Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
icking 1 q and 2 m when three letters picked without replacement from qqmqqqqqmqmqqquqmm? 5/34 Calculate prob of picking 1 d, 2 j, and 1 a when four letters picked without replacement from {z: 1, m: 2, j: 6, d: 3, a: 2, t: 1}. 6/91 Two letters picked without replacement from {v: 5, k: 4, p: 5}. Give prob of picking 1 k and 1 p. 20/91 Calculate prob of picking 1 s and 2 p when three letters picked without replacement from {s: 4, p: 2}. 1/5 Four letters picked without replacement from {p: 4, q: 7}. Give prob of picking 3 p and 1 q. 14/165 What is prob of picking 3 y and 1 x when four letters picked without replacement from {y: 7, x: 2, v: 2, l: 1}? 14/99 Calculate prob of picking 2 g and 2 s when four letters picked without replacement from {s: 6, g: 5, h: 2}. 30/143 What is prob of picking 1 s and 1 v when two letters picked without replacement from ssvovososvs? 3/11 Two letters picked without replacement from onnyyhn. Give prob of picking 1 n and 1 h. 1/7 Four letters picked without replacement from jwwjwwjwjj. Give prob of picking 1 j and 3 w. 5/21 Calculate prob of picking 2 t and 1 q when three letters picked without replacement from {t: 2, q: 1, f: 1}. 1/4 What is prob of picking 2 k when two letters picked without replacement from {k: 6, n: 1, a: 1, q: 5, s: 1}? 15/91 Two letters picked without replacement from {m: 2, e: 2, c: 4, s: 1}. What is prob of picking 2 c? 1/6 Calculate prob of picking 2 k when two letters picked without replacement from jkkjjkkjkjjkjjkkjkk. 5/19 Four letters picked without replacement from {m: 2, s: 3, i: 5}. What is prob of picking 2 s and 2 i? 1/7 Three letters picked without replacement from qqqqqaqqqqqaq. Give prob of picking 1 a and 2 q. 5/13 Calculate prob of picking 4 s when four letters picked without replacement from ssssss. 1 Calculate prob of picking 1 t, 1 w, and 2 i when four letters picked without replacement from iinwtsts. 1/35 Calculate prob of picking 1 y, 1 a, and 2 o when four letters picked without replacement from oovalloooly. 1/33 Three letters picked without replacement from {o: 1, h: 5, u: 5, m: 5, b: 2, x: 2}. Give prob of picking 1 u and 2 m. 5/114 Calculate prob of picking 2 q, 1 r, and 1 u when four letters picked without replacement from {q: 4, u: 1, c: 1, r: 6, p: 3}. 12/455 Two letters picked without replacement from {q: 1, d: 6, u: 2, j: 6, p: 3}. Give prob of picking 2 p. 1/51 Calculate prob of picking 1 l and 1 i when two letters picked without replacement from fijlifi. 1/7 Three letters picked without replacement from rrrld. What is prob of picking 2 d and 1 r? 0 Calculate prob of picking 4 f when four letters picked without replacement from ffffkfffffkfkfffkff. 455/1292 Two letters picked without replacement from ihyyiyzcy. Give prob of picking 2 i. 1/36 What is prob of picking 1 t, 1 r, and 2 o when four letters picked without replacement from {t: 1, e: 1, o: 1, r: 6}? 0 What is prob of picking 1 n and 2 c when three letters picked without replacement from {c: 7, n: 4}? 28/55 Calculate prob of picking 2 v when two letters picked without replacement from {v: 3, n: 3}. 1/5 Calculate prob of picking 3 d when three letters picked without replacement from dedd. 1/4 Calculate prob of picking 1 t and 2 x when three letters picked without replacement from {z: 1, d: 1, t: 5, x: 4}. 2/11 What is prob of picking 1 n, 1 u, and 2 o when four letters picked without replacement from {t: 1, r: 1, u: 3, n: 1, o: 5}? 1/11 Two letters picked without replacement from huqqqhqhqhqqwhh. Give prob of picking 1 q and 1 h. 2/5 Two letters picked without replacement from {x: 2, r: 1, e: 4, u: 3, i: 2}. What is prob of picking 1 r and 1 x? 1/33 What is prob of picking 2 d, 1 o, and 1 s when four letters picked without replacement from scdcsosdsdsosdcss? 24/595 Two letters picked without replacement from {q: 1, w: 4, p: 2, h: 3, l: 7, o: 1}. What is prob of picking 1 l and 1 p? 14/153 Two letters picked without replacement from {m: 7, u: 2, i: 1, s: 4}. Give prob of picking 2 m. 3/13 Calculate prob of picking 1 g and 2 w when three letters picked without replacement from hwwgwwgmwo. 1/6 Calculate prob of picking 1 f and 1 n when two letters picked without replacement from njjfrdf. 2/21 Calculate prob of picking 2 h and 1 j when three letters picked without replacement from hhhhhwojohwhjho. 8/65 Two letters picked without replacement from {y: 1, g: 2, q: 4}. What is prob of picking 2 q? 2/7 What is prob of picking 2 d and 2 i when four letters picked without replacement from {d: 3, b: 2, i: 4, f: 1}? 3/35 Calculate prob of picking 1 e, 1 t, and 1 b when three letters picked without replacement from ytyeeteetetbeee. 32/455 What is prob of picking 1 m and 1 k when two letters picked without replacement from {o: 1, m: 1, k: 2, t: 1, d: 1, x: 1}? 2/21 Four letters picked without replacement from ikkkyfkepkk. What is prob of picking 1 p, 1 k, 1 e, and 1 i? 1/55 Calculate prob of picking 1 k and 1 b when two letters picked without replacement from bcqkrbbckbhhbkhhkcrc. 2/19 What is prob of picking 1 t and 2 u when three letters picked without replacement from {u: 3, a: 2, d: 9, t: 4}? 1/68 What is prob of picking 4 e when four letters picked without replacement from eeee? 1 Two letters picked without replacement from wiwiwwmwoliwiwwwy. What is prob of picking 1 l and 1 o? 1/136 Three letters picked without replacement from {m: 1, d: 5, x: 5}. Give prob of picking 3 x. 2/33 Two letters picked without replacement from yyyyyfykyyfkffkf. Give prob of picking 2 y. 7/30 What is prob of picking 1 a and 1 z when two letters picked without replacement from {z: 2, a: 1, y: 4}? 2/21 What is prob of picking 3 m when three letters picked without replacement from {m: 9}? 1 What is prob of picking 1 d and 1 k when two letters picked without replacement from klklldkk? 1/7 Two letters picked without replacement from kbll. What is prob of picking 1 k and 1 b? 1/6 What is prob of picking 1 k and 1 i when two letters picked without replacement from kidikit? 2/7 Four letters picked without replacement from {h: 4, n: 2, x: 4}. What is prob of picking 1 n, 2 h, and 1 x? 8/35 What is prob of picking 1 a, 2 o, and 1 n when four letters picked without replacement from zhaooyhnynohoyzny? 9/1190 Four letters picked without replacement from {q: 4, p: 4, b: 3}. What is prob of picking 2 q, 1 p, and 1 b? 12/55 Four letters picked without replacement from {l: 3, a: 2}. What is prob of picking 1 a and 3 l? 2/5 What is prob of picking 1 d and 1 j when two letters picked without replacement from {z: 1, i: 5, j: 3, e: 3, d: 3}? 3/35 Two letters picked without replacement from {j: 1, g: 1, z: 9}. Give prob of picking 1 j and 1 z. 9/55 What is prob of picking 2 h when two letters picked without replacement from {k: 10, h: 4, t: 2}? 1/20 Two letters picked without replacement from blub. What is prob of picking 1 b and 1 l? 1/3 What is prob of picking 2 g when two letters picked without replacement from {j: 1, g: 2}? 1/3 Calculate prob of picking 1 s, 1 j, and 1 g when three letters picked without replacement from jjkjjsssjgjhg. 18/143 Three letters picked without replacement from sasqsqaasasqqqeaesee. What is prob of picking 1 a and 2 q? 5/114 Three letters picked without replacement from {d: 7, q: 2, h: 3}. What is prob of picking 2 h and 1 d? 21/220 What is prob of picking 2 k, 1 p, and 1 r when four letters picked without replacement from rkirrprkkprkgp? 90/1001 What is prob of picking 1 m and 1 z when two letters picked without replacement from {z: 6, m: 4}? 8/15 Two letters picked without replacement from yqnyyyyunmmyyuyyyyyy. Give prob of picking 2 y. 39/95 What is prob of picking 2 i, 1 k, and 1 f when four letters picked without replacement from kyiiqiiississff? 2/91 What is prob of picking 1 r and 1 g when two letters picked without replacement from {r: 7, g: 2, z: 3}? 7/33 Four letters picked without replacement from {u: 5, h: 13}. Give prob of picking 2 u and 2 h. 13/51 What is prob of picking 2 g and 1 o when three letters picked without replacement from {g: 9, o: 11}? 33/95 What is prob of picking 1 q and 3 j when four letters picked without replacement from judjwqj? 1/35 What is prob of picking 1 a, 1 b, and 1 h when three letters	{ "pile_set_name": "DM Mathematics" }
i*2 - 58i. i*2 - 58i Collect the terms in 2060g3 + 1242g3 - g2 + 2 + g*2 - 1027g*3 + 1622g*3. 3897g*3 + 2 Collect the terms in 59871k - 99449k - 178106k - 105677k. -323361k Collect the terms in 119501863 - 59750931 - 59750932 + 39g. 39g Collect the terms in 126w2 + 55159w + 124w2 - 242w*2. 8w*2 + 55159w Collect the terms in 2058343890 - 550r3 - 2058343890. -550r*3 Collect the terms in 63i + 1329i2 + 13983i*2 + 58i - 122i. 15312i*2 - i Collect the terms in 1227i*3 - 8698i*3 + 5030i*3 + 1218i*3 + 1226i*3. 3i*3 Collect the terms in -21 + 1068t - 19 - 48 + 113 - 25. 1068t Collect the terms in -5420p - 378p - 538p - 239p2 - 1686p + 238p2. -p2 - 8022p Collect the terms in -468027367371b + 468027367371b - b3. -b3 Collect the terms in 6526n + 16037n + 38834n + 12538n. 73935n Collect the terms in -36358b*2 + 5b - 36335b2 + 109041b*2 - 36352b*2 + 3b*3 - 5b. 3b3 - 4b*2 Collect the terms in 94u - 40u - 943u*2 + 24u - 40u - 38u. -943u2 Collect the terms in -1951r + 137 - 272 + 135. -1951r Collect the terms in 906q*2 - 1694q*2 + 791q*2. 3q*2 Collect the terms in -3 - 12 - 2 - 64p*2 + 28p*2 + 21p*2. -15p*2 - 17 Collect the terms in 6r*3 - 7592r - 7786r + 15378r. 6r3 Collect the terms in -22188k*3 - 908765 + 908765. -22188k*3 Collect the terms in 26742g*2 + 5g + 15g + 10g - 30g. 26742g*2 Collect the terms in -89812162y - 200651092y + 7426315y. -283036939y Collect the terms in 110v - 205v + 119576 + 97v. 2v + 119576 Collect the terms in -4665z*3 - 50z*2 + 49z*2 + 4683z*3. 18z3 - z2 Collect the terms in -b*2 + 502b*3 - 2b - 3170b3 + 1757b*3. -911b3 - b2 - 2b Collect the terms in -51w*3 + 307w*3 - 184w*3 - 35w*3 - 42w*3. -5w*3 Collect the terms in -8280171c + 2c2 + 2760056c + 2760064c + 2760051c. 2c2 Collect the terms in 430w*3 - 7w - 1809w3 + 518w*3 + 425w*3 + 426w*3 + 6w. -10w3 - w Collect the terms in -1834k*2 + 429k*2 + 541k*2 + 445k*2 + 440k*2. 21k*2 Collect the terms in -2x*3 + 881965 - 176386 - 176390 - 176395 - 176389 - 176386. -2x*3 + 19 Collect the terms in -15n - 28 - 178 - 3n2 - 3n - 147. -3n2 - 18n - 353 Collect the terms in 8621p2 - 8765p*2 + 30143p - 30143p. -144p2 Collect the terms in -217423988996875 + x3 + 217423988996875. x*3 Collect the terms in 2n + 695 - 307 + 224 + 1368. 2n + 1980 Collect the terms in 248o*2 - 156o*2 + 651o*2 - 61o + 61o. 743o*2 Collect the terms in 378293i + 383539i + 655136i - 88845i. 1328123i Collect the terms in 29417n2 - 4 + 2n - 58803n2 + 29421n*2 + 4. 35n*2 + 2n Collect the terms in -599 - 2q2 + 599 - 5356q*3 + 20q. -5356q3 - 2q*2 + 20q Collect the terms in -41 - 24 - 50h + 136h - 40h - 42h. 4h - 65 Collect the terms in -33m*3 + 19m*3 + 210m*3 - 176m*3. 20m*3 Collect the terms in 1009q + 42q2 - 13q*2 - 501q - 509q. 29q*2 - q Collect the terms in -429076 + 429119 - 9a3 - a3. -10a3 + 43 Collect the terms in 1 - 403098c + 2372c2 + 403098c. 2372c2 + 1 Collect the terms in 2447g - 3545021 - 2447g - 40g*2 + 3545021. -40g*2 Collect the terms in -13026 - 13034 - 3525o*2 + 26061. -3525o*2 + 1 Collect the terms in -3530s - 5002s + 12095s - 3564s. -s Collect the terms in 9200 + 9162 + 9178 - 36716 + 9176 + 13m*3. 13m*3 Collect the terms in -1800f*2 + 6134f*2 + 5164f*2 - 336f*2. 9162f*2 Collect the terms in x + 1683084 - x + 2x - 2x + 2x - 1682217. 2x + 867 Collect the terms in 88731947474 - 88731947474 - 6v. -6v Collect the terms in 184254u - 1 + 1. 184254u Collect the terms in -62927 - z + z - 2z*2 + 3z2. z2 - 62927 Collect the terms in 30412s - 30416s + 1409 - 684 - 725. -4s Collect the terms in -32h*3 - 2 + 245h*3 - 34h*3 - 52h*3. 127h*3 - 2 Collect the terms in -269t*2 + 24t*2 - 267t*2 - 262t*2 + 781t*2. 7t*2 Collect the terms in 22237s + 22167s - 44217s. 187s Collect the terms in 1323o - 1317o + 18575718 - 18575718. 6o Collect the terms in -18086381 + 0b + 9043197 + 0b + b2 + 9043184. b2 Collect the terms in -152a - 1033 + 1033 - 441a. -593a Collect the terms in 2186k*3 - 6635k*3 + 2192k*3 - 185 + 2254k*3. -3k*3 - 185 Collect the terms in -329l - 27l2 + 34l*2 - 315l + 647l. 7l*2 + 3l Collect the terms in -699p3 - 685p*3 - 42266 + 42270. -1384p*3 + 4 Collect the terms in -112 + 135p - 137p + 34 + 47 + 31. -2p Collect the terms in 35u - 24 - 29u + 71u + 23 + 8u. 85u - 1 Collect the terms in -551i + 1710i + 2i*2 - 4606i. 2i2 - 3447i Collect the terms in 3278o2 - 9o + 3136o2 + 4o - 6418o2 + 5o. -4o2 Collect the terms in -209 - 10q*3 + 258q*2 - 126q*2 + 49q*3 - 132q*2. 39q*3 - 209 Collect the terms in -6880087c*3 + 13760118c*3 - 6880056c*3. -25c*3 Collect the terms in -72868 + 36374 + 19k*2 + 36494. 19k*2 Collect the terms in 2207 - 734 - 3656y*2 - 740 - 735 + 3604y*2. -52y*2 - 2 Collect the terms in -210g*2 + 549g*2 - 248g*2 + 16g*2. 107g*2 Collect the terms in -18a + 3 + 7a + 11a + 0 + 3a + 8a. 11a + 3 Collect the terms in -2890b + 1489b - 10b*2 + 1401b - 14b2 + 4b*2. -20b*2 Collect the terms in -52 - 5r + 31 + 54r + 116r*2 + 16. 116r*2 + 49r - 5 Collect the terms in -25m - 16m + 41m + 4113636m*3 - 4113895m*3. -259m*3 Collect the terms in 388k*3 - 8586 - 8589 + 17175 + 58k*3. 446k*3 Collect the terms in -1364c + c*2 + 0c*2 - 1825c + 3c2 - 3c2 + 1. c2 - 3189c + 1 Collect the terms in 69 + 22 + 2j - 93 - 4j - 45698j*2. -45698j*2 - 2j - 2 Collect the terms in 13540 + 13581 - 2c2 + 13547 - 54200 + 13532. -2c*2 Collect the terms in 20n - 33n + 13n + 9n - 27062. 9n - 27062 Collect the terms in -808348q3 + 642132q*3 + 166219q*3. 3q*3 Collect the terms in -316j*3 - 167j*3 - 24j*3 - 143j*3. -650j*3 Collect the terms in 3482u - 27600u - 12618u - 18485u. -55221u Collect the terms in -1859h2 + 10371h*2 + 13168h*2. 21680h*2 Collect the terms in -217652991z - 217653014z + 435306006z. z Collect the terms in 181652208164l2 - 363304416328l*2 + 181652208165l2. l2 Collect the terms in -49249h2 + 98851h*2 - 49623h*2. -21h*2 Collect the terms in 4473w*2 + 3059w*2 + 25958w*2. 33490w*2 Collect the terms in -725k + 144k + 140k + 122k + 112k + 146k. -61k Collect the terms in 4g - 6934822483 + 6934822483. 4g Collect the terms in 76 - 36592r + 165127r + 70245r - 76. 198780r Collect the terms in 54s - 32s - 49 - 23s - 109 + 11s*2. 11s*2 - s - 158 Collect the terms in 1 + 160p + 1 - 286p - 339p + 0. -465p + 2 Collect the terms in -231284526332d*2 + 2d*3 + 231284526332d*2 - 206d. 2d3 - 206d Collect the terms in 630d2 + 577d*2 - 132d*2 - 160d*2. 915d*2 Collect the terms in -1098261583m*3 + 3 + 26 - 29 + 1098261580m*3. -3m*3 Collect the terms in -7t*2 + 3 + 41 - 34395t - 3t3 + t3 + 34395t. -2t3 - 7t*2 + 44 Collect the terms in -3 + 300z - 1 + 27z2 + 337z + 6 - 3. 27z2 + 637z - 1 Collect the terms in 85146c2 + 0c - 255994c2 + 85326c*2 + 0c + 85222c2. -300c*2 Collect the terms in 103 - 42015d + 42050d + 14. 35d + 117 Collect the terms in 152 - 72 - 2977z2 - 41 + 2980z*2 - 39. 3z*2 Collect the terms in -44521k*3 + 6292k*3 + 19280k*3 - 60941k*3. -79890k3 Collect the terms in y3 - 31 - 38 - 39 - 32 + y*3 - 10 + 151. 2y*3 + 1 Collect the terms in 33626c*3 - 29 + 10619c*3 + 19967c*3 + 29. 64212c*3 Collect the terms in -881w*2 - 882w*2 + 4378w*2 - 874w*2 - 880w*2 - 860w2. w2 Collect the terms in -67029l + 136433l - 69402l. 2l Collect the terms in -87 - 9r + 48 - 118 + 157. -9r Collect the terms in -175349z2 - 304z + 304z + 175365z*2. 16z*2 Collect the terms in -1267i*2 + 5835i*2 + 22929i*2. 27497i*2 Collect the terms in 113315j - 70472j + 155635j + 22146j. 220624j Collect the terms in 116s - 1193 - 552 - 66s - 66s. -16s - 1745 Collect	{ "pile_set_name": "DM Mathematics" }
/9 d Let h = -4 + 4.1. Let d = h - -0.4. What is the second biggest value in -5, d, 4? d Let v = 10 - 17. Let t = v + 6.8. Let s = 1 - -2. Which is the biggest value? (a) s (b) 1 (c) t a Let i be (-1)/(2/1 - 3). Let x(j) = 2j + 3. Let s be x(3). Let c be -1 - -6 - s/3. What is the second smallest value in c, 3, i? c Let l = -0.07 - 0.03. Let o = -0.12 - l. Let g = 0.28 - o. Which is the third biggest value? (a) g (b) 2/3 (c) 3 a Let f = 15 + -28. Let s = 12.4 + f. Let j be (-2)/8 + 6/88. Which is the second biggest value? (a) j (b) s (c) 0.1 a Let q = -20 - -25.1. Let m = 5 - q. Which is the third smallest value? (a) 0.04 (b) 5 (c) m b Let k = -0.283 - 0.017. Let i be (14/(-10))/(-1). Which is the third biggest value? (a) i (b) 4 (c) k c Let q = 19.95 - 20. Let b = 10 - 15. What is the third smallest value in -0.1, q, b? q Let j = -9 + 11. Let r be (1 - j)/34-4. Which is the third biggest value? (a) 3 (b) 2 (c) r c Let m = -0.5 - 0.3. Let d = -3.8 - m. Let o = -0.2 - 0.8. What is the third biggest value in o, d, -2/15? d Let b = -1.4 + 1.4. What is the third smallest value in 1/5, 0.1, b? 1/5 Let f = 24 - 21. Which is the biggest value? (a) -5 (b) -0.4 (c) f c Suppose 5 + 15 = 4x. Let t(s) = -s*2 + 4s + 6. Let u be t(5). Suppose -w + 3 - u = 0. Which is the smallest value? (a) w (b) -1 (c) x b Let d be 3 + (4 + -4 - 3). Suppose -3w = -w - 2. Which is the third biggest value? (a) 4 (b) d (c) w b Suppose 5p - p = -4o - 8, -6 = 2o. Let l(g) = g + 10. Let v be l(-10). Let q be v - (2 + (-33)/18). What is the second smallest value in -2/9, p, q? q Let i = -0.2 + -0.3. Suppose 0 = -3u + 7u + 4, -u = -4r + 21. What is the smallest value in r, -4/3, i? -4/3 Let z = 25 + -25. Let i(t) = -t3 - 6t*2 - 6t - 2. Let w be i(-5). Which is the third biggest value? (a) 2/3 (b) w (c) z c Let x = 24 - 29. What is the smallest value in -0.05, x, 0.1? x Suppose 4 = o - 1. Suppose -21 = 3r - 6. What is the third smallest value in o, r, -0.3? o Let u = 0.017 - 4.017. Let q be 12/(-14)2/(-3). Which is the third biggest value? (a) 2/7 (b) u (c) q b Let w = 1.3 + -1.2. Which is the second smallest value? (a) w (b) 8 (c) -4 a Suppose -u - 3u = n + 48, -2n = 0. Let k be (u/(-18))/(4/6). Let w be 0 - (k - 7/4). Which is the third smallest value? (a) -2/3 (b) w (c) -3 b Let k = -16.5 + 17. What is the second biggest value in k, -1/4, -1/3, -3? -1/4 Suppose -2q - 18 = 2s, q + 6 = -3q + 2s. Let y = 0.63 - -1.39. Let p = -0.02 + y. What is the smallest value in p, 2/5, q? q Suppose 3m + 5 = 20. Which is the third smallest value? (a) m (b) 1 (c) -3/2 (d) 3 d Let j = 28 + -33. Let z = 3 - 1. Which is the third smallest value? (a) j (b) z (c) 0 b Let y(l) = -l3 - 9l*2 - 6l - 5. Let h be y(-8). Let o = h + 65/3. What is the biggest value in -0.3, -0.1, o? o Let r = -15/131 - -2317/786. Let x = 5/2 - r. What is the third biggest value in -0.2, x, -3/2? -3/2 Let a = 1147/28 - 165/4. Let h = -0.1 + 0.2. What is the third biggest value in h, a, -7? -7 Let v(o) = -o*2 - 13o + 15. Let j be v(-15). Let r = j - -13. Which is the third biggest value? (a) r (b) -0.2 (c) 0 a Let o = -4.13 - -0.13. Which is the third smallest value? (a) 5 (b) o (c) -2/11 (d) 3 d Let n = 0.5 + -0.8. What is the second biggest value in n, -4/7, -3/5? -4/7 Let k = -31 + 17. Let u = 10.25 + -0.25. Let r = k + u. Which is the second smallest value? (a) 2/17 (b) r (c) 0.4 a Suppose 5j = 5i - 25, 0 = j - 3 + 2. Let y be i/27 - (-8)/18. Which is the third smallest value? (a) 2/9 (b) y (c) -3/4 b Let u = 21.3 + -17.3. Suppose 7q = 3q. What is the third biggest value in q, -0.08, u? -0.08 Let i = -585/4 + 145. Let u = -0.07 - -7.07. Let l = u - 4. Which is the biggest value? (a) 1 (b) i (c) l c Let k = 69 - 757/11. Let o = -1.6 + 2. Let w = -0.1 - o. Which is the biggest value? (a) w (b) k (c) 0 b Let r = -4.9 - 0.1. Let d = -4.9 - r. Which is the third biggest value? (a) -3 (b) -10 (c) d b Let l = 4.83 - 4.6. Let y = 4.07 - 4. Let i = y + l. Which is the biggest value? (a) i (b) 0.5 (c) 2 c Suppose -3q + 5w - 29 = -5q, -4q - 4w = -28. Let h = -70.5 + 71. What is the third biggest value in h, q, -0.1? -0.1 Let v = -190.87454 - 0.14546. Let o = -196 - v. Let q = o - 0.02. What is the third smallest value in 3, q, -0.5? 3 Suppose 15 = -5h - 0. Let v be -2 + (48/(-33))/(-1). Which is the third biggest value? (a) v (b) h (c) 3 b Let x = 85 - 39. Let i = 277/6 - x. Which is the smallest value? (a) -5 (b) i (c) 5 a Let x be (-414)/(-99) - 8/2. Let f = 0.5 + -0.8. What is the biggest value in f, x, 4/9? 4/9 Let p = -0.035 - -0.435. Which is the second biggest value? (a) -0.5 (b) -4 (c) p a Let r = 1 + -4. Let z = -286/3 + 96. Which is the smallest value? (a) z (b) r (c) 1 b Let m(u) = u*3 + 5u*2 + 8u + 5. Let i be m(-3). What is the smallest value in -2, i, -0.2, -3? -3 Let n = -67 + 401/6. What is the fourth biggest value in 0.4, 2/3, n, -1/2? -1/2 Let f be (-5)/((-15)/(-48))1. Let m be (-10)/68f/20. What is the second biggest value in m, 2/9, 0.2? 0.2 Let m = -15 + 15.02. Which is the third biggest value? (a) m (b) -1/3 (c) 0 b Let c be (-1)/(-5) + (-3)/(-35). Let r be 1/(-5) + 8 + -8. What is the third biggest value in 5, c, r? r Let y = -0.2 + 0.7. Let n(f) = f*2 - 2f - 4. Let j be n(2). What is the third smallest value in y, j, 0.2? y Let h be (80/(-12))/10(-2)/(-4). What is the third smallest value in -5, 0.5, -1, h? h Let l = 0 + 0. Let z be 0 + 2 + 64/(-30). What is the smallest value in 3, l, z? z Suppose -u - 33 = -2u + 5q, 5q = -20. Which is the third smallest value? (a) 2 (b) u (c) -3 b Let j = -7 + 6.95. Let f = 0.35 - j. Which is the second smallest value? (a) 0.3 (b) f (c) 4 b Let x = 22 - 27. What is the smallest value in x, 5, 3? x Let w = 7.3 + -7. Let i = -476 + 478.99. Let l = i + 0.01. Which is the smallest value? (a) l (b) -1/5 (c) w b Let u = 1 + -0.6. Suppose -d - 2t - 6 = -2d, -5 = 5t. Which is the smallest value? (a) -3 (b) d (c) u a Let v be (-3 - 1)/((-1)/(-1)). Let k = 8 - 10.5. Let r = 2 + k. Which is the second biggest value? (a) v (b) r (c) -0.3 b Let j = -79/6 + 13. Let s = 12.3 + -12. What is the smallest value in j, s, -0.4? -0.4 Let c = -0.1 - -0.5. Let i = c - 0.1. Let j = -880/7 - -126. What is the smallest value in i, -1/5, j? -1/5 Let u = 4.9 - -0.1. Let f = 18.5 - 15.5. Which is the third smallest value? (a) u (b) f (c) -0.1 a Let x = 5.4 + -2.4. Which is the second smallest value? (a) 0.5 (b) x (c) -1 (d) 5 a Suppose 4k = 23 + 21. Let r be k/(-15) + (-2)/(-5). What is the smallest value in r, -3, 6/5? -3 Suppose 6l - 3 = 5l. Suppose f - 16 = -lf. Suppose 4j = 8, 4s - 2s + f = -j. What is the second biggest value in -5, s, 3/8? s Let c = 3 - 12. What is the third biggest value in c, -0.4, 0? c Let k = 77 + -84.2. Let p = k + 7. What is the third smallest value in -2, -1, p? p Let m be (3/2)/((-36)/(-16) + 0). Which is the biggest value? (a) m (b) -2/17 (c) 5/4 (d) 3 d Suppose 0 = -m - m. Which is the second smallest value? (a) m (b) 5 (c) 2/3 c Let h = 2.01 + -0.01. Let s = h - 6. Let j = -1 - -0.7. What is the second biggest value in 4, j, s? j Let s = 347/6 - 58. What is the third smallest value in -4, s, 20? 20 Let j = -0.84 + 0.94. What is the third biggest value in 0.5, -1, 4, j? j Let b be (2 + -1)/(1/(-5)). Let z = 144/53 - 30884/11289. Let n = -1306/1491 - z. What is the biggest value in b, n, -5/3? n Let j = -150 - -144.95. Let p = 0.05 + j. What is the second biggest value in -1/5, p, 2? -1/5 Suppose -22w + 21 = -21w. Which is the third smallest value? (a) -2 (b) w (c) -0.3 b Let m = -5.9 + 0.9. Let n = 0.41 - 6.41. What is the third biggest value in 5, m, n? n Let z = 14 - 8. Let v = z + -6. Which is the third smallest value? (a) 0.3 (b) v (c) -1 a Suppose -c = -4, 2l + 0c = 5*c - 22. Let k = -0.3 - -0.3. What is the third biggest value in 5, k, l? l Let f = -0.38 + 0.58. Which is the third biggest value? (a) 2/3 (b) 0.4 (c) f (d) 1 b Let y = -3/175 - -78/175. Let k = -2 - -2. What is the second biggest value in k, y, 2? y Let v = 1 + -0.6. Let p = 1.0184 - 0.0184. Which is the	{ "pile_set_name": "DM Mathematics" }
= 5v. What is p(v)? 2 Suppose 0 = -2p + 2i + 8 + 8, 4i + 8 = -4p. Let q(n) = -14n + 25. Calculate q(p). -17 Let s(w) = w*3 - 7w*2 + w + 5. Let x = -2569 - -2576. What is s(x)? 12 Suppose -2 + 26 = -4h. Let t(n) be the second derivative of n5/20 + n4/2 + n*3/6 + 4n - 936. Give t(h). -6 Let d = -17 + 27. Suppose -k - 3p = -8p + 10, -2p = -k - d. Let r(y) = -y - 5. Calculate r(k). 5 Suppose -4v = 2w + 4, 4w + 0w - 10 = -2v. Let z = 252 - 186. Let u(r) = -3r - z + 4r + 66. Calculate u(w). 4 Let g(p) be the second derivative of 11p3/6 - 75p*2/2 - 2p - 659. Calculate g(7). 2 Let a(j) = j*3 - 9j*2 + 3j - 6. Suppose 2n + n - 4b + 2 = 0, -5n + b = -8. Suppose -4z + 23 = 3k, nz = -2k - 3k + 43. Calculate a(k). 21 Suppose 22 = 2x + r, 5r = -4x + 38 + 12. Let a = 2 + 8. Suppose -b + 32 = -5o + a, 5o + x = -5b. Let g(c) = 5c - 3. Determine g(b). 7 Suppose 13a - 63 = 42 - 14. Let k(p) be the first derivative of p*4/4 - 7p3/3 - p2/2 - 3p + 1. What is k(a)? -10 Let h(b) = -2b + 9. Let a be (-84)/(-10) - (-9)/(45/(-2)). Suppose -a = 2s - 20. Calculate h(s). -3 Let d be (-71 - 2)4/(24/(-6)). Let k(u) = 2u - 35 - 74u3 + u2 + du3 - 3u. Determine k(0). -35 Let a(z) = -z*3 + 38 + 22383z*2 - 19z - 11192z2 - 11213z*2. Give a(-21). -4 Let r be ((-8)/14)/((-6)/21). Let n(w) = -5w*3 - 5 - 2w*r + 5 + w. Let k be (-2)/8(-3)/((-24)/(-32)). Give n(k). -6 Let m(w) = w*2 - 64887w*3 + 129809w*3 - 64889w*3 - 2 - w. What is m(-1)? -33 Let s(z) = -19z + 14. Let a be 6/5635 + (-1)/(-4). Give s(a). -62 Let m(l) = -5979 - 9l + 24l - 5808 + 11933. Determine m(-10). -4 Let g(q) = 2 - 5 - 18 + 5q*3 - 4q*3. Let l = 100 - 95. Suppose -2 = -d + p - 3p, ld - 3p + 3 = 0. What is g(d)? -21 Let p(a) be the second derivative of a*5/120 - 27a*3 + 194a. Let v(z) be the second derivative of p(z). What is v(4)? 4 Let t(m) = -9m3 + 51m*2 - 164m - 9. Let h(v) = 4v3 - 25v*2 + 63v + 4. Let c(z) = -5h(z) - 2t(z). Give c(12). 10 Let y(k) = k*3 - 8k*2 - 2k + 8. Let v(z) = -20z - 632. Let p be v(-32). Calculate y(p). -8 Suppose 3b - 4b = 0. Suppose b - 14 = -2m. Let x(o) = 3o - 4. Let u(f) = -5f + 7. Let q(c) = -5u(c) - 8x(c). Calculate q(m). 4 Let s be ((-12)/2)/(138/(-644)) + -11. Let p(h) = -9h + 155. Determine p(s). 2 Let q(c) = 9c - 1. Suppose -2u - 6 = 2d, 14 = -3d - 1. Suppose ui + 3f + 4 = 0, -7 = i + 5f + 2. Determine q(i). 8 Let b(g) = 5g - 2g + 16g2 - g - 15g*2. Suppose -4r = 4o - 3r - 7, -2r - 12 = -5o. Let v(y) = 2y - 6. Let k be v(o). Calculate b(k). 0 Let v(o) be the third derivative of 1/24o*4 - 1/120o*6 + 1/15o*5 - 2 - 7o*2 + 0o + 1/2o3. Give v(3). 15 Let f be (2 - (-15)/(-6))2. Let c(n) = 839 - 838 + 135n3 - 136n*3. What is c(f)? 2 Let i(q) = -11q*2 + 229q + 40. Let m(s) = 5s2 - 103s - 19. Let p(v) = -4i(v) - 9m(v). Determine p(16). -69 Let z be -3 + 35/(315/162). Let t(n) be the first derivative of -2n - z + 1/2n*2. Calculate t(-7). -9 Let l(y) be the first derivative of -1/2y*2 - 13y - 129. What is l(-5)? -8 Let y(x) = -x + 2x2 - x3 + 6x*2 + 1 - 4x2. Let t(h) = -h2 - 60h + 330. Let n be t(-65). Determine y(n). -29 Let p(r) = -r - 1. Let t(u) = -7. Let f(z) = -p(z) - t(z). Suppose 96h + 76 = -212. Give f(h). 5 Suppose -4y + 8 = t, 3t = -4y + 7t + 8. Let s be y/2(46 + -16). Let m(g) = -s - 2g + 36 - 16. Give m(-7). 4 Let c(d) = 5d - 41. Let h be 3/(-1) - ((-26 - -10) + 6). Calculate c(h). -6 Let d(m) be the third derivative of -m4/12 - m3/6 + 3m*2 - 11m + 5. Suppose 1 = -t - 2i - 3, 8 = -2t - 5i. Give d(t). 7 Let d(y) = -y3 - 14y*2 - 8y + 18. Suppose 16 = -4i + 9n, -1 = 3i + n + 42. Determine d(i). -47 Let u(p) = -5p - 1. Let q(s) = 2s - 13. Let h be q(8). Let v(b) = 4b + 2. Let z(x) = hu(x) + 4v(x). What is z(-13)? -8 Let v(w) = w - 1. Let s(t) be the second derivative of -t*4/12 + 5t*3/6 - 3t*2/2 - 10t. Let m(r) = s(r) + 3v(r). Let l be (3/1)/(8/16). Calculate m(l). 6 Let l(f) = -22f*2 - 17f - 44. Let j(k) = -62k2 - 50k - 135. Let y(g) = -6j(g) + 17l(g). Calculate y(-4). -14 Let a(w) = -2w + 2. Suppose -5c + 115 = 95. Suppose -3j = -4j - c. Calculate a(j). 10 Let x = 47 - 41. Let s(d) = -36d3 + xd*2 - d - 4d*2 + 21d*3. Let r(m) = 46m*3 - 7m*2 + 4m. Let c(v) = 2r(v) + 7s(v). Calculate c(-1). 12 Suppose 0 = 6h - 27 - 27. Suppose 0 = 2j + 5p + 6, -3j - 5p = -10p + h. Let o(k) = -k*3 - 3k*2 + k + 2. Give o(j). -1 Let z(l) be the second derivative of -5l*3/6 + 19l*2 - 7205l. Give z(5). 13 Suppose -7p - 175 + 4949 = 0. Let z = 681 - p. Let h(g) = -7g3 + g2 + g. Calculate h(z). 7 Let q(x) = x*3 - 4x*2 + 3x. Suppose 10o = 69 + 21. Let s = o - -25. Suppose -11b = 1 - s. Determine q(b). 0 Suppose 2t - 5t - 3l = -33, 38 = 3t + 4l. Let u(s) = -9 - 398s + 97s + 105s + 102s + 95s. What is u(t)? -3 Suppose -31v + 73 = -82. Let t(z) be the second derivative of 5/6z3 - z2 + 0 - vz - 1/12z*4. Give t(4). 2 Let j(b) = -13b*3 - 18b*2 + 18b + 1. Let p(f) = -14f3 - 18f*2 + 18f + 3. Let y(n) = -13j(n) + 12p(n). What is y(-19)? 4 Suppose -w - 1 = 11v - 10v, -17 = 2v - 3w. Let t(j) = 6j + 21. What is t(v)? -3 Suppose 2q - 20 = -2r, 22 = 5q - 3. Let j(w) = w*3 - 9w*2 + 7w + 7. Give j(r). -58 Suppose 23d - 38 = 4d. Let w(b) = 2b + 3b*2 + 4b*2 + 4b - 2b2 - 6b*d. Let n = 11 - 4. What is w(n)? -7 Suppose 191 = -3k - 13. Let c = k - -70. Let b(p) = 1 - 2 + 3p - cp. Determine b(5). 4 Let r(w) = -2w3 - w2 + 2w - 2. Let n(y) = -7y3 + 11y*2 + 6y - 17. Let j(o) = -n(o) + 3r(o). Calculate j(14). 11 Let x(z) = -z2 - 9z + 11. Let s = 261 + -309. Let u be 6/(s/168(-7)/(-3)). What is x(u)? 11 Suppose -19x - 40 - 55 = 0. Suppose h = 4b - 22, -5b + 3h = 2h - 27. Let i(z) = -4 - b - 4z + 3 + 0z - z*2. Calculate i(x). -11 Let j(m) = -5m*2 - 6m + 8. Let y(w) = 253w - 3287. Let v be y(13). What is j(v)? -24 Let f(r) = 2r + 3. Let y be f(7). Let w(o) = -o*3 - 59o*2 - 37o*2 + 112o*2 + 16o + 18. What is w(y)? 1 Let a(l) = -1101032l - 7l*2 + 2l*2 + 4l*2 - 2 + 1101015l. Let f be (2/4 - 1)34. Calculate a(f). -2 Let x(n) = 1. Let c(y) = -5y + 5. Let i(d) = -c(d) + 4x(d). Let u be ((-2)/(-4))/((-694)/(-2776)). What is i(u)? 9 Let w(j) be the first derivative of -j4/2 - 4j3 + j2/2 - j - 165. Determine w(-6). -7 Let p(s) = -s*3 + 8s*2 + 3. Let b(c) = -3c*3 + 47c*2 - 31c + 23. Let l be b(15). Calculate p(l). 3 Let h(q) be the second derivative of q5/20 - q4 + 35q3/6 - 5q*2 + 56q. Let y be h(4). Let w(k) = -3k3 + 2k - 1. Determine w(y). -21 Let h(p) = 2p2 - 9p + 10. Let l be h(4). Suppose 2 = li - 10. Let z(x) = 2x + 0xi - 65 + 71 + 3x - 2x2. Give z(5). -19 Let r = 15086 - 15072. Let q(a) = -4a - 14. What is q(r)? -70 Let t(f) = -48 + 0f - 8 + 7f - 51. What is t(13)? -16 Let y(j) = -6j - 73. Suppose 54z - 35 = 5v + 49z, -v + 2z - 3 = 0. What is y(v)? -7 Suppose -o - 2w + 472 = 0, 4o = -3w - 902 + 2785. Let q = -468 + o. Let h(t) = -t*3 - 3t*2 + 2t. Calculate h(q). -16 Let r(g) = -7g3 + 0 + 8 - 3g + 3g3 - 4g*2 - 2 - 5g*3. Let c be r(1). Let t(j) = -2j*2 - 19j + 7. Calculate t(c). -3 Let w be (-3 - (-1 + 1)) + 14 + -3. Suppose -w + 18 = 5q. Let t(g) = q + g - 3 - 8g - 2g. Give t(-1). 8 Suppose -129 = 21c - 339. Let n(g) = g*2 - 4g - 120 + cg3 + 120 + 5g. Calculate n(-1). -10 Let u(y) be the first derivative of -y*4/4 - 28y*3/3 - 17y*2 - 195y - 9542. What is u(-27)? -6 Let c be (2 + -2 - -32) + -4. Suppose -f + 2i = i - 12, 3i = -f + c. Let y(j) = -j + f - j*2 + 0j - 10. What is y(0)? 6 Let x(a) be the third derivative of -1/60a5 + 0a - a*3 + 2a*2 + 0 - 5/24a*4. Let t be x(-2). Let j(m) = -m + 6. Determine j(t). 6 Let o(y) = 4y + 45. Let k(u) = 2u2 + 16u - 222. Let g be k(-15). What is o(g)? -3 Let v(c) = c3 - c2 - c - 1. Let z(o) = -11o3 - 5o*2 - 3o - 2. Let d be (-169)/143 - (-6)/33. Let b(q) = dz(q) + 3v(q). Give b(1). 15 Let x(t) be the third derivative of -t*6/120 + 19t*5/60 + 7t*4/8 - 7t*3/3 - 3967t**2. What is x(20)?	{ "pile_set_name": "DM Mathematics" }
= -10g + 5g, 4c + 3g - 116 = 0. Let t(x) = -7x - 12. What is the remainder when c is divided by t(-4)? 13 Let p(m) = m3 - 2m*2 + 4. What is the remainder when 37 is divided by p(3)? 11 What is the remainder when 52 is divided by 2(-27)/(-4 + 1)? 16 Let y = -1 - 1. Let i be 45/3 - 1y. Let o = i + -9. Calculate the remainder when o is divided by 5. 3 Let m(d) = 0 + 2d - 8d + 2. Suppose 3p + 4 + 8 = -l, 0 = p - 4l - 9. Calculate the remainder when m(p) is divided by 7. 6 Suppose -2d = 2d + 3q - 28, -2q - 8 = -4d. Suppose -15 = -ds + 73. What is the remainder when 64 is divided by s? 20 Let z(p) = -p + 8. Let c be 0 + -2 - 9/(-1). Calculate the remainder when 3 is divided by z(c). 0 Suppose n - 9 = -r, -3r + 0n - 5 = -5n. Suppose 0 - r = u. Let z = 7 + u. What is the remainder when z is divided by 2? 0 Suppose 816 = -12n + 3516. Calculate the remainder when n is divided by 46. 41 Suppose 2l - 19 = -1. Calculate the remainder when 32 is divided by l. 5 Let m = 1 + 2. Let d(a) = a*3 + 5a*2 - a + 3. Calculate the remainder when d(-5) is divided by m. 2 Suppose -2g + 0g + 27 = z, -g = -3z + 46. Calculate the remainder when z is divided by 6. 5 Suppose -4s + 4n + 72 = 0, -2s = n - 3 - 21. Calculate the remainder when (-2)/7 + 578/14 is divided by s. 13 Let y = 206 - 173. Calculate the remainder when 97 is divided by y. 31 Let b be 0 + (-164 - -2) + -3. Let f = -115 - b. What is the remainder when f is divided by 26? 24 Let q(t) = -3t - 8. What is the remainder when q(-19) is divided by 26? 23 Let n be (3 + 7/(-2))0. Suppose n = 2c + 8, -3c - 30 = -3x - 0x. What is the remainder when 9 is divided by x? 3 Let w = -196 - -282. What is the remainder when w is divided by (220/(-100))/(5/(-50))? 20 Let v(i) = 4i - 6. Let g = -12 + 16. Let m = 58 - 29. Calculate the remainder when m is divided by v(g). 9 Suppose 0y + o + 6 = 2y, -3o + 6 = 0. Suppose -18 = -p + m - 3, -p - ym + 30 = 0. Calculate the remainder when 53 is divided by p. 17 Suppose q + q - 12 = 0. Suppose 32 = 3o - 5h - 28, -o - 3h + 6 = 0. Calculate the remainder when o is divided by q. 3 Let m(c) = -7c - 6. What is the remainder when 86 is divided by m(-4)? 20 Let n = 25 - -7. Calculate the remainder when n is divided by 17. 15 Let f(i) = -7i3 - 1. What is the remainder when 52 is divided by f(-1)? 4 Let t = 0 - 0. Suppose -30 = -3v + 3n, v - 14 = -3n - tn. Calculate the remainder when 32 is divided by v. 10 Let b(p) = 3p*2 - 2p + 1. Let t be b(-3). Suppose 0 = -5i - 5h - 70, -i = i + 4h + t. Let q = 24 + i. Calculate the remainder when 24 is divided by q. 11 Suppose -4d + 0d - 24 = 0. Let k(f) = -f3 - 7f*2 - 6f + 7. Let p be k(d). Let z = p + 7. Calculate the remainder when 26 is divided by z. 12 Let u(r) = -r. Let k(j) = -3j + 2. Let o(p) = k(p) - 4u(p). Suppose 3v = -t + 12 + 2, -4t + 17 = -v. What is the remainder when t is divided by o(0)? 1 Suppose 0 = 2v + 6. What is the remainder when 21 is divided by (12/(-10))/v20? 5 Suppose 0 = 6i - i - 370. Let o be 35/10 + (-2)/4. Suppose -ot - i = -5t. What is the remainder when t is divided by 13? 11 Suppose -5t - q + 113 = 0, t + 2q = 5t - 96. What is the remainder when 67 is divided by t? 21 Let c = -7 - -12. Suppose 2o = cb + 18, 2o - 4o + 24 = -2b. What is the remainder when 54 is divided by o? 12 Suppose f + 3f - 68 = 0. Suppose 7w = 5w + 12. What is the remainder when f is divided by w? 5 Suppose -4p + 38 = 2g, 0p - 5p = 4g - 91. Calculate the remainder when g is divided by 8. 5 Let a = 40 + -31. Let y(d) = d2 - 3d + 5. Calculate the remainder when y(5) is divided by a. 6 Let n be (16/20)/(1/35). What is the remainder when (3 - 4) + n/2 is divided by 7? 6 Suppose -o + 4 = -2c - 1, -2o + 5c = -10. What is the remainder when 14 is divided by o? 4 Let o(g) = 16g - 8. What is the remainder when o(6) is divided by 18? 16 Suppose 80 = -4j + 376. What is the remainder when j is divided by (75/(-12))/((-2)/8)? 24 Let j(q) = -q + 2. Let v be j(6). Let z be v/(-1 - 0) + -1. Suppose 4a = 4, -50 = u - zu - 4a. Calculate the remainder when u is divided by 8. 7 Let h = -56 + 52. Let z(k) = -k + 1. Let p(t) = 6t - 4. Let r(c) = -2p(c) - 6z(c). What is the remainder when 76 is divided by r(h)? 24 Let z(u) be the second derivative of 7u*3/6 - 7u*2/2 - 2u. Let y be z(5). Calculate the remainder when 42/(-4)y/(-6) is divided by 17. 15 Let h = -17 + 35. Let y = -68 + 121. Calculate the remainder when y is divided by h. 17 Let m = 16 + 72. Suppose 0 = -5r + 2r - 4s + 67, m = 4r + 5s. What is the remainder when 65 is divided by r? 14 Suppose -3b = 3w - 300, 0 = w + b - 5b - 125. Calculate the remainder when w is divided by 36. 33 Let x(i) = i2 - 5i + 3. What is the remainder when x(6) is divided by 3? 0 Suppose 0 = -3v - 9, -v + 4 = -2b + v. Let f(g) = -10g - 6. Let p(k) = -k2 + k + 15. What is the remainder when f(b) is divided by p(0)? 14 Suppose 0 = -3b, 0 = 5u + 10b - 7b - 15. What is the remainder when 4 is divided by u? 1 Let h(b) = b - 8. Let s be h(13). Suppose so - 41 - 19 = 0. Let d = 113 + -78. What is the remainder when d is divided by o? 11 Let h be 6/(-9) - (-2)/(-6). Suppose 5k + 0w + 4w = 62, 0 = -3w + 9. What is the remainder when (1/1 - h) + 17 is divided by k? 9 Let h(n) = n + 8. What is the remainder when 66 is divided by h(15)? 20 Let j(u) = u*3 - 6u*2 + 5u - 6. Let p be j(5). Let g(d) = -d*2 - 6d + 6. What is the remainder when g(p) is divided by 3? 0 Let n(j) be the third derivative of -j6/120 - j5/15 + 5j4/24 + 5j*3/6 - 5j*2. What is the remainder when n(-6) is divided by 16? 15 Suppose -4c + 139 = 3h, 3h + 27 = 2c - 20. Calculate the remainder when c is divided by 17. 14 Suppose 0a - 5a + 115 = 0. What is the remainder when 44 is divided by a? 21 Suppose 3 = 3m - 3b, 4b = 2m + 3b - 4. Calculate the remainder when 55 is divided by (2/m)/((-10)/(-285)). 17 Let l be (-18)/(3 - (-9)/(-2)). Let b = 32 - l. Suppose -152 = -6p + 2p. What is the remainder when p is divided by b? 18 Let u(v) = -v*2 - 14v - 10. What is the remainder when u(-9) is divided by 12? 11 Let t = -8 - -11. Suppose -2 = -5x + td + 2, 0 = -d + 2. Suppose -p + 27 = -x. Calculate the remainder when p is divided by 15. 14 Let m(q) = 11q2 + 3q + 4. What is the remainder when m(-3) is divided by 24? 22 Let a = 53 - 10. Calculate the remainder when a is divided by 13. 4 Let q be ((-24)/(-16))/((-2)/16). Let n = -6 - q. Calculate the remainder when 1 is divided by n/10 - (-2)/5. 0 Suppose -21 = -5x + 14. Suppose c - 3z + 6 = -1, -3c + 3 = -z. Suppose 0 = ca + 5l - 20, a - 5l + x = 2. What is the remainder when a is divided by 3? 2 Suppose r - 2p - 40 = -7p, 39 = r + 4p. What is the remainder when r is divided by 13? 9 What is the remainder when 55 is divided by (24/2 - -2)(-4 - -5)? 13 Let r(n) = 2n2 + 8n + 8. Let y(f) = f*2 + f + 22. What is the remainder when y(0) is divided by r(-4)? 6 Suppose -16 = x - 50. Let m = x - 14. Calculate the remainder when 59 is divided by m. 19 Suppose 3j + 3j - 78 = 0. What is the remainder when 37 is divided by j? 11 Suppose 0j + 5j - 20 = 0. Suppose b + 33 = 5q, 0 = -3q - 4b - 0b + 6. Calculate the remainder when q is divided by j. 2 Let m = 24 - -11. Calculate the remainder when m is divided by 18. 17 Suppose -n + 10 = -0n. Suppose n = -4j - 2. Calculate the remainder when 14 is divided by (j/2)/((-9)/48). 6 What is the remainder when 124 is divided by (11 - 9)(16 - 0)? 28 Suppose 2 = -5i + 27. What is the remainder when 11 is divided by i? 1 Suppose 36 + 4 = -5y. Let z = 17 + y. Calculate the remainder when 25 is divided by z. 7 Let m be (8/(-12))/(2/(-15)). Suppose -2g - 2q - 160 = -7g, -mg - 5q + 195 = 0. Calculate the remainder when g is divided by 7. 6 Let f(j) = j2 - 9j + 6. What is the remainder when 44 is divided by f(10)? 12 Let n(i) = -i*2 - 8i - 6. Let f be n(-5). Let l(h) = -h*2 + 12h - 8. Calculate the remainder when l(f) is divided by 7. 5 Let y(z) = -z. Let l be y(-5). Suppose 0t + 45 = lt. Calculate the remainder when t is divided by 4. 1 Suppose 0 = -g - 2g. Suppose g = -4f - 4n + 76, 5f + n - 104 = -29	{ "pile_set_name": "DM Mathematics" }
1111102? 1132223 In base 16, what is -5 + a1d2? a1cd In base 10, what is -26 + 96423? 96397 In base 6, what is -32330 - 14? -32344 In base 14, what is -877d - 57? -87d6 In base 12, what is -52 + 2521? 248b In base 14, what is -a13 + -240? -c53 In base 11, what is -48 - -29a? 252 In base 2, what is -110001110000 + 1101? -110001100011 In base 3, what is -12 + 122111111200? 122111111111 In base 16, what is -6a - 1f7? -261 In base 9, what is -816 - -48? -757 In base 10, what is 39 - 3937? -3898 In base 5, what is -311 - 122144? -123010 In base 10, what is -8937 - 13? -8950 In base 2, what is -10010001010001001010 - 11? -10010001010001001101 In base 9, what is 5 + 2206? 2212 In base 3, what is 2011002 + 22? 2011101 In base 3, what is 100 + -1121111000? -1121110200 In base 16, what is 0 + 4030? 4030 In base 7, what is 6513 - 3235? 3245 In base 15, what is 6dd7a - 4? 6dd76 In base 15, what is -62a74 + 1? -62a73 In base 10, what is 60586 + 0? 60586 In base 4, what is -2 - -13311? 13303 In base 9, what is -1 + -455820? -455821 In base 3, what is 210200112102 + 11? 210200112120 In base 10, what is -1509565 + -2? -1509567 In base 13, what is -998b + -3? -9991 In base 15, what is -5 + -7ce35? -7ce3a In base 12, what is 815 - -103? 918 In base 4, what is -2 - 101213332? -101220000 In base 3, what is -220001011001 + -10? -220001011011 In base 3, what is -1 - 10102222120? -10102222121 In base 11, what is -4120663 + 4? -412065a In base 6, what is 1 + -231410? -231405 In base 4, what is -11 + -3331011113? -3331011130 In base 15, what is 3 - -d6475? d6478 In base 12, what is 211979 - 3? 211976 In base 15, what is -81e0 + -1? -81e1 In base 9, what is 12353 - -24? 12377 In base 14, what is 3 + 2276? 2279 In base 12, what is 2a617b + 0? 2a617b In base 13, what is -6b + 297? 229 In base 8, what is 50242 - -20? 50262 In base 5, what is -11444 - -12143? 144 In base 11, what is 2534 + 2? 2536 In base 14, what is 1 + -3928? -3927 In base 4, what is -123110133 + 130? -123110003 In base 7, what is 32526364 + -2? 32526362 In base 2, what is 11 - -10100011110101? 10100011111000 In base 4, what is 122 - 21122? -21000 In base 15, what is -1527 + 4? -1523 In base 6, what is -14320 + -23? -14343 In base 15, what is 1 + -1ee9e8? -1ee9e7 In base 7, what is 366 + -211? 155 In base 9, what is 11 - 6534? -6523 In base 12, what is 5 - 8849? -8844 In base 7, what is 21 + -524251? -524230 In base 5, what is -21013 + 3441? -12022 In base 3, what is 11 - 21212100212? -21212100201 In base 9, what is -44560 + -14? -44574 In base 2, what is -10111001000011100 - -100? -10111001000011000 In base 12, what is -85 + 6759? 6694 In base 5, what is -341334 + 113? -341221 In base 5, what is -22110 + -3242? -30402 In base 7, what is 1 + -102342? -102341 In base 14, what is -3a3 + 1bba? 1817 In base 7, what is 3 - -40644? 40650 In base 11, what is 53 - 272? -21a In base 16, what is -3a - -6a1? 667 In base 8, what is 63671 + 21? 63712 In base 13, what is 126c9 - -9? 12705 In base 12, what is -42 - 244? -286 In base 15, what is -1a4 + -537? -6db In base 8, what is 5 - -2340? 2345 In base 16, what is -3 + -260c3? -260c6 In base 2, what is -101110001001111000010 - 0? -101110001001111000010 In base 12, what is -6757 - 546? -70a1 In base 10, what is 63953 - 5? 63948 In base 10, what is -2674 - -44? -2630 In base 5, what is 4 + -2111010? -2111001 In base 9, what is 1280 - -37? 1327 In base 5, what is -232 - 12221? -13003 In base 3, what is -1022001002 - -2? -1022001000 In base 7, what is 15 + -15261? -15243 In base 14, what is c2b1 + 3? c2b4 In base 14, what is 1275 - 1b6? 109d In base 8, what is 12731 + 6? 12737 In base 11, what is -2604 + -7? -2610 In base 4, what is 0 - -230332321? 230332321 In base 9, what is -463 + -306? -770 In base 9, what is 1000 - -155? 1155 In base 5, what is 1411113 - -14? 1411132 In base 15, what is -b56d + 2d? -b540 In base 4, what is 120332132 - -3? 120332201 In base 2, what is -1010001 + -100111110? -110001111 In base 5, what is -3 + 10001130? 10001122 In base 3, what is 2 - -10220121222? 10220122001 In base 5, what is 2122 - 1111? 1011 In base 11, what is -57109 - 3? -57111 In base 12, what is -283222 + -4? -283226 In base 4, what is 3313 - -11? 3330 In base 9, what is 4 + -173770? -173765 In base 7, what is 20135 + 1? 20136 In base 5, what is 331142 - -2? 331144 In base 9, what is -1420 - 11? -1431 In base 8, what is 760 - 17? 741 In base 13, what is 6 + 4322b? 43234 In base 2, what is -1001010 - -1001110110000? 1001101100110 In base 8, what is -10 + 40731? 40721 In base 6, what is -505 + -54152? -55101 In base 14, what is -11079 + 5? -11074 In base 5, what is -1140 - 11344? -13034 In base 8, what is -676361 + -5? -676366 In base 10, what is 36 - -4606? 4642 In base 6, what is 4 + 12531232? 12531240 In base 12, what is -173467 + 4? -173463 In base 3, what is -12 + -10002011001? -10002011020 In base 3, what is 101202201 + -21? 101202110 In base 3, what is 111222 + 1020222? 1202221 In base 14, what is -32 - -3703? 36b1 In base 8, what is 6335 + 13? 6350 In base 16, what is -4 + 710b2? 710ae In base 15, what is 400047 - 1? 400046 In base 9, what is 74 - 2831? -2746 In base 14, what is 23 - 4a62? -4a3d In base 4, what is 200011111 + 10? 200011121 In base 14, what is -4 - -12a7? 12a3 In base 12, what is 2346b + 3? 23472 In base 9, what is -5137 - -20? -5117 In base 3, what is -12120201200220 + 1? -12120201200212 In base 6, what is -15 + 133? 114 In base 6, what is -1 + -2352322? -2352323 In base 3, what is -11212100102 + 1? -11212100101 In base 6, what is 111 - -100415? 100530 In base 11, what is -768 - 90? -848 In base 9, what is 85 + 1888? 2084 In base 15, what is -26d48 + 4? -26d44 In base 15, what is a - -3448? 3453 In base 14, what is -1d1 - -b1? -120 In base 16, what is -1da79 + 5? -1da74 In base 16, what is 1 + -1e1? -1e0 In base 6, what is -2342050 + 3? -2342043 In base 9, what is -13 + -3454? -3467 In base 14, what is -489 - 2cc? -777 In base 13, what is 3207 - 8? 31cc In base 7, what is -1042 - 1004? -2046 In base 2, what is -11 + 1011101001100011100? 1011101001100011001 In base 15, what is -2e + 88e? 860 In base 9, what is 1 + -314844? -314843 In base 3, what is -10022222201 - 0? -10022222201 In base 12, what is -431 - -1? -430 In base 9, what is -28868 - -11? -28857 In base 10, what is 257080 - -5? 257085 In base 3, what is -2 + 10002011? 10002002 In base 2, what is -10111101101110010101011 + -100? -10111101101110010101111 In base 5, what is -1 - 103101? -103102 In base 5, what is -2032 + -344? -2431 In base 13, what is 3 + -3bb0c? -3bb09 In base 3, what is -12201222020 + -2? -12201222022 In base 12, what is -2 + -10522? -10524 In base 11, what is 32249 + -3? 32246 In base 3, what is -12 - -210100200? 210100111 In base 16, what is -4 - -5728? 5724 In base 14, what is -543 - d8? -63b In base 16, what is 3e - 1e? 20 In base 2, what is 1101111111111011100 - 1? 1101111111111011011 In base 9, what is 831323 - 3? 831320 In base 2, what is 10010101111111 - 11011? 10010101100100 In base 10, what is -7 + -5392? -5399 In base 6, what is -4 + -10055? -10103 In base 5, what is -111142 + 2023? -104114 In base 8, what is -41 + 13375? 13334 In base 14, what is 71 + -948? -8b7 In base 2, what is -100 + -100000010101? -100000011001 In base 8, what is 553 - 10207? -7434 In base 5, what is 440034 + -3? 440031 In base 2, what is -111010 - 10100100010? -10101011100 In base 7, what is -51000 - 3? -51003 In base 4, what is -10022030 + 10? -10022020 In base 6, what is -2530345 + -5? -2530354 In base 3, what is 2110122212221 + 1? 2110122212222 In base 13, what is b1 - -10a? 1bb In base 12, what is -5940b - -3? -59408 In base 9, what is -335 - 3380? -3725 In base 6, what is 12314 - 10? 12304 In base 14, what is 15 - -12cc? 1303 In base 4, what is 10323110 - 11? 10323033 In base 12, what is -21297 + 3? -21294 In base 12, what is -2 + -174140? -174142 In base 12, what is 72595 - 15? 72580 In base 2, what is 100000 + 100110101001? 100111001001 In base 10, what is -5 + -74822? -74827 In base 8, what is -61405 + -202? -61607 In base 3, what is 102120120001 + -11? 102120112220 In base 12, what is -ab10 + b? -ab01 In base 8, what is 123175 + 1? 123176 In base 6, what is -4 + 303253? 303245 In	{ "pile_set_name": "DM Mathematics" }
utes before 9:45 PM? 1:55 PM What is 428 minutes before 7:45 PM? 12:37 PM How many minutes are there between 6:21 AM and 5:36 PM? 675 What is 669 minutes before 1:27 PM? 2:18 AM How many minutes are there between 7:17 AM and 6:49 PM? 692 What is 505 minutes before 4:23 PM? 7:58 AM How many minutes are there between 6:24 PM and 7:13 PM? 49 What is 706 minutes before 2:11 PM? 2:25 AM How many minutes are there between 5:17 AM and 7:07 AM? 110 How many minutes are there between 9:38 AM and 5:43 PM? 485 What is 250 minutes after 5:01 PM? 9:11 PM What is 54 minutes before 11:57 AM? 11:03 AM What is 186 minutes before 12:59 PM? 9:53 AM How many minutes are there between 6:49 PM and 7:33 PM? 44 What is 51 minutes after 5:54 PM? 6:45 PM What is 166 minutes before 3:57 AM? 1:11 AM How many minutes are there between 12:51 PM and 1:51 PM? 60 How many minutes are there between 2:20 PM and 10:25 PM? 485 What is 610 minutes before 4:38 AM? 6:28 PM How many minutes are there between 11:28 PM and 12:50 AM? 82 How many minutes are there between 1:21 AM and 10:34 AM? 553 What is 414 minutes before 4:14 AM? 9:20 PM What is 587 minutes before 6:10 AM? 8:23 PM What is 253 minutes after 9:39 PM? 1:52 AM How many minutes are there between 3:21 AM and 1:07 PM? 586 What is 532 minutes before 12:16 PM? 3:24 AM What is 672 minutes after 7:14 AM? 6:26 PM How many minutes are there between 4:36 AM and 7:50 AM? 194 How many minutes are there between 1:34 AM and 2:37 AM? 63 What is 688 minutes after 4:32 PM? 4:00 AM How many minutes are there between 4:53 AM and 6:56 AM? 123 How many minutes are there between 12:50 AM and 11:42 AM? 652 How many minutes are there between 12:18 AM and 1:48 AM? 90 What is 52 minutes after 6:33 AM? 7:25 AM How many minutes are there between 1:07 AM and 2:03 AM? 56 How many minutes are there between 4:17 PM and 2:26 AM? 609 What is 60 minutes before 6:26 PM? 5:26 PM How many minutes are there between 2:37 AM and 7:39 AM? 302 How many minutes are there between 8:05 AM and 10:37 AM? 152 What is 459 minutes before 5:22 PM? 9:43 AM What is 145 minutes before 6:53 AM? 4:28 AM What is 530 minutes before 3:28 AM? 6:38 PM What is 176 minutes after 4:22 AM? 7:18 AM What is 704 minutes after 11:09 PM? 10:53 AM What is 547 minutes after 8:29 PM? 5:36 AM How many minutes are there between 8:57 PM and 1:11 AM? 254 How many minutes are there between 5:02 PM and 7:34 PM? 152 What is 420 minutes after 1:15 PM? 8:15 PM How many minutes are there between 12:50 PM and 8:24 PM? 454 What is 137 minutes after 2:13 PM? 4:30 PM What is 454 minutes before 2:30 PM? 6:56 AM What is 404 minutes before 4:48 PM? 10:04 AM What is 466 minutes after 8:12 PM? 3:58 AM What is 693 minutes after 6:22 PM? 5:55 AM What is 617 minutes after 11:55 AM? 10:12 PM What is 557 minutes before 10:40 AM? 1:23 AM What is 59 minutes after 1:22 PM? 2:21 PM How many minutes are there between 1:28 AM and 4:33 AM? 185 What is 62 minutes after 2:36 AM? 3:38 AM What is 405 minutes after 8:27 PM? 3:12 AM What is 543 minutes before 7:27 PM? 10:24 AM What is 706 minutes before 8:14 AM? 8:28 PM How many minutes are there between 5:05 AM and 6:48 AM? 103 What is 88 minutes before 2:42 PM? 1:14 PM How many minutes are there between 1:54 AM and 7:25 AM? 331 How many minutes are there between 5:16 PM and 6:33 PM? 77 How many minutes are there between 12:57 AM and 8:33 AM? 456 What is 430 minutes after 9:52 PM? 5:02 AM What is 62 minutes before 7:05 PM? 6:03 PM How many minutes are there between 5:01 PM and 4:41 AM? 700 How many minutes are there between 5:41 PM and 9:05 PM? 204 How many minutes are there between 5:11 PM and 9:09 PM? 238 What is 591 minutes after 2:37 AM? 12:28 PM How many minutes are there between 8:32 PM and 10:57 PM? 145 What is 520 minutes before 12:49 PM? 4:09 AM What is 558 minutes before 10:29 PM? 1:11 PM How many minutes are there between 2:40 AM and 6:46 AM? 246 What is 355 minutes after 5:56 AM? 11:51 AM What is 120 minutes before 1:41 PM? 11:41 AM How many minutes are there between 9:52 AM and 8:56 PM? 664 What is 710 minutes before 11:50 PM? 12:00 PM How many minutes are there between 5:14 PM and 10:17 PM? 303 What is 634 minutes before 1:05 AM? 2:31 PM What is 76 minutes after 11:06 AM? 12:22 PM How many minutes are there between 7:02 PM and 12:12 AM? 310 How many minutes are there between 7:52 PM and 8:25 PM? 33 How many minutes are there between 7:52 AM and 2:30 PM? 398 How many minutes are there between 10:49 PM and 10:26 AM? 697 What is 705 minutes after 1:05 PM? 12:50 AM How many minutes are there between 9:51 AM and 10:54 AM? 63 What is 681 minutes before 3:29 PM? 4:08 AM How many minutes are there between 1:29 AM and 4:07 AM? 158 What is 186 minutes before 3:35 AM? 12:29 AM What is 558 minutes after 8:44 AM? 6:02 PM What is 644 minutes after 12:11 AM? 10:55 AM What is 677 minutes after 7:01 PM? 6:18 AM What is 60 minutes before 1:55 PM? 12:55 PM What is 145 minutes after 12:41 PM? 3:06 PM What is 719 minutes before 8:00 AM? 8:01 PM How many minutes are there between 7:05 PM and 10:19 PM? 194 What is 690 minutes after 4:07 AM? 3:37 PM How many minutes are there between 8:37 PM and 10:27 PM? 110 What is 355 minutes after 10:39 AM? 4:34 PM How many minutes are there between 6:35 AM and 1:59 PM? 444 How many minutes are there between 11:19 AM and 4:44 PM? 325 What is 688 minutes before 10:49 PM? 11:21 AM What is 236 minutes after 9:43 AM? 1:39 PM What is 620 minutes before 4:17 AM? 5:57 PM How many minutes are there between 10:03 AM and 3:06 PM? 303 What is 2 minutes before 1:51 PM? 1:49 PM What is 345 minutes before 8:18 AM? 2:33 AM How many minutes are there between 7:34 PM and 12:23 AM? 289 How many minutes are there between 5:42 PM and 3:06 AM? 564 How many minutes are there between 10:04 AM and 10:23 AM? 19 What is 676 minutes after 8:55 AM? 8:11 PM What is 468 minutes before 1:29 PM? 5:41 AM How many minutes are there between 8:28 AM and 6:06 PM? 578 What is 254 minutes after 11:21 PM? 3:35 AM What is 539 minutes after 6:41 AM? 3:40 PM How many minutes are there between 3:52 AM and 9:14 AM? 322 How many minutes are there between 7:47 AM and 5:17 PM? 570 What is 354 minutes after 6:00 AM? 11:54 AM How many minutes are there between 5:41 AM and 12:53 PM? 432 How many minutes are there between 10:21 PM and 7:45 AM? 564 How many minutes are there between 5:43 PM and 8:21 PM? 158 What is 283 minutes after 9:36 PM? 2:19 AM How many minutes are there between 7:43 PM and 12:07 AM? 264 What is 244 minutes before 1:22 PM? 9:18 AM What is 33 minutes before 11:55 PM? 11:22 PM What is 303 minutes before 4:39 AM? 11:36 PM What is 485 minutes before 6:46 AM? 10:41 PM How many minutes are there between 1:24 AM and 4:29 AM? 185 How many minutes are there between 9:01 AM and 10:10 AM? 69 How many minutes are there between 12:18 PM and 9:17 PM? 539 How many minutes are there between 10:39 AM and 11:42 AM? 63 How many minutes are there between 12:49 PM and 2:50 PM? 121 How many minutes are there between 7:23 PM and 5:39 AM? 616 What is 110 minutes before 6:37 PM? 4:47 PM What is 524 minutes after 8:48 PM? 5:32 AM What is 145 minutes before 12:54 PM? 10:29 AM How many minutes are there between 4:19 AM and 7:33 AM? 194 What is 535 minutes after 4:54 PM? 1:49 AM How many minutes are there between 10:01 AM and 6:51 PM? 530 How many minutes are there between 8:57 AM and 2:38 PM? 341 What is 719 minutes before 8:28 PM? 8:29 AM How many minutes are there between 6:13 PM and 2:06 AM? 473 What is 502 minutes after 9:07 PM? 5:29 AM How many minutes are there between 2:23 PM and 7:09 PM? 286 What is 293 minutes before 7:49 PM? 2:56 PM How many minutes are there between 7:52 PM and 12:44 AM? 292 What is 154 minutes before 1:01 AM? 10:27 PM What is 488 minutes before 6:57 AM? 10:49 PM What is 303 minutes before 2:08 PM? 9:05 AM What is 468 minutes before 3:30 PM? 7:42 AM What is 300 minutes after 6:03 AM? 11:03 AM How many minutes are there between 3:11 PM and 9:06 PM? 355 What is 292 minutes before 1:28 AM? 8:36 PM How many minutes are there between 5:53 AM and 10:08 AM? 255 What is 104 minutes before 10:43 AM? 8:59 AM How many minutes are there between 2:00 PM and 6:11 PM? 251 How many minutes are	{ "pile_set_name": "DM Mathematics" }
(14/5))(-6) assuming k is positive. k(-84) Simplify (ggg(-17))/(g(1/3)/g) assuming g is positive. g(-43/3) Simplify (s(-1/3))38/(s(2/3)/s(-7)) assuming s is positive. s(-61/3) Simplify ((d/(dd5))(-10/9))23 assuming d is positive. d(1150/9) Simplify ((t*1t)(-3/10))(11/3) assuming t is positive. t*(-11/5) Simplify v/(v/(v/(vv*(4/23)))v)(v/v(6/7)v)/vv assuming v is positive. v(-5/161) Simplify y/(y/y(-3/2))yy(-2/3)/y assuming y is positive. y(-13/6) Simplify w(12/13)/(ww/w11) assuming w is positive. w(129/13) Simplify (q*(-2/11)/((q/(q/(qq*1q)))/q))/((q/q*5)/qqq(2/5)) assuming q is positive. q(78/55) Simplify (ii/(i7/i))30 assuming i is positive. i(-120) Simplify ((p(-1)p)/((ppppp(-1/5)pp)/p))/(p(1/2)p/((((p/(p/(((((pp/p(-2))/pp)/pp)/ppp)/p)))/p)/p)/p)) assuming p is positive. p(-53/10) Simplify (u(2/9)uu(-6))(-31) assuming u is positive. u(1333/9) Simplify n(-7)/(n/((nn*(-3/2)nn)/n)n)(n0/n)28 assuming n is positive. n(-73/2) Simplify m(-3)mm/m7m*(6/5)m(mm*(-1/3)m)/m assuming m is positive. m(-77/15) Simplify (s(-3)s(-1/2))/(s/((ss(s/(ss/s*(-2)ss))/ssss)/s))6 assuming s is positive. s(-43/2) Simplify (q/((qq(4/3))/q))(-30) assuming q is positive. q10 Simplify i(-2/5)ii/i(-1)ii(-2/19)i(-3) assuming i is positive. i(47/95) Simplify ((l*(-1/4)/l)/l(l(-5)/l)/l)(-5/6) assuming l is positive. l*(185/24) Simplify pp*(-2/9)p(-11) assuming p is positive. p(-92/9) Simplify (rr/(r(-4/5)/rr))(-15/7) assuming r is positive. r(-6) Simplify (rrr*14rr((r/((r(r/r(3/5))/r)/r))/r)/r)16 assuming r is positive. r(1408/5) Simplify ((s/((s/s(-1))/s)s)/ss)/(s(-3/4)s)(s5/s)/s(-6) assuming s is positive. s(43/4) Simplify (bb*8b)/(bb/b(-3/4)) assuming b is positive. b(29/4) Simplify (zz*(-3/4)z)/((z*13z)/zz) assuming z is positive. z(-51/4) Simplify ss*(2/75)s(s/(s/((s/s(-4/7))/s)))/s assuming s is positive. s(839/525) Simplify (k/(k/k(-2/25)))35 assuming k is positive. k(-14/5) Simplify (o(-1/3))14 assuming o is positive. o(-14/3) Simplify ((r(-6)/r)/(r(r/((r/r(2/11))/r))/r))/(r(1/3)/rr)(-20/11) assuming r is positive. r(-250/33) Simplify (d/d(-1/5)dd(-1))/(dd(-2/7))(-26/7) assuming d is positive. d(944/245) Simplify w(-10/9)/((w*(-6)www)/w) assuming w is positive. w(26/9) Simplify (d(3/2)/(d*(-3)dd))/(d0/(d(-6)d)) assuming d is positive. d(-5/2) Simplify (x(2/19)/(x/((x(x/(xx8))/x)/x)))/(x0/x)(-26) assuming x is positive. x(-682/19) Simplify (i*(3/8)i(ii*(-6))/i)/(ii/i(-2/7))45 assuming i is positive. i*(-6019/56) Simplify ((d/(dd(2/3)))/d)26/(ddd*(-2/13)d*0d) assuming d is positive. d(-1801/39) Simplify (y/(y/(y1/y)))*9(y/(y/(y(-2)/y)))(-3/7) assuming y is positive. y(9/7) Simplify (k1k)(-39)/(k/(k(k/((k*0/kk)/k))/k))13 assuming k is positive. k(-65) Simplify (z/(z/z(1/4)))(-6/13)/((z(-1/5)/z)/((z(1/4)/zz)/z)) assuming z is positive. z(87/260) Simplify ((k5k)/k)/(kk2)((((k/k(-1/2))/k)/k)/k)(6/13) assuming k is positive. k*(17/13) Simplify ((a(a*2a)/a)/a)/((aa/a3)/a)(a/(aa/a(4/7)aa))/((a(-7)/a)/aa) assuming a is positive. a*(67/7) Simplify nn*(4/13)nn(12/7) assuming n is positive. n(366/91) Simplify (aa/(a/((a/a*(-1))/a))a)(2/11)/(a1(a(-2/5)/a)/a) assuming a is positive. a(107/55) Simplify (w/(w(-3)/w)w)/w*(-2/7)w*6ww(-3) assuming w is positive. w(72/7) Simplify (n/(n/(n/(nn/(n/(n*(6/11)/nn))))))/((nn(-9)n)/n) assuming n is positive. n(82/11) Simplify ((l(-4))(-35))(-12/11) assuming l is positive. l*(-1680/11) Simplify (xx/(x/(xx/x(-1/20)x))x)/(x/x(-31)) assuming x is positive. x(-539/20) Simplify qqq/q(-28)qq(-1/8) assuming q is positive. q(255/8) Simplify m(m*(-1/11)/m)/mm*(-2/5)(m/(mm0m))15 assuming m is positive. m(-907/55) Simplify (ff(-2/5))3/((ffff*1)/(f(f*(1/2)f)/ff)) assuming f is positive. f(3/10) Simplify f(-4/3)/ff/(ff(2/9))(f/((fff*6/fff)/f))/f5 assuming f is positive. f(-131/9) Simplify ((kk*(-2)k)/k)/k(2/13) assuming k is positive. k(-15/13) Simplify (i(1/13))(-3/7) assuming i is positive. i(-3/91) Simplify o(2/3)o(-3)o*(6/5)o(-2/7) assuming o is positive. o(-149/105) Simplify o*(-24)/(oo(-1)) assuming o is positive. o(-24) Simplify (f(2/9)/f(-2))(5/4) assuming f is positive. f(25/9) Simplify o*(-21)oo/(oo*(18/7)o) assuming o is positive. o(-165/7) Simplify (h/h14)/(((h/h(1/17))/h)/h) assuming h is positive. h(-203/17) Simplify ((w(-2/23))13)41 assuming w is positive. w(-1066/23) Simplify (ii(1/10)iii(2/7))(-44) assuming i is positive. i(-5214/35) Simplify ((j/(j1jjj))/j)(-3/8) assuming j is positive. j(3/2) Simplify (g(-1)/(g(-2/3)g))/(g(-1/4))21 assuming g is positive. g(47/12) Simplify (x1/x)/x(2/7) assuming x is positive. x(-2/7) Simplify ((z*(-7)z)/(z/(z*(-6)z)))49 assuming z is positive. z(-588) Simplify ((r*(2/7)r)(10/7))(-33) assuming r is positive. r(-2970/49) Simplify o(3/7)/(ooo*(-3/10)o)(oooo((o/(o(2/7)o))/o)/ooo)(-1/31) assuming o is positive. o(-5189/2170) Simplify (q*(-2/7)/qq*(2/7))/((qq*(-4)q)/(q*(1/2)qqq)) assuming q is positive. q(9/2) Simplify q(-1/12)/(q(q(-18)/q)/qq) assuming q is positive. q(215/12) Simplify (o/(o/o(-1)oo))(-13/5)/(o(-1))(2/31) assuming o is positive. o(1219/155) Simplify ((c*(6/11)/ccc)/(cccc*(1/3)ccc))/(c/(c*(-2/3)c))(18/5) assuming c is positive. c(-1186/165) Simplify (q/q*(1/12))/(qq(-1/9)) assuming q is positive. q(1/36) Simplify ((h*(-6)/h)/(hh(3/5)))/(h(-2/5))(1/46) assuming h is positive. h(-988/115) Simplify (l(-15))(-2/121) assuming l is positive. l(30/121) Simplify (v(-1/2))*(-11)v*(-1/7)vv/v(-7) assuming v is positive. v(201/14) Simplify (v(-1/3)/v)(-1)/(v4/(v/(vv(vv/(v(1/11)/v))/v))) assuming v is positive. v(-184/33) Simplify (ss(-1/3))(-13/4)/((s(ss6)/s)/s9) assuming s is positive. s(-1/6) Simplify (yy/((y/(y19/y))/y))(2/11) assuming y is positive. y(40/11) Simplify (u(-1)u)(1/28)/(u(-2/13)/((u2u)/u)) assuming u is positive. u*(28/13) Simplify (((y/(yy/(y/(y*(-20)yyy)))y)/yy)/y)/yy(-13/6)y assuming y is positive. y(89/6) Simplify ((d/((d/(d/d(3/8)))/dd))/dd*8d)/(d(-1/2)/d4) assuming d is positive. d(105/8) Simplify (v(4/9))(-17/5) assuming v is positive. v(-68/45) Simplify (z24/z)(6/13) assuming z is positive. z(138/13) Simplify ((n(-11)/nn)/n)(2/53) assuming n is positive. n(-24/53) Simplify j(1/3)j*(-16)j assuming j is positive. j(-44/3) Simplify (p(-8)p)/(p(3/13)p) assuming p is positive. p(-107/13) Simplify z(-5)/(zzz/z*(11/3)z) assuming z is positive. z*(-16/3) Simplify ((x/(x(xx(-1))/xx))/(x*6x))(-37) assuming x is positive. x259 Simplify x(x(-2/5)x)/x(x/(xx(xx/x*(-5/3))/xx)x)/x(x*(-1/2)x)/x(-2/27) assuming x is positive. x(-943/270) Simplify (v(-3)/v)(-47)v(-2)/v1 assuming v is positive. v185 Simplify (g(1/7)ggg*8g)/(g*(5/2)gg(-2/13)g) assuming g is positive. g(1237/182) Simplify (y0)27 assuming y is positive. 1 Simplify ((p/p(1/6))/ppp(-7)/p)(-2/43) assuming p is positive. p(1/3) Simplify n(1/5)/(n/n(-6/13)) assuming n is positive. n(-82/65) Simplify (vv(-3)vv6/v)/(v(2/5))(-15) assuming v is positive. v10 Simplify s/(ss/(s/(ss(2/5)/s)s))s6/s(ss(-2/5))(-9/5) assuming s is positive. s(113/25) Simplify ((f(-2/3)/ff)/f)19 assuming f is positive. f(-95/3) Simplify f*(-8)/(ff/(f*38f)) assuming f is positive. f*29 Simplify (rr(17/3))(-2/5) assuming r is positive. r(-8/3) Simplify z(-2/35)/(z*3/z)(z2)(1/10) assuming z is positive. z(-13/7) Simplify u/u6(uuu(-2/5)u)/u(uu*(2/21)u)/(u*(2/13)u) assuming u is positive. u**(-3	{ "pile_set_name": "DM Mathematics" }
= -0.2 - -1.2. Which is the third smallest value? (a) d (b) 3/7 (c) x a Let o = -1171/91 - -89/7. Which is the second smallest value? (a) -1/4 (b) 1/2 (c) o c Let y = -0.03 + 0.13. Which is the third biggest value? (a) 2/3 (b) -1 (c) y b Let x = -5/34 - -1/34. Which is the fourth biggest value? (a) 4 (b) -4 (c) 0.5 (d) x b Let o = 28 + -169/6. Let a = 11 - 20. Let j = a - -9.2. What is the third biggest value in 1, j, o? o Let k = 0.4 + -0.3. Let n = -56 + 52.9. Let y = n + k. What is the biggest value in -1, y, -2? -1 Let c = -121/4 - -30. What is the second biggest value in -33, -2/3, c? -2/3 Let j = 249/4 + -62. What is the third smallest value in -4, 0.1, j? j Let w be -1 + 4/(-24)-106. Let x = w - 191/12. Let n = 0.03 - -0.27. Which is the second biggest value? (a) 3 (b) n (c) x c Let l = 0.49 - 0.89. Which is the biggest value? (a) -0.08 (b) 0 (c) l (d) -1 b Let w = -1.1 + 1. Let r = -0.3 + w. Let i be (2 - 0)(-1)/3. What is the biggest value in -2, i, r? r Let n = 7.1 + -8. Let u = n - -0.5. Let j = -3 - -8. Which is the third biggest value? (a) j (b) u (c) -1 c Let v = -0.31 - -0.11. What is the second biggest value in 7, v, -5? v Let n = -0.13 - -0.83. Let l = -0.5 + n. Suppose 6 = -5f - 19. Which is the second biggest value? (a) f (b) l (c) 2/15 c Let f = -10.6 + -2.4. Let p = f + 9. What is the second biggest value in 5, -1/9, p? -1/9 Let s = -0.08 + -2.92. Let l = -2.5 - s. What is the third biggest value in l, -0.3, -1? -1 Let w = 5 - 6. Let x = 0.32 - 0.12. Which is the biggest value? (a) w (b) 0.3 (c) x b Let o = 0.2 - 0.7. Let u = -2.3 + 2. Let y = -7 + 8. Which is the smallest value? (a) u (b) o (c) y b Let a = -17 + 24.6. Let x = -8 + a. What is the third biggest value in 2/5, x, 3? x Let t = 14.1 + -14. What is the biggest value in -2/13, t, -5? t Let j = 2.4 - -0.6. Let s = -0.59 - -0.09. What is the second biggest value in j, -1/8, s? -1/8 Let b = -0.2 - -0.3. Let f = -0.5 + b. Let t = -19/2 - -11. What is the second smallest value in -2/9, t, f? -2/9 Let d be 45/(-40)2/6. Let v = 40/3 + -38/3. What is the smallest value in v, d, 1/3? d Suppose 5p - 5 = -5c, -4p + 0p + 5c = -22. Let y = -0.15 + -11.85. Let o = y + 8. What is the biggest value in 6, p, o? 6 Let b = -3.8 - -1.8. What is the biggest value in -0.5, b, -1/6, -2/3? -1/6 Let t be (-1)/3 + (-2)/(-42). Let d = -1.9 + -7.1. Let x = d + 5. Which is the third biggest value? (a) t (b) 4 (c) x c Suppose -2g = 3g. Let s = -53/231 - -1/21. Which is the second biggest value? (a) g (b) 0.1 (c) s a Let z = 1.6 - 8.6. Let l = -8 - z. What is the third biggest value in 0.5, l, -5? -5 Let p = -0.5 - 0.5. Let d = p + 5. Which is the third smallest value? (a) -3 (b) d (c) 1 b Let o = -3.8 - -0.8. Which is the second biggest value? (a) 0.5 (b) o (c) 4 a Let n = 0.03 - 0.33. Let h be (-9)/3 + (-2 - -1). What is the third smallest value in n, h, -0.2? -0.2 Let l = 0.2 + 0.8. Let j be 4 + -4(-2)/4. Suppose -j = c - 3w + 7w, -c = -3w - 8. What is the third biggest value in l, c, -1/2? -1/2 Let w = 1.1 - -0.5. Which is the biggest value? (a) -0.5 (b) 0.2 (c) w c Let o = 937 + -2815/3. Let c be (1 - -2) + (-1 - -2). What is the third smallest value in -1/7, c, o? c Let x(m) = m + 1. Let u be x(0). Let t = -5 + 3. Let p = 2 + -1.6. Which is the second biggest value? (a) t (b) u (c) p c Let r = -0.03 - 4.97. What is the biggest value in -1/10, 3, r? 3 Let s = -0.61 - -1.61. What is the third smallest value in -18, s, 4? 4 Let r = -6.97 - -7. Let u = 0.27 + r. Suppose 4a - 5w + 22 = 0, -w + 5w - 8 = 0. What is the biggest value in u, a, 0? u Let y(c) = c*3 - 4c*2 - 6c + 1. Let m be y(5). Let p = -58/7 - -60/7. What is the biggest value in m, -3, p? p Suppose 3z - 6 - 3 = 0. Suppose c = -zc - 4. Let d be 4/(-6) - 10/(-6). What is the smallest value in c, d, -2/5? c Let f = 0.18 - 3.18. What is the smallest value in f, 1, 0.3? f Let h = 2.349 - 0.049. Let k = h - 0.3. Which is the third smallest value? (a) -3/2 (b) 3/4 (c) k c Let x = 16 - 12. Suppose -1 = t + 2r + 7, -r = t + x. Which is the third biggest value? (a) -0.4 (b) -1/6 (c) t a Let c be (-2)/(-6)(-6 + (-18)/(-6)). Let n = 0.08 + -0.38. Let o = 0.1 - 0.5. What is the second smallest value in c, n, o? o Suppose 0 = -3j - 9, -2j = -3b - 2b - 114. Let h = b - -22. What is the smallest value in 1/2, 0.2, h? h Let z be -4 - (4 - 260/32). What is the third smallest value in 5, -5, z? 5 Let m = -15.5 - -16. Suppose 2i = -4x + 10, -4x + 8 = 4i - 8. Let y be ((-3)/(i/10))/(-2). Which is the smallest value? (a) -1/4 (b) y (c) m a Let x = 1.2 + -2.3. Let d = -9 - -8.2. Let n = x - d. What is the second smallest value in n, 1, -5? n Let r be 5 + -2 + (-100)/36. What is the third biggest value in r, -0.02, 3/4? -0.02 Let f = 5652/7 - 806. Let n = f + -37/21. What is the third biggest value in -0.4, n, -2? -2 Let d = 7 + -10. Let l = -0.4 + -1.1. Let g = -1 - l. Which is the third biggest value? (a) -2 (b) d (c) g b Let s = 26 + -23. Which is the second smallest value? (a) 2 (b) 0.2 (c) s a Let j = -12 + 7. Let p = -0.04 - -0.34. Let y = -0.7 - p. What is the third biggest value in -0.3, y, j? j Let y(l) = 5l. Let d be y(1). Suppose r - d = -0. Which is the second smallest value? (a) 0.4 (b) -4 (c) r a Let m = 63/4 + -16. What is the biggest value in 4, -0.3, m? 4 Let p be -2 + ((-52)/(-10) - 3). Let m = 0 + -1. Which is the second smallest value? (a) m (b) p (c) -0.1 c Let o = -61/4 - -15. Which is the biggest value? (a) -2/5 (b) -7 (c) o c Let d = -22 + 23. What is the second biggest value in d, 0, 0.13? 0.13 Let y = -63 + 66. What is the smallest value in -0.16, y, 0.1, 0.5? -0.16 Let d = -12 + 16. What is the third smallest value in 1/4, d, 1/5? d Let i = 3/5 + -1/5. What is the biggest value in i, -3, -2? i Let o = 6 - 4. Let k = -0.024 - 0.076. Which is the third biggest value? (a) 0.3 (b) o (c) k c Suppose s - 44 = 8. Let a be (-4)/(-18) - s/153. Let x = -0.1 + 0. What is the biggest value in 5, x, a? 5 Let r = 77/40 - 9/8. Let j = 0.38 - -0.02. Which is the biggest value? (a) j (b) 2 (c) r b Let w be (-21)/(-9) - 4/(-6). Which is the biggest value? (a) -1 (b) 4 (c) w b Let z = 102 - 712/7. Which is the third smallest value? (a) z (b) 2/11 (c) 4 c Let w = -37 - -36.9. Which is the smallest value? (a) 5 (b) -4 (c) -1 (d) w b Let m = -0.7 - -4.7. Let x = m + -3.8. Let g = -76 - -75.9. Which is the second smallest value? (a) x (b) 0.4 (c) g a Let d be ((-20)/(-6))/(-2) + 2. Let k(j) = j3 + 13j*2 + 14j + 19. Let l be k(-12). What is the second biggest value in d, l, 0? 0 Let t(m) = -m + 21. Let p be t(19). Which is the third biggest value? (a) 1 (b) 3 (c) p a Let f = 5 - 0. Let p = 1.3 - 9.3. Let i = p + 4. What is the third smallest value in f, i, 4? f Let g = 0.3 - 0.4. Let z = 0.3 + g. Which is the second smallest value? (a) -0.3 (b) z (c) 1 b Suppose 0 = 4t - 10t - 24. What is the fourth smallest value in -2, 1.4, t, 5? 5 Let w = -0.55 + -3.45. Which is the smallest value? (a) 4 (b) -2 (c) -0.05 (d) w d Let l = -49 - -54. Which is the biggest value? (a) l (b) -2 (c) -0.08 a Let w = -3 - -4. Let s = 0 - 1. Let r = -0.7 - -0.6. Which is the third smallest value? (a) r (b) s (c) w c Let h(s) be the third derivative of -s*4/24 - 7s*3/6 - 6s*2. Let d be h(-4). Let y be (-1)/3 - 10/24. What is the biggest value in -0.1, d, y? -0.1 Let n = 8.6 - -14.4. What is the smallest value in 0.5, n, 3/7? 3/7 Let j = -2.1 - 0.9. What is the second smallest value in 2/47, -1/6, j? -1/6 Let g be (-3)/(-2)8/3. Let n = 15.5 - 17.5. Which is the second biggest value? (a) n (b) -3 (c) g a Let j = 1.13 - 0.83. Which is the second smallest value? (a) 10 (b) 4 (c) j b Let s = -8 + 1. Which is the third smallest value? (a) -4 (b) -0.4 (c) s b Let k = 17.4 - 18. Let a = -0.3 + 0.2. Let j = k - a. What is the smallest value in -1/5, 4, j? j Let m be 128/(-36) + 1. Which is the smallest value? (a) 1/13 (b) -3 (c) m b Let v = -6.99 - 0.01. What is the third biggest value in -2/5, v, 5? v Let u = -118 - -111. What is the fourth biggest value in u, 1, -0.5, 2? u Suppose 5d - 176 = -y - 2y, 3d = y	{ "pile_set_name": "DM Mathematics" }
alue in -6, 1, -1, -0.03, -0.4? 1 Which is the second biggest value? (a) 4/9 (b) 3/2 (c) 22 b Which is the smallest value? (a) 0.6 (b) 52 (c) -2 c Which is the biggest value? (a) -1 (b) -0.4 (c) 0.3 (d) -11 c Which is the biggest value? (a) 0.07 (b) -3/2 (c) 24/5 c Which is the third biggest value? (a) -6/35 (b) 0.3 (c) 0.05 (d) 2/13 c What is the fourth biggest value in 3, -1.3, 0.1, -4? -4 Which is the second biggest value? (a) -0.3 (b) 0.52 (c) -3 a What is the third biggest value in 3, 23/4, 0.4? 0.4 What is the third biggest value in 0.2, 3/4, -7? -7 What is the second biggest value in -0.41, 3, -4? -0.41 Which is the third biggest value? (a) 2 (b) -0.5 (c) 0.3 (d) -4 (e) 1/3 c What is the second smallest value in 4, -4/7, 450? 4 What is the smallest value in -4, 0.4, -5/2, -13, -0.16? -13 What is the third smallest value in -9, 1.6, -0.1, -3? -0.1 Which is the fourth smallest value? (a) 1 (b) -3 (c) -4 (d) -2 a Which is the biggest value? (a) -9 (b) 51 (c) -5 (d) -1/3 (e) 0.5 b What is the third biggest value in 1/8, 1, 3, -2/5, 5? 1 What is the third biggest value in -13, -8/5, -0.2? -13 What is the second smallest value in -3, 0.4, 3, -1/2? -1/2 What is the smallest value in -2, 2, 5, 0? -2 Which is the fourth biggest value? (a) 1 (b) -1/7 (c) -1 (d) 4 c What is the smallest value in 3, -4, 81, 1/4? -4 Which is the fifth smallest value? (a) -22/7 (b) -1 (c) -5 (d) 2/3 (e) -0.4 d Which is the third biggest value? (a) 2 (b) 416.1 (c) -1 c Which is the second smallest value? (a) 5 (b) -0.2 (c) 2 (d) 2/3 d What is the second smallest value in -0.3, 6, 3? 3 What is the second smallest value in -1, 2/9, -0.1, 84, 0.1? -0.1 Which is the biggest value? (a) 1/2 (b) 10/7 (c) -4 (d) 1 b What is the smallest value in 4, 0.5, 7? 0.5 Which is the smallest value? (a) -0.3 (b) 53 (c) 0.1 a Which is the third biggest value? (a) 1 (b) -26 (c) -0.4 (d) 2/5 c Which is the third biggest value? (a) 3/4 (b) 4 (c) 1 (d) 0.4 a Which is the second biggest value? (a) 2/11 (b) 78 (c) 1/2 c What is the second smallest value in 3, -33, -2/15, 2? -2/15 What is the third biggest value in 6/7, -9, -2? -9 Which is the second biggest value? (a) 1/133 (b) -5/3 (c) -5 (d) -0.3 d Which is the smallest value? (a) 12 (b) -0.1 (c) 1/2 (d) 1/5 (e) -2 e Which is the second biggest value? (a) 4626 (b) -4 (c) -3 c Which is the second smallest value? (a) 3 (b) -1/6 (c) 2/17 c What is the smallest value in 3/40, -0.1, -7? -7 What is the biggest value in 1/3, 152, -0.5? 152 What is the third smallest value in 2/13, 847, 2, 4? 4 What is the smallest value in -0.08, -8, 2? -8 Which is the third smallest value? (a) -0.3 (b) 8 (c) 5 (d) -8 (e) -10 a What is the third smallest value in 30, 2/11, -3? 30 Which is the second smallest value? (a) -2 (b) 2/11 (c) -2/611 c What is the fourth biggest value in -0.5, 5/6, 0, -17? -17 What is the second smallest value in 43, -0.5, -3, 0.9? -0.5 What is the second biggest value in -0.135, 1/4, 5? 1/4 What is the biggest value in -0.1, 21, -2/7, -0.2, 0.5? 21 Which is the biggest value? (a) -30 (b) -3 (c) 0.33 c What is the fourth smallest value in -1.1, -0.2, -3/2, 2/15? 2/15 Which is the biggest value? (a) 2 (b) 5 (c) -0.13 (d) 4 (e) -1 b What is the third biggest value in -5/6, 0.41, 1/2? -5/6 Which is the smallest value? (a) 0.2 (b) -1/6 (c) 72/7 b What is the second smallest value in -2/15, 1, -2? -2/15 What is the second biggest value in -1, 17, -5/3? -1 Which is the third smallest value? (a) 2/217 (b) -11 (c) -5 a What is the second biggest value in 12, 0.3, 5, 0.4? 5 Which is the second biggest value? (a) -0.017 (b) -3 (c) 5 (d) 0.2 d Which is the fifth biggest value? (a) 1 (b) -23/2 (c) -35 (d) -4 (e) 4/3 c Which is the third biggest value? (a) -1/2 (b) -1 (c) 0.02 (d) -0.3 a Which is the smallest value? (a) -10 (b) 0.2 (c) -20 c What is the fifth smallest value in 0.3, 1/11, 5, 4, -1/4? 5 Which is the smallest value? (a) -6 (b) 6 (c) -11 c Which is the biggest value? (a) 2/13 (b) 1/4 (c) 0 b What is the third biggest value in 1, -2/9, 2, 3/22? 3/22 Which is the second biggest value? (a) 2/7 (b) 2/17 (c) -0.5 (d) -1/5 (e) -0.3 b What is the smallest value in 1/8, -140, 2/9? -140 What is the third biggest value in -2, 132, 2/3? -2 What is the fifth biggest value in 1/9, 1, 9, 2/53, 0.4? 2/53 Which is the third biggest value? (a) -2/7 (b) -4/7 (c) -3 c What is the third smallest value in -4, 220, 4, 0.5? 4 What is the smallest value in 22, 8, 0.3, -2/5? -2/5 What is the third smallest value in -5, -0.4, -120, 3/5? -0.4 What is the smallest value in -19546, 0.4, 5? -19546 Which is the smallest value? (a) -1/11 (b) 5 (c) -0.06 a Which is the biggest value? (a) 4 (b) 0 (c) -0.046 (d) -2 a What is the third smallest value in 0.02, 4, -4? 4 What is the biggest value in 5, 0.5, 9.4, -2? 9.4 What is the third biggest value in -0.5, -15, 5, -0.3, 34? -0.3 What is the second biggest value in 1, 1341, 0.3? 1 What is the second smallest value in -2/15, 3, -4, 2? -2/15 Which is the second smallest value? (a) 21 (b) -0.6 (c) 0.123 c Which is the second smallest value? (a) 9 (b) 4 (c) -0.279 b What is the third smallest value in -160.5, -3/5, -1.2? -3/5 Which is the biggest value? (a) -7 (b) 1/29 (c) -0.4 b Which is the smallest value? (a) 3 (b) -72/121 (c) -0.1 b What is the second biggest value in -823, -0.2, 2/3? -0.2 What is the third smallest value in -14, 62, -2/3, -1? -2/3 What is the third smallest value in -3, 0.074, 0.2? 0.2 Which is the second smallest value? (a) 0.5 (b) -2/7 (c) 1/6 (d) 1 (e) 72 c Which is the second smallest value? (a) 42 (b) 0 (c) 6/5 c What is the second biggest value in -5, -0.3, -7, 1/2? -0.3 What is the second smallest value in 2/3, 3, 8, 2/17, -7? 2/17 Which is the smallest value? (a) -4/9 (b) -163 (c) 1/6 b Which is the third smallest value? (a) -2/107 (b) 0.1 (c) -4/7 (d) 2 b What is the second smallest value in 2/39, 1, 5, 43? 1 Which is the biggest value? (a) -0.07 (b) 3 (c) 171 c What is the smallest value in 0.06684, -5, 1/4? -5 Which is the smallest value? (a) -0.4 (b) -4 (c) -1620 (d) 1/2 c Which is the second biggest value? (a) -8/3 (b) -1/2 (c) -5 a Which is the second smallest value? (a) -4/5 (b) -1/2 (c) -1/4 (d) 64 (e) 2 b What is the smallest value in 6, 21, -2/25? -2/25 What is the third biggest value in 0.4, 1, -4, 15? 0.4 Which is the smallest value? (a) -1 (b) 7 (c) 0.017 (d) -4 d What is the fourth smallest value in -0.2, -2/13, -2/3, 140? 140 What is the third smallest value in -3/4, -1, 21.7? 21.7 Which is the smallest value? (a) -0.433 (b) 1 (c) -1 c What is the biggest value in -2/27, 1/4, 2/9, -2.7? 1/4 Which is the fifth biggest value? (a) -2 (b) 43 (c) -5 (d) 0.3 (e) 4 c Which is the third smallest value? (a) 0.2 (b) -3 (c) 58 c What is the biggest value in -1/2, -23, -6? -1/2 What is the third smallest value in 0.05, -2/7, 32/5? 32/5 What is the third biggest value in 5, 0.085, 0, 2? 0.085 Which is the smallest value? (a) -2 (b) -14 (c) -1 (d) 0.04 b Which is the third smallest value? (a) -1/10 (b) 0.1 (c) 0.2 (d) 103 c What is the biggest value in 0.3, 68, 3? 68 What is the biggest value in -12, -3/5, -1? -3/5 What is the smallest value in -1221, 5, 1/6? -1221 What is the second smallest value in 5, 1/6, 2/11, 2, 89? 2/11 Which is the third biggest value? (a) 5/2 (b) -5 (c) 5 b What is the third biggest value in -1/5, -5643, 4, -1/8? -1/5 Which is the third smallest value? (a) -3 (b) 5 (c) 1 (d) -142 c What is the second smallest value in 0.03, -4, 1/2, 13/6? 0.03 What is the third biggest value in -2/13, 8, -2, -1? -1 Which is the fourth biggest value? (a) -4 (b) -0.03 (c) 2 (d) 1/4 a What is the second biggest value in -458, -0.2, -0.7? -0.7 Which is the third smallest value? (a) -11 (b) 83 (c) 4 b What is the second smallest value in -2, 0.8, -5/2, 7? -2 What is the fourth smallest value in 5, -26, -3/8, 12? 12 What is the third smallest value in -17/2, 2, -1, 0? 0 Which is the second biggest value? (a) 0 (b) 3 (c) 2/5 (d) -2/9 c What is the fourth smallest value in	{ "pile_set_name": "DM Mathematics" }
5 -9 Evaluate (-2)/((-6)/4 - (-1333)/(-62)). 2/23 What is (-198)/88(-32)/(-24)? -3 Evaluate 4239/(-6123)78/(-9). 6 What is (2 + -1)/(-28 - -32 - (-58)/(-14))? -7 (-9)/(648/(-630)) - 8 3/4 Evaluate (-2 - 1) + (-20580)/2156 + (-36)/(-66). -12 Calculate (1943/58)/(35/(-10)) + 10. 3/7 What is the value of 1628 + -1637 + (-3)/(1 + (-56)/46)? 24/5 What is the value of (14/(-147) + (-1012)/(-924))-8? -8 ((-54)/162)/(3/(-9)) 1 Calculate 2-13(240/(-3960) - 58/132). 13 36 + -6 + 18432/(-640) 6/5 What is the value of 20 - ((-945)/35 + 59)? -12 (-8)/(-10) + (18208/(-5760) - 7/(-63)) -9/4 (-5200)/304 - -17 - 680/38 -18 (-16)/(-16) - ((14 - 10) + -7) 4 Evaluate (-510)/(-44) - (-14283)/(-1242). 1/11 Calculate (136/32)/(23/(-92)). -17 Calculate 12/20 - 102/(-60)2 - -6. 10 (318/(-1272)3/17)/((-30)/16) 2/85 What is 150/8(-58)/(-290) - 15/3? -5/4 Evaluate (-12)/32-4 - 1012/88. -10 What is the value of -6 - (-5 + 126/24)517/(-22)? -1/8 What is the value of (-37)/74 + (-28)/(-8)? 3 0/(-1) + 5 + -5 - -10 10 Calculate ((-3)/(-6))/((-127)/1524) + (-35)/(-2). 23/2 Calculate 1/(2/(-7)(-133)/114). 3 (-15 - 306/(-18))/((-1)/(-4)) 8 (-13)/((-1365)/(-84)) - (-108)/(-15) -8 Calculate -132 + 136 + (342/56)/((-24)/16). -1/14 1 + -1 - (-224)/(-1008) -2/9 What is -108/(-220)(1 + 54)? 20 What is 20/154(-20)/(-100)? 2/77 36138/570631 19 What is (-500)/(-50) + ((-225)/(-5))/(-5)? 1 Calculate ((-75834)/3410 - -22)/(-5) + 4/(-50). -1/31 (-20 - -5)/(-15)(11 - 12) -1 Calculate (-7)/(-1)((-128)/(-1792))/((-2)/(-116)). 29 What is ((1230/(-110) - -11)/(4/(-11)))/(-3)? -1/6 Calculate (-50)/(-144) + (-34)/272. 2/9 Evaluate 44/(1 - -1)(14 + 725/(-50)). -11 Calculate -17 + (40 - (-12 + 23)). 12 (-41 - -45) + (-2 - 0 - (-108)/(-4)) -25 Calculate (1 + 8/(-9))(35360/255)/(-104). -4/27 (30/(-6) + 3)/(-4)16 8 Calculate 2581/356 - 10/8. 6 Evaluate ((-1264)/1106)/((-4)/42-3). -4 Calculate ((-6)/4)/((-4)/142 - 1569584/(-37346)). -1/28 What is the value of (-390)/5265 - (-58)/1512? -1/28 Evaluate 83/(-2324) - 1170/168. -7 (18 - (-26147)/(-1386)) + 2/63 -5/6 Calculate ((-272)/12)/(4/6). -34 What is 5526/3377 - 328/187? -2/17 Calculate ((-41)/(-410))/((-5)/40). -4/5 What is the value of 3/(-1) + 648/32? 6 What is ((-2)/(-126))/((-5)/1605) - -5? -2/21 (-4128)/(-1364) + -2 + 10540/341 + -32 -2/31 (-5467)/132 - -39 - -2 -5/12 Calculate 142/(-288) + 375/675. 1/16 What is (-16)/(-70) + 20 + (-693)/35? 3/7 Calculate 4/(-134) - 1307284/54538. -24 Calculate ((-34)/(-119))/((-69)/7245). -30 11/(-175) - 464/5800 -1/7 Calculate 15(1/(-6))/(23/46). -5 Evaluate -9 - 0 - 35968/(-3372). 5/3 (-16 - -46) + 53 + -68 15 Calculate 315/844/(-70). -3/14 Evaluate (0 - (-16)/6)10/(-16)-12. 20 What is ((-14)/((-168)/(-81)) - (-4)/(-16)) + -2? -9 Evaluate ((-16)/(-120))/1(3 - (-36)/(-8)). -1/5 What is the value of -5(1/4 + 11 + (-1112)/96)? 5/3 What is (-136)/48 - (3/(-18) - 0)? -8/3 0/2((-24)/(-9) - 221/102) 0 What is (-4041)/(-1796) - (-79)/(-28)? -4/7 Evaluate -14 + (474 - 14)/23. 6 Evaluate 1/7 - 209/(-308)6-2. -8 Evaluate (21/14)/(240/520). 13/4 Evaluate -3 + (7 + -12 - (-7 - -3)). -4 What is the value of (276/(-48))/23(2 + 10)? -3 What is the value of (-273)/78 - 60/(-8)? 4 What is the value of 2/(-2) - (-100224)/97920? 2/85 280/309/7 12 16 + (-5)/(600/1944) -1/5 (-2548)/(-5733) - (-158)/9 18 What is the value of -7 + (-8)/2(-9)/2? 11 (6 - -2) + -12 + 0 -4 What is (-95)/15(-6)/(9/276)? 19 Calculate (736/805 - (324/30)/9)-105. 30 Calculate 140/(-22) + (-224)/(-616). -6 (-14 - 4 - 7)3(-4)/30 10 What is the value of 14/(-22) + -4824/(-12672)? -6/11 What is the value of -23(-29)/(-377)13? -23 Calculate 15/(-33) + 87156/3564. 24 Calculate 10 - 1-13(-31 - -32). 13 -19 - ((-9432)/(-168))/(-3) -2/7 What is the value of 0/(-2) + 2/(-23) + (-6435)/80730? -1/6 Evaluate ((-8690)/1815 + 3 + (-39)/11)1. -16/3 Evaluate -1 + (-8)/(-24) - 3/((-18)/3). -1/6 What is 5/(-110)5318/(-9) - 5? -2/11 What is (-42)/1050(10/15)/(1/3)? -2/25 What is (-5)/20 + (42/(-28))/((-30)/25)? 1 What is -4 - ((1194/50)/(-3) - (-127 + 123))? -1/25 Evaluate 2(-9)/(-33) + 448/(-1386). 2/9 Calculate 575/3000 - 3/45. 1/8 585/(-450) + 1/1 -3/10 Calculate 14/(-6) - (1290/90 - 11). -17/3 What is ((-209)/55)/19(-60)/16? 3/4 Evaluate (-9 - 6/(-18)) + 3/(-9). -9 Calculate -15((3 - 112/(-60)) + -14 + 9). 2 Evaluate 18(-49)/686 + (-3)/7. -1 (3 - 1896/84) + -3 + 125/35 -19 What is the value of 55/6612 - (-202)/(-20)? -1/10 (52/(-28) + 1)/((-14)/(-294)) -18 Calculate (-3104)/(-25520) + (-174)/1682. 1/55 What is the value of (5/30)/((-160)/(-840)(-28)/6)? -3/16 What is the value of ((-4)/3)/(12 - ((-11375)/(-30))/35)? -8/7 Evaluate -23/(-6) + (-53)/(742/84). -5 What is (-6)/(-10)(6188/378 + -4 - 12)? 2/9 What is (-12)/22((-57)/(-76) - (-188)/(-16))? 6 Calculate (9/4)/(-36 + 10476/288). 6 What is (-75)/(-2)472/(-1180)? -15 (3445/624)/(-5) - -7(-8)/(-48) 1/16 What is (12/(-18))/((-54)/(-891))? -11 ((-5)/3)/(-5 + (-160)/(-33)) 11 Evaluate -42 - (-5144/90 - 12/(-2)). -40 (244452/(-4888) + 50)/((-3)/4 + 1) -2/47 What is ((56/84)/((-50)/18))/((-20)/(-50))? -3/5 (-288)/8 + 67 + -39 -8 Calculate (-34 - -50 - 25) + 29. 20 Evaluate (-3)/12(-200)/(-525). -2/21 (-1 - -7)/(1514/(-140) - -1) -12 Calculate (-74 - (-11194)/116)((-10)/9 + 2). 20 Calculate -2 + 3 + -7 + -71 + 78 + 8. 9 What is the value of (-2 + 4)/((18/(-8))/(-9)) - 0? 8 What is (-34)/323-19((-2)/94)/(-1)? 2/47 1540/(-245) + (10/(-25) - (-24)/35) -6 65/220 + 3(26/(-24))/13 1/22 What is ((-12)/10)/(((-32)/5 - -6)4)? 3/4 Evaluate (3/2)/(132/11) + 81/216. 1/2 -7 + 103/15(74 - 73) -2/15 What is (-5)/(-8)(42/(-56) - (-284)/80)? 7/4 What is (1596/1862)/(-1(-6)/(-9))? -9/7 (-482)/2410 - 52/(-210) 1/21 Evaluate (-1 - (-22)/10) + (23 - 26). -9/5 What is the value of 8370/(-1395) + 0 + ((-165)/(-24) - 1)? -1/8 What is the value of (-90)/27((-6)/(-12) - -4)? -15 What is the value of 240/63006(-1)/4? -2/35 What is the value of (-30)/(-20)-4 - ((-35)/(-15) - 8)? -1/3 (1 - 35)1((-405)/30)/(-27) -17 What is (-1503)/668116/(-30)? 6/5 What is (-1(-14)/(-273))/((-16)/(-48))? -2/13 What is (-5)/850/(-6000)-12? -1/16 -4((-78)/(-4) - 19) -2 What is 13(2898/273)/23? 6 Evaluate (2/18)/((168/27)/8). 1/7 (-1)/(-6)(-23868)/306 -13 ((-2)/6)/(-16 + (-539)/(-33)) -1 Evaluate 58/(-6) + ((-11070)/162 - -68). -10 What is (-13)/(-21 + (-30 - -47))? 13/4 (-5)/(-1)(-4)/(-10)297/198 3 What is the value of (697/(-20910))/(9/12)? -2/45 What is the value of 1/3 - 102/(-612) - (1 - 1)? 1/2 Calculate 62/(-93)(7 - (-77)/(-14)). -1 What is the value of (5100/(-450))/(1 - ((-70)/6)/(-7))? 17 Evaluate -18 + (-2460)/(-140) - 17/(-56). -1/8 What is the value of (-2)/6(-63)/(-42)-26? 13 What is the value of (63(-32)/(-3360))/(-1 + (-26)/(-25))? 15 What is the value of 5(-5)/(-261 - 14)? 1/11 What is the value of (20739/(-837) - (-2)/(-9)) + 41? -21 What is the value of ((-91)/21 - -4)0? 0 What is 135/(-9)((-72)/20 + 4)? -6 (-14)/49((-6)/14)/((-91)/(-637)) 6/7 (-130)/(-40)(22 - 30) -26 Calculate ((-7)/14 + 1)/((-8)/1344-7). 12 What is the value of -7 - (-132)/16 - 7/(14/3)? -1/4 Calculate (((-64)/(-816))/(22/(-33)))/(2/4). -4/17 What is the value of -6 + (-1)/(-7 + 875/126)? 12 Calculate (-3 + 34/10)(10 - 600/64). 1/4 Calculate (-2)/15 - (-112)/(-48)590/175. -8 Calculate 100(((-1)/(-2) - 0) + (-375)/500). -25 What is the value of 14670/(-1141) + (0 - -5) + 6? -13/7 Evaluate 5/8 + -1 - (-2107)/(-7224). -2/3 What is the value of 2/(-2)171/1881? -1/11 What is -3 - (-11 + (-228)/(-594)21)? -2/33 Calculate -6 + 303/9 + 3. 7 Calculate (-22)/(-2)-3(-2)/1947. 2/59 Evaluate -34/72 + (-3 - (-849)/234). 6/13 Evaluate (-1)/(-1 + (-15)/(-12)) + (884 - 882). -2 What is (68/12 - 3)/(-2)(-27)/(-162)? -2/9 (-66)/(-44) + -6 + 22 -1/2 Calculate -20 + (-7308)/(-280) - -2(-3)/60. 6 Evaluate (-209)/418 + -2 + 182/76. -2/19 What is the value of (-24)/(128/240-3)? 15 (-5)/(80/(-36)) - (-1311)/276 7 Evaluate (-17)/2 + (-5)/120-12. -8 What is the value of (-3)/637 + 19/3? 6 Calculate (-38)/171 - 68/(-63). 6/7 What is the value of (-651)/744(-6 - 2)? 7 What is the value of (-8 + 5358/666)/((-80)/96)? -2/37 What is the value of (1206/99 + -12)*-11? -2 Calculate 4/(21/((-378)/(-24)))	{ "pile_set_name": "DM Mathematics" }
alse Is 5674977577 a composite number? True Is 4161457967 prime? True Is 4324149433 composite? True Is 537615094 prime? False Is 974378099 composite? True Is 4644344787 composite? True Is 197683447161 prime? False Is 464698263 a prime number? False Is 226215449 composite? True Is 1543421773 a composite number? False Is 95902240673 a composite number? False Is 52335017461 prime? True Is 2626767721 a prime number? False Is 14780458921 prime? True Is 1541631727 composite? False Is 96008717 prime? False Is 73288710613 composite? False Is 543348087 a prime number? False Is 88969532219 a composite number? True Is 187231605007 a composite number? False Is 7132678313 a composite number? True Is 3378811661 a prime number? True Is 20329054453 composite? False Is 62351282407 a prime number? True Is 1602576809 a prime number? False Is 3910543951 composite? True Is 7476767923 a prime number? False Is 5967809089 prime? False Is 524344019 a composite number? False Is 7360385 a composite number? True Is 5849642389 prime? False Is 17046444097 a composite number? False Is 7702046447 a composite number? True Is 2241200021 a composite number? True Is 34542389993 a prime number? True Is 17877553391 a prime number? False Is 6171138197 prime? False Is 331371793 prime? False Is 4724341417 a composite number? True Is 25589973499 composite? False Is 26672222851 a composite number? True Is 20350141793 a prime number? True Is 95239632991 prime? True Is 7341206687 composite? False Is 173146187 a prime number? False Is 4967507761 a composite number? False Is 17136218531 composite? True Is 41153624429 prime? False Is 94329387941 a composite number? True Is 122382358223 composite? True Is 5748003951 a prime number? False Is 17598877523 a prime number? True Is 2336024333 composite? False Is 3935283749 a prime number? True Is 90363731 a prime number? False Is 7746723019 prime? False Is 4021747942 prime? False Is 1211293813 a composite number? False Is 2011612429 a prime number? True Is 2559809477 a composite number? False Is 21256388287 a composite number? False Is 8590446457 a prime number? True Is 67212803 a composite number? True Is 101924822261 a composite number? False Is 5003498807 a composite number? False Is 1134630979 a prime number? True Is 2024995958 prime? False Is 1277333389 prime? True Is 182506967 composite? True Is 554292542 composite? True Is 672965719 a composite number? False Is 4862699447 prime? True Is 26383169 a composite number? False Is 6857112649 prime? False Is 48626770631 composite? False Is 12313213243 a prime number? False Is 109811589 composite? True Is 9238629067 a prime number? False Is 492297217 a prime number? False Is 557466823 a composite number? False Is 219655361 a prime number? False Is 7785702437 a composite number? False Is 6654749485 a prime number? False Is 46097018993 composite? True Is 130095499 a composite number? True Is 128630767 a composite number? True Is 356303587 a composite number? True Is 66552212567 composite? True Is 4316493979 composite? True Is 1011920341 a prime number? False Is 2082304219 composite? False Is 456079997 a prime number? False Is 2622900779 prime? False Is 2787637 prime? False Is 193531796369 a prime number? True Is 26562016499 a prime number? True Is 1515965149 a composite number? True Is 959671013 a prime number? False Is 133595140963 composite? False Is 29183813 a composite number? False Is 379554330065 a composite number? True Is 434222111 a composite number? True Is 2222005769 prime? True Is 2168982169 a composite number? False Is 1574936273 composite? False Is 24160469651 a composite number? True Is 150953849 prime? False Is 9350966441 prime? True Is 203729623 a composite number? False Is 9986968753 a prime number? False Is 1658047999 composite? True Is 136071698431 a prime number? True Is 62100917161 composite? True Is 65037892861 prime? False Is 303345743 a composite number? True Is 384549793 prime? True Is 328457598907 prime? True Is 6398237609 a composite number? False Is 29639314253 a composite number? False Is 52405123267 a prime number? False Is 135991117 prime? True Is 4151148059 a prime number? False Is 1346599523 composite? False Is 332931617 a prime number? True Is 7645074133 a composite number? True Is 19151925673 a prime number? True Is 1312228479 prime? False Is 2348618093 a prime number? True Is 19848120703 a composite number? True Is 220590569 a composite number? False Is 7748197829 a composite number? True Is 3201705515 prime? False Is 23163562151 a prime number? True Is 117339449 a prime number? False Is 2428233517 composite? True Is 4459629331 a composite number? True Is 11012111443 a prime number? False Is 343791445 a prime number? False Is 11340919609 a prime number? False Is 2019700223 a composite number? True Is 163513733 composite? True Is 189522121 prime? False Is 1572480359 a prime number? False Is 377880541 prime? True Is 724592597 prime? True Is 37211854789 composite? False Is 119939275171 a composite number? True Is 7361442653 composite? False Is 3155015537 a prime number? False Is 420514733 a prime number? False Is 60809894599 a prime number? False Is 5138719349 prime? True Is 34877532641 a prime number? False Is 569032507 composite? False Is 7001609737 a prime number? False Is 5693904763 composite? False Is 52946133235 prime? False Is 1288110949 prime? True Is 36339291767 prime? True Is 99643206367 prime? False Is 7226915879 a prime number? True Is 22490258489 a composite number? False Is 671121203 a composite number? False Is 911872019 composite? False Is 13074635429 prime? True Is 267904464697 a composite number? True Is 99981613 a composite number? False Is 1504072187 composite? True Is 1549606235 a composite number? True Is 1147381843 prime? False Is 38455028531 composite? True Is 284895901 a composite number? False Is 11957843965 a prime number? False Is 10874740049 composite? False Is 720998413 a prime number? True Is 1739988389 a prime number? False Is 14813823581 prime? False Is 25168419083 a composite number? False Is 7641567293 prime? False Is 2070702233 a composite number? False Is 28917090113 composite? True Is 426682693 a prime number? True Is 90109367863 a composite number? False Is 53262558113 a prime number? True Is 10995008847 prime? False Is 27956864929 composite? True Is 5651311571 prime? False Is 123131941 prime? False Is 279731759 prime? False Is 94359122477 composite? False Is 2551196859 a prime number? False Is 231694361 a composite number? True Is 7002691831 a prime number? True Is 2251464697 a composite number? False Is 16935316187 composite? True Is 152714592473 a composite number? True Is 623560711 composite? True Is 917693474957 a composite number? True Is 4523103119 composite? False Is 53753701927 a composite number? False Is 3231630553 prime? True Is 110261469 a composite number? True Is 71330733367 a prime number? False Is 6393882251 prime? False Is 354705311 a composite number? False Is 86327806 a prime number? False Is 33435122951 composite? False Is 11631073603 a prime number? False Is 1416520659 a composite number? True Is 1587585278 composite? True Is 24407146843 a prime number? True Is 5310452831 prime? True Is 373411253 composite? False Is 99394379 prime? False Is 4048724027 prime? True Is 11362551913 prime? False Is 481743017 a composite number? True Is 2884431317 a composite number? True Is 9826357943 prime? True Is 98667329 composite? True Is 77248285 a prime number? False Is 38355131561 a composite number? False Is 26566588141 a composite number? False Is 6210823967 a composite number? False Is 12364507867 a composite number? False Is 1812114149 a composite number? True Is 1287111649 a prime number? False Is 2662201937 a composite number? False Is 805191203 a composite number? True Is 20440623979 prime? True Is 38921177639 a prime number? True Is 1482599653 a composite number? False Is 9108691927 composite? False Is 22941105589 composite? False Is 55651021 a prime number? False Is 17776296287 a prime number? True Is 18176503841 prime? True Is 149338279 a prime number? True Is 9874595047 composite? True Is 15135969911 prime? False Is 8577465599 composite? False Is 22016213117 prime? True Is 46158676162 a composite number? T	{ "pile_set_name": "DM Mathematics" }
