Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
0h2 - h2 - 2h*2 + 0h2 - h2 + 2h2 + (-11 + 7 + 8)(3h2 + 2h*2 - 6h*2). -6h*2 Expand (48q + 30q - 111q)(1 + 0 + 1). -66q Expand 3c - 3c - c*3 + (-1 + 1 + 7c*3)(-2 - 1 - 1). -29c3 Expand (-t + 0t + 2t)(4t + 2 - 4t + t). t*2 + 2t Expand (2q2 + 0 + 0)(-3q + 2q - q) + (0q2 - q3 + 0q*2)(0 + 3 - 2) + 830q + 15q*3 - 830q. 10q3 Expand -o + o - o4 + (-5o + 3o + 3o)(-3o*3 + 3o*3 - 2o*3) + (-o + 2o - 2o)(5 - 3 - 1)(-o3 - 6o*3 + 3o3). o4 Expand (-14z2 + 11z*2 - 20z*2)(-3z + 2z + 0z). 23z*3 Expand (-3 + 0 + 1)(-4s - s3 + 4s) + (-s*2 + 2s - 2s)(-2 + 3s + 2). -s3 Expand -p + p + 2p + (1 + 1 + 0)(-4 + 4 + 7)(-4p + 3p + 3p). 30p Expand (n*3 - 3 + 3)(1 + 0 - 2) + 8n - 3n*3 + 3n*3 + 3n*3. 2n*3 + 8n Expand (0 - 17 - 11)(-1 - 3 + 2)(-2l2 + 3l*2 - 3l*2). -112l*2 Expand (-6j - 6 + 6)(0 + 0 + 2j*2). -12j*3 Expand (r - 2r + 0r)(-6 - 3 + 6 - 2r). 2r*2 + 3r Expand (-4a2 + 3a*2 - 3a*2)(6 - 4 - 5). 12a2 Expand (-j2 - 5j3 - j2 - j*3)(2j2 + 0j + 0j + (-3j + 3j - 3j)(-2j + 4j - j)) + 0 + 0 + 2j*5. 8j*5 + 2j*4 Expand (0d + 5d + 0d)(-2d*3 + 0d*3 + 0d*3). -10d*4 Expand (4y + 11y - 11y)(6 - 1 - 2). 12y Expand (2 - 2 - j)(-2j*2 + 23j - 23j + (-1 + 1 + j)(j + 0 + 0)). j*3 Expand (-12 + 12 - 5v)(-2 + 2 + 2). -10v Expand (5m + 2m - 3m)(0m3 + 2m*3 + 0m3) - 3 - m4 + 3 + 2m4 + 0m*3 + 0m3 - m4 + 4m4 + 2m - m*4. 11m*4 + 2m Expand (o*2 - 3o2 - o2)(-4o*3 + 0o3 - o3). 15o5 Expand (-4u + u + 5u)(-3 + 6 - 2) - 4u - 10u + 2u. -10u Expand (-f + 3f - f + (-2 + 2 + f)(-3 + 2 + 0) + 2f - 5f + f - 4f + 3f + 3f + 0f - f + 0f)(f + 2 + f - 3). -2f2 + f Expand (-1 - 1 + 0)(-2 + 1 - 2)(6m - 5m + m). 12m Expand 2 + 26o - 2 + (0o + 6o - 4o)(0 + 3 - 4). 24o Expand (5k2 + 5k*2 - 5k*2)(2 + 2 - 3)(k2 + 3k*2 - 5k*2). -5k*4 Expand (-3h*2 + 2 - 2)(3h - h - 3h) - 2h3 + 2h3 - h3. 2h3 Expand i4 - 3i4 + i4 + (-3i3 + i3 + i3)(i + 3 - 3) + 0i4 + 0i*4 + 6i*4 + (2 - i + 2i*2 + i)(3i2 - 6i*2 - 4i*2). -10i*4 - 14i*2 Expand -3w*3 + 5w*3 + 2w*3 + (6w*3 - 55w*2 + 55w*2)(1 - 4 + 1). -8w3 Expand -5y*3 + 4y3 - y3 + (17 - 4y - 17)(3y - 6y*2 - 3y) + (6y2 - 2y*2 - 3y*2)(-2 + 2 - y). 21y3 Expand -4m*2 + 0m*2 + 3m*2 + (1 + 1 - 4)(-2m2 + 2m2 + m2) + (5m - 2m - m)(m - m + 2m). m*2 Expand (3t*2 + 0t2 - t2)(t + 0t - 4t)(8t - 9t - 3t). 24t*4 Expand (0m*2 - 2m*3 + 0m*2)(0 - 1 + 2) - 22m2 + 22m*2 - 5m*3. -7m*3 Expand (4i - i - 5i)(-2i2 - 4 + 4)(1 - 3 + 0). -8i3 Expand 5a - 3a - 4a - a*2 + (3 + 1 - 3)(3a2 - a + a) + 11a*2 - 15a*2 - 8a*2 + (-3a - 2a2 + 3a)(-2 + 3 + 1) + 0a + 0a + 2a*2. -12a*2 - 2a Expand (2 + 3 - 6)(22 - 54 + 2f + 11). -2f + 21 Expand (2l*3 + l + 0l - 3l - 2l*2)(-5l + 0l + 2l). -6l*4 + 6l*3 + 6l*2 Expand ((-2 + 4 - 3)(4c - 3c - 3c) - 3c + 3c + 2c + c - 5c + 2c)(-c2 - 6c*4 - 3c*4 + 22c*4). 26c*5 - 2c*3 Expand (3 - 4 - 1)(-5 - 2k + 5)(1 + 1 - 5)(-5 + 1 + 3). 12k Expand (d - d + 2d3)(d*2 - 2d + 2d) + 6d*5 - 30d*5 + 53d*5. 31d5 Expand (-1 - z2 + 1)(-2z + 5z - 5z - 4). 2z3 + 4z*2 Expand (-2h + 7h + 1 + 8h)(-5h*3 + 3h*3 - 3h*3). -65h*4 - 5h*3 Expand -12i - 16i + 19i + (0 + 0 + i)(-2 + 0 + 1). -10i Expand (-4r + 3r + 5r)(-5r + r + 3r) + 0r2 - 4r*2 + 3r*2. -5r*2 Expand (2v*2 + 0v + 0v)(0v2 + v2 + 0v2) - v4 + v4 - v4 - v*4 + 0v*4 - 6v*4. -6v4 Expand (1 - 1 - n3)(0 - 1 + 0) - 2n*3 + 22n*3 - 7n*3. 14n*3 Expand 1 + 3f*4 - 1 + (-2f*3 - 5f*3 + 6f*3)(-5f + 3f + 3f)(1 - 1 + 2). f*4 Expand (7f + 2f - 3f)(0 + 2 - 3)(f*2 + 0f + 0f). -6f*3 Expand (6h - 3h - h)(-2h2 - 3h*2 + 3h*2) + 5h*3 - 3h*3 + 8h*3. 6h*3 Expand (-22 + 18 + 13)(0 + 3c + 2 - 2c). 9c + 18 Expand (3v - 2v + 0v)(8 + 24v - 8). 24v2 Expand (0c - 4c + 5c)(-6c*4 + 3c4 + c4) - 3c5 + 2c5 - c5 + 2c5 - c + c - 8c*5 + 22c*5 + 6c*5. 18c*5 Expand (2g + 4g - 5g)(-1 + 1 - g) + 4g*2 - 3g*2 - 4g*2 - 2g2 + g2 + 2g2. -3g*2 Expand (-j + 2j*2 + j)(-201j + 105j + 223j). 254j*3 Expand (-3x*2 - 4 + 2x*2 + 3)((2x + 3x - 4x)(2 + 2 - 2) - 14 + 14 + 23x)(x - 3x + x). 25x*4 + 25x*2 Expand (-23c - 26c + c)(2 + 1 - 1). -96c Expand (83 - 27s*3 - 83)(-s - 2s + 4s). -27s4 Expand -2i*2 + 3i*4 + 5i*4 + 2i*4 + (-2i*2 + 2i2 + i2)(-3i2 + i2 + 0i2). 8i*4 - 2i*2 Expand ((1 + 2h - 1)(8 - 3 - 2) + 2h - 2h - h + 2h - 3h + 0h + h + 0h - 2h)(-2h + 0h + 3h + (2 - h - 2)(-1 - 3 + 1)). 12h*2 Expand 5p - 2p5 - 5p + (1 + 2 + 4)(-9p*5 - 2p*5 + 2p*5). -65p*5 Expand (-17 + 17 - 16a*3)(7a - a - 4a). -32a4 Expand -4d2 + d2 + 4d2 + (17d + 16d - 2d)(4d - d - 2d - 1). 32d*2 - 31d Expand (16 - 5 + 0)(-2q + 0q + 3q). 11q Expand 9b3 + b4 - 9b3 + 3b3 + b4 - 3b3 - 5b*4 + 2b*3 - 2b*3 + (-4 + 2 + 4)(3b4 + b4 - 3b4). -b4 Expand 3p + 2p - 4p + (4 - 4 - p)(2 - 3 - 1) - 17p + 40 - 40. -14p Expand 0h3 - 3h*3 + 4h*3 + (4 - 2h - 4)(h2 - 3h*2 + 0h*2) - 2h3 + h3 + 0h3. 4h*3 Expand -5r2 + r4 + 5r2 + (-r + r + r)(-5r3 + 3r*3 - 6r*3) + 2r*4 - 2 + 2. -5r*4 Expand -5a*5 + 0a*5 + 2a*5 + (2a + 2 - 2)(2a*4 - 3a + 3a) + 3 - a5 - 3 - 2a*5 + 0a*5 + 4a5 - a3 - 2a3 + 5a3 + a5. 3a5 + 2a*3 Expand (-6n + 4n + 0n)(2n*3 + 7n - 7n) - 4n*4 + 0n*4 + 0n*4. -8n*4 Expand (1 + 2 - 6)(-5j3 + 3j*3 + 0j*3 + 3j*2). 6j*3 - 9j*2 Expand (7d - 2d - 3d)(-3d + 6 - 6) + d*2 - 3 + 3 + (4d*2 + 4 - 4)(5 - 1 - 2). 3d2 Expand -a3 - a3 + 3a*3 + (-a - 2a*3 + a)(-3 + 0 + 5) + 3 - 3 + a*3 - 3a + 3a3 + 3a. a*3 Expand (1 - 3 + 1)(3q - q - q)(4 - 4 + 11)(-5q*2 + 4q*2 + 2q*2). -11q*3 Expand -2u*2 + 0u2 + u2 + (2u - 3u - u)(-3 + 2u + 3) - 3u2 + 5u*2 - 3u*2 + (-2u*2 - 1 + 1)(-4 + 0 + 2) - 5 + 5 - 9u2. -11u*2 Expand (-4c - 5c + 8c)(-3 + 2 - 1). 2c Expand (0 + 0 - 3l - 2 + 2 - l + 0l + 2l + 0l + (3l - l - 4l)(1 - 1 - 1) - l - l + 0l + 0l - l + 2l)(2 - 2 + 2l)(-l + 0l + 3l). -4l*3 Expand (30y - 4y2 - 30y)(2y*2 + 3y*2 - 3y*2). -8y*4 Expand (-3g + 3g + 2g)(-5g3 + g3 - 2g3) + 3g*3 - 3g*3 + 2g*4. -10g*4 Expand (-5 + 5 + 6)(5 - 9 + 10)(u2 - 3u*2 + 3u*2). 36u*2 Expand -5 + 5 + 2m + (0 + 0 + 2m)(3 + 1 - 2) + 4 - 4 + m - m + 5m - 3m + 1 - 1 + 2m + (1 + 0 - 3)(6m + 0m - 3m) + 4m + m - 4m. 5m Expand -2w3 + 3 - 3 + (0w2 + w3 + 0w2)(0 - 4 + 0) - 3w3 + 7w*3 - 2w*3 + (-3w*2 - 4w*2 + 5w*2)(3w + w - 2w). -8w3 Expand (5f*2 - 2f*4 - 5f*2)(3 + 1 - 5) + f*4 - 2f*4 + 3f4 - f4 + 4f4 - 8f4. -f4 Expand (1 + 0 + 1 + (-1 + 2 + 0)(1 - 2 + 2))(3j - 10j - 6j). -39j Expand (y*5 + 2y*5 - 2y*5)(3 - 2 - 3) + (-3 + 8y + 3)(-y2 + y2 + y*4). 6y*5 Expand 2h*4 + 3 - 3 + (2h*3 - 5h*3 + 2h*3)(3h - 2h - 3h) - 2h*4 + 2h4 + h4. 5h4 Expand (-5 + 0 - 4)(-4o - 2o + o). 45o Expand (-4 + 12 + 3)(-3l3 - l3 + 2l*3). -22l*3 Expand 9u*5 - 2u*5 + 0u*5 + (-4u*2 - 2u*3 + 4u*2)(-6u + 2u + 3u)(-2 - 2u + 2). 3u*5 Expand (9d*2 + d - 13d*2 + 21d*2)(4 - 2d - 4). -34d*3 - 2d*2 Expand (o + 0o - 3o)(0 + 0 - 1) + (-2 + 3 - 2)(4o - o - o) - 2o - o + o + o + 0o - 3o - 4o + 6o - 4o. -6o Expand (-m - 4m + 6m + (m + 3 - 3)(-4 + 2 + 0) - 3m - m + 3m)(-5m + 3m + 0m). 4m2 Expand (-4 + 4 + 2g)((0 + 0 + 2)(0g + 2g + g) + (2g - 6g + g)(-4 + 2 + 1)). 18g*2 Expand (-r + 7r - r)(4 - 4 + 3r*3) + 3r3 - r4 + 2 - 7r2 + 7r*2. 14r*4 + 3r*3 + 2 Expand ((0s + s + 0s)(-1 + 1 - s*2) + 1 - 1 - 2s*3 + 2s*3 - 28 + 28)(-2s + 2s - 2s). 2s**4 Ex	{ "pile_set_name": "DM Mathematics" }
1013. 71, 113, 131 What are the prime factors of 21040? 2, 5, 263 What are the prime factors of 710670? 2, 3, 5, 23689 What are the prime factors of 18084? 2, 3, 11, 137 What are the prime factors of 235018? 2, 7, 16787 List the prime factors of 36245617. 36245617 What are the prime factors of 68947? 68947 List the prime factors of 3036693. 3, 11, 17, 5413 List the prime factors of 1372960. 2, 5, 8581 What are the prime factors of 109887? 3, 36629 List the prime factors of 2717582. 2, 7, 194113 What are the prime factors of 97685? 5, 7, 2791 What are the prime factors of 289014? 2, 3, 11, 29, 151 What are the prime factors of 2892202? 2, 479, 3019 List the prime factors of 6091059. 3, 13, 47, 3323 List the prime factors of 209820. 2, 3, 5, 13, 269 List the prime factors of 192158. 2, 96079 What are the prime factors of 197827? 7, 59, 479 What are the prime factors of 29633703? 3, 11, 17, 101, 523 List the prime factors of 608613. 3, 37, 5483 List the prime factors of 971981. 971981 List the prime factors of 1645170. 2, 3, 5, 29, 31, 61 List the prime factors of 1003054. 2, 13, 173, 223 What are the prime factors of 5646050? 2, 5, 112921 List the prime factors of 20305. 5, 31, 131 List the prime factors of 149796. 2, 3, 19, 73 List the prime factors of 13631. 43, 317 What are the prime factors of 16683849? 3, 7, 13, 1567 List the prime factors of 6120012. 2, 3, 223, 2287 List the prime factors of 1230552. 2, 3, 211 List the prime factors of 439567. 439567 What are the prime factors of 287606? 2, 11, 17, 769 List the prime factors of 16668. 2, 3, 463 List the prime factors of 36975931. 283, 130657 What are the prime factors of 641757? 3, 213919 What are the prime factors of 296986? 2, 163, 911 List the prime factors of 149467. 137, 1091 List the prime factors of 6796484. 2, 1171, 1451 What are the prime factors of 1424939? 1424939 What are the prime factors of 96192? 2, 3, 167 List the prime factors of 9809068. 2, 17, 67, 2153 What are the prime factors of 28349037? 3, 29, 47, 2311 What are the prime factors of 1157193? 3, 42859 What are the prime factors of 41005? 5, 59, 139 What are the prime factors of 77886? 2, 3, 4327 What are the prime factors of 419214? 2, 3, 109, 641 What are the prime factors of 1968466? 2, 157, 6269 What are the prime factors of 51519? 3, 13, 1321 What are the prime factors of 961325? 5, 38453 List the prime factors of 5012572. 2, 97, 12919 What are the prime factors of 14540154? 2, 3, 2423359 List the prime factors of 6130691. 7, 97, 9029 What are the prime factors of 377552? 2, 7, 3371 What are the prime factors of 12772842? 2, 3, 113, 18839 List the prime factors of 15339209. 15339209 What are the prime factors of 9397240? 2, 5, 234931 List the prime factors of 1032598. 2, 7, 73757 What are the prime factors of 846722? 2, 23, 79, 233 List the prime factors of 7891775. 5, 315671 List the prime factors of 124989. 3, 61, 683 List the prime factors of 13727059. 13727059 List the prime factors of 645320. 2, 5, 13, 17, 73 List the prime factors of 18134606. 2, 7, 211, 877 What are the prime factors of 13732052? 2, 67, 51239 List the prime factors of 897071. 7, 128153 What are the prime factors of 852349? 41, 20789 List the prime factors of 246087. 3, 37, 739 What are the prime factors of 1809477? 3, 107, 1879 List the prime factors of 3470653. 3470653 What are the prime factors of 221479? 241, 919 List the prime factors of 770859. 3, 97, 883 What are the prime factors of 239618? 2, 119809 List the prime factors of 4333368. 2, 3, 13, 17, 19, 43 What are the prime factors of 601731? 3, 13, 37, 139 What are the prime factors of 1557351? 3, 173039 List the prime factors of 990607. 17, 58271 What are the prime factors of 2585329? 47, 67, 821 List the prime factors of 163385. 5, 41, 797 List the prime factors of 15396545. 5, 23, 5821 What are the prime factors of 804804? 2, 3, 7, 11, 13, 67 What are the prime factors of 5968? 2, 373 What are the prime factors of 1171374? 2, 3, 195229 What are the prime factors of 19014045? 3, 5, 307, 4129 What are the prime factors of 20009256? 2, 3, 833719 What are the prime factors of 162433? 127, 1279 List the prime factors of 1635529. 7, 31, 7537 List the prime factors of 8666233. 139, 62347 What are the prime factors of 255861? 3, 28429 List the prime factors of 105433. 59, 1787 What are the prime factors of 11960487? 3, 7, 11, 523 List the prime factors of 25423109. 17, 1495477 List the prime factors of 440869. 11, 13, 3083 What are the prime factors of 2302831? 1433, 1607 What are the prime factors of 6904636? 2, 1726159 What are the prime factors of 158545? 5, 37, 857 List the prime factors of 20717672. 2, 31, 139, 601 What are the prime factors of 648776? 2, 81097 What are the prime factors of 420931? 7, 60133 What are the prime factors of 844959? 3, 281653 What are the prime factors of 11378? 2, 5689 List the prime factors of 27368. 2, 11, 311 List the prime factors of 837772. 2, 13, 16111 What are the prime factors of 4424793? 3, 37, 39863 What are the prime factors of 5330659? 19, 280561 What are the prime factors of 1195089? 3, 7, 56909 List the prime factors of 123158. 2, 7, 19, 463 List the prime factors of 14507981. 149, 97369 List the prime factors of 85816. 2, 17, 631 List the prime factors of 730186. 2, 331, 1103 List the prime factors of 675859. 675859 What are the prime factors of 584428? 2, 13, 11239 List the prime factors of 4901151. 3, 17, 5653 List the prime factors of 11615564. 2, 653, 4447 What are the prime factors of 4006684? 2, 11, 41, 2221 What are the prime factors of 5322328? 2, 11, 31, 1951 What are the prime factors of 309567? 3, 19, 5431 What are the prime factors of 236170? 2, 5, 11, 19, 113 List the prime factors of 811506. 2, 3, 211, 641 List the prime factors of 581329. 7, 83047 What are the prime factors of 15562710? 2, 3, 5, 19, 479 List the prime factors of 1185998. 2, 11, 31, 37, 47 List the prime factors of 1051990. 2, 5, 105199 What are the prime factors of 19409393? 17, 19, 60091 List the prime factors of 2302432. 2, 11, 31, 211 What are the prime factors of 12895646? 2, 367, 17569 What are the prime factors of 2890120? 2, 5, 72253 List the prime factors of 639788. 2, 307, 521 What are the prime factors of 50636? 2, 12659 What are the prime factors of 2905033? 2905033 What are the prime factors of 7395357? 3, 17, 145007 What are the prime factors of 43124944? 2, 47, 57347 What are the prime factors of 586545? 3, 5, 39103 What are the prime factors of 1086469? 1086469 List the prime factors of 34485. 3, 5, 11, 19 List the prime factors of 8192999. 8192999 List the prime factors of 3766910. 2, 5, 7, 53813 List the prime factors of 120662. 2, 60331 List the prime factors of 12914183. 67, 192749 List the prime factors of 5187349. 313, 16573 What are the prime factors of 19502565? 3, 5, 31, 41941 List the prime factors of 4074952. 2, 7, 72767 List the prime factors of 252752. 2, 15797 What are the prime factors of 329181? 3, 179, 613 List the prime factors of 245513. 245513 What are the prime factors of 460798? 2, 13, 37, 479 List the prime factors of 7778863. 53, 317, 463 List the prime factors of 3869022. 2, 3, 644837 List the prime factors of 537388. 2, 37, 3631 What are the prime factors of 17767742? 2, 2161, 4111 What are the prime factors of 214230? 2, 3, 5, 37, 193 List the prime factors of 28376307. 3, 709, 4447 List the prime factors of 1438621. 863, 1667 List the prime factors of 11551739. 73, 158243 What are the prime factors of 1140566? 2, 7, 257, 317 What are the prime factors of 1125723? 3, 17, 22073 List the prime factors of 374230. 2, 5, 37423 What are the prime factors of 1982333? 977, 2029 What are the prime factors of 172710? 2, 3, 5, 19, 101 List the prime factors of 316561. 7, 41, 1103 What are the prime factors of 7543999? 67, 109, 1033 List the prime factors of 6086455. 5, 241, 5051 What are the prime factors of 2964374? 2, 7, 211741 What are the prime factors of 196614? 2, 3, 11, 331 What are the prime factors of 15769076? 2, 23, 171403 List the prime factors of 3783503. 17, 457, 487 What are the prime factors of 960163? 31, 47, 659 List the prime factors of 191772. 2, 3, 7, 761 List the prime factors of 2954092. 2, 738523 W	{ "pile_set_name": "DM Mathematics" }
2))(-372z - 7628z + 243z) to the form qz3 + yz*2 + g + iz and give q. -7757 Express 3q + 3q*4 - 3q + (51 - 61 - 28)(-2 + 3q*4 + 2) - 4q*4 + 4q*4 + 2q*4 in the form u + wq*3 + nq + iq2 + yq*4 and give y. -109 Express (7640l - 244997 + 244997)(l + 0 + 0) in the form t + vl + fl2 and give f. 7640 Express (-286644g + 285582g - 3 + 7)(-1 + 0 + 3) as og + q and give q. 8 Express 3213l*2 + 177l - 151l - 26l in the form il + g + ul*2 and give i. 0 Rearrange -27v + 54 + 277v3 + 3v*2 - 278v*3 - 58 to nv + y + hv2 + cv*3 and give h. 3 Express -6w2 + w2 - 1 - 375865w3 + 375843w*3 - w in the form zw + j + aw3 + mw*2 and give m. -5 Express -3b - 285313b3 - 2b + 283759b3 in the form cb*2 + wb*3 + yb + s and give y. -5 Rearrange -31 - 39 - 2a - 35 + 162 - 46 - 21a*2 to the form na + w + ra2 and give r. -21 Express -313o*3 - 48o*2 + 152 + 319o*3 + 43o*2 - 9 in the form ho + ao2 + do*3 + b and give b. 143 Rearrange (290 - 99970a - 1133 + 283 + 270 + 290)(0a - 4a + 6a) to ra + ba*2 + s and give r. 0 Express -46 + 20 + 1298u*2 + 19423u*2 + 26 as pu*2 + ju + o and give p. 20721 Express (-132f3 + 257f*3 - 137f*3)(4f + 0f - f) + (f - 1 + 1)(5f*3 - 4f*3 + 0f*3) as wf*4 + if + yf3 + rf*2 + k and give w. -35 Rearrange 47w*3 - 142638w - 6w2 + 6w*2 - 2w*4 + 142599w to hw4 + x + cw*2 + gw + ow3 and give h. -2 Rearrange (-4 + 4 + 2k)(-2 + 2 - 4)(6824k2 - 6814k*2 + 950k*3 - 951k*3 - 756) to the form fk*3 + y + vk*2 + lk*4 + wk and give l. 8 Express -1 + 2r2 + 8r + 169r4 + 5 + 3r*3 + 2 - 165r*4 - 17r in the form yr + fr*3 + xr*2 + v + ur*4 and give v. 6 Rearrange (4313 - 10261 + 5264 - 7191 - 9593 - 10211)(-1 + 1 - 3o2) to lo + no2 + u and give n. 83037 Express 1 - 2i*3 - 231i*4 - 26i*4 + 19i*2 - 729i*4 + 90i*4 - 21i*2 as ui + oi4 + di*3 + gi*2 + y and give g. -2 Rearrange -160h - 399h + 22h - 404h to fh + t and give f. -941 Express (-2o2 - 3o + 3o)(-2 - 2o + 2) + 9518o*2 + 3o*3 - 1050o + 1051o - 5154o*2 as do*2 + qo + i + fo3 and give f. 7 Express (6693y - 676y + 3778y - 329y)(-4y2 - y2 + 4y*2) as gy*2 + my + ry3 + h and give r. -9466 Rearrange -59 + 60 - 1281r*2 + 3033r*2 to the form l + qr + dr2 and give d. 1752 Express -185w*2 + 9 + 7 + 39w*2 - 150w*2 - 138w*2 in the form zw*2 + qw + b and give z. -434 Express l*4 + 6l3 + l2 + 2l + 278645 - 3l*3 - 278653 as m + ol*4 + ql + jl2 + dl*3 and give d. 3 Express 1633g*2 + 12429g*2 - 3753g*2 in the form kg*2 + x + ng and give k. 10309 Express 18960250c - 18 - c2 - 18960245c - 33c2 in the form bc*2 + q + nc and give q. -18 Rearrange (-34q3 + q + 29q*3 + 2q)(80 - 80 + 180q) to jq + iq*3 + wq*2 + l + oq*4 and give w. 540 Rearrange 27656x*3 - 7 - 13830x*3 - 13828x*3 + 10x + 3x4 - 5x*2 to the form kx*2 + qx*4 + r + ix + sx3 and give k. -5 Rearrange -c - 31c*3 + 13c*4 - 40c*3 - 32c*3 + 108c*3 - 2 to wc*2 + gc*3 + ic*4 + f + tc and give t. -1 Express -10 - 12850j2 + 6467j*2 + 6489j2 - j3 in the form xj2 + fj + g + hj3 and give g. -10 Express 1222 + 996 + 0s*2 - 2s*2 - 527 as ws*2 + k + zs and give k. 1691 Express 29o2 + 2 - o + 33o*2 + 66o*3 - 1 - 48o*3 + 0o*2 as jo*2 + co*3 + f + xo and give f. 1 Express (-3 - 2t + 3)(7 - 4 + 0)(178t + 246t + 75t) as ut2 + zt + h and give z. 0 Rearrange -6177y - 444y*2 + 3082y + 3088y to v + my*2 + cy and give m. -444 Express -2f2 - 285f*3 + 6f*2 + 3f + 156f3 - 4f + 155f3 - 3 as gf + u + hf2 + nf*3 and give n. 26 Express 13099z*2 + 12372z*2 - 323 + 323 as tz*2 + g + wz and give t. 25471 Rearrange -201s2 - 1506s*2 - 1061s*2 to ps*2 + us + l and give p. -2768 Rearrange y*2 + 120058y + 120065y - 240137y - 24y3 to sy + py3 + iy*2 + r and give p. -24 Rearrange -2914t*3 + 0 - 502t*3 + 0 + 149t*3 + (-3 + t + 3)(11t - 11t + 13t2) to the form mt*2 + f + st + zt3 and give z. -3254 Express -4829g*2 - 3457g*2 + 1512g*2 in the form lg*2 + ug + o and give l. -6774 Express (-38p + 130p + 47p)(3p2 - 12p*3 + 7p3 - p2) in the form ap + qp*2 + c + mp*4 + sp*3 and give m. -695 Rearrange 38t*2 + 1818t*2 + 3170t*2 to the form q + gt*2 + dt and give g. 5026 Rearrange (-18d + 18d + 40d2)(22 - 1308d - 176 + 1307d) to c + od2 + hd*3 + vd and give h. -40 Rearrange 10q4 - 7q3 + q3 - 7 - 2q2 + 11 + 3q*3 + 6q*3 + 3q to the form bq2 + l + pq + iq4 + rq*3 and give p. 3 Rearrange 728 + 165k - 690 + 213k + 0k to the form z + uk and give u. 378 Express -9152n - 38n2 + 12n*2 + 20n*2 + 7n*2 in the form un*2 + tn + a and give u. 1 Rearrange 51m + 54m - 197m + 56m + 49m + 121 to bm + n and give b. 13 Rearrange -44 - 42 + 84 + 1268j + 2 to q + bj and give b. 1268 Express (-1381 - 2314 - 1813)(-c + c + 3c) as k + qc and give q. -16524 Rearrange -15q - 32q - q3 + 23528364q*2 + 2q*3 - 2 - 23528433q*2 to nq*2 + g + hq*3 + kq and give h. 1 Rearrange 138739o + 138738o - 7372o2 - 277477o to yo + l + ko*2 and give k. -7372 Express -4804n2 + 1 - n3 + 2421n2 + 4n + 2382n2 + n4 in the form an*4 + ln*3 + r + on + wn2 and give a. 1 Express (t2 + 0t*2 - 2t*2)(-3720 + 3720 + 10263t) in the form a + mt*3 + it + pt2 and give m. -10263 Express -301 + 24n*2 + 463 - 160 as rn*2 + an + y and give y. 2 Rearrange (243q + 375q + 38q)(-3 + 0 + 6)(q - q - 3q*2) to yq*3 + g + hq*2 + sq and give y. -5904 Rearrange 15l4 - l2 + 2 + 23l - 62l3 - 26l - 16l4 - 151l*3 to a + xl*2 + ol + tl3 + pl*4 and give a. 2 Express 32g*2 - 1074g - 44g2 + 936g + 52g2 + 11g*2 in the form ng*2 + k + pg and give p. -138 Rearrange (14c2 + 49c*2 + 0c*2)(-c + 3c + 0c)(-3 - 6 - 4) to rc*2 + g + nc*3 + oc and give n. -1638 Express (-4b - 11b + 7b)(-b*2 + 0b + 0b) - b3 - 5b*3 + 4b*3 - 16b*2 + 17b*3 - 29b*3 + 26b*3 as gb + p + nb2 + yb*3 and give y. 20 Express -100p + 76p2 + 100p + 2 + 951p2 as op*2 + l + tp and give l. 2 Express -45442h + 87213h - 31252h as n + mh and give n. 0 Express (-3 - 1 + 3)(-3i*3 - 3i*3 + 5i*3) + 501i - 1082i - 241i*3 + 559i as ni + r + yi*2 + zi*3 and give n. -22 Express -15z*2 - 9725z + 4861z + 4862z + 1 - 3z4 + z3 in the form az + gz2 + l + nz*4 + tz*3 and give l. 1 Rearrange (0 - b + 0)(3165b3 + 6897b*3 + 10576b*3 + 1824b*3) to mb + nb3 + q + kb*2 + cb*4 and give c. -22462 Express (-3 + 2l + 3)(0 - 1 + 2)(26l3 - 19l*3 + 1216l*3) as gl*3 + ql*2 + w + pl*4 + ml and give p. 2446 Rearrange -5d3 - 606d + 6d3 - 432d - 479d - 196d to the form id3 + y + zd*2 + bd and give i. 1 Express -1615n3 + 11n*2 - 11n*2 + 14653 - 14651 in the form yn*3 + dn + b + sn2 and give y. -1615 Rearrange 18 + 32i + 2 - 13 + 39 to wi + a and give a. 46 Express 4530 - 4f*2 - 4710 + 2f*2 as df + uf2 + r and give u. -2 Rearrange (-9 + 1 + 1)(1463 + 1954 + 700 + 2128)(-2u - 4 + 4) to ku + c and give k. 87430 Rearrange -9s + 628s3 + 80s - 22s - 20s - 23s to fs + ys3 + t + ns*2 and give f. 6 Rearrange (-4 - 5 + 1)(232 - 458 + 2o2 + 230) to the form m + ro + xo2 and give x. -16 Express -4w*4 - 1601522w + 1601520w + 30w*3 + 9w*4 + 10w*4 - 3w*4 in the form yw*4 + jw + x + fw2 + lw*3 and give l. 30 Express -95n + 324n + 448n as vn + p and give p. 0 Express -d + 19 - 143 - 3d*3 + 64 - 2d*4 - 35 as md*3 + fd + sd2 + p + id*4 and give m. -3 Express -9x*3 + 14944 - 3x*2 + 5x*3 + x - 14928 + 2x*2 as ix*2 + b + yx + sx3 and give i. -1 Rearrange (0i + 0i + i)(762i - 102 - 757i - 23) + 2i2 - 4i*2 + 3i*2 to ri*2 + si + j and give s. -125 Express 10 - 21u - 35u + 53u - 2u3 + u2 as vu3 + au + yu*2 + m and give y. 1 Rearra	{ "pile_set_name": "DM Mathematics" }
increasing order. a, -3/2, -1/5 Let c = -164.38 - -164.18. Sort c, 37.3, -11 in increasing order. -11, c, 37.3 Suppose 13g + 22 = -251. Let k = g - -23. Sort k, 3, 7 in ascending order. k, 3, 7 Suppose 0 = -5n + 11 + 4. Let k be 14/12 - (-1)/n. Let f = 307.72 + -308.12. Sort k, -0.3, f in ascending order. f, -0.3, k Suppose -8w - 9 = -3w + 3j, -4w - 14 = -j. Let y be (w + 4)3 - 2. Put 4, y, -4 in descending order. 4, y, -4 Suppose 0 = -2k + 2u - 12, -5k + u + 28 = 54. Put -19, -9, 2, k in increasing order. -19, -9, k, 2 Suppose -310920b - 155 = -311075b. Let x = 3 - -12. Suppose 2u = 2d + 14, -6d - 5u - x = -d. Sort 5, d, -6, b in increasing order. -6, d, b, 5 Let f be 1 + 16 + 2 + -22. Sort f, -4, -2, -18. -18, -4, f, -2 Let f = -1251 - -1243. Put -5, 2, f in descending order. 2, -5, f Let t = -710269/67 - -10601. Put 0.2, t, 22 in decreasing order. 22, 0.2, t Let a = 4623 - 4628. Put 0.01, a, 0.2 in increasing order. a, 0.01, 0.2 Let m = 6766 + -7255. Put 4, m, 0 in descending order. 4, 0, m Let b = -18355 + 18363. Sort b, -42/11, 1, 4 in descending order. b, 4, 1, -42/11 Let f = -14.2 - -1.2. Let m = -179.1 + 179. Let w = 1.4 - -0.6. Put m, w, -0.5, f in decreasing order. w, m, -0.5, f Let t = -7.4 + 11. Let j = -3344 - -3347.2. Let x = t - j. Put x, 1/3, -2 in decreasing order. x, 1/3, -2 Let g = 0.2228 - -0.2772. Let t be (-19)/(-6) + 12/(-18). Put 2/7, 4, t, g in increasing order. 2/7, g, t, 4 Let x = -7.282 + 6.782. Put 0, x, -2, -31/3 in descending order. 0, x, -2, -31/3 Let r = -33.7 + 30.9. Let v = -2.9 - r. Sort -2, -6, v. -6, -2, v Suppose 4178y - 4193y = 75. Put 187, 0, -2, y in descending order. 187, 0, -2, y Let r = 3278 + -3277.5. Let s be 2 - 1 - 0 - -2. Let a = 1/46 - 13/69. Put r, s, a in increasing order. a, r, s Suppose 0 = 11n - 2316 + 666. Suppose 4g + 132 = -2q, 0g - 5q + n = -5g. Sort g, 0, -5 in increasing order. g, -5, 0 Suppose -41k + 33k = -152. Let l(m) = 2m - 38. Let c be l(21). Sort k, -2, c in increasing order. -2, c, k Let a = -25.751 - -25.551. Sort -24, a, -1, 6/11. -24, -1, a, 6/11 Let r(y) = -y3 + 14y*2 - 13y - 9. Let s be r(13). Let x = s + 9. Suppose -4v = 2k + 2, -3v - 3k - 9 = -x. Sort 3, v, 5 in increasing order. v, 3, 5 Let b = 1150 - 1154. Let a = 40 - 24. Let r = 18 - a. Put b, r, -0.1, -3 in ascending order. b, -3, -0.1, r Let g(y) = -5y + 87. Let c be g(26). Let r = 41 + c. Put r, -5, 6 in increasing order. -5, r, 6 Let i be 178/(-801) - (-80)/(-6)(-4)/150. Sort 4/9, -1/5, i, 7 in decreasing order. 7, 4/9, i, -1/5 Let m = 103 + -102.529. Let r = m - -0.049. Let j = r - 1.52. Sort j, 0.4, 3. j, 0.4, 3 Suppose -m + 15 = 4l, 3l = -131m + 126m + 24. Suppose 4u - 68 = -0u. Sort -0.1, -1, u, l. -1, -0.1, l, u Let b be (3 + -4)/(352/1210 + 1/(-11)). Sort 5, b, 20, 16. b, 5, 16, 20 Let t = 12 - -3. Let u = -123 - -145. Suppose 0 = -8h - 2 - u. Put 2/9, h, t, 0.5 in descending order. t, 0.5, 2/9, h Let t = -0.0722 + 0.0722. Sort 2/3, -1/5, t, 34 in decreasing order. 34, 2/3, t, -1/5 Let d = -1 + 0. Let p = 106953791/221 - 483950. Let f = p - 51/13. Put -0.5, f, d in decreasing order. f, -0.5, d Let l be 2(-72)/(-5) - 20/(-100). Suppose -3i = -3t + 27, -6t + i + l = -t. Sort 4, t, 0, -53 in ascending order. -53, 0, 4, t Suppose c = 3b - 24 + 15, 0 = 3c - b - 5. Suppose 0 = 5f - 5m - 10, 0 = 5f - 3f + cm - 19. Suppose -4 = -3q + 2. Sort q, -5, -4, f in descending order. f, q, -4, -5 Suppose -2g = -5u - 26, -4u + 5g + 3 = 34. Sort -1, 4, u, 2, 0. u, -1, 0, 2, 4 Let t(y) = -3y*2 - 15y - 3. Let j be t(-5). Let f = -45.23 + 3.93. Let d = 41 + f. Put d, j, 2, -1/3 in decreasing order. 2, d, -1/3, j Let g(f) = 33f + 2307. Let u be g(-70). Put -25, -11, 5, u in ascending order. -25, -11, u, 5 Let g = -2.6 + 0.55. Let r = g + 0.05. Let n = -40/123 - -446/615. Put n, 0.02, r in ascending order. r, 0.02, n Let l be (-68)/(-7) - 16/(-56). Suppose -2j - 8 = 12. Let s be (-3)/5 + 14/j. Put s, l, -1 in descending order. l, -1, s Let g be ((-76)/(-20) + -3)50/20. Put -30, 3, -1, g, -4 in ascending order. -30, -4, -1, g, 3 Let a be ((-8)/9 - (-22)/99)-6. Suppose 16 = ag, 5g - 10 = -0q + 2q. Let y be -4 + (-25)/q + 5. Sort y, 0, -9. -9, y, 0 Let u(t) = -t*3 - 15t*2 + 52t + 604. Let v be u(-16). Sort -5, v, 5, -3 in descending order. v, 5, -3, -5 Suppose 784 = 5l + 44l. Suppose -2p + 3 = -u, 0 - 2 = -3p + 2u. Let q be l/(-10) + (p - (-102)/(-30)). Put -5, q, 1, 5 in increasing order. -5, q, 1, 5 Let o(h) = h2 - 25h + 158. Let g be o(13). Put 1, -278, g in decreasing order. g, 1, -278 Let u = 2/36487 - 72992/328383. Put 3/10, 166, u in ascending order. u, 3/10, 166 Let q = -5/163 - -501/5705. Let l = 179/70 - q. Let a = 3.95 + 0.05. Put -10, 3, a, l in decreasing order. a, 3, l, -10 Let q = 171 + -170.674. Let h = q + 0.174. Sort -6, -1/5, h in increasing order. -6, -1/5, h Let n = -127.634 + 127.334. Let g = 335.0544 + -0.0544. Sort g, n, 1 in increasing order. n, 1, g Let p(x) = 24x - 37. Let o be p(2). Let z be 1/2(13 - o). Sort -4, z, 5 in descending order. 5, z, -4 Let u = -2.7 - -0.7. Let w be (-24)/1065/(-26). Let m = -12 - -13. Put w, 0, u, m in descending order. w, m, 0, u Suppose -4l = -4p + p + 14, 2p + 4 = -4l. Let a be ((-30)/(-4))/((-69)/(-6) + -12). Let w be (-9)/5 - 12/a. Put -5, p, w, -3 in ascending order. -5, -3, w, p Let g(m) = 28m + 1313. Let o be g(-47). Let s(p) = -p*3 + 5p*2 + p. Let z be s(5). Let y = z + -6. Sort o, 2, 5, y in increasing order. o, y, 2, 5 Suppose 3 + 32 = 7h. Let y = 3 - h. Let p be 4/(-18) - 2/(-9). Put p, y, 5, -4 in decreasing order. 5, p, y, -4 Suppose 2t + 2 = 12. Let j = 556 + -557. Sort 4, j, -5, t. -5, j, 4, t Let j = -41358 + 41348. Put j, -5, 5, -2, -3 in decreasing order. 5, -2, -3, -5, j Let s = -6874.8 + 6875. Put -1, s, 11/10, -2, 3 in ascending order. -2, -1, s, 11/10, 3 Let n = -3221.869 - -3222. Sort 2, n, -0.4, -4/3, -1/6 in decreasing order. 2, n, -1/6, -0.4, -4/3 Let d = 0.749 - -0.251. Put 4, -42, d in decreasing order. 4, d, -42 Suppose -1 + 3 = 2w. Suppose -5n = -3u - 21, n - u + w = 2n. Let v be (-291)/(-194) - (-2 + (-9)/6). Put n, v, -6 in descending order. v, n, -6 Let r be (-10 + (2 + -1)-2)/(-2). Let n = 1.627 - 1.327. Put n, -8, r in increasing order. -8, n, r Let v = -6535 + 111147/17. Let g = -502/153 + v. Sort -2/5, g, -10/11. -10/11, -2/5, g Let j = -15.954 - -15.854. Put -3, -2/5, 0.04, j in ascending order. -3, -2/5, j, 0.04 Suppose 5k - 19 + 8 = 4f, 0 = 4f + 16. Let p = 13 + -9. Suppose 55 + 44 = -33o. Sort o, k, 5, p in decreasing order. 5, p, k, o Let w = 40 + -17. Let s = 23 - w. Let g = 1341/7 + -192. Sort g, 9, s in decreasing order. 9, s, g Suppose 0 = 2s - 8, -5t + 5 + 9 = s. Suppose -56j + 59j = -15. Suppose 2u + 15 = 3u + 4w, -u + 11 = 2w. Sort u, t, j in descending order. u, t, j Let y = 0.4107 + 2.5893. Sort -2, 0.96, -0.5, y in descending order. y, 0.96, -0.5, -2 Let a be 3375/108 + 6/8. Suppose 11v + av = -43. Sort -2/23, 2/9, v in increasing order. v, -2/23, 2/9 Let h(k) = -1165 - 16k2 - k3 + 1150 - 78k - 2k2. Let a be h(-11). Sort -3, a, 4 in descending order. 4, -3, a Let i = 6 - 5.913. Let v = -19.913 - i. Let k = -22 - v. Sort 1, k, -5 in increasing order. -5, k, 1 Let m = 117.234 + -111.2. Let c = -0.034 + m. Let v = -6.3 + 6.7. Sort c, v, 3, -4 in decreasing order. c, 3, v, -4 Suppose -5r = -3j + 5, -4j - 50 + 18 = 3r. Let k be (-5 + -11)/(-2 + 0). Put 4, k, j in decreasing order. k, 4, j Let h be (-8)/((-8)/(-3)) - -4 - 3. Suppose -3t - 4o + 28 = 0, 12 = 5o - 2o. Let l = 0 - -5. Sort -4, h, t, l in descending order. l, t, h, -4 Let p = 5407/16248 - -3/5416. Put 0.09, -5/6, p, -2, -0.06 in descending order. p, 0.09, -0.06, -5/6, -2 Let k = 232 + -232.068. Let v = -4.068 - k. Let t(b) = b2 + 2b + 5. Let z be t(0). Sort z, v, -3, -2 in ascending order. v, -3, -2, z Let w(q) = 49q - 302. Let k be w(14). Sort 3, k, 4 in descending order. k, 4, 3 Let l be (75819/(-254))/(2/4). Put -5, 5, l in decreasing order. 5, -5, l Let a = 1250 + -1251. Put -4, -3, a in decreasing order. a, -3, -4 Let c = 10.1 + -9.2. Let u = c + -17.9. Sort u, 4, 3. u, 3, 4 Let g(n) = n3 + 50n*2 - 160n - 57. Let y be	{ "pile_set_name": "DM Mathematics" }
Find the first derivative of x(a) wrt a. -72a + 8 Let g(p) be the third derivative of -2/15p*5 + 0p*4 - 6p*2 + 0p*6 + 2/35p*7 + 0p + 0 + 0p3. What is the third derivative of g(f) wrt f? 288f Let l(g) be the third derivative of -g6/48 - g5/12 + g*4/4 - 14g2. Let p(m) be the second derivative of l(m). Find the first derivative of p(u) wrt u. -15 Let f(l) be the third derivative of l7/210 - 11l6/24 - l5/20 + 25l*4/8 - 3l*2 - 2. Find the third derivative of f(t) wrt t. 24t - 330 Let k(x) = 40x2 - 26x + 576. Let p(u) = 8u2 - 5u + 115. Let i(m) = -2k(m) + 11p(m). What is the derivative of i(o) wrt o? 16o - 3 Let g(t) = -t3 - 2. Let s be g(0). Let y be (3 + -5)/(s/3). Find the third derivative of -x3 + x2 - 7x*2 + 0xy wrt x. -6 Let c(x) be the second derivative of -x6/180 - 5x4/24 + x3/2 + 5x. Let r(u) be the second derivative of c(u). Find the first derivative of r(w) wrt w. -4w Suppose -12 = -2m + d, 2m - 20 = -2d + 7d. Let q(i) = i - 3. Let v be q(m). Find the third derivative of 7b*2 - 16b*v + 4b2 + b6 wrt b. 120b3 Let u(a) be the third derivative of 17a9/168 + a7/210 + a5/30 - a4/12 + a*2 + 20a. What is the third derivative of u(q) wrt q? 6120q3 + 24q Let h(x) = 3x2 - 1. Let o(y) = -151y*3 + 306y*2 + 6. Let n(u) = 6h(u) + o(u). What is the third derivative of n(m) wrt m? -906 Let l = 9 + -9. Suppose 0 = -4i - u + 13, li + 3u = 2i + 11. Find the second derivative of 3y3 + 15y - 17y + iy*3 wrt y. 30y Find the second derivative of 276y3 - 2y - 3y + y + 172y*3 - 178 + y wrt y. 2688y Let t(i) be the second derivative of -i9/3024 + i6/60 - 4i3/3 + 4i. Let s(u) be the second derivative of t(u). Find the third derivative of s(l) wrt l. -60l2 Let g(q) be the third derivative of 0 + 0q*4 + 0q*3 + 10q*2 + 0q*6 + 19/210q*7 - 23/60q*5 + 0q. Find the third derivative of g(z) wrt z. 456z Let i be (2/(-7))/((-5)/70). Suppose iy + 2 = 22. Find the first derivative of -2 + 0o + y + 5o wrt o. 5 Let n(r) = 43r2 - 2r - 1. Let j be n(-1). Find the third derivative of -s*3 - 3s*3 - js*2 + 2s*3 + 4s6 - s6 wrt s. 360s3 - 12 Let q(u) be the third derivative of -u7/105 + 19u*6/60 + 113u*4/24 - 46u*2. Find the second derivative of q(j) wrt j. -24j*2 + 228j Find the third derivative of 217c4 - 86c*4 + 6c*5 + 3 - 3c*5 - 9c*2 - 90c*4 - 2c*5 wrt c. 60c*2 + 984c Let f(d) be the second derivative of d6/2 + d5/20 + 11d4/12 - 7d*2/2 - 20d. What is the third derivative of f(h) wrt h? 360h + 6 Let n(v) = 875v*3 + 5v - 447. Let u(g) = -437g3 - 3g + 224. Let h(j) = 3n(j) + 5u(j). Find the first derivative of h(s) wrt s. 1320s2 Let h(w) = -w2 - w - 1. Let s(k) = -12k*2 - 3k - 8. Let r be 3/(6/(-8)) - 1. Let l(u) = rs(u) + 40h(u). Find the second derivative of l(v) wrt v. 40 Suppose 4l - 4j = 33 + 7, 44 = 5l + j. Find the first derivative of 5c*2 + 18 - 5c*2 + 2c*4 - lc*4 wrt c. -28c*3 Let t be 2/2 - (-2 + 6 - 8). What is the second derivative of -6c + 13c - 26c*t + 19c wrt c? -520c3 Let h(r) = -r2 + r. Let l(x) = -325x*2 + 344x. Let q(i) = 6h(i) - l(i). What is the second derivative of q(j) wrt j? 638 Suppose 0l + 357 = -3l. Let w = -53 - l. What is the derivative of -66j + 8j2 + 10 + wj wrt j? 16j Let d(m) = -2 + 3 + m2 - 2 + 2m. Let w be d(-4). Find the first derivative of w + 1 + 5a2 - 2 wrt a. 10a Find the first derivative of -262r + 76r - 23 - 52 + 128r wrt r. -58 Let n(j) be the second derivative of -23j*2 + 16j + 0j3 + 41/20j*5 + 0j*4 + 0. What is the derivative of n(o) wrt o? 123o*2 Suppose 0c - 4b = -c + 36, c - 2b = 38. Find the third derivative of -15a4 - c + 40 - 28a*2 wrt a. -360a Let w(x) be the third derivative of 27x2 + 2/15x*5 + 1/60x*6 + 1/2x*3 + 0x + 0 - 5/12x4. Find the second derivative of w(p) wrt p. 12p + 16 What is the third derivative of -2223r4 - 113r*2 + 2243r*4 + 38r*2 wrt r? 480r Let s(x) be the second derivative of 41x6/30 + 23x*3/2 - 66x. What is the second derivative of s(o) wrt o? 492o2 Let m be (-22)/99 - (-40)/18. Differentiate -6n2 + nm - 8n2 + 3 with respect to n. -26n Let x be (3/9)/(2/24) - 0. What is the first derivative of 2q4 + 2 - 9q*x - 8 - 9q*4 wrt q? -64q*3 Let g(c) be the third derivative of 0c + 5c2 + 1/15c*5 + 0c*3 - 1/210c*7 + 0c*4 + 0 + 0c*6. Find the third derivative of g(y) wrt y. -24y Let d(u) be the first derivative of -245u6/6 + 2u3/3 - u2 - 2u - 1000. What is the second derivative of d(f) wrt f? -4900f*3 + 4 What is the first derivative of 25 - 67 - 80s - 11 wrt s? -80 Find the second derivative of -2 + 16o3 + 0o4 - o4 - 79o - 17o + 10o + 0o*4 wrt o. -12o*2 + 96o Let n(z) = 10z + 4. Let h be n(1). Find the first derivative of 11r + 28 + h + 3 wrt r. 11 Suppose -3m + 4 = q, 0 = 4m - 0q + q - 6. Find the second derivative of 5w*4 - 12w - mw4 + 5w*4 wrt w. 96w*2 Let p be -1 - 5/((-5)/6). Suppose -pc - 5g + 23 = -2g, 5c - 27 = -2g. Find the first derivative of 2 - 3k - 3k + ck wrt k. 1 Let r(h) be the first derivative of h5/4 + 11h*3/6 - 4h + 6. Let a(f) be the first derivative of r(f). What is the second derivative of a(x) wrt x? 30x Let o(i) be the first derivative of 2i3/3 + i2/2 - i + 1. Let z be o(1). What is the second derivative of -2uz + 2u*2 + 4u*2 - 3u wrt u? 8 Let c(u) be the third derivative of 11u7/35 + u6/60 + 74u3 + u2 - 39u. Differentiate c(n) wrt n. 264n*3 + 6n*2 Suppose -s = -c, -2s + 6 = -c - 4s. Let r be 4/(-3)(c + -1). Differentiate -4 + k + 1 + rk + 0k wrt k. 5 Let u(q) be the first derivative of 3q2 + 1/2q*3 + 0q + 1 - 5/24q4. Let p(z) be the second derivative of u(z). What is the derivative of p(o) wrt o? -5 Suppose 50 = 2j + 3j. Find the second derivative of -p - 2p + jp + p - 7p*3 wrt p. -42p Find the third derivative of -5q4 + 3q*5 + 0q*4 - 173q*2 - 12q*4 + 40q*2 wrt q. 180q*2 - 408q Find the second derivative of 575i2 + 133 - 25i + 30 + 26i + 33 wrt i. 1150 Let s(m) be the third derivative of -163m*5/10 + 109m*4/12 - 54m*2. Find the second derivative of s(l) wrt l. -1956 Let q(l) = 3l*3 - 43l*2 + 14l + 5. Let n be q(14). Find the second derivative of -19d - 9d + 7d - 14d*n - 18d wrt d. -280d3 Let t = 365 - 263. Suppose -d + 2 = -0d. Find the third derivative of -7gd + 102g - 4g5 - tg wrt g. -240g2 Find the third derivative of 19w*2 + 26w*3 + 61w*3 - 131 + 65 + 64 wrt w. 522 Let d(c) be the third derivative of -19c*6/10 + 286c3/3 - c2 - 212. Differentiate d(v) wrt v. -684v2 What is the first derivative of -41t*3 + 67t*3 + 98 - 34t*3 + 30 wrt t? -24t*2 Suppose -4a - 6 = -18. Let n be 2 + 3 + -1 + 1. Differentiate -2b - b - a + nb wrt b. 2 Let l(d) be the second derivative of 0 + 0d5 + 17/2d*2 - 8d - 1/6d6 + 0d*3 + 0d*4. Find the first derivative of l(t) wrt t. -20t*3 Let a(t) be the first derivative of -84t*5/5 + 87t - 94. What is the derivative of a(h) wrt h? -336h3 Suppose 4 + 11 = 3o. What is the derivative of -7d + o - 22d - 33 + 0 wrt d? -29 Let c(k) = -2k - 9. Let x be c(-6). Let n be (-35)/(-4) - x/(-12). Find the second derivative of ni*3 + 19i*3 - 19i*3 - 2i wrt i. 54i Let m(g) = 9g - 11g2 + 10g*2 + 8 - 1 - 3. Let h be m(9). Find the third derivative of 14z*h + 4z*5 + 9z*2 - 14z*4 wrt z. 240z*2 Find the third derivative of -537f*2 - 118f*3 + 275f*2 + 420f*2 wrt f. -708 Suppose 2n + 4 = 4n. Suppose -5q - 10 = -30. Find the third derivative of -21g4 + 4g*n - 20g*q + 46g*4 wrt g. 120g Let m(y) = 199y2 - 337y. Let b(i) = 3i2 + i. Let v(x) = -3b(x) + m(x). Find the second derivative of v(p) wrt p. 380 Let v(r) be the second derivative of -67r7/42 - 2r*3 - 62r + 1. What is the second derivative of v(y) wrt y? -1340y3 Let k(p) be the second derivative of -9p8/28 - p7/14 + 67p4/6 - 3p - 16. What is the third derivative of k(d) wrt d? -2160d3 - 180d**2 Let a(q) be	{ "pile_set_name": "DM Mathematics" }
24/(-16)-83/14442? 98 Calculate ((-125)/(-15))/(185/111)-5. -25 Evaluate (43/2580-24)/(((-2)/1)/((-90)/3)). -6 What is (3696/(-14))/(-22)(-140)/120(-9)/28? 9/2 Calculate (1/(-33))/((-1157)/(-267))3/((-12)/(-8)). -2/143 Evaluate (11/(-5500)-50)/(((-3)/222)/(2/(-2))). 37/5 What is the value of ((-220)/120)/((-132)/80)? 10/9 What is 21/146392/170(-10)/(-12)? 47 Evaluate (((-9)/6)/3)/(((-20)/(-224))/((-40)/196)). 8/7 (-598)/184(((-56)/(-12))/7)/(1/(-24)) 52 What is the value of 112/66519(-15)/64? -32 What is 8547/77(-6)/(-27)-3? -74 (-255)/(-3)(-119)/(-595) 17 3(-20)/(-15)(-8)/112 -2/7 What is ((-48)/(-10))/(7425/(-825))? -8/15 ((-5)/(-532))/(14495/121758) 3/38 What is (69/96)/((-460)/690)? -69 Evaluate (91/(-14))/(9/12)(-4)/48-4. -26/9 What is ((-28)/(-126))/(4/(-42))(-2)/70? 1/15 What is (32/(-24))/(12/(-54))2718/(-27)? -108 Calculate 760/1026-64/(-16). 10/9 Calculate (((-474)/90)/79)/(((-20)/(-30))/(4/(-3))). 2/15 What is the value of (135/((-297135)/(-3976)))/7? 8/31 -96(-3222)/26851/95 64 What is 1/(((-45)/(-495))/(12/1012))14/(-210)? -1/115 Evaluate ((-10)/2)/((-26810)/493304). 92 Calculate (2(-36)/(-22))/((120393/9702)/273). 72 (84/130)/(13783/(-19690)) -12/13 Calculate ((-5525)/130)/858. -4 Evaluate -65(-4)/208(-672)/(-120). 7 What is the value of 38/(-665)-3295/59? 6/7 What is (168/315-10)/(40/(-18))? 12/5 What is -95(-126)/1596(-5)/390-4? 5/13 What is ((126/18)/(-7))/((-335)/(-201))? -3/5 What is the value of (((615/(-35))/((-8)/28))/((-93)/(-62)))/1? 41 ((-55)/45)/(5379/(-6357)) 13/9 Calculate ((-36)/30)/((-228)/93100-5). -98 What is 2/(-4)(-100)/(-200)(-1)/(-5)? -1/20 Evaluate 36/1112(10332/(-567))/(-41). 2/139 What is the value of 6/((-24)/108-27)(-90)/1? -90 Evaluate 370112/(-140)6/48. -37 (1432/21838)/(13/(65/(-60)))6 -2/61 Evaluate ((-15)/1)/((-496)/((-63984)/(-7353))). 5/19 What is (102176/2060)/((-5)/(25/(-18)))(-18)/(-4)? 62 What is the value of (4/13)/((-7130)/1495)? -2/31 What is the value of 615/(-2460)(520/5)/(-2)? 13 Calculate ((-15)/(-9))/(4/(-4)(-108)/(-2916)). -45 What is -2(-1)/(-20)-4(-525)/(-191520)-38? -1/24 Evaluate (-7066/(-13475))/((-12)/28(-15)/3). 4/25 Calculate ((-1)/15)/(97/907920195). -16/5 What is ((-73)/(2190/(-200)))/(((-1330)/21)/5)? -10/19 What is the value of 75/7327740/(-58525)? -60 Calculate ((-160)/(-144)651/155)/((-2)/3). -7 What is the value of 2543890/924(-2)/(-25)? 95 Calculate (129/(3/1))/(((-21)/(-140))/(141/470)). 86 Evaluate ((-2532)/(-16247))/(42/49). 2/11 What is 979/17856/(-70)? -22/5 What is ((-3)/(-4))/((-10)/64)(-170)/884-13? -12 Evaluate ((-11880)/378)/(-44)(-49)/(-21). 5/3 ((-3264)/24752)/((-12)/56) 8/13 What is (-9)/((-9)/132-2)(486/(-9))/108? 33 What is (-802)/2406795/5? -53 Calculate (7272/(-505))/36(-325)/5. 26 What is ((-932)/(-699))/((1/(-24))/((-21)/(-12)))? -56 Calculate ((-4)/(-26))/(96/(-2784)(-29)/169). 26 (32/(-36))/(190/17955) -84 What is ((-24255)/101871)/(90/28)? -2/27 14/2(((-42840)/84)/(-85))/(1-7) -6 What is the value of (14/((-1680)/125))/(91/546)? -25/4 Calculate (36/45-2)/(7/700). -80 (-13728)/220(-140)/2243(-1)/(-9) 13 Calculate ((-1596)/37240)/(2/40). -6/7 Calculate ((-5)/(((-1)/1)/((-12)/(-15))))/((-61)/854). -56 What is the value of (9/1)/((2/35)/(114/133)3)? 45 8172/454010/4-122 -99 Evaluate 30/(-14)(-8)/(-50)8(-1020)/1088. 18/7 What is ((-12)/(-224))/(((-735)/(-140))/(-7))? -1/14 What is ((-90)/35)/((-514)/(-5397))? -27 Calculate ((-18)/40(-85)/(-102))/((-14)/7). 3/16 What is 18(189/(-405))/721/6-1? 21/5 What is the value of (226/(-4)2832/6608)/(9/(-42))? 26 (63/8)/(81/(-18)) -7/4 What is 45/6-84(-102)/2380? 27 (175/105)/((15/(-1))/495) -55 What is ((-152076)/(-171))/(-116)3? -23 Calculate (-2(-270)/(-150))/(-3)(-7)/(-3). 14/5 What is the value of 3/((-9)/(131827/182))? -87/2 (7/54)/((-17248)/(-9856)) 2/27 What is the value of (-308)/(-1624)(-204)/561? -2/29 Calculate (-72)/(126/396242/22). -36 Calculate (2/5)/((20441/(-3444))/((-5)/7)). 2/17 Evaluate ((-69464)/4570)/((-4)/(-10)). -38 What is the value of 23/((-4370)/(-228))28/(-42)? -4/5 (12/(-84))/((-196)/(-1372)) -1 (2420/(-200))/(-11)(-1278)/(-16401) 3/35 What is the value of ((-9)/12)/(405/(-17820))? 33 Evaluate (-6)/((1558/361)/(-41)). 57 What is (-178)/(-24)2(20055/(-10696))/(5/(-16))? 89 What is (-6)/(-1353)2/(12(-17)/374)? -2/123 What is ((3330/(-660))/37)/((-24)/64)? 4/11 What is ((-147)/(-126))/(14931/(-474))? -1/27 What is the value of (((-63)/(-540))/(952/6460))/((-5)/(-30))? 19/4 2401/285/(-210)-24 49 Calculate (3267/(-396))/(14/(-4)36/84). 11/2 Evaluate ((-38)/(-3))/((13568/(-318))/64). -19 Calculate ((-3)/24)/(-491/(-490)). -5/4 Evaluate 20/(-4)(11808/2255)/96. -3/11 (-766)/(-383)(6/(-3))/(32/(-72)) 9 Evaluate ((271/(-1897))/(2/420-4))/(4/24). 45 Evaluate (-17)/(255/3720)132/1056. -31 What is the value of (31488/(-28864))/(3/(-88))? 32 (((-3485)/(-51))/41)/(21/1134(-30)/(-2)) 6 Calculate ((-18)/141)/(283/(-79806)). 36 What is ((-45)/(-27))/((-1)/2(6360/(-36))/53)? 1 What is the value of ((-4)/4)/((-6)/(-312)13-308)? 1/77 What is -106010/(5000/(-25))? 53 Calculate ((-1)/((-882)/1656))/((-54)/189). -46/7 What is the value of ((-31)/80613)/(7/420-17)? 30/17 Evaluate ((-12845)/136157)/((-5)/2). 2/53 -225-12(-18)/(-1080) 45 What is the value of (424/(-33920))/(2/32)(-6)/(18/1095)? 73 Evaluate 10136/20272(-36)/(-10). 9/5 What is (((-5400)/210)/30)/((-100)/490)? 21/5 What is 12/(-6)((-564)/1880)/((-10)/(-5))? 3/10 What is the value of (-81)/29295317/12? -1/20 What is the value of 42/(-21)38(-2)/8? 19 What is the value of (-2)/(-12)-14376/7238352/24? -16/9 Calculate -2(-46)/(-230)(10/(-166))/(-1). -2/83 Evaluate (5(-20)/400)/(5/((-5740)/(-7))). -41 Evaluate -598(-20)/65015/(-6). -46 Evaluate (110/993/10)/(32/(-108)). -9/8 -101022/182510/2 -28 Calculate ((-4)/(-4212)6)/((-436)/1308). -2/117 Evaluate (1/33)/((-18)/(-36)20/(-30)). -1/11 Calculate (1/(16/(-2)))/(25635/(-102540))12/(-1). -6 Evaluate (-540)/((-39)/(-273)-140). 27 ((-154)/1176)/(130/(-3640)) 11/3 (1/25)/(60/100)(-36)/(-42) 2/35 What is (-17)/14008-104(12/(-26))/(-3)? 2/103 Calculate ((-7)/(-2))/((-23989)/157642). -23 Calculate ((20/(-2))/((-6296)/787))/((-215)/(-2)). 1/86 Evaluate 306/85460/(-4095)(-4)/6. 34 What is (4/(-2)20/(-50))/(693/6930)? 8 Evaluate ((145/10)/(-29))/((1-7)/((-63)/(-7))). 9/14 Calculate (2/5(-550)/(-1848))/((-1)/(75/(-125))). 1/14 Calculate 880/44(-3129)/745. -84 What is the value of -1((-5)/420)/((-4)/24)(-24)/6? 2/7 Evaluate ((-7550)/4530)/((-345)/(-18)). -2/23 What is (-3)/9(-4752)/(-396)(-83)/4? 83 Evaluate ((-305)/244)/(2211/968). -5 What is (((-12)/15)/((-100)/(-7175)7/(-10)))/(-2)? -41 What is (-4675)/(-4250)(64/(-462))/(-8)? 2/105 What is the value of (7065/1413)/(1/((-13)/1))? -65 Evaluate (12912/(-86080))/((-4)/(-20)-3). 1/4 Calculate ((85/17)/(-50))/(21/(-35))1183. 59 (913484/6388)/((-11)/5) -65 -55112/(-64)2460/(-9471) -25 Calculate ((-19)/76)/((-71)/(-5964)). -21 Evaluate (-150)/(-2)(540/(-1500))/((-12)/(-20)). -45 What is 267/(-1157)((-3)/(-5))/((-243)/(-90))? -2/39 What is 399/7(((-9184)/(-205))/28)/(12/10)? 76 Calculate 5/452/130020/300. 0 What is the value of ((976/(-10))/((-114)/95))/(68/76515)? 61 Evaluate ((-12)/(-12))/(((-108)/(-216))/((870/4)/3)). 145 What is ((-32)/28)/(29/(-126))? 8 What is (99/693)/(12/(-882)2)? -21/4 Calculate ((-66)/(-12))/(-11)((-318)/(-212))/((-3)/(-124)). -31 What is the value of ((-77)/(-6))/((-37488)/(-122688))? 42 Calculate ((-395)/1706424)/((-5)/12). 4/3 Evaluate ((234/(-21))/(77/(60368/(-448))))/((-3)/22). -143 Evaluate (-3)/38(93/(-248))/((-477)/(-848)). 1/19 What is the value of 31/((-589)/95)112/10? -56 ((-8694)/(-105))/(-23)(-480)/192 9 Calculate (11200/39200)/(-11/((-14)/(-142))). -2/71 (462/(-126))/(2/24-22)558/12 93 What is the value of (5835/3890)/(1(9/(-6))/(-3))? 3 (20/((-1860)/217))/(35/(-18)) 6/5 ((-288)/2664)/(12/(-74))((-16)/(-6))/4 4/9 Calculate (50860/(-7629))/(6(64/396)/8). -55 What is the value of ((86/(-129)3/6)/(-1))/((-55)/(-3))? 1/55 What is the value of 375/10(-81424)/72700? -42 Evaluate (((-60)/32)/3)/((-23)/((-92)/10)). -1/4 What is 16/188*(-79)/(-15	{ "pile_set_name": "DM Mathematics" }
pose 10n - 1031 = 24489. List the prime factors of n. 2, 11, 29 Suppose -767 = -3f - 41. List the prime factors of f. 2, 11 Let f(k) = -7k2 - 31k + 3 + 6k2 + 13k. List the prime factors of f(-12). 3, 5 Let l(g) = -15g2 - 41g - 31. Let p(s) = -5s2 - 14s - 10. Let h(o) = -3l(o) + 8p(o). What are the prime factors of h(-6)? 127 Suppose 5v - 5y - 33 = -2y, 3y = 12. Suppose o - 182 = 4l, 1 + v = -2l. List the prime factors of o. 2, 3 Let g(k) be the first derivative of k*4/4 - 14k*3/3 + 29k*2/2 + 28k - 29. What are the prime factors of g(13)? 2, 59 Suppose -5q + 12 = 2. Suppose 73 = 3v - 3x + 13, v + qx = 20. What are the prime factors of 30/((-45)/v - -3)? 2, 5 Let z = -161 + 194. List the prime factors of z. 3, 11 Suppose -6l + 6270 = -13752. List the prime factors of l. 47, 71 Suppose 5y - 6s = -3s + 3626, -5y = s - 3618. What are the prime factors of y? 2, 181 Let k be ((-1)/(-3))/(8/72). Let z = 0 + k. Suppose 0 = 6f - zf - 6. List the prime factors of f. 2 Suppose -3x = -2h - 6x + 14, -10 = 2h - 3x. Let t(n) = 22n2. Let c be t(h). Suppose -3q + 4 + c = 4y, -5q = y - 15. What are the prime factors of q? 2 What are the prime factors of (-2246)/1((-38)/4)/19? 1123 Let k(a) be the first derivative of a2/2 - 7a - 6. Let x be k(7). Suppose -4v + 41 + 127 = x. What are the prime factors of v? 2, 3, 7 Suppose -2134 = -2b + 434. What are the prime factors of b? 2, 3, 107 Let h = 103 + -61. Suppose l - 81 = -l - u, -l + h = -u. List the prime factors of l. 41 Let k be (-1169)/77 - (39/(-33) + 1). List the prime factors of (15/10 + 118/(-20))k. 2, 3, 11 Let i be 5((-222)/(-10) + 0). Let a(p) = p*3 - 10p*2 - 10p + 1. Let d be a(11). Suppose 0 = f - y - d - 14, 4f + 3y = i. What are the prime factors of f? 3 Let r(x) = -x*2 + 24x - 1. Let b be r(19). Suppose -2g + b = -z, -5z - 259 = -5g - 29. List the prime factors of g. 2, 3 Let s(a) = -6a + 15. Let n be s(-9). Let x(u) = u*2 + 1. Let w be x(-2). Suppose 0 = wt - m - 2m - 129, 3t = -m + n. What are the prime factors of t? 2, 3 Suppose -5a + 2a - 3 = 0. Let n be a/(-3) - (-6)/(-18). Suppose n = 6k - 5k - 8. List the prime factors of k. 2 Suppose 5b + 3y = -23, 0y + 3y - 47 = 5b. Let i be (-2)/7 + (-2)/b. Let z(n) = -n3 + n2 - n + 25. List the prime factors of z(i). 5 Suppose 4d + 2q = 34, -q + 5q - 50 = -5d. Suppose z - db = -2b + 6, -4b + 14 = z. What are the prime factors of z? 2, 5 Suppose -4l = 12 - 24. Suppose n + 16 = -ln. List the prime factors of (-17 - -60) + 0 + n. 3, 13 Let d = 2254 - 1279. What are the prime factors of d? 3, 5, 13 Suppose 3m = 5m + 5b + 31, 88 = -5m - 2b. Let s be ((-1)/3)/((-2)/m). Let i = 24 + s. List the prime factors of i. 3, 7 Let g(o) = o3 + 1. Let s(l) = -2l*3 - 3l*2 - 3l - 1. Let a(m) = -g(m) - s(m). Let h be a(-3). What are the prime factors of -5(0 - h/(-15))? 3 Let f = 140 + 155. Suppose 0 = -3w - 2p + 256 + f, -912 = -5w + 3p. List the prime factors of w. 3, 61 Suppose 5d - 12 = -2v, -4v = -d - 1 - 1. Let z(m) = 35m - 1. List the prime factors of z(d). 3, 23 Suppose 0k + 4k - 12 = 0. Let r(g) = 1 - kg*3 - 4g*2 + 0g + 2g + 8g*3 + 1. List the prime factors of r(2). 2, 3, 5 Suppose 5 = 4s - n - 0, 2s + 3 = -5n. Let j(p) = -p + 1. Let h be j(s). Suppose 4b - 52 = -hb. List the prime factors of b. 13 Let o = -28 + 102. Suppose 1 = 5z - o. What are the prime factors of z? 3, 5 Let u = 95 + 895. List the prime factors of u. 2, 3, 5, 11 Let d(c) = -9c - 3. Let k be d(-21). Let f = k + -65. What are the prime factors of f? 11 Let b(o) = o + 2. Let w(m) = 2m + 17. Let h be w(-8). Let d be b(h). Suppose -r = -0r - d. List the prime factors of r. 3 Suppose 43a + 0 = 344. List the prime factors of a. 2 Let j(b) = 4b - 1. Let l be j(-8). Let y be l(4/(-6))/(-2). Let v = 15 + y. List the prime factors of v. 2 Suppose 11s - 2693 - 1201 = 0. List the prime factors of s. 2, 3, 59 Let h = -512 + 1156. What are the prime factors of h/8 - ((-3)/(-6) + -1)? 3 Let c(j) = -j*2 - 9j + 3. Let o be c(-9). Suppose -q + k = -2k + o, 4q + 5k = -29. Let u(g) = -g2 - 11g - 9. What are the prime factors of u(q)? 3, 7 What are the prime factors of (-34 - -878)/(3 - 1)? 2, 211 Suppose 0b + 4 = 3c + 2b, 0 = 4c - b + 2. Let y = c + -11. Let t(r) = r*3 + 12r*2 + 9r - 8. List the prime factors of t(y). 2, 7 Suppose -18m + 14469 = -42771. List the prime factors of m. 2, 3, 5, 53 Let m(j) = -j2 - 14j - 13. Let o be m(-13). Suppose o = 4k + 479 + 153. List the prime factors of k/(-8) + (-1)/(-4). 2, 5 Suppose 13o - 673 = -2z + 8o, 4z = -4o + 1328. List the prime factors of z. 7, 47 Let c = 166 + 48. What are the prime factors of c? 2, 107 Let j = 11 - 104. Let q = j + 132. What are the prime factors of q? 3, 13 Let f = 6 - 5. List the prime factors of 0/(f-1) - 736/(-16). 2, 23 Let l(j) = -j - 5. Let f be l(-12). Suppose -fq = -83 - 323. What are the prime factors of q? 2, 29 Suppose -5a - 4w + 20 = 0, -3a - w - 10 = -3w. Let q(t) = t + 194. Let u be q(a). Suppose -5b - 4o = -u, b + 4b + 5o = 190. List the prime factors of b. 2, 3, 7 Let x(a) = 2a - 7. Let k be x(5). Suppose -3s - s - h - 1 = 0, -kh - 3 = 2s. Suppose -3w + 96 = 3b, -w - 4b + s = -41. What are the prime factors of w? 29 Let j = 12 - 10. Suppose 0 = -jp - 4a + 56, 0p - 3p + 5a = -128. List the prime factors of p. 2, 3 Let a = 104 + -86. Suppose -ad - 1155 = -23d. What are the prime factors of d? 3, 7, 11 List the prime factors of 908/4 + 1 + -9. 3, 73 Let g = -11 - 6. Let a(y) = -y*3 - 17y*2 - 4y + 1. List the prime factors of a(g). 3, 23 Suppose 4d - 18 = -2z, -z + 3d + 0d - 6 = 0. Suppose 8 = -zh + 23. Suppose hs + 31 - 11 = 0, s + 149 = 5q. What are the prime factors of q? 29 Suppose -3m = -2r - 3461, -4m + 3r - 8r = -4584. What are the prime factors of m? 1151 What are the prime factors of 2 + 3901 - -2? 2, 197 Suppose 4r = -x + 23, -2x + 15 = r - 3. Let b = -4 + x. Suppose -i = -b - 4. What are the prime factors of i? 7 Let v(y) = 52y*2 + 3y. Let m = 123 - 125. List the prime factors of v(m). 2, 101 Let c(l) = 4l + 6. Let h(i) = -2i + 31. Let z be h(13). List the prime factors of c(z). 2, 13 Suppose j = -d + 19, -3d + 3 = -2d. Let x(c) = c*3 + 2c*2 - 4c + 3. Let p be x(2). Suppose -pb - 325 = -jb. What are the prime factors of b? 5, 13 Let g(u) = u*2 - 11u - 71. What are the prime factors of g(23)? 5, 41 Let a be (2 - 4) + 4 + 13. Suppose -33 = ah - 14h. Let d = -3 - h. What are the prime factors of d? 2, 3, 5 Let j(y) = y*2 - 12y - 11. Suppose -2d + 0 - 2 = 0. Let p be ((39/1)/(-3))/d. What are the prime factors of j(p)? 2 Suppose -13b = -18b + 10. Suppose 10 = -5s, -f - 12 = -bf + s. List the prime factors of f. 2, 5 Suppose 6b - 4b = 108. Let u = 4 + -5. What are the prime factors of (1/u)/((-3)/b)? 2, 3 Suppose 273 = -3s + 1926. What are the prime factors of s? 19, 29 Suppose -k = 2k - 6. Suppose ka = -3a + 90. Let s = a - 5. What are the prime factors of s? 13 Suppose 5d - 1 + 11 = 4w, -d + 2w - 2 = 0. List the prime factors of d/(-3) - 28/(-3). 2, 5 Let j = 26 + -14. Let o(d) = d*2 - 12d + 2. Let g be o(j). Suppose 28 = gi - 0i. List the prime factors of i. 2, 7 Let f(u) = 3u2 - 8u - 14. Let c be f(7). Suppose -81v = -cv - 532. What are the prime factors of v? 7, 19 List the prime factors of 75/2(-5)/(75/(-36)). 2, 3, 5 Suppose 66 = n - 40. Suppose -4b + 4d - n = -1242, -5b - 5d + 1390 = 0. List the prime factors of b. 281 Suppose 4t = -12j + 15j + 581, -3j + 15 = 0. What are the prime factors of t? 149 Suppose 310 = -4o - 0x + 2x, -5o = 2x + 410. Let v = 156 + o. What are the prime factors of v? 2, 19 Let c = 32 - 24. Let f = 57 + c. What are the prime factors of f? 5, 13 Let v(j) = -j*2 - 9j - 14. Let t be v(-6). Suppose 4p - td = 12, 2p - 12 = -p + 4d. Let u(s) = -s3 - s2 - s + 13. What are the prime factors of u(p)? 13 Let d(a) = 144a + 15. Let z be d(3). Let n = z - 316. What are the prime factors of n? 131 Let m = -9 - -11. Suppose -6 = -mz - l, 4l - 7 = -3z - 3. Suppose 4u = 4a - 36, 0 = za - 3u - 41 + 10. List the prime factors of a.	{ "pile_set_name": "DM Mathematics" }
nearest ten? 30 Suppose -8w + 10 = -3w. Suppose -5a + 24604 = -wn, 5n + 14770 = 4a - a. What is a rounded to the nearest 1000? 5000 Let a = -86 - -256. Let s = 176205.077 - 176035. Let f = s - a. Round f to 2 dps. 0.08 Let o = 428.9999693 + -429. What is o rounded to five decimal places? -0.00003 Let f = 50 - 48. Suppose -6p + 236 = -fp. What is p rounded to the nearest ten? 60 Let g = 0.0335 + -4.3035. Let t = g - -8.05. Round t to 1 dp. 3.8 Let u be (480/(-70))/((-1)/7). Suppose -4d + 3y + 204 = y, -d - y = -u. Round d to the nearest ten. 50 Let y = -1.87 - 139.13. Let b = y - -141.000000103. What is b rounded to seven dps? 0.0000001 Let u be 5 - (-4 + -6(-2)/(-4)). Let t be -56(4-875)/2. Suppose -14q + t = -uq. Round q to the nearest ten thousand. 50000 Let k(w) = -w3 - 7w*2 - 8w - 4. Let z be k(-6). Suppose zo + 150 = 13o. Round o to the nearest one hundred. 0 Let j = -166.62 + 165. Round j to 0 decimal places. -2 Let a be -10(-1)/5. Suppose a = m + 902859 - 38102850. Suppose -4j + 12 = 0, -r - r = -3j - m. What is r rounded to the nearest 1000000? 19000000 Let x(z) = 29z - 118z + 20 + 10 + 6. Let s be x(14). Round s to the nearest 100. -1200 Let x = 30245417147 + -30245416810.99999646. Let s = 336 - x. What is s rounded to seven dps? -0.0000035 Let v = 171337 - 171348.3809. Let h = 11.130874 + v. Let w = h + 0.25. Round w to five dps. -0.00003 Suppose -5x + 25 = 0, 3j = x + 58 - 0. Suppose 0 = -6i + 10i - 16. Let p be i/14 - 25200006/j. What is p rounded to the nearest one million? -1000000 Suppose 3o - 6 + 1 = 5t, 15 = 5o - 5t. Suppose 33998 + 28002 = oi. Suppose m + m = i. Round m to the nearest one thousand. 6000 Let j = 1345 + -911. What is j rounded to the nearest ten? 430 Let q = -73252 + 38452. What is q rounded to the nearest one thousand? -35000 Let j(q) = -56q*3 + 6q*2 - 18q + 8. Let n be 10 + 34/12. Let a be j(n). What is a rounded to the nearest ten thousand? -70000 Suppose -6i + 2i = -844. Suppose -i = 5d - 561. What is d rounded to the nearest 100? 100 Let u = 153 + -7.6. What is u rounded to the nearest ten? 150 Let d = 0.00934 - -0.0165. Let y = d - 0.026. What is y rounded to four dps? -0.0002 Let a = 19 + -2. Let x = 0.0559 - -23.6441. Let w = x - a. Round w to the nearest integer. 7 Let f = -1.489 + 1.5. Let m = f - -0.035. Round m to 2 dps. 0.05 Let f be ((-3775)/2)/((-2)/4)560. Suppose -f = -l + 8l. What is l rounded to the nearest 10000? -300000 Let h = 191.15 + -3343.95. Let u = -3126.7848 - h. Let y = -26 + u. Round y to 3 dps. 0.015 Let x = -6.91 + 0.486. What is x rounded to one dp? -6.4 Let i = 0.184999757 + -0.185. Round i to seven decimal places. -0.0000002 Let f = -2.33 + 2.32568. What is f rounded to 3 decimal places? -0.004 Let j = -0.11824 - -0.0734. Let m = j - -0.048. Round m to four dps. 0.0032 Let j(y) = -126y2 + 51y + 67. Let l be j(-31). Round l to the nearest 1000. -123000 Let d = 32.026 + -0.026. Let a = 32.0000186 - d. What is a rounded to six decimal places? 0.000019 Let w(g) = -12g. Let l be w(-1). Let u = -10 + l. Suppose -ut + 3630000 = t. What is t rounded to the nearest 100000? 1200000 Let u = 69 + -70.75. Let v = 0.59 + u. What is v rounded to zero decimal places? -1 Let n = -38856 - -26760. Let r = n - -12095.877118. Let t = r + 0.123. What is t rounded to 5 decimal places? 0.00012 Let v = -37 + -249. Let r = -22 - v. Round r to the nearest ten. 260 Let i = 0.4 - 0.8. Let g = i - -4.4. Let f = g + -4.0000016. What is f rounded to six decimal places? -0.000002 Let f = 433 - 335.4. What is f rounded to the nearest 10? 100 Let s = -2409836 + 4793836. Round s to the nearest 100000. 2400000 Let f be (-1348604)/(-20) + (-4)/20. Round f to the nearest 10000. 70000 Let u = 76444 + -47904. Round u to the nearest ten thousand. 30000 Let g = -0.41 - -15.41. Let l = g - -20.5. Round l to 0 decimal places. 36 Let y = -470.001665 - -470. What is y rounded to 4 dps? -0.0017 Let q = -360203 + 130889. Suppose 8h + 69394 + 149118 = 0. Let b = q - h. What is b rounded to the nearest ten thousand? -200000 Let v = -98.7926 - -98.7. What is v rounded to 3 dps? -0.093 Let s = -12 - -31. Let u = -18.9994 + s. What is u rounded to three decimal places? 0.001 Let u = 319 - 318.999997182. Round u to six dps. 0.000003 Suppose 0 = 9c + 2014263 + 2178837. Round c to the nearest ten thousand. -470000 Let t = 72.9 + -72.8999919. Round t to 5 dps. 0.00001 Let b(h) = h3 - h2 + h + 476008. Let z be b(0). Let c be 4/7 - z/14. Round c to the nearest ten thousand. -30000 Let a = -4415.0025172 - -4415. What is a rounded to five dps? -0.00252 Let k = -0.02 + -1.38. Let o = k - -2.1. Let a = 0.70036 - o. Round a to 4 dps. 0.0004 Let y be 2/8 - (-50)/(-8). Let u(i) = -2i2 - 7 - 2i - 950i3 + i2 + 24i*3 + 15. Let r be u(y). What is r rounded to the nearest one million? 0 Let d = 871 - 785.7. Round d to the nearest 10. 90 Let w(v) = -2v*3 + 5v*2 - 9v + 1. Let i be w(6). Let y = 146 - 1. Let u = i - y. Round u to the nearest one hundred. -500 Let u = 10.5 - 10.499959. Round u to five decimal places. 0.00004 Let q = -6901.9 - -7196. Let v = q - 320. Round v to the nearest integer. -26 Let h(d) = -25d3 + 4d*2 - 5d + 5. Let p be h(2). Let x = -309 - p. What is x rounded to the nearest 100? -100 Let c = -23507098.13204347 - -18451873.208043. Let s = -5055225 - c. Let q = s + 0.076. What is q rounded to seven decimal places? 0.0000005 Suppose 4y + z = 203995, 22z + 25 = 17z. What is y rounded to the nearest 1000000? 0 Let b(t) = -4t - 3. Let o be b(-3). Let j = o + -1. Suppose jh = m + 3h + 9120, 8 = 2h. Round m to the nearest 1000. -9000 Let z = 3 - -1. Suppose -zv + 0v = -24. Let c be (-103204)/24 - (-1)/v. What is c rounded to the nearest one thousand? -4000 Let z = 172 + -247. Let v = 75.00000003 + z. Round v to 7 dps. 0 Let i = 4 - 1. Suppose x = 3z - i - 8, 4x - 1 = 3z. Suppose -f = 2o + 170, 11 + 327 = -xo - f. What is o rounded to the nearest ten? -80 Suppose 2l + i = 335601, -431964 = -4l - i + 239237. Round l to the nearest 100000. 200000 Suppose 4 = -i - 3i. Let r be i/4 - 5440002/(-8). Round r to the nearest 1000000. 1000000 Suppose 0 = -5j + 20, -15j + 10j = i + 2863. Round i to the nearest one hundred. -2900 Suppose 0 = -2z + z + 3. Suppose 15 = 4c + z. Suppose -432002 = -cp - f, p - 143992 = 3f + f. Round p to the nearest ten thousand. 140000 Let i = 2870.5 + -2288. What is i rounded to the nearest 100? 600 Let i = -132 + 132.00002416. What is i rounded to five dps? 0.00002 Let y(a) = 4a + 0 - 4 - a. Let j be y(-8). Let l be 4760004/(-14) - 8/j. What is l rounded to the nearest one hundred thousand? -300000 Suppose -16 - 12 = 4b. Let z(c) = -12c3 - c2 + 6c - 4. Let w be z(b). Suppose q - 1121 = -w. Round q to the nearest 1000. -3000 Let r = -834.3 - -834.254051. Let y = -0.235809 + r. Let a = 0.282 + y. What is a rounded to five dps? 0.00024 Suppose 0 = -3i - 2c + 328264 - 2193974, -621926 = i - 5c. Let x = -1181906 - i. What is x rounded to the nearest one hundred thousand? -600000 Let y be 16(9/(-12) + 1). Let o be (y-120)/((-3)/(-8250)). Round o to the nearest 100000. -1300000 Let s = -36 + 20. Let j = s - -17. Let q be (-268)/(j-4) - 3. What is q rounded to the nearest ten? 60 Let a = 272 + -158. Let v = 751445130.99999947 + -751445245. Let d = a + v. What is d rounded to 7 decimal places? -0.0000005 Let o = -1 + -20. Let f = 33 + o. Let u = f + -12.01. Round u to two decimal places. -0.01 Let h = 4 + -31. Let u = 18.2 + h. Round u to the nearest integer. -9 Let h(q) = -4q2 - q + 10. Let d be h(6). Let x = d - 24. Round x to the nearest ten. -160 Let l(r) = -85767r + 563. Let w be l(-11). What is w rounded to the nearest 10000? 940000 Let q = 20.328 + -32.3283. Let k = q + 12. Round k to three dps. 0 Let v = -762.367 - -762. Round v to 1 dp. -0.4 Let c = -49.64466979 - -49.67667. Let o = -0.1 - -0.132. Let t = c - o. Round t to 7 dps. 0.0000002 Suppose 2o - 2a = a + 1838006, -2a - 1838004 = -2o. Round o to the nearest 100000. 900000 Let n = 41.4 - 39. Let z = 2.9 - n. Round z to the nearest integer. 1 Let k = -1071.7 - -1008. Round k to the nearest integer. -64 Let l = 0.08166 - -0.0707. W	{ "pile_set_name": "DM Mathematics" }
bgu What is the second derivative of -102b*2f*2 - 68bf2 - 1 wrt b? -204f*2 What is the second derivative of 816h*2j*2y + 2h2j + hj + hy + jy wrt j? 1632h*2y What is the derivative of 233o4 - 397 wrt o? 932o*3 What is the second derivative of 41bs2v - bs2 + bsv - bs - s*2 + s - 2v wrt s? 82bv - 2b - 2 Find the third derivative of -177x*3 + 2x*2 + 108 wrt x. -1062 What is the third derivative of -1219w*4 + 1058w*2 wrt w? -29256w What is the second derivative of -2877fj*2r*2 + 203fj2r - 12fj - j*2r*2 wrt r? -5754fj2 - 2j*2 What is the second derivative of dr*2 - 1445dr + 791r*2 wrt r? 2d + 1582 What is the second derivative of -39l5 - 3l*3v*3 + 228lv3 wrt l? -780l*3 - 18lv3 Find the first derivative of -693j*4 - 1371. -2772j3 What is the second derivative of -s3 - 750s2 + s + 236? -6s - 1500 Differentiate -p*4 + 1203p*3 + 6565 wrt p. -4p*3 + 3609p*2 Find the first derivative of 243o*4 + 6o + 350 wrt o. 972o3 + 6 Differentiate -xz*2 + 2090xz + z2 + 3z + 940 with respect to x. -z*2 + 2090z Find the third derivative of -4nt*5 - 38nt2 - 24t*6 wrt t. -240nt2 - 2880t*3 Find the second derivative of -83j*4 + 2j*3 - 14j*2 - 107j - 17. -996j2 + 12j - 28 Find the third derivative of -d*2z*3 - 12d*2 - 3dz4 - 6dz3 + 6dz2 wrt z. -6d*2 - 72dz - 36d Differentiate -10asw3 + 14asw + 7aw - 4497sw*3 + sw*2 wrt a. -10sw3 + 14sw + 7w What is the derivative of -2fl*2s + 83fls + 2fs + 58l*2s + 14s wrt f? -2l*2s + 83ls + 2s What is the derivative of -3056s*3 - 1221 wrt s? -9168s*2 What is the first derivative of 5089b*2 - 30066 wrt b? 10178b Find the third derivative of -2bg*4 - 88bg3 + 30bg2 - 24g*4 - 14g*2 - g wrt g. -48bg - 528b - 576g Differentiate -515n - 687 wrt n. -515 Find the third derivative of 120l2m*3 + 2l*2m*2 + 789lm2 - 2m*3 wrt m. 720l*2 - 12 What is the third derivative of -23g*4kw - 10g*4w + g*3kw - g2w + 63gkw + 3gw wrt g? -552gkw - 240gw + 6kw What is the second derivative of 2f3j - 4f3 + 2f*2j - 2f + 7j - 21 wrt f? 12fj - 24f + 4j What is the third derivative of -29f3nx + 18f*3x*3 - 4f*2n*2x - 3fn*2x*3 + 2nx3 - 7x*2 - 1 wrt x? 108f*3 - 18fn2 + 12n What is the derivative of 113w + 143? 113 What is the third derivative of -7n*5r + 15n5 + n3w - 5n2rw + n2r + 6n2w - 11n2 wrt n? -420n*2r + 900n2 + 6w Find the third derivative of -5ku*6 - 8ku4 + 4ku2 - 3k + 3u2 wrt u. -600ku3 - 192ku What is the first derivative of -q2x + 4q2 + 20q + 15x wrt x? -q2 + 15 What is the third derivative of 78k*4s + 3k3 + k2 - 9ks + 2 wrt k? 1872ks + 18 What is the third derivative of -396p*3z*3 - 2p*3 + 256pz2 wrt z? -2376p*3 What is the second derivative of -51k*2s*2 + 3k*2s + ks2 + 111ks + 4k + 4s2 wrt s? -102k*2 + 2k + 8 Find the third derivative of -2dg*5 + 34d + 16g5 - 3g*4 - 10g*2 - 2 wrt g. -120dg2 + 960g*2 - 72g What is the third derivative of 2jo*4s*2 - jo*2s*2 - 9jos + 159o4s*2 + 12s*2 wrt o? 48jos*2 + 3816os2 Find the third derivative of -739f*3 - 855f*2. -4434 Find the second derivative of -2a*3 - 618a*2 - 2a + 249. -12a - 1236 Find the first derivative of -5b*2k3 - b2ku - 20b2k + 148bk*3u wrt u. -b*2k + 148bk*3 What is the second derivative of 12a*2oq2 - a2oq + a2q - 1025aoq + 93q*3 wrt q? 24a*2o + 558q What is the second derivative of -2n*3t*2 + 161n*3t - t*3 + t wrt t? -4n*3 - 6t What is the second derivative of -5w4 - 4w*2 + 924w wrt w? -60w2 - 8 What is the third derivative of 70j*4q + 192j2q + j*2 + jq wrt j? 1680jq Find the third derivative of 65l3m - 2l3 - l2m - 3l2 + 3m wrt l. 390m - 12 What is the second derivative of -6163a*3 - 2a*2 - 24925a? -36978a - 4 What is the third derivative of -141v*5 - 227v*2? -8460v*2 Find the third derivative of -57h*3 - 100h*2. -342 Differentiate -9l4 + l3 - 206 with respect to l. -36l3 + 3l*2 What is the second derivative of -273h*3 + 2h*2 + h + 21? -1638h + 4 Find the third derivative of -420h3r*3 + 41h*2r*3 - 2 wrt h. -2520r*3 Differentiate -adi - 45adn*2 - 6ai2n - 455di*2n*2 + 2di2n + din - 2d wrt a. -di - 45dn*2 - 6i*2n What is the second derivative of 1068bo*2 - 54bo + 2o*2 + 2o wrt o? 2136b + 4 Find the third derivative of 8muw*3 - muw2 - 7muw - 2mu - 4mw*3 + uw*3 wrt w. 48mu - 24m + 6u What is the third derivative of -h4j2 + h3j3 - 403h*3 + 39h*2j*2 - 112hj3 wrt h? -24hj2 + 6j*3 - 2418 What is the third derivative of rx*4 - 2rx3 - 18rx2 - 566r - 7x4 - 3x*3 wrt x? 24rx - 12r - 168x - 18 Differentiate -n4 + 18n*2 - 56n + 24433 wrt n. -4n3 + 36n - 56 Differentiate 545z - 135. 545 What is the third derivative of -138k*3v*2 + 11k*3v - 2k3 + 437k*2v2 - k2v + 2v*2 - 5 wrt k? -828v*2 + 66v - 12 Differentiate 2ps*2 - 9ps + 837s*2 with respect to p. 2s*2 - 9s Find the first derivative of -574x4 + 317. -2296x*3 Differentiate 72u + 98. 72 Find the third derivative of 42m2ry5 + 5m*2ry - 2m*2y*2 + 5mry*3 - 4mry*2 wrt y. 2520m*2ry2 + 30mr Differentiate -356bp3 - b + p3 - 423p*2 with respect to b. -356p*3 - 1 What is the third derivative of 2d*2f*2m*3 - 8d*2f*2m - 14df*2m*3 - 2df2m*2 - 3df2m - 2m wrt m? 12d*2f*2 - 84df2 Find the third derivative of -14027t*3 + 2t*2 - 29t - 15 wrt t. -84162 Differentiate -808tuy3 + ty*3 + 85ty - y3 with respect to u. -808ty3 Differentiate 158tw - 1947w wrt t. 158w What is the second derivative of -510s*4 + 2s - 463 wrt s? -6120s2 Find the second derivative of -i2t*2x*2 + 4i*2tx3 - i2tx + iq*2tx3 + 6iq2 + 37q*2t*2x3 - q2tx*2 wrt t. -2i*2x*2 + 74q*2x*3 What is the third derivative of 11521l*3y - 2l2y - 2895ly + 2l wrt l? 69126y What is the third derivative of -2z5 - 41z*4 - 27z*3 - 23756z*2 wrt z? -120z*2 - 984z - 162 Find the third derivative of 104r5 - 908r*2 + 2r + 2 wrt r. 6240r2 What is the second derivative of -127f5 + f2 + 2516f? -2540f*3 + 2 Differentiate 5v*2 + 11v - 413 with respect to v. 10v + 11 What is the first derivative of -1246l*2 + l - 12890? -2492l + 1 Differentiate 304d4 - 309 with respect to d. 1216d*3 Differentiate 1042bo2 - b - 4135o*2 wrt b. 1042o*2 - 1 What is the third derivative of 246t*3w3 - t3 + 16t2w*2 wrt w? 1476t*3 Find the second derivative of -1996w*5 - 4w - 39 wrt w. -39920w3 What is the second derivative of 292r*4 + 14r3 - r2 - 2r + 17090? 3504r*2 + 84r - 2 What is the second derivative of 4h3 + 590h*2 + 24h - 16 wrt h? 24h + 1180 Find the first derivative of -an*3t - 4an*2 + 8an - 9n*3t + 91n3 - 26nt wrt t. -an*3 - 9n*3 - 26n Find the third derivative of 442n2t*3 + 3n*2t*2 + 6n*2 - 2t*3 - 5t wrt t. 2652n2 - 12 Find the second derivative of -3f*3p*3 + 39f*3p2 + f3 - f*2 - 4fp3 + 14fp wrt p. -18f*3p + 78f3 - 24fp What is the second derivative of 2041m*4 + 2582m? 24492m2 What is the third derivative of m2o*4 + 60m*2o*3 - 3m*2o - o*4 - 551o*2 wrt o? 24m*2o + 360m2 - 24o Find the second derivative of 3q3r + 127q2r + 16qr + 2q - 11r wrt q. 18qr + 254r Find the third derivative of -1812r*6 - 582r*2 - r wrt r. -217440r*3 What is the second derivative of 33rs2 + 3r + 8s2 + 20s wrt s? 66r + 16 Find the third derivative of 8b*4m - 2b3m - 2b2m - 2b2 + 42m wrt b. 192bm - 12m What is the third derivative of -23bl5 + 2bl3 + 3bl2 + l2 wrt l? -1380bl2 + 12b Find the third derivative of -44q4s**2	{ "pile_set_name": "DM Mathematics" }
is the remainder when 87 is divided by 2 - 3/2(t + 16)? 2 Suppose 0 = 16g - 182 - 458. Suppose 4 = 2a, 4a = -5x - 0a + 128. Suppose 4t - g = x. What is the remainder when 29 is divided by t? 13 Suppose -3u = 6, 4s - 14 = -0s + 3u. Suppose -m = r + 2r - 48, -172 = -5m + sr. What is the remainder when m is divided by (13 + -14)3 - -26? 13 Suppose 0 = -14d + 2150 - 218. Let v(k) = k*2 - 1. Let u be v(2). Suppose a - t = -2t + 44, -ut - d = -3a. Calculate the remainder when a is divided by 16. 13 Let x be (-3)/12 - (-97)/4. Suppose r + x = 2r. Suppose -2h - 101 = -j, -j + 0h + 5h = -77. What is the remainder when j is divided by r? 21 Let q = 164 + -104. Let w(n) = 7n - 32. Let o be w(5). Suppose -s + 0t + 17 = -5t, -5s + ot + 85 = 0. Calculate the remainder when q is divided by s. 9 Suppose -96n + 3296 = -1408. Let a(h) = -22h - 6. What is the remainder when a(-11) is divided by n? 40 Suppose -4l + 11 = 7, 5p - 5l = -40. Let o(z) = 1 - 6 - 6z - 2. Calculate the remainder when o(p) is divided by 10. 5 Suppose 3n - 875 = 5z, -n = 5z - 36 - 249. Calculate the remainder when n is divided by 44. 26 Let l be (56/98)/(4/(-14)). Let p(k) = -6k + 1. Calculate the remainder when ((-108)/3l)/2 is divided by p(-3). 17 Let s(l) = l*3 + 10l*2 - 14l - 11. Let i be s(-11). Suppose 1181 = ix - 1877. What is the remainder when x is divided by 9? 4 What is the remainder when (-9)/2(208/(-216))/(9/702) is divided by 72? 50 Let j(u) = -58u3 + 7u*2 + 24u + 15. Let z(a) = 5a2 + 2a - 3. What is the remainder when j(-1) is divided by z(2)? 14 Suppose 2l - 3a - 4416 = -3814, 4a + 602 = 2l. Calculate the remainder when l is divided by 18. 13 Suppose 2x - i = 114, 0 = -154x + 155x - i - 58. What is the remainder when 413 is divided by x? 21 Let d(s) = 2s*2 - 3s + 2. Let p = -20 + 26. Suppose 2k - p = 0, -5k = -5a - 4k + 82. Calculate the remainder when d(-5) is divided by a. 16 Let b be (0/1)/((-12)/6). Suppose -3q - 2p + 62 = b, -4q = -11p + 9p - 64. What is the remainder when 143 is divided by q? 17 Suppose -15 + 3 = -3u, -5g - u = 1. What is the remainder when 40 is divided by 9 + 4 + 1 + (g - -1)? 12 Let x = 138 + -135. Suppose 358 = xz + 5g, 4z + g = 3g + 434. Suppose 34 - z = -11h. What is the remainder when 18 is divided by h? 4 Suppose -52m - 11m = 51m - 79230. What is the remainder when m is divided by 69? 5 Let m be (8/28)/(8/7 + -1). Suppose -4 - 5 = c + 5w, 5c - 47 = -mw. Suppose 3z - 195 = -2z. Calculate the remainder when z is divided by c. 6 Let g(b) = 4b2 - 173b + 779. What is the remainder when g(5) is divided by -328/(-6)? 6 Suppose 65 = 16t - 11t + j, 75 = 5t - j. What is the remainder when 68 is divided by t? 12 Suppose -737f + p = -741f + 2877, 0 = 5p - 5. What is the remainder when f is divided by 60? 59 Let u be (5 + -3 - 2) + 0. Suppose -5q - 67 + 1632 = u. What is the remainder when q is divided by 63? 61 Suppose -6 = -x - 2r, -4x + 9x - 3r + 9 = 0. Suppose x = 5z + 55 - 130. What is the remainder when 37 is divided by z? 7 Suppose 0 = m + 3m - 12. Suppose -4 - 185 = -md. Calculate the remainder when d is divided by 22 - ((-360)/(-63) - 4/(-14)). 15 Suppose -59 = 2d - 5g, 0 = -0g + 2g - 6. Let h = d - -26. Suppose -3v + 3j + 45 + 51 = 0, 0 = hv + j - 113. What is the remainder when v is divided by 8? 5 What is the remainder when 2497 is divided by (9945/(-18))/(-13)(-12)/(-10)? 49 Calculate the remainder when 7344 is divided by 41 - (1/(-12) - (-2783)/276). 28 Suppose 2l + 264 = 242. Suppose -23 = -k + 12. Let j = l + k. Calculate the remainder when 90 is divided by j. 18 Suppose 4y + 2d - d - 429 = 0, -y + 123 = -2d. What is the remainder when 353 is divided by y? 26 Let g = 92 + -86. Let z be (-2 + g - 77) + (-3)/(-1). Let s = -61 - z. Calculate the remainder when 124 is divided by s. 7 Let c(h) = -2h + 7. Let g be c(-13). Let x = -30 + g. Suppose -3m + xk + 123 = 5k, 192 = 5m - k. What is the remainder when m is divided by 21? 18 Suppose 1 = i - r, -5i + 3 = 2r - 9. Let j(h) = -h2 + 9h - 11. What is the remainder when -1(-6 - 4/i) is divided by j(2)? 2 Let g be -3(2 + -1) + 8. Suppose 3f + 46 = 5f + 4o, go = f - 2. Let u(j) = -j*3 + 33j*2 - 30j - 54. What is the remainder when f is divided by u(32)? 7 Let h(f) = 30f + 4560. What is the remainder when h(-134) is divided by 133? 8 Let p(b) = -b2 - 22b - 89. What is the remainder when 3159 is divided by p(-12)? 28 Let m(l) be the second derivative of l5/20 - l4/6 - l*3/3 + 2l*2 + 14l - 2. Calculate the remainder when m(4) is divided by 17. 11 Suppose -5m - 15 = 0, -7m + 8m - 25 = -4r. Suppose -3l + 209 + r = 0. Calculate the remainder when l is divided by 16. 8 Let m = 722 - 607. Let k(h) = -h3 - 2h*2 - 2h. Calculate the remainder when m is divided by k(-4). 35 What is the remainder when (-130)/(-520) - 22422/(-8) is divided by 349? 11 Let m(t) = -t*3 + 23t2 + t. Let s(b) = -b3 + 13b2 + 4b - 38. What is the remainder when m(23) is divided by s(13)? 9 Let o = -160 + 166. Suppose -76 + o = -14v. What is the remainder when 32 is divided by v? 2 Suppose -52h + 249 = -15091. What is the remainder when h is divided by 187? 108 Suppose 23z = -66z + 3827. Calculate the remainder when z is divided by (-3)/18 - 628/(-24). 17 Let z = 3705 + -3634. Let s(b) = -2b - 3. Calculate the remainder when z is divided by s(-9). 11 Let d(w) = 2w - 102. Let i be d(-29). Let n = -136 - i. What is the remainder when 28 is divided by n? 4 Suppose 11o + 124 = -20o. Let c(u) = -u*3 - 2u*2 - 8u - 3. What is the remainder when c(o) is divided by 23? 15 Let h be 4/(-34) + ((-18)/(-51))/3. Suppose h = -c - 5 + 16. What is the remainder when 117 is divided by c? 7 Let o be (-15)/(-5) + (-2)/(-1). Suppose -3g - 18 + 102 = -of, -f = -g + 28. Let k(q) = -q*2 + q + 8. What is the remainder when g is divided by k(0)? 4 Calculate the remainder when 993 is divided by (-13 - -1)/(374/(-9537)). 75 Let t(x) = -331x - 3905. What is the remainder when 2879 is divided by t(-12)? 65 Let s(z) be the third derivative of 7z4/24 - 14z*3 + 79z*2. What is the remainder when 69 is divided by s(15)? 6 Suppose 0 = -l + g + 25, -3l + 90 = -4g + 16. What is the remainder when 8993 is divided by l? 23 Let u = 957 + -924. Suppose -5p = -2d - 1478, -p - 3d + 168 = -131. Calculate the remainder when p is divided by u. 32 Let p be (-3 - -1) + -2 - -9. Suppose -5y - pq + 275 = 0, -2q = -3y + 7y - 222. Let u = y + -48. What is the remainder when 22 is divided by u? 6 Let o = -1061 + 1503. Let m = -440 + o. Calculate the remainder when m is divided by 1. 0 Suppose 0 = -27k - 339k + 397476. Calculate the remainder when k is divided by 13. 7 Let v(y) be the first derivative of y4/2 - 11y*3/3 - 3y*2/2 + 11y - 73. What is the remainder when 112 is divided by v(6)? 25 Let l(f) = f*2 - 6f - 12. Suppose -5a + 5u - 53 - 27 = 0, -18 = a - 3u. Let y be (12/(-10))/((-3)/a). Calculate the remainder when l(y) is divided by 7. 4 Let h(s) = -s2 + 16s + 5664. What is the remainder when h(0) is divided by 11? 10 Let d be (-1 + -6)/(-14) - 1614/(-4). Let z = d + -328. What is the remainder when z is divided by 13? 11 Let a be 1 - (6 + 0) - -4. Let n(p) = 10p2 + 2p + 2. What is the remainder when n(-1) is divided by (8/(-20)a)/((-1)/(-5))? 0 Calculate the remainder when 179 is divided by (117 - -7) + (-2)/26. 61 Suppose 2s - k = -s - 1029, -3 = -k. Suppose -5c - 3a + 152 = 0, 2a - 11411 + 11403 = 0. What is the remainder when c is divided by 2/(-7) - s/21? 12 Let c = 6700 - 6679. What is the remainder when c is divided by (-1)/(-4) - 189/(-12)? 5 Let l = -881 + 893. What is the remainder when 14578 is divided by l? 10 What is the remainder when (-53212)/(-265) - (-1)/5 is divided by 68? 65 Let r(u) = 33u3 + u2 + 225u - 694. What is the remainder when r(3) is divided by 70? 41 Let k(r) = r*3 - 20r*2 - 332r - 67. Calculate the remainder when 647 is divided by k(31). 11 Suppose 0 = -x - 10, -5h = 1375x - 1370x - 150. Let l = 153 - 74. Calculate the remainder when l is divided by h. 39 Let l(h) = 3h*2 - 3h - 4. Let c be ((-9)/(252/(-16	{ "pile_set_name": "DM Mathematics" }
717 - 338. Let z = 0.683 + p. Which is the closest to 0? (a) -0.5 (b) 0.7 (c) z c Let b = 6.93 - 7. Let l = 3248 + -3248. What is the closest to l in -1/3, b, -0.1? b Let y = 0.058 + -0.303. Let j = 17 - 17.045. Let w = y - j. What is the nearest to w in 3, 4, -5? 3 Let a = 0.39175 + -0.29175. What is the nearest to a in -2, 1.02, -7? 1.02 Let a = -0.105 - -0.075. What is the nearest to -0.02 in -2/7, a, 3, -1? a Let w = -64 - -26. Let v = w + 28. Let b = 12 + v. What is the closest to 2 in -2, 2/11, b? b Let s be 15/(-5) - (-3 - (-16)/88). Suppose 6 = -q + 3. Which is the nearest to -1? (a) q (b) 3/7 (c) 27 (d) s d Let o = -33/4 - -8. Let a = 608 + -606. What is the nearest to 1 in o, 0.04, a? 0.04 Let z = 0.58 + 0.42. Which is the closest to 2? (a) 12 (b) -1 (c) z (d) 0.2 c Suppose 5w - 3t = 26 - 27, t = 2w. Which is the closest to w? (a) -0.4 (b) 8 (c) 3/2 (d) -4 c Let h = 10.2 - 11. Let a = -0.4 - h. Let s = 0.216417 - 2.216417. What is the nearest to 2/7 in a, 3, s? a Suppose 0 = -21r + 48r. Let p = -2.9 + 3. What is the nearest to 2/5 in -3, p, r? p Let g = 39/4 + -269/28. Which is the closest to -2? (a) g (b) 0.3 (c) -0.053 c Suppose -5x + 58 = -4w + 7w, 2x + 23 = 3w. What is the closest to 1 in w, -4, -0.06? -0.06 Let m = 13 - 16. Let u be -4 + (-152)/(-16) + (-2)/4. Suppose uh - 3h = 2. What is the nearest to 1 in -0.2, m, h? h Let k = 0.2021 - 3.4521. Which is the nearest to -0.2? (a) k (b) 1/6 (c) 1 b Let t = 169 - 842/5. Let y = 0.3235 + -0.0235. Which is the closest to t? (a) y (b) -4/3 (c) 0.2 a Let j be (-6 + 228/30)/((-2)/(-15)). Suppose 2x - 16 = -j. Let q = -2 - 0. Which is the nearest to q? (a) -1/4 (b) -2 (c) x b Let j = -4.9 + 8.5. Let d = j - 2.7. Let n = 0.5 - d. Which is the closest to -0.2? (a) -3/2 (b) n (c) 1/4 b Let s = 335 + -321. Suppose r = 8r - s. What is the nearest to r in 1, -2/9, 0.2? 1 Let y = -0.2 + -0.3. Let n = 21291 - 21291.4. Which is the nearest to 1? (a) y (b) 0.4 (c) n b Let n = 4.132 - 4.1. Let u = -0.02 + n. Let a = 24.988 + u. What is the closest to 0.1 in a, 5, 4? 4 Let w = 42 - 42.5. Let x = -61 + 33. Let u = 25 + x. What is the closest to 0.2 in -2, w, u? w Let j = -2213 - -2213.4. Which is the closest to j? (a) -2/5 (b) -16/7 (c) -4/5 a Let l = -49 - -48.5. What is the closest to l in -1, -3, 14? -1 Let f(k) = 1070k + 6420. Let n be f(-6). What is the nearest to -0.1 in -2/9, n, -6, -3? n Let y be 2/(-2) + 2250/18 - -6. Let i be (-832)/y + (7 - 1). Which is the nearest to i? (a) -2/13 (b) -0.07 (c) -4/7 (d) -0.4 d Let q be 156/104(-2)/692. Let k = -21 - -22. Which is the nearest to q? (a) 0.5 (b) -1/4 (c) k b Let o = -2119 - -2110. Let h be 19/5 - (-4)/20. Suppose -2 - 6 = -hj. Which is the closest to 0? (a) o (b) j (c) 0.5 c Let s = 62.46 + -61.46. What is the closest to s in -11.2, -4/3, -0.5, -2? -0.5 Let m be (1 - 2)((-8)/(-2) + -9). Suppose -mh = 16 - 6. Let v be (14/21)/(-112/6). Which is the closest to h? (a) 1/7 (b) v (c) -1/3 c Let w = -2.03 + 0.03. Let n be (15 - 132/8)(-51)/9. Which is the nearest to 2/5? (a) 1/9 (b) n (c) w a Let m = 1.808 - -0.192. Let h = -5/21 + 4/7. Let v = -31.9 - -32.2. What is the nearest to h in m, 0.1, v? v Let b be (1/(-3))/(-10(835/75 + -11)). Let o(r) = 3r*3 - 3r*2 - 2r - 2. Let n be o(3). Let d = n + -136/3. What is the nearest to d in -0.3, 2, b? b Suppose 4u - 3u + 7 = 0. Let x be 2 - (19/u - 22/77). What is the nearest to 1 in 4, -2/5, x? -2/5 Let f be (6/(-264))/(21/12 - 2). Let s be (13 + -4)/9 + 1. Which is the closest to f? (a) 2/5 (b) s (c) 3/2 a Let f(w) = w*2 + 40w + 196. Let r be f(-38). Let o be r/(-72) - (-16)/6. Let y = -0.1 + -0.1. What is the nearest to 0.05 in y, o, 2? y Suppose 24v - 19v + 5 = 2m, 2m + 5 = -5v. Let p be -10v/2 + 12/(-4). Let h = -0.4 - 0.1. Which is the nearest to 3? (a) h (b) -1 (c) p c Let m be 1/((5/(-2))/5). Let v be (-3)/(-30) + 1/m. Let y = -220226 - -1541584/7. Which is the closest to v? (a) y (b) -0.5 (c) 3 b Let r = -10037/2 + 5014. Which is the nearest to 0? (a) 5 (b) r (c) 52 b Let g = 1723/10554 - -6/1759. Which is the closest to 0? (a) -7 (b) 2/3 (c) -25 (d) g d Let l = 9577.94 - 9738. Let t = l + 160. Which is the nearest to 0.5? (a) -5 (b) t (c) -2/13 b Let g = 5.38 + -5.58. Let h = -2158/11 + 196. What is the closest to 0 in h, g, -4.3, -3? h Let w = -13831 + 13836. What is the closest to -1 in -24, -3, w, -1? -1 Let d be (106/(-15))/((-654)/60). Let f = -2/109 - d. Let m be 57/3830/9. What is the nearest to -1/3 in f, m, 0.4? f Let t = 0.17309 + -0.27309. Let r = 0.1 + -0.5. Let z = r - 0. Which is the nearest to -1? (a) t (b) z (c) 2/7 b Suppose j - 9 = -2j. Let f be ((-2)/(-6))/(2/j). Let o = -12369 + 37111/3. What is the nearest to f in -3, o, -5? o Let m = -4080 + 142798/35. Which is the nearest to -2/5? (a) 3/7 (b) 6 (c) m (d) -0.3 d Let z = -14 + 16. Let q be (3/z)/((-9)/12). Suppose 5p + 0p + 5 = 2m, -5m + 4 = -4p. Which is the closest to p? (a) -0.3 (b) -0.2 (c) q a Suppose -25 = -5k, -2f - 11 = -37k + 36k. Let u be (-5)/2(-3)/30. What is the closest to u in 0, -2/25, f? 0 Let x = 0.47 + 4.13. Let z = 0.6 - x. Let m = 8 + z. Which is the nearest to 2/5? (a) m (b) -2 (c) 0.3 c Let d = 20 + -137. Let l = 113 + d. Let r = 17/33 - 2/11. Which is the nearest to r? (a) 2 (b) l (c) 0 c Let u = 890795 + -890796. Let a = -143/20 - -37/5. Let g = -621/7 - -89. What is the nearest to g in a, u, -0.5? a Let k be (-4)/50 + 8528/(-400). Let j = -229/10 - k. Suppose 2w = 2o, 5o - 2w = -7w + 30. Which is the nearest to 2? (a) j (b) 4/3 (c) o b Let z be -293 + 1 + (-5)/((-15)/(-6)). Let y be (-2)/(-20) + -8 + z/(-35). Which is the closest to 0.1? (a) 11 (b) y (c) -2/5 b Let v = 11926 + -59626/5. Let c be (-5)/((-10)/(-4)) + 2. What is the nearest to c in v, 5, -1? v Let j = 34.95 - 35.95. Which is the nearest to -71? (a) j (b) 0.5 (c) 0.7 a Let n = 343 + -344. Let r = 1101 - 1110. Let i = 0.7 - -0.3. Which is the closest to n? (a) r (b) i (c) -5 b Let o = 0.9 + 0.1. Let a = -77/12 - -20/3. Suppose 3z + t = -2, 9 = t + 8. What is the nearest to z in 3/2, a, o? a Let u = -2672/6349 - 7/907. What is the nearest to 1.3 in u, -2/3, 2/7, -0.2? 2/7 Suppose 1 = -f, -u - f - 2f = 4. Let v be (-1)/(u/(-2) + 0)-84. Let i be (-36)/(-35) + (-72)/v. What is the nearest to 2/3 in i, 0.3, -1? i Let j = -1594 + 7971/5. Let r = -4 + 5. Let s = -3 + r. What is the nearest to s in j, -3, 3? -3 Let w be 1((-11)/4 - -3). Let g be 15170/16280 + (-3)/4. What is the closest to 0.1 in w, 1/5, g? g Let n = 1 + 3. Let m = 57.2 + -59.2. What is the closest to 0 in n, m, 14? m Let q = -397 - -397.1. Let f = -9.74 + 10. Let u = 0.76 - f. Which is the nearest to 1? (a) -3 (b) q (c) u c Let o = -0.077 + -35.923. Let y = o - -6. Let z = y + 30.3. Which is the nearest to -5? (a) z (b) -5 (c) -0.2 b Let u = -195 - -452. Let s = u - 251. What is the closest to s in 0.1, -5, -3? 0.1 Let z = 454 + -675. Let y = 210 + z. What is the closest to y in -2/3, 2/13, -3? -3 Let x = -0.7 + -0.2. Let r be (398/10 - 5)/((-1)/(-10)). Let w = r + -343. What is the closest to -1 in x, 0.3, w? x Let w = 7.44 + -75.24. Let g = -66 - w. Which is the closest to 0? (a) -5 (b) g (c) 4 b Let l = 5.1 - 5. Let y = -331/2 + 103. Let j = -63 - y. Which is the closest to l? (a) -12 (b) j (c) 3 b Let j = -788.021 - -785. Let l = j + 0.021. What is the closest to -1/5 in l, 3, -2? -2 Let i = -29034 + 29022.1. Which is the closest to 1? (a) i (b) -1/3 (c) 14 b Let r(n) = 2n*3 - 18n*2 + 8n - 78. Let f be r(9). Which is the closest to 1? (a) -90 (b) f (c) -4 (d) -5 c Let s(c) = -c*2 - 5c + 65. Let x be s(6). Let o be 31/105 - (-14)/((-1176)/36). What is the nearest to -1 in o, -2/3, x, -14? x Let a = -16387 + 16387. Let h be (-4)/(-6)3/(-5). What is the closest to a in h, -5, 0.2? 0.2 Let q = 0.1585 - -0.0415. Let c = -4.6 - -4.6. What is the nearest to -2 in c, q, 5? c Let x be 16/7 + (-2527)/(-931). Which is the closest to -2? (a) x (b) 6 (c) -0.1 c Suppose 4m - 29 = 3g + 12, 2g = -4*m - 54. Which is the closest to 0.1? (a) 5 (b) g (c) 7 a Let r be 1/(-9) - (-110)/(-792). Let l =	{ "pile_set_name": "DM Mathematics" }
704, -5034, -6564, -8312? -10296 What is next in 33747, 33623, 33429, 33165, 32831, 32427, 31953? 31409 What comes next: -39723, -39881, -40147, -40521? -41003 What is next in 8108, 5531, 2954, 377? -2200 What comes next: -3652, -8076, -20084, -43468, -82020, -139532, -219796? -326604 What is next in -144875, -289886, -434897? -579908 What is next in 957874, 957843, 957796, 957733, 957654, 957559, 957448? 957321 What is next in -101310, -101364, -101432, -101496, -101538, -101540? -101484 What is next in -230, -230, -136, 52, 334, 710? 1180 What comes next: 2295, 7372, 15843, 27714, 42991, 61680, 83787? 109318 What is next in 31866, 63153, 94440, 125727, 157014? 188301 What comes next: -643, 327, 1925, 4139, 6957, 10367, 14357? 18915 What comes next: -272, -181, 498, 1987, 4508? 8283 What is the next term in -24, -235, -488, -783, -1120, -1499, -1920? -2383 What comes next: 3430, 13887, 31326, 55753, 87174? 125595 What is next in 1071, 2206, 3321, 4422, 5515? 6606 What comes next: 2955, 12190, 27563, 49068, 76699? 110450 What is next in -385218, -769712, -1154206, -1538700? -1923194 What comes next: 1403, 9520, 31563, 74498, 145291? 250908 What comes next: 13510, 49273, 85036, 120799? 156562 What comes next: 12437, 26164, 39891, 53618, 67345? 81072 What comes next: -1224, -4000, -11668, -26718, -51640, -88924, -141060, -210538? -299848 What is the next term in 42614226, 42614243, 42614272, 42614313, 42614366, 42614431, 42614508? 42614597 What comes next: 13815, 27624, 41431, 55236, 69039? 82840 What is the next term in 20961131, 41922254, 62883373, 83844488, 104805599, 125766706? 146727809 What is the next term in -4594399, -4594409, -4594419? -4594429 What is next in 2525, 2514, 2485, 2414, 2277, 2050, 1709, 1230? 589 What is next in 2282, 2067, 1738, 1289, 714, 7, -838, -1827? -2966 What comes next: -263540, -527718, -792534, -1057982, -1324056, -1590750, -1858058, -2125974? -2394492 What is next in -908, -315, 3256, 11299, 25308, 46777, 77200, 118071? 170884 What is next in 2848, 7357, 11878, 16417, 20980, 25573, 30202? 34873 What comes next: 1851, 2005, 2203, 2397, 2539? 2581 What comes next: -1234488, -2469001, -3703526, -4938069, -6172636, -7407233, -8641866? -9876541 What is next in -9550, -19091, -28636, -38185, -47738? -57295 What is the next term in 18325297, 36650588, 54975879? 73301170 What is next in -14720, -29383, -43994, -58559, -73084? -87575 What is the next term in 5641183, 5641190, 5641197? 5641204 What is the next term in 734, 1449, 2658, 4367, 6582, 9309, 12554, 16323? 20622 What is the next term in 1986, 4355, 7096, 10209, 13694? 17551 What is the next term in 74105, 142998, 211891, 280784, 349677? 418570 What comes next: -39617, -79396, -119175? -158954 What comes next: 497065, 1988282, 4473651, 7953172, 12426845, 17894670? 24356647 What is the next term in -2821, -5927, -9043, -12169, -15305? -18451 What comes next: -447, -2516, -7263, -15750, -29039? -48192 What comes next: -24708, -98880, -222452, -395388, -617652, -889208, -1210020? -1580052 What comes next: -1968530, -3937060, -5905590, -7874120, -9842650? -11811180 What is the next term in 526339, 526647, 526955, 527263, 527571, 527879? 528187 What is next in 1193, 7649, 24581, 57221, 110801, 190553, 301709? 449501 What comes next: 19577, 19992, 20697, 21704, 23025, 24672, 26657, 28992? 31689 What comes next: -553035, -1105922, -1658809, -2211696, -2764583? -3317470 What is next in -184061, -368199, -552337, -736475, -920613? -1104751 What is the next term in -643, -2478, -5563, -9898? -15483 What is the next term in -5558645, -11117283, -16675921, -22234559? -27793197 What comes next: 19138351, 19138349, 19138347? 19138345 What is the next term in -120374, -120399, -120422, -120443, -120462, -120479? -120494 What is next in -816054, -1632084, -2448076, -3264012, -4079874, -4895644, -5711304, -6526836? -7342222 What is the next term in -106150, -106061, -105912, -105703, -105434, -105105, -104716? -104267 What is next in 15253, 13396, 11539, 9682? 7825 What is the next term in 213320, 426672, 640088, 853598, 1067232, 1281020? 1494992 What is next in 335815, 335521, 335227? 334933 What is the next term in 13371, 12897, 12411, 11907, 11379, 10821? 10227 What comes next: 1407, 2772, 4181, 5634, 7131, 8672? 10257 What is the next term in 2291528, 2291593, 2291658, 2291723, 2291788, 2291853? 2291918 What is next in 53639, 53642, 53633, 53606, 53555, 53474, 53357, 53198? 52991 What is the next term in 217837, 435506, 653005, 870334, 1087493, 1304482? 1521301 What is the next term in 650545029, 650545030, 650545031, 650545032, 650545033, 650545034? 650545035 What is next in 10229124, 10229129, 10229136, 10229145, 10229156, 10229169, 10229184? 10229201 What is next in -10177, -20698, -31221, -41746, -52273, -62802? -73333 What comes next: -1145, -9554, -32359, -76760, -149957, -259150? -411539 What is next in 1235, 2370, 3443, 4442, 5355, 6170, 6875, 7458? 7907 What is the next term in 19916506, 19916505, 19916504, 19916503, 19916502? 19916501 What is the next term in -28193, -112439, -252837, -449381, -702065, -1010883, -1375829? -1796897 What comes next: 279465, 558912, 838337, 1117728, 1397073, 1676360, 1955577? 2234712 What is next in 465798, 931515, 1397232, 1862949, 2328666, 2794383? 3260100 What is the next term in 3109500, 3109498, 3109496, 3109494, 3109492? 3109490 What is next in 2930375, 5860750, 8791125, 11721500? 14651875 What is the next term in 1586, 6214, 14322, 26234, 42274, 62766, 88034, 118402? 154194 What comes next: 92255, 92270, 92285, 92300? 92315 What comes next: 8947970, 8947974, 8947978, 8947982? 8947986 What is next in -38808, -77913, -117018, -156123, -195228? -234333 What is the next term in -191834, -191856, -191880, -191906, -191934, -191964, -191996? -192030 What comes next: 7353, 13950, 20545, 27138, 33729, 40318, 46905? 53490 What comes next: -88998, -179257, -269516, -359775? -450034 What is next in -3022, -6029, -9018, -11989, -14942, -17877? -20794 What comes next: 8616, 3102, -2398, -7878, -13332, -18754, -24138, -29478? -34768 What is the next term in -8215, -32883, -73991, -131527, -205479, -295835, -402583, -525711? -665207 What is next in -11895697, -23791325, -35686953, -47582581? -59478209 What is next in 14570532, 14570531, 14570530, 14570529, 14570528? 14570527 What is the next term in 399, 828, 1267, 1722, 2199, 2704? 3243 What comes next: 52000, 109198, 166396? 223594 What is next in -13070484, -13070578, -13070734, -13070952, -13071232, -13071574, -13071978? -13072444 What is the next term in -118260, -118036, -117418, -116208, -114208? -111220 What is next in 362, 1439, 3912, 8459, 15758? 26487 What comes next: 2043, 4685, 8529, 14175, 22223, 33273, 47925, 66779? 90435 What is next in -7032, -7024, -7026, -7038, -7060, -7092? -7134 What comes next: -751, -2959, -6599, -11635, -18031? -25751 What is next in 589, 1340, 2407, 3958, 6161, 9184, 13195, 18362? 24853 What is next in 30679, 23551, 11671, -4961, -26345? -52481 What is next in -7043554, -7043557, -7043560, -7043563? -7043566 What is next in 866956, 866990, 867024, 867058, 867092, 867126? 867160 What comes next: -1349331, -1349328, -1349341, -1349370, -1349415? -1349476 What is the next term in -118998, -237990, -356978, -475962, -594942? -713918 What is next in 1406, -7980, -17370, -26770, -36186? -45624 What comes next: 18417, 48470, 98559, 168684, 258845? 369042 What comes next: -23, -203, -591, -1307, -2471? -4203 What is next in -3192, -3307, -3464, -3663, -3904? -4187 What comes next: 599, 4729, 15979, 37907, 74071, 128029, 203339? 303559 What is the next term in 395271, 790576, 1185881, 1581186, 1976491, 2371796? 2767101 What is the next term in -185, 1089, 5271, 13813, 28167? 49785 What comes next: -787862163, -787862164, -787862165, -787862166, -787862167? -787862168 What is the next term in -1540, -3786, -6006, -8200, -10368, -12510? -14626 What is the next term in 3110, 6075, 8758, 11021, 12726, 13735, 13910? 13113 What comes next: -285, 1298, 5589, 13944, 27719, 48270, 76953, 115124? 164139 What is the next term in -1142172, -2284169, -3426166, -4568163, -5710160, -6852157? -7994154 What is the next term in -6828, -54875, -185508, -440097, -860012, -	{ "pile_set_name": "DM Mathematics" }
ate the highest common factor of o and 117. 13 Suppose 5h - 584 = 3c, -2c = 3c - 2h + 986. Let q = c - -486. Calculate the highest common factor of q and 32. 32 Suppose 2s = 8, 2i - 81 = s + 67. Suppose 5l - 24 = i. What is the greatest common divisor of l and 5? 5 Let t be (1 + -2 + -1)-1. Suppose 7z = tz + 85. Let n = z - 6. Calculate the greatest common divisor of 77 and n. 11 Suppose -2m - 462 = -13m. Calculate the greatest common divisor of 14 and m. 14 Let n(u) = 3 - 3 + 14u + u. Let p be n(2). Let c(r) = 2r2 + 5r - 2. Let w be c(-4). What is the highest common divisor of p and w? 10 Suppose -4t - 4b - 11 = -3, 0 = -2t + 4b + 14. What is the greatest common factor of 5 and t? 1 Suppose -3f = 4g - 1 + 4, 4f + 20 = 0. Let r be 786/(-12) - 1/2. Let s be ((r/(-1))/2)/1. Calculate the greatest common factor of g and s. 3 Let i be 638/10 + (-17)/(-85). Let s(l) = -l + 1. Let r be s(-7). What is the highest common factor of r and i? 8 Suppose 0 = c + 3c - 24. Suppose 9w - cw = 6. Let m be (-9)/(-2)8/6. What is the highest common factor of m and w? 2 Let y be (40/6)/(2/18). Suppose 3h + h = -y. Let v be 4/10 - 114/h. What is the greatest common divisor of 80 and v? 8 Let j(n) = 2n3 - n2 - n - 2. Let p be j(2). What is the greatest common divisor of 4 and p? 4 Let q(g) = 2g*2 - 8g + 2. Let c be q(6). Suppose -3m + 65 = 2m. What is the greatest common factor of c and m? 13 Let p be (-483)/(-9) + (-12)/(-9). What is the highest common factor of p and 11? 11 Suppose -3y = -4y + 39. Let g = 69 - y. Suppose 3l - 3r - 45 = 0, -l - r = 3r. Calculate the greatest common factor of l and g. 6 Let v = -67 - -257. Calculate the greatest common factor of v and 38. 38 Suppose -3f = -3d - 0 + 15, d = 5. Let h be f - 2(-4 + 0). Let n(i) = 16i2 + 3i - 3. Let p be n(1). What is the greatest common factor of h and p? 8 Let s be (-16)/(-6)((-93)/(-6) - 5). What is the greatest common divisor of s and 4? 4 Let z be (-1)/1 - 1-28. Let c = z + -6. Suppose -2a + 50 = 4x, 0x + 3a = 2x - c. What is the highest common divisor of 12 and x? 12 Let y be 150/4(-4)/(-3). Let k = y - 8. What is the highest common divisor of k and 6? 6 Let t(c) = -c - 1. Let h(y) = y*2 + 11y - 4. Let p(v) = -h(v) - 4t(v). Let a be p(-8). Let w = a - -1. Calculate the highest common divisor of 2 and w. 1 Let t = 1 - -1. Suppose -3 = -tv + 1. Let q be -1 + 12 + 1 - v. Calculate the greatest common factor of q and 2. 2 Suppose 3r - 5p - 34 = 0, p - 7 = -6r + 2r. Calculate the highest common divisor of 1 and r. 1 Let l = 2 + -8. Let y(g) = -g*2 - 8g - 9. Let q be y(l). Calculate the highest common divisor of q and 3. 3 Let b be 1 + 1-3 - -41. Let i(c) = c3 + 5c*2 + 4c + 13. Let o be i(-4). What is the greatest common divisor of b and o? 13 Let y be 1 + -1 + 22 + -7. Let g be (20/(-6))/((-8)/36). What is the highest common factor of g and y? 15 Let h(p) = 25p - 1. Let z be h(1). What is the greatest common factor of 144 and z? 24 Let i = -3 + 1. Let f be i/(-12) + (-858)/(-36). Let p = -31 + 67. What is the greatest common divisor of p and f? 12 Let n be 2(4 + -3) - -42. What is the greatest common factor of 11 and n? 11 Let c(i) = 84i2 + 1. Let h be c(-1). Calculate the highest common divisor of h and 17. 17 Let b = 41 - -85. Calculate the greatest common factor of b and 14. 14 Let f be (-18)/(-81) - (-86)/18. Suppose -a = -6a - 3c + 61, fa = -5c + 65. Calculate the greatest common divisor of 55 and a. 11 Let f(j) = 2j + 1. Let k be f(2). Suppose -k = -4z + 3. Suppose 0 = l + zv - 14, -5l + 88 = -0v + 4v. Calculate the highest common divisor of 30 and l. 10 Suppose -3x - 8 = -x, 5o + 5x = 0. Suppose op - 312 = -72. Calculate the highest common divisor of p and 24. 12 Suppose -3f = -73 - 14. Let w be 1-1 - (3 + f). Let s be (-501)/w + (-2)/11. Calculate the greatest common factor of s and 165. 15 Let l be 1/(1(-1)/(-25)). What is the greatest common divisor of l and 225? 25 Let q be 2 + 0 - (-1 - 0). Suppose 5p + 3t - 2t = 11, 4p - 5t = 32. Calculate the highest common factor of p and q. 3 Let s(h) = -11h + 68. Let a be s(5). Let f be (-47)/7 + 4/(-14). Let w = a + f. What is the greatest common factor of 66 and w? 6 Let a(s) = -6s + 6. Let t be a(-7). What is the greatest common factor of 12 and t? 12 Let v(l) = 11l - 2. Let a be v(4). Let k be (8/(-6))/(2/(-21)). Calculate the highest common factor of a and k. 14 Let d(f) = -2f2 + 3f - 3. Let a be d(3). Let z(j) = -7j - 18. Let c be z(a). Calculate the highest common factor of c and 6. 6 Let g(h) = h - 14. Let p be g(12). Let t = p + 27. What is the greatest common factor of 5 and t? 5 Let d(k) = -19k + 1. Let x be d(-1). Let p(r) = -r*2 - 8r - 9. Let j be p(-7). Let h be 122/4 - (-1)/j. Calculate the highest common factor of x and h. 10 Let p be -1 - (-3)/(9/120). Let z be ((-2)/(-1))/(-1) + 89. Suppose 3d = -3w + d + 72, -3d = -3w + z. What is the highest common factor of w and p? 13 Let n(a) = a*3 - 5a*2 - 5a - 7. Let y be 52/8 + 2/(-4). Let d be n(y). Let v be 46/4 - d/2. Calculate the greatest common factor of v and 18. 6 Let d(l) = l*2 + 4l + 3. Let v be d(-6). Suppose 5y = -0y + v. Calculate the greatest common factor of 33 and y. 3 Let y be ((-117)/(-6) - -4)18. What is the greatest common divisor of 47 and y? 47 Let h(q) = -4q*3 - 2q*2 - q. Let i be h(-1). Let p = 90 - 57. What is the highest common factor of i and p? 3 Let q = -9 + 12. Calculate the greatest common factor of 6 and q. 3 Suppose -6i + i = -20. What is the highest common divisor of i and 16? 4 Suppose 0 = -p - p + 6. Suppose -i = -1 - p. Suppose 0 = -im + y + 263, -2y - 266 = m - 5m. Calculate the greatest common divisor of m and 13. 13 Suppose 3g + 2g - 599 = -3z, -2g = -3z + 613. Calculate the greatest common divisor of z and 29. 29 Let k(u) = 2u - 6. Let h be k(-5). Let r be h/56 - 88/(-14). What is the highest common factor of r and 3? 3 Suppose -16 = -2n - 2n. Let v = 1 - -3. Let k = 24 - v. Calculate the greatest common divisor of k and n. 4 Let a(c) = 15c*2 - c - 1. Let h be a(-1). Suppose r + 57 = 162. Calculate the highest common factor of r and h. 15 Let a = -10 + 17. Suppose -2v - 5 = -av. Let n(k) = 2k - 3. Let f be n(2). What is the greatest common factor of v and f? 1 Let r = 59 - 4. Let g be 12 - 6 - (-1)/(-1). Calculate the highest common divisor of g and r. 5 Suppose -5u - 3a = -388, a + 2a - 3 = 0. Calculate the greatest common divisor of 7 and u. 7 Suppose -3a + 30 = 2a. Let i = 268 + -175. Suppose r = 5o + 13, -6o + i = 5r - 3o. Calculate the greatest common divisor of r and a. 6 Let p = -40 - -72. Calculate the greatest common divisor of p and 8. 8 Let b = -9 + 15. Let y = 2 - 2. Suppose -4d + 5t + 182 = 0, -10 = -yt - 5t. Calculate the highest common divisor of b and d. 6 Suppose -3x - 2x = -10. Let t be 99/(-45) + (-2)/(-10). Let u be 13/2 + 3/t. What is the highest common divisor of u and x? 1 Let s(h) = -12h - 6. Let k be s(-6). What is the greatest common divisor of k and 44? 22 Let o = 159 - 42. Suppose -o = -6v + 3v. Calculate the highest common divisor of v and 13. 13 Let m = 5 + -1. Let d be (4/(-3))/(m/(-66)). Let f = 6 + -4. Calculate the greatest common divisor of f and d. 2 Suppose 4 = 2v - 0. Suppose -m = -vm + 3. What is the greatest common factor of 27 and m? 3 Let p(n) = -n*2 - 4n - 6. Let a be p(-4). Let f be a/(-21) - 162/(-21). Suppose 0 = -y - y + 4, 3y = -h + 38. What is the greatest common divisor of h and f? 8 Suppose 7i = 72 + 320. Calculate the highest common factor of i and 84. 28 Suppose o - 4v = -1, -4v + v + 3 = 0. What is the highest common divisor of 48 and o? 3 Let c be (-44)/5(-11 - -1). What is the greatest common divisor of c and 8? 8 Suppose 375 = 19f - 4f. What is the greatest common divisor of 200 and f? 25 Suppose -3s = -8s + 70. What is the greatest common factor of 154 and s? 14 Let x = -144 + 180. Let p = 5 - 1. Calculate the greatest common factor of x and p. 4 Let j = 42 + -31. What is the highest common divisor of j and 55? 11 Suppose 3i = -5n + 152, 0 = 4i - 6 - 10. Let f(h) = h*2 - 5h + 4. Let j be f(5). What is the highes	{ "pile_set_name": "DM Mathematics" }
