Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
0 + 3g) - 973g + 7143g - 37g + 3587g - 182g)(-1 - 4 + 3) as a + sg and give s. -19088 Express (-5f + 2f + 4f)(-18149f2 + 36329f*2 + 24 - 902f + 243f - 18178f*2) in the form sf + mf2 + w + tf*3 and give s. 24 Express -73z*3 - 101z*3 + 142z*3 + (-2 + 3z + 2)(8z*2 - 36z*2 - 3z2) + z3 + 0z3 - 3z*3 in the form iz*2 + rz + v + pz3 and give p. -127 Express (x3 - 3x*3 + 0x*3)(-1461 + 2x - 1622 + 56) + 0x*4 + 0x*4 + 2x*4 in the form lx*3 + n + bx*4 + ax*2 + yx and give b. -2 Express -3u3 + 3u*3 - 6u*4 + (-15u*2 - 2u*3 + 15u*2)(4141 - 4143 + 85u + 113u) in the form t + yu3 + hu*4 + fu*2 + mu and give h. -402 Express 2g - 3g + 0g + (-1 + 0 - 1)(-2g - g + 4g) - 4137g - 13 - 8173g + 21 - 8 in the form rg + h and give r. -12313 Express 1755c - 1753c - 1 + 92c4 + c2 + 16c4 as uc*2 + pc + v + rc3 + jc*4 and give j. 108 Express 8h*3 - 367h*2 - 19h*3 + 16 - 11 + 7h*3 + 3h*3 as kh*3 + vh*2 + z + bh and give v. -367 Rearrange -2i3 - i3 + 2i*3 + (-172i*3 - 155i*3 - 29i*3)(-3 - 1 + 1) to zi3 + hi*2 + di + g and give z. 1067 Rearrange (-7h - 32 + 32 + (-2h - 1 + 1)(-3 + 1 + 3))(84 + 111 - 37) to yh + a and give y. -1422 Express -202t*2 + 4345540t - 4345540t - 20t*3 in the form ft*3 + mt*2 + l + ht and give h. 0 Express 11968f + 761044 - 761044 as qf + m and give q. 11968 Express (-266t + 1528t + 1311t)(4 - 2 + 0)(2t*2 - 4 - 2t + 4) as ct2 + a + rt + wt3 and give r. 0 Express 62 - 25q - 193 + 208q + 63 + 67 as k + bq and give k. -1 Rearrange -4l4 - 6l*4 + 6l4 + (l4 + 0l + 0l)(-2 + 3 + 7) to the form w + nl*4 + yl + fl3 + vl*2 and give f. 0 Rearrange -3a + 21a + a - 18a - 2280 to sa + f and give f. -2280 Rearrange (2 + x2 - 2)(16 - 31 + 29 - 4 + 4 + 2 + (4 - 6 + 4)(-3 + 4 + 0) + 0 - 4 + 3 - 3 + 1 - 2) to the form qx + nx2 + y and give y. 0 Rearrange 793548i*2 - 803485i*2 + 0i + 0i to c + bi*2 + ai and give b. -9937 Rearrange j*4 - 2j4 - j4 + (0j4 + 0j4 + j4)(0 + 1 - 4) + 12816j - 101j4 - 12816j to pj + o + bj*4 + mj*2 + rj*3 and give b. -106 Rearrange o - 3o + 4o + (3o - 2 + 2)((-3 - 1 + 2)(24 - 54 + 24) + (0 - 1 - 1)(3 + 0 - 4)) + 6o + 7o - 5o to the form r + wo and give w. 52 Express 0z*4 + 0z4 + z4 + (5z2 - z2 - 3z*2)(z - 2z2 - z) + 3087z*4 - 3202z*4 + 2035z*4 as cz*3 + jz + pz4 + l + wz*2 and give c. 0 Rearrange (-1 - 1 + 4 - 2a)(-3 + 3 + 2a*3) - 6027a*4 + 1065a*4 - 8294a*4 to the form ca*2 + da + z + ba3 + ra4 and give r. -13260 Rearrange (-i2 + i*2 + 2i*2)(18752 + 17529 + 6073 - 7729) to the form pi + l + hi*2 and give l. 0 Rearrange (9 - 2 - 3)(-1 + 1 - 28)(2 - 4 + 3)(-1 - 3f + 1) to sf + c and give s. 336 Express (((-3 + 0 + 2)(-2 + 4 + 0) - 38 - 1 - 1)(3l + 8l - 10l) - 2l - 2l + 2l)(-3 + 1 + 3) in the form kl + b and give k. -44 Express 13 - 28 - 448x + 16 + 2x + x - 4x - 4x + 6x + 0x + x + 0x - 2x + (3x + x - 2x)(-4 - 2 + 4) in the form bx + i and give b. -452 Rearrange 2c3 + 30186c*2 + 34c*4 - c - 30184c*2 + 6c*3 + 2 - 2c - 4c3 to the form m + tc*3 + hc*2 + gc*4 + vc and give h. 2 Rearrange 6 + 464t + 1127t + 2481t - 6 to bt + k and give b. 4072 Express -601n + 199n + 200n - 11 + 11n*3 + 200n + 7n4 as bn*2 + cn*4 + rn*3 + qn + t and give c. 7 Express (44 + 15t2 - 44)((-4 + 2 - 2)(3t + 3t - 4t) + 14t - 6 + 6) as zt + vt2 + wt*3 + r and give w. 90 Express 2u*2 - 35u + 40u + 52u + 87u as pu + o + nu2 and give p. 144 Express (5 + 0 + 0 + 2)(-4245 - 5541 - 3205)(1 - b - 1) in the form ob + x and give o. 90937 Express (-3 + 0 + 5)(445 - 74 + 1115 + 343 + 5q + 266) in the form uq + n and give n. 4190 Rearrange (-2i + i3 - i3 + 2i2 + 1 - 2i*3)(35 - 156 - 79) to the form fi2 + l + ui*3 + yi and give y. 400 Rearrange 656c2 - 1 - 2c + 1 + 1300c2 to the form i + nc + uc2 and give u. 1956 Rearrange (33k*2 - 55k*2 + 2k - 93k2)(20k + 7 - 10k - 4) to nk2 + a + tk + qk3 and give t. 6 Rearrange 2 - 4 + 72y + 273y2 + 278y*2 - 569y2 - y3 to the form qy + t + py*2 + vy*3 and give v. -1 Rearrange 518 + 2769x - 176 - 170 - 172 to the form ix + v and give v. 0 Express -1 - 48h + 41h + h2 - 354h as r + wh2 + zh and give z. -361 Rearrange -128x2 + 391x*2 - 122x*2 - 143x*2 + 910x to ax + m + rx*2 and give a. 910 Rearrange 2572s*3 - 17s*3 + 65s*3 + 129s*3 + 2 to ls + x + ts3 + ms*2 and give t. 2749 Rearrange -5s*3 - 76s + 102 - 4s2 - 100 + 72s + 0s2 to the form c + ds*2 + gs + ps3 and give d. -4 Express 3670j - 1840j - 1833j - 60j2 + 1 + 3j*3 - 1 as i + dj*2 + mj + oj3 and give m. -3 Express -20194a + 2927a - 5241a as q + na and give n. -22508 Express -3281h - 10219h + 745h - 1263h as fh + d and give f. -14018 Rearrange -6 + 675j + 7 - 1 - 2358j to the form mj + v and give m. -1683 Express -60 + 30 - 84 - 42b + 33b - 85 as cb + v and give c. -9 Express (12 - 129 + 16)(-3f*3 - 11f*3 + 3f*3) as rf + kf2 + nf*3 + p and give r. 0 Rearrange 19i*2 - 17i*3 - 24i*3 - 27i*2 + 9i*2 + i + 1 + 0i + i*4 to the form x + yi + ci3 + ai*2 + wi*4 and give w. 1 Rearrange 3755i + 8241i - 2125i - 1904i + 10974i to the form si + q and give s. 18941 Express -1665t + 485t2 - 3t*3 - 569t*2 - 2040t*2 + 1667t as ct3 + nt + s + pt2 and give n. 2 Rearrange 1 + 126h*4 - 127h*4 + 114h2 + h3 - 3h3 + 25h*2 to nh*2 + x + bh*3 + kh + lh4 and give l. -1 Rearrange -3g + 86g + 10g - 41g2 + 256g to p + qg2 + bg and give b. 349 Express 2083 + 838 + 584 + 2x as d + gx and give d. 3505 Rearrange (13 - 6 - 6)(430403 - 430403 - 10m) to the form r + ym and give y. -10 Rearrange (2p*2 - 33 - 24 + 48)(1 - p - 1)(-6 - 4 + 5)(18 - 18 + 2p) to kp*4 + zp*2 + o + lp*3 + yp and give k. 20 Express 4u3 - 135u - 52u + 32942u*2 - 2u*3 - 32938u*2 as bu + gu3 + mu*2 + j and give j. 0 Express -40k*4 + 67430k - 67432k + 0 + 2 - 2 - 12k*3 + 2k*2 as gk*4 + xk*2 + b + uk*3 + ck and give u. -12 Rearrange 6m3 + 2911m*2 - 5770m*2 + 2853m*2 + 222m to the form jm3 + x + am*2 + sm and give j. 6 Rearrange 27 + 232k3 - k2 + k2 - 448k*3 + 294k*3 to the form yk*3 + mk + qk2 + r and give q. 0 Express 2487w + 2147w + 1803w - 1428w + 225 - 226 in the form o + dw and give d. 5009 Express -l*2 + 58l + 4 + 1 - 3 - 5l4 - 1200l - 89l3 + 91l*3 as gl*4 + k + bl + sl2 + ql*3 and give g. -5 Express -10 - 54h*2 + 37h*2 + 20h*2 + 11h in the form qh + p + mh*2 and give m. 3 Rearrange -41n*3 - 108n*3 - 109 + 148 - 37 + 5n*2 to hn*3 + tn*2 + wn + g and give t. 5 Express (4x + 3x + 0x)(-3 + 7 + 1) + (0 + 18 + 2)(3x + 3x + 7x) as i + dx and give d. 295 Express (59s*3 + 24s*3 + 348s*3)(-s + 2s - 2s) + 3s + 2s*4 - 3s as vs4 + js*3 + us*2 + ps + g and give u. 0 Express (-2d + 0 + 0 + (-1 - 5 + 5)(d + 0d + d))(-135 - 187 + 111)(25 - 10 - 11) as r + pd and give p. 3376 Express 93u3 - 300u + 4u2 + u4 - 90u*3 + 6 - 3u*2 - 2 - 6 as ru*4 + nu + hu3 + j + zu*2 and give j. -2 Express (-2788x*3 + 2361x*3 + 0x - 3x)(3x - x - 3x) as dx3 + yx*4 + kx + s + lx2 and give l. 3 Express -7c - 2c + 11450 - 11451 + 0 + 0 - 2c + (-5 + 2 + 1)(-5c + 2c + 5c) - 24c + 0 + 5 - 4 as m + pc and give p. -39 Rearrange 2030102o2 + 2o*4 + o + 1 + 50o*3 - 2030107o*2 - 4 to the form fo*2 + vo + so4 + t + co*3 and give f. -5 Express -1417w*2 + 713w*2 - 84w*3 + 705w*2 + 5w*4 in the form hw*4 + ow*2 + sw + pw3 + b and give o. 1 Express -x3 + 820 - 2x*4 - 449 - 369 + 103x - 3x4 in the form wx*3 + a + jx*2 + tx + gx4 and give a. 2 Rearrange -5106c*2 - 1870c*2 - 9452c*2 - 3762c*2 + 660c*2 to h + sc + tc2 and give t. -19530 Express (-856j*3 + 1609j*3 - 41j + 75j - 855j*3)(3*	{ "pile_set_name": "DM Mathematics" }