s z > y? False Let b(r) = -r - 11. Let g(v) = v*3 + 4v*2 + v - 11. Let j be g(-4). Let h be b(j). Suppose -c - 3 = -hc. Which is smaller: c or -2/13? -2/13 Let y be (-15)/(-5) - (-27 + -12). Is y at most as big as 97? True Suppose 0 = -9t - 3t - 9348. Let l = 8653/11 + t. Is 7 greater than l? False Let y = -179884955/198 + 908508. Let p = y + 20/11. Let n be (3/(-15))/(5/(-25)). Which is bigger: p or n? n Suppose -34 = 6i + 26. Let n be (-421)/2 + (-35)/i + -3. Let b be -2(-119)/n - 2/(-15). Is b at least as big as -15/13? True Let n = -8.77 + 8.87. Let g = 256 - 444. Which is bigger: g or n? n Suppose 13612 = 90t - 12014 + 786. Which is greater: 293 or t? 293 Let u(j) = j2 + 20j + 7. Let g be u(-5). Which is smaller: 20 or g? g Let r(z) = z*3 - 10z*2 - 2z + 25. Let n be r(10). Suppose 0 = 3p - nt - 415, 5p = -2t - 3t + 745. Is 143 less than or equal to p? True Suppose -4 = -6a - 22. Let d be (a + 11)/((-8)/(-32)). Suppose -7q = -2q - 160. Is d at least q? True Let r = -6 - 2. Let d(m) = -m*3 - 13m*2 - 8m + 50. Let h(t) = -12t - 48. Let b be h(-3). Let f be d(b). Is r >= f? False Let m = 0.348 + -7.848. Let p = m + 7.625. Is p at most -0.1? False Let u = -11/4197 - 54451/41970. Let o be -1(-1 - 0)-1. Is u bigger than o? False Let m = 27 - 19. Let c = m - 43. Let t = c - -44. Is t at least as big as -1/2? True Let b = -36.936584 - 0.090416. Let o = b + 37. Let x = o + 5.027. Are -2 and x equal? False Let h be 4/72-2 + (-154)/18. Let f = h + -55/12. Is f <= -13? True Let m = 2.5142 + 0.1858. Is 0.047 equal to m? False Suppose 101w + 30471 = -22049. Which is smaller: w or -519? w Suppose 15 = 2o + 2v + 23, -4o - 2v - 8 = 0. Suppose -2y + 5y = 4374. Let x = -59782/41 + y. Is o less than or equal to x? False Let l be (-15)/(-40) - (-15895)/(-40). Let d(g) = -12g*2 - 10g - 25. Let f be d(-6). Is f at most as big as l? True Suppose 37g - 4g + 66 = 0. Suppose 2t + 4 = -2t. Let o be t(3/(-1) - -4). Which is smaller: o or g? g Suppose -6m = -2m - 112. Suppose -2z = -4 - m. Let q be ((-36)/(-24))/((-6)/z). Is q <= 3? True Let i be (-1)/(((42/4)/(-7))/3). Let n(q) = -iq + q - q + 38q*2 - 2 - 1. Let f be n(-1). Is f >= 38? False Let z = -5695/4 + 1411. Let o(s) = 1468s - 35245. Let u be o(24). Is u >= z? False Suppose -104 = 3h - 74. Let a be h/(-110) - 892/10296. Is a less than or equal to -1? False Let t = 41.10728 + -0.10728. Which is greater: t or -2.2? t Let b be (-2)/14 - 55/105. Which is bigger: -6 or b? b Let j(o) = -2o*2 - 534o + 6098. Let f be j(11). Let b = -38125/6 + 6337. Does f = b? False Let t = 809/7335 - -2/2445. Let v(x) = x*3 - 2x*2 - 3x + 4. Let z be v(3). Suppose -3r + 3g = -g - 16, -4r = -zg - 16. Which is smaller: r or t? r Suppose -4t - 5t - 19781 = -4085. Is t != -1744? False Suppose 289 - 1090 = -2a + x, 5x - 1637 = -4a. Which is greater: a or 399? a Suppose -39y + 134 = -100. Let b(x) = -x - 6. Let p be b(-6). Suppose -2a + 4r = p, 4a + 2r = -1 + 21. Which is smaller: y or a? a Let s = 68.69 - 68.89. Is -0.7 smaller than s? True Suppose 0 = -4o - 3r + 2240, -82o + 81o = 3r - 569. Is o != 2? True Let v = -0.15 - -0.1. Suppose -179 = 34l - 26 + 17. Do v and l have the same value? False Let v = -21.4 + 5. Let d = -16.554 - v. Which is greater: d or 0? 0 Suppose 3 = -134c + 137. Is c != -2/57? True Let r = 33 - 25. Suppose -rm = -44 + 12. Let w be ((-9 - -3) + m)/(-1 - 9). Which is smaller: 0 or w? 0 Let k = -708 - -583. Suppose 3n - 4z + 358 = 0, 0 = -2n + z + 2z - 237. Which is greater: n or k? k Suppose -22 = -y - 2q, 2q = 2y + 5q - 44. Suppose 14k = -60 - 10. Let m = k + y. Which is bigger: m or 18? 18 Let w(o) = o2 + 8o - 4. Let q be w(-6). Let j be -6 - (q - (-4 + 0)). Let b be -46/8-2. Is b > j? False Let v = 199.5 - 297.5. Is v at least as big as -1? False Let c = -11196.3 - -11192. Which is bigger: c or -1.8? -1.8 Let j = -0.581 + 10.581. Suppose 47o = 51o - 28. Do o and j have the same value? False Let f = 15.79 - 16. Let t(q) = -q*3 - 5q*2 - 10q - 277. Let l be t(-8). Which is smaller: f or l? l Let j be 18 + -15 - (-1 + 0). Suppose -jx + 26x + 1232 = 0. Which is smaller: x or -55? x Let v = -67 - -438. Let a = v + -35. Let q be 3/9 + a/(-198). Is -2 less than or equal to q? True Let i(g) = 16g2 - 21g + 30. Let a(y) = 5y2 - 7y + 10. Let l(v) = -7a(v) + 2i(v). Let c be l(2). Which is smaller: c or -27/4? c Let q = -12261 + 12237. Suppose -5g - 3s + 8 = 2, -3g + s + 12 = 0. Let u be (2 - 0) + (g - 27). Which is smaller: u or q? q Let o = -411.9693 - -412. Let x = -17.9693 - o. Is -7 > x? True Suppose f + 4l = 3l - 2, -5l - 20 = -5f. Let v be 2/(-9) - 32/18. Let d be (1/(-4) - v)/4. Is f smaller than d? False Suppose 0 = -673x + 481x. Is x greater than or equal to 1/14400? False Suppose 4w + c = -3, 0 = 5w + c - 18 + 21. Which is smaller: w or -9/4007? -9/4007 Suppose 4y = 3y - 4p - 428, 2p = -2y - 862. Let t = 12321 + -49285/4. Which is smaller: y or t? y Let v be (-209355)/1467270 + 2/21. Is v less than 0? True Let v be (14 - -10)/((-6)/(-4)). Suppose -4a - 4 = 2q - v, 0 = -3q + a + 18. Let n be (0 + q/8)2. Which is bigger: n or 2? 2 Let k be 33 + 914/(-21). Suppose 29r - 208 = kr. Is r != 103? True Let r be (-515)/195 - 54/(-81). Which is smaller: -2 or r? -2 Let n be (12 - 18)(-4)/(8/3). Suppose 27z = nz - 576. Is z less than or equal to -32? True Let n(k) = -k*3 - 23k*2 + 25k + 23. Let d be n(-24). Let q be (-8)/(-28)(d - -2). Which is greater: q or 19/3? 19/3 Let q = -11782/1311431 + -12/7013. Let p(z) = -2z + 3z2 + z3 - 3z + 0z2 + z2. Let w be p(-5). Which is smaller: q or w? q Let f = -148861/8 + 75117/4. Which is smaller: f or 172? f Let m = -2.2917 - -0.2917. Is m at least -238/19? True Let l = -2347 + 1829. Is l <= -507? True Suppose -3i = -5i + 2. Let f be 2 + -5 - 5 - i. Let p be -1 + 158/(-22) - 54/(-297). Which is greater: f or p? p Let f(c) = 2c*2 + 6c - 104. Let u be f(40). Let i = 904054/271 - u. Is 0 at least i? True Suppose 9h = 3h + 42. Suppose 0 = -5i + 17 - h. Suppose -ig = 2g. Is g equal to 3/7? False Let k = 113.61 + 2.39. Let l = 127 - k. Let i = -11.3 + l. Which is bigger: i or 5? 5 Suppose -16 = 4f, -f - 48 = 16q - 12q. Which is greater: q or 48? 48 Let u = 2726 + -854. Which is smaller: 0.1 or u? 0.1 Let o = 15930 - 15928. Suppose -15 = -5l - 0l. Suppose 3x + 0 + l = 0. Do o and x have the same value? False Suppose -71w - 5r + 10 = -76w, -3r = -5w - 8. Which is smaller: 3/2227 or w? w Suppose -q + 232 - 237 = 0. Let h(n) = n*3 + 5n*2 + n - 13. Let l be h(q). Is -18 bigger than l? False Let h be (-38)/(-95) + 1 + (-24)/(-15). Suppose -47 = -hp + 19. Is p at least 116/5? False Let i = -5899/7 - -843. Let c be 12((-21)/6 - -2). Let a be (15/c)/((-2)/(-6)). Is i not equal to a? True Let z = 182 + -180. Let o be -3276/16 + z/(-8). Which is bigger: o or -53? o Let y = -4043 - -2339. Do y and -1705 have the same value? False Let c = 2/2375 - -107823/2375. Let y = -1748 + 1792. Which is smaller: y or c? y Suppose -6d - 10 = -22. Which is bigger: -368 or d? d Suppose 11m + 11m + 29524 = 0. Let y = m + 6631/5. Are -16 and y equal? False Let v = 428 - 438. Let y be (8/v)/(2620/50). Which is smaller: y or 1? y Let p be (-1425)/(-20) - 1/4. Suppose -4t + 2x = 0, t - 4x + 3x = 0. Suppose t = pm - 68m + 78. Is -27 smaller than m? True Suppose 4106f - 4104f = -2. Which is greater: f or 1/81? 1/81 Let m be (-27)/216(2/(-7))/(-1). Let q(u) = -2u3 - u2 - 2u - 2. Let t be 0/(-3) + 1-1. Let p be q(t). Which is bigger: p or m? p Let d = -222.67 - -222.47. Let a(o) be the first derivative of -3o*2/2 + o - 3. Let q be a(9). Which is smaller: q or d? q Let d = -30.09702 - -0.15502. Let t = 0.058 - d. Let n = -29 + t. Which is smaller: -0.2 or n? -0.2 Suppose -3a - 1 = -2l, -5l - 4a = -0l + 55. Which is smaller: l or -92/15? l Suppose 8g - 35 - 173 = 0. Let f = -51 - -62. Suppose fz = 14z - 81. Which is smaller: g or z? g Let z = -6371 + 790. Is -5580 > z? True Suppose -4n + 3x - 40 = -x, -n - 20 = x. Let d = -42 - -41. Let q be -117 + (2 - d). Which is smaller: n or q? n Suppose -v + 16 = -12. Let l(o)	{ "pile_set_name": "DM Mathematics" }
ird derivative of -n5/60 + n3/6 + 181n2 - 4n. Determine um(s) - 5o(s). -4s2 Let i(b) = -5b + 14. Let o(p) be the second derivative of p*3/6 + 8p*2 - 15p. Let d be o(-13). Let q(v) = 2v - 5. What is di(j) + 8q(j)? j + 2 Let v(j) = 13 + j + 3 - 2 - 9j. Let b(k) = 3k - 5. Let y be (-16)/(7/(-7)) - 2. Let m be (44/(-16) - -4)4. Determine mv(r) + yb(r). 2r Let c(t) = t2 - 3t + 1. Let s be c(1). Let h(y) = 2y2 + 3y - 3. Let f be (2/62)/(1/18). Let j = f - 15. Let u(z) = -z + 1. Determine ju(p) + sh(p). -2p*2 Let i(k) = 8k*3 + 12k*2 + 9. Let q(s) = -3s + 6s + 2s*3 - 7s + 4s + 3s2 + 2. Let t(j) = j2 - 3j + 5. Let g be t(4). What is gq(z) - 2i(z)? 2z*3 + 3z*2 Let y(a) = 56a*3 + 2a*2 + 2a. Let p(k) = -k*2 - k. Let u be (-28)/((-560)/(-60)) - (2-2 + -1). Determine up(m) + y(m). 56m*3 Let r(u) = 3u + 7. Let l(g) = 6g + 14. Let c(f) = -f3 - 5f*2 - f + 19. Let s be c(-3). Calculate sl(q) - 9r(q). -3q - 7 Let n(u) = 103u - 9478. Let s be n(92). Let o(c) = 15. Let y(g) = g - 1. Determine sy(t) - o(t). -2t - 13 Let b(x) = 2x - 1. Let p(f) = -13f - 125. What is -3b(d) - p(d)? 7d + 128 Let i(v) = 29v*3 - 83v*2 + 5. Let g(j) = -42j*3 + 85j*2 - 6. Give 2g(t) + 3i(t). 3t*3 - 79t*2 + 3 Let n(p) = 2p. Let o(h) = 3h. Let f be 6/((-12)/78 + (-98)/(-130)). Suppose f = -16m + 14m. Calculate mn(y) + 4o(y). 2y Let q(d) = -56d3 + 5d*2 + 5d + 5. Let t(s) be the first derivative of -55s4/4 + 2s*3 + 3s*2 + 6s + 5833. Determine -6q(j) + 5t(j). 61j3 Suppose -72 = -113x + 104x. Let a(t) = 6t*3 + 8t*2 + 16t - 8. Let p(r) = 4r3 + 5r*2 + 11r - 5. Determine xp(f) - 5a(f). 2f3 + 8f Let c(t) = -13t + 13. Let k(d) = d - 8. Let j(f) = c(f) + 2k(f). Let p(l) = l. Let y(i) = -4i - 2. Let a(h) = -6p(h) + y(h). Calculate 4a(z) - 3j(z). -7z + 1 Let m(f) = f3 - 1. Let z(h) = -5h*3 + 8h*2 - 8. Determine 3m(g) + z(g). -2g3 + 8g*2 - 11 Let h be (-2217)/(-24) + (-12)/32. Suppose -19r + h = 4r. Let n(x) = -14x. Let o(v) = -5v. Determine rn(z) - 11o(z). -z Let i(p) = 3p*2 - 2p. Let l(k) = 30k2 - 2k - 30. What is i(d) - l(d)? -27d2 + 30 Let y be 26/(-91) + 150/(-14). Let x(l) = -2. Let b(r) = -7r*2 - 6r*2 + 5 + 10r2 + r2 + r*2. Determine yx(d) - 4b(d). 4d*2 + 2 Let p be 5/(-1) - (133 - -13). Let x = p - -142. Let u(q) = -6q - 8. Let d(w) = -13w - 16. Determine xu(b) + 4d(b). 2b + 8 Let i(f) = 531f + 41. Let l(c) = 425c + 30. Determine -11i(p) + 14l(p). 109p - 31 Let n be ((-182)/6)/(13/78). Let u = -193 - n. Let r(v) = v2 - 5v - 4. Let h(x) = -2x2 + 9x + 7. What is ur(j) - 6h(j)? j*2 + j + 2 Let d be (-22)/(-24) - (-13)/156. Let h(w) = -20w + 40. Let t(x) = -1. Calculate dh(z) + 40t(z). -20z Let s(x) = x. Let y = 2 - -3. Let r(f) = -4f + 64. Let w be r(10). Let v(z) = -14z. Let t(k) = 69k. Let l(q) = wv(q) + yt(q). Determine l(h) - 5s(h). 4h Suppose -20d + 109 + 14 = -157. Let j(w) = -56w*3 - 20w*2 + 14w - 6. Let p(l) = 19l3 + 7l*2 - 5l + 2. Determine dp(b) + 5j(b). -14b3 - 2b*2 - 2 Suppose 0 = -5n - 10, -n = 5h + 4n. Let y(s) = -s + 1. Let z be y(h). Let k(t) = 4t + 1. Let d(j) = -18j + 12j - 11j + 16j. Give zk(i) - 3d(i). -i - 1 Let d(r) = 2r + 8. Let w(p) = -185p2 + 4p + 27. Calculate -2d(x) + w(x). -185x*2 + 11 Let i(c) = 189c*3 + 4c*2 - 4c - 2. Let y(x) = -200x3 - 6x*2 + 3x + 3. Give -3i(f) - 2y(f). -167f3 + 6f Let i(s) = s*2 - s. Let x(n) = -2n*2 + 7n + 3. Let r(d) = -4i(d) - x(d). Let b = 2731 - 2735. Let m(f) = 5f*2 + 9f + 8. Determine bm(k) - 11r(k). 2k2 - 3k + 1 Let k(x) = -7x3 + 65x*2 + 7x - 14. Let t(a) = 4a3 - 32a*2 - 3a + 6. Calculate 3k(i) + 7t(i). 7i3 - 29i*2 Let n(o) = -100o*3 - 2o*2 + 38o. Let b(l) = -201l3 - 4l*2 + 77l. Give 3b(y) - 5n(y). -103y3 - 2y*2 + 41y Let w(m) = -7m2 + 3. Let h(x) = -13x*2 + 67x - 4. Let r be h(5). Let y(a) = -40 - 37 + ra2 - 40 + 149 - 34. What is 2w(p) + 3y(p)? 4p*2 Let d(z) = -3z - 1. Let n be 12/2 + (5 - 3). Let b(w) = -1 + nw - 9w + 6 + 14w. Let k(v) = -18v*2 - v - 1. Let q be k(-1). Calculate qd(u) - 4b(u). 2u - 2 Let t(u) = u*3 + 4u*2 - 6u - 6. Let c(y) = 2y3 + 8y*2 - 13y - 13. Suppose -58o + 22o + 37o = -6. Determine oc(j) + 13t(j). j3 + 4j*2 Let h(b) = 4b. Let g be (-10)/(-1 - (5 + -8)). Let z(l) = 3l. Suppose 66x - 14x = 208. Calculate gz(j) + xh(j). j Let w(c) = 66c + 40. Let s(o) = -39o. What is s(b) + w(b)? 27b + 40 Let f(p) be the second derivative of 0p2 + 0p*3 - 99p + 1/12p4 + 0. Let z(y) = -y2. Suppose 0u + 4 = u. What is uf(s) + 3z(s)? s2 Let l(v) be the second derivative of -v4/12 + v*3 - 3v*2 + 4v. Let n(y) = y*2 + y - 1. Suppose 6s - 16s - 10 = 0. Determine sl(i) + 6n(i). 7i*2 Let r(v) = -4v - 8. Let l(f) = -f - 1. Suppose 0 = -2c - 3t + 42, 73 = -c + 4c + 2t. Suppose 8b = c + 53. Determine bl(n) - r(n). -6n - 2 Let u(p) = p2 + 2p - 2. Let a(q) = 6q3 - 6q*2 - 12q - 147. Give -a(x) - 6u(x). -6x*3 + 159 Let g(h) = -2 + 5 + 2 - 4. Let n(r) be the second derivative of 5r*3/6 + 5r*2/2 + 5r + 213. Calculate 3g(k) - n(k). -5k - 2 Suppose -5d = 5m + 5, -d - 4m - 19 = -9m. Let g(c) be the first derivative of -7c2/2 + 8c - 28. Let r(v) = -6v + 7. What is dg(y) + 5r(y)? -2y + 3 Let r(x) = -27. Let t(z) = 2z2 + 112z + 270. Calculate 10r(y) + t(y). 2y*2 + 112y Let l(r) = 5r - 3. Let g(w) be the first derivative of 11w*2/2 - 6w - 2968. Let u be (-4)/6(-30)/(-4). Give ul(j) + 2g(j). -3j + 3 Let a(x) = -2. Let n be -34/(-6)1500/120. Suppose -24j = -nj + 2. Let g(i) = i - 4. What is jg(y) - 5a(y)? 2y + 2 Let x(n) = 13n + 3. Let m(o) = -25o - 5. Let g be (-84)/(-22) + 38/209. Suppose 16s - 11s + 15 = 0, 18 = -2w - gs. Determine wm(p) - 5x(p). 10p Let h(f) = -3f2 + 7f + 9. Let m(g) be the third derivative of g5/60 - g4/8 - 5g3/6 - 4429g*2. Determine 2h(t) + 5m(t). -t2 - t - 7 Suppose 0 = -50h + 8h + 53 - 11. Let q(y) = y - 3. Let f(i) = -i2 - i - 1. Calculate hq(u) - 2f(u). 2u*2 + 3u - 1 Let j(g) = -4g - 2 + 2g - 1. Let z(n) = -n - 1. Suppose -s + 5 = -h, 58h - 7 = -3s + 53h. Calculate sj(u) - 7z(u). -u - 5 Let a(h) = -102h*3 - 9h*2 + 27h - 178. Let n(r) = 25r3 + 2r*2 - 6r + 45. What is -2a(f) - 9n(f)? -21f3 - 49 Let m(o) be the first derivative of -47o*2/2 - o + 2514. Let y(x) = -23x - 1. What is 3m(u) - 5y(u)? -26u + 2 Let j(l) = 3l - 38. Suppose -81x = -37x - 42x - 6. Let z(p) = 2p - 19. Calculate xj(s) - 5z(s). -s - 19 Let i(p) = -1. Let l(u) = -83u - 3319. Let s be l(-40). Let d(k) = -25k. Give sd(h) - 2i(h). -25h + 2 Let k(n) = 4n - 1. Suppose 5u - 97 = -4v, 2u + 1047v - 57 = 1044v. Let w(f) be the first derivative of -17f*2/2 + 3f - 1. What is uk(y) + 2w(y)? 2y - 3 Let h(i) = i + 1. Let f(p) = 5p - 48. Let c be f(9). Let s(b) = -2b + 41. Let z be s(19). Let j(q) = 3 - q + zq + q + q. Calculate ch(g) + j(g). g Let u(x) = 1. Let w(y) = 84y - 260y + 77y + 92y - 6. Calculate -2u(n) - w(n). 7n + 4 Let g(y) = -4y - 2. Let b(x) = 3x - 33. Let r(z) = -2z + 28. Let m be (-6)/((-180)/175) - 1/(-6). Let f(s) = mr(s) + 5b(s). What is -2f(d) - 3g(d)? 6d Let v(j) = -j2 + 1. Let r(l) = 16l*2 + 45l - 8. Let f(w) = 13w2 + 39w - 7. Let k(t) = -7f(t) + 6r(t). What is k(s) + v(s)? 4s2 - 3s + 2 Let y(m) = 2m2 - 2m - 1. Let z(i) = 169i2 + 16i + 12. Determine -6y(u) - z(u). -181u*2 - 4u - 6 Let n(p) = -19p2 + 93p + 15. Let i(y) = 3y2 - 5y - 2. What is -6i(m) - n(m)? m2 - 63m - 3 Let a(x) = -11x2 - 4x - 4. Let y(u) = 2u2 - u - 1. Let o(j) = a(j) - 6y(j). Let l(z) = z*2 + z + 1. Give 2l(s) - o(s). 25s2 Let s(f) = -f2 + 5. Suppose -u = -0u. Let r be s(u). Let t(p) = 6p2 - 4p - 5. Let v(w) = 3w - 6w2 - w2 + 11w - 5 + 11 - 9w. Give rt(o) + 4v(o). 2o2 - 1 Let o(v) = 3v*2 - 2v - 2. Let d(s) = -6s2 + 4s + 4. Suppose 0 = 2i + 4i - 0i. Suppose iq = -q - 27. Let m = -24 - q. Determine md(b) + 5o(b). -3b2 + 2b + 2 Let z(t)	{ "pile_set_name": "DM Mathematics" }
7592(2 + -1) + -8? 7 Let u(w) = 4w*2 + 12w*2 + 2 + 18w - 4 - w*3. Suppose 110y = 2o + 115y - 34, -o = -4y - 17. What is the units digit of u(o)? 5 Let a(r) = 19r - 11 + 24r + 4r + 51. Let p be a(-7). Let n = p + 565. What is the tens digit of n? 7 What is the thousands digit of -965946/(-440) + 5/4? 2 Let z be (-3395)/161 + (-2)/(-23). Let a be (1 + 0)/((-2)/14). What is the units digit of 0 + 82 - z/a? 9 Suppose -64501 + 341533 = 194i. What is the tens digit of i? 2 What is the tens digit of (-9)/((-54)/5676/76)? 9 Suppose 3p - 44 = -f, -2f - p + 88 = -5p. Let o = 47 - f. Suppose 5q = -3i + 29, -3i - oq - q = -31. What is the tens digit of i? 1 Suppose -3p + 125 - 34 = -2x, 0 = 5p - 4x - 155. Let s = 73 + p. What is the hundreds digit of s? 1 Let z = -275 + 266. Let l(j) = -21j - 37. What is the tens digit of l(z)? 5 Let h be 280/36 - 18/(-81). What is the units digit of h/(-10) + (-10440)/(-50)? 8 Suppose -44s + 26 = 114. Let u = s + 392. What is the tens digit of u? 9 Let s be -6 - (0 - 1)/(0 - -1). Let u be (-3)/(-1) - (-48)/6. What is the units digit of 6s/(-9)(u - -1)? 0 Suppose -171y + 175y - 115476 = 0. What is the units digit of y? 9 Suppose -37 = -3r - 2h - 11, 0 = r + 4h - 12. Suppose -7n + 22800 = rn. What is the units digit of n? 0 Let g = -1484 - -16643. What is the units digit of g? 9 Let w(s) = 97s + 252. Suppose 19f - 23f = -y - 53, 5y + 61 = 3f. What is the units digit of w(f)? 6 Let p = -19 - -27. Let h be 4407(p/(-6) + 2). Suppose 6d = -7d + h. What is the tens digit of d? 2 Suppose -2j - 2480 = -72h + 68h, 0 = -4h - 4j + 2480. What is the units digit of h? 0 Let p = 14620 + -2434. What is the units digit of p? 6 Suppose -451w - 56168 = -479w. What is the units digit of w? 6 Suppose -v + 17v - 688 = 2128. What is the units digit of v? 6 Let w(a) = -8a + 1 + 105a2 + 116a*2 - 22. What is the hundreds digit of w(-2)? 8 Suppose -4a - 3a = 749. Let i = 140 + a. What is the tens digit of i? 3 Suppose -27 = 2n - 45. Suppose 10x - x = -n. What is the tens digit of (x2)/((-8)/408)? 0 Suppose -5t + 35 = -5l, 4 + 1 = -t - 2l. Suppose 5n = 5, -5n - 71 - 122 = -tm. What is the tens digit of m? 6 Let a(p) = -2p3 - 40p*2 - 122p + 75. What is the tens digit of a(-29)? 5 Suppose 4y + 172 = 15w - 11w, -3w - 3y = -159. Suppose -76r + 16128 = -wr. What is the tens digit of r? 7 What is the units digit of 317 + -324 - (-2697 + 1)? 9 Let y be ((-10)/5)/((-20)/(-50)). What is the units digit of y - (-10)/(-30)-4749? 8 Suppose 0 = 769k - 774k + d + 111472, -5k + 2d + 111474 = 0. What is the thousands digit of k? 2 Let c(d) be the third derivative of -d*5/60 - 11d*4/6 - 4d*3/3 + 4d*2. What is the tens digit of c(-20)? 7 Let g(n) = 96n*2 - 9n - 9. Let z be g(-1). Suppose -5k + z = 2b + 37, -2b - 2k + 68 = 0. What is the tens digit of b? 3 Let m(j) = j*3 - 24j*2 + 24j - 12. Let u be m(23). Suppose t = -5n + 20, -9 = -5n + t + u. Suppose np = -0p + 408. What is the tens digit of p? 0 Suppose -213b + 4080772 = -326914 + 245666. What is the ten thousands digit of b? 1 Suppose 0 = b + 439 - 442. Suppose 10 - 388 = -3g - 2z, -bg - 3z + 375 = 0. What is the tens digit of g? 2 Suppose -2j + 4d = -6101 + 1309, -d - 3 = 0. Suppose 8n - 1658 = j. What is the units digit of n? 6 Suppose 3v - w = -v + 19, 2v = -4w + 32. Suppose -m + 2c - 6 = 0, 0 = 2m + 2c - v - 0. What is the tens digit of (88/(-20) - m)/((-4)/200)? 2 Suppose -4z + 28584 + 33304 = 4m, 2z + 4m = 30938. What is the tens digit of z? 7 Let a = 282 - 39. Suppose 7j = 4j + a. Let n = -3 + j. What is the units digit of n? 8 Let s(b) = 34b3 + 14b*2 - 75b + 750. What is the hundreds digit of s(13)? 8 Let c(n) = 26n3 + 6n*2 - 6n + 12. What is the thousands digit of c(5)? 3 Let t(d) = 449d2 - 790d - 4810. What is the hundreds digit of t(-6)? 0 Let d(a) = -122a + 18. Suppose -57 = 14o - 11o. Let l = -21 - o. What is the tens digit of d(l)? 6 Let r = -24 + 0. Suppose p + 55z - 57z = -10, -4z = -5p - 14. Let m = p - r. What is the units digit of m? 6 Let w(m) = -m3 + 19m*2 - 28m - 20. Let q be w(17). Suppose -qj + 93j - 12914 = 0. What is the units digit of j? 4 What is the units digit of (-8710056)/(-504) + (-6)/213? 1 Suppose -7f + 10f - 2n - 85231 = 0, -5n - 198875 = -7f. What is the hundreds digit of f? 4 What is the thousands digit of ((-63835)/10)/(-17)(13 + (-2)/(-2))? 5 Suppose -4989906 - 3921016 - 1627116 = -293a. What is the units digit of a? 6 Let u = 505 - 500. Suppose 0 = uf + 2g - 8610, 10g = 14g + 20. What is the units digit of f? 4 Let q be 411/3 - (-4)/12. Suppose 2v + q = 4v. Suppose 192 = vc - 5c. What is the tens digit of c? 9 Let h(i) = -206i + 7441. What is the units digit of h(-48)? 9 Let m(c) = -c*3 - 15c*2 - 27c + 12. Let y(d) = -19d + 63. Let j be y(4). What is the tens digit of m(j)? 2 Let a(h) = h3 - 10h*2 + 2h - 11. Let r be a(10). Suppose r - 9 = -n. Suppose 4s = -t - nt + 178, -4s - 20 = 0. What is the tens digit of t? 9 Let y be 8 - (26 + -28)(-1)/(-1). Suppose -3b = -yb + 12271. What is the units digit of b? 3 Suppose -h + 1908 - 376 = -5x, 2h + 2x = 3052. What is the units digit of h? 7 Suppose 0 = c + 47 - 108. Suppose 2k + 94 = 3y, -2y = -0k - k - c. Suppose -y = -2w + 54. What is the tens digit of w? 4 Let p = -50 - -46. Let a be p/10 - (-18570)/(-75). Let m = a - -358. What is the hundreds digit of m? 1 Let l be 6/21 + (-2475)/(-35). Let p be -3 + (-4 - 116)/(-2). Let h = l - p. What is the tens digit of h? 1 Suppose 13t = 19t - 246. Let r(w) = 11w - 139. What is the hundreds digit of r(t)? 3 Suppose 36z = 39z - 120. What is the units digit of -35 + z - 135-2? 5 Let z = -1035 - -2473. Suppose 2y - y + 5774 = 4d, z = d - 3y. What is the units digit of d? 4 Let o = 9 + 50. Let p = -57 + o. Suppose 0 = 5u - 15, -ps - 4u = -3s + 60. What is the units digit of s? 2 Let c = 52221 - 36937. What is the units digit of c? 4 Let z be (-2)/((-12)/(-18) + 89/(-129)). Suppose 139 = -5i - z. Let n = 144 + i. What is the units digit of n? 9 Suppose -2n = 49 - 267. Suppose k + n + 555 = 2u, u - 5k = 332. What is the units digit of u? 2 Suppose -2r + f + 12157 = 0, -3r - 3f + 13475 = -4747. What is the thousands digit of r? 6 Let m(f) be the second derivative of 3/2f2 + 0 - 2/3f3 + f. What is the units digit of m(0)? 3 Let f(a) = a3 + 12a2 + 11. Let i = 107 - 118. What is the hundreds digit of f(i)? 1 Let k be ((-10296)/(-195))/(4/(-50)). Let r = 5 - k. What is the tens digit of r? 6 Let c(i) = 336i*2 - 11i + 6. Let k be c(-6). Suppose -32t + k = -8t. What is the hundreds digit of t? 5 Let n(m) = -m*3 + 8m*2 - 4m. Let q be -5 + (-60)/4 - 1. Let t(f) = -f*2 - 22f - 15. Let z be t(q). What is the tens digit of n(z)? 4 Let u be -4 + -1 + (4 - (-27 - 2)). Suppose 5q + 3t - 279 = 0, -4t - 230 = -5q + u. What is the units digit of q? 4 Suppose -23d = -16d + 3x - 15416, 0 = 5d + 2x - 11012. What is the units digit of d? 4 Let v be (216/30 - 4) + (-2)/10. Suppose vf - 45 = -2f. What is the units digit of f/31 - -169? 2 Let g(c) = c3 + c2 + 1. Let d(s) = 569s3 - 4s*2 - 5s - 3. Let w(x) = d(x) + 6g(x). What is the units digit of w(1)? 5 Let q(i) = 183i + 405. What is the ten thousands digit of q(77)? 1 Let t be -6 + 46/4. Suppose t = -10k + k + 3060. What is the hundreds digit of k? 3 Let m(l) = 306l - 1019. What is the tens digit of m(7)? 2 Suppose 4 + 5 = y - 3f, 0 = -4f - 12. Suppose 22o - 23o + 2 = y. Suppose -4m = -5u - 143, -5m - ou = -7u - 180. What is the units digit of m? 7 Let z(n) = 460n - 481. What is the thousands digit of z(9)? 3 Let t(m) = 4m*2 - 12m + 5. Let c be t(5). Let n = -37 + c. What is the tens digit of n - 3 - 4 - -74? 7 Let a = 89 - 83. Suppose -4j + aj - 159 = y, 4j = y + 323. Let h = 167 - j. What is the units digit of h? 5 Let a(m) = -m3 - 6m*2 + 5m + 10. Suppose 6 = -t + 3d, t + 6 = d + 3d. Let n be a(t). What is the units digit of (1 + n/15)-6? 2 Let j(t) = 32t*3 - 12t*2 + 35t - 62. What is the units digit of j(5)? 3 Suppose 0 = 4t - 8, -c - 2t - 441 = -6*c. Let p	{ "pile_set_name": "DM Mathematics" }
d the third derivative of w(i) wrt i. -4110 Let o be (-3 - -6)(6 - 5). Let p(w) = -w + 2. Let v be p(0). Differentiate -2 + 38c*v + 3c*o - 38c*2 with respect to c. 9c*2 Let t(l) = -85l*4 - 2l*3 + 2l - 124. Let i(c) = -86c4 - 3c3 + c2 + 3c - 126. Let d(a) = -2i(a) + 3t(a). Differentiate d(y) with respect to y. -332y*3 - 4y Let u(x) = 409x3 + 385x*2 - 11x + 34. Let h(c) = 68c3 + 64c*2 - 2c + 6. Let t(g) = -34h(g) + 6u(g). Find the third derivative of t(s) wrt s. 852 Let r(u) = 14u - 13. Let c be r(2). What is the derivative of -z3 - 5z*4 - 5z4 + z3 - c wrt z? -40z3 Let q(d) = -d - 10. Let y be q(-13). Let t(r) be the second derivative of 1/20r*5 + 0 + 0r*y + 3/2r*2 + 0r*4 + 3r. Differentiate t(b) wrt b. 3b2 Let l = 35 - 31. Find the first derivative of 3i - 11 - 3i + 2i - li wrt i. -2 What is the second derivative of -96s*5 - 186900s*2 - 16 + 186900s*2 + s wrt s? -1920s*3 What is the second derivative of 6 + 2f*4 - f - 31 - 2f*5 + 6f*4 wrt f? -40f*3 + 96f*2 Let g(p) be the first derivative of -181p*4/4 - 100p - 408. What is the first derivative of g(n) wrt n? -543n2 Let x(n) = -46n*3 - 16n + 1. Let q = 107 + -106. Let v(o) = -o*3 + o + 1. Let z(g) = qv(g) - x(g). Find the second derivative of z(p) wrt p. 270p Suppose -4r - 15 - 1 = 0. Let j be 4/((r/(-4))/1). What is the third derivative of 1 + h*2 - 4h4 - hj - 1 wrt h? -120h Suppose -4t - 2g = -38, -1 = -g - 0. Find the third derivative of -3u*6 + 30u*6 + 21u*2 - tu*6 wrt u. 2160u3 Let t(u) be the third derivative of -u6/3 + 26u3/3 + u2 + 38u. Differentiate t(v) wrt v. -120v2 Let u(o) be the first derivative of 49o*3/3 + 3o*2/2 - 6. Let k(g) = 25g*2 + g. Let s(j) = -5k(j) + 3u(j). Find the second derivative of s(b) wrt b. 44 Suppose -7r + 6r = -2. What is the third derivative of -29 + 15p*r + 13p*3 - 2p*2 + 29 wrt p? 78 Suppose 5a + 2 = 17. What is the third derivative of -3o2 + 8o*a - 4o*3 - 2o*3 wrt o? 12 Suppose 18c - 1166 = -950. Let v(u) be the first derivative of 0u4 + 0u*3 + 13 - cu + 1/5u5 + 0u*2. What is the derivative of v(i) wrt i? 4i*3 Suppose 0 = 2f - 5d + 10, -6 = f - 4d + 5. Find the third derivative of fl3 + 34l*2 - 131l + 131l wrt l. 30 What is the second derivative of -165h - 40 - 47 + 87 + 97h2 wrt h? 194 Let w(z) be the second derivative of 0 + 7/12z*4 + 13/6z*3 - 5z + 0z2. Find the second derivative of w(o) wrt o. 14 Find the second derivative of 80v*2 + 15 - 15 + 8v*2 - 162v + 2v2 wrt v. 180 Let s(c) be the second derivative of 4/3c*3 + 8c + 0 - 1/3c4 + 0c*2. What is the second derivative of s(x) wrt x? -8 What is the second derivative of -6u*3 + 5u*3 - 25u*2 - 3u*4 + 49u + u*3 wrt u? -36u*2 - 50 Let o(j) = 3j + 4. Let k be o(11). What is the second derivative of 30a + 37a*4 - 23a + 2a4 + ka wrt a? 468a2 Let m(n) be the second derivative of -67n*6/15 + 41n*2 + 36n - 1. Differentiate m(a) wrt a. -536a3 Let j(d) = d2 + d + 1. Let k(f) = 3f*3 + 14f*2 + 5f + 162. Let p(x) = -5j(x) + k(x). Find the first derivative of p(b) wrt b. 9b*2 + 18b Suppose -2u - 7u = -126. What is the third derivative of 21v2 - 10v*3 - 6v*3 + uv*3 wrt v? -12 Let z(r) = -2r*2 - 46r + 37. Let l be z(-23). What is the third derivative of 15y2 + 4y*4 + 388y*3 + ly*4 - 388y*3 wrt y? 984y Let c(o) be the third derivative of 121o7/210 + 65o*3/6 + 149o*2. What is the derivative of c(h) wrt h? 484h3 Let m(p) = p3 + 16p2 - 19p - 29. Let j be m(-17). What is the third derivative of 10dj + 15d*2 + 10d + 11d - 21d wrt d? 600d2 Find the first derivative of 10 + 32 - 113s*4 - 4s + 117s4 wrt s. 16s*3 - 4 Let w(s) be the first derivative of 44s5/5 - s4/4 + 2s3/3 + 5s - 86. Find the third derivative of w(v) wrt v. 1056v - 6 Find the second derivative of 1 - 8t - 12t - 279t*2 - 438t*2 - 8t + 197t2 wrt t. -1040 Let o(s) = 563s*4 - 60s*2 - 2s. Let y(v) = -561v4 + 60v*2 + 2v. Let d(r) = 2o(r) + 3y(r). What is the third derivative of d(g) wrt g? -13368g Find the third derivative of 16l*5 - 70 - 14l*2 + 57l*5 + 71 wrt l. 4380l*2 Let p(j) = -214j*4 + 7j*2 + 826j + 7. Let w(t) = -72t4 + 2t*2 + 275t + 2. Let g(n) = 2p(n) - 7w(n). What is the second derivative of g(z) wrt z? 912z2 Let z = -21 + 24. Suppose 0 = 2c - 6 - 0. Find the third derivative of 2h2 - 4h - 4hz + ch*2 + 4h wrt h. -24 What is the second derivative of -1881p4 + 193p - 568p + 2006p*4 wrt p? 1500p*2 Let y(j) be the second derivative of 23j5/20 + j4/12 - 7j3 - j2 - 9j + 9. Find the second derivative of y(c) wrt c. 138c + 2 Let m(k) = 7k*2 + 6k - 30. Let j(q) = -15q2 - 13q + 61. Suppose -20w + 17w = 18. Let i(f) = wj(f) - 13m(f). Differentiate i(s) with respect to s. -2s Let i(l) = -8l*4 + 8l*2 - 3l + 28. Let j(m) = m*2 - m. Let r(v) = -i(v) + 3j(v). Differentiate r(b) wrt b. 32b3 - 10b Let c(o) = 32o2 - 6o + 2. Let l be c(6). Find the second derivative of 28v4 - 23v + 1118v2 - lv*2 wrt v. 336v*2 What is the second derivative of 220z*3 - 28z*2 + 64z*2 + 485z - 35z2 - 39z*3 wrt z? 1086z + 2 Find the second derivative of 74f + 18f - 129f3 + f4 + 21f*3 - 28f*3 wrt f. 12f*2 - 816f Let l = -10 + 19. Differentiate 9m - l + 12m - m wrt m. 20 Let s(w) be the first derivative of w*7/168 + 2w*6/45 + 9w*3 - 15. Let g(q) be the third derivative of s(q). Find the third derivative of g(v) wrt v. 30 Let z(p) be the second derivative of 6p6/5 - p5/10 - 47p4/12 - p2 - 9p + 1. Find the third derivative of z(w) wrt w. 864w - 12 Let o be (2 - -1) + -36 + 3. Let k = -24 - o. What is the first derivative of -1 - kl*4 - 4 + 16l*4 wrt l? 40l*3 Find the second derivative of 45 - 65q + 147q3 + 8q - 41 + 5q wrt q. 882q Let c be (-7 - 1)(-6)/16. Differentiate -4w + 6 + w + cw + 10w wrt w. 10 Suppose z = 3p - 14, -4z - 36 = -4p - 4. Suppose 11 = 4v - 13. Find the second derivative of vm + 3m - 5m3 - mp - 2m wrt m. -36m What is the second derivative of 5v - 4v - 2v - 11287 + 11727 + 676v3 wrt v? 4056v Find the second derivative of 2u + 2u + 61u2 + 41u*2 + 219 - 201 wrt u. 204 Let v(p) = 2p*2 + 10p + 9. Let m be v(-6). Let l = m - 6. Find the third derivative of 4b3 + 18b*3 + 4b*2 - lb*3 - 3b*2 wrt b. 42 Let u(p) be the second derivative of -5/2p*3 - 27p + 0 + 6p2. Differentiate u(v) wrt v. -15 Let y(s) = s2 + 9s + 2. Let g = -20 - -11. Let j be y(g). Find the second derivative of 9v + 7v - 7vj - 13v wrt v. -14 Let y = 6 + -4. Find the third derivative of -4oy + 5o*4 + 6o*4 + 9o2 + o4 wrt o. 288o Find the first derivative of 130t - 55 + 154 + 82 wrt t. 130 Let g(l) be the second derivative of 38l6/15 + 28l*4 - 6l + 21. Find the third derivative of g(x) wrt x. 1824x Let j = 571 - 568. Let x(m) be the second derivative of 1/20m*5 - 1/2m*4 + 0m*j + 0m*2 + 2m + 0. Find the third derivative of x(t) wrt t. 6 What is the derivative of h*2 - 6 + 86h*4 - 69h*3 + 69h*3 + 35 + 189 wrt h? 344h*3 + 2h Let f(d) be the first derivative of -3d5/5 - 11d*3/3 - 19d*2 - 10. Let l(p) be the second derivative of f(p). Differentiate l(r) with respect to r. -72r Let s(n) be the second derivative of -41n5/10 + n4/3 + 2n*3/3 + 48n. Find the third derivative of s(q) wrt q. -492 Suppose -2f - 3s + 22 = 0, -4f + 59 = -3s - 3. Differentiate -7 + 2 - fa2 + 9 wrt a. -28a Suppose -122 = -3w - 2w - 3r, 100 = 4w + 3r. Find the second derivative of 11v - wv + 3v*4 + 11v + 10v wrt v. 36v*2 Suppose -16 = -3g - g. Let r(k) = 5k2 + k. Let c be r(-1). Find the second derivative of -gi + 5i + ci*2 - 3i + 3i wrt i. 8 What is the second derivative of -21h*5 + 2h + 12 - 3 - 8 - 3h - 115h*5 wrt h? -2720h*3 What is the third derivative of -1 + 77g*4 + 1 + 96g*2 - 158g*2 wrt g? 1848g Let n(h) be the third derivative of -h*7/210 - 43h*5/30 + 23h*3 - 4h**2. What is the first derivat	{ "pile_set_name": "DM Mathematics" }
ut replacement from {y: 3, a: 1}. Give prob of sequence yy. 1/2 Four letters picked without replacement from wwwudwuu. What is prob of sequence wwdu? 3/140 Calculate prob of sequence url when three letters picked without replacement from rudrxedl. 1/168 Calculate prob of sequence xp when two letters picked without replacement from {s: 1, x: 1, u: 3, p: 2, f: 3}. 1/45 What is prob of sequence xsss when four letters picked without replacement from xxsussxusssxssbss? 6/119 What is prob of sequence xxxx when four letters picked without replacement from {x: 6}? 1 Two letters picked without replacement from {p: 6, w: 6}. What is prob of sequence ww? 5/22 Two letters picked without replacement from dqddqdqdqd. Give prob of sequence qd. 4/15 Four letters picked without replacement from {j: 3, v: 3, i: 2, f: 1, b: 1}. Give prob of sequence jfvj. 1/280 Calculate prob of sequence uke when three letters picked without replacement from ewumeemmmeuemmkee. 7/2040 Two letters picked without replacement from hkqnskkzzqhn. Give prob of sequence sq. 1/66 Calculate prob of sequence dbb when three letters picked without replacement from wbobhbohwwwvbwdhhbh. 10/2907 Two letters picked without replacement from attwtwtwwt. What is prob of sequence wa? 2/45 What is prob of sequence mkm when three letters picked without replacement from {k: 1, m: 3}? 1/4 Two letters picked without replacement from {r: 1, g: 3, n: 3, w: 3, d: 4, f: 1}. What is prob of sequence nr? 1/70 Four letters picked without replacement from {k: 10}. Give prob of sequence kkkk. 1 Calculate prob of sequence vvvv when four letters picked without replacement from {v: 4, w: 3}. 1/35 What is prob of sequence fae when three letters picked without replacement from {a: 6, e: 2, f: 5}? 5/143 Four letters picked without replacement from nhnhxnhlxhxhhxxhnn. Give prob of sequence xxln. 5/3672 Calculate prob of sequence yt when two letters picked without replacement from {n: 4, y: 3, t: 4}. 6/55 Three letters picked without replacement from titiiit. Give prob of sequence ttt. 1/35 Two letters picked without replacement from {n: 2, w: 3, q: 1, t: 4, h: 9}. What is prob of sequence hh? 4/19 Three letters picked without replacement from {d: 2, q: 5, z: 4, s: 2, h: 4}. What is prob of sequence dqh? 1/102 What is prob of sequence xspi when four letters picked without replacement from {s: 2, x: 1, i: 2, p: 1}? 1/90 What is prob of sequence sys when three letters picked without replacement from msmssmgpqyp? 1/165 Calculate prob of sequence ybvb when four letters picked without replacement from {s: 1, a: 2, j: 3, b: 2, v: 2, y: 2}. 1/1485 Three letters picked without replacement from ltlli. Give prob of sequence ltl. 1/10 Four letters picked without replacement from {j: 3, e: 2, i: 2, h: 6, k: 1, q: 1}. What is prob of sequence ehkq? 1/2730 Four letters picked without replacement from {i: 2, j: 7, z: 2}. Give prob of sequence jiij. 7/660 Four letters picked without replacement from hssgghkggkh. Give prob of sequence gskg. 1/165 Four letters picked without replacement from zzzbzbzz. Give prob of sequence bzbz. 1/28 What is prob of sequence jaa when three letters picked without replacement from {a: 4, j: 2}? 1/5 What is prob of sequence wvv when three letters picked without replacement from {w: 1, v: 3}? 1/4 Three letters picked without replacement from {n: 1, i: 1, e: 1, x: 2, h: 1, l: 1}. What is prob of sequence nxe? 1/105 Two letters picked without replacement from {w: 5, a: 1, f: 1, n: 1, t: 2}. What is prob of sequence tf? 1/45 Calculate prob of sequence mmm when three letters picked without replacement from {z: 4, m: 3}. 1/35 Three letters picked without replacement from ocnynnoiio. What is prob of sequence noy? 1/80 Three letters picked without replacement from {l: 7, k: 1, s: 1, e: 4, u: 2}. What is prob of sequence llk? 1/65 What is prob of sequence hi when two letters picked without replacement from kiimrhi? 1/14 Two letters picked without replacement from {n: 1, t: 2, m: 1, x: 1}. Give prob of sequence tt. 1/10 Calculate prob of sequence hhzz when four letters picked without replacement from zhhhzhhhhh. 1/45 Two letters picked without replacement from {g: 3, h: 4, w: 5, o: 1}. What is prob of sequence go? 1/52 Calculate prob of sequence fw when two letters picked without replacement from {m: 5, w: 1, x: 1, d: 3, f: 2}. 1/66 What is prob of sequence jzmm when four letters picked without replacement from mxxjxzmmxxmxzzz? 2/1365 Two letters picked without replacement from memmmme. What is prob of sequence ee? 1/21 What is prob of sequence ccc when three letters picked without replacement from cccccccccxxccxcccxc? 455/969 Calculate prob of sequence hh when two letters picked without replacement from {h: 2, l: 1, x: 1, m: 1}. 1/10 What is prob of sequence oomm when four letters picked without replacement from {m: 6, o: 4}? 1/14 What is prob of sequence siin when four letters picked without replacement from nnnnnsnnssnnnnnnssin? 0 Three letters picked without replacement from {g: 5, v: 2, d: 4, z: 5, u: 3}. What is prob of sequence uuz? 5/969 What is prob of sequence hi when two letters picked without replacement from {h: 18, i: 2}? 9/95 Three letters picked without replacement from {i: 6, y: 4}. Give prob of sequence yiy. 1/10 Two letters picked without replacement from kgkggggkggggggkggg. Give prob of sequence kg. 28/153 What is prob of sequence llkl when four letters picked without replacement from {k: 7, l: 12}? 385/3876 What is prob of sequence pyg when three letters picked without replacement from gsgpgfggsggggsfpygg? 11/2907 Calculate prob of sequence iuuv when four letters picked without replacement from {u: 6, v: 8, i: 3}. 3/238 What is prob of sequence efrj when four letters picked without replacement from joreoffeqeejqj? 1/1001 Two letters picked without replacement from hhqppuy. What is prob of sequence hy? 1/21 Calculate prob of sequence oyb when three letters picked without replacement from {y: 2, q: 2, b: 2, o: 4}. 1/45 Three letters picked without replacement from ssseeee. Give prob of sequence ess. 4/35 Four letters picked without replacement from gxkppiggxukp. Give prob of sequence xkpg. 1/330 Calculate prob of sequence pihp when four letters picked without replacement from {m: 3, h: 1, t: 1, i: 3, p: 2, l: 1}. 1/1320 Three letters picked without replacement from {n: 3, b: 3, y: 3, a: 1}. What is prob of sequence anb? 1/80 Calculate prob of sequence us when two letters picked without replacement from {t: 2, s: 1, u: 1}. 1/12 Three letters picked without replacement from ttt. Give prob of sequence ttt. 1 Three letters picked without replacement from {r: 7, o: 3, v: 4, f: 2, y: 2}. Give prob of sequence yvf. 1/306 Two letters picked without replacement from oosh. What is prob of sequence os? 1/6 What is prob of sequence ccn when three letters picked without replacement from {c: 2, j: 6, n: 8, r: 3}? 8/2907 Three letters picked without replacement from {l: 1, y: 1, z: 2, a: 10, t: 1, i: 3}. Give prob of sequence ila. 5/816 What is prob of sequence jviv when four letters picked without replacement from {x: 1, j: 1, y: 3, z: 4, v: 2, i: 4}? 1/4095 Four letters picked without replacement from {f: 5, b: 11}. Give prob of sequence bbfb. 165/1456 Three letters picked without replacement from wztzswsswtsttss. What is prob of sequence swt? 12/455 Two letters picked without replacement from {a: 1, i: 1, k: 4, j: 1, s: 1}. Give prob of sequence as. 1/56 Three letters picked without replacement from mmblpqpbpm. What is prob of sequence lbb? 1/360 Three letters picked without replacement from eggefefeggeffeef. Give prob of sequence fgf. 1/42 Calculate prob of sequence qq when two letters picked without replacement from {m: 4, q: 2, o: 1, j: 2, t: 7}. 1/120 What is prob of sequence trkk when four letters picked without replacement from {n: 1, t: 2, r: 1, k: 9}? 6/715 Calculate prob of sequence kkek when four letters picked without replacement from xnnnxkenennxeenxxe. 0 What is prob of sequence fzb when three letters picked without replacement from ifiifizbiiiibiii? 1/840 Four letters picked without replacement from anzzpaszazzazpzpwpp. Give prob of sequence aznz. 7/3876 Calculate prob of sequence em when two	{ "pile_set_name": "DM Mathematics" }
Which is bigger: j or c? j Let l(n) = 2n - 21. Let w(p) = 2. Let g(r) = 3l(r) + 6w(r). Let t be g(8). Which is smaller: 10 or t? t Let s = 285 - 529. Let z = s - -266.9. Let b = 23 - z. Do -2 and b have the same value? False Let x(q) = 2q + 1. Let z be x(2). Let g be (-19 - 26)(-1)/3. Suppose 42 = -2t - 4i, -g = 5i - z. Which is greater: -18 or t? t Let o(h) = -h*2 + 10h + 3. Let k(q) = -q*3 - 3q*2 - 3q + 1. Let y be k(-3). Let g be o(y). Let s be (-1)/((-345)/114 + g). Are 38 and s equal? True Let y = -263 - -313. Let m = y - 49.68. Which is smaller: m or 2? m Suppose b = -2s + 11, -3s + 49 = -b - 4b. Let a be (s/24 + 109/6)/2. Which is bigger: a or 8? a Let k = -31 + 34. Let y(p) = 3p*2 + 22p. Let i(q) = -q*3 - 3q*2 + 6q + 1. Let n be i(-4). Let g be y(n). Is g < k? True Let m = 0.274 + 30.026. Let r = 28.3 - m. Is -2/361 not equal to r? True Let h(x) = -4x + 7. Let a be h(2). Let z be a + -20 + -4 + 0. Let g be z/(-15)4/10. Is 1 less than g? False Let i be ((-1)/2)/((-14)/4176 - -2). Which is bigger: i or 0? i Let t = 8371.1 - 8792. Let r = 421 + t. Which is greater: 298 or r? 298 Suppose -7g - 10 = -12g. Suppose -gi + 51 = -49. Let f = i + -37. Are f and 14 equal? False Let g(k) = 51k + 131 - 22k - 20k - 12k. Let p be g(29). Let s = 2.9 + -3. Which is bigger: p or s? p Let g = -2865/16 - -179. Let t = 277/11984 - -39/214. Let i = g + t. Is i less than or equal to 6? True Let p = 1/1140 + -71/2964. Let d = -175 + 175. Is p equal to d? False Let i(o) = -974o + 2833. Let n be i(3). Which is bigger: n or -20? -20 Let c(j) = 2j - 3. Let p(r) = -42r + 205. Let v(m) = 4c(m) + p(m). Let a be v(14). Which is bigger: -284 or a? a Suppose -10f - 2852 = 13f. Suppose 54 + 1166 = -10z. Are f and z nonequal? True Let d = -842 - -866.68. Let t = 24.6 - d. Is 2 >= t? True Let j = -1.9 + 2.8. Suppose -5g = 4c - 49, 4g = 6c - 2c - 76. Let d be (c/9 - 2)/(6/9). Which is bigger: d or j? j Let m = 3.77 + -171.77. Let s = 117 + m. Let y = 50.9 + s. Does -8 = y? False Let u = 39707/93 + -2954/31. Let w = u - 340. Let j be (2 - 1)-33. Which is smaller: j or w? j Let r = -1876/11 - -13187/77. Which is greater: r or -0.029? r Let p = -38 - -36.6. Let k = -4.65 - -0.25. Let t = k - p. Is -6/11 less than t? False Let x be 4 - (0 - (-357 + 6)). Let r = -625 - x. Is -278 < r? False Let b = -0.35886 + -135.11314. Let k = b - -141.2. Let s = -0.028 + k. Is s less than 2/9? False Suppose 4i = 210 - 294. Let w be (-18)/(-63)i/(-6). Are 2/193 and w equal? False Suppose -7w + 14w - 7 = 0. Let n = 1/1764 + 101/44100. Does w = n? False Let d = 7477 - 8079. Is -1 < d? False Let w(t) = t*2 - 2t - 7. Let y be w(2). Let s(v) = -v*3 - 2v*2 + 56v - 7. Let g be s(y). Is g > -153? False Let q be 1485/300 - (-1 - 14/(-8)). Let f = 0.20047 + -5.20047. Is q less than or equal to f? False Let m = -6.66 - -414.86. Let r = -408 + m. Which is greater: r or 81? 81 Let i = -301 - -304. Let p be (7 - i) + 227/(-57). Which is greater: p or -1/2? p Let o be (-4)/31/40 - 0. Suppose -16u = -14u. Suppose -3b - 4p - 12 = u, 6p = -4b + 4p - 6. Is b less than o? False Let g be 12/4 + -1 + 3. Let y(i) = -i + 3. Let w be y(g). Which is greater: -62/19 or w? w Let y be (-143)/52 + 3(-2)/(-8). Suppose -4 + 15 = o. Let t be ((-12)/o)/3 + 28/(-154). Which is smaller: t or y? y Suppose -i - 1 = -6, -2x + 23 = 3i. Suppose -c + 0b + 42 = -4b, -b - x = 0. Is c at least 18? True Let n(z) = 23z*2 + z - 2. Let h be n(-2). Let v = h + -100. Let p be v/27 + 8/12. Are -0.8 and p non-equal? True Suppose -5r = r + r. Suppose r = -3c + 9c + 6. Which is bigger: -2 or c? c Suppose -18z = -131 + 23. Let f be (314743/13420)/31 - z/8. Is 0.1 greater than f? True Let s = -2155 + 916. Let i be s/(-310) + -6 + 4 + -2. Which is smaller: i or -1? -1 Suppose 0 = -6p + 9p + 6. Let x be (-17)/p - ((-26)/(-4))/(-13). Suppose 45 = xs - 6s. Which is smaller: 1 or s? 1 Let y be (-7 + 10/2)(-8 + (-76)/(-8)). Which is smaller: -130/53 or y? y Let x = -164008/35 - -4686. Which is bigger: -6 or x? x Let m be 16/10 - 8/4. Let x = 1/10 - m. Suppose 0 = -22f - 18f - 16f. Which is greater: x or f? x Let c = 54416323/2274 + -143581/6. Is c greater than 0? False Let n = -64 - -27. Let k = n - -47. Let d be (0/k)/(3 + -2). Which is smaller: d or -2/55? -2/55 Let a = 6.8481 - 4.76173. Let z = a - -0.00463. Let v = -0.091 + z. Do v and 2.2 have the same value? False Let x be 9 - 2708/68 - 16/(-8). Which is smaller: x or -28? x Let q(g) = -5g*3 + 23g*2 - 16g + 10. Let i be q(4). Let m be ((i/8)/(-1))/(259/(-252)). Which is smaller: m or -2? -2 Let y = 179/4 + -45. Let p be (-4)/(-4)-1 - 567/(-588). Which is smaller: p or y? y Let t = -16 + 78/5. Suppose 8 + 12 = 5p. Suppose 5r = 3b + 29, 5r - 34 = pb - 7. Are t and r unequal? True Suppose 2i = 2c + 5i - 22, -5c + 105 = -5i. Suppose 142b - 139b + a - 31 = 0, b - c = a. Let d be (2/4)/(1/30). Is b greater than or equal to d? False Let g = -0.1 - -0.1. Let z = 25812/13 - 25811/13. Does g = z? False Let g = -0.274 + 0.022. Let a = 0.162 + g. Which is bigger: -0.4 or a? a Suppose -43z + 40z = 0. Suppose z = -v + q - 78, -10 - 10 = -5q. Which is smaller: v or -75? -75 Suppose 0 = -s + 4j - 26, 255s = 250s - 2j - 42. Which is bigger: -603/68 or s? -603/68 Let q = -196.9 - -197.9. Which is smaller: -137 or q? -137 Let h(a) = -7a + 11. Let r(t) = t3 + 11t*2 - 9t - 6. Let s be r(-12). Let u = s - -46. Let c be h(u). Is c > -15? False Suppose -4 = -2u, 0 = 3a + 3u - 8u - 5. Is 17 less than a? False Let r be ((-189)/3885)/(33/55). Is 0.16 at least r? True Let d be -121(-1)/33. Suppose d = -3o + 4o - 4s, 4s = -12. Let r = 880 - 51922/59. Is o equal to r? False Let h = 783 - 8614/11. Let a = 13 + -17. Let d = 3 + a. Which is bigger: h or d? h Suppose 4p + 9 = 29, -j = 2p - 22. Suppose 109t - 110t = -j. Which is bigger: -2 or t? t Let g = 37 - 68. Let l(a) = -a3 + 19a*2 - 86a - 22. Let j be l(11). Which is smaller: j or g? g Let d = 125 - 107. Let n be (2/6)/((-3)/d). Let p be 4(n + 3) - (-134)/(-34). Is -1 less than or equal to p? True Let c(v) = -v3 + 18v*2 + 2v + 8. Let d be c(18). Let x = d + -62. Let r be (4/(-8))/(1/x). Which is greater: r or 8? r Let n(v) = 320v + 67521. Let g be n(-211). Let w = -0.378 - 2.532. Which is smaller: w or g? w Suppose 14y - 9y - 5 = 0. Let x be ((-68)/208)/((-215)/(-870)). Let f = -35/26 - x. Which is smaller: f or y? f Let f = 174 - 17. Let p(t) = -385t - 3694. Let g be p(-10). Which is greater: g or f? f Let u(g) = -g*3 + 93g*2 + 97g - 346. Let y be u(94). Which is smaller: 3/13 or y? y Let k = 19359 + -24024. Is k at least as big as -4661? False Let m(c) = 85c2 - 2c - 4. Let f be m(-2). Let p = -23121/68 + f. Let g = p + -107/1972. Is g <= 0? True Let m = -435613/22 - -19801. Is 14 <= m? False Let u = 18 - 13. Let y = 607 + -597. Suppose 2g + 26 = 4p, g = up - 18 - y. Is 1 equal to g? False Let x = 0.0422 + -0.0979. Let g = 140.0557 + x. Is g bigger than -1/3? True Let q = -24260 + 24260.12. Is q equal to -191? False Let r = 20 + -20.9. Let l = 0.46 + r. Let y = -23.44 - l. Which is smaller: y or 0.1? y Let u be (41/(-2))/((-27)/(-18) + -1). Suppose t + 2h = -9, -4h - 23 + 3 = 0. Is t less than u? False Suppose 5o + 0k = -5k + 5, -2o + 5k + 23 = 0. Suppose 0 = -2u - u - 5i - 40, -u - 25 = oi. Let w be (6/3)/10 + (-49)/u. Are 7 and w nonequal? True Let f = 0.49 + -73.49. Let w = f - -66. Are -1/12 and w unequal? True Let m = 124 - 101. Suppose -m = -5f + 17. Is 17 bigger than f? True Let y be ((-1870)/1320)/((3/3)/8). Suppose -s = 4s + 60. Which is smaller: s or y? s Suppose -z + 33 = -4f, -89 + 17 = -3z + 3f. Suppose 2l - 12 = -u - 2l, 5l = u - z. Suppose -n + 54 = 2n. Is n >= u? True Let n(a) = -12a - 95. Let k be n(-8). Let r = -12/359861 - 5412668749/16553606. Let w = r - -327. Which is greater: w or k? k Let z be (-47033303484)/(-68199)(-3)/63. Let f = 5877414/179 + z. Let l = f + -1/889. Which is bigger: 1 or l? 1 Let j = 1334/18165 - 16/173. Is 1 != j? True Let p(t) = -6t2 + 12t + 3. Let l be p(-4). Let b = -140 - l. Which is smaller: 3/104 or b? 3/104 Let c = 23800.107 + -23800. Which is	{ "pile_set_name": "DM Mathematics" }
-5 - 10. What is mt(s) + 2u(s)? -7s2 - 1 Suppose 595 = 78b + 7b. Let h(m) = 4m + 4. Let a(q) = 13q + 11. Determine bh(o) - 2a(o). 2o + 6 Let m = -10533 - -10535. Let d(x) = 2x2 + 3x + 3. Let j(w) = w*3 - 7w*2 - 9w - 10. Calculate mj(k) + 7d(k). 2k3 + 3k + 1 Let y(i) = -i*3 + 26i*2 + 3 + 0i + 3i - 29i*2. Suppose 8 - 38 = -15n. Let x(p) = 7pn + 2p*3 - 21p*2 - 2p + 16p2 - 2. Give -3x(b) - 2y(b). -4b*3 Let r(m) = 8m*2 + 7m + 5. Let w = 4516 - 4515. Let p(b) = -b*2 + b + 1. Give wr(s) - 5p(s). 13s*2 + 2s Let q(u) = -59u - 47u - 10u2 + 104u + u*3. Let c(l) = -3l*3 + 41l*2 + 8l. Determine 2c(n) + 9q(n). 3n3 - 8n*2 - 2n Let u(m) = -3m2 + 6m + 3. Let q(b) = 21b - 28b*2 - 41b - 35b2 + 67b*2 + 15b - 3. Give -7q(v) - 6u(v). -10v2 - v + 3 Let h(k) = -150k*3 - 14k*2 + 4k - 7. Let l(r) = -141r3 - 17r*2 + 5r - 8. What is 5h(b) - 4l(b)? -186b3 - 2b*2 - 3 Let n(x) = 5x*3 - 32x*2 - 15x - 2. Let o(u) = u3 + u2 - 4u - 1. Determine -n(z) + 4o(z). -z*3 + 36z*2 - z - 2 Let f(m) = 9m - 10. Let o(c) = -36 + 6c + 31 - c. Let u = -5938 - -5935. Give uf(j) + 5o(j). -2j + 5 Let o(a) = -10a + 8070. Let l(y) = 8y - 6456. What is 14l(x) + 11o(x)? 2x - 1614 Let q(d) = -6d - 1. Let s(n) = 81n + 3. What is 12q(h) + 3s(h)? 171h - 3 Let l(i) = -25i2 - 26i - 8. Let f(q) = -81q2 - 79q - 25. Calculate 6f(v) - 19l(v). -11v2 + 20v + 2 Let c(j) = -7j2 - 16j - 4. Let a(h) = -15h - 8h*2 - 2h + 2035 - 861 - 1179. Determine 6a(b) - 7c(b). b*2 + 10b - 2 Suppose 11w - 5w = -588. Let m(q) = 371. Let i(a) = -445. Let v(x) = -5i(x) - 6m(x). Let h(n) = -7n2 - 49. Give wv(b) + 2h(b). -14b*2 Let w(o) = 403o - 5. Let h(z) = -147z + 2. What is 11h(c) + 4w(c)? -5c + 2 Let r(v) = 17v3 + 3v*2 - 3v - 2. Let a(l) = -32l3 - 6l*2 + 5l + 4. Determine 3a(k) + 5r(k). -11k3 - 3k*2 + 2 Let o(g) = -77g*3 + 34g*2 - g + 152. Let m(l) = 9l*3 - 4l*2 - 19. Calculate -17m(y) - 2o(y). y3 + 2y + 19 Let r(s) = -9s2 + 14s + 19. Let v(q) = 11q2 - 10q - 20. Calculate -6r(a) - 5v(a). -a*2 - 34a - 14 Let o(t) = -6t2 - t - 1. Let a be o(-1). Let k(c) = 4c*2. Suppose -4j - 11 = -j - 8. Let y(p) = -p*2. What is ay(d) + jk(d)? 2d*2 Let f(c) = 13c + 8. Let o be (-1 - 0)((-140)/112)/((-20)/96). Let d(y) = 13y + 9. Determine of(v) + 5d(v). -13v - 3 Let r(a) = -3a*2 + 3a - 3. Let o(w) = 17w2 + 11w - 16. Give -o(g) + 6r(g). -35g*2 + 7g - 2 Let z(r) = 5r3 + 3r*2 - 4r - 1. Let u(n) = 2 + 9n + 27n*3 - 67n*3 - 6n*2 + 29n*3. Suppose -8 = 13c - 15c. What is cu(i) + 9z(i)? i3 + 3i2 - 1 Let o(i) = -i2 + 2i - 3. Let j(v) = 23v*3 - 4v*2 + 13v - 16. Determine -j(d) + 4o(d). -23d*3 - 5d + 4 Let q(k) = -37k - 2851. Let s(r) = 17r + 1418. Calculate 6q(w) + 13s(w). -w + 1328 Let l(t) = -t. Let j(n) = 3n - 1. Let f(p) = -15p + p*2 - 29 + 5p - 16p - 3p*2. Let r be f(-12). Determine rl(d) - 2j(d). -d + 2 Let q(a) = a2 + a - 1. Let k(i) = -8i*2 - 641i + 4. What is k(x) + 6q(x)? -2x*2 - 635x - 2 Let p(b) = -261b2 - 9b - 9. Let v(y) = 65y2 + 2y + 2. Let k be 6/(-8)1(-18 - -6). What is kv(i) + 2p(i)? 63i2 Suppose -4j + 7j = 6. Let x(n) = 4n*2 - 2n2 - n3 - 7n2 + jn*2. Let q(k) = 3k*3 - 8k*3 - 8k*2 + 0k*3 + 2k*3. Calculate 3q(d) - 8x(d). -d3 Let t(n) = 54142n*3 - 11n*2 + 11n + 44. Let s(b) = -18047b3 + 4b*2 - 4b - 16. Determine -11s(u) - 4t(u). -18051u3 Let w(g) = -558g. Let d(k) = -k + 3. Give d(a) + w(a). -559a + 3 Let l(n) = 34n*2 + n - 1. Let r(c) = -14008c*2 - 408c + 408. Calculate 408l(k) + r(k). -136k*2 Let h(m) = 41m*2 + 10m + 38. Let z(c) = 41c2 + 12c + 27. What is 6h(a) - 5z(a)? 41a2 + 93 Let o(w) = -4079w - 6. Let b(c) = 1014c + 1. Calculate 9b(m) + 2o(m). 968m - 3 Let i(v) = v*2 + 1. Let n(q) = 0 + 2 + 7q*2 + 3. Let k = -23622 + 23623. Give kn(u) - 5i(u). 2u*2 Let x(o) = 35o*2 - 18o - 331. Let t(h) = 9h2 - 4h - 82. Calculate -9t(u) + 2x(u). -11u2 + 76 Let i(b) = -18722b - 18769b + 37486b - 9b3 + 5b*2 - 5. Let m be (-4)/6 + (-39)/9. Let p(l) = 13l*3 - 7l*2 + 7l + 7. What is mp(c) - 7i(c)? -2c3 Let f(d) = -23d*2 + 9d - 962. Let o(s) = 8s2 - 3s + 322. What is 6f(v) + 17o(v)? -2v2 + 3v - 298 Let v(r) = -909r3 + 49r*2. Let q(m) = 144228m*3 - 7777m*2. Determine -14q(z) - 2222v(z). 606z*3 Let u(r) = 50r - 6. Suppose -127z + 288 = -47z - 62z. Let b(n) = -10n + 1. Give zb(k) + 3u(k). -10k - 2 Let p(q) = -2q + 1. Let s(g) = 148g + 3 - 296g + 147g - 2. Calculate -3p(v) + 5s(v). v + 2 Let o(p) = p + 43. Suppose 4q - 2q - 17 = -3h, h - 3 = 0. Let a(n) = n + 43. Give qa(k) - 5o(k). -k - 43 Let d(r) = -3r2 - 4. Let n(j) be the second derivative of -13j + 0j3 + 5/12j*4 + 4 + 4j*2. Give 7d(z) + 4n(z). -z2 + 4 Let n(s) = 16887344s*2 - 28544s - 71360. Let k(t) = -3550t2 + 6t + 15. What is 14272k(g) + 3n(g)? -3568g2 Let m(z) = 4z + 2. Let g(r) = -21r - 11. Let f = -369 - -397. Let n be 322/f + -1 + (-3)/(-6). Determine nm(s) + 2g(s). 2s Let s(y) = -y*2 + 4y - 1. Let g be (-16)/(-6)(-3)/(-2). Let d = -73 - -76. Let t(l) = -4l + l - 3 - dl2 + 7l + 7l. Calculate gt(a) - 11s(a). -a2 - 1 Let o(i) = -i3 + i2 - i. Let y(w) = -13w*3 - 677w*2 - 2w + 339w2 - 6w + 343w2 + 11w*3. What is -5o(c) + y(c)? 3c3 - 3c Let q(u) = -18u2 - 34u + 293. Let z(t) = -7t2 - 12t + 98. Determine -6q(m) + 17z(m). -11m2 - 92 Suppose -5b = 4c - 17 + 1, -3c = 5b - 17. Suppose -1 = -2q - w, -w + 3 = 5q - 4. Let z(r) = 3 - qr + 3r - 6. Let d(m) = -2m + 5. Give bd(o) + 7z(o). -o - 1 Let x be (-1)/3 - (-1)/3. Suppose 0 = 4p - p + o - 10, p - 4o + 1 = x. Suppose 2v = -5 + p. Let u(s) = 5s*2 - 5. Let n(t) = -1. Give vu(r) + 5n(r). -5r*2 Let m(f) = -31f*2 - f + 4. Let k(r) = 94r*2 - 2r - 14. Calculate 2k(h) + 7m(h). -29h2 - 11h Let b(k) = -k. Let q(m) = -3m - 2. Suppose 32v + 5 = 31v, 4v + 24 = 4c. What is cq(t) + 2b(t)? -5t - 2 Let f(x) = -20x3 - 2x*2 + 6x - 451. Let o(s) = 3s3 - s - 6. Give f(g) + 6o(g). -2g3 - 2g2 - 487 Let i(l) = -l3 - 3l2 + 1063l. Let d(g) = 2g3 + 5g*2 - 2125g. Give 3d(u) + 5i(u). u*3 - 1060u Let n be ((-40)/(-4) - 3)/((-13)/(-104)28). Let d(q) = 2q*2 + 2q + 1. Let h(a) = -a*2 - 2a - 1. Determine nh(p) + 3d(p). 4p2 + 2p + 1 Let c(g) = -1708g2 - 10. Let v(z) = 194711z*2 + 1142. Give 1142c(m) + 10v(m). -3426m*2 Let f(p) = -3p*2 - 11p + 4. Let i(b) = 4b2 + 11b - 5. Suppose 15 = -21u - 22 - 26. Calculate uf(d) - 2i(d). d2 + 11d - 2 Let n(z) = 3z + 8. Let d(c) = 30c - 7. Let k(x) = 23x - 4. Let v(a) = -3d(a) + 4k(a). What is -5n(s) + 8v(s)? s Let m(x) = -8x*2 + 3x + 17. Let j(r) = -4r2 + r + 8. What is -5j(q) + 2m(q)? 4q*2 + q - 6 Let p be 10/(-130)(16 - 3). Let w(b) = -b. Let l(u) = 2u + 6. Let s(t) = l(t) - 2w(t). Let z(j) = j + 1. What is ps(v) + 5z(v)? v - 1 Let n(m) = -16m3 + m2 - 4m. Let f(a) = -31a3 + 3a*2 - 9a. What is 2f(z) - 5n(z)? 18z3 + z2 + 2z Let p(z) = 684z2 + 12z. Let i(k) = -5k2 - k. Give -10i(a) - p(a). -634a2 - 2a Let p(n) = 23n3 - 2n*2 + n - 2. Let s(m) = -46m*3 + 5m*2 - 3m + 5. Suppose 20u + 90 = 2o, 0 = -6u + 5u - 4. Give op(b) + 2s(b). 23b3 - b Let t(h) = 13h*2 - 7h + 1. Let w(s) = 22s2 - 11s + 1. Let j(v) = -5t(v) + 3w(v). Let u(p) = -2p2 + 28 - p - 2p - 25. Calculate -8j(g) - 5u(g). 2g2 - g + 1 Let g(b) = -12b*3 + 262b*2 - 4b + 13. Let y(t) = -6t3 + 130t*2 - 2t + 7. Calculate -4g(s) + 7y(s). 6s3 - 138s*2 + 2s - 3 Suppose -23a = 24 + 45. Let d(v) = -1. Let u(l) = -16l - 1. Determine ad(b) + u(b). -16b + 2 Let v(z) = -1. Let w(k) = 168k - 21. Determine 21v(q) - w(q). -168q Let n(i) = 1408i*2 + 10i - 3. Let o(s) = 2816s2 + 25s - 8. Determine -5n(t) + 2o(t). -1408t2 - 1 Let z(c) = -c3 + 5c*2 + 34c - 5. Let r be z(-4). Let s(u) = -155u2 + 20u. Let v(d) = 22d2 - 3d. Calc	{ "pile_set_name": "DM Mathematics" }
(sqrt(2)1) - (-5sqrt(102)/sqrt(6) + 4-3sqrt(17)))*2. 8990 Simplify ((sqrt(255) - -1(1sqrt(255) - sqrt(255)))/((sqrt(245) - -2sqrt(245)) + sqrt(245) - sqrt(245)))/(6(sqrt(30)/(sqrt(5)-2))/sqrt(2)). -sqrt(17)/63 Simplify ((2sqrt(252)-1)/(2sqrt(588)))/((5sqrt(12)/sqrt(2))/(sqrt(2) + -2(sqrt(18) + sqrt(2)))). sqrt(7)/5 Simplify (1sqrt(5184) + sqrt(5184) - sqrt(5184))/(sqrt(24)/(sqrt(18) - sqrt(2))) + (3 + sqrt(75)-2)2 + (1 + 2sqrt(75))*2. -16sqrt(3) + 610 Simplify (-3(5 + (3sqrt(176))*2) + sqrt(176) + (-3(2 + sqrt(176)))*2 + (sqrt(176) + 2 + sqrt(176))-2)4. -12604 + 528sqrt(11) Simplify (1-3sqrt(540))/(sqrt(15)/(sqrt(3)3-3)) + -3. -3 + 162sqrt(3) Simplify (-4(sqrt(180) - (sqrt(180) + 1)) - (sqrt(5) + -2 + sqrt(5) + -2 + 4 + sqrt(720)))*2. -112sqrt(5) + 996 Simplify ((2 + (-3 + 1sqrt(99) - sqrt(99)) + -5 + 0 + -3)2)*2. 324 Simplify (5 + sqrt(192) + 1 + sqrt(192) + (sqrt(192) + 1)-1 - -1((sqrt(192) - (1 + sqrt(192))) + -1 + (1 + sqrt(192))-2))*2. -16sqrt(3) + 193 Simplify 3(-6-4(1 + (3 + -1sqrt(242) - sqrt(242) - (sqrt(242) - (sqrt(242) + -1 + -2))))5)2. -1900800sqrt(2) + 41860800 Simplify (1 + (sqrt(13) + -1sqrt(13) + 4 + (-1sqrt(143))/sqrt(11))*2 - (((sqrt(52) - sqrt(156)/sqrt(3)) + sqrt(52))2)/(-1sqrt(324))) + -5. -70sqrt(13)/9 + 25 Simplify 4 + -4((2 + -2sqrt(847) - (-3 + 2sqrt(847)))2 - (2sqrt(847)6 - 12sqrt(847))2). 1760sqrt(7) + 284496 Simplify (-2sqrt(130)5 + sqrt(130))/(sqrt(50)/sqrt(5)-3) + ((sqrt(104) + -2sqrt(104))5 + sqrt(104))/(sqrt(800)2). 14sqrt(13)/5 Simplify -6(1(3 + sqrt(72)1 + 2 - ((sqrt(72) - (sqrt(72) - (1 + sqrt(72))-3)) + 4-2sqrt(72))))2. -62592 - 6912sqrt(2) Simplify 3 + -2 + ((sqrt(170)-2)/sqrt(10) + 4 + 4 + sqrt(153)/(sqrt(36)/sqrt(4)))2 + 3. -16sqrt(17) + 85 Simplify (-62sqrt(1440)-6)/((-2sqrt(2304))/(-2sqrt(8)/sqrt(4))). 36sqrt(5) Simplify (3sqrt(539)265 - (sqrt(539) - (2 + sqrt(539))-2 - (sqrt(539) + 0 - sqrt(539))-3))*2. -9912sqrt(11) + 16886347 Simplify (4 + ((sqrt(640)-6)/((sqrt(5) - -3sqrt(5) - sqrt(5))-5))23 + 3)-4. -6844/25 Simplify (-3(-5(sqrt(832)-3 + 4) - ((2sqrt(832) + sqrt(832) - sqrt(832)) + -3 - sqrt(832))2))*2. -26208sqrt(13) + 1267236 Simplify ((5(sqrt(440) + -1sqrt(440) + sqrt(440) + sqrt(440)))/((sqrt(392) - -1sqrt(392) - sqrt(392)) + sqrt(392)))/(2sqrt(55)/(sqrt(704)/sqrt(4))). 10sqrt(11)/7 Simplify 4 + ((sqrt(90)/sqrt(5) - (-1 + sqrt(2))-4) + -1 + sqrt(242) + -1)*2 + -4 + 2. -216sqrt(2) + 686 Simplify ((-1sqrt(100)-1)/((sqrt(20) - 3sqrt(20))/sqrt(5)))/(sqrt(500) + (-1sqrt(500) - sqrt(500)) + sqrt(500) + 4sqrt(125)). -sqrt(5)/40 Simplify (4 + -3 + sqrt(34)/sqrt(2) + 2sqrt(2448) + 1 + -4 + sqrt(102)/sqrt(24) + 2)*2. 44217/4 Simplify (-1(-3 + sqrt(288) + 0 + 2sqrt(288)1 - (3 + 0 + sqrt(288) + -1sqrt(288)-3)) + 2)*2. 192sqrt(2) + 352 Simplify ((sqrt(19) + 0)-5 + 3 + sqrt(76) + ((sqrt(209)2)/sqrt(11) - (-1 + sqrt(475))) + 2)*2. -72sqrt(19) + 720 Simplify (-4(sqrt(19) - sqrt(19)-4))*2 + (sqrt(76)-4 + sqrt(76))/sqrt(4) + (5 + sqrt(19)-2 + sqrt(19))2 + (-3sqrt(133))/sqrt(7). -16sqrt(19) + 7644 Simplify ((-5sqrt(196)1)/(sqrt(28)-5))/(-3sqrt(100) - sqrt(100)-1). -sqrt(7)/20 Simplify (3sqrt(20)/sqrt(810) - ((sqrt(20)/(sqrt(40)/sqrt(4)))2 - ((sqrt(242)-2)*2 - sqrt(2)))) + 5. -2sqrt(2)/3 + 971 Simplify ((6(sqrt(68) + 1sqrt(68)))/sqrt(2))/(sqrt(8)/(sqrt(12)/sqrt(3)4)) + 3 + -3. 48sqrt(17) Simplify -3 + (63(2sqrt(91) + sqrt(91)))/((-4sqrt(28)/sqrt(4) - sqrt(7))5)-3. -3 + 162sqrt(13)/25 Simplify (-5 + (sqrt(243) + (-31sqrt(243) - sqrt(243)) + sqrt(243)-11)/((2sqrt(99)2 + sqrt(99))/(sqrt(11) + sqrt(11) + sqrt(539)-1)))*24. -480sqrt(3) + 1828 Simplify (sqrt(180) + -1)-5 + ((sqrt(180) + -2 + sqrt(180) - sqrt(180)) + -3)*2 - ((1 + sqrt(180) - sqrt(180))3 + -3 + 3)*2. -90sqrt(5) + 201 Simplify -2 + (3 + sqrt(180) + -1 + -3 - 4(sqrt(180) + ((0 + sqrt(180))2 + sqrt(180))5)) + 1. -3602 - 138sqrt(5) Simplify (-4((sqrt(567) + -1)5 + 1) - (2 + 5 + sqrt(567) + sqrt(567)-2 + 5))*2. -1368sqrt(7) + 204703 Simplify ((sqrt(44)-3)21 - ((sqrt(22)-1 - sqrt(22))/sqrt(2) + -3)) + 0 + -2. 2sqrt(11) + 397 Simplify ((sqrt(18) - sqrt(18)31) + sqrt(1800)-2)/(((2sqrt(12) - sqrt(12))-6)/sqrt(128)) + -2. -2 + 88sqrt(3)/3 Simplify -3(((sqrt(24) - 2sqrt(24))3)/(sqrt(432)2 + sqrt(432)) + (sqrt(1944)-2 + sqrt(1944))/(-4sqrt(192)))-4. 19sqrt(2)/4 Simplify 1 + 2((sqrt(75) + sqrt(75) + (sqrt(75) + 1)-1)*2 - (sqrt(75)-4 + -5)*2)-4. 1680sqrt(3) + 9193 Simplify ((3sqrt(66) + sqrt(66) + sqrt(66))-1-5)/((sqrt(66)-5-3 + sqrt(66))/sqrt(11)) + -5. -5 + 25sqrt(11)/16 Simplify ((sqrt(77) - (sqrt(77) - (sqrt(77) + (1sqrt(77) - sqrt(77))3)))2)/(-3-2sqrt(396)) + -5. -5 + sqrt(7)/18 Simplify (5(-4 + 4 + -6-2sqrt(1584))46-4)*2. 52553318400 Simplify ((sqrt(187) + 2sqrt(187)2)5-6)/(3-2sqrt(275)-1). -5sqrt(17) Simplify (1 + sqrt(2736) + 5 + (21sqrt(2736) - sqrt(2736) - sqrt(2736)) + sqrt(2736) + -3)2 + (-2 + (-1(sqrt(2736)-1 + sqrt(2736)))2 + sqrt(2736))4. 192sqrt(19) + 10945 Simplify -1 + (-6(-5 + 2(-1 + sqrt(605))) + -3)2-6 + 5. -531842 + 61776sqrt(5) Simplify 3((5 + sqrt(325)-1 - (sqrt(325)2-4)2) + (2sqrt(325)1 + -3(0 + sqrt(325) + sqrt(325)))*2)-5. 75sqrt(13) + 233925 Simplify 4(-5sqrt(130)-2-1)/(sqrt(640) - (sqrt(640) - ((sqrt(640)-2 + sqrt(640))5 - sqrt(640)))). 5sqrt(13)/6 Simplify 4((-6sqrt(228)-1 - sqrt(228))/(sqrt(24)/(-1sqrt(2))) + (-2 + 2sqrt(304) + -1)2) + -4. -212sqrt(19) + 4896 Simplify 6((sqrt(60) - (sqrt(180) - sqrt(180)1)/sqrt(3) - sqrt(60)) + (-2sqrt(240) + sqrt(240) + sqrt(240))/sqrt(4))/(sqrt(1200)1-5). 0 Simplify (5(sqrt(3645) + sqrt(3645)3) - sqrt(3645))/(sqrt(54)/sqrt(6)2-2)-5. 855sqrt(5)/4 Simplify ((-1 + -1 + ((sqrt(847) - (3 + sqrt(847))) + 1 - (sqrt(847) + 3)2))*2 + 3)-4. -13964 - 1760sqrt(7) Simplify -4-5(-4(1(sqrt(1300) - (sqrt(1300)-2 + sqrt(1300)) - sqrt(1300) - sqrt(1300)) + 2(3sqrt(1300) - sqrt(1300))))*26. 39936000 Simplify ((-3 + -3(sqrt(2268) + -2)-5)-3 + 3)2. -165240sqrt(7) + 4603104 Simplify -1 + 3(sqrt(1216)-2 + -5) + -5(sqrt(304) - (0 + sqrt(304) + 1)2). -28sqrt(19) + 1509 Simplify 3(4 + -3(sqrt(78)-1)/sqrt(6) - ((sqrt(1300)-1 - sqrt(1300))2 + (sqrt(65)/sqrt(80))2)). -249447/16 + 9sqrt(13) Simplify (sqrt(864)2)/sqrt(2)-6 + sqrt(3) + sqrt(3) + 3 + 0 + -2sqrt(3) + 1. -144sqrt(3) + 4 Simplify (3sqrt(1800) + (-1sqrt(100))/sqrt(2))/(6((sqrt(10) - sqrt(40)) + sqrt(10)) + sqrt(50)/sqrt(80)). 68sqrt(5) Simplify 2(-5(sqrt(308) - (sqrt(308) - (sqrt(308)-1 + sqrt(308)) - sqrt(308)))/sqrt(7))/(sqrt(8)/(-2sqrt(18))). 60sqrt(11) Simplify (3 + (2 + (3 + sqrt(4800) + 1)*2 + 2)5)3. 4800sqrt(3) + 72309 Simplify ((1sqrt(1536) - sqrt(1536)) + sqrt(1536))/(sqrt(32)/(sqrt(8)/sqrt(2))) - ((sqrt(27)/sqrt(3))/sqrt(3) - (1sqrt(432) - sqrt(3)))*2. -300 + 8sqrt(3) Simplify (3 + (-3(-4sqrt(114)/sqrt(3) - sqrt(38)))/((sqrt(2156)/sqrt(11))/sqrt(2)) + 2)*2. 150sqrt(19)/7 + 5500/49 Simplify ((sqrt(88) - (-2sqrt(88) - sqrt(88)))-56)/(-6sqrt(704)-22). -5sqrt(2)/4 Simplify (-1 + ((4(sqrt(72) - 2sqrt(72)) + sqrt(72) + sqrt(72))/sqrt(12))/(sqrt(4)/sqrt(2)6 - (sqrt(18)/(sqrt(36)/sqrt(4)) - sqrt(2))))*2. 2sqrt(3)/3 + 4/3 Simplify -5 + ((-2(sqrt(110) + (-1sqrt(110) - sqrt(110)))6)/(sqrt(70)/(-1sqrt(7)) + sqrt(10) - (sqrt(40)/sqrt(4)2 + sqrt(10)))2)*2. 699 Simplify 2(3 + -1 + (sqrt(1100) - (sqrt(1100) + 3)) + 1 + (-1 + sqrt(1100) + sqrt(1100) + 3 + sqrt(1100))*2) + 2. 240sqrt(11) + 19810 Simplify (-5 + -6((sqrt(243) - (sqrt(243) + -1)-4 - (1 + 2sqrt(243))) + -2(sqrt(243) + 1 + 1)))*2. -5292sqrt(3) + 11149 Simplify ((-3-3(sqrt(6) - sqrt(42)/(sqrt(21)/sqrt(3))))/((sqrt(27) - sqrt(189)/(-1sqrt(7)))-2))*2. 0 Simplify (((sqrt(1512)1 - sqrt(1512)) + sqrt(1512) + 4sqrt(126)/sqrt(3))-4)/(sqrt(1944) + sqrt(6) + sqrt(42)/(sqrt(7) - sqrt(252))). -100sqrt(7)/47 Simplify -1((sqrt(96)/(-4(sqrt(4) + (sqrt(4) - sqrt(36))) - sqrt(4)))/(sqrt(24)/(sqrt(9)/sqrt(3)) - (sqrt(8) + -21sqrt(8) - sqrt(8)))-6)*2. -4/3 Simplify (-3(sqrt(720) + -53sqrt(720) + (sqrt(720) - sqrt(720)*2 - sqr	{ "pile_set_name": "DM Mathematics" }
b be o(1). Suppose -bv + 12v + c = 0. Is v composite? False Let g(f) = 130f2 - 3f. Let n be g(-3). Suppose 0 = -8w + 237 + n. Is w prime? False Let p be -4 + (-26)/(-2)683. Suppose -4z = 5l - p, 5z + 3001 - 14067 = 3l. Is z composite? True Let l = -352 + 585. Is l prime? True Suppose 0 = -2z - 4, 20164 = 3w + w - 4z. Suppose -5j - w = -20544. Is j a prime number? False Let x be (20/6)/((-4)/18). Let g = -8 - x. Suppose 2y - gy + 30 = -r, 0 = 4y + 2r - 38. Is y a prime number? True Suppose 4p + 4c = -84, -4c = -2p - 8 - 46. Let t(g) = -48g3 + 2g*2 + 3g. Let o be t(-2). Let j = o - p. Is j a prime number? True Suppose z - 5z = -3b - 23615, -b + 23627 = 4z. Is z a prime number? False Let z = -1051 - -4178. Is z composite? True Let p(f) = 101f + 4. Let y be 18/(-3) - -3 - -9. Let x = -3 + y. Is p(x) a composite number? False Suppose 3o - 2h + 5 = -7h, 5 = -o - 5h. Let l be 0(o - (-2)/(-4)). Suppose l = -3g + 180 + 21. Is g a composite number? False Suppose -2n = -4l - 2, 2l - 14 = 2n + 2n. Let s(a) = -29a3 - a2 - 8a - 4. Let u be s(l). Let k = -547 + u. Is k a prime number? False Let a(l) = -l2 - l + 4. Let x be a(0). Suppose 0 = -xo + w + 335, -3w - 3 = 6. Let k = 268 - o. Is k prime? False Let c be (100/30)/((-2)/(-21)). Let t = 514 - c. Is t a prime number? True Let j = 229 + -381. Let p = 990 + j. Is p a composite number? True Let d(g) = 1585g*2 + 22g + 20. Is d(-1) a composite number? False Suppose -2i + f + 2f = -1, -f - 7 = -2i. Let t(n) be the second derivative of 3n*5/20 - 5n*3/6 + 5n*2/2 + 15n + 1. Is t(i) a prime number? False Let l(n) = n - 1. Let c be l(6). Suppose -4j = -m + 28 + 18, -cm = 3j - 138. Is (m/24)/(3/708) a composite number? True Let l = 11 + -8. Suppose -2617 = -5j - y, -4j - ly = y - 2084. Is j/9 - 18/81 a prime number? False Let a be (3/((-15)/6905))/(-1). Let w = -636 + a. Is w a composite number? True Let b(d) = 2d2 - 2d + 2. Let f be b(3). Suppose -ft = -24t + 48910. Is t composite? True Let c(j) = 3 + 3j + 2j*2 + 39j*2 + 59j*2. Suppose 0 = 3y + 2r - 4, 5y + r + 8 = 3. Is c(y) prime? True Suppose -2 + 4 = a. Let t(m) = -m3 - ma - 27 + 2m3 + 82 + m. Is t(0) prime? False Let m(w) = 16w - 161. Is m(18) a prime number? True Suppose -3 = -x - 0. Suppose u = -x - 4. Let p(b) = -b*2 - 9b + 5. Is p(u) a composite number? False Let w(h) = 21h2 + 9h + 13. Is w(11) composite? True Suppose -26467 - 190050 = -7s. Is s prime? True Let x(w) be the first derivative of w2/2 - 8w - 7. Let p be x(8). Suppose -s + 205 = -ps. Is s composite? True Suppose 4b - 3b = 3. Is (12/16)/(b/156) prime? False Let k be (-10)/(-25) + 8/5. Suppose -5l - k = -12. Suppose 0 = -lh + 67 + 99. Is h a prime number? True Let o(r) = 68r*2 - 22r - 157. Is o(-28) composite? True Let j(w) = 228w2 + 4. Let h(y) = -y2 + 10y - 6. Let r be h(9). Let s be j(r). Is (s/(-16))/((-1)/2) a composite number? False Let z be -3(-4)/121. Let k(r) = z + 3r - 2r + 4r. Is k(1) prime? False Suppose y - 99 = 548. Let d = -240 + y. Is d composite? True Let k = -2983 - -5444. Is k a composite number? True Suppose 7c - 26576 = 23271. Is c a prime number? True Suppose 5h - 3h + 8 = 2k, 0 = -5k - 2h + 13. Let m = 198 + -198. Suppose 5a - 3y = 4a + 133, m = ka + y - 349. Is a composite? True Suppose -23956 = -26g + 12678. Is g prime? True Let f = 5 + 5. Is (11740/(-25))/((-4)/f + 0) a prime number? False Suppose 0 = o + 3q - 4, -2o - o = 2q + 2. Let s be (o - -3)(0 + 0). Suppose -c - 3r + 402 = -4r, s = 5c + r - 1980. Is c composite? False Let u = 609 - -542. Is u prime? True Let k(x) = -x2 + 19x + 5. Let c be k(20). Is 8980/c-3 + 3/(-1) a prime number? False Let q be -1488((-4)/6 + (-8)/(-6)). Let r = 1401 + q. Is r a composite number? False Suppose -l = 5h - 2609, -12h = -4l - 14h + 10400. Is l prime? False Let k(m) = 214m2 + 5m - 123. Is k(10) a prime number? False Let b(p) = -39p3 + 13p*2 - 10p - 47. Is b(-9) composite? False Suppose 3f - 2f - 5 = 0. Suppose -23 - 6 = -s + 5o, -fs + 91 = 2o. Is s a prime number? True Let c be ((-14)/(-6) - 3)/((-8)/1932). Suppose 2g = -0g + 8. Suppose -3m = -gm + c. Is m a prime number? False Let n = 12666 - 5303. Is n composite? True Suppose 11f - 56 = 3f. Is (-1481)/(-2)(f + -5) a composite number? False Let x(i) = -216i2 - 2i + 1. Let r(j) be the second derivative of -j*4/12 + 4j. Let m(s) = 6r(s) - x(s). Is m(1) composite? False Suppose 70 = -2i - 832. Is (14/8)/7 - i/4 a prime number? True Suppose -3g - m - 14 = 0, -g + 5m - 4m = 2. Let q be (-6)/(-1) - (g + 8). Is (q/5)/(4/2780) prime? False Let z(h) = 21h*2 + 31h + 87. Is z(-25) a prime number? True Let v = -5 + 1. Let l be -6 + (-4)/v4. Is 92/l7/(-2) composite? True Let k(w) be the second derivative of -14w3/3 + 3w*2/2 + 24w. Is k(-26) prime? False Let k(a) = 18a2 + a - 12. Let o be k(7). Suppose 3f = -n - 0n + o, 0 = 5n + f - 4385. Is n composite? False Let j(k) = 3k - 15. Let y be j(6). Let a(m) = -92m3 - m2 + 1. Let t be a(-1). Suppose -2x = -x - s - t, -yx - 3s + 246 = 0. Is x composite? True Suppose 4c - 11c = -980. Let w = 3499 - c. Is w prime? True Let o = 2399 - -13436. Is o a prime number? False Suppose 0 = -c - 2b + 5, 2c - 3b + 2 - 5 = 0. Suppose 5p = cp + 678. Is p a prime number? False Let t be (417/6)/(1/62). Suppose -3681 = -2b + t. Is b/15 - 6/(-9) composite? True Is ((-2)/4)/(3(-1)/5322) a prime number? True Suppose -5f + 4f = -1. Suppose h + 1 = -0, g + h = -f. Suppose -5u = g, 0u - 385 = -5z - 2u. Is z a composite number? True Is (-79 - -2844) + (1-12)/2 composite? True Suppose -n - v = -4249, -4n - 12747 = -7n + 3v. Is n a composite number? True Suppose 0 = 9k - 14k. Suppose k = -4q + 3q + 3413. Is q prime? True Suppose 0 = -5r - 3b + 24, -2r + b = r - 6. Suppose -w + 2w - 1257 = -5j, -1010 = -4j - rw. Is j a composite number? False Suppose 15 = 2k - k. Let m = -14 + k. Is (99/(-9))/((-1)/m) composite? False Suppose -4d + 4b + 11360 = 0, -b + 1297 + 1545 = d. Is d a composite number? True Let t = 29842 - 17475. Is t prime? False Is ((-2)/(-5))/(-103/(-137850)) a composite number? True Let l = 11 + -31. Is (l/6)/(16/(-9528)) prime? False Let y(z) = 110z*2 - 225z*2 + 17z*3 + 116z*2 + 5 - z. Is y(2) composite? True Let h(o) = 13o - 7. Suppose 0 = -4x - 8 + 56. Suppose -27 + x = -3i. Is h(i) a prime number? False Let t(x) = -2x - 10. Let n be t(-7). Let h = -15 + n. Let g(o) = o3 + 12o*2 + 7o - 7. Is g(h) composite? False Let q(o) = 18o + 13. Let m(v) = 18v + 14. Let r(y) = -4m(y) + 3q(y). Let t(x) = -2x3 + 2x*2. Let k be t(2). Is r(k) a composite number? False Let y(m) = 4m*3 - 4m*2 + 2m + 5. Let z be (2/6)/(2/30). Is y(z) prime? False Let m(s) = -49s3 - s2 + 1. Let i be m(1). Let r = 212 + i. Is r composite? False Is 14126/7 + 0/(-1) prime? False Let h = -39 + 42. Suppose 24999 = hi - 1818. Is i prime? False Let i(t) = -t*2 + 9t + 26. Let d be i(11). Is (99700/40)/(2/d) a composite number? True Suppose 0h - 2h = 3c - 10113, -6742 = -2c + 3h. Is c prime? True Is 9/24 + (-1675331)/(-56) prime? True Suppose 0 = m, -2a + 11626 - 3340 = 3m. Is a prime? False Suppose -97s + 1077 = -96s. Is s prime? False Let m(u) = -678u - 2. Let z(b) = -1355b - 3. Let t(v) = -7m(v) + 3z(v). Is t(4) prime? True Is ((-2746)/6)/(4/(-12)) a composite number? False Suppose -y = 4m - 8, 7m - 3y - 21 = 4m. Suppose 1855 = mw + 2w. Is w a composite number? True Let f(y) = 499y*2 + 6y - 46. Is f(-9) composite? True Suppose 3c - 5m + 13 = -m, 4c = m. Is 2 + 0 + c + (535 - -3) a prime number? True Let j(o) = 60o*2 - 81o - 28. Is j(13) composite? False Let m(l) = 8l2 - 10l + 9. Suppose -2c - 1 = -3v, -6c + 2c = -v - 23. Is m(c) a prime number? True Is -508(-1 + (4 - (-395)/(-20))) a composite number? True Let v(m) = 43m*2 - 12m - 6. Is v(5) composite? False Let b = 519 + 92. Is b prime? False Let x(l) = l*3 + 6l*2 - 3l + 17519. Is x(0) a composite number? False Let z be 2/((-1)/42). Let c be 2/(z + 36/8). Suppose -2j = 0, -cy = -8y - 5*j + 636. Is y composite? True Suppose	{ "pile_set_name": "DM Mathematics" }
t(k) be the third derivative of k6/600 + k5/100 - k*4/5 + 19k3/2 + k2 - 49. Let x(f) be the first derivative of t(f). Factor x(b). 3(b - 2)(b + 4)/5 Factor 24970c2 - 1246700/3c + 1300/3c3 + 5/3c*4 + 4598405/3. 5(c - 7)*2(c + 137)*2/3 Let m = -167 + 172. Factor 7n*m - 10n*3 + 10n*2 - 5n*3 + 2n*5 - 4n*5. 5n*2(n - 1)*2(n + 2) Let m(v) be the second derivative of v*5/30 + 10v*4/3 + v + 517. Factor m(w). 2w*2(w + 60)/3 Suppose -179m - 4 = -171m - 4. Let c(y) be the first derivative of my + 1/5y*5 - 1/2y*4 + 0y2 - y3 + 31. Let c(l) = 0. What is l? -1, 0, 3 Let a(h) be the first derivative of 35/3h3 + 22 + 5/4h*4 + 0h + 15h2. Solve a(r) = 0 for r. -6, -1, 0 Let d(x) be the second derivative of x7/2520 - x6/90 - 3x*5/40 + 27x*4/4 - 3x - 11. Let b(q) be the third derivative of d(q). Factor b(n). (n - 9)(n + 1) Suppose -2 = -4b + 2b + 2j, b - 9 = -j. Find a, given that 15a4 - 15a2 - a3 + 15a5 - 5a*b - 5a - 4a3 = 0. -1, -1/2, 0, 1 Let 21169v*4 - 21171v*4 + 16v*2 + 10v*3 + 43v - 139v = 0. What is v? -3, 0, 4 Let o be 116/357 + 304/(-7752). Factor -2k*2 - 16/7 + ok*3 + 4k. 2(k - 4)(k - 2)(k - 1)/7 Determine k, given that -3541k + 2k4 + 3108k*2 + 126224 - 3543k - 14314k - 16943k + 5805k - 130k*3 = 0. 14, 23 Let r = -7142/11 + 21778/33. Factor 88/3o - r - 10/3o3 - 16/3o*2. -2(o - 2)(o + 4)(5o - 2)/3 Let t(f) be the second derivative of 3f*5/20 + 9f*4 + 251f*3/2 + 324f*2 - 7f + 251. Suppose t(u) = 0. What is u? -27, -8, -1 Let l(d) be the first derivative of d*7/147 - 8d6/105 + d5/10 - 39d - 154. Let j(x) be the first derivative of l(x). Factor j(h). 2h*3(h - 7)(h - 1)/7 Let b(r) be the first derivative of 0r*3 + 27/5r*5 + 0r*2 - 1/2r*6 + 0r + 132 - 6r4. Factor b(q). -3q*3(q - 8)(q - 1) Let c = 849 - 847. Factor -hc + 18 - 8h - 9h + 14h. -(h - 3)(h + 6) Solve 18/5o + 35 - 1/5o2 = 0. -7, 25 Suppose 915/8l*4 - 141/2 + 9/4l*5 - 191/2l + 1911/8l2 + 821/2l*3 = 0. Calculate l. -47, -3, -2/3, 1/2 Suppose 0 = 19r - 5r - 126. Solve 511g*3 - 4g*5 - 517g*3 + rg4 + g5 = 0 for g. 0, 1, 2 Let y(q) = q*2 + 30q - 19. Let v be y(-31). Let x be ((-4)/v - (-2)/(-3)) + 4. Factor 20r + 0r*3 - 10r*2 - 24 + 64 - 5r*x. -5(r - 2)(r + 2)2 Let j(n) be the first derivative of -n4/54 + 4n*2/9 + 43n - 75. Let l(p) be the first derivative of j(p). Factor l(x). -2(x - 2)(x + 2)/9 Let v = 54334/3 - 380326/21. Factor -12/7y + 8/7 + vy*2. 4(y - 2)(y - 1)/7 Let z(j) = -2j*2 - 35j - 54. Let b be z(-16). Let o be b/12 + (-18)/(-4). Factor 0 + 0n2 + 2/3n*5 - 4/3n*3 + 0n - 2/3no. 2n*3(n - 2)(n + 1)/3 Let l(v) be the first derivative of -4v*3/3 + 624v*2 - 97344v + 2339. Suppose l(b) = 0. Calculate b. 156 Let d(x) be the second derivative of -3x5/20 - 23x*4/4 - 107x*3/2 - 255x*2/2 - 3419x. Find w, given that d(w) = 0. -17, -5, -1 What is p in -7p + 7p - 3218p2 + 2p*3 + 1480p2 = 0? 0, 869 Let c(t) = -t3 - 5t2 + 17t - 11. Let h be c(-8). Suppose 15 = -2i + h. Determine b, given that -15 - 16b*2 + 18 - 52b - i = 0. -3, -1/4 Let c(a) be the first derivative of 10/3a2 - 8a - 244 + 4/9a3. Factor c(p). 4(p - 1)(p + 6)/3 Let i be (-164)/(-2) + 1099756/(-13671). Determine v so that 2/9v*4 + 0 + 28/9v*2 + 16/9v + iv3 = 0. -4, -2, -1, 0 Let o = 392 - 390. Determine l so that 115 + 84l - 253 + 318 - 4lo - 4l3 = 0. -3, 5 Let p(k) be the second derivative of k4/30 + 3568k3/15 + 3182656k*2/5 + 4k - 648. What is b in p(b) = 0? -1784 Let c = 4036 + -4036. Let g(i) be the second derivative of 2/5i5 + 3i*3 - 2i*2 - 2i*4 - 18i + c. Let g(m) = 0. What is m? 1/2, 2 Let v be 178/267 + -1 + (-19)/(-3). Let i be -2 - (-7 + -1 + 4). Let -5n + 10n*2 + vn*i - 11n*2 = 0. Calculate n. 0, 1 Factor 2806j + 1167j2 - 3j*3 - 1946j + 1486j. -3j(j - 391)(j + 2) Let s(z) be the first derivative of 2z3/33 + 1554z*2/11 - 3110z/11 - 4697. Solve s(u) = 0. -1555, 1 Let j = 175/51 - -721/102. Factor ji2 - 41/2i + 6 + 12i3 + 2i*4. (i + 3)(i + 4)(2i - 1)*2/2 Let r be 10((-1273)/(-76) + -17) - -3. Find k such that 5k - 25/2 - rk*2 = 0. 5 Factor 1092/5u*3 + 4332/5u*2 + 0 + 3/5u*4 + 864u. 3u(u + 2)*2(u + 360)/5 Let g(q) be the first derivative of -q*6/60 + 3q*5/4 - 28q*4/3 - 5q*3/2 + 225q*2/4 - 50q - 89. Let y(d) be the first derivative of g(d). Factor y(h). -(h - 15)*2(h - 1)(h + 1)/2 Let n be ((-8)/2)/4 - 11. Let c = 17 + n. Factor -10j*3 + 16j2 - jc + j*3 - 8j*3 - 6j + j*2 + 7j*4. -j(j - 3)(j - 2)(j - 1)*2 Let u be 3/3 - 12/(-348)-29. Let l(q) be the third derivative of -1/600q6 - 44q*2 + 0 + 0q*3 + 0q + uq4 + 1/300q5. Factor l(f). -f2(f - 1)/5 Let q(k) = 2k*2 + 12k - 23. Let b be q(-11). Factor 0t4 - bt*5 - 4t*2 + 5t*4 + 5t*3 + 82t5 - t2. -5t2(t - 1)*2(t + 1) Factor 1/4m5 + 101/4m*4 + 1349/2m*3 + 7301/4m + 2401/4 + 3749/2m2. (m + 1)3(m + 49)*2/4 Let j(s) be the second derivative of 1010025s*4/4 - 2010s*3 + 6s*2 - 308s + 3. Factor j(o). 3(1005o - 2)2 Let p(t) be the third derivative of t6/180 + 2t5/9 + 17t*4/36 - 38t*3/9 - 3t*2 - 244. Factor p(s). 2(s - 1)(s + 2)(s + 19)/3 Suppose -3o - 114 = -3c, -3o - c - 50 = 52. Let h be 240/o + 6 - 185/(-175). Determine r so that 3/5r + hr3 - 1/5r4 + 0 + r2 = 0. -1, 0, 3 Let b(c) = -15c3 - 19c*2 + 15c + 4. Let n(r) = -7r3 - 8r*2 + 7r + 2. Let z(j) = -2b(j) + 5n(j). Factor z(w). -(w - 1)(w + 1)(5w + 2) Find i such that -186553i*3 - 4176i*5 + 4175i*5 - 2281024i*2 - 5249888 - 7140512 + 868i*4 - 9236480i + 3465i3 = 0. -4, 440 Let z(s) = -20s*3 + 5420s*2 - 3s - 5328. Let a(j) = 5j3 - 1355j*2 + j + 1331. Let v(c) = 23a(c) + 6z(c). Determine t so that v(t) = 0. -1, 1, 271 Let q(s) = 2s*2 - 3s - 34. Let z(o) = -o*2 + 2o + 17. Let c(y) = 2q(y) + 5z(y). Let l be c(6). Factor -lr3 - 7r + 13 - 9r2 - 15 - 2r4 + r4. -(r + 1)*3(r + 2) Suppose 7 = -13h + 33. Suppose -hp = -3r + 22, -r + 0r - 3p - 11 = 0. What is q in 3/2q2 - qr - 1/2 + 1/2q3 - 1/2q = 0? -1, -1/2, 1 Let i(k) be the third derivative of -k6/300 + k5/150 + 14k4/15 - 476k2. Suppose i(v) = 0. Calculate v. -7, 0, 8 Let x(f) be the third derivative of -f6/60 + 226f5/15 - 75f*4 - 11650f2. Determine c, given that x(c) = 0. 0, 2, 450 Let a(h) be the second derivative of h4/16 + 85h3/8 + 63h*2/2 - 412h - 2. Factor a(g). 3(g + 1)(g + 84)/4 Let v = -101985 + 101987. Factor 46d + 40/3 - 7/3d*v. -(d - 20)(7d + 2)/3 Suppose n + w - 4 = 0, 0 - 16 = -4n - 3w. Suppose 103 = nh - 5. Factor -18l3 + hl + 9 - 12l2 - 15l*4 + 4l*2 - 6l + 14l2 - 3l*5. -3(l - 1)(l + 1)3(l + 3) Let w(y) = 11y - 32. Let t be w(12). Factor -121g*2 + 4g - 5g + tg*2. -g(21g + 1) Let k be (-23)/(-6) + (-30)/(-180). Solve -213h*3 - 7h*2 + 38h*3 - 23h*2 + 0h*2 - 180hk = 0. -3/4, -2/9, 0 Let u(s) be the third derivative of -s6/120 + s*5/4 + 17s*4/24 - 7s*3/3 + 6s*2. Let p be u(16). Factor -9 + 9d + 15 + 3d3 - 9d*p - 9. 3(d - 1)*3 Let p be (-2 - 145/(-87))(3 + -4). Determine v so that 0 - pv - 37/3v*3 - 20v*4 - 12v*5 - 10/3v*2 = 0. -1/2, -1/3, 0 Let f(z) = 167z*2 - 333z - 2. Let m be f(2). Suppose -1/2s2 + 1/2s*4 + ms + 0 + 1/4s3 - 1/4s*5 = 0. What is s? -1, 0, 1, 2 Let n = 159643 - 1117495/7. Factor -4/7w - 2/7w2 + n. -2(w - 1)(w + 3)/7 Find u such that 12 - 25/2u*3 - 15/2u*2 - 9/2u*4 + 13u - 1/2u5 = 0. -4, -3, -2, -1, 1 Let c(v) be the third derivative of v6/40 - 23v*5/20 + 7v*4 + 40v*3 - 109v*2. Factor c(m). 3(m - 20)(m - 4)(m + 1) Suppose 36v - 99 = 3v. Let b(y) = 2y3 + 4y*2 + 8y - 16. Let c(z) = z*3 + 4z*2 + 8z - 16. Let s(m) = vb(m) - 4c(m). Factor s(k). 2(k - 2)2(k + 2) Let m be 27728/(-2457) + -1 + 13 + -2. Solve -6 + 27/7c - 3/7cm = 0 for c. 2, 7 Suppose 5k + 6 = -4l, 3l + 8 = 2k + 2l. Suppose 0 = 4g - 3i - 43, -ki + 0i - 22 = -2*g. What is h	{ "pile_set_name": "DM Mathematics" }
e fourth biggest value? (a) 2 (b) 3 (c) -2 (d) j c Let i = -0.2 + -0.3. Suppose 0d = 3d - 4m, -4d = m - 19. Which is the second biggest value? (a) i (b) -2/7 (c) d b Let p = -2686 + 5523/2. Let y = p + -75. Which is the fourth smallest value? (a) y (b) 4/7 (c) -1/4 (d) -0.1 b Let w = -59.344 + -0.056. Let m = w - -59. What is the biggest value in 5, m, -3/5, -1/7? 5 Let f(d) = 2d + 2d + 4 - 2d - d2 - 7d. Let t be f(-6). Let i be (-91)/(-3) - t. Which is the third biggest value? (a) -0.1 (b) i (c) 0 a Let u = -963 + 963.1. Which is the smallest value? (a) u (b) -10 (c) 0 (d) 8 b Let x = -226 - -221. Which is the biggest value? (a) 0.5 (b) -0.4 (c) x (d) -4/29 a Let h = -0.06 - 0.44. Let k = h + -1.5. What is the biggest value in 2, k, 4? 4 Let h = 24 - 43. Let p = 20.1 + h. Let i = -5.1 + p. What is the smallest value in i, 0, 0.5? i Let x = -79 - -85. Let s be (5/15)/((-14)/x). Let n = 179 - 1257/7. Which is the second smallest value? (a) 0 (b) n (c) s c Suppose -8f + 3 = -13. Let i be (-212)/420 + 1 - f/5. Which is the smallest value? (a) i (b) 0.07 (c) -0.1 c Let r = -0.06 - 7.94. Let q = 3.8 + -3.4. What is the third smallest value in r, q, -5? q Let u be (-14934)/1881 + 24. What is the smallest value in -2/3, u, 0? -2/3 Let k = -548 - -545. What is the fourth smallest value in 0, -1/4, k, -1/8? 0 Let k = 4 + -8. Let t = k - -6. Let f = 110 - 111. Which is the second biggest value? (a) -2/3 (b) t (c) f a Let h = 3 - 3.5. Let x = 0.278 - 0.069. Let r = x + -0.009. What is the third smallest value in -5, h, r? r Let f = -102 - -48. Let x be (-6)/f(3 + -5). Let z = 2 + -8. What is the smallest value in -1/5, z, x? z Let f = -21 + 22. Let v = 9.6 - 10.01. Let g = v + -2.59. Which is the biggest value? (a) 0.4 (b) g (c) f c Let y = 59/65 - 4/13. What is the smallest value in y, 0, -2/11, 5? -2/11 Let y be 18/48 - (-36)/32. What is the smallest value in 3, 1/3, y, 0.5? 1/3 Let q = -336 - -331. What is the second biggest value in q, 2/131, -0.5? -0.5 Suppose 3y = 4 + 2. Suppose -s + f - 17 = 0, s + ys + 53 = 4f. Let v = s + 17. Which is the third biggest value? (a) -1 (b) -15 (c) v b Suppose 8 = 4v, -2v = -c - 6v + 10. Suppose -4x + 6x = c. What is the second smallest value in x, -5, -2/89? -2/89 Let j = -1041.7 + 1042. What is the second biggest value in j, -2, -5, -41? -2 Let w(x) = -x - 8. Let y be w(-13). Suppose -6 = -yh + 14. Suppose 0 = -hd + 2d - 2. What is the second smallest value in -5, 4, d? d Let w = 1.072 - 1.072. Let o be (-3)/(2 + (-46)/(-4)). Which is the third smallest value? (a) w (b) o (c) -0.3 a Let s = -0.48 - -1.21. Let w = s - 1.03. Which is the biggest value? (a) w (b) -2 (c) 1/32 c Let w = -1337.3 + 1332.3. Let g = 578/7 + -82. What is the third biggest value in 10/7, g, w? w Let y be 0 + -1 + 2/3. Let n = -33.2 + 53. Let p = 20 - n. Which is the second biggest value? (a) p (b) y (c) -0.3 c Let k = 165 - 59. Let v = -109 + k. What is the biggest value in v, -5/2, 4, 4/3? 4 Let u = 74 - 77. Let c be (-56)/(-42)u/(-2). What is the second smallest value in -3, -4, c, 0.2? -3 Let p = -8 - -7.92. Which is the third smallest value? (a) 8 (b) p (c) 5 a Suppose -129i + 144i = 30. Let m = -3 - -7. Suppose 3k - 2f = m, -5 - 3 = -k + 2f. Which is the third biggest value? (a) i (b) 3 (c) k c Suppose 620 - 668 = -24s. Let v = -0.5 - -1. Let r = v - 1. What is the second smallest value in -0.4, s, r? -0.4 Let o = -2.93 + 26.93. Which is the second biggest value? (a) -5 (b) -0.4 (c) o (d) 2/7 d Let y = -1.235 + -0.365. Let z = -1.5 - 0. Let i = y - z. Which is the third smallest value? (a) i (b) 4/5 (c) 0 b Let l be 96/52 + (-10)/(-65). Suppose 3u + lu + i = 7, 3u + i = 5. Which is the biggest value? (a) -5 (b) -1/3 (c) -0.2 (d) u d Let v = -0.058 + 0.158. Which is the second smallest value? (a) -1 (b) v (c) 0.04 c Let j = -3 + 8. Let n = -2583 + 2582. Which is the third smallest value? (a) 1 (b) 4 (c) j (d) n b Let y = 104/55 - 12/11. Let w = -2.2 + 2. Let o be (-15)/(-12) - 1 - (-1)/(-4). What is the third smallest value in w, y, o? y Let u = 190 + -189.9. Which is the third biggest value? (a) 2 (b) 4 (c) u (d) 1/5 d Let l = -198.5 - -198. Which is the third biggest value? (a) l (b) -17 (c) 1/5 b Let t = 426 - 429. What is the fourth biggest value in t, -0.54, 0.1, 3? t Let s = 0 + -0.2. Let k = 0.085 + 1.275. Let r = -0.36 + k. What is the smallest value in r, -0.4, s? -0.4 Let t = 130 - 129.26. Let h = 0.94 - t. What is the smallest value in -4, h, 5, 0? -4 Let g = 2.2 - 2.24. Let z = g - 0.01. Let c = 0.45 - z. What is the smallest value in -0.5, -1/7, c? -0.5 Let d = 131 - 130.7. What is the third smallest value in d, -0.3, 0? d Let w = 2/107 + 208/321. Let b be (-1)/2 - 84/(-8). Let v = b + -5. What is the biggest value in w, v, 0.2? v Let i = 0.318 + 0.182. Which is the second smallest value? (a) 9 (b) -2 (c) i (d) 4 c Let a = -359 - -359.2. What is the third smallest value in -3, -0.5, 2, a? a Let g = 208 - 212. Which is the third smallest value? (a) -2/7 (b) -0.06 (c) g (d) 4 b Let x = 5374 - 5376. Let s be ((-6)/(-4))/(6/(-16)). Which is the third smallest value? (a) 5 (b) s (c) x a Let q be 5 - (1 + (-1)/(-1)). Which is the second biggest value? (a) 0.04 (b) -2/9 (c) q (d) 0.05 d Let v = 37 - 32. Let k be 3 + 0 - 99/22. What is the smallest value in 0.1, k, v, 3? k Let u be 4/14 + (-24)/(-161). Let o = u + -142/115. Which is the second smallest value? (a) 9 (b) o (c) 2/3 c Let p = 549 - 549.1. Which is the third smallest value? (a) p (b) 3/5 (c) -1 (d) -2/3 a Let j = 1363/7 + -194. Let t = -0.496 - -0.196. What is the second smallest value in t, j, 4? j Let f = 1 - 3. Let c = -31.7 - -31.7. What is the fourth smallest value in 0.3, c, f, -3/5? 0.3 Let n = 18 - 22. Let l = 72821/106 - 687. Let m = l + 111/530. Which is the third smallest value? (a) n (b) m (c) 4 c Let t = -0.316 + 0.126. Let w be 6/(-4)4/12. What is the second smallest value in w, -1, t? w Suppose 0 = -5w + 2g - 7 + 3, w = -4g - 14. Let y = -2348 - -2347. What is the third smallest value in w, -0.3, y? -0.3 Let i = 1124 + -1123.9. Which is the second biggest value? (a) i (b) 17/2 (c) -0.4 a Let i = -9.06 - -6.06. What is the third smallest value in 20, i, 0.1, 0.3? 0.3 Suppose 4t - 9 - 31 = 0. Suppose -3y + y - t = 0. Let n = 86 - 90. Which is the biggest value? (a) y (b) 3 (c) n b Let q = -77 + 537/7. Let h = -114/7 + 1040/63. Let y = -7 - -12. What is the third biggest value in q, y, h? q Let h = -2551 + 33165/13. Suppose -9 + 3 = 3t. Which is the third smallest value? (a) t (b) h (c) 2 c Let s(g) = 2g2 - 5g - 4. Let i be s(3). Let w = i - 1. Let n be (3 + w)(-2)/(-6). Which is the second smallest value? (a) n (b) 2 (c) -4 a Let d = 0.42 - 3.42. What is the smallest value in 2/21, d, -0.2, 5? d Let r = -1 + 0. Let l = 303 + -175. Let t = l - 128.04. What is the biggest value in r, 0.5, t? 0.5 Let o = -29.01 - -20.01. Let r = 3 + -2. What is the second biggest value in 0.4, r, o, -3? 0.4 Let y = -23.2 + 28.2. Which is the fourth smallest value? (a) -3 (b) 0.3 (c) y (d) -0.045 c Suppose -4f - 27 = 65. Let j = f + 21. Suppose 2 = -4x - u, 2x - u - 6 = 2u. What is the second biggest value in j, x, 3/5? x Suppose 4u + 5d = 4d - 20, -u - 5d = 24. Let n = u + -41. Let m = -136/3 - n. Which is the third smallest value? (a) -5 (b) m (c) 0 c Let k = 110.01 - 110. Which is the second biggest value? (a) 0.4 (b) k (c) -0.1 b Let q be (0 + (-2)/4)/(130/40). Let c = 23 - 22. What is the second smallest value in 0, c, -0.5, q? q Let f = -66.99 - -0.99. Let g = -44 - f. Let x = g - 27. Which is the smallest value? (a) 4/3 (b) x (c) 2 b Let p = -1.463 - 2.537. Which is the third smallest value? (a) -0.4 (b) -0.34 (c) p b Let q be (-4)/10 - ((-1530)/200 + 7). Which is the second smallest value? (a) -2 (b) -95 (c) q a Suppose 2 = 2j - 2. Suppose jq - 15 = f, 5q - 16 - 19 = 3f. Suppose 4v = -v - q. Which is the smallest value? (a) -1 (b) v (c) 2 b Let g = -74 + 72.7. Let n = 0.4 + g. Which is the third biggest value? (a) -2 (b) 0.2 (c) n a Let o = -13.88 + 4.88. Which is the bi	{ "pile_set_name": "DM Mathematics" }
-1895, -1883, -1857, -1811, -1739, -1635, -1493? -1307 What is next in 1829454, 3658905, 5488356? 7317807 What is next in 11023, 44046, 99083, 176134, 275199? 396278 What comes next: -181, -377, -579, -781, -977? -1161 What comes next: 16553, 33136, 49717, 66296, 82873, 99448? 116021 What is the next term in 9, -340, -1313, -3228, -6403, -11156, -17805? -26668 What comes next: -6099, -6153, -6207? -6261 What comes next: -240, -929, -2068, -3645, -5648, -8065, -10884? -14093 What comes next: -12767, -25556, -38333, -51092, -63827, -76532? -89201 What is next in 2207, 4400, 6619, 8864, 11135? 13432 What comes next: -272, -647, -1022? -1397 What is the next term in 22398, 44810, 67234, 89676, 112142, 134638, 157170, 179744? 202366 What comes next: -126, -1421, -3580, -6603? -10490 What is next in 7587, 15177, 22767, 30357? 37947 What is next in 713, 630, 539, 434, 309, 158, -25? -246 What is the next term in 140832, 140875, 140946, 141045, 141172? 141327 What is the next term in 45017, 45014, 45009, 45002, 44993, 44982? 44969 What is next in -8944, -17890, -26836, -35782? -44728 What is the next term in -279, -742, -1527, -2646, -4111? -5934 What is the next term in 432284, 432293, 432306, 432323, 432344, 432369, 432398? 432431 What is next in -28177, -28180, -28183? -28186 What is next in -557, -2415, -5495, -9791, -15297, -22007? -29915 What is the next term in 435, 852, 1267, 1680? 2091 What is next in 88, 382, 928, 1774, 2968, 4558, 6592, 9118? 12184 What comes next: 240, 566, 892? 1218 What is next in -46, -122, -280, -562, -1010? -1666 What is next in -9898, -9900, -9902, -9904, -9906, -9908? -9910 What comes next: 188, 313, 438, 563, 688, 813? 938 What is the next term in -344, -688, -1028, -1364, -1696, -2024? -2348 What is the next term in -11496, -11485, -11474? -11463 What is next in -32780, -32927, -33074, -33221? -33368 What is next in 110, 305, 836, 1871, 3578, 6125, 9680? 14411 What comes next: 12492, 12490, 12488, 12486? 12484 What is next in 701867, 701863, 701859, 701855? 701851 What comes next: 151327, 302658, 453991, 605326? 756663 What is the next term in -116, -236, -428, -686, -1004, -1376? -1796 What is next in -281, -599, -917, -1235, -1553, -1871? -2189 What is next in 986, 1962, 2938, 3914? 4890 What is the next term in -478, -840, -1188, -1516, -1818, -2088, -2320? -2508 What is next in 1004, 1007, 1014, 1025, 1040? 1059 What comes next: -11861, -11892, -11929, -11972, -12021, -12076? -12137 What is the next term in -1986, -1984, -1974, -1950, -1906, -1836, -1734, -1594? -1410 What is next in 4446, 4429, 4412? 4395 What is the next term in 3433, 6851, 10255, 13645, 17021? 20383 What is next in -1921, -3822, -5713, -7588, -9441? -11266 What comes next: 37293, 149181, 335661, 596733, 932397? 1342653 What is the next term in 78, 10, -176, -540, -1142, -2042? -3300 What is the next term in -5201, -10401, -15601, -20801? -26001 What is next in 7625, 7598, 7537, 7424, 7241, 6970? 6593 What comes next: -425, -445, -467, -491, -517, -545? -575 What comes next: 109, 414, 723, 1036? 1353 What is the next term in -239, -264, -327, -446, -639? -924 What comes next: -16463, -16458, -16453, -16448, -16443? -16438 What comes next: 4822, 9627, 14432, 19237, 24042? 28847 What comes next: -409, -1266, -3589, -8110, -15561, -26674, -42181? -62814 What comes next: 2649, 2648, 2647, 2646, 2645, 2644? 2643 What comes next: -96, -175, -196, -153, -40, 149, 420, 779? 1232 What comes next: 1708, 2119, 2530, 2941, 3352? 3763 What comes next: -535, -1738, -3769, -6640, -10363? -14950 What is next in -1392, -3199, -5008, -6819, -8632, -10447? -12264 What is the next term in 114908, 114890, 114870, 114848? 114824 What is the next term in 100843, 201687, 302531? 403375 What comes next: 1389, 1359, 1329, 1299, 1269, 1239? 1209 What is next in 177542, 177560, 177588, 177626, 177674, 177732? 177800 What is next in -5245, -5226, -5173, -5068, -4893, -4630, -4261, -3768? -3133 What comes next: -1039, -5104, -16139, -37630, -73063? -125924 What comes next: 46, -376, -798? -1220 What is next in -1337, -2825, -4313, -5801? -7289 What comes next: -2778, -5674, -8678, -11790? -15010 What comes next: -1506, -3255, -5248, -7485, -9966, -12691? -15660 What comes next: -588, -1143, -1686, -2211, -2712, -3183, -3618? -4011 What is the next term in -7186, -14104, -21014, -27910, -34786, -41636, -48454, -55234? -61970 What is next in -114962, -229922, -344882, -459842, -574802? -689762 What comes next: 831, 799, 767? 735 What is the next term in -805, -921, -1227, -1819, -2793, -4245? -6271 What comes next: 82, 2033, 7742, 19087, 37946, 66197? 105718 What is the next term in -11749264, -11749267, -11749272, -11749279, -11749288, -11749299? -11749312 What is next in 5977, 23120, 51691, 91690? 143117 What is next in -55287, -55324, -55387, -55476, -55591? -55732 What is the next term in 84550, 84533, 84492, 84415, 84290? 84105 What comes next: -2119, -2154, -2239, -2398, -2655, -3034, -3559, -4254? -5143 What is next in 546, 1792, 3746, 6420, 9826, 13976, 18882, 24556? 31010 What comes next: -1350, -2706, -4076, -5472, -6906? -8390 What is the next term in 9522, 19030, 28538, 38046, 47554? 57062 What comes next: -63, 26, 299, 852, 1781, 3182? 5151 What is next in -26300, -26335, -26370, -26405, -26440, -26475? -26510 What comes next: 31380, 62766, 94152, 125538, 156924? 188310 What is the next term in -10269, -10258, -10235, -10194, -10129, -10034, -9903, -9730? -9509 What is the next term in 106036, 212068, 318098, 424126, 530152, 636176? 742198 What comes next: 12253, 24507, 36761? 49015 What comes next: -1521, -1468, -1413, -1362, -1321, -1296? -1293 What is next in -27, -105, -233, -429, -711, -1097? -1605 What is the next term in -20301, -20309, -20317, -20325? -20333 What is the next term in 4548, 9057, 13528, 17943, 22284, 26533, 30672? 34683 What comes next: 185, 343, 613, 1001, 1513, 2155, 2933, 3853? 4921 What is next in 619, 1418, 2397, 3556, 4895, 6414, 8113? 9992 What is the next term in 12335, 12298, 12233, 12134, 11995, 11810, 11573? 11278 What is the next term in -1695, -2700, -3705? -4710 What comes next: 63, 66, 87, 138, 231, 378, 591? 882 What is the next term in -7611, -7586, -7551, -7512, -7475, -7446, -7431, -7436? -7467 What comes next: -32, -49, -32, 25, 128? 283 What is next in 6775, 6757, 6727, 6685, 6631, 6565, 6487? 6397 What comes next: -884, -1678, -2470, -3260, -4048, -4834, -5618? -6400 What is the next term in -42021, -84042, -126063, -168084, -210105? -252126 What comes next: -510037, -510036, -510035, -510034, -510033, -510032? -510031 What comes next: 4897, 4865, 4833, 4801? 4769 What is next in 19, -6, -57, -128, -213, -306, -401, -492? -573 What is next in -46, -42, -40, -40? -42 What is the next term in -283, -1053, -2337, -4135, -6447? -9273 What comes next: 6583, 13113, 19643, 26173, 32703? 39233 What is next in -74442, -74444, -74446, -74448, -74450? -74452 What is the next term in -248098, -496191, -744284, -992377, -1240470? -1488563 What is the next term in -1190, -1171, -1150, -1127, -1102, -1075, -1046? -1015 What is the next term in 1324, 1337, 1346, 1351, 1352? 1349 What is the next term in -763, -959, -1285, -1741? -2327 What is next in -15654, -31311, -46970, -62631, -78294? -93959 What comes next: -9520, -19039, -28556, -38071, -47584, -57095, -66604? -76111 What comes next: -9628, -19229, -28830, -38431, -48032? -57633 What comes next: 128, 258, 394, 536, 684, 838, 998? 1164 What comes next: 126162, 126160, 126158, 126156? 126154 What is the next term in -833, -824, -807, -782, -749? -708 What is the next term in 1112, 1073, 1022, 953, 860, 737, 578, 377? 128 What is the next term in -455, -945, -1435? -1925 What is next in 315, 578, 853, 1146, 1463? 1810 What is next in 2210, 4923, 8136, 11849? 16062 What comes next: 2497, 5002, 7509, 10018? 12529 What comes next: -16462, -16516, -16570, -16624, -16678? -16732 What is the next term in 123, 131, 27, -189, -517? -957 What is the next term in 3576, 7154, 10732, 14310? 17888 What is next in 3947, 3929, 3911, 3893, 3875, 3857? 3839 What is the next term in 157, 108, 29, -80? -219 What is next in 19114, 38226, 57336, 76444, 95550, 114654, 133756? 152856 What comes	{ "pile_set_name": "DM Mathematics" }
h = 2 + -1. What is x(h)? -4 Let p(x) = x + 4. Let k be (-109)/(-9) - (-8)/(-72). Suppose -4j = 4, k = 5y - 3j + 49. Give p(y). -4 Let k(i) = 229 - i2 - 231 - 4i + 12i. Give k(4). 14 Let i = -208 + 122. Let h = i - -85. Let f(c) = -8c. Give f(h). 8 Let f(r) = 8r. Let t(u) = 40u. Let q(d) = 16f(d) - 3t(d). Suppose -2 = -5z + 13. Let a be ((-18)/3)/3 + z. Give q(a). 8 Let h be (-1 - 1/1) + 3. Let w be 6/212/18. Let d(y) = 9y - wy - 3y - 3y + 1. What is d(h)? 2 Let y(r) = 5r2 - 2r - 1. Let i = 7 - 5. Suppose 0 = l - 3z - 6, 3l - 4l - 6 = 3z. Suppose lm = m - i. Calculate y(m). 15 Let w(r) = 12r*2 + r - 1. Let x be (0 - (-3 + 5)) + 37. Let j = 36 - x. Calculate w(j). 12 Suppose -2h = -22m + 23m + 10, 0 = 5m + 4h + 38. Let i(y) be the second derivative of y*4/12 + 5y*3/6 + 3y*2 + y. Determine i(m). 12 Suppose 0 = -d + 5c + 19, -4d - 2c + 1 = -7c. Let j(p) = p3 + 5p*2 - 7p - 8. Calculate j(d). -2 Suppose -3v - 20 = -8. Let n(l) = l2 + l + 1. Let r be n(0). Let y(u) = -r + 2u*2 + 2u - u*2 - u. Give y(v). 11 Suppose -24 = 6j - 2j. Let d = -12 - j. Let m(w) = w2 + 6w + 9. Determine m(d). 9 Suppose 0 = -j, 4j = -m - j + 3. Let z(s) = -2 - s + 0 + m. What is z(0)? 1 Let p(j) = j. Let c(i) = -i + 2. Let g(s) = -3c(s) - 4p(s). What is g(11)? -17 Suppose 3s - 2s + 25 = 3c, -2c + 18 = -s. Let v(w) be the first derivative of 1/2w*2 - 6w + 3. Give v(c). 1 Suppose -2m = 4j + 22 - 56, -m + j = -2. Let p be (-10)/14 - 1 - 2/m. Let q(o) = 3o + 1. Give q(p). -5 Let w be (2/4)/((-7)/294)-1. Let y(z) = -z + 28. Determine y(w). 7 Let v(l) = 11l - 5l - 10 + 13 + l2. Let c(y) = -y3 - 7y2 + 8y - 6. Let m be c(-8). Give v(m). 3 Let u(z) = z*2 + 10z + 12. Let a be u(-9). Let j(s) = 23s2 - 15s*2 - 4s - a - 9s2 + 0s. Give j(-5). -8 Let k(v) be the second derivative of -5v3/6 - 3v*2/2 + 14v. Suppose -5i - 2r - 15 = -5r, -r = -i - 1. Let c be (-3)/i + 7/(-2). Give k(c). 12 Let x(c) be the second derivative of -c5/20 + c4/3 + c3/3 + 2c*2 + 11c + 3. Give x(5). -11 Let l be 5 + 2 + -2 - (-114 + 122). Let f(g) be the first derivative of 2g2 - 2g - 1. Give f(l). -14 Let a(k) = 2k2 - 2k + 1. Let m be a(2). Let q be m - (-3 - -3) - 3. Let w(d) = d - 50 + d*3 + 45 - 3d*q - 2d*3. Give w(-4). 7 Let s(k) = 4k*2 - 36k + 4. Let b(j) = j*2 - 10j + 1. Let o(a) = -7b(a) + 2s(a). What is o(-3)? 16 Suppose -z + 4z - 15 = 0. Suppose h + 5q = -28, -q = -zh + 2q. Let m(d) = 3d2 - 4 - 2d + d + d*3 + 2d. What is m(h)? -7 Let i(g) be the third derivative of g*5/60 - 11g*4/24 + 2g*3/3 + 42g*2. Calculate i(11). 4 Let u = 22 + -21. Let b(l) = -8l*2 - 9l*2 + 25l*2 - 6l*2. Give b(u). 2 Let a(k) = -k + 39 - 80 + 40. What is a(7)? -8 Suppose 20i + 138 = 18. Let a(x) = x*2 + x - 1. Let w(q) = -5q*2 - 10q + 4. Let r(p) = ia(p) - w(p). Let m be 2/(-1) + (-16)/(-2). Determine r(m). -10 Let j(f) = 47f - 29. Let c(h) = -h*2 - 3h - 1. Let y(r) = -2c(r) + j(r). Determine y(-27). 0 Let y(n) be the third derivative of n6/120 + 2n*5/15 + 13n4/24 + n3/3 + n*2 + 117n. Calculate y(-6). -4 Suppose 66j - 4a = 67j - 9, -2a + 18 = -4j. Let c(b) = 2b + 2 - 2 + 4. What is c(j)? -2 Let k(u) = -8u - 2. Let l(c) = -c2 + 10c - 21. Let p be l(5). Let v be 6 - (p - -4) - (1 - 1). Calculate k(v). 14 Let y be 0/(7/(28/16)). Suppose -3g - 7 - 8 = y. Let r(z) = z2 + 2z*2 - 2z*2 + 7 + 6z - 3. Calculate r(g). -1 Let y(u) be the first derivative of u*2 + u - 661. Calculate y(-4). -7 Let g(m) = m. Let s(w) = 4w + 2. Suppose -4y = -2d - 4, 3y = -d + 4d + 9. Let c(b) = ys(b) + 6g(b). Determine c(4). 6 Suppose -19 + 28 = -2q + 3b, -q - 4b = -1. Let x(v) = -v3 - 3v*2 - 4v + 1. What is x(q)? 13 Let n(b) be the first derivative of -b*3/3 - 2b*2 - 6. Let s be -14-1 - 2. Let t(r) = -2r. Let x be t(s). Determine n(x). 0 Let d(n) = n - 8. Let u be -1 + 5 + -8 - -13. What is d(u)? 1 Let n be (-10)/(-25) - ((-38)/5 + 2). Let w(q) = 9q3 - 15q*3 + 5q*3 + 6q - q - nq2 - 9. What is w(-7)? 5 Let b = -204 + 300. Let x be 20/35 - b/(-28). Suppose -2o + x = -4. Let k(h) = -h*3 + 3h*2 + 3h + 1. What is k(o)? -3 Let l(z) = -428z + 429z + 3 - 5. Give l(1). -1 Let f(l) be the first derivative of -l*4/4 + 5l*3/3 + 9l*2/2 - 8l - 171. Suppose -q + 3 = w, -2w + 4w - 21 = 3q. Determine f(w). 10 Suppose -31 = 3v - 13. Let z(l) = -4l - 23. Give z(v). 1 Let y(r) = -15r*2 - 31r - 23. Let h(p) = 5p2 + 11p + 8. Let a(l) = -17h(l) - 6y(l). Calculate a(2). 20 Let g(z) be the first derivative of -z*4/12 + 2z*3 - 2z2 + 7. Let i(j) be the second derivative of g(j). Calculate i(8). -4 Let o(h) = h3 - 1. Let b(k) = -k*3 + 4k*2 - 2k + 1. Let j be b(3). Suppose 3z - p + 10 = -17, -31 = jz - 3p. Let q = 12 + z. Give o(q). 7 Let j be (-2)/10 + (-238)/(-140)6. Let i(p) = -p*2 + 11p - 9. What is i(j)? 1 Let a(d) be the second derivative of -d*3/6 + 7d*2/2 - 10d - 14. Determine a(4). 3 Let y be (-2088)/1008 + (-2)/(-28). Let x(o) be the third derivative of -o4/12 - o2. Give x(y). 4 Suppose -3d = -4d - 4. Let y(r) = -3r + 4. What is y(d)? 16 Let n(k) = 10k + 3. Let u(d) = d*3 + 8d2 - d - 9. Let g be u(-8). Let z be n(g). Let j(m) = -m2 - 10m - 10. What is j(z)? 11 Suppose -3z - 4d - 14 = 0, 0 = -2z + 3d + 2d - 17. Suppose 4t - 2 = 6. Let x(c) = 7 + 6c - c*2 + 0c*t + 2c2. Determine x(z). 7 Let w(d) be the second derivative of -d4/12 - 5d3/3 + 7d*2/2 + 16d - 4. Determine w(-8). 23 Suppose -5m - 5u - 60 = 0, 3u - 10 = 4m + 3. Let q = 9 + m. Let g(k) = 6k2 - 2k*2 - 9 - 5kq. Give g(0). -9 Let p(c) = -c2 - 1. Let u(d) = d*3 + 10d*2 + 6d - 6. Let q(n) = 2p(n) + u(n). Suppose l + 9 = 2m, 5l - 5m - 13 = -53. Calculate q(l). -1 Let o = 7 + -4. Suppose -3p - 3n + 21 = 0, 3p - 23 = -3n + n. Let t(w) = 1 + 6w + 5w - w*2 - pw. Calculate t(o). -2 Suppose g - 15 = -2p + 31, 5g = 3p + 204. Let r = g + -39. Let c(x) = -8x - 2 + 2x2 - xr + 5x + x. What is c(2)? -6 Let n(s) = -s*3 + 6s*2 - 4s - 3. Suppose 0 = -q + 2 + 7. Let t be (3/4)/(q/36). Suppose -tj = -6j + 15. Calculate n(j). 2 Let u(p) = -p*3. Let o(b) = -989b*2 - 14 - 23b + 990b2 + 37. Let v be o(22). Determine u(v). -1 Let f(r) = r3 - 5r*2 + 6r - 2. Let z be 1/((-44)/12 + 3)-2. Suppose -4s + 13 = zq, -5q + 3 = s - 4q. Give f(s). 6 Suppose -2c + 7 = -1. Let b(k) = -3k - 5. Let z(v) = 11v + 15. Let d(q) = -7b(q) - 2z(q). Determine d(c). 1 Let y(i) = 5 + 2623i2 - 2644i*2 - 3 - 4 + 24 - 37i - i3. Determine y(-19). 3 Let p(y) = y2 - 3y + 2. Suppose 4h = 3h - 1, 64 = -3g + 5h. Suppose 5b = -75 + 200. Let r = g + b. Determine p(r). 0 Let s(b) = -27b3 + b2 + 109b - 28. Let c(d) = -7d3 + 28d - 7. Let m(p) = 23c(p) - 6s(p). Calculate m(8). 55 Let x(s) = -s*3 - 3s*2 + 2s + 2. Let y = 72 - 54. Suppose -2g = -4l - y, -9 = 5l - 2g + 4g. Calculate x(l). -4 Let j(r) = 24r + 22r - 8 - 48r - 2r2 + 9. What is j(2)? -11 Let i(y) = 8y*2 - 6 + 6y - 1 - 3 + 4y - y3. Let p(z) = -z2 - 13z - 15. Let f be p(-10). Let m = f + -6. Determine i(m). -1 Suppose 0 = -9l - 6l + 30. Suppose o - 6 = 2y, lo + 15 = 3o - 5y. Let d(c) = -c*2 - c + 12. What is d(o)? 12 Suppose -p = 3p - 12. Suppose 4a + 6 = -2t + 2a, -pa + 27 = -3t. Let o(b) = b2 + 8b + 4. Give o(t). -8 Let g(y) = -2y - 4. Let t(m) = 3m*3 - 11m*2 - 4m - 2. Let k be t(4). Give g(k). 0 Let i be 4/2-11. Let m(j) = 2j2 + 2j. Let z be m(i). Let h(r) be the second derivative of -r*3/6 - 5r*2/2 + r - 234. Calculate h(z). -9 Let w = -39 - -43. Suppose 5h + 5u = 30, -3h + 0h + w = -4u. Let g(q) = q*2 - 5q + 5. Calculate g(h). 1 Let a(x) = -x*3 + 7x*2 - 6x + 8. Let d be (0 + 1)(-2 - -1). Let g(b) = 6b2 - b - 1. Let q be g(d). Give a(q). 8 Let w(l) = -l2 + l - 1. Let o(t) = t3 + t2 - 5t + 1. Let f(v) = -o(v) - 6w(v). What is f(5)? 0 Let y(z) be the second derivative of z*3/3 + 11z*2/2 + 11z - 4. Determine y(-12). -13 Let b(m) = 0m2 + m2 + 0m*2 + 0m - 2450 + 2447 + 6m. Determine b(-7). 4 Let f(q) be the first derivative of -q4/4 + 5q	{ "pile_set_name": "DM Mathematics" }