t t = 31 + -21. Suppose u - 25 + t = 0. Solve -5g = -0g + u for g. -3 Let d be (-3)/(-2(-9)/(-12)). Solve -h = dh for h. 0 Let j(o) = o - 13. Let h be j(13). Solve -3r + 9 + 0 = h for r. 3 Suppose 60 = a + 2a. Solve 3h - a = -5 for h. 5 Let x = -4 + 7. Let a(j) = -1 + 3 + 7j*2 - 4j*3 + xj*3 + 8j. Let w be a(8). Solve w = -4k + 3k for k. -2 Let b(z) = -z*2 + 10z - 12. Let n = -4 - -12. Let h be b(n). Solve -2 = -2j - h for j. -1 Suppose -64 + 4 = -4s. Solve -5q - 5 = s for q. -4 Let u(f) be the second derivative of -f3/6 + 7f*2/2 - 4f. Let d be u(3). Solve -d = x - 0x for x. -4 Let z be 0 + (-1)/(0 - -1). Let u be (3 + z)-1 - -10. Solve -3g + 20 = -ug for g. -4 Let y(h) = 4h + 44. Let s be y(-10). Solve g - 5g = s for g. -1 Let z be (2 - -2) + (-2 - -1). Let h(u) = -u*3 + 6u*2 - 3u - 5. Let b be 22/4 - (-5)/(-10). Let q be h(b). Solve 0 = zr - q - 7 for r. 4 Let a be 0 - -3 - 6/(-2). Suppose 0 = 5m + 6 - 16. Solve -mi = -5i + a for i. 2 Let w(u) = u*2 - 3u - 1. Let a be w(3). Let c(t) = -t. Let j(l) = -4l + 16. Let k(v) = aj(v) + 6c(v). Let m be k(-12). Solve i = -i - m for i. -4 Suppose -5 = -2b - 1. Suppose c + k - 3k = 0, -4 = -c - bk. Solve n = cn - 2 for n. 2 Suppose -5 + 15 = -5t - 2k, -4t = 3k + 15. Suppose 0 = 2f + 2d + 2, -2f - f + 5d = -21. Let l be (t/4)/(f-1). Solve l = 4u + u for u. 0 Let k(c) = 2c*2 - 17c - 6. Let o be k(9). Solve -ov = -6v for v. 0 Let y(r) = -r*2 - 8r + 9. Let o be y(-9). Let k(g) = -g + 4. Let p be k(o). Suppose -44 = -4q + 4v, -45 = -4q + v + pv. Solve l - q = -l for l. 5 Let m be 3/(-6) + (-21)/(-2). Let o = m + -5. Solve 7x - ox = 8 for x. 4 Let r = 6 - 2. Suppose 8c + n - 34 = 3c, 2c - rn - 18 = 0. Solve 2 = 3v - c for v. 3 Let r(h) = -h2 - 17h + 16. Let q be r(-17). Solve -6a = -2a - q for a. 4 Suppose 2w = -0w - 5q + 37, -4w + 4q = -4. Let p = 0 - -2. Suppose pl - wl = 0. Solve lt = 4t - 12 for t. 3 Suppose -4h - u = -107, -2h = -3h - 5u + 3. Solve 4g = -8 + h for g. 5 Let d(i) = 2i2 + 1. Let p be d(1). Let x = 2 + p. Solve 6 = -xs - 4 for s. -2 Let p = -1 - -4. Suppose -2d + pi - 2 = 5i, 0 = -i - 1. Suppose -2r = -5k + 14, -3r + 7 = -2k + 2r. Solve t - kt + 9 = d for t. 3 Let q = -10 - -8. Let i(k) = 0k + 3k - 2k + 2. Let o be i(q). Solve -3p + op + 15 = 0 for p. 5 Let a(f) = f*3 - 2f*2 + 4f - 3. Let i be a(2). Let c = -2 + 4. Suppose -cq - q = 0. Solve q = im - 1 - 24 for m. 5 Suppose -5c = -10c + 40. Let f be (-69)/(-21) - 4/14. Suppose fs - c = l, -2l - 7 = -2s + 1. Solve -2 - 6 = -sg for g. 4 Let r = -5 + 8. Suppose -2t - rt = -25. Solve -4l = l + t for l. -1 Let o(i) = 0i*2 - 3i*2 + 5i + 2i2 + 1 - 5. Let y be o(4). Solve 5z - z = y for z. 0 Suppose -x + 13 = 3k - 28, -5x + 3k = -223. Suppose -5u - 9 + x = 0. Solve -2w + u = -1 for w. 4 Let b be ((-6)/2)/(-2 + 1). Let i(o) = 2o*2 - 4o + 4. Let p be i(b). Let m = p - 6. Solve 0y = y - m for y. 4 Let n(p) = -p2 - 8p + 10. Let i be n(-9). Solve -3 = o - i for o. -2 Suppose 5k - 4f = k - 4, k = -2f + 8. Suppose 3z = 3 - 0. Solve k + z = -t for t. -3 Let o = -31 + 15. Let m = -11 - o. Let i(r) = -r*3 + 4r*2 - 2. Let n be i(3). Solve 13 = ml - n for l. 4 Suppose 4a - 17 = -3k, 2a - 18 + 2 = -4k. Let c(p) = p*2 + 4p - 6. Let f(x) = -x*2 - 7. Let y be f(0). Let v be c(y). Solve -aq - v = q for q. -5 Suppose -16 = -4r - 0. Suppose -rp = -0p - 12. Suppose -7n = -pn. Solve n = 2c + 4 for c. -2 Let d(h) = h3 - h2 - 3h - 4. Let y be d(3). Suppose 2m - 4k - 14 = m, k = -2m - 17. Let u be (0 + -1)1 - m. Solve -4z = -yz + u for z. 5 Let n be 4/30 - (-2368)/240. Solve -2q = -0 - n for q. 5 Let y(h) = h*2 + 7h + 7. Let m(n) = -n. Let a(l) = -4l + 4. Let d(x) = a(x) - 2m(x). Let f be d(5). Let u be y(f). Solve -t = -0t + u for t. -1 Let f be 1/12-10-6. Solve -fq + 0 = 20 for q. -4 Let i(r) = 5r - 2r - 3r + r2 + 1. Let x be i(0). Solve -x = -2f + f for f. 1 Let m be (-1)/(2/(-6) + 0). Let g(y) = y*2 - 15. Let x be g(-7). Suppose -2l - 13 = -v, -mv = l - 6l - x. Solve vs - 13 = -1 for s. 4 Let f(i) = i3 + 6i*2 + 2i + 7. Let a be f(-6). Let s be (1 + 1/(-2))18. Let c = a + s. Solve cw - 7w = 15 for w. -5 Suppose 0 = 3f - f - 6, 4w - 5f = 5. Let j = w - 0. Solve jb + 4 = -11 for b. -3 Suppose 0 = -0v + 2v - o - 8, 0 = -3v - 2o + 19. Suppose 4l - 5k - 15 = 0, 2k = vl + 4 - 10. Solve l = w + w - 10 for w. 5 Let u be 25/6 + (-5)/30. Let m = -1 + u. Solve mc + 12 + 0 = 0 for c. -4 Suppose -5t = 5, 0 = 4g + t - 2t - 57. Suppose i = 3i - g. Let d be (-18)/(-4) + (-4 - 20/(-8)). Solve -d - i = -5n for n. 2 Let r = -23 - -24. Solve -3x - r + 4 = 0 for x. 1 Suppose 2m = 31 - 7. Let d = -11 + m. Solve -7 = 3u - d for u. -2 Suppose u + 4s - 23 = -s, 0 = -s + 3. Let n = 17 + -13. Solve 0 = -0z - nz + u for z. 2 Suppose 4d + 5 = -3y, 35 = 3y - y - 5d. Solve -yo + o = -4 for o. 1 Let z be (27/18)/((-6)/(-8)). Solve -zp - 3p = 10 for p. -2 Let i = 11 - 5. Suppose iw - 60 = 2w. Solve -10 - w = 5h for h. -5 Let i(n) = -11n*2 - 16n - 33. Let b(g) = 7g2 + 11g + 22. Let f(y) = 8b(y) + 5i(y). Let r be f(-7). Solve -2a = -ra - 2 for a. -1 Let g be (-3)/(0 - -3)-1. Let c be (-13)/(-4) - 6/24. Let h be -2 - (-3)/(3/c). Solve -2l + g = -h for l. 1 Suppose 2t = t. Suppose -4b - 36 = -5q - 2b, -5q + 32 = -4b. Suppose -m + 3m - q = t. Solve -ms = -8s + 8 for s. 2 Let d = -9 - -15. Let z be d(-2)/4 + 1. Let s be (-30)/12z/1. Solve si + 7 = -13 for i. -4 Let a = 13 - 24. Let n = a - -16. Solve 40 - 15 = -nb for b. -5 Let n = -3 + 8. Solve 0b - 5 = nb for b. -1 Let j = -15 + 15. Solve -t + jt = 1 for t. -1 Suppose 0 = -3q + 3f, 0 - 2 = -2f. Solve 4r + q + 7 = 0 for r. -2 Let q(g) = g*3 - 8g*2 - 9g + 2. Let j be q(9). Solve -x = x - j for x. 1 Let q(c) = -c*3 - 8c*2 - 8c - 7. Let t be q(-7). Solve 4y + 7 + 1 = t for y. -2 Suppose 0 = -k + 4 + 1. Solve -2 = -l - k for l. -3 Suppose -8j + 3j - 34 = -3r, 2r + 5j + 19 = 0. Solve -rn - 3 = 3 for n. -2 Suppose 3g = -2 + 8. Let u = g + 0. Suppose 2f = 9 - 1. Solve -f - 2 = -ui for i. 3 Let l(w) = -2w + 27. Let x be l(11). Solve xp - 3p = 0 for p. 0 Let n be 6/4(-32)/(-6). Let y(z) = z*2 - 6z + 4. Let l be y(n). Solve 0 = 2k - 6k + l for k. 5 Let v(h) = -h*2 - 4h + 7. Let f be v(-5). Solve -2 = fc - 0c for c. -1 Let s = 3 - 1. Suppose -2i + s = q, -2q = 2q + 2i - 2. Solve -5h + 5 + q = 0 for h. 1 Let k(t) = -4 - t - 5t*2 + 6t*2 - 2t. Let n be k(4). Suppose 2a + 2d - 12 = n, a + 3d - d = 6. Solve -2o = -a - 2 for o. 4 Suppose 5v + 0l + 2l - 4 = 0, 2l - 4 = -3v. Solve n - 4n + 15 = v for n. 5 Suppose h + 0d = 5d + 7, 5d = -2h - 1. Solve 0 = hk - 3k + 5 for k. 5 Suppose 6 = -3s, 3j + 2s = -s + 6. Solve -jc = -3c + 2 for c. -2 Let u = -39 + 16. Let p = 32 + u. Let k = 9 - p. Solve i + i = k for i. 0 Suppose 4h - 2 = 5z - 10z, -z - h = 0. Solve 2a + z - 6 = 0 for a. 2 Let a = -1 + 5. Let b = 5 - 2. Solve 11 = -al + b for l. -2 Let h = 20 + -8. Let i be 33/h - (-1)/4. Solve 15 + 0 = -im for m. -5 Let i = 16 + -9. Suppose 2r - 11 = -3h, -2h + i = 4r - 11. Let l be 7(-1 + (-3)/(-1)). Solve 0 = 5k + l + h for k. -3 Let v = -5 + 11. Solve -2c - v = -0c for c. -3 Suppose 9 = -5z + 39. Solve -zh + 25 = -h for h. 5 Suppose -15 = -3n - 2f, 5n + f - 35 + 10 = 0. Solve nv - 14 + 29 = 0 for v. -3 Let l be -2((-12)/3)/8. Solve 21 = -5p + l for p. -4 Let i(a) = -6a + 13. Let c(n) = -7n + 12. Let h(o) = -5c(o) + 6i(o). Let b be h(13). Solve -br + 4r = 0 for r. 0 Let o = -5 + 5. Let b(t) = -t2 - 5t + 5t + t3 + 11. Let s be b(o). Solve 4i - s = 9 for i. 5 Let n be (-12)/42 + 2/7. Solve -h + nh = -1 for h. 1 Let r(f) be the third derivative of -f4/8 + f3/3 + 2f*2. Let p be r(-5). Solve -2d = -7 + p for d. -5 Let k = -18 + 37. Suppose 9j - 4j - k = -3w, -4j = -3w + 1. Solve jq - 4 = -0 for q. 2 Let l = -3 - 0. Let z = l + 6. Solve j + 12 = -zj for j. -3 Let g be 2/(6/3) + 1. Suppose 0 = -gm + m. Solve 4v - 4 = -m for v. 1 Let a = -8 + 5. Let n be 0/a2/(-4). Suppose -3b = b. Solve -3q + b*q + 12	{ "pile_set_name": "DM Mathematics" }
e third derivative of -h5/20 - h2. What is c(s(m))? 6m2 Let u(x) be the first derivative of 2x2 + 1. Let p(g) = -g3 - 3g2 - 2g - 4. Let l be p(-3). Let k(z) = 4zl - z2 - 4z*2. Calculate u(k(n)). -4n*2 Let z(f) = -21f. Let k(c) = -3c. Give z(k(b)). 63b Let b(d) = 6d2. Let s(t) be the third derivative of t5/30 - 7t*2. Give b(s(x)). 24x*4 Let c(m) = -5m - 1. Let h(f) = -6f. What is c(h(a))? 30a - 1 Let s(w) = -4w + 36. Let i(k) = -k2. Give i(s(h)). -16h*2 + 288h - 1296 Let l(o) = o*2. Let w(h) = 10 - 10 + 16h*2. Give w(l(j)). 16j4 Let i(m) be the third derivative of m5/20 + 7m2. Let r(g) = -g + 1. Let p(x) = -5x + 6. Suppose -3 + 2 = n. Let z(t) = np(t) + 6r(t). What is i(z(k))? 3k2 Let h(a) = 4a. Let c(o) be the first derivative of o*2/2 + 8o - 1. Let q be c(-6). Let u(l) = 0l2 - 2l*2 + 4l*q. Give u(h(n)). 32n*2 Let b(p) be the third derivative of -7p6/720 - p4/8 + 4p2. Let g(i) be the second derivative of b(i). Let z(d) = 2d*2. Determine g(z(v)). -14v*2 Let u(d) = 6d2. Let l(w) be the first derivative of -w3 + 1. What is l(u(p))? -108p4 Let h(d) = -5d. Let v(j) = 36j. Let f(c) = 15h(c) + 2v(c). Let p(m) = m2 - m2 + 3m*2 - 2m*2. Calculate f(p(q)). -3q2 Let i(s) = -s2. Let g(m) = -m - 904. Calculate i(g(v)). -v*2 - 1808v - 817216 Let y(r) = 2r. Let v(j) = 3j + 74. Give y(v(s)). 6s + 148 Suppose 3s + 4f - 35 = -0s, 0 = 4s + 3f - 35. Let g = -2 + s. Let x(u) = 2u2 - 4u + gu + u. Let p(v) = -3v*2. Calculate x(p(a)). 18a4 Let w(a) = a2. Let t(k) = 15k - 18. Determine t(w(n)). 15n*2 - 18 Let d(m) = -3m. Let t(r) = 313r. Determine d(t(g)). -939g Let p(z) = z. Let x(s) = -722 + 722 + 4s. Give x(p(f)). 4f Suppose 2 = -c + 2c, 4c - 24 = -4f. Suppose 21 = fh - 4q + 5q, -16 = h - 4q. Let u(z) = h - 2z - 4. Let s(v) = 3v2. What is u(s(i))? -6i2 Let g(m) be the second derivative of m3/3 + m - 11. Let v(t) = 6t - 1. Give g(v(h)). 12h - 2 Let t(b) = -9b2. Let w(g) = 2g - 3. Let s(c) = 1. Let d(q) = -3s(q) - w(q). Give t(d(m)). -36m*2 Let q(u) = -105u. Let p(i) be the third derivative of i*5/60 + 15i*2. Determine p(q(t)). 11025t*2 Suppose -2 = -j - 5. Let q be j + 3 + -2 - -4. Let o(d) = 0d2 - dq - d*2. Let n(m) = -2m*2. Determine o(n(c)). -8c*4 Let l(z) = -2z. Let m(n) be the first derivative of 9n2/2 + 6n + 3. Let y(g) = 26g + 17. Let j(o) = 17m(o) - 6y(o). Give l(j(v)). 6v Suppose 4f = -4 - 0. Let w be ((-8)/20)/(f/5). Let d(h) = 3h2 + h2 - 3hw. Let r(i) = -i. What is d(r(m))? m2 Let v(z) = -z + 3. Let l(m) = -3m + 8. Let s(d) = 4l(d) - 11v(d). Let n(a) = -a - 2. Let o(i) = 2n(i) - 4s(i). Let r(g) = 7g2. Give o(r(x)). 14x*2 Let b(h) = 31h. Let c(i) = -33i. Give c(b(y)). -1023y Let y(i) = 31i2. Let o(b) = 6b*2. Determine o(y(k)). 5766k4 Let x(y) = -y2 + 6y + 6. Let m(t) = -t - 1. Let r(b) = -6m(b) - x(b). Let s(w) = -32w. Calculate s(r(c)). -32c*2 Let n(u) = 7524u*2. Let l(w) = -5w*2. Determine n(l(k)). 188100k*4 Let g(d) = -17d. Let h(k) = k*2 + 3. Let f(u) = -2. Let a be 3(-1)/(5 - 4). Let v(n) = af(n) - 2h(n). Determine g(v(t)). 34t2 Let a(t) = -t2 + 3. Let q(c) = c2 - 2. Let y(z) = -z - 1. Let w be y(1). Let x(p) = wa(p) - 3q(p). Let u(k) = -k. Determine u(x(h)). h2 Let w(q) = -q2. Let j(h) be the second derivative of 0 - 5/6h*3 + 0h*2 + 4h. Determine w(j(y)). -25y2 Let d(l) = -647l. Let m(v) = 35v. What is d(m(b))? -22645b Let v(m) = -m + 6. Let o(z) = 2z - 13. Let w(g) = -6o(g) - 13v(g). Let l(x) = 2x*2. Determine w(l(r)). 2r*2 Let r(a) = -25a + 3. Let p(d) be the first derivative of 2d3/3 - 20. Give r(p(x)). -50x*2 + 3 Let f(z) = 6z - 9z + 8z + 9z. Let x(n) = 2n*2. Determine f(x(m)). 28m*2 Let n(a) = -2a*2. Let j = -9 - -12. Suppose 4c = 10 + 2. Let k(q) = -j + c + 3q. Calculate n(k(o)). -18o*2 Let a(n) = -3n2. Let j(p) be the second derivative of -p3/3 - 6p. Calculate j(a(z)). 6z*2 Let j(t) = -4t. Let o(l) = -3l2 - 5l - 5. Let z(v) = -4v2 - 6v - 6. Let g(n) = -6o(n) + 5z(n). Calculate j(g(u)). 8u2 Let f(u) = -21u. Let m(w) = 31w2 + 2w - 2w - 29w*2. Calculate f(m(i)). -42i*2 Let g(p) = -1820p. Let d(l) = -2l. Calculate d(g(u)). 3640u Let y(j) = 24j. Let b(k) = -15k*2. What is y(b(v))? -360v*2 Let v(o) be the third derivative of 2o*2 - 1/6o*4 + 0o*3 + 0 + 0o. Let p(n) be the second derivative of -n*3/6 + 2n. Calculate v(p(g)). 4g Let t(q) = 5q*2 - 3q*2 - 4q2. Let s(v) be the second derivative of -v4/24 + 3v2 - 2v. Let y(l) be the first derivative of s(l). Calculate y(t(z)). 2z2 Let z(t) = -7t. Suppose 0 = -h + 3m + 14, 4h + 1 + 7 = -4m. Let q(v) = -13v + 13v - hv*2. Determine q(z(n)). -98n*2 Let s(t) be the third derivative of -7t*4/6 + 41t*2. Let a(i) = -3i*2. Give s(a(x)). 84x*2 Let i(l) = -3l*2 - 1. Let j(m) = 6m*2. Determine i(j(n)). -108n*4 - 1 Suppose -3f + 45 = 2f. Let d(h) = -9 - 15h - 4 + 13. Let b(r) = -8r. Let g(c) = fb(c) - 5d(c). Let z(w) = w. What is z(g(u))? 3u Let w(z) = 1970z2. Let p(r) = -8r*2. Calculate p(w(k)). -31047200k*4 Let l(v) = 25v. Let m(k) = -60k. Determine l(m(f)). -1500f Let g(i) = -1. Let o(p) = -6p2 + 15. Let n(m) = 15g(m) + o(m). Let u(j) = 9j2. Determine u(n(s)). 324s*4 Let d(c) = 8c*2. Let g(n) = -5n*2 + 9n + 9. Let v(b) = b*2 - 2b - 2. Let s(u) = 4g(u) + 18v(u). Give s(d(q)). -128q4 Let h(t) be the first derivative of -2t*3/3 + 12. Let r(c) = 23c. Give r(h(y)). -46y2 Let i(y) = 3y2 + 4. Let m(s) = -s2 - 1. Let t(p) = -i(p) - 4m(p). Let r(g) = 41g. Give r(t(v)). 41v2 Let l(h) = h. Let z(d) = -1. Let q(o) = -6. Let a(i) = 3q(i) - 15z(i). Let b = 18 - 14. Let k(f) = -f2 + 4. Let u(t) = ba(t) + 3k(t). Give u(l(p)). -3p*2 Let q(j) = -12j*2. Let d(h) = 2h - 17. Determine q(d(g)). -48g2 + 816g - 3468 Let t(j) = 25j2. Let h(u) = 5u. Determine t(h(x)). 625x2 Let z(j) be the first derivative of 2j*3/3 + 1. Let a(s) be the second derivative of -1/4s*4 + 0s*3 + 4s + 0s2 + 0. Give z(a(y)). 18y*4 Let v(s) = -24s*2 + 2. Let x(u) = 8u*2 - 3. Give x(v(q)). 4608q*4 - 768q*2 + 29 Let c(k) = k. Let a(u) = 1234u. Give a(c(s)). 1234s Let v(b) = -4b2 + b2 - 4b2. Let p(t) be the second derivative of t3/6 + 21t. What is v(p(o))? -7o2 Let l(z) = 5z*2. Let b = 38 + -36. Let a(v) be the first derivative of b + 0v*2 + 0v - 1/3v3. Calculate l(a(q)). 5q*4 Let q be 8/3(-9)/(-6). Suppose -4y - y + qj + 4 = 0, 4j = 3y + 4. Let s(v) = 2v2 + yv*2 + 2v*2 - 5v*2. Let c(p) = -3p. Give s(c(w)). 27w2 Let c(t) = t2. Let m(k) = -208 + 208 + 9k. What is c(m(q))? 81q2 Let x(u) = 4u*2. Suppose -2c - c + 4z + 6 = 0, 4c = 5z + 8. Let f(a) = a2 + ac - 2a2 - a2. Calculate f(x(l)). -16l4 Let a(g) = -5g. Let n be a(-1). Let s(b) = 5 + 5b - n + 0b. Let r(h) = -h. Calculate r(s(p)). -5p Let k(q) be the second derivative of q3/2 + 25q. Let t(x) = -12x2. What is t(k(n))? -108n*2 Let h(c) = -2c. Let n(i) = -530i. Calculate h(n(d)). 1060d Let h(n) = -n - 17. Let a(z) = 10z2 + z. What is h(a(r))? -10r2 - r - 17 Let o(x) = x2. Let q(n) be the first derivative of 2n2 + n2 - 10 + 0. What is o(q(p))? 36p*2 Let n(a) = -a. Let v(f) = 7f + 5f - 3f - 2f. Give n(v(d)). -7d Let x(i) = i. Let c(z) = -z + 5. Suppose -3p = -4s - 27, 2s + 0s + 26 = 4p. Let b(h) = h - 4. Let j(f) = pb(f) + 4c(f). Determine x(j(d)). d Let j(m) = -2m. Let a(d) = -14d2 + 24d*2 - 15d*2. Calculate a(j(n)). -20n*2 Let c(p) be the third derivative of 3p*2 + 0 + 0p*3 - 1/24p*4 + 0p. Let d(g) = g2. Calculate c(d(n)). -n2 Let n(r) = -2r2 - 5r. Let f(g) = g*2 + 3g. Let k(j) = 5f(j) + 3n(j). Let p(q) be the first derivative of -5q2/2 - 4. Give p(k(s)). 5s2 Let c(h) be the second derivative of -h4/6 - 3h. Let m(g) = 2g*2. Give m(c(f)). 8f*4 Let q(o) = -5o - 2. Let d(p) = -119p - 49. Let t(f) = -2d(f) + 49q(f). Let l(v) = -12 + 2v*2 + 0v*2 + 10 + 2. Give t(l(n)). -14n**2 Let s(f) be the t	{ "pile_set_name": "DM Mathematics" }
2g + 6 = 3g. Suppose 2k + k + i = -19, 2k - i + g = 0. Let y = -3 - k. Give d(y). 4 Suppose v + 2v = 15. Let c(j) = 2j - 3. Determine c(v). 7 Let w(s) = 3s - 2s + 2s - s + 6. Calculate w(5). 16 Let c be 4/(-3)(-3)/2. Let z(g) = -5g - 3 + gc - 2g*2 - 2. What is z(-4)? -1 Let m(k) = 4k + k - k - 3k + 4. What is m(-5)? -1 Let x(j) be the third derivative of -j9/30240 - j5/12 - j2. Let l(r) be the third derivative of x(r). Calculate l(1). -2 Let m(x) be the third derivative of -x6/120 + x4/24 - x3/3 - 29x*2. Suppose o + 3o = 0. What is m(o)? -2 Let b(g) = -g*3 + 7g*2 - 4g - 6. Let h be b(6). Let l(y) = -hy2 - 3y + 3 - 5y + 5y*2 + 4y. Give l(-5). -2 Let y(l) be the second derivative of -l4/6 - l3 - 2l2 + 2l. Suppose 3p = -p - 16. Calculate y(p). -12 Let y(t) be the first derivative of t4/4 + 4t3/3 + t2 - t - 28. Suppose -3q = -6q - 12. Calculate y(q). -9 Let o(f) = 7f3 - 3f*2 + 4f - 3. Let c(d) = -11d3 + 4d*2 - 6d + 4. Let x(p) = p*2 + 2p - 7. Let a be x(-5). Let n(y) = ao(y) + 5c(y). Give n(4). 4 Let z(x) = x*2 - 7x + 6. Let a(v) = v*2 - 2v - 1. Let q be a(4). Let w = q - 3. What is z(w)? -6 Let f(a) = a + 5. Let k(v) = v - 14. Let y(w) = w*3 + 6w*2 + 6w + 2. Let l(n) = n*2 + 6n + 4. Let m be l(-4). Let h be y(m). Let g be k(h). Give f(g). 1 Let g(d) be the second derivative of d*5/5 + 37d. What is g(-1)? -4 Suppose -4g - 4k = 5 - 49, 3g - 4k + 2 = 0. Let i(u) = 3u + 7. Let d(a) = 10a + 22. Let l(v) = -2d(v) + 7i(v). Give l(g). 11 Let k(u) = -3u2 - 2u. Let s(w) be the third derivative of -w5/30 - w4/24 - 3w2. Let q(z) = -3k(z) + 5s(z). What is q(3)? -6 Let g be (-6)/44/3. Let z(b) be the third derivative of 1/3b3 + 2b*2 - 1/30b*5 + 0 + 0b*4 + 0b. Calculate z(g). -6 Let s = -1 + 3. Let g(t) = -t + 1. Let c(u) = -u + 2. Let k(q) = -c(q) + 5g(q). Calculate k(s). -5 Let k(v) = v2 - 5v - 10. Let d be k(7). Suppose 0 = di - i + 12. Let m(f) = -2f. Calculate m(i). 8 Let n(q) be the second derivative of -q7/840 - q6/72 + q5/20 - q4/6 - 4q3/3 + 4q. Let w(r) be the second derivative of n(r). Calculate w(-6). -4 Let q(l) = -l*3 + 4l*2 + 2l - 1. Suppose 3b - 10 = 2j - j, 2j + 4 = -2b. Determine q(b). 11 Let w = 2 - 0. Let f be w - 5/((-15)/6). Suppose -2o = -f - 4. Let a(s) = s3 - 4s2 - s - 2. Calculate a(o). -6 Let i = 15 - 10. Let j = 0 + i. Let l(y) = -y2 + 6y. Determine l(j). 5 Let u(o) = -o2 - 3o - 2. Let z = 168 + -171. Determine u(z). -2 Suppose w + 15 = 6w, 2w - 9 = -3x. Let g(y) = 10y2 + 1. Determine g(x). 11 Let i(r) be the second derivative of r5/60 - r4/8 - r3/2 + r*2/2 - r. Let p(w) be the first derivative of i(w). Calculate p(-2). 7 Let i(g) = 5g - 1. Let k(j) = -5j + 1. Let r(n) = -5i(n) - 4k(n). Determine r(4). -19 Let p(h) be the second derivative of -h3/6 - h2/2 + h. Suppose -3r = 9 - 0. Let w be p(r). Let c(l) = l*2 + l - 2. Give c(w). 4 Suppose -2y + 3a + 21 + 13 = 0, -2a + 36 = 4y. Let w be 2/y + (-2)/11. Let t(h) = h2 + h - 9. Give t(w). -9 Let o be 0/(-1)(-1 - 0). Let l(g) be the second derivative of -g4/12 + g3/6 - 3g2/2 - 69g. Calculate l(o). -3 Let f(n) = -n*3 - 7n*2 - 8n - 5. Let o be -6(-3)/(-6) + 6. Suppose -c + 2 + o = 0. Suppose 3z - ci + 1 = -2, -21 = 2z + 3i. What is f(z)? 7 Let w(d) = d2 - 8d + 3. Let u be w(7). Let z(i) be the first derivative of -i*2 - 3i - 9. Give z(u). 5 Let b = 14 - 18. Let c(j) = -j*2 - 7j - 3. Calculate c(b). 9 Let r(g) = g*2 + 10g - 11. Let k be r(-11). Suppose kj - 20 = -5j. Let w(v) = 2v2 - 6v + 1. Give w(j). 9 Let g(x) = -x*2 + 0x - 2x + 2 + 5x + 2x. Give g(5). 2 Let o(q) = 11q + 6. Let i(n) = 24n + 13. Let j(s) = -6i(s) + 13o(s). Let k be (-4)/14 + (-47)/7. What is j(k)? 7 Suppose 15 = 5u - k, -4k - 12 - 14 = -3u. Let d(w) = 2w - 4w*u - 2w*2 + 0 + 8 + 0w2 - w3. Calculate d(-6). -4 Let v(l) be the first derivative of -5l2 + 2l + 49. Determine v(2). -18 Let q(t) = -4t + 10t - 1 + 2 - 2. Give q(-2). -13 Let y(i) = -3i - i3 + 7i + 5i + 17i*2 - 5 - 23i2. Determine y(-7). -19 Let w(q) = q2 - 3q - 4. Let c be 1 + (-1 + -2)/(-1). Calculate w(c). 0 Let w(k) = -k2 - 5k - 2. Let t = 8 + -21. Let d = -10 - -18. Let c = d + t. Determine w(c). -2 Let w(c) = -2c. Let v(a) be the first derivative of 3a*2/2 + a - 5. Let q(r) = 3v(r) + 4w(r). Calculate q(6). 9 Let m(i) be the second derivative of -7i3/6 - i2/2 + i. Let u(a) = -6a - 1. Let p(g) = -5m(g) + 6u(g). Calculate p(-5). 4 Let z(s) = -3 + s + 0 + s3 - 3 + 0. What is z(0)? -6 Let i(t) = -t3 + 5t*2 + 6. Suppose 5s = -0s + 155. Let z = s - 26. Give i(z). 6 Let q(j) = 4j + 3. Let h(s) = 2 + 2s + 3s - 2s. Let b(z) = -5h(z) + 4q(z). Calculate b(6). 8 Let x(a) = 2a*2 - 2a - 1. Let q(z) = 3z2 - z - 2. Let d be ((-6)/4)/((-5)/(-10)). Let l(o) = dq(o) + 4x(o). Determine l(-5). 2 Let m(b) be the second derivative of -b3/6 - b2/2 - 17b. Let q(t) = -2 - 2 - 7t - 6. Let a(v) = 6m(v) - q(v). Determine a(-5). -1 Let k(n) be the first derivative of 2n2 + n - 45. Determine k(-2). -7 Let g(y) = y. Suppose 5p - 4p + d = 4, 5p + 20 = 5d. Suppose -5r + 4n + 20 = -pr, -3r = -2n - 10. What is g(r)? 0 Let c = 42 + -42. Let q(x) = -x + 5. Give q(c). 5 Let k(v) be the first derivative of v6/12 + v5/60 - v*3/6 + 3v*2/2 - 3. Let u(r) be the second derivative of k(r). Calculate u(-1). -10 Let t(y) = -5y*2 - 23y + 20. Let o(r) = r*3 + 4r*2 - 7r - 7. Let s be o(-5). Let n(u) = 2u2 + 8u - 7. Let v(w) = st(w) + 8n(w). Determine v(4). 0 Let a(d) = d*3 + 4d*2 + d + 2. Let i(j) = 11j*2 + 1. Let c be i(1). Let k = -18 + c. Let g be (3/1)/(k/8). Determine a(g). -2 Let g(h) = 7h - 6. Let n(m) = 15m - 13. Let s(w) = 13g(w) - 6n(w). Give s(1). 1 Let p(f) = -f3 + 4f*2 + 2f - 1. Let h be p(4). Let s(j) = j*2 - 9j + 7. Determine s(h). -7 Suppose 2q = -3q - 15. Suppose 6n + 16 = 10n. Let s(g) = 0g2 + g3 + 1 + 2g*2 + 3g*2 + ng. What is s(q)? 7 Let v(m) = 6m - 2 + 3m - m - 6m - m2. Give v(2). -2 Suppose -15 = 2k + 1. Let r = k - -4. Let w(d) = -d + 1. Let t(u) = -8u + 2. Let l(j) = t(j) - 6w(j). Give l(r). 4 Let q(l) = -l + 7. Let n = -2 - -4. Let o be 1 + (n + -1 - -3). Give q(o). 2 Let m(j) = 3j + 12. Let s = -176 + 167. Give m(s). -15 Let c(a) be the first derivative of a4/4 - 2a*3/3 - 3a*2/2 + 3a - 65. Determine c(2). -3 Let b = -12 + 6. Let j = b + 12. Let l be -1-10(-3)/j. Let n(t) = t*3 + 4t*2 - 6t + 1. Calculate n(l). 6 Let x(s) be the first derivative of 4s2 - 1. Suppose -5h - 13 = -5z + 12, 4z = 5h + 21. Determine x(h). -8 Let t(w) = 2w*2 - 1 + 3w + 2w2 - w3 + 0 - 6w*2. Suppose -m = 4x, -x - 2m = 3x. Suppose x = -s - 3. Determine t(s). -1 Suppose 3w - 2g - 26 = 0, 0w + 4g - 4 = -w. Suppose -6m + m + y - w = 0, 5y + 6 = 2m. Let c(h) = 2h - 1. What is c(m)? -5 Let a(q) = q*3 + 6q*2 + 2q + 2. Let n be a(-5). Suppose nj = 12j - 15. Let w(s) = s*3 + 3s*2 + 3s + 4. Determine w(j). -5 Let p(j) = -2j + 5j*2 + 0j - 4j2 + 7 + 9j. Determine p(-5). -3 Suppose -2m - 4v = 8, -2m + 2v = -6m - 4. Let f(k) = -k - 3k*2 + 4k2 - 2 + k3 - 2k3. What is f(m)? -2 Let g(m) = 4m*2 - 4m + 2. Let n be g(2). Let q be n(13/5 + -2). Let x(b) = -2b - 2b - b - 1 + qb. Give x(2). 1 Let k(w) = -5w2 - w + 1. Let x = 4 - 2. Suppose xb - 5g - 11 = 11, 3b - 3g - 15 = 0. Give k(b). -5 Let w(i) = -i + 1. Let g(m) = m3 + 6m*2 - 4m + 23. Let v be g(-7). Calculate w(v). -1 Let c(j) = j + 8j2 - 2j3 + j3 + 4 - 6j2. What is c(3)? -2 Suppose 6i = 3i - 6, 3 = j + 2i. Let c(h) = -4 + h*2 + 6h - jh - 4h. Determine c(3). -10 Suppose -3i = -8t + 3t - 10, 0 = -2i - 4t - 8. Let f(w) = iw - 6 - 3w2 + 1 - 4w + 2w2. Suppose 0 = -3p - 0p - 15. Calculate f(p). -10 Let f(b) = -b3 - 3b*2 + 3b - 1. Let q be f(-4). Let s be 4/(-12) - (-19)/q. Let n(u) = -u*2 + 6u - 5. What is n(s)? -5 Let v(m) = -m*3 + 9m*2 + 5m - 10. Let o(s) = -3s3 + 26s*2 + 14s - 29. Let l(w) = -4o(w) + 11v(w). Give l(5). 1 Let t(i) = -4*i + 1. Let s be t(-1). Let x(o)	{ "pile_set_name": "DM Mathematics" }
of 17 - ul + 7l*3 - 17 wrt l. 42l Let k(n) be the first derivative of 9n2 - 1/2n*4 + 0n*3 - 29n + 10. Find the first derivative of k(p) wrt p. -6p2 + 18 Let q(m) be the second derivative of 3m*7/70 - 13m*3/6 + 5m*2/2 + 26m. Let i(j) be the first derivative of q(j). Differentiate i(f) wrt f. 36f3 Let x be (24/9)/(40/(-12) - -4). Suppose -2w = w - 15. What is the second derivative of -wa - 5a + xa + 6a*5 wrt a? 120a*3 What is the third derivative of -24q - 322q2 - 4q + 18q5 + 31q*5 + 28q wrt q? 2940q2 Let s(d) = d + 1. Suppose -3 = -x - 2. Let o(a) = -8a + 5. Let g(p) = xo(p) + s(p). Differentiate g(k) with respect to k. -7 Let q(x) be the second derivative of -x7/21 - 7x*4 + 7x*3/6 - 5x - 14. What is the second derivative of q(n) wrt n? -40n3 - 168 Let n(i) = -2i*2 - 12i - 5. Suppose 3r = -23 + 8. Let c be n(r). What is the third derivative of -1 - cj*2 - 5j*4 + 1 + 0j*2 wrt j? -120j Let s(u) be the third derivative of u8/336 - u5/30 - 7u3/3 - 15u*2 - 4u. Find the third derivative of s(l) wrt l. 60l2 Let m = -40 + 42. What is the first derivative of m - 31b - 1 + 48b wrt b? 17 Let p(w) = -w3 - 9w*2 + 10w - 5. Let q be p(-10). Let g be q/2(-12)/15. What is the derivative of 5sg + 0 - 2 - s2 + 3s2 wrt s? 14s Suppose 3g - 3n = 81, -11g + 12g + 2n = 12. What is the first derivative of g + 4r - 9r - r wrt r? -6 Let k(b) be the second derivative of b7/21 + 3b*5/4 + 41b4/12 - b3/6 - 2b - 15. What is the third derivative of k(t) wrt t? 120t*2 + 90 Let j(d) = -205d*3 - 42d*2 - 14d - 2. Let f(x) = -102x3 - 21x*2 - 8x - 1. Let m(t) = -7f(t) + 4j(t). Find the third derivative of m(g) wrt g. -636 Let f(c) be the first derivative of 17c4/12 - 2c*3/3 - 18c + 15. Let y(l) be the first derivative of f(l). What is the second derivative of y(r) wrt r? 34 Let t(p) = -25p - 31. Let w(l) = 12l + 16. Let n be (-13)/3 - (-16)/(-24). Let f(h) = nw(h) - 2t(h). What is the derivative of f(x) wrt x? -10 Let i(h) be the first derivative of 12h4 - 2h*3/3 + 55h*2 + 89. What is the second derivative of i(y) wrt y? 288y - 4 Let o(j) be the second derivative of 0 - 14j + 1/6j*3 + 1/2j*2. Differentiate o(q) wrt q. 1 Let o(t) be the third derivative of -3t6/40 + t5/10 - 38t3/3 + 27t*2. Differentiate o(w) wrt w. -27w*2 + 12w Let s(a) = 2a + 6a*2 + 6a*2 + 2 + 19 + 10a*2. Let q(j) = -22j*2 - 3j - 22. Let u(m) = 2q(m) + 3s(m). Differentiate u(w) wrt w. 44w Let s be (-21)/3(-12)/14. Let x be 7 + (-1)/(-6 - -5). Find the third derivative of -17ds + 7d6 + d6 + xd2 + 10d*6 wrt d. 120d*3 Let a be (-1 + 3/9)9. Let l be a/8 - (-286)/8. What is the second derivative of -5r - 11r*3 - 35 + l wrt r? -66r Let m(w) = 5w - 7. Let u(o) = -4o + 7. Let q(p) = 3m(p) + 4u(p). Let x be q(4). Find the second derivative of -7s + 0s*2 - 4s - 3s2 + xs wrt s. -6 Let v(w) be the first derivative of -w6/18 - w4/12 + 19w3/3 - 2. Let i(m) be the third derivative of v(m). Differentiate i(f) with respect to f. -40f Let j(r) be the second derivative of 0r4 + 0r*2 + 0 - 8r + 3/20r5 - 11/6r*3. What is the second derivative of j(g) wrt g? 18g Let t(v) = v*2 - 19v - 18. Let q be t(20). What is the second derivative of -4g - 225g*2 + 225g*q + 13g*4 wrt g? 156g*2 Let d be (-6)/4 + (-54)/(-12). Let b be d/(3 - 4 - -2). Find the third derivative of -9z*2 - 10z*b + 3z*3 - 2z*3 wrt z. -54 What is the first derivative of 59r*2 - 769 - 821 - 11r*2 + 1680 wrt r? 96r What is the second derivative of -6g2 - 11g*2 - 1 - 17g + 6g2 - 3g wrt g? -22 What is the third derivative of -f*3 + 57f*2 + 125f*2 + 284f*2 + 14f*5 wrt f? 840f*2 - 6 Suppose -12 - 24 = -6y. Differentiate 2 + 10 + 7c4 - 2c*4 + yc*4 wrt c. 44c*3 Let p(s) = -3s*2 - 2. Let k(c) = 221c*2 - 275. Let y(x) = k(x) - 3p(x). Differentiate y(z) wrt z. 460z Let d(u) = 15u*3 + 609u. Let k(s) = -3s3 - 122s. Let p(o) = -2d(o) - 11k(o). Find the second derivative of p(y) wrt y. 18y Let x(p) = -68p*3 - 3p*2 - 139. Let q(l) = -137l*3 - 5l*2 - 276. Let y(h) = -3q(h) + 5x(h). What is the derivative of y(b) wrt b? 213b*2 Let q be 18/(2/1) - -1. Suppose -5a = 4u - 2u - 3, 0 = 2u - 2a - q. Find the first derivative of 2 - 6su - 7 + 0s*4 wrt s. -24s*3 Let m be (4/5)/(8 + (-195)/25). Find the second derivative of 6 + mq*5 + 4 + 11q - 10 wrt q. 80q3 Let a(t) be the second derivative of -122t*3/3 - 443t*2/2 + 596t. What is the first derivative of a(f) wrt f? -244 Suppose 103 = -7r + 103. Let q(f) be the third derivative of rf + 8f2 + 0 + 13/24f*4 + 4/3f*3. What is the first derivative of q(p) wrt p? 13 Let g(p) = 5p*4 + 6p*3 + 3p - 47. Let r(h) = -9h4 - 13h*3 - 7h + 95. Let q(u) = -7g(u) - 3r(u). What is the derivative of q(w) wrt w? -32w3 - 9w*2 Let d(m) = 22m*3 - 3m*2 + 38. Let p(f) = 43f*3 - 5f*2 + 77. Let l = -35 + 32. Let k(a) = lp(a) + 5d(a). What is the derivative of k(c) wrt c? -57c*2 Suppose -2b + 2l = -6, 2l = 5l + 3. Find the third derivative of -8v + 9v - 4v*2 - 27v*3 + 11v*b + 2v wrt v. -162 Let p(r) = r3 - r2 - r + 7. Let d be p(0). Let q = 9 - d. What is the second derivative of w*3 + qw*2 + 0w - 2w2 + 5w wrt w? 6w Let o(j) = 37j*3 - 4j*2 + 25j - 4. Let m(p) = -112p3 + 11p*2 - 76p + 11. Let v(k) = -4m(k) - 11o(k). Find the second derivative of v(z) wrt z. 246z Let w(a) = 28a - 1. Let d(n) = -16n + 1. Let z(k) = -9d(k) - 4w(k). What is the first derivative of z(g) wrt g? 32 Suppose 11v - 60 = 6v. What is the second derivative of -13c*2 - 8c + 20c + c + vc wrt c? -26 Let q(r) be the first derivative of -289r4/4 + r3/3 + r2/2 + 18r + 132. Find the second derivative of q(n) wrt n. -1734n + 2 Let b be (18 - 7) + -1 + 1. Find the second derivative of -7w - w + bw + 18w*2 - 2w wrt w. 36 Let g(h) = -228h + 40. Let d(w) = -114w + 30. Let m(a) = -7d(a) + 4g(a). What is the first derivative of m(z) wrt z? -114 Let w(m) = 149m2 + 20m + 1. Let n(p) = -148p2 - 21p - 1. Let z(v) = -5n(v) - 6w(v). What is the second derivative of z(o) wrt o? -308 Let y(n) be the first derivative of -16/3n3 + 5/6n*6 + 0n*2 + 0n + 0n4 + 0n*5 + 12. Find the third derivative of y(u) wrt u. 300u*2 Let o = 262 - 258. Let p(f) be the second derivative of 1/6f*o - 5/2f*2 + f + 0 + 0f*3. Differentiate p(w) wrt w. 4w Let h(i) be the first derivative of -133i6/3 - 122i*3 + 229. Find the third derivative of h(b) wrt b. -15960b*2 Find the third derivative of 51v*3 - 25v*2 + 1497 - 1497 wrt v. 306 Let l(r) = 121r + 54. Let m(h) = -121h - 53. Let b(x) = -4l(x) - 3m(x). Find the first derivative of b(g) wrt g. -121 Let t(a) be the first derivative of 3a*6/5 + 7a*3/3 - 19a - 12. Let y(h) be the first derivative of t(h). Find the second derivative of y(g) wrt g. 216g2 Let j(v) = -v5 - v4 - v3 + 1. Let r(b) = 4b5 + b4 + b*3 - b - 3. Let u(x) = -2j(x) - 2r(x). Find the second derivative of u(o) wrt o. -120o3 Let w(f) = f3 + 5f2. Let z be w(-5). Let a(n) = n2 - n + 2. Let y be a(z). What is the second derivative of 3m - 8m + 3m + ym2 wrt m? 4 Let k(x) be the third derivative of -x7/70 - x4/3 - 65x*3/6 - 33x*2 + x. Find the first derivative of k(l) wrt l. -12l*3 - 8 Suppose -q + 0r + 14 = 2r, 0 = -q - 4r + 12. Find the first derivative of 16 - 13 + k + q + 14k wrt k. 15 Let a(u) be the second derivative of 17u*5/4 - 3u*2 - 22u + 1. What is the derivative of a(d) wrt d? 255d2 Let d(w) be the second derivative of 0 - 6w*2 + 1/3w*4 + 0w*3 + 7w. Differentiate d(b) wrt b. 8b Find the second derivative of -26 + 12o2 + o + o2 - 3o5 + 5 + 36o*2 wrt o. -60o*3 + 98 Let m(w) be the first derivative of -88w*5/5 - 22w*3/3 + 66. What is the third derivative of m(l) wrt l? -2112l Let z(m) be the second derivative of -m*6/6 - 7m4/12 + m3/6 - 28m2 - 113m. Find the second derivative of z(u) wrt u. -60u2 - 14 Let y(q) be the third derivative of 41/6q*3 + 0q**5	{ "pile_set_name": "DM Mathematics" }
ob of picking 1 g and 1 y when two letters picked without replacement from {t: 1, y: 3, a: 4, h: 2, o: 1, g: 1}. 1/22 Calculate prob of picking 2 t and 1 s when three letters picked without replacement from ttst. 3/4 Calculate prob of picking 2 k when two letters picked without replacement from oukkuuoupkzukp. 6/91 Three letters picked without replacement from qeeeveq. What is prob of picking 1 e and 2 q? 4/35 Two letters picked without replacement from {a: 6, l: 2}. Give prob of picking 2 l. 1/28 Two letters picked without replacement from vixtxvv. What is prob of picking 2 v? 1/7 Four letters picked without replacement from {z: 6, n: 13}. Give prob of picking 4 z. 5/1292 Two letters picked without replacement from {q: 1, r: 1, l: 1, d: 2, s: 2, u: 1}. Give prob of picking 1 u and 1 s. 1/14 Calculate prob of picking 1 p and 1 t when two letters picked without replacement from {i: 3, p: 2, a: 2, z: 3, k: 1, t: 1}. 1/33 Two letters picked without replacement from {e: 1, s: 2, c: 2, u: 1}. What is prob of picking 2 s? 1/15 Four letters picked without replacement from mgaggjxgtmtgmaagjg. What is prob of picking 2 t and 2 m? 1/1020 Calculate prob of picking 2 o when two letters picked without replacement from {s: 3, w: 4, j: 9, o: 2}. 1/153 Calculate prob of picking 2 u and 1 f when three letters picked without replacement from {f: 2, u: 2, s: 6, m: 6, i: 1}. 1/340 Four letters picked without replacement from dlldaadrllrrdllllll. What is prob of picking 1 a, 1 d, and 2 r? 2/323 Two letters picked without replacement from {e: 4, s: 2, y: 6}. Give prob of picking 2 s. 1/66 Two letters picked without replacement from {s: 2, l: 2, r: 1, y: 1, n: 4}. What is prob of picking 1 l and 1 r? 2/45 Three letters picked without replacement from {k: 5, u: 3, y: 1}. Give prob of picking 1 u and 2 k. 5/14 Three letters picked without replacement from eghtggghgkegtek. Give prob of picking 2 h and 1 t. 2/455 Two letters picked without replacement from zyyezeyezeyyzyz. What is prob of picking 1 z and 1 y? 2/7 Two letters picked without replacement from eppzphzmzm. Give prob of picking 1 z and 1 m. 2/15 Three letters picked without replacement from vmvjvvvmssvmivmvm. What is prob of picking 1 v and 2 s? 1/85 What is prob of picking 1 m and 1 d when two letters picked without replacement from {m: 1, d: 1, s: 1, z: 3, y: 6}? 1/66 What is prob of picking 1 r and 1 l when two letters picked without replacement from leler? 1/5 Three letters picked without replacement from qvqvv. Give prob of picking 3 v. 1/10 Two letters picked without replacement from bbbbbibbiiibbiibbb. Give prob of picking 2 i. 5/51 Calculate prob of picking 1 l, 1 c, and 1 j when three letters picked without replacement from {l: 1, g: 4, j: 1, c: 6, i: 2, m: 4}. 1/136 What is prob of picking 1 b, 1 j, and 2 o when four letters picked without replacement from {o: 1, b: 3, j: 1}? 0 Three letters picked without replacement from osggoon. Give prob of picking 1 o and 2 g. 3/35 Two letters picked without replacement from {h: 1, t: 6, v: 2, f: 5, l: 2}. What is prob of picking 1 t and 1 f? 1/4 Two letters picked without replacement from aaaaaooaa. What is prob of picking 2 o? 1/36 Two letters picked without replacement from vcvvvchvvsvovso. Give prob of picking 1 c and 1 o. 4/105 Two letters picked without replacement from rhrharqlrhhrrhhahgrh. What is prob of picking 1 r and 1 l? 7/190 Two letters picked without replacement from {n: 1, s: 2, a: 2, k: 8, c: 1, l: 3}. What is prob of picking 1 k and 1 s? 2/17 Calculate prob of picking 2 g and 2 q when four letters picked without replacement from {q: 8, g: 2}. 2/15 Calculate prob of picking 2 v and 1 j when three letters picked without replacement from jjjvjjjjvjjjvj. 33/364 Calculate prob of picking 3 w when three letters picked without replacement from uuuwuuwuuuwpuwuwuu. 5/408 Calculate prob of picking 1 l and 1 g when two letters picked without replacement from gllxxblylyggylyvyx. 5/51 Three letters picked without replacement from {z: 1, c: 2, x: 1, o: 2, n: 2, f: 1}. What is prob of picking 1 n and 2 z? 0 Calculate prob of picking 1 v, 1 m, and 1 g when three letters picked without replacement from {v: 2, m: 1, g: 1}. 1/2 Three letters picked without replacement from {e: 1, y: 4, h: 4, r: 7, g: 2}. Give prob of picking 1 e and 2 r. 7/272 What is prob of picking 1 x, 1 j, 1 l, and 1 d when four letters picked without replacement from {l: 1, p: 2, s: 1, d: 5, j: 3, x: 1}? 3/143 Two letters picked without replacement from yyyyyyy. What is prob of picking 2 y? 1 Calculate prob of picking 2 w and 2 r when four letters picked without replacement from mmrormrmwworomm. 2/455 Three letters picked without replacement from gbbnjjjjjgjjjjjjjgj. Give prob of picking 1 n, 1 g, and 1 j. 13/323 What is prob of picking 1 n and 3 z when four letters picked without replacement from zzznzzzzznznznnz? 165/364 Calculate prob of picking 1 r and 1 k when two letters picked without replacement from {r: 3, s: 2, k: 4, b: 6}. 4/35 Calculate prob of picking 3 r and 1 n when four letters picked without replacement from {r: 5, k: 1, n: 1, b: 3}. 1/21 What is prob of picking 1 f and 2 t when three letters picked without replacement from {w: 3, r: 6, t: 8, f: 2}? 56/969 Two letters picked without replacement from {m: 6, r: 1, p: 11}. Give prob of picking 2 m. 5/51 Calculate prob of picking 2 u, 1 o, and 1 b when four letters picked without replacement from {q: 1, o: 1, u: 2, b: 1, r: 2}. 1/35 Two letters picked without replacement from {v: 1, w: 1, g: 1, s: 1, c: 5, y: 10}. What is prob of picking 1 v and 1 y? 10/171 What is prob of picking 1 q and 1 c when two letters picked without replacement from qqjzcqjzzq? 4/45 Three letters picked without replacement from gtpptpgoioottp. What is prob of picking 1 g and 2 t? 3/91 Three letters picked without replacement from jwmhwwehmmmhwwjwmww. What is prob of picking 2 j and 1 h? 1/323 Two letters picked without replacement from uuauuuaauuuuuaauaua. What is prob of picking 2 u? 22/57 Two letters picked without replacement from {z: 2, i: 4, f: 1}. Give prob of picking 1 z and 1 f. 2/21 Three letters picked without replacement from llxxungxxlxxujxuugun. Give prob of picking 1 g, 1 j, and 1 n. 1/285 Two letters picked without replacement from eewcxgg. What is prob of picking 1 e and 1 x? 2/21 What is prob of picking 1 q and 1 h when two letters picked without replacement from {q: 5, h: 1, l: 1, o: 2, f: 2, u: 4}? 1/21 Four letters picked without replacement from ghuhhhuhheug. What is prob of picking 1 g, 2 h, and 1 u? 2/11 Three letters picked without replacement from tiitttitiiiti. What is prob of picking 2 t and 1 i? 105/286 Two letters picked without replacement from {y: 1, w: 2}. What is prob of picking 1 w and 1 y? 2/3 Two letters picked without replacement from {a: 1, j: 1, r: 2, k: 3, z: 4}. Give prob of picking 2 z. 6/55 Three letters picked without replacement from naxaaranaxan. Give prob of picking 2 x and 1 a. 3/110 Calculate prob of picking 1 p and 1 u when two letters picked without replacement from {j: 5, p: 11, u: 1}. 11/136 Four letters picked without replacement from {h: 11, q: 2, b: 1, t: 5}. What is prob of picking 2 q and 2 h? 55/3876 Three letters picked without replacement from {b: 1, v: 1, g: 2}. What is prob of picking 2 g and 1 v? 1/4 Three letters picked without replacement from {w: 7, k: 7, g: 4}. What is prob of picking 1 g, 1 w, and 1 k? 49/204 Calculate prob of picking 4 m when four letters picked without replacement from {a: 1, m: 14}. 11/15 Calculate prob of picking 2 g and 1 d when three letters picked without replacement from {d: 5, g: 8, q: 3}. 1/4 Two letters picked without replacement from {u: 1, q: 1, o: 1, c: 1, v: 1}. Give prob of picking 1 o and 1 u. 1/10 Three letters picked without replacement from mmhwalxha. What is prob of picking 1 m, 1 x, and 1 h? 1/21 Three letters picked without replacement from ffbpfffsfspfbbp. Give prob of picking 2 f and 1 s. 6/65 Calculate prob of picking 1 t and 1 r when two letters picked without replacement from {h: 4, r: 1, w: 1, v: 2, t: 1}. 1/36 Four letters picked without replacement from lppxxlxllplppxlllx. Give prob of picking 3 x and 1 p. 5/306 Two letters picked w	{ "pile_set_name": "DM Mathematics" }
w)((-2 - 1 - 2)(4w - 3w + 0w) - 1 + 2w + 0 + 3). 9w2 - 6w Expand (0x + 11x + 3x)(16x4 + 7x*4 - 7x*4) + (-x - 1 + 1)(5x2 - 2x*4 - 5x*2). 226x*5 Expand (8f*2 - 5f*2 + 2f*2)(31 + 5 + 48 - 7). 385f2 Expand (2 - 5 + 2)(0 - 1 - 1)(2o*3 + 0o*3 + 29o - 2 + 3). 4o3 + 58o + 2 Expand 0g5 + g5 - 4g*5 + (8g*2 - 8g*2 - 4g*4)(-g + 3 - 2g - 5). 9g*5 + 8g*4 Expand (-2 + t + 2)(4 - t*3 - 4) - 3t - 1708t4 + 3t - 268t4. -1977t*4 Expand (-4k + 0k + 3k)(0k*2 - 9k*2 - 4k*2 + (6k + 4k - 3k)(2k + 3k - 4k)). 6k3 Expand (2k + 0k - 5k)(-2 + 1 + 0) - 2k - 2k - k + (-2k - 1 + 1)(-5 + 1 + 2) + 3 + 2k - 3. 4k Expand (0 + 2 - 5)(-1 + 3g + 1 + (6 - 6 + 2g)(1 + 3 - 1)). -27g Expand (-t*2 + 1 - 1)(2 + 1 + 2) - 4t2 + 0t*2 + 3t*2 + 2t2 + t - t + t - t2 - t + (2 + 2t - 2)(6t - 3t - t). -t*2 Expand (3 + 0 - 1)(-2q3 + 3q3 + q3 + (q2 - q2 + q*2)(-q + 6q - 3q)). 8q3 Expand (-2 - 2 - 1)(-1 - 1 - 3)(3q3 - q3 + q*3). 75q*3 Expand 117o + 34o - 27o + (2 - 5 + 1)(3o - 5o + o). 126o Expand (-v*2 - 5 + 5)(2v + 0 + 0)(112v2 + 913v - 913v). -224v*5 Expand (-2u*2 - 5u*2 + 5u*2)((0u2 + 2u2 - u2)(-2u - 1 + 1) + 3u3 + 0u*3 + 0u*3 - 7u*3 + 7u*3 + 13u*3). -28u*5 Expand 2l*2 + 0l + 0l - 9l + 9l - 6l*2 + 5l*2 + 0l*2 - 4l*2 + (-7l + 0l + 4l)(-l + 0l - l). 3l2 Expand (-9 + 43b + 43b - 89b)(2b*2 + 0b*2 - 3b2 + (-b2 + b*2 + 2b*2)(5 - 3 - 4) - 2b2 + 3 - 3 + b2 - 1 + 1 - b2 - b2 + b2). 21b*3 + 63b*2 Expand (-49 + 103 + 87)(-15 + 15 + 4h - 4h - h + 6h + (h - 3h + h)(-1 - 2 + 1) + 2h + 0h + 0h). 1269h Expand (4r + 3r - 5r)(7r*2 + 7r - 7r) - 3r*3 + 0r*3 + 5r*3. 16r*3 Expand (-197 + 197 + 174f + 220f)(1 - 4 + 6). 1182f Expand (-5w*2 + 3w*2 - 3w*2)(1 + 3 + 2)(w + 0w + w)(-4 - 4 + 5). 180w*3 Expand (5c*3 - 3c3 - c3)(3c*2 - 2c*2 + 0c*2) - 12c*5 + 34c5 - c5. 22c5 Expand -7t + 3t - 5t + (-4 + 1 + 1)(4t + t - 3t). -13t Expand (3 + 0 - 5)(0w*3 + 3w*3 - 4w*3 + (-w + 3w - w)(-w2 - 2w2 + w2) + w*3 - 2w*3 + 2w*3 + 65 - 65 - 19w*3). 42w*3 Expand (4s + 0s - 3s)((21 + 23 + 6)(3 + 3 - 5) - 1 + 2 + 1). 52s Expand -3y + 5y - 3y + (0y - 2y + 4y)(0 + 0 - 13) - 3y + 4y - 5y. -31y Expand (0 + 0 - 4)(1 - 1 - d5) + d5 + d5 - d5 + (-2d*4 + 2d*3 - 2d*3)(5d - 5d - 49d). 103d*5 Expand -9s - 22 + 22 + (0 + 0 - 8)(-5s - s + s). 31s Expand (-2q3 - q3 + 4q3)(-3 + 14 + 10505q - 10501q)(-1 + 2 - 3). -8q*4 - 22q*3 Expand -5f*3 + 3f*3 + 0f*3 + (-f + 4 + 2f + 0)(-19897 - 212f*2 + 19897). -214f*3 - 848f*2 Expand (-3 + 0 + 5)(-l*4 + 2l4 + l4)(0l + 5l - 3l + (4 - 2 - 3)(l + 4l - 3l) - 5l + 2l + 4l + 2l + 0l - l + 0 - l + 0)(0 + 9 + 12). 84l*5 Expand (-8l + 0 - 1 + 9l)(-1 - 12 - 3). -16l + 16 Expand (3x*2 - 2x*5 - 3x*2)(-37 + 16 + 1) + (0 + 0 - x*3)(-2x - x2 + 2x). 41x5 Expand (-4d - 4 + 4)(2d*2 - 2d2 + d2) + 7d2 + 29d*3 - 7d*2 + 0d*3 - 2d*3 + 0d*3. 23d*3 Expand (-u + 0u - u + (2u + u - 5u)(0 + 1 + 1))(1 - 2 + 0 + (-4 + 2 + 4)(-45 + 48 - 126)). 1482u Expand (u + 4u + 0u)(-5 + 2 - 2)(0 + 0 - 2u). 50u*2 Expand (-l + 2l*3 + l)(269 - 213 - 147). -182l3 Expand (0o*3 + 0o3 + o3)(-77o*2 + 95o*2 + 246o*2). 264o*5 Expand (-17t*2 + 50t - 17t - 33t)(-1 + 2 - 5). 68t2 Expand -c3 + 3c3 + c3 + (0 + 0 - 3)(-3c - 2c*3 + 3c) - 2c3 + 0c*3 - 2c*3. 5c*3 Expand (4 - 1 - 1)(-2l4 + l4 + 2l*4) - 4l*4 + 6l*4 + 3l*4 + (-4l - 4l + 6l)(4l*3 - 4l*3 + 3l3). l4 Expand (-28d + 142 - 142)(1 + 1 + 0). -56d Expand (-5 - 40f + 4 - 1)(1 - 1 + 8f). -320f2 - 16f Expand (6o + 3o + 0o)(o2 - o2 - 2o2 + (o - 5o - o)(1 + 2o - 1) - 2o2 + 2o2 - o2). -117o3 Expand (0l*2 + 0l2 + l3 + l*2 - 2)(36l - 115 + 115 + 4l - 3l + 0l + (-l + 0l - l)(-1 + 1 + 2) + 2l - 2l - 2l) + 0l + 0l - l4. 30l*4 + 31l*3 - 62l Expand 0o2 + o2 - 4o*2 + (2 - 3o - 2)(2o - 7o + 2o). 6o2 Expand (-42z*2 - 6z*2 - 57z*2 - 2z*2 + 2z*2 - 2z*2 + (-z - z + z)(-1 - 2z + 1) - z + z + 2z*2)(-2 + 3 + 0 + (5 - 5 - 1)(-4 + 5 - 3)). -309z*2 Expand (1 - 1 - 1)(-1 + 1 + 4y)(-2 + 4 - 1) - 6y + y + 4y + (2y + 0y - y)(1 - 1 - 2). -7y Expand t + 2t - 2t + 2 - 2 + t + (0 + 2 - 3)(-2t - 2t + 2t) + 2t + 3 - 3 + 1 + 2t - 1 + 0t + 4t - 6t - 14t + 464t + 417t. 873t Expand (3 - 4 - 13)(-4k - 2k - 10k). 224k Expand -2p + 2768 + 0p - 2799 + (1 - 4 + 1)(2 - 2 - 2p). 2p - 31 Expand (-w + 2w + w)(43237w*2 - 21547w*2 - 21416w*2). 548w*3 Expand (-2 + 3 + 6)(0u5 - 5u*5 - 3u*5) + 0u*5 + 4u*5 - 3u5 + (-2 - u4 + 2)(u + 3u - 2u). -57u*5 Expand 10f - 10f - 5f*2 + (-1018 + 26f + 1018)(f + 2f - 5f) - 5f + 5f - 2f*2. -59f*2 Expand -2x - x + 4x - 3x - x + 3x + (0 - 2 + 4)(-8x - 2x + 0x). -20x Expand (-6m2 + 5m*2 - 4m*2)(3 + 0 - 1 + 0 + 3 - 4 + (0 - 3 + 1)(3 + 2 - 3))(18m2 - 5m*2 - 3m*2). 150m*4 Expand (4f - 60f - 35f)((-1 + 1 + f)(-4 + 6 - 4) + 5f - f - f). -91f*2 Expand (1 + 2 + 5)((1 + 4 - 6)(6 - s - 6) + s - 4s + 5s + (0 + 0 - 2s)(-2 + 3 + 1) - 1 - s + 1 + 2s + s - 5s)(-2s2 + 3s2 + s2). -64s3 Expand (-2b + 0b + b)(3 - 8 + 39b2 + 2b - 41b2). 2b*3 - 2b*2 + 5b Expand (1 + 1 - 1)(28741 - 14370 - 14371 + 649f*2). 649f*2 Expand 32x*2 - 15x*2 - 15x*2 - 101 + (-1 + 1 - 2x)(0 + 0 - 2x) + 2x - 2x + 2x2. 8x2 - 101 Expand (w2 + 3 - 3)(2w + w - 5w) + (2 - 3 + 0)(-5 + 5 + 3w)(-120 - 17w2 + 120). 49w*3 Expand (1 + 55 - 316)(-2i + 5i - 2i). -260i Expand (2 + 4 + 14)(35 - 14o - 35). -280o Expand 7b + b*2 - 7b + 6 - 6 - 8b2 + (-3 - 2 + 3)(-1 + 1 - 2b2) - 4b*2 + 0b*2 + 5b*2 - 3b + b*2 + 3b. -b*2 Expand -3d + 61d - 153d + (2 + 2 - 6)(-2 + 2 + 2d). -99d Expand (-38y + 3756 - 3756)(2y2 - y2 - 2y2)(-3 + 4 - 2) + 8y3 + 0 + 0. -30y*3 Expand (-108 - 10 - 2)(3 + 1 - 3)(-3 - j + 3). 120j Expand (1 + 1 - 1)((4n + 0n - 2n)(0 - 1 + 2) - 78 + 78 + 112n). 114n Expand (3i + 0i + 0i + (6 - 2 - 2)(-2 + 3i + 2))(-2 + 2 - 10i). -90i2 Expand (-4 + 4 - 5x)(-2 + 0 + 1)(18454x2 - 18454x*2 - 2x*3 - 10x). -10x4 - 50x*2 Expand 1 - 10c - 1 + (0c + 0c - c)(4 + 0 - 3) + 2c + 0c + 0c + 4c + 6 - 6 + c - c - 2c. -7c Expand (-27u*4 - 141 + 141)(1 - 1 + u)(5 - 6 + 9) - 2u5 + u4 - u*4. -218u*5 Expand 2d*5 + 0d*5 + 0d*5 + (-21d*2 + 1 - 110d + 110d)(9d2 - 6d*2 + 9d*2)(0 + 0 + d). -250d5 + 12d*3 Expand (2 - 1 - 3)(-199u2 + 1760 - 1760). 398u*2 Expand (-3 + 3 - 2 + 4 - 3 + 2 + 2 + 0 + 0 + (3 - 2 + 1)(1 - 2 + 2) - 3 - 1 - 2)(-1 + 4z + 1). -4z Expand (3s + s - 6s)(2s2 - 3s*2 - 5s*2)(1 - 2 + 2)(4 - 2 - 1)(0 + 0 + 2)(-1 + 5 + 0). 96s*3 Expand (-70k - 935 + 935)(3k*3 - 3k*3 - 4k*4). 280k*5 Expand (-2v - 14v + 6v)(3v3 + 3 - 3 - v2)(-3v + 0v + 4v). -30v5 + 10v*4 Expand (r - 1 + 1)(2 - 2 + r) - 3 + 4r2 + 3 + (-3 - 3 + 0)(-2r2 + 2r*2 - 3r*2) + 1 + 4r*2 - 1. 27r*2 Expand ((-3b + 0b + 6b)(-b - 2b + b) + 6b2 + 0b*2 + 3b*2)(2 - 2b3 - 2 + 2b*2). -6b*5 + 6b*4 Expand (-2c + 1 - 1)(3c*2 + 2c*2 - 3c*2) + 342c*3 - 102c*3 + 280c*3. 516c*3 Expand (-5 + 4 - 1 + (-3 + 2 - 1)(0 + 0 + 2) + 1 - 4 + 1 + 7 - 7 + 6)((5 + 0 - 4)(2f3 - 9f*3 - 4f*3) + 2f3 - f3 + f*3). 18f*3 Expand (-4 - 1 + 3)(-2 - 3i + 2) + (-1 + 1 + i)(1 + 0 - 2) + 0 + 2i + 0 - 1241 + 91i + 1241. 98i Expand (5 - 4 - 3)((-3y - y + 5y)(2 + 2 - 3) - 2y + 9y - 2y) - 2y + 0y + 2 - 5y. -19y + 2 Expand (-4g - 2g + g)(-g - g + 4g) + (-4g + g + 2g)(-5g + 6g + 7g). -18g2 Expand (8r + 14r - 4r)(r + 0r + 0r) + 5r*2 + 0r*2 - 3r*2 + (0r + 0r + 2r*2)(1 + 3 - 2). 24r2 Expand (-21 - 61k + 9 + 10)(-5 + 4 + 0 + (-3 - 1 - 3)(2 + 0 -	{ "pile_set_name": "DM Mathematics" }
) be the second derivative of a*5/20 + 7a4/6 - a3/3 - 15a2/2 - 5a. What is the tens digit of i(-14)? 1 Let y(m) be the third derivative of -m6/120 - m5/10 - m*4/3 - 7m*3/6 + 6m2. What is the units digit of y(-5)? 8 Let a(j) = j3 + 2j2 + 2j - 2. Let i(r) = 2r3 + 3r*2 + 3r - 3. Let s(x) = 7a(x) - 4i(x). What is the units digit of s(-2)? 0 Suppose -3a - 2k = -0a - 35, -3a - 3k + 30 = 0. What is the tens digit of a? 1 Suppose n + 3 = -3n - o, 2n - 4o = 12. Suppose h - 3h + 4 = n. What is the units digit of 2/(2/6h)? 3 Let b(s) = -s + 13. What is the tens digit of b(0)? 1 Let u = 7 + 0. What is the units digit of 4/1u/2? 4 Let v = 17 + -15. What is the units digit of v? 2 Suppose 3h - 30 = -2h. Suppose -5t = o - 24, -5t + 26 = 3o - h. Let x = o - 2. What is the units digit of x? 2 Let f be 6/9 + 20/6. Suppose 0 = 3r - f - 65. What is the tens digit of r? 2 Let h(u) = -u + 6. Let w be h(4). Suppose -4m - 7 = -a, wm + 5 - 3 = 2a. What is the units digit of -1 - (-2 - (m + 4))? 3 Let m(h) = -h + 6. Let w be m(10). Suppose -4r = -3r + 21. What is the units digit of 16/6r/w? 4 Let d(s) be the third derivative of -3s6/10 - s3/6 + s*2. Let h be d(-1). Suppose -3c = 2c - h. What is the units digit of c? 7 Let j be (12/5)/((-4)/(-20)). What is the tens digit of 126/(-6)j/(-14)? 1 Let h(a) = 3a3 - 3a*2 + a + 2. Let l be h(2). Suppose 2t = -5s - l + 1, 2s = -2t - 18. Let y(c) = -c. What is the units digit of y(t)? 0 Suppose 1 = o + 3q - 14, 5o + q - 47 = 0. Let h = -7 + o. What is the units digit of 14/4(4 - h)? 7 Let i = 41 + -25. Suppose 0 = -q + 52 - i. What is the tens digit of q? 3 Let o be (1 - 2) + 4/4. Suppose o = 3v + 13 + 8. Let p = 22 + v. What is the tens digit of p? 1 Suppose -3v + 17 = 5w - 5v, 12 = 4w - 2v. Suppose 2n - 4 = 0, wu = -0n + 5n + 10. What is the units digit of u? 4 Let k(q) be the first derivative of -q*3/3 - 2q2 + q - 2. Let o be k(-4). What is the units digit of o/((-21)/(-9) + -2)? 3 Let c(n) = -n3 + 4n2 + 11n + 11. What is the units digit of c(6)? 5 Let g(k) = k2 - k + 4. Let d(o) = o2 - o. Let i be d(1). Let r be g(i). Suppose p - 5 = -rp. What is the units digit of p? 1 Suppose -119u + 115u = -776. What is the hundreds digit of u? 1 Suppose 3u = s - 59, -2s - s + 3u + 165 = 0. What is the units digit of s? 3 Let l be (-54)/(-10) - 10/25. Let t(s) = -s - 4. Let x be t(-9). Suppose -lz - 4f + 52 = 0, 7z - 2z + xf = 55. What is the units digit of z? 8 Let d = 8 - 4. Suppose dh = -4z + 16, z - 4h - 2 = -8. Suppose -z = -w + 5p, w = -p - 0p + 2. What is the units digit of w? 2 Let w = 6 + -4. Suppose 0i + 2i - 3a - 10 = 0, 4i + wa - 20 = 0. Suppose im - 3b = 60, -m - 4b + 5 = 16. What is the units digit of m? 9 What is the units digit of -1 - -3 - (-3 - 20)? 5 Suppose 5r = 0, -91 + 7 = -4z + 2r. What is the units digit of z? 1 Let y be ((-6)/10)/((-2)/10). Suppose 0 = u - q - 8, -u = 3u - yq - 30. Suppose -uk - 15 = -9k. What is the units digit of k? 5 Suppose 228 = -4k + 96. What is the tens digit of 4/22 + (-555)/k? 1 What is the tens digit of (6 - -1)(-240)/(-56)? 3 Let i = 20 - 4. Let k = 8 + i. What is the units digit of k? 4 Let p(a) = -46a - 12. What is the tens digit of p(-7)? 1 Let u be (-2)/(-3 - -8 - 3). What is the units digit of -6(-3 - (1 + u))? 8 Let q = 161 - 15. What is the tens digit of q? 4 Let i(x) be the third derivative of -x4/24 - x3 + 2x*2. Let l be i(-5). Let v = 0 - l. What is the units digit of v? 1 Let i = -2 + 34. What is the units digit of i? 2 Let o(c) = -20c - 2. Let k be (-4)/(-6) + 15/(-9). What is the tens digit of o(k)? 1 Let r(i) be the second derivative of -3i5/10 + i4/6 + i3/6 + 3i. Let o be r(-1). Suppose 2a - 1 - o = 0. What is the units digit of a? 4 Let q be (96/15 - 2)5. Suppose h - q = -3a, 0 = -4a + 5a - 4. Suppose 3m - h = 8. What is the units digit of m? 6 Let z be 2/9 - (-48)/27. Suppose 0 = -0a - za + 48. Suppose -4j = 4w + 4 - 56, -a = -2j - w. What is the units digit of j? 1 Let g = -4 - -9. Suppose -ga - 5h + 135 = 0, -a - 2a + 91 = -2h. What is the tens digit of a? 2 Suppose -2d - 2g - 20 = 0, d - g + 14 = -2d. Let m = d - -10. Let r = m - 3. What is the units digit of r? 1 Let h be 6/3 - 2 - 3. What is the units digit of h/12 - 387/(-12)? 2 Suppose 0 = -5c + 10 + 5. Suppose 7 - 34 = -ck. What is the units digit of k? 9 Suppose 0 = -2h + 72 + 30. What is the units digit of h? 1 Suppose -2d - 2 + 4 = 0. Let c(y) = 0 - 1 + 11y + y. What is the units digit of c(d)? 1 Let z(j) = 2j - 3. Let p be z(3). Let b be ((-1)/(p/12))/(-1). Let x = 11 + b. What is the units digit of x? 5 Let z = 120 + -79. What is the units digit of z? 1 What is the tens digit of -2 + 4 + 17 + 1? 2 Let t(r) be the second derivative of r*4/12 - 5r*3/6 + 7r*2/2 - 3r. What is the units digit of t(6)? 3 Let h(s) = -s*2 - 7s + 4. Let f be h(-7). Suppose 14 = -2r + fr. What is the units digit of r? 7 Let v be 1/2 + (-1)/2. What is the tens digit of 0 - (-1 - v)13? 1 Let a(f) = 10f3 - f2 - f + 1. Let u be a(1). Suppose -d + 5b - 10 = -0b, -3d + 2b - 4 = 0. Suppose t = -d + u. What is the units digit of t? 9 Let x(z) = 5z - 8. What is the units digit of x(4)? 2 Suppose -f = f + 16. Let q = f - -17. What is the units digit of q? 9 Let b(i) = -i2 + 28i - 15. What is the units digit of b(14)? 1 What is the tens digit of 306/(-36)(1 + -3)? 1 Suppose q = -q + 38. Let r(o) = -o3 - 5o*2 - o + 4. Let i be r(-4). Let g = i + q. What is the units digit of g? 1 Let h be ((-2)/4)/((-10)/260). Let m = 17 - h. What is the units digit of m? 4 Let p be (4/2)/(1/2). Let x = p - 1. Suppose 0m + m + x = 0, -3z = 4m - 18. What is the units digit of z? 0 Let s(l) = -3l3 + l + 1. Suppose 2c + 1 = u, -u = -c - 0c. Let g be s(u). Suppose g - 9 = -w. What is the units digit of w? 6 Let d be -6(1/(-2))/1. Let y be ((-6)/(-9))/(d/45). Suppose -20 = -c - v, 3v + 20 = 3c - y. What is the tens digit of c? 1 What is the units digit of (10 + -28)/((-6)/4)? 2 Let y(t) = -t*3 - 5t*2 - t. Let k be y(-5). What is the units digit of ((-32)/k)/((-4)/30)? 8 Let t be ((-20)/(-6))/((-11)/33). Let w(k) = -5k - 14. What is the units digit of w(t)? 6 Let d = -5 - -7. Suppose 0 = df + 1 - 11. Suppose 5n - fc - 70 = 0, -4c + 9c = -15. What is the units digit of n? 1 Suppose -4v + 156 = -l, 4v - l - 196 = -v. What is the tens digit of v? 4 Let i be (-1 - -2 - 0) + -1. Suppose -5h = -4a + 39, -5h - 27 = -ia - 2a. What is the units digit of ((-45)/a)/5-6? 9 Let w(r) = -r3 - 19r*2 - 38r + 41. What is the hundreds digit of w(-17)? 1 Let f = -41 + 14. Let u(d) = -d3 - d2 + d + 328. Let l be u(0). What is the units digit of l/18 + 6/f? 8 Let p(j) = -j*3 - 5j*2 + 5j - 4. Let w be p(-6). Suppose -wr + 38 = -36. What is the units digit of r? 7 Let u(g) = 15g - 3. Let r(n) = -22n + 5. Let d(q) = 5r(q) + 7u(q). What is the units digit of d(-3)? 9 Let f(r) be the second derivative of -r3/3 - 2r*2 + 7r. What is the units digit of f(-4)? 4 Let j = -3 - -5. Suppose 4y + jy - 198 = 0. What is the units digit of y? 3 Suppose y + 13 = 4z, -8 = -4y + 5z - z. Suppose -3l + y = -5. Let n = l - -9. What is the tens digit of n? 1 Suppose -4d + 3l - 5l + 42 = 0, 5d - 65 = -5l. Let c(u) = 8u - 17u + 2 - u2 - d. What is the units digit of c(-5)? 4 Suppose 452 = 5p - 4r, p + 3p = 4r + 364. Suppose -m - 128 = -5b, -3b - p = -7b - 4m. What is the units digit of b? 5 Suppose 15 = 5s, -6 = 2y + y - 5s. Suppose 0 = 3o - 36 + y. Let d = o + -3. What is the units digit of d? 8 Let k(x) = x3 - 9x*2 + 10x + 2. Let j be k(8). Suppose -l - j = 2l. What is the units digit of 9 - (-4)/l3? 7 Let t be 0 + -6(-16)/12. Let d(l) = 3l - 4. What is the tens digit of d(t)? 2 Let u = -8 + 7. Let d be (7-2)/u + -3. Suppose 0 = -2l + d + 13. What is the tens digit of l? 1 Suppose 134 = o + 2l + 2l, -5l = 2o - 253. What is the hundreds digit of o? 1 Let k(a) = -a + 21. What is the tens digit of k(9)? 1 Suppose -7z + 0z = -364. What is the tens digit of z? 5 Suppose -120 = -13x + 8x. Let l = x - 16. What is the un	{ "pile_set_name": "DM Mathematics" }
. Solve z = -2k - k - 12 for k. -4 Suppose -8s - 5o + 35 = -4s, 33 = 3s - 3o. Solve 0 = 158a - 163a - s for a. -2 Let v(u) = -9u2 + 20u - 74. Let o be v(6). Let g = o - -281. Solve 0w + 12 = -gw for w. -4 Suppose 0 = 3w - 2h - 488, -w + 5h - 41 + 208 = 0. Let r be 164/18 + (-18)/w - 5. Solve 6 = -rt + 2t for t. -3 Let v = 222 + -54. Suppose 0 = -6j + 14j - v. Solve 11z + j = 4z for z. -3 Let m(v) = -v2 - 2v + 16. Let n be m(0). Suppose np = -6p + 176. Solve pi = 10i for i. 0 Suppose 3 = -3m, m - 24 = -4w + 107. Suppose -5l = -3z - 635, w = 5z + 8. Let k = 132 - l. Solve b + k = 1 for b. -1 Let b(u) = -2u*3 - 10u*2 + 29u - 38. Let v(s) = s*3 + 5s*2 - 14s + 19. Let z(c) = 2b(c) + 5v(c). Let f be z(-7). Solve 10w - 5w - f = 0 for w. 1 Let k(a) = -a - 1. Let x(j) = -21j - 21. Let s(y) = 2k(y) + x(y). Let b be s(-2). Solve -19 = v - b for v. 4 Suppose -5r - 2c - 307 + 1037 = 0, 0 = 4r - 2c - 584. Solve 157h - rh = 0 for h. 0 Suppose -6a + 84 - 12 = 0. Suppose 8u + 319 = au + p, -5u - p = -398. Solve g - 75 = -u for g. -4 Let r be (5 + -1)168/(-224). Let c(x) = 2x + 10. Let m be c(r). Solve -m = -4v - 20 for v. -4 Let j = -12665 - -12727. Solve -jx - 88 = -84x for x. 4 Let y(j) = -j3 - 12j*2 - 10j + 14. Let r be y(-11). Suppose 3f + 0o - 25 = 4o, f + ro + 9 = 0. Solve -fn - 1 = -2n for n. -1 Suppose -292p + 295p - 18 = 0, -24 = 2f - 4p. Solve -10a + 5 + 45 = f for a. 5 Suppose -4c - 70 = -2n, 6n + 4 = 2n. Let l be 16/96 + (-231)/c. Solve -7w + lw = 30 for w. 5 Suppose -31u - 35u + 59u = -28. Let d(x) = -x*3 + 3x*2 + 2x - 1. Let q be d(2). Let l = q - 4. Solve 0 = lf - uf for f. 0 Suppose -66t + 908 = -2015 + 151. Solve 90r = 97r - t for r. 6 Suppose -4v = 4n - 7n - 225, -4v = 4n + 300. Let a be ((-6)/10)/(15/n). Suppose 8h - 7h + 4t = -20, at + 15 = -h. Solve -3k = -hk - 9 for k. 3 Let r(m) = -m*3 - 12m*2 - 11m - 12. Let b be r(-11). Let y be (3 - (-1245)/b) + 6/8. Let w be 10/(y/(-78)) - 1/(-5). Solve 5i + w = -2 for i. -2 Let x = 357 + 1227. Let y be 2/18 - x/(-324). Solve y + 0 = -s for s. -5 Let l(c) = 2c + 74. Let g be l(22). Suppose 2r - 184 + 654 = 4f, -f + r + g = 0. Let a = f - 117. Solve av = v for v. 0 Let a(n) = n2 - 15n - 15. Let z be a(16). Let i be 0/((-10)/5(z + -2)). Solve i = 4t - 2t for t. 0 Let a = -152 - -471. Let u = a + -311. Solve -t = -u + 6 for t. 2 Let b = 2256 - 2123. Solve 0 = -7o - 98 + b for o. 5 Let o be -2 + 2 + (1 - -7). Suppose -5c = z + 74, -4z - 201 = -0c + c. Let v = 53 + z. Solve 0 = 2l - vl + o for l. 4 Let l(p) = 5p + 16p + 0p*2 + p - 61 - 6p - p*2. Let v be l(9). Solve -vb = 6 - 14 for b. 4 Let u be (6/8 - (-21)/(-28))/1. Let c = -23 - -13. Let s = 12 + c. Solve u = 3v + sv for v. 0 Let r = 105 + -99. Suppose -ra = a - 42. Solve a = 2n + n for n. 2 Suppose 0 = 11h - 2622 - 1206. Let m = h + -343. Solve -mr + 9 = 4 for r. 1 Let x = -4913 - -5205. Solve 0 = -290h + xh + 2 for h. -1 Let n be 0/(1 - 0/(-14)). Let f = 3 - -1. Suppose fk + 16 = 8k. Solve -l + k = -n for l. 4 Let c = 500 - 1235. Let q = -726 - c. Solve 9d + 18 = -q for d. -3 Let t = 26 + 44. Suppose -74q = -tq - 16. Solve 0 = 10k - qk - 6 for k. 1 Let q be -5(3/5 - 1) + 3. Let m = q + 2. Suppose 23 = 4w + m. Solve wo - 2o = -6 for o. -3 Let j be ((-40)/15)/((-4)/288). Let p be (-4)/10 + j/80. Solve 0 = -7i + pi for i. 0 Let c be -5 + (10 - 8 - -3). Solve c = -6n - 91 + 73 for n. -3 Let m(o) = o*3 + 18o*2 - 4. Let p be m(-18). Let x be p + 16/2 - (0 + -1). Solve xa + 17 = 2 for a. -3 Let z(t) = t*2 + 34t - 94. Let x be z(-37). Suppose -12c = xc - 8c. Solve -4j = -cj + 12 for j. -3 Suppose 18n = 14 + 40. Suppose 29 = 3v - 5m, nm + 18 = 9v - 7v. Let p be 8(1 + 0/(-3)). Solve s = -vs - p for s. -2 Let j = 1736 - 1731. Solve 10a = -ja + 15 for a. 1 Suppose 0 = -144r + 147r - 774. Let s = -252 + r. Solve sc + 1 = -11 for c. -2 Let m = 75 + -63. Let l(q) = -2q2 + 21q + 41. Let u be l(m). Suppose 3p + 2d = 8 + u, p - 9 = -3d. Solve -b + pb - 8 = 0 for b. 4 Let t be -1(-11 + 11)/3. Solve t = -186u + 161u for u. 0 Let d be -3(-2)/(-3) - -4. Let f be d - 0 - 4/(-2). Let u = -618076 - -618076. Solve -a - a - f = u for a. -2 Suppose -6o + 42 = -3l, 2o + 0 = 5l - 2. Solve 260z + o = 263z for z. 3 Let x = 12552 + -12552. Solve x = -57k + 50k - 14 for k. -2 Suppose 0 = -m + s, s + 12 = 4m - 0s. Let c(l) = -7 + 1 + 37 - ml. Let f be c(7). Solve -a = fa + 4 for a. -1 Suppose -47t + 7t = 8t. Solve t = -137w + 145w + 32 for w. -4 Suppose -5v = u + 25 - 73, -5v + 46 = 2u. Let m be 7 + 30 - 3/((-6)/v). Solve 37a = ma - 10 for a. 2 Suppose -7k + 1410 = 1207. Solve -56 - k = -17f for f. 5 Let c(z) = 7z2 + 2z + 6. Let a be 0 - 4/520/8. Let i be c(a). Let h be 664/i - ((-128)/(-60) + -2). Solve 4y = h - 2 for y. 5 Let s(y) be the second derivative of -19y5/20 - y3/6 - y2/2 - 12y. Let x be s(-1). Suppose -xt - 15 = -24t. Solve -z + tz = -6 for z. -3 Let d be (-1)/(-4) + 57/12. Let h be 34 + 6/(-2) + 1. Suppose -4v = -4u, -3u + 11v = 16v - h. Solve -dn = -3n + u for n. -2 Let g = 4708 + -4688. Suppose 3t + t = 0. Solve -2s - 3s + g = t for s. 4 Let s = -70 + 118. Suppose 0w = 6w + s. Let k be -2 - -1 - (w + 3). Solve -l + 5l = -k for l. -1 Let m = 67 - 33. Let j = m + -32. Let t = 55 + -51. Solve -tg = -jg + 2 for g. -1 Suppose 1 = f - 5l + 24, 20 = 4l. Let h be ((-2 + 3)6)/f. Let w = -21 + 43. Solve 7 = hz + w for z. -5 Suppose -60x - 1371 + 19 = -164x. Solve 0 = xf - 160 + 134 for f. 2 Let z(c) be the second derivative of 5c*4/6 - 12c. Let k be z(-1). Suppose a + y = 4a - k, 4a - 8 = 4y. Solve -2 = -3v + a for v. 2 Let d(h) be the second derivative of -7h3/2 - 101h*2/2 - 99h - 2. Let z be d(-5). Solve 2 = zr + 14 for r. -3 Suppose 2l + 258 = -5d, l + 664 = -4l - 3d. Let g = l + 137. Solve 0f = -gf for f. 0 Let v(b) = b2 + 13b + 78. Let f be v(-12). Solve 1279a + f = 1301a for a. 3 Let d(u) = u*2 - 13u - 12. Let r be d(14). Suppose 3f - rx = 18, 2f - 12 = -x - 3x. Solve fn + n = 0 for n. 0 Let w = 621 + -612. Solve -58 + 22 = wl for l. -4 Let t be ((-5860)/(-120))/((-3)/(-18)). Solve -57m + t + 106 = 0 for m. 7 Suppose -1296 = 7w + 356. Let y = -233 - w. Solve -y = u - 5 for u. 2 Let s = 1469 + -1469. Solve s = 17m - 102 - 0 for m. 6 Suppose -2r + 2g + 4 = 2, 5r + g + 1 = 0. Suppose r = 5u - 2b + 5b - 29, -2u + 14 = 2b. Let y = -3 + 4. Solve -u = s - y for s. -3 Let n(s) = -3s + 210. Let r be n(4). Solve -335p + 368p = r for p. 6 Let j = -55 - -40. Let g be 1 + 0 - 15/j. Suppose -gz + 11 = 7. Solve -d = zd - 9 for d. 3 Suppose -i + 33 = j, 2i = -i + j + 99. Let y = i + -29. Suppose 4m = 3m + y. Solve -2k = -mk - 6 for k. -3 Suppose 4j + 4 = 0, 0 = 15z - 18z - 3j + 2172. Let t = -713 + z. Solve -2k + 6k = -t for k. -3 Suppose -27 = -z - s + 5s, 5s + 25 = 0. Suppose zg - 83 - 218 = 0. Solve g - 33 = 2t for t. 5 Let g = -188 - -155. Let f be -4 + 3 + -1 - -41. Let r = f + g. Solve s - r = 3s for s. -3 Let t = -28382 - -28428. Let m(d) = d*3 - 5d*2 + 5. Let u be m(5). Solve t = -un + 51 for n. 1 Suppose -12h - 24h = 109h - 3h. Solve h = 142k - 152k - 10 for k. -1 Let s(l) = l*3 - 5l + 7. Let z be s(-3). Let p be (-6)/z(-265)/(-159). Solve 29 = po + 35 for o. -3 Let y = 16350 + -16350. Solve 7q - 36q - 58 = y for q. -2 Let f(l) = l*3 - 8l*2 + 6l + 6. Let p be f(7). Let n be 0((-3)/p)/6. Solve n = -4m - 16 - 4 for m. -5 Suppose 29 = 19n + 3 - 164. Solve 18 = -nq + 48 for q. 3 Let l(i) = i + 17. Let h be l(-9). Let s = -12 + h. Let d be (s - (-12 - -4)) + -1. Solve m = d - 6 for m. -3 Let i(o) = -13o + 175. Let a be i(13). Suppose 19m + am - 200 = 0. Solve 15 = md - 5d for d. 5 Suppose -2j - 2j + 12 = 0. Suppose -4y - 12 = -p, -jp + 2 = 5y - 0. Let x(m) = m*2 - 4m + 4. Let c be x(4). Solve 0 = -ci + 3i - p for i. -4 Suppose 0 = 8s - 3s - l - 188, -4l + 8 = 0. Solve -17o - 140 = -s for o. -6 Suppose -53b + 1662 - 284 = 0. Solve b = 16p + 74 for p. -3 Let x = -509 + 387. Let j = x + 130. Solve w = 5*w - j for w. 2 Let	{ "pile_set_name": "DM Mathematics" }
wwy when three letters picked without replacement from {w: 9, y: 11}? 11/95 What is prob of sequence olf when three letters picked without replacement from zkkkzzokqkqqklffoqkk? 1/1710 Two letters picked without replacement from qqajrqaqj. What is prob of sequence rq? 1/18 Two letters picked without replacement from ttkk. What is prob of sequence kt? 1/3 Four letters picked without replacement from {u: 2, w: 10}. Give prob of sequence wwuw. 4/33 Two letters picked without replacement from {z: 1, a: 2, y: 3, j: 6, s: 4, v: 4}. What is prob of sequence jj? 3/38 Calculate prob of sequence nly when three letters picked without replacement from {y: 2, c: 2, l: 1, n: 7, u: 4}. 1/240 Calculate prob of sequence nq when two letters picked without replacement from ppqppqn. 1/21 What is prob of sequence pp when two letters picked without replacement from {p: 2, n: 5}? 1/21 Four letters picked without replacement from {d: 2, t: 8, v: 4}. Give prob of sequence tdvd. 8/3003 Calculate prob of sequence al when two letters picked without replacement from {x: 1, e: 1, z: 3, a: 5, l: 1}. 1/22 Calculate prob of sequence jov when three letters picked without replacement from {j: 2, w: 1, o: 1, y: 4, v: 1}. 1/252 Two letters picked without replacement from {r: 14, i: 5}. What is prob of sequence ri? 35/171 Calculate prob of sequence azh when three letters picked without replacement from ezezeheazphhaea. 9/910 Four letters picked without replacement from {s: 1, h: 1, r: 1, p: 1, f: 2, c: 1}. Give prob of sequence fhcs. 1/420 What is prob of sequence rnch when four letters picked without replacement from {r: 2, c: 1, n: 1, h: 1}? 1/60 Calculate prob of sequence cc when two letters picked without replacement from crccccrcrcccrc. 45/91 Four letters picked without replacement from ojtttjddudxx. What is prob of sequence dxjj? 1/990 What is prob of sequence mqu when three letters picked without replacement from {u: 1, v: 3, w: 1, m: 4, o: 1, q: 2}? 1/165 Four letters picked without replacement from {j: 1, w: 6, g: 3, x: 4}. What is prob of sequence ggjx? 1/1001 Two letters picked without replacement from rrrgrvv. Give prob of sequence rv. 4/21 Four letters picked without replacement from {f: 1, v: 6, j: 1, h: 1}. Give prob of sequence jfvv. 5/504 What is prob of sequence uku when three letters picked without replacement from ukkuzzzuzkuu? 1/22 Four letters picked without replacement from eeohorheehoeo. Give prob of sequence eeeo. 2/143 What is prob of sequence sre when three letters picked without replacement from {s: 2, e: 2, r: 1, b: 4, o: 3, y: 2}? 1/546 Two letters picked without replacement from abtvttatvdaattt. Give prob of sequence tt. 1/5 Two letters picked without replacement from gggggg. What is prob of sequence gg? 1 Four letters picked without replacement from {u: 3, b: 2, d: 2, m: 1, h: 1, g: 3}. What is prob of sequence dggu? 1/330 What is prob of sequence gw when two letters picked without replacement from {w: 2, g: 11, h: 7}? 11/190 What is prob of sequence opop when four letters picked without replacement from oopppphoopoh? 10/297 Two letters picked without replacement from nchdlvd. What is prob of sequence dn? 1/21 Calculate prob of sequence rrzr when four letters picked without replacement from {r: 13, z: 5}. 143/1224 Two letters picked without replacement from dwmwdwjmdwjjmjmwjjw. Give prob of sequence jm. 4/57 Three letters picked without replacement from ggg. Give prob of sequence ggg. 1 Three letters picked without replacement from rqlrqbrrqjq. What is prob of sequence blq? 2/495 Calculate prob of sequence jj when two letters picked without replacement from llfjkfljljllklfklklk. 3/190 Calculate prob of sequence yyq when three letters picked without replacement from qllellqqyyyqyqy. 10/273 Calculate prob of sequence unns when four letters picked without replacement from {s: 2, u: 1, n: 2, x: 7}. 1/2970 Four letters picked without replacement from nhnhhhhhh. Give prob of sequence hnhn. 1/36 Two letters picked without replacement from qersa. What is prob of sequence es? 1/20 Calculate prob of sequence ga when two letters picked without replacement from {g: 2, a: 1}. 1/3 Two letters picked without replacement from gmyymgyzyyynym. What is prob of sequence gm? 3/91 Calculate prob of sequence ddxt when four letters picked without replacement from txddd. 1/20 Four letters picked without replacement from {h: 6, i: 2, v: 3, t: 8}. What is prob of sequence thvt? 7/646 What is prob of sequence gi when two letters picked without replacement from {r: 1, v: 2, i: 3, g: 6}? 3/22 Calculate prob of sequence ym when two letters picked without replacement from {y: 5, d: 2, w: 2, v: 4, m: 1}. 5/182 Three letters picked without replacement from ntntynytyttn. Give prob of sequence yyt. 1/44 Three letters picked without replacement from {o: 3, n: 3, k: 2, w: 5, u: 2}. Give prob of sequence wkw. 4/273 Four letters picked without replacement from {m: 5, a: 3, u: 2, c: 5, q: 4}. Give prob of sequence mqqc. 25/7752 What is prob of sequence eee when three letters picked without replacement from {e: 10}? 1 Calculate prob of sequence ziq when three letters picked without replacement from nfqzidqfqdiqfqzqn. 1/170 What is prob of sequence ttut when four letters picked without replacement from {t: 7, u: 1, k: 1, l: 6}? 1/156 What is prob of sequence vy when two letters picked without replacement from vhhkeeyf? 1/56 What is prob of sequence qqqq when four letters picked without replacement from {q: 9}? 1 Four letters picked without replacement from {n: 4, p: 3, j: 1, t: 3, e: 3, b: 2}. What is prob of sequence pbje? 3/7280 Three letters picked without replacement from {r: 1, i: 3}. What is prob of sequence rii? 1/4 Three letters picked without replacement from {n: 3, f: 1, k: 4, j: 5, l: 1, v: 3}. Give prob of sequence knk. 3/340 What is prob of sequence gg when two letters picked without replacement from {s: 1, x: 1, m: 2, g: 2}? 1/15 Three letters picked without replacement from rtuttut. Give prob of sequence tru. 4/105 Calculate prob of sequence rr when two letters picked without replacement from rrrrr. 1 Calculate prob of sequence tfy when three letters picked without replacement from yntfvnfvfvnvv. 1/572 Calculate prob of sequence jbr when three letters picked without replacement from buujjyjrjjjrljuj. 1/210 Two letters picked without replacement from {c: 3, h: 3}. Give prob of sequence cc. 1/5 Calculate prob of sequence sp when two letters picked without replacement from wsjlpwjln. 1/72 What is prob of sequence xxxx when four letters picked without replacement from {x: 10}? 1 Four letters picked without replacement from {d: 1, g: 2, f: 3, k: 3, u: 1, q: 1}. What is prob of sequence ugdq? 1/3960 Four letters picked without replacement from {z: 1, b: 9, o: 2, r: 1, t: 5}. What is prob of sequence trot? 1/1836 What is prob of sequence qt when two letters picked without replacement from {f: 1, t: 1, j: 1, r: 2, q: 1, e: 1}? 1/42 Four letters picked without replacement from {w: 6, a: 2}. What is prob of sequence wwww? 3/14 Three letters picked without replacement from tgjnmqm. What is prob of sequence qmt? 1/105 What is prob of sequence jqd when three letters picked without replacement from {f: 1, k: 1, q: 2, d: 1, e: 1, j: 2}? 1/84 Calculate prob of sequence micn when four letters picked without replacement from {m: 3, i: 1, c: 1, n: 4, o: 5}. 1/2002 Calculate prob of sequence qp when two letters picked without replacement from qxqqninqqp. 1/18 What is prob of sequence ewbi when four letters picked without replacement from {w: 2, e: 9, b: 4, i: 1}? 3/1820 Calculate prob of sequence jlos when four letters picked without replacement from {x: 1, s: 2, l: 2, k: 5, o: 2, j: 1}. 1/2145 Three letters picked without replacement from {l: 1, r: 5, y: 3, z: 1, h: 1, g: 3}. Give prob of sequence zrh. 5/2184 What is prob of sequence eqnq when four letters picked without replacement from {q: 2, y: 1, n: 7, e: 2, r: 6}? 7/18360 Four letters picked without replacement from {q: 6, w: 4, r: 4}. Give prob of sequence wwrw. 4/1001 Three letters picked without replacement from gqmugguugmjpqup. Give prob of sequence ppg. 4/1365 What is prob of sequence gii when three letters picked without replacem	{ "pile_set_name": "DM Mathematics" }
ose 0 = t - 5t + 32. What is the remainder when t is divided by 5(i + (4 - -1))? 3 Let o(p) = p*2 + 16p + 2. Let x be o(-16). Suppose 19 = w - 3q, 7w - xw - 55 = 5q. What is the remainder when 19 is divided by w? 5 Suppose -14q + 208 = 2q. Suppose 180 = -9m + qm. What is the remainder when m is divided by 16? 13 Suppose 0 = 3y - 5 - 25. Calculate the remainder when y - -1(-8)/(-4) is divided by 7. 5 What is the remainder when -5 + (-2)/(-4)(1623 - -25) is divided by 41? 40 Suppose 147 - 815 = -2j. What is the remainder when j is divided by 67? 66 Suppose -9b = -8b. Suppose 0 = -ba - 2a + 80. Let r = a + -19. Calculate the remainder when r is divided by 6. 3 Let a = 247 - 240. Calculate the remainder when 123 is divided by a. 4 Suppose 7j - 25737 = -16j. Calculate the remainder when j is divided by 40. 39 Calculate the remainder when (-340)/25(-11 + 6) + -2 is divided by 2/(-7) + 121/7. 15 Let u(l) = l3 - 3l*2 + 5l + 6. Let s = -23 - -32. What is the remainder when u(4) is divided by s? 6 Let i = 21 + -13. Let a(h) = -h*2 + 20h + 98. Let g be a(24). Suppose -gs + 10 = 4. Calculate the remainder when i is divided by s. 2 Let w(u) = -2u*2 + 84u + 21. Calculate the remainder when w(39) is divided by 88. 79 Suppose 14a = 11a - i + 667, 4 = i. Calculate the remainder when a is divided by 62. 35 Calculate the remainder when 16 is divided by 15 - -3 - (1 + 4). 3 Suppose 3o - 5o = -62. Suppose 4x - 57 = o. Suppose x = u - c, 0 = -c - 6 + 2. Calculate the remainder when u is divided by 10. 8 Let u = 131 - 118. Calculate the remainder when 70 is divided by u. 5 Suppose -3a + 6 = -0a. Let r be (4 + -16)a/(-3). What is the remainder when 132/(r + -4) - -3 is divided by 13? 10 Suppose -5b + 15 + 5 = 0. Suppose -4d = -q, bd = 3q - 4q + 32. Calculate the remainder when 77 is divided by q. 13 Let l(i) = -i + 1. Let z be l(-1). Calculate the remainder when 56 is divided by -2 + z + -1 - (-20 - -7). 8 Let l be 1/(-2) + 25/2. Let u = -37 + 22. Let c = l - u. Calculate the remainder when 80 is divided by c. 26 Suppose 0 = 2r - r + 3, -3r = -3c + 63. Suppose -23j + cj = -135. Calculate the remainder when 107 is divided by j. 26 Suppose -r + 421 = -13n + 15n, -r = -n - 412. Calculate the remainder when r is divided by 26. 25 Let d be 18/(2(-1 + 2))39. Suppose d = 5s + 4s. Calculate the remainder when 154 is divided by s. 37 Suppose 48 = -3z - 3n, -7 = z - 5n + 3. Let b(w) = w3 + 16w*2 + 14w + 2. What is the remainder when b(z) is divided by 8? 1 Suppose -2j + 5n = -0j - 34, 68 = 4j - 5n. Calculate the remainder when 66 is divided by j. 15 Let v(f) = 2f - 1 + 6f + 4 - f. Let r be v(5). Let b = r + -19. Calculate the remainder when 35 is divided by b. 16 Suppose -57 = -7r + 6r. Let h = r + 83. Calculate the remainder when h is divided by 29. 24 Suppose 33 = 8s - 71. Calculate the remainder when (-2)/(-17) - ((-744)/34 + -3) is divided by s. 12 Let l = -181 + 96. Let v = -9 - l. What is the remainder when v is divided by 26? 24 Let n = 68 - 46. Let f(k) = 4k3 - 4k*2 + 4k. Calculate the remainder when f(3) is divided by n. 18 Suppose -3m + 6 = -4k, -4k + 4 = 10m - 8m. Suppose -5n + 13 + 27 = k. What is the remainder when n is divided by 3? 2 Let p(n) = n*3 - 6n*2 - 5n. Let x be p(7). Let y be ((-30)/45)/((-2)/15). Suppose -yd = -x - 61. What is the remainder when d is divided by 8? 7 Let l be (-16 + -2)/((-4)/(-6)). Let n = l - -61. What is the remainder when 64 is divided by n? 30 Let x(p) = p2 - 8p + 7. Let u be x(6). Let k(d) = -14d - 25. Calculate the remainder when k(u) is divided by 6. 3 Let l = -110 - -113. Suppose -2v + 16 = -5y, y + ly - 4 = -4v. What is the remainder when 13 is divided by v? 1 Suppose 5f - 520 = 4n, -2f + 3n + 140 = -75. Let z = -58 + f. Calculate the remainder when 167 is divided by z. 41 Let f(t) = t2 + 26t + 247. Calculate the remainder when f(-12) is divided by 26. 1 Let l = -7 + 6. Let m be (-2)/(4/2)-25. Let w = m + l. What is the remainder when 93 is divided by w? 21 Let y = -10 + 14. Let h(k) = -4k*2 + 4k*2 + 5k - k*2 + 0k. What is the remainder when 14 is divided by h(y)? 2 Let t = 19 + -16. Let o = -8 + -4. What is the remainder when (-27)/o + 6/8 is divided by t? 0 Let j(h) = -2h2 - 4h + 3. Let a be j(-3). Calculate the remainder when 26 is divided by (-84)/(-6) + (a - 1). 6 Suppose n + 181 = -m + 1284, 2n - 2198 = -4m. What is the remainder when 4/14 - n/(-21) is divided by 27? 26 Calculate the remainder when 113 is divided by -18(66/(-18) + (-15)/(-9)). 5 Let q = 104 - 95. Calculate the remainder when 20 is divided by q. 2 Let s(k) = -19k + 125. What is the remainder when 69 is divided by s(5)? 9 Let f(v) = v*2 + 12v + 5. Let m be (12/(-15))/(3/45). Let b(x) = 2x + 3. Calculate the remainder when b(2) is divided by f(m). 2 Suppose -781 - 69 = -25i. Calculate the remainder when 80 is divided by i. 12 Let s = -2 - -13. Suppose -12 = 3v + 30. Calculate the remainder when (v/(-4))/((-4)/(-48)) is divided by s. 9 Let d = -2 + 10. Let u = 120 - 14. Suppose -uk = -111k + 110. What is the remainder when k is divided by d? 6 Let i be 713/(-69) + (-2)/(-6). What is the remainder when (-36)/i - 8/(-20) is divided by 2? 0 Suppose 5b = -5d - 10, 2b + 5d + 4 = 3. What is the remainder when b(5 - 64/3) is divided by 17? 15 Let w = 1 + -1. Suppose w = 4m - 12, 2m - 56 = 2o - 7o. What is the remainder when (7 + -8)/(3/111-1) is divided by o? 7 Suppose -5x + 4m + 301 + 30 = 0, m + 67 = x. Suppose 0 = -5u + 15, -2s + s = -u - 30. What is the remainder when x is divided by s? 30 Let p(l) = 12l + 507. Calculate the remainder when p(15) is divided by 13. 11 Let h = -1393 + 1407. What is the remainder when 153 is divided by h? 13 Suppose -5t + 46 = -3t + 4h, t - 38 = -5h. Suppose 157 + 287 = 3g. Suppose -g = -0z - 4z. What is the remainder when z is divided by t? 11 What is the remainder when (266/21 + 0)/(5/615) is divided by 71? 67 Let m be 10/50 + ((-1924)/(-10))/(-2). Let r = m + 115. What is the remainder when 32/(-6)21/(-2) is divided by r? 18 Calculate the remainder when (-1 - -45)/(11 + 126/(-12)) is divided by 15. 13 Suppose 30 = -4n + 30. Suppose -4a + 125 + 27 = n. What is the remainder when a is divided by 8? 6 Suppose 68d - 76 = 64d. Calculate the remainder when d is divided by (9/(-6))/((-3)/16). 3 Suppose -4t - 171 = 2y - 1211, 0 = 3y. Calculate the remainder when t is divided by 87. 86 Let f = -1 - -5. What is the remainder when f is divided by (-6)/15(-6 + 1)? 0 Suppose -2f - 2f - 4z + 340 = 0, -2f + 2z + 190 = 0. Calculate the remainder when 99 is divided by f. 9 Suppose -1164 - 460 = -5w - 4k, -4w - 6k = -1302. Calculate the remainder when w is divided by 21. 9 Let t(q) = -q3 + 12q*2 + 11q + 29. Let r be t(13). Suppose -ri + 80 = i. Calculate the remainder when 117 is divided by i. 17 Let t(l) = -22l - 139. Calculate the remainder when t(-16) is divided by 29. 10 Let b = 3 + -1. Suppose -bi + 40 = 2i. Let o(q) = -q*3 + 10q*2 + 2q - 10. What is the remainder when 27 is divided by o(i)? 7 Let y = -1997 + 2002. Suppose j + 5w - 19 = 0, -j - 5w + 37 = 2j. What is the remainder when j is divided by y? 4 What is the remainder when (600/(-32))/(2 + (-82)/40) is divided by 42? 39 Suppose 42g - 208 = 34g. Calculate the remainder when 43 is divided by g. 17 Let o(x) be the second derivative of -x4/12 - 3x*3/2 + 8x*2 + 11x. Calculate the remainder when 117 is divided by o(-8). 21 Let h = 6 + 1. Calculate the remainder when (-280)/1820 - (-327)/13 is divided by h. 4 Suppose 761 - 5 = 6w. Calculate the remainder when w is divided by 19. 12 Let d(g) = -g3 - 5g*2 + 3g + 11. Let b = 20 + -26. Calculate the remainder when 86 is divided by d(b). 28 Let g(m) = -m*3 + 11m*2 - 13m - 12. What is the remainder when -128(-8 - -1) is divided by g(9)? 31 Let c(r) = 13r - 4. Let x be c(3). Suppose 250 = 19q - x. Calculate the remainder when 27 is divided by q. 12 Let w = 50 + -22. Let y = 51 - w. What is the remainder when 67 is divided by y? 21 Suppose -3j = 12, 4x + 6j - 9j = 448. Calculate the remainder when 313 is divided by x. 95 Suppose 0 =	{ "pile_set_name": "DM Mathematics" }
re the prime factors of 389? 389 List the prime factors of 55694. 2, 27847 List the prime factors of 1167. 3, 389 List the prime factors of 3431. 47, 73 What are the prime factors of 1856? 2, 29 List the prime factors of 1914. 2, 3, 11, 29 What are the prime factors of 78523? 17, 31, 149 What are the prime factors of 1458? 2, 3 List the prime factors of 3009. 3, 17, 59 What are the prime factors of 2083? 2083 List the prime factors of 355. 5, 71 List the prime factors of 9944. 2, 11, 113 What are the prime factors of 1432? 2, 179 What are the prime factors of 5539? 29, 191 What are the prime factors of 934? 2, 467 What are the prime factors of 75290? 2, 5, 7529 What are the prime factors of 388? 2, 97 List the prime factors of 274. 2, 137 List the prime factors of 1513. 17, 89 What are the prime factors of 787? 787 What are the prime factors of 90? 2, 3, 5 What are the prime factors of 8576? 2, 67 List the prime factors of 234. 2, 3, 13 What are the prime factors of 917? 7, 131 List the prime factors of 16976. 2, 1061 List the prime factors of 2662. 2, 11 List the prime factors of 3757. 13, 17 What are the prime factors of 1559? 1559 List the prime factors of 31348. 2, 17, 461 What are the prime factors of 4178? 2, 2089 List the prime factors of 12891. 3, 4297 What are the prime factors of 14745? 3, 5, 983 List the prime factors of 3134. 2, 1567 List the prime factors of 25116. 2, 3, 7, 13, 23 List the prime factors of 7743. 3, 29, 89 List the prime factors of 17831. 11, 1621 What are the prime factors of 1546? 2, 773 List the prime factors of 3463. 3463 List the prime factors of 1311. 3, 19, 23 What are the prime factors of 162135? 3, 5, 1201 List the prime factors of 477. 3, 53 What are the prime factors of 2874? 2, 3, 479 List the prime factors of 25377. 3, 11, 769 What are the prime factors of 4765? 5, 953 List the prime factors of 3400. 2, 5, 17 List the prime factors of 1166. 2, 11, 53 What are the prime factors of 16404? 2, 3, 1367 List the prime factors of 36839. 11, 17, 197 What are the prime factors of 199? 199 What are the prime factors of 37782? 2, 3, 2099 What are the prime factors of 590? 2, 5, 59 What are the prime factors of 119533? 119533 List the prime factors of 16225. 5, 11, 59 List the prime factors of 1843. 19, 97 What are the prime factors of 48128? 2, 47 What are the prime factors of 5491? 17, 19 What are the prime factors of 455? 5, 7, 13 What are the prime factors of 2305? 5, 461 List the prime factors of 3660. 2, 3, 5, 61 List the prime factors of 3988. 2, 997 List the prime factors of 777. 3, 7, 37 What are the prime factors of 3300? 2, 3, 5, 11 List the prime factors of 81101. 81101 What are the prime factors of 93013? 47, 1979 List the prime factors of 98327. 98327 List the prime factors of 4730. 2, 5, 11, 43 List the prime factors of 2162. 2, 23, 47 What are the prime factors of 12188? 2, 11, 277 List the prime factors of 58322. 2, 11, 241 What are the prime factors of 2076? 2, 3, 173 What are the prime factors of 1078? 2, 7, 11 List the prime factors of 49516. 2, 12379 What are the prime factors of 33989? 41, 829 List the prime factors of 4900. 2, 5, 7 List the prime factors of 1476. 2, 3, 41 What are the prime factors of 21835? 5, 11, 397 What are the prime factors of 1958? 2, 11, 89 List the prime factors of 7134. 2, 3, 29, 41 List the prime factors of 86. 2, 43 List the prime factors of 734. 2, 367 List the prime factors of 112016. 2, 7001 List the prime factors of 7847. 7, 19, 59 What are the prime factors of 3555? 3, 5, 79 List the prime factors of 8648. 2, 23, 47 List the prime factors of 962. 2, 13, 37 What are the prime factors of 31742? 2, 59, 269 List the prime factors of 7280. 2, 5, 7, 13 List the prime factors of 3642. 2, 3, 607 What are the prime factors of 1852? 2, 463 What are the prime factors of 5610? 2, 3, 5, 11, 17 List the prime factors of 132659. 53, 2503 List the prime factors of 10729. 10729 List the prime factors of 590. 2, 5, 59 What are the prime factors of 23457? 3, 7, 1117 What are the prime factors of 4185? 3, 5, 31 What are the prime factors of 189? 3, 7 List the prime factors of 143008. 2, 41, 109 List the prime factors of 9085. 5, 23, 79 What are the prime factors of 2981? 11, 271 What are the prime factors of 4201? 4201 What are the prime factors of 59907? 3, 19, 1051 What are the prime factors of 4521? 3, 11, 137 List the prime factors of 42. 2, 3, 7 What are the prime factors of 900? 2, 3, 5 List the prime factors of 3103. 29, 107 What are the prime factors of 1097? 1097 List the prime factors of 18433. 18433 What are the prime factors of 13104? 2, 3, 7, 13 List the prime factors of 7514. 2, 13, 17 What are the prime factors of 1578? 2, 3, 263 What are the prime factors of 681? 3, 227 What are the prime factors of 1369? 37 What are the prime factors of 228? 2, 3, 19 List the prime factors of 12029. 23, 523 List the prime factors of 513. 3, 19 What are the prime factors of 13892? 2, 23, 151 What are the prime factors of 4973? 4973 What are the prime factors of 5601? 3, 1867 What are the prime factors of 1033? 1033 What are the prime factors of 1367? 1367 What are the prime factors of 24152? 2, 3019 What are the prime factors of 1955? 5, 17, 23 What are the prime factors of 552? 2, 3, 23 List the prime factors of 865. 5, 173 List the prime factors of 1253. 7, 179 What are the prime factors of 11540? 2, 5, 577 List the prime factors of 655. 5, 131 List the prime factors of 16810. 2, 5, 41 List the prime factors of 26188. 2, 6547 What are the prime factors of 7225? 5, 17 List the prime factors of 27339. 3, 13, 701 List the prime factors of 1299. 3, 433 List the prime factors of 1646. 2, 823 What are the prime factors of 27417? 3, 13, 19, 37 List the prime factors of 492. 2, 3, 41 List the prime factors of 23326. 2, 107, 109 What are the prime factors of 7487? 7487 List the prime factors of 179890. 2, 5, 17989 List the prime factors of 642. 2, 3, 107 List the prime factors of 70885. 5, 14177 List the prime factors of 773. 773 What are the prime factors of 56996? 2, 14249 What are the prime factors of 145118? 2, 72559 What are the prime factors of 43420? 2, 5, 13, 167 List the prime factors of 311. 311 What are the prime factors of 13344? 2, 3, 139 What are the prime factors of 20632? 2, 2579 What are the prime factors of 84044? 2, 21011 List the prime factors of 70552. 2, 8819 What are the prime factors of 17692? 2, 4423 List the prime factors of 47742. 2, 3, 73, 109 What are the prime factors of 34952? 2, 17, 257 List the prime factors of 3970. 2, 5, 397 List the prime factors of 1772. 2, 443 List the prime factors of 1252. 2, 313 What are the prime factors of 3913? 7, 13, 43 What are the prime factors of 2833? 2833 What are the prime factors of 925? 5, 37 What are the prime factors of 41388? 2, 3, 3449 What are the prime factors of 20957? 19, 1103 List the prime factors of 2644. 2, 661 What are the prime factors of 1986? 2, 3, 331 What are the prime factors of 22285? 5, 4457 List the prime factors of 12313. 7, 1759 List the prime factors of 8178. 2, 3, 29, 47 What are the prime factors of 4319? 7, 617 What are the prime factors of 119055? 3, 5, 7937 What are the prime factors of 1791? 3, 199 List the prime factors of 231. 3, 7, 11 What are the prime factors of 945? 3, 5, 7 List the prime factors of 4808. 2, 601 List the prime factors of 150. 2, 3, 5 List the prime factors of 60720. 2, 3, 5, 11, 23 List the prime factors of 26511. 3, 8837 List the prime factors of 207. 3, 23 List the prime factors of 322. 2, 7, 23 What are the prime factors of 67769? 13, 401 What are the prime factors of 88960? 2, 5, 139 What are the prime factors of 4813? 4813 What are the prime factors of 23346? 2, 3, 1297 What are the prime factors of 33347? 33347 List the prime factors of 6614. 2, 3307 What are the prime factors of 3200? 2, 5 List the prime factors of 4142. 2, 19, 109 List the prime factors of 960. 2, 3, 5 What are the prime factors of 20180? 2, 5, 1009 List the prime factors of 9028. 2, 37, 61 What are the prime factors of 409? 409 What are the prime factors of 3156? 2, 3, 263 What are the prime factors of 278? 2, 139 List the prime factors of 430. 2, 5, 43 What are the prime factors of 8	{ "pile_set_name": "DM Mathematics" }
211l? 882.11 How many hours are there in twelve sevenths of a week? 288 How many grams are there in 995.6488mg? 0.9956488 What is six fifths of a hour in seconds? 4320 What is fifty-four fifths of a gram in milligrams? 10800 How many millilitres are there in thirteen fifths of a litre? 2600 How many kilograms are there in seven eighths of a tonne? 875 Convert 0.7473308 millilitres to litres. 0.0007473308 What is 4415.053um in kilometers? 0.000004415053 What is 1/4 of a day in hours? 6 What is 17/2 of a litre in millilitres? 8500 What is 21/5 of a centimeter in micrometers? 42000 What is twenty-seven quarters of a meter in millimeters? 6750 What is 3/10 of a litre in millilitres? 300 Convert 62731.06 weeks to seconds. 37939745088 How many centimeters are there in 4.924707um? 0.0004924707 How many micrometers are there in 1/4 of a millimeter? 250 Convert 816846.9 millennia to months. 9802162800 How many millilitres are there in one tenth of a litre? 100 How many decades are there in 0.0345757 years? 0.00345757 Convert 120.1287s to minutes. 2.002145 How many centuries are there in 0.7788659 millennia? 7.788659 How many centuries are there in 37906.55 years? 379.0655 How many microseconds are there in twenty-one halves of a millisecond? 10500 Convert 85398.32 hours to milliseconds. 307433952000 What is 935145.5l in millilitres? 935145500 Convert 140950.1km to meters. 140950100 How many grams are there in 45/2 of a kilogram? 22500 What is twenty-two ninths of a day in minutes? 3520 How many kilograms are there in 8338.86t? 8338860 Convert 6.347002l to millilitres. 6347.002 What is 1/100 of a millimeter in nanometers? 10000 How many months are there in 45/4 of a decade? 1350 What is 1/5 of a second in milliseconds? 200 Convert 4079.477 decades to millennia. 40.79477 How many microseconds are there in seventeen halves of a millisecond? 8500 What is 2/15 of a minute in milliseconds? 8000 What is 76.20974 centimeters in millimeters? 762.0974 What is 93.32102 millilitres in litres? 0.09332102 What is 6/5 of a litre in millilitres? 1200 What is 89112.12 decades in years? 891121.2 Convert 0.9926014 millilitres to litres. 0.0009926014 How many minutes are there in 2/105 of a week? 192 How many kilograms are there in 700664.7 grams? 700.6647 How many months are there in 11/2 of a millennium? 66000 How many millimeters are there in one tenth of a kilometer? 100000 What is 5.126313 milliseconds in seconds? 0.005126313 How many micrograms are there in 1506.26t? 1506260000000000 How many millimeters are there in thirty-seven halves of a meter? 18500 How many micrograms are there in 2.080794 nanograms? 0.002080794 How many millilitres are there in 61/4 of a litre? 15250 How many months are there in 0.8388157 years? 10.0657884 How many millilitres are there in twenty-seven quarters of a litre? 6750 What is 546972.6 litres in millilitres? 546972600 Convert 0.9826939mm to nanometers. 982693.9 How many litres are there in 0.4023202 millilitres? 0.0004023202 How many seconds are there in 129865.5ns? 0.0001298655 How many millilitres are there in 21/2 of a litre? 10500 How many years are there in sixty-nine halves of a millennium? 34500 Convert 940.1306ml to litres. 0.9401306 What is 3/40 of a gram in milligrams? 75 How many months are there in 25/8 of a century? 3750 How many micrometers are there in three sixteenths of a centimeter? 1875 What is 1/4 of a century in years? 25 What is 0.7370956 minutes in milliseconds? 44225.736 What is 818316.5g in kilograms? 818.3165 How many decades are there in six fifths of a century? 12 What is 146.9332nm in kilometers? 0.0000000001469332 What is 7/2 of a second in milliseconds? 3500 Convert 3.913032 millilitres to litres. 0.003913032 How many months are there in 3.54298 centuries? 4251.576 How many minutes are there in thirty-one fifths of a hour? 372 How many nanometers are there in 6238.149 meters? 6238149000000 How many millilitres are there in one tenth of a litre? 100 What is 6/25 of a centimeter in micrometers? 2400 Convert 4.46576ml to litres. 0.00446576 Convert 618.9736 litres to millilitres. 618973.6 What is 391082.4 years in decades? 39108.24 What is 665705.97 minutes in days? 462.2958125 How many millennia are there in 1896.534 months? 0.1580445 How many litres are there in 27446.71ml? 27.44671 How many months are there in one sixth of a millennium? 2000 What is 321.6581 meters in centimeters? 32165.81 How many micrograms are there in three tenths of a milligram? 300 How many nanograms are there in 11/4 of a microgram? 2750 What is thirteen quarters of a litre in millilitres? 3250 Convert 107.9682 meters to micrometers. 107968200 What is 949.6642kg in grams? 949664.2 What is 11/4 of a micrometer in nanometers? 2750 How many years are there in 1.567521 millennia? 1567.521 How many milligrams are there in one sixteenth of a kilogram? 62500 What is 6/5 of a centimeter in millimeters? 12 What is 179.7691266 milliseconds in weeks? 0.0000002972373125 What is 3/25 of a meter in millimeters? 120 How many millilitres are there in 3642.801 litres? 3642801 How many kilometers are there in 0.1937402mm? 0.0000001937402 What is 28722.1 centimeters in meters? 287.221 How many nanoseconds are there in 285066.8 weeks? 172408400640000000000 How many microseconds are there in 77582.37 days? 6703116768000000 What is 53/5 of a microsecond in nanoseconds? 10600 What is 7.83767l in millilitres? 7837.67 How many kilograms are there in 49943.16 micrograms? 0.00004994316 What is one quarter of a kilogram in grams? 250 Convert 3.430938l to millilitres. 3430.938 How many kilometers are there in 3693.612cm? 0.03693612 What is thirteen fifths of a microgram in nanograms? 2600 Convert 208843.02 minutes to hours. 3480.717 How many milliseconds are there in 7.0028 hours? 25210080 How many nanometers are there in 21/8 of a micrometer? 2625 How many millilitres are there in nine tenths of a litre? 900 What is thirty-two fifths of a litre in millilitres? 6400 How many nanograms are there in twenty-nine halves of a microgram? 14500 How many millennia are there in 294848.8 years? 294.8488 How many seconds are there in 9/10 of a day? 77760 How many micrograms are there in 27/4 of a milligram? 6750 What is four thirds of a hour in seconds? 4800 What is 1/5 of a microgram in nanograms? 200 What is 1/45 of a hour in milliseconds? 80000 How many millilitres are there in 1623.13 litres? 1623130 How many kilograms are there in 4675.455ng? 0.000000004675455 How many millilitres are there in 444.704l? 444704 What is eight fifteenths of a century in months? 640 What is 572.0836ug in nanograms? 572083.6 What is one fifth of a century in years? 20 How many hours are there in 58/3 of a week? 3248 How many micrometers are there in twenty-nine fifths of a centimeter? 58000 Convert 68.5087ns to milliseconds. 0.0000685087 What is 15332.004 months in centuries? 12.77667 What is 27/5 of a litre in millilitres? 5400 What is thirty-one halves of a micrometer in nanometers? 15500 What is one sixth of a millennium in months? 2000 What is 237.2 microseconds in milliseconds? 0.2372 What is 0.486488 kilometers in meters? 486.488 How many months are there in sixty-seven fifths of a century? 16080 What is 21/5 of a microgram in nanograms? 4200 What is fourty-five eighths of a millennium in months? 67500 How many years are there in 12/25 of a millennium? 480 What is one tenth of a millennium in years? 100 What is 0.1259961ug in tonnes? 0.0000000000001259961 How many months are there in 3.201987 years? 38.423844 What is 5/4 of a millimeter in micrometers? 1250 What is 68/9 of a day in minutes? 10880 How many meters are there in five quarters of a kilometer? 1250 What is 0.634043cm in nanometers? 6340430 How many months are there in thirty-one halves of a century? 18600 How many litres are there in 0.2979 millilitres? 0.0002979 What is 21/8 of a litre in millilitres? 2625 How many milligrams are there in 11/4 of a gram? 2750 How many decades are there in 3/10 of a century? 3 What is 5288.021 nanoseconds in microseconds? 5.288021 What is 177764.5 hours in minutes? 10665870 What is seven thirds of a hour in minutes? 140 What is 1/4 of a kilogram in grams? 250 What is 5/4 of a centu	{ "pile_set_name": "DM Mathematics" }