s the second derivative of d(t) wrt t? -1224t2 Let h(n) be the first derivative of -3n*5/2 + 41n*4/12 - 9n - 40. Let m(z) be the first derivative of h(z). What is the third derivative of m(y) wrt y? -180 Let o(k) = 153k2 - 3k + 64. Let m(t) = 308t2 - 5t + 127. Let y(i) = -3m(i) + 5o(i). What is the first derivative of y(b) wrt b? -318b Let j(c) be the second derivative of -c3/6 - 9c*2/2 + c. Let s be j(-10). What is the first derivative of 3a - s - 4 + a + 0 wrt a? 4 Find the second derivative of -4 - 1701a2 + 16a + 849a2 + 852a*2 - 165a*3 wrt a. -990a Let i(m) be the second derivative of -m*5/10 - 10m*4/3 - 77m3/2 + m2/2 + 271m. What is the second derivative of i(w) wrt w? -12w - 80 Let p = 1 + -33. Let v be p/(-5) - 24/(-40). Let w(i) = 13i + 21. Let h(n) = -4n - 7. Let f(r) = vh(r) + 2w(r). What is the derivative of f(x) wrt x? -2 Let t(v) = -31v3 + 7v + v + 32v3 + 10v*2 - 7. Let h be t(-9). Find the third derivative of 7s*4 - 5s*h - 8s*4 + s - s wrt s. -24s Differentiate -55 + 16p4 - 42 + 36p*4 + 20 wrt p. 208p*3 What is the third derivative of -223s - 248s6 + 237s2 - s5 + 272s6 - 235s*2 wrt s? 2880s*3 - 60s*2 Differentiate 33 + 149b + 29 - 39b - 35 + 7 with respect to b. 110 Let p(u) be the first derivative of 73u*3 - 34u + 564. What is the first derivative of p(t) wrt t? 438t Find the second derivative of 1861z*2 + 3z*3 + 55z + 4z4 - 1861z*2 wrt z. 48z*2 + 18z Let o(b) be the third derivative of 119b4/12 - 22b*3/3 + 30b*2. What is the first derivative of o(k) wrt k? 238 Suppose 4v - 7 = 1. Differentiate -12 + 4bv - 9b*3 - 8b*2 + 4b*2 wrt b. -27b*2 Suppose 12s - 5s = -0s. Let a(p) be the first derivative of 0p4 - 7 - 1/2p*2 + 0p + sp3 - 1/5p*5. What is the second derivative of a(f) wrt f? -12f*2 Differentiate 134a + 137a + 149a*2 + 491 + 130a + 137a - 539a wrt a. 298a - 1 Suppose 4p - 30 = -5w + p, -p = w - 8. What is the second derivative of 5m*5 + 32m*5 + 3m*5 - wm*5 + 34m wrt m? 740m3 Let q = -21 - -31. Let t = -8 + q. What is the third derivative of -11h*t - 11h*4 - 9h + 9h wrt h? -264h Let j(b) = -3b4 - b3 + 177b. Let p(h) = 2h4 + 2h*3 - 178h. Let a(f) = -3j(f) - 2p(f). Find the second derivative of a(r) wrt r. 60r2 - 6r Let s(u) be the third derivative of 0 + 0u + 0u*4 + 7/60u5 + u2 + 1/40u6 + 0u3. Find the third derivative of s(w) wrt w. 18 Let g(q) = -q2 + 10q - 21. Let p be g(6). Let i(n) = -n2 - 11n. Let v be i(-11). Find the third derivative of 7o2 + vo*p + 3o*3 - 2o*2 wrt o. 18 Let j(x) be the second derivative of -115x*3/6 - 87x*2 + 517x. Find the first derivative of j(r) wrt r. -115 Let s(m) = -m3 - m2 - 1. Let q(j) = -175j3 + 3j*2 - 56. Let b(d) = q(d) + 3s(d). Differentiate b(k) wrt k. -534k2 Suppose 0 = -4j - 4l + 12, -l - 3l - 8 = -j. Find the second derivative of -jc4 - 21c - c*4 + 6c*4 wrt c. 12c*2 Let a = 13 + -13. Let v = a + 2. Differentiate v - 4 - 3q*2 + 0 wrt q. -6q Let k(v) be the second derivative of -83v4/12 - 16v*2 - 2v - 70. What is the first derivative of k(j) wrt j? -166j Let n(f) be the third derivative of 1/120f*6 + 0f*4 + 0f + 0 + 0f5 + 4f*2 + 4/3f*3. Differentiate n(m) with respect to m. 3m2 Let u(t) = -t2 + 4t + 1. Let v be u(3). What is the third derivative of -12c*4 + 19c*2 + 41c*v + 11c*2 wrt c? 696c Let n(o) be the third derivative of 1/3o5 + 0 + 5/42o*7 + 0o*4 - 24o*2 + 0o*6 + 0o*3 + 0o. What is the third derivative of n(z) wrt z? 600z Let l be 0/(2/6-3). Suppose l = k + 3 - 7. Find the third derivative of 2u4 + 0u*2 + ku*2 - 5u*4 wrt u. -72u Let v(u) be the second derivative of -u*7/14 - 31u*4/12 - 2u*3/3 - 21u*2/2 - 724u. Find the second derivative of v(f) wrt f. -60f3 - 62 Let d(q) = q3 - 8q*2 + 10q - 16. Let v be d(7). Differentiate -7u2 + 4u*2 - vu*2 - 2u*2 - 8 with respect to u. -20u Suppose 14a = 16a - 10. Find the second derivative of j*a - 29j*2 - 27j - 31j2 + 41j*2 wrt j. 20j*3 - 38 Let m be (-14)/21(-3)/2. Suppose -2q + 5 = -m. What is the third derivative of i2 - 4i*3 - 5i*2 + 2i*q wrt i? -12 Let f(j) = 4 + 0 + 6j*3 + 0 - 21j*4 - 19. Let p(c) = 20c*4 - 5c*3 + 16. Let g(z) = -5f(z) - 6p(z). What is the first derivative of g(o) wrt o? -60o*3 Let c = 92 - 90. Find the second derivative of -21z + 7z + 3z + cz2 + 25z*2 wrt z. 54 Let v(j) be the third derivative of 73j*5/60 - 61j*3/6 - 10j*2 + 1. Find the first derivative of v(o) wrt o. 146o Let c = 21 - 17. Let u be (1 - 0) + 2 + -1. Find the first derivative of 0 + g*4 - ug*c + 1 wrt g. -4g*3 Let b(s) be the second derivative of 0s*2 + 1/12s*4 - 2s + 11/20s5 + 5 - 9/2s*3. What is the second derivative of b(a) wrt a? 66a + 2 Let c(p) = -p*2 - 10p - 4. Let u be c(-9). Differentiate -11l2 + l2 + 6l*2 + u with respect to l. -8l Suppose 0 = -2c - 4j - 8, -8c = -3c + 3j - 8. Differentiate 12 - 24h + 2h - 5 + ch wrt h. -18 Let r(v) = 3v + 82. Let b be r(-17). Find the third derivative of bo*2 + 39o*6 + 58o + 63o - 121o wrt o. 4680o3 Suppose -5k + 9 = -p - 8, 11 = -3p + 5k. Let n be 10/4(p - 1). Find the third derivative of -ns*3 + 4s*3 - 2s3 - s2 + 0s2 wrt s. -18 Suppose 0 = -14m + 10m + 16. Find the third derivative of 16q*2 + 14q*4 - 18q*2 - 4q*m wrt q. 240q Suppose -3 = g + 3v, 3g = -2v + 5 - 0. What is the derivative of -6741 + 16b*g + 13b*3 + 6733 wrt b? 87b*2 What is the derivative of 36 + 21 - 41 - 3s + 3s3 + 13s + 60 wrt s? 9s2 + 10 Suppose 4i - 51 = 41. What is the first derivative of ih3 - 11h*4 + 5 - 23h*3 wrt h? -44h*3 Suppose 7 - 5 = i. Let b = i - -3. Find the third derivative of -2w*b + 0w*5 + 3w*2 - 6w*2 + 4w*2 wrt w. -120w*2 Let k(w) be the first derivative of -4w*7/7 - 8w*4/3 + 7w - 20. Let l(r) be the first derivative of k(r). What is the third derivative of l(i) wrt i? -1440i2 Let b(u) be the second derivative of 5u*7/7 + 28u*3/3 - 10u + 7. What is the second derivative of b(w) wrt w? 600w3 Let x(c) = -c2 - c - 1. Let b(d) = -22d*2 + 2d + 28. Let w(q) = -b(q) - 2x(q). What is the first derivative of w(g) wrt g? 48g Let y(f) be the third derivative of -3f4/2 + 38f3/3 - f2 - 51. Find the first derivative of y(k) wrt k. -36 Let j(p) = 24p - 24. Let m(v) = 10 + 2v - 14 + v + v. Let s(b) = 6j(b) - 34m(b). What is the derivative of s(d) wrt d? 8 Let i(w) be the first derivative of 5w6/6 + 85w*3/3 + 551w*2/2 - 661. Find the second derivative of i(a) wrt a. 100a*3 + 170 Find the third derivative of 52i2 + 25 - i4 + 8i6 - 56i - 54i2 - 25 wrt i. 960i*3 - 24i Let w be 6/15 + (-186)/(-10). Let z = 25 - w. Find the second derivative of 8h + 5h*2 + zh - 2h - 2h wrt h. 10 Suppose -5q = -0 - 80. Let r = 20 - q. What is the third derivative of 8k*2 - 2k*4 - rk*6 + 2k*4 + 5k*6 wrt k? 120k*3 Let c(l) be the first derivative of -73l*3/3 - 26l + 28. What is the derivative of c(r) wrt r? -146r Let j = 65 + -30. What is the second derivative of 33s - 59s - 14s*2 + js wrt s? -28 Differentiate 547 - 47i - 93i - 488 - 27i wrt i. -167 Let x(p) = -33p*3 - 66p2 - 1. Let j(o) = o2 - 1. Let t(n) = -j(n) + x(n). What is the third derivative of t(w) wrt w? -198 What is the third derivative of -123l2 + 74l*4 - 97l*4 + 56l*4 wrt l? 792l Let g(h) be the third derivative of 7h5/4 + h4/24 - 25h*3/3 + 72h*2. What is the second derivative of g(z) wrt z? 210 Suppose 0 = -13q + 18q - 25. Find the second derivative of 4n - 26nq + 39n + 37n5 wrt n. 220n*3 Let c(s) = 113s*2 + 8s + 4. Let j(t) = 117t2 + 9t + 4. Let b(o) = -5c(o) + 4j(o). What is the second derivative of b(x) wrt x? -194 What is the third derivative of -5 - 36r2 - 11821r4 - r5 + 32r6 + 11821r*4 - 1 wrt r? 3840r*3 - 60r*2 Let y(r) be the third derivative of -21r*5/5 - 157r*3/6 + 304r*2. What is the derivative of y(q) wrt q? -504q Suppose d - 6 + 22 = 0	{ "pile_set_name": "DM Mathematics" }
ivative of -983h6/30 - 463h*2/2 + 11h - 22. What is the first derivative of w(i) wrt i? -3932i3 Let n(q) = 4 + 37q + 124q3 - 143q + 71q. Let t(l) = -121l*3 + 36l - 5. Let f(o) = -5n(o) - 4t(o). What is the second derivative of f(j) wrt j? -816j Let j = -337 + 341. What is the derivative of -41u*j + 0u*3 + 14 - 5u*3 - 12u*4 + 6u*3 wrt u? -212u*3 + 3u*2 Let b(d) be the second derivative of -751d*5/20 - 57d3/2 - d2 + 68d. Find the second derivative of b(u) wrt u. -4506u What is the second derivative of -324d2 + 16d*2 - 535d*2 + 1209d + 77d2 wrt d? -1532 Let a(f) be the first derivative of -48f6 - f4/2 - 3815f2/2 + 624. What is the second derivative of a(i) wrt i? -5760i*3 - 12i Let h(c) be the second derivative of 36c7/7 - 5c*4/12 - 26c*2 - 2c + 114. Find the third derivative of h(u) wrt u. 12960u2 Let g(j) be the first derivative of -8j*4 - 23j3/3 - j2/2 - 66j - 1357. What is the second derivative of g(u) wrt u? -192u - 46 Suppose 5038 = 11n + 990. What is the first derivative of -224 + n + 9s*3 - 31s*3 + 4s wrt s? -66s2 + 4 Let x(a) = -2a + 10. Let p be x(-7). What is the derivative of 8v2 - pv*2 + 18v*2 + 72 - 45v wrt v? 4v - 45 Find the second derivative of 400429k*2 - 9 + 30k - 399358k2 + 36 wrt k. 2142 Let n(w) be the second derivative of -w6/10 - 113w*5/5 + 3w*4/4 - 19w*3/6 - 3297w. Find the third derivative of n(s) wrt s. -72s - 2712 Let p(x) be the third derivative of -99x*7/35 - 1385x*4/24 + 1007x*2 - x. Find the second derivative of p(q) wrt q. -7128q*2 What is the third derivative of -322347 - 923t*3 + 161174 + 4702t*2 + 161173 wrt t? -5538 Differentiate 383 + 215m - 1330m - 565m with respect to m. -1680 Suppose 58h = 50h + 16. What is the second derivative of -1682sh + 1666s2 + 0 + s3 - 21s + 0 wrt s? 6s - 32 Suppose 2a - 4a = -36. Suppose k = a - 1. Find the first derivative of 3t3 - k + 9t3 + t3 wrt t. 39t2 What is the third