 16, 2, -12? -26 What is the next term in 14, 22, 30? 38 What comes next: 81, 86, 93, 102? 113 What comes next: 31, 48, 65, 82, 99? 116 What comes next: 173, 175, 177, 179? 181 What is next in 36, 131, 288, 507, 788? 1131 What comes next: -78, -156, -236, -318, -402? -488 What is next in -26, -9, 84, 289, 642, 1179? 1936 What comes next: -43, -168, -377, -670, -1047? -1508 What comes next: 694, 685, 676, 667? 658 What comes next: -1470, -2957, -4432, -5889, -7322, -8725, -10092? -11417 What comes next: -50, -114, -176, -236? -294 What is next in -91, -110, -155, -238, -371, -566, -835, -1190? -1643 What is next in -4, -31, -70, -115, -160, -199, -226, -235? -220 What is next in 12, 15, 26, 51, 96, 167, 270? 411 What is next in -555, -546, -523, -480, -411? -310 What comes next: -289, -300, -299, -280, -237, -164? -55 What is next in 134, 140, 160, 200, 266, 364, 500? 680 What comes next: 1975, 1967, 1945, 1903, 1835, 1735? 1597 What is the next term in 80, 79, 78, 77? 76 What is next in -5, -37, -115, -263, -505? -865 What is the next term in -29, -96, -205, -356, -549? -784 What is next in 382, 1474, 3294, 5842, 9118? 13122 What comes next: -8, -59, -194, -455, -884, -1523, -2414, -3599? -5120 What is the next term in 3, 14, 29, 48, 71? 98 What is the next term in -45, -73, -69, -21, 83, 255? 507 What is the next term in -22, -14, -6, 2? 10 What is the next term in -56, 12, 126, 286, 492, 744, 1042? 1386 What comes next: 8, 17, 52, 125, 248? 433 What is the next term in 915, 1822, 2717, 3594, 4447, 5270, 6057? 6802 What is next in -22, -28, -22, 2, 50? 128 What comes next: -15, 2, 31, 78, 149? 250 What is next in -1, 23, 63, 119, 191, 279, 383? 503 What is the next term in -2104, -4204, -6304? -8404 What comes next: 1096, 2190, 3284? 4378 What is the next term in -35, -74, -125, -188, -263? -350 What comes next: 207, 213, 209, 189, 147, 77, -27? -171 What comes next: -235, -483, -735, -991? -1251 What comes next: -14, -16, -14, -8, 2, 16? 34 What is the next term in -1260, -1260, -1268, -1290, -1332, -1400? -1500 What is the next term in -3, -26, -65, -126, -215, -338, -501, -710? -971 What is the next term in -76, -151, -228, -307, -388, -471, -556? -643 What comes next: -1, -14, -35, -64, -101, -146? -199 What is the next term in -9, -30, -67, -132, -237, -394, -615, -912? -1297 What comes next: 197, 198, 199, 200? 201 What is the next term in 13, 24, 35, 46, 57? 68 What comes next: -2, -4, -10, -20, -34? -52 What comes next: 735, 1469, 2203, 2937? 3671 What is next in -47, -32, -7, 34, 97? 188 What is the next term in -26, -51, -78, -107, -138, -171? -206 What is next in 262, 275, 294, 319, 350, 387, 430? 479 What is next in -248, -253, -258, -263, -268? -273 What is the next term in -75439, -75440, -75441? -75442 What is the next term in -138, -294, -462, -648, -858, -1098, -1374? -1692 What comes next: 14, -4, -48, -130, -262, -456, -724, -1078? -1530 What comes next: -91, -92, -95, -100, -107? -116 What comes next: -4, 33, 84, 155, 252, 381, 548? 759 What comes next: -66, -142, -220, -300, -382? -466 What is next in 21, 29, 41, 57, 77, 101, 129? 161 What comes next: 63, 251, 561, 993, 1547, 2223, 3021? 3941 What is the next term in -11, -17, -13, 7, 49, 119, 223? 367 What is next in 315, 329, 343, 357, 371, 385? 399 What is next in 9, 132, 335, 618, 981, 1424? 1947 What comes next: 262, 517, 762, 991, 1198, 1377, 1522? 1627 What comes next: 18, 22, 26, 30, 34, 38? 42 What is next in -57, -229, -521, -939, -1489, -2177, -3009, -3991? -5129 What comes next: -278, -341, -454, -623, -854, -1153, -1526, -1979? -2518 What is the next term in -14, -48, -132, -290, -546, -924? -1448 What is the next term in -210, -203, -196, -189, -182, -175? -168 What is next in 289, 325, 397, 523, 721, 1009, 1405, 1927? 2593 What comes next: -410, -799, -1166, -1499, -1786, -2015? -2174 What is the next term in 937, 1884, 2833, 3784, 4737, 5692, 6649? 7608 What comes next: -3753, -7502, -11241, -14964, -18665, -22338? -25977 What is the next term in -16273, -16275, -16279, -16285, -16293, -16303, -16315? -16329 What is the next term in -864, -1730, -2596, -3462, -4328? -5194 What is the next term in 10, 12, 10, 4, -6, -20, -38? -60 What is next in -1694, -3388, -5082, -6776, -8470? -10164 What is next in 143, 142, 141, 140, 139, 138? 137 What is next in 46, 167, 368, 649? 1010 What is next in 42, 47, 64, 99, 158, 247, 372, 539? 754 What is next in 8, -8, -44, -106, -200? -332 What comes next: 187, 373, 563, 757, 955, 1157? 1363 What is the next term in 443, 498, 553? 608 What comes next: -2096, -2095, -2094, -2093, -2092, -2091? -2090 What comes next: 326, 328, 330? 332 What is next in 147, 271, 397, 525, 655? 787 What is next in 20, 86, 260, 596, 1148, 1970, 3116? 4640 What comes next: -1706, -1698, -1684, -1664? -1638 What is the next term in -34, -40, -58, -94, -154? -244 What is next in -716, -1435, -2156, -2879, -3604, -4331, -5060? -5791 What comes next: -7, 48, 199, 494, 981, 1708? 2723 What is the next term in 27, 31, 31, 27, 19, 7? -9 What comes next: 9681, 9681, 9669, 9639, 9585? 9501 What comes next: 1884, 3763, 5640, 7515, 9388? 11259 What is the next term in -135, -134, -131, -126, -119, -110, -99? -86 What is the next term in 2, 27, 88, 203, 390, 667, 1052, 1563? 2218 What is next in -118, -117, -116, -115, -114? -113 What comes next: 11, 28, 63, 116, 187? 276 What comes next: -1722, -6895, -15516, -27585, -43102, -62067, -84480? -110341 What is next in -2864, -5736, -8610, -11486, -14364, -17244, -20126? -23010 What is next in 1196, 1203, 1206, 1199, 1176, 1131, 1058? 951 What comes next: -14, -32, -88, -200, -386, -664, -1052, -1568? -2230 What is next in -12, -5, -8, -27, -68, -137, -240, -383? -572 What is next in 3, 17, 37, 63, 95? 133 What is next in -515, -1042, -1567, -2090, -2611, -3130? -3647 What is the next term in 61, 109, 147, 169, 169? 141 What is the next term in 76, 75, 74? 73 What comes next: 77, 42, -5, -70, -159, -278? -433 What comes next: 120, 267, 414, 561? 708 What is the next term in -42, 31, 92, 135, 154? 143 What is next in -3, -15, -41, -87, -159? -263 What comes next: -80, -168, -258, -350? -444 What is next in 285, 288, 291, 294, 297, 300? 303 What is next in -712, -715, -720, -727, -736, -747, -760? -775 What is the next term in -729, -734, -743, -756, -773, -794, -819? -848 What is next in 38, 167, 386, 695, 1094, 1583, 2162? 2831 What is the next term in -80, -70, -54, -32? -4 What is the next term in 248, 507, 766? 1025 What comes next: 117, 97, 53, -27, -155, -343, -603? -947 What is next in 42, 63, 84, 105? 126 What is the next term in 827, 823, 817, 809, 799, 787? 773 What comes next: 42, 99, 168, 249, 342, 447, 564? 693 What is next in 21, 18, 15? 12 What comes next: 55, 63, 81, 115, 171, 255, 373, 531? 735 What is the next term in 8113, 16229, 24345? 32461 What is the next term in -105, -157, -145, -63, 95, 335, 663? 1085 What is next in 7, -20, -69, -152, -281, -468, -725? -1064 What is the next term in -391, -387, -383, -379, -375? -371 What comes next: 147, 287, 437, 603, 791? 1007 What is the next term in -34, -28, -20, -10? 2 What comes next: -67, 7, 137, 329, 589, 923? 1337 What is the next term in 924, 3692, 8314, 14796, 23144? 33364 What comes next: -92	{ "pile_set_name": "DM Mathematics" }
Round u to the nearest integer. -5 Let y be (8/12)/(1/342). Suppose b - y = -1458. What is b rounded to the nearest one hundred? -1200 Let a = 2.60998785 - 2.61. Round a to six dps. -0.000012 Let p = -36243 - -36250.00152. Let a = p + -7. What is a rounded to four dps? 0.0015 Suppose 2481 = 5a - 2a. Suppose -3j + 5911 = -a. Suppose -w - j = -5646. What is w rounded to the nearest 1000? 3000 Let d = -47374 - -71084. Round d to the nearest one thousand. 24000 Let w = 2652.999992428 + -2653. Round w to 6 decimal places. -0.000008 Let l = 5.94 - 6. Let j = l - -0.44. What is j rounded to 1 decimal place? 0.4 Suppose 3x + 263356 = 47056. What is x rounded to the nearest 10000? -70000 Let o be -1 + (3 - (1 - 4)). Let g be 64/o + 1/5. Suppose 17i - gi = -15200000. What is i rounded to the nearest one million? -4000000 Let s = 5593543.73289 + -5593571. Let i = -25.967107 - s. Let l = 1.3 - i. What is l rounded to 5 dps? 0 Let w = 159.5828 + 0.0172. Let b = w + -149.285. Let h = -0.015 + b. Round h to the nearest integer. 10 Let t = 7970884.999982 + -7970893. Let o = t + 8. What is o rounded to five decimal places? -0.00002 Suppose -7 = -f + 4x, -5f - 3x + 10 = 2x. Let a be -3803773(-3 + f + 1). Let h = a + 6503773. What is h rounded to the nearest one million? 3000000 Let k = -128 - -127.942. Let f = k - -0.05800025. What is f rounded to seven dps? 0.0000003 Let v be -1 + 120 + (-1 - -2). Suppose 0z = 3z - v. Let d be (z/(-3))/(2/600). Round d to the nearest ten thousand. 0 Let g = -7.05 - -7.049999125. Round g to 7 decimal places. -0.0000009 Let b = -3083638163491.6000003 - -3083637591507. Let z = -571987.6 - b. Let d = z + 3. Round d to 6 dps. 0 Suppose 4b - 5v = 570 + 4453, -4v - 5024 = -4b. What is b rounded to the nearest one hundred? 1300 Let h = -9.315 - -9.1. Let o = 0.149 - h. Round o to one decimal place. 0.4 Let q = -8999.97 + 9222.9192. Let h = q + -223. What is h rounded to two dps? -0.05 Let s(l) = 6184l*3 - l - 214l*3 + 54l*2 - 44l*2 + 1911l3 - 10. Let z be s(-10). Round z to the nearest one hundred thousand. -7900000 Let x = -619 - -618.6675. Round x to 1 dp. -0.3 Let n(r) = r3 + r*2 + r + 300000. Let s be n(0). What is s rounded to the nearest 1000000? 0 Suppose -2 = -3o + 4. Let g = -143 - -407. Let b be -7 + 5 + g/o. What is b rounded to the nearest 100? 100 Let n(j) = -961j - 89 + 89. Let l be n(-9). Suppose p - 749 = -l. What is p rounded to the nearest 1000? -8000 Let b = -148 + 108. Let r = b + 40.00222. What is r rounded to three dps? 0.002 Let k = 82 + -78. Suppose 0 = r + kw + 18299980, 4r + 3w + 73199975 = -2w. Round r to the nearest 1000000. -18000000 Let n = 117 - 113. Suppose -4k - k + 180800025 = nj, -3j + 135599980 = -4k. What is j rounded to the nearest 1000000? 45000000 Let y = -1.224 + 1.23638. Round y to three decimal places. 0.012 Let q = 0.07177049 - 0.07173. Round q to six dps. 0.00004 Let w be ((-576765)/(-252))/(2/16). What is w rounded to the nearest 1000? 18000 Let f = -34.1 - -34.103592. What is f rounded to four dps? 0.0036 Let h = 7.9 - 12.6. Let j = 17.4 - 5. Let p = h + j. What is p rounded to the nearest integer? 8 Let v = 0.114899224 + -0.1149. Round v to seven decimal places. -0.0000008 Let m = -3756569 + 6285569. What is m rounded to the nearest 10000? 2530000 Let a = -1.7 + 0.7. Let v = -0.64 + a. What is v rounded to 1 dp? -1.6 Let s = -41 + 46. Suppose -5v = -5l + 106010, -35905 = sv + 3l + 70089. Round v to the nearest 1000. -21000 Let s = 3552.9992948 + -3553. What is s rounded to 4 decimal places? -0.0007 Let d = 1.02795 - 1.03. Round d to four decimal places. -0.0021 Let q(d) = 2944d - 2. Let p(x) be the first derivative of 5x2/2 - 4. Let t(h) = 30p(h) - 5q(h). Let g be t(-7). What is g rounded to the nearest 10000? 100000 Let c = -581 - -662.6. Let x = c - 81.57258. Let f = -0.027 + x. Round f to four dps. 0.0004 Let r = 2531 - 1473. Let s be 4/18 + 4/(-9)r. What is s rounded to the nearest 100? -500 Let z = 0.3898 - 36.0498. What is z rounded to the nearest ten? -40 Suppose 5r + 9 + 29 = -4i, 4i - 42 = 3r. Let z = -13 - r. Let t be 3 - 0/z - 1603. What is t rounded to the nearest one thousand? -2000 Suppose -19896 = 1319u - 1311u. What is u rounded to the nearest one hundred? -2500 Let z = 12595 + -8295. Let w be 0/((-3 + 2)/1). Suppose -h + 3h + z = w. What is h rounded to the nearest one hundred? -2200 Let s = 60056.884684 + -60057. Let u = -0.115 - s. What is u rounded to 5 dps? 0.00032 Let i = 7203.96167 + -7204. What is i rounded to three decimal places? -0.038 Let y = 33.1 + -33. Let w = -0.100054 + y. What is w rounded to 5 dps? -0.00005 Suppose d - 4 = -d. Suppose 0 = -di - 0i - 2f + 217894, -4f = 0. Let x = i - 3708947. Round x to the nearest 1000000. -4000000 Suppose 0 = 5c + 13 - 33. Let j(p) = 719p + 14. Let d be j(c). Round d to the nearest one hundred. 2900 Let i = 893.91 + -904.9098. Let l = 11.9 + -22.9. Let c = l - i. What is c rounded to four decimal places? -0.0002 Let q = 8.86 + -9. Let i = q - -0.13. Let n = -0.009994 - i. Round n to 6 decimal places. 0.000006 Let z = 4503 - 7603. Round z to the nearest ten thousand. 0 Let m = -53.6 + 54.08. Round m to one decimal place. 0.5 Suppose -4d = 3r - 308100004, 5r - 9d - 513499996 = -5d. Round r to the nearest one million. 103000000 Let m(z) = -z*3 - 19z*2 - 14z - 16. Let h = 19 - 27. Let j be m(h). Let x = j - -238. What is x rounded to the nearest 100? -400 Let u = 880.99954 - 881. Round u to four dps. -0.0005 Let c = -1612 + -1088. Round c to the nearest 100. -2700 Let c = -3.1059175 - -18.3059845. Let v = 140 - 155.2. Let z = c + v. What is z rounded to five decimal places? 0.00007 Let m = 27011.6338 + 5.3662. Let y = m + -27016.19965. Let t = y - 0.8. Round t to four decimal places. 0.0004 Let i = -51.7 - 19.9. Round i to the nearest 10. -70 Let v = 241 + -395. Let j = -164.1 - v. What is j rounded to the nearest integer? -10 Let o = 11.8632 - 11.93. What is o rounded to 2 decimal places? -0.07 Let d(c) = -29c + 15. Suppose 8 = 3y - 1, 3q + 39 = -y. Let t be d(q). What is t rounded to the nearest 10? 420 Let w = -5858 + 5858.06018. What is w rounded to 3 dps? 0.06 Suppose 0 = -6r + 8r - 28. Suppose -2v - 74 = -2f, 5f + 4v + 123 - 353 = 0. Let x be 3120002/(-6) + r/f. What is x rounded to the nearest 100000? -500000 Let o = 543.0000002815 + -543. What is o rounded to seven decimal places? 0.0000003 Let v = -179 + 108. Let z = v + 160. Let g = -88.9999907 + z. What is g rounded to six decimal places? 0.000009 Suppose 3k - 15 = -0k. Suppose -3z = -z + 3h - 754, 0 = 3z - kh - 1150. Round z to the nearest 100. 400 Let a = -0.869876 - -0.87. Round a to 5 decimal places. 0.00012 Suppose 3t - 6b - 15 = -3b, 3b = 5t - 25. Suppose 352 = tz + 5p - 3, 205 = 3z + 5p. What is z rounded to the nearest 10? 80 Let y = -14671.07691 + 14671. Let t = 70.83309 - y. Let z = t - 72. What is z rounded to one decimal place? -1.1 Let t = -0.29 - -20.29. Let b = -23.4 + t. Let s = 2 + b. What is s rounded to the nearest integer? -1 Let k = 128 + -55. Let d = 73.051 - k. What is d rounded to two decimal places? 0.05 Suppose -10 = -4g + 9g. Let n = 32 - g. What is n rounded to the nearest ten? 30 Let o = -175 + 182.7. Let c = 7.9 + 1.1. Let n = c - o. What is n rounded to one decimal place? 1.3 Let b be (((-5856)/(-20))/3)/(2/10). What is b rounded to the nearest 10? 490 Let h = -1.5 - -1.54. Let t = h + 0.1. Let w = 11.64 - t. What is w rounded to zero decimal places? 12 Let w = 0.048 - -24.952. Let x = w + -25.9. What is x rounded to the nearest integer? -1 Let u = 47.101497 + -48.0615. Let y = u - -0.96. What is y rounded to 6 dps? -0.000003 Let w be 6 + (-5 - (-3)/3). Suppose -3s = -a + s + 41, 0 = wa - 4*s - 66. Let v be (a/(-3))/(8/(-89280)). What is v rounded to the nearest 10000? 90000 Let o = 73 - 130. Let p = o + 34. Let g = p - -22.784. Round g to 2 decimal places. -0.22 Let f = 7.579 - 0.399. Let z = 7.17999703 - f. Round z to 6 dps. -0.000003 Let g = -31.0999742 + 31.1. What is g rounded to five dps? 0.00003 Let d = -4614181582 - -2307649559. Let a = -2306531989.00000079 - d. Let u = a - 34. What is u rounded to 7 decimal places? -0	{ "pile_set_name": "DM Mathematics" }
g z is positive. z(1947/8) Simplify (h0)*(8/11)((h/((hh/h(6/5)h)/hh))/h)/(h(-5/3)/hh) assuming h is positive. h(-2/15) Simplify r(-4)/r*(-3/8)(r(-4/5)/r)/(((r(-1/22)r)/r)/rr) assuming r is positive. r(-2367/440) Simplify (m(-3/10)/(m*(-2/9)m))/(m(m/(mm*(-10)mmm))/mm(1/8)/m) assuming m is positive. m(-2593/360) Simplify ((c/((c(-1/3)/c)/c))(1/66)/(c(-4/7)/c(5/6)))(-31) assuming c is positive. c(-62527/1386) Simplify (gg(g/(gg/(g/(g/(g*(-5)/gg)g))))/g)/g0g*(-14)g(1/11) assuming g is positive. g(-219/11) Simplify ((i*5/ii(-2/3))(-50))(-30) assuming i is positive. i5000 Simplify ((a*(-13)/aa)/a*(-3/7))/(aaa/a9a(-1)) assuming a is positive. a(-39/7) Simplify (j(-1/14))1j(-3/17)j(j/j(8/3))/j assuming j is positive. j(-1367/714) Simplify (j8/j)/jj*(-1/4)jjj/(j/(jj(jj/(j2j))/jjj)j)j*4jjj assuming j is positive. j*(63/4) Simplify (b/(bbb/b(-13)b))/((bb(1/20)b)/b)b(2/31)/((b/b13)/b) assuming b is positive. b(-2471/620) Simplify (((i/(i/i(2/15)))(5/13))7)43 assuming i is positive. i(602/39) Simplify ((zz/(z/((zz(-1/4))/z)))(3/8)z/(zz/(z(z/z*7)/z))z5)(-5/6) assuming z is positive. z(275/192) Simplify (u(2/23)/u)/u*(-1/4)(u/u*(8/5)u)(-15) assuming u is positive. u(-613/92) Simplify ((r(-1/4)/r)/r(1/6)r(-1/2)(r/r(-2))/r)50 assuming r is positive. r*(25/6) Simplify ((gg*7/gg/(g*(-5)g))30)39 assuming g is positive. g14040 Simplify ((((r(7/9)/r)/rr)/r)/r)(-22)rr(9/8)rrr(rrr/r(-2/29)rr)/r assuming r is positive. r(121277/2088) Simplify (l/l(-4))/(ll/(l*(-22)l)l)(lll/l*16)/(lll(1/13)l) assuming l is positive. l(-456/13) Simplify r/r(-2/39)rr*(-2/21)(r(11/2)/r)(1/65) assuming r is positive. r*(1843/910) Simplify (fff5ff/f25)19 assuming f is positive. f(-304) Simplify (((b/b0)/(b/b(2/3)))/(bb(1/4))(-37))(3/7) assuming b is positive. b(563/28) Simplify ((c(-7/2))3)(-31) assuming c is positive. c(651/2) Simplify r*6rrr/((r/(r*(1/7)/r))/r)(r*(2/17)r)/rr9 assuming r is positive. r(2054/119) Simplify (p(-4/9)/(((p/p(1/20))/p)/p))/((p/(p(-17)/p))/(p/p14p)) assuming p is positive. p*(-5471/180) Simplify (((w/((ww*(-3/23)w)/w))/ww)(-8/7))33 assuming w is positive. w(-792/161) Simplify (q(2/3)q)*(-42)q*(1/20)q5 assuming q is positive. q(-1299/20) Simplify (ll(-1/5))42/(l(-12)/l(-6/7)) assuming l is positive. l(1566/35) Simplify (ccc/((c(c(-1/24)/c)/c)/c))/((c/(c/((c/(c/(c/c(1/10)))c)/c)))/c)(c*(11/2)c)/c(-17) assuming c is positive. c(3437/120) Simplify ((o*4/oo*(-3)o)(-36))(-42) assuming o is positive. o1512 Simplify (z(-4/19)/z(-18/7))(2/5) assuming z is positive. z*(628/665) Simplify (dd*(-5/3)d*(-14)d)/(dd(-5))(5/13) assuming d is positive. d(-473/39) Simplify k(7/2)/(k(-2/19)kk)k/(kk(3/17))kk(-15) assuming k is positive. k(-8121/646) Simplify ((v(-2/127)vv)/(v(-16)v))(37/4) assuming v is positive. v(79809/508) Simplify (s/s*(-1/10)s)/s*(-2/65)s*(-25)ss/(s/(s/(s/((s/s13s)/s)))) assuming s is positive. s*(-4403/130) Simplify (a/(aa*(-2/5))aa13a)/(aaa*(2/9)aaaa(a/((aa(-2)a)/a))/a) assuming a is positive. a(368/45) Simplify ((c2)(-1/9)/(c(-1/9)cc(5/3)))(-1/40) assuming c is positive. c*(5/72) Simplify (tt(16/7))46/(t*(3/11)/(((t/((t/(tt*(-14)))/t))/tt)/t)) assuming t is positive. t(10616/77) Simplify u(3/5)/((uu(-6))/u)(u/(u*0uu)u)(9/10) assuming u is positive. u(33/5) Simplify ((zz(-4))/(zz*(-3/8))z*(3/2)zz(4/3))(-2/25) assuming z is positive. z(-1/60) Simplify ((mm8)/m12)/(m*(-2/3)mm(-5/6)) assuming m is positive. m(-5/2) Simplify ((f/(f/(ff*(10/11)f)))/fff)*(-3/43)/(ffff*6/ff(-6/5)) assuming f is positive. f(-389/55) Simplify ((oo1/o)/o(-1/3)(o/o*6)/oo(1/10))(2/9) assuming o is positive. o*(-137/135) Simplify (y/(yy*2y)y5)/((y/(y/(y0y)))/y(-1/4)) assuming y is positive. y(3/4) Simplify (r/r1)(-16/3)/(((r*(-8)/r)/rr)/((r/r4)/r)) assuming r is positive. r5 Simplify (i/i(6/13))/(i(-26)/i)i(-20/11)/(i30/i) assuming i is positive. i(-469/143) Simplify (g(-2/3)/gg/((gg(-5/7)g)/gg))/(ggg4ggg*11g) assuming g is positive. g(-461/21) Simplify b(-2/3)/b*(-18)(b(-4/9))(-4/15) assuming b is positive. b*(2356/135) Simplify (((aa/(aa(-2/7)))(1/38))(1/14))(-2/9) assuming a is positive. a(-1/1862) Simplify (j1/((j(7/2)j)/j))/(j(2/7)/j)27 assuming j is positive. j(235/14) Simplify (d(1/16)/(dd/((d(-3/23)/d)/ddd)d))(-10) assuming d is positive. d(5645/184) Simplify (gg/(g/(g(1/11)/g)))47/((g/g16)/g(3/2)) assuming g is positive. g(457/22) Simplify (t2/t)(-12)/(((tt/t*2t)/t)/(t*(-1/21)t)) assuming t is positive. t*(-232/21) Simplify rr*(-2)r(r/((r/(r/(rr*(3/4)r)r))/r))/r(rr6)21 assuming r is positive. r(585/4) Simplify (((x(-2))(-1))(9/2))(-29) assuming x is positive. x(-261) Simplify (aa/(a/(a17/a)))(-2/9)(a/a(3/14))/a(-2/53) assuming a is positive. a(-19729/6678) Simplify ((v(-13)/v)/(v6v))(2/79) assuming v is positive. v(-42/79) Simplify (cc(-1/4)c*(-11/3))/(ccc13)11 assuming c is positive. c(-2015/12) Simplify ((((pp/p*(-2/9)p)/p)/pp)/p)(-43)p(1/32)/(p/(p/p(-1/4)p)) assuming p is positive. p(-14767/288) Simplify (p(-6))(4/27)(pp(2/31)p)/p(-11) assuming p is positive. p(3397/279) Simplify i*(4/3)/i((i*(-2/5)/i)/i)/ii*(-1/8)ii((i*(-7)i)/i)/i assuming i is positive. i*(-1103/120) Simplify (z((z*(1/2)z)/z)/z)*(-16)/(((zz/((z/(z/(z/z*(1/4))))/z))/z)/zzz(-2/9)zz) assuming z is positive. z(-397/36) Simplify (k(kk/(k(-7)kk)k)/k)(-24)/(k(1/23)(kkkkk/k(-12/5)k)/k) assuming k is positive. k*(-22936/115) Simplify (zz(16/7))(2/21)/((z/(zz/(z22/z)))/(zzz(-3)/zzzzz)) assuming z is positive. z(-2600/147) Simplify (j36/j(-3/13))(-1/4) assuming j is positive. j(-471/52) Simplify kk*(-11)(k*13k)/k(kk/k(-1/2))(-3/16) assuming k is positive. k*(81/32) Simplify ((k/(kk*(-3/2)k)k)/kk(kk(-12)/k)/k)/((k/k(1/9))/k(-1/14)) assuming k is positive. k(-785/63) Simplify (l(lll/l(-2/43)l)/l)/l*(-31)(l*(8/7)ll)48 assuming l is positive. l(55957/301) Simplify ((vvvv*6/v)/vvv/v(-15))/(v/(v/((v(v*(-1/4)/v)/v)/v))v)(-19) assuming v is positive. v(1/4) Simplify f*(2/23)/(f/(ff*(-2/37)))ff24fff/f(-1) assuming f is positive. f(24707/851) Simplify (y(-3/7))(14/13)((y/((yy*(-2/7)yy)/yy)yy)/y)/yyy(-3/8)/y assuming y is positive. y(-1857/728) Simplify c*9c*12c(c1)11 assuming c is positive. c33 Simplify (((v/v5)/(v(v8/v)/v))(-4/29))(-1/9) assuming v is positive. v(-44/261) Simplify (a19/a(-1/18))/(a*(1/27)a8) assuming a is positive. a(595/54) Simplify ((g(8/11))(1/14))(-20) assuming g is positive. g(-80/77) Simplify (p*(2/13)/(pp*(-35)/pp))/((p*(-12/13)p)/(pp23)) assuming p is positive. p(755/13) Simplify ((q/(qqq2/qqq))27/(q(-8)((qqqq(2/15))/q)/q))(46/5) assuming q is positive. q(-69782/75) Simplify (b(-3))(-4/7)/((bb(1/19))/b(1/25)) assuming b is positive. b(2333/3325) Simplify (j(-6)j/j(-11))21 assuming j is positive. j126 Simplify (b/(bb(-1/6)))(-8)((b(-16)/b)/b)/(b/b(-1)) assuming b is positive. b(-64/3) Simplify (p/(pppp*(1/23)pp))/(p/(p/p2))pp/(p/(pp*(-14)))p(-11) assuming p is positive. p(-668/23) Simplify (j(-2/5))36/(j*32jj(-25)) assuming j is positive. j(-112/5) Simplify f(-7)f*(-2/5)f*(-32)(f/(f(ff/f*(-1/60)f)/ff)f)/ff assuming f is positive. f(-497/12) Simplify b(-1/2)/bb*(-2/13)b(b(-1))5 assuming b is positive. b(-147/26) Simplify kk*(-24)k/((k/(k*(-3/20)k))/k)kk(k7)5 assuming k is positive. k(317/20) Simplify (((ii(-5)/i)(-40))39)(12/7) assuming i	{ "pile_set_name": "DM Mathematics" }
igit of 97991? 7 What is the hundreds digit of 14971? 9 What is the units digit of 11590? 0 What is the units digit of 2382? 2 What is the hundreds digit of 41496? 4 What is the ten thousands digit of 34555? 3 What is the units digit of 858? 8 What is the hundreds digit of 358? 3 What is the tens digit of 28067? 6 What is the tens digit of 17582? 8 What is the units digit of 8938? 8 What is the tens digit of 964? 6 What is the hundreds digit of 16761? 7 What is the units digit of 6967? 7 What is the thousands digit of 187575? 7 What is the hundreds digit of 51591? 5 What is the hundreds digit of 53884? 8 What is the thousands digit of 1709? 1 What is the hundred thousands digit of 101292? 1 What is the tens digit of 602? 0 What is the ten thousands digit of 122963? 2 What is the units digit of 1376? 6 What is the hundreds digit of 1187? 1 What is the hundreds digit of 1902? 9 What is the units digit of 741? 1 What is the units digit of 7887? 7 What is the tens digit of 30341? 4 What is the thousands digit of 4107? 4 What is the thousands digit of 2280? 2 What is the units digit of 2598? 8 What is the thousands digit of 1799? 1 What is the hundreds digit of 196? 1 What is the tens digit of 21726? 2 What is the ten thousands digit of 69820? 6 What is the hundreds digit of 6439? 4 What is the tens digit of 39726? 2 What is the ten thousands digit of 63950? 6 What is the units digit of 86669? 9 What is the thousands digit of 5777? 5 What is the units digit of 69326? 6 What is the tens digit of 3421? 2 What is the thousands digit of 124966? 4 What is the tens digit of 487? 8 What is the hundreds digit of 1357? 3 What is the tens digit of 6115? 1 What is the units digit of 47468? 8 What is the thousands digit of 8904? 8 What is the tens digit of 40447? 4 What is the thousands digit of 16249? 6 What is the ten thousands digit of 38201? 3 What is the hundreds digit of 700? 7 What is the units digit of 286? 6 What is the hundreds digit of 51858? 8 What is the ten thousands digit of 42473? 4 What is the ten thousands digit of 77118? 7 What is the hundreds digit of 126061? 0 What is the ten thousands digit of 32407? 3 What is the ten thousands digit of 58495? 5 What is the tens digit of 69184? 8 What is the hundreds digit of 2006? 0 What is the thousands digit of 2071? 2 What is the tens digit of 22245? 4 What is the units digit of 3805? 5 What is the ten thousands digit of 56045? 5 What is the units digit of 119760? 0 What is the tens digit of 483? 8 What is the units digit of 58758? 8 What is the units digit of 875? 5 What is the tens digit of 640? 4 What is the units digit of 904? 4 What is the units digit of 2613? 3 What is the hundreds digit of 9342? 3 What is the units digit of 552? 2 What is the units digit of 3393? 3 What is the hundreds digit of 5238? 2 What is the units digit of 3817? 7 What is the tens digit of 1486? 8 What is the tens digit of 39? 3 What is the ten thousands digit of 52088? 5 What is the hundreds digit of 2604? 6 What is the hundreds digit of 3359? 3 What is the thousands digit of 35714? 5 What is the hundreds digit of 2984? 9 What is the ten thousands digit of 41700? 4 What is the hundreds digit of 171? 1 What is the units digit of 59? 9 What is the tens digit of 6974? 7 What is the units digit of 30366? 6 What is the hundreds digit of 1742? 7 What is the ten thousands digit of 72713? 7 What is the tens digit of 88831? 3 What is the hundreds digit of 2425? 4 What is the hundreds digit of 147666? 6 What is the tens digit of 10832? 3 What is the thousands digit of 4189? 4 What is the tens digit of 1360? 6 What is the hundreds digit of 539? 5 What is the units digit of 333? 3 What is the hundreds digit of 8278? 2 What is the units digit of 25623? 3 What is the thousands digit of 1831? 1 What is the hundreds digit of 30733? 7 What is the tens digit of 1058? 5 What is the hundreds digit of 7966? 9 What is the thousands digit of 4341? 4 What is the units digit of 971? 1 What is the thousands digit of 10428? 0 What is the tens digit of 1693? 9 What is the hundreds digit of 159? 1 What is the thousands digit of 24706? 4 What is the tens digit of 13456? 5 What is the tens digit of 6937? 3 What is the units digit of 15943? 3 What is the tens digit of 204? 0 What is the tens digit of 3436? 3 What is the tens digit of 28989? 8 What is the ten thousands digit of 13548? 1 What is the tens digit of 4144? 4 What is the ten thousands digit of 49117? 4 What is the tens digit of 1449? 4 What is the units digit of 2371? 1 What is the units digit of 44410? 0 What is the units digit of 968? 8 What is the thousands digit of 4857? 4 What is the units digit of 2788? 8 What is the hundreds digit of 371? 3 What is the tens digit of 1466? 6 What is the units digit of 301? 1 What is the units digit of 2668? 8 What is the hundreds digit of 20677? 6 What is the units digit of 17415? 5 What is the tens digit of 233? 3 What is the units digit of 1524? 4 What is the tens digit of 2382? 8 What is the thousands digit of 77601? 7 What is the ten thousands digit of 16552? 1 What is the ten thousands digit of 27994? 2 What is the tens digit of 999? 9 What is the tens digit of 19379? 7 What is the units digit of 8089? 9 What is the units digit of 9409? 9 What is the units digit of 910? 0 What is the units digit of 18892? 2 What is the units digit of 64661? 1 What is the thousands digit of 31616? 1 What is the thousands digit of 1121? 1 What is the thousands digit of 138759? 8 What is the tens digit of 1245? 4 What is the hundreds digit of 497? 4 What is the thousands digit of 36708? 6 What is the tens digit of 20402? 0 What is the tens digit of 216? 1 What is the hundred thousands digit of 107049? 1 What is the thousands digit of 33482? 3 What is the units digit of 386? 6 What is the units digit of 43296? 6 What is the thousands digit of 1932? 1 What is the tens digit of 20130? 3 What is the hundreds digit of 919? 9 What is the tens digit of 79826? 2 What is the tens digit of 7172? 7 What is the units digit of 40370? 0 What is the units digit of 1047? 7 What is the thousands digit of 15591? 5 What is the hundreds digit of 1513? 5 What is the hundreds digit of 1428? 4 What is the ten thousands digit of 53081? 5 What is the units digit of 10596? 6 What is the units digit of 9558? 8 What is the units digit of 21400? 0 What is the hundreds digit of 2073? 0 What is the hundreds digit of 24285? 2 What is the hundreds digit of 317? 3 What is the hundreds digit of 102911? 9 What is the thousands digit of 6809? 6 What is the units digit of 273? 3 What is the tens digit of 4449? 4 What is the thousands digit of 3553? 3 What is the tens digit of 13256? 5 What is the hundreds digit of 52203? 2 What is the thousands digit of 47268? 7 What is the tens digit of 57358? 5 What is the hundreds digit of 1228? 2 What is the hundreds digit of 5404? 4 What is the hundreds digit of 45172? 1 What is the hundreds digit of 45263? 2 What is the ten thousands digit of 50117? 5 What is the hundreds digit of 5435? 4 What is the thousands digit of 5685? 5 What is the hundreds digit of 45890? 8 What is the units digit of 468? 8 What is the hundreds digit of 5180? 1 What is the hundreds digit of 1723? 7 What is the tens digit of 287? 8 What is the units digit of 7896? 6 What is the units digit of 762? 2 What is the thousands digit of 2216? 2 What is the hundreds digit of 2215? 2 What is the tens digit of 6123? 2 What is the hundred thousands digit of 122962? 1 What is the tens digit of 92150? 5 What is the hundreds digit of 1330? 3 What is the thousands digit of 6064? 6 What is the thousands digit of 14709? 4 What is the units digit of 24220? 0 What is the hundreds digit of 6971? 9 What is the thousands digit of 3551? 3 What is the hundreds digit of 3786? 7 What is the tens digit of 3634? 3 What is the tens digit of 596? 9 What is the thousands digit of 21344? 1 What is the tens digit of 2209? 0 What is the tens digit of 8314? 1 What is the hundreds digit of 11869? 8 What is the tens digit of 124787? 8 What is the thousands digit of 4488? 4 What is the units digit of 14329? 9 What is the hundreds digit of 1567? 5 What is the units digit of 36384? 4 What is the hundreds digit of 101687? 6 Wha	{ "pile_set_name": "DM Mathematics" }
Let l(i) = 3i - 75. Let g be l(33). Let w(k) = k2 - 27k + 80. Let x be w(g). Solve -3r - x = -8 for r. 0 Let x = -6819 - -6825. Solve 0 = xl - 7l - 4 for l. -4 Let y be 11 - ((-5)/(-4))/((5/(-20))/(-1)). Solve 33s + y + 27 = 0 for s. -1 Let v = 5185 - 5185. Solve v = 41a - 37a + 16 for a. -4 Suppose -f - 481 = 13f - 943. Solve 13c + 20 - f = 0 for c. 1 Suppose -56w = -703 - 6185. Solve w = 6o + 159 for o. -6 Let g be (-3)/(-66) + 9785/110 + 7. Solve 0u - g = -24u for u. 4 Let q = 0 + 3. Suppose -t + q = -4u + 20, 18 = t + 3u. Suppose -ti + 2 - 6 = r, i = -3. Solve -rw + w = -4 for w. 1 Suppose -5w - 4x = 1303, -x - 3x + 1327 = -5w. Let u = -260 - w. Let p = -1 - -1. Solve v + u + 1 = p for v. -4 Let i be (32/(-2))/(21/(-553)). Let h = 86 - i. Solve 0 = 4k - h - 5 for k. 3 Let t be 3 + (-279)/(-7) - 1/(14/12). Solve 6 + t = -8q for q. -6 Let r = 13425 + -13370. Solve 0 = -41t + 27 + r for t. 2 Let t(x) = -8x + 105. Let j be t(12). Suppose 4m = 4r - 5r + j, -5r + 23 = -2m. Let f = -3 + 3. Solve fs = -rs for s. 0 Suppose s = d + 1 - 10, -2d - s = -6. Let y be ((-3780)/(-217))/9 - 8/(-124). Suppose -do + 9 = -yo. Solve -oa + 8 = -a for a. 4 Let w = -7 + 7. Let d be 6/2 + 10 + -10. Let o be 23 - (-1)/1d. Solve 5x + o - 6 = w for x. -4 Let c = 5960 - 5920. Solve -38n + 36 = -c for n. 2 Let g be 12 + (-14)/7. Let n = 119 - 117. Let i be (-555)/37n/(-5). Solve 2z + i + 0 = g for z. -3 Suppose -149n + 307n - 146n = 864. Solve nr = 66r + 36 for r. 6 Let w(g) be the first derivative of -g3/3 + 3g*2/2 - 67. Let c be w(3). Solve -12 = -3t - c for t. 4 Suppose -24w + 294 + 86 = -220. Solve -w = -13g + 8g for g. 5 Let z(q) = q2 - 7q + 16. Let g be z(4). Let o(h) = h. Let t(x) = -10x - 29. Let w(m) = go(m) + t(m). Let k be w(-6). Solve 2y - k + 1 = 0 for y. 3 Let v be (-1)/((-2)/(-308))(6 + -7). Solve -108t + vt + 276 = 0 for t. -6 Suppose -p - 105 = 4l - 903, -2l + p = -396. Solve 11f + 122 = l for f. 7 Let a(g) = 11g*2 + g + 6. Let v(u) = -31u*2 - 4u - 17. Let h(n) = -17a(n) - 6v(n). Let r = -2 + 4. Let o be h(r). Solve ol - 7l = -3 for l. -1 Suppose 0 = -d - 4v + 23, 3d + 0v - 4v - 149 = 0. Let p = 47 - d. Solve -8y + p = -9y for y. -4 Let r(j) = 6j2 - 144j + 26. Let c be r(24). Solve 0 = o + 32 - c for o. -6 Suppose -35n = -37n + 90. Suppose 7o + n = 66. Solve 7 = -od + 4 for d. -1 Suppose -5m = -4n - 0 + 1, -5n + 20 = 0. Let d(x) = -75x + 525. Let q be d(8). Let k be (0 - -5) + (-75)/q. Solve -w = -mw - k for w. -3 Let y be (-34 - -38) + (-17 - -1). Let i(g) = -g - 12. Let f be i(y). Solve -3d + d = f for d. 0 Suppose z - 1555 = 2n, 4z - 2n - 3378 = 2812. Suppose 1565s - 80 = zs. Suppose 19 = 5w - 3o, o + 3 = -3w - 2o. Solve -sh + wh = 10 for h. -5 Let z(l) be the third derivative of l6/120 - l5/12 - 3l*4/8 + 13l*3/6 - 5l*2 + 1. Let w be z(6). Let c be 1 + w/25-5. Solve cm - 2 = m for m. 2 Suppose -2r + 90 = 8r. Let q be 6 + -10 + -1 + r. Suppose 2o = s - 10, 3s - 3o - 2o - 26 = 0. Solve s = 2k - qk for k. -1 Let z(f) = -6f*2 + 16f - 45. Let j be z(9). Let i = -385 - j. Solve -in + 2 = -n for n. 2 Let f(h) = 1689h - 2473. Let b be f(2). Solve -b = 8j - 913 for j. 1 Let w(i) = -8 + 20 + i + 7. Let c be (-16)/((-96)/9)-10. Let y be w(c). Solve -6 = -yf - 2 for f. 1 Suppose -4v + 0v = 2g - 6, 0 = -g - 1. Let b(l) = -4l3 + 163l*2 + 1392l + 7. Let q be b(48). Solve vi + 20 = qi for i. 4 Let y = 8 + -3. Suppose yr = 21 + 4. Let u = -3608 - -3612. Solve rx + 1 = -u for x. -1 Suppose 25k - 19k = 0. Solve -36o + 10o - 78 = k for o. -3 Let y(s) = -2s2 - 52s + 2. Let c be y(-26). Suppose 3f + 0t + 4t = 27, -f = 5t + c. Solve fh - 27 = 4h for h. 3 Let i(u) = -48u + 1292. Let p be i(25). Solve -106 = 7x - p for x. -2 Let c(y) be the third derivative of y*4/24 - 7y*3/3 - 2y*2 - 32y. Let r be c(16). Solve 8o + r = 6o for o. -1 Suppose 0 = f - 3x - 4 + 3, 5f + 2x - 22 = 0. Let u(i) = -7i*2 - 217i + 224. Let z be u(-32). Solve z = -fr + 6r - 8 for r. 4 Let l(i) = 8i + 230. Let u be l(-28). Let b be (-11/u)/(12/(-72)). Solve -4r - b = -21 for r. 5 Let b = 163 + -272. Let p = 113 + b. Solve x = -px - 5 for x. -1 Let r(i) = 7i - 11. Let w be r(5). Suppose -94a + 97a + w = 0. Let g be (-28)/(-16) + -3(-2)/a. Solve 3 + g = d for d. 4 Suppose -8229 = -155y + 20911. Solve -23r - 24r = -y for r. 4 Let q be 91/3 - (21 - -2). Let c = 12 + q. Let z be (-1)/2 + ((-20)/c - 2). Solve z = -3b + 3 for b. 1 Suppose -25a - 16a - 19a = -3a. Solve 4i + 44 - 56 = a for i. 3 Suppose 5h - 11 - 9 = 0. Let x(g) = g3 - 27g*2 - 57g - 989. Let s be x(30). Solve 5 = -hk + s for k. -1 Let v be -919 + (8 - (7 + -8)). Let i = v + 911. Solve -14 = -3f + i for f. 5 Suppose 82f = 28f + 48f + 2100. Solve 0 = 46j + 24j + f for j. -5 Suppose -883 = 67a - 6712. Solve -17c + 155 - a = 0 for c. 4 Let x(q) = 3q - 53. Let w(d) = -10d - 3. Let n be w(-2). Let z be x(n). Let j(c) = -c2 - 5c. Let s be j(z). Solve 2f - s = -f for f. 2 Let y(d) = 3d + 5. Let w be y(-7). Let j = w + 13. Let r be (-2)/j + (-39)/(-9) + -3. Solve -o - 3 = r for o. -5 Let a(u) = -6u + 16. Let c be a(10). Let n be (-11)/(2/88). Let i = n - c. Solve g = -ig - 4 for g. -4 Let y be (0 + 6/(-4))(-26 - -34). Let q be (-1 + 6)(y/4)/(-3). Solve -4d + q - 1 = 0 for d. 1 Let f(z) = 2z + 15. Let r be f(12). Suppose 1077o = 1075o - 5d - 20, 0 = 3o - d - 4. Solve o = -5q + r - 19 for q. 4 Let a be (2/5)/(8/80). Suppose 3q = -ac + 43, 5q + 2c - 67 = 28. Solve qk - 20k = -5 for k. -5 Suppose -5m + 5 + 15 = 5a, -m = 0. Solve -8w + 7w = a for w. -4 Let o(i) = 2i2 + 12i + 9. Let x be o(-9). Suppose -86y = -79y - x. Solve 4c + 20 = yc for c. 4 Let o be (-6)/4 - 1(-68)/8. Let q be (-3 + o/3)/(6/(-27)). Let k = 16 + -8. Solve -k = -qa + a for a. 4 Suppose -a - 20 = -19, 4c + 3a = -1315. Let w = c - -334. Solve -2g = -4g + w for g. 3 Let g be (10 + -4)/(50/175 + (-430)/1652). Solve -39p - 41 = -g for p. 5 Let l be (5010/45 + 9)12/(-2). Let y = l + 753. Solve -yn - 20 = -26n for n. -4 Let x(z) = -z - 2. Let f be x(-3). Let q(y) be the second derivative of y5/4 - y4/12 + y*3/6 + 93y. Let s be q(f). Solve -c + s = 3 for c. 2 Suppose -3z - 4 = -4z. Let a = 15 - z. Let q = 4154 + -4153. Solve -2n - a = -q for n. -5 Let k(i) = -62i - 731. Let g be k(-12). Solve -20 = -gj + 3j for j. 2 Let c be -1166/((-168)/7). Suppose 3l = -5w + 28 - c, -4w = -3l + 17. Solve 0 = -ln - 0 + 3 for n. 1 Let a = -2101 - -2108. Solve -aj - 8 = 13 for j. -3 Let l(n) = -125 + n + 8n - 3n + 21. Let a be l(18). Solve q = -aq - 5 for q. -1 Let h be (2 - 5)/(1/6). Let a be 21/63h/(-1). Suppose 3v - 9 = -a. Solve 2i - v - 7 = 0 for i. 4 Let j = -859 - -863. Let h be (6/j)/(-4 - 806/(-200)). Solve 0 = 53q - hq - 15 for q. 5 Suppose 0n = 4p - 5n - 7, 11 = 5p - 4n. Let o be (-2)/(1 + p/3) + 4. Let z(y) = -2y - 2. Let t be z(-7). Solve 0j - oj = t for j. -4 Suppose 21 = n + 5. Let g = 3 + n. Let j(w) = -w3 + 19w*2 - w + 21. Let u be j(g). Solve t - 3 = ut for t. -3 Suppose 5n - 9n + 16 = 0. Suppose -2a + o + 8 = 0, na - o + 4o - 16 = 0. Suppose 16 - 3 = 5z + 2m, -4z - am + 8 = 0. Solve -9 = -zk - 0k for k. 3 Let u = 71 + -71. Suppose -d - 2j = u, 6 = 2d - 3j - 22. Solve 4p + d = 4 for p. -1 Suppose p = 12v - 13v + 392, -1962 = -5v - 3p. Solve -401t + vt = -40 for t. 5 Let m be (-32175)/(-260) - 26/(-8). Solve 5 = 126f - mf for f. -5 Let n be (-1 - -3 - 1) + 1 + 50. Suppose -5y - 17 = -n. Solve yx = 2x for x. 0 Let q(f) = -8f2 - 167f - 97. Let a be q(-19). Solve -5t - 42t + a = 0 for t. 4 Let n be 48/8 - -43. Solve 59 = 4q + n for q. 3 Suppose -12g = 3o - 9g - 108, -4o - 5g + 152 = 0. Solve 0 = -483u + 476u - o for u. -4 Let l = -9640 - -9661. Solve -399w + 402w + l = 0 for w. -7 Suppose 5 = 5v - 5. Let s(i) be the third derivative of -i5/60 - i4/6 + 17i3/6 + 107i2. Let n be s(-6). Solve -k + n = v for k. 3 Let n(x) = -x2 + 26x - 23. Let t be n(24). Suppose 2p - 20 = -2r, -r - 3p = r - t. Solve z = -rz - 24 for z. -4 Let s(x) = -x*2 +	{ "pile_set_name": "DM Mathematics" }