Do 2533/2 and 1267 have the same value? False Which is bigger: -270221 or -270223? -270221 Is 673804 >= 673803? True Is 5.7 greater than or equal to 1795? False Is 126207 >= 126209? False Which is smaller: 11781 or 1/16? 1/16 Is -841 at least 2? False Which is smaller: -0.0587 or -2/717? -0.0587 Which is smaller: 10/2167 or -0.116? -0.116 Is -1 bigger than 1/389097? False Which is bigger: 0 or 9/197911? 9/197911 Is -3734 != -3723? True Which is smaller: -190/39 or 1/6? -190/39 Is -12 less than or equal to 132222? True Which is smaller: -9580 or -9544? -9580 Is 1/5 >= 2/273091? True Which is greater: -0.2 or 6964? 6964 Is 5941 at least as big as 5945? False Is -3/55 greater than or equal to -1531? True Is -31011 smaller than -31042? False Which is smaller: -57817 or -57819? -57819 Which is smaller: -961 or -2032? -2032 Which is greater: -2502 or -1385? -1385 Is 1641/343 bigger than 5? False Which is bigger: 0 or -1/69583? 0 Is 101371 bigger than 101368? True Is 0.2 bigger than 35/42614? True Is 1 >= 344/5069? True Is 194 > 90? True Which is bigger: 1484 or 10382/7? 1484 Which is bigger: 3/112 or -800? 3/112 Which is smaller: 23102/185 or 124? 124 Is 30981 smaller than 30983? True Which is greater: 1714 or 1766? 1766 Which is greater: 802 or 25695/32? 25695/32 Does -145850 = -145849? False Is 99569 > 99570? False Are 9243 and 9245 equal? False Is -44306 smaller than -44303? True Which is smaller: 22651 or -4? -4 Which is greater: 0 or -763/521? 0 Which is bigger: 30210 or 120835/4? 30210 Is 84/73223 not equal to 0? True Which is greater: -269167 or -269177? -269167 Which is bigger: 3216/37 or 86? 3216/37 Which is greater: -54157 or -54156? -54156 Is -464 greater than 6? False Is -2451 at least as big as -2451? True Which is greater: -1 or 1/77823? 1/77823 Which is smaller: -50 or 512? -50 Is 78766/3 at least as big as 26255? True Is -25/1921 less than -1? False Which is bigger: 1008/5105 or -1? 1008/5105 Which is smaller: 1982325 or 3? 3 Are 0 and 11/50665 unequal? True Which is greater: 868 or -17? 868 Are 2/10730049 and 0 non-equal? True Which is smaller: -6127/674 or -9? -6127/674 Which is bigger: -41 or -1283? -41 Which is bigger: 40 or 15985/404? 40 Which is smaller: -47617 or -619024/13? -619024/13 Is -203037 at least -203034? False Is 0 at least as big as 337/326? False Is 52/789 equal to 1? False Do 9012/29 and 312 have different values? True Do 0.057 and 295 have the same value? False Which is greater: -75799 or -75800? -75799 Which is bigger: -0.14 or 3410? 3410 Which is smaller: 5/5931676 or -1? -1 Is -1 less than 5/837577? True Is -29/132773 smaller than -1? False Which is greater: 2/69 or 4339? 4339 Is 20312 > 20322? False Is -1 > -4/65035? False Are -907 and -838 unequal? True Is 86089 smaller than 86089? False Is 3 bigger than 2116/1203? True Which is greater: 13716990 or 0? 13716990 Which is smaller: 120307/4 or 30077? 120307/4 Is -153635 greater than or equal to -153635? True Is -1 less than or equal to -62625/11? False Is -1/12 at most as big as -155.606? False Which is smaller: -20/474489 or 1? -20/474489 Is 1548509 <= 1548509? True Which is smaller: 497 or 7? 7 Which is greater: -374227 or -374225? -374225 Does 2547483 = 2547483? True Which is bigger: -36/86125 or 1? 1 Which is smaller: -1831 or -129972/71? -1831 Which is smaller: 1749483 or 1749482? 1749482 Do 111255/8 and 13907 have the same value? False Which is smaller: -15/9899 or 1? -15/9899 Is 0.1 < 14348579? True Is 59025 at most as big as 59025? True Which is smaller: 55544 or 388818/7? 55544 Is 3410 less than 3662? True Which is smaller: -73.0472 or 1/3? -73.0472 Is 2 equal to 0.573? False Which is smaller: 22684 or 22685? 22684 Is 5470790 bigger than 5470790? False Is -9/690148 >= 1? False Are 1909 and 1943 non-equal? True Do -2512.1 and 4 have the same value? False Is 37440 equal to 112316/3? False Which is bigger: 1569 or -0.004? 1569 Which is smaller: 3 or -156370? -156370 Is 160/1793 != -1? True Is 56708 greater than or equal to 56712? False Which is greater: -141768 or -141767? -141767 Which is greater: -2/5 or 18139? 18139 Is 1543334 != 1543336? True Which is smaller: 923 or -2/331? -2/331 Is 8709 > 8829? False Which is smaller: -7822 or -4? -7822 Which is smaller: 10.5 or -152/241? -152/241 Which is smaller: 499 or 298? 298 Are 3 and 1026/391 nonequal? True Which is smaller: 992 or 1843? 992 Which is smaller: -2/1702351 or 1? -2/1702351 Which is greater: 1 or 17582? 17582 Is 1 at least 36556? False Which is greater: 5/63 or 1/2556? 5/63 Which is greater: 1 or -124/497? 1 Is -1 equal to -3/353512? False Is 1/5 at least as big as 11666/27? False Is -1/3921401 not equal to 0? True Is -907 smaller than -1058? False Is -0.1 <= 678368? True Is 14972 at least 44915/3? True Is 14.1843 <= 4/3? False Which is smaller: 492 or 17681/36? 17681/36 Is 11 > 821/66? False Is 296517 at least as big as 16? True Is -8782 smaller than -8781? True Is -12642/5 at most -0.1? True Which is smaller: -13/2419 or -1? -1 Is -792 smaller than -737? True Which is smaller: -1877 or -357? -1877 Which is bigger: -4/23 or 3/182? 3/182 Is 8775 <= 8385? False Which is bigger: 1 or -2/694875? 1 Does 1/28 = -0.02501? False Is 855 at most as big as 1/4? False Is 255/77233 less than -1? False Is 0 smaller than -21/588629? False Which is greater: -4627 or -23133/5? -23133/5 Is -14130 > -14123? False Which is bigger: -1/95011 or 0? 0 Which is greater: -3/7917385 or -1? -3/7917385 Do -1 and -2/414831 have the same value? False Which is bigger: 1054130 or 1054131? 1054131 Is 0 smaller than 294/701? True Which is smaller: -2/457 or -631? -631 Which is greater: 2176 or 2503? 2503 Are -677667 and -677667 nonequal? False Is 127/3967 at least 0? True Which is smaller: -3/70 or -33? -33 Is -2/8351 at least -2/37? True Are 2/15459 and 0 non-equal? True Which is smaller: 368 or 8075/22? 8075/22 Which is bigger: -2035/24 or -84? -84 Is -947592 greater than or equal to 1/2? False Which is greater: -2/11 or 0.16571? 0.16571 Is -6513757 equal to -6513756? False Is 667 at least 510? True Which is smaller: 25/3739 or -1? -1 Are -1 and -178/511 unequal? True Is -2/278643 greater than or equal to -1? True Which is smaller: 366413 or 366411? 366411 Do -3 and 17811 have the same value? False Do 14398 and 14391 have different values? True Are -898 and 13 equal? False Which is smaller: 343.716 or 3? 3 Is -0.2 less than or equal to -3112? False Is -10 greater than -3757/7? True Which is smaller: 1 or -182/22821? -182/22821 Is 0.1 at most as big as -111280? False Which is bigger: -3508 or -2065? -2065 Which is greater: 10.7 or 0.46? 10.7 Are 9252 and 0.1 nonequal? True Is -1655 > 72? False Which is bigger: 1 or 1909/7471? 1 Do -6312/1901 and -3 have the same value? False Is 50/468747 less than 0? False Which is smaller: -6172 or -6178? -6178 Is 118233 != 236467/2? True Is 0.06497 less than -2/95? False Which is bigger: -631/9 or -69? -69 Which is greater: -116492/5 or -23298? -23298 Which is bigger: 298 or 10101/34? 298 Which is smaller: 0 or 6/511? 0 Which is smaller: -38219 or -38216? -38219 Which is smaller: -1085/442 or 1? -1085/442 Is 29717 > 1/2? True Which is smaller: -1 or 4/4523171? -1 Are -144392 and 0 equal? False Which is greater: -1/4 or 174667? 174667 Which is greater: -31317 or -31318? -31317 Are 5314 and 0.06 equal? False Is -12689/156 at most as big as -82? False Is 9640 greater than or equal to 9640? True Is -0.013 greater than or equal to 1149? False Is 2910 >= 4/21? True Are 493/93 and 6 equal? False Do 20/34847 and 1 have different values? True Do 3/26 and 1502 have the same value? False Is 3143 >= 3122? True Which is smaller: -2461223 or -2461221? -2461223 Which is smaller: -0.1 or -1884856? -1884856 Is -2 bigger than -12396? True Which is smaller: 1 or -9/117362? -9/117362 Which is smaller: 232893 or 232895? 232893 Is 0.1 >= 7807? False Is 18/25517 at least -1? True Which is smaller: -975065 or -975063? -975065 Is -8 greater than -1296/187? False Which is greater: -48718 or -48716? -48716 Is 14618 greater than 33? True Is -2/123169 at least as big as -1? True Which is greater: 6674 or 6621? 6674 Which is greater: 29.9 or 79? 79 Which is greater: -14605 or -58425/4? -14605 Which is smaller: -1964	{ "pile_set_name": "DM Mathematics" }
272. 272 Calculate the highest common divisor of 175 and 88975. 25 What is the highest common divisor of 667544 and 8? 8 What is the greatest common divisor of 2160 and 11760? 240 What is the highest common divisor of 5228928 and 216? 216 Calculate the greatest common factor of 2246811 and 10185. 2037 What is the greatest common factor of 102899 and 43? 43 Calculate the greatest common divisor of 2312 and 115022. 578 Calculate the highest common factor of 383320 and 280. 280 What is the greatest common divisor of 2860 and 250780? 20 Calculate the highest common factor of 1310 and 50042. 262 Calculate the greatest common divisor of 299 and 12765. 23 Calculate the greatest common factor of 795 and 111565. 265 Calculate the greatest common factor of 61128 and 648. 216 Calculate the greatest common divisor of 179 and 398. 1 Calculate the greatest common factor of 63240 and 8959. 527 What is the highest common factor of 223328 and 3136? 224 What is the highest common divisor of 1353 and 1312? 41 Calculate the greatest common divisor of 39 and 1451151. 39 Calculate the highest common factor of 405 and 3916215. 135 What is the highest common divisor of 363 and 41140? 121 Calculate the greatest common factor of 2081 and 3385787. 2081 What is the greatest common factor of 21370 and 2590? 10 What is the greatest common factor of 414 and 4342722? 138 Calculate the highest common factor of 3675 and 13524. 147 What is the greatest common divisor of 776356 and 3029? 233 Calculate the greatest common factor of 119 and 48008. 17 What is the highest common factor of 498 and 308594? 166 Calculate the highest common divisor of 67 and 11658. 67 What is the greatest common factor of 15762 and 55500? 222 What is the greatest common divisor of 2755 and 440610? 95 Calculate the highest common divisor of 6030 and 4500. 90 What is the greatest common factor of 961 and 6944? 31 Calculate the greatest common divisor of 8 and 87910. 2 Calculate the highest common divisor of 464 and 35136. 16 What is the greatest common factor of 1617 and 69762? 231 Calculate the highest common factor of 3048 and 156. 12 Calculate the greatest common divisor of 880 and 19056. 16 Calculate the greatest common divisor of 18 and 264951. 9 Calculate the greatest common divisor of 14 and 46878. 2 Calculate the highest common divisor of 2184 and 39858. 546 What is the greatest common divisor of 3708 and 516? 12 What is the highest common divisor of 1940572 and 284? 284 Calculate the greatest common factor of 47276 and 6913. 223 Calculate the greatest common divisor of 1352540 and 10. 10 Calculate the highest common factor of 175548 and 60. 12 Calculate the highest common factor of 588 and 123284. 196 Calculate the highest common factor of 31655 and 156. 13 Calculate the highest common divisor of 1052973 and 118. 59 What is the greatest common factor of 6390 and 95140? 710 What is the highest common divisor of 58247 and 1484? 371 What is the highest common factor of 280 and 318500? 140 What is the greatest common factor of 328094 and 52? 26 Calculate the greatest common divisor of 2491 and 5452. 47 What is the greatest common factor of 3212 and 396? 44 What is the highest common factor of 71118 and 14310? 54 Calculate the highest common divisor of 5088 and 4992. 96 Calculate the greatest common factor of 201062 and 24503. 229 What is the greatest common divisor of 80 and 13860? 20 Calculate the greatest common factor of 48 and 277968. 48 Calculate the highest common divisor of 429000 and 228. 12 What is the greatest common factor of 1242 and 693? 9 What is the highest common factor of 113728 and 288? 32 Calculate the greatest common divisor of 374382 and 558. 18 What is the highest common divisor of 549340 and 11? 11 Calculate the greatest common divisor of 1518 and 363660. 66 Calculate the greatest common factor of 2183863 and 11. 11 Calculate the highest common divisor of 802587 and 408. 51 Calculate the greatest common divisor of 28 and 3114076. 28 What is the greatest common divisor of 44871 and 30? 3 Calculate the greatest common factor of 872965 and 230. 115 What is the highest common factor of 5 and 1145? 5 What is the greatest common divisor of 328041 and 882? 63 Calculate the highest common divisor of 202672 and 208. 16 What is the highest common factor of 1845 and 809135? 205 What is the highest common divisor of 632 and 61? 1 Calculate the highest common divisor of 1991 and 605. 11 Calculate the greatest common factor of 14768 and 112. 16 What is the greatest common divisor of 119760 and 240? 240 Calculate the highest common divisor of 2568 and 4006936. 856 What is the greatest common divisor of 9264 and 698274? 1158 What is the greatest common divisor of 16789075 and 106? 53 What is the highest common divisor of 73 and 3577? 73 What is the highest common factor of 924 and 12089? 77 What is the greatest common factor of 298 and 150341? 149 What is the greatest common divisor of 14379 and 81? 3 What is the greatest common factor of 431410 and 105? 35 Calculate the highest common divisor of 404 and 5. 1 Calculate the highest common factor of 16318 and 2747. 41 What is the highest common divisor of 64 and 232? 8 What is the greatest common factor of 5123851 and 17? 17 Calculate the greatest common factor of 8 and 419824. 8 What is the greatest common divisor of 364010 and 534? 178 Calculate the highest common divisor of 315742 and 266. 266 Calculate the highest common divisor of 173224 and 4012. 236 What is the highest common divisor of 5575 and 18050? 25 Calculate the greatest common divisor of 1113241 and 31. 31 Calculate the highest common factor of 44514 and 162. 18 Calculate the highest common divisor of 888 and 334036. 148 What is the greatest common divisor of 3995 and 1734? 17 What is the greatest common divisor of 176 and 18491? 11 What is the greatest common factor of 13 and 1194271? 13 What is the highest common factor of 455 and 55315? 65 Calculate the greatest common divisor of 243 and 8235. 27 What is the greatest common divisor of 1831310 and 10? 10 Calculate the greatest common factor of 5588687 and 13. 13 What is the highest common divisor of 1027 and 1391? 13 What is the highest common divisor of 30 and 1735815? 15 What is the highest common divisor of 5984 and 891? 11 Calculate the highest common divisor of 476907 and 213. 213 What is the highest common factor of 1426 and 21886? 62 What is the greatest common divisor of 13757 and 9? 1 What is the highest common divisor of 28480 and 10? 10 What is the greatest common factor of 87 and 2822686? 29 What is the greatest common factor of 216 and 20556? 36 Calculate the greatest common divisor of 282502 and 418. 22 Calculate the greatest common divisor of 6506 and 104. 2 Calculate the highest common divisor of 263887 and 9575. 383 What is the highest common factor of 406 and 3422? 58 What is the greatest common divisor of 46609 and 1468? 367 Calculate the highest common divisor of 149719 and 272. 17 What is the highest common factor of 4864 and 55296? 256 Calculate the highest common factor of 6766 and 124574. 398 Calculate the highest common divisor of 1225 and 16415. 245 What is the greatest common divisor of 1270152 and 138? 138 What is the highest common divisor of 10 and 333170? 10 Calculate the highest common divisor of 57729 and 21. 21 Calculate the greatest common divisor of 1584 and 172359. 99 What is the highest common divisor of 384 and 681984? 384 What is the highest common factor of 96 and 1356756? 12 Calculate the greatest common divisor of 3247 and 187. 17 What is the greatest common divisor of 65567 and 692? 173 Calculate the highest common factor of 1616 and 4498944. 1616 What is the highest common factor of 40368 and 288? 48 What is the greatest common divisor of 131588 and 804? 268 What is the greatest common divisor of 16315 and 351? 13 What is the greatest common factor of 61344 and 3195? 639 What is the greatest common divisor of 13 and 11141? 13 Calculate the greatest common divisor of 1544866 and 214. 214 What is the highest common factor of 45 and 3092031? 9 What is the highest common divisor of 2516 and 1887? 629 What is the greatest common divisor of 1225 and 18475? 25 What is the greatest comm	{ "pile_set_name": "DM Mathematics" }
? True Is -209 bigger than 2/7? False Are -2/5 and -0.1 nonequal? True Are 0 and -1/312 unequal? True Does 4801 = 4801? True Which is bigger: -4/771 or 0? 0 Which is smaller: -31 or -72? -72 Which is smaller: -1661 or -1660? -1661 Which is greater: 132/5 or -3? 132/5 Is 46 at most 57? True Which is smaller: -0.06 or -0.039? -0.06 Which is smaller: 1023 or 4? 4 Is 1/2 not equal to -2/2869? True Is -2/427 <= 3.4? True Which is greater: -3/817 or 1? 1 Which is smaller: 7/450 or -1? -1 Are 4 and 1/12 equal? False Is -439 at least -416? False Which is greater: -27 or -136/5? -27 Which is smaller: 432 or 1729/4? 432 Are 3/44416 and 0 unequal? True Is 610/11 less than or equal to 54? False Is 1/183 bigger than 0.3? False Is 11 at least as big as 465/43? True Is 4/85 < 0? False Which is greater: -0.12402 or -1? -0.12402 Does -3609/2 = -1804? False Which is smaller: -735 or 1? -735 Is -393 at least as big as -390? False Which is bigger: -4381 or -4382? -4381 Do 948 and 945 have the same value? False Which is bigger: 3536 or 3538? 3538 Is -200 less than -200? False Which is smaller: 1.7 or -18? -18 Is 21106 <= 21106? True Which is bigger: -27 or -86? -27 Does 1 = 10/473? False Which is smaller: 19 or -3/2? -3/2 Is -24 >= -19? False Which is smaller: -44/85 or -2? -2 Is 33 greater than -107? True Is 2/5869 equal to 1? False Which is bigger: -26 or -4? -4 Is 1 != -2/971? True Is 102 != 1.9? True Is -18 at most as big as 1.3? True Is -15684 smaller than -15683? True Do -3900/23 and -170 have the same value? False Which is greater: 1494/19 or 78? 1494/19 Is -5740 <= -5740? True Are -1 and -5/602 equal? False Is 879 <= 1? False Is 76 at least 0.01? True Which is smaller: -0.1 or 19.4? -0.1 Is -2201 > -2201? False Which is smaller: 157/2 or 80? 157/2 Is -6 smaller than -1/16? True Which is greater: -132 or -87? -87 Which is bigger: 281 or 2809/10? 281 Does 0 = 3/766? False Are 453 and 454 non-equal? True Is 217 at most 1735/8? False Which is smaller: -14/13 or -2? -2 Which is smaller: 21 or 218/11? 218/11 Are 301 and 1/4 equal? False Are -439 and -441 non-equal? True Is 287 greater than 3? True Which is smaller: -933 or -2? -933 Which is smaller: -69/70 or -1? -1 Which is greater: -3 or -85/24? -3 Which is bigger: 1/999 or -1? 1/999 Is -37591 != -37591? False Which is bigger: 48/7 or 1.4? 48/7 Which is greater: 37 or 71? 71 Which is bigger: 131 or 118? 131 Which is smaller: 2.7 or 0.2? 0.2 Which is bigger: -78 or -0.2? -0.2 Is -1 greater than -8/29? False Which is smaller: 931 or 932? 931 Is -56/237 != -1? True Which is bigger: 22774 or 22773? 22774 Which is greater: -44 or -2/379? -2/379 Is -19/2 less than or equal to -9? True Is -1208 smaller than -1207? True Is -114/569 greater than 1? False Is -27 smaller than -0.03? True Does 9 = 95/12? False Is -590 less than -591? False Are 0.14117 and 0 equal? False Which is bigger: 0 or 2/8607? 2/8607 Which is smaller: 1009 or 1012? 1009 Is 48 less than 56? True Is 9 less than or equal to -0.0962? False Is -2499 > -2499? False Does 0 = -2/671? False Which is greater: 0 or -3/226? 0 Is -637 equal to -637? True Which is smaller: 105 or 104? 104 Is -1089 != -1091? True Is -636 at most -639? False Is -8 greater than -13? True Which is greater: 29 or 250/9? 29 Which is greater: -1 or 127/420? 127/420 Which is smaller: -25 or -38? -38 Are 751 and 765 unequal? True Do -467 and -467 have the same value? True Is 231 at least as big as 232? False Which is smaller: 1044 or 1046? 1044 Is 6 at least as big as -198? True Is 41 <= 1/19? False Which is greater: -6446 or -6447? -6446 Is 2 < -823/4? False Which is greater: -188 or -190? -188 Is 1 at least -14? True Which is greater: 2 or 11/21? 2 Is -3147 smaller than -3147? False Which is smaller: 1 or -7/281? -7/281 Is 77/83 at most 1? True Which is smaller: 3 or 1099? 3 Which is smaller: 2/29 or -10? -10 Which is bigger: 1033 or -1/4? 1033 Is 0 bigger than -6972/23? True Is -1/3 equal to -17211? False Which is smaller: 12 or 3? 3 Which is smaller: -1/2 or 184.7? -1/2 Do 0.1 and 1/72 have the same value? False Which is greater: -782 or -774? -774 Is -109 != 9? True Which is smaller: -9/88 or 0? -9/88 Which is smaller: 78 or 703/9? 78 Is -10/179 >= -1? True Is 0.1615 greater than or equal to 2/3? False Which is bigger: 0 or 14/41? 14/41 Which is greater: -169 or -20? -20 Which is smaller: -3 or 4953? -3 Is 2.6 >= -6? True Is 28 greater than 17? True Is -0.3 at least as big as 6/97? False Is -11 at least as big as 3? False Do -12 and -150/13 have the same value? False Is -62.9 less than 0.1? True Which is bigger: -2 or 307? 307 Is 37 greater than 34? True Is 6911 at least as big as 6910? True Are 1 and -377/3 non-equal? True Is 3341 bigger than 3341? False Which is smaller: 0 or -1/281? -1/281 Is -277/49 less than -6? False Which is greater: -4/25975 or 1? 1 Which is greater: 121 or 28? 121 Is 0.15 >= 1.1? False Which is smaller: 0 or -1/11287? -1/11287 Which is bigger: 967 or 10642/11? 10642/11 Are -1135 and 2/5 equal? False Which is smaller: 584 or 586? 584 Which is smaller: -0.1 or 0.39? -0.1 Is 44/95 > -1? True Which is smaller: 2117 or 0? 0 Is 0.525 greater than 2/7? True Is 663 >= 664? False Which is smaller: -127/3 or 2? -127/3 Is 5488 bigger than 5490? False Which is bigger: -4/21 or 0? 0 Which is bigger: 264 or 0.4? 264 Is -1 smaller than 142? True Is 2036 smaller than 4073/2? True Is 61/104 > 0? True Which is smaller: 1 or 19/4? 1 Is -4410 <= -0.2? True Which is smaller: -1899 or -1900? -1900 Is 2867/3 greater than or equal to 957? False Is 42 < -21? False Which is smaller: 159/2 or 80? 159/2 Which is smaller: -1/5 or 2210? -1/5 Do 210/19 and 11 have different values? True Which is bigger: -13449 or -13450? -13449 Is -60/229 less than -1? False Is -3927 bigger than -3926? False Is 2 less than 7/8? False Which is smaller: 6483 or 6485? 6483 Is 1 smaller than 133.8? True Which is smaller: 10562 or 10563? 10562 Which is greater: 4467 or 4469? 4469 Which is bigger: 187/27 or 6? 187/27 Which is greater: 2/113 or 48.3? 48.3 Is 2/435 greater than or equal to 0? True Does -399 = -396? False Is -6 not equal to -20? True Which is greater: 11 or 48? 48 Is 0.7 bigger than -3/14? True Is 0.06 at most -0.44? False Which is smaller: 3 or 52? 3 Which is smaller: 6654 or 6651? 6651 Which is greater: 2 or 14313? 14313 Which is smaller: 40 or 327/8? 40 Is 7/64 less than -0.1? False Which is smaller: 10 or 98.7? 10 Do 5/2003 and 1 have the same value? False Which is smaller: -1/11300 or 0? -1/11300 Is 207 less than 202? False Which is bigger: 16 or -44? 16 Does 748 = 748? True Which is smaller: 2/9 or 28.1? 2/9 Does -1.866 = 0.6? False Are 0 and 3/5350 nonequal? True Which is bigger: -1 or 67.6? 67.6 Is -1318/15 < -88? False Are 12355 and 12356 equal? False Which is greater: 712/5 or 4? 712/5 Is 2/7 > -12.284? True Which is greater: -12 or -67/5? -12 Are -144 and -143 equal? False Which is smaller: -51 or -52? -52 Does -1/350 = 1? False Which is bigger: -38 or -42? -38 Which is greater: 1335 or 1338? 1338 Which is greater: -319 or -2? -2 Is 0 equal to -9/245? False Which is greater: 41 or 34? 41 Is 1562 less than 1564? True Which is bigger: 1/109 or 1? 1 Does 7725 = 7725? True Which is smaller: -58/15 or -3? -58/15 Are 289 and 216 equal? False Are 206 and 208 non-equal? True Is 194/29 > 7? False Which is greater: -1 or 22/405? 22/405 Is -11 greater than or equal to 27? False Which is bigger: -3 or -0.09? -0.09 Which is smaller: 1609 or 1608? 1608 Which is smaller: -2972 or -2970? -2972 Is -664 >= 2/5? False Which is bigger: 0 or -2/67? 0 Which is bigger: -1182 or -1180? -1180 Is -611/12 > -52? True Which is greater: -2275/2 or -1138? -2275/2 Which is smaller: 0 or -10.31? -10.31 Which is smaller: 1 or -8/169? -8/169 Are 31 and 121/4 unequal? True Do -525 and -525 have the same value? True Which is bigger: 0 or -44/51? 0 Is 0 less than 2/33093? True Is 508 at least 508? True Do -1317 and -1317 have different values? False Which is smaller: -5 or -0.6? -5 Is -22/29 bigger than 0? False Which is smaller: 222 or 226? 222 Which is bigger: 2/7 or 1/157? 2/7 Is -120/11 less than -11? False Is 1345/4 at most as big as 336? False Which is greater: 72 or -5.3? 72 Which is smaller: 1939 or 1943? 1939	{ "pile_set_name": "DM Mathematics" }
2 Sort -3, 1.44, -0.2, -2/3, 80, -0.4 in descending order. 80, 1.44, -0.2, -0.4, -2/3, -3 Put 3, 0, 24 in increasing order. 0, 3, 24 Put -0.3, -2/13, -273, -86, -0.04 in decreasing order. -0.04, -2/13, -0.3, -86, -273 Sort -346, 19, -3, 5, 2 in ascending order. -346, -3, 2, 5, 19 Put -4, -16, -1, -145, 2, -5 in decreasing order. 2, -1, -4, -5, -16, -145 Sort 0.2, -146, -1.2, 4, 1, -3/2 in increasing order. -146, -3/2, -1.2, 0.2, 1, 4 Sort -30, -5, -2, 0, -4, -607 in decreasing order. 0, -2, -4, -5, -30, -607 Sort 1, 5, -7, 4, -8, -3 in decreasing order. 5, 4, 1, -3, -7, -8 Put -2/11, 37, -3/8, 0.2, 4 in ascending order. -3/8, -2/11, 0.2, 4, 37 Sort 9, -276, 3, 5, -6 in ascending order. -276, -6, 3, 5, 9 Sort -3, -1/5, 1, -2/299, 0, 0.2 in ascending order. -3, -1/5, -2/299, 0, 0.2, 1 Sort 180, 5, -704, 2. -704, 2, 5, 180 Put 0, 3, -2, -5, 1, -14 in increasing order. -14, -5, -2, 0, 1, 3 Sort -14, 4, -1, -3/4, 309, 0.8 in ascending order. -14, -1, -3/4, 0.8, 4, 309 Sort 0.13, 156, 63 in ascending order. 0.13, 63, 156 Put -42, 24, -0.1, 4/5 in descending order. 24, 4/5, -0.1, -42 Put 1, -8054, -1/12 in increasing order. -8054, -1/12, 1 Sort -4, -2, 2, 240. -4, -2, 2, 240 Sort 4, -5, -17, -3, -1, 61. -17, -5, -3, -1, 4, 61 Put 14, 5, 3, -10 in descending order. 14, 5, 3, -10 Put 7, 3, 1, -135, 5 in decreasing order. 7, 5, 3, 1, -135 Sort -5, 2/35, 0, 447, 6. -5, 0, 2/35, 6, 447 Put -5/32, -4, -32, -1 in descending order. -5/32, -1, -4, -32 Put -0.24, -0.51, -46 in ascending order. -46, -0.51, -0.24 Sort -1, -2/7, 764, -5, -3/4 in ascending order. -5, -1, -3/4, -2/7, 764 Sort -0.3, 3, 4, 2, 110 in decreasing order. 110, 4, 3, 2, -0.3 Sort 449, 2, -437 in increasing order. -437, 2, 449 Put -1, 493, 38, -4 in descending order. 493, 38, -1, -4 Put -4, -22/9, 0.3, 0, -0.3 in descending order. 0.3, 0, -0.3, -22/9, -4 Put -2, 1, -16, -113 in increasing order. -113, -16, -2, 1 Sort 2/9, -293/5, -0.1, -1 in increasing order. -293/5, -1, -0.1, 2/9 Put 0, -0.4, 0.4, 2/19, -25, -0.16 in decreasing order. 0.4, 2/19, 0, -0.16, -0.4, -25 Sort -0.4, -0.5, 2564, -0.2 in increasing order. -0.5, -0.4, -0.2, 2564 Sort -4, 11, -19/6, 2 in decreasing order. 11, 2, -19/6, -4 Sort -3, -315, -4, -5, 5, 4 in descending order. 5, 4, -3, -4, -5, -315 Sort 1, 36816, -5 in increasing order. -5, 1, 36816 Put -13, 5771, 4, 1, 5, -3 in decreasing order. 5771, 5, 4, 1, -3, -13 Put -201, -7, -46 in increasing order. -201, -46, -7 Put 12, 0, 3, 1191, -0.5 in ascending order. -0.5, 0, 3, 12, 1191 Put -1, 27, -5, 7 in decreasing order. 27, 7, -1, -5 Put 0.31, 0.5, 2/3, 18, 2/11 in ascending order. 2/11, 0.31, 0.5, 2/3, 18 Sort -3, -1, -18280 in increasing order. -18280, -3, -1 Sort 4, 1, 1054, 0 in ascending order. 0, 1, 4, 1054 Sort 12, 4, 2/7, -4/25, -2 in decreasing order. 12, 4, 2/7, -4/25, -2 Sort -0.05, 2/23, -20, -14, -0.4. -20, -14, -0.4, -0.05, 2/23 Sort 1/4, 41/11, -152. -152, 1/4, 41/11 Sort 280519, -1, 0.5 in descending order. 280519, 0.5, -1 Sort -23, -456, 4 in decreasing order. 4, -23, -456 Put -1/4, -1.195, 0, 3, -1/8, -0.4 in increasing order. -1.195, -0.4, -1/4, -1/8, 0, 3 Sort 3/13333, 6, 0.3 in ascending order. 3/13333, 0.3, 6 Put 2, 1750, -1, -5 in decreasing order. 1750, 2, -1, -5 Put 7, 5, -2/15, 0.4 in increasing order. -2/15, 0.4, 5, 7 Sort -5, 64134, 0 in descending order. 64134, 0, -5 Sort 3, 4, 0, -1, -197, -5. -197, -5, -1, 0, 3, 4 Put 3, -20, -5, -22224 in decreasing order. 3, -5, -20, -22224 Sort 29, 88.7, -4, 2, -5, 1 in increasing order. -5, -4, 1, 2, 29, 88.7 Sort -39, 0, -29 in decreasing order. 0, -29, -39 Put 2/145, 1/25, -0.4 in decreasing order. 1/25, 2/145, -0.4 Sort -13413, -5, -151 in descending order. -5, -151, -13413 Sort 4, -1, -2, 8, 31. -2, -1, 4, 8, 31 Sort 1/634, -2, 5, 2/9, 0.4, 1/3. -2, 1/634, 2/9, 1/3, 0.4, 5 Put -2/23, 3, 5, -0.5, -5, 2/13 in descending order. 5, 3, 2/13, -2/23, -0.5, -5 Put 5, 139, -1, 18, 2 in ascending order. -1, 2, 5, 18, 139 Sort -5, 1, -2, -0.1195, -0.1. -5, -2, -0.1195, -0.1, 1 Sort 18, -1, 1, 53, -5 in decreasing order. 53, 18, 1, -1, -5 Put -711, -0.3, 4/7, 2, 0 in descending order. 2, 4/7, 0, -0.3, -711 Sort 1, -5, -4, -14, 0, -6 in increasing order. -14, -6, -5, -4, 0, 1 Sort 2/7, 3/5, -1/55, -259 in descending order. 3/5, 2/7, -1/55, -259 Put -20, 1, 5, 0, -867 in ascending order. -867, -20, 0, 1, 5 Sort 55, 0, 2, -113, 3, 4 in decreasing order. 55, 4, 3, 2, 0, -113 Put -0.03, -3/5, -3, -15/4, -4/7 in decreasing order. -0.03, -4/7, -3/5, -3, -15/4 Sort 35, -4, 5, -9, 2 in descending order. 35, 5, 2, -4, -9 Sort -5, 4, -0.19, 0.666. -5, -0.19, 0.666, 4 Put -4, 0.08, 67817 in increasing order. -4, 0.08, 67817 Put 5, -14, 189 in descending order. 189, 5, -14 Put 1, -77, -3, 139 in decreasing order. 139, 1, -3, -77 Sort 5, 724, -2 in descending order. 724, 5, -2 Sort 5, -135, -249 in descending order. 5, -135, -249 Sort -801, 14, 6, 4, 5 in descending order. 14, 6, 5, 4, -801 Sort 4, 48, -4, 45. -4, 4, 45, 48 Sort 406, 2, -3/5, 0.13 in ascending order. -3/5, 0.13, 2, 406 Sort -1, 3, -0.4, 315311. -1, -0.4, 3, 315311 Put 7, -3, 671, -18 in increasing order. -18, -3, 7, 671 Put -3, -64, 161, 4, 5 in increasing order. -64, -3, 4, 5, 161 Put 5, -1/3, 0.00073, 4, -0.2 in descending order. 5, 4, 0.00073, -0.2, -1/3 Put 0, 3, -2/102563 in descending order. 3, 0, -2/102563 Sort -4, -36, 423 in increasing order. -36, -4, 423 Put 1/90, 5, 1/6, 2, 2/15, 7/3 in decreasing order. 5, 7/3, 2, 1/6, 2/15, 1/90 Put 1/6, 1711, 393 in ascending order. 1/6, 393, 1711 Sort -263.1, -0.2, -0.062 in increasing order. -263.1, -0.2, -0.062 Put -8, -32, -5, 12, 1 in decreasing order. 12, 1, -5, -8, -32 Sort -5, -1, 120, 17 in increasing order. -5, -1, 17, 120 Sort 2, 60, 11, 17. 2, 11, 17, 60 Sort 5, 0, -1/13, 1/63 in descending order. 5, 1/63, 0, -1/13 Sort 82, 2, 4, 1, 3, -7 in descending order. 82, 4, 3, 2, 1, -7 Put 17/13, 0, 1, 5, -2, -3 in decreasing order. 5, 17/13, 1, 0, -2, -3 Sort 4285, -4, 1 in descending order. 4285, 1, -4 Sort -0.2, -47, -1/2, -2, 0 in ascending order. -47, -2, -1/2, -0.2, 0 Sort 0.1, -69700, -2/7, 2/11 in decreasing order. 2/11, 0.1, -2/7, -69700 Put -13, 5, 4, -27, -5, 17 in decreasing order. 17, 5, 4, -5, -13, -27 Put -530, -17, 2 in decreasing order. 2, -17, -530 Sort 1, -4, -1/4, -1.028, -3 in descending order. 1, -1/4, -1.028, -3, -4 Sort 2/3, 3/10, 435/8, -1/4 in decreasing order. 435/8, 2/3, 3/10, -1/4 Sort 3, -19718, 5 in descending order. 5, 3, -19718 Sort 18, -1, -0.41403 in ascending order. -1, -0.41403, 18 Sort -115, -4, 5, 3 in descending order. 5, 3, -4, -115 Put -0.2, -0.01, -0.171, 0, 4 in ascending order. -0.2, -0.171, -0.01, 0, 4 Sort -4, 0.062, 0, 5, -0.3 in descending order. 5, 0.062, 0, -0.3, -4 Put 2/11, 54205, -5 in increasing order. -5, 2/11, 54205 Put 62, 0, 829 in decreasing order. 829, 62, 0 Put 449, -1, 110/9 in descending order. 449, 110/9, -1 Sort 25, -160, 1/10, 0.4, -4, -3 in increasing order. -160, -4, -3, 1/10, 0.4, 25 Put -1706, -1, 4, -3 in decreasing order. 4, -1, -3, -1706 Sort -4, 39, -42, -23, 5, 1 in decreasing order. 39, 5, 1, -4, -23, -42 Sort 5, 4, 3, -2224. -2224, 3, 4, 5 Put -1, -344, -1/15, 4 in increasing order. -344, -1, -1/15, 4 Put 312, 1, 6, -5, 2, -26 in descending order. 312, 6, 2, 1, -5, -26 Sort 5/3, 4, 1.73, -2/5, -2/9, -3 in descending order. 4, 1.73, 5/3, -2/9, -2/5, -3 Sort -11, 6, -200. -200, -11, 6 Sort 3, 23, 120, -4, -18, 4 in increasing order. -18, -4, 3, 4, 23, 120 Sort -54, -5, 2, 323, -1 in descending order. 323, 2, -1, -5, -54 Sort -1, 8, -150, 0.3, -2/7 in decreasing order. 8, 0.3, -2/7, -1, -150 Sort -2, 1, -55/2, 4 in decreasing order. 4, 1, -2, -55/2 Sort -4, -1/5, 12, 15/71, 2/3, -5 in decreasing order. 12, 2/3, 15/71, -1/5, -4, -5 Sort 32, -593, 2, -3 in decreasing order. 32, 2, -3, -593 Sort 10, -51.7, -1/2, -2, 3, -5/2 in ascending order. -51.7, -5/2, -2, -1/2, 3, 10 Put 8, 2, 145, -549 in descending order. 145, 8, 2, -549 Sort 2, -6, 6, -13, 38. -13, -6, 2, 6, 38 Put 7/3, -3/5, -1/20, 19 in decreasing order. 19, 7/3, -1/20, -3/5 Put -1, -3, -0.31, -15/4 in decreasing order. -0.31, -1, -3, -15/4 Put -4, -40, -2227, -5 in increasing order. -2227, -40, -5, -4 Sort 13/31, -288, -0.2, 3 in increasing order. -288, -0.2, 13/31, 3	{ "pile_set_name": "DM Mathematics" }
t(3)/42 Simplify sqrt(95)/sqrt(125) + (1 + sqrt(19))3. 3 + 16sqrt(19)/5 Simplify ((-1 + sqrt(288) - sqrt(288) - sqrt(288) - sqrt(288)) + -5)*2. 288sqrt(2) + 1188 Simplify sqrt(5) + 1 + -3 + -1. -3 + sqrt(5) Simplify (-3 + (-3 + sqrt(2) + sqrt(8)/sqrt(4))-5-6)*2. -11160sqrt(2) + 15849 Simplify (-2 + sqrt(475) + sqrt(475) + -3)-4. -40sqrt(19) + 20 Simplify (sqrt(385)/sqrt(112))/((sqrt(88)/sqrt(2))/sqrt(4)). sqrt(5)/4 Simplify ((3sqrt(88)/sqrt(4) + sqrt(22))/(2sqrt(99) - sqrt(99) - sqrt(11)))*2-5. -40 Simplify (1 + sqrt(117) + 0 - ((sqrt(117) - (sqrt(117) + 0) - sqrt(117))-1 + sqrt(117)))2. -6sqrt(13) + 118 Simplify -2 + sqrt(2) + sqrt(2)-5 - -3sqrt(8)/sqrt(4). -2 - sqrt(2) Simplify 5sqrt(171)/(-2sqrt(9)). -5sqrt(19)/2 Simplify ((sqrt(1584) + (sqrt(1584)4 - sqrt(1584)))-2)2 - sqrt(1584). -12sqrt(11) + 101376 Simplify (4sqrt(156)-2)/(sqrt(48)1). -4sqrt(13) Simplify (-2(sqrt(171) + 1 + -1))2. 684 Simplify (sqrt(1377) - (1 + (sqrt(1377) - 4sqrt(1377) - sqrt(1377) - sqrt(1377)) + sqrt(1377)))*2. -90sqrt(17) + 34426 Simplify -3sqrt(1088) - (-2 + sqrt(17))-2. -22sqrt(17) - 4 Simplify (-6sqrt(88)3)/sqrt(8). -18sqrt(11) Simplify -2sqrt(931) + 5 + (6(1sqrt(19) + 4))2. 274sqrt(19) + 1265 Simplify ((sqrt(6) - (sqrt(216) + sqrt(6)))/sqrt(3))*2 - sqrt(4)/(2sqrt(2) + sqrt(2)). -sqrt(2)/3 + 72 Simplify (-3 + sqrt(500)-2)1. -20sqrt(5) - 3 Simplify ((-1 + sqrt(153) + 4)2 - sqrt(153)) + 3. 15sqrt(17) + 165 Simplify (sqrt(132) - 3sqrt(132)3)/((sqrt(132)-3)/sqrt(11)). 8sqrt(11)/3 Simplify sqrt(33)/(sqrt(48)-3). -sqrt(11)/12 Simplify -2sqrt(675). -30sqrt(3) Simplify -1 + ((1 + sqrt(7))-5 - (sqrt(1008) - (sqrt(1008) + sqrt(1008) + -1 + sqrt(1008))))5. -31 + 95sqrt(7) Simplify -42sqrt(720) + 4 + (sqrt(720) - (0 + sqrt(720)))*2 + -5. -96sqrt(5) - 1 Simplify (sqrt(75) - (-2sqrt(75) + sqrt(75)))5 - (2 + (sqrt(75) - (sqrt(75) + 0)))*2. -4 + 50sqrt(3) Simplify (-4 + (sqrt(19) + sqrt(76)/sqrt(4))6)1. -4 + 12sqrt(19) Simplify (sqrt(19) - (0 + sqrt(19)))4 + -5. -5 Simplify -3 + ((sqrt(242) + sqrt(242) + -1 + sqrt(242))6 + sqrt(242))2. -2508sqrt(2) + 87395 Simplify (sqrt(300) + 1)-1. -10sqrt(3) - 1 Simplify (2(sqrt(1216)1 + 2))*2. 128sqrt(19) + 4880 Simplify (sqrt(128) - -1sqrt(128))/(sqrt(196)1). 8sqrt(2)/7 Simplify sqrt(21)/(4sqrt(7)) + -5. -5 + sqrt(3)/4 Simplify -3 + ((sqrt(275) + -2)*2 - sqrt(275))-1. -282 + 25sqrt(11) Simplify (1 + sqrt(432))1 - (3 + sqrt(432) + 1 + sqrt(432)). -12sqrt(3) - 3 Simplify ((sqrt(68) + 2sqrt(68)-6)/(sqrt(4) + sqrt(4) + (sqrt(16)1)/sqrt(4)))*2. 2057/9 Simplify (2 + sqrt(2299))1 + (-2 + sqrt(2299) + sqrt(2299)-2)2. 55sqrt(19) + 2305 Simplify -5 + (sqrt(130)/(sqrt(10)-1) + 2)2. -4sqrt(13) + 12 Simplify (-52sqrt(104) + sqrt(104) + sqrt(104))/(2sqrt(800)). -2sqrt(13)/5 Simplify (sqrt(6)/(sqrt(2) - sqrt(32))-2)2. 4/3 Simplify (sqrt(2112)-2 - sqrt(2112))/((-2sqrt(36) - sqrt(36))/sqrt(12)). 8sqrt(11) Simplify -1 + (sqrt(425)-1)2. 424 Simplify (-1sqrt(252))/(sqrt(64)1 + sqrt(4)). -3sqrt(7)/5 Simplify ((2sqrt(228)-6)/sqrt(12)-1-2)*2. 10944 Simplify ((sqrt(171) + (-3(sqrt(171) + (sqrt(171) - sqrt(171)-2)) - sqrt(171)))/((sqrt(36)1)/sqrt(4)))*2. 2736 Simplify 3 + sqrt(60)/(sqrt(12) - sqrt(300)). -sqrt(5)/4 + 3 Simplify (sqrt(300) + -3sqrt(300) - sqrt(3))*2 + sqrt(3) + (sqrt(27) - sqrt(3)) + 1. 3sqrt(3) + 1324 Simplify -4 + -5(-1 + sqrt(833))2 + 5. -4169 + 70sqrt(17) Simplify sqrt(3) + 1 + sqrt(3) + 2 + sqrt(3) + -1. 2 + 3sqrt(3) Simplify (sqrt(24) + (sqrt(24) - sqrt(96)-1))/(sqrt(8) - -4(sqrt(8) - sqrt(8)-2)). 4sqrt(3)/13 Simplify ((-1(sqrt(2) + 0) - (sqrt(12)/sqrt(6) + -3))-2)2. -48sqrt(2) + 68 Simplify 2 + ((sqrt(10) - -2sqrt(10)) + sqrt(10))/sqrt(5). 2 + 4sqrt(2) Simplify ((1sqrt(2695))/((sqrt(11) + sqrt(11)-2)5))2. 49/5 Simplify -2 + sqrt(117) + 4. 2 + 3sqrt(13) Simplify (sqrt(132) - (sqrt(132) - -1sqrt(132))-4)/(sqrt(60)/sqrt(20)). 18sqrt(11) Simplify sqrt(1008) + (sqrt(1008) + sqrt(1008)-1)-3 + 1. 1 + 12sqrt(7) Simplify (sqrt(550)/sqrt(176))/((sqrt(10) - sqrt(40)/sqrt(4)-6) + sqrt(10)). sqrt(5)/32 Simplify ((sqrt(209) - (sqrt(209) - (3sqrt(209) - sqrt(209) - sqrt(209)))) + sqrt(209))/sqrt(11)5. 10sqrt(19) Simplify (sqrt(68)-2 + sqrt(68) + -4)2. 16sqrt(17) + 84 Simplify -3 + (sqrt(891) - (1 + sqrt(891))) + -3. -7 Simplify -3(sqrt(11) + 2sqrt(176)). -27sqrt(11) Simplify (-2 + 1sqrt(98) - sqrt(98))*2 + 2. 6 Simplify ((2(0 + sqrt(13)) - (-1 + sqrt(1872)))3 + 5)2. -480sqrt(13) + 11764 Simplify 6(3 + -1sqrt(48))*2. -144sqrt(3) + 342 Simplify (sqrt(7)11 + -1)*2. -2sqrt(7) + 8 Simplify sqrt(126)/sqrt(2) + 1. 1 + 3sqrt(7) Simplify (3(sqrt(272) + -4 + (sqrt(272)-2 - sqrt(272))))2. 576sqrt(17) + 9936 Simplify sqrt(325) + 1 + 1 - sqrt(325). 2 Simplify ((-1(sqrt(65)-2 - sqrt(65)) - sqrt(65)) + sqrt(65) + sqrt(65))/(sqrt(45)/(sqrt(36)/sqrt(4))). 4sqrt(13) Simplify (6(sqrt(612)2 + sqrt(612) + sqrt(612)))2 + sqrt(170)/(sqrt(10)-2) + -2. -sqrt(17)/2 + 352510 Simplify sqrt(84)/sqrt(972) + (-5(sqrt(7) + sqrt(7) + 3))2 + sqrt(7). 2710sqrt(7)/9 + 925 Simplify 1 + sqrt(19) + -2 + sqrt(2736)1 + sqrt(19) - (4 + sqrt(76)/sqrt(4) + sqrt(1900)1). -5 + 3sqrt(19) Simplify -5(sqrt(52) + 1) - (sqrt(52) + 5sqrt(312)/sqrt(6)). -22sqrt(13) - 5 Simplify (2sqrt(4)-5 + sqrt(4))/(sqrt(288) - (-2sqrt(288) - sqrt(288))). -3sqrt(2)/16 Simplify (3(4 + sqrt(11) + sqrt(11)))2 + sqrt(11) - (sqrt(11) + sqrt(396))-3. 540 + 166sqrt(11) Simplify -1 + (sqrt(700) + 4 + sqrt(700) + 2)2. 240sqrt(7) + 2835 Simplify (sqrt(24)2)/((sqrt(300)-2 - sqrt(300) - sqrt(300)) + sqrt(300)). -2sqrt(2)/15 Simplify 6(0 + sqrt(45))*2. 270 Simplify 3(-3 + 5(sqrt(13) + -1)). -24 + 15sqrt(13) Simplify ((-2sqrt(84)1)/sqrt(12))*2 + -5. 23 Simplify sqrt(13)3-1-6 + 2. 2 + 18sqrt(13) Simplify 1((2sqrt(119))/sqrt(7))2. 68 Simplify (sqrt(104) + -52sqrt(104))/((sqrt(64)-1)/sqrt(8)). 9sqrt(13) Simplify (2sqrt(363) - (1 + sqrt(147)))*2. -30sqrt(3) + 676 Simplify sqrt(45)/(sqrt(9) + (sqrt(27)/sqrt(3) - sqrt(9))) + (sqrt(10)/sqrt(2)3)2. sqrt(5) + 45 Simplify ((sqrt(54)/sqrt(3))/sqrt(9))2-4. -8 Simplify ((-3 + sqrt(1216) + sqrt(1216)2 + sqrt(1216) - sqrt(1216)) + sqrt(1216))2. -192sqrt(19) + 19465 Simplify 1 + (3 + -1 + sqrt(243))3. 7 + 27sqrt(3) Simplify 4 + sqrt(1100) + 1. 5 + 10sqrt(11) Simplify (((-1sqrt(550))/sqrt(10))/((sqrt(66)-1)/sqrt(6)))2. 5 Simplify (sqrt(2) + 0)-3 - (sqrt(18) + 2sqrt(18))/sqrt(9). -6sqrt(2) Simplify (sqrt(396) + 2 + sqrt(396))1. 2 + 12sqrt(11) Simplify (5 + sqrt(468) + 1sqrt(468))2. 120sqrt(13) + 1897 Simplify (4-1sqrt(204))/(sqrt(84)/sqrt(63)). -12sqrt(17) Simplify -4(4 + sqrt(19) + sqrt(76))*2. -748 - 96sqrt(19) Simplify (-5sqrt(88)/sqrt(4))/sqrt(2). -5sqrt(11) Simplify (1sqrt(17) + -2)5. -10 + 5sqrt(17) Simplify ((-4 + sqrt(22)/sqrt(2))4 + -4)*2. -160sqrt(11) + 576 Simplify ((sqrt(19) + sqrt(133)/(sqrt(7)-1))-1 + 3)6. 18 Simplify -1 + 2-4sqrt(70)/(sqrt(20)/sqrt(2)). -8sqrt(7) - 1 Simplify 6sqrt(396)4. 144sqrt(11) Simplify (sqrt(2736) + 1 + sqrt(2736))2 + sqrt(2736) + (0 + sqrt(1900) - sqrt(1900))2. 60sqrt(19) + 10945 Simplify -5(sqrt(171) + 2)-2. 20 + 30sqrt(19) Simplify (-1sqrt(405)4)2. 6480 Simplify (-6(-1sqrt(102))/sqrt(6))2. 612 Simplify (sqrt(168)/(-2sqrt(8) + sqrt(8) - sqrt(8)))/(sqrt(252)5 + sqrt(7) + sqrt(7)). -sqrt(3)/64 Simplify (1sqrt(300) + -2)*2 + -1. -40sqrt(3) + 303 Simplify ((sqrt(1053) + 2)-3)2-4. -38052 - 1296sqrt(13) Simplify sqrt(16)/(-3sqrt(392)). -sqrt(2)/21 Simplify (-2sqrt(180) + -5 - (2sqrt(180) + -3))*2. 96sqrt(5) + 2884 Simplify (((sqrt(304) - (sqrt(304) + -1)) + sqrt(304))3 + sqrt(304))2. 96sqrt(19) + 4873 Simplify -3 + (sqrt(17) - 3sqrt(17)) - sqrt(17) - (sqrt(833) - (sqrt(833) + sqrt(833) + -3)). -6 + 4sqrt(17) Simplify ((sqrt(288) - (-4((sqrt(288) + 1 - sqrt(288)) + sqrt(288)) - sqrt(288))) + -5 + 1sqrt(288))*2. -168sqrt(2) + 14113 Simplify (sqrt(54)/(1sqrt(6)) + sqrt(9))/((sqrt(75) - sqrt(3))5). sqrt(3)/10 Simplify sqrt(121)/((sqrt(891) + sqrt(11))3). sqrt(11)/30 Simplify (sqrt(95) - ((sqrt(95) + sqrt(95)-1)*-2 + sqrt(95))	{ "pile_set_name": "DM Mathematics" }
inutes are there between 12:08 AM and 3:30 AM? 202 How many minutes are there between 4:41 PM and 10:06 PM? 325 What is 266 minutes after 3:30 PM? 7:56 PM How many minutes are there between 10:52 AM and 7:40 PM? 528 What is 530 minutes after 7:45 AM? 4:35 PM What is 697 minutes after 4:05 PM? 3:42 AM How many minutes are there between 2:23 PM and 9:19 PM? 416 How many minutes are there between 3:46 AM and 12:07 PM? 501 How many minutes are there between 2:22 AM and 4:54 AM? 152 How many minutes are there between 7:54 PM and 12:07 AM? 253 What is 466 minutes after 6:12 AM? 1:58 PM How many minutes are there between 1:52 AM and 1:56 AM? 4 How many minutes are there between 11:18 PM and 8:38 AM? 560 How many minutes are there between 9:35 PM and 2:53 AM? 318 How many minutes are there between 1:50 AM and 6:00 AM? 250 How many minutes are there between 10:18 AM and 12:34 PM? 136 What is 25 minutes before 11:06 AM? 10:41 AM What is 410 minutes after 3:33 PM? 10:23 PM What is 170 minutes after 9:50 AM? 12:40 PM How many minutes are there between 3:16 PM and 11:32 PM? 496 What is 639 minutes after 7:41 AM? 6:20 PM What is 639 minutes before 11:34 PM? 12:55 PM How many minutes are there between 8:31 PM and 8:42 PM? 11 How many minutes are there between 4:39 PM and 2:26 AM? 587 How many minutes are there between 11:11 PM and 6:10 AM? 419 What is 678 minutes after 1:07 PM? 12:25 AM What is 286 minutes after 9:54 PM? 2:40 AM What is 568 minutes after 5:17 AM? 2:45 PM How many minutes are there between 10:07 PM and 2:10 AM? 243 What is 472 minutes before 4:59 AM? 9:07 PM How many minutes are there between 12:05 AM and 6:19 AM? 374 How many minutes are there between 2:06 AM and 9:53 AM? 467 How many minutes are there between 8:24 PM and 12:24 AM? 240 How many minutes are there between 8:29 AM and 1:15 PM? 286 What is 655 minutes after 11:28 PM? 10:23 AM What is 160 minutes before 10:28 PM? 7:48 PM How many minutes are there between 3:23 AM and 7:29 AM? 246 How many minutes are there between 2:05 AM and 9:44 AM? 459 What is 107 minutes after 10:05 AM? 11:52 AM How many minutes are there between 5:12 PM and 1:06 AM? 474 What is 391 minutes after 4:58 AM? 11:29 AM How many minutes are there between 12:12 PM and 2:57 PM? 165 How many minutes are there between 1:55 PM and 3:25 PM? 90 How many minutes are there between 8:20 PM and 6:59 AM? 639 What is 664 minutes after 10:41 AM? 9:45 PM How many minutes are there between 9:55 PM and 6:53 AM? 538 How many minutes are there between 12:05 AM and 5:08 AM? 303 How many minutes are there between 10:04 PM and 5:43 AM? 459 What is 59 minutes after 7:09 AM? 8:08 AM How many minutes are there between 6:18 AM and 6:06 PM? 708 What is 418 minutes after 2:34 AM? 9:32 AM What is 643 minutes before 9:33 PM? 10:50 AM What is 115 minutes after 3:31 AM? 5:26 AM What is 173 minutes after 11:42 PM? 2:35 AM What is 325 minutes before 1:16 AM? 7:51 PM How many minutes are there between 10:45 PM and 2:55 AM? 250 What is 344 minutes after 4:15 AM? 9:59 AM What is 67 minutes after 5:19 PM? 6:26 PM How many minutes are there between 2:23 PM and 12:32 AM? 609 How many minutes are there between 5:33 PM and 7:23 PM? 110 What is 110 minutes after 8:13 AM? 10:03 AM How many minutes are there between 12:25 PM and 5:52 PM? 327 What is 388 minutes before 3:22 PM? 8:54 AM How many minutes are there between 6:53 PM and 12:11 AM? 318 How many minutes are there between 2:28 PM and 12:40 AM? 612 How many minutes are there between 10:26 PM and 8:51 AM? 625 How many minutes are there between 6:43 AM and 8:13 AM? 90 How many minutes are there between 6:44 AM and 6:30 PM? 706 How many minutes are there between 12:28 PM and 4:28 PM? 240 What is 467 minutes before 3:55 PM? 8:08 AM What is 470 minutes before 4:54 AM? 9:04 PM How many minutes are there between 3:32 AM and 10:55 AM? 443 How many minutes are there between 4:46 AM and 8:49 AM? 243 What is 657 minutes before 4:03 PM? 5:06 AM What is 14 minutes before 6:04 AM? 5:50 AM What is 643 minutes before 7:18 AM? 8:35 PM What is 400 minutes before 11:08 PM? 4:28 PM What is 592 minutes after 9:37 AM? 7:29 PM What is 235 minutes after 8:38 AM? 12:33 PM What is 154 minutes before 2:13 PM? 11:39 AM What is 39 minutes before 1:34 AM? 12:55 AM What is 401 minutes after 10:37 PM? 5:18 AM What is 408 minutes after 10:34 AM? 5:22 PM What is 260 minutes after 1:52 PM? 6:12 PM How many minutes are there between 9:58 AM and 10:51 AM? 53 How many minutes are there between 5:21 PM and 8:36 PM? 195 How many minutes are there between 5:04 PM and 2:23 AM? 559 What is 492 minutes before 8:47 PM? 12:35 PM What is 439 minutes after 2:44 PM? 10:03 PM How many minutes are there between 5:17 AM and 2:55 PM? 578 How many minutes are there between 4:22 PM and 11:34 PM? 432 How many minutes are there between 11:33 AM and 2:34 PM? 181 What is 586 minutes after 5:27 AM? 3:13 PM How many minutes are there between 8:27 PM and 3:26 AM? 419 What is 136 minutes before 12:55 AM? 10:39 PM What is 627 minutes after 9:14 PM? 7:41 AM How many minutes are there between 2:27 PM and 10:52 PM? 505 What is 582 minutes before 4:09 AM? 6:27 PM How many minutes are there between 2:14 PM and 10:42 PM? 508 What is 313 minutes after 4:00 PM? 9:13 PM How many minutes are there between 5:55 AM and 8:56 AM? 181 What is 526 minutes after 2:08 AM? 10:54 AM How many minutes are there between 1:04 AM and 8:38 AM? 454 What is 691 minutes after 4:17 AM? 3:48 PM How many minutes are there between 3:04 PM and 4:03 PM? 59 How many minutes are there between 9:28 PM and 12:59 AM? 211 How many minutes are there between 11:25 PM and 10:44 AM? 679 How many minutes are there between 9:14 PM and 11:20 PM? 126 What is 293 minutes before 9:08 PM? 4:15 PM How many minutes are there between 1:16 PM and 6:16 PM? 300 How many minutes are there between 12:20 PM and 1:01 PM? 41 What is 655 minutes after 2:08 PM? 1:03 AM How many minutes are there between 3:28 AM and 6:08 AM? 160 What is 539 minutes after 10:20 AM? 7:19 PM What is 204 minutes after 2:31 AM? 5:55 AM What is 543 minutes after 3:26 AM? 12:29 PM How many minutes are there between 6:25 PM and 2:26 AM? 481 How many minutes are there between 12:03 AM and 9:55 AM? 592 How many minutes are there between 2:09 PM and 1:58 AM? 709 What is 244 minutes after 3:45 PM? 7:49 PM How many minutes are there between 1:31 PM and 3:22 PM? 111 What is 286 minutes after 1:24 PM? 6:10 PM What is 97 minutes before 9:43 AM? 8:06 AM What is 254 minutes before 1:28 PM? 9:14 AM What is 238 minutes after 11:54 AM? 3:52 PM What is 466 minutes after 3:39 PM? 11:25 PM How many minutes are there between 1:36 AM and 2:45 AM? 69 What is 394 minutes after 2:01 AM? 8:35 AM How many minutes are there between 4:30 AM and 11:01 AM? 391 What is 443 minutes before 3:39 AM? 8:16 PM How many minutes are there between 7:34 AM and 7:01 PM? 687 What is 145 minutes after 8:35 AM? 11:00 AM What is 680 minutes after 3:13 AM? 2:33 PM What is 332 minutes before 8:16 AM? 2:44 AM What is 560 minutes after 2:09 AM? 11:29 AM What is 103 minutes after 1:18 AM? 3:01 AM How many minutes are there between 4:21 AM and 7:48 AM? 207 What is 501 minutes before 10:30 PM? 2:09 PM What is 428 minutes before 8:21 AM? 1:13 AM How many minutes are there between 2:44 AM and 6:11 AM? 207 How many minutes are there between 9:12 PM and 9:14 PM? 2 How many minutes are there between 6:36 PM and 2:22 AM? 466 What is 481 minutes before 4:01 AM? 8:00 PM What is 137 minutes after 7:50 AM? 10:07 AM What is 191 minutes before 3:42 PM? 12:31 PM What is 488 minutes after 7:08 PM? 3:16 AM What is 552 minutes before 7:45 AM? 10:33 PM How many minutes are there between 1:58 AM and 11:30 AM? 572 What is 463 minutes after 11:54 PM? 7:37 AM How many minutes are there between 10:39 PM and 9:57 AM? 678 How many minutes are there between 10:13 AM and 10:46 AM? 33 What is 90 minutes after 2:40 AM? 4:10 AM What is 332 minutes before 5:58 AM? 12:26 AM What is 289 minutes after 2:09 PM? 6:58 PM What is 303 minutes before 3:17 PM? 10:14 AM How many minutes are there between 12:38 PM and 7:19 PM? 401 How many minutes are there between 11:30 PM and 4:32 AM? 302 How many minutes are there between 4:44 AM and 3:2	{ "pile_set_name": "DM Mathematics" }
080v2 wrt v. -535877520v Find the third derivative of 452774b6 - 4361547b*2. 54332880b*3 Differentiate dk*2 - 819dk - 4d - 15303k2 - 30614120 wrt k. 2dk - 819d - 30606k Find the third derivative of -578n*4 + 800n*3 - 11n*2 - 258958n wrt n. -13872n + 4800 What is the third derivative of 187560726n*4s + n*3s*3 + 62768904n*2s*3 wrt n? 4501457424ns + 6s*3 Find the second derivative of -8315889g*3 - 14896062g. -49895334g What is the third derivative of -337l*6 + 10385l*4 + 3503439l*2 wrt l? -40440l*3 + 249240l Find the second derivative of -10808031p2 - 73048796p. -21616062 What is the third derivative of -5241187x3 + 340347x*2 wrt x? -31447122 Find the first derivative of 6q*3r + 3q3ux + q2ux + q2 + 1800qrux - 2qux + qx + 952ru - 231ux - 5u wrt r. 6q3 + 1800qux + 952u Find the second derivative of -2426323b*2g - 3b2 + 2193072b - g wrt b. -4852646g - 6 What is the second derivative of -1632548m*2 + 2073187m wrt m? -3265096 What is the derivative of -f*4 - 3882586f*3 - 2f*2 - 49417564 wrt f? -4f*3 - 11647758f*2 - 4f What is the first derivative of -3b3 - 30224897b*2 - 127641489 wrt b? -9b*2 - 60449794b What is the derivative of c*3 - 961c*2 - 4587c - 182877483 wrt c? 3c2 - 1922c - 4587 Find the second derivative of -149009901p3 + 88492014p wrt p. -894059406p What is the derivative of -4227chn - 6chw - 5ch - 3cnw - 406hnw - 13729h + 2w wrt n? -4227ch - 3cw - 406hw What is the first derivative of 339267q*3 + 2q*2 - 9q + 45430953? 1017801q2 + 4q - 9 Find the first derivative of -7526461p + 2013226. -7526461 Find the first derivative of -9717783s*2t*3 - 2431304s*2 - s - 4t*3 wrt t. -29153349s*2t*2 - 12t*2 Find the second derivative of 30139844c*3z*2 - 3c*3z + c*2 - 27823cz - z wrt z. 60279688c*3 Differentiate -213845738dw - 1206w + 104079 wrt d. -213845738w Find the first derivative of -909u*4 + 3123u*3 + 3u*2 - 47907579. -3636u*3 + 9369u*2 + 6u What is the first derivative of -542338884fm*2 - 7m*2 + 2725m - 5071 wrt f? -542338884m2 What is the derivative of 4j*4 + 293705j3 + j2 - 472609489 wrt j? 16j3 + 881115j*2 + 2j What is the third derivative of 1526306tw*3y*2 - 2twy*2 - 23ty2 - 14w*3y*2 - 28298w*2y*2 - 1 wrt w? 9157836ty2 - 84y*2 What is the second derivative of -33t*4 - 1064140t*2w + 7tw + 24t - 18w - 32 wrt t? -396t2 - 2128280w Find the first derivative of -9s2 + 125264s + 103313666. -18s + 125264 What is the third derivative of 34j*3x*4 + 287j*3x - 1057j3 - 5539j*2x*5 + 6j*2x*2 wrt x? 816j*3x - 332340j2x*2 What is the third derivative of -70245150y*3 - 2y*2 + 205y + 27342? -421470900 Find the first derivative of -14w4 + 6w*2 + 1517284w + 722916885. -56w3 + 12w + 1517284 What is the second derivative of -85078797q2 - 3875238q - 7 wrt q? -170157594 Differentiate -5o3 - 456079o - 12532891. -15o2 - 456079 What is the second derivative of -875617h*2vz - 2h*2v + 7h2 + 6hvz - 7hz + 4vz - 20720v wrt h? -1751234vz - 4v + 14 Find the third derivative of 8r4 - 53182709r*3 - 21934r*2 + 404r + 1. 192r - 319096254 Find the third derivative of 16j*2n*3 + 2j*2n - 8jn*3 - 281895jn2 - 50956n3 + n2 + 2n + 2 wrt n. 96j*2 - 48j - 305736 What is the derivative of 1271a3x*2 - 1420a3 + x2 + 899619 wrt a? 3813a2x*2 - 4260a*2 Find the second derivative of -2901m*3 + 1438m*2 - 3529099m wrt m. -17406m + 2876 Find the second derivative of 10cv2z + 4041cvz3 - 342279v*2z*3 + 215vz3 + vz*2 wrt v. 20cz - 684558z*3 Find the third derivative of 21503410t*6 - 371001t*2 - 2t + 1. 2580409200t3 What is the derivative of -193079270h + 142509304? -193079270 Find the second derivative of -14n3o*3 - 882627n*3o - no3 + 10o*3 + 1684o*2 wrt n. -84no3 - 5295762no What is the second derivative of 352986234a*2 - 2a + 215501195? 705972468 What is the third derivative of 2k4 + 6503727k*3 + 2k*2 + 94997949 wrt k? 48k + 39022362 What is the second derivative of 57i3x + 25651i2x + 2i2 + 15336249ix wrt i? 342ix + 51302x + 4 What is the third derivative of -4099787b3 + b2 - 5326b - 1487? -24598722 What is the second derivative of -1261709g3 - 25329g - 1583? -7570254g What is the third derivative of -334856884a*6 + 37651854a*2? -40182826080a*3 Find the first derivative of 12043r*2 - 941r + 78156489 wrt r. 24086r - 941 Find the third derivative of 102s*3w*3 + 2s*3w*2 + 3s*3 + 308sw2 + 178243w3 + w2 - 12w wrt w. 612s*3 + 1069458 What is the third derivative of 8g*5 + 19g*4 - 115g*3 + 437058g*2 - 10? 480g*2 + 456g - 690 What is the third derivative of 2dw*3 + 3dw2 + 8083dw - 4216852w*3 - 11w*2 wrt w? 12d - 25301112 What is the third derivative of 106y5 - 31y*4 + 8143y*3 - 5y*2 + 33y + 192190? 6360y2 - 744y + 48858 Differentiate -59829gk*3t - 71gk - 2k3 + 11k*2 + 75t*2 - 674 wrt t. -59829gk3 + 150t What is the first derivative of -226693298x + 65820659? -226693298 Differentiate 3az2 - 2712az - 56848235a + 45z2 - 5z with respect to z. 6az - 2712a + 90z - 5 What is the derivative of 2f3 - 11467f*2 - 60f + 4191743 wrt f? 6f2 - 22934f - 60 Find the third derivative of -918831103s3 - 725038874s*2. -5512986618 Differentiate -335743607p + 172930684 with respect to p. -335743607 Differentiate 7z4 - 312741z - 3312952. 28z3 - 312741 Find the second derivative of 55f*3 - 1499773f*2 + 51316f + 29 wrt f. 330f - 2999546 Differentiate 9mq2 + 6131mq - 7960660m - q*2 + q wrt q. 18mq + 6131m - 2q + 1 What is the derivative of 781y*3 + 58y*2 + 2y - 8979291 wrt y? 2343y2 + 116y + 2 What is the second derivative of -19f2gl2 - 604f*2gl + f2l*2 + 2f*2l - 143fg + 17047gl*2 + 2gl wrt l? -38f*2g + 2f2 + 34094g What is the second derivative of -109109710a2 + 56042412a wrt a? -218219420 What is the third derivative of 66978041q5 + 3q*4 - 721736028q*2? 4018682460q*2 + 72q What is the second derivative of -88179123t3 + 3879884t? -529074738t Find the second derivative of 920484542h*2 - 76541360h - 3 wrt h. 1840969084 What is the second derivative of 1002s4 - 982s*3 + 3880611s? 12024s2 - 5892s Find the second derivative of 12b2kv2 + 818b*2kv - 141b*2k - 126866bkv2 - 3bv - k wrt v. 24b*2k - 253732bk Find the first derivative of -68832442h3 - 62495707. -206497326h*2 What is the third derivative of 1667w*6 - 8179w*3 + 14w*2 + 28577w + 4? 200040w3 - 49074 What is the first derivative of -171329n*3r - 1539n3s + 2n3 - 29n*2rs - 5rs + 6r wrt s? -1539n3 - 29n*2r - 5r Differentiate 34825881d*2 + 49405477 wrt d. 69651762d What is the first derivative of 706756771q - 1194977952? 706756771 What is the second derivative of 62iw3 + 4iw2 + i + 9w*3 - 24w*2 - 5048989w wrt w? 372iw + 8i + 54w - 48 Find the third derivative of -6215359o3 - 2336903o*2 - 3o. -37292154 Differentiate 46986893lq + 78885l - 315 with respect to q. 46986893l Find the third derivative of -771oz*3 + 2oz2 - 621o + 2283z4 - z2 - 9z - 10 wrt z. -4626o + 54792z Find the third derivative of 61c2r*4 - 25c*2r + 4502cr*4 - 2cr2 + 4c - 406r + 10 wrt r. 1464c*2r + 108048cr Find the second derivative of -242400385t2 - 58t - 4506213 wrt t. -484800770 Find the second derivative of -3986877d4 + 5640375d wrt d. -47842524d2 What is the second derivative of -4409910j*2 - 341564j - 23 wrt j? -8819820 Find the third derivative of -3339873h3i*2 - 2h*3 + 3h*2i*2 - 98032h*2 + 18hi2 wrt h. -20039238i*2 - 12 What is the third derivative of 142356296q*5 - 604542760q*2? 8541377760q*2 Find the third derivative of 298322441r*3 + 3446684r*2 wrt r. 1789934646 Find the third derivative of 4257355n*3 + 1265441n**2 + 5. 25	{ "pile_set_name": "DM Mathematics" }
2801809. Let k = l + 0.1025919. Let y = k - -0.29. Round y to 6 decimal places. -0.000006 Suppose 2v = 5v - 6. Suppose 0 = 3z + 6, 0 = -vd - 3d + 4z + 718. What is d rounded to the nearest 10? 140 Let n(t) = -6t2 + 1. Let k be n(-1). Let g be (-2)/(-5) + 12000002/k. Round g to the nearest one million. -2000000 Let y = -233 + 50. What is y rounded to the nearest 10? -180 Let f = 0.8 + -0.747. Let x = -2.353 + f. Let d = x + 2.282. Round d to 2 dps. -0.02 Suppose 0 = q + 3q. Suppose 0r - r + 20 = q. Let j be 5/r + (-31198)/(-8). What is j rounded to the nearest 1000? 4000 Let a = 1.2684 + -1.29. Round a to two decimal places. -0.02 Let s = 0.1 - 1.1. Let h = s + 1.0000054. What is h rounded to six dps? 0.000005 Let m = 256 - -764. Round m to the nearest one hundred. 1000 Let m = 96274621 - 96274624.9999971. Let h = m - -4. What is h rounded to 6 dps? 0.000003 Let y(k) = 4 - 155k3 - 6 + k2 - 3k + 0k + 16k3. Let q be y(-2). What is q rounded to the nearest one hundred? 1100 Let m = -1.1 + 1.062. Let v = m - -0.0196. What is v rounded to 3 decimal places? -0.018 Let u = -23 - -23.18. Let x = 0 + u. Let z = x - 0.17956. Round z to four dps. 0.0004 Let p(u) = 8u*2 + 3u*2 + 7u - 74u3 + 16 + 10u. Let n be p(16). What is n rounded to the nearest one hundred thousand? -300000 Let u = -8 + 7.86. Let b = u - -0.139951. Round b to 5 decimal places. -0.00005 Let n(y) = -y. Let v be n(5). Let a(c) = -519c2 + 4c - 5. Let k be a(v). What is k rounded to the nearest ten thousand? -10000 Let z = 3415.4724053 + -3413.2115. Let g = -90.7385047 - z. Let k = 93 + g. Round k to four decimal places. 0.0006 Let t be -3 + 0 - 3/(-3). Let b(g) = -265001g - 2. Let a be b(t). Round a to the nearest 100000. 500000 Let t = -3.7 + 3.70045. What is t rounded to 4 dps? 0.0005 Let b = 0.38575 + -0.2556. Let v = b - 0.13. What is v rounded to 4 dps? 0.0002 Let y = -751 + 443. Round y to the nearest 100. -300 Let q(n) = 1. Let h(p) = 11499p - 4. Let a(t) = h(t) + 2q(t). Let l be a(-2). Round l to the nearest 10000. -20000 Let q = -109.907 - -110. Let n = -0.09243 + q. What is n rounded to 4 decimal places? 0.0006 Let l = 142.96976561 - 141.919765. Let r = l + -1.05. Round r to 7 dps. 0.0000006 Let g = -2926.9 - -2927.200045. Let y = g + -0.3. What is y rounded to five dps? 0.00005 Let p = 0.014 - 0.014023. Round p to 5 dps. -0.00002 Let d(j) = -27733716j*3 - 2j*2 - 2j - 1. Let r = -5 - -4. Let b be d(r). Let s = b + -18333715. What is s rounded to the nearest one million? 9000000 Suppose -5p - 5z - 500 = 0, 3p + 7z = 2z - 310. Round p to the nearest ten. -100 Let x = 4 + 1.1. Let v = 0.9 + x. Let q = -5.999972 + v. Round q to 5 dps. 0.00003 Let w = -318416 + 818416. Round w to the nearest 1000000. 1000000 Let x(a) = -189001a - 3. Let d(m) = 378002m + 5. Let l(s) = -4d(s) - 7x(s). Let b be l(1). What is b rounded to the nearest 10000? -190000 Let i = 0.02 - 0.024. Let w = i - 5.196. What is w rounded to the nearest integer? -5 Let s(x) = 8198x + 20. Let i be s(10). Round i to the nearest ten thousand. 80000 Let d(a) = a*3 + 5a*2 + a - 3. Let l be 0((-3)/6)/(-1). Suppose 4s + 2b + 6 = -lb, 3s - 3b = -18. Let t be d(s). Round t to the nearest 10. 10 Let h = 0.899972 - 0.9. Round h to six dps. -0.000028 Let w = -3.631203 - 5.668961. Let f = w + 9.3. What is f rounded to 5 dps? -0.00016 Let t = 2.86 + -154.86. Let k = t - -152.000069. What is k rounded to 5 decimal places? 0.00007 Let v = -6.463983 - -6.5189. Let l = -26 - -25.945. Let f = v + l. Round f to five decimal places. -0.00008 Let n(u) = -u2 - 8u - 4. Let i be n(-7). Suppose 4t = 3a - 16015, 0a + 2a = it + 12010. Round t to the nearest 10000. 0 Let w = -10.3 - -10.3000044. What is w rounded to 6 dps? 0.000004 Let n = 10 - 10.06. Let q = 0.05999988 + n. What is q rounded to seven dps? -0.0000001 Let j be 3/(-9) + 151309/3. Suppose 2g + 2h + 2h - j = 0, 2h - 126122 = -5g. Suppose -4t - 4i + 8406 = g, i + 5 = 0. Round t to the nearest one thousand. -4000 Let x = -103.0297 + 103. What is x rounded to three decimal places? -0.03 Let w = 1123793132 - 1123230048.00152. Let m = w + -563129. Let l = 45 + m. Round l to 4 decimal places. -0.0015 Suppose 2b = 10, 4t + 20 = 3b - 3. Suppose u = -u + 6. Let a be 9200000 - t - (u - 1). What is a rounded to the nearest one million? 9000000 Suppose -5n - 20 = 5d, -4n = -5d - 3n - 2. Let y(p) = 3p - 17. Let o be y(7). Let s be -1 - o/d - -72. Round s to the nearest ten. 80 Let m(y) = 28y + 30. Let i be m(-13). What is i rounded to the nearest 10? -330 Let p = -198 - -283. Let d = 84.59 - p. Let i = d + 3.31. What is i rounded to the nearest integer? 3 Let v be -6 - (-3 + -1 + 7). Let k = 1 - v. Round k to the nearest 100. 0 Let g(c) = 186c2 - 9c + 3c + 2 - 1. Let x be g(4). Let l = x - 6753. What is l rounded to the nearest one thousand? -4000 Suppose -1405 - 170 = -5a. Let h = 215 - a. Round h to the nearest 1000. 0 Let m = -4 - -2. Let f = 1.4 + m. Let n = 0.6000048 + f. What is n rounded to six decimal places? 0.000005 Let g = -2331838.00103 + 2331939. Let b = -0.11 + 101.11. Let m = b - g. What is m rounded to 4 dps? 0.001 Let s = 1.8 + -2. Let x = -0.1981 - s. What is x rounded to 3 decimal places? 0.002 Let h = -21.00000015 - -21. What is h rounded to 7 dps? -0.0000002 Let p = -159 - -158.999405. What is p rounded to four decimal places? -0.0006 Let f = 7.003999 - 6.934. Let w = f + -0.07. What is w rounded to five dps? 0 Let l(n) = 28616n2. Let t be l(1). Let s = t - 18516. Round s to the nearest one thousand. 10000 Let s = 490 + -490.0000347. Round s to 6 dps. -0.000035 Let s = 13 - 20. Let a = 7.11 + s. What is a rounded to one dp? 0.1 Let r be 938/(-6) + (-2)/3. Let q = r + 265. Let f = -268 + q. Round f to the nearest 100. -200 Let v = 24.00031 - 24. What is v rounded to 4 dps? 0.0003 Suppose 0 = -7s - 1920123 - 627877. What is s rounded to the nearest ten thousand? -360000 Let j = -17 + 12. Let q = -2 - j. Let m = q - 3.032. Round m to 2 decimal places. -0.03 Let z = -82.000445 + 82. Round z to five dps. -0.00045 Let r(d) = -d*3 + 6d*2 + 14d - 11. Let n be r(9). Round n to the nearest 10. -130 Suppose -2a + 2 = 4t, -3a = 3t - a. Let k be t((-243)/6)/(-3). What is k rounded to the nearest ten? 30 Let x(u) = -223u*2 - 5u - 1. Let y be x(-4). Let w = 1873 + y. Let v = w - -2476. Round v to the nearest one hundred. 800 Let w = 16 + 1. Suppose -2u - 2 = -2n - 0, 3n + 4u = w. What is n rounded to the nearest 10? 0 Let d = -33.8 + 30. Let o = d - -4. Let j = o - 0.19. What is j rounded to one dp? 0 Let f = -0.048 + -0.279. Round f to 2 dps. -0.33 Let y = 17 - 16.9993. Round y to 4 dps. 0.0007 Suppose g + 1 + 8 = x, 3x - 30 = 4g. Let q be (0 - x)/3 - -6. Suppose 2r + 126002 = -2t, qr + 4t - 2t = -252002. Round r to the nearest ten thousand. -60000 Let l = 0.681 - 0.68100537. What is l rounded to 6 dps? -0.000005 Let g be (-2642)/(-3) + (-2)/3. Suppose 2i = i + g. What is i rounded to the nearest 100? 900 Let w = -4306662.5999991 + 4306660. Let x = -2.6 - w. Round x to 7 decimal places. -0.0000009 Suppose 2f - 110 = -14. Suppose -5s - f - 22 = 0. Let y be (-836)/s + (-2)/(-7). What is y rounded to the nearest 100? 100 Let q = 16.09 - 16. Let k = -0.35 - q. Let x = 0.04 + k. Round x to zero decimal places. 0 Let x = -0.7 + 1.23. Let l = x + -0.21. What is l rounded to 1 dp? 0.3 Let z(d) = -d*2 - 6d - 3. Let l be z(-5). Suppose 3t + 13303 - 71803 = 0. Suppose c - t = -lc. What is c rounded to the nearest one thousand? 7000 Let f = -44.942 + 56725.942. Let i = f + -56704.921. Let l = -24 - i. What is l rounded to two decimal places? -0.08 Let n = 5026418 + -2926418. What is n rounded to the nearest one million? 2000000 Let m = -0.381 + 0.3307. Let k = m - -2.3803. Round k to 1 dp. 2.3 Suppose 3j - 8j + 22021 = -3h, -3 = -h. Suppose 4r - 394 = j. Round r to the nearest one thousand. 1000 Suppose 3860441 + 1651622 = k. Suppose 3c - k = 7267937. Suppose -3d + c = -6*d. What is d rounded to the nearest one hundred thousand? -1400000 Let k = 3.154 + -3.99. What is k rounded to one decimal place? -0.8 Let r = -3.30023 - -3.3. What is r rounded to four dps? -0.0002 Le	{ "pile_set_name": "DM Mathematics" }
(1200)-1) + sqrt(1200)). sqrt(2)/10 Simplify (1(sqrt(98) - -4sqrt(98)2)-4)2-1. -127008 Simplify (-2-1sqrt(133) + -2sqrt(133)-2)/(sqrt(21)/(sqrt(96)/sqrt(2))) + 1. 1 + 24sqrt(19) Simplify (sqrt(800)/sqrt(10) + (sqrt(45)/sqrt(9) - sqrt(5))-4)3. 12sqrt(5) Simplify ((sqrt(2000)6)/(sqrt(4)3-2 - sqrt(4)))2. 18000/49 Simplify -6((sqrt(99) - sqrt(99)4)3)/(sqrt(324) - 3sqrt(324)). -9sqrt(11)/2 Simplify ((sqrt(26) - (sqrt(26) + sqrt(104)/sqrt(4)1))4)/(-5sqrt(48)/sqrt(6)). 2sqrt(13)/5 Simplify ((sqrt(320)-3 - sqrt(320)) + sqrt(5))6 + ((sqrt(60)/sqrt(6))/sqrt(2))*2 + 5. -186sqrt(5) + 10 Simplify ((-2sqrt(847) + sqrt(847))36-5-5)2. 171517500 Simplify ((sqrt(2268) + 3sqrt(2268))/(sqrt(441)-1 + sqrt(9)))2. 112 Simplify (sqrt(162) + 3(sqrt(162) - (sqrt(162) - (sqrt(162) + sqrt(162)-2))) - (sqrt(162) - (-2sqrt(162) + 5)))*2 - -24(sqrt(162) + 0). -378sqrt(2) + 4075 Simplify (sqrt(2)1 + 4)2 + -2 + sqrt(8)/sqrt(4) - (-4 + sqrt(40)/sqrt(5))2. -8 + 25sqrt(2) Simplify (1((sqrt(60)-1)/sqrt(12) + 5sqrt(5)-2)6)2. 21780 Simplify 1 + ((61sqrt(5))2 - sqrt(45)-2)6. 36sqrt(5) + 1081 Simplify (-5(sqrt(22)/sqrt(2) + sqrt(11)) + sqrt(11) + (2sqrt(99) - sqrt(99))/sqrt(9) + -6-2sqrt(539) + -1)*2. -152sqrt(11) + 63537 Simplify (sqrt(152) + 4(sqrt(152) - -3sqrt(152)))/(sqrt(128)1 + sqrt(128)). 17sqrt(19)/8 Simplify (sqrt(144)/sqrt(324))/(sqrt(512)-3 - sqrt(8) - sqrt(8)). -sqrt(2)/156 Simplify (-1 + -3sqrt(5) - (sqrt(500)4 - sqrt(500))) + 3. -33sqrt(5) + 2 Simplify -2(sqrt(5) + sqrt(25)/(sqrt(5) + 3sqrt(5)))*2 + (sqrt(5) - sqrt(40)/(sqrt(8)-2)) + -1. -133/8 + 3sqrt(5)/2 Simplify ((2sqrt(95)2 + sqrt(95))/(sqrt(25)/sqrt(20))-1)*2. 1900 Simplify (-4(0 + sqrt(242))5 - (-4 + 1sqrt(242) + -4))*2. -3696sqrt(2) + 106786 Simplify (sqrt(65) - (sqrt(65) - -2-1sqrt(65)))/(-3sqrt(5)-1). 2sqrt(13)/3 Simplify (-2 + (sqrt(22)/(sqrt(12)/sqrt(6)) - (0 + sqrt(1584))))2. 44sqrt(11) + 1335 Simplify (((2sqrt(68) + sqrt(68) - sqrt(17)) + -3 + (0 + sqrt(425) - (sqrt(425) + 1 - sqrt(17))))4)*2. -768sqrt(17) + 10048 Simplify (6sqrt(405))/((sqrt(81)2 + sqrt(81))/sqrt(9)) + -5. -5 + 6sqrt(5) Simplify (4 + -5 + (sqrt(637)-1 + -3)3 + -3)2. 546sqrt(13) + 5902 Simplify (sqrt(52) - sqrt(208)-5 - (1sqrt(3328) + sqrt(3328)))/(-3-2sqrt(400)). -sqrt(13)/12 Simplify (-3(sqrt(192)1 + 4 + -4))*2. 1728 Simplify -1 + ((1sqrt(24))/sqrt(2) - 5(2 + sqrt(3))-4). 22sqrt(3) + 39 Simplify (-2 + sqrt(931) - (sqrt(19) + sqrt(304) + -5)) + 0 + -1sqrt(475). -3sqrt(19) + 3 Simplify (sqrt(112)/(sqrt(18)-6))/((sqrt(800) - sqrt(800)1-5) + sqrt(800)). -sqrt(7)/1260 Simplify ((sqrt(80) + 0)1 + 1sqrt(10)/sqrt(2) + 5)*2. 50sqrt(5) + 150 Simplify 5 + sqrt(5)3 + 2 - (sqrt(5)24 - 3-1sqrt(5)). -8sqrt(5) + 7 Simplify (sqrt(2793) - (4sqrt(2793) + sqrt(2793)) - sqrt(2793))/sqrt(3) + (-4sqrt(2736))*2 + 3 + 1. -35sqrt(19) + 43780 Simplify ((2(sqrt(315) + sqrt(315)1 + sqrt(315)))/sqrt(7))/(2(((sqrt(81) - sqrt(81)2 - sqrt(81)) + sqrt(81) - sqrt(81)) + sqrt(81))). -sqrt(5) Simplify (2 + 3sqrt(325)-1)-44. -32 + 240sqrt(13) Simplify -4 + -2 + sqrt(7) + (sqrt(175) + -2 + sqrt(175) + sqrt(175))2 - sqrt(14)/(sqrt(4)/sqrt(2)3). -178sqrt(7)/3 + 1573 Simplify ((sqrt(312)/(2sqrt(8) + sqrt(8)) + sqrt(39) - sqrt(39))/sqrt(3) - (sqrt(208) + 0 + sqrt(208)-2 + sqrt(208))2) + -2. -2 + sqrt(13)/3 Simplify (-1 + (-1sqrt(125))*2 + 3 + -2)-6. -750 Simplify (sqrt(55) - sqrt(440)/sqrt(288))/(-2sqrt(11)3)-6. 5sqrt(5)/6 Simplify ((sqrt(140)/sqrt(5)4 + sqrt(28))-5)/(-4(sqrt(1296) - sqrt(36))). 5sqrt(7)/12 Simplify 2((sqrt(2400)-1)/sqrt(12) + ((sqrt(8)-1 - sqrt(8)) + 2)2). -52sqrt(2) + 72 Simplify -1 + (sqrt(108)/sqrt(2)-1)/((sqrt(32)/sqrt(2))/sqrt(8) + sqrt(2)). -3sqrt(3)/2 - 1 Simplify -415(0 + sqrt(76) + 1). -40sqrt(19) - 20 Simplify -1 + (sqrt(18)/(sqrt(24)/sqrt(8)))/(3sqrt(2)-3). -1 - sqrt(3)/9 Simplify 4 + -5 + 21-2sqrt(468)4. -96sqrt(13) - 1 Simplify -5(-4 + ((sqrt(5) - -1sqrt(45)) + (1 + -3sqrt(5) - sqrt(5)))*2). 15 Simplify (-3sqrt(4455)4 - sqrt(4455))/(-5sqrt(180)). 39sqrt(11)/10 Simplify (sqrt(18) + 1 + -4 - (5 + -2sqrt(18)) - sqrt(54)/(5sqrt(3)-1))*2. -768sqrt(2)/5 + 6208/25 Simplify ((sqrt(54)/(sqrt(32) - sqrt(2)))/(1sqrt(144)) + -3)2. -sqrt(3)/2 + 433/48 Simplify 2 + ((sqrt(125)-3)*2-2 - sqrt(125)) - (sqrt(125) + sqrt(125)22 - ((sqrt(125)2 - sqrt(125) - sqrt(125)) + -3))2. -5382 - 155sqrt(5) Simplify ((-2(sqrt(1053) + 0 + sqrt(1053)))2 - sqrt(78)/(6(sqrt(6) + sqrt(12)/sqrt(2))))13. -sqrt(13)/4 + 50544 Simplify (-4sqrt(560)-1 + sqrt(560) - sqrt(560) - sqrt(560))/(sqrt(320) - -4(sqrt(5) + sqrt(45) - sqrt(5))). 3sqrt(7)/5 Simplify (sqrt(700)3)2 + (sqrt(7) + -4)22 + 4. -16sqrt(7) + 6350 Simplify ((1 + -3 + 1 + (sqrt(1331) + -2)-4)5)2. -15400sqrt(11) + 533625 Simplify (((sqrt(3136) - -1sqrt(3136))-2)/(sqrt(700) + -6sqrt(700)-1 + sqrt(700)) + -1)*2. 4sqrt(7)/5 + 53/25 Simplify (sqrt(102) - (1sqrt(102)-3 - sqrt(102)))/((sqrt(600) - -1sqrt(600)) + sqrt(600) + sqrt(600))3. 3sqrt(17)/8 Simplify (sqrt(28)33)2 + ((sqrt(700)-3 - sqrt(700)) + (sqrt(70) + -3sqrt(70) - sqrt(70))/sqrt(10))2. 15211 Simplify (-3(-1sqrt(99) + -2 - (3 + sqrt(99)-1)))*2. 225 Simplify (-54(4 + sqrt(1377)1) + 4)*2. 27360sqrt(17) + 556576 Simplify ((sqrt(72) - (sqrt(72) + -21sqrt(72)))/sqrt(4))/((sqrt(729) - -1sqrt(729) - sqrt(729)) + (1sqrt(1296) - sqrt(1296)))-5. -10sqrt(2)/9 Simplify (5(2sqrt(1225) + sqrt(49))/sqrt(7) + -4 + 3)*2. -110sqrt(7) + 21176 Simplify (sqrt(8064) - (sqrt(8064) + (-22sqrt(8064) - sqrt(8064)) + sqrt(8064)))/((sqrt(5760)3)/sqrt(5)). 4sqrt(7)/3 Simplify 5 + ((-1(sqrt(2) + -2) - (1sqrt(20))/sqrt(10))5)2. -200sqrt(2) + 305 Simplify (sqrt(19) - (sqrt(228)/sqrt(768))*2) + 0 - (-4sqrt(304) + -2). 109/64 + 17sqrt(19) Simplify (-4 + sqrt(272) + sqrt(272) + -5 - (sqrt(272) - 4(sqrt(272) - (sqrt(272) + -4) - sqrt(272) - sqrt(272))))*2. -392sqrt(17) + 13377 Simplify (((sqrt(102)4 - sqrt(102))/sqrt(2))/(sqrt(75)-4))*2. 153/400 Simplify (-4(sqrt(4) + sqrt(12)/sqrt(3)) - -1sqrt(400))/(sqrt(800) + (sqrt(800) - sqrt(800)5)). -sqrt(2)/30 Simplify (-1 + (22sqrt(2))*2 + sqrt(24)/sqrt(3) + 5)-6. -216 - 12sqrt(2) Simplify (((sqrt(104) + sqrt(104) + sqrt(104) + -2sqrt(104))-6)/(2sqrt(24)/sqrt(3) - sqrt(8)) + 5)*2. -60sqrt(13) + 493 Simplify (2 + sqrt(60)/(sqrt(768)2) + 4 + -5)2. sqrt(5)/8 + 261/256 Simplify ((5 + -6(-2 + sqrt(153))3 + -4)5)*2. -99900sqrt(17) + 1273525 Simplify -6(3(sqrt(160)/sqrt(5))*2 + (-1sqrt(128)/sqrt(4))*2). -768 Simplify -5 + (2-4(5 + -3 + sqrt(1377)4 + sqrt(1377)))*2. 11520sqrt(17) + 2203451 Simplify sqrt(1900) + ((-3 + sqrt(1900) + sqrt(1900))-4)2 - sqrt(95)/(sqrt(405)/sqrt(9)). -5731sqrt(19)/3 + 121744 Simplify 3 + (sqrt(119) - (sqrt(119) + (sqrt(119) - (1sqrt(119)4 - sqrt(119)))))/(-5-1sqrt(7)). 2sqrt(17)/5 + 3 Simplify (-2(2 + sqrt(68))*2 + sqrt(119)/((1sqrt(35))/sqrt(5)))-5. 75sqrt(17) + 720 Simplify -6(2 + sqrt(612) + (sqrt(612) - (-1 + sqrt(612))))2 + ((sqrt(612) - (0 + sqrt(612)))3 - (3 + sqrt(612) + 2sqrt(612)))2. -108sqrt(17) + 1791 Simplify ((-4(sqrt(91) - (sqrt(91)1 + sqrt(91)) - sqrt(91)) - sqrt(91))-4)/(((sqrt(308)-1)/sqrt(11))/sqrt(4)). 28sqrt(13) Simplify (((sqrt(684) - (sqrt(684)-1 + -1)) + sqrt(684))*2 - sqrt(684)-1-5) + 4 + 0. 6sqrt(19) + 6161 Simplify (4 + 2 + 2sqrt(2057)-1)*23. -792sqrt(17) + 24792 Simplify 4 + ((sqrt(1008) + -1)-1)*2 + ((sqrt(112)/sqrt(4)-1)/sqrt(4))*2. -24sqrt(7) + 1020 Simplify (-3-5(-6(sqrt(1900) + -2) - (sqrt(1900) + -2)1))*2. -441000sqrt(19) + 20991600 Simplify ((sqrt(120) + (sqrt(120) + sqrt(120) + 1sqrt(120))-6)/sqrt(12))/(((-1sqrt(72) - sqrt(72)) + sqrt(2))-4). -17sqrt(5)/44 Simplify (-3(sqrt(171) + 4(sqrt(171) + 2sqrt(171))))/(4sqrt(36)6). -13sqrt(19)/16 Simplify ((2sqrt(228)-25)/((sqrt(12) + sqrt(12) + -2sqrt(1728))-1))*2 + 5. 2505/121 Simplify ((sqrt(44) - (sqrt(5324) - (2sqrt(5324) - sqrt(5324))))/(sqrt(768)/sqrt(12)) + -2)6. -12 + 3sqrt(11)/2 Simplify (-1 + 3sqrt(147) + 4)2 - (-4sqrt(147)11)*2. -1020 + 126sqrt(3) Simplify	{ "pile_set_name": "DM Mathematics" }
of x and n. 44 Let q(m) be the third derivative of m*5/30 + 5m4/24 - m3/3 - 3m2. Let u be q(-8). What is the smallest common multiple of 2/4 - u/(-4) and 12? 132 Let j(z) = -z3 - 9z*2 - 10z - 8. Let y(m) = m*3 - 10m*2 - 6. Let r be y(10). Let v(c) = -2c - 4. What is the lowest common multiple of v(r) and j(-8)? 8 Suppose -3q + 4x = -4q - 3, 0 = -2q - x + 8. What is the smallest common multiple of ((-27)/(-1))/3 + -2 and q? 35 Let y = 7 - -17. Suppose -i + 4i + y = 0. What is the lowest common multiple of 2 + 0 - (i - 1) and 4? 44 Let l be -13 + (-9)/3. Calculate the common denominator of (-101)/(-12) + (l - -4) and -113/20. 60 Let m(n) = 3n - 6. What is the least common multiple of m(12) and 3? 30 Let z(p) = -p3 - p2 + p - 5. Let c be z(0). Let d(v) = v + 8. Calculate the smallest common multiple of d(c) and 6. 6 What is the common denominator of -59/5 and (-1 - 4)(-42)/(-100)? 10 Find the common denominator of 19/4 and (-80)/(-12) - -2 - 3. 12 Let n(x) = -x + 2. Calculate the smallest common multiple of n(-8) and 7. 70 Let n(h) = -h*3 + 5h*2 - 4h + 6. Calculate the least common multiple of 12 and n(4). 12 Let d = 130/17 + 677/136. Find the common denominator of d and 17/10. 40 Let q = -33 - -61. What is the lowest common multiple of 12 and q? 84 Let c be 51/(-2)-2. Suppose 3r + 12 = 3i, -i - 2i - cr = 20. Let t(l) = -l + 2. What is the lowest common multiple of 8 and t(i)? 8 Let h(q) = 7q - 1. Let v be h(-1). Calculate the common denominator of -49/9 and ((-126)/(-75))/(v/(-30)). 90 Let u = 16441/112 - 1042/7. Calculate the common denominator of -71/2 and u. 16 Calculate the common denominator of ((-5406)/265)/(-121) and -25/8. 40 Let o(a) = a3 - 17a*2 + 1. Calculate the least common multiple of 1 and o(17). 1 Let v = -558 - -4455/8. Let u = -33053/15 + 272041/120. Let g = -483/8 + u. What is the common denominator of v and g? 40 Let u = -61/18 + 1/18. Find the common denominator of u and 4/5. 15 Let z = -175511/18 + 9755. Calculate the common denominator of 11/18 and z. 18 Calculate the common denominator of 170/(-2)(-1)/(-12) and -71/10. 60 Let c = 346 - 509. Calculate the common denominator of 7/4 and 9/15 + c/(-45). 36 Calculate the common denominator of ((-52)/(-18))/(2/(-5)) and 49/9. 9 Let d = 32 + -46. Let y = 20 + d. Let n = 9 - 5. Calculate the lowest common multiple of n and y. 12 Suppose 4 + 16 = -4b. Let x = b + 13. Calculate the smallest common multiple of (0 - (-10 - 1)) + -2 and x. 72 Calculate the common denominator of 267/(-42) - (-20)/(-35) and -51/8. 56 Let h be (2 - 0)(-1)/(-1). Suppose j + 0 = h. Suppose -2 = -jq + 2. Calculate the lowest common multiple of 9 and q. 18 Let u = 19 + -7. Calculate the lowest common multiple of u and 20. 60 Suppose -13 = -3c + 14. What is the smallest common multiple of 19 and c? 171 Let h = 10 + 2. Let d = 6 + -22. What is the least common multiple of h and (-2)/40 - d? 48 Let g(k) = k2 - 4. Let n be g(6). Suppose -5f + n = -f. What is the lowest common multiple of f and 14? 56 Find the common denominator of -149/12 and 1 + -1 + 33/24. 24 Let k = 541/4 + -997/8. Calculate the common denominator of 18 and k. 8 Let y be 3 + -6 + 0 - 359. Let s = 2526/7 + y. Let w = -160 + 473/3. Find the common denominator of s and w. 21 Suppose 4 = -4c + 44. Let n = -3441/2 + 1675. Calculate the common denominator of n and c/(-6)102/16. 8 Suppose 2r - 3z - 111 = 3r, 3r = 3z - 369. What is the common denominator of 99/2 and (-236)/r - (-1)/3? 10 Suppose -39 = -4m + 33. Calculate the least common multiple of 16 and m. 144 What is the least common multiple of 20 and (-99)/(-4) + 1 + (-18)/24? 100 Let d = -42 - -75. What is the smallest common multiple of d and 10? 330 Suppose 0 = 5t - 95 + 15. Suppose 0 = 3d + 2d + 35. Let b = d + 11. What is the smallest common multiple of b and t? 16 Let k(n) = n3 + 4n*2 - n + 1. Let a = -8 + 4. Let c(i) = 3i - 5. Calculate the least common multiple of c(4) and k(a). 35 Suppose -4n - n - 3j - 7 = 0, 14 = -5n + 4j. Let y be n2318629/72. Let v = y - -17696. What is the common denominator of v and 7/8? 72 Let b = 105305/22 + -4784. Let c be 4/((-16)/(-57))-4. Find the common denominator of b and c/(-10)(-1)/3. 110 What is the common denominator of -19/8 and ((-10)/(-195))/(16/6)? 104 Suppose -4a + 15 = -13. Calculate the least common multiple of a and 1. 7 Let y = 1087/26 + -82/13. Calculate the common denominator of y and 63/100. 100 Calculate the common denominator of 31/4 + (7 - 4) and 51/10. 20 Suppose 13 = 5l - 42. Suppose l = 4i - 3i. What is the smallest common multiple of 2 and i? 22 Let d be ((-2)/(-6))/(1/39). Let t = -5 + d. What is the lowest common multiple of 10 and t? 40 Suppose -4i = 5k - 53, 10 = 2i - i - 2k. Suppose w - o = i + 4, -5w + 40 = 5o. Find the common denominator of (-33)/84 + (-3)/w and -63/22. 154 Let a = 5460 + -2156698/395. Let q = a + -16217/4345. What is the common denominator of 25/9 and q? 99 Suppose -4v + 7 + 9 = 0. Let k(u) = vu - u*2 + 5 + 2u - 2u. Calculate the smallest common multiple of k(4) and 5. 5 Suppose 2b = -2b + 20. Suppose -4o - 13 - 35 = 0. Let t = 13 + o. What is the least common multiple of t and b? 5 Let n = 115 - 91. What is the lowest common multiple of n and 9? 72 Suppose -4g + 9 = d, 2 = -2g - 4d + 10. Calculate the lowest common multiple of g and 25. 50 Suppose -5h - 4b - 6 = 0, 20 = 4h - 2h - 4b. Suppose h = 2g, 2g + 9 = 2j - g. Calculate the least common multiple of j and -24(4 + -1)/(-6). 12 Let u = -17510/4861 - -53846812/4797807. Let w = u - 7/141. What is the common denominator of w and (2/(-6))/((-1)/55)? 21 Let l be (-2)/1(-4)/(-8). Find the common denominator of 5/11 and l + 114/(-27) + 1. 99 Suppose 0k = 5k - 50. Let o = -3673/7 + 530. Find the common denominator of o and -1 - -3 - 124/k. 35 Let d = -5 - -3. Let b(z) = -5z + 6z - 2z. Calculate the least common multiple of 6 and b(d). 6 Let z(q) = 12q - 10. Let f be z(8). What is the least common multiple of 16 and 2/4 + f/4? 176 Suppose -10h - 5h = -60. Suppose 2y - 32 = -2y. What is the lowest common multiple of y and h? 8 Let u be 38/(-2 + 5 - 4). Calculate the common denominator of 73/22 and 12/(-112)u + -1. 154 Find the common denominator of 87/16 and (-20)/(-30) - 37/(-30). 80 Find the common denominator of -17/7 and 4/6(-10)/(-150). 315 Let z = 13 + -7. Calculate the lowest common multiple of z and 3 + (0 - 0)/3. 6 Find the common denominator of -121/20 and (-2)/40(-72)/4. 20 Let d = 12 - 3. Suppose w = -t + d, -5t + 2w + 38 = -14. Calculate the smallest common multiple of 18 and t. 90 Let g(c) = 11c - 3. Let v be g(9). Suppose 3a - v = 258. Find the common denominator of -41/7 and 2/(-5)a/(-4). 35 Let k = 31497/8 - 3932. What is the common denominator of 43/16 and k? 16 Let n = 7 - 3. Suppose -29v + 27v = -10. Calculate the smallest common multiple of n and v. 20 What is the lowest common multiple of 76/14 + (-42)/98 and 6? 30 Let t(d) = -d2 - 10d - 8. Let s be t(-6). Find the common denominator of (-1519)/(-372) + 1/((-6)/(-4)) and ((-92)/6)/(s/(-9)). 8 Let i(k) = -3k2 + k. Let n be i(-1). What is the smallest common multiple of (-11)/n(-24)/(-3) and 2? 22 Suppose 244 - 901 = g. Let m = 6517/10 + g. Find the common denominator of m and -67/8. 40 Suppose -4u = -3l + 36, 0 = -2l - 2u + u + 24. Suppose -92 = -3h - 32. Calculate the least common multiple of 448/h + (-6)/15 and l. 132 Let j(h) = -h2 - 16h - 10. Calculate the smallest common multiple of j(-15) and 3. 15 Suppose 2m + m = 3. Suppose 7 + 9 = 8l. Calculate the least common multiple of m and l. 2 Let x(f) = f*2 + 6f - 6. Calculate the lowest common multiple of x(-7) and 7. 7 Calculate the least common multiple of 12 and 27-21/(-6). 36 Let k = -264 - -1860/7. What is the common denominator of k and 10? 7 Let c = 1 - 1. Suppose 3a + 2696 + 7003 = c. Let v = -12995/4 - a. What is the common denominator of 59/9 and v? 36 Suppose 0 = s - 4s + 9. Suppose -1 = -p, -sj + 3p = 2*j - 12. Calculate the least common multiple of 4 and j. 12 Let h = -10965319/18310 - 54/1831. Let r = h - -597. Let k = -5277/10 + 530. What is the common denominator of r	{ "pile_set_name": "DM Mathematics" }
e number? True Let g be ((-34)/(-6))/(2/60). Suppose -34u + 117 = -33u. Let r = g - u. Is r a prime number? True Let s(n) = 22n2 - 1. Is s(1) a prime number? False Suppose 0 = 2n + 14 - 126. Is -1 + 3 + n + 1 prime? True Suppose -n - 1970 = 4n. Let k = n - -555. Is k prime? False Let m(f) = f3 + 9f*2 - 10f - 2. Let x be m(-10). Is 5/((-15)/(-663)) - x prime? True Let t(l) = 5l2 - 23l - 5. Is t(-13) a composite number? True Suppose -5m + 10m = -4v + 5439, m = 4v - 5445. Is v prime? True Let x be 3093/2 - (-11)/22. Suppose -5d = -x - 348. Is d a prime number? True Let w(v) be the third derivative of v4/24 + v3/3 + 7v2. Is w(5) prime? True Let n(y) = -y3 - 6y2 - 5y - 8. Let h be n(-6). Let k = h - -91. Is k composite? False Suppose u - 1 = 1. Suppose 5t = -4v + 323, uv + 10 = -3t + 203. Suppose 0i + 3i + 4o = 154, i - o - t = 0. Is i a composite number? True Let g(u) = u2 + u3 + 3u*2 - 5u - 2 + u*2. Is g(-5) a prime number? True Let h(f) = 2f*2 - 3f - 3. Let u(c) = -c*2 - 6c + 6. Let v be u(-6). Is h(v) a composite number? True Let b be (104/(-13))/(2/(-118)). Is (-3)/((-12)/b) - -3 a prime number? False Suppose -2r = -5r + 6. Let i be 11/2 + r/(-4). Suppose -2m + 3m = -ip + 476, 4p + 5m - 385 = 0. Is p prime? False Is -52((-68)/16 - -3) a prime number? False Suppose -5a + 8 = c, 0 = -2c + a + 2 + 3. Suppose 104 = -cu + 851. Is u composite? True Let i be ((-18)/8)/(2/8). Let g = 55 + i. Suppose g = 5c - 409. Is c prime? False Suppose 4c - 5k - 80 = 0, 3c - 5k = 6c - 60. Suppose c = x + x. Is x a composite number? True Let t = 68 + 2111. Is t a prime number? True Let f = 215 + -106. Is f prime? True Let f(u) = -u3 + 2u*2 - 9u + 3. Let b be f(-9). Suppose 5g - b = 5m, 5g = -m - 418 + 1387. Is g a composite number? True Let i(a) = 5a*3 - 2a*2 + a. Let r be i(1). Suppose 2f - 108 = -5v + rf, f + 43 = 2v. Is v a composite number? True Let u(v) = 4 + 0v + 3v - v2 + 5v*2 - 2v. Is u(3) a prime number? True Let j be 4(1 - 2) - 1829. Is j(4 + 39/(-9)) composite? True Suppose 0 = 7v - 568 - 853. Is v a composite number? True Let f(p) = p2 + 3p + 2. Let i be f(-2). Let v(m) = -m*2 + 46. Is v(i) composite? True Let w(o) be the third derivative of -11o*4/24 - 11o*3/6 - 3o*2. Is w(-8) prime? False Let h = -250 - -553. Is h a prime number? False Suppose c = -0c + 10. Is c prime? False Suppose -5u + 28 - 3 = 0. Suppose -3c + 611 = -z - z, 0 = -5z - u. Is c prime? False Suppose -5j - 13 = -3. Let w be 3123/(-6)j. Suppose -3i + 59 = 2v - 302, 0 = -i + 2v + w. Is i composite? True Suppose 868 = 4z + 2h, 2z + 4h = -3z + 1085. Let o = z + -126. Is o prime? False Let c(v) = 5v2 + 4v + 3. Let h be c(-4). Suppose 94 = y - h. Is y a prime number? False Let q = -12 + 9. Let c(r) = -19r3 - 2r*2 + 3r + 1. Is c(q) a composite number? False Let h(d) = d*2 - 2d + 7. Let b be h(7). Let z be (-1)/1(-6)/2. Suppose zr + 0r = b. Is r prime? False Let y(c) = 5c*3 + 3c*2 + 10c - 1. Let x(h) = 4h3 + 3h*2 + 9h - 1. Let a(p) = -6x(p) + 5y(p). Is a(7) a prime number? False Suppose 6t - 35 = t. Suppose -46 - t = -l. Is l composite? False Let v = 57 - 39. Suppose 5m - 3t - 39 = 0, m - 3t - t = v. Is 7(-4)/m-3 composite? True Let r = -7 - -11. Let k(o) = o*3 - 3o*2 - 2o + 6. Is k(r) a prime number? False Let r = -252 + 461. Let w = r + -78. Is w a composite number? False Let m(b) = 0b + 1 + 2b - 1 - 4. Let l be m(-4). Is (-4)/l - (-110)/3 prime? True Let p = 4 + -5. Let f = 8 + p. Is f a prime number? True Let j be (-5)/(2 + 1-3). Let z = j + -5. Suppose -5g + 183 = -4c + 2c, z = c - 1. Is g prime? True Suppose 0 = q - 5q + 24. Let r(t) = t3 - 6t*2 + 4t + 7. Is r(q) a prime number? True Is (-155)/25 + 6 - (-2096)/5 a composite number? False Suppose 5l - 3l - 3p - 18 = 0, -3p = 12. Let s(f) = -3f2 + 3 + 2f*3 + 3f3 + fl + 6f - 5f*3. Is s(5) composite? False Let w be ((-2)/4)/((-2)/(-8)2). Let x = 18 + -13. Let a = x - w. Is a a prime number? False Suppose 3o + 6 = 0, 0 = -4s + 3o - 2o + 762. Is s/4 - (-3)/(-6) a prime number? True Let f = 0 - -1. Suppose s + 0 = v + f, -3v = 3s + 21. Let i(n) = 3n2 - 2n + 4. Is i(s) a prime number? True Is ((-2384)/(-20))/((-6)/(-15)) prime? False Suppose -n = -3n + 298. Is n a prime number? True Let u(s) = 3s*2 - 10s - 4. Suppose 0p + 5p - 45 = 0. Is u(p) composite? False Let v(s) = -3s + 1. Let q be v(-1). Suppose 3f + 85 = qf. Is f a composite number? True Suppose 9q - 406 = 7q. Is q a prime number? False Let i(d) = -26d - 25. Is i(-14) a prime number? False Let k = 53 + 17. Suppose 0 = -3t + 2x + 10, 5t + 4x = -4 + 50. Suppose tq - q - k = 0. Is q prime? False Let v(f) = -f3 - f + 12. Let t be v(0). Suppose -3i = -5i - 8, -t = -l + 3i. Suppose -158 = -lk - 2k. Is k a composite number? False Suppose 0 = 4y - 85 + 13. Let s be (-2)/(-3) - (-798)/y. Let x = s + 10. Is x a prime number? False Let t(o) = -2 + 0 - 3o + 1. Is t(-5) a prime number? False Suppose 5w = -4c + 30, -w + 6 = 2w. Let z(f) = 41f + 5. Let r be z(c). Suppose r + 120 = 2h - 5g, 445 = 3h + 5g. Is h a prime number? False Let u = 3982 - 2765. Is u a prime number? True Let b(o) = -108o - 41. Is b(-14) prime? True Let c = 2 - 2. Let s(g) = -g3 - g + 33. Let q(d) = -1. Let h(v) = -2q(v) + s(v). Is h(c) a composite number? True Let a = 0 - -2. Suppose -365 + 1139 = 5n - 4z, 5n - 782 = az. Is n composite? True Suppose -2 = 3a - 4a. Is a/7 + (-18925)/(-35) a composite number? False Suppose -3t = -6t. Suppose 0 = 2h + p - 63, -4h - p + 4p + 151 = t. Is h composite? True Let b = 2762 + -1855. Is b a composite number? False Suppose 10x = 8x + 298. Is x a prime number? True Let w = 1 - 1. Suppose wf = -2f + 66. Is f composite? True Let c(r) = -r2 + r. Let n(p) = 5p*2 + 3p + 1. Let z(i) = -4c(i) - n(i). Let u(h) be the first derivative of z(h). Is u(-7) composite? False Let c(q) = -q3 - 6q*2 - 3q + 13. Let y be c(-6). Let s = 0 + 2. Suppose -y = -sp + 251. Is p prime? False Let k = 0 + 2. Is 41/k - 1/(-2) prime? False Let q = 288 - 74. Is q a prime number? False Let o = -3 - -5. Suppose -5p + 2l + 4 = 4l, 0 = -4p - 3l + 6. Suppose -oa - a + 12 = p. Is a a prime number? False Suppose -2x + 4 = -2a + 20, 0 = -2a + 5x + 10. Suppose -2p + a = -0p. Let c(b) = b3 - 5b*2 + 3b - 2. Is c(p) a prime number? True Suppose -3m - d = -4m + 14, -5d = -2m + 28. Let i = m - -7. Is i prime? False Let p = 9 - 4. Suppose py - 45 = -0y. Is y a composite number? True Let m(w) = w - 6. Let q be m(9). Suppose 2n + qn = 1075. Is n prime? False Suppose -315 = -4p - 19. Is p a composite number? True Let f be 0 + (-7 - -1)/(-2). Let q(y) = 2y - 3. Let x be q(f). Suppose 2s + xj - 2j = 39, 5j - 24 = -s. Is s prime? True Suppose -6 = -5d + 19. Suppose -dt + 5m + 35 = 0, -2t - 5m = -5t + 27. Suppose -t = -4a + 20. Is a prime? False Let g = 223 + -159. Let n = g + -9. Is n a prime number? False Suppose -3f - x = 22, -4f + 2f - 15 = x. Let o(r) = r*3 + 7r*2 - 7r + 6. Is o(f) a composite number? True Suppose p - 340 = -3p - 4y, 2y - 419 = -5p. Is p a composite number? False Let q be (2/(-3))/(2/330). Let v = q - -223. Is v a prime number? True Let f(w) = w*3 + 4w*2 + 3w - 1. Let l be f(-3). Let o be 1(-4 - -2)/2. Is -1 - o - (l + -18) prime? True Let u be 2/3 - (-57)/9. Suppose us = 2s, -5q + 4s = -465. Is q prime? False Let a = 1460 - 581. Is a prime? False Let m(z) = -z3 - z2 - 7z - 5. Is m(-4) a composite number? False Let y(c) = 6c - 2. Let w be y(6). Let h = 57 - w. Is h prime? True Let t(r) = r3 + r3 + r2 - 2r*2 + 3 + 2r - r*3. Is t(4) a prime number? True Suppose -i = 2h - 383, 4i - 1096 - 386 = 2h. Is i composite? False Suppose 3b - 12 = v - 2, -4b + 10 = -3v. Suppose -3y + 2y + 108 = vw, 5w = 3y + 259. Is w a composite number? False Let l(k) be the third derivative of 11k4/12 - 2k*2. Suppose -3o + 11 = 5p, p + o = 5o - 7. Is l(p) a composite number? True Suppose s = 2u + 201, 2u = 6u + s + 411. Let p = u + 187. Is p a prime number? False Suppose 7t - 8*t = 1. Is (2/t)/(	{ "pile_set_name": "DM Mathematics" }
tor of p and 9? 9 Let o(k) = 41k + 42. Let g be o(5). Let i = g - 169. What is the highest common factor of i and 104? 26 Let r(i) = -34i + 2. Let x be r(-3). Let y(p) = -3p2 - 44p - 52. Let o be y(-13). What is the highest common factor of o and x? 13 Suppose f - 85 = 5w, -12 = 4f + w - 289. Let q be (f/28)/((-2)/(-4)). What is the highest common factor of q and 60? 5 Let u be (-32)/8 + -1 + 4. Let j(p) = -p*2 - 4p - 2. Let q be j(u). What is the greatest common divisor of q and 8? 1 Suppose 2t = -5p + 15, 0 = 5t + 2p + 2 - 8. Suppose t = -4s + 42 - 10. Calculate the highest common divisor of s and 32. 8 Let h = -4867 - -4927. What is the greatest common factor of 4800 and h? 60 Let d(v) = -1. Let y(z) = -7z + 27. Let q(w) = 3d(w) - y(w). Let s be q(10). Suppose -8 = 3h - 4h. What is the highest common divisor of h and s? 8 Suppose -3t = -282 - 3699. Suppose t = 6a + 307. What is the highest common divisor of a and 10? 10 Suppose -5s + 1638 = s - 3s. Calculate the greatest common factor of s and 208. 26 Suppose 5v - 265 = -3q - 1, -q + v = -72. What is the greatest common factor of q and 507? 39 Let l = -541 + 560. What is the highest common divisor of l and 247? 19 Suppose 0 = -5w + 28 + 37. Let z be -1 + (5 - -2) - 18. Let g be (-3)/z - 4568/(-32). What is the greatest common divisor of g and w? 13 Let d = 2156 - 1212. Suppose -r + 13z + 948 = 9z, r - d = 2z. What is the highest common divisor of 47 and r? 47 Let n(j) = -63j + 946. Let p be n(12). Let k = -350 + 825. Calculate the highest common divisor of p and k. 95 Let p(r) = 4r3 + 32r*2 - 38r - 346. Let c be p(-7). Calculate the highest common divisor of c and 820. 4 Let i be (-2)/6 + (-1168)/(-48). Suppose -5d = l - 48, -2l - id + 19d = -106. Calculate the greatest common factor of l and 406. 58 Let o = -5033 - -5047. Calculate the highest common divisor of 1561 and o. 7 Let v(x) = x*3 - 3x*2 - 5x + 12. Let g(m) = 19m - 90. Let r be g(5). Let q be v(r). Calculate the greatest common divisor of q and 2. 1 Let v = -230 + 230. Suppose -3t - 11 = -u, v = 5u + t - 2t - 13. What is the highest common divisor of u and 6? 2 Let w = 2598 + -2210. What is the greatest common divisor of w and 97? 97 Let g(m) = -2m3 + 5m*2 - 2m + 1. Let u be g(5). Let c = -90 - u. Suppose -659r + 36998 + 1347 = -5149. What is the greatest common factor of r and c? 22 Suppose -599 = -7j + 5h, -h + 241 = 22j - 19j. What is the greatest common divisor of 7585 and j? 41 Suppose 0c + 6 = 2c. Suppose -6r + 2r - 56 = 0. Let v(y) = y3 + 16y*2 + 27y + 13. Let d be v(r). What is the highest common divisor of d and c? 3 Let s(m) = -2m3 - 2m*2 + 29m + 160. Let c be s(-5). What is the highest common factor of 301 and c? 43 Let z = 117 - 93. Suppose 5l - 24 - 21 = 0. Let u be (-3)/l-827. What is the greatest common factor of z and u? 24 Suppose 0 = -2o + 5x + 79, 7o - x - 112 = 4o. Let g = 48 - o. What is the greatest common divisor of 1 and g? 1 Let w(d) = d3 + 8d*2 - 11d + 9. Let h be w(-9). Let f = h + 68. Let i = 43 - 24. Calculate the highest common divisor of i and f. 19 Let r = -108 - -113. Suppose -9 = 3v, 9s - 3v + 716 = 14s. What is the highest common factor of s and r? 5 Let a be (-164)/(-8) - 5/(-10). Suppose m + 4r + a = -11, 5r = 3m + 79. Let v = m - -56. What is the greatest common divisor of v and 8? 4 Let h(p) = 24p*2 - 45p + 654. Let g be h(8). What is the highest common divisor of 130 and g? 10 Let f be (-12)/(-1)(-21)/(-6). Let a(r) = 4r*2 + 936r + 20958. Let z be a(-24). What is the highest common divisor of f and z? 42 Let f(c) = c*3 - 8c*2 + 4. Let v be f(8). Suppose -20 = -vb + 4. Suppose s - 1 = b. Calculate the highest common factor of 7 and s. 7 Let v(a) = 4a + 48. Let y be v(-11). Let g = 7 - 4. Let n be (1842/y)/g - 6/12. Calculate the greatest common factor of n and 17. 17 Suppose -16g - 56 = -88. Let f = g - -412. Calculate the greatest common factor of 9 and f. 9 Suppose 104n - 185380 = -26n. What is the highest common divisor of n and 372? 62 Let c(n) = 680n - 5371. Let w be c(8). Calculate the highest common factor of w and 5451. 69 Let a = 357 + -159. Suppose -172 = -11v + 26. What is the greatest common factor of v and a? 18 Suppose -69 = -3s - 5q + 86, -139 = -4s + 3q. What is the greatest common factor of s and 2624? 8 Let x = 5777 + 3167. What is the greatest common factor of 208 and x? 208 Suppose -12n + 55 = -257. Calculate the highest common factor of 1352 and n. 26 Let i(z) = 24z - 12. Let k be i(3). Suppose 3132 = -kv + 78v. What is the highest common factor of v and 435? 87 Let l(h) = 2h2 + 126h + 2820. Let f be l(-42). Calculate the highest common factor of f and 1419. 33 Let z be (2/3)/((-98)/(-12789)) + 5. Calculate the highest common divisor of 1219 and z. 23 Let d(r) = -23r3 + 4r*2 - 2r - 1. Let x be d(2). Let p = 582 - 860. Let f = x - p. Calculate the greatest common divisor of f and 15. 15 Suppose 3o + 2320 = 8o - 4a, -2o + 951 = 3a. Let n(i) = i3 - 56i*2 - 140i + 1410. Let b be n(58). What is the greatest common divisor of o and b? 18 Let v = 2976 - -2141. Calculate the highest common divisor of 85 and v. 17 Suppose 2k + 2 = 8. Suppose 6 = 3r, 2a - 2 - 10 = kr. Suppose -ai + 6i = -3. Calculate the highest common factor of i and 5. 1 Let l be 14 - (-13)/(208/9376). Calculate the highest common divisor of l and 850. 50 Let x be (210/27 - -1) + 68/(-18) + 4. Suppose -34 = -2y - h + 3h, 5y = -h + 91. Calculate the greatest common divisor of x and y. 9 Suppose -8 = 4a, 1590 = 9j - 5j - 3a. What is the greatest common factor of j and 27? 9 Suppose 0 = -8u + 65 + 207. Suppose ua - 81 = 31a. Suppose 1147 = 14v + a. Calculate the greatest common factor of 32 and v. 16 Suppose 3g - 65 - 85 = 12. What is the greatest common divisor of g and 2862? 54 Suppose 117f + 62 = 119f. Calculate the greatest common factor of 589 and f. 31 Let x be 38/(-14) - (-2)/(-7). Suppose -2150 = -54p - 2p - 30p. Let t = x + p. Calculate the highest common factor of 22 and t. 22 Let a = -90 + 96. Suppose -af + 10f + 272 = 0. Let r = f + 88. What is the greatest common factor of r and 30? 10 Suppose -6c + 2 = 14. Let s be (0/(4/(c + -2)))/(-2). Suppose -44 = -o - so. What is the greatest common divisor of 396 and o? 44 Let z be (-13)/(14 + (-1206)/90 + (-8)/5). Let n = 225 + -134. Calculate the greatest common factor of z and n. 13 Suppose 0 = -14r - 15r + 29. Let i be ((12/21)/r)/(10/35). Let v(o) = 2o - 5. Let s be v(5). Calculate the highest common factor of i and s. 1 Suppose -4997 + 1682 = -17b. Let f = b - 89. Calculate the greatest common divisor of f and 106. 106 Let t be (18/(-10))/(118/(-60)) - 4. What is the highest common divisor of 2342 and t? 2 Let v(p) = 59p + 303. Let o be v(-5). Suppose -y - 3i + 46 = 0, -2y + 3i = y - 114. Calculate the highest common divisor of o and y. 8 Suppose 4x - 237 = -p, -14p + 9p = -2x + 135. What is the greatest common factor of x and 4240? 20 Let f be -1(0 - (4 + -5)-1). Let j(k) = 33k - 19. Let p be j(f). Let o = 832 + -594. What is the highest common divisor of p and o? 14 Suppose -s + 255150 = 47s - 6s. Calculate the highest common factor of 3 and s. 3 Suppose 125v - 172v = -95598. What is the highest common factor of v and 18? 18 Suppose 559 = -34y + 899. Calculate the highest common factor of y and 7295. 5 Let g = 4 - 111. Let j = -91 - g. Let b be 1(-1 - -2)8. What is the highest common factor of j and b? 8 Suppose -15l = -12128 - 367. Calculate the greatest common divisor of l and 102. 17 Let k = -422 + 501. Suppose 3j - k = -d, -d + 4j = 3d - 300. Calculate the highest common divisor of 57 and d. 19 Let p(l) = 4l2 + 187l + 268. Let c be p(-48). Calculate the greatest common divisor of 7493 and c. 127 Let m(g) = 6756g2 + 12g + 16. Let l be m(-1). What is the greatest common divisor of 104 and l? 104 Let s = -412 + 434. Suppose -6u = s - 28. What is the greatest common factor of 2 and u? 1 Suppose 8 = 2t + 2d, 3t + t - 5d - 25 = 0. Suppose -44i - 50i = 0. Suppose ik = -tk + 30. What is the greatest common divisor of k and 12? 6 Let c(u) = -2u**3 -	{ "pile_set_name": "DM Mathematics" }