n -192b3 - 81788578 + 81788578. -192b*3 Collect the terms in -6501j + 20149j - 7170j - 6473j. 5j Collect the terms in -403s - 406s - 403s - 413s + 1633s. 8s Collect the terms in -4322z3 - 4431z*3 + 1 - 4316z*3 + 13068z3 - 1. -z3 Collect the terms in 33995k2 - 2k + 66683k2 - 22509k*2. 78169k*2 - 2k Collect the terms in 1209h - 2119h + 923h. 13h Collect the terms in -28o2 + 2717o - 5528o + 2814o. -28o2 + 3o Collect the terms in 67u3 + 21034873 - 10517466 - 10517406. 67u*3 + 1 Collect the terms in -21z*2 + 6z + 57 + 81 - 3z - 138. -21z*2 + 3z Collect the terms in 9v - 6 - 10 + 16v - 11 + 11v + 25. 36v - 2 Collect the terms in -37g - 69596g*2 + 126g - 43g - 46g. -69596g2 Collect the terms in 463834722a*3 - 463834737a*3 + 6 - 6. -15a*3 Collect the terms in -377z*2 - 217548846 + 217548846 + 23z*2. -354z*2 Collect the terms in -29 + 2162m*2 - 19 + 2m + 52. 2162m2 + 2m + 4 Collect the terms in -21298w2 + 20973w*2 - 199 + 199. -325w*2 Collect the terms in 289922u*2 - 164383u*2 - 125541u*2. -2u*2 Collect the terms in 66z*3 - 50z*3 + 392z*3 - 399z*3. 9z*3 Collect the terms in 0q - 5q + 4q + 3q - 11q + 5q + 14. -4q + 14 Collect the terms in 58d3 - 131d*2 - 380d*2 - 66d*3 - 73d*3. -81d*3 - 511d*2 Collect the terms in -9533r*3 + 3253r*3 - 8604r*3 + 5384r*3 - 10371r*3. -19871r*3 Collect the terms in -9q*2 + 3048q - 3044q + 126q*2. 117q*2 + 4q Collect the terms in 7224y - 60583y + 23209y - 213905y. -244055y Collect the terms in 194541 - f + 193632 - 581712 + 193539. -f Collect the terms in 40c*3 - 63c*3 - 17c + 19c + 15c + 24c. -23c*3 + 41c Collect the terms in 44347572f + 5 - 22173786f + 0 - 5 - 22173789f. -3f Collect the terms in 1470p - 854p - 945p + 19. -329p + 19 Collect the terms in -2a2 + 2a + 3a2 - 36a*2 - 2a + 80a2. 45a*2 Collect the terms in -4565w - 478w + w3 - 696w + 2w3 - 4. 3w*3 - 5739w - 4 Collect the terms in -4442g + 17602g - 4438g - 4400g - 4316g. 6g Collect the terms in -8021a + 8021a - 25974a3. -25974a*3 Collect the terms in 27v*2 - 626v - 443v + 1094v. 27v2 + 25v Collect the terms in 2 - 1 - 5 - 492l + 2571l*2 + 0 + 491l. 2571l2 - l - 4 Collect the terms in 1630a + 8a2 - 3a*2 - 2a*2. 3a*2 + 1630a Collect the terms in g - 956 + 3612 - 2g + 4g - 2656. 3g Collect the terms in -116597 + 116597 + 2427u*2. 2427u*2 Collect the terms in -23k*2 + 23k*2 + 36k - 2k3 + 1 + 5 + 254k. -2k3 + 290k + 6 Collect the terms in -3482 + 66498v + 6969 - 3487. 66498v Collect the terms in 149 - 39s2 + 127 - 276 - 99s*3. -99s*3 - 39s*2 Collect the terms in 501k*2 + 443k*2 - 1579k*2 + 514k*2. -121k*2 Collect the terms in -92758q + 176q - 15487q - 9908q. -117977q Collect the terms in 36i - 827i - 1102i. -1893i Collect the terms in 56707 - 28543 - 28164 + 7a2. 7a*2 Collect the terms in -5l*3 + 3l*3 + 9l*3 + 6l*3 + 18l*2 - 31l*2 + 14l*2. 13l3 + l2 Collect the terms in -24 - 19 - 15 + 30r - 20 + 71 - 110r. -80r - 7 Collect the terms in -3n - 12556446n3 + 3n + 12555910n3. -536n*3 Collect the terms in -9f + 26f + 5f*2 - 192038 - 8f - 9f + 192038. 5f*2 Collect the terms in -688604441l + 688604441l + 103l*3. 103l*3 Collect the terms in 311a + 3a2 - 151a - 159a + 610 + 160. 3a2 + a + 770 Collect the terms in -c + 83488137932886 - c2 - 83488137932886 + c. -c*2 Collect the terms in -430w - 434w + 1741w - 434w - 439w - 37w2. -37w*2 + 4w Collect the terms in 113d2 - 113d*2 - 54665d*3. -54665d*3 Collect the terms in -4t*3 + 671t + 3t3 + 47 - 31 - 16. -t3 + 671t Collect the terms in -31797a - 13073a - 3 - 3046a - 25889a. -73805a - 3 Collect the terms in 3 + 4 + 98b*3 + 8 - 6 + 8. 98b*3 + 17 Collect the terms in -1530g*2 - 2 - 4116g*2 + 1675g*2. -3971g*2 - 2 Collect the terms in -288 - 15549v*3 + 15550v3 - 256. v3 - 544 Collect the terms in -2 - 231138n3 - 3 - 2 + 0. -231138n*3 - 7 Collect the terms in -3 - 15553434321k*3 + 3 + 15553434314k*3. -7k*3 Collect the terms in 2r*2 + 3585r*3 - 2r*2 - 2939r*3. 646r*3 Collect the terms in 3064 + 2i - 885 + 974. 2i + 3153 Collect the terms in -19853s + 39823s - 19943s. 27s Collect the terms in -222a*2 + 381a + 220a2 + 12 - 347a. -2a2 + 34a + 12 Collect the terms in -20894d - 20905d - 20902d + 83590d - 20908d. -19d Collect the terms in 7518a2 - 3253a*2 + 2225 - 2224 + 3538a*2. 7803a*2 + 1 Collect the terms in 2i*3 - 5i*3 + 5i*3 + 54i*2 + 63i*2. 2i*3 + 117i*2 Collect the terms in -133n - 56n + 306n - 128n. -11n Collect the terms in -9439n - 7554n + 5597n. -11396n Collect the terms in 161 + 123 + 137q + 125 - 409. 137q Collect the terms in -4k3 - 2030k + 2030k - 651 + k3. -3k*3 - 651 Collect the terms in -32634s - 30301s - 11884s. -74819s Collect the terms in -103 + 319039m - 99 - 319050m + 202. -11m Collect the terms in 3124 + 4629c - 6240c - 3126. -1611c - 2 Collect the terms in -453r*2 + 2 + 299r*3 + 156r*3 + 453r*2 - 2. 455r*3 Collect the terms in 1653u*2 + 74u*3 + 1634u*2 - 3287u*2 - 3 - 7u*3 + 1. 67u*3 - 2 Collect the terms in -8m*2 - 148906m + 148908m + 17m*2 - 20m*2. -11m*2 + 2m Collect the terms in 12810v + 13948v - 587v - 2796v + 2691v. 26066v Collect the terms in 44072156 + 29q - 44072156. 29q Collect the terms in -4d + 11551d*3 + 11549d*3 + 11541d*3 - 34625d*3. 16d*3 - 4d Collect the terms in -26r + 6447r*2 + 26r - 8838r2 - 12884r*2. -15275r*2 Collect the terms in 271n*2 - 271n*2 + 61079n*3 + 180787n*3. 241866n*3 Collect the terms in 202551m*3 - 406450m*3 + 203915m*3. 16m*3 Collect the terms in -672444g*2 - 672342g*2 + 1344803g*2. 17g*2 Collect the terms in 3 + 27961005i + 4 - 7. 27961005i Collect the terms in -14x + 770343 + 770325 - 1540668. -14x Collect the terms in 21q*2 + 32766q*3 - 32735q*3 - 6q*2. 31q*3 + 15q*2 Collect the terms in -41948965k*3 - 41948977k*3 + 83897951k*3. 9k*3 Collect the terms in 649129v - 162352v - 162085v - 162337v - 162357v. -2v Collect the terms in 42q + 22q2 + 7q*2 + 27q*2 - 15q - 28q. 56q*2 - q Collect the terms in -414 - 101a - 102a + 210 + 205a + 202. 2a - 2 Collect the terms in -y - 32y*2 - 5y*2 + 133y*2 + 2y - 60y2. 36y*2 + y Collect the terms in -171b - 401b - 168b. -740b Collect the terms in 55479k - 216301k2 - 55479k. -216301k2 Collect the terms in -372t*3 + 487t*2 + 187t*3 - 531t*2 + 179t*3. -6t*3 - 44t*2 Collect the terms in -9162 + 1855 + 1855 + 1852 + 1743 + 1857 + 14v. 14v Collect the terms in 232 - 11h + 380 + 275 - 887. -11h Collect the terms in 770 - 4999i - 722 + 4997i. -2i + 48 Collect the terms in 40 + 2005b3 - 100b*2 - 77 + 37. 2005b*3 - 100b*2 Collect the terms in -2g - 642521g3 - 7g + 160629g3 + 160632g*3 + 9g + 160625g3 + 160637g*3. 2g*3 Collect the terms in 597405740t*2 + 597405738t*2 - 1194811482t*2. -4t*2 Collect the terms in 39139z*3 - 79223z*3 + 40039z*3. -45z*3 Collect the terms in -6g*2 - 132 - 1 + 20 + 53g*2. 47g*2 - 113 Collect the terms in -139850n*2 - 149698n*2 - 91138n*2. -380686n*2 Collect the terms in 7 + 4k - 181k2 + 206k*2 - 4k + 546k2. 571k*2 + 7 Collect the terms in -91 + 51 + 328r + 42 + 199r. 527r + 2 Collect the terms in -2674f - 2499f - 2475f + 7659f. 11f Collect the terms in 81621w*2 - 44647w*2 + 304784w*2 + 0 + 1586w*2 - 2. 343344w*2 - 2 Collect the terms in -417g*2 + 56g*2 - 57g*2 - 169g*2 + 161g*2 + 82g*2. -344g*2 Collect the terms in 34 + 572l + 610l - 32 - 1146l. 36l + 2 Collect the terms in -410b - 402b - 35 + 805b + 9 + 16 + 10. -7b Collect the terms in 50634m*3 + 53776m*3 + 89441m*3. 193851m*3 Collect the terms in 3o + 174 - 1674 + 1505. 3o + 5 Collect the terms in -16863l*3 - 16590l*3 + 34220l*3 + 6 - 6. 767l**3 Collect the terms in	{ "pile_set_name": "DM Mathematics" }
and. -5200000 Round 88893 to the nearest one hundred. 88900 What is 0.00209 rounded to three dps? 0.002 Round -9240 to the nearest 1000. -9000 Round -0.59925 to 2 decimal places. -0.6 Round -123.25 to the nearest 10. -120 What is 0.009562 rounded to three decimal places? 0.01 Round 643290000 to the nearest one million. 643000000 What is -2.8549 rounded to two decimal places? -2.85 What is -0.023059 rounded to 3 decimal places? -0.023 What is 1.9559 rounded to two dps? 1.96 What is -0.0005186 rounded to 4 dps? -0.0005 What is -6.065 rounded to the nearest 10? -10 What is 5.16 rounded to one dp? 5.2 What is -0.02773 rounded to three decimal places? -0.028 Round 0.51731 to one dp. 0.5 Round 1.03163 to 1 decimal place. 1 What is -0.093465 rounded to 4 decimal places? -0.0935 Round 4917900 to the nearest one million. 5000000 What is -2587 rounded to the nearest one hundred? -2600 Round 0.0036263 to 3 decimal places. 0.004 Round -961900 to the nearest one hundred thousand. -1000000 Round 6.6595 to the nearest integer. 7 Round -1888000 to the nearest 100000. -1900000 What is 0.056432 rounded to four dps? 0.0564 Round 0.00428 to four decimal places. 0.0043 What is 254860 rounded to the nearest 100000? 300000 What is 0.0025479 rounded to 4 decimal places? 0.0025 Round -117270 to the nearest ten thousand. -120000 Round 12280000 to the nearest 1000000. 12000000 Round -350 to the nearest 10. -350 What is -0.0013357 rounded to four dps? -0.0013 Round 0.0021357 to 4 dps. 0.0021 Round 0.00000383 to 7 dps. 0.0000038 Round -0.0458555 to 4 dps. -0.0459 What is -0.00046423 rounded to 4 decimal places? -0.0005 What is -2541280 rounded to the nearest 100000? -2500000 What is 4858 rounded to the nearest 1000? 5000 Round 602250 to the nearest one hundred thousand. 600000 What is 2387.96 rounded to the nearest 100? 2400 Round 2.303 to zero dps. 2 Round -0.9116 to 1 decimal place. -0.9 What is 6751600 rounded to the nearest 100000? 6800000 Round 0.02546 to three dps. 0.025 Round 11.9755 to zero dps. 12 Round 1122 to the nearest one hundred. 1100 Round -2.3432 to one decimal place. -2.3 Round -0.00001298 to 6 dps. -0.000013 What is -0.000001015 rounded to 7 dps? -0.000001 Round -5.692 to 0 dps. -6 What is -0.220032 rounded to 2 dps? -0.22 What is 3897800 rounded to the nearest 100000? 3900000 Round 67900 to the nearest 10000. 70000 Round 0.0009525 to five decimal places. 0.00095 What is 5002700 rounded to the nearest ten thousand? 5000000 Round 7840000 to the nearest 100000. 7800000 Round 0.0498 to 2 decimal places. 0.05 What is -0.1463 rounded to 2 decimal places? -0.15 Round 35.1 to the nearest 1000. 0 What is -0.01403 rounded to three dps? -0.014 Round -0.000000755 to 7 dps. -0.0000008 What is 512760 rounded to the nearest one thousand? 513000 Round -0.00056273 to six dps. -0.000563 What is -2152.3 rounded to the nearest ten? -2150 Round -0.0000685 to 5 dps. -0.00007 What is -7988300 rounded to the nearest 1000000? -8000000 What is 64759 rounded to the nearest one thousand? 65000 What is -1171770 rounded to the nearest 100000? -1200000 What is 0.00575 rounded to three decimal places? 0.006 What is 0.00060426 rounded to 4 dps? 0.0006 What is -0.000000772 rounded to 7 dps? -0.0000008 Round -0.6855 to two decimal places. -0.69 What is 5020 rounded to the nearest 10000? 10000 Round 1.148 to one decimal place. 1.1 Round -0.00568942 to 5 dps. -0.00569 Round -0.0691 to two decimal places. -0.07 What is 0.000326 rounded to 5 dps? 0.00033 What is -66.415 rounded to one decimal place? -66.4 Round -15.164 to zero decimal places. -15 What is 75.8 rounded to the nearest 10? 80 What is 58.49 rounded to the nearest 10? 60 Round 4.1108 to two dps. 4.11 Round 0.00000321 to 5 dps. 0 What is 38190 rounded to the nearest one thousand? 38000 What is -43700 rounded to the nearest one thousand? -44000 Round 0.0001599 to 6 decimal places. 0.00016 What is 0.085865 rounded to two decimal places? 0.09 What is 0.0000221499 rounded to 5 decimal places? 0.00002 Round 46.63 to the nearest 10. 50 What is 0.000717 rounded to four decimal places? 0.0007 What is 31070 rounded to the nearest 1000? 31000 Round 0.000001432 to seven decimal places. 0.0000014 Round 141355 to the nearest 10000. 140000 What is -0.00017329 rounded to six dps? -0.000173 What is -274800 rounded to the nearest 10000? -270000 What is 4.0478 rounded to 1 dp? 4 Round -0.00185 to three dps. -0.002 What is -198 rounded to the nearest one hundred? -200 What is -12.196 rounded to 0 decimal places? -12 Round 553.6 to the nearest 10. 550 What is 0.0000055205 rounded to 7 decimal places? 0.0000055 What is -0.051 rounded to two decimal places? -0.05 What is 0.03346 rounded to 4 dps? 0.0335 What is 4065400 rounded to the nearest 1000000? 4000000 What is 0.031275 rounded to four decimal places? 0.0313 What is 237.478 rounded to zero decimal places? 237 Round 5504 to the nearest one hundred. 5500 What is 0.0000023305 rounded to 7 dps? 0.0000023 Round 4.89 to the nearest integer. 5 What is -139690 rounded to the nearest 10000? -140000 What is 0.00612 rounded to three dps? 0.006 Round 27.0184 to the nearest integer. 27 What is -94972 rounded to the nearest ten thousand? -90000 What is -10.487 rounded to the nearest 10? -10 What is 6.285 rounded to zero dps? 6 What is 0.00000843 rounded to 6 dps? 0.000008 Round -0.00056775 to 5 decimal places. -0.00057 What is -0.38676 rounded to 2 decimal places? -0.39 Round -14250 to the nearest one hundred. -14300 Round -1410.4 to the nearest 10. -1410 Round -0.0004384 to 5 dps. -0.00044 What is -853000 rounded to the nearest 10000? -850000 What is 0.002905 rounded to three decimal places? 0.003 Round -0.5379 to 2 decimal places. -0.54 What is 0.05415 rounded to three decimal places? 0.054 Round -19400 to the nearest one thousand. -19000 Round -171130 to the nearest one thousand. -171000 What is 55578 rounded to the nearest 1000? 56000 What is 3.412 rounded to 0 decimal places? 3 Round -263230 to the nearest 100000. -300000 What is -4244 rounded to the nearest one hundred? -4200 Round 0.00136151 to 4 decimal places. 0.0014 What is -0.241651 rounded to 2 decimal places? -0.24 What is -170060 rounded to the nearest 10000? -170000 What is 11169 rounded to the nearest one hundred? 11200 Round -0.000117652 to five dps. -0.00012 What is -136950 rounded to the nearest 1000? -137000 What is 0.5468 rounded to 1 dp? 0.5 Round -82492 to the nearest one hundred. -82500 What is -2364 rounded to the nearest 100? -2400 What is 0.000004125 rounded to 7 decimal places? 0.0000041 Round -3.40757 to 2 dps. -3.41 What is 0.31358 rounded to 3 decimal places? 0.314 Round -0.00100342 to 5 dps. -0.001 What is -6182.7 rounded to the nearest 100? -6200 What is -39.116 rounded to the nearest ten? -40 Round 0.00008097 to six decimal places. 0.000081 Round 1822600 to the nearest 100000. 1800000 Round 296.98 to the nearest 10. 300 What is 0.01992 rounded to 3 dps? 0.02 Round 0.000000411 to 6 dps. 0 What is -0.000003605 rounded to five decimal places? 0 What is 0.0026307 rounded to four dps? 0.0026 What is 48200000 rounded to the nearest 1000000? 48000000 What is 405700 rounded to the nearest one hundred thousand? 400000 What is -531600 rounded to the nearest 100000? -500000 What is 0.0007655 rounded to five dps? 0.00077 What is 0.0009765 rounded to 4 dps? 0.001 What is 90.02 rounded to 0 dps? 90 Round 0.000007957 to 5 dps. 0.00001 Round 360600 to the nearest 10000. 360000 What is 0.00014467 rounded to 5 dps? 0.00014 Round -0.00069002 to 5 decimal places. -0.00069 Round -0.00016585 to 5 dps. -0.00017 What is -47690 rounded to the nearest 1000? -48000 What is 291240000 rounded to the nearest 1000000? 291000000 What is 0.047281 rounded to 3 dps? 0.047 Round -15190 to the nearest ten thousand. -20000 What is 62.119 rounded to the nearest ten? 60 Round 35812 to the nearest 1000. 36000 Round -0.1015 to 3 decimal places. -0.102 What is -5.4648 rounded to the nearest integer? -5 What is -54.3 rounded to the nearest ten? -50 What is 7.3832 rounded to the nearest integer? 7 What is 0.50243 rounded to 1 dp? 0.5 What is -59300000 rounded to the nearest one million? -59000000 What is 68.36 rounded to the nearest integer? 68 What is 53629 rounded	{ "pile_set_name": "DM Mathematics" }
-1((-24)/(-3))/(-8) 1 What is ((-1)/9)/(((-20)/6)/(-5))? -1/6 What is 32-120/(-540)? 2/9 Evaluate 1-1-2(-6)/(-3). 4 (750/70)/((-1)/(-1)) 5 What is the value of 2/1050/40? 1/4 Calculate (-7)/245-7-10. -2 (4/64)/(1/2) 1/8 What is ((-1)/2)/(99/108)? -6/11 What is ((-8)/(-40))/((-16)/(-30))? 3/8 Calculate 2/((-16)/(-42))102/153. 7/2 What is 14/5(-100)/40? -7 Calculate (6/4)/((-3)/41). -2 What is (24/(-16))/((-4)/(56/(-3)))? -7 (3/(-1))/(-3)10/(-8) -5/4 Calculate (3/2)/(23/2). 1/2 Calculate ((-270)/135)/((-2)/(-8)). -8 Evaluate 3/(-1)3/6-2. 3 What is (596/(-149))/(1/1-6)? 2/3 228/(-152)20/6 -5 Evaluate (8/(-4))/(14/35). -5 Calculate ((-10)/6)/(5/(-6)). 2 Calculate 15/(-10)(128/12)/(-4). 4 What is (-61/50)/(1/(-5))? 3/5 What is the value of (2/4)/(36/(-48))? -4/3 What is the value of (-357)/8565/(-78)? 7/2 Evaluate (22)/((-19)/38). -8 Evaluate ((-15)/(-40))/(63/140). 5/6 (-1)/(((-4)/4)/((-4)/2)) -2 (1/(-2))/((-6)/(-84)) -7 (-1176)/336-21 7 What is the value of 18/(-30)(-20)/(-9)? -4/3 What is (-220)/(-22)5/225? 2/9 Calculate (-515)/(-1339)(-26)/(-2). 5 What is the value of 48/127(-4)/16? -7 What is the value of (-336)/(-2142)3/4? 2/17 Calculate (-15)/(-9)(-6)/4. -5/2 What is (5/2)/((-40)/(-16))? 1 What is the value of 297/(-33)2/(-63)? 2/7 10/(-15)6/4 -1 Evaluate (-4)/(-12)3-7. -7 (-2)/(-4)72/(-96) -3/8 What is the value of 9/60-1(-58)/(-87)? -1/10 (-3)/(-12)21 1/2 ((-8)/(-30)-3)/((-18)/(-15)) -2/3 What is (2/(-5))/((-3)/(-9)-2)? 3/5 What is ((-10)/(-60))/(1/(-8))? -4/3 (8(-8)/(-320))/(3/(-5)) -1/3 Calculate (-12)/(-30)1/(-10)5. -1/5 ((-7)/(-7)2)/(-2) -1 Evaluate 3/22/(-15). -1/5 84/(-24)24/21 -4 What is the value of ((-1)/(-3))/(((-120)/(-18))/(-5))? -1/4 Calculate (6/9)/((-60)/18)-1. 1/5 (28/21)/(3/(-9)) -4 Evaluate 80/(-90)(-9)/12. 2/3 What is the value of 80/32(-20)/(-475)? 2/19 Evaluate 0/(1/(-2)32/(-8)). 0 Evaluate (25/((-1250)/140))/((-4)/(-10)). -7 Calculate 5/(5(-10)/(-30)). 3 What is -4(-231)/444/(-14)? -6 Calculate 6/(-45)2(-6)/8. 1/5 What is the value of (-6(-4)/30)/((-26)/(-65))? 2 Evaluate (4/14)/2(-59)/59. -1/7 Evaluate (-36)/(-96)2/(-3). -1/4 What is the value of (8/(-4))/((-16)/2)? 1/4 (24/4)/((-5)/((-25)/(-10))) -3 What is 33/(-22)(-2)/(-6)? -1/2 Calculate ((-5)/((-30)/(-12)))/((-5)/20). 8 What is the value of (-2)/(((-128)/(-24))/(-8))? 3 Evaluate ((-78)/104)/((3/(-1))/(-6)). -3/2 Evaluate ((-13)/39)/(3/2). -2/9 Calculate 15(-1)/(-18)6. 5 What is the value of 5/3(-18)/100-15? 9/2 Evaluate 1/(1/3)1/(-27). -1/9 What is (-2)/2(-2)/(-1)? -2 9/12(-168)/1197 -2/19 Calculate (-60)/(-225)2/(-4). -2/15 (-27)/125(-28)/105 3 Calculate 5/(45/(-3))53. -5 Calculate ((-3)/3610)/((-35)/21). 1/2 22/112/(-6) -2/3 What is the value of (6/2523)/((-1)/4)? -2/7 What is the value of ((-4)/(-2))/(-1418/(-504))? 4 Evaluate ((-28)/(-294))/(6/7)1. 1/9 Evaluate ((-20)/60)/((-1)/(-15)). -5 What is (3/((-3)/2))/((-36)/(-54))? -3 What is the value of (((-15)/(-6))/5)/((-1)/(-6))? 3 Calculate (4/4)/((-6)/18). -3 Calculate ((3/(-1))/(-12))/((-12)/(-48)). 1 Evaluate ((-12)/180)/((-2)/12). 2/5 Calculate ((-85)/20)/174-2. 2 Calculate -2((3/3)/1)/(-1). 2 What is (286/(-572))/((10/(-28))/(-5))? -7 What is ((-4)/(-12))/(-12/(-12))? 2 What is the value of ((-9)/15)/(3/3)? -3/5 What is the value of (-81)/(-108)72/6? 9 Calculate 2/(((-3)/9)/((-8)/(-12))). -4 Calculate (8/(-28))/(3/63-3). 2 What is (4/50)/((-48)/60)? -1/10 What is 36/1515/427? 6 What is the value of (10/(-490)-21)/(4/(-14))? -3/2 Calculate 1210/(-60)3. -6 What is ((4/(-9))/1)/(4/2)? -2/9 What is ((-6)/(528/4))/((-3)/24)? 4/11 0((-1)/2)/(4/(-8)) 0 ((-4)/(-7))/((-2)/(-7)) 2 Calculate 15/4-11/(-10). 3/8 24/20(-1)/3 -2/5 1/((-6)/410/15) -1 What is ((-3)/(-2))/(90/120)? 2 What is ((-126)/(-36))/((-6)/4)? -7/3 What is the value of (-1)/2(-3)/(9/6)? 1 What is the value of (0/(4/4))/1? 0 (4/6)/(((-561)/9)/11) -2/17 What is (9/6)/((-5)/(-10)-1)? -3 Evaluate 1/((2/(-4))/(28/7)). -8 What is 6/10-340/24? -3 Evaluate ((-3)/(-5))/((-2)/10). -3 4/(((-5)/4)/(14/56)) -4/5 Calculate 18/(-4)(48/6)/(-4). 9 What is the value of ((6/(-4))/(-3))/(12/(-24))? -1 Evaluate (-3)/963/6. -1 ((-1)/2(-32)/8)/(-5) -2/5 Evaluate (-4)/(-9)3(-9)/8. -3/2 What is the value of 1/3(-12)/4-1? 1 Calculate (-12)/(-9)-1(-15)/(-120). -1/6 (-60)/900(-12)/(-2) -2/5 Calculate 924/(-2079)6-3. 8 4/(-15)(-77)/(-154) -2/15 ((-448)/(-9520))/((-2)/5) -2/17 (34/102)/(-3(-3)/27) 1 What is (1/(-2))/((518/(-28))/(-37))? -1 What is the value of ((-4)/(-21))/((-162)/567)? -2/3 Calculate ((-6)/165)/((-22)/110). 2/11 ((-150)/25)/((-12)/6) 3 What is the value of (-28)/3((-225)/(-60))/(-5)? 7 Evaluate ((-2)/3)/(112/72). -3/7 What is the value of ((-2)/(-2))/(66/11)? 1/6 Evaluate 84/405/3. 4/3 What is the value of ((-18)/8)/(22/(-88))? 9 (-9)/640/270 -2/9 What is the value of (3/(-15))/((-3)/((-150)/(-5)))? 2 (14)/((-27)/(-3)) 4/9 (-36)/(-16)(-4)/12 -3/4 (-16)/(-40)25/(-20) -1/2 Calculate (3/(-45))/((-27)/90). 2/9 What is (2/(-10))/((-12)/30)2? 1 Evaluate (108/81)/(8/(-10)). -5/3 Calculate (7(-30)/(-140))/(42/8). 2/7 What is (37/((-2035)/60))/((-2)/11)? 6 Evaluate (-21)/14015/(-6). 3/8 What is the value of (-66)/(-88)(-1)/(-9)? 1/12 Calculate (-7)/((2/8)/(7/(-28))). 7 Evaluate (-10)/3(-40)/100. 4/3 What is the value of (-2)/(-1)7/168? 1/12 Calculate 2/1(-9)/135. -2/15 What is (2/(-8))/((-45)/(-36))? -1/5 Calculate (-8)/(-22)-2(-36)/(-48). -6/11 Calculate ((-5)/(-50))/(5/(150/4)). 3/4 Evaluate (4/(112/(-21)))/3. -1/4 What is (-4)/(-4)28/(-98)? -2/7 What is ((275/(-30))/11)/(1/(-6))? 5 Evaluate (64/(-80))/((-12)/5). 1/8 What is 1(-10)/(50/(-35))? 7 What is -2((-3)/(6/5))/(-1)? -5 ((-512)/6528)/((8/(-3))/(-4)) -2/17 What is the value of (-1)/46(-48)/36? 2 What is 10/(-15)(-3)/(-2)? -1 (126/1638)/(4/14) 2/13 What is the value of (1/(-5))/(24/(-40))? 1/3 1/(3/3)(-60)/(-12) 5 Calculate ((-4)/(-10)(-30)/(-1))/2. 6 (-2)/6-518/15 2 ((63/9)/7)/(-4) -1/4 What is -1(1/(2/4))/(-2)? 1 What is the value of (2/6-6)/(10/2)? -2/5 What is 21165/(-2805)? -2/17 What is (-425)/7652/(-10)? 1/9 Calculate (4/6)/(20/(-30)). -1 ((-255)/(170/10))/(3/(-2)) 10 What is the value of ((-39)/26)/(18/3)? -1/4 Evaluate 13/(-2)78/39. -3 What is the value of -1((-1)/1)/1-2? -2 Evaluate (-2)/(-4)-8(-14)/(-224). -1/4 What is the value of 2/((-4)/2-4)? 1/4 Evaluate 1-31/915. -5 What is the value of 8/530/12? 4 (-16)/(-180)110/(-4) -2/9 What is the value of 9/(-1)(-3)/(-72)2? -3/4 Evaluate (2/30)/(-6(-3)/60). 2/9 What is the value of ((-4)/(-8))/(5/30-4)? -3/4 5-1(-81)/(-45) -9 What is the value of (3/(-4))/(6/(-48))? 6 What is the value of (0/(-12))/((-2)/(-2))? 0 What is the value of ((-7)/28)/(2/(36/3))? -3/2 Calculate (9/(-12))/((-195)/40). 2/13 What is (6/57)/(2/(2/(-1)))? -2/19 ((-6)/2)/(-4(-1)/8) -6 Evaluate (-126)/(-210)((-1)/(-1))/(-1). -3/5 What is ((-9)/3)/((-6)/10)? 5 What is (-12)/(9/3)(-3)/3? 4 What is the value of ((-4)/(-12)-3)/((-7)/28)? 4 Calculate (-36)/486(-18)/1. 4/3 Evaluate (-4)/220/20. -2 78/4114/247 9 ((-56)/(-84))/(2/(-3)) -1 What is (5/(-15))/((-13)/(-39))? -1 Calculate ((-10)/(-60))/(14/(-21)). -1/4 Evaluate 8/(-38)4/(-8). 2/19 What is (1/7)/(344/(-301))? -1/8 What is the value of (-14)/68(-12)/21? 2/17 Calculate (-5)/37(-28)/490. 2/3 What is 162/(-45)45/18? -9 What is (-30)/4028/(-42)? 2/7 (-2)/(-3)288/(-64) -3 Evaluate (-40)/8002/(-1). 1/10 Calculate 6/(-3)10/(-4). 5 (-22)/(50/(-5)) 2/5 What is 1/(((-15)/(-50))/((-3)/2))? -5 Evaluate (-14)/(-12)(-112)/(-98). 4/3 387/(-58)(-4)/(-9) -2 Calculate (-6)/14((-48)/(-18))/(-4). 2/7 Calculate (5/(-15))/((-3)/(-18)). -2 ((-21)/24)/((-28)/16) 1/2 What is the value of 1/(9/610/(-45))? -3 Evaluate (-51)/(-34)(-2)/36-15. 5/4 What is the value of ((-21)/(-49))/((-1)/(-14))? 6 Calculate (2/(-21))/(-1(-3)/7). -2/9 What is (20/6)/(13/(-234)6)? -10 (-114)/(-171)3/(-6) -1/3 Evaluate 2/(-40)15/6. -1/8 Evaluate (-5)/1536/155. -4 What is the value of ((-104)/(-390))/((6/5)/(-1))? -2/9 Evaluate (0/2)/((-2)/1). 0 What is ((-3)/(-15))/((-3)/((-6)/2))? 1/5 What is the value of (-10)/25-3*20/12? 2 Calculate ((0/13)/7)/(-1). 0 What is (-3)/(2/(10/(-15)))? 1 W	{ "pile_set_name": "DM Mathematics" }
mmon factor of 9720 and 314760? 120 Calculate the highest common divisor of 222816 and 71782200. 5064 Calculate the highest common divisor of 46755552 and 194. 194 What is the highest common factor of 15 and 1569534? 3 Calculate the highest common divisor of 1010 and 145660. 10 Calculate the highest common factor of 21689 and 2239625. 943 Calculate the greatest common factor of 2912126 and 56. 14 Calculate the greatest common factor of 34076 and 10242272. 4868 What is the highest common factor of 172 and 7378069? 43 What is the greatest common divisor of 18732 and 140820932? 6244 What is the highest common factor of 828 and 558808? 92 Calculate the highest common divisor of 332 and 5327104. 4 Calculate the greatest common factor of 6435 and 3166605. 585 Calculate the highest common divisor of 260 and 50102140. 20 What is the highest common factor of 4248090 and 18480? 2310 What is the greatest common divisor of 67818278 and 22? 22 Calculate the highest common divisor of 12 and 5490516168. 12 Calculate the greatest common factor of 497100 and 2308. 4 What is the highest common factor of 60528 and 8568? 24 What is the greatest common factor of 184314 and 295152? 78 What is the highest common divisor of 50050 and 112021? 91 What is the greatest common divisor of 23 and 20987201? 23 What is the highest common factor of 18296676 and 4? 4 Calculate the greatest common divisor of 56578873 and 17. 17 What is the highest common factor of 962424 and 990? 18 Calculate the highest common divisor of 1374085949 and 7985. 1597 Calculate the highest common divisor of 938192 and 686452. 1228 Calculate the highest common divisor of 11747 and 1667383. 691 Calculate the greatest common divisor of 59061233 and 385. 77 What is the greatest common factor of 1672 and 45875918? 418 What is the highest common factor of 7597 and 13505647? 107 Calculate the highest common factor of 20442846 and 615. 123 What is the highest common divisor of 63069094 and 10450? 418 Calculate the greatest common divisor of 696 and 426806340. 348 Calculate the greatest common divisor of 595 and 2226035. 35 Calculate the greatest common factor of 7 and 99324211. 7 What is the highest common factor of 17105 and 424248? 11 What is the greatest common factor of 236 and 52432592? 236 Calculate the highest common factor of 15252 and 1277478. 246 Calculate the greatest common factor of 466796 and 352. 44 Calculate the highest common divisor of 556406 and 5855768. 5402 What is the greatest common divisor of 128326 and 946352? 418 Calculate the highest common factor of 157 and 185395177. 157 Calculate the greatest common divisor of 100440 and 186279. 93 What is the greatest common divisor of 124470 and 770040? 270 Calculate the greatest common divisor of 1122 and 366542. 22 What is the greatest common factor of 995904 and 170164? 76 What is the highest common divisor of 91 and 824257? 7 What is the greatest common factor of 7310 and 1031857670? 7310 Calculate the greatest common factor of 2280663 and 63126. 189 What is the greatest common factor of 1120 and 39726784? 32 Calculate the highest common divisor of 13139 and 30639. 7 Calculate the greatest common divisor of 543181900 and 700. 100 What is the greatest common divisor of 627 and 29253540? 57 What is the greatest common factor of 1529856 and 315? 9 Calculate the highest common factor of 408 and 12796971. 51 What is the greatest common factor of 98496283 and 187? 17 What is the highest common factor of 136 and 1972949518? 34 Calculate the greatest common factor of 6565 and 2662865. 505 What is the highest common factor of 147 and 1486317? 147 Calculate the greatest common divisor of 58 and 1874200429. 29 What is the highest common divisor of 795 and 120795? 15 What is the greatest common factor of 5973 and 1243651? 181 Calculate the greatest common factor of 61 and 211445459. 61 Calculate the highest common divisor of 199044 and 79540. 388 What is the highest common divisor of 7428 and 91479534? 3714 What is the greatest common divisor of 81 and 5248719? 81 What is the highest common factor of 4375 and 480000? 625 Calculate the greatest common divisor of 2645174 and 210. 14 Calculate the highest common factor of 1233 and 17460924. 411 Calculate the highest common divisor of 15309 and 43306974. 2187 Calculate the highest common factor of 35332 and 161535. 121 Calculate the greatest common divisor of 6066797 and 17. 1 What is the greatest common divisor of 44181 and 19901086? 4909 What is the greatest common divisor of 555 and 19165980? 15 What is the greatest common factor of 13417610 and 7790? 190 What is the greatest common divisor of 2320 and 415280? 2320 Calculate the highest common factor of 3590958 and 438882. 1158 What is the highest common divisor of 36450 and 228450? 150 What is the greatest common divisor of 18456 and 1240248? 24 Calculate the highest common factor of 123728 and 5513. 37 Calculate the greatest common divisor of 350901085 and 1345. 1345 What is the greatest common divisor of 2547109 and 53761? 1453 Calculate the highest common factor of 256 and 334769408. 256 Calculate the highest common divisor of 23640 and 26310. 30 What is the highest common factor of 81184 and 3920? 16 What is the highest common divisor of 1881692 and 235? 47 What is the greatest common factor of 318 and 39161594? 106 Calculate the greatest common factor of 42075 and 1596760. 55 What is the highest common divisor of 15928 and 29656? 88 What is the greatest common divisor of 9120 and 66304680? 2280 What is the highest common factor of 503315 and 387? 43 What is the greatest common divisor of 11051154 and 9? 9 Calculate the greatest common divisor of 137900 and 28700. 700 What is the highest common divisor of 14390 and 70? 10 What is the highest common divisor of 18 and 362043306? 18 What is the greatest common divisor of 38400040 and 560? 280 What is the greatest common divisor of 236912484 and 58? 58 What is the greatest common divisor of 3557204 and 49? 49 Calculate the highest common divisor of 48774795 and 45. 15 Calculate the highest common divisor of 1000 and 57501500. 500 Calculate the greatest common factor of 5274 and 10413126. 18 What is the highest common factor of 27 and 20881167? 3 Calculate the highest common divisor of 249 and 144661281. 249 Calculate the greatest common divisor of 580 and 4792053380. 580 What is the highest common factor of 222000 and 18519000? 3000 What is the greatest common factor of 4955 and 149? 1 Calculate the greatest common factor of 158880 and 3632394. 1986 What is the highest common divisor of 118859984 and 3034? 3034 Calculate the greatest common factor of 25 and 3239950. 25 Calculate the greatest common divisor of 16 and 35188976. 16 Calculate the highest common divisor of 1912347 and 2584. 17 Calculate the highest common factor of 15111 and 12443. 23 What is the greatest common divisor of 3084717 and 1767? 93 Calculate the highest common divisor of 1165842 and 38001. 717 What is the highest common divisor of 2860 and 343486? 286 What is the highest common divisor of 164 and 5233340204? 164 What is the highest common divisor of 16175 and 301975? 25 Calculate the greatest common factor of 20520 and 6929528. 152 Calculate the highest common factor of 316 and 360700. 4 What is the highest common divisor of 408 and 7057958? 34 What is the highest common factor of 174 and 63847995? 87 What is the highest common factor of 104456802 and 2765? 79 Calculate the greatest common divisor of 2982 and 24190836. 426 Calculate the greatest common factor of 3852 and 4017957. 321 What is the greatest common divisor of 10638138 and 7182? 798 Calculate the greatest common factor of 44 and 951214. 22 What is the highest common factor of 3417 and 89378469? 3417 Calculate the highest common factor of 9442922 and 332369. 4553 Calculate the highest common factor of 1598151 and 2814. 201 Calculate the highest common divisor of 107182008 and 54. 54 What is the highest common divisor of 10367448 and 564186? 4242 Calculate the greatest common divisor of 12990 and 13734760. 4330 Calculate the greatest common divisor of 30 and 3002620650. 30 What is the highest common divisor of 523 and 221471149? 523 What is the highest common di	{ "pile_set_name": "DM Mathematics" }
Give l(w). 4 Let f(z) = -z*3 - 2z - 1. Let k(a) be the third derivative of a6/60 + a5/60 + a4/8 + a3/6 - 4a2. Let b(h) = 4f(h) + 3k(h). Calculate b(-2). -7 Let i be 9-3(-3)/27. Let n(v) = v2 - 9v - 2. Let l(y) = -y - 1. Let h(j) = 4l(j) - n(j). Give h(i). 4 Let n(r) = -4r*2 + 7r + 10. Let f be 5/2(-16)/(-20). Let y(a) = -2a - a*f + 3a + 3 - 3a + 4a. Let k(i) = -2n(i) + 7y(i). Determine k(-1). 2 Let m(v) = -v. Let x = 2 - -1. What is m(x)? -3 Let a(q) be the second derivative of -q6/120 + q5/30 - q*4/12 + 4q*3/3 + 3q. Let p(g) be the second derivative of a(g). Give p(2). -6 Let l(k) = -k*3 - 2k*2 + 2k + 1. Suppose 0 = -4m - 10 - 2. Let p = 6 + -5. Let u = p + m. Calculate l(u). -3 Let s(h) be the third derivative of -1/180h*6 + 0h + 1/60h5 + 0 + h2 - 1/24h*4 - 1/3h*3. Let d(t) be the first derivative of s(t). Give d(2). -5 Let x be (-3)/(-6) + 1/(-2). Suppose -3 = -xl - l. Let w(h) = h*3 - 3 + 0h*l + h - 4h + h + 3h2. What is w(-4)? -11 Let y = 5 - 6. Let m(w) be the second derivative of 3w5/20 - w4/12 + w*2/2 - 14w. Calculate m(y). -3 Let y(f) = -4f + 43. Let d be y(12). Let q(v) = -v3 - 5v*2 + 2v - 2. Give q(d). -12 Let y(w) = w*3 - 3w*2 + 2w - 3. Let v be -1(3 - 8/(-2)). Let p(f) = 2f + 9. Let o be p(v). Let q = -2 - o. Calculate y(q). 3 Let j(z) = 5z2 - 7z + 9. Let l(x) = 4x2 - 7x + 8. Let s(t) = 3j(t) - 4l(t). Let r be ((-26)/39)/(6/(-45)). What is s(r)? 5 Let g = -5 + 7. Let s(n) = 0 + 6n - 3 - g + n2. What is s(-6)? -5 Let k(b) be the first derivative of -b6/120 - b5/12 + 7b4/24 + b3/6 - b2 + 2. Let u(m) be the second derivative of k(m). Determine u(-6). -5 Let c(a) be the third derivative of -a4/24 + a*3/3 + 54a*2. Give c(3). -1 Let r = 15 - 5. Suppose -5d - r = -0d. Let w(g) = -g3 - 2g*2 + g - 1. Give w(d). -3 Let w(z) = z. Suppose h - 20 = 6h. Let m be (-10)/3(-3 + 0). Let j(u) = 2u + 1. Let y(p) = hj(p) + mw(p). Calculate y(4). 4 Let p(g) be the second derivative of g3/6 - g2 + 5g. Let t = 4 + 0. Determine p(t). 2 Let l be (2 + 0)/40. Suppose lu = -3m + 3u + 3, u - 14 = -2m. Let c(t) = -t*2 + 4t + 6. Determine c(m). 1 Let a(t) = t*3 - 5t2 + t - 3. Let j be (6/(-4))/((-6)/16). Let y(m) = m + 3. Let b be y(j). Suppose -z = 2 - b. Give a(z). 2 Let r(g) be the first derivative of g4/4 - 5g3/3 - 2g*2 - 8g - 23. What is r(6)? 4 Let m(u) = u*2 + 5u - 1. Suppose 4o = 3 - 11. Suppose -2 = a + 1, j = -5a - 17. Let k be (o + 0)/(j/(-4)). Give m(k). -5 Let b(j) = -j*3 - 3j*2 + 1. Let c(g) = 2 - 2g + 8g - 5 + g2. Let k be c(-6). Calculate b(k). 1 Suppose o + 1 = -2b + 12, 15 = o + 3b. Let w = 4 - -9. Suppose -a = oa + i + w, -5a - i = 16. Let r(m) = -2m*2 - 5m - 4. Calculate r(a). -7 Let z be ((-4)/(-8) - 0)6. Suppose -5 = zs - 4s. Let c(n) = -3n + 1. Give c(s). -14 Suppose -7q = 21 - 7. Let f(a) = -3a - 3. Give f(q). 3 Suppose -4r + 1 = -23. Suppose 3o - 5o = -r. Suppose 3f = -3t - 30, 0 = -ot - 3f + f - 25. Let q(h) = -h3 - 6h*2 - 4h + 2. Calculate q(t). -3 Suppose -3q = -2a, 0 = 3a + 4q - q - 15. Let f(z) = -3z2 + 2z - 4z2 + za + 3z*2. What is f(4)? 8 Suppose -3l - 5 = 3d + l, -4d + l = -25. Let x be (d + -2)(1 - 0). Let k(s) = -sx - 2 + 0s2 + s2 + 11 - 3s + 2s. Calculate k(0). 9 Let f = 10 + -6. Suppose 5u - 4w = -20, -u + 7w = 4w + f. Let l(x) be the first derivative of -x*3/3 - 5x*2/2 + 2x - 2. Give l(u). 6 Let u(k) = k*2 + 7k + 4. Let l(q) be the first derivative of -2q3/3 + 5q*2/2 - 2q + 2. Let g be l(3). Determine u(g). -6 Let k(s) = 3s - 3. Suppose 6d - 36 = -3d. Determine k(d). 9 Let h(v) = -v + 2. Let i(z) = z - 3. Let u(g) = 4h(g) + 3i(g). Let m be u(-7). Let w(d) = -d + 3. Give w(m). -3 Suppose -3s = 3s + 24. Let c = 10 + -6. Let r(j) = cj - 2j - j2 + j3 + 5j*2. Give r(s). -8 Let g(j) = -5j + 3. Let t(u) = u*2 + u + 11. Let f be t(0). Let b(h) = 14h - 8. Let a(l) = fg(l) + 4b(l). Determine a(3). 4 Let s(n) be the second derivative of -n7/2520 + n6/120 - n5/20 + n4/3 + 3n. Let f(r) be the third derivative of s(r). Determine f(5). -1 Let w(a) = -a3 - a2 - a + 1. Suppose 0y - 4y = -3u - 13, -4u = 3y + 9. What is w(u)? 22 Let l be -3 - -2 - (-3 + 0). Let b(p) = -3p + lp + 2p - 3 - 3p. Calculate b(-2). 1 Suppose -4c - 6w - 29 = -w, 2c + 4w + 16 = 0. Let q(m) = m + 3. Give q(c). -3 Let i(h) = h*2 + 3h - 1. Suppose -6u + 36 = -15u. Calculate i(u). 3 Suppose d = -3d + 4. Let q(c) = -4c*3 - c + 1. Give q(d). -4 Let h(b) = -b - 1. Let d be h(3). Let n(f) = -5f*2 - 6 + 4f*2 - 6f - f. What is n(d)? 6 Let q = -4 - -6. Suppose q = -2g + 3j, -2j + 29 = 5g - j. Let u(c) = -c + 7. Give u(g). 2 Let u be (-1 - -1) + 1 + 3. Let f(t) = -u - t + t - t. Let r be (-46)/(-14) - 4/14. Give f(r). -7 Let n(q) = q*3 - 3q*2 - 4q + 3. Suppose 4g - m - 12 = 0, -3m = -0m + 12. Let f = -4 + g. Let l be (-4 - f) + (-18)/(-3). Determine n(l). 3 Let s(p) = -4p*3 - 3p*2 - p + 5. Let w(c) = 4c*3 + 2c*2 + c - 4. Let i(r) = -4s(r) - 5w(r). Give i(1). -3 Let m(v) = -2v + 6. Let b(w) = 1. Let k(t) = -14b(t) + 2m(t). Determine k(-3). 10 Let b(s) = 0 - s*3 - 4s + 1 - 10s2 + 4s2. Let m(u) = u2 + 4u - 7. Let c be m(-7). Let p = 9 - c. Calculate b(p). -4 Suppose 11 = -4i - 4d - 21, 4d - 4 = 5i. Let m(p) = p2 + 6p + 2. Determine m(i). -6 Let v = -19 + 23. Let x(k) = -4k + 4. Calculate x(v). -12 Let l(a) = -a. Let y(q) = -q3 + q - 2. Let d be y(0). Give l(d). 2 Suppose -3x - 5r + 16 = -0x, 2r = -3x + 10. Let f(y) be the second derivative of y + 0yx + 0 + 1/3y*3. Give f(2). 4 Let a(s) = -4s*2 + s + 1. Suppose -15 = -2n - n. Suppose 0 = y + 2v - 0v, 0 = ny - 5v. Suppose -3 = 3q - yq. Calculate a(q). -4 Let a be 1(2 - -1) - 4. Let q(o) = -o + o3 - o2 - 2o*3 - 3o*3. Calculate q(a). 4 Suppose 48 = 5f - f + 5s, f + 3s = 19. Let u be 40/f - (-26)/91. Let d(c) = c*3 - 5c*2 - 6c - 7. Calculate d(u). -7 Let m(u) = -5u3 + 2u*2 - 5u + 5. Let o(d) = -14d3 + 7d*2 - 14d + 14. Let g(q) = -11m(q) + 4o(q). Give g(6). -5 Let k be (-2)/(-4)22 - 1. Let s be (-72)/15k/(-2). Let r(q) = -s - 2q + 24. Determine r(1). -2 Let k be (1 + -21)/(-1). Let u = k + -5. Let h(g) be the first derivative of g*2/2 + 2g + 5. What is h(u)? -2 Let w(g) = -g - 5. Let z = -46 - -41. What is w(z)? 0 Let p(y) be the third derivative of y*4/12 + 2y*3/3 + 5y2. Let f(u) = u + 1. Let o be f(-5). What is p(o)? -4 Let g(h) = h3 + 9h2 + 1. Let d be g(-9). Let u be d + (-2 - -2 - 0). Let p(r) = 6r*2 + 2r - 1. Determine p(u). 7 Let d(n) = -n*2 - 5n + 1. Let c be d(-4). Let i(f) = -f*2 + 13f - 7. Let m be i(12). Let o(q) = 3q2 + 4 + q2 - 2q - 3q2 - mq. What is o(c)? -6 Suppose 49 = 3d - 5o, d - 13 = 2o - o. Let g(v) = 21v*2 + 2v - 3. Let b(m) = 2 - 6m2 - 1 - m - m2. Let y(c) = db(c) + 3g(c). Calculate y(-1). 8 Let x(a) be the second derivative of -a5/20 + a4/12 - a3/6 - 2a*2 + 2a. Let c be 0/(-17)(-1 - 0). Calculate x(c). -4 Let n = -8 + 10. Let j be 1n1/1. Suppose -7b + 15 = -jb. Let m(t) = -t3 + 3t*2 - 3t + 3. What is m(b)? -6 Let n(q) = -q - 4. Let k be n(-5). Let l(o) = -o. Let u(p) = 4p + 7. Let v(f) = ku(f) + 3l(f). Give v(-3). 4 Suppose -j + 2 = -0. Let y(n) = -n - jn*2 - n + 0n2 + 1 + n3. Let b be (-13)/(-4) - (-6)/(-24). Calculate y(b). 4 Let o(g) be the first derivative of -g2/2 + g + 4. Calculate o(5). -4 Let c(l) be the third derivative of -l6/120 + l*5/10 + 3l4/8 - l3 - 8l2. Determine c(7). 8 Let z(k) = -3k - 3. Let b(l) = l*3 + 4l*2 + 2l + 4. Let j be b(-4). Calculate z(j). 9 Suppose 7 = -2y - 5s, -5y - 2s + 8 = -27. Let g(q) = 2q2 + q + 15. Let t(o) = -o2 - 3 - 2 - 2. Let c(n) = yt(n) + 4g(n). What is c(2)? 1 Let i(g) = g2 - g - 1. Let b = -1 - -2. Let y(h) be the first derivative of 11h*3/3 - 3h*2/2 - 4h - 1. Let o(q) = by(q) - 4i(q). Determine o(-1). 6 Let w(z) = -2. Let q(n) = 4n - 13. Let p(b) = 2q(b) - 14w(b). Calculate p(-2). -14 Let g(z) = -z. Let t = 0 + 6. Let c = t + -4. What is g(c)? -2 Let t(p) = 11p - 25p + 17p +	{ "pile_set_name": "DM Mathematics" }
ivisor of 44 and 1284272. 44 What is the greatest common divisor of 155210 and 160820? 1870 Calculate the greatest common divisor of 2352 and 2747724. 588 What is the highest common divisor of 325192 and 24? 8 What is the highest common divisor of 216432 and 312? 24 Calculate the greatest common factor of 534 and 336954. 534 Calculate the greatest common divisor of 10900 and 147586. 218 Calculate the greatest common factor of 6517 and 6384. 133 What is the greatest common factor of 699268 and 236? 236 Calculate the greatest common factor of 17995 and 112240. 305 Calculate the highest common divisor of 1057522 and 458. 458 What is the highest common divisor of 16234 and 68? 2 What is the greatest common divisor of 131142 and 44? 22 Calculate the highest common divisor of 19 and 1824. 19 What is the greatest common factor of 4150 and 3? 1 Calculate the greatest common factor of 207416 and 4. 4 Calculate the highest common factor of 330957 and 9. 9 What is the greatest common factor of 1336908 and 36? 12 What is the greatest common divisor of 182 and 963937? 13 Calculate the highest common factor of 1968 and 8036. 164 What is the greatest common factor of 69 and 64929? 69 Calculate the highest common divisor of 259455 and 75. 15 Calculate the greatest common divisor of 107627 and 1547. 221 What is the greatest common divisor of 27322 and 57? 19 What is the greatest common divisor of 690527 and 10577? 1511 What is the highest common factor of 23520 and 22330? 70 What is the highest common divisor of 334 and 6725257? 167 What is the greatest common divisor of 336 and 604? 4 Calculate the greatest common factor of 12194 and 169778. 938 Calculate the greatest common divisor of 1286594 and 79. 79 Calculate the greatest common divisor of 17370 and 360. 90 What is the greatest common divisor of 792 and 771111? 99 Calculate the highest common factor of 762 and 1687449. 381 What is the greatest common divisor of 35 and 424? 1 What is the highest common divisor of 109680 and 285? 15 What is the greatest common factor of 464 and 868463? 29 What is the highest common factor of 126 and 364986? 18 What is the highest common factor of 206 and 132046? 206 What is the highest common divisor of 2023 and 1274201? 289 What is the greatest common divisor of 470 and 2914? 94 What is the greatest common factor of 20 and 1044? 4 What is the highest common factor of 288 and 1233? 9 What is the greatest common factor of 34 and 4658? 34 What is the greatest common divisor of 2472 and 466590? 618 What is the greatest common divisor of 216 and 350514? 54 What is the highest common factor of 8798 and 18338? 106 Calculate the greatest common factor of 1962 and 162. 18 What is the highest common factor of 108410 and 296? 74 What is the greatest common factor of 38 and 1289606? 38 What is the highest common factor of 342 and 17366? 38 Calculate the greatest common factor of 1 and 3049. 1 What is the greatest common factor of 9 and 11148? 3 Calculate the highest common divisor of 1920 and 19710. 30 What is the greatest common divisor of 63 and 750? 3 What is the greatest common divisor of 2241 and 581? 83 What is the greatest common divisor of 25622 and 2438? 46 Calculate the highest common factor of 639 and 1207. 71 Calculate the highest common divisor of 2230 and 890662. 446 Calculate the highest common divisor of 11031939 and 186. 93 What is the greatest common divisor of 3080 and 13783? 77 What is the greatest common factor of 1519182 and 84? 42 What is the highest common factor of 186306 and 60? 6 Calculate the highest common divisor of 799 and 40987. 17 What is the highest common factor of 7208 and 637007? 901 What is the greatest common factor of 3621570 and 40? 10 Calculate the greatest common factor of 468 and 2713698. 234 Calculate the highest common divisor of 171 and 382158. 9 Calculate the greatest common factor of 216 and 462834. 54 Calculate the highest common divisor of 41 and 533. 41 Calculate the greatest common divisor of 395320 and 296. 8 What is the greatest common divisor of 99 and 491931? 99 Calculate the greatest common divisor of 197446 and 8074. 734 What is the highest common divisor of 287048 and 2332? 212 Calculate the greatest common factor of 28007 and 21. 7 What is the highest common factor of 220 and 228250? 110 Calculate the highest common factor of 1030304 and 176. 176 Calculate the highest common divisor of 446865 and 15. 15 What is the highest common divisor of 1632 and 28356? 204 What is the highest common factor of 60 and 2359950? 30 Calculate the highest common factor of 306 and 809370. 306 What is the highest common factor of 6039 and 1611? 9 What is the highest common divisor of 35 and 27279? 7 Calculate the greatest common factor of 791 and 13272. 7 Calculate the highest common divisor of 768 and 356112. 48 What is the highest common divisor of 92670 and 1470? 30 Calculate the highest common divisor of 36492 and 180. 12 Calculate the highest common factor of 36345 and 15. 15 What is the highest common factor of 396 and 34551? 99 Calculate the highest common factor of 4776 and 3188. 4 Calculate the greatest common factor of 1313 and 533. 13 Calculate the greatest common factor of 2646 and 138726. 378 Calculate the highest common divisor of 7 and 15519. 7 What is the highest common divisor of 1344 and 33936? 336 What is the greatest common divisor of 364057 and 371? 53 What is the greatest common factor of 27 and 171486? 9 What is the greatest common divisor of 70576 and 528? 176 Calculate the greatest common factor of 228 and 783888. 12 What is the highest common divisor of 7065 and 30? 15 What is the greatest common divisor of 95323 and 261? 29 What is the highest common factor of 765 and 53125? 85 What is the greatest common factor of 55432 and 936? 104 What is the greatest common factor of 25109 and 425? 17 Calculate the greatest common factor of 75782 and 56. 14 What is the highest common divisor of 157832 and 18312? 872 Calculate the highest common factor of 136 and 780232. 136 Calculate the highest common divisor of 3626 and 2146. 74 Calculate the highest common factor of 9330 and 330. 30 What is the highest common divisor of 2958 and 82059? 51 Calculate the highest common factor of 86400 and 19170. 270 What is the greatest common factor of 39998 and 182? 14 What is the highest common divisor of 957 and 43413? 87 What is the highest common divisor of 76429 and 920? 23 What is the highest common divisor of 916968 and 39? 39 Calculate the greatest common factor of 47571 and 39093. 471 Calculate the highest common divisor of 40 and 34390. 10 What is the greatest common divisor of 2127 and 145? 1 What is the greatest common factor of 52 and 368212? 52 What is the highest common factor of 13087 and 9706? 23 Calculate the greatest common factor of 11499 and 15. 3 Calculate the greatest common divisor of 50373 and 965. 193 What is the greatest common divisor of 1482 and 6383? 13 What is the highest common factor of 44745 and 428610? 2355 Calculate the greatest common divisor of 882 and 1254. 6 Calculate the greatest common factor of 402 and 202206. 402 Calculate the highest common factor of 21160 and 1564. 92 What is the greatest common factor of 128849 and 932? 233 Calculate the highest common divisor of 38898 and 8. 2 Calculate the greatest common factor of 104 and 88439. 13 Calculate the greatest common divisor of 144795 and 8820. 735 Calculate the highest common divisor of 53497 and 61. 61 What is the greatest common factor of 3951 and 5943621? 1317 Calculate the highest common factor of 93 and 207979. 31 What is the highest common divisor of 24573 and 42? 3 What is the greatest common factor of 1175 and 70171? 47 What is the greatest common divisor of 2226 and 1247302? 742 What is the highest common divisor of 73852 and 4491? 499 What is the greatest common factor of 34 and 46257? 17 Calculate the greatest common divisor of 522 and 73341. 261 Calculate the highest common factor of 12201 and 25149. 249 Calculate the highest common divisor of 67984 and 434. 14 Calculate the greatest common divisor of 30998 and 17842. 22 What is the highest common divisor of 7 and 8575? 7 Calculate the greatest common factor of 74 and 390868. 74 Calc	{ "pile_set_name": "DM Mathematics" }
ppose j = -3q + 4q - 15, -cq - 37 = 2j. Let z = 15 + j. Is 2/71 at least as big as z? True Suppose 2d = 10, 59d - 64d + 10 = 5v. Is v != -10? True Let m = 0.07 + -0.31. Let d = m - -0.14. Which is smaller: -3/8 or d? -3/8 Suppose 2q + 5a = q - 1, -4 = 4q - 3a. Let x = -297677/107 - -2782. Let i = x + -151/2247. Which is smaller: q or i? q Let k = -20 - -22.3. Let m = k + -8.8. Let o = 7 + m. Which is bigger: 2/7 or o? o Let c = -0.39 - -0.79. Is 0.49 smaller than c? False Let t be 46/(-84) - (-4)/(-24). Suppose -g = h + 4h - 14, 0 = 2g - h + 5. Let z = g + -1. Which is greater: z or t? t Let y = -363 - -245. Let v = y + 128.1. Let z = 10 - v. Is 5 greater than or equal to z? True Let w be (0/(-11 + 15))/8. Is 3/67 equal to w? False Suppose 5z + 44 = -56. Is z less than or equal to -19? True Let a(l) = 5l + 16. Let k be a(-9). Let i be 1(30/k + -2 + 3). Which is smaller: i or 1? i Let b(m) = -3m - 1. Let s be b(-6). Let k = s - 13. Suppose -12 = -5v - p, 4v - p - kp = 27. Is v > 4? False Let v be 8/3777/15836. Which is smaller: v or 0? 0 Suppose 4b = 3b + 5. Suppose 2z - 6 = -3i + 5z, -bi = -z - 2. Let d(s) = s*3 + 7s*2 + s + 8. Let a be d(-7). Do i and a have the same value? False Let j = 27 + -22. Suppose -jo + 3w - 17 = 0, -4o - 7 = -w + 1. Let s be (-40)/138 - o/3. Which is greater: 0 or s? s Suppose -2a + 8 = 2f - 4, 0 = -f + a. Suppose c - 15 = -3w + 4c, 25 = -5w - 5c. Suppose -fs = -ws. Is 2/7 less than s? False Let v = 1827 - 1707. Is 114 <= v? True Let w(f) = -f*3 + 3f*2 + 4f + 24. Let q be w(4). Which is greater: -1 or q? q Let v = -59 + -13. Let t be (-4)/10 + v/(-30). Suppose 0 = 2i + t. Is i not equal to -2/19? True Let x(r) = -r3 - 16r*2 + 25r - 58. Let m be x(-17). Is -194 at least m? True Let c = -241.62 - 4.48. Let l = c + 217. Let p = l + 29. Which is greater: p or 0.1? 0.1 Suppose -3t - 40 = 5l, -5l + 2t = -2t + 40. Let w be (l/12)/((-14)/42). Let b(m) = m*3 - 3m*2 + 3m - 2. Let k be b(2). Is k equal to w? False Let d = 34 - 52. Let v be 102/46/d. Let n = v - -123/14. Is n < -1? False Let p(c) = 2c - 19. Let b be p(8). Let m be b - (16/(-28) + -2). Let g = -2 + 3. Which is bigger: m or g? g Let y(r) = 1 + 7r2 - 4r*2 + 0 - 5r - 4r2. Let v be y(-5). Let c be 8/(-4) + (2 - -3). Is v equal to c? False Let v(q) = 2q - 2. Suppose 8o = 3o + 10. Let h be v(o). Suppose 3 = -3c + hc. Which is greater: -2 or c? -2 Let h = -26 + -22. Let n be 2/3 + h/99. Let x be (-3)/3643. Which is smaller: n or x? x Let i(m) = -5m2 + 2m - 1. Let k be i(1). Suppose -32 = 2d - 6d. Let w be (-27)/18d/3. Are k and w equal? True Let i = 61 + -46. Let n be 34/3 + (-2)/(-3). Let m = n - i. Is 4 > m? True Let k(a) = -a2 + 15a - 17. Let u be k(13). Suppose u = -4m - 7. Is -2 not equal to m? True Let c(x) = -15x - 35. Let t be c(1). Do t and 14 have different values? True Let z(b) = -b*3 - 5b*2 - 5b - 4. Let j be z(-3). Let m = 3 + j. Let n(l) = -l - 9. Let q be n(m). Is -3 greater than q? True Let h(t) = t*2 + 5t - 11. Let o be h(-9). Suppose 45 = 4v + o. Which is greater: v or 9/2? v Let v(z) = -z3 - 3z*2 + 3z + 3. Suppose -5o = -o + 16. Let c be v(o). Let i be (1/(-2))/(1/(-2)). Which is smaller: i or c? i Let s be (-8)/(-480)3/(-9). Is s < 0? True Let u be 0 + 18/45 + 3/15. Which is smaller: u or 78/7? u Suppose 2z = -6, 5z - 2358 - 1647 = -5p. Is 804 smaller than p? False Suppose -34 + 7 = -3c. Suppose 5 - c = -2i. Suppose -5s = o - 0s - 11, io = 3s - 4. Do -0.2 and o have the same value? False Let l = 138 + -131. Suppose -5x = -4g - l - 0, x = -4g + 11. Is g equal to 4? False Let h = 36 - 38.2. Let i = h - -2.2. Let z(g) = g + 4. Let f be z(-3). Which is smaller: i or f? i Let h be (-1 + 0)/(2/(-6)). Let j(s) = -s*2 + 6s - 5. Let w be j(h). Let o be 3/(-3) + -1 + w. Which is bigger: o or -3? o Let b(h) = h*3 - 8h*2 + 4h + 18. Let r be b(7). Is r >= 36? False Let a = 48 - 93. Let p = -38 - a. Is p less than -2/3? False Suppose -2t - 3a = -1, 0 = a - 6a + 5. Suppose 0h = -5h + 30. Is t != h? True Let k(z) = 7z*3 - 17z*2 + 11z + 43. Let s(u) = 4u3 - 8u*2 + 5u + 22. Let t(y) = -3k(y) + 5s(y). Let r be t(10). Which is smaller: 3/4 or r? 3/4 Let l = -5224/9 - -581. Let w be 3/((-36)/(-24) + (-3)/(-2)). Which is greater: w or l? w Let k be 2 - ((-108)/22)/(-3). Suppose 0x = -2v + x + 5, -3v + 5x + 18 = 0. Are k and v unequal? True Let s(u) be the first derivative of -16u2 - 31u - 20. Let d be s(-2). Is d greater than or equal to 36? False Suppose 77 = 4c - 79. Suppose c = -4n + 23. Let o be (-12 + 3)/(33/n). Which is smaller: 1 or o? 1 Let c = 11/6 - -179/12. Which is smaller: c or 16? 16 Let p = 42 + -42.92. Let l = -0.08 + p. Let u = -169/296 - 2/37. Which is smaller: u or l? l Let w be (-68)/(-190) + (-1)/((-60)/(-12)). Is w <= 1/11? False Let b(z) = z*3 - 5z*2 + 7z - 1. Let p be b(3). Suppose -a - 11 = 3u, p = -3u - 13. Which is greater: a or 7/2? a Suppose -4f + z = -14, -5f + 6z + 11 = 8z. Suppose -o = -4n - 1, 3o - f = 2n - 0o. Is n != -2/25? True Let b = 618 + -618. Is -1/4 != b? True Let i = -85.9 - -94. Let r = i + -8. Let x = -0.5 + r. Which is smaller: 3 or x? x Let w = -89 - -64. Let k = -40 - w. Let v = 14.9 + k. Are 1/4 and v nonequal? True Let g(a) be the third derivative of -a*5/60 - 5a*4/12 + 11a*3/6 - 10a*2. Let k be g(-11). Let v be ((-2)/51)/((-1)/9). Which is greater: k or v? v Let j be ((-6)/(-16))/(-3)2. Suppose -3d + 50 = -2d. Let h = -49 + d. Which is greater: j or h? h Let p(y) = y*2 - 5y + 6. Let r be p(4). Suppose 7 - 2 = -5b, rs = -2b + 8. Suppose -3 = 3n - 12. Is s less than n? False Suppose 0k + 5k - 395 = 5t, -4k - 422 = 5t. Is -82 bigger than t? False Let a(u) = u3 + 8u*2 + 6u. Let b be a(-5). Let v be (50/b)/5-3. Are v and 0.07 nonequal? True Let u(c) = -c3 - 16c*2 + c + 18. Let o be u(-16). Suppose 0 = oa - 32 + 34. Which is smaller: a or 3/7? a Let d = -9 + 29. Let b = -22 - -21. Is b >= d? False Let t = -1171 - -1169. Which is smaller: t or -53? -53 Let m = 219 - 197. Which is smaller: m or 28? m Let h = -6 - -15. Let t = h - 22. Let c = -10 - t. Which is smaller: c or 2/7? 2/7 Let i(j) = 5j2 + 13j - 5. Let t(x) = 6x2 + 14x - 4. Let f(h) = 5i(h) - 4t(h). Suppose -7p = -2p + 50. Let k be f(p). Which is greater: k or 2/31? k Let x = 443 + -444. Which is smaller: -1/785 or x? x Suppose 3k + k + 5i - 31 = 0, 2k = -2i + 16. Let q(c) = 0c2 + 1 - c2 - k + 13c - 4. Let x be q(12). Which is smaller: x or -2/81? -2/81 Let n = 758 + -741. Which is greater: 2/31 or n? n Let g = 137 + -77. Suppose 6n + g = n - b, 5n = -5b - 40. Let m be (-15)/2(-36)/(-225)10. Which is bigger: n or m? m Let r(a) = 7a*2 + 15a + 15. Let w(k) = -6k2 - 14k - 15. Let x(i) = 5r(i) + 6w(i). Let c be x(-6). Suppose y - c + 1 = 0. Which is bigger: y or 1/2? y Let y(i) = 25i + 53. Let t be y(-3). Which is smaller: -8 or t? t Let d = -1.46 + 0.06. Let o = d + 1.5. Suppose -w - 2f + 2 + 10 = 0, -5f - 12 = -w. Which is smaller: o or w? o Let j = 55 + -55. Let n be (1/2)/((-27)/(-18)) + j. Is 1.8 greater than n? True Let s(c) = -11c - 39. Let g(i) = 6i + 20. Let q(y) = 5g(y) + 3s(y). Let z be q(-8). Which is bigger: z or 8? 8 Suppose -31h = -27h - 12. Suppose 3b - hu = 3 + 3, 0 = -3b + u. Is -4/87 at least as big as b? True Let p be 1 - (-1 + (-180)/(-93)). Let i = 2072 + -2072.1. Is i >= p? False Let w(b) be the first derivative of b*3/3 + 4b*2 + 7b - 16. Let y be w(-9). Is y > 14? True Let b be (-80)/631230/(-350). Which is smaller: b or -1? -1 Suppose -5o - 12 = 3. Let t(h) = -h*2 - 5h + 3. Let y be t(o). Let i be 5/y - 7/21. Which is bigger: i or -1? i Let n(v) = 2v2 - 10v + 2. Let q be n(5). Suppose -293 + 115 = -qu. Which is smaller: 90 or u? u Let l(i) = -15i. Let m be l(1). Let a = 68 - 56. Let k = m + a. Does -11/3 = k? False Let y be 2 + ((-16)/2 - -14). Which is greater: y or 5? y Suppose -28h = 7h. Which is smaller: h or 9/16? h Suppose -6y + 2y = 20. Let c be ((-3)/3)/(1/(-311)). Let b = -1267/4 + c. Is y != b? True Suppose 0 = 131k - 135k + 20. Which is bigger: k or 60/17? k Let u(h) = h**3	{ "pile_set_name": "DM Mathematics" }
ed by 79. 22 Calculate the remainder when 12078 is divided by 225. 153 Calculate the remainder when 80399 is divided by 191. 179 Calculate the remainder when 6611 is divided by 22. 11 What is the remainder when 83974 is divided by 43? 38 What is the remainder when 1283 is divided by 404? 71 What is the remainder when 23610 is divided by 621? 12 What is the remainder when 342698 is divided by 3327? 17 Calculate the remainder when 2329645 is divided by 97. 93 Calculate the remainder when 17265 is divided by 110. 105 Calculate the remainder when 106713 is divided by 9701. 2 Calculate the remainder when 47686 is divided by 262. 2 Calculate the remainder when 66105 is divided by 13221. 0 Calculate the remainder when 70294 is divided by 35144. 6 What is the remainder when 3629 is divided by 455? 444 What is the remainder when 2325 is divided by 43? 3 Calculate the remainder when 26056 is divided by 71. 70 Calculate the remainder when 69898 is divided by 20. 18 What is the remainder when 4290 is divided by 1691? 908 What is the remainder when 39762 is divided by 313? 11 What is the remainder when 5827 is divided by 5399? 428 What is the remainder when 2206 is divided by 100? 6 Calculate the remainder when 10501 is divided by 4975. 551 Calculate the remainder when 22057 is divided by 4279. 662 What is the remainder when 653221 is divided by 571? 568 What is the remainder when 353796 is divided by 18620? 16 Calculate the remainder when 1298 is divided by 429. 11 Calculate the remainder when 4346 is divided by 42. 20 Calculate the remainder when 1770 is divided by 437. 22 What is the remainder when 15720 is divided by 787? 767 What is the remainder when 350727 is divided by 11690? 27 Calculate the remainder when 42176 is divided by 10544. 0 Calculate the remainder when 55340 is divided by 428. 128 What is the remainder when 2472 is divided by 414? 402 What is the remainder when 3409 is divided by 117? 16 Calculate the remainder when 1067962 is divided by 533971. 20 Calculate the remainder when 24695 is divided by 24. 23 Calculate the remainder when 2268 is divided by 57. 45 What is the remainder when 16468619 is divided by 347? 346 What is the remainder when 37677 is divided by 24? 21 Calculate the remainder when 465404 is divided by 662. 18 What is the remainder when 22783 is divided by 256? 255 Calculate the remainder when 8652 is divided by 980. 812 What is the remainder when 3207 is divided by 1413? 381 Calculate the remainder when 3367 is divided by 192. 103 Calculate the remainder when 53739 is divided by 78. 75 Calculate the remainder when 215233 is divided by 107608. 17 Calculate the remainder when 18066 is divided by 899. 86 What is the remainder when 11956 is divided by 52? 48 What is the remainder when 24887 is divided by 415? 402 What is the remainder when 4017 is divided by 1339? 0 What is the remainder when 45316 is divided by 22584? 148 What is the remainder when 5111 is divided by 269? 0 What is the remainder when 4064 is divided by 8? 0 Calculate the remainder when 1947 is divided by 733. 481 What is the remainder when 27857 is divided by 1740? 17 Calculate the remainder when 2700 is divided by 667. 32 What is the remainder when 7445 is divided by 3719? 7 What is the remainder when 6048 is divided by 5713? 335 Calculate the remainder when 2679594 is divided by 525. 519 Calculate the remainder when 56181 is divided by 2447. 2347 Calculate the remainder when 1479 is divided by 826. 653 What is the remainder when 2062 is divided by 44? 38 Calculate the remainder when 14775 is divided by 1054. 19 Calculate the remainder when 721448 is divided by 120237. 26 Calculate the remainder when 9892 is divided by 3244. 160 What is the remainder when 17077 is divided by 898? 15 What is the remainder when 41851 is divided by 364? 355 What is the remainder when 185 is divided by 58? 11 What is the remainder when 493362 is divided by 61? 55 What is the remainder when 77250 is divided by 62? 60 What is the remainder when 900 is divided by 122? 46 Calculate the remainder when 481953 is divided by 102. 3 What is the remainder when 11735 is divided by 65? 35 What is the remainder when 227383 is divided by 113684? 15 What is the remainder when 5517 is divided by 69? 66 What is the remainder when 1442 is divided by 945? 497 What is the remainder when 133157 is divided by 86? 29 What is the remainder when 66872 is divided by 33434? 4 Calculate the remainder when 91099 is divided by 118. 3 Calculate the remainder when 108673 is divided by 104. 97 Calculate the remainder when 57404 is divided by 1063. 2 Calculate the remainder when 39397 is divided by 13132. 1 What is the remainder when 3898 is divided by 3871? 27 Calculate the remainder when 44457 is divided by 2. 1 What is the remainder when 1985 is divided by 576? 257 Calculate the remainder when 64797 is divided by 18. 15 What is the remainder when 43194 is divided by 73? 51 Calculate the remainder when 8480 is divided by 860. 740 What is the remainder when 1283910 is divided by 12839? 10 What is the remainder when 420383 is divided by 348? 347 Calculate the remainder when 4827 is divided by 1145. 247 What is the remainder when 15769 is divided by 2603? 151 Calculate the remainder when 94531 is divided by 11. 8 Calculate the remainder when 21458 is divided by 10724. 10 Calculate the remainder when 2602 is divided by 152. 18 Calculate the remainder when 192353 is divided by 261. 257 Calculate the remainder when 77863 is divided by 29. 27 What is the remainder when 268706 is divided by 78? 74 Calculate the remainder when 2314813 is divided by 32. 29 What is the remainder when 43426 is divided by 201? 10 Calculate the remainder when 23928 is divided by 150. 78 What is the remainder when 45331 is divided by 756? 727 What is the remainder when 58550 is divided by 457? 54 Calculate the remainder when 18318 is divided by 273. 27 What is the remainder when 829 is divided by 115? 24 Calculate the remainder when 3261 is divided by 16. 13 Calculate the remainder when 626634 is divided by 31. 0 What is the remainder when 148592 is divided by 13? 2 What is the remainder when 1961 is divided by 263? 120 What is the remainder when 240676 is divided by 120333? 10 Calculate the remainder when 365407 is divided by 304. 303 Calculate the remainder when 7938 is divided by 3. 0 What is the remainder when 2153 is divided by 546? 515 Calculate the remainder when 76526 is divided by 223. 37 Calculate the remainder when 1082 is divided by 345. 47 Calculate the remainder when 4202 is divided by 525. 2 Calculate the remainder when 70811 is divided by 681. 668 What is the remainder when 8360 is divided by 7297? 1063 What is the remainder when 733176 is divided by 64? 56 What is the remainder when 6642 is divided by 6642? 0 What is the remainder when 11967 is divided by 5978? 11 Calculate the remainder when 1374 is divided by 484. 406 What is the remainder when 872080 is divided by 185? 175 Calculate the remainder when 8454 is divided by 223. 203 What is the remainder when 365158 is divided by 40? 38 Calculate the remainder when 38410 is divided by 9597. 22 Calculate the remainder when 28375 is divided by 156. 139 What is the remainder when 29693 is divided by 48? 29 What is the remainder when 193266 is divided by 3? 0 What is the remainder when 1696271 is divided by 359? 355 Calculate the remainder when 5086 is divided by 1686. 28 Calculate the remainder when 77829 is divided by 376. 373 Calculate the remainder when 51027 is divided by 81. 78 Calculate the remainder when 1989492 is divided by 497373. 0 What is the remainder when 295 is divided by 232? 63 What is the remainder when 1484 is divided by 61? 20 Calculate the remainder when 246484 is divided by 82. 74 What is the remainder when 334143 is divided by 37? 33 Calculate the remainder when 44873 is divided by 69. 23 What is the remainder when 27537 is divided by 170? 167 What is the remainder when 32826 is divided by 89? 74 Calculate the remainder when 6825 is divided by 3. 0 Calculate the remainder when 2552 is divided by 2402. 150 Calculate the remainder when 1002738 is divided by 905. 903 Calculate the remainder when 177102 is divided by 44245. 122 Calculate the remainder w	{ "pile_set_name": "DM Mathematics" }
factors of y/(-1)11/(-1)? 11 Suppose 0 = 5x - n - 210, 2n + 94 + 116 = 5x. What are the prime factors of x? 2, 3, 7 Suppose -2n = p - 2, -4p = 2n - 2 + 12. Suppose nq - 2q - 4 = 0. Suppose -3k = -11 + 2, 2x - qk = 12. List the prime factors of x. 2, 3 Suppose -j = -2c - 1, c + 2j + 3j - 5 = 0. Suppose 3b + 2b - 70 = c. What are the prime factors of b? 2, 7 Suppose 3r + 512 = 5q - 413, -370 = -2q + 5r. What are the prime factors of q? 5, 37 Let u = -77 - -109. List the prime factors of u. 2 Suppose 2c - 102 = -20. Suppose 0d = 4d. Suppose 5o = -w - 3, -5w = -dw - 3o - c. What are the prime factors of w? 7 Let k(n) = 2n2 - 3n + 2. Let l be k(2). Suppose 3c + s - 9 = 0, lc + 2s = 9 + 5. List the prime factors of c. 2 Let x(p) = -p2 + 20p - 13. List the prime factors of x(13). 2, 3, 13 Let a be -31 - (-2 + (-12)/(-4)). Let y = a + 59. What are the prime factors of y? 3 Let q(l) = -l*2 - 5l - 3. Let y(j) = -j - 3. Let z be y(0). List the prime factors of q(z). 3 Let l(i) = 2i2 + 6i - 10. Let m(b) = -b*2 + b. Let w(f) = l(f) + 3m(f). Let r be w(7). What are the prime factors of (6 - r)14/4? 7 Let f = 36 - 22. Suppose 0c - f = -2c. What are the prime factors of c? 7 Let j = 69 - 47. What are the prime factors of j? 2, 11 Suppose 3r = 2q - 24, -2r + 6 = 2. What are the prime factors of q? 3, 5 Let b = -2 + 5. Suppose -x = bq + 29, 0x = 3q + 5x + 37. List the prime factors of 6/(-3) - (q + -1). 2 Suppose -4f + 3y + 204 = 0, 153 = 3f - y - 3y. List the prime factors of f. 3, 17 Let a = -148 - -250. List the prime factors of a. 2, 3, 17 Let u = 29 - 9. Let d = u - 10. What are the prime factors of d? 2, 5 Suppose -25 = -5d + 10. Let x = 16 - d. What are the prime factors of x? 3 Let n = -21 - -42. Let h = n + 23. Suppose 5s + 0s = 4g + 52, 0 = 4s - 2g - h. What are the prime factors of s? 2, 3 List the prime factors of 2-1(-21 + 4). 2, 17 Suppose 3g = -4w + 460, 4w - 439 - 173 = -4g. Suppose -g = -3p - p. Let u = -27 + p. What are the prime factors of u? 11 Let d(g) = -g - 3. Let r be d(-6). Let z(s) = 2s*2 - s + 1. What are the prime factors of z(r)? 2 Let h(u) = u + 13. List the prime factors of h(9). 2, 11 Let p be -5(0 + (-3)/3). Let u = p - 0. Suppose 4q - k - 6 = 3, 0 = -2q + uk + 9. List the prime factors of q. 2 Let t(m) = -m - 5. Let p be t(-7). List the prime factors of p/3 + (-160)/(-12). 2, 7 Let l = 6 - 2. What are the prime factors of 3/24l12? 2, 3 Let b(j) = j + 3. Let z be b(2). Suppose u = -z, 3u + u + 180 = 4g. What are the prime factors of g? 2, 5 Suppose -3d + 2z = 2d - 30, -5z = d - 33. List the prime factors of (-201)/(-6) + (-4)/d. 3, 11 Let t = 70 + -45. What are the prime factors of t? 5 Let o(n) = n3 + 6n*2 - 10n - 9. Let m = -7 - -5. Let z be 1/(2/28m). List the prime factors of o(z). 2, 3 Let u = -54 - -81. List the prime factors of u. 3 Suppose -188 = -5o + 822. What are the prime factors of o? 2, 101 Let l be 0 + -1 - (-1 + 1). Let a be l10(-4)/10. Let k = 13 - a. What are the prime factors of k? 3 Suppose -5l + 225 = 85. Suppose 0 = 3b - 7b + l. What are the prime factors of b? 7 Let m(n) = 72n*2 + 2n - 1. List the prime factors of m(1). 73 Let i = 20 + -70. Let p = 72 + i. Suppose 5y + 3h + 2h = 35, 2h + p = y. What are the prime factors of y? 2, 3 Let q = 0 - -2. Suppose -qs + 82 = 10. Suppose 4o - s = 2o. List the prime factors of o. 2, 3 Suppose -2b + 1 = -3. Let o(v) = 2v3 - 4v*2 + 2v + 1. Let t be o(b). Suppose -2w = 3p + t, -w - p = 2w - 10. List the prime factors of w. 5 List the prime factors of 2 - (-34 + -3 + 4). 5, 7 Suppose 19 = -a - 2z + 1, -4a - z - 86 = 0. Let i = -7 - a. What are the prime factors of i? 3, 5 Suppose 4i - 10 = 6. Suppose -16 = -u + i. What are the prime factors of u? 2, 5 Suppose t + 3t = 0. Suppose 3f - 33 = -tf. List the prime factors of f. 11 Suppose 0 = p + 6 - 26. List the prime factors of p. 2, 5 Let b = 2 + 1. Suppose 0 = 2d + 6, bz - d - 13 = 35. List the prime factors of z. 3, 5 Let g be ((-18)/(-15))/(4/10). Let j(w) = -w3 + 2w*2 + 5w - 2. What are the prime factors of j(g)? 2 Let u(v) = -v - 2. Let d be u(-4). Suppose h = -ds + 24, -3h + 2s = -h - 48. Suppose -4o + 8 + h = 0. List the prime factors of o. 2 Let s(h) = -h3 + h2 + 23. Let q be s(0). Let f = q + -14. List the prime factors of f. 3 Let h = 2 - -2. Suppose -59 = -3q + 9k - hk, 0 = 4q - 2k - 60. List the prime factors of (-1)/1 + q + 0. 2, 3 What are the prime factors of (-1 + -1)1(-190)/4? 5, 19 Let i(a) = -a2 - 25a - 27. List the prime factors of i(-16). 3, 13 Let s(o) = 11o. List the prime factors of s(3). 3, 11 Let z(y) = -4y - 1. Let c be z(-1). Suppose cs = -2s, 0 = -3h + s - 81. Let w = -15 - h. What are the prime factors of w? 2, 3 Let k(i) = i3 - 5i*2 - 4i - 6. List the prime factors of k(6). 2, 3 Let m = 35 + 27. What are the prime factors of m? 2, 31 Let i = 0 - 1. Let o be (-8)/(-2)(i - -2). Suppose -w = 5, -4m - 3w - o = -13. List the prime factors of m. 2, 3 Let h(i) = -12i - 6. What are the prime factors of h(-5)? 2, 3 Suppose 0 = 3g - 9. Suppose -2u = gl + l - 20, -19 = -l - 4u. Suppose d - li - 24 = 0, -3i - 20 - 16 = -2d. What are the prime factors of d? 2, 3 Suppose g - 44 = -5. List the prime factors of g. 3, 13 Let j = 316 - 190. Suppose -7w - 35 + j = 0. What are the prime factors of w? 13 Let h be -41/(8/(-42)). Suppose -h = -c - 0c. What are the prime factors of c? 3, 7 Let s(l) = l*2 + 3l + 4. Let c be s(-3). Suppose 4q - 12 = t + ct, 2t - 8 = 0. List the prime factors of q/44 - (-31)/11. 3 Suppose 352 = -3q + 11q. What are the prime factors of q? 2, 11 List the prime factors of (0 + 6)/(118/56 + -2). 2, 7 Let b(n) = n3 + 8n*2 + n + 1. List the prime factors of b(-7). 43 Suppose -d + 15 = 2s, 4s - 13 = 3. Let v = -1 + d. List the prime factors of v. 2, 3 What are the prime factors of 2/(-1) + (30 + 0)1? 2, 7 Suppose 5n = 2 - 7, n = -4h + 275. Let c = -41 + h. What are the prime factors of c? 2, 7 Suppose -22 = 5n - 272. List the prime factors of n. 2, 5 Suppose 2c = -3c - 10. Let a be c/1 - 0 - -10. Let n = -3 + a. What are the prime factors of n? 5 What are the prime factors of 360/(-12)(-8)/5? 2, 3 Let a be (-2 + (-3)/(-2))16. Let d = a - -3. What are the prime factors of (-1)/(1/d) - 1? 2 Suppose 4g + 2d - 6 = -0d, -4d + 12 = -3g. Let u(v) = -v + 16. List the prime factors of u(g). 2 Let u = 46 - 17. What are the prime factors of u? 29 Let p(k) be the third derivative of -k*5/60 + 7k*4/24 + 7k*3/6 - 7k*2. What are the prime factors of p(6)? 13 Let a = -13 - -8. What are the prime factors of 17 + (6 - 3) + a? 3, 5 Suppose 0 = -2b - 2. Let w be 2 + (b - 2/2). Suppose n - 1 - 5 = w. What are the prime factors of n? 2, 3 Let f(i) = -12i + 1. Let h be f(-4). Let j = h - 33. Suppose q + q = j. What are the prime factors of q? 2 Let b = -3 - 1. Let v be (1 + 0)(-6 - b). Let y = 4 + v. What are the prime factors of y? 2 Let g(v) be the second derivative of -v*3/6 - 5v*2/2 + 2v. Let l be g(-6). What are the prime factors of 10 + -1 - (l + 0)? 2 What are the prime factors of 62 + 0/(2 + -7)? 2, 31 Suppose -5a + b + 13 = 0, 0 = 2a + b - 7 - 1. Suppose af + 0f - 18 = 0. List the prime factors of f. 2, 3 Suppose 964 + 226 = 10u. List the prime factors of u. 7, 17 List the prime factors of ((-182)/39)/(1/(-3)). 2, 7 Let t(u) = -14u*3 + 1. Suppose -2 = -3l + a - 3, 5l + 2a + 9 = 0. What are the prime factors of t(l)? 3, 5 Suppose 0 = 2p + t + 3t - 36, 4p = -3t + 52. Let q be p/((0 - -2)/(-1)). Let j = 12 + q. What are the prime factors of j? 7 Let x(c) = 2c - 4. Let w be x(4). Let i = 6 + -7. List the prime factors of (i/(-1))/(2/w). 2 Let j = 1111 - 752. What are the prime factors of j? 359 Let d be (-2 - (-1)/(-1)) + 15. Suppose -d = -3m + h + 26, -2m - h = -32. What are the prime factors of m? 2, 7 Let b(g) = -g - 1. Let m be b(1). Let w = -2 - m. Let d = 2 + w. List the prime factors of d. 2 Suppose o - 5o + 20 = 0. Let v = -1 + o. What are the prime factors of v? 2 Let j(f) = 48f2 + f. Let y be j(1). Let t = y + -9. What are the prime factors of t? 2, 5 Let i(g) = 4	{ "pile_set_name": "DM Mathematics" }
7r2 Let v(i) = i3 + 2i*2 - i. Let z be v(-2). Let c(a) = -za + 3a + a. Let w(x) be the second derivative of -x4/12 - x. Give c(w(q)). -2q*2 Let u(l) = -228l*2 + 1. Let m(p) = 3p. Determine m(u(v)). -684v2 + 3 Let b(s) = 2s*2 - 9s. Let j(f) = f2. Let t(c) = -c2. Let r(l) = -4j(l) - 5t(l). Calculate r(b(a)). 4a4 - 36a*3 + 81a*2 Let n(l) = 23l - 17. Let u(a) = -8a + 6. Let g(b) = 6n(b) + 17u(b). Let k(t) = -25t. Let q(r) = -12r. Let z(y) = -6k(y) + 13q(y). What is z(g(s))? -12s Let s(m) = 5m2. Let u(h) = 38h*2 - 67h*2 + 34h*2. Calculate u(s(d)). 125d4 Let q(n) be the third derivative of -n6/720 - n*4/4 + 4n2. Let b(w) be the second derivative of q(w). Let o(g) = g2. Give b(o(c)). -c*2 Let z(d) = -4 + 4 + d. Let y(r) = -5r + 2. Let p(l) = 21l - 9. Let w be ((-9)/(-1))/(-5 + 4). Let c(b) = wy(b) - 2p(b). What is c(z(i))? 3i Let m(z) = 1091z. Let g(o) = 3o*2. What is m(g(t))? 3273t*2 Let h(q) = -587q*2 - 6. Let k(y) = 4y. Calculate h(k(j)). -9392j2 - 6 Let u(x) = -2x*2 - 32x. Let s(j) = -25j - 23j + 45j. Determine s(u(f)). 6f*2 + 96f Let q(n) = 3n2. Let b(d) = 3d*2 - 1. Calculate q(b(a)). 27a*4 - 18a*2 + 3 Let v(w) = 8452w*2. Let f(o) = 2o. Calculate v(f(s)). 33808s2 Let h(c) = -26c*2. Let q(x) = -129x*2. Determine q(h(j)). -87204j*4 Let u(i) = -12i2. Let b(y) = -y3 + 5y2 + 3. Let a be b(5). Let k(v) = 2v - av + 0v. What is u(k(c))? -12c2 Let j(m) = 4m. Let o(u) be the second derivative of u*3/3 + 11u. Give o(j(c)). 8c Suppose 3v = -3n - 0 + 12, 5v = -3n + 22. Let s(h) = 0 - 6h + vh + 0. Let b(p) = 4p. Determine b(s(m)). -4m Let j(l) = -l + 729. Let k(o) = 2o*2. What is k(j(m))? 2m*2 - 2916m + 1062882 Let k(r) = -8r. Let l(x) = 232x*2. Calculate l(k(h)). 14848h*2 Let z(r) = -6r. Let k(w) be the third derivative of -w6/180 - w3/2 + w*2. Let g(h) be the first derivative of k(h). Determine g(z(j)). -72j*2 Let r(f) = -5f*2. Let v(q) be the third derivative of -5q*4/24 - 26q*2. Determine v(r(m)). 25m2 Let x(n) = -n2 - 1. Let j(o) = 6o2 + 3. Let h(p) = j(p) + 3x(p). Let w(u) = -9u2. Calculate h(w(a)). 243a*4 Suppose k - 3 - 3 = -2h, 0 = 3h - 6. Let x(q) = -2q2 - qk + 4q2. Let j(z) = 4z*2. What is j(x(n))? 4n4 Let u(r) = r2 - 5r + 7. Let o be u(7). Let a(i) = oi - 21i + 5i*2. Let z(w) be the first derivative of 2w*3/3 + 1. Calculate z(a(c)). 50c*4 Let r(l) = -3l*2. Let j(h) = 5h*2 - 10h. Give r(j(d)). -75d4 + 300d*3 - 300d*2 Let z(i) be the first derivative of 2/3i*3 + 0i*2 + 0i + 4. Let s(y) = 2y. What is z(s(b))? 8b*2 Suppose 4a = c + 3c, -4c = 3a - 14. Suppose -18 = -4s - 2m, -21 = -5s - cm - 2m. Let o(t) = -t + 5 - s. Let l(b) = 2b2. Give o(l(z)). -2z2 Let p(n) be the third derivative of -n6/360 - n*3/6 + 2n2. Let u(v) be the first derivative of p(v). Let b(o) = o. Calculate b(u(d)). -d2 Let f(q) = 3195q. Let t(d) = 3d. What is f(t(y))? 9585y Let i(n) = n. Let v(g) be the first derivative of 0g - 3 + 3/2g2. What is v(i(c))? 3c Let o(v) = 2v. Let j(a) = -6003a*2. Give j(o(k)). -24012k*2 Let m(b) = 3b*2. Let z(s) = -92s + 1. Determine m(z(n)). 25392n2 - 552n + 3 Let z(u) = -48u + 2. Let p(c) = 25c. Calculate z(p(s)). -1200s + 2 Let l(k) = 2k*2. Let v(g) = 98g. What is v(l(s))? 196s2 Let v(h) = 2h*2. Let f(i) be the first derivative of 0i*2 + 2/3i*3 - 1 + 0i. Give f(v(t)). 8t4 Let s(u) be the third derivative of u2 + 0u*3 + 0u + 0u4 + 0 - 1/60u*5. Let h(m) = 0m - 2m2 - m2 + 0m. Calculate h(s(d)). -3d4 Let r(g) = -3g. Let h(z) = z. Let n(y) = y. Let j(b) = 3h(b) - 4n(b). What is r(j(u))? 3u Let n(y) = -31y*2 + 2y - 2. Let d(i) = i - 1. Let x(c) = 2d(c) - n(c). Let a(h) = -2h. What is x(a(j))? 124j2 Let n(j) = 3j. Let o(c) = 442c - 2. Give o(n(y)). 1326y - 2 Let n(p) = -2p. Suppose -4t = -2t. Let r(k) = 13 + 2k + tk - 13. Calculate n(r(f)). -4f Let x(m) = -m. Let v(o) = -o*2 + o. Let f(c) = -3v(c) - 3x(c). Let r(u) be the third derivative of 0 + 5u*2 - 1/12u*4 + 0u*3 + 0u. Calculate r(f(i)). -6i2 Let g(p) = -8p. Let v(l) = 0 + 0 + 5l2 - 7l*2. What is g(v(b))? 16b*2 Let f(b) = 4b - 3. Let y(u) = 17u - 13. Let i(m) = 26f(m) - 6y(m). Let p(o) = o. Let g(a) = -6a*2 - 18a. Let l(r) = g(r) + 18p(r). Calculate i(l(d)). -12d*2 Let j(x) = 2x2 + 2 - 2. Let k(t) be the second derivative of -t7/1260 + t*4/3 - t. Let z(l) be the third derivative of k(l). Give z(j(h)). -8h*4 Let u(s) = -8s*2 + 16. Let z(g) = 1. Let q(o) = u(o) - 16z(o). Let j(p) = -2p. Determine j(q(i)). 16i*2 Let f be (-1)/(-1)31. Let r(a) = -2a*2 + fa*2 - 2a*2. Let u(l) = -2l. Let c(h) = h. Let q(z) = 6c(z) + 2u(z). Determine q(r(i)). -2i2 Let q(b) = b2. Let l(f) = -64f*2 - 7f. Let p(w) = -32w2 - 3w. Let c(t) = 3l(t) - 7p(t). What is q(c(g))? 1024g4 Let y(w) = 76w. Let i(q) = 59q2. What is i(y(d))? 340784d*2 Let v(a) = -75a + 3. Let j(w) = 2w2. Calculate v(j(n)). -150n*2 + 3 Let u(o) = o. Let x(f) be the third derivative of 2/15f*5 + 0f + 0 + 0f4 + 5f*2 + 0f*3. What is x(u(a))? 8a*2 Let v(f) = -2f - 1. Let a(x) = -1 + 3 - 4 - x + 1. Let u(w) = -3a(w) + 3v(w). Let t(r) = 2r2. Give u(t(j)). -6j*2 Let d(l) = -7l + 2. Let y(z) = 6z. Determine d(y(g)). -42g + 2 Let p(x) = -2x. Let b(d) = -9d*2 - 20d + 15. Calculate b(p(v)). -36v2 + 40v + 15 Suppose 10w - 12 = 7w. Let t(u) = -4u2 + 4u - wu. Let i(j) = 3j. Calculate i(t(h)). -12h2 Let k(s) = -19s*2. Let p(u) = 1188u. Give p(k(q)). -22572q2 Let d(l) = -7l. Let g(p) = 6p + 5. Let i(f) = -2f - 2. Let k(u) = -4g(u) - 10i(u). Determine d(k(h)). 28h Let s(m) be the second derivative of -5m*4/12 + m. Suppose 5v - 25 = 5k - 10, -3k - 17 = -5v. Let a(i) = -v + 0 + 4 + i. Calculate s(a(o)). -5o*2 Let w(z) be the first derivative of 2 + 1/2z*2 + 0z. Let j(d) = d2. Give w(j(r)). r2 Let f(n) = 3n2. Let j(l) = -l2 - 38l. Give f(j(z)). 3z4 + 228z*3 + 4332z*2 Let q(x) = -733x*2. Let h(i) = -4i. Determine h(q(r)). 2932r2 Let j(s) = s. Let c(i) = -2 + 2 + 14i - 16i. Determine c(j(p)). -2p Let n(y) = -130y + 1. Let v(l) = l. What is n(v(u))? -130u + 1 Let w(s) = -3s. Let f(t) be the second derivative of -5t*3/6 + 6t. Let q(g) = 5f(g) - 8w(g). Let h(n) = -7n. What is q(h(z))? 7z Let p(o) = -2o2 + 1. Let n(j) be the second derivative of j3/6 + 30j. Give p(n(q)). -2q2 + 1 Let o(c) be the third derivative of -c5/60 - c2. Let a = -8 + 19. Let r(x) = ax - 11x + x2. Give r(o(l)). l4 Let m(t) = 299t*2 - t. Let i(n) = 2n. What is m(i(j))? 1196j2 - 2j Let b = -3 + 2. Let j be (b/5)/(2/(-10)). Let t(n) = -5n - 2 + 3 - j. Let p(m) = -2m. Determine p(t(h)). 10h Let c(w) = 2w*2. Let i(n) = 2n - 4n + 7n*2 + 2n - 5n. Let p(d) = -6d*2 + 4d. Let h(j) = -4i(j) - 5p(j). Calculate h(c(y)). 8y4 Let p(w) = 5w*2. Let u(y) = -143y. Calculate p(u(f)). 102245f2 Let y(l) = -16l. Let t(g) = 16g. What is t(y(q))? -256q Let q(i) be the second derivative of 0i3 + 0i*2 + 2i + 1/6i4 + 0. Let m(t) = t2. Give q(m(r)). 2r*4 Let m(h) = -2h*2. Let v(l) = 135l - 17. Let z(p) = -17p + 2. Let k(y) = 6v(y) + 51z(y). Determine m(k(a)). -6498a*2 Let q(c) = -6c2. Let h(b) be the first derivative of b6/180 - 2b3/3 + 3. Let w(m) be the third derivative of h(m). What is q(w(d))? -24d4 Let a(j) be the first derivative of j3/2 + 2j + 1. Let u(n) be the first derivative of a(n). Let b(f) = 2f*2. Determine u(b(l)). 6l*2 Let i(u) = -2u*2. Let y(m) = m + 1. Let g(c) = -8c + 3. Let w(o) = -2g(o) + 6y(o). What is w(i(k))? -44k2 Let f(g) be the first derivative of -7g*3/3 - 2g + 3. Let q(u) = 8u2 + 3. Let z(l) = -3f(l) - 2q(l). Let t(y) = 2y. Give z(t(a)). 20a2 Let a(r) be the first derivative of r6/120 - 4r*3/3 - 4. Let b(y) be the third derivative of a(y). Let p(i) = i. Give p(b(z)). 3z*2 Let o(s) = 52s*2 + s. Let t(b) = 3b. Determine t(o(x)). 156x2 + 3x Let o(s) be the first derivative of -s*4/3 + 2s	{ "pile_set_name": "DM Mathematics" }
ger? 9787 What is the third root of 22170089 to the nearest integer? 281 What is 59872318 to the power of 1/3, to the nearest integer? 391 What is 946116126 to the power of 1/9, to the nearest integer? 10 What is 2268029 to the power of 1/3, to the nearest integer? 131 What is 2252201813 to the power of 1/8, to the nearest integer? 15 What is the fourth root of 629215696 to the nearest integer? 158 What is the cube root of 1255619831 to the nearest integer? 1079 What is the square root of 44710825 to the nearest integer? 6687 What is the ninth root of 855326032 to the nearest integer? 10 What is the cube root of 27100068 to the nearest integer? 300 What is the square root of 780918399 to the nearest integer? 27945 What is 26800820 to the power of 1/2, to the nearest integer? 5177 What is the third root of 970464161 to the nearest integer? 990 What is 15481619 to the power of 1/10, to the nearest integer? 5 What is the cube root of 309653069 to the nearest integer? 677 What is 201550421 to the power of 1/2, to the nearest integer? 14197 What is the tenth root of 11843228 to the nearest integer? 5 What is the square root of 223405693 to the nearest integer? 14947 What is 212652788 to the power of 1/3, to the nearest integer? 597 What is 594049259 to the power of 1/3, to the nearest integer? 841 What is the square root of 109703413 to the nearest integer? 10474 What is 354085748 to the power of 1/10, to the nearest integer? 7 What is 113159027 to the power of 1/8, to the nearest integer? 10 What is the square root of 80758732 to the nearest integer? 8987 What is 116910522 to the power of 1/4, to the nearest integer? 104 What is the ninth root of 182245589 to the nearest integer? 8 What is the square root of 428075254 to the nearest integer? 20690 What is the square root of 2587480 to the nearest integer? 1609 What is 113969805 to the power of 1/3, to the nearest integer? 485 What is 23393575 to the power of 1/2, to the nearest integer? 4837 What is the third root of 46824738 to the nearest integer? 360 What is 3580144768 to the power of 1/3, to the nearest integer? 1530 What is the cube root of 1745920 to the nearest integer? 120 What is the cube root of 5545784215 to the nearest integer? 1770 What is the cube root of 1533999173 to the nearest integer? 1153 What is 390057508 to the power of 1/7, to the nearest integer? 17 What is the seventh root of 48018020 to the nearest integer? 13 What is the third root of 217043669 to the nearest integer? 601 What is 1732598986 to the power of 1/3, to the nearest integer? 1201 What is the cube root of 196773936 to the nearest integer? 582 What is the square root of 300063248 to the nearest integer? 17322 What is the eighth root of 145969675 to the nearest integer? 10 What is the tenth root of 34276254 to the nearest integer? 6 What is the cube root of 8699580 to the nearest integer? 206 What is the third root of 21999116 to the nearest integer? 280 What is 141481844 to the power of 1/5, to the nearest integer? 43 What is the eighth root of 185293611 to the nearest integer? 11 What is the square root of 2790895429 to the nearest integer? 52829 What is 61932646 to the power of 1/10, to the nearest integer? 6 What is 28211692 to the power of 1/3, to the nearest integer? 304 What is the third root of 331667406 to the nearest integer? 692 What is the square root of 336901998 to the nearest integer? 18355 What is 6544869649 to the power of 1/3, to the nearest integer? 1871 What is the third root of 26588872 to the nearest integer? 298 What is the ninth root of 3302644289 to the nearest integer? 11 What is the square root of 37764918 to the nearest integer? 6145 What is the square root of 443166200 to the nearest integer? 21052 What is the cube root of 186716838 to the nearest integer? 572 What is the third root of 94382044 to the nearest integer? 455 What is 98666062 to the power of 1/7, to the nearest integer? 14 What is the third root of 447179795 to the nearest integer? 765 What is 1567144690 to the power of 1/2, to the nearest integer? 39587 What is the square root of 178058591 to the nearest integer? 13344 What is the third root of 2203976205 to the nearest integer? 1301 What is the square root of 6178569753 to the nearest integer? 78604 What is the seventh root of 20710446 to the nearest integer? 11 What is the fifth root of 28406841 to the nearest integer? 31 What is 1951978436 to the power of 1/2, to the nearest integer? 44181 What is 60529685 to the power of 1/3, to the nearest integer? 393 What is the fourth root of 1344976867 to the nearest integer? 192 What is 1249329157 to the power of 1/2, to the nearest integer? 35346 What is the square root of 200533688 to the nearest integer? 14161 What is 3655307341 to the power of 1/8, to the nearest integer? 16 What is 229991474 to the power of 1/10, to the nearest integer? 7 What is 19953661 to the power of 1/2, to the nearest integer? 4467 What is the square root of 1191757538 to the nearest integer? 34522 What is 46342769 to the power of 1/5, to the nearest integer? 34 What is the fifth root of 198199054 to the nearest integer? 46 What is the sixth root of 40845773 to the nearest integer? 19 What is 567165863 to the power of 1/2, to the nearest integer? 23815 What is 1256326897 to the power of 1/2, to the nearest integer? 35445 What is 313819283 to the power of 1/3, to the nearest integer? 680 What is the cube root of 315541905 to the nearest integer? 681 What is the sixth root of 42092842 to the nearest integer? 19 What is the seventh root of 769665359 to the nearest integer? 19 What is the square root of 27912002 to the nearest integer? 5283 What is the cube root of 823998863 to the nearest integer? 938 What is 154277841 to the power of 1/4, to the nearest integer? 111 What is the cube root of 41012687 to the nearest integer? 345 What is the sixth root of 157778423 to the nearest integer? 23 What is the cube root of 51167196 to the nearest integer? 371 What is the third root of 31717502 to the nearest integer? 317 What is the square root of 126987858 to the nearest integer? 11269 What is the fourth root of 27155017 to the nearest integer? 72 What is 172021332 to the power of 1/6, to the nearest integer? 24 What is the eighth root of 129170275 to the nearest integer? 10 What is the eighth root of 728235135 to the nearest integer? 13 What is 714521411 to the power of 1/2, to the nearest integer? 26731 What is 957241497 to the power of 1/5, to the nearest integer? 63 What is 502760741 to the power of 1/2, to the nearest integer? 22422 What is the square root of 327132008 to the nearest integer? 18087 What is 116055364 to the power of 1/3, to the nearest integer? 488 What is 259414365 to the power of 1/3, to the nearest integer? 638 What is the tenth root of 75073747 to the nearest integer? 6 What is 1904936926 to the power of 1/2, to the nearest integer? 43646 What is the cube root of 425904330 to the nearest integer? 752 What is the third root of 7766713 to the nearest integer? 198 What is the cube root of 43070181 to the nearest integer? 351 What is 200682549 to the power of 1/2, to the nearest integer? 14166 What is the fourth root of 38528762 to the nearest integer? 79 What is the square root of 244318109 to the nearest integer? 15631 What is 52600582 to the power of 1/5, to the nearest integer? 35 What is 4057875 to the power of 1/4, to the nearest integer? 45 What is 972892475 to the power of 1/2, to the nearest integer? 31191 What is 295487158 to the power of 1/3, to the nearest integer? 666 What is the cube root of 2627167113 to the nearest integer? 1380 What is the square root of 27260953 to the nearest integer? 5221 What is the square root of 282465162 to the nearest integer? 16807 What is 511413985 to the power of 1/2, to the nearest integer? 22614 What is 1092948554 to the power of 1/8, to the nearest integer? 13 What is 3160809609 to the power of 1/7, to the nearest integer? 23 What is 119555184 to the power of 1/5, to the nearest integer? 41 What is 4129372133 to the power of 1/2, to the nearest integer? 64260 What is the square root of 85749549 to the nearest integer? 9260 What is 26316428 to the power of 1/2, to the nearest integer? 5130	{ "pile_set_name": "DM Mathematics" }
. -9230.8326049 -3129 + -49827678 -49830807 Sum -6663174484429 and 0. -6663174484429 What is 12750463.56 plus 49? 12750512.56 Calculate 200.591041357 + -0.02. 200.571041357 What is -109.5 less than 0.32992892137? 109.82992892137 Calculate 30.95 + -920657991. -920657960.05 What is 86571758 + 2.10887? 86571760.10887 Subtract -0.2772 from 8206774.136. 8206774.4132 What is -0.22127 less than 264093? 264093.22127 Sum 0.1438 and 138615949.972. 138615950.1158 What is 0.1 less than -1584.1086793007? -1584.2086793007 Calculate 1.33 + -0.2635836526. 1.0664163474 Calculate 4960485 - 0.075007. 4960484.924993 Sum 5147226.563 and -0.0392. 5147226.5238 What is 11533.725246 + -92? 11441.725246 Total of -142125426 and -0.057036. -142125426.057036 What is 0.05904266 less than -753270? -753270.05904266 Subtract 12862504 from 2892.4. -12859611.6 Subtract 720819830 from -0.21633. -720819830.21633 -552.0056 + -154142 -154694.0056 What is the difference between -128403296 and 102.6? 128403398.6 What is the distance between 2 and 5659112.02777? 5659110.02777 What is the difference between 5456401500292 and 0.02? 5456401500291.98 Work out -0.0920329 - 11.2002. -11.2922329 What is the distance between -18103.651 and -3485.77? 14617.881 Sum -79 and -1.75056959846. -80.75056959846 Total of 12241114758 and 4. 12241114762 Sum 0 and -32376188157724. -32376188157724 Total of -113655524047.509 and 0.5. -113655524047.009 Total of -438641771643 and 0.2. -438641771642.8 What is the difference between 5391.3 and 370747? 365355.7 Calculate -34251478.8429 + -5. -34251483.8429 Calculate -10.646106 + 2505. 2494.353894 Add 0.20059434368 and 23. 23.20059434368 Work out 0.904383 + 2712325. 2712325.904383 What is 3995.140268 plus -0.0542? 3995.086068 0.1 - 137777753845.3 -137777753845.2 0.97539721514968 - 0.2 0.77539721514968 Add -23301 and 532.7152727. -22768.2847273 Add together -236049461 and 23.86. -236049437.14 309.3059647567 - -2 311.3059647567 Put together -739111 and -45313. -784424 What is 2.1 take away -20113201297? 20113201299.1 Subtract -16.20191 from 5.4842. 21.68611 Sum 313 and -637483260. -637482947 -0.1+-17.33994875051 -17.43994875051 What is 0.0124584914 less than -1.2? -1.2124584914 Work out -20619688976519 - 0.17. -20619688976519.17 What is 0.0237 - 19208702904? -19208702903.9763 What is -1.87 + -0.1544212405483? -2.0244212405483 Sum -783627173 and 632580. -782994593 What is 1247810.4 take away 514153? 733657.4 What is -429962 minus 299170? -729132 What is -170682973113 + -1? -170682973114 What is 381.22 + -153980.2896? -153599.0696 Add 3.537135778 and -0.96229. 2.574845778 -19236114125.568 + -3 -19236114128.568 Work out 198 - -15119537900. 15119538098 Work out 46155 + 62.3921. 46217.3921 What is 0.3 take away -63681970094? 63681970094.3 0 - 155775363739 -155775363739 Total of 2386 and -425069844. -425067458 Add 589.16143685 and -2.6759. 586.48553685 What is -0.2 less than -19024642858475? -19024642858474.8 0.027618895382 - 2.1 -2.072381104618 What is the distance between -2949117302 and -0.1? 2949117301.9 Add together -0.01004 and 351070.15. 351070.13996 What is 930027154625 - 117? 930027154508 Work out 520.5 + 42558432504. 42558433024.5 What is -201451317 less than 2.8? 201451319.8 What is 246.5 + -132877776? -132877529.5 What is the difference between -1138268563 and 702? 1138269265 Calculate -991.6847 - -198491.2. 197499.5153 Add together 6.9 and -143295.32516. -143288.42516 What is -2800298 take away -79.383389? -2800218.616611 Calculate 0.861 - 8910.209294. -8909.348294 Total of -2.52059 and 9.25658. 6.73599 Calculate -43 + 706709223.436. 706709180.436 Calculate -21 - -5414497116497. 5414497116476 What is the distance between 0.2 and 107332607652288? 107332607652287.8 What is the distance between -185884908501 and -1? 185884908500 What is 0.051059 + -119460.358? -119460.306941 Calculate 2936.150527 + -12343. -9406.849473 What is -0.5 take away 59109411158144? -59109411158144.5 What is 2065 - -1569419258? 1569421323 -23508462004 + -0.032 -23508462004.032 What is 278553 + -158.873784? 278394.126216 Calculate -186831.094578 + 13. -186818.094578 Total of -31 and -17654140136. -17654140167 Calculate 0.4 + -392.4653382854. -392.0653382854 What is -31.25594 plus 148277? 148245.74406 What is 2 - 1248.658057937? -1246.658057937 Calculate -1826.4 + 19.474716. -1806.925284 What is -19656225 take away -6.5507? -19656218.4493 Add together -1846324616.6 and 11204. -1846313412.6 What is 0.5 minus 20179.47973472? -20178.97973472 What is -1421333180273 take away 0.1? -1421333180273.1 Sum 54989990257103 and -2. 54989990257101 What is 11742.1 + 912600? 924342.1 Calculate -10 + 1555398136668. 1555398136658 Subtract 386.271163367 from 329. -57.271163367 What is the distance between -18 and 507.163179865? 525.163179865 What is -2773073495 + 12.8? -2773073482.2 19+4982194224 4982194243 13+-46491362.510895 -46491349.510895 Calculate 0.1 - -357.92041416. 358.02041416 Calculate 0.02 + 3502707271057. 3502707271057.02 Calculate 36480709 - 292821. 36187888 What is -1276 minus 397223.7489? -398499.7489 What is the distance between -0.0255733533 and 355? 355.0255733533 What is 0.2 - -67664801657? 67664801657.2 Work out -264511503464 - 10.1. -264511503474.1 What is 6362009150602 plus 0.022? 6362009150602.022 -4828271002622 + 0.3 -4828271002621.7 Put together -0.2383 and -14957208876. -14957208876.2383 Add together -2.1816 and 185108991. 185108988.8184 Put together 2147711 and -17978832. -15831121 -0.1037 + 1359362.4401 1359362.3364 What is -0.3 less than 248378.001883? 248378.301883 What is the difference between 17 and -10580255938012? 10580255938029 What is -59 less than 1095.60645715? 1154.60645715 Add together -11754 and 785354.759. 773600.759 -556.5874467+-0.118 -556.7054467 What is -5.54250325 plus 417? 411.45749675 What is 1 less than 34848598995? 34848598994 What is the distance between 1 and -39058220193? 39058220194 Add together 58118914773 and -1284. 58118913489 What is -15072087881.45 minus -0.2? -15072087881.25 What is -19.64379678 plus -65? -84.64379678 0.5+4315388.27089 4315388.77089 Work out 595598433176 - -4. 595598433180 Work out 378 - 44721823.4. -44721445.4 What is -113244936 plus 1.895189? -113244934.104811 What is 3.3 + -205059144783? -205059144779.7 Calculate 1 - 7648811324473. -7648811324472 -52874.25832+1 -52873.25832 What is -0.00876720649 minus -131.005? 130.99623279351 Add together -0.867 and -772422941831. -772422941831.867 Subtract -31893534795 from -869. 31893533926 1.074438514295+5 6.074438514295 What is 1257256 - -171328? 1428584 Work out 1.2 + -602815396.65. -602815395.45 Work out 1.7408 - -2461877751. 2461877752.7408 Subtract 2136.187771 from -1446. -3582.187771 10047.192 + -1.81542 10045.37658 Work out -19548 - -2009369203. 2009349655 What is 38659440339884 - -3? 38659440339887 Sum -1434488 and 1.872358. -1434486.127642 Add together 10041.5927742163 and 4. 10045.5927742163 What is the difference between 10780.76524 and -3798? 14578.76524 What is the distance between 29159882 and 0.0830906? 29159881.9169094 Add 6342 and -358489618. -358483276 Add -276947.9 and 856.97. -276090.93 What is 36135104.47 plus 26.4? 36135130.87 Subtract -0.033339727487 from -0.4. -0.366660272513 Subtract 1 from 0.33213909658. -0.66786090342 Total of 0.032 and 29.1566219051. 29.1886219051 What is the difference between 86.4 and 2629732951? 2629732864.6 Calculate -350.283 + 0.00930639. -350.27369361 0 - -729.424833 729.424833 What is -5 - -66768449038? 66768449033 What is -4 take away 88.258035965? -92.258035965 Calculate -8853385 - -54536058. 45682673 Sum -0.031 and 6920881211. 6920881210.969 Subtract 14215047 from 4371068. -9843979 Subtract -6198804210 from -2.775. 6198804207.225 Work out 767034750 + -0.05517. 767034749.94483 Put together 592.6 and -4694417.8. -4693825.2 Calculate -38.7976334471 - -4. -34.7976334471 What is 0.76393771131 - -823? 823.76393771131 What is the difference between -16408394 and -1.11015? 16408392.88985 Calculate -48.325678221 + 357. 308.674321779 What is 5.75 minus 3.74665645? 2.00334355 -15.08581498 + 1931 1915.91418502 What is -74.5 less than -4346.32802? -4271.82802 Work out 11 + -15818.43282. -15807.43282 Add -121202 and 697593. 576391 What is -0.	{ "pile_set_name": "DM Mathematics" }