Let r = 6 - o. What is the units digit of 8 + (r - 0 - 0)? 7 Suppose 0 = -3j - 2j + 20. Suppose 2 = -f + h - 5, 2f - j = -4h. What is the units digit of 2/(-6)(f - 2)? 2 Suppose 42 = -5t - 2f, -2 + 6 = -t + 4f. Let w(l) = 3l - l + 3 - 3l - 4. What is the units digit of w(t)? 7 Suppose -137 = 8q - 1161. What is the tens digit of q? 2 What is the units digit of 36/8(1 - -1)? 9 Let f be (4/(-6))/(10/(-45)). Suppose -fk + 72 = k. What is the units digit of k? 8 Suppose g - 12 = -g. Suppose 2d - gd = 5z - 35, 0 = 2z + 5d - 31. What is the units digit of z? 3 Let i(v) = 2v2 - 1. Let f be i(-1). Let c = 2 - f. What is the units digit of c? 1 Let r be 13 - (-1 - (-2 + 1)). Suppose -4k + 3 = -r. Suppose 4q - 18 = -l, -3q = -kl - 4q + 27. What is the units digit of l? 6 Suppose 5q + 3 = 4g, -5q - 20 = 2g + 1. Let w = -5 - g. What is the tens digit of (w/3)/((-2)/36)? 1 What is the tens digit of (2 + -1)/(2/86)? 4 Suppose -6c + 9c = -2k + 305, 4k = -4c + 608. What is the tens digit of k? 5 Let t = 167 + -112. Suppose a + 4p = t, -5p = -2a + 7a - 200. What is the tens digit of a? 3 Suppose -d - 879 = -3x, -3x - 4d = -2x - 306. What is the tens digit of x? 9 Suppose -3i = -4 - 8. Suppose r + i = 9. What is the units digit of r? 5 Suppose 7d - 6d = 8. What is the units digit of d? 8 Suppose -152 = -a + 5g, 530 + 126 = 4a - 4g. What is the units digit of a? 7 Suppose -5s + 5g + 95 = 0, -5s + 46 = -3g - 51. Let y = s + -3. What is the tens digit of y? 1 Let a be ((-1)/(-2))/((-2)/(-72)). Suppose 0 = -y - y + a. What is the units digit of y? 9 Let z(b) = -4b2 - 2 - b2 + 5 + 0b3 + b3. What is the units digit of z(5)? 3 Let n be (-2)/(-10) - (-258)/10. Let j(o) = -2o3 + o2 - o - 1. Let p be j(-1). Suppose -n + 1 = -pl + u, 37 = 3l - 4u. What is the units digit of l? 7 Let r(n) = -3n*2 + 4n + 4 + 2n2 + 5n + 0n. Let x be r(8). What is the tens digit of 2/20x10? 1 Suppose 656 = 15f - 694. What is the units digit of f? 0 Let x(s) = 2s2 - 4s - 3. Let u be ((-16)/10)/(16/(-40)). What is the units digit of x(u)? 3 Suppose -11r + 6r - 55 = 0. Let h = 13 + r. What is the units digit of h? 2 Suppose -t = 15 + 12. Let j = 18 + t. Let d = 19 + j. What is the tens digit of d? 1 Let d = -7 - -4. Let v = 28 - 24. What is the tens digit of (v/(-10))/(d/120)? 1 Suppose 0 = -2q - 5z + 16, 2q = -z + 2z + 4. Suppose 0h + 5c - q = h, 5h = c + 57. What is the tens digit of h? 1 Let z(j) be the first derivative of -j2/2 + 5j + 2. What is the tens digit of z(-10)? 1 Let t(u) = 2u2 - 1. Let x be t(-2). Suppose -3i + 14 = -x. Suppose 4z - 5c - 16 = 0, -iz + 2z - 2c = -53. What is the units digit of z? 9 Suppose -2y = -7y. Suppose 0 = 5d - 5 - y. What is the units digit of d? 1 Let g = -78 + 88. What is the tens digit of g? 1 What is the tens digit of -7 + 242 + 0/1? 3 Let i be -2 - -1(-12)/(-3). Suppose 5o + 23 = 5w + 68, -io + 22 = -4w. What is the units digit of o? 7 Suppose k - 8 = -0k. What is the units digit of k? 8 Let m(r) = r*2 - 4. What is the units digit of m(-9)? 7 Suppose i = 24 + 119. What is the tens digit of i? 4 Let r = 48 - -27. Suppose 5v - r = 80. What is the tens digit of v? 3 Suppose 2m + 3 = -l + 12, 0 = -2l + 4m - 6. Suppose -4a + la + 33 = 5s, -a + 28 = 4s. What is the units digit of a? 8 Let q(o) = 2o - 6o - 5o + 1. What is the units digit of q(-2)? 9 Suppose 0 = -4w + 8 - 0. Let h be w/(-8) - 1/(-4). Suppose 0 = -0d - 3d, i + 5d - 6 = h. What is the units digit of i? 6 Let r(i) = 3i - 4i*2 + 3i*2 + 0i + 2. Let s be r(3). Suppose -z = 3q + 7, 4z - 6q = -sq + 36. What is the units digit of z? 5 Let x(s) = -113s + 12. What is the units digit of x(-2)? 8 Suppose -10 = -l + 6l + 5y, 4l = 4y - 16. Let u = l - -5. Suppose -3f + u + 9 = n, 4f - 13 = -n. What is the units digit of f? 2 Suppose -4k + 92 + 36 = 0. What is the units digit of k? 2 Suppose 0 = 2y - 3u - 9 - 187, 2y - 4u - 192 = 0. What is the hundreds digit of y? 1 Let n = -31 + 53. What is the tens digit of n? 2 Let g(v) = v*2 - 2v. Let p be g(-3). Suppose -3n + 7n + 3o - 39 = 0, -n + o + p = 0. Let k = 18 - n. What is the units digit of k? 6 What is the tens digit of (-4(-1)/(-5))/(7/(-2205))? 5 Let c(i) = i - i*3 + 0i + 3i2 - 2i*3 + 4i*3 - 1. What is the units digit of c(-2)? 1 Suppose 14z - 122 = 12z. What is the tens digit of z? 6 Let f(v) = -v3 + 15v*2 - 17v - 9. What is the tens digit of f(12)? 1 Let b be 15/64/(-5). What is the tens digit of 22/(0 - b/1)? 1 Let b(d) = d - 5. Let t be b(5). Let x = 10 + -6. Suppose q + 3q - x = t. What is the units digit of q? 1 Let a(l) = -l*2 - 7l - 2. Let j be a(-6). Let n be 4/(-3)(-9)/2. Let c = n - j. What is the units digit of c? 2 What is the units digit of (71 + -2)/(18/12)? 6 Let c(u) = 2u - 4. Let r be c(4). Suppose rq = 2q + 24. What is the tens digit of q? 1 Suppose -7 = -5x + 18. What is the units digit of x? 5 Let q = 22 + -8. What is the units digit of q? 4 Suppose -d + 29 = 5r, d - 2r - 9 = -3r. Suppose -2y + b = -3b, 5y - db = 12. Suppose -t - z + 10 = 0, -37 = -4t + z - yz. What is the units digit of t? 7 What is the tens digit of 1/(2/13684)? 7 Suppose -3t + 13 = -2t. Suppose -3h - 2h + 45 = 0. Let d = t - h. What is the units digit of d? 4 Let l(k) = 4k*3 - 2k*2 + 1. Let g be l(1). Suppose gs - 240 = -s. What is the units digit of 2/(-3) - s/(-9)? 6 Let k be (50-1)/(1 - 2). Suppose r = 6r - k. Suppose 0d - 10 = 3d - 5y, 3d = y + r. What is the units digit of d? 5 Let k(t) = t2 - 10. What is the units digit of k(7)? 9 Let t(j) be the third derivative of j4/12 - 3j3/2 + j2. Let n be t(6). What is the units digit of n/1 - (-1 + 3)? 1 Suppose 4d - 3q - 16 = 0, -5d + 11 + 9 = -3q. Suppose 2c - dc = -52. What is the tens digit of c? 2 Suppose n = 2n. Suppose n = -2z - 2g + 4, z - 4g + 11 = -12. Let m = z - -11. What is the units digit of m? 8 Suppose 0 = 5h - g - 15, -5h + 3g = g - 20. Let v be (-21)/(-6) + 1/h. Let o = v + 2. What is the units digit of o? 6 Let a(p) = p*3 + 7p*2 - 9p - 4. Let k be a(-8). Let c = k + 8. What is the tens digit of c? 1 Suppose -2z + 4z = -10. Suppose 3b = -y + 8b - 37, -5y - 2b = 77. Let f = z - y. What is the tens digit of f? 1 Let c(d) = -d*2 + 11d + 3. Let t(x) = x*3 - 8x*2 + 7x + 8. Let g be t(7). What is the tens digit of c(g)? 2 Let k(m) = 2m + 72. Let u be k(0). Suppose 2a - 4a = -u. What is the units digit of a? 6 Suppose c - 5 = -1. Let n = c + 15. What is the tens digit of n? 1 What is the units digit of -13 + 18 + (-179)/(-1)? 4 Let n(l) = -l2 + 29l + 23. What is the units digit of n(23)? 1 Suppose -4i + 3i = -2d + 41, -5d + 110 = -i. What is the tens digit of d? 2 Let f(v) = -v*3 - 9v*2 - 8v + 6. Let i be f(-8). What is the tens digit of (9/(-3) + 5)i? 1 Let w be ((-6)/(-2))/(24/16). Suppose 0 = -wy - 3 + 41. What is the tens digit of y? 1 Let q(k) be the first derivative of 5k2/2 - k - 5. What is the units digit of q(6)? 9 Suppose -95 - 263 = -2l. What is the hundreds digit of l? 1 Let t be 18/(-4)(-22)/(-33). Let v be 50/4 + (-2)/(-4). Let l = v + t. What is the units digit of l? 0 Suppose -3m = 4n - 74, 48 = 2n - 5m - 2. Let o(i) = i2 + 6i - 4. Let g be o(-7). Suppose gh = h + n. What is the tens digit of h? 1 What is the units digit of (32 + -1)/((-1)/(-3))? 3 Let z = -83 + 102. What is the tens digit of z? 1 Let y = 6 - 1. Let k = y - 3. Suppose 4n - 16 = i, 0 = -n + kn - 5i + 15. What is the units digit of n? 5 Let q = 31 + 18. What is the tens digit of q? 4 Suppose j = -1 + 3. Suppose 3m = jm + 7. Let d = m + 7. What is the units digit of d? 4 Let l be (0/(-2))/(-2 + 1). Suppose h - 3 = -lh. Let y = 3 + h. What is the units digit of y? 6 Let h be (-3 - -3) + 0 - -16. Suppose -2j = -n - 70, h = 3j - 4n - 84. What is the units digit of j? 6 Suppose -f = -l - 5f + 54, -141 = -4l - f. What is the tens digit of l? 3 Suppose -f - 11 = -2m + m, -m + 2f = -13. Let y = m - 6. Let k = y + 0. What is the units digit of k? 3 Let x be (0/2)/3 - 0. Let c be 2/2 + -7 + x. What is the units digit of (-14)/(-1)*(-3)/c? 7 Let a be	{ "pile_set_name": "DM Mathematics" }
. Let h = t + 269322.899998. Let v = h + -3. What is v rounded to five decimal places? 0 Suppose 14p = 9p + 12977240. Suppose -n + p + 404549 = -3g, -3n + 3999991 = -4g. What is g rounded to the nearest one hundred thousand? -1000000 Suppose -z - f + 23022 = 4819, -5f - 90985 = -5z. Round z to the nearest 1000. 18000 Let o be (1 - 2-2) + 0. Let y(u) = 2801u3 - 5u2 - u + 5. Let f be y(o). Round f to the nearest 100000. 400000 Let w(p) = p3 - 4p3 - 7p*2 - 1 + 7. Let r be w(-5). Suppose -r = j - 3n, -j + n + 198 = -2j. What is j rounded to the nearest one hundred? -200 Let m(j) = 2808j*2 + 3j + 5. Let r be m(4). Let g = r - 22045. What is g rounded to the nearest 1000? 23000 Let f = 0.13 - 0.08. Let b = -0.050006 + f. What is b rounded to five dps? -0.00001 Let k(i) be the second derivative of -17999i3/6 + 3i*2/2 - 2i. Suppose 4c = 2c - 6. Let v be k(c). Round v to the nearest 10000. 50000 Let s = -122.3 - -18.4. What is s rounded to the nearest ten? -100 Let p = 39 - 38.83. Let n = -0.17011 + p. Round n to four dps. -0.0001 Let b = 10 + -8. Let o(c) = -c. Let h(g) = 99g. Let t(q) = -h(q) - 66o(q). Let n be t(b). Round n to the nearest 10. -70 Let g = 0.25 - 0.05. Let x = 0.20015 - g. What is x rounded to five dps? 0.00015 Suppose 6i = 2i + 151020. Let y = i + 596391. Let q = -1054146 + y. Round q to the nearest 100000. -400000 Let c = -90753 + 50753. What is c rounded to the nearest 100000? 0 Let q = -191 - -190.99999821. What is q rounded to seven decimal places? -0.0000018 Suppose p - 4p = -1092. Let h = p - 99. Suppose -2n - 3n + 370 = -4g, 4n + 3g - h = 0. Round n to the nearest 100. 100 Let p(s) = 122s - 9 - 102s + 73s + 188s. Let y be p(-11). Round y to the nearest one thousand. -3000 Let p = -14 + -56. Let a = 23234.67097 + -23164.67. Let h = p + a. What is h rounded to four decimal places? 0.001 Let r be (-4 + (1 - -243))550000/6. Round r to the nearest 1000000. 22000000 Let z = -228 + 223.68. Let n = -16 - -16.18. Let a = n - z. Round a to the nearest integer. 5 Let y = 457.0000213 + -457. Round y to five dps. 0.00002 Suppose -i - 148999 - 2872544 = 0. Let q be ((-3)/2)/((-1)/(-5214362)). Let b = q - i. What is b rounded to the nearest 1000000? -5000000 Let u = -1645.3305 + 35.1405. Let y = -1598 - u. Let m = -11.3 + y. What is m rounded to one decimal place? 0.9 Let n = -314 - -314.000000169. What is n rounded to 7 dps? 0.0000002 Let r = -2442456 - -2442455.82999955. Let q = r - -0.17. What is q rounded to seven dps? -0.0000005 Let p = -0.126 + -0.484. Let d = p + -10.71. Let a = -12 - d. What is a rounded to one dp? -0.7 Suppose 16 = 7b - 3b. Suppose 0 = -4f + 3f - bw + 20, 3f + 5w = 25. What is f rounded to 1 decimal place? 0 Let s(j) be the second derivative of j*3/6 + 7j*2/2 - 2j. Let m be s(-7). Let t be (-18 + (-1 - m))2. What is t rounded to the nearest ten? -40 Let s = -76.118 - -76. Let i = s - -0.118087. Round i to five dps. 0.00009 Suppose 7 = 5u - 3. Suppose v + 3t = 4006, 3v + uv + t = 20002. What is v rounded to the nearest one thousand? 4000 Let h = 0.42386757 + -18.82372657. Let x = 18.4 + h. Round x to five decimal places. 0.00014 Let k = 6 - -1. Let q = -8.7 + k. Let z = q - -1.7000007. What is z rounded to 7 decimal places? 0.0000007 Let o = -522 + 6132. Suppose -g = -4326 - o. Suppose -28064 - g = -2b. What is b rounded to the nearest ten thousand? 20000 Suppose 2g = -0p - 2p + 2279998, 0 = -3g + 2p + 3420002. Round g to the nearest 100000. 1100000 Suppose 2u + 1145502 + 52454506 = 2h, 0 = 2h + 5u - 53599980. Round h to the nearest one million. 27000000 Let q = 7.64 + -7.6400577. What is q rounded to 5 dps? -0.00006 Let h = 14 - 8. Let z(y) = 60001y - 6. Let p be z(h). Round p to the nearest one hundred thousand. 400000 Suppose -24 = -4s - 8. Suppose 2m + 2m = 3c + 3855, m = -sc + 940. Round m to the nearest one hundred. 1000 Let l = 1166708646.7 - 1166708449.69999921. Let o = -197 + l. Round o to seven decimal places. 0.0000008 Let v = -0.36 - -1.8. Let k = -53.04 - -53. Let f = k + v. What is f rounded to 1 decimal place? 1.4 Let m = 29.9999785 - 30. What is m rounded to 6 dps? -0.000022 Let p(u) = u + 3. Let v be p(-3). Let l be (-23)/4(-28 + v). What is l rounded to the nearest 10? 160 Let z be (4/(-3))/((-4)/(-54)). What is z rounded to the nearest 10? -20 Let y = 58.2 - 307.2. Let o = 248.99883 + y. What is o rounded to four dps? -0.0012 Let k = 6.2 - 6. Let z = -0.02 + k. What is z rounded to 1 dp? 0.2 Let c = 196801672 - 196801677.99999988. Let b = c + 6. Round b to 7 dps. 0.0000001 Let z = 14 - 13.999966. Round z to five dps. 0.00003 Let o = -11 + -20. Round o to the nearest ten. -30 Let l = 635135 - -273739. Let d = 908889.69931 - l. Let n = d - 15.7. Round n to 4 dps. -0.0007 Let z(g) = 7001g3 + g2 + 3g + 1. Let x be z(-2). Let d = 21009 + x. Round d to the nearest ten thousand. -40000 Let y = -213134309198 + 213134149063.905041. Let d = -160134 - y. Let i = d - 0.095. What is i rounded to five decimal places? -0.00004 Let u(j) = -46987j2 - 8j - 7. Let r be u(5). Let w = 414722 + r. What is w rounded to the nearest one hundred thousand? -800000 Let n(a) = a*2 + 9a - 2. Let p be n(-10). Suppose ph = 6h + 1460000. Round h to the nearest 100000. 700000 Let y = -45.000045 - -45. Round y to 5 dps. -0.00005 Let l(w) be the second derivative of 437500w4/3 - w3/3 - 2w*2 + 5w. Let h be l(-2). What is h rounded to the nearest one million? 7000000 Let g(f) = -4f + 2 + 5 + 2f. Let x be g(6). Let o(i) = 1380i. Let a be o(x). Round a to the nearest one thousand. -7000 Let j(y) = 2626y*3 - 2y*2. Let u be j(2). Round u to the nearest 1000. 21000 Let v = -3.8221 + -2.17785. Let r = 0.7 - -5.3. Let o = v + r. What is o rounded to 5 dps? 0.00005 Suppose -878 = -c - 5y + 4837, -3y - 28603 = -5c. Suppose -c = -3o - 4a + 2562, -13788 = -5o + a. Let j = o + -5358. Round j to the nearest one thousand. -3000 Let z = -0.4195 + 0.70865. Let l = 0.29 - z. Round l to four dps. 0.0009 Let q = -14 - -13.99999966. Round q to 7 dps. -0.0000003 Let d = 1.4 - 1.40000117. What is d rounded to 7 dps? -0.0000012 Let k = -33.0199 + -0.0801. Round k to the nearest integer. -33 Let i = -0.329 - -1.739. Let s = 1.55 - 0.05. Let g = i - s. Round g to 1 dp. -0.1 Let z = 0.181 + -0.1809801. What is z rounded to 6 decimal places? 0.00002 Let s = 6 - 8. Let k(r) = -1364r*3 - 4r*2 - 3r - 2. Let f be k(s). Suppose 0l + l = -f. What is l rounded to the nearest one thousand? -11000 Let o = 242 - 241.99401. What is o rounded to 3 dps? 0.006 Let z = -5 + 16. Let n = -11.0000051 + z. Round n to six decimal places. -0.000005 Let l = -2263 + 2263.05978. Let g = 0.06 - l. What is g rounded to four decimal places? 0.0002 Let k = -3.917 - -0.017. Let q = 8254.0919 + -8258. Let o = k - q. Round o to three dps. 0.008 Let n be (-120)/(2/20). Let d be 3/2(-1464)/18. Let k = d - n. Round k to the nearest 10. 80 Let a(h) = 3h*2 - 3h. Let l be a(-3). Suppose l = -z - 2d, -2z = -z + 4d + 32. What is z rounded to the nearest one hundred? 0 Let r = 2687.57301 + -2566.5735. Let g = -0.096 - 120.904. Let w = r + g. What is w rounded to 4 dps? -0.0005 Let t(a) = 1900000a. Let i be t(4). What is i rounded to the nearest 1000000? 8000000 Let k = 1.68 + 0.12. Let n = -11 - -10.16. Let x = k + n. Round x to 1 dp. 1 Let i = 3.46 + 0.14. Let y = i + -25.55. Let q = y - -23. Round q to one decimal place. 1.1 Let b = 14.35 + -14. Let j = 49.35 - b. Let h = 60.7 - j. Round h to 0 dps. 12 Let c = 11359 - 11132.01. Let r = -229 + c. What is r rounded to 1 dp? -2 Let o be 10 + 3/(-6)2. Let h(j) = 160494j*2 - 2j + 4. Let n be h(o). Suppose 0v - n = v. Round v to the nearest 1000000. -13000000 Let n = 226 - 92. Let z = n - 136.02. Round z to one dp. -2 Suppose 0 = 3p - 330 - 237. Round p to the nearest 100. 200 Let n(b) = b*3 + 3b*2 - 2b - 3. Suppose -7a + 6a = 3. Let h be n(a). Suppose hm + 3s = -15312, -3s - s = 16. What is m rounded to the nearest 1000? -5000 Let k = 3 + -8. Let j(b) be the second derivative of 529b5/20 + b4/3 - b*3 - 5b*2/2 - 3b. Let p be j(k). What is p rounded to the nearest ten thousand? -70000 Let d = -43.0	{ "pile_set_name": "DM Mathematics" }
9 = 0. Round h to the nearest 1000000. -6000000 Suppose t = 5c + 2491, 22c = 20c - 3t - 1010. What is c rounded to the nearest one hundred? -500 Let t = 1.9075818 - -12975798.0924182. Let k = t - 12975813.999639. Let i = k + 14. Round i to four dps. 0.0004 Let z(t) = -1038t - 14. Let s = 172 + -175. Let v be z(s). What is v rounded to the nearest ten thousand? 0 Let x = 292.8 + -5.8. Let g = x - 312.7. Let j = 23.67 + g. Round j to one decimal place. -2 Let o = 13 - 28. Let v = 1287582 - 1287567.00039. Let h = o + v. Round h to four decimal places. -0.0004 Let r = -4.19 - -5.108. Let z = 0.19 - r. Let o = -0.068 - z. What is o rounded to one dp? 0.7 Let t = 0.11981 - 0.121658. Round t to three dps. -0.002 Suppose -44n = -42n + 2440. Let d = -2884 - n. Round d to the nearest 100. -1700 Let i = -775.1178 - -775. Let b = i - -15.7378. Let t = -1.58 - b. Round t to 0 decimal places. -17 Let n = 1687 + -2437. Let s = n + 750.01774. What is s rounded to 3 dps? 0.018 Let s = -2094 - -670. Let k = s + 1423.999177. Round k to 4 decimal places. -0.0008 Let f = 55.5614 - -0.1386. Let h = 55.5956 - f. Round h to 2 decimal places. -0.1 Let z = -1.95 + -9.35. Let i = 0.27473367 - -11.02536333. Let f = z + i. What is f rounded to 5 decimal places? 0.0001 Let b = 145220 + -760470. What is b rounded to the nearest ten thousand? -620000 Let z = 28882.938 + -28913. Let o = -29.6 - 0.4. Let l = z - o. What is l rounded to two decimal places? -0.06 Let r = -22815.99936038 - -22816. Round r to four dps. 0.0006 Let y(t) be the first derivative of -t4/4 + 7t*3/3 - 4t*2 - 12t - 92. Suppose -4s - 28 = -0s. Let r be y(s). Round r to the nearest one hundred. 700 Let o = -26.2551 + 320.3877. Let b = -294.4 + o. What is b rounded to two dps? -0.27 Let l = -142.12 - -143. Let n = 1.47 + l. Round n to one dp. 2.4 Let q(m) = -31m - 59m + 12m - 59 - 43m. Let u be q(9). What is u rounded to the nearest 10? -1150 Let g = 140629 + -140708.033. Let t = 79 + g. Let j = t + 6.333. What is j rounded to zero dps? 6 Let p = 207546 + -207545.999878957. Round p to 6 decimal places. 0.000121 Let h = -5.24 + 85.14. Let l = h + -1.9. Let d = l - 79.28. Round d to one dp. -1.3 Let n = -10 - -10.037. Let g = n - 0.527. Let c = -0.48844 - g. What is c rounded to four decimal places? 0.0016 Let h = 9523.3762 + -9523. Round h to one decimal place. 0.4 Let k = -4861 - -4180.4. Let u = -618 - k. Let z = -62.599727 + u. Round z to 5 decimal places. 0.00027 Let n = 9834 + -9833.9946022. Round n to three dps. 0.005 Let j = -46.932 + 5.262. Let s = j + -0.33. Let c = s - -46.8. Round c to the nearest integer. 5 Let r = 6802612 - -4550188. Round r to the nearest 1000000. 11000000 Let x(r) = 27r2 + 10r - 3. Let g be x(-8). Let t = 2616 - g. Suppose -3o + 3c - 8c = -t, -5c = -o + 297. What is o rounded to the nearest ten? 320 Let f = -684362 + 442122. What is f rounded to the nearest ten thousand? -240000 Let s = -130887 - -190543. Let k = s - 102256. Round k to the nearest one thousand. -43000 Let p = -2254.1797 + 2254. Let z = 0.0393 - p. What is z rounded to two dps? 0.22 Let l = 958.3 - 958.64364. Round l to three decimal places. -0.344 Let y(k) = 8k3 - 15k*2 + 4k - 37. Suppose 0 = 3q + 685 - 736. Let w be y(q). Round w to the nearest 1000. 35000 Let n = 6729.02763 - 6729. Let b = -0.2924 + 0.323. Let w = b - n. What is w rounded to three dps? 0.003 Let z = 0.0183 - -0.1765. Let i = 26.1452 + z. Round i to the nearest ten. 30 Let y = -2831.1366 + 0.3366. What is y rounded to the nearest one thousand? -3000 Let g = 32690083251393.1600162 + -32690066798526. Let z = 16452869 - g. Let i = 1.84 - z. Round i to six decimal places. 0.000016 Let q = 695774.4866 + -696532.4. Let p = 758 + q. Round p to 3 decimal places. 0.087 Suppose -5w + 2h + 55 = -0w, 0 = 4w + h - 31. Suppose -ws + 3s - 1800000 = 0. What is s rounded to the nearest ten thousand? -300000 Let u = -204 + 662. Let l = 457.9999031 - u. Round l to 5 decimal places. -0.0001 Let y = -5.984552 + 5.969. Round y to 3 decimal places. -0.016 Let o = 256.589 + -0.639. Let f = o + -266. What is f rounded to the nearest integer? -10 Let b = -42282 + 52288.5. Let s = b - 10006.340034. Let w = 0.16 - s. What is w rounded to 5 decimal places? 0.00003 Suppose -31q - 5372 = -69q - 1952. Let b be 75/(-12) + (-1)/(-4). Let z be q + 1 + b/2. Round z to the nearest 10. 90 Let m(t) = -77t + 7. Let u be m(6). Let l = u - -162. Round l to the nearest 100. -300 Let g = 90.88 + -91. Let m = 42.78 - g. What is m rounded to the nearest integer? 43 Let x = -88.94 + 88.940009102. What is x rounded to seven dps? 0.0000091 Let y = -50 + -24. Let v = y - -74.0218. What is v rounded to two dps? 0.02 Suppose 51104 = 6v - 3712. Let d = v + -75136. Round d to the nearest 100000. -100000 Let v = -209598 + 810327. Suppose 2x + 3k - v = 0, 2x + 0k - 600733 = k. Suppose -1479634 - x = 10a. Round a to the nearest 10000. -180000 Let p = 784.34909 - -0.05091. Let b = p + 17.6. Let x = b - 802.00000457. Round x to seven dps. -0.0000046 Let i(o) = -9o3 - 7o*2 + 13o + 24. Let w be i(7). Let x be w/(-6)840/21. What is x rounded to the nearest 1000? 22000 Suppose -12728088 = -2a - 40295618. Let c = a + 8483765. What is c rounded to the nearest 1000000? -5000000 Let k = -125.19 - 3425.91. Round k to the nearest one thousand. -4000 Let d = -34589.22 + 34084. What is d rounded to the nearest integer? -505 Let b = -2095.85132 - 0.04868. What is b rounded to the nearest 10? -2100 Let s = -0.062 - 0.09. Let l = 26.933104306 + -26.781105. Let t = s + l. What is t rounded to 7 dps? -0.0000007 Let n = -10968 + 10967.999982875. What is n rounded to 6 decimal places? -0.000017 Let z(v) = 10v2 - 66v + 236. Let s be z(-24). Round s to the nearest 1000. 8000 Let n = -0.275 + -222.725. Let r = -213.36 - n. Round r to the nearest integer. 10 Suppose -4s + 2n + 88934 = -0s, -44471 = -2s + 5n. Suppose -4v + 5431 = -s. Suppose v - 23516 = 2k. What is k rounded to the nearest one thousand? -8000 Suppose 0 = -25v - 103 - 1172. Let u be 12/102 + 103989006/v. What is u rounded to the nearest 1000000? -2000000 Let d be 50/14 + 12/(-21). Suppose b + w + 0w = -35, -db - w - 97 = 0. Let f = b + 21. Round f to the nearest 100. 0 Let p = -4270 + 4270.05081. What is p rounded to 2 dps? 0.05 Let t = 9643.071853 + -9643. What is t rounded to 3 dps? 0.072 Let v = 0.103 - 0.024. Let d = v + 1.701. Let r = d + -1.77769. What is r rounded to four decimal places? 0.0023 Let a = -0.400243 - -0.051953. Round a to three dps. -0.348 Suppose 0 = -7t + 13083 + 23779. Let u = -5946 - t. Let f = u + 41212. Round f to the nearest 10000. 30000 Suppose 12k + 185220 = -153960. Round k to the nearest one thousand. -28000 Let j = 0.032563 - -0.434617. What is j rounded to three dps? 0.467 Let i = -661 - -663.99. Let w = i - 3.0345. Round w to two dps. -0.04 Let n = -896.863 - 2.137. Let l = n + 803.6. What is l rounded to the nearest 100? -100 Suppose -2g + 29556 = -2m, -3g + 14264 = -5m - 30070. Suppose 9 - 5 = 4u, 0 = -2o - 2u - g. What is o rounded to the nearest 100? -7400 Let w = -1783.94012 - -1784. Let f = 146.941 - 147. Let d = w + f. Round d to four dps. 0.0009 Let j = 75.753 + -0.113. Round j to the nearest 10. 80 Let s(b) = -b. Let f be s(-5). Suppose 4j + fd = 29430, 9j + 36804 = 14j - 2d. Round j to the nearest 1000. 7000 Let l = -248 - 227. Let v = -204 - l. Suppose 453 = -4r - v. What is r rounded to the nearest 10? -180 Let w = 5.92 - -408.08. Let a = 414.0000009 - w. What is a rounded to six decimal places? 0.000001 Suppose -3o + 4960 = -4s, -19o + 6635 = -15o - s. Round o to the nearest 100. 1700 Let w be 1844/6(-2142)/(-14). Let x = 107022 - w. Round x to the nearest 1000000. 0 Suppose -21i + 2v = -17i + 273004, -3i + 2v - 204750 = 0. Round i to the nearest 100. -68300 Let b = -7078.7439 + 7078. Round b to 0 dps. -1 Suppose n - 28 = -3n + 2l, -l = 5n - 21. Suppose -nk + 8k - 7346889 = 0. Suppose -3751037 - k = 2*a. Round a to the nearest 1000000. -3000000 Let t = -16224.549 - -16232. Round t to 1 dp. 7.5 Let p = 13851 + -13871.624. Round p to 1 dp. -20.6 Let g = 27407758597.2 - 27407754212.200002999. Let k = g - 4385.	{ "pile_set_name": "DM Mathematics" }
6) - (sqrt(156)-1 + sqrt(156)))))/((6sqrt(144)1)/(sqrt(432) - (sqrt(432) - 1sqrt(432)))). 10sqrt(13) Simplify -3 + (sqrt(65) - 5sqrt(65)-2)/((sqrt(120)/sqrt(4))/sqrt(6))-1 + 2 + 5 + 2. -11sqrt(13) + 6 Simplify (sqrt(40)/(1sqrt(10)-1))/(sqrt(72) - (sqrt(128) + (sqrt(128)2 - sqrt(128)) + sqrt(128))). sqrt(2)/18 Simplify (2sqrt(1216)-5 + sqrt(1216) + (2 + sqrt(1216) - sqrt(1216))4)2 + 4 + (sqrt(1216) - (-3 + sqrt(1216)2)) + -2. -1160sqrt(19) + 98565 Simplify (-1 + 3 + -5 + 0 + sqrt(76) + -3(sqrt(76) + (sqrt(76) + (sqrt(76) - (1sqrt(76) + sqrt(76))) + sqrt(76) - sqrt(76)) + 1) + -1)2. 56sqrt(19) + 353 Simplify ((sqrt(1008) - (-3 + sqrt(1008) + sqrt(1008))3) + 5)2 + (-1(-4sqrt(28) - sqrt(672)/sqrt(6)))2. -1680sqrt(7) + 26404 Simplify -2 + ((1(2 + (sqrt(175) - (1 + sqrt(175))) + sqrt(175) - sqrt(175) - sqrt(175)) + -2sqrt(175)6 + 3)5)*2. -13000sqrt(7) + 739773 Simplify (sqrt(225)3-14)/(5-4sqrt(180)5). 3sqrt(5)/50 Simplify (sqrt(768) - 3sqrt(768)4 - -3-3sqrt(768))/((sqrt(36)-34)/(sqrt(9) + sqrt(81)/(sqrt(54)/sqrt(6)))). 80sqrt(3)/3 Simplify (sqrt(49)-23 + sqrt(49))/(sqrt(56)/(sqrt(128) - sqrt(8))) + (sqrt(77)/(3sqrt(11)) - (6sqrt(28))*2) + -1. -1009 - 44sqrt(7)/3 Simplify (-5(5(sqrt(539) + (1sqrt(539) - sqrt(539)) - sqrt(539))1 + sqrt(539) + sqrt(539)2-3 + sqrt(539) + 0 + sqrt(539)-2)4)*2. 7761600 Simplify ((sqrt(5) - 5(sqrt(5) - sqrt(20) - sqrt(5))) + sqrt(5) + sqrt(15)/sqrt(3)-2)-1 + 2 + (sqrt(200)/(-2sqrt(10)))/(sqrt(24)/(sqrt(12)/sqrt(2))). -21sqrt(5)/2 + 2 Simplify ((5sqrt(210))/sqrt(7) - (sqrt(30) + sqrt(2430)-4))/(((2sqrt(168))/sqrt(4))/(sqrt(63)/(sqrt(18)/sqrt(2)))). 20sqrt(5) Simplify ((5sqrt(882)2)/(sqrt(6) - (sqrt(6) + sqrt(48)/sqrt(128) + sqrt(6)) - 51sqrt(6)))*252. 18816/5 Simplify ((sqrt(72)/sqrt(9) - sqrt(18)/(sqrt(9)-2))5 + 2 + (-11sqrt(242) - sqrt(242)) + sqrt(242))2-6. -51 - 36sqrt(2) Simplify (-4-2(sqrt(104) + sqrt(104)2 + sqrt(104) - sqrt(104))-4)/(-1sqrt(800) + (sqrt(8) - 3sqrt(968))). 16sqrt(13)/7 Simplify (-2((sqrt(3024) - (sqrt(3024)1 - sqrt(3024))) + sqrt(3024))-2)/(-3-2sqrt(112)4)-4. -4sqrt(3) Simplify (((sqrt(250) - (sqrt(250) - (-1sqrt(250) - sqrt(250)))-1)/(sqrt(20)/(sqrt(4)/sqrt(2))))/((sqrt(800)1)/(2sqrt(1210))))*2. 2420 Simplify (-4(sqrt(136) + (-2sqrt(136) - sqrt(136))) + (-1-2sqrt(136) - sqrt(136)))/(sqrt(392) - (-3sqrt(392)2 - sqrt(392))) + -5. -5 + 9sqrt(17)/56 Simplify 1 + 4 + 3 + (3(5 + sqrt(500) + 5(sqrt(500) + -1) + 0))*2. 162008 Simplify ((sqrt(66) - (sqrt(66) - (sqrt(66)-6 + sqrt(66) - sqrt(66)))4 - sqrt(66)1-3)/((sqrt(450)6)/(sqrt(15)/sqrt(5)1)))2. 176/25 Simplify ((sqrt(234)-5-4)/sqrt(6))/((-1sqrt(9))/sqrt(3)-6). 10sqrt(13)/3 Simplify (-6(sqrt(17) - sqrt(34)/sqrt(2))2 - (sqrt(272) + 1)) + 4 - (sqrt(153)/sqrt(9) + -1 - ((sqrt(17) - sqrt(17)2) + 4)). -6sqrt(17) + 8 Simplify (-4(-5((sqrt(99) - 1sqrt(99)) + sqrt(99)) - sqrt(99)))/((sqrt(81) - 4(sqrt(81) - 5sqrt(81)))/sqrt(9)). 24sqrt(11)/17 Simplify (-4 + (sqrt(1331) - (sqrt(1331) + 1)))2-1 + ((-6-2sqrt(99))/(sqrt(9) + (2sqrt(45))/sqrt(5) + sqrt(9)))2. 74 Simplify ((sqrt(28)3)/sqrt(7))/((sqrt(2) + sqrt(98))5) + ((sqrt(192)/sqrt(6))/sqrt(4))/(sqrt(484) - (sqrt(484) + sqrt(484)3)). 59sqrt(2)/1320 Simplify (sqrt(22)/(sqrt(2) - sqrt(162)) - sqrt(11) - sqrt(77)/(sqrt(7) + -4sqrt(7) + sqrt(7)))*2 + -1 + sqrt(176) + 5 + 3. 723/64 + 4sqrt(11) Simplify (-1(2 + ((sqrt(108) + sqrt(108) + sqrt(108)-1)/sqrt(9))/(5(sqrt(54)/sqrt(9) + sqrt(6) - sqrt(6)))))2. 4sqrt(2)/5 + 102/25 Simplify ((sqrt(245) + 1-1sqrt(245))/(sqrt(84)/(sqrt(36)/sqrt(3))))/(-1(sqrt(847) + sqrt(847)-3)4). 0 Simplify (32(6sqrt(84) - sqrt(84)))/(sqrt(132)/(sqrt(11) + sqrt(33)/(sqrt(36)/sqrt(12)))). 60sqrt(7) Simplify (-3(5 + (5 + sqrt(9)/sqrt(3) - sqrt(3))) + -44sqrt(3) + sqrt(15)/sqrt(5) + -5)*2. 1050sqrt(3) + 1900 Simplify (((sqrt(364)-3 - sqrt(364))/sqrt(7) - ((5sqrt(104) - sqrt(104)) + sqrt(104) + sqrt(104))/sqrt(2))/((sqrt(8)/sqrt(2)3 + sqrt(4))-66))2. 325/5184 Simplify (62sqrt(85))/(2sqrt(500)) + -4((2 + sqrt(833))2 + 0 + sqrt(17) + 2). -3356 - 577sqrt(17)/5 Simplify 2 + ((-2sqrt(20)/sqrt(4) - sqrt(15)/(sqrt(3)2))3 - (sqrt(125) + 0 + (sqrt(605)-5 - sqrt(605)))). 2 + 107sqrt(5)/2 Simplify 1 + ((sqrt(147) + -4sqrt(147))*2 - sqrt(21)/(sqrt(7) + sqrt(700)) - 2((sqrt(432)-1 - sqrt(432)) + sqrt(18)/(sqrt(30)/sqrt(5)))). 505sqrt(3)/11 + 1324 Simplify ((-3sqrt(39)2 - 3sqrt(975))-2)/((-2sqrt(81) - sqrt(81))/(sqrt(3) - sqrt(9)/sqrt(48))). -7sqrt(13)/2 Simplify (((-3 + sqrt(405))3 - (sqrt(45)/sqrt(81) - 2sqrt(5)-4)) + -2)22. -2464sqrt(5)/3 + 33538/9 Simplify -6(6((4 + sqrt(1300))-3 + 1 + -5 + sqrt(1300)4 + sqrt(1300) + 2))2. -1165536 + 120960sqrt(13) Simplify (((sqrt(88) + 2sqrt(88))-2)/(sqrt(8) + sqrt(16)/sqrt(2)-4)1 + 3 + -5)-5. -10sqrt(11) + 10 Simplify sqrt(63)-2 + sqrt(7) + (6sqrt(112))*2 - (sqrt(42) + sqrt(84)/(sqrt(8)/sqrt(4)))/((sqrt(6)2 + sqrt(6))-1). -13sqrt(7)/3 + 4032 Simplify (-6sqrt(216)/(sqrt(81) - sqrt(9))-5)/((sqrt(72) + sqrt(72)-1)/sqrt(9) + (sqrt(24)/sqrt(3)6 - sqrt(8))). 3sqrt(3) Simplify 4 + (sqrt(78) - -21sqrt(78) - sqrt(78))/sqrt(6) + 3 - ((3sqrt(1053)2)2 - sqrt(1053) - ((sqrt(1053) + sqrt(1053)-1)*2 - sqrt(1053))4). -37901 - 25sqrt(13) Simplify 3(-4 + 3 + 4 + -45(sqrt(832) + -4))*2. -79680sqrt(13) + 1019067 Simplify -4((3-1(3 + sqrt(175) + (1sqrt(175) - sqrt(175)) + -2)3)2 + -1). -57020 - 3240sqrt(7) Simplify (6(5 + -1(-3sqrt(800) - sqrt(800))) + 0)2 + 2 + -5. 28800sqrt(2) + 461697 Simplify ((-3-16-1sqrt(136))/(1((sqrt(64)2 + sqrt(64))4)/sqrt(8)))2. 153/4 Simplify sqrt(176)-4-6 + (sqrt(176) - sqrt(176)-5)4 - 4(-1 + sqrt(176))*226. -8496 + 576sqrt(11) Simplify ((sqrt(275) + 1sqrt(275)-1)/(sqrt(5) - (-2sqrt(50))/sqrt(10)))/((sqrt(99) + sqrt(99)-2 - sqrt(99))1-4) + -3. -3 Simplify ((5 + (sqrt(288) - (sqrt(288)-2 + 4)) - -2sqrt(288)-2-6) + -5 + 3)*2. -648sqrt(2) + 209953 Simplify (sqrt(208) - (sqrt(208) + 5))2 + sqrt(13) + (sqrt(208) + -3)2 - ((sqrt(26)/(sqrt(2)2)-4)*2 + 5). -23sqrt(13) + 185 Simplify -1 + 1((sqrt(3328) - 6(sqrt(3328) + -1)) + -4 + sqrt(832)2 + sqrt(832))2. -224sqrt(13) + 40771 Simplify 3(0 + (1sqrt(304)-2)2-3)-6. 65664 Simplify ((22(sqrt(125) + (sqrt(125) - (-1-1sqrt(125) + sqrt(125)) - sqrt(125)))6 + 1)-4)2. -3840sqrt(5) + 1152016 Simplify (-3(sqrt(192) + sqrt(192)4 - sqrt(192))6)/((sqrt(56)/sqrt(252))/sqrt(2)). -1728sqrt(3) Simplify ((sqrt(468) + sqrt(468) + (1 + sqrt(468))1 + sqrt(468) + -4)2 + 3)*2 + -2 + -4. -288sqrt(13) + 29955 Simplify (((-1sqrt(1029) - sqrt(1029)) + sqrt(168)/(sqrt(24)/sqrt(3)))5)/(2(sqrt(288)/(sqrt(8)-1))/sqrt(12)). 65sqrt(7)/2 Simplify (sqrt(144) + -2sqrt(144) + (sqrt(324) - (sqrt(324) + sqrt(324) + -1sqrt(324))))/((sqrt(24)/sqrt(2)1 + sqrt(12))/(sqrt(4) - 2(sqrt(4) - sqrt(16)))). -6sqrt(3) Simplify (-3 + (sqrt(135)/(-2sqrt(5)) - sqrt(27) - (sqrt(27) - (sqrt(27) + sqrt(81)/sqrt(3)-6))2 - (sqrt(27) - (-1 + sqrt(27) + (5 + sqrt(27))2))-4))-1. 249sqrt(3)/2 + 1179 Simplify 3 + (-44sqrt(448) + 2 + -1sqrt(448)6 + 6(-1sqrt(448) + sqrt(448)))2-4. -867341 + 2816sqrt(7) Simplify ((sqrt(84) - sqrt(84)2 - sqrt(84))3 + (-2sqrt(84)-1 - sqrt(84)) + sqrt(84))/(-1sqrt(12) - (sqrt(3) + 2sqrt(12))). 8sqrt(7)/7 Simplify (1 + 3 + (2 + (sqrt(343) - -1sqrt(343)) - 6(1 + sqrt(343)))-3 + -1)2. 2520sqrt(7) + 49617 Simplify -6(-5(sqrt(187) + (-1sqrt(187) - sqrt(187))-6)5)/(62-1sqrt(11)2). -325sqrt(17)/4 Simplify 1(sqrt(936)2-5)/(3sqrt(18)/sqrt(36)). -40sqrt(13) Simplify (((sqrt(5040) - (sqrt(5040) + 1sqrt(5040) + sqrt(5040)) - -5(sqrt(140)/sqrt(4) - sqrt(35)))-6)/(2sqrt(343) + sqrt(70)/(sqrt(70)/sqrt(7))))2-3. -6912/5 Simplify 1 + (sqrt(180) + -6(1 + sqrt(180)) - (sqrt(180) + -2(sqrt(180) + 0)))*2 + (5(sqrt(180) + 0)-1)2 + 3. 288sqrt(5) + 7420 Simplify (1(sqrt(3024) - 1sqrt(3024)) - (sqrt(3024) + -1sqrt(3024)-6 + sqrt(3024)))/(((sqrt(27)/sqrt(3))/sqrt(3) + sqrt(300)2)-5). 32sqrt(7)/35 Simplify (-5 + sqrt(425)-1 - (3sqrt(425) + sqrt(425) + -2) - (-5(sqrt(425)	{ "pile_set_name": "DM Mathematics" }
q)q/(q2q)q(3/2)/q assuming q is positive. q(-9/10) Simplify (i/(i/(ii((ii*(-3)i)/i)/i)))*(-2/113)(i(-4))(2/129) assuming i is positive. i(-646/14577) Simplify m(-21)/m*(2/41)m*(8/5)m(-15) assuming m is positive. m(-7062/205) Simplify ((f*12f)(-9/7))(-2/15) assuming f is positive. f(78/35) Simplify (((i(2/5)/i)/i)/i)*(-31)ii17i/(((((i/(i*17/i))/i)/i)/ii)/iii) assuming i is positive. i*(578/5) Simplify (((vv*(-1/15)v)/(v*(-2)v))(3/7))(-1/8) assuming v is positive. v(-11/70) Simplify ((o1)38/(o(-2)o)31)41 assuming o is positive. o2829 Simplify ((l/l(3/7))43)(-7/2) assuming l is positive. l(-86) Simplify (r(-1))(1/16)r(-2/17)/(r(4/7)/r) assuming r is positive. r*(473/1904) Simplify (fff(-5/2))(-27)/(f(-1/8)/f29) assuming f is positive. f(341/8) Simplify (xx/(xx(-2/9)))25/(x(3/16)/x(9/2)) assuming x is positive. x(5021/144) Simplify (z(-9))(18/5)(z/z(-4))19 assuming z is positive. z(313/5) Simplify c/(c/(c(-4/11)c))c(cc((cc*(1/17))/c)/ccc)/c((c/c*8)/ccc)/c17 assuming c is positive. c(-3610/187) Simplify r(-7/3)/r(-4/7)((r/(rr(1/3)))/r)(9/5) assuming r is positive. r(-437/105) Simplify (l/l7l(ll(l(l/(l/l*(-3)))/lll)/ll)/l)/(l5/(l/((l/(((l/(l/(l/(l/l(-2/3))ll)l)l)/ll)/l))/ll))) assuming l is positive. l*(-29/3) Simplify ((ppp12p)/pp(-7)p)/(p*(3/8)(p/(p/p*(5/2)))/pp) assuming p is positive. p(41/8) Simplify u(1/9)/u*11u*0((u/(uu(u*(-11)/u)/uu))/u)/u assuming u is positive. u*(-17/9) Simplify (j/(jj10))/(j(-6/11)j)((j/((jj(-2/65)/j)/j))/j)/(jj(-2/25)) assuming j is positive. j(-36979/3575) Simplify (d(-10)/d10)/((d*14/dd)/d0) assuming d is positive. d(-34) Simplify (bb(2/57)b)*(1/5)bb16bb(-18) assuming b is positive. b(116/285) Simplify (g(-4))7(gg(1/2)g)(-42) assuming g is positive. g(-133) Simplify (s*22s(2/41))/((s/(s(-2/21)/s)s)/s)37 assuming s is positive. s(-47764/861) Simplify (i/i(3/7)i)(-36)/(i(1/12)/iii18) assuming i is positive. i(-6271/84) Simplify ((h/(hh/(h/(h/(((h/(hh*(-7)h))/h)/hh))h)))/hhhh(-1/2))/((hh8)/h15) assuming h is positive. h(23/2) Simplify ((h4/h)/h)*(-2/27)h*(3/17)hhh*8h assuming h is positive. h(5062/459) Simplify (o(-2/3))(3/23)/(o/(o4/o))(-2/73) assuming o is positive. o(-238/1679) Simplify ss/s(-17)ss0(((s/((s/(ss(-18/11)s)s)/s))/ss)/s)/(ss(-25)/s) assuming s is positive. s(488/11) Simplify p/(p(-1/10)/p)p/(pp(p/(pp/p(6/7)p)p)/p)(p(-6))(11/6) assuming p is positive. p*(-613/70) Simplify ((d/(dd0))(-7)(d/(d/d0))(2/5))(-2/51) assuming d is positive. 1 Simplify ((o/((o/(o/(((ooo(2/43)/o)/oo)/o)))/o))/(oo/(oo/(o*(15/4)/o)o)))/(oo/(o/(((o19/o)/o)/o))o(-3)) assuming o is positive. o(-2373/172) Simplify ((l/(l*(-8/7)/l)l)/((l/l*13)/ll))(-7) assuming l is positive. l(-113) Simplify ((a/a*(-2/13)a/a*(-6))/(a(aa(-3)a)/aa)1)(3/20) assuming a is positive. a(159/130) Simplify r(-8)(rr(-2/27))/r((r/(r*(2/5)rr))/r)(-25/2) assuming r is positive. r(592/27) Simplify i24/(iiiii(3/4)ii)(ii(-11))/i(-2) assuming i is positive. i(37/4) Simplify (i(-23)ii(4/13))(-15) assuming i is positive. i(4230/13) Simplify ((((q/(q/q(-1/2))q)/q)5)(-5/2))(-33) assuming q is positive. q(-825/4) Simplify (p(-1/6))(-8/7)/(ppp(-2))(-21) assuming p is positive. p(4/21) Simplify a2/(((a/(aa(2/7)))/a)/a)(a*(-1/7)a)33 assuming a is positive. a(228/7) Simplify m/(m*(-20)m)m1m*(1/16)m(-8/9) assuming m is positive. m(2905/144) Simplify ((ii(8/7))(-49))(-3/2) assuming i is positive. i(315/2) Simplify (a/(aa/(aa/(((a/a9a)/a)/a))))*(19/2)((aaaa/((aa*8)/a)a)/a)14 assuming a is positive. a39 Simplify (n/(n/n(7/5)))(3/2)(n(-30)/n)/((n/n15nn)/n) assuming n is positive. n(-159/10) Simplify ((i/i(1/3))/i)(2/25)(i/(i*6/i)ii)(-7/5) assuming i is positive. i(208/75) Simplify ((z2)(-41)(z/(z*(-1/9)z))/z1)35 assuming z is positive. z(-26110/9) Simplify (h/(h/h(-19))h(-3/7)/h)(-7/4) assuming h is positive. h(143/4) Simplify (xx3)(4/13)/((xx/((x/(x6x))/x))/x)(-5) assuming x is positive. x(536/13) Simplify ((w/(w/((www*(-1))/w))w1/w)/(w/w(-3/7)www(-6)))(3/35) assuming w is positive. w(54/245) Simplify (v(2/23)/(vv/(v*(6/13)v)))/(v*(-7)v(1/2)) assuming v is positive. v(3617/598) Simplify (dd5)18((d/(d*0d))/d)(-1/16) assuming d is positive. d(1729/16) Simplify c*(-3/2)/(c/(c/((c/(cc*9))/c)))c*(-1/24)(c*7c)/c assuming c is positive. c(371/24) Simplify (((t(-5)/tt)(1/57))(-35))38 assuming t is positive. t(350/3) Simplify m(7/4)mm(2/3)mmm*(-2/7)m(mm/m17)/m assuming m is positive. m(-829/84) Simplify ((((k/(k*1/k))/kk)(-5/14))(2/9))14 assuming k is positive. k(-10/9) Simplify ((a*(-2/7)a)/aa/a9)/(a(4/3)/aa)(-17) assuming a is positive. a(302/21) Simplify (r/(r(-1/2)/r))(-2/89)r(1/8)/(r/r7) assuming r is positive. r(4321/712) Simplify ((c5c/c*(4/7))/((cc*(1/2)cc)/c)(-1/17))(-41) assuming c is positive. c(-54407/238) Simplify (l(2/9))(-11/8)/(l(-2/5)/l)(-37) assuming l is positive. l(-9379/180) Simplify (b(-10/3)/b(-1/5))/(b/((b(1/10)/b)/b))(-42) assuming b is positive. b(356/3) Simplify (((w/w(-1/3))/(ww*9/ww))/(((w/w(-2/9))/w)/((w/(w(3/4)w))/ww)))(-3/4) assuming w is positive. w(347/48) Simplify (aa(-19)/aaa/(aa/(a*(-3/7)/a)a))/(a*20aaa*(-15)a) assuming a is positive. a(-206/7) Simplify (j9j/(j(4/9)j)jj)/(((j(((jj*20)/j)/j)/j)/j)/(jj/j(-7/3))) assuming j is positive. j(-28/9) Simplify (x*(-1/9)x*(-1/12)xxxx(-3)x((x(x/(xxxxxx1/xx))/x)/xx)/x)38 assuming x is positive. x(-3553/18) Simplify (h(h*0h)/h)*(-34)h/((h/((h*(-7)h)/h))/h)h(-6) assuming h is positive. h(-46) Simplify (((((vv*(-16)v)/v)/v)/vv)(-10))(-2/9) assuming v is positive. v(-320/9) Simplify ((ww/((w(w/w3)/w)/w)ww)/w)12(w(-3))(-7/3) assuming w is positive. w79 Simplify (x/(x/x8xx)x(-20/7))6 assuming x is positive. x(132/7) Simplify (aa/(aa(-12))aa(-4)a)/((a/a(-11/4))/(a13a)) assuming a is positive. a(85/4) Simplify ((zz*1/zz)/zz/z10)/((z/(z/z14))/(z/(z/z(-4/11)))) assuming z is positive. z(-246/11) Simplify ((rr*(-2/7)r*(-1/6))/((rr/(rr(1/5)/rrr))/(r/((rrrr/(r*(-2/3)r)r)/r))))(-34) assuming r is positive. r(6851/105) Simplify ((s(1/4)/s)(-20)(s(1/4))(2/23))(1/42) assuming s is positive. s(691/1932) Simplify ((aa/(a/((aa(aa(-24))/a)/a)))/a(-14))/(aa(2/9))15 assuming a is positive. a(-79/3) Simplify (xx*(-1/12)x)/(xx0)(xxx*(-2/17))/(x/(xx/(xxxx6x)xx)) assuming x is positive. x(-857/204) Simplify ((y(-1/3)y(-2)/y)/(yy/y1)(-1/4))26 assuming y is positive. y(-481/6) Simplify (d/(d/(d(d/(d13/d))/d)))/d(3/7)d*(-8/5)/dd/(dd(-8/7)) assuming d is positive. d(-451/35) Simplify (((n(1/3)/nn)/n)*27/((n/(nn1))/n)28)6 assuming n is positive. n228 Simplify (c/(c(c(-10)c)/c))*(1/44)(c/(c/c*(-2)c))(-13/6) assuming c is positive. c(74/11) Simplify u*(-7/5)uuu*(1/13)(uu(-3))(10/9) assuming u is positive. u(-904/585) Simplify m(17/5)/m(-2/57)m*(-1/2)(m/(m*(-12/5)m))/m assuming m is positive. m(2471/570) Simplify r/r(-2/85)rr*12/r(rrr8)(-4/21) assuming r is positive. r*(19847/1785) Simplify (oo(-1/18))(4/13)(o/((o/((o/o19)/o))/o))(-40) assuming o is positive. o(84274/117) Simplify (f(-7)f)42/((f15f)/(f(5/4)f)) assuming f is positive. f(-1063/4) Simplify ((l(1/2))(-32)/(l0)1)(-1/9) assuming l is positive. l(16/9) Simplify ((b/(b/b(2/13)))/(bb(2/7)b)(b/(((b/b(2/13))/bb)/b))/(bbb2))(-15) assuming b is positive. b(6795/91) Simplify (a4aa/(a/((a/((a/(aa(2/5))a)/a)*a)/a)))/	{ "pile_set_name": "DM Mathematics" }
7? 7 Which is bigger: -22256 or -5? -5 Which is greater: -1722171 or -2? -2 Which is bigger: -3 or -2401/800? -3 Are 1416 and 571 equal? False Which is bigger: -1805/9 or -200? -200 Is 1047287 smaller than 1047290? True Which is smaller: -125 or -2831/7? -2831/7 Which is bigger: 47 or 4612/97? 4612/97 Which is smaller: 10 or 541/50? 10 Do 174.3 and 492 have the same value? False Is -1454 less than or equal to -535? True Is -1 smaller than 8/267121? True Is -767 bigger than 50? False Is 26 != 48018? True Which is bigger: 1/120 or -0.016? 1/120 Which is smaller: 0 or 772? 0 Is 107465 greater than or equal to 107464? True Which is smaller: -799 or -807? -807 Which is greater: 2/7 or 5182? 5182 Is -1642 greater than or equal to -1632? False Is -1 bigger than -1/580900? False Is -0.22 > 2133? False Which is greater: 19 or -52/133? 19 Is 91 less than -150? False Is -272336 bigger than -272336? False Is 1388 smaller than 1043? False Which is smaller: -3/152 or -0.0994? -0.0994 Which is smaller: 11 or 25145? 11 Which is greater: 272/19 or 0? 272/19 Which is greater: 3/116005 or -1? 3/116005 Which is smaller: 0 or -33.9062? -33.9062 Is -72/1889 < -1? False Is 10082 >= 10089? False Which is greater: 7/60330 or 0? 7/60330 Which is smaller: -85275/97 or -880? -880 Which is smaller: 44410 or 177637/4? 177637/4 Which is greater: 4261 or 4259? 4261 Which is smaller: -2217.9 or 2/7? -2217.9 Which is smaller: -3230 or -119483/37? -3230 Is -1 greater than 90/341891? False Which is bigger: -2195052 or -2195054? -2195052 Which is smaller: 0 or 86/33723? 0 Which is smaller: 506764 or 506768? 506764 Which is bigger: -323 or 29? 29 Does 0 = 2476/3007? False Is 192313 > 192311? True Is -1/4715472 at least 1? False Is -30 > -2709/89? True Is -300162 not equal to -300162? False Which is smaller: -47/5926 or 0? -47/5926 Are 174 and 146 non-equal? True Which is bigger: 497 or 3153? 3153 Which is bigger: -0.091453 or -3? -0.091453 Which is smaller: 11/3148 or 1? 11/3148 Which is smaller: -847/4854 or -1? -1 Which is greater: -126 or -584? -126 Is -168 < -1.65? True Which is smaller: -1 or -2/911561? -1 Is 0 greater than or equal to -234678/11? True Which is bigger: -8/375 or -29? -8/375 Which is bigger: 1588 or 57? 1588 Is 5365 <= 5352? False Is 1783 at least 2171? False Is -107843 >= -107839? False Are 29030 and 29029 equal? False Which is greater: -772/9 or -87? -772/9 Is 79961 greater than 79964? False Which is bigger: 6014.1 or 5/2? 6014.1 Which is smaller: -5349 or -5366? -5366 Which is bigger: 2/113 or 7/39? 7/39 Which is greater: 178 or 17263/97? 178 Which is bigger: -42 or 12/35? 12/35 Does -1200408/13 = -92339? False Which is smaller: -544704/11 or -49518? -544704/11 Which is smaller: -24264 or 29? -24264 Which is smaller: 15/49552 or 1? 15/49552 Is -108645/8 at most -13580? True Which is greater: 0.2 or 904016? 904016 Is 0 at least as big as -1/2135094? True Which is smaller: 28/341 or 10? 28/341 Which is smaller: -5312/79 or -68? -68 Is 16178 > 16173? True Do 1 and -0.0460463 have the same value? False Is -101859 less than or equal to -101859? True Is -156427 bigger than -156435? True Which is smaller: 141 or -0.1556? -0.1556 Is 93 smaller than 236? True Which is smaller: -105378 or -105374? -105378 Which is greater: 172/9413 or -1? 172/9413 Which is smaller: 2/29167 or 2? 2/29167 Which is bigger: -105761 or -105762? -105761 Is -308 smaller than -436? False Which is bigger: -12308/3 or -4103? -12308/3 Is 536990 > 2? True Is -151384 <= -3? True Which is smaller: -483 or -209? -483 Which is bigger: -168 or -1525/9? -168 Which is greater: -7/13756 or 0? 0 Which is bigger: 860203 or 860206? 860206 Does 1172/11797 = 1? False Is 0 less than or equal to 155/11348? True Which is smaller: -939/86 or -11? -11 Are -1/4100144 and 0 nonequal? True Which is smaller: 383918 or 383915? 383915 Is -65273 equal to -65275? False Which is bigger: 3192/367 or 8? 3192/367 Is -53501 > -53501? False Is 172306/9 bigger than 19144? True Which is smaller: 0.5 or -2018? -2018 Is 1 greater than 18/3793? True Is -113589 smaller than -1249492/11? False Do -845/8 and 1201 have the same value? False Which is smaller: 67/2944 or 0? 0 Is -143 > 161? False Which is bigger: -329862/11 or -29986? -29986 Which is bigger: 0.1 or 0.86316? 0.86316 Are -1 and 2583/11678 nonequal? True Is 4/1297373 < 0? False Is -18379 > -18408? True Is 1/1014 equal to -285? False Which is smaller: 4685 or 4737? 4685 Is -2/77 <= -5113? False Which is greater: -22723 or -22721? -22721 Is 78 at most 31.38? False Which is bigger: 37332 or 186667/5? 186667/5 Which is smaller: 14 or -3/947? -3/947 Is 1 less than 1964/4189? False Are -2728448 and -2728449 equal? False Which is smaller: -0.1 or -202627? -202627 Is 241/639 less than 0? False Is 640 greater than -1/8? True Are -123300 and -123301 equal? False Which is smaller: -1/4 or -114100? -114100 Which is greater: 12311 or 31? 12311 Is -127320/29 >= -4391? True Which is smaller: 5946521/4 or 1486631? 5946521/4 Is -1.3 at most as big as -1/270? True Does 566 = 213? False Which is bigger: -2/4621673 or -1? -2/4621673 Which is smaller: -0.51 or 56383? -0.51 Which is smaller: 1676 or 1683? 1676 Which is smaller: -1039.69 or 0.25? -1039.69 Which is smaller: 8399 or 8396? 8396 Is 6992 >= 20978/3? False Which is smaller: 430 or 2151/5? 430 Is -932 > -946? True Is 61608 smaller than 61586? False Does -21801 = -21913? False Which is greater: 25953 or 25954? 25954 Which is smaller: -2 or -630/257? -630/257 Which is greater: -2 or -976/1819? -976/1819 Which is smaller: 1214 or 57035/47? 57035/47 Is -30 > 5390? False Does -0.23 = -75830? False Which is greater: 0 or -1/30375? 0 Which is smaller: 44113 or 44109? 44109 Is -3176 at least as big as -3174? False Which is smaller: -29 or 917? -29 Is -52197 less than -52197? False Which is smaller: -3463 or 581? -3463 Which is smaller: -1 or 152/5341? -1 Do -105 and -2125 have the same value? False Is 51315 less than or equal to 51314? False Which is smaller: -1 or -5/1768? -1 Which is greater: 16/623183 or -1? 16/623183 Which is greater: 1 or 2/18919? 1 Is -1 < -1472.461? False Is 1 greater than 669459? False Is 4849148 greater than or equal to 4849147? True Is -165 less than or equal to 434? True Which is greater: -8547 or -8544? -8544 Is -113460 <= -113460? True Which is smaller: -2712 or -13554/5? -2712 Are -389 and -291 unequal? True Is 61611 bigger than 1/31? True Is 1/4 at most 0.47468? True Which is smaller: 1 or -219/7784? -219/7784 Which is bigger: 108811/21 or 5182? 5182 Which is smaller: 22644 or 2? 2 Is 1 at most 43.086? True Is 7938 not equal to 7768? True Which is bigger: 113696/5 or 22739? 113696/5 Which is bigger: 3847 or 4002? 4002 Does -394684 = -394684? True Are -1003520 and -1003521 non-equal? True Is 2/37 greater than or equal to -2063? True Which is bigger: 653850 or 2? 653850 Which is greater: 209025 or 209024? 209025 Are 1 and -2/666999 nonequal? True Which is smaller: 2/8977 or 1? 2/8977 Which is smaller: -454 or -465? -465 Which is smaller: 193 or -2259? -2259 Which is bigger: -3/53 or 2/359? 2/359 Which is smaller: 0 or -765/7012? -765/7012 Do -1 and -4/302939 have different values? True Do -5519 and 66 have different values? True Are 12599 and 0.6 unequal? True Is 81 less than 2/3171? False Which is smaller: -1 or -312/419? -1 Which is bigger: -1 or 635/1637? 635/1637 Which is smaller: -248268 or -248267? -248268 Is -1 greater than or equal to -4/274407? False Which is smaller: 19/8729 or 0? 0 Which is bigger: 5.97 or -0.72? 5.97 Is -894 < -25920/29? True Is -938 bigger than -547? False Is -12456 equal to -12232? False Is -79110 less than -237329/3? True Which is smaller: -4 or -37897? -37897 Is 93 less than -1676? False Is -229 equal to -15372/67? False Is -95413 <= -1? True Is -290555 <= -290560? False Does -2/25 = 6349? False Is -15 less than -1011? False Are -418 and -14167/34 unequal? True Is 7/4 != -22.085? True Which is smaller: -63520 or -63517? -63520 Is -158222 at least as big as 0? False Is -57462 <= -57462? True Which is greater: -1581/118 or -13? -13 Is -2 at most as big as 216869? True Are -27343 and -27343 unequal? False Is 417/457 bigger than 0? True Which is smaller: 3/13 or -8292/5? -8292/5 Ar	{ "pile_set_name": "DM Mathematics" }