51nt + 5 wrt n? 12nt - 24890544n What is the second derivative of -187932012o*2y*2 + oy*2 + 4oy - 3o - 5y2 - 12655y - 33 wrt o? -375864024y2 Find the third derivative of -821j*2w*3 + 2j*2w*2 + 67j*2 - 12176jw3 - 8jw2 + jw - w*2 + 31w wrt w. -4926j2 - 73056j Find the second derivative of -2164h2np2 + 305070h*2np - 21hn + 796np2 wrt p. -4328h*2n + 1592n Differentiate 2k*2w - 6k2 - kw + 3561k + 5126187w wrt k. 4kw - 12k - w + 3561 Differentiate -98406742s*3x*2 - 53s*3 + 718459s*2 wrt x. -196813484s*3x Find the second derivative of -71697960k5 + 104448004k wrt k. -1433959200k3 Find the first derivative of -4z*3 + 2z*2 - 6466674z - 65506253. -12z2 + 4z - 6466674 What is the derivative of -26491832fr + 1749ft + 311rt - 2r + 24t wrt t? 1749f + 311r + 24 What is the third derivative of 16312984b3kl3m + 3b3kl2 - 2b*3l*2m - 4b2l*2 - 2161b*2lm + bkl3m - 2bkm - bm wrt l? 97877904b3km + 6bkm Find the first derivative of -1280615ap*3 - 2171a - 222p3 - 23309 wrt p. -3841845ap2 - 666p*2 Find the second derivative of 11fj4 - 784fj + f - 509241j*5 + 4j - 42 wrt j. 132fj*2 - 10184820j3 What is the second derivative of -t5 + 11819041t2 - 26217200t wrt t? -20t3 + 23638082 Find the first derivative of -1063ab3i - 9931ai*3 + 8155b*3i*2 + 208b*2i*3 wrt a. -1063b*3i - 9931i3 What is the second derivative of -16vz2 + 28663vz + 6v - 168514z2 wrt z? -32v - 337028 What is the third derivative of 134498556o3 + 168349513o*2? 806991336 Differentiate 98b*2 + 113514b + 39225977 wrt b. 196b + 113514 What is the third derivative of -15462679r*3 - 46r*2 - r - 140136? -92776074 What is the third derivative of -4053001f*2u*3 - 4f*2u*2 - 955f*2 - 2fu2 + fu - 2f - 52u*2 wrt u? -24318006f*2 What is the third derivative of -12687509m*3 - 32468m*2 + 83m? -76125054 Find the third derivative of -24636138c5 - c4 + 5c*3 + 212c*2 + 1870c + 47 wrt c. -1478168280c2 - 24c + 30 Find the first derivative of 427926696o2 - 452836685. 855853392o Differentiate -43937d2 + 3884d - 364477747 with respect to d. -87874d + 3884 Find the third derivative of 31620811g*4 + 178g*2 + 10724g wrt g. 758899464g What is the third derivative of 48c*3f*2m - 43619c3fm - c2f*2m - 53c2f2 + c2f + 605m wrt c? 288f2m - 261714fm What is the derivative of 570675675q4 - 868188277? 2282702700q*3 Find the third derivative of 11961b*4 + 186b*3 + 10b*2 - 17b + 514 wrt b. 287064b + 1116 Find the third derivative of -19827486b*4 - 26983300b*2 wrt b. -475859664b Find the second derivative of 80rt*3v - 8rt*2v + 2rtv - 39rt + 6rv + 3r + 517t3v - tv + v wrt t. 480rtv - 16rv + 3102tv Find the first derivative of 1429tz*2 + 3tz - 53740t + 36483205z2 + 11 wrt t. 1429z*2 + 3z - 53740 What is the third derivative of 3505i3j*5 + 14207i*3j*3 - 4912445i*3j + ij2 wrt j? 210300i*3j*2 + 85242i*3 What is the derivative of -217767112m*3 + 296475675 wrt m? -653301336m*2 Differentiate 1064743x*4 + 139x*2 + 157174127 with respect to x. 4258972x*3 + 278x Find the first derivative of 144w2 + 327468w - 162314058. 288w + 327468 What is the derivative of 364o*3y - 470o3 - 2o*2y + 337oy + 4o + 3y + 754 wrt y? 364o3 - 2o*2 + 337o + 3 Find the first derivative of -12117oy*3 + 7oy2 - 92y*3 + 2495y wrt o. -12117y3 + 7y*2 Find the second derivative of 1320384j*2o*2 + 674138j*2o + 7j2 - 2o*2 wrt o. 2640768j*2 - 4 What is the third derivative of 2h*5 + 3097189h*4 + 8565899h*2 + 4h wrt h? 120h2 + 74332536h Find the first derivative of 46p2y*4 + 140915p*2y - 2p2 + 1356985p + 2 wrt y. 184p2y*3 + 140915p*2 Find the second derivative of -37577379h*4 + 2h + 197816 wrt h. -450928548h2 What is the second derivative of -13692598k*5 + 34k*3 + 26314048k - 17? -273851960k3 + 204k Find the third derivative of 32340982g3p*3 + 2g*3s + g*2s + 11gp*3 - 51gps + 649g + 2p*2s wrt g. 194045892p3 + 12s Find the second derivative of 1934fi*3 + 2fi2 - 2fi + 3292f + 4i3 - 2i*2 + 1064 wrt i. 11604fi + 4f + 24i - 4 Find the second derivative of 3d*3q - 10d3 + 28d*2q + 36d2 + 5dq - 27d - 2q - 624 wrt d. 18dq - 60d + 56q + 72 Find the first derivative of 5090650h + 879723 wrt h. 5090650 What is the second derivative of 16228636b2 - 9706278b? 32457272 What is the third derivative of 30988714l6 - 3194880l*2 + l wrt l? 3718645680l3 Find the second derivative of i2t2 + 5i*2t + 71i2 - 33915it2 + 48it + 2i - 36t2 - 7t wrt t. 2i2 - 67830i - 72 What is the second derivative of 59904i3 + 59i*2 + 12905026i? 359424i + 118 Find the first derivative of 214t*3 + 6t*2 + 87t + 18134824. 642t2 + 12t + 87 What is the second derivative of -11704117o5 - 50114415o wrt o? -234082340o3 What is the third derivative of -637567247d*3x*3 + 3d*3x - 59d3 + 5d*2x*2 - 953d*2x - 3d - 2 wrt x? -3825403482d*3 Find the second derivative of -3h*4 + 153102h*3 + 9h*2 - 13h + 7325115 wrt h. -36h2 + 918612h + 18 What is the derivative of -19384381r4 + 68043166? -77537524r*3 What is the first derivative of 7179679g + 38039487 wrt g? 7179679 What is the second derivative of -9n3 - 892298n*2 + 19980787n? -54n - 1784596 What is the second derivative of 24133d*4 - 1765d*2 - 17248703d + 2? 289596d2 - 3530 Find the second derivative of -15176232a*3p2 - a3p + 9a - 3184p + 21 wrt p. -30352464a*3 Find the second derivative of -575277819n*3 - 743866545n. -3451666914n Find the third derivative of 754q*6 - 317q*4 + 2q*3 - 1886279q*2 - 2q wrt q. 90480q3 - 7608q + 12 What is the second derivative of 61a3c*3 - 2a*3 + 2a*2c + 262a2 + 136c*4 - 3c*3 - 1719c wrt c? 366a3c + 1632c2 - 18c Find the first derivative of -50mn*3 - 6598793mnp + 760n3p - 155215n2p wrt m. -50n3 - 6598793np Differentiate 1387259fx2 + 7218581x*2 with respect to f. 1387259x*2 What is the first derivative of -910120314d*4 - 452409988 wrt d? -3640481256d*3 Find the third derivative of -10465237h*6 + 9h*4 + 45938807h*2 wrt h. -1255828440h*3 + 216h What is the first derivative of -n*3 - 33275981n*2 + 65680210 wrt n? -3n*2 - 66551962n What is the first derivative of 102362215t + 74426361 wrt t? 102362215 Differentiate 732966h*3 - 3182606 with respect to h. 2198898h*2 Find the second derivative of -5q*5 + 32q*4 - 11893q*3 + 2444673q + 3 wrt q. -100q3 + 384q*2 - 71358q Find the third derivative of -96565355p3t - 58687p2 + 217pt wrt p. -579392130t Differentiate 97254812v - 313622181 wrt v. 97254812 Differentiate -1607b*3g - 18901b3h + 63b2h*2 - 3470gh2 with respect to g. -1607b*3 - 3470h*2 What is the second derivative of -3s*5 - 2s*3 + 167393s*2 - 6641088s? -60s3 - 12s + 334786 Find the first derivative of -459bc + 268bg*2 + 2b - 13cg - c - 120g3 + 378 wrt g. 536bg - 13c - 360g2 Differentiate -83013455q + 32817019. -83013455 Find the second derivative of -702657660ry*3 - ry - 322530r - 2y + 44 wrt y. -4215945960ry Differentiate -102z4 + 9z*2 - 284z - 12886546 with respect to z. -408z3 + 18z - 284 What is the third derivative of 7814324j4l*2 + 5j*4l - 205j2l*2 - 3j*2 - 57jl2 + jl + 15 wrt j? 187543776jl*2 + 120jl Find the first derivative of -7f*4 + 20f*3 - 4420f*2 + 10375754. -28f*3 + 60f*2 - 8840f Find the third derivative of -60h4 + 892h*3uv + 250h*3v - 66h2v - 30h2 - huv + 3431hv + 5uv wrt h. -1440h + 5352uv + 1500v What is the second derivative of 47129u*2z*4 + 14u*2z*3 - 879u*2z - u*2 + 27u wrt z? 565548u2z*2 + 84u*2z Differentiate 1158kl*2 + 2kl + 49k + 4l2 + 3l - 188506 wrt l. 2316kl + 2k + 8l + 3 What i	{ "pile_set_name": "DM Mathematics" }
ange (-b*3 + 2 - 2)(211 + 38b + 97 - 39b) to gb + vb*3 + sb*4 + p + ub*2 and give v. -308 Rearrange (-1796 - 149v*2 + 1796)(3 - 3 + 2)(-v + 2v - 3v) to sv*3 + jv*2 + wv + d and give j. 0 Rearrange (-79 - 8 - 30 + 0)(-3k + 3k - 7k) to the form wk + o and give w. 819 Express -4479h - 2h3 + 4479h - 72h2 as ih*3 + d + yh*2 + zh and give d. 0 Express (1 + 1324y + 1310y - 2619y)(1 + 1 - 3) in the form wy + v and give w. -15 Rearrange m3 + 0m2 + m2 + 2m3 - 4m - 16m3 to sm*3 + dm*2 + o + km and give d. 1 Express -54 - 50r2 + 48r*2 - 82 in the form or*2 + dr + m and give o. -2 Rearrange -6049w - 5836w + 12628w to y + vw and give v. 743 Rearrange 9756f3 + 3f*2 - 9511f3 - f2 + 2 to the form j + if3 + uf + vf2 and give j. 2 Express -8y + 28 + 19y - 2y*2 - 11y - 2y3 in the form jy*2 + qy + uy3 + n and give j. -2 Express (-108n + 56n + 125n)(0 + 3 - 2) in the form in + p and give i. 73 Rearrange -69 - 61i - 69 + 138 to the form ui + h and give u. -61 Rearrange -2z - 18 + 30 + 35 + 108 + 2z*2 to the form c + gz*2 + dz and give d. -2 Express -4f + 3f*3 + 7f + 12f + 4f - f*2 in the form d + pf*2 + yf + uf3 and give u. 3 Express -19q + 137q + 75q + 56q in the form pq + j and give p. 249 Express 16 - 11 + 6 - 407k - 11 as h + yk and give y. -407 Rearrange 150d - 28d + 294d to the form bd + a and give b. 416 Rearrange (-2w + 6w - 2w)(4 - 2 - 1) + 2 - 2 + 2w + 1 - 1 - 14w + (-2 - 2w + 2)(0 + 3 - 2) - 4w + w + 2w + w - 1 + 1 to the form vw + a and give v. -12 Express (107 - 54 + 1034 - 235 + 1170)(-r + 3r - r) as sr + a and give s. 2022 Express -5 - 4 - 4 + 13 - 1190p in the form dp + r and give r. 0 Express -3k2 + 47k + 0k2 - 36k - k*2 - 142k as nk + q + yk*2 and give n. -131 Express (-115 + 13m - 11m + 35)(4m - m + 6m) as d + om2 + lm and give o. 18 Rearrange 3 - 424p + 22 - 25 to z + fp and give z. 0 Express (153 - 443 + 159)(-2 + 4 + 0)(3 + x - 3) in the form bx + h and give b. -262 Rearrange f + 0f*2 + 50f*4 - 51f4 - f2 - 2f to h + vf*4 + gf*3 + nf + sf2 and give n. -1 Rearrange (82 + 235 - 7)(-l + 2l - 2l)(-2 + 1 - 1) to gl + a and give g. 620 Rearrange (-1 + 2 + 1)(-3j + j + 0j) + 80 + 129 - j - 19 to the form cj + u and give u. 190 Express s - 27s3 - 25s*3 + 2s*2 + 17s*4 - 1 + 58s*3 in the form ls*3 + z + ys*2 + us*4 + rs and give y. 2 Rearrange 403n - 65n - 66n + 403n + 118n to bn + d and give b. 793 Rearrange 3 + a*3 - 259a + 5a2 + 262a + 0a3 + a4 to the form s + ka + ha4 + ma*3 + ca2 and give h. 1 Rearrange j2 + 13j3 + 3j + 14j3 - 5j - 25j3 + 22j*4 to mj + u + gj4 + lj*3 + xj2 and give g. 22 Express (-g3 - 4g3 + 4 + 4g*3 + (-1 - 14 + 2)(-2g3 + 0g + 0g))(3g + 2 - 7 + 4) as qg*2 + cg*3 + vg*4 + kg + l and give v. 75 Express 36 - 23 + l - 5l - 6l + 22 as zl + s and give z. -10 Rearrange -40 + 87 + v2 + v - 34 to the form kv*2 + i + ov and give i. 13 Express (-6 + 14 + 10)(-p2 + 3p - 3p) - 4p*2 - 19 + 19 in the form j + up*2 + mp and give u. -22 Express -4y2 + 6924y*3 - 3455y*3 - 3463y*3 + 6 as py*2 + my*3 + x + iy and give m. 6 Express (-296 + 571 - 314)(0 + 1 + 1)(2q - 3q + 0q)(1 - 3 + 4) as hq + z and give h. 156 Rearrange (-1320f + 4 - 4 - 2110f - 528f)(2f*3 - 4f*3 + 3f*3) to the form af*2 + kf*4 + i + of*3 + qf and give k. -3958 Rearrange -53a + 412 - 412 + 0a + 0a + a + (-3 + a + 3)(1 + 2 - 1) - 4a - a + 6a to the form na + b and give n. -49 Rearrange 1 + 220a*3 - 670a*3 + 229a*3 + 18a*4 - 2a + 224a3 + 2a*2 to o + ua*3 + ka*2 + la*4 + ja and give j. -2 Express 18 + 21 + 20 + 677w2 - 59 as lw*2 + cw + h and give h. 0 Rearrange m*3 - 28 - 37 + 2m*4 + 25 to the form dm*4 + rm*3 + p + cm + ym2 and give d. 2 Express 68g*4 - 7g*2 - 4g - 70g4 + 2g*3 + 0g*3 + 1 + 4g in the form d + yg + ug*2 + sg*4 + tg*3 and give s. -2 Express -4b*2 + 3b*2 + 544713b - 544715b + 11b*4 + 2 in the form kb*3 + rb + lb2 + nb*4 + s and give r. -2 Express -134j*2 + 1 - 1418j + 1418j in the form cj + rj2 + l and give r. -134 Express 16q - 60q - 50q + 10q in the form yq + f and give y. -84 Express -2 + 1418z - 60z*2 + 9z*3 - 1418z as y + mz + az*2 + jz*3 and give y. -2 Rearrange (0h + 2h3 + 0h)(-1742 - 1873 + 2881) to th + sh3 + x + dh*2 and give s. -1468 Express -3o2 - 934 + 1856 + o2 - 1022 as bo2 + yo + i and give b. -2 Rearrange 2 - 1165v2 + 1334v*2 - 4 to qv*2 + yv + l and give q. 169 Rearrange 1 - 3u4 - 82u*2 - 3u*4 + 2u*3 - 3u + 81u2 to the form qu + ou2 + wu*4 + t + nu*3 and give o. -1 Rearrange -23b*2 + 3b - 3b - 82b*2 to m + fb*2 + qb and give m. 0 Express (9i + 19i + 141i)(5i - 2i - i)(1 - 3 + 4) in the form ri*2 + ji + v and give r. 676 Rearrange (126 - 127 + 0i - 2i)(-4i + 5i - 4 - 2) to the form ri + ji2 + t and give j. -2 Express -3 + 17 - 2f*4 + 4f*2 + 3f*3 - 26f - 2f3 + 24f as zf3 + n + gf*4 + bf + kf2 and give g. -2 Rearrange -3q*3 + 6q*3 - 4q*3 + (q - 2 + 2)(-2q - 6 + 6)(-q - 2 + 11 - 8) to the form xq2 + aq + d + cq3 and give c. 1 Express 1376 - 2s - 14s - 1369 as hs + q and give q. 7 Rearrange -23 - 1 + 77b3 - 72b*3 + 194b*2 - 193b*2 to the form yb*3 + cb*2 + xb + t and give c. 1 Express -39q - 125 + 125 in the form b + zq and give z. -39 Express (2j - 2j + 3j)(34j + 40j + 44j + 15j - 6j) as x + nj + oj2 and give o. 381 Express -p3 + 5p*3 - 5p*3 + (7p*2 + 0p*2 - 2p*2)(-30p + 5 + 34p - 4) as ap + i + up*3 + tp*2 and give a. 0 Rearrange 134t - 90t + 249t to the form p + it and give i. 293 Rearrange (3o - 3o - 2o)(15o + 11o - 9o + (13 + 2 + 3)(2o + 3o - 3o)) to zo2 + v + co and give z. -106 Rearrange (-2n2 + 0n*2 + 3n*2)(0n + 2n + 4n)(1 + 3 - 5) + 625n - 625n + 29n3 to c + yn*2 + gn + pn3 and give p. 23 Rearrange 940l - 318l + 137l to ql + s and give q. 759 Rearrange -33w*2 + 0 + 22w2 + 2 - w2 to the form dw + x + tw*2 and give x. 2 Express (4s*2 + 4s*2 - 5s*2)(66s + 349 - 349) + 2s*3 + 2s*3 - 3s*3 as n + is*2 + ps*3 + xs and give p. 199 Express 20d4 - 168 - d3 - 12d*2 + 168 - 64d*4 in the form gd*4 + b + qd*3 + nd + vd2 and give g. -44 Express -3n*4 - 4 + 9n - 2n2 - n3 - 2n + 3n2 - 6n + 0n in the form bn*4 + v + in + gn2 + ln*3 and give i. 1 Rearrange -m - m + 3m + 0m + 3m - 6m - m + 4 - 4 + (0 + 0 - 2)(-m + m - 2m) - 5m - 19m - 4m + 2m - m - 2m to km + h and give k. -28 Express 4y*3 - 29 - 25 - 274 - 2y*3 - 74 in the form qy*2 + sy*3 + my + l and give l. -402 Rearrange 4s - 3s - 3s - 11428 + 9567 to the form rs + b and give b. -1861 Rearrange (-5i - i + 0i)((4 + 2i - 4)(-3i*2 + 2i2 - i2) - 11i3 - 2i*2 + 2i*2) to the form p + zi*2 + xi*3 + yi + vi4 and give v. 90 Rearrange 16 + 181x - 181x - 336x*2 - 16 to dx*2 + zx + n and give d. -336 Rearrange 196p + 6p*2 + 2 - 203p - 363p - 5p*2 - 2p*2 to jp*2 + xp + o and give o. 2 Rearrange (-4s + 2s + 0s)(-9 + 4 - 2) + (3 - s - 3)(5 + 1 - 2) to xs + k and give x. 10 Express (-8 + 0 + 22)(-4 + 0 - 2)(0x + 2x + 0x) in the form vx + s and give v. -168 Express (-2006 + 416 - 1856)(-2o*2 - 5o*2 + 5o*2) in the form do*2 + i + ko and give d. 6892 Rearrange 1 - 2s3 - s + 1 - 6s*3 - 11s*3 + 23s*3 to the form os*3 + ns + gs2 + m and give n. -1 Rearrange (3 + 27382d - 13623d - 13106d)(0 + 0 - 3) to the form t + nd and give n. -1959 Rearrange -28 - 22o4 + 0o*2 + 27 + 2o*2 + 2o + 0o2 + 9o*4 to lo*2 + t + xo*3 + uo*4 + vo and give u. -13 Express (-5c - 48c + 0c)(-1 - 2c + 1) + (2c - 2 + 2)(0c - 3c + c) - 3c*2 + 0c*2 + 9c*2 as u + mc*2 + pc and give m. 108 Express -623q3 + 516q*3 + 420q*3 - 2q as bq2 + yq*3 + n + oq and give b. 0 Rearrange -7*	{ "pile_set_name": "DM Mathematics" }
5)3 - sqrt(1225)) + sqrt(1225) - sqrt(1225)) + sqrt(1225)))/((sqrt(77)1)/sqrt(11)). -60sqrt(7) Simplify (5(-5 + sqrt(11) + 0 + 0 + -3))*25-1. -9375 + 2000sqrt(11) Simplify (sqrt(117) - (0 + (2sqrt(117))2)) + 23sqrt(117) + -3. -471 + 21sqrt(13) Simplify -3 + (1 + sqrt(162)1 - sqrt(162) - (-3 + 1 + sqrt(162))). -9sqrt(2) Simplify (1 + (0 + sqrt(567) - sqrt(567)) + sqrt(567) + -3)*2 - ((-2sqrt(175) - sqrt(175)) + 3 + -4). -21sqrt(7) + 572 Simplify (-2sqrt(1134)-2)/((-1sqrt(28) - sqrt(28) - sqrt(28))2). -3sqrt(2) Simplify (sqrt(25)/(-2sqrt(320)) - ((4 + sqrt(320) - sqrt(320)) + 0))2. sqrt(5)/2 + 4101/256 Simplify (-52sqrt(102) + sqrt(102) + (sqrt(102)-2 + sqrt(102))-5)/(-6(sqrt(6) - sqrt(24)/sqrt(4)-3)). sqrt(17)/6 Simplify -5(1 + sqrt(637))-4 - (0 + 1sqrt(637) + 5). 15 + 133sqrt(13) Simplify -1(-1sqrt(8))2-33. 72 Simplify 4 + (5 + sqrt(5)3 + 3)*2 + (-3(sqrt(720)4)2 - sqrt(720)). -34447 + 36sqrt(5) Simplify 4 + (2(sqrt(99) + -2) - (61sqrt(110))/sqrt(10))2. 20 Simplify (5 + 4(sqrt(1008) + (sqrt(1008) + 0)6)1)*2. 3360sqrt(7) + 790297 Simplify (sqrt(2106) - (sqrt(2106) + 2sqrt(2106)))/sqrt(2)-1 + -1. -1 + 18sqrt(13) Simplify -5(-1sqrt(98))2 + (2 + sqrt(98) + 3)2 + -2. -369 + 70sqrt(2) Simplify -2(-4sqrt(143)1 + sqrt(143) - sqrt(143) - (sqrt(143) - sqrt(143)2)-6)/(sqrt(44)/(1sqrt(4)2)). 40sqrt(13) Simplify ((sqrt(156) + sqrt(156) + (sqrt(156) - -2sqrt(156)))2 - sqrt(156)2-6)/(sqrt(60)/sqrt(45) + (sqrt(12) + (sqrt(12) - sqrt(192)) + sqrt(12))-4). 66sqrt(13)/13 Simplify (2-3-1sqrt(17) - (2 + (sqrt(187) + 2sqrt(187) + sqrt(187))/sqrt(11))*2) + 2 + 4. -270 - 10sqrt(17) Simplify -2((-1 + ((2sqrt(13))*2 - sqrt(13)) - (sqrt(208) + 0)) + (-2sqrt(468) + 1)*2). -3848 + 58sqrt(13) Simplify (-6-2sqrt(72))*2 + -4 + ((-1sqrt(80))/sqrt(4))/(1sqrt(10)6 + sqrt(10)). -sqrt(2)/7 + 10364 Simplify -5(sqrt(245) + sqrt(245) + -1) - (-3sqrt(180) + -4)*2. -1631 - 214sqrt(5) Simplify ((sqrt(352)/(sqrt(64)/sqrt(2)))/(sqrt(324)1 - (sqrt(4) + -6sqrt(36) - sqrt(4))))*2. 11/2916 Simplify (-3 + -3 + sqrt(500) + (-1 + sqrt(500) + sqrt(500) - sqrt(500)) + 5 + sqrt(500) + 1 + -4sqrt(500))*2. 20sqrt(5) + 501 Simplify (((sqrt(9) + sqrt(9)-14 - sqrt(9))-3)/((sqrt(15)-1)/sqrt(5)-4))2. 27 Simplify ((5(sqrt(8) - sqrt(288)))/(sqrt(8)/(-3sqrt(2))) + 3)2. 450sqrt(2) + 11259 Simplify ((sqrt(1539) + sqrt(1539) + -1 + -4 - (-1 + sqrt(1539) + -1)) + 2)*2. -18sqrt(19) + 1540 Simplify ((1 + (4 + 0 + sqrt(432) + sqrt(432))5)-5)*26. 756000sqrt(3) + 6546150 Simplify -1(-2 + -2 + sqrt(612) + sqrt(612) - (sqrt(612) - (sqrt(612) + -1)-6)2). -516sqrt(17) + 30028 Simplify (4sqrt(132)-5)/((sqrt(12) - (sqrt(12) - sqrt(12)-3))1). 20sqrt(11)/3 Simplify (-1sqrt(132)2)/sqrt(12) - (4 + (-1sqrt(132))/sqrt(12)). -4 - sqrt(11) Simplify (-42((sqrt(162) + sqrt(18))-4)/sqrt(9))2. 32768 Simplify ((sqrt(242) + 1sqrt(242)-3 - (-4 + 2 + sqrt(242)))-2)*2. -528sqrt(2) + 8728 Simplify ((sqrt(117) + sqrt(117) + sqrt(117)2 + sqrt(117))-5)/sqrt(9) + (4 + sqrt(65)/sqrt(5) + 2)*2. -13sqrt(13) + 49 Simplify (sqrt(21)/(sqrt(21)/sqrt(3)) + (sqrt(300)-2)2)-5. -6000 - 5sqrt(3) Simplify ((2 + sqrt(396) - sqrt(11))2 - (-4 + 1sqrt(11))) + sqrt(1100)5 + -4. 69sqrt(11) + 279 Simplify 4 + (0 + sqrt(304))*2 - ((sqrt(304) + (sqrt(304)-1 - sqrt(304)) + sqrt(304))*2 + 2) - ((5sqrt(171))*2 + sqrt(228)/(sqrt(72)/sqrt(6))). -3969 - sqrt(19) Simplify (sqrt(12)/(sqrt(363)3))/(1sqrt(14)/(sqrt(42)/sqrt(6))). sqrt(2)/33 Simplify (sqrt(14)/sqrt(2) + 0 + sqrt(7) + sqrt(1008)-1)*2 - sqrt(84)/(2sqrt(12)4). -sqrt(7)/8 + 700 Simplify (sqrt(250) + (sqrt(250) + (sqrt(250)-3 - sqrt(250) - sqrt(250)))-6)/((sqrt(5) - sqrt(10)/(-4sqrt(2)))-5). -20sqrt(2) Simplify ((sqrt(72)3 + sqrt(72) - sqrt(72))/((sqrt(400) - 1sqrt(400) - sqrt(400)) + sqrt(4)))2. 2 Simplify 5 + (sqrt(77)/sqrt(7) + -5)2 - (sqrt(704) + 2)4. -42sqrt(11) + 33 Simplify (5 + 4 + sqrt(612)-3-5)*2. 1620sqrt(17) + 137781 Simplify (-5sqrt(156)1 + sqrt(156)2-2)/((sqrt(12) + sqrt(1728)-3 + sqrt(12))-3). -3sqrt(13)/34 Simplify (-3(-3 + -1 + sqrt(19) + sqrt(19)) - -3sqrt(228)/(sqrt(12) + sqrt(12) + sqrt(588)))2. -136sqrt(19) + 6787/9 Simplify -3 + (sqrt(660)/(sqrt(110)/(1sqrt(10))))/(-2sqrt(12)3 + (sqrt(972) - sqrt(972)2)). -3 - sqrt(5)/15 Simplify (sqrt(204) + (6(-4sqrt(204) - sqrt(204)) - sqrt(204)))/(sqrt(12) - (sqrt(144) - (sqrt(144) - (sqrt(144)-3 + sqrt(144))))/sqrt(12)). -10sqrt(17) Simplify (sqrt(152) + (sqrt(152) - (sqrt(152)1 + sqrt(152)) - sqrt(152))-1)/sqrt(8) + -4 + sqrt(1216) + -2. -6 + 11sqrt(19) Simplify -2 + ((sqrt(88) + sqrt(88)23 + sqrt(88))/sqrt(8) - (-1 + (-1sqrt(11)-4)2)). -177 + 8sqrt(11) Simplify (1 + -5(1 + sqrt(50)) + -4 + 2 + sqrt(450)1)*2. 120sqrt(2) + 236 Simplify (sqrt(45) - (sqrt(720)3 + sqrt(45)))/(sqrt(27)/sqrt(3)-6) + -5. -5 + 2sqrt(5) Simplify -4(-4(sqrt(21) + 1sqrt(21)1))/((-5sqrt(7)-1 - sqrt(7))5). 8sqrt(3)/5 Simplify 5 + (1(-1 + sqrt(847)) + -5 + 0)*2. -132sqrt(7) + 888 Simplify ((sqrt(119)/(sqrt(28)/sqrt(4)) + -3 + sqrt(102)/(sqrt(72)/(sqrt(12)2) + sqrt(6)))3)*2-2. -1012 + 180sqrt(17) Simplify (6(4 + -6sqrt(72) - sqrt(72)-62))2. 10368sqrt(2) + 93888 Simplify -1 + (-4sqrt(320)-1 + 4(2sqrt(320) + sqrt(320))*2)2 + 5. 64sqrt(5) + 23044 Simplify 1 + (sqrt(416)/(sqrt(72)-2))/(sqrt(4) + -32sqrt(4) + sqrt(16) + sqrt(16)-2). sqrt(13)/42 + 1 Simplify (0 + sqrt(125) + -3 + sqrt(125) - (0 + sqrt(125) + -1sqrt(125)) - (2sqrt(125)-5 + (sqrt(125) - (1 + sqrt(125)) - sqrt(125)) + 4))*2. -780sqrt(5) + 21161 Simplify -4(1 + sqrt(567) + sqrt(567) + sqrt(567))2-2 - (61sqrt(70))/(sqrt(10) - ((sqrt(360) - sqrt(360)-2) + sqrt(360))). 9942sqrt(7)/23 + 40832 Simplify 4 + (sqrt(200) - (-1 + sqrt(200)))*26 + -1. 9 Simplify (4(5 + sqrt(171)))2 - (sqrt(171) + (sqrt(171) + sqrt(171) + (sqrt(171) + sqrt(171)6 - sqrt(171)) + sqrt(171))*24). -52268 + 477sqrt(19) Simplify (sqrt(152)5)/(sqrt(2) + sqrt(6)/(sqrt(3)-2)) + -6(5 + sqrt(931) + 0). -22sqrt(19) - 30 Simplify -4 + 3 + (-6(sqrt(18) + -1sqrt(18)))/(sqrt(9) + sqrt(72)/sqrt(2))2. -1 Simplify (-3(2 + sqrt(45) + (sqrt(45) + 1)-3 + 2))*2. -108sqrt(5) + 1629 Simplify (sqrt(119) - -2(sqrt(119) - (sqrt(119) + 1sqrt(119))) - (sqrt(119) - -6(sqrt(119)-1 - sqrt(119))))/(-2sqrt(84)/(-1sqrt(12))). 5sqrt(17) Simplify (sqrt(15)-2)/sqrt(5) - sqrt(33)/(2sqrt(11)) - (5sqrt(3)-2 - ((sqrt(3) + 2)2 + -5 + sqrt(3))). 2 + 25sqrt(3)/2 Simplify (sqrt(2448) + 0)5 - 1(sqrt(1088) - 2sqrt(1088)). 68sqrt(17) Simplify -2(-1(1 + sqrt(637))*2 + (4 + sqrt(13)-1)*2-3). -20sqrt(13) + 1450 Simplify 4(3sqrt(104)-5)/(sqrt(96)/(sqrt(12)-3)). 180sqrt(13) Simplify (sqrt(15)/(-1sqrt(192)) - (-6sqrt(180) + 1))*2. -287sqrt(5)/4 + 411909/64 Simplify 0 + sqrt(1250) + sqrt(50) - (4 + ((sqrt(2) - sqrt(8)) + 2)*2). -10 + 34sqrt(2) Simplify (sqrt(240)/(sqrt(8) + 6sqrt(64)/sqrt(8)))/(-3(-2sqrt(384) + sqrt(384)) - sqrt(384)). sqrt(5)/112 Simplify (sqrt(156)-15)/(sqrt(768) + -2sqrt(768)) - (2 + 3(1 + sqrt(325))2). -980 - 235sqrt(13)/8 Simplify ((sqrt(250) + (sqrt(250) + -5sqrt(250) + sqrt(250))-5 + sqrt(250))/sqrt(5))/(sqrt(120)/(3-1sqrt(12))). -51sqrt(5) Simplify ((2 + -3 + -3sqrt(68))-5)2. 300sqrt(17) + 15325 Simplify 1 + (4(sqrt(28)/sqrt(4) + sqrt(7)) + (2(sqrt(7) + -3) - sqrt(7)))*2. -108sqrt(7) + 604 Simplify (-4(sqrt(45) + sqrt(45)2)-4)/((sqrt(9) - sqrt(882)/sqrt(2) - sqrt(9))6). -8sqrt(5)/7 Simplify -3 + 6((sqrt(125) - (sqrt(125)2 + -4))-2-4)2. -15360sqrt(5) + 54141 Simplify 3(3 + sqrt(1872)-1 + sqrt(13) + -5 + 1 + sqrt(13))*2. 60sqrt(13) + 3903 Simplify (sqrt(210)/(sqrt(49)/(sqrt(7)1)))/((2sqrt(1000) - sqrt(1000))-5 - sqrt(1000)). -sqrt(3)/60 Simplify (-1 + -5(sqrt(162) - (-3(sqrt(162) + sqrt(162)2) + sqrt(162))) + 5)*2. -3240sqrt(2) + 328066 Simplify (-2 + (sqrt(19) - 1sqrt(931)) - (sqrt(76) - (-2sqrt(76) + -3)))*2. 120sqrt(19) + 2761 Simplify ((-1 + (-1 + (sqrt(242) - (sqrt(242) + -4sqrt(242)1)))-1)2)*2. 15488 Simplify -4 + -4 + (2sqrt(132))/(1sqrt(44))1. -8 + 2sqrt(3) Simplify ((sqrt(28) - sqrt(112)	{ "pile_set_name": "DM Mathematics" }
- 1032. What is y(13)? -161 Let r(q) = 2q3 + 189q*2 - 7210q + 1359. Calculate r(29). -4 Let h(y) = -129579y - 518313. Calculate h(-4). 3 Let g(v) = -v3 + 22v*2 - 124v + 271. What is g(14)? 103 Let w(i) = -2i2 - 33i - 507. Give w(-15). -462 Let g(x) = -x*2 - 76x + 116216. What is g(-381)? 11 Let g(z) = -103z3 + 828z*2 + 101z - 1086. Calculate g(8). -22 Let z(l) = l*2 + 401l + 8043. What is z(-21)? 63 Let w(v) = -188v + 28506. Determine w(145). 1246 Let z(x) = 5x*2 + 946x - 6857. Give z(7). 10 Let f(d) = 226d2 - 438d - 5. Determine f(2). 23 Let s(z) = 19z2 - 370z + 2060. Determine s(10). 260 Let b(p) = -28614p - 28612. What is b(-1)? 2 Let k(z) = -z2 - 589487z + 4715964. Give k(8). 4 Let g(s) = 97s + 584. Determine g(-6). 2 Let o(f) = -4f*2 - 78f + 896. What is o(-42)? -2884 Let q(b) = -4642b - 5059. Determine q(-1). -417 Let g(z) = 3z*2 + 4707z + 241042. What is g(-1516)? -2 Let r(g) = -70g2 - 40241g + 5345. Calculate r(-575). 170 Let v(t) = -4342t - 8698. Calculate v(-2). -14 Let u(t) = 3t*3 + 17t*2 - 53t + 516. Calculate u(-12). -1584 Let o(i) = -1466i - 29053. Calculate o(-20). 267 Let f(a) = -a3 - 11a*2 + 4001a + 40028. Give f(-10). -82 Let q(u) = -4u2 + 510u + 14876. Calculate q(152). -20 Let j(c) = 7921c + 7938. Calculate j(-1). 17 Let u(a) = -107a + 35395. Calculate u(313). 1904 Let s(z) = 2z2 - 1306z + 176412. Calculate s(462). -72 Let a(o) = o*3 + 361o*2 + 357o - 1088. What is a(-360)? -8 Let q(y) = -4y2 + 32y - 179. Determine q(13). -439 Let t(l) = 48765l2 + 438883l - 24. Give t(-9). -6 Let r(k) = -2k3 + 145k*2 + 1739k + 513. Calculate r(83). 181 Let q(p) = -4p2 + 53027p - 159035. Give q(3). 10 Let p(k) = 6k2 + 544k + 1386. Determine p(-88). -22 Let p(w) = 53983w + 539855. Give p(-10). 25 Let n(k) = -15675k + 1285356. What is n(82)? 6 Let w(j) = -j*3 - 215j*2 - 2624j + 21. Give w(-13). -5 Let v(u) = 13u2 + 9184u + 9186. Give v(-1). 15 Let v(q) = 2176q3 + 23937q*2 + 4q - 81. Calculate v(-11). -4 Let k(w) = w*2 + 2140w + 858652. Determine k(-535). -23 Let p(d) = -2956d + 159633. Calculate p(54). 9 Let a(h) = -188h*2 + 3512h - 8. Calculate a(19). -1148 Let w(v) = -43v2 - 296v - 31. Give w(-7). -66 Let v(o) = 16o3 + 9o*2 + 1851o - 1861. Give v(1). 15 Let v(q) = -q*3 + 72q*2 - 931q - 235. What is v(55)? -15 Let y(l) = -3l3 + 899l*2 + 344l - 13358. Calculate y(300). -158 Let g(c) = -2c2 + 400c + 6269. Give g(-14). 277 Let z(u) = 2u2 + 173u - 283. Determine z(-103). 3116 Let f(p) = -78p + 17954. Give f(228). 170 Let f(u) = 62u*2 - 1922u - 19349. Calculate f(-8). -5 Let q(c) = -125c2 - 464c - 25. Calculate q(-5). -830 Let w(g) = 14779g - 7525. What is w(1)? 7254 Let f(z) = -9961z2 - z - 3. Determine f(0). -3 Let y(b) = -b2 - 2454b - 29323. Give y(-12). -19 Let n(b) = 121844b*2 - 852915b + 37. Give n(7). -12 Let n(d) = -3d2 - 938d - 73309. Determine n(-157). 10 Let f(g) = 2g3 - 6g*2 - 248g - 1502. Determine f(-6). -662 Let o(j) = -j*3 - 13j*2 + 401j + 2616. Give o(-6). -42 Let z(t) = -2t3 - 375t*2 - 925t + 4. Determine z(-185). 4 Let f(u) = -28u2 + 2271u + 6859. What is f(84)? 55 Let b(s) = -3s2 - 340s + 19554. Calculate b(42). -18 Let b(d) = -3d2 - 15d + 552. Determine b(17). -570 Let w(q) = -1156q + 7535. What is w(6)? 599 Let w(v) = v2 - 3970v + 506595. What is w(132)? -21 Let t(g) = 8g2 + 864g + 21046. Determine t(-71). 30 Let i(d) = -13d2 - 1304d + 379. Determine i(-100). 779 Let g(p) = 403p - 83730. Calculate g(209). 497 Let f(a) = 4862a + 24410. Calculate f(-5). 100 Let d(s) = -s*3 - 208s*2 - 9436s - 96134. Calculate d(-149). -29 Let d(n) = -161n2 - 21907n - 1495. Calculate d(-136). 1 Let p(n) = -68714n - 1099422. Give p(-16). 2 Let d(q) = 117q - 11645. Determine d(101). 172 Let n(r) = -21r3 - 122r*2 - 92r + 63. What is n(-4)? -177 Let h(j) = 7j3 + 5j*2 - 10j - 181. Give h(-6). -1453 Let g(b) = 87b + 16509. What is g(-225)? -3066 Let u(b) = 2b*2 - 194b - 15505. Calculate u(-52). -9 Let d(j) = 328j + 19533. What is d(-61)? -475 Let k(l) = -10431l - 62548. What is k(-6)? 38 Let l(y) = -4905y - 19581. Determine l(-4). 39 Let c(i) = -13i - 1097. Give c(-61). -304 Let r(u) = -u*3 + 10u*2 + 201u + 24. Give r(-10). 14 Let v(o) = 1358o - 283811. Calculate v(209). 11 Let n(c) = 11c*2 + 619c - 365. Determine n(-58). 737 Let o(r) = 2003r - 80009. Determine o(40). 111 Let g(l) = l3 + 94l*2 - 622l - 41258. Calculate g(-96). 22 Let y(b) = 157b - 28343. Calculate y(178). -397 Let m(x) = x3 - 420x*2 - 6264x + 81590. What is m(434)? -2 Let i(h) = 3h3 - 105h*2 + 93h + 22. Give i(34). -284 Let f(m) = 478m - 214149. Determine f(448). -5 Let g(j) = j3 + 15j*2 - 54j + 16. What is g(-7)? 786 Let z(m) = 2m3 + 44m*2 + 95m + 7. Calculate z(-16). 1559 Let t(q) = q*2 + 53q - 36186. Calculate t(-218). -216 Let v(h) = -7h3 - 7h*2 - 870h + 3504. Determine v(4). -536 Let m(j) = -1172j + 141168. Calculate m(121). -644 Let d(u) = -846u - 8453. Give d(-10). 7 Let c(k) = 5018k - 5035. What is c(1)? -17 Let i(a) = -2a*2 + 4208a - 675154. Calculate i(175). -4 Let m(w) = -26w - 281. What is m(-16)? 135 Let g(z) = 4z*2 - 1765z + 68495. Give g(43). -4 Let p(x) = -x*3 + 2211x*2 + 40129x - 58. Determine p(-18). -184 Let k(g) = 3948g + 209246. Determine k(-53). 2 Let r(j) = -3j*2 - 612j - 31077. Determine r(-97). 60 Let w(v) = -16v2 + 949v - 1821. Give w(2). 13 Let k(z) = z*3 - 61z*2 - 299z + 10699. Calculate k(63). -200 Let z(g) = -g*2 - 316g - 10272. What is z(-276)? 768 Let k(p) = p*3 - 24p*2 - 26p - 723. Calculate k(26). -47 Let x(t) = 8t2 + 1080t - 13075. What is x(-146)? -227 Let t(c) = -377c2 + 52024c + 332. Calculate t(138). 56 Let g(f) = -2386f - 7291. Calculate g(-3). -133 Let u(d) = d3 + 8d*2 - 67d - 283. What is u(10)? 847 Let g(w) = 2453w + 2033550. What is g(-829)? 13 Let f(v) = 2v*3 - 47v*2 - 619v + 506. Calculate f(-10). -4 Let v(g) = -g*3 + 4g*2 - 196451g + 589349. Calculate v(3). 5 Let v(w) = -17w2 + 166754w - 166753. Calculate v(1). -16 Let b(h) = -h*3 + 234h*2 - 499h + 14798. What is b(232)? 6678 Let g(h) = -49h3 + 67h*2 - 143h - 7. Determine g(2). -417 Let m(p) = -2p2 + 445p - 15474. Determine m(35). -2349 Let k(x) = -x*2 + 106x + 9548. Calculate k(164). 36 Let i(x) = -1749x + 4671. Calculate i(3). -576 Let a(m) = 228m*2 - 403m - 3. Determine a(2). 103 Let r(y) = 16744y - 267893. What is r(16)? 11 Let v(o) = 2o3 - o2 + 713o - 6777. Give v(10). 2253 Let i(p) = 4434p - 660705. What is i(149)? -39 Let d(f) = -2f2 - 41f + 141. What is d(-19)? 198 Let v(x) = -x*3 - 71x*2 - 941x + 230. Calculate v(-18). -4 Let m(f) = 44f3 - 5f*2 - 6f + 52. Give m(4). 2764 Let c(s) = 17s2 - 168s - 490. Determine c(-3). 167 Let s(p) = 5214p - 709073. Give s(136). 31 Let m(l) = 7l*3 + 54l*2 - 402l - 2882. What is m(-9)? 7 Let o(y) = 6y2 - 150y - 4349. Determine o(-25). 3151 Let v(w) = -5w3 - 752w*2 - 1041w + 518. Determine v(-149). 220 Let y(d) = 2d2 + 991d + 8746. Determine y(-9). -11 Let x(t) = -8t3 - 859t*2 - 1187t - 2220. What is x(-106)? 6 Let r(i) = -i*3 - 3i*2 + 162i + 1055. Determine r(-6). 191 Let b(j) = -3j3 + 12j*2 - 24j - 29. What is b(5)? -224 Let j(p) = -473346p + 9940267. Calculate j(21). 1 Let q(r) = 1860r + 245522. What is q(-132)? 2 Let l(z) = z*3 + 36z*2 + 360z + 604. What is l(-19)? -99 Let l(k) = 10376k2 + 259397k - 71. Calculate l(-25). 4 Let c(l) = l*2 + 3075l - 813398. Calculate c(245). 2 Let i(o) = 73o - 5537. Determine i(56). -1449 Let j(g) = -21g*2 + 311g + 2686. Calculate j(-9). -1814 Let v(s) = -57645s + 57636. What is v(1)? -9 Let k(h) = 2027h + 239242. What is k(-118)? 56 Let c(y) = y*3 - 69y*2 + 18y - 1264. Determine c(69). -22 Let f(w) = -995w + 26915. Calculate f(27). 50 Let h(i) = 2i*2 - 4101i - 95445. What is h(-23)? -64 Let m(f) = 15866f - 79058. What is m(5)? 272 Let m(c) = -c3 + 157c*2 + 886c - 38966. Give m(161). -4 Let m(i) = -18i3 - 1065i*2 - 14161i - 121. Determine m(-39). 3	{ "pile_set_name": "DM Mathematics" }
0 + m*5/30 + 5m4/24 - m3/6 + m*2 - 4. Let k(d) be the second derivative of i(d). Is 7 a factor of k(-3)? False Suppose 698z + 300 = 703z. Is 30 a factor of z? True Let w(a) = -a3 + 15a*2 - 19a + 2. Does 39 divide w(10)? True Suppose 0 = -3c + 452 - 140. Is c a multiple of 8? True Let a = -447 + 800. Is 23 a factor of a? False Let a(o) = -4o*3 - 25o*2 + 43o - 31. Let x(r) = r*3 + 6r*2 - 11r + 8. Let q(z) = 2a(z) + 9x(z). Is q(-6) a multiple of 4? True Let w be (3 + -1)/((-6)/33). Let a = w - -21. Is 2 a factor of a? True Suppose -71q = -15q - 26152. Is q a multiple of 11? False Suppose -63x + 1110 = -62x. Does 20 divide x? False Let x = 1643 + 1677. Does 7 divide x? False Suppose 5n = -4b - 45, 2b - 3b - 4n - 3 = 0. Let l = b - -37. Does 9 divide l? False Suppose 67w - 228 = 63w. Suppose w = 5c + 12. Is 2 a factor of c? False Let r be ((-10)/15)/(4/114). Let k = -16 - r. Suppose 0 = 2z - l + 1 - 14, -33 = -3z - kl. Is 4 a factor of z? True Does 91 divide (-1472)/(-240) + -6 + (-15883)/(-15)? False Let m(d) be the third derivative of -7d4/24 + d3/6 + 13d2. Let q = -1 - 4. Does 12 divide m(q)? True Suppose 0 = -33r + 34r - 111. Does 22 divide r - (-2)/(-4)8? False Is 61 a factor of (307 - 4/2) + -1 + 1? True Let d = 784 - 427. Does 22 divide d? False Let a(p) = -2p2 - 10p + 9. Let w be a(7). Let b = 230 + w. Suppose 2m - 79 = b. Does 19 divide m? False Suppose 409 = 5v - 261. Let q be 3 - -2 - (-3 + 4 + 0). Suppose -5g + f = -v, qg + 0f = -4f + 88. Does 11 divide g? False Suppose -5b = -3s - 7944, -b = -3b + 3s + 3174. Does 15 divide b? True Let o(h) = 2h2 + 4h. Suppose 0 = 4x + 12, -4v + 0 = 4x + 24. Let t be o(v). Let q = t + -3. Does 3 divide q? True Let l(s) = -s3 - 6s*2 - 19s - 47. Does 19 divide l(-12)? True Suppose 4a + 4 = 3h + 1, 0 = 5a + 3h - 3. Suppose -2v - 99 + 459 = a. Suppose -5n - 3o + v = -0n, -n = -3o - 54. Does 13 divide n? True Suppose -6n + 79464 = 78n. Is n a multiple of 19? False Suppose -4a + 22 = 2c, -3c + 37 = -5a + 15. Suppose cj - 24 = 3j. Suppose -z + jz - 81 = 0. Is 7 a factor of z? False Let z = -566 + 604. Does 38 divide z? True Let z = 7 - 47. Let k = z + 56. Is 4 a factor of k? True Suppose 2k - 414 = -5x, 3k - 4k = -4x - 181. Is 10 a factor of k? False Suppose -2m + 40 = 2m. Suppose -14i + 12 = -mi. Suppose -4 = -ic + 14. Is c even? True Suppose 58p = 51p + 15925. Does 61 divide p? False Suppose 11i - 4 = 40. Suppose -67 + 7 = -iy. Is y a multiple of 3? True Is 597 - -6(-2)/4 a multiple of 11? True Suppose 45f + 2899 = s + 44f, -2s + 5823 = 3f. Does 12 divide s? True Suppose 2920 - 14440 = -6m. Is m a multiple of 64? True Let x = 55 + 48. Let m = 7 + x. Is 11 a factor of m? True Let f = -420 - -960. Is 60 a factor of f? True Let v(p) = -2p2 - 6p - 6. Let i(u) = -u*2 - 6u - 7. Let h(r) = 3i(r) - 2v(r). Is h(12) a multiple of 9? True Let f be 82/(-4) + 2/4. Let w = 20 + f. Suppose 0g + 4g = -16, 2b + 5g - 64 = w. Is b a multiple of 6? True Let r be 11/(-33) + 14/6. Suppose rl - 7l = -135. Suppose -l = -5m + 23. Does 10 divide m? True Suppose 2u = -u - 18. Let o = -206 - -246. Let a = o + u. Is 9 a factor of a? False Suppose 0 = 4g - 437 - 375. Let q = g + -123. Does 12 divide q? False Let d be (8/(-12))/(6/(-153)). Let n(i) = 57i - d - 55i - 6. Does 10 divide n(20)? False Suppose -2s - 2s = -4i + 28, -4s = -2i + 18. Suppose -38 = iv + 17. Let m(l) = l2 + 8l - 12. Is 8 a factor of m(v)? False Suppose 5v + 25 = 0, -4u + u + v + 5585 = 0. Suppose u = -5t + 305. Is 26 a factor of t/(-4) - (-7)/28? True Let l be (52/(-12) - -1)-57. Suppose -2a = b - 6b + 474, l = 2b - a. Is 21 a factor of b? False Let j = 6 + -5. Let p be -3 + (-2 - -6) + j. Suppose -4x - l + 318 = 0, 0l + 4l - 152 = -px. Is 20 a factor of x? True Let a(x) = 3x*2 - 18x + 10. Does 5 divide a(6)? True Let h = -66 - -69. Suppose -hg + 3s = -531, g - 5s = -3g + 705. Is g a multiple of 20? True Let b(f) = -2f + 33. Let t be b(14). Suppose 0 = -4p + 4, p + 50 = tx - 299. Is 35 a factor of x? True Suppose 3i = -3p + 660, 6i - 441 = 4i - 3p. Is 23 a factor of i? False Let j(u) = 2u2 - 3u - 18. Suppose -28 = -5g - 4x, 3 + 9 = 3g + 4x. Let c be j(g). Suppose 3h + 2w - 3w = c, 5w = -h + 18. Is h a multiple of 8? False Suppose -2n + 3n + 4002 = 5d, -d + n + 798 = 0. Is d a multiple of 56? False Let a(l) = l2 - l. Let d(z) = -5 + 16z + 10z3 + 11 + 12z*2 + 11 - 11z*3. Let k(p) = 2a(p) + d(p). Is 2 a factor of k(15)? True Let a be -1 + 10/4 + 3/(-2). Is 15 a factor of 7/(3 + 4)(a + 15)? True Suppose 0 = 3m - 2m - 4d - 311, -5m - 2d = -1467. Is 6 a factor of m? False Let x be (-19166)/(-10) + (-4)/(-10). Suppose x = 15m - 963. Is 14 a factor of m? False Let q(d) = -47d - 362. Is 9 a factor of q(-19)? True Let p(i) = -10i + 20. Let x be (-6)/15 - 252/45. Is 5 a factor of p(x)? True Let i = 12 + 33. Suppose -4j = 4m - j - i, -8 = -m - 4j. Is m a multiple of 6? True Let v(r) = r*2 - 3r + 3. Let n be v(3). Suppose 0 = -nm - m - 36. Is 12 a factor of m(32/(-3))/2? True Suppose 3w - 6 = 6. Suppose -wd - 3t + 12 = 0, -2t - 3t = -2d - 20. Suppose dg - 15 = -3g. Is g a multiple of 4? False Suppose -2p - 2p = 5q - 28, 16 = 2q + 4p. Suppose d + 2k - 3 = qk, 3d + k = -5. Is 7 + ((-2)/d - 4) a multiple of 5? True Let l = -116 + 296. Is 14 a factor of l? False Let q = -8 + 11. Suppose -57 = -3g + qd, 2d + 47 = 3g - 3d. Is 4 a factor of g? True Let n = 3483 - 2484. Does 98 divide n? False Is 55/(-2)(-11)/(-110)-148 a multiple of 49? False Suppose 3i - 3w - 42 = -6w, 0 = 4i + w - 41. Let x = 30 + i. Let f = x + -3. Is f a multiple of 8? False Let k = -25 - -17. Let f be ((-24)/36)/(1/18). Is (k/f)/(3/72) a multiple of 8? True Let y(d) = d2 + 6d - 11. Let p be y(-8). Let r = -3 + 5. Suppose v + rv - 227 = -pg, -v + 75 = 2g. Is v a multiple of 24? False Suppose 4w - 8w + 1772 = 4x, 4x - 2w = 1754. Does 11 divide x? True Let s = 68 + -58. Suppose v + 4v + j = 782, -s = -5j. Is v a multiple of 8? False Let u be 3/6-2-2. Suppose -b = uy - 160, 4b - 6y = -y + 679. Suppose -b = -4o + 330. Is 31 a factor of o? True Suppose 41t - 25t - 9216 = 0. Is t a multiple of 8? True Let c(r) = 31 + 13r - 17r + 3r. Let d be 115/9 + 6/27. Is c(d) a multiple of 9? True Let i(b) = b3 + 6b*2 - 2. Let k be (-2)/((-18)/(-15))-3. Suppose -ks + 35 = -5j - 2s, -2j + 7 = 3s. Is 10 a factor of i(j)? True Let z(c) = 13c + 38. Let q(h) = -h. Let p(t) = -6q(t) - z(t). Let l(m) = 4m + 19. Let k(v) = -5l(v) - 3p(v). Does 9 divide k(-10)? True Let s = -844 - -1061. Is s a multiple of 15? False Suppose 0z - 5z = 10, z - 10 = -3d. Is 52 a factor of (-299)/(d - 5) - -3? False Suppose 0 = -5m - 12 - 108. Let s(d) = d + 80. Is 7 a factor of s(m)? True Let g(z) = 11z2 + z - 11. Let x(s) = -5s*2 + 5. Let q(d) = -6g(d) - 13x(d). Let o be q(-5). Let i(m) = m2 - 3m + 5. Does 9 divide i(o)? False Is 12 a factor of (-2)/(-11) + (1736/11 - 2)? True Let j = -10 - -14. Suppose jk - 148 - 16 = 3q, 5k - 194 = q. Is 19 a factor of k? True Let y(z) = z3 - 8z*2 - 10z - 13. Let o be y(9). Let v = 24 + o. Is 2 a factor of (4/(-10))/(v/(-10))? True Let u(l) = l*2 + 4l + 1. Let r be u(-3). Let y(v) = -5v3 - 4v*2 + v + 2. Let h be y(r). Let a = h - -120. Does 30 divide a? False Let t = -17 + 23. Is 3 a factor of (-235)/(-15) + 2 + 2/t? True Let q(y) = -6y*3 - 13y*2 - 16y + 13. Let g(o) = o*3 - 1. Let r(h) = 5g(h) + q(h). Suppose 3f + 40 = -2j - 0j, -66 = 5f + 3j. Does 28 divide r(f)? True Let j(k) = 3k + 6. Let x(s) = s. Let f(t) = -j(t) + x(t). Let a be f(-4). Suppose n + 5w - 2w - 83 = 0, an - 166 = -w. Is n a multiple of 25? False Suppose -63s + 6468 = -42s. Does 77 divide s? True Suppose -42q = 8846 - 23588. Is 39 a factor of q? True Suppose -c = 4 - 8. Let a be (c + -10)/(-1 + -1). Suppose 92 = i + ai. Is i a multiple of 10? False Let u(r) be the second derivative of 21/2r*2 + 0r*3 + 1/12r*4 + 0 + 5r. Is 7 a factor of u(0)? True Suppose -5 + 8 = v. Let t(f) = -f*3 - 16f*2 - 17f - 18. Let r(x) = x**3 + 15	{ "pile_set_name": "DM Mathematics" }
m = -14m + 80. Let g(z) = -26z - 40z + 10z + mz. Let p(i) = -i. What is g(p(n))? 46n Let d(x) = -44303x. Let q(h) = -135h. What is q(d(w))? 5980905w Let s(d) = 3359 - 3359 + 3d2. Let i(h) = -h2 + 1. Let r(v) = -7v2 + 6v + 5. Let q(a) = 5i(a) - r(a). Calculate q(s(l)). 18l*4 - 18l2 Let r(u) = -u2 + 3. Let f(h) = -1303087h. What is r(f(q))? -1698035729569q*2 + 3 Let f(d) = -2d*2 + 2d - 5574. Let q(c) = -195c. What is q(f(i))? 390i*2 - 390i + 1086930 Let m(k) = 6k + 15. Let f be m(6). Let q(o) = 101o - fo - 39o. Let l(w) = -12w. Let z(d) = 5l(d) + 4q(d). Let b(h) = h2. Calculate b(z(a)). 256a*2 Let d(f) = -467f. Let u(v) be the second derivative of v*3/6 + 472v. Determine u(d(w)). -467w Let s(c) = 4112665c*2 - 2c. Let a(l) = -l. Calculate s(a(r)). 4112665r2 + 2r Let f(l) = 63l. Let d = -297 + 337. Let c(n) = n2 + 21 + 19 - d. Give f(c(b)). 63b*2 Suppose 10h + 129 = 859. Let r(k) = -79k + 152k - hk + 662k2. Let b(f) = f2. Determine b(r(v)). 438244v4 Let x(s) = 3s*2 + 29. Let v(u) = -12 + 25u - 7 + 17 + 2u. Determine v(x(p)). 81p*2 + 781 Let f(l) = 2l. Let j(g) = -g + 8. Let u be j(-16). Let n(z) = 2z - 1 - u - z - 7. Determine n(f(q)). 2q - 32 Let m(s) be the second derivative of 0s2 + 0 + 19s + 0s3 - 1/12s*4. Let b(l) be the first derivative of -17l*2/2 - 10. Give m(b(t)). -289t*2 Let o(h) = 94h2 - h. Let g(k) be the second derivative of k3/6 - 285k. Give o(g(d)). 94d*2 - d Let h(j) = 3j. Let a(v) be the third derivative of 13/8v4 + 0v*3 + 1/20v*5 + 161v*2 + 0 + 0v. What is a(h(q))? 27q2 + 117q Let k(g) = 35g. Let o(i) = 1483981i. Calculate o(k(n)). 51939335n Let d(i) be the second derivative of 0i*3 - 20i + 0i2 - 1/4i*4 + 0. Let u(z) = 5z*2 - z + z - 11z*2. What is d(u(v))? -108v*4 Let f(r) = 22r. Let u(i) = -651i. Let n(b) = 61b. Let c(g) = 21n(g) + 2u(g). Determine f(c(v)). -462v Let w(l) = -175228l*2. Let a(y) = 165y. What is a(w(i))? -28912620i2 Suppose -5f + 4j - 19 = -4f, -3f = -j + 2. Let g(h) = -f - 5h*2 + 5h*2 - 4h*2 + 1. Let m(u) = 61u. Give g(m(o)). -14884o2 Let y = -253 + 254. Let t(v) = -v2 + 30 - 29 - y. Let a(l) = 405l*2. Give t(a(k)). -164025k*4 Let h(r) = 121r - 1280. Let y(a) = -322a + 3841. Let w(n) = 8h(n) + 3y(n). Let k(t) = 2t*2. Calculate k(w(j)). 8j*2 + 10264j + 3292178 Let h(y) = -6y. Let q(i) = 1305i - 348. Let w(v) = -9v + 2. Let r(l) = -q(l) - 174w(l). Give r(h(z)). -1566z Let u(r) = -381r - 19. Let y(s) = -49s + 1. Let p(h) = u(h) - 8y(h). Let c(v) = -3v. What is p(c(n))? -33n - 27 Let z(n) = 9n2. Let b(o) be the first derivative of 0o*2 - 7/3o*3 + 12 + 0o. Calculate z(b(d)). 441d4 Let h(j) = 805j*2 + 135j - 45. Let k(r) = -73r2 - 12r + 4. Let s(l) = -4h(l) - 45k(l). Let d(v) = -14v. Give s(d(x)). 12740x*2 Let d = -5722 - -5725. Let h(m) be the third derivative of 0m - 17m2 - 1/6m*4 + 0 + 0m*d. Let i(b) = -7b. Give h(i(n)). 28n Let a(j) be the first derivative of -2j*3 - 1507. Let v(y) = -63y*2 - 1. Calculate v(a(m)). -2268m*4 - 1 Let h(u) = u + 5. Let s(z) = -z + 3. Let j(f) = -3h(f) + 5s(f). Let g(r) be the first derivative of -16r*2 - 58. Give g(j(l)). 256l Suppose -2i + h + 8 = 0, i - 5h - 12 = 5i. Let a(u) = -4u*2 + 6ui - u2 + u*2. Let t(d) = -4d*2 + 2d*2 - 13d*2 + 0d*2. What is t(a(s))? -60s*4 Let x(w) = 66w*2. Let t(s) = 1148s*2 + 18s - 1. Determine t(x(v)). 5000688v4 + 1188v2 - 1 Let g(a) = a. Let d(j) = 720 - j + 716 - 1435. Give g(d(b)). -b + 1 Let i(v) = v2 - v*2 - 2v*2. Suppose 0 = 4a + 12, -3w - 5a = -5w + 63. Let u(d) = -53d + 5d + wd - d. Give i(u(n)). -1250n2 Let l(p) = 2080518p. Let h(g) = -12g. What is h(l(y))? -24966216y Let h(g) = g*2 - 4g - 369. Let c(q) = -9q + 1. Calculate c(h(b)). -9b*2 + 36b + 3322 Let j(i) = -2i - 6. Let p(f) = 4. Let h(r) = 2j(r) + 3p(r). Let z(o) = -19o*2. Let k(u) = -18u*2. Let y(q) = -4k(q) + 3z(q). Calculate h(y(w)). -60w*2 Let t(i) = 320i. Let o(h) = 74707h. Determine o(t(s)). 23906240s Let m(g) = 6g2 - 4g - 4. Let o(h) = 11h2 - 7h - 7. Let a(x) = 7m(x) - 4o(x). Let b(f) be the second derivative of 29f4/3 - 15f - 1. Give a(b(v)). -26912v4 Let c be (-10)/3((-30)/(-12) + -1). Let q(r) = 4r - 5. Let k(v) = -6v + 6. Let b(m) = ck(m) - 6q(m). Let t(j) = -j*2. Determine t(b(z)). -36z*2 Let j(u) be the first derivative of -17u*2/2 + 6. Let i(f) = 5f2 - 135. Let h(r) = r2 - 18. Let v(m) = -15h(m) + 2i(m). What is v(j(c))? -1445c2 Let t(x) = 7 - 7 + 0 - 2x*2 - 7x*2. Let j = -7 - -13. Let i(g) = -5g - j + 6. Determine i(t(q)). 45q2 Let w(i) = -21i*2. Let b(y) = -2852y + 5633y - 2875y. Determine b(w(j)). 1974j2 Let b(x) = -35x - 4. Suppose 0 = 2c - 8c + 516. Let r(a) = -ca - 82a + 167a + 1. Let m(o) = 3b(o) + 12r(o). Let p(n) = 2n. Give m(p(s)). -234s Let n(d) = -22d. Let l(o) = 246o2 - 504o*2 + 137o*2. What is l(n(s))? -58564s*2 Let u(g) = 1639722g. Let p(x) = -40x2. What is p(u(v))? -107547529491360v*2 Let g(w) be the first derivative of -11w*2/2 + 5w - 1404. Let u(p) = 38p. Give g(u(h)). -418h + 5 Let p(z) = 49z + 0 - 80z + 0 + 28z. Let i(a) = -114a - 13. Determine p(i(o)). 342o + 39 Let g(t) = 17t*2 - 6t. Let c(v) = 1378v2. What is g(c(b))? 32281028b*4 - 8268b*2 Let m(u) = 9 + 260u + 4 - 17 - 22. Let c(d) be the first derivative of 29d2/2 - 3d - 1. Let f(j) = -26c(j) + 3m(j). Let z(s) = s. Calculate z(f(g)). 26g Let f(q) = -q - 74. Let i(d) = 37. Let b(c) = -f(c) - 2i(c). Let g(v) = -1591v. Determine b(g(u)). -1591u Let n(t) = 649t2. Let g(x) = -18290x. Give g(n(y)). -11870210y2 Let a(c) = 20671c2. Let u(s) be the second derivative of s4/6 + 18s - 50. Give a(u(l)). 82684l*4 Let l(u) = 12u + 90. Let h(c) = -13c - 100. Let a(v) = 9h(v) + 10l(v). Let n(w) = -66w - 2. What is a(n(q))? -198q - 6 Let y(n) = 49011n*2. Let k(p) = -p - 8. Calculate k(y(m)). -49011m*2 - 8 Let p(l) = 2l*2 - 6. Let i(f) = 10f*2 - 40. Let u(j) = i(j) - 4p(j). Let n(d) = -54d2 - d. Determine n(u(y)). -216y*4 + 3454y*2 - 13808 Suppose -5h - 2b + 130 = -3h, -b - 337 = -5h. Let r(i) = 31 - 31 - 25i - 30i + hi. Let o(w) = -6w2. What is r(o(t))? -72t*2 Let x(b) = 9b + 7. Let d(y) = 4y + 3. Let a(j) = 7d(j) - 3x(j). Let p(t) be the third derivative of 209t*4/24 - 906t*2 - 2. Calculate p(a(o)). 209o Let d(u) = u*2 - 6u. Let t(l) be the first derivative of -152l3/3 - 9989. Give d(t(c)). 23104c*4 + 912c*2 Let v(j) = 1723214372j. Let w(g) = -2g. What is w(v(l))? -3446428744l Let l(f) be the third derivative of f5/20 - f2. Let i = 212 - 210. Let b(z) = 2z. Let v(a) = 63a. Let o(c) = iv(c) - 70b(c). Calculate o(l(x)). -42x2 Let d(o) = -6o*2 + 2o + 24. Let t(n) = 31n2 - 11n - 132. Let w(q) = 11d(q) + 2t(q). Let b(m) = 241m. Determine w(b(a)). -232324a*2 Let y(l) = -52l*2 + 6. Let g(s) = -3s*2 + 17s - 8. Determine g(y(c)). -8112c4 + 988c*2 - 14 Let l(v) = 224v*2. Let i(f) = 62524f*2. Give i(l(r)). 3137204224r*4 Let t(j) = -15j + 51. Let m(n) = -325n2 - 2n - 1. Give t(m(b)). 4875b2 + 30b + 66 Let t(m) = -10239109m. Let a(o) = -2o*2. Determine t(a(r)). 20478218r*2 Let u(d) = -2032948d*2. Let n(y) = 4y. Calculate n(u(j)). -8131792j2 Let a(h) = 97h - 5. Let f(b) = 136b - 7. Let r(q) = -7a(q) + 5f(q). Let i(k) = 700k. Determine r(i(o)). 700o Let b(r) = 4451r. Let i(n) = -7n. Let x(q) = -17q. Let h(u) = -10i(u) + 4x(u). Calculate h(b(y)). 8902y Let y(i) = -5i. Let d(b) be the second derivative of -1/3b3 - 5 + 11b + 0b2. Determine d(y(l)). 10l Suppose -a = -4q - 213 + 291, -5a = 3q - 93. Let r(y) be the first derivative of -13/2y*2 + 0y - q. Let f(v) = 2v2. Determine r(f(u)). -26u*2 Let l(m) = -m. Let a be ((-6)/4)/((-8)/80-5). Let z(v) = 14v2 - 4v. Let q(g) = -13g2 + 3g. Let u(p) = az(p) - 4q(p). Determine l(u(t)). -10t2 Let w(o) = -10137 + 10137 - 70o2. Let u(d) be the second derivative of d3/3 + 38d. Calculate w(u(p)). -280p**2 Let z(k)	{ "pile_set_name": "DM Mathematics" }
arest to 1/2 in 4, q, i? i Let j = 18.87 - 19. Let h = j + -2.87. Which is the closest to 0.2? (a) -1/3 (b) h (c) 1 a Let z = -1/41 + 44/123. Which is the closest to -2? (a) z (b) -3 (c) 0.3 b Let h = 0 + -0.4. Let g = 131 + -913/7. Let z = -0.21 - 0.09. Which is the closest to -2/3? (a) h (b) g (c) z a Let t = 510/7 + -73. What is the nearest to 0 in 2/9, -4, t? t Let t = -607/5 + 121. Let n = -16 + 19. Which is the closest to t? (a) 5 (b) 0.4 (c) n b Suppose 4 = -16v + 20. Suppose 9 = 3t - 6. What is the nearest to v in -5, t, -0.3? -0.3 Let s = 2.5 - 2.3. Let p be -1 - 3/((-18)/4). What is the nearest to -1/3 in s, 0, p? p Let u = 10 + -9.6. Which is the nearest to 3? (a) -3 (b) 3/7 (c) u b Let r = 9 + -8. Let i = 1.95 + 0.05. Let g = 23/11 + -229/99. Which is the nearest to r? (a) 0.1 (b) i (c) g a Let m = -0.06 + 0.16. Let y be 1/312/(-14). Let s = -2.01 - -0.01. What is the closest to y in s, m, 5/4? m Suppose 3k = 3o + 24, -5o = -k - 3k + 42. Let u = o - -16. Suppose 0 = -un + 2n - 4. What is the closest to 2/5 in 1, n, -5? 1 Let q = -4 + 3. Let n = -2/653 - 2606/1959. Which is the closest to 2/5? (a) -0.2 (b) n (c) q a Let r = -7.4 + 7. Let i = 1.58 + 0.02. Let m = i - r. Which is the nearest to -0.1? (a) m (b) 0.4 (c) -0.3 c Let v(s) = -s + 3. Let d be v(6). Which is the closest to 1? (a) -1/3 (b) d (c) -4 a Suppose -2d = 5l - 2l, l = 2d. Suppose l = -4s - 2051 + 639. Let p = s + 5297/15. Which is the closest to 0.1? (a) p (b) -0.3 (c) -0.1 a Let f be (3/(-12))/((-4)/6). Let p = -4 + 3. Let n = 0.12 + -2.12. Which is the closest to n? (a) 0.4 (b) f (c) p c Let n = -0.28 - -0.3. Let j = 4.02 - n. Which is the nearest to 2/7? (a) j (b) 5 (c) 1/2 c Let r = 2 + -1.1. Let f = r - -0.1. Let n = -2 - 0. Which is the closest to n? (a) -3 (b) 3/5 (c) f a Let x = -0.1 + 0.3. Let h = 867 - 866. What is the nearest to h in x, -0.1, -2? x Let v = -58 - -58.1. Which is the closest to 0.2? (a) v (b) 2/5 (c) -1/3 a Let b = 0.2 - 0.3. Let k = -5.1 - b. What is the nearest to 1 in k, -1, 4? -1 Let q = -4.9 + 7.9. Let y be 34/(-18)-6. Which is the nearest to -1? (a) q (b) y (c) 1 c Let k be 3/(-10)(-20)/(-24). Let o(x) = -x + 16. Let u be o(16). Which is the closest to k? (a) u (b) 0.4 (c) -2 a Let h = -6.8 + 7.8. What is the closest to h in 2/3, 1, 5? 1 Let c(f) = -f3 - 9f*2 - 6f + 5. Let x be c(-8). Let q = -10 - x. What is the nearest to 2 in 0, 0.2, q? q Let k = -2/25 - -37/150. Let h = -5034/11 + 460228/1001. Let a = h - 24/13. What is the closest to a in 0.2, 4, k? 0.2 Let r = 8 - 7.7. Let l = -0.7 - r. Let n = -6 + 8. Which is the nearest to n? (a) -1/6 (b) 0.1 (c) l b Let x = 0.27 - -0.03. Let f = 0.16 + -0.06. Suppose 5p = p - 16. Which is the closest to f? (a) 0.5 (b) x (c) p b Let w = 1432/13243 - 2/697. Which is the closest to -1? (a) 5 (b) -3/8 (c) w b Let u = -47/66 + 1/22. Let o = 0.03 - 0.43. What is the nearest to -1 in -4, o, u? u Let m = 2.04 + -0.04. Let g = -7.5 + 2.5. What is the nearest to m in g, -1/7, 5? -1/7 Suppose 0k = k. Let y = -0.2 - 0. Let l(u) = 3u2 - 9u - 9. Let j be l(4). What is the nearest to 1 in k, j, y? k Let m = -35/2 + 17. Let z = 57/70 + -11/10. What is the closest to m in 6/7, z, 0.1? z Let o = 0.2 - 0.7. Let t = -2.131 - -0.031. Let d = 2 + t. Which is the closest to d? (a) 0 (b) o (c) -4 a Let g = -71 + 69. Which is the nearest to -1? (a) -7 (b) g (c) 1 b Let n(p) = -p3 - p2 + p - 1. Let i be n(-2). Let y = -6 - -8. Which is the nearest to i? (a) 1/4 (b) y (c) 2/3 c Let u = 4.85 - -0.15. Let j = -23 + 23.2. What is the nearest to 2/3 in u, -1/4, j? j Let a be (-1 + 2)2 + 0. Let l = 312/497 + -9293/9940. Let d = 2/35 + l. What is the nearest to d in -1/2, 3, a? -1/2 Suppose -4z - 8 = -4k, 3k - 4z - 11 = -0z. Let q = k - -11/4. Which is the nearest to 1? (a) 0.3 (b) -0.1 (c) q a Let h be 6/(-15)20/(-8). Which is the nearest to h? (a) 2 (b) -1 (c) 2/9 c Let x = -57 - -57. Let c = 1.5 - 1. What is the closest to x in -0.3, c, -0.4? -0.3 Let y = -5.15 - -0.15. What is the nearest to -0.3 in 3, y, 3/2? 3/2 Let w = 0.4 + 0.1. Let l be (18/12)/(2/(-4)). Let b be l/(-4)(-3 + 5). What is the closest to -0.1 in w, -2/7, b? -2/7 Let m = -0.6 + 0.5. What is the closest to 0.4 in -2, 1/3, m? 1/3 Suppose -3m - 3p - 17 = 2m, -3p - 1 = m. What is the nearest to 0 in -7, m, 5? m Let r = -6 - -5. Let d = r - 0. What is the closest to d in -1, 0, -5/3? -1 Suppose -3 = -d, 2x + 2d = -0x - 2. Let n = 0.01 - -2.99. Let q = -4 + n. Which is the nearest to 0.1? (a) x (b) 1/4 (c) q b Let l = 2 + 0. Let t = 7.83 - -0.17. Let r = t + -4. What is the nearest to 2 in -2, l, r? l Let o = 0.013 - 3.013. What is the closest to -2 in o, 2, -4? o Let l = -77 + 86. Which is the closest to l? (a) 0 (b) -3/7 (c) 0.4 c Let l = 221 - 309. Let d be (-6)/l - (-2)/(-8). What is the nearest to -0.1 in d, -3, -1? d Let h = 100/3 - 33. What is the closest to 2 in 5, h, 0? h Let z = -17 + 17. Which is the closest to 0? (a) -3/5 (b) 2/3 (c) z c Let w = 8.4 - 8. Let q = -0.36 - -0.01. Let x = -0.05 - q. Which is the closest to -1/4? (a) w (b) x (c) -2/13 c Let h = 25 - 24.68. Let i = 0.02 - h. What is the closest to -2/7 in -3, i, 1? i Let g = 9 + -14. Let y be (-1)/1 + 5/g. What is the closest to y in 4, 3/4, 0.1? 0.1 Let d be ((5/(-6))/(-5))/(14/(-21)). What is the closest to 1/5 in d, -3/8, 0.1? 0.1 Let h = 0 + 0.2. Let w = -2 + 1. What is the nearest to w in -2, 0.1, h? -2 Let l = 0.13 + 7.87. Let u = l - 8.4. What is the closest to -2/7 in u, -1/8, -5? u Let n = 119 + -123. Which is the nearest to -0.2? (a) -2 (b) 1/2 (c) n b Let m = 15/7 - 13/7. What is the nearest to 2 in -2, -4, m? m Suppose -4 = 4s - 4u, -2u = -s - 5 + 6. What is the closest to 0 in 6, s, -4? s Let r be 3/(-2) + 4/(-8). What is the closest to 2/5 in r, 3, 1? 1 Let i(x) = x. Let k be i(-4). Let o be (1/2)/((-1)/k). Let w be (6/8)/(-1 - 1). What is the closest to 0 in w, -5, o? w Let g = -1.8 - -2.8. Which is the closest to 0? (a) -5 (b) -2 (c) g c Let t(w) = -w*2 - 9w - 10. Let l be t(-7). Which is the nearest to -0.1? (a) -3 (b) 3/7 (c) l b Let b = -0.27 + -0.03. Suppose -3u = 4r - 17, -3u + r + r = -5. What is the nearest to -1 in u, 1, b? b Let i be (-2)/4(-2)/3. Let u = -5.4 - -5. Let q be (-42)/24 - 1-2. Which is the closest to q? (a) 0.1 (b) i (c) u b Let s = -769 + 768.6. Let x = 6 + -4. Which is the nearest to -1/3? (a) x (b) s (c) -2/9 b Let l = -7 - -6.9. Let h = 0.9 - l. What is the closest to 1 in -2, h, 5? h Let z = 73/12 + -41/6. Which is the closest to -1? (a) 2/9 (b) z (c) -1 c Let j = 214/483 + -1/69. What is the closest to 1 in -4, j, -1? j Let q = 4 + -15/4. What is the closest to -2 in 4/3, 0, q? 0 Let w be -1((-4)/(-7))/(-2). Let f be (-18)/24 + 2/(-8). Let q = -69.1 - -69. What is the nearest to q in f, 0, w? 0 Let y = 3.6 - 3.8. Which is the nearest to 0.2? (a) y (b) -0.4 (c) 3 a Let f = 16 + -31/2. Let t = 0.5 + -0.3. Let s = 0.2 - t. Which is the closest to 1? (a) f (b) -0.3 (c) s a Let n = 8 + -12. Let g(k) = k*3 - 8k*2 + 8k + 1. Let z be g(7). Suppose 0 = 3v - zv. Which is the closest to v? (a) n (b) -1 (c) -3 b Let y = 4/73 + 65/146. What is the nearest to 0.1 in 2/5, y, 11? 2/5 Let x = -8 - -9. Let m = -351 - -5267/15. Which is the closest to x? (a) 2/3 (b) -4 (c) m a Let y = -15 + 11. Let h = 0.04 - -4.46. Let f = h + y. What is the closest to -0.1 in f, -5/4, 2/9? 2/9 Let n be (-4)/14 + (-24)/14. Let p = -5.98 - -6. Let r = p + 0.98. Which is the nearest to -0.1? (a) n (b) r (c) 4 b Let w = -1 - -0.8. Let t = 254 - 3812/15. Which is the nearest to -3? (a) t (b) w (c) -4 c Let s = -1.1 - 0.9. Which is the nearest to 2/5? (a) 1 (b) 2 (c) s a Let q = 58 - 59. Which is the closest to q? (a) -0.4 (b) 0.5 (c) 19/5 a Let v = -102 - -99. Which is the nearest to v? (a) -0.4 (b) -1/4 (c) 2/7 a Let v = 2.9 + -3. Let f = 2 - 4. Let t = 1061/5 + -213. What is the nearest to v in t, 5, f? t Let t(m) = -m*2 + 12m + 2. Let b be t(12). What is the nearest to 1 in b, -0.5, -3? b Let t be -2*(-92)/(-40) - 2/5. Which is the nearest to -0.1? (a) -1/5 (b) 1/4 (c) t a Let r	{ "pile_set_name": "DM Mathematics" }
39204/19 = 0. -81, -11, 2/3 Factor -f*3/7 + 1203f*2/7 - 51600f - 51772. -(f - 602)*2(f + 1)/7 Factor 2o2 - 20o - 48. 2(o - 12)(o + 2) Factor 12s3 + 164s*2 + 100s - 52. 4(s + 1)(s + 13)(3s - 1) Suppose -2k3/5 - 6k*2 + 104k/5 - 72/5 = 0. Calculate k. -18, 1, 2 Factor 4r4/7 + 2r*3 + 18r*2/7 + 10r/7 + 2/7. 2(r + 1)3(2r + 1)/7 Factor w2/4 + 205w + 42025. (w + 410)*2/4 Find z such that -2z*5/5 + 2z*4/5 + 28z*3/5 - 56z*2/5 - 16z/5 + 64/5 = 0. -4, -1, 2 Find f, given that 4f4/3 - 556f*3/3 - 376f*2 = 0. -2, 0, 141 Let -60h*4 + 460h*3 - 3545h*2/3 + 1150h - 375 = 0. Calculate h. 5/6, 3 Factor 2h4/5 - 6h*3/5 + 6h*2/5 - 2h/5. 2h(h - 1)*3/5 Find g, given that 4g*4 + 8g*3 - 44g*2 - 48g = 0. -4, -1, 0, 3 Factor 3b3 - 9b*2 - 759b + 765. 3(b - 17)(b - 1)(b + 15) What is b in -b2/2 + 11b/2 - 15 = 0? 5, 6 Factor 2x3 - 288x*2 + 10368x. 2x(x - 72)2 Factor -q2/2 - 164q - 13448. -(q + 164)2/2 Factor -2u*2/11 + 80u/11. -2u(u - 40)/11 Solve t*3/7 - 524t*2/7 + 523t/7 = 0. 0, 1, 523 Find f such that 2f3/5 - 26f*2/5 + 72f/5 = 0. 0, 4, 9 Factor -2r5 + 2r*4 + 6r*3 - 10r*2 + 4r. -2r(r - 1)*3(r + 2) Solve 3t2 - 76t + 25 = 0. 1/3, 25 Determine v so that -8v4/9 - 28v*3/9 + 112v*2/9 - 16v/3 = 0. -6, 0, 1/2, 2 Determine n so that -18n5 + 123n*4 + 523n*3 + 478n*2 - 64n - 160 = 0. -4/3, -1, 1/2, 10 Factor 4a2/7 - 248a/7 + 2820/7. 4(a - 47)(a - 15)/7 Suppose i*3/3 + 59i*2/3 + 424i/3 + 272 = 0. What is i? -51, -4 Solve -2x3/21 + 374x*2/21 + 36x = 0 for x. -2, 0, 189 Find m such that -m*3/4 + 97m*2/4 - 47m/2 - 48 = 0. -1, 2, 96 Solve -3m4 + 2847m*3 - 674025m*2 - 676875m = 0 for m. -1, 0, 475 Determine v, given that 3v4 - 36v*3 + 90v*2 - 84v + 27 = 0. 1, 9 Solve n*5 - 8n*4 - 45n*3 + 220n*2 + 1024n + 768 = 0. -4, -3, -1, 8 Solve f*2/3 - 14f/3 + 8 = 0. 2, 12 Find q such that 162q5 + 468q*4 - 976q*3 - 1088q*2 - 256q = 0. -4, -4/9, 0, 2 Factor 2s2/3 - 61s/2 - 72. (s - 48)(4s + 9)/6 Solve -3m2/5 = 0. 0 Factor -3l*3/8 + 351l*2/8 - 13689l/8 + 177957/8. -3(l - 39)3/8 Solve m3/2 + 4m*2/5 - 13m/10 = 0. -13/5, 0, 1 Factor 2b3 - 2b*2 - 32b - 40. 2(b - 5)(b + 2)*2 Suppose 8h*2/5 - 5378h/5 + 1344/5 = 0. What is h? 1/4, 672 Factor -2x2/5 + 8x + 192/5. -2(x - 24)(x + 4)/5 Factor -p*4 + 21p*2 + 20p. -p(p - 5)(p + 1)(p + 4) Factor 20h*2 - 2492h - 1000. 4(h - 125)(5h + 2) Determine m so that 5m*5 + 30m*4 + 55m*3 + 10m*2 - 60m - 40 = 0. -2, -1, 1 Solve -n5/3 + n4/3 + 5n3/3 + n2 = 0. -1, 0, 3 Determine h, given that -h4/6 + 2h*3 - 8h*2 + 32h/3 = 0. 0, 4 Factor -44521j2/4 + 211j - 1. -(211j - 2)2/4 Let -15q*4/7 + 57q*3/7 + 177q*2/7 + 123q/7 + 18/7 = 0. What is q? -1, -1/5, 6 Factor -t*5/6 - 43t*4/6 - 293t*3/3 - 345t*2 + 2025t/2 - 1125/2. -(t - 1)*2(t + 15)*3/6 What is l in 3l*5 + 21l*4 - 51l*3 + 27l*2 = 0? -9, 0, 1 Determine z so that -3z*3/4 + 29z*2/2 + 171z/4 + 55/2 = 0. -5/3, -1, 22 Factor 2w5 - 4w*4 - 8w*3 + 4w*2 + 6w. 2w(w - 3)(w - 1)(w + 1)*2 Find x such that 3x*2/4 - 1131x/4 - 1143 = 0. -4, 381 Solve -2j5/9 + 10j*4/9 - 4j*3/9 - 28j*2/9 + 2j/3 + 2 = 0. -1, 1, 3 Solve -9d4 + 147d*3 - 42d*2 - 96d = 0 for d. -2/3, 0, 1, 16 Determine x, given that 7x4 - 46x*3 + 39x*2 = 0. 0, 1, 39/7 Suppose -7f*3/11 + 4f*2 - 12f/11 = 0. What is f? 0, 2/7, 6 Solve -2g2 + 266g + 268 = 0. -1, 134 Factor -15y2/2 - 51y/2 - 9. -3(y + 3)(5y + 2)/2 Factor -7r4/4 - r3 + 7r2 + 4r. -r(r - 2)(r + 2)(7r + 4)/4 Suppose -15d4 + 109d*3 - 174d*2 + 12d + 40 = 0. Calculate d. -2/5, 2/3, 2, 5 Factor o*5/5 - 28o4/5. o4(o - 28)/5 Factor -3w*5/2 + 87w*4/2 - 489w*3/2 - 2019w*2/2 - 1104w - 384. -3(w - 16)2(w + 1)*3/2 Factor 2f*3/11 + 178f*2/11 - 2f/11 - 178/11. 2(f - 1)(f + 1)(f + 89)/11 Determine u so that u3 + 32u*2 - 67u + 34 = 0. -34, 1 Let -g*3/8 - 3g*2/4 - 3g/2 - 1 = 0. Calculate g. -2 Solve 4g5 + 692g*4/5 + 940g*3 - 22132g*2/5 + 22496g/5 - 5776/5 = 0 for g. -19, 2/5, 1, 2 Suppose 71b4/5 - 43b*3 + 6b2/5 = 0. What is b? 0, 2/71, 3 Find z such that z3/4 + 3z2/2 - 15z/4 - 25 = 0. -5, 4 What is b in 2b4/7 + 2b*3 - 8b*2 + 40b/7 = 0? -10, 0, 1, 2 Determine q so that -6q5 - 4q*4 + 6q*3 + 4q*2 = 0. -1, -2/3, 0, 1 Solve 2k*5/9 + 8k*4/9 - 136k*3/9 + 212k*2/9 + 134k/9 - 220/9 = 0. -11, -1, 1, 2, 5 Solve 4t5 + 68t*4 - 624t*3 + 1168t*2 + 320t - 1536 = 0 for t. -24, -1, 2, 4 Factor y*4/4 + 9y*3/4 - 5y2/2. y2(y - 1)(y + 10)/4 What is z in -4z4 + 24z*3 + 32z*2 - 384z + 512 = 0? -4, 2, 4 Suppose -2h4 - 2h*3 + 114h*2 + 2h - 112 = 0. Calculate h. -8, -1, 1, 7 Determine q so that -q*3 + 507q*2 - 85683q + 4826809 = 0. 169 Solve 2w2/5 + 402w/5 - 404/5 = 0 for w. -202, 1 Let 4m4/5 + 121m*3/5 + 146m*2/5 + 29m/5 = 0. Calculate m. -29, -1, -1/4, 0 Factor -2d3/9 + 70d*2/9 - 416d/9 + 224/3. -2(d - 28)(d - 4)(d - 3)/9 Factor j5/4 + 9j*4/4 + 29j*3/4 + 43j*2/4 + 15j/2 + 2. (j + 1)*3(j + 2)(j + 4)/4 Suppose -20v*2 + 815v + 205 = 0. Calculate v. -1/4, 41 Find y such that y*3/6 + 7007y*2/6 + 12278015y/6 + 12271009/6 = 0. -3503, -1 Factor -4l3 + 352l*2 + 732l - 1080. -4(l - 90)(l - 1)(l + 3) Factor v3/8 + 11v*2/4 - 288v - 8100. (v - 50)(v + 36)2/8 Factor -m4/4 + 7m*3/4 + 3m*2/4 - 55m/4 - 25/2. -(m - 5)*2(m + 1)(m + 2)/4 Factor -2y*2/3 + 158y/3 + 108. -2(y - 81)(y + 2)/3 Suppose -4v2/3 + 784/3 = 0. Calculate v. -14, 14 Find x such that -36x*3 - 10x*2 + 4x = 0. -1/2, 0, 2/9 Factor -5c5 + 555c*4 - 1635c*3 + 1625c*2 - 540c. -5c(c - 108)(c - 1)3 Suppose 10m*4/3 - 244m*3/21 + 46m*2/7 + 244m/21 - 208/21 = 0. What is m? -1, 1, 52/35, 2 Factor -2f3 - 10f*2 + 100f. -2f(f - 5)(f + 10) Let -6f*4/17 - 20f*3/17 - 18f*2/17 - 4f/17 = 0. What is f? -2, -1, -1/3, 0 Factor -2k2 - 62k + 444. -2(k - 6)(k + 37) Factor -o*5 + 9o*4 + 22o*3 + 2o*2 - 21o - 11. -(o - 11)(o - 1)(o + 1)*3 Factor 5y*2 - 1440y + 103680. 5(y - 144)2 Factor -4s*2/9 + 1160s/9. -4s(s - 290)/9 Let 11g4 - 83g*3/7 - 128g*2/7 - 4g = 0. Calculate g. -7/11, -2/7, 0, 2 What is h in 4h2 + 32h - 192 = 0? -12, 4 Suppose 147p5 - 6090p*4 - 4104p*3 + 23856p*2 + 14064p + 2016 = 0. What is p? -2, -2/7, 2, 42 Factor 5o2 + 50o - 280. 5(o - 4)(o + 14) Factor 6k2/7 + 232k/7 - 78/7. 2(k + 39)(3k - 1)/7 Determine z, given that 21z*4/2 - 87z*3 + 321z*2/2 - 102z + 18 = 0. 2/7, 1, 6 Let 3f3/2 - 110f*2 + 3959f/2 + 1369 = 0. Calculate f. -2/3, 37 Solve b*3 + 77b*2 + 1443b - 1521 = 0. -39, 1 Factor p*5 - 2p*3 + p. p(p - 1)*2(p + 1)*2 Solve 2g*4/3 - 2g*3 - 244g*2/3 - 280g - 784/3 = 0. -7, -2, 14 Suppose 2j2 - 540j = 0. Calculate j. 0, 270 Determine g so that -6g3 - 328g*2/3 + 216g + 160/3 = 0. -20, -2/9, 2 Solve -3l5 - 690l*4 - 38274l*3 + 160764l*2 - 203931l + 82134 = 0. -117, 1, 2 What is h in -3h5 - 9h*4 - 9h*3 - 3h*2 = 0? -1, 0 Find x such that -3x*2/7 + 2724x/7 - 618348/7 = 0. 454 Determine g, given that 3g5 + 447g*4 + 2610g*3 + 5172g*2 + 3432g = 0. -143, -2, 0 Determine q so that q*3 - 218q*2 - 884q - 888 = 0. -2, 222 Let 4n4 - 72n*3 + 404n*2 - 768n + 432 = 0. Calculate n. 1, 2, 6, 9 Factor 2z2/11 - 92z/11 + 1058/11. 2(z - 23)2/11 Suppose -5l*4 - 290l*3 - 285l*2 = 0. What is l? -57, -1, 0 Factor 3y*2 + 702y + 41067. 3(y + 117)2 Factor 2c*4/7 - 16c*3/7 + 10c*2/7 + 4c. 2c(c - 7)(c - 2)(c + 1)/7 Factor -k3/5 + k2 + 8k/5 - 12/5. -(k - 6)(k - 1)(k + 2)/5 Solve 15f*3 + 200f*2 + 595f - 490 = 0 for f. -7, 2/3 Find w, given that -3w5 + 33w*4 - 102w*3 + 42w*2 + 105w - 75 = 0. -1, 1, 5 Suppose 3n3 + 255n*2 + 4089n - 59643 = 0. What is n? -47, 9 Factor 4z2 + 56z. 4z(z + 14) Factor 2c2/3 + 32c - 200/3. 2(c - 2)(c + 50)/3 Let 5k4 + 220k*3 + 815k*2 - 6060k + 7020 = 0. What is k? -39, -9,	{ "pile_set_name": "DM Mathematics" }
t the prime factors of 2690440. 2, 5, 67261 What are the prime factors of 8896660? 2, 5, 444833 List the prime factors of 5026909. 5026909 List the prime factors of 8894508. 2, 3, 7, 19, 5573 List the prime factors of 21476390. 2, 5, 13, 165203 List the prime factors of 553170. 2, 3, 5, 18439 List the prime factors of 987704. 2, 331, 373 List the prime factors of 185652. 2, 3, 191 What are the prime factors of 875697? 3, 291899 List the prime factors of 233688. 2, 3, 7, 13, 107 What are the prime factors of 807321? 3, 439, 613 What are the prime factors of 209091? 3, 69697 What are the prime factors of 4844938? 2, 7, 271, 1277 List the prime factors of 10247274. 2, 3, 97, 5869 What are the prime factors of 399053? 41, 9733 What are the prime factors of 1946148? 2, 3, 127, 1277 List the prime factors of 1333615. 5, 109, 2447 What are the prime factors of 1479065? 5, 7, 6037 What are the prime factors of 580203? 3, 13, 19, 29 What are the prime factors of 2821178? 2, 29, 127, 383 What are the prime factors of 1951405? 5, 390281 What are the prime factors of 327348? 2, 3, 7, 433 What are the prime factors of 76815? 3, 5, 569 List the prime factors of 298036. 2, 74509 List the prime factors of 82190. 2, 5, 8219 What are the prime factors of 206853? 3, 19, 191 List the prime factors of 1068975. 3, 5, 4751 What are the prime factors of 796688? 2, 17, 29, 101 List the prime factors of 1749494. 2, 499, 1753 List the prime factors of 1196548. 2, 299137 List the prime factors of 742798. 2, 7, 17, 3121 List the prime factors of 859938. 2, 3, 331, 433 What are the prime factors of 8714576? 2, 13, 41897 What are the prime factors of 611655? 3, 5, 11, 337 What are the prime factors of 137747? 23, 53, 113 What are the prime factors of 4296890? 2, 5, 13, 33053 List the prime factors of 12598. 2, 6299 List the prime factors of 1067154. 2, 3, 11, 19, 23, 37 List the prime factors of 215406. 2, 3, 3989 What are the prime factors of 2914757? 659, 4423 List the prime factors of 101259. 3, 11251 List the prime factors of 2058234. 2, 3, 83, 4133 What are the prime factors of 4387335? 3, 5, 292489 List the prime factors of 5954161. 619, 9619 List the prime factors of 685799. 79, 8681 What are the prime factors of 389377? 41, 9497 What are the prime factors of 99662? 2, 49831 List the prime factors of 7125714. 2, 3, 395873 List the prime factors of 1559211. 3, 519737 List the prime factors of 18320834. 2, 7, 23, 56897 What are the prime factors of 1871085? 3, 5, 124739 What are the prime factors of 963501? 3, 7, 11, 43, 97 List the prime factors of 4116302. 2, 83, 137, 181 What are the prime factors of 354600? 2, 3, 5, 197 What are the prime factors of 629291? 13, 48407 List the prime factors of 819691. 819691 What are the prime factors of 217576? 2, 27197 What are the prime factors of 71008? 2, 7, 317 What are the prime factors of 7917270? 2, 3, 5, 263909 What are the prime factors of 1169222? 2, 19, 29, 1061 What are the prime factors of 47301? 3, 15767 List the prime factors of 390544. 2, 7, 11, 317 List the prime factors of 1012930. 2, 5, 101293 List the prime factors of 166412. 2, 41603 List the prime factors of 356867. 7, 7283 List the prime factors of 23430358. 2, 7, 31, 53987 What are the prime factors of 1427433? 3, 7, 101, 673 List the prime factors of 1576469. 29, 54361 What are the prime factors of 1577256? 2, 3, 65719 List the prime factors of 112419. 3, 12491 List the prime factors of 5055765. 3, 5, 11, 13, 2357 What are the prime factors of 3042736? 2, 19, 10009 What are the prime factors of 8312026? 2, 439, 9467 What are the prime factors of 869575? 5, 7, 4969 List the prime factors of 667013. 667013 What are the prime factors of 203877? 3, 839 What are the prime factors of 446001? 3, 148667 What are the prime factors of 207404? 2, 19, 2729 List the prime factors of 779137. 779137 List the prime factors of 198557. 181, 1097 What are the prime factors of 1404013? 13, 17, 6353 List the prime factors of 815517. 3, 31, 37, 79 List the prime factors of 10617095. 5, 17, 124907 What are the prime factors of 4073? 4073 What are the prime factors of 189115? 5, 109, 347 List the prime factors of 14996. 2, 23, 163 What are the prime factors of 151110? 2, 3, 5, 23, 73 What are the prime factors of 3849804? 2, 3, 7, 15277 List the prime factors of 746691. 3, 11, 17 List the prime factors of 10290089. 149, 69061 What are the prime factors of 177827? 13, 13679 List the prime factors of 149. 149 List the prime factors of 755909. 7, 11, 9817 List the prime factors of 18608203. 1301, 14303 List the prime factors of 1725580. 2, 5, 19, 239 List the prime factors of 163504. 2, 11, 929 What are the prime factors of 284494? 2, 7, 2903 What are the prime factors of 5236151? 41, 127711 List the prime factors of 1254538. 2, 627269 List the prime factors of 11955249. 3, 47, 9421 What are the prime factors of 745007? 499, 1493 What are the prime factors of 2149878? 2, 3, 358313 What are the prime factors of 2236650? 2, 3, 5, 13, 31, 37 List the prime factors of 140725. 5, 13, 433 List the prime factors of 380606. 2, 47, 4049 What are the prime factors of 576636? 2, 3, 29, 1657 What are the prime factors of 1351175? 5, 7, 1103 List the prime factors of 70768. 2, 4423 List the prime factors of 559742. 2, 17, 101, 163 What are the prime factors of 379323? 3, 7, 223 List the prime factors of 3414842. 2, 1707421 List the prime factors of 592914. 2, 3, 7, 19, 743 List the prime factors of 128118. 2, 3, 131, 163 What are the prime factors of 4504377? 3, 223, 6733 List the prime factors of 7677183. 3, 17, 150533 List the prime factors of 4482667. 7, 1867 What are the prime factors of 1397942? 2, 7, 13, 7681 List the prime factors of 362891. 41, 53, 167 What are the prime factors of 6944584? 2, 868073 What are the prime factors of 6511340? 2, 5, 11, 17, 1741 List the prime factors of 775020. 2, 3, 5, 12917 What are the prime factors of 1199428? 2, 299857 List the prime factors of 31253855. 5, 73, 85627 What are the prime factors of 1427334? 2, 3, 23, 10343 What are the prime factors of 303181? 137, 2213 What are the prime factors of 770901? 3, 256967 What are the prime factors of 3318067? 3318067 List the prime factors of 3078477. 3, 401, 853 List the prime factors of 714241. 11, 29, 2239 List the prime factors of 22931560. 2, 5, 573289 List the prime factors of 3922555. 5, 7, 13, 37, 233 What are the prime factors of 1555079? 1555079 What are the prime factors of 506308? 2, 11, 37, 311 What are the prime factors of 1367017? 1367017 List the prime factors of 5420130. 2, 3, 5, 19, 37, 257 What are the prime factors of 21618? 2, 3, 1201 What are the prime factors of 1245665? 5, 249133 What are the prime factors of 1275246? 2, 3, 7, 29, 349 List the prime factors of 9748313. 9748313 What are the prime factors of 203379? 3, 11, 6163 List the prime factors of 738321. 3, 19, 12953 List the prime factors of 9942647. 11, 13, 23, 3023 List the prime factors of 429603. 3, 89, 1609 List the prime factors of 765342. 2, 3, 14173 List the prime factors of 1572036. 2, 3, 269, 487 What are the prime factors of 7513392? 2, 3, 157, 997 What are the prime factors of 209052? 2, 3, 5807 List the prime factors of 175681. 11, 15971 What are the prime factors of 13350877? 13350877 List the prime factors of 1128203. 317, 3559 List the prime factors of 639016. 2, 7, 11411 What are the prime factors of 89375? 5, 11, 13 List the prime factors of 33004535. 5, 67, 83, 1187 List the prime factors of 2455293. 3, 17, 31, 1553 What are the prime factors of 12675227? 12675227 List the prime factors of 5175560. 2, 5, 13, 37, 269 List the prime factors of 671662. 2, 41, 8191 What are the prime factors of 12345309? 3, 37, 131, 283 List the prime factors of 4162369. 461, 9029 What are the prime factors of 3214073? 3214073 What are the prime factors of 448964? 2, 112241 List the prime factors of 1939717. 13, 17, 67, 131 List the prime factors of 2207373. 3, 7, 257, 409 List the prime factors of 1977756. 2, 3, 11, 14983 List the prime factors of 1810861. 13, 139297 What are the prime factors of 142711? 142711 List the prime factors of 4567149. 3, 507461 List the prime factors of 46613. 7, 6659 What are the prime factors of	{ "pile_set_name": "DM Mathematics" }
ne hundred thousand. -200000 Round -35.1596261 to 3 decimal places. -35.16 What is -11876.18889 rounded to the nearest 100? -11900 Round 0.002324998818 to 3 dps. 0.002 What is -1.6805337 rounded to 1 dp? -1.7 What is -9800.2535 rounded to the nearest integer? -9800 What is 0.00103869733 rounded to 4 decimal places? 0.001 What is -0.485171425 rounded to four decimal places? -0.4852 What is -150.912068 rounded to the nearest ten? -150 Round 2.33036579 to 1 decimal place. 2.3 Round 1655213294 to the nearest one hundred thousand. 1655200000 What is -2289782.7706 rounded to the nearest 100? -2289800 What is -32816.2247 rounded to the nearest ten? -32820 Round 149.7480579 to the nearest 10. 150 What is 94951873.5 rounded to the nearest one million? 95000000 What is -0.0697906523 rounded to 3 decimal places? -0.07 Round 2587565.92 to the nearest 100. 2587600 Round 2060233.26 to the nearest 1000000. 2000000 Round 139.57239614 to 2 decimal places. 139.57 What is 3419765.46 rounded to the nearest ten thousand? 3420000 Round 0.00000106240828 to 7 dps. 0.0000011 What is -635976.6 rounded to the nearest one million? -1000000 What is -0.7384332279 rounded to 2 decimal places? -0.74 Round 7863.9877 to the nearest one thousand. 8000 What is 0.00000641830792 rounded to 6 decimal places? 0.000006 What is 19131289.4 rounded to the nearest 100000? 19100000 What is -84409667.3 rounded to the nearest 100000? -84400000 Round 116874916190 to the nearest one million. 116875000000 Round 0.0000455253286 to 7 dps. 0.0000455 Round -0.166996193 to five dps. -0.167 Round 0.0001148471633 to 5 decimal places. 0.00011 What is 54145.01322 rounded to 0 dps? 54145 What is 12151.1552 rounded to the nearest ten thousand? 10000 Round -255272835.8 to the nearest ten thousand. -255270000 Round -0.04469732 to one dp. 0 Round -4.18123015 to 4 dps. -4.1812 Round -21221452.39 to the nearest one hundred thousand. -21200000 Round 79.902842 to one decimal place. 79.9 Round -2494573920 to the nearest one hundred thousand. -2494600000 What is 954.03045 rounded to zero dps? 954 What is -1630430090 rounded to the nearest 1000000? -1630000000 What is 100.26951358 rounded to the nearest integer? 100 Round -14.145468 to the nearest one hundred. 0 What is -0.00003123709935 rounded to six decimal places? -0.000031 What is 283.45755 rounded to the nearest 100? 300 What is 8.653063707 rounded to 1 decimal place? 8.7 What is -6.22238934 rounded to 2 dps? -6.22 What is 41.2641052 rounded to the nearest ten? 40 What is -0.00178628939 rounded to 6 decimal places? -0.001786 Round 8246.6607 to the nearest 100. 8200 What is -17406.4183 rounded to the nearest integer? -17406 What is -0.0000017228226 rounded to 6 dps? -0.000002 What is -6416.385198 rounded to the nearest integer? -6416 Round 0.30714422 to 2 dps. 0.31 Round 80581120 to the nearest 100000. 80600000 Round 12790715810 to the nearest 1000000. 12791000000 Round -128608.844 to the nearest 1000. -129000 What is 87933830.51 rounded to the nearest one million? 88000000 Round -0.0249937811 to five decimal places. -0.02499 What is -4.94371519 rounded to two decimal places? -4.94 Round -867.6622403 to one dp. -867.7 Round -30907922.2 to the nearest one million. -31000000 Round -13857403.84 to the nearest 100000. -13900000 What is 0.803181396 rounded to 2 dps? 0.8 Round -0.00676168742 to four decimal places. -0.0068 Round 7832594.01 to the nearest 1000. 7833000 Round 0.0578801599 to 2 decimal places. 0.06 Round -1.013854452 to 3 decimal places. -1.014 Round 0.0224251869 to two decimal places. 0.02 Round 0.025800541 to four dps. 0.0258 Round 506688.94 to the nearest one thousand. 507000 What is 1974976.97 rounded to the nearest one million? 2000000 Round 1418422.182 to the nearest 100. 1418400 Round 0.74747502 to 3 dps. 0.747 Round 16158064.82 to the nearest one hundred thousand. 16200000 Round 0.175962033 to three decimal places. 0.176 Round -841937.95 to the nearest one million. -1000000 Round 0.0001527882743 to 6 dps. 0.000153 Round 0.0001329820283 to 7 dps. 0.000133 What is -11.0539025 rounded to 2 decimal places? -11.05 Round 0.0000057137985 to seven dps. 0.0000057 What is -7.13568698 rounded to one decimal place? -7.1 What is 0.02971489529 rounded to four dps? 0.0297 Round 0.00000098522333 to seven dps. 0.000001 Round 0.0209660689 to 6 dps. 0.020966 What is -0.000000366795 rounded to six decimal places? 0 Round -1268208.879 to the nearest ten thousand. -1270000 What is 350790.56 rounded to the nearest ten thousand? 350000 What is -0.0000109108256 rounded to 6 decimal places? -0.000011 What is 0.59369032 rounded to 1 dp? 0.6 What is 2844.140251 rounded to 0 dps? 2844 What is 0.00273549409 rounded to four dps? 0.0027 What is -6293452200 rounded to the nearest 1000000? -6293000000 Round 0.000163897786 to seven decimal places. 0.0001639 What is -42.33844334 rounded to 0 dps? -42 Round 1562.253686 to the nearest 100. 1600 Round -0.357274317 to four dps. -0.3573 What is 5.9506181 rounded to two decimal places? 5.95 Round -6092.43577 to the nearest integer. -6092 Round 2528739.86 to the nearest 100000. 2500000 Round -0.001536668328 to 7 dps. -0.0015367 What is -0.025296699 rounded to three dps? -0.025 Round 0.01756350195 to 5 dps. 0.01756 What is -0.000000940398213 rounded to six decimal places? -0.000001 What is -17245.903014 rounded to one dp? -17245.9 Round -19905279.3 to the nearest one thousand. -19905000 What is 147057.45 rounded to the nearest one hundred thousand? 100000 Round 17281.466335 to one decimal place. 17281.5 What is 595998.246 rounded to the nearest one thousand? 596000 Round 0.00024932076 to seven decimal places. 0.0002493 What is -0.15954369674 rounded to 6 decimal places? -0.159544 What is 8854856.904 rounded to the nearest one hundred thousand? 8900000 What is -18620.05132 rounded to the nearest integer? -18620 Round 0.0181402839 to three decimal places. 0.018 Round -17919.92374 to the nearest 100. -17900 Round -0.0073331689 to 5 decimal places. -0.00733 What is 126828.2222 rounded to the nearest one hundred? 126800 What is -0.00199650728 rounded to five dps? -0.002 Round -1402831.54 to the nearest one hundred. -1402800 What is -450412249 rounded to the nearest ten thousand? -450410000 Round -1.0550241 to 2 dps. -1.06 What is 3929.252455 rounded to 1 dp? 3929.3 Round 1263012.721 to the nearest 100000. 1300000 What is -0.00107370753 rounded to 5 dps? -0.00107 Round -18942.64206 to the nearest one hundred. -18900 Round 0.1051004739 to four decimal places. 0.1051 What is 2803.01619 rounded to the nearest 100? 2800 What is 26236731830 rounded to the nearest one million? 26237000000 What is -197.1341072 rounded to 2 decimal places? -197.13 Round 2205174687 to the nearest 100000. 2205200000 What is 0.134783092 rounded to 3 dps? 0.135 What is 319.877598 rounded to one dp? 319.9 What is -154734.70479 rounded to the nearest one hundred? -154700 Round 1323.619474 to one dp. 1323.6 What is 41.6170105 rounded to 2 dps? 41.62 Round 0.00027997559 to five dps. 0.00028 Round 0.15837186332 to 2 decimal places. 0.16 What is 50.7076245 rounded to three decimal places? 50.708 Round -4.12086168 to three decimal places. -4.121 What is -217591.9561 rounded to the nearest 10000? -220000 What is -669804.6 rounded to the nearest 10000? -670000 Round -0.00237157336 to 5 dps. -0.00237 What is 86098.6277 rounded to the nearest ten? 86100 Round 1341510365 to the nearest 10000. 1341510000 What is -0.02536630452 rounded to 4 dps? -0.0254 What is -6789.192245 rounded to the nearest ten? -6790 Round -8.8637556 to the nearest integer. -9 Round 0.000346885385 to 4 dps. 0.0003 Round 0.067868261 to five dps. 0.06787 What is 0.00000853381 rounded to six decimal places? 0.000009 What is 9.944284 rounded to two dps? 9.94 Round -5337980.095 to the nearest 1000000. -5000000 Round -0.0015488179077 to 6 decimal places. -0.001549 What is -0.03530273678 rounded to 2 dps? -0.04 What is -1948.4434 rounded to the nearest ten? -1950 Round 812.73696 to the nearest one hundred. 800 Round -370.334397 to the nearest ten. -370 Round 101735373 to the nearest 100000. 101700000 Round -7800.598 to the nearest 100. -7800 Round -1.0292575449 to 4 decimal places. -1.0293 Round -301.831337 to th	{ "pile_set_name": "DM Mathematics" }
1)). 20 What is the lowest common multiple of 6/(-15) - (-126)/15 and (2/(-3))/(-4 + (-520)/(-132))? 88 What is the least common multiple of 12 and 2 + 4 + 10 + 2? 36 Let m(u) = 3u2 - 2u*2 - 2u + 1 - 6. Calculate the least common multiple of 2 and m(5). 10 Let k = -250 + 1173. Let d be (-41)/6134 + 2. Let p = d + k. Find the common denominator of 73/3 and p. 3 What is the common denominator of 2 + 63/(-112)(-276)/9 and 1 + 0 + (-68)/22? 44 Suppose 5a - 80 = -0a. Let i be ((-9)/12)/((-2)/8). Calculate the smallest common multiple of a and (i + (-1 - 0))5. 80 Suppose 0 = -3g + 16 - 1. Calculate the least common multiple of g and 6. 30 Let g be (16/(-42))/((-6)/(-2226033)). Let z = g + 141714. Let v = 378 - z. Calculate the common denominator of 83/4 and v. 28 Suppose 3s + 12 = 48. Let m(g) = 4g*2 - 3g. Let h be m(-3). Suppose -3q + h = 3x, -5q + q + 4x + 52 = 0. Calculate the least common multiple of q and s. 84 Let b(c) = -3c - 1. Let u(l) = l. Let w(a) = 3b(a) + 6u(a). What is the least common multiple of 11 and w(-2)? 33 Let n(p) = -8p*2. Let b be n(1). Let y be b/(-12) - 574/60. Let o = 483/20 + y. What is the common denominator of o and 19/5? 20 What is the lowest common multiple of 33 and (9/6 + -4)/(1/(-6))? 165 Let t = -3 + -33. Let y be 750674/t - (-5 - -2). Let z = y - -20841. What is the common denominator of -7/22 and z? 198 Let b(s) = -1999s - 1. Let w be b(3). Let i = w + 120021/20. Calculate the common denominator of 79/12 and i. 60 Suppose -2w + 6w = -24. Calculate the smallest common multiple of ((-9)/w)/((-9)/(-24)) and 10. 20 What is the lowest common multiple of ((-1)/(-1) - 0)2 and 4? 4 Calculate the lowest common multiple of 4 and (2 + -3)(-2 - 1). 12 Let y = -4/895 + 9194/54595. Let h = 2004/427 + y. Let g = 1/741 + -7660/2223. What is the common denominator of h and g? 63 Let k(u) = -u*3 + 8u*2 + u - 7. Let n be k(8). Suppose -2h + n + 3 = 0. Calculate the least common multiple of h and 10. 10 Let v = 4 - -2. Let k = 24 + -17. Calculate the least common multiple of v and k. 42 Let p = 1381796 + -96748707/70. Let m = p - -2256/7. Calculate the common denominator of m and 5/3. 30 Let f = 312485/59934 - -2/4281. Calculate the common denominator of f and (115/105)/(6/35). 126 Let t = 3/8525 + -202907/34100. Calculate the common denominator of t and 61/22. 220 Suppose 8j - 6 = 5j. Calculate the lowest common multiple of 7 and j. 14 Let c = 37487/26 + -1442. Find the common denominator of 117/10 and c. 130 Let l(a) = -3177a3. Let y be l(-1). Let s = 22184/7 - y. Calculate the common denominator of s and 18/25(-100)/30. 35 Let f = -7393 - -5110. Let y = 13757/6 + f. What is the common denominator of 0 + -2 + (-525)/(-28) and y? 12 Suppose 5i = -4m + 18, 4i - 5i = -m. Suppose -4d + 0d + 88 = 0. What is the smallest common multiple of d and m? 22 Calculate the common denominator of -139/6 and (-62)/45 - (19/3 - 6). 90 Let v(g) = 2g2 + 2g. What is the least common multiple of 22 and v(-2)? 44 Let x(h) = -h - 2. Let v(l) = -l - 1. Let m(s) = 6v(s) - 5x(s). What is the smallest common multiple of 8 and m(-4)? 8 Let a(x) = x*2 - 4x + 5. Let s be a(4). Suppose 4c = -r + s, -5r = 3c - 2r + 3. Let d = 6 - c. What is the least common multiple of d and 3? 12 Calculate the common denominator of (-16)/(-132) - (-8)/(-12) and -43/2. 22 Let h = 1/3266 + -7155/2034718. Let b = 19309/1246 - h. What is the common denominator of b and -19/14? 14 Calculate the common denominator of (32/8)/((-44)/(-30)) and 83/26. 286 Let x = -134/77 + -3/14. What is the common denominator of x and ((-4)/(-160))/((-1)/94)? 220 Find the common denominator of 1/(((-112)/220)/4) and -20/11. 77 Let i = -1994/349 - 2/2443. Let q = -508 - -2981/6. What is the common denominator of q and i? 42 Let k(s) = s3 - s2 - s - 16. Let v be k(0). Calculate the smallest common multiple of -854/v and 5. 10 Let u be 21/12 + 1/4. Calculate the least common multiple of 14 and (2 - 16)/(-1) - u. 84 What is the lowest common multiple of 7 + 2/6 + (-10)/(-6) and 19? 171 Let t = -5621/6 - -940. What is the common denominator of t and -1 - -1 - (-174)/(-20)? 30 Let l be (9/6)/(3/20). Let f = -6 - -11. Suppose -j - fk + l + 4 = 0, 0 = -j - 3k + 14. Calculate the lowest common multiple of 10 and j. 70 Let h(s) = 423s2 + 0 + 2s - 1 + 2. Let f be h(-1). Let m = f + -1199/3. Find the common denominator of 52/9 and m. 9 Let a be (-72)/20(-40)/6. Suppose 6i - 3i - a = 0. What is the least common multiple of i and 12/90 - (-148)/15? 40 Let p be (-6)/27 - (-108164)/12486. Let z = -8/2081 - p. Calculate the common denominator of z and 194/(-66) - 1/3. 99 Let w be 2/(-4) + 3285/(-6). Find the common denominator of -95/2 and w/(-3)(-6)/(-48). 6 Let k = -2/57 + 5419/114. What is the common denominator of k and 29/134? 134 Let a(z) = -6z - 11. Calculate the smallest common multiple of a(-5) and 1. 19 Let k(j) = -4j + 1. Let a be 0 + 11 + 4 + -8. Let w(t) = t*2 - 4t - 10. Calculate the lowest common multiple of w(a) and k(-2). 99 Suppose 166d = 165d + 14. Let k = -23 - -70. Let o = -31 + k. What is the lowest common multiple of d and o? 112 Suppose -r + 15 + 3 = 0. Calculate the smallest common multiple of r and 9. 18 Let g = -6 + 17. What is the smallest common multiple of 6 and g? 66 Suppose 2n - 37 = -0v + 3v, 5v = -25. Calculate the least common multiple of n and 5. 55 Let b = -2/1541 - -155677/27738. Calculate the common denominator of b and -93/10. 90 Suppose -2v + 3 = -1. Suppose 4i + 0 + 12 = 0. Calculate the lowest common multiple of v(i + (-9)/(-2)) and 6. 6 Let h(c) = -2c*3 + 5c*2 - 2. Let o be h(5). Let p be (-1006)/16(0 + 2). Let q = p - o. Find the common denominator of q and 27/2. 4 Let v = -1/6019 + -619917/240760. What is the common denominator of 58/35 and v? 280 Let u = -1 - -5. Let k = -3 + u. What is the lowest common multiple of 11 + k(1 + -2) and 18? 90 Let u = 191650072679/37423980 + 5/1871199. Let v = u + -5118. What is the common denominator of -125/12 and v? 60 Suppose n + 0 - 14 = -4z, -2n + 28 = -3z. What is the lowest common multiple of n and 6? 42 Suppose 20 = 4d + 2y, 4d - 34 = -2y + 7y. Let w = 2 + 0. What is the smallest common multiple of d and w? 6 Suppose 13l - 11l - 22 = 0. Calculate the smallest common multiple of l and 1/(-4) - (-82)/8. 110 Suppose 240 = 4j + 80. Let a = 4 + 0. Calculate the smallest common multiple of a and j/(-2)(-4)/8. 20 Let w = -107277355/12 + 8945709. Let p = 5936 - w. Let k = 408359/72600 - -2/9075. Calculate the common denominator of k and p. 24 Let j = 161100 - 114960. Suppose -3h = 2h + j. Let t = -92189/10 - h. What is the common denominator of t and 27? 10 Let w = -50 + 62. Suppose 14 - 4 = n. What is the least common multiple of n and w? 60 Let r = 321/29 - 3723/580. What is the common denominator of r and -87/4? 20 Suppose 0j = 2j + g - 6, 0 = -j - 3g - 2. What is the lowest common multiple of j and 6/10 + (-14)/(-10)? 4 Let z(u) = -u + 1. Let x be z(8). Let l = 1 - x. What is the lowest common multiple of 16 and l? 16 Let x be (-2 - -1)(-23 - 5). Let q be x/(-720) + (-1 - -1). Let t = q + -5531/1260. Find the common denominator of t and -43/5. 35 Suppose 112 = 5y + 2i, -92 = -3y - y - 4i. Calculate the smallest common multiple of y and 44. 44 What is the common denominator of 68/9 and (-1)/11100/6? 99 Let n = -9901 - -118963/12. Let q = -32922/1715 - 6/1715. Let o = 1229/70 + q. What is the common denominator of o and n? 84 Let s be (0 - 7) + (-1)/(-1). What is the common denominator of 1358/88 - (-2)/(-11) and (s/45)/((-16)/474)? 20 Suppose 0s = 4s + 20. Let v(c) = 2c3 - 4c*2 - 4c. Let m be v(s). What is the least common multiple of 2 and (-4)/(-14) - m/21? 16 Let t = 1 - 3. Calculate the lowest common multiple of 4/4 + (-14)/t and 6. 24 Suppose 2a - 4a - m = -4, 0 = 4a + 4m - 12. Let b = a - 2. What is the least common multiple of 3 and -2(-5 - b)1? 24 Suppose 61 = 4q + 13. Let g = -1047 - -1069. Calculate the least common multiple of g and q. 132 Let c(o) = -6 - 1 - 5 + 2 + o. Let z be c(10). Suppose zw + 5w - 73 = -m, 0 = 4w + 5*m - 71. What is the smallest common multiple of 12 and w? 84 Let b(q	{ "pile_set_name": "DM Mathematics" }
- 18 for x. 2 Suppose 3n - 12 = -f, -4f - 4 + 0 = -n. Solve no - 6 = c, -3c = 5o - 6c - 4 for o. 2 Suppose 4s + 21 = 113. Suppose 0 = 4l + 3n - 80, -6l + 3l + 4n + 85 = 0. Let g = s - l. Solve g = -2w - j - 5 - 2, -4w - 9 = j for w. -1 Suppose -2j + 0j = -28. Suppose -3c + 4 + j = 0. Solve -2v + 6 = -0v + 5l, -3l = -c for v. -2 Let r be (-25)/(-10)-21-4. Solve 0 = -4l + 2w + 10 + r, 4l + w - 15 = 0 for l. 5 Suppose -125 = -37b + 12b. Solve -6r + 4r + 10 = -4y, 0 = -br - 5 for y. -3 Let c be (0(-3 - -2))/1. Solve -2p + 18 + 15 = 5w, c = -p + w - 1 for p. 4 Suppose 14t - 9t = 15. Solve -3c - l + 13 = t, 3l - 10 = c for c. 2 Let w be 13/(-3 - (-1 + -1)). Let q(x) = x*2 + 12x - 8. Let u be q(w). Let n(k) = k. Let y be n(5). Solve 0 = h - 0h - f + u, 0 = -yh + 2f - 16 for h. -2 Let f(d) = -2d*2 - 5d + 7. Let a be f(-5). Let q = a + 21. Solve -5b + 9 = -2y, 3b + qy - 6y = 0 for b. 3 Let k(n) = n3 + 6n*2 - 7n + 2. Let d = -14 - -17. Suppose 2m - dm = 7. Let l be k(m). Solve 5v - 4r = 4v + l, 0 = -4r - 4 for v. -2 Let g = -2 - -7. Let v = 198 - 123. Suppose 3n - v = -0n. Solve -5y - 5j + n = 0, gy + 0 + 15 = 3j for y. 0 Let o = -82 + 90. Solve 2u = f + o, 2u - 3f - 2f = 24 for u. 2 Let w = 9 + -6. Suppose -j = 2j - 6. Suppose -3 + 9 = jm. Solve 0 = -0f - 4f + mb - 7, -4f + w = -b for f. 2 Suppose 0 = -5d - s - 4, -3s - 7 = -3d + 5. Suppose 0 = -r - 5o + 12, d = -r + 2r - 5o + 8. Solve -rw = v - 3 + 9, 0 = 5v + w + 12 for v. -2 Suppose 15 = 3g, 8g + 2 = -w + 6g. Let y be 3/w(1 - 0)-52. Solve -32 = -5m - 4c, 2m = m - 3c + y for m. 4 Let f = -8 - 32. Let q = 42 + f. Solve 5z + 2j + 15 = -0j, 18 = qz - 4j for z. -1 Let g be (-2 + (-5)/(-2))22. Suppose 0 = j + 6 - g. Solve jm + 10 = -v, -4v - m - 6 + 4 = 0 for v. 0 Let t be ((-14)/(-21))/(((-3)/(-9))/1). Solve -3 = 5l - 0l - b, tb = -3l - 7 for l. -1 Let h = -104 - -106. Let k(c) = 2c - 2. Let r be k(3). Let n = 7 - r. Solve 0 = -4a, -i = hi - 3a + n for i. -1 Let s be (-54)/(-1(3 + -2)). Suppose s = 5a + 44. Solve 4p - q - a = 15, -3p = -5q - 34 for p. 3 Let s(y) be the first derivative of y*3/3 - 3y*2/2 - 5y - 1. Let q be s(-2). Solve j - qh = 17, -4j + 3h = -7j - 3 for j. 2 Let v = -5 - -6. Let o = v - -3. Solve 0 = -oz - 5h - 35, 4z + 5 + 12 = h for z. -5 Let a = -23 - -26. Suppose 0 = ao - 2c - 13, 5 = c + 4c. Solve 23 = od - 2, -5d + 28 = -v for v. -3 Suppose 4o - 45 = 3v - 2, 3v = 2o - 17. Suppose -60 = 2b - 6b. Solve x = -m - 3x + o, m = -5x + b for m. 5 Suppose 5s - 28 = 107. Let o = s + -2. Solve o = 5l, 3d + 0d = -4l + 20 for d. 0 Suppose 41y - 866 + 169 = 0. Solve 3p + 6 = 2c, -13p + c = -8p + y for p. -4 Let y(c) = -8c + 228. Let v be y(28). Solve 0 = vz + w - 5 - 14, -3z - 3w + 21 = 0 for z. 4 Suppose -2t + 48 = 22t. Solve -tn + 4x = 16, -4n - 2x + 6 = -12 for n. 2 Suppose -4x - a - 112 = 231, 3x - 3a = -276. Let q = 90 + x. Solve qt + 6 = -3b, 4t - b + 3 = 5 for t. 0 Let h(z) = -z - 7. Let b be h(-9). Suppose -6v + 2v + 116 = 0. Let j = v + -29. Solve -l - 3n = -b, -5l + n + 19 + 7 = j for l. 5 Let q be 1421. Let z be (-147 - -1) + 0 + 4. Let a = z - -145. Solve 4r - 22 = 2v, qv + ar = 3v + 10 for v. -1 Suppose 3u = -u. Let n = u - -3. Let c be 4 + 3/(-6)(-12)/(-3). Solve 7 = -5f - 4g - c, -nf + 4g - 31 = 0 for f. -5 Let l = 3 - -3. Let o(m) = -m*2 + 50m + 163. Let f be o(53). Solve f = -3i - w, w + l = -5i - 2 for i. -2 Let l = -195 - -200. Solve -3g + 4g + lz = 29, 2g = -z + 13 for g. 4 Suppose 20c - 53 + 13 = 0. Solve -4d = -2f - 4, 5f + c = -2d + 4d for d. 1 Let p(u) = 3u + 11. Let k be p(-3). Suppose -4 = -4z + 4h, 2h - 22 = -kz - h. Solve -zq - 5m = -30, -q - 3m - m + 12 = 0 for q. 4 Let x = -81 - -134. Let f = 58 - x. Solve 0 = 3u - 2t + 10, -2u - ft = -5u - 16 for u. -2 Let w be (-15)/108/(-6). Suppose 3p - g - 84 = 0, -5p + 2g = 7g - 140. Solve -wr - p = 2r + 3t, 24 = -2r - 4t for r. -4 Suppose -2r + 63 + 3 = 0. Let q = r + -31. Solve 3 = -a - qd, 4a - 8d + 3d = 14 for a. 1 Suppose -4a = 4j + 8, -9 = a - 4. Suppose -jv + 0 + 12 = 0. Solve 1 = 3u - 2c, 5c + 1 = 2u + vc for u. 1 Let o(w) = 6w + 6. Let q be o(-3). Let m be q/9(-3)/2. Suppose 5t + m = 6t. Solve tg + 3v = -9, -3g = v - 2 + 12 for g. -3 Suppose -67k = -72k + 25. Solve -kj = -4n - 3, 5j + 1 - 2 = 3n for n. -2 Suppose -q - 4 = 3a, 7q - 10q - 3a = 0. Solve -y = 3u - 2, -qy + 0y = 3u - 4 for u. 0 Let d(a) = -a2 - 35a - 93. Let o be d(-32). Solve ou + 12 = 3p, 3p = u + 3u + 16 for p. 0 Suppose 198 = 53s - 67. Solve -3d - 4p + 5 + 3 = 0, sd - p + 25 = 0 for d. -4 Suppose -6r = -5r - 5. Suppose -5u - 4 = q, 2q = u - 0 + 3. Solve -g = rs + 19, -s = -4g + 7 + q for g. 1 Suppose 7 - 45 = -f. Suppose -3j + f = -25. Let k = 23 - j. Solve t - r = -t + 2, -3t = kr - 10 for t. 2 Suppose 0 = 2b + 4n - 22, n - 5 = -b + 8. Let h = 107 + -107. Let p = h + b. Solve 5z = -p, -q + 8z = 3z - 10 for q. -5 Let k be (2 - 3 - 3)/(-2). Let i(o) = 9 + o*k + 8 - 4o - 12. Let c be i(2). Solve d = 5j + 4, c - 17 = -4d - 2j for d. 4 Suppose 4g - 15 = 5. Suppose -gh + 4k = 3k - 28, -3h = -k - 16. Solve -3a - h = -2a - j, -5a - 3 = 4j for a. -3 Suppose 10 = -2s + 7s. Suppose -sz = 4 - 22. Solve 3k - 5o - 9 = 0, -3k + 4o - 3 = -z for k. -2 Suppose k = -5s - 3, -3k - 4 - 5 = -s. Let c(f) = f3 + f2 + 8. Let g be c(s). Solve -4x + 0m - 4m - g = 0, -5m - 12 = 4x for x. 2 Let b be 14(-20)/24-3. Let p(r) = -13r3 + 1. Let v be p(-1). Let w be 4/v + 33/7. Solve 2g - o + 9 = 0, -wg = -o - 4o + b for g. -2 Suppose -8 = -5c + 7. Solve 0o = 3d + 3o - 18, -co - 14 = -5d for d. 4 Let v be (-1155)/9 - (1 + 3/(-9)). Let t = -126 - v. Solve -2s + c - 30 = 3s, -10 = 5s + tc for s. -5 Let s(j) = j*3 + 11j*2 - 11j + 14. Let k be s(-12). Solve 4i - z - 1 = -14, 16 = ki + 4z for i. -2 Let j be 5/1 - (4 + (12 - 16)). Solve 3h = jl - 4l + 5, -4h = 4l - 28 for l. 4 Suppose -36 - 98 = 18q - 206. Let k be 2/(-3) + (-8)/(-3). Let x be (8/10)/(3/15). Solve -ki = -xm - 8, 0i + qi = 4m + 4 for i. -2 Let w(p) = -23p + 30p + 12 - 29p + 4p*2. Let d be w(5). Solve 2o - 20 = 4n - 6, -do = 4n + 26 for o. -3 Let w(v) = -v. Let j(o) = 11o - 25. Let n(p) = j(p) + 2w(p). Let x be n(3). Solve 2 = -d + xu - u, 2u = d for d. -4 Suppose 0 = -3z - 3q + 6, 3q = 2z + 8q - 13. Let m be 2z(7 + -8). Solve 4h - 5o + mo - 10 = 0, 4h + o - 18 = 0 for h. 4 Let h(a) = -2a2 - 17a - 34. Let i be h(-4). Solve -2m - 4w = -18, 0 = -4m + iw - 3w + 1 for m. -1 Suppose 3n = -n. Let i = -281 + 284. Solve -c - iy = -nc + 5, 3y + 6 = 0 for c. 1 Let l be 13 - 14/((-112)/(-40)). Solve 0 = f + 3n - ln - 16, 0 = f + 3n + 8 for f. 1 Let l be (5/2)/(75/120). Solve 6n = -5k + 4n - 10, -2k - l = n for k. -2 Let y be ((-19)/4 - -5) + 3/4. Let m(w) = -3w + 1. Let d be m(-3). Let a be d - (y - (-3 - 0)). Solve i + 3 = n, 5i - a = 2n - 27 for n. -2 Suppose 0 = 5f - 5o - 60, 45 = 4f + 5o - 6o. Solve 0 = -4i + 16, i - f = -3t - i for t. 1 Let x(m) = -m*3 - 7m*2 - 13m + 4. Let h be x(-4). Suppose -5w = 2j - 22, -20 - h = -4j - 2w. Solve 5u - 4i + 4 = 2, 3i + j = 0 for u. -2 Suppose -92g + 2393 - 553 = 0. Solve 20w - 4r - g = 16w, -3r - 15 = 3w for w. 0 Suppose 0 = 3o + o - 8. Let u be o/3 - (-174)/9. Suppose -8s + u = -3s. Solve 0 = 5h - sc, h + c = -4h + 25 for h. 4 Suppose -f = 4q - 9, 0 = -0q + 2q + 2f. Let c = q + -2. Solve k - c = -4u, 3 = -k - 3u + 4 for k. 1 Suppose 117 = 5b + 97. Solve -5n - 4c - c = 0, n = bc for n. 0 Let d(s) = -s3 + 6s*2 + 7s + 2. Let o(v) = -v*2 - 5v + 13. Let t be o(-6). Let x be d(t). Solve xw - 2y = 2, 0 = -3w - 3y + 14 + 1 for w. 3 Let z be 52/6 - (-12)/(-18). Let w = z + -7. Let c be 0 + (-10 - w)/(-1). Solve c = -4l - 3k, 6l = 2l - k - 1 for l. 1 Let j(o) = -o*2 - 5o + 38. Let r be j(-9). Let g be 0 - (2/(-2) + -2). Let d be 46/4 - (-1)/(-2). Solve -gk - f + d = r, 13 = 5k + f for k. 2 Let o(l) = l*3 - 19l*2 + 94l - 33. Let w be o(11). Solve -3*y	{ "pile_set_name": "DM Mathematics" }
alculate (0 - 0 - 0) + 3 + -37 + 24. -10 What is 18 + -10 - 37 - -19? -10 What is the value of 10 + -29 - (-2 - (1 + 2 + -1))? -15 Calculate (-2 - -1) + (14 - 7 - 0). 6 Calculate 25 + -1 + (-61 - -21). -16 What is 0 + (-2 - (-11 - 1))? 10 Calculate -16 + -4 - ((14 - 6 - 4) + -10). -14 Calculate 1 + 19 + (-16 - -9) + -6 + -9. -2 Calculate (-3 - 7 - (-3 + 0)) + -90 + 90. -7 Calculate 89 - 82 - (16 + (-1 - 0)). -8 Calculate -3 + (2 - (7 - 3)). -5 29 + 2 - (-61 - -29 - -52) 11 What is the value of 10 + (-7 - (-12 + -5)) + -33? -13 Calculate -20 - ((11 - (14 + 0)) + 1 + 6). -24 Evaluate (-22 + 11 - -2 - -6) + 1 - 7. -9 What is the value of 4 + (3 - 6 - 9) + 13? 5 What is the value of 18 + 10 + (-20 - 1)? 7 Evaluate -48 + 33 + 18 + -1 + 4. 6 What is the value of (-26 - -28) + 0 + (7 - (0 - -3))? 6 What is (21 - 41) + (2 - 4 - -2) - -8? -12 What is 8 - (8 - (-6 - -3 - (-1 - 4)))? 2 Evaluate -1 + -7 + (1 - -9) + -1. 1 What is the value of 13 + (-7 + -10 + 7 - (2 - 10))? 11 31 + (0 - (-7 + 12)) + (0 - 10) 16 What is -15 - (-5 + -2 - (-2 + 1)) - 10? -19 Evaluate (-7 - (-5 + -1 - 3)) + -14. -12 Calculate (39 - 14) + -13 + 1 + -29. -16 Calculate -1 + (-5 - 0 - -2). -4 What is the value of 7 + -9 - (1 - (3 + 1 - 2))? -1 Calculate -7 + -13 + 25 - (8 + 2). -5 13 - (-6 + (-4 - -9)) 14 What is the value of 2 + -9 + -2 + 9 + -16? -16 What is (-1 - -2) + -5 + (1 - -2 - 3)? -4 -1 + 17 + -23 + -9 -16 Evaluate -10 - -11 - (24 + -10). -13 What is 6 + (9 - (0 - -7)) + -1? 7 What is the value of 27 - 27 - (33 - 15)? -18 What is 28 - 0 - (-9 - (-9 + -19 + 14))? 23 What is the value of 3 - (12 + -3) - (-10 + (2 - -25))? -23 Calculate 50 - 38 - (-3 + 3 + 1). 11 Evaluate 19 + 25 + -80 + 24. -12 11 + -13 + -6 + 3 -5 What is the value of -2 + -1 - (110 - 96) - 0? -17 What is the value of 1 + 20 + 4 - (3 - (-1 - -5))? 26 11 + -6 + -7 + 3 1 -5 + (3 - 3 - -14) 9 2 - 3 - (-8 + 6 + 9) -8 Evaluate -17 - (1 + -2 + 7 + -9 + -3). -11 Evaluate -3 - (-15 - (-2 + (-4 - (-6 - -4)))). 8 Calculate 10 + (-10 - -12) + -6. 6 What is the value of (52 + -39 - -7) + -35? -15 Calculate 32 + (-13 + 9 - 14). 14 (-5 + -2 - -3) + (-1 - 4) + -22 -31 Calculate -14 - ((-8 - -5) + -5). -6 Evaluate 31 - (59 + -23 + 2). -7 What is -23 + 15 + 11 - -32? 35 Evaluate (-20 - -36) + -14 + 2 + 3. 7 Evaluate (7 + 12 - (8 + -3)) + -8. 6 Evaluate -18 - 1 - (56 + -69) - -11. 5 What is -5481 - -5498 - (0 - (-1 + 8))? 24 What is 3 + (17 - 32 - -18)? 6 What is the value of 42 + -38 + 2 + -34? -28 Calculate 4 + (-7 - -8 - 7) + 7. 5 What is 43 - ((-13 - 16) + 34)? 38 Calculate -56 - -60 - ((3 - -2) + 5). -6 Calculate 2 + (-21 - -20) + -10. -9 ((44 - (7 + -11)) + -9 - 6) + -12 21 What is 4 + -24 + -14 - (0 - -2)? -36 What is the value of -22 + 16 + 18 - 27? -15 What is -13 - (-17 + (-4 - -13))? -5 Calculate 10 - (-4 - (-4 - (-2 - 0))) - -3. 15 17 + -83 + 25 + 31 -10 Calculate -12 - (-9 + (19 - 43)). 21 Evaluate -26 + 8 + 114 + -71. 25 Evaluate 0 + 12 + 9 + -11. 10 What is 1 - (-28 + -9) - (11 - 2)? 29 What is -10 + -3 + 11 - 1? -3 What is the value of -1 - (-25 - (0 + -9))? 15 What is 0 + (-23 + 10 + 8 - (-3 - -26))? -28 Evaluate (0 + 2 - (-11 - (-4 + -4))) + 0. 5 Evaluate -11 + (-95 - -97) + -1 + 0. -10 Calculate -29 + -18 + 5 + 16. -26 What is -2 - -10 - (-60 - -71) - (-8 - 1)? 6 Calculate 4 - (12 - ((10 - 21 - -18) + -1)). -2 What is 27 + -37 + 23 + -24? -11 -2 + (1 - 2) - (32 - 35) - -11 11 Evaluate (558 - 571) + (1 - 10). -22 Evaluate -12 + 30 - 14 - (31 - (2 - 0)). -25 Evaluate (102 - 108) + -9 + 2. -13 What is 2 + -3 + 3 + (23 - 107 - -59)? -23 19 + 37 + -25 + -11 20 What is 10 + 27 + -23 + -31? -17 Evaluate -3 - ((-1 - -3) + 32 + -39). 2 What is 11 + 1 + -9 + 4? 7 -2 + 8 - (11 + -4) -1 Evaluate -12 - -2 - (-9 + (-1 - -24)) - -8. -16 (111 - 125) + -2 + 1 -15 (4 + -2 - 18) + (2 - 10) -24 What is 1 - 1 - (-18 + 8 + 5) - -8? 13 What is 4 - (-12 + 8 + 11 + (3 - 4))? -2 Evaluate 1 + (22 - ((-13 - -8) + 3 - 7)). 32 -47 + 15 + 32 + (-2 - 1) -3 -1 + (-5 - (4 - -1 - 2)) -9 What is 537 + -524 + (-28 - 0)? -15 Evaluate (-160 - -184) + 3 + -1. 26 What is (0 - 1) + 3 + (-9 - -12)? 5 0 - 4 - (15 + (-34 - -10)) - 1 4 Evaluate (-21 - -5) + 12 + 1. -3 What is the value of (-9 - (-27 + 6)) + (4 - 20)? -4 Calculate 24 - (-1 + -2 - (140 - 151)). 16 What is the value of (-20 - 0 - -2) + 453 + -440? -5 What is the value of (0 - 0) + 252 + -263? -11 Evaluate 30 + -46 + -5 - -36. 15 Evaluate (11 - (20 - (4 + 8))) + (-15 - -1). -11 30 - (76 + -5) - -17 -24 What is (-15 - 0) + 7 - (-16 + 3)? 5 Evaluate 5 + 6 + -4 + 1 + 0 + -11. -3 What is the value of (2 - 6) + -17 + 13? -8 Calculate (70 - 79) + 17 + 0. 8 What is -3 - (-1 + 1 - (23 - 20) - -10)? -10 Evaluate (-7 - 1 - (-3 - 0)) + (9 - -2). 6 Evaluate (2 - -19) + (31 + -23 + 18 - 19). 28 What is 14 - ((0 - -11) + 2 + -2)? 3 What is (1 - -10) + (6 + -12 - -6)? 11 Evaluate 18 + -22 + -3 + 17. 10 What is (-21 - (-24 + 14)) + 15 - (12 + 0)? -8 What is (-27 - -14) + 11 + (6 - 2) + 5? 7 Calculate -34 - -32 - -3 - -9. 10 Evaluate 2 + (2 + -2 + 8 + -2 - 5). 3 What is the value of -11 + 4 + -5 + (5 - -3)? -4 1 + -1 + 12 + -1 + 10 + -14 7 What is the value of (-3 + -2 - (7 + -12)) + (5 - -1)? 6 Evaluate (8 + -17 + 5 - (0 + 0)) + 0. -4 Evaluate 8 + 12 + (-30 - 3). -13 Evaluate 5 - (3 + (-3 - -8)). -3 What is -3 + 12 + 0 + 135 + -126? 18 What is the value of (16 - 13 - -2 - (7 + -1)) + -13? -14 What is 6 + (-1 - -43 - 15) + -16? 17 39 + 2 + (35 - 69) 7 What is 6 - (61 + -60 - (-15 + -1))? -11 What is the value of -13 + -27 + 7 + 34? 1 Evaluate 0 - (0 - ((-4 - -4 - 1) + -5)). -6 Calculate 1 + -7 + 39 + -40. -7 What is the value of 5 + (0 + -7 - -7)? 5 Evaluate 2 - 1 - -21 - ((-17 - -15) + 10). 14 7 + (12 + -5 + -14 - -3) 3 What is the value of 9 - (0 + -4 + -183 + 193)? 3 -136 + 132 - (3 + (3 - 1) + -3) -6 Evaluate (2 - 2 - 0) + (-11 - (-7 - 10)). 6 Calculate (-7 - -4) + (0 - 6) + 21 + -20. -8 Evaluate 3 + (-2 - -5) + (14 - 8 - 10). 2 What is 43 - 36 - (-3 + 14)? -4 What is the value of -6 + (-30 - (-22 - -1))? -15 Calculate 17 + (2 - (-21 + 20)). 20 What is the value of (7 - (4 - (8 - 16))) + 9? 4 Calculate 49 + 1 - (-4 + (21 - -1)). 32 Evaluate 21 - (24 + 12 - -12). -27 What is -3 + -1 + -2 + 0 - (113 + -107)? -12 (6 - (3 + -2 + 10)) + 2 -3 What is the value of (5 - 16 - -8) + 9? 6 (4 - (11 + 4 + -8)) + (2 - 1) -2 Evaluate (5 - 13) + 4 + -6 + 5. -5 What is (-1 + 1 - 0) + -7 + 13? 6 What is the value of 17 - (11 + -13) - 4? 15 -6 - (1 + 0) - (-6 + 9) -10 Calculate -3 + (-9 - -9) + (-4 - (-3 + 0)). -4 What is -3 - (15 - -4 - 14) - 2? -10 What is (-18 - -10 - 2) + 2 + -11? -19 -28 - 8 - (-8 - 49) 21 Calculate 2 + (-1 - (-1 + -1)) + 625 + -617. 11 What is -3 + -9 - -15 - (-3 - -3)? 3 What is the value of -39 + 80 + 17 + -53? 5 -25 - 5 - -42 - (-1 + 3) 10 -13 - -6 - 4 - (0 - 24) 13 Calculate 89 + -73 - (-1 - (-4 + 3)). 16 What is (4 - 1) + (9 + -5 - 0) + 3? 10 What is the value of (29 - 28) + -3 + 1 - (27 - 23)? -5 What is -16 + 13 + (-25 - -3)? -25 3 + (2 - 2) - -11 - 15 -1 Evaluate 13 + (5 - (9 + -4 - -2)). 11 Evaluate (13 - 7 - -2) + -17 - (-2 - -4). -11 What is -17 - (-2 + -2 + -12)? -1 Calculate -4 - (-256 + 262 - (12 - (-2 - -1))). 3 Calculate -14 - (23 + -17 - 25) - -27. 32 0 + 5 - (51 + -45 - (-2 - -4)) 1 -17 - -26 - -4 - (4 + -2 + -2) 13 What is 43 + (5 + 7 - 35)? 20 Calculate 7 + -15 + -4 + 4. -8 What is the value of -1 + 6 - (8 - 0) - -4? 1 What is the value of -6 + (3 - (4 - 7)) + -7? -7 Calculate 104 + -88 - (1 + 23). -8 What is -2 - -12 - (-6 + (-22 - -35))? 3 3 + (1 - 10) + (15 - 12 - 12) -15 Calculate -8 + (-8 - (-3 + 16 - 1) - 5). -33 What is -33 - (23 - (-30 - -78))? -8 Evaluate (-5 + 14 + -9 - 3) + 15 + -7. 5 What is 15 - (-83 + 81 - (0 + -10))? 7 What is the value of 11 + (18 - 4 - (3 + 8))? 14 Calculate 33 + (6 - 4 - (1 + 7)) - 8. 19 (-12 - -2) + (3 - -9) - (1 - -7) -6 -409 + 395 - ((-3 - -21) + 3) -35 What is 7 - (9 - (-7 + 8))? -1 Evaluate -1 - (13 + (10 - 16)). -8 Evaluate (-2 - -7) + (-21 + 5 - -8). -3 What is the value of (-10 - (-1 - -10)) + 5? -14 Calculate 9 + (5 - 17) + -2 + (-1 - -1). -5 Evaluate (-9 - (-23 + 2)) + (-27 - -2). -13 Calculate 9 + (-1 - 10) + 15 + -22. -9 Calculate 17 + -11 + -3 + 18 + 7. 28 Calculate 6 - (-2 - 2 - (139 + -134)). 15 Calculate 1 + 0 + -1 + 0	{ "pile_set_name": "DM Mathematics" }