f - 35f = 9. What is the greatest common factor of x and 44? 4 Suppose -1760 = -4n + 1052. What is the greatest common divisor of 19 and n? 19 Let h(n) = 2n*2 - 4n + 1. Let d be h(2). Suppose -2k = -4w + d + 51, -2k = -8. Calculate the greatest common divisor of 15 and w. 15 Suppose 16m - 20m = 3j - 289, 2j = -5m + 202. What is the greatest common factor of j and 21? 7 Suppose -u - 24 = -2c, 58 = 5c + 10u - 13u. Let k be 684/7 + 4/14. Calculate the greatest common divisor of c and k. 14 Let r = -388 - -616. Calculate the highest common divisor of r and 57. 57 Let z = 23 - 14. Let v = -1191 + 1200. What is the highest common divisor of z and v? 9 Let t(k) = -34k - 1. Let w be t(-4). Suppose -w = -v + 140. Suppose 2c - 133 = -5p, 4c = 2p - 3p + 41. Calculate the highest common factor of p and v. 25 Let r = -61 + 69. What is the greatest common factor of r and 60? 4 Let z(f) = -f*2 - 22f - 12. Let i be z(-19). Let m(c) = c*2 + 8c - 2. Let r be m(-10). Calculate the highest common divisor of r and i. 9 Let v = 178 + -151. What is the greatest common factor of 351 and v? 27 Suppose -5t + 357 = 3v - 513, -4t - 4v = -704. What is the greatest common divisor of t and 38? 19 Let q be (-2)/6 + (-6)/(54/(-1047)). What is the highest common divisor of 29 and q? 29 Suppose -y - 2 - 1 = -5n, 2n - 3 = y. Let r be (-7 - y)(1 + -3). Suppose -46 - 34 = -5k. What is the greatest common divisor of k and r? 8 Let s = -83 + 68. Let a = 9 + 13. Let d = s + a. Calculate the greatest common divisor of d and 7. 7 Suppose -125 + 419 = 14k. What is the highest common factor of k and 147? 21 Let q(k) = k3 - 10k*2 + 10k - 10. Let o be q(9). Let l be ((-180)/(-2))/(1 - (o + 1)). What is the highest common divisor of 18 and l? 18 Let u = -54 - -77. What is the highest common factor of u and 1334? 23 Let d be (-1 - -1)(-5)/5. Suppose -3b + 2 + 79 = d. Suppose b = 2l - 27. What is the highest common divisor of 3 and l? 3 Suppose -666 = -5h - 2u, 4h - 3u - 383 - 136 = 0. Let r = h - 52. Suppose 0 = 2i - 14 - 6. Calculate the greatest common factor of i and r. 10 Let s(p) = p - 18. Let i be s(19). Let a be -2 + (i - 2)/((-3)/12). Calculate the greatest common factor of a and 5. 1 Suppose 3j = -4u + 784, 2j = -2u - 3u + 532. What is the highest common divisor of j and 16? 16 Let f = 511 - 470. Suppose 5n - 732 = 908. What is the highest common factor of f and n? 41 Suppose d = -0d + 15. Suppose -209j + 210j - 15 = 0. Calculate the highest common factor of j and d. 15 Suppose -2x - 2244 = -3d, 2x - 810 = -3d + 1446. Calculate the greatest common divisor of d and 30. 30 Let h be (6 + (-560)/60)/((-4)/1530). Calculate the greatest common divisor of h and 85. 85 Let b(c) = 3c*2 - 2c + 8. Let y be b(-4). Suppose 52 = 6j + 4. Calculate the greatest common factor of j and y. 8 Suppose 2u - 2 = 0, -3u + 213 = o + 4o. Let r(k) = -35k2 + 2k + 6. Let d be r(0). Calculate the greatest common divisor of d and o. 6 Suppose -4i + 12v + 27 = 11v, 0 = 4i + v - 21. What is the highest common factor of 69 and i? 3 Suppose 0 = n - c - 57, -n - 3n + 222 = -2c. What is the highest common divisor of 270 and n? 54 Let n be (-195 - -25)(-3)/6. Calculate the greatest common factor of n and 935. 85 Let b(g) = 6g*2 + 8g + 39. Suppose 0 = 7k - 13k - 36. Let f be b(k). Calculate the highest common factor of 23 and f. 23 Suppose -h - 14 - 1 = 0. Let i be h/(-1 - (-3 + 3)). What is the greatest common divisor of i and 120? 15 Suppose 0 = 4x - 99 + 27. Let f(g) = -2g*3 + 13g*2 + 43g - 245. Let l be f(5). Calculate the highest common factor of l and x. 9 Suppose -3t = -4t + 4z + 44, -63 = -2t + 3z. Calculate the highest common divisor of 84 and t. 12 Let b(q) = -q3 + 16q*2 + 19q + 4. Let d be b(17). Let s = d - 33. Suppose 43 = si - 57. Calculate the greatest common factor of i and 60. 20 Let x = 148 + -127. Suppose -3j = -6j + 126. What is the highest common divisor of x and j? 21 Let f be (4/6)/(20/(-6870)). Let p = f + 102. Let k be 5/20 - p/4. What is the highest common factor of k and 8? 8 Let d = 14 + -10. Suppose 0 = -dw + 3w + 13. What is the highest common divisor of w and 26? 13 Let v be (2 - 2-3)/((-10)/(-25)). Let i = v + -10. What is the highest common divisor of i and 50? 10 Let o = -394 + 570. Calculate the greatest common factor of o and 22. 22 Suppose -173 = -4b + 7. Suppose 2p - 6p = 0. Suppose 4u + u - 75 = p. What is the highest common divisor of u and b? 15 Let x(m) = m*3 - 14m*2 - 16m + 18. Let f be x(15). Suppose 38 = fh - 28. Calculate the greatest common factor of 2 and h. 2 Suppose 709 = 3u - 323. Suppose 774 + 172 = 22j. What is the highest common divisor of u and j? 43 Suppose 0 = -2i + d + 317, -3i + 2i + d + 161 = 0. Calculate the greatest common factor of 9 and i. 3 Let p be 2(1 + (-4)/2) - -5. Suppose -2v = 5l - 116, 2v = -pl + 5v + 57. Calculate the highest common divisor of l and 154. 22 Let d(n) = n*2 - 14. Let z be d(-4). Let u be (-2)/4z - (-2 + -8). What is the highest common factor of 45 and u? 9 Let i(g) = -4g + 144. Let d be i(34). What is the highest common factor of d and 1? 1 Suppose 9z + 2u = 4z + 63, -2z + u = -18. Suppose 13 + 53 = 2t. What is the highest common divisor of z and t? 11 Suppose -d - 2m + 1038 = 0, 110m - 112m = -2d + 2046. Calculate the greatest common divisor of d and 8. 4 Let g(h) = h*2 - 8h - 5. Let i be g(9). Calculate the greatest common factor of 152 and i. 4 Suppose n + 2c = -80, 2n = -2n + 2c - 350. Let q = n + 128. Suppose -k = 3k - 84. Calculate the highest common factor of q and k. 21 Let y(r) = -4r. Let x be y(7). Suppose 6k + 76 + 98 = 0. Let f = x - k. What is the highest common factor of 4 and f? 1 Let j(f) = f3 - 11f*2 + 4f + 4. Let a be j(12). Calculate the highest common divisor of a and 147. 49 Let n(o) = -o*3 + 4o*2 - 2o + 6. Let d be n(5). Let b = d + 45. Let z be b/12 + (-1792)/(-6). What is the greatest common divisor of 30 and z? 30 Let x be -3925/(-5) - 0. Let w(y) = -3y + 49. Let c be w(0). What is the greatest common divisor of c and x? 49 Let i(h) = -h*2 + 2h + 2. Let u be i(5). Let k = -10 - u. Calculate the highest common divisor of k and 2. 1 Suppose 3v + v - 200 = 0. Let j(q) = -q2 - 5q + 2. Let c be j(-4). Let z(d) = 2d - 2. Let p be z(c). Calculate the highest common factor of p and v. 10 Let l(p) = -4p - 30. Let w be l(-14). Calculate the highest common divisor of w and 208. 26 Let j = -38 + 45. Calculate the greatest common divisor of 133 and j. 7 Let y be (8/20)/1 + 133/5. What is the highest common divisor of y and 432? 27 Let j(g) = -17g + 2g*3 - 22g*2 + 17g2 - g3 + 25. Let i be j(7). What is the highest common divisor of i and 52? 4 Suppose 0 = 9x - 4182 + 1608. What is the greatest common factor of 22 and x? 22 Suppose 342c - 352c + 2700 = 0. What is the highest common divisor of 720 and c? 90 Suppose 5r - 3l - 609 = 0, -5r + 372 = -2r - 4l. Let n be 36/1428/6. What is the greatest common factor of n and r? 12 Suppose 0 = -y + 3z + 14, -2y + 3z + 56 = 2y. Suppose -27q = 7q - 1904. Calculate the greatest common divisor of q and y. 14 Suppose -4 = -4o, 60o - 37 = -4c + 55o. What is the highest common divisor of 10 and c? 2 Suppose 15i + 12i = 108. Suppose 40 + 48 = 4o. Suppose 2n + 0n = -4g + o, 5n - 61 = -ig. Calculate the greatest common factor of n and 143. 13 Let h(w) = -7w - 7. Let o be h(-6). Suppose -24i - 3k = -19i - 184, 117 = 3i + 4k. Calculate the greatest common divisor of o and i. 35 Suppose 5t = -4t + 90. Let w(r) = r2 + 6r + 10. Let c be w(-10). Calculate the greatest common factor of t and c. 10 Let n = -34 + 50. Suppose -2v - 13 = -l, -3l + 5v = 2l - 40. Suppose 4b = -5i + 14, -lb - 7 = -i - 4i. What is the highest common divisor of i and n? 2 Suppose 4n - 1022 = -590. Calculate the highest common factor of 189 and n. 27 Let b = -302 - -332. What is the greatest common factor of b and 24? 6 Let a = 1056 - 1032. Calculate the highest common factor of 8 and a. 8 Suppose 16y = 55*y - 624. What is the greatest common factor of y and 80? 16 Let t be (19 - -66)/((-2)/(-4)). Wh	{ "pile_set_name": "DM Mathematics" }
2d2. Let q(l) = l + 1. Let b(c) = 2h(c) + 10q(c). Let j(n) = 6n. What is j(b(k))? 12k2 Let d(m) = -m2. Let q(r) = -r2 + 1. Let g(x) = -6x*2 + 15. Suppose -p - 3p - 72 = -4n, 3n + 4p - 33 = 0. Let z(f) = nq(f) - g(f). Determine z(d(j)). -9j4 Let t(o) = 9o*2 - 5o*2 + 15o2. Let v(n) = n2. Give t(v(y)). 19y4 Let g(x) = -4x. Let v(y) = 56y2. Calculate v(g(q)). 896q*2 Let x(q) = -3q. Let d(j) = -2j2 + 2j*2 - 5j*2 + 0j*2. Calculate x(d(u)). 15u*2 Let d(o) = -3o. Let w(b) = 103b2 + b. What is w(d(c))? 927c*2 - 3c Let y(i) = 2i2. Let r(q) = -q2 + 2 - 2 - 6q*2. Give y(r(f)). 98f*4 Let c(r) = 2r*2 + 3r. Let v(f) = 2f2. Determine v(c(o)). 8o*4 + 24o*3 + 18o*2 Let c(z) = 12z. Let k(m) = -2m. Give k(c(h)). -24h Let c(f) = -2f2 + 492. Let b(s) = -2s*2. Calculate b(c(x)). -8x*4 + 3936x*2 - 484128 Let z be 3/(12/16) - 4. Let n(i) be the second derivative of 0i*2 + z + 1/3i*3 - 2i. Let c(t) = 4t. What is c(n(p))? 8p Let c(f) be the second derivative of -2f3/3 - 2f. Let y(o) = o. Give c(y(u)). -4u Let k(p) = 3p*2. Let j(n) = -13n*2 + 7n. Let g(r) = -4r2 + 2r. Let z(w) = -7g(w) + 2j(w). Give z(k(s)). 18s4 Let t(u) = 2u - 3u + 4u. Let i(q) be the second derivative of -q*3/3 + 3q. Calculate i(t(o)). -6o Let x(u) = -28u*2. Let d(w) = -2w*2. Calculate x(d(s)). -112s*4 Let h(z) be the first derivative of 1 + 0z - 1/3z3 + 0z2. Let g(m) = m. Calculate h(g(d)). -d2 Let m(a) be the second derivative of 0a3 - 1/6a*4 + 0a*2 + 0 + a. Let l(h) = 2h2 - h2 + 0h2. What is m(l(w))? -2w*4 Let g(u) = 1558u. Let r(y) = y. Calculate r(g(d)). 1558d Let k(o) be the third derivative of o7/630 - o5/60 - o2. Let a(c) be the third derivative of k(c). Let w(l) = -2l. Give w(a(v)). -16v Let q(z) = -2z*2. Let k be (-2 + -1)/(-3)3. Let r = k + 2. Let i(c) = -2c2 + 5 - r. Calculate q(i(u)). -8u*4 Let d(l) = 3l*2 - 3l*2 - 3l2 + l2. Let j(y) = y + 0y + 2y. What is d(j(w))? -18w2 Let b(v) = -14v*2. Let o(i) = -9i. What is o(b(p))? 126p2 Let f(x) = -9x2 - x. Let i(k) = k2. Give i(f(b)). 81b4 + 18b3 + b2 Let t(l) be the first derivative of -1/2l2 - 3 + 0l. Let i(n) = -5n. Give i(t(k)). 5k Let f(q) be the third derivative of -q*4/6 + 3q*2. Let h(z) = 2z. Determine h(f(s)). -8s Let y(z) = -4z*2. Let c(h) = -54h. Calculate c(y(v)). 216v2 Let c(v) = -5v*2. Let g(p) = -10p. Let i = 10 + -8. Let t(q) = -q. Let y(d) = ig(d) - 22t(d). Determine y(c(u)). -10u2 Let i(y) be the second derivative of 0y*2 + 0 + 4y + 0y3 + 2/3y4. Let b(f) = f2. What is i(b(w))? 8w4 Let r(c) = c2. Let v be (-4)/6 + (-10)/(-15). Let h(l) be the first derivative of 2/3l*3 + 1 + 0l*2 + vl. Determine h(r(u)). 2u4 Let m(p) = 0p*2 - 3p2 + p2. Let c = 0 - -1. Let y(i) = -c + 0 + 1 + 3i2. Calculate y(m(l)). 12l*4 Let l(p) = 6p*2. Let y(w) = 63w*2. Determine l(y(s)). 23814s*4 Let n(m) = 2m*2 - 132m - 6. Let r(b) = -3b. Calculate r(n(s)). -6s*2 + 396s + 18 Let q(n) = -3n2 + 3n*2 - 4n2. Let t(y) be the second derivative of -y3/3 + 4y. Give q(t(i)). -16i*2 Let f(h) = 3h. Let a(s) = 175s2. Give f(a(z)). 525z*2 Let m(o) = 25o*2 + 11. Let u(g) = -5g*2 - 2. Let j(i) = -2m(i) - 11u(i). Let r(h) = -22 + 22 + h2. Determine r(j(s)). 25s*4 Suppose -4y - 3g + 0 = 14, -5g - 16 = 3y. Let t(k) = -1. Let z(l) = 4l - 2. Let c(w) = yt(w) + z(w). Let x(m) = 4 - 4 + 3m2 - m2. Give c(x(n)). 8n2 Let b(s) = -41s2. Let j(o) = -o2 + 15. Calculate b(j(l)). -41l4 + 1230l*2 - 9225 Let a(r) = 3r*2 - 12r. Let l(k) = 11k. Determine a(l(v)). 363v*2 - 132v Let l(x) = -26x2. Let b(r) = -22r. What is l(b(a))? -12584a2 Let m(a) be the third derivative of 5a*4/12 - 15a*2. Let k(i) = -4i*2. Determine m(k(w)). -40w2 Let l(r) be the third derivative of -r5/12 + 4r2. Let u(g) = 2g*2. Calculate u(l(k)). 50k*4 Let o be ((-3)/6-10)/1. Let k(b) = 5b - 8 + o + 3. Let m(p) = -2p. Determine m(k(c)). -10c Suppose -2 = 5v - 2k, 3k = 2 + 1. Let l(p) = -2p2 + vp*2 + 3p2. Let o(s) be the third derivative of s4/12 + s*2. Calculate l(o(x)). 4x*2 Let f(m) = 618m*2. Let d(s) = -2s. Give f(d(b)). 2472b2 Let p(y) = -3y - 5. Let v(j) = 4j + 6. Suppose -2i + 0 = 10. Let d(s) = iv(s) - 6p(s). Let z(o) = 3o2. Determine d(z(c)). -6c*2 Let p(l) = l - l - 3l. Let b(x) be the first derivative of 0x - 1/3x*3 - 3 + 0x*2. Give b(p(n)). -9n*2 Let l(r) = -23r. Let s(x) = -28x2. Give l(s(k)). 644k*2 Let h(a) = 3a. Let u(s) be the first derivative of 2/3s3 + 2 + 0s + 0s2. Give h(u(v)). 6v*2 Let c(a) = 7a. Let k(r) = 59r - 3. Give c(k(n)). 413n - 21 Let b(h) = h*2 - 3h. Let r(g) = -g*2 + 5g. Let j(n) = -5b(n) - 3r(n). Let p(d) = 11d2. Give j(p(a)). -242a*4 Let h(s) = -4s. Let y(a) be the first derivative of -4a3/3 + 5a*2/2 - 5a + 1. Let v(z) = -z*2 + z - 1. Let o(d) = 5v(d) - y(d). Give h(o(u)). 4u2 Let p(a) = 4 + 7 + 5 - 15. Suppose -2 - 2 = 4g - 2l, 0 = -5g + l - 8. Let b(u) = -u - 2. Let h(n) = gp(n) - b(n). Let c(v) = -2v*2. Give h(c(j)). -2j*2 Let d(b) be the second derivative of -2b + 0b2 + 0b*3 + 0 + 1/12b4. Let w(i) = i2 + i*2 - 5i*2. What is d(w(m))? 9m4 Let j(a) be the second derivative of -a4/3 + a. Let s(v) = -2v. Let k(d) = 5d. Let x = 8 - 0. Let g(l) = xs(l) + 3k(l). Determine g(j(y)). 4y2 Let q(g) be the second derivative of g + 0 + 0g*3 - 1/12g*4 + 0g2. Let i(u) be the third derivative of u4/24 + 4u2. Determine q(i(s)). -s2 Let o(p) = -22p. Let f(v) = 3v. Let c(u) = -21f(u) - 3o(u). Let r be (-24)/(-9) + (-2)/3. Let z(g) = -2g*2 + 0gr + g2. Calculate z(c(l)). -9l2 Let c(w) = 4w + 7w2 + 9w*2 - 4w. Let b(d) = -2d. Determine c(b(x)). 64x2 Let j(t) be the third derivative of t5/30 + 32t2. Let f(g) = -2g - 17. Give f(j(c)). -4c2 - 17 Let g(p) be the first derivative of -5p*2/2 + 24. Let y(o) = 2o*2. Give g(y(i)). -10i*2 Let i(m) = -2m*2 + 25. Let b(w) = -12w. What is i(b(r))? -288r2 + 25 Let p(z) = 11z. Let y(x) = 2x + 51. Calculate y(p(f)). 22f + 51 Let q(r) be the third derivative of r4/12 - r2. Let l(i) = 14i. Determine q(l(a)). 28a Let h(a) = -2a2. Suppose -o = 3g - 0g - 1, 5o + 15 = -5g. Let q be -2 + (g - (-4 + 0)). Let j(i) = -4 - i2 + q. Calculate j(h(y)). -4y*4 Let z(a) = a. Let y be 4/(-10) - 33/5. Let p = 9 + y. Let g(u) = -2u*2 + 3u*2 - 2up. Calculate z(g(n)). -n2 Let p(r) = -r. Let f(w) = -2w2 - 5w. Let m(l) = -f(l) + 5p(l). Let b(y) = -y2. Calculate m(b(g)). 2g*4 Let o(d) = d. Let y(l) = -10l*2 - 9 + 14 - 5. Give o(y(i)). -10i*2 Let p(v) = -2v. Let b(g) = 5g. Let u(c) = c3 + 2c*2 - 2c - 1. Let i be u(2). Let w(y) = ip(y) + 4b(y). Let z(q) = 4q2. Determine w(z(j)). -8j*2 Let a = 57 + -40. Let w = a + -8. Let r(k) = -wk*2 + k + 8k*2 - k. Let l(s) = 4s*2. Calculate l(r(g)). 4g4 Let n(k) = -k + 1. Let t(b) = -b2 + 2b - 2. Let j(c) = 2n(c) + t(c). Let s(y) = -2y - 1. Give s(j(r)). 2r2 - 1 Let a(l) = l. Let o(v) = -v2 + 4v + 1. Let f be o(3). Suppose -fi - 2 + 14 = 0. Let k(u) = -3 + i + 3u. What is k(a(w))? 3w Let i(l) be the third derivative of -4l5/15 - l2. Let z(h) = h2. Give i(z(g)). -16g*4 Let s(p) = -14p. Let g(h) be the first derivative of h*2 + 2. Determine g(s(a)). -28a Let j(i) = 2i2. Let k(n) = 4n + 0n - 9n. Calculate k(j(d)). -10d2 Let u(o) = 3o*2 + 2o - 2. Let c(a) = a - 1. Let r(h) = -2c(h) + u(h). Suppose s - 3 - 2 = 0. Let p(i) = si - 2i - i. Give r(p(q)). 12q*2 Let l(y) = 2y. Let u(s) = s - 1823. Give u(l(a)). 2a - 1823 Suppose z - 8 = -3z. Let l(d) = 2 - 2 - d*z + 0d*2. Let j(u) = u - 3. Let h(r) = 6r - 16. Let y(b) = 3h(b) - 16j(b). Give l(y(c)). -4c2 Let p(b) = -7b. Let f(u) be the first derivative of -2u3/3 - 5. Give p(f(h)). 14h*2 Let r(c) be the first derivative of 0c + 3 + 1/3c3 + 0c*2. Let p(q) = 2q*2. Give p(r(m)). 2m*4 Suppose -32 = -5a + 4h, 3a - 2a = -5h + 18. Suppose -8m = -6m. Let k	{ "pile_set_name": "DM Mathematics" }
denominator of -23/4590 and 67/15. 4590 What is the lowest common multiple of 8 and 12? 24 Calculate the common denominator of 49/423 and 107/30. 4230 What is the common denominator of -32/9 and 81/6472? 58248 What is the least common multiple of 112 and 876? 24528 Calculate the lowest common multiple of 14 and 64812. 453684 What is the common denominator of -37/2151 and -89/16? 34416 What is the common denominator of 79/63 and 109/2548? 22932 Calculate the smallest common multiple of 36 and 1035. 4140 Find the common denominator of -63/1048 and 93/20. 5240 Calculate the smallest common multiple of 462 and 847. 5082 Calculate the least common multiple of 1554 and 2220. 15540 Calculate the lowest common multiple of 4400 and 3850. 30800 What is the smallest common multiple of 28 and 14? 28 Calculate the lowest common multiple of 341 and 31. 341 Calculate the common denominator of -27/40 and 51/1832. 9160 What is the least common multiple of 8 and 1288? 1288 Find the common denominator of 48/167 and -87/14. 2338 Calculate the common denominator of 26/63 and 23/387. 2709 Calculate the least common multiple of 26 and 210. 2730 Find the common denominator of -51/16 and -1/112. 112 What is the smallest common multiple of 10 and 7260? 7260 Find the common denominator of 17/1956 and -39/1630. 9780 What is the least common multiple of 70 and 2653? 26530 Calculate the common denominator of 3/4 and 39/631. 2524 Calculate the lowest common multiple of 99 and 55. 495 What is the smallest common multiple of 8284 and 228? 24852 What is the common denominator of 111/28 and -17/44? 308 Calculate the least common multiple of 70 and 70. 70 Calculate the common denominator of -19/3 and 27/32. 96 What is the least common multiple of 32 and 110? 1760 What is the least common multiple of 440 and 220? 440 What is the least common multiple of 150 and 165? 1650 Calculate the common denominator of 11/100 and 83/225. 900 Calculate the common denominator of -77/874 and -99/4256. 97888 What is the least common multiple of 8 and 366? 1464 What is the common denominator of -99/820 and -75/164? 820 Calculate the common denominator of 107/588 and -67/63. 1764 Calculate the smallest common multiple of 20 and 388. 1940 What is the common denominator of -133/15696 and -43/11? 172656 Calculate the smallest common multiple of 1416 and 1652. 9912 What is the lowest common multiple of 18 and 69? 414 Calculate the common denominator of 85/6 and -97/22210. 66630 Find the common denominator of -81/16 and -27/154. 1232 Calculate the smallest common multiple of 252 and 108. 756 Calculate the lowest common multiple of 25 and 753. 18825 Calculate the common denominator of -73/60 and -13/256. 3840 Calculate the least common multiple of 2970 and 2376. 11880 What is the common denominator of 59/44 and 91/66? 132 What is the lowest common multiple of 4 and 569? 2276 What is the smallest common multiple of 116 and 40? 1160 Calculate the common denominator of 83/66 and -55/28. 924 Calculate the common denominator of 17/14 and 7/240. 1680 Calculate the lowest common multiple of 4 and 22732. 22732 Calculate the smallest common multiple of 420 and 40. 840 Find the common denominator of 27/506 and 93/2530. 2530 Calculate the common denominator of 21/1088 and 35/4. 1088 Calculate the smallest common multiple of 826 and 8. 3304 What is the common denominator of 29/25 and -26/25? 25 Calculate the lowest common multiple of 63 and 36. 252 Calculate the smallest common multiple of 90 and 144. 720 Calculate the lowest common multiple of 188 and 235. 940 What is the least common multiple of 15 and 70? 210 Calculate the smallest common multiple of 228 and 9. 684 What is the common denominator of 121/144 and 97/192? 576 Find the common denominator of -63/176 and 31/16. 176 What is the least common multiple of 51 and 68? 204 Calculate the common denominator of 95/18 and 95/5078. 45702 Calculate the lowest common multiple of 270 and 60. 540 Calculate the least common multiple of 10 and 28. 140 What is the common denominator of -49/16 and 47/1870? 14960 What is the lowest common multiple of 144 and 144? 144 What is the smallest common multiple of 92 and 506? 1012 Calculate the lowest common multiple of 14 and 110. 770 Calculate the lowest common multiple of 171 and 209. 1881 Calculate the common denominator of 31/251 and 71/9. 2259 What is the lowest common multiple of 113 and 22? 2486 Calculate the common denominator of -59/110 and -139/732. 40260 Calculate the least common multiple of 8 and 10050. 40200 What is the lowest common multiple of 7728 and 42? 7728 What is the common denominator of 149/180 and 53/90? 180 Calculate the least common multiple of 12 and 4. 12 Calculate the least common multiple of 21 and 63. 63 What is the common denominator of 95/6 and 53/176720? 530160 What is the common denominator of -139/1404 and -47/18? 1404 Find the common denominator of -47/197 and -19/4. 788 Calculate the smallest common multiple of 1108 and 5540. 5540 Calculate the least common multiple of 9 and 159. 477 What is the lowest common multiple of 711 and 36? 2844 What is the least common multiple of 24 and 458? 5496 Calculate the lowest common multiple of 3732 and 3732. 3732 Find the common denominator of -19/21 and 52/231. 231 Calculate the common denominator of 9/80 and 173/168. 1680 Calculate the smallest common multiple of 6774 and 12. 13548 Calculate the common denominator of 79/117 and -43/39. 117 Calculate the common denominator of -32/33 and -101/110. 330 Find the common denominator of -43/78 and 167/30. 390 Find the common denominator of 87/2 and -37/1544. 1544 Calculate the common denominator of -161/132 and 15/22. 132 What is the smallest common multiple of 147 and 77? 1617 What is the common denominator of -77/2 and -17/4360? 4360 Find the common denominator of -127/726 and 54/5. 3630 What is the lowest common multiple of 708 and 24? 1416 Calculate the smallest common multiple of 4 and 110. 220 What is the common denominator of -181/810 and -7/120? 3240 What is the smallest common multiple of 98 and 14? 98 Calculate the lowest common multiple of 14 and 906. 6342 Calculate the least common multiple of 2290 and 5. 2290 Find the common denominator of -133/19134 and 3/10. 95670 What is the least common multiple of 91 and 39? 273 Calculate the smallest common multiple of 21 and 126. 126 What is the least common multiple of 636 and 56? 8904 Calculate the smallest common multiple of 65 and 78. 390 Calculate the common denominator of -81/76 and -45/2444. 46436 Find the common denominator of 17/40 and 38/9. 360 What is the common denominator of -47/280 and 67/14? 280 What is the common denominator of -46/5 and 28/61? 305 Find the common denominator of 67/18 and 4/87. 522 What is the smallest common multiple of 106 and 530? 530 Calculate the least common multiple of 172 and 36. 1548 What is the least common multiple of 332 and 32? 2656 Calculate the smallest common multiple of 85 and 110. 1870 Calculate the lowest common multiple of 33 and 18. 198 Find the common denominator of 31/44 and -105/2312. 25432 What is the common denominator of 113/414 and -53/9? 414 Calculate the least common multiple of 912 and 2508. 10032 What is the common denominator of 37/270 and 43/90? 270 What is the common denominator of -13/6 and 1/45? 90 What is the smallest common multiple of 1814 and 18? 16326 Calculate the lowest common multiple of 42 and 406. 1218 What is the common denominator of -41/44 and 37/24? 264 What is the lowest common multiple of 390 and 3978? 19890 Calculate the least common multiple of 7 and 77. 77 Calculate the smallest common multiple of 180 and 72. 360 Calculate the smallest common multiple of 220 and 25. 1100 Calculate the smallest common multiple of 632 and 948. 1896 Calculate the common denominator of 3/266 and 89/444. 59052 Calculate the least common multiple of 1573 and 605. 7865 Calculate the smallest common multiple of 231 and 161. 5313 What is the smallest common multiple of 90 and 40? 360 Calculate the lowest common multiple of 423 and 8. 3384 Calculate the common denominator of -85/4 and 73/1316. 1316 What is the smallest common multiple of 916 and 10? 4580 What is the smallest common multiple	{ "pile_set_name": "DM Mathematics" }
24? 208 What is the highest common factor of 33206337 and 19052? 433 Calculate the highest common divisor of 165 and 9192315. 165 Calculate the greatest common factor of 252324 and 452403. 387 Calculate the greatest common factor of 1244 and 25280568. 1244 What is the highest common divisor of 18495018 and 20254? 1558 What is the greatest common factor of 1504 and 3047433? 47 What is the greatest common divisor of 1751 and 15250? 1 What is the greatest common divisor of 2474832 and 1136? 16 Calculate the highest common divisor of 69762 and 21132903. 4983 Calculate the highest common divisor of 2414108 and 2444. 188 Calculate the highest common divisor of 20313118 and 98. 14 What is the greatest common factor of 2290715 and 175? 35 Calculate the highest common divisor of 242301 and 612. 51 Calculate the greatest common divisor of 136701 and 19256. 83 What is the greatest common divisor of 140 and 408831460? 20 What is the highest common factor of 239750 and 61390? 70 Calculate the highest common divisor of 6207575 and 275. 275 Calculate the greatest common divisor of 247 and 91786721. 13 What is the highest common factor of 19925538 and 711? 237 What is the highest common factor of 1680 and 1249? 1 What is the highest common divisor of 608 and 237136? 16 Calculate the highest common factor of 2964918 and 5384247. 5511 What is the highest common factor of 171428733 and 37? 37 Calculate the highest common factor of 57350 and 6985850. 1550 Calculate the greatest common factor of 29484 and 96916932. 756 What is the greatest common divisor of 12531673 and 2233? 77 Calculate the highest common factor of 2479584 and 9568. 736 Calculate the highest common divisor of 1260820 and 28556. 484 What is the highest common divisor of 627343 and 603595? 1979 What is the greatest common factor of 52500 and 636? 12 What is the greatest common divisor of 79857260 and 10? 10 Calculate the highest common factor of 13035804 and 9384. 204 Calculate the highest common divisor of 21267253 and 21. 7 Calculate the highest common divisor of 6345 and 5032525. 235 Calculate the greatest common factor of 4672 and 1082079. 73 Calculate the greatest common divisor of 1841 and 8044644. 263 What is the greatest common divisor of 30353542 and 3145? 37 What is the highest common divisor of 3524184 and 3096? 72 Calculate the highest common factor of 290 and 3756283. 29 What is the greatest common factor of 388120 and 36? 4 What is the highest common divisor of 17056158 and 15330? 3066 Calculate the highest common divisor of 1310833 and 6018851. 6863 What is the highest common divisor of 716308 and 72451? 1367 Calculate the highest common divisor of 113737 and 488449. 13 Calculate the highest common factor of 4148 and 3018707. 1037 Calculate the greatest common divisor of 119616 and 77875. 623 Calculate the highest common factor of 1215125 and 1125. 125 What is the greatest common factor of 600160 and 86800? 2480 What is the highest common factor of 560046 and 372? 186 Calculate the highest common factor of 961051 and 3401. 179 Calculate the greatest common factor of 249368434 and 2402. 2402 What is the greatest common divisor of 3737792 and 8? 8 What is the greatest common divisor of 132 and 8062284? 12 Calculate the highest common factor of 32262 and 121467. 57 Calculate the greatest common factor of 18653 and 20079. 23 What is the highest common divisor of 13667 and 5704502? 173 What is the highest common divisor of 58148480 and 3393? 377 Calculate the highest common divisor of 1624 and 113310540. 812 Calculate the greatest common factor of 4516 and 371416162. 2258 What is the highest common factor of 5837561 and 759? 23 What is the greatest common factor of 4928 and 469056? 448 What is the highest common factor of 96117 and 3664983? 4179 Calculate the highest common divisor of 10849843 and 2627. 37 What is the greatest common divisor of 82592209 and 641? 641 Calculate the highest common divisor of 41216 and 27790. 14 Calculate the greatest common divisor of 2663699908 and 19. 19 Calculate the greatest common divisor of 8375 and 21927875. 125 What is the highest common divisor of 1754 and 21659269? 877 Calculate the highest common divisor of 346076 and 152934. 718 What is the highest common factor of 622945 and 85777? 31 What is the highest common divisor of 4872 and 305160968? 1624 What is the highest common divisor of 5832 and 4616928? 72 Calculate the highest common divisor of 1595 and 5890973. 319 What is the greatest common factor of 8975856 and 21708? 804 What is the greatest common divisor of 1093806 and 4554? 18 What is the greatest common factor of 56 and 119988428? 28 What is the highest common divisor of 1691 and 6403? 19 Calculate the greatest common factor of 20357739 and 261. 261 Calculate the highest common factor of 54 and 3620124. 18 Calculate the greatest common factor of 76 and 930503796. 76 Calculate the greatest common factor of 41408 and 12478042. 1294 What is the highest common divisor of 6749323 and 4386? 731 Calculate the highest common divisor of 247 and 1368601. 13 Calculate the greatest common factor of 3567 and 11405831. 41 Calculate the highest common factor of 174784048 and 80. 16 Calculate the highest common divisor of 1343850 and 562650. 4650 Calculate the highest common factor of 2370786 and 9. 3 What is the highest common divisor of 912184 and 9256? 104 What is the highest common factor of 1658630 and 7285? 235 Calculate the highest common divisor of 1410960 and 384. 48 Calculate the highest common factor of 140 and 699206. 2 What is the highest common factor of 1964712 and 80088? 1704 Calculate the highest common divisor of 1595786327 and 674. 337 Calculate the highest common factor of 6386851 and 283967. 4813 What is the greatest common factor of 416 and 1491282? 26 Calculate the highest common factor of 91 and 87236149. 91 What is the greatest common factor of 837 and 16536361? 31 What is the highest common divisor of 3842 and 949229? 17 Calculate the highest common factor of 2821797 and 41877. 891 Calculate the greatest common divisor of 117604698 and 4623. 201 What is the greatest common divisor of 4135023 and 10179? 783 Calculate the highest common factor of 1355 and 675543380. 1355 Calculate the greatest common divisor of 252 and 1364157. 9 What is the highest common divisor of 38799 and 269001? 81 Calculate the highest common factor of 119799 and 7776. 243 What is the highest common factor of 56924 and 22042? 214 Calculate the greatest common divisor of 19406 and 263546. 626 Calculate the greatest common divisor of 19836523 and 833. 49 What is the highest common factor of 8125469 and 44? 11 Calculate the highest common divisor of 45 and 18723615. 15 What is the greatest common factor of 11065 and 46703152? 2213 What is the highest common factor of 9687345 and 5? 5 Calculate the highest common divisor of 91 and 262037111. 7 Calculate the highest common divisor of 18905 and 2828785. 995 What is the highest common factor of 6491977 and 7562? 3781 Calculate the highest common divisor of 2734372 and 1271. 41 Calculate the highest common factor of 63 and 342475. 7 What is the highest common divisor of 25072 and 6145774? 3134 What is the greatest common divisor of 1253057 and 42149? 113 Calculate the greatest common divisor of 245860316 and 22479. 7493 What is the greatest common divisor of 1274627183 and 3617? 3617 What is the greatest common divisor of 1951517 and 383407? 821 Calculate the greatest common factor of 83148816 and 12. 12 Calculate the highest common factor of 257683864 and 860. 172 Calculate the highest common divisor of 20757 and 51183. 33 Calculate the greatest common factor of 12425 and 16926329. 497 Calculate the greatest common factor of 185592700 and 2. 2 Calculate the greatest common factor of 5521411 and 12127087. 16681 Calculate the greatest common divisor of 765037 and 2548. 637 What is the highest common divisor of 2494 and 110338? 86 Calculate the highest common divisor of 348817 and 931. 7 Calculate the greatest common factor of 5891 and 184427. 43 What is the highest common factor of 130 and 2070705? 65 Calculate the highest common factor of 73910 and 10030. 10 What is the greatest common factor of 16014 and 52	{ "pile_set_name": "DM Mathematics" }
n*3 Let p(j) be the third derivative of -2291j*5/60 - 1327j*3/2 - 2878j*2. What is the derivative of p(y) wrt y? -4582y What is the second derivative of 6337w3 - 12415w*3 - 1507w + 6484w3 wrt w? 2436w Let n = -143 - -146. Find the third derivative of -24 + 36 - 125o3 + 7o*2 + 22o*n - 18 wrt o. -618 Suppose -17o = -12o. Suppose 1 = -4g - 4v + 25, -2v + 8 = o. Differentiate -13z4 - 15 + 2z*3 - gz*3 + 11 with respect to z. -52z*3 Let s(v) = -3873v*3 - 8v*2 + 48v + 1. Let u(k) = -2k2 - 2k + 1. Let w(j) = -s(j) + 3u(j). What is the third derivative of w(d) wrt d? 23238 Let o be -7(-1 + 268/(-28)). Find the second derivative of o + 28y2 + y - 6y - 75 wrt y. 56 Let m = -315 + 338. What is the first derivative of -76 + 52n + 35n - 126 - mn + 30n wrt n? 94 Let l = 8157 - 8155. Let i(g) be the first derivative of 21 + 34g - 47/2g*l. Differentiate i(d) wrt d. -47 Suppose -4u = -3y - 0 - 11, 2u = -4y + 22. Suppose -uz + 92 + 78 = 0. Find the third derivative of 0c2 + 39c*2 + zc*3 + 2c*2 + 2c*3 wrt c. 216 What is the derivative of 421a*2 - 797a*2 + 165 + 17 + 137 + a wrt a? -752a + 1 Let q = 307 - 269. What is the second derivative of -qw5 - w + 13 + 11 - 24 wrt w? -760w*3 Let o(w) = -116w*2 - 1619w + 1517. Let b(x) = 97x2 + 1617x - 1517. Let l(i) = 6b(i) + 5o(i). Differentiate l(j) with respect to j. 4j + 1607 Let y be ((-225)/27 - -6)-6. Find the second derivative of yu3 - 294u*4 + 56u - 376u - 30u*3 + 16u*3 wrt u. -3528u*2 Let a(k) be the first derivative of -1148k*3/3 + 2663k + 2316. Find the first derivative of a(x) wrt x. -2296x Let g(i) = -16248i*2 + 8845. Let m(o) = 24391o*2 - 13267. Let y(w) = 13g(w) + 9m(w). What is the first derivative of y(p) wrt p? 16590p Let w(s) be the second derivative of -5657s6/30 - s4/12 - 2705s*2/2 + 36s - 2. Find the third derivative of w(d) wrt d. -135768d Let x(l) = l3 + 9l*2 - 10l + 20. Let b be x(-10). Suppose -b = -3o + 10. What is the derivative of o + 21m*4 - 22m*4 + 7 wrt m? -4m*3 Let z be (-2)/3 + (-328)/(-6). What is the first derivative of z + 59d*3 - 1615d*2 + 1615d*2 wrt d? 177d*2 What is the second derivative of -2861h + 0h3 - 2891h + 5660h - 43h*2 - 2h*3 wrt h? -12h - 86 Let p = -99/40 - -1097/120. Let t(n) be the third derivative of 22n2 + 0 + 13/120n*6 + 0n*5 + 0n*4 + 0n + pn3. Differentiate t(r) wrt r. 39r*2 Let u(n) = 133n*3 - 520n*2. Let f(d) = -347d*2 + 2 - 91d*3 + 0 + 179d*3 - 2. Let o(a) = 8f(a) - 5u(a). Find the third derivative of o(l) wrt l. 234 What is the first derivative of 63v - 2v2 - 910 - 781 - 9v*2 + 775 + 6v*2 wrt v? -10v + 63 Let f(i) be the first derivative of 203i6/6 + 2i*2 - 70i - 649. What is the second derivative of f(z) wrt z? 4060z3 Let a be 22/(-10)(-20)/(-8)-2. What is the third derivative of 27j*2 + 163j*3 - 28j*2 + 0j + aj + 8j wrt j? 978 What is the second derivative of -51272i - 51388i - 1055i5 + 102865i wrt i? -21100i3 Let b(u) = -4u - u - u + 91 - 12u2 - 27. Let s(v) = -12v*2 - 4v + 65. Let n(x) = 2b(x) - 3s(x). What is the derivative of n(w) wrt w? 24w Let g(r) be the third derivative of -r7/35 + 13r*6/120 + 230r*3/3 + 260r*2. What is the first derivative of g(i) wrt i? -24i*3 + 39i*2 Let n(i) = -253i*2 - 380i - 12. Let v(t) = 254t2 + 373t + 8. Let s(r) = 2n(r) + 3v(r). What is the second derivative of s(x) wrt x? 512 Find the first derivative of 5157 - 348142c3 + 348229c*3 - 9c + 3c wrt c. 261c*2 - 6 Let g(x) be the second derivative of 0 - 10/3x*4 + 1/2x*2 - 43x - 19/6x3. Find the second derivative of g(w) wrt w. -80 What is the second derivative of -55k - 1 + 139k2 - 6k*3 - 75k - 765k wrt k? -36k + 278 Let b(z) be the third derivative of -13z7/105 - 7z*4/24 + 1183z*3/6 - 777z*2. What is the derivative of b(f) wrt f? -104f*3 - 7 Let n be 15/(-75)((-1)/1 + 1). Find the third derivative of 1170 + nc3 - 1157 + 281c*5 + 0c*3 + 2c*2 wrt c. 16860c2 Let f(q) be the first derivative of -q4/4 + 5q3/3 - 33q*2/2 - 4q + 2591. What is the second derivative of f(v) wrt v? -6v + 10 Let f(b) be the second derivative of 0b*3 - 31b*2 - 30b + 0b4 + 0b*5 + 17/15b*6 - 1. Differentiate f(a) wrt a. 136a*3 Let b(h) be the second derivative of -1/2h*3 - 2h - 1/6h4 + 3 - h2. Differentiate b(s) with respect to s. -4s - 3 Let k be 9/18(-40)/(-2). Let j be 35/k + (-3)/6. What is the second derivative of -3p - 7p3 + jp*3 - 2p*3 - 7p*3 wrt p? -78p Let m(l) = 7137l2 + 28l + 4260. Let v(g) = -7136g2 - 26g - 4260. Let c(b) = 13m(b) + 14v(b). Differentiate c(x) with respect to x. -14246x Let i(m) = -m + 1. Let n be i(1). Suppose -4a + ng + 53 = -g, 4a - 55 = 3g. Find the second derivative of -5h*3 - ah - 4h3 - 4h*3 wrt h. -78h Let y(c) be the third derivative of 943c6/60 - c5/30 - 967c*3/6 - 2736c*2. What is the third derivative of y(t) wrt t? 11316 Let i(l) be the first derivative of 3l*2/2 - 7l - 23. Let q be i(3). What is the third derivative of 20h2 - q - 43h*2 + 26h*4 + 2 wrt h? 624h Let g(l) = l - 23. Suppose 0 = -3a - a + 4. Let i(w) = 9 - a - 16. Let u(s) = 3g(s) - 8i(s). What is the derivative of u(p) wrt p? 3 Let c be ((-1)/(-3))/(4/12)9. Suppose -2g + cg = 0. Find the third derivative of -6h3 - 20h*2 - 2h*3 + gh*3 wrt h. -48 Let x(j) = 6923j*4 + 18j*2 + 38j + 88. Let p(r) = 2r2 + 3r + 1. Let w(d) = -13p(d) + x(d). Find the third derivative of w(n) wrt n. 166152n Let l = 12 - 14. Let k be ((-2)/l - 2)/((-15)/30). Find the third derivative of -150 - 4a2 + 150 - 11a*3 - 6ak wrt a. -66 Let b(j) be the second derivative of j3/3 + 57j2/2 + 5j. Let z be b(-23). Find the second derivative of -zi - 10i*2 - 2i + 39i2 - 26i wrt i. 58 Let n(c) be the second derivative of 1351c4/12 - 4c*3 + 5c*2/2 - 156c. Find the second derivative of n(d) wrt d. 2702 Let n(p) = 28934p3 - 30559p*2 - 9p - 9. Let v(r) = -7234r3 + 7641r*2 + 2r + 2. Let l(h) = -2n(h) - 9v(h). Find the third derivative of l(s) wrt s. 43428 Let f = -199 - -221. Differentiate -21 - 2m2 - f + 20 - 60m with respect to m. -4m - 60 Let r(p) = -9806p*3 - 60p*2 - 9574p - 6. Let a(h) = -h*3 + 10h*2 + 2h + 1. Let f(j) = 6a(j) + r(j). Find the second derivative of f(q) wrt q. -58872q Let o = 34 + 36. Let a = -78 + 148. What is the second derivative of -ok3 - 20k*4 - 13k + ak3 wrt k? -240k*2 Let o(k) be the third derivative of 227k*7/70 + 91k5/60 - k4/8 + 4k3/3 + 4364k*2. What is the third derivative of o(b) wrt b? 16344b Let f(y) = 1775y3 - 1494y*2 - 3y + 3. Let t(z) = 1780z3 - 1495z*2 - 4z + 4. Let w(v) = -4f(v) + 3t(v). What is the third derivative of w(q) wrt q? -10560 Find the third derivative of -2098z2 + 461z*2 - 839z*2 + 373z*3 - 367z*2 wrt z. 2238 Let f(h) = 10h*2 + 47h + 153. Let j be f(-3). Find the second derivative of 30z3 + 14z - 13z3 + jz - 8z3 wrt z. 54z Let z(a) = 12125a3 - 15a*2 + 958a + 5. Let g(s) = 6064s3 - 6s*2 + 479s + 2. Let f(j) = -5g(j) + 2z(j). Find the second derivative of f(u) wrt u. -36420u Let l(p) be the first derivative of 10p7/7 - p6/2 + 9p5/5 - 72p*3 + 1240. What is the third derivative of l(x) wrt x? 1200x*3 - 180x*2 + 216x Let w(x) be the second derivative of -2211x5/10 - 5x*4/12 + 121x*2 - 938x - 3. Find the third derivative of w(t) wrt t. -26532 Let d = -35 - -41. Suppose 4c - 18 = d. Find the third derivative of 13i*4 + 5249 - 5249 + ci*2 wrt i. 312i Suppose -2y = 2w - w - 538, 5w + 247 = y. Suppose 3f = 2l - y, -65 - 86 = -l + 5f. What is the second derivative of 5v3 - 63v + lv - 94v wrt v? 30v Let v(a) be the first derivative of a6/60 + 47a4/24 - a3/3 + 2a + 8. Let c(r) be the third derivative of v(r). Find the first derivative of c(f) wrt f. 12f Find the third derivative of -1531y5 - 3172y*5 - 4804y - 60y2 + 5 + 4801y wrt y. -282180y2 Differentiate 450r*2 + 2461r*2 + 2766 + 921r**2 + 679	{ "pile_set_name": "DM Mathematics" }
194 = 0, -3v + 0v - 1026 = 5p. Let b = p + 407. Is b a composite number? True Let n(a) = -94a*2 - 4a - 1. Let g(w) = -w. Let z be g(-8). Let u(c) = 281c2 + 11c + 3. Let v(f) = zn(f) + 3u(f). Is v(-1) composite? True Let z(v) = 3v2 + 1 + 3v - 3v. Let l be z(1). Is l/12 - (-44)/3 a prime number? False Let j(u) = 102u*3 + 2u*2 - 1. Let v be j(1). Suppose -7g - v = -8g. Is g a composite number? False Let c = -2 - -8. Suppose 2z - 2n + 8 = -5n, z - n = c. Is 16 + (-2)/(4 - z) prime? False Suppose 5r - 2z = 1737, -4z + 681 + 9 = 2r. Is r composite? False Let o(y) = -y*3 - 4y2 - y - 4. Let v be 1/(((-1)/4)/1). Let h be o(v). Let m(z) = -z2 - z + 15. Is m(h) a composite number? True Suppose -2w = 4z - 10, -2z = -z + 5w - 7. Suppose -5d + 3d = 4, -3y + zd - 41 = 0. Let s = 22 - y. Is s a composite number? False Suppose -3z - 4u = -7u - 6, -5u + 10 = 5z. Let p = 5 - 3. Suppose -pg - g + 12 = -zh, 2g + 2h = 18. Is g a composite number? True Suppose -3u + 2p = -u - 3940, -2u + 3935 = 3p. Is u composite? True Suppose -8i + 210 = -5i. Suppose -3g + g = -i. Is g prime? False Suppose -8698 = -4g - v, -4g + 2g = -v - 4346. Is g prime? False Suppose 215 = 5u + 5t, 0 = 3u - t - 40 - 73. Let o = 26 + u. Is o prime? False Let m be 0 - (-20 - (-2 + 2)). Suppose c + 4 = 0, -3q + 3c + m = q. Suppose q - 100 = -2g. Is g prime? False Let j(i) = 14i*2 + 2i - 1. Suppose -d = 4d + k - 10, 4d = k - 1. Is j(d) composite? True Let f(r) = r*2 + 3r - 27. Is f(11) prime? True Let t(d) = -26d + 33. Is t(-23) a prime number? True Suppose 2s + 0s = 3590. Is s a composite number? True Suppose 0 = -5g + 148 + 1187. Suppose -c = -4c + g. Is c a prime number? True Suppose 2o - t + 301 = 1085, -3o = -5t - 1169. Is o prime? False Let v be 2 + 1/(-3)-3. Suppose vi + 0i - 21 = 0. Is i a prime number? True Is (-2 - 0 - -1) + (-17528)/(-7) prime? True Let h(s) = -3s + 7. Is h(-10) composite? False Let f(q) = 0q3 - q3 + 3q*2 - 5 - 2q + q*3 - 2q3. Is f(-4) a composite number? False Let a(l) be the second derivative of -l5/10 - 5l4/6 - l3/6 + 15l*2/2 - 3l. Is a(-7) composite? True Let h = 6 - 1. Suppose 2o + d - 88 = h, 0 = -3o - d + 140. Is o a prime number? True Suppose f - 41 = 5f + 5m, 20 = -4m. Is f/(4/(-35)) + 4 composite? True Let l(v) = -v3 - 11v*2 - 51v - 11. Is l(-12) prime? False Suppose -4k = -k - i - 25, -k = -5i + 1. Let q be 24/k132/(-8). Let y = 123 + q. Is y a composite number? False Suppose 0 = -4k - k + 10. Suppose 1 = 2c - kh - 1, 2h + 6 = 4c. Suppose ct = -d + 16, -5t - 4 - 33 = -3d. Is d prime? False Let p be 13/(-2)-2. Suppose 7 = 2w - p. Suppose -332 = -4s - wa, a + 30 = -s + 113. Is s composite? False Suppose 11w - 22146 = 5w. Is w composite? False Let t = 65 + -61. Is t a composite number? True Let j be (-4)/6 + (-8)/(-3). Is (-3009)/(-33) + j/(-11) a composite number? True Suppose -5l + 883 = 2f - 55, -3f + 1417 = 5l. Is f composite? False Let c = 4189 - 2659. Is 4/(-6)c/(-12) a prime number? False Let q(f) = -14f - 7. Is q(-7) composite? True Suppose -3d + 11 = -4u - 21, -4u = 5d - 32. Let s(b) = b*3 - 5b*2 - 6b + 5. Is s(d) a composite number? False Let l = -4 + 6. Let d = 3 + 0. Suppose -w - dk = -10, lw - 2k = -0w + 60. Is w prime? False Let k(h) = -3h - 4. Let p be k(-3). Let j(u) = 7u - 2. Is j(p) composite? True Let w be (12/(-14))/((-12)/56). Suppose 4u + 43 = p, 2u - wu - 10 = 0. Is p composite? False Suppose 0 = -4c + 3r - 4, -5r + 30 = 5c - 0r. Suppose 0 = -cv + 5v - 18. Suppose 0 = -11z + vz + 105. Is z composite? True Let m(p) = 11p2 + 1. Is m(4) composite? True Let k be 14/35(-2110)/(-2). Suppose -4c = 2y + 642 + k, y = 2c - 536. Is ((-2)/3)/(4/y) a composite number? False Suppose -8j = -4j - 12. Suppose -2d + jd - 55 = 0. Is d a composite number? True Let d = -158 - -955. Is d prime? True Suppose h - 1 = 1. Suppose -l + 277 = hy, 2l - 4y - 534 = -3y. Is l a prime number? True Suppose 15 = 3k - 3l, 6 = -5k + l + 35. Is 160 + (-6)/(k/3) prime? True Let h(q) = -q. Let c be h(0). Suppose 0r + 2r - 98 = c. Is r prime? False Let v(j) = 2j3 + 2j*2 + j + 1. Let t be v(-2). Is t/(-3)267/9 composite? False Suppose -5q - 2 = -2n - 20, -6 = 5q + 4n. Let d be (-3 + 1)/(q/(-8)). Let k(p) = 2p2 - 2p + 7. Is k(d) composite? True Let h = 18 - 13. Suppose i = h + 9. Is i prime? False Let m = 1 - 1. Suppose 4g + 4 = 72. Suppose -l + 40 - g = m. Is l composite? False Is (-70)/25(-1970)/4 a prime number? False Let m = 7 + -3. Suppose 4q - q = -2b + 211, q - 61 = mb. Is q prime? False Suppose -d + 493 = -4a + 108, -3d = 3a + 285. Let v be -2(2 - 306/4). Let w = v + a. Is w prime? True Let p(b) = -2b + 2. Let t be p(1). Suppose -5s = -ts - 1495. Is s prime? False Let a(d) = d3 + d2 + 5. Let u be a(0). Suppose -2i + 94 = 2x, 0 = -ui + 2i. Is x prime? True Let j(k) = -k*3 + 3k*2 + 5k + 2. Let t be j(4). Let i be 4t/162. Suppose 5f - 158 = if. Is f prime? True Let u(g) = g*3 + 7g*2 - 2g. Let i = 11 - 43. Let d be -3(-3 - i/6). Is u(d) a composite number? True Suppose -z + 103 = 4q, 5q - 40 = -2z + 151. Is z composite? False Suppose 3645 - 174 = 3r. Is r prime? False Suppose -5c = -874 + 169. Is c composite? True Suppose 3j + 2 = 4q + 7, 3j = -q + 25. Is j a composite number? False Let n(w) = -w2 + 6w - 10. Let m be n(8). Let d be (-3 + 4)/((-2)/78). Let g = m - d. Is g a prime number? True Suppose 3i + 3n = 18, -n + 46 = -i + 6i. Let v = 4 - i. Let l = 9 + v. Is l prime? True Suppose 0 = -2v + 3v - 2. Suppose -vy + 4y = 0. Suppose 3r + 2m - 213 = -ym, 2m = 0. Is r composite? False Let j = 138 + -53. Is j a prime number? False Let r = -301 + 428. Suppose -2q = -q - r. Is q composite? False Let o(h) = h*2 + 7h - 3. Let q be o(-7). Is q + 18(9 - 2) composite? True Let l = -19 + 66. Is l a composite number? False Suppose 0 = 6n - 2n + 4c - 16, -2c - 6 = -5n. Suppose 4v = nv + 66. Is v prime? False Is (-1 + 77 + 3)11 prime? False Let l = -6 + 95. Is l a composite number? False Suppose -5q + 5h + 9 = -6, 4q + h + 3 = 0. Let j = 2 + q. Suppose -26 = -jr + 40. Is r composite? True Suppose -3b = 2x - 394, 3b = 3x + b - 565. Is x composite? False Let r(v) = -331v. Is r(-3) a prime number? False Suppose 215 = 4m - 341. Is m prime? True Let m = -91 + 29. Let v = m - -261. Is v prime? True Let m(d) = 106d + 1. Let h be m(1). Suppose 5k = -a + 50, -5a = -0a + k - 154. Let t = h - a. Is t a composite number? True Suppose 2l + 2008 = 140. Let u = l + 1761. Let y = u - 574. Is y a composite number? True Let n be (71/3)/((-6)/(-54)). Let a = n - 30. Is a a prime number? False Suppose v - 248 - 9 = 0. Is v a composite number? False Let p(u) = -43u - 13. Is p(-4) a composite number? True Suppose -5n - 4 - 11 = 3i, -43 = 4i - n. Suppose -4a - 140 = -4k, 5k + 0a - 3a - 167 = 0. Let b = i + k. Is b a prime number? False Suppose 2y = 3y - 161. Is y a composite number? True Is 5-329/(-3) a prime number? False Let p(f) = 264f*2 - 1. Is p(-2) prime? False Let g = -11 - -13. Suppose l = gl - 15. Is l a prime number? False Let t(n) = -n*3 + 8n*2 - 9n. Let v be t(6). Let w = 3 + v. Is w a composite number? True Suppose y - 6 = -3. Suppose 0 = -5a + 4w + 18, 0a - 3 = -ya + 5w. Suppose -a + 29 = b. Is b a prime number? True Suppose 2m + n = 4m - 2, 20 = 5n. Suppose 0 = 4y - 1250 - 50. Suppose mi - y = -2i. Is i prime? False Suppose 27 = 2g + 7. Is g + 11 - (3 + -1) prime? True Let s(a) = a*3 - 8a*2 + 6a + 8. Let x be s(7). Let r be x - 0 - (8 + -7). Is r - 1/(-1)59 a composite number? False Suppose -1 = x + 99. Let w = 167 + x. Is w a prime number? True Let f be 16(-4)/(64/(-12)). Suppose -17u + 395 = -fu. Is u composite? False Let y(z) = 5z2 - 2z - 7. Let f be y(5). Let l = 149 + f. Is l a composite number? False Let g(q) = -q*3 + 5q*2 + q - 2. Let l be g(5). Suppose -y = -1, -y + ly = -2p + 156. Is p prime? False Let t(i) = 38i*2 - 1. Suppose -4 = 4l - 0. Let n(d) = 2d3 + d2 + d + 1. Let r be n(l). Is t(r) composite? False Let o(b) be the second derivative of b*3/	{ "pile_set_name": "DM Mathematics" }
, n: 6, k: 1}. Give prob of sequence ksr. 1/840 What is prob of sequence exs when three letters picked without replacement from {s: 2, e: 1, x: 1}? 1/12 What is prob of sequence gn when two letters picked without replacement from {n: 3, g: 3, j: 3, p: 2, c: 3, s: 3}? 9/272 Two letters picked without replacement from xrddzoirz. Give prob of sequence ri. 1/36 Calculate prob of sequence kuuu when four letters picked without replacement from {k: 5, u: 7}. 35/396 Two letters picked without replacement from qqqqqqqqqqqqzqqqqqqq. Give prob of sequence qz. 1/20 What is prob of sequence izi when three letters picked without replacement from {h: 9, z: 3, i: 4}? 3/280 Two letters picked without replacement from cccjwtjjtctjc. Give prob of sequence tt. 1/26 Four letters picked without replacement from {l: 6, q: 2}. Give prob of sequence lqql. 1/28 Three letters picked without replacement from {x: 4, p: 3}. What is prob of sequence pxx? 6/35 Calculate prob of sequence mp when two letters picked without replacement from zpjzjjzjjzxpzpjpjpm. 5/342 What is prob of sequence kzu when three letters picked without replacement from {u: 1, k: 5, z: 11}? 11/816 Three letters picked without replacement from {u: 9, g: 1, e: 2, p: 2}. What is prob of sequence guu? 3/91 Calculate prob of sequence jjh when three letters picked without replacement from {h: 2, j: 16}. 5/51 What is prob of sequence rtha when four letters picked without replacement from ggaghggtrtgggggllr? 1/18360 Four letters picked without replacement from eeeedddeee. Give prob of sequence eeed. 1/8 Calculate prob of sequence qc when two letters picked without replacement from qnqsvcnsqns. 3/110 Calculate prob of sequence le when two letters picked without replacement from {c: 3, l: 3, e: 5, h: 2, r: 2}. 1/14 What is prob of sequence kvr when three letters picked without replacement from {u: 10, k: 2, v: 3, r: 3}? 1/272 Calculate prob of sequence ku when two letters picked without replacement from {u: 8, o: 2, e: 3, k: 3}. 1/10 Four letters picked without replacement from {d: 5, v: 2, x: 12}. What is prob of sequence dvdd? 5/3876 Two letters picked without replacement from {z: 2, l: 2, m: 2, d: 1, c: 1}. What is prob of sequence md? 1/28 Four letters picked without replacement from mzmmmzmzsimmmmmbbzi. Give prob of sequence sbzb. 1/11628 What is prob of sequence iam when three letters picked without replacement from {q: 3, i: 4, m: 1, a: 3}? 2/165 Two letters picked without replacement from kkkkkkkkkk. Give prob of sequence kk. 1 Two letters picked without replacement from {w: 1, x: 12}. Give prob of sequence xx. 11/13 Calculate prob of sequence xo when two letters picked without replacement from {m: 1, s: 1, c: 1, x: 1, o: 1}. 1/20 Two letters picked without replacement from rpppppptptpptrpdrrd. What is prob of sequence dp? 10/171 Two letters picked without replacement from {v: 2, o: 1, j: 2, u: 1}. What is prob of sequence vu? 1/15 Two letters picked without replacement from {f: 4, j: 7, q: 2, x: 1}. Give prob of sequence fq. 4/91 Two letters picked without replacement from smbkbrso. Give prob of sequence ss. 1/28 What is prob of sequence cbbb when four letters picked without replacement from {p: 8, l: 4, e: 1, b: 6, c: 1}? 1/969 What is prob of sequence ysox when four letters picked without replacement from {x: 3, y: 4, g: 3, o: 6, s: 4}? 4/1615 Four letters picked without replacement from {g: 1, e: 2, y: 5, x: 3, c: 5}. Give prob of sequence ecex. 1/1456 Calculate prob of sequence kh when two letters picked without replacement from khhkk. 3/10 Two letters picked without replacement from tmmmmmbmmtbmtmm. What is prob of sequence mb? 2/21 Two letters picked without replacement from {m: 1, t: 2, n: 2, a: 4, y: 2, z: 3}. What is prob of sequence mt? 1/91 What is prob of sequence ik when two letters picked without replacement from {i: 3, q: 2, r: 6, b: 4, k: 3}? 1/34 Three letters picked without replacement from {z: 3, g: 1, w: 1, q: 2, e: 3, k: 3}. What is prob of sequence kgw? 1/572 Two letters picked without replacement from {d: 2, o: 2, t: 3, l: 4, u: 1, m: 2}. What is prob of sequence lu? 2/91 Four letters picked without replacement from kkksssk. What is prob of sequence ksks? 3/35 What is prob of sequence vri when three letters picked without replacement from {r: 2, v: 1, i: 11}? 11/1092 Three letters picked without replacement from qdydyqddddyd. What is prob of sequence ydy? 7/220 What is prob of sequence ibb when three letters picked without replacement from {b: 5, i: 2}? 4/21 Three letters picked without replacement from {z: 1, g: 4, c: 6}. What is prob of sequence ggg? 4/165 Calculate prob of sequence zmzz when four letters picked without replacement from {m: 2, z: 8, h: 4}. 4/143 What is prob of sequence mv when two letters picked without replacement from {x: 6, m: 3, f: 2, v: 2, d: 2, n: 2}? 3/136 Four letters picked without replacement from mmpmppppppwpmpppmm. Give prob of sequence pwpm. 11/1224 What is prob of sequence uhfh when four letters picked without replacement from uffwhfffhwfwfwwcwf? 1/4590 Calculate prob of sequence ov when two letters picked without replacement from oclovtw. 1/21 Three letters picked without replacement from vvvsscvsscvcvss. Give prob of sequence vcs. 18/455 What is prob of sequence tlba when four letters picked without replacement from {l: 1, a: 1, b: 2, o: 3, y: 4, t: 1}? 1/5940 Two letters picked without replacement from dajyadddyjjyya. What is prob of sequence dd? 6/91 Four letters picked without replacement from vhhvp. What is prob of sequence hhpv? 1/30 Two letters picked without replacement from liliidiiiidd. Give prob of sequence ld. 1/22 Two letters picked without replacement from aanndallalgadglak. What is prob of sequence ag? 3/68 Three letters picked without replacement from {f: 2, q: 1}. What is prob of sequence fff? 0 Four letters picked without replacement from wgtmgzn. Give prob of sequence zwgz. 0 Three letters picked without replacement from {y: 3, v: 5, w: 1, b: 1, s: 2}. Give prob of sequence yvy. 1/44 Calculate prob of sequence sss when three letters picked without replacement from ssssss. 1 Three letters picked without replacement from {n: 2, b: 8, e: 4}. Give prob of sequence neb. 8/273 Calculate prob of sequence ee when two letters picked without replacement from yyyeeyyyyeeye. 5/39 Four letters picked without replacement from {k: 13, j: 4, q: 3}. What is prob of sequence kjjj? 13/4845 Three letters picked without replacement from qnqqqnnnqqqnq. Give prob of sequence nnq. 40/429 Two letters picked without replacement from zthfozx. Give prob of sequence zh. 1/21 Calculate prob of sequence hbb when three letters picked without replacement from ubbuhububuuh. 1/55 Four letters picked without replacement from {c: 2, x: 5}. What is prob of sequence xxcx? 1/7 Two letters picked without replacement from {h: 6, b: 4, u: 10}. Give prob of sequence uu. 9/38 Four letters picked without replacement from {p: 1, b: 1, o: 5, v: 3, l: 5}. What is prob of sequence opvb? 1/2184 Four letters picked without replacement from {v: 7, c: 4, k: 2}. Give prob of sequence cvcv. 21/715 Four letters picked without replacement from {z: 6, j: 2, q: 1, p: 2, i: 7}. What is prob of sequence pqzj? 1/3060 Two letters picked without replacement from ossnzssozsnnssslzs. Give prob of sequence nz. 1/34 What is prob of sequence zxzk when four letters picked without replacement from {g: 2, k: 4, s: 6, z: 2, x: 3}? 1/2380 What is prob of sequence snz when three letters picked without replacement from {s: 2, n: 5, z: 2}? 5/126 What is prob of sequence ay when two letters picked without replacement from {a: 9, y: 1, f: 1}? 9/110 What is prob of sequence xxp when three letters picked without replacement from {r: 6, p: 1, x: 2, u: 4}? 1/858 Two letters picked without replacement from okdkook. Give prob of sequence oo. 1/7 Two letters picked without replacement from {x: 5, n: 4, k: 3, o: 4}. Give prob of sequence no. 1/15 What is prob of sequence ssf when three letters picked without replacement from {s: 2, f: 6, x: 2, g: 7, q: 1}? 1/408 Two letters picked without replacement from dxyhtxxdx. What is prob of sequence yh? 1/72 Four letters picked without replacement from cccccckkbkqqf.	{ "pile_set_name": "DM Mathematics" }
, r? 4/5 Suppose -2v = -z - v - 2, 20 = 5v. Which is the third smallest value? (a) z (b) 2/11 (c) -1 a Let l = 0.5 + -0.9. Let k = -4.9 - -5. Which is the third smallest value? (a) l (b) -2/3 (c) k c Let q = -2 + 6. Let x = 4.2 - q. What is the second biggest value in -3, x, 0? 0 Let c(p) = 3p3 - 2p*3 + 4p*2 + 0p*2 - 5p*2 + 1. Let f be c(1). What is the third smallest value in -0.4, 2, f? 2 Suppose 12 = -k + 10. Let l be (-4)/k + 10/(-6). Let f = -0.2 - 0.3. Which is the biggest value? (a) l (b) -2 (c) f a Let h be 1/(-2) - (-12)/(-48). Let q = 8 - 8.1. What is the third biggest value in 0, q, h? h Let g = -3 + 3.5. Which is the second biggest value? (a) g (b) 0.3 (c) 2/5 c Let x = -5 + 13/3. Which is the second smallest value? (a) -4/5 (b) x (c) 0.4 b Let d = -1 - -5. Suppose -ds = -5s. Let j = 231.3 - 231. Which is the biggest value? (a) s (b) j (c) -0.5 b Let x be (4/(-70))/(1/5). Which is the smallest value? (a) 0 (b) x (c) 1 b Let i = -29 + 173/6. Let x = 2.9 - 3. Let s = 0 + x. What is the second biggest value in 4, i, s? s Let n be -2 - (-4)/(-9)-4. Let k = -2.9 + 2.9. Which is the second biggest value? (a) 1/6 (b) n (c) k c Let n(l) = -l - 3. Let f be n(0). Let w = 1 + -2. Let i = w - -1. Which is the second biggest value? (a) f (b) -4 (c) i a Let j = -0.84 + 1.14. What is the second smallest value in j, 1, -7? j Let r = 9.4 + -3.4. Let v = -8 + 6. Which is the smallest value? (a) r (b) v (c) 2 b Suppose 4g + 2y + y = 63, g + 2y = 17. Suppose 5k - 5 = -g. Let m be (-1 + -1 - -4)/k. Which is the second biggest value? (a) m (b) 0 (c) -4 a Let p = 0.54 - 0.6. Let i = 330.5 - 330. What is the third smallest value in i, p, 1? 1 Let n = -1/145 + 301/1595. Let x(p) = 5p. Let z be x(3). Let j be 6/4(-4)/z. Which is the second biggest value? (a) n (b) j (c) -2/21 c Suppose 6 = -3u - 0u. Let x = 3 - u. Which is the third biggest value? (a) -0.9 (b) 4 (c) x a Suppose 6 = -2g, -112 = -5y + 3g - 13. Let r = -19 + y. What is the biggest value in -0.1, r, 1/7? 1/7 Let u = -24.03 - -24. What is the second smallest value in -4, u, -0.2, -1? -1 Let y = -3 + 7. What is the second smallest value in y, -4, -2/3? -2/3 Let q be -3-2(-2)/(-4). Suppose -qk + 10 - 1 = 0. What is the second smallest value in 5, 1/4, k? k Let n = 26.6 - 22. Let x = -20 + 20.4. Let f = n + x. Which is the biggest value? (a) -0.2 (b) 2 (c) f c Let u be 1/(-3) + (-17)/(-33). Let x be (-13)/((-455)/28)-15. What is the biggest value in -2, x, u? u Let v = 2 - -2. Suppose -5m = w + 36, 3w + 9 = vm - 4. Let y = w - -6. Which is the second smallest value? (a) -2/11 (b) -0.1 (c) y a Suppose -4d + 12 = -12. Let n be (-3)/(-14)d/9. Which is the biggest value? (a) n (b) 0.4 (c) 1/4 b Let v = 1.9 + -1.7. Let s = -1.2 + v. What is the smallest value in -2/9, -1/3, s? s Let z be (4/8)/((-1)/(-276)). Let v be z/6016/3. Let y = v + -38/3. Which is the biggest value? (a) 0.3 (b) -1 (c) y a Let r = -8 - -6. Which is the third smallest value? (a) r (b) -2/5 (c) 5/4 c Let k be -5 - (9/(-3) - -2). Let q = -0.02 - 0.38. Let l = q + 0.9. What is the second biggest value in -2/9, l, k? -2/9 Let q = -183 + 182. Let w = 4 + -1. What is the second biggest value in -3, q, w? q Let j(f) = -6f - 7. Let m be j(-2). Which is the smallest value? (a) m (b) 1 (c) -2/3 c Let j = 113 + -113. Which is the smallest value? (a) 1/4 (b) -2/5 (c) j (d) -2 d Let p = 4 - 1. Let u be p - (36/14 - 0). Which is the biggest value? (a) u (b) 1 (c) -1/9 b Let c = -21 + 24. What is the second smallest value in -2/3, -3, c? -2/3 Let q = -1.3 - -1. Let x = -0.43 - -0.03. What is the biggest value in x, -7, q? q Let w = 38 - 37. Let u be 2/(-42) - (-8)/(-28). What is the smallest value in 1/5, w, u? u Let h = -3 - -10. Let k = h + -12. Which is the second smallest value? (a) 3 (b) k (c) -2/3 c Let o = 0 - -0.5. Let g = 0.1 - o. What is the third biggest value in 0.1, -1/2, g? -1/2 Suppose 3x - 2x = 0. Let h = -51 + 56. Suppose 5u - 5t = -45, 3t - t = 10. What is the second smallest value in x, h, u? x Let g(w) be the first derivative of -5w2/2 + 2. Let a be g(-1). What is the biggest value in -3, a, -1? a Let f be -1(0 - 4/7). Let s = 9/4 + -11/4. Suppose 7n = 3n, i - 5n + 1 = 0. What is the third biggest value in s, f, i? i Let p be 0 + -1 - 14/7. Let l be p/(-3) - -3 - 0. Let u be (-18)/(-15) + 1-2. Which is the third biggest value? (a) u (b) l (c) 5 a Let n = 0.2 + -0.2. Let r be (6/(-24)2)/(1/2). Which is the smallest value? (a) 3 (b) n (c) r c Let l be 2/(-4) - 1/(-4). Suppose n + 0n + 1 = 0. Let s = 0 - 5. What is the third biggest value in l, n, s? s Let y be ((-1)/7)/((-2)/(-6)). What is the third smallest value in y, -0.2, 4? 4 Let v = 1 + -1. Suppose 2r - 18 = -5j + 16, -4r = 2j - 20. Let h be -4 + j + (-38)/18. What is the third smallest value in v, 2, h? 2 Let m = -98 - -97.5. Let r = -0.2 - 0.2. What is the second smallest value in r, m, 2? r Let r = 0.8 - -0.2. Let j = -0.8 - -0.3. Let o = -0.3 - 0. What is the second biggest value in r, j, o? o Let s = 20 + -19. What is the third smallest value in -2/9, 0.3, s? s Let k = -35 - -34. Let t = -3 + 3. Let n = -0.7 + 0.3. Which is the third smallest value? (a) t (b) n (c) k a Let i = -4 + 3. Let x = i - 0. What is the third smallest value in 2/21, 4, x? 4 Suppose x = -3x + 80. Suppose -x = -4s - s. Let q = 5.8 + -0.8. Which is the third biggest value? (a) 0.1 (b) s (c) q a Suppose 0 = 4h - h - 4d, 0 = -d - 3. What is the second biggest value in 5, 0, h? 0 Let r = 0.6 - -0.4. Let w = r - -4. What is the third biggest value in 0, -4, w? -4 Let v = 25 - 41. Let r = 16.5 + v. Which is the smallest value? (a) 0.2 (b) r (c) -1 c Suppose -4d - 5r = -d + 5, -27 = -3d + 3r. Let s(l) = l*3 - 5l*2 + 1. Let p be s(d). What is the second biggest value in 5, 2/3, p? p Let j = -0.2 - 0.3. Let x = j + -2.5. Let f = 2.5 + x. What is the second smallest value in f, 1, 0? 0 Let z = 1.6 - 5.6. Which is the second smallest value? (a) z (b) 3 (c) -3 c Let j = -26.79 - -27. Let y = -1.21 + j. Let n = 77 - 388/5. Which is the second biggest value? (a) n (b) y (c) -4 b Suppose 3u + 0u + 6474 = 0. Let g be (-6)/21 + u/(-252). Let q = 17/2 - g. Which is the third biggest value? (a) -0.1 (b) q (c) -3/2 c Let g be (-6)/(-21) - (-16)/140. Let r = -32 - -225/7. Let u = -0.1 + 1.1. Which is the second smallest value? (a) r (b) g (c) u b Let t = 0.3 - 0.8. Let d = 665/36 - 73/4. Which is the biggest value? (a) t (b) 2/3 (c) d b Let n = -23 + 23.5. Which is the third smallest value? (a) n (b) -4 (c) 4 c Let m = 49/195 - 2/39. What is the smallest value in -4, m, -2? -4 Suppose 3u - 6u - 132 = 0. Let m be u/48 - 8/(-12). Which is the third smallest value? (a) m (b) 0.1 (c) -1/6 b Let p = -1.8 - -2.1. Which is the second smallest value? (a) -1/3 (b) 2 (c) p c Let i = -30.7 - -31. Let x = 253.06 + -250. Let m = x - 0.06. Which is the smallest value? (a) m (b) i (c) 0.5 b Let l = 4.2 + -4. Let k = -0.15 + l. Let w = -0.05 + k. What is the third smallest value in -2/13, w, -5? w Let o = -0.79 - -11.19. Let r = o - 10. What is the smallest value in 0.5, -4/7, r? -4/7 Let p = -103/477 + -1/159. Let i be ((-2)/1)/2 + -2. Let y be 5 + i/62. Which is the third smallest value? (a) y (b) p (c) 1 a Let v = -0.24 - 0.06. Let o = 0.2 + v. What is the third biggest value in 0.4, o, -5? -5 Let n = 24/35 - 2/105. Let l be (-17)/(-34) - 6/4. Suppose 0 = 5g - 4o + 7, -4o + 7 = -2g - o. Which is the biggest value? (a) l (b) n (c) g c Let q = 51/10 - 43/10. Which is the smallest value? (a) 4/3 (b) q (c) -3 c Suppose 4 = 3w + w. Which is the third biggest value? (a) 0 (b) w (c) -5 (d) -3 d Let o = -0.9 - -4.9. Let f = 0.4 + -0.3. Let l = f - -0.1. What is the third biggest value in -0.5, l, o? -0.5 Let a = -3.4 - -3. Suppose -3j - 2 = -5o, -2j + 3 = 2o - j. What is the biggest value in 0.2, o, a? o Let d = -31/84 - -1/12. Suppose 0 = -2i - i + 3. Let x be i/(-5) - (-42)/10. Which is the smallest value? (a) -4 (b) d (c) x a Let d be 4 + 2/((-4)/14). Let n be -2 + (-4)/((-40)/(-306)). Let j = -33 - n. What is the third sma	{ "pile_set_name": "DM Mathematics" }
7598 Let q(j) = 2j2. Let t(o) = o3 - 3o*2 - o - 9. Let v be t(4). Let c(m) = -2m - 2m + 70 + 0m + vm. Give c(q(h)). -2h*2 + 70 Let w(j) = j - 1. Let k(u) = -9u + 6. Let q(p) = -k(p) - 6w(p). Let f(n) = -26n*2. Calculate f(q(h)). -234h*2 Let q(g) = -6g + 310 - 310. Let s(m) = 2m + 2m + 3m - 3m. Let x(w) = -w. Let h(r) = -2s(r) - 7x(r). Determine h(q(d)). 6d Let i(t) = -t - 228676. Let m(k) = k. What is i(m(r))? -r - 228676 Let p(v) = -12v - 30. Let n(f) = f + 3. Let g(t) = 20n(t) + 2p(t). Let l(q) = 3q + 1 - 1. Determine g(l(i)). -12i Let b(l) be the third derivative of 0l + 1/30l*5 - 44l*2 + 0 + 0l*3 + 0l*4. Let w(z) = -4z + 4. Determine b(w(n)). 32n2 - 64n + 32 Let h(c) = 1289993 - 4c - 1289993. Let a(s) = -3s*2 + 5s*2 + 5s*2. What is h(a(u))? -28u*2 Let l(k) = 3k*2 - 80k + 3. Let b(c) = -19c2. What is l(b(i))? 1083i*4 + 1520i*2 + 3 Let k(w) = -62088w. Let r(a) = 2a2. Give k(r(v)). -124176v*2 Let t(v) = -44v - 12. Let l(u) = -42u + 1. Give t(l(q)). 1848q - 56 Let b(s) = 304s - 2. Let v(p) = -114609p + 755. Let z(n) = 755b(n) + 2v(n). Let g(a) = -2a2. What is g(z(w))? -182408w*2 Let v(h) = -16h*2. Let l(w) = -48w - 11. Give v(l(b)). -36864b2 - 16896b - 1936 Let c(r) = 22r2. Suppose 3y = -4a + 22, 0 = -2y + 3a + 9 + 17. Let l(q) = -5 + 2q + 15 - y. Give l(c(f)). 44f2 Let t(o) = 95o*2 + 35o - 35. Let g be (-9)/12 + (-1 - (-294)/8). Let i(b) = -16b2 - 6b + 6. Let q(m) = gi(m) + 6t(m). Let a(d) = -2d. What is a(q(w))? -20w*2 Let h(j) = -2j - 8. Let f(q) = 9q2 + 4q + 15. Give h(f(o)). -18o2 - 8o - 38 Let q(n) = -n*2. Let b be 2 + -5 + 3 + 3. Let m be (0b/12)/1. Let l(f) = mf + 9 - 9 - 7f. Give l(q(r)). 7r2 Let o(j) = -j2. Let g(m) = 197283m*2 - m. Determine g(o(u)). 197283u4 + u2 Let h(g) = -327g. Let s(z) = 6z*2 + 8. Let b(t) = -4t*2 - 5. Let i(o) = 8b(o) + 5s(o). Give h(i(k)). 654k*2 Let q(s) = 28s - 45s + 19s. Let o(i) = -6i2 + 2i - 2. Let g(m) = -m*2 - m + 1. Let n(k) = -4g(k) - 2o(k). What is n(q(v))? 64v*2 Let d(b) = 2b. Let n(h) be the second derivative of 0h4 - 1/60h5 + h2 + 0h3 + 0 + 3h. Let x(f) be the first derivative of n(f). Give d(x(a)). -2a2 Let k(n) = -262n. Let d(v) be the second derivative of -v*3/6 - 578v. Determine k(d(j)). 262j Let m(y) = 3y*2. Let w(b) be the second derivative of -1/3b*3 + 0 + 4b + 0b2. Give w(m(f)). -6f*2 Let p(x) = -9x*2 - 11. Let b be (-10)/4 - 6/4. Let g(t) = 3t*2 + 4. Let z(u) = bp(u) - 11g(u). Let h(o) = 8o*2. Determine h(z(s)). 72s4 Let q(p) be the third derivative of -p5/15 - p*2. Let s(r) be the first derivative of 8 + 0r*2 - 2/3r*3 + 0r. What is q(s(c))? -16c4 Let u(m) = 0m - m + 0m + 2. Let t(l) = 1. Let x(k) = -6t(k) + 3u(k). Let s(g) = -3g. Calculate x(s(y)). 9y Suppose -4a + 2499 = -5x, 6a - 2a - 2x = 2514. Let c(s) = -s + a - 631. Let y(d) = 9d2. Give c(y(h)). -9h*2 Let b(u) = -u. Let s(t) = 65t - 248. Give b(s(a)). -65a + 248 Let h(f) = 10f - 30. Let u(p) = 2. Let k(n) = -2h(n) - 30u(n). Let g(r) be the third derivative of -r*4/24 + 4r*2. Give k(g(s)). 20s Let o(n) be the first derivative of n - 19. Let t(f) = -f - 4. Let l(d) = 4o(d) + t(d). Let h(s) = 6s. Calculate l(h(y)). -6y Let a(o) be the second derivative of 2o*3/3 - 2o. Let t(n) = -n*2 - 4607n + 4607n. Calculate a(t(c)). -4c*2 Let l(c) = 465c - 1. Let v(m) = -72m2. Give l(v(i)). -33480i*2 - 1 Let p(m) = -5697m*2 - 12m + 1. Let d(g) = -2g. What is p(d(h))? -22788h*2 + 24h + 1 Let s(x) = -2x. Let o(i) = -16644i*2 - 2i - 1. Determine o(s(g)). -66576g2 + 4g - 1 Suppose 2x = -3x + 25. Let c(t) = -6t. Let r(s) = 7s. Let h(g) = xr(g) + 6c(g). Let k(y) be the first derivative of -y3/3 + 120. What is k(h(b))? -b2 Let a(r) = 5r2 - 2r*2 + 3r*2. Suppose 5y - 28 = -d - 1, 4d = 3y - 7. Let p(n) = -n*2 + 52n - 52n - nd. Determine a(p(v)). 24v4 Let i(x) = -x2. Let j(w) be the second derivative of -316w3/3 + 85w - 3. Give j(i(n)). 632n2 Let i be (-4)/(-2) + 2 + -1. Suppose -ih = u + 2u, 0 = 3h - 3u - 30. Let j(a) = -10a + 10a + ha*2. Let k(r) = 4r*2. Determine k(j(g)). 100g4 Let n(c) = c2. Let h(l) = 121l + 809. Calculate h(n(j)). 121j*2 + 809 Let b(i) = 0i*2 + 0i*2 + 2i*2. Let p be 7(80/(-35) + 4). Let o(m) = 3m + 0m - pm + 3m. What is o(b(y))? -12y2 Let v(g) = -49g - 2. Let f(d) be the second derivative of -d*4/6 + 470d. Calculate f(v(q)). -4802q2 - 392q - 8 Let p(c) = -20c2 + 36412 - 36412. Let r(s) = -5s*2. Calculate p(r(k)). -500k*4 Let d(b) be the third derivative of -25b*4/24 - 6b2. Let v(o) = -o2 - 4o - 2. Let j(t) = -3t*2 - 14t - 7. Let z(p) = -4j(p) + 14v(p). Give d(z(a)). 50a2 Suppose -24 = -2v - 5d, 10 - 2 = -2v + 3d. Let f be -1 - (-2)/2 - -2. Let p(k) = 5k2 - kf - 3kv. Let u(w) = -14w*2. Calculate p(u(b)). 196b*4 Let u(d) = 33d - 11d + 29d. Let k(g) = 3g. What is k(u(r))? 153r Let k(h) be the first derivative of 14h3/3 + 1. Let u(y) be the first derivative of -2y*3/3 - 379. What is k(u(q))? 56q*4 Let c(z) = 2z2. Let h(y) = y3 + 3y2 - 5y - 4. Let k be h(-4). Let d = 3 + k. Let q(w) = -dw - 5w + w. Determine q(c(i)). -14i2 Let i(s) = -s + 2s - 3s. Let o(p) = -164 + p2 - 4p*2 - 11p*2 + 164. Give o(i(h)). -56h2 Let v(h) be the second derivative of -h4/6 + 346h - 1. Let s(f) = f - 5f - 9f. Determine s(v(d)). 26d*2 Let m(a) = 9a. Let g(w) = 33330w. Calculate g(m(z)). 299970z Let z(j) = -7811j2. Let f(w) = -94w*2. What is z(f(m))? -69017996m*4 Let g(o) = 3o - 523. Let j(d) = -1243d2. Give g(j(a)). -3729a2 - 523 Let d(j) = -j2 - j2 - j2. Let w(p) = -90 - 78 - 21p - 87 + 255. What is w(d(t))? 63t*2 Let n(p) = 16p. Let b(s) = -13519s. Determine b(n(y)). -216304y Let j(w) be the first derivative of -1193w3/3 + 142. Let h(u) = -u2. Calculate h(j(f)). -1423249f*4 Suppose 0 = -5b + 44 - 9. Let y(k) = -k + 3k + k - bk. Let o(i) = -i*2. Determine o(y(n)). -16n*2 Let w(f) = -7f. Let v(u) = 5310u2. Calculate w(v(i)). -37170i*2 Let k(i) = -2i. Let u be (49 + -43 - 16)/(-4). Let t(v) be the third derivative of 0v*3 + u + 0v*4 + 0v + 10v2 + 3/10v*5. Give t(k(n)). 72n*2 Let t(v) = 6v*2. Suppose -12m + 16m - 12 = 0. Let n(i) = 6i + 9 + m - 12. Determine t(n(j)). 216j2 Let r(n) = 2n. Let p(o) = -14o - 3. Let w(x) = -x3 + 5x*2 + 2x - 7. Let z be w(5). Let t(g) = 27g + 5. Let s(l) = zt(l) + 5p(l). What is r(s(b))? 22b Let f(i) = 22i + i - 4545 + 4545. Let c(t) = -4t. Give f(c(a)). -92a Let w(u) be the second derivative of -u3/6 + 2u. Let s(x) = 2x2 + 3x + 3. Let d be s(-2). Let g(i) = i - di + 2i*2 + 4i. Calculate g(w(z)). 2z2 Let t(h) = -90 - 80 + 251 - 83 + 16h. Let z(u) = -12u. Calculate t(z(v)). -192v - 2 Let n(q) = 7q2 + 8q*2 - 19q*2. Let k(l) be the second derivative of 5l*3/6 + 8l. What is n(k(s))? -100s2 Let k(b) = -16b. Let l(u) be the second derivative of 1/3u4 + 0u*3 - 5 + 0u*2 + 3u. Give k(l(q)). -64q2 Let m(o) = 2o. Let n(j) be the third derivative of j*4/12 - 20j*3/3 - 241j*2. Give n(m(i)). 4i - 40 Let o(b) be the first derivative of 2b3/3 - 166. Let p(g) = -88g*2 + 2. What is p(o(y))? -352y*4 + 2 Let u(j) = -128j*2. Let p(l) = 9l*2 - 15l*2 + 0l*2 + 8l*2. Give u(p(w)). -512w*4 Let x(d) = 2d*2. Let u be 16/20(-35)/(-2). Let s(y) = y*2 - 14y + 2. Let m be s(u). Let r(k) = 2k2 - k2 - 3k*2 - 7k*m. Determine r(x(g)). -36g*4 Let x(n) = 287n - 7. Let p(c) = 95c - 2. Let m(w) = 14p(w) - 4x(w). Let s(r) = r2. Determine m(s(a)). 182a*2 Let s(p) = 3p. Let b be (-34)/6 - 1/3. Let r(l) = -l*3 - 5l*2 + 6l + 3. Let t be r(b). Let z(i) = -ti - 10i + 10i. Calculate s(z(g)). -9g Let q(o) be the first derivative of o*2 - 50o - 442. Let b(f) = 5f. Give q(b(u)). 10u - 50 Let k(s) = 25s2. Let g(z) = 3z - 5. Let f(y) = -2y + 6. Let b(x) = 5f(x) + 6g(x). What is k(b(t))? 1600t*2 Let o(q) = -72q*2. Let f(n) = 76n. Give o(f(v)). -415872v*2 Let o(q) = 34	{ "pile_set_name": "DM Mathematics" }
t f(o) = o*2. Give f(y(h)). 49h*4 Let g(a) = -16a - 8a - 15a - 30 + 40a. Let b(h) = -3h. What is g(b(u))? -3u - 30 Let n(p) be the third derivative of p7/420 - 7p*4/24 - 3p*2. Let z(f) be the second derivative of n(f). Let v(w) = -w. Determine z(v(a)). 6a*2 Let i(m) = 25m. Let d(r) = -r*2 - 2. Suppose 5u = -5j - 35, 8 = -2j + u - 6. Let g(z) = 3z2 + 7. Let b(t) = jd(t) - 2g(t). Give b(i(a)). 625a*2 Let h(r) = 16r2. Let t(n) be the second derivative of -n4/12 - 76n. Determine t(h(o)). -256o*4 Let k(f) = 4f*2 - 12f. Let g(b) = -215b. What is g(k(h))? -860h*2 + 2580h Let k(s) = -2s. Let c(z) = z2 + 363z + 16. Calculate c(k(m)). 4m2 - 726m + 16 Let j(q) = -3q2 - 9q. Let x(t) = 58908t. Give j(x(z)). -10410457392z*2 - 530172z Let t be (20/(-3))/((-26)/39). Let p(g) = 10 - 6g - t. Let y(f) = f2. Give y(p(n)). 36n*2 Let f be (-3 - (3 - -3))/(-1). Let i(y) = 3 + 6 - f + 13y. Let a(p) = 2p2. Give a(i(z)). 338z*2 Let s(a) = -2a*2. Let q be 3 + 2/4-2. Let m(y) = 2 + 2y2 + 3y*2 - q. Give s(m(z)). -50z4 Let f(d) be the first derivative of d2 + 21. Let w(t) be the third derivative of 9t4/8 - 2t*2. Calculate w(f(u)). 54u Let v(f) = 3f2 - 24. Let i(l) = -23l*2. Determine v(i(j)). 1587j*4 - 24 Let h(v) = 2v*2. Let d = 41 - 25. Let p = d + -9. Let t(l) = -60l - pl2 + 60l. Determine h(t(x)). 98x4 Let l(p) = 13p - 2. Let x(w) = 66w - 11. Let o(v) = 11l(v) - 2x(v). Let c be -2((-2270)/(-4))/(-5). Let n(t) = 2t2 - ct + 227t. Calculate o(n(q)). 22q*2 Let n(h) = -5h. Let t(o) be the second derivative of 13o3 + 7o + 5. What is n(t(f))? -390f Let b(c) = 25 + 4c*2 - 78 + 53. Let w(x) = -3x*2 + 7x. What is b(w(y))? 36y4 - 168y*3 + 196y*2 Let l(y) be the first derivative of -14 + 1/3y*3 + 0y + 0y2. Let j(u) = u2. What is j(l(v))? v4 Let q(z) = -295z. Let b(m) = 4m2 - 11m. Give q(b(n)). -1180n2 + 3245n Let a(y) = 17 - 12 + 11y - 9y - 5. Let i(s) = -1 + 1 + 4s. Give i(a(v)). 8v Suppose 2f = 5x - 22, 3x + f - 6 = 5. Let k(o) = o3 + 7o*2 - 9o - 5. Let n be k(-8). Let p(a) = -xa - a + na. Let j(y) = 3y2. Give j(p(d)). 12d*2 Let f(w) = -1803w. Let s(b) = -43b. What is f(s(l))? 77529l Let d(c) be the third derivative of c*4/8 - 797c*2. Let g(s) be the first derivative of 7s*2/2 - 1. Give g(d(q)). 21q Let k(s) = -4s2. Let a(g) = g - 1. Suppose 1 = -z - 5. Let f(b) = 4b - 6. Let u(h) = za(h) + f(h). Give u(k(d)). 8d*2 Let z(t) be the first derivative of -2t*3/3 - 35. Let w(k) = 2k*2. Let x(q) = 4w(q) + 5z(q). Let c(l) = -21l. Determine c(x(o)). 42o2 Let i(g) = 8g*2 + 11. Let t(m) = 29m*2. Determine i(t(b)). 6728b*4 + 11 Let q(a) = -124a*2. Let m(u) = 29u - 24u + 0u. Determine m(q(w)). -620w2 Let y(a) = -9962a*2. Let o(j) = 7j. Give y(o(u)). -488138u2 Let h(p) = 6p*2. Let q(s) = -810s*2 - 19 + 811s*2 + 30. What is h(q(x))? 6x*4 + 132x*2 + 726 Let t(a) = 12a. Let p(f) be the second derivative of -2f4 + f2/2 - 32f + 3. Calculate t(p(h)). -288h2 + 12 Let x(t) be the first derivative of -t3 + 1. Let b(g) = 133g*2 - 38g. Let u(a) = 22a2 - 6a. Let d(q) = 3b(q) - 19u(q). Calculate x(d(w)). -1083w4 Let y(j) = -j2. Let u(f) = -10 - 5 - 32f + 28f. Give u(y(n)). 4n*2 - 15 Let c(s) = 13s. Let z(m) = 18145m2. What is c(z(p))? 235885p*2 Let c(r) = 16r*2. Let y(b) = -4402b*2. Determine y(c(f)). -1126912f*4 Let q(l) = 2l. Let o(t) = -6678t + 15. Calculate q(o(i)). -13356i + 30 Let x(a) = 1361929a. Let k(h) = -2h. Give x(k(l)). -2723858l Let w(g) be the first derivative of 17g*2/2 + 3g + 608. Let c(q) = 2q2 - 2q + 2q. Determine c(w(u)). 578u*2 + 204u + 18 Let h(s) = 21s2. Let k(g) = 6g*2 - 3g + 7. Determine k(h(x)). 2646x4 - 63x*2 + 7 Let i(p) = 356p*2. Let l(u) = -3419u. Calculate i(l(b)). 4161483716b2 Let q(h) = 72h*2. Let a(m) = m + 7m - 9m + 0m. Determine a(q(g)). -72g2 Let l(m) = 5 - 8 - 3m + 2 + 1. Let x(q) = 6q - 8. Calculate l(x(h)). -18h + 24 Let a(x) = -5x. Let c(k) be the third derivative of -89k*4/24 + 2k*2 + 14k. Determine a(c(r)). 445r Let i be (-20)/90 + 58/18. Let b(v) = 274v*2 + 3v - iv - 286v*2. Let r(f) = f. Determine b(r(j)). -12j2 Let m(h) = h2. Let o(t) = 643791t2. Give m(o(n)). 414466851681n*4 Let b(l) = 409l*2. Let p(m) = 4m + 13. What is p(b(i))? 1636i2 + 13 Let p(t) = 61t*2 + 57t*2 - 119t*2. Let h(i) = -20i. Give p(h(a)). -400a2 Let r(d) = 2d*2 - 2d - 1023. Let o(t) = 4t2. Determine r(o(l)). 32l*4 - 8l*2 - 1023 Let d(v) = 158v + 30. Let c(g) = -g*2. Give c(d(x)). -24964x*2 - 9480x - 900 Let f be 1 + (4 - 1) + 0. Let u(q) = -fq + 2q + 0q. Let c(k) = 3k. What is u(c(z))? -6z Let m(i) = -2i*2 + 227i + 1. Let a(w) = -9w2. What is m(a(o))? -162o*4 - 2043o*2 + 1 Let h(q) = q. Let t(y) = -70055y. Calculate t(h(w)). -70055w Let b(x) = -28x*2. Let w(k) = 588k - 5. Calculate b(w(c)). -9680832c2 + 164640c - 700 Suppose 3c = -r + 23, -3r - 3c = -34 - 5. Let m = r + -5. Let l(j) = mj*2 - 8j*2 + 3j*2. Let h(n) = -2n*2. Calculate l(h(x)). -8x*4 Let l(r) = -5r. Let t(d) be the second derivative of -5d4/24 - 17d*2/2 + 18d. Let b(y) be the first derivative of t(y). Give l(b(n)). 25n Let g(l) = 6l + 80. Let v(j) be the third derivative of -j*5/30 + 382j*2. What is g(v(x))? -12x*2 + 80 Let b(n) = -17n + 1. Let h(y) = y. Let t(g) = -2g2 - g. Let x(l) = h(l) + t(l). What is x(b(j))? -578j*2 + 68j - 2 Let b(o) = -3o2 - 43o. Let z(m) = -4854m + 4852m + 0 + 0. Determine b(z(f)). -12f2 + 86f Let t(y) be the third derivative of 0 + 0y - 1/3y*4 + 16y*2 + 0y*3. Let z(i) = 6i. Determine z(t(q)). -48q Let o(f) = -82f2 + f. Let r(j) be the first derivative of j2/2 + 567. Determine o(r(c)). -82c2 + c Let t(s) = -s2. Let y(n) = -1296n. What is y(t(p))? 1296p2 Let m(j) = 209j*2. Let y(n) = 345n. Give m(y(f)). 24876225f2 Let f(a) = -4a. Suppose 73 - 101 = -7b. Let w(v) be the second derivative of bv + 0v2 + 1/4v*4 + 0 + 0v*3. Calculate f(w(m)). -12m*2 Let k(z) = -5z. Let x(y) be the second derivative of y*3/3 + 37y*2 + 221y. What is x(k(l))? -10l + 74 Let g(r) = -765r*2. Let k(t) be the first derivative of -2t*3/3 + 1102. Determine k(g(u)). -1170450u*4 Let a(u) = 2u2. Let h(x) be the first derivative of x2/2 - 2x - 52. What is h(a(g))? 2g*2 - 2 Let r(h) be the second derivative of -11h*4/24 - 3h*2/2 + 28h. Let z(x) be the first derivative of r(x). Let p(a) = a*2. Give p(z(y)). 121y*2 Let g(t) = 28t. Let a(h) be the second derivative of h*3/3 - 37h. Let r(n) = -60a(n) + 5g(n). Let j(w) = -2w2. Give j(r(s)). -800s*2 Let y(u) = -357u. Let p(f) = 806f2. Give p(y(c)). 102723894c*2 Suppose -3q = 7 + 5. Let m be (-2 - (-11)/q)-8. Let b(u) = 19 + 19 - 2u - m. Let t(l) = 9l. Determine t(b(g)). -18g Let x(a) = 1702a. Let k(h) = 5h*2. What is x(k(y))? 8510y2 Let j(y) = -y2. Let z = -170 - -47. Let w(v) = -39v2 - 2v - 2. Let q(c) = -2378c2 - 123c - 123. Let l(x) = zw(x) + 2q(x). Calculate l(j(f)). 41f4 Suppose 0k - 14 = -2k + 4w, -k = 4w + 11. Let t(d) = k + 4d - 5d - 1. Let n(q) = -29q. Calculate t(n(j)). 29j Let k(z) = -631z - 1787. Let q(s) = s. Give q(k(f)). -631f - 1787 Let l(z) = -12z*2 - 18. Let p(v) = 6v*2 + 8. Let i(k) = -4l(k) - 9p(k). Let r(o) = -29o. Calculate r(i(t)). 174t2 Let y(k) = 1454 + 44k*2 - 47k*2 - 1454. Let q(g) = -57g*2 - g. What is q(y(o))? -513o*4 + 3o*2 Let k(a) = -225a*2. Let q(b) = 805b - 1. Determine q(k(g)). -181125g2 - 1 Suppose -2j + 27 = -j - 5d, 0 = -j + 2d + 12. Let z(f) = -1 + 19fj + 1 - 2f*2. Let u(h) = 2h. Determine u(z(i)). 34i2 Let l(a) = 13 + a2 - 13. Let r(c) = -1 - 8c*2 - 1 + 13c*2. Give r(l(h)). 5h4 - 2 Let d(s) be the third derivative of s4/8 - 2s2. Let c(u) be the third derivative of 0u + 3u2 + 1/12u*4 + 0u*3 + 0. Calculate d(c(x)). 6x Let h = -2 + 9. Let f = h + -2. Let k(b) = 3b - fb + 7b. Let m(c) = c. Give k(m(o)). 5o Let q(n) = -52*n + 4. Let b(s) = 4	{ "pile_set_name": "DM Mathematics" }
= -r + 4, 0y - y + 17 = 2r. What is the units digit of y? 9 Let x be 2/11 + 60/33. Let k(f) = 14f - xf - f*2 - 5 - 1 + 0. What is the units digit of k(9)? 1 Let s be (-4)/(-6)(11 - 2). Let l(x) = x*2 - 7x + 9. Let f be l(s). Suppose 0 = -4h + 5v + 13, 3h + 2v - 1 - f = 0. What is the units digit of h? 2 Let x(n) = -1 + 3n - 1 - 4n. Let p be x(-5). Suppose -k - p + 8 = 0. What is the units digit of k? 5 Let t(i) = i3 - i - 2. Let w(l) = l2 - 8l + 9. Suppose 0a - 16 = -4a, -r + 5a = 13. Let v be w(r). What is the units digit of t(v)? 4 Suppose -2 = s - 4. Let g(u) = -2 - 2us + u2 + 10. What is the units digit of g(0)? 8 Let g(o) = o2 - 10o + 17. Let z be g(14). Let v = 111 - z. What is the units digit of v? 8 Let z = 11 + -6. Suppose 0 = -4s - 5d - 23, 0 = -zd - 10 - 5. What is the units digit of (-36)/(-15) - s/(-5)? 2 What is the units digit of ((-10)/4)/((-5)/12)? 6 Let v = 81 - 26. What is the units digit of v? 5 Let i = 18 + -13. Let g be i/(-2) - (-1)/(-2). What is the units digit of (g - -2)/1 + 7? 6 Suppose 0 = i - 2i + 12. Suppose a - i = -3a. What is the units digit of a? 3 Let g(r) = r2 + 9r - 9. Let j(x) = -2x2 - 8x + 9. Let q(p) = 3g(p) + 2j(p). What is the tens digit of q(6)? 2 Suppose 4j = 16, -6v + 2j + 17 = -v. Suppose 0 = 5l - 0c - 2c - 193, vl = -4c + 169. What is the tens digit of l? 3 Let o be 8(9/(-6))/(-3). Suppose -2m = 2y + 2, -oy = -0m + 2m - 4. What is the units digit of (-3 - -1)/m12? 6 Suppose -4z = -38 - 70. What is the units digit of -1 + -1 + z + 5? 0 Suppose q - 12 = 5p + 14, -2q - p = -85. What is the tens digit of q? 4 Suppose -5v + 441 = -209. Suppose -5k = 5u - v, -4u - 2k + 100 = -0k. Suppose -2s - s = o - 18, -o = 4s - u. What is the units digit of s? 6 Let o(c) = -c*3 - 7c*2 - 8c - 8. Let u be o(-6). Suppose -ug - 6 = -26. What is the units digit of g? 5 Let d(h) = -4h - 1. Let q be d(-1). Suppose 0g = g + q. Let x(w) = -6w - 3. What is the tens digit of x(g)? 1 Let j(r) = r*2 - r - 4. Let s be j(-3). Let b be (-42)/(-2) + (s - 5). Let v = b + -9. What is the tens digit of v? 1 Let i = 93 - 49. What is the units digit of i? 4 Suppose 5b = 4w + 9, 0b - 33 = -2w - 5b. Suppose -wi + 0i - 20 = 0. Let s = 7 + i. What is the units digit of s? 2 Let d be (-1 - -2)/(3/9). Let s be 4/(d/6 - 0). What is the units digit of (-11)/(-9) + s/(-36)? 1 Let x be 15 - (2 + 1 + -2). Suppose 4a - x = 30. Suppose 4z - 41 = a. What is the tens digit of z? 1 Suppose 0k + 2k - 2 = 0. What is the units digit of k? 1 Let n(g) = 4g3 - 4g*2 + 2g. Let z be n(2). Let j = z + -5. What is the units digit of j? 5 Suppose 4d + 32 = 4f, -7f + 3f = 5d - 5. Let i(g) = 2g + 4. Let p be i(-4). Let k = f + p. What is the units digit of k? 1 Let w = -9 - -16. What is the units digit of w? 7 Let x(k) = -k*2 + k + 5. Suppose -2l + 0l + 26 = 2u, -3l + 36 = 2u. Suppose lv - 5v = 0. What is the units digit of x(v)? 5 Let s = 60 - 43. What is the units digit of s? 7 Let k(n) = n*3 - 3n*2 + 2n + 1. Let w = 0 - -2. What is the units digit of k(w)? 1 Let g(p) = 2p2 - 4p + 5. Let u(h) = 4h3 - h + 1. Let d be u(1). What is the tens digit of g(d)? 2 Suppose -5h + 38 + 22 = 0. Suppose i - h = 11. What is the units digit of i? 3 Let o = -8 - -8. Suppose 5t - 3x - 83 = o, -4x + 0x = -4t + 68. What is the tens digit of t? 1 Suppose r - 5l + 70 = 6r, -10 = 5l. What is the units digit of r? 6 Suppose z + 0z - 15 = 0. Suppose 0 = 3f - 39 - z. What is the units digit of f? 8 Suppose 0r = -3r + 24. Let v be (r - 4) + -12. Suppose vk = 6k - 8. What is the units digit of k? 2 Suppose -4g + 2485 = -971. What is the tens digit of 2/(-10) - g/(-45)? 1 Suppose 4k = 11 + 9. Suppose 4j = -ks + 17 + 13, 5s + 20 = j. What is the tens digit of j? 1 Suppose 22m = 24m - 222. What is the hundreds digit of m? 1 Let x = 5 + 17. Let m = -14 + x. What is the units digit of m? 8 Suppose 5s = -h - 2h - 166, 5h + 281 = -4s. Let o = 2 - h. What is the units digit of o? 9 What is the units digit of 39 + (-4)/((-12)/(-9))? 6 Let k(f) = -f + 7. Let m be 15/(-3)(-1)/1. Let p be k(m). Suppose 2b - 12 = -2y, -3y + 0 = -b - p. What is the units digit of b? 4 Let p(w) = -10 + 9w + 1 - w2 + w. Let l be p(9). Suppose 4i - 3t - 40 = l, -3i + 4 = 4t - 1. What is the units digit of i? 7 Suppose 3g = -2g. Suppose 0 = -d + 6 - g. What is the units digit of d? 6 Let x(z) = -9z + 5. What is the units digit of x(-3)? 2 Let z = 3 - 3. Let h be ((-9)/3)/((-6)/10). Let a = h - z. What is the units digit of a? 5 Let l be ((-18)/(-10))/(13/585). Let x = l - 36. What is the units digit of x? 5 Let n = 61 + 229. What is the tens digit of n? 9 Suppose -3 = b, 5c = -4b - b - 10. Let p = 1 + c. Suppose 4f + py = 36, 3y = 7 + 5. What is the units digit of f? 7 Let l(z) = -z - 5. Let t be l(-7). What is the units digit of 1/(t/(-4)-2)? 1 Let s = -3 + 9. What is the units digit of (-15)/s(-6)/5? 3 Suppose 4u + 5k - 119 = 0, -2u = u + k - 92. Let d = u - 21. What is the tens digit of d? 1 What is the units digit of (-8)/2(-10)/8 + 3? 8 Suppose 5z - x = -145, z - 5z + x - 115 = 0. What is the units digit of (-144)/z(7 - 2)? 4 Suppose k = -3k + 96. What is the units digit of (7/(14/k))/1? 2 Suppose 5u = 8u - 9. Suppose 0 = uw + 34 - 112. What is the tens digit of w? 2 Let r = -1 - -72. What is the tens digit of r? 7 Suppose -5q - 10 = -0. Suppose 0 = -h - 4. Let r = q - h. What is the units digit of r? 2 Suppose m = -4z + 30, 0 = 3z - 0z - 5m - 34. What is the units digit of (2/3)/(z/12)? 1 Let a(b) = 2b*2 + 8b + 5. Suppose -4w - 33 = 6x - x, 5w - 10 = 4x. What is the units digit of a(x)? 5 Suppose -48w + 37w = -3795. What is the units digit of w? 5 What is the tens digit of 21 + (-3 + 1 + 0 - -1)? 2 Suppose -3d + 0d + 15 = 0. Suppose -4i = a + 2, -da + 3i = -i - 62. What is the tens digit of a? 1 Let t = 305 - 207. What is the tens digit of t? 9 Suppose 3z + 3 - 5 = -4j, -6 = -4z - 2j. Suppose zp = 8, -20 = -3g + 5p - 10p. Suppose -t - 2t + 3 = g. What is the units digit of t? 1 What is the units digit of -2 - ((-5 - -3) + -146)? 6 Let v(u) = 6u2 + 4u - 3. What is the units digit of v(3)? 3 Let n = 1170 + -803. What is the tens digit of n? 6 Suppose 26 - 10 = 4x. Suppose xn = -43 + 115. What is the tens digit of n? 1 Let c(d) = d*3 + 2d2 + d + 1. Let a(w) = -w3 + w. Let y(b) = -2a(b) - c(b). Let o be y(-2). Let m = o - -26. What is the units digit of m? 5 Suppose 0g - 3g - 5f = 5, -36 = -4g + 4f. What is the units digit of g? 5 Suppose 4w - 191 = 3j, -5w - 4j + 231 = -0j. What is the units digit of w? 7 Let m(d) = 7d*2 + d. Let z be m(-1). What is the units digit of (-2 - z/(-8))-4? 5 Let f(o) be the second derivative of 7o4/12 - o3/6 - o. What is the units digit of f(1)? 6 Let j(w) = -w3 - w + 7. What is the units digit of j(0)? 7 Let u(f) = -92f - 22. What is the hundreds digit of u(-3)? 2 Let b = 25 - 12. Suppose b = w - 2x - 3, -52 = -4w + 5x. What is the units digit of w? 8 Let b be 3/(-12) + (-39)/(-12). Suppose 2l + 58 = bx, -2x - l + 26 + 15 = 0. What is the tens digit of x? 2 Suppose -l + 3y = 2l - 189, 0 = -3l - 2y + 184. Let z = l - 44. What is the units digit of z? 8 Suppose 38 = 2d + h, 2d - 72 = -3h - 30. Suppose 5o - d = 137. What is the tens digit of o? 3 Suppose -5p - 5z = -10, 9 = -4p + z + 22. Suppose ph + 27 = 3b, -4h + 70 + 6 = 4b. Suppose 0q = 2q - b. What is the units digit of q? 7 Suppose 3b = -4q - 56, 4q - 19 = 3b + 45. Let o = b - -12. What is the units digit of ((-4)/o)/((-1)/(-2))? 1 Suppose 0 = -2v + 3v - 32. What is the tens digit of v? 3 Let x be (29 + 1)/(1 - 2). Let l = -17 - x. What is the tens digit of l? 1 Let f = 68 - 138. Let o = 99 + f. What is the units digit of o? 9 Suppose -n + 6 + 0 = 0. Let s be 13/5 + n/15. Suppose -5u + 5l = -6 - 9, 39 = 3u + sl. What is the units digit of u? 8 Let w = -3 - -3. Suppose 4i - 2i = w. Suppose i = 2x - 14 - 16. What is the tens digit of x? 1 Let j(t) = 2t3 - 2t*2 + t. Let v be j(1). What is the units digit of v-35/(-3)? 5 Let f(u) = u - 2u + 4 - 3 + 4u2 - 5	{ "pile_set_name": "DM Mathematics" }
6))/(sqrt(432)2 + sqrt(3)))2. 68/625 Simplify -5 + (-1sqrt(192)-3)2. 1723 Simplify (sqrt(70)/((sqrt(50) + sqrt(800))/sqrt(5)))2. 7/25 Simplify ((sqrt(5) - (sqrt(180) - (0 + sqrt(180)) - sqrt(5))) + sqrt(5) + 1)22. 12sqrt(5) + 92 Simplify ((sqrt(220)/sqrt(4))/sqrt(11))2 + (sqrt(140)/sqrt(4))/sqrt(7). sqrt(5) + 5 Simplify -3 + sqrt(704) + sqrt(704) + -1. -4 + 16sqrt(11) Simplify (13(sqrt(847) - (-1 + sqrt(847))))*2. 9 Simplify 0 + sqrt(78)/(sqrt(12)/sqrt(2)). sqrt(13) Simplify (sqrt(9)/sqrt(3) + sqrt(3) - sqrt(3))-4 + (sqrt(3) - sqrt(3)-2-4)*2. -4sqrt(3) + 147 Simplify 2sqrt(125)-5 - (sqrt(125) + sqrt(125) + 2 + -2)*2. -500 - 50sqrt(5) Simplify (-2 + sqrt(35)/sqrt(125) + sqrt(7))*2. -24sqrt(7)/5 + 352/25 Simplify (3 + sqrt(98) + -1 + sqrt(98) + sqrt(98) + -2 + 1sqrt(98))2. 1568 Simplify 6(-1 + sqrt(500)). -6 + 60sqrt(5) Simplify -3 + sqrt(44) + (sqrt(11) + -1)-5. -3sqrt(11) + 2 Simplify (sqrt(60)/(sqrt(12) + -1sqrt(588) + sqrt(12))1)2. 1/5 Simplify sqrt(3) + -1 + sqrt(27) - (sqrt(27) + -2). 1 + sqrt(3) Simplify (5 + (sqrt(2057) - (1 + (sqrt(2057) + sqrt(2057) + -1)2)))2. -16450 + 110sqrt(17) Simplify (2sqrt(252)6)2. 36288 Simplify ((1 + sqrt(2057))3 + sqrt(2057))-2. -88sqrt(17) - 6 Simplify (sqrt(24)/(sqrt(128)1))2. 3/16 Simplify (-1(5 + -1sqrt(1573)))2. -110sqrt(13) + 1598 Simplify (2sqrt(6655))/(sqrt(55)/(-1sqrt(11))). -22sqrt(11) Simplify -3 + (-21sqrt(243))2. 969 Simplify sqrt(72)23 + sqrt(72). 42sqrt(2) Simplify ((1sqrt(4752))/((sqrt(60)/sqrt(4))/sqrt(5)))2. 1584 Simplify sqrt(2592) + sqrt(2)5-1. 31sqrt(2) Simplify 1 + -4(sqrt(208) + -2). -16sqrt(13) + 9 Simplify -2 + (sqrt(13) + sqrt(1872) + -1)*2 - ((sqrt(130) + sqrt(130)-2)6)/sqrt(10). -20sqrt(13) + 2196 Simplify (sqrt(5) + sqrt(45)/(sqrt(36)/sqrt(4)))*2 - (-5sqrt(45))*2. -1105 Simplify (sqrt(19) - sqrt(304)) + 2 - (sqrt(19)3 + 0). -6sqrt(19) + 2 Simplify (((sqrt(104) + (sqrt(104) - (sqrt(104) - (sqrt(104) + -1sqrt(104) + sqrt(104)))))-5)/sqrt(8))25. 6500 Simplify (-4 + (44(sqrt(17) + -1))*2)4. -2048sqrt(17) + 18416 Simplify -1 + sqrt(1300)-24. -80sqrt(13) - 1 Simplify sqrt(432)-1 + -4. -12sqrt(3) - 4 Simplify sqrt(25)/(-54sqrt(5)). -sqrt(5)/20 Simplify -6(sqrt(121) - -1sqrt(121))/sqrt(11). -12sqrt(11) Simplify (-2 + (sqrt(192) + 1sqrt(192) - sqrt(192)) + sqrt(192))*2. -64sqrt(3) + 772 Simplify -3 + sqrt(7) + -2 - (sqrt(847) + 3)*2. -861 - 65sqrt(7) Simplify ((sqrt(3888) + sqrt(3888) + (sqrt(3888) - (sqrt(3888) + 0)))3 - sqrt(3888))2-2. -194400 Simplify (sqrt(171))*26 - (sqrt(399)/sqrt(7))/sqrt(3). -sqrt(19) + 1026 Simplify (-3 + (3sqrt(27) - sqrt(3)))2. -48sqrt(3) + 201 Simplify (0 + sqrt(1872) + -2 - (0 + sqrt(1872) + 1))*2-2. -18 Simplify -6((sqrt(3) + 0)2 + -4) + 4. 10 Simplify sqrt(192)24 + -4. -4 + 64sqrt(3) Simplify (sqrt(140)/sqrt(7) + sqrt(5) + sqrt(35)/sqrt(63))6. 20sqrt(5) Simplify (sqrt(80)/sqrt(4))*26. 120 Simplify 2 + sqrt(3) + (sqrt(108))*2 + 5. sqrt(3) + 115 Simplify (sqrt(102) + (sqrt(102) - ((sqrt(102) + -2sqrt(102) - sqrt(102))2 + sqrt(102))))/((sqrt(48)-2)/sqrt(8)). -5sqrt(17)/2 Simplify ((sqrt(66) - sqrt(66)-1 - sqrt(66))-6)/(2sqrt(600)). -3sqrt(11)/10 Simplify 0 + (sqrt(11) + sqrt(44) + 0)2. 99 Simplify 0 + (sqrt(288) - (-1 + sqrt(288) - sqrt(288)))2 + -5 + (sqrt(288) - (-1 + sqrt(288))) + sqrt(288) + sqrt(288). 48sqrt(2) + 285 Simplify (sqrt(300)/(sqrt(30)/sqrt(3)))/(1sqrt(294) + sqrt(294) - sqrt(6)). sqrt(5)/13 Simplify 2(0 + sqrt(252)) + (2sqrt(252))22. 12sqrt(7) + 2016 Simplify ((1sqrt(216) + sqrt(216) + sqrt(216))/sqrt(12))/sqrt(6). 3sqrt(3) Simplify (sqrt(76)-3)*2-2. -1368 Simplify (5sqrt(15)/sqrt(3) - sqrt(5))2 + (-3(0 + sqrt(5)) - sqrt(5)) - sqrt(20)/(2sqrt(4))-6. -sqrt(5) + 80 Simplify 5(-2sqrt(27))*2-3. -1620 Simplify ((sqrt(3) + -2)-4 + sqrt(81)/sqrt(3))2. -16sqrt(3) + 67 Simplify (((sqrt(119) - sqrt(119)-2)-2)/(sqrt(7) + 2sqrt(7)4))*2. 68/9 Simplify (sqrt(45)/(sqrt(3)-1 - sqrt(3)))/((sqrt(15) - sqrt(135))/sqrt(5)). sqrt(5)/4 Simplify (4 + (sqrt(1872) - 3(sqrt(1872) + (sqrt(1872)4 - sqrt(1872) - sqrt(1872)))))*2. -768sqrt(13) + 119824 Simplify sqrt(891)44. 144sqrt(11) Simplify (sqrt(72) + -3)2 - (sqrt(2) - (-4 + sqrt(8)/sqrt(4))). -36sqrt(2) + 77 Simplify (-3(sqrt(108)-2 - (sqrt(3) - (sqrt(363) + -1))))*2. 36sqrt(3) + 117 Simplify sqrt(320)1 - (1 + sqrt(605))2. -606 - 14sqrt(5) Simplify 2(-4 + sqrt(17) + sqrt(17)3). -8 + 8sqrt(17) Simplify 4(sqrt(168)/sqrt(8)1)/sqrt(3). 4sqrt(7) Simplify (3sqrt(3500) - sqrt(3500))/(sqrt(5) - (sqrt(5) - (sqrt(5) + sqrt(80)3))). 20sqrt(7)/13 Simplify ((sqrt(200) + -1)2 - sqrt(200)) + 2. -30sqrt(2) + 203 Simplify (sqrt(104) - (sqrt(104) + (2sqrt(104) + sqrt(104))2 + sqrt(104)))/(sqrt(392)-2). sqrt(13)/2 Simplify (sqrt(99) + (sqrt(99) - -1((sqrt(99) - 1sqrt(99)) + sqrt(99) - sqrt(99))))/sqrt(9). 2sqrt(11) Simplify (sqrt(19) - sqrt(171))-24. 16sqrt(19) Simplify -5 + sqrt(1700)-2. -20sqrt(17) - 5 Simplify ((-2sqrt(77)1)/(sqrt(704) - 2sqrt(704))2)2. 7/4 Simplify (sqrt(11) - (sqrt(11) - 4(1 + sqrt(11)))) + 0 + 0 + 2. 6 + 4sqrt(11) Simplify (0 + -3 + sqrt(500))2 + 0. -60sqrt(5) + 509 Simplify (sqrt(110)/(sqrt(10) + sqrt(20)/sqrt(2)) + sqrt(11))2 + (sqrt(1331) + -1)2. -22sqrt(11) + 5427/4 Simplify ((-6-2sqrt(70))/(sqrt(40)/sqrt(4)-4))*2. 63 Simplify 5sqrt(60)/(sqrt(60)/sqrt(5)). 5sqrt(5) Simplify 3 + (-2sqrt(132)3)/(-2sqrt(768)). 3sqrt(11)/8 + 3 Simplify (-1((sqrt(5) - sqrt(5)1) + 2) + -2)2. 16 Simplify sqrt(49)/(sqrt(49)/(sqrt(7) - (sqrt(7) + (sqrt(7) - (sqrt(7) + (sqrt(7) - (sqrt(7) + sqrt(175)))))))). -5sqrt(7) Simplify (-4sqrt(99)-2)/((-2sqrt(72))/sqrt(8)). -4sqrt(11) Simplify 5 + sqrt(36)/sqrt(2) + 5. 3sqrt(2) + 10 Simplify 4 + (5 + -2sqrt(2057))*2. -220sqrt(17) + 8257 Simplify ((sqrt(2736) + 3 + sqrt(2736))6)2. 5184sqrt(19) + 394308 Simplify sqrt(35)/(sqrt(10)/sqrt(2)) + (sqrt(7) + -5sqrt(63) + sqrt(7))2. sqrt(7) + 1183 Simplify (sqrt(117)/(sqrt(9) + sqrt(144) + sqrt(9))-5 - (-3 + (sqrt(65)/(sqrt(20)/sqrt(4)) - sqrt(13))))*2. -5sqrt(13) + 649/36 Simplify sqrt(19) - (sqrt(57)/sqrt(12))*2 - (sqrt(1900)2)*2. -30419/4 + sqrt(19) Simplify ((-5sqrt(60)1)/(3sqrt(36)/sqrt(3)))*2. 125/9 Simplify (sqrt(8) - (1sqrt(56))/sqrt(7))/sqrt(4). 0 Simplify (sqrt(11) - sqrt(66)/sqrt(24))4. 2sqrt(11) Simplify ((sqrt(153) - 2sqrt(153))3)*2. 1377 Simplify sqrt(7) - sqrt(84)/sqrt(192) - sqrt(77)/sqrt(704). 5sqrt(7)/8 Simplify (-3(sqrt(156) - -2sqrt(156) - sqrt(156)))/(sqrt(48)/sqrt(4)5). -6sqrt(13)/5 Simplify ((2sqrt(99)1)/(sqrt(36)/sqrt(4)3))2. 44/9 Simplify (sqrt(3087)-1 + sqrt(3087))/(sqrt(9) - ((1sqrt(90))/sqrt(10) - sqrt(9))). 0 Simplify -4 + (sqrt(2) - (0 + sqrt(2)))2 - sqrt(2) - (sqrt(6)1)/sqrt(3). -4 - 2sqrt(2) Simplify -3(sqrt(1872) + -4). -36sqrt(13) + 12 Simplify -1sqrt(847) + 0 - (sqrt(252) - (5 + sqrt(252) + 1))*2. -36 - 11sqrt(7) Simplify ((2sqrt(270))/sqrt(10))/((sqrt(90)/sqrt(2))/sqrt(5)). 2sqrt(3) Simplify 3(1(sqrt(125) + -1) + sqrt(125) + (-4 + (sqrt(125) - -2sqrt(125)))2). -330sqrt(5) + 3420 Simplify (sqrt(162) + 1(0 + sqrt(162)))2. 648 Simplify ((2sqrt(153) - sqrt(17) - -3(3 + sqrt(17))) + -3)2. 96sqrt(17) + 1124 Simplify sqrt(56)/((sqrt(8) - sqrt(8)-1)2). sqrt(7)/4 Simplify (3 + 2sqrt(320) - -4(sqrt(320) + 1 + sqrt(320) + sqrt(320)))*2 + -4. 1568sqrt(5) + 62765 Simplify 6(-2 + -2 + sqrt(7))5. -120 + 30sqrt(7) Simplify (5(sqrt(352)-5)/sqrt(8))2. 27500 Simplify 1 + 1sqrt(2)-2 + -2sqrt(32) + 0. -10sqrt(2) + 1 Simplify sqrt(56)/(sqrt(200)-1). -sqrt(7)/5 Simplify sqrt(35)/((sqrt(126)/sqrt(2))/sqrt(9))3. 3sqrt(5) Simplify -3 + (sqrt(19)3)2 + sqrt(152)/sqrt(8) + -2. sqrt(19) + 166 Simplify -4((-3 + sqrt(3)1 + 5)2 + 4). -44 - 16sqrt(3) Simplify sqrt(54)/sqrt(2) + -1 + -4(-2 + sqrt(27)). -9sqrt(3) + 7 Simplify 1(3 + (sqrt(363) + (sqrt(363) - (1 + sqrt(363) + sqrt(363) + 1 + sqrt(363))))2). 44sqrt(3) + 370 Simplify 2(sqrt(75)-2)*23. 1800 Simplify (sqrt(15)/sqrt(48) - sqrt(5) - (sqrt(40)2)/sqrt(8))2. 605/16 Simplify (sqrt(1331) - (0 + sqrt(1331)) - (-1sqrt(11) + -4))*2. 8sqrt(1	{ "pile_set_name": "DM Mathematics" }
*2 - 11u - 3. Calculate -2l(o) - 5t(o). o*2 + 11o - 1 Let s(j) = 0j - 11j - 3 + 6j2 + 14. Let u(q) = 2q*2 + 4q + 2q - 8q*2 - 6 + 3q*2. Determine -6s(k) - 11u(k). -3k*2 Let h(k) = 6k*2 + 1. Let d(p) = 35p*2 - 14p + 9. Give -d(q) + 4h(q). -11q*2 + 14q - 5 Let p(a) = 4a3 + a2 - 6a + 3. Let l(i) = -11i3 - 4i*2 + 17i - 9. Give -6l(b) - 17p(b). -2b3 + 7b*2 + 3 Let p(j) = -44505j*3 - 69j*2. Let k(a) = 1309a*3 + 2a*2. Determine -69k(m) - 2p(m). -1311m*3 Let v(o) = -4o*3 - 2o*2 + 4o - 3. Let k = -1598 + 1597. Let i(n) = -n + 1. Give kv(w) - 3i(w). 4w3 + 2w*2 - w Let d(g) = 14g*2 + 4. Let s(k) = 15k*2 + 17k + 5 + k - 18k. What is -5d(a) + 4s(a)? -10a*2 Let j(v) = 3v*2 - 4v - 32. Let t(k) = 4k2 - 4k - 33. Calculate -3j(h) + 2t(h). -h*2 + 4h + 30 Let b(z) = z*2 + 3z + 2. Let t(m) = m*2 + 2m + 1. Let g be (-106)/9 - (-2)/(-9). Let w be (0 - -4)((-9)/9 - -3). Let p = g + w. Determine pb(d) + 6t(d). 2d*2 - 2 Let x(w) = -w - 1. Let m(k) = -k + 4. Let j be m(5). Let r be 2024/128(-3 - 1). Let a(f) = 18f + 15. Determine ja(u) + rx(u). -3u Let l(u) = 2 - 1 + 2 + 1. Let w(v) = -v - 1. Let f(m) = -l(m) - 2w(m). Let o(k) be the first derivative of k + 274. What is -f(h) - 5o(h)? -2h - 3 Let g(z) = -z*3 - 1. Let m(r) = -4r*3 + 4r*2 - 2. Calculate 2g(t) - m(t). 2t3 - 4t*2 Let m(d) = -48411d*2 + 495d + 990. Let y(n) = 196n2 - 2n - 4. Give 2m(l) + 495y(l). 198l2 Let v(q) = 15q*2 + q + 15. Let a(p) = -45p*2 - 3p - 43. What is -6a(g) - 17v(g)? 15g2 + g + 3 Let i(y) = -2. Let a = 29 - 32. Let o(f) = f2 - 2. Let c be 16/(-28)21/(-6). Calculate ai(s) + co(s). 2s2 + 2 Let t(b) = b3 - 23b + 7. Let z(p) = p*3 - 23p + 6. What is -6t(x) + 7z(x)? x*3 - 23x Let w(z) = 14z2 - 6z - 17. Let o(i) = 5i2 - 2i - 6. Suppose -286 = -5r - 56. Suppose -2b = 3g - 0g + r, 4b + g + 72 = 0. Give bo(t) + 6w(t). -t2 - 2t Let f(l) = l2 - l. Let b(s) be the first derivative of s3/3 - 23s2/2 + 23s - 22. Let w be b(22). Let y(r) = 30r2 - 36r. Calculate wy(v) - 36f(v). -6v2 Let a(y) = 4y*2 + 3y - 2y + y. Let k(h) = -h2 - 18. Let z be k(0). Let r(x) = -17x*2 - 9x. What is za(i) - 4r(i)? -4i2 Let c(b) = -13b - 618. Let z(p) = 8p + 618. Calculate 2c(h) + 3z(h). -2h + 618 Let v(y) = -10y2. Let g be (-3)/((11 - 3)/(-16)). Let l(a) = -10a*2. Give gv(c) - 5l(c). -10c*2 Let j(r) = -84r - 5r3 - r2 - 71r + 159r - 4. Suppose -4n + 4 = -2f, -4f + 4n - 1 + 5 = 0. Let b(g) = -g3 + g - 1. Calculate fb(v) - j(v). v3 + v2 Let j(y) = y*2 - 10y + 1. Let r(z) be the second derivative of z*3/6 + 17z - 2. What is -2j(a) - 18r(a)? -2a2 + 2a - 2 Let f(u) = u - 51. Let c(x) = -x + 53. Determine 6c(q) + 5f(q). -q + 63 Let m(n) = n*3 - 5n*2 + 15n - 38. Let h be m(4). Let t(g) = -9g + 6g + 5 - 10g. Let d(a) = 7a - 3. What is ht(v) + 11d(v)? -v - 3 Let m(c) = -c*3 + 16c*2 - 39c - 22. Let r be m(13). Let k(h) = -3h. Let s(i) = i. Calculate rs(d) - 6k(d). -4d Let v(t) = -t - 1. Suppose 0 = -n + 89 - 90. Let k(g) = -5. Determine nk(q) + 5v(q). -5q Let p(c) = 45c + 2. Let u(z) = -90z - 4. What is 11p(j) + 6u(j)? -45j - 2 Let q(l) = -l*2 - l. Let x(i) = 2i*2 + 3i - 2. Suppose -5h + 5f = 15, 0f - 8 = -4h - f. Determine hx(n) + q(n). n2 + 2n - 2 Let z(i) = 4i2 - 20i - 165. Let m(s) = 5s2 - 23s - 164. Determine 6m(h) - 7z(h). 2h2 + 2h + 171 Let l(z) = 3z - 2. Let d(h) = -3h + 3. Let c be -143((-3)/9 - (-4)/3). Let b = -148 - c. Calculate bl(n) - 4d(n). -3n - 2 Let j(q) = -11q2 - 7q + 167. Let r(l) = 19l2 + 12l - 335. Give -7j(m) - 4r(m). m*2 + m + 171 Let b(o) = o - 1. Let d(g) = 6g*2 + 8g - 3. Let f(m) = m*2 + m. Let s(n) = d(n) - 3f(n). Determine -3b(x) + s(x). 3x*2 + 2x Let p(j) = 4j2 + 5j - 9. Let m be 7(6/35 + (-36)/(-90)). Let z(g) = g2 + g - 2. Calculate mp(u) - 18z(u). -2u*2 + 2u Let a = 42 - 29. Let n(b) = -b*2 + 2b*2 + a - 12. Let v(r) = -12r*2 - 10. Suppose -q + 17 = 7. Determine qn(c) + v(c). -2c2 Suppose -4c - 32 = -176. Let l(n) = 16 + cn - 9 + 15. Let r(w) = 5w + 3. Calculate 6l(i) - 44r(i). -4i Let v(t) be the first derivative of -t2/2 + t - 71. Let h(c) = 9c - 7. Determine h(d) + 6v(d). 3d - 1 Let a(i) = 152i - 30. Let b(k) = -101k + 19. What is 5a(t) + 8b(t)? -48t + 2 Let n(m) = -6m + 4. Let l(q) = 5q - 6. Calculate -4l(z) - 3n(z). -2z + 12 Let c(d) = -2d + 1. Let p(r) = -8r + 149. Let i be p(18). Let o(y) = -4y + 2. What is ic(k) - 2o(k)? -2k + 1 Let z = 58 - 29. Let g(q) = -87q3 + 24q*3 + zq*3 - 4q*2 + 5q + 30q3. Let i = -11 + 3. Let y(x) = -6x*3 - 6x*2 + 8x. Give ig(n) + 5y(n). 2n3 + 2n*2 Suppose 0c = -c - 1. Let l(b) = b*3 - 1. Let k(f) = 3f*3 - 2f*2 + 2f - 1. Give ck(x) + l(x). -2x*3 + 2x*2 - 2x Suppose -o + 14n = 11n - 18, 0 = -n - 4. Let b(x) = 25x2. Let w(z) = 8z*2. Determine ob(v) - 21w(v). -18v*2 Let u(t) = 2t*2 + 4t. Let o = -510 + 499. Let f(p) = 6p2 + 11p - 1. Give ou(s) + 4f(s). 2s2 - 4 Let u(v) = v. Let y = -3288 + 3291. Let x(c) = 2c + 9. Let t(q) = q + 4. Let z(p) = -9t(p) + 4x(p). Give yz(o) - 3u(o). -6o Let s(l) = -2l - 7. Let d(f) = -f - 2. Suppose -4h + 4r + 76 = 0, -86 = -4h - 40r + 39r. Determine hd(j) - 6s(j). -9j Let p(j) = 20j + 1. Let x = 0 + 1. Let n be p(x). Let d = n - 13. Let u(k) = k - 1. Let s(a) = 3a - 2. What is du(i) - 3s(i)? -i - 2 Let r(i) = 37i - 14. Let s(m) = 74m - 25. Give 7r(z) - 4s(z). -37z + 2 Let d(t) = 3t*2 + t + 4. Let v(b) be the second derivative of 5b4/12 + b3/6 + 7b2/2 - b + 188. Suppose 7 = 4r - 9. Determine rv(f) - 7d(f). -f*2 - 3f Let a(q) = -200q3 - 6q*2 + 2q - 5. Let w(h) = h3 + h2 + 1. What is -a(j) - 6w(j)? 194j*3 - 2j - 1 Let w(s) = -23s2 - 7s - 3. Let q(t) = -1 + 29t2 - 1 + 4t - 18t2 + 3 + 1. What is 7q(a) + 4w(a)? -15a*2 + 2 Let y(j) = -j. Let x(h) = 2h - 3. Suppose 4r + 2f - 18 = 0, 8r - 4r + 3f - 21 = 0. Calculate ry(d) + x(d). -d - 3 Let x(s) = -2s - 3. Suppose 0 = -2f - 2f - 16. Let w(p) = -5 - 3p + 4p + 6. What is fw(o) - x(o)? -2o - 1 Suppose 4n - 2l - 6 = 0, 5n - 18 + 4 = -4l. Let j(a) = 2a + 5. Let q(g) = 4g + 11. What is nq(i) - 5j(i)? -2i - 3 Let p(l) = -l*3 + 12l*2 - 16l + 59. Let j be p(11). Let h(n) = -2n + 2. Let i(a) be the third derivative of a4/24 - a3/6 - a2. Give jh(b) + 9i(b). b - 1 Let r(a) be the second derivative of 1/2a*2 + 0a*4 + 1/20a*5 - 22a + 0 + 1/6a3. Let o(y) = 3y2 + y - 1. Determine -o(g) + r(g). g3 - 3g2 + 2 Suppose 0j - 6 = -3j. Let d(o) = -4o + 8. Suppose 0z + 36 = 5z + 3k, -3z - k = -20. Let y(u) = -6 + z + 2 - u. Give jd(l) - 9y(l). l - 2 Suppose 4 - 1 = d. Let p(g) = 2g - 3. Let y(b) = 5b - 3. Let f(a) = -2a + 1. Let x(h) = -2f(h) - y(h). Calculate dx(q) + p(q). -q Let v = 383 - 380. Let s(t) be the third derivative of -2/3t*v + 1/6t*4 + 3t*2 + 0 + 0t. Let n(d) = -d*2 - 13d + 13. Calculate -2n(h) - 7s(h). 2h2 - 2h + 2 Let b(x) = -3x3 - 5x*2 - 5x + 3. Let k(y) be the first derivative of y3/3 + y2/2 - y + 18. Give b(r) + 3k(r). -3r*3 - 2r*2 - 2r Let f(t) = -t*3 + 4t*2 - 19t + 7. Let q(a) = a*3 - 3a*2 + 19a - 6. What is -6f(x) - 7q(x)? -x*3 - 3x*2 - 19x Let s(d) = 84d2 - d - 4. Let o(q) = 334q*2 - 6q - 17. What is -2o(p) + 9s(p)? 88p2 + 3p - 2 Let x(l) = 2l3 + 3l*2 + 49l. Let w(n) = -n*2. Calculate 3w(r) + x(r). 2r3 + 49r Let s(z) = z*2 - 4z + 1. Let d(m) = -6m2 + 22m - 3. Let f(y) = -d(y) - 5s(y). Let o = 0 - -1. Let u(r) = 1. Give of(x) + 2u(x). x2 - 2x Let q(h) = 7h - 1. Let u be -1 - (-3)/(-1) - (13 - 12). Let z(o) = -10o + 1. Determine uz(m) - 7q(m). m + 2 Let w(y) = 20y3 + 3y*2 - 3y - 3. Suppose -42a + 140 = 14. Let d(j) = 940j*3 + 140j*2 - 140j - 140. What is ad(k) - 140w(k)? 20k3 Let o(v) = 48v + 50. Let a(x) = -17x - 17. Determine 17a(h) + 6o(h). -h + 11 Let j(d) = 2d - 29 + 28 - 4d + d. Let l(p) = 7p + 5. What is -4j(k) - l(k)? -3k	{ "pile_set_name": "DM Mathematics" }