derivative of 11d*5 + 327d*2 - 329d*2 - 5d*5 - 39 + 50d*3 - 42d*3 wrt d? 360d*2 + 48 Let i(u) be the third derivative of 0 + 42u*2 - 2u - 21/8u4 - 31/3u*3 + 0u*5 - 1/120u*6. What is the derivative of i(n) wrt n? -3n2 - 63 Let h(z) = z2 - 29z + 83. Let s be h(27). Find the first derivative of -s + 9c*2 + 5c*2 + 31c*2 wrt c. 90c Let t = 34 + 20. Let o = t - 52. Find the third derivative of 106u4 + 25u*2 - 123u*4 - 5u*o wrt u. -408u Let f(m) = 30m - 93. Let g be f(4). What is the derivative of -53 + 78i*2 - 64i*2 - gi*2 wrt i? -26i Let u(s) be the second derivative of -s*4/6 - 1237s*3/6 + 1185s*2/2 - 1474s. What is the derivative of u(i) wrt i? -4i - 1237 Let z(o) = 136o + 24. Let d(c) = 331 - 250c + 731c - 65 + 1017c. Let t(f) = 6d(f) - 68z(f). What is the first derivative of t(g) wrt g? -260 Let g(v) = -1. Suppose -3l + 45 = -12l. Let u(p) = 44p + 84. Let f(q) = lg(q) - u(q). Differentiate f(b) wrt b. -44 Let l(x) be the third derivative of -39x7/70 + x6/8 - 855x3/2 + 5090x*2. What is the derivative of l(c) wrt c? -468c*3 + 45c*2 Suppose -3u + 30 = 3u. Let d = u - 3. Find the third derivative of -9 + 7k*d + 9 + 3k*3 wrt k. 18 Suppose -s - 2s = -2o + 4, 14 = 2s + 2o. Suppose -4 = sg - 8. What is the third derivative of 88t2 + 81t*2 + 6t*5 - 158t*g wrt t? 360t*2 Let x(z) = -6649z*2 - 34z + 364. Let m(b) = 950b2 + 5b - 52. Let t(a) = -41m(a) - 6x(a). What is the second derivative of t(s) wrt s? 1888 Let h be (-13)/(-4) + (-3)/12. Suppose -6z = -5z - h. Find the first derivative of -11 - 40t4 + 11t*4 - zt*4 wrt t. -128t*3 Let j(a) be the third derivative of 2411a*7/210 + 271a*5/10 - 34a*2 + 2. What is the third derivative of j(l) wrt l? 57864l Find the third derivative of -2302p4 - 604p*4 - 3661p*2 + 136p*4 + 3389p*2 wrt p. -66480p What is the second derivative of 273 - 268 + 3y3 - 5530y*5 + 38y - 404y - 3y*3 wrt y? -110600y*3 Let o = 68 - 65. Let h(l) be the first derivative of -19l + 25 - 7l3 - 27 - 15 + ol*3. What is the derivative of h(g) wrt g? -24g Let g(w) = 221w2 - 2993w + 28511. Let y(v) = 138v2 - 1996v + 19007. Let d(f) = 5g(f) - 8y(f). Differentiate d(s) wrt s. 2s + 1003 Let b(z) be the first derivative of 0z*4 + 0z*2 + 0z - 7/5z5 - 68z*3 - 10. What is the third derivative of b(p) wrt p? -168p Let v(l) = -2l2 - 7l + 8. Let h be v(4). Let i be (-216)/h - 4/26. What is the third derivative of a*4 + 2a*4 - 3a4 + ai - 24a2 wrt a? 24a Let d(i) = 1247i5 - 2i*2 - 517i + 1. Let a(r) = 2496r5 - 3r*2 - 1034r + 1. Let w(s) = 3a(s) - 5d(s). Find the second derivative of w(m) wrt m. 25060m3 + 2 Let s(h) = 3258h*4 + 5819h*2 + 4. Let k(z) = 6515z*4 + 11639z*2 + 7. Let b(x) = 4k(x) - 7s(x). What is the third derivative of b(v) wrt v? 78096v What is the second derivative of 202k - 645k - 199k3 - 177k*3 - 601k + 265k3 wrt k? -666k Let r(v) = 19685v2 - 16v + 26261. Let y(a) = -26247a2 + 22a - 35014. Let z(g) = -11r(g) - 8y(g). What is the derivative of z(m) wrt m? -13118m Let i(j) be the first derivative of 0j*2 + 23 + 103/3j*3 + 43/4j*4 + 0j. What is the third derivative of i(y) wrt y? 258 Let h(u) be the second derivative of 29/6u3 + 230u + 0u2 - 137/12u*4 + 0. Find the second derivative of h(l) wrt l. -274 What is the second derivative of -60 - 73m + 65m - 1004m*2 - 26 + 2832m*2 wrt m? 3656 Let l(c) = 4c + 1. Let i(h) = -299 + 8h - h - 6h + 298. Let b = 14 - 8. Let d(g) = bi(g) - l(g). What is the first derivative of d(k) wrt k? 2 Let f be -61 + (6/8)/(3/12). Let w = f + 82. Find the second derivative of 21x*3 - wx - 4x - 7x - 2x3 wrt x. 114x Let v = 127 - 125. Suppose -s = -3g + 27 + 95, -8 = -vs. Find the second derivative of -gw + 50w*2 + 49w*2 - 110w*2 wrt w. -22 Let u(p) be the third derivative of 2p*7/35 + 2p*5/15 - 571p4/8 + p3/3 + 2p2 - 88p. What is the second derivative of u(l) wrt l? 144l2 + 16 Let s(c) = 2c*2 + 6c + 6. Let w be s(-3). Suppose -t + 2 = d, 2d + wt - t = -5. Find the second derivative of df2 - 38f*2 - 8f - 10f wrt f. -66 Let g(p) be the first derivative of 117/2p*2 - 16p + 109. What is the first derivative of g(w) wrt w? 117 Let d(r) = -5094r + 8725. Let t(x) = 5093x - 8754. Let n(a) = 4d(a) + 5t(a). Differentiate n(z) wrt z. 5089 Let y(w) = 2w2 - 1. Let f(i) = -4278i*4 - 4215i*2 - 14. Let z(a) = f(a) - 14y(a). What is the third derivative of z(o) wrt o? -102672o Let q(x) be the first derivative of 5x*6/2 + 23x4/4 - x3/3 - 144x2 + 4x + 1042. What is the third derivative of q(p) wrt p? 900p2 + 138 Let q(l) be the third derivative of -257l*5/6 - 515l3/2 - l2 + 516. What is the first derivative of q(i) wrt i? -5140i Find the first derivative of 72318 - 71855 + 334u - 984u wrt u. -650 Suppose -5d + 12 = -48. Suppose 4i + 64 = 4t, 4t + 3i - 35 - 8 = 0. What is the derivative of t - 7 + dw2 + 9 wrt w? 24w Let b(l) = -11l3 - 31l*2 - 179l + 8. Let q(n) = -11n3 - 30n*2 - 178n + 6. Let o(t) = -3b(t) + 4q(t). Find the second derivative of o(h) wrt h. -66h - 54 What is the third derivative of 107h*4 + 71h*4 - 7184h*2 + 193h*4 - 2h*3 + 3h*6 + 37h*4 - 11h*4 wrt h? 360h*3 + 9528h - 12 What is the derivative of -1029 - 643 + 2781n4 - 542 - 410 + 396 - n3 wrt n? 11124n*3 - 3n*2 Let t = -259 - -264. What is the third derivative of -5g*2 - 17g*2 + 16g*2 + 17g*t - 3 wrt g? 1020g*2 Find the first derivative of 871k*4 + 788k*4 + 7987 - 4477k*4 - 1864k*4 - 5334k*4 wrt k. -40064k*3 Let u(k) = 29k - 5. Let n be u(4). Suppose -36 = -7q + n. What is the third derivative of 11x*2 + qx*5 - 14x*2 + 25x*2 wrt x? 1260x*2 Let x(m) be the first derivative of 1541m*4/2 + 8860m - 6019. What is the derivative of x(p) wrt p? 9246p2 Let m = -4224 - -4323. Let u be 1 + -2 - 2-2. Find the third derivative of c*3 - 22c*2 - mc4 - cu + 90c4 wrt c. -216c Let l(i) be the first derivative of 2761i4/2 + 3748i - 3	{ "pile_set_name": "DM Mathematics" }
and 2 o when three letters picked without replacement from {w: 1, p: 1, n: 3, o: 10}. 9/91 Four letters picked without replacement from ppapzez. What is prob of picking 3 z and 1 p? 0 Three letters picked without replacement from khokfhwkofkohwk. Give prob of picking 2 w and 1 h. 3/455 Two letters picked without replacement from {l: 2, w: 3, u: 1, c: 4, y: 2, q: 2}. Give prob of picking 1 c and 1 y. 8/91 Three letters picked without replacement from {o: 2, m: 18}. What is prob of picking 2 m and 1 o? 51/190 Two letters picked without replacement from {f: 3, k: 4}. Give prob of picking 1 k and 1 f. 4/7 Calculate prob of picking 1 d and 2 o when three letters picked without replacement from oddddojjjjddoofooo. 21/136 Three letters picked without replacement from {u: 3, b: 1, q: 6, z: 5, n: 2}. Give prob of picking 3 u. 1/680 Four letters picked without replacement from {t: 1, p: 2, e: 1, u: 2, o: 1}. Give prob of picking 2 p, 1 o, and 1 t. 1/35 What is prob of picking 1 n and 1 o when two letters picked without replacement from {v: 10, n: 4, o: 3, x: 3}? 6/95 Three letters picked without replacement from {c: 1, s: 1, k: 1, r: 1, u: 2, a: 2}. What is prob of picking 1 a, 1 k, and 1 r? 1/28 Calculate prob of picking 2 n when two letters picked without replacement from {n: 7, b: 7}. 3/13 Calculate prob of picking 1 a, 1 v, and 1 r when three letters picked without replacement from {a: 8, r: 1, v: 1, i: 4, z: 3}. 1/85 Four letters picked without replacement from vvvvvv. What is prob of picking 4 v? 1 What is prob of picking 1 x and 1 g when two letters picked without replacement from xvgvvggggxvxgxxg? 7/24 Two letters picked without replacement from {o: 1, b: 2, g: 1, t: 2, a: 2, l: 1}. What is prob of picking 1 t and 1 a? 1/9 Three letters picked without replacement from {x: 9, l: 1, a: 1, d: 6}. What is prob of picking 1 a and 2 d? 3/136 Calculate prob of picking 1 g and 1 x when two letters picked without replacement from {a: 1, g: 5, i: 3, f: 1, o: 2, x: 1}. 5/78 Four letters picked without replacement from {k: 9, e: 2}. Give prob of picking 1 e and 3 k. 28/55 Three letters picked without replacement from jjjjaqaajaaqjjjj. Give prob of picking 3 j. 3/20 What is prob of picking 1 o, 1 e, and 1 s when three letters picked without replacement from eqeopse? 3/35 Calculate prob of picking 1 z and 1 y when two letters picked without replacement from {y: 1, m: 1, z: 2}. 1/3 Three letters picked without replacement from sxwxxxxxxksqwxxqxxs. What is prob of picking 1 s and 2 w? 1/323 Two letters picked without replacement from {k: 11, c: 3}. Give prob of picking 2 k. 55/91 Calculate prob of picking 2 x when two letters picked without replacement from ffxxx. 