ich is the third biggest value? (a) -1/22274 (b) -0.07 (c) -24 (d) -5 (e) -1 (f) 5 (g) 4 a What is the fourth smallest value in -5, 0.1, 5, 2110.752? 2110.752 Which is the third biggest value? (a) 96 (b) 0.057 (c) -3223 c Which is the third biggest value? (a) 0.005 (b) -124 (c) 0.386 b What is the second biggest value in -6/7, 428612, 0.7? 0.7 What is the smallest value in -144873, 3/7, -14, -0.1? -144873 What is the fifth smallest value in 0.01, -0.064904, -28, 0.4, -0.2? 0.4 What is the second biggest value in 223, -2/9, 0.088, -0.4, -1.2, -82? 0.088 Which is the fifth biggest value? (a) 0 (b) 3.922 (c) -6/5 (d) 1 (e) 0.4 (f) -2/5 f Which is the second biggest value? (a) 3028/5 (b) 0 (c) -1433 b Which is the second smallest value? (a) 18 (b) -173 (c) 3 (d) 2/7 (e) -10/7 e What is the third smallest value in 353, 0.5, -8.47, -9, -4/5? -4/5 Which is the biggest value? (a) 0.1 (b) -5561/327 (c) 0 (d) 1 d What is the second smallest value in -3, 47.6, -1/3, -0.5, -4, 448? -3 Which is the fourth biggest value? (a) -22 (b) -170 (c) -648 (d) 0 (e) 4 (f) 0.1 a What is the sixth smallest value in 1.7, 12, 2, 0.0373, -1, -1/4, 0.4? 2 Which is the third smallest value? (a) 10 (b) -0.6 (c) 0 (d) -7 (e) 4 (f) 69 c What is the third smallest value in 10, 57, -0.1, 43.5? 43.5 What is the sixth biggest value in -2/7, 4/7, 5/4, 32, 1, 0.64, 2? 4/7 Which is the third biggest value? (a) -5/2 (b) -18 (c) 23982 b What is the sixth biggest value in -496, -4/3, 3, 0.3, -2/3, 6/65? -496 What is the fifth biggest value in 1/3, -23, -4, 3, -247, 2/17? -23 Which is the smallest value? (a) -0.13 (b) -1/38 (c) 18 (d) 369 a Which is the biggest value? (a) -7 (b) 0.4569 (c) -0.01 (d) -2 (e) 2 e Which is the smallest value? (a) -2 (b) -47/14 (c) 3/8 (d) -1.7 (e) -6 (f) 2/3 (g) 0.5 e What is the fourth smallest value in 3, 9356, -0.03, -1? 9356 Which is the second smallest value? (a) 470 (b) 2/25 (c) 6 (d) -14/3 b Which is the third smallest value? (a) 7 (b) 0.281639 (c) -5 (d) 0.5 d Which is the third smallest value? (a) -12 (b) 3 (c) 5 (d) -0.048 (e) 2 (f) 1.1 f What is the fifth smallest value in -156, -0.2, 5, 1, 2? 5 What is the smallest value in 15, -4/7, 1/12, -2/3, 2077, 2.52? -2/3 Which is the smallest value? (a) -0.3 (b) 1/5 (c) -32 (d) 0.5 (e) -5 (f) -382.6 f What is the third smallest value in 0.005, -10/597, 4, 1/17, -0.2? 0.005 Which is the third smallest value? (a) 0.17 (b) -30 (c) 2/11 (d) 3196 c What is the second biggest value in -359.3, 2/217, -2? -2 Which is the seventh biggest value? (a) 0.0283 (b) -4 (c) -2.6 (d) 5 (e) 4 (f) -3 (g) -2 b What is the smallest value in 0.2, 12, 545, -0.5, 0.08? -0.5 Which is the smallest value? (a) -2/9 (b) 7/4 (c) -4 (d) -3 (e) 1 (f) -1/2 (g) -309 g What is the fourth smallest value in -4, -3/5119, 0.5, -1/1474? 0.5 What is the third smallest value in 4, 1/40, 3/4, 39.01? 4 What is the fourth biggest value in -2, 322, 2/9, -317, 0.1, -0.4, 4? 0.1 What is the second smallest value in -1597, 2/339, -6? -6 Which is the second biggest value? (a) -0.027 (b) -2 (c) -1563 (d) -44 b Which is the third smallest value? (a) 1 (b) -7979 (c) 27 (d) 9 d Which is the fourth biggest value? (a) 24 (b) -40 (c) 31 (d) 1/33 b Which is the fifth smallest value? (a) 14 (b) 1 (c) 134/13 (d) -2/5 (e) 5 a What is the fourth biggest value in -5, 15837269, 5, -4? -5 What is the fourth smallest value in -2/15, -0.3, -2/29, 2/11, -4, 0, 0.9? -2/29 What is the smallest value in 3, 17744, -71, 1, 1/2? -71 What is the second smallest value in -0.2993772, -2/3, 2/5? -0.2993772 What is the fifth biggest value in 0.3, -2, 1, 17118, 0.05? -2 Which is the fourth smallest value? (a) -101 (b) -2 (c) 148 (d) 36 (e) 1/6 (f) -10 (g) -3 b What is the biggest value in 1, 0.4, -0.4, -11.599, -8, -3/4? 1 What is the biggest value in -2.4, 1, -2, -3/2, -388, 5? 5 Which is the second smallest value? (a) 1597 (b) 2 (c) -2 (d) 4 (e) 11 (f) 4/3 f Which is the third smallest value? (a) -3/7 (b) 0.02 (c) 180 (d) 313 (e) -1/7 b What is the fourth smallest value in -0.07, -2/11, -3.5566, 0? 0 What is the smallest value in -1510, 1/58, -10, 0.1, -1/9, -2/9? -1510 Which is the third smallest value? (a) 16.3 (b) -27 (c) -2.9 (d) 2/13 (e) 3 (f) 5 (g) -3/5 g What is the third biggest value in -1/2, 0.4, 38094130, -5? -1/2 What is the fourth smallest value in 2, 47, 0.1, -1/10, 5, -75? 2 Which is the smallest value? (a) -14 (b) 34 (c) -4 (d) 1/5 (e) 0.086 (f) 1.5 (g) -1 a Which is the third smallest value? (a) -0.5 (b) 0.04089 (c) -0.4 (d) -4 (e) -3 a Which is the third smallest value? (a) 523 (b) -30816 (c) 0.07 a Which is the third smallest value? (a) -1/9 (b) 2 (c) -0.07 (d) -1514 (e) -7/4 a Which is the sixth biggest value? (a) 598/5 (b) 0 (c) 2/15 (d) -5 (e) 2/53 (f) -4 (g) -31 d Which is the third biggest value? (a) -0.2 (b) 0.069 (c) 4/5 (d) -103 (e) 27.3 b What is the fourth biggest value in 0.3, 1, -331, -0.00283? -331 What is the fourth biggest value in 47, 5, -4, -0.0343895? -4 Which is the fourth smallest value? (a) -2 (b) -0.107 (c) 0.4 (d) -5 (e) 327 (f) 15 c Which is the seventh biggest value? (a) -4/3 (b) -0.51 (c) -2 (d) -456 (e) 1/5 (f) -4 (g) 5 d Which is the smallest value? (a) -2/3 (b) 28 (c) -3 (d) -1050 d What is the fourth biggest value in -1, -2.3029, 2/11, 628, 2/9? -1 Which is the second biggest value? (a) -38 (b) -2 (c) 1/546 (d) -0.3 (e) -3/5 (f) -3 (g) 4 c What is the biggest value in -96825, -1.1, 0.8? 0.8 Which is the seventh biggest value? (a) 31 (b) -4 (c) 0 (d) 1/2 (e) 25 (f) -0.3 (g) -82 g Which is the fourth biggest value? (a) 228.19 (b) -0.2 (c) 0 (d) -3/7 (e) -0.4 e Which is the second biggest value? (a) 0.4 (b) 1/3 (c) 1678/13 (d) -0.94 (e) 7 e What is the seventh smallest value in -3/5, -2/37, -2/3, -5, 0.3, 0.94, 1/9? 0.94 Which is the second smallest value? (a) 1/19 (b) 1/6411 (c) 0.1 (d) 0 (e) 34 b Which is the second smallest value? (a) -0.3 (b) -475 (c) -0.5 (d) 12 (e) 1 (f) 19 (g) 2 c Which is the fourth biggest value? (a) 0.007 (b) 5 (c) -5/41 (d) -0.2 (e) -0.06 c Which is the smallest value? (a) -10 (b) 24 (c) 2/11 (d) -1 (e) -4 (f) -3/2 a What is the smallest value in 0.5, -4, -780460, 2/11? -780460 What is the fifth smallest value in 0.27, -0.166, -3, -12, -2/5? 0.27 Which is the second smallest value? (a) -8300 (b) -182 (c) 0.3 b What is the fourth smallest value in -13, 9/8, 3.994, -1/3, 2? 2 Which is the second smallest value? (a) -53 (b) 0.1 (c) 1 (d) 6 (e) -2 (f) 28 (g) -3/2 e Which is the third smallest value? (a) 2100703 (b) 35 (c) -2/3 (d) 1 b What is the third smallest value in 0.2, 4, -6/5, -8, 1, 5, -2/13361? -2/13361 Which is the smallest value? (a) 1/6757 (b) -4 (c) -17147 c Which is the seventh smallest value? (a) -20 (b) 0 (c) -3 (d) -2 (e) -2974/7 (f) 0.3 (g) -0.1 f What is the sixth smallest value in -0.023, -6, 2/3, -1/2, -4, -0.07? 2/3 Which is the biggest value? (a) -0.00726 (b) 35 (c) -275 b Which is the fifth smallest value? (a) 0.5 (b) 0.1 (c) 76 (d) 140 (e) 0.2 (f) 1/6 (g) 17 g What is the fifth smallest value in 4, -12/17, -0.07, -0.5, 0.016, 10/19? 10/19 What is the third smallest value in -819, 4, 2621? 2621 What is the third smallest value in -2.3, -5, -10251, 1? -2.3 Which is the third smallest value? (a) 73/16 (b) -2 (c) 0.33 (d) -2/5 c Which is the second biggest value? (a) 0.1 (b) -1698289 (c) -16 c Which is the smallest value? (a) -1 (b) 0.2169 (c) 43 (d) 52 a What is the third biggest value in 11, -1.82, 4, 0.32, 0.4, 3? 3 What is the second biggest value in 4567, 4, -3/94, -2/15? 4 Which is the second biggest value? (a) -0.56 (b) -34/5 (c) -3/7 (d) -10 (e) 0 (f) -1/2 (g) -2/3 c What is the seventh smallest value in 2/7, 0.5, -2, -7155, 1.83, 4, 0.4? 4 Which is the second biggest value? (a) -3 (b) 5 (c) 897/10 (d) -0.36 (e) -5 b What is the third smallest value in 0, -125/6, -278, -2/9? -2/9 Which is the third smallest value? (a) -10 (b) -395/11 (c) 1/7 (d) 4 (e) 3 (f) 16 (g) 1/4 c What is the se	{ "pile_set_name": "DM Mathematics" }
5 Expand (-2l + 0l + 3l + (0l + 0l - 2l)(2 - 1 + 1))(-3l + 5l + 0l) + 1 - 1 + 2l2 + (3 - 4 + 0)(4l2 + 3l*2 - 6l*2). -5l*2 Expand (0 - 5 + 1 - 2 + 6 - 3 + (5 - 2 - 2)(-1 - 3 + 6) - 3 + 2 + 0)(h + 0h + h). -4h Expand (1 + 2 - 5)(0u3 - u3 + 0u*3) + 2u3 + u3 - u*3 + (0u*2 + 0u*2 - 3u*2)(-2u + 0u + u). 7u3 Expand (3 - 3 + 2i + i - 3i + 0i + (0 + 1 + 1)(-i + 2i - 2i))(i2 + i3 - i*2). -2i*4 Expand (0t + 0t + 3t*3)(-4 - 6 + 2 + (0 - 1 + 2)(-1 - 3 + 3) + 1 + 1 - 3) - 3t*2 + 3t2 + t3. -29t3 Expand (2i*3 - 2i*3 - 4i*3)(2 - 1 + 1)(-3 - 3 + 5). 8i3 Expand q2 + 0q2 - 3q*2 + (44 - 44 - 3q)(-4q + 4q - q). q2 Expand (-3t + 3t - t)(3t3 - 3t3 - t4) - 7 - 8t5 + 7. -7t*5 Expand (0w*2 + 0w2 + w3)((5 - 5 - 2w)(w + w + 0w) + 4w2 - 3w*2 + 0w*2 + w - w - 3w*2) + 2w*5 + 6w*3 - 6w*3. -4w5 Expand (-n2 + 2n2 - 3n*2)(-3n2 + 3n2 + n2) - 1203n + 1188n - 2n4 + n4. -3n*4 - 15n Expand ((2y - y + y)(2y + 3y - 4y) + y2 - 4y*2 + 0y*2)(0y2 - y + 4y*2 - 6y*2). 2y4 + y3 Expand 5 - 4 - 6p + 3p - p + 4p - 5p - 2p - 4p + 4p + 2p + 1 - 1 + (5 - 4 - 2)(-4p + 5p - 3p) - 3p + 5p - 3p + 3 - 3 + 2p. -2p + 1 Expand (w3 + 2w - 2w)(-w + w - 2w) + 16w*4 - 3w*4 + 1 + 0. 11w*4 + 1 Expand (0m*2 + 4m*2 - 3m*2)(2m + 2m - 5m) + 2m*2 + 3m*3 - 2m*2. 2m*3 Expand 2 + 2 - 2 - 2u + (3u - u - u)(3 + 0 - 5) - 3u - u + 11u + (3u + u - 3u)(1 + 1 + 0). 5u + 2 Expand (a*3 - 3a3 - a3)(1 + 0 + 1 + a2). -3a*5 - 6a*3 Expand (2d - d + 0d)(6d + 4d + 0d) + (-d + 0d + 0d)(-2d + 0 + 0). 12d*2 Expand (6n - n - 3n)(-40 - 6n + 3n + 5n). 4n*2 - 80n Expand (-5k - 5k - 7k)(-3k2 + 4 + 2k*2 - 3). 17k*3 - 17k Expand (o - 3o + 4o)(0o*2 + 4o*2 - 2o*2) - 4o - 2o3 + 4o + (o - o - o)(-5o*2 - 5 + 4o*2 + 2). 3o*3 + 3o Expand (1 - 1 - 2)(1662 + 41i - 1662). -82i Expand (-15w*3 + 15w*3 - 9w*4)(2 - 2 + w)(1 + 0 + 0). -9w*5 Expand (-3 - 1 + 5)(-h*2 + 2h2 + h2)(2 - 2h*3 - 2) - 3h*5 + 11h*5 + 0h*5. 4h5 Expand (z4 + 0z3 + 0z*3 + 0z*4 + 3z*4 - 5z*4 + (0z + 0z + 2z*4)(-1 - 3 + 6))(3 + 2 - 2). 9z*4 Expand (0g + g - 2g)(-2g + g + 0g) + 2g + 2g*2 - 2g + 2g2 - 2g2 + g2 + 0g2 - 3g2 + g2 + (7g - 4g - g)(2g + 3g - 4g). 4g2 Expand -t + 2t + 0t + (1 - 1 + 4t)(5 - 5 - 2) + 1 - 1 - 2t - 3t - 4t + 10t. -6t Expand ((1 + 1 - 4)(2 - 1 - 3) + 3 - 3 - 1 + 0 - 4 + 2)(3f - 5f + f). -f Expand (3k + k + 0k)(k + 3k - 2k). 8k*2 Expand (-31t*2 + 23 - 23)(2t - 2t - t). 31t3 Expand -202o - 195o + 338o + (o + o - 4o)(0 - 4 + 2). -55o Expand 4i4 - i4 - 5i4 + (2i*3 - 4i3 - i3)(i - i + 2i). -8i4 Expand (-9 + 9 + 4a*2 + (-5a - a + 4a)(-3 + a + 3))(0a*2 - 4a*2 + 5a*2). 2a*4 Expand (0s2 + s2 + s*2)(-2 - 5 + 3)(-2s*3 + 2s3 + s3). -8s5 Expand (18o - 33o + 2 + 12o)(-2o + o - o). 6o2 - 4o Expand (1 + 1 - 1)(2 - x3 - 2)(8x2 + 0x*2 - 2x*2). -6x*5 Expand (2k - k - 2k + k + 4k - 4k + (0k + 2k - k)(1 - 1 + 2))(-4 + 3 + 9). 16k Expand (z*3 - 5z*3 + 6z*3)(z - 2 + 2) + (3z2 - 4z + 4z)(-4 + 3z2 + 4). 11z*4 Expand (-2 - 2 + 2)(-2k4 - 7k4 + k3 - 4k4). 26k*4 - 2k*3 Expand (4f + f - 4 - 3f)(-6f - 3f + 4f - 1). -10f*2 + 18f + 4 Expand (42 - 27 - 44)(2i + i - 2i). -29i Expand (6h - 4h - h)(-h + h + h2) + 3h*3 - 3h*3 + 2h*3 + (7h*2 - 5h*2 + 4h*2)(-4h - h + 1 + 4h). -3h3 + 6h*2 Expand (0 + 3m + 2 - 2m)(-6m2 + 0 + 11m*2 - 1). 5m*3 + 10m*2 - m - 2 Expand (-4f + 11f - 8f)(-f + f - 5f*2). 5f*3 Expand -2z*3 + 4z*3 + 0z*3 + 13 + 8z*3 - 13 + (-2z + z - z)(z2 - z2 + 2z*2) - 5z*3 + 3z*3 + 3z*3 - 2z*3 - 2z*3 + 3z*3. 6z*3 Expand (0v*3 + 2v - 3v3 - v)(-v*2 - 2v*2 + 5v*2). -6v*5 + 2v*3 Expand (3 + o - 3)(-4o - 5o + 4o)(-2 + 2 - 2). 10o2 Expand (-1 - l2 + 1)(6l - 3l - 2l) + (2l*2 - 2l2 + l2)(4 - l - 4) + (-l2 + l3 + l2)(-5 + 0 + 3) - 3l3 - 4l*3 + 5l*3. -6l*3 Expand (x + 2x*2 - x)(2x - 3x - x) + (-x2 + x2 - x*2)(5x - 6 + 6). -9x*3 Expand (0 + 1 + 1)(-4 + 1 + 2)(17p*3 - 7p*2 + 7p*2). -34p*3 Expand (-3u*2 + 3u*2 - 2u*3)(8 - 2 + 10). -32u3 Expand ((-f3 + 4f*3 - 4f*3)(-f - 2f + 4f) + 9f4 - 8f*4 - 4f*4)(-f + f + f) + f5 - f3 + f*3. -3f*5 Expand -f + 2f + 0f + (-f - f + f)(-1 - 2 - 1) + 2 - 2 - 2f + f - f + f + (1 - 4 + 1)(3f - 2f - 2f) + 0 - 3f + 0. 3f Expand (-2z*2 - 3 + 3)(7 - 3 + 1) + 6z2 - 2z*2 - 2z2 - z2 - z*2 + 0z*2 - 4z2 - z2 + 3z2 - 6z*2 + 3z*2 + 2z*2. -13z*2 Expand (0 - 3 + 1)(2 + 2 - 5)(5p - 2p - p). 4p Expand (b*2 + 0b*2 + 0b*2)(b + 0b + 0b) + b*3 - 4b3 - b3 + 0 + 0 - 2b3. -5b*3 Expand (-5 + 5 - 19)(-6q4 + 3q4 + q4) + 3q4 - 5q*4 + 0q*4. 36q4 Expand i5 - 4i5 + 4i*5 + (4i*2 + 0i*2 - 2i*2)(-2i3 + i - i) - 4i*5 + 3i*5 - 2i5 - i2 + 0i2 + 2i*2 - 2i*5. -8i5 + i2 Expand 0o + 3o + o + (0o + o - 2o)(-5 + 4 + 2) - 1 + 1 + 5o. 8o Expand 0b + 0b - b3 + (-b2 + 0b2 - b2 + (-4b + 0b + 2b)(1 + b - 1) + 4b - b2 - 4b)(-4 + 2 + 0)(-2b - 2b + 0b). -41b*3 Expand (-4 + 2q*2 + 4)(3q - 2q + q + (-q + 2q - 2q)(-1 + 0 - 1)). 8q*3 Expand (q - q + 2q*2)(0 + 0 + q) + q*3 - 2q*3 + 13q*3. 14q3 Expand 5 + v2 - 5 + (-45v - 3v*2 + 45v)(-2 - 3 + 6) - v2 - v2 - 2v*2. -6v*2 Expand (3v - 3v - 2v)(-2v*4 + 4v4 - v4). -2v5 Expand -1216 + 1216 + 6l + (-5l + 5l - 2l)(0 - 4 + 3). 8l Expand (0m + 0m - m)(m2 + m2 - m2) - m3 + 4 - 5m3 + 5m*3 + (-2m - m + m)(5m*2 - 3m*2 + 0m*2) + 0m*2 + 0m*2 - 2m*3. -8m3 + 4 Expand (k2 + 0k2 + 2k*2)(24 - 24 - 6k2). -18k4 Expand (-l3 + 0l3 - l3)(10 + l - 10) + 0l4 - 2l*4 + 3l*4 + 2l*4 - 7l*4 + 3l4 + l4 - 5l4 + l4. -6l*4 Expand j - j - 5j + (-2 - 2j + 2)(-3 + 0 + 2) + 3 - 4j - 3. -7j Expand -s2 + s2 + s*2 + (0 + 0 + 1)(-s*2 - 3s + 3s) + s2 + s2 + 0s*2 + 2s*2 - 3s*2 - 2s2. -s2 Expand (563 + 20y - 563)(-4y2 - 3y*2 + 6y*2 - 2y). -20y3 - 40y*2 Expand (1 - 2 + 4)(-6z5 + 0z*5 + 3z*5 + (-2z + z - z)(-z4 - z3 + z3)). -3z*5 Expand 3 + 5m - 3 + (-4 + 3 + 3)(9m + 2m + m). 29m Expand (-26t + 4t + 12t)(2t3 + 0t*3 - 3t*3). 10t*4 Expand (-4 + 4 - 2c)(-5c + 12 - 12)(-c - 3c + 6c)(4c - 3c*2 - 4c). -60c5 Expand (4 - 3 + 2)(-4p + 4p - p)(2p - p - 3p)(0p + p - 4p). -18p3 Expand (-26r + 29r + r3 + 2r*2 - 2r*3)(4r2 - 2r*2 - 4r*2). 2r*5 - 4r*4 - 6r*3 Expand 0l + 0l + l2 + (0l*2 - 4l*2 + 3l*2)(-1 - 3 + 2) + (8 + 2 - 5)(-2l*2 + 0l*2 - 3l*2). -22l*2 Expand (0 - m + 0)(68 - 68 - 6m2) + 4m*3 + 0m*3 - 5m*3. 5m*3 Expand (2s - 2 + 2)(10s + 2 - 6 - 13s). -6s*2 - 8s Expand (-c - 6c + 2c)(2 - 2 + 1 - 5c). 25c2 - 5c Expand -3v2 - 2v*4 + 3v*2 + (-4 - 26v + 4)(-3v*3 + 3v3 + v3) + (3v - 5v + 0v)(0v2 + 2v*3 + 0v*2). -32v*4 Expand 38i*4 - 76i*4 - 84i*4 + (-2i + 1 - 1)(2i*3 - 2i3 - i3). -120i4 Expand (3o - 5o + o)(0 + o + 0)(375 - 80o - 375). 80o3 Expand (4 + 14 - 16)(-p*2 + 2p*2 + 2p*2). 6p2 Expand (-g3 + g*3 + 2g*3)(-2 - g*2 + 0g*2 + 0). -2g*5 - 4g*3 Expand 26x + 16 - 16 + (2x + 3 - 3)(-1 - 1 + 0). 22x Expand -4c*3 + 2c*3 + 3c*3 + (2c2 - c2 + c*2)(-c + 3c + c) + (0c - 4c - 2c)(c - c - 2c*2). 19c*3 Expand 2d*2 + 2d - 2d + (-d + d + d)(4d - 2d - 5d) + (d2 + 53d - 53d)(3 - 2 + 1). d*2 Expand (-2g + 2g - g)(4g2 - 3g*3 - 2g*2 + 7g*3). -4g*4 - 2g*3 Expand (12s - 3s - 4s)(3 - 2s - 3). -10s2 Expand (5z*3 - 4z*3 + 0z*3)(-26z - 17z - 27z + 15z). -55z4 Expand (1 - 1 - 2l)(3l2 + l3 - 3l2) - l4 + 4l**4	{ "pile_set_name": "DM Mathematics" }
hen two letters picked without replacement from {w: 2, k: 1}. 1/3 What is prob of picking 1 j and 2 y when three letters picked without replacement from {y: 6, j: 7}? 105/286 What is prob of picking 2 o when two letters picked without replacement from {p: 3, q: 2, o: 10}? 3/7 Four letters picked without replacement from {x: 5, g: 7}. What is prob of picking 3 x and 1 g? 14/99 Two letters picked without replacement from wjssjwufwj. Give prob of picking 1 s and 1 f. 2/45 Four letters picked without replacement from {c: 4, u: 14}. Give prob of picking 4 u. 1001/3060 What is prob of picking 1 r, 1 g, and 1 w when three letters picked without replacement from {w: 3, r: 4, g: 4}? 16/55 Three letters picked without replacement from rssv. Give prob of picking 2 s and 1 r. 1/4 What is prob of picking 1 x, 2 s, and 1 c when four letters picked without replacement from cszxu? 0 What is prob of picking 3 t and 1 x when four letters picked without replacement from xrrtgxgrrttrt? 8/715 What is prob of picking 2 t and 1 d when three letters picked without replacement from qtztqqzqzbddbtqqwz? 1/136 What is prob of picking 3 v and 1 j when four letters picked without replacement from {v: 5, t: 5, j: 4}? 40/1001 Calculate prob of picking 1 w and 1 j when two letters picked without replacement from jwjwjjjwjjjjww. 45/91 Four letters picked without replacement from {o: 2, i: 2, j: 7, h: 1}. Give prob of picking 1 h, 1 o, and 2 j. 14/165 Calculate prob of picking 1 y, 1 s, and 2 r when four letters picked without replacement from {s: 2, n: 8, r: 3, y: 3}. 9/910 What is prob of picking 2 p when two letters picked without replacement from {p: 10}? 1 Two letters picked without replacement from rcpcpccwcpwwcccrcc. Give prob of picking 1 w and 1 p. 1/17 Three letters picked without replacement from igigigigggigiiggggg. What is prob of picking 1 i and 2 g? 154/323 Calculate prob of picking 1 r and 2 f when three letters picked without replacement from iiiirffirii. 2/165 What is prob of picking 3 b when three letters picked without replacement from {b: 7}? 1 What is prob of picking 1 o, 2 x, and 1 q when four letters picked without replacement from qxqoqzxlzzz? 1/110 Two letters picked without replacement from {w: 2, o: 2}. Give prob of picking 2 o. 1/6 Two letters picked without replacement from btmmccamqqbm. What is prob of picking 1 c and 1 a? 1/33 Two letters picked without replacement from {l: 2, k: 1, r: 2, h: 1}. Give prob of picking 1 r and 1 k. 2/15 Two letters picked without replacement from jhaajhhajhhjaa. What is prob of picking 2 j? 6/91 What is prob of picking 3 d and 1 h when four letters picked without replacement from ooobhhhdhoddduzodddh? 35/969 Calculate prob of picking 2 a, 1 n, and 1 l when four letters picked without replacement from lalallallan. 6/55 Four letters picked without replacement from {f: 2, l: 1, n: 4, b: 1, z: 1}. Give prob of picking 2 f, 1 l, and 1 n. 2/63 Two letters picked without replacement from {b: 1, m: 2, o: 5, h: 1, c: 3, d: 1}. Give prob of picking 1 m and 1 c. 1/13 Two letters picked without replacement from smmmszsmissasimsm. What is prob of picking 1 a and 1 s? 7/136 Calculate prob of picking 1 v and 1 h when two letters picked without replacement from {v: 4, h: 1, w: 1, c: 2, q: 3}. 4/55 Calculate prob of picking 2 h when two letters picked without replacement from {z: 1, f: 3, i: 4, h: 4, u: 1}. 1/13 What is prob of picking 2 d when two letters picked without replacement from {a: 3, n: 9, d: 4}? 1/20 Calculate prob of picking 2 z and 1 r when three letters picked without replacement from {j: 4, x: 4, m: 2, d: 3, z: 3, r: 1}. 3/680 Calculate prob of picking 1 q and 1 j when two letters picked without replacement from qqqqjqqqqqqhqqlqj. 13/68 What is prob of picking 2 z, 1 g, and 1 f when four letters picked without replacement from zfezeggfwegegfge? 3/364 What is prob of picking 1 d and 2 o when three letters picked without replacement from wdiiono? 1/35 Three letters picked without replacement from {v: 2, z: 8, x: 2, r: 2, t: 2, e: 1}. Give prob of picking 2 z and 1 v. 7/85 Four letters picked without replacement from cqqjcjcc. Give prob of picking 1 j, 1 c, and 2 q. 4/35 What is prob of picking 1 i, 1 m, and 1 y when three letters picked without replacement from {k: 2, m: 2, q: 2, y: 2, i: 5}? 10/143 Two letters picked without replacement from uoguouoouuuuouo. Give prob of picking 1 o and 1 u. 16/35 Two letters picked without replacement from {q: 2, d: 9, p: 4, f: 1, s: 1}. What is prob of picking 2 q? 1/136 Two letters picked without replacement from oovv. What is prob of picking 2 o? 1/6 What is prob of picking 2 p, 1 e, and 1 u when four letters picked without replacement from {e: 4, u: 7, v: 4, m: 1, p: 4}? 56/1615 What is prob of picking 1 k and 2 q when three letters picked without replacement from ktktywgkkqqyyky? 1/91 Four letters picked without replacement from {q: 2, r: 1, w: 2, l: 3, j: 7, g: 5}. Give prob of picking 1 g, 2 r, and 1 j. 0 Three letters picked without replacement from seseregresesseee. What is prob of picking 1 e and 2 r? 1/70 What is prob of picking 2 i and 1 m when three letters picked without replacement from {z: 1, b: 2, m: 3, k: 1, d: 1, i: 4}? 9/110 Calculate prob of picking 2 p when two letters picked without replacement from {p: 7}. 1 Two letters picked without replacement from {u: 11, j: 5}. Give prob of picking 2 j. 1/12 Calculate prob of picking 2 c when two letters picked without replacement from {c: 3, d: 1, z: 1, b: 2, f: 3}. 1/15 What is prob of picking 1 c, 1 m, and 1 d when three letters picked without replacement from {p: 2, m: 1, c: 4, d: 1}? 1/14 What is prob of picking 1 d, 2 t, and 1 i when four letters picked without replacement from {h: 8, t: 7, i: 1, d: 2}? 7/510 What is prob of picking 1 r, 1 i, and 1 q when three letters picked without replacement from qqqrqrrqqeji? 9/110 Four letters picked without replacement from {d: 4, v: 10}. What is prob of picking 2 d and 2 v? 270/1001 What is prob of picking 3 h when three letters picked without replacement from {h: 7, d: 6}? 35/286 What is prob of picking 1 s and 1 k when two letters picked without replacement from {g: 1, k: 5, a: 5, s: 4}? 4/21 What is prob of picking 2 n when two letters picked without replacement from {q: 2, r: 2, n: 3, m: 2}? 1/12 What is prob of picking 2 i and 1 z when three letters picked without replacement from {e: 8, i: 6, z: 3}? 9/136 Four letters picked without replacement from {o: 6}. Give prob of picking 4 o. 1 What is prob of picking 3 m and 1 b when four letters picked without replacement from mmbmbbmbbbmbbbbbbb? 13/306 What is prob of picking 3 a when three letters picked without replacement from {y: 1, m: 2, a: 3, x: 4}? 1/120 Three letters picked without replacement from fggllglgf. Give prob of picking 1 g and 2 f. 1/21 What is prob of picking 2 u when two letters picked without replacement from {u: 3, f: 9, z: 2, j: 3}? 3/136 Three letters picked without replacement from dwwwdmdmddwdwd. Give prob of picking 1 m and 2 d. 3/26 Two letters picked without replacement from {n: 3, x: 1, w: 6, f: 1, z: 4}. What is prob of picking 1 w and 1 n? 6/35 What is prob of picking 3 a and 1 e when four letters picked without replacement from {e: 4, a: 6, o: 7}? 4/119 What is prob of picking 1 r and 2 x when three letters picked without replacement from {r: 2, x: 5}? 4/7 Three letters picked without replacement from oazsupazazus. What is prob of picking 1 p and 2 s? 1/220 Calculate prob of picking 2 b and 2 v when four letters picked without replacement from {v: 2, b: 6}. 3/14 What is prob of picking 2 s and 1 a when three letters picked without replacement from {s: 2, a: 3}? 3/10 What is prob of picking 3 r and 1 z when four letters picked without replacement from {z: 10, r: 9}? 70/323 Three letters picked without replacement from {k: 1, p: 4, g: 1, o: 1, u: 1}. Give prob of picking 1 o and 2 p. 3/28 Two letters picked without replacement from rfrwrwffufurxfk. Give prob of picking 1 k and 1 u. 2/105 Four letters picked without replacement from iiisnisiiqyinnsiiiq. What is prob of picking 3 i and 1 n? 30/323 Two letters picked without replacement from {f: 1, z: 7, i: 1, q: 5}. What is prob of picking 1	{ "pile_set_name": "DM Mathematics" }
r*4 + yr and give f. -4 Express 0 + 2u2 - 7 + 14u + 3 - 8u + 5 in the form z + ku + hu2 and give z. 1 Express -3s*2 - 2s + 2s2 - 2 + 2s as ts2 + i + vs and give i. -2 Rearrange (-a*2 - a + a)(2 - 2 - 6) + a - 135a2 - 12883 + 12883 + (-a2 + 1 - 1)(2 - 4 + 1) + a*2 + 2 - 2 to the form w + ta*2 + fa and give t. -127 Rearrange 9h + 2h*2 - 3h*2 - 3h + 1 - 43h - 4h to u + vh + wh*2 and give u. 1 Express (1 + 0 + 1 + (6 - 5 + 1)(1 + 4 - 3) + 3 + 3 + 0)(0 + 0 + 2)(0z - z + 0z) in the form t + bz and give b. -24 Rearrange 29t*3 + 41t*3 + 2t2 + 37 - t2 + 15t3 - 39 to kt + jt3 + yt*2 + h and give h. -2 Rearrange 19r*2 - 3r + 2 + 2r + 2003r*4 - 2004r*4 to z + tr*3 + pr + br2 + ir*4 and give i. -1 Express -30g + 65g + 78g in the form d + jg and give j. 113 Rearrange (-9 - 13m + 9)(13 - 2 + 7) + (0 + 0 - 2)(-m - 5m + 10m) + (-4 + 1 + 2)(2 - 2 + 2m) to the form l + om and give o. -244 Rearrange -61073 + 61073 + 6o*3 - 8o - 2o2 to the form m + no*3 + zo*2 + wo and give w. -8 Rearrange -1857a3 + 6 - 7a*2 + 1852a*3 - 23a*2 - 5 to ua*3 + b + ra + ma2 and give m. -30 Rearrange o3 + o3 - 11 - 101 + o - o4 - 3o - o*4 to the form bo*3 + l + ko*4 + io + zo2 and give l. -112 Express -2m*4 - 5627m*3 - 3 + 5628m*3 - 14m + 5m4 in the form wm + hm2 + t + bm*3 + rm*4 and give r. 3 Rearrange 512b - 279b + 1248b to gb + x and give x. 0 Express -3k2 - k3 - 5152 - 3k3 + 2k + 5152 as rk + fk*2 + yk*3 + d and give r. 2 Express -2x*3 - 18850x*2 - 14x + 2x4 + 18851x*2 + 3x in the form nx2 + wx*3 + j + mx*4 + dx and give w. -2 Rearrange -4w2 + w4 + 2173 - 3w + w*3 + 2w - 2185 to the form sw + dw*4 + a + zw*3 + cw*2 and give a. -12 Express -b + 21b*4 + 6b - 4b - 51b*4 - 2b3 + b2 + 1 in the form h + db2 + nb*3 + jb*4 + fb and give h. 1 Express 2f2 + 15f*3 - 39f*3 + 0 + 10f*4 + 12f*3 + 9f*3 - 4f - 2 as yf2 + gf*3 + jf + pf4 + w and give p. 10 Express 4 - 241x - 20 + 16 as fx + c and give f. -241 Rearrange 276f*2 - 9f - 274f2 + 166f to af + tf*2 + n and give t. 2 Express 12t2 - t4 + 6 + 12t2 - 21t2 - 4 - t3 - 2t as bt*3 + x + rt + kt2 + yt*4 and give b. -1 Express -25y*2 + 0y3 + 1 + y4 + 26y2 - 6y*3 as ay*2 + qy + l + by3 + sy*4 and give b. -6 Rearrange 4t*2 - 13 + 20 + 3t - 1 to the form x + gt2 + ct and give g. 4 Express 3w2 + w2 - 3w*2 + ((w + w - w)(3 + 17 + 7) + (1 + 2 - 1)(w - 4 + 4))(9 - 2w - 9) in the form jw*2 + uw + h and give j. -57 Express -2x4 - 3x*3 + 7927 - 7947 + 4x*3 + x in the form dx*2 + fx*3 + z + kx*4 + tx and give z. -20 Rearrange (-2y2 - 8y*3 + 10y*3 + 2 + 11y*2)(4y + 4 - 4) to the form ly*3 + iy*4 + ay + t + hy2 and give l. 36 Express (-3p + p + 4p)(-p + 1 - 1) - 9p2 + 7p*2 + 9p*2 in the form dp*2 + bp + v and give d. 5 Rearrange 424q2 + 1 - 1 - 404q*2 to i + xq + pq2 and give p. 20 Express 22 + 5o - o*2 - o + 3o*2 - 14o*4 + 13o4 - o4 as co4 + jo*2 + wo + yo3 + z and give c. -2 Rearrange 281 - 362m + 362m - 2m*2 to am*2 + vm + r and give r. 281 Rearrange -53k + 34k - 36k - 8 + 8 + 5k + (-2 - k + 2)(-1 + 2 + 1) - 5k + 3k + 3k to the form f + rk and give r. -51 Rearrange (5v - 3v2 - 5v)(2 - 3 + 3) + 3v*2 - 3v2 - v2 + 0v + 0v - 3v2 to the form x + wv*2 + nv and give w. -10 Rearrange (-3h2 - h2 + 11h*2)(26h - 69h + 28h)(0 - 1 - 1) to the form nh2 + qh + i + mh3 and give m. 210 Express -47v - 2 - 3 + 2 - 20v as r + kv and give k. -67 Express (-j - 2j + j)(384j + 2 - 596j - 573j) as cj + sj2 + d and give c. -4 Rearrange (3r + 2r2 - 6 - 11 + 10)(-31 - 56 + 24) to pr2 + a + lr and give a. 441 Express -30c3 + 2c - 38c3 - 19 + 17 as w + sc + mc2 + dc*3 and give s. 2 Rearrange (2y - 2y - y)(4640 + 2y - 8159 + 4687) to the form jy*2 + gy + m and give j. -2 Rearrange 359q2 - 198q*2 - 200q*2 - q to dq + cq2 + f and give c. -39 Express 2j + 19 + 18 + 5 as p + ij and give i. 2 Express 6 - 4 + 2b - 4b2 + 3b*2 - b as cb + a + wb2 and give a. 2 Rearrange -1289 + 2760 - 1244 - 1232 + 2h to r + uh and give r. -1005 Rearrange 612j*3 - 182j*3 - 230j*3 + 2j + j to uj + qj*2 + fj*3 + v and give u. 3 Express 45j - 42j + 7 - 2j*2 + 7j*3 - 8 in the form gj*2 + vj + qj3 + i and give v. 3 Rearrange -2a - 724a2 + 730a*2 - 144 + 2a to sa + g + da*2 and give g. -144 Express (-1 - t + 1)(-2 - 2t + 2) + 2t*2 + 1 - 1 - 548t*2 - 593t*2 - 468t*2 + 592t*2 as ht + k + rt2 and give r. -1013 Rearrange 6s*2 + 224s*2 + 59s*2 to us + hs2 + d and give h. 289 Express 588w - 590w + 9w2 - w3 - 7 + 3 in the form cw2 + fw + tw3 + x and give x. -4 Express (o + 3 - 3)(-38 + 19 + 48)(3 - 6 + 4) in the form mo + a and give m. 29 Express 0l + l4 + 0l*4 + 3l + (21752 + 162l - 21752)(-4l3 + 4l*3 + 2l*3) as dl*4 + ql*2 + cl + tl3 + o and give d. 325 Express (-d2 + d2 + 2d*2)(-1 + 1 - 2d) + 85d + 462d - 9d*2 - 538d - 3d3 + 1 in the form md + s + xd2 + yd*3 and give s. 1 Rearrange (-26 - 2o3 + 4 + o3)(-o - 4o - 3o) to xo*2 + lo*3 + c + qo*4 + uo and give q. 8 Express (-24 - 88 + 25)(1 - 4 + 1)(2t2 - 2t2 - t2)(3 - 3 + 2t) in the form c + nt + kt*2 + wt*3 and give w. -348 Express 130 + 3v + 111 - 5v - 10 in the form gv + o and give o. 231 Express (2d - 4d + 0d)(26 - 17 + 22 + (-2 + 0 + 4)(4 + 0 - 3) - 4 + 2 + 1) as ud + r and give r. 0 Rearrange -670f2 + f + 1050f*2 - f to the form v + mf*2 + hf and give m. 380 Express ((0 + 1 + 0)(-2 - 7 - 8) - 3 - 1 + 2 + (-2 - 3 + 4)(-4 + 1 + 2) + 3 - 3 + 1)(3s + 2 - 3 - s) as n + ls and give n. 17 Rearrange -5o*2 - 7o*2 + 15o + 21o2 - 14o*2 - 2 to the form fo*2 + t + xo and give f. -5 Express 25 - 2 - 5n + 6n + 9 in the form rn + u and give u. 32 Rearrange 973m - 753m + 0 - 1 + 1 to the form qm + u and give q. 220 Express -2v - 2 - 14v*4 - v + 5v*4 + 4v in the form mv4 + iv*2 + a + fv*3 + qv and give m. -9 Rearrange 17 + 72k2 - 993k*2 - 17 to the form zk*2 + y + dk and give z. -921 Rearrange (24 - 2d - 24)(2d + 2d - d)(-d + 1 - 6d + 5d) + d3 + 16 - 16 to c + sd + ad2 + hd*3 and give s. 0 Rearrange 46m*2 + 26m - 3m - 48m*2 to the form im + h + dm2 and give i. 23 Rearrange -240y + 428y - 284y - 382y to the form h + vy and give v. -478 Express 256m2 - 11775m*3 + 11774m*3 + 2 - 2 as pm*3 + lm*2 + im + n and give p. -1 Express (-37z + 11z - 3 - 8z + 6z)(z2 + 0z*2 + 2z*2) in the form t + hz*3 + iz + bz2 and give h. -84 Express (-3r + 0r + 7r)(-41 + 41 - 3r)(0 + 1 - 4) in the form a + mr + ir2 and give i. 36 Express 2y*2 - 219y*3 - 68y*3 - 21y*3 in the form uy*3 + ay*2 + wy + k and give u. -308 Rearrange (-n + 2n - 5n)(-n - n3 + n) + (43n - 7n + 22n)(-n3 - 3 + 3) to the form an*4 + vn*3 + pn + yn2 + u and give a. -54 Rearrange 4 - 4 + 1 - 1 - 52b to the form n + wb and give w. -52 Rearrange 109r*2 - 82r*4 + 1 - 30r*2 + 81r*4 to the form ar*3 + f + vr*4 + sr*2 + br and give f. 1 Rearrange -50225 + 50224 - 75t - 3t to q + kt and give q. -1 Express -34 - 93v*2 - 95v*2 + 11 + 286v*2 - 95v*2 as cv*2 + jv + r and give c. 3 Rearrange (-2145 + 2145 + 330a)(3a2 - 5a*2 + 3a*2) + 3a*3 - 2a3 + a3 + a3 - a3 - 3a3 to ka*3 + ma*2 + x + fa and give k. 329 Express -22w - w2 + 2w*3 - 27w + 10w - 2w - 3w2 in the form m + nw + kw2 + zw*3 and give k. -4 Express -81 - 3d - 81 - 2d2 + 243 - 85 in the form cd + yd2 + h and give y. -2 Express 862y*2 + 42y*2 + 619y*2 - 2y*2 - 40y*2 in the form b + qy + gy2 and give g. 1481 Rearrange (5p*3 - 5p*3 + 4p*3)(-2p - 1 + 1)(-32 + 16 + 61) to the form g + ip + kp*4 + mp*2 + hp*3 and give g. 0 Express (0f + 3f - f)(1 + 27 - 3)(0f**2	{ "pile_set_name": "DM Mathematics" }
g k is positive. k(-106/175) Simplify (m/m1)*(-32)m*(-2/11)(m*(-3/2)m)/m(mm/m*(1/2)m*(6/5)m)(-21) assuming m is positive. m(-4366/55) Simplify ((a(a/(a(a*(1/53)a)/a))/a)*(5/14)/(a/(aa/(a/(a*8/aa))))(-1/38))(1/15) assuming a is positive. a(-1021/70490) Simplify (r(-2/21)/(r(rr(-2/23))/r))(-24/7)r4r/r*8(r/r*(-1)rr)/(rr(-8)/r) assuming r is positive. r(14039/1127) Simplify ((c*(-2/13)(c/(c*2c))/c)/(c/(c/c*0)c/((cc(-3)c)/c)))/((c0)(2/39)c/c3cc6) assuming c is positive. c(-145/13) Simplify (s14(s*(-4/5)ss)/s)(1/23)/(((ss*(-4/3))/ss)/(s/s(-16)))(-2/93) assuming s is positive. s(7849/32085) Simplify (a(-38)a(aa(-5)a)/a)/(a*(-29)/(a/(aa*(-14/9)/a)a)) assuming a is positive. a(-76/9) Simplify ((t(-2/7)t)/(tttt*(2/13)t)t(-2/19)/(t/t(1/2)))/((t(-2)/t)(17/4)(t*(-1/3)/t)/(t/(ttt/(t0t)))) assuming t is positive. t(187531/20748) Simplify ((l/l4)/l)/(l*(2/9)l)(l/(l/l(-1/6))l)/(l/l*(-5))((l1)(20/7))(20/7) assuming l is positive. l(-1963/882) Simplify (r1)(-12)(r(-2/3))(-30)(r/r1)24/(r1)(-1/16) assuming r is positive. r(129/16) Simplify (((c(-5)cc)/c(-2/9))/(c3((cc(-2))/c)/c))/(((c0/cc)/(cc*(3/4)c))/(c/c(1/4))(2/19)) assuming c is positive. c(35/684) Simplify ((v(-2))(-17))(-37)((vv(1/4))(-7))(-1) assuming v is positive. v(-4997/4) Simplify (c(-2/3)/c)(-42)(cc*(-1/3)/cc)/(cccc/c4c)((c/(cc(-2/5)))(-35))(-49) assuming c is positive. c(2267/3) Simplify (((w/w*(-18))/w)/(ww9))/(w/w(-4/13)w(-38)) assuming w is positive. w(581/13) Simplify (q30)(-3/4)/(q(-1/6)q(q36/q)/q) assuming q is positive. q(-172/3) Simplify ((gggg(2/7)/g)(-9/5))(2/61)/((g/(g(2/5)/g))/gg(g/((gg1/g)/g))/gg*3gg0g) assuming g is positive. g(-14379/2135) Simplify ((z(1/5)z)(-2/9))(12/17)(z*(-4)/zz(1/18))(-24) assuming z is positive. z*(30212/255) Simplify (n/((n(n/(n/(nn/n(-5)nn))n)/n)/n)nn/n*3n)/((n/(nn/(nnn(2/7)nn)))/(n/(n2n)))((n1)(-13))(18/7) assuming n is positive. n(-327/7) Simplify ((((h(-1)/h)/h)/h)/h4)(-31)/(((h/(h/(h/(h(h/(h*(-2/23)/h))/h))h))/h)/(h/(h*(-3/8)h)h))(-2/15) assuming h is positive. h(341419/1380) Simplify (tt/(tt/t(-1)t))31/(t(2/5)t/(t/(t(-4/7)t)t))t(-8)/(t/t(-2/25))(t2)(-7) assuming t is positive. t(-14859/175) Simplify (ww*(-1/2)/ww*(3/2)w)/((w*(-1/2)w)/((w*(1/4)/w)/www))w*2/((w/((w/(ww*(-5)/ww))/w)w)/w)w(2/3)/(w(-7)/w) assuming w is positive. w(185/12) Simplify ((l(1/4)l)/(l/(ll*(1/2)/l))(((lll*(2/3)l)/l)/l)(2/55))/((l/l(3/5))/ll(-5))(-3/11) assuming l is positive. l(-43/60) Simplify (o10/(o/((oo*(-1/3)o)/o))(o(-3))(12/11))7 assuming o is positive. o(1477/33) Simplify ((v/v1)/(vv/((vv/v(-6/7)v)/v)vv)v0/v0)/(((vv*(2/9))/v)/vv/v(1/3))(-16) assuming v is positive. v*(-184/63) Simplify ((ss*(-17)ss(-10))/(s(5/7)ssss(-2/47)))(20/7) assuming s is positive. s(-188660/2303) Simplify (q(1/3))(20/3)((qq(1/6)q)/q)/(qqq*(1/5)q)(q(-6)/(q5/qq))/((q*(-2/3)/qq)/q(3/7)) assuming q is positive. q(-6121/630) Simplify ((k*(-1)/(kk/(kk(-1/3))k)(kkk0)(-7))(-4/11))(1/46) assuming k is positive. k(104/759) Simplify ((m/m(-4))/m(-2/27))3/(((m/(m(2/17)/m))/((m(-3/2)/m)/m))/((m(-1)m)/(m(mm/m*4)/mm))) assuming m is positive. m(3317/306) Simplify (((f(-1)f)(1/4)/((ff6)/f(-3/2)))(-38))(10/9) assuming f is positive. f*(3230/9) Simplify ((c((((c/c*2c)/c)/c)/c)/cc(-1/9)c)/((c11/c)/c)15)28 assuming c is positive. c(-34552/9) Simplify ((b*(-1)b)39)(-30)/((b1)(1/3)(b/(((bb*(2/5)b)/b)/b))/b5) assuming b is positive. b(61/15) Simplify ((n/n*(19/4)n)*(-50)n*19nn38)13 assuming n is positive. n(5083/2) Simplify ((z(z/z*(-10)z)/zz)/z(-8))(-17)/((z/z(-3/4))/(z/(z(-5)z))(z2)(3/31)) assuming z is positive. z(-43889/124) Simplify ((n(-5)/nn)*(3/13)(nn(-1/4)n)(-1/27))42 assuming n is positive. n*(-11977/234) Simplify (((c/(cc/(c*12/c)cc))/(c/(c(-1/25)/c)))(-2/41))(-2/5) assuming c is positive. c(596/5125) Simplify (h(-16)/h(-5/6)h0/((h(2/9)h)/h))(6/7) assuming h is positive. h(-277/21) Simplify (s1)(14/3)/((sss(6/11)ss)/s(2/11))(s/s*(-2)s)*(-7/5)(s/(s/s(-2/3)))14 assuming s is positive. s(-2414/165) Simplify ((j0j(-1/2)(jj0)(-11/6))(-1/39))(-4/7) assuming j is positive. j(-4/117) Simplify ((r(-19/6)/(r/(rrr16)))/(r(-32)r(rr*11r)/rr))(-21) assuming r is positive. r(-1337/2) Simplify (((((v/(v/v(-13))v)/v)/v)/v*2)/(vv/(v/(v/((vv(2/49))/v)))vv6))(2/3) assuming v is positive. v(-2446/147) Simplify (zz0)(1/52)/(zz(-1))(-5/18)(z3/(z6/z))/(zzz*(1/2)z)(-3/37) assuming z is positive. z(-3265/1924) Simplify ((zzz2)40)*(2/9)/((z/(zz4))(4/17))(-1/2) assuming z is positive. z(5368/153) Simplify ((x*(-3/2)x)4)(2/55)(x(-9)x6/x)11 assuming x is positive. x*(-2424/55) Simplify (ii*6(i*9i)/iii)*(-2/35)/(iii/(i/(i/i3))ii1i(ii*(-2/5)i)(-4/9)) assuming i is positive. i(-209/63) Simplify ((r/(r/r*0)r)3/(r(2/3)(rr(5/4))/r))/(r(-2/13)rr/(rr(1/4)rrr)((r1/r)/r)(-1/2)) assuming r is positive. r(233/78) Simplify ((m6m*(-2/9)m)/(m(-2)/m(2/11)))/((m4/m)(1/5))(-34) assuming m is positive. m(14533/495) Simplify ((o(2/23)/o(-10))/(o/(o*(1/14)/o)(o(oo/(o/(o/(o/o*(3/22)))oo))/o)/o))(-1) assuming o is positive. o(-17749/1771) Simplify (((j/(j(j/j*(-12))/j))/((jj*(1/22))/jj))/(j*(-3/13)jjj(-7)/j))(13/5) assuming j is positive. j*(-1949/110) Simplify ((ss*(1/3)ss(s/(s/(s*(-3/10)s)ss))/s)/(s/(ssss(-1/13))s/s(-8)))/((s/s(-1/3)s)/(ss(1/12)))29 assuming s is positive. s*(-32989/780) Simplify (v/(v/(vv*(-1/2)))v*2v(vv/v(1/2))1)/((v*(-1/2)/v)/vv11)33 assuming v is positive. v(-551/2) Simplify ((n/(n/n10))/((nn(-10)n)/nn))/(n(-22)n(-37)) assuming n is positive. n77 Simplify (a(-2/3))(2/15)a(-2/5)a*(2/5)((a/(a/a4))/(a/((a/(((a/a(-2/13))/a)/a))/a)))/((a/(aaa/a6))/a5) assuming a is positive. a(2783/585) Simplify (((o/(o/(o(2/5)/o)oo))/o*(2/5)(ooo(-1/3))(-3/22))(-1/5))(25/6) assuming o is positive. o(355/132) Simplify z/z11z(16/9)z(-2/49)/z(2/51) assuming z is positive. z(-62242/7497) Simplify (r(-2)rr*(-2)/r(rr(1/2)/r)/(rr/r*5))/((rrrr*(3/2)/rrr(-2))/((r/((rrr(2/3)rr)/r)r)/(r5/r))) assuming r is positive. r(-26/3) Simplify ((((f*(2/9)f)/f)/f)/f)/((f*8/f)/f)(ff(f/(f*(-1/4)f))/f)*(-1/10)(f/(ff(-2)f)f)(19/6)/((f0/f)/(f/f(-1))) assuming f is positive. f(103/72) Simplify ((x(-1/4))1/(x(-18)/x)21)50 assuming x is positive. x(39875/2) Simplify ((q/q(1/2))43(q/q0)(-42))/((q(1/4))(-6))3 assuming q is positive. q(-16) Simplify ((h(-3/5)/h)8/(h(-2/13))(1/12))(5/3) assuming h is positive. h(-4987/234) Simplify ((q(-1/2))(-6/23))*(2/5)q(-5/4)/(q0/qq)q*(-3/5)/qqq/q(-2/9) assuming q is positive. q(-2383/4140) Simplify ((o/o(-39)o)/((o*(-20)/o)/oo)o/((o(2/105)o)/oo)oooo/(o(-17/2)/o))(-5/6) assuming o is positive. o(-15851/252) Simplify ((jj(jj*(-1/4))/jjjjj(j/j(-1))/j)/(j1)*(19/4))/((j/(j/((jj*(3/5))/jj)))/(j/j(-2/19)))(-13) assuming j is positive. j*(801/95) Simplify ((n/(n((n*(-1/5)n)/n)/n))/(n/n(-1/4)))/(n1)(3/11) assuming n is positive. n(-71/220) Simplify (((s*(-33)s)/s)/s)/ss27/s(sss(-1/8))/(s/s32) assuming s is positive. s(191/8) Simplify ((z(-31)zz(-20/7))/(z/z(-1/16)z(z(-25)/z)/z))(-23) assuming z is positive. z(20401/112) Simplify (((g(-1/5)g(2/19))/(g1)(-1/19))43)46 assuming g is positive. g(-7912/95) Simplify (g(-3/4)/g40)/(gg0)(2/109) assuming g is positive. g**(-17775/436) Si	{ "pile_set_name": "DM Mathematics" }
/7l + 4/7l*5 + 48 - 132/7l*3 - 4/7l*4 = 0. Calculate l. -3, -2, 1, 7 Let l(f) be the first derivative of -3f*2 + 11/3f*3 + 94 + 1/5f*5 - 3/2f*4 + 0f. Find j, given that l(j) = 0. 0, 1, 2, 3 Let n(l) = l*2 - 3l - 25. Let y be n(7). Find s such that 6s - ys*2 + 41 + 171s - 68 - 23 - 124 = 0. 1, 58 Let h(o) = 6o + 8. Let s be h(-4). Let a = -1 - s. Suppose -2u*4 + 5 - au - u + 1 + 12u2 = 0. Calculate u. -3, 1 Let x(s) be the third derivative of -s5/30 + s4 + 13s*3/3 + 7s*2. Let z be x(13). Factor zc*4 + 12c*3 - 6c*4 + 6c - 15c2 + 3c*4. -3c(c - 2)(c - 1)*2 Let r be -20 + -15 + 18 - (1 + (-1500)/78). Factor 2/13c*2 - 66/13 - rc. 2(c - 11)(c + 3)/13 Let f(a) be the third derivative of -a*6/60 - 2107a*5/10 - 4439449a*4/4 - 9353919043a*3/3 + 1141a*2. Factor f(t). -2(t + 2107)*3 Let g(i) = -95i*3 - 5725i*2 - 240800i - 672060. Let k(y) = -14y3 - 818y*2 - 34400y - 96009. Let n(d) = 3g(d) - 20k(d). Suppose n(x) = 0. What is x? -80, -3 Factor 1/4u2 + 42 - 17/2u. (u - 28)(u - 6)/4 Suppose 10a + 330 = -1420. Let c = 179 + a. Factor -6q - 2/3q*3 + 0 - cq*2. -2q(q + 3)2/3 Find o such that -2/5o*3 + 0 + 128/5o - 126/5o2 = 0. -64, 0, 1 Suppose 0 = i + 5p - 269, 4i + i - 5p - 1195 = 0. Let f be (12/(-14))/2i/(-183). Let 0 + 2/7y*2 - fy = 0. Calculate y. 0, 2 Let x(t) be the second derivative of t*4/84 - 3t*3/14 - 1191t. Factor x(a). a(a - 9)/7 Factor 2/11d*3 + 2d*2 - 400/11 - 20/11d. 2(d - 4)(d + 5)(d + 10)/11 Let g(d) be the third derivative of -2d*7/105 - 14d6/3 + d5/15 + 70d4/3 - 1074d*2. Factor g(p). -4p(p - 1)(p + 1)(p + 140) Let 6037/2l*2 - 2687/2l*3 + 19/2l*4 + 7/2l*5 + 374 - 2062l = 0. Calculate l. -22, 2/7, 1, 17 Factor 89 - 156c2 - 87 + 202 - 2c*3 + 122 + 326c + 154. -2(c - 3)(c + 1)(c + 80) Let a be (-23120)/1232 + 19 + (-14 + 10)/44. Factor 12/7m*2 - am*4 - 4/7m*3 + 0m + 0. -m*2(m - 2)(m + 6)/7 Suppose 2196 - 1774 = 211c. Solve -1/2x - 1 + 1/2x*c = 0. -1, 2 Determine z so that -164/9z - 18 - 2/9z2 = 0. -81, -1 Factor -31301 - 139r*2 - 193r*2 + 7r*4 + 31301 - 1160r3. r2(r - 166)(7r + 2) Let f(p) be the second derivative of 0 + 9p*2 + 39/5p*5 - 11/2p*3 - 16p - 7p4. Factor f(b). 3(2b - 1)2(13b + 6) Let f be 4(6 - 5(7 - 6)). What is v in 5 + fv*2 + 7v*2 - 4v - 15v2 + 3 = 0? -2, 1 Let c(v) be the second derivative of v4/48 + 766v*3/3 + 1173512v*2 + 2750v + 1. Factor c(a). (a + 3064)*2/4 Let q = -1339 - -1341. Let r(n) be the first derivative of -18n*6 + 0n + 256/3n3 + 0n*5 + 32n*q + 72n*4 - 13. Let r(a) = 0. Calculate a. -2/3, 0, 2 Let h(k) = 32k - 441. Let w be h(14). Factor -8p2 + 16p + 22p3 - p5 - wp*4 + 16 - 74p*3 + 36p*3. -(p - 1)(p + 2)*4 Let p(f) be the second derivative of 243f*7/56 + 27f*6/8 + 9f*5/8 + 5f*4/24 - 3f*3 - 6f - 10. Let d(x) be the second derivative of p(x). Factor d(v). 5(9v + 1)*3 Suppose 2a - 41 = -21. Suppose -3x - 140 = -ax. Factor -y + 8y3 - xy*3 + 8y*3 + 5y. -4y(y - 1)(y + 1) Factor 5b - 169b2 + 2b - 6b + 169 - 48b*3 + 97b*3 - 50b*3. -(b - 1)(b + 1)(b + 169) Let f(l) = 112l*3 - 792l*2 + 564l - 148. Let i(p) = -p3 + p2 + p + 3. Let j(g) = f(g) + 12i(g). Let j(t) = 0. What is t? 2/5, 7 Let -2s*3 - 18/11s*4 - 4/11s*2 + 0 + 0s = 0. What is s? -1, -2/9, 0 Let q(w) be the first derivative of 2/15w5 + 11/9w*3 + 14w + 2/3w2 + 12 + 13/18w*4. Let i(a) be the first derivative of q(a). Factor i(s). 2(s + 1)(s + 2)(4s + 1)/3 Let p = -35/281 - -1545/1124. Let a(v) be the second derivative of 0 - 4v*3 + 2v - pv4 + 6v*2. Factor a(k). -3(k + 2)(5k - 2) Let u(f) be the third derivative of -f*6/30 - 2f*5/3 + 53f*4/6 - 28f*3 - 2585f*2. Factor u(l). -4(l - 3)(l - 1)(l + 14) Factor -1497/2n3 + 248751n*2 + 3/4n*4 - 110778111/4 - 54890055/2n. 3(n - 333)3(n + 1)/4 Let b = -29279/18 + 14644/9. Factor 1/6y4 + 0 + by*2 - 1/2y*3 - 1/6y. y(y - 1)3/6 Let t(n) be the third derivative of n6/420 - 37n*5/14 + 6394n*4/7 + 77284n*3/21 - 3424n2. Solve t(s) = 0 for s. -1, 278 Let y(r) be the first derivative of -r4/2 + 80r3/3 + 271r*2 + 460r + 12115. Factor y(g). -2(g - 46)(g + 1)(g + 5) Let y(o) be the third derivative of -1/360o*6 - 2/9o*5 - 7/3o*3 - 48o*2 + 3o + 83/72o4 + 0. Let y(l) = 0. What is l? -42, 1 Let p(a) = a2 - 12a + 14. Let h be p(11). Suppose -6nh + 3n*3 - 175 + 2n*3 + 177 + 3n = 0. What is n? -1, 2 Let z(h) be the first derivative of 3h5/40 + 9h*4/8 + 9h*3/4 - 57h*2/4 + 135h/8 + 1737. Determine t, given that z(t) = 0. -9, -5, 1 Let q be 3 - 4 - 6/(-2). Suppose 0 = qb - v - 5, -b = 4v + 8 - 24. Suppose -2 - bn3 - 278n*2 - 3n + 290n2 - 3n*3 = 0. What is n? -2/7, 1 Let d = -966799 + 966802. Factor 1/4k*d + 31/2k*2 - 31/2 - 1/4k. (k - 1)(k + 1)(k + 62)/4 Let j = 28 - 26. Factor -5i + 17i + 12ij - 14i*2 - 64 + 24i. -2(i - 16)(i - 2) Let x(h) be the second derivative of h*4/36 + 22h*3/3 + 129h*2/2 + 7h - 33. Find z, given that x(z) = 0. -129, -3 Let v(f) = -8f4 - 30f*3 + 176f*2 - 168f + 7. Let a(c) = 7c4 + 29c*3 - 170c*2 + 168c - 6. Let n(u) = -7a(u) - 6v(u). Factor n(o). -o(o - 3)(o - 2)(o + 28) Let r be 22/10 + 1/(-5). Let 27i*2 + 20i - 14 + 2 - 31ir - 4 = 0. Calculate i. 1, 4 Let q(n) be the second derivative of -3n*5/20 + 5n*4/2 + 400n*3 - 18000n*2 - 261n + 1. Factor q(o). -3(o - 20)2(o + 30) Suppose r + 6 = j, 0 = 3r - r + 8. Let -6p*2 + 350p*3 + 0p*j - 347p*3 = 0. What is p? 0, 2 What is a in -152/5a*2 + 32/5a*4 - 26/5a*3 + 0 - 93/5a - 1/5a5 = 0? -1, 0, 3, 31 Let u = -797 - -817. Suppose -4n + 4f = -u, 4n - 11 = -f - 1. What is r in -2/3rn - 2/9r - 2/3r2 - 2/9r*4 + 0 = 0? -1, 0 Let r(c) be the second derivative of 0c*3 + 0 + 12c - 1/40c4 + 17/2c*2 + 1/100c*5. Let l(f) be the first derivative of r(f). Factor l(h). 3h(h - 1)/5 Let u(b) = 84b + 1. Let k be u(-1). Let n = -83 - k. Suppose 1/2l4 + n - l3 + 1/2l*2 + 0l = 0. Calculate l. 0, 1 Let u(j) be the first derivative of 1/4j6 + 85/6j*3 + 65/8j*4 + 6j + 13j2 - 41 + 23/10j*5. Find t such that u(t) = 0. -3, -2, -1, -2/3 Let z(f) = -4f*3 + 483f*2 - 19200f + 256003. Let v(c) = -10c2 - 20c*2 + 1 + 31c*2. Let r(g) = 3v(g) - z(g). Factor r(h). 4(h - 40)3 Suppose -87i = 19463 + 17773. Let f = i - -2579/6. Suppose 0r2 + 0 + 0r - fr4 - r3 - 1/2r*5 = 0. Calculate r. -3, -2/3, 0 Find o, given that 20o*5 + 29o*4 - 210o*3 - 374o*4 - 140o*3 + 90o*2 + 75o*3 = 0. -1, 0, 1/4, 18 Suppose -4776u*5 - 9000 - 14700u - 3918u2 + 4771u*5 - 180u*4 - 2085u*3 - 4672u*2 = 0. What is u? -15, -2 Let u(c) = -11c*2 + 904c + 921. Let t(h) = -h*2 - h + 1. Let o(y) = -6t(y) + u(y). Suppose o(x) = 0. What is x? -1, 183 Suppose -13x = -148 + 41 - 309. Let k(v) = -v. Let r be k(-2). Let -xi - 42i3 - 20i*r + 0i*2 - 39i*3 + 77i*3 - 16 = 0. What is i? -2, -1 Let v = -863204/7 + 123316. Solve -16l - 94/7l2 + 104/7l*3 + 62/7l*4 + vl*5 + 32/7 = 0 for l. -4, -1, 1/4, 1 Let f = 306 + -282. Suppose -1 - 22g*3 + fg*3 + 0g + 1 + 10g2 + 8g = 0. What is g? -4, -1, 0 Let a = -11 + 12. Let w = a + 4. Determine y, given that 3 + 15y3 + 2 + wy - 6y2 - y2 - 18y*2 = 0. -1/3, 1 Let b(g) be the second derivative of 10/27g*3 + 16/9g*2 - 5 + 2g + 1/54g4. Factor b(o). 2(o + 2)(o + 8)/9 Let z(m) be the second derivative of 5m*4/12 - 9500m*3/3 + 9025000m*2 - 1156m. Solve z(h) = 0. 1900 Let b = -415 - -417. Determine q, given that -108 + 56q2 - 200q*b - 139q*4 + 216q + 135q4 + 40q3 = 0. 1, 3 Let p(d) be the third derivative of d8/4032 - d7/252 - d6/12 + 33d5/20 + 23d*2. Let k(h) be the third derivative of p(h). Factor k(w). 5(w - 6)(w + 2) Factor -320226/5m + 22896/5m2 - 446631 - 462/5m*3 + 3/5m*4. 3(m - 53)*3(m + 5)/5 Let h(g) be the second derivative of -5g7/84 - 9g*6/20 - 27g*5/40 + 47g*4/24 + 4g*3 - 9g*2 - 9652g. Find v, given th	{ "pile_set_name": "DM Mathematics" }
-5k - 39. Let j be i(-15). Let g = 28 + -47. Let n = g + 31. Calculate the greatest common divisor of j and n. 12 Suppose -5j - 15 = -0j. Let l be j(-10)/21. Calculate the greatest common divisor of l and 9. 3 Let a(n) = -n3 - 4n*2 - 7n + 2. Let s be a(-3). Let u be (12/s)/(276/(-56) - -5). Calculate the highest common divisor of 8 and u. 4 Let g = 2728 - 1753. What is the highest common factor of g and 13? 13 Suppose -27 + 30 = r. Calculate the highest common factor of r and 177. 3 Let x(r) = 8r2 - 7r - 12. Let g be x(-3). Calculate the highest common factor of 54 and g. 27 Let v(d) = 5d2 + 93d - 28. Let l be v(-19). Suppose 3k + k - 160 = -2q, -2k = -2q - 80. Calculate the greatest common divisor of k and l. 10 Suppose 83j - 1989 = 66j. Calculate the highest common divisor of 104 and j. 13 Let c = -15 + 22. Suppose -cf + 176 = -5f. Let a(r) = 3r2 + r + 1. Let m be a(-2). Calculate the highest common factor of m and f. 11 Let k = -50 - -55. Suppose 35 = 3l + k. Let x = 10 + -5. Calculate the greatest common factor of x and l. 5 Let q = 125 + -73. What is the greatest common factor of q and 572? 52 Let b(g) = 6g2 + 12g + 12. Let l be b(7). What is the highest common factor of 30 and l? 30 Suppose -q + 4q + 2b - 38 = 0, 0 = -4q - b + 44. Let l be 4/22 - (1176/22)/(-14). Calculate the highest common divisor of q and l. 2 Let k(p) = -2p + p - 1 + 3p2 - p + 0p*2. Let z be k(2). Suppose 0 = za - 5a - 2. Calculate the greatest common divisor of a and 10. 1 Let c(g) = g3 + 11g*2 - 16g - 8. Let q be c(-11). Suppose -42 = 124v - 126v. Calculate the greatest common factor of q and v. 21 Let c = -77 + 183. Let i = c - 72. What is the greatest common divisor of 306 and i? 34 Let h = -35 + 43. Let w be (40/(-15))/h - 13/(-3). Suppose 2d + 0d = 24. What is the highest common factor of w and d? 4 Let f be 3(1 + 0) - (26 - 27). Suppose -i + 195 = 4v, i + 78 = fv - 111. Calculate the highest common factor of v and 6. 6 Let y be (-2)/5 + (-76)/10. Let r(j) = -j2 - 7j - 9. Let v be r(y). Let p = 27 + v. What is the greatest common factor of 20 and p? 10 Suppose 3h = 5y - 154, -10h + 5h = y - 14. What is the highest common factor of 319 and y? 29 Suppose 4b = u - 361, -1167 - 345 = -4u - b. What is the highest common divisor of u and 58? 29 Suppose u + 8 = -3u. Let i be (u/(-4))/(1/2). Suppose -i = -s + 6. Calculate the highest common factor of s and 63. 7 Suppose 4w - w = 60. Suppose 2p = -58 - w. Let v = p + 60. What is the highest common divisor of v and 3? 3 Let k(l) be the first derivative of 2l*3/3 + 5l*2 - 4l - 14. Let o be k(-8). Calculate the greatest common factor of 4 and o. 4 Let v = -206 + 530. Calculate the greatest common divisor of 36 and v. 36 Suppose 148 - 52 = s. Calculate the highest common factor of 32 and s. 32 Suppose 0 = 2q - 0q + 4. Let b be 3q/4-10. Calculate the highest common factor of b and 30. 15 Suppose -62l = -64l + 68. What is the highest common factor of l and 136? 34 Suppose -4s = -3s + 9. Let z = -7 - s. Suppose 5y - 30 = -u, zy + 2y = 3u - 52. Calculate the highest common factor of u and 4. 4 Let p(q) = 3q2 - 6q + 55. Let w be p(-13). What is the highest common divisor of 30 and w? 10 Let k = -444 + 563. Calculate the highest common divisor of 51 and k. 17 Let l = 511 - -308. What is the highest common divisor of l and 63? 63 Suppose 55b = 54b + 446. Calculate the greatest common divisor of 4 and b. 2 Let h be ((-104)/(-22))/(50/275). Let o be 2/8 - (-1)/(-4). Suppose -n + 3n - 260 = o. What is the highest common divisor of h and n? 26 Let i = 24 - 24. Let v = 2 - i. Suppose -v - 2 = -y. What is the highest common divisor of y and 2? 2 Suppose -4x = -d - 33, 4d - x = -5x - 52. Let k = d - -19. Let r be (4 - -1)/(k/6). Calculate the highest common divisor of 6 and r. 3 Let o be (3/(-6))/(2/24). Let r(y) = -y - 3. Let n be r(o). Suppose -5w - 4h + 167 = -953, -5h - 672 = -nw. What is the greatest common divisor of 28 and w? 28 Suppose -4d - 4873 = -18313. What is the highest common factor of d and 60? 60 Let i be 1/(-2) - 37/(-2). Let g = i - -6. Suppose 4m - 12 = g. What is the greatest common divisor of m and 3? 3 Suppose r - 9 = -4x - 0r, 2x + r - 5 = 0. Let t = -9 + 8. Let l be ((-10)/(-4))/(t/(-2)). What is the greatest common divisor of l and x? 1 Let m = 0 + 19. Let v(s) = s - 5. Let a be v(0). Let t be (-4)/(1 + a)209. What is the highest common divisor of t and m? 19 Let b(m) = -m + 5. Let n be b(6). Let u be n(0 + 13)-1. Let j(y) = y*2 - 11y + 13. Let k be j(0). Calculate the greatest common divisor of u and k. 13 Let k = 421 + -297. Calculate the greatest common divisor of 93 and k. 31 Let q be -3 + (3 - (-16 - 1)). Suppose -3x + 32 = 5i - q, -i + 5 = 0. Let j = x - -104. What is the greatest common divisor of 16 and j? 16 Let s be (1/(-2))/((-2)/8)1. Let h be (s + -7 - -4)/(2/(-20)). Calculate the greatest common factor of 10 and h. 10 Let v = -211 + 255. Let w be ((-8)/(-10))/(1/5). Calculate the greatest common factor of w and v. 4 Suppose -117v = -116v - 195. Calculate the highest common factor of v and 13. 13 Let d = -1048 + 1113. Calculate the highest common factor of 117 and d. 13 Let m(p) = -p + 130. Let f be m(20). Calculate the greatest common divisor of 1265 and f. 55 Let a(b) = -2b*2 - 2b - 4. Let c be a(3). Let m = -18 - c. Calculate the highest common factor of 25 and m. 5 Suppose -k - 2 = -12. Let v(h) = -7h + 4. Let u be v(-3). Calculate the highest common divisor of u and k. 5 Let o be 10320/1204(2 - 100/(-6)). Calculate the greatest common divisor of o and 704. 32 Let t be 3 - -32/6. Let b be 6/(t/((-440)/(-15))). What is the greatest common factor of 110 and b? 22 Suppose -3k + 5k = 2q - 74, -5k = 4q - 139. Suppose 5v = 5n + 920, -7n - 188 = -v - 5n. Calculate the highest common factor of q and v. 36 Let r = 5 + 0. Let j = 72 + -67. What is the greatest common factor of j and r? 5 Let a be 72 + (-2)/(-4)0. Let t be -4 + 7 + -39. Let m = t + 42. What is the greatest common divisor of a and m? 18 Let c be ((-145)/87)/((-2)/144). Calculate the highest common factor of c and 1320. 120 Let y(b) = -116b3. Let l be y(-1). Suppose l = 4p + 4i, p - 2i = 2i + 49. What is the greatest common factor of p and 22? 11 Let q(a) = -382a - 222. Let l be q(-1). Suppose -2k = 3w - 90, -3w + w + 67 = -k. What is the highest common divisor of w and l? 32 Let k = -65 + -55. Let q be 34/((-8)/10 - -1). Let w = k + q. What is the highest common divisor of w and 25? 25 Let o = -253 + 254. What is the greatest common factor of o and 11? 1 Let j = -2 - -10. Suppose 5t + 9 = 5u - 6, -3t = 5u + 17. Let w = t + j. Calculate the highest common factor of w and 32. 4 Suppose 574 = -4m + 3006. What is the greatest common divisor of m and 8? 8 Let j be (26/(-4))/((-12)/24). What is the greatest common factor of 416 and j? 13 Let v = 21 - 17. Let d be (v - 10)2-10. Suppose 6i - 4i - d = 0. Calculate the highest common factor of i and 15. 15 Let f(z) = 11z + 11. Let h be f(9). Let w be (-9)/(-2 - 1) + 4. Suppose 5p = -20, -2a + 2p = -wa + 47. What is the highest common factor of a and h? 11 Let y(q) = 19q*3 - 2q*2. Let c be y(2). Let v = -60 + c. Suppose f - v = -3f. Calculate the highest common divisor of 14 and f. 7 Let l(b) = -654b - 214. Let k be l(-3). Calculate the highest common divisor of 92 and k. 92 Let i be 6 + 2(2 - 3). Suppose -43 = -3n + d + d, 4n - 56 = 4d. Suppose -5o = n - 95. Calculate the greatest common divisor of i and o. 4 Let i(v) = -126 - 2v + 99 - 3v + 68. Let w be i(0). What is the greatest common factor of w and 41? 41 Suppose 0 = -110s + 102s + 1664. Calculate the greatest common divisor of 364 and s. 52 Suppose 0 = -2t + 2 + 4. Suppose -6d + 40 = -d - 5w, 0 = tw + 12. Calculate the highest common factor of 4 and d. 4 Let i be 16/136 + (-270)/(-17). What is the greatest common divisor of i and 108? 4 Let l be 1/(-4) - 131/4. Let b = -3088 + 3123. Let a = l + b. Calculate the greatest common factor of a and 8. 2 Let w = -1396 - -1452. Calculate the highest common factor of 154 and w. 14 Let r be 3*((-175)/(-30) - (-3)/2). Let c be (	{ "pile_set_name": "DM Mathematics" }
(n(g))? -240g4 - 2g*2 Let s(f) = 84f. Let l(w) = 8w. Give s(l(d)). 672d Let y(a) = -2a2. Let q(z) be the third derivative of -z2 + 0z + 0 + 0z3 + 1/6z*4. What is q(y(m))? -8m*2 Let z(i) = 18i2. Let n(j) be the second derivative of j3/6 - 2j. Give z(n(o)). 18o*2 Let w(g) = 8g - 11g + g. Let t(k) = -12k. Give w(t(y)). 24y Let r(l) = 4l. Let f(k) be the first derivative of -15k2/2 + 55. Calculate r(f(q)). -60q Let y(n) = 5n2. Let c(h) = -4h*2 - 45h. Determine c(y(a)). -100a4 - 225a*2 Let l(j) = -20j*2. Let i(u) = 60u*2. Let p(z) = -3i(z) - 8l(z). Let n(s) = 4s*2. Let b(w) = -14n(w) - 3p(w). Let h(y) = -2y. Calculate h(b(o)). -8o2 Let a(j) = 6j + 21. Let b(k) = k + 4. Let q(i) = -4a(i) + 21b(i). Let x(y) be the first derivative of y*2/2 - 2. Calculate q(x(t)). -3t Let s(k) = 4k + 4. Let n(m) = -1. Let z(v) = 4n(v) + s(v). Let w(x) be the first derivative of x*2 - 1. What is w(z(g))? 8g Let u(y) = 6y2. Let q(f) = -f3 - 9f*2 - 10f - 12. Let h be q(-8). Let z(p) = 0p - hp + 3p + 3p. Give z(u(n)). 12n2 Let p(j) = 2j. Let k(x) be the third derivative of x*4/12 + 4x*2 + 5. What is p(k(i))? 4i Let r(i) = -2i2. Let j(b) = -b + 1. Let g be j(2). Let u(v) = v - 1. Let a(y) = -3y*2 - 9y + 9. Let k(c) = ga(c) - 9u(c). Calculate r(k(m)). -18m4 Let p(n) = 4n*2 + 11n2 - n2. Let d(h) = 2h. What is d(p(y))? 28y*2 Suppose -m = 3m. Let t(j) be the second derivative of 0j3 + 2j + 0 + mj2 - 1/12j*4. Let l(k) = -2k*2. What is l(t(y))? -2y4 Let b(s) = s2. Suppose 0 = a - 1. Suppose -2 = -4h + 2. Let n(g) = -h + a + g. Calculate b(n(d)). d2 Let y(p) = 27p + 4. Let z(f) = 26f + 5. Let j(c) = 3y(c) - 2z(c). Let b(x) = 2x. Give j(b(r)). 58r + 2 Let u(d) = -d2. Let p(z) = -4z. Let s = 1 - 2. Let m(l) be the second derivative of l*3/6 + l. Let i(k) = sp(k) - 6m(k). Calculate u(i(y)). -4y*2 Let v(w) = w + 1. Let n(y) = -10y - 7. Let a(q) = -2n(q) - 14v(q). Let p(j) = -j. What is p(a(r))? -6r Let h(y) = -2y. Let z(s) be the first derivative of -s*5/60 - 2s*3 + 2. Let a(m) be the third derivative of z(m). Give h(a(p)). 4p Let a(j) = -108j2 - 56j*2 + 129j*2. Let g(z) = -3z. What is a(g(t))? -315t2 Let w(r) = -4 - 2r - 6 + 10. Let f(h) = 6h2. What is w(f(a))? -12a*2 Let r(z) = 2258z*2. Let x(i) = 2i*2. What is r(x(a))? 9032a*4 Let k(d) = 6d*2 + 3d. Let a(c) = 19c2 + 8c. Let v(i) = -3a(i) + 8k(i). Let w(p) = 2p. Determine w(v(z)). -18z*2 Let y(k) = k. Let p = -16 - -15. Let h(j) = -6j. Let o(g) = ph(g) - 2y(g). Let n(l) = -2l2. Calculate o(n(r)). -8r*2 Let r(u) = 18u + 4u2 - 18u - 2u2. Let l(s) = -2s. Determine l(r(d)). -4d2 Let m(f) = f2. Let a(j) = -2j + 2. What is m(a(b))? 4b2 - 8b + 4 Let d(z) = -15z. Let w(g) be the third derivative of g5/60 + 16g*2. Calculate d(w(h)). -15h*2 Let z(t) = 105t. Let n(s) = 35s. Let p(x) = -17n(x) + 6z(x). Let h(d) = -d. Calculate p(h(u)). -35u Let w = 2 - 0. Let k(v) = -wv + 0v + 3v. Let r(c) = -3c*2 + 3c*2 + 2c*2. Give r(k(a)). 2a2 Let l(i) be the second derivative of i3/3 - 3i. Let h(r) = -r. Calculate l(h(t)). -2t Let c(r) = -r*2 - 3r - 3. Let m(d) = d + 1. Let i(l) = -2c(l) - 6m(l). Let s(k) be the second derivative of k*4/6 - 2k. Determine s(i(x)). 8x4 Let h(f) = f2. Let c(v) = -3v*2 + 2v. Determine h(c(n)). 9n4 - 12n*3 + 4n2 Let g(w) be the third derivative of w4/8 - w*2. Let a(y) = -y - 4y + 3y. Give a(g(l)). -6l Let n(t) = t*2. Let h(a) = 24a - 12. Give n(h(k)). 576k2 - 576k + 144 Let j(k) be the second derivative of -k*3/6 + 2k + 15. Let b(z) = 2z2 + 3z*2 - 2z*2. What is j(b(q))? -3q*2 Let a(v) = 24v*2. Let n(w) = -2w. What is n(a(r))? -48r2 Let b(x) = 0x*2 + 2x*2 - 2x*2 - 4x2. Let l(y) be the second derivative of -y3/2 + 4y. Determine l(b(j)). 12j*2 Suppose 0o - 3o = 15, -8 = 3g + 4o. Let u(a) = 30a + 4 - 31a - g. Let f(j) = -j2. Determine f(u(w)). -w2 Let w(l) = -8l*2. Let x(c) = -41c. Calculate w(x(a)). -13448a2 Let s(o) = 39o*2. Let t(f) = -3f. Give s(t(q)). 351q2 Let b(d) = 10d2 - 1. Let y(h) = h2. Give y(b(o)). 100o4 - 20o*2 + 1 Let y(k) = -16k*2 - 2k. Let l(r) = -13r. What is l(y(o))? 208o*2 + 26o Let q(k) = 2k2. Let d(v) be the first derivative of 5v*2/2 - 13. Give q(d(l)). 50l*2 Let o(q) = 4q + 4. Let r(z) = 4z + 6. Let k(w) = -3o(w) + 2r(w). Let h(j) = 3j. What is h(k(g))? -12g Let g(a) be the first derivative of 7a3/3 + 8. Let n(b) be the second derivative of -b4/12 - b. Give g(n(o)). 7o4 Let t(v) = -3v*2. Let b(x) = -130x. Calculate t(b(a)). -50700a2 Let v be (2/(-4) + 1)0. Let c(p) = vp + 4p - 2p. Let k(l) = 3l*2 - 2l*2 + 6 - 6. What is c(k(z))? 2z*2 Let x(d) = -47d. Let s(v) = -58v. Calculate s(x(r)). 2726r Let f(d) = d. Let s(q) = 2115q. What is f(s(t))? 2115t Let u(l) = -l + 7 - 7. Let n(i) be the second derivative of 0i2 + 0 + 0i*3 + 1/4i*4 - 2i. Determine u(n(f)). -3f2 Let u(y) be the first derivative of -2y*3/3 - 32. Let a(x) = -15x*2 + 2. Determine u(a(o)). -450o*4 + 120o2 - 8 Let o(m) be the second derivative of m3/3 - 16m. Let z(w) = w2. What is z(o(x))? 4x2 Let j(n) be the first derivative of -n2 + 1 - 2 - 4. Let t(v) = 5v. Determine j(t(z)). -10z Let o(b) = -10 + 22 - 28b2 - 12. Let q(d) = -2d. Determine q(o(a)). 56a2 Let p(i) = 4i - 6i + 0i - 7i. Let l(k) be the second derivative of -k3/6 + 2k. What is p(l(c))? 9c Let f(g) be the second derivative of -g5/60 - 5g*3/6 + 3g. Let m(q) be the second derivative of f(q). Let w(x) = -2x2. What is m(w(j))? 4j*2 Suppose 4u + 25 = 2o + o, -u = 5o - 11. Let g = o + 1. Let n(a) = 6a2 - 13a*2 + ga*2. Let h(b) = -3b*2. Give n(h(q)). -27q*4 Let c(n) = 8n2 - 5. Let h(k) = k2 + 4k. Let b be h(-5). Let m(v) = 12v*2 - 7. Let s(g) = bm(g) - 7c(g). Let o(u) = 0 + u + 0. Give s(o(w)). 4w2 Let b(l) = -l2. Let v(p) = -1936p2. Calculate b(v(d)). -3748096d*4 Let k(q) = -2q*2. Let h(f) = -4f*2 + 5f. Let y(p) = 5p2 + 4 - 5p - p - 4. Let i(n) = 6h(n) + 5y(n). What is k(i(x))? -2x4 Let t(x) = 2x*2. Suppose 2c + q = -3q + 4, 4q = -4. Suppose -2r = -0r - c. Let i(w) = w*r - 8 + 8. Give i(t(z)). 4z4 Let q(h) = -h2. Let l(d) = d*3 - 6d*2 - 6d - 5. Let i be l(7). Suppose -i = -3r + 7. Let n(z) = 4z - z - z - rz. Calculate q(n(o)). -o2 Let s(i) be the second derivative of -i4/4 - 2i. Let w(k) = -9 + 14 - 5 + 3k2. What is w(s(u))? 27u*4 Let u(w) = 0w + 0w + 2w*2. Let s(b) be the second derivative of 5b*3/6 + 3b. Let m(p) = -14p. Let z(x) = 6m(x) + 17s(x). Determine z(u(q)). 2q*2 Let j(c) = 22c*2. Let r(s) = -14s*2. What is r(j(a))? -6776a4 Let d(a) be the second derivative of a3/3 + 3a. Let j(b) = 2b. Give j(d(g)). 4g Let g(m) = -m. Let d(c) = -21c*2 + 23c*2 + 11c*2. Give d(g(a)). 13a*2 Let n(g) = -115g + 23. Let q(s) = -29s + 6. Let j(y) = -6n(y) + 23q(y). Let v(z) = -2z. Give j(v(w)). -46w Let a be (0 + 0)(-3 + 2). Let p(r) = 6r + r + ar. Let t(u) = -2u2. Calculate t(p(n)). -98n*2 Let n(q) = 409q. Let y(r) = -3r. Give y(n(b)). -1227b Let s(z) = -45z2 - 1. Let o(j) = 3j*2. Determine o(s(g)). 6075g*4 + 270g*2 + 3 Let y(z) be the first derivative of -1/12z*4 + 5 + 0z + 0z3 - 1/2z*2. Let g(v) be the second derivative of y(v). Let h(i) = -6i*2. Give h(g(d)). -24d2 Let k(l) be the third derivative of -l7/1260 - l4/24 + l2. Let h(a) be the second derivative of k(a). Let j(r) = 3r2. Calculate h(j(n)). -18n4 Let d(z) = z2. Let o(w) = 29w2 - 6w - 6. Let t(y) = -58y2 + 13y + 13. Let h(i) = 13o(i) + 6t(i). Calculate h(d(q)). 29q4 Let o(b) = 3b. Let u(m) = -m - 6. Let h be u(-10). Let x(s) = s + hs - 4s. What is o(x(v))? 3v Let g(v) = 2v - 171. Let u(s) = -3s2. Give u(g(t)). -12t*2 + 2052t - 87723 Let x(l) = 3l. Let q(t) be the third derivative of 0 + 0t*3 + 6t*2 - 5/24t*4 + 0t. Determine x(q(b)). -15b Let h(v) = 39v*2 - 8. Let a(l) = 26l*2 - 5. Let u(b) = 8a(b) - 5*h(	{ "pile_set_name": "DM Mathematics" }
z? True Suppose 0 = -4y - 2z - 882, 5y + z - 542 = -1637. Does 7 divide (5 - y) + 2 + -1? True Let l(i) = 7i*3 + 4i*2 - 6i - 8. Let g be l(5). Let h = g - -55. Does 62 divide h? True Let c = 11801 + -3584. Does 15 divide c? False Let y(k) = 14k2 + k - 6. Let m be y(3). Let w = m - 69. Does 9 divide w? True Let x = -24262 + 55500. Is x a multiple of 34? False Suppose 4a - 2109 = 3q - 25858, 5a + 39575 = 5q. Does 9 divide q? True Let w be (-4530)/(-9) + (-12)/(-18). Suppose -5h + h - 4m + w = 0, 0 = -5m. Is 18 a factor of h? True Let z = -54 - -101. Suppose -4u + z = 6p - 3p, -u = -5p + 17. Is u even? True Let i(r) = r*3 - 20r*2 - 19r - 28. Let s be i(21). Suppose -sz = -4131 - 769. Does 32 divide z? False Let x be 3/(-9) + (-35)/(-15). Suppose 20 = u + x. Let s = u + 40. Is s a multiple of 21? False Let f(q) = 3q - 16. Let l(r) = 17r2 + r - 1. Let u be l(1). Let y be f(u). Suppose 2k - 122 = -5o, -y = -3k + 2k + 4o. Is k a multiple of 11? False Let g(h) = -h*3 + 20h*2 - 3h + 1. Does 2 divide g(18)? False Let a(h) = 608h2 - 211h - 38. Does 3 divide a(-4)? False Let u(n) be the third derivative of -n*4/8 + 21n*3/2 + 19n*2 - 12n. Let o = 1 - 1. Is u(o) a multiple of 14? False Let l = -13645 - -26318. Is l a multiple of 14? False Let z(u) = 15u3 - 4u*2 - 31u + 48. Is z(6) a multiple of 29? True Let o = -709 - -729. Let g(l) = 7l3 + 3l*2 + 2l. Let m be g(-2). Is (m/o + 2)/(1/(-90)) a multiple of 9? True Suppose -4l - 20 = 5t, -8t = l - 13t - 20. Suppose -5g + 7k - 11k = -3566, l = -g + 4k + 694. Is 37 a factor of g? False Let m(i) = -40i - 87. Let d be m(-3). Does 14 divide (d/(-6))/1178-1? False Let z be (95/190)/(0 + 1/94). Suppose z = 4q + 2343. Is 8 a factor of q/(-8) + 22/88? True Let r = 3837 + 196. Is r a multiple of 37? True Suppose 5o - 1 = 9. Let u(d) = -1 + 25d + d*3 - 4d - 14 - 20do. Is 6 a factor of u(19)? False Let f be (637/(-65))/(1/(-5)). Suppose -4v = n - f + 14, 4v - 20 = 0. Is 7 a factor of n? False Let g be (1 - 3) + 25 + -25. Is 81 a factor of g/5-15 - -966? True Suppose 5p = -4i + 134, -6i + 2p + 222 = -p. Does 2 divide i? True Is (-3)/3 + 7/(119/26027) a multiple of 25? False Suppose -286v + 1465398 = -565488. Does 18 divide v? False Let l(z) = z2 - z + 1. Let a be l(3). Let q(u) = -u2 + 3u + 13. Let v be q(a). Is -25/15v a multiple of 10? True Suppose -2o = -2x + 98, 3x - 4o = x + 94. Let b = x + 73. Suppose -3t + 4n + b + 237 = 0, 0 = -5n + 10. Does 8 divide t? False Let q(x) = -x3 + 25x*2 + 51x + 47. Let y be q(27). Is (-1)/2 + (-14161)/y a multiple of 16? True Suppose -2k - 17r = -18r - 877, -2k + 5r + 865 = 0. Does 88 divide k? True Does 32 divide (8392/(-6))/(33/(-792))? True Suppose 7u + 5v + 8090 = 11u, -2u + 4040 = -5v. Is u a multiple of 5? True Suppose -5s = 5k + 120, 0k = 3s + 4k + 74. Let b = -18 - s. Suppose 3f = -2f - 5, 0 = -2g + bf + 304. Does 35 divide g? False Let q be -41/(12/(-2721)). Let z = q - 600. Let a = z - 216. Is 18 a factor of a? False Suppose -17k - 49k - 5k + 961695 = 0. Does 35 divide k? True Let i(m) = -2m*3 + 2m - 12. Let k(g) = -3g3 + g2 + 5g - 25. Let d(q) = -5i(q) + 2k(q). Let l = -614 - -617. Does 17 divide d(l)? True Let f(i) = -68i3 + 2i*2 - 10i - 32. Is 6 a factor of f(-4)? True Let k = 14 + -9. Let r(o) = -o*2 + ko*2 - 2o*2 + 8o*2 + 3. Is 10 a factor of r(-2)? False Let j be 1/(4((-234)/48 - -5)). Suppose jk - 179 = -c, -3k = -5c + 7c - 361. Does 4 divide c? False Let g(r) = r*3 - 23r*2 + 72r - 36. Let d be (-42)/(-10)17/(68/20). Does 33 divide g(d)? True Let q be -31/(-6)0. Let s(x) = -x2 + 8x - 3. Let h be s(7). Suppose hj - 142 - 54 = q. Is j a multiple of 10? False Let l be 408/66 + 2/(-11). Let u(k) = 86k - 129. Is u(l) a multiple of 65? False Let z be 1/4 - (-5)/(-20). Suppose z = 10g - 17g + 1050. Does 15 divide g? True Does 15 divide (-15314380)/(-665) + (-5)/351? False Let a(v) = -v2 + 9v - 166. Let d be a(32). Let k = -823 - d. Is 6 a factor of k? False Is -9 + 323 + 24 - (-1 + -1 + 4) a multiple of 28? True Let u(k) = 6k2 + 148k + 219. Does 11 divide u(-56)? True Is 135 a factor of (-6460)/(91/117 + -1)? True Let y(k) = -253k + 17. Let r be y(-4). Let a = r + -537. Is a a multiple of 27? False Let d(b) = -b*3 - 12b*2 - b - 1. Let z be d(-12). Let o be (z/(-2))/((-12)/(-672)). Let p = -165 - o. Is p a multiple of 17? False Is ((3200/(-24))/10)/((-23)/12144) a multiple of 352? True Let n = 14060 - 13630. Is 5 a factor of n? True Let l be (-1)/(-6)4 - 5/(-15). Let q be (2 + -218)/l. Let z = q - -39. Does 5 divide z? True Suppose -51y - 115y = -4009232. Is 18 a factor of y? False Suppose -12528568 = -407b + 5827539. Is 9 a factor of b? False Is 16 a factor of (-134)/4489 - (-1277166)/402? False Suppose -3w = -2a + 680, -5w - 2a - 1160 = -0w. Let i = w + 370. Suppose 36 = y - k - 0k, i = 5y + 5k. Is y a multiple of 8? True Suppose -70 = -8s + 7s. Suppose d + 4d = -s. Does 16 divide -2 - -2 - (d - 2)? True Let c(m) = 18m2 - m3 - 6 - 14 + 12 + 11m. Does 36 divide c(18)? False Suppose -87m + 82m - 10 = 0, 0 = g + 2m - 6524. Is g a multiple of 34? True Suppose 364 - 353 = t. Does 12 divide 313/(-5 - ((-242)/4)/t)? False Let m(i) be the second derivative of 7i4/12 + i3 + 3i*2/2 + 2i. Let o = 362 - 358. Does 18 divide m(o)? False Let u(q) = -q*3 - 9q*2 - q - 6. Let r be u(-9). Suppose 4g + i - 4 = -i, -rg = -3i + 6. Suppose 30k - 27k - 540 = g. Is k a multiple of 36? True Let r be (-2 + 1)/((-3)/(-27)). Let i be -3r/(54/4). Suppose 8s - it = 3s + 252, -4s + 3t = -203. Does 7 divide s? False Let s be (-5 + 5)/(-3) - -4. Does 14 divide 398844/276 + s/(-46)? False Let s be 2 + 648/(-9). Does 4 divide (-471)/(-6) - (-75)/s? True Suppose 2795 = 4s - 5k, s - 5k + 2105 = 4s. Suppose -r = -6r + s. Is 35 a factor of r? True Let q = 112 - 71. Let j be 4/(4/3) + 1. Let w = q + j. Is w a multiple of 15? True Let u(i) = 2i - 10. Let a be u(6). Suppose 3q + 288 = 4d, -4d + 3q = aq - 288. Is d a multiple of 8? True Suppose 0 = 4f - 3o - 58, -f - 2o - 1 + 10 = 0. Suppose fx - 580 = -7x. Is 24 a factor of x? False Suppose 2 = -5u - 18, -5568 = -2v - 4u. Does 159 divide v? False Is 53 a factor of (6/(-8))/(((-162)/(-20640))/(-27))? False Let n(g) = 520g - 41. Suppose 4j - 19 = -5u, 4 - 3 = -2j + u. Is 22 a factor of n(j)? False Suppose 60 = 20m - 26m. Does 46 divide 8/(-40) + -1 + (-1102)/m? False Let m(i) = -i + 23. Let f be m(24). Let w be (1 - -1)f/(-1). Suppose wz - 135 = -3z. Is 5 a factor of z? False Let z(p) = -30p + 60. Let c be z(2). Suppose 2q - 4q + 2h + 542 = c, 0 = q - 3h - 273. Is q a multiple of 11? False Suppose 2l = -2i + l + 18, 4i - 2l - 52 = 0. Suppose 6r + 720 = ir. Is 18 a factor of r? True Let j(k) be the third derivative of k5/60 + k4/3 + 74k2. Does 13 divide j(-38)? False Is -1415/(-315)7023 a multiple of 8? False Let m(d) = -3d*2 - 6d + 20. Let f be m(0). Is (-1716)/(-8) + 50/f a multiple of 7? True Let y(k) = 206k2 - 11k - 6. Let q be (-5)/((-7)/((-112)/40)). Does 31 divide y(q)? False Let m = 179 - 179. Suppose m = -6g + 156 - 48. Does 7 divide g? False Let k(y) = y2 - 2y + 120. Suppose 0 = -2x + 5c + 26, 0 = -c - 4 + 2. Suppose -xu = -2u - 0u. Is 12 a factor of k(u)? True Suppose 5c + 105 = 4p - 3p, -5p + 441 = 3c. Let y = p + -75. Is y a multiple of 3? True Let g(i) = 26i + 8. Let j(y) = -29 - 19 - 2 + 8 - 131y. Let l(d) = -11g(d) - 2j(d). Is l(-8) a multiple of 24? False Let z(j) = j*2 + 15j + 36. Let i be z(-12). Suppose -b + i + 52 = 0. Let t = b - -26. Is t a multiple of 14? False Let f be -3 + (-54)/(-15) + 408/120. Let p(i) = 5i3 + 11i*2 - 2i + 19. Is 37 a factor of p(f)? False Let d(b) = 180b + 2. Let o be 6/(-8)22/33-4. Suppose 2 + 0 = oy. Is d(y) a multiple of 14? True Suppose u + 2985 = 4f - 50743, 0 = 4f + 2u - 53704. Is 17 a factor of f? True Suppose 1293 = -3w + 3q, 0q + 2163 = -5w + 3q. Suppose 5d + 25 = -5m, -3m + d - 23 = -4. Does 8 divide w/(-6) - (-3)/m? True Let j = 5204 + -2671. Is j a multiple of 7? False Suppose -7y - 2	{ "pile_set_name": "DM Mathematics" }
548 + 2842 for w. -97 Solve 3717w = 2068w + 6596 for w. 4 Solve 128m = 37m - 140m for m. 0 Solve 9255 = -637h + 20h for h. -15 Solve -1251q - 847 = 26905 + 9778 for q. -30 Solve 32m - 2895 = -687 for m. 69 Solve 4l - 2l + 98l = -2100 for l. -21 Solve 0 = 1322f - 15624 + 3726 for f. 9 Solve -581u - 665u = -328u + 37638 for u. -41 Solve -345h + 3898h = 11774 + 8729 + 815 for h. 6 Solve 170163 - 80313 + 190049 + 357709 = 6856c for c. 93 Solve 0 = 787k - 388k + 802k - 60498 + 8855 for k. 43 Solve -4163 - 35365 = 1464b for b. -27 Solve 33d - 8d + 60 = 8d + 485 for d. 25 Solve 118170 = 1205j + 1421j for j. 45 Solve -16831n + 3675 = -16726n for n. 35 Solve -63l + 3869 = 1428 - 1213 for l. 58 Solve 99u - 141u + 25480 = -679u for u. -40 Solve -1226s + 18176 = -14842 - 130040 for s. 133 Solve -19k + 43k - 2613 + 195 = -69k for k. 26 Solve 18r + 73r - 23r = -3285 - 1543 for r. -71 Solve 568d - 5964 = -12621 - 12655 for d. -34 Solve -1421z - 458z - 48z = 853z + 172360 for z. -62 Solve -2219637 = 21093c - 4404c for c. -133 Solve 19532 = -1179y - 1690 for y. -18 Solve 909v + 23377 + 23443 = 554 - 11910 for v. -64 Solve 243016 = 235t - 72t + 263391 for t. -125 Solve -74a - 1075 + 164 - 1012 = 1481 for a. -46 Solve -29d + 55d + 22d - 804 - 2460 = 0 for d. 68 Solve -2316u + 1191u = 1340u - 160225 for u. 65 Solve -84621 = 10367m - 2351m - 165285 - 239976 for m. 40 Solve -7627 = -560b + 297b for b. 29 Solve 48245621b + 1396 = 48245558b - 3455 for b. -77 Solve -5238p + 4488p = 77250 for p. -103 Solve 20k + 107 + 945 = 92 for k. -48 Solve 44p + 30p + 34p = 8p + 5400 for p. 54 Solve -459v - 6012 = 3944 - 2153 for v. -17 Solve 7937w = 6102w - 121110 for w. -66 Solve 84c + 4c + 17c - 1050 = -70c for c. 6 Solve -124589 = -31f - 123194 for f. 45 Solve 20w = -4w - 302w - 20w + 18684 for w. 54 Solve 2028z - 17822 = 802z - 61958 for z. -36 Solve -833y + 567788 = 2663y + 975y + 183y for y. 122 Solve -3941w = -640w - 14687 - 180072 for w. 59 Solve -639r + 23734 + 10699 - 4638 + 1516 = 0 for r. 49 Solve -4714n + 19751 = -23172 + 552035 for n. -108 Solve -1613a = -1670a + 228 for a. 4 Solve 1787h + 135717 + 61380 = -49509 for h. -138 Solve -251091 + 176075 = 5746g + 263998 for g. -59 Solve -931r + 1249 - 41449 = 303r + 56052 for r. -78 Solve -385y - 71y + 8392 = 593y for y. 8 Solve 194f = -16374 + 550 + 1856 for f. -72 Solve -57j + 412j - 385 = -30j for j. 1 Solve 192o + 1346 - 64 + 1790 = 0 for o. -16 Solve 29m + 43m + 2184 = 16m + 112m for m. 39 Solve -21f + 100393 = 110f + 101441 for f. -8 Solve -124a - 3741 - 591 = 3616 - 1500 for a. -52 Solve 1837p = -1849p - 241p + 479094 for p. 122 Solve 603d - 53668 - 144162 = 3313d for d. -73 Solve -906n - 816n + 365n = -120009 - 23833 for n. 106 Solve 2817 + 3174 = -118b - 3083 + 2938 for b. -52 Solve -964d + 4393 = -76d + 23099 + 31022 for d. -56 Solve 61v = 19786 - 21555 for v. -29 Solve -373s + 5888s - 181579 = -2367s + 669677 for s. 108 Solve 1936 = -82n - 18n - 9n - 2097 for n. -37 Solve -29126z + 96 = -29128z for z. -48 Solve 9179 + 253 = 76s + 67s + 1567 for s. 55 Solve -34878a + 33114a - 104076 = 0 for a. -59 Solve -389h = 4359h - 85184 + 139259 + 131097 for h. -39 Solve 27131 = -997v - 14743 for v. -42 Solve -255c - 274c - 8464 = 0 for c. -16 Solve 4087 = 2549x + 8740 + 20837 for x. -10 Solve 254 + 321 = -15z - 401 + 226 for z. -50 Solve -603u - 68952 = 2805 for u. -119 Solve 3903 - 1051 = 417r - 1735 for r. 11 Solve -11w + 180 - 250 = -125 for w. 5 Solve -695w - 11007 = 4755w - 125457 for w. 21 Solve -4680w - 171900 - 90564 = 23016 for w. -61 Solve -1927728x - 86 = -1927771x for x. 2 Solve 246 + 294 = 540j for j. 1 Solve 2015q - 384q - 23153 - 53504 = 0 for q. 47 Solve 5853t = 5788t + 1659 + 8286 for t. 153 Solve 0 = -716d + 288d + 10523d - 84228 + 23658 for d. 6 Solve -54903 = -6191v - 482082 for v. -69 Solve -9059p + 7185 + 682044 = 1228p for p. 67 Solve 17t + 7222 = -68t + 18t - 818 for t. -120 Solve 2340 = -186x + 303x for x. 20 Solve 9k - 33k + 476 = 10k for k. 14 Solve -1071 - 1594 = -93k - 4k - 10619 for k. -82 Solve -3774 = 2204538k - 2204436k for k. -37 Solve -31373 - 37726 = 2229m for m. -31 Solve -1509b - 83036 = -16640 for b. -44 Solve 6184r - 71625 = 663r + 91352 + 129636 for r. 53 Solve 3431m - 3067m - 3945 = 10979 for m. 41 Solve 48f - 11620 = -78f - 26f + 12f for f. 83 Solve 13904a - 1719a = -11320a + 154a + 186808 for a. 8 Solve -25794x = 25786x - 51558x - 1166 for x. 53 Solve 29427 - 9555 = 363f - 1191f for f. -24 Solve 21270i + 18148 = 21619i for i. 52 Solve 4151 = -2832v + 4629 + 33506 for v. 12 Solve 24a - 1598655 + 1599975 = 0 for a. -55 Solve -75636i - 232456 = -71485i for i. -56 Solve -194299j = -194322j + 184 for j. 8 Solve 0 = 42c + 32c + 137 - 2213 - 70 for c. 29 Solve 782f + 731f = -353f + 106362 for f. 57 Solve 111w - 398 = -1336 - 1133 + 184 for w. -17 Solve 4291 = -218s + 9778 + 4977 for s. 48 Solve -2425w + 76 = 42 + 34 for w. 0 Solve -199q - 2913 = 1188 + 41 + 435 for q. -23 Solve -316s - 75715 = 552s - 71s for s. -95 Solve -4g - 14g - 4706 = -5498 for g. 44 Solve 8006r + 33683 = -169403 - 285280 for r. -61 Solve -145o - 16120 - 14877 = 840o + 32043 for o. -64 Solve 0 = 9006z + 4280z - 1222312 for z. 92 Solve -764a + 1062a = 839a + 15689 for a. -29 Solve 427955p - 427839p = 2204 for p. 19 Solve 961p - 1955p + 953p = 984 for p. -24 Solve 2256x - 3559x = 67756 for x. -52 Solve 16520x - 50 = 16518x + 30 for x. 40 Solve -10284 + 2832 = -257k - 19k for k. 27 Solve 1949k = 103557 - 35342 for k. 35 Solve 0 = 184u + 184u + 431u + 37553 for u. -47 Solve 98o + 117o + 845 = 49o - 483 for o. -8 Solve 580r + 32r - 20r + 558r + 47150 = 0 for r. -41 Solve 0 = -664h + 597 - 597 for h. 0 Solve 34967 = -3661a - 93168 for a. -35 Solve -224d + 1789 + 92 = -167d for d. 33 Solve 12405 + 47355 = -1045s - 947s for s. -30 Solve 724o - 12032 = -780o for o. 8 Solve 682613b - 682680b + 1474 = 0 for b. 22 Solve 9822f + 24272 = 20175f - 9697f for f. 37 Solve 491u + 138u + 232u + 5u = 31176 for u. 36 Solve 421g + 415g = 724g - 4480 for g. -40 Solve 34 - 1471 = 52u + 487 for u. -37 Solve 3269 = 162h + 370 - 2123 for h. 31 Solve -90m - 21m = 31m + 2982 for m. -21 Solve -774f + 967f - 608f - 17015 = 0 for f. -41 Solve -389t - 433t + 915t + 1023 = 0 for t. -11 Solve 1413m - 63256 = -14744 + 17899 for m. 47 Solve 1541y + 11092 = 28043 for y. 11 Solve 1006j - 3602j - 4318j - 1082774 = 5252j for j. -89 Solve -362u - 1460u + 49008 = 1593u - 9047 for u. 17 Solve 118n - 21570 + 4864 = -532n + 13844 for n. 47 Solve 269y - 219y = -524y - 21238 for y. -37 Solve -489a + 2070 = -934a + 560a for a. 18 Solve 116x - 22435 - 20061 = -1212x for x. 32 Solve 0 = 46o - 12 - 218 for o. 5 Solve -136582 = -2394n + 157880 for n. 123 Solve 27813l - 33195l = -435942 for l. 81 Solve 132i - 51i = 43i + 114 for i. 3 Solve 152i = -148i + 10200 for i. 34 Solve 342b - 29376 = 1074b + 84b for b. -36 Solve -4104u = 68u + 310u - 537840 for u. 120 Solve -256506 = -2548j + 56898 for j. 123 Solve 5712 - 1484 = -24v + 115v + 60v for v. 28 Solve -2750b + 764024 = -11634b for b. -86 Solve -32j + 85j + 105j - 4328 - 2150 = 0 for j. 41 Solve -89329 - 101147 = -2886m for m. 66 Solve -3654n - 3610n + 7307n - 86 = 0 for n. 2 Solve 471x - 1000x + 2306 = -354x - 9244 for x. 66 Solve 33353g - 12240 = 33183g for g. 72 Solve 154a = -138a + 402a + 9680 for a. -88 Solve 0 = 21665n - 22042n + 2639 for n. 7 Solve 411t - 139186 = -125212 for t. 34 Solve -1505v - 19 = -1513v + 29 for v. 6 Solve -9343w + 612233 = -41777 for w. 70 Solve 0 = -894d + 808d + 1892 for d. 22 Solve 502w = 765w + 10520 for w. -40 Solve 3264i + 27926 + 79434 = 580i for i. -40 Solve -1925x - 2224x - 197725 = -122871 - 622522 for x. 132 Solve 1954v = -88981 - 39672 - 17897 for v. -75 Solve 1887n + 65865 = -32259 for n. -52 Solve -1478 - 8054 = -1338h + 18566 for h. 21 Solve 101104 = -1829b - 81023 - 53405 + 47145 for b. -103 Solve 134u = 222u + 125*u + 234	{ "pile_set_name": "DM Mathematics" }
t is the nearest to -1 in 0.3, 2/9, 465, -1? -1 What is the closest to 2/3 in 0.1, -0.2, -8, -12, -68? 0.1 Which is the nearest to 7? (a) -14 (b) -2/3 (c) 3/5 c Which is the closest to -0.15? (a) -52 (b) -30.4 (c) -3 c Which is the nearest to 0? (a) -0.01 (b) 106 (c) 2.8 a What is the nearest to 0.5 in -0.2, -14/5, 5, -11/6? -0.2 What is the nearest to 1/4 in -0.249, 2/3, 203? 2/3 What is the nearest to 2 in -0.2, 7, 2, 2/7, 3/8? 2 What is the nearest to 101 in -1, 1/5, -2, 1? 1 What is the nearest to -3 in 0.3, 8, 2/7, 4? 2/7 What is the nearest to 0.2 in 0.5173, 3/5, -13? 0.5173 What is the nearest to -1 in 0.1, -0.499, 36, -1/5, 0.4? -0.499 Which is the nearest to -2/381? (a) 2 (b) 2/7 (c) -2 (d) -1 b What is the closest to -7/9 in 0.2, -3, -6? 0.2 Which is the nearest to 4? (a) -6/217 (b) 3 (c) 1/2 b Which is the nearest to -0.41? (a) 0 (b) -2.1 (c) -2 a What is the closest to -4 in 2/9, -1264, -1? -1 What is the nearest to 2221 in -0.1, -0.4, 0.1, -2? 0.1 Which is the nearest to -2? (a) 321 (b) 5 (c) 7 (d) -0.2 d What is the nearest to 9.79 in 52, -10, -0.3? -0.3 Which is the closest to -76? (a) 5 (b) 39/4 (c) 1 (d) -0.3 d Which is the closest to -0.2? (a) 16 (b) 0.1 (c) -0.4 (d) -0.66 c What is the closest to 1/4 in 13.5, -1/5, 3, -6? -1/5 What is the closest to 7 in 4, -15, 5.2? 5.2 Which is the closest to -14? (a) -2/7 (b) -2 (c) 315/8 (d) 3 b What is the nearest to -164.8 in -2, 3/7, -0.01, 2/11, 1? -2 What is the closest to 6/11 in 5, 88/9, -1/11, -0.3? -1/11 What is the closest to 1/4 in 3, 12, 81093, 2/5? 2/5 What is the nearest to 0 in 3/4, -5, -1, 0.303? 0.303 Which is the nearest to -1/4? (a) 0.5 (b) 0 (c) 7/52 b What is the closest to 1 in 1260, 1, 1/3, -1, 2/15? 1 What is the closest to -0.1 in 293.1, 1.4, -2, -0.3? -0.3 What is the nearest to 0 in 1.4, 4394, -3? 1.4 Which is the closest to -47? (a) 2/5 (b) 0.5 (c) -32 c What is the nearest to -1 in -7, 473, 0.4, 3/5? 0.4 What is the closest to -0.09 in 4, -2526, 0.2, 6? 0.2 Which is the nearest to 2? (a) -1.025 (b) -1 (c) -2/17 (d) -4 (e) -7 c What is the nearest to 1/481 in -2/9, 22, 0.2? 0.2 Which is the nearest to 0? (a) -17 (b) -12 (c) -3.5 (d) -1/3 (e) -0.3 e Which is the nearest to -3/40? (a) 8 (b) -0.6 (c) 3 (d) -3/4 b Which is the nearest to 1? (a) 2/3 (b) 0.13 (c) -7/69 a Which is the closest to 2? (a) 4 (b) -6/7 (c) -25 (d) 9 a What is the closest to 1/4 in 3/40, 100, -3? 3/40 Which is the nearest to -2? (a) -2/7 (b) -3/56 (c) 12.7 a Which is the closest to 59? (a) 1 (b) -0.3 (c) 816 a What is the closest to 0.1 in 0, 3, 1/2, -65? 0 What is the closest to -2 in 0.1, -1/21, -0.2, 2/7? -0.2 Which is the closest to 0? (a) 9.97 (b) -2/15 (c) -10 (d) -2/13 b Which is the closest to 0? (a) 2 (b) -3.13 (c) -1.1 c Which is the nearest to 2? (a) -1 (b) -2 (c) -0.0725 (d) 3 d Which is the closest to 1? (a) 3 (b) 4 (c) 0.12 (d) 116 (e) -0.8 c What is the closest to -0.1 in -6/13, 5, -0.5, -4053? -6/13 Which is the closest to -11/51? (a) -5 (b) -2/3 (c) 4 (d) 0.4 b What is the nearest to -2 in -22, -25.2, 4? 4 Which is the closest to -1? (a) 195 (b) -1/87 (c) 0.3 b What is the closest to -3/2 in 8, -0.4, -0.6? -0.6 What is the closest to -14/25 in -4, -1.7, 1/3? 1/3 What is the nearest to -0.049 in -3, 8/13, 4? 8/13 Which is the closest to 65? (a) 0 (b) 4/7 (c) 46 (d) 0.5 c Which is the nearest to -376? (a) 0.9 (b) -3 (c) -0.9 b What is the closest to -3 in 1, 0.2, 412, 0? 0 What is the closest to -0.07 in -4, 1/3, -2, 10, 2/11? 2/11 Which is the closest to -2/3? (a) 7 (b) -4 (c) -5 (d) -231 b What is the closest to -16.6 in 4, 0, 15/2, 1, -4? -4 Which is the nearest to 990? (a) -2/17 (b) 252 (c) -1 b Which is the closest to 0.1? (a) -1247 (b) 2/9 (c) -3.3 b What is the closest to -1 in -1.52, -1, -0.15, -2/11? -1 Which is the nearest to 1? (a) 1/9 (b) 1 (c) -60015 b What is the closest to 6/13 in -1, -1/7, -6, -0.4? -1/7 What is the closest to -37 in 0.4, -15, -0.08? -15 What is the closest to 0.2 in -5/13, -3, 610? -5/13 What is the closest to 1 in 151.071, -0.4, 1/3? 1/3 What is the closest to 0 in -3, 1/10, 5, 2/7, 888? 1/10 What is the closest to 2/7 in -1, 34, -33, 2/11, 7? 2/11 Which is the closest to 15076? (a) 0.1 (b) -0.2 (c) 5 c Which is the nearest to -2? (a) 0.4 (b) 0.1 (c) -0.6 (d) -3/94 c Which is the nearest to -17? (a) -25/3 (b) 2/25 (c) 1 a What is the nearest to 193849 in 5, 1, -3? 5 Which is the nearest to -7/2? (a) 2 (b) -3 (c) -51 (d) 10 (e) -2 b What is the closest to 2 in 30, -19, -2? -2 What is the closest to -0.1 in -64, -0.2, -2/15, -2/17, -0.571? -2/17 What is the nearest to 0.2 in -64.6, -4, -0.5? -0.5 What is the closest to 3/31 in -0.39, 3, 0, -2? 0 Which is the nearest to 11? (a) 0.1 (b) 4 (c) 11/21 b What is the closest to -0.11 in 2, -3/8, 5, -0.08? -0.08 Which is the closest to 0? (a) 13 (b) 9 (c) 188 b Which is the nearest to 2? (a) 0.066 (b) 2/7 (c) 1.72 c What is the nearest to 3/4 in 2/5, -3, 3/8, -2/11? 2/5 What is the nearest to 58 in 2, -158, 1/5, -0.3? 2 Which is the nearest to 2/19? (a) 4 (b) 1/3 (c) -0.5 (d) -1.6 (e) -4 b Which is the nearest to 1? (a) -0.4 (b) 101 (c) 2/9 (d) -2 (e) -26 c Which is the closest to -0.3? (a) -1 (b) -2 (c) -3/5 (d) 170/3 c Which is the closest to -25? (a) 2/15 (b) 0.06 (c) 12/13 b What is the nearest to -1.8 in 5, -239, 0, -4? 0 Which is the closest to 2? (a) 19/24 (b) 0.2 (c) 3 (d) 1/6 c Which is the closest to 1? (a) 0.5 (b) 4 (c) 41/3 (d) 1/13 a What is the closest to 0.172 in 1, -15, 0.07, -0.4? 0.07 What is the nearest to -35 in -10, -3, -13? -13 What is the closest to 2 in -2/377, 1/9, -0.2, -5, -0.3? 1/9 What is the closest to -1437 in 3/4, 2/5, -2? -2 Which is the nearest to -74.1? (a) 1.6 (b) 3 (c) 0.4 c What is the nearest to -2/7 in -0.003, 2/7, 0, 0.11? -0.003 What is the nearest to 0.1 in 4, 2, 6/11, -1/5? -1/5 What is the closest to 0.3 in -0.073, -0.24, 8? -0.073 Which is the nearest to -2/253? (a) -3 (b) 2/5 (c) 0.2 (d) 0.5 c What is the closest to 0 in -0.5, 7, -0.4, 4, 35? -0.4 What is the closest to 1 in -20, -13, 0.079? 0.079 What is the nearest to -8 in 0.3, 23, -5/4, -1/5? -5/4 Which is the closest to -17/3? (a) -0.4 (b) 1 (c) -138.47 (d) -2 d What is the closest to -2/5 in -41, -2/11, -988, 1/4? -2/11 What is the closest to -0.1 in 2, 0.322, 57, -5? 0.322 What is the nearest to -9.9 in 3, 5, 22, -1.5? -1.5 What is the nearest to 2 in -1/3, 2.5, 0, 4/7, -0.2? 2.5 What is the closest to 2 in 4, -1234, 3/2, -5? 3/2 Which is the closest to 0.28? (a) 5 (b) 0.4 (c) -4 b What is the closest to 14 in 2, 0.2, 83, -2, 0.1? 2 Which is the closest to 1? (a) -2/5 (b) -19 (c) 2/39 (d) -1/2 (e) 5 c What is the nearest to 1 in -5, -1/2, 2/37, 381, 0? 2/37 Which is the nearest to 3/34? (a) -1/24 (b) 2 (c) -9 (d) -0.4 a What is the closest to 1 in 3, -0.4, 4/5, 0.5, 14? 4/5 What is the closest to -7 in 30, -1, 3/7, 0.09? -1 Which is the closest to -7? (a) 1 (b) 1/6 (c) 1/8 (d) -23 c Which is the closest to 428340/13? (a) 2/9 (b) -1 (c) 0.3 c What is the closest to -0.1 in 0.1, 16, 1/4, 0, -5? 0 Which is the closest to 6/55? (a) 0.1 (b) -1/14 (c) -5 a Which is the closest to 4? (a) 1/11 (b) -0.4 (c) -0.5 (d) 262.58 a What is the closest to 1 in 460, 1, 4/5, 2, 5? 1 Which is the nearest to 2? (a) 0.08 (b) 8 (c) 2 (d) -1 (e) -9 c Which is the nearest to -1/2? (a) -3 (b) -27 (c) -9 (d) 0 (e) -4 d Which is the closest to 3/5? (a) -2/5 (b) 2.11 (c) 4/7 (d) -1/6 c What is the nearest to 1/2 in 9, 56, -0.3, -4? -0.3 Which is the closest to -331.4? (a) 5 (b) 1 (c) 2 b What is the nearest to 2 in 2/3, 20, -28, 0.4? 2/3 What is the nearest to -30 in 1/3, -2/5, 26, 4? -2/5 Which is the closest to -42/13? (a) 6.3 (b) 70 (c) -0.2 c Which is the nearest to -1.8? (a) -2 (b) 2 (c) 1 (d) -4 (e) -107 a Which is the closest to 3? (a) -25/29 (b) -1/3 (c) 2/3 (d) -2 c Which is the closest to 0.6? (a) 1/4 (b) 0.1 (c) -2/9 a Which is the closest to 6? (a) -2 (b) -3 (c) 2/5 (d) 0.6 (e) 5 e Which is the closest to 64? (a) -0.01 (b) 4 (c) -0.1 (d) 1/7 b Which is the nearest to -0.52? (	{ "pile_set_name": "DM Mathematics" }
e 7, what is -6 + -20? -26 In base 10, what is -3 - -1053? 1050 In base 12, what is -2b - -32? 3 In base 6, what is 5 + 4? 13 In base 11, what is 3 - 2574? -2571 In base 3, what is 1202021 - 2? 1202012 In base 9, what is -2 - 615? -617 In base 10, what is 83 + 8? 91 In base 6, what is 15 + 22? 41 In base 4, what is 0 + 222113? 222113 In base 2, what is -100111100 + 100? -100111000 In base 4, what is 10 + 11313? 11323 In base 3, what is 1000200 - 11? 1000112 In base 3, what is 0 + 22021? 22021 In base 7, what is -10 + -30? -40 In base 3, what is 1 - -10020? 10021 In base 10, what is 0 - 295? -295 In base 4, what is 0 - -203112? 203112 In base 7, what is 633 - -26? 662 In base 11, what is 0 - 64? -64 In base 9, what is -1 - -5238? 5237 In base 11, what is -176 - 179? -344 In base 8, what is -13 - -136? 123 In base 15, what is -4 - c5? -c9 In base 8, what is -676 + -3? -701 In base 15, what is 29c - 4? 298 In base 8, what is -26012 - 4? -26016 In base 4, what is -31 - 112? -203 In base 6, what is 5 - 22403? -22354 In base 4, what is 2 - -301? 303 In base 12, what is 5 - -48? 51 In base 13, what is -3 - -2221? 221b In base 6, what is -13 - 301? -314 In base 15, what is -61 + 51? -10 In base 10, what is 0 + -47? -47 In base 10, what is 802 + -5? 797 In base 12, what is -1 - 432? -433 In base 5, what is -1 + 104? 103 In base 14, what is db + -2d? ac In base 6, what is -105325 + -2? -105331 In base 8, what is -6 - 0? -6 In base 12, what is -3 - a5? -a8 In base 16, what is 39 - -4? 3d In base 7, what is -53 + 6? -44 In base 5, what is -100 - -140? 40 In base 7, what is -13122 - 0? -13122 In base 13, what is 50 + -5? 48 In base 5, what is 431440 - 3? 431432 In base 15, what is 3 + -31? -2d In base 8, what is -14 + -354? -370 In base 3, what is 22100 + 122? 22222 In base 8, what is -2 + 126? 124 In base 4, what is 11 - 2130? -2113 In base 3, what is -121001 + -1? -121002 In base 9, what is 1 - 21? -20 In base 15, what is -5 + -463? -468 In base 13, what is -2 - 83? -85 In base 7, what is 142 + -10? 132 In base 7, what is -5 + 543? 535 In base 8, what is 3 + -13? -10 In base 8, what is 3 + -7102? -7077 In base 7, what is -14 + -352? -366 In base 4, what is -10 - 131? -201 In base 16, what is -5 - 6fb? -700 In base 14, what is 5c0 - 4? 5ba In base 8, what is -242 + 3? -237 In base 5, what is -31 + 1132? 1101 In base 10, what is -31 - -41? 10 In base 7, what is 15 + 3? 21 In base 7, what is -4 + 655? 651 In base 14, what is -2 - -b7? b5 In base 6, what is 4 + -1022? -1014 In base 4, what is 21 - 223? -202 In base 11, what is -316 + a? -307 In base 4, what is 132 + -12? 120 In base 10, what is 2947 + 5? 2952 In base 14, what is -5 - 124b? -1252 In base 2, what is 10000 - -1000001? 1010001 In base 12, what is -45 - -6? -3b In base 8, what is 6 + 20? 26 In base 4, what is -12 + 1233? 1221 In base 13, what is 31 - 1c1? -190 In base 3, what is -10 + 1000010? 1000000 In base 14, what is 4 + ca? d0 In base 15, what is 4 - 50? -4b In base 10, what is -4 + -65? -69 In base 5, what is 1320 - -103? 1423 In base 12, what is 2 + 4b8? 4ba In base 13, what is 4 + -1349? -1345 In base 3, what is -11000 + 21202? 10202 In base 5, what is -33203 + -3? -33211 In base 8, what is -2 - -116? 114 In base 14, what is 740 + 4? 744 In base 9, what is 4 - -18? 23 In base 5, what is 4 + -13030? -13021 In base 15, what is -520 - 0? -520 In base 15, what is -4 + -5? -9 In base 14, what is 4 - -1a? 20 In base 14, what is 99 - -4? 9d In base 10, what is 12 + 2? 14 In base 2, what is -11111001100 - 10? -11111001110 In base 14, what is 328 - 4? 324 In base 7, what is 5 - 15? -10 In base 13, what is 1 - 13? -12 In base 7, what is 22 - -151? 203 In base 8, what is 7 + 45? 54 In base 5, what is -114 + -12? -131 In base 16, what is 0 + 15? 15 In base 13, what is -4 + 804? 800 In base 6, what is 5144 - 3? 5141 In base 11, what is -5 + 186? 181 In base 3, what is 101 + 1120? 1221 In base 5, what is -1432 - 4? -1441 In base 7, what is -4 + -1356? -1363 In base 12, what is 12 - 31? -1b In base 5, what is 22 - 20? 2 In base 8, what is -10 + 14? 4 In base 3, what is -211010002 + 10? -211002222 In base 14, what is 589 + b? 596 In base 2, what is -110110 + -100100? -1011010 In base 6, what is 5 - 212? -203 In base 7, what is -3266 + -1? -3300 In base 13, what is -10 - -a? -3 In base 3, what is -1221012 + 2? -1221010 In base 10, what is -4 + -96? -100 In base 8, what is 224 - 36? 166 In base 14, what is -81 - -5? -7a In base 13, what is 0 + 8? 8 In base 8, what is 0 - 216? -216 In base 8, what is -40 + 16? -22 In base 15, what is -52 - -4? -4d In base 16, what is -1c - -21? 5 In base 9, what is 133 + -5? 127 In base 11, what is -3 + -86? -89 In base 6, what is -1015 - 0? -1015 In base 7, what is -116 + -2? -121 In base 6, what is -2 - 45? -51 In base 4, what is -33 + 3123? 3030 In base 13, what is -2277 - 3? -227a In base 11, what is 17 - -48? 64 In base 7, what is -16 + -3? -22 In base 7, what is -62 - -61? -1 In base 7, what is -4366 - 3? -4402 In base 11, what is -a - 2? -11 In base 6, what is 541 + 2? 543 In base 6, what is 34 - -221? 255 In base 2, what is 101010 + -100010? 1000 In base 6, what is 233 - -22? 255 In base 11, what is -11 - 25? -36 In base 6, what is -5 + 23? 14 In base 10, what is -451 + 2? -449 In base 10, what is 1758 + -5? 1753 In base 8, what is 632 + 2? 634 In base 11, what is 17 + -10? 7 In base 9, what is 4 + 3? 7 In base 14, what is 1c0a + -5? 1c05 In base 7, what is -2255 - 0? -2255 In base 12, what is -b - -56? 47 In base 3, what is -21 + -11? -102 In base 2, what is 11 + -11000001? -10111110 In base 12, what is -13 + -21? -34 In base 12, what is -2 - -133? 131 In base 16, what is 2 + -12? -10 In base 6, what is -2 - 52410? -52412 In base 4, what is 2 - 102? -100 In base 11, what is -301 + -4? -305 In base 16, what is 4 + -7? -3 In base 8, what is 33 - -3? 36 In base 10, what is 42 - 0? 42 In base 9, what is -2 + 6? 4 In base 13, what is -8 - 385? -390 In base 2, what is 1010000 - 10? 1001110 In base 11, what is 0 - a56? -a56 In base 2, what is -111010011 + -1010001? -1000100100 In base 3, what is 112 + 110000? 110112 In base 2, what is 101 + -10000011? -1111110 In base 4, what is 3011 + -1? 3010 In base 16, what is -736 - 4? -73a In base 15, what is 1 - 4? -3 In base 16, what is 3 - -439? 43c In base 7, what is 234 - 3? 231 In base 9, what is -1 - -2? 1 In base 3, what is 12 + 212? 1001 In base 3, what is -201212 + -1? -201220 In base 3, what is -12202201 - 11? -12202212 In base 15, what is c4 - -5? c9 In base 8, what is 13 - 0? 13 In base 8, what is 10 - 167? -157 In base 7, what is -61 + -135? -226 In base 9, what is 5 - 170? -164 In base 9, what is 5 - 1457? -1452 In base 16, what is -58 - -8? -50 In base 12, what is -53 - -4? -4b In base 4, what is 22133 - -1? 22200 In base 2, what is -1100000 + 1000? -1011000 In base 12, what is -25 - -b? -16 In base 4, what is 321111 + 1? 321112 In base 5, what is -121 + -44? -220 In base 11, what is 2 + 1526? 1528 In base 7, what is 5 - 15? -10 In base 13, what is a2 - b? 94 In base 13, what is 11b2 + -5? 11aa In base 14, what is 0 + -1509? -1509 In base 7, what is 153 - 10? 143 In base 6, what is 1335434 - 3? 1335431 In base 13, what is -18 + 2? -16 In base 5, what is 1044 + -2? 1042 In base 5, what is 41 - -1211? 1302 In base 14, what is 0 + 1b? 1b In base 12, what is 4 + -6? -2 In base 5, what is -13 - 14? -32 In base 14, what is -4 - 0? -4 In base 12, what is 81 - -4? 85 In base 15, what is -4d8 - -3? -4d5 In base 15, what is -1 - 58? -59 In base 8, what is -2123 + -4? -2127 In base 16, what is -7 - -20? 19 In base 10, what is 3 + -65? -62 In base 2, what is 10 - -10100? 10110 In base 10, what is -3400 + 1? -3399 In base 7, what is 545 - 0? 545 In base 9, what is 1 - 146? -145 In base 4, what is -1203 - -10? -1133 In base 3, what is 1 - -111102? 111110 In base 16, what is 16 + -3? 13 In base 12, what is 58 - 2? 56 In base 7, what is -1462 + -2? -1464 In base 10, what is 1512 + 1? 1513 In base 12, what is a + 26? 34 In base 11, what is -14 - 2? -16 In base 14, what is -5 + -287? -28c In base 15, what is -2d4 + -4? -2d8 In base 8, what is 54 - 10? 44 In base 12, what is -2 - -bb6? bb4 In base 10, what is 72 + 5? 77 In base 5,	{ "pile_set_name": "DM Mathematics" }
1723 -3244748 * -10 32447480 Calculate 9.863-1656. -16333.128 16986 -10711 -181937046 What is -6919 times 19536? -135169584 What is the product of -211813.0175 and -0.3? 63543.90525 Product of -0.51875 and 100. -51.875 Work out -63.5436 * 195. -12391.002 What is the product of -206656 and 3.19? -659232.64 Product of 73961.1 and 31. 2292794.1 Product of -0.6 and 348653. -209191.8 What is 3 times -0.06007076? -0.18021228 Work out -9950.7 * -44. 437830.8 31119233 10269336 Multiply 36.95272 and -1.4. -51.733808 -129.76599 1 -129.76599 289.2 * 0.0569 16.45548 What is the product of -381.2498 and -81? 30881.2338 Work out -1 * -4040.59. 4040.59 Multiply 0.0337 and -0.125034. -0.0042136458 Calculate -276773.1-3. 830319.3 Product of -7651 and 0.3013. -2305.2463 924 times 162872 150493728 -0.8 -27923520 22338816 Product of 2177 and -2040.3. -4441733.1 -99219 * -206 20439114 Multiply 2 and 2.0012822. 4.0025644 -184 times -0.78221 143.92664 What is -0.13 times 20875? -2713.75 What is 5 times -2.9414? -14.707 14005 * 15 210075 Product of 2 and 2230992. 4461984 Product of 210 and -3.224974. -677.24454 Work out -1542 * -10333. 15933486 -43289 * -1.212 52466.268 What is the product of -0.04 and 574774? -22990.96 What is the product of 1210432 and 0.12? 145251.84 What is the product of -0.17 and 11868.64? -2017.6688 -0.14 times -6534729 914862.06 What is the product of -2678 and 0.3339? -894.1842 Calculate -751639.32. -122949 Product of 43451 and -568. -24680168 What is 54407.0873 times -1? -54407.0873 Product of -0.4 and 3555499. -1422199.6 0.15597 times 220.3 34.360191 Multiply 2.044 and -200724. -410279.856 130461823 -6 -782770938 Product of 336.01 and -0.003. -1.00803 What is 3162 times -35342? -111751404 504.7 times 146.6 73989.02 Calculate -117394094. -17394094 Product of 56548211 and 0.5. 28274105.5 Calculate -4-80207143. 320828572 Multiply -0.49 and 1272.078. -623.31822 106730 * -27 -2881710 6.767515.8 106.9265 -0.3 times 144851999 -43455599.7 What is -32.61 times 13.5? -440.235 26 times -6031.6 -156821.6 -0.0551275.87 -70.17285 -3102118 -306354 2.8 -0.936724 -2.6228272 -8934565 * -0.4 3573826 Product of -26160 and -307. 8031120 Multiply 470582 and -334. -157174388 Multiply -466109 and 53. -24703777 9 times 73918934 665270406 Work out 108384568 * 0. 0 What is the product of -0.154176 and -8.97? 1.38295872 What is the product of 0.363312 and 39? 14.169168 0.3 * -130.2526 -39.07578 What is -0.0872568 times -34? 2.9667312 Calculate -56591-0.113. 6394.783 Multiply -436306323 and -0.4. 174522529.2 Product of 0.4 and -1.63737851. -0.654951404 Product of 7.01 and -0.399348. -2.79942948 Work out -32132.56 -0.13. 4177.2328 Work out -123.4 * 34899. -4306536.6 Work out -160 * 593.1642. -94906.272 -5650084-173 977464532 Product of -1.3 and -2689960. 3496948 4101444 6 24608664 What is the product of -1918363 and 0.57? -1093466.91 Work out 945.5 * -5. -4727.5 What is -3 times -13694432? 41083296 -16066.823 -48200.46 Product of -24106 and -0.7353. 17725.1418 Product of -203.392 and -0.1622. 32.9901824 20 154824 3096480 Calculate 0.05798114. 469.8006 What is the product of -132055 and -714? 94287270 29.048 times 20329 590516.792 What is -0.1 times -10.640126? 1.0640126 -1.87209 -0.01 0.0187209 What is the product of 16501292 and -0.24? -3960310.08 25 times 41559 1038975 What is the product of -0.049 and 12017.8? -588.8722 What is the product of 42007 and -5? -210035 -1.01805341.1 -1.11985874 Work out 48.95083 -0.83. -40.6291889 What is -0.11 times -0.294093? 0.03235023 38118768 7150608 1176 -0.9292 -1092.7392 -21.259986 times 4 -85.039944 What is the product of 29852929 and 5? 149264645 What is 195 times 594.232? 115875.24 Calculate 103.7-48426. -5021776.2 3-25650.4 -76951.2 Work out 16640430 * -0.1. -1664043 What is -8086 times -2.239? 18104.554 Multiply 155.081434 and 0. 0 Work out 7158.6 * -1080. -7731288 Product of 6894579 and -2. -13789158 Product of -0.06035 and -2707.5. 163.397625 -28 * -0.12914 3.61592 Work out 35058349 * 0.11. 3856418.39 -0.5 times 450102 -225051 -1 * 0.14789615 -0.14789615 Multiply 0 and 90.10806. 0 0 * -162.8552 0 What is 135 times 514797? 69497595 Multiply 124459.7 and -0.4. -49783.88 What is -3.1052 times 0.951? -2.9530452 103825324.3 * 3 311475972.9 Multiply -1 and 1955.7808. -1955.7808 -1054722402 -236273894 2-0.4091866 -0.8183732 11216600.65 729079 Product of -27 and 24441. -659907 What is -25 times -860.42? 21510.5 Product of 2741.15867 and 0.3. 822.347601 Product of -14643 and 2798. -40971114 712319 -56 -39889864 What is the product of -627 and 46953? -29439531 Multiply -83329 and 1063. -88578727 What is -0.03771 times 7437? -280.44927 -1 * -253285337 253285337 Calculate -8.5-2016.81. 17142.885 Multiply 283781 and -0.5. -141890.5 Multiply -1725.0974 and -9. 15525.8766 What is -306045 times -0.28? 85692.6 What is the product of -0.647838 and -0.01? 0.00647838 Work out 1.98 0.57487. 1.1382426 What is -0.4 times -29161617? 11664646.8 -1529.7 * -22.18 33928.746 What is the product of -0.0447 and 9711? -434.0817 -2-90918870 181837740 What is -0.11 times 2094094? -230350.34 Work out -21 -23416. 491736 -578596 * -0.43 248796.28 Multiply -0.1921 and -0.006843. 0.0013145403 Product of 0.1 and -6419173. -641917.3 Multiply -1.1 and 1219015. -1340916.5 35560 times 0.078 2773.68 -0.13752842-0.16 0.0220045472 Multiply 0.4 and 1166013.1. 466405.24 What is the product of -155.7 and -0.71753? 111.719421 -1.805285-181 326.756585 What is the product of 0.4 and -935.284? -374.1136 85.12 times -2781 -236718.72 Work out 5.83 * -0.7054. -4.112482 Multiply 5420 and -3006. -16292520 What is the product of -29980 and 129? -3867420 Multiply 1220.71 and -0.082. -100.09822 Work out 909.9 * 23385. 21278011.5 Work out 9490070 * -0.04. -379602.8 Multiply 0.06923 and -0.7655. -0.052995565 3.0765-0.454 -1.396731 -0.959 0.13905 -0.13334895 Calculate 0.083-127458. -10579.014 -11 -173415 1907565 108.65 * 494.43 53719.8195 Multiply 547939 and 9. 4931451 What is -39.537573 times -29? 1146.589617 0.35 * -587250 -205537.5 What is the product of 1.990567 and 72? 143.320824 0.0749 * -2538.8 -190.15612 0.3-1800.2866 -540.08598 0.5 times -1019577 -509788.5 56663.97 -1.5 -84995.955 2697 * 96.89 261312.33 Calculate -0.2647735.8. -129547.16 What is the product of 2 and 1.693034? 3.386068 Product of -11.76 and -3.382. 39.77232 -2610 263.57 -687917.7 Calculate 50779920.1. 507799.2 Multiply -5 and 1385834. -6929170 Product of -14.93 and 13469. -201092.17 What is the product of -4429.614 and 6.7? -29678.4138 Work out 3.9 1783096. 6954074.4 Work out -14 * 1.380594. -19.328316 What is the product of 0.0017172 and -191.5? -0.3288438 1820.975 times -1.7 -3095.6575 -124214 times 14.2 -1763838.8 Multiply 7105407 and -52. -369481164 Multiply -1113 and 0.0547084. -60.8904492 Work out -15 * -35294532. 529417980 -277.3353 -154.6706 Work out -482715.77 -5. 2413578.85 6949033-4 -27796132 Multiply -2749075 and -5. 13745375 0.82144017-0.3 -0.246432051 Calculate -334.1114. -135.6762 Calculate -3155883150. -467649450 Multiply -38.85748 and -0.1. 3.885748 4 times 99.347 397.388 0.135 times -18419.52 -2486.6352 -163783872 times -0.5 81891936 Calculate 793134504. 357225752 Product of -5 and -3641666. 18208330 Work out -840 32.12. -26980.8 Work out 2 * -117242.7. -234485.4 Product of 16327611 and 6. 97965666 Calculate 4.763159. 15036.84 Work out 14464.46 30. 433933.8 What is -0.4 times 70783? -28313.2 0 times -3056102 0 -3129586 -388758 Work out -6350341 -16. 101605456 3 times -101.37475 -304.12425 Product of 2 and -633.1151. -1266.2302 17 times 19766248 336026216 Multiply 0.4 and -2057379. -822951.6 -44.916 * -147.9 6643.0764 What is the product of -4191187 and -23? 96397301 Multiply 0.105197 and 0.26. 0.02735122 What is -2359 times 6133? -14467747 What is the product of 581 and 8834? 5132554 -0.3 times 19307760 -5792328 What is -15738521 times 0.3? -4721556.3 What is the product of -0.15 and -13331373? 1999705.95 3-2501811.43 -7505434.29 Calculate -56485090-0.3. 16945527 -0.1 * -13470408 1347040.8 Calculate -4301-30.63. 131739.63 Work out 60.72659 59. 3582.86881 What is the product of 1005 and -4.19? -4210.95 M	{ "pile_set_name": "DM Mathematics" }