of sequence ck when two letters picked without replacement from gkysgcckkgygysgyfsg. 1/57 Four letters picked without replacement from cddqdodddcocdcoqe. Give prob of sequence cdoq. 1/340 What is prob of sequence ol when two letters picked without replacement from {l: 4, o: 15}? 10/57 Two letters picked without replacement from {j: 1, i: 2, c: 4, r: 7, s: 3}. Give prob of sequence ii. 1/136 Three letters picked without replacement from {s: 7, l: 4}. Give prob of sequence lll. 4/165 Three letters picked without replacement from {v: 1, k: 1, e: 2, m: 1}. What is prob of sequence mve? 1/30 Two letters picked without replacement from nxaanywm. Give prob of sequence yx. 1/56 Four letters picked without replacement from dzsslzidllvildi. Give prob of sequence vdsz. 1/2730 Calculate prob of sequence nqno when four letters picked without replacement from {o: 6, n: 8, q: 3}. 3/170 Two letters picked without replacement from piypgduu. What is prob of sequence pp? 1/28 Calculate prob of sequence fls when three letters picked without replacement from {s: 6, f: 7, k: 4, l: 1}. 7/816 Four letters picked without replacement from cschchh. What is prob of sequence hchc? 3/70 Two letters picked without replacement from {d: 17, x: 1, q: 1}. Give prob of sequence dx. 17/342 What is prob of sequence uums when four letters picked without replacement from {n: 3, u: 5, m: 3, b: 1, s: 3}? 1/182 Four letters picked without replacement from {e: 18, n: 1}. Give prob of sequence neen. 0 Calculate prob of sequence bb when two letters picked without replacement from bbbbybbbbbbbbbbbyb. 40/51 Calculate prob of sequence aib when three letters picked without replacement from {i: 1, a: 16, b: 3}. 2/285 Two letters picked without replacement from {g: 7, x: 3, p: 1, c: 1}. Give prob of sequence xp. 1/44 Calculate prob of sequence ss when two letters picked without replacement from {b: 5, s: 4, c: 3, o: 7}. 2/57 Two letters picked without replacement from {j: 1, l: 5, g: 4, c: 4, t: 1}. Give prob of sequence jg. 2/105 Three letters picked without replacement from {b: 9, k: 9}. Give prob of sequence bbb. 7/68 Three letters picked without replacement from {h: 4, d: 10}. What is prob of sequence dhh? 5/91 Four letters picked without replacement from {c: 2, g: 2, t: 5, f: 8, n: 1}. Give prob of sequence fttn. 1/459 What is prob of sequence vvvv when four letters picked without replacement from vvvvvvvvvv? 1 Four letters picked without replacement from ccccgggggg. What is prob of sequence cccg? 1/35 Calculate prob of sequence qnnn when four letters picked without replacement from {q: 5, v: 4, n: 7}. 5/208 Four letters picked without replacement from {k: 14, d: 1, f: 5}. Give prob of sequence fffd. 1/1938 What is prob of sequence szn when three letters picked without replacement from jnnsvzjjsvjnnjvj? 1/420 Calculate prob of sequence xpg when three letters picked without replacement from xhpxgxpbbppxgghbhgg. 40/2907 What is prob of sequence jaji when four letters picked without replacement from {a: 2, j: 3, f: 1, p: 1, i: 3}? 1/140 What is prob of sequence rs when two letters picked without replacement from {r: 1, s: 2, d: 1, p: 1}? 1/10 Calculate prob of sequence sses when four letters picked without replacement from {e: 2, s: 2}. 0 Three letters picked without replacement from {z: 5, w: 14}. What is prob of sequence wzw? 455/2907 Three letters picked without replacement from {g: 5, e: 11}. What is prob of sequence ggg? 1/56 Calculate prob of sequence dnjd when four letters picked without replacement from {d: 5, j: 3, b: 3, k: 6, n: 1}. 1/1224 Calculate prob of sequence eeez when four letters picked without replacement from {e: 3, z: 1, n: 1}. 1/20 Calculate prob of sequence xnx when three letters picked without replacement from xxxzwxzazzwnzawnbza. 4/969 Three letters picked without replacement from ffffff. Give prob of sequence fff. 1 Four letters picked without replacement from typpbcbbxbyyyct. What is prob of sequence ycpc? 2/4095 What is prob of sequence oj when two letters picked without replacement from {q: 2, j: 8, o: 4, r: 3}? 2/17 What is prob of sequence sq when two letters picked without replacement from sssssqqsqsqqqqsqqs? 9/34 Calculate prob of sequence eecc when four letters picked without replacement from cccececccccecceccccc. 8/323 Four letters picked without replacement from pcspsspssasads. Give prob of sequence sadc. 1/1716 What is prob of sequence gg when two letters picked without replacement from {y: 1, v: 1, g: 2, l: 2, i: 1, n: 1}? 1/28 Two letters picked without replacement from {k: 1, p: 4, v: 8}. What is prob of sequence pp? 1/13 Calculate prob of sequence bmm when three letters picked without replacement from nnnnnnnnmnbbmn. 1/546 What is prob of sequence qc when two letters picked without replacement from {v: 2, j: 2, t: 1, c: 4, q: 1, f: 2}? 1/33 Three letters picked without replacement from {d: 5, j: 8, o: 4, f: 1}. What is prob of sequence ddf? 5/1224 Two letters picked without replacement from fxlollllvlllll. What is prob of sequence xl? 5/91 What is prob of sequence fifz when four letters picked without replacement from dmmfffnfnzfiz? 1/429 What is prob of sequence qqqq when four letters picked without replacement from qqqqqqq? 1 Calculate prob of sequence hh when two letters picked without replacement from {h: 4}. 1 Two letters picked without replacement from {m: 5, b: 1, d: 12, c: 1}. What is prob of sequence mm? 10/171 What is prob of sequence www when three letters picked without replacement from ywww? 1/4 Calculate prob of sequence yf when two letters picked without replacement from fyy. 1/3 Three letters picked without replacement from ggiiiigudigdii. Give prob of sequence igg. 1/26 Three letters picked without replacement from pphhuuhuhphhpphh. What is prob of sequence php? 1/21 Two letters picked without replacement from npjjnqfpjqpjpf. What is prob of sequence qj? 4/91 Two letters picked without replacement from {b: 3, j: 2}. What is prob of sequence jj? 1/10 What is prob of sequence osxx when four letters picked without replacement from {s: 2, z: 1, x: 3, o: 1}? 1/70 Three letters picked without replacement from bhbcbbcvnb. Give prob of sequence bvh. 1/144 Four letters picked without replacement from {x: 7, w: 9}. Give prob of sequence wxxw. 9/130 Four letters picked without replacement from fnfftnntntnftn. What is prob of sequence ntnt? 15/1001 Four letters picked without replacement from {q: 3, s: 2, y: 1, l: 2, x: 7, r: 5}. What is prob of sequence rrll? 1/2907 What is prob of sequence vpv when three letters picked without replacement from vvppvvfvvvppvvvvp? 55/408 Calculate prob of sequence hqhl when four letters picked without replacement from {c: 3, l: 6, q: 1, h: 5}. 1/273 What is prob of sequence bb when two letters picked without replacement from xoolooxblb? 1/45 Two letters picked without replacement from xxuuutui. What is prob of sequence xt? 1/28 Four letters picked without replacement from didd. Give prob of sequence didd. 1/4 Two letters picked without replacement from fffffmffffff. Give prob of sequence ff. 5/6 Calculate prob of sequence jjjo when four letters picked without replacement from jooojjjjjjj. 7/55 What is prob of sequence aa when two letters picked without replacement from {a: 7, m: 4}? 21/55 Three letters picked without replacement from {m: 2, l: 1, t: 2, b: 4}. Give prob of sequence btl. 1/63 Three letters picked without replacement from xsxffxfxxxsxxxxxsx. Give prob of sequence xxx. 55/204 Two letters picked without replacement from jjdmj. What is prob of sequence dj? 3/20 Calculate prob of sequence yy when two letters picked without replacement from {y: 6}. 1 What is prob of sequence pw when two letters picked without replacement from fwwpwyyfwfwywyfwff? 7/306 What is prob of sequence hq when two letters picked without replacement from {h: 5, q: 3, d: 4, b: 1}? 5/52 Two letters picked without replacement from mussxxxuuxumxuuxuxu. What is prob of sequence xu? 28/171 Four letters picked without replacement from tdnvtqp. Give prob of sequence ttqp. 1/420 Two letters picked without replacement from {o: 1, t: 1, m: 1, s: 2, z: 1, f: 1}. What is prob of sequence fm? 1/42 Calculate prob of sequence srp when three l	{ "pile_set_name": "DM Mathematics" }
t is the first derivative of 13781816b2 - 19682412 wrt b? 27563632b What is the second derivative of 72963g2iy2 - 176g*2y*2 - 937g*2 + 14giy + 7gi - 16i - 1 wrt y? 145926g*2i - 352g2 Find the third derivative of -62031k*4 + 43k*3 + 339k*2 - 729k + 3 wrt k. -1488744k + 258 Find the first derivative of -7897259i*2 + 11347911. -15794518i What is the first derivative of 17a3 + 59044a*2 + 3335998? 51a*2 + 118088a What is the third derivative of -42952180iz*3 - 7743iz + 47z*2 - z + 6 wrt z? -257713080i What is the third derivative of -2595147i6 - 1558i*2 - 14i - 7 wrt i? -311417640i3 What is the second derivative of 245f*3r*4 - 178f*3r - 117139f2r2 + f2r + 2990f*2 - 7r - 2 wrt r? 2940f3r*2 - 234278f*2 What is the derivative of 1459741194z*4 + 536497503? 5838964776z*3 What is the third derivative of 294833z*5 - 3z*2 + 551566? 17689980z*2 What is the third derivative of -9626437v*4 + 4v*3 - 85060615v*2 wrt v? -231034488v + 24 What is the third derivative of 6096649r5y + 2r2y + 2013155r2 wrt r? 365798940r*2y Find the third derivative of 36057407x3z + 101x2z + 1057x2 - 12xz + 3x wrt x. 216344442z Find the third derivative of -6064945i*3v - i*3 + 132i*2v + 4iv - 2731v wrt i. -36389670v - 6 What is the third derivative of 11097494g5 + 2838940g*2 - 1? 665849640g*2 What is the second derivative of 56986b*2q*2 - 75474b*2q - b*2 - 2bq4 + 3b + 13q2 wrt q? 113972b*2 - 24bq2 + 26 Find the third derivative of 9609722o*3 + 9802o*2 + 400. 57658332 Find the third derivative of -127086156j*3 - 102934j*2 + 2019 wrt j. -762516936 Find the second derivative of 9h*4 + 5265767h*3 - 21268306h - 8. 108h2 + 31594602h Find the third derivative of 9554045h6 + 6131579h*2. 1146485400h*3 Differentiate -6642954aqu + 4aq + 2au + 4a - 2q + 34618 with respect to u. -6642954aq + 2a What is the second derivative of 1388229s*3 - 2s*2 + 188459s + 12 wrt s? 8329374s - 4 Differentiate 401563865m*4 - 161703639. 1606255460m*3 Differentiate 129l*3 + 10310l*2x*2 + 143x*2 + x - 7861 wrt l. 387l*2 + 20620lx2 Find the second derivative of -41577391i*3t*2 + 3i*3t - 263it + 2i - 10t - 10 wrt t. -83154782i3 Find the second derivative of 5709755n*3 - 464n - 14462 wrt n. 34258530n Find the third derivative of 463076562y*3 - 3y*2 - 127y + 12512 wrt y. 2778459372 What is the second derivative of -13093881i2 - 91i + 22361 wrt i? -26187762 Find the first derivative of 946746979d + 1124548833 wrt d. 946746979 Find the second derivative of 41t*3 - 4473999t*2 + 700881905t wrt t. 246t - 8947998 What is the second derivative of 6678589g*2 - 2189033g? 13357178 Find the second derivative of 65090318cx*2 - 5cx + c + 66761x wrt x. 130180636c What is the second derivative of -141654188g*2y + 252143gy - 17g - y wrt g? -283308376y Find the second derivative of 715137r3 + 7r*2 + 13739887r. 4290822r + 14 What is the third derivative of 15871543d*3k - d*2k + 3d2 + 167538dk - 2k wrt d? 95229258k What is the second derivative of -22124666r*2 + 536r + 12059? -44249332 What is the derivative of -523439w2 + 20w - 49345626 wrt w? -1046878w + 20 What is the second derivative of j2kz2 - 4j*2k - 1672461jkz4 + 203kz + 587z wrt z? 2j2k - 20069532jkz2 Find the second derivative of -8c*2y - 102828c2 - 4cy + 6895603c - 2y + 4 wrt c. -16y - 205656 What is the first derivative of 301851698y2 + 136555832 wrt y? 603703396y Find the second derivative of 4l3 + 1199000l*2 - 1472l + 116 wrt l. 24l + 2398000 What is the second derivative of -9771782y*4 + 11520722y wrt y? -117261384y2 What is the third derivative of -36433w*4 - 19w*3 - 32w*2 + 55403 wrt w? -874392w - 114 What is the third derivative of 473l4 - 53732l*3 + 87l*2 + 47l + 709 wrt l? 11352l - 322392 Differentiate -432f*2 + 18105f - 58489316. -864f + 18105 What is the first derivative of -7303181r + 777050 wrt r? -7303181 What is the second derivative of -1266g2x*3 + 61g*2x*2 + 49g*2x - 480gx*3 + 3281x*3 + x wrt g? -2532x*3 + 122x*2 + 98x What is the first derivative of 2n2v - 101n2 - 12nv + 2n - 583799v wrt n? 4nv - 202n - 12v + 2 What is the derivative of 148350853g + 100766918? 148350853 Find the second derivative of 5199i2v*2 + 217i*2v + 691iv*2 + 17iv - 3v*2 - 1746 wrt v. 10398i*2 + 1382i - 6 Find the first derivative of 25910133jx + 285337j + 1 wrt x. 25910133j Find the first derivative of 2f3 - 57f*2 + 978f - 12496409. 6f2 - 114f + 978 Find the third derivative of -7678b2v*4 + 310158401b*2v*2 - 407bv4 - v3 wrt v. -184272b*2v - 9768bv - 6 Find the second derivative of -470973g4 - g3 + 7g*2 + 2283842g - 4. -5651676g2 - 6g + 14 What is the first derivative of -11271515z2 + 25826055? -22543030z Find the second derivative of -900515f2 - 228464f + 4. -1801030 Find the third derivative of 91758h6 - 32h*5 - 6h*3 - 4387566h*2 - h + 15 wrt h. 11010960h*3 - 1920h*2 - 36 What is the first derivative of 35885uw2 + 3uw + 93364272u - w*2 - 8w wrt w? 71770uw + 3u - 2w - 8 What is the second derivative of 18144265g2 - 11339373g? 36288530 Differentiate 9b4 - 79b*3 - 170811b - 778423594. 36b3 - 237b*2 - 170811 What is the first derivative of -1545550j*2 - 5464130? -3091100j What is the third derivative of -1117343b3m*3t*2 + 4b*3m*3t + 4b3m*2t + b*3t*2 + 279732b*2mt2 wrt m? -6704058b*3t*2 + 24b*3t Differentiate 330069564j + 15934274 with respect to j. 330069564 What is the second derivative of 10d*2t2 - d2t + 127071d*2 + 1334d + 10t2 + 23 wrt d? 20t*2 - 2t + 254142 Find the third derivative of 5045974s3 - 14933848s*2 wrt s. 30275844 What is the third derivative of 316o*4 - 41453o3 + o2 - 2o - 250186? 7584o - 248718 Find the first derivative of -4l2z*3 + 476875lz3 + 1219587z*3 + 3 wrt l. -8lz3 + 476875z*3 Find the third derivative of 22c*6 - 100157c*3 + 11979858c*2. 2640c*3 - 600942 Differentiate -6875pr2 - pr - 1842308pt*3 + 2pt - 17p - 2r2t - r*2 wrt t. -5526924pt2 + 2p - 2r2 What is the third derivative of -198d*4t*2 + 14477d*3t*3 + 874689d*2t*2 + 13dt3 wrt d? -4752dt2 + 86862t*3 What is the third derivative of 17286024g*6 - 4g*2 - 3382919g? 2074322880g3 What is the second derivative of qs*5 - 56568262qs2 - 99q + 17s - 9338 wrt s? 20qs3 - 113136524q Find the first derivative of -2218519t - 8032182. -2218519 Differentiate -bmq3 - bmq - 2bm - 4496380b + 23mq*3 - 18mq2 + mq + 40q3 + 3q*2 with respect to b. -mq*3 - mq - 2m - 4496380 What is the second derivative of 73562863x*2 - 2x + 14046129 wrt x? 147125726 What is the derivative of -3392900hn*3 - 9287171n*3 wrt h? -3392900n*3 What is the derivative of 16017n*2 - 1709n - 202262700? 32034n - 1709 Find the first derivative of -13588240j - 14080196 wrt j. -13588240 Differentiate -2aq*2 - aq + 750a - 50945q*2 + 6q - 26244 with respect to q. -4aq - a - 101890q + 6 Find the first derivative of 88296199h*2 + 118408312 wrt h. 176592398h Find the third derivative of -l*6 + 80l*4 - 176l*3 + 4l*2 - 21272l - 20 wrt l. -120l3 + 1920l - 1056 Find the third derivative of 144917610k3 + 34222983k*2 - k. 869505660 Find the first derivative of 9l*3 + 245l*2 + 2017l + 6897418 wrt l. 27l2 + 490l + 2017 Find the third derivative of 143764475b2d*3 + 301b*2d*2 + 2b*2d + b*2 - bd*2 + 2bd - 50d wrt d. 862586850b2 Find the third derivative of 11d*2f*4 - 99d*2f*3 + 48d*2f*2 - 2319f*3 + 59888f*2 - 4f + 3 wrt f. 264d2f - 594d2 - 13914 Find the third derivative of -638x*6 + 133028x*3 + 4x*2 + 7041026x. -76560x3 + 798168 Find the first derivative of 365316168m - 77860685. 365316168 Find the second derivative of 16858jk*2 - 12jk + 190j + 132*k	{ "pile_set_name": "DM Mathematics" }
f 3951 and 117? 9 What is the greatest common divisor of 3224 and 104? 104 What is the highest common factor of 258 and 1118? 86 Calculate the highest common factor of 16766 and 166. 166 What is the greatest common divisor of 28 and 5754? 14 What is the greatest common divisor of 131208 and 84? 84 Calculate the highest common divisor of 364 and 195. 13 What is the highest common factor of 123 and 2009? 41 What is the greatest common factor of 112 and 980? 28 What is the greatest common factor of 414 and 23? 23 What is the greatest common divisor of 960 and 312? 24 Calculate the highest common divisor of 1 and 1777. 1 What is the highest common divisor of 1680 and 12040? 280 Calculate the highest common divisor of 2 and 877. 1 What is the greatest common factor of 9353 and 47? 47 What is the greatest common divisor of 168 and 432? 24 What is the greatest common factor of 34 and 986? 34 Calculate the greatest common factor of 8801 and 13. 13 What is the greatest common factor of 18848 and 248? 248 Calculate the greatest common divisor of 55 and 11. 11 Calculate the highest common factor of 2727 and 135. 27 Calculate the greatest common factor of 1096 and 8. 8 Calculate the highest common factor of 30 and 4430. 10 What is the highest common factor of 1169 and 21? 7 Calculate the highest common divisor of 1694 and 14. 14 Calculate the highest common factor of 426 and 4899. 213 Calculate the greatest common factor of 126 and 10647. 63 Calculate the greatest common factor of 230 and 1840. 230 What is the highest common factor of 208 and 18? 2 What is the highest common factor of 1159 and 19? 19 What is the greatest common divisor of 5800 and 3016? 232 Calculate the greatest common factor of 4004 and 44. 44 What is the greatest common divisor of 34 and 1547? 17 What is the greatest common divisor of 9 and 3513? 3 What is the highest common factor of 15615 and 45? 45 What is the greatest common divisor of 15 and 1780? 5 What is the greatest common factor of 57 and 9? 3 Calculate the highest common divisor of 29 and 464. 29 Calculate the highest common divisor of 3312 and 32. 16 What is the highest common factor of 407 and 11? 11 Calculate the highest common divisor of 135 and 15. 15 Calculate the highest common factor of 598 and 377. 13 What is the highest common factor of 1072 and 16? 16 What is the highest common factor of 4527 and 6? 3 What is the greatest common factor of 188 and 25709? 47 What is the greatest common factor of 340 and 30? 10 What is the greatest common divisor of 529 and 23? 23 What is the greatest common divisor of 288 and 63? 9 Calculate the greatest common factor of 37 and 71743. 37 What is the greatest common factor of 308 and 77? 77 What is the highest common factor of 345 and 3243? 69 What is the greatest common factor of 1600 and 25? 25 Calculate the greatest common divisor of 31 and 13361. 31 What is the highest common factor of 9275 and 25? 25 What is the greatest common factor of 86 and 11911? 43 Calculate the highest common divisor of 5943 and 42. 21 Calculate the greatest common factor of 40 and 64. 8 What is the greatest common divisor of 668 and 501? 167 Calculate the greatest common divisor of 6080 and 190. 190 Calculate the highest common factor of 11 and 2112. 11 What is the greatest common divisor of 107 and 3424? 107 Calculate the highest common factor of 7880 and 40. 40 What is the highest common factor of 104 and 32? 8 Calculate the greatest common factor of 4379 and 151. 151 Calculate the greatest common divisor of 157 and 10519. 157 Calculate the highest common factor of 32 and 56. 8 What is the greatest common divisor of 27579 and 87? 87 What is the greatest common factor of 22 and 40? 2 Calculate the highest common divisor of 60 and 15000. 60 Calculate the greatest common factor of 360 and 126. 18 Calculate the greatest common divisor of 12 and 9288. 12 Calculate the greatest common factor of 21746 and 262. 262 What is the highest common factor of 24249 and 177? 177 What is the highest common divisor of 74 and 18574? 74 Calculate the highest common divisor of 1236 and 6. 6 What is the highest common divisor of 34 and 153? 17 What is the highest common factor of 198 and 126? 18 What is the greatest common factor of 1 and 79? 1 Calculate the greatest common factor of 86 and 731. 43 Calculate the highest common factor of 712 and 8. 8 What is the greatest common factor of 54 and 603? 9 What is the highest common factor of 588 and 204? 12 What is the greatest common divisor of 22 and 40733? 11 What is the greatest common divisor of 4 and 97? 1 Calculate the highest common factor of 61 and 1037. 61 Calculate the highest common divisor of 63 and 144. 9 What is the highest common divisor of 28241 and 62? 31 Calculate the highest common factor of 12 and 3. 3 Calculate the highest common divisor of 190 and 1178. 38 What is the greatest common divisor of 26 and 39? 13 Calculate the greatest common divisor of 36 and 4068. 36 Calculate the greatest common factor of 325 and 50. 25 What is the greatest common divisor of 414 and 506? 46 Calculate the highest common divisor of 200 and 700. 100 What is the highest common divisor of 200 and 40? 40 What is the highest common divisor of 516 and 5848? 172 What is the greatest common factor of 93 and 620? 31 What is the highest common factor of 582 and 30? 6 What is the greatest common factor of 3 and 10932? 3 What is the highest common divisor of 896 and 28? 28 What is the highest common divisor of 176 and 768? 16 What is the greatest common factor of 544 and 748? 68 Calculate the greatest common factor of 2485 and 781. 71 What is the greatest common factor of 2597 and 49? 49 What is the highest common divisor of 375 and 165? 15 What is the highest common factor of 2191 and 7? 7 What is the highest common factor of 351 and 52? 13 Calculate the highest common divisor of 91 and 559. 13 Calculate the greatest common divisor of 35 and 65. 5 What is the highest common divisor of 5642 and 364? 182 What is the greatest common factor of 20 and 9260? 20 What is the greatest common factor of 50 and 30? 10 Calculate the greatest common divisor of 41148 and 72. 36 Calculate the highest common divisor of 851 and 46. 23 Calculate the highest common divisor of 1457 and 31. 31 What is the highest common factor of 37 and 13283? 37 What is the highest common divisor of 14 and 4? 2 Calculate the highest common divisor of 872 and 8175. 109 Calculate the highest common divisor of 973 and 7. 7 Calculate the highest common factor of 44200 and 408. 136 Calculate the greatest common factor of 79 and 1. 1 What is the highest common factor of 352 and 48? 16 What is the highest common divisor of 152 and 342? 38 What is the greatest common factor of 1596 and 2052? 228 What is the greatest common factor of 3595 and 5? 5 What is the greatest common divisor of 5620 and 843? 281 What is the greatest common divisor of 119 and 1211? 7 Calculate the highest common factor of 218 and 9483. 109 What is the greatest common factor of 580 and 812? 116 Calculate the highest common factor of 7254 and 117. 117 What is the highest common divisor of 598 and 46? 46 What is the greatest common divisor of 133 and 231? 7 Calculate the greatest common divisor of 48 and 276. 12 What is the highest common divisor of 41 and 343? 1 Calculate the highest common divisor of 5993 and 169. 13 Calculate the greatest common factor of 45 and 129. 3 What is the greatest common divisor of 180 and 828? 36 Calculate the highest common divisor of 82 and 2. 2 Calculate the highest common factor of 340 and 136. 68 What is the highest common factor of 452 and 16? 4 Calculate the greatest common factor of 12 and 2208. 12 Calculate the highest common factor of 495 and 44. 11 What is the highest common divisor of 302 and 4681? 151 What is the greatest common divisor of 800 and 950? 50 Calculate the highest common factor of 25 and 5. 5 What is the highest common factor of 119 and 5117? 119 Calculate the highest common factor of 70059 and 363. 363 What is the highest common factor of 3839 and 44? 11 What is the greatest common factor of 54 and 513? 27 Calculate the greatest common factor of 746 and 4103. 373 What is the greatest common factor of 16	{ "pile_set_name": "DM Mathematics" }
/(-399)? 8 Let l be (28/35)/(1/(-5)). Let r(y) = -y + 1. Let m(o) = -16o + 18. Let u(x) = lm(x) + 72r(x). What is the units digit of u(-3)? 4 What is the units digit of (3 - -3) + -6 - -525? 5 Let o = 12 - 8. Suppose -2r = od - 2d, 3d = 2r + 5. What is the units digit of d? 1 Let g(y) = -64y - 159. What is the thousands digit of g(-36)? 2 Suppose -2z = -2n - 1240, -15n = -z - 12n + 620. What is the units digit of z? 0 Let s = -21 + 24. Suppose x + 250 = sx + 4f, -5x + 4f + 583 = 0. What is the hundreds digit of x? 1 What is the hundreds digit of (8/7 + -1)7394? 3 Suppose 4r = -4b - 124, -2b - 4 = 2. Let a = r - -161. What is the tens digit of a? 3 Suppose -s - 184 = -3i, -i + 0s = 5s - 40. Let h = i - -5. What is the tens digit of h? 6 Suppose -21w - w = -38060. What is the tens digit of w? 3 Suppose 6v = 4v. Suppose z = -2a + 6, v = 2a + 5z - 5 - 1. Suppose -an + y + 70 = 0, -50 = -5n + 4n - 5y. What is the units digit of n? 5 Let x = 38 + -37. Let z(p) = 44p*2 - 2. What is the tens digit of z(x)? 4 Suppose -24o = -13158 + 894. What is the units digit of o? 1 Let w = -115 + 120. Suppose 0 = wu + u - 528. What is the tens digit of u? 8 Suppose -18 = -3u + 72. What is the units digit of (u/9)/((-52)/60 - -1)? 5 Let q = -886 + 1348. What is the units digit of q? 2 Suppose -1051 = -y - d, 2y = -4d + 8d + 2120. What is the tens digit of y? 5 Let x(j) = -5j - 5. Let f(k) be the second derivative of 4k3 + 13k*2 + 12k. Let b(u) = 4f(u) + 22x(u). What is the tens digit of b(-4)? 5 Let m(f) = -f*3 - 11f*2 - 23f - 142. What is the units digit of m(-12)? 8 Let j(c) = -15c. Let v(q) = q - 1. Let b(z) = j(z) + 2v(z). What is the units digit of b(-1)? 1 Suppose 0s - s = -5s. What is the hundreds digit of -1 + 108 + -3 + s? 1 Suppose 0 = 4n - 0n - y + 11, n + 5y = 13. Suppose 3w - 5x + 9 = -w, -4w = 5x - 41. Let s = w + n. What is the units digit of s? 2 Suppose -5m - 3f + 11 - 142 = 0, 2f + 129 = -5m. What is the units digit of (-10)/m - (-728)/5? 6 Suppose 3s + 4 = -5. What is the units digit of 3 - s/(9/213)? 4 Let m(v) = -41v - 136. What is the tens digit of m(-11)? 1 Suppose -181 = -q + 167. What is the tens digit of q? 4 Let y = 37 - 33. Let p be (y + -7 - 0) + -2. Let f(c) = -6c + 6. What is the units digit of f(p)? 6 Let g(o) = -112o + 285. What is the hundreds digit of g(-4)? 7 Suppose 3d = -j + 1472, -3d + 5j + 970 = -d. Suppose d = 39f - 34f. Let r = -43 + f. What is the tens digit of r? 5 Let x = -186 - -1018. What is the units digit of x? 2 Let z be 18/30 + (-3)/5. Suppose z = -2s + 26 + 14. What is the tens digit of s? 2 Let b = 242 + -140. Let t = b - 72. What is the tens digit of (16/(-12))/((-2)/t)? 2 Let n = -48 - -47. Let v(o) = -56o + 6. What is the tens digit of v(n)? 6 Suppose 36 = -5d - r + 5r, -r = 2d + 4. What is the units digit of 2/(d/(-88) + 0)? 4 Suppose 3g - 31 = -10. Suppose 6l = gl - 32. What is the units digit of l? 2 Let n be -6((-6)/(-9) - 1). Suppose -8 = -nv + 38. What is the units digit of v? 3 Let v be 9185/20 - 3/12. Suppose -v + 129 = 3m. What is the tens digit of ((-2)/5)/(2/m)? 2 Suppose f - 94 = -0f - 5s, 0 = -3f - 4s + 227. Let q = 141 - f. What is the tens digit of q? 7 Suppose 0 = a + 6s - 2s - 158, 2s - 298 = -2a. Let d be (-2)/5 + (-27)/(-5). Suppose dz = 34 + a. What is the units digit of z? 6 Suppose -3u - 36 = -0u. Let l be (15 - 0)100/u. Let f = -79 - l. What is the tens digit of f? 4 Suppose v = 5h + 4 - 2, 0 = -5v - 4h + 10. Suppose 2s - 288 = -vc - 2s, 0 = s - 1. What is the tens digit of c? 4 Let m(w) = -w2 + 3w + 6. Let d be m(4). Let z be (-10)/20 - (-1)/d. Suppose zi - 108 = -3i. What is the units digit of i? 6 Let i = 131 - -60. What is the units digit of i? 1 Let f = -141 + 144. Suppose -fq - 306 = 2u - 992, -15 = 3u. What is the hundreds digit of q? 2 Suppose -3y - 2z = -6614, z + 4421 = 104y - 102y. What is the tens digit of y? 0 Let i = -263 - -529. Suppose -9 = -5c + i. Suppose -7f - c = -8f. What is the units digit of f? 5 Let n(s) = 13s2 + 3s - 65. What is the tens digit of n(7)? 9 Suppose 0 + 9 = -3t. Let p(n) = -8n*2 + 4. Let k be p(t). Let c = -37 - k. What is the units digit of c? 1 Let s(u) = -4u - 7. Let b(l) = 2l + 1 + 5 + 3l. Let v(o) = -5b(o) - 6s(o). What is the units digit of v(10)? 2 Let k be (-8)/12-2-153. Let h = 289 + k. What is the units digit of h? 5 Suppose 8h - 3h - 25 = 0. Let r(k) = -k*3 + 6k*2 + 3k + 7. Let w be r(h). Let a = -22 + w. What is the tens digit of a? 2 Suppose 4u + 2 = 22. Suppose u = -2g + 29. What is the units digit of g? 2 Let n be ((-58)/6)/(2/(-144)). Let i = -131 + 91. What is the tens digit of n/15 - (-16)/i? 4 Let p = -332 - -799. What is the hundreds digit of p? 4 Let d(x) = -19x - 198. What is the units digit of d(-28)? 4 Let s = 1214 + -416. What is the hundreds digit of s? 7 Let s(f) = -7f + 11. Let j be s(5). Let x be j/9(-1 + -8). Let l = x - 0. What is the tens digit of l? 2 Suppose o - 5m - 68 = 0, -3m + 95 = -5o + 479. What is the units digit of 20/130 - (-3)/(o/2908)? 2 Let k = -323 - -1554. What is the thousands digit of k? 1 Suppose -9a + 7a = -12. What is the units digit of ((-27)/a)/1-2? 9 Let v be -2(0 - 13) - 0. Let w be 0 + v/(-4)-12. Suppose 0y + 2y - w = 0. What is the tens digit of y? 3 Suppose i + 32 = -0i. Let s = i - -88. Suppose t - s = -t. What is the units digit of t? 8 Let u = -133 + 133. Let j = 2 + 1. What is the units digit of -1 + u + (j - -12)? 4 Suppose -1194m - 1672 = -1202m. What is the units digit of m? 9 Let g be (-677)/(-9) + (-10)/45. What is the units digit of (g/(-14)4)/((-2)/14)? 0 Suppose 5h - 4 = -q, 0q + 4q - 5h = -34. Let k(t) = -16t - 12. What is the units digit of k(q)? 4 Let y(s) be the third derivative of s*5/60 + 5s*4/24 - 3s*3/2 + 8s*2. Let m be y(9). Suppose 2u - m = -u. What is the units digit of u? 9 Let p(x) = 4x2 + x + 5. Let u be p(-5). Let o = u - 55. What is the tens digit of o? 4 Suppose 4d + 55 = 387. What is the tens digit of d? 8 Let c(s) = s. Let x(h) = 9h - 17. Let d(o) = 6c(o) - x(o). What is the units digit of d(-8)? 1 Suppose -3v + v + 4 = 0. Suppose -3x + 0a + 176 = -a, -a - 118 = -vx. What is the units digit of x? 8 Let j(s) = -56 - 3s3 + 54 - 6s*2 + 18s*2 + 2s*3 - 5s. What is the units digit of j(11)? 4 Let a(d) = -71d + 2. Let n be a(1). Let r = -6 - n. What is the tens digit of r? 6 Suppose 15 = c + 4i, -5i + 12 = -4c + 3c. Suppose -k + 54 = a, -3k = -a + ca - 158. What is the units digit of k? 0 Suppose -10n + 4 = -46. Suppose -87 = -4h + 4c - 7, -5c = nh - 80. What is the units digit of h? 8 Suppose -2i = v + 1, 0 = -i + 3v - 0v + 17. Suppose -112 + 32 = -ix. What is the units digit of x? 0 Let n(p) = 8p + 31. Let f be n(10). Let c = f - 1. What is the tens digit of c? 1 Let j(d) = d3 + 20d*2 - 18d - 55. What is the thousands digit of j(-13)? 1 Let y(w) = 10 - 162w3 - 169w3 + w2 + 330w3 + 15w - 3w2. What is the units digit of y(-7)? 0 Let v(t) = t3 - 6t*2 + 2t - 12. Let f be v(6). Let h(s) = -5s + 68. What is the tens digit of h(f)? 6 Let o(z) be the second derivative of 43z*4/12 - 15z. What is the units digit of o(1)? 3 Suppose 2a - 3 = -k + 1, 2a = 2k + 4. Suppose -h - 112 = -at - 2h, 5h + 155 = 3t. Let j = t - 41. What is the tens digit of j? 1 Suppose -k = 1 - 0. Let o(j) = -47j - 46j + 86j - 47j. What is the tens digit of o(k)? 5 Let j(c) = c2 + 5c - 18. Let p be j(9). Suppose 5y + 119 = -x, 4y + 4x + p = -0y. Let h = -20 - y. What is the units digit of h? 3 Let g(y) be the third derivative of -y6/120 + y5/12 + y*4/8 - 5y*2. Let m be g(6). Let f = 31 + m. What is the units digit of f? 3 Suppose i + 2138 = 3u + 620, -3 = i. What is the tens digit of u? 0 Let c = -576 + 1044. Suppose -4w + 360 = 2z, 2z = -5w + 4z + c. What is the units digit of w? 2 What is the tens digit of 5/33 - -83? 8 What is the tens digit of (-134204)/(-48) - (-3)/36? 9 What is the hundreds digit of (-2461)/(-12) + (-1)/(-72)-6? 2 Suppose -4f + 6 = -10. Suppose 93 = h + fg, -4h + g + 312 = -3*g. What is the units digit of	{ "pile_set_name": "DM Mathematics" }
the highest common divisor of 17 and c. 17 Suppose 34 = 2q + m + m, 3q + 5m - 55 = 0. What is the highest common divisor of q and 15? 15 Suppose 0 = 2k + 3 + 3. Let u(d) = 2d2 - 2d + 1. Let i be u(k). Calculate the greatest common divisor of i and 10. 5 Let p = -43 + 62. Suppose -w + 3g + 65 = 0, -g = 4w + 2g - 230. Let z = w - p. What is the highest common divisor of z and 5? 5 Let i = -17 - -20. What is the greatest common factor of i and 6? 3 Let c be (-6)/21 + (-426)/(-21). What is the highest common factor of 100 and c? 20 Suppose 0 = 4y - 7y - 2c + 30, 4y - 3c = 23. Let a be 266/y + (-1)/4. Suppose -4n + 19 = -25. What is the highest common divisor of a and n? 11 Suppose 0 = -2j - 2y + 12, 0 = -j - y - 3y - 6. Let n be (60/7)/(-3)-7. Calculate the highest common divisor of j and n. 10 Let k = 50 - 17. Calculate the greatest common divisor of k and 22. 11 Let v be (4/5)/((-10)/(-25)). Suppose vc - c = 98. Let b = -53 + c. What is the greatest common divisor of b and 9? 9 Let k be 6/8 + 2/8. Let s(y) = y*2 - 2y - 3y2 + 24 + y2 - 6y. Let l be s(-10). Calculate the highest common divisor of k and l. 1 Let r be 520/6 - (-8)/(-12). Suppose r = d + 17. What is the greatest common divisor of 46 and d? 23 Let w be 21/2 + 17. Suppose 9p - 630 = 4p. What is the greatest common factor of p and w? 18 Let z(x) = -x3 - 19x*2 - 7x - 28. Let h be z(-19). What is the highest common factor of 70 and h? 35 Suppose 104 = 3g + w, 0 = g - 0g + 4w - 20. Suppose 4j + 50 = m + 148, 0 = 5j + 2m - 116. What is the highest common factor of g and j? 12 Suppose 5w + 24 = -1. Let i = w + 5. Suppose 2y - 4 - 4 = i. Calculate the highest common divisor of 10 and y. 2 Suppose -6y + 2y = -52. Calculate the highest common factor of 65 and y. 13 Let y(v) be the third derivative of 1/3v3 + 0v - 2v2 + 0 + 1/3v*4. Let t be y(2). What is the highest common divisor of t and 54? 18 Suppose 7m + 3u - 23 = 2m, m = -3u - 5. Suppose -4x = -x - 84. What is the highest common divisor of m and x? 7 Let l(s) = s*3 + 13s*2 + 26s + 4. Let g be l(-10). Calculate the highest common divisor of g and 44. 44 Suppose -3s = -3o + o - 169, 2s - 81 = -5o. Suppose -s - 91 = -2q. Let i be ((-32)/(-10))/(2/5). What is the highest common factor of i and q? 8 Let p(f) = 5f*2 - f + 2. Let a be p(-2). Let b = -21 - -213. What is the greatest common divisor of a and b? 24 Let c = -28 - -63. Let r = c + -13. What is the highest common factor of 110 and r? 22 Suppose 0 = v - 5u - 85, -4v + u + 118 + 298 = 0. What is the highest common factor of v and 30? 15 Let u(j) = -j - 6. Let o be u(-7). Let h = o - -1. Calculate the highest common divisor of 3 and h. 1 Suppose 0 = -2w + 2k + 78, -2w = 3k - 8k - 66. Calculate the greatest common factor of 86 and w. 43 Suppose y + 3035 = 6y. Suppose -4o - q + 0q + y = 0, 5o + 4q = 745. Calculate the highest common divisor of o and 17. 17 Let b = 81 - 36. Calculate the highest common factor of 27 and b. 9 Let o(d) = d + 4. Let n be o(-6). Let u be ((-14)/10 - n)15. Calculate the greatest common divisor of u and 27. 9 Let q be 11/(-2 + 0 - -3). Calculate the highest common divisor of 121 and q. 11 Suppose -64 = -2m - 2m. Suppose m + 8 = n. Calculate the greatest common divisor of 16 and n. 8 Let z = -5 + 7. Suppose -zl = 2l - 40. Let j(k) = -12k - 2. Let s be j(-6). Calculate the highest common divisor of l and s. 10 Let s be 3(3 + 1-2). Suppose -1072 = -sr - r. Let u be (-4)/(-20) - r/(-10). What is the greatest common factor of 18 and u? 9 Suppose -27 = 3r - 6r. Let d be -3((-105)/r - -1). Calculate the highest common factor of 16 and d. 16 Suppose 0c = -5f + 3c - 23, 18 = -4f + 2c. Let m be (-33)/f - 5/20. Calculate the greatest common divisor of m and 2. 2 Suppose 0 = 123q - 125q + 30. What is the greatest common divisor of 45 and q? 15 Suppose -2d + 34 = 3l, -5l + 37 = 2d - 1. Calculate the greatest common factor of d and 2. 2 Let c = -196 - -277. Let m = c + -33. Calculate the greatest common divisor of m and 12. 12 Let o = -31 - -45. What is the highest common divisor of 21 and o? 7 Let d(s) = -s*3 - 5s*2 + 6. Let q(r) = -r + 1. Let f be q(6). Let i be d(f). Suppose -3o = 6 - 51. What is the highest common divisor of o and i? 3 Let h(w) = w + 46. Let q be h(-17). What is the greatest common factor of q and 145? 29 Suppose -4d - 2v = -110, 43 = d + 2v + 8. Calculate the highest common factor of d and 25. 25 Let h be (16/2)/21. Let b = -1 + h. Let l = 7 - b. What is the greatest common divisor of l and 20? 4 Let i be (-1)/(3 - (-128)/(-42)). Calculate the greatest common divisor of i and 42. 21 Let n = -44 + 62. Calculate the greatest common divisor of n and 72. 18 Let v(i) = i*2 - i. Let l be v(0). Suppose l = -2b + 6b - 312. What is the highest common divisor of b and 52? 26 Suppose 0 = m + m + 2. Let o be (-2)/(-2)16 - m. Calculate the highest common factor of 153 and o. 17 Let n be 480/14 - (-10)/(-35). Let o = n - 24. Let x be 2016/40 + (-4)/o. What is the highest common factor of x and 20? 10 Let h = 11 + 7. Suppose -b = -8 - 28. What is the highest common factor of b and h? 18 Let d be (-3 + 1)20/(-8). Suppose 15 = dm - 0m. Suppose -2x + 37 = -mt, 0 = -3x - 0t - 3t + 63. Calculate the highest common divisor of x and 30. 10 Let f = 0 + 1. Let r(q) = 46q. Let g be r(f). Let j = -32 + g. What is the highest common divisor of 56 and j? 14 Suppose -2n = -4p - 4, 0p + 5 = -5p + n. Let x be -3 - ((2 - p) + -10). Suppose f - xs = -3f + 8, 3s = 9. What is the highest common divisor of 15 and f? 5 Let t = -1 + 14. What is the greatest common factor of 26 and t? 13 Suppose -4q + 12 = -4. What is the greatest common factor of q and 1? 1 Let l be -132(-2 + 1 - 0). Suppose 2h - 3h = -l. Calculate the greatest common divisor of 12 and h. 12 Suppose 1 + 8 = -o. Let l be -876/o - 2. Let k be (-1)/(-2) + (-54)/(-4). What is the highest common factor of l and k? 14 Let x be 1 + 1/(-2 + 1). Suppose -s + 1 = -xs. Let d(b) = -b*2 - 8b + 5. Let p be d(-8). What is the greatest common factor of s and p? 1 Let z(l) be the second derivative of 5l4/12 + l2/2 + 2l. Let t be z(1). Calculate the highest common divisor of 42 and t. 6 Let i(z) = -2z - 6. Let g be i(-5). Let p(l) = -l3 + 4l*2 + 3l - 5. Let q be p(g). What is the highest common divisor of q and 63? 7 Let i = 87 + -223. Let y = i - -191. Calculate the highest common divisor of y and 22. 11 Let r(t) = 4t2 - 3t + 1. Let l be r(1). Let f = 18 + -10. Calculate the greatest common divisor of f and l. 2 Let g be (792/55)/(2/(80/6)). Calculate the greatest common divisor of 12 and g. 12 Let b = 5 - 1. Suppose 4g = -4 + 8. Let h be (g - 2/(-4))24. Calculate the greatest common factor of h and b. 4 Let h be 30(9 + 2/1 - -1). What is the highest common divisor of h and 36? 36 Let o = 7 - -1. Let a = -6 + o. Suppose -5g + 3b + 187 = 0, -ab + 3b = 2g - 74. Calculate the highest common factor of g and 7. 7 Suppose 0u + 3u = -2q + 2, u + 4q = -6. Suppose -5 + u = -3g. Let i = -2 - -3. What is the highest common divisor of g and i? 1 Suppose 0 = 4c + 5 - 25. Suppose 4m + 2j + 5 + 29 = 0, 0 = -2j + 6. Let i be 252/10 - (-2)/m. What is the highest common factor of i and c? 5 Let c be 5/((-40)/14)20. Let a be ((-100)/c)/((-1)/(-7)). Let g = 445 + -225. Calculate the highest common divisor of g and a. 20 Suppose 0 = 3j + 2j - 220. Calculate the greatest common factor of j and 110. 22 Let h be -1(-101)/2 + (-6)/12. Calculate the highest common divisor of 25 and h. 25 Let p = -181 - -186. Calculate the highest common divisor of p and 10. 5 Suppose 0 = -3o + o - 24. Let l = o + 5. Let p = l + 15. What is the highest common divisor of p and 32? 8 Suppose 6v = -3n + 2v + 154, -4v + 4 = 0. Let j = -22 - -32. What is the greatest common divisor of j and n? 10 Let q be (-2)/8 + 217/(-28). Let n be (q/(-12))/(3/18). What is the highest common factor of 4 and n? 4 Let b(i) = 5i + 5 - 3 - 9. Let s be b(5). Calculate the highest common factor of s and 6. 6 Let j be 38/(-9) - (-2)/9. Let u be (j/1)/((-1)/4). Calculate the greatest common factor of 2 and u. 2 Suppose p - 2	{ "pile_set_name": "DM Mathematics" }