3/10 Four letters picked without replacement from {a: 4, n: 9, d: 1}. Give prob of picking 1 a and 3 n. 48/143 Three letters picked without replacement from {r: 2, j: 3, k: 1, a: 1, y: 1, f: 3}. Give prob of picking 1 f and 2 j. 3/55 Calculate prob of picking 3 x when three letters picked without replacement from xjxxxxjxjjxxjjxxxx. 55/204 Two letters picked without replacement from {m: 3, s: 2, v: 2, j: 4}. Give prob of picking 1 s and 1 j. 8/55 Three letters picked without replacement from eeexeeiexneniefen. Give prob of picking 1 f and 2 i. 1/680 Three letters picked without replacement from phhhphufuhpvhhuvhv. Give prob of picking 1 v, 1 p, and 1 h. 3/34 Three letters picked without replacement from {s: 1, w: 2, h: 3, z: 8, r: 1, j: 3}. Give prob of picking 1 j, 1 r, and 1 s. 1/272 Two letters picked without replacement from {c: 1, b: 2, i: 1, f: 3}. Give prob of picking 1 b and 1 i. 2/21 Two letters picked without replacement from oggoogeeggeoo. What is prob of picking 1 g and 1 o? 25/78 Two letters picked without replacement from ccgctucuuqgqggotouc. What is prob of picking 1 g and 1 c? 20/171 What is prob of picking 1 r and 3 l when four letters picked without replacement from rlqlqrlrl? 2/21 Two letters picked without replacement from nnppnynw. Give prob of picking 1 w and 1 p. 1/14 What is prob of picking 1 n and 1 z when two letters picked without replacement from sszseozssszoozszznz? 7/171 Three letters picked without replacement from {z: 14, j: 2, l: 1}. What is prob of picking 2 z and 1 l? 91/680 Three letters picked without replacement from tkttkkktkkttk. Give prob of picking 2 t and 1 k. 105/286 Two letters picked without replacement from awwca. What is prob of picking 2 a? 1/10 Three letters picked without replacement from lwwwlkwwwlkwlwwllww. What is prob of picking 2 w and 1 k? 110/969 Three letters picked without replacement from jjbbbbjbbbjbjjbjbbb. Give prob of picking 3 b. 220/969 What is prob of picking 1 a and 1 l when two letters picked without replacement from {a: 1, l: 2, y: 2, b: 1}? 2/15 Calculate prob of picking 4 y when four letters picked without replacement from yyyyycycyyyycc. 30/143 Two letters picked without replacement from sytwxyxsssxwwsystwz. What is prob of picking 1 y and 1 z? 1/57 Four letters picked without replacement from nenrrnnrenerenn. Give prob of picking 4 n. 1/39 Four letters picked without replacement from wwmoyyyxwyyxxxxxmyy. Give prob of picking 3 w and 1 o. 1/3876 Three letters picked without replacement from ttltbatalaaalalaaatl. Give prob of picking 2 a and 1 t. 3/19 Calculate prob of picking 3 v and 1 e when four letters picked without replacement from {e: 5, v: 15}. 455/969 What is prob of picking 2 h when two letters picked without replacement from jfjjhtjtthtth? 1/26 What is prob of picking 1 f and 1 p when two letters picked without replacement from {g: 1, e: 4, f: 2, v: 2, p: 1, b: 5}? 2/105 Calculate prob of picking 2 o when two letters picked without replacement from hkhkkhakkakaooahak. 1/153 Two letters picked without replacement from {w: 3, k: 1}. What is prob of picking 2 w? 1/2 Three letters picked without replacement from {a: 2, j: 5, w: 3}. What is prob of picking 3 w? 1/120 Three letters picked without replacement from oiiooooiooaooqo. What is prob of picking 1 i and 2 o? 27/91 Three letters picked without replacement from kkkk. Give prob of picking 3 k. 1 What is prob of picking 2 e when two letters picked without replacement from {e: 4, g: 6, v: 1, d: 2}? 1/13 Three letters picked without replacement from {k: 3, f: 7}. Give prob of picking 3 f. 7/24 Two letters picked without replacement from mmmkcckmcmcmccc. What is prob of picking 1 k and 1 m? 4/35 What is prob of picking 1 n and 1 l when two letters picked without replacement from hmhsmnhlsmnll? 1/13 What is prob of picking 2 x when two letters picked without replacement from {x: 7, z: 2, p: 1, k: 4}? 3/13 What is prob of picking 1 p and 2 r when three letters picked without replacement from {q: 1, k: 1, p: 4, g: 1, r: 2}? 1/21 Three letters picked without replacement from {q: 1, u: 3, e: 2, w: 2, y: 4, v: 3}. Give prob of picking 2 v and 1 e. 6/455 Calculate prob of picking 2 q, 1 i, and 1 c when four letters picked without replacement from qhhccnnihooq. 2/495 Two letters picked without replacement from {h: 7, l: 9}. What is prob of picking 1 h and 1 l? 21/40 Three letters picked without replacement from {s: 3, r: 4}. Give prob of picking 2 s and 1 r. 12/35 Calculate prob of picking 2 q, 1 i, and 1 o when four letters picked without replacement from {m: 4, q: 2, u: 3, o: 1, i: 1}. 1/330 Four letters picked without replacement from {f: 9, o: 4, c: 4}. What is prob of picking 2 f and 2 c? 54/595 What is prob of picking 4 w when four letters picked without replacement from {w: 6}? 1 Calculate prob of picking 3 d when three letters picked without replacement from zaazalaaalaedcd. 0 Four letters picked without replacement from xoxvvvovoovvvvvvvx. Give prob of picking 2 o and 2 x. 1/170 Three letters picked without replacement from {i: 2, x: 7, n: 9}. Give prob of picking 1 x and 2 i. 7/816 What is prob of picking 2 g and 1 v when three letters picked without replacement from gvvvgg? 9/20 Three letters picked without replacement from {b: 4, n: 3, z: 4, p: 1, r: 1}. Give prob of picking 1 b and 2 n. 6/143 Two letters picked without replacement from {u: 13, z: 5}. Give prob of picking 1 z and 1 u. 65/153 What is prob of picking 1 k and 2 e when three letters picked without rep	{ "pile_set_name": "DM Mathematics" }
/13)c) assuming c is positive. c(-28667/3198) Simplify ((((lll(5/3)l)/l)/ll(2/9))/(l4/l5))(2/95) assuming l is positive. l(14/171) Simplify (d/d12d(-2/21)/d)47 assuming d is positive. d(-11938/21) Simplify (m/m(-2/11))*(-1)(m/m(-3))(-12/7) assuming m is positive. m(-619/77) Simplify (m16/m)/(m/m*(-1/22)m)m(3/2)/m(1/2) assuming m is positive. m(307/22) Simplify (kk/k6)(-4/11)(k(-8/7))(6/5) assuming k is positive. k(32/385) Simplify y/(y/y(-1/4))yyy*(-12)/yyyy*(2/3)y/(yy/(y(2/23)/y)) assuming y is positive. y(-2897/276) Simplify (o(-18)o(-22))/(((o/((o/o(-6/5)o)/o))/o)/(oo*(5/14)/ooo)) assuming o is positive. o(-2481/70) Simplify (a(2/11)a)*(-1/17)(aa(-1/10)a)/(aaa(1/2)/a) assuming a is positive. a(309/935) Simplify o*(-1/4)o*(-8)oooo(-1/10)oo(1/2) assuming o is positive. o(-77/20) Simplify (n(6/7)n*(14/5)nn)/(n(-3/8))(4/3) assuming n is positive. n(431/70) Simplify (((o1)(1/7))(-16/5))(-3/44) assuming o is positive. o(12/385) Simplify (d(-1/7)d*(1/25))/(ddd(dd(-1/3)d)/dddd)27 assuming d is positive. d(-31518/175) Simplify (((u/(uu*2)u)/u)/((u/(uu(3/8)))/u))/((u/(uu(5/2)))/u)50 assuming u is positive. u(1395/8) Simplify j(-13/3)j14/jj*(-23)/(jj(-23)/j) assuming j is positive. j(26/3) Simplify (((jj(-4/7))/jjj)/(jjj/(j/(j/(jj*(3/8))j))jjj)j*7jjj(1/9))(-8) assuming j is positive. j(-2477/63) Simplify ((q0q)(19/2)/(q/(qq/((q*(-1/4)q)/q)qq))(3/7))(-39) assuming q is positive. q*(-11895/28) Simplify ((d(d/d*28)/dd)/(d*(-24)/dd))/(d/(((d/(dd(21/5)/dd))/d)/d)d41d) assuming d is positive. d(-256/5) Simplify (p6pppp*(-2/3)(p/(p*2p))/(pp(3/2)))17 assuming p is positive. p(391/6) Simplify ((w(2/33)w*0w)/(w(-3/5))(-2/13))(-4) assuming w is positive. w(-8308/2145) Simplify ((pp/(p/p(-13)p)p(2/15))(-16))(-2/23) assuming p is positive. p(-6176/345) Simplify (((ppp(-2/7))/(p(p/(pp4p))/p))16)(-2/5) assuming p is positive. p(-1504/35) Simplify (m(-2))*(-3)((m((m5m)/mm)/m)/m)(-2/3) assuming m is positive. m(8/3) Simplify (m/m(2/3))/mm*(3/4)m*(-3)mm(-17) assuming m is positive. m(-227/12) Simplify ((((y(1/4)/y)/y)/y)(-1/7)/((yy(-1/3)/y)/y)(-1/13))(23/5) assuming y is positive. y(7291/5460) Simplify (z/((z/z*(-12))/z)zz/(z/z(3/23)))/((zz*(9/8)z)/((zzz/z(-31))/z)) assuming z is positive. z(3681/184) Simplify (q/(qq3q))*(-6/23)q/(q/(q/q*(-17)))qq/(q(-16)q) assuming q is positive. q(829/23) Simplify ((x/x(-8/5)x((xx/(x/x(-3)))/xx)/x)/(xx/(xxx(xx(-3))/x)xx(8/7)))(29/4) assuming x is positive. x(-899/35) Simplify (kkk26k)/(k/k*21)k*(1/34)kk15 assuming k is positive. k(2211/34) Simplify (n(3/4)/nn)*(-10)(nnn*(3/4)n)/((n*(-7/5)/nn)/nn) assuming n is positive. n(-47/20) Simplify (r/r(-5)r/(rr(-8/9)rr))/((rrrr/r*22r)/r(7/2)) assuming r is positive. r(457/18) Simplify (y*(-16)(y/(y/(y/(y*(-3/7)y)yy)y))/yyy)/(y(-10/11)/(yy/y*(2/3)y)) assuming y is positive. y(-2386/231) Simplify