2sqrt(500)-2 + -5. -5 + 40sqrt(5) Simplify -3(-4 + sqrt(171))*2. -561 + 72sqrt(19) Simplify (sqrt(304) + 3 + sqrt(304) + 1)*2 + 4. 64sqrt(19) + 1236 Simplify -6sqrt(52)/sqrt(1296). -sqrt(13)/3 Simplify (-6(sqrt(19) + -5(sqrt(19) + sqrt(57)/sqrt(3)) + 0 + sqrt(19)-2))*2. 82764 Simplify -2sqrt(25)/sqrt(5)-4. 8sqrt(5) Simplify (sqrt(45) + -5)-5. -15sqrt(5) + 25 Simplify 2((sqrt(5082) + sqrt(5082)3)/sqrt(6))*2. 27104 Simplify (sqrt(63)/((2sqrt(81) - sqrt(81)) + sqrt(81) - sqrt(81)))2. 7/9 Simplify ((sqrt(125) - (-4 + 0 + sqrt(125))) + -4)2. 0 Simplify (sqrt(11) - (sqrt(11) + (-2sqrt(99))/sqrt(9))2) + sqrt(176)6 + -5. -16 + 25sqrt(11) Simplify 1 + -2 + sqrt(252) + sqrt(252) + 1. 12sqrt(7) Simplify 3 + sqrt(12)/sqrt(4) - 4sqrt(15)/sqrt(5). -3sqrt(3) + 3 Simplify -3 + ((sqrt(153)-2 - sqrt(153)) + sqrt(153) - sqrt(153)) + sqrt(153). -6sqrt(17) - 3 Simplify (0 + sqrt(153) + 3 + sqrt(153))*2. 36sqrt(17) + 621 Simplify ((sqrt(56) - sqrt(56)-1)-3)/(sqrt(288)-1). sqrt(7) Simplify -1 + (-1sqrt(66))/sqrt(6)-5. -1 + 5sqrt(11) Simplify -3(-2 + (sqrt(39)/sqrt(3) - sqrt(13)) + sqrt(208)-1). 6 + 12sqrt(13) Simplify 4 + sqrt(768) + sqrt(768)3. 4 + 64sqrt(3) Simplify sqrt(135)/sqrt(5) - (sqrt(18)/((sqrt(24)/sqrt(4) - sqrt(6)) + sqrt(6)) - sqrt(3)). 3sqrt(3) Simplify sqrt(567)26. 108sqrt(7) Simplify (sqrt(3) + sqrt(21)/sqrt(252) - (-3 + -1 + sqrt(3)))2. 4sqrt(3)/3 + 193/12 Simplify (5 + -1(sqrt(171) + -1) + 5)2. -66sqrt(19) + 292 Simplify (3sqrt(12)/sqrt(4) + (sqrt(192)-1)*2)3. 9sqrt(3) + 576 Simplify ((sqrt(200) + -1 + sqrt(200))2 - sqrt(2)) + 5. -41sqrt(2) + 806 Simplify (sqrt(84)-2 + sqrt(84))/sqrt(12) - (sqrt(7) - (sqrt(224)/sqrt(4))/sqrt(8))2. -sqrt(7) Simplify (sqrt(288) + -4(sqrt(288) + 2))*2-5. -13280 - 2880sqrt(2) Simplify 1 + 1 + sqrt(34)/sqrt(2). 2 + sqrt(17) Simplify (sqrt(380)/(sqrt(10)2))/(sqrt(288)/sqrt(9)). sqrt(19)/8 Simplify 3(3 + sqrt(13) + -4). -3 + 3sqrt(13) Simplify ((sqrt(21)2 + sqrt(21))-3)/(sqrt(84)/(2sqrt(12))). -18sqrt(3) Simplify -2 + (sqrt(3) + (sqrt(3) - sqrt(6)/sqrt(2)))*2 + 5 + sqrt(432). 6 + 12sqrt(3) Simplify sqrt(3)-51-6. 30sqrt(3) Simplify -2sqrt(63)/(sqrt(9) + (sqrt(9) - sqrt(18)/sqrt(2)-1) + sqrt(9)). -sqrt(7)/2 Simplify ((sqrt(180) - 1sqrt(180))/sqrt(3))/((1sqrt(24))/sqrt(2)). 0 Simplify (2(sqrt(245) + 0))2. 980 Simplify -5 + sqrt(176) + -5 + sqrt(176) + -4. -14 + 8sqrt(11) Simplify sqrt(7) + (sqrt(14)/sqrt(2) + sqrt(7))*2 + -3 + sqrt(63)/(sqrt(9)3 - sqrt(9)). 3sqrt(7)/2 + 25 Simplify (sqrt(891) + sqrt(891)1 + -5)*2 + sqrt(891). -171sqrt(11) + 3589 Simplify (4sqrt(153)2-4 + 1)2. -192sqrt(17) + 156673 Simplify sqrt(264)/sqrt(6) + (sqrt(11) + -1 + 3)*2. 15 + 6sqrt(11) Simplify (2 + (sqrt(200)/sqrt(360))/sqrt(10))*2. 2sqrt(2)/3 + 73/18 Simplify 3 + sqrt(75) + 3. 6 + 5sqrt(3) Simplify (-2 + (-2sqrt(2299)6 - sqrt(2299)))2 + -1. 572sqrt(19) + 388534 Simplify (0 + -1 + -2 + sqrt(1008))*2. -72sqrt(7) + 1017 Simplify (sqrt(133)-15)/(-2sqrt(847) + sqrt(847)). 5sqrt(19)/11 Simplify (sqrt(3744)2)/(sqrt(12)/(sqrt(12)/sqrt(2) + sqrt(6) + sqrt(6))) + -3. -3 + 72sqrt(13) Simplify -1 + sqrt(720) + -3. -4 + 12sqrt(5) Simplify (sqrt(171) + (sqrt(171) - (2 + sqrt(171)))-3 - sqrt(171))*2. 36 Simplify (sqrt(39)/(-6(sqrt(243) + sqrt(3) + sqrt(3))))*2. 13/4356 Simplify -2(-3 + sqrt(20)). -4sqrt(5) + 6 Simplify -2(sqrt(5) - -1sqrt(45) - sqrt(5)-13)2. -490 Simplify (6sqrt(11)1 - (-1 + sqrt(99)))2. 6sqrt(11) + 100 Simplify sqrt(11)1 + sqrt(11) + 5 - -6sqrt(176). 5 + 26sqrt(11) Simplify sqrt(11) + sqrt(99)/(2sqrt(9)) - (-2sqrt(11) + 5). -5 + 7sqrt(11)/2 Simplify ((1sqrt(121)-5)/sqrt(11) - (2sqrt(99))/sqrt(9)-6)*2. 539 Simplify (5 + sqrt(80) + (sqrt(5) + sqrt(80))2)*2. 140sqrt(5) + 1005 Simplify (1 + 2 + sqrt(76)1)2. 12sqrt(19) + 85 Simplify (-63sqrt(112) + sqrt(112) - (-4(sqrt(112) + -3) + sqrt(112)))2. 1344sqrt(7) + 22096 Simplify -1 + (1 + sqrt(68) - sqrt(153)-2)2. 16sqrt(17) + 1088 Simplify ((-2sqrt(168))/sqrt(8))/(sqrt(432)1). -sqrt(7)/6 Simplify (-3 + (1 + sqrt(720) + sqrt(720) - sqrt(720))-1 + sqrt(720) + (-1 + sqrt(720) + sqrt(720))-1 + sqrt(720))*2. 72sqrt(5) + 729 Simplify (sqrt(612) - (0 + sqrt(612) + 5) - sqrt(612))*2. 60sqrt(17) + 637 Simplify 2sqrt(20) + 1. 1 + 4sqrt(5) Simplify (sqrt(36)/sqrt(3)-5)/sqrt(4). -5sqrt(3) Simplify 2((0 + 2sqrt(704))4)2. 90112 Simplify (6sqrt(912))/sqrt(3) - ((sqrt(19) - (sqrt(19) + 1))*26 - (sqrt(57)/sqrt(3) + sqrt(19) + 4)). -2 + 26sqrt(19) Simplify (sqrt(1800)2 - sqrt(1800))/(sqrt(9) + sqrt(54)/sqrt(6)-3). -5sqrt(2) Simplify sqrt(27)22. 12sqrt(3) Simplify (-2((1 + sqrt(847) + sqrt(847))-5 - (1sqrt(847) + -4)))*2. 968sqrt(7) + 409952 Simplify -5 + 1sqrt(5) + sqrt(5) + sqrt(25)/sqrt(5) + 3. -2 + 3sqrt(5) Simplify (sqrt(28) + 2 + sqrt(567)-1 + sqrt(567))2. 8sqrt(7) + 32 Simplify sqrt(170)/(sqrt(10)-1) - (sqrt(153) - (sqrt(153) + -1))2 - ((sqrt(68) - (-2sqrt(68) - sqrt(68))4) + sqrt(68))2. -13329 - sqrt(17) Simplify (((-2sqrt(108) - sqrt(3)) + (sqrt(9)-1)/sqrt(3))-3)*2. 5292 Simplify sqrt(68) + 1 + 1sqrt(34)/sqrt(2). 1 + 3sqrt(17) Simplify (sqrt(170) + (sqrt(170) - (sqrt(170)1 + sqrt(170)))-4 + sqrt(170))/(-5(sqrt(160) - sqrt(10))). -2sqrt(17)/5 Simplify sqrt(14)/(2sqrt(200)). sqrt(7)/20 Simplify (-5 + 3 + sqrt(14)/sqrt(162))*2. -4sqrt(7)/9 + 331/81 Simplify (sqrt(44) + sqrt(176)/(sqrt(4) - (sqrt(8)/sqrt(2) + sqrt(4)) - sqrt(4)))/(sqrt(28)/(-2sqrt(7) - sqrt(7))). -3sqrt(11)/2 Simplify 4(sqrt(1900)2)*2-2-3. 182400 Simplify -1(sqrt(125) - (-6(sqrt(125) + ((sqrt(125) + -1)2 - sqrt(125))) - sqrt(125))). -756 + 50sqrt(5) Simplify (((sqrt(224) - sqrt(224)-1) + sqrt(224))/sqrt(7)4)*2. 4608 Simplify (2(sqrt(833) - (sqrt(833) - (sqrt(833) - -2(-1 + sqrt(833)))))1)*2. -336sqrt(17) + 30004 Simplify sqrt(70)/sqrt(640) + 5. sqrt(7)/8 + 5 Simplify -6-2sqrt(3) + (sqrt(48))*2. 12sqrt(3) + 48 Simplify (sqrt(7) + -5 + sqrt(7) + 5 + 5 + sqrt(7) + 5)*2. 60sqrt(7) + 163 Simplify ((-2sqrt(300))/(sqrt(12)/(sqrt(12)/sqrt(4))))2 + 1. 301 Simplify sqrt(72) + ((-5 + sqrt(72)-1)*2 - sqrt(72)) + 2. 60sqrt(2) + 99 Simplify (sqrt(153) + -4sqrt(153)2)/(((1sqrt(99) - sqrt(99)) + sqrt(99))/sqrt(11)). -7sqrt(17) Simplify (3-6sqrt(2)-1-3)*2. 5832 Simplify ((sqrt(150) + sqrt(6))-1)/(sqrt(3)-3-5). -2sqrt(2)/5 Simplify (5-4-21sqrt(1900))2. 3040000 Simplify (sqrt(50)-2)*2 + 1 + (sqrt(2) + sqrt(2)2)*2. 219 Simplify sqrt(143)/(sqrt(11) + sqrt(121)/(sqrt(11) + sqrt(99)))-4. -16sqrt(13)/5 Simplify (4 + -5sqrt(1088)3)2. -960sqrt(17) + 244816 Simplify ((sqrt(864) - sqrt(864)-1)/((sqrt(2) + sqrt(2)2)1))2. 192 Simplify -3 + sqrt(13) + sqrt(13) + sqrt(78)/sqrt(150). -3 + 11sqrt(13)/5 Simplify (6(sqrt(363) + sqrt(363) + 1 + (sqrt(3) - sqrt(24)/(sqrt(16)/sqrt(2)))))2. 1584sqrt(3) + 52308 Simplify (52sqrt(85) + sqrt(85))/sqrt(5). 11sqrt(17) Simplify ((sqrt(44) + sqrt(2156))/sqrt(2))/((sqrt(2) + (sqrt(50) - sqrt(2)))6). 4sqrt(11)/15 Simplify ((sqrt(14) + -1sqrt(14))/sqrt(7) - sqrt(72)2)2. 288 Simplify sqrt(152)/(sqrt(8) + (sqrt(32)/sqrt(4) - sqrt(8)))-5. -5sqrt(19) Simplify ((-3 + sqrt(13)-2)-1)2 + 5. 12sqrt(13) + 66 Simplify (-2sqrt(171)-2)/sqrt(9). 4sqrt(19) Simplify (sqrt(30)/sqrt(3))/sqrt(2)-5. -5sqrt(5) Simplify (sqrt(21)2)/sqrt(3)4-6. -48sqrt(7) Simplify (sqrt(24)-1)/(sqrt(243)/sqrt(9)). -2sqrt(2)/3 Simplify -4 + sqrt(567) + -1 + 1 + 5 + (sqrt(567) - -1sqrt(567))*2. 9sqrt(7) + 2269 Simplify -4 + 0 + -6(sqrt(19)-2)*2. -460 Simplify (1(-1 + 2sqrt(112)))21. -16sqrt(7) + 449 Simplify (sqrt(25) + sqrt(50)/sqrt(2) - sqrt(25))/sqrt(5) + (sqrt(90)/sqrt(3))/sqrt(6) + (-5 + -1 + sqrt(180))2. -70sqrt(5) + 216 Simplify sqrt(3)-2 + 5 + 4 - (2sqrt(27)1)2. -99 - 2sqrt(3) Simplify 2((-5(sqrt(66) + sqrt(66)-1 + sqrt(66)) - sqrt(66))/(sqrt(6) - (sqrt(216)1 - sqrt(216))))*2. 792 Simplify 5-4(sqrt(19)12 - sqrt(19) - sqrt(209)/(sqrt(11) + sqrt(33)/sqrt(3))). -10sqrt(19) Simplify (sqrt(76) - -6(sqrt(76) + 1))2-4. -15040 - 672sqrt(19) Simplify (-4 + sqrt(475) + 0)-4. -20sqrt(19) + 16 Simplify -1 + (-5(sqrt(77) - (-2*s	{ "pile_set_name": "DM Mathematics" }
? 2, 19, 103 List the prime factors of 2756. 2, 13, 53 What are the prime factors of 99201? 3, 43, 769 What are the prime factors of 866? 2, 433 List the prime factors of 2646. 2, 3, 7 What are the prime factors of 7611? 3, 43, 59 What are the prime factors of 434? 2, 7, 31 What are the prime factors of 52? 2, 13 What are the prime factors of 154113? 3, 47, 1093 List the prime factors of 96697. 96697 List the prime factors of 127375. 5, 1019 What are the prime factors of 976? 2, 61 List the prime factors of 687. 3, 229 List the prime factors of 672. 2, 3, 7 List the prime factors of 59855. 5, 11971 List the prime factors of 28867. 28867 List the prime factors of 1726. 2, 863 What are the prime factors of 30997? 139, 223 What are the prime factors of 11721? 3, 3907 List the prime factors of 1840. 2, 5, 23 List the prime factors of 68604. 2, 3, 5717 What are the prime factors of 8134? 2, 7, 83 What are the prime factors of 84449? 84449 What are the prime factors of 57? 3, 19 List the prime factors of 2554. 2, 1277 What are the prime factors of 3997? 7, 571 List the prime factors of 4738. 2, 23, 103 List the prime factors of 8442. 2, 3, 7, 67 What are the prime factors of 3481? 59 List the prime factors of 12131. 7, 1733 What are the prime factors of 36628? 2, 9157 What are the prime factors of 3909? 3, 1303 List the prime factors of 551. 19, 29 List the prime factors of 1100. 2, 5, 11 What are the prime factors of 63964? 2, 15991 What are the prime factors of 8951? 8951 List the prime factors of 1692. 2, 3, 47 What are the prime factors of 439? 439 List the prime factors of 10524. 2, 3, 877 List the prime factors of 42866. 2, 21433 What are the prime factors of 11185? 5, 2237 List the prime factors of 2681. 7, 383 What are the prime factors of 23908? 2, 43, 139 List the prime factors of 3726. 2, 3, 23 List the prime factors of 452. 2, 113 List the prime factors of 39196. 2, 41, 239 What are the prime factors of 54568? 2, 19, 359 List the prime factors of 29417. 23, 1279 What are the prime factors of 13672? 2, 1709 What are the prime factors of 143526? 2, 3, 19, 1259 List the prime factors of 1517. 37, 41 List the prime factors of 2276. 2, 569 List the prime factors of 1068. 2, 3, 89 List the prime factors of 63458. 2, 31729 List the prime factors of 2190. 2, 3, 5, 73 What are the prime factors of 2604? 2, 3, 7, 31 What are the prime factors of 13765? 5, 2753 What are the prime factors of 5502? 2, 3, 7, 131 List the prime factors of 76674. 2, 3, 13, 983 What are the prime factors of 6307? 7, 17, 53 List the prime factors of 691. 691 List the prime factors of 36747. 3, 1361 What are the prime factors of 2879? 2879 What are the prime factors of 4584? 2, 3, 191 What are the prime factors of 7389? 3, 821 What are the prime factors of 3743? 19, 197 What are the prime factors of 15428? 2, 7, 19, 29 List the prime factors of 15038. 2, 73, 103 What are the prime factors of 16604? 2, 7, 593 What are the prime factors of 132194? 2, 157, 421 List the prime factors of 788. 2, 197 What are the prime factors of 8340? 2, 3, 5, 139 List the prime factors of 1235. 5, 13, 19 List the prime factors of 402. 2, 3, 67 What are the prime factors of 1627? 1627 What are the prime factors of 788? 2, 197 List the prime factors of 3515. 5, 19, 37 List the prime factors of 580. 2, 5, 29 List the prime factors of 55419. 3, 7, 13, 29 What are the prime factors of 1241? 17, 73 List the prime factors of 6120. 2, 3, 5, 17 What are the prime factors of 26684? 2, 7, 953 List the prime factors of 77553. 3, 7, 1231 What are the prime factors of 1999? 1999 What are the prime factors of 4471? 17, 263 List the prime factors of 478. 2, 239 List the prime factors of 1169. 7, 167 List the prime factors of 1561. 7, 223 What are the prime factors of 22? 2, 11 What are the prime factors of 5571? 3, 619 What are the prime factors of 7903? 7, 1129 What are the prime factors of 4352? 2, 17 List the prime factors of 1406. 2, 19, 37 What are the prime factors of 885? 3, 5, 59 What are the prime factors of 11402? 2, 5701 What are the prime factors of 2422? 2, 7, 173 What are the prime factors of 49748? 2, 12437 List the prime factors of 2354. 2, 11, 107 List the prime factors of 25299. 3, 937 What are the prime factors of 164? 2, 41 List the prime factors of 153802. 2, 11, 6991 List the prime factors of 47906. 2, 17, 1409 What are the prime factors of 7442? 2, 61 What are the prime factors of 1752? 2, 3, 73 What are the prime factors of 1145? 5, 229 List the prime factors of 6527. 61, 107 What are the prime factors of 15323? 7, 11, 199 What are the prime factors of 7226? 2, 3613 List the prime factors of 17739. 3, 73 List the prime factors of 3170. 2, 5, 317 List the prime factors of 6836. 2, 1709 What are the prime factors of 33942? 2, 3, 5657 What are the prime factors of 8898? 2, 3, 1483 List the prime factors of 1153. 1153 List the prime factors of 1860. 2, 3, 5, 31 What are the prime factors of 299? 13, 23 What are the prime factors of 11422? 2, 5711 What are the prime factors of 1075? 5, 43 What are the prime factors of 5317? 13, 409 List the prime factors of 1504. 2, 47 List the prime factors of 10881. 3, 13, 31 What are the prime factors of 32443? 32443 List the prime factors of 1066. 2, 13, 41 List the prime factors of 7802. 2, 47, 83 List the prime factors of 32842. 2, 16421 List the prime factors of 18662. 2, 7, 31, 43 List the prime factors of 36737. 17, 2161 What are the prime factors of 1439? 1439 List the prime factors of 32. 2 List the prime factors of 526. 2, 263 What are the prime factors of 2283? 3, 761 What are the prime factors of 39385? 5, 7877 List the prime factors of 70135. 5, 13, 83 List the prime factors of 1158. 2, 3, 193 List the prime factors of 353. 353 List the prime factors of 81772. 2, 20443 What are the prime factors of 2803? 2803 List the prime factors of 2613. 3, 13, 67 List the prime factors of 9094. 2, 4547 List the prime factors of 1695. 3, 5, 113 List the prime factors of 2566. 2, 1283 What are the prime factors of 12598? 2, 6299 What are the prime factors of 5900? 2, 5, 59 What are the prime factors of 35425? 5, 13, 109 List the prime factors of 5790. 2, 3, 5, 193 What are the prime factors of 27093? 3, 11, 821 List the prime factors of 11066. 2, 11, 503 What are the prime factors of 814? 2, 11, 37 List the prime factors of 11204. 2, 2801 What are the prime factors of 5951? 11, 541 What are the prime factors of 1423? 1423 What are the prime factors of 2285? 5, 457 List the prime factors of 16245. 3, 5, 19 What are the prime factors of 69547? 17, 4091 List the prime factors of 50792. 2, 7, 907 List the prime factors of 21036. 2, 3, 1753 List the prime factors of 911. 911 List the prime factors of 659. 659 What are the prime factors of 2067? 3, 13, 53 What are the prime factors of 36961? 23, 1607 What are the prime factors of 8042? 2, 4021 List the prime factors of 926. 2, 463 List the prime factors of 32218. 2, 89, 181 List the prime factors of 1604. 2, 401 What are the prime factors of 1319? 1319 What are the prime factors of 20657? 7, 13, 227 What are the prime factors of 107971? 107971 What are the prime factors of 10648? 2, 11 What are the prime factors of 252? 2, 3, 7 What are the prime factors of 32483? 11, 2953 What are the prime factors of 134577? 3, 19, 787 List the prime factors of 976. 2, 61 List the prime factors of 113059. 167, 677 What are the prime factors of 494? 2, 13, 19 What are the prime factors of 172000? 2, 5, 43 List the prime factors of 18619. 43, 433 What are the prime factors of 3330? 2, 3, 5, 37 What are the prime factors of 35862? 2, 3, 43, 139 What are the prime factors of 1151? 1151 What are the prime factors of 2826? 2, 3, 157 List the prime factors of 3386. 2, 1693 List the prime factors of 6664. 2, 7, 17 What are the prime factors of 18002? 2, 9001 What are the prime factors of 1759? 1759 What are the prime factors of 5628? 2, 3, 7, 67 List the prime factors of 11588. 2, 2897 What are the prime factors of 3166? 2, 1583 List the prime factors of 213. 3, 71 List the prime factors of 979. 11, 89 List the prime factors of 56028. 2, 3, 7, 23, 29 List the prime factors of 6031. 37, 163 List the prime factors of 668. 2, 167 Lis	{ "pile_set_name": "DM Mathematics" }
-12m3 Collect the terms in 2w*3 - 16212528 + 16212528. 2w*3 Collect the terms in -1 - 14g*2 + 36g + 14g + 107g*2. 93g*2 + 50g - 1 Collect the terms in -5014885082 + 4z + 5014885082. 4z Collect the terms in -49v + 49v + 15950v3. 15950v*3 Collect the terms in 7 + 10r*2 - 4r - 19r + 7r*2 - 52r. 17r2 - 75r + 7 Collect the terms in 16816x - 2195x*2 - 16816x. -2195x2 Collect the terms in -84w*2 - 1 + 265w*2 + 1 + 222w*2. 403w*2 Collect the terms in -379 + 758 - 379 - 92u. -92u Collect the terms in -20 + 20 - 945j*2 + 959j*2. 14j*2 Collect the terms in 17f*2 + 2f*2 + 49f*3 - 19f*2 + 51f*3. 100f*3 Collect the terms in 268i*3 - 542i*3 + 266i*3. -8i*3 Collect the terms in -7g - 68g2 + 6g - 27g2 - 5g. -95g2 - 6g Collect the terms in -3f + 2f + 34 - 4f - 292 + 3f. -2f - 258 Collect the terms in 10i*3 - 32i*3 + 9i*3 + 0i*3 + 8i*3. -5i*3 Collect the terms in -3196d + 6402d - 3199d. 7d Collect the terms in -28v*3 - 2418v*2 + 809v*2 + 807v*2 + 802v*2. -28v*3 Collect the terms in -355 + 355 + 24187v*3. 24187v*3 Collect the terms in -185r - 96r - 43 + 44 + 47r. -234r + 1 Collect the terms in 69a*2 + 1241a - 2474a + 1233a. 69a2 Collect the terms in 4g*2 - 159g + 159g - 3g*2 + 4809g*3 - 2. 4809g3 + g2 - 2 Collect the terms in -491h2 - h + h + 6579h*2. 6088h*2 Collect the terms in 2005h*3 - 15 - 1998h*3 + 15. 7h*3 Collect the terms in -24g*3 - 122 - 118 + 240. -24g*3 Collect the terms in -6w*2 + 6w*2 - 55w*3 + 296 + 25w*3 + 28w*3. -2w*3 + 296 Collect the terms in 10064d - 10064d + 40 - 4d*2 - 40. -4d*2 Collect the terms in -18i + 1 + 4 - 10 - 5. -18i - 10 Collect the terms in 1042v*3 - 2161v*3 + 1124v*3. 5v3 Collect the terms in -p3 - 98p - 224p + 322p + 3p*3. 2p*3 Collect the terms in v + 1869v*3 - v + 2304v*3 - 4178v*3. -5v*3 Collect the terms in -37g*2 - 37g*2 + 80g*2 - 42g*2. -36g*2 Collect the terms in -10t*3 - 7t*3 + 184t*3. 167t*3 Collect the terms in 109168a*2 + 107803a*2 - 61945a*2. 155026a*2 Collect the terms in -14 - 10 - 4k*2 + 35 - 37k*2. -41k*2 + 11 Collect the terms in -10 + 20 - 625z + 14. -625z + 24 Collect the terms in 23m*2 - 53m - m*2 - 31m + 84m. 22m*2 Collect the terms in -1820 + 1819 + 447r - 136r. 311r - 1 Collect the terms in -62 + 8u + 24 + 2u*3 - 8u + 38. 2u3 Collect the terms in 325 + 295 - 7q + 4q - 610. -3q + 10 Collect the terms in 8t2 - 88t + 9t2 - 5t*2 + 88t - 17t2. -5t*2 Collect the terms in -82g + 82g - 6g*3 - 12g*3 + 3g*3 - 8g*3. -23g*3 Collect the terms in -172c*2 + 31 + 338c*2 - 167c2. -c2 + 31 Collect the terms in -6l2 - 73l*2 + 59l*2. -20l*2 Collect the terms in -52 + 116k*2 - 88 - 116k*2 + 140 - 2k*3. -2k*3 Collect the terms in 65j*3 + 14j*3 - 532 - 38j*3 - 44j*3. -3j*3 - 532 Collect the terms in -1545z + 27z + 100z. -1418z Collect the terms in -10f + 25 + 8f - f - 2f + 4f. -f + 25 Collect the terms in 191b*2 - 191b*2 + 475b*3. 475b3 Collect the terms in y2 + 16 + 35y3 - 12y*3 - 76y*3. -53y3 + y2 + 16 Collect the terms in -27f - 28f - 17f + 68f. -4f Collect the terms in -8u + 50 - 11 - 21 - 18. -8u Collect the terms in 10 - 1 - 30233404v + v*3 - 9 + 30233404v. v*3 Collect the terms in -173i*3 - 3i*2 - 6 + 7i*2 + 1 + 4. -173i*3 + 4i*2 - 1 Collect the terms in -106m + 23 + m*3 - 22 + 106m - 3m3 + 0m*3. -2m*3 + 1 Collect the terms in 37l + 121l + 14 - 14 - 36l. 122l Collect the terms in -12224147m + 12224147m - m2. -m2 Collect the terms in -2692x*2 - 6x*3 - 5x*3 + 2692x*2 - 3x*3. -14x*3 Collect the terms in -701u*2 - 724u*2 - 116u*2 + 279u*2. -1262u*2 Collect the terms in 10o*3 + 0o*3 + 9o*3 - 6o*3 + 7o*3 - 15o*3. 5o*3 Collect the terms in 3 - 3 + 1375i*3 - 638i*3 - 615i*3 - 143i*3. -21i*3 Collect the terms in 33y*3 - 1935 + 1935. 33y*3 Collect the terms in 4 - 16 + 12 + 27o*2 + 13o*3 - 35o*2. 13o*3 - 8o*2 Collect the terms in 11114s*2 - 22225s*2 + 7 + 11115s*2. 4s*2 + 7 Collect the terms in -4654b*2 + 2404b*2 + 2893b*2. 643b*2 Collect the terms in -45h*3 - 5h + 2h - 102h*3 + 3h. -147h3 Collect the terms in -3947s + 73s + 79s. -3795s Collect the terms in -17g + 57g - 20g - 4g3 - 13g - 7g. -4g*3 Collect the terms in -449765 + 449765 - 35u*2. -35u*2 Collect the terms in -259356 + 259356 - 53v*2. -53v*2 Collect the terms in 50o*3 - 313o*2 + 313o*2. 50o*3 Collect the terms in -107y*3 + 1 - 1 - 3y*3 + 20y*3. -90y*3 Collect the terms in b - b + 10007295 + 13b*2 - 10007295. 13b*2 Collect the terms in 480v + 4v2 - 239v - 9v2 - 241v. -5v2 Collect the terms in -11 - 4n - 8 + 19. -4n Collect the terms in 194m*3 + 935m*3 - 132m*3 - m. 997m*3 - m Collect the terms in 22 - 3l + 149 + 47 + 178. -3l + 396 Collect the terms in 14v + 20v - 8v + 5v + 0v. 31v Collect the terms in -3003s*3 + 1601s*3 + 1396s*3. -6s*3 Collect the terms in -21 + 41u*3 - 150u*3 + 21. -109u*3 Collect the terms in -2d - 5d2 + 2d - 35d2. -40d*2 Collect the terms in -16c - 23c - 7c + 47c - 8c - 12c. -19c Collect the terms in 149 - 149 - 1113x2. -1113x*2 Collect the terms in 1 - 29157k - 1 + 29153k. -4k Collect the terms in -10m3 + 15m*3 + 247m*2 + 2m*3 - 247m*2 - 41. 7m*3 - 41 Collect the terms in -28s - 32s - 258 + 259. -60s + 1 Collect the terms in -437y2 - 443y*2 + 879y2. -y2 Collect the terms in -960j + 126 + 78 + 964j. 4j + 204 Collect the terms in 2396 + 18n + 2393 - 7180 + 2391. 18n Collect the terms in 241v + 59v + 275v - 372v. 203v Collect the terms in -2 - 125w2 - 4346w*3 + 3 + 125w*2. -4346w*3 + 1 Collect the terms in -448t*2 + 1807t*2 - 448t*2 - 452t*2 - 466t*2. -7t*2 Collect the terms in 115b*2 - 181b*2 - 220b*2. -286b*2 Collect the terms in 70k*3 - 810k*3 - 116k*3. -856k*3 Collect the terms in 2972w*2 - 1475w*2 - 1501w*2. -4w*2 Collect the terms in -1011c*2 + 3 - 2 + 1061c*2. 50c*2 + 1 Collect the terms in -77l*3 + 8l*3 + 67l*3. -2l*3 Collect the terms in -31n - 98n + 0 - 27n - n - 1. -157n - 1 Collect the terms in 41 - q2 - 2q + 44 - 85. -q*2 - 2q Collect the terms in -66s - 53s*3 + 47s + 19s. -53s*3 Collect the terms in 8a*2 - 5a*2 - 11a*2 - 5a*2 - 3a*2 - 9a*2. -25a*2 Collect the terms in -48 + 22 + 17 + 19 - j + 2. -j + 12 Collect the terms in -17i + 1 - 67i - 133i. -217i + 1 Collect the terms in 601 - 107g + 608 - 1210. -107g - 1 Collect the terms in -70z - 73z + 5 + 225z - 77z. 5z + 5 Collect the terms in 17 + 40 + 44 - 101 - 6m2. -6m*2 Collect the terms in -2424w + 2413w + 25 - 25. -11w Collect the terms in -4m2 + 54 - 19m3 + m2 + 17m3. -2m*3 - 3m*2 + 54 Collect the terms in 11j*2 - 4j*2 + 37j*3 - 7j*2 - 98j*3. -61j*3 Collect the terms in 1465f*3 + 1414f*3 - 4348f*3 + 1464f*3. -5f*3 Collect the terms in -2755v + 1417v + 1353v. 15v Collect the terms in -291z + 134z + 142z. -15z Collect the terms in 13 + 0o*3 + 5o*3 + 12. 5o*3 + 25 Collect the terms in -8z*2 + 691 + 6z*3 - 1419 + 8z*2 + 728. 6z*3 Collect the terms in -11b*2 + 2b*2 - 2b*2 - 6b*2 - 5b*2 + 19b*2. -3b*2 Collect the terms in 4113 - 5t*3 - 4113. -5t*3 Collect the terms in -89l*3 - 44l*3 + 47l*3 + 34l*3 - 88l*3. -140l*3 Collect the terms in -5r + 15r - 38r*2 + 16r*2 - 8r. -22r2 + 2r Collect the terms in 692g + 563g - 319g. 936g Collect the terms in 8s + 623s*2 - 8s - 589s2. 34s*2 Collect the terms in -65280s*2 + 65280s*2 + 271s*3. 271s*3 Collect the terms in -15821t + 14 - 19374t - 14. -35195t Collect the terms in 687i - 1295i - 8i2 + 694i. -8i2 + 86i Collect the terms in 14h2 - 18h*2 + 15h*2 - 21h*2. -10h*2 Collect the terms in 132u - 52u + 139u. 219u Collect the terms in -35v - 144v - 38v - 32v. -249v C	{ "pile_set_name": "DM Mathematics" }
) - 33i(m). 11m*2 Let w be (-112)/(-24)((-45)/6)/5. Let u(g) = -26g3 + 7g + 13. Let k(m) = 13m3 - 3m - 6. Give wk(s) - 3u(s). -13s3 + 3 Let b(o) = 28o - 741. Let i(f) = 12f - 247. Determine -3b(y) + 8i(y). 12y + 247 Let k(x) = 145469x3 - 204x*2 - 102x + 102. Let d(f) = -7096f3 + 10f*2 + 5f - 5. Give 102d(w) + 5k(w). 3553w3 Let h(o) = 1. Let j(a) = 39a2 - 3. Let y(g) = -g3 - 23g2 - 39g - 375. Let b be y(-22). Calculate bj(q) - 3h(q). -39q2 Let q(h) = -4889626h*3 + 30947h*2 - 8842h. Let r(a) = 4425a3 - 28a*2 + 8a. What is -4q(x) - 4421r(x)? -4421x3 Let b = -248 + 253. Let m(k) = -6k + 7. Suppose 2o + 12 = 6. Let q be (-6)/(-15) - o/5. Let v(f) = f - 1. Give bv(h) + qm(h). -h + 2 Let h(x) be the first derivative of -x2/2 - x + 1. Let b(n) = -253n + 28. Let p be b(-4). Let w = p + -1035. Let y(o) = 4o + 3. Determine wh(z) + y(z). -z - 2 Let t be 42(-9)/24. Let g(h) = -6h2 - 3h. Let b(w) = 7w2 + 4w - 1. Let o be -7 - (-5)/(20/13) - (-5)/(-20). Give og(x) + tb(x). 3x2 + 3 Let q(i) = i3 - i - 1. Let c(v) = v3 - 3v - 3. Let h be ((-16)/(-10))/(18/1035). Suppose -26z = -3z + h. Calculate zq(x) + c(x). -3x*3 + x + 1 Let s(w) = 11w*3 + 7w*2 - 4w + 1. Let x(r) be the third derivative of -r6/12 - r5/10 + r4/8 - r3/6 - 1278r2. Calculate -3s(v) - 4x(v). 7v*3 + 3v*2 + 1 Let t(v) = -434v - 50. Let s(u) = -36u + 1. Give -12s(b) + t(b). -2b - 62 Let p(t) = t3 + 7t + 6. Let w be 27/(-15) - (-231)/(-55). Let q(x) = 6x + 5. Give wp(a) + 7q(a). -6a*3 - 1 Let d(t) = -72t*3 - 10t*2 - 26t + 140. Let w(o) = 24o3 + 3o*2 + 9o - 40. What is -2d(p) - 7w(p)? -24p3 - p2 - 11p Let d(q) = q. Suppose -a + 4t = -13, -t - 1944 + 1940 = -a. Let v(o) = -8o*2 - 6o. What is av(h) + 2d(h)? -8h2 - 4h Let c(l) = l + 1. Let b(t) = -t + 0t - 12 + 15 - 5 - 6. Give -b(n) - 6c(n). -5n + 2 Let d(i) = 3i*3 - 6i*2 - 5i. Let v(z) = -z*3 + 3z*2 + 2z. Let x = -5252 + 5247. Calculate xv(a) - 2d(a). -a*3 - 3a*2 Let b(u) = 7u*3 + 10u*2 + 1. Let z(j) = 3j*3 + 5j*2. Let g = -344 + 355. Suppose -o - 22 = 4i, go - 7o - 2i - 2 = 0. Determine ob(f) + 5z(f). f3 + 5f2 - 2 Let j(z) = -z2 - 16z + 52. Let u be j(-19). Let t(c) = c - 1. Let a(h) = -4h + 19. Determine ut(r) - a(r). -r - 14 Let o(g) = 1935g + 60. Let v(d) = -644d - 17. Determine 2o(a) + 7v(a). -638a + 1 Let f(m) = -3m3 - 17m*2. Let z(u) = 4u*3 + 17u*2. Let n = -1674 + 1678. What is nz(o) + 5f(o)? o3 - 17o2 Let l(r) be the third derivative of r6/40 - 139r5/60 + 17r*3/6 + 991r2. Let g(d) = -d3 + 46d2 - 6. What is 17g(p) + 6l(p)? p3 - 52p*2 Let p(k) = -3k*2 + 0k*2 + 7k*2. Let o(s) = 2s*2 - 2. Let l(z) = 95z*2 - 90. Let i(h) = l(h) - 45o(h). Let n = 25 + -31. What is np(f) + 5i(f)? f2 Let k(y) be the third derivative of -y4/6 + y*3 + 3y*2. Let p(s) = -43141 + 21566 + 21572 + 2s. Calculate -4k(b) - 9p(b). -2b + 3 Let h = -134 + 129. Let j(l) = -l - 4. Let x(a) be the third derivative of -a3/2 + 36a*2. What is hj(k) + 6x(k)? 5k + 2 Let j(k) = 11k3 - 371k*2 - 13k + 7. Let i(a) = -30a3 + 990a*2 + 34a - 19. Calculate 7i(y) + 19j(y). -y*3 - 119y*2 - 9y Let m(t) = -t - 5. Let d(h) = 1170 + h*2 - 593 + h - 571. Give 2d(l) + 3m(l). 2l*2 - l - 3 Suppose -p = -2n - 9, -n - 18p = -22p - 13. Let d(x) = 2x3 - 5x*2 - 4x - 7. Let c(u) = 3u3 - 9u*2 - 7u - 13. Calculate nd(q) + 4c(q). -2q3 - q2 - 3 Let q(p) = 307p*3 + 4p*2 + 2. Let w(j) = -615j*3 - 9j*2 - 5. Calculate 9q(r) + 4w(r). 303r*3 - 2 Let o(y) = -5y*2 + 11y. Let j = 32 + -31. Suppose -u - 31 = 3d, j = 2u - 3. Let r(i) = 38i + 3i*2 - 19i - 25i. Give dr(g) - 6o(g). -3g2 Let g = -101770 + 101759. Let c(q) be the first derivative of q3 + q*2/2 - 2q - 2. Let b(p) = -9p2 - 3p + 6. What is gc(o) - 4b(o)? 3o2 + o - 2 Let z(w) be the first derivative of w3/3 - w2/2 + w - 2404. Let c(y) = -4y*2 - 3y + 3. Let p = -5 + 4. Determine pc(a) + 3z(a). 7a2 Let p(r) = 7r*3 + 12r*2 - 75r + 2. Let k(x) = 4x3 + 8x*2 - 75x + 1. What is 3k(y) - 2p(y)? -2y3 - 75y - 1 Let w be (-15)/(-21) + -1 + 153/119. Let h be ((w/(-2))/1)/((-21)/(-210)). Let i(x) = -1 + 0 + x - 2 + 9. Let y(a) = -a - 7. Give hy(c) - 6i(c). -c - 1 Let j(l) = -2l2 - 9l - 15. Let f(u) = 3u2 - 263u + 28. Let a(z) = -9z2 + 743z - 83. Let s(m) = -6a(m) - 17f(m). Calculate 7j(d) + 5s(d). d*2 + 2d + 5 Let c(g) = 53g - 2 + 26g - 80g. Let s = 41 - 38. Let y(m) = m + 2. What is sy(d) + 4c(d)? -d - 2 Let v(x) = 37x*2 - 13x - 3. Let j(s) = -12s2 + 2s - 1. Let w(d) = 3j(d) + v(d). Let r(q) = 2q*2 - 15q - 13. Determine 3r(m) - 7w(m). -m*2 + 4m + 3 Suppose 9 = -3c - 5t, -2c - 2t = 2c - 2. Suppose p = 3j + 33, 9 = cp - 5p. Let g(h) = -h + 1. Let a(w) = -12. Determine jg(l) - a(l). 12l Let m(x) = -x. Let c(j) = 225j2 + 205j*2 + 1 + 5j - 421j2. Determine -c(v) - 5m(v). -9v2 - 1 Let g(k) = 2k - 1. Let r(u) = u*2 + 7u - 1. Let x(p) = 7g(p) - 2r(p). Let n(l) = -l*2 - l + 1. What is n(h) + x(h)? -3h*2 - h - 4 Let s = -4 - 2. Let k(m) = 3m*2 + 14m - 11. Let w(q) = 5q + 7q*2 + 3q*2 - 25q*2 + 16q*2 - 4. What is sk(z) + 17w(z)? -z2 + z - 2 Let d(n) = -12n. Suppose 0 = -2h + 3a - 2, -2a + 2 = -2. Let z(q) = -q3 - 7q*2 + 7q - 1. Let s be z(-8). Let j(l) = -s - l + 7. Give hd(k) - 20j(k). -4k Let q(t) = 126t + 22. Let u(k) = -188k - 31. Give -7q(c) - 5u(c). 58c + 1 Let n(z) = 109z - 58. Let t(m) = 108m - 78. Determine -4n(l) + 3t(l). -112l - 2 Let q(r) = -2r - 6. Let u(t) = -167t + 33. Determine 5q(y) + u(y). -177y + 3 Let x(c) = -5c + 72. Let r(u) = -10u + 148. Determine -5r(q) + 11x(q). -5q + 52 Let x(k) = -k*2 + 1. Let l(s) = -7s*3 + 21s*2 - 21. Suppose -4m = -2b + 374, -2m = -5m + 3. Suppose b = -8h + 17h. What is hx(p) + l(p)? -7p3 Let s(t) = 13t - 4. Suppose 4c - 45 = -c. Suppose -3 = 5j + 17. Let l(m) = -2346m - 2321m + 9358m - 2342m - 2 - 2343m. What is cl(n) + js(n)? 2n - 2 Let n(c) = -1. Let g(l) = -28l - 39l + 147l - 36l - 8 - 29l. Determine g(b) - 5n(b). 15b - 3 Let l(c) = -744c - 5. Let j(a) = -447a - 3. What is 13j(r) - 8l(r)? 141r + 1 Let i(v) = 5v - 6. Let j(d) = 3d - 1. Let n(y) = -i(y) + 3j(y). Let c(b) = -3b - 3. Let z = 326 - 331. What is zc(q) - 4n(q)? -q + 3 Let k(h) = 224793724h3 + 403953h*2 - 73446h + 36723. Let v(q) = 12243q3 + 22q*2 - 4q + 2. What is -2k(n) + 36723v(n)? 12241n3 Let h(r) = -15r*2 - 12r + 29. Let y(g) = -17g2 - 14g + 33. Determine -10h(x) + 9y(x). -3x2 - 6x + 7 Let m(x) = -76x + 32. Let b(k) = -78k + 27. What is -4b(v) + 3m(v)? 84v - 12 Let z(x) = -17040x*2 + 17047x*2 - 11 + 3x*3 + 4 - 12x*3. Let c(s) = -5s*3 + 3s*2 - 3. Give 7c(l) - 3z(l). -8l*3 Let o(z) = 3z*3 - 2z - 4. Let j(f) = -f - 1. Let n be (-3)/((-40)/16 - (3 - (-38)/(-8))). What is nj(c) - o(c)? -3c*3 - 2c Let n be 4/((-20)/15) - -5. Let i(k) = 1 - 3237k + k2 - 8k*n + 3232k. Let f = 8 - 14. Let t(o) = 8o2 + 6o - 1. Give fi(d) - 5t(d). 2d2 - 1 Let h(r) = 3r. Let z(u) = -12u + 1. Suppose -x + 17 = 4a, -a + 2x + 2 = -0x. Suppose -9f + af = -10. Calculate fz(i) + 9h(i). 3i + 2 Let r(t) be the second derivative of 0t*2 + 0t*4 + 7/20t*5 + 13t + 0 + 5/6t3. Let s(g) = -3g*3 - 2g. Calculate 2r(i) + 5s(i). -i*3 Suppose x - 7 = 3t, -2x + 50 = 3t + 9. Suppose -2p + x - 8 = 0. Let r(s) = s3 - 5s. Let j(b) = b*3 - 6b. Give pj(f) - 5r(f). -f*3 + f Let l(q) = 34400q*3 + 256q*2 - 512q + 256. Let f(i) = 800i3 + 6i*2 - 12i + 6. Calculate -128f(o) + 3l(o). 800o3 Let o = 673 + -678. Let d(f) = 22f*2 - 8f - 56. Let j(v) = 15v2 - 5v - 37. Let u(n) = 5d(n) - 8j(n). Let s(t) = -3t2 + 5. Give ou(x) + 16s(x). 2x*2 Let u(i) = 29i - 4. Let n(f) = 4 - 16f + 4f + 4f - 3 + 7f. Calculate 4n(z) + u(z). 25z Let u(h) = 18850h + 220. Let z(a) = -2693a - 33. Give 3u(b) + 20z(b). 2690b Let k(o) = 3o*2 + 12o. Let p(u) = -u**3 -	{ "pile_set_name": "DM Mathematics" }
+ 1582 for u. -30 Solve -15w + 215 = 65 for w. 10 Solve 16490b - 5301 = 16319b for b. 31 Solve 28b + 336 = -84b for b. -3 Solve -2h + 33h = 7h + 288 for h. 12 Solve -16d - 309d + 8788 = 13d for d. 26 Solve -4m + 67 + 1 + 0 = 0 for m. 17 Solve -151a + 15 = 75 + 91 for a. -1 Solve 1741 = 120f - 164f + 25 for f. -39 Solve 74a - 426a - 9504 = 0 for a. -27 Solve -2149 = 6u - 4381 + 2184 for u. 8 Solve -760i + 867i + 1819 = 0 for i. -17 Solve -5g - 230 = -13g - 2g for g. 23 Solve -20 - 221 = 230j + 11j for j. -1 Solve -61r = -248r - 43r + 3220 for r. 14 Solve -29x + 54x + 275 = 0 for x. -11 Solve -67y + 183 = -85 for y. 4 Solve -59 = 432x + 226x + 1257 for x. -2 Solve -925g + 898g = 216 for g. -8 Solve m - 14 + 13 + 23 = 0 for m. -22 Solve 144a - 1936 = -321 + 401 for a. 14 Solve -87v - 112v - 585 = -244v for v. 13 Solve -9p - 9p + 39p = 210 for p. 10 Solve 75s + 41 = 37s + 155 for s. 3 Solve 417 = -18q + 129 for q. -16 Solve -224f - 444 - 287 = -267f for f. 17 Solve -51r + 438 = 14r + 8r for r. 6 Solve -529v + 506v = -10 + 148 for v. -6 Solve -210u + 48u = -3906 - 1116 for u. 31 Solve -5571 = -488f - 19235 for f. -28 Solve 302l - 608l = -316l + 10 for l. 1 Solve -153l - 12l = 2145 for l. -13 Solve -45r + 46 = -134 for r. 4 Solve -564x = -544x + 82 + 58 for x. -7 Solve 296 - 8 = -123g - 327 for g. -5 Solve -19h - 85 - 43 - 81 = 0 for h. -11 Solve 92 = -96j + 50j for j. -2 Solve 44 + 156 = 25a for a. 8 Solve b + 35 = 63 - 33 for b. -5 Solve 22m - 76 = 562 for m. 29 Solve 0 = 2038m - 2025m + 247 for m. -19 Solve 192 = 35j - 40 + 57 for j. 5 Solve 676u - 1033 - 331 - 664 = 0 for u. 3 Solve 215 - 9035 = -420b for b. 21 Solve -13d + 144 = 298 - 375 for d. 17 Solve -578h + 498h - 240 = 0 for h. -3 Solve -327 = -645u + 536u for u. 3 Solve -1312 = 84y + 19y + 61y for y. -8 Solve -22p - 108p - 1512 = -4p for p. -12 Solve -153f - 1566 + 160 = 583 for f. -13 Solve -210 = 120i + 1212 + 1578 for i. -25 Solve 0 = -3573w + 3604w + 279 for w. -9 Solve 14128d + 564 = 14081d for d. -12 Solve -12d + 39 = 21d - 20d for d. 3 Solve 69a = -452a + 5987 - 2340 for a. 7 Solve 102a = -20 + 20 for a. 0 Solve 32u - 39u - 3180 = -113u for u. 30 Solve -24784 = -3q - 24796 for q. -4 Solve 0 = 4a + 7a - 110 for a. 10 Solve -5 = 14i - 1 + 24 for i. -2 Solve -447x - 393x = -903x - 630 for x. -10 Solve -454 - 1562 = -712o + 640o for o. 28 Solve 20 - 138 + 64 = 9h for h. -6 Solve -244r + 171r = 1013 + 301 for r. -18 Solve -447 = 9y - 285 - 270 for y. 12 Solve -175d + 115d = -720 for d. 12 Solve 63d - 3 = 64d for d. -3 Solve 201 - 96 = -4a + 89 for a. -4 Solve -1753o - 24 = -1755o for o. 12 Solve 36 = -21222k + 21216k for k. -6 Solve 212u - 344u = -264 for u. 2 Solve -232t - 28768 = -36t + 703t for t. -32 Solve -21339 = 3x - 21300 for x. -13 Solve 1505a + 10871 = 336 for a. -7 Solve 2j - 68 - 64 = -130 for j. 1 Solve 110m - 212 = 1328 for m. 14 Solve 28q + 260 - 38 = -114 for q. -12 Solve 869 = -165d + 3344 for d. 15 Solve -615p + 6464 = 1455 - 9136 for p. 23 Solve -60 = 103o - 68o - 50o for o. 4 Solve 4c - 73c = 0 for c. 0 Solve -31663 + 30963 = 20b for b. -35 Solve -44j - 13j - 224 = -j for j. -4 Solve -1526y + 506y - 3619 - 1481 = 0 for y. -5 Solve 141t - t = -592 - 808 for t. -10 Solve s + 14s = -147 + 57 for s. -6 Solve 0 = 132n + 81n - 7n - 206 for n. 1 Solve 0 = 115j - 150 + 1990 for j. -16 Solve -4804 = 204p - 796 + 1296 for p. -26 Solve -62g + 946 = 636 for g. 5 Solve 205198 - 205120 = -13a for a. -6 Solve -232l = 44 - 49 + 237 for l. -1 Solve 0 = 676o + 134 - 12978 for o. 19 Solve 336f + 286 = 362f for f. 11 Solve 121167v + 102 = 121201v for v. 3 Solve 35f + 401 + 234 = 145 for f. -14 Solve 0 = -31v + 18v - 78 for v. -6 Solve 0 = -11484l + 11473l - 99 for l. -9 Solve 1609 = 505k - 182 + 276 for k. 3 Solve 6357 - 5847 = 15n for n. 34 Solve -83p + 206 = 123p for p. 1 Solve 25650 = -1112o + 257o for o. -30 Solve -245b + 3908 = 9543 for b. -23 Solve -965g = -5081 - 709 for g. 6 Solve -458 = b - 237 - 236 for b. 15 Solve -596j + 386j = -299j - 3382 for j. -38 Solve 0 = -24r + 12 + 32 - 68 for r. -1 Solve 9u - 182 - 52 = -9u for u. 13 Solve 4q - q = 8q - 70 for q. 14 Solve -13472y + 13340y = 2772 for y. -21 Solve -24w + 53w - 150 = 14w for w. 10 Solve 0 = -1704d + 1746d - 1428 for d. 34 Solve -3o = o + 88 - 120 for o. 8 Solve -8184 = -248v - 434v for v. 12 Solve 78d - 136 = 22d + 39d for d. 8 Solve 145 = -163i - 21 - 160 for i. -2 Solve 103i + 2181 = 636 for i. -15 Solve 190 - 324 = -58b - 1816 for b. -29 Solve 7k - 7 = -2k + 2k for k. 1 Solve -10 = 52g - 30g - 32g for g. 1 Solve -214d + 639 = -285d for d. -9 Solve -78x - 89x = 703x + 32190 for x. -37 Solve -564i = -455i - 1038 - 1796 for i. 26 Solve -7j = -7j - 2j - 12 for j. -6 Solve -150h + 198h = 816 for h. 17 Solve -273g + 153g - 156g + 2484 = 0 for g. 9 Solve -124 = -19m - 5m + 68 for m. 8 Solve -3n - 8n - 9n = 200 for n. -10 Solve -131z - 1592 = 2202 - 1043 for z. -21 Solve -10272 = -241l - 641l + 26l for l. 12 Solve -5b - 43b + 10b = -418 for b. 11 Solve 561 - 525 = -4y for y. -9 Solve -264k - 197 + 743 + 774 = 0 for k. 5 Solve -1045 = 265888g - 265943g for g. 19 Solve 497 = -20v + 85v + 6v for v. 7 Solve -2259m + 2241m = 162 for m. -9 Solve 248t - 263t = 75 for t. -5 Solve -425h - 9490 = -60h for h. -26 Solve -90k = -58k - 256 for k. 8 Solve 43v - 108 = 31v for v. 9 Solve 113 + 592 = 47g for g. 15 Solve 62o = -55o + 153o - 396 for o. 11 Solve -1600 = -126a + 777 - 361 for a. 16 Solve 54z = 65z - 55 for z. 5 Solve 366 = 4369q - 4308q for q. 6 Solve -10 - 34 = -5r + 16 for r. 12 Solve -991n = -877n - 684 for n. 6 Solve 32w - 251 = 213 + 144 for w. 19 Solve 391l = -1884 - 7891 for l. -25 Solve 0 = -62n - 166n + 456 for n. 2 Solve 4148g = 4132g - 32 for g. -2 Solve -101q + 73q = 224 for q. -8 Solve 37k + 0 + 137 = -122 for k. -7 Solve 1770 = -142w + 24w for w. -15 Solve 0f - 54 = 6f + 36 for f. -15 Solve -163 = 3l - 139 for l. -8 Solve 55n - 885 = -7n + 3n for n. 15 Solve -19t - 416 = -227t for t. 2 Solve 0 = -13k + 13 + 61 + 95 for k. 13 Solve -124750 = 15g - 125035 for g. 19 Solve 7r + 22 - 39 = 18 for r. 5 Solve 55d - 443d - 1552 = 0 for d. -4 Solve -399k = -395k - 48 for k. 12 Solve -249j + 186j - 552 = 1338 for j. -30 Solve 313 = -14j + 411 for j. 7 Solve -4569 = 368x + 1579 - 1364 for x. -13 Solve -211 = -53i - 66 + 226 for i. 7 Solve -17s = 51s + 20s + 2200 for s. -25 Solve 200 = -51099n + 51119n for n. 10 Solve -71b + 352 = -287 for b. 9 Solve 131 = 112u - 343 - 86 for u. 5 Solve 1986 - 8836 = 685v for v. -10 Solve -352 = 18d - 31d - 9d for d. 16 Solve 0 = 5l + 160 - 120 for l. -8 Solve -10w + 4w = 44w for w. 0 Solve -1423 = 17s - 1321 for s. -6 Solve -6409 + 1740 = -1453g + 4049 for g. 6 Solve -585 = -742q + 625q for q. 5 Solve -170h - 1244 - 1088 = -462 for h. -11 Solve -991x = -1038x - 940 for x. -20 Solve -83l - 2056 = 431l for l. -4 Solve 55c - 923 = -152c + 2389 for c. 16 Solve 4g - 14g = 14g + 504 for g. -21 Solve 252j - 1316 = 700 for j. 8 Solve 0 = 195v + 701v - 36140 + 9260 for v. 30 Solve -240 = -316s + 151s + 175s for s. -24 Solve 326a - 287a - 118 = 38 for a. 4 Solve 114z = 111z + 6 for z. 2 Solve 70 - 24 = -29x + 17 for x. -1 Solve 4c = 3c + 3 for c. 3 Solve -35u - 37u + 801 = 17u for u. 9 Solve 48d + 13d - 1944 = -20d for d. 24 Solve 62t + 293 + 199 = 21t for t. -12 Solve -970h = 685h - 384h + 5084 for h. -4 Solve 0 = -360h - 2184 + 402 - 378 for h. -6 Solve 95i + 4950 = -197i + 17i for i. -18 Solve -102a + 22 = -88a - 20 for a. 3 Solve -33w - 379 = -412w for w. 1 Solve -28m + 975 - 947 = 0 for m. 1 Solve -15l = 31l - 368 for l. 8 Solve 3x - 9 + 15 = -30 for x. -12 Solve -183 + 86 = -f - 85 for f. 12 Solve -1740 = -3467x + 3380x for x. 20 Solve 13d + 93 - 22 = -20 for d. -7 Solve 0 = -5y - 41268 + 41208 for y. -12 Solve 3904 = 361l + 11124 for l. -20 Solve 3710 = -41b + 75b + 72b for b. 35 Solve -34493c + 34509c + 64 = 0 for c. -4 Solve 59*t	{ "pile_set_name": "DM Mathematics" }
n*2 + 51n - 54. 3(n - 1)(n + 18) Find b, given that -5b3 - 55b*2 - 95b - 45 = 0. -9, -1 Solve -3i4/5 - 9i*3/5 + 3i*2 + 9i/5 - 12/5 = 0 for i. -4, -1, 1 Factor -w*4/3 - 5w*3/3 - 4w2/3. -w2(w + 1)(w + 4)/3 Factor -3p2 + 846p - 59643. -3(p - 141)2 Factor 3p*3/5 - 9p/5 + 6/5. 3(p - 1)2(p + 2)/5 Factor -243l4 - 540l*3 - 111l*2 - 6l. -3l(l + 2)(9l + 1)2 Find a such that a4/3 - 484a3/3 + 26082a*2 - 4251044a/3 + 4173281/3 = 0. 1, 161 Factor -k*2 - 119k. -k(k + 119) Find k, given that -4k*5 + 40k*4 - 148k*3 + 256k*2 - 208k + 64 = 0. 1, 2, 4 Factor -m*5/9 + 2m*4/9 + 4m*3/3 - 40m*2/9 + 32m/9. -m(m - 2)3(m + 4)/9 Factor 6g3 - 159g*2 - 81g. 3g(g - 27)(2g + 1) Factor -2h4 - 12h*3 - 8h*2 + 48h + 64. -2(h - 2)(h + 2)*2(h + 4) Factor -3i2 - 21i + 90. -3(i - 3)(i + 10) Suppose 2n2 - 164n + 320 = 0. What is n? 2, 80 Factor 3c5/4 + 555c*4 + 308025c*3/2 + 18994875c*2 + 3514051875c/4. 3c(c + 185)*4/4 Suppose -2o*3/9 + 50o*2/9 - 136o/9 + 88/9 = 0. What is o? 1, 2, 22 Suppose 6d3 - 80d*2/7 - 134d/7 - 12/7 = 0. What is d? -1, -2/21, 3 Factor -7s3/5 - 211s*2/5 - 233s/5 - 29/5. -(s + 1)(s + 29)(7s + 1)/5 Factor s3 + 45s*2 + 528s + 484. (s + 1)(s + 22)2 Factor -2v*5 - 22v*4 - 86v*3 - 146v*2 - 112v - 32. -2(v + 1)3(v + 4)*2 What is l in -3l*2/5 - 99l/5 + 102/5 = 0? -34, 1 Determine k, given that k*4/2 + 5k*3/2 - 3k*2/2 - 13k/2 + 5 = 0. -5, -2, 1 Factor -q*2 + 238q - 14161. -(q - 119)*2 Factor 50j*3/13 + 1760j*2/13 - 1432j/13 + 288/13. 2(j + 36)(5j - 2)2/13 Solve -3r*3 - 387r*2 - 14040r - 97200 = 0 for r. -60, -9 Factor -9t3 - 41t*2 - 34t + 24. -(t + 2)(t + 3)(9t - 4) Find i such that -63001i*2 + 8032i - 256 = 0. 16/251 Find u such that -2u4/3 - 8u*3 - 38u*2/3 + 8u + 40/3 = 0. -10, -2, -1, 1 Let 5q5 - 20q*4 - 35q*3 + 170q*2 - 120q = 0. Calculate q. -3, 0, 1, 2, 4 Suppose -2v3/9 + 10v*2 - 58v/3 + 86/9 = 0. Calculate v. 1, 43 Factor x*4/8 + 3x*3/4 - 27x*2/2 - 115x/4 - 117/8. (x - 9)(x + 1)2(x + 13)/8 Solve 16v5/15 + 10v*4/3 - 14v*3/5 - 182v*2/15 - 118v/15 - 4/5 = 0. -3, -1, -1/8, 2 Solve -5n3 - 7885n*2 - 3120455n - 9290535 = 0. -787, -3 Factor -4x3 + 272x*2 - 4624x. -4x(x - 34)*2 Factor -2t*2 - 48t - 46. -2(t + 1)(t + 23) Let 4y2 + 584y + 21316 = 0. What is y? -73 Let -f*3 - 72f*2 - 528f - 1024 = 0. Calculate f. -64, -4 Factor 2f5/15 - 142f*4/3 - 1450f*3/3 - 3650f*2/3. 2f*2(f - 365)(f + 5)2/15 Determine k, given that -5k*4 + 45k*3 + 710k*2 + 1740k + 1080 = 0. -6, -2, -1, 18 Find t, given that -2t2/11 - 128t/11 - 2048/11 = 0. -32 Factor -s*3/5 - 24s*2/5 - 31s - 60. -(s + 4)(s + 5)(s + 15)/5 Factor -3t3 + 828t*2 - 56295t - 115926. -3(t - 139)2(t + 2) Solve 5c3 - 90c*2 - 420c - 440 = 0. -2, 22 Find b, given that 27b5 - 79b*4 + 21b*3 + 83b*2 - 48b - 4 = 0. -1, -2/27, 1, 2 Factor b*2/3 - 19b + 56/3. (b - 56)(b - 1)/3 Find o, given that -32o*3/5 + 2224o*2/5 - 1106o/5 + 138/5 = 0. 1/4, 69 Determine c, given that -c*2/2 + 39c/2 - 19 = 0. 1, 38 Solve 3h2/4 - 75h/2 + 1875/4 = 0. 25 Let -p3 - p2 + 16p - 20 = 0. Calculate p. -5, 2 Suppose -3o*4 + 276o*3 + 2034o*2 + 4428o + 2673 = 0. Calculate o. -3, -1, 99 Factor 2197845z2 + 13260z + 20. 5(663z + 2)2 Determine w, given that w4 + 62w3 + 513w*2 - 14060w + 43808 = 0. -37, 4, 8 Factor -5x3 + 35x*2 - 70x + 40. -5(x - 4)(x - 2)(x - 1) Factor -2n*3/11 + 2n*2/11 + 10n/11 + 6/11. -2(n - 3)(n + 1)*2/11 Let 18o*5 + 1866o*4/7 - 2368o*3/7 + 520o*2/7 + 128o/7 = 0. Calculate o. -16, -1/7, 0, 2/3 Factor -2y2 - 204y + 206. -2(y - 1)(y + 103) Suppose 6p5 + 104p*4 - 96p*3 - 416p*2 + 288p = 0. Calculate p. -18, -2, 0, 2/3, 2 Factor 5d3 + 145d*2 + 1400d + 4500. 5(d + 9)(d + 10)*2 Let 8o*3 + 138o*2 + 454o - 600 = 0. What is o? -12, -25/4, 1 Factor 5l4 - 510l*3 - 515l*2. 5l*2(l - 103)(l + 1) Suppose 3k*4 + 171k*3 - 177k*2 - 171k + 174 = 0. What is k? -58, -1, 1 Factor f*4/3 + 5f*3 - 37f*2/3 - 17f. f(f - 3)(f + 1)(f + 17)/3 Factor n5 + 1068n*4 + 284085n*3 - 572450n2. n2(n - 2)(n + 535)*2 Factor 5r*2 + 1140r. 5r(r + 228) Determine m, given that -18m5/5 - 32m*4/5 - 2m*3 + 4m*2/5 = 0. -1, 0, 2/9 Factor 3p*2/4 + 111p/4 + 120. 3(p + 5)(p + 32)/4 Factor -w*5/4 + 13w*4/4 - 11w*3/2 - 63w*2 + 162w + 216. -(w - 6)*3(w + 1)(w + 4)/4 Factor -4k*4 - 8k*3 + 192k*2 - 504k + 324. -4(k - 3)2(k - 1)(k + 9) Factor m5/2 + m4 - 3m*3 - 2m*2 + 13m/2 - 3. (m - 1)*3(m + 2)(m + 3)/2 What is z in -2z*2/3 - 30z + 92/3 = 0? -46, 1 What is h in -h*2/7 + 502h/7 + 503/7 = 0? -1, 503 Let -12c5 + 32c*4 + 68c*3 - 152c*2 - 80c + 96 = 0. What is c? -2, -1, 2/3, 2, 3 Find q such that -q*4/4 + 99q*3/2 - 9601q*2/4 - 4950q - 2500 = 0. -1, 100 Factor -z*2/4 - 197z - 38809. -(z + 394)*2/4 Solve 3r*4 - 12r*3 + 9r*2 + 12r - 12 = 0. -1, 1, 2 Suppose 3t2 - 1026t - 1029 = 0. What is t? -1, 343 Factor -d*2/2 - 3d/2 + 377. -(d - 26)(d + 29)/2 Factor -2l*4/9 - 454l*3/9 - 25990l*2/9 - 25538l/9. -2l(l + 1)(l + 113)2/9 Find a such that 9a*3/8 + 1785a*2/8 - 1193a/8 + 199/8 = 0. -199, 1/3 Let -2y5/5 + 24y*4/5 + 2y*3/5 - 24y*2/5 = 0. What is y? -1, 0, 1, 12 Let 4t*2 - 2340t + 2336 = 0. What is t? 1, 584 Suppose -k*4/2 + 12k*3 - 83k*2/2 + 30k = 0. Calculate k. 0, 1, 3, 20 Factor -2c3/13 - 10c*2/13 - 4c/13 + 16/13. -2(c - 1)(c + 2)(c + 4)/13 What is n in -4n*2/9 - 800n/3 - 40000 = 0? -300 Factor -55y2 - 19685y + 1790. -5(y + 358)(11y - 1) Factor 5q*3 - 6555q*2 + 2145120q + 2151680. 5(q - 656)2(q + 1) What is z in 2z4/5 - 303z*3/5 + 1891z*2/5 - 174z = 0? 0, 1/2, 6, 145 Factor 3z4 + 9z*3 - 60z*2 - 144z + 192. 3(z - 4)(z - 1)(z + 4)2 What is c in -64c*5/7 - 416c*4/7 + 1788c*3/7 + 3272c*2/7 + 1276c/7 + 144/7 = 0? -9, -1, -1/4, 4 Factor -2s2/3 + 64s/3 + 152. -2(s - 38)(s + 6)/3 Let 3s2 + 438s = 0. Calculate s. -146, 0 Let 3v3 - 2061v*2 + 2058v = 0. Calculate v. 0, 1, 686 Factor -4d2 - 12d + 40. -4(d - 2)(d + 5) What is m in -m*5 - 7m*4 - 15m*3 - 13m*2 - 4m = 0? -4, -1, 0 Find k such that -8k2 - 86k/3 - 20/3 = 0. -10/3, -1/4 Solve 5l5 + 35l*4 + 90l*3 + 100l*2 + 40l = 0 for l. -2, -1, 0 Factor -2x2 + 120x - 118. -2(x - 59)(x - 1) Factor -3s2/2 - 96s + 2475/2. -3(s - 11)(s + 75)/2 Factor u*5 - 5u*4 - 7u*3 + 5u*2 + 6u. u(u - 6)(u - 1)(u + 1)2 Suppose -2s*2/13 - 662s/13 + 1332/13 = 0. Calculate s. -333, 2 Find w such that -w*3 - 13w*2 - 35w + 49 = 0. -7, 1 Find t, given that -6t3 + 128t*2 + 538t + 300 = 0. -3, -2/3, 25 What is s in -s*2/5 - 64s/5 = 0? -64, 0 Solve -9f4 + 21f*3 - 6f*2 = 0. 0, 1/3, 2 Let 2c*2/13 + 668c/13 - 3390/13 = 0. What is c? -339, 5 Let -a*2 + 1609a = 0. Calculate a. 0, 1609 Factor -3i3 - 10890i*2 - 21771i - 10884. -3(i + 1)2(i + 3628) Let z*4/7 - 20z*3 - 429z*2/7 - 4z/7 + 572/7 = 0. Calculate z. -2, 1, 143 Find d such that d*4/7 - 8d*3/7 + 9d*2/7 + 18d/7 = 0. -1, 0, 3, 6 Factor 3u3/2 - 309u*2/2 + 153u. 3u(u - 102)(u - 1)/2 Let 5f*3 + 40f*2 + 80f = 0. What is f? -4, 0 Find u, given that -u*2/5 + 132u/5 - 4356/5 = 0. 66 Determine s so that 2s2 + 7084s + 6272882 = 0. -1771 Let -2a2/7 + 52a/7 + 310/7 = 0. What is a? -5, 31 Factor -2p2/3 - 1126p - 3376/3. -2(p + 1)(p + 1688)/3 Determine y, given that -3y3/8 + 315y*2/2 - 22050y + 1029000 = 0. 140 Factor -4o2 - 1660o - 3304. -4(o + 2)(o + 413) Solve 27n4 - 36n*3 + 12n*2 = 0 for n. 0, 2/3 Factor 2c*3/7 + 52c*2/7 + 384c/7 + 576/7. 2(c + 2)(c + 12)*2/7 Suppose -26f*3/7 + 4f*2/7 + 104f/7 - 16/7 = 0. Calculate f. -2, 2/13, 2 Factor y*3/3 + 10y*2/3 + 31y/3 + 10. (y + 2)(y + 3)(y + 5)/3 Factor 3i5 - 21i*4 + 30i*3 + 6i*2 - 33i + 15. 3(i - 5)(i - 1)*3(i + 1) Determine m, given that m*3 + 30m*2 - 99m = 0. -33, 0,	{ "pile_set_name": "DM Mathematics" }
- 1)(o + 1)2 Let r(q) be the first derivative of -4 - 18/7q + 6/7q2 - 2/21q*3. Let r(v) = 0. Calculate v. 3 Let s(b) be the second derivative of 0b*2 + 0 - 3b - 7/20b4 - 1/5b*3. Suppose s(r) = 0. What is r? -2/7, 0 Let s = -20 - -23. Let w(k) be the second derivative of 0k*2 + 0k*4 + 0 + 1/30k*6 + 0k*s - k + 1/20k5. Factor w(z). z3(z + 1) Factor 28u*2 - 31u2 - u3 - 8u3. -3u*2(3u + 1) Let 0 + 0x*3 - 1/8x*5 + 1/8x + 1/4x4 - 1/4x*2 = 0. Calculate x. -1, 0, 1 Let q be ((-12)/(-3))/(-2 + 3). Factor 2 + 3 - 4z - 7 - 9zq + 2z*2 + 1 + 12z3. -(z - 1)2(3z + 1)2 Let w(i) be the second derivative of i5/20 - i4/12 + i3/6 + 3i2/2 - 3i. Let b be w(0). Find p such that -p*3 - 6p2 - p3 - 5 + b - 6p = 0. -1 Let l(x) be the first derivative of -1/16x*4 + 1/12x*3 + 4 + 1/8x*2 - 1/4x. Factor l(i). -(i - 1)*2(i + 1)/4 Let 16/7 - 12/7n2 + 8/7n - 10/7n3 - 2/7n*4 = 0. What is n? -2, 1 Let v(i) = 3i. Let n be v(-1). Let d be n/(-18) + 1/3. Solve 0 + 0z - dz4 + z3 - 1/2z2 = 0. 0, 1 Let w(n) be the first derivative of 2n*3/21 + 2n*2 + 14n + 43. Factor w(h). 2(h + 7)2/7 Let m(p) be the third derivative of -7p*5/12 - 15p*4/8 - 5p*3/3 - 6p*2. Suppose m(q) = 0. Calculate q. -1, -2/7 Let w(y) be the second derivative of 2y*7/49 + 10y*6/21 + 71y*5/35 + 29y*4/7 + 92y*3/21 + 16y*2/7 - 17y + 1. Find f, given that w(f) = 0. -4, -2, -1, -1/3 Let g(n) be the first derivative of -n*4/2 + 10n*3/3 - 8n*2 + 8n - 17. Factor g(w). -2(w - 2)2(w - 1) Let p be (0 - 0)/(-2 - -1). Suppose pt = -2t - 4r + 26, 25 = 5t + 2r. Suppose -k2 + 6k - 3kt + 2k*3 - 3k - k = 0. Calculate k. -2, 0, 1 Let m be 1(2 + (-3 - -1)). Factor 0 + 1/3p*3 - 1/3p*2 + mp. p*2(p - 1)/3 Let r(y) = 6y. Let b be r(1). Factor -bq + q*2 + 4q*2 - 2q*2. 3q(q - 2) Let d be 126/27 + 2/(-3). Let q be (-3)/(1/d-6). Factor 0w4 + 0 + 0w*q + 4/3w*3 - 2/3w*5 - 2/3w. -2w(w - 1)*2(w + 1)*2/3 Let f = 18 + -18. Let n(p) be the second derivative of 1/21p*4 - 2/105p*6 - 2p - 1/21p3 + 1/147p*7 + 0p*5 + f + 0p*2. Suppose n(d) = 0. What is d? -1, 0, 1 Solve -3/5a + 3/5a3 - 9/5a*2 + 9/5 = 0 for a. -1, 1, 3 Suppose 8 = -3t - t, 0 = -2h - 2t. Let k(f) be the second derivative of 0fh - 2f + 1/42f4 - 1/21f*3 + 0. Let k(y) = 0. Calculate y. 0, 1 Let q be 2/6(174/(-42) + 5). Factor q - 6/7u + 6/7u*2 - 2/7u*3. -2(u - 1)*3/7 Let f(k) be the second derivative of -5k + 0 + 1/6k2 + 1/4k*3 + 1/18k*4. Solve f(w) = 0 for w. -2, -1/4 Let n be -2 - 16/6-1. Factor nl + 1/3l2 + 1/3. (l + 1)2/3 Suppose 0 = 5m - p - 15, 0 = 4m + m + 2p. Let w(n) be the first derivative of 2n - 2/3n3 - 1/4n*4 + 3 + 1/2n*m. Factor w(v). -(v - 1)(v + 1)(v + 2) Let w = -2 + 2. Factor 5r*4 + 2 - 3r*4 + w - 4r*2. 2(r - 1)*2(r + 1)*2 Let x(a) = 15a*2 - 325a + 2565. Let g(o) = -22o2 + 487o - 3847. Let f(v) = 5g(v) + 7x(v). Find u, given that f(u) = 0. 16 Find z such that 24z3 + 16z*2 + 16z*4 + 2074 - 2074 + 4z + 4z5 = 0. -1, 0 Let d(f) be the third derivative of 0f*3 + 1/600f*6 + 0f*4 + 1/1050f*7 - 1/1680f*8 + 0 + 0f + 3f2 - 1/300f5. Let d(o) = 0. Calculate o. -1, 0, 1 Let q(c) be the second derivative of c5/20 + c*4/3 + 2c*3/3 + 13c. Factor q(d). d(d + 2)2 Let u(q) be the first derivative of -7/12q*6 + 8 - 5/8q*2 + 19/16q*4 + 13/12q*3 - 1/2q - 11/20q5. Determine r, given that u(r) = 0. -1, -2/7, 1/2, 1 Solve 12z - 4z3 + 2z*4 + 2z - 2 - 10z = 0 for z. -1, 1 Let j(v) be the third derivative of -v7/5040 - v6/480 - v5/120 + v4/8 - 2v*2. Let q(w) be the second derivative of j(w). Factor q(p). -(p + 1)(p + 2)/2 Let q(o) = 2o3 + 13o*2 - 23o + 14. Let s(k) = 8k3 + 53k*2 - 91k + 56. Let z(n) = 26q(n) - 6s(n). Find t, given that z(t) = 0. -7, 1 Factor 0 + 4/7n3 - 2/7n*2 + 2/7n*4 - 4/7n. 2n(n - 1)(n + 1)(n + 2)/7 Let u(l) be the second derivative of -7/30l5 + 0 + 4l + 2/3l2 + 1/6l*4 + 7/9l*3 - 1/9l*6. Solve u(r) = 0 for r. -1, -2/5, 1 Let a(k) be the second derivative of -25k*7/126 + 11k*6/18 + 14k5/15 + k4/3 - 10k. Determine z, given that a(z) = 0. -2/5, 0, 3 Suppose 0n = 3n - 27. Let r = n + -7. Factor 4/5m*r + 2/5m*3 + 0 + 0m. 2m2(m + 2)/5 Let r(s) = -s - 2. Let w be r(-8). Let l = -3 + w. Solve -b*5 - 3b + lb4 - 3b*3 + 3b + b*2 = 0. 0, 1 Let s be 1 - (-3)/(-6)4/(-2). Factor 27/7c - 27/7 - 9/7c*s + 1/7c3. (c - 3)3/7 Let r(w) = w*2 - w + 5. Let m = -3 - -3. Let l be r(m). Determine p, given that -2p*l - 2p*3 + 5p3 - p3 = 0. -1, 0, 1 Let x be -2 - (-7 + 5) - (-2 + -1). Factor 2/3z4 - 2z*2 - 10/3z - 4/3 + 2/3zx. 2(z - 2)(z + 1)3/3 Let j(v) be the third derivative of 0v + 0v4 + 0v*5 - 5/1008v*8 + 0v*3 - 1/210v*7 + 1/180v*6 + 0 - 2v*2. Suppose j(g) = 0. Calculate g. -1, 0, 2/5 Let s be (9/2)/9(-4)/(-30). Let i(y) be the third derivative of 2y2 + 0 + 0y + sy4 + 1/60y*5 - 2/15y*3. Factor i(h). (h + 2)(5h - 2)/5 Let k be 0 - 9/72(-5 - 1). Solve 0 + kj3 + 0j + 1/4j5 - 3/4j*4 - 1/4j2 = 0. 0, 1 Let w(d) be the second derivative of -d6/120 + d*4/8 - 2d*3/3 - 2d. Let b(l) be the second derivative of w(l). Determine q so that b(q) = 0. -1, 1 Let t(q) be the first derivative of -2q3/21 + 2q*2 - 14q + 5. Let t(b) = 0. What is b? 7 Let -5/2s + 5/2s*2 - 5/6s*3 + 5/6 = 0. What is s? 1 Factor -4/5k*2 + 0 + 1/10k*3 + 8/5k. k(k - 4)2/10 Let z(j) be the third derivative of -j7/1260 - j6/360 + j5/360 + j4/72 + 5j*2. Factor z(v). -v(v - 1)(v + 1)(v + 2)/6 Let k(a) be the third derivative of -a7/840 + a6/360 + a5/120 + a4/8 + 3a2. Let w(n) be the second derivative of k(n). Determine s so that w(s) = 0. -1/3, 1 Let y = -17 + 17. Determine i so that -12 - 9i*3 - 21i - 24i2 + y + 6 = 0. -1, -2/3 Let t be (4 + -6)/(-2(-3)/(-2)). Factor tn2 + 2/3 + 4/3n. 2(n + 1)2/3 Factor 4/5j*4 - 4/5j*2 + 0 - 4/5j + 4/5j3. 4j(j - 1)(j + 1)2/5 Let p(v) be the second derivative of -v4/4 + v*3 - 3v*2/2 + 3v. Determine g so that p(g) = 0. 1 Let z(r) be the third derivative of -r9/17280 - r8/4480 - r7/5040 - r5/30 - 8r2. Let p(o) be the third derivative of z(o). Factor p(v). -v(v + 1)(7v + 2)/2 What is w in 1/2w2 - 1 + 1/2w = 0? -2, 1 Let x(h) = 62h3 - 152h*2 + 100h - 4. Let t(r) = r3 - r2 + r + 1. Let k(g) = 12t(g) - x(g). Solve k(m) = 0. 2/5, 2 Let m(y) be the second derivative of y6/45 - y5/10 + y4/6 - y3/9 - 6y. Factor m(x). 2x(x - 1)3/3 Let z = -1/1343 - -1427/112812. Let n(v) be the third derivative of 0 - v2 + 0v3 + 1/210v*5 + zv*4 + 0v. Factor n(l). 2l(l + 1)/7 Suppose 5x = 4r + 2, 2x + 0x = -5r + 14. Determine p, given that -13p - 6 + 20pr + 3 + 5 = 0. 1/4, 2/5 Let w(s) = -25s - 1. Let o be w(-2). Let u = 345/7 - o. Factor -4/7 - 6/7y - uy*2. -2(y + 1)(y + 2)/7 Suppose 4v - 6v = -40. Let u be (-92)/v + 2 + 3. Solve -4/5j*2 + 0j + 2/5j4 + u + 0j*3 = 0 for j. -1, 1 Suppose -2l - 9 + 49 = -4r, 88 = 5l - 4r. Factor lf*2 - 3f*2 - 28f*4 + 6f*3 + 7f*3 - 3f + 5f. -f(f - 1)(4f + 1)(7f + 2) Let m be (2 + 3/1)2. Let r be (-4)/m - 282/(-30). Determine k, given that -2k*2 + 0k*2 + r - 7 = 0. -1, 1 Let u(d) = -4d3 - 2. Let m(t) = -t3 - t*2 + t - 1. Let y = 10 + -12. Let l(a) = yu(a) + 6m(a). Factor l(i). 2(i - 1)*3 Let r = 112 - 109. Determine y so that -3/4y*3 + 21/4y*2 - r + 0y - 9/4y4 + 3/4y5 = 0. -1, 1, 2 Let o(w) be the first derivative of w3/3 - 3w2/2 + 2w + 27. Factor o(p). (p - 2)(p - 1) Let h = -11/6 + 13/6. Let k(s) be the first derivative of 2/3s*4 + 1 - 4/3s*3 - hs*2 - 1/3s*6 + 4/3s + 8/15s5. Suppose k(b) = 0. Calculate b. -1, -2/3, 1 Let t(o) be the first derivative of -o4/2 + 64o*3/3 - 256o*2 + 53. Factor t(s). -2s(s - 16)2 Let h = -5/117 + 2/13. Let j(f) be the third derivative of -hf*3 - 1/360f*6 + 1/24f*4 + 2f*2 + 0 + 0f + 0f5. Suppose j(l) = 0. Calculate l. -2, 1 Let g be (-30)/7216/(-30). Sol	{ "pile_set_name": "DM Mathematics" }
(c) 3/4 (d) 17/3 (e) n d Let q = 2400/7 - 62421/182. Which is the second biggest value? (a) -2/183 (b) q (c) -1/2 b Let o = -0.4 + 0.1. Let p = 547 - 189. Let q = 2863/8 - p. Which is the biggest value? (a) 4 (b) q (c) o (d) 0.3 a Let y be ((-2)/4)/1 + 21/6. Suppose -yw + 0w = 12. Let r be 146/(-30) + (-6)/(-30) - w. What is the second biggest value in -4, r, 4, -14? r Let o(l) = -3l2 - 63l - 169. Let z be o(-3). Which is the biggest value? (a) z (b) -1 (c) 7 (d) 2/7 (e) -3 c Let u be 1-3 - (122 - 61). Which is the second smallest value? (a) 3/4 (b) -0.5 (c) 1/6 (d) u b Let j = -1 + -1. Let g = -10 + j. Let q be 10/81288/(-5635). Which is the third biggest value? (a) -4/9 (b) g (c) q b Let y = -4840 - -4835. Let g = 2.02 + -0.02. Let b = -27.2 + 28. What is the second smallest value in g, y, b? b Let n = -4386 - -4390. Which is the third smallest value? (a) 6 (b) 0 (c) 7 (d) 2/13 (e) n e Let z = 12.45 - 11.45. Which is the smallest value? (a) -3 (b) 4 (c) -1/2 (d) z (e) -0.06 a Suppose 0n = -4n - 16. Let f = -285.2 - -285. What is the third biggest value in f, n, 2.4? n Let z = 4669/1698 + 1/3396. What is the third smallest value in z, -2/5, 16? 16 Let f = -275 - -383. Let u = -108.4 + f. What is the second smallest value in u, 0.23, -0.3? -0.3 Let p = 1081/6 - 179. Let n be (-2 + -8)(36/(-30))/3. Suppose w + n = 4f, 5f = 2w + 2w + 16. Which is the third biggest value? (a) p (b) w (c) -2/7 b Let i = -2 - 3. Let f = -120.871 + 58.871. Which is the biggest value? (a) 3 (b) f (c) i a Let l = -2420.19 - -2445. Let t = -25 + l. Let i = -1.19 - t. Which is the third smallest value? (a) i (b) 54 (c) -4 b Suppose 134t - 30 + 26 = 398. Which is the biggest value? (a) -0.162 (b) -2 (c) t c Let k = 8 + -6. Let x(q) = -q*3 + 35q*2 + 38q - 73. Suppose 30m - 1019 = 61. Let s be x(m). Which is the second smallest value? (a) s (b) 0 (c) k b Let t = 14 + -12.8. Let d = t + -11.8. Let f = -11 - d. What is the second biggest value in f, 5, 0.3? 0.3 Let p be 8/116 + 507/(-12818). Let n be 0 - ((-14)/10 - -1). Which is the second biggest value? (a) -0.3 (b) 1 (c) n (d) p c Let r be 256/792 - 2/(-9). Let b(p) = p2 - 63p + 177. Let m be b(3). What is the smallest value in r, -1/10, m? m Let x = 0.8 + -4.8. Let r = -14 + 20. Suppose -5q + z = 22, -129q + 36 = -134q + 3z. Which is the third biggest value? (a) x (b) -0.3 (c) r (d) q d Let o = 778 + -310. Let i = -465 + o. Let v = -1.4 + 1. What is the second smallest value in i, v, 4? i Let w(i) = 4i2 - i - 1. Let a be w(-1). Let o = 111343 - 111354. What is the smallest value in o, 0.2, a? o Let j = 9196 - 9196.1. What is the fourth biggest value in j, 12, -2, -1/4, 0.3? -1/4 Let v = -216.1 - -24.1. Let l = 196 + v. Which is the smallest value? (a) 2/13 (b) -3/2 (c) l b Let r = -1606.6 - -1606.7. Which is the fourth biggest value? (a) -5 (b) -19 (c) r (d) -1 b Let k = 0.87 - -552.13. Let w = k + -528. What is the second smallest value in w, 10, -0.1, 1? 1 Let x = -4.632 - -4.932. Which is the fifth smallest value? (a) -11 (b) x (c) -0.3 (d) -1/3 (e) 5/4 e Let t = 2 - 38. Let s = -2 + t. Let r = 37.7 + s. What is the third smallest value in 7, 5, r, -5? 5 Let p = -0.25 - 0.15. Let t be (-155)/22/44. Let a = t + 1087/7. What is the smallest value in -3, p, -2, a? -3 Let s = 6429 - 6488. Which is the fourth biggest value? (a) -3 (b) -0.9 (c) s (d) 5 c Let j = 0.48 - -0.02. Let f(t) = -t - 2. Let s be f(2). Let h = -11549.81 + 11550. Which is the biggest value? (a) s (b) h (c) j c Let x = 0.11664 - -0.28336. What is the fourth smallest value in 0.1, -3, 58, x? 58 Let g be (-17)/(-680)20982/1. Let p = g + -2859/5. Let m = -47 - p. Which is the biggest value? (a) 5 (b) 0.7 (c) m (d) 0 a Let s = -432/43 - -1685/172. Let q be 0/(-2) - 3/(-30). Which is the second biggest value? (a) -7 (b) 4/5 (c) s (d) q d Let i = 5.687 + -5.287. Which is the fourth smallest value? (a) i (b) 3/34 (c) -0.1 (d) 5 d Let f(q) = -q*3 + 63q*2 + 201q - 142. Let y be f(66). Which is the second smallest value? (a) -3 (b) -0.1 (c) y b Let z = 79124 - 79127. Let a = 3 - 12. What is the third biggest value in a, -5, z, 4? -5 Let i(l) = l*2 + 47l + 90. Let o be i(-46). Which is the smallest value? (a) -0.07 (b) o (c) 6 a Let f = 339 + -338.9. Let r be -3 + 12/(-8)78/(-45). Which is the third biggest value? (a) r (b) 5 (c) f (d) 13 c Let h = -9458 + 9457.9. Which is the second biggest value? (a) -1 (b) 1 (c) 2 (d) h b Let q = 6.34 + -6.2931. Let f = 0.1269 - q. What is the smallest value in -3, -15, f? -15 Let s be (-80)/(-319) + (-12)/66. Which is the third smallest value? (a) -1/9 (b) s (c) -8 b Let k = 1078 - 55. Let x = -1079.3 + k. Let r = x + 54. Which is the third biggest value? (a) r (b) 3 (c) -3/2 a Let x = 157 - -68. Let z = 230 - x. What is the smallest value in -2/9, z, 1/7, -2/23? -2/9 Let q = -138 - -140. Which is the fourth biggest value? (a) -2/11 (b) -7 (c) q (d) 3 b Let l = 16.6 + 9. Let r = 26 - l. Which is the smallest value? (a) -70 (b) -2 (c) r a Let m(t) be the third derivative of t4/24 - 5t*3/6 + 9t*2. Let o be m(5). Suppose -4n - n - 10 = o. What is the third smallest value in n, -6, -0.3? -0.3 Suppose -286f + 270f = -64. Let y = 30/7 + -125/21. Let k be (-15)/14 + (-2)/(-4). Which is the smallest value? (a) k (b) y (c) 1 (d) f b Let i be 12/(-66) + (-10)/(-11220)138. What is the biggest value in 85, i, -1/4? 85 Let w = 2.9284 + 0.0716. Which is the third smallest value? (a) 40/7 (b) 0.5 (c) w (d) -5 c Let l = -7326 - -7321. Which is the third biggest value? (a) -2/15 (b) -3 (c) l (d) -0.5 (e) 22/3 d Suppose 0 = -w - n - 3 - 6, -4w + 9 = -n. Which is the fourth smallest value? (a) 5 (b) -2/111 (c) w (d) 0.5 (e) 0.1 d Let r = 0.136 - 0.18. Let f = 109.976 + -110.02. Let n = f - r. Which is the second smallest value? (a) n (b) 18 (c) -2 a Let q = -2 + 0.97. Let k = q - 19.97. Let l = 0.05 + -3.05. Which is the second smallest value? (a) 2 (b) k (c) l c Let z = 231.31 + -230.31. Let k = 9.3 - 0.3. Let q = -18 + 53/3. Which is the third biggest value? (a) q (b) z (c) -5 (d) k a Let t = 0.16 + 2.84. Let b = 0.5422 + -0.5022. What is the smallest value in -5, t, b, 1/6? -5 Let a = 3104 + -3103.8. What is the smallest value in -4, a, -0.37? -4 Suppose 0 = 4h + 2r + 1582, 7h + 396 = 6h - r. Let v = h - -5137/13. Which is the third smallest value? (a) 1/6 (b) -2/65 (c) v a Let m = 2.813 + -2.513. What is the second biggest value in 3/11, 29, m? m Let n = -2/795 + -524/2385. Let c = 544.5 - 545. What is the second smallest value in n, 0.1, -4, c? c Let y = -0.145 + -0.155. Suppose x - 2 - 6 = 0. Let h be 3 - (10/x + 1). Which is the fourth smallest value? (a) -2/5 (b) 0 (c) h (d) y c Let t = -92622 - -92623. Suppose -3x = k + 6, 0k + 5x = 2k + 1. What is the fourth biggest value in t, -1, -15, k? -15 Let n = -118 - -118.2. Let z be -5 + (-2 - 2)/(-2). Let l = 136 - 136.4. What is the smallest value in z, l, n? z Let t = 0.7976 + 0.2024. Which is the third smallest value? (a) t (b) 4 (c) -64/11 (d) -3/5 a Let k = -0.34 + -0.06. Let y be -30 + 0 + 3077/102. Which is the second smallest value? (a) y (b) -4 (c) -0.7 (d) k c Let t = -9125.775543 + 12.662543. Let y = t - -9107. Let f = y + 0.113. Which is the third smallest value? (a) 3 (b) f (c) -1 a Let a = -0.17 - -0.29. Let o = -68.12 + 66. Let f = o + a. What is the second biggest value in -14, -0.4, f? f Let s(u) = -8u + 11. Let q be s(2). Let f be q - -5 - 16/(-88). Which is the fourth smallest value? (a) -2 (b) -0.2 (c) f (d) -4 c Let i = 301 - 105. Let j = 191 - i. What is the second biggest value in -4, j, 6, -0.5? -0.5 Let h = -38.89 + 36.89. What is the second biggest value in 7, -6, -2/13, h? -2/13 Let t(d) = -d2 + 23d - 118. Let u be t(15). Suppose uz + 29 = -3k, 2k = -3k - z - 46. What is the biggest value in 5, k, 1? 5 Let l = 19.28 - 51.28. Which is the fifth smallest value? (a) 5 (b) -0.2 (c) 4 (d) l (e) 0.03 a Suppose 17r - 2r - 20640 = 0. Let g(z) = -2z2 + z2 - 61 + rz - 1398*z. Let w be g(-19). Which is the third smallest value? (a)	{ "pile_set_name": "DM Mathematics" }
descending order. 6, 5, 4, 3, -7 Put -4, 3, -3, 38, -5 in descending order. 38, 3, -3, -4, -5 Put -1, 3, 184 in increasing order. -1, 3, 184 Sort -1, 0, -58. -58, -1, 0 Sort -5, -47, -1 in ascending order. -47, -5, -1 Sort -1, 0, -8, 2. -8, -1, 0, 2 Put -12, 32, 0 in descending order. 32, 0, -12 Sort -2, 4, -1, -14 in decreasing order. 4, -1, -2, -14 Sort 0, 2, -33, -0.2 in ascending order. -33, -0.2, 0, 2 Sort -23, -4, 20 in increasing order. -23, -4, 20 Sort 1, 53, 0, -5 in ascending order. -5, 0, 1, 53 Sort 12/5, 2/13, 33. 2/13, 12/5, 33 Put -21, 5, 0, -6 in decreasing order. 5, 0, -6, -21 Put -5/3, -4, 5/2 in increasing order. -4, -5/3, 5/2 Sort -1/3, -3/11, 1 in decreasing order. 1, -3/11, -1/3 Sort 4, -2/11, 3/5, -2/5 in descending order. 4, 3/5, -2/11, -2/5 Put 4, -1/6, -121/2, -5, 1/8 in increasing order. -121/2, -5, -1/6, 1/8, 4 Sort 0.5, -5, 40. -5, 0.5, 40 Sort 0, 1, 9, 22, -2 in descending order. 22, 9, 1, 0, -2 Sort -6, -18, -1. -18, -6, -1 Put 0, -1, 54, 1 in decreasing order. 54, 1, 0, -1 Put -2, 105, 4 in descending order. 105, 4, -2 Sort -5, 119, 1, 75 in decreasing order. 119, 75, 1, -5 Sort 1.6, -1/7, 4, 2.3 in descending order. 4, 2.3, 1.6, -1/7 Put 177, 3, -106 in ascending order. -106, 3, 177 Put -2/17, 4, -0.3, -5, 1 in decreasing order. 4, 1, -2/17, -0.3, -5 Sort -113, 2, -4, 0, 1 in ascending order. -113, -4, 0, 1, 2 Sort 3, -249/4, -3 in ascending order. -249/4, -3, 3 Sort -0.17, -2/11, -4 in decreasing order. -0.17, -2/11, -4 Sort -4, -2, -0.04, 18. -4, -2, -0.04, 18 Sort 38, 2, 0 in decreasing order. 38, 2, 0 Sort -8.4, 0.1, -0.4, 5 in descending order. 5, 0.1, -0.4, -8.4 Sort 112, -1, 0 in decreasing order. 112, 0, -1 Put 4, 7, -13, 3 in descending order. 7, 4, 3, -13 Put 1, 29, 0 in decreasing order. 29, 1, 0 Put 4, 0.4, 2/35, 2 in descending order. 4, 2, 0.4, 2/35 Sort 119, 4, -5 in descending order. 119, 4, -5 Put 4, -0.085, 3 in decreasing order. 4, 3, -0.085 Sort -14, 20, -3, 1 in increasing order. -14, -3, 1, 20 Put 2341, -2, 5 in increasing order. -2, 5, 2341 Put -4, 7, -9 in decreasing order. 7, -4, -9 Sort 3/16, -0.2, -1/4, 0 in ascending order. -1/4, -0.2, 0, 3/16 Sort -0.4, 2/45, -1/4. -0.4, -1/4, 2/45 Put -2, 306, -7 in descending order. 306, -2, -7 Sort -9, 153, 0.1 in descending order. 153, 0.1, -9 Sort -2, -1, 3, -0.3 in increasing order. -2, -1, -0.3, 3 Put -92, 3, -1, 1, -3 in increasing order. -92, -3, -1, 1, 3 Sort 1, -14, 5, -1 in ascending order. -14, -1, 1, 5 Sort 0, 7, 9 in increasing order. 0, 7, 9 Sort -5, 0, 1/2253. -5, 0, 1/2253 Put -9, -0.1, -104 in descending order. -0.1, -9, -104 Put -4, 1, -5, 5 in ascending order. -5, -4, 1, 5 Put 3, 15, 4, -3 in increasing order. -3, 3, 4, 15 Sort -3, -0.04, -9, 1/2 in increasing order. -9, -3, -0.04, 1/2 Put -2, 115, 1 in ascending order. -2, 1, 115 Sort -6, 1, 5, 85 in decreasing order. 85, 5, 1, -6 Sort -3, -21, -48, -1 in ascending order. -48, -21, -3, -1 Sort -28, 18, 4, -4 in decreasing order. 18, 4, -4, -28 Put 2, 0, -2, -31, 1 in ascending order. -31, -2, 0, 1, 2 Put 206, -3, -5 in decreasing order. 206, -3, -5 Put 14, -2, 12 in descending order. 14, 12, -2 Put -11, 3, -42 in increasing order. -42, -11, 3 Put 5, -143, -4 in increasing order. -143, -4, 5 Sort 0.03, 1/2, 0.4 in increasing order. 0.03, 0.4, 1/2 Sort 4, -3, -247, -1. -247, -3, -1, 4 Sort -5, 4, -6, -3, 66 in descending order. 66, 4, -3, -5, -6 Put -6, -2, 2, -27 in decreasing order. 2, -2, -6, -27 Sort -383, 2, 4, 1/5 in decreasing order. 4, 2, 1/5, -383 Sort 0, -1, 1 in ascending order. -1, 0, 1 Sort -2, -0.1, 16/7 in ascending order. -2, -0.1, 16/7 Put -36, -1/2, -4/3, 2/9 in ascending order. -36, -4/3, -1/2, 2/9 Sort -3, 5, 367, -1, -5 in ascending order. -5, -3, -1, 5, 367 Sort -11, -2, 4, 1/11 in decreasing order. 4, 1/11, -2, -11 Sort 22, 0, 1 in increasing order. 0, 1, 22 Sort 1, 0.2, -2/3, -5 in ascending order. -5, -2/3, 0.2, 1 Sort 11, -4, 4, 7 in ascending order. -4, 4, 7, 11 Put -4, 1, -1179 in decreasing order. 1, -4, -1179 Put 22, 3, -1, 5 in decreasing order. 22, 5, 3, -1 Sort 5/2, 1/6, 1, 2/7 in ascending order. 1/6, 2/7, 1, 5/2 Sort -1, 25, 28, 1 in descending order. 28, 25, 1, -1 Put -4, 3, -309, 0 in decreasing order. 3, 0, -4, -309 Sort -7, 1, 3 in descending order. 3, 1, -7 Sort 1, -2, 4, -46 in increasing order. -46, -2, 1, 4 Sort -5, -3, -61, 6, 5 in descending order. 6, 5, -3, -5, -61 Put 28, -1/16, -1, -4, 3/2 in descending order. 28, 3/2, -1/16, -1, -4 Sort 5, 0, -5, 10. -5, 0, 5, 10 Put 5, -7, -11, -4 in ascending order. -11, -7, -4, 5 Put -3/2, -0.2, -0.156 in ascending order. -3/2, -0.2, -0.156 Sort 3, 4, -120 in increasing order. -120, 3, 4 Sort -39, 4, 3 in decreasing order. 4, 3, -39 Put 4, -83, 1, 2 in ascending order. -83, 1, 2, 4 Put -0.5, -5, 1/35, -1/4 in descending order. 1/35, -1/4, -0.5, -5 Sort 5, -13, 9, -1, -2 in decreasing order. 9, 5, -1, -2, -13 Sort 3, -195, -5 in decreasing order. 3, -5, -195 Sort -2, 0.2, -4 in descending order. 0.2, -2, -4 Sort 5, -5, 2 in decreasing order. 5, 2, -5 Sort 1, -6, 0.4, 0.3. -6, 0.3, 0.4, 1 Put 15, 0, -3, -17 in increasing order. -17, -3, 0, 15 Put 4, -19, 8, -2, 2 in decreasing order. 8, 4, 2, -2, -19 Sort -333, 3, -2 in increasing order. -333, -2, 3 Sort 67, 1, -4, 4, 1/2. -4, 1/2, 1, 4, 67 Put 21, 3, 4, 8, 1 in decreasing order. 21, 8, 4, 3, 1 Sort -3, 4, -47 in increasing order. -47, -3, 4 Put -2, 69, 4, -5, 0 in descending order. 69, 4, 0, -2, -5 Sort -2, 5, 4, 8, -3 in increasing order. -3, -2, 4, 5, 8 Sort -3, 0, -2, 3 in increasing order. -3, -2, 0, 3 Put -219, -5, 0, 1 in decreasing order. 1, 0, -5, -219 Put -25, -1, -11 in ascending order. -25, -11, -1 Sort -53, -0.2, 6 in increasing order. -53, -0.2, 6 Sort 5, -2/13, -10, 2. -10, -2/13, 2, 5 Sort -4, -3, 55, -79, 0 in decreasing order. 55, 0, -3, -4, -79 Sort 0.2, -990, 2/17 in ascending order. -990, 2/17, 0.2 Sort 2/5, 7/2, 2, 4. 2/5, 2, 7/2, 4 Put 0.3, -3/7, -1, 2.3 in decreasing order. 2.3, 0.3, -3/7, -1 Sort 1, 0, -169, -1 in ascending order. -169, -1, 0, 1 Sort -9, 6, -8, 4 in descending order. 6, 4, -8, -9 Put 6, 66, -4 in descending order. 66, 6, -4 Put -7, -125, 4 in descending order. 4, -7, -125 Sort 0.1, 1/7, 9, 0.2, -20 in increasing order. -20, 0.1, 1/7, 0.2, 9 Sort 1/7, 3/4, -2, 0.4 in increasing order. -2, 1/7, 0.4, 3/4 Put 0, 0.4, -1/26 in descending order. 0.4, 0, -1/26 Put 5, 4, 8, -2 in increasing order. -2, 4, 5, 8 Put -1, -3, -20, -2, 5 in descending order. 5, -1, -2, -3, -20 Put 1.9, -1/17, 29 in ascending order. -1/17, 1.9, 29 Sort 2.2, -2/3, 4, -4/7 in ascending order. -2/3, -4/7, 2.2, 4 Sort 0.6, -4, 37. -4, 0.6, 37 Put -3, -40, 5, 0 in descending order. 5, 0, -3, -40 Put -4, -27, -3, -5 in decreasing order. -3, -4, -5, -27 Sort 1, 0, 9. 0, 1, 9 Sort 23, -1, 2, 5 in descending order. 23, 5, 2, -1 Sort -5, 2, -58 in ascending order. -58, -5, 2 Sort -1, 16, 2, 1, 3 in decreasing order. 16, 3, 2, 1, -1 Sort -11, 5, -1, -3, 6 in increasing order. -11, -3, -1, 5, 6 Sort 7, 2, 1, -22.5 in increasing order. -22.5, 1, 2, 7 Put 3, 927, -2 in ascending order. -2, 3, 927 Sort -1, 2/7, 5, -0.104 in descending order. 5, 2/7, -0.104, -1 Sort -7, -6, -2/7, 5 in increasing order. -7, -6, -2/7, 5 Sort -3, 155, 18 in increasing order. -3, 18, 155 Sort -0.3, 0.4, 0.3, 0.002, -3 in decreasing order. 0.4, 0.3, 0.002, -0.3, -3 Sort 77, -2, -55. -55, -2, 77 Sort -4, 2, -2, 31. -4, -2, 2, 31 Put 23, 0, 3, 14, -3 in decreasing order. 23, 14, 3, 0, -3 Sort 2/17, 4/7, -1.3 in decreasing order. 4/7, 2/17, -1.3 Sort 15, -1, 8. -1, 8, 15 Sort -4, 0, -1000. -1000, -4, 0 Sort -0.64, -2, 2 in decreasing order. 2, -0.64, -2 Put -3, -2, -41, 20 in ascending order. -41, -3, -2, 20 Sort 3, 0, -3560 in decreasing order. 3, 0, -3560 Sort -2, 0.3, -0.08, -6 in decreasing order. 0.3, -0.08, -2, -6 Sort 7/2, 0, -1/2, 3. -1/2, 0, 3, 7/2 Sort -6, -2/3, -1/10, 3/8 in descending order. 3/8, -1/10, -2/3, -6 Sort 1/4, 29/6, -2, -1. -2, -1, 1/4, 29/6 Sort 0, -9, 42. -9, 0, 42 Sort -12, -3, 4. -12, -3, 4 Sort -3, 4, -2, -27 in descending order. 4, -2, -3, -27 Put -2, -5277, 4 in ascending order. -5277, -2, 4 Sort -0.2, -3, 0.237, 0. -3, -0.2, 0, 0.237 Sort -5, 16, 76 in decreasing order. 76, 16, -5 Sort -6, -1/5, 2. -6, -1/5, 2 Put 36, 0.55, -5 in decreasing	{ "pile_set_name": "DM Mathematics" }
*3i + 373b2i*2 wrt b. -24bi - 1260i*2 - 12i Find the third derivative of 41g6 + 7g*2 + 2g. 4920g3 Find the third derivative of a4 - 57a*2 wrt a. 24a Find the second derivative of 21186z2 - 881z + 12. 42372 Find the second derivative of 137a4 - 4a + 9. 1644a2 Find the second derivative of 2j*3z2 - j3z - j2z*2 - 4j*2 + 15jz + 13z*2 wrt j. 12jz2 - 6jz - 2z*2 - 8 What is the second derivative of 674x*4 + 120x - 2 wrt x? 8088x2 What is the third derivative of -2529o*6 + 54o*2 + 15? -303480o*3 What is the third derivative of -877p*5 + 1586p*2? -52620p*2 Find the third derivative of 110l*3 + 564l*2 wrt l. 660 Find the second derivative of -216t*5 - 13t*2 + 12789t + 2 wrt t. -4320t3 - 26 What is the first derivative of -135b*3 - 186? -405b2 Differentiate h2v2 - 25h*2 + 4v*2 - 5v wrt h. 2hv*2 - 50h Find the third derivative of -1043n4 + 2n*2 + 522 wrt n. -25032n What is the second derivative of -1038s4 - 468s wrt s? -12456s2 Find the first derivative of -2j*2 - 8j + 415 wrt j. -4j - 8 Find the second derivative of 65ar2 - 1403ar + 10r*2 wrt r. 130a + 20 What is the second derivative of 1760s2 + 684s - 1? 3520 What is the first derivative of -61tv + t - 25v + 5 wrt t? -61v + 1 Find the second derivative of 5d4w + 6d4 + dw - 27w wrt d. 60d*2w + 72d2 What is the derivative of -814r + 1482? -814 What is the second derivative of kn4 + 8kn - 3k - 126n4 + 1 wrt n? 12kn2 - 1512n*2 Differentiate -7o*3x*3 + 605o*3 - 9x*3 wrt x. -21o*3x*2 - 27x*2 Find the second derivative of -5522u*2 + 382u - 1. -11044 Find the first derivative of -7j3x3 - j3 - 129x3 wrt j. -21j*2x*3 - 3j*2 What is the second derivative of 1437g*5 - 2845g? 28740g3 Find the second derivative of -27g*2 - 149g wrt g. -54 Find the second derivative of 209g2 + 2g - 2 wrt g. 418 What is the first derivative of s*3 + 5s + 213? 3s2 + 5 What is the second derivative of -13j*2q*3 - 6j*2 + jq*3 - 21j + 3q3 wrt j? -26q*3 - 12 Find the third derivative of -159f*3 - 155f*2. -954 What is the third derivative of -27i*3n*3z + 2i3n*3 - 21i*3n*2z - i*3z - 2i2n*2z + 3in*3z wrt n? -162i3z + 12i3 + 18iz What is the second derivative of 199hw2 - 51hw + 2w wrt w? 398h Differentiate 37f*2m*3 - 2f*2m + 135f2 with respect to m. 111f*2m*2 - 2f*2 Find the second derivative of -2d*4h*3 - 5d*3h*3 + dh + 187h3 wrt d. -24d*2h*3 - 30dh3 What is the first derivative of -27q*3x - 2q3 + qx*4 + qx wrt x? -27q3 + 4qx3 + q What is the third derivative of -301d4 + d3 - 1541d2 wrt d? -7224d + 6 What is the second derivative of -10h3 + 300h*2l - 4hl - 36h + 2l wrt h? -60h + 600l What is the third derivative of 16h2m3 - h2m2 + 4h*2m + hm5 - 11hm3 + 24hm - m2 wrt m? 96h*2 + 60hm2 - 66h Find the third derivative of -12238ak*3 + ak - 111k2 - 2k - 5 wrt k. -73428a Find the third derivative of 9k*5 - 3k*4z - 2k2z - 134kz - z wrt k. 540k2 - 72kz Find the second derivative of 1414f*3 - 81f + 7 wrt f. 8484f Find the second derivative of -138d*2y*2 + 615d*2y + 2d2 + 5y*5 wrt y. -276d*2 + 100y*3 What is the third derivative of -52r*3s*3 - 3r*3s*2 + 3r*2s*2 + 3rs3 wrt s? -312r*3 + 18r Find the first derivative of -223m4 - 62. -892m*3 What is the first derivative of -1291l - 25? -1291 Find the third derivative of -443m6 + 2m*2 - 72 wrt m. -53160m*3 Differentiate -51by3 - by*2 - b + 15 with respect to y. -153by2 - 2by Find the third derivative of -g2t*3z + 10g2t*2 + 2g*2tz + gt*2z - 100t3z wrt t. -6g2z - 600z Find the third derivative of 394d*4 - 123d*2 - 9d. 9456d Find the second derivative of -148t*4 + 2t*2 + 5t - 5. -1776t2 + 4 Find the third derivative of -382f*3 - 529f*2. -2292 What is the second derivative of -87q*2 + 3q + 30 wrt q? -174 What is the first derivative of d3 + d2 - 284d + 79? 3d*2 + 2d - 284 Find the second derivative of -377l4y*3 - 2ly3 + 183y*3 - 2 wrt l. -4524l*2y*3 What is the second derivative of -26n*5 - 6n*3 + 2n - 12076 wrt n? -520n3 - 36n Find the third derivative of -12co*3x - co3 + 4co2x - 11co*2 - cx + 10o3x + 3o2x wrt o. -72cx - 6c + 60x What is the first derivative of 17717b3 + 6831 wrt b? 53151b*2 Find the second derivative of -2t*2u*2y*2 - 2t*2u*2 - 2t*2y + 89tuy + 2u*3y2 + u3 + 178y2 wrt y. -4t*2u*2 + 4u*3 + 356 Differentiate 78pr2u*3 - pu*3 - 3r*2u*2 + 532u*3 wrt p. 78r*2u3 - u3 What is the second derivative of -d*5 + 242d*4 - 21d - 2 wrt d? -20d3 + 2904d*2 Find the second derivative of 30dio*2 - 98di + 2do + 2io2 + 3i + 4o2 wrt o. 60di + 4i + 8 Find the third derivative of -z*4 + 5581z*3 - 6822z*2 wrt z. -24z + 33486 What is the first derivative of 304i + 530? 304 Find the second derivative of 5662a*2b2 - a2b - 1914a*2 - 3b*2 wrt b. 11324a*2 - 6 Find the second derivative of -13f*5j - 8f5 + f2j - 2fj + f + 2093j wrt f. -260f*3j - 160f3 + 2j What is the first derivative of 11w2x*2 + 124w*2 - 15wx3 + 2 wrt x? 22w*2x - 45wx*2 What is the third derivative of -741o*6 + 336o*2 - 3? -88920o*3 What is the third derivative of -9f*6 - 29f*3 - 2543f*2? -1080f*3 - 174 Find the third derivative of -4965l*4 - 2l*3 + 3l*2 - 659l. -119160l - 12 Find the first derivative of -1063g*2n - 2187g2 wrt n. -1063g2 Find the third derivative of -g4 - 54g3 - 624g*2. -24g - 324 Find the second derivative of 2z4 + 86z*3 + 20z + 5 wrt z. 24z2 + 516z What is the third derivative of -2i2k4 + i2 + 3ik*3 - 3k6 + k2 + 53 wrt k? -48i2k + 18i - 360k*3 Find the first derivative of -7d*3l - 3d2l*2 - 3d - 3l2 + 31 wrt d. -21d*2l - 6dl*2 - 3 Differentiate 8k*4w - 30k3w*2 + 608w*2 wrt k. 32k*3w - 90k2w*2 Find the second derivative of -546a3 - a2 + 4a + 2 wrt a. -3276a - 2 What is the third derivative of 705dp*3t*3 - 5dp3t*2 + 27dp2 + 2dt2 - 2pt2 + 10t*3 wrt p? 4230dt3 - 30dt2 What is the first derivative of k3wz - k3 + kwz2 - 2wz4 + 6w + 1 wrt z? k*3w + 2kwz - 8wz3 What is the second derivative of 41g*5x*3 - 10g*5 + 4gx3 - 6gx + 10x*3 wrt g? 820g*3x*3 - 200g*3 What is the third derivative of -1942m*3 - 9m*2 + 2m + 5 wrt m? -11652 Find the third derivative of -g*5z - 2704g4z - 85g2 + 3z - 2 wrt g. -60g2z - 64896gz What is the first derivative of -296q2x*2 - 150q*2 + qx*4 - 2 wrt x? -592q*2x + 4qx*3 Find the third derivative of -12r*5 - 9r4 + r3 - 1857r2 + r - 1. -720r*2 - 216r + 6 What is the third derivative of -116r3 - r2 - 32? -696 What is the derivative of 68p + 12835 wrt p? 68 What is the derivative of 732t4 - 572 wrt t? 2928t*3 Find the third derivative of -888o*3v3 - o3v2 - 3o*3v + 76o2v wrt v. -5328o3 Differentiate 41d*2l2 - d2l - 630d*2 - 4dl3 wrt l. 82d*2l - d*2 - 12dl2 Differentiate -4u*3wz - 28uw2 + 2uz - 37w*2 - 3z - 2 with respect to u. -12u2wz - 28w*2 + 2z Find the first derivative of -2921v - 9695. -2921 Find the third derivative of 2g*5 + 12g*3 - 18g*2 - 2g. 120g2 + 72 What is the third derivative of -11lz5 - 2lz3 - 37lz2 - l - 3z4 + z2 wrt z? -660lz*2 - 12l - 72z Differentiate 42w*2 + w + 1753. 84w + 1 What is the second derivative of 525b2 - 747b? 1050 What is the first derivative of -2qu*2 + 40qu + 127q wrt u? -4qu + 40q Find the third derivative of -2r*6s + 491r3s*2 - 14r*2s*2 - 5r*2s wrt r. -240r3s + 2946s2 Find the second derivative of 46gw2 + 6gw - 3g - 3w2 + 6w wrt w. 92g - 6 What is the second derivative of 132m*	{ "pile_set_name": "DM Mathematics" }
-0.003 Let x = -0.06859 + -1.31891. Round x to 1 dp. -1.4 Let u be (1/3)/(13/156). Suppose 4v = -5q + 213, -q - uq - 72 = -v. Suppose vc = 52c - 1360. What is c rounded to the nearest 10? -270 Let t = 3069 - 3146.49. Round t to the nearest ten. -80 Suppose 1517n = 1528n - 5874. Let j be (381)/((-1)/10). Let h = n + j. What is h rounded to the nearest 10? 150 Let v = -72626.0265 + 72717. Let d = 70.4 + 20.6. Let q = d - v. What is q rounded to three dps? 0.027 Let h = -9659 - -15178. Suppose h = -4c + 4o - 1025, -4c - 3o = 6558. Round c to the nearest one hundred. -1600 Let b = -32.0000432 - 62.9999626. Let k = -121 + 216. Let x = b + k. Round x to 6 dps. -0.000006 Let h = 2.465 + 0.035. Let d = h + -2.484. Let k = d - -0.056. Round k to 2 dps. 0.07 Let b = 53 - 173. Let f = 1229 + -1285.9. Let z = b - f. What is z rounded to 0 decimal places? -63 Let b = 1.03 - 25.43. Let u = 12.8 - b. Round u to 0 decimal places. 37 Let u = -1515.75 + 1515.851409. Round u to 3 decimal places. 0.101 Let c = -452503.5 + 65798.5. Let k = -386705.1099802 - c. Let b = 0.11 + k. What is b rounded to six decimal places? 0.00002 Let i = -4080890.2299588 + 4080889. Let g = i + 1.23. What is g rounded to five decimal places? 0.00004 Let l = -42 + 37. Let u(j) = -7960j2 - 2j - 10. Let z be u(l). Round z to the nearest 100000. -200000 Suppose -16a + f - 6149 = -14a, 5a + 15375 = 5f. Round a to the nearest one thousand. -3000 Let m = 7113.8 + -6569. What is m rounded to the nearest 100? 500 Let r = -2386 + 2255.946. Let t = 0.054 + r. Let q = t - -129.99286. What is q rounded to three decimal places? -0.007 Let q = 0.073 + -0.131. Let c = 1.1 - 1.0525. Let l = c + q. What is l rounded to three decimal places? -0.011 Suppose 0 = 79k - 80k - t - 54302, -2t = -k - 54296. What is k rounded to the nearest ten thousand? -50000 Let k = -25889 - -25889.026142. What is k rounded to 3 dps? 0.026 Let b = 71.5116 - -0.0884. Let n = b - 27.8. Round n to the nearest 10. 40 Let l be 108/(-3) + 0 - -6. Let g be (-11 - l/5)8140. What is g rounded to the nearest ten thousand? -40000 Let f = 0.027 + -0.557. Let b = f + -0.04. Let v = -0.570043 - b. Round v to four dps. 0 Let u = -27.78 - -27.78000054062. What is u rounded to seven dps? 0.0000005 Let h = 728161.3590334 - 728232.359. Let j = 71 + h. What is j rounded to 6 decimal places? 0.000033 Suppose 3m = b + 14 + 2, -2m = 5b + 12. Let o be m + -990006 + 0 + 2. Round o to the nearest one hundred thousand. -1000000 Let a = -99778.0000078617 - -99778. What is a rounded to 6 dps? -0.000008 Suppose 2s - 4s - 911227 = 5p, -5p = -3s - 1366778. Let x = -262301 - s. Round x to the nearest ten thousand. 190000 Let h = -293.847 + -73.543. What is h rounded to the nearest one hundred? -400 Let x = -466243585.55237421 + 2.55237421. Let h = -466243515.0000047 - x. Let d = 68 - h. What is d rounded to six dps? 0.000005 Suppose 10m + 15 = 7m, -3m = c + 5. Let d = c + -8. Suppose -dx + 5x = -11910000. What is x rounded to the nearest 100000? -4000000 Let r(j) = -844j*3 + 5j*2 - 13j - 28. Let c be r(6). What is c rounded to the nearest ten thousand? -180000 Let j = -77269.9 + 70165. What is j rounded to the nearest one thousand? -7000 Let b = 317.27 - 317.2639178. What is b rounded to 4 dps? 0.0061 Let d = -32 - -57. Suppose db = -12372607 - 8102393. Round b to the nearest 100000. -800000 Let j = 19 + -27.6. Let g = -0.055 - -9.055. Let x = g + j. What is x rounded to the nearest integer? 0 Suppose 381t - 194t - 262420000 = 192t. Round t to the nearest one hundred thousand. -52500000 Suppose -7v + 14 = -0v. Suppose -6g + vg = -20. Let w be 21450/(-9)(1 + g). Round w to the nearest one thousand. -14000 Let d = -738172 - -738237.2073. Let z = -65.2 + d. What is z rounded to 3 dps? 0.007 Let z = 19.7 - 10.55. Let m = -131.9 - -123. Let d = z + m. Round d to one decimal place. 0.3 Let r = -16872 - -16884.481. Let y = 9.884 + 1.826. Let b = r - y. Round b to one dp. 0.8 Suppose 4r - 5 = -w - 1, -3w = 3r - 12. Let p be (-39 - (-2 + 0))7027. Let s be (-2)/8 + p/w. Round s to the nearest 10000. -70000 Let q = 6976.65 + -6712. Round q to the nearest integer. 265 Let q = -7882050.892999425 - -7882145.893. Let b = -6.5 + -88.5. Let i = q + b. What is i rounded to 7 dps? 0.0000006 Let n = -3792 + 3791.99999954375. What is n rounded to seven decimal places? -0.0000005 Let m be (9/(-6))/((-1)/12). Let r(c) = -c + 23. Let i be r(m). Suppose 0b = -3s - 2b + 8159994, -ib = 2s - 5439985. Round s to the nearest 100000. 2700000 Let z = -7226462.209 + 7222001. Let m = z + 4461.0150141. Let k = -0.194 - m. What is k rounded to 6 dps? -0.000014 Let q be 36/(-54) - 88/(-6). Suppose -40 = qy - 9y. Let h be (y - -28)(-2121 + 1). Round h to the nearest 1000. -9000 Let x = 37.1275 + 1531.7825. Let p = -1578 + x. Round p to the nearest integer. -9 Let j = 22731.8 - 25687. What is j rounded to the nearest ten? -2960 Suppose -6y = -4y - 85306. Let f(j) = 1887j - 116803j - 2 + yj - 189735j. Let l be f(1). What is l rounded to the nearest ten thousand? -260000 Let j(o) = 45000o2 - 4o - 8. Let z = -90 + 88. Let m be j(z). Round m to the nearest 10000. 180000 Let h = 0.5203 - 0.5230956. What is h rounded to 5 decimal places? -0.0028 Let w = -513 - 449. Let s = 961.998822 + w. Round s to 4 decimal places. -0.0012 Suppose 51r - 21184391 = -30291021 - 48880370. Round r to the nearest 1000000. -1000000 Let c = 658 + -472. Let n = c + -185.999415. Round n to four decimal places. 0.0006 Suppose 3 + 0 = 3g. Let s(o) = -23502o2 - g + 0o - 1 - 3o - 2o. Let t be s(-2). Round t to the nearest ten thousand. -90000 Suppose 33a - 70492878 - 61177287 = 0. Suppose 26c - a = 5i + 21c, -5i + 4c - 3990004 = 0. What is i rounded to the nearest 10000? -800000 Let i = -102.1778 + 103.26. Let o = 0.98 - i. What is o rounded to two decimal places? -0.1 Let n = -0.056 - -0.0578825. What is n rounded to four dps? 0.0019 Suppose -4n = -10n + 135312. Let f = n - 13062. What is f rounded to the nearest 1000? 9000 Let g = 405079.09635 + -405237.1. Let v = g + 158. Round v to three decimal places. -0.004 Suppose 0 = 41b + 209639 + 1323966. Let u = b - -65635. What is u rounded to the nearest one thousand? 28000 Let y = 35542.408 - 35419. Let l = y - 123. Round l to one dp. 0.4 Let x = -18205.00092953 - -18205. What is x rounded to five decimal places? -0.00093 Let t = 33382.24 + -33685. What is t rounded to the nearest integer? -303 Let y = -37219574 - -25420274. What is y rounded to the nearest one million? -12000000 Let p = -2590.99999884 - -2591. What is p rounded to seven dps? 0.0000012 Let b = -52 - -52.51. Let o = -32.95 + 32. Let j = o + b. Round j to one decimal place. -0.4 Let m = -0.028 - -0.1278. Let h = -13.4302 - m. What is h rounded to zero dps? -14 Let o = -2732 + 2504.1. Let x = -261.19 - o. Let v = 33 + x. What is v rounded to one decimal place? -0.3 Let a(v) = 1 - 3v2 + v2 - v + v*2 + 0v. Let z(h) = -4400003h2 - 4h + 3. Let c(p) = -4a(p) + z(p). Let r be c(-1). Round r to the nearest 1000000. -4000000 Let c = -2005826.850228 - -2006194.85. Let n = c - 368. Round n to four dps. -0.0002 Let b = -1374.705339 + 0.295339. Let a = b + 1382. What is a rounded to 1 dp? 7.6 Suppose 0g + 2g - 9444212 = 0. Let v = g - 1082106. Round v to the nearest 1000000. 4000000 Let s be (-55 + -2)(-2)/6. Suppose -1 = -k + 3o, o - 4 = 2k - 31. Suppose sb - kb = 1980000. What is b rounded to the nearest 100000? 700000 Let u = 2 + -17. Let f = 8.2 + u. Let s = f - -7.78. What is s rounded to one decimal place? 1 Let z = 44879.3 - 48827.79. Let t = 3930 + z. Round t to 0 dps. -18 Let x = -1.247363 - -1.312. Round x to two dps. 0.06 Let i = 7.11 + -69.91. Let q = -696 - -754.17. Let u = i + q. Round u to 1 dp. -4.6 Let s = -4978 + 4977.99996556. What is s rounded to six dps? -0.000034 Let b = -489 - -490. Let f be -1 - 2578/(3 - b). What is f rounded to the nearest 1000? -1000 Let z = -88672.61 + 89400. What is z rounded to 0 decimal places? 727 Let w = 38187485.6698909 + -38187484. Let n = w - 1.67. What is n rounded to 6 dps? -0.000109 Let f = -3449 - -3478.67. Let v = f + 4.13. Let d = 34 - v. What is d rounded to	{ "pile_set_name": "DM Mathematics" }
121232 Product of 217 and -187. -40579 -0.11 * 1.6498 -0.181478 11962 times 0.14 1674.68 -455 * -62 28210 Calculate -0.05-478467. 23923.35 Product of 9 and -71022. -639198 Multiply -36928 and -0.02. 738.56 2 0.66 1.32 Product of -1 and 11788. -11788 What is the product of -0.66172 and -0.3? 0.198516 Multiply -0.01 and 12827. -128.27 Product of -1.49 and 15.033. -22.39917 Product of -413 and 100. -41300 Calculate -3-41672. 125016 Calculate -88193-0.4. 35277.2 Multiply -13541 and -2. 27082 0.013 * -1008 -13.104 -4.4 * 1.277 -5.6188 -0.8 times 9002 -7201.6 Multiply -25.1226 and -0.1. 2.51226 0.050.2116 0.01058 14.72 0.928 13.66016 Multiply 120 and -14386. -1726320 -558-21 11718 560.65-0.31 -173.8015 41.367-0.4 -16.5468 -805035-0.2 161007 Calculate 2.059-740. -1523.66 -119 54 -6426 What is 0.5 times 10104? 5052 -0.2-148112 29622.4 -1865904 times 2 -3731808 -1038 -13 13494 Calculate 3.5-123.5. -432.25 Multiply -0.6 and -6155. 3693 What is 0.077 times 0.153? 0.011781 Calculate -0.4520.232. -0.104864 -100780.25 -2519.5 -3.8 times -0.2533 0.96254 -0.010.39257 -0.0039257 What is -2188.61 times 0.5? -1094.305 Calculate 4-9019. -36076 0.4 -194185 -77674 1.98288 15747.2 Calculate -360-19. 6840 159 * 587 93333 Product of 0.1098 and 2.7. 0.29646 Calculate -7-0.0911. 0.6377 What is the product of 42 and -0.4645? -19.509 -9238 times 0.4 -3695.2 What is the product of -0.37 and -20480? 7577.6 Work out -0.0319 -20. 0.638 Multiply -438.9 and 54. -23700.6 Calculate -1.790.02467. -0.0441593 -1 times 1.15911 -1.15911 What is 0.4 times 101551? 40620.4 1669 times 6.9 11516.1 2708.6 times -8 -21668.8 What is 332 times 4469? 1483708 -11.166 -66.96 What is the product of -184780 and -0.4? 73912 Multiply -11 and -25731. 283041 What is the product of 1 and -1.7677? -1.7677 What is the product of 206 and -6.636? -1367.016 Work out 1014.022 * 2. 2028.044 What is the product of 5481 and 224? 1227744 What is -3 times 8006? -24018 -1014555 times 1 -1014555 0.0428 * -0.004 -0.0001712 -2-1.1313 2.2626 Multiply -68555 and -3. 205665 What is the product of 2 and 32550? 65100 What is 3 times 14534? 43602 Work out 0.037797 0.3. 0.0113391 Work out -17002 * -0.8. 13601.6 What is the product of 733166 and -0.4? -293266.4 Multiply -0.106 and -9.089. 0.963434 Calculate -1075581. -107558 Product of 0.3 and -12891. -3867.3 Multiply -0.4 and -90.49. 36.196 Calculate 0.1234.9. 23.49 What is the product of 2 and 327718? 655436 Calculate 30-2342. -70260 Product of -6.36 and -6. 38.16 -271-11.194 3033.574 Multiply -0.41 and 25778. -10568.98 Calculate 121.05-4. -484.2 -13.89 142 -1972.38 2559649 2303676 Work out -2054 461. -946894 -44.88 times -3.4 152.592 Product of -74949 and 0.2. -14989.8 158962 times -2 -317924 Multiply -25.14 and 23. -578.22 Work out 161865 * 10. 1618650 Multiply 350238 and 0.1. 35023.8 Multiply -0.0326 and -20.7. 0.67482 What is the product of 2.436 and 0.107? 0.260652 Multiply 1076875 and -3. -3230625 -7-0.010363 0.072541 What is 35 times -192.8? -6748 Work out -412 -775.2. 319382.4 What is the product of 0.4 and -295505? -118202 Work out -31.9001 * 0.5. -15.95005 Calculate -0.1042876. -299.104 What is -23913 times 0.3? -7173.9 Product of -0.4 and -0.782. 0.3128 Multiply 0.1 and -803. -80.3 Multiply -0.3 and 2210. -663 Multiply 0.05 and -5.16348. -0.258174 What is the product of -79 and -211.43? 16702.97 Work out -15.77425 0.4. -6.3097 Multiply -5 and 17782. -88910 Calculate 2311-13. -30043 What is the product of 2 and -15.2815? -30.563 23 times 0.303 6.969 What is the product of 52809 and -0.3? -15842.7 -32.58 times -3.1 100.998 453558 times -0.06 -27213.48 0.3-7725.59 -2317.677 5 times -315202 -1576010 -34.6 times 4257 -147292.2 1869 times 0.158 295.302 Calculate -3-27124. 81372 -2.3 times 0.2264 -0.52072 Work out 0.26 -18715. -4865.9 -0.322681.4 -0.451752 -1.1 1.3049 -1.43539 0.1-33834 -3383.4 What is the product of -23 and -9200? 211600 Product of 0.06519 and -0.2. -0.013038 Multiply 10.74 and 0.13. 1.3962 Calculate 117604. 17604 Work out -19 * -0.25095. 4.76805 What is -0.045 times 0.03? -0.00135 421462 61404 Work out -13312 0.5. -6656 Calculate 298-0.11256. -33.54288 100200-39 -3907800 -4-0.0276761 0.1107044 What is the product of -4 and 3287.33? -13149.32 Work out -3.87865 -3. 11.63595 26 times -12562 -326612 Product of 7705 and -6.8. -52394 -14342 * 0.01 -143.42 0.1997-0.1502 -0.02999494 Calculate -2.748-0.002. 0.005496 9 times 13552 121968 -703554-2 1407108 Calculate -104-196. 20384 -270.674 * 0 0 Product of -0.0385 and -0.115. 0.0044275 What is the product of 0.41 and -0.0314? -0.012874 -0.0072.1708 -0.0151956 Work out -1.2 -2709. 3250.8 188 times 2643 496884 What is the product of 190 and -8.9? -1691 What is -0.5 times -192136? 96068 Calculate -6182.04. -1260.72 Calculate -0.794.19. -3.3101 6.11324 8076.4 -34020 -0.85 28917 Work out -549 * 66. -36234 What is -5 times -10.9806? 54.903 Multiply 130 and -129. -16770 Multiply -6580 and -3. 19740 1929.2 times -5 -9646 Multiply -610.36 and -54. 32959.44 -27038 * -2 54076 What is the product of -4 and -19979? 79916 Product of 0.4 and 1415.695. 566.278 What is 0.436 times 1670? 728.12 10952 times -0.5 -5476 -12-1.1305 13.566 Multiply 8.613 and 30. 258.39 -0.4 1.800686 -0.7202744 0.0459120.033 0.001515096 -10 -0.356 3.56 What is the product of 0.8956 and 0.2? 0.17912 Work out -3 * -29.5716. 88.7148 Product of -0.3 and -24512. 7353.6 What is the product of -23.3691 and 4? -93.4764 Multiply 4 and 6.536. 26.144 Product of -761350 and 0.3. -228405 Calculate -1463-0.366. 535.458 -0.10.0866 -0.00866 What is the product of -1.8 and 94.81? -170.658 Calculate -38770-0.16. 6203.2 Calculate 0.116270. 1627 -1.1 times 3.953 -4.3483 -8 * -20.45 163.6 Work out 2126 * -669. -1422294 Work out 4 * -8455. -33820 1219.5 * 0.057 69.5115 Product of 99650 and 0.2. 19930 Multiply 0.2 and -1676. -335.2 Calculate 6355360.5. 317768 What is -5743 times -7.32? 42038.76 -2.20879 -0.5 1.104395 Multiply -0.06 and 2073. -124.38 What is -5.29205 times -0.4? 2.11682 -15.52-0.64 9.9328 Product of 27 and 30880. 833760 Calculate -227489. -54978 Multiply 0.04 and -1681.8. -67.272 Product of -2 and -3847.1. 7694.2 Calculate -1534298. -514470 Calculate 92871. 25839 Multiply -8 and -0.005371. 0.042968 Calculate 2159117. 367047 Multiply 190.958 and 0. 0 -805682 0.1 -80568.2 Work out 0.03 * -82125. -2463.75 What is 0.1 times -38719? -3871.9 7.59 * 184 1396.56 What is 102 times -6.08? -620.16 -1.613153 -21044.8 9568 7648 Product of -1647.3 and 116. -191086.8 98.1-0.54 -52.974 What is the product of -820082 and 0? 0 75.425 1885 3 times 0.0035527 0.0106581 What is -510 times 2? -1020 What is the product of -1956.4 and 4.1? -8021.24 Multiply -0.05 and -6239. 311.95 Calculate -320728. -62184 Product of 15.1 and -664. -10026.4 Product of -2.5 and -1.5476. 3.869 Work out -9 -7296. 65664 Multiply 2630 and 37.1. 97573 Calculate 244583. 109992 What is the product of -3.5 and 149739? -524086.5 1479.312.2 18047.46 Work out 0.1 * -1.88783. -0.188783 What is the product of -4222 and -1? 4222 Work out -20011 * 1.85. -37020.35 Multiply 5 and -0.883. -4.415 What is the product of 0.03 and 72348? 2170.44 Multiply -4.5779 and 1. -4.5779 -6 times 82056 -492336 12543-1 -12543 -65 -0.0116 0.754 Calculate -0.49282. -138.18 -40.1372 -0.5488 -0.0492 * -9.18 0.451656 Calculate 0.398220. 7.964 0.3-0.89495 -0.268485 -121.4 times -26 3156.4 What is -4.2 times 0.066743? -0.2803206 4180 times 0.097 405.46 -275843 -82752 Work out -13 -764. 9932 What is the product of -85222 and 6? -511332 139.58 * -3 -418.74 Calculate -5400907. -2004535 Work out -38 -583. 22154 Multiply 289 and -37. -10693 Work out 154 * -181. -27874 381780 67640 121 -1461 -176781 -3328 times -1.2 3993.6 -92469 * -0.7 64728.3 What is 3489 times -16? -55824 Work out -2375 * -14. 33250 -91655.8 * 0.3 -27496.74 What is -2.8 times 34.45? -96.46 -1 times -242.543 242.543 2 * -1176380 -2352760 What is the product of -1223 and -0.35? 428.05 -0.55 * 8971 -4934.05 Product of -2654964 and -0.3. 796489.2 Work out -25 * 2085. -52125 Multiply -3.5354 and 0.05. -0.17677 0.5 * -31.5922 -15.7961 Product of -0.6128	{ "pile_set_name": "DM Mathematics" }