- 37). -80l3 Expand ((-1 + 2a + 1)(5 - 4 - 3) + a - 3a + 8a)(-2a3 + 2 - 2). -4a4 Expand z2 - 3z2 + z2 + (0z + z + 0z)(-3z - 4z + 6z) + (-2 + 2 - z2)(3 + 2 - 1). -6z2 Expand (c + 4c - 6c)(3 - 3 - 2c3) + 2c*4 + 5c*4 + 5c*4. 14c4 Expand -n4 + 7n3 + n2 - 7n*3 + (-3n*2 + 5n*2 - 3n*2)(n2 + n2 + 0n2) - n4 + n4 - 2n4 + n - n4 - 3n4 + 2n*4. -7n4 + n2 + n Expand (-8 - 2 + 1)(2t - 2 + 2). -18t Expand (-3r*2 + 4r*2 - 2r + 4r)(-26r3 - 20r*2 + 20r*2). -26r*5 - 52r*4 Expand (0w + w - 8w)(12w - 12w - w*4). 7w*5 Expand (-g + 3g + 0g)(-g - 2g + 5g)(-1 + 3 - 3). -4g*2 Expand (-5 + 2 + 2)(2u + 1 - 1)(4 - 2 + 1). -6u Expand (0 + o2 + 0)(8 - 16 - 16). -24o2 Expand 3t4 - t4 - 3t4 + (3t + t - 6t + (-1 + 5 - 3)(-1 + 1 - t) + 2t - 5t + t)(-2t*3 - t + t). 9t*4 Expand 3p2 + p2 - 7p2 + (-2 + 5 + 0p + p)(-6p + 9p + 4p). 4p2 + 21p Expand (1 - 5 - 2)(-2w5 - w2 + w*2 + (2w*4 + 0w*2 + 0w*2)(w - 4w + 2w) + 2w5 - 3w*5 - 2w*5). 42w*5 Expand (2z4 + z4 - 2z4)(-1 + 5z - 3z + 3). 2z5 + 2z*4 Expand (-5 - 2 + 5)(-18i + 12i + 2i + (-4i + 4i - i)(-2 + 0 + 3) - 2i - i + i - i + 1 - 1 + 3i + 2i - 6i). 18i Expand (1 - b - 1)(-4b + 6 + 6b - 3b). b2 - 6b Expand (0 - 6 - 15)(-2s*2 - 4s + 4s). 42s*2 Expand -2y2 + y2 - y*2 + (5y - 3y + 0y)(0 + 2y + 0) + y2 - y2 + y*2. 3y*2 Expand (1 - 30o*3 + 11o*3 + 15o*3)(-2 + 1 + 3). -8o3 + 2 Expand (-n2 - n3 + n2)(-1 - 4 + 6) + 3 - 3 - n3 - n3 - n*2 - 5n*2 - 14n*2. -3n*3 - 20n*2 Expand (0 + 0 + 4)(-3 + 3 - h)(-1 - 5 + 3). 12h Expand (7l3 - 15 + 15)(-2 - 2 + 2) - l3 + l3 + 2l3 - 1 + 1 - l3 + (-3l*2 + 0l*2 + 4l*2)(-2l + 3 - 3) - 2l*3 - 3l*2 + 3l*2. -17l*3 Expand (-2i*3 - i + i)(-3 + 5 + 0) - 3i3 + 4i*3 - 3i*3 + 4i*3 - 2i*3 - 6i*3 - 2i*3 + 2i*3 - 2i*3 + (-i + i - 2i*2)(-3i + 4i + i). -16i3 Expand -5m*3 + 6m*3 - 2m*3 + (-4m*2 + 6m*2 - 3m*2)(2m - 2 + 2) + 1 - m3 - 1 - 12m*3 - 2m*2 + 0m*2 + 11m*3. -5m*3 - 2m*2 Expand (-4 - 4 - 1)(2 - 2 - b*4). 9b*4 Expand (-2t3 - t2 + t*2)(-17t + 14t - 2t2 + t2). 2t*5 + 6t*4 Expand (3x*2 - 3x2 - x3 - x*2)(-x + 9x - 2x) + (-x + 0x + 0x)(x2 + 2x3 - x2). -8x4 - 6x*3 Expand (2p*4 + 3p*4 - 6p*4)(-p + p + 3p) + (0p*4 + 4p*4 - 2p*4)(2p + 0p + 0p) + 3p*5 - 3p5 + p5 - 11p + 11p + 6p5. 8p*5 Expand (-4 + 2 + 1)(-11l + 3l + 5l). 3l Expand (-1 - 2w + 1)(w*4 - 4w*4 + 4w*4) - 5w5 + w5 + 5w5 + 6w*3 - 7w*5 - 6w*3. -8w*5 Expand (5 - 5 - 1)(0v + 5v - 2v) + v - 3v + v + 0v + 3v - v + (-1 + 3 - 4)(-2v + v - v). 2v Expand (2p2 - p2 - 3p2)(4 + 11p - 4). -22p*3 Expand (1 + 1 - 4)(0g5 + 3g5 - g5) - 3g5 - 2g*5 + 4g*5 + 2g*4 - 9g*5 - 2g*4 + 3g*5 + 0g5 - g5. -12g5 Expand (-1 - k + 1)(-1 - 3 - 2)(0 + 0 + 2)(-3k4 + 3k4 + k4). 12k5 Expand 1 - 1 + 2r*3 + (-1 - 3 - 2r*2 + 2)(0r + 3r + 0r). -4r*3 - 6r Expand (0s + 2s + 0s)(1 - 6 + 2) + 2s + 2 + s - s. -4s + 2 Expand (-3b3 - 2b*3 + 0b*3 + (3b*3 - 2b*3 - 2b*3)(2 + 1 - 4))(5b*2 - 4b2 + b2). -8b5 Expand (2 - 3 - 1)(-3x - x + 3x + (-2x - x - 2x)(2 - 3 + 0))(0 + 0 - 2x2). 16x3 Expand i3 + 3i3 - i3 + (4 - 3 - 4)(-2i3 + i3 + 3i*3). -3i*3 Expand (-4 + 2 - 2)(4 - 4 - m). 4m Expand (1 + 3b - 1)(-33b + 35b + 27b*2 + 2b*2). 87b*3 + 6b*2 Expand (2 - 2 + i)(1 + 8 - 2) - 3i - 5 + 5. 4i Expand (y + 0y + 0y)(2 + 4 - 5) + (4 - 6 + 4)(-3y - y + 3y). -y Expand 3n5 + 2n*5 - 7n5 + (-n2 + 0n2 - 2n*2)(-16n2 + 4n*2 - 2n*2)(0 - n + 0). -44n5 Expand (-4 + 4 - 1)(-29 + 44 + 3y - 4y). y - 15 Expand (2l + 0l + 2l)(2 - 2 - 5l) + 5 + 2l*2 - 5. -18l*2 Expand (-4 - m + 4)(2 + 3 - 3)(-4m + 0m + 6m)(9m - 7m2 - 9m). 28m4 Expand (-4j*2 + 0j*2 + 2j*2)(-3j + 3j + j*2 + 2j + j*2 - 2j + (0 + 0 + j*2)(3 - 2 + 1) + (-1 + 1 + 3j)(-4 + j + 4)). -14j4 Expand (c2 + 3c*2 - 6c*2)(c - 1 + 1) + 11c + c3 + 2 - 11c. -c*3 + 2 Expand (9x*2 + 16x*2 - 5x*2)(2 + x*2 - 2 + (-x + 0x - x)(-x + 1 - 1)). 60x*4 Expand (2o + 3o - 3o)(-4 + 3 + 2)(0 - 8 - 46o + 41o). -10o2 - 16o Expand ((0 - 5 - 3)(2 - 2 + 2h) - h + 5h - h + (0 + 2 + 0)(0 - h + 0))(-2 + 2h + 2). -30h2 Expand -3n*3 + 0n*3 + 0n*3 + (3 - 4 + 0)(-3n - 2n*3 + 3n) + 0n3 + 5n*3 - 3n3 - n2 + 3 + 3n3 + n2. 4n*3 + 3 Expand (-3x2 + x2 + x*2)(1 + 0 - 3)(0 + 3 - 2)(-1 - 3 + 6). 4x2 Expand b - b + 3b*3 - b + b + 3b3 - b2 + 2b3 + b2 + (-b - 5 + 5)(-b2 + 1 - 1) + b3 - b*3 + 2b*3. 11b*3 Expand (0m + 6m - 2m)(1 + 0 - 4)(-2 + 3 - 3). 24m Expand (2d3 + d3 - d*3 + (-2d2 + d2 + 3d2)(-2d - 2d + 6d) - 5d*3 + 4d*3 - 4d*3)(1 + 2 - 4)(2d2 + d2 - d*2). -2d5 Expand (w4 + 0w4 - 8w*4)(2 + 6 - 7)(-w + 2w + w). -14w5 Expand ((-1 - 1 + 0)(-j - j + 3j) - 2j + j - j)(-4j*4 + 3j - 3j). 16j*5 Expand (-3b + b + 0b)(-3b2 - 2b*3 + 3b*2) + (0b*2 + 0b2 + b2)(0 + b2 + 0). 5b*4 Expand -3k - k + k + 2 + (4k - 7k + k)(1 - 2 - 1) - k + 0k + 2k + k + k - k. 3k + 2 Expand (-1 - 1 + 4g - g)(g + 5g - 2g)(3g - 3g - g2). -12g*4 + 8g*3 Expand (-4x + 0x + 2x)(-5 - x + 5) + 20x - 20x + 8x*2. 10x*2 Expand (0 + 1 + 0)(b - 3 + 3) - 2b + 2b - 2b + 4. -b + 4 Expand (-8o + 2o + 0o)(0 + 0 + o). -6o*2 Expand (5f*2 - 4f2 + f2)(f + 0f + 0f) + (2f*2 + 3f - 3f)(-4f - 1 + 1). -6f*3 Expand (-7 + 0 + 3)(0 - o + 0) - 4o + 3o + 2o. 5o Expand (1 - 1 - 1)(1 - 1 + 2n) - 4 + 4n + 4. 2n Expand (z*3 + 5z*3 - 3z*3)(2z2 + z2 + 2z*2). 15z*5 Expand -2v + v - v + (0v + 2v - v + (0 - 2v + 0)(-3 - 1 + 3))(2 - 5 + 4). v Expand -2i*2 - 16i - 18i + 45i + 4i3 + (-4i - i + 3i)(3i - 2i*2 - 3i). 8i3 - 2i*2 + 11i Expand (2v + 12v - 2v)(0 + 2 - 3). -12v Expand -14v - 3v - 5v + (-5v + 4v + 3v)(5 + 2 - 4). -16v Expand (-w - 3w + w)((1 - 3 + 3)(2 - 1 + 0) + (-5 - 1 - 1)(5 - 3 - 1)). 18w Expand 4d2 + d2 - 3d*2 + (2d - 2 + 2)(4 - 2d - 4) - 3d + 12 + d2 + d - 9. -d2 - 2d + 3 Expand (1 - 3 + 1 + (2 + 0 - 4)(2 - 5 + 1) + 1 - 2 + 0 + 1 - 18 + 4 - 1 - 2 + 1)(3j + 0j - 2j)(1 + 3 - 5). 13j Expand 38q*4 - 8q*4 + q + 4q*4 + (-5q*2 + 3q*2 + 3q*2)(q*2 - 3q*2 + 0q*2). 32q*4 + q Expand (-32 - 19 - 13 + (3 - 1 + 0)(-4 + 3 + 3))(3h - 6h + h)(4 - 4 - h). -120h2 Expand -u - 2u - u - u - 5u + 2u + (0u - 3u + 2u)(6 - 3 - 4). -7u Expand (-8a*2 - 10a*2 + 6a*2)(3a2 - 2a*2 + 0a*2). -12a*4 Expand 2p*3 + 5p3 - p3 + (p + p - p)(-p2 + 0p*2 + 0p*2) + (3p*3 - 3p*3 + 2p*3)(-1 - 2 + 1). p*3 Expand (-3 + 2 - 3)(w - 2w + 2w). -4w Expand (3j*4 - 4j + 3j - j4)(0j + 11j + 11j + 2j - 1 + 1 - 2j + j - j + j + 4 - 4 + (-3 + 0 + 2)(0j + 0j - 2j)). 50j*5 - 25j*2 Expand (4l + l + l + 2l - 2l - l + (-l + 0l + 3l)(0 - 4 + 2))(-1 + 3l2 + 1). 3l*3 Expand 3 + i - 3 + (3i - 2i + 2i)(3 + 2 - 4) + i + i - i + 2 + 0 + 4i - i. 8i + 2 Expand (-1 + 3 - 4)(-21h + 13h + 2 - 1) - 3h + 3h + h + (2 + 5 - 5)(h + 4 - 4). 19h - 2 Expand (0 + 0 - s)(-3s2 - s2 + 2s2)(-1 - 1 + 4) + 3s3 + 0s*3 - 2s*3. 5s3 Expand (j4 + 2j4 - 4j*4)((-j + 2 - 2)(-1 - 1 + 1) + 15 - 15 + 6j). -7j5 Expand -2b - 4b + b - 1 + 1 + b + (-4 - 1 + 3)(-5b + b + 11b). -18b Expand (111j - 160j + 133j)(-5j2 + j2 + 2j2). -168j3 Expand u4 - 4u4 + 2u*4 + (-3u + 0u + 5u)(u - 2u*3 - u) - 2u4 - u2 + u*2 + (-1 + 1 - 2u*2)(2 - 2 - 3u2). -u4 Expand ((3 + 12 - 3)(0g - 3g + g) + 1 - 1 - g)(-3g2 - g3 + 3g2). 25g*4 Expand (2c - c*2 + 2 - 2c)(-2 + 4 + 1) + 2c*2 + 0c*2 + 2c2. c2 + 6 Expand (0c2 + 0c*2 - 2c*2 + (-2c - c + 4c)(-c + c - 2*c) + 4	{ "pile_set_name": "DM Mathematics" }
-13, 132 Find q, given that -4q3 + 1416032q*2 - 7080004q - 19824168 = 0. -2, 7, 354003 Find t such that -4t3 + 32232t*2 - 14918180t = 0. 0, 493, 7565 Let -4u4 - 836u*3 - 7836u*2 + 25556u + 175120 = 0. What is u? -199, -11, -4, 5 Suppose 3x2 + 965406x + 19306920 = 0. What is x? -321782, -20 Suppose -59n3/3 - 10121n*2 + 54910n - 57200/3 = 0. What is n? -520, 22/59, 5 Factor -4l3 + 33008l*2 - 2230672l + 37842816. -4(l - 8184)(l - 34)2 Solve -o3/2 + 153783o2/2 - 230670o = 0 for o. 0, 3, 153780 Let -2l3/13 - 18664l*2/13 + 168098l/13 - 373640/13 = 0. What is l? -9341, 4, 5 Determine n so that 13n4 - 159n*3 - 4394n*2 + 5820n + 7000 = 0. -14, -10/13, 2, 25 Find v such that 2v5/5 - 88v*4 + 4628v*3 - 36680v*2 + 450138v/5 - 57888 = 0. 1, 3, 5, 67, 144 Suppose 2m4/3 + 410m*3 + 88956m*2 + 23574016m/3 + 222376128 = 0. Calculate m. -234, -164, -53 Factor -x*2 - 881353x - 881352. -(x + 1)(x + 881352) Suppose -3c*2 + 307705242c - 7890209662856547 = 0. Calculate c. 51284207 Factor 58s2/13 + 3550698s/13 - 244876/13. 2(s + 61219)(29s - 2)/13 Let 4r*4 + 780004r*3 - 17941764r*2 + 86590044r - 119354688 = 0. Calculate r. -195024, 3, 17 Find n such that -2n2 + 403468n + 2824374 = 0. -7, 201741 Determine z so that 2z3 + 19794z*2 + 48060000z = 0. -5625, -4272, 0 Determine c, given that 2c4/17 + 4860c*3/17 + 134922c*2/17 + 985720c/17 + 2161800/17 = 0. -2402, -18, -5 Factor 2x3 + 11328x*2 + 9100698x - 21458702428. 2(x - 974)(x + 3319)*2 Suppose 11k*3/3 - 60832462k*2/3 + 110604436k/3 + 22120888/3 = 0. What is k? -2/11, 2, 5530222 Determine r so that -5r3 + 178255r*2 - 712955r + 534705 = 0. 1, 3, 35647 What is g in -2g5/11 - 14180g*4/11 + 355436g*3/11 - 2233360g*2/11 + 485058g - 4354380/11 = 0? -7115, 2, 3, 17 Determine w so that w*2/3 - 50747w/3 = 0. 0, 50747 What is k in 4k5 - 194952k*4 + 2533772k*3 - 3507560k*2 - 31183488k - 24947200 = 0? -2, -1, 8, 48725 Suppose -3996z2/7 + 190870z/7 + 3536/7 = 0. What is z? -1/54, 1768/37 Determine m so that -150m3 - 3653m*2 - 21522m - 7155 = 0. -15, -9, -53/150 Let 5q5/4 + 2417q*4/4 + 43023q*3/4 + 112815q*2/4 - 20925q = 0. Calculate q. -465, -15, -4, 0, 3/5 Suppose 2z4/5 - 786z*3 + 177534z*2/5 - 1891054z/5 - 414504 = 0. Calculate z. -1, 20, 27, 1919 Factor -j*2 + 71110j - 568816. -(j - 71102)(j - 8) What is r in r4 + 289r*3 - 32655r*2 - 498281r - 1791146 = 0? -373, -7, 98 Factor -124z2/9 - 9134032z + 5303632/9. -4(z + 662954)(31z - 2)/9 Factor -8k*3/3 - 944068k*2/3 - 944065k/6 - 19668. -(k + 118008)(4k + 1)*2/6 Suppose -9o*5/5 + 42333o*4/5 - 112816o*3/5 - 7528o*2 + 150416o/5 + 75216/5 = 0. What is o? -2/3, 2, 4701 Let -t*4/7 - 669t*3 - 5577673t*2/7 - 31758243t - 1669982710/7 = 0. Calculate t. -2321, -31, -10 Determine q so that -q*5/3 - 9961q*4/3 - 1204199q*3/3 - 37798919q*2/3 - 24008360q - 11806800 = 0. -9839, -60, -1 Factor 2s4/9 + 2446s*3/9 + 62582s*2/9 + 44954s. 2s(s + 13)*2(s + 1197)/9 Factor o*4/2 - 121135o*3 - 5088258o*2 - 71238356o - 332452064. (o - 242312)(o + 14)3/2 Factor 2r*3 - 11230r*2 + 33672r. 2r(r - 5612)(r - 3) Factor 17t*2 - 41482t - 161304. (t - 2444)(17t + 66) Factor -3a2/2 + 14201025a - 67223037016875/2. -3(a - 4733675)2/2 Suppose 3u*2/7 + 21994290u/7 - 21994293/7 = 0. Calculate u. -7331431, 1 What is m in m*5 + 39m*4 + 473m*3 + 1281m*2 - 6714m - 7560 = 0? -15, -14, -12, -1, 3 Solve -3w4/4 + 577479w*3/4 - 9526719w*2/2 - 4907730w = 0. -1, 0, 34, 192460 Factor -4i3 - 1448160i*2 - 131000523600i + 13114537960000. -4(i - 100)(i + 181070)*2 Determine d so that -3d*4 + 15990d*3 + 289056d*2 - 1411872d = 0. -22, 0, 4, 5348 Suppose 5l5 + 3570l*4 + 631225l*3 + 26784460l*2 - 739586700l + 4049996000 = 0. Calculate l. -472, -131, 10 Factor 2j2/17 + 274751896j/17 + 9436075544449352/17. 2(j + 68687974)2/17 Solve 3x*4/4 + 31533x*3/4 - 2647995x*2/2 + 56460567x - 107688222 = 0. -10677, 2, 82 Factor -a*2/2 - 86188a + 172378. -(a - 2)(a + 172378)/2 Solve 5c*2 - 468295c - 468300 = 0 for c. -1, 93660 Factor 3m3 - 252234m*2 + 5297794515m + 169787810400. 3(m - 42055)2(m + 32) Factor 5l4 + 9379930l*3 + 4399154340245l*2. 5l*2(l + 937993)*2 Let 4l*2 - 9125844l + 9125840 = 0. What is l? 1, 2281460 Suppose 5d2/4 + 603486415d/2 + 1206972825/4 = 0. What is d? -241394565, -1 Factor -3v2 - 13734v - 544560. -3(v + 40)(v + 4538) Find z such that 2z5 + 578z*4 - 90972z*3 + 782728z*2 - 1720112z + 1027776 = 0. -404, 1, 2, 6, 106 Find k such that -k*3/11 + 10513k*2/11 + 115754k/11 + 105240/11 = 0. -10, -1, 10524 Determine a so that 21a5 + 1089a*4 - 36663a*3 - 9225a*2 + 500178a - 455400 = 0. -75, -4, 1, 22/7, 23 Let 14d2/9 + 10876d/9 - 11440/3 = 0. Calculate d. -780, 22/7 Solve x*2 - 29206x = 0 for x. 0, 29206 What is d in -4d5/7 - 110d*4/7 + 964d*3/7 + 5360d*2/7 = 0? -67/2, -4, 0, 10 Factor -3k*3 - 1242k*2 + 10323k + 82290. -3(k - 13)(k + 5)(k + 422) Factor -2y*2/3 - 996922y/3 + 78794284. -2(y - 237)(y + 498698)/3 Let 5l2 + 70280l + 3431715 = 0. Calculate l. -14007, -49 Solve -4s5 - 4949604s*4 - 1531153810380s*3 + 4593491128804s*2 - 4593501028032s + 1531168659216 = 0 for s. -618702, 1 What is a in -5a2 - 91191343a + 36476538 = 0? -18238269, 2/5 Determine i, given that 860i4 + 43228i*3 - 137424i2 = 0. -11452/215, 0, 3 Let -w3/6 - 20735w2/3 - 71691250w - 716221500 = 0. Calculate w. -20730, -10 Factor 3p2 - 224138274p + 4186497155974923. 3(p - 37356379)2 Determine i so that -i2/6 + 16321i/3 - 1462815/2 = 0. 135, 32507 Suppose 2i4/3 + 97760i*3/3 + 400135836i*2 - 5396269596656i/3 - 125983172190418406/3 = 0. Calculate i. -19241, 8843 Determine r so that 2r4 + 818r*3 + 73506r*2 + 2252726r + 18602948 = 0. -298, -49, -13 What is x in -3x2 + 43236x + 9523479 = 0? -217, 14629 Find x, given that 4x4 + 578648x*3 + 124863552x*2 + 8987189760x + 215656722432 = 0. -144446, -72 Determine i, given that -i*2/5 - 57104908i/5 - 815242629422116/5 = 0. -28552454 Factor -i*2/7 + 7687i/7 - 660726. -(i - 7029)(i - 658)/7 Determine y so that 3y*2 - 67200312y + 376323494408112 = 0. 11200052 Factor -h*5/9 + 17861377h*4/9 - 17861375h*3/3 + 53584123h*2/9 - 17861374h/9. -h(h - 17861374)(h - 1)*3/9 Find y such that 4y*3 - 2409728y*2 - 159059472y = 0. -66, 0, 602498 Suppose 51x4 - 145155x*3 + 724908x*2 - 1159404x + 579600 = 0. Calculate x. 1, 2, 48300/17 Factor -o*2/4 + 197385o - 2368611/4. -(o - 789537)(o - 3)/4 Suppose 3t*5/5 + 3604161t*4/5 + 1082496240738t*3/5 - 1082507053236t*2/5 - 2164999689816t/5 = 0. What is t? -600694, -1, 0, 2 Let 164c2 + 3951428c + 289128 = 0. What is c? -24094, -3/41 Factor 1162261467k4 - 174291390360k*3 - 7173797400k*2 - 98412000k - 450000. 3(k - 150)(729k + 10)3 Factor -3a*2/5 - 8781a - 920682/5. -3(a + 21)(a + 14614)/5 Factor -4y2 - 1528284y. -4y(y + 382071) Let -13b5/9 - 4379b*4/9 - 6986b*3/3 - 13936b*2/9 + 2656b/9 = 0. What is b? -332, -4, -1, 0, 2/13 Factor 62u2/15 - 13784u/5 + 214016/3. 2(u - 640)(31u - 836)/15 Solve 4k*4 - 3798952k*3 + 900956951844k*2 + 496388543499200k + 68292950772640000 = 0 for k. -275, 475144 Determine w, given that 3w5/5 - 5091w*4/5 + 410007w*3/5 + 1696107w*2/5 + 2141814w/5 + 860808/5 = 0. -2, -1, 89, 1612 Find i, given that i*3/4 - 81i*2/4 + 431i - 1680 = 0. 5, 28, 48 Factor 5g4 - 1730g*3 - 42555g*2 + 44280g. 5g(g - 369)(g - 1)(g + 24) What is k in 5k3 - 6075k*2 + 1525420k + 126192300 = 0? -65, 494, 786 Suppose -2l2/13 + 16402l/13 - 4710188/13 = 0. Calculate l. 298, 7903 Factor 4z3 + 2492z*2 + 425936z + 11758288. 4(z + 34)(z + 278)(z + 311) Solve -x2 + 24082x - 61884225 = 0. 2925, 21157 Let 35g3 - 11145g*2 + 15685g + 52305 = 0. What is g? -11/7, 3, 317 Factor 94q2 + 29221124q + 621726. 2(q + 310863)(47q + 1) Determine r so that -3r*2 + 224991r + 449994 = 0. -2, 74999 Solve -48p*3/	{ "pile_set_name": "DM Mathematics" }
ppose -c = -4p - 77. Which is greater: 1 or p? 1 Let m = -154 - -153.8. Is 0.9 at most m? False Suppose 0 = -2w + 3k - 10, 2w - 2 = -3k + 12. Suppose 4j = 5j + w. Which is greater: 3/8 or j? 3/8 Let w = 168 - 168. Let k = 16 + -22. Is k not equal to w? True Suppose u = -17 + 10. Is -55/9 less than u? False Suppose -3z = -2f - 8 - 8, 5z - 4f - 24 = 0. Suppose 3b = -4a + 40 + 29, 0 = 2b - 2a - 32. Let j = b + -10. Which is bigger: j or z? j Let o be (-28)/120(-8)/42-312. Let i = o - -14. Let g = 0 - -1. Which is smaller: i or g? i Suppose 18i + 24i - 378 = 0. Is i at most as big as 8? False Suppose -u - 4u = -20. Suppose ud = -4z - 144, 0z - 3z - d - 98 = 0. Which is smaller: z or -32? -32 Let u = -2.2 - -16.2. Let a = -14.68 + -0.32. Let x = a + u. Which is greater: 6 or x? 6 Let z = -44 - -53. Suppose -6x - 42 = -zx. Which is greater: 15 or x? 15 Let t be 0(0 - (0 - -1)). Suppose -3m - 2 - 5 = 2o, -4m - 20 = t. Suppose 40 = ok - 2r, 4r = -8k + 3k + 24. Is k bigger than 7? True Let d = -491630 + 16226468/33. Let a = 232/3 - d. Which is smaller: -4 or a? -4 Let z = 124 - 122.34. Let m = 0.66 - z. Are m and -29 non-equal? True Let u = 29 + 41. Let t be -6 + 0 + 67 - -8. Which is greater: u or t? u Suppose 4c = r - 9, -3c - 5 = -2r - 2. Is c bigger than -3/2? False Let n be (-1)/(((-4)/10)/((-36)/(-45))). Suppose -15 = -5c - 3g, 1 = nc + 2g - 9. Which is smaller: 2/11 or c? c Let w(m) = -m*3 + 2m*2 + 4m - 4. Let c be w(3). Let u be -53((-304)/(-38) - 41/5). Which is bigger: u or c? u Let k be 2 + 0 - (-12)/6. Suppose 2r + 5 = 9. Suppose 5h + 0n = 2n, 0 = -rh - 5n + 29. Which is smaller: k or h? h Suppose -4m - 3s = 7, 0 = -12m + 7m + 2s - 3. Which is smaller: 4/529 or m? m Let j = -2059 - -2058.7. Which is bigger: -9.6 or j? j Let m be ((-216)/189)/((-8)/112). Let j(z) = 2z2 + 7z + 1. Let v be j(-5). Is m less than or equal to v? True Let h = 47/13 - 2953/806. Let x = -260712191/434 - -600719. Let a = x - h. Is 5 < a? False Let c = -308 + 251. Is -57 >= c? True Let k = -2.014 + -3.05. Let r = 0.064 + k. Is 2 greater than r? True Suppose -a - 60 = 4g, 4a - 5g = -2g - 164. Do a and 7 have different values? True Let h = 4.4 - 4.2. Let f = -36 - -25. Let c = f + 15. Is h less than c? True Let a = -136 + 1091/8. Is a > -1? True Let y be ((-464)/5075)/((-6)/(-263)) + 4. Is y smaller than -1? False Let n = -0.143 + 0.733. Let y = -6.59 + n. Which is smaller: y or 3? y Let w = 1972/9 + -673/3. Let v = w + 875/171. Suppose m - 2m + 4 = -4z, 0 = -5z + 2m - 8. Which is bigger: v or z? z Let z be 5/(30/42) - -5. Is 56/5 less than or equal to z? True Let a = 109 + -109. Which is smaller: a or -16/29? -16/29 Suppose -3j = 3, -5w + 287 = -4j + 2j. Let i = w + -38. Is 17 less than i? True Let j = -425.7 + 426. Let v = 2.04 + -2. Let t = v - -0.36. Is t less than or equal to j? False Let i be 12/20 - (1 + 6684/15). Which is smaller: -1 or i? i Let g = 333 - 438. Which is smaller: -108 or g? -108 Suppose -236v = -233v - 54. Is v greater than 11? True Let h be (-40)/(-90) - 365/(-9). Is h greater than 3? True Let a(l) = -l*2 + 3l - 2. Let i be a(2). Let z = 371 - 533. Let t = z - -482/3. Which is smaller: t or i? t Let b be -6 + (59/(-5) - -1). Which is bigger: b or -18? b Let t be 21/12 - (-3)/12. Let r be (t - (-33)/(-17))-2. Suppose m - 3z + 3 = -4m, -3m + 4z = 4. Is r less than m? True Let r = 14 + -11. Suppose u = ru. Suppose o + g = 6, uo - 2g - 37 = -5o. Is 7 at most o? True Suppose 7f + 6562 = -10f. Which is greater: -385 or f? -385 Let i = -34 + 6. Let n be i/(-42) - 46/6. Let t(d) = 2d + 15. Let v be t(n). Is v >= 6/7? True Let k(d) = 5d. Let c(s) = 26s + 1. Let t(r) = 2c(r) - 11k(r). Let x be t(-7). Is 23 > x? False Let h = -68 - -71. Let f = 10.6 + -0.6. Let p = f + -3. Which is bigger: p or h? p Let f be 60 - 60 - (-4)/14. Let q = 1 + 0. Which is smaller: f or q? f Let b = -13 - -14. Let l = 181.08 - 181. Is l bigger than b? False Let p be (255/20)/((-9)/6). Which is smaller: p or -8? p Let s = 551 + -554.81. Let b = s + 0.51. Is 1 < b? False Suppose -3d + 24 = 3n, 0 = -3n - 0d + d + 28. Let t be 40/6 - n/(-27). Which is greater: 10 or t? 10 Let p(k) = k - 2. Let z be p(7). Suppose 0 = -zo + a + 2, 6 = -2o + 3a - 1. Let i be ((-11)/3 + 3)/(69/9). Which is bigger: o or i? o Let x be (-6)/9 + 2/(4 - -2). Do x and -70 have the same value? False Let h be (12/(-15) - (-17272)/40) + -7. Which is smaller: h or 426? h Let g = -143955/17 - -8455. Which is smaller: g or -12? g Let t = -449.22 + 454. Let d = -4.7 + t. Which is greater: 1 or d? 1 Suppose -3c + 1 = 5i - 389, i + 2c = 71. Are 79 and i unequal? True Let f = 4.28 + 0.42. Let r = f - 5. Let j = 21 - 20.9. Does j = r? False Suppose -5w + 8 = -3o, -3o + 10 = 5w - 8o. Is 25/11 greater than w? True Suppose 0 = 10u + 577 + 263. Is -84 less than or equal to u? True Let n be ((-1)/234)/(5/10). Which is smaller: 1 or n? n Let w = 1 - -1. Let m be (w/9)/((-10)/12). Suppose -x - 107q + 17 = -103q, 2x = q - 2. Are m and x unequal? True Let v = 14.5 - 23. Let q = 8.46 + v. Let u = 0 - -0.1. Is u not equal to q? True Suppose -3u + 22 = v - u, -4v + 4u = -100. Let g be 0 - v/(-5 - -1). Suppose -181 = gy - 13. Is -27 < y? False Let t be 3/((-585)/(-775)) - 4. Let w = 5/26 + t. Are -4/7 and w non-equal? True Suppose 0i + 4i - 200 = 0. Suppose 0w - 5w = i. Which is smaller: w or -8? w Suppose 1857w = 1854w + 138. Is w at least as big as 44? True Suppose 2p = 19 + 243. Suppose 0x - 3x - 2t = p, 5t - 185 = 5x. Which is smaller: x or 0? x Let w = -0.98 + 0.9. Let b = -0.04 + w. Which is greater: b or 3? 3 Let p = 9.038 + -9. Let m = p - 4.238. Let n = -4 - m. Which is bigger: -1/9 or n? n Let i be (-8)/12243/(-6). Which is smaller: 294/11 or i? 294/11 Let w = -3 - -7. Suppose 0 = -3n + wh - 218, -4n = 4h - 33 + 277. Let k be 3 + -1 + 150/n. Is 1 smaller than k? False Let x(y) = 3y2 + 2y - 2. Let d be x(2). Let c be (2/3)/(d/21). Which is greater: 1/2 or c? c Let f = 163 - 179. Which is smaller: 2/3 or f? f Suppose 14 = 2r - 2d, -2 + 10 = -r - 2d. Let x(v) = 3v + 7 + 1 + v*3 - 5v*r - 3. Let o be x(4). Which is smaller: 3/8 or o? 3/8 Let y = 15.748 - -0.052. Let v = -16 + y. Are -2/45 and v equal? False Let c = -1/1052 - -2159/57860. Let u = 16 + -9. Suppose -uk + 8k = 0. Is c less than or equal to k? False Let w = 242/69 + -73/23. Let r be -2 + (2 - (2 + 10)). Let h be ((-3)/6)/((-1)/r). Is w at least as big as h? True Let c(o) = o + 5. Let w be c(6). Let k = w - 22. Let t be 21/284/k. Which is smaller: t or 0? t Let v = -4.48 - -3.48. Is v > 0.4? False Let r = 597.8 + -695. Let q = -97 - r. Which is smaller: q or 0.9? q Let x = -15 - -12. Let c = -79 - -76. Is x >= c? True Let x be (-4)/6 + 60/(-171). Let j = 7/38 + x. Which is smaller: j or 0? j Let u be 7/(-7)(-350)/(-75). Let y = 1 + 1. Suppose 0 = -0q + yq + 3r - 7, r = 5. Is q at least u? True Suppose -23r + 19r + 3732 = 0. Let f = r + -34519/37. Which is smaller: -0.3 or f? -0.3 Let q = -3 + 3.09. Let p = q - 0.2. Let k = -0.69 + p. Do k and 0.1 have the same value? False Let z be (11 + -9)(-2 - 2). Let u be 16/20(-5)/(-2). Let x = u + -1. Which is smaller: z or x? z Let v = -131 - -236. Let f be 7/(4/(-22) - v/(-154)). Which is smaller: 73/5 or f? f Let y be ((-88)/36)/(-11)8. Which is smaller: 2 or y? y Let q = -286 + 293. Which is greater: 15 or q? 15 Suppose 14 - 4 = -y + 3a, -y - 4a = -25. Are 70/11 and y equal? False Suppose y - 9 = 3i, y + 7 - 4 = -3i. Let l be -1(-7 - i)-1. Let o be (-1 - 16/(-6))-3. Is o greater than or equal to l? True Let o be 270/720 + 93/(-120). Suppose -5u + 2d - 1 = 0, -2d = -u - d + 1. Let j = 2 + u. Which is greater: o or j? j Suppose -16 = -3d - 7. Let g be 3 - ((-2 - -3) + d). Let p = -4 + 4. Is p < g? False Let z = -2.7705 - 30.2105. Let v = -0.019 + z. Which is greater: -0.1 or v? -0.1 Let c = 20.01 + -61.86. Let i = -42 - c. Which is bigger: 1/4 or i? 1/4 Let u = 126125/99 - 1274. Is u greater than or equal to 0? False Suppose -312 = 74n + 30n. Do n and -40 have the same value? False Suppose 5b - b - 18 = 2a, 20 = 4*b. Let n = a + 28. Are 28 and n unequal	{ "pile_set_name": "DM Mathematics" }
tor of u? False Let y(a) be the first derivative of a*2/2 + 4a + 2. Let o be y(-4). Suppose 3q - 23 + 5 = o. Is q a multiple of 6? True Let n(a) = -a3 - 26a*2 - 28a - 11. Is n(-25) a multiple of 4? True Let j = 52 - 32. Suppose -2a = -a - j. Does 7 divide a? False Suppose -2x = 3x - 195. Is 13 a factor of x? True Let q = 2439 - 5145. Let z be 6/(-27) - q/27. Suppose -3t = 2t - z. Is t a multiple of 10? True Let f(c) = c2 - c + 2. Let w = -3 - -5. Does 4 divide f(w)? True Let p(c) = 37c + 17. Is p(3) a multiple of 12? False Let l(d) = d*2 + d - 6. Does 9 divide l(6)? True Suppose 0 = 4p - 7p. Let l(g) = g3 + 27. Is l(p) a multiple of 9? True Let o(i) = 40i. Let l be o(3). Suppose 6s = s + l. Is 22 a factor of s? False Suppose -5r = k + 13, -k - 10 = -r + 3k. Let s be (1 + (-2)/2)/r. Suppose -5 = -5d - 3y, -y - 9 = -d - sy. Is 3 a factor of d? False Let p = -38 - -58. Is 20 a factor of p? True Let o(w) = w*3 + 5w*2 - 6w - 6. Let p be o(-6). Let x(h) = h*3 + 5h*2 - 4h + 6. Let l be x(p). Is 4 a factor of (l/(-2))/((-6)/(-16))? True Let d(s) = s*3 + 5s*2 - 7s - 1. Let z be d(-6). Suppose -5n + x + 37 = -4, -n = zx - 29. Is 4 a factor of 30/n - 2/(-3)? True Suppose -173w + 608 = -171w. Is 19 a factor of w? True Let z be 2/(-8) - (-164)/16. Let y = z - 22. Is -2(y + (-4)/(-2)) a multiple of 10? True Let u(o) = -2o - 1. Does 5 divide u(-5)? False Let h(o) = -o*2 + 8o - 7. Let a(p) = -p*3 - 8p*2 - 2p - 11. Let f be a(-8). Let d be h(f). Suppose 0q + d = q. Does 4 divide q? True Let a = 5 - 58. Let t = -14 - a. Is 13 a factor of t? True Let u(f) = 2f*2 - 4f + 6. Suppose 0 = -2l + 6l - 16. Is 11 a factor of u(l)? True Let t = 3 - -6. Let o = 26 - t. Is 9 a factor of o? False Let g(j) = j*3 + 6j*2 - 3. Let k be g(-6). Does 14 divide k/9 + (-85)/(-3)? True Let s be 2-11(-3)/(-3). Let l be 4/(-8) + s/(-4). Suppose -ly + 130 + 10 = 0. Does 14 divide y? True Let i(u) = u*3 - 5u*2 + 6u + 3. Let s be 2/8 - 36/16. Let t be 4 - s - (-1 + 2). Is 24 a factor of i(t)? False Let j = 89 + -221. Is 2 a factor of (-3)/12 + j/(-16)? True Suppose -2i + 3 + 1 = 0. Suppose 0 = -is + 3s - 26. Is 14 a factor of s? False Suppose 6k - 11k + 325 = 0. Is k a multiple of 11? False Suppose -2n = n. Suppose n = -0r + 2r - 44. Does 11 divide r? True Suppose -q + 6q - 4p = 58, 3q - 2p = 34. Does 3 divide q? False Let u(r) = 2r2 - 2r - 2. Let l be u(2). Suppose -194 = -lw + 2c, -5c = -3w + 128 + 163. Is w a multiple of 20? False Let x(c) = -4c. Let w be x(-1). Let j be (-1)/w-20. Suppose -4y + h - 2h + 36 = 0, j = 2h. Is y a multiple of 4? False Let o = 117 - 209. Let l = -7 - o. Suppose 5u - l - 25 = -2s, -5u + 3s + 85 = 0. Is u a multiple of 20? True Suppose -u + 112 = -116. Does 23 divide u? False Let c be 9 + -2 + (1 - 0). Suppose -3b = -cb + 45. Is 6/(b/24 - 0) a multiple of 9? False Let h(p) = -10 - 3p + 3p + 2p. Let q be h(7). Let c = 28 + q. Does 12 divide c? False Suppose 150 = j + 4j. Is j a multiple of 10? True Suppose -c - 2r = 11 - 81, 3c + 3r = 207. Is 5 a factor of c? False Let d = -4 + 6. Suppose 6y = dy - 4. Does 10 divide 27 + 0 + y + 0? False Suppose 0 = -2u + 3u - 58. Suppose -2q - 13 + u = 3z, 15 = q + 3z. Is 11 a factor of q? False Let x(d) = -10d - d2 - 2 + 1 - 3. Let o be x(-8). Let z = o + 7. Is z a multiple of 19? True Let x be 55/(-3) + (-16)/(-12). Let p = 31 + x. Is 13 a factor of p? False Let o(a) = a + 1. Let f be o(3). Suppose -3n - 3x + 0x + 12 = 0, 3n = -fx + 7. Is n a multiple of 3? True Let s(o) = 2o + 6. Let c(d) = -19 + 12d + 6 - 7d2 + 6d*2. Let u be c(10). Does 9 divide s(u)? False Let k(b) = 2b + 16. Is 8 a factor of k(0)? True Let i be 3/12 - 262/(-8). Let y = 59 - i. Is 13 a factor of y? True Let h be (-2)/(-3) - (-220)/(-6). Is (-1)/(-4) - 1431/h a multiple of 10? True Suppose 4u - 2z = 68 + 456, -3u - 3z = -411. Suppose -127 = -5k + u. Is 13 a factor of k? True Let o(w) = -w3 + 10w*2 - 10w. Is o(7) a multiple of 20? False Suppose c - 2f = 40 - 10, 150 = 5c - 2f. Does 10 divide c? True Let s = -7 - -14. Suppose -2l + 1 = -s. Is 89/4 + (-1)/l a multiple of 9? False Let u(c) = 4c - 4. Let v(y) = y - 1. Let b be v(7). Suppose k - bk = -30. Is u(k) a multiple of 10? True Let p be (3 - 2) + 1-1. Suppose 3r - 2m - 23 = p, -2 = r + 4m - 5. Let j = 23 - r. Is j a multiple of 8? True Let m = 97 + -65. Is m a multiple of 14? False Suppose -3g + 5v = -7g + 52, 4g = 4v + 52. Is 4 a factor of g? False Let c be 534/18 - 2/(-6). Is ((-8)/(-3))/(10/c) a multiple of 3? False Let w be 36/82/1. Suppose -29 = -5v - w. Is v a multiple of 2? True Let r(o) = o + 8 + 6o2 + 3 + o3 - 3 - 8o. Is 3 a factor of r(-7)? False Let p be ((-3)/9)/((-1)/(-6)). Is 12 a factor of (0 - (p + -1)) + 9? True Let i(t) = -2t - 4. Let s(h) = h*3 - 7h*2 + 7h - 9. Let u be s(6). Let j be i(u). Let p(y) = y*3 + 2y*2 + 2y - 2. Is p(j) a multiple of 11? False Suppose 5o = 4i + 20, i = 4o - 2i - 15. Let c(t) = -t3 + t2 + t + 23. Does 16 divide c(o)? False Let p(g) = 3g - 22. Let w(i) = 16i - 111. Let y(q) = -11p(q) + 2w(q). Let o be y(0). Suppose -2s = -6s - h + o, 2s = h + 4. Does 4 divide s? True Suppose -4l + 36 = -l. Does 6 divide l? True Does 6 divide (-296)/(-10) + 12/30? True Let h(t) = -2t + 10. Let m be h(7). Does 14 divide (21/m)/((-12)/32)? True Let t be (-1)/((-2)/4) + 2. Suppose -t = -2k + 6. Suppose -kv + 140 = -5. Is v a multiple of 14? False Let z = 0 + 4. Let o(m) = 1. Let h(u) = -6u + 4. Let q(r) = zo(r) - h(r). Does 3 divide q(1)? True Suppose -4q = -0q. Suppose m = -4u - 4m, 4u - 5m = q. Is 7 a factor of -2 - (27/(-3) - u)? True Let f = -2 + 7. Suppose 16 = 2g + 5i - 19, 2g - 85 = fi. Is g a multiple of 15? True Let i = 3 + -4. Let p be (i/(-2))/((-2)/(-8)). Suppose j = pj - 6. Does 6 divide j? True Let g(w) = 3w2 - 6w - 1. Let m be g(-4). Let s = 185 - m. Suppose 0 = 4v - v - s. Is v a multiple of 12? False Suppose j + j = 296. Is j a multiple of 37? True Let o(z) = z2 - 1. Let v(r) = r2 + 10r + 7. Let j(q) = -2o(q) + v(q). Let f be j(9). Is f/(-4)(-48)/9 a multiple of 12? True Let s be (4/(-10))/(5/1825). Let z be (6 + -5)2/(-1). Does 26 divide 3/(3z/s)? False Let i(m) = m*3 + 5m*2 - 5m + 8. Let w be i(-6). Let d(q) = 5q3 - 3q*2 + q + 1. Does 31 divide d(w)? True Suppose 4x - 345 = -x. Is x a multiple of 23? True Let t = 21 - 12. Is t a multiple of 3? True Let o = 78 - 42. Does 18 divide o? True Let b = 4 + -3. Let z be 2 - 4 - 2/b. Is 4 a factor of 4/z(-20)/2? False Let v be 6/2 - (-3 - 0). Suppose -1 = t, -2n - 3t + 19 = v. Is 8 a factor of n? True Let f = -69 + 109. Suppose -r + 5 = 2x - 2r, 3x - f = -5r. Does 3 divide x? False Suppose 4u - 63 = 57. Is u a multiple of 10? True Does 12 divide ((-52)/10 + 4)/(3/(-260))? False Let u = 19 - 27. Let p = 31 + u. Does 13 divide p? False Let y(b) = b*3 - 14b*2 + 24b + 9. Is y(12) a multiple of 9? True Let d = 38 + -23. Is d a multiple of 5? True Let n be -3 + 3(1 - 0). Suppose n = 3q - 22 + 4. Is q a multiple of 3? True Suppose 14 = l - 2h, 4 = -h + 1. Is l/(-2)4/(-8) even? True Suppose z = -4z. Let o(j) = j2. Let p be o(z). Suppose 2u + 4n - 3 = -7, -3n - 12 = p. Is 6 a factor of u? True Let v(l) = 5l + 4 - 3 - l + 5. Does 11 divide v(9)? False Suppose c + 2r - 7 = 0, 19 = 2c + 6r - r. Is (-1)/((-3)/(3 - c)) even? True Suppose 0 = 2k - 0k - 24. Is 4 a factor of k? True Suppose -2g + 242 = 3s, 0s - 3g - 300 = -4s. Is s a multiple of 14? False Suppose -3b + 19 = 4s, -4s + 14 = -b + 3b. Suppose s = l - 11. Is 12 a factor of l? True Let r(p) = 0p + 5p2 + 0p + p3 + 3. Let d = -2 + -3. Is r(d) a multiple of 3? True Let g(i) be the first derivative of i3/3 - i*2/2 - 8i + 2. Is g(6) a multiple of 17? False Suppose -3 = -2t + 5b, 3t + 3b - 36 = -0b. Does 4 divide t? False Suppose 0v - 4 = v - 3l, -2v + 4l - 2 = 0. Suppose vx - 369 = 151. Suppose -4w + x = -16. Does 11 divide w? False Let p be 153/4 + 5/(-20). Let f = p + 1. Is f a multiple of 13? True Suppose -n + 5n = 136. Is n a multiple of 3? False Suppose 3d = -2d + 55. Is (-3)/6d-4 a mu	{ "pile_set_name": "DM Mathematics" }
assuming p is positive. p*(-40/51) Simplify (h/(hh/h10))/h28 assuming h is positive. h(-19) Simplify ((q/(q(-7/5)q))/q)/((q/q(-4/3)q)/q) assuming q is positive. q(-29/15) Simplify (n(4/5))(-37) assuming n is positive. n(-148/5) Simplify (ggg*(-10/13)g)/(gg2) assuming g is positive. g(-10/13) Simplify (p(-2)/((ppp(-3)p)/p))/(p*(-7)/(p/(pp*(-1)/p)p)) assuming p is positive. p*9 Simplify (uuu(-1/5)uu(-3))(-20) assuming u is positive. u4 Simplify (tt(1/33))/t17 assuming t is positive. t(-527/33) Simplify (v/(v/(v(2/51)/v)v))/v(-15/4) assuming v is positive. v(365/204) Simplify ((zz/(z/(z/(((z*(2/7)z)/z)/z))z))/zz/(zz(zzz*(-2))/z)z)(-43) assuming z is positive. z(-516/7) Simplify g*2/((gg/g*0)/ggg)(g/((g/g*(-5))/g)g)/g5 assuming g is positive. g(-9) Simplify m*(-2)/(mm/m*(-1/4))m*(-3/5)mm(m/(mm(-4)m))/m assuming m is positive. m(-17/20) Simplify ((i(-2))25)(-49) assuming i is positive. i2450 Simplify a1/(a/a(-6/7)) assuming a is positive. a(-6/7) Simplify ((m*(-13/5)/mm)/m)/m9 assuming m is positive. m(-63/5) Simplify (p/p*(-4)pp6/p)/(p(-1/2)/ppp(-1/9)/p) assuming p is positive. p(227/18) Simplify (y(1/7)y)/(y(y(-10/9)y)/y) assuming y is positive. y*(79/63) Simplify (cc*(-1)/ccc(c/(c(-6/11)/c))/c)(2/63) assuming c is positive. c*(8/99) Simplify mmm4m/(m*8m)m(-2/9)/(m(1/3)/m) assuming m is positive. m(-14/9) Simplify (f(3/16)f)(1/2) assuming f is positive. f(19/32) Simplify (v*(-7)v/((vv/(v(-2/7)v))/v))(-15/7) assuming v is positive. v(660/49) Simplify (c1)33/(c0)(5/2) assuming c is positive. c*33 Simplify (gg*(1/2)g)15/(g(2/9)/gggg(-3/8)) assuming g is positive. g(2639/72) Simplify (kk*(-1)/kk)*(28/5)k3/k(-5) assuming k is positive. k*8 Simplify (j/(j(j*(-3/4)/j)/j))/(j/(j/(jj*(1/3))j))(j(2/3))48 assuming j is positive. j(413/12) Simplify ((k/k0)(6/19))(2/113) assuming k is positive. k(12/2147) Simplify ((((qq/(q/(qq/(qq/q*1))))/qq)/q)(-2/13))(6/17) assuming q is positive. q*(-12/221) Simplify ((bb/b(2/5))/(b/(b/(((b/((b/(b(-7)/b)b)/b))/b)/b))))(-1/2) assuming b is positive. b(-29/5) Simplify (kk*0k(-3))/(k(2/19)k5) assuming k is positive. k(-135/19) Simplify (w(1/7)w)/(w/w*(4/5)w)(ww*(-2/13)w)/(wwww/w(-1)) assuming w is positive. w(-1461/455) Simplify ((hh/h*(3/11)h)/h(-1/8))/((h/h4)/hh/h(2/7)) assuming h is positive. h(3781/616) Simplify (s/(sss11)ss1)/((s/s(2/15))/((s/((ss10/s)/s))/s)) assuming s is positive. s(-298/15) Simplify (((d*(-3/2)/d)/d)/dd)/d*1(d(2/7))(-3) assuming d is positive. d(-75/14) Simplify (m(-4)mm(-2/7))/((m(-4/3)/mm)/(m(2/5)m)) assuming m is positive. m(-58/105) Simplify d(-1/3)/(d/(dd(1/5)))(d/(d*2/d)d)/(d/d(1/14)) assuming d is positive. d(-13/210) Simplify (a((a/a(-1/12))/a)/a)/(a/(a/a(-7)))(a4/a)/a3 assuming a is positive. a(85/12) Simplify (d(-2/3))(27/4) assuming d is positive. d(-9/2) Simplify ((g/(gg(-2/13))g)/(g/((g*(-7)gg)/gg)))/(g*8g(-3/2)) assuming g is positive. g(-295/26) Simplify (ll/(l/((ll(-8/7))/l)))/l(-26/3) assuming l is positive. l(179/21) Simplify b(1/3)/bbb/b*(1/7)b(((b/b(4/7))/b)/b)/b(-7) assuming b is positive. b(160/21) Simplify p(3/2)p/p*6pp(4/5)/p(ppp*(-10)p)/p assuming p is positive. p*(-107/10) Simplify (n/(nn/(n(n(3/4)n)/n))(n/((nnn/n(1/11)n)/n))/nn)(-19) assuming n is positive. n(969/44) Simplify (l(-5)l)/llllll/(l/((l(-11)/l)/l)) assuming l is positive. l(-14) Simplify (p/p(1/2))/pppp*(-6)ppp(p/(p/((p/(p(-1/3)/pp))/p)p))/ppp(-6) assuming p is positive. p(-49/6) Simplify s(2/5)/(s8s)(((sss(-2)s)/s)/s)(-15) assuming s is positive. s(32/5) Simplify (jj(6/13))/(j/(j/j(-9/2)j)) assuming j is positive. j*(181/26) Simplify (f/(fff(1/6)f))14 assuming f is positive. f(-91/3) Simplify (t(-6))(-10) assuming t is positive. t60 Simplify (t/(t(2/119)/t))/((t/t*(-23))/tt) assuming t is positive. t(-2620/119) Simplify ((n/n(1/11))/(nn(1/5)))/(n(-4)/((n/(n/n0))/n)) assuming n is positive. n(149/55) Simplify (((h/h(2/25)h)/h)/h(1/8))/(h(3/7)((h/(h/h5))/h)/hhh) assuming h is positive. h(-6487/1400) Simplify c(1/4)c/c*(-1/2)cc/(c(c*(-2/7)c)/c)c4 assuming c is positive. c(197/28) Simplify (b/(b/(b/b(-2))))(-1/24)/(b/b(-2/3))42 assuming b is positive. b(-561/8) Simplify ((d(4/3)d)/d(-5))(2/3) assuming d is positive. d(44/9) Simplify (u(2/35)/u)(-9) assuming u is positive. u(297/35) Simplify ((yy(-2))/(y/y6))/(((y/y1y)/yy)/(yyy(-8)y)) assuming y is positive. y(-2) Simplify (q/q(-12))/(q/((q*(-14)qq)/q)) assuming q is positive. 1/q Simplify m/(m15m)((m/(m(-1/19)/m))/m)/m assuming m is positive. m(-284/19) Simplify (m(-3/11)/m)/m17 assuming m is positive. m(-201/11) Simplify (p/p(20/7))12 assuming p is positive. p(-156/7) Simplify w(-17)/w(-14) assuming w is positive. w(-3) Simplify (p(11/6)/p1)(-17) assuming p is positive. p(-85/6) Simplify ((gg*(-16)g)/g)/(g/g(-2/3)) assuming g is positive. g(-50/3) Simplify (ww(-9/2))(-1/4) assuming w is positive. w(7/8) Simplify f(-5/2)/f(-1/18) assuming f is positive. f(-22/9) Simplify (g/(g(g(g(-3)g)/ggg)/g))30/(g(2/27)(g(-1/11)/g)/g) assuming g is positive. g(9509/297) Simplify (d5d)(-5/4) assuming d is positive. d(-15/2) Simplify p/(p*(-3/17)p)p(-5/6) assuming p is positive. p(-67/102) Simplify b(2/9)/b(-3)b2/b(1/5) assuming b is positive. b*(226/45) Simplify c/(cc/(c/c*(-7)))cc7cc7/c(-2/15) assuming c is positive. c(347/15) Simplify (o1/o)(2/11)(oo(1/9)/o)/o(2/3) assuming o is positive. o(-5/9) Simplify (t(2/5)t*7/t)/(((t(t*(-2/3)tt)/ttt)/t)/tt)(-6/7) assuming t is positive. t(42/5) Simplify (r/r(-15/4))(-42) assuming r is positive. r(-399/2) Simplify c(-4)/(cc/(c/(cc*2cccc)))(c*(2/13)c)/c(c/c(-2/7))/c assuming c is positive. c(-1052/91) Simplify ((oo/(o/o*5))/o)/(ooo/(oo(o(-6)o)/o)) assuming o is positive. o*(-2) Simplify c/(cc/(c*(-19)/c)c)ccc12c assuming c is positive. c*(-7) Simplify (rrr(-3/8)/r)40 assuming r is positive. r25 Simplify (j(2/5)jj)/jj*(2/15)/j(j(j(-1/3)/j)/j)26 assuming j is positive. j(-512/15) Simplify (k/k(-2/29)((kk(2/3)/k)/k)/k)/(k(3/11)/(kk*(1/10)kk)) assuming k is positive. k(24527/9570) Simplify (uuu(-2/9)/u)(-1/19)(u/(u/u*(3/5))u)/(u(uu/(uu1)uu)/u) assuming u is positive. u(-377/855) Simplify (u/(u/u(1/7)))(-3/14) assuming u is positive. u(-3/98) Simplify kk*(-2)k*6(k(((k/((k/k(-2/5))/kk))/k)/k)/k)(10/7) assuming k is positive. k(11/7) Simplify ((aa(-2/3))/a)21/(a(-9)aa(-3/4)) assuming a is positive. a(-21/4) Simplify h(3/7)((hh/(h/((h/((hh*(-5))/h))/h)))/h)/hh*5h(hh(-5))/h assuming h is positive. h(38/7) Simplify ((h(h/(hh*(-1/2)h))/hh)(-3/25))(15/4) assuming h is positive. h(-9/40) Simplify (y/(y/((yy1)/y)))(-1/4)/(y(-2/5))(-2/17) assuming y is positive. y(-101/340) Simplify (c9)(-3) assuming c is positive. c(-27) Simplify qqq*(-30)q(1/22) assuming q is positive. q(-615/22) Simplify h*6h*(2/3)h*(-2/21)hh/(h/(h(-4/5)h))h assuming h is positive. h(307/35) Simplify (d/(d(-36)d))/(d*24d) assuming d is positive. d*11 Simplify (z((zz(-2))/z)/zz(-4)/z)(-6) assuming z is positive. z42 Simplify b/b13b5 assuming b is positive. b(-7) Simplify (f/(f(5/12)/f))/(f(-28)/ff) assuming f is positive. f(355/12) Simplify (r/(r(-3)r)rr0/r)/(r/r(1/3))(-4/5) assuming r is positive. r(53/15) Simplify (m(5/3)m/m*5)/((mm*(5/3))/(mm/m(6/11))) assuming m is positive. m(-39/11) Simplify (v/(v*(-8)/v))/(vv/(v(-41)/v)) assuming v is positive. v(-34) Simplify (((g/(g/g(-5)))/g)/g)22 assuming g is p	{ "pile_set_name": "DM Mathematics" }
i6 + 39i*3 + 78i*2 - 1? -480i*3 + 234 Find the second derivative of -43f*2gi2r + 16f2g - 2f2i*2 + 7fgi - fg + fi + 2gir - 4i*2r wrt f. -86gi*2r + 32g - 4i*2 Find the third derivative of -ht*4 - 14ht3 - 82ht - t2 wrt t. -24ht - 84h What is the third derivative of -171d4 - 217d*2? -4104d Find the second derivative of 209k4 - 23k + 1. 2508k2 What is the second derivative of -1064b*5 + 36b + 9? -21280b3 What is the first derivative of -2f*3l2 + f3 - 39f2l*2 - 2fl2 + 24f wrt l? -4f3l - 78f2l - 4fl Find the second derivative of -3s5 - 25s*4 + 368s wrt s. -60s3 - 300s*2 What is the third derivative of 2317k*5 + 1703k*2? 139020k*2 Find the second derivative of 2o*5 - 48o. 40o3 What is the third derivative of 9m*6 + 2m*2 + 642m? 1080m3 What is the second derivative of -2343p*3 + 11p - 14? -14058p What is the third derivative of 22s6 - s5 - 3s3 + 2s*2 - 20s - 19 wrt s? 2640s3 - 60s*2 - 18 What is the first derivative of -2dh3 - 14d - 88h3 wrt d? -2h*3 - 14 Differentiate 4320c*2 + 17789. 8640c What is the third derivative of -2mr*3z - mr3 + 3mr2z + 2mrz + 5mr + 3mz + 3r*3z + 359r3 - 3r*2 wrt r? -12mz - 6m + 18z + 2154 What is the second derivative of 17i*3u*2 + 7i*3 + iu*2 + 11iu - 2u*2 + 86u wrt i? 102iu*2 + 42i What is the first derivative of -134gn + 2547g + 13n wrt n? -134g + 13 What is the third derivative of 3f*2v*6 + 126f*2v*3 - 11f*2v*2 - 44f*2v wrt v? 360f2v*3 + 756f*2 Differentiate -1017q + 935 wrt q. -1017 Find the second derivative of 13y3 - 15y*2 - 80y - 3 wrt y. 78y - 30 Differentiate 905a*2 + 5173 with respect to a. 1810a What is the third derivative of -2z6 + 29z*4 - 150z*2? -240z*3 + 696z What is the derivative of c*4q*3 + 3c*2 - 81q3 + q2 wrt c? 4c3q*3 + 6c What is the derivative of -4346j4 + 7576 wrt j? -17384j*3 What is the second derivative of 8f*2p*3y + f*2p*2y + 4f2y - 2f2 - 3fp3y - 1056p3 wrt f? 16p*3y + 2p2y + 8y - 4 What is the first derivative of 16248r*4 + 8681? 64992r*3 Find the third derivative of -2b*3l*3y*2 - 14b*3l*2y + 3b2l*2y - 2bl*3 + 2bly*2 - 4by2 wrt b. -12l*3y*2 - 84l*2y What is the second derivative of 2a2u*2 - 10a*2 - 30au - 110u*3 wrt u? 4a*2 - 660u What is the second derivative of -4n3y*3 + 22n*3y - n*2y + 38ny*3 - 3ny2 - 15n - 2y2 - 4y wrt y? -24n3y + 228ny - 6n - 4 What is the derivative of by*4 - 37by - b wrt y? 4by3 - 37b Find the third derivative of -a*6 - 588a*4 + 6a*2 + 3a - 21. -120a3 - 14112a What is the first derivative of -1518b2 + bh*2 + 11482h*2 wrt b? -3036b + h*2 What is the second derivative of 630h*4o*2 - 3h*3o*2 + 73ho2 + 2ho + 3h wrt h? 7560h2o*2 - 18ho2 Find the third derivative of -7566g*3v - 4g2v - 9gv + v wrt g. -45396v What is the third derivative of -127o*4 + 95o*2 - 1 wrt o? -3048o Find the second derivative of 904g5 + 206g + 1. 18080g3 Find the third derivative of -2w*4x - 3w3x2 - w3 + 2w2x + 70wx*2 wrt w. -48wx - 18x*2 - 6 Find the first derivative of 7k*2wx2 + 126k*2w + 2wx + w - 2x2 - 2x wrt x. 14k2wx + 2w - 4x - 2 Find the third derivative of -3942g*4 - 2739g*2 wrt g. -94608g What is the third derivative of -426j6 - j2 + 140j wrt j? -51120j3 Find the third derivative of 85s*5 + 12s*4 - 2s*3 - 2764s*2. 5100s*2 + 288s - 12 Find the third derivative of o*4v*2 - 2o*3v*2 + 73o*3v - 5092o2v*2 wrt o. 24ov2 - 12v*2 + 438v What is the second derivative of -1127c2 + 1263c wrt c? -2254 What is the third derivative of -113q6 + 4q*5 + 605q*2? -13560q*3 + 240q*2 Find the first derivative of 11411o + 28484. 11411 Find the third derivative of m*3v*3 + 19m*3z - m*2v*2z + 82mv3 + v3z + v2z wrt v. 6m3 + 492m + 6z Find the second derivative of -866i*5 - 42i + 11. -17320i3 Differentiate 1362j*2k - 12j2 + 3jk - 7j + 2k - 9 wrt k. 1362j*2 + 3j + 2 Find the third derivative of 6h6 + 7h*3w - 3h2w - 4w - 1 wrt h. 720h*3 + 42w What is the second derivative of 243h3 + 800h? 1458h What is the second derivative of -3q*5 + 52q*4 + 11q*3 + 12q + 77 wrt q? -60q3 + 624q*2 + 66q Find the third derivative of 2np*3 + 113npy*3 - 14np - 6ny3 - 2ny2 + p3y*3 + 19p*2y*2 wrt y. 678np - 36n + 6p3 Find the first derivative of 2a*2 + 2821ab3 - 7b*3 - 8b*2 + b wrt a. 4a + 2821b3 Differentiate 9356c*4 - 8937 with respect to c. 37424c*3 Find the second derivative of -2f*5 - 6f*3o + 2f3 + f + 130o wrt f. -40f3 - 36fo + 12f Find the third derivative of 318b6 + 3b*3 + 1297b*2 - 2b wrt b. 38160b3 + 18 What is the third derivative of 6f*4 - 779f*3 + 10743f*2? 144f - 4674 Differentiate k*3x*2 + 159k*3 - 17kx2 with respect to x. 2k*3x - 34kx What is the third derivative of -126bq*5 + 8bq2 - 2q*2 wrt q? -7560bq2 Find the second derivative of 11p5 - p3 - 558p - 3. 220p*3 - 6p Find the first derivative of -1539p3v*2 + 16v*2 + 5v wrt p. -4617p2v*2 Find the first derivative of 13f*2q*2 + 9f*2 - 7q*3 + 4 wrt q. 26f*2q - 21q2 Find the third derivative of -300n*4 + 2n*3 + 53n*2 - 3 wrt n. -7200n + 12 Find the second derivative of -f*5n - 50f4n*2 - 2fn2 + 97n*2 wrt f. -20f*3n - 600f2n*2 What is the second derivative of -33r*2s3 + r2s - 6r*2 - 2r + s*4 wrt s? -198r*2s + 12s2 What is the derivative of 1139s - 319? 1139 Differentiate 2441d4 + 11321 with respect to d. 9764d*3 What is the first derivative of 7t*3u*2 + 2t*3uz - 140t*3 - 13tu2z - 19tz*2 wrt z? 2t*3u - 13tu*2 - 38tz What is the third derivative of 7i*4 + 51i*3 - 2i*2 - 532i - 2 wrt i? 168i + 306 What is the derivative of 1386w*3 - 724 wrt w? 4158w*2 Find the second derivative of -32fg2p*3 - 2f + 2g2p2 - g2p + 51g*2 - gp*3 wrt p. -192fg2p + 4g2 - 6gp What is the third derivative of 517j*3x*3 - 94j*3x - x*2 wrt x? 3102j*3 What is the derivative of 217br + 4b - 1725r wrt b? 217r + 4 Find the third derivative of -2lz*6 + 92lz3 + 2lz2 - 9l + 2z6 + 8 wrt z. -240lz3 + 552l + 240z3 What is the third derivative of 180m*3 - 35m*2 + 4m? 1080 What is the second derivative of 8l2y*4 + 15l*2y3 - l2 + 15l - 5y + 1 wrt y? 96l2y*2 + 90l*2y Find the second derivative of -578r5 + 242r wrt r. -11560r3 Find the first derivative of 5425ms2 + 4s*2 - 2s + 154 wrt m. 5425s2 What is the third derivative of -231cn3 + 4cn + 2n*4 - 2n*3 - 2n*2 + n wrt n? -1386c + 48n - 12 What is the second derivative of 2r*2tz2 - 30r*2t + 4r2 - 3rz2 + tz*3 - 19z*2 - 7z wrt z? 4r2t - 6r + 6tz - 38 What is the second derivative of -2f*4 + 642f*3 - 100f wrt f? -24f2 + 3852f What is the third derivative of -301r5 + 2r*4 - 917r*2? -18060r*2 + 48r Differentiate -14s3 - 12s*2 + 563. -42s*2 - 24s Differentiate 3934oq + 2os - 3qs - 2q + 14s + 4 wrt o. 3934q + 2s Find the third derivative of -13o5 - 3o*3s*2 + 68o*2 + 2os2 + 2o wrt o. -780o2 - 18s*2 Find the second derivative of 5a*3n*3 - 5a*2n*3 - 3an3 + 5an - 1 wrt a. 30an3 - 10n*3 What is the third derivative of -19098q*6 + 2q*2 - 11495? -2291760q*3 What is the third derivative of -156np4 + 12np2 - 5n - p*4 wrt p? -3744np - 24p What is the third derivative of 1468a4 + 2a*2 - 249? 35232a What is the second derivative of 11929p2 + p - 9287 wrt p? 23858 Differentiate -2a*2 - 9an - 18a + 51n - 13 with respect to a. -4a - 9n - 18 Differentiate -2427o*2 + 3288 wrt o. -4854o Find the second derivative of 47g5 + 2g*4 + 19g*2 + 4002g. 940g3 + 24	{ "pile_set_name": "DM Mathematics" }
- -43/4. Is h != t? True Let t = -2179 - -2178.94. Which is smaller: t or -11.8? -11.8 Let c = -28048 - -28034. Let t(x) = x*3 + 5x*2 + 6x + 2. Let q be t(-5). Is c less than q? False Suppose 3051 = 18n - 495. Let v = n + -200. Let m = -377 - -3376/9. Which is greater: v or m? m Let v be 6/9(-7 - -4) + 17. Let p(l) = -11l + 24l + 34 - vl + l3. Let i be p(0). Which is smaller: i or 33? 33 Let q be 324/(-8)17/(51/6). Let z be 992/(-12) + 3/(-9). Is q at least as big as z? True Let a = -57 - -128. Suppose -49 = 3i - 259. Let b = a - i. Which is greater: b or -46? b Let n = -314.19 - -174.19. Which is bigger: 2/15 or n? 2/15 Suppose 3u = -k + 13, -7k + 5u + 1 = -3k. Let h be (-9 - -9) + (-2 - -9). Is h > k? True Suppose 758 = -4a + 794. Suppose -m = -d + a, 0 = -3d - d - 12. Is -12 >= m? True Suppose 0 = -5d + 4d. Let r = -767 - -789. Suppose -5b + 50 = -5f, 0 = 31f - 32f + 4b - r. Which is smaller: d or f? f Let a = -33.63 + 34. Let u = 107.06 + -106.59. Let z = a - u. Which is smaller: z or -15? -15 Let l = -109 + 236. Let q = 89 + 37. Let s = q - l. Is -25 bigger than s? False Let q be (-26711026)/(-2232) - 1/(-4). Let t = 11954 - q. Is t < -15? False Suppose 0p = -2p - 38. Let l(x) = -x*3 - 18x*2 + 19x + 13. Let b be l(p). Suppose 0 = -u + 5, n + u = -n - b. Which is smaller: n or -7? n Let p = -696 + 587. Let w be ((-3)/((-3)/(-347)))/3. Let a = p - w. Is 8 > a? True Let z(j) = -14j2 - 9j + 369. Let s be z(-19). Is s <= 1? True Let w = -369 - -369.3. Is -31 < w? True Let m = 4007149/77 + -52042. Which is bigger: m or -1? -1 Let s = 555 - 543.84. Let p = s - 11.1. Which is smaller: 2 or p? p Let z be 4/((-245)/500 - 3/(-6)). Let v = -808 + z. Is v equal to -409? False Let f be ((-5481)/(-504))/((-12)/(-8)). Which is smaller: 7 or f? 7 Let n = 7035 + -7034.6. Is n >= 975? False Let t = -104 + 301. Suppose 117 = -8v + t. Which is smaller: v or 81/8? v Let p = 602 - 606. Let x be (21)/((-8 - p)/2). Is 5/57 >= x? True Let m be -492/(-24)6. Suppose 2i = -4h - m, 4i - h - 4 = h. Is i < -1/36? True Suppose -174 = -2l - u - u, 3l = 5u + 301. Suppose 0 = -2p - 5v - 165, -1 = -2v + 1. Let s = 176 + p. Is s < l? True Let a(y) = 27y - 143. Let x be a(-6). Let i = x + 1524/5. Which is smaller: i or -1? -1 Suppose -7r - 2688 = 7r - 26r. Which is bigger: r or 5? r Let q be ((-956)/10)/((-2)/(-20)). Let s be q/20 - (-3)/(-15). Let k = -298 + 249. Which is greater: s or k? s Let p(g) = 63g - 702. Let u be p(11). Let b(q) = -14q - 3q2 + q2 + 2q*2 - 2q*2 - 8. Let w be b(-7). Is w at least u? True Let q = -9597 - -9620.991. Let t = 0.009 + q. Let h be (4 + -1 + -1)/(-3). Which is smaller: t or h? h Suppose 34 = 4y + 42. Let z be (1 + -3 - 12)/(y/11). Is 77 <= z? True Let p = 218 + -218.2. Let g = -809 + 788. Does p = g? False Let h be -4 - 0 - (-44)/(4/(-1)). Let t(p) = 4p2 + 50p - 13. Let j be t(h). Suppose 0 = -v + j - 141. Is -5 >= v? False Let h = -28699/56 + 3548/7. Which is smaller: 0.1 or h? h Let o be ((-24)/25326 + 0)(-75)/850. Is 1 at most o? False Let x = -52.07 - -52. Let r = -0.03 - x. Let w = r + -0.04. Which is bigger: 7 or w? 7 Suppose -5v = -10v - 5. Let f = 1834 + -359461/196. Which is smaller: v or f? v Let r = 41657/6 + -6976. Are -33 and r non-equal? True Let z(p) = 113p - 734. Let f be z(-37). Are f and -4917 equal? False Let q be (-2)/(-112)7 + 5852/40480. Which is greater: 1 or q? 1 Let j = -18002 + 18041. Let q be 606/48/30. Do q and j have different values? True Let r(b) = 3b2 - 2b - 61. Let v be r(7). Is -24 greater than v? False Suppose x = -5a + 103, -4a = 2x + 49 - 135. Let o be 8/a + 15/25. Is o < 2/53? False Suppose 0 = -3p + 165 + 6. Suppose -p = -3t + l, 0 = t + 4l + 5 - 11. Let j be (-6)/7216/t. Which is bigger: 1 or j? 1 Let r = 244 + 60. Let h = 304.149 - r. Let m = h - 0.049. Is m equal to -51? False Let n = -124.017 - -124. Let t = -0.283 + n. Let p = 120.92 + -121. Do p and t have different values? True Let n = 844 - 842. Let v be n/(-4)0(0 + -1). Are 2 and v unequal? True Let h be 2/(-3)3/44. Let j = h - 39/110. Let c = -14067.96 - -14068. Which is greater: c or j? c Let n(x) = -15x3 - 3x*2 + 15x - 1. Let w be n(2). Is 0.03 at most w? False Let o = 2483 - 2480.4. Is 2/23 > o? False Let z(r) = 35r2 + 1. Let y be z(1). Let b be (-56 + 106420/1904)8/(-3). Which is greater: b or y? y Suppose 0 = -5y + z - 17 + 23, 2y = z. Is -2693/6 bigger than y? False Let u = 5 - 0. Suppose 3p - 23 = 2r, -2p + 3 + 8 = 3r. Suppose -uv + 22 = x, -p = -2v - x + 3. Is -3 > v? False Let i = 58 + -56.76. Let o = i - 0.46. Let a = -9213 - -9213.1. Is a smaller than o? True Suppose q = 3, -4c - 10q + 11q = 3. Suppose b = -b - cb. Let y be (-2)/6 - (-82)/264. Which is smaller: y or b? y Let t = -170005 + 170005. Let d = 32/91 - 10/39. Is t < d? True Suppose 19n + 184648 = 5n + 54112. Are -9324 and n non-equal? False Let g(x) = -3x3 + 30x*2 + 4x + 37. Let l be g(18). Let t = -160973/21 - l. Which is greater: t or 1? t Let q = -554 - -904. Let c = -218 + q. Which is bigger: c or 133? 133 Suppose -14497 = -143x + 162x. Which is smaller: -761 or x? x Let s be -9216/18 - 5. Let x = s - -326. Suppose 2q + 1 = q. Is q smaller than x? True Let w = -24.05 - -23.9. Let l = -0.109 + w. Is l greater than -1? True Let r = 1.8 - 9.7. Let p = r + 101.9. Are p and 2/7 unequal? True Let y be 10980/(-2745) + (-9)/(-2)4/(-2). Which is bigger: y or -57? y Let h = 20155/7 - 60021555/20846. Is h <= 0? False Let q = -0.333 - -0.043. Let p = q + 4.29. Is p not equal to -3? True Let x = -1.43 + 1.532. Let c = -0.052 + x. Which is greater: c or -0.01? c Suppose -2h = 109h. Which is bigger: h or -15/884? h Suppose -4n - t - 278 = 0, -n + 2t - 61 = -5. Which is smaller: n or -69? -69 Let o = 816 - 815. Is o greater than -2/979? True Suppose -2b + 2u - 7u + 47 = 0, 5b - 3u = 71. Suppose 142s - 1467 = -473. Which is bigger: s or b? b Suppose -5 = 7q - 2q. Suppose 49 = -6s - s. Let z be 2/5(s + 2). Which is bigger: q or z? q Let m be -8 + 1014/130 + (-204)/155. Is -2 at least as big as m? False Let o(d) = -d2 - 10d - 26. Let t be o(-9). Let u(m) = -16m3 - m2 + m. Let b be u(1). Let x = t - b. Which is bigger: 1/38 or x? 1/38 Let d = 7863/16 + -78521/240. Which is bigger: d or -0.2? d Let v = 1195 - 1310. Is v at most 3? True Let k = 469 - 430.5. Let t = -39.5 + k. Which is smaller: t or 43? t Let u = -37246 - -40056. Is u > 2807? True Let o = 1 - 115/113. Suppose 75u - 82u = -126. Suppose -25 + u = -7d. Is d at most as big as o? False Let u be ((-1427)/(-304))/(3(-1)/2). Let b = u + 77/24. Is 1 < b? False Let c = 818 - 870. Which is smaller: c or -51? c Let a = 964 + -437. Let i = a + -526.94. Are 0.5 and i nonequal? True Let i(o) = -25o + 22. Let k be i(6). Let t(j) = -58j + 163. Let z be t(5). Which is smaller: k or z? k Let s(v) = 26v + 74. Let l be s(-9). Let f = l - -639/4. Is f less than 8/15? True Let g = -387 + 391.1. Let o = g + -1.2. Which is smaller: 6 or o? o Let n = 2780118/265 - 10491. Let i be 4 - 2 - (-10716)/(-5565). Let v = i + n. Which is smaller: v or 0.1? v Let v = 13 + -33. Let d be (-2 - 1)(-232)/v-5. Let m be d/(-7) + (-3)/21. Which is smaller: m or 0.2? m Let x = -7.789 + 10.623. Which is smaller: x or 3/8? 3/8 Let g = -26 + 26. Suppose 0 = -d - gd. Suppose d = 2u + 4z - 18, u - 18 = -3u + z. Which is greater: u or 3? u Let c be (1128/(-48) - -13)/(2/8). Which is smaller: 34 or c? c Let m = 3514198/1114569 + -8/18891. Which is smaller: 2 or m? 2 Let d(c) = -c*2 + 6c + 4. Let r be d(6). Let v be ((-30)/12)/(-1(-6)/r). Suppose 4j = -j - 15. Which is smaller: j or v? j Suppose 2a + 80 = -13t + 15t, 4a + 115 = -5t. Let u be (a/(-63))/(88/12). Which is smaller: 1 or u? u Let v = -1.11 - 0.09. Suppose 0 = x - 228 + 280. Let n be 4 - (x/(-14))/1. Which is smaller: n or v? v Let v = 774649/10 - 77588. Let r be 1 + ((-3615)/(-6))/5. Let f = v + r. Is -2 at most as big as f? True Let w(y) = -y2 + 13y - 40. Let r be 760/228*(-6)/(-4). Let l be w(r). Is 19/33 < l? False Let p = 3009 + -2973. Is 18 < p? True Let j = -39.23 - -38.83. Do -112/3 and j have different values? True Suppose -11 - 5 =	{ "pile_set_name": "DM Mathematics" }
). -1588 - 14sqrt(11) Simplify -5((sqrt(132)3-6)/(sqrt(12) - (sqrt(12) + (sqrt(12) + 1sqrt(12))-2)) + 2). -10 + 45sqrt(11)/2 Simplify (-1sqrt(1100)1)/((-2sqrt(576) + sqrt(576))2). 5sqrt(11)/24 Simplify (-1(sqrt(209) + (sqrt(209)1 + sqrt(209) + sqrt(209) - sqrt(209))) - (sqrt(209) + -1sqrt(209) + sqrt(209))2)/(-2(sqrt(1584)-1 - sqrt(1584))). -5sqrt(19)/48 Simplify (5(sqrt(175) + 6(sqrt(175) + 3)))2 + (-1sqrt(175) + -5 - ((sqrt(175) + sqrt(175) + 0)2)2). 31495sqrt(7) + 219670 Simplify (3 + (-4 + sqrt(882) + 3 + sqrt(882) - sqrt(882)) + 3)*2. 210sqrt(2) + 907 Simplify (2 + sqrt(16)/(sqrt(32)-4))5. -5sqrt(2)/8 + 10 Simplify 2((-1 + (sqrt(288) - -1sqrt(288))/sqrt(6))2 + 5). -32sqrt(3) + 396 Simplify (sqrt(11) - (sqrt(11) + -2 + sqrt(11)))5 + sqrt(11) + 4 + (-4-2sqrt(88) + sqrt(88))/sqrt(8). 14 + 5sqrt(11) Simplify 2 + (1 + ((sqrt(50) - sqrt(100)/sqrt(2)) + sqrt(50))*2 - (sqrt(12)/(2sqrt(6)) + 1sqrt(200))2). -335/2 Simplify (((1sqrt(126))/sqrt(7) + (sqrt(18) + sqrt(18)-1)6)/((-3-1sqrt(72))/sqrt(8)))*2. 2/9 Simplify (-3sqrt(931)-1-1 + (sqrt(931) - (sqrt(931) + -1)) + -3 + (sqrt(931) - (sqrt(931) - (2sqrt(931) + 2))))2. 931 Simplify ((sqrt(468) + 0 + -5 - sqrt(468))2 + 1)-5. -130 Simplify 1 + 3 + sqrt(2450) + -5. -1 + 35sqrt(2) Simplify (42sqrt(68) + 0 + -4)6. -24 + 96sqrt(17) Simplify ((((sqrt(1700) - (sqrt(1700)-4 + sqrt(1700))) + sqrt(1700))5 - 1sqrt(1700)-2) + 4)2. 2160sqrt(17) + 1239316 Simplify -4 + (-31sqrt(78))/(sqrt(384)3) + -3. -7 - sqrt(13)/8 Simplify 6((sqrt(270) + (2sqrt(270) - sqrt(270)))/sqrt(6))/(1sqrt(81)). 4sqrt(5) Simplify 0 + ((-2sqrt(1728) + sqrt(1728))*2 - sqrt(1728)) + 5. -24sqrt(3) + 1733 Simplify (5((sqrt(130) - -2sqrt(130))5 - sqrt(130)))/(-4(sqrt(150)/sqrt(3))/sqrt(5)). -35sqrt(13)/2 Simplify ((sqrt(77) + 2sqrt(77)4)-5)/(sqrt(539) + -2-2sqrt(539)). -9sqrt(7)/7 Simplify sqrt(5)4-1 + -5 + (-3sqrt(2835))/sqrt(7). -31sqrt(5) - 5 Simplify (4(-2sqrt(171)4 + 3)-2)2. -9216sqrt(19) + 700992 Simplify -1 + ((sqrt(19) + -2)1 - sqrt(19)) - (sqrt(95)/sqrt(5)-3 + -1). -2 + 3sqrt(19) Simplify (sqrt(280)/(sqrt(10)-22))/(1sqrt(4)6 + sqrt(4) + (sqrt(4) - (52sqrt(4) + sqrt(4)))). sqrt(7)/12 Simplify 3 + (sqrt(400)/(sqrt(30)/sqrt(3)))/((sqrt(88)2)/sqrt(11)). sqrt(5)/2 + 3 Simplify 0 + (sqrt(63) - sqrt(252)/sqrt(4))/sqrt(9) - (3sqrt(847) + -2). -33sqrt(7) + 2 Simplify ((-3(sqrt(35) + -2(sqrt(35) + sqrt(210)/sqrt(6))))/((sqrt(21)/sqrt(48) - sqrt(7))-3))2. 80 Simplify 2(sqrt(198)/(sqrt(33)/sqrt(3)) + sqrt(18) - ((sqrt(18) - sqrt(54)/sqrt(3))1 + sqrt(18)))/(-2sqrt(225)1). -sqrt(2)/5 Simplify (4 + sqrt(76) + -1 + sqrt(76))2 - sqrt(76) - 3(-1sqrt(228))/sqrt(12). 25sqrt(19) + 313 Simplify (4(sqrt(425) + 1 + sqrt(425))-6 + (sqrt(204)-14)/(sqrt(120)/((sqrt(10) - (sqrt(10) + sqrt(40))) + sqrt(10))))*2. 11328sqrt(17) + 947408 Simplify (1 + (sqrt(432) - (sqrt(432) + (sqrt(432) - (sqrt(432) + -3 + sqrt(432))) - sqrt(432))) + sqrt(33)/((3sqrt(99) - sqrt(99))/sqrt(9)))2. -98sqrt(3) + 7219/4 Simplify 0 + -4 + -5 + 2sqrt(7) + 5 + (sqrt(7) - sqrt(42)/(sqrt(6) - sqrt(54)) - sqrt(7)). -4 + 5sqrt(7)/2 Simplify ((sqrt(135) + -1sqrt(135))-6)/((sqrt(165)/sqrt(176))/sqrt(5)). 0 Simplify ((6(1 + sqrt(1100)))2 - (-4(sqrt(539) + -2))*2) + 2. 1168sqrt(11) + 30950 Simplify 2 + 4 + 4 + ((sqrt(112) + 0)-3 - sqrt(112))2 + 3. 1805 Simplify (-3 + (sqrt(228)/sqrt(192) + (sqrt(19) - sqrt(76)/(sqrt(12)/sqrt(3))))-1)*2. 3sqrt(19)/2 + 163/16 Simplify (sqrt(77) + -5sqrt(77)-2 - (sqrt(77) + (sqrt(77)1 + sqrt(77))-3))/(sqrt(70)/sqrt(40) - -2sqrt(847)). 32sqrt(11)/45 Simplify (sqrt(242)-3-2 + sqrt(242) + 2 + 3)*2. 770sqrt(2) + 11883 Simplify ((sqrt(304)-3)2 - (sqrt(19) + sqrt(684))4) + -2 + sqrt(171) + (sqrt(95)/sqrt(20) - sqrt(19))*2. -25sqrt(19) + 10955/4 Simplify ((-1 + sqrt(288) + sqrt(288) + sqrt(288) + sqrt(288))-12 + (-2(sqrt(288) + -1 + sqrt(288)) - -2(sqrt(288) - (0 + sqrt(288)))))*2. -1152sqrt(2) + 41488 Simplify 0 + (sqrt(7) - (1 + 4sqrt(7))) + (1 + sqrt(28)/sqrt(4) - (sqrt(7) - sqrt(70)/(sqrt(50)/sqrt(5))))2. -sqrt(7) + 7 Simplify 0 + (sqrt(304)-4 + sqrt(304) - sqrt(304) - (-4 + sqrt(19))1). -17sqrt(19) + 4 Simplify (sqrt(2156) - (sqrt(2156) - (sqrt(2156) - (sqrt(2156) + 1 + sqrt(2156) + 4))))*2 + 5(sqrt(396) + -1)*24. -100sqrt(11) + 10121 Simplify (sqrt(80)5)/(sqrt(250) + -2sqrt(250)). -2sqrt(2) Simplify (-2 + (-1 + (sqrt(1700) + 3)*2 - sqrt(1700)))3. 150sqrt(17) + 5118 Simplify ((sqrt(1300)2 + sqrt(1300))-6 + (sqrt(1300) - ((sqrt(1300) + sqrt(1300) + -3)2 + -1)) + 5)3. -15609 - 150sqrt(13) Simplify ((sqrt(52) + (sqrt(364)1 + sqrt(364))/sqrt(7) + sqrt(208)/sqrt(4)-6)/(1sqrt(16)1))2. 117/4 Simplify -5(sqrt(6655) - (sqrt(6655)1 - sqrt(6655) - sqrt(6655)))/((2sqrt(66))/sqrt(6)). -55sqrt(5) Simplify (-5(1sqrt(170)-4 - sqrt(170)))/((sqrt(30) - (sqrt(90) - (sqrt(90) - (2sqrt(90) + sqrt(90))))/sqrt(3))/sqrt(3)). -25sqrt(17)/2 Simplify 2(-5sqrt(396))*2 + (sqrt(110)-1-4)/sqrt(10). 4sqrt(11) + 19800 Simplify ((sqrt(90)1)/sqrt(5))/((sqrt(162)/sqrt(9))/sqrt(2))2. 2sqrt(2) Simplify 32(sqrt(88) + 1(sqrt(88) - -2sqrt(88)))/((sqrt(96) - (1sqrt(96) - sqrt(96)))/sqrt(12)). 24sqrt(11) Simplify -3(4 + ((-5 + sqrt(2448) + 0)3)2). -66783 + 3240sqrt(17) Simplify (sqrt(88) + (-3(sqrt(88)-3 + sqrt(88) - sqrt(88) - sqrt(88) - sqrt(88)) - sqrt(88)))/(-4sqrt(72))-4. 5sqrt(11) Simplify (2sqrt(104)2)/(sqrt(80)/sqrt(40)) - 1(-3 + (sqrt(1300) - -1sqrt(1300))). -12sqrt(13) + 3 Simplify (sqrt(242)-2 + sqrt(242) - sqrt(4)/sqrt(2)-3 - (sqrt(2592) - (sqrt(2592) + -4sqrt(2592) + sqrt(2592) - sqrt(2592)))/sqrt(9))2. 6272 Simplify ((((5(sqrt(136) + sqrt(136)1) - sqrt(136)) + sqrt(136))/sqrt(8) - (4 + (sqrt(153) - 2sqrt(153))/sqrt(9)))-5)2. -2200sqrt(17) + 51825 Simplify (sqrt(1029) + sqrt(1029)-21 - sqrt(1029))/(((sqrt(324)2)/sqrt(12))/sqrt(9)). -7sqrt(7) Simplify -1(2sqrt(1584)-2 + 3) + 3. 48sqrt(11) Simplify (sqrt(21) + sqrt(2541)1 + sqrt(2541) + 1sqrt(42)/sqrt(2) + sqrt(21))/(sqrt(49)/sqrt(112) + sqrt(35)/(sqrt(15)/sqrt(3))). 20sqrt(3) Simplify (64sqrt(95))/(-23sqrt(5)). -4sqrt(19) Simplify 4((sqrt(11)1 + 2)6 + 3)3. 180 + 72sqrt(11) Simplify 6(-3 + (sqrt(200) + -4)*2 + sqrt(200) + 0 + sqrt(200) + (1sqrt(200))*2). -360sqrt(2) + 2478 Simplify (((sqrt(77) - (sqrt(77) - (sqrt(77) - -1sqrt(77))))/sqrt(7) - (-3 + sqrt(99)) - -2(sqrt(11) + (2 + sqrt(11))-2)) + 5)2. 99 Simplify 1-2(0 + (sqrt(343)-1)*2 - 3(-1sqrt(343))2). 1372 Simplify (sqrt(171) + (sqrt(171) - (sqrt(171) + -2sqrt(171)-3 - sqrt(171))) + sqrt(171) + -1sqrt(171)2)/(-2-4sqrt(18)/sqrt(2)). -5sqrt(19)/8 Simplify ((1sqrt(216))/sqrt(8) + (sqrt(81)1 + sqrt(81))/sqrt(3))/((-1sqrt(2187))/sqrt(3)). -sqrt(3)/3 Simplify ((sqrt(48)/sqrt(3)-3 - sqrt(16))/sqrt(4))/(sqrt(24)/(-2sqrt(588))). 56sqrt(2) Simplify (-2sqrt(6)/(-3sqrt(2)))*2 - ((sqrt(3) + 0)2 - (-1sqrt(12))2). -2sqrt(3) + 40/3 Simplify (-3sqrt(1008) + -4 + 1)26. 1296sqrt(7) + 54486 Simplify -4(-3 + sqrt(1700)2 + sqrt(1700)-1 + -3)-3. -72 + 120sqrt(17) Simplify 4(sqrt(637)-1)*2 - (sqrt(65) + (sqrt(65) + sqrt(65)-4)3 + sqrt(65))/sqrt(5). 7sqrt(13) + 2548 Simplify -6(-5 + 2 + sqrt(16)/(sqrt(8)2) + -1). -3sqrt(2) + 24 Simplify -1(sqrt(2057)1 + 2sqrt(17)2)2-22. 15300 Simplify -6(sqrt(228)/(-1sqrt(300)) - ((2sqrt(1216))*2 + sqrt(1216))1). 246sqrt(19)/5 + 29184 Simplify (-3 + (-2sqrt(2057) + 5 - 11sqrt(2057)) + 2)*2. -264sqrt(17) + 18529 Simplify ((sqrt(121) + (sqrt(121) + (sqrt(121) + 1sqrt(121) - sqrt(121))-1 + sqrt(121) + sqrt(121) - sqrt(121)))4)/(sqrt(396)-26). -sqrt(11)/9 Simplify ((sqrt(30) - 1sqrt(1470))-6)/(-6-2sqrt(640)). 3sqrt(3)/8 Simplify ((-52sqrt(91))/sqrt(7))*2 - 2(1sqrt(13)-1 - sqrt(13)). 4sqrt(13) + 1300 Simplify (((sqrt(77) - 1sqrt(77)-4)/sqrt(11) + -2)-1)*2 + -1. -20sqrt(7) + 178 Simplify -5(-63sqrt(2299)6 + 2) + -3. -13 + 5940sqrt(19) Simplify (6(sqrt(684) - sqrt(19)) - sqrt(228)/sqrt(192))-4 + 0. -119sqrt(19) Simplify 4 + (-2(1 + -3 + sqrt(117) + sqrt(117) - (1 + -1sqrt(117) + sqrt(117))))*2. -144sqrt(13) +	{ "pile_set_name": "DM Mathematics" }
2 - l - 6. Let h(d) = 26d3 - 46d*2 + 6d + 30. Let n(y) = -3h(y) - 16v(y). Factor n(x). 2(x - 3)(x - 1)(x + 1) Determine j, given that 3/8j*5 + 21/2j + 57/4j2 + 75/8j*3 + 3 + 3j4 = 0. -2, -1 Let n(a) be the second derivative of -a4/27 - 2a3/27 - 12a. Solve n(z) = 0 for z. -1, 0 Let n(f) be the second derivative of -f*4/4 + 6f*2 + 3f. Factor n(d). -3(d - 2)(d + 2) Let u(z) be the second derivative of -z*6/6 - 3z*5/2 - 5z*4 - 25z*3/3 - 15z*2/2 - 3z. Factor u(t). -5(t + 1)3(t + 3) Let i(c) be the first derivative of -1/60c5 - 1/360c*6 + 1 + 0c*2 + 0c - 1/24c4 + 2/3c3. Let w(k) be the third derivative of i(k). Factor w(r). -(r + 1)2 Let y(r) be the first derivative of 1/6r3 - r - 1/36r*4 - 1/3r*2 + 2. Let q(n) be the first derivative of y(n). Solve q(w) = 0 for w. 1, 2 Let v(t) = 2t*4 + 4t*3 - 21t*2 - 17t - 7. Let o(a) = a*4 + 2a*3 - 10a*2 - 8a - 3. Let j(z) = 13o(z) - 6v(z). Let j(u) = 0. Calculate u. -3, -1, 1 Let g(u) = u4 + u2 + u. Let d(w) = -w*5 + 11w4 + w3 + 7w2 + 9w. Let t(a) = 2d(a) - 18g(a). Let t(z) = 0. Calculate z. -1, 0, 1, 2 Let t be 3-1 - 77/(-22). Factor 1/2b*3 + 1/4b*5 - 1/4 - 3/4b - tb2 + 3/4b*4. (b - 1)(b + 1)4/4 Let b(w) be the first derivative of -w3/6 + 3w2/4 - w - 16. Suppose b(r) = 0. What is r? 1, 2 Let m(x) be the first derivative of -2 + 0x - 1/5x5 + 3/4x4 - x3 + 1/2x2. Factor m(k). -k(k - 1)*3 Let m be 3/(-4) + (-15)/(-20). Let w be (-8)/(-36)(m + 1). Factor 0u2 + wu*3 + 2/9u*5 + 0u + 4/9u4 + 0. 2u*3(u + 1)*2/9 Let x(d) be the second derivative of 0 + 1/30d*4 - 4d + 1/5d2 + 2/15d*3. Solve x(s) = 0. -1 Let v(f) be the second derivative of 0 - 2f*3 - 7/60f*5 + 5/6f*4 - 2f + 4/3f2. Factor v(k). -(k - 2)2(7k - 2)/3 Let u be 38/(-8) + -11 + 16. Let d be (-30)/(-9)6/5. Factor 0 + 1/4v - 1/4v*3 - uv*2 + 1/4v*d. v(v - 1)*2(v + 1)/4 Let f(p) be the third derivative of 0 + 1/300p5 + 0p*3 + 0p - 1/600p6 + 4p*2 + 0p4. Factor f(n). -n2(n - 1)/5 Suppose 4/5i*3 + 1/5i*2 - 4/5i + 0 - 1/5i4 = 0. What is i? -1, 0, 1, 4 Let i(p) = -4p*4 - 20p*3 + 12p*2 - 12p. Let r(q) = -q4 - q3 - q. Let k(v) = -i(v) + 8r(v). Factor k(z). -4z(z - 1)3 Find u, given that -12u - 15u2 + 5u*2 + 12u*2 + 18 = 0. 3 Suppose p - 15 = -5h, -4p = 5h - 15 - 15. Let s be 7/(-14) + 5/2. Factor 5c2 + 3c*s - hc - 6c2. 2c(c - 1) Let u(t) = -t2 - 7t + 11. Let q be u(-8). Determine c so that -c*q - 2 - c - 2c*2 - 1 + 3 = 0. -1, 0 Let j be (-5)/1(-3 + 4). Let t(d) = 10d4 - 6d*3 - d - 3. Let g(x) = 7x*4 - 4x*3 - x - 2. Let b(y) = jt(y) + 7g(y). Factor b(i). -(i - 1)3(i + 1) Let v(c) be the first derivative of -3/14c4 + 4/21c*3 - 4/7c + 3/7c2 + 3. Find p, given that v(p) = 0. -1, 2/3, 1 Let u(i) = 12i*4 + 12i*3 - 33i*2 - 9. Let x(h) = -3h*4 - 3h*3 + 8h*2 + 2. Let z(k) = 2u(k) + 9x(k). Solve z(m) = 0 for m. -2, 0, 1 Let g(r) = r - 1. Let c be -1 + 0 - -2 - 2. Let p(q) = q2 + 3q. Let z(a) = cp(a) + g(a). Factor z(b). -(b + 1)2 Suppose -7 = o - 9. Let q(i) be the second derivative of oi - 1/48i4 + 0 + 0i*3 + 1/8i2. Find f such that q(f) = 0. -1, 1 Let d(a) be the first derivative of -a4/2 + 4a3/3 - 13. Factor d(f). -2f*2(f - 2) Let h = 7 - 5. Factor -7 + 2qh - 5q + 2q3 + 5 + 3q. 2(q - 1)(q + 1)*2 Let l(q) be the third derivative of 0 + 1/24q*6 + 1/24q*4 + 0q*3 + 4q*2 - 1/140q*7 + 0q - 3/40q5. Find w such that l(w) = 0. 0, 1/3, 1, 2 Suppose -5r - 11 = -11. Factor -1/4c3 - 1/4c*4 + rc*2 + 0 + 0c. -c*3(c + 1)/4 Let n be (-4)/18 + (-112)/(-18). Solve z*2 - nz3 + z4 - 4z2 + 6z + z4 + z4 = 0 for z. -1, 0, 1, 2 Suppose -10 - 2 = -2h. Let u be -2 + h/(-2) + 7. Solve -2/3w + 1/3 + 1/3wu = 0 for w. 1 Factor 0x + 0 + 2/5x2. 2x2/5 Let r = 13 - 9. Determine z, given that z4 - 2z - 4 + 2 - 2z*5 - 3zr + z2 + 3z2 + 4z*3 = 0. -1, 1 Suppose 0 = 3q - 3z - 3, q + 4z + 5 = 1. Factor 2/13x3 + 4/13x*2 + 0x + q. 2x2(x + 2)/13 Suppose v - 68 = 4p - 3v, -v + 1 = 0. Let l = -5 - p. Let -9 + 4u - u2 + l + 3u*2 = 0. Calculate u. -1 Let t = -165/8 + 1179/56. Factor tu*2 + 0 + 0u. 3u2/7 Let y(i) = -3i*4 + 2i*3 + 7i*2 - 6i. Let z(p) = p*2 - p. Let q(m) = y(m) - 4z(m). Determine b so that q(b) = 0. -1, 0, 2/3, 1 Let d(j) = 14j3 + 17j*2 - 3j - 6. Let t(p) = -36p3 - 2 + 2 + 37p3 + p2. Let i(b) = -d(b) + 5t(b). Solve i(c) = 0. -1, 2/3 Let k = 20 - 16. Let o(s) be the first derivative of -2/3s*3 + 2 + 0s + 1/2sk + 0s*2. Factor o(w). 2w*2(w - 1) Factor 4/9 - 2/9x3 - 10/9x + 8/9x2. -2(x - 2)(x - 1)2/9 Let k = -9 - -11. Let m(q) be the first derivative of 0q*3 + 0q*k - 1/15q*5 + 0q + 1 + 1/12q4. Solve m(a) = 0. 0, 1 Let r(m) = m4 + m3 - m2 + m. Let g(a) = -6a*3 + 3a*2 + 39a + 24. Let n(f) = g(f) - 3r(f). Determine k, given that n(k) = 0. -2, -1, 2 Let n = 2/573 + 503/20055. Let a(p) be the third derivative of -1/20p*6 - np*7 + 0 + 0p*4 + 0p*3 - 1/30p*5 - 1/168p8 - p2 + 0p. Factor a(t). -2t*2(t + 1)3 Factor -l4 + l*3 + 8l - 9l3 - l4 - 2l*4 + 4. -4(l - 1)(l + 1)3 Let s(k) be the third derivative of -k5/12 + 35k*4/24 - 5k*3 + 21k*2. Suppose s(b) = 0. What is b? 1, 6 Suppose 1/7a + 8/7a3 + 2/7 + 4a*4 - 3a2 = 0. What is a? -1, -2/7, 1/2 Let u(x) be the second derivative of -x6/15 - x*5/10 + 2x. Factor u(n). -2n3(n + 1) Let h be (-104)/(-20) - (-8)/(-2). Suppose 0 + 0i - hi*2 - 3/5i3 = 0. What is i? -2, 0 Let s(z) be the second derivative of -z6/15 + 3z5/10 - 17z. Factor s(r). -2r3(r - 3) Let t(p) be the third derivative of p*8/560 - 2p7/175 - p6/100 + 3p5/25 + 9p*4/40 - 6p*2. Factor t(w). 3w(w - 3)2(w + 1)*2/5 Solve 0 + 1/4z*3 + 0z - 1/4z2 = 0 for z. 0, 1 Let s(w) be the third derivative of -1/630w*7 + 1/180w*5 + 0 + 0w*6 + 0w*4 - 2w*2 + 0w + 0w3. Factor s(z). -z2(z - 1)(z + 1)/3 Let h be (-209)/(-228) - 2/12. Find f, given that -hf*4 + 0f + 0 - 1/4f2 + 1/4f*5 + 3/4f3 = 0. 0, 1 Let d(a) be the third derivative of a6/600 + a*5/200 + 2a*3/3 + 5a2. Let b(p) be the first derivative of d(p). Solve b(c) = 0 for c. -1, 0 Let w(b) be the second derivative of b6/90 - b4/18 + b2/6 + b. Factor w(t). (t - 1)*2(t + 1)*2/3 Let x be (-3 + 1)13/2. Let s be (x/(-7) - 3) + 2. Factor 6/7b + 2/7 - 2/7b*2 - sb*3. -2(b - 1)(b + 1)(3b + 1)/7 Let y(c) = -c3 - c2 - c. Let f(g) = 5g*3 - 2g*2 - 3g + 2. Let o = -19 - -20. Let b(p) = of(p) + 2y(p). Find q, given that b(q) = 0. -1, 1/3, 2 Suppose 2p + 1 - 5 = 0. Let k = p - 3. Let y(n) = 18n*3 + 14n2. Let l(o) = -o3 - o*2 - o. Let d(i) = ky(i) - 4l(i). Solve d(a) = 0 for a. -1, 0, 2/7 Let m(u) = -9u*5 + 8u*4 + 11u*3 + 10u*2 + 8u. Let z(d) = -d5 + d4 + d3 + d2 + d. Let w(b) = 3m(b) - 24z(b). Suppose w(a) = 0. What is a? -1, 0, 2 Let n(a) be the first derivative of a*4 - 2a*3/3 - 5a*2 - 4a + 10. Determine l, given that n(l) = 0. -1, -1/2, 2 Let l(x) = -x*2 - 5x + 1. Let z be l(-3). Let f be 2/7 + 12/z. Factor 1/2jf - 1/2 + 1/2j - 1/2j3. -(j - 1)2(j + 1)/2 Let m(p) be the first derivative of 0p + 10/3p*3 + 2p2 - 1 + p4. Determine r so that m(r) = 0. -2, -1/2, 0 Let z(f) be the first derivative of -f*4/10 - 4f*3/15 + 1. Factor z(h). -2h*2(h + 2)/5 Let u(x) be the third derivative of -x5/60 - x4/8 - x*3/3 + 6x*2. Let u(n) = 0. What is n? -2, -1 Let p(y) be the third derivative of 0 + 1/21y*4 + 4/21y*3 - 1/70y*5 + 0y - 5y2. Factor p(m). -2(m - 2)(3m + 2)/7 Factor -192 - 3/4r2 - 24r. -3(r + 16)2/4 Let x(w) be the first derivative of 4w*3/3 - 16w + 8. Solve x(z) = 0 for z. -2, 2 Factor 38g - 2g*3 + 2g*4 - 38g. 2g3(g - 1) Let x(m) = 3m - 3 - 1 - 2m + 3. Let q(v) = -v*2 - 13v + 10. Let z(y) = 2q(y) + 22x(y). Let z(g) = 0. What is g? -1 Let i(p) be the first derivative of -7p6/51 - 94p*5/85 - 91p*4/34 - 122p*3/51 - 2p*2/17 + 16p/17 - 52. Solve i(h) =	{ "pile_set_name": "DM Mathematics" }
7 or -2? -2 Which is smaller: 2.1719 or 0.2? 0.2 Which is bigger: -770 or -2/5? -2/5 Which is greater: 0 or -262? 0 Do 18 and 8/7 have the same value? False Which is smaller: 888 or 897? 888 Which is smaller: 56 or 343/6? 56 Which is smaller: -708 or -705? -708 Is -2/2897 > 1? False Which is bigger: -9 or -71? -9 Is 3/2 greater than 90? False Are -17/65 and 3 non-equal? True Which is smaller: 1 or -8? -8 Is -8980 smaller than -8980? False Is 21 at most as big as -41? False Which is bigger: 935 or -1? 935 Which is smaller: 43331/5 or 8667? 43331/5 Does 0 = 2/87? False Is -2/2387 not equal to -1? True Which is smaller: -7664 or 0? -7664 Is 1 bigger than -3/1006? True Is -4056 < -4055? True Is -12261 != -12261? False Which is bigger: 2/47 or 0.089? 0.089 Which is bigger: -6/7 or 79/4? 79/4 Which is greater: 0.1 or -20/17? 0.1 Is 1884 greater than 1882? True Is -660 smaller than -2? True Is -690 at most -7596/11? False Is 1 greater than or equal to 2/2591? True Is -298/17 smaller than -17? True Are 856 and 855 unequal? True Which is greater: -96 or -678/7? -96 Is 262 greater than -1/4? True Is -24 < -323/13? False Which is smaller: 628/3 or 208? 208 Is -141 at most 2/7? True Do -151 and -156 have different values? True Which is smaller: 4 or 41/9? 4 Is 0 greater than or equal to -120/277? True Which is greater: 1/180 or -1? 1/180 Is -149 at least as big as -149? True Is -287 <= -0.35? True Is 0.326 at least as big as 0? True Are -728 and -733 non-equal? True Which is smaller: 1298/3 or 432? 432 Is 1840 less than 1840? False Are -5/694 and 0 unequal? True Is -207 at least -7? False Is 1/23355 at least -1? True Which is smaller: 53 or 209/4? 209/4 Which is greater: -136 or -138? -136 Which is smaller: 4040 or 4041? 4040 Which is smaller: -2 or -0.595? -2 Which is bigger: -7/2 or -1/1329? -1/1329 Is -4 > -190/73? False Which is bigger: -5 or -0.117? -0.117 Which is greater: -2260.8 or -1? -1 Which is smaller: -2109/4 or -527? -2109/4 Which is smaller: 7266 or 7267? 7266 Which is smaller: 262 or 272? 262 Is -1 less than or equal to -2/633? True Which is greater: -38 or 1? 1 Is -10 equal to -22.53? False Which is bigger: -80 or -241/3? -80 Is -784 not equal to -783? True Is 58 greater than or equal to 4? True Is 5780/21 > 276? False Is 7 > 2.65? True Which is smaller: -74 or -49? -74 Which is smaller: -11 or -1? -11 Which is smaller: -2 or -0.18? -2 Is -2 less than -18/11? True Which is bigger: 240 or 239? 240 Is 1530 smaller than 1530? False Which is smaller: -222 or -221? -222 Which is greater: 614 or 612? 614 Is -4999 at least -4999? True Is 1/7 <= -7.3? False Is 2/3095 at least as big as -1? True Which is greater: -1 or 2/125277? 2/125277 Which is smaller: 1 or -2/196387? -2/196387 Which is greater: -10502 or -10501? -10501 Which is bigger: 1.897 or 1? 1.897 Which is smaller: -2/7 or 3/2494? -2/7 Are 0 and -19/13 unequal? True Which is smaller: 1 or 3/926? 3/926 Does 0.0355 = -9? False Which is greater: 11.7 or -0.2? 11.7 Which is bigger: 54/269 or 1? 1 Are -50/17 and -4 equal? False Which is smaller: 2/567 or 1? 2/567 Which is greater: 250 or 1499/6? 250 Which is smaller: -1987 or 0.4? -1987 Do -166 and -63 have the same value? False Is -1145 greater than -1143? False Is 3844 not equal to 3844? False Are 2/6057 and 1 equal? False Which is greater: 572 or 568? 572 Is -987/11 > -91? True Which is smaller: 183/197 or 0? 0 Is 1/3 not equal to 0.205? True Is -178 smaller than -178? False Which is smaller: 526 or 525? 525 Which is smaller: 27 or 25? 25 Do -156 and -156 have the same value? True Which is bigger: 2/197 or 2? 2 Which is bigger: 132 or 76? 132 Which is smaller: 68 or 63? 63 Which is smaller: -522/11 or -48? -48 Which is smaller: -3 or 164? -3 Is -2/33 greater than 20? False Which is smaller: 145/66 or 3? 145/66 Which is bigger: 0 or -2/343? 0 Which is smaller: 5 or 8? 5 Which is smaller: 0 or 20/21? 0 Is -3/3392 at least 1? False Which is bigger: -22 or -1.1? -1.1 Is -940 < -1/3? True Which is bigger: -102 or -112? -102 Which is smaller: 6/605 or 1? 6/605 Does -0.3837 = -0.2? False Are -749 and -0.05 non-equal? True Which is greater: 60.2 or 1/3? 60.2 Which is smaller: -2039 or -16305/8? -2039 Which is greater: 1 or -23/158? 1 Is 1348 < -3? False Is -344 not equal to -343? True Is -2/212741 at least as big as 0? False Which is greater: -4/3 or 34? 34 Which is greater: 5/6 or 0? 5/6 Is -3956 smaller than -3960? False Is 213 less than 222? True Which is greater: 5288 or 5289? 5289 Which is smaller: 27 or 14? 14 Is 1/4983 greater than -1? True Are -0.1 and 30422 nonequal? True Which is greater: 0 or -17/118? 0 Is 1/8877 at most -1? False Is -1/2 less than 0.1317? True Which is smaller: 14167 or 0.1? 0.1 Which is smaller: -9 or 1/4? -9 Which is bigger: 16573 or 16572? 16573 Which is greater: -0.17 or -197? -0.17 Is 265 > 250? True Is 2/317 smaller than 1? True Which is smaller: -479/2 or -241? -241 Is 5 less than 222/49? False Which is smaller: -1 or 50? -1 Is 0 greater than or equal to 42/131? False Which is bigger: 0 or 3/142? 3/142 Is 3 at most 78/133? False Is -391 less than 7? True Is -6 at most as big as 20? True Which is bigger: -1/9671 or -1? -1/9671 Which is greater: 893/2 or 2/9? 893/2 Which is bigger: -3/4000 or 1? 1 Which is bigger: -1061 or -1081? -1061 Is -69 > -2? False Is -6/9605 >= -1? True Which is smaller: -6/91 or 0.115? -6/91 Is -1 greater than or equal to 1/3076? False Which is smaller: -54 or -823/15? -823/15 Is 1 greater than 4/195? True Is 11 at least as big as 205/17? False Is 0 >= 3/1687? False Is 1103 equal to 3? False Do -50 and -49 have different values? True Is 2437 greater than 2439? False Are -70 and 8.2 equal? False Is 34/953 smaller than 1? True Is -0.3 greater than or equal to 117? False Which is greater: 704 or 712? 712 Which is smaller: -11 or 385? -11 Is 3/1318 at most 0? False Is -12 > -493/46? False Are 1/3 and -6682 equal? False Is 214 less than 1? False Which is smaller: 10062 or 10061? 10061 Is 798 smaller than 793? False Which is greater: 1391 or 2781/2? 1391 Which is greater: 0 or 82/385? 82/385 Are -1 and -5502 unequal? True Is -1/24 greater than 191? False Which is bigger: 3/1547 or 0? 3/1547 Do -2921 and -2921 have different values? False Which is smaller: -459 or -460? -460 Which is bigger: -12/11 or -1? -1 Is 178 less than or equal to -0.1? False Which is smaller: -128 or -124? -128 Is -0.1 at most as big as 20673? True Is -1.1 less than 1.3? True Are 1 and 2/287 non-equal? True Is 3 less than or equal to 4/5? False Which is smaller: 644/11 or 60? 644/11 Is 0.38 bigger than 10? False Is 9 equal to 9? True Is 80 bigger than 76? True Which is bigger: -425 or -417? -417 Which is greater: 89 or 715/8? 715/8 Which is smaller: 0 or 12/25? 0 Is -104 greater than or equal to -103? False Is -20740 > -20740? False Is 0 bigger than 0? False Which is smaller: 1 or 700? 1 Which is smaller: -140 or -136? -140 Which is smaller: -1 or 3/434? -1 Is 13072 at least 13072? True Which is smaller: -17/10 or -2? -2 Which is smaller: 48 or 44? 44 Are 3626 and 3627 unequal? True Which is bigger: -102/23 or -4? -4 Is 4/185 bigger than 1? False Is 0.1 smaller than 8044? True Which is smaller: 2/627 or 1? 2/627 Is -138/65 at most -3? False Which is smaller: 0 or -1/128? -1/128 Which is greater: -1 or 2066? 2066 Is -4599 at most as big as -4597? True Does 1.498 = 1? False Is -183 at least as big as 15? False Is -40 > -41? True Is 11 at most as big as 65? True Which is greater: -12/181 or 0? 0 Is 1138 not equal to 1138? False Which is greater: 0.4 or 2365? 2365 Are -0.03 and 52/75 unequal? True Which is smaller: 10/1601 or -1? -1 Is -787 greater than or equal to -786? False Which is smaller: 17900 or -1? -1 Which is bigger: 2 or 0.0446? 2 Are 126 and 121 non-equal? True Is 1252 bigger than 1250? True Which is smaller: -1 or -8/259? -1 Is -22/161 equal to 1? False Which is smaller: 1868 or 1865? 1865 Which is smaller: 19 or 21? 19 Is -115 at least -2/7? False Is 1 smaller than 32/23? True Which is smaller: -0.0589 or 0.1? -0.0589 Which is smaller: 174 or 60? 60 Which is smaller: 1 or 1/3047? 1/3047 Do 100/43 and -0.3 have different values? True Which is smaller: -1 or 7/923? -1 Is -1 at most -14/47? True Is 0 less than	{ "pile_set_name": "DM Mathematics" }
895, -12061, -16385, -20921, -25723? -30845 What comes next: -7880, -16643, -26302, -36863, -48332? -60715 What is next in -122231, -244418, -366549, -488624, -610643, -732606, -854513? -976364 What is the next term in -206, -1658, -3966, -7130, -11150? -16026 What comes next: 51582, 206353, 464318, 825489, 1289878, 1857497, 2528358? 3302473 What is next in 127724, 255317, 382906, 510491, 638072? 765649 What is the next term in 5234, 5195, 5132, 5057, 4982? 4919 What is the next term in -2010, -15869, -53494, -126795, -247682, -428065? -679854 What is next in 15723, 63079, 142007, 252507, 394579, 568223? 773439 What is next in 45543, 91180, 136801, 182400, 227971, 273508, 319005, 364456? 409855 What is the next term in 262, 458, 682, 946, 1262, 1642, 2098? 2642 What is the next term in -279303, -558546, -837785, -1117020, -1396251? -1675478 What is next in 7192, 14266, 21340? 28414 What comes next: 2971, 12464, 28483, 51028, 80099? 115696 What is next in -10141, -1983, 6175, 14333, 22491, 30649? 38807 What is the next term in -3491, -2931, -2371, -1811, -1251, -691? -131 What is next in -4513995, -4513998, -4514001, -4514004? -4514007 What is the next term in -773, -3536, -10941, -25310, -48965, -84228, -133421, -198866? -282885 What is next in 17713, 34567, 51421, 68275? 85129 What comes next: -22769, -24968, -27167, -29366? -31565 What comes next: 3280490, 13121965, 29524430, 52487891, 82012354? 118097825 What is next in -1763518, -3526822, -5290126, -7053430, -8816734, -10580038? -12343342 What is next in -802415, -1605202, -2407989, -3210776? -4013563 What comes next: -701475, -1403003, -2104531, -2806059? -3507587 What comes next: -6283484, -6283483, -6283482, -6283481, -6283480? -6283479 What comes next: 11783, 24676, 37569, 50462? 63355 What is next in 58214740, 58214743, 58214746? 58214749 What comes next: 859687, 1719392, 2579111, 3438850, 4298615, 5158412, 6018247? 6878126 What is the next term in 18568, 18359, 18150, 17941? 17732 What is next in -2977, -6857, -13321, -22369, -34001? -48217 What is next in 17166, 17221, 17276? 17331 What is next in 17625, 24875, 32125, 39375, 46625, 53875? 61125 What is the next term in 653232, 653249, 653268, 653289, 653312? 653337 What is the next term in 15473, 31844, 48235, 64646, 81077? 97528 What comes next: 31806654, 63613307, 95419960, 127226613, 159033266, 190839919? 222646572 What comes next: -42821979, -85643965, -128465951, -171287937, -214109923, -256931909? -299753895 What comes next: 9652, 38492, 86724, 154354, 241388, 347832? 473692 What comes next: 41061353, 41061355, 41061357, 41061359, 41061361, 41061363? 41061365 What is next in -43287, -43274, -43253, -43224, -43187, -43142? -43089 What is next in 30, 88, 172, 282? 418 What is next in 12653783, 12653743, 12653641, 12653447, 12653131, 12652663, 12652013? 12651151 What is next in -21595, -22909, -24221, -25531? -26839 What comes next: 5390, 5398, 5406? 5414 What is next in -1167, -12858, -45601, -109920, -216339, -375382, -597573? -893436 What comes next: 19110, 38537, 57964, 77391, 96818? 116245 What is next in -8990959, -8990963, -8990967, -8990971, -8990975, -8990979? -8990983 What is the next term in -1262088, -1262090, -1262092? -1262094 What comes next: -281964, -564105, -846246, -1128387, -1410528, -1692669? -1974810 What is next in -10989352, -10989355, -10989358? -10989361 What is the next term in -4606, -9428, -14226, -18988, -23702, -28356, -32938, -37436? -41838 What is the next term in -227971, -455926, -683863, -911782, -1139683? -1367566 What is next in 18348, 37187, 56026, 74865? 93704 What is next in -10859, -24532, -38205, -51878? -65551 What is the next term in 1967435, 1967432, 1967429? 1967426 What comes next: 1703838, 3407600, 5111362, 6815124, 8518886? 10222648 What is next in 18129092, 18129100, 18129108? 18129116 What is the next term in 121349, 242577, 363691, 484685, 605553? 726289 What is the next term in -9756, -19931, -30106, -40281? -50456 What comes next: -4232768, -4232767, -4232766, -4232765? -4232764 What is next in 21149, 20715, 20281, 19847, 19413? 18979 What is next in -1700757, -1700773, -1700799, -1700835? -1700881 What comes next: 132642, 266138, 399630, 533118, 666602, 800082, 933558? 1067030 What is next in 2862828, 5725701, 8588616, 11451573, 14314572, 17177613, 20040696? 22903821 What comes next: -18316, -36307, -54310, -72331, -90376? -108451 What is next in 16333, 15435, 13945, 11869, 9213? 5983 What comes next: 203523, 407339, 611455, 815871, 1020587, 1225603? 1430919 What comes next: -1597813, -3195878, -4794197, -6392770, -7991597? -9590678 What is the next term in 1888525, 1888518, 1888511? 1888504 What comes next: -3873, -15482, -34765, -61722? -96353 What is the next term in 10633065, 21266135, 31899205? 42532275 What comes next: -452648, -452641, -452636, -452633? -452632 What comes next: -164925, -1319503, -4453359, -10556133, -20617465? -35626995 What is next in 150260, 601511, 1353596, 2406515, 3760268? 5414855 What is next in 1292, -12814, -36324, -69238, -111556, -163278, -224404? -294934 What comes next: -2485, -2530, -2563, -2578, -2569, -2530? -2455 What is next in -16184709, -32369414, -48554113, -64738806, -80923493, -97108174, -113292849? -129477518 What is the next term in -78738960, -157477921, -236216882, -314955843? -393694804 What comes next: -2484, -234, 3530, 8820, 15648, 24026, 33966? 45480 What is next in 12360, 16246, 20132, 24018, 27904? 31790 What is the next term in 5608, 11417, 17382, 23503, 29780, 36213, 42802? 49547 What is next in 19790, 20053, 20322, 20597, 20878, 21165? 21458 What comes next: -1501, -5777, -10053, -14329? -18605 What is the next term in 377, 1117, 2409, 4439, 7393, 11457, 16817, 23659? 32169 What is next in 6686300, 13372622, 20058944? 26745266 What is next in 193528069, 193528067, 193528065? 193528063 What comes next: -12674, -7500, 1132, 13228, 28794, 47836, 70360, 96372? 125878 What is next in 2064, 1845, 1622, 1395? 1164 What comes next: 1470, 852, -842, -4152, -9618? -17780 What comes next: -1611, -3592, -5979, -8772, -11971, -15576? -19587 What is the next term in 3014, 3107, 3262, 3479, 3758? 4099 What is next in 608667, 1217336, 1826015, 2434704, 3043403, 3652112, 4260831? 4869560 What is next in 55616668, 55616669, 55616670? 55616671 What comes next: 14838, -3331, -21500? -39669 What is the next term in -91, -194, -283, -340, -347? -286 What is next in 70324, 70413, 70562, 70771? 71040 What comes next: 70, 476, 1190, 2188, 3446? 4940 What is next in -1181, -4351, -8939, -14375, -20089, -25511, -30071? -33199 What is the next term in -612818, -612795, -612772, -612749? -612726 What is next in -325171, -649311, -973451, -1297591, -1621731, -1945871? -2270011 What comes next: -120324183, -120324182, -120324181? -120324180 What comes next: 58158, 56800, 55442, 54084? 52726 What is the next term in -3813, -7788, -12073, -16824, -22197, -28348, -35433, -43608? -53029 What is the next term in 3513, 7473, 11433? 15393 What is next in -5501195, -11002377, -16503559, -22004741? -27505923 What is the next term in -30487097, -60974166, -91461235, -121948304, -152435373, -182922442? -213409511 What is the next term in -504795, -504819, -504859, -504915, -504987? -505075 What is the next term in -114210, -225339, -336468, -447597, -558726? -669855 What is next in -19424, -36143, -50156, -61463, -70064? -75959 What is the next term in -170015, -339949, -509799, -679565? -849247 What comes next: 19, 439, 1709, 4249, 8479, 14819, 23689, 35509? 50699 What is the next term in -20061660, -40123320, -60184980, -80246640, -100308300? -120369960 What is the next term in 45242, 364777, 1232066, 2920985, 5705410, 9859217? 15656282 What is the next term in -1098, -3373, -5620, -7839? -10030 What comes next: -78955, -157790, -236579, -315298, -393923, -472430? -550795 What is next in 78033, 78110, 78161, 78186, 78185? 78158 What comes next: 37595, 150318, 338171, 601154, 939267, 1352510, 1840883? 2404386 What comes next: 143827, 287711, 431571, 575407, 719219, 863007, 1006771? 1150511 What is next in -948, -858, -936, -1266, -1932, -3018, -4608, -6786? -9636 What comes next: -1533274, -1533446, -1533618, -1533790, -1533962, -1534134? -1534306 Wh	{ "pile_set_name": "DM Mathematics" }
p3 - 4p*2 Collect the terms in -703 - 257 - 2286h - 2h2 - 2266h + 4552h. -2h*2 - 960 Collect the terms in -78 - 7m*2 + 2m - 175 + 226 - 167. -7m2 + 2m - 194 Collect the terms in -6t2 + 1 + 7010t*3 + 6t - 1 - 8t. 7010t*3 - 6t*2 - 2t Collect the terms in 89500 + 1738p + p3 + 2p*3 - 89500 - 1738p + 0p3. 3p*3 Collect the terms in -11 - 297a - 8a2 - 2a*3 + 14a*2 - 6a*2 + 520a. -2a3 + 223a - 11 Collect the terms in -66i - 32i - 97i + 308i - 49i. 64i Collect the terms in 21s2 + 47s*3 + 22s*2 + 63s*3 + 39s*2 - 82s*2. 110s3 Collect the terms in -i3 + 8503i - 2891i - 2719i - 2896i. -i*3 - 3i Collect the terms in -5 - 301 + 3b - 5b*3 + 540. -5b*3 + 3b + 234 Collect the terms in 32651632k - 65303298k + 32651670k. 4k Collect the terms in 3h + 0h - 9h + 106h*3 + 23h. 106h3 + 17h Collect the terms in -5o + 1569843160120 - 4o - 1569843160120. -9o Collect the terms in 59t*3 - 24t*3 - 192t + 185t - 34t3. t3 - 7t Collect the terms in -65263i*2 + 35284i*2 - 172i*2 - 78619i*2. -108770i*2 Collect the terms in 0s*2 - 55s + 184s + 9s*2 - 61s - 59s. 9s*2 + 9s Collect the terms in 26785w2 - 1029w*2 - 878w*2. 24878w*2 Collect the terms in -414055b*2 + 207019b*2 + 207039b*2 - 57. 3b*2 - 57 Collect the terms in -1 - 7 + 31c*3 + 11074c*2 - 22131c*2 + 11060c*2 + 8. 31c*3 + 3c*2 Collect the terms in 199r + 180r - 886r + 177r + 179r + 165r. 14r Collect the terms in 9 - 19 - 121q2 + 50q*2 + 10 + 57q*2 + 16q*2. 2q*2 Collect the terms in -144c + 577c - 13 - c2 - 2468c + 1 + 15. -c*2 - 2035c + 3 Collect the terms in -6745g2 + 3g + 6830g2 + 0g. 85g2 + 3g Collect the terms in -9o + 26o*3 - 170o - 84o3 + 33o*3 + 27o*3. 2o*3 - 179o Collect the terms in 123907p2 + 388 - 123902p*2 + 390 - 777. 5p*2 + 1 Collect the terms in -7 + 2497480a + 7. 2497480a Collect the terms in -372b*2 - 803b*2 + 336b*2 - 1273b*2 + 349b*2. -1763b*2 Collect the terms in 11050w*2 + 10965w*2 - 33079w*2 + 10992w*2. -72w*2 Collect the terms in -511345f*2 + 255658f*2 + 255677f*2. -10f*2 Collect the terms in 2615045 - 1307729 - 37j - 1307316. -37j Collect the terms in 207 + 51 - 258 - 135v*3. -135v*3 Collect the terms in -33g*2 - 177 + 47 - 300g*2 + 130. -333g*2 Collect the terms in 10534y + 27032y - 2560y. 35006y Collect the terms in -696 + 69 + 25j*3 + 647. 25j*3 + 20 Collect the terms in 1732737f - 3465472f + 1732735f - 36f2. -36f*2 Collect the terms in 9646211m*3 - 3m - 9645773m3 + 3m. 438m3 Collect the terms in -1080x*3 + 5703x*3 - 1902x*3 - 1561x*3. 1160x*3 Collect the terms in 11k + 37k - 28 - 113k - 58. -65k - 86 Collect the terms in 43w*2 - 2w + 87w2 + w + 325 - 65. 130w*2 - w + 260 Collect the terms in 28g*2 + 1980793g - 1980793g + g3. g3 + 28g*2 Collect the terms in -459h - 496h + 955h + 62h3 + 0h*3. 62h*3 Collect the terms in -1024392g*2 - 629611g*2 - 1318339g*2 + 334396g*2. -2637946g*2 Collect the terms in -1359u*2 + 653u*2 - 1910u*2 + 230u*2. -2386u*2 Collect the terms in -88248910666 + 88248910666 + 18h. 18h Collect the terms in 7782326 - 9n - 3891033 - 3891289. -9n + 4 Collect the terms in -42 + 228 + 9 + 0k + 144 - 2k + 121. -2k + 460 Collect the terms in -29767 - 6677y2 + 29767 + 6674y*2. -3y*2 Collect the terms in 16494r + 16499r + 16497r + 16558r - 65924r. 124r Collect the terms in -15c - 21c - 4c - 20c + 85c - 19c. 6c Collect the terms in 477 - 477 - 1909167m. -1909167m Collect the terms in -1076562y3 + 1079676y*3 - 35y + 35y. 3114y*3 Collect the terms in -2b*2 + 1 - 2 - 340b - 3990b. -2b*2 - 4330b - 1 Collect the terms in 63f - 35f - 25f - 2 + 80 + 163. 3f + 241 Collect the terms in -4q + 194295024 - 388589958 + 4q + 194294934 - 2q2. -2q*2 Collect the terms in -861c - 1129c - 1138c + 2983c. -145c Collect the terms in 2975j - 1240j + 910j + 1861j. 4506j Collect the terms in -739k + 457k + 1073k + 999k. 1790k Collect the terms in -564724d2 - 82d + 82d. -564724d*2 Collect the terms in 26072c*2 - 8698c*2 - 8579c*2 - 8731c*2. 64c*2 Collect the terms in -702b*2 + 39421328b - 39421328b. -702b*2 Collect the terms in 41z - 16393994z3 - 120z + 16393996z3. 2z*3 - 79z Collect the terms in 239851139o2 - 32o - o*3 - 239851139o2. -o3 - 32o Collect the terms in 474o - 872o2 + 3484o*2 - 471o. 2612o2 + 3o Collect the terms in 0s + 5s - 9757 + 6s + 3s. 14s - 9757 Collect the terms in 979 - 494 + 12547y*2 - 485. 12547y*2 Collect the terms in 5087374078p*2 - 2543687041p*2 - 2543687034p*2. 3p*2 Collect the terms in -75m*2 + 0m*2 + 2 + 20m*2 + 15m*2 + 16m*2 + 2 + 23m2. -m2 + 4 Collect the terms in 3687c2 - 1743c*2 - 1944c*2 - 751c*3. -751c*3 Collect the terms in -2770 - 9165 + 2o - 6367 - 6887. 2o - 25189 Collect the terms in 2t*3 + 588t + 325t - 217t + 413t. 2t*3 + 1109t Collect the terms in -16y2 - 104922 - 34y + 45y3 + 104919 - 11y*3. 34y*3 - 16y*2 - 34y - 3 Collect the terms in -26x - 9x - 20x - 13 - 1 + 68x - 10x. 3x - 14 Collect the terms in -2433i2 + 7022i*2 - 3221i*2. 1368i*2 Collect the terms in 10s + 54221172662032 - 54221172662032 - 8s. 2s Collect the terms in -49669109t - 154t*3 + 49669109t. -154t3 Collect the terms in 13z + 22z2 + 325z*2 - 335z*2. 12z*2 + 13z Collect the terms in 149 - 50 + 15312k - 35 - 31 - 32. 15312k + 1 Collect the terms in -38h + 38h + 54500h3 + 48574h*3. 103074h3 Collect the terms in y3 + 3 + 37y + 11 - 37y - 16y3 + 6 + 16y3. y3 + 20 Collect the terms in 2461i2 + 1427i*2 + 4461i - 4461i + 585i*2. 4473i*2 Collect the terms in -31 + 107 - 41 + n - 30. n + 5 Collect the terms in -9313d + 155087 - 155087. -9313d Collect the terms in -511117 - 4s*2 + 511117 + 0s*2. -4s*2 Collect the terms in 2i*2 - 2i*2 - 514053007i*3 + 514053024i*3. 17i*3 Collect the terms in 2129657l + 3549454l + 137514l. 5816625l Collect the terms in -94139a*3 - 94130a*3 - 94132a*3 + 282439a*3. 38a*3 Collect the terms in -42x - 23x3 - 98721 + 98721. -23x*3 - 42x Collect the terms in 50r3 - 17r*3 - 103r*3 - 180r3 + r3 + 54r3. -195r*3 Collect the terms in -14r2 - 26664 - r2 + 9r2 + r2. -5r*2 - 26664 Collect the terms in 0l - 1419l3 - 1430l*3 + 5690l*3 - 1426l*3 + 3l - 1423l3. -8l*3 + 3l Collect the terms in 9631b3 + 6536b3 + b2 - b*2 + 3255b*3. 19422b*3 Collect the terms in -5h - 152 + 464 - 164 + 13h - 148 - 3h. 5h Collect the terms in -3w - 1945 + 5684 - 1831 - 1852. -3w + 56 Collect the terms in -546u - 21u2 + 2 - 966u + 480u - 2. -21u*2 - 1032u Collect the terms in 154 + 72667d - 74 - 72828d - 80. -161d Collect the terms in -115 + 320y + 247 - 62 - 70. 320y Collect the terms in -224a + 5248 - 5a3 - 15759 + 5253 + 5258. -5a*3 - 224a Collect the terms in -80 + 52 - 1160w2 + 16 + 12. -1160w*2 Collect the terms in 270q + 489960q2 - 11q*3 - 3 - 489960q*2. -11q*3 + 270q - 3 Collect the terms in -337b2 - 1860b*2 - 17 + 496b*2. -1701b*2 - 17 Collect the terms in 4363v*3 - 12821v*3 + 4122v*3 + 4347v*3. 11v*3 Collect the terms in -100t*2 - 63100t + 1 + 126067t - 62967t. -100t2 + 1 Collect the terms in 6628n*2 - 1460n*2 - 2051n*2 - 1972n*2 - 1839n*2. -694n*2 Collect the terms in 200g*2 - 567g*2 + 5 - 5 + 248g*2 + 217g*2. 98g*2 Collect the terms in 20y*3 + 10y*2 + 36y*3 - 4y - 20y3 + 1 + 119y*3. 155y*3 + 10y*2 - 4y + 1 Collect the terms in v*2 + 183 - 167 - 16 - 1029v. v*2 - 1029v Collect the terms in 140 + 133 + 116 - 382 + 46g3. 46g*3 + 7 Collect the terms in 17w*2 + 2w + 8w - 7w + 0w2 - 1274w*3. -1274w*3 + 17w*2 + 3w Collect the terms in -38 + 4o3 + 40 - 5o*3 - 31o*3 - 23o*3. -55o*3 + 2 Collect the terms in 0 - 5470f*3 - 64019f*3 + 0. -69489f**3 Collect the te	{ "pile_set_name": "DM Mathematics" }