s(4/27)/(ss(1/29)ss)(((s/(s*(1/16)s))/s)/s)(-14) assuming s is positive. s(162793/6264) Simplify (v(1/2)/v)(-13/6)(vvv(2/45)/v)/v(vv(v/(v/((v*(-1/11)v)/vv)))/vv)/v assuming v is positive. v(6013/1980) Simplify (d(-3/8)ddd/d(2/43))(10/3) assuming d is positive. d(4435/516) Simplify t/(t/t2)t*(5/4)t(t(1/4))(-7) assuming t is positive. t(5/2) Simplify (f(-12/11))(4/11)/((f/((f(-18/11)/ff)/f))/ff)44 assuming f is positive. f(-19408/121) Simplify (h(h/h*6)/hhh/(h/(hh/h*9))h(1/2)/h(-5))(-2/69) assuming h is positive. h(11/69) Simplify ((f(-1/3)/f)/f)/f(-5)f(-1/2)/(f/((ff/(f*(-12)f))/f)) assuming f is positive. f(79/6) Simplify (((c(6/5)c)/(c/(ccc4)))/((c/(c(-2/5)/c))/c)8)(5/4) assuming c is positive. c(-5) Simplify o13o*26o(o(1/2))3 assuming o is positive. o(83/2) Simplify ((a(-7)a/a(-11))/(a/a3aaa(-13)))(2/31) assuming a is positive. a(36/31) Simplify (l/l(3/7))(1/51)(l/(l/l(1/7)))(-7) assuming l is positive. l(-353/357) Simplify (n(-1/11)nnn(-2)n)/(n6)39 assuming n is positive. n(-2564/11) Simplify (t(4/11)/t)(-2/29)/(t(-2/53)t/(ttt(-1/13)t)t) assuming t is positive. t(220824/219791) Simplify ((k/(k/(k/(kk(-9)))))/(k12/k))/(kkkk(-16)/k)19 assuming k is positive. k264 Simplify (bb*6b)*(1/33)/(bb*(-1/2)b)15 assuming b is positive. b(-1469/66) Simplify ((((bb/(bb*(-6)))/b)/bb(-2))38)35 assuming b is positive. b3990 Simplify (u(2/17)/u)/u(4/13)(u/(u(1/8)u)uu)/(u(u(u*(-11)u)/u)/u) assuming u is positive. u(18891/1768) Simplify (a(3/20)/(a/(a*28a)))/((aaa/a*(-35)aa)/a(-31)) assuming a is positive. a(-857/20) Simplify ((k(-4/5)k)/k*(-1)kk(4/3)(kkk/(kk/((k/k(1/10))/k)))/kk)(-35) assuming k is positive. k(-931/6) Simplify (i(-3/5))(3/43)/(i(-2/15))(-20) assuming i is positive. i(-1747/645) Simplify h/h(-2/7)h((h/h*(5/4))/hh)/h(h(2/5))(9/4) assuming h is positive. h(271/140) Simplify (t(-3))(-11/7)t/((tt/t(-1/7)tt)/tt)(t/(t/(t(-5)t))t)/t assuming t is positive. t(-17/7) Simplify ((uu/u*(1/7)u)/u)*(6/35)u(2/11)/((u/u(-3/4)u)/u) assuming u is positive. u(-13473/10780) Simplify (((l6l)/((l/((l/(ll/l(1/2)))/l))/ll))/(l/l*(-1/7)(l/(l/l(2/25)))/l))(-47) assuming l is positive. l(-70359/350) Simplify (p10p)/(pp*(-4))(p((pp(-3/7))/p)/p)(2/89) assuming p is positive. p*(8716/623) Simplify (tt*(-2/11)/tt)(-33)/((t21/t)/(t*(-11)t)) assuming t is positive. t(-57) Simplify (d10)*(-11)/((d/(dd(-3/8)/d))/(d/d42d)) assuming d is positive. d(-1211/8) Simplify (i17/(i(-2/41)/ii))/(i(2/23)/i)(-16/9) assuming i is positive. i(43639/2829) Simplify (((z(-1)z)(-1/10))44)(-8/5) assuming z is positive. 1 Simplify c(-2/21)/cc*(-5/4)(cc(-2/7)/cc)35 assuming c is positive. c(1903/84) Simplify (((v/v*(6/19)v)/((v/(v/(v/(vvv*23))))/vvv))38)37 assuming v is positive. v34706 Simplify (g(-1)/g(2/17))/(g(-2/31)/(gg(-5/3))) assuming g is positive. g(-2719/1581) Simplify ((r(r/(rrr(2/17))r)/rrr*11r)/((r/((r*(-8)r)/rrr)rr)/(rr(1/6))))28 assuming r is positive. r(7210/51) Simplify ((l(2/15)l)/l)(1/24)/(l(3/5))(1/13) assuming l is positive. l(-19/468) Simplify o/(oo(-3/4)/ooo)o*15o*(-6/23)/((oo*(-19)o)/o) assuming o is positive. o*(2989/92) Simplify (oo(-2/7))(-13/5)/(o(o(o/(o/(o*(-1/2)o)))/o)/o)(2/3) assuming o is positive. o(-46/21) Simplify u4/(u/u5u)((u/(u*3u))/uu)26 assuming u is positive. u(-71) Simplify (b(12/13)bb/(b/(b(2/33)/b)))/(b/((b/(b/b9))/b)bb)(-19) assuming b is positive. b(-40333/429) Simplify (z/(zz*(-4)/zz))(41/5)/(z4zz(9/4)/z) assuming z is positive. z(531/20) Simplify (c*38/(c/(ccc(17/3)cc)))(-2/35) assuming c is positive. c(-8/3) Simplify (t(1/18)/(t(9/4)/t))/(t15/(ttt/((t/(t(tt/(tt*(-4/3))t)/t))/t))) assuming t is positive. t(-355/36) Simplify ((b/(((b/b3)/bb)/b))/bbb/(b/b(-4/5)))/(b(1/3))36 assuming b is positive. b(-44/5) Simplify (c(3/7)c)(-11/5)/((c(-3/2)/c)/(((c/c(2/7))/c)/c)) assuming c is positive. c(-27/14) Simplify ((o0/o)/o(-1/5))/(o(-1/31)/o(1/4)) assuming o is positive. o*(-321/620) Simplify ((g((gg28/gg)/g)/gg(-4))(-11/5))(-41) assuming g is positive. g(10824/5) Simplify (((lll(-1/13))/l(-5))46)(3/19) assuming l is positive. l(12420/247) Simplify (a(-7/4)a)/a*(1/2)a*(-5)aa7 assuming a is positive. a(7/4) Simplify (t(t/t*3t)/ttt)*5t/(tt(-3/8))tt0 assuming t is positive. t(51/8) Simplify ((s/(s(-4/7)/s))/ss(4/7))/(s(-1/4))(-14) assuming s is positive. s(-19/14) Simplify (s*(-6/5)/(ss/s(-14)))/(s2)(1/34) assuming s is positive. s(-146	{ "pile_set_name": "DM Mathematics" }
883 (base 9) in base 8? -546626 What is 45515a (base 12) in base 10? 1107862 Convert -1b6a9 (base 12) to base 3. -2001212210 Convert 344331344 (base 6) to base 3. 102222202211001 What is -113220131322 (base 4) in base 16? -5e877a Convert 7119d9 (base 14) to base 16. 3a1a8b 1013134 (base 7) to base 6 2332521 135122 (base 6) to base 14 493c -21054411 (base 8) to base 12 -16001a1 Convert -8671447 (base 9) to base 4. -101233330231 -121181 (base 11) to base 4 -232312002 Convert -62360301 (base 7) to base 3. -100212022000210 What is 400473 (base 8) in base 4? 200010323 -937b8 (base 16) to base 10 -604088 Convert -7a8699 (base 11) to base 10. -1285249 -13053 (base 9) to base 13 -4008 21a754 (base 13) to base 12 323855 -10101110000010010000110 (base 2) to base 3 -101201201202110 Convert 330021123 (base 4) to base 2. 111100001001011011 What is 413330 (base 7) in base 2? 10001010010101010 Convert -22250302 (base 6) to base 9. -1238332 Convert -10020230043 (base 5) to base 7. -150255335 152363 (base 13) to base 3 222101001012 -27133 (base 12) to base 9 -81653 Convert 102220121011101 (base 3) to base 16. 6096a9 What is 3031215 (base 6) in base 3? 21022202002 -256741 (base 9) to base 5 -14442011 Convert 52140 (base 13) to base 12. 71390 -430422022 (base 5) to base 9 -3360056 1020211102202020 (base 3) to base 16 1125708 What is 2b0d6 (base 14) in base 10? 107204 -1341145 (base 7) to base 6 -3452311 1565b9 (base 15) to base 12 41a4a9 What is -37d6b (base 16) in base 15? -47b7a Convert -273c51 (base 13) to base 7. -11041113 111201021112 (base 3) to base 15 54ea8 Convert -136474 (base 8) to base 16. -bd3c Convert 1256 (base 9) to base 6. 4210 What is -627357 (base 8) in base 16? -32eef What is 2258660 (base 9) in base 12? 4aa139 -201112222121 (base 3) to base 9 -645877 Convert 1110111110011110 (base 2) to base 4. 32332132 Convert -e976c (base 16) to base 8. -3513554 Convert -3b3c64 (base 15) to base 16. -2b74af Convert 4413020 (base 5) to base 11. 52120 What is -419bd (base 14) in base 9? -261172 10111011000100000 (base 2) to base 15 1d5a1 1030112122 (base 5) to base 12 898301 -1031321100 (base 4) to base 6 -10501040 2527575 (base 8) to base 12 299311 -1521252300 (base 6) to base 10 -19104876 Convert -1000000110011111001111 (base 2) to base 5. -1020424402 Convert -404de (base 16) to base 5. -31412030 Convert -211003242 (base 5) to base 9. -1573788 What is 29aa225 (base 11) in base 7? 61540033 3311743 (base 8) to base 6 31023323 What is 51143 (base 6) in base 9? 10240 Convert -21200021201 (base 3) to base 14. -3d0d9 210120211102111 (base 3) to base 15 1019104 Convert -1256541 (base 7) to base 15. -34100 Convert -adc51 (base 14) to base 16. -6716f Convert -10110010010011000 (base 2) to base 14. -253a8 1361a (base 13) to base 15 aac9 -1515112 (base 7) to base 4 -302100202 What is a7942e (base 16) in base 2? 101001111001010000101110 -3655753 (base 9) to base 12 -7b9156 Convert 101011110001111010 (base 2) to base 12. 87936 -111100000000001110111000 (base 2) to base 10 -15729592 7356c1 (base 16) to base 4 130311123001 3060070 (base 8) to base 16 c6038 Convert -1265326 (base 7) to base 13. -5b357 Convert -140702 (base 11) to base 10. -220464 Convert 2424433240 (base 5) to base 2. 10101110000001010110000 515267 (base 8) to base 14 462b5 Convert 14543353 (base 6) to base 10. 511413 What is -10101110110010110 (base 2) in base 15? -1b7b4 What is -1010000011111100010 (base 2) in base 10? -329698 b77c7 (base 13) to base 14 88836 Convert -55421264 (base 7) to base 5. -2210402402 What is -15405 (base 6) in base 9? -3415 What is -30233131 (base 4) in base 11? -36235 Convert -377941 (base 12) to base 3. -1200222112211 Convert -298a2d (base 14) to base 15. -1d83b5 What is 1822823 (base 10) in base 9? 3377388 What is 3543 (base 14) in base 2? 10010000110111 What is -331234112 (base 5) in base 7? -15105435 Convert 10110100011001001101001 (base 2) to base 6. 330410225 Convert -b3860 (base 16) to base 3. -1101100200101 What is -110142 (base 8) in base 5? -2140322 Convert cbd (base 14) to base 16. 