39213? False Is 136802 a multiple of 5? False Is 22 a factor of 29896592? True Is 9028458 a multiple of 18? True Is 10622364 a multiple of 2082? True Is 242 a factor of 125226? False Is 32 a factor of 585370? False Does 1023 divide 19650807? True Is 423968 a multiple of 32? True Is 16199280 a multiple of 1510? True Does 38 divide 1716364? False Does 290 divide 3020753? False Is 354386 a multiple of 37? True Is 364389 a multiple of 2? False Does 3 divide 4568? False Is 1192640 a multiple of 320? True Is 242 a factor of 2765576? True Is 142 a factor of 1787087? False Is 39 a factor of 1169457? False Is 337516 a multiple of 69? False Is 1040820 a multiple of 95? True Is 535 a factor of 39055? True Is 9 a factor of 58383? True Is 3656822 a multiple of 26? True Is 692682 a multiple of 3? True Does 913 divide 1878590? False Is 129 a factor of 85928? False Is 3147408 a multiple of 528? True Does 13 divide 95263? False Is 9 a factor of 386928? True Does 230 divide 305545? False Does 16 divide 91700? False Is 8417 a multiple of 28? False Does 62 divide 139373? False Does 1715 divide 7882140? True Is 39 a factor of 8853? True Is 673 a factor of 1658272? True Is 69 a factor of 554202? False Does 154 divide 4168164? True Is 16 a factor of 64652? False Is 338472 a multiple of 12? True Is 39 a factor of 134518? False Is 914 a factor of 822834? False Does 178 divide 3487732? True Does 141 divide 382591? False Is 109 a factor of 45288? False Is 23 a factor of 189944? False Is 152 a factor of 102904? True Is 7 a factor of 1629194? True Is 3012933 a multiple of 33? True Is 19 a factor of 983945? False Is 45 a factor of 33885? True Does 15 divide 2406705? True Does 8 divide 556358? False Does 111 divide 65255? False Is 71760 a multiple of 230? True Is 5593508 a multiple of 51? False Does 13 divide 29250? True Is 162 a factor of 255176? False Does 1085 divide 8172220? True Is 81 a factor of 3696597? True Is 15784 a multiple of 20? False Does 55 divide 312215? False Is 33567 a multiple of 351? False Is 25 a factor of 176867? False Does 17 divide 1789790? False Is 52 a factor of 691184? True Is 74871 a multiple of 300? False Does 14 divide 170492? True Is 38 a factor of 506996? True Is 20 a factor of 122783? False Does 244 divide 281401? False Is 13311 a multiple of 17? True Is 706734 a multiple of 39? False Does 160 divide 137973? False Does 45 divide 283980? False Does 652 divide 8967113? False Is 7 a factor of 1366743? True Is 19 a factor of 78166? True Does 17 divide 188292? True Does 20 divide 104280? True Is 50 a factor of 428250? True Is 475956 a multiple of 156? True Is 1594005 a multiple of 595? True Is 381 a factor of 21045268? False Is 826147 a multiple of 1103? True Is 418 a factor of 2738243? False Is 153331 a multiple of 16? False Does 40 divide 208560? True Does 15 divide 475440? True Does 83 divide 6474? True Is 4 a factor of 4310? False Does 17 divide 2001871? False Is 1836 a factor of 8651663? False Is 38 a factor of 1748853? False Is 391893 a multiple of 455? False Is 11520 a multiple of 36? True Is 143472 a multiple of 21? True Does 46 divide 2469510? True Is 251291 a multiple of 5? False Is 187365 a multiple of 2? False Does 871 divide 19850090? True Does 8 divide 599048? True Is 4 a factor of 962149? False Does 350 divide 1996881? False Is 355610 a multiple of 62? False Is 1996615 a multiple of 2? False Is 9 a factor of 113735? False Is 26 a factor of 813353? False Is 30 a factor of 713610? True Is 611488 a multiple of 8? True Is 654977 a multiple of 33? False Is 5712234 a multiple of 1166? True Is 10924256 a multiple of 32? True Does 19 divide 1005157? True Does 47 divide 4263041? True Is 107 a factor of 135609? False Is 382 a factor of 202297? False Does 44 divide 361464? False Does 599 divide 722993? True Does 64 divide 66993? False Does 15 divide 1341241? False Is 3 a factor of 20373? True Is 23 a factor of 573706? False Is 1631205 a multiple of 27? True Does 71 divide 791443? False Is 30798 a multiple of 2? True Is 6 a factor of 1970242? False Is 1252 a factor of 931488? True Is 1908848 a multiple of 149? False Is 242 a factor of 395670? True Is 160 a factor of 515040? True Does 22 divide 9477586? False Is 597 a factor of 491815? False Is 57385 a multiple of 176? False Does 2 divide 12639? False Is 2780821 a multiple of 19? True Is 88819 a multiple of 210? False Is 249250 a multiple of 1994? True Does 86 divide 37960? False Is 172790 a multiple of 18? False Is 7953 even? False Does 18 divide 724594? False Does 70 divide 112185? False Is 241 a factor of 1199457? True Is 149047 a multiple of 132? False Is 197 a factor of 22458? True Is 255 a factor of 3688439? False Does 76 divide 521411? False Does 53 divide 681783? False Is 4275162 a multiple of 53? False Does 180 divide 108180? True Is 12 a factor of 221429? False Does 11 divide 254276? True Is 550914 a multiple of 162? False Is 9 a factor of 94456? False Is 14 a factor of 1237502? True Is 1975899 a multiple of 91? False Is 4270954 a multiple of 11? False Is 365421 a multiple of 8? False Does 194 divide 155306? False Does 4 divide 509568? True Does 1098 divide 557784? True Does 9 divide 100629? True Does 59 divide 51591? False Is 246561 a multiple of 21? True Is 1069446 a multiple of 14? True Does 38 divide 8866616? True Does 19 divide 970026? True Does 306 divide 132162? False Does 12 divide 3017388? True Is 3137039 a multiple of 4? False Is 4044096 a multiple of 714? True Is 170 a factor of 7987248? False Does 148 divide 1043079? False Does 259 divide 319282? False Is 35 a factor of 935935? True Is 199507 a multiple of 96? False Is 524460 a multiple of 15? True Does 71 divide 141148? True Is 1325 a multiple of 2? False Does 37 divide 2006660? False Is 105679 a multiple of 9? False Is 88107 a multiple of 24? False Is 741299 a multiple of 13? True Does 12 divide 86360? False Does 31 divide 1563068? False Is 44071 a multiple of 3? False Does 251 divide 1496298? False Does 71 divide 636930? False Does 68 divide 352929? False Is 168 a factor of 2510199? False Does 1304 divide 3472389? False Is 9 a factor of 60226? False Is 61 a factor of 534030? False Does 88 divide 932272? True Is 116656 a multiple of 317? True Is 13127101 a multiple of 1651? True Does 10 divide 48290? True Is 537 a factor of 580497? True Is 416 a factor of 4560811? False Is 780864 a multiple of 52? False Is 1157 a factor of 2625977? False Does 31 divide 402411? True Is 108394 a multiple of 379? True Is 117 a factor of 506935? False Does 216 divide 5281? False Is 4914 a multiple of 172? False Does 168 divide 3842496? True Is 1576 a factor of 19302848? True Is 825536 a multiple of 13? False Does 708 divide 28320? True Does 10 divide 250990? True Is 11443436 a multiple of 31? False Is 92 a factor of 60913? False Is 13 a factor of 202769? False Is 40 a factor of 85160? True Does 21 divide 37323821? False Does 226 divide 249005? False Is 127 a factor of 10909850? False Is 257427 a multiple of 61? False Does 11 divide 770693? True Is 169 a factor of 687591? False Does 18 divide 791118? True Does 37 divide 348518? False Is 47796 a multiple of 28? True Is 2150385 a multiple of 44? False Does 386 divide 399804? False Does 58 divide 316075? False Is 3320384 a multiple of 58? True Does 145 divide 164140? True Is 341 a factor of 2437752? False Is 144714 a multiple of 534? True Does 9 divide 375545? False Is 7 a factor of 81256? True Does 57 divide 1718493? True Is 90 a factor of 180089? False Is 1068921 a multiple of 7? True Is 16245 a multiple of 5? True Is 243 a factor of 2297322? True Does 5 divide 69910? True Is 21 a factor of 2181970? False Is 451 a factor of 4447505? False Is 816 a multiple of 24? True Is 7848 a multiple of 18? True Is 34136 a multiple of 34? True Is 4768308 a multiple of 54? True Is 26034 a multiple of 3? True Is 23421 a multiple of 25? False Does 19 divide 57817? True Is 2 a factor of 269590? True Is 153987 a multiple of 18? False Is 34 a factor of 807024? True Does 30 divide 3425940? True Is 1633699 a multiple of 43? True Is 17 a factor of 30498? True Does 25 divide 131175? True Is 96579 a multiple of 27? True Does 27 divide 9460395? True Is 3209412 a multiple of 6? True Does 5 divide 5233100? True Does	{ "pile_set_name": "DM Mathematics" }
sequence ccxx. 1/21 Two letters picked without replacement from psqq. Give prob of sequence ps. 1/12 What is prob of sequence rrt when three letters picked without replacement from krtkrtkt? 1/56 What is prob of sequence pbx when three letters picked without replacement from pthbhttbpxpttptbt? 1/340 What is prob of sequence vu when two letters picked without replacement from vum? 1/6 What is prob of sequence bjy when three letters picked without replacement from {y: 2, b: 1, a: 1, k: 5, j: 1}? 1/360 Four letters picked without replacement from eneeeeesjujnjsjes. Give prob of sequence nens. 1/1360 What is prob of sequence gss when three letters picked without replacement from jggsssbgssbgs? 10/143 Three letters picked without replacement from bbbeebbttt. What is prob of sequence eet? 1/120 Calculate prob of sequence vlv when three letters picked without replacement from vsxvxxvxsxlxlsvyvyvl. 1/76 Calculate prob of sequence kqkk when four letters picked without replacement from kmsqlkklgqqmm. 3/2860 What is prob of sequence epee when four letters picked without replacement from eessespeeepsepeeeep? 55/1292 What is prob of sequence tw when two letters picked without replacement from wwwttww? 5/21 What is prob of sequence zz when two letters picked without replacement from {x: 3, q: 7, g: 5, z: 2}? 1/136 Calculate prob of sequence xbv when three letters picked without replacement from {x: 8, m: 1, q: 2, v: 1, b: 1, c: 1}. 1/273 Calculate prob of sequence dyyy when four letters picked without replacement from {d: 1, y: 3}. 1/4 What is prob of sequence cxc when three letters picked without replacement from cycyccyccyyxyyyccxy? 56/2907 What is prob of sequence iwwv when four letters picked without replacement from {i: 3, m: 3, v: 2, u: 3, z: 1, w: 2}? 1/2002 Calculate prob of sequence uzh when three letters picked without replacement from ushueshsudssuzs. 4/1365 What is prob of sequence xxkk when four letters picked without replacement from cxxcckkk? 1/140 Three letters picked without replacement from tttottto. What is prob of sequence too? 1/28 Calculate prob of sequence sves when four letters picked without replacement from {v: 1, w: 3, e: 1, i: 3, s: 2}. 1/2520 Calculate prob of sequence ra when two letters picked without replacement from {r: 1, q: 1, a: 3, v: 6, u: 6}. 3/272 What is prob of sequence zqm when three letters picked without replacement from qzqqqdjqzmzdq? 3/286 Three letters picked without replacement from {p: 3, o: 4}. Give prob of sequence opp. 4/35 Three letters picked without replacement from {e: 2, s: 1}. Give prob of sequence eee. 0 Four letters picked without replacement from {h: 3, j: 1, n: 3, y: 2, q: 1, z: 3}. Give prob of sequence hnyq. 3/2860 What is prob of sequence lb when two letters picked without replacement from elbblbeeeebee? 2/39 Four letters picked without replacement from zoszosfsoo. Give prob of sequence zsfo. 1/210 Four letters picked without replacement from lmlwwwqmwq. Give prob of sequence wwwq. 1/105 What is prob of sequence tq when two letters picked without replacement from ttgttttgtgtgtttttgqt? 7/190 Four letters picked without replacement from yvvbvbbvvnyyvybb. Give prob of sequence byvb. 1/91 Calculate prob of sequence fdd when three letters picked without replacement from {f: 3, c: 4, d: 6}. 15/286 Four letters picked without replacement from yyyygyhhh. What is prob of sequence hhyy? 5/126 Calculate prob of sequence eu when two letters picked without replacement from {u: 9, e: 7}. 21/80 Calculate prob of sequence pll when three letters picked without replacement from {p: 2, y: 1, l: 2}. 1/15 Four letters picked without replacement from xxcmmc. What is prob of sequence cmcm? 1/90 Calculate prob of sequence vvvv when four letters picked without replacement from {v: 7}. 1 Two letters picked without replacement from xgwgixwwwiww. What is prob of sequence gx? 1/33 Two letters picked without replacement from {k: 1, e: 3, f: 4, t: 3}. Give prob of sequence fe. 6/55 Four letters picked without replacement from {a: 4, o: 7, f: 1, b: 2}. What is prob of sequence oaoo? 5/143 What is prob of sequence dg when two letters picked without replacement from {a: 2, b: 1, d: 1, h: 1, g: 2, r: 1}? 1/28 What is prob of sequence tt when two letters picked without replacement from {p: 15, t: 3}? 1/51 What is prob of sequence gz when two letters picked without replacement from zznggngnzzz? 3/22 What is prob of sequence rbrb when four letters picked without replacement from {n: 1, r: 2, q: 2, t: 10, z: 2, b: 1}? 0 Four letters picked without replacement from {e: 1, i: 4, a: 6}. What is prob of sequence iiee? 0 Calculate prob of sequence ywz when three letters picked without replacement from wyrozrwww. 1/126 What is prob of sequence kkw when three letters picked without replacement from kkwkpwpkkkwkwkpk? 3/35 Calculate prob of sequence tka when three letters picked without replacement from kkktkgakkgggggk. 1/390 Calculate prob of sequence mm when two letters picked without replacement from mgggmggmggmggg. 6/91 Four letters picked without replacement from {o: 5, g: 3, b: 8, q: 1, y: 3}. What is prob of sequence gboo? 4/969 What is prob of sequence rs when two letters picked without replacement from {s: 1, r: 19}? 1/20 Three letters picked without replacement from ygngggnofgnx. What is prob of sequence goy? 1/264 Calculate prob of sequence qyyi when four letters picked without replacement from iqyddyaydi. 1/420 Two letters picked without replacement from jyyjyjnyy. Give prob of sequence yy. 5/18 Four letters picked without replacement from ddddhdddyzyz. Give prob of sequence ddzh. 7/990 Two letters picked without replacement from {s: 8, f: 9, d: 1, r: 1}. What is prob of sequence ds? 4/171 Calculate prob of sequence qm when two letters picked without replacement from jqxmquqqqqqqxxxutuju. 2/95 What is prob of sequence lf when two letters picked without replacement from {l: 4, u: 4, n: 1, f: 6, w: 2, v: 1}? 4/51 Calculate prob of sequence jjxl when four letters picked without replacement from xjlxjlxll. 1/126 What is prob of sequence qb when two letters picked without replacement from {b: 1, q: 1, x: 2}? 1/12 Four letters picked without replacement from {o: 3, j: 3, q: 1, f: 2, n: 2, h: 1}. What is prob of sequence hfoo? 1/990 Calculate prob of sequence lxx when three letters picked without replacement from aaalllxnax. 1/120 What is prob of sequence zpbn when four letters picked without replacement from pibnnnppppnbpbzppzb? 8/2907 What is prob of sequence ju when two letters picked without replacement from {q: 2, u: 2, a: 1, h: 1, j: 8, i: 1}? 8/105 What is prob of sequence jc when two letters picked without replacement from jjjjjjjcjjjjjjjjjcjj? 9/95 Calculate prob of sequence qq when two letters picked without replacement from qdtlttttttqqdztlt. 3/136 Four letters picked without replacement from vyyvvyyyyvy. Give prob of sequence yvyy. 7/66 Two letters picked without replacement from dsspdjdsdpdpsdudsudx. Give prob of sequence sp. 3/76 What is prob of sequence vqq when three letters picked without replacement from {q: 4, v: 2}? 1/5 Calculate prob of sequence yt when two letters picked without replacement from {o: 6, d: 1, l: 1, y: 3, t: 1, i: 4}. 1/80 Two letters picked without replacement from {s: 1, u: 1, b: 1, c: 1, h: 2, e: 1}. What is prob of sequence cu? 1/42 Three letters picked without replacement from bpbphhqqbqqhqmhqqm. What is prob of sequence hph? 1/204 What is prob of sequence tt when two letters picked without replacement from nqqtnnqqntnnnqnqnq? 1/153 What is prob of sequence ub when two letters picked without replacement from {b: 2, a: 1, g: 1, p: 2, u: 1}? 1/21 Calculate prob of sequence uuuu when four letters picked without replacement from {u: 6}. 1 Two letters picked without replacement from {j: 2, l: 1, f: 2, x: 1, q: 1}. What is prob of sequence fl? 1/21 Three letters picked without replacement from {q: 7, t: 6, j: 1}. What is prob of sequence qjq? 1/52 What is prob of sequence wq when two letters picked without replacement from {q: 2, y: 1, w: 4}? 4/21 Two letters picked without replacement from ftftfffutfftt. What is prob of sequence ft? 35/156 Calculate prob of sequence ra when two letters picked	{ "pile_set_name": "DM Mathematics" }
8i - 2. Let y(b) = -j(b) - 6k(b). Let d(u) = -4u2 + 9 - 4 - 4u*2 - 5u + u*2. What is 6d(t) - 15y(t)? 3t2 Let p(m) = -m2 - 4m + 5. Let b(d) = -3d*2 - 9d + 10. Give -3b(x) + 7p(x). 2x2 - x + 5 Let v(p) = -p2 + p + 1. Let c(k) = k2 + 2k - 7. Give -c(h) + 2v(h). -3h*2 + 9 Let c(f) = -7f*3 + 5f*2 + 6f - 7. Let t(x) = -20x3 + 16x*2 + 17x - 20. Give 17c(b) - 6t(b). b*3 - 11b*2 + 1 Suppose 8q = 4q. Let d(t) = -t + 0t + qt + 4 + 1. Let w(j) = 1. Determine -d(h) + 5w(h). h Let i(s) = -7s + 1. Let m(g) = -13g + 1. Calculate 11i(r) - 6m(r). r + 5 Let d(k) = -8k3 + k - 3. Let l(i) = 9i*3 - i + 4. What is 4d(x) + 3l(x)? -5x*3 + x Let d(l) = -10l*2 + 6l - 11. Let x(g) = -2g2 + g - 2. Let b = 21 - 19. What is bd(n) - 11x(n)? 2n*2 + n Let s(c) = 19c*2 + 3c. Let d(o) = o*2 + o. Calculate 4d(m) - s(m). -15m2 + m Let b(p) = 4p*2 + 9. Let v(u) = -2u2 + u2 - 4 - u*2 + 0u*2. What is 4b(x) + 9v(x)? -2x*2 Let b(o) = 2o*2 + 5o + 2. Let f(h) = -9h2 - 25h - 11. Give -11b(r) - 2f(r). -4r2 - 5r Let j(n) = 7n3 - 4n*2 + 10n. Let m(g) = -6g3 + 3g*2 - 9g. Determine 5j(f) + 6m(f). -f*3 - 2f*2 - 4f Let x(l) = 34l2 - 16l + 16. Let i(g) = -23g2 + 11g - 11. Let q(b) = 8i(b) + 5x(b). Let y(j) = -9j2 + 5j - 5. What is 5q(o) - 8y(o)? 2o2 Let u be 4(2/(-1) + 0). Let p = u + 4. Let m(f) = -5f + 6. Let i(b) = 20b - 15. Let h(o) = -7o + 5. Let g(s) = 8h(s) + 3i(s). What is pg(z) - 3m(z)? -z + 2 Let a(m) = m. Let k(x) = 4x + 2. Let b(u) = -1 - 3u - 1 - 6u. Let h be b(-3). Suppose -3c + 3y - 7 = -h, 0 = 5c + 4y - 3. Calculate ca(p) - k(p). -p - 2 Let a(c) = -15c*2 + 9c. Let r(y) = -11y2 + 15y*2 + 4y - 11y2. Give 4a(k) - 9r(k). 3k2 Let i(p) be the second derivative of p4/12 + p*3/6 + 2p. Let m(f) = 6f2 + 4f + 1. Give 5i(x) - m(x). -x2 + x - 1 Let s(f) = -3f*3 + 4f*2 - 5f + 2. Let i(l) be the first derivative of -5l4/4 + 2l*3 - 4l*2 + 3l + 3. Calculate -5i(h) + 8s(h). h*3 + 2h*2 + 1 Let v(m) = -3m*2 - 5m + 3. Let d(y) = -6y2 - 11y + 6. What is -3d(w) + 7v(w)? -3w2 - 2w + 3 Let d(o) = -o + 9. Let j(l) = 2l - 26. Calculate 17d(f) + 6j(f). -5f - 3 Suppose 8 = -4l + 5l - 2w, 4l - 2w = 26. Suppose 1 = -3d + 2d. Let z(a) = 4a*2 - 6a. Let g(q) = q*2 - q. Calculate dz(u) + lg(u). 2u*2 Suppose 2j = -5m + 59, -2j + 14 = -3m - 5. Suppose 16 = -3p - j. Let t(d) = 7d + 8. Let k(v) = 1 - 2 - 7 - 13v - 7. Give pt(f) - 6k(f). f + 2 Let c(a) = -a - 1. Let d(h) = h + 8. Let f(x) = 2c(x) + d(x). Let s(j) = j - 5. Give -2f(o) - 3s(o). -o + 3 Let b(d) = d2 - 1. Let t = 7 - 15. Let u(f) = 10f*2 + 2f - 8. Calculate tb(z) + u(z). 2z*2 + 2z Let l(p) = 15p2. Let m = -174 - -179. Let c(u) = -u3 + 8u*2 - 10u + 9. Let v be c(7). Let t(g) = 6g2. What is ml(f) + vt(f)? 3f*2 Suppose -5b - 35 = 5. Let a be 19/(-4) + 2/b. Let n(g) = -6g. Let d(v) = -3v. Calculate an(z) + 9d(z). 3z Let s(l) be the second derivative of l6/30 + l2/2 - 2l. Let k(n) be the first derivative of s(n). Let w = -7 + 4. Let g(x) = -x*3. Give wg(f) - k(f). -f*3 Let m(w) = -5w*3 + 2w*2 + 19w - 4. Let i(j) = -11j3 + 4j*2 + 37j - 9. Give -4i(q) + 9m(q). -q*3 + 2q*2 + 23q Let y(g) = -11g + 8. Suppose -i + 5 = 3j, i - 6 - 7 = 5j. Let a(f) be the second derivative of -7f*3/6 + 5f*2/2 - 2f. Give ia(o) - 5y(o). -o Let j(s) = -16s + 2. Let l(p) = 49p - 6. What is -17j(a) - 6l(a)? -22a + 2 Let k(p) = p. Let s(c) = c + 2. Let t(f) = f2 + 2f - 4. Let n be t(-3). Let q(u) = ns(u) - 4k(u). Let i(v) = 3v + 1. Give 11i(h) + 6q(h). 3h - 1 Let p(t) = -16t + 3. Let l(d) = 47d - 9. Determine 6l(b) + 17p(b). 10b - 3 Let h(q) = q2 - q - 3. Let r(b) = -b2 + 4. Calculate -6h(j) - 5r(j). -j2 + 6j - 2 Let d(w) = w3 + w2. Let y(p) = -6p3 + 20p*2 + 1. Calculate 5d(c) + y(c). -c*3 + 25c*2 + 1 Let h(q) = 33q. Let k(r) = r. What is h(t) - 12k(t)? 21t Let i(p) = p. Let o(n) be the third derivative of 7n4/24 + n3/2 - 8n*2. Suppose 8 = m + 3a, -2m - m + 4a - 15 = 0. What is mo(f) + 5i(f)? -2f - 3 Let v(p) = 2p*2 + 3p + 3. Let u = -6 - -9. Let h(w) = -2w2 + w2 - 2w*2 - 4 - 4w. Determine uh(s) + 4v(s). -s*2 Suppose -20 = -5p + 2a, -3a = 2p - 5a - 14. Let r(o) = 2o + 3o*2 - 4o - 5op + 6o*2. Let h(u) = -2u*2 + u. Calculate -5h(v) - 2r(v). 2v*2 - v Let f(l) = -l. Let u(c) = 6c - 1. Suppose -25 = -5m - 0m. Calculate mf(r) + u(r). r - 1 Let i be (-11)/(-2) - 3/(-2). Let f(g) = -6g + g - i - g. Let c(x) = -7x - 8. Give 5c(l) - 6f(l). l + 2 Let k(h) = -66h*3 + 8h*2 - 6h. Let a(c) = 44c3 - 5c*2 + 4c. Calculate 8a(x) + 5k(x). 22x3 + 2x Let h(b) = -3b2 + 91b. Let n(x) = x*2 - 30x. Give -4h(f) - 11n(f). f*2 - 34f Let y(j) = -4j + 3. Let b(a) = 3a - 2. Give 6b(i) + 4y(i). 2i Let j(o) = -6o*3 + 4o*2 - 4o - 6. Let i(u) = 3u2 - 7u - 2 - 3 + 9u - 5u - 5u3. Calculate -4i(f) + 3j(f). 2f*3 + 2 Let h(y) = 7y - 9. Let f(q) = 10q - 13. Suppose 0 = 6o - 5 + 113. Let m = o + 11. Determine mh(i) + 5f(i). i - 2 Let n(v) = -2v3 + 6v*2 - 4v - 8. Suppose 2d - 12 = -d. Let r(a) = -4a + a*2 + 0 + da - a - 1. Let k = -12 + 6. Give kr(x) + n(x). -2x*3 + 2x - 2 Let x(b) = -6b2 - 2b + 4. Let c(n) = 6n2 + 3n - 5. Give -4c(j) - 5x(j). 6j2 - 2j Let q(p) = 3p2 - 3. Let t(u) = u2 - 2. Give -3q(h) + 5t(h). -4h*2 - 1 Let n(z) = 15z + 1. Let o(k) = 7k. What is 6n(x) - 13o(x)? -x + 6 Suppose j - 1 = 5. Suppose -2o + 52 = -jo. Let w(n) = -15n*3 - 2n*2 + 13n + 4. Let b(c) = -7c3 - c2 + 6c + 2. Give ob(r) + 6w(r). r3 + r2 - 2 Let q(h) = -6h2 - 5h - 1. Let x(m) = -3m2 - 3m - 1. Suppose -5r = -3t + 40, 5t - r = 4t + 10. What is tx(c) - 3q(c)? 3c2 - 2 Let x(t) = -t - 1. Let g = -30 - -29. Let a(y) = -2y - 6. Give ga(k) + 5x(k). -3k + 1 Let d(m) = -m2 - 9m - 15. Let k be d(-5). Let t(u) = u*2 - 2u + 2. Let y(p) = 3p2 - 5p + 5. What is kt(b) - 2y(b)? -b2 Let q(s) be the third derivative of -s5/30 + s*4/6 + 2s*3/3 + 8s*2. Let z(k) = -4 - 11k - 7 + 3 - 3 + 5k2. Calculate 11q(m) + 4z(m). -2m2 Let w(g) be the third derivative of -g5/20 + g4/12 - g3/2 + 5g2. Let z(v) = -13v*2 + 9v - 12. What is 9w(s) - 2z(s)? -s*2 - 3 Let i(p) = -4p + 5 - 3 - 7p. Let r = 1 + 8. Let y(v) = -5v + 1. What is ry(b) - 4i(b)? -b + 1 Let m(t) = -t + 3. Let r(p) = -p - 1. Let f(w) = -w - 1. Let a(j) = -f(j) + 2r(j). What is a(b) + m(b)? -2b + 2 Let b = -5 + 2. Let v(i) = -i3 + 2. Let x(j) = j3 - j*2 - j + 2j + 0 - 4 + 1. What is bv(o) - 2x(o)? o*3 + 2o*2 - 2o Let a(x) = 8x3 - 6x*2 + 8x - 6. Let i(q) = 17q3 - 11q*2 + 15q - 11. Determine 11a(n) - 6i(n). -14n3 - 2n Let s(z) = -z*2 + 9z - 1. Let g(m) = -m*2 + 13m - 1. Suppose -5 + 3 = 2d. Let j = d - -8. What is js(f) - 5g(f)? -2f*2 - 2f - 2 Let p(n) = 33 - 4n3 - 7n*3 - 33n*2 - 2n*3 - 11n*3. Suppose 56 = 3a - 43. Let z(w) = -3w3 - 4w*2 + 4. Determine az(h) - 4p(h). -3h*3 Let v(a) be the second derivative of 0 + 1/6a*4 - 1/20a*5 + 2a*2 - 2a + 0a3. Let l(g) = 2g3 + g3 - g*3 - 5 - 2g*2. Give -3l(y) - 4v(y). -2y*3 - 2y*2 - 1 Let p(f) = -3f - 2. Let x(o) = -10o - 7. Suppose 0 = -2n + 4n. Suppose y - 6y + 70 = n. Suppose 0 = -5a + 2 - 22. What is ax(w) + yp(w)? -2w Let z(a) = a*3 + 3a2 - a. Let m(l) = l2 - l + 1. Let t(c) = c*3 + 3c*2 - 2c + 9. Let s be t(-4). What is sm(i) - z(i)? -i3 - 2i*2 + 1 Let l(b) = 2b*3 - 3b*2 + 3b. Let w(i) = -i*2 + i. Let j be 6/(-3) + (-1 - -4). Determine jl(m) - 2w(m). 2m3 - m2 + m Let u(i) = -2i2 - 12i. Let v(x) = -11x2 - 71x. Determine 34u(g) - 6v(g). -2g2 + 18g Let h be 1 + -2 + 0 + 0/2. Let j(t) = -t*2 - 2t - 3. Let s(k) = -k*3 - k - 1. Calculate hj(m) + 3s(m). -3m3 + m2 - m Let w(u) = 7u + 4. Let h(l) = -7l - 3. Give -4h(z) - 3w(z). 7z Let j(g) = g - 1. Let a(q) = -3q + 4. Determine -5a(k) - 20j(k). -5k Let k(f) = f3 + f*2 + 1. Let l(j) = 3	{ "pile_set_name": "DM Mathematics" }
s)/s)/s(1/5)s(ss*(-1))/ss/(s/(s/(sss9))) assuming s is positive. s(-76/5) Simplify (g/(g/g*0g))(-31)/(g0)35 assuming g is positive. g31 Simplify w(w/(w/(w/w(1/5)w)))/ww/(w/(w/(w/((w(13/4)w)/w))w))(w(1/4))(1/7) assuming w is positive. w*(213/35) Simplify (((pp*(2/9)p)/p)/((p*(-8)p)/p))/(p/(p/(p*(9/7)/pp)))(3/8) assuming p is positive. p(4405/504) Simplify (((x/(x*(-1/2)/x))/x)/x(x/x*(-7))/xxx)/(x(-2/23)/(x(-3/8)/xx)) assuming x is positive. x*(1695/184) Simplify (xx/(x/x(-2)))/(x/(x(-3/4)/x))(x(-2/15))(-4/5) assuming x is positive. x(-1093/300) Simplify ((i/((i(i/(i*(-4/3)i))/i)/i)i)/(ii(-6)))/(i(5/2)i)(-2) assuming i is positive. i(41/3) Simplify ((cc*(-2)c)/ccc*(-2)(ccc*(-7)cc)/(c/c(-13)))(-24) assuming c is positive. c456 Simplify (t(-2/11))(-28)(t(1/25)/t)(-8) assuming t is positive. t(3512/275) Simplify ((y(4/7)/(y(-7)/y))(-2/83))(-28) assuming y is positive. y(480/83) Simplify (d10/(d/d(3/11)))/(d*(-2)d4) assuming d is positive. d(80/11) Simplify (fff/(ff(-24)/f)f(4/9))(18/7) assuming f is positive. f(494/7) Simplify (r(5/7)r/(r/r(-1/3)rr)r)/(r*(-2/55)rrr(-19)) assuming r is positive. r(18962/1155) Simplify (z(1/10)/z)(15/7)(z(z/((z*2z)/z))/z)24 assuming z is positive. z(-363/14) Simplify ((qq30)(-39))(1/15) assuming q is positive. q(-403/5) Simplify (i/(i/(i(i*5/ii)/i))i/(i(-1/3)i)(i(-1/3)ii)(-6/13))(2/37) assuming i is positive. i(356/1443) Simplify (d(-3/5)/d)(-24)/((d/((d22d)/d))/d(1/6)) assuming d is positive. d(1787/30) Simplify (ll(-19))/((l(-2/3)l)/l)l(-3/14)ll(l*(-2/17)/ll)/ll assuming l is positive. l(-11185/714) Simplify (((mm/(mm(-4/5)mm))/(m/(mm*1m)))/(m(-2/5)/m(-6)))(10/11) assuming m is positive. m(-38/11) Simplify (g*3g)/(g/(g/g*(3/14)))(g(-2/9))27 assuming g is positive. g(-31/14) Simplify ((g(-3)/(g/g0))/((g(1/2)/g)/g6))(-30) assuming g is positive. g*(-75) Simplify (jjj/j7jj(-4))/(j(jj/j(3/5))/jjj(7/5)) assuming j is positive. j(-54/5) Simplify (l(-15)/lll(3/2))/(l(-14)/(ll(3/4))) assuming l is positive. l(9/4) Simplify (s/s*(4/9)s(6/11))/(s(3/2)/s(-2/11)) assuming s is positive. s(-115/198) Simplify (w/(ww/w(-8)))(-1/30)(w/w(-1/2))/w(2/41) assuming w is positive. w*(359/205) Simplify (hhh(3/8)hh)/(h/((h(h/(h*(-23)hh))/hh)/h))(h/((h/(h/(hh*8)h))/h))(2/29) assuming h is positive. h(5791/232) Simplify (d*(-3)dd(1/45))9 assuming d is positive. d(-89/5) Simplify ((d0/(d(-3)d))36)(-35/2) assuming d is positive. d*(-1260) Simplify ((b/(bb(-1/5)))(-8/7)/(bb10b/(b*(-1/8)bb)b))(12/5) assuming b is positive. b(-9537/350) Simplify ((n(-1/2)/n(-3/2))/((n6/n)/n(3/5)))(13/7) assuming n is positive. n(-221/35) Simplify (n/n*(-11)nn)(-38)/(n(-2/41))(-7/2) assuming n is positive. n(-21819/41) Simplify (w(-16)w*(2/7)w)10 assuming w is positive. w(-1030/7) Simplify (c(-25)/c(-1/38))(-6/11) assuming c is positive. c(2847/209) Simplify (o(-1/11))(-27)/(((oo(1/11)o)/o)/(o(1/13)/o)) assuming o is positive. o(63/143) Simplify ((y(-1/2))23yy/y*(-1/3)yyy(-5/2))(3/32) assuming y is positive. y(-29/32) Simplify (z(-2/15))*(-16)((z/z*(-2))/zz)(-42) assuming z is positive. z(-1858/15) Simplify (d*17/((dd*(-3/10)/d)/dd))/(d/d(-2/5))(-1/14) assuming d is positive. d(87/5) Simplify ((q(1/4)q)(1/36)/(qq*1q)(30/7))(-3/10) assuming q is positive. q(2585/672) Simplify (d(1/38)/(dd/d(-22)))(-13/6) assuming d is positive. d(11843/228) Simplify (aa*2a)*(10/7)((aa(2/3))/a)(-12) assuming a is positive. a(-16/7) Simplify ((((((vv/(v/(vv6)))/v)/v)/v)/(v/v6))(-30/11))(2/25) assuming v is positive. v(-24/11) Simplify (((pppp*(-17/3)p)/(p*(2/5)p))(-4/13))(1/26) assuming p is positive. p(92/2535) Simplify (v/v(2/3))/vv20vv(2/7)vvv*7/vvvvvv assuming v is positive. v(706/21) Simplify (b(1/6))(-35)/(b(-2/5)/b)(27/2) assuming b is positive. b(196/15) Simplify r*3/rr/(r/(r*23r))(r/(r/((r(-4/17)r)/r)))21 assuming r is positive. r(358/17) Simplify (m*22mm/(mm/m20))/(m(-1/2))(-3/17) assuming m is positive. m(1425/34) Simplify (l*26/(ll((ll*(-2/81)l)/l)/l))/(ll/l28(l*(-3/10)l)/l) assuming l is positive. l(40763/810) Simplify (s(-4))*(19/2)(s*(-11/2)s)/(ss(s/s*(-2/21)s)/sss) assuming s is positive. s(-1999/42) Simplify (x14/x5)/(x/(x2/xx))(10/13) assuming x is positive. x(127/13) Simplify nnn/((n(n/((nn/(n(-12/11)n))/n))/n)/n)(nn*(-15))/nn*(-8)/(nnnn/(n/(n*(-2/17)/n))n) assuming n is positive. n(-4075/187) Simplify (a1/((a(aa*(-2/19))/aaa)/aa))/((a*(-2/7)/a)/aa/((a/(a(2/17)/a))/a)) assuming a is positive. a(618/2261) Simplify (vvv(v/v(4/5))/vv)*(-6/17)v/v*(-9)v(v(1/12)v)/v assuming v is positive. v*(10153/1020) Simplify (ssss*18ss)/ss*(-3/7)(s/s(-11))/s(-2/35) assuming s is positive. s(1177/35) Simplify w(-1/4)/(w*(-4/9)w)w15/www13 assuming w is positive. w(979/36) Simplify z(-4)/(z(1/14)z)(z(-1/11)/zz)(-24/5) assuming z is positive. z(-3569/770) Simplify ((t*(-2)/tt(5/4))(-4/35))(21/2) assuming t is positive. t(21/10) Simplify ww/w19w*25(((ww5/w)/w)/w)/w(-26) assuming w is positive. w37 Simplify (((m/(mm/m*(17/2)))/mm)/m(8/5))/(m/(m(1/7)/m))(3/5) assuming m is positive. m(67/14) Simplify (((n/n*(-1)n)/n)*9n*(2/9)n1)(-14) assuming n is positive. n*(-2422/9) Simplify ((h/(hh*(-4)h))/h2)/(h(-3))(-35) assuming h is positive. h(-104) Simplify o(6/5)/o(1/19)(oo(-4/3))(-10/3) assuming o is positive. o*(1931/855) Simplify (y/(y/(yy*(5/2)/y))y(-32))/(y1/y11) assuming y is positive. y(-39/2) Simplify (((d/d*11d)/dd)/(dd/d*(-10)))/((d/(ddd/(dd(dd*13)/ddddd)dd))/(dd/d(1/5))) assuming d is positive. d(-171/5) Simplify (oo(-15)o/(o/(((o/(o/(ooo*12o))o)/oo)/o)o))/(o26o(-12/5)) assuming o is positive. o(-118/5) Simplify (g*2g)(-37)/(g2)(-6/25) assuming g is positive. g(-2763/25) Simplify ((y/(y/y*(-3/4))y)/(y(y/y(1/2)y)/y))/(y*1/yy6) assuming y is positive. y(-29/4) Simplify ((dd(18/7))36)(-18/11) assuming d is positive. d(-16200/77) Simplify ((p(-16)p)/p)*(-1)/(ppp(9/2)pp/(p(1/16)/p)) assuming p is positive. p(105/16) Simplify w/w6ww(-5/3)(w*(-6/7)/w)/(ww/(w/w*10)ww) assuming w is positive. w(-431/21) Simplify ((n/((nn*(-26))/nn))(-30))(-18/5) assuming n is positive. n2808 Simplify w/w(-9)w11(w/w(-2/3))/w9 assuming w is positive. w(41/3) Simplify (l/((((l(1/25)/ll)/l)/l)/l))/(l/(l/l(-8/3)))((l(ll*3/l)/ll)/l)/lll(-22/5)/l assuming l is positive. l(317/75) Simplify (((f(-2/3))19)(10/7))(-14) assuming f is positive. f(760/3) Simplify ((p/(p/((p/p13)/p))pp)/(((p/p9)/p)/p))/((p(-2/3)p)/p(-9)) assuming p is positive. p(-31/3) Simplify o/(o/(o/((o14/o)/o))o)(o(oo(-1/11)/oo)/oo)/oo*3/(oo/(o/(((o*17/oo)/o)/o)oooo)) assuming o is positive. o(-221/11) Simplify ((k/(k1/k))47/(k(-1/3)/k)(-4/5))23 assuming k is positive. k(15847/15) Simplify (k(2/7)k(-6)kk(-9)k(-5))(2/97) assuming k is positive. k(-262/679) Simplify ((w(-1/2)w)/www(-16))/((ww/(ww(-2/9))w)/(ww/w16)) assuming w is positive. w(-571/18) Simplify (j(2/11)/j(-9))/((jj*(3/8))/(jjj(2/5))) assuming j is positive. j(4491/440) Simplify (q29/(q/(qq/(qq24)qq)))/(q0q/(qq17/q)) assuming q is positive. q23 Simplify (jj/(j/(j/(jj(-13))j)j)jj(2/13))/(jj/(jj(-5))jj)(-35) assuming j is positive. j(3837/13) Simplify ((i5)(25/3))(-8/5) assuming i is positive. i(-200/3) Simplify (s8)(-18)(ss4s)/(s/(sss/(ss/(s/(s(1/28)s)))ss)) assuming s is positive. s(-3809/28) Simplify ((v/(v/v(-2/7)v)v)	{ "pile_set_name": "DM Mathematics" }
7/6 of a hour in seconds? 4200 What is 995831.8km in micrometers? 995831800000000 What is seven halves of a kilometer in meters? 3500 What is 917.8045cm in millimeters? 9178.045 What is twenty-seven quarters of a gram in milligrams? 6750 How many millilitres are there in 44/5 of a litre? 8800 What is 13/5 of a day in minutes? 3744 Convert 989.8213 centimeters to millimeters. 9898.213 How many millilitres are there in one quarter of a litre? 250 What is 50699.64 litres in millilitres? 50699640 How many seconds are there in one sixth of a day? 14400 What is 28/3 of a hour in minutes? 560 How many minutes are there in four sevenths of a week? 5760 How many millilitres are there in three tenths of a litre? 300 What is 5/4 of a kilometer in meters? 1250 What is 46/5 of a century in decades? 92 What is 1209.869 nanometers in millimeters? 0.001209869 What is 3/50 of a week in seconds? 36288 What is 2/15 of a hour in minutes? 8 What is 27.77286 months in years? 2.314405 What is 5/4 of a microgram in nanograms? 1250 What is fourty-eight fifths of a litre in millilitres? 9600 Convert 465082.6 micrograms to kilograms. 0.0004650826 What is 75553.25 millennia in months? 906639000 What is 310.6493 weeks in seconds? 187880696.64 What is twenty-one halves of a meter in centimeters? 1050 What is 1/6 of a minute in seconds? 10 What is 27/5 of a microgram in nanograms? 5400 What is 1/4 of a tonne in kilograms? 250 How many litres are there in 4.574439 millilitres? 0.004574439 What is 477.4466 milligrams in kilograms? 0.0004774466 Convert 6.619871 milligrams to micrograms. 6619.871 Convert 0.806358 kilometers to micrometers. 806358000 What is sixty-seven thirds of a year in months? 268 What is 4.6548 tonnes in nanograms? 4654800000000000 How many millennia are there in 153.6873 years? 0.1536873 What is 9.99636 litres in millilitres? 9996.36 How many grams are there in 91170.15t? 91170150000 What is ten sevenths of a week in minutes? 14400 How many centimeters are there in 20616.43 meters? 2061643 How many days are there in 239031.3 weeks? 1673219.1 Convert 7.984057 millilitres to litres. 0.007984057 How many kilograms are there in 49/4 of a tonne? 12250 What is 35181.29km in meters? 35181290 How many litres are there in 39.27908 millilitres? 0.03927908 How many minutes are there in 62.4837 milliseconds? 0.001041395 What is 10/3 of a millennium in months? 40000 Convert 2.940787 years to centuries. 0.02940787 How many decades are there in twenty-one quarters of a millennium? 525 How many months are there in 1/10 of a century? 120 How many grams are there in seventy-two fifths of a kilogram? 14400 How many milligrams are there in 3479.8 nanograms? 0.0034798 How many millilitres are there in 3/50 of a litre? 60 Convert 76768.38ug to tonnes. 0.00000007676838 How many kilograms are there in 1/10 of a tonne? 100 Convert 7.213163g to milligrams. 7213.163 What is 85367.31 days in microseconds? 7375735584000000 What is thirty-seven halves of a millisecond in microseconds? 18500 How many millilitres are there in thirty-two fifths of a litre? 6400 Convert 393923.4ns to minutes. 0.00000656539 How many meters are there in three fifths of a kilometer? 600 How many centimeters are there in one fifth of a meter? 20 What is 41.09546 micrograms in milligrams? 0.04109546 How many seconds are there in five sixths of a hour? 3000 How many tonnes are there in 9.87682 milligrams? 0.00000000987682 How many grams are there in 6/5 of a kilogram? 1200 How many milligrams are there in 29/5 of a gram? 5800 What is 21/2 of a milligram in micrograms? 10500 How many millennia are there in 947019.2 centuries? 94701.92 What is 4815396.6 days in weeks? 687913.8 How many kilograms are there in sixty-one quarters of a tonne? 15250 What is four thirds of a minute in milliseconds? 80000 How many minutes are there in seven thirds of a hour? 140 What is 19/4 of a litre in millilitres? 4750 How many millennia are there in 0.025457 decades? 0.00025457 Convert 3.665083 nanometers to micrometers. 0.003665083 What is 588.9765l in millilitres? 588976.5 How many nanometers are there in 12/25 of a micrometer? 480 What is 21/4 of a litre in millilitres? 5250 What is 3/40 of a meter in millimeters? 75 What is fifty-one quarters of a millimeter in micrometers? 12750 How many millilitres are there in fourty-one halves of a litre? 20500 Convert 274.2497um to millimeters. 0.2742497 What is 55.95584ml in litres? 0.05595584 What is 2.977773km in meters? 2977.773 What is 1/4 of a century in years? 25 What is five sixths of a century in months? 1000 How many years are there in thirteen fifths of a decade? 26 How many years are there in 3/5 of a century? 60 What is 27/4 of a litre in millilitres? 6750 How many micrometers are there in eleven halves of a millimeter? 5500 What is 2869.87 millennia in months? 34438440 How many millennia are there in 213594.9 months? 17.799575 What is sixty-one quarters of a hour in minutes? 915 How many months are there in 32/5 of a century? 7680 What is 7/4 of a kilogram in grams? 1750 What is 61.85192 kilometers in millimeters? 61851920 Convert 15189.08nm to micrometers. 15.18908 What is 57.80734 millilitres in litres? 0.05780734 What is 9780.592 kilometers in centimeters? 978059200 How many kilometers are there in 8164.02 nanometers? 0.00000000816402 Convert 14629.227 months to centuries. 12.1910225 How many years are there in twenty-one halves of a millennium? 10500 How many days are there in 15280.5393ns? 0.00000000017685809375 Convert 57.69 months to decades. 0.48075 How many micrometers are there in 15/4 of a millimeter? 3750 What is 5/4 of a litre in millilitres? 1250 How many millilitres are there in seven halves of a litre? 3500 What is eighteen fifths of a millennium in years? 3600 Convert 230182.7 hours to microseconds. 828657720000000 Convert 0.6918683 years to months. 8.3024196 What is twenty-one quarters of a year in months? 63 Convert 89101.51ml to litres. 89.10151 Convert 79.53183 nanograms to tonnes. 0.00000000000007953183 How many nanoseconds are there in one tenth of a millisecond? 100000 What is 1.959508 litres in millilitres? 1959.508 Convert 658.7449 millimeters to kilometers. 0.0006587449 Convert 99219.08 micrograms to kilograms. 0.00009921908 What is twenty-one fifths of a millimeter in micrometers? 4200 What is 7375.833 months in centuries? 6.1465275 How many nanometers are there in 0.6467197 centimeters? 6467197 How many microseconds are there in 32.77653 weeks? 19823245344000 What is twenty-six fifths of a millisecond in microseconds? 5200 What is three eighths of a gram in milligrams? 375 Convert 801.6811s to microseconds. 801681100 What is seventeen quarters of a meter in centimeters? 425 Convert 0.3438331 years to millennia. 0.0003438331 What is seventeen sixths of a day in minutes? 4080 How many years are there in 27/4 of a millennium? 6750 What is fifty-eight thirds of a year in months? 232 How many micrograms are there in twenty-five quarters of a milligram? 6250 What is 660125.3 centuries in months? 792150360 What is fourty-two fifths of a century in decades? 84 Convert 28.57884nm to millimeters. 0.00002857884 How many weeks are there in 93149.9352s? 0.15401775 How many millennia are there in 490.2469 decades? 4.902469 How many grams are there in sixty-seven quarters of a kilogram? 16750 What is three fifths of a kilometer in meters? 600 What is 0.404489 meters in millimeters? 404.489 How many years are there in 18/5 of a decade? 36 How many millilitres are there in one twentieth of a litre? 50 Convert 388.2169 micrometers to millimeters. 0.3882169 How many millilitres are there in 252.5838 litres? 252583.8 What is 94.3255 hours in milliseconds? 339571800 What is 655.1769mm in micrometers? 655176.9 What is 2/9 of a hour in seconds? 800 How many decades are there in 32/5 of a century? 64 How many millilitres are there in 13/4 of a litre? 3250 What is eleven quarters of a litre in millilitres? 2750 Convert 6026.22 millilitres to litres. 6.02622 How many millilitres are there in eighty-seven quarters of a litre? 21750 What is 78018.38ml in litres? 78.01838 How many micrograms are there in 14.74284mg? 14742.84 Convert 8504.819 litres to millilitres. 8504819	{ "pile_set_name": "DM Mathematics" }
)? 5 Let q(p) = -99p3 + 2p*2 + 2p + 1. Calculate q(-1). 100 Let m(l) = 2l3 + 4l*2 + 3l. Determine m(-3). -27 Let c(p) = p*2 + 22p - 40. What is c(-24)? 8 Let i(y) = -2y2 + 55y - 312. What is i(8)? 0 Let c(z) = -z*3 - 6z*2 - 10z - 3. What is c(-4)? 5 Let b(l) = l*3 + 6l*2 - 10l - 18. Calculate b(-7). 3 Let r(b) = -7b3 + 2b*2 - 4b + 3. Calculate r(1). -6 Let u(q) = -q*3 - 13q*2 + 11q - 2. What is u(-14)? 40 Let x(q) = 14q - 212. Determine x(15). -2 Let m(n) = n2 + n - 15. Give m(-9). 57 Let x(f) = 5f - 20. What is x(14)? 50 Let o(b) = -b*3 + 11b*2 + 11b + 6. Give o(12). -6 Let i(j) = j*3 - 8j*2 - 8j + 9. Determine i(9). 18 Let p(d) = -8d + 15. Calculate p(-9). 87 Let x(s) = -2s - 3. Give x(10). -23 Let z(h) = 22h - 212. Determine z(10). 8 Let c(n) = -n2 + 27n - 32. Determine c(26). -6 Let t(o) = 2o3 - 14o*2 + 3o - 2. Give t(7). 19 Let y(d) = -8d + 197. Give y(25). -3 Let w(n) = -47n*3 - 2n2 + n. Give w(1). -48 Let i(z) = z2 - 13z + 27. Determine i(11). 5 Let w(r) = -4r*2 - 2r + 4. Calculate w(0). 4 Let q(g) = -g*2 + 8g + 5. Calculate q(4). 21 Let w(x) = -3x3 - 4x*2 - 5x - 7. Determine w(-3). 53 Let m(a) = 3a - 26. Determine m(13). 13 Let l(f) = f3 - 13f*2 - 29f - 12. Determine l(15). 3 Let r(l) = l*2 + 17l - 107. Determine r(-22). 3 Let n(w) = w*2 - 24w - 171. What is n(29)? -26 Let u(x) = -12x + 72. Give u(6). 0 Let l(q) = -q - 13. What is l(-19)? 6 Let t(j) = j3 - 5j*2 + 3j + 1. What is t(5)? 16 Let w(u) = 6u + 25. Determine w(-3). 7 Let u(j) = -7j + 3. Give u(-1). 10 Let r(s) = 13s + 2. Determine r(-1). -11 Let b(l) = l3 + 12l*2 - 19l - 3. What is b(-13)? 75 Let o(a) = -a*2 + 4a + 16. What is o(7)? -5 Let q(c) = 19c - 7. Determine q(8). 145 Let p(k) = -k3 - 13k*2 - 2k - 6. Give p(-13). 20 Let p(h) = h*3 - 20h*2 - 2h - 57. What is p(20)? -97 Let w(v) = 2v2 - 7v - 7. What is w(9)? 92 Let k(n) = -n*2 - 7n + 8. Determine k(-6). 14 Let y(c) = c + 3. Determine y(-9). -6 Let s(v) = v*3 + 8v*2 + 11v + 5. Give s(-7). -23 Let q(x) = x*3 - 2x*2 - 3x + 6. Determine q(3). 6 Let u(t) = t*3 - 6t*2 - 8t - 4. Calculate u(7). -11 Let l(o) = -10o - 12. What is l(9)? -102 Let f(x) = -2x*2 + 15x - 9. Give f(7). -2 Let n(f) = f*2 - 7f - 92. What is n(14)? 6 Let j(h) = 2h3 + 4h*2 + 2h + 6. Determine j(-2). 2 Let g(z) = 4z - 11. Give g(4). 5 Let q(s) = -3s*2 - 2s + 2. What is q(3)? -31 Let w(k) = k*2 + 14k + 25. What is w(-11)? -8 Let y(a) = -a*3 + 5a*2 - 3a - 6. Determine y(4). -2 Let i(t) = -21t + 113. What is i(5)? 8 Let r(x) = x2 - 41x - 128. Give r(44). 4 Let w(j) = -3j2 + 37j + 1. Determine w(12). 13 Let r(z) = -z*2 - 15z - 31. Determine r(-9). 23 Let w(r) = -7r + 3. Calculate w(-2). 17 Let i(x) = 2x*2 + 35x - 6. What is i(-18)? 12 Let d(q) = -27q - 3. What is d(0)? -3 Let m(a) = 5a + 48. Calculate m(-8). 8 Let l(m) = -39m2 - 1131m + 6. Determine l(-29). 6 Let x(o) = o*2 - 12o + 19. Give x(8). -13 Let r(f) = 2f3 + 4f2 - f - 2. What is r(1)? 3 Let w(i) = i2 - 3i - 1. What is w(7)? 27 Let m(i) = 6i - 1. Calculate m(-2). -13 Let x(a) = a*2 + 22a - 12. Give x(-26). 92 Let t(r) = -4r - 6. Give t(-4). 10 Let z(s) = s2 + 5s - 46. Determine z(-14). 80 Let j(d) = d*3 - 11d*2 - 22d - 50. Give j(13). 2 Let b(p) = -p*3 - 4p*2 + 30p + 9. Calculate b(4). 1 Let t(u) = -9u2 + 90u - 3. Calculate t(10). -3 Let o(g) = 3g2 - 181g - 129. Determine o(61). -7 Let x(n) = 3n3 + 2n*2 - 3n - 2. What is x(-2)? -12 Let v(j) = -j*3 + 7j*2 - 3j + 5. Give v(7). -16 Let q(s) = -s*3 + 3s*2 - 4s + 4. Give q(3). -8 Let m(w) = w*3 + 3w*2 - 5w + 5. Give m(-5). -20 Let g(y) = -y*2 + 2y + 41. Determine g(6). 17 Let g(l) = 4l + 42. Determine g(-11). -2 Let m(x) = -25x*3 + 2x*2 - 3x + 4. Determine m(2). -194 Let q(v) = v*2 + 19v + 8. Determine q(0). 8 Let d(f) = -f*3 - 3f*2 - 2f - 8. Give d(-6). 112 Let b(s) = s*3 + 4s*2 - 45s - 202. Calculate b(-5). -2 Let c(a) = -2a2 - 35a - 11. Calculate c(-15). 64 Let t(b) = 12b2 - b - 2. What is t(-2)? 48 Let g(f) = -2f*2 - 4f + 5. Determine g(-6). -43 Let l(z) = z*3 + 4z*2 - 10z - 7. Determine l(-6). -19 Let j(g) = -104g + 940. Determine j(9). 4 Let f(x) = -x2 - 19x + 14. Give f(-20). -6 Let z(f) = -17f + 76. Calculate z(5). -9 Let k(c) = -9c + 13. Give k(-2). 31 Let c(o) = o - 12. Determine c(3). -9 Let h(i) = -i*2 + 11i - 12. Calculate h(10). -2 Let k(y) = y*3 - 10y*2 - 28y + 50. What is k(12)? 2 Let z(j) = 3j2 - 102j + 10. Calculate z(34). 10 Let h(n) = -n*3 - 11n*2 - 12n - 15. Calculate h(-10). 5 Let f(q) = q*2 - 11q + 18. Determine f(2). 0 Let r(v) = -20v + 20. Give r(1). 0 Let w(l) = l2 + 6l - 6. What is w(-6)? -6 Let m(w) = w + 11. Calculate m(-14). -3 Let s(m) = -m*2 + 25m - 20. What is s(24)? 4 Let w(n) = -9n - 472. What is w(-53)? 5 Let b(k) = -9k - 19. Calculate b(-8). 53 Let z(i) = i*2 + 27i + 181. What is z(-15)? 1 Let g(a) = -2a + 25. Calculate g(11). 3 Let v(s) = -s2 + 3s + 78. Calculate v(-8). -10 Let p(v) = v*2 - 12v + 17. What is p(13)? 30 Let o(t) = 29t3 - 1. What is o(1)? 28 Let r(i) = -i - 23. Give r(0). -23 Let u(z) = z2 + 17z + 50. Give u(-12). -10 Let u(c) = 12c + 65. Give u(-6). -7 Let x(c) = c2 + 4c + 3. Determine x(-4). 3 Let a(z) = -z*2 - 17z + 12. Calculate a(-17). 12 Let g(m) = m*2 - 11m + 23. Give g(0). 23 Let a(s) = s*3 + 2s*2 - 5s + 4. What is a(-5)? -46 Let n(z) = 3z - 24. Determine n(6). -6 Let w(v) = 4v*2 + 35v + 12. What is w(-8)? -12 Let g(x) = -5x - 11. Calculate g(-3). 4 Let q(w) = 21w + 44. Give q(0). 44 Let x(f) = -14f - 7. Give x(4). -63 Let p(u) = 3u*2 + 12u - 18. Give p(2). 18 Let f(r) = -r*2 + 40r + 169. Calculate f(44). -7 Let p(a) = 5a + 18. Calculate p(6). 48 Let d(m) = -4m + 18. Calculate d(-25). 118 Let o(w) = w - 5. Calculate o(1). -4 Let a(y) = y*3 + 5y*2 + y - 3. Determine a(-4). 9 Let c(l) = 37l - 226. What is c(6)? -4 Let g(y) = -14y - 1. Give g(1). -15 Let u(t) = -36t + 169. Give u(6). -47 Let s(q) = 2q2 + 10q + 5. Give s(-4). -3 Let g(d) = 6d3 + 3d*2 + 3d + 3. Determine g(-2). -39 Let z(r) = -r*3 - 14r*2 - 10r + 5. Give z(-13). -34 Let d(h) = -6h + 37. Calculate d(6). 1 Let v(k) = 2k + 2. What is v(-4)? -6 Let d(q) = 5q2 + 104q - 31. Give d(-21). -10 Let r(d) = 17d + 29. Determine r(-8). -107 Let m(i) = -3i*2 - 17i. Give m(-7). -28 Let z(l) = 2l3 - 68l*2 + 2l - 58. What is z(34)? 10 Let b(j) = -8j + 37. What is b(4)? 5 Let v(f) = f3 + 2f*2 - 25f + 4. Calculate v(-6). 10 Let s(t) = t*2 - 26t - 3. Calculate s(26). -3 Let f(o) = -7o + 15. Determine f(6). -27 Let s(p) = 2p*2 + 23p + 11. What is s(-11)? 0 Let g(f) = -3f2 - 55f + 43. What is g(-19)? 5 Let j(n) = n*2 + n - 8. Give j(-8). 48 Let j(k) = -2k*2 + 4k + 4. What is j(4)? -12 Let c(y) = 7y2 + 1. Determine c(1). 8 Let c(g) = -6g + 97. Determine c(14). 13 Let i(t) = 6t - 2. What is i(-1)? -8 Let h(d) = -2d*2 - 13d + 5. Give h(-7). -2 Let w(f) = -f*2 + 4. Give w(4). -12 Let t(o) = -3o*3 - 4o*2 - 2o. Calculate t(-2). 12 Let m(y) = -6y2 - 17y - 11. Calculate m(-2). -1 Let f(q) = -q*2 - 13q + 9. What is f(-5)? 49 Let d(r) = 2r3 + r + 1. Calculate d(-1). -2 Let g(w) = 2w*3 - 4w2 + w - 3. Give g(2). -1 Let l(q) = q3 + 6q2 + 5q + 10. Determine l(-5). 10 Let s(q) = -12q - 28. What is s(-1)? -16 Let r(l) = -l3 + 16l*2 - 13l - 30. What is r(15)? 0 Let n(a) = -a*3 + 15a*2 + 20a - 73. What is n(16)? -9 Let b(f) = -6f3 + 14f*2 - 3f + 1. What is b(3)? -44 Let k(g) = g*3 - 10g*2 - 7g + 54. Determine k(10). -16 Let k(t) = -t*3 + 6t*2 - 7t. Calculate k(5). -10 Let y(s) = -7s + 49. What is y(11)? -28 Let b(c) = 10c - 19. Give b(7). 51 Let q(u) = -25u3 - u2 + 1. Give q(-1). 25 Let x(i) = -2i - 3. What is x(-6)? 9 Let w(q) = -q*3 - 6q*2 + 2q - 5. Determine w(-6). -17 Let v(f) = -10f + 22. Determine v(1). 12 Let w(v) = 2v - 4. What is w(7)? 10 Let m(v) = v*3 - 10v*2 + 16v + 7. Calculate m(7). -28 Let s(d) = -3d2 - 4d + 6. Determine s(1). -1 Let d(w) = -w + 11. Calculate d(6). 5 Let o(d) = d*3 - 2d**2 - d - 10. G	{ "pile_set_name": "DM Mathematics" }
s in ascending order. -3/5, -0.1, s Suppose -5r - 6a + 15 = -a, 2r - 3 = -5a. Suppose 3i + 6 = q - 0q, -r = q + 2i. Sort q, 5, 2 in ascending order. q, 2, 5 Suppose 3n = -n - 8. Let t be (-3)/1 - (-2 - n). Sort -4, 5, t in increasing order. -4, t, 5 Suppose -c = 2 - 0. Sort 3, c, -4 in decreasing order. 3, c, -4 Suppose 2 = -b + 4. Let z = b - 4. Sort z, -5, 5 in ascending order. -5, z, 5 Let j = 168 - 163. Suppose -5y - 8 = -2w, -2w - 3y - 16 = -6w. Put j, w, 1 in descending order. j, w, 1 Let b be (-80)/192 - 2/(-8). Let t = 0 - 0.2. Put -4, b, t in decreasing order. b, t, -4 Let l = -35282/49 - -720. Let q = -45/98 + l. Let s = -85 - -337/4. Put q, s, 1/3 in decreasing order. 1/3, q, s Let u(n) = -2n*2 - 15n - 9. Let l be u(-7). Sort 1, l, 2. l, 1, 2 Let v(k) = -k*2 - 8k + 3. Let l be v(-8). Suppose lf - 10 = -2f. Sort f, 0, -1 in decreasing order. f, 0, -1 Let t be (-1)/(44/2)2. Sort t, 1.5, -2. -2, t, 1.5 Let m = -1.94 - 0.06. Let b be 54/12 - 1. Sort 1, b, m. m, b, 1 Let p = 4 - 6. Let f be 0/((-2 - -2) + 2). Suppose -v - v = f. Sort v, 4, p in ascending order. p, v, 4 Suppose 388 = 2p - 2o, -4p - 2o + 756 = -o. Let w be 1/5 - p/(-50). Put -4, -2, w in ascending order. -4, -2, w Suppose 3d - 38 = -4i - 2d, 2i = -d + 16. Sort -3, 2, 3, i in descending order. i, 3, 2, -3 Suppose 4 - 1 = 2a + l, -1 = -l. Let y be 135/60 - (-1)/(-4). Sort a, y, 5 in decreasing order. 5, y, a Let z = -4 + 3. Let m be ((-6)/45)/((-4)/(-100)) + 4. Put m, 0.1, z in descending order. m, 0.1, z Let b = -53 + 54. Sort b, 2, -3, -5. -5, -3, b, 2 Let n = 9 + -8. Let b = n - 0.6. Let f = b - -0.6. Sort f, -0.3, -0.1 in decreasing order. f, -0.1, -0.3 Let m = 13 + -15. Sort m, 0, -0.2 in increasing order. m, -0.2, 0 Let y = -6.9 - -6.7. Put -4, y, -5, 0.2 in decreasing order. 0.2, y, -4, -5 Let h = -2 + -2. Let p = -2 - h. Sort p, 5, 3 in decreasing order. 5, 3, p Let w be (-2)/(-5) + 18/(-45). Let q be w/((-2)/(-2 - -1)). Put q, -4, 4 in ascending order. -4, q, 4 Let p be (-9)/(-18) + (-1)/(-2). Sort 0.4, -2/7, p in ascending order. -2/7, 0.4, p Let l = -11 - -1. Let a = -6 - l. Let d(c) = 4c*3 + 2c2 - 1. Let g be d(1). Sort g, a, 3. 3, a, g Let v(z) = -z2 - 9z + 5. Let q be v(-9). Sort 2, q, 1 in decreasing order. q, 2, 1 Suppose -b = 2x + 4, -3b - 10 = -x + 5x. Put b, 2, 4 in descending order. 4, 2, b Let z(l) = 12l - 58. Let d be z(5). Sort 15, 4, d, -3 in increasing order. -3, d, 4, 15 Suppose -3m = -m + 2. Put 4, 0, m in ascending order. m, 0, 4 Suppose -g + 5f - 16 = 12, 3f = -3g - 12. Let t(c) = -c2 + 5c + 5. Let x be t(5). Put -5, x, g in increasing order. g, -5, x Let b = 87.3 + -87. Sort -0.5, b, 0.7 in increasing order. -0.5, b, 0.7 Let x be 10/4 - (1 + 1). Suppose -4k = -3k - 3. Let d = 2 - k. Sort d, x, -0.1 in ascending order. d, -0.1, x Let p(c) = -3c + 9. Let q be p(4). Sort q, -2, -4 in descending order. -2, q, -4 Suppose 5a + 4s = 2a + 7, 3a + 2 = 5s. Suppose 3z - 4v - 11 = 8z, 5z + 13 = -2v. Put a, 5, z in ascending order. z, a, 5 Suppose 9 = -3u - 4f, 5u = -0f - f - 15. Sort u, 5, -5. -5, u, 5 Let r be (1/(-44))/((-1)/(-6)). Let s = -1/88 - r. Put -3, -2/57, s in ascending order. -3, -2/57, s Suppose -88 - 12 = 2p - 4r, 4p + 3r + 167 = 0. Let v be p/36 - (-2)/2. Put -0.2, v, -5 in decreasing order. -0.2, v, -5 Let m = -1/88 + 281/1496. Let f = m - -8/51. Let q = -0.2 + 0.4. Put q, f, 2 in increasing order. q, f, 2 Suppose -2p - 208 = 2p. Let d = p - -209/4. Let s be ((-4)/(-21))/(42/49). Sort -2, d, s in decreasing order. d, s, -2 Suppose 2 + 6 = -2f. Let k = 7 + f. Sort k, 5, 1 in decreasing order. 5, k, 1 Let h = -2 - -1.5. Let t = 3.01 - 0.01. Let n = t + -3.4. Sort n, 0.4, h in descending order. 0.4, n, h Let y = 2/3 - 22/15. Sort y, 0, 4, 0.5 in descending order. 4, 0.5, 0, y Suppose 2x + 1 = -9. Sort -4, 4, x. x, -4, 4 Suppose m + 4 = -3m. Let s(c) = 180 - 180 - c + 0c + 2c*2. Let z be s(m). Put z, -4, -3 in decreasing order. z, -3, -4 Suppose -5t + 6t + 4 = 0. Sort -25, 4, t. -25, t, 4 Let p be (4/7)/((-18)/(-63)). Sort p, -4, 3. -4, p, 3 Let p = 0.15 - -0.29. Let n = 0.04 - p. Let c = -0.3 - n. Put c, 2/17, 1 in descending order. 1, 2/17, c Suppose 5g - 15 = 0, 2r - 2 = -g - 3. Let d = -0.4 - -0.6. Put 0, r, d in descending order. d, 0, r Let c be ((-252)/(-3465))/(2/453). Sort -2/5, 2/5, -0.1, c in descending order. c, 2/5, -0.1, -2/5 Let k(f) = f3 - f2 + 2. Let x be k(2). Suppose -2q - q - x = 0. Sort q, -6, -3 in ascending order. -6, -3, q Let i = -0.2 - -0.4. Let b = -0.3 + 0.4. Let x be 4/(-12) + (-7)/(-30). Sort x, b, i. x, b, i Let l be (-4)/18 - 16/90. Let s = 16 - 15. Let z be -1 - 0 - (s + -3). Put 2, l, z in decreasing order. 2, z, l Suppose 0 = 2n + 2n - 16. Suppose 0 = a - q + 4, -2a + 7 = nq - 3. Let j = -6 + 6. Put j, a, 3 in descending order. 3, j, a Let t = -219/1144 + 1/104. Let f = 9 + 1. Let y = 15 - f. Put -0.2, t, y in decreasing order. y, t, -0.2 Suppose m + 0m - 4 = 0. Sort m, -1, 3 in decreasing order. m, 3, -1 Let n = -3.59 - 0.41. Sort n, -11, 5, -2/17. -11, n, -2/17, 5 Suppose 4y + 0y = 0. Sort y, 6, -4 in decreasing order. 6, y, -4 Let m(f) = f3 + f2 + f - 4. Let b be m(0). Suppose -15 = -5a - 2u, 0 = a + 2a + 2u - 9. Let w = -6 - -11. Sort w, b, a in increasing order. b, a, w Let d be ((-4)/(-6))/((-6)/(-9)). Suppose -2h + 5p = -9, -3p = -d + 10. Sort 2, 3, h. h, 2, 3 Suppose -4w + 18 = -c, 0 = -5c - 0c - 10. Let l(r) = -2r + 5. Let m be l(4). Put m, w, -1 in increasing order. m, -1, w Let c = -41 + 45. Sort -1/9, c, 3/8, -2 in increasing order. -2, -1/9, 3/8, c Let r be -2 + ((-3 - -3)-1)/(-1). Put 1, -8, r in decreasing order. 1, r, -8 Let w be 40/(-18) - 4/(-18). Let f(z) = z - 11. Let t be f(10). Sort -5, w, t in descending order. t, w, -5 Let d = -1.6 - -0.5. Let s = -0.1 - d. Let a = 4 + s. Sort a, 1/5, -2 in decreasing order. a, 1/5, -2 Suppose -o + 5o = 8, -2o = n + 1. Sort n, -3, -4, 2 in descending order. 2, -3, -4, n Let n = 0.4 + 3.6. Sort 0.4, -1/4, n in ascending order. -1/4, 0.4, n Suppose 2c = -3c - 5h + 10, -5h + 18 = -3c. Let r = c - -4. Sort -2/7, r, 0.5 in decreasing order. r, 0.5, -2/7 Suppose 4n = -2x - 16, x + 0x = -5n - 14. Put -1, -10, x in increasing order. -10, x, -1 Suppose 2 = -4g + 2g. Put -3, -6, g in descending order. g, -3, -6 Let f = 0.2 + -0.2. Suppose 5m - 8 = m. Suppose 0 = 3q - m - 10. Sort f, q, -2/5 in ascending order. -2/5, f, q Let r be ((-4)/(-30))/((-12)/15). Sort 1, -5, r in descending order. 1, r, -5 Let f = 86/11 + -893/110. Let t = -727/21 - -103/3. Sort f, -3, t. -3, f, t Let k(y) = -y2 - 8y. Let c be k(-9). Let z = c + 14. Put -3, z, -5 in increasing order. -5, -3, z Let d be 8/(-6)(-12)/8. Suppose 6v - 4v = d. Sort -5, -2, v in descending order. v, -2, -5 Let x be (-8)/(-4) - (-3)/1. Suppose -7s - 6 = -xs. Suppose -3c + 4v - 6 = 0, 0 = -2c + c + 2v - 4. Sort s, c, -4 in decreasing order. c, s, -4 Suppose 4d - 7 = 5. Sort -3, -2, d, -1. -3, -2, -1, d Let l = 0.5 - 4.5. Let m = -3.98 - l. Let f = -0.12 + m. Put f, -2, 2/9 in ascending order. -2, f, 2/9 Suppose -3a = -6a - 9. Let h be (2 + -1)-1 + a. Sort -1, 4, h in decreasing order. 4, -1, h Let j(c) = -4 - 3c + 15 + 5c. Let k be j(-5). Suppose -2n - b + 3 = 0, 2n = 4b + 7 + 1. Put -1/3, k, n in descending order. n, k, -1/3 Let m be (-4)/(-6) - 8/(-6). Let b be 2/3m/4. Let w = -28/15 + 19/15. Put -0.2, b, w in descending order. b, -0.2, w Let m be (-215)/(-20) - (-1)/4. Let v = -9 + m. Let r = -1 + -2. Sort v, r, -4 in decreasing order. v, r, -4 Let g = 17 - 219/13. Put -15, -0.5, g, 1/3 in decreasing order. 1/3, g, -0.5, -15 Suppose 2w + 19 = 4n + n, -2w + 11 = n. Suppose -wv = 3 - 18. Let c = -4 + v. Put -5, c, 4 in ascending order. -5, c, 4 Let q = 0.31 + -0.01. Let z = 23.6 + -24. Sort q, z, -1 in ascending order. -1, z, q Let m = -11 - -16. Let y = 12 + -15. Sort 0.3, m, y in ascending order. y, 0.3, m Suppose -6o + 18 = -2o + 5p, 5o - 14 = -2p. Let m(n) = -n*3 - 4n*2 - 3n - 2. Let v be m(-3). Sort v, 3, o in descending order. 3, o, v Let w = -51 - -53. Put 1, w, 0.3 in ascending order. 0.3, 1, w Let t = 0.5 + -0.3. Let b = t - -0.1. Suppose 2	{ "pile_set_name": "DM Mathematics" }
qrt(8) + sqrt(8) + sqrt(80)/(sqrt(20)/sqrt(2))) - (5sqrt(24)/sqrt(2))2. -300 + sqrt(3)/3 Simplify (3(4 + -1(sqrt(187) + (2sqrt(187) - sqrt(187)))/sqrt(11)))*2. -144sqrt(17) + 756 Simplify (sqrt(208)/(sqrt(24)/sqrt(3)) + (1sqrt(130) - sqrt(130))/sqrt(5) + sqrt(26))/(-2sqrt(162)-4). sqrt(13)/36 Simplify 1sqrt(98) + -2 + (sqrt(98) + 0 + sqrt(98)-1)2 - (-1 + -2sqrt(98) + sqrt(98) + sqrt(98) + (sqrt(98) + 0)*2 + 1). -100 + 7sqrt(2) Simplify (6(-1sqrt(85) - sqrt(85)) + (sqrt(85) - -1-2sqrt(85) - sqrt(85)))/(-2sqrt(20)/sqrt(4) - sqrt(50)/(-1sqrt(10))). 14sqrt(17) Simplify (-4 + (sqrt(125) + sqrt(125)3-2)5 + 4)*2. 78125 Simplify (sqrt(32)/sqrt(2) + sqrt(4) + sqrt(4))/(sqrt(24)/sqrt(108)) + ((sqrt(20)/(sqrt(40)/sqrt(4)) + 5(sqrt(2) + 1))5)2. 1512sqrt(2) + 2425 Simplify ((-6(-1 + sqrt(3) + sqrt(3)) + 2 - (-1sqrt(27) - 4(1 + sqrt(3))))3)*2. -1080sqrt(3) + 1971 Simplify (-2 + 3sqrt(48) + 3)2 + -1. 24sqrt(3) + 432 Simplify 6(sqrt(48)-2)*2 + -2 - (3sqrt(108) - (sqrt(75) + 2 + sqrt(75))). -8sqrt(3) + 1152 Simplify 5 + (0 + 0 + sqrt(108))2 - (-5 + (-5(sqrt(108) - -2sqrt(108)))2). -24182 Simplify (-3 + (sqrt(6)/sqrt(2) + -1 + 1)2 + -3 + -5)-5. 40 Simplify -1(-1 + 2 + -1 + (sqrt(1539) + 0 - sqrt(1539)) + 5)2. -25 Simplify ((2sqrt(216)5)/sqrt(12))/(2(sqrt(9) - sqrt(27)/sqrt(3)) + (sqrt(108)-1)/sqrt(12)). -10sqrt(2) Simplify -2((sqrt(288) + 3)-3 + 1 + (sqrt(2) - (0 + sqrt(18)) - sqrt(2)))*2. -6212 - 1248sqrt(2) Simplify 5(sqrt(7) - (2 + sqrt(847))) + (sqrt(343)3 + 0 + sqrt(343))*2. -50sqrt(7) + 5478 Simplify (sqrt(7920)-4)/((-2sqrt(22))/sqrt(2) + sqrt(11)). 48sqrt(5) Simplify 4((sqrt(36)/(-2sqrt(3)) - sqrt(12))2 - (sqrt(27) + 1 + -1)). -12sqrt(3) + 108 Simplify (((sqrt(18)5 + sqrt(18))/sqrt(6) + (sqrt(3) - (2 + -3sqrt(3))))6)2. -1440sqrt(3) + 10944 Simplify (-2sqrt(2178)5)/(-2sqrt(576) - sqrt(900)2). 55sqrt(2)/18 Simplify 0 + ((-1 + (sqrt(7) - sqrt(28)))2 + sqrt(7) + 4 + sqrt(7)3)3. 36 + 18sqrt(7) Simplify -5(-2 + sqrt(847) + 2 + (sqrt(847) - sqrt(847)-2)6)2. -1528835 Simplify ((12sqrt(66))/(sqrt(150)2))*2 - (-2(sqrt(110)/sqrt(2))/sqrt(5))*23. -3289/25 Simplify -2(3 + (-2 + 5 + sqrt(1300))2). -2624 - 120sqrt(13) Simplify (sqrt(68)-21 - sqrt(68)-26)/((sqrt(4) - (sqrt(8)/sqrt(2)1 + sqrt(4)))-2). 5sqrt(17) Simplify 5(sqrt(40)/(-3sqrt(4) - sqrt(4)) - sqrt(10))/(-5(3sqrt(5) + sqrt(5) + sqrt(5) + sqrt(5))). 5sqrt(2)/24 Simplify sqrt(153) - (-4 + (-3sqrt(153))2) - (-3 + (sqrt(17)3 - sqrt(17))2). -1370 - sqrt(17) Simplify -2-6(1 + (-4-2sqrt(500) - sqrt(500))2). 294012 Simplify (6((sqrt(5) + -2 + sqrt(5) + sqrt(20) - (3 + sqrt(5) + 4)) + -1)2)2. -8640sqrt(5) + 20880 Simplify 1((sqrt(1053) + 1)-3)*2 + 2 + -4. 162sqrt(13) + 9484 Simplify 0 + ((sqrt(300)/sqrt(6))/sqrt(10))*2-2 + 2 + 1sqrt(5)-3. -8 - 3sqrt(5) Simplify -6(1 + 1 + sqrt(5) - sqrt(245)-2 - (1sqrt(45) + 2)). -72sqrt(5) Simplify ((sqrt(136) + sqrt(136)1)26)/(-1(sqrt(72)2 - sqrt(72))). -8sqrt(17) Simplify 5((sqrt(98) + 0)5 - (0 + ((1sqrt(98))*2 - sqrt(98))) - (-3sqrt(98)1 + (-1(2sqrt(98) + sqrt(98)))2)). -4900 + 315sqrt(2) Simplify (-5(sqrt(65) - -1sqrt(65) - sqrt(65)))/sqrt(5) + (sqrt(624)-3)/sqrt(3). -17sqrt(13) Simplify (sqrt(216)/(sqrt(12)25))/(2sqrt(576)4) + 4. sqrt(2)/640 + 4 Simplify (sqrt(2880) + 3sqrt(2880)-2)/((sqrt(1440)2 - sqrt(1440))-6). 5sqrt(2)/6 Simplify (-1 + 4(((sqrt(15) + 2sqrt(15))/sqrt(3) - ((sqrt(5) - sqrt(30)/sqrt(54)) + sqrt(5))) + -5))2. -224sqrt(5) + 5249/9 Simplify (((sqrt(48) - sqrt(3))-4 + sqrt(3))-1 + -1)-5. -55sqrt(3) + 5 Simplify (4 + ((0 + sqrt(567) + -1)-2)2 + -3)1. -72sqrt(7) + 2273 Simplify (sqrt(3) - (-2sqrt(15))/sqrt(5)) + sqrt(3) + -2sqrt(3)4 + (sqrt(363)2)2 + 4. -4sqrt(3) + 1456 Simplify (-5(sqrt(1053) + sqrt(1053) + 2 + sqrt(1053)2) + (0 + sqrt(1053) + 0)-4)2. 4320sqrt(13) + 606628 Simplify -3(sqrt(304) + 4sqrt(304)-1)2 - ((sqrt(304) + (-2(sqrt(304)2 + sqrt(304)) - sqrt(304)))-2)*2. -51984 Simplify (1(sqrt(77) + sqrt(77)-1)-5)/((4sqrt(1512))/sqrt(6)). 0 Simplify (((sqrt(208) + 0 + sqrt(208))-2 - sqrt(208)) + -4)-1. 4 + 20sqrt(13) Simplify ((sqrt(600)43)/sqrt(10))/(sqrt(108)/sqrt(225) - (sqrt(972)2 + sqrt(972) + sqrt(972))). -60sqrt(5)/179 Simplify 2 + 1 + sqrt(304)-4 + -2(0 + sqrt(19)). -18sqrt(19) + 3 Simplify -3 + -4 + (sqrt(28) - (-4sqrt(280))/sqrt(10)). -7 + 10sqrt(7) Simplify (-3(sqrt(405) + 0))*2-2 + 2. -7288 Simplify -65sqrt(21)/sqrt(112)1 + 5 + -3. -15sqrt(3)/2 + 2 Simplify -3 + sqrt(156)/(sqrt(3) - sqrt(27)) - (sqrt(52)-11 - (sqrt(52) - ((sqrt(52) - (-1 + sqrt(52))) + 2))). -6 + 3sqrt(13) Simplify ((sqrt(204) - (sqrt(204) + sqrt(204) + sqrt(204)-53)) + sqrt(204) + sqrt(204) + sqrt(204))/(sqrt(1728)4). 17sqrt(17)/48 Simplify 2 + -5sqrt(2)2 + sqrt(96)/sqrt(3) + 3. -6sqrt(2) + 5 Simplify ((5 + 1 + sqrt(1539) + (sqrt(1539) - (sqrt(1539) - 2(0 + sqrt(1539)))))-3)*21. 2916sqrt(19) + 124983 Simplify -2-1(3sqrt(38)/sqrt(72))*2. 19/2 Simplify (sqrt(210)/sqrt(28))/sqrt(10) - ((sqrt(48)/sqrt(4))/sqrt(4) + ((3sqrt(48) + sqrt(3))*2 - sqrt(3))). -507 + sqrt(3)/2 Simplify ((sqrt(147) + 4sqrt(147))/sqrt(7) - sqrt(21))/(sqrt(252)3). 2sqrt(3)/9 Simplify (-3(sqrt(272) + 0)6 + 2 + -2sqrt(272) + -3)2. 160sqrt(17) + 108801 Simplify 2(-2(-4 + (sqrt(15)/sqrt(5)3)22) + -1). -202 Simplify (2(-2(1 + sqrt(1331)) - sqrt(1331)))*2 + (-2 + (sqrt(99) - (sqrt(99) - 1sqrt(99))) + 0)*2. 516sqrt(11) + 48035 Simplify (-62((sqrt(684)-3 - sqrt(684)) + 4)-5)*2. -691200sqrt(19) + 39456000 Simplify (-5 + 4(2 + sqrt(208) + (sqrt(208)1 - sqrt(208)) - sqrt(208)2-6) + 1)*2. 1664sqrt(13) + 562448 Simplify (-4(sqrt(192)/(1sqrt(8)))/sqrt(2) + -1)5. -40sqrt(3) - 5 Simplify sqrt(57)/(((sqrt(12) - sqrt(3)) + sqrt(3))4) + -1 + ((-2-1sqrt(19))2 + sqrt(19) - (sqrt(1539) + 1 - sqrt(1539))). 9sqrt(19)/8 + 74 Simplify (2((2 + (sqrt(2448)1 - sqrt(2448)) - sqrt(2448)) + 3-1sqrt(2448)))*2. -768sqrt(17) + 156688 Simplify ((sqrt(105)/(sqrt(20)/sqrt(4)))/sqrt(7) + sqrt(192) + -1 + -3)*2. -72sqrt(3) + 259 Simplify 3(-3 + sqrt(700) + (1 + sqrt(700))2 + sqrt(28)4 + (sqrt(112) + sqrt(7))*2-5 + (sqrt(70)/sqrt(2))/sqrt(5)). -531 + 117sqrt(7) Simplify (sqrt(13) - (-1 + sqrt(13) + -3))-5 + ((1sqrt(13) - sqrt(13))-6)*2 + -5. -25 Simplify 3(((sqrt(704) + sqrt(704) + 0 + sqrt(704) - sqrt(704))4 + sqrt(704) + (1sqrt(704) - sqrt(704)) + 2)*2 + -1 + -4). 864sqrt(11) + 171069 Simplify 2(sqrt(147) + (-2 + sqrt(147) - sqrt(147))2 + sqrt(147) + 4 - (3 + sqrt(147)1)). 10 + 14sqrt(3) Simplify (((sqrt(80) + 4 + -3 - sqrt(80)) + (sqrt(80) - (-2 + sqrt(80) + 0)))-5)*2. 225 Simplify (sqrt(1584) + sqrt(1584) + 0 + (sqrt(1584) - -2sqrt(1584) - sqrt(1584)))*25 + (sqrt(1584) + 1 + -1)-5. -60sqrt(11) + 126720 Simplify (2-2sqrt(700) - sqrt(700)) + 1 + 0 + sqrt(700) - (-2 + sqrt(700) + -1 + (-2sqrt(700)-1)*2). -2796 - 50sqrt(7) Simplify (sqrt(63)/sqrt(36) - ((sqrt(567) - sqrt(567)1)2 - sqrt(7))) + ((sqrt(385) + sqrt(385)-1)/sqrt(11))/(2sqrt(45) + sqrt(5)). 3sqrt(7)/2 Simplify (-3 + (1 + sqrt(2))*2)-1 - (4sqrt(8)/sqrt(4) + -4). -6sqrt(2) + 4 Simplify (5(sqrt(1872) + sqrt(1872)-1 + sqrt(1872) + sqrt(1872)))/(sqrt(8)/sqrt(2)2 + sqrt(20)/sqrt(5)5). 60sqrt(13)/7 Simplify (-4-1(5(sqrt(252) + 0) + 4))*2-4. -404224 - 15360sqrt(7) Simplify -6(-6(3sqrt(176)-1 + -4))2. -345600 - 20736sqrt(11) Simplify ((0 + sqrt(475) + (sqrt(475) + -3)6 + sqrt(475) + sqrt(475) + (sqrt(475) - (0 + sqrt(475))) + 0)6)*2. -58320sqrt(19) + 1396764 Simplify (-3 + (-1 + (sqrt(768) - sqrt(48)))-3)2. 3888 Simplify ((sqrt(931) + 2)3 + 2)*2 + 2. 336sqrt(19) + 8445 Simplify (-4 + sqrt(637) + (sqrt(637)-1 - sqrt(637)))2 + (3 + sqrt(637)2 - sqrt(637))*2. 98sqrt(13) + 1299 Simplify (4 + (sqrt(117)/((sqrt(9) + sqrt(576))1))2)6. 674/27 Simplify (2 + (2(sqrt(68)-2 + 3 + sqrt(68)) - 5(-1sqrt(68) + 2)))*2. -24sqrt(17) + 616 Simplify (sqrt(130) - 2sqrt(130)-1)/(sqrt(490)-6) + -1. -1 - sqrt(13)/14 Simplify (sqrt(19) + sqrt(57)/(sqrt(3)1))6 + -3 - (-1 + (1 + sqrt(684))2). -4 Simplify (-2 + (-2*sqrt(4114	{ "pile_set_name": "DM Mathematics" }
a and -54/7? 35 Let i(t) = -t + 13. Calculate the smallest common multiple of i(12) and 10. 10 Calculate the common denominator of -23/8 and 23/45 - -2 - (24 + -22). 360 Let s(j) = 2j - 25. Calculate the common denominator of 113/6 and s(10). 6 Calculate the common denominator of ((-39)/130)/(288/(-100)) and -31/66. 528 Let c = -7982/9 - -884. Let z = -16993/1332 - -58/333. What is the common denominator of c and z? 36 Suppose 2d = 6b - 7b - 81, 122 = -3d - 2b. What is the common denominator of 3(-59)/(-27)1 and d? 9 Suppose 30 = u + 2u. Let o be 5/u(1 - 1). Suppose 10f - 14f + 32 = o. Calculate the smallest common multiple of 10 and f. 40 What is the common denominator of 50/36 - (40 + -38) and 61/54? 54 What is the common denominator of 77/38 and 186/(-465) + (-44)/90? 342 Let a = 37375/90117 + -9/527. What is the common denominator of a and -10/57? 171 Suppose -5o = 2u - 31, 43 = 5u + 5o - 4o. Let w be ((-15794)/30)/(u/(-20)). Let z = w + -1309. Calculate the common denominator of z and 3/22. 66 Suppose 201 = 28m - 247. Suppose 4f + 10 - 2 = 0, 22 = -2w - 5f. Let i = w - -20. Calculate the least common multiple of i and m. 112 Let k(m) = m2 - 5m + 6. Let g be k(5). Suppose -gp + 1540 = -p. Calculate the common denominator of 39/4 and 2 - (1 - p/(-12)). 12 Suppose -i = 3x - 20, 4x + 13 = -i + 38. Suppose -5r + 1195 = in, 0 = -4r - 2n + 5n + 977. Calculate the smallest common multiple of r and 2. 242 Suppose -7s + 184 = -5s. Let x be s/1025/185. Let k = -3017/222 - x. Calculate the common denominator of k and 19/12. 12 Calculate the lowest common multiple of 5 and 884/(-6)((-27)/(-2))/(-9). 1105 What is the common denominator of (-4)/(-18) - 2098/(-360) and 264/143 + -2 + 3122/(-156)? 60 Suppose -3d = -z + 1 + 1, z - 5d = 0. Suppose -zl = -0l. Suppose -36 = -lv - 3v. Calculate the lowest common multiple of 2 and v. 12 Let l = -40/589 - -25891/42997. Calculate the common denominator of l and 20/3. 219 Let q(w) = -49370w + 4. Let d be q(2). Let z be 4 - ((-436276)/d - -4). Let k = z - -4/2057. Find the common denominator of k and -43/8. 24 Suppose -22j + 210 = -12j. Calculate the least common multiple of j and 33. 231 Let k = -21969/14 - -1574. Calculate the common denominator of k and 19/230. 1610 Suppose -4i - 34 = 3b - 43, 0 = 2i + 2b - 4. What is the lowest common multiple of i and 21? 21 Let h be 25/(-2)-1. Suppose -hz - 122 = 118. What is the common denominator of -81/50 and (23/5)/(z/(-20))? 300 Let d be (-6)/(-3) + 18766487034/(-1352). Let k = -13880541 - d. Let b = k - -1/338. What is the common denominator of b and -29/4? 4 Suppose -4o - 21 = -3v, -v = -3v + 2o + 14. What is the smallest common multiple of 41 and v? 287 Suppose -2m - 8 + 20 = 0. Let w = 1029 - 6143/6. Calculate the common denominator of w and (-424)/(-44)(m/4 + -1). 66 Let t = -296/665 - 12/95. What is the common denominator of -37/66 and t? 462 Let w(q) = -12q2 + 14q. Let x be w(8). Let k be (-4)/4x/62. Let t = k - -21/124. Calculate the common denominator of t and -97/2. 4 Let z be ((-6)/2)/12 + (-3)/4. Find the common denominator of -39/20 and (-306)/220 + z/5. 220 Suppose 16d - 2 = 15d. Let w = -63 - -69. What is the least common multiple of d and w? 6 Let x = 80 - 52. Calculate the lowest common multiple of x and 42. 84 Suppose 4y + 8 = 0, -2y - 8 = -2g - 4y. Let x(a) = -a3 + a - 8. Calculate the smallest common multiple of x(-3) and g. 48 Let k(c) = 3c + 2. Let g be k(3). Let a = 19 - g. Calculate the smallest common multiple of a and 27. 216 Let j(d) = -d*3 - 2d*2 - 3d + 4. Suppose -6y = -8y - 6. What is the smallest common multiple of j(y) and 26? 286 Suppose -5n - 4g = -98, -9n + 12n - 48 = 3g. Calculate the lowest common multiple of n and 180. 180 Let a = 92279/736 + -2952/23. What is the common denominator of a and 41/44? 352 Find the common denominator of 107/22 and (-265)/6210 - (-18)/(-207). 594 Find the common denominator of (-5)/4 - 16786/(-8712) and -151/36. 396 Let s = -6132 - -3323. Let h = 1659 + s. Find the common denominator of (-3)/15h/12 and 103/6. 6 Suppose -4h = -6h - 3r - 35, 3r - 97 = 4h. Let p be (1/2)/(4/(-8)). What is the common denominator of h and (-2 - p/6) + -2? 6 Let t(r) = -2r*2 + 3r - 18. Let x(m) = -5m2 + 10m - 54. Let d(o) = -8t(o) + 3x(o). What is the smallest common multiple of d(-9) and 1? 9 Suppose 2q = q + 2v + 4, 4q + v = -20. Let z be (-1)/9(-4047 + q). Let m = z - 451. Find the common denominator of m and -61/10. 90 Suppose 3j - 7j = -48. Calculate the smallest common multiple of 6 and -4 + (-8)/j-12. 12 Find the common denominator of 65/14 and 4/40 + 6/9. 210 Let f(y) = -y + 8. Let o(l) = l2 + 5l + 5. What is the smallest common multiple of o(-5) and f(-3)? 55 Let p = -7498 + 45125/6. Calculate the common denominator of 65/24 and p. 24 Let i = -44 - -62. Let z be (-22)/3 - 1/(-3). Find the common denominator of 4 and (12/i)/(z/(-36)). 7 Suppose 0 = -37r + 39r - 8. What is the smallest common multiple of 24 and r? 24 Let p = -50074/5301 + 1/589. Let z = -6012/23 + 104053/414. Let y = p + z. Calculate the common denominator of y and 57/2. 2 Let t(g) = -g + 7. Let f be t(5). Suppose 329 = -fp - 4v - 6941, -2p - 3v - 7269 = 0. Let m = -61718/17 - p. What is the common denominator of m and -34/9? 153 Let h be 20/5 + 0/(-1) + 24. Suppose 3z - 2x = 5z, -5z = -2x - h. What is the lowest common multiple of 29/3 + (-1)/(-3) and z? 20 Let z(k) = -k2 + 1. Suppose 0 = 5x, -5c + 4x - 3 = 2. Let w be z(c). Suppose w = -3l + l + 38. What is the least common multiple of l and 7? 133 Let l = 20/699 + -61933/39144. What is the common denominator of l and -37/154? 616 Suppose z + 11021 = -3a, 3z + 7 = -8. Let g = -404598/7 - -4167645/77. Let m = g - a. What is the common denominator of m and 79/4? 44 Suppose -3l - 2i - 118 = -6l, -3l + 5i + 106 = 0. What is the lowest common multiple of l and 24? 168 Let s = 56881335/328 + -173419. What is the common denominator of -25/12 and s? 984 Calculate the common denominator of 1 + (5 - 4045/715) and 22/91. 1001 Suppose -3t - 54 = 3t. Let i = 18 + t. What is the least common multiple of 30 and i? 90 Let l = -4 + 24. Suppose 882 - 816 = 4q + 2x, q - 2x - 4 = 0. Calculate the lowest common multiple of q and l. 140 Suppose 2y + 0y - 4 = 0. Suppose -4k + 2r - 24 = -90, 4r - 48 = -yk. Let x(w) = -2w*3 - 3w + 2. What is the lowest common multiple of x(0) and k? 18 Let i(r) = r + 16. Let b be i(-7). Suppose b + 39 = 8j. What is the least common multiple of 6 and j? 6 Let d be (-1288)/(-40) + (-1)/5. Suppose -35 = -4p + 2b - 9, -3p + d = -4b. What is the lowest common multiple of 10 and p? 20 Let b = 301 - 277. What is the least common multiple of b and 96? 96 Let v = 2/373 + -16051/2238. What is the common denominator of 91/110 and v? 330 Let i(q) = 23q - 103. Calculate the smallest common multiple of 12 and i(7). 348 Suppose 2l - 3b - 3 = 9, -2l + 12 = -5b. Find the common denominator of 71/6 and -3 + 42/(-16) - l/(-3). 24 Let w(n) = -4n3 - 9. Let g be w(-3). Suppose -3r - g = -6r. What is the smallest common multiple of 24 and r? 264 Let o = 23/238 + -140015/119. Let i = o - -1140. Find the common denominator of i and ((-82)/6)/(8/(-3)). 8 Let w = 133399/33 - 4043. Let g = 100307/49224 + 8/2051. Find the common denominator of w and g. 264 Let k = 9628/1309 + -13/187. Find the common denominator of k and 41/124. 868 Let o = -6242 + 87309/14. Find the common denominator of 59/16 and o. 112 Let d = -33269/22 - -1512. Find the common denominator of d and 23/(2 - (0 - 0)). 22 Suppose 0f = -2f + 42. What is the least common multiple of (-6 + 21/(-7))-1 and f? 63 Suppose -9u + 256 = 76. Calculate the smallest common multiple of 618 and u. 6180 Let r(h) = h2 - 18h + 7. Let i be r(8). Let j be (-23)/((-2)/i). Find the common denominator of 1/8 and (-2)/60j + -2. 40 Let n be (0 - 2) + 80799/(-226688). Let g = -1/1408 + n. Let p = 2623/44 + -444/11. What is the common denominator of p and g? 28 Suppose 82 = -3r - 2o, -4r + o = -2o + 132. Let c(z) = z*3 - 7z*2 - 25z + 7. Let h be c(9). Calculate the common denominator of -99/2 and 42/h	{ "pile_set_name": "DM Mathematics" }
w - qf + 37 = 0. Is 11 a factor of w? False Let h(o) = -2o + 6. Let l be h(7). Let m(u) = -u + 1. Is m(l) a multiple of 9? True Suppose 3w - 5w + 68 = -4s, -w - 2s + 22 = 0. Does 14 divide w? True Let l = 30 - 66. Let w = l + 50. Is w a multiple of 7? True Let p(w) be the second derivative of 7/6w3 + 0 + 1/2w*2 - w. Is 15 a factor of p(2)? True Let l(j) = -25j + 5. Is 5 a factor of l(-1)? True Let q = -109 - -216. Is 30 a factor of q? False Suppose 2q - 5q = -168. Does 18 divide q? False Let v = 552 + -387. Is v a multiple of 26? False Let o(d) = d*3 - 7d*2 - 7d + 3. Does 11 divide o(8)? True Is 7 a factor of (-8 - -16)(-5)/(-2)? False Let d(y) = -17y. Let u be d(-8). Let j = 204 - u. Is j a multiple of 25? False Let k(l) be the third derivative of -l6/120 - l5/60 + l4/3 + l3/2 + 3l2. Is k(-5) a multiple of 21? True Suppose 0 = -3g + 5r + 327, -3r - r - 444 = -4g. Suppose -2i = 4h - 4i - g, 0 = 3h - 3i - 84. Suppose 3k = h - 5. Is k a multiple of 8? True Is 10 + -3 + -4 + 1431 a multiple of 26? False Let w = 0 + -1. Let f = 0 + w. Is ((-6)/(-3) + -27)/f a multiple of 12? False Let w(v) = 5v3 + 6v*2 - v + 1. Let u(g) = 11g*3 + 13g*2 - g + 2. Let b(c) = 4u(c) - 9w(c). Is b(-4) a multiple of 11? True Suppose -4c - 439 = -8c - 3x, -3c - 3x = -327. Is c a multiple of 19? False Let y(w) = w*2 - 9w + 12. Does 12 divide y(9)? True Let c(w) = -4w2 - 19w + 2. Let k(j) = 2j2 + 9j - 1. Let z(g) = 6c(g) + 13k(g). Is z(-5) a multiple of 13? False Let p be (-1)/4 + (-316)/16. Let x be ((-15)/p)/((-2)/8). Is x/(-6)(31 + 1) a multiple of 8? True Let c = 102 + -72. Does 12 divide c? False Let n = 33 + -18. Is n a multiple of 3? True Let j(x) = 2x - 7. Let i be j(5). Let a be (-4)/i(-3)/2. Suppose -ad - 2d = -52. Is d a multiple of 4? False Is ((-3)/1)/(-3) - -59 a multiple of 15? True Suppose 5u = -0 - 15. Is ((-24)/4)/(u/28) a multiple of 11? False Suppose 25 + 60 = f. Is 17 a factor of f? True Let a(d) = d + 7. Let f be a(-13). Is (f + -2)(-10)/4 a multiple of 10? True Let l = -108 + -2. Let w = l + 177. Does 25 divide w? False Let v(a) = -a + 1. Let y be (-1)/(-4) + (-246)/(-8). Suppose -4o - y - 13 = 0. Is 6 a factor of v(o)? True Suppose -4l = -9l - 35. Let f(k) = -k*3 - 7k*2 - 2k + 3. Is f(l) a multiple of 5? False Let b be (5 - 9)(1 + -33). Suppose 0 = w + 52 - b. Does 19 divide w? True Suppose c = -c + 5y + 34, -2c + 74 = 5y. Let h = c + -23. Is 3 a factor of h? False Let m(o) = -1 - 4o - o - o2 + 3o. Let f be m(-1). Suppose f = -6p + p + 30. Is 2 a factor of p? True Let b(s) = s2 + 10s + 13. Let n be b(-9). Suppose -5w + 16 = -n. Is w a multiple of 4? True Let s be 10/6 + 2/6. Suppose -3z + d - 2d = -2, 3z - 6 = -3d. Suppose zp - p - 3m = 3, sp - 4 = -4m. Is p a multiple of 7? False Suppose 3h = 27 - 9. Let j(u) = -u*3 + 5u*2 + 9u - 5. Does 13 divide j(h)? True Let s = 1 + -1. Let g be s + -1(2 - 7). Suppose g = d - 13. Does 9 divide d? True Let k(w) = 7w + 1. Let z be k(-1). Let m be (z/(-1))/2 - 1. Suppose -n + mv + 25 = 0, -n - n - 3v + 85 = 0. Does 13 divide n? False Is 19 a factor of 3/21 - (-795)/21? True Is 6 a factor of (181/(-8))/(6/(-80))? True Suppose 0 = -x - 0n - 5n - 19, 4x - 3n = -30. Is 8 a factor of (x/6 - -2)46? False Let k be (10/8)/(2/8). Suppose -kq = -q - 44. Suppose -z + q = 1. Is z a multiple of 3? False Let l = -1 + 1. Suppose lc + 4c - 56 = 0. Does 7 divide c? True Let c(d) = 46d - 1. Does 29 divide c(1)? False Let o(c) = -2c + 3. Is 4 a factor of o(-4)? False Let t = -33 - -53. Is 12 a factor of t? False Suppose 0d + d - 5 = 0. Suppose 4f = df - 16. Let b = 3 + f. Is b a multiple of 9? False Let k = 6 - 3. Suppose 2o + 11 = ko. Does 11 divide o? True Let c = -5 + 5. Suppose n + 23 = -cg - g, 4g = 2n - 68. Let p = -1 - g. Is 6 a factor of p? True Is 8/28 - 477/(-21) a multiple of 11? False Let k(j) = -j2 + 2j - 3. Let v be k(3). Let f be 82 - 43/v. Suppose f = n + n. Does 21 divide n? True Suppose 4a - 11 = 1. Suppose -14 = at - 5t. Is 7 a factor of t? True Let m(n) = -n*2 + 12n + 3. Is m(10) a multiple of 2? False Let s be (6 + -3)/(-3)0. Suppose -h + 2 = -s, -k - h = -13. Does 11 divide k? True Let y(x) be the third derivative of x5/30 + 2x*3/3 - 3x*2. Does 13 divide y(-4)? False Suppose 2z - 5z - 16 = 5b, -b - 3z = -4. Is 8 a factor of -15b/((-50)/(-16))? True Is 39 a factor of ((-6)/9)/((-1)/234 - 0)? True Let y = 157 - 46. Suppose 2a = -39 + y. Is a a multiple of 12? True Let b be (4/7)/((-5)/(-35)). Suppose ba + 2d - 4d = 170, 145 = 3a - 5d. Is a a multiple of 22? False Is (9/(-3))/3 - -191 a multiple of 62? False Suppose 2o - 9 = -7o. Let g be 4/(-5)15. Does 11 divide -22o/g2? True Suppose 3f - 122 = -h + 272, -2h = f - 133. Does 15 divide f? False Suppose 2d - 2v - 182 = 0, 4d - 464 = -d - 4v. Does 23 divide d? True Let n(x) = 6x2 - 4x + 3. Let q = 2 - 2. Suppose 3i + 0i - 6 = q. Does 8 divide n(i)? False Suppose 11k = 7k + 232. Does 10 divide k? False Suppose 5s = 3s + 180. Is s a multiple of 30? True Suppose 7v = 4v + 228. Is 15 a factor of v? False Suppose -56 = 5r + m + 79, -5m - 59 = 3r. Let o = -12 - r. Is 16 a factor of o? True Let w = -9 + 13. Let r be (-505)/(-15) + w/(-6). Is 9 a factor of -12r/(-6)? False Let w = 21 - 30. Let g(v) be the third derivative of v6/120 + v5/6 + v4/6 - 2v*3 + 14v*2. Is g(w) a multiple of 11? True Let s(n) = 2n*2 - 2n - 1. Let y be s(2). Suppose -yd = -57 - 9. Is d a multiple of 11? True Suppose 7y - 2y = -2o + 285, -4o = -20. Is y a multiple of 5? True Let s(y) = y3 + 7y*2 + 6y + 3. Let g be s(-6). Suppose -3k = -gf - 21, -f = -2f + 3. Is 5 a factor of k? True Suppose 0i - 8 = i + 4u, -2i = u + 16. Is (-406)/i + 1/4 a multiple of 13? False Let x(j) = 8j - 2. Let i be x(2). Suppose i + 46 = 5q. Is q a multiple of 6? True Let s(j) = -5j + 0j - 4 + 4. Let n be s(-1). Suppose 175 = nz - 5p, 0 = 2p - 0 - 4. Is z a multiple of 12? False Let a(k) = 6k + 4. Let j(o) = -o*2 - 9o + 3. Let u be j(-9). Does 22 divide a(u)? True Let f be (-4)/6 + (-212)/(-12). Does 8 divide (-4)/(-2) + -2 + f? False Suppose -2r - 4y + 110 = 0, 2r + 3y + 2y - 109 = 0. Is 13 a factor of r? False Does 37 divide (888/(-36))/(2/(-6))? True Let h(b) = 3b*2 + 2b + 1. Let x(k) = -k*3 + 7k*2 - 8k + 9. Let a be x(6). Is h(a) a multiple of 5? False Suppose 2k - 10 = -3k. Is ((-9)/(-2))/(1/k) a multiple of 9? True Let u be 0 - 42/4. Does 14 divide (-3)/u56/3? True Suppose w - 12 = 5w. Let f be -47 - (w/(-1))/3. Is (1/(-2))/(4/f) a multiple of 3? True Let t(z) be the second derivative of z5/120 - 5z4/24 + z3/3 - z. Let j(b) be the second derivative of t(b). Is 3 a factor of j(8)? True Let x(y) = 6 - 2y - 2y + 2y + y. Is 7 a factor of x(-7)? False Suppose 0 = 2m - c - 14, -5m + 2c + 38 = 1. Suppose 7r + 20 = 2r + 3u, -4u + 17 = 3r. Is (m/(-15))/(r/5) a multiple of 3? True Suppose 3d + 4t + 9 - 135 = 0, -3t = 0. Is d a multiple of 3? True Suppose 3y = -151 + 448. Is 20 a factor of y? False Let f = -27 + 241. Is 12 a factor of f? False Let u(x) = 90x - 2. Does 14 divide u(1)? False Let z(k) = 27k - 36. Does 39 divide z(10)? True Let x = 16 - -6. Let r be 1 + -1 + x/(-2). Let i = r + 35. Is i a multiple of 8? True Let p = -10 + 28. Let m = p - 12. Is 4 a factor of m? False Let q(o) = -o2 - 5o + 2. Let g be q(-5). Suppose -gk + 12 = k. Does 4 divide k? True Suppose 2u + 5 = c - 0u, 0 = -3c + u + 40. Is 5 a factor of c? True Suppose p + 1 - 11 = 0. Let v = -1 + 6. Let o = v + p. Is 10 a factor of o? False Suppose 5j = 2y + 61, 2y = -2j + 8 + 22. Is j a multiple of 5? False Let s = -2 + 5. Let t be s(4/(-6) - -2). Suppose tf - 3z - 136 = 2z, -100 = -4f - 4z. Is 18 a factor of f? False Let o be 2/(-3) + (-325)/(-15). Is (-346)/(-14) - (-6)/o a multiple of 8? False Let v be 6/4(-920)/30. Let d = v + 88. Does 14 divide d? True Suppose -40 = -14b + 10b. Is 5 a factor of b? True Let g(r) = 23r*3 + 2r*2 - 2. Let u be g(2). Suppose u + 140 = 3m. Suppose -m = d - 6d. Does 11 divide d? True Let o(i) = -i3 + 13i**2 + i + 31. Is o(13) a multip	{ "pile_set_name": "DM Mathematics" }
*2 - 629290w - 1 Let z(k) = 2k2. Let y(j) be the second derivative of -6 - 1/2j*2 + 8/3j*3 - 15j. Calculate y(z(m)). 32m2 - 1 Let j(n) = 12n - 3. Let o(m) be the second derivative of -m - 2/3m3 + 0m*2 + 132. Determine o(j(g)). -48g + 12 Let u(s) be the second derivative of 9s3/2 - 3s*2/2 - 85314s. Let w(r) = 6r - 4r + 0r. Give u(w(a)). 54a - 3 Let d(t) = 130t2 + 21 + 0t + 207t2 - 21 + 2t. Let n(s) = -2s. What is d(n(g))? 1348g*2 - 4g Suppose 0 = -15x + 44x - 34829. Let r(j) = -xj + 2405j - 1239j. Let s(i) = 3i. What is r(s(o))? -105o Let p(u) = u2. Let k(a) be the first derivative of -2024a*3/3 + 1717. Determine k(p(s)). -2024s*4 Let n(k) = -2k*2. Let u(z) = 18488591z*2. Give u(n(p)). 73954364p4 Let w(y) be the second derivative of y4/12 + 7y + 1. Let c be (1 - (0 - 0))2. Let t(f) = -2f2 - 3f*2 + 4fc. Calculate t(w(i)). -i4 Let h(p) = -8p2. Let f(a) be the second derivative of 0 - 11/6a*3 - 9a + 0a2. Calculate f(h(g)). 88g*2 Let f(l) = 2l*2. Let m(d) = 1384d*2 + 49610d. What is m(f(w))? 5536w4 + 99220w*2 Let y(l) = -71884l. Let r(d) = 80d. Give r(y(v)). -5750720v Let t(u) = -u*2 + 9u. Let l(s) = 5s + 4011. Calculate t(l(y)). -25y*2 - 40065y - 16052022 Let a(v) = -75v. Let c(k) be the third derivative of k8/10080 - 2k*5/3 - 2k*3/3 - 154k*2. Let g(p) be the third derivative of c(p). Calculate g(a(x)). 11250x*2 Let x(v) = -2v. Let s(a) = -2a - 19. Let h be s(-21). Let i(w) = -43w + hw - 29w. Give x(i(j)). 98j Let v(y) = -11y*2 + 2. Let g(k) = 39k*2 - 9. Let r(j) = -2g(j) - 9v(j). Let s(x) = -27x + 3. What is s(r(h))? -567h2 + 3 Let r(n) = 12451n - 15000n - 8199n. Let f(o) = -2o. Give r(f(v)). 21496v Let w(a) = 8a2. Let i(g) be the first derivative of -22g*3 - 23g*3 + 41 + 43g*3. Calculate i(w(z)). -384z*4 Let w(c) = 2c*2. Let x(u) be the first derivative of -5/3u*3 - 235 + 0u + 0u2. Calculate x(w(p)). -20p*4 Let c(q) = -20q - 1339. Let v(f) = 9f + 618. Let s(o) = -6c(o) - 13v(o). Let b(m) = 0m - 27 + m - 3m. What is s(b(y))? -6y - 81 Let r(l) = -6492l2. Let u(s) be the second derivative of -s4/12 - 4741s. Determine r(u(o)). -6492o4 Let m(p) = 3p*2 + 14p. Suppose 1366 = 10r + 466. Let s(k) = -r - 3k + 186 - 96. Give s(m(n)). -9n2 - 42n Let y = 37 - 20. Let p(w) = 12w + 4w - yw. Let d(o) be the third derivative of -o5/30 + o4/8 - 2o*2. What is p(d(t))? 2t*2 - 3t Let f(v) = -5v2. Let h(r) = -r2 + 4r. Let z(a) = 7a2 - 20a. Let u(o) = -5h(o) - z(o). Give u(f(k)). -50k*4 Let b be 1/((-2)/5) + 2/(-4). Let q be (2 - -1)b5/(-45). Let c(h) = 2 - 7h + q - 3. Let k(w) = 2w2. What is k(c(n))? 98n*2 Let g(o) be the second derivative of 187o*4/8 - 4o*2 - 3o. Let h(i) be the first derivative of g(i). Let p(y) = 2y2. Give p(h(m)). 629442m*2 Let m(x) be the third derivative of 0x*3 + 1/20x*5 + 1/24x*4 + 0 - 4x*2 - 3x. Let y(a) = -2a. Determine y(m(o)). -6o*2 - 2o Let p(v) = -2v - 240236. Let g(r) = 3r*2 + 7. What is p(g(w))? -6w*2 - 240250 Let u(w) = 2 - 379w - 2 + 189w + 192w. Let b(z) be the third derivative of 0z3 + 0 + 0z*4 + 0z + 1/30z5 + 2z*2. Calculate u(b(j)). 4j*2 Let k(x) = -197x - 1. Let w(q) be the first derivative of -3q2 + 69. What is k(w(b))? 1182b - 1 Let t(g) = -g2 - g2 - 7g2. Let u be (-72)/18 - -61. Let c(r) = -87 + 87 + 2r + ur. Calculate c(t(v)). -36v2 Let s(o) = 3o - 3o + 2o. Let c(r) be the second derivative of -2r2 - 42 + 3/2r*3 - r. Give s(c(m)). 18m - 8 Let d(z) = -1. Let f(x) = x + 1. Let l(h) = d(h) - 3f(h). Let g(c) be the second derivative of 0c*2 - 1 + 43c - 1/3c3. Calculate g(l(j)). 6j + 8 Let k(p) be the third derivative of 11p8/20160 - 32p*5/15 - 2p*2 - 10p. Let t(m) be the third derivative of k(m). Let u(d) = 3d. Determine u(t(r)). 33r*2 Let g(r) = r. Let t be 12/3 - (-2 - 13 - -9). Let z(a) be the third derivative of 0 + 0a*4 + 1/20a*5 + 0a + 0a3 - ta*2. Calculate z(g(i)). 3i*2 Let b(h) = -4h*2. Let c(m) = -577m + 1797m - 613m - 869m. Determine b(c(z)). -274576z*2 Let r(f) = 180f - 95. Let s(v) = -27v - 3. What is r(s(y))? -4860y - 635 Suppose -4o - 3i + 72 = 0, o + 0o - 5i = -5. Let q(d) = 7 - 8d2 - 7 + od2. Let c(l) be the third derivative of -l5/30 - 17l2. Give q(c(v)). 28v*4 Let v(p) = 9p*2. Let b(h) = -11h + 30. Let m(o) = -17o + 32. Let c(k) = -3b(k) + 2m(k). Determine c(v(y)). -9y*2 - 26 Let y(t) = -8t*2 + 3t + 42. Let p(v) = 7v2 - 2v - 28. Let m(h) = 6p(h) + 4y(h). Let w(c) = 58c2. Determine m(w(x)). 33640x*4 Let v(f) = 0 + 0 + 69f + 40f. Let i(w) = -51w*2 - 28w*2 - 25w*2 + 102w*2. What is i(v(k))? -23762k*2 Let b(z) = -145z. Let s(t) be the third derivative of 0t3 - 1/24t*4 + 0 - 103t*2 + 0t. Calculate s(b(d)). 145d Let i(r) = -13r. Let h(z) = -37z2 - 9763z + 7. Give i(h(y)). 481y2 + 126919y - 91 Let a(f) = -19f. Let s(v) = 43868840v*2. Calculate s(a(n)). 15836651240n*2 Let k(n) = -7775n. Let s(a) = -3a + 10. Give k(s(u)). 23325u - 77750 Let m(h) = 121480110h2. Let u(b) = 2b. Determine u(m(k)). 242960220k2 Let w(d) = -943d*2. Let u(a) be the second derivative of 2a*3 + 5543a. What is u(w(r))? -11316r2 Let r(i) = 33971i. Let o(n) = 994n2. Give r(o(b)). 33767174b*2 Let b(x) be the first derivative of -10x3/3 + 2525. Let m(v) = v2 - v. Give m(b(p)). 100p4 + 10p*2 Let f(j) = 22j*2 - j - 6j*2 + j. Let y(s) = s - 2. Let g(x) = -1. Suppose 36k - 5 = 31k. Let u(a) = ky(a) - 2g(a). Give u(f(c)). 16c*2 Let a(c) = -2c. Let d(s) = 842285960s. What is a(d(i))? -1684571920i Let p(n) = 79225n. Let d(z) = 136z*2. Give p(d(v)). 10774600v*2 Let y(f) = -9f*2 + 8f. Let j(t) = -t*2 + t. Let c(h) = -40j(h) + 5y(h). Let v(s) = -1068s + 271s + 264s + 266s + 263s. Give v(c(k)). 20k2 Let a(k) = 143767k + 20. Let x(i) = 2i2. Calculate a(x(j)). 287534j2 + 20 Let l(w) = w2 - 514w. Let o(r) = r2 - 1950420r + 1950420r. Determine o(l(y)). y4 - 1028y*3 + 264196y*2 Let x(h) = -3h*2 + 3 - 4 + 0 + 3. Let k(w) = -2434w - 2421w - 1 + 4856w + 1. Calculate x(k(u)). -3u2 + 2 Let m(d) = 5d - 71 + 150 - 72 + 0d. Let v(l) = -l. Calculate v(m(a)). -5a - 7 Let p(s) = -9s. Let b(u) = 1831363u. What is b(p(i))? -16482267i Let q(i) = -835i*2. Let r(m) = -42m - 4. Let b(z) = 74z + 7. Let t(s) = -4b(s) - 7r(s). What is t(q(c))? 1670c*2 Let t(i) be the first derivative of 0i*2 - 134 - 2/3i*3 + 0i. Let y(w) = 2w2 - 27w. Calculate y(t(f)). 8f4 + 54f*2 Let i(l) = 7l + 1 - 3 + 2. Let z(p) = 4p + 3. Let n(o) = 11o + 8. Suppose 5f + 37 = 4w - 20, -4w + 17 = 3f. Let q(c) = wz(c) - 3n(c). What is i(q(y))? -7y Let j(t) = 7t*2. Let d be 448/6272 + (-1)/14. Let i(a) be the first derivative of 19 - 5/2a*2 + da. Determine i(j(q)). -35q2 Let t(h) = 31h. Let b(u) = -22216u. Calculate t(b(l)). -688696l Let l(o) = -4o2. Let w(x) be the first derivative of -240x*2 - 2x - 4878. Calculate l(w(a)). -921600a2 - 7680a - 16 Let t(c) be the first derivative of c*2 - 31c - 129133. Let f(a) be the second derivative of a*3/6 - a. What is f(t(k))? 2k - 31 Let g(p) = 33 - 4p + 2p + p. Let o(v) = -10785 + 43129 - 10776 - 10786 + v - 10782. Calculate g(o(d)). -d + 33 Let f(k) = -27k. Let t(i) be the second derivative of -43i4/12 + i3/6 + 7757i. Determine f(t(m)). 1161m*2 - 27m Let f be 36/(-84) - (-1)/((-7)/(-3)). Let x(u) = -u + 12 + f - 12. Let n(m) = -4 + 8m - 1 + 2 + 15m. Give x(n(g)). -23g + 3 Let j(m) = -2m. Let o(q) be the first derivative of -q*4/3 + 3q*3/2 - 41q*2 - 21. Let t(n) be the second derivative of o(n). Calculate t(j(d)). 16d + 9 Let u(y) = 778y2 - 5y - 10. Let v(k) = 310k2 - 2k - 4. Let b(o) = -2u(o) + 5v(o). Let h(x) = 2x - 2x + 6x. What is b(h(p))? -216p2 Let p(a) = -a2 + 16. Let t(n) = -6n - 4. Let u(d) = -10d - 7. Suppose 4q = -2i - 9 + 27, -3q - 32 = -5i. Let j(r) = it(r) - 4u(r). Calculate j(p(k)). 2k2 - 32 Let t(g) = -46g*2 + 6g*2 + 5g*2 + 7g - 5g. Let k(x) = -4	{ "pile_set_name": "DM Mathematics" }
9 What is the v'th term of -292119861, -292119860, -292119859, -292119858, -292119857? v - 292119862 What is the g'th term of -307518, -307504, -307490, -307482, -307486, -307508? -g*3 + 6g*2 + 3g - 307526 What is the s'th term of 75383, 75294, 75223, 75176, 75159, 75178? s*3 + 3s*2 - 105s + 75484 What is the g'th term of -7201035, -14402068, -21603101, -28804134, -36005167? -7201033g - 2 What is the y'th term of -29976107, -29976112, -29976117, -29976122, -29976127? -5y - 29976102 What is the n'th term of 101371, 103947, 106523? 2576n + 98795 What is the x'th term of -3572272, -3572281, -3572290, -3572299? -9x - 3572263 What is the s'th term of 88917, 176417, 263917? 87500s + 1417 What is the o'th term of -344266, -1376981, -3098146, -5507761, -8605826, -12392341, -16867306? -344225o*2 - 40o - 1 What is the i'th term of -7136772, -14273559, -21410346, -28547133, -35683920? -7136787i + 15 What is the b'th term of -2000, -2432, -3152, -4160, -5456? -144b2 - 1856 What is the y'th term of -33704, -31693, -29684, -27677, -25672, -23669, -21668? -y2 + 2014y - 35717 What is the p'th term of 921415036, 921415032, 921415026, 921415018? -p2 - p + 921415038 What is the b'th term of 3441, 3511, 3585, 3663? 2b*2 + 64b + 3375 What is the z'th term of -4190, -3293, -1798, 295, 2986? 299z2 - 4489 What is the j'th term of 129, 804, 2631, 6186, 12045? 96j*3 + 3j + 30 What is the d'th term of -11666494, -23332988, -34999482, -46665976, -58332470? -11666494d What is the f'th term of -5553761, -5553776, -5553801, -5553836? -5f*2 - 5553756 What is the k'th term of 396521, 793075, 1189629, 1586183, 1982737, 2379291? 396554k - 33 What is the j'th term of -1748231, -3496435, -5244651, -6992885, -8741143, -10489431, -12237755, -13986121? -j*3 - 1748197j - 33 What is the r'th term of -1674191, -1674190, -1674189, -1674188? r - 1674192 What is the g'th term of -50426, -201514, -453326, -805862? -50362g2 - 2g - 62 What is the l'th term of -68528, -274087, -616674, -1096289, -1712932, -2466603? -68514l2 - 17l + 3 What is the m'th term of -613181, -1226348, -1839517, -2452688, -3065861, -3679036, -4292213? -m*2 - 613164m - 16 What is the j'th term of 37467, 39902, 42337, 44772, 47207, 49642? 2435j + 35032 What is the z'th term of -942, -973, -1024, -1095, -1186? -10z*2 - z - 931 What is the b'th term of 2444, 10171, 23048, 41075? 2575b*2 + 2b - 133 What is the q'th term of -72827240, -72827238, -72827236, -72827234? 2q - 72827242 What is the r'th term of -12628, -33785, -54942? -21157r + 8529 What is the n'th term of 42972, 42888, 42754, 42570, 42336? -25n2 - 9n + 43006 What is the n'th term of 4441614, 4441619, 4441624? 5n + 4441609 What is the o'th term of -54069, -108132, -162187, -216234? 4o*2 - 54075o + 2 What is the c'th term of -516, 2718, 8110, 15666, 25392, 37294, 51378? c*3 + 1073c*2 + 8c - 1598 What is the o'th term of 31624, 114879, 253644, 447925, 697728? o*3 + 27749o2 + o + 3873 What is the a'th term of 1059, -29685, -60415, -91125, -121809? a3 + a*2 - 30754a + 31811 What is the w'th term of 4395537, 4395545, 4395553? 8w + 4395529 What is the i'th term of 67968, 135888, 203808, 271728, 339648, 407568? 67920i + 48 What is the a'th term of 54812092, 109624184, 164436276, 219248368, 274060460? 54812092a What is the f'th term of 1261947, 2523898, 3785855, 5047824, 6309811, 7571822, 8833863? f3 - 3f*2 + 1261953f - 4 What is the d'th term of -99009, -198089, -297169, -396249, -495329? -99080d + 71 What is the r'th term of 276452617, 276452619, 276452621, 276452623? 2r + 276452615 What is the o'th term of -605, -5050, -17357, -41534, -81589, -141530, -225365? -668o3 + 77o*2 - 14 What is the y'th term of -3006304, -6012539, -9018774, -12025009, -15031244? -3006235y - 69 What is the u'th term of -370, -269, 724, 3029, 7066? 70u3 + 26u*2 - 467u + 1 What is the h'th term of -58209, -56263, -54327, -52407, -50509, -48639, -46803, -45007? -h3 + h2 + 1950h - 60159 What is the n'th term of 7450, 61753, 209754, 498301, 974242? 7808n3 + n2 - 356n - 3 What is the w'th term of -297228, -1189018, -2675318, -4756122, -7431424, -10701218, -14565498? w3 - 297261w*2 - 14w + 46 What is the s'th term of -138834, -138885, -138938, -138993, -139050, -139109, -139170? -s*2 - 48s - 138785 What is the j'th term of -1434980, -2869944, -4304908, -5739872, -7174836? -1434964j - 16 What is the f'th term of -418647929, -837295857, -1255943785, -1674591713? -418647928f - 1 What is the s'th term of 60789, 243112, 546983, 972402? 60774s2 + s + 14 What is the o'th term of 294, 153, -56, -333, -678, -1091, -1572? -34o*2 - 39o + 367 What is the g'th term of -2326, -4976, -7652, -10354, -13082, -15836? -13g2 - 2611g + 298 What is the z'th term of 660, 4592, 14688, 33846, 64964, 110940? 483z3 + 184z*2 - z - 6 What is the p'th term of 132, -392, -1624, -3858, -7388, -12508, -19512? -49p*3 - 60p*2 - p + 242 What is the m'th term of -71919, -143838, -215737, -287604, -359427? 2m*3 - 2m*2 - 71927m + 8 What is the t'th term of -41765, -165433, -371007, -658487, -1027873, -1479165, -2012363? -40953t2 - 809t - 3 What is the j'th term of -1855, 883, 5451, 11849, 20077? 915j2 - 7j - 2763 What is the d'th term of 22, -523, -1068, -1613, -2158, -2703? -545d + 567 What is the p'th term of -26134, -47180, -68228, -89278, -110330, -131384, -152440? -p2 - 21043p - 5090 What is the j'th term of -1735172, -3469524, -5203888, -6938270, -8672676, -10407112? -j*3 - 1734345j - 826 What is the u'th term of -68808975, -68808977, -68808979, -68808981, -68808983, -68808985? -2u - 68808973 What is the g'th term of 1788, 3963, 6510, 9429? 186g*2 + 1617g - 15 What is the h'th term of 1132, 3307, 5476, 7639? -3h2 + 2184h - 1049 What is the q'th term of 68021, 67189, 66357, 65525? -832q + 68853 What is the t'th term of 11120909, 11120908, 11120907, 11120906, 11120905, 11120904? -t + 11120910 What is the g'th term of -71169, -284875, -641115, -1139889, -1781197, -2565039? -71267g*2 + 95g + 3 What is the q'th term of -219972913, -439945827, -659918741, -879891655? -219972914q + 1 What is the w'th term of 40413, 40364, 40315, 40266? -49w + 40462 What is the x'th term of 280681, 1122763, 2526225, 4491061, 7017265, 10104831, 13753753? -x*3 + 280696x*2 + x - 15 What is the t'th term of -11785, -18577, -25369, -32161, -38953, -45745? -6792t - 4993 What is the f'th term of 128909, 515703, 1160385, 2062955, 3223413, 4641759, 6317993? 128944f2 - 38f + 3 What is the l'th term of 4494, 9024, 13544, 18042, 22506, 26924, 31284? -2l3 + 7l*2 + 4523l - 34 What is the c'th term of -483692667, -483692668, -483692669, -483692670, -483692671, -483692672? -c - 483692666 What is the i'th term of 226, -278, -1128, -2330, -3890, -5814, -8108? -i*3 - 167i*2 + 4i + 390 What is the g'th term of -179, 114, 873, 2332, 4725, 8286, 13249? 39g3 - g2 + 23g - 240 What is the z'th term of 10225, 10178, 10063, 9850, 9509, 9010, 8323, 7418? -5z3 - 4z*2 + 10234 What is the p'th term of 69257254, 138514509, 207771764, 277029019, 346286274, 415543529? 69257255p - 1 What is the y'th term of 47407, 47522, 47827, 48418, 49391, 50842, 52867, 55562? 16y3 - y2 + 6y + 47386 What is the g'th term of 8948, 35445, 79610, 141443, 220944, 318113? 8834g2 - 5g + 119 What is the d'th term of 5164, 7207, 9288, 11425, 13636, 15939? 3d3 + d2 + 2019d + 3141 What is the w'th term of -237, -1223, -2773, -4863, -7469, -10567? 4w3 - 306w*2 - 96w + 161 What is the y'th term of 488, 3199, 10254, 23825, 46084? 362y3 + 177y - 51 What is the f'th term of -14325, -15536, -16747, -17958? -1211f - 13114 What is the i'th term of -25652, -52062, -78472, -104882? -26410i + 758 What is the p'th term of -264111, -1055574, -2374679, -4221426, -6595815? -263821p2 - 290 What is the t'th term of -149150766, -298301532, -447452298, -596603064, -745753830, -894904596? -149150766t What is the d'th term of 19829951, 39659895, 59489839? 19829944d + 7 What is the k'th term of 367, 631, 775, 787, 655, 367, -89, -725? -2k*3 - 48k*2 + 422k - 5 What is the n'th term of -161495, -1	{ "pile_set_name": "DM Mathematics" }
aaa/a*23(a*(-7/5)aa)(-40) assuming a is positive. a(-721/16) Simplify (gg*(-6)/gg)0/(g(-13)/((((g*(1/8)g)/g)/g)/g)) assuming g is positive. g*(89/8) Simplify (r(r*33rrr)/r(((r/(r/r(-3/8)))/r)/r)/r)/(((r/r(-9/5))/r)/(r/(rrr(-6/11)))) assuming r is positive. r(13363/440) Simplify ((((sss2)/s)/s(5/4))/((s/(s/((ss/(s/(s*(-4)/s)))/ss)s))/s7))33 assuming s is positive. s(1815/4) Simplify (c(1/9)/c(c(-13)/c)/c)(-2/13) assuming c is positive. c*(22/9) Simplify ((f/(f/(ff/(f*0f))))(-50)/(f/f0ff*(2/15)f))(4/9) assuming f is positive. f(-3188/135) Simplify (((hh(3/5))/h1)48)(-48) assuming h is positive. h(-6912/5) Simplify (t(-2/5)t(t(-2/11)t)/tt)23 assuming t is positive. t(1794/55) Simplify o14o*(4/11)(o/(o/o(-2/17)))(4/11) assuming o is positive. o*(2678/187) Simplify (jj/j(2/23))/((j12j)/j)jj17jjj(2/3)/j assuming j is positive. j(661/69) Simplify k*(-2)k*2(k(-1)/k)(-17) assuming k is positive. k*34 Simplify (r/(r/(rr*(8/7)r)r))(-7/12)/(r(3/13))11 assuming r is positive. r(-197/52) Simplify (n(11/5)/n(-9))/(n/n(-3)n(n/(((n(-4)n)/nn)/n))/n) assuming n is positive. n(11/5) Simplify (rrr(-2/5)r/(r/r*(2/5))((rr/((rrrr*(4/3)/rr)/r))/r)/r1)(-36) assuming r is positive. r48 Simplify (b9)45/(b(7/5))(2/117) assuming b is positive. b(236911/585) Simplify (y(-13)/(y(-2/9)y))/(y/(yyy/((yyy(-1/3)/y)/y)))(-44) assuming y is positive. y(-1048/9) Simplify (((v/(vvvv*(-1/6)/vvvv))/vv/(v/(v/v(-3))))27)(5/3) assuming v is positive. v(-75/2) Simplify ((g(-1/23)g)/(g*17gg))(-6/7) assuming g is positive. g(2490/161) Simplify (v/(vv*6v))/(v*(-1/3)v)((v/(v/(v2/v))vv)/v)47 assuming v is positive. v(259/3) Simplify (z/((((z/((z(1/13)z)/z)z)/z)/z)/zz)z/((zz*(-7)zzzz)/z)z)/((z/z(-8))/((z(6/13)/z)/z)) assuming z is positive. z(-58/13) Simplify (r2)(1/20)/(r/(r(-2/5)/rrrr))(3/29) assuming r is positive. r(47/290) Simplify ((a(-4/7)(a/a(-3))/a)36)(2/65) assuming a is positive. a(1224/455) Simplify ((x/(xx(-11/4)x))/xx(-31))/(x(-21)/x)(-12/11) assuming x is positive. x(-217/4) Simplify ((l(1/2))(-15)(((l/(l*(-2/3)l))/l)/l)/(l*(5/2)ll))50 assuming l is positive. l(-2000/3) Simplify (g/((g(-2/5)g)/gg))30(gg(2/7)/ggg)(-21/4) assuming g is positive. 1 Simplify h(1/6)hh22h(h11/hh)/(h/(hh/(h(3/11)h))) assuming h is positive. h(2303/66) Simplify (y(-1)yy(-14))/(y(2/7))22 assuming y is positive. y(-142/7) Simplify h*(2/5)h*(2/9)/h((h(-4)/h)/h)/h13 assuming h is positive. h(-872/45) Simplify (x(-2/7))*31(xxx/x5)(-3) assuming x is positive. x(-20/7) Simplify (u/(u(-2/15)/u))/u*(-11)u(4/11)/u11 assuming u is positive. u(412/165) Simplify ((t(-4)/(tt(-3)))20)(-14) assuming t is positive. t560 Simplify (r8r(-3/19))(-2/51) assuming r is positive. r*(-298/969) Simplify (b/(b/((((bb*(-1/4)/bbbb)/bb)/b)/b)))(4/9)b*(-7)/(bb(b/(bb((bb*(-1/10))/b)/bbb))/bb) assuming b is positive. b(-203/30) Simplify (((m(-8)m)/(mm/(mm2)mm))(-13))(-9) assuming m is positive. m(-936) Simplify h/(hh*(3/2))h*(-11)h9/h(2/11) assuming h is positive. h(-81/22) Simplify (d(-1/9)ddd(d*6/d)/dddd)/(d(-18/7)/d7) assuming d is positive. d(1226/63) Simplify q(5/4)/q*(1/35)q31/((q/(q(-23)qqq))/qq) assuming q is positive. q(1571/140) Simplify (o(-9)o/(o/(o(o*(-1/3)/o)/oo))o)/(o(-5/6)(oo/(oo(1/8)))/o) assuming o is positive. o(-59/8) Simplify (j(3/2)/(j/j(-2/5)))/(j*(-4/7)/jjjj*(-2/7)/jj) assuming j is positive. j*(-3/70) Simplify (n/(nn/(n/(n/n(-1)))))(-4)(n(nn(8/7)n)/n)/n(nn*(-12)nn)/nn assuming n is positive. n(8/7) Simplify z(-4/3)zz*(-6/5)(z(1/3))(-5/4) assuming z is positive. z*(-39/20) Simplify ((k/(k/(kk/((k*(1/13)/k)/k))))/((kk(-1/2))/k))(-1/30) assuming k is positive. k(-23/156) Simplify (((t/(t/t(2/13)))/t(-4))/(((t/(t6/tt)t)/t)/((tt/(t/(tt*(2/5)t)))/t)))(-25/6) assuming t is positive. t(-3755/78) Simplify ((l*(-1/5)ll)/(ll/l(-2/115)))(-33) assuming l is positive. l(165/23) Simplify (((b(-14)b)/b)(-2/15))(-2/51) assuming b is positive. b(-56/765) Simplify (m(-11)m/(m*(-10)m))/(m*6mmm/(mm/(m/(mm*(-10)))m)m) assuming m is positive. m(-18) Simplify (c9(c/(c/c*(-2/5))c)/c)/(((c/(c/(c/((c/(c/(ccc/c*(-17)c)))/c)))c)/c)/ccc21/c) assuming c is positive. c(38/5) Simplify v(-8)/(v/(vv/(((v/v*5)/v)/vv)))((v/(v(-3/2)v)v)/vv)/(v/(v/(((v/v*(-7))/v)/vv))) assuming v is positive. v(-13/2) Simplify ((k(-5)k(-4/3))/(k(-2/7))(-25))(2/39) assuming k is positive. k(-566/819) Simplify ((h(-4)hh/(hh/h*2)h)14)33 assuming h is positive. h(-462) Simplify (l/(l20/l))*(-15)/(ll(-16))40 assuming l is positive. l*870 Simplify (jj/(j*6j))3/(j(-22))19 assuming j is positive. j403 Simplify (g*8gggg(2/9)g)/(g*(-3/5)gg(5/4)g) assuming g is positive. g(1723/180) Simplify (((y38y)/yyy)/yy*(3/32)y)(42/5) assuming y is positive. y(26943/80) Simplify (s*(2/33)s)*(-2/77)s*(1/4)ss/(ss(-1/4)) assuming s is positive. s(1069/726) Simplify (ii(-4/7)i)*(-31)(i((i1/i)/i)/i)(-1/20) assuming i is positive. i(-6193/140) Simplify (i(-2)/ii*(1/33)i)/(i(-1/8)/i8) assuming i is positive. i(1625/264) Simplify (i(1/9))(2/65)/((i/(i/((i(-7/2)ii)/ii)ii))/ii13) assuming i is positive. i(-9941/1170) Simplify q*3qq/(qqq19qq)q/(q/(qq/((q/(q/(q(q*(1/27)/q)/qq)))/q)))qq/((q*(-2/41)q)/q) assuming q is positive. q(-14378/1107) Simplify (g(-11)/(gg(-3/2)))(1/3) assuming g is positive. g(-7/2) Simplify (w(1/13)w(4/7))/(w(3/2)/w0) assuming w is positive. w(-155/182) Simplify (q/(q*(-1/2)/q)q*10qq)/(q/(q/q(2/13)))31 assuming q is positive. q(253/26) Simplify (((g(-5/6))(1/6))45)13 assuming g is positive. g(-325/4) Simplify n(-1/5)/(nn*(-4)n)n(-5/6)/nn/(n(2/9)/n) assuming n is positive. n(157/90) Simplify ((w(2/11))(-1)/((w/w*9)/ww/(w/(w/(ww0)))))(2/151) assuming w is positive. w(194/1661) Simplify ((i(-1/3))(2/109)/(i/i(-1/4))(-16))19 assuming i is positive. i(124222/327) Simplify (jj/((jj(jj3)/jj)/jjj))/j*(-3)(jjj/(((j/(j(j(jj/(jj/(j*(-1/9)jj)))/jj)/j)j)/jj)/j))35 assuming j is positive. j(1522/9) Simplify hh(-9/8)/h((h/(hhh*15h)h)/h)/h((hh9)/h)/h3 assuming h is positive. h(-105/8) Simplify (kk(-35))/k(-2/21)(k(-23))(10/9) assuming k is positive. k(-3746/63) Simplify ((a/(a/(a/a(-6)))a)/(((a/(aa/(a/a(-8))))/a)/a))/(a/(a(-7)a)a/(a(-1/5)/a)) assuming a is positive. a(-36/5) Simplify (z/z(-4/9))/(z11/z)zz(3/8)(z/(z*(-9)zz))/z assuming z is positive. z(-13/72) Simplify ((n/(n/((n(1/3)n)/n))n)/(n/(nn(-6))))/(n16(n/n(-1/19))/n) assuming n is positive. n(-1181/57) Simplify (n/((n/(nn*(-10)n))/n))34/(n/n8nnnnnn/n5) assuming n is positive. n(-232) Simplify (m/m(-1/6))/(m(-11)m)(m(-2/5)/m)(-2/105) assuming m is positive. m*(1679/150) Simplify (s(((s/s(-3/2))/s)/s)/s)(1/2)(ss/((s(ss/(s(ss*(-9/7)s)/s)s)/s)/s))/s1 assuming s is positive. s(-1/28) Simplify h(3/11)hhh/(h*(-4)/h)hh6h(3/14)/h assuming h is positive. h(2231/154) Simplify ((o/(o/o*15)o)/ooo11/o)(1/19) assuming o is positive. o*(26/19) Simplify (s(s/(s/s*29s))/s)/(ss/((ss/(ss16)ss)/s))s*16s(((s(-6)s)/ss)/s)/s assuming s is positive. s22 Simplify ((c/(cc/c(-24)))/(c(-1/2)c))/(c/c(-13)c7) assuming c is positive. c(-93/2) Simplify ((f/(((f(((f/f(-1))/f)/f)/f)/fff)/ff)f)43((f(1/3)/f)/f)/(f(-10)f))(-1/10) assuming f is positive. f(-151/30) Simplify d32/(d/(d/((dd*(-2/117))/d)))dd/(d/(dd*(-2/7)))d*(-14)/dd assuming d is positive. d*(16160/819) Simplify ((hh/((h*(-3/2)h)/h)*	{ "pile_set_name": "DM Mathematics" }