-1sqrt(5)-5)*2. 180 Simplify sqrt(204)/(sqrt(12) - -1sqrt(108)). sqrt(17)/4 Simplify (1 + sqrt(242))5. 5 + 55sqrt(2) Simplify (sqrt(20) - (sqrt(60)/(sqrt(3)1 + sqrt(3)) + sqrt(20)))/(sqrt(250)-1 - sqrt(250) - sqrt(250) - sqrt(10)). sqrt(2)/32 Simplify sqrt(847)-35. -165sqrt(7) Simplify (0 + sqrt(720))2-5 - (sqrt(720) - (sqrt(720)-1 + sqrt(720) - sqrt(720)))2-5. 10800 Simplify (1sqrt(7) + 5)2-6. -192 - 60sqrt(7) Simplify (12sqrt(7) + (sqrt(7) + -2sqrt(63))*2)6. 12sqrt(7) + 1050 Simplify (-1sqrt(21)/sqrt(3)-5)2. 175 Simplify sqrt(22)/(sqrt(4)/sqrt(2)-6). -sqrt(11)/6 Simplify (-5(sqrt(68) + -1 + sqrt(68)) + 0 + 1 + sqrt(68))2. -216sqrt(17) + 5544 Simplify sqrt(114)/(3sqrt(6)-5). -sqrt(19)/15 Simplify (sqrt(14)/(sqrt(7) - sqrt(28)))*22. 4 Simplify -23sqrt(4)/sqrt(2). -6sqrt(2) Simplify sqrt(1900) + (sqrt(1900) - (sqrt(1900) + (sqrt(1900) - (-5(sqrt(1900) + 3) + sqrt(1900))) + sqrt(1900)))*2. 1810sqrt(19) + 68625 Simplify -3 + 5 + ((sqrt(5) - (-5 + sqrt(45))) + sqrt(5))*2. -10sqrt(5) + 32 Simplify -1 + (sqrt(40)-3 + sqrt(40))/sqrt(8). -2sqrt(5) - 1 Simplify ((sqrt(125) + 2)4)2. 320sqrt(5) + 2064 Simplify (sqrt(650) - sqrt(650)1)/(sqrt(50) + sqrt(800)). 0 Simplify -5 + (-4 + -1sqrt(396)6)2. 288sqrt(11) + 14267 Simplify (-5 + (1 + sqrt(17) - sqrt(17)))*2 - (sqrt(272) + 0). -4sqrt(17) + 16 Simplify ((sqrt(119) - (sqrt(119)1 - sqrt(119)))2)/sqrt(7). 2sqrt(17) Simplify (0 + sqrt(13) + -1)2 + -6sqrt(208) + sqrt(13) + sqrt(13). -24sqrt(13) + 14 Simplify -3 + (sqrt(1300) + sqrt(1300) + -2 + sqrt(1300))1 + 0. -5 + 30sqrt(13) Simplify 6(-3 + (sqrt(44)/sqrt(4) + -1 - sqrt(11))). -24 Simplify -4sqrt(539) + 2sqrt(1584). -4sqrt(11) Simplify 4 + (sqrt(57) - (-2sqrt(114))/sqrt(2))/sqrt(3). 4 + 3sqrt(19) Simplify (sqrt(1900) - (-5 + ((sqrt(1900) + sqrt(1900)2)*2 - sqrt(1900))))-3. -60sqrt(19) + 51285 Simplify ((-2(1sqrt(170) - sqrt(170)) + sqrt(170) - sqrt(170))/(sqrt(110)/(sqrt(11) + sqrt(55)/sqrt(5))))2. 0 Simplify (((sqrt(28) + sqrt(84)/sqrt(3) + sqrt(28))-2 - sqrt(28))/((sqrt(400) - (sqrt(400)2 + sqrt(400))) + sqrt(400)))2. 343/100 Simplify -6sqrt(208)2 + -5 + (sqrt(208)-1 - sqrt(208)) + sqrt(208). -52sqrt(13) - 5 Simplify sqrt(114)/(sqrt(486) - -1sqrt(486))-1. -sqrt(19)/18 Simplify sqrt(12)/(sqrt(4) - 5sqrt(36)). -sqrt(3)/14 Simplify sqrt(20)/sqrt(64) + sqrt(245) + -2. -2 + 29sqrt(5)/4 Simplify (sqrt(209)3-3)/(sqrt(11)21). -9sqrt(19)/2 Simplify (sqrt(21)/sqrt(3))*2 + -5 + (sqrt(448)5)2. 11202 Simplify sqrt(44) + ((sqrt(5324))2 - sqrt(44)) + -2. 5322 Simplify (6sqrt(200)4)2. 115200 Simplify (sqrt(11) + 2 + sqrt(11) + 0 + -3)2. -4sqrt(11) + 45 Simplify (-6(sqrt(117) + 0 - sqrt(13)) + -5)*2-6. -11382 - 720sqrt(13) Simplify 2(2 + sqrt(11) + -3sqrt(11)). -4sqrt(11) + 4 Simplify -6(sqrt(2)-14 - sqrt(18)/sqrt(36)). 27sqrt(2) Simplify (sqrt(95) - (sqrt(95) + 5sqrt(95) - sqrt(95)) - sqrt(95))/sqrt(5) - -6sqrt(114)/sqrt(6). sqrt(19) Simplify 1sqrt(5) + -1 + (sqrt(35)/(sqrt(28)/sqrt(4)) - sqrt(5)). -1 + sqrt(5) Simplify sqrt(39)/(sqrt(3)-3 + sqrt(3))-4. 2sqrt(13) Simplify (sqrt(2) - (((sqrt(14) - sqrt(56))/sqrt(7))*2 - sqrt(2))) + 3. 1 + 2sqrt(2) Simplify (sqrt(432) + 1 + sqrt(432))31. 3 + 72sqrt(3) Simplify sqrt(325)3 - ((sqrt(13) - (sqrt(13) + -4 + sqrt(13)) - sqrt(13))-3)2. -612 + 159sqrt(13) Simplify (sqrt(19) + sqrt(114)/sqrt(6) + -3 + sqrt(19) + -2 + sqrt(2736))*2. -150sqrt(19) + 4300 Simplify (sqrt(432)-2-5 + sqrt(432))*2. 52272 Simplify (3 + 3sqrt(75) - ((sqrt(75) - sqrt(75)3) + -3))2. 300sqrt(3) + 1911 Simplify (6sqrt(60)/sqrt(3))/((sqrt(540) - sqrt(60))/sqrt(6)). 3sqrt(2) Simplify ((sqrt(68) - (-2sqrt(68)4 + sqrt(68)))/((sqrt(32)/sqrt(2) + sqrt(16))/sqrt(4) - sqrt(4)))2. 1088 Simplify 4 + (3 + sqrt(68) - sqrt(68))2 - (1 + ((-2 + sqrt(68))*2 - sqrt(68)) - sqrt(68)). -60 + 12sqrt(17) Simplify ((sqrt(156)-1 + sqrt(156))-1 - sqrt(156))/sqrt(12). -sqrt(13) Simplify (sqrt(16)/(sqrt(8)-2) + -2)2 + -1. 2sqrt(2) + 7/2 Simplify 3((sqrt(114)-3)/sqrt(6) - sqrt(19) - ((-3sqrt(190))/sqrt(10) - sqrt(19))). 0 Simplify (5 + sqrt(162)2)-5. -90sqrt(2) - 25 Simplify (sqrt(1400)/sqrt(7) + 4 + 5)*2. 180sqrt(2) + 281 Simplify (sqrt(170) + sqrt(170)1 + sqrt(170))/sqrt(10)-4. -12sqrt(17) Simplify (sqrt(19) - (sqrt(209) + 1sqrt(209))/sqrt(11)) + 0. -sqrt(19) Simplify ((sqrt(15)/sqrt(3) - sqrt(5)) + 1 + 2)*2. 9 Simplify -2 + sqrt(12)/sqrt(4)-4. -4sqrt(3) - 2 Simplify (12sqrt(70))/(sqrt(50)/(sqrt(5) - (sqrt(5) - sqrt(45)))). 6sqrt(7) Simplify (sqrt(56)/(-1sqrt(8)))23 + sqrt(77)/(sqrt(11) + (sqrt(1331) - sqrt(1331)1 - sqrt(1331))). -sqrt(7)/10 + 21 Simplify ((sqrt(3000)-1)/(-1sqrt(490) - sqrt(10) - sqrt(10)))2. 100/27 Simplify (sqrt(2736) + (sqrt(2736) - (sqrt(2736) + -1 + sqrt(2736))1))*2 + sqrt(2736) - sqrt(2736) - (-2 + 2sqrt(2736)). -24sqrt(19) + 3 Simplify (-5 + -2sqrt(208))*2. 80sqrt(13) + 857 Simplify -2(1 + sqrt(432))-5. 10 + 120sqrt(3) Simplify (-5 + sqrt(567))2 + 4. -90sqrt(7) + 596 Simplify -1 + (sqrt(272) - (0 + sqrt(272)) - (sqrt(17) - (0 + sqrt(17) + 5)))*2. 24 Simplify 6((sqrt(10)/sqrt(2))*2 + 4). 54 Simplify (sqrt(306) + 1sqrt(306))/(sqrt(2) + (sqrt(10)/sqrt(5) + sqrt(2))-6). -6sqrt(17)/11 Simplify (4(sqrt(2548) + 1))2. 448sqrt(13) + 40784 Simplify -4 + ((sqrt(720) - sqrt(720)2)6 + sqrt(720) + 1sqrt(720) + -4)2. 384sqrt(5) + 11532 Simplify -5(sqrt(1377) + -1) + sqrt(1377) + -5 + sqrt(1377)1 + sqrt(1377). -18sqrt(17) Simplify sqrt(33)/(sqrt(9)/sqrt(27)) + -5. -5 + 3sqrt(11) Simplify (sqrt(70)/(sqrt(5) + sqrt(5) + sqrt(10)/sqrt(2) - sqrt(5)))/(sqrt(21)/(sqrt(21)/sqrt(7))). sqrt(2)/2 Simplify -6(sqrt(1900) + sqrt(1900)-1 - sqrt(19)1-3). -18sqrt(19) Simplify sqrt(72)4. 24sqrt(2) Simplify (3sqrt(143)-2)/(sqrt(396) + (sqrt(396) - -1sqrt(396))). -sqrt(13)/3 Simplify (-3 + sqrt(11) + (2 + sqrt(176) - sqrt(176) - sqrt(11)))*2. 1 Simplify sqrt(132)/(sqrt(24)/sqrt(2)) + 3. 3 + sqrt(11) Simplify sqrt(68)/sqrt(64) + sqrt(17) + ((sqrt(68)-1)/sqrt(4))*2. 5sqrt(17)/4 + 17 Simplify (-3(-4(sqrt(6)-2 + sqrt(6)))/sqrt(2))2. 432 Simplify sqrt(12)/((sqrt(96) - sqrt(6))6)5. 5sqrt(2)/18 Simplify -2sqrt(90)/sqrt(2)3. -18sqrt(5) Simplify (sqrt(1539) + 1 + sqrt(1539) + sqrt(1539) + -2)-4 + 4. -108sqrt(19) + 8 Simplify 3(5 + (sqrt(5) + 1)*2 - sqrt(5))5. 15sqrt(5) + 165 Simplify 1 + sqrt(175) - (5 + (sqrt(7) - sqrt(7)1))*2. -24 + 5sqrt(7) Simplify -4 + 5sqrt(119)/sqrt(7)-6. -30sqrt(17) - 4 Simplify -6sqrt(200) - (sqrt(48)/sqrt(6))/sqrt(4). -61sqrt(2) Simplify (-2 + 2sqrt(2736) + -2)*2. -192sqrt(19) + 10960 Simplify sqrt(136)/((sqrt(88)1)/sqrt(11)). sqrt(17) Simplify sqrt(19) + (1sqrt(19))*25 - (0 + sqrt(19))-5. 6sqrt(19) + 95 Simplify (-1 + sqrt(48) - (sqrt(3) - (0 + sqrt(75))*2)) + -3. 3sqrt(3) + 71 Simplify (5 + (-4 + sqrt(612) + 1)2)2. -24sqrt(17) + 2449 Simplify ((sqrt(896) - sqrt(896)-1) + sqrt(896) - sqrt(14))/(sqrt(20)/(sqrt(490) + sqrt(10))). 184sqrt(7) Simplify (sqrt(847) + 3(-2 + sqrt(847)))2. -528sqrt(7) + 13588 Simplify ((sqrt(28) + sqrt(28)1 - sqrt(28))-4)/((sqrt(4) + sqrt(8)/sqrt(2))5). -2sqrt(7)/5 Simplify ((-2sqrt(1088))2 - sqrt(17))-1. -4352 + sqrt(17) Simplify (5 + -1sqrt(98))2 - sqrt(98). -77sqrt(2) + 123 Simplify (sqrt(13) - (sqrt(13) - sqrt(91)/sqrt(7)))*2-6-5. 390 Simplify (3 + (sqrt(33)-1)/sqrt(11)6)2. -36sqrt(3) + 117 Simplify 0 + (-2 + sqrt(363) + sqrt(363) + -5)*2. -308sqrt(3) + 1501 Simplify sqrt(832)-1 + 5. -8sqrt(13) + 5 Simplify 0 + (sqrt(833) + -1 + -4 - sqrt(833))*2. 25 Simplify (sqrt(405)2)/((-1sqrt(9) - sqrt(9))-4). 3sqrt(5)/4 Simplify sqrt(38)/(sqrt(2) + (sqrt(2) - (sqrt(2) - sqrt(8)/sqrt(4)))-6 - sqrt(2))1. -sqrt(19)/6 Simplify ((5 + 2(sqrt(1331) + -2))-6)2. 1584sqrt(11) + 191700 Simplify 5 + -5 + -4sqrt(475). -20sqrt(19) Simplify -1 + sqrt(605) + 5. 4 + 11sqrt(5) Simplify sqrt(121)/(sqrt(55)/sqrt(5)) + (sqrt(99) + 5)2. 31sqrt(11) + 124 Simplify (0 + sqrt(2736) + -2sqrt(2736))2. 2736 Simplify ((sqrt(70) - (sqrt(70) + (sqrt(70) - (sqrt(70) + sqrt(70) + sqrt(70) + sqrt(70)-3))))-5)/sqrt(10). 5sqrt(7) Simplify 2 + (1 + sqrt(175))*6.	{ "pile_set_name": "DM Mathematics" }
-3 + (sqrt(15)/(sqrt(450)/sqrt(10)) + 2)*2. -14sqrt(3)/3 + 4/3 Simplify -61(4 + ((sqrt(76) - 64sqrt(76))/sqrt(4)5)2). -1507674 Simplify ((6(4 + sqrt(3) + 1)1 - (-2sqrt(375))/(12sqrt(5)))5)2. 16500sqrt(3) + 31575 Simplify (3sqrt(2)2 - sqrt(2) - 6(sqrt(2) + -1) - (sqrt(162) - (sqrt(162) + 0) - sqrt(2)23))2 + 3 + (sqrt(2)15 - sqrt(22)/(sqrt(11)-2))*2. 60sqrt(2) + 299/2 Simplify ((sqrt(153) - 4(sqrt(153) + (sqrt(153) - sqrt(153)1))) + -22sqrt(153))/((4sqrt(9)3 - sqrt(9)) + 1sqrt(144))2. -14sqrt(17)/15 Simplify (-1 + (5(-5 + sqrt(300)) + sqrt(300)-2-1)*2)2. -7000sqrt(3) + 30648 Simplify (sqrt(119)-13)/((sqrt(315)/sqrt(5))/sqrt(9)) - ((sqrt(170) + sqrt(170)-3 - sqrt(170))5)/(sqrt(40)/sqrt(4)-4). -27sqrt(17)/4 Simplify (3(-3 + (sqrt(2448)2 + 1 - sqrt(2448))5 - ((-2sqrt(2448) + sqrt(2448))-54 + -5)))2. -22680sqrt(17) + 4957641 Simplify 5-1((-3sqrt(4598) + sqrt(38))/(sqrt(200)1) + 1). -5 + 16sqrt(19) Simplify -3 + -6sqrt(10)/sqrt(5)-3 - -5(5 + -2sqrt(2) - (-2 + sqrt(32)))2. -402sqrt(2) + 602 Simplify (sqrt(3) - (sqrt(3) + (4(-1 + sqrt(3) - sqrt(3)))2)) + 5 + (-41sqrt(147))2 + (-1 + (sqrt(72)/(sqrt(8)-1))/sqrt(3)3)2. 6sqrt(3) + 2369 Simplify (1((sqrt(1900) + -1 + sqrt(1900)-1)-4 - (5 + sqrt(1900)-2 + 4 + -1 + sqrt(1900)))5)2 + -4. -2000sqrt(19) + 47896 Simplify 3(sqrt(105)/(sqrt(18)/sqrt(6) + sqrt(3)) + sqrt(35) - sqrt(140)/sqrt(4)1)/(sqrt(252) + 4-2sqrt(252) + (-2(sqrt(252)1 - sqrt(252)) - sqrt(252))). -sqrt(5)/32 Simplify (5-1sqrt(175)/sqrt(5))/(-1(5sqrt(245) + sqrt(245))) + 5. 5sqrt(7)/42 + 5 Simplify (sqrt(5) - sqrt(25)/sqrt(5))2 + 3 + ((sqrt(200)/sqrt(5))/sqrt(8))2 - (((sqrt(5) + -2)6)*2 - sqrt(20)/sqrt(100)). -316 + 721sqrt(5)/5 Simplify ((((1sqrt(1008) - sqrt(1008))-6)*2 + (sqrt(1008)2 - sqrt(1008))*2-6 - ((sqrt(1008)-2)2 + -5 - 2(-1 + sqrt(1008))*2)) + 2)1. -8055 - 48sqrt(7) Simplify 4 + -1(-4 + ((4-1(-1(sqrt(432) + -1) + sqrt(432)))2 + -5)5). -47 Simplify (3 + (5(sqrt(17) + sqrt(17) + 1 + -3 + sqrt(17)) - sqrt(170)/sqrt(40)4))*2-4. -11688 + 728sqrt(17) Simplify 1((1(-1sqrt(3000) + sqrt(3000) - sqrt(3000)))/(sqrt(10) - -5sqrt(30)/sqrt(3) - (sqrt(80)2)/sqrt(8))-4)2. 300 Simplify ((sqrt(720)2-5 - sqrt(540)/((sqrt(108)1)/sqrt(9) + sqrt(12))) + -5)*2 + -5. 1215sqrt(5) + 295325/4 Simplify (2((sqrt(76) - sqrt(76)3 - sqrt(76)) + 0 - (sqrt(76) + sqrt(76) + sqrt(76) + 1sqrt(76) + 4)) + 2)24. 1344sqrt(19) + 59728 Simplify (-5(sqrt(18) - -2sqrt(288)))/((sqrt(96) - (sqrt(96) + sqrt(96)-2 - sqrt(96))) + sqrt(6) + sqrt(450)/sqrt(3)). -5sqrt(3)/2 Simplify ((sqrt(105) - (sqrt(105) - (sqrt(105) - 1sqrt(105)))1)/((sqrt(33) + sqrt(297))/sqrt(11)))/(sqrt(1008) - (sqrt(1008) - -3sqrt(1008))). 0 Simplify (-3(3 + sqrt(468) + -2) + (sqrt(208) + -1 + -1)-1)*2. 44sqrt(13) + 6293 Simplify (((sqrt(108)2 + sqrt(108) + sqrt(108))5)/((sqrt(144)/sqrt(3))/sqrt(12)) - -2(-1 + sqrt(27)-1 - (sqrt(27) + (sqrt(27) + -1)-4)))2. -1440sqrt(3) + 15652 Simplify -4 + ((-4 + -2sqrt(405) - (sqrt(405) + 0 + 1))4 + ((sqrt(405) + 1 + sqrt(405))-5 - (-4 + sqrt(405)3)))*2. 9450sqrt(5) + 253562 Simplify ((41sqrt(88) - sqrt(88)1-4) + (sqrt(88) - 1sqrt(88))3-2)/((sqrt(224)2)/sqrt(7) - (sqrt(1152)1 + -5sqrt(32))). 4sqrt(11) Simplify (-5-4sqrt(672)-3)/((sqrt(150) + (sqrt(150) + 4sqrt(150) - sqrt(150))-2 + sqrt(150))2). 4sqrt(7) Simplify 6-2((sqrt(405) - -6(2sqrt(405))*2) + sqrt(405) + -2 + sqrt(405)-1 + -3 + -2). -116556 - 108sqrt(5) Simplify ((1sqrt(384))/((sqrt(2) - sqrt(2)-26) + sqrt(2)))/((sqrt(120) + (-1(sqrt(120)2 + sqrt(120) - sqrt(120)) - sqrt(120)) + sqrt(120))/sqrt(5)). -sqrt(2)/7 Simplify (((sqrt(4) - -1sqrt(4))-1 + sqrt(4) - 1sqrt(16))-3)/((-2(sqrt(128) + -1sqrt(128)) - sqrt(128) - sqrt(128))/sqrt(4)). -9sqrt(2)/8 Simplify -3 + (-4(sqrt(588) + -3)*2 - ((-2sqrt(1728))*2 + 2))1. -9305 + 336sqrt(3) Simplify (sqrt(17) - sqrt(153))-1 + -5 + -5 + (3 + sqrt(17) + -1 + sqrt(17) - (sqrt(153) + 1)) + -2. -11 + sqrt(17) Simplify 3(3(-2 + 3 + -2sqrt(1331)) - -3(0 + -2 + sqrt(1331) + sqrt(1331))-4)2. -53460sqrt(11) + 3595887 Simplify (2(sqrt(228) - sqrt(228)-2)-32)/((sqrt(132)-3 - sqrt(132) - sqrt(132))/sqrt(11) - sqrt(12) - (sqrt(1452) - (-3sqrt(1452) + sqrt(1452)))). 12sqrt(19)/13 Simplify (-1sqrt(684)/(sqrt(108)/sqrt(36)))/(((sqrt(12) - sqrt(108))6)/(-6sqrt(16))). -2sqrt(19) Simplify ((3((sqrt(5100) - sqrt(5100)-3) + sqrt(5100)))/((sqrt(18) + sqrt(2178)3)/sqrt(6)))*2 + -1. 5608/17 Simplify (-1 + -1 + (-2 + sqrt(125))6 + (sqrt(125) - ((sqrt(125) - sqrt(125)-2) + sqrt(125) + -3) - 2sqrt(125)-4))2. -1210sqrt(5) + 15246 Simplify ((sqrt(500) - (sqrt(500) + -2sqrt(500)-6) - -5sqrt(500)-1)/(22sqrt(1210)-4))2. 7225/15488 Simplify -2 + (-4(3 + sqrt(500)-2 - sqrt(500) - -3(1 + sqrt(500) + sqrt(500) - sqrt(500))))*2 + (-1sqrt(500)3 - (2 + (sqrt(500) - (1 + sqrt(500))))2)1. -30sqrt(5) + 573 Simplify ((sqrt(12) - (-2 + sqrt(12) + 1)) + (sqrt(72)2)/sqrt(6) - (3 + 0 + 1sqrt(108) + -5))2. -12sqrt(3) + 21 Simplify (-2sqrt(1815)-16)/(sqrt(125) - (sqrt(125)-2-4 - sqrt(125)) - -5sqrt(125)-2). -33sqrt(3)/20 Simplify ((sqrt(85)-4 - sqrt(85))-1 + 3(sqrt(85) + sqrt(85) + sqrt(85)1))/((sqrt(500) - -2sqrt(500)-6) + -5-1sqrt(500)). -7sqrt(17)/30 Simplify (-2 + (-3 + ((sqrt(90) + 4sqrt(90)1)/sqrt(10))/(sqrt(96)/sqrt(8)))3)*2. -165sqrt(3) + 1159/4 Simplify ((1sqrt(99))/sqrt(9) - (sqrt(33)/sqrt(3) + -1) - -5(sqrt(1331) + (sqrt(1331) - (sqrt(1331)13)*2))) + 4. -59890 + 110sqrt(11) Simplify -4 + 3(-2 + ((5(sqrt(153) + 0) + -4)*2 - ((sqrt(153) - -1sqrt(153))-2 - (-6(sqrt(153) + 1sqrt(153)))2))). -324sqrt(17) + 77609 Simplify -6(-4 + (-1(-1 + -5 + -2 + sqrt(605))3)2). -36102 + 9504sqrt(5) Simplify (-5 + -6(sqrt(468) - sqrt(468)4) - (4 + -5sqrt(468)2))*2. -3024sqrt(13) + 366993 Simplify 3 + ((sqrt(528) + -2-1sqrt(528))/sqrt(11))*2 + (sqrt(75)14)2 + -5 + -5. 1625 Simplify -2 + (1 + sqrt(1900) + -2sqrt(1900) - (2 + sqrt(1900) + -5) - (-2 + 5(sqrt(1900)2 + sqrt(1900))))*2. -2040sqrt(19) + 549134 Simplify 4((-62(-2sqrt(66))/sqrt(6))*2 + 5)6 + -3 + -3. 152178 Simplify (-3 + 1 + sqrt(19) + -2 + -4 + sqrt(19)2 + 3 + (sqrt(304) - (sqrt(304) + -1))5)*2. 171 Simplify 3(sqrt(975)-2)/(6sqrt(27) - sqrt(3))1. -30sqrt(13)/17 Simplify (4 + (sqrt(252) - (1 + sqrt(252) + 4)))-4 - (5(sqrt(252)2 + 0 + 4))2. -25596 - 2400sqrt(7) Simplify 5(((sqrt(1800)1)*2 + sqrt(1800))2 + -3)-3-2. 1800sqrt(2) + 107910 Simplify 2(-1 + ((sqrt(3744) - (sqrt(3744) - (sqrt(3744) - -1sqrt(3744)))) + sqrt(3146)1)/(sqrt(128) + sqrt(100)/sqrt(2)))*2. -140sqrt(13)/13 + 2476/13 Simplify ((-2sqrt(120))/(sqrt(45)6))/((sqrt(288)-1 - sqrt(288))3 + -2sqrt(288)1 + sqrt(288)). sqrt(3)/378 Simplify (sqrt(360)-5 - -3sqrt(160))/(2(sqrt(2) - sqrt(8)) + (sqrt(242) - (sqrt(242) - (sqrt(242) - sqrt(242)4 - sqrt(242))))). 9sqrt(5)/23 Simplify (((sqrt(64) - (sqrt(64)4 + sqrt(64)))-5)/(-1(4sqrt(392) + sqrt(392))) + 4)2. -64sqrt(2)/7 + 912/49 Simplify (-3(1sqrt(119)2 - (sqrt(119) - (sqrt(119) - sqrt(119)-2-2))))/(1sqrt(3388)-1). -3sqrt(17)/11 Simplify (sqrt(209)-1-4 + 2(sqrt(209) + sqrt(209)-2))/((2-1sqrt(11) - (sqrt(121) - sqrt(121)2)/sqrt(11))5). -2sqrt(19)/5 Simplify 4(0 + sqrt(448) + -3) - ((-1sqrt(567) + 2)2 - ((-2sqrt(567)1)2 + sqrt(567) + sqrt(567))). 86sqrt(7) + 1685 Simplify 3 + 3 + 4 + (0 + sqrt(3))*2 + (6sqrt(81))/sqrt(3) + 5. 18 + 18sqrt(3) Simplify (-3sqrt(540)-1-5)/((2sqrt(120)3)/(sqrt(120)/(sqrt(12) - sqrt(192)))). 5sqrt(5)/2 Simplify (-3 + (-4 + 6(sqrt(1216) + -1))-5 + 5 + -2 + 0)2. -24000sqrt(19) + 1096900 Simplify ((sqrt(4) - sqrt(324))/sqrt(2) - sqrt(72)1)2 - (-2sqrt(8) + sqrt(8) + -6sqrt(2)2 + -3)*2. -84sqrt(2) - 9 Simplify ((sqrt(204)-1-3 + 6(-2sqrt(204) + sqrt(204)))-1)/(4(sqrt(192) + 1sqrt(192)2)). sqrt(17)/16 Simplify -4 + 3 + (-4 + sqrt(300)5 + sqrt(300))2 + -4 + 1. -480sqrt(3) + 10812 Simplify 5 + (-1sqrt(4400) + -1 - (sqrt(4400) + (-12sqrt(4400))2) - (1(sqrt(396) + -1)*2 + 4)). -17997 - 28sqrt(11) Simplify ((sqrt(42	{ "pile_set_name": "DM Mathematics" }
ate 01/1(-18)/(-72). 0 Evaluate (6/68)/((5/10)/(-1)). -3/17 What is the value of ((12/70)/(14/(-98)))/(12/80)? -8 What is (((-10)/210-9)/((-3)/(-2)))/1? 2/7 Calculate ((-6)/(-165)60/4)/(270/1980). 4 Evaluate (-18)/264608/(-798)14. 8/11 8/(-215)(-6950)/(-5560) -2/43 Evaluate 20/67/(-6)360/(-56). 25 What is 12/(-192)(39/26)/(1/(-2))? 3/16 (-51)/15472110/(-15) 6/13 What is (37/74)/(((-252)/(-8))/7)? 1/9 Evaluate (16/24)/(((-18)/90)/((-78)/(-10))). -26 What is the value of 112/196((-84)/30)/((-8)/(-10))? -2 What is the value of (((-72)/9)/(-4))/(78/3)? 1/13 (-108)/24-43/180 3/10 (-2(-3)/(-1))/(7/((-1064)/(-171))) -16/3 What is the value of (4/4)/((-1)/(-7)9/(-36))? -28 Evaluate (28/50451)/(-21/4). -17/3 What is -107/(140/(-30))? 15 Calculate 187/945(9/2)/(-3). -1/5 ((-1)/4-2)/(63/(-144)4) -2/7 Evaluate -102/3(-73)/146. 0 What is (56/112)/(((-6)/(-48)-2)/(-4))? 8 What is the value of ((5/5)/(1-3))/(14/18)? -3/7 What is the value of 45/(-10)8/(-60)? 3/5 What is (1/3)/(((-64)/132)/(-16))? 11 (-5)/(-25)260/(-286) -2/11 (-2015)/1030/250 -18/5 Evaluate (2126/2912)/(-1). -3/16 Evaluate (364/(-13))/(-14)-1. -2 What is the value of (-232)/(-464)3-1? -3/2 What is the value of (11/((-1815)/110))/(16/18)? -3/4 Evaluate (23/(-3))/((1065/(-45))/(-71)). -23 ((-25)/75)/(2/1010/(-24)) 4 What is ((-546)/84)/((-117)/(-108))? -6 What is the value of 2/(-2)196/29445/2? -15 (2052/(-912))/((-6)/((-72)/5)) -27/5 What is (-4602)/(-118)(-2)/(-6)? 13 What is 18/12(-210)/456/(-693)? 2/33 What is 1/((-12)/56)99/(-18)? 21 What is the value of (((-2)/(-6))/((-65)/78))/(144/(-9360))? 26 What is (-2)/(8/(-468)9)? 13 What is (-36)/(-162)27/12-14? -7 Calculate (-2)/22225/30. -15 (23/92)/(10/7515/(-12)) -3/2 What is (57/(-912)100)/(30/(-16))? 10/3 Calculate (1/(-100))/(9(-7)/126). 1/50 Calculate (-195)/(-52)8/3. 10 What is (180/15(-1)/2)/(-22)? 3/11 What is ((-255)/(-225)5)/(1/((-12)/(-4)))? 17 Calculate (-522)/(-2349)15/4. 5/6 What is the value of ((-726)/66)/((-1)/((-1)/1))? -11 Calculate ((-2050)/3280)/(110/(-8)). 1/22 (-10695)/(651/21)1/(-15) 23 Evaluate ((-108)/(-504))/((-1)/41)-1. 6/7 3/(((375/(-250))/((-1)/(-1)))/16) -32 Evaluate (((-6270)/210)/19)/(((-4)/(-14))/(-1)). 11/2 Evaluate ((-384)/(-432))/((2/3)/1). 4/3 (2/(-57))/((-42)/189)(-16)/48 -1/19 (-30)/1(-386)/1737(-3)/(-2) 10 What is (-65)/(780/(-3192))4/28? 38 (9/420)/(498/1660) 1/14 (62/(-31))/(((-6)/(-4))/3) -4 Evaluate (-36((-7)/21)/(-1))/((-4)/(-3)). -9 Calculate ((-39)/(-26))/((-21)/140). -10 What is (33/(-99))/(50/(-12))5/(-2)? -1/5 Evaluate (-9)/6(-24)/(-4). -9 Evaluate (-195)/2344/20. -1/6 (72/(-56)28/(-6))/(3/(-7)) -14 What is the value of (-1106)/31648/(-21)? 8 What is the value of (-60)/(-75)180/12? 12 -49248/(-15190)(-110)/4 -22 What is (-3)/(-8)(-144)/126? -3/7 140/14((-1566)/36)/29 -15 Evaluate (75/150)/(26/6)2. 3/13 What is the value of (-24)/(-96)(-8)/(-3)1-3? -2 Calculate ((-27)/405)/((-18)/(-240)). -8/9 What is 24-3240/2560? -4 What is (24)/(((-22)/24)/((-1496)/408))? 32 (-5)/(-3)36/96 5/8 What is (-6630)/(-1105)(-8)/(-18)(-2)/(-8)? 2/3 What is (-172)/215(-10)/(-88)(-4)/14? 2/77 What is 36/((-2340)/(-91))? 7/10 Evaluate -1132/1232203/(-2). 29 (657/730)/(6/10) 3/2 What is 2/((3/(-36))/(6/24))? -6 What is the value of (-2)/(-16)376/(-94)? -1/2 Evaluate ((-4)/3)/(-2)-6(-673)/14806. 2/11 What is ((-12)/21)/(1/(-10)740/(-518))? -4 Evaluate (-1022)/153327/(-12)-18. -27 What is ((-19)/(285/5))/((-2)/54)? 9 What is (20/15-1)/2(-16)/8? 4/3 What is the value of (34/(-187))/(6/(33-2))? 2 (-16)/14((-1)/(-2))/(34/102) -12/7 Evaluate (-15)/(-840)28211. 11 Calculate ((-742)/106)/((-42)/(-18)). -3 ((43680/128)/(-39))/((-5)/12) 21 Evaluate (3/3)/(26/(-26)). -1 Evaluate ((-2550)/(-105))/17(-735)/35. -30 286/(-198)93/3 -13 Evaluate ((-1)/(-105))/(71/497). 1/15 What is (-90636)/10790(-10)/4? 21 (1742/(-335))/(20/50) -13 Calculate ((12/18)/(5/(-525)))/((-18)/9). 35 Calculate (-5(-2)/6)/((65/(-30))/13). -10 Evaluate 2/(68/(-1190)5). -7 What is the value of (26/13227525)/(3/33)? 2/37 Calculate (4/24)/(((-81)/243)/((-7)/(-1))). -7/2 Calculate ((72/15)/12)/(-5(-22)/4675). 17 What is (11/(682/(-31)))/(1/24)? -12 What is the value of (372/(-4557))/(44/14)? -2/77 (72/(-10))/(-2)195/117 6 (4/1)/((-370)/555) -6 Calculate (-37)/(74/(-8))10/(-4). -10 Calculate 11/((-55)/40)(-11)/(-44)-4. 8 Evaluate (3/2)/(2414/6944). 31 What is (4/(12/3))/((-4)/32)? -8 (-1548)/(-1290)(-3)/(6/5)-1 3 What is (2406/(-6416))/((-1)/(-104))? -39 (3367/(-1443))/((-7)/15) 5 -576/665-7(-2)/(-116) 2/29 What is the value of (62/(-310))/(((-12)/80)/(4/(-96)))? -1/18 3517/(-255)(-6)/1 14 What is the value of (-59)/((-8496)/(-180))8? -10 What is the value of ((-10)/(80/36))/((10/(-4))/(-5))? -9 Calculate (169/13)/(44/16). 13 What is (-202)/505(-3)/110/6? 2 Evaluate ((-10)/(-54))/((-8)/176-55). 2/27 Evaluate (-65)/2696/(-30)12. 16 What is the value of (-8)/112-77-2? -11 What is (5/(-3))/(16/24)(-4)/(-10)? -1 Evaluate (-48(-31)/2232)/(4/(-6)). -1 4/(-734/119) -2 (21/(-4)-8)/(5306/(-379)) -2/7 Evaluate (5/9)/((-900)/432). -4/15 What is ((-5)/10)/((-244)/(-16))? -2/61 -1((-4)/(-3))/(1786/(-141)) 2/19 What is the value of (-80)/(-12)333/2590? 6/7 Evaluate (-100)/15(-90)/(-120). -5 Calculate (16/(-10))/(2/(-10))19/418. 4/11 (-48)/30(-10)/12 4/3 What is (-18)/(-39)(1404/(-6))/(-18)? 6 Calculate (-514/(-210))/(3/27). 3 Calculate 32/((-1536)/(-72))6/(-1). -9 What is (-206)/3296(4/3)/((-4)/(-6))? -1/8 (-51)/((3-1)/(36/60)) 1 -1(528/(-3))/8(-6)/(-12) 11 What is (-744)/(-1023)55/(-70)? -4/7 Evaluate (-12)/(-27)-1(-11)/(-88)4. -2/9 Evaluate (-3)/2(72/(-30))/((-45)/50). -4 What is (-2)/((-96)/(-60))(-1)/5? 1/4 Evaluate (304/(-171))/(16/(-72)). 8 What is the value of (9261/(-42))/(-49)20/6? 15 What is -5(20/(-25))/226/13? 4 Calculate (5/20)/((-24)/1056). -11 What is the value of ((-2106)/(-1170))/(9/(-30))? -6 Calculate (1/(11/(-154)))/(72/21). -21 What is the value of 0/3(-284)/(-5680)? 0 What is (646/(-646))/(((-2)/26)/1)? 13 What is the value of (((-30)/(-3))/(-40))/((805/168)/(-23))? 6/5 Evaluate (824/(-103))/(((-84)/18)/7). 12 Calculate ((-412)/26368)/(2/8). -1/16 Calculate (-57(-9)/(-27))/((-21)/(-21)). -19 ((-58)/(290/25))/((-3)/((-18)/(-5))) 6 Calculate 12(-6)/2712/8. -4 What is ((-8)/(-90))/(446/(-1115))? -2/9 (58/(-5)(-690)/(-276))/1 -29 Evaluate ((-6)/(-7))/((1920/(-168))/40). -3 Calculate (1440/3848/(-6))/(10/4). -2 (1972/4446)/(17/13) 4/17 What is the value of (150/(-60))/((-2)/41)? 5 What is ((19/19)/20)/((-1)/(-12))? 3/5 What is the value of (4150/(-51875))/((-4)/30)? 3/5 Evaluate (3/(6/(-7)))/(66/(-72)). 7 What is the value of ((-6)/75)/((22/(-6))/((-70)/(-42)))? 2/55 What is the value of 18/2(10/(-10))/(-3)? 3 4/(-6)(-6240)/(-208) -20 156/6(6/8)/((-12)/8) -13 What is the value of (-15)/(-3)(-15)/10(-16)/(-380)? -6/19 -199/(-135)-15 -11 Evaluate (8352/2552)/((-20)/22). -18/5 Evaluate (2/((-40)/(-25)))/(-9(-95)/342). 1/2 Calculate (-78)/36(-6)/3927. 9 Calculate (-2440)/13421/(18/33). -10/3 Evaluate (-14)/756-183. 1 What is ((-20)/8)/(6/(-12)-1)? -5 (240/(-400))/(96/(-30)) 3/16 (10/183/(-4))/(420/(-756)) 3/4 What is the value of (((-1148)/84)/(-41))/((-1)/18)? -6 Calculate 7(-15)/42(-1218)/105. 29 What is ((-75)/(-6)(-8)/(-10))/(99/99)? 10 Calculate ((-8)/(-440))/(-3(-2)/(-20)-2). 1/33 What is (24/36)/((-5)/1-1)? 2/15 15631/(-812)(-2)/11-2 -7 Evaluate -15(8/30)/(54/(-135)). 10 (102/(-34))/(((-36)/32)/(6/(-8))) -2 What is the value of ((-336)/(-420))/(1/(-15))? -12 What is 2496/(-676)13/(-2)? 24 What is ((-2535)/14196)/(75/(-21))? 1/20 What is the value of ((-3)/(-1))/(296/(-888))? -9 Calculate (1-4)/(((-286)/65)/(-11)). -10 Calculate 2(1/((-8)/16))/(-34). 2/17 Calculate (8/(-10))/(208/(-260)). 1 What is (4/602)/(6(-2)/120)? -4/3 What is the value of (-2)/31-12(-40)/(-480)? 2/31 Calculate ((-34)/289)/((-58)/10353). 21 1/(((-30)/300)/((-7)/5)) 14 Calculate (0/2)/3(-16)/(-80)5. 0 Evaluate -1198/(-5148). 2/13 Calculate (160/(-960))/((((-4)/30)/1)/2). 5/2 What is (50/175)/((-9)/((-1701)/6))? 9 What is (((-10)/2)/5-1)/((-4)/(-1))? 1/4 What is 8/(-8)(-17)/(34/(-2))	{ "pile_set_name": "DM Mathematics" }
- z. What is the remainder when q is divided by 13? 4 Let o = 101 + -91. Calculate the remainder when 26 is divided by o. 6 Let z = -224 - -238. Calculate the remainder when z is divided by 4(-2)/(-8)9. 5 Suppose -5n + 392 = 5l + 1117, -2n + l - 296 = 0. Let k = 202 + n. Calculate the remainder when 107 is divided by k. 52 Let y(q) = -2q*3 - 14q*2 - q - 4. Calculate the remainder when y(-8) is divided by 2. 0 Let b(y) = -3y - y*3 + 67 - 61 + 8y*2 - 5y. Calculate the remainder when b(6) is divided by 11. 8 Let j be ((-14)/49)/(2/(-14)). What is the remainder when 1/j(20 - 2) is divided by 6? 3 Suppose -484 = 3y - 14y. Calculate the remainder when 393 is divided by y. 41 Let q = -68 - -60. Calculate the remainder when -184/q29 is divided by 53. 49 Let p be -1(-4)/(4/3). Let m be 8 + (2 - 2 - p). What is the remainder when 19 is divided by 5/(m/14) + -3? 8 Let z(k) = k*2 + k - 9. Let n be z(-4). Suppose 0 = -j + g + g + 6, nj - 36 = -3g. What is the remainder when 27 is divided by j? 7 Let h = -148 + 52. Let r = -57 - h. What is the remainder when r is divided by 19? 1 Let z = -720 + 761. Calculate the remainder when 119 is divided by z. 37 Let f = -137 + 186. What is the remainder when f is divided by 2/8 + (-204)/(-16)? 10 Calculate the remainder when (-1)/4 - (-40662)/216 is divided by 27. 26 Suppose 306 + 46 = 11y. Calculate the remainder when 383 is divided by y. 31 Suppose -32o = -31o - 3. Suppose -4k + 5k = o. What is the remainder when 26 is divided by 4 + (-1 - k) + 14? 12 Let c = 44 - -7. Let s = c + -42. Calculate the remainder when 43 is divided by s. 7 Calculate the remainder when (-21)/(3 + -4) - 5 is divided by (-6)/(-12) + -2 - 42/(-4). 7 Let f = -145 - -346. Suppose 8g - 363 = -91. Calculate the remainder when f is divided by g. 31 What is the remainder when (0 - (-8)/10)/(8/1160) is divided by 20? 16 Let i be 132/4 + 4/(-2). Let k = i + -13. Calculate the remainder when k is divided by (-1 - (-4 + -2))1. 3 Suppose 86o = 12281 - 1273. What is the remainder when o is divided by 49? 30 Let o(h) = h3 - 5h*2 + 5h - 7. Let v = 65 + -60. What is the remainder when 33 is divided by o(v)? 15 Suppose -2v + 3z + 14 = 0, 5v + 5z + 6 - 66 = 0. Suppose k + 2y - 56 = -22, -4k + 112 = 2y. What is the remainder when k is divided by v? 6 Let l(j) = 2j - 5. Let y(i) = 34i3 - 2i*2 + 1. What is the remainder when y(1) is divided by l(7)? 6 Suppose -5l - 437 = -2s, -4 = -3l - 19. Let g = -143 + s. What is the remainder when g is divided by 22? 19 Let d(k) = k*3 - 6k*2 - 11k - 7. Suppose -2s = 3s - 5v - 15, 3s = -v + 29. Calculate the remainder when 162 is divided by d(s). 30 Let a be (2/4-1)/((-46)/1012). Let u = 6 + 0. Suppose 0 = uw - 5w - a. What is the remainder when w is divided by 6? 5 Suppose -24o - 2o = -2002. Calculate the remainder when 306 is divided by o. 75 Suppose g + 59 = 2g + 2n, -3n + 12 = 0. What is the remainder when g is divided by 10/(-15) + 166/6? 24 Suppose 65 = 5o + 25. What is the remainder when 37 is divided by o? 5 Let i(y) = -9y - 3. Let m be i(-3). Suppose l + 2l = m. Calculate the remainder when l is divided by 5. 3 Suppose -314 = -3b - 56. Let g(n) = -n*3 - 4n*2 + 5n. Let k be g(-5). Suppose 0 = -kh - h + b. What is the remainder when h is divided by 22? 20 Let q = -600 - -696. What is the remainder when 381 is divided by q? 93 Calculate the remainder when 404 is divided by 219/8 + (-21)/56. 26 Let m(f) = 9f + 100 - 63 - 57. Let p be (-13)/42-2. Calculate the remainder when m(p) is divided by 25. 22 Let f be ((-130)/15)/115/(-2). Let y = -56 + f. Calculate the remainder when 24 is divided by y. 6 Suppose 0 = -2z + 3n + 265, 0 = 4z + 5n + 220 - 717. Calculate the remainder when z is divided by 62. 4 Suppose -4q + 2678 - 1102 = 0. What is the remainder when q is divided by 59? 40 Let v = -112 - -115. Suppose -5s = -k + 6, k + 2s + 36 = vk. Let d = 19 - 7. Calculate the remainder when k is divided by d. 9 Suppose 0 = 63d - 2870 - 1036. Calculate the remainder when d is divided by 13. 10 Let i(v) = 3v + 13. Let z be i(-3). Suppose -91 = -2s - n + 105, 2s + 5n - 196 = 0. Calculate the remainder when s is divided by (-6)/12 - ((-114)/z - -3). 23 Let s(y) = 21y + 576. Suppose 1 + 5 = 3o. Calculate the remainder when s(-27) is divided by o. 1 Suppose -74 = -4d + 166. Calculate the remainder when d is divided by 4. 0 Suppose -4b = -4, -3m = -5b + 9b - 118. What is the remainder when m is divided by 13? 12 Suppose -5u + 70 = 25. Let c = -9 - -9. Suppose 13y = -cy + 208. Calculate the remainder when y is divided by u. 7 Let c(z) = 2z2 - 113z - 813. What is the remainder when 149 is divided by c(-7)? 73 Let s(x) = -x*3 - 7x*2 - 7x + 6. Let i be s(-5). Let l(n) = -n - 6. Let m be l(i). What is the remainder when ((-24)/7)/(m/(-21)) is divided by 13? 11 Let a(o) = -17o - 21. Calculate the remainder when 385 is divided by a(-2). 8 Suppose 9x - 90 = 4x. Suppose -23 + 56 = 3g. Calculate the remainder when x is divided by g. 7 Let l be (36 + (1 - 0))7. Let v(o) = -12o - 14. Let d be v(14). Let c = d + l. Calculate the remainder when c is divided by 20. 17 Let k = 1214 - 807. Calculate the remainder when k is divided by 10. 7 Suppose 4k - 4c + 21 = 101, 0 = 4k + 2c - 86. Let h = k + -6. What is the remainder when 58 is divided by h? 13 Let c(q) = 9q + 3. Let g = -6 - -4. Let x be c(g). Calculate the remainder when (27/x)/((-2)/30) is divided by 7. 6 Let f(s) = -7s - 3. What is the remainder when 75 is divided by f(-1)? 3 Suppose 12 = 4r - 6z - 26, 0 = -r - 3z + 5. Let f(i) = 2i - 3. What is the remainder when f(12) is divided by r? 5 Let t = 6 + -6. Let s = 5 + t. What is the remainder when 63 is divided by 2/5 + 78/s? 15 Let d(t) = t*2 + 4t - 5. Let m be d(-6). Let y(q) = -3q + m + 16 + q + q. Calculate the remainder when 31 is divided by y(6). 14 Suppose -5f = -14 + 4, -f = 4z - 22. Suppose r + 5q - 3 = 0, -4r - r + zq = -75. Calculate the remainder when 127 is divided by r. 10 Calculate the remainder when 126 is divided by (4/(-12))/(19/(-3876)). 58 Let k(q) = q*2 - 31q + 9. What is the remainder when 98 is divided by k(32)? 16 Suppose 3j = -2j + 5, 5d - 244 = j. What is the remainder when d is divided by 35? 14 Let o(c) be the second derivative of c4/6 + c3/6 - c2 - c. Calculate the remainder when o(3) is divided by 11. 8 Let v be -4 - (-7 - -1)16. Let a = v + -32. Let r = a - -40. Calculate the remainder when r is divided by 34. 32 Let f(u) = -14u - 165. What is the remainder when f(-17) is divided by 20? 13 Let c = -58 - -81. Let x = -40 - -85. What is the remainder when x is divided by c? 22 Let k = 7 - -29. What is the remainder when 3/9-181575/(-42) is divided by k? 28 Calculate the remainder when 117 is divided by 4/18 - (-77)/12652. 21 Let w = -60 + 32. Let o = 1 - w. What is the remainder when 114 is divided by o? 27 Let q(y) = y2 + 10y - 13. Let x be q(-11). Suppose 10 = -3t + 25. Calculate the remainder when -6 - -9 - (0 + x) is divided by t. 0 Suppose -5m + 221 = 2v, -5m + 137 = -2m - v. Suppose m = 13r - 4r. What is the remainder when 23 is divided by r? 3 Let v = -340 - -213. Let r = -53 - v. Calculate the remainder when r is divided by 15. 14 Suppose 0 = 2v - 2, -4o + 2v + 116 = -46. Calculate the remainder when 323 is divided by o. 36 Let f be (135 - 9)/(3/2). Suppose 0 = -t + 4t - 450. Let s = t - f. What is the remainder when s is divided by 23? 20 Let m(z) = -2z - 4z2 - 14 + 10 - 4z - 2z3. Let s be m(-4). Let j = s - 49. What is the remainder when j is divided by 12? 11 Let h(p) = -10 - 10 - 4 + 4p - 3. What is the remainder when 49 is divided by h(11)? 15 Let g = 103 + -123. What is the remainder when g/(-8)22 + 3 is divided by 21? 16 Let k be -6(-8)/(-12) + 34. Suppose 2p - k = -5l, 2p - 5l - 1 = -11. What is the remainder when p is divided by ((-3)/(-2))/(-3)-4? 1 Suppose 9c - 5n = 12c - 29, 2c + 2n = 22. Suppose 0r + 44 = 4r. What is the remainder when c is divided by r? 2 What is the remainder when (1512/2940)/((-6)/(-430)) - (-1)/7 is divided by (-4)/6 - (-44)/3? 9 Let p be 4(-2)/(-6)9/6. Calculate the remainder when	{ "pile_set_name": "DM Mathematics" }
-84, -492, -1232, -2334, -3828? -5744 What comes next: 14380, 29031, 43702, 58399, 73128, 87895, 102706, 117567? 132484 What is next in -68491, -139499, -210505, -281509, -352511? -423511 What comes next: 73, 400, 1155, 2536, 4741, 7968? 12415 What comes next: 7579182, 7579183, 7579184? 7579185 What comes next: 9278950, 9278949, 9278948, 9278947, 9278946? 9278945 What is next in 4560, 8923, 13284, 17643, 22000? 26355 What comes next: -1284, -2679, -4228, -5985, -8004, -10339, -13044? -16173 What is the next term in 24251, 97301, 219055, 389519, 608699, 876601, 1193231? 1558595 What comes next: -77323599, -77323601, -77323605, -77323611? -77323619 What is next in 832, -66, -1532, -3542, -6072, -9098, -12596, -16542? -20912 What is next in 34916, 31607, 28298, 24989, 21680? 18371 What comes next: -97394, -194722, -292050, -389378? -486706 What is next in 88997, 177774, 266529, 355262, 443973? 532662 What comes next: 5090006, 5089967, 5089928? 5089889 What is the next term in -190857, -191478, -192099, -192720, -193341? -193962 What is next in 116791, 116411, 116031, 115651? 115271 What comes next: -101585, -101032, -100111, -98822, -97165, -95140, -92747? -89986 What is the next term in 1028930, 2057871, 3086824, 4115789? 5144766 What is next in 1045097449, 1045097450, 1045097451? 1045097452 What is next in 1587230, 3174438, 4761646? 6348854 What is next in 15604, 15781, 16082, 16513, 17080, 17789, 18646, 19657? 20828 What is the next term in -2587890, -2587893, -2587896? -2587899 What is next in 400246, 400024, 399654, 399136? 398470 What is next in -350520, -350580, -350654, -350748, -350868, -351020, -351210, -351444? -351728 What comes next: 3836, 10190, 19070, 30482, 44432? 60926 What comes next: 33, 255, 1193, 2841, 5193, 8243, 11985, 16413? 21521 What comes next: -2728, -10912, -24554, -43654, -68212, -98228? -133702 What comes next: -666644, -666383, -666122, -665861, -665600, -665339? -665078 What comes next: 37588, 73790, 109980, 146164, 182348, 218538, 254740, 290960? 327204 What comes next: -56271, -112563, -168869, -225195, -281547, -337931? -394353 What is the next term in -2232, -18293, -61890, -146793, -286772, -495597? -787038 What is the next term in -69856020, -69856032, -69856052, -69856080, -69856116? -69856160 What is the next term in -40937, -41298, -41659? -42020 What is the next term in -25219299, -50438601, -75657905, -100877211, -126096519? -151315829 What is the next term in 168302, 336789, 505276, 673763? 842250 What is the next term in 3411, 13722, 30905, 54960? 85887 What comes next: 24593, 24369, 23995, 23471? 22797 What is next in 5051, 40369, 136297, 323159, 631279? 1090981 What comes next: -230495, -229702, -228377, -226520? -224131 What comes next: 11248290, 22496581, 33744872, 44993163, 56241454? 67489745 What comes next: -34271, -274117, -925093, -2192765, -4282699, -7400461, -11751617? -17541733 What is next in -53148, -106372, -159594, -212814, -266032, -319248? -372462 What is next in -981092, -3924380, -8829868, -15697556, -24527444, -35319532, -48073820? -62790308 What is next in -2764, -3075, -980, 3521, 10428, 19741, 31460? 45585 What is next in -5445, -12393, -23975, -40197, -61065, -86585, -116763, -151605? -191117 What is the next term in -43111704, -43111702, -43111700, -43111698, -43111696? -43111694 What is the next term in -427802, -427806, -427810, -427814? -427818 What is the next term in -52661088, -52661091, -52661094, -52661097, -52661100, -52661103? -52661106 What comes next: 431421030, 431421025, 431421020? 431421015 What is the next term in -5742, -5677, -5530, -5301, -4990? -4597 What comes next: -7050, -6935, -6598, -5925, -4802? -3115 What comes next: 755, -3704, -11119, -21490, -34817? -51100 What is the next term in -4310, -8951, -13918, -19211, -24830, -30775? -37046 What is the next term in 16, 166, 382, 700, 1156, 1786? 2626 What is the next term in 32968, 33336, 33704? 34072 What is the next term in -34280, -90736, -169382, -270224, -393268, -538520? -705986 What is the next term in 448, 1378, 2780, 4648, 6976, 9758, 12988, 16660? 20768 What comes next: -143890, -143623, -143342, -143041, -142714? -142355 What is next in -474, -6477, -22714, -54285, -106290, -183829, -292002? -435909 What comes next: 148614, 297082, 445536, 593970, 742378? 890754 What is next in 253623, 507240, 760857, 1014474, 1268091? 1521708 What is the next term in 23122, 45941, 68760, 91579, 114398? 137217 What is the next term in 3929, 15909, 35899, 63899, 99909? 143929 What is the next term in -1352, -1714, -2314, -3152? -4228 What comes next: -55527, -53652, -51775, -49896? -48015 What is next in 2313791, 2313785, 2313779, 2313773? 2313767 What is the next term in -33698, -31963, -29076, -25043, -19870, -13563? -6128 What is the next term in -49360, -49368, -49384, -49414, -49464, -49540, -49648, -49794? -49984 What is next in 3463815, 3463811, 3463797, 3463767, 3463715, 3463635? 3463521 What comes next: 234367215, 234367211, 234367207, 234367203, 234367199? 234367195 What is next in 103572, 414301, 932182, 1657215? 2589400 What comes next: 1874700, 7498795, 16872296, 29995209, 46867540, 67489295, 91860480? 119981101 What is next in -63663, -63320, -62977, -62634, -62291? -61948 What is the next term in -512, -2117, -4888, -8909, -14264, -21037, -29312, -39173? -50704 What is the next term in -45829, -91637, -137407, -183121, -228761, -274309, -319747, -365057? -410221 What comes next: 105872845, 105872847, 105872849? 105872851 What is the next term in 33098, 264558, 892786, 2116160, 4133058, 7141858? 11340938 What comes next: -1552, -995, -78, 1193, 2812, 4773, 7070? 9697 What is the next term in -101215, -404628, -910239, -1618048, -2528055, -3640260? -4954663 What is next in 23282340, 23282311, 23282282, 23282253, 23282224? 23282195 What is the next term in -2827276, -2827280, -2827286, -2827294, -2827304, -2827316, -2827330? -2827346 What is next in -39085, -157558, -355021, -631474? -986917 What is next in 173788892, 695155579, 1564100058, 2780622329, 4344722392, 6256400247, 8515655894? 11122489333 What is next in -31475083, -31475045, -31474981, -31474891? -31474775 What is next in -5562163, -22248666, -50059505, -88994680, -139054191? -200238038 What is next in 8349, 6719, 5097, 3483? 1877 What is the next term in 5838, 46737, 157806, 374145, 730854? 1263033 What is next in 797773984, 797773985, 797773986, 797773987? 797773988 What comes next: 183784, 367597, 551412, 735229, 919048, 1102869, 1286692? 1470517 What comes next: 1325468, 2650726, 3975984, 5301242, 6626500, 7951758? 9277016 What comes next: -182548, -182562, -182576, -182590, -182604, -182618? -182632 What comes next: -39790, -79038, -118308, -157612, -196962? -236370 What is the next term in -9756125, -39024588, -87805351, -156098408, -243903753? -351221380 What is next in 1011504, 1011527, 1011566, 1011621, 1011692, 1011779? 1011882 What comes next: -250289, -250315, -250361, -250427? -250513 What is next in 1539552, 3079080, 4618608, 6158136, 7697664? 9237192 What comes next: 2816, 5425, 8032, 10637, 13240, 15841? 18440 What is the next term in 17625404, 17625411, 17625430, 17625467, 17625528, 17625619, 17625746? 17625915 What is next in -85521, -171042, -256563, -342084, -427605, -513126? -598647 What is the next term in 2025, 2074, 2137, 2220, 2329? 2470 What is the next term in -117028, -234077, -351128, -468175, -585212? -702233 What is the next term in 76986, 77046, 77132, 77250, 77406? 77606 What is the next term in -2024968, -4049922, -6074870, -8099812? -10124748 What is the next term in -3624, -1188, 1250, 3690, 6132? 8576 What comes next: 5643540, 5643520, 5643488, 5643444, 5643388? 5643320 What comes next: -68800, -274903, -618408, -1099315, -1717624, -2473335, -3366448? -4396963 What is the next term in -103898, -208289, -312680, -417071, -521462, -625853? -730244 What comes next: 206366, 206368, 206368, 206366, 206362, 206356, 206348? 206338 What is the next term in -286418, -572813, -859208, -1145603? -1431998 What is next in 6305018, 12610043, 18915080, 25220135, 31525214, 37830323? 44135468 What is next in -1948503, -3897007, -5845511, -7794015? -9742519 What is the next term in 1309151, 1309154, 1309157? 1309	{ "pile_set_name": "DM Mathematics" }