hird derivative of t5/30 - t4/8 - t*3/2 + 991t*2. Determine -g(s) - 3z(s). s*2 Let l(v) = -3v - 923 + 5v + 1844 - 10v - 920. Let a(u) = 15u - 1. Determine 3a(k) + 5l(k). 5k + 2 Let u = 505753 + -505754. Let n(h) = h - 1. Let b(v) = 3v + 4. Let d(i) = 3i + 4. Let x(p) = -5b(p) + 6d(p). What is ux(c) - 4n(c)? -7c Let j be 26/(15 + -28)(-3)/2. Let q = -4 + 18. Let s(m) = 6m2 + 14 + 3m + jm - 2m3 - q. Let y(p) = -p2 - p. Calculate s(o) + 6y(o). -2o*3 Let m(k) = 14768k*3 + 1144k*2 + 1144k. Let b(s) = -13s3 - s2 - s. Calculate 4576b(n) + 4m(n). -416n*3 Let t(x) = 32x*3 - 12x*2 - 28x + 14. Let r(q) = -q*2 - 4q + 2. Calculate -14r(l) + 2t(l). 64l3 - 10l*2 Let g(h) = -24h + 8. Let y(f) = -25f + 9. Let k be (1/4)/((-9)/60) + 1222/(-282). Give kg(l) + 5y(l). 19l - 3 Let x(n) = -5n. Suppose -19y = -1617 + 1598. Let h(u) = -u. Calculate yh(f) + x(f). -6f Let n(i) = -181i2 - 2i - 1. Let v(y) = -347y2 - 4y - 2. What is 7n(o) - 4v(o)? 121o2 + 2o + 1 Let p(a) = -3a3 + 20a*2 - 13a - 773. Let h(z) = 4z3 - 25z*2 + 15z + 772. What is -4h(n) - 5p(n)? -n*3 + 5n + 777 Suppose 4g - 76 = 6g. Let i = -36 - g. Let o(b) = 7b2. Let v(n) be the first derivative of n3/3 + 51. Determine io(t) - 18v(t). -4t*2 Let h(j) = 5j*2 - 4j - 7. Let g(d) = -d*2 + d. Let f = 3644 + -3640. What is fg(m) + h(m)? m*2 - 7 Let x(q) = 11q*2 + 9q + 2. Let i(b) = 5b2 + 4b + 1. Let r be (-8 - (-88)/10)/((-2)/5). Calculate rx(t) + 5i(t). 3t2 + 2t + 1 Let a(g) = -3g - 8. Let b(x) = -216 + 4x + 58 + 54 + 56 + 57. Give 6a(f) + 5b(f). 2f - 3 Let o(p) = -5p*2 - 6p - 3. Let x(j) = -384j2 + 6j - 5. Let c(v) = -77v2 + v - 1. Let u(z) = 5c(z) - x(z). What is -o(k) + 6u(k)? -k2 + 3 Let z(r) = 5r*2 + 5r + 4. Let m(k) be the third derivative of -k5/15 - k4/6 - k*3/2 + 18k*2 + 6. Let b = 13 - 15. Let f = b + 0. Give fz(n) - 3m(n). 2n*2 + 2n + 1 Let z(k) = -274k3 - 75k*2 - 20. Let g(j) = 96j*3 + 25j*2 + 7. Determine -17g(y) - 6z(y). 12y*3 + 25y*2 + 1 Let a(k) = 14k - 1. Let t(v) = -370v - 25. Give -4a(u) - t(u). 314u + 29 Let y(m) = -81m - 33. Let v(z) = 5z + 2. Let k be (2 + 1)/1-11. Let g be (-4)/(58/((-377)/(-13))). Calculate gy(u) + kv(u). -3u Let p(i) = 68i*3 - 122i*2 - 22i + 9. Let k(o) = 14o3 - 24o*2 - 4o + 2. Determine -11k(z) + 2p(z). -18z3 + 20z*2 - 4 Let y(j) = -12j*3 + 12j - 9. Let p(c) be the second derivative of 3 + 0c4 - 1/6c*3 + 7c + 1/20c5 + 1/2c*2. Determine 9p(z) + y(z). -3z3 + 3z Let q(p) = -4407p - 19. Let r(u) = 17635u + 82. Give -26q(m) - 6r(m). 8772m + 2 Let p be 11 + 1 + 210/(-14). Let k(x) = 4x*3 - 3x*2 + 5x + 3. Let u(w) = -2w3 + 2w*2 - 3w - 2. What is pk(c) - 5u(c)? -2c3 - c2 + 1 Let f(x) = 3444x*2 + 2x - 33. Let z(t) = -6887t2 - 2t + 55. Calculate 5f(l) + 3z(l). -3441l2 + 4l Let l(a) = 14a + 3. Let d(q) = 5q + 1. Let p(u) = 16u - 529. Let y be p(32). Calculate yd(i) + 6l(i). -i + 1 Let r(o) = 7o*3 - 30o*2 + 8o - 1. Let m(q) = -q*3 + 11q*2 - 2q - 1. What is -4m(z) - r(z)? -3z*3 - 14z*2 + 5 Let d(o) = 4o + 3. Let p be 3(-1)/(-3)-5. Let x(a) = -6a - 7a + 10a + 8a + 4a + 7. Calculate pd(v) + 2x(v). -2v - 1 Let u be (-10)/20 - (-4 + (0 - (-2)/4)). Let r(l) = 1. Let w(a) = 2a + 36. Calculate ur(c) + w(c). 2c + 39 Let c(u) = u2 + 25u. Let o(z) = -8z. Let v(h) = -c(h) - 3o(h). Let p(n) = -4n2 - 2n. Determine 2p(k) - 2v(k). -6k2 - 2k Let w(x) = -2x + 5. Let u(m) = m2 + 11m + 125. Calculate -u(b) - 5w(b). -b2 - b - 150 Let y(i) = -2i + 7. Let v(z) be the first derivative of z*2/2 + 142. Suppose 0u - 2u - 4 = p, 0 = -4p + 4u + 32. What is pv(n) + y(n)? 2n + 7 Let c be 6 + -12 + 7 + (0 - 0). Let a(f) = -149 + 150 + 7f - 4f. Let g(y) = -y. Determine ca(o) + 2g(o). o + 1 Let k(m) = -8m - 4 + 0m + 4m + 7m + 4m. Let n(o) = -6o + 3. Give -2k(y) - 3n(y). 4y - 1 Let s(h) = 1413h2 + 163h + 2. Let k(n) = 2825n2 + 381n + 4. Determine -3k(v) + 7s(v). 1416v2 - 2v + 2 Let u(q) = 27q - 1. Let r(k) = 173k - 223. Let c(v) = 58v - 81. Let s(t) = 11c(t) - 4r(t). Determine -3s(l) - 5u(l). 27l + 2 Let d(k) = 2k2 - k + 2. Let f(r) = -2552r*3 - 3248r*2 + 1624r - 3248. Calculate -4872d(t) - 3f(t). 7656t3 Let g be (-4 - (-3 - -1)) + (10 - 9). Let w(a) = -a2 + 1. Let u(y) = y2 + 3 + 4 - 8 - 3. What is gu(f) - 3w(f)? 2f*2 + 1 Let b(i) = -325. Let g(z) = -406. Let v(j) = 5b(j) - 4g(j). Let k(f) = -10f + 7. What is -k(s) - 6v(s)? 10s - 1 Let s(l) = l3 - l2 - l. Let a(o) = -247o3 - 6o*2 - 6o + 16. Give -a(k) + 6s(k). 253k*3 - 16 Let r(n) = -17n - 15. Let m(b) = -30b + 36b + 0 + 5. Suppose -4g = 2c - 0g + 10, -2c + 5g = 1. Let z be -3 + c/(15/40). What is zm(x) - 4r(x)? 2x + 5 Let v(a) = -68a3 - a2 + 7a. Let y(c) = -22c3 + 2c*2. What is -v(f) + 3y(f)? 2f3 + 7f*2 - 7f Let t(f) = -12f2 - 87f - 155. Let n be t(-4). Let m(b) = b*3 + b + 1. Let x(v) = 5v*3 + 4v*2 + 6v + 5. Calculate nx(l) - 4m(l). l*3 + 4l*2 + 2l + 1 Let s be 13/(-52) + 2/1611602. Let p(g) = -727g - 724g + sg. Let m(v) = -4v2 + 12v. Give -m(b) - 12p(b). 4b*2 Let u(k) = 2k + 3. Let y(d) = 12375d + 19305. Determine 12870u(c) - 2y(c). 990c Let n(v) = -69v3 - 5v - 5. Let y(u) = -1517u3 - 111u - 111. Suppose 48l - 47l - 107 = -4j, -4j - 115 = -l. Calculate ln(m) - 5y(m). -74m3 Let t(n) = 15n - 90. Let l(i) = 60i - 373. Give 2l(j) - 9t(j). -15j + 64 Let l(k) = -k*2 + 36k + 231. Let b(a) = a*2 - 30a - 230. Calculate 6b(o) + 5l(o). o*2 - 225 Let i be (-27 + 0)(-34)/119. Let u(q) = 4q - 1. Let s(z) be the second derivative of 5z3/6 - z2/2 - 3z - 135. Determine iu(d) - 3s(d). d - 1 Let d(b) = -2b - 1 + 7 - 4 + 7b. Let t(i) = -9 - 8 - 85i - 18. Determine 35d(p) + 2t(p). 5p Suppose g + 10 = 12. Let c be g/11 - (-153)/187. Let w(q) = -24q3 - 16q*2 + 16q - 16. Let n(z) = -z3 - z2 + z - 1. Calculate cw(k) - 16n(k). -8k3 Suppose -9r + 16 = -29. Let v(k) = k*2 + 52 - rk*2 + 3k - 47. Let n = 62 + -69. Let c(a) = -2a2 + a + 2. What is nc(x) + 3v(x)? 2x*2 + 2x + 1 Let m(p) = 146p - 3001. Let l(o) = 122o - 3002. What is 6l(b) - 5m(b)? 2b - 3007 Let r(g) = 7g + 6g2 - 3 + 6g + 0. Let j(s) = -4s2 - 97s + 53s + 2 + 35s. Suppose 3p - 3f + 24 = 0, -15 = 5p - f + 13. Determine pr(d) - 7j(d). -2d*2 - 2d + 1 Let n(m) = 5m - 4. Let l(h) = 292h - 99h + 1 - 192h. Determine -6l(x) - n(x). -11x - 2 Let n(v) = -11v2 - 20v - 16. Let i(u) = 10u2 + 19u + 12. Let z(x) = 4i(x) + 3n(x). Let a(g) = -20g2 - 47g. Determine -6a(q) - 17z(q). q*2 + 10q Let c(q) = 21q - 32. Let f(h) = 15h - 33. Determine -2c(j) + 3f(j). 3j - 35 Let x(y) = 26y - 21. Let d(f) = -102f + 85. Determine -6d(h) - 23x(h). 14h - 27 Let q(t) = 1044t2 + 3t - 3. Let a(c) = 25c2 + c - 1. Calculate -2a(n) + q(n). 994n2 + n - 1 Let r(u) = -5u*2 + 2u + 19. Let y(b) = 14b2 - 5b - 61. What is 17r(x) + 6y(x)? -x*2 + 4x - 43 Let j(k) = -3k2 - 33k - 50. Let t(y) = y*2 + y + 7. Determine -j(h) - 2t(h). h*2 + 31h + 36 Let u be (-1)/(-2 - (-2)/2). Let c = 25240 - 25246. Let r(g) = g - 1. Let l(j) = -j - 6 + 7j + j2 + 2j*2. Calculate cr(t) + ul(t). 3t*2 Let h(v) = -7v*2 - 5v - 43. Let i(o) = 10o2 + 7o + 64. Suppose 99 - 631 = -76q. Give qh(l) + 5i(l). l2 + 19 Suppose 4641t - 3i - 17 = 4643t, -27 = -3t + 3i. Let s(j) = 64j3 + 48j2 - 48. Let m(n) = n3 + n*2 - 1. Calculate ts(g) - 96m(g). 32g*3 Let y(m) = 157100 + 3m - 157098 - m. Let w = 12 - 9. Let k(j) be the third derivative of -j*4/6 - 5j3/6 + j2. Calculate wk(z) + 7y(z). 2z - 1 Let o(j) be the first derivative of j2/2 + j - 2. Let r(g) = -65g + 33g + 35g. Suppose 0 = -3b - 4b + 14. Calculate bo(c) - r(c). -c + 2 Let k(a) = a3 + 42a*2 - 96a - 359. Let q be k(-44). Let l(c) = -c2 + c + 4. Let d(s) = -s2 + s + 5. What is ql(z) + 6d(z)? z*2 - z + 2 Let k(v) = 2v*3 - 9v*2 + 3. Let o = -417 + 422. Let c(q) = -6q**	{ "pile_set_name": "DM Mathematics" }
108 - 101. Suppose 1 - 92 = -on. Calculate the remainder when 16 is divided by n. 3 Let o(u) = -u2 + 4u + 295. Calculate the remainder when (-12 + 0)333/(-27) is divided by o(18). 19 Let k be (-15)/(-5)5 + 0. Let v(o) = o*3 - 17o*2 + 15o - 2. Let s be v(k). What is the remainder when 1 + 15/(-20) + s/(-4) is divided by 30? 27 Let f(t) = t*2 + 20t + 94. Suppose 193 = -15m - 62. Calculate the remainder when 210 is divided by f(m). 38 Let g = 21332 + -12476. Calculate the remainder when g is divided by 26. 16 Let c = -4196 + 4212. What is the remainder when 1836 is divided by c? 12 What is the remainder when 7777/(-14)(-32)/88 is divided by (-2070)/(-50) - (-2)/5-1? 38 Suppose -4k + 425 = 5r, 2k + 99 = r - 0k. Let p = 78 - 53. What is the remainder when r is divided by p + 1 + -5 + -1 + 3? 20 Suppose 0 = -25865u + 25933u - 10608. Calculate the remainder when u is divided by 133. 23 Calculate the remainder when (746/10)/((-66)/(-330)) is divided by 15. 13 Suppose 5u = 528 + 162. Let d be 54/(-6)324/135. What is the remainder when u is divided by (-286)/d - 27/36? 33 Let s be (7 - (11 - 5))566. Suppose -4i = s - 1890. Calculate the remainder when i is divided by 84. 79 Let y(c) = c*3 + 8c*2 + 2c - 7. Suppose -2r - 69r + 165 = -16r. Calculate the remainder when y(-7) is divided by r. 1 Let x(w) = w3 - 55. Let v = -37 + 37. Let p be x(v). What is the remainder when 19 is divided by (p/22)/(((-1)/2)/1)? 4 Suppose -31u + 30u + 84 = 2a, -4u = 4a - 184. Calculate the remainder when 3683 is divided by a. 35 Let m be 5/(-10) - 1125/(-2). Let s = m + -460. Calculate the remainder when s is divided by 16. 6 Let x(s) = 3s2 + 39s + 4. Suppose 29 + 16 = -3h + v, -2h - 5v = 13. Calculate the remainder when x(h) is divided by 1 - 2/((-2)/11). 10 Let b = 6584 - 6305. What is the remainder when 1105 is divided by b? 268 Suppose -r = -5t + 4139, -4t - r = -796 - 2526. What is the remainder when t is divided by 34? 13 Suppose 0b - b = -2b, -220 = -4n + b. What is the remainder when 581 is divided by n? 31 Suppose -t = -3t + 20. Suppose -5z + 4v + 50 = 0, 160z + 1 = 161z + v. What is the remainder when t is divided by z? 4 Let t = -7172 - -7679. Calculate the remainder when t is divided by 102. 99 Let p = 2658 + -392. Calculate the remainder when p is divided by 84. 82 Let y(k) = k3 + 89k*2 + k + 212. What is the remainder when y(-89) is divided by 23? 8 Let h = -13 + 32. Suppose 75w = 16w + 3953. What is the remainder when w is divided by h? 10 Let y(u) = 55u + 1290. Calculate the remainder when y(4) is divided by 2. 0 Let v = -4032 - -4043. What is the remainder when 60 is divided by v? 5 What is the remainder when ((-1892)/430)/(2/(-260)) is divided by 76? 40 Let t(q) = -15q + 27. Let x be (-4)/(-10) + 310/(-25). Let h(b) = 36b + 17. What is the remainder when t(x) is divided by h(1)? 48 Let i = 468 + -206. Suppose 310 = 11j - i. Let t = 464 - 260. Calculate the remainder when t is divided by j. 48 Suppose 125n = 5h + 126n - 7263, 5n - 1443 = -h. Calculate the remainder when h is divided by 112. 109 Suppose 0 = 3b + 6, 7t - 6t = b + 23. Calculate the remainder when 121 is divided by t. 16 Let j = 11819 + -11800. Calculate the remainder when 3985 is divided by j. 14 Suppose -337w = -297w - 3006 - 194. Let s(t) = 3t + 3. Let q be s(-5). Let x(g) = -3g - 9. Calculate the remainder when w is divided by x(q). 26 Suppose -5x - 370 = -2q, 18x - 13x = 5q - 940. Let j = q - 78. Calculate the remainder when j is divided by 38. 36 Let c(o) = -5o*2 - 4o - 5. Let u be c(-3). Let d = 40 + u. Suppose -4n = -l + 5l - 72, -3l - dn = -53. Calculate the remainder when 82 is divided by l. 14 Suppose 0 = -2x + x - 10. Let q = -5 - x. Suppose 0 = -99o + 75o + 48. Calculate the remainder when q is divided by o. 1 Suppose -61w = -69w + 776. Suppose -9b + 3b = -84. What is the remainder when w is divided by b? 13 Let f(k) = -k2 + 17k - 60. Let n be f(12). Suppose -5o + 127 + 63 = n. Calculate the remainder when 148 is divided by o. 34 Suppose -5t - 2w = -410, -59 = -t + 12w - 17w. What is the remainder when 86 is divided by t? 2 Suppose 77o - 68o - 14505 = 2586. What is the remainder when o is divided by 5? 4 Suppose -m = 4s - 0s, 16 = 3m - 4s. Suppose -346 = -mg - 38. What is the remainder when g is divided by 16? 13 Let y(u) = -8u - 11. Suppose 3 = 3x + 6i - 2i, 0 = -4x + 3i - 21. Calculate the remainder when 19 is divided by y(x). 6 Suppose 2n = -n + 201. Let g(q) = -73 - 15q + 2q3 + 10q2 - q3 + 133 - n. What is the remainder when 143 is divided by g(-11)? 32 Let w(v) = 2v - 29. Let m(t) = -2t + 28. Let n(q) = -2m(q) - 3w(q). What is the remainder when 164 is divided by n(-1)? 32 Let t = 522 - 522. Calculate the remainder when 129 is divided by (1/1 - t) + 1152/36. 30 Let o(c) = -c*2 + 16c + 23. Let p be o(17). Calculate the remainder when (7 + (4 - 2))11 is divided by 5/((-75)/(-505)) - (-2)/p. 31 Let x(w) = -28w - 4. Let h(b) = -27b - 3. Let z(v) = -4h(v) + 3x(v). Calculate the remainder when z(3) is divided by 4(3 + (-7)/(-4)). 15 Let y = 162 + -24. What is the remainder when 536 is divided by y? 122 Suppose 3k = -m - 55, 0 = -4k + 3m + 5 - 87. Let i(c) = -c3 - 21c*2 - 41c - 14. Calculate the remainder when 128 is divided by i(k). 42 Let s(f) = 121f - 2033. Let m(u) = -u2 + u + 93. Calculate the remainder when m(0) is divided by s(17). 21 Suppose -329d + 236 = -324d - m, 2m - 233 = -5d. Calculate the remainder when 2864 is divided by d. 44 What is the remainder when -445((-667)/1595 + (-2)/11) is divided by -2 + 1 + -2 + 70? 66 Let k = -113 + 174. Suppose -3664 = -65q + 2323 + 5713. Calculate the remainder when q is divided by k. 58 Let t(c) = -18c*2 - 28c*2 - 19 + 56c2 - c3 - 6c. What is the remainder when t(7) is divided by 22? 20 Let z = 2778 - 2751. Calculate the remainder when 91 is divided by z. 10 Calculate the remainder when 178 is divided by (2832/80)/(2/5). 10 Let o = 98 - 95. Suppose -og + 3 = -39. Calculate the remainder when g is divided by -2 + 3 - (-8)/2. 4 Suppose 5q - 2214 = -2k, 10q - 873 = 8q - 5k. Calculate the remainder when q is divided by 77. 59 Suppose -3o + 326 = 89. What is the remainder when o is divided by (17 + 4)/(0 + (0 - -1))? 16 Suppose 0 = 4l - h - 1676, 3h - 203 - 1473 = -4l. Calculate the remainder when l is divided by 49. 27 What is the remainder when 257 is divided by -14 - -35 - 13 - 3? 2 Let d(s) = 8s - 7. Suppose 16k + 2k - 381 - 1401 = 0. What is the remainder when k is divided by d(3)? 14 Let i = 294 - 264. Suppose 0g + 2760 = ig. Calculate the remainder when g is divided by 16. 12 Let b = -434 - -545. Suppose -110v + bv - 8 = 0. What is the remainder when 44 is divided by v? 4 Let i(a) = a2 + 9a - 64. Suppose 13v = 15v. Suppose r = -b + 74, v = 3r + 2r + 5. Calculate the remainder when b is divided by i(-15). 23 Suppose 9g - 10g = -8w - 34, -8 = 2g + 3w. Let o(s) = s3 + 1. Let t be o(-2). What is the remainder when t/21 + (-7)/(-3) is divided by g? 0 Let u = -307 - -484. What is the remainder when u is divided by 55? 12 Calculate the remainder when 672 is divided by (-1 + 185)(-26)/(-104). 28 Suppose -34 = 3q + 4n - 150, 2q - 5n = 39. Let d be 12/(-8)6/9. Calculate the remainder when q is divided by (-4)/22 + (d - (-145)/11). 8 Let g(s) = 12s*2 + 4s - 16. Let d be g(-5). Suppose d = 21i - 135. What is the remainder when 57 is divided by i? 0 Let x be (-35)/(-20) - 9 - 2/(-8). Let u(n) = -2n*3 - 11n*2 - 8n - 9. What is the remainder when u(x) is divided by 39? 38 Let i(h) = 5h2 + 2h + 5. Let t be i(-2). Suppose -t = -2p + 95. Let b = 36 - 20. What is the remainder when p is divided by b? 10 Suppose -4l - 5s + 10s = -390, -3l = 3s - 252. Calculate the remainder when 9717 is divided by l. 87 Suppose 5q = 4t + 431, 120t + 174 = 2q + 118t. Calculate the remainder when 401 is divided by q. 69 Let t = 46 - -4. Suppose 0 = 2o - t + 26. Suppose -189 = -ol + 3. Calculate the remainder when 79 is divided by l. 15 Let k(h) = 6h*3 - 26h*2 + 63h + 25. Calculate the remainder when k(6) is divided by 29. 9 Suppose -41*	{ "pile_set_name": "DM Mathematics" }
e of b7/840 + b5/15 + b*2. Let r(t) be the third derivative of d(t). What is r(a(x))? 12x Let j(r) = 5 - 12r - 12 + 7. Let m(u) = u2. Determine j(m(o)). -12o2 Let k(h) = h2. Let m(j) = 13j2 - 11j - 11. Let b(y) = -y*2 + y + 1. Let z(r) = -22b(r) - 2m(r). Calculate z(k(p)). -4p*4 Let q(u) = -2u*2. Let p(s) = 178s. Determine q(p(k)). -63368k2 Let t(x) = -61x*2 + x. Let w(v) = -2v*2. Give t(w(i)). -244i*4 - 2i*2 Let n(t) = -t. Let s(d) be the second derivative of -5d*4/4 - 9d. Calculate s(n(f)). -15f2 Let m(i) be the second derivative of i4/24 + 3i*2/2 - 4i. Let g(l) be the first derivative of m(l). Let b(f) = -3 + 3 - f. Determine b(g(h)). -h Let v(r) = -2r - 6. Let z(a) = 4a + 11. Let f(k) = 11v(k) + 6z(k). Let b(n) = -3n2. Determine b(f(c)). -12c*2 Let k(c) = 6c + 771 - 771. Let g(w) = -3w. Determine g(k(y)). -18y Let q(y) = -153y2 - y. Let f(c) = -3c. Determine q(f(v)). -1377v2 + 3v Let b(i) = -2i. Let v(k) = -4k + 5. Let q(o) = 6o - 8. Let x(l) = 5q(l) + 8v(l). Calculate x(b(r)). 4r Let z(j) = 2j2. Let b(i) = i2 - 5i. Let f(x) = x*2 - 6x. Let p(w) = 6b(w) - 5f(w). Calculate p(z(g)). 4g4 Let x(c) = -23c. Let o(v) = 26v. Determine x(o(z)). -598z Let q(c) = -3c. Let t(b) = -10b. Let s(g) = 14q(g) - 4t(g). Let l(m) = -3m + 4m + 0m. What is s(l(n))? -2n Let h(o) be the third derivative of 2o2 + 1/20o*5 + 0o*4 + 0o + 0 + 0o3. Let l(d) = d. Let w(t) = 8t. Let x(p) = 6l(p) - w(p). Calculate h(x(s)). 12s*2 Let r(z) = -2z*2. Let q(w) = 2w. Let x(n) = -3n. Let u(d) = 9q(d) + 5x(d). Give u(r(a)). -6a*2 Let g(n) = -18n*2 - 16n*2 + 59n*2 - 21n*2. Let q(r) = -3r + 3r2 + 3r. What is q(g(m))? 48m4 Let d(r) = 3r. Let k(y) be the first derivative of -y*3/3 + 1. Determine k(d(z)). -9z2 Let y(p) = -p. Let t(r) = -r2 + 6r + 6. Let i(z) = z2 - z - 1. Let c(b) = 6i(b) + t(b). What is y(c(v))? -5v2 Let g(p) = -353p. Let q(b) = -2b2. Determine q(g(n)). -249218n*2 Let l(z) = -4z*2 + 4z*2 + 2z2. Let n(j) be the first derivative of -j2 + 3. What is n(l(m))? -4m2 Let y(s) be the second derivative of s4/6 - 4s. Let a(c) = -9c. Calculate y(a(g)). 162g*2 Let r(b) = 2b*2. Let s(n) be the second derivative of -7n*3/3 + n + 6. What is r(s(t))? 392t*2 Let r(o) = -15o*2. Let d(h) = -3h. What is d(r(i))? 45i2 Let k(z) = -968z*2. Let q(g) = -g. Calculate q(k(f)). 968f*2 Let t(z) = z. Let p(x) be the first derivative of 5x*2/2 + 7. Give p(t(w)). 5w Let s(x) = -18x2. Let r(z) = -1 - z2 + 6 - 5. Determine s(r(l)). -18l*4 Let t be 0/(-3) + -1 + -5. Let b = 8 + t. Let j(a) = -4a*2 + 3a*b + 0a*2. Let f(u) = 2u*2. Determine f(j(y)). 2y*4 Let y(j) = 4j*2 + 11j - 11. Let h(q) = -2q2 - 6q + 6. Let i(m) = 11h(m) + 6y(m). Let s(d) = 35d - 2. Determine i(s(b)). 2450b*2 - 280b + 8 Let x(o) = -7o + 11. Let d(p) = -8p + 12. Let q(v) = -6d(v) + 7x(v). Let y(m) = -m + 7. Let l(t) = 7q(t) - 5y(t). Let i(w) = 6w. What is l(i(u))? -12u Let f(q) = -20q2. Let p(h) = 2h*2 + 14h - 14h. Calculate f(p(g)). -80g*4 Let z(w) = 4w2. Let t = 10 + -8. Let s(n) = -nt - 2n2 - 2n + 2n. Let i(h) = -h2. Let p(f) = -5i(f) + 2s(f). Calculate p(z(v)). -16v4 Let d(n) = -n. Let a(c) = -c2 + 4c + 7. Let u be a(5). Let r(z) = z - uz + 4z. What is d(r(s))? -3s Let z be (-6)/(-9) + (-16)/(-3). Let l(o) = -2o2 - 6 + z. Let i(w) be the first derivative of -w3/3 - 2. What is i(l(b))? -4b*4 Let i(p) = -10p*2 - 6p - 6. Let w(j) = -9j2 - 5j - 5. Let f(d) = 5i(d) - 6w(d). Let q(n) = n - 5n + 2n + n. Give f(q(y)). 4y2 Let v(o) = 6o. Let a(n) = n*2 - 6n + 5. Let d be a(5). Let l(k) = 3k - 2k*2 + dk - 3k. Calculate v(l(p)). -12p*2 Let q(m) = -5m*2 + 0m + 0m. Let z(r) = 5r + 6r - 5r - 4r. Calculate z(q(h)). -10h*2 Let y(k) = 5k. Let o(d) be the first derivative of 0d - 2/3d*3 + 0d*2 + 3. What is y(o(i))? -10i*2 Let k(m) = -299m*2. Let b(u) = -7u*2. Calculate b(k(c)). -625807c4 Let u(z) = 0 + 0 - z. Let p(b) be the third derivative of b4/12 - 4b2. Calculate p(u(f)). -2f Let q(z) = -6z. Let k(t) = -243t*2. Give k(q(w)). -8748w*2 Let q(g) = -2g*2. Let s(d) = -11d - 7. Give s(q(p)). 22p2 - 7 Let y(b) = -b. Let c(x) = -176x. What is c(y(s))? 176s Let h(r) = -3r. Let w(t) = -t + 1005. What is w(h(o))? 3o + 1005 Let f(a) = -a2 - 802. Let m(n) = n2. What is m(f(l))? l4 + 1604l2 + 643204 Let s(l) be the third derivative of -l4/24 - 2l2. Let g(b) = b + 3 - 3. Give g(s(d)). -d Let n(s) = -s + 2200. Let j(l) = -3l*2. What is n(j(h))? 3h*2 + 2200 Let p(d) = -8d*2 + 0d2 + d2 + d*2. Let x(m) = -2m. Determine p(x(i)). -24i2 Let d(t) = -1 + 1 - 3t. Let o(u) be the first derivative of -u*3/3 + 12. Determine d(o(i)). 3i*2 Let w(s) be the first derivative of -17s*2/2 - 13. Let c(k) = -2k. Calculate c(w(z)). 34z Let f(s) = -2s*2. Let n(p) = -2p2 - p2 + 5p2. Determine f(n(h)). -8h*4 Let a(j) be the third derivative of 4j*2 + 0j*3 + 0 + 1/20j*5 + 0j*4 + 0j. Let t(y) = 8y2. What is t(a(g))? 72g*4 Let c(s) = -3s*2 + 47s + 16. Let x be c(16). Let m(v) be the first derivative of 3 - 1/3v3 + xv + 0v2. Let z(f) = -4f*2. What is m(z(t))? -16t4 Let s(y) be the third derivative of y5/60 + 4y2. Let a(n) be the first derivative of 0n + 1/2n2 + 1. Determine s(a(b)). b2 Let f(r) = -r. Let z(p) = 0 + 7 - 6 + 0. Suppose d + 8 = b - 5b, 0 = 3b - 4d + 6. Let a(y) = y - 2. Let x(j) = bz(j) - a(j). Determine x(f(o)). o Let s(a) = 3a. Let d(g) = g*3 + 2g*2 - 3g - 3. Let h be d(-2). Let b = h + 2. Let x(m) = -3m2 - 3m*2 + bm*2. What is s(x(f))? -3f2 Let g(f) be the third derivative of -f7/5040 + f*5/30 + 2f*2. Let a(j) be the third derivative of g(j). Let y(k) = 2k. Give y(a(v)). -2v Let b(m) = 3m. Let l(j) = -j*2 - 4j + 2. Let h be l(-4). Suppose 2i - 3s = i + 15, -2s = -i + 11. Let v(f) = -3f*2 - i + 2f*h + 3. Calculate v(b(r)). -9r*2 Let x(u) = u. Let g(r) = 4r - 8. Let b be g(6). Let s(f) = -16 + 3f + b. Determine x(s(c)). 3c Let s(m) = -4m2. Let i(h) = -2h + 11. Let p(b) = -b + 6. Let n(f) = -6i(f) + 11p(f). Give s(n(k)). -4k2 Let o(l) = 7 + 0 - 7 + 3l. Let n(d) = -3. Let q(u) = u*2 - 5. Let t(s) = 5n(s) - 3q(s). Give o(t(j)). -9j2 Let z = -56 + 1345/24. Let t(o) be the third derivative of 0 - o2 + 0o + 0o*3 + zo*4. Let x(g) = 3g*2. What is x(t(v))? 3v*2 Let k(u) = 4u. Let c(m) = 4m2 + 18. Determine k(c(a)). 16a2 + 72 Let h(j) be the third derivative of -j7/5040 - j*5/30 + 2j*2. Let n(d) be the third derivative of h(d). Let o(g) = -4g + 4g - 2g. Give o(n(b)). 2b Let w(y) = -2y. Let u(t) = -29t2 + 16t*2 + 16t*2. Determine u(w(h)). 12h2 Let h(l) = -l3 - 6l2 - 6l - 2. Let k be h(-5). Let g(f) = -3 + k - f. Let m(q) = 0q + 3q - 3q2 - 3q. Determine m(g(a)). -3a2 Let m(i) = -11i*2 + 3i. Let q(v) = -v*2 + 5v. Let o(w) = -2w2 + 8w. Let r(d) = 5o(d) - 8q(d). What is r(m(y))? -242y4 + 132y*3 - 18y*2 Let h(m) = 4m. Let i(u) = -161u2. Calculate h(i(b)). -644b*2 Let n(b) = -2b*2 - 2. Let f(c) = 1. Let h(q) = -5f(q) - n(q). Let z(t) = t*2. What is h(z(m))? 2m*4 - 3 Let l be (-24)/6 - 0/2. Let k(d) = 32d*2 + 11d. Let q(o) = 11o2 + 4o. Let x(m) = lk(m) + 11q(m). Let b(f) = -2f2. Determine x(b(s)). -28s*4 Let i(r) = -7r*2. Let p(w) = -5w + 5. Let j(m) = 1. Let d(a) = 5j(a) - p(a). What is d(i(t))? -35t*2 Let b(i) = -17i*2 + 7i*2 + 8i*2 + 0i*2. Let r(o) = -18o*2. Give r(b(z)). -72z*4 Let v(s) be the second derivative of 23s*4/12 + 39s. Let j(l) = 2l. Calculate j(v(a)). 46a*2 Let z(g) = 4g*2. Let t(n) = -2056n. Calculate z(t(a)). 16908544a2 Let i(m) be the second derivative of m4/3 - 5m. Let n(k) = 5k + 3k*2 - 2k*2 - 5k. Determine n(i(r)). 16r4 Let t(s) = -s2 - 4s. Let b(x) = x. Let w(d) = -4b(d) - t(d). Let a(r) = 2r*2. Give a(w(h)). 2h*4 Let q(y) = 2y2. Let h(a) be the first derivative of a2 - 1. Determine q(h(s)). 8s2 Let b(i) = -21 + 21 - i*2. Let w(r) =	{ "pile_set_name": "DM Mathematics" }
1835x4 - x + x2 - 1 + 2x + 2x3 to the form qx + yx4 + ux*3 + px*2 + s and give s. -1 Express (-1755 - 137n + 1755)(-10 - 15 + 5 - 4 + 2) in the form on + d and give o. 3014 Express m*2 - 116 - 2m*2 + 2m*2 + 0m*2 + 152 as h + vm + im2 and give i. 1 Express (0h - 4h + h + (-2 + 2 - 1)(h + 0 + 0))(-46h - 16 + 20 - 2) in the form sh + ah*2 + j and give s. -8 Express 4 + 27x - 40x - 53x in the form sx + i and give s. -66 Rearrange (3v - 5v + 3v)(-3v - 2v - 3v)(4 + 0 - 5)(-3 - 2 + 3) - v*2 - 2v*2 - 6v*2 to jv + uv2 + y and give u. -25 Express -l + l2 - 3l*4 + 0l*3 + 31l + 8l - 2l*3 as ml*3 + rl + kl2 + s + il*4 and give m. -2 Rearrange -14d*2 - 95d*2 + 22d*2 - 127d*2 to the form bd + z + qd2 and give q. -214 Rearrange 0v*3 - 6v - 59v3 + 6v + 0v + 3 + v to pv*2 + hv*3 + lv + d and give h. -59 Rearrange (0z2 + 0z2 + z3)(3 + 0 + 2)(-2 + 2 - 2)(-7 + 10 + 17 + (-1 + 4 - 5)(-1 + 2 + 2)) to nz + vz*3 + f + jz*2 and give j. 0 Express 514 + 3j*2 + 2j*2 + 0j*2 - 4j*2 - 3j - 545 in the form dj + gj*2 + m and give g. 1 Rearrange (-4v + 5v + 0v)(-2 + 2 - 603392v + 610045v) to zv*2 + q + hv and give z. 6653 Express ((-3 + 2 - 1)(-2 - 1 + 2) + 20 + 10 - 45)(-5z + 5z*3 + 5z) as dz3 + oz*2 + y + iz and give d. -65 Express -30a + 28a - 42a3 + 36a*3 - 13 in the form ha*3 + fa + xa2 + m and give h. -6 Rearrange (-3d - 8d + 7d - 12d)(-4 + 7d2 + 4) to zd + qd2 + r + cd*3 and give c. -112 Rearrange (2 - 2 - 1)(480u - 561u + 1400u) to pu + r and give p. -1319 Rearrange 15 + n2 + n4 + n - n to zn3 + rn*4 + j + an*2 + dn and give a. 1 Express -23 + 3f2 + 3f*3 + 0f3 - 4 - f3 - 2f as pf*3 + lf*2 + bf + g and give b. -2 Rearrange 0 - 13y + 1 + 6 - 8 to p + by and give p. -1 Rearrange 40 + 282v2 + 34 - 74 to cv + zv2 + p and give z. 282 Rearrange (-2b + 3b + 0b)(0 + 0 - b) - 109b*2 + 21b*2 + 2424b - 2423b to ab*2 + d + nb and give d. 0 Express c + 4666c3 - 4668c*3 - 5 - 3c + c*4 as zc*2 + oc*3 + n + wc + dc4 and give n. -5 Express 18j + 12j - 30j + 38j2 - 1 as q + kj*2 + tj and give t. 0 Rearrange 2f3 + 16f*2 + 4f - 7f2 - 7 - 9f*2 to df + pf2 + b + kf*3 and give b. -7 Rearrange -367 + 116f*2 - 5f - 365 + 732 to the form c + yf + mf*2 and give m. 116 Rearrange (s - 5s + 115 + 6s)(1 - 2 - 4) to p + ls and give l. -10 Rearrange (-3g*2 + 4g*2 - 3g*2)(-g - g - 2g)(-g + 2 - 2) + g*4 + 2712g*3 - 2667g*3 - 7g*4 to vg*2 + ug + tg3 + r + ig*4 and give r. 0 Express p - p + p + (-3 + 3 - 2p)(0 - 2 + 0) + 4p - 4p - p + 2p + p - 2p + 271p - 127p - 146p - 2463 as h + kp and give k. 3 Express ((2m - 1 + 1)(32 - 327 - 74) - 3m + 2m + 2m)(m - m + 2m*3) in the form qm*3 + vm*2 + um + t + cm4 and give c. -1474 Rearrange (-42 - 37 + 26)(-g + 2g + g + (g + 0g - 3g)(-2 - 1 + 2)) to the form cg + z and give c. -212 Rearrange -2s + 21s3 - 13s*3 - 2s*2 - 31s*3 + 2s*4 to the form ds*4 + ws*3 + z + ys*2 + os and give w. -23 Rearrange (2 + 2 + 0)(-b + 0b + 11b) + 1 - 1 + b to hb + s and give h. 41 Rearrange (-4z2 + z2 + 7z*2)(11z + 11 - 11) + 3 - 2z*3 - 3 + (3z*2 + 3z*2 - 5z*2)(-1 + 1 - z) to r + tz + pz*2 + hz*3 and give h. 41 Rearrange -4m*3 + 0m3 + m3 - m + (-2 + 0 + 7 + (1 - 1 + 1)(3 - 1 - 1))(5m3 - m3 - 2m*3) to o + tm*2 + pm + rm3 and give r. 9 Express (-3v*3 - 5 + 5)(3 - 2 - 4)(-22 - 18 + 43) as lv*2 + tv + zv3 + c and give z. 27 Rearrange -11k - 2k3 + 1 + 14k*4 - 7k*4 - 10k4 + k3 to hk4 + vk*3 + ck*2 + z + nk and give c. 0 Express -3g2 - 7g*2 + 3g - g*3 + 6g*2 as o + xg*2 + zg*3 + jg and give z. -1 Express (3 - 19 + 63 + 19)(f2 - 2f*2 + 2f*2 - 6f*2 + 28 - 28 + (f - 2 + 2)(-2 - 2f + 2)) as if + j + hf2 and give h. -462 Rearrange -2 - 37s*2 - 55s*2 - 3s*4 + 5s*4 + 87s*2 + s - 3s*4 + 15s*3 to the form t + ls*2 + ys*4 + ds*3 + gs and give t. -2 Express -30 - 33 + 0p2 - 5p*2 + 101 - 35 as ap*2 + q + kp and give a. -5 Express -c*4 + 591c*3 - 593c*3 + 2 + 2c*4 - 5c as l + kc3 + rc*4 + nc*2 + oc and give l. 2 Express -5649j3 + 6014j*3 - j + j + 2j*2 as bj*2 + cj + qj3 + x and give q. 365 Rearrange -37d*3 - 4d + 11 + 3d2 + 35d*3 + 0d*2 to id + v + wd3 + hd*2 and give h. 3 Express -2x*2 - 106x + 56x - 4x*2 + 8x*2 + 51x as u + kx + ax*2 and give a. 2 Express (-36x*3 - 44x*3 - 30x*3 + (0x*2 - 3x*2 + 6x*2)(-x + x + x))(-4 + 0 + 5) in the form jx*3 + ox + ax2 + c and give j. -107 Rearrange -2z + 3z4 + 2z*2 + 13z*4 - 20z*4 to the form iz*3 + x + qz + kz4 + nz*2 and give q. -2 Rearrange (-2 - 4 + 4)(34 - 55 + 1)(0 + 2p + 1 - 3) to l + zp and give l. -80 Express (31v + 30v - 62v)(0 + 5 - 4) in the form s + bv and give b. -1 Express 3z4 + 5 + 35z*3 + z - 6z + 5z - z - 6 as qz + wz4 + g + fz*3 + xz*2 and give q. -1 Express 3g*3 + 228g*4 - 222g*4 + 2 - 4 in the form sg*4 + wg + pg3 + n + lg2 and give n. -2 Rearrange (r2 + 0r2 + r3 - 4r*2)(1 - 1 - 2)(-145 + 85 + 61) to the form hr*3 + b + zr*2 + kr and give z. 6 Express -1 + 2i4 - 4i*2 - 3i - 1 - i*3 - 3i + 5i as ji*3 + wi + xi2 + ni*4 + d and give d. -2 Express -2d*2 + 2d - 2d + (-d + 2d - 2d)(-3 + 2 - 1)(-2898d - 2688d + 5239d) as xd2 + cd + k and give x. -696 Rearrange -76 + 7r2 - 6r*2 + 52 to the form m + cr + xr2 and give x. 1 Express (-1 - 1 - 4)(558 + 0i2 - 3i*2 - 559) in the form o + mi*2 + zi and give m. 18 Rearrange (-1 + 1 + x + (1 - 5 + 1 - 1 + 2 - 2 + 6 + 5 + 4 + 3 + 1 - 6 + (1 + 1 + 0)(2 - 4 + 3))(0 - x + 0))(-3 - 1 + 3) to the form y + jx and give j. 10 Rearrange (x + 3x + 4x)(116 - 12 - 48) + 0x + 3x - 2x to the form hx + p and give h. 449 Rearrange -47y + 245 - 23y - 5y*3 - 123 - 122 to the form by*2 + m + py + vy3 and give v. -5 Rearrange (2v - 2v - 2v + (v + 0 + 0)(-2 + 2 + 1) + 1 - 1 + 2v)(-29v + 31v - 59v) to the form p + mv + cv*2 and give c. -57 Rearrange -434w*3 + 6w*3 - 234w3 + (-w3 - w3 - w3)(3 + 2 - 3) to aw*2 + l + gw*3 + hw and give g. -668 Express -2s3 + 3s*4 + 2s*3 + (209 - 209 - 8s*2)(-9s2 - 7s*2 + 6s*2) in the form is*3 + vs*4 + ys*2 + b + xs and give v. 83 Rearrange (4u - u3 - 4u)(-1 + 0 + 3) + 59u*2 - 194u*3 + 446u*3 - 227u*3 to wu*3 + bu*2 + ou + m and give w. 23 Rearrange (-18n + 7n + 5n)(-27n - 21 + 6n + 23n) to the form qn + u + rn2 and give q. 126 Rearrange 16h + 9h + 0h + 8h to the form bh + g and give b. 33 Express (b*2 - 2b2 - b2)(-10b + 135 - 135) + 2b3 + 6b3 + b3 + b*3 + 5b*3 - 2b*3 as wb + qb2 + fb*3 + m and give f. 33 Rearrange -2 - 72w*2 + 2w3 + w4 + 155w2 - 76w*2 to sw + rw4 + n + mw*3 + jw*2 and give r. 1 Express (-3y*3 + 2y3 - y3 - 10y3 + 8 - 8 + (0y - 2y + 0y)(y2 - 2y*2 + 3y*2))(-3 + 2 + 2) in the form uy + w + xy*2 + sy3 and give s. -16 Rearrange s3 - 49s2 + 49s*2 + 3s*3 - 27 - 2s*3 to hs + vs3 + is*2 + w and give v. 2 Rearrange -124h*2 + 2h*3 - 6h*3 + 0h*3 - 4h*3 + 98h*2 to the form sh + f + qh3 + dh2 and give q. -8 Rearrange (u2 + 16u2 - 3u*2)(2u + 7u + 2u) + 0u*2 + 0u*2 - 2u*3 to the form q + ju*3 + hu + mu2 and give j. 152 Rearrange (l + 6l - 4l)(1941 - 1941 + 596l2)(l - 2 + 2) to pl4 + zl*3 + g + vl + kl2 and give p. 1788 Express -8a*3 + 39a*2 + 19 - 41a*2 + 0a - 13a - 19 as qa + za2 + s + va*3 and give q. -13 Express (-2p + 18p - 5p)(23 + 37 - 27)(-3 + 2p + 3) as n + bp*2 + sp and give b. 726 Rearrange (0j + 3j + j)(-22 - 28 - 2)(j + 4j - 3j) to the form xj2 + o + wj and give x. -416 Express (-5t - t + 2t)(3 - 3 + 1)(-1 + 2 - 4 + 0) as pt + g and give p. 12 Rearrange (18h*3 - 55 + 55 + 55h*3)(2 + 6 - 4) to the form ph*3 +	{ "pile_set_name": "DM Mathematics" }
rd root of 47 to the nearest integer? 4 What is 471 to the power of 1/4, to the nearest integer? 5 What is the cube root of 3613 to the nearest integer? 15 What is 1085 to the power of 1/2, to the nearest integer? 33 What is the square root of 894 to the nearest integer? 30 What is 12706 to the power of 1/2, to the nearest integer? 113 What is the third root of 461 to the nearest integer? 8 What is the fifth root of 895 to the nearest integer? 4 What is 7003 to the power of 1/5, to the nearest integer? 6 What is the ninth root of 3406 to the nearest integer? 2 What is 558 to the power of 1/3, to the nearest integer? 8 What is 85996 to the power of 1/8, to the nearest integer? 4 What is the cube root of 155050 to the nearest integer? 54 What is the third root of 255 to the nearest integer? 6 What is the third root of 6410 to the nearest integer? 19 What is 17019 to the power of 1/2, to the nearest integer? 130 What is the seventh root of 5766 to the nearest integer? 3 What is 4934 to the power of 1/9, to the nearest integer? 3 What is 1321 to the power of 1/2, to the nearest integer? 36 What is 19633 to the power of 1/2, to the nearest integer? 140 What is the cube root of 14209 to the nearest integer? 24 What is 1414 to the power of 1/4, to the nearest integer? 6 What is 119 to the power of 1/3, to the nearest integer? 5 What is 2081 to the power of 1/3, to the nearest integer? 13 What is 10855 to the power of 1/5, to the nearest integer? 6 What is the cube root of 25412 to the nearest integer? 29 What is the third root of 55827 to the nearest integer? 38 What is 9938 to the power of 1/8, to the nearest integer? 3 What is 1173 to the power of 1/9, to the nearest integer? 2 What is 11023 to the power of 1/2, to the nearest integer? 105 What is 17575 to the power of 1/4, to the nearest integer? 12 What is 957 to the power of 1/10, to the nearest integer? 2 What is the ninth root of 280 to the nearest integer? 2 What is the cube root of 21742 to the nearest integer? 28 What is the cube root of 21212 to the nearest integer? 28 What is the third root of 712 to the nearest integer? 9 What is 163 to the power of 1/3, to the nearest integer? 5 What is the square root of 10026 to the nearest integer? 100 What is the sixth root of 10650 to the nearest integer? 5 What is the cube root of 7138 to the nearest integer? 19 What is the third root of 37026 to the nearest integer? 33 What is the cube root of 4021 to the nearest integer? 16 What is the square root of 6182 to the nearest integer? 79 What is the cube root of 31106 to the nearest integer? 31 What is the tenth root of 149230 to the nearest integer? 3 What is 38902 to the power of 1/10, to the nearest integer? 3 What is the third root of 24910 to the nearest integer? 29 What is the cube root of 43403 to the nearest integer? 35 What is the third root of 2403 to the nearest integer? 13 What is the fourth root of 109109 to the nearest integer? 18 What is 2088 to the power of 1/3, to the nearest integer? 13 What is the eighth root of 6609 to the nearest integer? 3 What is 108 to the power of 1/6, to the nearest integer? 2 What is 852 to the power of 1/3, to the nearest integer? 9 What is 1281 to the power of 1/10, to the nearest integer? 2 What is 12576 to the power of 1/2, to the nearest integer? 112 What is the fourth root of 18831 to the nearest integer? 12 What is the square root of 4523 to the nearest integer? 67 What is 6619 to the power of 1/3, to the nearest integer? 19 What is 37305 to the power of 1/3, to the nearest integer? 33 What is the ninth root of 830 to the nearest integer? 2 What is 52014 to the power of 1/3, to the nearest integer? 37 What is the square root of 4363 to the nearest integer? 66 What is the cube root of 12834 to the nearest integer? 23 What is the seventh root of 135143 to the nearest integer? 5 What is 4022 to the power of 1/4, to the nearest integer? 8 What is the seventh root of 14999 to the nearest integer? 4 What is 39064 to the power of 1/10, to the nearest integer? 3 What is the fifth root of 3574 to the nearest integer? 5 What is the cube root of 2216 to the nearest integer? 13 What is 1045 to the power of 1/2, to the nearest integer? 32 What is the square root of 38526 to the nearest integer? 196 What is the third root of 950 to the nearest integer? 10 What is 537 to the power of 1/3, to the nearest integer? 8 What is the square root of 733 to the nearest integer? 27 What is the cube root of 770 to the nearest integer? 9 What is the square root of 1068 to the nearest integer? 33 What is the third root of 2201 to the nearest integer? 13 What is 1644 to the power of 1/3, to the nearest integer? 12 What is 31827 to the power of 1/2, to the nearest integer? 178 What is the fourth root of 11 to the nearest integer? 2 What is 7618 to the power of 1/3, to the nearest integer? 20 What is the third root of 155 to the nearest integer? 5 What is the seventh root of 3646 to the nearest integer? 3 What is the square root of 102150 to the nearest integer? 320 What is the square root of 100378 to the nearest integer? 317 What is 1263 to the power of 1/5, to the nearest integer? 4 What is 516 to the power of 1/6, to the nearest integer? 3 What is the cube root of 15604 to the nearest integer? 25 What is 44477 to the power of 1/9, to the nearest integer? 3 What is 192020 to the power of 1/3, to the nearest integer? 58 What is the square root of 9034 to the nearest integer? 95 What is 6335 to the power of 1/2, to the nearest integer? 80 What is the sixth root of 1073 to the nearest integer? 3 What is the square root of 7174 to the nearest integer? 85 What is the square root of 19876 to the nearest integer? 141 What is the fourth root of 4066 to the nearest integer? 8 What is the seventh root of 90 to the nearest integer? 2 What is 72655 to the power of 1/2, to the nearest integer? 270 What is the sixth root of 134 to the nearest integer? 2 What is the third root of 2340 to the nearest integer? 13 What is the third root of 531 to the nearest integer? 8 What is the cube root of 1355 to the nearest integer? 11 What is the ninth root of 2436 to the nearest integer? 2 What is 1458 to the power of 1/9, to the nearest integer? 2 What is the cube root of 5794 to the nearest integer? 18 What is 8155 to the power of 1/4, to the nearest integer? 10 What is 36439 to the power of 1/2, to the nearest integer? 191 What is 796 to the power of 1/2, to the nearest integer? 28 What is 3573 to the power of 1/3, to the nearest integer? 15 What is 1394 to the power of 1/2, to the nearest integer? 37 What is 49585 to the power of 1/7, to the nearest integer? 5 What is the square root of 5866 to the nearest integer? 77 What is 15967 to the power of 1/4, to the nearest integer? 11 What is the third root of 3934 to the nearest integer? 16 What is the sixth root of 5881 to the nearest integer? 4 What is the tenth root of 8033 to the nearest integer? 2 What is 397 to the power of 1/6, to the nearest integer? 3 What is the square root of 2530 to the nearest integer? 50 What is 2949 to the power of 1/2, to the nearest integer? 54 What is the square root of 806 to the nearest integer? 28 What is the cube root of 17868 to the nearest integer? 26 What is the eighth root of 11665 to the nearest integer? 3 What is 50315 to the power of 1/5, to the nearest integer? 9 What is the square root of 11809 to the nearest integer? 109 What is the fifth root of 1406 to the nearest integer? 4 What is the fourth root of 492 to the nearest integer? 5 What is 36927 to the power of 1/8, to the nearest integer? 4 What is 23345 to the power of 1/3, to the nearest integer? 29 What is the cube root of 30860 to the nearest integer? 31 What is the square root of 1970 to the nearest integer? 44 What is 65804 to the power of 1/2, to the nearest integer? 257 What is the ninth root of 3588 to the nearest integer? 2 What is the seventh root of 4531 to the nearest integer? 3 What is 83054 to the power of 1/2, to the nearest integer? 288 What is the third root of 113097 to the nearest integer? 48 What is 1472 to the power of 1/6, to the nearest integer? 3 What is the seventh root of 1780 to the nearest integer? 3 What is 36475 to the po	{ "pile_set_name": "DM Mathematics" }
Let r be 4/(-1 - (0 - 108/116)). Let n = r - -66. Differentiate 6j + 7j + n + 5j with respect to j. 18 Let x(o) be the first derivative of -55o3 - o2/2 + 3503o + 1940. Differentiate x(j) wrt j. -330j - 1 Let c(i) = -i*3 - 6i*2 - 6i + 23. Let x be c(-5). What is the second derivative of -334l3 - 249l*3 + xl + 673l3 + 3 wrt l? 540l Let q(d) = -2125d + 1022. Let z(r) = 3r - 3. Let g(o) = -2q(o) - 4z(o). Differentiate g(i) wrt i. 4238 Let y(x) = 40135x - 23033. Let d(p) = 8027p - 4606. Let i(q) = 19d(q) - 4y(q). What is the derivative of i(g) wrt g? -8027 Find the second derivative of 262l - 378l*2 + 1102l*2 - 6l*4 - 390l*2 + 1055l - 391l2 wrt l. -72l*2 - 114 Suppose 7u - 4u = 6. What is the second derivative of 4k + 35k2 + 17k*2 - 2k*u - 13k*2 wrt k? 74 Let h(q) be the first derivative of -2q*6/3 + 4q*5/5 + 13q*3/3 - 2391q*2/2 - 6225. What is the second derivative of h(z) wrt z? -80z*3 + 48z*2 + 26 Let u(n) be the second derivative of 3133n*4/12 + 16n*3 - 15n*2 + 5674n. What is the second derivative of u(y) wrt y? 6266 Suppose 70 = 10t - 3t. What is the first derivative of -48 - a*2 - ta - a*2 - 37a - 36a wrt a? -4a - 83 Let c(g) be the second derivative of -227g6/15 - 7g*4/12 + 2611g*2 - 1780g. Find the first derivative of c(k) wrt k. -1816k3 - 14k Let m(r) be the second derivative of 228r + 0r*2 + 0 + 0r*5 - 9/4r*4 + 1/6r*3 + 341/30r*6. What is the third derivative of m(y) wrt y? 8184y Let p(c) be the second derivative of 262c3 - 369c*2 - 1321c. Differentiate p(s) wrt s. 1572 Let w(b) be the first derivative of 28b - 5 + 97/2b2. What is the first derivative of w(d) wrt d? 97 Let h(u) = -u3 + 12u2 - 10u - 5. Let b be h(11). What is the second derivative of -96c + c + 4c*3 - bc*3 + 11c - 4c2 wrt c? -12c - 8 Let x(m) = 7287m2 - 32m + 5195. Let s(z) = -2430z2 + 10z - 1732. Let y(r) = 13s(r) + 4x(r). What is the first derivative of y(t) wrt t? -4884t + 2 Suppose w + 5y - 8 = 0, 0y - y - 14 = -5w. Find the third derivative of -36t2 - 12t*w + 41t*2 - 114t*2 - 58t*3 wrt t. -420 Suppose 8r - 67 = 5. Find the first derivative of 15 - 235w - 8 + rw + 16 wrt w. -226 Let c(l) = 2381l + 1588. Let f(p) = 13p + 1. Let d(j) = c(j) - f(j). Find the first derivative of d(y) wrt y. 2368 Find the second derivative of -111b2 - 224b*2 - 216b*2 - 368b wrt b. -1102 Find the first derivative of 821q3 - 1777q*3 - 1529q*3 - 516 + 4501 wrt q. -7455q*2 What is the first derivative of 165u*2 - 9100u*2 - 3179u*2 + 2465 wrt u? -24228u Differentiate 675 + 52l - 205l - 21l - 100l with respect to l. -274 Suppose 5z - 18 = -4d, -2 = 4d - 3d - 2z. Let k be (48/(-84))/(-4)-14(-9)/2. Differentiate -19l*d + 10l*2 - 83 - kl*2 + 91 with respect to l. -36l Let b(q) = -q*2 - 1. Suppose 33 = -10p + 113. Let v(a) = 3 - 8a2 + p + 10. Let r(k) = -4b(k) - v(k). What is the derivative of r(g) wrt g? 24g Let q(t) be the first derivative of 238 - 38/7t*7 + 1/6t*6 + 7t*2 - 2/3t*3 + 0t*5 + 0t*4 + 0t. Find the third derivative of q(f) wrt f. -4560f3 + 60f*2 Let v(n) be the second derivative of 9n*8/56 + 7n5/20 + n4/4 - 241n2/2 + 315n. Find the third derivative of v(h) wrt h. 1080h3 + 42 Let r = 368 - 366. What is the first derivative of -xr - 2932x + 2906x + 53 + 4 + 3x*2 wrt x? 4x - 26 Find the third derivative of 307y2 - 147y*2 - 8y*4 - 153y*2 - 354y*3 - 1 + 145y wrt y. -192y - 2124 What is the third derivative of -679u*2 - 328u*2 + 1034 - 35u*3 - 1034 wrt u? -210 What is the second derivative of 17i*3 - 14 + 288i*5 + 304i*5 - 60i*5 - 30i - 17i3 wrt i? 10640i*3 Let y(h) be the first derivative of 1/3h*3 + 0h*2 + 41 + 0h*4 - 72/5h*5 - 8h. Differentiate y(j) with respect to j. -288j3 + 2j What is the second derivative of -16v + 3v*2 - 2v*3 - 4v*2 + 25837 - 1567v*4 - 25894 wrt v? -18804v*2 - 12v - 2 Let h(t) be the second derivative of 765t4 + 7487t*2/2 - 5746t. Differentiate h(l) with respect to l. 18360l Suppose -5j = 4a + 20, -a + 2j + 8 = -4a. Differentiate -24 - v + 22v*2 - 5 + av - v wrt v. 44v - 2 Let q(t) be the third derivative of -151t*7/42 - 3188t*3/3 - 37t*2 + 5t. What is the derivative of q(i) wrt i? -3020i3 Let a = -22 + 25. Suppose 0 = -ax + r + 11, -r = 4x - 4 + 1. What is the third derivative of -9q*2 - 4q*4 + 3qx - q4 + 0q4 wrt q? -120q Let x(i) be the first derivative of 1354i3 + 1269i*2/2 - 4181. Find the second derivative of x(f) wrt f. 8124 Suppose -4p + 2k + 10 = k, k = -5p + 8. Let g(b) = 75b + 6. Let v(t) = 76t + 5. Let r(i) = pv(i) - 3g(i). What is the derivative of r(q) wrt q? -73 Let k(a) be the first derivative of -2947a4/2 + 6313a*2 + 14264. What is the second derivative of k(z) wrt z? -35364z What is the third derivative of -90209p3 - 4 + 89138p*3 + 4 + 607p*2 wrt p? -6426 Differentiate -497g*4 - 229g*3 + 453 + 229g*3 + 1569 + 2090g*4 wrt g. 6372g*3 Differentiate -536h + 128 + 101h + 1093h + 991h + 171 wrt h. 1649 Let q(w) be the first derivative of 140/3w*3 - 331/2w*2 + 97 + 0w. What is the second derivative of q(t) wrt t? 280 Suppose 0 = 3n - 132 + 27. Let t = n - 31. What is the third derivative of -29f*2 + 10f*t - 14f*6 - 25f*4 + 15f*4 wrt f? -1680f3 Let j(b) = b4 + 2b - 1. Let t(i) = -4i*4 - 194i*3 - 115i + 2. Let f(x) = 3j(x) + t(x). Find the second derivative of f(q) wrt q. -12q*2 - 1164q Suppose 260 = 7q - 12q. Let r = q - -54. What is the derivative of -7 + 12 - ri4 + 0i*4 wrt i? -8i*3 What is the second derivative of -16595a*2 + 2 + 17205a*2 + 3a - 3 wrt a? 1220 Find the first derivative of -2671w - 54w - 1990w - 6521 - 194w wrt w. -4909 Let z(h) = -2h - 11. Let i be z(-9). Let o = i - -2. Find the second derivative of -op + 29p2 + 10p*2 - 24p*2 wrt p. 30 Differentiate 80v*4 + 173 + 1422 + 160v*4 - 24v*4 + 389v*4 with respect to v. 2420v*3 What is the first derivative of -967 + 96 - 231x + 258 - 488x - 580 wrt x? -719 Let v(w) = -w2 - 2w + 87. Let k be v(0). Let h = 91 - k. Find the second derivative of 9m - 6m*3 + hm - 7m wrt m. -36m Let t(w) = w*2 - 6w + 4. Let u be t(4). Let v(n) = 309n - 333. Let o(h) = 62h - 67. Let q(i) = uv(i) + 21o(i). What is the derivative of q(a) wrt a? 66 Let j(d) be the third derivative of -7d2 + 0d + 5/6d3 + 1/6d*4 + 0 + 5/6d*5. Find the second derivative of j(l) wrt l. 100 Let p(m) be the third derivative of -326m*6/15 - 141m*5/10 + 2938m*2. Find the third derivative of p(z) wrt z. -15648 Let z(f) be the third derivative of -331f*5/30 - 1207f*3/6 + 95f*2 - 3f. What is the first derivative of z(o) wrt o? -1324o Suppose -l + 3g + 59 + 59 = 0, 612 = 5l - 4g. Let n be ((-8)/(-44) + l/44)1. Differentiate 34 + 8a*n - 6 - 7a*3 + 29a*3 with respect to a. 90a*2 Let u(k) be the first derivative of 155k*6/6 + 5k*4 - 990k*3 - 1541. Find the third derivative of u(v) wrt v. 9300v*2 + 120 Let t(k) be the third derivative of 163k*7/10 + 170k*3 + 294k*2. Differentiate t(m) with respect to m. 13692m3 Let u(q) = -q2 + 9q2 + 3 + q3 - 10q + 2q + 15. Let p be u(-9). Find the third derivative of -y5 + 2y*2 + py*2 + 14y*5 wrt y. 780y*2 Let c be 127 - 43/(-12). Differentiate 38 - 53 - c + 84v2 - 229v*2 wrt v. -290v Let f(y) = -2039y3 - 48y*2 + 12y - 2192. Let r(l) = 4079l3 + 88l*2 - 22l + 4383. Let w(x) = -11f(x) - 6r(x). What is the derivative of w(t) wrt t? -6135t2 Let p be ((-117)/18)/(1/(-2)). Let b(x) be the first derivative of -p + 2x + 3x2 + 0x*2 - 8x2. What is the first derivative of b(c) wrt c? -10 Let h(l) be the second derivative of l8/56 + 2l6/5 - 2837l*4/12 - 3343l. What is the third derivative of h(x) wrt x? 120x3 + 288x Let y(z) be the second derivative of -169z6/3 - 3z*4 - 2z*3/3 + 16z + 47. What is the third derivative of y(n) wrt n? -40560n What is the derivative of -599u - 523 - 777 + 251 wrt u? -599 Let s(f) = -2f3 - 2f**2 - f - 1.	{ "pile_set_name": "DM Mathematics" }
1 + -0.09. Let r be (2/6)/((-14)/(-18)). Sort r, k, 1 in descending order. 1, r, k Suppose 3z + d - 8 = 0, 1 = -5z - 2d + 13. Put 2, z, -2 in decreasing order. z, 2, -2 Suppose x - 8 = 1. Sort -2, 5, x. -2, 5, x Let y = -37 - -55. Put y, 2, 0.1, -2 in decreasing order. y, 2, 0.1, -2 Let q be -4 + (-4)/(-2 + 4). Let s be q/9 + 2/(-6). Let b = -9 + 5. Put s, b, 1 in ascending order. b, s, 1 Let f(c) = -c - 1. Let z be f(-4). Suppose 0 = 3v + p + 11, 7v = 2v + 4p + 10. Sort z, v, 2 in decreasing order. z, 2, v Suppose 3 = -i + 5. Suppose 4u - 4 = -3n + 10, in + 2u = 8. Sort 5, -1, n in decreasing order. 5, n, -1 Let b = -67 - -70. Put b, -1, -3/5, -5 in decreasing order. b, -3/5, -1, -5 Let m = -12 + 13. Let w = -3 - 2. Put w, m, 5 in ascending order. w, m, 5 Let g = -1.89 - 0.11. Let q be (-3 + 1)(-2)/26. Sort 0.03, q, g. g, 0.03, q Let r = -22 - -21.5. Sort -0.4, 3/5, r in descending order. 3/5, -0.4, r Let z(c) = -c*2 + 4c. Let j be z(4). Suppose j = -v - 4i - 10, -4v - v + 2i = 6. Let q = -213 - -1919/9. Sort -1/8, v, q. v, -1/8, q Let u be 21/(-6)(-12)/357. Put -0.2, 11, u in descending order. 11, u, -0.2 Suppose -2t - 2 = 3j, 4 = -3t + j - 10. Let g be 1t10/(-220). Put 1/7, g, -4/3 in descending order. g, 1/7, -4/3 Let a = 0.19 - -0.13. Let q = a - 0.3. Let b = 1.02 - q. Sort -2/3, b, -3 in increasing order. -3, -2/3, b Let y = 0.9 + 0.3. Let d = y + -3.2. Sort -1/4, d, -6 in ascending order. -6, d, -1/4 Suppose -6 = -s - 2. Suppose 4w - 8w = 0. Let q = -366/5 - -73. Put s, w, q in descending order. s, w, q Let x = 86 + -85.6. Put 0, 4/3, x in decreasing order. 4/3, x, 0 Let o = 2.18 - -0.22. Let y = o + -3. Let q = y + -4.4. Sort q, -1, -4/7 in ascending order. q, -1, -4/7 Suppose -4o - 2l = 10, 5l - 13 + 38 = -o. Sort o, 5, -3, 1. -3, o, 1, 5 Let r = 28 - 27. Sort r, -2/11, -1, 4 in ascending order. -1, -2/11, r, 4 Let l = 3.9 - -1.1. Let u = l + -8. Suppose -2z - 2 + 6 = 0. Put u, -2, z in descending order. z, -2, u Suppose 9c = 4c - 105. Let n be -1 + -1 + c/(-3). Let y(w) = -2w + 6. Let o be y(n). Sort o, 2, -2 in descending order. 2, -2, o Let c(i) = i*3 + 6i*2 + i + 4. Let q be c(-6). Let b be (0/5)/(0 + q). Sort b, 5, -3 in ascending order. -3, b, 5 Let d = -33 + 31. Sort d, -5, 5 in decreasing order. 5, d, -5 Let x = -11 - -10.9. Let u be (-2)/12(3 + -4). Sort u, x, 3 in ascending order. x, u, 3 Let z(i) = i - 4. Let u be z(4). Suppose -5g - 4y + 36 = u, 0 = -2g + 6g - 5y + 4. Let b = -5 + 7. Sort b, -5, g in descending order. g, b, -5 Let o = 18 + -27. Let q be (o/42)/((-12)/32). Sort q, -2/9, 0.2. -2/9, 0.2, q Let s = 24 + -42. Let g = s + 13. Sort -4, g, -2 in descending order. -2, -4, g Let s(g) = -2g*2 + 9g*2 - 3g*3 - 4g*2 - 4g2. Let n be s(-1). Sort n, 5, -2. -2, n, 5 Let c = -102 - -101.91. Let s = -1 - -2. Put c, 5, s in ascending order. c, s, 5 Let h = 10 + -4. Let z = -72 + 72. Suppose z = l - h + 2. Put l, -3, 1 in ascending order. -3, 1, l Let i(g) = -g2 + 5g - 6. Let u be i(5). Sort -5, 0, u in ascending order. u, -5, 0 Suppose 8 + 16 = 6v. Sort 1/6, 0.04, v in decreasing order. v, 1/6, 0.04 Suppose -2r = r - 18. Suppose 2p - t + 9 = 7p, 0 = -p - 3t - 1. Suppose pa + a = r. Put a, 3, 1 in ascending order. 1, a, 3 Let i(c) = 5c - 6c + 3 - 8. Let k be i(-3). Sort k, 0, 3 in ascending order. k, 0, 3 Suppose f - 6 = -2f. Let q(t) = -t*2 + 4t + 5. Let c = 4 + 0. Let h be q(c). Sort h, f, 0. 0, f, h Let q = 161 - 157. Sort 13, 0, q. 0, q, 13 Let l be 6/(-27) + 21/(-27). Let q = 2 - 2. Put 4, q, l in decreasing order. 4, q, l Let o = 45 + -41. Let g = -6 + 2. Sort 3, o, g. g, 3, o Suppose 13 = -3p - 4z, 6 = -2p - 3z + z. Put 2, p, 4, -2 in descending order. 4, 2, p, -2 Let y = 1.95 + -0.15. Let d = -2.2 + y. Sort -4, 2/7, d. -4, d, 2/7 Let g be (-12)/3 - 488/(-124). Put 0.5, g, -3/4 in decreasing order. 0.5, g, -3/4 Let x = 2 + -1. Let j be (-5 - -5)/(x - 2). Let w(f) = f*3 - 8f*2 - 2f + 12. Let r be w(8). Sort r, -2, j. r, -2, j Let q = -4/13 + 21/26. Sort 0.06, -3, q in descending order. q, 0.06, -3 Let t = -1 + 3. Let c = 7 + 0. Let a = c + -7.1. Sort 1/2, a, t in descending order. t, 1/2, a Let s = -14 - -12. Sort s, 3, 0 in decreasing order. 3, 0, s Suppose -5o - 6 = -2b - 2o, -10 = -3b + 4o. Let n(s) = s2 - 5s - 6. Let h be n(b). Put 1/2, h, 4/7 in increasing order. h, 1/2, 4/7 Let q = 0.8 + -0.5. Sort -4, -0.3, q in decreasing order. q, -0.3, -4 Let z = 2 + -2.09. Let u = z + 3.09. Put 2, u, 0.5 in decreasing order. u, 2, 0.5 Let a be ((-60)/(-9))/53. Put 0, -3, a in decreasing order. a, 0, -3 Let n(g) = -g3 - 5g*2 + 2g + 7. Let h be n(-5). Let s = 55 + -54. Put -3/7, s, h in ascending order. h, -3/7, s Let y be 2/(-9) + 2 - 10/(-45). Sort 4, y, 3, 1 in increasing order. 1, y, 3, 4 Let m = -63 - -61. Put 1, 0.4, m, 0 in descending order. 1, 0.4, 0, m Suppose 3l - 3a + 3 = -0l, -5l = -3a + 9. Let d = 2 + -8. Let k be (-8)/6d/(-4). Sort k, -1, l in ascending order. l, k, -1 Let x be 10/(-3) - 2/(-6). Suppose 5a - 16 = -i, -2a - 5i = 2a - 17. Put -2, x, a in ascending order. x, -2, a Let h = -123 - -121. Put -3, -5, h in increasing order. -5, -3, h Let b = 1145/9 - 127. Put -0.06, 2, b in increasing order. -0.06, b, 2 Let s = -2.4 + -0.6. Let f(a) be the first derivative of -a*4/4 + 8a*3/3 - 7a*2/2 + a + 4. Let w be f(7). Sort -5, w, s. -5, s, w Let k = 0.039 + -24.039. Sort k, -4/9, -5/6 in descending order. -4/9, -5/6, k Let q(o) = 2o*3 + 2o*2 + 2o + 2. Let w be q(-3). Let d be 4/(-2) - w/16. Let t = 1.3 - 0.3. Sort d, t, 2 in ascending order. d, t, 2 Let i(h) = 4h + 1. Let z be i(1). Suppose 3 = zw - 7. Put w, -2, 1 in decreasing order. w, 1, -2 Suppose -5g + 2x - 6 + 33 = 0, -x + 19 = 4g. Let l = 8 - g. Put -1, -5, l in ascending order. -5, -1, l Let b = 3 + 7. Suppose 2m - b = -4. Suppose 0 = -u + mu. Sort -3, u, -2. -3, -2, u Let i(o) = -4o*2 + 2o - 2. Let z be i(2). Let k be ((-4)/(-3))/(z/(-21)). Put 1, -4, k in increasing order. -4, 1, k Let v = -0.5 + -0.1. Let n = 0.353 + -0.253. Sort 2, v, n in increasing order. v, n, 2 Suppose -r - 4r - 345 = 0. Let n = 205/3 + r. Let m = -3 - -3.5. Put n, m, 0.3 in decreasing order. m, 0.3, n Suppose 0 = -5l - 2g + 61, -2l - 4g + 23 = 5. Let t = -24 + l. Let b = t + 7. Sort 4/5, -1, b in descending order. 4/5, -1, b Let r(d) = d3 - 5d*2 + 4d + 2. Let m be r(4). Suppose -m = a + a. Let u = 3 + a. Put -1, -3/2, u in decreasing order. u, -1, -3/2 Let r = 9 + -6. Suppose 3i + 12 = -i. Sort -1/2, r, i in descending order. r, -1/2, i Let g(v) = -v + 1. Let n be g(-5). Suppose 4y + j = -5 - n, -j - 7 = 2y. Let m(x) = -x + 13. Let a be m(11). Sort y, -5, a in increasing order. -5, y, a Suppose -6h + h + 25 = 0. Put h, 4, -5, -2 in decreasing order. h, 4, -2, -5 Let f = 6 - 6.1. Sort -2, 2/9, f in increasing order. -2, f, 2/9 Suppose 0 = -22f + 17f. Let u be 1 - 1/((-1)/(-6)). Let t = -3 - u. Sort f, -3, t in descending order. t, f, -3 Let h be (-5)/((-15)/9) - -17. Let j be (16/(-10))/((-8)/h). Let n = j + -2. Sort 0.1, 2/7, n in increasing order. 0.1, 2/7, n Let x = -14.2 + 14. Let y = 3.5 + -3. Sort 2/3, y, x in ascending order. x, y, 2/3 Let f = 807/4 - 203. Put 1/4, f, -0.2 in ascending order. f, -0.2, 1/4 Let b = -10 - -7. Suppose 12j = 10j + 16. Sort j, b, 4 in increasing order. b, 4, j Let y(h) = h3 + h2 - 1. Let f be y(-2). Sort 6, f, 3. f, 3, 6 Let i = -357/5 - -71. Put 4/7, -0.5, i in descending order. 4/7, i, -0.5 Let g = 66/5 - 1112/85. Let h = 1/17 - -13/68. Let m = 0.1 - -0.4. Sort h, m, g. g, h, m Let h be (12/(-16))/(14/8). Let l = 3.7 + -2.4. Let y = l - 6.3. Put 1/3, y, h in ascending order. y, h, 1/3 Let l(n) = n*2 + n - 12. Let h be l(-4). Sort -2, 5, h in descending order. 5, h, -2 Suppose 6 = 4i - a - 38, -2i = -2a - 16. Sort i, 3, 1. 1, 3, i Let h be -2 - (3 + (-1)/1). Let c be 4/(-18) + 581/63. Put 2, c, h in ascending order. h, 2, c Let r = 0.24 - 0.2. Let u = r - -0.06. Sort 5, u, -0.5 in ascending order. -0.5, u, 5 Suppose 6 + 2 = -4n. Let q(s) = 2s + 22. Let f be q(-10). Sort -3, f, n in ascending order. -3, n, f Suppose -10 = -3*v + 2. Let m be (-14)/v + 2/(-4). Sort m, 2/11, -0.1 in ascending order. m, -0	{ "pile_set_name": "DM Mathematics" }
z. Let k(y) = 2y. Give s(k(d)). -8d2 Let k(a) = -1164a*2. Let n(s) = 7s. What is n(k(t))? -8148t2 Let i(n) = -43n*2. Let v(l) = l + 175. Determine i(v(a)). -43a*2 - 15050a - 1316875 Let d(k) = -k. Let w be 3/2 + 3/2. Let c(b) = 5b - wb + 4b - 4b. Give d(c(r)). -2r Let k(h) = 2h*2 - 2h*2 + 8h2 - h2. Let g(o) be the third derivative of -o4/24 + o2. Give k(g(t)). 7t2 Let d = 0 + 3. Let f(q) = 4q*2 + 0q*2 - 2q*2 - dq*2. Let b(r) = -2r. Calculate f(b(i)). -4i2 Let q(b) = -9b*2. Let p(f) = 40f. Calculate p(q(k)). -360k2 Let u(b) = 81b - 81b + 3b*2. Let x(j) = 3j. Give x(u(s)). 9s2 Suppose 5 = j, -3l + 11 = -5l + 3j. Let h(p) = l + 2p - 5p - 2. Let a(y) = 3y. Calculate a(h(o)). -9o Let k(r) = 3r. Let n(i) be the second derivative of i5/60 - 2i*3/3 + 5i. Let l(b) be the second derivative of n(b). Give l(k(h)). 6h Let b(m) = -m2 + 0m + 0m. Let h(x) = 4x - 9. Let u(z) = -2z + 4. Let q(l) = 4h(l) + 9u(l). Calculate q(b(j)). 2j*2 Let l(f) = 6f2. Let r(w) be the third derivative of -w4/3 + 41w2. What is r(l(c))? -48c*2 Let g(f) = 4f*2 - 6f. Let b(c) = 7c. Calculate b(g(l)). 28l*2 - 42l Let k(f) = 2f2. Suppose -u - 3y + 6 = 1, 6 = 5u - 4y. Let z(b) = -3b2 + u - 2. Determine z(k(c)). -12c*4 Let o(t) = t. Let s(l) = -3l - 87. Calculate o(s(y)). -3y - 87 Let o(j) = -5j*2. Let b(n) = n + 2n - 2n2 - 3n. Determine b(o(p)). -50p4 Let v(t) = -4t*2. Let l(n) = -5n. Let i(f) = -f. Let d(p) = -3i(p) + l(p). Calculate d(v(h)). 8h*2 Let q(t) = -t. Let a(w) = -4w. Calculate q(a(x)). 4x Let g(n) = -3n*2 + 2n*2 + 2n*2. Let c(u) = -5u. Let t(x) = -24x. Let j(w) = 14c(w) - 3t(w). Give j(g(q)). 2q*2 Let u(f) = 4f*2. Let q(l) = 5l - 21. Determine u(q(c)). 100c2 - 840c + 1764 Let b(l) = 4l2. Let k(x) be the second derivative of -x3/6 - 6x. What is b(k(u))? 4u2 Let t(r) be the second derivative of r5/30 - r2 + r. Let n(k) be the first derivative of t(k). Let x(p) = 4p. Give n(x(v)). 32v2 Let n(g) = -g. Let w(b) be the third derivative of b5/20 - b3 - 3b*2. Let p(z) = 6z*2 - 13. Let y(j) = -6p(j) + 13w(j). What is y(n(f))? 3f*2 Let d be 24/((-6)/(-2)) + -3. Let z(n) = -5n + dn + 4n2. Let j(b) = -b2. Calculate j(z(y)). -16y4 Let f(v) = 59v - 20v - 23v. Let q(g) = -2g2. Give q(f(n)). -512n*2 Let f(v) = -36v. Let y(m) = 6m. Give y(f(u)). -216u Let g(r) = -2r2 + 7r - 7. Let v(n) = n*2 - 2n + 2. Let c = -11 + 4. Let h(l) = cv(l) - 2g(l). Let u(b) = 3b. Calculate h(u(y)). -27y*2 Let d(k) = 3k. Let z(n) = -2072n. Give d(z(h)). -6216h Let v(c) = -c*2 + 3c*2 + 2c*2. Let l(b) = -5b. Give l(v(w)). -20w2 Let a(o) = -135o2. Let b(n) = -n2. What is b(a(p))? -18225p4 Let m(p) = -p2. Let c(w) = 41w*2 - 5w - 2. Let v(h) = 39h2 - 4h - 2. Let y(d) = -4c(d) + 5v(d). What is m(y(k))? -961k4 + 124k*2 - 4 Let j(k) = 736k + 2. Let b(q) = -2q2. Determine j(b(c)). -1472c*2 + 2 Let j(s) = -4s*2. Let g(i) = 2i2 + i2 - i*2 - 5i*2. What is j(g(l))? -36l*4 Let l(v) = -9v - 6. Let m(d) = 8d + 5. Let b(g) = 5l(g) + 6m(g). Let h(p) be the second derivative of -p3/2 - 2p. Determine b(h(o)). -9o Let a(f) = 3 - 3 + 6f2. Let r(d) be the first derivative of -d3/6 - 6d - 7. Let p(b) be the first derivative of r(b). What is p(a(z))? -6z*2 Let g(y) = 13y*2 + 48. Let o(p) = -5p*2. Determine g(o(m)). 325m*4 + 48 Let b(d) = 2d*2 + 48. Let m(x) = 7x*2. Calculate m(b(i)). 28i*4 + 1344i*2 + 16128 Let t(w) be the second derivative of -5w*3/6 + 5w. Let x(g) = -3g. What is t(x(h))? 15h Let i(k) = k. Let h(c) be the second derivative of -7c4/4 + 14c. Give i(h(r)). -21r2 Let p(w) be the second derivative of w4/4 - 4w. Let a(s) be the third derivative of s5/20 + s2. What is p(a(g))? 27g4 Let m(c) = -c2. Let q(w) = -95w. Give m(q(y)). -9025y2 Let z(m) be the third derivative of -m5/30 - 10m*2. Let r(f) be the first derivative of 0f - 1/2f2 - 2. Calculate r(z(h)). 2h*2 Let t(n) be the third derivative of -11n7/5040 - n5/60 + 2n2. Let r(f) be the third derivative of t(f). Let d(h) = h. Calculate r(d(q)). -11q Let y(t) = 124t2. Let o(u) = -9u. Calculate o(y(l)). -1116l2 Let z(g) = 7g. Let m(u) = u*2 + 90u. Calculate z(m(i)). 7i2 + 630i Let g(m) = 3m. Let c(w) be the third derivative of 0w - 1/60w5 + 0w*4 + 0 + 0w*3 - 4w*2. Calculate c(g(u)). -9u2 Let p(f) = -f2. Let a(o) = -3o2 + 3. Let s(l) = -1. Let y(u) = a(u) + 3s(u). Give p(y(h)). -9h4 Let j(s) = 3s. Let q(g) be the first derivative of g*4/12 - g + 2. Let n(v) be the first derivative of q(v). Determine n(j(i)). 9i*2 Let h(d) = -2d. Suppose 4j + 15 = j, 2i - 4j = 26. Let q(m) = -m - 3m + im. Determine h(q(g)). 2g Let c(d) = -2d2. Let m(a) = 35a. Suppose 2 = -t - 2, 2 = 2o + 3t. Let r = o - -23. Let n(b) = -b. Let p(i) = rn(i) + m(i). Determine p(c(q)). -10q*2 Let m(a) = -2260a*2. Let g(n) = -4n. Give g(m(x)). 9040x2 Let y(o) be the first derivative of -4o*3/3 + 3. Let r(q) = 2q + 3q - 2q*2 - 5q. Give r(y(i)). -32i4 Let t(a) = -a2 - 2. Let k(u) = -5u*2 - 11. Let q(v) = 4k(v) - 22t(v). Let o(d) = 3d - 2d - 3d. Give q(o(r)). 8r2 Let a(v) = 3v. Let i(f) = 13f2 - 65. Let o(d) = -1. Let n(c) = i(c) - 65o(c). What is n(a(r))? 117r2 Let c(t) = -6t2 + t2 + t2. Let y(q) be the second derivative of -q5/60 - 3q2/2 - 8q. Let j(r) be the first derivative of y(r). Give j(c(p)). -16p4 Let o(z) = z. Suppose -3m + 6 = -0m. Let i(j) = 0j2 - j2 - 3j2 + 2j*m. What is i(o(c))? -2c2 Let z(x) = x2 - 3x + 3. Let d be (-564)/(-180) - 4/30. Let a(q) = 2q*2 - 8q + 8. Let h(u) = da(u) - 8z(u). Let l(n) = -4n. What is l(h(i))? 8i*2 Let c(t) = -6t. Let i(n) = 18 - 9 - 9 - 4n2. Calculate c(i(q)). 24q*2 Let g(b) = -49b. Let a(t) = -t - 4. Calculate g(a(j)). 49j + 196 Let h(w) = -w2 + 7w - 7w + 0w*2. Let i(d) = -10d. What is h(i(q))? -100q2 Let o(x) = -39 - 4x + 39. Let n(y) = 3y - 4y + 0y. Calculate o(n(h)). 4h Let b(t) = t*2. Let l(v) = -97v*2 - 2. Determine b(l(p)). 9409p*4 + 388p*2 + 4 Suppose 0o = 2o - 14. Let l(g) = 2g*2 + 3g*2 - og*2. Let p(z) = z. Let q(s) = s. Let r(k) = -6p(k) + 3q(k). What is r(l(t))? 6t2 Let d(g) = g2. Let c(j) = 8j - 2. Give d(c(t)). 64t*2 - 32t + 4 Let h(r) = r. Let z = -10 - -30. Suppose 3n + 2n - z = 0. Let p(t) = 11t - 11t - nt2 + 3t2. Calculate p(h(g)). -g2 Let r(y) = -y2. Let d(n) be the second derivative of -n3/6 + 2n + 9. Give d(r(s)). s2 Let v(o) = -2o. Let i(q) = -q + 6q + 8q + 3q - 1. Give i(v(w)). -32w - 1 Let s(t) = -t. Let i(k) = -k*2. Let p(d) = 6d*2 + 3. Let m(b) = 4i(b) + p(b). Let x(z) be the first derivative of m(z). Give x(s(u)). -4u Let c(r) = -9r*2. Let g(l) = 2l*2 - 3l - 3. Let x(h) = h + 1. Let b(s) = g(s) + 3x(s). Determine c(b(q)). -36q*4 Let j(l) = -4480l. Let m(q) = -4q2. Determine m(j(k)). -80281600k*2 Let a(k) = -20k2. Let c(o) be the second derivative of -o3/2 - o + 1. Calculate a(c(u)). -180u2 Let h(c) = -5c*2. Let a(w) = -3w + 16 - 6 - 10. Calculate a(h(l)). 15l2 Let u(w) be the second derivative of 0w*2 - 1/6w*3 - 2w + 0. Let c(z) be the first derivative of -z*3 + 1. Give u(c(r)). 3r*2 Let n(o) = -5o. Let k(r) be the first derivative of r5/30 - r2 - 4. Let u(f) be the second derivative of k(f). Determine n(u(b)). -10b2 Let y(g) = -5g*2. Let v(p) = -2p*2 - 5. Let d(h) = 1. Let z(u) = 5d(u) + v(u). Calculate y(z(b)). -20b4 Let k(s) = -4s2. Let f(y) = -y2 + y + 1. Let a(b) = -6b2 + 5b + 5. Let d be 2/(-7) + (-24)/14. Let u(w) = da(w) + 10f(w). What is k(u(p))? -16p4 Let y(r) = -r. Let l(q) = -3q - 2. Let g(d) = -7d - 5. Let n(a) = 6g(a) - 15l(a). Let w(x) = -x. Let s(k) = -2n(k) - 7w(k). Calculate s(y(f)). -f Let r(s) = -2s2. Let k(f) be the first derivative of -f4/4 + 5f + 2. Let o(v) be the first derivative of k(v). What is r(o(u))? -18u*4 Let n(f) = -f. Let x(s) = -4s. Let w(y) = 5n(y) - x(y). Let k(a) = -3a**2. Determ	{ "pile_set_name": "DM Mathematics" }
Let v be (i - 3)/(1 - 0). Calculate vl(t) - 6s(t). 5t2 Let w(y) = y2 - 2y + 1. Let j(m) = -3m2 + 5m - 3. Let u(n) = -17n - 179. Let h be u(-42). Let t = -530 + h. What is tw(z) + 2j(z)? -z2 - 1 Let f(s) = -4s3 - s2 + 1. Let p(u) be the first derivative of u4/4 - u3/3 + u + 791. Suppose -m + 14 = 13. What is mp(a) - f(a)? 5a*3 Let o(a) be the first derivative of -7a*3/6 - 3a*2/2 - 56a + 135. Let q(n) be the first derivative of o(n). Let x(y) = 50y + 20. Give 20q(j) + 3x(j). 10j Let a(g) = g. Let z(s) = 7s - 2. Let v(d) = 4a(d) + z(d). Let n(b) = 9b - 1. Let m(y) = -6n(y) + 5v(y). Let j(l) = 1. Determine 3j(r) + m(r). r - 1 Let i(o) = 5o3 - o + 1. Let t(l) = -4l*2 - 19l + 2. What is 2i(m) - t(m)? 10m*3 + 4m*2 + 17m Let i(r) = 5. Let g(p) = -p - 6. Let l be 22 + -29 + (4/12)/(2/24). Calculate li(q) - 2g(q). 2q - 3 Let f(u) = -u3 - 5u + 1. Let q(s) = 3s3 + 10s + 388. Give -2f(c) - q(c). -c3 - 390 Let h(a) = 7a + 8. Let n(t) = 3t2 + 2t + 1. Give h(p) - 3n(p). -9p*2 + p + 5 Let m = 20 + -11. Let y = m - 9. Suppose 3k + 0 + 15 = y. Let i(p) = -6p3 - 4p*2. Let x(b) = 7b*3 + 5b*2. Give ki(o) - 4x(o). 2o*3 Let k(c) = -36c + 1. Let f(h) = 92h + 27. What is f(s) + 4k(s)? -52s + 31 Let w(q) = -2q*3 + 5q*2 + 10q - 5. Let t(b) be the third derivative of -b*6/40 + 3b*5/20 + 19b*4/24 - 3b*3/2 - 1020b*2. Give -3t(l) + 5w(l). -l3 - 2l*2 - 7l + 2 Let k(l) = -4l3 - 5l*2 + 9l + 5. Let p(c) = -2954c2 - 2 + 2c*3 + 1458c*2 - 5c + 1498c2. Calculate -2k(q) - 5p(q). -2q*3 + 7q Suppose -23q + 12456 = 12364. Let i(b) = -b2 + 2. Let p(y) = -y - 1. What is qp(x) + i(x)? -x*2 - 4x - 2 Let w(m) = 109m. Let u(p) = 331p + 3. Let v(x) = 2u(x) - 6w(x). Let g(c) = -7c - 6. Determine -3g(y) - 2v(y). 5y + 6 Let k(l) = -4 - 7l + 4 + 18l - 887l3 + 731l*3. Let g(x) = -31x*3 + 2x. What is -11g(p) + 2k(p)? 29p3 Let j(v) = 3v*2 + 4v - 6. Let t(i) be the first derivative of -4i3/3 - 5i*2/2 + 7i - 6. Let g be (-133)/(-14) + (-54)/12. Determine gj(n) + 4t(n). -n2 - 2 Let p(d) = d2 - d - 1. Let o(x) = -14x2 + 3x + 3. Let m be (-93 - -90)(-3)/(-9). Determine mo(g) - 3p(g). 11g*2 Let f(o) = -152o*2 - 16o - 1. Let m(i) = -70i2 - 7i - 1. Give 4f(n) - 9m(n). 22n2 - n + 5 Let k(q) = 20q*2 - 7q. Let z(l) = 7l2 - 2l. Suppose -2p + 4d - 6 + 26 = 0, 3p = -d + 2. Determine pk(j) - 7z(j). -9j*2 Let x(q) = 7q*3 + 19q*2 + 5q + 4. Let v(f) be the second derivative of -3f5/20 - 3f4/4 - f3/3 - f*2 + 3330f. Calculate 5v(a) + 2x(a). -a*3 - 7a*2 - 2 Suppose -5q + 2i = -0q - 17, 10 = 6q - 5i. Let y(w) = w + 2. Let n(a) = 1. Let t(r) = -4n(r) + y(r). Let f(z) = 3. What is qt(h) + 4f(h)? 5h + 2 Let k(m) = 4m2 - 5m + 5. Let g(o) be the second derivative of -o + 7/12o4 - 3/2o*3 - 1 + 9/2o*2. Determine 6g(i) - 11k(i). -2i*2 + i - 1 Let m(s) = -10s - 5. Let q(h) be the first derivative of -19h2/2 - 10h + 2624. What is 11m(x) - 6q(x)? 4x + 5 Let t(w) = 15849w - 12. Let y(p) = 158483p - 117. Calculate 39t(g) - 4y(g). -15821g Let d(x) = 7x + 4. Let a(w) = -8w - 4. Let m = 9123 - 9130. What is md(n) - 6a(n)? -n - 4 Let g(z) = 9z2 - 93z - 13. Let v(p) = -12p2 + 92p + 15. Determine -7g(x) - 6v(x). 9x2 + 99x + 1 Let x = -5029 - -5032. Suppose 2z = 4z - 10. Let m(l) = -2l2 + 2l + 5. Let q(r) = 3r2 - 4r - 9. What is xq(c) + zm(c)? -c*2 - 2c - 2 Let q(z) = 26z - 139. Let g(r) = -51r + 276. Determine 2g(l) + 5q(l). 28l - 143 Let x(s) = -27s - 2108. Let p(n) = 17n + 1405. Give 8p(y) + 5x(y). y + 700 Let n be (1 + -3)(72 + -46)(-2)/8. Let z(b) = 7b*3 - 6b*2 - 9b + 1. Let l(d) = 15d3 - 13d*2 - 18d + 2. What is nz(g) - 6l(g)? g*3 - 9g + 1 Let k be (3 - 4) + 1 + 2. Let u(d) = -7d - 3. Let b(y) be the first derivative of y2/2 + y - 8436. Give kb(x) + u(x). -5x - 1 Let d(w) = -5w*2 - 2w + 2. Let n = 3 + -1. Let b(c) = -1 - 2 + n + c. Let z be (-4)/5 + (-399)/(-105) - (4 - 0). Determine zd(u) - 2b(u). 5u2 Let j(p) = 483p*3 + 5p*2 + 110p + 28. Let y(k) = 241k3 + 2k*2 + 44k + 14. Give 2j(x) - 5y(x). -239x3 - 14 Let v(k) = 6k + 6. Let z be (-8)/16 + 15/10. Let o(d) = -d - 1. Give zv(a) + 4o(a). 2a + 2 Let f(b) = -b. Suppose -162 = -67l + 49l. Let u(m) = -m + 2 + 0m + lm - m. Calculate -4f(c) - u(c). -3c - 2 Let b(q) = -q. Let v(a) = 16a + 0 - 8 + 2 - 11a. Let j(l) = 4b(l) + v(l). Suppose -25s + 1244 - 503 = 32s. Let x(h) = -2h + 13. Give sj(y) + 6x(y). y Let q(o) = 6o - 635. Let h(p) = -5p + 604. Give 3h(l) + 2q(l). -3l + 542 Let j(m) = -4m2 - 8m + 5. Let v = 1 + -7. Let y(t) = 330t2 + 996t + 5. Let s be y(-3). Let k(q) = 9q2 + 17q - 11. What is sj(i) + vk(i)? -2i2 + 2i + 1 Let p(n) = 2n - 2. Let r = 415 - 413. Suppose 3w + w - 28 = -3j, 5j = 4w - 60. Let f(m) = -7m + 10m + 4m - w + 3m. Calculate rf(d) - 11p(d). -2d + 2 Let l be (-1)/4 + 17/4. Let i(p) = l - 2 - 5p3 - 3 + 4p*3. Suppose 0 = 1107c - 1066c - 41. Let b(k) = k3 - 1. Determine cb(u) - i(u). 2u3 Let f(u) = -u2 - u + 2. Let a(g) = -1197g*2 + 76g - 152. Calculate a(v) + 76f(v). -1273v2 Let i(b) be the third derivative of b5/30 - b*4/6 + 2b*3/3 - 151b2 - 1. Let j = -23 + 24. Let f(u) = -u2 + u - 1. Calculate ji(z) + 4f(z). -2z2 Let w(a) = -5a*3 + 14a*2 - 26a. Let z(l) = 2l3 - 5l*2 + 9l. Let x be (12 - 3) + 2/5 + 3888/(-720). Determine xw(j) + 11z(j). 2j3 + j2 - 5j Let k(u) = 79u2 - 87u + 215. Let z(n) = -47n2 + 47n - 108. What is 3k(l) + 5z(l)? 2l2 - 26l + 105 Let k(h) = 2h + 19. Let j = -264183 - -264174. Let w(i) = 4 - 2i + 5 + 3i. Determine jw(y) + 4k(y). -y - 5 Suppose -7d - 15 = -71. Let k be d/(-16)2 + -2. Let v(x) = -7x*2 - 6x. Let h(w) = 4w2 + 3w. Determine kv(p) - 5h(p). p*2 + 3p Let a(r) = 4r3 - 2r*2 + r - 1. Let c(o) = -983o*3 - 4o*2 + 2o - 2. Determine 4a(j) - 2c(j). 1982j3 Let n(m) = 2m*3 + 13m2 - m + 3. Let c(h) = h3 + 4h2. Let i(t) = -6c(t) + 2n(t). Let k(z) = 4z*3 - 5z*2 + 5z - 12. Determine 5i(b) + 2k(b). -2b3 + 6 Let m(x) = -9x3 + x2 - 5x - 7. Let n(g) = -640g + 305g + 337g + 3 + 4g3. Give 3m(h) + 7n(h). h3 + 3h2 - h Let f(t) = -t2 - t. Suppose -z - 4 = -5. Let k(r) = -8097r3 + 4039r*3 - 6r*2 + 16r - 22r + 4049r*3. Give zk(c) - 6f(c). -9c*3 Let c(s) = 28s*2 + 48s - 9. Let o(t) = 55t2 + 80t - 19. What is 5c(f) - 3o(f)? -25f2 + 12 Let w(b) = -98 + b + 97 + b2 + 0b*2 + 11b*3 + 4b*3 - 16b3. Let u(l) = l3 + l*2 - 2l + 2. Give u(j) + 2w(j). -j3 + 3j*2 Let o(c) = 11c*2 - 5297c - 9. Let g(i) = 5i2 - 2654i - 4. Give 9g(u) - 4o(u). u*2 - 2698u Let o(q) = -663q3 - 6q*2 - 15q - 6. Let d(c) = -c3 - c2 - 2c - 1. Calculate -6d(s) + o(s). -657s3 - 3s Let d(f) = 3f - 32. Let a = -16305 + 16303. Let n(q) = -q + 8. Determine ad(i) - 9n(i). 3i - 8 Let m(k) = -7k + 7. Let s be (2/7 + 341/(-385))-5. Suppose 4o + 24 = 5p + 15, p + s = -4o. Let f(a) = -a + 1. Calculate pm(v) - 6f(v). -v + 1 Let q(w) = w - 10. Let r(y) = y2 - 80y + 152. Let k be r(78). Let g(t) = t - 9. Determine kq(d) + 3g(d). -d + 13 Suppose -4h + 4l + 7 = -17, 3l + 3 = 0. Let i(a) = -4a. Let g(y) = -5y - 1. Let w(q) = -2q*2 - 28q - 54. Let s be w(-12). What is hg(j) + si(j)? -j - 5 Let a(x) = -27x - 2543. Let f(g) = -25g - 2552. Calculate -12a(m) + 13f(m). -m - 2660 Let g(a) = 1074a + 15. Let d(p) = p - 4. Give -4d(c) - g(c). -1078c + 1 Let r(t) = t - 1. Let i(x) = 42x - 35. Let s(g) = g*2 - 99g + 1990. Let y be s(74). What is yr(q) - 4i(q)? -28q Let b(a) = 38a + 180. Let y(j) = 871j + 4134. What is 91b(x) - 4y(x)? -26x - 156 Let l(d) be the first derivative of d4/4 + d2/2 + 1. Suppose 5r = 78 + 17. Let c(b) = 20b*2 - rb*2 - 2b*3 + 6b + 2 - 10b. Determine -c(p) - 4l(p). -2p3 - p2 - 2 Let d(p) = -2. Let x(t) be the third derivative of -t5/60 + t4/24 - t2. Let s(l) = -2l + 48. Let y = -51 - -74. Let n be s(y). What is n*x(c) + d	{ "pile_set_name": "DM Mathematics" }
fourth root of 108877 to the nearest integer? 18 What is 10442 to the power of 1/7, to the nearest integer? 4 What is the third root of 1920 to the nearest integer? 12 What is the eighth root of 12703 to the nearest integer? 3 What is the third root of 10675 to the nearest integer? 22 What is the square root of 158967 to the nearest integer? 399 What is 91427 to the power of 1/3, to the nearest integer? 45 What is the third root of 2638 to the nearest integer? 14 What is the third root of 3978 to the nearest integer? 16 What is 68106 to the power of 1/2, to the nearest integer? 261 What is the square root of 1076 to the nearest integer? 33 What is 64412 to the power of 1/2, to the nearest integer? 254 What is 154763 to the power of 1/10, to the nearest integer? 3 What is 53233 to the power of 1/2, to the nearest integer? 231 What is the square root of 69 to the nearest integer? 8 What is the third root of 3500 to the nearest integer? 15 What is the ninth root of 35276 to the nearest integer? 3 What is 10538 to the power of 1/10, to the nearest integer? 3 What is 4892 to the power of 1/2, to the nearest integer? 70 What is 1734 to the power of 1/6, to the nearest integer? 3 What is 18301 to the power of 1/6, to the nearest integer? 5 What is the third root of 41749 to the nearest integer? 35 What is the square root of 190 to the nearest integer? 14 What is 7768 to the power of 1/6, to the nearest integer? 4 What is the tenth root of 66365 to the nearest integer? 3 What is 576 to the power of 1/2, to the nearest integer? 24 What is 49835 to the power of 1/7, to the nearest integer? 5 What is the third root of 61902 to the nearest integer? 40 What is the third root of 28658 to the nearest integer? 31 What is 4419 to the power of 1/5, to the nearest integer? 5 What is the ninth root of 1097 to the nearest integer? 2 What is the square root of 1129 to the nearest integer? 34 What is 1683 to the power of 1/9, to the nearest integer? 2 What is 9588 to the power of 1/2, to the nearest integer? 98 What is the sixth root of 350 to the nearest integer? 3 What is 2302 to the power of 1/3, to the nearest integer? 13 What is 557 to the power of 1/2, to the nearest integer? 24 What is the seventh root of 1783 to the nearest integer? 3 What is the cube root of 17066 to the nearest integer? 26 What is the cube root of 70467 to the nearest integer? 41 What is 4110 to the power of 1/9, to the nearest integer? 3 What is the cube root of 3570 to the nearest integer? 15 What is 97094 to the power of 1/2, to the nearest integer? 312 What is the fifth root of 852 to the nearest integer? 4 What is 299 to the power of 1/7, to the nearest integer? 2 What is 2177 to the power of 1/3, to the nearest integer? 13 What is the cube root of 5298 to the nearest integer? 17 What is the square root of 3818 to the nearest integer? 62 What is the fourth root of 11632 to the nearest integer? 10 What is 139 to the power of 1/2, to the nearest integer? 12 What is 46244 to the power of 1/2, to the nearest integer? 215 What is 924 to the power of 1/2, to the nearest integer? 30 What is 1756 to the power of 1/2, to the nearest integer? 42 What is 1822 to the power of 1/2, to the nearest integer? 43 What is 14899 to the power of 1/3, to the nearest integer? 25 What is 2787 to the power of 1/5, to the nearest integer? 5 What is the tenth root of 612 to the nearest integer? 2 What is the square root of 19539 to the nearest integer? 140 What is the third root of 445 to the nearest integer? 8 What is the third root of 850 to the nearest integer? 9 What is 42689 to the power of 1/9, to the nearest integer? 3 What is the seventh root of 6105 to the nearest integer? 3 What is 92719 to the power of 1/3, to the nearest integer? 45 What is the square root of 7226 to the nearest integer? 85 What is 1929 to the power of 1/2, to the nearest integer? 44 What is 127200 to the power of 1/8, to the nearest integer? 4 What is the cube root of 1299 to the nearest integer? 11 What is 4957 to the power of 1/10, to the nearest integer? 2 What is 5233 to the power of 1/5, to the nearest integer? 6 What is 9120 to the power of 1/2, to the nearest integer? 95 What is 18111 to the power of 1/2, to the nearest integer? 135 What is the square root of 1825 to the nearest integer? 43 What is 1307 to the power of 1/5, to the nearest integer? 4 What is 307 to the power of 1/2, to the nearest integer? 18 What is the sixth root of 33902 to the nearest integer? 6 What is the tenth root of 84306 to the nearest integer? 3 What is 4047 to the power of 1/9, to the nearest integer? 3 What is 5807 to the power of 1/2, to the nearest integer? 76 What is the third root of 112559 to the nearest integer? 48 What is the cube root of 36293 to the nearest integer? 33 What is the square root of 102543 to the nearest integer? 320 What is the square root of 58757 to the nearest integer? 242 What is the third root of 4208 to the nearest integer? 16 What is 67594 to the power of 1/9, to the nearest integer? 3 What is 3367 to the power of 1/3, to the nearest integer? 15 What is 637 to the power of 1/6, to the nearest integer? 3 What is the seventh root of 9077 to the nearest integer? 4 What is 2141 to the power of 1/2, to the nearest integer? 46 What is 4226 to the power of 1/4, to the nearest integer? 8 What is the seventh root of 3530 to the nearest integer? 3 What is the square root of 4823 to the nearest integer? 69 What is 35379 to the power of 1/6, to the nearest integer? 6 What is 26214 to the power of 1/8, to the nearest integer? 4 What is the square root of 17054 to the nearest integer? 131 What is 4124 to the power of 1/6, to the nearest integer? 4 What is the square root of 977 to the nearest integer? 31 What is 64252 to the power of 1/3, to the nearest integer? 40 What is the cube root of 3863 to the nearest integer? 16 What is the square root of 885 to the nearest integer? 30 What is the fifth root of 54299 to the nearest integer? 9 What is 1211 to the power of 1/2, to the nearest integer? 35 What is the cube root of 9217 to the nearest integer? 21 What is 185 to the power of 1/3, to the nearest integer? 6 What is 915 to the power of 1/2, to the nearest integer? 30 What is 30146 to the power of 1/2, to the nearest integer? 174 What is 76003 to the power of 1/5, to the nearest integer? 9 What is 32500 to the power of 1/3, to the nearest integer? 32 What is 3 to the power of 1/3, to the nearest integer? 1 What is 8269 to the power of 1/2, to the nearest integer? 91 What is 390 to the power of 1/3, to the nearest integer? 7 What is 3353 to the power of 1/3, to the nearest integer? 15 What is the fourth root of 25569 to the nearest integer? 13 What is the square root of 15933 to the nearest integer? 126 What is the cube root of 1871 to the nearest integer? 12 What is the sixth root of 1563 to the nearest integer? 3 What is the seventh root of 822 to the nearest integer? 3 What is the ninth root of 7217 to the nearest integer? 3 What is 50849 to the power of 1/3, to the nearest integer? 37 What is the eighth root of 1591 to the nearest integer? 3 What is 811 to the power of 1/5, to the nearest integer? 4 What is 549 to the power of 1/3, to the nearest integer? 8 What is the cube root of 2191 to the nearest integer? 13 What is the seventh root of 20706 to the nearest integer? 4 What is the cube root of 48254 to the nearest integer? 36 What is the fourth root of 687 to the nearest integer? 5 What is 2644 to the power of 1/8, to the nearest integer? 3 What is the ninth root of 3033 to the nearest integer? 2 What is 331 to the power of 1/2, to the nearest integer? 18 What is the tenth root of 6885 to the nearest integer? 2 What is 143514 to the power of 1/9, to the nearest integer? 4 What is the third root of 922 to the nearest integer? 10 What is the fourth root of 1708 to the nearest integer? 6 What is the tenth root of 6789 to the nearest integer? 2 What is the ninth root of 21503 to the nearest integer? 3 What is the square root of 73699 to the nearest integer? 271 What is the square root of 6809 to the nearest integer? 83 What is 97240 to the power of 1/2, to the nearest integer? 312 What is the fourth root of 152108 to the nea	{ "pile_set_name": "DM Mathematics" }
- 5v2 - 5v + 2. What are the prime factors of d(l)? 2, 3 Let t = 39 - -37. What are the prime factors of t? 2, 19 Suppose -p + 6p = 235. List the prime factors of p. 47 Let b be 2 + -1 + 0 + 6. Suppose -23 - b = -5s. Suppose -5p + 39 = -s. List the prime factors of p. 3 Let p(f) = -f3 + 12f*2 - 18f + 5. What are the prime factors of p(5)? 2, 3, 5 Suppose 4t = 3z - 68, -3z + 6z = -4t + 52. Suppose 0 = 7l - 3l - z. List the prime factors of 27/l - 6/(-10). 2, 3 Suppose 0 - 10 = 5b. What are the prime factors of 8(-2 - (b - 2))? 2 Suppose 0 = -l - 4, -4j - 2l + 12 = j. Let g = 28 + -18. Suppose -j = o - g. List the prime factors of o. 2, 3 Let s(u) = u3 - 2u*2 - u + 2. Let f be s(3). Suppose 0 = 5c + f - 118. What are the prime factors of c? 2, 11 Let p(d) = -3d + 1. Let g(f) = f + 1. Let o(c) = 2g(c) + p(c). Let m be o(0). Let x = m + -1. What are the prime factors of x? 2 Let r(p) be the third derivative of p6/90 - p5/120 - p*4/24 + 2p*2. Let l(j) be the second derivative of r(j). What are the prime factors of l(1)? 7 Let z be 23 + (-4)/(-4)-3. Suppose 0u = -u + 4w + 25, 0 = -2u - 2w + z. List the prime factors of u. 13 Let s(v) be the second derivative of v*4/12 + 4v*3/3 + 5v*2 + v. Let k be (2 - 1)(-12 - -5). What are the prime factors of s(k)? 3 Let y(x) = 51x3 + 7x*2 - 8x - 8. Let c(w) = w*2 - w - 1. Let d(l) = 6c(l) - y(l). What are the prime factors of d(-1)? 2, 5 Suppose -5w + 3h = h - 167, 4h - 86 = -2w. What are the prime factors of (-12)/(-48) + w/4? 3 Let r be 21/(-28) - 782/(-8). Let n = r + -57. List the prime factors of n. 2, 5 Suppose 32 = -5h + 7. Let s(g) = 2g + 5. Let r be s(-7). Let j = h - r. What are the prime factors of j? 2 Let p = -4 - -8. Let a(t) = t*3 - 5t*2 + 6t - 4. Let g be a(p). Suppose 5l + 3n = gl + 11, 0 = 3l - 5n + 9. List the prime factors of l. 2 Let g(x) be the first derivative of -x4/4 - x3 + x2 + 5x - 3. Suppose -16 = 2a + 2a. What are the prime factors of g(a)? 13 Let q(a) = -36a - 1. List the prime factors of q(-1). 5, 7 Let l = 0 + 23. What are the prime factors of l? 23 Suppose -2w + 4 = d - 34, 0 = -3d - 2w + 122. What are the prime factors of d? 2, 3, 7 Suppose 4c + c = 10. Suppose 2x = -cj + 26, 3j + 0j - 37 = -5x. What are the prime factors of j? 2, 7 What are the prime factors of 8/12 - 784/(-12)? 2, 3, 11 Let m be 10/55 + 4/(-22). Suppose m = 7l - 10l + 33. List the prime factors of l. 11 Let c(u) = 6u + 33. What are the prime factors of c(20)? 3, 17 Let d be ((-1)/(-2))/(2/(-8)). What are the prime factors of d - (-13 + 0 + -3)? 2, 7 Let v = 28 + 5. List the prime factors of v. 3, 11 Let i(u) = -4u - 2. Let r be i(-8). Suppose 4p - 18 - r = 0. List the prime factors of p. 2, 3 Let w = 70 - 30. Suppose 0 = -5j + w. List the prime factors of j. 2 Let o = 1 - 1. Suppose -5y = 2a - 27 + 70, a - 1 = o. What are the prime factors of -33/y + 8? 3 Let i(r) = 6r + 2. What are the prime factors of i(20)? 2, 61 Let q be -2(-30)/2 - -4. Let x = 8 + q. List the prime factors of x. 2, 3, 7 Let c(t) = -t2 + 15t - 18. List the prime factors of c(12). 2, 3 Suppose -28 = -3f + 38. What are the prime factors of f? 2, 11 Let n(t) = -t3 - t2 + t + 5. Let i be n(0). Suppose -6 = m - i. List the prime factors of 8 - (-1 + m - 0). 2, 5 Suppose 0p = 5p + 5y + 25, 25 = -3p - 5y. Suppose -v + pv = -3. Suppose -q + 9 + v = 0. What are the prime factors of q? 2, 3 Let b = 138 + -93. List the prime factors of b. 3, 5 What are the prime factors of (-1)/(((-9)/(-276))/((-9)/6))? 2, 23 Suppose -3d - 5 = 3g - 20, 0 = -g + 2d + 2. Suppose 65 = gf + h, 5f - 3h = -0f + 94. List the prime factors of f. 17 Suppose 0l + 276 = 2l. List the prime factors of l. 2, 3, 23 Let o = -81 - -171. What are the prime factors of o? 2, 3, 5 What are the prime factors of (66/(-8))/(18/(-96))? 2, 11 Let t(v) = -2v - 2. What are the prime factors of t(-7)? 2, 3 Let b = 137 + -78. List the prime factors of b. 59 Let c = -9 - -14. Suppose -37 = -3b - 4v, cb - 7v - 19 = -3v. List the prime factors of b. 7 Suppose 38 = 4k - 22. List the prime factors of k. 3, 5 Suppose 0 = -5l - 3g + 8g + 40, -2l = -3g - 21. Suppose -5t + 32 = 4m, -lm + t = 5t - 23. What are the prime factors of m? 13 Suppose -5g + 2g - 24 = -4a, -5a + g = -19. List the prime factors of a. 3 Suppose 4z - 4n + 65 = -z, -n = 2z + 13. Let u = -2 - -4. Let x = u - z. What are the prime factors of x? 11 Let a be (12/(-7))/(1/(-7)). Suppose -x - 2 = -a. List the prime factors of x. 2, 5 Let a be 1 + -1 - (-2 - -2). Let x = 15 + a. List the prime factors of x. 3, 5 Suppose -4k - 2r = -14, -2r - 10 = -4k + 8. Suppose -ku + 4 = -2u. Suppose a - 33 = 5n, 0 = -5a - un + 30. List the prime factors of a. 2 Suppose 2v - 81 = -c, -202 + 31 = -4v + c. List the prime factors of (v/49)/((-1)/(-21)). 2, 3 Let m = 58 + -31. What are the prime factors of m? 3 Let j(s) = s*3 + 4s*2 + 3s. Let v be j(-3). Suppose -3n - 2w + 11 = 0, vw = -2n - w + 8. Let h = 11 + n. List the prime factors of h. 2 Suppose -74 = -z - 4h, -3z - h = -2z - 77. Let u be (2/6)/(2/z). Suppose -3q + 11 = -u. What are the prime factors of q? 2 Suppose 3f + 0f = 21. Let o(l) = 2l - 9. List the prime factors of o(f). 5 Let k(z) = -z3 - 6z*2 - 5z + 5. Let q be k(-5). Suppose 0 = -qu + 23 + 42. List the prime factors of u. 13 Suppose 5k = b + 8, 3b - 5 = -k + 3. Suppose kr + 5u - 2u = 12, u = 0. Let t = r + -3. List the prime factors of t. 3 Let n be 9/(-7) + 30/105. List the prime factors of -4((-21)/(-12))/n. 7 Suppose 0d = -d + 16. Let l = -6 + d. What are the prime factors of l? 2, 5 Let h = 8 + -6. Suppose -3j - hj = -25. What are the prime factors of j? 5 Let m(a) = -3a + 48. What are the prime factors of m(-16)? 2, 3 Let k(x) = -x3 + 11x*2 - 9x - 10. Let g be k(10). Suppose -5w = -gw - 15. List the prime factors of w. 3 Let s(w) = w*2 - 1. Let k be s(2). Suppose -2r + kr = 0. Suppose z = -5v + 34, rv = -v - 5z + 26. What are the prime factors of v? 2, 3 Let r(q) = q*3 + 5q*2 - q + 7. Suppose 5h + 7u - 35 = 2u, 5h - u - 5 = 0. Suppose 0 = -hb + l - 15, 5l - 20 = l. What are the prime factors of r(b)? 2, 3 Let a(d) = -d3 - 10d*2 + 3. Let z be a(-10). Suppose 0 = -v - zl + 32, -6l = 3v - 4l - 75. List the prime factors of v. 23 Suppose 6 + 9 = 3s. Let n be 5/3 - (-1)/3. Let d = n + s. What are the prime factors of d? 7 Suppose -4a - 43 + 11 = 0. Let v be (3/(-4))/(1/a). Suppose -20 = -11f + vf. List the prime factors of f. 2 Let c = 162 + -83. What are the prime factors of c? 79 Let b(a) = -12a*3 + 5a. Let p(v) be the third derivative of -5v6/24 + 11v4/24 + v2. Let j(n) = -13b(n) + 6p(n). List the prime factors of j(1). 7 Let l be -2(-2 - -1 - 2). Suppose -51 = -5f - l. What are the prime factors of f? 3 Suppose u + 16 = 3u. Suppose -31 = -3v - 2o, u = -5v - 3o + 58. List the prime factors of v. 7 Let n be 160/(-15) - 4/(-6). Let z be (-6)/15 - 274/n. Suppose -s + z = 2s. List the prime factors of s. 3 Let u(f) = 23f2 - f + 5. What are the prime factors of u(2)? 5, 19 Let d(h) be the first derivative of -6h - 2 + 1/2h2. List the prime factors of d(10). 2 Suppose -4n + 135 = 5g, -2g + 38 = 3n - 9. List the prime factors of g. 31 Let u(j) = j2 - 2j - 3. Let v be u(-2). Let g = v - 3. Suppose 0y - g = -y. List the prime factors of y. 2 Suppose 0 = 6g - 206 + 62. What are the prime factors of g? 2, 3 Let d(w) = -72 + 4w2 + 41w*2 + 17. Let g(r) = 5r*2 - 6. Let l(p) = -6d(p) + 55g(p). What are the prime factors of l(1)? 5 Suppose -7j + 3j - 5r + 199 = 0, 2j + 3r - 97 = 0. Let h = j - 40. List the prime factors of h. 2 Let p = 6 + -43. Let t = -22 - p. List the prime factors of t. 3, 5 Let b(u) = u*2 + 7u + 1. Let l be b(-6). Let f(q) = q*2 + 4q - 6. Let x be f(l). What are the prime factors of (1 + x - 2) + 11? 3 Suppose 2l + 202 = 4f - 4, 5l = -f + 35. Suppose f = 7s - 2s. What are the prime factors of s? 2, 5 Suppose -u + 471 = 3g, -3u + 9 = -0u. List the prime factors of g. 2, 3, 13 Suppose 0 = -2t + a + 544, 9t - 7t + 4a = 534. List the prime factors	{ "pile_set_name": "DM Mathematics" }
0.102321 minus -13.964? 13.861679 What is 5636 minus -90803? 96439 Total of -9.22239034 and -0.5. -9.72239034 What is -0.4 less than 333622.284? 333622.684 What is the distance between 0.011 and 558242097? 558242096.989 -0.5 - -1795.99067 1795.49067 Calculate -52520 - 184. -52704 What is -0.2 less than 511094621? 511094621.2 What is -0.2 - 86976.22? -86976.42 Sum -2 and 19134928. 19134926 -1.314 - -103003 103001.686 What is the difference between 2.864 and -170182? 170184.864 Work out -323.41397 + 1. -322.41397 Add together -368.24667 and -4. -372.24667 What is 0.0688 less than -1086.73232? -1086.80112 Work out 0.2 - -70208.4439. 70208.6439 -286952 - -20.42 -286931.58 What is 102.87543 minus 2912? -2809.12457 Sum 8382.9 and -48102. -39719.1 Put together 7.762839 and -2787. -2779.237161 Work out 11999 - -156. 12155 Add together -0.3391461 and -8. -8.3391461 Add together -52 and 317522. 317470 Add -0.0177193 and 1.097. 1.0792807 What is -54815 minus 5.6021? -54820.6021 7767 - -506.708 8273.708 Work out -6114.91 - 0.047. -6114.957 61077.784 - 3 61074.784 What is 222 + 215.74? 437.74 Total of 15882 and -799. 15083 Work out -305.004 - -0.3317. -304.6723 22443 - -14.48 22457.48 5+-729249718 -729249713 191336.1696 + -13 191323.1696 Calculate -904 - -11759609. 11758705 Work out -92.435 - -24028. 23935.565 What is 7 less than 1.03602572? -5.96397428 What is the distance between -20741662 and 0.318? 20741662.318 What is -0.04585 minus -43.5? 43.45415 What is 3225564.06 minus -0.148? 3225564.208 Subtract 13237449469 from -0.1. -13237449469.1 What is 44086 + -2585? 41501 -4036.484+0.335 -4036.149 Work out 28778453 - -0.21. 28778453.21 Put together 808 and 4839957. 4840765 Put together 18 and -316558.559. -316540.559 -23769196 - 1 -23769197 What is the distance between -28 and 4310290? 4310318 What is 2.17 less than -0.822711? -2.992711 Subtract -4 from -112812.764305. -112808.764305 What is the difference between 6.9308 and 0.0807? 6.8501 Total of -15813 and 16478. 665 3443955 + -775 3443180 What is -15937370 less than -6.3? 15937363.7 Sum 3658 and -6608. -2950 Subtract -0.11 from 19476451.77. 19476451.88 Add 813527359 and 0.4. 813527359.4 1 + 1159335933 1159335934 Work out 2 + -2922118. -2922116 What is the distance between 3.0082 and -1153616? 1153619.0082 Total of -2.85 and 15807037. 15807034.15 Add together 10191 and -0.160174. 10190.839826 What is -97264200 take away 6? -97264206 Work out 2222 - -1168. 3390 What is 2159 less than -3354.49? -5513.49 What is -0.3 less than -127832.4038? -127832.1038 Subtract 232 from 10378791. 10378559 Calculate 0.2 - -20539.55685. 20539.75685 What is -6179 take away 26379.8? -32558.8 Work out -0.015108 - -322. 321.984892 Work out 1402 - 100.45365. 1301.54635 What is -606229839 minus 0.5? -606229839.5 What is the difference between -97130406 and -839? 97129567 What is 3 less than -93671528? -93671531 What is 0.3537005 plus 0? 0.3537005 What is -6437347 take away -2.1? -6437344.9 Calculate 526902.44 + 262. 527164.44 -47916 + -10628 -58544 What is 4 plus 13911926? 13911930 What is the difference between 0.03 and -1407920734? 1407920734.03 What is -0.37382309 minus -86? 85.62617691 Put together -109706.98 and 15. -109691.98 What is -796934011 less than 0.3? 796934011.3 Subtract 1.2872531 from 2.4. 1.1127469 Calculate -8508.93 - -0.03741. -8508.89259 What is -11778 - 33059? -44837 What is 944.166 - 722? 222.166 250 - 6490.551 -6240.551 0.3 - 578.52557 -578.22557 Work out 0.081142 - 0.77. -0.688858 What is 2.2478 take away -1753? 1755.2478 25232 + 13009 38241 What is the distance between 0.2 and -1133929? 1133929.2 Calculate -1145 + 0.07017. -1144.92983 Total of -11 and 249491. 249480 What is -0.40823 minus 101480? -101480.40823 Add together 311.1362 and -77. 234.1362 Work out 0.2 - 197026083. -197026082.8 Work out 0.2 + -0.04825343. 0.15174657 What is 2.604189 + 0.044? 2.648189 Work out 0.4 - -443085.1309. 443085.5309 Calculate 53.04354 - 3838. -3784.95646 What is -0.0987759 take away -0.0054? -0.0933759 What is the distance between 3 and 87217.35181? 87214.35181 Add 0.228 and -7.40365. -7.17565 What is -0.1 + 1565897036? 1565897035.9 What is 0.07313376 take away -15? 15.07313376 4076.958 + -0.0602 4076.8978 Total of -75 and -462850803. -462850878 What is 5708.06 less than 0.3348? -5707.7252 What is -7629410137 + 0.5? -7629410136.5 What is -39269 plus 985? -38284 -6444611662 - 1 -6444611663 -6486215+0.076 -6486214.924 Put together 112.8 and -97937. -97824.2 -310681 + -9389.5 -320070.5 Subtract -1131207 from 74.09. 1131281.09 Calculate 0.081 + -10750942. -10750941.919 Sum 2.762018 and 10.41. 13.172018 Calculate -1.83154779 + -274. -275.83154779 What is 5.86 - 25523.6? -25517.74 -1.386 - 638.366 -639.752 Work out 4.9 - 453827. -453822.1 What is -0.08 - 1525940644? -1525940644.08 0.145625026 + 47 47.145625026 Work out -1605.144416 - 0.06. -1605.204416 What is 94451 + -845524? -751073 What is 1416 + -29.736? 1386.264 What is the difference between 4 and 17.2197704? 13.2197704 What is -79028 minus 7.25? -79035.25 What is -0.17 plus 0.00621983? -0.16378017 What is -2 - -5988994? 5988992 Calculate -4 + -164795695. -164795699 What is -585 minus 0.32156? -585.32156 Sum 19576 and 400267. 419843 Calculate 87379 - -2174. 89553 What is -3.426 plus 45773? 45769.574 -2221501969 - 2.3 -2221501971.3 Add together -0.03 and -11126065. -11126065.03 What is -390.369 minus 8.1? -398.469 What is -7106114 take away -4? -7106110 -0.6 - 16866287.67 -16866288.27 Add together 153.6 and -20164190. -20164036.4 Calculate 0.5 + -35324345. -35324344.5 What is -7.8836785 take away 3? -10.8836785 What is -76.77322397 minus 3? -79.77322397 What is 0.18 - 14.58926? -14.40926 Work out 5.8 - -518908. 518913.8 What is -0.12 plus -4994415? -4994415.12 Work out 0.5 - -364.541519. 365.041519 What is the distance between -83823880 and -62.3? 83823817.7 What is the distance between -5 and 9961985.64? 9961990.64 Add -1246 and -1013235. -1014481 What is -18038.1 - 204? -18242.1 Put together 46803 and -8529. 38274 What is 3.7 plus -14699.04? -14695.34 8.53+3522229 3522237.53 Add together -0.0353 and 177.025. 176.9897 What is the distance between 298.1695828 and 3? 295.1695828 What is -0.3 take away 6948789257? -6948789257.3 Sum -66848.1 and -33.12. -66881.22 Sum 403818 and -6.6. 403811.4 What is -18558 - -191988? 173430 What is 11135.9 + 1.04? 11136.94 Calculate 12726 - 143435. -130709 What is -207 less than 636954? 637161 Add together -12945835 and 0.06. -12945834.94 -10326+-1578654 -1588980 What is 0.38346 minus 56.2? -55.81654 What is the distance between 16 and 1.95247? 14.04753 Work out 117.46 - -150402. 150519.46 Put together 67291 and -4.84. 67286.16 Work out -0.3 - 73130492. -73130492.3 Sum -0.1 and 60660.5969. 60660.4969 Calculate 6097 - -22934. 29031 Calculate 266593252 + -0.2. 266593251.8 What is 19 less than -3827114.05? -3827133.05 -0.12+-252102.504 -252102.624 What is the distance between 17111633794 and 0.2? 17111633793.8 Add -0.202 and -122189. -122189.202 Add -0.3888471952 and 0.08. -0.3088471952 Total of 14699766484 and 0.1. 14699766484.1 Put together -99.8 and -604936. -605035.8 Add together -429965752 and -0.1. -429965752.1 What is -0.3 + -3865526259? -3865526259.3 Subtract -0.08 from 1.488821866. 1.568821866 25 + 3933783 3933808 Calculate -0.3 + -158062271. -158062271.3 What is the distance between 10100 and 12417? 2317 Work out 6.7 - 160423.33. -160416.63 What is the distance between -162.1017 and -0.2? 161.9017 What is 0.7 - 15312274792? -15312274791.3 Put together -461349 and -50. -461399 Calculate -2.38115 - -7. 4.61885 What is -0.03 plus -29129.317086? -29129.347086 Put together 0.46 and -1053749870. -1053749869.54 What is 27657 minus -15176? 42833 Put together -237774397 and 57. -237774340 What is -16 - 9417459? -9417475 What is the difference between -766777 and -0.76? 766776.24 What is -14.2 - 7.305993? -21.505993 -0.5+-106308930 -106308930.5 -821.8 + 1.714003 -820.085997 Add together 2256760 and 5935. 2262695 Calculate 0.978922 - 1.996. -1.017078 Work out 434 - -10.1986. 444.1986 Work out 0.15221789 + -0.12. 0.03221789 What is -0.4 + -4204242? -4204242.4 What is 15 take away 98592707? -98592692 Sum 242 and -928.75938. -686.75938 Subtra	{ "pile_set_name": "DM Mathematics" }
/3 + 4x2 - 50x. Calculate v(7). 1 Let j(o) = 5o2 + 4 + 2o*3 + 0o*3 + 3o - 3o3 - 8o2. Let k be j(-3). Let h(n) = -n2 - 6n - 7. Determine h(k). -2 Let z(i) be the first derivative of -i6/180 + i5/60 - i4/12 + i3/3 - 3. Let o(r) be the third derivative of z(r). Determine o(2). -6 Let g(v) = -4 + 6 + 3v + 0v - 1. Calculate g(-1). -2 Let n(r) = -r. Let c(w) = w2 + 13w - 7. Let q be 3/6(-104)/4. Let k be c(q). Calculate n(k). 7 Let t(k) = 8 + 11 - 29 + 11 - k2 - 4k. Suppose -2u + 0h = -4h + 16, 0 = 3u - 3h + 21. Determine t(u). -11 Let a(b) = 6 + 0b + 4b - b - 2b. Determine a(0). 6 Let b(o) = -2o2 - 4o + 1. Let a = -6 + 3. Let f be b(a). Let j(i) = i*2 + 5i - 2. What is j(f)? -2 Let s(r) be the second derivative of 1/6r3 + 0 + r - 7/2r2. Let w = -1 - -6. Give s(w). -2 Let k(y) be the second derivative of y3/6 - 17y2/2 - 4y. Determine k(0). -17 Let m = -6 - -3. Let k be -1(m - -8)1. Let b(v) = v*3 + 6v*2 + 2v - 6. What is b(k)? 9 Let i(w) = -w*2 - 6w + 3. Let t = 16 + -21. What is i(t)? 8 Suppose -6y + y = 0. Let i(t) be the third derivative of 2t*2 + 0t - 1/120t6 - t3 + yt*5 + 1/24t*4 + 0. Determine i(0). -6 Let v = 0 - 0. Let j(q) be the first derivative of -1/2q*2 - 2 - 1/3q*3 + 1/4q*4 + 4q. Calculate j(v). 4 Let c(a) = 2a3 - 3a*2 + a - 2. Let w(j) = 4j*2 - 2j. Let r be w(1). Give c(r). 4 Let t be (-6)/9 + (-20)/6. Let y be 45/6t/(-5). Let s(f) = -f3 + 7f*2 - 7f - 4. Determine s(y). -10 Let v(n) be the second derivative of n*3/6 - 2n*2 - 4n. Determine v(4). 0 Let a(t) = -t*2 + t. Let o(h) = 5h*2 - 3h - 2. Let j(k) = -4a(k) - o(k). Suppose -5f - 8 = -4n + 7, -15 = 5f - n. What is j(f)? -4 Let b(o) = o*2 - 5o - 9. Suppose 10l - 35 = 5l. What is b(l)? 5 Let i(c) = -c - 3. Let a(h) = h + 4. Let k(s) = -3a(s) - 4i(s). Suppose 4d + 5q = d + 18, 3d - 18 = -2q. What is k(d)? 6 Let c(p) = -p. Suppose v + v = 2. Let f be 0 + (2 + v - 3). What is c(f)? 0 Let c(g) be the first derivative of -g3 - g2 + g - 78. Let t be 1 + -1 - 0 - -6. Suppose 4 = -tu + 4u. Calculate c(u). -7 Suppose 2w + 6 = 0, -2w + 13 = -5h + 9. Let j(i) = -2i + 2. Calculate j(h). 6 Let k(n) be the third derivative of 7n5/60 + n4/8 + n3/6 - 4n*2. Let j(x) = 6x*2 + 3x + 1. Let d(z) = -6j(z) + 5k(z). Give d(-2). 1 Let u(s) = 4s3 + 2s*2 - s + 1. Suppose -2b - 13 = -9. Determine u(b). -21 Let a = -106 + 110. Let r(v) = -3v - 1. Determine r(a). -13 Suppose -22 = -q - 4k, -k + 26 = 3q + k. Let o(n) = -n3 + 7n*2 - 6n + 8. Determine o(q). 8 Let t(c) be the third derivative of -c9/20160 - c8/20160 - c7/2520 - c6/720 - c5/20 + c2. Let o(n) be the third derivative of t(n). Determine o(-1). 3 Let h(s) = -2s + 5. Suppose -4o = 20, 27 = 3f - 2o + 2. Let x be h(f). Let v(k) = -k*2 - 7k + 1. Calculate v(x). 11 Let s(k) = 15k - 17. Let a(r) = -7r + 8. Let i(z) = -9a(z) - 4s(z). Suppose -t - 9 = -4b, 0 = 2t + b - 0 - 9. Suppose -tp = -3 - 6. Calculate i(p). 5 Let l(x) = x + x3 + 3x + 6x2 - 7 - x. Let u = 2 + -5. Let f = u - 2. Calculate l(f). 3 Let z(t) = -t2 - 8t - 4. Let h(a) = -1 - 3 + a - 2a2 + 6a + a*2. Let p be h(7). What is z(p)? 12 Let n(x) = -3x - 44. Let i(b) = 15 + b + 6b - 6b. Let t(u) = 11i(u) + 4n(u). Calculate t(0). -11 Suppose -17 = g + 3y, g - 6y + y - 7 = 0. Let t(x) = -x*2 - 7x + 4. Determine t(g). -4 Let c(v) = v + 8. Let k be -4 + 512/15. What is c(k)? 8 Suppose 3l + 0l = 21. Let d(m) = -m3 + 8m*2 - 9m + 10. Let j be d(l). Let q(x) = x*2 + 3x - 3. Give q(j). 1 Suppose -109b = -107b - 4. Let k(q) = 3q3 - 4q*2 + 2q. What is k(b)? 12 Let a(t) be the first derivative of -t*2/2 - 11t - 22. Give a(-8). -3 Let d(f) = -2f - 2 - f + 5 + 2f. Determine d(8). -5 Let l(x) = 2 - x - 7x3 - 4x*2 - 1 + 3x*2. Suppose -9t - 2 = 3i - 8t, -3t = 3i + 12. Give l(i). -8 Let m = -8 + 16. Let g = -7 + m. Let n(f) = 5f2 - 1. What is n(g)? 4 Let b(h) = h3 - h2 - h. Let z(m) = -7m*3 + 9m*2 + 10m + 4. Let k(f) = -6b(f) - z(f). Calculate k(4). -4 Let k(i) = -7i - 2. Let a(x) = 20x + 5. Let v(c) = -6a(c) - 17k(c). Determine v(-8). 12 Suppose -2z = 4 + 4. Let h(y) = 5y3 + y2 - 4y - 3. Let x(f) = -f*3 + f + 1. Let w(v) = zx(v) - h(v). Suppose 0 = -3m - 2m. Determine w(m). -1 Let m(q) = -2 + 84q - 87q + 7. What is m(4)? -7 Let v(g) be the second derivative of -g3 + g2/2 - 4g. Let r = 0 + 1. Determine v(r). -5 Let n(b) = 4b*2 + 18b + 2. Let q(x) = x*2 + 6x + 1. Let t(u) = -3n(u) + 10q(u). What is t(5)? -16 Let l(k) = -2k - 6. Let c be l(-4). Let f(j) = -2j*3 + cj2 - j2 + 1 - j + 3j2 + j3. Determine f(2). 7 Let n(s) = -s3 + 6s*2 - 3s - 7. Let a = 116 + -317. Let d be 1/2 + a/(-6). Suppose -4b = -8, 2b + 5 = -5i + d. What is n(i)? 3 Let o(w) = -w3 + 4w*2 - 3w + 2. Let v = 17 + -27. Let h = 13 + v. Determine o(h). 2 Suppose 3k + p = 7, 0k + 3p + 9 = k. Let h(s) = s3 - s2 - 2s - 2. Determine h(k). 10 Suppose 10r - 11r + 5 = 0. Let c(z) = z - 6. What is c(r)? -1 Suppose 5b - 4 = -3c, 0b - 2c - 10 = -3b. Let t = b + -7. Let z(p) = -p - 2 + 0p + 0p. What is z(t)? 3 Let y(f) = -f2. Let b(w) = w3 + 3w*2 + 2w + 10. Let a(j) = -b(j) + 3y(j). Let s be a(-6). Let d(q) = -q + 1. Give d(s). -1 Suppose -4i - 5 - 11 = 0. Let z be (-2 - -4)(-6)/i. Let t(v) = -2v + v2 - v2 + vz + 1 + v2. Determine t(1). 1 Let j(r) = -r*2 - 7r - 7. Let t be j(-5). Suppose 0y = -3y + t. Let f(o) = 2o3 + 1. Give f(y). 3 Let s(r) be the third derivative of r6/120 - r5/30 - r4/8 - r3/3 + 47r*2. What is s(3)? -2 Let t(d) = 3 + 29d - 16d - 14d + d*2. Determine t(0). 3 Let s be ((-12)/(-18))/((-4)/6). Let o(k) = 6k. Calculate o(s). -6 Let u(l) = 3l2 + l. Suppose 2x + 5t = 17, 0 = 3x - 2t + 4 - 1. Suppose 0 = 11z - 12z - x. Calculate u(z). 2 Let d(i) = -i3 + 7i*2 - 7i + 9. Suppose f = 2, -5 = 3n - 5f - 13. Calculate d(n). 3 Let u(c) = -2c + 2. Let f(z) = 2z - 3. Let o be f(2). Let a be u(o). Let y(s) = -s3 - s2 - s - 6. Give y(a). -6 Let c(j) = j*2 - 1. Let b be (35/(-2))/52. Let z(d) = d*2 + 6d - 5. Let l be z(b). Calculate c(l). 3 Let x(g) = g + 13. Let j(o) = -o - 5. Let m be j(-5). Give x(m). 13 Let t(g) = 2g + 10. Let j be t(-7). Let k(x) = -4x - 1. Let s be 46/(-14) - (-12)/42. Let q(o) = -o. Let v(a) = sq(a) + k(a). What is v(j)? 3 Let l(m) = m3 + 5m*2 + 4m + 3. Suppose 11 + 19 = -10g. What is l(g)? 9 Let f(l) be the first derivative of l4/4 - l3/3 - l2 - 9. Calculate f(2). 0 Let m(a) = -a3 + 4a*2 - a - 1. Let o be m(4). Let c(v) be the second derivative of 1/20v*5 + 1/2v*4 - v + 0 + 2v2 + v3. Give c(o). -1 Let p = 7 + -4. Let q(j) = -10j + j2 + 0j*2 - 10j + 21j - 2. Determine q(p). 10 Let v(q) = q2 + 6q - 4. Let s = 0 - -3. Suppose -sc = -4c - 7. Let o be v(c). Let w(g) = -g - 2. What is w(o)? -5 Let t = -2 - -3. Let r(p) = 6p2 + 5p*2 + p - 34 - 4p*2 + 33. Give r(t). 7 Let w be 4/(-7) - (-22)/14. Let y(p) = -16p. Give y(w). -16 Let t(a) be the third derivative of -a7/280 - a6/360 + a4/24 + a3/3 + 4a2. Let u(i) be the first derivative of t(i). Calculate u(-1). 3 Let s be -1(-2 + 3) + 6. Let d(j) = -4 + s - j + 2j3 - j2 - 6j3. Give d(1). -5 Let j = 57 + -51. Let a(f) = f2 - 5f - 2. Determine a(j). 4 Let x(h) = 2h2 + h - 1. Let i be x(-2). Let z be i + 1/(-1) + -2. Let l(s) = -s3 + s2 + s + 2. Calculate l(z). 0 Let y(m) = -m2 + 2m. Let f be y(2). Let b = 3 - f. Suppose w + 3s - 19 = bw, 4s = -2w + 16. Let g(d) = d3 + 2d*2 + 3d. What is g(w)? -6 Suppose 0 = -p - 3d - 9, -2p + 0p + 17 = -d. Suppose 4y - py + 6 = 0. Let t(l) be the first derivative of -l4/4 + 2l3/3 + l2 - 10. What is t(y)? -3 Let j(y) = 8y3 - 20y*2 - 11. Let b(n) = -3n*3 + 7n*2 + 4. Suppose -6 - 5 = -p. Suppose -2w + 2 + 6 = 0. Let x(f) = pb(f) + wj(f). Give x(-3). 0 Let o = -3 - -7. Suppose -6y - 12 = -oy. Let s(n) = -n - 8. What is s(y)? -2 Let j = 6 + -7. Let w(s) = 4s3 - 3s*2 + 2s + 5. Let f(y) = -2y3 + y2 - y - 2. Let a(h) = 5f(h) + 2*w(h). Determine a(j). 2 Let n(i) be	{ "pile_set_name": "DM Mathematics" }