9d7 Convert -83743 (base 10) to base 11. -57a10 Convert -4325a2 (base 11) to base 5. -134112011 Convert -30210110333 (base 4) to base 13. -8b4732 Convert 2474313 (base 10) to base 5. 1113134223 -9b95e (base 15) to base 3 -221010211022 -4e3246 (base 15) to base 5 -1430210031 -36dc8 (base 14) to base 8 -406444 What is -35891d (base 16) in base 12? -1212479 What is -30001021 (base 4) in base 11? -33a90 Convert 369313 (base 16) to base 4. 31221030103 What is -1001001111111011 (base 2) in base 16? -93fb Convert 141555041 (base 6) to base 10. 2892481 Convert 8ca988 (base 13) to base 15. 45d9a4 -2011121110 (base 3) to base 14 -117dc What is 321223211 (base 4) in base 6? 5021445 24001012 (base 5) to base 12 a6802 Convert -160132 (base 9) to base 12. -49025 Convert -150230404 (base 6) to base 11. -1827268 Convert -14081886 (base 9) to base 8. -32436764 Convert 26510151 (base 7) to base 10. 2439501 What is 394988 (base 10) in base 11? 24a840 What is 975b3 (base 13) in base 12? 11228b Convert -110001001111110110 (base 2) to base 16. -313f6 -122555332 (base 6) to base 9 -4425782 Convert -2032000032 (base 4) to base 3. -1002112212110 -403421444 (base 5) to base 3 -10001110211222 -71a155 (base 14) to base 3 -21012122000000 Convert 3311321243 (base 5) to base 16. 6ce24f Convert a38023 (base 11) to base 4. 12112201102 1020202311 (base 4) to base 15 5d096 Convert 1111010011101110010 (base 2) to base 13. 147420 Convert -11203042 (base 5) to base 6. -2052445 What is -210102 (base 8) in base 15? -159b8 What is 6360a (base 12) in base 11? 8a033 Convert 36431 (base 13) to base 3. 12001121012 What is -112120222 (base 4) in base 14? -255b4 What is -131232001200 (base 4) in base 5? -3443300223 What is -105a4 (base 15) in base 8? -145300 123132433 (base 6) to base 15 3239cc Convert -4022343 (base 5) to base 4. -33221202 What is 43112752 (base 8) in base 12? 3103a0a What is b99055 (base 12) in base 15? 3d0de8 Convert 22111000201012 (base 3) to base 12. 1614905 Convert -20223032202 (base 4) to base 5. -1040233320 Convert 5536048 (base 11) to base 14. 140c661 499593 (base 12) to base 8 4444377 What is -cb03b (base 14) in base 3? -220221211200 What is -8816 (base 15) in base 13? -10170 Convert -1442404 (base 9) to base 13. -21b212 Convert 2120051 (base 6) to base 10. 103711 -21a21a (base 11) to base 8 -1254154 What is 2011066 (base 7) in base 13? 844a8 Convert -15400532 (base 7) to base 4. -11221021310 Convert 102432141 (base 6) to base 8. 6714035 Convert -3a6811 (base 12) to base 15. -141094 What is -100100011101111001 (base 2) in base 4? -210131321 613b8 (base 16) to base 15 7d00e Convert 461743 (base 8) to base 15. 3162d Convert 14081 (base 12) to base 16. 6c61 What is aadd (base 16) in base 4? 22223131 -3a4615 (base 13) to base 8 -5300435 77a7 (base 12) to base 15 3dc1 Convert 37260 (base 12) to base 14. 1d2d2 -32434230 (base 6) to base 3 -1211020022100 Convert 11110100110101011111 (base 2) to base 15. 14c217 -10650416 (base 7) to base 5 -214432344 Convert -2508884 (base 10) to base 9. -4643478 What is 2232243 (base 5) in base 6? 503442 Convert -c88e09 (base 16) to base 7. -216501264 Convert 21ac70 (base 16) to base 4. 20122301300 -123025 (base 7) to base 8 -54201 -10210222010 (base 3) to base 15 -17393 What is -34331201 (base 5) in base 8? -1132115 -8a493 (base 11) to base 12 -639a8 -1021011120010 (base 3) to base 2 -10100100001100100010 Convert -b993a (base 14) to base 8. -1555100 What is 278833 (base 14) in base 3? 2120111201022 195e5 (base 16) to base 7 611641 What is 10451330 (base 6) in base 2? 1001101100110100110 -120131033 (base 4) to base 8 -303517 What is 12112011212 (base 3) in base 8? 324320 Convert 2202121331 (base 4) to base 10. 665213 What is 4d478 (base 14) in base 10? 190226 Convert 83183 (base 12) to base 7. 1312314 What is 7299 (base 14) in base 15? 5caa What is -200322221 (base 4) in base 2? -100000111010101001 Convert -563c5c (base 13) to base 4. -13301030233 23522580 (base 9) to base 5 10414024223 38217 (base 9) to base 6 314541 Convert -13412213 (base 5) to base 14. -38641 What is 2321552 (base 7) in base 13? a269b Convert 7714737 (base 8) to base 11. 1194a84 -248414 (base 11) to base 12	{ "pile_set_name": "DM Mathematics" }
i(9)? 20 Let a(b) = -b + 1. Let v be a(-1). Let y = v - -7. Calculate the lowest common multiple of y and 30/7 - (-4)/(-14). 36 Let o = 958/3 + -315. Calculate the common denominator of o and -91/8. 24 Let s = -64/13 + -15/26. What is the common denominator of s and 18/10(-200)/(-84)? 14 Let p = -3 - -1. Let h be 6/p(-463)/1. Find the common denominator of -45/11 and h/(-54) + 4/18. 22 What is the common denominator of (20/(-5))/(20/(-22)) and 1? 5 Let i be ((-6)/15)/(2/(-20)). Suppose i = p - 6. Let g = -12 + 34. Calculate the lowest common multiple of g and p. 110 Let s = -2187/2 - -12989/12. Calculate the common denominator of 76/9 and s. 36 Find the common denominator of 19/10 and 36/35 - (-4)/10. 70 Find the common denominator of -11/63 and ((-56)/10 + 5)(-124)/6. 315 Let r = -13963/6 - -2338. What is the common denominator of r and -107/6? 6 Suppose -20 = u + 4u - 5i, 0 = 2u + 4i - 22. Suppose u = -z + 11. What is the lowest common multiple of 1 and z? 10 Let w = -41735/24228 + 1/2692. Find the common denominator of 85/32 and w. 288 Let y(k) = 2k. What is the lowest common multiple of 4 and y(5)? 20 Let o = -542 + 20597/38. Find the common denominator of 74/9 and o. 342 Let u be (2 + -1 - 8) + -2. Let n = u - -1. Find the common denominator of -46/5 and n/12118/4. 15 Calculate the common denominator of -103/18 and (-15)/(-2 + -3) + (-242)/20. 90 Let a = 194723/42672 - 2/2667. Suppose -5b + 5 = 10, 0 = -5k + 3b - 1067. What is the common denominator of a and (-1)/(-32)k + 1? 16 Let l be 2/4-2 - -1. Suppose v - 6 = -lv. What is the lowest common multiple of 12 and v? 12 Let z be (-7158)/(-16) - (-3)/12. Let o = z + -447. Calculate the common denominator of o and 45. 8 Suppose 0 = -4z - z + 165. Suppose 0s - z = -s - 5p, -4s + 84 = 4p. Calculate the smallest common multiple of s and 6. 18 Let f(w) = -w*2 - 22w - 2. Calculate the lowest common multiple of f(-19) and 5. 55 Let t = 67 - 57. What is the smallest common multiple of 10 and t? 10 Let t = 3273/2 - 1601. Find the common denominator of t and (-6)/(-9) + (301/(-24))/1. 8 Find the common denominator of -15 and 58(-3)/(-84)-2. 7 Let q(y) be the third derivative of y5/15 + y4/24 + y*3/6 - 3y*2. What is the least common multiple of q(-1) and 24? 24 Let f = 848/3 + -10945/42. Let d be 546/98 + 3 + 0. Let n = d - f. Calculate the common denominator of -79/2 and n. 2 Let p(m) = -6m3 - m2 - 2. Calculate the smallest common multiple of 2 + (3 - (-13 - -2)) and p(-2). 336 Let p = 604580/8979 + 2/2993. Let r = -665/6 + p. Let k = 7171 + -71623/10. Calculate the common denominator of k and r. 10 Suppose -45 = -5d + 90. Calculate the lowest common multiple of d and 33. 297 Let g = -2/863 + 128599/5178. Let y = -217 - -1153/6. Calculate the common denominator of y and g. 6 Let v = -113129/5262 - 2/2631. Calculate the common denominator of v and (-1)/(-4) - 174/88. 22 Calculate the common denominator of 67/22 and 70/(-15)6/(-64). 176 Suppose 4t = -20, 1 = 2r + 2t - 1. Suppose -2l = -w - 8 - r, 2l - 2w = 16. Calculate the lowest common multiple of 12 and l. 12 Let o = 7 - 16. Let s = -2 - o. Calculate the least common multiple of s and 6. 42 Suppose 0l + 4 = -l. Calculate the common denominator of ((-52)/44)/(2/l) and (114/(-16))/(2/8). 22 Let d be (2 - (7 - 2)) + -30. What is the lowest common multiple of ((-4)/(-6))/((-1)/d) and 6? 66 Let w be 602/(-948) + (-1)/(-2). Let v = w + 13073/3792. Calculate the common denominator of v and -17/16. 16 Let y = -38128/5553 - 14/617. Calculate the common denominator of 81/2 and y. 18 Let k = -1000/253 - -70/23. Find the common denominator of k and (3/6)/((-3)/46). 33 Let l = -1587 + 4801/3. Find the common denominator of l and -69/4. 12 Suppose 0 = -f - 1 + 11. What is the smallest common multiple of 16 and f? 80 Let o(t) = -2t - 11. Let m be (-3805)/(-3) - (-1)/(-3). Let b = m + -8858/7. What is the common denominator of o(-4) and b? 7 Let g = -545 - 988. Let j be (g/15)/((-176)/(-10)). Let m = j + 35/11. Calculate the common denominator of m and 81/10. 40 Let b(c) = -c*2 - c + 12. Let f be b(-5). Calculate the common denominator of (340/18)/(-4 - f) and 109/18. 