ii/(i/(i(ii7)/i)))/i))(2/37) assuming i is positive. i(-71747/370) Simplify (o9o*(13/2)(o/(o*14/o)o)/(oo/(oooo(1/3))))17 assuming o is positive. o*(595/6) Simplify (fff/(f(-1/12)/f)ffff(-3/11))(-31)/((fff(-4)f)/f*1f*8/fff7) assuming f is positive. f(-29585/132) Simplify ((i(1/2)i*(3/4))/(ii(i(i*(-4/9)i)/i)/i)20)(-34/3) assuming i is positive. i(18275/54) Simplify (r25rr(1/46))/(r(-38)r(13/2)/r) assuming r is positive. r(1346/23) Simplify (((g/g(-2/73))/(g/(g15g)))13)(-2/65) assuming g is positive. g*(-468/73) Simplify (((ff(-8))/f)(-14)(f(-4/5))(1/6))(3/38) assuming f is positive. f(839/95) Simplify (((l(4/3)/l)/ll)/(l*4/ll))/(l/l*(-3/2)l/(((ll1)/l)/l)l)(l(1/5)/l)(-25)(ll/(ll(-5/6)))/(l/l4) assuming l is positive. l*(50/3) Simplify ((mmm(-2/5)mmm)43/(m5m(-2/19)m))(-7) assuming m is positive. m(-127617/95) Simplify ((m(-1/4))19)*(3/11)(m0)(-5)(m(-2))15 assuming m is positive. m(-1377/44) Simplify ((m/(mm*(-1))m)(-22))(-8/17)/(((m*3m)/mm)/mmm(-1/2)m)(3/19) assuming m is positive. m(12917/646) Simplify ((ii(-6/5)i)/(i*(3/2)i))/(ii(-2/7)/i)37ii(-2/9)i*(-2/3)ii(-7)ii3i assuming i is positive. i*(5029/630) Simplify (ddd(-8)d)*(-1/10)((d*31d)/dd)(-7/3) assuming d is positive. d(-445/6) Simplify ((l/(ll/(lll3)))/l(1/3))*(-38)(ll(-2/3)l)/(lll*2/llll)((l(-5)/l)/l)/(l/l(-6)) assuming l is positive. l(-158) Simplify (a/(aaa(-10)a))*32((a(1/54)/a)/a)(-26) assuming a is positive. a*(8303/27) Simplify (ii/i*(-2/67)ii)/ii/(i/i*(-22))ii/((i(7/3)/i)/i)iii/(ii(2/15)) assuming i is positive. i(-15514/1005) Simplify (((nn*(3/16)nn)/(n/n(-10/9)n))/((((n(-2/3)/n)/n)/n)/n(2/7)))(4/3) assuming n is positive. n(4061/756) Simplify (s*(-1/4)s(-8))/(s(3/4)s/(ss/(s*(-5/6)/s)s))((s(-5))(-23))(-34) assuming s is positive. s(-23491/6) Simplify ((j/j(-1/3))/(jj*(2/17)/jj)(j/j0)(2/17))/((j/(j(-1/6)j)(j/(j/(jj*(-7)))jj)/j)/(j(3/7)j/(jj5))) assuming j is positive. j(25/42) Simplify n(-2/15)nn(-2/9)n/(n/n*(-5))n*0((n(-3)/n)/n(-1))/(n*(-3/10)nn5n) assuming n is positive. n*(-253/18) Simplify (nn*7)/nn*(-4/7)n((n/n4)/n)/(((nn*(3/5))/n)/nnn)(n(-2))(-17/7)(n(-2/5))(-45/7) assuming n is positive. n(324/35) Simplify ((u(2/11)u/(u/u(-5)))/((u(3/4)u)/(u((((u*(1/4)u)/uu)/u)/u)/u)))/(u2u((((u(-6)u)/u)/u)/u)/u)(8/11) assuming u is positive. u(-65/22) Simplify (r*(-1/2)r(rr7/r)/r)(-45)(rr*(-4)(r/((r/((r*(-6)r)/rrrr))/r))/r)/(r(1/4))(8/7) assuming r is positive. r(-4183/14) Simplify (((((gg*(-32)/gg)/g)/g)/(g/g5))(1/4))(18/13) assuming g is positive. g(-261/26) Simplify ((ss(-4/3))/s(ss(-1/29))/ss*(11/3)s33)(-23) assuming s is positive. s(-70633/87) Simplify (g2/g*(-1/3)g*(3/8)/(gg*(-6)g))/((g*(2/3)g)/(gg3))(-6/19) assuming g is positive. g(2723/456) Simplify (t(-14)/(((tt*17)/t)/t)(ttt(2/25)/t)(-5/7))29 assuming t is positive. t(-31233/35) Simplify (((a/a(-8))/a)(9/4)/(aa(-4/3)a(-27)))8 assuming a is positive. a*(1088/3) Simplify (kk*0kkk/(k/k*(-16)k)(k13k)/(k*(7/5)k))(-2/13) assuming k is positive. k(24/65) Simplify ((yy(-7/6)y*9yy)/((yyy13)/(y/y8)))(-2/5) assuming y is positive. y(67/15) Simplify (p(-1/21)p*41)/(pp(1/8))(-8/13) assuming p is positive. p(11369/273) Simplify (((x(-8)/(x/((x/(x(x/(xx*12xx))/x)xxx)/x)))33)(-50))(-3/26) assuming x is positive. x(19800/13) Simplify h*(3/4)h*(-3)h*(3/4)h/(h/((h/((h(hh*(-1)/h)/hh)/h))/h))((h/((h(-9)/h)/h))/(hh*(1/4)))/((hh5)/(h(-1)/h)) assuming h is positive. h(9/4) Simplify i(-12)ii*(-1/3)ii/i(-2/79)i/(((i(-29)/i)/i)/i) assuming i is positive. i(5615/237) Simplify ((l*(-15)((ll(l/l*(-19)ll)/l)/l)/llll)/(l*(-2/15)ll2))(2/47) assuming l is positive. l(184/705) Simplify ((q(-5))9)(-5/6)/((qqq(-4))/qq/(q*(-2)q)q(-3)/(q/((qq*(2/3)q)/q))) assuming q is positive. q*(245/6) Simplify ((w/(w/(w(w(w/((ww*(1/8))/w))/w)/w))ww)/(w/w(1/3)))(-1)w*(1/2)/wwwww/((w0/w)/ww)(w/(w(2/7)w))(1/100) assuming w is positive. w(9613/4200) Simplify (((hh(-5))/h17)/(h(2/9)h)(-34))1 assuming h is positive. h(185/9) Simplify k(2/7)/((k*(2/15)k)/k)(k(-1/2)/k)(-2/65)((k/(k*(3/7)k))23)(-29) assuming k is positive. k*(390466/1365) Simplify ff/(ff/f(-7))ff/f6f((f/f(1/2))/f)/((f(-2/5)f)/f)((f/((f(-3)/f)/f)f)/f)/(ff(2/9))f*(-2)(ff(3/5)f)/f assuming f is positive. f(-103/18) Simplify (j(3/7)j(2/11)/j)31/((jjj1)/(j(-1)j)j0j5) assuming j is positive. j(-1546/77) Simplify ((i/i(1/4))(-3)/(ii0i*(-2/3)))/(((i/(iii/i0))/i)(-9/5)(ii(1/2)/ii)33) assuming i is positive. i(-3449/60) Simplify (l(ll/(llll/(l/(l/(l/l(-5/2))))))/ll(-1/8))/((l/l(-2/9))/(l*(-7/3)l))(l(-1))20(l(-2/7)/l)/l(-1/5) assuming l is positive. l(-56111/2520) Simplify (l(2/3))*(3/7)((l/(l*(2/17)/l))/l)/((l/(ll*(2/7)))/l)((l0)(-11))7 assuming l is positive. l(292/119) Simplify (jj(-6)j(1/3))(4/15)/((j*6j(jjj/(jj*(1/2)j)jj)/j)/(j/(jj/(j6/j))j/(jj(-3/7)j))) assuming j is positive. j*(-3979/630) Simplify ((qqq(3/2))/(qqq/q(-5/2))(qqq(-3/4))(14/3))(-2/107) assuming q is positive. q(-23/321) Simplify (pp(p/((pp(1/4))/p)p)/ppp5)(-1/11)/((p1)(3/4)/(p/p*(2/15)(p(1/3)/p)/p)) assuming p is positive. p(-129/55) Simplify (((f(-1/4)/f)/f)15)*43((ff(1/9))/f(ff3)/f)/(f/(f/f8)f/(f*(-6)/f)ff) assuming f is positive. f(-52781/36) Simplify (g(-4)g4/g)/(g0/(g*(1/13)g))g4g*(-3/2)(ggg/(g/(((gg0)/g)/g)))(2/17) assuming g is positive. g(1191/442) Simplify (((v/v(2/7))/v)14)(-2/9)v4/(v/v(-5))(v/(v(-1)/v))45 assuming v is positive. v(1205/9) Simplify k/(kkk(5/2))kk/(k(-5)k)k(k/(k*(2/17)kk))/(k/(k(-2/15)/k))(k*(-5/6)k7)(-36) assuming k is positive. k(-113093/510) Simplify ((a/(a/a(1/8))a)44/(a0/aaaa(7/4)))(-1/26) assuming a is positive. a(-187/104) Simplify w(-5)(w/(w/w(-6)w))/ww(w0)(2/41)((w/(w(-1)/w))(-15/7))(-25) assuming w is positive. w(1041/7) Simplify (((rr(-1)/r)(1/64)(rr*(2/3)r)(5/7))(13/3))6 assuming r is positive. r(33007/672) Simplify ((b/(b(-5)/b))/(b/b(1/4)bb))/((bb/(b(1/4)bb))/b)34(b(-1))(-48)/(b*(3/2)/((b(bb/b3)/bb)/b)) assuming b is positive. b(369/4) Simplify ((j(-1/7))38)(-1/22)j(-8/5)jj/(j(1/12)j)j(((j/((jj1j)/j))/j)/jj)(-2) assuming j is positive. j(21083/4620) Simplify (((y(y*(2/87)y)/y)/(y(y/(yy/((yyy(3/25)/y)/y)))/y))/(y29)(1/6))(2/9) assuming y is positive. y(-4249/6525) Simplify (r(-7)rr*(-5/2)r*(-2/69)/(rr(-1/10)))(-2/9) assuming r is positive. r(6506/3105) Simplify (z(2/35)(z(z/(z*(1/4)/z))/z)/zz*(-3/19)/(zzz(-2/51)))27 assuming z is positive. z(-1601307/45220) Simplify ((z(2/3)/z)9)(4/17)/((z2)(2/31))(34/5) assuming z is positive. z(-4172/2635) Simplify (q(3/5)/(q/(qq/(q/(q/q*5)qqq)))q(-5/6)q1)16 assuming q is positive. q(-1496/15) Simplify ((n/(n/n3)n)/(n20n))/(n30)(-2/25) assuming n is positive. n*(-73/5) Simplify (z/(zzz/z(-4))zz7)34/((z(-5)zz(-1/6)z)/((z*6z)/(z*(-3)zz))) assuming z is positive. z(475/6) Simplify ((q1)(-34)(qq/q(2/9))/q(-7/2))/((qq*(-1/2)q)*(-23)((q*(2/3)q)/q)30) assuming q is positive. q(-128/9) Simplify (c/(cc4)c)/((c/c*(-1)c)/c)(c(-1/3)/cc)*(25/2)(c*4c/(cc/(cc(3/5))))(-35) assuming c is positive. c*(-1021/6) Simplify ((c/(c/(cc*6cc))c(-1))/(((c4c)/c)/(c((c/((cc(1/4))/c))/c)/c)))/(c4c*(3/4)c*(-7)/(ccc(-2/5)cc)) assuming c is positive. c(48/5) Simplify (bb/b*(-13)b	{ "pile_set_name": "DM Mathematics" }
n2 + 0 - 8n + 11. Let q(d) = -d*2 + 5d - 5. Let a(c) = -8q(c) - 5r(c). What is a(t(w))? 12w2 Let g(q) = -6q. Let h(b) = 2b2 - 3b - 3. Let a(m) = 6m2 - 10m - 10. Let d(w) = -3a(w) + 10h(w). What is g(d(o))? -12o2 Let w(j) = -2j*2 + 17. Let a(u) = 68u*2. Determine w(a(z)). -9248z*4 + 17 Let g(s) = 156s + 5. Let u(k) = k*2. Determine g(u(n)). 156n*2 + 5 Let w(v) = -4v*2 - 8v. Let q(x) = 118x. Calculate w(q(a)). -55696a*2 - 944a Let o(i) = -7i + 7i - 2i2 + 3i2. Let k(n) be the second derivative of -n4/4 - 2n. What is o(k(t))? 9t*4 Let b(k) = -k - 3. Let y be b(-6). Let z(w) = -4w + 0w + 2w + yw. Let g(s) = -5s. Calculate z(g(r)). -5r Let u(y) = -y - 163. Let p(w) = -2w. Give u(p(k)). 2k - 163 Let b(h) = -863h. Let i(u) = 2u2. What is b(i(r))? -1726r2 Let k(c) = c2. Let d = -13 - -8. Let g = -3 - d. Let q(z) = 6 + 2zg - 6. Determine k(q(o)). 4o*4 Let v(t) = -5t. Let j(x) = -70x2. Determine v(j(a)). 350a2 Let n(r) = r2. Let o(p) = -35p2 - 3. Let t(y) = -6930y*2 - 595. Let d(h) = 1190o(h) - 6t(h). Give n(d(c)). 4900c*4 Suppose -6 = 2z + 2. Let w = -4 - z. Let f(l) = -l + 3l + wl. Let c(q) = 3q2. Give c(f(x)). 12x2 Let f(y) = y. Let g(l) be the first derivative of -l2 + 17. Give g(f(x)). -2x Let g(n) be the second derivative of n4/4 + 25n. Let i(z) = z. Determine i(g(d)). 3d2 Let k(q) = -74q. Let n(o) = 2o2 - 61o. Give n(k(r)). 10952r2 + 4514r Let d(b) = -8b. Let q(r) = 4r*2 - 113. Determine q(d(w)). 256w*2 - 113 Let g(x) be the third derivative of 0 + 0x - 1/6x4 + 0x*3 - 3x2. Let a(d) = -d2. Calculate a(g(f)). -16f2 Let s(y) = -7y*2 - 3y - 3. Let p(k) = -20k2 - 8k - 8. Let a(i) = -3p(i) + 8s(i). Let j(t) = -3t2. Calculate j(a(z)). -48z*4 Let b(k) = 77k*2. Let o(g) = -2g. What is b(o(q))? 308q2 Let m(g) = 16g*2. Let f(d) = -8d*2. Determine m(f(x)). 1024x*4 Let g(x) = -5x*2. Let u(v) = -138v*2. Give g(u(l)). -95220l*4 Let r(n) = 46n. Let d(g) = 32g. Determine r(d(z)). 1472z Let a(b) = 910b2. Let v(r) = -r2. Give a(v(h)). 910h*4 Let o(w) = 4w*2. Let g(y) = 19y. Determine g(o(d)). 76d2 Let l(h) = 2h*2. Let v(y) = 14 - 8 + 0 + 4y + 8. Let n(o) = o + 3. Let m(a) = -14n(a) + 3v(a). Give m(l(g)). -4g2 Let a(p) = 13p + 9. Let c(h) = -13h - 9. Let b(n) = 4a(n) + 5c(n). Let y(u) = 3u + 2. Let j(d) = -2b(d) - 9y(d). Let g(i) = -5i. What is j(g(v))? 5v Let c(q) = -3q. Let a(n) = -745n*2. Give c(a(k)). 2235k2 Let z(f) = -f2. Let n(r) = 0r - 7r + 2r. Let v(q) = -2q. Let u(p) = 2p. Let g(m) = -4u(m) - 3v(m). Let b(o) = 5g(o) - 3n(o). Give z(b(x)). -25x*2 Let o(n) = -6n2. Let c(h) be the third derivative of h5/12 + h*2. Suppose -8 + 5 = -w. Let r(f) = wo(f) + 4c(f). Let l(k) = -2k. Calculate r(l(d)). 8d2 Let t(f) = 2f - 41. Let y(l) = -14l. Give t(y(n)). -28n - 41 Let n(r) = -70r. Let w(m) = -m2. Calculate n(w(u)). 70u*2 Let p(z) = 7z. Let w be (-6)/(-21) + (-76)/(-28). Let m(b) = b*2 + wb*2 - 5b2 - b2. Determine p(m(a)). -14a2 Let d(h) = h2. Let j = -2 - -4. Let i(z) = z + jz + 6z. Determine i(d(p)). 9p*2 Let q(o) = -518 + 518 + 2o*2. Let j(s) = 5s. What is j(q(p))? 10p2 Let s(p) = -1663p. Let q(h) = -5h2. Give q(s(f)). -13827845f*2 Let c(h) = 13h*2. Let g(a) = 6a. Let d(t) = t*2 - 4t. Let l(s) = 3d(s) + 2g(s). What is c(l(f))? 117f4 Let h(n) = n2. Let z(v) be the first derivative of 0v*2 + 2 + 0v - 4/3v3. Determine z(h(i)). -4i4 Let d(w) be the third derivative of -w8/20160 - w*5/15 - 2w*2. Let h(t) be the third derivative of d(t). Let o(a) = 8a. Give h(o(r)). -64r2 Let v(p) = 2p*2. Let h(c) = 744c*2. Determine v(h(a)). 1107072a*4 Let r(f) = 10f. Let i(s) = -134s2. What is r(i(n))? -1340n*2 Let k(g) = 7g. Let u(a) = 11a2 - 5. Calculate u(k(j)). 539j*2 - 5 Let s(r) = 3r*2. Let i = 0 + 3. Let q(d) = -i - 8d + 3. Give q(s(p)). -24p2 Suppose -4v + 18 + 26 = 0. Let q(o) = o*2 - 11o. Let r be q(v). Let t(p) = -4p2 + r + 0. Let u(x) = -x2. Determine u(t(f)). -16f*4 Let f(k) = -4k*2. Let s(n) = 7n*2 + 6n. Let t(y) = 6y2 + 5y. Let i(m) = 5s(m) - 6t(m). Give i(f(g)). -16g4 Let r(o) = 2o - o + o. Let j(h) = -h + 10h - 8h. Calculate j(r(w)). 2w Let d(j) = 351j - 11j2 - 351j. Let v(o) = -2o2. Give d(v(p)). -44p*4 Let i(j) = -2j. Let w(o) be the first derivative of o*3 + 8. Give w(i(x)). 12x*2 Let g(h) = -2h. Let p(k) be the third derivative of 0k3 + 0k - 1/12k4 + 0 + 2k*2. Determine g(p(i)). 4i Let a(c) = -c2. Let b(s) be the second derivative of -s7/2520 - 5s4/12 + 2s. Let y(q) be the third derivative of b(q). Give a(y(g)). -g*4 Let r(d) = -4d. Let m(f) = 3f - 9. Determine r(m(i)). -12i + 36 Let m(l) = l - 1. Let d(r) = 2r - 5. Let u(x) = d(x) - 5m(x). Let n(y) = 6y2. Give n(u(w)). 54w*2 Let a be (-22)/(-6) - (-4)/(-6). Let z(q) = -aq - 4q + 4q. Let m(x) = 2x2 - 8x. Let y(u) = u*2 - 5u. Let i(g) = 5m(g) - 8y(g). Give z(i(h)). -6h2 Let v(o) = -3o. Let q(d) = 402d. Calculate v(q(n)). -1206n Suppose 3k - 31 = 4o, 3o + 6 + 11 = k. Let s(r) = -2r*2 + 3r*2 - kr + 5r. Let b(i) = 5i. Calculate s(b(v)). 25v2 Let n(j) = 5j. Let o(g) = -7g + 2. Let d(l) = -90l + 27. Let q(v) = 2d(v) - 27o(v). Let z(k) = -7n(k) + 4q(k). Let s(y) = 25y2. Give s(z(t)). 25t*2 Let q(d) = -3d + 14 - 14 + 29d. Let z(i) = -2i. Give q(z(j)). -52j Let d(r) = 0r - r - 2r. Let s(f) be the third derivative of -f5/30 + 3f*2. Determine d(s(h)). 6h*2 Let z(o) = -2o. Let t(q) = -2q2 - 17q - 34. Let n(i) = -i*2 - 6i - 12. Let c(b) = -17n(b) + 6t(b). What is c(z(g))? 20g2 Let x(r) = -2r. Let w(p) = p*2 + 1. Let n be w(-1). Suppose -22 = -3k - nh, 3k = -2k + 5h - 5. Let b(o) = o*2 - ko*2 + 2o*2. Determine x(b(t)). 2t*2 Let g(i) = 3i2 - 1. Let s be g(-1). Let d(a) = as - 3a2 - a2. Let w(z) = -z + 3 - 3. What is d(w(r))? -3r*2 Let z(x) = -17x. Let p(k) be the third derivative of k*4/6 + 56k*2. Calculate p(z(a)). -68a Let c(p) = -5p2. Let f(t) = -t + 1. Let s(w) = 12w - 11. Let b(d) = -22f(d) - 2s(d). Give b(c(y)). 10y2 Let r(m) = -m2 + 13m - 7. Let d be r(12). Let u(f) = -11f - 5. Let y(p) = -27p - 12. Let g(h) = dy(h) - 12u(h). Let l(q) = 2q2. Give g(l(i)). -6i*2 Let x(v) = v. Suppose -11 = -p - 9. Let u(r) = -39r*2 - 27r - 27. Let y(g) = 3g2 + 2g + 2. Let t(d) = pu(d) + 27y(d). What is x(t(i))? 3i2 Let q(u) = 81u. Let f(r) = 77r. Determine q(f(b)). 6237b Let d(a) = -3a2. Let l(g) = 2g. Let x(z) = -3z. Let q(n) = -6l(n) - 5x(n). Calculate q(d(p)). -9p2 Let f(z) be the second derivative of z4/4 - z. Suppose -4 = 3i - 1. Let l(q) = 1. Let k(m) = m + 1. Let b(c) = il(c) + k(c). Calculate b(f(p)). 3p2 Let w(k) = -36k. Let g(u) = 15u + 9. Calculate w(g(f)). -540f - 324 Let o(x) = -3x. Let k(v) be the third derivative of v5/20 - 3v*2. Determine o(k(b)). -9b*2 Let f(h) = -13h. Let i(p) = 12p2 - 3p. Calculate i(f(r)). 2028r2 + 39r Let t(x) = -x*2 + 15. Let g(z) = -2z. Determine g(t(r)). 2r2 - 30 Let r(f) be the first derivative of 11f3/3 - 4. Let o(w) = -w2. What is r(o(u))? 11u4 Let n(p) = -700p. Let s(u) = -2u. What is s(n(y))? 1400y Let u(j) = 2j2. Let a(w) = w2 + 2. Suppose 0 = -4l + 5n - 25, -2l - 10 = -5n + 3n. Let t be a(l). Let z(x) = 6x2 - 5x*2 + 0x*t. Give u(z(q)). 2q4 Let k(o) = 0 + 0 - o. Let w(i) be the third derivative of i6/360 + i*4/12 + 2i*2. Let n(q) be the second derivative of w(q). What is k(n(x))? -2x Let v(u) be the third derivative of -u*5/60 - 8u2. Let h(b) be the third derivative of -b5/30 + 2b2. What is h(v(i))? -2i*4 Let r(g) = g. Let h(x) = x. Let z(b) = -3b. Let w(q) = h(q) - z(q). Determine w(r(u)). 4u Suppose 4u = 9u - 15. Let n(t) = -5t*2 + 3t*2 + ut2. Let m(l) be the third derivative of l4/12 + l*2. Calculate m(n(s)). 2s*2 Let u(x) = -2x*2. Let a(n) = 2n + 81. Give u(a(g)). -8g2 - 648g - 13122 Let o(h) = h*2. Let s(m) = 7m + 4m + 4m + 3m. Give s(o(w)). 18w	{ "pile_set_name": "DM Mathematics" }
) = 5o + 4. Let d(c) = c - 1. Let n(x) = -d(x) + s(x). Let j(t) = -5t - 5. Let v(q) = 2j(q) + 3n(q). Let h(g) = -g - 2. Give -10h(l) - 4v(l). 2l Let i(u) = -42u*3 + 12u*2 - 12u + 12. Let y(b) = -17b3 + 5b*2 - 5b + 5. Calculate 5i(o) - 12y(o). -6o3 Let l(h) be the second derivative of h3/3 - 11h*2/2 + h. Suppose d = -2d - 2k + 25, 4d - 2k - 52 = 0. Let y(x) = x - 6. Give dy(r) - 6l(r). -r Let y(m) = m3 + 3m*2 - 2m - 3. Let v(x) = -2x3 - 5x*2 + 4x + 5. Determine 3v(c) + 5y(c). -c*3 + 2c Let u(m) = 144m. Let w(s) = 13s. Calculate -3u(j) + 32w(j). -16j Let q(h) = -4h*2 - 16h + 4. Let o(z) = z*2 + 5z - 1. What is -10o(v) - 3q(v)? 2v2 - 2v - 2 Let t(g) = -4g2 + 5g - 5. Let u(a) = a*3 - 7a*2 + a - 2. Let z be u(7). Let v(l) = 4l*2 - 6l + 6. Calculate zv(p) + 6t(p). -4p2 Let n(w) = -2w - 4. Let i(l) = -2l + 4. Let g(x) = -x. Let y(v) = g(v) - i(v). Let f(d) be the first derivative of y(d). Calculate 2f(q) + n(q). -2q - 2 Let v = 11 - -1. Let y = 2 + 1. Let f(o) = oy + 2o - 2o3 - o. Let g(a) = -14a*3 + 12a - 2. Give vf(z) - g(z). 2z*3 + 2 Let h(z) be the first derivative of -5z*3/3 + 5z*2/2 - 3z - 5. Let y(t) = 6t2 - 6t + 4. What is -4h(o) - 3y(o)? 2o2 - 2o Let p(a) be the first derivative of a*3 - 7a - 6. Let g(w) = -w*2 + 2. Let y(n) = -7g(n) - 2p(n). Let u(i) = i2. Calculate 6u(q) - 7y(q). -q2 Let q(g) = g2 - g + 1. Let z(j) = 3j*2 - 2j + 2. Suppose -4w + 3s - 11 = 11, 0 = 2w + 5s - 2. Let l = w + 6. What is lq(n) - z(n)? -n2 Let f(r) = 3r + 2. Suppose -245 - 7 = 6k. Let w(x) = -30x - 21. Calculate kf(t) - 4w(t). -6t Let w(k) be the second derivative of k4/12 - k2 + 3k. Let v(r) = r*2 - 5. Give 2v(c) - 5w(c). -3c*2 Let o(a) = -9a*3 + 5a*2 + 3a + 5. Let u(w) = -14w3 + 8w*2 + 5w + 8. Let t = 20 - 15. Calculate tu(j) - 8o(j). 2j3 + j Let d(f) = 6f*2 - 8f + 1. Let u(i) = 5i2 - 7i + 1. Let c(x) = -x*2 + 2x + 7. Let j be c(0). What is ju(t) - 6d(t)? -t*2 - t + 1 Let q(v) = 8v*3 - 6v*2 - 8v + 4. Suppose 3d - 6 = 2d. Let r(s) = -9s3 + 7s*2 + 9s - 5. Calculate dr(m) + 7q(m). 2m3 - 2m - 2 Let s(w) = -2w2 - 5. Let t be 1/(2 + (-21)/12). Let b(y) be the third derivative of 0 + 0y*t + 7/3y*3 + 1/12y*5 + 0y - y*2. Give 4b(d) + 11s(d). -2d*2 + 1 Let l(p) = 4p*3 + 3p*2 + 3p - 3. Let b(c) = c*2 + c + 1. What is 3b(z) - l(z)? -4z3 + 6 Let a(p) = -4p*2 - 2p + 1. Let d = -2 + 3. Let r be (0 + (-9)/3)/d. Let i(v) = v*2 - 1. Determine ri(x) - a(x). x*2 + 2x + 2 Let g(f) = 9f3. Suppose 2x = -3x. Let i be (-8)/(-2) + (x - 0). Let y(q) = 15q - 15q + iq*3. Determine -2g(z) + 5y(z). 2z*3 Let t(z) = 8z*2 - 14z + 17. Let o(y) = 18y2 + 0 - 5y + 3 - 15y2 + 3. Give -17o(b) + 6t(b). -3b2 + b Let m(v) = v3 - v*2 + v - 1. Let h(p) = -90p*3 + 108p*2 - 108p + 108. Calculate h(s) + 108m(s). 18s3 Let c(l) = l3 + 2l2 - 2l. Let x = 8 - 5. Let w(a) = a*2 - a. Determine xc(g) - 6w(g). 3g3 Let y(r) = r3 + r*2 - 1. Let n(l) = 2l*3 - 2l*2 + 2. Calculate -n(d) - 2y(d). -4d3 Let o(b) = -b2 + b - 1. Let i(m) = -44m*2 + 55m - 55. Give -i(c) + 55o(c). -11c*2 Let p(w) = 5w*2 - 6w. Suppose -3b - 33 = -6b. Let k(y) = -13y - 8 + 8 + by*2. Suppose -5s - 12 = -3s. Calculate sk(f) + 13p(f). -f2 Let l(a) = 4a - 1. Let n be l(-1). Let z(p) = 2p + 5. Let u(k) = k + 2. Calculate nu(i) + 2z(i). -i Let r(b) = -1. Let m(f) = f2 + 2. Let x be (3/9)/(5/15). What is xm(w) + 2r(w)? w2 Let x(u) = -8u + 2. Let i(b) = -b. What is -2i(c) + x(c)? -6c + 2 Let o(m) = -1. Let y(f) = -3f - 1. Calculate -o(i) - y(i). 3i + 2 Let f(w) = -w2 + w + 1. Let h(n) = -n2 + 18n + 4. What is -3f(c) + h(c)? 2c2 + 15c + 1 Let q(a) = -2a - 1. Let g(w) = -3w. Let o be (-15)/(-6)((-4)/5)/1. Determine oq(u) + 3g(u). -5u + 2 Let r = -3 + 4. Let v(c) = c + 0c + c. Let n(i) be the first derivative of -i3/3 - 1. Determine rv(k) + n(k). -k*2 + 2k Let c(w) = 69w2 + w3 - 72w*2 + w + 0w. Let x(u) = -2u2. Determine 2c(p) - 3x(p). 2p*3 + 2p Let a(q) = -5q2 + 2q*2 + 0q2 + 2. Let g = 56 - 61. Let m(h) = 3 - h2 + 2 - 6h2. Calculate ga(t) + 2m(t). t2 Let k(b) = -4b*2 + 6b + 7. Let h(s) = 22s + 2 + 6 - 5s*2 - 15s. Give -5h(m) + 6k(m). m*2 + m + 2 Let m be 0-13/(-6). Let d(o) = 4o*2 - 4o + 6o + mo. Let h(u) = u*2 + u. What is -d(n) + 2h(n)? -2n2 Let t(z) = z - 1. Let d(u) = -4u - 4. Calculate d(v) + 3t(v). -v - 7 Let q(u) = 11u*3 - 6u - 6. Let f = -10 - -9. Let p(s) = -s*3 + s + 1. What is fq(y) - 6p(y)? -5y*3 Let r = -35 - -19. Let a = r - -13. Let d(s) = -3s*2 - s + 4. Let g(i) = 4i*2 + i - 5. Calculate ad(n) - 2g(n). n2 + n - 2 Let a(b) be the second derivative of b3/3 + 3b. Let y be 28/6 + 8/24. Let z(n) = -4n - 1. Determine ya(q) + 2z(q). 2q - 2 Let q(t) = -t*2 + 5. Let o(i) = 2i*2 - 4. What is -2o(d) - 3q(d)? -d2 - 7 Let w(y) = -3y - 6. Let o(x) = -2x + 24. Let l be o(9). Let m(q) = 4q + 7. Determine lw(v) + 5m(v). 2v - 1 Let f(u) = -4u + 1. Let x(j) = -5j. Calculate 7f(y) - 6x(y). 2y + 7 Let w(m) = -m*2 + 3m + 1. Let d(n) = -2n2 + 4n + 1. What is -3d(h) + 4w(h)? 2h2 + 1 Let j(a) = -12a*2 + 6a + 6. Let x(i) = i*2 - i - 1. What is 3j(r) + 18x(r)? -18r*2 Suppose 14p + 25 = -17. Let z(a) = 5a2 - 2a + 2. Let f(q) = -4q2 + q - 2. What is pf(t) - 2z(t)? 2t*2 + t + 2 Let j(t) = -13t + 24t - 25t - 3 - 3. Let k(g) = -9g - 4. Calculate -5j(a) + 8k(a). -2a - 2 Let a(q) = 4 - 4 + 2q + 3. Let h(j) = 5 + 6 + 6 + 4 - j - 23. Let p = 22 + -16. Give ph(b) + 4a(b). 2b Let j(y) = y + 1. Let n(l) = -7l - 2. What is 6j(s) + n(s)? -s + 4 Let q(j) = -3j - 9. Let o(c) = -6c - 17. Let k(u) = -6o(u) + 11q(u). Let m(s) = -2s - 2. What is 3k(h) + 4m(h)? h + 1 Let y(a) be the second derivative of a5/120 - a4/24 + 7a*3/6 + 8a. Let o(n) be the second derivative of y(n). Let b(m) = 6m - 6. Give 6b(s) - 34o(s). 2s - 2 Let p(o) = 0 - o3 - o + 1 + 0 - o2. Let m = 860 - 854. Let c(x) = -8x3 - 6x*2 - 5x + 6. Determine mp(f) - c(f). 2f*3 - f Let r(x) = 6x - 2. Let p(z) = 3 - 1 + 3z - 2z - 3. Give 4p(y) - r(y). -2y - 2 Let u(r) = -5r - 6. Let q(p) = p - 4. Let w be q(-6). Let b be w/4(-30)/25. Let i be (-30)/(-4) - (-3)/6. Let a(j) = 2j + 2. Give bu(y) + ia(y). y - 2 Let m(d) = -4d*3 + d + 6. Let c(h) = 9h3 - h2 - 2h - 12. Give 2c(l) + 5m(l). -2l*3 - 2l*2 + l + 6 Let k(g) = 2g*3 + 3g. Let q(v) = 11v3 + 17v. Suppose 2b = -5p + 179, 64 = p + p - 3b. Let f = p + -1. What is fk(r) - 6q(r)? 2r*3 Let a(g) = 16g*2 + g. Let x(s) = -15s*2 - s. Calculate 4a(v) + 5x(v). -11v*2 - v Let p(t) = -4t + 6. Let v(a) be the third derivative of -5a4/24 + 7a*3/6 + 21a*2. Calculate 4p(j) - 3v(j). -j + 3 Let f(b) = 10b*2 + 3b + 1. Let l(t) = t + 1. Calculate -f(h) + 2l(h). -10h2 - h + 1 Let w(i) = i2 - i - 1. Let u(y) = 5y3 - 2y*2 + 2y + 3. Let k = -44 + 42. What is kw(j) - u(j)? -5j*3 - 1 Let v(b) = -25b3. Let q(i) be the third derivative of -i6/120 - 44i2. Calculate 20q(m) - v(m). 5m3 Let s(l) = -2l*2 + 3l + 3. Let n be (-2)/(-3) + (-20)/(-6). Let m(k) be the first derivative of 2k3/3 - 2k*2 - 4k - 10. Calculate ns(u) + 3m(u). -2u2 Let o(k) = -2k*3 + 4k2 - k - 1. Let c(g) = g2. Let t be 2(3 + 1 + -6). Give tc(l) + o(l). -2l3 - l - 1 Let r(y) = 4y + 4. Let c(f) = 15f + 15. Let l(n) = 7n + 7. Let x(b) = 4c(b) - 9l(b). Determine 5r(w) + 7x(w). -w - 1 Let j(v) = 1. Let r(q) be the first derivative of -q*3/3 + 3q - 6. Calculate -3j(x) + r(x). -x2 Let j(p) = p2 - p + 1. Let f(d) = 4d*2 - 4d + 2. Let l = 9 - 5. Suppose y + lo = 11, -2y + 2 = 3o - 10. Suppose -5t - y - 2 = 0. Give tf(n) + 2j(n). -2n2 + 2n Let x(h) = -h*2 - h. Let p(v) = 26v3 + v2 - 9v. Let m(d) = p(d) + x(d). Let q(a) = -2a + 0a3 - 5a*3 + 4a. Determine 3m(o) + 16q(o). -2o3 + 2o Let p(t) = t*3 + 3t2 - 3. Let b(o) = o3 + 3o2 - 3. What is -3b(n) + 2p(n)? -n3 - 3n**2 +	{ "pile_set_name": "DM Mathematics" }
2 Let v(w) = w*3 - 6w*2 + 3w - 5. Let n be v(6). Suppose -5t + 63 = 4t. Let l be (t - 9) + n/7. Which is the third biggest value? (a) l (b) -0.1 (c) 7 a Let o = -7/68 - 163/68. Let l be 2/7 - (-24)/(-182). Which is the second biggest value? (a) l (b) o (c) -0.2 c Let b = -20.4 + 3.4. Let i = -9 - b. Let a = i + -11. What is the biggest value in a, 0.5, 5? 5 Suppose -17t + 121 = -406. Which is the third biggest value? (a) t (b) 0 (c) 0.3 b Let l = -14.9 - -14.93. Which is the smallest value? (a) l (b) -1/4 (c) -0.2 (d) 4 b Let h be (0/2)/((-18)/(-6)). Let p be 15/1048/2. Let y be p/15 + -2 + h. What is the third biggest value in 6, 2/17, y? 2/17 Let a = 28.936 + 0.064. Let p = a - 27. What is the third smallest value in p, -4/5, -3/2? p Let j be 9(-2)/(-10) - 2. Let a = -34.03 + 0.03. Let c = -33.5 - a. What is the second biggest value in 4, j, c? c Let p = 1.09 + -0.09. Which is the third smallest value? (a) -0.38 (b) 0 (c) -1/3 (d) p b Let z = 1.018 - 0.018. Let d = 2 + -4. Let x be (3 - 8) + (-1 - d). Which is the second biggest value? (a) z (b) 1/2 (c) x b Let o = -359 - -357. Let f = -0.9 + 0.6. What is the biggest value in o, 2/7, f, -3? 2/7 Let s = -2398.1 - -2398. Let g = 7.93 + 0.07. Which is the second smallest value? (a) s (b) g (c) -3/5 a Let m be (1/(-5))/(4/(-10)). Let d be (20/12)/(26/15). Let l = 6/13 - d. Which is the second biggest value? (a) 6 (b) m (c) l b Let v = -39.9 + 39.6. Let g be 2/44-47 + 2. What is the third smallest value in v, 5, g? 5 Suppose 0 = -777j + 778j. Let p be 2 + (-4 - (-4)/(-2)). Let k be -1(p/(-1) - 0). Which is the smallest value? (a) 1/5 (b) j (c) k c Let s = -0.461 + -0.139. Let d = 2.4 - s. What is the fourth smallest value in d, -0.03, 0.1, 4? 4 Let w = 2.91 - 3.201. Let h = 0.091 + w. What is the second biggest value in -3/2, h, -2/11, 1/13? -2/11 Let i be (-72)/(-54) + (-2)/(-3). Suppose ip + 3 = 4o + 7, -5o = -5p. Which is the smallest value? (a) -0.5 (b) 2 (c) p c Let f = 1629.1 + -1610. What is the third smallest value in -4, f, -0.5, 0.3? 0.3 Suppose -2n + 4x + 8 = -0n, 3n + 4x = -18. Let c = -602 + 601.6. What is the second smallest value in c, 2, n, 0.5? c Let y be ((-10)/(-30))/((-2)/(-6)). Let i be 1(-72y)/(-4). Which is the second smallest value? (a) i (b) -1/3 (c) -0.4 b Let h be (1/3)/(5/(-75)). Let k = -0.02 - -0.22. Let v = -0.1 + k. What is the smallest value in h, -0.4, v? h Let w = -9 + 12. Suppose -i = -d - w, -1 + 3 = -2d + 4i. What is the third biggest value in -1, 4, d? d Suppose 4n + 38 = 42. Let y be (0/((-1)/(-1)))/(-2). Which is the second biggest value? (a) -1/7 (b) y (c) n (d) 8 c Let r = -2.04 - -0.14. Let t = r - -1.5. Let p = 3.4 + t. Which is the second smallest value? (a) p (b) -3 (c) -0.5 c Let u = -11.8 - -10.8. What is the biggest value in u, 1/2, 3, -45? 3 Let q = -40 - 77. Let d = -120.15 - q. Let b = d + 0.15. What is the second biggest value in b, -2/15, 0? -2/15 Let u = 163 - 178. What is the second smallest value in -3, 2/15, 1, u? -3 Suppose 0 = 2w + 4l + l + 22, 4 = w - 5l. Let h be (-1)/(-3) + 4 + 22/w. Let j = 0.5 + -4.5. Which is the smallest value? (a) h (b) j (c) -3/7 b Let f = -179 - -182. Let v be 5/(30/(-4))3. Which is the smallest value? (a) 0.3 (b) f (c) v c Suppose 2j - 91 = 21. Let a = j + -59. What is the smallest value in 9, -1/6, a? a Let f(y) = y*3 + 5y*2 + 4y - 1. Let x be f(-3). Suppose 0 = j - 4p, -2j + 5j = -xp. Which is the biggest value? (a) j (b) -2 (c) -17 a Let h = 56 - 53. Let u be h127/(-243). Which is the third smallest value? (a) 1/4 (b) -1.3 (c) u a Let k be 86/18 - (-10)/45. Let o = -86.6 + 94. Let f = o - 1.4. Which is the third smallest value? (a) k (b) f (c) -2/11 b Let l = 2.6 - 1.7. Let b = 1.9 - l. What is the second smallest value in 4/5, b, 3? b Let z = 67.5 + -75. Let f = -7.7 - z. Which is the third smallest value? (a) -33 (b) 2/5 (c) 1 (d) f b Let z = 1053/7 + -150. Let m be 2 + 2 - (-1 + 0). What is the second biggest value in m, z, 0.1, -0.1? z Let g be (-81)/135(-1)/3. What is the fourth smallest value in 4, g, -3/2, -87? 4 Let j = -1426 + 1428. Which is the third smallest value? (a) j (b) 1/4 (c) 4 (d) -0.3 a Let k = -24 + 26. Let t = k - 2.4. What is the smallest value in t, -8, 0.3? -8 Let u = 42 - 59. Let d = -16.3 - u. Let v = 1 - d. What is the second biggest value in 5, v, 1? 1 Let n = 21 - 20.862. Let v = -0.038 + n. Which is the third biggest value? (a) v (b) -0.16 (c) -1/7 b Let b = -0.01 + 0.31. What is the third biggest value in -0.029, -1/4, b, 0.4? -0.029 Let j = 776 + -782. Which is the smallest value? (a) j (b) -0.2 (c) -0.38 a Let z be 1224/3213(-2)/((-16)/(-6)). Which is the second biggest value? (a) z (b) -41 (c) 4 (d) 2 d Let h = -212 - -213. What is the second biggest value in h, -1/3, -2/5, 29? h Let u = -0.276 - -17.276. Which is the second smallest value? (a) 0 (b) 0.5 (c) u b Let j = -2.4 + 7.4. Which is the smallest value? (a) -1/4 (b) j (c) 9 (d) 0.5 a Let s = -4.4 - -0.8. Let y = -0.13 + -1.27. Let v = y + s. Which is the third biggest value? (a) 10 (b) -1/7 (c) v c Let l = -0.9208 + 0.7208. Let x = -3.1 + 0.1. What is the smallest value in l, x, 1/6, 1/5? x Let x = -313 + 938/3. Which is the second biggest value? (a) -4 (b) x (c) 1 b Let m = 11.3 + -5. Let k = m - 6. What is the second smallest value in -1, k, -0.1, -3? -1 Let z be 1(1 + -2)5. Which is the biggest value? (a) z (b) -1/4 (c) 0.2 c Let m be (6/8)/(13/(-52)). Let v(n) = 2n2 - 4n + 1. Let y be v(3). Let z be (-66)/(-126) + m/y. What is the second biggest value in -1, z, 0.01? 0.01 Suppose -4d - 2g = -14, -2d - 2d + g = -11. Let q = -0.025 + -0.275. What is the third smallest value in d, q, 0.5? d Let q = -60 - -56. Suppose 2w - w + 2 = 0. What is the third biggest value in q, -5, w? -5 Let q(u) = u3 - 7u*2 - 2u + 13. Let l be q(7). Let n = 15.04 + -15. What is the third smallest value in -0.1, l, -1/2, n? -0.1 Suppose 0 = y + 2g + 15, -11g - 57 = 5y - 10g. Which is the fourth smallest value? (a) 3/5 (b) -4 (c) -1 (d) y a Let z(u) = -u*3 + 2u + 2. Let i be z(4). Let o be 180/i12/70. Let k = 109/253 - 12/23. Which is the second smallest value? (a) k (b) o (c) 3 a Suppose -6n + 27 = 3. Let s = -0.18 - -12.18. Let q = 14 - s. Which is the second smallest value? (a) q (b) 0 (c) n a Let w be (-5530)/(-5225) + 3/15. Let d = 15/11 - w. Suppose 9 = -0v + 3v. Which is the smallest value? (a) v (b) d (c) 0.3 b Let u = 0.6635 + -0.0635. Which is the smallest value? (a) 3 (b) 0.07 (c) u (d) -3/8 d Let i be 1/(1/3-7). Let r = -9285/18578 + -2/9289. Which is the third smallest value? (a) 8 (b) i (c) r a Let s = -0.0296 + -0.0504. What is the fourth smallest value in -5/4, 0.5, s, 2/7? 0.5 Let m = 210.3 + -210.7. Let i = 1 - 5. Which is the fourth biggest value? (a) m (b) -3 (c) 0.5 (d) i d Let n = -175.5 + 176. Which is the second smallest value? (a) -2/11 (b) -22 (c) n (d) -2 d Suppose 0 = 4t + 2f + 6, 833t - 835t = 3f - 7. Let n = -7/24 + 1/168. What is the smallest value in n, t, 0.4, -1/7? t Let h = -400 + 401. What is the third biggest value in -0.3, h, -1, -3? -1 Let z = -3510 + 21061/6. Suppose 3y = -2y + 5r, -r + 3 = 2y. Which is the fourth biggest value? (a) -4 (b) y (c) -12 (d) z c Let z = 5.1 + -5. Let o(l) = -l - 12. Let h be o(-13). Suppose -3y - h = -4. Which is the smallest value? (a) y (b) 0.3 (c) z c Let q = 1.2 + -2.2. Let y = -1/17 + -13/68. What is the third smallest value in q, y, -2.2? y Let o = 39.7 - 39.8. Which is the biggest value? (a) o (b) 3/7 (c) 0.2 b Let v = 5.15 + -0.15. Suppose -5o = -25, k - 37 = -4o - 13. Let i be k/6 + 14/(-24). Which is the third smallest value? (a) 9/4 (b) v (c) i b Let x = 0.1 + -0.9. Let s = x + 0.3. Let a = 961 + -961.3. What is the biggest value in s, a, -2/9? -2/9 Let i = 44 + -42. Let v = -3 - -12. Let r = v + -6. What is the second biggest value in r, -2/5, i? i Let l = 274 - 279. What is the third smallest value in l, -17, -2, 1/3? -2 Let u(h) = 4h*2 + 31h - 10. Let g be u(-8). What is the second smallest value in g, 5, 1, 42? 1 Suppose 25 = 2p - 7p. L	{ "pile_set_name": "DM Mathematics" }
7 for y. -4 Let p(y) = -y*3 + 45y*2 + 3y - 135. Let n be p(45). Solve -6i + 14i + 16 = n for i. -2 Let q be (-6)/(((-56)/(-7))/(-40)). Suppose 8g - q = -14. Solve go = -2o + 2o for o. 0 Let z(o) be the second derivative of -o*5/10 + 5o*4/6 - 5o*3/3 + 7o*2 + 37o. Let l be z(6). Let r = -116 - l. Solve rs - 4 = s for s. 4 Let g(i) = -79i - 4. Let v be g(1). Let q = v - -87. Solve -3 = qt + 13 for t. -4 Let v = -27 - -40. Let g(p) = 8p + 42 - 11p - 18 + v. Let y be g(11). Solve -a + 5 = ya for a. 1 Let j(o) = -o*3 - 51o*2 - 23o - 1166. Let z be j(-51). Solve -zh - 93 + 128 = 0 for h. 5 Let o = 53 - 65. Let m be (-8 - -4)/(o/45). Suppose -5r = -0r - m. Solve g = -0g + r for g. 3 Suppose -240 = -2j - 3j + 2p, 2j = -2p + 96. Solve -j = -12f + 12 for f. 5 Let t = 657 - 613. Suppose -26z + 3l = -28z + t, -4l = z - 32. Solve 0 = -q - 3q - z for q. -4 Let v(b) = b3 - 5b*2 + 5b - 20. Let c be v(5). Suppose 0 = 4i + cf - 47, 0f + 3f + 7 = 2i. Let r(x) = x - 4. Let t be r(i). Solve -ty - 9 = 7 for y. -4 Suppose -5u + 4m - 1874 + 6704 = 0, -4u + 3870 = -2m. Solve 0 = uw - 985w + 105 for w. 7 Suppose 6l + 463 = -815. Let m = 225 + l. Solve u + 3u = m for u. 3 Let a be -29 + 50 + (2 - 1). Solve a - 7 = 3z for z. 5 Suppose 0p - 2 = -2p. Let s be (12/(-36))/(1 - 68/66). Suppose -2d = z, 3d = 10z - sz + 1. Solve 2n + p = -d for n. -1 Suppose 12 = -3y + 6y. Let c = -78 - -932. Let r = c - 852. Solve 3o - ro + y = 0 for o. -4 Suppose 0 = 4y + 2 + 2. Let l be (0 - -3)/((y - -2)/1). Suppose 5p - 23 = 2i, -2p = 4i - li - 2. Solve -x = -px for x. 0 Let t(m) = -23m - 18m2 + 23m2 - m3 + 19m. Let p be t(3). Suppose -20i = -22i + p. Solve 2r + 15 = -ir for r. -3 Let j = 21 - 23. Let h be (j + -7)1(-3 + 2). Let o(q) = -q3 + 8q*2 + 12q - 22. Let i be o(h). Solve -ir - 12 = -r for r. -3 Let u(p) = 4p*2 - 6p - 29. Let d be u(-9). Let m = d - 347. Solve -2 = mr - 12 for r. 5 Let x be (-12)/(-2) + -36 + 30. Suppose -114w + 116w - 14 = x. Solve -wa = -5a for a. 0 Let t be 10/(-40) - (-6)/(-8). Let f be (-1 + 9)t/(-2). Solve 5x - fx = 1 for x. 1 Let y(h) = -8h - 15. Let l be y(-3). Suppose 0a - 22 = -2a. Let j = a - l. Solve 0 = 3t + jt + 10 for t. -2 Let x = 24 - 14. Suppose 3g = g + 8. Suppose 0 = -5w - k + 5k + 10, -8 = -4w - 4k. Solve -gr = -wr - x for r. 5 Let l(j) = 3j2 - 31j - 24. Let r(k) = k*2 - k - 2. Suppose 11i = -7i + 18. Let h(q) = il(q) - 2r(q). Let x be h(30). Solve -w - x = -6w for w. 2 Let l be 22/4 + 15/(-10). Suppose -lw + 0h = 2h - 186, 34 = w - 2h. Let o = w + -44. Solve 0z + 4z + 8 = o for z. -2 Let o be (10/(-25))/(2/710). Let k = -139 - o. Solve b - 16 = -kb for b. 4 Let j be -3 + -69(-13)/3. Let r = j + -291. Solve rt - 27 = -12 for t. 3 Suppose h + 41 = -l + 2l, 3h - l = -125. Let t be h/(-189) + 1 + (-22)/18. Suppose 0r + 9r = t. Solve 0 = -4v - r + 4 for v. 1 Let v = 6 + -1. Suppose 688 = -55w + 4758. Suppose w = vg + 4z, 5z = 4g - 2g - 23. Solve -5b + 4 = g for b. -2 Let v = -118 + 119. Let i be -4 - v/((-1)/58). Suppose -j + i = 8j. Solve -s + j = 2s for s. 2 Let a = 10 - 10. Suppose 2z - 11 - 3 = a. Let i = 557 + -553. Solve -zy - i = -3y for y. -1 Let d = -258 - -289. Suppose 0 = z - d + 28. Solve 3 + z = 6c for c. 1 Suppose 6 = v - 1. Suppose -6s + 10 = r - 2s, 4 = -2r + 4s. Suppose -6 = -y - 4d, 4d - 30 = -vy + ry. Solve 15 = -3n + yn for n. 5 Suppose -2i + 628 - 188 = -k, -5i - 5k = -1070. Solve i - 134 = 14a for a. 6 Let g(y) = -1051y - 7347. Let w be g(-7). Let z = -6 + 9. Solve 0 = wh - 13h - z for h. -1 Let l(b) = b*2 - 5b. Let w be l(5). Suppose -2o + 3c + 24 = 0, c = o - 12 - w. Let p = -6770 + 6774. Solve -o - p = 4t for t. -4 Let p(t) = t3 + 3t*2 - 4t. Let u be p(-4). Suppose 5z + uz = 10. Suppose -x + 26 = 2s, 1683x = 5s + 1681x - 56. Solve 0 = zn + 4 - s for n. 4 Let a(y) = -y + 2. Let u(h) = 12h - 163. Let m(k) = a(k) + u(k). Let r be m(15). Solve -2f + r = -4 for f. 4 Suppose n - 27 = -8n. Suppose -2d - 12 = 5j - 6j, nj = 4d + 26. Solve -jy - 10 = -0y for y. -5 Let i = 1024 + -1011. Solve 7 = -20q - i for q. -1 Let h(s) = -2s - 16 + 0s - 5s - 17s. Let f be h(-1). Solve f = -5k + 23 for k. 3 Let o be 5 + (-9 - -3) + 49. Solve -20n = -4n - o for n. 3 Suppose 0 = -986h + 1255h - 15500 - 11938. Solve h = 21y + 39 for y. 3 Let u = -3681 - -3738. Solve -4k = -u + 77 for k. -5 Let l be ((-15)/(-45))/(1/(-57)). Let h = l + 18. Let f be (-6(-5)/(-2))/h. Solve -5y + f = -0y for y. 3 Suppose -34p + 1534 = p - 1336. Solve -pw - 21 = -89w for w. 3 Let m(q) = -q2 + 4q + 8. Suppose -r + 158 = 4d, -2r + 3d + 328 = 5d. Suppose 4s = -146 + r. Let u be m(s). Solve -ua + 14 = -1 for a. 5 Let f = 15 - 9. Suppose 4g + g + 4i = -9, 5g - 45 = 5i. Solve -go = -o + f for o. -3 Let l = -273 - -274. Let k be l6/(-6) + 4. Solve -12 + 3 = -kw for w. 3 Suppose -23 = 4t - 19, g - 5t - 7 = 0. Solve -gc = -16c - 28 for c. -2 Let d be 90/23 - (-44)/506 - 14. Let i be ((-64)/160)/(2/d). Solve 0 = -10r + ir - 16 for r. -2 Let r(c) = -5c*2 - 37c - 34. Let n be r(-6). Solve 17k + n = 21k for k. 2 Let u = 23344 - 23331. Let h = 7 + -10. Let b be 0/2 - (1 + h). Solve 0 = 5a + b + u for a. -3 Let b be -5 + 0 + 9 + (-9)/9. Suppose 16q - 12q = bx - 46, 4x = -4q + 80. Solve 0 = -16u + xu + 6 for u. -3 Suppose 0 = 5p + 30, -2p - 13 = 5o - 31. Solve -2d + 16 = -od for d. -4 Let y be 7 + -1(1 + -2). Let c(h) = 16h3 + 546h*2 + 72h + 162. Let f be c(-34). Solve -f = yo - 2 for o. -3 Let v be 13820/(-30)(-1)/2. Suppose 2z - 3y + 5y = v, -y - 1 = 0. Suppose n = -z + 28. Solve -l = nl for l. 0 Suppose -100k - 5g + 704 = -96k, -3k = 4g - 528. Solve 186 = 5w + k for w. 2 Let m(l) = -119l + 1441. Let s be m(12). Solve sb = 21b - 32 for b. 4 Suppose n - 5 = -7f, 2n - 4f + 32 = 5n. Solve 11 = -l + nl for l. 1 Let r(w) = -w3 + 8w2 + w - 4. Let j = -32 - -20. Let c(t) = t2 + 14t + 32. Let m be c(j). Let o be r(m). Solve -5i = -3i + o for i. -2 Let u(t) = 18t - 81. Let k be u(5). Let n be (21/(-14))/((k/(-4))/3). Solve 0 = -nh + 7 - 11 for h. -2 Suppose 5m + 2f - 5f - 616 = 0, 5m - f = 612. Let d = m - 122. Solve 16x - 12x + 20 = d for x. -5 Let q(f) = 31 - 17 + 21 + 21 + f2 - 17f. Let b be q(13). Solve bo = 14 - 2 for o. 3 Suppose 3t + 5t + 426 = 14t. Solve 8k + t = 23 for k. -6 Let n = 134 + -112. Let z(x) = -x3 + 22x*2 + 2x - 38. Let j be z(n). Solve -4o = -jo for o. 0 Let a(c) = -7c2 + 28c - 100. Let s(v) = -v*2 + 3. Let i(l) = -a(l) + 6s(l). Let x be i(23). Solve -xp - 1 = -4 for p. 1 Let v be 30/(-165) - ((-50550)/55)/6. Solve -24 = vg - 165g for g. 2 Let b be (-35 + 36)/((-1)/(-28)). Solve 28 = bq + 112 for q. -3 Let p(g) = -g*3 - 21g*2 + 195g + 34. Let y be p(-28). Solve 0 = -5z + y - 22 for z. 8 Let r(b) = 7b - 7. Let u be r(2). Suppose -ut - 15t = -4t. Solve i - 6i - 10 = t for i. -2 Let y be (368/(-552))/(1/(-147)). Solve -u - 13u = y for u. -7 Suppose -632a = -627a + 2575. Let k = -509 - a. Solve -5m - k = 14 for m. -4 Let j = -36 + 55. Suppose 0 = -t - z + 21, 0z + 3z - 81 = -4t. Solve jb - 4 = tb for b. 4 Let p(j) = -j3 - 3j*2 + 14j - 14. Let c be 6/(-9)12/1612. Let t be p(c). Solve 0 = 6d - d + t for d. -2 Let h(g) = -g2 + 2g + 16. Let u be h(5). Let i = -1 - u. Let j be (1/(-2))/(i/20). Solve 3p - 2 = -j for p. -1 Let k = 30 - 9. Suppose 12x = 5x + k. Let s be 12 - (-4 - 0/x). Solve -6b + 2b + s = 0 for b. 4 Suppose -5o = -6o + 5. Suppose ol = 3l + 10. Suppose lf = -f + 24. Solve fd + 4 = -0 for d. -1 Let r be (-26)/(-30) + -1 + (51/45 - -12). Let f(a) = -a + 8. Let g be f(6). Solve -14x = -rx + g for x. -2 Let y = 9419 + -9384. Solve 44k - y = 49k for k. -7 Suppose -7i = -0i. Suppose i = -3x, 5x - 49 = -4g - 5. Suppose g = 5d + 1. Solve d = 4l + 14 for l. -3 Let w be 256/16 + 10/(-2). Solve 4d - w = 15d for d. -1 Let m(b) = 34b2 - 402b - 67. Let y be m(12). Suppose 5t = -2v + 53, 0 = -t + 3v + v - 7. Solve -2a - t = -ya for a. 3 Let d be 15 - -2(-9)/3. Suppose 4s = -5n + d*s +	{ "pile_set_name": "DM Mathematics" }