-gm - 10 = 10 for m. -4 Let b(j) = 36j - 164. Let y be b(6). Solve -w = 12w - y for w. 4 Suppose -3p = -9p. Let j = -11 - -15. Let c be (j - 4)(-1 + 2). Solve c = -pz - z - 2 for z. -2 Let f = -4 + 9. Suppose -5b = -2b - x - 13, 4b - 2x - 16 = 0. Suppose bz = -5d + 55, 2d + 0z - 32 = -4z. Solve fr + 14 = -d for r. -4 Let u be (42/8)/((-30)/(-80)). Solve -5j = 11 + u for j. -5 Suppose -7o = -40 + 12. Solve ob + 1 = 9 for b. 2 Suppose -82 = -3m + 5n - 5, n = -4. Solve 6 + m = 5v for v. 5 Let i be -9 - (7 + -5 - 13). Solve -4x - ix = -x for x. 0 Let m = 9 + -6. Solve -13 = -mn - 7 for n. 2 Suppose 4z + 14 = 2m, -4m + 0 = -2z - 4. Let b(s) = -s*3 - 2s*2 - 3s - 1. Let q be b(m). Suppose -5n - 1 = 4h, -n = 3n + 4. Solve h + q = o for o. 2 Suppose -3h - 55 = -6h - w, 30 = 2h + 2w. Suppose -h = -21q + 16q. Solve -qz = -2z for z. 0 Let g be -12/(-1) + 2. Suppose -14 = -gt + 2. Suppose 24 = -ti + 8i. Solve -2s + i = 2 for s. 2 Let u be 33/2733. Let z(j) = 17 + 6j + 6j - uj. Let p be z(-11). Solve -pn = -4n for n. 0 Let o be (-3)/(30/4) + (-17)/(-5). Suppose 2g + 5 = or, -2g = 2r - 0g. Solve 3 + r = -s for s. -4 Let c(g) be the second derivative of g5/20 - g4/2 + 5g3/6 + g2 + 8g. Let v be c(6). Let m be v/(-24)(0 + -3). Solve -mo - 1 = -17 for o. 4 Suppose -12 = -n - 3x, 0n + x = -3n + 20. Suppose 0 = d + 4d. Suppose 3s - 4z = n, 5z = -3s - d + 6. Solve 0w - w - s = 0 for w. -2 Let a be (-3)/(1 + 0) + (5 - 4). Let o be a(-3 - 15/(-10)). Solve 3 = ou - 0 for u. 1 Suppose 6t = -2d + 5t - 4, -3d - 12 = 3t. Let q(l) = l*3 + 2l*2 - 4l - 1. Let w be q(-3). Suppose 6j = 5j + w. Solve jc + c = d for c. 0 Let a(v) = 2v*3 - 26v*2 + 48v + 20. Let c be a(11). Solve -j - c = -17j for j. 4 Let s(z) be the first derivative of -z3/3 + 6z*2 - 11z + 2. Let o be s(9). Let x be 0 + 0 + -2 + 6. Solve xh - o = -0h for h. 4 Suppose 2b + 11 + 13 = 0. Suppose -4u - 2g + 0g = 58, 10 = -u - 5g. Let t = b - u. Solve -tk - 3 = 6 for k. -3 Suppose -x + 4x = 66. Let q = 20 - x. Let u be (-1)/q-6 - -10. Solve 20 = 2y - uy for y. -4 Let b be (10(-2)/(-12))/(1/3). Solve -6d + b = -d for d. 1 Let l(f) = -18f2 - 4f. Let h(r) = 12r2 + 3r. Let n(m) = 7h(m) + 5l(m). Let c be n(-1). Let k be (1 + -11)c/14. Solve 0 = -kb + 25 - 5 for b. 4 Let u be 10/(-4)40/(-25). Let a(q) = 2q - 2. Let h(p) = 3p - 5. Let o(y) = -5a(y) + 3h(y). Let d be o(-5). Solve d = -0i - ui + 16 for i. 4 Let k be 1 + 1/1 - -2. Let t(b) = 9b*2 - 52b - 68. Let g be t(7). Solve -f - k = -g for f. 5 Let l(g) = 2g2 - 151g + 367. Let b be l(73). Let o = 1 - -2. Let n = 9 - o. Solve -bt - t = -n for t. 2 Let r be (-2)/(-8)-1(7 - 15). Solve ry = 2 - 4 for y. -1 Let d(h) = 0h + 0h + 3 - 3h3 + 2h*3. Let i be d(0). Let a be ((-60)/20)/(6/(-8)). Solve iz = az for z. 0 Let s = 18 - 16. Suppose -10 = -5p, -38 = -0c - sc - 4p. Let b = 0 + 2. Solve h + bh = c for h. 5 Let f be 12/3 - (-8 - -10). Solve 0 = i + fi for i. 0 Let s be 3/1 + 0/(49/(-7)). Suppose 5j = 47 + 18. Solve j - s = 5l for l. 2 Let i = 22 - 17. Let p(t) = -t3 + 2t + 1. Let n be p(-1). Suppose -4c + 5u = n, 0c = -2c + 3u. Solve c = ix - 3x + 6 for x. -3 Let j be ((-3)/3)/(2/(-10)). Suppose 2m = 2t + 7m + 14, 5t - 27 = 3m. Suppose i = -ti. Solve 0 = -ir + r - j for r. 5 Let i = 32 + -29. Suppose 5m - i = -0w + 3w, -2m = -3w - 3. Let z(s) = s3 + 5s*2 + 3s + 1. Let n be z(-4). Solve ng = -mg for g. 0 Let i(m) be the third derivative of -1/120m6 + 0m + 0m5 + 6m*2 + 1/2m*3 + 0m*4 + 0. Let p be i(0). Solve pj = -0j for j. 0 Suppose 49 = 3z + 5s, s + 4 = -0. Solve -3 + z = -4v for v. -5 Let t(o) = -o*3 - 8o*2 - 17o - 42. Let j be t(-7). Solve j = q + 32 for q. -4 Let m(l) = -2l2 + 3 + 5l*2 - 4. Let b be m(1). Suppose 12 = 4x, -32 - b = -5j - 3x. Solve jh - 6 = 14 for h. 4 Let g(k) = k3 - 9k*2 + 5. Let d be g(9). Let p(u) = 2u - 7. Let q be p(d). Let c = 1 - -2. Solve 0 = cy + q + 6 for y. -3 Let p be ((-18)/4)/(2/4). Let k be (-2)/p33. Suppose kz = -z. Solve -u + 4 = -zu for u. 4 Suppose 4t - 4m + 342 = -6m, -5m = -t - 58. Let c = t + 87. Solve co = 11 + 1 for o. 3 Let l(q) = q*3 - 5q*2 + 6q - 4. Let t be l(4). Solve -3y + 5 = -ty for y. -5 Let x(b) = 16b + 658. Let g be x(-41). Let u = -1 + 2. Solve u = gz - 7 for z. 4 Let g be (67 - 69)6/(-1). Solve -1 = -gk + 59 for k. 5 Let h = -37 + -47. Let b be h/(-7) - 3 - (-1 + 2). Solve -2j = -0j + b for j. -4 Let f be (-6)/(-8) + 45/(-12) + 48. Let i = f - 43. Solve -is = -7s + 10 for s. 2 Suppose 5a - 3a = 20. Suppose -26 = -3h + a. Suppose h = 4c - z, -3c + 28 = c + 3z. Solve 0 = -ci - 2 - 6 for i. -2 Let n be (0 - -1) + (-5)/(-5). Let y be (21/2)/(9/12). Suppose -4g = -y + 6. Solve g = nc + 12 for c. -5 Suppose 27j - 74 = 88. Solve -3 = -t - j for t. -3 Let s(w) = 3w - 3w*2 + 0w - w*3 + 3 - 1. Let c be s(-3). Let h = c - -11. Solve y + y + h = 0 for y. -2 Let k = 3 - 2. Let f(o) = 31o*2 + 495o - 12. Let q be f(-16). Solve -i - k = q for i. -5 Let j(p) be the third derivative of p5/120 - p4/12 - p*3/3 - 4p*2. Let o(y) be the first derivative of j(y). Let z be o(5). Solve 16 - 4 = zh for h. 4 Let w be (1 + 6/(-3))/(4/(-20)). Let j be -15(-5 + (-3)/(-1))/w. Solve x + x = j for x. 3 Let y(l) = -l2 + 17l + 14. Let w be y(0). Solve wa = 16a + 2 for a. -1 Let f(s) = -s*2 - 23s - 57. Let g be f(-20). Solve -5q = -gq + 6 for q. -3 Let s be (74 - 51)/(1 - 0). Solve 6r + 5 = s for r. 3 Suppose j + 7 = -3i, -j + 0j - 1 = -3i. Let d be ((1 - -2) + 7)/i. Let p be ((-9)/(-6))/(-3)d. Solve -23 = -pu - 3 for u. 4 Let n = -730 - -730. Solve n = 14i + 10 + 4 for i. -1 Let c(i) = 11i*2 + 1. Let y be c(-1). Let s be y/9(-21)/(-14). Solve -4 = sv + 2v for v. -1 Suppose -15 = -11n + 6n, 0 = -5i - 5n + 30. Let c be (-25)/(-4) + i/(-12). Solve 3o = 6 + c for o. 4 Let l = 20 - 20. Suppose 8 = b - k, -2 = -b - lb - k. Solve 0 = -bc + 2c + 6 for c. 2 Let o = 15 - 10. Let g = -2 + o. Suppose gx = -3x. Solve n - 2 = -x for n. 2 Let j(f) = f*2 - 7f + 13. Let g be j(3). Solve -2d - 3 = -g for d. -1 Let p(w) = -2w + 14. Let l(d) = -d - 1. Let v(x) = l(x) - p(x). Let z be v(11). Let s be 42/5 - z/(-10). Solve -s = -4g + 4 for g. 3 Let o(p) = -p3 - 3p*2 + 8p + 3. Let m be o(-5). Let x(a) = 26 - 4 + 2 - a. Let j be x(17). Solve -j - m = -5b for b. 4 Suppose -4p - 2m - 10 = 0, -2p + 2m = 3p + 8. Let u be 3/(p - (0/4 - 3)). Solve 5r + u - 18 = 0 for r. 3 Let u = 2 - -5. Let p be 5/206(-8)/(-2). Solve p = 4t - ut for t. -2 Let y(v) be the third derivative of -v5/60 + 5v*4/12 + 4v*3/3 - 12v*2. Let r be y(10). Suppose -1 = g - r. Solve -gb + 3b - 4 = 0 for b. -1 Suppose -12l - 49 = -19l. Solve 0 = lb - 4 + 18 for b. -2 Suppose -w + 4b = -32, -2w + w = 4b + 8. Suppose 12 = 8u - w. Solve uv - 6v - 15 = 0 for v. -5 Let f = -64 - -34. Let o = -53 - -84. Let k = o + f. Solve j - 2 = -k for j. 1 Let b = 58 - 55. Solve -2p = bp + 15 for p. -3 Let d(n) = n + 9. Let p be d(-7). Let b be 3 + -2 + p + (-3 - 0). Solve -4j - j = b for j. 0 Let t = 436 - 434. Solve -4s + 6 = t for s. 1 Let b = 63 - 59. Suppose 5k - b = 16. Solve 25 = -ky - y for y. -5 Let b be -1(48/(-4) + 3). Suppose 0 = 6o - b + 3. Solve -q + o = -3 for q. 4 Suppose 5m + 2m = 217. Let b = -23 + m. Solve -4j + 0 = b for j. -2 Suppose -2f - 3f + 59 = g, 0 = -f + 3g + 15. Let r be 1f(-1)/(-2). Suppose -l + 3l - r = 0. Solve 0 = -u + lu - 8 for u. 4 Let d = -151 + 244. Let f = d + -90. Solve 2 = -5u - f for u. -1 Let h = -22 - -8. Let b = h + 17. Suppose 4s = 6g - 2g, 3 = 4s - bg. Solve -2r = s - 1 for r. -1 Let l(q) = -q3 - q2 + q + 1. Let b(f) = -4f*3 - 10f*2 + 5f + 11. Let m(t) = b(t) - 5l(t). Let v be m(5). Solve -c + v = -3c for c. -3 Let v = 1 - -4. Suppose -13w + 17w + 12 = 2t, 5t + 3 = -w. Solve -v + t = f for f. -5 Let o be (-5)/2(-4)/5. Suppose 2v + 117b - 10 = 112b, 2v - 10 = 5b. Solve -7l = -ol + v for l. -1 Let l(p) = p*2 + 10p. Let f be l(6). Suppose -f = 5*m - m. Let d = m - -30. Solve -n = n + d for n.	{ "pile_set_name": "DM Mathematics" }
y rounded to the nearest 1000000? 0 Let f = 231 + -294. Let b = -110236986.000057 - -110237049. Let i = b + f. What is i rounded to 5 decimal places? -0.00006 Let j = 600.9997264 - 601. What is j rounded to six decimal places? -0.000274 Suppose -32q + 34q + 3y = 456194, 4q + y = 912398. Round q to the nearest 1000. 228000 Let y = 191 - 190.9998822. What is y rounded to 6 dps? 0.000118 Let o(i) = -39481i - 114. Let y be o(6). Round y to the nearest one million. 0 Suppose 0 = -7q + 3q + 2q. Suppose qs + 42000 = -6s. What is s rounded to the nearest 1000? -7000 Let m = -0.579998516 - -0.58. Round m to seven dps. 0.0000015 Suppose 0 = -19v + 18v + 19. Let c = 26 - v. Round c to the nearest integer. 7 Let p = 25 - 25.55. Let m = 0.55 + -1.26. Let w = p + m. Round w to 1 dp. -1.3 Let h = 1.3607 - -1.6438. Let q = -0.0345 + h. What is q rounded to one decimal place? 3 Let a = 3434 - 9154. Round a to the nearest one hundred. -5700 Suppose 5s - 4h - 417 = 0, 3h = 2s + 6h - 153. Suppose 5g + 18 = 3v - s, -3v + 87 = -g. What is v rounded to the nearest 10? 30 Let b = 3.944 + -3.99438. What is b rounded to three decimal places? -0.05 Let q = 0.02138 + -3830.02138. Let h = -3825.994 - q. Let j = h + -4. Round j to 2 decimal places. 0.01 Let h(y) = -y*3 - 22y*2 - 21y + 2. Let m be h(-21). Suppose 5400 = -mx - x. What is x rounded to the nearest one thousand? -2000 Let h = -4.259 - -0.229. Round h to 0 decimal places. -4 Let d = 7.033 - 4.87. What is d rounded to one dp? 2.2 Let v = -2000.98817 + 2001. What is v rounded to two dps? 0.01 Let x = -36827129.00233 + 36826804. Let a = x - -325. What is a rounded to four dps? -0.0023 Let k(j) = 51498j*2 - 24j - 40. Let h be k(-10). What is h rounded to the nearest 100000? 5200000 Let v = 355231659.249219 - 355231376. Let d = 300.64929 - v. Let n = 17.4 - d. Round n to five dps. -0.00007 Let p = 8.3 - 8. Let z = -10.7461762 - -10.44617. Let y = p + z. Round y to 6 decimal places. -0.000006 Let x = -96.899229 + 96.9. Round x to four decimal places. 0.0008 Let w = 1.266 + -0.066. Let x = -0.3 - 1. Let h = x + w. What is h rounded to 0 dps? 0 Suppose 0k + 2y = -5k - 4, 5y + 10 = -k. Let z be k + 4/1 + -560004. Round z to the nearest 100000. -600000 Let b = 25699.87 + -25852. Round b to 0 decimal places. -152 Let d = -0.0936 - -0.14. Let g = d + -0.042. Round g to 3 dps. 0.004 Let r = 54 + -51. Suppose 48100000 = rn + 10n. Round n to the nearest 100000. 3700000 Let g = 166.0909 + 1.2491. Let x = g - 165. What is x rounded to 1 dp? 2.3 Let l = -0.057 + -50.943. Let j = 51.0083 + l. What is j rounded to 3 dps? 0.008 Let t(h) = -6 - 4h - 2 - 4h*2 + 22h*3 + 8h*3 + 9h*3. Let r be t(-8). What is r rounded to the nearest 1000? -20000 Let u = 1.131685 + -0.79162. Let w = 19 - 18.66. Let g = w - u. What is g rounded to 5 decimal places? -0.00007 Suppose -611p + 601p - 240700 = 0. What is p rounded to the nearest 1000? -24000 Let b be (-68)/10 - (-5)/(-25). Let w = 12 + b. Suppose -94012 = -2m + 3q, -wq + 46980 = 2m - m. What is m rounded to the nearest ten thousand? 50000 Let c = 69 + -68.899. Let b = 0.1010087 - c. Round b to 6 decimal places. 0.000009 Let q = 67.88 - 69. Let u = q - -1.11999939. Round u to 7 dps. -0.0000006 Let c = -8391 + 8390.91651. Round c to two dps. -0.08 Suppose -5f + 8 = 4s, -f = -2s - 0s - 10. Let u be 1(s - (852012/1)/(-4)). Round u to the nearest ten thousand. 210000 Suppose 5u - 551 = 3y + 1215, 2y + 1199 = -u. What is y rounded to the nearest one hundred? -600 Let j = -1469 + 1469.0019074. What is j rounded to five decimal places? 0.00191 Let l = 332.6 + -373. Round l to the nearest ten. -40 Let f(z) = -253z*2 - 11z - 36. Let c be f(11). What is c rounded to the nearest one thousand? -31000 Let s = -187.5025301147 - -3.3025291117. Let n = -184.2 - s. Round n to 7 dps. 0.000001 Let m = 116.106 + -116. Let g = 0.937 - 1. Let j = g + m. Round j to two dps. 0.04 Let k be -1007 + -6(-5)/15. Let t = -2095 + k. Round t to the nearest 1000. -3000 Suppose -2n = -4r + 40, n = 2r + 3n - 8. Let g be (-1659)/(-12) - 2/r. Round g to the nearest 10. 140 Let k(l) = l3 + 2l*2 - l + 1. Let v be k(-3). Let i = 9 + v. Suppose p = 4p - 3h - 10199991, ip + h = 13600003. What is p rounded to the nearest 1000000? 3000000 Let w = 68321675.000073 - 68321555. Let v = -120 + w. Round v to five decimal places. 0.00007 Let p = 66 + -64.96. Let n = 0.944 - p. Round n to two decimal places. -0.1 Let h = -912.478 - -910. Round h to 1 decimal place. -2.5 Let k(q) = -q*2. Let c(t) = 532t*2 + 2t. Let d(g) = -c(g) + 6k(g). Let m be d(-4). Round m to the nearest one thousand. -9000 Let d(s) = 18s*3 - 2s*2 + 1. Let a be d(1). Suppose -18z - 900 = -az. What is z rounded to the nearest 100? -900 Let j = -1.3599287 + 1.36. Round j to 6 decimal places. 0.000071 Let l(b) = b2 + 15b - 7. Let p be l(-16). Let n be (-1753)/p - 2/9. What is n rounded to the nearest ten? -200 Let i = 288 - 288.000000216. Round i to 7 decimal places. -0.0000002 Suppose 0 = 8y - 174489 - 247911. Round y to the nearest one thousand. 53000 Let m = 292784648.2000303 - 292784602. Let b = m - 46.2. Round b to 6 decimal places. 0.00003 Let t = 67753.48915 + 207284.19995. Let a = t + -275015. Let c = -22.7 + a. Round c to three decimal places. -0.011 Let m = 64.994 - 0.394. Let l = m + -72. What is l rounded to zero dps? -7 Let k = 18480 - 18480.10341. What is k rounded to 2 decimal places? -0.1 Let n = -3598 - -3598.011544. What is n rounded to 4 decimal places? 0.0115 Let w = -4.5187 - -4.045. What is w rounded to two dps? -0.47 Let d = -5.285 + 5.6. Let z = d + 1.715. What is z rounded to one decimal place? 2 Let l = 1365961.9839 - 1365725. Let q = -237 + l. What is q rounded to 3 decimal places? -0.016 Let k(j) = 943j*3 - 21j*2 - 26j + 38. Let i be k(19). What is i rounded to the nearest 1000000? 6000000 Let a = -19.2 - -19.199999971. What is a rounded to seven decimal places? 0 Let p = -2235.02187 + 2235. What is p rounded to four decimal places? -0.0219 Let d = 17665874 - 17822886.573. Let n = 157008.57299897 + d. Let o = n + 4. Round o to 7 decimal places. -0.000001 Let i(n) = n*2 + 8n - 14. Let q be i(-10). Let u be 131982/q + (0 - -3). Round u to the nearest 10000. 20000 Suppose -16n = -20n. Suppose -4d = -4k - 6040, -d + 3020 = -nk - 2k. What is k rounded to the nearest 100? -1500 Let w be (2/(-4))/(1/(-8)). Suppose -5v - 11000025 = -0n + 2n, -5v = wn + 22000025. What is n rounded to the nearest 1000000? -6000000 Let f = 85.9 - 85.900001497. Round f to seven decimal places. -0.0000015 Suppose c - 4 - 27 = -5t, -5t = -c + 1. Suppose 15n + 44600000 = cn. What is n rounded to the nearest 1000000? 45000000 Let v = 23 + 3. Let g = v - 26.014. Round g to 2 dps. -0.01 Let l = 70 + -29. Let x = -40.994 + l. Round x to three decimal places. 0.006 Let l = 7 + -11. Let z be (l + 12)7/2. Let v be 2 + z/4-34286. Round v to the nearest 100000. -200000 Suppose 0o + 4o + 3g - 3 = 0, 2g = -6. Suppose 5f + 33003 = -q, f + q + 6594 = oq. What is f rounded to the nearest 1000? -7000 Suppose 0 = -c + 2c - 6. Let v be (1 + (-1078)/c)600/(-32). What is v rounded to the nearest 100? 3400 Let w = 524 + -241. Suppose t - o - 3o = -w, 0 = -4t + 4o - 1096. What is t rounded to the nearest ten? -270 Let s = 30487.12837 + -30487. Let o = 0.001602 + s. Let k = o + -0.13. Round k to 5 dps. -0.00003 Let p(i) = -3i2 - 11i - 6. Let r be p(-4). Let c be (-6)/r + 94491/15. Round c to the nearest one thousand. 6000 Suppose 0 = 17c - 65489471 - 249180529. Round c to the nearest one hundred thousand. 18500000 Let y = -100 - -111. Suppose 3011769 = -yd - 3368231. Round d to the nearest 100000. -600000 Let o = 14994960 - 14994966.0000006. Let g = -6.11 + 0.11. Let p = o - g. What is p rounded to 6 dps? -0.000001 Let f = 1873.79 - 1865. Let p = f + 0.81. Round p to the nearest integer. 10 Let k(z) = -962z + 4. Let n(i) = -963i + 4. Let t(g) = -3k(g) + 4n(g). Suppose 33 - 15 = -3m. Let r be t(m). What is r rounded to the nearest one thousand? 6000 Let q = -17.03 + 43.37. What is q rounded to the nearest 10? 30 Let p(v) = -5842854v - 22. Let d be p(7). Round d to the n	{ "pile_set_name": "DM Mathematics" }
)/(-75)). Solve 0 = -uz - 110 + 130 for z. 1 Suppose -3x + 4a = 2x + 37, -3a = 4x + 11. Let y(h) = 2h + 11. Let p be y(x). Solve -u + 0 = p for u. -1 Let q = -6416 - -6438. Solve -q - 34 = 14i for i. -4 Suppose -2814 = 5t + 16t. Let f = -131 - t. Let i be ((-7)/(-3))/(2/6). Solve -i = -2y - f for y. 2 Let l = 173 + -164. Suppose 0 = -la + 7a. Solve a - 1 = k for k. -1 Suppose 3m + 1753r = 1750r + 93, 3 = 3r. Solve -m = -119s + 124s for s. -6 Suppose 0 = -4n - 3v + 249, -2n + 4v = v - 147. Solve 0 = -48f + 59f + n for f. -6 Let h = -8776 + 8794. Solve 31c = 22c + h for c. 2 Suppose 0 = -4i - 3 - 21, -5b = 2i - 73. Solve 0 = -24n + bn + 21 for n. 3 Let x(l) be the first derivative of -37l2/2 - 140l + 175. Let m be x(-4). Solve 0 = mf - 13f - 5 for f. -1 Let k(z) be the third derivative of 2z4/3 - 46z*3/3 + 111z*2 + 2z. Let i be k(6). Solve 0 = -2x - ix for x. 0 Let f = 83 + -75. Let q be (f/6 + 10/(-12))0. Suppose 1 = 3u - 2, -3i - 5u + 20 = q. Solve 3k = -2k + i for k. 1 Suppose -1635 = -116u + 1729. Solve -20 + u = -3a for a. -3 Let a be 4/(-7) - (-26390)/1421. Solve m = a - 21 for m. -3 Suppose -5b + 400 = u, 99 = 4b + 5u - 221. Solve 0 = bw - 77w + 6 for w. -2 Suppose r - 4218 = 5y, 0 = -2r + 5r + 2y - 12552. Solve -4193a = -ra + 30 for a. -6 Let p(n) = -n3 + 12n*2 + 2n - 20. Let t be p(12). Suppose 94 = -tz + 126. Solve 49w + z = 47w for w. -4 Suppose 108i - 658 - 62 = -72i. Suppose 0s + 4x + 23 = -3s, 0 = x + 5. Let t = s - -1. Solve -i = d - t for d. -4 Let d = -5540 - -5595. Solve d = 70n - 59n for n. 5 Let p be (-2 - (-126)/8)-4. Let h be 0 - ((1/(-1) - -3) + 9). Let k be 16/5 - h/p. Solve -kn + 4 = n for n. 1 Suppose 110 = 3r - 2n, 5r - 200 = -n - 8. Solve 0 = rm - 33m + 25 for m. -5 Suppose 8c + 115 = 6c + 7c. Solve 2 = ca - 25a for a. -1 Let f be 139 - -4(-22)/(-8). Solve -65 = 163t - ft for t. -5 Let g(b) = -b3 + 8b*2 + 2b + 1. Let c be g(8). Let q be -373567/(-30150) + (26/(-20) - -1). Solve 23 = -qo - c for o. -5 Suppose -65z + 3094251 - 3093991 = 0. Let r(v) = v2 - 2v - 2. Let p be r(4). Solve zq + pq = -20 for q. -2 Let m be 84/252(3 + 31 + 2). Suppose 0 = i + 3i - 20. Solve 2c = ic - m for c. 4 Let i(j) = -8j + 54. Let v be i(6). Solve -14q - vq = 120 for q. -6 Let n(o) = -o2 - 5o - 3. Let x be n(-2). Suppose -3g - 9 = -xv, -2v - 2g = 3v - 22. Solve 7i = 8i + v for i. -4 Let o(w) = 3w*3 - 26w*2 + 11w - 164. Let a be o(9). Solve ak + 91 = 29k for k. 7 Let z = -969 - -984. Solve -7a - 29 + z = 0 for a. -2 Let b = 8293 + -8166. Solve 0 = -14p - 43 + b for p. 6 Let g(t) = -t*3 + 24t*2 + 17. Let r be g(24). Suppose 0 = -4a - 9 + r. Let m(w) = w - 6. Let c be m(18). Solve az + 2z = c for z. 3 Let l be 4 + 2 + 84 + (4 - 0). Solve -l = -11k - 39 for k. 5 Let c be 136/(-10) + (1 - 7/5). Let u(q) = -q - 26. Let w be u(c). Let y = -12 - w. Solve y = 3v + 2v - 5 for v. 1 Let k = 31819 + -31443. Solve k = 31d + 16d for d. 8 Let y = 155 - 153. Suppose -c + s = -17, -2c = ys - 14 - 4. Solve 0 = 2i + 3 - c for i. 5 Suppose 10h - 3 = 17. Suppose 0 = w + 4a, -hw - a = -w - 9. Suppose wx - 4x - 32 = 0. Solve xl - 2l = -6 for l. -3 Let h = 212 - 194. Suppose -s = -h - 7. Solve 7q = 2q - s for q. -5 Suppose d + 4b - 45 = 0, -d - 60 = 3b - 100. Solve -dg = 8g + 264 for g. -8 Let x(k) = 3k3 + k2 + 10. Let j = 78 + -75. Let n be x(j). Suppose 2y - n = -8y. Solve 4h + y = 2h for h. -5 Let t(b) = -2b2 - 67b + 108. Let v be t(-35). Let n = -16 + 24. Let l(p) = p*2 + 37p + 7. Let x be l(0). Solve xh = nh + v for h. -3 Suppose -3v - 4j + 55 = 0, -3j = -v + 19 + 21. Solve -31f - 12 = -vf for f. -2 Suppose 5u - 3 = -8, 0 = -2v - u + 2257. Suppose -v = -12t - 1105. Let k be 1/3 - (-3)/(-9). Solve -tc - 8 = -k for c. -4 Let l = -8450 - -8453. Solve -2t - l + 7 = 0 for t. 2 Suppose 4h - 5h = 2o - 6, 2h = 5o - 33. Suppose 0 = -2z + q - 1, -z + 6q - oq - 1 = 0. Suppose z = 2x + 2x - 12. Solve xs = 5s for s. 0 Let v(q) = -9q - 31. Let z be v(12). Let g = z - -142. Solve -m + gm - 8 = 0 for m. 4 Suppose n - 97 = -15. Let u = 971 - 1051. Let k = u + n. Solve 0j + 6 = kj for j. 3 Suppose -2a - 5k = -3a, 3a - 5k = 0. Let o be 10 + (a + -2 - 1). Suppose -3u + 8 - 19 = c, 2u = -3c + 2. Solve o = -cd + 27 for d. 5 Let m(h) = h3 + 6h*2 + 8. Let y be m(-3). Let x be (-126)/y(40/(-3))/1. Let a = -31 + x. Solve 4p - a = -1 for p. 4 Let s(j) = 21 + 4 - j + j + j. Let q be s(0). Suppose -29g + qg = -20. Solve 6 = -gc + 3c for c. -3 Let w be (1 + 27)/(-7) + 33. Solve 0 = 21k + 8 - w for k. 1 Suppose 0 = -21b + 15b + 36. Suppose 4y - b = 3y. Solve 9k + 9 = yk for k. -3 Let a(p) = -p*2 + 10p - 8. Let m be a(7). Suppose g - 4b = m, -5b - 26 = g - 3g. Suppose 5w - 32 = z, z + 109w - 115w = -39. Solve zo - g = -4 for o. 3 Let h be (1/(-2))/(1/2)-3. Suppose 4o + l = 4l + 10, -4l + 8 = 0. Suppose 2j + 3 = -or + 5j, 0 = -4r - 3j + 27. Solve -2p + r = -h for p. 3 Let j be ((-5)/4)/(1/(-4)). Suppose -835 = -u - 804. Suppose -2 - 3 = 5r - 3y, 5y = -3r + u. Solve -rv - 12 = -jv for v. 4 Let h be 9 + (-9)/(63/(-14)). Suppose 0 = hc + c - 192. Solve 6k = 2k - c for k. -4 Let g = 117 + -115. Suppose a + 3 = -g. Let j(i) = 5i + 30. Let s be j(a). Solve su + 3 = 23 for u. 4 Suppose -q - 4p - 171 = 0, -3q - 4p - 531 = -p. Let d = q - -221. Solve 3i + 57 - d = 0 for i. -5 Let f(x) = -31x + 168. Let q be f(5). Let c be ((-13)/q)/((-2)/20). Solve 14n - cn - 12 = 0 for n. 3 Let l = -71 - -72. Let z(g) = 15g + 3. Let u be z(l). Let d be ((-8)/12)/(2/(-15)). Solve ds - u = 2 for s. 4 Let v be 24/15 + -2 - 46/(-115). Let u be (-24)/(-9)(-3 + 2 + 4). Solve v = -13y + uy - 10 for y. -2 Suppose -23y = -22y - 50y + 19404. Solve 52c + y = 8c for c. -9 Let s(w) = w3 - 26w*2 - 30w + 90. Let l = -370 - -397. Let f be s(l). Solve -1 = fb + 8 for b. -1 Let n be 5 + (-4)/1 - (11 - 25). Let r be (30/9)/((-10)/15). Let a be 4/(60/(-9))r. Solve 0s = -as + n for s. 5 Suppose -3j = -2j - 5. Suppose 0 = -r + jr. Suppose 2t - 4u + 3 = -3u, r = t - 2u + 6. Solve t = -f - f + 10 for f. 5 Let a(f) = f2 + 4f + 14. Suppose -t - c - 2 = 0, 2 = -2t - 2t - c. Let z be a(t). Solve 29 - z = -5v for v. -3 Let r(l) = l2 - 11l + 5. Let j be r(16). Suppose -jm + 69m = -96. Solve 3a - ma = 2a for a. 0 Suppose 0 = z - 4z - 12, -l - 2z = 2. Let h(c) = c - 4. Let j(t) = 3t*2 + t - 4. Let f be j(2). Let v be h(f). Solve -v = 4a - la for a. 3 Let h(q) = 4q + 509. Let b be h(-101). Solve -480r + 465r = b for r. -7 Suppose -20 = 2w + 28. Let c be (w/30 - -1) + (-27)/(-15). Let o(t) = -t3 + t2 + 2t + 1. Let b be o(2). Solve 5 = cl + b for l. 2 Suppose 3k = 2p + k + 156, -3p = -4k + 239. Let a(f) = -76f3 + f2 - 1. Let w be a(-1). Let o = w + p. Solve 0 = 3t - 6t - o for t. -1 Let q = -422 + 438. Suppose -5l - 3t + 4 = 0, -17t = -4l - 13t + q. Solve 0 = -ln - 2 - 6 for n. -4 Suppose -o + 4j + 23 = 0, 8o + 2j = 3o + 5. Suppose -2k - 12 = -5x, 2k - 3x + 16 = ok. Let i be -12(9/(-12))/1. Solve -y = -ky + i for y. 3 Let s be 14/(-119) + 516/51. Suppose 5h = 15 + s. Suppose 31 = 9u - 41. Solve hj + 17 = -u for j. -5 Let m = 192 - 143. Let g be (-42)/m + 450/35. Solve k = 4k + g for k. -4 Let y = 4 - 1. Suppose -4b = 2v + 8, -b + 7 = 2v + y. Solve 2 = -vf - 10 for f. -3 Let q(l) = l2 - 17l + 38. Let o be q(23). Let k = -170 + o. Solve -2b - k + 0 = 0 for b. -3 Let s = -790 + 546. Let g = s - -247. Solve 0 = -gk + 5k + 8 for k. -4 Suppose 80 - 10 = -5t - 20. Let y(b) = b*3 + 3b*2 - 5b. Let n be y(-4). Let p be t(n/(-2))/(-1 - -4). Solve 3f = -f + p for f. 3 Let f(h) = h*3 - 9h*2 - 7h - 35. Let a be f(12). Suppose -28 = -11u + a. Solve 32t = ut + 5 for t. 5 Let s(j) = j - 1. Let l = 16 + -11. Let p be s(l). Let i be (-35 + 35)/((-2 - -3)3). Solve py - y = i for y. 0 Suppose 0 = 4h - 3c - 0c + 211, 186 = -4h - 2c. Let a = h + 85. Suppose 4k + 12 = a. Solve -kp - 6 = -4p for p. -3 Suppose 4c + m + 2 + 2 = 0, -c - 16 = 4m. Solve -3f + c*f - 9 = 0 for f. -3 Let j =	{ "pile_set_name": "DM Mathematics" }
t(r) be the first derivative of -r*4/18 + 8r*3/27 + 19r*2/9 + 28r/9 - 162. What is j in t(j) = 0? -2, -1, 7 Suppose 264q - 75/2q*4 - 312q*2 + 3q*5 - 72 + 162q*3 = 0. What is q? 1/2, 2, 6 Let s(x) be the first derivative of -5x*6/2 + 141x*5/5 - 207x*4/2 + 128x*3 - 48x*2 - 639. What is l in s(l) = 0? 0, 2/5, 1, 4 Let q be ((-26)/(-3))/((12/109)/(-3)). Let j = 237 + q. Factor -jy*3 + 1/3 - 3/2y + 2y2. -(y - 1)2(5y - 2)/6 Let v(u) be the third derivative of u5/210 - 31u*4/42 + 961u*3/21 - 142u*2. Factor v(h). 2(h - 31)*2/7 Let g = 11885/26088 + 3/1087. Let x = 7/8 + g. Factor -xt*3 + 2t*2 + 1/3 - 4/3t + 1/3t4. (t - 1)4/3 Let c(j) be the second derivative of -j4/12 - 9j*3 + 55j*2/2 - 81j. Factor c(r). -(r - 1)(r + 55) Suppose -6 = -p + 4. Factor 17k - 2k3 - 15k - pk - 10k*2. -2k(k + 1)(k + 4) Let q(g) = -2g + 33. Let v be q(14). What is k in 10k*2 + k - 3k - 2k - 18k*2 + 8k*4 + 4kv = 0? -1, 0, 1 Let n(l) be the third derivative of l5/60 + 25l4/24 - 13l*3/3 - 2l*2 + 30l. Find r, given that n(r) = 0. -26, 1 Let d = -23308/9 + 2590. Find q such that 0q2 + dq*4 + 0q + 0q3 + 0 = 0. 0 Let o(m) be the third derivative of 1/8m*4 + 0 + 0m + 0m3 + 1/10m*5 + 1/40m*6 + 8m*2. Factor o(y). 3y(y + 1)2 Solve 12998v*4 - 24v + 6v3 + 1 - 12996v*4 - 1 - 8v*2 = 0 for v. -3, -2, 0, 2 Let j(c) be the second derivative of -2c*2 + 2c3 + 0 - c4 + 23c + 1/5c*5. Factor j(q). 4(q - 1)*3 Let o be (-2)/(-8) + (1 - (-552)/(-448)). Let f(y) be the second derivative of -oy*7 + 0 - 6y + 0y2 + 0y*5 + 0y*4 + 0y*3 + 1/20y*6. Factor f(p). -3p*4(p - 2)/4 Let o = -2416 - -2416. Factor 2/3f3 - 5/3f*4 + 0f + of2 + 0. -f3(5f - 2)/3 Suppose -11h - 120 = -120. Let h + 1/4o2 - 1/4o = 0. Calculate o. 0, 1 Let k be (-1 + 1)/(216/(-54)). Factor v + k - 1/2v2. -v(v - 2)/2 Let x(h) be the first derivative of 0h2 - 1/16h*4 + 52 + 0h - 1/4h3. Factor x(k). -k2(k + 3)/4 Let u(x) be the first derivative of -x*3/4 - 39x*2/8 - 27x + 394. Let u(q) = 0. What is q? -9, -4 Let m(c) be the second derivative of -c*3/6 + 15c*2/2 + 12c. Let u be m(15). Factor -3/7 + ut + 3/7t*2. 3(t - 1)(t + 1)/7 Let y(t) = 12t + 4t3 - 5t*3 - 4t*3 + 29t*2 - 8 - 2t. Let x(r) = -3r3 + 19r*2 + 7r - 5. Let a(p) = -8x(p) + 5y(p). Factor a(z). -z(z + 1)(z + 6) Let j(n) = n3 - n2 - 1. Let a = -33 + 12. Let x = 23 + a. Let z(d) = -10d3 + 11d*2 - d + 11. Let c(m) = xz(m) + 22j(m). Factor c(r). 2r(r - 1)(r + 1) Let t(s) be the second derivative of s*4 - 35s*3/2 + 201s*2/2 - 2s. Let k(p) = -3p2 + 26p - 50. Let n(b) = -9k(b) - 2t(b). Solve n(u) = 0 for u. 4 Let w(h) be the third derivative of 0h4 + 0 - 1/1050h*7 - 7h*2 + 0h*3 + 0h*6 + 1/300h*5 + 0h. Find g such that w(g) = 0. -1, 0, 1 Factor 0j + 18633j*2 + 0j - 2j3 - 18581j*2. -2j*2(j - 26) Let k(a) = -41a2 + 527a - 15571. Let y(q) = 13q2 - 174q + 5190. Let d(b) = -6k(b) - 19y(b). Factor d(f). -(f - 72)*2 Let v(j) be the first derivative of 0j2 - j4 + 2/5j5 + 0j*3 - 19 + 0j. Factor v(a). 2a3(a - 2) Let h(m) be the first derivative of -10m2 + 5/4m4 + m5 + 40m + 12 - 10m*3. Factor h(g). 5(g - 2)(g - 1)(g + 2)*2 Factor -63j*2 - 117j*2 + 378j*3 - 12j + 18j + 18j - 147j4. -3j(j - 2)(7j - 2)2 Let x = -83 + 47. Let d = x + 145/4. Factor -1/4b + db3 + 0 + 0b*2. b(b - 1)(b + 1)/4 Suppose 13f = 30f. Let u(x) be the third derivative of 1/24x*4 + f - 1/30x*5 + 0x*3 - 2x*2 + 0x + 1/120x6. Let u(t) = 0. What is t? 0, 1 Suppose 21 = j + 2j - 3d, 0 = 3j + 5d - 13. Factor -8v - jv + 6v - 5 - 2v - 5v*2. -5(v + 1)*2 Let n(w) be the first derivative of 15w*3 + 9w*4 + 6w*2 - 12/5w*5 - 2 + 0w. Factor n(h). -3h(h - 4)(2h + 1)*2 Let c be 3/(6/16) + -45 + 2233/58. Suppose 0 = -6v + 4v. Factor v - cp + 9/4p2. 3p(3p - 2)/4 Let f be (-2)/(-5)(-2 - 203). Let c = 250/3 + f. Factor 1/3w*2 + cw + 4/3. (w + 2)*2/3 Suppose 0b = 3b - 2l - 2, -b + 10 = 4l. Factor 8q*b - 4q*3 - 10q*2 + 0q*2 + 3q + q*5 + 0q*3 + 2. (q - 2)(q - 1)(q + 1)3 Find w such that 23w*2 + 20w*2 + 16w - 39w2 = 0. -4, 0 Suppose -2u + 9 = -1. Find g such that u + 32g + 2g*2 + 8g*2 + 54g*2 - 1 = 0. -1/4 Let k be (3 - (-88)/(0 + -8))/(14/(-12)). Solve -ky*4 + 0 + 3/7y - 24/7y2 + 54/7y*3 + 15/7y*5 = 0 for y. 0, 1/5, 1 Let b(c) be the first derivative of -2/21c*3 + 1/35c*5 + 9/7c - 6/7c2 - 4 + 1/7c*4. Let b(j) = 0. Calculate j. -3, 1 Let -23/5z*2 + 71/10z*3 + 1/10z*5 + 0z + 0 - 13/5z4 = 0. Calculate z. 0, 1, 2, 23 Suppose -98p + 1689 = 1689. Suppose -1/4t3 - 3/4t*2 + p - 1/2t = 0. Calculate t. -2, -1, 0 Factor -2o2 + 355 - 10o + 4o2 - 347. 2(o - 4)(o - 1) Let y(l) be the second derivative of 3l*5/10 + 31l*4/4 + 43l*3/2 + 21l*2 - 505l. Solve y(n) = 0 for n. -14, -1, -1/2 Let n(i) be the first derivative of i3/9 + i2/2 - 4i/3 - 18. Factor n(g). (g - 1)(g + 4)/3 Let b(d) = 2d2 + 2d - 1. Let n(p) = 11p2 + 6p + 10. Let i(m) = 6b(m) - n(m). Factor i(j). (j - 2)(j + 8) Let r(p) be the first derivative of -3p5/160 + p3/16 - 7p - 10. Let n(z) be the first derivative of r(z). Solve n(b) = 0. -1, 0, 1 Factor -44/9 + 2/9h2 - 2h. 2(h - 11)(h + 2)/9 Let k = -6206 + 12413/2. Solve -3/2d + kd*2 + 1 = 0. 1, 2 Let t(i) be the third derivative of 363i*5/40 + 77i*4/4 + 49i*3/3 - 338i*2. Factor t(b). (33b + 14)*2/2 Factor 3a + 5214a2 - 2609a*2 + a - 2607a*2. -2a(a - 2) Let k(b) be the second derivative of b7/84 - b6/20 + b5/20 - 127b. Solve k(s) = 0 for s. 0, 1, 2 Let h be ((-6)/9)/((-12)/(-18)). Let a be (1 + 15/(-12))h. Factor 0 + 1/2v - av2 - 1/4v*3. -v(v - 1)(v + 2)/4 Suppose -133/2q*2 - 38q*3 + 3/2q*4 + 0 - 27q = 0. What is q? -1, -2/3, 0, 27 Let z be -27(-9)/(-108)11/(-21). Let m = z + -3/7. Factor 0d - d2 + md*4 + 0 - 1/4d*5 + 0d3. -d2(d - 2)2(d + 1)/4 Suppose 5p = a - 15, 0 = -2a + 3p + p + 60. Let g be -2 + a/15 - 0. Factor 2j*4 + gj*5 + 2j*3 + 0 + 0j + 2/3j2. 2j*2(j + 1)*3/3 Suppose 4 + 2 = 3s. Let t be (-61)/(-671) + (-1327)/(-44). Determine a, given that -9/4a - 1/2 - 6a*4 + 13/2a*s + ta*3 - 28a5 = 0. -1, -1/4, 2/7, 1 Let b(t) be the second derivative of -t9/52920 - t8/11760 - t7/8820 - t*4/6 - 12t. Let m(j) be the third derivative of b(j). Factor m(y). -2y2(y + 1)2/7 Let d(n) be the first derivative of -n5/90 + n*4/9 + 11n*2/2 - 13. Let m(c) be the second derivative of d(c). Factor m(r). -2r(r - 4)/3 Let f be 210/45(-3(-185)/315 - 1). Factor 16/9q + 2/9q2 + f. 2(q + 4)*2/9 Let s be ((-30)/28)/(18/(-7)). Let m(k) be the second derivative of sk*3 - 2k - 1/6k4 - 1/4k*2 + 0. Suppose m(z) = 0. Calculate z. 1/4, 1 Suppose 0t + 8 = -j - 4t, t + 2 = 4j. Factor 8r2 - 16r - 4r3 + jr*2 + 12r. -4r(r - 1)*2 Let k be -1 - (-11)/2 - (-2 + 5). Let p(t) be the first derivative of kt + 1 + 1/6t3 + t2. Factor p(d). (d + 1)(d + 3)/2 Let g(r) be the second derivative of -r*6/315 - 2r5/105 - r4/63 + 4r3/63 + r2/7 + 44r. What is s in g(s) = 0? -3, -1, 1 Suppose 4j3 + 0 + 2/3j*5 + 2/3j + 8/3j2 + 8/3j*4 = 0. Calculate j. -1, 0 Suppose -985c + 1967c = 949c + 66. Factor 3/2bc + 2b*3 + 1/2b*4 - 2 - 2b. (b - 1)(b + 1)(b + 2)2/2 Let s(t) be the third derivative of -t6/540 + t5/27 - t4/4 + 2t3/3 + 5t*2. Suppose s(x) = 0. What is x? 1, 3, 6 Suppose -7 = -10l + 3l. Suppose -3u + 1 = l. Solve 3/7h4 + 3/7h*3 + uh*2 + 0h + 0 = 0 for h. -1, 0 Let w(z) be the second derivative of z6/480 + z5/120 + z*4/96 + 4z*2 - 17z. Let x(q) be the first derivative of w(q). Factor x(h). h(h + 1)2/4 Suppose -4t + 24 = 0, 2t = s - 3 + 13. Factor -3/7b*3 + 3/7b*s + 0 + 6/7b. -3b(b - 2)(b + 1)/7 Determine t, given that -3t*3 - 11t*3 - 9t*3 - 310t - 145t2 + 29t3 - t3 = 0. -2, 0, 31 Solve -152a2 - 7 + 7 + 148a*2 - 20a = 0. -5, 0 Let z(a) be the second derivative o	{ "pile_set_name": "DM Mathematics" }
36889, -36892? -36895 What is next in -40129, -40130, -40131? -40132 What is the next term in 147, 673, 1511, 2655, 4099, 5837, 7863? 10171 What is next in -124, -74, 4, 122, 292, 526, 836? 1234 What comes next: -3681, -7367, -11053, -14739, -18425, -22111? -25797 What comes next: -5415, -21648, -48703, -86580, -135279, -194800? -265143 What comes next: 622, 592, 502, 322, 22, -428, -1058? -1898 What is the next term in -146, -340, -534, -728? -922 What is next in 3756, 3758, 3760, 3762, 3764? 3766 What is next in 4350, 17398, 39148, 69600, 108754, 156610, 213168? 278428 What is next in -648, -727, -930, -1317, -1948, -2883? -4182 What is next in 1393, 1859, 2325, 2791, 3257, 3723? 4189 What comes next: -2369, -2476, -2617, -2810, -3073, -3424? -3881 What comes next: -188951, -188953, -188955, -188957, -188959? -188961 What is next in 185, 723, 1577, 2741, 4209, 5975? 8033 What comes next: -424, -1706, -3854, -6874, -10772? -15554 What is next in 2095, 8213, 18361, 32545, 50771, 73045, 99373, 129761? 164215 What is next in -434, -600, -766, -932? -1098 What comes next: 812, 3250, 7312, 12998, 20308? 29242 What is the next term in -3597465, -7194930, -10792395, -14389860? -17987325 What is the next term in -2736, -10951, -24644, -43815, -68464, -98591? -134196 What is next in 11195, 11244, 11309, 11396, 11511, 11660, 11849? 12084 What is next in 87, 162, 237, 312, 387? 462 What is the next term in 318, 1379, 3148, 5625, 8810? 12703 What comes next: 3715, 3721, 3727, 3733, 3739, 3745? 3751 What is next in -1374529, -1374528, -1374527, -1374526, -1374525? -1374524 What is next in 3518, 3564, 3664, 3836, 4098? 4468 What is next in 68890, 551028, 1859690, 4408138, 8609634, 14877440? 23624818 What comes next: -7255, -7196, -7029, -6700, -6155, -5340? -4201 What is the next term in 317563, 317572, 317583, 317596, 317611? 317628 What is the next term in 127, -228, -1543, -4298, -8973, -16048, -26003? -39318 What is next in 263744, 263746, 263748, 263750, 263752? 263754 What is the next term in -476161, -476164, -476167, -476170, -476173? -476176 What comes next: 48087, 96173, 144259, 192345, 240431? 288517 What is the next term in -16693, -16701, -16711, -16723? -16737 What comes next: -12545, -12533, -12515, -12491? -12461 What comes next: 538, 1169, 1822, 2497, 3194, 3913? 4654 What is next in -87, -61, -61, -99, -187, -337, -561, -871? -1279 What comes next: -60249, -60253, -60257, -60261, -60265? -60269 What comes next: 8, 142, 284, 434, 592, 758? 932 What is next in 183, 737, 1659, 2949? 4607 What is the next term in -5491, -10978, -16455, -21916, -27355, -32766, -38143? -43480 What is the next term in -2067, -8362, -18855, -33546? -52435 What is the next term in 101, 187, 269, 347, 421? 491 What is next in -109095, -436379, -981843, -1745481, -2727287, -3927255? -5345379 What comes next: -18193, -17880, -17553, -17206, -16833, -16428, -15985? -15498 What comes next: 1397, 11249, 37995, 90083, 175961, 304077? 482879 What comes next: -551437, -551434, -551429, -551422? -551413 What is next in -3, -9, 49, 225, 573? 1147 What comes next: 4014, 6864, 9714, 12564, 15414? 18264 What is next in 7959, 7918, 7877, 7836, 7795, 7754? 7713 What is the next term in -21435, -42858, -64273, -85680? -107079 What is next in 2931, 2914, 2897? 2880 What is the next term in -7620, -7556, -7510, -7488, -7496, -7540, -7626? -7760 What is the next term in -4942, -19783, -44522, -79159, -123694? -178127 What is the next term in -4261, -8513, -12765? -17017 What comes next: -896, -3563, -8014, -14249, -22268, -32071, -43658? -57029 What comes next: 521, 995, 1431, 1823, 2165, 2451? 2675 What is the next term in -360, -676, -898, -978, -868, -520? 114 What is next in 2287982, 4575961, 6863940? 9151919 What is next in -19019, -19009, -18999? -18989 What comes next: -395, -466, -367, -14, 677, 1790, 3409? 5618 What is the next term in 674, 455, 236, 17, -202? -421 What comes next: -172, -147, -106, -49, 24? 113 What comes next: 1326097, 2652192, 3978287? 5304382 What is next in -597, -594, -591, -588, -585? -582 What is next in 2, 62, 166, 314? 506 What comes next: -71, -185, -349, -569, -851, -1201, -1625, -2129? -2719 What is the next term in -1171, -2341, -3511? -4681 What comes next: -643, -690, -737, -784, -831, -878? -925 What comes next: 49286, 49417, 49548? 49679 What is next in -517, -1058, -1609, -2170, -2741, -3322, -3913? -4514 What is next in 35, -132, -309, -496? -693 What comes next: -24139, -24154, -24185, -24238, -24319? -24434 What is next in -3738, -14895, -33492, -59529? -93006 What is the next term in -724, -447, 320, 1823, 4308, 8021, 13208, 20115? 28988 What is next in 112897, 112899, 112905, 112915, 112929, 112947, 112969? 112995 What is next in -36, -321, -798, -1461, -2304, -3321, -4506, -5853? -7356 What is next in -4241, -4258, -4293, -4352, -4441, -4566, -4733? -4948 What is next in 1, 4, 3, 4, 13? 36 What is the next term in -1915, -1912, -1909, -1906? -1903 What is the next term in 228304, 228303, 228302, 228301, 228300, 228299? 228298 What is the next term in -819, -6484, -21867, -51828, -101227, -174924, -277779, -414652? -590403 What comes next: 191822, 191820, 191818? 191816 What is the next term in 5661, 11318, 16981, 22650? 28325 What is next in 20256, 40461, 60648, 80811, 100944, 121041, 141096, 161103? 181056 What comes next: -7096, -14192, -21286, -28378, -35468, -42556, -49642? -56726 What is next in 30320, 30359, 30424, 30515, 30632? 30775 What is the next term in 320, 748, 1484, 2546, 3952, 5720, 7868, 10414? 13376 What comes next: -1105, -2185, -3255, -4309, -5341? -6345 What is next in -18242, -36674, -55108, -73544, -91982? -110422 What is the next term in -161709, -323456, -485203, -646950? -808697 What is the next term in 1108, 1866, 2278, 2344, 2064, 1438? 466 What is next in -260, -1152, -2652, -4772, -7524? -10920 What comes next: -66, -24, 22, 72, 126, 184, 246? 312 What is the next term in -284, -2330, -7890, -18722, -36584, -63234, -100430, -149930? -213492 What is next in 4071, 32622, 110121, 261042, 509859, 881046? 1399077 What is next in 66, 64, 56, 42, 22? -4 What is the next term in -7294, -7268, -7208, -7096, -6914, -6644, -6268, -5768? -5126 What comes next: 12607, 25213, 37819, 50425, 63031, 75637? 88243 What is the next term in 360120, 360130, 360154, 360198, 360268, 360370, 360510? 360694 What is the next term in 197252, 394502, 591752, 789002, 986252? 1183502 What is next in 206762, 206754, 206742, 206726, 206706, 206682, 206654? 206622 What is next in 6672801, 6672802, 6672803, 6672804, 6672805, 6672806? 6672807 What is the next term in 72, 20, -100, -318, -664, -1168? -1860 What is the next term in -1724, -7012, -15826, -28166, -44032? -63424 What is next in -248, -555, -860, -1163, -1464, -1763, -2060? -2355 What comes next: 100, 604, 1926, 4474, 8656, 14880? 23554 What comes next: 143, 403, 815, 1361, 2023, 2783, 3623, 4525? 5471 What is the next term in 1451, 5801, 13047, 23189, 36227? 52161 What comes next: -213, -472, -859, -1338, -1873, -2428? -2967 What is next in -4983, -4978, -4973, -4968, -4963, -4958? -4953 What is the next term in -178, -213, -274, -361, -474? -613 What comes next: 26044, 52205, 78366, 104527, 130688, 156849? 183010 What is the next term in -1680, -1098, -516, 66, 648, 1230? 1812 What comes next: 46, 52, 64, 82, 106, 136, 172? 214 What comes next: 711, 149, -779, -2067, -3709, -5699? -8031 What is next in 971, 1789, 2607, 3425, 4243? 5061 What is next in -1256523, -2513049, -3769575, -5026101, -6282627, -7539153? -8795679 What comes next: -51, -357, -1183, -2787, -5427? -9361 What comes next: -80, -67, -54, -41? -28 What is the next term in 78247, 156493, 234737, 312979? 391219 What is the next term in 4190, 4247, 4342, 4475, 4646? 4855 What is next in 138, -26, -190, -354? -518 What is next in -54, -143, -268, -429? -626 What is the next term in 392, 975, 1554, 2129, 2700, 3267? 3830 What comes next: -440, -442, -436, -416, -376, -310? -212 What is the next term in -218, -101, 28, 163, 298, 427, 544, 643? 718 What is next in -56740, -56742, -56744? -56746 What is the next term in 2375, 2307, 2239, 2171, 2103, 2035? 1967 What is next in 1026, 1056, 1094, 1128, 1146, 1136? 10	{ "pile_set_name": "DM Mathematics" }
2 + 20t + 2 What is the x'th term of -7431, -7430, -7429, -7428, -7427, -7426? x - 7432 What is the s'th term of -42, -82, -122, -162? -40s - 2 What is the o'th term of -29, -22, -13, -2, 11? o*2 + 4o - 34 What is the l'th term of -8696, -8694, -8690, -8684, -8676, -8666, -8654? l2 - l - 8696 What is the r'th term of -20694, -20695, -20696, -20697, -20698? -r - 20693 What is the a'th term of 137, 140, 141, 140, 137, 132? -a2 + 6a + 132 What is the r'th term of 64, 133, 202? 69r - 5 What is the t'th term of -3, -16, -29, -42, -55, -68? -13t + 10 What is the k'th term of -12, -15, -24, -45, -84? -k3 + 3k*2 - 5k - 9 What is the d'th term of 666, 661, 652, 639? -2d2 + d + 667 What is the b'th term of -4, 8, 34, 80, 152? b3 + b2 + 2b - 8 What is the k'th term of -3033, -6065, -9097, -12129? -3032k - 1 What is the l'th term of -1536, -1541, -1548, -1557? -l2 - 2l - 1533 What is the q'th term of 122, 123, 124, 125? q + 121 What is the y'th term of -368, -295, -224, -155, -88? -y*2 + 76y - 443 What is the f'th term of 967, 1934, 2901, 3868, 4835, 5802? 967f What is the m'th term of -23, -23, -13, 13, 61, 137, 247, 397? m3 - m2 - 4m - 19 What is the c'th term of -41, -46, -51? -5c - 36 What is the w'th term of -135, -138, -143, -150, -159? -w2 - 134 What is the f'th term of -737, -725, -705, -677, -641, -597, -545? 4f2 - 741 What is the o'th term of 210, 198, 174, 132, 66, -30? -o3 - 5o + 216 What is the f'th term of -80, -78, -76, -74? 2f - 82 What is the q'th term of -109, -111, -113, -115? -2q - 107 What is the n'th term of 285, 551, 807, 1047, 1265, 1455, 1611? -n3 + n2 + 270n + 15 What is the d'th term of 20, 102, 310, 704, 1344, 2290, 3602, 5340? 10d3 + 3d*2 + 3d + 4 What is the h'th term of -12, -49, -110, -195, -304? -12h2 - h + 1 What is the h'th term of -130, -163, -196, -229, -262? -33h - 97 What is the r'th term of -22, -37, -52, -67, -82, -97? -15r - 7 What is the r'th term of -759, -1510, -2265, -3030, -3811, -4614, -5445? -r3 + 4r*2 - 756r - 6 What is the m'th term of -18289, -36576, -54863, -73150? -18287m - 2 What is the d'th term of 55, 112, 177, 256, 355? d3 - 2d*2 + 56d What is the n'th term of -1102, -2206, -3310, -4414, -5518, -6622? -1104n + 2 What is the d'th term of 35, 65, 95, 125? 30d + 5 What is the c'th term of 260, 508, 756, 1004, 1252, 1500? 248c + 12 What is the d'th term of -112, -124, -152, -202, -280? -d3 - 2d*2 + d - 110 What is the u'th term of 4199, 4198, 4197, 4196, 4195? -u + 4200 What is the q'th term of -52, -68, -80, -88, -92? 2q*2 - 22q - 32 What is the o'th term of -925, -1845, -2763, -3679, -4593? o*2 - 923o - 3 What is the y'th term of 47, 66, 85? 19y + 28 What is the t'th term of -5, -9, -9, -5, 3, 15? 2t*2 - 10t + 3 What is the u'th term of 28593, 28594, 28595, 28596, 28597, 28598? u + 28592 What is the r'th term of -95, -442, -1019, -1826, -2863, -4130? -115r2 - 2r + 22 What is the n'th term of -8, -15, -30, -53, -84, -123, -170? -4n2 + 5n - 9 What is the a'th term of -6, -61, -120, -183, -250, -321, -396? -2a2 - 49a + 45 What is the o'th term of -23, -18, 1, 40, 105? o3 + o2 - 5o - 20 What is the m'th term of 167, 289, 411, 533, 655? 122m + 45 What is the f'th term of -96, -489, -1136, -2031, -3168, -4541? f*3 - 133f2 - f + 37 What is the a'th term of 0, 1, -4, -21, -56, -115, -204, -329? -a3 + 3a2 - a - 1 What is the o'th term of 174, 348, 522, 696? 174o What is the j'th term of 14, -13, -40, -67, -94, -121? -27j + 41 What is the i'th term of 3660, 7319, 10974, 14625? -2i*2 + 3665i - 3 What is the f'th term of 841, 844, 847, 850, 853? 3f + 838 What is the z'th term of 201, 202, 203, 204, 205, 206? z + 200 What is the l'th term of -1055, -2108, -3161, -4214? -1053l - 2 What is the d'th term of -45, -86, -127, -168, -209? -41d - 4 What is the b'th term of 14, 50, 124, 248, 434, 694, 1040? 2b*3 + 7b*2 + b + 4 What is the h'th term of -17, -10, -3, 4, 11? 7h - 24 What is the t'th term of -67, -62, -53, -40? 2t2 - t - 68 What is the n'th term of -9, -11, -11, -9, -5, 1, 9? n2 - 5n - 5 What is the o'th term of -645, -651, -667, -699, -753, -835, -951? -o3 + o2 - 2o - 643 What is the f'th term of 17, -4, -47, -118, -223? -f3 - 5f*2 + f + 22 What is the l'th term of 287, 376, 465, 554, 643? 89l + 198 What is the v'th term of -2, 3, 12, 25, 42, 63, 88? 2v2 - v - 3 What is the c'th term of 42, 40, 38, 36? -2c + 44 What is the x'th term of 304, 344, 446, 640, 956, 1424? 5x3 + x2 + 2x + 296 What is the t'th term of 5277, 10555, 15833, 21111, 26389? 5278t - 1 What is the n'th term of -262, -254, -230, -184, -110? n3 + 2n*2 - 5n - 260 What is the y'th term of -54, -60, -66, -72, -78? -6y - 48 What is the y'th term of 4, -15, -60, -143, -276, -471? -2y3 - y2 - 2y + 9 What is the v'th term of -15, -5, 5? 10v - 25 What is the i'th term of -193, -211, -257, -343, -481? -2i3 - 2i*2 + 2i - 191 What is the l'th term of -189, -216, -243? -27l - 162 What is the u'th term of 116, 194, 276, 362, 452? 2u*2 + 72u + 42 What is the f'th term of 100, 102, 106, 112, 120? f*2 - f + 100 What is the l'th term of 368, 724, 1080, 1436? 356l + 12 What is the p'th term of -308, -320, -354, -422, -536? -2p3 + p2 - p - 306 What is the c'th term of 29, 30, 19, -10, -63, -146, -265? -c3 + 8c + 22 What is the b'th term of 175, 349, 523? 174b + 1 What is the c'th term of 106, 411, 920, 1633, 2550, 3671? 102c*2 - c + 5 What is the l'th term of -1, 16, 33, 50? 17l - 18 What is the f'th term of -117, -100, -71, -30, 23, 88, 165? 6f2 - f - 122 What is the d'th term of -38, -30, -22, -14, -6? 8d - 46 What is the h'th term of 30, 60, 90, 120, 150? 30h What is the z'th term of 840, 1703, 2566? 863z - 23 What is the d'th term of 36, 56, 76, 96, 116? 20d + 16 What is the p'th term of 33, 138, 319, 576, 909, 1318, 1803? 38p*2 - 9p + 4 What is the n'th term of -33, -54, -75, -96? -21n - 12 What is the x'th term of -3495, -3489, -3481, -3471? x2 + 3x - 3499 What is the n'th term of -153, -153, -163, -189, -237, -313, -423? -n3 + n2 + 4n - 157 What is the n'th term of -47, -46, -47, -50? -n2 + 4n - 50 What is the o'th term of 231, 239, 251, 267, 287? 2o2 + 2o + 227 What is the i'th term of 68, 182, 308, 452, 620, 818, 1052, 1328? i*3 + 107i - 40 What is the l'th term of 17, 34, 67, 122, 205? l*3 + 2l*2 + 4l + 10 What is the z'th term of -4269, -4267, -4265, -4263? 2z - 4271 What is the p'th term of 0, 6, 16, 30, 48, 70, 96? 2p2 - 2 What is the s'th term of 55, 118, 201, 310, 451? s3 + 4s2 + 44s + 6 What is the n'th term of 2220, 4440, 6660, 8880? 2220n What is the c'th term of 317, 309, 297, 281, 261? -2c*2 - 2c + 321 What is the p'th term of 2386, 2391, 2406, 2437, 2490, 2571? p3 - p2 + p + 2385 What is the x'th term of -287, -294, -299, -302, -303, -302? x*2 - 10x - 278 What is the p'th term of -536, -2140, -4814, -8558, -13372? -535p2 + p - 2 What is the m'th term of 379, 383, 387, 391, 395? 4m + 375 What is the g'th term of 248, 200, 152, 104, 56, 8? -48g + 296 What is the g'th term of -58, -48, -32, -10, 18, 52? 3g2 + g - 62 What is the x'th term of 55, 44, 19, -26, -97, -200, -341? -x3 - x*2 - x + 58 What is the m'th term of 47, 49, 51, 53, 55? 2m + 45 What is the i'th term of -20, -74, -224, -518, -1004? -8i3 + 2i - 14 What is the z'th term of -143, -305, -479, -671, -887? -z*3 - 155z + 13 What is the o'th term of 345, 688, 1031, 1374, 1717, 2060? 343o + 2 What is the i'th term of 68, 77, 80, 71, 44, -7? -i3 + 3i*2 + 7i + 59 What is the v'th term of 31, 81, 163, 295, 495, 781, 1171, 1683? 3v3 - 2v*2 + 35v - 5 What is the n'th term of -596, -1187, -1792, -2417, -3068, -3751, -4472? -n3 - n2 - 581n - 13 What is the w'th term of 144, 209, 128, -171, -760, -1711? -12w3 - w2 + 152w + 5 What is the f'th term of -206, -200, -190, -176, -158? 2f2 - 208 What is the m'th term of 2321, 2330, 2329, 2312, 2273, 2206? -m3 + m*2 + 13m + 2308 What is the k'th term of -170, -159, -148, -143, -150, -175, -224, -303? -k*3 + 6k**2 - 175 What is the l'th term of -564, -573, -	{ "pile_set_name": "DM Mathematics" }
What are the prime factors of 21311? 101, 211 What are the prime factors of 2316? 2, 3, 193 List the prime factors of 38026. 2, 19013 List the prime factors of 43267. 7, 883 List the prime factors of 15397. 89, 173 List the prime factors of 6643. 7, 13, 73 What are the prime factors of 124? 2, 31 What are the prime factors of 1764? 2, 3, 7 What are the prime factors of 3839? 11, 349 List the prime factors of 744. 2, 3, 31 What are the prime factors of 3423? 3, 7, 163 What are the prime factors of 1533? 3, 7, 73 List the prime factors of 62221. 43, 1447 List the prime factors of 3730. 2, 5, 373 What are the prime factors of 1041? 3, 347 List the prime factors of 3025. 5, 11 List the prime factors of 199. 199 What are the prime factors of 1183? 7, 13 What are the prime factors of 7317? 3, 271 List the prime factors of 21540. 2, 3, 5, 359 What are the prime factors of 5107? 5107 List the prime factors of 6763. 6763 List the prime factors of 1281. 3, 7, 61 List the prime factors of 14534. 2, 13, 43 What are the prime factors of 2640? 2, 3, 5, 11 What are the prime factors of 355? 5, 71 List the prime factors of 4578. 2, 3, 7, 109 List the prime factors of 13609. 31, 439 List the prime factors of 2607. 3, 11, 79 List the prime factors of 16752. 2, 3, 349 List the prime factors of 1891. 31, 61 List the prime factors of 1016. 2, 127 List the prime factors of 316. 2, 79 What are the prime factors of 5552? 2, 347 List the prime factors of 45323. 61, 743 List the prime factors of 105192. 2, 3, 487 List the prime factors of 2878. 2, 1439 What are the prime factors of 28640? 2, 5, 179 What are the prime factors of 22153? 22153 What are the prime factors of 6386? 2, 31, 103 What are the prime factors of 6627? 3, 47 What are the prime factors of 2087? 2087 List the prime factors of 36679. 43, 853 What are the prime factors of 792? 2, 3, 11 What are the prime factors of 364? 2, 7, 13 List the prime factors of 463. 463 What are the prime factors of 9298? 2, 4649 List the prime factors of 2887. 2887 List the prime factors of 2928. 2, 3, 61 List the prime factors of 58896. 2, 3, 409 List the prime factors of 30302. 2, 109, 139 What are the prime factors of 13823? 23, 601 List the prime factors of 4575. 3, 5, 61 What are the prime factors of 140745? 3, 5, 11, 853 List the prime factors of 63680. 2, 5, 199 What are the prime factors of 3857? 7, 19, 29 List the prime factors of 465. 3, 5, 31 What are the prime factors of 32299? 32299 What are the prime factors of 877? 877 What are the prime factors of 1364? 2, 11, 31 List the prime factors of 81534. 2, 3, 107, 127 What are the prime factors of 941? 941 What are the prime factors of 172371? 3, 57457 What are the prime factors of 410? 2, 5, 41 List the prime factors of 11888. 2, 743 What are the prime factors of 360? 2, 3, 5 What are the prime factors of 1482? 2, 3, 13, 19 List the prime factors of 15779. 31, 509 What are the prime factors of 3464? 2, 433 List the prime factors of 1749. 3, 11, 53 List the prime factors of 7131. 3, 2377 List the prime factors of 19114. 2, 19, 503 What are the prime factors of 664? 2, 83 What are the prime factors of 4200? 2, 3, 5, 7 What are the prime factors of 1046? 2, 523 What are the prime factors of 7662? 2, 3, 1277 What are the prime factors of 821? 821 What are the prime factors of 5985? 3, 5, 7, 19 List the prime factors of 18830. 2, 5, 7, 269 What are the prime factors of 14442? 2, 3, 29, 83 List the prime factors of 860. 2, 5, 43 What are the prime factors of 28947? 3, 9649 List the prime factors of 10853. 10853 List the prime factors of 2648. 2, 331 What are the prime factors of 1516? 2, 379 List the prime factors of 5606. 2, 2803 What are the prime factors of 278? 2, 139 What are the prime factors of 904? 2, 113 List the prime factors of 3709. 3709 What are the prime factors of 82647? 3, 3061 What are the prime factors of 11560? 2, 5, 17 List the prime factors of 10870. 2, 5, 1087 List the prime factors of 48113. 13, 3701 What are the prime factors of 7074? 2, 3, 131 What are the prime factors of 944? 2, 59 List the prime factors of 2250. 2, 3, 5 List the prime factors of 54075. 3, 5, 7, 103 List the prime factors of 529. 23 List the prime factors of 30226. 2, 7, 17, 127 What are the prime factors of 4073? 4073 What are the prime factors of 1145? 5, 229 What are the prime factors of 113565? 3, 5, 67, 113 List the prime factors of 10015. 5, 2003 What are the prime factors of 2000? 2, 5 What are the prime factors of 933? 3, 311 List the prime factors of 724. 2, 181 What are the prime factors of 20352? 2, 3, 53 What are the prime factors of 745? 5, 149 List the prime factors of 24124. 2, 37, 163 What are the prime factors of 138298? 2, 69149 List the prime factors of 22664. 2, 2833 List the prime factors of 60515. 5, 7, 13, 19 What are the prime factors of 9767? 9767 What are the prime factors of 5567? 19, 293 What are the prime factors of 12832? 2, 401 What are the prime factors of 145693? 89, 1637 List the prime factors of 138602. 2, 37, 1873 List the prime factors of 49001. 19, 2579 List the prime factors of 466. 2, 233 What are the prime factors of 123233? 11, 17, 659 What are the prime factors of 5053? 31, 163 What are the prime factors of 2110? 2, 5, 211 List the prime factors of 29002. 2, 17, 853 What are the prime factors of 1356? 2, 3, 113 List the prime factors of 7025. 5, 281 What are the prime factors of 45525? 3, 5, 607 List the prime factors of 13095. 3, 5, 97 What are the prime factors of 40962? 2, 3, 6827 What are the prime factors of 2787? 3, 929 What are the prime factors of 3053? 43, 71 List the prime factors of 123991. 7, 17713 List the prime factors of 63791. 7, 13, 701 List the prime factors of 14443. 11, 13, 101 List the prime factors of 3618. 2, 3, 67 What are the prime factors of 144389? 7, 20627 List the prime factors of 85811. 11, 29, 269 What are the prime factors of 10908? 2, 3, 101 What are the prime factors of 4421? 4421 List the prime factors of 9294. 2, 3, 1549 List the prime factors of 1942. 2, 971 What are the prime factors of 1483? 1483 What are the prime factors of 33531? 3, 11177 List the prime factors of 5832. 2, 3 What are the prime factors of 152042? 2, 11, 6911 List the prime factors of 1103. 1103 What are the prime factors of 59286? 2, 3, 41, 241 What are the prime factors of 8455? 5, 19, 89 List the prime factors of 705. 3, 5, 47 What are the prime factors of 8423? 8423 What are the prime factors of 43434? 2, 3, 19, 127 List the prime factors of 16933. 7, 41, 59 What are the prime factors of 672? 2, 3, 7 List the prime factors of 36744. 2, 3, 1531 List the prime factors of 2245. 5, 449 List the prime factors of 58598. 2, 83, 353 What are the prime factors of 50328? 2, 3, 233 List the prime factors of 38613. 3, 61, 211 List the prime factors of 1484. 2, 7, 53 List the prime factors of 139344. 2, 3, 2903 List the prime factors of 5167. 5167 List the prime factors of 22317. 3, 43, 173 What are the prime factors of 26424? 2, 3, 367 List the prime factors of 411. 3, 137 List the prime factors of 111794. 2, 55897 List the prime factors of 29564. 2, 19, 389 What are the prime factors of 7022? 2, 3511 List the prime factors of 705. 3, 5, 47 What are the prime factors of 63082? 2, 31541 What are the prime factors of 12720? 2, 3, 5, 53 List the prime factors of 4155. 3, 5, 277 What are the prime factors of 10679? 59, 181 List the prime factors of 129. 3, 43 What are the prime factors of 1006? 2, 503 List the prime factors of 3672. 2, 3, 17 What are the prime factors of 15298? 2, 7649 List the prime factors of 57743. 7, 73, 113 List the prime factors of 82235. 5, 16447 What are the prime factors of 65985? 3, 5, 53, 83 What are the prime factors of 1386? 2, 3, 7, 11 List the prime factors of 5953. 5953 List the prime factors of 686. 2, 7 What are the prime factors of 12784? 2, 17, 47 List the prime factors of 70747. 263, 269 What are the prime factors of 4709? 17, 277 What are the prime factors of 1601? 1601 What are the prime factors of 4914? 2, 3, 7, 13 What are the prime factors of 5360? 2, 5, 67 List the prime factors of 27452. 2, 6863 What are the prime factors of 126172? 2, 31543 What are the prime factors of 30708? 2, 3, 853 What a	{ "pile_set_name": "DM Mathematics" }
et n = j - -70. Suppose ng - 788 = -t, -682 = -5g - 5t + 118. List the prime factors of g. 157 Let v(f) = 185f*2 + 48f + 704. List the prime factors of v(20). 2, 4729 Suppose 2b - 2a - a = -8, 10 = -5a. Let c(m) = 5m + 38. Let h be c(b). Suppose o + z - 71 = 0, -ho + 135 = -4z - 113. What are the prime factors of o? 2, 19 Let x = 2111 + 5196. What are the prime factors of x? 7307 Suppose 0 = c - o - 15, -3c = -6o + 4o - 41. Suppose cu - 734 = 421. What are the prime factors of u? 3, 5, 7 Suppose 481h - 12354905 - 12894709 = 0. What are the prime factors of h? 2, 3, 13, 673 Suppose 29r + 5382 = 23r. Let k = -507 - r. What are the prime factors of k? 2, 3, 5, 13 Suppose 26 = 5a - 3a + 5r, 3a - 2r = 1. Let z(l) = -22l2 - 2l - 1. Let j be z(-2). What are the prime factors of j/(-3)a - (-9)/3? 2, 11 Suppose 4n + n + 47090 = 4p, 5p - 58848 = -n. Suppose 73j - 83j + p = 0. What are the prime factors of j? 11, 107 Suppose -2b + 5b - 2193 = -2s, -2s + 3b + 2175 = 0. Suppose -3y - 4n + 1068 = -0n, -3y + 4n = -s. Let q = -205 + y. List the prime factors of q. 5, 31 Let u(q) = 9 - 15q - 10 + 18q - 3 + 46q2. Suppose -m - 4m + 5 = 0. List the prime factors of u(m). 3, 5 Let i(k) = k*3 + 11k*2 + k - 31. Let l be i(-8). List the prime factors of -48(34/l - 32/9). 2, 5 Let r(s) = 68s + 1719. List the prime factors of r(29). 3691 Let s = -158 + 188. Suppose 95f = sf + 17680. What are the prime factors of f? 2, 17 Suppose 2o = 8, 4o = 3x - 4x + 14744. List the prime factors of x. 2, 7, 263 Let w(h) be the first derivative of h4/2 + h3/3 - 7h*2 + 19h - 20. What are the prime factors of w(6)? 13, 31 Suppose 4v - 2c = 164, -3c = -0v - 5v + 206. Suppose -2h + v = -0. What are the prime factors of (-274)/(-8) + h/(-16)? 3, 11 Suppose -135936 - 91599 = -33j. List the prime factors of j. 5, 7, 197 Suppose j - 26 = -5g, -4j + 95 = -2g - 53. Suppose -14b + 17b = j. List the prime factors of b/(-30) - ((-1928)/(-10))/(-2). 2, 3 List the prime factors of (1 - 0)/((-1)/(-5797)). 11, 17, 31 Let i = 17892 - 7389. What are the prime factors of i? 3, 389 Let u = -3794 + 5549. List the prime factors of u. 3, 5, 13 Suppose -y + 19 = 90. Let o = 68 + y. List the prime factors of (-7 - -4)/(o/169). 13 Let f = 29 - -39. Let n = f - 70. What are the prime factors of ((-1)/n)/((-2931)/(-732) + -4)? 2, 61 Suppose 0 = 3x - 9 - 0. Suppose 8d = xd. Suppose 0m - 5m + 200 = d. List the prime factors of m. 2, 5 Let c = -278 - -510. Suppose 0 = 7f - 3f + 20, 0 = -q + 4f - 135. Let a = q + c. What are the prime factors of a? 7, 11 Let q = 523 + -504. Suppose -ql = 496 - 2852. What are the prime factors of l? 2, 31 Suppose 49438 = 4m - 2g, -39m = -43m + 4g + 49448. What are the prime factors of m? 3, 1373 Suppose -27x + 264795 = 83192 - 117503. List the prime factors of x. 2, 29, 191 Suppose 3c - 2476 = -577. Let t be c/(2 + (-9)/6). Suppose 13a - 7a = t. What are the prime factors of a? 211 What are the prime factors of 4641 - (1 + 4) - (-8 + 14)? 2, 5, 463 List the prime factors of (291 - 247)(-3)/(-12)2707. 11, 2707 Suppose -30 = -8y + 2. Suppose -yk - 3 = 97. What are the prime factors of (-10)/k - 366/(-10)? 37 Let j = -8397 - -28298. List the prime factors of j. 7, 2843 Let j = 496 + -477. Suppose 2612 = -17c + jc. List the prime factors of c. 2, 653 Suppose -21060 = -32c + 22c. List the prime factors of 96/(-24)(c/(-8) - -1). 1049 Let d be 333/(-74)4/(-9). Suppose -3i - 4m + 1774 = -dm, -i + 593 = -m. What are the prime factors of i? 2, 37 Suppose -30702 = -5r + 10628. What are the prime factors of r? 2, 4133 Let f(v) = 3v3 - v2 - 70. Let b be f(0). List the prime factors of (-1)/(-10) + 9(-3647)/b. 7, 67 Let l = -126 - -74. List the prime factors of (12558/l)/(4/((-32)/6)). 2, 7, 23 Let d(u) = u*3 + 11u*2 - 6u + 19. Let i(b) = -4b - 3. Let g(h) = -5h - 3. Let l(v) = -3g(v) + 2i(v). Let r be l(-2). What are the prime factors of d(r)? 5, 17 Let f(o) = 3o2 - 347o - 287. List the prime factors of f(147). 7, 1933 Suppose -127844 - 189127 = -41l. What are the prime factors of l? 3, 859 Let w be 3/15 - 57/(-15). Suppose ws = -o - 40, 4s = -11o + 9o - 88. List the prime factors of (-1 + 138/(-8))/(o/192). 73 Let q(j) = -22j - 16 + 14j2 + 0 + 19j. What are the prime factors of q(-5)? 349 Suppose -4z + 12 = 4d, 4 = d - 2z + 1. Suppose -10s + 6s + 2m = -2550, 5s + dm = 3160. List the prime factors of s. 5, 127 Suppose 0 = a - 11a - 100. Let t(j) = j2 + 4j - 23. Let r be t(a). Let g = r + 12. List the prime factors of g. 7 Let v = 2142 + 406. Suppose 0 = -5z + 3617 + v. List the prime factors of z. 3, 137 Suppose -52g = -127974 - 210026. Suppose 4i + 6502 = 2t + 3t, -5t + 5i = -g. What are the prime factors of t? 2, 3, 7, 31 Let h(k) = -k3 + 7k*2 - 4k - 9. Let i be h(6). Suppose -15 = y + 4w, -5y - 6 - i = -2w. Let c = 47 + y. What are the prime factors of c? 2, 11 List the prime factors of (-510572)/(-11) - (-3816)/(-2332). 2, 23, 1009 Let r = -837 - -1177. What are the prime factors of r? 2, 5, 17 Let u = -171 - -157. Let i(r) = -74r - 114. What are the prime factors of i(u)? 2, 461 Suppose -6t + 106t = 584300. List the prime factors of t. 5843 Suppose 6n = -2825 + 38579. What are the prime factors of n? 59, 101 List the prime factors of (27 - 29)(325584/(-10) + (-12)/(-30)). 2, 73, 223 Let y(z) = -2z + 19. Let u be y(8). Suppose -up + 237 = -0p. Let s = p + 2. List the prime factors of s. 3 Let v = 306 + -302. Suppose vk = 146 + 694. List the prime factors of k. 2, 3, 5, 7 Let l = 55 + -54. Suppose 4f - 3 = 2h - l, f = -4h + 5. What are the prime factors of 240/3h - (1 - 1)? 2, 5 Suppose -45u = -41u - 4960. Suppose -u + 85 = -5s. What are the prime factors of s? 3, 7, 11 Let n(x) = 1 - 8x - 6x3 - 31x2 - x3 - 6x + 4 + 22x2. List the prime factors of n(-5). 5, 29 Let b(d) = -d3 + 3d2 - 3d + 1. Let k be b(3). List the prime factors of k/(-1 + 3) + 31. 3 Let x be 28/(-70) - (-4)/10. Suppose s + xt - 116 = 3t, -4t = 3s - 400. Let g = s + -92. List the prime factors of g. 2, 3 Suppose -205c + 95358 = -67c. List the prime factors of c. 691 Suppose 316 = 18v - 80. Suppose 21t + vt - 39818 = 0. List the prime factors of t. 2, 463 Suppose -w = -2n - 5829, -107w = -108w + n + 5825. What are the prime factors of w? 5821 Let a(v) = 6v + 2. Let d be a(1). Suppose -6034 = ds - 15642. List the prime factors of s. 1201 Suppose 3x - n - 2090 = 0, -2x + 3n + 1127 = -278. Suppose -4m + 9m = x. List the prime factors of m. 139 Suppose 5r - 25 = -2c, 0r - 77 = -4c - r. List the prime factors of (-24)/c - (-6962)/10. 5, 139 Suppose 5w - 2 = 2t, -3t - 8w = -3w - 22. Suppose 3l = -4d + 507, -tl - 192 = -2d + 34. What are the prime factors of d? 3, 41 Let h be (1(0 + -2))/(8/424). Let m = -101 - h. Suppose -4u - 2p = -218, 0p - mp = 4u - 209. What are the prime factors of u? 2, 7 Let t(u) = u*3 - 6u*2 - 3u + 9. Let i(w) = w*3 - 5w*2 - 12w - 8. Let y be i(7). Let s be t(y). What are the prime factors of (78/s - 1)/(5/(-45))? 3, 29 List the prime factors of 6745321/1179 - (-4)/(-18). 3, 1907 Suppose -1124060 = -75r + 26r. What are the prime factors of r? 2, 5, 31, 37 Suppose 27010 + 9146 = 5q + 3686. What are the prime factors of q? 2, 17, 191 Let l(d) = -d3 - 15d*2 + 36d + 45. Let v be l(-17). Suppose 0k + 99 = 3k. Let f = v + k. List the prime factors of f. 2, 11 Suppose -5q + 2b + b + 1872 = 0, -749 = -2q + b. Suppose -4n + 817 = -q. List the prime factors of n. 2, 149 Let n = 136 + -133. Suppose 0 = -3y - 2c - nc + 2918, 2y = -3c + 1946. List the prime factors of y. 2, 61 Suppose 4c - 80 = -c - 5n, -5c + 3n + 40 = 0. Suppose 12h - 432 = ch. What are the prime factors of h? 2, 3 Suppose -21o + 49 = -35. Suppose -5m + m + 788 = ob, -4m - 207 = -b. List the prime factors of b. 199 Suppose 3w = n + 7, 0 = 2w - 3n - 2 + 9. Suppose -29 = h - y, wh - h + 3y = -63. What are the prime factors of 164/10 + 10/h? 2 Let i be (-18)/(-4)4236/18. Let u = i + -514. Suppose -3x = l - 335, 0x - 5l + u = 5*x. What are the prime factors of x? 113 Suppose	{ "pile_set_name": "DM Mathematics" }
Calculate k(-4). 56 Let u(y) = 1161y + 2326. Calculate u(-2). 4 Let b(t) = -31t - 307. Give b(-8). -59 Let q(b) = -4b2 - 71b - 50. Determine q(-17). 1 Let k(o) = 1138o + 14800. Calculate k(-13). 6 Let l(v) = -369v + 2962. Give l(8). 10 Let a(f) = f*3 + 15f*2 - 33f + 33. What is a(-17)? 16 Let t(m) = -41m - 50. Determine t(-2). 32 Let n(f) = -649f*2 + 1298f - 1. Give n(2). -1 Let q(v) = 3v3 - 32v*2 + 15v + 60. Calculate q(10). 10 Let a(p) = -p*3 + 16p*2 - 38p - 34. Give a(16). -642 Let n(k) = 2k3 - 278k*2 + 282k - 858. Determine n(138). -30 Let c(f) = -f*3 + 34f*2 - 100f + 197. What is c(31)? -20 Let s(a) = -1937a + 1932. What is s(1)? -5 Let o(t) = -9t*3 - 64t*2 - 32t - 184. Determine o(-7). -9 Let a(p) = 14p2 - 98p - 198. Determine a(-2). 54 Let l(n) = n*2 + 1371n + 350546. Determine l(-340). 6 Let s(x) = 3x3 + 24x*2 + 12x + 20. What is s(-7)? 83 Let g(m) = -24m2 - 118m + 361. What is g(3)? -209 Let l(h) = -2h3 - 8h*2 + 12h - 63. What is l(-7)? 147 Let m(k) = -k*3 + 41k*2 - 109k - 199. What is m(38)? -9 Let y(i) = -4i3 + 892i*2 + 5494i + 458. Determine y(229). 0 Let t(w) = 63w + 10912. Calculate t(-173). 13 Let g(u) = -75u - 2333. What is g(-30)? -83 Let b(f) = f*3 - 70f*2 + 499f - 202. Calculate b(62). -16 Let u(c) = c2 - 130. Give u(12). 14 Let v(d) = -d3 + 35d2 + 112d + 77. Give v(38). 1 Let t(i) = i*2 + 164i + 6478. Give t(-67). -21 Let k(j) = 10616j - 53047. What is k(5)? 33 Let a(w) = 6w - 61. Determine a(-7). -103 Let v(t) = t*2 + 36t + 224. What is v(-13)? -75 Let z(f) = 2f3 + 2f*2 + 30f + 123. Give z(-3). -3 Let y(n) = -n*2 + 39n + 602. What is y(-12)? -10 Let x(f) = -2f3 - 98f*2 - 2f - 107. Give x(-49). -9 Let s(x) = -3x2 - 69x - 389. Calculate s(-10). 1 Let f(o) = -2o2 - 131o - 12. Give f(0). -12 Let p(o) = 22o3 - 8o*2 - 18o + 8. What is p(-2)? -164 Let q(w) = 321w2 + 28w + 27. What is q(-1)? 320 Let b(a) = a - 88. Give b(-8). -96 Let a(w) = 30w2 - 116w - 3. Give a(4). 13 Let y(p) = -31p - 295. Determine y(-17). 232 Let u(n) = -507n - 166296. Determine u(-328). 0 Let n(u) = -u*3 - 28u*2 - 39u + 15. Determine n(-27). 339 Let l(n) = n*3 + 8n*2 - 42n + 90. What is l(-12)? 18 Let s(p) = p*3 + 28p*2 - 429p - 7. Give s(-39). -7 Let p(z) = -41z2 - 21z - 12. What is p(-6)? -1362 Let y(n) = -3n2 + 43n - 17. Determine y(13). 35 Let k(i) = 2i3 + 34i*2 + 49i + 226. Give k(-16). -46 Let g(i) = i*3 + 62i*2 + 180i + 178. Give g(-59). 1 Let k(b) = 7b + 466. What is k(-58)? 60 Let p(b) = -3b*2 + 4b - 83. Give p(11). -402 Let y(v) = -v*3 - 3v*2 + 89v - 4. What is y(8)? 4 Let o(r) = 4r2 - 37r + 71. Calculate o(6). -7 Let k(j) = -j*2 + 112j + 657. Calculate k(-5). 72 Let m(z) = -z*3 - 8z*2 + 16z + 145. What is m(-8)? 17 Let p(g) = g*3 + 4g*2 - 3g - 7. What is p(2)? 11 Let u(f) = f*3 + 18f*2 + 19f + 23. Determine u(-17). -11 Let u(p) = -p*2 + 3p - 212. Give u(11). -300 Let d(z) = -z*2 + 221z - 12059. Calculate d(101). 61 Let z(p) = -39p - 415. What is z(-5)? -220 Let y(q) = -q3 - 11q*2 - 20q - 17. Determine y(-10). 83 Let z(n) = n*3 - 10n*2 + 10n - 39. Determine z(4). -95 Let h(u) = -10u2 + 754u - 308. Give h(75). -8 Let k(t) = -2t3 - 35t*2 - 18t. Determine k(-17). 17 Let g(x) = x*3 - 26x*2 - 153x - 63. Calculate g(31). -1 Let n(o) = o*2 + 24o - 344. Determine n(10). -4 Let o(b) = 3b3 - 20b*2 - b + 30. Calculate o(8). 278 Let w(m) = -5m*2 + 465m - 3011. Give w(86). -1 Let l(b) = -1101b2 - 2204b + 3. Give l(-2). 7 Let f(d) = -27d + 624. Give f(23). 3 Let q(x) = x3 + 7x*2 - 235x + 80. Give q(12). -4 Let k(j) = -12147j - 60707. What is k(-5)? 28 Let i(a) = 239a - 467. Calculate i(2). 11 Let j(t) = -239t + 2848. Calculate j(12). -20 Let j(g) = -2g*2 - 26g + 186. Give j(-18). 6 Let v(r) = -r*3 - 6r*2 - 6r - 4. Give v(-4). -12 Let x(a) = 77a2 + 221a + 151. Give x(-1). 7 Let v(m) = -m*3 + 23m*2 - 97m - 87. Determine v(17). -2 Let x(l) = l*3 + 14l*2 + 78. Determine x(-14). 78 Let p(t) = 458t - 37559. Calculate p(82). -3 Let x(p) = -2p3 - 96p*2 - 9p - 399. Give x(-48). 33 Let j(v) = 6v2 + 103v + 385. Calculate j(-12). 13 Let i(f) = 11f2 - 320f + 63. What is i(29)? 34 Let u(v) = -v*2 + 16v + 406. Determine u(23). 245 Let o(t) = t*3 - 18t*2 - 170t + 38. Determine o(-7). 3 Let i(a) = -78a + 8341. Calculate i(107). -5 Let d(h) = -h2 - 40h - 371. Calculate d(-18). 25 Let p(w) = 47w + 3608. What is p(-76)? 36 Let v(y) = 5y + 310. What is v(-36)? 130 Let s(a) = -205a + 4294. What is s(21)? -11 Let b(f) = -f2 - 102f + 205. Determine b(2). -3 Let d(h) = -h*3 - 93h*2 + 1027h - 320. Give d(-103). -11 Let f(p) = p*3 - 4p - 45. Determine f(0). -45 Let n(x) = -67x2 + 17x + 3. Determine n(-2). -299 Let o(h) = 5h + 95. Determine o(-13). 30 Let d(k) = -19k*3 + 2k*2 + 3k + 5. Determine d(-2). 159 Let x(o) = 10783o + 53905. Calculate x(-5). -10 Let c(m) = m2 - 32m + 118. Give c(24). -74 Let y(k) = 2k2 + 39k + 280. What is y(-10)? 90 Let q(z) = 6z2 + 11z + 48. Give q(-5). 143 Let l(m) = 2m2 + 251m + 5256. Calculate l(-99). 9 Let k(x) = -x*3 + 12x*2 + 88x - 150. Calculate k(17). -99 Let x(d) = -d*3 - 174d*2 - 2098d - 72. Calculate x(-13). -7 Let b(l) = 138l2 + l - 2. Determine b(2). 552 Let g(n) = -10n*2 + 10n + 2. Determine g(-1). -18 Let q(p) = -1868p - 11211. Calculate q(-6). -3 Let m(h) = 2h*3 + 25h*2 - 12h - 23. Determine m(-13). -36 Let t(c) = -6c + 213. Give t(17). 111 Let y(d) = -47d + 651. Give y(10). 181 Let h(w) = 2w3 - 106w*2 - 224w + 18. Calculate h(55). -202 Let w(p) = p*3 + 3p*2 - 30p + 14. Calculate w(-7). 28 Let w(o) = -51o + 3460. Calculate w(67). 43 Let t(n) = n3 - 33n*2 + 138n + 17. What is t(5)? 7 Let s(j) = -209j + 1062. Determine s(7). -401 Let t(i) = -i2 - 63i + 725. Give t(-73). -5 Let y(p) = 2134p + 4251. What is y(-2)? -17 Let h(y) = -150y - 2137. Give h(-14). -37 Let d(k) = 1932k - 1886. What is d(1)? 46 Let u(g) = -33g - 5. Calculate u(-2). 61 Let w(c) = 651c + 7806. Give w(-12). -6 Let c(n) = n2 + 8n - 110. Calculate c(-19). 99 Let y(f) = f*3 - 48f*2 - 58f + 269. Calculate y(49). -172 Let h(t) = -t*3 - 11t*2 + t + 149. Give h(-12). 281 Let k(b) = -19b*2 + 79b + 9. Calculate k(5). -71 Let l(q) = 5q2 + 165q - 52. Calculate l(-33). -52 Let b(v) = 1556v + 4673. Determine b(-3). 5 Let y(j) = j2 - 40j - 1815. Give y(67). -6 Let h(t) = 109t + 64. Determine h(-3). -263 Let i(w) = 2w*3 + 23w*2 - 76w - 68. Calculate i(-14). 16 Let i(h) = 95h2 + 3h + 13. Determine i(-1). 105 Let s(t) = -t*2 + 29t + 49. What is s(29)? 49 Let m(z) = z*2 + 11z + 135. What is m(-8)? 111 Let p(d) = -2d3 - 89d*2 - 832d + 69. Determine p(-31). -86 Let n(g) = -24g3 - 4g*2 - 7g - 3. What is n(-2)? 187 Let t(v) = v*3 - 14v*2 - 25v + 52. What is t(15)? -98 Let c(w) = -w*3 + 151w*2 - 3168w + 2263. Calculate c(126). -5 Let w(f) = -f*2 - 3274f + 42724. What is w(13)? -7 Let b(y) = y*3 - 25y*2 - 270y + 7310. Calculate b(23). 42 Let b(y) = y*2 - y - 148. Determine b(9). -76 Let h(r) = 11r + 207. Determine h(-18). 9 Let v(h) = 38h3 - 51h + 53. Give v(1). 40 Let f(u) = -11u2 - u + 101. Determine f(3). -1 Let n(j) = 13j + 1030. What is n(-83)? -49 Let m(f) = 1261f - 18921. Determine m(15). -6 Let j(c) = c2 + 35c + 254. Determine j(-8). 38 Let o(t) = -t*3 - 8t*2 - 8t - 13. What is o(-6)? -37 Let c(y) = y*2 - 40y - 390. What is c(51)? 171 Let p(z) = -5z2 + 203z - 27. What is p(40)? 93 Let m(q) = 4q3 + 2q*2 - 3q - 1. Give m(1). 2 Let o(r) = -r*3 + 21r + 23. Determine o(-3). -13 Let f(j) = -20j + 675. Calculate f(31). 55 Let u(x) = 31x*2 + 401x - 21. Determine u(-13). 5 Let r(n) = 100n - 108. Give r(3). 192 Let w(l) = -l2 - 51l - 408. Give w(-9). -30 Let a(g) = -4g3 + 35g*2 - 26g + 34. Give a(8). 18 Let n(i) = i*3 - 116i*2 - 63i - 6309. Give n(117). 9 Let u(k) = k*2 + 3991k - 177545. Give u(44). -5 Let g(t) = -t*3 + 15t*2 - 4t - 146. Calculate g(14). -6 Let a(d) = -d*2 - 38d + 372. Calculate a(8). 4 Let o(v) = 328*v + 2	{ "pile_set_name": "DM Mathematics" }
g(k)? -7 Let c(l) = l2 + 6. Let o(s) be the second derivative of -s3/3 - 3s. Let n be o(-2). Suppose -ny = -y. Determine c(y). 6 Let t(h) = h*3 + 8h*2 + 2. Let o be t(-8). Suppose 11 = 3b + 3x + 2, -2b = -ox - 6. Let l(q) = -3q. Give l(b). -9 Let t(u) = -37u + 20u - 4 - 5 + u*3 + 8u + 5u2. Determine t(-6). 9 Let r(n) be the third derivative of n3/6 - 2n*2. Suppose -2a + 20 = -2w, 18 = a - w - 2w. Let b(k) = -k*2 + k. Let t(c) = ar(c) - b(c). Give t(0). 6 Let r(d) = 29d + 27d - 55d + 5. Calculate r(5). 10 Let a(r) = r2 - 5. Let o(g) = -g3 + 3g*2 + 5g - 4. Let v be o(4). What is a(v)? -5 Let y(p) = 5p3 + 2p*2 - 2p + 8. Let c(f) = 11f3 + 5f*2 - 4f + 17. Let l(b) = 6c(b) - 13y(b). Determine l(-2). 2 Let o(z) = -z - 1. Let s = -4 - -10. Suppose -3r + s = -0r. Let m be ((-3)/(-3))/(r/(-6)). What is o(m)? 2 Let h(u) be the second derivative of 4u - 2/3u*3 + 0 + 3u*2 - 1/12u*4. Determine h(-5). 1 Let i(x) = 6x*2 + 8x + 7. Let m(u) = 7u2 + 8u + 8. Let t(s) = 6i(s) - 5m(s). Let n be t(-7). Let j(b) = -b - 8. Give j(n). -3 Let g(z) be the third derivative of -z5/60 - z4/12 - z*3/3 + 2z*2. Let w = 1 - 2. Let o be (-18)/6 - 0/w. Calculate g(o). -5 Let t(o) = -15o + 4 - 4 - 1 + 5o. What is t(1)? -11 Let r(n) be the second derivative of -1/6n*3 - 1/6n*4 - 6n + 0n2 + 1/20n*5 + 0. Give r(-1). -2 Let i(h) = 2h + 7. Let t = -7 + 9. Let f be 1 + (t - 2) + -6. Give i(f). -3 Let h(m) = m - 7. Let p be h(6). Let c = 3 - 2. Let o(n) = c - n - n - 2. Give o(p). 1 Let k be (-4)/(-12)3 + -8. Let s = -3 - k. Let o(p) = p3 - 4p*2 + p - 5. What is o(s)? -1 Let r(l) = -2l + 2 - 3 - 3. Determine r(4). -12 Suppose 5w = -0 - 5. Let g(o) = -o2 + 1. What is g(w)? 0 Let k(b) be the third derivative of b7/840 + b5/120 + b4/12 + b3/2 + b2. Let r(u) be the first derivative of k(u). Give r(2). 12 Let i(o) = -11o*2 + o. Let b(j) = -3j + 2j + 2j + 3j2 - 15j*2. Let n(f) = 5b(f) - 4i(f). Calculate n(-1). -17 Let i be ((-3)/(-2))/((-2)/(-4)). Let p = -3 + i. Suppose pu + 3u = -12. Let b(r) = -r3 - 5r*2 - 2r - 3. Give b(u). -11 Let t(u) be the first derivative of u*2 + 10. Give t(-1). -2 Let g be (-54)/(-36)10/(-3). Let d(x) be the first derivative of x*2/2 - 6x + 1. What is d(g)? -11 Let o(r) = r*2 + 3r + 3. Suppose -q - 2 = -2q + 3h, 5q + 4h = -28. Determine o(q). 7 Let c(i) = -4i + 3. Let m be c(-5). Let s(k) = -mk + 17k - 2k2 + k2 + 7. Determine s(-6). 7 Suppose -9 = 3m + c + 9, 4m + 4c + 24 = 0. Let b(v) = -2v - 5. Calculate b(m). 7 Let i = 1 - 1. Let z(l) be the first derivative of 1/3l3 - 1/4l*4 + 4l + 7 + 0l2. Determine z(i). 4 Suppose 3o = o + 6. Let h(b) = -3b2 - 2bo - b2 + 3b3 + 5 + 2b - 5b. Determine h(4). -7 Suppose 36 = 3p - 3q, 5p + 3q + 2q - 10 = 0. Suppose -u - 15 = -3j, -5j = -2u - 0j - 25. Let b(l) = -l + ul + p - 13. Calculate b(0). -6 Let z(r) = -6r - 2. Let a(w) = -12w - 5. Let k(l) = -3a(l) + 7z(l). What is k(1)? -5 Let z(b) = -11 + b3 + 13 + 3b*2 - b + 0b - 2b. Determine z(-4). -2 Let m(i) = 3i*2 - 2i + 7. Let p(l) = l*2 - l + 1. Let b(x) = m(x) - 4p(x). Determine b(-2). -5 Suppose -5o - 1 = -3z - 0, -z + 3o = 1. Suppose -1 = -zl + 3. Let w(f) = -2f + f + f3 + 5f*l - 6 + 0f. What is w(-5)? -1 Let i(z) be the first derivative of z4/2 - z2/2 + z + 1. Let a be ((-2)/8)/((-3)/12). What is i(a)? 2 Let c = 0 + 9. Let q be 21/(-9) - (-3)/c. Let i(g) = -4g2 - g + 2. What is i(q)? -12 Let f(y) = 0 + 7y + 2y + 1. Let n = 0 + -1. Let j = n + 0. Give f(j). -8 Let q(p) be the first derivative of -p2/2 - 5p + 11. Give q(0). -5 Let h(r) = r*3 + 6r2 + r + 6. Let s(o) = o3 + 11o2 - 9o + 30. Let y be s(-12). Give h(y). 0 Suppose 0 = -7k + 9k - 4. Let p(c) = -2 - c - kc + 4c - 4. What is p(6)? 0 Suppose -4a + 8 = -0. Suppose -3d + 2 = 5. Let y(s) = s*3 + 2s*2 - 4s. Let b(k) = -1. Let q(z) = dy(z) + 2b(z). Give q(a). -10 Let l(f) = -6 + 1 + 2 + f + f*2 + 2. Give l(2). 5 Let v(i) = -1 - 2 + i + 0 + 4 - 5i2 - i3. Suppose -4s = -4, -5s + 4s = 3x + 14. Give v(x). -4 Suppose -3x + 4t - 10 = 0, -2t - 2 = 2x - 14. Let z(b) = 22b2 - b3 - 22bx. Let q(r) = -r2 - r + 1. Let o be q(-2). Calculate z(o). 1 Let g(b) = -3b + 1 + 12 - 6 - 6. What is g(3)? -8 Let c(u) = 0 + u + 0 - 5 - 1. Suppose -1 = -n + 4. Determine c(n). -1 Suppose 5u = 2u. Let z(p) = -2p + up + 3p + 2. Calculate z(5). 7 Let z(q) be the third derivative of q*6/120 - 2q5/15 + q4/3 - 5q3/3 - 4q*2. What is z(7)? -3 Let b be (-96)/(-42) - (-4)/(-14). Let r(p) = -bp + 1 + 1 + p + 2p. Calculate r(-1). 1 Let k(f) be the third derivative of 1/12f*4 + 0f*3 + 1/60f*5 + 0 + 2f*2 + 0f. Give k(-2). 0 Let i(s) = -s*2. Let g(x) be the second derivative of -5x4/12 + x3/6 + 3x2/2 + 2x. Let t(o) = -g(o) + 6i(o). What is t(0)? -3 Let n be (-8 + -2)3/6. Let z(j) = j*3 + 5j*2 + 7. Calculate z(n). 7 Let w(l) = l. Let i = -2 + 1. Let z(y) = -2y3 + y2 + 2y + 1. Let b be z(i). Give w(b). 2 Suppose -2 = p + 1. Let z be -2 + 2 - 0 - p. Let m(b) = 3b*2 - 3b*2 + zb*2 - 4b*2 - 3 - 2b. Calculate m(-2). -3 Let d(y) be the second derivative of -y*5/20 + 5y*4/12 - 7y*2/2 - 5y. Suppose -4h - 19 = -3k, 3k = -2h + 4 + 9. Calculate d(k). -7 Let k(v) = v*3 + 4v*2 + 3v - 4. Suppose 3o + 0 = 6, 0 = -t + 3o - 2. Suppose -5i + 0c = tc - 31, i + 4c = 19. Suppose iu + 0u = -9. Determine k(u). -4 Let z(h) = -h*3 - 2h*2 - 5h + 6h - 7h + 3 - 4h2. What is z(-5)? 8 Let j(g) be the first derivative of g4/4 + 5g*3/3 - 4g*2 - 9g + 38. Calculate j(-6). 3 Let g(f) = f*3 - 3f - 41f2 - 3 + 46f*2 + 5f + 1. What is g(-4)? 6 Let j(m) = 692m3 - 11m - 11m2 - 4 - 693m3 - 6. Determine j(-10). 0 Let j(l) = l3 - 6l2 + 6l + 7. Suppose 5k - 44 = -19. Give j(k). 12 Let b(w) = -w3 + 5w*2 + 6w - 1. Let s(t) = -2t2 + 9t + 2. Let p be s(4). Calculate b(p). -1 Suppose 0 = n + 5v - 5, 2v - 4v = -2. Let t(z) be the third derivative of 1/3z*3 + 2z*2 + nz + 0 - 1/60z5 + 1/8z*4. What is t(3)? 2 Let t be (-4)/18 + (-232)/(-72). Suppose m - 12 = -0m. Let j be t3(-4)/m. Let k(y) = y*3 + 3y*2 + 2y - 1. Give k(j). -7 Let k(a) be the third derivative of -3a2 - 1/20a*5 + 2/3a*3 + 0 + 1/120a*6 + 0a + 0a4. Determine k(3). 4 Let o(w) be the first derivative of -8w3/3 - w2/2 - 1. What is o(1)? -9 Let c(v) = 17v3 - 14v*2 + 14v - 17. Let n(l) = -6l3 + 5l*2 - 5l + 6. Let w(o) = -4c(o) - 11n(o). Let f be (-2 + 0)(1 + -2). Give w(f). -12 Suppose -6z = -9z. Let u(g) = g2 - g - 4. Determine u(z). -4 Let l = 1 + 2. Let j(n) = n3 - 5n*2 + 2n - 1. What is j(l)? -13 Let t(a) = -14a3 - 3a*2 + 14a + 3. Let r(y) = 5y3 + y2 - 5y - 1. Let c(o) = 17r(o) + 6t(o). Calculate c(1). 0 Let y(f) = 5f3 + f2 - 2f + 1. Suppose 0 = -3q + 4x - 14, 3x - 3 = -3q + 18. Suppose 4t + q = 6. What is y(t)? 5 Let d = 19 + -13. Suppose 2q - d = -0q. Let o(m) be the first derivative of -m3/3 + m2 - 4m - 1. Determine o(q). -7 Let u(v) = 21v + 11v*2 - 1 - 5v - 14v - 2v2. What is u(1)? 10 Let a(k) = -k3 + 4k2 - k - 1. Suppose 12 = -2x + 5x. Give a(x). -5 Let v(b) be the second derivative of 0b*2 - 2b - 1/6b4 - 1/40b*5 + 0 + 0b*3 - 1/720b*6. Let t(u) be the third derivative of v(u). Determine t(-5). 2 Let h(q) = -15q*3 + 7q*2 - 3q + 11. Let c(w) = 7w3 - 3w*2 + w - 5. Let t(p) = -13c(p) - 6h(p). Determine t(-4). -5 Let q be (-16)/(-12)(-12)/(-8). Suppose -6t - 28 = q. Let g(x) = x2 + 5x. What is g(t)? 0 Let d(u) = u*2 - 2u - 1. Let f be 5 + -5 + 3 + 3. Let b be f - (3 + -1 + 1). Determine d(b). 2 Suppose 0 = -0j + 4j - 8. Let b(y) = 0 + y*3 - y + 0y + 0 + 1 - y*j. What is b(2)? 3 Let f(x) be the second derivative of 5x4/12 + x3/3 + x*2/2 - 18x. Give f(-1). 4 Let i(h) = -h. Suppose -6g + 3g = 2j + 11, -10 = j + 3g. What is i(j)? 1 Let k(w) be the second derivative of -w*3/6 - 4w*2 + 10w. Determine k(-4). -4 Let a be (-3)/(-1(0 - 1)). Let b = 6 + 1. Let q(h) = -6 - h + 9 - b. Calculate q(a). -1 Let m(k) = -k*2	{ "pile_set_name": "DM Mathematics" }
is prob of picking 1 s and 1 b when two letters picked without replacement from vvbzvsbvssvvmv? 6/91 Calculate prob of picking 2 p when two letters picked without replacement from ppp. 1 Three letters picked without replacement from {h: 6}. What is prob of picking 3 h? 1 Two letters picked without replacement from osoyddsyoso. What is prob of picking 1 d and 1 s? 6/55 What is prob of picking 1 g, 2 u, and 1 w when four letters picked without replacement from wueugvvk? 1/70 Calculate prob of picking 1 i and 1 r when two letters picked without replacement from rrrrrrrirrrirrrrrr. 32/153 Calculate prob of picking 1 s and 3 e when four letters picked without replacement from eeeseeeseee. 28/55 Calculate prob of picking 1 k and 1 v when two letters picked without replacement from {k: 1, m: 11, d: 2, p: 2, v: 3}. 1/57 Two letters picked without replacement from xdxxdrdxdrxxrrd. Give prob of picking 2 d. 2/21 What is prob of picking 1 t and 1 a when two letters picked without replacement from {r: 1, t: 1, a: 1}? 1/3 Calculate prob of picking 1 o and 1 x when two letters picked without replacement from ohjorjxorrrh. 1/22 What is prob of picking 1 j and 1 c when two letters picked without replacement from {c: 2, j: 3, p: 4, i: 1, e: 4, x: 1}? 2/35 Calculate prob of picking 2 d when two letters picked without replacement from {d: 2, h: 2}. 1/6 What is prob of picking 1 g and 2 a when three letters picked without replacement from rgrxaxggargxggx? 6/455 What is prob of picking 1 k and 1 a when two letters picked without replacement from {v: 6, k: 4, a: 2}? 4/33 What is prob of picking 2 a when two letters picked without replacement from llllllllallllaalll? 1/51 Calculate prob of picking 1 j and 2 z when three letters picked without replacement from {j: 12, z: 7}. 84/323 What is prob of picking 3 n when three letters picked without replacement from {n: 9, k: 3}? 21/55 Four letters picked without replacement from icciiiiciciccc. Give prob of picking 2 c and 2 i. 63/143 What is prob of picking 1 i and 1 o when two letters picked without replacement from yoyooydyyyldoddyiog? 5/171 Calculate prob of picking 3 k when three letters picked without replacement from {k: 4, v: 10, e: 6}. 1/285 Calculate prob of picking 2 u and 1 v when three letters picked without replacement from {z: 4, u: 2, l: 2, v: 7, j: 2, k: 2}. 7/969 Two letters picked without replacement from jttttttttjttttttjttt. Give prob of picking 2 j. 3/190 Two letters picked without replacement from {b: 2, y: 2, r: 1, h: 9}. Give prob of picking 2 y. 1/91 Three letters picked without replacement from zjkczcz. What is prob of picking 1 z, 1 c, and 1 j? 6/35 What is prob of picking 1 g and 1 u when two letters picked without replacement from {g: 2, c: 1, s: 4, u: 8}? 16/105 Two letters picked without replacement from {r: 5, o: 2, d: 7}. Give prob of picking 1 r and 1 d. 5/13 Calculate prob of picking 1 m and 1 y when two letters picked without replacement from myttaem. 2/21 Calculate prob of picking 1 g and 2 y when three letters picked without replacement from {g: 1, q: 1, e: 2, y: 6, z: 5}. 3/91 What is prob of picking 1 r and 1 p when two letters picked without replacement from {p: 7, c: 7, r: 2, k: 3}? 14/171 Calculate prob of picking 2 p when two letters picked without replacement from {p: 10, c: 4}. 45/91 What is prob of picking 2 l when two letters picked without replacement from {z: 4, a: 6, x: 1, l: 3}? 3/91 Calculate prob of picking 2 w when two letters picked without replacement from {w: 4, g: 1, s: 5}. 2/15 Three letters picked without replacement from {v: 2, c: 1, e: 2, p: 1, g: 1}. What is prob of picking 1 e, 1 g, and 1 c? 2/35 Four letters picked without replacement from {n: 5, s: 1, h: 2, z: 1}. What is prob of picking 2 z and 2 s? 0 What is prob of picking 1 a and 3 d when four letters picked without replacement from {j: 1, d: 3, a: 1}? 1/5 Two letters picked without replacement from wwjpjppwjwwwjwawwa. What is prob of picking 1 a and 1 p? 2/51 What is prob of picking 1 o and 1 n when two letters picked without replacement from {o: 8, m: 2, n: 6, u: 3}? 16/57 Calculate prob of picking 1 n and 2 j when three letters picked without replacement from ctnjjjjjtnnj. 9/44 Two letters picked without replacement from xsjxjjjjjj. Give prob of picking 2 x. 1/45 Two letters picked without replacement from {u: 1, g: 1, t: 1, o: 3, z: 1}. Give prob of picking 1 z and 1 t. 1/21 Two letters picked without replacement from {y: 17, i: 1}. What is prob of picking 2 y? 8/9 Two letters picked without replacement from {x: 1, i: 12, e: 1, j: 1}. Give prob of picking 1 x and 1 j. 1/105 Three letters picked without replacement from sjmmsmjskg. What is prob of picking 3 m? 1/120 Calculate prob of picking 1 j and 1 t when two letters picked without replacement from itujogtijti. 6/55 What is prob of picking 1 n and 1 s when two letters picked without replacement from smmmnhmn? 1/14 Three letters picked without replacement from ynxwxnwxwywwwwwywxxw. What is prob of picking 1 w and 2 x? 5/57 What is prob of picking 2 t when two letters picked without replacement from ktkkkt? 1/15 What is prob of picking 2 k when two letters picked without replacement from {k: 8, x: 2, t: 3, i: 1, u: 5, w: 1}? 14/95 Three letters picked without replacement from iiimoicmaaia. Give prob of picking 2 a and 1 m. 3/110 What is prob of picking 2 r and 2 q when four letters picked without replacement from rgrfqfqrgr? 1/35 Two letters picked without replacement from {x: 4, s: 11, u: 3}. What is prob of picking 1 x and 1 s? 44/153 What is prob of picking 1 b and 2 x when three letters picked without replacement from eeeexebxxexeebeeeex? 20/969 Four letters picked without replacement from {d: 16, c: 4}. Give prob of picking 4 d. 364/969 Three letters picked without replacement from {x: 3, k: 8}. Give prob of picking 3 x. 1/165 Calculate prob of picking 1 i and 1 f when two letters picked without replacement from fiwfifwww. 1/6 What is prob of picking 2 b and 2 u when four letters picked without replacement from uobuuvvooubbov? 18/1001 Three letters picked without replacement from {o: 1, g: 1, d: 1, s: 2}. What is prob of picking 1 g and 2 s? 1/10 Calculate prob of picking 2 q and 1 m when three letters picked without replacement from qqmqqqm. 4/7 Calculate prob of picking 3 m when three letters picked without replacement from aaammaaaaammmmma. 1/16 Three letters picked without replacement from {j: 1, m: 1, o: 1, c: 1, v: 1}. What is prob of picking 1 o, 1 v, and 1 c? 1/10 What is prob of picking 3 h when three letters picked without replacement from {h: 4, m: 3}? 4/35 What is prob of picking 1 f, 1 u, and 2 s when four letters picked without replacement from {f: 2, u: 3, s: 2, g: 4, d: 2}? 6/715 Four letters picked without replacement from {u: 4, x: 3, q: 2}. Give prob of picking 3 u and 1 q. 4/63 Three letters picked without replacement from {l: 4, r: 2}. What is prob of picking 1 l and 2 r? 1/5 What is prob of picking 1 j and 1 u when two letters picked without replacement from jujjjjujjujuju? 45/91 Two letters picked without replacement from {o: 1, t: 3, n: 2, s: 2, p: 4}. Give prob of picking 1 p and 1 o. 2/33 Calculate prob of picking 2 a and 1 u when three letters picked without replacement from {u: 2, a: 3, r: 1, j: 1, d: 4}. 2/55 What is prob of picking 2 q when two letters picked without replacement from {l: 1, q: 3, k: 1}? 3/10 What is prob of picking 1 h and 1 e when two letters picked without replacement from {o: 3, h: 2, u: 1, e: 1}? 2/21 Calculate prob of picking 2 m when two letters picked without replacement from qnmmnnnmmmqmnmm. 4/15 Three letters picked without replacement from {g: 5, z: 3, k: 2}. What is prob of picking 1 z, 1 g, and 1 k? 1/4 What is prob of picking 2 y and 1 e when three letters picked without replacement from eeyeeeyyee? 7/40 Calculate prob of picking 1 b and 1 h when two letters picked without replacement from {h: 1, b: 1, t: 1}. 1/3 Three letters picked without replacement from {z: 3, k: 12}. Give prob of picking 2 k and 1 z. 198/455 Three letters picked without replacement from {p: 9, a: 7}. What is prob of picking 3 p? 3/20 Two letters picked without replacement from {o: 5, m: 3, i: 2, j: 2, k: 1	{ "pile_set_name": "DM Mathematics" }
alse Do 0 and -44200460/3 have the same value? False Which is bigger: -18178 or -18218? -18178 Which is smaller: 70278781 or 351393902/5? 351393902/5 Is -37 bigger than 519298? False Which is smaller: 4/187997 or 1? 4/187997 Is 0 less than or equal to -17/1172033? False Which is smaller: 8303990/3 or 2767996? 2767996 Do -1427247/2 and -0.01 have the same value? False Which is smaller: -32 or -20417/618? -20417/618 Is 3/14 >= -9417202? True Which is smaller: -216562.9 or 9/7? -216562.9 Is 4240 equal to 63187? False Which is smaller: 7/6453768 or -2? -2 Which is smaller: 2280864 or 2280866? 2280864 Which is smaller: 45344768 or 45344765? 45344765 Is -8/77149 less than -0.11? False Which is bigger: 10852632 or 10852636? 10852636 Is 169186 != 169186? False Which is greater: 1834/3153 or 2? 2 Is -937654/2137 greater than -438? False Is -1 smaller than 2/236892345? True Is -0.3 at most -2875648? False Is 345958 at least 346047? False Is -7778699 <= -7778699? True Which is smaller: -103604 or -102362? -103604 Is -17494365 at most -17494365? True Which is smaller: -3/1038287024 or 1? -3/1038287024 Are -11.453 and 67351 nonequal? True Which is smaller: 362588 or 362652? 362588 Which is smaller: -0.1 or -12.2956448? -12.2956448 Which is bigger: -5183 or -17432? -5183 Which is greater: -197/2238579 or -1? -197/2238579 Is 0 at most -15/28622617? False Do 108272 and 108380 have different values? True Which is smaller: 0 or -1/29133730? -1/29133730 Which is bigger: -175425 or -174623? -174623 Do -7117767 and -7117767 have the same value? True Which is bigger: -1 or -4201/5778? -4201/5778 Which is bigger: -2169/6268 or -1? -2169/6268 Is 593843 bigger than 593834? True Which is greater: -34530821 or -1? -1 Which is bigger: 5347561 or 5347544? 5347561 Which is greater: -2797 or 1991.6? 1991.6 Is -105 equal to -196604/1881? False Which is smaller: -94721451 or -94721454? -94721454 Do -10077574 and 16 have the same value? False Which is smaller: -348.5 or 1/162? -348.5 Which is bigger: -25/102 or -2114/17? -25/102 Which is greater: 22 or -920.1479? 22 Is 372 less than or equal to 16195.6? True Is -16557060 >= -1? False Which is greater: 0 or -1029/3287920? 0 Is 337/21268 greater than 1? False Which is smaller: 1/26012 or -0.1317? -0.1317 Which is greater: -6007048 or -6007052? -6007048 Which is smaller: 1762/32741 or -1? -1 Does 227 = 102446/449? False Is 45999 at most as big as -142? False Is 70981743 at most as big as 70981743? True Do 80 and -647/227 have the same value? False Is -2693364 bigger than -10773459/4? True Does 16/2113055 = 0? False Which is smaller: 1 or -1648/79781? -1648/79781 Which is smaller: -2870 or -2885? -2885 Which is smaller: -15/1139 or 11031? -15/1139 Is -557/12375 < 1? True Which is bigger: 775231/518 or 1496? 775231/518 Do 1639.023 and -0.007 have the same value? False Is -26954815 at least as big as -26954815? True Do 3983963 and 3983962 have the same value? False Are 26869 and 4/625 equal? False Which is greater: 65475360 or 65475356? 65475360 Are 76261/8574 and 8 non-equal? True Which is smaller: 57/706687 or 0? 0 Is 11 at most as big as -1215865.6? False Is -23518834 greater than -23518834? False Do 0 and -3/1537127717 have different values? True Which is greater: -80219523 or -80219528? -80219523 Which is greater: 1 or 179/446? 1 Which is greater: -2179 or 1296? 1296 Which is greater: -3/35422 or -1048? -3/35422 Are 1168 and -128144 non-equal? True Is 189 != -19089? True Which is bigger: 47352 or 1336? 47352 Is -5703147 >= -5703113? False Is 71955 greater than or equal to 71892? True Which is smaller: -1 or -793/38021? -1 Do 2/26147629 and 1 have different values? True Is 9852 not equal to -410/169? True Is -5104169 at most -5104168? True Which is smaller: 3127422 or 15? 15 Are 1449531 and 1449550 equal? False Is 9478 greater than 7833? True Is -78099 greater than or equal to -77566? False Which is bigger: 2 or 28584/11485? 28584/11485 Which is greater: 41579 or -1.5? 41579 Which is greater: 0 or 19960/55741? 19960/55741 Is 389032 bigger than 389191? False Is 105104933 bigger than 105104935? False Is -1/708007322 >= 1? False Do 140938 and 841 have different values? True Which is smaller: 26101623/11 or 2372874? 2372874 Is -133997 less than -43? True Are -8.204 and 93758 non-equal? True Are -19/41725 and 2/5 nonequal? True Which is greater: 591998 or 593147? 593147 Is 521163 greater than 521406? False Which is bigger: -1562850/7 or -223264? -223264 Does -1528327 = -1528328? False Is -4740439 at most -4740439? True Is 621958 greater than or equal to 622174? False Which is bigger: 1/320345090 or 1? 1 Which is greater: -91794 or 3590? 3590 Is 15 smaller than -58886109? False Which is bigger: 30891 or 28183? 30891 Which is greater: 7 or -823449? 7 Which is smaller: 63100125 or 63100126? 63100125 Is -3.57 smaller than -13341? False Are -5282 and -5108510/967 equal? False Are -80835 and 69/40 nonequal? True Is -17571436 smaller than -17571434? True Is -92018 greater than -2852596/31? True Which is bigger: 8103 or 494347/61? 494347/61 Is 0 at least 6/46531? False Which is smaller: 137602628 or 137602626? 137602626 Which is smaller: -37481640 or -37481627? -37481640 Which is greater: -341 or -2/4886779? -2/4886779 Is -250811465/2 at least -125405732? False Is 0 < -120/17026277? False Which is bigger: 1454 or 275893? 275893 Which is smaller: 187223/85 or 0.1? 0.1 Which is smaller: -47600/1247 or 0.048? -47600/1247 Which is greater: 0 or 2178/53081? 2178/53081 Does 664.29 = -18? False Is 1082009 less than or equal to 1081988? False Is -164493406 smaller than -164493406? False Which is greater: 620 or 28485? 28485 Which is bigger: 1 or -49/175073? 1 Which is greater: 23438/51983 or 1? 1 Which is bigger: 20914136 or -3? 20914136 Which is bigger: -86 or 8213? 8213 Is 2654/29299 at most as big as 1? True Which is smaller: -30703176 or -30703175? -30703176 Which is greater: 4502303 or 13506905/3? 4502303 Which is smaller: 10691 or 14971? 10691 Do -7468 and -7365 have the same value? False Are -1 and -1167/34213 nonequal? True Which is greater: -1 or 32/5098151? 32/5098151 Is -177842878 >= -177842880? True Is 1512677/8 bigger than 189084? True Is 1 at least -3/6771418? True Is 2/156068755 <= 1? True Is -903/833342 > 0? False Which is bigger: -1 or 7/274770? 7/274770 Which is smaller: -5580 or -5662? -5662 Which is bigger: -2/3 or 15075670? 15075670 Is 2082627634 < 2082627634? False Which is bigger: 29239545 or 29239542? 29239545 Which is smaller: -9841/3689 or -4? -4 Do 3120 and 189 have the same value? False Is 1 at least -2/654642833? True Is 22/7 bigger than 46603/11? False Which is greater: -210054829 or 2/3? 2/3 Which is smaller: -56237 or 1564? -56237 Which is smaller: -4181323 or -4181335? -4181335 Is -1 <= 3/1831036? True Is -0.11 smaller than -4133928? False Which is smaller: 287029 or 82? 82 Which is smaller: -5/108813 or -2.97? -2.97 Which is smaller: 1843.698 or -5? -5 Is 19313302/9 >= 2145921? True Which is smaller: -23641475 or -23641472? -23641475 Is 4/341106715 smaller than 0? False Is -4993097 greater than -4993097? False Which is smaller: 94028 or 93927? 93927 Is -7075/414 at least as big as -18? True Is 5/113842819 at least as big as 0? True Is -5827135 <= -5827152? False Which is smaller: 131348 or 1372? 1372 Which is smaller: -719541866/7 or -102791695? -719541866/7 Is -2558377 smaller than -2558362? True Are -8259.8 and -609 unequal? True Is -315181/13 at most -24246? False Which is bigger: 11/6090101 or 0? 11/6090101 Which is greater: -16586 or -16320? -16320 Do -1188279 and -1188276 have the same value? False Which is bigger: -48/11 or -1939768? -48/11 Is 70204/371 at least 189? True Which is smaller: 0 or 2/1671890887? 0 Does -2676581/6 = -446098? False Is 5000 smaller than 724939/145? False Which is greater: 9338/99349 or -1? 9338/99349 Are 231 and 587950 unequal? True Does 365719/54 = 6772? False Is 0.4 > 2798547? False Which is bigger: 1/82176963 or 0? 1/82176963 Is 330 at most as big as 20059/61? False Is 122383 greater than 122399? False Is -4.3 not equal to -543958? True Is -1 < -2/105217347? True Is 1571062 less than or equal to 1571632? True Which is greater: 0.013888 or 2051? 2051 Which is smaller: 1234187	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.