18 Suppose t + n = -1531 - 17, -3112 = 2t - 2n. Let b = 158/5 - 529/20. What is the common denominator of (1/32)/((-8)/t) and b? 80 Suppose -4 = 2k - 2. Let s = k + 9. Suppose -47 = 2w - 61. Calculate the least common multiple of w and s. 56 Let i = -5349 + 74959/14. Find the common denominator of i and -37/8. 56 Let w(q) = -q3 - 6q*2 + 8q + 10. Let z be w(-7). Let p = -1 + z. Calculate the least common multiple of p and 8. 8 Find the common denominator of (-8)/(-48)200/(-6) and 107/6. 18 Suppose -31 = u - 3x, 7u + 134 = 3u + 2x. Let c = u + 54. Calculate the lowest common multiple of 20 and c. 20 Let a = 1670799/238 + -815686603/116025. Let o = 2/975 + a. Find the common denominator of o and 81/8. 40 Let z = 28 - 14. What is the smallest common multiple of 1 and z? 14 Let u(v) = v3 - 7v*2 - 6v - 8. What is the smallest common multiple of u(8) and (-1)/3 + 244/12? 40 Suppose w = -0a - 4a - 14, 5w + 2a = 2. Calculate the lowest common multiple of (8/(-5))/(w/(-5)) and (-1 + 0 + 19)/1. 36 Let r = -105 + 109. What is the least common multiple of 12 and r? 12 Let g = -27 - 51. Let d = -6/175 + 10337/350. What is the common denominator of -1 + g/(-14) + 1 and d? 14 Suppose f + 0f - 5 = -3h, -4f + 34 = -2h. Calculate the common denominator of 14/f21/12 and 21/20. 80 Let f = 437/5 - 87. Find the common denominator of f and (-1 - 1)/(20/(-3)). 10 What is the common denominator of (2 - 2 - (-5)/4)/(-2) and -95/178? 712 Suppose 2 + 14 = 4f. Suppose fo - 100 = 32. Suppose 5i - 7 = o. Calculate the least common multiple of 8 and i. 8 Find the common denominator of -21/5 and (0 + 10)(-1 - 85/(-120)). 60 Calculate the smallest common multiple of (-2)/3 - (-29)/3 and 5/(-15) - (-22)/3. 63 Let u = 5771/10 - 574. What is the common denominator of u and 59/9? 90 Find the common denominator of ((-9)/(-4))/(36/(-39)) and 1(-2)/4-17. 16 Suppose x + 0x = 11. What is the smallest common multiple of x and 9? 99 Let i(a) = -2a2 - 10a - 4. Let j(q) = -q2 + q + 6. Let y be j(0). Calculate the lowest common multiple of 26/4 - (-3)/y and i(-4). 28 Let n(o) = o3 - 3o2 + 2o - 1. Let g be n(2). Let k = 122/15 - 8/15. Calculate the common denominator of k and 135/4g/10. 40 What is the common denominator of -1/30 and (-4160)/495 - (-8)/44? 90 Let v(d) be the second derivative of 0 - 2d + 5/3d3 + 1/2d*2. What is the least common multiple of v(1) and 3? 33 Let g = -19 - -41. What is the smallest common multiple of 20 and g? 220 Let s = -11023/110 + 1044/11. Suppose 5 = -3k - 2q - 19, 0 = -4k - 3q - 33. Find the common denominator of (226/k)/(30/(-9)) and s. 10 Find the common denominator of -41/12 and ((-51)/(-45))/((-24)/(-126)). 60 Suppose 26i = 27i, -m + 34 = -i. Suppose -6g + 60 = -g. Calculate the smallest common multiple of m and g. 204 Let n(u) = -2u + 5. Let w be n(5). What is the common denominator of ((-110)/(-16))/(w - -6) and 381/60 - (3 - 1)? 40 Let c be 15/(-2) + 8/(-16). Find the common denominator of 13/9 and ((-10)/c)/((-1)/(-18)). 18 Let i = -10544/765 - 103/170. Let t = 685 - 29741/45. Let r = i + t. Calculate the common denominator of 103/10 and r. 10 Let o(q) = -q2 + 5q. Let y(i) = i - 8. Let a be y(12). What is the least common multiple of 1 and o(a)? 4 Find the common denominator of -37/16 and (9/56)/((-30)/440). 112 Let c = 4556 - 18125/4. Let x be (-3365)/2(-6)/(-20). Let q = -9953/20 - x. Calculate the common denominator of q and c. 20 Let z = 113133/10 + -11301. What is the common denominator of z and (0 - -2) + 942/(-192)? 160 Suppose -4j + 0s - 2s = -42, -5j - 3s + 53 = 0. Let f(b) = 7b - 35. What is the smallest common multiple of f(7) and j? 70 What is the common denominator of (-9)/24(-536)/18 and -49/9? 18 Let i = -446/69 - -13277/1104. Find the common denominator of i and 23/11. 176 Let j = -7065 + 70571/10. Let u = 343/5 + -2249/40. What is the common denominator of j and u? 40 Suppose 4k + 0k - 4 = 0. Calculate the smallest common multiple of 3 and k. 3 Let b = 2/2655 + 8828/2	{ "pile_set_name": "DM Mathematics" }
Let d(t) = 27t3 - 33t*2 - 15t. Let a(r) = -7r3 + 8r*2 + 4r. Let y(v) = -15a(v) - 4d(v). Find the third derivative of y(o) wrt o. -18 Let b(y) be the first derivative of 28y5/5 + 12y*3 - 23. Find the third derivative of b(r) wrt r. 672r Let z(t) be the second derivative of t9/5040 + t7/1260 - t*4/4 - 2t. Let m(i) be the third derivative of z(i). What is the third derivative of m(g) wrt g? 72g Let k(y) = -y2 + 5. Let n be k(0). Find the third derivative of -6x*2 - 5x + nx - 3x*3 wrt x. -18 Suppose -2g = -5 - 5. Let a(l) = l - 7. Let h(r) = 1 + 0 - 2. Let y(t) = gh(t) - a(t). Differentiate y(u) wrt u. -1 Let d(c) be the first derivative of c10/1680 + c6/180 - c3/3 + 2. Let a(z) be the third derivative of d(z). What is the third derivative of a(p) wrt p? 360p*3 Let f(r) = 11r*4 - 5r3 + 2. Let p(i) = i4 - i*3 - 1. Let n(k) = f(k) - 5p(k). Find the first derivative of n(u) wrt u. 24u3 Let k be (-2 - -3)/(-5) + 1/4. Let g(f) be the second derivative of kf5 - f2 - f + 0 + 0f3 + 0f*4. What is the derivative of g(j) wrt j? 3j*2 Let u = -5 + 7. Suppose -uh + l = -3h + 4, 2h - 3l - 3 = 0. Differentiate -v2 - 3 - 2 + h with respect to v. -2v Let v = 340 - 8159/24. Let d(b) be the third derivative of 1/6b3 + 0b + 0 - b*2 + vb*4. Find the first derivative of d(o) wrt o. 1 Let c = 8 + -6. What is the third derivative of -5v*4 + 3v*2 + 4v*c + 0v + 0v wrt v? -120v Suppose 2w + u - 10 = -u, 5 = 3w + u. Let d(f) be the second derivative of 0f3 - 1/20f*5 + 2f + 0 + 1/2f2 + wf*4. Differentiate d(p) wrt p. -3p*2 Let k(r) = 16r - 8. Let x(p) = -p + 1. Let y(h) = k(h) + 6x(h). Differentiate y(f) with respect to f. 10 Find the third derivative of 0r*5 - 2r*5 - 10r2 + r2 wrt r. -120r2 Let g(p) be the first derivative of p9/1008 + p6/180 - 2p*3/3 + 2. Let r(m) be the third derivative of g(m). What is the third derivative of r(j) wrt j? 180j*2 Let r be (8 + 0)/(4 + -2). What is the first derivative of 0 + 3k - r + 2 - k wrt k? 2 Let j(u) be the third derivative of -u8/2240 + u5/20 + u*4/12 + 4u*2. Let d(r) be the second derivative of j(r). Find the first derivative of d(c) wrt c. -9c*2 Let o = 12 + -26. Let r = -9 - o. Find the third derivative of -1 - 3g*r + 1 + 0 + 4g*2 wrt g. -180g*2 Suppose -3z + 15 = 5p - 8z, 2z = p - 4. Suppose -f - x + px + 8 = 0, f + 4x = -12. What is the first derivative of -5i + i + 2i - f - i wrt i? -3 Let l be (-2)/((-2)/(-3)-1). Suppose 0 = 4o - 4 - 8. What is the third derivative of -3g*2 - og*3 + 0g*3 + 3g*3 + 3gl wrt g? 18 Let q(p) = p4 - p3 - p2 - p + 1. Let m(i) = -40i4 + 3i*3 - 8i*2 + 3i - 3. Let c(n) = m(n) + 3q(n). Find the third derivative of c(j) wrt j. -888j Let s(p) be the third derivative of -7p5/60 - 5p*4/24 + 9p*2. What is the second derivative of s(h) wrt h? -14 Let o(r) = -35r*4 - 5r*3 + 5r + 21. Let y(f) = 140f4 + 21f*3 - 21f - 84. Let p(u) = 21o(u) + 5y(u). What is the first derivative of p(d) wrt d? -140d3 Let m(y) = 59y*4 + 7y*3 - 43y*2 + 7y. Let v(d) = -29d4 - 3d*3 + 22d*2 - 3d. Let u(h) = 3m(h) + 7v(h). Find the third derivative of u(n) wrt n. -624n Let y be (-4 - -13) + (-3 - 0). What is the second derivative of -s2 - 4s - ys3 + s2 wrt s? -36s Let f(j) = -j*2 - j. Let n(s) = 22s*2 + 5s - 7. Let o(c) = 5f(c) + n(c). What is the first derivative of o(g) wrt g? 34g Let a(i) = 61i + 19. Let y(q) = 61q + 19. Let r(b) = 3a(b) - 4y(b). Differentiate r(t) wrt t. -61 Let t(j) be the first derivative of 3j - 4 - 2j - 2j2 + 1 + 0j. Differentiate t(c) with respect to c. -4 Let s(v) = v3 - v2 + 1. Let x(h) = 36h3 - 4h*2 - 25h + 4. Let l(g) = -4s(g) + x(g). Find the second derivative of l(p) wrt p. 192p Let o(u) = 14u - 1. Let d(z) = -99z + 6. Let c(n) = -2d(n) - 15o(n). Differentiate c(f) wrt f. -12 Let f(j) be the third derivative of 0j7 + 0j*6 - 1/12j*4 + 4j*2 - 1/336j*8 + 0j*3 + 0j + 0j5 + 0. What is the second derivative of f(g) wrt g? -20g3 Let q(t) be the third derivative of -t5/30 + 5t4/24 + 21t*3/2 + 6t*2 + 8t. Find the first derivative of q(v) wrt v. -4v + 5 Let b(i) be the first derivative of -i8/840 + i4/8 + i3/3 - 2. Let g(v) be the third derivative of b(v). Differentiate g(h) wrt h. -8h*3 Let b(u) be the third derivative of -3u*2 + 0u + 0u4 + 0 - 1/40u*6 + 0u*5 - 4/3u*3. What is the derivative of b(j) wrt j? -9j*2 Let q(x) be the third derivative of 2x*5/15 + 5x*3/6 + 9x*2. What is the first derivative of q(p) wrt p? 16p Let z be 253/55 + (-4)/(-10). Find the third derivative of h*5 - 7h2 - hz + 2h5 + h5 wrt h. 180h*2 Let h(n) = 7n*5 + 4n + 2. Let a(i) = -29i5 - 16i - 9. Let