is smaller: -8678 or 2? -8678 Is 10836 greater than 10838? False Which is bigger: 2/10435845 or -1? 2/10435845 Are -1201776 and -1201776 non-equal? False Is 74/209 smaller than 14? True Are 5841 and 5843 unequal? True Is -76767 greater than or equal to -76767? True Which is bigger: -3/91193 or 0? 0 Which is bigger: -4726 or 6? 6 Which is greater: 5609/80 or 71? 71 Are -1 and 41/16326 equal? False Is -304655/4 > -76163? False Is 394915 less than or equal to 394919? True Which is smaller: -229050/43 or -5328? -5328 Which is smaller: -158 or -5/19? -158 Is -18/4607 greater than or equal to 1? False Which is greater: 2217616 or 2217617? 2217617 Which is smaller: 1 or -1/271427? -1/271427 Which is smaller: 248 or 9/8? 9/8 Which is greater: 5865 or 5822? 5865 Is 5513.5 bigger than 10.7? True Is 0.6555 at least 0? True Is 129895/2 smaller than 64949? True Which is smaller: 1223577 or 1223576? 1223576 Is -1649 > 106? False Is 28198 != 2/7? True Which is bigger: -21 or -914/45? -914/45 Is 635906 <= 635904? False Is 7 at least as big as 625/106? True Which is smaller: 43 or 971/23? 971/23 Is 1909/10 less than 192? True Which is smaller: -47802 or -47809? -47809 Is -1 at most as big as -1/786134? True Which is greater: 18398/9 or 2043? 18398/9 Which is greater: -6/793 or -21/2? -6/793 Is -25936/7 at most as big as -13? True Is -8592 smaller than 1/92? True Is -1 >= 649.869? False Is -1218 <= -1088? True Is 240920 not equal to 240916? True Do 6075 and 11/13 have the same value? False Which is greater: 49143 or 49144? 49144 Which is smaller: 765 or 131? 131 Do -16 and -2228/145 have different values? True Which is greater: 1/4 or -2157.8? 1/4 Which is greater: -56019 or -2? -2 Are -22625 and -22616 equal? False Which is bigger: -0.032147 or -10? -0.032147 Do 9241/6 and 1541 have the same value? False Which is smaller: -4190 or -4192? -4192 Is 2399296 != 2399297? True Which is greater: 43736 or 43721? 43736 Is -100668 less than -100666? True Which is smaller: 28636/87 or 330? 28636/87 Is 4 less than -1760? False Is 60 smaller than -1928? False Which is smaller: 819 or -126? -126 Is 70 greater than 31/27? True Which is bigger: -865 or -912? -865 Are -37 and -1889/53 non-equal? True Is -16/5 less than -12551? False Is 40 at least as big as 9318/241? True Which is greater: -147291 or 3? 3 Is -1006/17 bigger than -5? False Is 85/637 <= -1? False Which is smaller: -10431.153 or 1? -10431.153 Which is bigger: -2 or -254/405? -254/405 Which is greater: -8782 or -8776? -8776 Which is smaller: 0.5 or -141346? -141346 Which is smaller: 238804 or 238800? 238800 Which is smaller: 9137 or -3/142? -3/142 Which is greater: -1/306287 or -2/13? -1/306287 Does 0 = 2/539827? False Is -1197665 greater than or equal to -1197664? False Which is bigger: 1139 or 1167? 1167 Which is greater: 1/4 or 23733? 23733 Is 103752 at least as big as 103751? True Is 338 > 347? False Is 1290 bigger than 987? True Which is bigger: -6233157 or -6233156? -6233156 Which is bigger: 15715 or 15707? 15715 Is -2/7 less than or equal to -0.00143? True Are -3361 and -3534 nonequal? True Is 0.18 greater than -6/523? True Which is greater: -275 or 137? 137 Is -3113 < -3119? False Is 2095/6 < -1/2? False Is 92796 bigger than 92793? True Do -0.01 and -13048 have different values? True Is -23/103223 <= 1? True Which is bigger: 1644 or 1775? 1775 Is 2/1285103 bigger than 1? False Which is smaller: 1 or -2/837751? -2/837751 Which is bigger: 4358/835 or 4? 4358/835 Which is smaller: 5.9 or 58? 5.9 Is 1/1402950 greater than or equal to 1? False Which is smaller: 0 or -23/21526? -23/21526 Which is greater: 760835 or -6/7? 760835 Which is greater: -4 or -0.01303? -0.01303 Is 76369 bigger than 76368? True Which is greater: -3084 or -3061? -3061 Which is greater: 66353 or 66341? 66353 Is -151/252 greater than or equal to 0? False Which is greater: 27/3418 or 1? 1 Is 783920 >= 783922? False Is -1 >= -511/3397? False Which is smaller: 0 or 2386/2973? 0 Are -149 and -3408 nonequal? True Is -2930/4151 less than 0? True Is -19373/15 bigger than -1292? True Which is greater: -43 or -49? -43 Which is smaller: -27177 or 0.1? -27177 Is 1631 >= -80? True Is 1177 at most as big as 0.1? False Is -82040/31 smaller than -2647? False Which is bigger: 2 or -15142/3? 2 Which is smaller: 24208 or 24204? 24204 Is -3/1149200 at most 1? True Is 1 <= -50/13637? False Which is smaller: -2632/11 or -240? -240 Are -3182/257 and -12 equal? False Is 76 < 13210/173? True Which is smaller: 11205 or 100/7? 100/7 Which is smaller: 37761/7 or 5394? 5394 Is 32180 smaller than 32174? False Is 42963/220 at most as big as 194? False Does -1346 = -4135? False Do 1 and -3/11242 have the same value? False Which is smaller: 2/11 or 589? 2/11 Is -396001 smaller than 0.04? True Is -25328 not equal to 4/5? True Is -408 bigger than -10179/25? False Which is smaller: -0.3 or 19788? -0.3 Does 25895 = 25895? True Is -0.1 at least as big as -3935.3? True Which is smaller: -128 or -87? -128 Is -29150 at most as big as -1/4? True Which is greater: 26 or 1997/80? 26 Which is bigger: 57/53699 or 1? 1 Is 63115 < -6? False Is 1641993 < 1641993? False Which is smaller: -755 or -600? -755 Which is smaller: 458 or 457? 457 Are 1040 and 1232 nonequal? True Is 71.5 not equal to -317? True Which is bigger: -1 or 203/1324? 203/1324 Are 139 and -131 nonequal? True Is 2.655 at least as big as 92/7? False Which is smaller: 0.2 or 207.367? 0.2 Which is greater: 93 or 2168/23? 2168/23 Are -3.37 and 2/183 nonequal? True Which is bigger: -0.6 or -9106? -0.6 Is -4061 at least -4061? True Which is smaller: -1927421 or -1927420? -1927421 Is -177608 equal to -177611? False Are -9727 and -9724 nonequal? True Are 2/7 and -11/1792 non-equal? True Which is bigger: -0.1 or 8/3429? 8/3429 Is 231215 bigger than 231220? False Is -85981 at most -687841/8? True Are -1219 and -1203 nonequal? True Which is smaller: 71 or -1/65? -1/65 Is -2/380231 equal to 1? False Is 27455/2 <= 13727? False Which is bigger: -1671 or 388/5? 388/5 Which is smaller: 11 or 1/83? 1/83 Which is greater: 913737 or 2/9? 913737 Which is greater: 0.2 or 0.12273? 0.2 Which is smaller: -2/43 or 0.14074? -2/43 Is 0 greater than -11/4522? True Which is smaller: 949 or 586? 586 Are 11 and 0.764 unequal? True Are 13240 and 13242 non-equal? True Which is smaller: -2684/9 or 16? -2684/9 Is 5084 != 5091? True Which is smaller: 6/109 or 90? 6/109 Is -2168 > 27? False Which is smaller: -14/17 or 4/561? -14/17 Which is smaller: 1 or 4/7923? 4/7923 Does 9/13 = -0.511? False Are 11874708 and 11874707 non-equal? True Is -12317 < -0.8? True Which is smaller: -203306 or -203297? -203306 Which is smaller: -555/23 or -23? -555/23 Which is smaller: -38365 or -115097/3? -115097/3 Which is smaller: 2/801109 or 1? 2/801109 Is 95 bigger than 1808/19? False Which is smaller: 715623 or 715625? 715623 Which is smaller: 36341/3 or 12115? 36341/3 Do -202676/13 and -15589 have the same value? False Is -441/39863 bigger than 0? False Which is bigger: 1562 or 5395? 5395 Is -1 bigger than -71/670? False Is 0.121948 less than 1/12? False Which is greater: 5 or -79.9? 5 Is 1 at most as big as 141/6202? False Which is bigger: 50 or -4772? 50 Which is greater: 0 or -8.7089? 0 Are -4 and -777/173 unequal? True Is -473.1 greater than or equal to -33? False Is -12569 > -12603? True Which is bigger: 1637 or 1052? 1637 Is -3595 < -3660? False Which is smaller: 61817 or 61819? 61817 Which is smaller: -5 or -49460? -49460 Which is smaller: 162 or 14/71? 14/71 Which is smaller: 0 or -8/562599? -8/562599 Which is smaller: -10.3 or -28.05? -28.05 Which is smaller: -352081 or -352083? -352083 Which is greater: -11028 or -11014? -11014 Which is smaller: 1 or -2/8031? -2/8031 Which is smaller: -48743 or -48746? -48746 Is -1881 greater than 0.1412? False Which is smaller: 420211 or 0.1? 0.1 Which is greater: -1448/493 or -4? -1448/493 Is 855935 at least 2567807/3? False Is -364 >= -1205? True Which is smaller: -141556 or -141553? -141556 Which is bigger: 1 or 3/125065? 1 Is 354132/13 smaller than 27240? False Which is smaller: -34987 or -34988? -34988 Which is greater: -5665/238 or -24? -5665/238 Is 99/16 != -14? True Which is greater: -15995 or 64/3? 64/3 Which is sma	{ "pile_set_name": "DM Mathematics" }
795, -239785, -239775, -239765? -239755 What is next in 651, 531, 397, 243, 63, -149, -399? -693 What is the next term in -179, -699, -1557, -2753? -4287 What is the next term in -1195, -1168, -1141, -1114? -1087 What is the next term in -690, -1368, -2096, -2880, -3726, -4640, -5628, -6696? -7850 What is the next term in -330, -363, -412, -471, -534, -595? -648 What is the next term in -11597, -11585, -11559, -11513, -11441, -11337? -11195 What is next in 20208, 40416, 60624? 80832 What is the next term in 1610, 3227, 4844? 6461 What is next in 2006, 1907, 1812, 1721, 1634? 1551 What comes next: 27906, 55720, 83534, 111348, 139162, 166976? 194790 What is next in -3696, -14885, -33568, -59745, -93416, -134581, -183240? -239393 What is the next term in -623406, -1246801, -1870196? -2493591 What is next in -130, -1021, -3448, -8179, -15982, -27625? -43876 What comes next: 240351, 240352, 240353, 240354? 240355 What is the next term in 885, 920, 955? 990 What is the next term in 1785, 3556, 5325, 7092? 8857 What is next in 2806, 5540, 8264, 10966, 13634, 16256, 18820? 21314 What comes next: -587709, -587714, -587719? -587724 What comes next: 479, 459, 381, 209, -93, -561, -1231? -2139 What comes next: 17234, 17228, 17222, 17216, 17210, 17204? 17198 What is next in -411418, -822834, -1234248, -1645660, -2057070? -2468478 What is next in 1026, 1039, 1054, 1071, 1090, 1111, 1134? 1159 What is the next term in 21, 39, 73, 135, 237, 391, 609, 903? 1285 What comes next: 607332, 607334, 607334, 607332? 607328 What is the next term in 2279, 2220, 2129, 2012, 1875, 1724? 1565 What is next in -7834, -7861, -7888, -7915, -7942? -7969 What is the next term in 1852019, 1852009, 1851985, 1851941, 1851871, 1851769? 1851629 What comes next: -938, -7387, -24890, -58973, -115162, -198983? -315962 What is the next term in -170025, -340052, -510079, -680106, -850133? -1020160 What comes next: -19437, -38938, -58437, -77934, -97429, -116922, -136413? -155902 What comes next: 293553, 293554, 293555, 293556, 293557? 293558 What is the next term in -1445, -1022, -599, -176, 247? 670 What is the next term in -17767, -17777, -17789, -17803, -17819, -17837, -17857? -17879 What comes next: -2540, -2541, -2544, -2549, -2556, -2565? -2576 What is next in 2768, 5533, 8294, 11051, 13804, 16553? 19298 What is the next term in 860, 1724, 2588, 3452, 4316? 5180 What is the next term in -31, 120, 285, 458, 633? 804 What is next in -3551509, -7103029, -10654561, -14206111, -17757685, -21309289, -24860929, -28412611? -31964341 What comes next: 102, 276, 522, 840, 1230, 1692? 2226 What is the next term in -1248, -4996, -11242, -19986, -31228, -44968? -61206 What is the next term in 12071, 12071, 12081, 12107, 12155, 12231, 12341, 12491? 12687 What is the next term in 168169, 336340, 504511, 672682? 840853 What comes next: -1067, -4070, -9083, -16112, -25163, -36242? -49355 What comes next: -52, 31, 328, 947, 1996, 3583, 5816, 8803? 12652 What comes next: -17475, -70323, -158403, -281715, -440259? -634035 What is next in -1713, -1741, -1769, -1797, -1825, -1853? -1881 What is next in 1148262, 1148264, 1148268, 1148274, 1148282, 1148292? 1148304 What is the next term in -254580, -509186, -763792, -1018398? -1273004 What is next in -2141, -2160, -2213, -2318, -2493, -2756, -3125? -3618 What is next in -2351, -2506, -2659, -2810, -2959, -3106? -3251 What is the next term in -22577, -22556, -22521, -22472? -22409 What is next in -12, -176, -438, -798, -1256, -1812? -2466 What comes next: 3, 26, 63, 120, 203, 318, 471? 668 What comes next: 4357, 17381, 39079, 69445, 108473, 156157? 212491 What comes next: -797, -897, -995, -1091, -1185, -1277? -1367 What is the next term in 6978, 27886, 62736, 111528, 174262? 250938 What is next in -864, -2019, -3176, -4335, -5496? -6659 What is the next term in 289, 329, 367, 403, 437? 469 What comes next: -11985, -23742, -35499, -47256, -59013? -70770 What is next in 38, 4, -50, -124, -218, -332, -466? -620 What comes next: -1043, -8279, -27913, -66143, -129167? -223183 What is next in -8672, -8692, -8746, -8852, -9028, -9292, -9662, -10156? -10792 What is the next term in 7195, 7259, 7325, 7393, 7463? 7535 What comes next: -260, -224, -188, -152? -116 What is next in 1406, 5702, 12864, 22898, 35810, 51606? 70292 What is next in -8262, -16523, -24784? -33045 What comes next: -57064, -57063, -57062, -57061, -57060, -57059? -57058 What is the next term in -2838, -2816, -2794, -2772? -2750 What is the next term in 140, 222, 298, 368, 432? 490 What is the next term in -15077, -15069, -15057, -15041, -15021, -14997? -14969 What comes next: 255293, 255294, 255295, 255296? 255297 What is the next term in 16273, 16218, 16067, 15772, 15285? 14558 What is next in 89121, 89124, 89125, 89124, 89121, 89116? 89109 What is the next term in 211, 265, 383, 595, 931, 1421? 2095 What is the next term in -1247, -2604, -4059, -5612, -7263, -9012, -10859? -12804 What comes next: 102, 219, 356, 513, 690, 887, 1104? 1341 What is next in 407, 1671, 2939, 4211, 5487, 6767, 8051? 9339 What comes next: -2904, -2907, -2904, -2895, -2880? -2859 What is next in -190, -1569, -5304, -12571, -24546, -42405, -67324, -100479? -143046 What comes next: 18, 561, 1626, 3213, 5322, 7953? 11106 What comes next: 1829, 3724, 5667, 7682, 9793, 12024, 14399, 16942? 19677 What is next in 232, 287, 334, 367, 380, 367? 322 What comes next: -1715, -1807, -1899, -1991, -2083? -2175 What is the next term in -2100, -2020, -1940, -1860? -1780 What comes next: -2482, -4953, -7424, -9895, -12366? -14837 What is the next term in -332968, -665929, -998888, -1331845, -1664800? -1997753 What is next in -309684, -309679, -309674? -309669 What comes next: -1616, -12884, -43472, -103040, -201248, -347756, -552224? -824312 What comes next: -1214, -1210, -1174, -1088, -934, -694? -350 What is next in 3231, 24696, 82961, 196428, 383499, 662576, 1052061? 1570356 What is next in 2647, 5045, 7443? 9841 What is next in 24, 363, 1360, 3345, 6648, 11599, 18528, 27765? 39640 What comes next: -208, -199, -210, -265, -388, -603? -934 What is next in -54415, -108831, -163247? -217663 What comes next: 279, 1118, 2517, 4476? 6995 What is next in 378, 517, 678, 861, 1066, 1293? 1542 What comes next: -277, -281, -289, -301, -317? -337 What is the next term in -42468, -169903, -382296, -679647, -1061956? -1529223 What is the next term in 155276, 155276, 155274, 155270, 155264, 155256, 155246? 155234 What is the next term in 4025, 16068, 36139, 64238? 100365 What is the next term in -862, -1117, -1372? -1627 What is the next term in -55105, -55092, -55079, -55066, -55053, -55040? -55027 What is the next term in -365, -1512, -3425, -6104, -9549, -13760, -18737? -24480 What is next in 65, 83, 181, 401, 785, 1375? 2213 What comes next: 88, 239, 458, 775, 1220, 1823? 2614 What is the next term in 1502, 3079, 4654, 6227? 7798 What is next in -192, -372, -500, -552, -504, -332, -12, 480? 1168 What is next in 11, 97, 183, 269, 355? 441 What comes next: 2182, 4326, 6470, 8614? 10758 What is the next term in 27701, 27839, 27981, 28127? 28277 What is the next term in 137, 745, 1759, 3179, 5005? 7237 What is next in -1673, -6641, -14911, -26477, -41333, -59473, -80891, -105581? -133537 What is the next term in -264585, -529177, -793769? -1058361 What is the next term in 19, 77, 193, 379, 647? 1009 What comes next: -184518, -184521, -184524, -184527, -184530? -184533 What is next in -1855, -2323, -2777, -3211, -3619, -3995? -4333 What comes next: 5821, 46662, 157555, 373528, 729609, 1260826, 2002207? 2988780 What is the next term in -1300, -1891, -2874, -4243, -5992? -8115 What comes next: 1546393, 1546394, 1546395? 1546396 What comes next: -600, -600, -614, -648, -708? -800 What is next in 1251, 1340, 1443, 1560, 1691, 1836, 1995? 2168 What is the next term in 72, 61, -18, -171, -404, -723? -1134 What comes next: -166, -170, -174? -178 What is next in 14610, 29274, 43940, 58608, 73278? 87950 What comes next: -2064, -2055, -2046, -2037? -2028 What comes next: 764, 718, 670, 620, 568, 514, 458? 400 What is the next term in -10, 93, 260, 527, 930, 1505? 2288 What is next in -7289, -7288, -7285, -7280, -7273, -7264, -7253? -7240 What is next in	{ "pile_set_name": "DM Mathematics" }
-5/2, z, o. o, -5/2, z Let h = 477 + -473. Sort -0.7, h, -1, 0. -1, -0.7, 0, h Let x = 381 + -362. Sort -1, -3, x, 5 in increasing order. -3, -1, 5, x Let j = -45/44 + 3/11. Let s = -348/95 - -214/19. Let y = 39/5 - s. Sort j, -2/19, y. j, -2/19, y Suppose r + 97 = 102. Sort 3, r, 13 in descending order. 13, r, 3 Let z = -23.029 + 0.029. Let g = 27 + z. Let b = -0.54 + 0.04. Sort b, g, -0.04 in ascending order. b, -0.04, g Let d be (-17)/((-221)/(-143)) - -9. Let n(j) = -4 + 6j2 + 3j + 1 - 2j - j3. Let z be n(6). Put z, d, 8 in ascending order. d, z, 8 Suppose 0 = -5t - 38t + 344. Sort t, -3, -5, -1 in descending order. t, -1, -3, -5 Suppose -244f + 8 = -246f. Put f, -30, -5, 3 in descending order. 3, f, -5, -30 Let z = 1857 - 1856. Suppose 6g = 5g. Sort z, g, -1/4 in ascending order. -1/4, g, z Let q = -2074 + 2069. Sort 45/4, 4, -4, q in decreasing order. 45/4, 4, -4, q Let t be 2(3 - 4) + 2. Suppose 6b + 6 = -tb. Let l be ((-20)/25)/((-1)/5). Sort b, l, 2 in ascending order. b, 2, l Let s(y) = y*2 - 2y - 13. Let j be s(5). Let w be j(-6)/(-8)(-2)/3. Sort 10, w, -3 in increasing order. -3, w, 10 Let k be (-143)/4 - (-4)/(-16). Let b be (-1)/(-3) + 20/k. Let u = -331 + 330. Put b, 1/6, u in decreasing order. 1/6, b, u Suppose -3i = -2g + 9, -2g - 13 = -5g + 4i. Put 28, -5, g, -8 in decreasing order. 28, g, -5, -8 Let u = -326 + 329. Sort u, 161, -4 in descending order. 161, u, -4 Let y be 10/35 - 4/14. Suppose -10k + 6 = -24. Let a = 1 + -7. Sort a, k, y in ascending order. a, y, k Suppose -75l - 441 = -26l. Sort -2, -5, -4, l in ascending order. l, -5, -4, -2 Suppose -4s = -s - 6, 8 = 3m + s. Suppose -3t + 14 = y, 0 = t - mt + 2y - 7. Sort 5, t, 2. 2, t, 5 Let r(v) = -10v*2 + 519v + 55. Let i be r(52). Put 387, i, 1 in ascending order. 1, i, 387 Suppose -4m - c - 6 = 0, 2 = -5c + 6c. Let r be 2/((-3)/12m). Sort -5, -1, r in descending order. r, -1, -5 Let h(f) = -5f2 + 29f + 7. Let c be h(6). Let b = -2.35 + 3.92. Let o = -0.07 + b. Sort c, o, 0 in decreasing order. o, c, 0 Let h(q) = -q*2 - 4q + 6. Let n be h(-4). Let m be (n/18)/(-38/18). Put m, 3, 2 in decreasing order. 3, 2, m Let c = 0.06 - -0.24. Let i = 29 - 28.5. Let p = 4.15 - 0.15. Put c, p, i in descending order. p, i, c Suppose 4n - 2 + 14 = 0. Let h = -146 - -145. Let x = 2 - 1. Sort x, h, n in increasing order. n, h, x Let z be 159 + -137 - (1 - -6). Sort 4, -1, z, -4 in decreasing order. z, 4, -1, -4 Let h = 655 + -638. Sort h, 2, 0.1, 0.3 in increasing order. 0.1, 0.3, 2, h Suppose 5p = 4k + 10, 3k + 3p + 8 = 7p. Put k, 34, 1 in decreasing order. 34, 1, k Let a be 11/(-55)30/6. Let s(r) = -4r + 2. Let y be s(3). Let z = y - -6. Sort a, 2, z. z, a, 2 Let a be 9 + 7 + -9 + -10. Put -1, 3, a, -5 in increasing order. -5, a, -1, 3 Let r = 60 - 53. Let w(q) = q2 - 7q - 3. Let v be w(r). Sort -6, -4, -5, v in decreasing order. v, -4, -5, -6 Suppose -2s = 5g - 6s - 30, 24 = 2g - 4s. Let n(p) = -p - 34. Let f be n(-19). Let k be (-6)/(-4)(-4)/f. Sort k, g, 4/5 in ascending order. k, 4/5, g Suppose 40 = -0i - 4i. Let u(x) = x*2 + 8x - 14. Let g be u(i). Suppose -gj = 4 + 2. Put 4, j, 2 in ascending order. j, 2, 4 Let l = 4 - 5. Let z = -0.1 + 0.22. Let o = 4.88 + z. Sort o, -3, l in descending order. o, l, -3 Suppose -2w = -0u + 3u, 5u + 5w = 0. Let d = -112 + 81. Let v = -32 - d. Sort 2/17, v, u in increasing order. v, u, 2/17 Suppose l - 5 = 4q + 12, 3l - 4q = 27. Sort l, 27, -5, 4. -5, 4, l, 27 Suppose -91h - 42 = -98h. Put 5, h, 1, -3 in ascending order. -3, 1, 5, h Let d = 86 + -85. Sort d, 0, -4, -2 in descending order. d, 0, -2, -4 Let v = 2/11 - 100/187. Let q(i) = -i2 - i - 1. Let z be q(-2). Sort z, v, 0. z, v, 0 Let s be (-17784)/3496 + 2/23. Sort 4, s, 0 in ascending order. s, 0, 4 Suppose -49y = -52y - 51. Let s = 30 + y. Sort -0.1, s, -0.4 in increasing order. -0.4, -0.1, s Let g(k) = 2k - 11. Let m be g(8). Let c be 1/(-2(-1)/(-4)). Sort m, -3, 0, c. -3, c, 0, m Let p = -0.7 + -2.3. Let g = -402 - -406. Let l = -16 + 16. Put l, g, p in descending order. g, l, p Suppose 0 = -p - 1, r = -5p + 8p + 4. Put 5, r, -0.15 in increasing order. -0.15, r, 5 Let t(h) = h3 + 2h*2 - 4h - 4. Let i be t(-3). Let l(q) = -q*3 + 5q*2 + 3. Let f be l(5). Suppose -w + 51v - 2 = 53v, -w + 2v + 10 = 0. Sort f, w, i. i, f, w Suppose 2d - 4d + 16 = 0. Let y be d(5/4 - 1). Suppose 7q - y = 6q. Sort q, 1, -6 in decreasing order. q, 1, -6 Let w = -8/9 + 2/9. Put w, -0.5, 0, 62 in descending order. 62, 0, -0.5, w Suppose 15 = 5n - u, 6n - 5u - 31 = 3n. Let w(i) = i3 + 5i*2 + 6i + 3. Let f be w(-3). Put f, 6, n in decreasing order. 6, f, n Let b(f) = -f*2 + 3f + 6. Let o(t) = t*2 + 11t + 9. Let v be o(-10). Let s be (-10)/(0 - v - 3). Let i be b(s). Put i, -5, 5 in descending order. 5, i, -5 Let l be (-230)/(-69) - (120/(-18) + 6). Let r = 12 + -7. Put -2, r, -7, l in decreasing order. r, l, -2, -7 Let z = 127 - 89. Let y be (-57)/z1/((-6)/20). Put 4, -3, y in descending order. y, 4, -3 Let l(q) = -q - 2. Let n(t) = -t3 + t2 + t - 4. Let r be n(0). Let m(c) = c + 1. Let h(u) = rm(u) - 3l(u). Let f be h(2). Sort -5, -4, f. -5, -4, f Let p = -1819/1210 - -2/605. Sort 30/7, 0.5, 5, p in descending order. 5, 30/7, 0.5, p Let i(k) = 2k*3 + 14k*2 - 7k - 53. Let w be i(-7). Sort 4, w, 22 in ascending order. w, 4, 22 Let n = 6.849 - 6.8. Let l = 0.039 - n. Put -0.3, l, -0.5 in ascending order. -0.5, -0.3, l Let d = 99 - 101. Put -0.1, d, 2/17, -17 in ascending order. -17, d, -0.1, 2/17 Let y(n) = -18n + 239. Let w be y(13). Suppose -3h - 5 = 1. Put w, h, -4, 0 in ascending order. -4, h, 0, w Suppose 7h = h - 18, -4j + h - 13 = 0. Suppose 4 = 3f + 4s, -s - 16 = -3f + s. Put 2, f, 5, j in decreasing order. 5, f, 2, j Let b = -0.89 + 2.89. Let t = -52869/4316 - 1/2158. Let w = 12 + t. Sort b, -2, w in decreasing order. b, w, -2 Let v = 0.072 - 0.272. Put 5, 20, v in increasing order. v, 5, 20 Let x = -247 + 6917/28. Let t be 4 + -3 - 11/7. Sort -1, t, x in decreasing order. x, t, -1 Suppose 4w + 16 + 48 = 0. Suppose -2r = 5g - 5, -7g - 5 = r - 2g. Let t be (w/r)/(11/(-110)). Put t, 2, 1 in decreasing order. t, 2, 1 Let o = -2.2 + 3.4. Let u = -15 - -12.2. Let f = u - o. Sort f, -2, 4 in decreasing order. 4, -2, f Let i be 2/(-4) + 25/2. Let n = i - 9. Suppose -y = -4q + 16, 7 = nq - 3y - 5. Sort 8, 3, q in ascending order. 3, q, 8 Let k be -2(-3)/18 - 0. Let u = k - -13. Let p = -13 + u. Put p, 0.3, 5 in decreasing order. 5, p, 0.3 Let m(p) = -6p + 87. Let n be m(15). Let w = 2 + 1. Suppose -4i - wr + 8 = -2r, -4i - 5r = -8. Sort i, 1, n in ascending order. n, 1, i Let m = 0.038 + 0.462. Let i = -27 + 28. Let a be (12/(-15))/((-2)/10). Sort m, a, i. m, i, a Let r = 1.57 + -1.37. Put -4, -6, r, 2 in descending order. 2, r, -4, -6 Suppose -s - 3s - 4u - 140 = 0, 0 = -4s + 4u - 124. Let w(o) = -o*2 - 29o + 130. Let g be w(4). Sort 3, g, s in descending order. 3, g, s Suppose 0 = -24i + 7i - 17. Put -8, -2, i in increasing order. -8, -2, i Let h be (-9)/36 - (-29)/84. Let w(m) = m*2 + 5m - 1. Let n be w(4). Suppose n = -4x - x. Put 1, h, x in descending order. 1, h, x Let a be 3 - 0 - (2 + -2). Let k = 1 - 3. Sort a, k, 5 in decreasing order. 5, a, k Let s = -1 + 0.98. Let w = s - 3.98. Let n = -251 - -246. Put n, w, -2 in increasing order. n, w, -2 Let l = -0.049 + -6.751. Let y = l + 2.8. Let j = -0.62 - -0.7. Sort j, y, 1 in decreasing order. 1, j, y Suppose -7s - 47 = -26. Put s, 5, 2, -1 in decreasing order. 5, 2, -1, s Let c = 319 + -321.97. Let r = c - 0.03. Let a be 214/10. Sort -1/4, a, r in descending order. a, -1/4, r Let g = 160.6 - 161.607. Let l = 0.007 + g. Sort l, 3/2, -0.2, -1/2 in decreasing order. 3/2, -0.2, -1/2, l Let t = -172.27 - -172.2. Sort 0.3, 4, -4, t in increasing order. -4, t, 0.3, 4 Suppose 0 = 2x + 5y - 21, 2x + 2x - 3y = -23. Let f be 2/(15/(-6) - x). Put f, -5, -1, -2 in ascending order. -5, f, -2, -1 Suppose -4i - 29 = -2c - 13, 5c = i + 4. Sort c, 1, -5, -22 in decreasing order. 1, c, -5, -22 Let m = 1 - -1. Let c = -4 - -2. Sort -1, m, 5, c in decreasing order. 5, m, -1, c Let y be (-51 - -4)-2-1. Let c	{ "pile_set_name": "DM Mathematics" }
n + jf + pf*2 + if*3 and give p. -1 Express (-k + 2 - 2 + (1 - k - 1)(-4 + 3 + 2) - 1 + 1 - k)(580 - 513 + 262) in the form w + qk and give q. -987 Rearrange (-2 + 2 + m*4)(3 + 1 - 3) - 19m4 + 12m*4 + 16m*4 - 4m4 - m4 + 6m4 to the form km + p + fm2 + cm*4 + im*3 and give c. 11 Express (-8 + 3 + 2)(2 + 1 + 0)(-15z + 8z - 8z) as m + pz and give p. 135 Express -j + 0j + 3j + (-1 + 1 - 1)(-3 + 1 + 6)(1 - 1 + 3)(j - 8j + 0j) in the form wj + v and give v. 0 Rearrange (-6f + f + 4f)(-15 + 26 - 7 - 6f) + (-49f + 104f - 45f)(-3f + 4f - 2f) to wf + q + of*2 and give w. -4 Express -277 - 1581q + 277 as b + iq and give i. -1581 Express (2a*2 + 4a2 - a2)(-184 + 184 - 8a*2) + 3a + 0a - a + 4a*4 in the form fa*4 + ja*2 + i + ua + ra3 and give f. -36 Express (0 + 1 + 0)(5n - n - 3n) - 11n - 15n + 32n + (-4 + 4 + n)(-3 + 7 + 1) in the form vn + a and give v. 12 Express 13 - 11f - 8f2 - 8 + 10f + (-5f - 4f - 11f)(f + 2f - 2f) as zf2 + o + nf and give o. 5 Express ((-3b + 3b - 2b)(-5b2 + 2b*2 + 4b*2) - 1277b*3 + 3854 - 3854)(1 - 1 - 2) in the form cb + mb*2 + t + rb*3 and give r. 2558 Express 6s*2 - 10 - 5s - 7s2 - 11 + 18 + 0s*2 as js + us2 + v and give v. -3 Express 7 + 1275a*2 - 6 + 1 + 10a - 1269a2 + 5a*3 in the form z + ka*2 + ga*3 + sa and give s. 10 Rearrange -228a + 507a - 171a - 187a to the form p + ba and give b. -79 Rearrange -16j*2 - 92j*2 + 57j*2 - 123j*2 to the form hj + m + wj2 and give m. 0 Express 14 + 3v + 1 - 5 + (2 - 2 + 1)((0 - 5 + 2)(-v + 2v - 3v) + v + 5v - 4v) as iv + l and give i. 11 Express -99 - 37 + 22 + 2m*3 - 3m*3 in the form l + zm*2 + rm*3 + xm and give r. -1 Express (6s3 + 12 - 12)(5 - 4 + 0) + (-4s3 - 2s*3 + 5s*3)(-3 + 0 + 6) in the form ks + v + ms*2 + ts*3 and give t. 3 Express (-4 - 6 - 10)(-4 - 4 - 8)(-z + z - z) in the form oz + x and give o. -320 Rearrange (6z - z - 2z)(-2z + 3z - 2z) + 31z2 + 47z*2 + 44z*2 to the form tz + uz2 + n and give u. 119 Express (8745v + 1 - 3 - 8761v)(2v - v + v) in the form b + sv + zv2 and give s. -4 Express 546d*3 - 4d*2 - 275d*3 - 12 - 273d3 - d4 in the form bd4 + wd*3 + qd*2 + jd + v and give q. -4 Express o2 + o3 + 60 + 84o4 - 121o*4 + 40o*4 as a + jo*4 + io + mo2 + co*3 and give j. 3 Rearrange -2g*2 + 3g*2 + 0g*2 + (-67 + 98 + 89)(-3g + 3g*2 + 3g) to dg2 + ag + h and give d. 361 Express -1 - i*2 - 20i*3 - 38i*3 + 34i*3 - 4i as g + ri2 + mi + ni3 and give r. -1 Express -2m*3 - 57 + 6m*4 + 34 - 4m*2 + 21 in the form zm*3 + qm + cm2 + vm*4 + o and give o. -2 Express 0o - o - 4o - 27o as bo + c and give b. -32 Express b4 + 1 - 1058399b*2 + 192b*3 + 1058399b*2 - 2b in the form wb + a + mb*4 + qb*3 + hb*2 and give m. 1 Express 5n - n + n - n - 2 + 2 + 2 + 2n - 2 + (-1 + 0 + 3)(5n - 2n - n) - 12n + 13n - 91n as an + y and give a. -80 Express 62m3 + 2m2 - m4 - m - 66m3 - 3m*2 in the form z + lm*4 + km + jm2 + im*3 and give j. -1 Express 598 - 589 + 6j + 11j as r + kj and give k. 17 Rearrange (19g - 44g - 45 + 28g)(-3g - 7g + 5g) to b + ug*2 + kg and give b. 0 Express (0 - 3g + 0)(1 - 2 + 3) - 2g + 6g + 0g + (1 + 0 - 3)(0g - g - g) + (-3g + 0g + g)(1 - 2 + 2) + 2g + 3g + g as x + wg and give w. 6 Rearrange 6u - u - 14u3 + 2 - 5u + 8u4 + 19u3 - u2 to f + su4 + gu*3 + ju + ku2 and give g. 5 Express -3r*3 + 3r - 51r + 308r + 2r3 in the form wr*2 + zr*3 + p + fr and give z. -1 Express (-6j - 6 + 6)(-79j + 51j - 59j) in the form aj*2 + rj + b and give r. 0 Rearrange -747 + 3t3 + 801 + t3 to jt + wt2 + a + it3 and give i. 4 Rearrange 1 - 2 - 12 + b3 to the form v + qb2 + cb + wb3 and give v. -13 Rearrange 3l + 84 + 2l - 3l + 61 + 0l to the form x + al and give x. 145 Express (11h + 39h - 20h)(-22h - 3h + 5h + h + 0h + h - 3h + 3h - h + (1 + 2 - 1)(-2h + 3h - 2h)) as a + dh2 + ph and give a. 0 Express -280x - 4 - 33x + 5 - 1 as yx + w and give y. -313 Express -228175d + 228175d + 858d*2 in the form ud*2 + pd + k and give u. 858 Rearrange -6 - a*2 + 16a*2 + 8a*2 - 9a*2 to j + ya*2 + qa and give j. -6 Express (19r + 12r - 45r)(3r2 - 2r*2 - 3r*2) + (-8r*2 - 3r*2 + 4r*2)(6r - 10r - 6r) as t + cr*2 + pr*3 + dr and give p. 98 Rearrange 0h2 - 9h*2 + 2h*2 + (-6h + 14h - 7h)(-6h - 2h - 2h) to the form b + yh2 + gh and give y. -17 Rearrange -8 + 8n - 12 - 12n + 3 - 3n2 to the form kn*2 + x + ln and give x. -17 Express 84a2 - 5712 + 5712 in the form na*2 + c + pa and give n. 84 Express -738 + 738 + 909x as jx + s and give j. 909 Rearrange 119d3 - 497d*3 - 506d*3 - 4d*2 + 4d2 - d3 + (d + 0d - 2d)(5d + d*2 - 5d) to the form f + nd + gd*3 + xd*2 and give g. -886 Rearrange 5 - 120 - 101 - 7s*2 + 2s*2 + 52 to h + fs*2 + ds and give h. -164 Rearrange 93312 + 4o3 + 11o + 87o - 93310 to the form b + jo + wo2 + co*3 and give b. 2 Rearrange (-13033k*3 + 14k + 13024k3 - 2k*2 - 37k)(-2k - 3k + 6k) to the form nk4 + fk*2 + uk + rk3 + q and give n. -9 Express -1 - 3 + 49p + 13p2 + 9p*2 - 18p*2 as g + fp + yp2 and give f. 49 Rearrange 4f*2 - 10f*2 + 11f*3 - 5f3 + f4 + 8f2 - 2f + 2f3 to uf*4 + df*3 + jf*2 + nf + x and give j. 2 Express (-3t + 2t + 0t)(0t + t - 2t) - 12 + 1555t2 + 31 - 19 + 1285t*2 as dt*2 + f + ot and give d. 2841 Rearrange 9i - 15i*2 - 31i*2 + 50i*2 to the form z + si + ni2 and give z. 0 Express -30z*3 - 41z*2 + 23z*2 + 18z*2 - 3z in the form bz2 + x + yz + lz3 and give y. -3 Express -110c4 + 827 - 827 + 3 - c4 - 3 + (0c3 - 3c3 + c3)(-3c + 3c + 2c) as pc2 + fc*4 + sc + ac3 + k and give f. -115 Express (1561 + 538 + 1321)(-1 + 0 + 0)(y3 - 3y*3 + 3y*3) as v + qy + cy3 + ly*2 and give c. -3420 Rearrange 0d + 4d - 5d + (1 - 2 + 3)(-d + 0d - d) - d + 0d - d + (-5d + 2d + 2d)(-1 - 3 + 2) + 29d - 39d + 60d to ad + m and give a. 45 Express 92k - 47 + 91k + 92k - 272k + 284 in the form ak + b and give b. 237 Rearrange (0 - 1 + 0 + (-5 + 0 + 2)(-2 + 3 + 3))(-5r2 + 2r*2 - 3r*2) to wr + xr2 + v and give x. 78 Rearrange -1574c*2 + 1 - 4 + 4441c*2 + 3 to j + yc*2 + mc and give y. 2867 Rearrange -5r2 - 28r - 15r2 - 10r*2 + 13r*2 to q + ir + mr2 and give m. -17 Express (-2h + 3h + 0h)(-5 + 3 - 2)(6h2 - 8h*2 - 18h*2)(-3 + 1 - 2) as z + qh2 + vh + bh3 and give b. -320 Express -239k + 39k + 10k - 205k + 23k as mk + v and give v. 0 Rearrange (404 - 155 + 925 + 154)(0p3 + 2p*3 - 4p*3) to the form l + xp*2 + hp*3 + tp and give h. -2656 Rearrange 5i - 4 + 1 + 0 + 4 - 4i*4 to the form zi + gi3 + bi*2 + ai*4 + m and give m. 1 Express (v - 2 + 2)(-1 + 2 + 1)(-v + 3 + v2 + 1 + 18) as pv + xv3 + z + yv*2 and give x. 2 Rearrange 2m + m*2 - 2m + 27m2 - 15m*2 - 108m2 + (m2 - m*2 - 2m*2)(0 - 5 + 4) to the form vm2 + o + sm and give o. 0 Rearrange u + 699 - 6u4 + 704 + 0u*4 - 84u*2 - 1403 to ku*2 + lu + y + iu4 + pu*3 and give k. -84 Express -634m*2 + 319m*2 + 537m + 316m2 as pm + zm2 + f and give z. 1 Rearrange -506k*2 + 1017k*2 + 19k - 501k2 to the form wk + vk2 + q and give w. 19 Express s2 - s2 + s2 + (-5 + 2 - 1)(-3s2 - 2s*2 + 0s2) + s2 + 5s2 - 3s*2 as ps + qs2 + d and give q. 24 Express -290c + 189c - 3c2 - c2 + 167c in the form g + ic + bc2 and give i. 66 Express k - 9 - 123 - 27 as x + hk and give h. 1 Rearrange (2a2 - 11a + 11a)(0a2 + 1471 - 1470 + 3a*2) to the form ba*4 + va*3 + xa + pa2 + g and give b. 6 Express 50 - 43v - 50 + (-2v + 2v + 2v)(-1 + 0 - 1) + 2v + 4 - 4 as gv + d and give g. -45 Rearrange 10 - k - 7k + 15k - 6k - 6k to v*k + d and give d. 10 Rearrange	{ "pile_set_name": "DM Mathematics" }
et t = w - 3.6. What is the third smallest value in d, -2/3, 0, t? t Let n = -3041 + 3041.3. Which is the fifth smallest value? (a) 1/3 (b) -4/3 (c) 4 (d) n (e) -1/4 c Suppose 4m - 5r - 12 + 18 = 0, -18 = 2m + 5r. What is the fourth smallest value in m, 1/8, 1/4, -2/11? 1/4 Let i = -6488/21 - -309. Let g = 1.198 - 2.198. Which is the third smallest value? (a) i (b) g (c) 0 a Let u be (-1)/12 + 1 - 200/160. Let x = -23 + 24. What is the second biggest value in u, -2, x, -16/5? u Let t = -132.96775 + -0.03225. Which is the third biggest value? (a) 1 (b) 0.04 (c) t c Let c = 323.7 + -323.2. What is the second smallest value in c, 0.05, 4/9? 4/9 Let h = -4492 + 4493. Which is the third biggest value? (a) h (b) 5 (c) 4/7 (d) -6 (e) -0.1 c Let j = 4.6 + -5. Let k(s) = 287s3 - 3s*2 - 5s - 3. Let x be k(-1). Let y = x + 3170/11. Which is the third smallest value? (a) y (b) j (c) 0.24 c Let s = -78739 + 78760. Let f be (3/9)/(-1) + 0. Which is the fourth biggest value? (a) f (b) -1 (c) s (d) -3/7 b Let j = -51 - -48. Let n = 14 + -43. Let k = 20 + n. Which is the smallest value? (a) -0.2 (b) k (c) j b Let w be (-66)/55(-80)/24. Which is the second smallest value? (a) -14 (b) 20 (c) -4 (d) w c Suppose 0 + 6 = -6d. Let c(f) = 9f + 4. Let o be c(-3). Let h = o - -28. What is the second smallest value in -0.4, d, h? -0.4 Let q be (72/35 - 2)/((-9)/45). Let n = -1184 + 4765/4. Which is the fourth biggest value? (a) n (b) -5 (c) 3 (d) q b Let s = 4.97 + 0.03. Let l(v) = -v2 + 17v + 68. Let x be l(22). Let n be 10/35 - (-40)/x. Which is the second smallest value? (a) s (b) 0.5 (c) n b Let g = 6092.8 - 6093. Which is the fourth smallest value? (a) 5 (b) g (c) -1 (d) 1 (e) 9 a Let f = -4.96 + -209.04. Let y = f - -311. Let g = y - 97.1. Which is the second smallest value? (a) 0.5 (b) g (c) 1/10 c Let p be ((-6)/27)/((-2)/3). Let x = 45 - -18. Let m = x + -68. Which is the second smallest value? (a) -4 (b) p (c) 0.3 (d) m a Let y = -206 - -197. Let t be 2 + 75/y + 6. Let m be (32/200)/((-4)/10). Which is the third smallest value? (a) 4/3 (b) t (c) 2/11 (d) m c Let l = 95 - 42. Let z be (-24)/(-14) + (-3)/((-6)/(-4)). Suppose 0 = 104j - 98j - 12. Which is the third biggest value? (a) z (b) j (c) l a Let j = 9640 + -9636. Suppose 0 = h + 4w - 12, 4h - 4w = -0 - 12. Which is the second biggest value? (a) -1 (b) 10 (c) j (d) h c Let t = 539/3 - 2689/15. What is the fourth smallest value in -2/11, t, 0, 4? 4 Let q = -0.1411 - 0.0589. Suppose 4t = 3v + 2v + 3, -t + 2v = 3. What is the fourth biggest value in t, q, -5, -0.1? -5 Let z be 6/4 - (-2 + 3). Let p be -4-1(-33)/(-12). Suppose pj = -j + 120. Which is the smallest value? (a) j (b) 0.2 (c) z b Suppose 3h - 3 = -3x, 5h - 7 = -2x - 2x. Suppose u = -3u. Let l = -23.7 - -24. Which is the third biggest value? (a) h (b) u (c) l b Let r be 84/182 - 35/(-65). Let t = -296 - -307. Which is the third biggest value? (a) -0.1 (b) -2/3 (c) t (d) r a Let w = -9 - -6. Let g = 103728 - 103727.5. Let h = -5 - -10. Which is the third biggest value? (a) h (b) g (c) w (d) -2 d Let n = -35.18 - -39.18. Which is the smallest value? (a) n (b) 50 (c) -1 c Let n = -1.5 - 0.5. Let i = -3131 + 3134. Which is the second smallest value? (a) n (b) i (c) 0.6 (d) 0.1 d Let x = 0.24 + 1.76. Let m = x - 1.8. What is the third biggest value in m, 1.8, 1/3? m Let l = -7 + 7. Let q be 9 + (-152)/16 + 2. Which is the biggest value? (a) l (b) q (c) -0.2 b Let l = -3/4459 - 30733/713440. Let q = l - 5/32. Which is the second biggest value? (a) -2/41 (b) q (c) 0 a Let m = 0.2 - -5.8. Let t = -6904 - -6901. Let w = -2 - -1. Which is the third smallest value? (a) w (b) t (c) m c Let p = -1.1 - -0.1. Let x = -14.1 + 11.1. Let q be 25/23 - (-10 - -11). What is the third biggest value in q, p, x? x Let g = 35.7 + -36. Let w = -0.533 + 0.5. Let v = w + -0.117. Which is the second biggest value? (a) v (b) g (c) -2/5 b Let h = 0.04 + -0.14. Let v = h + 0.4. Let i = -36087/5 - -7218. What is the fourth smallest value in v, 4, i, 5? 5 Let i = -1899 - -1898. What is the third smallest value in i, 3/26, -0.3, -0.5? -0.3 Let p = -9.98 + 9.48. Let g = 1.6 - -2. Let f = g - 3.5. Which is the biggest value? (a) f (b) p (c) -0.2 a Let k = -128.4 - -258.4. Which is the smallest value? (a) 0 (b) k (c) 1/4 a Let j be 2 + 10 + -6 + -26. Let s be (-3 - 170/j) + 12/(-2). What is the third smallest value in 0.5, s, 12? 12 Let w = 0.056 - -95.944. Let v = w - 106. What is the biggest value in -0.5, 0.5, 0.4, v? 0.5 Let x be (-2 + -1)11 + 3. Let r be 55/33-891/5. Let l = r - x. Which is the smallest value? (a) 5 (b) l (c) -4/9 c Let j = 0.06615 + 0.02385. Which is the third smallest value? (a) j (b) -1 (c) 1.2 c Let o = -36.6 + 200.6. Let m = o + -163. Which is the biggest value? (a) m (b) 0.06 (c) -0.1 a Let m(o) = o3 + 18o*2 + 109o + 1564. Let f be m(-17). Which is the fourth smallest value? (a) f (b) -2/13 (c) -2/33 (d) 100 d Let y(z) = -z - 294 + 291 - 4z. Let s be y(-10). Suppose 0 = -4r + 17 + s. Which is the second smallest value? (a) r (b) -2/9 (c) 5 c Let z = -83/300 - -2/75. Let l be (-3 - -1 - 2) + (2 - -16). Suppose li = 14 - 14. What is the second biggest value in z, 3/8, i, 3/2? 3/8 Suppose -k = 5k. Suppose -3r = -kr - 15. Suppose -m + r = 9. What is the third biggest value in m, -12, -3? -12 Let v be (-1375)/6-1 - -4. Let f = -233 + v. Which is the fourth smallest value? (a) 2/25 (b) 0.07 (c) -1 (d) f d Let z = 5.215 - 5.515. Which is the second biggest value? (a) 0.5 (b) 1 (c) 6 (d) z (e) -4 b Suppose 61n = -74n - 675. What is the biggest value in n, -87, 0? 0 Let o = 65.2 + -492.2. Let l = o - -431. Which is the smallest value? (a) -0.3 (b) 5 (c) l (d) 0.3 a Let i = 0.191 - -0.039. Let w = i - 1.23. Let g = 111 - 221/2. Which is the smallest value? (a) w (b) -3 (c) g b Let l = 0 + -0.2. Let t = 307 - 340. Let u = 2060 - 2055. What is the second biggest value in l, u, t? l Let k(x) = -x2 + 19x + 1190. Let t be k(-27). Which is the second biggest value? (a) -2 (b) t (c) 13 a Let w be 28/(-7 + 11) + -11 + 18/5. Which is the second smallest value? (a) -6 (b) -3 (c) -4 (d) 5 (e) w c Let y = -226 - -229. Let m = -3.32 - -4.32. Which is the second smallest value? (a) 4 (b) m (c) y (d) -0.06 b Suppose -3g + 27 = -2g + 3r, -r - 5 = 0. Which is the biggest value? (a) g (b) 2 (c) 1/2 a Let m be (16/340)/(2/(-5)). Let n = 879 + -882. What is the smallest value in 0, n, m, -0.1? n Let v = 232.4 + -1216.4. Let g = 980 + v. Let y be 41/(-36)2. What is the third smallest value in g, -8, y? y Let t = 5118 + -5118. What is the biggest value in -492, t, -2? t Let q = -4.769 + 1.769. Which is the biggest value? (a) 0.1 (b) q (c) 5 (d) 3.6 c Suppose -t = -2y - 6, -y + 10t - 24 = 6t. Which is the biggest value? (a) y (b) -0.189 (c) 0.2 c Let v = 69.93 - 71. Let c = 0.77 + v. Let z be (4/(-21))/(4/6). What is the fourth biggest value in c, z, -3, 0? -3 Let m be ((-476)/(-63))/(-17)2/(-8). What is the second smallest value in -1/69, m, -0.2? -1/69 Let l(g) be the first derivative of g2 - 13g - 35. Let h be l(5). Let u = 2.06 - 2. Which is the biggest value? (a) h (b) u (c) -1/2 b Let t be (33 - 29)(0 + 1 + 1). Suppose 6n + t = 8. Which is the second biggest value? (a) -2 (b) -2.3 (c) n a Let t = -1.1 - -1.2. Let s = -69.5 - -391.5. Let c = s - 318.8. What is the third smallest value in t, 5, c? 5 Let m = 1.154 + -124.854. Let g = m - -124. Which is the fourth smallest value? (a) 4/5 (b) g (c) -1/11 (d) -0.2 a Let m = 23.483 + -23.5. What is the smallest value in m, -4, 1/2? -4 Let o = 251 - 250. Suppose -11b = 3m - 7b - 5, o = m + b. What is the second biggest value in 4/3, m, 6? 4/3 Let f = -28436 + 28436.1. Which is the second smallest value? (a) 1 (b) -5 (c) 9 (d) -1.7 (e) f d Let h = -486 - -304. Let f = -186 - h. What is the biggest value in -2/3, 0, f, -27? 0 Let d = 88.28 + -88.2. What is the fifth biggest value in 0.25, -0.4, 0, d, -0.5? -0.5 Let l(f) = -f3 + 15f*2 - 33f - 27. Let n be l(12). Let u = -12 - -22. Let y be u/8 + (-4 -	{ "pile_set_name": "DM Mathematics" }