(2i + 0i + 0i)(2i - 3i + 3i) - i2 + 0i*2 + 3i2 + i2 + 3i2 - 2i*2 - 2i - i*2 + 2i. -55999i2 Expand -2420f*2 - 671f*2 - 1008f*2 - 97f*2 + (-3f + 2f - f)(-3 - 2f + 3). -4192f*2 Expand (-5c + 3c + 0c)(-1034 - 1168 - 2602 - 54 - 13304). 36324c Expand -33a3 - 4a*4 + 33a*3 + (-5a*2 - 9a*2 + 21a*2)(-6 + 3a2 + 6). 17a*4 Expand (328 + 30724o - 107 - 108 - 112)(0o + o - 3o). -61448o*2 - 2o Expand (s + s - 3s + (-2s + 2 - 2)(3 + 0 - 1) + 0s + 2s + 0s)(-4 + 4 + 2)(0 - 1 + 3 - 2 + 7 - 1 + (7 - 2 - 3)(-19 - 30 - 31))(-3s + 4s - 2s). -924s*2 Expand (t + 1 - 1)(-2 + 0 + 1)((-9 - 3 + 4)(-2 + 7 - 4) - 7 - 3 - 1)(12 + 6 - 6). 228t Expand (4 - 5 + 0)(-2i + i + 3i) + 135 + 140 - 385i - 276. -387i - 1 Expand (5q*2 - 2q*2 - 41q*2)(-4q3 - 3q*3 - 10q*3). 646q*5 Expand -640v*5 + 373v*5 + 342v*5 + (3 + v - 3)(0v4 - v4 + 4v*4) + 0v - 5v5 + 0v. 73v5 Expand (1 - 5 + 3)(3 + 4 - 35)(-14 - 35a*3 + 14). -980a*3 Expand (-6 + 6 - 2265z + 5754z)(-z - 2z + z) + 2 - z2 - 2 + (-2z*2 - 3z + 3z)(-1 + 1 - 2) + 1 - 1 + z*2. -6974z*2 Expand (-76 - 33 - 5)(0 - 2f + 0)(3f2 - f2 - 5f*2). -684f*3 Expand (4 - 4 + u)(7u - 48u - 14u)(-4 - 14 + 0)(2u - 6u + 3u). -990u3 Expand 0i + 0i + 2i3 + (-i3 + 4i - 4i)(0 + 2 - 1) - 49i3 - i2 - 70 + 47i3 - 489i + 488i. -i3 - i2 - i - 70 Expand (-a + 5a - 3a + (35a + 72a - 17a)(-3 + 3 - 1))(-1 + 9 - 5)(0a*3 - 2a3 + a3). 267a4 Expand (29559q + 30413q - 64432q)(-q2 + 0q + 0q). 4460q*3 Expand (10x + 4x - 2x - 4x)(-3533x - 64x*3 + 3533x). -512x4 Expand (-k2 + k2 + k2 + (0k + k - 3k)(0k - 2k + 3k))((2 - 2 - 4)(-1 + 0 - 1) + 2 + 2 - 18). 6k*2 Expand (16 + 3b - 16)(b - b - 3b*4) + 188b*5 + 235b*5 + 50b*5. 464b*5 Expand -2q4 - q4 + 0q4 + (-65q*4 + 600q*4 + 315q*4)(2 - 4 + 1). -853q4 Expand (369q*2 + 474q*2 - 212q*2)(3 + 1 - 6 + q)(0 + 2 - 4)(1 - 5 + 3). 1262q3 - 2524q*2 Expand (2 - 5 + 2)(-5r - r + r) + ((3 + 2 - 3)(1 + 0 + 1) - 4 - 1 + 3 + 1 - 5 - 1)(6r + 18r - 14r). -25r Expand (7 - 2 - 12)(2 + 6 - 7k2 - 5) + 39 - 39 + 2k*2. 51k*2 - 21 Expand -409 + 46g + 409 + (12g + 10g - 8g)(0 + 3 - 1) + (-3g - 2g + 6g)(-1 + 0 - 1) - 3g + g + 0g + 2g - 3g + 2g. 71g Expand 0m3 + 2m*3 - 3m3 + (m3 - m2 + m2)(3 + 0 - 4) - 47m*3 + 24m*3 - 4m*3 + (-1 + 2m + 1)(0m + 0m - 2m*2) - 2m + 2m + 5m*3. -28m*3 Expand ((1 + 5 - 10)(6k + 3k - 2k) + 2k - 2k + 2k + 4k - 5k + 0k)(-k3 + k3 - 2k3). 54k*4 Expand 7 - 13o*3 - 7 - 5o2 - o3 + 5o2 + (3 + 0 - 1)(-o - o*3 + o) + 1 - 3o*2 - 339o*3 - 337o*3 + 679o*3. -13o*3 - 3o*2 + 1 Expand 18j*4 + 16j*4 - 11j*4 - 4j*4 - 1 + 1 + (4 + j - 4)(-5 + 5 + 7j3) + (-2j*2 + 2j2 + j3)((-j + 2j - 2j)(0 + 0 - 1) - 2 + 2 - 3j). 24j*4 Expand (-35 - 43 + 9 + 10)(-w - 6w - w + (3 - 3 + 2)(-3w - w + 2w) - 4w + 4w + w + 0w + 0w - w). 708w Expand -h + h - 3h + (91 - 18 + 934)(-2h + 4 - 4). -2017h Expand (4 + 0 - 1)(3i + 2 - 2)((-i + 2i + i)(3 - 6 - 5) + (-i + 0i + 3i)(2 - 2 - 1) + i - 3i + i). -171i2 Expand (-12o + 215o + 24o)(15o*4 - 11o*2 - 21o*2 + 29o*2). 3405o*5 - 681o*3 Expand (3 - 4 - 5)(-4g4 + 0g4 + g4) + (241 - 241 - 170g2)(-g + 0g + 2g)(-3g - g + 3g). 188g*4 Expand (2n - n - 2n)(-1730n + 695n + 830n - 794n - 536n - 1842n). 3377n2 Expand (3o - 12o + 4o + (2o - o - 3o)(-62 + 11 - 71))(2 + 1 - 1). 478o Expand (46951 - 46951 - 2983r)(2r - 1 + 1). -5966r2 Expand (2c + 0 + 0)(-c3 - 6c*3 + 4c3) + (-c3 + 2c - 2c)(-165c + 88c + 126c). -55c4 Expand (6f + 21f + 4f)(-3 + 2 - 1)(2 - 3f - 2) - 11f*2 - 7f*2 + 14f*2. 182f*2 Expand 87790z*2 - 87790z*2 - 965z*5 - 2z*5 + 3z5 + z5 + (2z + z - 2z)(-4z*3 + 4z*4 + 4z*3). -959z*5 Expand ((1 - 6 + 2)(2 - 1 - 3) + 29 + 15 - 15 + 2 - 1 + 1)(0s + 0s - 4s). -148s Expand (-80 + n2 + 9n + 80)(1080 + 299 - 70). 1309n*2 + 11781n Expand (a*2 + 5 - 5)(-300 - 183 + 483 - 21793a). -21793a*3 Expand (2l - l - 4l)(-8l - 8l - 25l - 29l - 63l). 399l*2 Expand (80 - 73 - 96)(-o + 3 - 3)(12 - 16o*3 - 12). -1424o*4 Expand (-967o + 1442o - 720o)(0o - 7o + 2o*2 + o). -490o*3 + 1470o*2 Expand -9731n*3 - 634n*4 + 9731n*3 + (-2n*2 - 2n*2 + 2n*2)(2n2 + 2n - 2n) - 4 + 0 - n4 + 5. -639n*4 + 1 Expand (-105u*3 + 12u*3 - 48u*3 + (-2 + 2 - 2u)(-2u2 - u2 + u*2))(5 + 9 - 13). -137u3 Expand (2 - 3k*4 - 2)(6 - 6 + 2k) - 11k*4 + 0k*5 - 4k + 12k4 + 2k*5 + 1 + 5k*5 + 4k*5 + 6k*5. 11k5 + k4 - 4k + 1 Expand (4l + 12l - 2l)(3l*3 - 3l3 - l3)(29 + 65 + 19). -1582l*4 Expand (-79j + 271j - 32j)(-1 - 1 - 3) + 1 - j - 1. -801j Expand (-4m + m + 2m)(-3 + 3 - m3) + 808m*4 - 10492m*4 - 2372m*4. -12055m*4 Expand (-3662l + 1508l - 2380l + 322l)(-1 - 1 - 1). 12636l Expand (329q + 273q - 509q)(5 + 28 + 11 + 4 + 2). 4650q Expand -117q3 + 2 + 60q*3 + 56q*3 - 2q*4 + (-3q + 4q + 0q)(q3 + 0q*3 + 0q*3) + 5q4 - q4 - 2q4 - 2q4 + q4 + 10q4. 10q4 - q3 + 2 Expand -445b - 507b + 1045b - b - 2b + 2b + (1 - 6 + 3)(-5b - b + 4b) - 2b + 3 - 3 + 2b - 2b + 2b + (2 + 0 - 4)(4b - 5b + 0b) + 3b + 2b - 4b. 99b Expand (463 - 856 - 3469)(-2h - h + 4h). -3862h Expand (-2835 - 39 - 24)(3k - 5k + 3k + k)(5 - 4 + 1). -11592k Expand (-8v3 - 20v*3 + 12v*3)((-4 + 2 + 0)(3v - 2v - 2v) - 162 + 162 + 14v). -256v*4 Expand (-3 - 1 - 5)(-2 - 4 - 5)(8o*5 - 6o*5 + 26o*2 - 28o*2 - 5o). 198o5 - 198o*2 - 495o Expand 2p - 3p + 0p - 823p - 167p - 259p - 850p + 37p - 4 + 4 - p + (3 - 2 + 1)(p + 2p - 5p). -2068p Expand -v*3 - 2v4 + v3 + (2v2 + 3v*2 + 4v*2)(0v + 0v + v)(-1 + 2v + 1 - 2v - 5v - 28v + (1 + 0 - 2)(0 - v + 0)). -290v4 Expand (2 + 1 - 5)(-20 + 8 - 6)(0z + 0z + z + (1 - 3 + 3)(-5z + 2z + 2z) + 0 + 5z + 0). 180z Expand ((5 + 3 - 4)(-u + u - 2u) - 5u + 3u + u)(1544u4 + 1579u*4 - 3281u*4). 1422u*5 Expand (4 - 2 + 2g2 - g2)(14g - 13g + 16g) + 230 - 91g - 23g*3 - 232 + 24g*3. 18g*3 - 57g - 2 Expand 136v2 + 180v - 180v + (24 - 4v - 33 + 2v)(0v - v + 0v). 138v2 + 9v Expand (-2t + 6t - t)(0 + 0 + 2)(534 + 329 - 123)(-t + t2 + t). 4440t*3 Expand -l + 4l - 4l - l + 5l - 2l + 2l + l - 4l + (-4 + 2 + 3)(4l - 3l - 3l) - 10l + 40l + 28l. 56l Expand -l + 3l + 6l + (-3l + 3l + 3l)(2 - 3 + 2) + 23l + 2l + 2 - 3l. 33l + 2 Expand (224v - 1142 + 1142)(-2 + 8 - 1) - 3v + 6v + 2v + v + 0 + 0. 1126v Expand (4 - 5 - 1)(-1 + 1 - 3o4)(-1 - 5 + 4)(-151 + 10 + 10)(-1 + 2o + 1 + (-1 - 3 + 2)(o + o - 3o) - o + 3 - 3). 4716o*5 Expand (-643 - 11o + 141 + 13o)(-2 + 2 - 5o). -10o*2 + 2510o Expand (-1 + 1 - 2)(1348g*2 - 1347g*2 - 152 - 158) - 21g + 2 + 4g2 + 21g. 2g2 + 622 Expand (32 - 10122h - 94 + 62)(-3 + 3 + 1). -10122h Expand (-3y + 0y + 0y)(-y*2 - 4y*2 + 4y*2) + (5 - 2y*2 - 5)((y + 4y - 3y)(-3 + 5 + 1) + 3y + y + 3y + 7y + y - y). -37y3 Expand (3 + 2 - 6)(-5581q - 6011q + 987q). 10605q Expand (120p - 8p*2 - 120p)(34p + 1 + 1 - 88p). 432p*3 - 16p*2 Expand (6j + 2j - 12j)(8 - 2 - 1)(16 - 13 + 7)(1 - 3 + 3). -200j Expand (-3t3 - 3t3 + t3 + (2t3 + t3 - 4t*3)(2 - 4 + 1))(-73t*2 + 38t*2 + 189t*2). -616t*5 Expand 49762c*2 - 48653c*2 + 4 - 4 + c + (c + 0c - 2c)(2c - 7c + 3c). 1111c*2 + c Expand (43 - 29f - 43)(-4f - 3f + 5f) + 6 - 6f2 - 5 - 2. 52f*2 - 1 Expand (0 + 35 - 4)(-2z2 + 8z2 - z2) + (-4z + 3z + 3z)(-1 - z + 1) + z*2 - 3z2 + z2 - 2z - 3z*2 + 2z. 149z2 Expand -1225w*3 + 75w*3 - 87w*3 + (-2w + 2w2 + 2w)(0w + 4w - 3w) - 4w3 + 3w*3 + 3w*3. -1233w*3 Expand 5y - 3y - y + (-4936y - 801 + 1620 + 104y - 819)(0 - 1 - 2). 14497y Expand 4v	{ "pile_set_name": "DM Mathematics" }
is the third biggest value? (a) k (b) v (c) 2 b Let r = -151/9 + 155/9. Let v be (13/((-325)/(-30)))/(2/(-10)). Which is the biggest value? (a) v (b) r (c) -3 b Let w(k) = -161k - 80. Let i be w(-3). Let v = -2823/7 + i. Which is the biggest value? (a) -1/6 (b) -0.5 (c) v a Let z be (4/(-8))/((-3)/6). Let m = -96.3 - -96. Let u = m + 2.3. Which is the third biggest value? (a) 7 (b) z (c) u (d) -2 b Suppose -64 = -3c - 10. Suppose 2y = -4i - c, 2i + 67 - 19 = -4y. What is the third smallest value in 0.2, y, -1? 0.2 Let z = 1.931 - 0.101. Let i = z + -19.83. Which is the fourth smallest value? (a) -0.4 (b) 3 (c) 2/13 (d) i b Let i be -2 - 0 - (-8)/3. Let t = -0.095984 - 0.304016. What is the second biggest value in -3/2, t, i, 10? i Suppose -7w = -9w + 12. Let k be (-6)/(-30)w/(-9). What is the biggest value in -1, k, 0.2? 0.2 Let g = 14831 + -14826. What is the smallest value in g, 9, -0.05, -1/3? -1/3 Suppose 0 = -2g - r - 5779, 5r = -12 - 3. Let m be g/202/4. Let f = m + 72. Which is the second biggest value? (a) -2 (b) f (c) 0.5 b Let d = 1.2549 - 1.1849. Which is the second biggest value? (a) d (b) 0.7 (c) 0.025 a Let y be ((-645)/30 + 21)-2. What is the fourth smallest value in -2, 3, y, -6/17, 0.05? y Let y = -1190 + 1195. Which is the biggest value? (a) 0.008 (b) y (c) -4 (d) -2/11 b Suppose 133j - 279j = -194j + 912. Which is the second biggest value? (a) j (b) -4 (c) 8 c Let o be (-2 + 14)(-17)/(-1428)14. Which is the biggest value? (a) -1 (b) o (c) -3/89 b Let f(w) = -w3 + 10w*2 + 12w - 5. Let c be f(11). Let b be (1/11)/((-3)/c). Suppose 0 = 2q - 3 + 11. What is the smallest value in q, -3, b? q Let i = -39 + 17. Let s be 40/i - (-4)/2. Let v = 2.0484 + 0.9516. What is the smallest value in s, v, -5, 0.2? -5 Let v = 279 - 160. Let u = v + -123.35. Let g = u - -0.35. What is the second biggest value in 5, 12, g? 5 Let d = 2531/2296 - -13/574. What is the second biggest value in -5, d, 1/4, -4? 1/4 Let f = 7/12 + -5/6. Let v = 0.23 - 9.33. Let s = v - -13.1. Which is the smallest value? (a) s (b) 0.05 (c) f c Let u = 0.0473 + -26.0473. Let s = 106 - 79.8. Let q = u + s. What is the third biggest value in -2/7, q, -1? -1 Let w = -31983 + 159914/5. What is the second biggest value in -2, -0.1, 30, w, 17? 17 Let y = 1085.906 - 759.043. Let l = y - 327. Let r = 0.037 + l. Which is the third smallest value? (a) -1/11 (b) r (c) -5/7 (d) 2/9 a Let s = 33.29 + 17.81. Which is the second smallest value? (a) 6 (b) 3 (c) s a Suppose 0 = 3m - 0 + 9. Let w be 480/3796 + (-422)/(-15403). Let g be (-1)/(-4) - 5/10. What is the second smallest value in w, m, g, 0? g Let m(d) = 33d + 18. Let n be m(2). Let j be (-6)/(-18) + (-16)/n. Let r = 32/45 - 10/9. Which is the second biggest value? (a) r (b) 2/15 (c) j b Let i = -5601.8 - -5600. What is the second smallest value in 0.086, -4, i, -0.4, 0? i Let u = -2.964 - 1.036. Let g = 0.18 + 3.32. Let h = g + u. Which is the third smallest value? (a) -6 (b) 1/6 (c) h b Let k = -107731 + 107681. Let w = 2 + -4. Which is the second biggest value? (a) 0 (b) w (c) k b Let v = -14 + -6. Let s = 5523.1 + -5810. Let j = 287 + s. Which is the third biggest value? (a) v (b) 5 (c) j a Let n = -54 + 160/3. Let m = -4983 + 4976.021. Let b = 0.021 - m. What is the biggest value in n, 0.5, b? b Let q = -1199 + 985. What is the second smallest value in q, 3/7, 0.1? 0.1 Let i = 20.43 - 20.4. What is the second smallest value in -2/11, i, -1, 1/6, 0.5? -2/11 Let d(o) = -o2 - 6o + 2. Let m be d(-7). Let n = 2/3043 - 9155/39559. What is the second biggest value in -5/3, n, m, -0.4? -0.4 Let v = -0.4 - -1.4. Let d be (-700)/182 - (-12)/(-78). Let c = -97 - -96.94. What is the fourth biggest value in d, -5, v, c? -5 Let w = 9849 + -9819. What is the biggest value in 6/7, -2, 2, -0.3, w? w Suppose 64s - 5797 = 11501 + 5678. Which is the smallest value? (a) -0.4 (b) -3/4 (c) s b Let q = -4.1 - -0.1. Let h = 157.093 + -157. Let j = h - -0.407. What is the smallest value in q, j, 4/3, -7? -7 Let p be (-1)/((-7)/(-2)) + (-9)/(-56). Let b = -18 - -17.52. Let n = b + 0.08. What is the third smallest value in 0.7, p, n? 0.7 Let w = -62.7 + 62.4. Let h = -24.82 + 25. Let z = h - 0.18. Which is the smallest value? (a) w (b) z (c) -0.1 a Let j = 0.01921 - 0.14921. Let i = 1 + -0.6. Which is the smallest value? (a) i (b) 0.5 (c) 2/7 (d) j d Let v = -58 - -58. Let g = 93338/5 - 3175127/170. Let o = -19/2 - g. What is the third smallest value in 0.5, o, 2/19, v? o Let d(p) = -p. Let j be d(-4). Let m = 8.3 - 8.24. What is the third biggest value in j, 5/2, m? m Let d = -37.15 + 2.15. Let m = d - -32. What is the biggest value in m, 14, 2/5? 14 Let n = -1.09 - -1. Let b = 11 + -7. Suppose bv + 4v = 24. What is the second smallest value in 0.1, n, v? 0.1 Let g be 4 - 0 - 2 - (16 - -397). Let n = g - -19315/47. Which is the second smallest value? (a) 4 (b) -0.8 (c) -5 (d) n b Let j(q) = q2 + 12q - 30. Let z be j(-14). Let x = -5.92 - 0.08. What is the biggest value in 2/9, x, z, 2/7? 2/7 Let g = -25 - -49/2. Let n = 0.27776 + -1.27776. What is the smallest value in n, -4, g, 4? -4 Let w = -4848.9 + 4849. Which is the third smallest value? (a) 1/5 (b) w (c) 6/11 (d) 2/55 a Let o = 7906.82 + -7907. Which is the third biggest value? (a) 0 (b) 5 (c) 0.01 (d) 1 (e) o c Let o be (-143830)/(-20026) - 4/62 - 7. Which is the third smallest value? (a) 1/4 (b) o (c) -10 (d) 9 (e) -3 b Let y = -147 + 245. Let r be y/(-25) + 2/(-25). Which is the third biggest value? (a) -0.08 (b) 1/4 (c) r c Let j = -181122 + 181122.5. Let a be ((-4)/10)/((-1)/(-10)). What is the smallest value in -0.2, a, 1/7, j? a Suppose -4m + 6 = -2. Let y = -712.673 + 713. Let u = y - 0.427. Which is the second smallest value? (a) u (b) m (c) 1 (d) -3 a Let o(g) = g2 - 147g + 3143. Let m be o(26). Let v = -5.542 + -0.058. Let y = v - -5. Which is the biggest value? (a) y (b) 0 (c) m b Let m = -1528 + 1536.43. Let r = m + -8.73. Which is the biggest value? (a) 0 (b) r (c) 2 (d) -14 c Let o = 126.19 + -126.43. What is the third biggest value in o, -2/9, 4? o Let z be 6/(-8)(-28 + (-8 - -24)). Let q = -6 - -6. What is the biggest value in z, 4, -0.4, q? z Let x = 0.4212 + -0.3012. Which is the biggest value? (a) 2/9 (b) -4 (c) x a Suppose -h + 4h + 5l - 6 = 0, 2l = 0. Suppose 5t - 44 = -hu - 118, 0 = -4t - 2u - 60. Which is the second smallest value? (a) 2/5 (b) t (c) 0.7 a Let q be (-2)/7 - 38/14. Suppose 70s = -236 - 44. Which is the smallest value? (a) s (b) q (c) 5/9 a Let q = 8.48 - 4.82. Let p = 10.34 + q. What is the third smallest value in 1, p, -0.3, 1/7? 1 Let i be (-16)/12(-2 - 47/(-22)). Let z = -8 + 5. Let v = 4 + z. Which is the third smallest value? (a) v (b) i (c) 1.1 c Let g = 24 - 20. Let k = 4814.9 + -4815. Which is the second biggest value? (a) -2/7 (b) -0.4 (c) g (d) k d Let j = 3607 + -18038/5. What is the third smallest value in 6/11, j, -52, 2? 6/11 Suppose -2r = -2b - 128 + 24, 5r - 2b = 263. Let h be (-2)/r + 2 + -2. What is the second biggest value in h, -0.4, -0.2? -0.2 Let g = -34387851109/705520 + 3/4938640. Let x = g + 48647. Let i = x + 94. Which is the second smallest value? (a) i (b) 0.3 (c) 6 b Let p = 982 - 982.46. Let w = p - -4.46. What is the second biggest value in -0.1, -5, 0, w? 0 Let q = -6.21 - -7.4. Let o = -0.56 + q. Let z = -0.53 + o. Which is the third biggest value? (a) 1/3 (b) -0.5 (c) z (d) 0.3 c Let t = 632 - 10750/17. What is the second smallest value in -1/51, t, 0.4? -1/51 Suppose 901 = 16t + 1029. What is the second smallest value in 0.2, t, 190? 0.2 Let y = -13293/5 + 2639. Let r = -1024.2 - -1024.6. Which is the third biggest value? (a) r (b) 5 (c) y c Let f = -729 + 736. What is the second biggest value in 37, f, -4? f Let f be (-10)/35 + 3/7. Let j = -47809/3 + 16077. Let i = -140 + j. Which is the biggest value? (a) 8 (b) f (c) i a Let a = -3.421 + 3.4. Let p = -0.121 - a. Let f = 45 - 45.5. What is the second smallest value in 2/5, p, 2/11, f? p Let r = 5058604/1698795 + 2/113253. Let j = 28/9 - r. Suppose -2g = 2*g - 12. Which is the biggest v	{ "pile_set_name": "DM Mathematics" }
What is the closest to -0.2 in f, -1/8, -5/4? -1/8 Let n = -62215 + 62219. Let s = 20 - 39/2. Let b = -0.5 - -0.3. What is the nearest to s in 5, n, b? b Let j = -5859 + 5858. Which is the closest to -2/7? (a) j (b) 39 (c) 0.8 (d) -2/3 d Let t = 17401 + -17396. Which is the closest to 0.1? (a) t (b) -4 (c) -0.9 (d) -7 c Let j = 2.08 - -415.92. Let q = 418.2 - j. Let p = -0.03 + 0.43. What is the closest to q in 5, -2, p? p Let u = -2/354163 - 48519057/225601831. Let x = u + 3/49. Let v be 1-81/6-3. What is the closest to v in 2, x, -0.1? 2 Let f = -6265 + 6265.5. Which is the nearest to 1/4? (a) f (b) 15.2 (c) 1/5 c Suppose 5i = -2c + 614, 4i + 4c - 726 = -230. Let v be (0 - -1) + (17 - i) - -3. Let p = 97 + v. What is the closest to 0.1 in -2/13, p, -0.5? -2/13 Suppose 31t - 103t - 218 - 142 = 0. What is the closest to 0 in -3/16, t, -5/9? -3/16 Let z = -6344 - -6344. Let h = 5 + -2. Let f = 3.2 - h. What is the closest to f in z, 1, -2? z Let r = -23 - -22.9. Let u be (18/(-81)(-3)/(-2))/(-1). Which is the nearest to -1/2? (a) -3/2 (b) u (c) r c Let r = -60 + -19. Let h = r - -82. Let k(x) = x*2 - 6x + 5. Let p be k(5). What is the nearest to p in -1/3, h, -1/10? -1/10 Let p be ((-5)/9)/1-10(-9)/(-300). Which is the nearest to -17? (a) -1/8 (b) -3/2 (c) p (d) -1 b Let k = -188 - -186. Let m = 1.07 - 1.37. Let j = 0.3 - 0.4. Which is the nearest to j? (a) m (b) 0.4 (c) k a Let j = -259 - -309. Let y = j - 55. Which is the nearest to 9? (a) 0.2 (b) y (c) -2/11 a Let b = 330 - 329.9. Let i = -1019 - -1023. What is the nearest to b in 3/2, 63, i? 3/2 Suppose 0 = 5k - 4f - 27, -6f + 7f = -4k + 9. Which is the closest to 2/5? (a) -0.5 (b) 298 (c) k a Let a = 5.303 + -5.603. What is the closest to 0 in 1.15, -1/8, a? -1/8 Suppose 0 = -0y + 3y - 9. Let a = -5.31893 - -2.31893. What is the nearest to 1 in a, y, 1/20? 1/20 Let h be 11/(44/8) - (-1314)/(-392). Let i = h + 5/49. Let z be (-1)/2 + (-22)/(-20). Which is the closest to -0.1? (a) i (b) 2/13 (c) z b Let t be 24/(-6) - (-4 + 15/(-3)). Let p = 6 - 15. Let u = p - -7. Which is the closest to -1? (a) -1/5 (b) t (c) u a Let i = 9136 + -9150. Suppose 0h + 16 = 2h. Let f = -10 + h. Which is the nearest to 2/5? (a) f (b) -0.3 (c) i b Let z = -0.64553 - -0.04553. Which is the nearest to 2/5? (a) -2/23 (b) z (c) 3 a Let j = -82.4 - -71. Let s = j - -11. Suppose -6l = -28l + 110. Which is the closest to 2/7? (a) -4 (b) l (c) s c Let l be ((-4)/42)/(1/3). Let d = -1727 - -1065. Let a = -662.4 - d. What is the closest to l in 5, 0.2, a? a Let t = 15 - 14.948. Let g = -1.948 - t. Let v be 6/30(-2 + 1). Which is the closest to g? (a) 3 (b) -0.1 (c) v c Let u be 2(-3)/(-54)3. Let z = -1.3561 + -4.6439. What is the closest to 0 in -2, u, z? u Let i = -1407.4 - -1403.4. Let w = -3.2 - -3. What is the nearest to i in -9, 5, w? w Let t be 19/76 + 9/(-20). Let q = 79/24 + -21/8. Let p = 7 + -7. Which is the nearest to q? (a) t (b) p (c) 1/3 c Let v(i) = -i - 1. Let r be v(1). Let d be ((-10)/4)/(-5)-1. Let t = -406.6 - -407. Which is the closest to 1? (a) r (b) d (c) t c Let c = 3.37 - -1.83. Let b = 5.1 - c. Let w = -10 - -15. What is the closest to 3 in w, 0, b? w Let k = -22.1 - -23.1. Let s = -0.071 - -0.231. Let x = -0.16 + s. What is the closest to -2 in x, 0.2, k? x Let z(v) = -80v + 275. Let j be z(-8). Let o = -911 + j. Let f be (-2)/9 - 10/(-126). Which is the nearest to o? (a) -3 (b) f (c) 4 c Let u = 5.015 - 5.258. Which is the nearest to u? (a) 0 (b) -2/9 (c) 4/3 (d) -2/23 b Let j = -1 + 5. Suppose 21529 - 21541 = -12v. What is the nearest to 0 in v, j, -1/6? -1/6 Let q = -0.1025 + -448.8975. Let a = -447 - q. What is the closest to -0.2 in 4, -3, a, -2/11? -2/11 Let p = -35.11 - -36.11. Which is the nearest to p? (a) -5 (b) -6/7 (c) -25 b Let b = -1.5 + 0.78. Let g = -0.28 + b. What is the nearest to g in -25, 0.4, -5? 0.4 Let y = 0.16 - -9.84. Let l = 2.8429 + 1.1571. What is the closest to y in -2/3, 5, l? 5 Let y be ((-52)/(-14) + -4)/(8/(-1)). Let s = y - 15/28. What is the nearest to 0.1 in s, -35, 0.5? 0.5 Let t = -31.95 - -28.95. Which is the closest to 4/9? (a) t (b) -2 (c) -3/8 c Suppose -2v - 13 = -t, 3t - v = -1019 + 1018. Let y = -1/133 + -395/532. Which is the nearest to -15? (a) t (b) y (c) 2/5 a Let h = -218.5 - -208. Let r = -9.5 - h. Which is the nearest to 2? (a) r (b) 7 (c) 0 a Let z = 2980 - 2929. What is the closest to 3/11 in 2/7, z, 0.1? 2/7 Let f = -1048 - -5238/5. What is the closest to -0.2 in -0.3, 0.3, f, 0.5? -0.3 Let v = 0 + -0.5. Let s = -2/11455 - 4576/34365. Which is the closest to -3? (a) -0.3 (b) s (c) v (d) -10/11 d Let f = -0.3 - -0.4. Let l = -1827.157 + 1826. Let m = l - -1.257. What is the nearest to m in -0.08, f, -5? f Let w = 5.6937 - -0.3063. What is the closest to 2 in -11.3, w, 0.5? 0.5 Let s be 1/(-31) - (-67200)/(-223200). Let u = -0.7 - -1. What is the closest to 0 in u, s, 2/55, 4? 2/55 Let a = -156 - -68. Let d = 87.87 + 5.13. Let m = d + a. What is the nearest to -2/3 in m, -0.4, -1? -0.4 Let r = -31.6 - -31.2. Which is the nearest to 1? (a) -18/11 (b) r (c) -12 b Let k = 220 + -619. Let l = k - -396. Which is the closest to 2? (a) -2/9 (b) 0.2 (c) l b Let s be (-15)/(-10) + (-22)/4. Let x be s/(-10) + (-34)/85. Let l = -4.1 + 3.9. What is the nearest to x in l, 3/5, 2? l Suppose 38i - 41i = -40i - 20128. Which is the closest to -0.2? (a) 0 (b) i (c) -2/3 a Let j = -2905 - -11619/4. Which is the closest to -6? (a) j (b) -4 (c) -1/5 b Suppose 1632 = -64p + 608. What is the closest to -1 in p, -22/7, 3? -22/7 Let j be (138/(-27))/(21/42) + 10. What is the closest to 1 in j, -0.7, 8/9, 0.02? 8/9 Let d = 41/135 - 11/135. What is the closest to 12 in 0.5, -5, d, 5/3? 5/3 Let f be (-21)/(7/((-231)/(-22))). What is the closest to 18 in -2/9, 5, -12, f? 5 Let i be 3/((-8)/(-8)(-24)/32). Which is the closest to 0? (a) -3 (b) i (c) 72 (d) 2/11 d Suppose -4f = 20, -4x = -4f + 1 - 9. Let y = -30 + 31. Let r = -84/19 - -401/95. Which is the closest to 2? (a) y (b) x (c) r a Let j = -17156 - -17208. What is the nearest to 0.05 in 1, -5, 4, j? 1 Let m = -6216.3 - -6674. Let v = -459 + m. Which is the closest to 1? (a) 3 (b) v (c) -6 a Let y = 93.6 + -97. Let j = y + 20.4. Let q = j + -18. Which is the closest to -0.1? (a) -4 (b) q (c) 0 c Let p be -8 - (1 - 420/36). Suppose 2g = 29 + 13. Let d = 20 - g. Which is the nearest to p? (a) 4 (b) d (c) 3 c Let i = -0.11368 + 0.11368. What is the nearest to i in -5, -11, -2/71? -2/71 Let w = -31/75 - -2/25. Let o = -2730 + 2732. Which is the closest to -15? (a) -1/5 (b) w (c) o b Let v = 288111.9909 + -288124. Let s = v + 0.0091. Let p be 4/(-14) - 8/21. What is the closest to 0 in p, 2, s? p Let x = -4.97 - -4.87. Let k = -72.82 + 72. Let u = k - 0.18. What is the closest to u in 2, x, -6? x Let r = -6.7221 - 0.2779. Which is the closest to r? (a) 0 (b) -2 (c) -1.1 (d) -5 d Let x(n) = -72n + 221. Let y be x(3). Let l be (3/(-4))/((-9)/(-8)). Which is the closest to 1? (a) y (b) -0.1 (c) l b Let j = -0.18 + 4.18. Let w(l) = l*3 + 3l*2 + 4l + 2. Let c be w(0). What is the nearest to -0.1 in j, c, -0.15? -0.15 Let o = 7434 + -7149.05. Let y = o + -285. What is the nearest to 2/5 in -2, y, 0, 2/3? 2/3 Let h = -3.6603 + -0.2397. What is the nearest to -18 in -2, h, 0.1? h Let f = -8 - -4. Let v = 100852 - 100852. Which is the closest to v? (a) f (b) 2/33 (c) 0.7 b Let l = 237.344 + -0.344. Let p = -242 + l. Which is the closest to -1? (a) 4 (b) -4/11 (c) p b Let u = -769 - -761. What is the closest to 0.1 in -0.5, u, 3/26? 3/26 Let o(u) = u*3 + 26u*2 - 21u - 1151. Let n be o(-25). Which is the nearest to n? (a) 0.3353 (b) 1/6 (c) -4/5 c Let f = 3004 - 3004. Which is the closest to 0.91? (a) 0.3 (b) -0.3 (c) f a Let n = -3.1 - -1.5. Let i = 2 + n. Suppose -1418a = -1484a. What is the closest to a in -13, 0, i? 0 Let k = 109/54 + -95/27. What is the nearest to -397 in k, -0.5, 3/2? k Let m = -10945/19068 - -7/2724. What is the closest to -5 in m, -53, 5, -1/2? m Let t = -15.65 - -14.65. What is the closest to 1 in t, 10, 5, 0.5? 0.5 Let u = 3.8	{ "pile_set_name": "DM Mathematics" }
s the first derivative of 6j3 - 1275060j*2 + j - 198667796? 18j*2 - 2550120j + 1 What is the third derivative of -8691qs*2x*3 - 31qs2 + 756qx3 - 3760s*2x*2 + 44x*2 wrt x? -52146qs2 + 4536q Find the second derivative of -232l2m*2 - 4l*2m - 1348l2 - 908lm2 + 7m*2 + 50 wrt l. -464m*2 - 8m - 2696 Find the second derivative of -30733670h2k*2 - 4873h*2k + 1641hk wrt k. -61467340h2 Find the first derivative of 2389746d*4 - 6d*2w*3 + 41593w*3 + 329 wrt d. 9558984d*3 - 12dw3 What is the third derivative of -179074495q4 + q3 - 19q2 - 8q + 1290? -4297787880q + 6 Find the second derivative of -6294277b*3 + 293998b - 5. -37765662b What is the second derivative of -354d*4h - 190917d4 + 58dh + 6048h + 1 wrt d? -4248d2h - 2291004d2 Differentiate -6n*4 - 517449n*3 - 11749287 wrt n. -24n*3 - 1552347n*2 Differentiate -846v*2 + 1497v + 8481313. -1692v + 1497 What is the first derivative of -5559571h*3u*2 - hu2 - u2 + 1790645u + 3 wrt h? -16678713h*2u2 - u2 Find the second derivative of -158705g5 - 88g*2 + g + 28274693 wrt g. -3174100g*3 - 176 Find the first derivative of -5h*4 - 7680h*2 + 15h - 3702753 wrt h. -20h3 - 15360h + 15 What is the third derivative of 50160x5 + 20x*4 + 13x*3 + 2x*2 + 16x + 949026 wrt x? 3009600x2 + 480x + 78 Find the second derivative of -6465359p2 + 2261832p wrt p. -12930718 Differentiate -25l4 - 22l*3 - 3l*2 + 12l - 51107. -100l3 - 66l*2 - 6l + 12 What is the second derivative of -a*3v2 + a3v + a3 - 246a*2 + 1473258av3 + 2av2 - av - 102v + 2 wrt v? -2a*3 + 8839548av + 4a Find the third derivative of 368939221o6 - 335040835o*2. 44272706520o*3 Differentiate -4u*3 - 502918u*2 + 2u + 33661825 wrt u. -12u2 - 1005836u + 2 Find the second derivative of 55639101oq*2 + 51oq + 57099o - 2q wrt q. 111278202o Find the second derivative of -5199737o3 + 5866916o. -31198422o What is the derivative of -3403242f*4 + 6515373 wrt f? -13612968f*3 Find the third derivative of 9723005x*3 + 845402x*2 - x wrt x. 58338030 Find the third derivative of -14754578q*3 - 4371859q*2. -88527468 What is the third derivative of 1237b*5 + 1264b*4r*2 + 46b*2r*2 - 4b*2r + 10b2 + 2br + 287r*2 wrt b? 74220b*2 + 30336br2 What is the second derivative of 36907x*3 + 63x*2 + 8618x - 314 wrt x? 221442x + 126 Find the second derivative of -946497m*3 + 27m - 8954. -5678982m Find the second derivative of -92s*2v*2 + 305s*2 + 21sv2 - 2581sv + 184v*2 + 2v wrt v. -184s2 + 42s + 368 Find the third derivative of 7h4 - 1409288h*3 - 7h*2 + 71229945. 168h - 8455728 Find the third derivative of 2115k5 - 339k*4 + 8447884k*2 wrt k. 126900k*2 - 8136k Differentiate -4a2t*2 + 230441798a*2 + 18464593t*2 with respect to t. -8a*2t + 36929186t Find the second derivative of 510j5 - j4 - 19797j2 - 2j - 4864910. 10200j3 - 12j*2 - 39594 What is the second derivative of 5f*4 - 8205f*3 - 67f*2 + 1477917508f? 60f2 - 49230f - 134 Find the second derivative of -51003696k2 + 172421020k. -102007392 What is the third derivative of -4168h3y*3 + 17h*3y + 5h3 + 2h*2y*2 + 3h*2 + 566hy3 + 8594hy + 2y*3 + 2y*2 wrt y? -25008h*3 + 3396h + 12 What is the third derivative of 138804936q4 - 57536637q*2 - 1 wrt q? 3331318464q Differentiate 4615s4 - 4587s*3 - 46212718 with respect to s. 18460s*3 - 13761s*2 What is the second derivative of -597951854q*3 - 875251761q? -3587711124q What is the first derivative of 3790283f - 11855644? 3790283 Find the third derivative of -8z5 - 3952793z*4 - 2z*3 + 157113z*2 + 226z. -480z2 - 94867032z - 12 What is the second derivative of -151490334w2 + 6553w - 319? -302980668 What is the derivative of -752728q3z*2 - 37q*3z - 41356922q3 wrt z? -1505456q*3z - 37q3 Differentiate -986025k*2 - 3k - 11517788 with respect to k. -1972050k - 3 What is the second derivative of 73407n*3 + 40n*2 - 122814353n? 440442n + 80 Find the second derivative of 599n*3 - 313073n*2 - 3n - 89039610 wrt n. 3594n - 626146 Differentiate 24234777a + 6645179 wrt a. 24234777 What is the derivative of 92v2 - 252691v - 15383786? 184v - 252691 Find the second derivative of 376w*3 - 17634w*2 + 277w - 73920 wrt w. 2256w - 35268 Differentiate -37812214g + 65871880 with respect to g. -37812214 What is the first derivative of 122786974y2 + 5y - 942997187? 245573948y + 5 What is the third derivative of 198233495h*3 + 7h*2 - 6h + 103950? 1189400970 What is the first derivative of 141958348h + 35166361? 141958348 What is the third derivative of c5 - 400685813c*3 + 1345c*2 - 49157? 60c*2 - 2404114878 What is the second derivative of 669n*4 + 2n*3 + 5797n*2 + 246n + 11832? 8028n2 + 12n + 11594 Find the first derivative of 92653373q3 - 158234794 wrt q. 277960119q*2 Find the third derivative of -21i*5 + 761i*4 + 120i*3 - 40i*2 - 1819567i wrt i. -1260i2 + 18264i + 720 Differentiate 36252385z + 7772147 wrt z. 36252385 What is the second derivative of 11f*5 + 2f*3 + 585955f*2 - 118416131f? 220f3 + 12f + 1171910 Differentiate 21i2w*2 - 719184i*2w + 4i2 - 30i + w*2 + 7574 with respect to w. 42i*2w - 719184i2 + 2w What is the derivative of -d*4 + 25313199d - 224877733? -4d3 + 25313199 Find the third derivative of a5 + 32a*4 + 18567a*3 + 3532513a*2 wrt a. 60a*2 + 768a + 111402 Find the third derivative of 6077836o3 - 890436o*2 wrt o. 36467016 Find the third derivative of -70op3 - 8op2 - 2op - 16o + 1592008p3 + 2p*2 + 12p - 28914 wrt p. -420o + 9552048 Find the first derivative of 4826863fq + 114971311f + 31q wrt q. 4826863f + 31 Differentiate -38229066y4 - 11381868 with respect to y. -152916264y*3 Find the third derivative of -4hv3 + 7344369hv2 - 156587v*3 wrt v. -24h - 939522 Find the second derivative of -29873940p2 - 32452p + 609. -59747880 What is the derivative of -432371596z - 488476259? -432371596 What is the derivative of 67862154n*4 - 119635605 wrt n? 271448616n*3 What is the first derivative of 24hi2 - 29929417h - 1355177i wrt i? 48hi - 1355177 What is the second derivative of 17v*3w + 127178v3 + 23v*2w - 54v + 978w + 65 wrt v? 102vw + 763068v + 46w Differentiate 2r2 + 14450935r + 56617438. 4r + 14450935 Find the second derivative of 30890924p*3 + 33661350p. 185345544p Differentiate 123k*3 + 118201k + 6185258. 369k2 + 118201 What is the first derivative of -m2w + 15421416m2 + 6mw2 + 104070w2 wrt w? -m2 + 12mw + 208140w What is the second derivative of 525h*3s*3 + 4h*3s - 3h3 + 38752h*2s*3 - 77h*2s + 194h2 - h - 2s wrt s? 3150h3s + 232512h2s What is the third derivative of 370476j3o - 31j3 - 6j*2o - j*2 - 5jo + 3785o - 2 wrt j? 2222856o - 186 Find the second derivative of 2d*2p*3 + 12664d*2p*2 - 3d*2p + 3d2 - 3dp2 - 2d + 327p3 - 123p wrt d. 4p3 + 25328p*2 - 6p + 6 Find the first derivative of -416a3q - 3424a2q*2 + 5q*2 - 23588q + 569 wrt a. -1248a2q - 6848aq*2 Find the third derivative of -3809z5 - z4 - 5775z3 + 92575169z*2. -228540z*2 - 24z - 34650 What is the third derivative of -25704812x3 + 37953103x2 wrt x? -154228872 Differentiate l3 + 847566l - 50438408 wrt l. 3l*2 + 847566 What is the third derivative of 77107400y*3 + 178099y*2 + 145y? 462644400 What is the third derivative of 77195u5 - 5u*4 - 4357722u*2 wrt u? 4631700u*2 - 120u Find the second derivative of -56251218i2 - 33221661i. -112502436 What is the derivative of -5986635w3 - 5283029 wrt w? -17959905w*2 Find the first derivative of 975u*4 + 16u3 - u2 + 24u + 35539102. 3900u*3 + 48u*2 - 2u + 24 What is the second derivative of 25703o5 - 17o*4r - 1659or - 6r + 76 wrt o? 514060o*3 - 204o*2r Find the first derivative of 2no*2 - 2810n*	{ "pile_set_name": "DM Mathematics" }
5z + 3z + 1547z3 + 0z - 8z. 1547z*3 Collect the terms in -2y*3 - 18y*2 + 2y*3 - 5y*3 + 17y*3. 12y*3 - 18y*2 Collect the terms in -31 + 1242c - 2479c + 1235c. -2c - 31 Collect the terms in -55g*3 - 69g*3 + 184g*3 - 61g3. -g3 Collect the terms in d3 - d3 + d3 - 266 - 88 - 403. d3 - 757 Collect the terms in -54y + 9 + 28y - 4 + 27y. y + 5 Collect the terms in 2s + 69 - 7s + 44 - 113. -5s Collect the terms in -855b3 + 1706b*3 - 870b*3. -19b*3 Collect the terms in 31a*2 + 20a*2 - 112a*2 + 31a*2. -30a*2 Collect the terms in 3x + 28 + 24 + 27 - 104 + 25. 3x Collect the terms in 45 + 80f*3 - 96 - 5f*3 + 51. 75f*3 Collect the terms in -3 + 3 - 221v*2 + 431v*2 - 216v*2. -6v*2 Collect the terms in 124v + 125 + 129v + 125v - 380v. -2v + 125 Collect the terms in 61i3 - 311i*3 + 71i*3 + 67i*3 + 61i*3 + 57i*3. 6i*3 Collect the terms in -62 + 25 + 37 + 15p. 15p Collect the terms in -78 - 47h*2 + 575 + 49h*2. 2h*2 + 497 Collect the terms in -64f*3 + 107f*3 - 34f*3. 9f*3 Collect the terms in -392u + 89u + 265u. -38u Collect the terms in 105z - 18z - 188z - 11z2 + 103z. -11z2 + 2z Collect the terms in -2131u2 - 2077u*2 + 4290u*2. 82u*2 Collect the terms in -15r - 5r - 5r + 3r. -22r Collect the terms in 12w2 - 70w - 17w2 - 7w*2 + 99w - 29w. -12w*2 Collect the terms in -186j*3 + 4j - 4j - 184j*3 + 368j*3. -2j*3 Collect the terms in 130f*2 - 19f + 19f + 430f*2. 560f*2 Collect the terms in 133 - 2d + 197 + 36 + 140. -2d + 506 Collect the terms in -49c + 4c + 18c + 18c. -9c Collect the terms in -2g2 - 12 - 126g + 40 - 14 - 14. -2g2 - 126g Collect the terms in -1043t + 3t*2 - 3t*2 + 901t - 2t3. -2t*3 - 142t Collect the terms in -2 - 7 + 2 + 833d + 7 - 846d. -13d Collect the terms in -266k*3 + 136k*3 + 6k*2 + 132k*3 - 23k*2. 2k*3 - 17k*2 Collect the terms in 98b*2 + 58b*2 + 28b*2 - 26b*2. 158b*2 Collect the terms in 3s*3 + 158383s - 5s3 - 158040s. -2s3 + 343s Collect the terms in 39885b - 79780b + 39897b. 2b Collect the terms in -2096z2 + 1414z*2 + 688z*2. 6z*2 Collect the terms in -1 + 277925v*3 + 290413v*3 + 1. 568338v*3 Collect the terms in 38s*3 + 25s*3 - 113s*3 + 43s*3. -7s*3 Collect the terms in 5715r + 5721r - 11436r + 7r3 - 18r*2 + 18r*2. 7r*3 Collect the terms in -54m*2 - 40m*2 + 91m*2 - 4m - 3m + 7m. -3m2 Collect the terms in -224362j*2 - 6j + 6j + 224366j*2. 4j*2 Collect the terms in -10x - 17 + 17 - 117x. -127x Collect the terms in -11m - 11m + 15m - 4m + 10m - m. -2m Collect the terms in 5 - 5 + 0 - 2y3 + 578y*2. -2y*3 + 578y*2 Collect the terms in -13 - 14k*3 + 14 + 4 - 5. -14k*3 Collect the terms in 1403r*2 - 1046r*2 + 1563r*2. 1920r*2 Collect the terms in 733271 - 2d2 - 733271 - d2. -3d2 Collect the terms in 23 + 2m + 6m - 4m - 3m + 3. m + 26 Collect the terms in -254 + 775 - 2r - 260 - 261. -2r Collect the terms in 313t - 941t + 315t + 310t. -3t Collect the terms in 806c - 270c - 284c - 269c. -17c Collect the terms in -67419d*2 + 43619d*2 - 139734d*2. -163534d*2 Collect the terms in 15l - 92l + 18l + 63l. 4l Collect the terms in -899p2 + 404p*2 + 495p*2 + 16p*3. 16p*3 Collect the terms in -32x - 25599 - 69x + 25599. -101x Collect the terms in 15 - 9 - m - 4m + 17m. 12m + 6 Collect the terms in -108y*2 + 108y2 + 1857 - y3 - 1857. -y*3 Collect the terms in -3d*2 + 420d + 168d + 2d*2 + 587d - 1. -d*2 + 1175d - 1 Collect the terms in 1111r + 1347r + 1282r. 3740r Collect the terms in -28b2 + 91b*2 - 22b*2 - 2 + 2 - 44b*2. -3b2 Collect the terms in m3 - 136691880 + 136691880. m*3 Collect the terms in 93842d*3 + 93875d*3 + 93856d*3 - 281637d*3. -64d*3 Collect the terms in 1 + 63r + 170r - 416r. -183r + 1 Collect the terms in -38w + 15w - 2w*2 - 22w. -2w2 - 45w Collect the terms in -235n2 - 2102195 + 2102195. -235n*2 Collect the terms in 30v*2 - 564 + 566 + 77v*2. 107v*2 + 2 Collect the terms in -184m*3 + 15m + 188m3 - 15m. 4m3 Collect the terms in -2685c + 91 + 88 - 179. -2685c Collect the terms in 5 + 4 - 279i*2 + 4 - 13. -279i*2 Collect the terms in 958x + 39 - 39. 958x Collect the terms in -76z - 108z + 174z. -10z Collect the terms in 2m - 19 - 25 - 19. 2m - 63 Collect the terms in -114t - 112t - 121t - 116t + 459t. -4t Collect the terms in 6t*2 - 6396t*3 + 6458t*3 - 6t*2. 62t*3 Collect the terms in 0z*2 - 5z*3 + 735z + 33z3 + 0z*2 - 735z. 28z3 Collect the terms in 1343l*2 + 1305l*2 - 2648l*2 - 4l*3. -4l*3 Collect the terms in -2642a*3 - 6277a*3 + 2375a*3. -6544a*3 Collect the terms in -1084 - 122075c + 1084. -122075c Collect the terms in 2p*2 - 5891 + 5885 - 3p2. -p2 - 6 Collect the terms in -10s3 + 2s*2 - 17209s - 5s2 + 17209s - s*3. -11s*3 - 3s*2 Collect the terms in -1490y - 1065y - 1501y. -4056y Collect the terms in 281840m*2 + 281834m*2 - 353m - 563671m2 + 353m. 3m2 Collect the terms in 2 - 32n*3 - 2 + 1042n*3. 1010n*3 Collect the terms in -11u - 7 + 13u + 7 - 23u*2. -23u*2 + 2u Collect the terms in 3039c3 + 1883c*3 - 4941c*3. -19c*3 Collect the terms in 28293b*2 - 1 - 27885b*2 + 2. 408b*2 + 1 Collect the terms in 1 - 276t*2 - 71t*2 + 1920t*2 - 1. 1573t*2 Collect the terms in -37o*2 - 99 + 8o*2 + 99 + 8o*2. -21o*2 Collect the terms in 114 + 0c - 25c - 30 - 84. -25c Collect the terms in 24l3 - 36l*3 + 5 + 13 + 8 - 26. -12l*3 Collect the terms in -65q*3 - 1 - 11q*3 - 58q3 - q2 + 0. -134q3 - q2 - 1 Collect the terms in -386501s - 386491s + 1159495s - 386500s. 3s Collect the terms in 0u - 86 + 471u*3 + 0u - 473u3 + 17. -2u*3 - 69 Collect the terms in -5616 + 5616 - 990x*3. -990x*3 Collect the terms in -2466r*2 - 2472r*2 - 2473r*2 - 2476r*2 + 9885r*2. -2r*2 Collect the terms in -56o + 57o - 8 + 15. o + 7 Collect the terms in 1861 - 6t*2 - t - 1861 + t. -6t*2 Collect the terms in 51 - 22 + 14k*2 - 12 - 17 + 11k. 14k2 + 11k Collect the terms in 31s3 + 291s*3 + 116s*3 + 6 - 24s*3. 414s*3 + 6 Collect the terms in 74l*3 + 389l*3 - 2l + 8l - 1 - 6l. 463l3 - 1 Collect the terms in 48z - 13z - z - 8z - 44z. -18z Collect the terms in 237235 - 237235 - 79t. -79t Collect the terms in 256r3 + 46r + 0r2 - 250r*3 - 45r + 0r2. 6r*3 + r Collect the terms in 163u*2 + 9u - 343u2 + 147u*2 - 9u. -33u2 Collect the terms in 127r + 141r - 263r. 5r Collect the terms in 8t + 3t - 22t + 7t - 2529 + 2t. -2t - 2529 Collect the terms in 121625734a*3 - 22 - 121625732a*3 + 47 - 25. 2a*3 Collect the terms in 24880t*2 + 6 - 6 - 49761t*2 + 3t*3 + 24881t*2. 3t*3 Collect the terms in -90u - 329u - 203u. -622u Collect the terms in -4 + 23r*2 + 15r*2 + 3 + 2. 38r*2 + 1 Collect the terms in -13 + 7 + 2038x*2 - 12 + 0. 2038x*2 - 18 Collect the terms in -7o + 32o + 22o. 47o Collect the terms in 12154 + 4612q - 12154. 4612q Collect the terms in -5 + 1 - 64r + 11r. -53r - 4 Collect the terms in 29446n3 + 57714n*3 - 21740n*3. 65420n*3 Collect the terms in -2 + 75112751d + 2 - 75112736d. 15d Collect the terms in -147737 - 63b + 147737. -63b Collect the terms in 519u - 250u - 274u - 9u*2 - 17u*2. -26u*2 - 5u Collect the terms in 8y2 + 83 + 78 - 31y*2 - 161. -23y*2 Collect the terms in -471p*2 + 137p*2 + 169p*2 + 162p*2. -3p*2 Collect the terms in -2w*2 + 1106661 - 1106661. -2w*2 Collect the terms in 2 - 3 + 26n*2 + 34n*2 + 17n*2 - 4n*2. 73n*2 - 1 Collect the terms in -2w + 4194w2 + 1225w*2 + 2668w*2 + 1328w*2. 9415w*2 - 2w Collect the terms in 49g + 29g - 140g + 45g + 37g. 20g Collect the terms in 16 + 100r + 96r + 24 - 194r. 2r + 40 Collect the terms in -26355x + 52718x + 2x2 + 4x*2 - 5x*2 - 26363x. x*2 Collect the terms in 3886k	{ "pile_set_name": "DM Mathematics" }
= 15 for c. -3 Suppose -4u + 202 = -5f + 2f, 2u - 98 = 3f. Solve 21 = 45l - ul for l. -3 Let k(r) = -r + 5. Let y be k(-6). Let u be (-196)/(-16) - (2 - (-22)/(-8)). Let x = u - y. Solve xj + j + 6 = 0 for j. -2 Let t be 18/(-1)4/8-1. Let s = -2 + 4. Solve -5a + t = -sa for a. 3 Let i(x) = 7x3 + 2x*2 + 9x - 10. Let v be i(1). Solve vt = 13t - 15 for t. 3 Suppose -2h = -5x + 4 - 0, -2h + x = -4. Suppose 2p + 8 = 2. Let i be -3 - (27/(-3) - p). Solve hv = 4v - i for v. 3 Let l be (-20)/(-6)((-32)/(-10) - 2). Suppose ls + 0s = 0. Solve 5k + s = -10 for k. -2 Let t = 227 + -223. Solve 0 = tm - 5m for m. 0 Let v be -1 + 0 - (-6 + -3 + 5). Solve vz - 4 = -16 for z. -4 Let h = -180 - -183. Solve -hj + 8j + 10 = 0 for j. -2 Let y = -9 - -14. Suppose -2a = -ya. Suppose -4 = -ah - h. Solve -g + 1 = -h for g. 5 Let q = 2408 - 2401. Solve -qc = -11c for c. 0 Suppose 2i = -3o + 6i + 17, -2o - 4i = 2. Suppose 3z - 43 = -5w, -3z + z - o = -3w. Solve z = -4x - 2 for x. -2 Suppose 9i + 144 = 13i. Suppose -4c = -4g - 24, -5g + 2g - i = -5c. Let v = -5 + c. Solve -vx - x = 0 for x. 0 Let a = -96 - -116. Suppose -5v + v = -a. Suppose 0 = -4n + q + 13, 5q + 0 = 4n - 1. Solve -7 = nb + v for b. -3 Let g = 1 - -3. Let c be ((-2)/g)/((-4)/32). Suppose 5w = 2v + 20, 0 = 2w - w - c. Solve f = -vf - 4 for f. -4 Let a be 8/(-36) - (-75)/(-27). Let u be -3a/925. Solve -u = -0g - 5g for g. 5 Let f(z) = -z3 - 61z*2 - 60z + 125. Let x be f(-60). Solve -14n - 11n - x = 0 for n. -5 Let d = 35 - 34. Suppose j = -7j. Solve x - d = -j for x. 1 Let s = -32 - -31. Let q be 0/(-1)s/(-5 + 7). Let j = 3 - 1. Solve 2 = -jp - q for p. -1 Let u be 24/15 - 8/(-20). Let n = u + -7. Let d = 13 + n. Solve -20 + d = 3w for w. -4 Let a = 10 - 6. Suppose 5m = am + 3. Suppose 0 = -2i + 1 + m. Solve -i = 3p - 5 for p. 1 Let c(u) be the third derivative of 2u4/3 + 2u*3/3 + 3u*2. Let m be c(2). Let i be 24/56 + m/14. Solve -8 = ix - 5 for x. -1 Let z = 231 - 343. Let a be (-2)/(-7) - 80/z. Solve 4d - a = 3 for d. 1 Let b be 5/26/5. Let s(h) = -h*2 - 154h + 967. Let k be s(6). Solve -bg = k - 4 for g. -1 Suppose 5j = -j + 12. Solve 4 = -jv - 2v for v. -1 Let n = -535 - -535. Solve t - 4t + 6 = n for t. 2 Suppose -2j + 7 = 2r + 3, 11 = r - 2j. Solve 41 = rc + 16 for c. 5 Let d be 32 + (-2)/2. Suppose -61o - 470 = -108o. Solve -di - o = -0 for i. -2 Suppose -t + 4a = -3t + 10, 0 = 4t - a - 29. Let j = t + 1. Let c(u) = -3u + 56. Let s be c(17). Solve sr + j = r for r. -2 Let j = -1050 + 1064. Solve -2 = -13x + jx for x. -2 Let w be -6-14(-8)/(-96). Let d be 2 - (1 + (-3)/3). Let a be (1 - d - -2) + 1. Solve -g = a - w for g. 5 Let x(h) = h*3 - 7h*2 + 8h - 4. Let a be x(6). Suppose -at - 10 = -13t. Solve z = -tz for z. 0 Let u(a) = a + 14. Let h be u(-14). Suppose 0 = -4l - 4, -2p + hl + 2l = -18. Solve 3k = 7 + p for k. 5 Suppose -2q - 17 = -4x + 51, 4x - 76 = 4q. Suppose -r = -4r. Let u = x - r. Solve 0t + 3t = -u for t. -5 Let h(o) = -o3 + 7o*2 + 11o - 17. Let q = -28 + 52. Suppose -5m = -2m - q. Let w be h(m). Solve -5i + w = 2 for i. 1 Let d(a) = -a + 1. Let i = 15 + -11. Suppose if - 5f + 1 = 0. Let b be d(f). Solve 4n = -bn + 20 for n. 5 Suppose -3 - 2 = -g. Suppose 2z + 2z = 2n - 24, -gn + 5z = -50. Let a = -4 + n. Solve -ad = -d for d. 0 Suppose -7b + 12 = -4b. Suppose 4y - b - 12 = 0. Let r(m) = m*3 + 22m*2 - 23m + 2. Let p be r(-23). Solve -pa = -3a + y for a. 4 Let z(i) = -i*3 - 14i*2 + 29i - 42. Let x be z(-16). Solve 10 + 8 = xt for t. 3 Suppose -6z = -11z. Let x be 22/(-33)90/(-4). Solve -5v + 2v + x = z for v. 5 Let p(j) = 4j2 + j - 1. Let w be -1 + 4 - (-1 - -4). Suppose w + 2 = 2s. Let a be p(s). Solve -k - k + a = 0 for k. 2 Suppose -3x - 3u + 27 = 0, x - u - 57 = -4x. Solve -2 = 3g - x for g. 3 Suppose 0 = -k + 5i + 5, k - 2k = 3i - 5. Let b be 3/(9/(-6)) - -1k. Solve 0 = y + b for y. -3 Let n be 0 - (1 + 40/(-8)). Solve -nh + 15 = -1 for h. 4 Suppose -5l - y - 61 = 11, 3y + 6 = 0. Let g(c) = -c2 - 16c - 24. Let s be g(l). Solve a = -sa for a. 0 Suppose 0 = -8b + 6b + 8. Let f be (-300)/(-21) + b/(-14). Let g = f - 7. Solve 0 = 5z + g - 2 for z. -1 Suppose 3m - 3j = 0, j - 6 = -4m + 3m. Suppose mf - 2b + 10 = f, -2b + 10 = 5f. Solve f = 3w - 0w - 3 for w. 1 Suppose y + 1 = -1. Let m = 0 - y. Suppose 5u + 4o = -18 + 57, -u + mo + 5 = 0. Solve -1 = -2z - u for z. -3 Let k(m) = m*3 + 12m*2 + m + 32. Let f be k(-12). Solve fa - 4 = 18a for a. 2 Let i(m) = m2 + m + 1. Suppose -4v = -2 + 10. Let h be i(v). Let c be ((-2)/1 + h)3. Solve 3 = co - 0o for o. 1 Let n(g) = g2 + 27g + 29. Let y be n(-26). Solve yz + 20 = 7z for z. 5 Suppose -3 = -3h + l + 14, -2h = 5l. Suppose 0 = hs - 2s - 9. Solve 3c - s = 4c for c. -3 Suppose 0 = 3j + 4u - 114, 0 = -5j - 37u + 38u + 190. Solve -j = 7b - 10 for b. -4 Suppose 4q + 8 = 0, 4x + 5q - 2 = x. Let d be 105/x + (-6)/24. Let t = -22 + d. Solve 0 = -i - ti for i. 0 Let x(r) = -r - 8. Suppose -5 = -5h, -3h = 4a - 4h + 41. Let t be x(a). Suppose -g + 5f = -19, -4g = -0g - tf - 22. Solve 0c = -gc - 12 for c. -3 Let x(a) = 18 - a - 32 + 19. Let y be x(-5). Solve -q - q = -y for q. 5 Suppose 2n + s = 2s + 17, 4s = 5n - 44. Let m(l) = -l3 + 9l*2 - 8l + 8. Let r be m(n). Let j be (-6)/(-4) - (-4)/r. Solve jd + d = -9 for d. -3 Let s(a) be the first derivative of a5/120 - a4/24 - 5a*3/3 - 4. Let q(t) be the third derivative of s(t). Let p be q(7). Solve -6 - p = 3g for g. -4 Let c be -9 - -936/6. Solve 0 = -52d + cd + 14 for d. 2 Suppose 17 + 37 = 3v. Suppose -2h + v = 4t - 7h, 5h = -t - 8. Solve 0 = -0d - td + 8 for d. 4 Let r(o) = 3o3 - 5o*2 + 7o - 6. Let t be r(4). Let c be t/10 + ((-17)/5 - -3). Solve 4b = c - 1 for b. 3 Let z(k) = k3 - 14k*2 + 13k + 3. Let u be z(13). Let i be 2/u - (-2)/(-3). Suppose 8 = 5g - 2. Solve -v = -iv - g for v. 2 Suppose 4 = -3t + 2u, -5t = -3u + 24 - 19. Solve -tf - 2f = -4 for f. 1 Suppose -y = 18t - 16t - 17, 4y - 74 = -2t. Solve -24r + yr + 15 = 0 for r. 3 Suppose -123m - 20 = -128m. Solve mc = 2c - 0c for c. 0 Suppose -246 + 234 = -2b. Solve 71t - 65t - b = 0 for t. 1 Let q(h) = -h*3 + 65h*2 - 302h + 126. Let s be q(60). Suppose 2 + 18 = a. Solve sz = 2z - a for z. -5 Let o = 18 + -13. Let u = 3 + o. Solve 10l + u = 12l for l. 4 Let k be 2/(-8) + 3/(-4) - -3. Solve kf - 22 + 14 = 0 for f. 4 Let q(r) = -r2 + 17r + 37. Let g be q(18). Solve -16 = -gv + 23v for v. -4 Suppose 2 = 2r - 4a, -8a + 3a + 35 = 5r. Let y = 1 + -1. Suppose -r = -h, yq - h = -q - 5. Solve qf = f + 4 for f. -4 Let a = 11 - 8. Suppose -2b + 2 = -4t - 20, ab - t - 13 = 0. Let g be (-17 - -27)(-3)/(-15). Solve -g = -bj + 1 for j. 1 Let x be (-4 - -10) + 5/(-10)0. Solve 14f = 12f - x for f. -3 Let a be ((-34)/(-8))/(6/(-24)). Let g = -9 - a. Solve 0 = -3x - g + 20 for x. 4 Suppose 0 = -79p - 2p + 2268. Solve -p + 8 = 10r for r. -2 Suppose 102w + 92 = 106w. Solve w = 5g + 3 for g. 4 Suppose 8 - 28 = -5w. Suppose 14 = wa + 2z, -a = 4a + 2z - 16. Let i be 20/8 - a/4. Solve it = -2t - 20 for t. -5 Let o(r) = 3r*2 + 17r - 19. Let a(s) = -2s2 - 16s + 18. Let l(y) = 4a(y) + 3o(y). Let k be l(12). Solve 5u + k = 28 for u. 5 Let m = 439 + -436. Solve -ma + 10a = 3a for a. 0 Let h = -37 - -41. Suppose 4v - 4 = -2s, -4v = hs + s - 4. Solve s = -4p - 2 - 6 for p. -2 Let l be (12(-14)/(-56))/((-1)/(-11)). Let g be (60/(-14))/(2/14). Let h = g + l. Solve 0 = c + 2 - h for c. 1 Let z(s) = s3 - s2 - s + 5. Let t be z(0). Suppose tw + 6 = 4u, 0u - w = u - 6. Solve -uq + q = 0 for q. 0 Suppose 331s + 64 = 335s. Solve -5d = 9 + s for d. -5 Let y(r) = 16r3 + r2 + 2r + 2. Let g be y(-1). Let w be 0/((-6)/g - 24/(-15)). Solve -4m + 2 + 10 = w for m. 3 Suppose -3q = -8q. Let v(d) = d*3 - 2d*2 + 16d - 24. Let l be v(2). Suppose 0 = -4g - g + 20. Solve q = gt + l for t. -2 Suppose 317 = 4f - 5h, -5f - 159 = -7f + 3h. Solve 10 - f = -17v for v. 4 Let p = 7 - 7. Suppose -5*x +	{ "pile_set_name": "DM Mathematics" }
x*3 + 2x*2 - 1. Let i be z(2). Let l = i + -3. Calculate the highest common factor of l and 8. 4 Suppose 15 = -5c, -63 = -u - 0u - 3c. Calculate the highest common divisor of u and 8. 8 Let v(i) = i*3 - 2i*2 + 2i + 2. Let j be v(-4). Let g = 58 + j. Let f be 2 + 1/((-2)/g). What is the greatest common divisor of f and 60? 12 Let z = -32 + 33. Calculate the greatest common divisor of 4 and z. 1 Suppose 3 = 3l - 12. Suppose -2q + 4m = q - 14, lq + 3m = 4. Calculate the highest common divisor of 1 and q. 1 Suppose -1 = -3h + 2. Let s(w) = 12w3 - w2 + 2w - 1. Let p be s(h). Calculate the greatest common factor of 6 and p. 6 Let u be (-22)/(-4) - (-2)/4. Suppose 4l = 2l - u. Let y be (2 - l) + 0 + 1. What is the greatest common factor of y and 6? 6 Let q = -32 + 48. What is the greatest common divisor of q and 4? 4 Suppose -4r - 7q = -2q + 25, 2r = 4q + 20. Let n(f) = f3 - f + 6. Let l be n(r). What is the greatest common divisor of l and 24? 6 Let h = -65 + 101. What is the highest common divisor of 24 and h? 12 Let y be 3 - (-3 + (-6)/(-2) + 1). Calculate the highest common divisor of y and 5. 1 Suppose 4z - 7z - 6 = 0. Let p be 5/((-2)/(-2)) - z. Suppose o + o = 4q + 38, o + q = p. Calculate the greatest common divisor of o and 77. 11 Suppose -4q + 4i = -i - 111, -3q + 3i + 81 = 0. Calculate the greatest common factor of 12 and q. 12 Suppose 0r + 2p + 28 = 2r, -4r - 5p + 83 = 0. What is the highest common factor of 68 and r? 17 Let x(h) = h3 - h2 + 1. Let i = 2 - 2. Let b be x(i). Let r = 28 - 20. Calculate the highest common factor of b and r. 1 Let h(p) = -4p - 35. Let r be h(-14). What is the greatest common factor of r and 147? 21 Let w = 129 + -44. What is the greatest common factor of 17 and w? 17 Suppose 3u - 9 - 3 = 0. Let x be -1 + -2 + (u - -3). Calculate the highest common divisor of 4 and x. 4 Let r be (-10)/((-2)/(2 - -2)). Let x = 2 + 3. Suppose 0 = -5c + 3c - xs, -2s = -c + 9. Calculate the highest common factor of r and c. 5 Let a be 30/8 + (-5)/(-20). Suppose -3o - o + 52 = -f, 3o - 26 = af. What is the highest common divisor of 2 and o? 2 Let f = -37 + 41. What is the greatest common divisor of 3 and f? 1 Let a = 260 - 172. What is the greatest common factor of 8 and a? 8 Let i be (-1 - -6)(-96)/(-20). Let w(n) = n3 + 9n*2 - 2n - 10. Let u be w(-9). Calculate the greatest common factor of u and i. 8 Let q(s) = -s*3 + 11s*2 - 3s - 10. Let b(h) = h3 + h2 + 10. Let y be b(0). Let z be q(y). What is the highest common factor of 40 and z? 20 Let f = -59 + 136. Suppose -u - 4w + f = 2u, w = u - 14. Calculate the greatest common divisor of u and 76. 19 Suppose 4x - 14 = 3x. Let n be (-1 + 3 - 0) + 0. Let l(p) = 7p3 - p + 2. Let v be l(n). Calculate the greatest common divisor of x and v. 14 Let g = 147 + -115. Suppose 57 = 2j + 5o, j + 3j + 2o - 74 = 0. What is the highest common divisor of j and g? 16 Let g(k) = -7k - 44. Let x be g(-10). What is the greatest common factor of x and 104? 26 Let c be 4/(-4 - -2)-56. Let a(d) = -2d3 - 2. Let f be a(-2). What is the highest common factor of c and f? 14 Suppose -b - 10 = -11. Calculate the highest common divisor of b and 9. 1 Let q(k) = k2 + 10k + 6. Let v be q(-10). What is the greatest common factor of 66 and v? 6 Suppose -50 = -0w - 5w. Calculate the greatest common factor of w and 40. 10 Suppose -48 = -4p + 3c, 9c + 44 = 4p + 5c. What is the greatest common factor of 9 and p? 3 Suppose -2d + r = 6r - 36, -3d + 49 = 5r. Suppose 0 = u + 1 - d. Calculate the highest common factor of 18 and u. 6 Let l be 13/11 + 0 + 20/(-110). Calculate the highest common divisor of l and 19. 1 Suppose -4o + r - 2 = -o, 12 = 2o - 4r. Let m = o - -6. Let d be m + -1 - (2 - 4). What is the greatest common factor of d and 5? 5 Suppose 5f = 5s - 3 - 2, 2s + 1 = -f. Let o be f/(3/12)-7. Let c = o + -17. Calculate the highest common factor of 55 and c. 11 Let q = 19 - 1. Let u be (25/1018)/1. Calculate the greatest common factor of q and u. 9 Let g(t) = 3t2 - 2t*3 + 2 - 3 - 2t*2 - 5t*2. Let s be g(-3). What is the greatest common divisor of s and 187? 17 Let k = -49 - -83. Calculate the greatest common divisor of k and 34. 34 Let j = -8 - -13. Suppose o + ja = -0 - 17, -4a = 4o - 12. Calculate the greatest common factor of o and 1. 1 Let o(i) = 2i2 + 1. Let g be o(2). What is the highest common factor of 45 and g? 9 Suppose -4k + 7 = 35. Let n = k + 52. What is the greatest common divisor of n and 18? 9 Let c(d) = d*3 - 9d*2 - 11d + 22. Let n be c(10). Calculate the greatest common divisor of n and 96. 12 Suppose -y + 3y - a = 49, -5y + 121 = -a. Let d = -16 + y. Let l = 187 + -99. Calculate the highest common factor of l and d. 8 Suppose -3m - m + 36 = 4t, 5t = 5m - 25. Let x = 1 + m. Calculate the greatest common divisor of x and 32. 8 Let v(f) = f*2 + 3f + 48. Let k be v(0). Suppose -3q + 6 = -12. What is the greatest common factor of k and q? 6 Suppose g = 3s + 49, -g + 0g + 2s + 44 = 0. Suppose 0 = -r + 3a + 16, -8r + 2a + g = -5r. What is the highest common divisor of 20 and r? 10 Let f be (-8)/(-52) + (-835)/(-65). What is the highest common factor of 104 and f? 13 Suppose 9b - 797 = 22. Calculate the highest common factor of b and 26. 13 Let c = -4 + -9. Let j = c - -19. Let b be (-99)/j(-40)/6. Calculate the greatest common divisor of 10 and b. 10 Let n(m) = -m*2 - 5m. Let p be n(-5). Suppose 5o = -po + 15. Let z(y) = 5y. Let q be z(o). Calculate the highest common factor of 105 and q. 15 Suppose 0 = -4i + 7 + 5, -3z = 2i - 63. Let m = 119 - -90. Calculate the highest common factor of m and z. 19 Suppose j + 357 + 91 = 2b, -2j = -2b + 446. Calculate the highest common factor of b and 25. 25 Suppose -2t + 6u - 5 = 3u, 0 = 5t + 4u - 45. Let z(k) = 2k - 7. Let c be z(t). What is the greatest common divisor of 27 and c? 3 Let k be -2 + 3 - 5-3. Let r be (4/(-5))/((-10)/100). Calculate the highest common factor of k and r. 8 Suppose 2f - 42 = -f. What is the highest common divisor of 112 and f? 14 Let f(m) be the first derivative of m4/4 + m3 - 3m*2 - 4m - 2. Let n be f(-4). Let q = -90 - -134. Calculate the greatest common divisor of q and n. 4 Suppose 0 = 5n - 5b - 1250, -5n + 5b + 1241 = 3b. Suppose -193 - n = -4g. What is the highest common factor of g and 22? 22 Suppose -4v + 2v + 40 = 0. What is the greatest common factor of 60 and v? 20 Let d = 2 - -15. Calculate the highest common factor of d and 68. 17 Let r be 1/(-2)8/(-2). Suppose 0 = 17y - 14y - 684. Suppose 24 - y = -rk. What is the greatest common factor of 17 and k? 17 Let h(r) = 4 - 14r + 14r + 2r2. Let z be h(-8). Calculate the greatest common divisor of 12 and z. 12 Let m = -47 + 22. Let y be 1/(4/m)-4. Let q = -15 - -20. Calculate the highest common factor of q and y. 5 Suppose 6 = 2b - 18. Calculate the highest common divisor of 12 and b. 12 Let v = -6 - -4. Let a be (-90)/(-1) + v + 2. What is the greatest common divisor of 18 and a? 18 Suppose -2n - 6 = -4n. Suppose -19 = nz - 7. Let o be -105(3 + z)/3. What is the highest common divisor of o and 5? 5 Suppose 0 = 4u - 30 + 18. Suppose 2r - 22 = -r + 4v, uv = -3r - 6. What is the greatest common factor of 2 and r? 2 Let s(n) = 2n2 + 6n + 2. Let j be s(-4). Let m = j + 4. Suppose -c = -4w - 56, c - 5w + 280 = 6c. What is the greatest common divisor of m and c? 14 Let n be ((-110)/11)/((-1)/(-2)). Let m be ((-120)/100)/(2/n). Calculate the highest common factor of m and 60. 12 Let v be (-4 - 2)(-20)/6. What is the highest common divisor of v and 5? 5 Suppose -i - 600 = -6i. What is the greatest common divisor of 24 and i? 24 Suppose 1 = 5q - 4. Let m be q/1 - (2 - 47). Calculate the greatest common divisor of m and 115. 23 Suppose l - 54 - 5 = 0. Let p = -35 + l. What is the highest common factor of 120 and p? 24 Suppose 4d + 6f - f + 4 = 0, 2d + 3f = -4. Let n be -4 + d - (2 - 50). Calculate the highest common factor of 6 and n. 6 Suppose -2z = -0z + 5b - 71, 5z - 230 = -2b. Let v(r) = -r2 + 9r - 2. Let d be v(7). Calculate the highest common factor of d and z. 12	{ "pile_set_name": "DM Mathematics" }
for x. 3 Solve 4y - s = -7, 0 = -8y + 9y + 5s + 28 for y. -3 Solve g - 4m - 5 = 4, -5 = 5m for g. 5 Solve 3i + 2l + 16 = 0, 6i - 2i - 4l = 12 for i. -2 Solve -w = -4x + 2w - 11, x - 4 = 3w for x. -5 Solve 4n + 4 = 4u - 0n, n = -5u - 13 for u. -2 Solve -a = 2t - 8, 3t = 5a + 2t + 4 for a. 0 Solve 5x - 14 = p - 34, p + 15 = -2x for p. -5 Solve 4 = -2c + v, -21c + v = -26c - 3 for c. -1 Solve -4q - 8 = 3o - o, -4o = -5q + 16 for q. 0 Solve 4y + 21 = -5q, 6q + 2y = 3q - 13 for q. -5 Solve -2v - 4 + 17 = 3j, 3j = v + 7 for v. 2 Solve 0 = -3y + 2l + 11, -12y + 9l + 7 = -7y for y. 5 Solve 0v + 5v - 16 = -4m, v - 4m = 8 for v. 4 Solve -13 = -4p - 5m, m = p + 443 - 435 for p. -3 Solve -3q - 3 = -4h + 10, 3q - 2h + 5 = 0 for q. 1 Solve -s + 13 = -0s + 2y, s = 3y - 7 for s. 5 Solve h + 4g = 0, 1591g = h + 1593g + 2 for h. -4 Solve -h - 16 = 4u, 4h - 40 + 9 = 3u for u. -5 Solve -21 = -4f + 3g, -g + 30 = 3f - 2 for f. 9 Solve 4q + 4 = 3l + 12, 5l + 4q + 24 = 0 for l. -4 Solve 22l + 10 = 2j + 18l, 5j - 3l - 11 = 0 for j. 1 Solve -2o - 6 = 4k + 6, 4k + 12 = 0 for o. 0 Solve 3w = 430g - 433g + 9, 0 = -4w - 3g + 12 for w. 3 Solve -8 = h + 3u, 3h + 0u - 18 = 5u for h. 1 Solve 2p = p + k + 1, 0 = 4k + 4 for p. 0 Solve -4k = i - 9, k + 5i - 26 = -0 for k. 1 Solve 5j = -3v + 5, 92j = 87j - 2v for j. -2 Solve -o = -4j + 19 - 0, 4o - 5j = -32 for o. -3 Solve -2b + 45 = -3v + 59, -3v + 9 = 3b for b. -1 Solve -5b = -o - 17, -3o = -2b - 0o + 12 for b. 3 Solve 7x - 5x = 5l + 2, l = -4x - 18 for x. -4 Solve 2q + 4d = -8, -3d + 7 = 8q - 13q for q. -2 Solve -j + 9 - 4 = -3p, -9 = 5j + 2p for j. -1 Solve -20 = 4o, -5j + 9j + 4o + 28 = 0 for j. -2 Solve 4p - 15 = -5j, -5p + 21 = 5j - j for p. 5 Solve 2l = -4u - 12, 2l - 3u + 8 = 3 for l. -4 Solve -5i + 40 = -5q, 3i = -4q + 15 - 19 for q. -4 Solve -4o + 0d + 8 = d, o = -4d + 2 for o. 2 Solve j + 4t = -19, 0 = 9j - 8j + t + 7 for j. -3 Solve 0 = -t - h + 4, 4t + h - 6h = -11 for t. 1 Solve -r - 33j = -32j + 8, -3r = 5j + 30 for r. -5 Solve -13n - 5 = -a - 47, 3a + 4n = 3 for a. -3 Solve -3c + 2r - 12 = -0c, -5c - 16 = -2r for c. -2 Solve -3f + 6 = 0, 11y - 12y - 5f + 14 = 0 for y. 4 Solve p = -2g + 2p + 4, 20 = 4g + 4p for g. 3 Solve -3 = 3f + 3o, 2f - o - 3o - 4 = 0 for f. 0 Solve x + 2 = a - 2, x + 10 = -a for x. -7 Solve -2b - 2u - 2 = 0, 0 = -5b + u - 4 - 1 for b. -1 Solve 3u + 2 = 5, -2s + 2u = -8 for s. 5 Solve -3c = -2o + 19, 0o + 4c = 6o - 42 for o. 5 Solve w + 10 = 2s, -s = w - 2w - 5 for w. 0 Solve 5s - 21 = -60w + 57w, 3s - w = 7 for s. 3 Solve -3n = -0n - o + 15, -10 = 4n + 2o for n. -4 Solve 0 = 4a + 4u + 24, -2u - 4 = -a + 2 for a. -2 Solve 5a + 35 = -2u, -5a - u - 28 = 12 for a. -9 Solve -9o + 7o = 4p - 8, -5o - 20 = 0 for p. 4 Solve 5m = 4p + 16, -5p + 0p + 25 = 5m for m. 4 Solve 2t - 6 = 2l, 3t - 4t + 5l - 1 = 0 for t. 4 Solve 2x - 3t = 16, 9x - 6x - 2t = 14 for x. 2 Solve 5 = -c + 5v - 2v, 5c - 3v - 11 = 0 for c. 4 Solve 5a + 35 = 4t, -2a + 28t = 31t - 9 for a. -3 Solve -76i = -2q - 79i - 2, 22 = -5q + i for q. -4 Solve 52d - 30 = 49d - 5o, -4d + o + 17 = 0 for d. 5 Solve a - 4 = 0, -7a + 2a + 24 = -s for s. -4 Solve 0v - 8 = -2i - 3v, -5i - 4v + 20 = 0 for i. 4 Solve 2t - 1 = 3n + 3, -n = -2t for n. -2 Solve 5n - l - 8 = 0, 4n + 4l = 3l + 1 for n. 1 Solve 5a + m = -7 - 4, m = 4a + 16 for a. -3 Solve 63 = 5b - 5o + 23, 5o = -15 for b. 5 Solve 5q - g + 27 = 0, -2g - 2 + 1 = q for q. -5 Solve -5g + 0n = 2n + 5, 4n = 0 for g. -1 Solve -b - 4 = -2z, 2z + 12 - 22 = 4b for z. 1 Solve 5w = -3f + 8, -w - 2f - 4 = -0 for w. 4 Solve -21 = -3g + u, 9 + 10 = 5g + u for g. 5 Solve -4y = -4p + 7p + 20, -4y + 5p = 20 for y. -5 Solve 0 = m + 3y - 1, 3y - 11 = 4m - 0y for m. -2 Solve -2j = -5j - 2m - 15, -2j = -2m for j. -3 Solve -v + 4b - 6 = 2b, 24 = 12b for v. -2 Solve 3j - 3g = -26 + 2, 5j + 2g = -5 for j. -3 Solve -2g + 2f = -4, 5f = -6g + g for g. 1 Solve 4p + 3u = 6, -4p + 17 = 4u + 13 for p. 3 Solve 66w + 4c + 35 = 63w, -3w - c = 20 for w. -5 Solve -2x = 2p, 5p - 5x = -17 - 23 for p. -4 Solve -c = -4v, -5c = -19v + 22v for c. 0 Solve 0 = -4m - 12, -p + m + 17 = 11 for p. 3 Solve 2k - 4m - 33 = -3k, -5k = -3m - 31 for k. 5 Solve -4f - 19 = 3n, n + 0f + 5f + 10 = 0 for n. -5 Solve -13q - 3y - 25 = -9q, -5q = -3y + 11 for q. -4 Solve -2f - i + 5 - 16 = 0, 4f + 25 = -3i for f. -4 Solve 5b - 21 + 51 = -5x, -3x - 8 = -2b for x. -4 Solve 5n + 9 - 22 = 2w, n - w = 5 for n. 1 Solve 3l + x - 8 + 1 = 0, 6 = -3x for l. 3 Solve 6 = 3k + 2y, 2y = 2k - 3y - 4 for k. 2 Solve 74 = 5i + 3h + 40, -3i + 18 = h for i. 5 Solve -3 = 2q - 5z + 10, 4q + 19 = 3z for q. -4 Solve 0 = p + 22b - 27b, -3p = 3b + 18 for p. -5 Solve 3t = y + 4, -5t - 2y = 3y for t. 1 Solve g = 3, -2l - l + 2g = 0 for l. 2 Solve 0 = -4m + a - 18, -2a - 9 - 5 = 2m for m. -5 Solve 0 = z - 2k, 4z + 2k = -14 + 4 for z. -2 Solve -c = 5v - 8, -2v = -3c - 6v + 13 for c. 3 Solve 2c - 28 = -2i + 7c, -5i + 3c + 13 = 0 for i. -1 Solve 14 = -2v - 2q, 5v - 2q = -11 - 3 for v. -4 Solve 6 = g + 4r + 2, 2 = 3g + 2r for g. 0 Solve -2c - a = 12 - 1, 9 = -2c + a for c. -5 Solve 11 = -5x + 4l + 47, 3x + 8 = -5l for x. 4 Solve -2p - 3i + 10 = 0, 4p - 3i - 2 + 18 = 0 for p. -1 Solve x - 15 - 3 = 5q, 0 = -2q + 4x for q. -4 Solve 0 = -3t + o + 8, 4t - 13 = 7o - 8o for t. 3 Solve 0 = c + 5k - 30, -24 = 3c - 7k + 3k for c. 0 Solve 4u = -4w + 4 + 16, -w + 5 = 0 for u. 0 Solve -5o + 58r - 59r - 19 = 0, 0 = -2o + 2r - 10 for o. -4 Solve 3c = 12y - 17y - 6, -2y = c + 2 for y. 0 Solve 0 = 5r - 11i + 15i - 34, -25 = -5r + 5i for r. 6 Solve -20 = 2t - t + 5l, t + 3l + 10 = 0 for t. 5 Solve -3a = -7a - c - 27, -4a - 31 = -3c for a. -7 Solve p - 2f = -557 + 549, 3f = 18 for p. 4 Solve 20k - 22k = -3y - 8, 0 = 3k + 5y + 26 for k. -2 Solve 0 = 3s - 2k - 2, 3s - 6 = -k - 7 for s. 0 Solve 5h + 8 = 4h + 2n, 3n - 26 = 5h for h. -4 Solve -5w = 3q + 7, 3q - 2w - 7 = -0q for q. 1 Solve 2s - 4n - 14 = 0, s - 5s = -2n - 4 for s. -1 Solve -12 = -3u, 5u - 6u = 2r for r. -2 Solve -5h = -2d - 0h - 13, -4d + 2h = 18 for d. -4 Solve -5s - 8 = 4l - 48, -l = -5s + 15 for s. 4 Solve j - 6 = p, 3p - 2j = -7j + 22 for p. -1 Solve -21 = q + 4c, q - 2 = 3c + 5 for q. -5 Solve 2r + 8 = 3q - 15, 0 = 4r + 4 for q. 7 Solve -5v = 4c - 5c + 15, -v + 2c = -6 for v. -4 Solve -5a = 4z + 29, 2a - 5z + 8 - 3 = 0 for a. -5 Solve 94o + 5z - 16 = 96o, o - 5z + 18 = 0 for o. 2 Solve 3a - 5 = -z, 0 = -z - a + 5a - 2 for z. 2 Solve -2f + 3 = -s, 0 = -2f - 4s - 87 + 65 for f. -1 Solve 0 = 5x - a, 8x + 3a + 10 = 13x for x. -1 Solve s = -4s - 3t - 14, s - 2 = t for s. -1 Solve -12 = 6f - 2f, -2p + 2f + 12 = 0 for p. 3 Solve 4p = 5s - 11, -6s + 2s = 2p - 14 for p. 1 Solve -2r = -4v + 2, 5v - 3r + 5r - 7 = 0 for v. 1 Solve 5n - 5 = -5i + 5, 2n = -3i + 8 for n. -2 Solve -14b + d - 3 = -11b, -15 = -5d for b. 0 Solve -2h - 14 = -5c, -5 = -c - 1 for h. 3 Solve 2c - w - 4 = 7c, 0 = -2c - 2w for c. -1 Solve 3h + a + 1 = 6a, -a = 3h + 7 for h. -2 Solve 4y = -3r + 18 - 3, -4r = -5y - 20 for y. 0 Solve 7 = 3a + 2a - l, -3a + l = -3 for a. 2 Solve 0 = 15q - 14q + 2, 0 = -4s + q + 6 for s. 1 Solve 4h + 3m - 322 + 326 = 0, h = -4m - 14 for h. 2 Solve 6 - 12 = 2h - 2u, 4h + 3u = -5 for h. -2 Solve 0 = -5p - 20, -5b = p - 0 - 6 for b. 2 Solve -5c = 20, 79t + 36 = 83t - 5c for t. 4 Solve 0 = 2f - 4m + 18, 43f - 44f + 6m = 21 for f. -3 Solve 5u + 0z = 4z - 37, 12 = 4z for u. -5 Solve 0 = -5h - s - 37 + 21, 3s = -2h - 9 for h. -3 Solve 3x - a = -10, x + 6 = -x + a for x. -4 Solve -2b + 2c + 5 - 1 = 0, 0 = -2b - 4c - 8 for b. 0 Solve -2s + 3s - 5 = 4d, -3s - 3 = -3d for s. -3 Solve -4z + 35 = 3h, 5h + z = -2z + 40 for h. 5 Solve 13j + 5b = 11j - 35, -4j = -2b + 10 for j. -5 Solve -3o - 6 = 0, -62 = -3	{ "pile_set_name": "DM Mathematics" }
acement from {t: 1, m: 2, v: 1, g: 2, o: 1}. 2/21 Two letters picked without replacement from bbuubbbvbubvbbuu. Give prob of picking 1 b and 1 v. 3/20 Three letters picked without replacement from {h: 4, q: 1, d: 4, p: 2}. Give prob of picking 1 q and 2 d. 2/55 Three letters picked without replacement from {d: 3, y: 3}. What is prob of picking 3 d? 1/20 Four letters picked without replacement from {o: 2, b: 2, u: 1, z: 1, e: 1}. Give prob of picking 2 o and 2 b. 1/35 Two letters picked without replacement from {k: 2, d: 1, o: 1, s: 1, g: 1, c: 1}. Give prob of picking 1 c and 1 k. 2/21 Calculate prob of picking 1 c, 1 y, and 1 j when three letters picked without replacement from {p: 2, c: 2, y: 1, j: 1}. 1/10 Three letters picked without replacement from zzsssssszszssssssssz. Give prob of picking 1 z and 2 s. 35/76 Calculate prob of picking 1 m and 1 f when two letters picked without replacement from mkmmmffmkmmmmmmkm. 3/17 What is prob of picking 1 o and 1 j when two letters picked without replacement from {j: 2, o: 2}? 2/3 Calculate prob of picking 1 t and 2 k when three letters picked without replacement from ttkk. 1/2 Two letters picked without replacement from {k: 2, u: 1, e: 1, h: 2, c: 2}. Give prob of picking 1 u and 1 e. 1/28 Two letters picked without replacement from vldwpwwlwwgpvpp. What is prob of picking 2 p? 2/35 Calculate prob of picking 1 y and 1 i when two letters picked without replacement from ziyzy. 1/5 Four letters picked without replacement from yyyyyrryryrry. What is prob of picking 3 y and 1 r? 56/143 What is prob of picking 2 c when two letters picked without replacement from {t: 1, z: 1, l: 2, x: 2, s: 1, c: 2}? 1/36 Two letters picked without replacement from pxxjpxqxpxppxg. What is prob of picking 1 j and 1 g? 1/91 Four letters picked without replacement from zzozzzzz. Give prob of picking 3 z and 1 o. 1/2 Calculate prob of picking 2 w and 2 e when four letters picked without replacement from weeweewewwew. 5/11 Calculate prob of picking 1 s and 2 x when three letters picked without replacement from {p: 1, t: 1, y: 2, u: 1, x: 2, s: 1}. 1/56 What is prob of picking 1 j and 1 v when two letters picked without replacement from {b: 4, i: 9, j: 2, v: 1}? 1/60 What is prob of picking 1 u and 1 o when two letters picked without replacement from {j: 5, u: 3, o: 1, q: 1, m: 2, y: 1}? 1/26 Three letters picked without replacement from {f: 4, s: 4, e: 11}. Give prob of picking 3 f. 4/969 Three letters picked without replacement from {k: 1, q: 2, h: 2, j: 1, c: 1}. What is prob of picking 1 h and 2 q? 2/35 Four letters picked without replacement from {d: 9}. Give prob of picking 4 d. 1 Four letters picked without replacement from zllfyy. What is prob of picking 3 y and 1 l? 0 Calculate prob of picking 3 e when three letters picked without replacement from eeej. 1/4 Two letters picked without replacement from {n: 2, m: 16}. Give prob of picking 2 n. 1/153 Two letters picked without replacement from {u: 1, k: 2, s: 3, c: 4}. What is prob of picking 1 c and 1 k? 8/45 What is prob of picking 2 y when two letters picked without replacement from yywwyyyyyyy? 36/55 Calculate prob of picking 2 c when two letters picked without replacement from crrcr. 1/10 Calculate prob of picking 1 n and 2 p when three letters picked without replacement from knppkjkknj. 1/60 Two letters picked without replacement from {j: 6, z: 7, v: 4}. What is prob of picking 2 j? 15/136 What is prob of picking 3 w and 1 k when four letters picked without replacement from {k: 5, w: 11}? 165/364 What is prob of picking 2 c when two letters picked without replacement from {p: 2, a: 1, c: 2, m: 1}? 1/15 Two letters picked without replacement from {q: 1, r: 12, w: 3}. Give prob of picking 2 w. 1/40 Calculate prob of picking 4 d when four letters picked without replacement from lddddldldddldl. 18/143 Two letters picked without replacement from pjppjjjpjjpjjojgj. Give prob of picking 1 p and 1 j. 25/68 Three letters picked without replacement from tttedtdttdtttetttt. Give prob of picking 1 t and 2 e. 13/816 Calculate prob of picking 1 p and 1 z when two letters picked without replacement from {b: 1, z: 1, p: 7, h: 3, w: 2, q: 4}. 7/153 Four letters picked without replacement from {v: 6, n: 3, g: 1, c: 1, d: 1}. What is prob of picking 1 d and 3 n? 1/495 What is prob of picking 4 x when four letters picked without replacement from {x: 5}? 1 Calculate prob of picking 2 r when two letters picked without replacement from {c: 1, o: 3, r: 2, v: 2, f: 5, w: 6}. 1/171 Calculate prob of picking 2 t and 1 o when three letters picked without replacement from tccmgctcpocccctcpp. 1/272 Two letters picked without replacement from hhhqhishxhhshx. Give prob of picking 1 q and 1 h. 8/91 Two letters picked without replacement from ddddmhdehdmdrd. Give prob of picking 2 e. 0 Three letters picked without replacement from jjllac. Give prob of picking 2 l and 1 a. 1/20 Four letters picked without replacement from cmcmckckcgcmmjgkkqgk. What is prob of picking 3 k and 1 j? 2/969 Four letters picked without replacement from lvvimiiiimiiimii. Give prob of picking 1 v, 2 i, and 1 m. 27/182 What is prob of picking 1 p, 1 r, 1 j, and 1 y when four letters picked without replacement from {o: 1, p: 1, j: 2, r: 3, y: 1, l: 3}? 1/55 What is prob of picking 4 j when four letters picked without replacement from {z: 10, j: 9}? 21/646 Two letters picked without replacement from ttvttttv. Give prob of picking 1 t and 1 v. 3/7 Three letters picked without replacement from bbtbtbbbbbb. What is prob of picking 2 t and 1 b? 3/55 Calculate prob of picking 1 c and 1 l when two letters picked without replacement from qslxcggq. 1/28 Calculate prob of picking 1 n, 2 o, and 1 x when four letters picked without replacement from {z: 1, y: 3, n: 5, x: 1, o: 3, q: 1}. 15/1001 Three letters picked without replacement from vuubuuujmjmuuumm. Give prob of picking 1 j and 2 b. 0 Two letters picked without replacement from mfdgzgggmtmfgfg. What is prob of picking 1 m and 1 z? 1/35 Calculate prob of picking 2 f and 1 s when three letters picked without replacement from xsxssfsxsffx. 3/44 Calculate prob of picking 2 p when two letters picked without replacement from {p: 3, g: 7, i: 3, r: 2}. 1/35 What is prob of picking 4 q when four letters picked without replacement from qqqqfqqqqqqqq? 9/13 Three letters picked without replacement from yytkkkoyotyoyky. Give prob of picking 1 k, 1 y, and 1 o. 72/455 Two letters picked without replacement from {j: 1, l: 7, y: 1, x: 10}. What is prob of picking 1 y and 1 l? 7/171 Two letters picked without replacement from ugugggp. What is prob of picking 1 p and 1 u? 2/21 Calculate prob of picking 2 m when two letters picked without replacement from {s: 2, m: 2, k: 1, i: 2, f: 2, v: 3}. 1/66 Four letters picked without replacement from eejjjejeeejjjeeeeejj. What is prob of picking 4 e? 22/323 Four letters picked without replacement from qcjcgjgcjjqqggqvvcqq. What is prob of picking 1 v, 1 q, 1 g, and 1 j? 64/1615 Calculate prob of picking 1 d and 2 i when three letters picked without replacement from {d: 4, f: 2, i: 3}. 1/7 What is prob of picking 1 i, 1 s, and 1 t when three letters picked without replacement from {t: 1, s: 4, p: 2, i: 8}? 32/455 Three letters picked without replacement from {h: 6, i: 4}. What is prob of picking 1 h and 2 i? 3/10 Calculate prob of picking 2 f when two letters picked without replacement from {z: 1, g: 6, k: 4, f: 2}. 1/78 Calculate prob of picking 2 e and 1 a when three letters picked without replacement from eeaeeeeeeeeaae. 165/364 Calculate prob of picking 2 q, 1 z, and 1 l when four letters picked without replacement from eqxzqxqxqxl. 1/55 What is prob of picking 1 c and 2 y when three letters picked without replacement from myycy? 3/10 What is prob of picking 1 l, 1 g, and 2 h when four letters picked without replacement from {l: 3, g: 2, t: 2, h: 8}? 8/65 Four letters picked without replacement from ooqooooo. Give prob of picking 3 o and 1 q. 1/2 Four letters picked without replacement from {r: 3, n: 5, o: 2}. What is prob of picking 4 o? 0 Four letters picked without replacement from xbmybmyybmi. What is prob of picking 1 i, 2 y, and 1 b? 3/110 Calcula	{ "pile_set_name": "DM Mathematics" }
/14 + 6/(-4). Let b be (-4)/8(-2 - c). Solve -4l - b = -3h, -6h = -5h + 5 for l. -4 Let r be 0/((-2 + -1)/(-3)). Solve r = -5a + 5c + 15, 0 = -3a - 0a + 2c + 6 for a. 0 Let v(c) = c + 6. Let j be v(-3). Suppose -b = jb. Solve 5h + 20 = b, -45 = -5t + 3h + 2h for t. 5 Let f(k) be the third derivative of -k4/24 - k3/6 - 2k*2. Let h be f(-6). Solve d = -3d - hb + 4, 4d - 3b = 4 for d. 1 Let u = 54 + -98. Let b be (-18)/45 + u/(-10). Solve -5q - bw - 5 - 2 = 0, -5w = -q + 16 for q. 1 Let p = -56 + 66. Solve 4w + 9 = -n - p, 5n + 4w = -15 for n. 1 Let r be (-2)/4 + (15/2 - 0). Solve b = -4f + r, -4b + 2f = -0b + 26 for b. -5 Let i = 14 - 9. Solve -iw - 10 = 2l, -2w - 2l = l - 7 for w. -4 Suppose -2b - 4o - 21 = o, 0 = 2b + 3o + 19. Let i = 12 + b. Suppose h = ih - 4r - 17, 25 = 5h - 5r. Solve -2p + 3 = -5q, hq = 2q - 5p + 21 for q. 1 Let b = 9 - 6. Suppose w = -bw. Suppose -a - 3a + 20 = w. Solve -3r - 2k + 3 = -3k, -ar + 15 = -5k for r. 0 Let b(r) = -r + 2. Let l be b(-6). Suppose 0 = 5d - d - l. Let h be 6/(-2)1 + 6. Solve hn + 1 = 4g, -4n - dg = g - 7 for n. 1 Let m be (1 - 0)-2 - -4. Let s = -3 - -6. Solve 4u - a + 6a = -2, 0 = -su - 2a + m for u. 2 Suppose 0 = 3v - 3, -5k - 101 = -0k - v. Let l = k + 20. Solve -8 = 4i, lr + 2r - 6 = i for r. 2 Let v be (-10)/4 - 18/(-12). Let h be 6 + -7 + (25 - v). Suppose c + 1 = -s - c, -3s = -4c - 27. Solve -3u + 6u = -o + s, h = -u + 5o for u. 0 Suppose 8r + u - 51 = 4r, -4r = 4u - 60. Let f = r - 8. Let g be ((-2)/5)/(2/(-10)). Solve q + 3d = 13, -3q - 8 = -gq - fd for q. 4 Suppose 2k = -a, k + 2a + 1 = -5. Let x(i) = -2i - 6. Let c be x(-5). Suppose -1 = -t + c. Solve -kf = tn - 10, 2f + 4n - 8 = f for f. 0 Suppose -j = -4a + 3, j = -0j + 5. Solve 2i + 3 = t - 5, -3i - at - 12 = 0 for i. -4 Let v(t) = 2t - 4. Let q be v(3). Solve s = 2w, 1 = -w + 2s - q for w. 1 Let j(z) = 2z - 10. Let w be j(7). Solve 3x - 17 = -2f, -3f + 2x = 3 + w for f. 1 Suppose -f = -4h - 0f + 15, -3f = -h - 10. Suppose 0 = hr - 9r + 16. Solve -5p + 27 = -3q, 0q = rq + 2p + 10 for q. -4 Let l = -56 + 76. Solve -2n = -h + 3h + l, 3n - 4h - 5 = 0 for n. -5 Let k(l) = -2l*2 + 3l. Let x be k(3). Let p be 10/4 + x/(-6). Let a be 2/1(-2 + p). Solve 1 + 14 = 3o, an - 27 = -3o for n. 3 Suppose 5u = 12 + 3. Solve 2g - 20 = -3g - ux, 0 = 3x for g. 4 Suppose -3l = -2s + 6, 4l - 7 = -2s - 1. Solve 7 = 5m + k, l = -k - k - 6 for m. 2 Let x(t) = 15t2. Let z be x(-1). Suppose 5m + 0m = z. Suppose 18 = 2q + 3o, -3q + mo = 2q - 3. Solve -c + 2 = -3p, 5c + 0c + qp = -8 for c. -1 Let r = 7 + -1. Solve 0 = 4p + 2m + 6, -5p - 4m = r + 6 for p. 0 Let y be 8/(-12) - (-16)/6. Suppose 0n = -2n + 3j + 14, -yj = -2n + 14. Let t be 1(-1 - -2 - -2). Solve 3h - 4p + n + 5 = 0, -th + 15 = 5p for h. 0 Let t(x) = -3x - 4. Let b be t(-3). Let o(n) = n2 - 4n - 4. Let z be o(b). Solve -f = -6f, 4f = -a - z for a. -1 Let j(z) = -z + 1. Let p be j(-11). Solve -g - g = -2i - p, -i = -3g + 14 for i. -2 Let m(g) = -g*2 - 2g - g + 0g + 4g. Let w be m(1). Let h be 6 - 2 - w/1. Solve -hr + 5x + 5 = 0, -3r + 5x + 3 = x for r. 5 Let z(f) = -2 + 2 - f*3 - 8f*2 + f + 2. Let b be z(-8). Let h be (-6)/(-4)(-20)/b. Solve -4y + 5 = -3s + 8s, -2y - 5s = h for y. 5 Let n(m) = m. Let i(l) = -l2 + 4l - 5. Let q(k) = -i(k) - 2n(k). Let f be q(6). Solve 0 = -4u + 4t - 36, -3u = -ft + 20 + 17 for u. -4 Let m(g) = -2g*2 + 14g - 8. Let h be m(6). Solve -hp - 4n + 8 = -0n, 4n - 14 = -p for p. -2 Suppose 0h + 2h - 6 = 0. Suppose 0 = -3z + 5c + 16, -hc + 6 = 5z + 2. Solve -q = 3t + 11, -zq - t = -6t - 22 for q. 1 Let i(h) = -h + 6. Let g be i(6). Suppose g = -2w + 3w + 1. Let a = w - -3. Solve -6 = -5v - 2y - a, 2v + 5y - 10 = 0 for v. 0 Let w = 191 - 186. Solve 3k - 11 - 11 = -wl, 2l = -k + 8 for k. 4 Let z(v) = -v*2 - 12v - 10. Let h be z(-11). Suppose 0 = 3x, i + x = 6 + h. Solve -i + 2 = -5r + 3w, -1 = -r + 4w for r. 1 Let l be 0/((-2 + 1)-1). Suppose 5m + 3f - f - 9 = 0, 0 = 2m - f - 9. Solve 3h = y + y - 7, mh + y + 1 = l for h. -1 Let s = 5 + -1. Suppose 3l - 2t - 1 = 9, 2l - t = 6. Solve -sm = 3o - 6, -3m - 4o = -10 + l for m. 0 Let u(o) = o3 + 5o*2 + 2o - 3. Let v be u(-3). Suppose v = 2r + 3. Solve -5k - b + rb - 22 = 0, 3k - 3b = -15 for k. -4 Let v be 23/(-6) - -7. Let o be 21 + 1 + v/(-3). Solve -4d + a + o = 0, -2d - 2a = 2a + 8 for d. 4 Let s be 92/22 + 6/(-33). Solve -k + 9 = 4z, -3k = sz - 5k - 18 for z. 3 Let s(q) = -q*2 - 7q - 4. Let c be s(-6). Let o(f) = -f - 7. Let y be o(-6). Let k = c - y. Solve -3r - 4v = -r - 6, 0 = kr - 2v - 17 for r. 5 Suppose n - 5i - 7 = 0, 0i = 4i. Let r be 0 + 1 + -2 + n. Solve 0 = -u - 2w + 10, 0 = 5u - w + rw - 30 for u. 2 Let j = 10 - 8. Suppose 3d = o + 3, jo + 2d = 15 - 5. Solve -3i - 3s = -9, 4s = -4i + 5s - o for i. 0 Let k = 33 + -31. Solve c + 13 = -a - 2c, 4a + kc = -22 for a. -4 Let k(m) = 3m*2 - 2m + 1. Let l be k(1). Let g = l - -3. Suppose -x + 8 = 4b + 4x, gb - 5x - 10 = 0. Solve -b = -4j - 3q, 3q = q + 4 for j. -1 Suppose 3h - 680 = -h. Let q be h/(-6) + (-2)/3. Let n be q/(-3) - 2/(-6). Solve -3y - 8 + 2 = j, 5j + 5y + n = 0 for j. 0 Suppose -2h - 27 = -2g - 7h, -g = -3h + 14. Suppose -2j + 5 = -g. Solve 0v + 2v = jz + 10, 5 = v + z for v. 5 Let w be ((-6)/(-4))/(-4 - 57/(-12)). Solve -9 = -wo - x, 4x - 15 = -4o + 5 for o. 4 Let f be 4 - (-21 + -1) - 1. Solve -4t = 2u - 20, -5t + 6u + f = u for t. 5 Suppose -2x = 3x - 125. Let m(b) = -b*2 - 3b + 10. Let w be m(-5). Solve -x = 5i + 5l, 0 = 2i - wi + 4l + 14 for i. -3 Suppose -6u = -2u - 20. Let v = 10 + -7. Suppose 0 = vr - ur - z + 27, 5z - 80 = -5r. Solve -5b = -3d + 28, -b = b - d + r for b. -5 Let p be (-22)/(-2 + 4)-1. Let k = p + -5. Suppose -3r = 3o - k, 4r = 3o + 3 + 26. Solve -5n - 2a = -0n - 9, ra = -4n - 3 for n. 3 Suppose -h - 2h + 15 = 0. Solve 0z - 3z - hp + 4 = 0, 0 = -z - 4p + 6 for z. -2 Suppose 0 = 128y - 125y - 9. Solve -3t = -t - 5w + 2, 5w - 3 = yt for t. -1 Let m = -1 - -1. Let u be (12/8)/(3/6). Solve uk = c + 12, 5c + 21 = 2k - mc for k. 3 Let t be 0 + 1 + -1 + 72. Suppose 6y - t = 3y. Solve -4x + 0k - 4k = 0, -3x + y = -3k for x. 4 Suppose 3j - s - 25 = 0, -5j + 3s + 59 - 12 = 0. Solve -5a = 15, -2k - 2a = j + 3 for k. -2 Suppose -5t = -11t + 30. Solve -y = th + 4y + 10, 3h = 3y + 6 for h. 0 Let s be 12/(-30) + 4/10. Solve -10 = -3p - k, sp + 2k - 14 = -3p for p. 2 Let r(i) = -i2 + 4i - 2. Let y be r(5). Let u(j) = -2j - 10. Let k be u(y). Solve 0 = 4z - 4m - 0 + 8, -7 = 5z - km for z. 1 Let c(r) be the first derivative of -r2/2 + 2r - 1. Let i be c(2). Solve o = 3, -6p + p + 4o + 3 = i for p. 3 Let h(q) = -q. Let p(f) = 10. Let g(z) = -2h(z) - p(z). Let a be g(7). Let j = -117 - -167. Solve -5m - j = -5k, -3k + am + 35 = -0m for k. 5 Suppose 15 = 3x - 5j, -2x - 3j = -0j + 9. Suppose -o + 31 = 2g - xg, 0 = 4o - 4g - 88. Solve 5y = o, -2p = -3y + 6 + 17 for p. -4 Suppose -5j = m - 222, j + m + 183 = 5j. Suppose -3y + j = 3w, 18 = 3w + 4y - 26. Solve -5a + w - 6 = 5u, 3u - 8 = -5a for u. 1 Let v = 46 + -25. Solve 0g - 2g + v = 5o, -4g - 18 = -2o for o. 5 Let r(p) = 2p*2 + 6p + 9. Let s be r(-8). Suppose -5l = -s + 14. Solve 2z - 12 + 2 = -3a, 3z - 4a - l = 0 for z. 5 Suppose -2n + 18 + 0 = 0. Suppose f - n = -2f. Suppose -6 = -fk + 15. Solve -4q - 4m = -km - 24, -23 = -5q + 2m for q. 3 Let g be (-1)/4 - (-34)/8. Solve -3b = -b - 3k - 15, 21 = 3b - gk for b. 3 Let n = 34 + -28. Suppose 14 = -5a + na - 5z, -4z + 4 = 3a. Solve -4k + 2 = 3g - 9, 4k = ag + 32 for k. 5 Let q = 23 + -7. Let z = -11 + q. Solve 5y - 4j + 19 = 0, y + 3y + 7 = -zj for y. -3 Let s(p) = p*2 - 21p. Let k be s(21). Solve -3r + 4l + 0l + 3 = k, -3l = 4r + 21 for r. -3 Suppose 0 = -3q + 3 + 9. Suppose 0 = -4g - r - r, -r = 4g - q. Solve 3u = 4f - 9 - 8, 0 = -f + gu + 8 for f. 2 Let b be (-3)/7 + (-144)/(-42). Solve 5 = 4	{ "pile_set_name": "DM Mathematics" }
36 AM What is 117 minutes after 8:13 AM? 10:10 AM How many minutes are there between 2:17 AM and 6:37 AM? 260 What is 274 minutes before 4:01 AM? 11:27 PM How many minutes are there between 8:25 PM and 11:05 PM? 160 How many minutes are there between 9:04 AM and 3:31 PM? 387 What is 474 minutes before 8:01 PM? 12:07 PM What is 292 minutes after 2:28 PM? 7:20 PM What is 145 minutes before 11:38 AM? 9:13 AM What is 627 minutes after 10:04 PM? 8:31 AM How many minutes are there between 8:46 PM and 12:00 AM? 194 What is 404 minutes after 1:19 AM? 8:03 AM How many minutes are there between 11:42 AM and 2:27 PM? 165 How many minutes are there between 1:41 AM and 9:53 AM? 492 How many minutes are there between 10:11 PM and 3:15 AM? 304 What is 202 minutes before 12:02 PM? 8:40 AM How many minutes are there between 6:59 AM and 8:35 AM? 96 What is 643 minutes before 8:55 PM? 10:12 AM How many minutes are there between 5:18 PM and 4:36 AM? 678 How many minutes are there between 10:14 PM and 10:49 PM? 35 How many minutes are there between 10:23 PM and 7:07 AM? 524 What is 445 minutes before 9:04 AM? 1:39 AM What is 159 minutes after 2:42 PM? 5:21 PM How many minutes are there between 12:51 AM and 12:40 PM? 709 How many minutes are there between 4:59 PM and 5:49 PM? 50 What is 416 minutes before 10:43 PM? 3:47 PM What is 558 minutes before 9:05 AM? 11:47 PM How many minutes are there between 2:27 AM and 10:00 AM? 453 What is 503 minutes before 7:31 PM? 11:08 AM What is 52 minutes after 8:01 PM? 8:53 PM What is 139 minutes before 1:45 PM? 11:26 AM What is 706 minutes before 1:30 AM? 1:44 PM What is 552 minutes before 6:03 PM? 8:51 AM What is 260 minutes before 9:03 PM? 4:43 PM How many minutes are there between 8:48 AM and 5:28 PM? 520 What is 444 minutes after 3:44 AM? 11:08 AM How many minutes are there between 11:50 AM and 12:31 PM? 41 How many minutes are there between 1:17 AM and 7:59 AM? 402 What is 700 minutes before 2:48 PM? 3:08 AM What is 255 minutes after 6:01 AM? 10:16 AM What is 88 minutes before 2:00 PM? 12:32 PM How many minutes are there between 4:43 PM and 7:04 PM? 141 How many minutes are there between 11:57 PM and 12:24 AM? 27 How many minutes are there between 1:24 AM and 10:42 AM? 558 What is 344 minutes after 9:10 PM? 2:54 AM How many minutes are there between 6:00 AM and 2:24 PM? 504 How many minutes are there between 4:02 PM and 12:46 AM? 524 How many minutes are there between 5:50 AM and 3:10 PM? 560 How many minutes are there between 4:04 AM and 9:28 AM? 324 How many minutes are there between 1:41 AM and 1:51 AM? 10 What is 715 minutes after 3:50 PM? 3:45 AM How many minutes are there between 10:32 PM and 12:10 AM? 98 What is 573 minutes before 7:31 PM? 9:58 AM What is 669 minutes after 10:24 AM? 9:33 PM What is 40 minutes after 7:31 AM? 8:11 AM How many minutes are there between 9:16 PM and 10:19 PM? 63 What is 62 minutes after 12:14 AM? 1:16 AM What is 142 minutes before 6:01 PM? 3:39 PM How many minutes are there between 8:51 PM and 12:42 AM? 231 How many minutes are there between 7:43 PM and 11:06 PM? 203 How many minutes are there between 9:57 AM and 10:37 AM? 40 What is 655 minutes before 9:56 PM? 11:01 AM How many minutes are there between 9:01 PM and 11:29 PM? 148 How many minutes are there between 8:47 PM and 8:31 AM? 704 How many minutes are there between 2:46 PM and 5:31 PM? 165 What is 111 minutes after 10:03 PM? 11:54 PM What is 159 minutes before 10:01 PM? 7:22 PM How many minutes are there between 12:29 PM and 10:46 PM? 617 What is 514 minutes after 6:36 PM? 3:10 AM How many minutes are there between 8:34 PM and 3:42 AM? 428 How many minutes are there between 11:52 PM and 4:52 AM? 300 How many minutes are there between 11:47 PM and 2:21 AM? 154 What is 60 minutes after 5:28 AM? 6:28 AM What is 627 minutes after 12:03 PM? 10:30 PM What is 508 minutes before 12:45 PM? 4:17 AM How many minutes are there between 9:50 PM and 5:23 AM? 453 How many minutes are there between 7:51 AM and 12:16 PM? 265 How many minutes are there between 6:07 AM and 2:01 PM? 474 How many minutes are there between 1:42 PM and 12:51 AM? 669 What is 331 minutes after 12:19 PM? 5:50 PM What is 470 minutes after 11:18 PM? 7:08 AM How many minutes are there between 11:43 AM and 5:10 PM? 327 What is 360 minutes before 7:19 PM? 1:19 PM What is 672 minutes before 7:46 PM? 8:34 AM What is 388 minutes after 10:22 AM? 4:50 PM What is 191 minutes after 7:31 AM? 10:42 AM How many minutes are there between 9:06 PM and 4:42 AM? 456 How many minutes are there between 6:12 AM and 12:24 PM? 372 What is 570 minutes after 1:53 PM? 11:23 PM What is 423 minutes after 2:52 AM? 9:55 AM What is 103 minutes before 5:23 AM? 3:40 AM What is 559 minutes before 12:36 AM? 3:17 PM What is 430 minutes after 3:09 PM? 10:19 PM What is 126 minutes before 4:21 PM? 2:15 PM What is 581 minutes after 4:16 AM? 1:57 PM How many minutes are there between 11:47 PM and 10:51 AM? 664 What is 126 minutes before 1:45 PM? 11:39 AM How many minutes are there between 6:10 PM and 9:02 PM? 172 How many minutes are there between 3:41 PM and 4:35 PM? 54 How many minutes are there between 12:55 PM and 5:25 PM? 270 What is 293 minutes before 1:18 PM? 8:25 AM How many minutes are there between 7:06 PM and 6:03 AM? 657 How many minutes are there between 7:28 AM and 10:33 AM? 185 How many minutes are there between 5:42 PM and 4:21 AM? 639 How many minutes are there between 12:12 PM and 2:22 PM? 130 How many minutes are there between 8:13 PM and 4:58 AM? 525 How many minutes are there between 12:49 PM and 6:21 PM? 332 What is 202 minutes before 11:05 AM? 7:43 AM How many minutes are there between 9:14 PM and 3:48 AM? 394 What is 432 minutes before 10:48 PM? 3:36 PM How many minutes are there between 10:27 AM and 8:08 PM? 581 How many minutes are there between 9:19 AM and 11:29 AM? 130 How many minutes are there between 1:12 PM and 10:24 PM? 552 What is 238 minutes after 10:20 AM? 2:18 PM What is 38 minutes before 10:49 PM? 10:11 PM How many minutes are there between 2:26 PM and 8:33 PM? 367 What is 341 minutes after 7:56 PM? 1:37 AM How many minutes are there between 12:47 PM and 10:06 PM? 559 How many minutes are there between 3:52 PM and 2:22 AM? 630 What is 715 minutes after 8:47 PM? 8:42 AM What is 564 minutes before 1:41 AM? 4:17 PM How many minutes are there between 3:28 PM and 3:38 PM? 10 How many minutes are there between 2:03 AM and 10:03 AM? 480 How many minutes are there between 5:17 AM and 5:59 AM? 42 How many minutes are there between 5:07 PM and 7:10 PM? 123 What is 244 minutes after 9:20 AM? 1:24 PM What is 502 minutes after 12:25 AM? 8:47 AM How many minutes are there between 12:56 AM and 4:20 AM? 204 What is 592 minutes after 10:55 PM? 8:47 AM What is 693 minutes after 7:45 PM? 7:18 AM What is 611 minutes before 2:47 AM? 4:36 PM What is 366 minutes before 11:36 PM? 5:30 PM How many minutes are there between 6:39 AM and 9:19 AM? 160 What is 454 minutes before 2:53 AM? 7:19 PM What is 444 minutes after 3:03 PM? 10:27 PM What is 394 minutes before 3:46 PM? 9:12 AM How many minutes are there between 5:11 PM and 11:05 PM? 354 What is 439 minutes after 12:35 AM? 7:54 AM How many minutes are there between 5:57 PM and 10:43 PM? 286 How many minutes are there between 8:18 PM and 10:54 PM? 156 How many minutes are there between 9:40 AM and 9:19 PM? 699 What is 391 minutes before 8:39 AM? 2:08 AM What is 578 minutes before 1:33 PM? 3:55 AM What is 243 minutes before 4:38 PM? 12:35 PM What is 211 minutes after 4:44 AM? 8:15 AM How many minutes are there between 6:54 AM and 3:19 PM? 505 What is 644 minutes before 1:54 AM? 3:10 PM What is 586 minutes after 12:11 PM? 9:57 PM How many minutes are there between 8:00 AM and 7:18 PM? 678 What is 302 minutes after 7:12 PM? 12:14 AM What is 687 minutes before 11:33 PM? 12:06 PM How many minutes are there between 11:59 PM and 6:05 AM? 366 How many minutes are there between 9:39 PM and 1:53 AM? 254 How many minutes are there between 7:33 AM and 2:15 PM? 402 What is 342 minutes before 3:02 AM? 9:20 PM What is 591 minutes before 12:30 PM? 2:39 AM How many minutes are there between 7:54 PM and 4:18 AM? 504 How many minutes are there between 1:35 PM and 9:29	{ "pile_set_name": "DM Mathematics" }
y) = -2y - 34. Let j be f(-19). What is the fourth smallest value in u, 0.3, -4/7, j? j Let u = -19/48 - -1/16. Let i = 5.053 - 4.553. What is the second biggest value in -5, u, i? u Let z = -6 - -28. Let u = 21 - z. Let t = 0.451 + -0.051. Which is the fourth smallest value? (a) 0.2 (b) t (c) 5 (d) u c Let w(n) = 80n - 1222. Let b be w(17). What is the second biggest value in b, 0.4, -1? 0.4 Let n = -262.23 - -264.3. Which is the third smallest value? (a) -2/11 (b) 4 (c) n b Let p = 451 + -451.4. What is the second biggest value in p, 12, -153? p Let k = 5.6 + -2.79. Let h = k + -3.31. Which is the third smallest value? (a) -8/9 (b) 0.5 (c) h (d) 0.4 d Let o = 1913.9 + -1914. What is the second smallest value in 4, -3/7, 2/3, -46, o? -3/7 Suppose -5o + 4n + 15 = 0, -3o + o = -2n - 8. Let p = -141 - -141.81. Let r = p - 0.61. What is the biggest value in r, o, -4? r Let t be (-6)/(-21) + 3/14. Let l = 637 + -586. Let v be l/85 - 4/(-10). Which is the third biggest value? (a) t (b) v (c) 0 (d) -2 c Suppose -2n - 2r + 2 = n, n + r = 0. Suppose -nl = l - 60. Suppose j + f = 3f + 8, -j + l = -5f. Which is the biggest value? (a) 1.2 (b) -1 (c) j a Suppose -6m - 10m + 32 = 0. Suppose 0 - 16 = 2t + mr, t = -3r - 18. Which is the fourth smallest value? (a) 0.4 (b) -0.4 (c) 1/5 (d) t a Let w = 280/3 + -92. Let h = -0.4 - -1.4. Let z = 71/3 - 24. Which is the fourth biggest value? (a) 4 (b) w (c) h (d) z d Suppose -3h - 4p = -12, -3p - 20 = -5h - 2p. Let x = -1115 + 1109. Let s = 11 + x. Which is the third biggest value? (a) h (b) 20 (c) -0.3 (d) s a Let i = -7485 - -7485.4. Which is the smallest value? (a) 3 (b) 3/2 (c) i (d) 0.2 (e) -3/2 e Let f = 204 - 206. Suppose -v - 15 = 5w, 5v - 128w + 29 = -130w. What is the smallest value in v, -4, 0, f? v Let j = -39 + 38.81. Let g = -4.068 - -0.258. Let o = j + g. What is the biggest value in 0.3, 2/5, o? 2/5 Let q = 108 - 307. Let g = q + 198.7. Let n be (-2)/33/6. Which is the second biggest value? (a) g (b) -5 (c) n c Let k = -23619/4 - -5902. What is the third smallest value in -0.1, 1, 3, k, -4? -0.1 Let x(c) = -c*2 + 17c + 43. Let a be x(19). Let l be 2/4 - 22/60. Let v be -6 + 0 - 980/(-161). What is the biggest value in l, -0.2, a, v? a Let v = 20539.2 + -20539. What is the third smallest value in 7, v, 5.53? 7 Let c = -2.4 - -2.8. Suppose 0 = -4g - w + 3, -2g + 16w - 21w - 3 = 0. Let i = -1.3 + 4.3. What is the second biggest value in g, -1/11, i, c? g Let b = 0.00791 + -0.09791. What is the third biggest value in -4, b, 0.37, 2/15? b Let w = 25927/5 - 5185. What is the fifth smallest value in 14, -0.3, 1, w, 0.5? 14 Let t = -1043 - -9385/9. Which is the third biggest value? (a) t (b) 0 (c) -8 (d) -3 (e) 3/4 a Let m(t) = 2t3 - 17t*2 + 35t - 1. Let s be m(5). Which is the fourth smallest value? (a) 0.3 (b) -0.1 (c) -0.06 (d) 0.5 (e) s a Let f = -4189 + 4185. What is the fourth smallest value in 0.06, -3, 8, f? 8 Let s = 32 + -32. Let h = -34 - -49. Let k be ((-110)/825)/((-24)/(-9) - 2). Which is the fourth smallest value? (a) h (b) k (c) s (d) 5 a Let n = -16853.5 + 16854. Let i = 190/3 + -2476/39. Let m = -1132/7 + 162. What is the second biggest value in m, i, n? m Let m = 27 + -31. Let w = -5473/6 - -912. Which is the biggest value? (a) 0 (b) w (c) m a Let y be 0 + -1 + 5 + (-200)/5. Let s be (y/30 - -1)1. What is the second biggest value in -0.5, s, 4? s Let h(m) = 9m + 35. Let l be h(6). Let x = 87 - l. Which is the second biggest value? (a) x (b) 1 (c) -3/2 (d) -3 c Suppose -y + j + 147 = 4y, -y - 2j + 25 = 0. Let k = y + -59/2. Let h = -2.5 - -2.3. Which is the second smallest value? (a) k (b) -3/5 (c) h a Let a = -3 - 0. Let u = 676 + -746. Let n be -1 - a - (-168)/u. What is the second smallest value in -0.5, n, 3? n Let v = 4 - 8. Suppose 2103 = 4q + 5367. Let s be (4/(-3))/2 - (-68)/q. Which is the second smallest value? (a) -1 (b) v (c) s (d) -9 b Let x be -131 - -65 - (21/(-3))/(-1). Which is the fourth biggest value? (a) -0.3 (b) 4 (c) -7 (d) x (e) 2/5 c Let c = -487 - -473. Let n = -43/3 - c. Let v(x) = -x2 + x - 2. Let l be v(0). What is the second biggest value in -23/6, l, n? l Let f = -893 - -8029/9. Let l = -1.35 - -0.35. Which is the biggest value? (a) -2 (b) 0 (c) l (d) f b Let g be (-54)/(-72) + 2 + (-12514)/4552. Let k = g + -179807/3414. Let w = k + 52. Which is the second smallest value? (a) -0.3 (b) 2 (c) w (d) 5 a Let k = -161 + 1447/9. Suppose 8t - 3t = -4n - 15, -2n - 6 = 2t. Which is the second biggest value? (a) 0.4 (b) n (c) k (d) -1 b Suppose 2b = -2p - 8, -3p + 6b - 13 = 8b. Let j be ((-156)/(-117))/(p/(-3)). What is the third smallest value in -4, j, 5/2? 5/2 Let h = 4.41527 + -0.36337. Let d = 0.0519 - h. What is the smallest value in 1/12, 1, d? d Let v = 15.6 - 15.1. What is the fifth smallest value in -9, -1/4, -3/8, v, -1.6? v Suppose z + 2 = 30. Let o = -11 + z. Let s = 90.86 + -85.86. Which is the smallest value? (a) 4 (b) s (c) -1/6 (d) o c Let u = 5612 + -95402/17. Which is the third biggest value? (a) u (b) -3/11 (c) 1/4 (d) -0.05 d Let c be (-8 - -6)/((-14)/1106). What is the second biggest value in -1, -2/13, c? -2/13 Let z = 14497 - 14491. What is the smallest value in 1/3, z, -13, 2? -13 Suppose -39s = -78s - 46s + 85. Which is the fifth biggest value? (a) 93 (b) 0.5 (c) 0 (d) 5 (e) s c Let o be ((-2)/88)/(3 + 52/(-16)). Let s be (0 - 14)(-114)/(-133). Let g be (-52)/(-16) - (-3)/s. Which is the second smallest value? (a) g (b) -1 (c) o c Let a = -2 + 5. Let h = -10924.42 + 10924.4. What is the fourth smallest value in 4, h, a, 1/2? 4 Suppose g = 1 + 1. Let z be g - (3 + 12/(-9)). Let x be (-2)/26 + (-8)/(-8). Which is the second smallest value? (a) z (b) -3/2 (c) x a Let h = -663.6 + -176.4. Let r = h - -837. Let d = 1.4 + -8.4. What is the third smallest value in -0.4, r, 0, d? -0.4 Let h = -1288 - -32204/25. What is the smallest value in h, -0.4, 2? -0.4 Suppose 5696d - 1940 = 5676d. What is the third biggest value in 4, d, -31? -31 Let a = -1866 - -1869.5. What is the third biggest value in a, 1, 0.4? 0.4 Let i = 27 + -32. Let g = -3 + 5. Let r = 0.834 + 3.166. Which is the third smallest value? (a) r (b) i (c) -0.4 (d) g d Suppose -2 - 3 = m. Let p = -49.5 + 48. Which is the fourth smallest value? (a) m (b) 0.2 (c) p (d) -1 b Suppose -600o - 1698 = -1166o. Let t = 0.1 - 0.1. Let b = t - -1. What is the smallest value in -2/11, o, -1/7, b? -2/11 Let x = -254.079 - -0.079. Let r = -287 - x. What is the third smallest value in r, 2/11, -1/3? 2/11 Let w(k) = k - 2. Let s be w(-2). Let q = -33/52 + 1315/2236. Let i = -6457 + 6461. What is the second biggest value in q, i, 0.3, s? 0.3 Let m be (-1)/(-6)96/15. Which is the second smallest value? (a) -2/7 (b) -2/17 (c) m (d) 69 b Let f = -2.36 - -1.86. Let g = 0 - 14. Let q = -13.7 - g. Which is the second biggest value? (a) f (b) -3 (c) q a Let k = 0.114 - -505.886. Let u = k - 509. Which is the second biggest value? (a) -0.8 (b) 2 (c) u a Let l = 15.7 + -103.7. Let q = l - -88.2. Which is the biggest value? (a) -0.8 (b) q (c) -0.01 (d) -0.3 b Let u = 226 - 226.152. Let n = -0.252 - u. Let g = 0.11 - -7.89. Which is the smallest value? (a) -3/4 (b) n (c) g a Let s = -0.1734 + 0.2734. Which is the smallest value? (a) 2/15 (b) -2/13 (c) -4/25 (d) s c Let k = -95.77 + 65.77. Let r = 19 - 113/6. Which is the second smallest value? (a) r (b) -3/4 (c) k b Let o = -642 - -335. Let j = -351 - o. What is the biggest value in -0.2, j, 0? 0 Let f = -246/665 + -4/133. Which is the fourth smallest value? (a) -0.5 (b) 2/27 (c) f (d) 2 (e) -1/7 b Let h = 74 - 73.8. Let k be -4 - ((-2)/5)/(4/20). What is the second smallest value in k, h, -0.09? -0.09 Let g = -5606 + 5604. Which is the second biggest value? (a) g (b) 2 (c) 0.39 (d) -0.2 c Let d = 863 - 861. What is the third biggest value in 0.3, d, 0.01, -0.5, 2/7? 2/7 Let c = -144 - -162. Suppose -3t = -3y - c, -5y + 4*t = 41 - 16. What is the biggest value in y, -1/3, 6, 4/7? 6 Let u be 15/(-180) - 148/(-48). What is the second smallest value in -0.234,	{ "pile_set_name": "DM Mathematics" }