by 72. 67 Let t(f) = f - 4. Let z be t(3). What is the remainder when 12/(26/4 - (-400)/(-80)) is divided by (-3)/6z12? 2 Suppose 28u = 3l + 27u - 404, -4l + 4u = -544. Calculate the remainder when l is divided by 75. 59 Let q be (20/(-15))/(((-20)/9)/5). Let l(p) = 3p*2 + 5p + 0 + 0 + qp2 + 10 + p3. Calculate the remainder when l(-5) is divided by 10. 0 Let m(s) = 5s*2 + 46s + 137. Calculate the remainder when 233 is divided by m(-8). 55 Suppose 24656 - 8472 = 34h. What is the remainder when h is divided by 53? 52 Let z(s) = 12s*2 + 45s - 115. Calculate the remainder when z(10) is divided by 27. 23 Let r(s) = -s*3 - 11s*2 - 36s + 67. Calculate the remainder when 40747 is divided by r(-8). 160 Let c(k) = k*2 - 17k + 15. Let h be c(17). Suppose 9l + 3 = -h. What is the remainder when 54 is divided by (-5)/(2/2)-2 + l? 6 Let p = 2 - -2. Let w = p - 1. What is the remainder when 11/4 - (-12 + 94/8) - -13 is divided by w? 1 Suppose 4i - 3g + 9 = -13, -3i + 4g - 20 = 0. Calculate the remainder when -7 + 107 + (3 - i) is divided by 36. 35 Suppose y - 5y + 24 = 0. Let b = 185 + -197. Let c = 22 + b. What is the remainder when c is divided by y? 4 Suppose -71 = -7z + 34. Let m = 42 - 39. Calculate the remainder when (14/m)/(((-5)/(-45))/1) is divided by z. 12 Suppose -3x + 143 = -2c, 39x + 5c + 179 = 43x. What is the remainder when 157 is divided by x? 4 Let o = 199 - 181. Suppose 0 = oq - 16q - 12. What is the remainder when 21 is divided by q? 3 Suppose -7707j + 7714j - 280 = 0. Let t(o) = -73o + 1. What is the remainder when t(-6) is divided by j? 39 Let j be 126/(1 - 3). Let h(w) = -9w - 85. Calculate the remainder when 222 is divided by h(j). 30 Let r = -8232 + 8325. Suppose -3v + 22 + 35 = 0. What is the remainder when r is divided by v? 17 Let k(q) = -7q*3 - 3q - 2. Suppose 5d = 2x + 219 - 51, 2x = 4d - 170. What is the remainder when x/(-3) + (-12)/(-9) is divided by k(-1)? 7 Let g = -98 - -115. Let d(l) = 5l - 56. Calculate the remainder when 136 is divided by d(g). 20 Suppose 0 = -27x - 37x + 2880. What is the remainder when x is divided by 24? 21 Suppose 2781 = 35v + 16. What is the remainder when 388 is divided by v? 72 Let p be 225/(-135)(31-1 - -1). Suppose -18 = d - p. Calculate the remainder when 98 is divided by d. 2 Let n be 9405/77 + (-1)/7. Suppose -91 - 31 = -2m + 5h, 0 = -2m + 4h + n. Calculate the remainder when m is divided by 1/(((-11)/(-682))/((-1)/(-2))). 30 Suppose -41 - 55 = -2b. Suppose 51 = -6d + 153. Calculate the remainder when b is divided by d. 14 Let d(w) = 6w - 41. Suppose 4i = 2o - 44, 0i - 31 = -3o - i. Let f = -3 + o. What is the remainder when 102 is divided by d(f)? 11 Suppose 0 = -108c + 164852 + 285076. What is the remainder when c is divided by 144? 134 Let n(y) = y - 46. Let v be n(7). Let p be 12/3 - v2. Suppose p - 208 = -7t. What is the remainder when 89 is divided by t? 17 Let q = -5781 - -6098. What is the remainder when q is divided by 51? 11 Let m(y) = 16y - 65. Let j be (-3)/(-27)-3 - 160/(-30). Calculate the remainder when 29 is divided by m(j). 14 Let g be (-54)/4(-2)/3. Suppose -4i + g = -i. Suppose 204 = 5d + j, -60j - 144 = -4d - 64j. Calculate the remainder when d is divided by i. 0 Suppose -2q + 680u + 680 = 683u, 4q + 3u - 1354 = 0. What is the remainder when q is divided by 85? 82 Let z(y) be the first derivative of -35y*2/2 - 3y + 3. Let o(u) = 5u2 - 131u + 23. Let k be o(26). What is the remainder when z(k) is divided by 26? 24 Suppose 0 = -12p + 175 + 65. Suppose 2z - 4o - 32 = -2z, 3z - 2o - p = 0. Suppose -3q + 56 + z = 0. Calculate the remainder when 93 is divided by q. 13 Let u be ((-150)/(-4))/(-5)(-156)/9. Suppose g + 122 - u = 0. Calculate the remainder when 35 is divided by g. 3 Let g(q) = q*2 + 11q + 17. Let c(h) = -h*2 + 7h + 7. Let z be c(9). Let o(j) = j3 + 7. What is the remainder when g(z) is divided by o(0)? 3 Let q(x) = x3 + 10x2 + 25x + 21. Let y be 0 + -6 - (10 - 10). Calculate the remainder when 101 is divided by q(y). 11 Let l(t) = 18t - 40. Let m(u) = u. Let h(b) = 2l(b) - 20m(b). What is the remainder when h(12) is divided by 19? 17 Suppose 5b - 8b - i = -155, -4b = 2i - 208. What is the remainder when 176 is divided by b? 23 Let s(u) = -11u - 6. Suppose -269q + 3861 = 218q - 6366. Calculate the remainder when s(-4) is divided by q. 17 Suppose 2i + 5m - 2m = 35, -3i - 2m = -65. Let x(c) = 86c*2 - 4c - 4. Calculate the remainder when x(-1) is divided by i. 11 Let z(h) = -h*2 - 23h - 104. Let v be z(-7). Suppose -vr + 381 = -419. Calculate the remainder when r is divided by 17. 15 Let i = 107 - -298. Let y = -394 + i. Suppose 3b + 57 = 6b. Calculate the remainder when b is divided by y. 8 Suppose 379 = -4a + 395. Suppose 3l = s - 11 - 64, -l = -a. Calculate the remainder when s is divided by 45. 42 Suppose 91w = -232w + 7627 + 6585. Calculate the remainder when 517 is divided by w. 33 What is the remainder when 7/(-14) - (101673/(-22))/13 is divided by 352? 3 Let u = -4870 - -4961. What is the remainder when 270 is divided by u? 88 Let p(i) = -i3 - 10i*2 + 38i + 44. What is the remainder when 680 is divided by p(-13)? 53 Suppose -15g + 7g = -5624. Suppose -g = -14o - 87. What is the remainder when o is divided by 13? 5 Let w be (9 + -18)/(0 - (-2)/154). Let d = 826 + w. What is the remainder when d is divided by 24? 13 Let y = -609 + 625. What is the remainder when 68 is divided by y? 4 Let k(w) = -23w*2 - 28w + 62. Let a be k(2). Let x = a + 113. What is the remainder when x is divided by 19? 8 Suppose 4b = -12, -3b = -2a - 2 + 47. Let x(d) = 13d. What is the remainder when x(4) is divided by (132/a)/(-2)-3? 8 Let g = 458 - 466. What is the remainder when 18/(-28)-72 + g/28 is divided by 7? 4 What is the remainder when 75 is divided by (62/155)/(4/30)(-220)/(-30)? 9 Let o(f) = 15f*2 + 33f - 67. Calculate the remainder when 144 is divided by o(2). 26 Calculate the remainder when -8(-6 - 77/(-14)) + 509 is divided by 136. 105 Suppose 522 = 3s + 2s + 4k, -328 = -3s + 5k. Let a = 175 - s. Calculate the remainder when a is divided by (60/25)/((-6)/(-30)). 9 Let f = -44 + 79. Let v(y) = 41y2 + 0y - 4y - 8y - 10 + 166y2. Calculate the remainder when v(-1) is divided by f. 34 Suppose 15l + 1150 = -10l. Let x = l + 63. Let h = 98 + -51. What is the remainder when h is divided by x? 13 Suppose -2x - 4 + 8 = v, -2x + 8 = -v. What is the remainder when 24 is divided by x? 0 Let r = 4632 + -4592. Calculate the remainder when 621 is divided by r. 21 Let z(o) be the second derivative of 11o + 3/2o4 - 1/20o*5 - 3o*3 + 0 + 33/2o*2. Calculate the remainder when 55 is divided by z(17). 7 Suppose 159 = 6u + 2355. Let c = 381 + u. What is the remainder when 172 is divided by c? 7 Suppose -2w + 317 = 3f, -5w = -4f - 111 - 693. What is the remainder when 280 is divided by w? 120 Let x(g) = 2g2 - 28g + 3. Let f be x(14). Suppose 4y - r = 831, -fr - 25 = -16. Calculate the remainder when y is divided by 26. 25 Let d(q) = q*2 - 37q + 8. Let w(x) = 2x2 - 38x + 8. Let l(m) = -2d(m) + 3w(m). What is the remainder when l(10) is divided by 7? 1 Let k = -87 + 102. Suppose -6a - 51 - k = 0. Let l = -8 - a. What is the remainder when 11 is divided by l? 2 Suppose -3r + c - 3 = -2c, r + 2c - 11 = 0. Suppose 5x = -0k - 2k + 132, -rx + 5k = -73. Calculate the remainder when x is divided by 2/2 + 72/(-9)-1. 8 Suppose 0 = 3c - 3k - 2370, 233 = 2c - k - 1344. What is the remainder when c is divided by 388? 11 Suppose 5z - 183i + 185i = 5943, -5i - 5985 = -5z. Calculate the remainder when z is divided by 98. 15 Let c(t) = -12t - 165. Let l(b) = 12b + 158. Let x(s) = -3c(s) - 4l(s). What is the remainder when 66 is divided by x(-13)? 9 Let s(b) = 2b3 + 49b*2 + 57b + 109. Calculate the remainder when s(-23) is divided by 43. 41 Let b(u) be the second derivative of u*5/10 + 11u4/6 - u3/2 - 27u2/2 - 108u. Calculate the remainder when 15 is divided by b(-11). 3 Let s = 502 - 494. What is the remainder when 161 is divided by (-1107)/(-82)*s/6? 17 Suppose 140462	{ "pile_set_name": "DM Mathematics" }
lect the terms in 8 - 8 - 34u + 21u. -13u Collect the terms in -14t*3 - 2t*3 - 13t*3 + 4t*3. -25t*3 Collect the terms in -13z + 26z - 9z - 7z. -3z Collect the terms in -281h + 81h - 271h. -471h Collect the terms in -1866n + 949n + 2n3 + 917n. 2n3 Collect the terms in -u + u - 147u*3 + 121u*3. -26u*3 Collect the terms in -3x - 1209 + 1209. -3x Collect the terms in -72v - 51v - 153v + 35v. -241v Collect the terms in 24v - 6v*2 - 9v - 15v. -6v*2 Collect the terms in -14c + 12c + 2c + 2c3. 2c*3 Collect the terms in -2 - 177o*2 + 2. -177o*2 Collect the terms in -64c*2 - 16 + 16 + 118c*2 - 57c*2. -3c*2 Collect the terms in 0v + 0 + 2v + 0. 2v Collect the terms in -44y3 - 29y*3 - 23y*3 - 34y*3. -130y*3 Collect the terms in -3924332 + 3924332 - p. -p Collect the terms in 2q*3 - 4 + 5 + 6q*3 - 3. 8q*3 - 2 Collect the terms in -7y*2 + 17y*2 - 2y*2. 8y*2 Collect the terms in 13o*2 - 3o*2 - 6o*2. 4o*2 Collect the terms in -3z + 1639z3 + 3z - 1616z3. 23z*3 Collect the terms in 9l - 9l + 8l. 8l Collect the terms in -j + 27791 - 27791 + j - 3j*2. -3j*2 Collect the terms in -1 - 850w*3 + 7 - 6 + 848w*3. -2w*3 Collect the terms in -99k + 217k - 107k. 11k Collect the terms in -4q*2 - 3q*2 - 4q*2 - 3q*2 + 3q*3. 3q*3 - 14q*2 Collect the terms in -9j*2 + 3j*2 + 11j*2 - 2j*2. 3j*2 Collect the terms in 2k*3 + 3k3 - k3 - 2k3. 2k*3 Collect the terms in -370 + 51u + 370 - 60u. -9u Collect the terms in -5n - 35n*2 + 5n + 28n2. -7n*2 Collect the terms in 2v*2 + 6v*2 + 0v*2 - 3v*2. 5v*2 Collect the terms in 10 - 6z + 8 - 3. -6z + 15 Collect the terms in 9u*2 + 4u - 5u2 - u3 - 152u. -u*3 + 4u*2 - 148u Collect the terms in -24b3 + 61b + 5b3 - 61b. -19b3 Collect the terms in -9h - 2263 + 2263. -9h Collect the terms in -578t - 582t + 1161t. t Collect the terms in -1473 + 1473 - 12b. -12b Collect the terms in -621t + 621t + t2. t2 Collect the terms in -1726l3 + 868l*3 + 854l*3. -4l*3 Collect the terms in -246n*3 - 256n*3 + 506n*3. 4n*3 Collect the terms in 5s*2 - 13s*2 + 6s*2 - 7s*2. -9s*2 Collect the terms in -5c - 2c + 7c + 18c3. 18c*3 Collect the terms in 55081 - 55081 + o - o + 13o*2. 13o*2 Collect the terms in -1104b - 1396b - 1212b. -3712b Collect the terms in -23 - 28 + 75 - 24 - o. -o Collect the terms in -182s + 14s - 39s. -207s Collect the terms in -7d*2 - 14d*2 + 20d*2 - 31d3 + d2. -31d3 Collect the terms in 9b*3 + b - b - 26b*3. -17b*3 Collect the terms in -15t - 2742 + 2742. -15t Collect the terms in 2v2 - 39 - v3 + 39. -v*3 + 2v*2 Collect the terms in 2x3 - x3 + x*3. 2x*3 Collect the terms in 9 + 6 + 11m - 15. 11m Collect the terms in s2 + 19s - 17s - 5 + 5. s2 + 2s Collect the terms in -7h + 6h + 9h - 3h. 5h Collect the terms in 126z*3 - 57z*3 - 71z*3. -2z*3 Collect the terms in 16v*3 - 33167 + 33167. 16v*3 Collect the terms in -5q*3 - 8q*3 + 18q3 - q3. 4q3 Collect the terms in 3y*2 + 103y + y*2 - 931y - 5y2. -y2 - 828y Collect the terms in -52d + 7d*3 + 52d. 7d3 Collect the terms in -9k*2 + 9k*2 - 17k*2 + 0k*2. -17k*2 Collect the terms in 27z*2 - 61z*2 - 47z*2. -81z*2 Collect the terms in -2w - 4w + 18w - 5w. 7w Collect the terms in 31t + 0t - 31t - 2t*2. -2t*2 Collect the terms in 0y*3 + 3y*3 + 7y*3 + 2y*3. 12y*3 Collect the terms in -510v + 998v - 493v. -5v Collect the terms in 3b - 8b2 - 70b*2 + 0b - 4b. -78b*2 - b Collect the terms in -6839 + 6839 + d. d Collect the terms in -87a*2 + 176a*2 - 87a*2. 2a*2 Collect the terms in 111s - s2 - 794 + 794. -s2 + 111s Collect the terms in 7m - 43m + 6m + 15m + 14m. -m Collect the terms in 51d3 - 102d*3 + 47d*3. -4d*3 Collect the terms in -4h*2 + 4h*2 + 14h*3 - 61h*3. -47h*3 Collect the terms in -91v*2 + 43v*2 + 42v*2. -6v*2 Collect the terms in 36 + 2i + 2i - 6i + 3i. i + 36 Collect the terms in 12l*2 + 6l*2 - 7l*2. 11l*2 Collect the terms in -309 + 16a + 309. 16a Collect the terms in 9l*3 - 3l*3 + 23l*3. 29l*3 Collect the terms in 41 - 6i + 37 - 123 + 45. -6i Collect the terms in 23x - 1 + 1 - 173x. -150x Collect the terms in 8p - 19p + 2p + 4p + 10p. 5p Collect the terms in 2p2 + 1640722p - 1640722p. 2p*2 Collect the terms in -28k*2 + 4k - 4k - 8 + 8. -28k*2 Collect the terms in -30n*3 + 0n + 18n - 18n. -30n3 Collect the terms in 97h*2 + 83h*2 - 179h2. h2 Collect the terms in 46x + 113x + 152x - 26x. 285x Collect the terms in 77r*2 + 262r*2 + 27r*2 + 292r*2. 658r*2 Collect the terms in -2t - 1 - 10t - 3t. -15t - 1 Collect the terms in a - 8a*2 + 6a*2 - 10a*2. -12a*2 + a Collect the terms in 38 - 2a*3 + 14 - 52. -2a*3 Collect the terms in 6v - 2v + 2v - 5v. v Collect the terms in 2y + 131 - 67 - 62. 2y + 2 Collect the terms in -74 - 14d*2 + 11d*2 + 36 + 38. -3d*2 Collect the terms in 14n + 21n2 - 41n*2 + 22n*2. 2n*2 + 14n Collect the terms in -5t2 + 30t*2 + 21t*2. 46t*2 Collect the terms in 3u*2 - 12u*2 + 7u*2. -2u*2 Collect the terms in -10 - 18j + 10. -18j Collect the terms in -16j*3 + 34j*3 - 19j3. -j3 Collect the terms in -20v3 + 6v*3 + 3v*3 + 2v*3 + 6v*3. -3v*3 Collect the terms in 16 - 5l + 4l - 35 + 19. -l Collect the terms in 45w*2 - 23w*2 + 175w*3 - 22w*2. 175w*3 Collect the terms in -179b*3 + 365b*3 - 188b*3. -2b*3 Collect the terms in 61m*2 + 2m + 55m2 - 23m*2 + 0m. 93m2 + 2m Collect the terms in -f - f + 0f + 3f + 89. f + 89 Collect the terms in 6 - 3u + 2 - 8. -3u Collect the terms in -14d2 - 83d*2 - 131d*2. -228d*2 Collect the terms in -4y*2 + 212y - 212y. -4y*2 Collect the terms in 2 - 1 - 1 + 2o. 2o Collect the terms in -107o*3 + 3o + 506o3 - 3o. 399o3 Collect the terms in 2 - 2326y*2 - 2 + 2348y*2. 22y*2 Collect the terms in 2580 + 3l - 2580. 3l Collect the terms in -17k*2 - 5k*3 + 16k2 + k2. -5k3 Collect the terms in -19 + 13 + 6 - f + 0. -f Collect the terms in 0m + 2m + 9m*3 - 33m*3. -24m*3 + 2m Collect the terms in -78l - 123l + 209l. 8l Collect the terms in -1624 + 1624 - 42z. -42z Collect the terms in 18l - 40l + 25l. 3l Collect the terms in -a*2 + 3a*2 + 0a*2 - 3a*2 + 49a*3. 49a3 - a2 Collect the terms in 4y - 3y - 2y + 3y - 3y. -y Collect the terms in -11q + 11q - 2 - q + 2. -q Collect the terms in 5877g - 5877g + 12g*3. 12g*3 Collect the terms in 233j*2 - 1015 + 1015 - 235j*2. -2j*2 Collect the terms in 5m*2 + 8m*3 + 3m*3 - 5m*2. 11m*3 Collect the terms in -9 + 7 + 2 - 21t. -21t Collect the terms in -48y - 51y + 146y - 46y. y Collect the terms in 0j - 3j - 7j + 0j. -10j Collect the terms in -5r3 - 140r*3 - 134r*3. -279r*3 Collect the terms in 0s - 16s - 4s. -20s Collect the terms in 72 - 146 - 2u*3 + 74. -2u*3 Collect the terms in -30j + 18j + 19j. 7j Collect the terms in -3870n*2 + 4n*3 + 3870n*2 - 5n3. -n3 Collect the terms in -281w + 669w - 390w. -2w Collect the terms in -62m2 - 85m*2 + 145m*2. -2m*2 Collect the terms in -18z*2 + 53z*2 - 17z*2 - 13z*2 - 7z*2. -2z*2 Collect the terms in w + w - 3w - 202 - w. -2w - 202 Collect the terms in -14 + 4l*3 + 14. 4l*3 Collect the terms in -38y*3 + 23y*3 + 0y*2 + 0y*2. -15y*3 Collect the terms in 3k + 4k - 3k - 124 - 2k. 2k - 124 Collect the terms in -111q3 - 64q*3 - 1 + 1. -175q*3 Collect the terms in 63g*3 + 36g*3 + 1 - 1. 99g*3 Collect the terms in -6 + 35 - 16 - 13 + 4i. 4i Collect the terms in -4 - q2 - 7 + 20q*2. 19q*2 - 11 Collect the terms in -35g + 4g + 24g + 27g. 20g Collect the terms in -47b2 + 13b*2 + 35b*2 + 29b*2. 30b*2 Collect the terms in -4a + 6 - 13 - 4 + 11. -4a Collect the terms in 4f*2 + 2f*2 + 2f*2 - 3f*2. 5f**2 Collect the	{ "pile_set_name": "DM Mathematics" }
7? -17 Let i = 1.103 - 0.103. Which is smaller: i or -4? -4 Let d = -2.1 - -2. Let i = -6 + 12. Let c be 4/8 - 7/i. Is c at least as big as d? False Let o be 2 - 3 - 1 - 2. Let w = 4 - 2. Suppose wu + 9 = -u. Which is smaller: u or o? o Suppose -6i + 3i = -3. Let f be (0 - 0) + i/2. Suppose -a = -2n + 1, -9 = 2n - 4a - 1. Are f and n unequal? True Let z(j) = -j*3 + 2j*2 - 476. Let m be z(0). Let a be ((-2)/(-7))/(m/(-49)). Does a = -1? False Let s = -7 + 9. Let z = -35 + 107/3. Is z greater than or equal to s? False Let s = -3 - -2. Are s and -1 nonequal? False Let k be -464/(-12). Let t be -4(2/k - 1). Suppose -4z - tj = 10 + 10, 2z + 10 = 2j. Is -1 at most as big as z? False Suppose 3v = -v - 4. Let u = -29 - -259/9. Which is smaller: u or v? v Let d = 10 - 5. Suppose -18 = -dz - p, -2z - 2z + 6 = -2p. Suppose 3r - 2w + 3 = zw, -w = 0. Is -2/9 less than r? False Let o(a) = a*2 - 7a - 5. Let m be o(4). Is -18 less than m? True Let x = -34 - -236/7. Suppose -5 = 2t + 3t. Is x > t? True Let n = 36 - 49. Which is smaller: n or 1/2? n Suppose 3r + 0r - 2k - 7 = 0, r - 7 = 3k. Let u = 231/1976 + 2/247. Which is greater: r or u? r Let k(s) = -s*2 - 4s - 13. Let x be k(-4). Is x equal to -14? False Let q = 0.9 - 0.8. Is q <= -1? False Let d be (-9)/(-3) - (1 - -8). Which is bigger: 1 or d? 1 Let d(h) = 3h + 63. Let k be d(-25). Which is smaller: -10 or k? k Let j = 885/2 - 404. Which is bigger: 40 or j? 40 Let x(j) = j2 + j - 3. Let a = -6 - -3. Let p be x(a). Suppose q = -pm + 27, q = 2q - 3. Is m at least 8? True Let l = -18 + 7. Let z be (-53271)/(-231) + 2/l. Let d = z + -231. Which is smaller: -2 or d? -2 Let c be (9/36)/((-10)/48). Let i = 2 + -3. Which is smaller: i or c? c Let p be 2 - (-1)/(-1)-1. Suppose -4y + 300 = -0f - 4f, 0 = -2y + pf + 151. Let d be 3/5 + y/(-90). Which is greater: d or 0? 0 Let c = 349 + -14311/41. Let n be 145/(-80) - (-1)/(-8). Which is greater: c or n? c Let q = -97/8 - -61/8. Which is smaller: -6 or q? -6 Let m = 3 - -1. Suppose mz = -2 - 34. Let b be 1/3 - (-3)/z. Which is smaller: b or 1/4? b Let s = 2.52 - 0.22. Let h = s - 2. Which is bigger: h or -0.3? h Let a = -7/6 + 2/3. Which is bigger: a or 3/4? 3/4 Let d = -13.15 + 0.15. Let a = -13 - d. Are a and -0.3 nonequal? True Let q be (4 - 8)1/5. Let r(o) = o - 10. Suppose 26 = 5w - 19. Let d be r(w). Is q <= d? False Suppose -2 = -0u + u - s, -u = 2s - 4. Let q be u - (3 - 2)/(-4). Is 1/2 less than q? False Let z(r) = 4r - 6r2 + 5 + r2 + 4r*2. Let v be z(5). Is 8/9 less than v? False Let m be 3/(-6) - (-9)/2. Suppose 0 = i - mw - 5, i + 3 = 3i - w. Suppose -i = 2g - 3g. Is 1 less than g? False Suppose -j - j - 2 = -d, -4d - 5j + 21 = 0. Suppose dq - 67 + 170 = -5o, -2o - 116 = 5q. Let l be (q/20 + 1)6. Is 0 bigger than l? True Suppose 0d + 4d = 4. Let q = 15 - 14. Is d at least q? True Let b be (12/(-126))/(12/2). Are -1 and b nonequal? True Suppose 0w = w. Suppose wu + 2u - 8 = 0. Let m(j) = -j2 + 7j + 3. Let v be m(7). Is v at least u? False Let g(k) = 2k2 - k. Let f be g(-1). Suppose -6t - 15 = -ft. Let o be (1/1)/(t - -4). Which is greater: -2 or o? o Let y = -2.32 + -0.71. Let a = 2 + -1.97. Let o = y + a. Is o equal to 0.1? False Suppose 5g + 13 = 2i, -2g + 3i - 8 = -6g. Let z be (-4)/510/(-34). Which is smaller: g or z? g Let d = -5 + 7. Suppose -6 = -dj - 4. Which is smaller: j or -2/25? -2/25 Let c(b) = b*3 - 14b*2 + 12b + 12. Let t be c(13). Is t <= 3/8? True Let z be -111/4. Let y = -0.9 - -0.1. Let s = -0.5 - y. Is z greater than s? False Let o = -24.9 + 25. Let b = -3 - -3.3. Let l = b - o. Which is smaller: -1 or l? -1 Let p be 1/(-2) - (-33)/(-6). Is -7 at least as big as p? False Let v be (114/209)/(1/(-5)). Which is bigger: v or -4? v Let g = -28 - -19. Let j(x) = x + 0x - 3 - 2x. Let h be j(g). Which is bigger: h or 5? h Let d be (-2 + -6)/((-2)/3). Let l be (8/6)/((-14)/d). Are l and -1 non-equal? True Let w = 54 + -29. Which is smaller: 27 or w? w Suppose 3q + 18 = 5m - 2m, -2q - 6 = m. Suppose mv + 2v - 8 = 0. Let u = 75/4 - 18. Are v and u equal? False Let m = 11 + -18. Let f(y) = y - 7. Let g be f(2). Which is greater: m or g? g Let x = 0 + 1. Let h = 43 - 38. Is x not equal to h? True Let f = 1/46 + -59/598. Suppose -4 = 2r - 4x, -2 = 5r - r - 2x. Are r and f equal? False Suppose 0b + 28 = 4b. Which is smaller: 5 or b? 5 Let y = -17 - -15. Which is bigger: y or -7? y Let o be (-1 + 0)/((-17)/(-2)). Is o at most as big as 1? True Let u = 1018835989/735 + -1386172. Let k = 2/147 - u. Which is bigger: k or -1/3? k Suppose 3j - 1 = -5u + 29, 4u - 12 = 0. Suppose -j = 3o + 1. Is 0 greater than o? True Let u = -121.5 - -121. Is u <= 1/4? True Let w = -70009/209 + 335. Let z = w + 3314/1045. Let j = 58/15 - z. Is 1/5 greater than or equal to j? False Let l be (-8 + 3)/(-1 + 0). Let c = -1 + l. Suppose -cq = -15 - 1. Do 4 and q have the same value? True Let l be 6((-2)/3)/(-1). Let m = -3 - -3. Suppose 0 = ld - md. Which is bigger: d or -0.4? d Suppose 2j + 89013 = -2t - 119455, 4j - 5t + 416954 = 0. Let q = 730819/7 + j. Let p = -167 + q. Is p not equal to 0? True Suppose 0z = z - 4. Let b(i) = i - 4. Let d be b(z). Suppose dg - 2q = -4g - 12, -4g - 5q + 16 = 0. Is -1 equal to g? True Let n be (0 + 2)2/4. Let l(x) = x2 - 7x + 1. Let z be l(8). Let j be (3/(-10))/(z/4). Is j at least n? False Let h be (-4)/6 + -1 - -1. Suppose 0k + 2k = -8. Let g be (k - -4) + (0 - 1). Is h < g? False Let k = -9 - -15. Let r be 0 + (2/(-1) - 1). Let g = k + r. Is -2/3 greater than g? False Let h be (32/(-3))/(-1). Let s = 3 + -2.9. Which is greater: h or s? h Let p be (2 + -6 - -5)/13. Which is greater: 1 or p? 1 Let f(b) = b2 + 13b + 25. Let s be f(-11). Is s < 2? False Let m be (-36)/(-12)(-32)/6. Which is smaller: -14 or m? m Let x = 13 + -7. Let s = x + -5. Let d = 559/3014 - 1/274. Is s smaller than d? False Let m = 19 + -21. Is -1/5 < m? False Let v be 12 + -9 + 0 + 4. Which is bigger: v or 8? 8 Let d be (-58)/(-2)(-5 - -6). Suppose -5u - d = -79. Let t = u + -15. Is -4 at least as big as t? True Let d(s) = -s2 - 14s - 21. Let c be d(-14). Is -19 greater than c? True Let i be 4 - (10/5 + 2). Let r = -0.2 + 0.3. Is r < i? False Suppose -5y - 17 = -2a, -4a - 3y - 7 = -2. Let f be a + -3 - (-4 - -1). Is f at most 1? True Let x = -0.33 - -14.33. Is x not equal to -0.1? True Suppose -2n = -5d - 32, -n + 3d = 2n - 30. Let t = n + -4. Which is smaller: 3 or t? t Let w be (((-2)/13)/(-2))/(0 + 1). Which is bigger: w or 1? 1 Let o = 26.9 + -29.9. Suppose 5l = 2m - 24, -m + 3l = 3m - 20. Let t be (1/(-1m))/2. Is t < o? False Let w be ((-116)/(-77))/(0 + -2). Let x = 4/7 + w. Which is greater: 5 or x? 5 Let n = -63 + 65. Are 0.3 and n equal? False Let t = -4 - -4.4. Let m = t + 2.6. Let j = -4 + m. Is j less than or equal to -0.2? True Let g(f) = -f3 - 4f*2 - 4f - 2. Suppose -4x = -3x - 5m - 17, 10 = -2x - m. Let c be g(x). Is c < 3/7? False Let s be 36/122/6. Which is greater: 5 or s? 5 Let x = 110719/297621 + -46/4077. Let u = 2/73 - x. Is u bigger than -2? True Let u = 150 + -603/4. Let f(g) = -g + 3. Let s be f(3). Do u and s have the same value? False Let z = -9/89 - 7/1691. Suppose -2m + 5b - 21 + 50 = 0, -3m = -2b - 16. Let a = m + -1. Is z smaller than a? True Let k = 0.04 + -5.04. Let x = 5.1 + k. Which is smaller: -6 or x? -6 Let x be (3 + -461)(-2)/(-12). Let q = 50 + -127. Let n = q - x. Which is bigger: n or 0.3? 0.3 Let g = 0.14 - 0.24. Let f = g + -0.9. Is 0.1 smaller than f? False Let k = 7.2 + -6. Let r = k + -0.2. Suppose -h = -4 + 1. Is r != h? True Let f = -255 - -141. Which is greater: -1/2 or f? -1/2 Suppose b + 3b = -3i - 12, 0 = 2i + 8. Do -0.04 and b have the same value? False Let n = 290 - 3186/11. Which is smaller: n or 0? 0 Let r be 0/(3/1) + 2. Suppose -3d = -3y + 12, 3y - rd = -y + 18. Which is smaller: y or 6? y Let n = -4 + 2. Are 1/2 and n nonequal? True Suppose w + 49 = -0w. Do -49 and w have the same value? True Suppose -a + 3 = -s + 1, -2s - 19 = -5a. Let p(j) = 2*j - 4. Let v be p(s). Which is smaller: 4/3 or v? 4/3 Let h be 0 + 5 + -4 + 0. Is 24	{ "pile_set_name": "DM Mathematics" }
5 for p. -4 Let s = -28 - -29. Let p = -6 - -12. Let f = p - s. Solve 0t = 5t - f, w = -5t for w. -5 Let z(q) = q2 - 1. Let a be z(0). Let w(o) = -2o*3 - o. Let m be w(a). Solve 2j - mj + 5 = -3c, c = -j - 7 for j. -4 Suppose 4s = -s + 5. Suppose 0 = -2f + s + 7. Suppose 5a - 7 = 13. Solve 5y = an + f, 4y = 2y - 5n - 5 for y. 0 Suppose 4h + q = 134, 2q = 2h - 3q - 56. Let o = h - 17. Suppose -3f - 5 = 2a - 21, 4a + 2f = o. Solve s + 3v + 10 = 0, -3v - 8 = -2s - av for s. 2 Suppose -7c = -2c. Suppose -5m + 120 = -5j, 0 = -cj - 5j - 4m - 84. Let i = j - -28. Solve y - 13 = 3v - iv, 12 = 3v + 2y for v. 2 Let d(q) = -q - 2. Let k be d(-5). Suppose -5h + 6 = -4, 5h + 5 = c. Solve -kf + c = -3l, -f + 2f - 5 = -3l for l. 0 Let s(c) = -c3 - 9c*2 + 9c - 10. Let l be s(-10). Suppose 0n - 32 = -4i - 2n, -4i - n + 32 = l. Solve -2p + 5w = 14, -p - i = -5w + 9 for p. 3 Let u = 107 + -89. Solve 2v - j - 4j = u, 4j = -16 for v. -1 Suppose 0 = 4f - i - 8, -i + 2 = f - 0i. Suppose 0 = -3o + 3k + 9, -2o - k = fk - 6. Solve h + 3 = 5s + 29, 2 = -s - oh for s. -5 Let p(q) = q*2 - 8q + 1. Let a be p(8). Solve -d = -4c + 3, 2c + d - a = 2 for c. 1 Suppose 0 = -2z + 7z - 630. Let b be z/10 - 4/(-10). Solve 4 = -2v - 3s, -4s + 2 = -3v + b for v. 1 Let x be (0 + -6)(-8)/24. Solve -4z - x = 5p, -3z = -z + 2p for z. 2 Let p = 11 - 6. Suppose pu = u - 60. Let y = -10 - u. Solve -10 = -yw - 5x, -2x - 2 = -3x for w. 0 Suppose 0 = 4i - 0v + 2v - 18, -4i + 3v = -43. Suppose 4s - 9 = i. Suppose -13h = -3 - 62. Solve -sq = -hk - 10, -2k = k - q + 6 for k. -2 Let u(h) = -h*2 + 6h - 5. Let n be u(4). Solve 0 = -no - 2o - 5q - 20, -q = -4o - 11 for o. -3 Let h(b) = b*3 - 3b*2 + 4b - 3. Let a be h(2). Let n = 4 - a. Solve -j = -5q - 2, nq + 2j - 6j - 9 = 0 for q. -1 Suppose 0 = -3b - 5u + 3u - 4, 5b - u - 15 = 0. Let i be -3 - (-4 - b - 0). Solve -2 = l + f, 4f + 8 = -il + l for l. 0 Suppose 17 + 3 = 5o. Solve 0 = -oy - 20, 7 = a + 4y + 25 for a. 2 Suppose -4l = l. Let m be -3 + 2 + l + 5. Solve 5t - 7 = 5n + 3, 3n + 8 = mt for n. 0 Let h be ((-8)/12)/(1/(-6)). Solve 5n - ht + 10 = 2, 0 = -5n - t + 2 for n. 0 Let a be (5 - 11)/(9/(-6)). Solve 3r - 4n - 4 = -0n, -16 = -2r - an for r. 4 Suppose 4d = -d - 25. Let j be (-84)/(-20) - (-1)/d. Suppose 0 = -jx - 3u + 13, 0x - 6 = -x + 2u. Solve q = 4p - 16, -p = xq + p + 10 for q. -4 Let d = 1 - -1. Let r = d - -4. Solve 4y + 6 = -5u - r, 5u = 5y - 30 for y. 2 Let w be (90/25)/((-2)/(-5)). Let m = -5 + w. Solve 5g - 7x + 26 = -3x, -8 = -4g - mx for g. -2 Suppose 4h - 116 = -0h. Suppose -b + 46 = -h. Suppose -2l - 4d = -d - 32, b = 5l + 5d. Solve 4u = 8, -3v + 4u = 3u - l for v. 5 Let q = 18 - 14. Suppose -m = -2o + qm + 27, 4m + 36 = 4o. Solve -o = -3g, 4g - 15 = 2n - 5 for n. -1 Suppose 0 = -4q + g + 21, -2g + 3g = -5. Let t = 9 - -5. Solve c - 3c = -8, 2r - qc + t = 0 for r. 1 Let f = -8 + 13. Suppose d - 12 = -0d. Suppose d + 18 = fr. Solve 4x + 12 = -5a, -2x + 4x = -a - r for a. 0 Let p(c) = c3 - 3c*2 + 5c - 2. Let n be p(2). Solve -5r + na + 15 = 0, 0r + 3a + 17 = -2r for r. -1 Let o(n) be the first derivative of n3/3 + 5n*2/2 + 2n + 5. Let d be o(-5). Solve -13 = 5a - dr + 3, -3r = 6 for a. -4 Suppose -2v + 3v = 19. Let t = v - 14. Solve tr + 3 = 2r, -h + 5r = -3 for h. -2 Let l(w) = w*3 - 7w*2 + 6w - 8. Let z be l(6). Let x be ((-36)/21)/(1/(-7)). Let y = z + x. Solve -3k - 9 = -2t - yk, -3k = 2t - 7 for t. 5 Let j(o) = 2o*2 - o + 4. Let w be j(0). Solve 24 = -4b + wh, b - 4h + 14 = -b for b. -5 Let g be -5((-1)/5 + -1). Suppose 4l - gl = -10. Let p(m) = 2m*3 + 11m*2 + 11m + 6. Let b be p(-4). Solve 0 = 4n + lf - 26, 7n - f = 4n + b for n. 4 Let t(p) = -6p3 + p2 - 1. Let g be t(-1). Let z = -1 + g. Suppose 11 = 6d - 1. Solve -4l = 5q - z, -l - dq = -0 - 2 for l. 0 Let c be (-6)/27 + 272/9. Suppose -6l = -0l - c. Solve -2z + 2 = -5j, -j - lz = -3j + 16 for j. -2 Let c = 4 - 4. Suppose -o + 5o - 8 = c. Solve -5w - 11 - 4 = i, -2i = -ow + 6 for w. -2 Let y(v) = v2 - 2v + 1. Let d be y(-3). Solve 0 = -2j - 0k - 5k + 11, -4j - 4k + d = 0 for j. 3 Let k = -7 + 15. Let q = 11 - k. Solve -3y = ql - 27, -l - 21 = -3y - 2y for y. 5 Let b = -19 + 24. Suppose 2n + 3q - 19 = 0, -4n - 4q + 28 = -0q. Solve n = 5d + 3w - b, 0 = -5w + 20 for d. -1 Suppose -5 + 65 = -3p. Let r = p + 22. Solve 0 = 3y + 9, 3j = 4j + ry + 1 for j. 5 Let i = 3 - 1. Suppose -40 = -4h - 5a, ia + 0a + 12 = 4h. Solve -f - hm + 1 = 0, 4f + 2m - 4 = -0m for f. 1 Suppose 0 = h + 2 + 1. Let x be 3 + (4-9)/h. Solve 0 = -5a + 4p + p - 30, 3p = x for a. -1 Suppose 3c - 3 + 9 = 0. Let t(l) = -2l2 + 3l. Let f be t(2). Let h = c - f. Solve -5r + 15 = -hi - 5i, 5i + 7 = r for i. -1 Suppose -5z + 13 - 48 = -4a, -a + 2z = -11. Solve -3h - d + 3d = a, 0 = h + 4d + 11 for h. -3 Let l = 10 + -4. Let m(f) = -f - 3. Let o be m(-9). Solve h - 4x + 8 = 0, -oh + 4h = 3x - l for h. 0 Let r(m) = m*3 + 5m*2 - 6m + 4. Let w be r(-6). Solve 0 = -3z + 2n - 1, n - w + 0 = 5z for z. -1 Suppose 0 = -15u + 17u - 4. Suppose -4n - u + 10 = 0. Let f(y) = 2y - 5. Let r be f(4). Solve -z = 5o - 8, nz + ro - 11 = -2o for z. 3 Let q be (-1 + 1)/(1 + 0). Let v be (q + -3)/((-6)/10). Solve -17 = 4a + 3d, 3a - vd + 15 = a for a. -5 Suppose 5s = 3a - 22, -2a = 4s - s - 2. Suppose -6 = -ah + 18. Suppose -h = -5g + 9. Solve -j = -4y + 20, y + 2y - 24 = gj for y. 4 Let f(i) = -i*3 - 28i*2 - 25i + 57. Let h be f(-27). Solve -2x + 5 = -hz, -x + 7 = z + 2 for x. 4 Let u = 6 + -3. Suppose uh = -2h + 150. Solve -h = -5y - 2a, -5y + 10 = a - 3a for y. 4 Let l(r) = -r*3 - 9r*2 + 10r + 2. Let i be l(-10). Suppose -i - 23 = -5y. Suppose 2 = yb - 3. Solve 5g + t = 17, 4t = -2g + 5g - b for g. 3 Suppose 3d = -2t + 7, 2d - d - 1 = 0. Suppose ti = -i + 6. Solve 3j = -15, 2o + ij = -3j - 15 for o. 5 Suppose 0 = n + 2y - 10 - 3, -n + 2y - 7 = 0. Suppose n = q + 1. Solve qf + 14 = 4x, 6x - 11 = 5f + 2x for f. 1 Let w = -72 - -77. Solve 4s + 24 = -wr, 0 = -3s - 2s - 5 for r. -4 Let l be 28/(-49) - 214/(-7). Solve -4t + 4b = -b + l, -5t - 4b - 17 = 0 for t. -5 Suppose -5n = -3n. Solve 5i - i = t + 3, n = t + 3i - 4 for t. 1 Let a = -4 - -9. Solve ah - 1 = -y - 4, -5h - 15 = -5y for y. 2 Let s(q) be the first derivative of -9/2q2 + 0q + 3. Let v be s(-2). Solve 4z - 3b = 2z + 2, -3z + v = 3b for z. 4 Let j be -2 - (-18 - -2 - -2). Solve -2x + 3k = -4, -3x + k - j = x for x. -4 Suppose -u = 4o + 4, -4u + o = 3 - 4. Suppose -r - 3r = d - 1, -5r - d + 1 = u. Solve -3n + rp + p + 3 = 0, -5p - 15 = 4n for n. 0 Let i(g) = -g - 1. Let p be i(-7). Suppose 0 = -k + p - 1. Solve -f + 15 = -5f + ka, 0 = -f - a - 6 for f. -5 Let j(h) = h*2 + 2h - 5. Let a be j(-4). Let r be -2((-20)/8 - a). Solve 6 = -4t - 5k, -3t - r = -3k + 7 for t. -4 Let z(v) = -v2 + 20v + 10. Let l be z(19). Solve 3u - 17 = -2p, 5p + 0p - l = -3u for p. 4 Let i be 10/55 + 106/22. Let z be (0 - 0) + 8 - 2. Solve 0 = 5y - ic + 25, -2c = 2y - 16 + z for y. 0 Suppose 0 = 2u + 10, n - 3u = 2u + 28. Solve -2c - 2i - 10 = -nc, 4 = -2c - 2i for c. 2 Let h = 79 + -74. Solve 3t = -4l - 16, 0 = -3t + 5t - hl - 20 for t. 0 Let t = -44 - -47. Solve 4h = 2j + 14, -tj = -3h + h + 5 for j. 1 Let h = 19 - 13. Suppose -hd - m = -d - 1, 2d - 2m = -2. Suppose d = -0l + 4l - 28. Solve -2g + 3a = -lg + 32, -g + 2a - 4 = 0 for g. 4 Let u(k) = 4k*2 - 6k - 3. Let i be u(-2). Solve -3m = -j - 5, 2m - 5j = -0j + i for m. 0 Let d be (-2 + -4 + 6)/2. Let i(p) = p - 8. Let y(n) = -2n + 4. Let q be y(-3). Let u be i(q). Solve -ux + 10 = -0x, d = -2a - 4x + 16 for a. -2 Let l(c) = c3 - 3c*2 - 2c - 2. Let q be l(4). Suppose 3t + 15 = qt. Solve -g + tr = 2 - 26, 0 = 5g - 2r - 28 for g. 4 Let p be 33/18-2-3. Solve j - 4h = -15, -4j - 2h + p = -j for j. 1 Let r(q) = -q*3 + 5q*2 + q. Let n be r(5). Let x(f) = 3f - 10. Let t be x(n).	{ "pile_set_name": "DM Mathematics" }
k*4 Let l(t) = 1440t + 2. Let g(j) = 2j + 0j - 378041 + 378041. Calculate g(l(w)). 2880w + 4 Let q(c) = 40c - 299c2 - 299c*2 + 601c*2 - 40c. Let l(k) = -k*2 - 60k. Give q(l(o)). 3o4 + 360o*3 + 10800o*2 Let g(f) = 13f. Let d(q) be the third derivative of -q7/630 + q5/20 + 13q3/2 - 86q*2. Let l(h) be the third derivative of d(h). Calculate l(g(s)). -104s Let z(a) = 6a - 296. Let b(d) = 233d - 3. Calculate b(z(f)). 1398f - 68971 Let m(k) be the first derivative of -4k*3/3 - 918. Let u(t) = -2t - 8. Determine m(u(p)). -16p2 - 128p - 256 Let h(s) = -6s2 + 5. Let t(p) = -322118p*2. Calculate h(t(j)). -622560035544j*4 + 5 Let w(k) = 8k + 32. Let z(n) be the first derivative of n*3/3 + 502. Determine z(w(t)). 64t*2 + 512t + 1024 Let k(q) = -21q2. Let m(s) = 62096s*2. Give k(m(b)). -80974177536b*4 Let u(i) = 2i*2. Let c(v) be the first derivative of -809v*2/2 + 1270. Calculate u(c(q)). 1308962q*2 Suppose -173 = -10n + 177. Let d(w) = 36w2 - nw*2 - 32w*2. Let u(t) = -2t*2. Calculate d(u(p)). -124p*4 Let v(l) = -939320l. Let p(c) = -2c. Calculate v(p(j)). 1878640j Let p(y) be the third derivative of -y*5/15 + 160y*2 - 2y. Let o(a) = -15a2 + 358a - 358a. What is o(p(j))? -240j*4 Let i(g) = 6794g. Let f(l) = -222l2. Calculate f(i(n)). -10247172792n*2 Let j(w) be the first derivative of 0w + 5/3w3 - 19 + 0w*2. Let t(g) = 19g. Determine j(t(h)). 1805h2 Let i(b) = -3b2 + 138 - 138. Let d be (-96)/(-42) + 4/(-14). Let v(r) = 3658 - rd - 3658. Determine i(v(w)). -3w4 Let s(j) = 9j*2 + 10j - 185. Let a(i) = -i + 18. Let y(d) = 10a(d) + s(d). Let n(p) = -21p. Calculate n(y(b)). -189b2 + 105 Let a(q) = 3q*2. Let m(d) = -5d + 2. Suppose -6c + 35 + 7 = 0. Suppose -18 + 4 = cr. Let z(t) = -26t + 11. Let y(b) = rz(b) + 11m(b). Determine a(y(j)). 27j*2 Let b(s) = 3426s. Let g(n) = 2n + 3. Let q(k) = 3k + 3. Let l(t) = g(t) - q(t). What is l(b(u))? -3426u Suppose 5a - 18 = -2w, 4w + 6 = 3w + 5a. Let t(x) = 6 - 8 - wx2 + 2. Let j(m) = -8m + 9m + 3m. Calculate t(j(h)). -64h2 Let z(u) = -154u + 35. Let k(x) = -9x + 2. Let a(w) = -35k(w) + 2z(w). Let h(c) be the third derivative of c5/3 - 1335c*2 + 2c. Give a(h(b)). 140b2 Let w(m) = -60222m*2 + 30455m*2 + 30398m*2. Let s(f) = 3f. Give s(w(v)). 1893v2 Let v(x) = -2x - 795. Let l(j) = 14j2 - 58324 + 58324 - 6j*2. Calculate l(v(b)). 32b*2 + 25440b + 5056200 Let q(u) = u*2. Let a(n) = -2429n + 20. Let r(v) = 784568v - 6464. Let g(h) = 1616a(h) + 5r(h). Give q(g(d)). 5875776d*2 Let i(r) = -16r*2. Let h = 765 + -721. Let l(w) = 109w - hw - 38w - 40w. Determine l(i(y)). 208y*2 Let z(f) = 23f. Let w(t) = -887t2 - 885t*2 + 3564t*2 - 893t*2 - 892t*2. Calculate w(z(p)). 3703p*2 Let s(m) = 83528m*2. Let r(w) = -124w*2. Determine r(s(b)). -865138921216b4 Let d(n) be the second derivative of n4/12 + 5334n + 2. Let t(c) be the first derivative of 409c*2/2 - 8. What is d(t(y))? 167281y*2 Let h(u) = 393u. Let g(j) = 20533j2. What is h(g(l))? 8069469l*2 Let r(s) = 654790109s. Let c(q) = 2q. What is c(r(k))? 1309580218k Let z(x) be the first derivative of -19x2/2 + 4. Let m(y) = 19y - 11y - 5 - 10y. Let i(a) = -2a - 4. Let u(w) = -5i(w) + 4m(w). Calculate u(z(d)). -38d Let u(w) = -w*2. Let p(c) = 4c + 4. Let t(f) = -11f - 5. Let a(r) = 130r + 60. Let s(k) = -3a(k) - 35t(k). Let m(d) = -6p(d) - 5s(d). What is u(m(g))? -g*2 - 2g - 1 Let l(m) = -m + 1. Let o(p) = 2p - 4. Let j(a) = -4l(a) - o(a). Let c(v) = -3250v + 9733v + 68v2 - 3244v - 3 - 3239v. Calculate j(c(r)). 136r*2 - 6 Let n(d) = -d - 2. Let f(l) be the second derivative of 2l*3/3 + 5l*2 - l + 11. Let p(v) = 2f(v) + 10n(v). Let y(b) = 19b*2. Calculate y(p(h)). 76h*2 Let r(f) be the third derivative of 4f*5/15 - 90f2 + 5. Let m(h) be the second derivative of -h3/3 + 18h. Determine r(m(k)). 64k*2 Let u(f) be the second derivative of 9f*3 - 34f. Let n(b) be the second derivative of -b*3/6 + 32b. Give n(u(s)). -54s Let b(n) = -13n. Suppose -448 = 4w - 876. Let s(m) = 127m + wm - 220m. Give s(b(a)). -182a Suppose -15b + 2b = -26. Let r(j) = 4j*2 - 4j*2 + 6j*b - 4j*2. Let p(m) = -12m - 2. Let u(v) = 49v + 9. Let c(a) = -9p(a) - 2u(a). Give r(c(k)). 200k2 Let j(w) be the first derivative of w3/3 - 3217. Let u(z) = -7649z. Calculate j(u(y)). 58507201y*2 Let s(t) = -2t*2. Let z = 196 + -182. Let l(u) = -z - 10 + 6u + 24. What is l(s(i))? -12i2 Suppose 3a - 317 = 268. Let o(l) = -96l + 3l*2 + 38 + al - 99l. Let n(i) = 2i. Give o(n(j)). 12j2 + 38 Let i(f) = -6 + 3f - 6 + 3. Suppose 13z - 44 + 161 = 0. Let o(a) = -a + 5. Let y(x) = zo(x) - 5i(x). Let t(w) = 7w*2. Give t(y(q)). 252q*2 Suppose -5r = -3a + 20, 0 = 4r + 10 + 6. Suppose -2h + 3g + 8 = a, -4h - 2g + 0g = -16. Let t(w) = -6w - hw + 12w. Let x(u) = -17u2. Give t(x(i)). -34i*2 Let d(k) = -8407k. Let y(b) = 12b + 2. Calculate d(y(w)). -100884w - 16814 Let r(c) = -18c2 + 13c + 3. Let p(n) = 36n2 - 22n - 7. Let v(l) = 3p(l) + 7r(l). Let i(q) = 2q2. Give v(i(u)). -72u*4 + 50u*2 Let t(s) = -3s + 95. Let p(q) = 2q - 57. Let x(r) = 5p(r) + 3t(r). Let k(l) = -1398l. Calculate k(x(v)). -1398v Let k(u) be the first derivative of -12u*2 - 4196. Let b(l) = 5l*2 - 26. What is k(b(x))? -120x*2 + 624 Let p(k) = -10k. Suppose 4h = 3u - 1 - 21, 2h + 8 = 0. Suppose -ul - 2l - 7l = 0. Let c(j) = 4j - j - j + lj. Give c(p(t)). -20t Let b(a) = 7763274a. Let h(t) = -2t. What is h(b(l))? -15526548l Let m(i) = -3i. Let q(j) be the third derivative of 0j + 268j2 + 0j*3 + 0 + 0j*4 + 1/12j*5. Calculate m(q(h)). -15h*2 Let c(r) = 2r*2. Let x(q) = -24q*2 + 85q*2 - 40q*2 - 18q*2 + 116. What is c(x(n))? 18n*4 + 1392n*2 + 26912 Let g(p) be the first derivative of 638p*2 + 4p - 4p - 642p*2 + 1. Let t(q) = 3q*2. Give g(t(i)). -24i*2 Let u(t) = 4t + 17t - 3t. Suppose 149 = 9h + 131. Let a(m) = -1134m*h + 1137m*2 - 5 + 5. Give u(a(k)). 54k*2 Let o(h) = 300h2. Let p(n) be the third derivative of n5/120 + 35n3 + 235n*2. Let j(z) be the first derivative of p(z). Calculate o(j(v)). 300v*2 Let j(o) = 11996306o. Let h(v) = -v*2. Calculate h(j(x)). -143911357645636x*2 Let z(c) = 2c*2 - 2c*2 + 2c*2. Let r(j) = 15j*2 + 2. Let l(k) = 27 + 664k*2 + 29 + 87 + 402k*2. Let i(x) = -2l(x) + 143r(x). What is i(z(d))? 52d*4 Let k(a) = -122a. Let f(i) = 1312147i. What is k(f(q))? -160081934q Let u(w) = -7198w. Let g(z) = -4972z*2. Determine u(g(l)). 35788456l*2 Let b(l) = 26l*2. Let u = 575 - 20. Let g(j) = -j + u - 555 - 3j. What is b(g(n))? 416n2 Let a(r) = -9r + 1236985 - 1236985. Let n(g) = 23g2. What is a(n(i))? -207i*2 Let v(w) = -5w*2. Let z = -85 + 91. Let j be (-2 - z/(-4))/(5/(-20)). Let y(d) = -d + 2d + jd + 0d. Calculate y(v(p)). -15p2 Let j(c) = -474c - 7. Let q(f) = -18645f - 275. Let s(k) = 275j(k) - 7q(k). Let l(h) = -8h. What is l(s(z))? -1320z Let d(r) be the first derivative of r3/3 - 3317. Let n(c) = c - 139. Determine d(n(h)). h2 - 278h + 19321 Let c(d) be the third derivative of -d*5/10 + 13d*4/24 + 1283d2. Let l(p) = -p2. Give l(c(m)). -36m4 + 156m*3 - 169m*2 Let v(d) = -2d*2. Suppose -3w + 2n + 9 = -4, -4w = -5n - 15. Suppose -wr - 2r = -63. Let s(h) = -rh*2 + 51 - 51 - 2h*2. Give v(s(p)). -242p*4 Let g(o) = 723841o. Let q(a) = -6a - 4. Determine g(q(m)). -4343046m - 2895364 Let l(s) = 9s2. Let o(m) = -2 - 19m*2 + 14m*2 + 10m*2 - 2m + 2m. Calculate l(o(n)). 225n*4 - 180n*2 + 36 Let p(t) = 128t. Let s(i) be the third derivative of -5i4/24 + 2i*2 - 1788i. Calculate s(p(c)). -640c Let z(b) = 0b - b - b + 0b. Let j(k) = -2k - 4. Let p(x) = -18x + 113. Let r(d) = 8j(d) - p(d). What is z(r(h))? -4h + 290 Suppose -346b + 336b = -2660. Let g(n) = -bn + 2n2 + 266n. Let z(d) = 27d2. What is g(z(r))? 1458r*4 Let p(a) = -3a + 6. Let q(k) be the third derivative of -k*5/30 - 4k**2 - 140.	{ "pile_set_name": "DM Mathematics" }
hundred thousands digit of 235145? 2 What is the ten thousands digit of 4665946? 6 What is the ten thousands digit of 16143? 1 What is the hundred thousands digit of 604078? 6 What is the units digit of 10785180? 0 What is the units digit of 6428063? 3 What is the tens digit of 283194? 9 What is the hundreds digit of 1318539? 5 What is the units digit of 239349? 9 What is the tens digit of 4944378? 7 What is the thousands digit of 745732? 5 What is the ten thousands digit of 203146? 0 What is the tens digit of 1975458? 5 What is the hundreds digit of 1144193? 1 What is the hundreds digit of 433686? 6 What is the tens digit of 2962166? 6 What is the tens digit of 345930? 3 What is the units digit of 7241062? 2 What is the tens digit of 207527? 2 What is the tens digit of 9549? 4 What is the thousands digit of 258125? 8 What is the hundred thousands digit of 2664926? 6 What is the thousands digit of 12719206? 9 What is the hundreds digit of 272947? 9 What is the hundred thousands digit of 505783? 5 What is the hundreds digit of 6444958? 9 What is the units digit of 2443994? 4 What is the thousands digit of 3067201? 7 What is the hundred thousands digit of 248840? 2 What is the units digit of 274059? 9 What is the ten thousands digit of 380787? 8 What is the tens digit of 327890? 9 What is the millions digit of 1518538? 1 What is the ten millions digit of 15762050? 1 What is the hundreds digit of 1805570? 5 What is the ten thousands digit of 9436684? 3 What is the hundreds digit of 964348? 3 What is the thousands digit of 526560? 6 What is the hundreds digit of 327997? 9 What is the hundreds digit of 2372068? 0 What is the tens digit of 566754? 5 What is the ten thousands digit of 526287? 2 What is the tens digit of 514720? 2 What is the tens digit of 128539? 3 What is the hundreds digit of 674009? 0 What is the hundreds digit of 259095? 0 What is the hundred thousands digit of 6981285? 9 What is the ten thousands digit of 108598? 0 What is the thousands digit of 636850? 6 What is the tens digit of 88003? 0 What is the thousands digit of 6442265? 2 What is the thousands digit of 367923? 7 What is the hundred thousands digit of 11455308? 4 What is the hundred thousands digit of 1006781? 0 What is the ten thousands digit of 806678? 0 What is the tens digit of 39876? 7 What is the thousands digit of 76402? 6 What is the millions digit of 10096938? 0 What is the units digit of 500833? 3 What is the units digit of 544628? 8 What is the hundreds digit of 1968540? 5 What is the thousands digit of 540794? 0 What is the thousands digit of 3180933? 0 What is the thousands digit of 1903774? 3 What is the tens digit of 864725? 2 What is the thousands digit of 15695278? 5 What is the hundreds digit of 19998293? 2 What is the units digit of 53389? 9 What is the ten thousands digit of 755571? 5 What is the units digit of 2682172? 2 What is the hundreds digit of 2310575? 5 What is the units digit of 787723? 3 What is the ten thousands digit of 1750129? 5 What is the tens digit of 1297590? 9 What is the hundreds digit of 871993? 9 What is the hundreds digit of 8149642? 6 What is the ten thousands digit of 4884151? 8 What is the tens digit of 980155? 5 What is the tens digit of 15298654? 5 What is the tens digit of 8463? 6 What is the units digit of 9610201? 1 What is the units digit of 3505220? 0 What is the ten thousands digit of 1187805? 8 What is the ten thousands digit of 16992656? 9 What is the units digit of 3755928? 8 What is the hundreds digit of 1524505? 5 What is the thousands digit of 260463? 0 What is the tens digit of 13178328? 2 What is the ten millions digit of 40665164? 4 What is the thousands digit of 479124? 9 What is the ten thousands digit of 464899? 6 What is the ten millions digit of 11809212? 1 What is the ten thousands digit of 731521? 3 What is the millions digit of 5926719? 5 What is the hundreds digit of 9702906? 9 What is the units digit of 175002? 2 What is the ten thousands digit of 41850? 4 What is the hundred thousands digit of 4647461? 6 What is the ten thousands digit of 13598? 1 What is the units digit of 1129963? 3 What is the units digit of 4335121? 1 What is the hundreds digit of 776795? 7 What is the thousands digit of 292634? 2 What is the thousands digit of 238075? 8 What is the tens digit of 21094616? 1 What is the hundreds digit of 29629591? 5 What is the ten thousands digit of 2406352? 0 What is the hundreds digit of 53103? 1 What is the hundreds digit of 30662481? 4 What is the units digit of 13015322? 2 What is the ten thousands digit of 361298? 6 What is the thousands digit of 244529? 4 What is the hundred thousands digit of 617590? 6 What is the hundred thousands digit of 1330440? 3 What is the ten thousands digit of 5118444? 1 What is the hundred thousands digit of 7321493? 3 What is the hundreds digit of 379765? 7 What is the millions digit of 1059529? 1 What is the hundred thousands digit of 861867? 8 What is the units digit of 7624563? 3 What is the millions digit of 1918420? 1 What is the tens digit of 1270851? 5 What is the thousands digit of 26178202? 8 What is the thousands digit of 901146? 1 What is the hundred thousands digit of 1970637? 9 What is the thousands digit of 143382? 3 What is the hundred thousands digit of 547240? 5 What is the units digit of 3029939? 9 What is the ten thousands digit of 776803? 7 What is the tens digit of 8063? 6 What is the thousands digit of 3790024? 0 What is the millions digit of 1734290? 1 What is the units digit of 1156583? 3 What is the hundreds digit of 16859845? 8 What is the units digit of 307239? 9 What is the hundred thousands digit of 575050? 5 What is the thousands digit of 252648? 2 What is the hundred thousands digit of 10471833? 4 What is the units digit of 2608198? 8 What is the hundreds digit of 51383? 3 What is the thousands digit of 110766? 0 What is the ten millions digit of 12066482? 1 What is the thousands digit of 146210? 6 What is the hundred thousands digit of 2178036? 1 What is the units digit of 5398164? 4 What is the tens digit of 156921? 2 What is the hundred thousands digit of 1768438? 7 What is the units digit of 24322539? 9 What is the hundred thousands digit of 975091? 9 What is the thousands digit of 210721? 0 What is the hundreds digit of 2819854? 8 What is the units digit of 567751? 1 What is the hundreds digit of 570959? 9 What is the ten thousands digit of 3704301? 0 What is the ten thousands digit of 392135? 9 What is the hundreds digit of 434665? 6 What is the thousands digit of 218703? 8 What is the hundred thousands digit of 1399397? 3 What is the tens digit of 1984160? 6 What is the millions digit of 5215771? 5 What is the thousands digit of 166665? 6 What is the tens digit of 862534? 3 What is the ten thousands digit of 233426? 3 What is the ten thousands digit of 3365815? 6 What is the tens digit of 4979242? 4 What is the tens digit of 89677? 7 What is the thousands digit of 10005906? 5 What is the ten thousands digit of 1531680? 3 What is the hundred thousands digit of 6759577? 7 What is the tens digit of 423449? 4 What is the units digit of 188806? 6 What is the hundred thousands digit of 6223243? 2 What is the hundreds digit of 770287? 2 What is the tens digit of 584307? 0 What is the hundreds digit of 82789? 7 What is the tens digit of 46722? 2 What is the hundreds digit of 1613146? 1 What is the tens digit of 11321120? 2 What is the hundreds digit of 248137? 1 What is the thousands digit of 19214600? 4 What is the units digit of 238752? 2 What is the units digit of 70176? 6 What is the millions digit of 12316637? 2 What is the ten thousands digit of 1491353? 9 What is the hundreds digit of 350373? 3 What is the hundreds digit of 220947? 9 What is the thousands digit of 7804834? 4 What is the millions digit of 11009834? 1 What is the ten thousands digit of 1044428? 4 What is the units digit of 18357832? 2 What is the hundreds digit of 2683406? 4 What is the thousands digit of 106833? 6 What is the hundred thousands digit of 10956122? 9 What is the hundred thousands digit of 8018735? 0 What is the ten thousands digit of 482791? 8 What is the hundreds digit of 5172438? 4 What is the thousands digit of 2794309? 4 What is th	{ "pile_set_name": "DM Mathematics" }
= 1621t for t. -14 Solve 939t + 5478 - 19821 - 25095 = 0 for t. 42 Solve -33 - 21209 = -312s + 5454 + 8248 for s. 112 Solve -2699 = 6o - 2627 for o. -12 Solve -1062 + 2784 = 628y - 1607 - 3579 for y. 11 Solve -3905x = 1420x + 122475 for x. -23 Solve 2809o = 1414o + 1406o - 506 for o. 46 Solve -11668 - 10316 = 7435v - 107v for v. -3 Solve -872l - 12673 = 10871 for l. -27 Solve -659x - 1403 + 17082 = -12658 for x. 43 Solve 0 = -598o + 290o + 337o - 870 for o. 30 Solve 714976 = 29o + 714947 for o. 1 Solve 915l - 29515 = 36l + 1053 + 14261 for l. 51 Solve 593f - 14687 = -31884 for f. -29 Solve 19276 = 210r + 19906 for r. -3 Solve 27w + 2007w = -344w + 137924 for w. 58 Solve 0 = 689h + 19279 + 8790 - 1887 for h. -38 Solve -596q + 556 + 4526 = -1200q + 681q for q. 66 Solve -181s - 718 = 1635 for s. -13 Solve 11 - 37 = -16b - 7 + 29 for b. 3 Solve 47267a + 55900 = 47826a for a. 100 Solve -2881p - 8013p + 195331 = -1220889 for p. 130 Solve -245s + 35277 - 36257 = 0 for s. -4 Solve -389301 = 2265d - 112971 for d. -122 Solve -344i - 2950 = 13008 + 3994 for i. -58 Solve 2222 + 6184 + 2458 + 2240 = -364m for m. -36 Solve -2240 = -254z + 2840 for z. 20 Solve -1020t + 6690 = -14730 for t. 21 Solve -23685 - 33495 = 3454n + 129336 for n. -54 Solve -1781d = 723d - 20032 for d. 8 Solve 0 = 1947t - 721t + 24520 for t. -20 Solve 793x - 557 - 322 = 707 for x. 2 Solve 411i + 14011 = -196 - 178 for i. -35 Solve 312k = 67k - 921 + 1166 for k. 1 Solve -585j + 330j = 2546j + 238085 for j. -85 Solve -1643u - 5034 - 103404 = 0 for u. -66 Solve -19y + 381y + 8273 - 1513 = -33784 for y. -112 Solve -88n = 39n - 2001 - 793 for n. 22 Solve -65j = 127j + 236j + 16692 for j. -39 Solve 465v - 13376 = -3146 for v. 22 Solve -8066 = -249h + 8068 - 4929 for h. 45 Solve -40858 - 29084 + 1266 = 5723g for g. -12 Solve -19393 - 2051 - 7868 = 829b + 3019 for b. -39 Solve 1667f + 2258f - 90275 = 0 for f. 23 Solve -259y + 136y + 7331 = 192y - 9364 for y. 53 Solve 526k + 1451k = 0 for k. 0 Solve 1424p - 724p - 736 = 723p for p. -32 Solve 49i - 592i - 1072 = -17i + 15234 for i. -31 Solve -1261d = -2499d + 1261d - 713 for d. 31 Solve -80b - 694b - 5456 + 111861 = -6599 for b. 146 Solve 5633p = 1178p - 111375 for p. -25 Solve 302b - 177422 = 6420b for b. -29 Solve 1574n - 28908 = -45246 - 48196 for n. -41 Solve 0 = -9788q + 57042 - 291954 for q. -24 Solve -156q - 32q - 101q + 10404 = 0 for q. 36 Solve 230k + 201k + 22k + 96k + 44469 = 0 for k. -81 Solve 0 = -3053l + 3034l + 1938 for l. 102 Solve 385 = -129n + 2320 for n. 15 Solve 107x - 4199 = -243x + 27x for x. 13 Solve 766701 + 388312 = -17239v for v. -67 Solve 51i + 145i + 15109 = -247i - 78i for i. -29 Solve 4310j - 4480j = -15640 for j. 92 Solve 1096i + 29459 = -285i - 1150i - 54064 for i. -33 Solve -21135l - 23681 - 87036 = -6565l + 20413 for l. -9 Solve -491j = -224j - 19756 - 2138 for j. 82 Solve 996l - 6123 = 936l - 1083 for l. 84 Solve 1171b + 64853 + 16922 - 13153 + 6322 = 0 for b. -64 Solve 419y - 1897 - 9289 - 1024 = 12y for y. 30 Solve -129c + 14c + 2569 = 277c - 25c for c. 7 Solve 4336z + 404217 = 953z - 272270 + 226548 for z. -133 Solve -64o + 415 = -453 + 118 - 146 for o. 14 Solve 7156j = 8099j + 6601 for j. -7 Solve -3882n - 10271 = 195475 for n. -53 Solve 172z - 173z - 16146 = 413z for z. -39 Solve -22253 = 73k - k + 8k + 107k for k. -119 Solve 76o - 6o - 3761 = -821 for o. 42 Solve 581r = -122r + 28823 for r. 41 Solve 8902 - 1318 = 1264l for l. 6 Solve 447c + 169c + 1050c + 1199c = -140385 for c. -49 Solve 3587j + 181j - 15948 = 40909 + 124007 for j. 48 Solve -765s - 11903 = 36292 for s. -63 Solve -49l + 114l - 1776 = 64l + 38l for l. -48 Solve 508223 = 4054j + 2529j - 94409 + 141822 for j. 70 Solve 0 = -71435b + 71608b + 12975 for b. -75 Solve -4673p + 69778 + 85262 + 36036 = 4156 for p. 40 Solve 276 = 152n + 2990 + 1542 for n. -28 Solve -18g + 1105 - 572 = -7g + 1160 for g. -57 Solve 167t - 180t = -381t + 18032 for t. 49 Solve 75627 = -2223p + 392p - 56205 for p. -72 Solve 543 - 4911 = 285q + 6520 + 1082 for q. -42 Solve 5780 = 320s - 43s - 107s for s. 34 Solve -237l - 3818 = 8032 for l. -50 Solve 66103 = 1232d + 11895 for d. 44 Solve 207h = 393h - 205h + 722 for h. 38 Solve -122r - 154r + 480 = -372r for r. -5 Solve 10209537u + 660 = 10209552u for u. 44 Solve -178982 + 67413 = 1829w for w. -61 Solve -30683m + 1166 = -30630m for m. 22 Solve 18480 = 91y + 13y - 440y for y. -55 Solve 43g + 2251 - 243 - 94 = 76g for g. 58 Solve 74066 = 607v + 13973 for v. 99 Solve -1695y + 13270 - 99715 = 0 for y. -51 Solve 187817 - 19301 = 2781r + 2655r for r. 31 Solve 0 = -19i - 50i - 36i + 2625 for i. 25 Solve 194 = -104q - 1158 for q. -13 Solve -42785 - 130818 - 176053 = 6763q + 218436 for q. -84 Solve -30437 = 788w + 1152w - 261w + 30007 for w. -36 Solve 994j - 38976 = -1442j for j. 16 Solve 1327x = -15246 - 936 - 5063 - 9276 for x. -23 Solve -638m + 5040 = 457 - 18385 for m. 36 Solve 650n - 23936 = 414n - 512n for n. 32 Solve -375y + 396y - 134 - 454 = 399 for y. 47 Solve -1253l - 9417l - 432731 - 869009 = 0 for l. -122 Solve -83i - 101i + 18855 + 3536 = -977 for i. 127 Solve -7 - 967 = 79p + 843 for p. -23 Solve 442u + 13269 = 1777 for u. -26 Solve 5936h + 1769h - 88947 = -374572 - 284545 for h. -74 Solve 54337v - 54991v + 33354 = 0 for v. 51 Solve -1250u + 23893 - 24578 = -14543 - 39892 for u. 43 Solve -487r + 1284 - 8213 = 5246 for r. -25 Solve 647a - 6035 - 6997 = 8966 for a. 34 Solve 0 = 47p + 264p + 153p - 10672 for p. 23 Solve -1959r + 13575r = 1045440 for r. 90 Solve 257h = -223h + 1222h - 213h - 38617 for h. 73 Solve -55q = 3097 - 182 for q. -53 Solve 355k = -2487 - 2483 for k. -14 Solve -64421 = 5772u - 393425 for u. 57 Solve -643w - 5040 - 27753 = 0 for w. -51 Solve -277402 = 4013q + 879q - 91679 + 156717 for q. -70 Solve 10x - 66 - 1021 + 17 = 0 for x. 107 Solve -43t = 28 - 1224 - 696 for t. 44 Solve -361n + 756 = -1524 + 396 - 643 for n. 7 Solve 528q + 213q - 41679 = 320q for q. 99 Solve 0 = -822h - 1939 - 43271 for h. -55 Solve -700g + 1815g = -20070 for g. -18 Solve -8913t - 10780 = -9133t for t. 49 Solve -757g = -698g - 3009 for g. 51 Solve 10292 + 1482 = -1780n - 17999 + 4853 for n. -14 Solve -253f + 486 = -526 for f. 4 Solve -69h - 491 - 1416 - 442 = 1584 for h. -57 Solve 4747 = -242h + 1843 for h. -12 Solve 5701 - 13658 = 8045l + 41934 + 6424 for l. -7 Solve 296p = -3527p + 117584 + 16221 for p. 35 Solve 803x - 478x + 156x + 87670 = -1113x for x. -55 Solve -15364f + 15457f + 4540 + 1319 = 0 for f. -63 Solve -263m + 3690 = -3355 + 996 for m. 23 Solve -8v + 570 = -103v for v. -6 Solve -1682172v + 1682091v = 4860 for v. -60 Solve 0 = -1500l - 14242 - 3575 - 37683 for l. -37 Solve -618u - 1869u = 1860u - 9699 - 103323 for u. 26 Solve 4629r + 4617r - 254 - 800 = 9229r for r. 62 Solve 82h - 36470 = -41144 for h. -57 Solve 16159 = -1033c + 521c + 287 for c. -31 Solve 116l - 905l = 20514 for l. -26 Solve -27855352 = -54s - 27853462 for s. 35 Solve -187 = 191s + 152s - 4646 for s. 13 Solve 266m - 767m - 41148 + 132462 = 300m for m. 114 Solve -12z = -561z + 45z - 24696 for z. -49 Solve -1125l + 60132 = -60928 + 40060 for l. 72 Solve -123420 = 7745w + 90341 - 35330 - 8041 for w. -22 Solve -21647 - 336955 + 2892 = -11857i for i. 30 Solve 261r = -11r - 116r + 17848 for r. 46 Solve 131z + 165447 = -560z - 4646z for z. -31 Solve -280z + 15552 + 7491 + 13077 = 0 for z. 129 Solve 8266d - 107048 + 284295 + 269117 = 0 for d. -54 Solve 7202j - 14171j = -7137j + 9912 for j. 59 Solve 410s + 119s - 19955 = -110s + 332s for s. 65 Solve -1037922h = -1037850h - 7632 for h. 106 Solve -586555 - 178222 = 3629a + 4964a for a. -89 Solve -1717 = 405v - 4957 for v. 8 Solve 0 = -3579d + 2938d + 8333 for d. 13 Solve -273y + 16918 = 509y - 211y - 10490 for y. 48 Solve -240i + 86774 + 2812 = 1337i + 82i for i. 54 Solve -8900 = -231w + 13057 - 6018 for w. 69 Solve 63s - 959 - 16 - 3019 = 4700 for s. 138 Solve 0 = -408o + 25o + 2570	{ "pile_set_name": "DM Mathematics" }
Let a = o - -1.232. Let g = a - -2.968. What is the nearest to -0.7 in g, -0.5, 2? -0.5 Suppose -q - x - 1030 + 1040 = 0, 0 = 18q + 5x - 50. Let v = 1.3 - 0.3. What is the closest to q in -4/5, 4/3, v? -4/5 Let t = -2425/7271 - -4/21813. Suppose -4o - 3 = 9. Which is the closest to o? (a) 0.2 (b) 6 (c) t c Let g be 136/(-476) + (-254)/42 - -6. Which is the closest to g? (a) -5 (b) -1/2 (c) 0.2 (d) 7 b Let z = -4.1 + 3.35. Let d = z + 31.75. Let f = -31 + d. Which is the nearest to 0? (a) 2/17 (b) 2 (c) f c Suppose 0 = l - 90 + 19. Let z = l + -106. Let t = 211/6 + z. Which is the closest to 0.2? (a) 2 (b) t (c) 1 b Let r be -25/20-2. Let z = -515 - -467.6. Let w = -47 - z. What is the nearest to 0 in 0, w, r? 0 Let w = -0.618 - -0.318. Suppose -5s - 6s = 11. What is the closest to s in -18, 6/11, w? w Let n = -142 - -402. Let f = n + -259. What is the nearest to -6 in 4, f, -0.4? -0.4 Let p(v) = v2 - 145v + 835. Let b be p(6). What is the closest to -1/2 in 1/5, -0.1, b, 3? -0.1 Let r = -2 - 3. Let u = -51 - -50.6. Let p = -251 + 252. Which is the nearest to 3? (a) r (b) u (c) p c Let g be (-114)/(-5) - 20 - (8/10 + -2). What is the nearest to 0 in 3, -6, g, 2/115? 2/115 Let u = 25839 + -25839.1. What is the closest to u in -0.1, -10/11, 0.4? -0.1 Let a = -2 - -3. Let n = -0.2595 + -59.2805. Let o = -59.5 - n. What is the closest to -0.1 in a, o, -3/5? o Let h = 12 + -12.2. Let a = -2292 + 2287. What is the nearest to 0 in a, 1/6, h? 1/6 Let r = 0.16872 + 0.63128. Which is the nearest to r? (a) -3/5 (b) -0.04 (c) 5 b Let q = -9768 - -9756. What is the closest to 12 in q, 0.2, 2/5? 2/5 Let o be 2/(-7) - 32/84. Let n = -5800.98 + 5801. Let w(v) = v*2 - 6v - 7. Let p be w(7). Which is the closest to p? (a) o (b) n (c) 4 b Let z = -91.4 + 91.5. Let v be (-2 - 1) + -1551. Let w = v - -635/4. What is the nearest to z in -1/8, 0.3, w? 0.3 Suppose -19c + 81c = -124c + 930. What is the nearest to -5 in -4, 0.39, -1/3, c? -4 Let o = -428 - -277. Let u = -151.1 - o. What is the nearest to -1 in -2/5, u, -3/4? -3/4 Suppose -3v + 173 - 202 = -2l, 3v = -3l - 69. What is the nearest to 4 in -0.09, v, 0.03? 0.03 Suppose -14z = z + 30. What is the nearest to z in 3/2, -0.4, -0.5, 0? -0.5 Let q = -259.845 - -260. Let s = q - 14.155. Which is the closest to 1/3? (a) s (b) 0 (c) 5 b Let y be 2/(-5)(-253)/(-46) - -3. Which is the closest to 2/5? (a) -0.2 (b) -0.11 (c) y c Let z = 21.78 - 21.98. Let h(t) = -t*2 + 18t - 15. Let x be h(17). Which is the nearest to x? (a) -0.3 (b) 5/3 (c) 1 (d) z b Let t = 0.05 - 2.05. Let w be (18/20)/((-207)/(-12) - 15). Which is the closest to 1? (a) -10 (b) w (c) t b Let y = -44652/5 - -8930. Which is the closest to y? (a) 1/9 (b) 1 (c) -2/3 (d) 0.37 c Let v = -51 + 16. Let g = v - -34.9. Let i = 17 - 12. What is the closest to i in 6, 5, g? 5 Let u = 6.682 + -6.882. Which is the nearest to 1.8? (a) u (b) -4 (c) -1/4 (d) -0.5 a Suppose -5w - 439s + 443s - 8 = 0, -2w + 5s - 10 = 0. Which is the closest to 2/7? (a) -266 (b) 3 (c) -1 (d) w d Suppose -d = -6d - 5j, 10 = d - 4j. Suppose 174 = 3y + 171. Let m be 2/((-2)/3-5) - y. Which is the nearest to m? (a) -3 (b) 1 (c) d b Let p(m) = 187m + 1. Let l be p(0). Which is the nearest to -0.2? (a) l (b) -0.1 (c) -1 (d) 2/51 b Let w = 18.6 - 13.6. Let t = 0.2339 - 0.0339. Which is the nearest to -0.05? (a) -2 (b) -1/5 (c) t (d) w b Let j = -1 - 5. Let z = 1577/32 - -71/32. Let t = -923/18 + z. Which is the closest to t? (a) -4 (b) j (c) 0.3 c Let i = -10568 - -10569. Which is the closest to -0.1? (a) 7 (b) i (c) 25 (d) -0.3 d Let q = 118358/9 - 13151. What is the closest to -2/5 in q, 0, -5? q Let p = -0.04302 + -0.35698. Which is the nearest to 0? (a) 1 (b) -24 (c) p (d) -1/5 d Let k = 12009 - 12010. Which is the nearest to k? (a) -0.339 (b) 2/9 (c) 2/11 a Let p be (-9)/54 - (-34)/90(-39)/(-26). Which is the closest to 2.5? (a) p (b) -5 (c) -1/12 (d) -2/11 a Let t = -48.75 - 2.85. Let f = t + 51. Which is the closest to 0.2? (a) 4 (b) -3/2 (c) f c Let s = 0.0877 + -0.1877. What is the closest to s in -1/15, -0.3, -1/10? -1/10 Let m = 0.1 + -0.3. Let r = 300896 + -300891. What is the closest to 0.3 in m, -0.1, r, 0.5? 0.5 Let u be -2 + (468/(-54) - -11). What is the nearest to -3.4 in -2/15, u, -5, 0.1? -5 Suppose 0 = -135m + 152m - 51. Let o = -2 + 1. Suppose 0 = 14l - 41l - 81. Which is the nearest to o? (a) l (b) m (c) 0 c Let c = -2843/11468 + -6/2867. What is the nearest to c in 5, 2, -1.7, 2/5? 2/5 Let g be 7/(-3) + 65/(-39) - (2 + -4). What is the nearest to 2 in g, 19, -51, -1? -1 Let l = 2960.8 - 2960.9. Which is the closest to 3/13? (a) -0.5 (b) -0.3 (c) l (d) -2/19 c Let l be (-38)/(-10) - (3 + 0). Let b = -94 + 29. Let h = 64 + b. What is the closest to h in -1, 2/3, l? -1 Let c be 3(1 + -5 + 5). Let x be 1 - (((-30)/(-25))/c)/1. Let v = -3.1 - -0.1. What is the nearest to -0.1 in v, 5, x? x Let l = -9428 - -9430. Which is the nearest to -0.104? (a) -0.3 (b) l (c) -3/5 (d) -5 a Let d = 0.56 - 0.06. Let t = -703.5 + 703. What is the closest to -0.3 in d, 2, t, 4? t Suppose -m = -0m - 2. Suppose m - 3 = -4g - c, 0 = -g + 5c - 26. Let a be g/((-35)/(-25) - 1). What is the nearest to a in 0, 2/15, -0.1? -0.1 Let o = -2390 + 2395. Which is the nearest to -2/7? (a) o (b) 1/93 (c) -4 b Let w = 0 - 0.3. Let l = -162 + 95. Let i = l + 68. What is the closest to i in 2/11, -2, w? 2/11 Let n = 11774 - 11796. Which is the nearest to 0.1? (a) n (b) 0.06 (c) -5 (d) 4 b Let y = 387/20 - 79/4. Let z = 1091 - 1090.7. What is the nearest to y in 5, z, 4/5? z Let m = -0.8 - -0.3. Let w = -9413.8 + 9413.5. Which is the nearest to -2? (a) m (b) w (c) 2/5 (d) -1 d Let h = 512 + -510. Let r = -22.1 + 22. Which is the nearest to -0.1? (a) r (b) 2/31 (c) h a Let g = -0.31601 - -0.25201. Which is the closest to g? (a) 3 (b) -3 (c) -14/9 (d) -1 d Let o = 53/19 + -515/171. What is the closest to o in -1, 5, -34? -1 Let s(o) = 57o2 + 287o + 8. Let q be s(-5). Which is the nearest to -1/2? (a) -2/3 (b) -1 (c) -2/87 (d) q a Suppose 8r + 88 = -0r + 80. What is the closest to r in 0.06, -48, -1, 2? -1 Let i = 35195 - 35196. What is the nearest to i in -0.2, 1, 4/9, 0.3? -0.2 Let i = -96.1 + 95.9. Which is the nearest to -15? (a) -7 (b) -1 (c) i (d) 0.06 a Suppose 4n - g = -n + 41, 0 = 3g - 12. Let q be (13 - 0) + (n - 12). Let h be q/((-7)/((-7)/(-2))). Which is the closest to -0.1? (a) h (b) 0.5 (c) -1 b Let j = -173.777 + -0.223. Let d = j + 173. Which is the nearest to -2? (a) d (b) -0.03 (c) -4 a Let h = 0.4271 - 1.4271. Which is the closest to h? (a) 0.3 (b) 2/3 (c) 1/6 (d) 2/19 d Let h = 51 - 50.5. Let s = -0.0093 - 0.3907. Which is the nearest to 0.04? (a) 3 (b) h (c) s c Let x = 0.32 - 3.32. Let i = 254.3 - 181. Let p = 73 - i. Which is the nearest to x? (a) -4 (b) p (c) 0.3 a Let o = -0.34 - 0.06. Suppose -4r = 5b - 8r - 12, -68 = 5b + 6r. What is the closest to 0 in 0, b, 3, o? 0 Let m = -200.67 + -4.33. Let p = 204 + m. What is the closest to p in -2/11, -7/4, -4? -7/4 Let w = 14195.55 - 14195.05. Let s = -4.6 + 5. Let u = s + 2.6. What is the closest to u in 2, -4/5, w? 2 Let p be (-6)/(-10) + (-103501)/(-215). Let b = p - 484. Let s = 0.1 - -0.9. What is the closest to b in 0.4, s, 4? 0.4 Let q = -21 + 20. Let u = -5147 - -5152. Let t = -2/27 + -7/27. What is the closest to 1 in t, q, u? t Let y = -42.942 - -43. Let n = y + -0.158. Let m be (2 - 0)/(-111). Which is the closest to 0.1? (a) n (b) m (c) 0.1 c Let d(q) = -q*2 - 9q - 14. Let i be d(-6). Let z be (-3 - (3 + -3))5/(-15). Let w = -0.18 - -0.28. What is the nearest to w in z, 2, i? z Let z be 1 + (-14)/10 - (-112)/(-70). Let d be 2 + z + (-12)/(-24). Let f = 0.06 + 0.34. Which is the nearest to d? (a) f (b) -0.06 (c) -0.4 a Let j = -35473 - -35477. Let k = -37/3 + 151/12. Let v = 7 + -11. Which is the closest to 3? (a) k (b) j (c) v b Suppose 0 = 17q - 119 - 0. Suppose qm = -53 + 18. What is the nearest to 0.1 in 5, 2, m? 2 Let f = -17992 - -17993. Suppose -3g + g + 2 = 0. Which is the closest to g? (a) -5 (b) -7 (c) f c Let y = 1	{ "pile_set_name": "DM Mathematics" }
= 0, 2f = 7f - 4h - 8. Which is the smallest value? (a) -2 (b) -0.1 (c) 2 (d) f a Let z = 0.8 + -10.8. Let d = z - -4.8. Let w = -5 - d. Which is the third smallest value? (a) 3/7 (b) w (c) -1 a Let h = 2/359 - -1426/1795. Which is the third smallest value? (a) -2/15 (b) h (c) -1 b Let z = 1 - 0.7. Let w = 10 + -7. What is the smallest value in w, -5, z? -5 Let q = -8 - -4. Suppose 4u + 6 = u, 4u + 8 = o. Suppose 20 = -op + 4p. Which is the third biggest value? (a) -1 (b) p (c) q c Let w(p) = -6p + 1. Let r be w(-1). Suppose 0j - 28 = -4j. Let l = j - r. Which is the third smallest value? (a) -2 (b) 0.5 (c) l b Let j = -26 + 3. Let s = 20 + j. Let m = -7 - -5. What is the second smallest value in 5, s, m? m Let g = 16.3 - 16. Which is the second biggest value? (a) 0.2 (b) 0 (c) g a Let y = 0 - -2. Let s = y + -1/2. What is the second biggest value in -5, s, -4? -4 Let q = 9 + -9.08. Let d = 3.92 - q. Which is the third smallest value? (a) 0.2 (b) d (c) 0.01 b Let h = 0.4 + -0.3. Let l = -2/13 + -3/65. Let d = 0.15 + 0.85. Which is the third biggest value? (a) d (b) l (c) h b Let d = 2.3 + -2.6. Which is the third biggest value? (a) 2 (b) 1/7 (c) d c Let z = 0.1 + -0.6. Let a = 42/5 + -8. What is the third smallest value in z, a, 3/5? 3/5 Let o = -6 - -5.7. Let n be -1 - (2 - 4) - -19. Let t be ((-8)/n)/((-22)/(-10)). What is the biggest value in t, o, 2? 2 Let g = -0.8 - 4.2. Let d = 10 + g. What is the biggest value in 1/2, d, -3? d Let a = 0.11 - 0.11. What is the biggest value in 1, a, 2? 2 Let f(w) = w - 7. Let o be f(8). What is the second biggest value in -2/11, -4/9, o? -2/11 Let c be -4(-12)/40 + 3. Let v = 2/10217 + -480219/102170. Let l = v + c. What is the third smallest value in l, -3, -0.4? -0.4 Let k = 3.2 + -3. Let g be 2 - 1 - 131. Let j be 0 + -1 - 9/g. Which is the third biggest value? (a) j (b) k (c) -3/7 c Let d(x) = -x*3 - 5x*2 - 5x - 6. Let g be d(-4). Let h = 168.6 + -169. Which is the second biggest value? (a) h (b) g (c) 1/3 a Let h be 2/(-4) + 6/28. Let l = 1630/77 + -152/7. What is the smallest value in h, -2, l? -2 Let l = 5 - 0. Let f(x) = 6x2 + x. Let j be f(-1). Suppose -jh + h = -12. What is the second smallest value in h, l, 1? h Suppose 2z + 16 = -2z. Let u be 1161/14 - 2/z. Let h = u - 83. What is the smallest value in -3, h, 1? -3 Let i = -25 - -15. Which is the biggest value? (a) -2 (b) i (c) -0.1 c Let t be (-1)/(-2) - (-201)/(-378). Let x = -71/252 - t. Let s = 1551/7 - 222. Which is the second smallest value? (a) -0.1 (b) s (c) x c Let f = -0.04 - 0.06. What is the smallest value in -1/5, 0.2, f? -1/5 Let r be 2422/(-105) + 1/(-3). Let i = r + 453/20. Let v be -4(-1)/3-1. Which is the smallest value? (a) i (b) 3 (c) v c Let o = 24.82 - 25. Let g = 0.08 + o. Which is the third biggest value? (a) -4 (b) g (c) -1/4 a Let s = 14 - 13.5. Let z = 6 + -8. Which is the second biggest value? (a) s (b) 2/3 (c) z a Let p = 45 + -73. Let f be (-50)/(-56) + 4/p. What is the second biggest value in -1, f, 2/3? 2/3 Let l be -1 + 0 + (2 - 2). Let t = 5 + -9. Which is the biggest value? (a) 0.5 (b) l (c) t a Let d = -30 - -94/3. What is the biggest value in d, -0.5, 1/2? d Let h = -9 - -11. Which is the smallest value? (a) 4 (b) h (c) 2/11 c Let m = 10/7 - 27/14. What is the third smallest value in 2, m, -1? 2 Let r = -22 - -19. What is the third smallest value in -3/8, 1/5, r? 1/5 Let g = 0.9 + -0.5. What is the third smallest value in 0.2, g, 0? g Let i = -4/21 - 5/84. Which is the smallest value? (a) i (b) -2/9 (c) -4/3 c Let r = -4.2 - -4. Let s = 0.6 + -1.6. Which is the second smallest value? (a) 2/3 (b) s (c) r c Let k = -0.5 + 0.9. Let r = -151/6 - -25. Suppose 6g = g + 15. Which is the third biggest value? (a) g (b) k (c) r c Let g be (-5)/(-860)4-2. Which is the biggest value? (a) g (b) -4/5 (c) 1/3 c Let l be (-2)/(-5)(20/(-52))/1. Let t = 7/68 + -6/17. Which is the biggest value? (a) 0 (b) l (c) t a Let m be (-30)/21/(-3). Which is the second smallest value? (a) m (b) -6 (c) 0.2 c Let q = -68 + 614/9. Let r(l) = -l2 - 4. Let i be r(0). What is the second biggest value in q, i, 1? q Let r = -0.3 - -0.3. Let g = r + 5. What is the second biggest value in -5, 2, g? 2 Let n = -10.3 - -1.3. Let d = -9 - n. Let y(m) = m - 5. Let h be y(0). Which is the second smallest value? (a) d (b) 5 (c) h a Let a = -23/84 - -3/28. Let h = 0.15 + 0.25. What is the second biggest value in a, h, -0.2? a Let d = -5.1 - -5. Let x = d + 3.1. Let p be (-2)/8 + 2/8. What is the smallest value in x, 0.5, p? p Let m be 3/(450/12)10/(-6). What is the smallest value in m, -9/5, 2/15? -9/5 Let m = -7 + 9. Let g = -0.33 + 0.41. What is the biggest value in m, -1/2, g? m Let p(t) be the second derivative of -t4/12 - t3/6 + 3t2/2 + 3t. Let f be p(-3). Let z = -2 + f. Which is the smallest value? (a) 3/8 (b) z (c) 0 b Let p = 0.03 + -2.03. Which is the second smallest value? (a) p (b) 0.3 (c) -0.4 c Let d = 15 + -13. Let g be 6/((-81)/(-12)d). Let y = -1 + 4. What is the third smallest value in 2, g, y? y Let q = 0.06 + -1.56. Let d = 8.5 + q. Let o = -5 + d. Which is the third smallest value? (a) -1/2 (b) 1 (c) o c Let p = 46 + -46. Which is the third biggest value? (a) 3 (b) -1/10 (c) p (d) 4 c Let y = -1.1 + 1. Let q = -0.1 - y. Let k = -0.3 - q. What is the biggest value in -0.4, 3, k? 3 Let v = 3.3 - 4. Let l = 4.4 - 4. Let j = v + l. What is the second biggest value in 1, j, 0? 0 Let g = 9 - 5. Let d = -11.2 - -11.7. What is the third smallest value in g, 3, d? g Let w = -0.1 + -4.9. Let o = -0.58 - -0.68. Let k = -0.1 - -0.1. Which is the second biggest value? (a) w (b) o (c) k c Suppose 3l - 4 = -1. Suppose l = 3p - 5. Suppose p = -2d + 12. Which is the third biggest value? (a) d (b) 0.3 (c) -2/9 c Let t be ((-7)/2)/(1/(-2)). Let p = 3 - t. Which is the second smallest value? (a) p (b) 3 (c) -5 a Let y = 41 + -37. Which is the third biggest value? (a) -1 (b) y (c) 3 a Let o = 10 - 8.2. Let y = -0.2 - o. Let i = y - -3. Which is the second biggest value? (a) -0.3 (b) i (c) 2 b Let k = 29 - 18. Let n = -9 + k. Which is the third smallest value? (a) -0.5 (b) n (c) 1/3 b Let z = 0.3 + -0.3. Let j = -80.3 + 80. Which is the second smallest value? (a) z (b) 0.5 (c) j a Suppose d + 0 + 5 = 0. What is the second biggest value in 0.1, d, 1.7? 0.1 Suppose a = -k + 8, -3a + 26 = 2k + 3k. Let y = a - 8. Let g be (y/(-6))/((-7)/(-21)). What is the biggest value in -5, g, -2? g Let z = 0.44 - 8.54. Let i = z - -8. What is the biggest value in 2/7, 3, i? 3 Let g = 66 - 66. Which is the third biggest value? (a) g (b) 4 (c) -0.2 c Let y = -35.6 - -36. Let u = 1.1 + 3.9. Which is the third smallest value? (a) 0.2 (b) y (c) u c Suppose -l = -4h - 18, l + 7 = -h - 0. Which is the third biggest value? (a) -7 (b) 2 (c) h a Let u = -32.2 + 32. Which is the third biggest value? (a) -3 (b) u (c) 3/4 a Let d = -19 + 17. Suppose m + 5 = 0, -3m - 5 = -5h + 5. Let i be (2/(-24))/(h/3). What is the biggest value in i, 2, d? 2 Let b = 1.8 - 0.8. Let c = -5 + b. Let z = -2 - c. What is the second biggest value in -0.5, z, 6? z Let p = 1.1 + -1.2. Let f = -67 - -203/3. Let h = 0 - -0.3. What is the third smallest value in h, p, f? f Let r = 0.6 + -0.7. Let n = -0.3 - -0.6. Let l = -2.4 - 0.6. What is the third smallest value in r, n, l? n Let w be -3 - (-4)/(-5 + 3). Which is the second smallest value? (a) -0.3 (b) w (c) 0.4 a Let h = -2.4 + 2. Suppose 2g = 4g + 6. Let l = -1 + 1. What is the second smallest value in h, l, g? h Let l = 10 + -11. Let c = -13 - -14. What is the third biggest value in 5, c, l? l Let j = -0.23 - -0.23. Let u = -1 + j. Which is the second smallest value? (a) 1 (b) u (c) 2 a Let o(x) = -x - 3. Let q be o(0). Let g be 3 + q + (-2)/14. What is the third smallest value in 0, g, -5? 0 Let n = -4.5 - -2.5. Which is the third biggest value? (a) 2 (b) n (c) 1/3 (d) 7 c Let l = 30 - 27. Which is the biggest value? (a) -1/3 (b) -4 (c) l c Let l = -3.8 - -0.8. Let m = -0.61 + 0.91. What is the smallest value in l, m, -0.2? l Let i be 2/(-8) - (-165)/20. Suppose	{ "pile_set_name": "DM Mathematics" }
3n2) as on + pn2 + un*3 + b and give u. -126 Rearrange 256 + 258 - 131v - 514 to t + gv and give g. -131 Rearrange ((-1 - 1 + 3)(2 - 2 - 1) - 5 + 3 - 3)(-25r - 186r + 47r) to the form ir + n and give i. 984 Rearrange -27h - 18h - 23h - 13h + 5h to the form q + oh and give o. -76 Express -747 - 9r*2 + 372 + 373 + (-4 + 4 + 3r)(8r - 2r - 13r) in the form wr + or*2 + p and give p. -2 Express (12 - 1 - 1)(100q + 96q + 2041 - 2044) in the form j + fq and give f. 1960 Express 19a - 8a + 24a + (2a - 4 + 4)(-2 + 0 + 1) - 2a - 2 + 4a - a as pa + m and give m. -2 Express 4o*3 - 3o*3 - 2o*3 + (-1 + 5 - 7)(-o + 3o + 4o)(4 - o2 + 2o*2 - 1) as ro*2 + w + yo + so3 and give r. 0 Express (-2x2 + x2 - 3x2)(-4 + 10 - 6 + 24x) as p + nx*2 + jx + yx3 and give y. -96 Express i3 - 2i*3 + 7i*3 - 2698i*2 + 2722i*2 as ti*2 + x + oi + ri3 and give t. 24 Rearrange 7o + 3o4 + 13o*2 + 6o*2 - 17o2 + o3 - 5o4 to the form lo*3 + wo*2 + g + to*4 + po and give t. -2 Rearrange (-2b - 3b + 3b)(31 + 107 + 620) to fb + h and give f. -1516 Express (-2 - 4 - 2)(-14 + 29 - 19 - 34l2) in the form x + ol*2 + wl and give o. 272 Express (2l + 0l - 3l)(l - 2l + 0l) + 7l2 - 12l*2 - 13l2 + l2 - 4l2 - 3l*2 as n + dl*2 + hl and give d. -23 Express (-2v + 3 + 3v - 1)(-818 + 423 + 481) in the form h + av and give a. 86 Express 175g + 71g + 209g in the form t + rg and give r. 455 Express (0 + 0 + 7)(-5 + 5 + 3k)(8k*3 - 1155k + 1155k) as hk*2 + uk*4 + j + wk + yk3 and give u. 168 Express 0q + 4q - 3q + (0q + 4q - q)(-2 - 1 + 2) + (9q - 17q - 11q)(4 - 4 - 2) - 3 + q + 3 in the form m + fq and give f. 37 Express -12m - 17m + 31m - 13m + 16 - 58 in the form nm + z and give z. -42 Rearrange (-q - 2 + 2)(-33q3 - 85q*3 - 110q*3) to xq*3 + oq + mq2 + hq*4 + a and give h. 228 Rearrange -98140 + 98138 + 102k + 96k to pk + f and give f. -2 Rearrange -141k2 - 146k*2 + 1298k*2 to dk + t + yk2 and give y. 1011 Rearrange -417o*3 + 4o + 231 - 426o3 + 844o*3 to co + io2 + y + go*3 and give c. 4 Rearrange (-1 - 2 - 1)(-52 - w + 52)(-3 + 2w + 3) to hw2 + gw + c and give h. 8 Express 2d4 + 21d*3 - 8d*3 + 14d*3 + 2d - 4d2 + 3d*2 - 4d*4 as od*3 + rd + wd4 + j + vd*2 and give w. -2 Express 566t + 170t + 435 - 435 in the form dt + w and give d. 736 Rearrange (-3 + 2 - 6)(-21u4 + u2 - u*2) to the form m + ou*2 + su*3 + bu*4 + yu and give b. 147 Express 8723h + 22h*3 - 8723h + 10 in the form ph2 + jh*3 + m + qh and give j. 22 Express m2 + m2 + 0m2 + (-m2 - 4m*2 + 0m*2)(3 + 45 + 91) as wm2 + j + cm and give w. -693 Rearrange (2 - 4 + 0 + (3 + 0 + 0)(5 - 4 - 3))(485 + 199n - 485) to gn + l and give g. -1592 Rearrange 825 - 6p3 + p - 813 + 3p*3 to the form vp*2 + b + tp*3 + cp and give c. 1 Rearrange 712m + 243m + 176m + 472m - 116m to qm + k and give q. 1487 Express -4 + 510p3 + 28p*2 + 5 - 512p*3 + 2p*4 in the form yp*3 + ap*2 + hp*4 + lp + t and give a. 28 Express (r - r + r)(1 - 1166r + 2207r - 1108r) as fr + p + zr*2 and give f. 1 Express (-2d - 1 + 1)(2d + 53 + d - 51) as jd + yd*2 + g and give g. 0 Rearrange (-6 + 0 - 6)(0 + 1 - 4)(3 - 6 + 4)((-1 - 2 + 0)(-u + u - u) + 0u - 3u + 7u) to j + cu and give c. 252 Express (-3 + 7 + 2)(2 - 2 + 2)(-10w - 12w - 3w) as j + cw and give c. -300 Rearrange -126 + 129 + 6p*2 + 2p + 9p2 + 46p*2 to xp + t + vp2 and give x. 2 Rearrange 380y + 389y - 1157y - 17 + 379y to the form i + wy and give w. -9 Rearrange 12p4 + 7p*4 + 12p2 - p2 - p*4 - 3p - 1 - 17p2 to the form xp*3 + bp*2 + hp + n + tp4 and give b. -6 Express (-255 - 313 - 86)(-4z2 + 0z*2 + 2z*2) as vz + q + yz2 and give v. 0 Express 3d - 41d2 - 6d + 3d + 1038 + 40d*2 as vd*2 + j + zd and give v. -1 Rearrange 138 + 131 + 15i2 - 257 + 2i*3 to l + yi*2 + hi + fi3 and give f. 2 Rearrange (23471 + 221z*3 - 23471)(-5z + 3z + z)(3 - 2 + 0) to the form vz*3 + tz + i + yz4 + lz*2 and give y. -221 Express (87 - 24 + 4)(-127a2 + 127a*2 + 15a*3) as ga*3 + na + y + ra2 and give g. 1005 Express y3 - y3 + y3 + (-2y*2 - 2y*2 + 2y*2)(-4y + 3y + 2y) + 402y*3 + 5286 - 5286 in the form py*2 + cy*3 + fy + m and give c. 401 Express -38z2 + 637 - 637 + 242z*2 in the form bz + iz2 + g and give i. 204 Express -2f*3 + 2 + 3 + 4f + f*3 + 2f*3 in the form l + if*3 + vf*2 + hf and give i. 1 Rearrange (-6i - 8i*2 + 0i + 6i2)(-i*2 + 12i*2 + 0i*2)(2 + 1 - 6) to qi + u + gi*2 + bi*3 + ti*4 and give b. 198 Express -749g + 749g + 25g*2 in the form ig*2 + x + qg and give i. 25 Rearrange -33p - 22p + 45p + 20p*2 - 4p*2 to q + ap*2 + bp and give a. 16 Rearrange (-q*2 - 5q*2 + 4q*2)(-2 + 509q2 - q + 471q*2 - 941q*2) to sq*3 + xq*4 + k + lq + oq2 and give s. 2 Rearrange (-4 - s + 4)(-63 + 22 + 41 - 2561s) to the form p + as*2 + rs and give a. 2561 Express (-1 + 6 - 3)(128 - 257 + 127)(-2f + 0 + 0) - 3f + 0 + 0 - 3 - f + 3 + (f - 3f + f)(3 - 1 - 3) - 3f + 2f + 2f in the form p + nf and give n. 6 Express -28z3 + 422z*2 + 21z*3 + 6z*3 + (-3z*3 - 2z*3 + 3z*3)(-2 + 1 - 1)(-3 + 3 - 2) in the form m + dz + xz3 + nz*2 and give n. 422 Rearrange -2 + 2v + 2 + (0v + v - 2v)(-4 - 1 + 3) + v + 4v - 4v - 2254 + 2254 - 146v + 0 + 2v + 0 to hv + x and give x. 0 Rearrange 2b + 11b*3 + 19b*2 + 90b*3 - 19b*2 to rb*2 + o + yb + qb3 and give q. 101 Rearrange 154 + 153v + 163v - 318v to ov + r and give r. 154 Express 2c - 16c2 + 7c*2 + 23 + 5c*2 + 4c2 + c2 as uc2 + t + oc and give t. 23 Express 1110p + 20 - 20 - 7p*2 - 1143p in the form mp2 + o + qp and give q. -33 Rearrange 56l - l4 - 6l*3 - 58l + 16l2 + 4l*3 + 2l*3 - 2 to cl*4 + hl*3 + jl*2 + b + fl and give f. -2 Rearrange (-7 - 16 + 6)(-65d + 33d - 32d) to the form s + ud and give u. 1088 Rearrange (297i*4 + 49 + 222i*4 - 49)(1 - 4 + 2) to the form bi + wi*2 + qi*4 + k + hi3 and give q. -519 Express (c4 + c4 - c4)(-1096 + 4841 + 680 + 2739) in the form lc*3 + hc*4 + g + yc + bc2 and give h. 7164 Express 2b*4 + 5 - 1 - 1 - 30b*3 - 2 + b in the form lb*2 + tb + z + fb3 + sb*4 and give t. 1 Express -780 + 373 + 192 + 2w in the form lw + c and give l. 2 Express -221s - 5s - 30s in the form as + q and give a. -256 Rearrange -22 - s - 67346s*4 + 0s + 67348s4 + 2s*2 to the form as + q + os3 + hs*4 + ns*2 and give a. -1 Rearrange 4v - 18 + 19 - 2v - 96v*3 + 0v2 + v3 - v2 - v4 to d + pv2 + fv*3 + nv + gv4 and give p. -1 Rearrange 5646 - 52w*2 - 5646 to the form uw + o + xw2 and give x. -52 Rearrange 16o - 34o - 11o - 32o + 0o to the form so + j and give s. -61 Rearrange -16n*4 - 7n + 15n4 + 88n*3 + 6n + 102n3 to hn*3 + gn + in4 + zn*2 + c and give i. -1 Rearrange -81u + 0u3 + 37u - 2u3 - 3u*2 + 43u to the form ou + g + bu*3 + ju*2 and give j. -3 Rearrange -127k*2 - 1204 - 2k + 1204 to the form dk + y + jk*2 and give j. -127 Rearrange 5 + 2p - 5 + (-38 + 1151 + 1185)(4p + p - 4p) to the form v + hp and give h. 2300 Rearrange -26a2 + 2a - 7a + 0a - 60a2 - 24a*2 to xa*2 + ma + f and give x. -110 Express (-4 + 28 + 41)(-5v*2 + 4v*2 + 2v*2) as b + yv + uv2 and give u. 65 Express 45 - 6929s + 6929s + 0s*3 - 2s*3 in the form gs + ts3 + vs*2 + j and give t. -2 Express -4a - 25a - 4 + 23a - 3a in the form ta + v and give v. -4 Rearrange -15q + 7 + 18q + 10q3 - 7 to the form zq*2 + vq*3 + oq + y and give o. 3 Rearrange 170 - 337 - 14a2 + 170 to the form ka*2 + wa + u and give u. 3 Express 2 - 8z - z3 + 13z + z + 0 as lz + r + jz*2 + hz*3 and give r. 2 Rearrange (w - w + w)(960w - 347w - 424w) to the form gw*2 + x + zw and give g. 189 Rearrange -g + 5	{ "pile_set_name": "DM Mathematics" }
s(x). Let v(o) = 3o2. Determine v(f(b)). 27b*2 Let r(b) = -2b + 2. Let c(m) = -2m + 1. Let x be c(5). Let l be r(x). Let y(g) = 7g + 8g - lg + 4g. Let k(p) = -p2. What is k(y(v))? -v2 Let p(s) = 2s. Let m(n) be the second derivative of 16n4 + 273n. Give m(p(d)). 768d2 Let a(j) be the second derivative of -j3/6 + 2j. Let i(g) be the second derivative of 0g3 + 9g + 2/3g4 + 0 + 0g*2. Determine i(a(n)). 8n*2 Let a(v) = 40v. Let q(o) = 5o2 + 2o + 2. Let m(h) = 7h2 + 3h + 3. Let s(d) = -4m(d) + 6q(d). Determine a(s(z)). 80z2 Let d(z) = -7z*2 - 5. Let a(o) = 2o2 - 6. Let b(r) = r2 - 2. Let p(i) = -4a(i) + 11b(i). Let c(m) = 2d(m) + 5p(m). Let q(s) = -10s. Give q(c(x)). -10x*2 Let r(y) = 8y + 5y - 10y. Let k(n) = -n + 1. Let j(c) = -3c2 - 9c + 9. Let l(z) = j(z) - 9k(z). What is l(r(o))? -27o*2 Suppose 10 + 6 = l. Suppose -3u - 5t = 0, -3t + 7 - l = 0. Let i(s) = -2 - 3 + s + u. Let q(x) = 11x. Calculate i(q(j)). 11j Let w(y) = -12y. Let f(a) = 67 + 6a - 67 - 37a. Give f(w(u)). 372u Let k(d) = 5d2. Let i(z) = 432 - 206 + 10z - 223. Determine k(i(w)). 500w2 + 300w + 45 Let i(x) = 153x2. Let t(w) = -538w. Determine i(t(r)). 44284932r2 Let p(w) be the second derivative of 7w + 0w2 + 0w*3 + 1/4w*4 + 0. Let b(u) be the first derivative of 2u*3/3 - 6. Calculate b(p(d)). 18d*4 Let u(a) = 62a. Let d(h) = 101h + 108h + 106h - 313h. Determine d(u(k)). 124k Let s(n) = -2n*2 - 5. Let c(o) = -3o*2 - 8. Let k(z) = -5c(z) + 8s(z). Let a(y) = 11y + 10y - 24y + 5y. Calculate a(k(t)). -2t*2 Let v(z) = 55z. Let w(u) = -31u2 - 2u. Give w(v(i)). -93775i2 - 110i Let l(i) = -13i. Let c(t) = -6761t. Calculate c(l(n)). 87893n Let s(q) = 1. Let v(c) = -2c + 2. Let k(u) = -2s(u) + v(u). Let z(h) = -44h*2. What is k(z(f))? 88f*2 Let t(m) = -m. Let h(w) = -46w - 7 + 7 - 7 + 7. Give t(h(g)). 46g Let l = -1440 - -1440. Let z(u) be the third derivative of 10u*2 + 0u + 0u3 + l + 1/12u*4. Let h(x) = 9x*2. Determine h(z(f)). 36f*2 Let d(u) = 2u. Let z = -8 - -14. Let h(m) = -3m - zm - 3m. Calculate d(h(r)). -24r Let t(x) = -3 + 1481x + 3 - 1480x. Let o(d) = -d - 2. Let n be o(-4). Let w(j) = -2 - 9j2 + 2 - nj*2. Give w(t(f)). -11f*2 Let y(v) be the first derivative of -3/2v*2 + 0v - 12. Let u(o) = -16o - 10. Let g(h) = 5h + 3. Let b(r) = 10g(r) + 3u(r). What is y(b(n))? -6n Let s(w) = 93779w. Let y(o) = -2o2. Give s(y(z)). -187558z*2 Let q(h) = -10 + 18 + 3h*2 - 8. Let i(f) = -2f*2 + 1. What is q(i(d))? 12d*4 - 12d*2 + 3 Let q(y) = 2y - 1. Let a(o) be the first derivative of o*2 + 30. What is q(a(i))? 4i - 1 Let g(k) = -9k. Let b(o) = 201o*2 + 1. Give g(b(t)). -1809t*2 - 9 Let y(t) = -3t*2. Let j(v) = 85224v*2. Calculate j(y(m)). 767016m*4 Suppose 4l = 16, -4l = -7z + 3z - 8. Let p(j) = 5j*z + 19j + 22j - 41j. Let w(q) = 2q2. Calculate p(w(v)). 20v*4 Let r(a) = 18a*2. Let s(p) = -12215p. Calculate s(r(t)). -219870t2 Let d = -45 + 65. Let i(a) = -da + 10a + 8a + 20. Let t(m) = m*2. Determine i(t(b)). -2b*2 + 20 Let i(z) = 12z. Let a(n) = -11n - 9n + 13n. What is i(a(l))? -84l Let c(d) = 2d2 - d + 1. Let a(q) = -74q*2 + 2q. Let s(u) = a(u) + 2c(u). Let h(b) = -4b. Calculate h(s(k)). 280k2 - 8 Suppose 9 = j + 5z, 2 = z - 1. Let m(s) = 3s2 - 5. Let q(y) = -4y*2 + 6. Let x(u) = jm(u) - 5q(u). Let r(a) = a - 61. Give r(x(i)). 2i*2 - 61 Let f(v) = 25v*2. Let a(t) = -507t*2. What is f(a(s))? 6426225s*4 Suppose 0 = -2w + 6w. Let c(k) = wk + k + 4k - 3k. Let r(a) = -6a2. Calculate c(r(b)). -12b*2 Let f(p) = 60 + 42 - p + 84. Let q(d) = 2d*2. Calculate f(q(w)). -2w*2 + 186 Let b(x) = 9x - 11. Suppose -3w + 2g = -33, -2g - 44 = -4w - 4g. Let t(u) = 5u - 6. Let v(d) = wt(d) - 6b(d). Let z(j) = 7j. Calculate z(v(c)). 7c Let s(i) = i*2. Let l(f) be the second derivative of 1/30f*5 + 0f*4 + 0f*3 + 0 - 2f + 5/2f2. Let k(h) be the first derivative of l(h). Give k(s(d)). 2d4 Let r(y) = -y2. Let q = 30 + -21. Suppose -l + 0 = -10. Let a(z) = -qz2 - lz*2 + 12z*2. What is a(r(u))? -7u*4 Let f(p) = 8p - 17p + 8p. Let l(d) = -5d + 13d - 6d. Determine l(f(n)). -2n Let a(b) = b + 0b - 2b. Let p(k) = -k*2 + k + 5. Let d(c) = -4c*2 + 5c + 27. Let m(i) = -2d(i) + 10p(i). Determine m(a(l)). -2l2 - 4 Suppose s + 54 = 2f + 51, 5f - 4s = 12. Let y(g) be the second derivative of -g + 0g2 - 5/12g*4 + 0 + fg*3. Let x(k) = 3k*2. Calculate x(y(n)). 75n4 Let u(k) = -k2 - 35. Let m(t) = 4080t - 1. What is u(m(c))? -16646400c*2 + 8160c - 36 Let z(u) = -7u. Let t(b) = -736b + 2. Calculate z(t(a)). 5152a - 14 Let r(d) = 28553d. Let k(u) = -3u. Determine r(k(g)). -85659g Suppose -11w + 5w + 12 = 0. Let v(x) = x*w - 15x*2 - 15x*2. Let k(b) = 2b*2. Calculate v(k(i)). -116i*4 Let j(w) = -3w*2. Let h(b) = 11b + 462. What is j(h(g))? -363g2 - 30492g - 640332 Let a(j) be the first derivative of 3j3 - 61. Let b(x) = 10x. Calculate b(a(n)). 90n2 Let m(j) be the third derivative of -j4/24 + 3j*2 + 1. Let w(p) = p + 1. Give w(m(q)). -q + 1 Let p(u) = 2 + u + 5 + 3 - 10. Let i(h) = 464h. Give i(p(d)). 464d Let c(p) = 5p. Let u(s) = -2 - 2 + 20s + 28s - 11s + 5. Determine u(c(t)). 185t + 1 Let a(b) = 2b2 + 102b - 20. Let y(z) = 3z. What is y(a(k))? 6k*2 + 306k - 60 Let l(o) = 2o. Let d(u) be the first derivative of -5u*2 - 6u + 126. Determine d(l(v)). -20v - 6 Let l(r) = -34r - 3. Let t(c) = -6c + 13. Give t(l(q)). 204q + 31 Let c(k) = 3k. Let b be (8 - 3) + -1 + -2. Let q be (3 + -3)/b + 3. Let t(r) = 2 - 2 + qr + 5r. What is c(t(v))? 24v Let l(d) = -599d2. Let x(y) = -y. Let u(g) = g2 - 2g. Let c(b) = -u(b) + 2x(b). Calculate c(l(z)). -358801z*4 Let d(z) = 3z2 - z + z. Let h(w) = w2 - 4w + 6. Let j be h(3). Let x(c) = -8c + jc + 0c + c. Calculate x(d(m)). -12m2 Let u(n) = -47n*2. Let k(o) = 27470o*2. Determine u(k(q)). -35466242300q4 Let i(r) be the third derivative of r5/60 + 2r2 + 25r. Let u(m) = -650m2. Give u(i(o)). -650o*4 Let t(n) = -8n - 15. Let y(f) = 7f + 12 + 8 - 4. Let i(h) = 6t(h) + 7y(h). Let z(u) = -u. Calculate z(i(k)). -k - 22 Let s(w) = -w - 2. Let m(d) = d - 8. Let p(g) = -m(g) + 4s(g). Let r(t) = 2t2. Determine r(p(u)). 50u2 Let g(j) be the second derivative of j4/3 + 153j. Let r(d) = d2. Give r(g(t)). 16t*4 Let z(p) = 4p. Let t(g) = 4g2 - 8g - 8. Let y be t(-1). Let m(f) be the third derivative of -yf2 + 0f + 1/8f4 + 0f*3 + 0. Give z(m(j)). 12j Let n(j) = -j*2. Let s = -3 - -5. Let t(o) = -10o*2 + 7o*s - 3o*2. Determine t(n(l)). -6l*4 Let d(i) = 4i. Let o(m) = -7m2 - 291m + 2. Determine o(d(a)). -112a2 - 1164a + 2 Let i(k) = 43k2 - 5. Let u(n) be the second derivative of 43n*4/12 - 2n*2 - 4n. Let g(r) = 4i(r) - 5u(r). Let c(h) = -h*2. Calculate g(c(j)). -43j*4 Let k(r) = -322r. Let t(j) be the third derivative of -j*4/12 - 5j*2. Calculate k(t(z)). 644z Let n(w) = -3w + 2w + 5 - 5. Let j(z) = z*2 - z. Suppose -3u + 0u + 18 = 0. Let o(y) = 8y*2 - 6y. Let i(v) = uj(v) - o(v). What is n(i(f))? 2f2 Let y(b) = b2 + 3. Let h(g) = -g*2 - 58g. What is h(y(u))? -u*4 - 64u2 - 183 Let z(g) be the first derivative of -g3/3 + 26. Let a(i) = -2i2 + 7i. Calculate a(z(c)). -2c4 - 7c*2 Let h(n) = -2n + n - 3 + 1. Let w(l) = -5 + 22 - 9 - 9. Let m(r) = -h(r) + 2w(r). Let v(s) = 2s. Give v(m(y)). 2y Let g(r) = 4r*2 + 4. Let z(p) = 25020p. Give g(z(s)). 2504001600s2 + 4 Let u(j) = -59j. Suppose 4v + 4q - 2q = 1024, -3v + 777 = -3q. Let c(z) = z + 255z*2 - vz*2 - z. What is c(u(l))? -6962l*2 Let x(c) = 11c. Let f(v) = -43166v. Determine f(x(m)). -474826m Let j be 48/10 - 1/(-5). Let q(f) = 5f2 - 5f + jf. Let w(r) = 61r*2 - 119r*2 + 60r*2. Give w(q(h)). 50h4 Let v(q) be the second derivative of q3/3 + 39q. Let d(o) = 405o*2. Give d(v(h)). 1620h*2 Let r(w) = -16w + 5w - 11w + 6w - 13w. Let z(t) = -16t2. Calculate r(z(k)). 464k**2 Let n	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.