= -2i - 0, -4s = 3i - 8. Let j(c) = -c3 + 24c + 23. Let a be j(-1). Solve -z + a = -s for z. 5 Suppose -o - 1 = -w, o + 2w + w - 15 = 0. Suppose -4j + 2r + 4 = 0, -7 = -or + 5. Let f be ((-6)/7)/((-6)/28). Solve j - 7 = -fh for h. 1 Let o(p) be the first derivative of p7/840 - p4/24 - 5p*3/3 - 2. Let x(g) be the third derivative of o(g). Let r be x(1). Solve 5k + 5 = -r for k. -1 Let r = 40 - 39. Suppose 2c + 3c - 10 = 0. Let p be 5/c8/5. Solve 0 = -w + p - r for w. 3 Let d be ((-98)/70)/(-1 - (-4)/5). Suppose -z = 2t - 6 + 1, -3z + 2t + d = 0. Solve -p + 16 = zp for p. 4 Let i = 238 - 220. Solve 3f - 9f - i = 0 for f. -3 Let m be (122/(-31) - 56/868) + 33. Solve 40 + 18 = mr for r. 2 Let h be 4/10 + 724/(-10). Let a = h + 72. Solve -2g - 6 = -ag for g. -3 Suppose 2s = 25 + 9. Suppose -4n = -53 + s. Solve -d - n = -4 for d. -5 Let h be -3 + 20/(-14)-7. Solve -33 + h = 13c for c. -2 Let g be 68/14 + -4 + 174/42. Let b be -1 + (6/(-10))/((-1)/g). Solve ba - 17 + 7 = 0 for a. 5 Let l be (6/2)/(-3)8. Let u be (-4)/l - (-27)/6. Let i be ((-28)/70)/((-1)/u). Solve 12 = ir + r for r. 4 Let z(i) = 27i*3 + 4i*2 - 5i. Let b be z(1). Solve 2 = -6s + b for s. 4 Let z(o) = o3 - 7o*2 + 6o - 1. Let q be z(6). Let m be q(0/(-2) - 2). Let w = 274 + -272. Solve 0c + mc + w = 0 for c. -1 Let a be (-1)/7 - 1564/(-119). Solve 4l - a = -5 for l. 2 Let d be 10/7 + 18/(-42). Solve 0l = -l - d for l. -1 Let m = -17 - -18. Suppose 27 = 2w - m. Suppose -5z + w + 11 = 0. Solve -4b = z - 1 for b. -1 Let y be (-2)/(-6)3(0 - -2). Suppose -y = 4g + 3k - 11, 2k - 6 = -5g. Solve g = 6i - i for i. 0 Suppose 0 = q + 14 - 19. Suppose u - 4u + 15 = qk, 0 = 3u. Solve kp + 8 = p for p. -4 Let f = -18 + 71. Suppose -5l + f = 8. Solve 5s - 29 + l = 0 for s. 4 Let i = -1368 + 1392. Solve 5r + 3r = i for r. 3 Let i = 26 + -26. Let q be (-7 + 1)/(-3 + i). Let l be 0/(q - (-2 + 2)). Solve 4h - 3h + 4 = l for h. -4 Let x = 302 + -300. Suppose n - 42 = -4k - 3, -k + n = -16. Let b = k - 8. Solve -3 - b = xj for j. -3 Suppose k = 3 + 1. Suppose 0 = 3w - kg, 3w - g = -2g. Solve wb + 3 = -b for b. -3 Let s be (3/(-2))/((-792)/256 + 3). Solve 4a - 60 = sa for a. -5 Let z(f) = -f*2 + 10f - 18. Let d be z(4). Let y be 3 + (3 - (-21)/(-6))d. Solve 0 = -2c - 4 - y for c. -2 Suppose -2u + 2h - 8 = 3u, -3u - 5 = -h. Let g be (0 + -1)(u + 0). Suppose go - 39 = -31. Solve -o + 16 = -4f for f. -3 Let q(t) = -5t - 26. Let o be q(-14). Let v = o + -41. Solve -vf + 4 = 1 for f. 1 Let k = 5 - 6. Let w be 5/10(-1 - k). Solve -m + 0 - 4 = w for m. -4 Let m be 12/9(8 - (-30)/(-24)). Solve 0 = 6b - m - 3 for b. 2 Let f be 60/8(-144)/(-30). Solve 40v + 4 = fv for v. -1 Let b = 69 + -101. Let w be 3/(-2)b/12. Solve wn = n - 6 for n. -2 Suppose -9j + 75 = -8j. Let s = j - 75. Suppose 0 = -p, -4p + 7p + 3 = y. Solve -3r + s = y for r. -1 Let k(m) = m - 6. Let f(b) = b*2 - 2b - 9. Let i be f(5). Let g be k(i). Solve g = w - 2w for w. 0 Suppose 160 = 4m + k - 2k, 4k = 4m - 160. Suppose 0p = -5p + m. Suppose 2y = x - p, -3x = x + 5y + 7. Solve xg - 5 = -3g for g. 1 Suppose -24k - 10k + 918 = 0. Solve -3n - 6n + k = 0 for n. 3 Suppose 8q = 160 + 72. Let n = 33 - q. Suppose 3z - 3v + 5v - 3 = 0, -4v = -4z + 4. Solve z - n = -g for g. 3 Suppose -3q + 48 = -111. Let l = -22 + q. Let h = 47 - l. Solve 4a - 4 - h = 0 for a. 5 Let s be ((-3)/(-9))/((-2)/(-6)). Suppose 3z + l - 7 = -0z, z + l = s. Solve -15 = -zk + 6k for k. -5 Suppose -v = 4w + 4, 3v + 3w - w - 8 = 0. Let k(h) = h2 - 3h - 1. Let u be k(v). Let q be 92/6 + (-4)/(-6). Solve up = -p + q for p. 4 Let m be (0/(-37))/(5 + -1). Solve 13o + 1 - 1 = m for o. 0 Suppose 7u - 11 - 24 = 0. Solve -4k = k - u for k. 1 Let q(g) = g*3 + 13g*2 + 12g + 11. Let j be q(-11). Let d be 2/11 - 22/j. Solve d = -u - u - 6 for u. -3 Let w be 7 - (1 - (4 - 5)). Suppose -2f + 18 + 10 = 3b, 0 = 3b + wf - 25. Solve -b = -3j + j for j. 5 Suppose 2j + 30 = 40. Solve 4s + 5 = js for s. 5 Let w = -387 + 387. Solve 0 = -wo - 2o + 2 for o. 1 Suppose -s - 27 = -2i, -i + 33 - 6 = -5s. Suppose -3d + i = 6. Solve -4a = 10 - d for a. -2 Suppose -4k + 7k = 30. Suppose k = -2q - 4h, 3h = -5q + q. Solve 7m + 8 = qm for m. -2 Suppose 5k = -3p + 2, -k - 2 = -4k - p. Solve -2d + k = -d for d. 1 Suppose 0 = i + 4u - 25, 2u - 19 + 78 = 5i. Solve -9f = -if for f. 0 Suppose 63 = 4w - 1. Suppose 4j + w = -4b + 6b, 5b + 2j - 16 = 0. Solve -bo - 7 = 1 for o. -2 Let w be (-2)/401. Let n be (1 - w) + (-26)/(-1). Suppose -24o - 9 = -no. Solve 8k = ok + 15 for k. 3 Let v be 10/(20/9)2. Solve vb = 17b + 16 for b. -2 Suppose -7n = -2d - 5n, 12 = 3n. Solve 4b - 6b = -db for b. 0 Suppose 0 = 3h - 19 + 16. Solve -1 - h = -2d for d. 1 Let r(x) = 2x3 + x2 - 6x + 5. Let s be r(1). Solve a - 1 + s = 0 for a. -1 Let d(g) = -g*2 - 47g - 170. Let u be d(-43). Solve 3 + 7 = -ub for b. -5 Let y(u) = u. Suppose -5c + 2m = 4 - 125, 3c - 73 = m. Let p be (10/c)/(2/10). Let i be y(p). Solve -id = 3d for d. 0 Let w = -645 - -653. Solve -3u = -u - w for u. 4 Let d be (-8)/28 - 16/(-7). Suppose p - d = 3. Suppose -2 + p = b. Solve bv = -v - 12 for v. -3 Suppose -25n + 35n = 190. Solve -nz + 8z = 11 for z. -1 Suppose 6m - h = m + 19, 3m = 2h + 10. Solve -9o + 11o + m = 0 for o. -2 Let c = 88 + -65. Solve 0 = -4m - 7 + c for m. 4 Let p = -58 - -54. Let w be 2(-4 + 3) - p. Solve wo + 16 = -2o for o. -4 Let k = -45 - -54. Suppose -3h + 1 = 2z - k, z + 6 = 4h. Solve 0 = 2t + zt + 8 for t. -2 Suppose 0 = -0z - z + 2. Suppose 0 = 5m - 0g + 4g - 56, -m + zg = -14. Solve m - 2 = -2y for y. -5 Let s(x) be the first derivative of -5x2/2 - 29x + 16. Let o be s(-6). Solve -i + 2 = -o for i. 3 Let p be (-9)/(30/(-21) - -1). Solve -4w + p = 5 for w. 4 Suppose 8b - 7b = 0. Suppose -5 = -5n - bn. Suppose -4m + 4h = -n + 9, -5h + 25 = 0. Solve -4d = m + 17 for d. -5 Suppose 4f - 73 = p - 0p, 3p = 4f - 75. Suppose -2x = -20 + f. Solve x = -2o + 5 for o. 2 Let h(z) = 3z*3 - 3z*2 + 3z - 1. Let g be h(1). Suppose 0 = -gn + 17 - 13. Solve 2t + 20 = -nt for t. -5 Let y be -5 + 5 + (0/(-2))/(-1). Let c be (-50)/(-20) + (2/4 - y). Solve -ci = -8i - 10 for i. -2 Suppose -33 = s - 5n - 4, s + 3n - 11 = 0. Let g be (-2)/s(9 - (-20)/(-4)). Solve -5p + g = -4p for p. 2 Let r be 134/14 + (-4)/7. Let z(p) = p*2 + 5p*2 - 3 - 2p - rp2 - p3. Let u be z(-3). Solve 0b + 3 = ub for b. 1 Suppose 3s - 3 = s + h, -2h = -s + 6. Solve -5b + 0 + 5 = s for b. 1 Let z be 0 + -6 - (5 + -16). Solve 0 = -3l + 4 + z for l. 3 Let g = 98 - 27. Let i = -69 + g. Solve -iz - 2z - 12 = 0 for z. -3 Suppose -8 = -4i - 4t + 8, 3i + 4t = 13. Solve ib = -7 + 1 for b. -2 Suppose -811 = -3j - 772. Solve 0 = -3v + jv + 20 for v. -2 Suppose 4j + 66 = 86. Solve 2q - jq = 0 for q. 0 Suppose 6 = 2x - 0. Let y be (4/8)/(x/30). Solve 0 = -l - 0l - y for l. -5 Let z(s) = s*3 + 4s*2 - 4s - 4. Let f be z(-4). Let h = 15 - f. Solve -3l - h = -2l for l. -3 Suppose 4g = -3x + 47, -2g = x - 27 + 6. Solve -t + 4 = g for t. -4 Suppose 0 = 32r - 2362 - 3878. Solve 6g = -219 + r for g. -4 Suppose -119p + 111p + 24 = 0. Solve -pv + 0 = -9 for v. 3 Let r(j) = -j - 42. Let a be r(-19). Let o = a - -26. Solve -of = -f for f. 0 Let h(d) = d + 2. Let g be h(-2). Let t(x) = x3 + 5x*2 - 12x + 17. Let n be t(-7). Solve 9 = -nf - g for f. -3 Suppose -3m + 20 = -25. Let y be 1/62 + (-5)/m. Let g be 3/6 + (-3)/(-2). Solve -l - gl + 3 = y for l. 1 Suppose -s + 0 = -1. Let w be 24/2s/2. Let v be (w/(-9))/(6/(-27)). Solve vp = -p for p. 0 Let q be (-30)/60(-3 - -3). Solve -281p + 284p - 12 = q for p. 4 Suppose 0 = -2m + m. Suppose m = -4o - 4l - 4, 3o - 2 = -4l - 9. Suppose 5t - 2 = o. Solve -k = -0k - t for k. 1 Let r be (-260)/50 + (-4)/5. Let y = 11 + r. Suppose u = m - 5, -3m + 0 = -yu - 15. Solve -4 = -n + mn for n. -1 Let o = 11 - 3. Suppose 3x - 21 = -3v, 4v - 36 = -x - o. Solve k + v = 2 for k. -5 Let h(g) = -g*3 - 3g*2 - 16g - 37. Let f be h(-3). Solve -2 = -f*j - 4	{ "pile_set_name": "DM Mathematics" }
is the second biggest value in t, z, s? z Let z = -36 - -30.9. Let o = -2.1 - z. What is the second biggest value in o, -1.1, -4? -1.1 Suppose -m = 2m. Let q(w) = -w2 + w + 1. Let n be q(-1). Let z be ((-20)/4 - -2)/(8 - 3). Which is the second smallest value? (a) m (b) z (c) n b Let g = 10 - 2. Let t(w) = w3 - 8w*2 - w + 11. Let j be t(g). Which is the smallest value? (a) j (b) 5 (c) 0 c Let h = 3 + 9. What is the third biggest value in 4, h, 3, -1/2? 3 Suppose 11 - 7 = -f. What is the third biggest value in 2/3, 7, f? f Let f = -5.218 - -0.018. Let v = 0.2 + f. Which is the biggest value? (a) 2/3 (b) 2 (c) v b Let b = 1657 - 124277/75. Let m = b + 164/525. What is the biggest value in 0.08, -0.5, m? m Let n = -0.5 + 0.1. Suppose 0z - 3z = -12. What is the smallest value in z, 0.2, n? n Let r be (0 - (-5 + 2)) + 56/(-22). What is the second smallest value in r, -1, 0.2? 0.2 Let h = 0.4 - -0.1. Let f = -0.8 + -2.2. What is the third smallest value in 0, f, h? h Suppose 0f = 4r + 2f - 10, 0 = r - 3f - 20. Which is the third smallest value? (a) -2/13 (b) 2/5 (c) r c Let f = 8 - 11. Let t be f + -1 - (-68)/18. What is the second biggest value in -5, -4, t? -4 Let j = 71/14 + -46/7. Which is the second smallest value? (a) 0.3 (b) -5 (c) j c Let q(n) = -n + 1. Let l be q(5). Let j = -1.94 + -0.06. Which is the second smallest value? (a) 0.4 (b) j (c) l b Let o(b) = -4b - 14. Let l be o(-4). What is the third biggest value in l, -3, 0.5? -3 Let g = 2.2 + -1.2. Let w = -8 - -3. Let v be ((-6)/4)/(w/(-2)). What is the smallest value in -2/5, g, v? v Let a be -7(-5)/((-35)/(-6)). What is the biggest value in 0.07, -5, a, 4? a Let c = 0.32 - 0.02. Let g = 0.18 - 5.18. What is the second biggest value in 0.5, g, c? c Let p be (-32)/(-6) + 7/(-21). Let d be (3/p)/((-2)/10). Which is the third smallest value? (a) -4 (b) d (c) 0 c Suppose 0 + 44 = -11v. Let l = 0.4 - 0.5. Let f = -1/88 + 269/440. Which is the second biggest value? (a) v (b) l (c) f b Suppose -j - 7 = -4x, -4j + 3x + 0 - 2 = 0. What is the third biggest value in -5/3, -3, j, 2/7? -5/3 Let f = 1.3 + -2.3. Which is the second biggest value? (a) f (b) -8/3 (c) -4 b Let g = 35.6 - 42. Let x = -6.1 + 0.1. Let n = x - g. Which is the third smallest value? (a) n (b) 2 (c) 1/6 b Let p be 20/(-9) - (-2)/9. What is the biggest value in -2/15, p, 0.3? 0.3 Suppose -2v = 3v. Suppose v = -4k + 7 + 1, -3k + 24 = -2l. Let u be l/(-5) + -2 + 0. What is the second biggest value in 1, 0.3, u? 0.3 Let s = 0 - -0.2. Let q = 9 - 6. Let v = 0 + q. What is the biggest value in s, 1, v? v Let r = -0.5 + 0.3. Let z(k) = -k*3 - 8k*2 + 5k + 10. Let y be z(-8). Let v be (-8)/80y/(-4). Which is the biggest value? (a) v (b) -0.5 (c) r c Let m(k) = 3k*2 + k - 1. Let x be m(-2). Let w = -9.7 - -10. Which is the third biggest value? (a) w (b) x (c) -0.2 c Let q = 0.19 - 1.89. Let z = -0.3 + q. Let k = z + 1. What is the biggest value in k, 3/5, -3? 3/5 Let q = 45 - 41. Let f be 6/164/(-6). Which is the second biggest value? (a) 2 (b) f (c) q a Let s = 25 + -39. Suppose 7w - 206 = 312. Let q be w/s - (-2)/7. What is the second biggest value in 2/5, -3, q? -3 Let h = 0.1 - 0.1. Let w be (7/3 + -3)/(-2 + -1). Which is the second biggest value? (a) h (b) 0.1 (c) w b Let y = -16.11 + 16. Let s = y - -0.01. What is the biggest value in -2, 1, s? 1 Let n(p) = -p + 1. Let r be n(4). Which is the third biggest value? (a) 2/3 (b) r (c) 0.5 b Let y = -7.9 - -8. Suppose 0 = 5x - 10 - 0. Let w be (x + (-1 - 0))-1. Which is the smallest value? (a) y (b) w (c) 3/4 b Let w = -16.9 - -17. Let v = -1 - -1. Suppose -k + 0k = v. What is the second biggest value in k, 2/7, w? w Let q = -72099 - -11103201/154. Let u = 3/22 - q. What is the third smallest value in u, -2/9, -2? u Let v = -3.1 - -0.1. Suppose -5h = -4p - 0h - 70, 4p + h + 82 = 0. Let d be (-4)/p + 13/10. Which is the second biggest value? (a) -0.3 (b) v (c) d a Let d = 39 + -39.3. What is the second smallest value in -0.2, -2/9, d? -2/9 Let f = -9.1 + 8.1. Which is the smallest value? (a) -0.15 (b) -0.4 (c) f c Let z = 0.021 + -0.421. What is the smallest value in -5, 4, z? -5 Let s = 0.27 + -1.27. Which is the second smallest value? (a) 4 (b) 2 (c) s (d) 1 d Let s = -4/101 - -723/404. Which is the fourth biggest value? (a) -1 (b) -0.2 (c) 5 (d) s a Let h(r) = r*3 + 8r*2 + 3r - 23. Let c be h(-7). What is the third biggest value in 1, -0.3, 4, c? 1 Let j be (-11 + 2)(-6)/(-9). Let k be j/2114/6. What is the second smallest value in 2/3, 1, k? 2/3 Let x = -16 + 15.8. What is the biggest value in x, 3, 5, -1? 5 Let o = -152 + 145. Let h = -3 - -2.8. Which is the second smallest value? (a) o (b) h (c) 2/13 b Let k(d) be the second derivative of -d*5/20 + 5d*4/12 - 5d*3/6 - 3d*2/2 - d. Let s be k(4). Which is the second biggest value? (a) s (b) -4 (c) -1 b Let i = -5.6 + 14.3. Let l = i - 9. What is the second biggest value in 0.3, l, -0.4? l Let s = 1.1 - 0.7. Let y = s - 1.4. Let p be 75/42 - (-4)/(-14). Which is the third smallest value? (a) 2 (b) y (c) p a Let x = 0 + -0.05. Let o = -2.6 + 2.45. Let c = o + x. What is the third biggest value in -0.1, c, 3/8? c Let l be ((-4)/(-10) - (-110)/(-525))3. What is the second smallest value in -0.3, 5, l? l Let b = -6.11 + 5.8. Let m = b + -0.09. What is the smallest value in 2, m, 1/2? m Let h = 14 + -11. What is the second biggest value in 3/2, h, 0? 3/2 Let g = 0.05 - -5.95. Let o = g + -11. What is the second biggest value in 4, o, -3? -3 Let r = 56 - 33. Suppose 5x + r = -5z + 2z, -2x = 8. Let c = -0.1 - 0. What is the second biggest value in z, -4/7, c? -4/7 Let k = 0 + -0.2. Let w = 0.5 + -0.3. Let s = -0.1 + w. Which is the second smallest value? (a) s (b) -2 (c) k c Let h be ((-17)/2)/((-1)/10). Let u = h - 511/6. Let t = -1.4 + -0.6. Which is the biggest value? (a) u (b) t (c) 0.3 c Let l = -13 + 20. Let g = -6 + l. Which is the biggest value? (a) g (b) -4 (c) -2 a Suppose -3q - q = 24. Let j = 11 + q. Which is the biggest value? (a) -4 (b) -2 (c) j c Let g be (-5)/(-2)(-1 - 1). Let l = -0.05 - -0.75. Let m = l - -0.3. Which is the third smallest value? (a) -3 (b) m (c) g b Let q = 13/12 + -5/6. Let o = -7 - -4. What is the smallest value in 4, o, q? o Let t = -0.55 + 0.26. Let w = t + -0.01. What is the biggest value in w, -0.4, -3/5? w Let m = -0.1 + -0.1. Suppose -11w = -8w - 12. Which is the third smallest value? (a) m (b) 0.5 (c) w c Suppose -g + 10 = -l + 152, 0 = -2g - 3l - 299. Let u = g + 1013/7. Let m = -16 + 11. What is the third biggest value in m, u, -3? m Let u = 1 + 0. Suppose 7m = 2m - 5. What is the smallest value in u, m, 2/7? m Let q = -1 + 3. Suppose 4 = -5d - 2s - 0, qd + 3s - 5 = 0. Which is the second smallest value? (a) 5 (b) -0.5 (c) d b Let w be (-2)/(-4) + 2/12. Let t be 184/6 - 1/(-3). Let r = t - 154/5. Which is the third biggest value? (a) -4 (b) w (c) r a Let q be ((-1557)/18)/(2/(-4)). Let x = q + -362. Let w = 1325/7 + x. Which is the second biggest value? (a) w (b) 1 (c) 3 b Let z = -45.24 - -45. What is the second smallest value in 2, 1, z? 1 Let w = 0.01 + -2.01. Let h = 1.9 + 0.5. Let y = w + h. What is the biggest value in 0, -3/4, y? y Let m = -0.1 - -7.1. Let s = m + -8. Which is the second biggest value? (a) s (b) -3 (c) -2 c Let j = 12 + -12. Let u = -2.8 + -0.2. Which is the third biggest value? (a) u (b) -0.2 (c) j a Let o = 1.4 + -1.6. Let c(n) = -3n2 + 3n + 4n2 + 3n - 7. Let q be c(-7). What is the smallest value in -2, q, o? -2 Let p = -5.4 + 5. Let z = -4.86 - -5. Let m = z - -0.06. Which is the third smallest value? (a) 0.5 (b) p (c) m a Let t(n) = 54n - 4. Let h be t(3). Let g = h - 1108/7. Let f = -31 + 36. Which is the second smallest value? (a) 1/2 (b) f (c) g a Let p = -3 - 0. Which is the second biggest value? (a) -0.4 (b) p (c) -1 c Let p = 27 + -17. Let i = p + -4. Let q be ((-1)/6)/((-8)/i). Which is the third biggest value? (a) 0 (b) q (c) 0.2 a Let k be -2(-6)/21 + 161/(-196). Let a be 38/(-42) - (-2)/6. What is the second smallest value in k, 2, a? k Let h = -5 - -4.6. Let	{ "pile_set_name": "DM Mathematics" }
*3 + 138n*3 wrt h. -140h*3n*3 + 20k*2n Find the third derivative of -265l6 - l5 - 275l*2 wrt l. -31800l*3 - 60l2 Find the third derivative of -f3tv*3 - 2f*3tv2 - 2f*3t - 2f3v*2 + 4f*2v*3 - ftv3 - 11fv2 wrt v. -6f*3t + 24f2 - 6ft What is the derivative of -115o + 154? -115 Find the first derivative of 241k4 + 45. 964k*3 What is the first derivative of -2f*2 - 3326f + 18707 wrt f? -4f - 3326 What is the third derivative of 2337f*2y*3 - 5f*2y*2 + 90f*2y + 6 wrt y? 14022f2 Find the first derivative of -329v*4 + 86. -1316v*3 What is the first derivative of -91rw2 - 2rw + 7r - w*3 + 5w*2 - 1760 wrt w? -182rw - 2r - 3w2 + 10w Find the third derivative of -398g4 - g2 - 115g. -9552g Find the second derivative of d4 - 253d*3 - 5d - 20 wrt d. 12d2 - 1518d Find the second derivative of 181t3x2 + t3x + 5tx + 162x*2 wrt t. 1086tx2 + 6tx Find the third derivative of 46m*3y*3 - 21m*3y*2 + 2m*2y*2 - 11my5 - 2my2 wrt y. 276m*3 - 660my2 What is the third derivative of 14621t*4 - 2t*2 - 89t? 350904t Differentiate 5o*2 - 667o - 20103. 10o - 667 Differentiate -20km3 - km*2w + 248k + mw + w wrt m. -60km*2 - 2kmw + w What is the second derivative of -23053s2 - 21889s? -46106 Find the third derivative of -613g3 - 816g*2 + 3g. -3678 What is the derivative of -78q4 + 2q - 151 wrt q? -312q3 + 2 Find the first derivative of 133m*2x*2 - 18m*2x + 2mx*2 - 6x*2 + 86 wrt m. 266mx2 - 36mx + 2x*2 Find the third derivative of -82k*2y*4 - 12k*2y*2 - 7k*2y - k2 - y5 wrt y. -1968k2y - 60y2 What is the second derivative of 2gu3x*2 - gu*2 + 2gx2 - 4gx - 3u*3 + x wrt x? 4gu3 + 4g Find the third derivative of 5845ioqr*3 - ioqr*2 + 2iq2r*3 - 13iq2 - 13iqr*2 - ir - oq2r*2 - 2q*2 wrt r. 35070ioq + 12iq*2 What is the second derivative of 97j5 - j4 + 1144j wrt j? 1940j*3 - 12j*2 Find the third derivative of -7886h*4 + 23h*2 + 33h - 5. -189264h Differentiate -2kn3s*3 + 642kn3s - 15n3s*3 + 7n*3s wrt k. -2n3s*3 + 642n*3s Find the third derivative of 423g3 + 28g*2 + 2 wrt g. 2538 Find the third derivative of -15751j*3m - 7226j2m wrt j. -94506m Find the second derivative of 2767c*2 - 28c + 422. 5534 Find the second derivative of 24064w2 - 15317w wrt w. 48128 Find the third derivative of -8f3h*3 + 85f*3 - 109f*2h*3 - 12f*2h*2 wrt h. -48f*3 - 654f*2 What is the third derivative of 2122y*5 + 5y*3 - 19961y*2 wrt y? 127320y*2 + 30 Find the second derivative of 2nuv*3 - 197nuv + 783nv*4 + 2u wrt v. 12nuv + 9396nv2 What is the third derivative of 767n6 - n2 + 53n? 92040n*3 Find the third derivative of -173dfl*3r + dfl*3 + dl*3r + dlr - 7d + 2fl + 3l*2r + 2r wrt l. -1038dfr + 6df + 6dr Find the first derivative of -2q2v*3y - 3q2v + 791qv*3y + 36qv*3 + qv wrt y. -2q2v*3 + 791qv3 What is the third derivative of -445g6 - g5 - g*4 + 64g*2 + 9g wrt g? -53400g3 - 60g*2 - 24g What is the first derivative of 31u4 + 2u + 643 wrt u? 124u3 + 2 What is the first derivative of biw2 - bi + 147bw*2 + 3iw2 + 7iw - w2 wrt b? iw*2 - i + 147w*2 What is the third derivative of -98a*5 + 22a*4 + 15a*2 + 4a + 45? -5880a2 + 528a Find the first derivative of 222mw*2x*3 - mx*3 - 615w*2 + wx*3 wrt m. 222w*2x3 - x3 Find the third derivative of -86djk3 - 26djk*2w + 3dk*3w + 5dkw + 2jk2 + 2k*2w wrt k. -516dj + 18dw Find the first derivative of 4b2v*3 - 215b*2v + v*3 + 177v wrt b. 8bv*3 - 430bv What is the first derivative of 3i*3qx2 - 54i*3q - 2ix*2 - ix + 1 wrt x? 6i3qx - 4ix - i Differentiate -126g*3r3 - g3 + 812r3 with respect to g. -378g*2r*3 - 3g*2 Find the third derivative of 4g*4lu + 5g*4u - g*3l*2 + 40g*2l + 2gl*2u + l*2 wrt g. 96glu + 120gu - 6l2 Differentiate 8860c*2p - 36p - 108 with respect to c. 17720cp Find the third derivative of -140i*6 - 9i*4v - i*2 - 10iv - 2v - 35 wrt i. -16800i3 - 216iv Differentiate -97k*2ot3 - k2o + 579k2t*3 - 2k*2t with respect to o. -97k2t3 - k2 What is the first derivative of 547s + 3219? 547 Differentiate -mp*2 + 8mp + 173m + p*2 wrt p. -2mp + 8m + 2p Differentiate bdp3 + 6268bdp + 429bp*3 - 3bp + 2p*3 wrt d. bp*3 + 6268bp Find the third derivative of 2c*4y - 2c3yz + 10c*3y + 3c3z - 2c2yz - 4c*2 - 4y - z wrt c. 48cy - 12yz + 60y + 18z What is the third derivative of 10011z4 + 21322z*2 wrt z? 240264z What is the third derivative of 178b5 - 257b*2 wrt b? 10680b*2 Find the second derivative of 3b*3 + 13b*2 - b - 51. 18b + 26 Differentiate -8124l3z + 6l3 + 915 with respect to z. -8124l*3 Find the second derivative of -7i*5 + 42i4 + i2 + 14443i wrt i. -140i*3 + 504i*2 + 2 What is the second derivative of -1778o*3 - 1536o? -10668o Find the second derivative of -73a*3 + 3a*2 - 1168a - 1 wrt a. -438a + 6 Find the third derivative of -24m*2p*4 + 13m*2p - 9mp*3 - 2mp2 + 41m - 2p4 - 3p*2 wrt p. -576m*2p - 54m - 48p What is the derivative of 15x3 + 33x*2 + 494? 45x*2 + 66x Find the second derivative of 1850d2 + 9d + 69. 3700 Find the third derivative of -87u6 + u5 + 332u*2 wrt u. -10440u*3 + 60u*2 Find the second derivative of -5p*5 - 174p4 - p2 - 944p. -100p*3 - 2088p*2 - 2 Find the third derivative of 10r*4 + 3r*3 + 47r*2 wrt r. 240r + 18 Find the first derivative of 53l3 - 3l*2m*3 + 661m*3 - 2m wrt l. 159l2 - 6lm3 Find the first derivative of 2u*4x*2 - 76u*3x*2 + 3x*2 - 29x wrt u. 8u3x*2 - 228u*2x*2 What is the second derivative of 13s*5 - 65s*3 - 686s? 260s3 - 390s Find the third derivative of 414i3 - 248i2. 2484 What is the derivative of -m3v3 - 38m*3v*2 - 7v*3 - 4v wrt m? -3m2v*3 - 114m*2v*2 Find the second derivative of 94il3 + 3il - 4i - l*3 + 6l wrt l. 564il - 6l What is the second derivative of 15m*4y + 10m2y - 529my wrt m? 180m2y + 20y Find the first derivative of -144x*2 + 2x - 2572. -288x + 2 Find the first derivative of -224h + 873. -224 Find the third derivative of 2a3q + 391a3 + 46a*2q + 2q wrt a. 12q + 2346 What is the first derivative of -12n3 + 6n*2r*2 - 249r*2 wrt n? -36n*2 + 12nr2 Find the second derivative of i5 + 81i*3q + 2iq + 90i + q wrt i. 20i*3 + 486iq Find the third derivative of -26h*5 - 2h*4 - 153h*2. -1560h*2 - 48h Differentiate 3jm*2s - 189js + m*2s - 5m - 2s wrt j. 3m2s - 189s Find the second derivative of -54y5 + y2 - 55y + 1 wrt y. -1080y*3 + 2 Find the second derivative of -11c*3 - 99c*2 + 14c + 22 wrt c. -66c - 198 What is the first derivative of i3 + 405i*2u*2 - 4458u*2 + 1 wrt i? 3i*2 + 810iu2 What is the second derivative of 2pq2y*2 + 16pqy + 2py*2 + 52q*2y*2 + y wrt q? 4py2 + 104y*2 Differentiate -2i*2r*2 + 3i*2 + 20ir2 + 243r*2 with respect to i. -4ir2 + 6i + 20r2 Find the third derivative of 354i*3q*3 + 2i*3q - 67iq*2 wrt q. 2124i*3 Find the third derivative of 205o*4 + 6o*2 + 14o wrt o. 4920o What is the derivative of -33n*3x*4 - 6n*3x*2 - 320n*3 wrt x? -132n*3x*3 - 12n*3x Find the second derivative of -986b2d + 2bd + 32d - 3 wrt b. -1972d What is the derivative of 119w - 231 wrt w? 119 Find the second derivative of 2s*4 + 184s*3 + 7s*2 + 2833s. 24s2 + 1104s + 14 What is the third derivative of -502d3 + 844d*2 + d? -3012 What is the third derivative of 2a*6y + 7a5 - 2a*2 - 48ay + y wrt a? 240a*3y + 420a2 What is the second derivative of 254i*3o*2u*2 + 11i*3o + 2i2ou2 - iu**2	{ "pile_set_name": "DM Mathematics" }
is the second derivative of m(h) wrt h? -12h2 What is the first derivative of -122b*4 + 54 + 133b4 - b3 - 8 wrt b? 44b3 - 3b*2 Let u(w) = 2w3 + w2 - 4w + 4. Let a(c) = -c3 + c2 + c - 1. Let f(x) = -4a(x) - u(x). What is the third derivative of f(h) wrt h? 12 Let z = -14 + 21. Differentiate -7f + zf - 3 + f*3 - 11f*3 wrt f. -30f*2 What is the first derivative of 7 + 12 + 12z*4 + 9z*4 wrt z? 84z*3 Suppose 3k = 2k + 3. What is the second derivative of -7j*2 + kj*2 + 3j2 - j2 + j wrt j? -4 Let l(j) be the first derivative of -j6/90 + j4/6 - j*3 - 2. Let r(q) be the third derivative of l(q). Differentiate r(z) wrt z. -8z Let x(r) be the second derivative of -17r4/12 + 14r*3/3 - r. Find the second derivative of x(l) wrt l. -34 Suppose -4k + 24 = -k. Find the second derivative of 5d4 - 12d*4 + kd*4 - 3d wrt d. 12d2 Let w(o) be the second derivative of -o5/2 + 3o*4/2 - 9o. What is the third derivative of w(c) wrt c? -60 Let d = 10 - -5. Suppose -4k - k = -d. Differentiate ck - 4 + 6 - 1 with respect to c. 3c2 Let p(q) = -q2 - 1. Let r(l) = 4l2 + 9l + 6. Let t = -22 + 16. Let w(o) = tp(o) - r(o). What is the second derivative of w(k) wrt k? 4 Let s(i) = -6i*2 - 9. Let l(k) = 1. Let u(q) = -4l(q) + s(q). What is the derivative of u(w) wrt w? -12w Let n(v) be the third derivative of -23v*4/8 + 35v*3/3 - 8v*2 + 4v. What is the first derivative of n(l) wrt l? -69 Let i = -17 - -28. Suppose i + 4 = 3y. What is the second derivative of t - 3t*y + 4t*5 + 0t wrt t? 20t3 Let v(k) be the second derivative of 9k*8/14 + 5k*4/2 + 17k. Find the third derivative of v(n) wrt n. 4320n3 Let l = 8 - 6. Suppose lk = 3u - 15, u + k + 3 = -k. What is the second derivative of 3s*5 + s + 0s*u + 5s*3 - 5s*3 wrt s? 60s*3 What is the third derivative of -3g*3 + 10g*3 + 6g*3 - 26g2 + g3 wrt g? 84 Let d(j) = j2 + 1. Let s(l) = -l2 + 20. Let w(o) = -d(o) + s(o). What is the derivative of w(h) wrt h? -4h What is the derivative of -5 + 3x*4 - 2x*4 + 11 wrt x? 4x3 Let a(p) = p + 12. Let o be a(-10). What is the derivative of -1 + 0 + 2 + o + w4 wrt w? 4w3 Let p be 3/((-2)/(1 + -3)). What is the third derivative of 4j*p + 0j2 + j2 + j2 - j2 wrt j? 24 Suppose -r - 5j - 10 = 0, r - j - 9 = 5. Suppose -3k - 4 + r = 0. What is the second derivative of -3o + 2o*2 - ko2 + o3 wrt o? 6o Let a(j) be the third derivative of 1/12j*4 + 2j*2 + 0j*3 + 1/70j*7 + 0j*6 + 0j*5 + 0j + 0. Find the second derivative of a(n) wrt n. 36n2 Find the third derivative of 20f2 + f4 + 0f4 - 4f*4 - 15f*2 wrt f. -72f Let o(n) = 73n2 + 45n + 5. Let v(k) = -37k2 - 22k - 3. Let q(c) = 3o(c) + 5v(c). Find the second derivative of q(r) wrt r. 68 Let x(c) be the first derivative of c*6/10 + 3c*2/2 + c + 1. Let d(l) be the first derivative of x(l). Find the first derivative of d(t) wrt t. 12t3 Let k(c) be the first derivative of -c7/168 + c*6/180 - 5c3/3 + 3. Let a(p) be the third derivative of k(p). Find the third derivative of a(o) wrt o. -30 Let p(u) be the second derivative of -u5/2 - 7u3/6 - u. What is the second derivative of p(m) wrt m? -60m Let z(j) = j*4 - 11j*2 + 6j - 6. Let y(f) = f*4 - 23f*2 + 13f - 13. Let o(q) = 6y(q) - 13z(q). Find the third derivative of o(g) wrt g. -168g Let c = -1 - -4. What is the derivative of 0t + 2t - 3t - c - t wrt t? -2 Let g = -1 - -6. Find the third derivative of 6t2 + 2t*3 - 9t*2 - gt3 wrt t. -18 Let w(q) be the third derivative of q5/60 - q4/8 + q3/3 - 3q2. Let d be w(3). Find the second derivative of -3v + 3v + v3 + dv wrt v. 6v Let n(z) = 2z + 2. Let y be n(-1). Find the first derivative of -a*2 - 2 - 4 + y wrt a. -2a Let n(p) be the first derivative of 2p6/15 - 5p*3/6 - 4p + 3. Let t(w) be the first derivative of n(w). What is the second derivative of t(y) wrt y? 48y2 Let d(j) = 2j*2 + j + 1. Let t be d(-1). Differentiate t + i - 2 - 1 with respect to i. 1 Find the third derivative of -19w*2 + 39w*2 + 0w*6 - 3w*6 wrt w. -360w3 Let d = 5 + -2. What is the third derivative of n2 + 0n2 - 2n*3 + dn3 + n3 wrt n? 12 Suppose 3a - 3h + 2 = 23, 2a = -h + 11. What is the third derivative of c2 - 5c*a + 8c6 - c2 - c*2 wrt c? 360c*3 Let c be ((-1)/(-2))/(1/6). Suppose -2j + cj - 12 = -2t, -3j = 3t - 21. What is the second derivative of s5 - s5 + s*t + 2s wrt s? 20s3 What is the first derivative of 26 + 8s*2 + 9s2 - 5 - s2 wrt s? 32s Let q(v) be the third derivative of -5v8/84 + v5/20 + 22v2. Find the third derivative of q(w) wrt w. -1200w2 Let f(g) be the first derivative of g - 2 - 2 - g2 + 4 + 1. What is the derivative of f(v) wrt v? -2 Suppose 4 = 33q - 31q. Differentiate 10 - 8 - 6lq + 2l*2 with respect to l. -8l Let x(m) be the second derivative of -m8/2240 + m7/2520 + m*4/4 + 3m. Let k(s) be the third derivative of x(s). Find the third derivative of k(y) wrt y. -18 Let q(d) be the first derivative of -3d2 + 0d*3 + 5 + 0d*4 + 0d - 2/5d5. What is the second derivative of q(w) wrt w? -24w2 Let i = -3 + 5. Let z be i - (0 - (1 - 1)). Find the third derivative of v2 + v*4 + 2v*2 - 2v*z wrt v. 24v Find the second derivative of 0q - 4q - q + q - 4q4 wrt q. -48q2 Let h(o) be the second derivative of o4/6 + 9o2/2 - 14o. Find the first derivative of h(p) wrt p. 4p Find the second derivative of 9y*3 + 14y - 47y + 25y - 27y3 wrt y. -108y Let w = 1 - -1. Suppose -2a - 2m + 8 = -0, 3a = 4m - w. What is the derivative of 4 - 2ya - 3 - y2 wrt y? -6y What is the third derivative of 770o6 - 3o*2 - 771o*6 + 4 + 0o*2 wrt o? -120o*3 Find the third derivative of -34b*3 + 21b*3 - 32b*2 + 16b*3 wrt b. 18 Find the second derivative of -4x*4 + 284x*2 - 5x - 284x2 wrt x. -48x*2 Suppose -3h - 6 = -5h. Find the second derivative of -9p*h + 9p*3 + 5p*4 + 9p - 4p wrt p. 60p*2 Let g(o) = -6o*4 + 8o*3 - 6o2 - 8. Let v(x) = x4 - x3 + x2 + 1. Let r(k) = -3g(k) - 24v(k). Find the third derivative of r(m) wrt m. -144m Let c(w) be the second derivative of w8/2240 - w6/240 + w4/4 + 2w. Let s(u) be the third derivative of c(u). What is the second derivative of s(n) wrt n? 18n Suppose 0 = g + 4 - 6. Let m(p) be the second derivative of 0 + 1/12p*4 - p + 1/3p*3 + 0p*g. Find the second derivative of m(r) wrt r. 2 Suppose 0 = 2x - 5f + 5 + 15, 0 = 3x - f + 4. What is the second derivative of -7y + 4y*4 + 2y*5 + xy - 4y4 wrt y? 40y*3 Let y(h) = 11h*2 + 3h - 2. Let q(l) = -11l2 - 2l + 3. Let o(g) = 2q(g) + 3y(g). What is the second derivative of o(c) wrt c? 22 Let o(y) = -y*2 - 6y + 8. Let b be o(-7). What is the derivative of -b + 3m + m - 4m + 5m3 wrt m? 15m*2 Let k = -20 - -20. Let q = 1 - -1. What is the third derivative of 2g3 - g2 + kg2 - gq wrt g? 12 What is the first derivative of -8u*4 + 13u*4 + 6 - 8u*4 - 1 wrt u? -12u*3 Let r be ((-10)/3 + 2)-3. Find the third derivative of 4m2 - 58m*5 - rm*2 + 2m*2 + 54m*5 wrt m. -240m*2 Let q(j) = 6j*3 - 4j*2 + 3j + 4. Let y(w) = 6w3 - 5w*2 + 2w + 5. Let a(p) = 5q(p) - 4y(p). Find the second derivative of a(z) wrt z. 36z Let z be (-57)/15 - -3 - (-3 - -2). Let i(c) be the second derivative of 0c*4 + 0c*3 + 1/2c*2 + 0 + c - zc*5. What is the derivative of i(y) wrt y? -12y2 What is the second derivative of d5 - 320d + 17d2 + d5 + 274d wrt d? 40d*3 + 34 Let y(q) be the third derivative of 0q*5 - 3/2q*3 + 0q*6 + 0q - 7q2 + 0 + 0q*4 + 1/42q*7. Differentiate y(i) wrt i. 20i*3 Find the third derivative of 12b*2 - 4b*2 + 7b*2 - 17b*5 wrt b. -1020b2 Let k(w) = -w3 + 6w2 - 5w + 2. Let z be k(5). Find the third derivative of 4x5 - 23x - 3xz + 23x wrt x. 240x2 Suppose 5y + 2 = 3l, 0 = y - 3y + l. Let d(v) be the first derivative of 4/3v3 + 2 + 2v*y + 0v. What is the second derivative of d(f) wrt f? 8 What is the second derivative of o + 22o*	{ "pile_set_name": "DM Mathematics" }
2 + a + 1. Calculate nt(r) + y(r). -3r*2 Let f(w) = -5w + 3. Let i(h) = 4h - 3. Suppose -175u = -92u - 85u - 10. Determine ui(n) - 6f(n). 10n - 3 Let n(c) be the third derivative of 0c3 + 0 - c2 + 0c + 1/24c*4. Let g(k) = 387k + 1936. Let l be g(-5). Let q(h) = h. Give ln(t) + 2q(t). 3t Let r(b) = 44b + 25. Let o(z) = -115z - 65. Let n(i) = 10o(i) + 26r(i). Let g(q) = 12q + 4 - 4. Calculate 2g(x) + 5n(x). -6x Let i(y) = 17y*2 - 17y + 13. Let u(d) = d + 7 + 2d - 12d + 6d2 - d3. Let m be u(5). Let a(s) = -8s - 2 + 8s2 + 6 + 2. Calculate ma(j) + 6i(j). -2j*2 + 2j Let f(g) = -5g3 + 286g*2 + 5g - 6. Let c(b) = b3 + b2 - b + 2. Determine -3c(t) - f(t). 2t*3 - 289t*2 - 2t Let b(v) = -5v2 + 6. Let y(r) = 30 - 17 + 119r*2 - 118r*2 - 14. Determine -2b(n) - 11y(n). -n2 - 1 Let g(w) = 8w*2 - 241w + 2. Let v(y) = -y*2 + 9y - 1. What is g(u) + 2v(u)? 6u*2 - 223u Let x(q) = -18q2 - 31q + 4. Let u(h) = -7h2 - 9h + 1. Determine -8u(n) + 3x(n). 2n2 - 21n + 4 Let v(m) = 300m + 85. Let z(q) = 485q + 127. Calculate -8v(d) + 5z(d). 25d - 45 Let r(n) = -3n*3 - 29n*2 - 33n + 11. Let c(g) = g*2 + 3g - 1. Determine 12c(v) + r(v). -3v*3 - 17v*2 + 3v - 1 Suppose -b + 4b = -5z - 6, 5z + b + 12 = 0. Let u = 0 - 2. Let j(v) = -29v + 101v + 3 - 28v - 21v - 22v. Let n(y) = -2. Determine uj(m) + zn(m). -2m Suppose -15r - 50r = -260. Let f(l) = -6l*3 + 4l - 2. Let o(s) = -5s3 + 3s - 1. What is ro(t) - 3f(t)? -2t3 + 2 Let r(n) = 161n*2 - 23n. Let w(q) = -2q2 - 10q - 11. Let o be w(-6). Let y(c) = 27c2 - 4c. Calculate oy(i) + 4r(i). 23i2 Let q(l) = 5l + 1. Let v(u) = 44u + 24. Give -6q(m) + v(m). 14m + 18 Let y(b) = 0b - 5806b2 + 0b + 5824b2 + 1 - 5. Let w(p) = 35p*2 - 7. Give 4w(a) - 7y(a). 14a2 Let s(f) = f3 + 4f2 + 11f + 9. Let v be s(-1). Let q(k) = -4. Let p(d) = -d. Determine vq(h) - p(h). h - 4 Let f(t) = -5t - 2160. Let i(b) = -4b - 2160. Give -3f(z) + 4i(z). -z - 2160 Let n(l) be the third derivative of 3l*4/8 + 21l*3/2 + 19l*2 - 28. Let y(s) = 1. Calculate 3n(t) - 189y(t). 27t Let a(d) = 57643374d - 740853. Let w(c) = 7158c - 92. Calculate 4a(k) - 32211w(k). 7158k Let z(h) = -40 + 3h - h*2 - 18 + 58. Let l = -1 - -3. Let s(j) = -3j*2 + 8j + 0jl - j. Calculate 4s(p) - 9z(p). -3p2 + p Let c(a) = -a3 + 3a2 + 5a. Let k(y) be the first derivative of y*4/2 - 5y*3/3 - 9y*2/2 + y - 212. Let s = 174 - 169. Give sc(h) + 3k(h). h3 - 2h + 3 Let f(k) = -12k3 + 2k - 3. Let h(x) = -50x3 + 7x - 12. Let y(c) = -15f(c) + 4h(c). Let l(v) = 41v3 + 3v + 5. Give 3l(b) + 5y(b). 23b3 - b Let w(z) = -4z*2 + 1314z - 25. Let o(r) = 2r2 - 658r + 11. Calculate -9o(l) - 4w(l). -2l2 + 666l + 1 Let y(g) = -9g + 7. Let b(n) = -53 + 61 + 127n - 137n. Let t be -1 - 3/(6/8). Calculate tb(w) + 6y(w). -4w + 2 Let v(w) = 2 - 4 + 2w - 1 - 3w + 4. Let t(c) = 3c - 18. Calculate t(u) + 2v(u). u - 16 Let b(s) = 80s + 731. Let v(f) = 68f + 731. What is -5b(z) + 6v(z)? 8z + 731 Let x(i) = 9i - 3. Let u(h) = -2h + 2 + 15h - 12h - 8h - 2h. Give -5u(f) - 4x(f). 9f + 2 Let d(v) = v - 15. Let h(t) = -2520t + 600. Calculate 40d(f) + h(f). -2480f Let a(k) = -15k*2. Let i = 1 - 26. Suppose 62d = 65d + t + 10, -3t = 3. Let b(f) = 2f2. Calculate da(g) + ib(g). -5g*2 Let i(d) = -2d*3 - 5d - 5. Let x = -139780 + 139776. Let c(q) be the third derivative of q6/120 + q4/12 + q3/3 + q2. Determine xi(w) - 10c(w). -2w3 Let d(f) = -15f*2 - 5f + 5. Let l(g) = -8g2 - 3g + 3. Suppose 11p = p - 580. Let x be (-61 - p)/(0 - -1). What is xd(r) + 5l(r)? 5r*2 Let j(p) = -2p3 + p2 - 4p. Let u(v) = 6v*3 + 154v*2 + 9v - 1. Give -2j(b) - u(b). -2b*3 - 156b*2 - b + 1 Let l(w) = 7w*2 + 5362w + 8. Let m(q) = 3q2 + 2682q + 3. Determine 2l(p) - 5m(p). -p*2 - 2686p + 1 Let l(f) = -30f + 17. Let o(b) = -121b + 55. Calculate -11l(s) + 3o(s). -33s - 22 Let n(m) = -60m + 13. Let r(j) = 40j - 9. Let u(v) = -v3 - 95v*2 - 446v + 367. Let p be u(-90). Calculate pr(z) + 5n(z). -20z + 2 Let h(y) = 9y - 15258. Let p(r) = 4r - 7639. Determine -2h(d) + 5p(d). 2d - 7679 Let t(h) = 2h3 + 5h*2 - 3h + 5. Let c = 458 - 460. Let d be c/(-8) + (-760)/(-160). Let b(u) = -2u3 - 6u*2 + 4u - 6. Give db(k) + 6t(k). 2k3 + 2k Let g(d) be the third derivative of -d4/4 + d3/2 + d*2. Let t(w) = -3 - 25w + 50w - 24w + 5 - 3. Determine 2g(l) + 6t(l). -6l Let c(k) = -16k*3 + 2k*2 - 2. Let r(y) be the second derivative of -47y*5/20 + 7y4/12 + y3/6 - 7y2/2 - 13835y. What is 7c(u) - 2r(u)? -18u3 - 2u Let v(b) = -5b2 - 5b - 8. Let l(j) be the second derivative of -j*4/3 - 5j*3/6 - 7j*2/2 - j - 353. Calculate 6l(f) - 5v(f). f2 - 5f - 2 Let d(m) = 55m2 - 5m - 5. Let n(z) = 138z2 - 12z - 12. Let c = 9643 - 9631. What is cd(o) - 5n(o)? -30o2 Let s(p) = -244p*2 - 7p + 7. Let i(k) = 213k2 + 9k - 6. Give -3i(w) - 4s(w). 337w2 + w - 10 Let x(f) = 9f*3 - 2f - 2. Let k(v) = -v3 - v2 + v + 1. Let s = -188 - -187. Let m be ((-119)/35 + 3)s5. Give mk(c) + x(c). 7c*3 - 2c*2 Let q(t) = 7t*3 - 6t*2 - 3t + 2. Let j(o) = -13o3 + 10o*2 + 6o - 1. What is 3j(n) + 5q(n)? -4n3 + 3n + 7 Let q(y) be the third derivative of 7y4/24 + 5y*3/2 + 9872y*2. Let a(z) = 20z + 45. Calculate 6a(u) - 17q(u). u + 15 Let x(c) = c - 439. Let v(n) = 3n - 875. Determine -4v(r) + 9x(r). -3r - 451 Let b(l) = 3l + 114. Let p(g) be the first derivative of -g2 - 57g + 10760. Give 3b(s) + 5p(s). -s + 57 Let s be ((-16)/52)/((-26)/169). Let f(v) = -9vs - 5 - 6v*3 + 245v + 234v - 488v. Let a(g) = 3g3 + 4g*2 + 4g + 2. Calculate -9a(r) - 4f(r). -3r3 + 2 Let r = 688 + -697. Let u(q) = -2q*2 + 2q + 5. Let i(c) = -8c2 + 7c + 21. Give ru(j) + 2i(j). 2j2 - 4j - 3 Let b(t) = 5 - 2t - 2 + 0 - 7 + 7. Let g(x) = -x - 1. Determine b(c) + g(c). -3c + 2 Let u be (-17)/((-34)/(-4)) + 1. Let b(l) = l - 1. Let m(j) = j*2 + 2j + 1. Let w(h) = 3h2 - 2h + 17. Let c(t) = 2m(t) - w(t). Give uc(z) + 6b(z). z2 + 9 Let p(f) = -1. Let k(x) = 12x + 37 - 15x - 3x - 41. Determine k(g) - 5p(g). -6g + 1 Let y(t) = -t*2 - 81t - 236. Let n be y(-78). Let c(j) = -4j + 2. Let p(x) = -1. Calculate nc(o) - 4p(o). 8o Let k(s) = 91568676s. Let q(a) = 5119a. Calculate -2k(i) + 35777q(i). 5111i Let q(o) = 5o*2 - 2o + 4. Let g(z) = 9z2 - 4z + 7. Suppose 41r + 91r = 31r - 303. Give rg(c) + 5q(c). -2c*2 + 2c - 1 Let r(w) = -10w3 - 2w*2 + 7w + 233. Let o(h) = -18h3 - 4h*2 + 12h + 466. Give -4o(m) + 7r(m). 2m3 + 2m*2 + m - 233 Let g(b) = 2b. Let l(n) = -n*3 + n. Let c be (288/(-42) + 4)14/(-4). Let z be c/(-4) + (-4)/(-8). What is zl(p) + g(p)? 2p*3 Let n(g) = -23g - 11. Let t(q) = -2q - 4. Give n(k) + 5t(k). -33k - 31 Let o(h) = 4h*3 - 9h*2 - 2h + 3. Let r(x) = 7x3 - 19x*2 - 4x + 5. Let c = -2813 - -2818. Determine co(g) - 3r(g). -g*3 + 12g*2 + 2g Let p(a) = 132a - 170. Let t(y) = -33y + 41. Give 4p(o) + 17t(o). -33o + 17 Let c(k) = -381k*2 - 17k - 2. Let z(m) = -127m2 - 6m - 1. Give 4c(f) - 11z(f). -127f2 - 2f + 3 Let h(j) = 4j2 - 8j + 4. Let b(y) be the second derivative of -y4/12 + y3/6 + y*2/2 + y - 2778. Give 6b(t) + h(t). -2t2 - 2t + 10 Let m(j) = 8j3 + 29j*2 + 6j - 66. Let x(z) = -7z3 - 25z*2 - 5z + 64. Calculate 6m(y) + 7x(y). -y3 - y2 + y + 52 Let u(l) be the second derivative of -3l3/2 - 9101l. Let y(i) = -19i + 1. What is 9u(k) - 4y(k)? -5k - 4 Let f = 489 - 483. Let y(z) = -z*2 + 2z - 6. Let p(w) = -w*2 + 2w - 5. Let k(l) = -l*2 + 3l + 23. Let u be k(-4). Determine fp(j) + uy(j). -j*2 + 2j Let s(a) = 5a2 + 2a - 2. Let x(g) = g. Let f(h) = -2h2 - 27h - 51. Let t be f(-11). Determine tx(z) - s(z). -5z*2 + 2z + 2 Let i(u) = 6u + 3. Let f(j) be the third derivative of j5/10 - j4/12 - j3/6 + 8j*2. Let r be f(1). Let k(y) = ry + 1 - 4y + 2y. Give i(b) -	{ "pile_set_name": "DM Mathematics" }
u? (a) f (b) 3 (c) -1 a Suppose 2f + f + 9 = 0. What is the closest to -2/3 in -0.2, f, 3/2? -0.2 Let l = 11 + -11.1. Which is the nearest to l? (a) 0.1 (b) -3 (c) -5 a Let u = -2 - -1. Suppose -2s + 5i - 11 = 0, 0 = -s + 4i - 4 - 3. Suppose -4 = -3o - 7. Which is the closest to o? (a) 0.2 (b) u (c) s b Let q = -0.03 + -0.37. Which is the closest to 1/4? (a) 1 (b) 0.5 (c) q b Suppose -3v + 3 = 3x, -2x - 3v + 0 = 1. Suppose xj = j + 15. Let t be 2 - 3 - (-9)/6. What is the closest to 0.1 in 0, j, t? 0 Let k = 36 + -35.5. Which is the closest to 0.3? (a) k (b) -1 (c) -0.1 a Let u = 0.5 - 0. Let x = 0 - -3. Let z(j) = j*3 + 6j*2 + 4j - 6. Let r be z(-5). What is the nearest to 0 in u, r, x? u Let s be (2/(-4))/((-9)/(-72)). Let k = 5 + s. Which is the nearest to 0? (a) k (b) -0.5 (c) 5 b Let u be (-1 - 136/(-36)) + -3. Let n = -4 + 1. What is the closest to n in -1/2, u, -4? -4 Let t(z) = -z3 + z2 + z + 2. Let n be t(2). Suppose l - 3h - 13 = n, 3h + 26 = 5l + h. Which is the closest to 1? (a) 6 (b) 0.3 (c) l b Let m = 35/11 + -3. Let o = -12 + 17. Let q = o + -6. What is the closest to q in -2/9, m, 0.2? -2/9 Let s = 11/105 - -2/21. Which is the closest to -2/3? (a) s (b) 5 (c) 2 a Let d = -18 - -29. Which is the closest to 0? (a) -0.4 (b) d (c) -1/2 a Let i = 808 + -89687/111. Let j = 2227607/2901984 - 899/1376. Let q = j - i. What is the closest to -1 in q, -0.5, -1? -1 Let d be (-2)/6 + (-2)/(-9). What is the closest to 1 in d, 0.2, 1? 1 Let v = -0.01 - 2.99. What is the closest to -0.1 in v, 0.01, -5? 0.01 Let n be (-4)/(-3)(-3)/48. Which is the closest to n? (a) -1 (b) -5 (c) 3 a Let t be (-2 - -1) + (1 - 1). Let n be t/2 + 12/8. What is the closest to n in 2/9, -5, 1/7? 2/9 Let n = -1 + -4. Let m = -3 + n. Let y = m - -7.9. What is the nearest to y in 5, 0.2, 4? 0.2 Let y = -16 + 12. Let r = 4.2 + -4. Which is the closest to 0? (a) 2 (b) r (c) y b Let r = -3.5 - -3. Let k be (2/8)/(5/(-30)). Which is the nearest to -2? (a) -0.2 (b) k (c) r b Let g(n) = n*3 - 4n*2 + 4n - 1. Let x be g(3). Let d = 2 - x. Let j be 14/(-4) + (-1)/2. Which is the closest to d? (a) j (b) -0.5 (c) -0.4 c Let h = 0.3 - 0.5. Let p = 18 - 19.6. Let a = p + 2. What is the nearest to h in -3, a, -2/5? -2/5 Suppose 0 = v - 2v - 4. Let q = -2 + 1. Let w be (-16)/(-12)2/(-8). Which is the nearest to q? (a) w (b) v (c) -3 a Suppose 0 = 3g + 5y - 25, 3y - 20 = -y. Suppose n + n = g. Suppose 3l - 7l = 0. Which is the nearest to l? (a) n (b) 5 (c) 0.5 a Let k = -2 + 1. Let y = 0.09 + 0.11. Let s = y + -0.2. What is the closest to 1 in 0.5, k, s? 0.5 Let f be 56/(-120) - 1/5. Let s = 19 + -22. What is the nearest to f in 2/3, 2/5, s? 2/5 Let t = 4.9 - 5.2. Which is the nearest to 0.19? (a) t (b) -1 (c) 0.5 c Let r be 6 - 1/(1/3). Suppose -3q - 15 = 0, rs - 2q + 6 = q. Let l = s + 11. What is the nearest to 1 in l, -0.1, -1? -0.1 Let j = -3 + 3.1. Let w = 5 + -7. Which is the closest to j? (a) -2/13 (b) 1/7 (c) w b Let s be (-33)/(-22)((-4)/1 - -2). Let n be 0/(-1) - 2/(-4). Let x = 0.1 + -0.3. What is the closest to 1 in n, x, s? n Let s = 7 - 13/2. Suppose -3j - 5 = -17. Which is the nearest to s? (a) 2 (b) j (c) -5 a Let m = 0.05 - 0.25. Let w = 5 - 7. Let i = w + 2. Which is the closest to i? (a) m (b) 3 (c) -5/4 a Let h(l) = l + 14. Let w be h(-12). Suppose p + wp = 9. Which is the closest to -2? (a) p (b) 2/5 (c) 2/13 c Let v be (3/4)/((-15)/(-40)). Let n be (2/8)/(42/48). Which is the nearest to -2/5? (a) n (b) 5 (c) v a Let q be 104/(-240) + 1/(-6)1. Which is the closest to 5? (a) q (b) 1/5 (c) -2/9 b Let o = -0.1 + 5.1. Let g = 28 + -26.7. Let s = -0.3 + g. Which is the nearest to -1/2? (a) s (b) -5 (c) o a Let o(m) = -m - 7. Let x be o(-6). Let v = 22/13 + -119/78. Let y = 1 + 0. What is the nearest to x in v, y, 0.5? v Let l = 1.6 - 1.1. Which is the closest to -0.03? (a) -5 (b) -1 (c) l c Let w be (-3)/(117/6)1. Which is the nearest to 2/5? (a) -2/7 (b) w (c) -0.1 c Let u = -2.8 + 3. Let y = -157 - -152.01. Let s = -0.01 + y. What is the closest to 0 in u, s, -1? u Let k be (-1 + (-8)/2)/(-1). Suppose 2o - kv - 2 = 0, -3v - 4 + 1 = -3o. Let r = 1/26 + 21/130. What is the nearest to o in 2, r, 4? r Suppose -5 - 15 = 5u. Let w = -10.99 - 0.01. Let h = w + 10. Which is the closest to h? (a) u (b) -1/3 (c) 0.3 b Let u = -91 - -91.1. What is the closest to 8 in u, 3, -5? 3 Suppose 2o + 20 = 7o. Which is the nearest to 0.1? (a) o (b) -3 (c) -2 c Suppose 6x - 5 = 5x. What is the closest to 1 in -5, 2/11, x? 2/11 Let d(m) = m + 11. Let r be d(-10). What is the closest to r in 7, 3, 2/3? 2/3 Let x = 419/4 - 105. What is the nearest to -0.2 in x, 3, -5? x Suppose 0 = d + 5d - 4d. Let t = -1/5 + -7/15. Let z = 0.06 + -2.06. Which is the closest to d? (a) t (b) 0.2 (c) z b Let f = -0.41 - -0.11. Let h = -1/69 + -205/138. What is the closest to 0 in -1, f, h? f Let t be (-2)/(-7) + 6/21. Which is the nearest to -1/9? (a) t (b) 0.3 (c) 1 b Let z = -11 - -10.8. Which is the nearest to -1? (a) z (b) 0.5 (c) 0 a Let p = 2/97 + -117/970. Let n = 7.4 - -0.6. Which is the closest to -0.1? (a) n (b) p (c) -5 b Let y = 5.11 - 0.11. Let u = -3.2 + 3.7. Which is the nearest to -1? (a) y (b) u (c) 4 b Suppose -7i - 6 = -4i. Which is the nearest to 1? (a) 3/5 (b) i (c) 0.1 a Suppose -v - 5c = -16, 13 = 2v - 4v - c. Let f be 3 + (120/v)/4. What is the closest to 0.1 in f, -4/7, 5? f Let k = -12.5 + 13. Let t = -3 + 2.2. Let w = t + 3.8. Which is the nearest to -1? (a) w (b) 0 (c) k b Let i(h) = h3 + 7h*2 - h - 2. Let o be i(-7). Let l = -4.94 - 0.06. Let c = 4.5 + l. What is the closest to -1 in c, o, -4/7? -4/7 Let d = -1 - -5. Suppose -dp - 5 = p. Let i = -1125/7 + 161. Which is the closest to i? (a) 0.5 (b) p (c) 2/3 a Suppose -2t - 9 = -3l, -2l - 4t + 6 = -7t. What is the closest to -1/17 in l, 0.5, -1/10? -1/10 Suppose x + 2x = 5r - 26, -5r = -x - 22. Let s = -33/4 - -8. Which is the closest to 1/4? (a) 3 (b) s (c) r b Let u = 2 - 1.9. Let p = 6.2 + -6. What is the nearest to u in 5, p, -2/9? p Let a = -20 - -23. Let j = a - 2. What is the nearest to j in -3, -1, 0? 0 Let y = -218/3 - -74. Let l = 2.128 - 0.028. Let u = l - 2. Which is the nearest to 2/7? (a) -1/9 (b) y (c) u c Let a = 58.4 + -58. What is the nearest to -0.4 in -2/11, -0.4, a? -0.4 Let l be (2/(-10))/((-2)/(-5)). Let r be (12/(-33))/(-9 + 7). Which is the nearest to -1? (a) 5 (b) l (c) r b Let w = -0.2 - -0.4. Let m(o) = -3o - 1. Let r be m(-1). What is the nearest to w in -1, r, -1/3? -1/3 Let v = -2.3 - -4.3. What is the nearest to -0.2 in v, -4, -1.1? -1.1 Let y = -0.1 + -3.9. Let t = 7 - 4. Let l = -3.3 + t. Which is the closest to -0.1? (a) 1 (b) l (c) y b Let v = 0.3 - 0.28. Let x = -2.98 - v. Suppose 4f + 8 = -12. Which is the closest to 1? (a) f (b) x (c) -4 b Let q be ((-20)/(-80))/((-1)/(-4)). Which is the closest to -1? (a) q (b) 3 (c) -4 a Let x = -22 - -25. Which is the nearest to 0.1? (a) 4 (b) -2/15 (c) x b Let w = -13 + 13.07. Let v = w - -0.03. What is the nearest to v in 3, -4, -0.1? -0.1 Let v = 2 + -2.3. Let f = 5 + -4. Which is the nearest to f? (a) 5 (b) -4 (c) v c Let q = -12 - -11. What is the closest to q in -2/9, -0.5, 3? -0.5 Let x = 38.1 + -40. Let o = -0.9 - x. Let s = 0.4 + -0.2. Which is the nearest to o? (a) 1 (b) s (c) -2/3 a Let c = 4.1 - 4. What is the nearest to -2/5 in c, 2/3, -0.5? -0.5 Let x = -68 + 70. What is the closest to 0 in -1/3, x, 0? 0 Let g = -12 - -11.9. Suppose 1 = -2z - 1. Which is the nearest to g? (a) 0.2 (b) 0.3 (c) z a Let s = -0.071 + 4.096. Let c = 0.055 - s. Let b = 0.03 - c. What is the nearest to 1 in 2/19, -1, b? 2/19 Let u be (-23)/92(-1)/(-1). Which is the closest to 1? (a) 2 (b) -3 (c) u a Let u be (8/(-42))/((-24)/28). Which is the nearest to -1/4? (a) u (b) 0 (c) 5 b Let f(r) = -5*r - 2. Let o be f(-1). Which is the closest to o? (a) 0.7 (b) 0.1 (c) 1/4 a Let c = -17609/10710 + 1/765. Let z = -15/7 - c. What is the closest to 0 in 2/11, -5/2, z? 2/11 Let o = 0 + -0.1. Let l = -0.5 - o. Let s = 0.2 - 0.3. Which is the nearest to s? (a)	{ "pile_set_name": "DM Mathematics" }
divided by 16? 13 What is the remainder when 4053 is divided by 193? 0 What is the remainder when 636 is divided by 40? 36 Calculate the remainder when 77 is divided by 16. 13 What is the remainder when 861 is divided by 302? 257 What is the remainder when 398 is divided by 128? 14 What is the remainder when 6832 is divided by 2274? 10 Calculate the remainder when 4708 is divided by 2352. 4 What is the remainder when 334 is divided by 33? 4 Calculate the remainder when 388 is divided by 381. 7 Calculate the remainder when 1572 is divided by 143. 142 What is the remainder when 288 is divided by 27? 18 What is the remainder when 1007 is divided by 46? 41 Calculate the remainder when 233 is divided by 227. 6 Calculate the remainder when 1131 is divided by 54. 51 What is the remainder when 23 is divided by 13? 10 What is the remainder when 55 is divided by 17? 4 What is the remainder when 781 is divided by 130? 1 Calculate the remainder when 373 is divided by 105. 58 Calculate the remainder when 421 is divided by 47. 45 Calculate the remainder when 480 is divided by 15. 0 What is the remainder when 1298 is divided by 21? 17 What is the remainder when 889 is divided by 225? 214 Calculate the remainder when 124 is divided by 62. 0 What is the remainder when 963 is divided by 88? 83 What is the remainder when 1543 is divided by 50? 43 Calculate the remainder when 1278 is divided by 406. 60 What is the remainder when 8 is divided by 7? 1 Calculate the remainder when 1634 is divided by 20. 14 Calculate the remainder when 42 is divided by 16. 10 What is the remainder when 56 is divided by 10? 6 Calculate the remainder when 148 is divided by 40. 28 What is the remainder when 290 is divided by 30? 20 What is the remainder when 2438 is divided by 61? 59 Calculate the remainder when 431 is divided by 215. 1 Calculate the remainder when 3087 is divided by 616. 7 What is the remainder when 478 is divided by 189? 100 What is the remainder when 9050 is divided by 821? 19 Calculate the remainder when 878 is divided by 20. 18 What is the remainder when 769 is divided by 10? 9 What is the remainder when 860 is divided by 245? 125 What is the remainder when 90 is divided by 3? 0 What is the remainder when 1373 is divided by 115? 108 What is the remainder when 7629 is divided by 12? 9 What is the remainder when 47 is divided by 11? 3 What is the remainder when 80 is divided by 12? 8 What is the remainder when 1482 is divided by 124? 118 Calculate the remainder when 48 is divided by 11. 4 Calculate the remainder when 8639 is divided by 64. 63 What is the remainder when 835 is divided by 29? 23 Calculate the remainder when 316 is divided by 106. 104 What is the remainder when 501 is divided by 21? 18 Calculate the remainder when 942 is divided by 15. 12 What is the remainder when 189 is divided by 48? 45 Calculate the remainder when 47 is divided by 22. 3 Calculate the remainder when 380 is divided by 57. 38 What is the remainder when 138 is divided by 77? 61 What is the remainder when 174 is divided by 60? 54 What is the remainder when 1695 is divided by 790? 115 Calculate the remainder when 287 is divided by 80. 47 What is the remainder when 760 is divided by 38? 0 What is the remainder when 324 is divided by 123? 78 Calculate the remainder when 1024 is divided by 220. 144 What is the remainder when 197 is divided by 58? 23 Calculate the remainder when 362 is divided by 13. 11 What is the remainder when 424 is divided by 56? 32 What is the remainder when 27 is divided by 12? 3 What is the remainder when 39 is divided by 22? 17 Calculate the remainder when 1105 is divided by 215. 30 What is the remainder when 1449 is divided by 58? 57 What is the remainder when 7433 is divided by 20? 13 What is the remainder when 158 is divided by 59? 40 What is the remainder when 1103 is divided by 48? 47 What is the remainder when 535 is divided by 187? 161 Calculate the remainder when 2158 is divided by 8. 6 Calculate the remainder when 777 is divided by 12. 9 Calculate the remainder when 325 is divided by 101. 22 What is the remainder when 890 is divided by 318? 254 Calculate the remainder when 208 is divided by 33. 10 What is the remainder when 233 is divided by 102? 29 Calculate the remainder when 476 is divided by 40. 36 Calculate the remainder when 712 is divided by 21. 19 What is the remainder when 1687 is divided by 94? 89 Calculate the remainder when 7825 is divided by 76. 73 What is the remainder when 374 is divided by 113? 35 Calculate the remainder when 545 is divided by 26. 25 Calculate the remainder when 12419 is divided by 18. 17 Calculate the remainder when 9949 is divided by 12. 1 Calculate the remainder when 24 is divided by 17. 7 Calculate the remainder when 208 is divided by 15. 13 What is the remainder when 1775 is divided by 26? 7 Calculate the remainder when 200 is divided by 5. 0 Calculate the remainder when 506 is divided by 15. 11 What is the remainder when 395 is divided by 33? 32 What is the remainder when 3293 is divided by 103? 100 Calculate the remainder when 696 is divided by 44. 36 What is the remainder when 167 is divided by 58? 51 Calculate the remainder when 554 is divided by 62. 58 Calculate the remainder when 999 is divided by 143. 141 What is the remainder when 1173 is divided by 56? 53 What is the remainder when 150 is divided by 17? 14 What is the remainder when 160 is divided by 42? 34 What is the remainder when 110 is divided by 28? 26 Calculate the remainder when 476 is divided by 78. 8 What is the remainder when 97 is divided by 25? 22 What is the remainder when 1353 is divided by 49? 30 What is the remainder when 138 is divided by 131? 7 Calculate the remainder when 144 is divided by 43. 15 Calculate the remainder when 405 is divided by 145. 115 What is the remainder when 1646 is divided by 8? 6 Calculate the remainder when 319 is divided by 36. 31 What is the remainder when 88 is divided by 40? 8 What is the remainder when 217 is divided by 20? 17 What is the remainder when 17576 is divided by 27? 26 What is the remainder when 869 is divided by 16? 5 What is the remainder when 1047 is divided by 96? 87 What is the remainder when 235 is divided by 26? 1 Calculate the remainder when 676 is divided by 21. 4 What is the remainder when 591 is divided by 6? 3 What is the remainder when 1959 is divided by 395? 379 Calculate the remainder when 3416 is divided by 15. 11 What is the remainder when 1786 is divided by 890? 6 What is the remainder when 107 is divided by 9? 8 Calculate the remainder when 262 is divided by 121. 20 Calculate the remainder when 48 is divided by 34. 14 What is the remainder when 173 is divided by 45? 38 Calculate the remainder when 5086 is divided by 12. 10 Calculate the remainder when 98 is divided by 15. 8 What is the remainder when 742 is divided by 95? 77 What is the remainder when 6018 is divided by 251? 245 Calculate the remainder when 210 is divided by 99. 12 Calculate the remainder when 216 is divided by 72. 0 Calculate the remainder when 668 is divided by 38. 22 What is the remainder when 168 is divided by 53? 9 What is the remainder when 1164 is divided by 11? 9 Calculate the remainder when 63 is divided by 15. 3 What is the remainder when 97 is divided by 14? 13 What is the remainder when 570 is divided by 20? 10 What is the remainder when 127 is divided by 36? 19 Calculate the remainder when 620 is divided by 158. 146 Calculate the remainder when 417 is divided by 9. 3 What is the remainder when 464 is divided by 117? 113 What is the remainder when 85 is divided by 47? 38 Calculate the remainder when 414 is divided by 15. 9 Calculate the remainder when 1615 is divided by 16. 15 Calculate the remainder when 151 is divided by 76. 75 Calculate the remainder when 160 is divided by 56. 48 Calculate the remainder when 402 is divided by 68. 62 Calculate the remainder when 62 is divided by 39. 23 Calculate the remainder when 127 is divided by 62. 3 Calculate the remainder when 1211 is divided by 237. 26 What is the remainder when 35 is divided by 21? 14 Calculate the remainder when 555 is divided by 74. 37 What is the remainder when 629 is divided by 314? 1 Calculate the remainder when 229 is divided by 72. 13	{ "pile_set_name": "DM Mathematics" }
0 Let j(t) = 32t + 520. What is j(-18)? -56 Let z(r) = -r3 + 3r*2 - 5r - 37. Determine z(4). -73 Let b(k) = -64k - 461. Calculate b(-7). -13 Let k(z) = -2z*2 + 6z + 66. Give k(7). 10 Let j(l) = 266l + 1324. Determine j(-5). -6 Let l(n) = -4n*2 - 68n - 37. Calculate l(-17). -37 Let v(t) = -t*3 + 13t*2 - 17t - 19. Calculate v(12). -79 Let c(l) = 326l + 450. Determine c(-1). 124 Let b(q) = -2q*2 + 27q + 874. Determine b(29). -25 Let r(b) = -7b3 - 54b*2 - 32b + 9. Calculate r(-7). -12 Let r(m) = 334m - 3344. What is r(10)? -4 Let d(z) = -95z + 232. Determine d(4). -148 Let h(q) = 66q + 502. Determine h(-8). -26 Let d(q) = 5q - 140. What is d(36)? 40 Let t(r) = 4214r + 58967. Give t(-14). -29 Let t(u) = -3u*3 + 18u*2 + 21u. Give t(7). 0 Let r(p) = 67p + 3193. What is r(-48)? -23 Let c(y) = 47y - 557. What is c(12)? 7 Let p(v) = v*3 + 71v*2 + 5v + 357. Calculate p(-71). 2 Let n(q) = -250q + 5285. Give n(21). 35 Let p(d) = 3d*2 + d - 50. Give p(6). 64 Let y(f) = 6f*3 + 444f*2 + 52f + 3845. Determine y(-74). -3 Let c(j) = -j3 + j2 + 6j + 5. Determine c(-1). 1 Let k(m) = 165m - 9. Determine k(-2). -339 Let u(o) = 2o2 + 3035o + 3036. Calculate u(-1). 3 Let j(i) = -25i + 556. Give j(6). 406 Let h(v) = 2v*2 - 84v + 878. Determine h(22). -2 Let d(x) = -19x + 260. Calculate d(17). -63 Let h(i) = i3 - 64i*2 + 64i - 56. Give h(63). 7 Let o(z) = 5z2 - 5z + 4. Give o(-6). 214 Let j(d) = 66d + 3950. Calculate j(-60). -10 Let w(p) = -2p*3 + 98p*2 - 96p + 2. Determine w(48). 2 Let z(p) = -p*3 + 32p*2 - 21p - 54. What is z(31)? 256 Let w(u) = 77u - 403. Calculate w(6). 59 Let r(w) = -3w*2 + 40w - 72. What is r(2)? -4 Let l(v) = -12v2 + 253v - 838. Calculate l(17). -5 Let r(q) = -q*2 + 10q - 50. What is r(0)? -50 Let y(q) = q*3 - 20q*2 + 8q - 182. Calculate y(20). -22 Let x(u) = -u*2 - 8948u - 62586. Determine x(-7). 1 Let a(t) = t*3 - 15t2 - t - 9. What is a(15)? -24 Let o(k) = -k3 + 30k2 + 30k - 167. What is o(31)? -198 Let o(k) = k*3 - 94k*2 + 1420k + 67. What is o(19)? -28 Let f(u) = 95u - 3. Determine f(3). 282 Let w(d) = -276d - 1281. Determine w(-5). 99 Let f(n) = -n*3 + 33n*2 - 273n + 7. Give f(17). -10 Let t(i) = -74i + 228. Calculate t(3). 6 Let f(v) = -103v - 9. Give f(-1). 94 Let r(v) = v*2 + 26v - 44. Determine r(-18). -188 Let x(v) = v*3 - 9v*2 - 5v + 156. Calculate x(6). 18 Let s(t) = -263t + 819. Determine s(3). 30 Let t(r) = r2 + 199r + 7323. Calculate t(-49). -27 Let l(t) = -t*3 + 2t*2 + 32t + 20. What is l(10)? -460 Let k(b) = 6b2 - 580b + 48. Give k(97). 242 Let w(p) = -p*2 + 8p + 38. Give w(-13). -235 Let a(t) = -t*3 - 11t*2 - 17t + 28. What is a(-9)? 19 Let g(v) = -40v2 - 63v + 64. Give g(1). -39 Let g(m) = -51m - 152. Determine g(-4). 52 Let a(f) = -1566f + 28147. Calculate a(18). -41 Let i(x) = 57x - 3036. Determine i(53). -15 Let u(s) = -157s*2 - 2s - 23. What is u(0)? -23 Let z(m) = -25m - 63. What is z(7)? -238 Let z(i) = -i3 + 136i*2 - 664i + 7. Give z(5). -38 Let b(d) = -223d - 36574. Determine b(-164). -2 Let w(g) = -2g*2 - 369g - 8117. Determine w(-159). -8 Let l(i) = 4i2 - 175i + 1655. Calculate l(14). -11 Let g(h) = 840h - 918. What is g(1)? -78 Let v(n) = n3 - 57n*2 - 117n - 70. What is v(59)? -11 Let a(w) = -2w2 - 40w - 521. Calculate a(-21). -563 Let x(c) = 2c2 + 10c + 74. Give x(13). 542 Let n(f) = f*3 + 31f*2 - 63f + 103. Give n(-33). 4 Let z(o) = o*3 + 7o*2 - 5o - 14. Calculate z(6). 424 Let r(p) = p*2 - 91p + 813. Calculate r(81). 3 Let u(q) = 4q3 - 23q*2 - 26q - 3. What is u(-1)? -4 Let u(b) = -5b3 + b2 + 7b - 4. What is u(2)? -26 Let s(r) = -15r - 221. Calculate s(12). -401 Let g(f) = -959f - 4800. Give g(-5). -5 Let r(o) = 2o2 + 68o - 533. Determine r(-43). 241 Let b(s) = -16s + 15. Calculate b(-26). 431 Let j(v) = -2v*3 + 202v*2 - 13v + 1312. What is j(101)? -1 Let n(g) = -43g2 + 1849g + 33. Calculate n(43). 33 Let n(z) = 3745z + 56153. Determine n(-15). -22 Let t(z) = -27z - 122. What is t(-9)? 121 Let h(a) = -113a - 1260. Give h(-11). -17 Let u(r) = 9r*2 + 66r - 293. Determine u(-12). 211 Let y(s) = -s*3 + 6s*2 - 9s - 22. What is y(5)? -42 Let o(z) = -17z + 258. Give o(17). -31 Let v(b) = -b2 - 50b - 311. Calculate v(-43). -10 Let s(h) = 439h - 79452. Determine s(181). 7 Let b(r) = 160r - 13. Give b(1). 147 Let h(o) = -3o2 - 40o - 100. Give h(-3). -7 Let l(p) = -p*2 + 13p - 126. Calculate l(17). -194 Let z(o) = o*3 + 2o*2 + 4o + 3. What is z(-4)? -45 Let o(r) = r*3 + 37r*2 + 41r + 104. Determine o(-36). -76 Let z(x) = -3x2 - 106x + 12. What is z(-38)? -292 Let x(a) = -3a3 - 38a*2 - 106a + 80. Determine x(-6). -4 Let p(w) = 10w2 - 45w + 141. Give p(3). 96 Let d(r) = -r*2 - 141r - 2891. Calculate d(-116). 9 Let z(b) = -27b + 37. Calculate z(1). 10 Let q(y) = y3 - 56y*2 + y - 44. Calculate q(56). 12 Let a(f) = -387f + 3390. What is a(8)? 294 Let j(o) = -24o2 - 2. Calculate j(-3). -218 Let z(q) = -245q - 4163. Calculate z(-17). 2 Let t(y) = -15y2 + 159y + 268. Give t(12). 16 Let a(t) = -289t - 580. Give a(-2). -2 Let r(t) = -t2 + 253t - 14880. Determine r(93). 0 Let p(m) = -127m - 2166. Calculate p(-17). -7 Let v(q) = -15q + 348. Determine v(18). 78 Let a(q) = 33q2 + 22q + 107. Determine a(-4). 547 Let z(y) = -y*2 + 30y + 399. Determine z(38). 95 Let m(h) = -3902h - 35111. Calculate m(-9). 7 Let r(i) = -42i*2 + 3i - 5. Calculate r(1). -44 Let l(v) = v*2 - 230v - 5014. Determine l(-20). -14 Let n(f) = -2f2 + 107f + 980. Calculate n(-8). -4 Let a(x) = 18x3 + 17x*2 - 28x - 91. Give a(-3). -340 Let i(o) = o*3 + 24o*2 - 36o - 58. Calculate i(-25). 217 Let y(h) = -35h2 + 283h + 15. Determine y(8). 39 Let b(i) = -12i3 - 3i*2 + i - 1. Calculate b(-2). 81 Let f(k) = -30k*2 + 5k - 2. Give f(1). -27 Let z(o) = 14o2 - 790o - 790. Give z(-1). 14 Let v(s) = 235s + 9700. Determine v(-41). 65 Let l(a) = 123a - 377. Give l(6). 361 Let l(t) = -t3 - t2 + 35t. Calculate l(-6). -30 Let u(w) = 6w3 + w2 - 5w + 5. What is u(1)? 7 Let p(l) = l3 + 32l*2 - 78l + 25. Give p(2). 5 Let p(g) = g*3 + 126g*2 - 1508g - 145. Determine p(-137). -8 Let g(z) = -z*2 - 375z + 61260. Calculate g(123). 6 Let x(i) = -125i - 1305. What is x(-11)? 70 Let r(a) = 6a*2 + 208a + 50. Calculate r(-34). -86 Let d(s) = 119s + 8687. Calculate d(-73). 0 Let w(y) = 7y*2 - 119y + 5. Determine w(17). 5 Let r(y) = y*2 - 49y - 111. Determine r(48). -159 Let p(n) = -n*2 + 41n - 430. Determine p(20). -10 Let w(s) = -s*2 - 23s + 215. Give w(-18). 305 Let b(k) = -59k - 581. What is b(-10)? 9 Let i(l) = -l3 + 50l*2 - 99l + 79. What is i(48)? -65 Let k(d) = -21d3 + 1031d*2 - 97d - 59. What is k(49)? -10 Let l(d) = -97d + 477. Give l(4). 89 Let v(r) = r3 - 48r*2 + 143r - 25. Give v(3). -1 Let d(n) = 136n2 + 5710n - 76. Determine d(-42). 8 Let c(f) = f*3 + 7f*2 - 218f - 35. What is c(-19)? -225 Let n(i) = 492i - 20663. What is n(42)? 1 Let u(q) = -q3 - 99q*2 + 7q + 639. Calculate u(-99). -54 Let q(g) = -3g2 - 276g + 1129. Determine q(4). -23 Let f(n) = n*3 - 11n*2 + 42n - 79. Determine f(7). 19 Let q(l) = 106l - 7303. What is q(69)? 11 Let i(j) = 57j + 59. Give i(-1). 2 Let m(v) = 2687v + 5. What is m(0)? 5 Let c(k) = 2k*2 - 7k - 1760. Determine c(-28). 4 Let y(t) = 4t2 - 25t + 74. Determine y(8). 130 Let d(v) = -3v3 + 83v*2 + 7177v - 48. What is d(-37)? -11 Let u(f) = -f*3 - 25f*2 - 31f - 764. Calculate u(-25). 11 Let o(y) = 6y3 + 127y*2 + 15y - 198. What is o(-21)? -72 Let f(l) = 3l2 - 58l - 46. Give f(20). -6 Let p(l) = -9l3 - 17l*2 - 6l - 25. Give p(-2). -9 Let d(u) = u*2 - 502u - 15397. What is d(-29)? 2 Let u(q) = -1083q - 19493. Give u(-18). 1 Let q(x) = 671x - 1338. Give q(2). 4 Let l(w) = 78w + 864. Calculate l(-11). 6 Let y(t) = -16674t - 33355. What is y(-2)? -7 Let w(s) = s*3 - 34s*2 + 146s - 87. Calculate w(29). -58 Let j(u) = 28u + 1084. Calculate j(-39). -8 Let l(o) = -12o - 256. What is l(-28)? 80 Let c(x) = 10x*2 - 188	{ "pile_set_name": "DM Mathematics" }
d*4 + 3 to the form md*2 + pd + hd3 + n + cd*4 and give m. -20 Express 10z*2 - 2 + 49z*4 + 11z*3 + 4z*2 + 54z*4 + 61z*4 - 162z*4 in the form fz + az4 + l + mz*3 + tz*2 and give l. -2 Express (3m - 2m + 6m)(m3 - 702m*2 + 1410m*2 - 707m*2 - 60) as hm + am4 + rm*2 + o + dm*3 and give a. 7 Rearrange 3r + 315 + 0r - 19r*2 - 318 + 0r to lr2 + s + jr and give l. -19 Express (3z - 8z + 23z)((-5z2 + 0z*2 + 3z*2)(3z - 2z - 3z) - 16 - 24z*3 + 16) as cz*2 + r + uz*3 + gz*4 + nz and give g. -360 Express (-422 + 422 + 6v)(7 - 14 + 7 - 402v) as h + bv*2 + iv and give b. -2412 Rearrange (2a - 5a + 2a)(-1 + 0 - 1)(-164a + 34a2 + 164a) + (4a3 + 0a*3 - 5a*3)(92 - 88 - 116) to c + xa2 + na*3 + ka and give n. 180 Rearrange 267y - 42y*2 + 8y - 59y to the form cy + ty2 + v and give t. -42 Express (4 + 0 + 1)(-321f - 861f + 66 - 208 + 142) in the form bf + i and give b. -5910 Rearrange (-4 + 4 - q2)(-472q + 759q - 521q) - 36q*3 + 501q - 2 - 501q to fq*2 + u + rq + cq3 and give u. -2 Rearrange -41 + 68k*2 + 32 - 71k*2 to the form ak*2 + n + vk and give a. -3 Express (16i - 7i + 27567 - 4i - 2i - 6238)(4 - 1 - 4) as ui + x and give u. -3 Express -14t4 - 20t*4 - 13 + 37t*4 - 10t*3 in the form ct*2 + n + gt + bt4 + yt*3 and give n. -13 Express (97 - 397c - 97)(-7c*3 + 16 - 11 - 4c*3) as ac*2 + gc + p + uc4 + rc*3 and give u. 4367 Express (2k - 2k + 2k)(9k2 + k2 + 8k2) - 813 + 64k*3 + 813 as gk*2 + tk + b + dk3 and give d. 100 Rearrange (-9n + 1 + 0 - 2)(-5464n + 3098n + 8n*2 - 6n*2) to c + an*3 + fn*2 + qn and give f. 21292 Rearrange (4w2 + 143 + 136 - 258)(4w - 8w + 9w) to the form xw*3 + gw*2 + dw + t and give d. 105 Express -48q - 9q*3 - 35 + 13q + 35q + 171q*3 as zq + xq3 + tq*2 + g and give z. 0 Rearrange -20676y - 40201y + 32467y to the form ry + z and give r. -28410 Express -36l*2 - 5l*2 - 2l*4 + 420577l - 420575l - 4 + 3l*3 as al + ml2 + zl*3 + jl*4 + u and give u. -4 Express 6144m*2 + 243286m - 243286m as v + wm + lm2 and give l. 6144 Express (-k + k - 2k)(7 + 6k - 7) + (6 - 13 + 4)(2k*2 + 0k*2 + 0k*2) - 11k*2 + 4k*2 + 16k*2 as jk + y + ik2 and give i. -9 Express 20v - 1 - 48v2 - 2791v*3 + 5531v*3 - 2739v*3 in the form fv + g + hv3 + uv*2 and give f. 20 Express (-2 - 4 + 5)(-79f + 151f - 497f2 + 1 - 70f) - 16f2 - 5f*2 + 8f*2 in the form zf*2 + mf + x and give m. -2 Rearrange -8c3 + 2492c + 3c3 - 3 - 2498c + (-15c2 - 16c*2 - 5c*2)(2c + 3c - 4c) to the form d + bc + pc3 + ic*2 and give p. -41 Express (999z - 427z - 415z)(0 - 3 + 2)(4 + 1 - 6)(-3z + 0z + 2z) + 1 + 46z - 46z + 3z2 in the form lz*2 + tz + i and give l. -154 Express 2q3 + 5q - q*2 + 45q + 0q + q4 - 55q + 89 as xq + hq*3 + zq*2 + kq*4 + p and give z. -1 Rearrange (0 + 1 + 0)(-2 + 2 - 4v) + 4v - 3v - 3v + (-41 - 26 - 33 + (1 - 3 - 2)(-2 + 7 - 2))(3v - 2v + 0v) to the form w + dv and give d. -118 Express s - 4s2 + 1 + 1 + 0s + (5 - 2 + 3)(41s + 75s - 218s)(s - 4s + s) + (1 + s - 1)(2 - s - 2) in the form w + ps*2 + zs and give z. 1 Express -6j + 3j - 2j + (-5 + 3 - 1)(-113 - 95j + 113) as cj + d and give c. 280 Rearrange (r*4 - 2r*4 + 0r*4)(37301 - 18526 - 18456) to dr2 + a + hr*4 + nr + zr3 and give h. -319 Express (-x - 14x*3 - 7x*3 + 15x*3)(-94 - 13 - 12) in the form zx2 + sx*3 + u + jx and give s. 714 Rearrange -16i2 - 5574i*3 + 14i*2 + 193i*3 + 216i*3 to ai*3 + s + wi*2 + ci and give a. -5165 Express -3573v2 + 6908v*2 + 3651v*2 in the form tv + n + dv2 and give d. 6986 Express 7n*4 - 3 + 161n - 5n4 - 244n + 1 - 404n as sn*3 + yn*4 + u + pn + in2 and give p. -487 Rearrange -299 - 22w - 2w2 + 28w + 281 to the form q + mw + iw*2 and give m. 6 Express (-1 + 1 - 2s)(4 - 2 + 0) + 2 + 5s - 2 + (1 + 2 + 0)(-2s - 1 + 1) - 56s - 6s + 28s + (1 - 3 + 5)(-3s + 4s + s) as t + fs and give f. -33 Rearrange -5h*2 - 3446 + 0h - h + 1730 + 1737 + 0h to y + bh + ph2 and give b. -1 Express 10v + 2v2 + 16v*3 - 19v*3 + 11v*3 + 845 - 844 in the form yv*2 + c + iv*3 + fv and give i. 8 Express 14384k3 - 28776k*3 + 14389k*3 + 2k*2 - 372k + 2 in the form wk + s + fk*2 + rk*3 and give w. -372 Rearrange 3673j*2 - 1217j*2 - 1220j*2 - 37 - 10j - j*3 - 1237j*2 to the form q + uj*2 + dj*3 + cj and give c. -10 Rearrange -2458o2 - 6253o*2 - 2542o*2 - 1048o*2 to qo + jo2 + v and give j. -12301 Rearrange 7407z + 5407z - 3 + 5624z - 15922z to the form oz + h and give h. -3 Express (-5 + 4f - 8 - 2f)((2f + f + 0f)(-f - 3 + 3) + 1 - 1 - 2f2)(6f - 3f - 16f) as r + vf*4 + df + yf2 + lf*3 and give l. -845 Express ((-2f + 0f + f)(3 + 0 - 5) - 3f + 4f + 0f)(2424690 + 2352f - 2424690) in the form bf + w + mf2 and give m. 7056 Express (-7u - 49302 + 24652 + 24651 + 135u4)(0 - 1 + 3 + (1 - 1 - 2)(3 + 0 - 1)) in the form pu*4 + fu + mu2 + cu*3 + g and give g. -2 Express 70502j - 31j3 - 141002j + 70499j + 4 as dj*2 + rj*3 + kj + h and give r. -31 Rearrange (0 + 1 - 2)(1294 - 378 - 576)(23y + 6y - 9y) to a + oy and give o. -6800 Rearrange -1282 + 1279 - 15h - 79h to the form vh + k and give k. -3 Rearrange -11k*4 + 3k3 - k3 + 12k4 + 3 - 112k + 33k2 - k3 - 35k*2 to bk + xk4 + y + zk*2 + lk*3 and give b. -112 Express 8651i*2 - 20193i + 10096i + 10097i in the form yi + ci*2 + g and give c. 8651 Rearrange 57284 + 2c - 52976 + 11c3 - 10c*3 to the form jc*2 + wc + dc3 + v and give v. 4308 Rearrange 2n*3 - 91700 - 15n*2 + 5n*4 + 91698 - 10n*2 to the form on + cn2 + d + tn*4 + rn*3 and give t. 5 Express 204h + 201h + 203h - 819h + 209h + 3245h2 as yh*2 + a + wh and give y. 3245 Rearrange -8 - 2z3 + 2 - 127z + 7 - z*2 + 3 to the form hz*2 + kz + az3 + v and give a. -2 Express (3 - 1 - 1)(383 - 15172q + 15171q + 1388) in the form a + zq and give a. 1771 Express -19 - 31 + 50 + 56l*2 in the form ml + jl2 + a and give j. 56 Rearrange -6401p - 549 + 549 - 277p to the form c + gp and give g. -6678 Express (2 - 4 + 0)(6n + 166n + 55n) as wn + c and give w. -454 Rearrange (-2 + 3 - 2)(-4v2 + 3v2 - v2) + (121v - 28646 + 28646)(0v + 5v + 8v) to uv*2 + nv + o and give u. 1575 Express -x*2 - 1 - 2624x + 0 - 361x + 126x + 201x in the form nx*2 + t + px and give t. -1 Express (0x3 + 3x*3 - 4x*3)((1 - 1 - x)(-1 + 1 - 2) - 26x + 80x + 93x) in the form sx3 + dx + u + kx2 + fx*4 and give f. -149 Rearrange (-7s - 11s + 16s)(58s + 6s - 13s)(-11s + 2s + s) to the form ps*2 + bs + w + zs3 and give z. 816 Express (1 + 0 - 2)(l*3 + 2l*3 - 2l*3) - 10l*3 + 8l*3 + 18l*3 + 21l*3 + 95l - 95l as cl*2 + jl + al3 + o and give a. 36 Rearrange s - s2 - 94 + 5s*2 + 4s*3 - 3s*2 - 92 + 188 to the form d + js + ps2 + ys*3 and give y. 4 Rearrange 101 + f - 230 + 127 - 3f - 49f3 - 10f*2 to the form sf + tf3 + lf*2 + p and give s. -2 Rearrange 217 - 9294986x*2 + 9294986x*2 + 3x*3 to qx*3 + rx*2 + ax + v and give v. 217 Express -34440p2 - 9p*3 + 120 - 47 + 34437p*2 in the form mp*3 + n + cp*2 + vp and give c. -3 Rearrange (4 - 4 - 3v)(-1 + 0 - 1) - 607 + 607 - 16v + (-2v + 2 - 2)(4 - 4 - 2) + 5v + 0v - 3v + 19v + 27v - 75v to n + hv and give h. -33 Express -6138m - 7608m + 1249m as f + dm and give d. -12497 Rearrange -7 + 671430p3 - 670250p*3 + 10 to the form rp + jp3 + z + xp*2 and give z. 3 Express 69 + 27m*2 - 48m*2 + 1 + 4m + 8m3 + 22m*2 as n + am + dm2 + zm*3 and give n. 70 Rearrange (0k2 + k2 - 6k + 0k)(2 + 3 + 6)(-10 - 2 + 0)(-4k - 2k + 4k) to lk + v + pk*2 + dk*3 and give d. 264 Express (1 - d - 1)(280 - 1364d - 6483d - 280) as x + kd2 + fd and give k. 78	{ "pile_set_name": "DM Mathematics" }
2822 What is -12 divided by 3? -4 Divide -6 by -28. 3/14 Divide -865 by -5. 173 767 divided by -767 -1 1 divided by 49 1/49 Divide 135 by -45. -3 Calculate 5 divided by 105. 1/21 Divide -3874 by -13. 298 Calculate -72 divided by -6. 12 3 divided by 108 1/36 What is 32 divided by -16? -2 Divide -76 by 19. -4 Divide -7 by 17. -7/17 Calculate 1650 divided by -275. -6 What is 151 divided by -4? -151/4 0 divided by -323 0 Calculate -36 divided by -9. 4 Divide 1892 by -22. -86 Divide 5 by -4. -5/4 -249 divided by -2 249/2 What is 5455 divided by -2? -5455/2 What is -2 divided by -5210? 1/2605 What is -324 divided by 81? -4 Calculate 0 divided by -593. 0 Divide 742 by -2. -371 What is 12 divided by 6? 2 Divide -211 by 1. -211 Divide 72 by 24. 3 What is -42 divided by 4? -21/2 Divide 25568 by -4. -6392 What is -9 divided by 3? -3 Calculate 1 divided by 23. 1/23 Calculate 318 divided by 1. 318 3 divided by -59 -3/59 What is -3 divided by 145? -3/145 What is 7 divided by 6? 7/6 What is -20022 divided by 47? -426 What is -5 divided by 96? -5/96 What is -72 divided by 8? -9 Divide -42 by 6. -7 Divide 20 by -4. -5 Calculate -9360 divided by 234. -40 Calculate 0 divided by 1699. 0 Divide 339 by 7. 339/7 -432 divided by -8 54 Divide -116 by -29. 4 Calculate 6660 divided by -10. -666 -340 divided by 5 -68 171 divided by 5 171/5 Divide -48 by 5. -48/5 Calculate 441 divided by 21. 21 -1809 divided by 3 -603 Divide -118255 by -5. 23651 Calculate 1122 divided by -6. -187 -231 divided by -11 21 305 divided by -5 -61 Divide -208 by -26. 8 -5 divided by -733 5/733 What is -5 divided by 34? -5/34 What is 4 divided by -562? -2/281 What is -2984 divided by 2? -1492 -4 divided by 29 -4/29 Divide 285 by 9. 95/3 Divide -137 by -11. 137/11 -390 divided by 2 -195 -5 divided by 277 -5/277 19008 divided by -66 -288 Divide 2416 by 604. 4 4 divided by -36 -1/9 Divide -11 by 949. -11/949 Calculate 2304 divided by 5. 2304/5 Divide -868 by 124. -7 Divide 7580 by -3. -7580/3 -62 divided by -3 62/3 What is 1596 divided by 4? 399 What is -1341 divided by -3? 447 What is 3 divided by -4102? -3/4102 Calculate 5769 divided by 9. 641 -10 divided by -33 10/33 What is 10 divided by -96? -5/48 -1119 divided by 18 -373/6 Calculate 1998 divided by -666. -3 Calculate 355 divided by 4. 355/4 Calculate 844 divided by -4. -211 Divide 153 by -1. -153 Divide -4 by 684. -1/171 Calculate 5642 divided by 91. 62 Divide -5 by -66. 5/66 Divide -308 by 7. -44 Divide 1642 by -821. -2 What is -1065 divided by -3? 355 Divide 35260 by -164. -215 Calculate 22731 divided by 2. 22731/2 Divide 6952 by -632. -11 1181 divided by 1 1181 Calculate -8018 divided by -4009. 2 Calculate -5 divided by -20. 1/4 What is -2 divided by -425? 2/425 Divide 175 by 10. 35/2 0 divided by 68 0 14 divided by 7 2 Calculate -598 divided by 23. -26 Calculate -5088 divided by 16. -318 Calculate -160 divided by -32. 5 Divide 1064 by 532. 2 Calculate -8197 divided by -5. 8197/5 What is -5 divided by -367? 5/367 340 divided by -2 -170 Calculate 780 divided by -3. -260 -1995 divided by -6 665/2 What is 44688 divided by 14? 3192 52 divided by -52 -1 Calculate -5 divided by -909. 5/909 -969 divided by -1 969 What is -2436 divided by 3? -812 What is 13 divided by 4? 13/4 Divide -43 by 85. -43/85 What is 0 divided by 38? 0 What is -4 divided by -745? 4/745 What is 7405 divided by 7405? 1 Divide 6609 by 3. 2203 What is 1 divided by 9? 1/9 -1198 divided by -5 1198/5 What is -56 divided by 391? -56/391 1 divided by -3315 -1/3315 What is 4 divided by -265? -4/265 7888 divided by 136 58 Calculate 506 divided by 23. 22 -5 divided by 21 -5/21 -2470 divided by 1235 -2 Divide -357 by 1. -357 Divide -70 by 10. -7 Calculate -484 divided by 1. -484 Divide 30 by -11. -30/11 605 divided by -11 -55 What is 281 divided by 5? 281/5 Calculate -3840 divided by 240. -16 Calculate -855 divided by -1. 855 What is 1840 divided by -5? -368 -25 divided by -10 5/2 What is 5 divided by 618? 5/618 Divide -779 by 5. -779/5 Divide 4 by 208. 1/52 1022 divided by -20 -511/10 3 divided by -121 -3/121 Divide -2 by 144. -1/72 What is 1709 divided by 2? 1709/2 What is 4 divided by 1101? 4/1101 What is -260 divided by 65? -4 Divide 0 by 853. 0 What is -10625 divided by 6? -10625/6 Calculate -1219 divided by -6. 1219/6 Divide -104 by -2. 52 Calculate 1552 divided by 1. 1552 Divide 0 by 710. 0 Calculate -312 divided by 26. -12 Calculate -2 divided by 449. -2/449 What is -122 divided by 2? -61 Divide -1505 by 3. -1505/3 Calculate -760 divided by -4. 190 Divide 0 by -322. 0 Calculate -126 divided by -42. 3 4784 divided by -208 -23 What is -7579 divided by -6? 7579/6 2 divided by 130 1/65 Divide -40 by -20. 2 What is 6900 divided by -60? -115 Divide 664 by 1. 664 Divide 7 by -292. -7/292 What is -1585 divided by -1? 1585 -11400 divided by -150 76 What is -156 divided by -6? 26 1625 divided by -5 -325 Calculate -2 divided by 193. -2/193 What is 12665 divided by 149? 85 2052 divided by -3 -684 What is -2296 divided by -4? 574 14 divided by -7 -2 -3 divided by 161 -3/161 What is -17 divided by -6? 17/6 What is 61 divided by 404? 61/404 -319 divided by 1 -319 Divide 4704 by -5. -4704/5 88 divided by 1 88 -109 divided by -12 109/12 Calculate 417 divided by 10. 417/10 3087 divided by -1029 -3 Divide 4 by -2591. -4/2591 What is -1576 divided by -8? 197 Divide -714 by 17. -42 What is -4 divided by -6? 2/3 Divide -4 by -1377. 4/1377 Calculate -2252 divided by 563. -4 What is 6 divided by 30? 1/5 Divide 3 by 31. 3/31 Divide -4 by -25. 4/25 Calculate 194 divided by 1. 194 What is 246 divided by -1? -246 What is 22360 divided by -430? -52 What is 1598 divided by 2? 799 -1 divided by -308 1/308 208 divided by 16 13 -418 divided by 22 -19 Divide 111 by 6. 37/2 -3 divided by 231 -1/77 Calculate -284 divided by -5. 284/5 Divide -6175 by -13. 475 What is 990 divided by 5? 198 Calculate 2592 divided by 72. 36 Calculate 35 divided by -1. -35 Calculate -16360 divided by -4. 4090 -8 divided by -39 8/39 -7 divided by -244 7/244 Calculate -121 divided by -11. 11 -852 divided by 142 -6 What is 0 divided by 249? 0 Divide -65 by 13. -5 Divide -3 by 148. -3/148 999 divided by -3 -333 -3 divided by -61 3/61 5 divided by -1135 -1/227 Calculate -2164 divided by -541. 4 Divide 3 by -489. -1/163 Divide 50 by 3. 50/3 Divide 0 by -321. 0 What is -13416 divided by -39? 344 What is 7 divided by 268? 7/268 Divide -6561 by -2187. 3 Divide 3934 by 281. 14 Calculate 3 divided by -156. -1/52 Calculate -1 divided by -25. 1/25 Divide 1 by -100. -1/100 Calculate 124 divided by -62. -2 What is -6 divided by -1722? 1/287 What is 5 divided by 1206? 5/1206 680 divided by -1 -680 What is 515 divided by 5? 103 What is 1631 divided by -19? -1631/19 Divide 9 by -6. -3/2 -16164 divided by -1796 9 -7 divided by 4 -7/4 What is -8464 divided by 8464? -1 4 divided by -89 -4/89 Calculate 30 divided by 30. 1 -6018 divided by 17 -354 Calculate 93 divided by 93. 1 1520 divided by 1 1520 What is 206 divided by -206? -1 194 divided by -48 -97/24 17 divided by 4 17/4 Divide 7332 by 564. 13 Divide -41 by -5. 41/5 Calculate 12625 divided by 5. 2525 Divide 437 by -437. -1 Divide 12 by 10. 6/5 -4 divided by -553 4/553 Divide -6 by -1843. 6/1843 Calculate -5 divided by 1611. -5/1611 What is 8 divided by 4? 2 Calculate -5775 divided by 7. -825 What is 2 divided by 1? 2 2 divided by 414 1/207 What is -806 divided by -3? 806/3 What is 4710 divided by 4? 2355/2 Calculate -377 divided by -3. 377/3 What is -54 divided by 3? -18 -35 divided by -7 5 What is -4 divided by 174? -2/87 Divide -490 by 70. -7 2720 divided by 17 160 Calculate 13900 divided by -25. -556 Divide -54 by 4. -27/2 Divide -158 by -79. 2 What is -3828 divided by -3828? 1 What is 0 divided by 44? 0 4218 divided by 6 703 What is -6205 divided by 73? -85 Divide 396 by 3. 132 Divide 25 by 88. 25/88 Divide 888 by -74. -12 1257 divided by -11 -1257/11 Calculate 882 divided by 441. 2 What is 2504 divided by 2? 1252 What is 3470 divided by 3470? 1 Calculate 26 divided by 13. 2 Divide 1485 by 55. 27 What is -531 divided by -1? 531 104 divided by 2 52 Divide -12 by -4. 3 Divide -940 by -2. 470 What is 6 divided by -592? -3/296 Calculate 0 divided by 120. 0 13806 divided by 18 767 What is 5 divided	{ "pile_set_name": "DM Mathematics" }
(a) 1/2 (b) -4 (c) m a Let x = 1 + -4. Let z = -1.7116 - 0.2884. Which is the closest to -2/5? (a) x (b) -4 (c) z c Let n = 24 - 44. Let o = n + 41. Let h = o - 19. What is the nearest to 2 in -2/3, h, 0.4? h Suppose 4k - 2h = 6, -h + 1 = -3k + 3. Let j = 28 + -22. Let z = j + -6.3. Which is the nearest to k? (a) 0 (b) z (c) 0.4 b Let s be -2 - -3 - 7/9. Let q = -43/3 - -15. Which is the closest to -3? (a) 0.2 (b) q (c) s a Let w(t) = -t2 - 6t + 4. Let b be (-45)/618/(-15). Let a = -15 + b. Let k be w(a). What is the nearest to -0.2 in k, -0.1, -2? -0.1 Let g = 43.6 - 26. Let y = g + -18. Let r = -27/5 - -113/20. What is the nearest to 0.1 in -1/6, y, r? r Let r be 8/27-3 - (1 - 2). Which is the closest to 10? (a) 0 (b) 5 (c) r (d) -1 b Let i = -19 - -16. What is the closest to 2/5 in 0.5, i, 1? 0.5 Let u(m) = 13m - 5. Let s be u(6). Let k = -221/3 + s. Let n = 0.05 - -0.25. What is the nearest to -1 in 1/7, k, n? k Let h = -1.424 - -0.424. Let p be 1 - (-3)/61. Which is the closest to p? (a) h (b) 0 (c) -0.3 b Let h = 78 - 1324/17. Let o = 8 - 8. What is the nearest to -1 in 0.3, o, h? o Suppose -5t + 216 = -17t. What is the closest to 1 in -5, -2, t? -2 Let p be 2/10 - 18/40. Let x = 0.054 + -39.054. Let i = -43 - x. Which is the nearest to p? (a) -0.4 (b) 1/6 (c) i a Let h be 2((-196)/(-105))/14. What is the nearest to h in 4, 3/4, -2/11? -2/11 Let z be ((-21)/(-105))/((-2)/6). Let d = 5 - 6. Which is the nearest to 0? (a) d (b) -1/6 (c) z b Let l = 0.1 + -0.5. Let n = -27 + 24. Let w = -8 - n. Which is the nearest to 1/3? (a) w (b) -4 (c) l c Let z be 2/11 - 60/(-33). Suppose 5p = zw - 22, -5w + p - 6p - 15 = 0. Let r be ((-1)/21)/(5/(-10)). Which is the nearest to w? (a) r (b) -1/8 (c) -0.2 a Let t = -17 + 17.16. Let q = 0.04 + t. Let w = 2 + 1. What is the nearest to 1 in w, 2, q? q Let g = -11 - -11. Let a = -1.2 - -1.1. Let r = -7.3 + 7. What is the nearest to a in g, r, 5? g Let k(o) = -o*3 - 9o*2 + 38o + 42. Let n be k(-12). What is the closest to 1 in -3, 0.2, n, 2? 0.2 Suppose 0 = 3d + 2r - 5, -3r = 3d - 0d - 6. Let j be (48/30)/(3 + 52/(-20)). Let i = 71/15 + -17/5. Which is the closest to -1/3? (a) j (b) d (c) i b Let k = 1225 - 1227. Which is the closest to 0? (a) k (b) -5 (c) -1.63 c Let k = -0.9973 - 0.0027. Let f be (-2)/(-1)2 + 0. Which is the closest to 1? (a) f (b) k (c) 1 c Let g be -1((-227)/5 + 0). Let f = -45 + g. Which is the closest to 2? (a) f (b) 3 (c) -4/7 b Let o = 1022/3 + -3068/9. What is the nearest to -2/5 in 33/5, -0.4, o, -0.3? -0.4 Let f be 12/(-48)12 - -221. What is the nearest to f in -3/5, -1/4, 3, -3? 3 Let o = 118.5 + -118. What is the closest to -0.1 in o, 6/11, 3, -0.3? -0.3 Let y be ((-2)/(-4)184/(-23))/14. What is the closest to -3 in 1/3, y, -0.1? y Let m = 10184.7 + -10185. Let r = 1 + 2. Which is the nearest to -2/5? (a) m (b) r (c) -1/5 a Let y = -2 + 1.4. Let f = y + 2.6. Let w = 0.0418 - -0.3582. Which is the nearest to f? (a) w (b) 1/3 (c) 0.1 a Let f = 49.46 - 49. Let x = -0.24 - f. Let u = x - -1.1. Which is the nearest to 1/12? (a) -5 (b) 4/9 (c) u c Let m be (-14)/8 - 6/8. Let p = 69 + -73.7. Let r = -5 - p. What is the closest to -1 in m, -0.5, r? -0.5 Suppose 4s - 2s - 4z + 12 = 0, 4s = 3z - 9. Which is the nearest to s? (a) -4 (b) 1/5 (c) -6/11 (d) -4/3 b Let j = -2.6 + -0.4. Let k = 30 + -148/5. What is the closest to 1 in -5, k, j? k Let r be 12/9 + 5 + (-24)/18. What is the closest to 4 in r, -0.2, 1? r Let k = -2536 - -2536.06. Let a = 0.9 - 1. What is the nearest to -1 in k, -5, a? a Let r = -0.0147 + 6.0147. Let o = -1 + 0. What is the nearest to 2/5 in r, -2, o? o Let t be 0 - (-50 + 52 + (-1 - 0)). What is the closest to 0 in 386, t, 1/4, 0.2? 0.2 Let y be 2/(332/108 + -3). Suppose 0 = yj - 28j - 3. What is the nearest to -2/5 in 4/5, -0.6, j? -0.6 Let v be 4/18 - 8/9. Let k = 310 - 147. Let n = 164 - k. What is the closest to v in n, 5, -3? n Let w = -3578 + 14311/4. Let r = -1.2 - -1. Which is the closest to -0.2? (a) w (b) 1 (c) r c Let t = 494 + -494. Which is the nearest to -1/2? (a) t (b) 2/5 (c) -0.112 c Suppose 5 + 6 = c. Let u = c + -15. Let k = -12 + 11. What is the nearest to 0 in k, u, 3? k Let y = 26 - 31. Let n = y + -5. Which is the nearest to -0.2? (a) 1 (b) n (c) 2 a Let p = -20 + 24. Suppose -4o + 3o - p = 0. Which is the closest to 8? (a) -2/5 (b) -3 (c) o a Let o = 138.5 - 139. Which is the closest to 0.2? (a) o (b) 5 (c) 9/4 a Let r = -16.26 - -0.26. Let q = r - -15.8. Which is the closest to -1/3? (a) -5/2 (b) 0.2 (c) q c Let h = 6.1 - 0.1. Which is the nearest to h? (a) -2/11 (b) -3/2 (c) -2 a Let l = -121 + 113. Let h = l - -6. What is the closest to h in -1, 4, -2/3? -1 Let k be (3/27)/((-1)/3). Let m = -0.9 + 1. Let q = 16 - 113/7. Which is the closest to m? (a) q (b) k (c) -5 a Let s = -24.8 - -29. Let i = 4 - s. Let k be 5 + ((-68)/8 - (-15 - -11)). What is the nearest to -3/5 in 2/5, i, k? i Let l = -1658 + 1657.5. What is the closest to 2 in -5/3, l, -8, -5? l Let k = 0.4 + 0.6. Let h = 4.975 - -0.125. Let v = 5 - h. What is the closest to v in k, -1/4, -0.5? -1/4 Let m = -231 + 231.341. Let x = m + -0.041. Which is the closest to -1? (a) 3 (b) x (c) 4 b Let u = -130 - -128. Let t = 36/11 - 434/99. Which is the closest to t? (a) u (b) 0 (c) -0.2 a Let v be (-3 - (-94)/30)/(8/80). Which is the closest to 0? (a) 5/6 (b) v (c) 0.2 (d) 2.5 c Let s = -540 - -544. What is the closest to -2 in 0.2, s, -9/8, 0.1? -9/8 Suppose -8r + 3r + 5a = 0, -5r - 2a = 0. Let t be r + (-1)/(-3)2. What is the nearest to 0.1 in 0.6, t, 2? 0.6 Let u = -1 - -0.7. Let y = 836 - 834. What is the nearest to y in u, -5, 6? u Let l = -109.6 - -109.9. What is the closest to -2/5 in 3, l, -1/2? -1/2 Let v = 14 - 0. Let u = 11 - v. Let g = 4 + -2. Which is the closest to 1? (a) g (b) u (c) -1 a Suppose 0 = -0g - 2g + 18. Let o be 3/12 - g/4. Let p be ((-2)/3 - -1)/1. Which is the nearest to 3? (a) o (b) p (c) 1/2 c Let z(p) = p2 - 8p + 2. Let q be z(3). Let b be (q - -14) + -2 + (4 - 2). What is the closest to 2/5 in b, 5, -1? b Let n = -1.7 + 2.3. Let h = -0.9 + n. Which is the closest to 4? (a) 1/4 (b) h (c) -1/5 a Suppose -1120z + 556z = -550z - 56. Let s be (0 - -1) + (-1)/(-1). Which is the nearest to -1? (a) 0 (b) z (c) s a Suppose -q = -3y + 17, -78q = 4y - 74q - 12. Let r(d) = -d3 + 2d*2 + 4d - 3. Let j be r(3). Which is the closest to y? (a) 3 (b) j (c) 1 a Let x = -0.028 + -10.372. Let s = x + 10. Which is the nearest to s? (a) 3/2 (b) 0.3 (c) -0.3 c Suppose 0 = 4f + 4z - 40, -f + 3z = 6z - 20. Let s = f + -6. Which is the nearest to s? (a) -2/3 (b) -0.5 (c) 1/4 a Let v = 14.1 - 12.1. What is the nearest to 4 in v, 3/4, 2/5? v Let y = 20.93 + -20.73. What is the nearest to y in -5, 5, -13? 5 Let n = -15 + 11. Let u(s) = s*2 + 5s + 1. Let j be u(-5). Let t be j/(-2) + 7/(-10). What is the nearest to -1 in 4, t, n? t Let n = 6.42 + -9.45. Let d = -4.97 + 5. Let q = n + d. Which is the closest to 0.1? (a) -3/4 (b) q (c) 1/7 c Suppose 5 = 5k, 75j + 4k = 71j + 16. Which is the closest to -1? (a) j (b) 1 (c) 2/43 (d) -1/3 d Let k = 0.22 + -0.258. Let w = 5.038 + k. Let n = 4 - 4.1. Which is the nearest to n? (a) w (b) -1/6 (c) -0.4 b Let l = -0.346 - -1.776. Let r = -0.43 + l. Suppose 0 = -4y - y - 10. Which is the nearest to r? (a) y (b) -1 (c) 2 c Let k = 0 + -0.1. Let o = -5 + 0. Let s = -23 - -23. What is the closest to s in 1, k, o? k Suppose -8b + 7b = 5w + 19, -4w = -3b. What is the nearest to w in -1, 1/7, 0.5? -1 Suppose -5 = 2j + y, 15 = -7j + 3j + 3y. Which is the closest to j? (a) -1/6 (b) 4 (c) 2/7 a Let m = -0.3074 - -0.1074. What is the closest to -2/3 in 34/5, 1, m, -4? m Let g = 37 + -36. Let o be 14/(-10) - 4/(-10). Let n be (2 - (5 - 2))/o. Which is the closest to n? (a) -1 (b) 0 (c) g c Let h(a) = 5a + 14 - 4a - 1. Let i be h(-11). Suppose -z + 2z - p = -24, -ip + 105 = -5z. What is the nearest to -1 in 0.3, z, -2? -2 Suppose 8z = 19*z + 572. Which is the closest to -6? (a) 4 (b) -1/6 (c) z b Let m = 13.2 - 18.2. Let c = 6.4 - 6. Wha	{ "pile_set_name": "DM Mathematics" }
18 What is the remainder when 285827213 is divided by 26441? 3 Calculate the remainder when 437583 is divided by 48431. 1704 Calculate the remainder when 9899636 is divided by 170683. 22 Calculate the remainder when 28642856 is divided by 12. 8 What is the remainder when 10337790 is divided by 256? 254 What is the remainder when 156917 is divided by 378? 47 What is the remainder when 626620 is divided by 41766? 130 What is the remainder when 745538 is divided by 46? 16 What is the remainder when 140410073 is divided by 2529? 2522 Calculate the remainder when 10155689 is divided by 91. 89 Calculate the remainder when 10928105 is divided by 2185605. 80 Calculate the remainder when 5224054 is divided by 274950. 4 What is the remainder when 216471 is divided by 7208? 231 What is the remainder when 1880034 is divided by 939905? 224 Calculate the remainder when 3807139 is divided by 173030. 479 Calculate the remainder when 28683989 is divided by 80. 69 Calculate the remainder when 2180858 is divided by 857. 650 Calculate the remainder when 3381260 is divided by 30189. 92 Calculate the remainder when 23498620 is divided by 42. 40 Calculate the remainder when 1398482 is divided by 77. 8 Calculate the remainder when 26331036 is divided by 14801. 57 Calculate the remainder when 119293 is divided by 118916. 377 What is the remainder when 97723 is divided by 3354? 457 What is the remainder when 48648 is divided by 3397? 1090 Calculate the remainder when 24437083 is divided by 2455. 13 What is the remainder when 18574 is divided by 3120? 2974 Calculate the remainder when 657010 is divided by 6027. 67 Calculate the remainder when 4207817 is divided by 1051951. 13 Calculate the remainder when 21835121 is divided by 3023. 3015 Calculate the remainder when 1026440 is divided by 205286. 10 What is the remainder when 3211454 is divided by 802851? 50 Calculate the remainder when 5600893 is divided by 2432. 2429 What is the remainder when 437437962 is divided by 2823? 2820 Calculate the remainder when 2881576 is divided by 138. 136 Calculate the remainder when 6972216 is divided by 996028. 20 What is the remainder when 731853 is divided by 8028? 1305 What is the remainder when 231474575 is divided by 29? 26 Calculate the remainder when 149670720 is divided by 74835353. 14 Calculate the remainder when 8923461 is divided by 446172. 21 What is the remainder when 1222288 is divided by 4930? 4578 Calculate the remainder when 716018 is divided by 655. 103 What is the remainder when 409721 is divided by 1741? 586 Calculate the remainder when 27497005 is divided by 1291. 1287 What is the remainder when 58118838 is divided by 26? 24 Calculate the remainder when 239262 is divided by 9214. 8912 Calculate the remainder when 1862605 is divided by 6951. 6688 What is the remainder when 451035 is divided by 620? 295 Calculate the remainder when 7118892 is divided by 2265. 2262 Calculate the remainder when 232751 is divided by 21. 8 Calculate the remainder when 110854621 is divided by 33. 31 What is the remainder when 2866165 is divided by 943? 388 Calculate the remainder when 1957862 is divided by 58. 14 Calculate the remainder when 15047 is divided by 570. 227 Calculate the remainder when 9102996 is divided by 1634. 1616 What is the remainder when 3654674 is divided by 152277? 26 Calculate the remainder when 100960 is divided by 47966. 5028 Calculate the remainder when 12301175 is divided by 5316. 5267 What is the remainder when 1462759 is divided by 146271? 49 What is the remainder when 123157 is divided by 41033? 58 What is the remainder when 125780 is divided by 17872? 676 Calculate the remainder when 480924 is divided by 228. 72 What is the remainder when 1615367 is divided by 397? 371 What is the remainder when 11547902 is divided by 40377? 80 What is the remainder when 229610 is divided by 2030? 220 Calculate the remainder when 9736430 is divided by 885128. 22 What is the remainder when 830675 is divided by 1902? 1403 What is the remainder when 2653 is divided by 2515? 138 Calculate the remainder when 1814212 is divided by 27. 1 What is the remainder when 2668511 is divided by 381214? 13 Calculate the remainder when 499918 is divided by 14703. 16 What is the remainder when 74543 is divided by 68? 15 What is the remainder when 3047723 is divided by 2671? 112 Calculate the remainder when 79659 is divided by 2195. 639 What is the remainder when 3471561 is divided by 123983? 37 What is the remainder when 1815041 is divided by 6030? 11 Calculate the remainder when 7595181 is divided by 1898792. 13 Calculate the remainder when 2256 is divided by 321. 9 Calculate the remainder when 494886 is divided by 179. 130 Calculate the remainder when 1713246 is divided by 2576. 206 What is the remainder when 767116 is divided by 3144? 3124 Calculate the remainder when 41145627 is divided by 1607. 1606 What is the remainder when 226731 is divided by 56367? 1263 What is the remainder when 1213357 is divided by 770? 607 What is the remainder when 9053411 is divided by 27106? 7 What is the remainder when 245112217 is divided by 25? 17 Calculate the remainder when 359929 is divided by 64. 57 Calculate the remainder when 10159358 is divided by 18641. 13 Calculate the remainder when 5653920 is divided by 17. 9 What is the remainder when 4097169 is divided by 672? 657 What is the remainder when 5436 is divided by 2702? 32 What is the remainder when 1371958 is divided by 685967? 24 What is the remainder when 50229 is divided by 7174? 11 What is the remainder when 1540508 is divided by 1043? 1040 What is the remainder when 407507 is divided by 27097? 1052 Calculate the remainder when 932649 is divided by 4201. 27 Calculate the remainder when 11222428 is divided by 2699. 2685 Calculate the remainder when 20620353 is divided by 20. 13 What is the remainder when 17085424 is divided by 1114? 6 What is the remainder when 28602173 is divided by 2043012? 5 What is the remainder when 3201706 is divided by 208? 170 What is the remainder when 142539011 is divided by 84? 83 What is the remainder when 51880 is divided by 4814? 3740 What is the remainder when 1571159 is divided by 3099? 3065 What is the remainder when 2384661 is divided by 85? 71 Calculate the remainder when 1142655 is divided by 708. 651 What is the remainder when 8784981 is divided by 1435? 1346 Calculate the remainder when 5847941 is divided by 44. 33 Calculate the remainder when 38160749 is divided by 1275. 1274 Calculate the remainder when 94671 is divided by 44477. 5717 Calculate the remainder when 5168686 is divided by 2284. 2278 Calculate the remainder when 233262802 is divided by 3152200. 2 Calculate the remainder when 657094 is divided by 1048. 1046 Calculate the remainder when 43328 is divided by 902. 32 What is the remainder when 171689 is divided by 21187? 2193 What is the remainder when 159314 is divided by 3011? 2742 What is the remainder when 306657 is divided by 76483? 725 What is the remainder when 552450 is divided by 660? 30 What is the remainder when 30125932 is divided by 12706? 6 Calculate the remainder when 2585309 is divided by 1256. 461 What is the remainder when 8204197 is divided by 683683? 1 What is the remainder when 13319220 is divided by 442? 434 Calculate the remainder when 3821102 is divided by 33. 32 Calculate the remainder when 15918 is divided by 3426. 2214 What is the remainder when 965842 is divided by 107306? 88 Calculate the remainder when 2383947 is divided by 595981. 23 Calculate the remainder when 2864374 is divided by 1741. 429 What is the remainder when 476784 is divided by 9345? 189 What is the remainder when 9847028 is divided by 32? 20 What is the remainder when 718746741 is divided by 3794? 3793 What is the remainder when 4330057 is divided by 6? 1 Calculate the remainder when 14684767 is divided by 360. 7 What is the remainder when 6359189 is divided by 25? 14 What is the remainder when 2116088 is divided by 2116088? 0 What is the remainder when 5621688 is divided by 63? 9 What is the remainder when 8164001 is divided by 2721296? 113 What is the remainder when 51897 is divided by 14955? 7032 Calculate the remainder when 6679752 is divided by 12167. 69 Calculate the remainder when 13609 is di	{ "pile_set_name": "DM Mathematics" }
h term of 421, 417, 417, 427, 453, 501, 577? n*3 - 4n*2 + n + 423 What is the d'th term of 546, 1006, 1466, 1926? 460d + 86 What is the p'th term of -15, -113, -339, -747, -1391, -2325, -3603, -5279? -9p3 - 10p*2 - 5p + 9 What is the l'th term of -3612, -3625, -3662, -3735, -3856, -4037, -4290? -2l3 + l - 3611 What is the x'th term of 48479, 193920, 436323, 775688, 1212015? 48481x*2 - 2x What is the l'th term of 11119, 11132, 11169, 11242, 11363, 11544, 11797? 2l3 - l + 11118 What is the i'th term of -1772, -7097, -15970, -28391, -44360, -63877, -86942? -1774i*2 - 3i + 5 What is the j'th term of -36, -117, -274, -525, -888? -3j3 - 20j*2 - 13 What is the u'th term of -15, -80, -153, -234? -4u*2 - 53u + 42 What is the r'th term of -2173, -1993, -1813, -1633, -1453? 180r - 2353 What is the w'th term of -390, -1533, -3476, -6261, -9930, -14525? -7w*3 - 358w*2 - 20w - 5 What is the m'th term of -540, 68, 676, 1284, 1892, 2500? 608m - 1148 What is the c'th term of -17751, -35520, -53305, -71112, -88947, -106816? -c3 - 2c*2 - 17756c + 8 What is the i'th term of -3885, -3899, -3937, -4011, -4133, -4315, -4569, -4907? -2i3 - 3883 What is the j'th term of -7047488, -7047489, -7047490, -7047491, -7047492? -j - 7047487 What is the b'th term of -3919, -4007, -4103, -4207, -4319, -4439, -4567? -4b*2 - 76b - 3839 What is the y'th term of 1157, 9311, 31447, 74555, 145625, 251647? 1165y3 + y2 - 4y - 5 What is the o'th term of -2317, -4878, -7439, -10000, -12561, -15122? -2561o + 244 What is the w'th term of -133, -535, -1205, -2143, -3349, -4823? -134w*2 + 1 What is the u'th term of -699, -1317, -2349, -3795, -5655, -7929, -10617? -207u*2 + 3u - 495 What is the v'th term of -897549, -1795097, -2692645, -3590193, -4487741, -5385289? -897548v - 1 What is the i'th term of 82324, 164607, 246890, 329173, 411456? 82283i + 41 What is the n'th term of 93572, 187140, 280708, 374276, 467844? 93568n + 4 What is the f'th term of 3367, 3359, 3351? -8f + 3375 What is the m'th term of 279, 556, 833, 1110, 1387, 1664? 277m + 2 What is the k'th term of -920, -478, 258, 1288? 147k*2 + k - 1068 What is the w'th term of -826840, -826839, -826838? w - 826841 What is the l'th term of 15788, 31717, 47646, 63575, 79504? 15929l - 141 What is the d'th term of 3367, 6804, 10241, 13678, 17115, 20552? 3437d - 70 What is the c'th term of -142, -309, -488, -679, -882, -1097? -6c*2 - 149c + 13 What is the u'th term of -55008, -55004, -55000? 4u - 55012 What is the w'th term of 173, 233, 293, 353? 60w + 113 What is the r'th term of 1226, 2582, 4038, 5600, 7274, 9066? r*3 + 44r*2 + 1217r - 36 What is the q'th term of -1352490, -1352489, -1352488, -1352487, -1352486, -1352485? q - 1352491 What is the u'th term of 529, 659, 993, 1633, 2681, 4239? 17u3 + 11u + 501 What is the d'th term of -21981, -43985, -65989? -22004d + 23 What is the r'th term of -41618, -41598, -41564, -41516, -41454, -41378, -41288? 7r*2 - r - 41624 What is the l'th term of -1217, -2439, -3665, -4895, -6129, -7367? -2l*2 - 1216l + 1 What is the o'th term of -657, -645, -635, -627, -621? -o*2 + 15o - 671 What is the z'th term of -23034, -46071, -69122, -92193, -115290, -138419, -161586? -z3 - z2 - 23027z - 5 What is the w'th term of -1364490, -1364492, -1364494, -1364496, -1364498, -1364500? -2w - 1364488 What is the a'th term of 13180, 13182, 13192, 13216, 13260? a*3 - 2a*2 + a + 13180 What is the c'th term of 26337, 52665, 78989, 105309, 131625, 157937, 184245? -2c*2 + 26334c + 5 What is the c'th term of -311, -2454, -8283, -19646, -38391, -66366? -308c3 + 5c*2 - 2c - 6 What is the t'th term of -7708, -7716, -7730, -7750, -7776, -7808? -3t2 + t - 7706 What is the v'th term of 198, 340, 588, 942? 53v*2 - 17v + 162 What is the c'th term of 264300, 1057170, 2378612, 4228620, 6607188, 9514310? -c*3 + 264292c*2 + c + 8 What is the r'th term of -140295, -280592, -420889, -561186, -701483, -841780? -140297r + 2 What is the f'th term of 1105, 1924, 2743, 3562, 4381, 5200? 819f + 286 What is the w'th term of -267, 2203, 6313, 12057, 19429? -w3 + 826w*2 - w - 1091 What is the v'th term of -18315, -18322, -18329, -18336? -7v - 18308 What is the q'th term of -319353, -638705, -958057, -1277409, -1596761, -1916113? -319352q - 1 What is the u'th term of 704120, 704122, 704124, 704126? 2u + 704118 What is the t'th term of -2922, -5847, -8778, -11715, -14658, -17607, -20562? -3t2 - 2916t - 3 What is the w'th term of 69365, 69367, 69371, 69377, 69385? w*2 - w + 69365 What is the c'th term of 5421, 21514, 48335, 85884, 134161, 193166? 5364c*2 + c + 56 What is the p'th term of 381, 718, 993, 1188, 1285, 1266, 1113? -3p*3 - 13p*2 + 397p What is the w'th term of -56083, -56089, -56101, -56119, -56143, -56173, -56209? -3w2 + 3w - 56083 What is the d'th term of 3630, 6678, 9726, 12774, 15822, 18870? 3048d + 582 What is the a'th term of 513843, 513844, 513845, 513846, 513847, 513848? a + 513842 What is the a'th term of -133, -552, -1293, -2362, -3765, -5508? -a3 - 155a*2 + 53a - 30 What is the l'th term of -179, -832, -1955, -3548? -235l2 + 52l + 4 What is the w'th term of 33867, 135467, 304797, 541851, 846623, 1219107, 1659297, 2167187? -w*3 + 33871w*2 - 6w + 3 What is the t'th term of -6356, -12765, -19172, -25577, -31980? t*2 - 6412t + 55 What is the p'th term of 41633, 83340, 125047? 41707p - 74 What is the x'th term of 255, 540, 859, 1230, 1671? 3x3 - x2 + 267x - 14 What is the d'th term of -258456, -258437, -258394, -258315, -258188, -258001, -257742, -257399? 2d*3 + 5d - 258463 What is the y'th term of 10888, 21774, 32660, 43546, 54432? 10886y + 2 What is the f'th term of 131, 160, 193, 230, 271, 316? 2f*2 + 23f + 106 What is the u'th term of 255, 987, 2197, 3885? 239u2 + 15u + 1 What is the l'th term of 41, -13, -223, -655, -1375, -2449? -11l3 - 12l*2 + 59l + 5 What is the m'th term of 1111, 1097, 1083? -14m + 1125 What is the k'th term of 561, 1105, 1649, 2193, 2737? 544k + 17 What is the i'th term of 29167, 29177, 29189, 29203, 29219, 29237? i*2 + 7i + 29159 What is the f'th term of 4004, 4007, 4012, 4019, 4028, 4039, 4052? f2 + 4003 What is the y'th term of -349881, -349883, -349883, -349881, -349877? y2 - 5y - 349877 What is the j'th term of -5542, -11083, -16624, -22165, -27706, -33247? -5541j - 1 What is the w'th term of -233082, -233078, -233074, -233070? 4w - 233086 What is the f'th term of -2575, -5149, -7723? -2574f - 1 What is the p'th term of 1078602, 1078617, 1078630, 1078641, 1078650, 1078657? -p*2 + 18p + 1078585 What is the w'th term of 24, 89, 184, 309? 15w2 + 20w - 11 What is the z'th term of -2619, -5252, -7885, -10518, -13151? -2633z + 14 What is the j'th term of -122, -553, -1274, -2285, -3586? -145j*2 + 4j + 19 What is the t'th term of -4947, -9901, -14857, -19815, -24775, -29737, -34701? -t*2 - 4951t + 5 What is the r'th term of -153596, -153599, -153604, -153611, -153620, -153631, -153644? -r*2 - 153595 What is the a'th term of -358, -530, -702, -874, -1046, -1218? -172a - 186 What is the i'th term of -551, -1104, -1657, -2210, -2763? -553i + 2 What is the b'th term of 58938, 117877, 176816, 235755, 294694? 58939b - 1 What is the b'th term of -72, -127, -180, -231? b*2 - 58b - 15 What is the t'th term of -7091, -7054, -7017, -6980, -6943? 37t - 7128 What is the m'th term of -458062, -916124, -1374186, -1832248, -2290310? -458062m What is the d'th term of 2, -25, -88, -193, -346, -553? -d*3 - 12d*2 + 16d - 1 What is the c'th term of -2219, -8885, -19995, -35549, -55547? -2222c2 + 3 What is the y'th term of 7321, 7295, 7269, 7243? -26y + 7347 What is the o'th term of -106750, -106752, -106754? -2o - 106748 What is the k'th term of -129096, -129093, -129088, -129081, -129072, -129061? k2 - 129097 What is the q'th term of 2572, 5040, 7508, 9976? 2468q + 104 What is the t'th term of 27354, 109448, 246272, 437826, 684110? 27365t2 - t - 10 What is the b'th term of 5587, 11456, 17327, 23200, 29075? b2 + 5866b - 280 What is the y'th term of -1409, -1401, -1397, -1397, -1401, -1409? -2y*2 +	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.