w(r) = -2a(r) - 9h(r). What is the second derivative of w(l) wrt l? -100l3 Let l(j) be the second derivative of 53j5/20 - j3/3 - j*2/2 + 27j. Find the second derivative of l(p) wrt p. 318p Suppose -t - 7 = 2x, 0x - 5x - 25 = 0. Find the second derivative of -15vt + 7v3 + v2 + 6v - v2 wrt v. -48v Let l(n) = n*2 + 2n - 3. Let w be l(2). Let h be 10/25 - 26/(-10). Differentiate -p*4 - 2p*4 + wp*4 + h wrt p. 8p3 Let a(v) be the second derivative of -v5/24 - v4/24 - v3/3 + 4v. Let j(b) be the second derivative of a(b). Differentiate j(h) with respect to h. -5 Let m be ((-18)/(-4))/(6/24). Suppose 2s = g + 7, -5g + m = s - 2. What is the second derivative of -w3 - 3w*2 + 3w*2 - gw wrt w? -6w Suppose w = b - 0w, -4w = 0. Let f = 2 + b. What is the third derivative of -6n5 + nf - 2n2 + 4n*5 wrt n? -120n*2 Let r(w) = -6w*2 - 14w - 3. Let n(h) = h*2 + h + 1. Let p(o) = -3n(o) - r(o). What is the second derivative of p(b) wrt b? 6 Let g be (-9)/(-3)-1 + 6. What is the first derivative of 3x*2 + 5 - 3x*2 + gx*2 wrt x? 6x Let p(u) = u - 26. Let a(h) = -9. Let c(t) = 11a(t) - 4p(t). Differentiate c(k) with respect to k. -4 Let d(a) be the first derivative of 6a3 + 5a*2 - 9. What is the second derivative of d(h) wrt h? 36 What is the second derivative of 22o + 19o + 4o*4 - 55o wrt o? 48o2 Find the second derivative of -5z - 9z3 + 12z*3 + 14z wrt z. 18z Find the third derivative of -16w*6 + 4w*6 - 11w*2 + 10w*6 - 3w*2 wrt w. -240w*3 Let y(c) be the first derivative of 2c*6/15 - 5c*2/2 - 5c - 4. Let d(u) be the first derivative of y(u). Differentiate d(w) wrt w. 16w3 Let f(y) = 27y*4 + 9y*2 + 9y + 47. Let h(g) = 7g4 + 2g*2 + 2g + 12. Let w(r) = 2f(r) - 9h(r). What is the first derivative of w(x) wrt x? -36x3 Let r be (2/3 + -1)-6. Find the third derivative of 4b5 + rb*6 + 2b2 - b6 - 4b5 wrt b. 120b3 Let d(v) be the second derivative of -v9/1512 + v5/60 - v3/2 + 4v. Let s(q) be the second derivative of d(q). Find the second derivative of s(f) wrt f. -40f*3 Let a(y) = -y - 1. Let u(n) = n - 1. Suppose 4j = 3i + 28, 0j = i + 2j - 4. Let m(v) = iu(v) - a(v). What is the derivative of m(t) wrt t? -3 Let d(a) be the first derivative of -43a5/5 - 19a + 20. Find the first derivative of d(u) wrt u. -172u3 Let z = -8 - -28. What is the second derivative of -20p*3 + zp*3 - 3p + 3p5 wrt p? 60p*3 Let d = 3 - 1. What is the derivative of 1 + 2c - 3c + 6c + d wrt c? 5 Let x(j) be the second derivative of -1/6j3 + 0 + 1/6j*4 + 3j + 0j2. What is the second derivative of x(n) wrt n? 4 Suppose 0f = -f + 2. Find the second derivative of v + v*f - 2v + 3v2 - 3v*2 wrt v. 2 Let i(k) be the second derivative of -2k*8/7 - 7k*4/6 - 16k. Find the third derivative of i(o) wrt o. -1920o3 Let a(z) = 2z*2 - 7z - 1. Let v be a(4). Let t(n) be the second derivative of 1/6n4 + 0nv - n2 - n + 0. Differentiate t(k) wrt k. 4k Let c = 4 - 2. Let x = 0 + c. Find the third derivative of -2b6 - bx - b*2 + 4b*2 wrt b. -240b*3 Find the third derivative of 9k*5 + 3k*2 - 17k + 17k wrt k. 540k*2 Suppose 2k = -5l + 26, 0l - 2 = -2k + l. What is the derivative of 9 + 2f*3 + 9f4 + f4 - 2fk wrt f? 40f**3 Let b(u) b	{ "pile_set_name": "DM Mathematics" }
g r is positive. r(31/15) Simplify ((t(-3/4)t)/ttt((t/t5)/t)/t)/(t(-1/2))*(-38)t/t*1t*(-1/3)(t(-1/4))(-7/2) assuming t is positive. t(-557/24) Simplify d(1/5)d/((d(d/(dd/d0))/ddd)/d)d(d/(dd(-2)))/d(-1/3)((d/(d/d(-1/2))d)(-49))8 assuming d is positive. d*(-2872/15) Simplify ((ggg/g(-6/25))/g)43/((g/g(-1/11)g)/gg/(gg*(24/5)/gg)) assuming g is positive. g(27508/275) Simplify ((r4r)14)(3/5)((r/r(2/5))(-17))(3/7) assuming r is positive. r(1317/35) Simplify (((o*(1/57)o)/o)/o)*(2/43)/((oo(2/131))/o(5/4)) assuming o is positive. o(242785/1284324) Simplify ((f(-5)fff/(f/(f(-25)ff))f)/((f/f*37)/ff(5/8)))(-2/119) assuming f is positive. f(-13/68) Simplify q(-1)qq*(3/5)qq6q*(6/7)((((qq/((q1/q)/q))/q)/q)/q)/qq*(-2/7)/q(q*(1/4)/q)/qqqq/(q/q*(-4))q assuming q is positive. q*(479/140) Simplify ((k/((kk*(1/4)/kk)/k))*(1/3)(k(-2/3))(-9/7))(-1/8) assuming k is positive. k(-31/224) Simplify (x*(-6)/x)/xx*(-2)x/x*(-1)x*(1/4)x/(xx/x(1/4))x/x*7x*1xx5 assuming x is positive. x(-15/2) Simplify ((g(-2/7)g)/(g/(gg(2/19)g)))/(g*3/gg/g*(1/5))(g(-1/4))(-30)g/g7g/(g/g*0g) assuming g is positive. g(-639/1330) Simplify q(-12)qq/(q/(q/((q/((q/(qq8))/q))/q)))q(q16q)/(qq13) assuming q is positive. q(-15) Simplify (b9b3)(2/85)/(b*(1/6)/bb(-3))36 assuming b is positive. b(11754/85) Simplify z(-20)/z*(1/23)z*11z/z(-43) assuming z is positive. z(804/23) Simplify (((ww/w4)/w)(2/25)(w(-1))(-1/12))(1/4) assuming w is positive. w(-47/1200) Simplify (k*(4/9)k*4kk(-1/2)/k(-1/4))/((k2/kk*3k)/(k((k/k(-4))/k)/kkk(-3/2))) assuming k is positive. k(133/36) Simplify ((((k(-1/4)/kk)(-43))(-2/29))(-5))(-20) assuming k is positive. k*(-2150/29) Simplify ((dd*(-7)d)/d(-5))(-6)/(((d/(d*(6/11)d))/d)/d(-2))(-2/27) assuming d is positive. d*(10/297) Simplify (dd*1d*(-1/2)d5/d(-5))/(dd/(d/d4d)d/(d0d)d3dddd4) assuming d is positive. d(-5/2) Simplify (((i/i1)/i(-1/11))/(((i/(ii/(ii/(ii*(1/24))ii)))/ii)/ii)(-36))(-1/39) assuming i is positive. i(-1553/858) Simplify (m/m2)(-13/7)(mm(1/2))28((m/m*7)/(mmm(7/3)mm))(-5) assuming m is positive. m(2216/21) Simplify ((x(1/3))(-3/8))(-1/35)/((((((x(-2/9)/xx)/x)/x)/xx)/x(1/2))/(x(-2/9))(-12)) assuming x is positive. x(13589/2520) Simplify ((u(-1)u)*(-4)(u/u(-1/4))/u(-2))/((u*(-2)u)/uu(2/17)/u(u(-2/7))25) assuming u is positive. u(6319/476) Simplify b2/bb/(b/(b(bb(-1))/b))b((b/b(2/5))/b)/bb(b/b(2/9)b)/b(b(-1/3))(-19)b*(-2/9)/bb5 assuming b is positive. b(562/45) Simplify (jj/(((j(1/3)j)/j)/j))*(-5/7)j*(4/5)/j(jj(2/9)j)/jj((j/(jj/(jj0)))(2/21))(2/89) assuming j is positive. j(37/315) Simplify (y(1/2))(-2/95)/((y/((y/(y/(y/y*(1/5))))/y)yy)/(y/(yy*(-4)/y)))(y*(3/5)/(yyy/(y(-3)y)y))(-31) assuming y is positive. y(16073/95) Simplify ((tt1)(6/17))*41(t(-1/4))(-18)/(t*0/((tt*(1/8)tt)/t)) assuming t is positive. t(4837/136) Simplify (((h/(h(7/2)/h)h(-1))/(h(-7)/(hhh11)))(8/5))49 assuming h is positive. h1372 Simplify (((((q/(qqq/q*(-4)qq))/q)/q(-2/11))/(q(-2/3))22)(1/58))(24/7) assuming q is positive. q(772/2233) Simplify (((u/u4u)*(-32)u*(2/11)uu(-4)/uu)(9/10))(3/19) assuming u is positive. u(18171/2090) Simplify (((q0qq/q*11qq)/(q0)(-6/5))(-34))29 assuming q is positive. q6902 Simplify ((((iii(-1/9))/(ii(2/5)))(-10/11))49)(-31) assuming i is positive. i(6076/9) Simplify (((g(-3/10)/((g/(g(g/(g(g/((g/(g*(2/9)/g))/g))/ggg)g)/g))/gg))39)(-35))37 assuming g is positive. g(461279/6) Simplify ((l(-2/7)l(l(-4)l)/ll)/(l6ll(-3)))/((l(2/7)/l)(-36/11)/((l(1/2)/l)/l)(-1/18)) assuming l is positive. l(-7891/924) Simplify (q/(q1/q))(16/9)q*2qq(-3/5)q/q*6(q/(q/((q*4qq)/q)))/q(q*(-1)q)(-4/19) assuming q is positive. q(143/45) Simplify ((j(j/(jj(j(2/3)/jj)/j)j)/j)(-9)j(-4/3)/j(1/3))/((j*(2/3)j)/((j/((j*(3/5)j)/j))/j)j6j/(jj(-7)/j)) assuming j is positive. j(-314/15) Simplify (((r/(r(-29)r))/(r/(r(-21)/r)))/(r/(r7r)r19))50 assuming r is positive. r*(-300) Simplify (a/(((aa(-1/2))/a)/a))(-47)(a/a(1/2))/aaa/(aa(-30)) assuming a is positive. a(-87) Simplify ((f(-1/2))(-29))(5/11)/((f/((f4/ff)/f))/(f/f(2/9))f*5f/(ff(-1/4))) assuming f is positive. f(1631/396) Simplify (ii/(i/(ii(-3/7)/i))i*2i*(-5)i(-2/11))/(i7/(ii5))(-5/3) assuming i is positive. i(-218/231) Simplify ((k/k9)/k(kk(3/7))/k)39/((kk*8)/(kk/k(-2)))(6/17) assuming k is positive. k*(-39990/119) Simplify (((ii/((i*0i)/i))*(-1/12)((ii(ii(-7))/i)/ii)/ii(-3))(-32))(-8/11) assuming i is positive. i(-640/3) Simplify (c/(c(-2)c)c(-2)ccc(ccc/(c/(c/c0)c))(-14))/((c(-2/7)c)/(c/((c(-1/10)/c)/c)))25 assuming c is positive. c(485/14) Simplify (((p/p(-14)p)/p(-5/11))/(p18p(-2/15)))(-1) assuming p is positive. p(233/165) Simplify (a/(aaaaa/(a/a(2/7))aa))4a(-1/5)/(a(-2/15)/a)((aa*(-9)/a)/(a/(aa/(a/(a/a(-4))))))(-5/4) assuming a is positive. a(-1597/105) Simplify ((g(-4)/(g/(g(-2/5)/g)))/(g(2/5))*(-24))/((ggg(-4/5)g)/(gg(2/5)g)g(6/5)g(4/7)) assuming g is positive. g(57/35) Simplify ((j4/j(-3))/((jj/(j(-1)/j)j)/j)(-4/7))/((j/((j/(j/(j/(j/(j/(j(-5)j))))))/j))/j(-2/11))(-36/5) assuming j is positive. j(-4237/385) Simplify (oo(-1/5))(-4/21)oo*(-1/2)ooo*8(o*(-7)o*(3/5))/((oo/o*(-5))/(ooo(-3))) assuming o is positive. o(-851/210) Simplify (((r(-2/3))45r*9((r/(r/(r/(rr11)))r)/r)/rr)40)(-37) assuming r is positive. r47360 Simplify ((f1f)*(-6/25)/(ff/f0)(-38))/(f/(ff(-4))ff3(f/(f/(f*(-1)/f))f)(13/2)) assuming f is positive. f(3701/50) Simplify ((z*2zz1)/(z(-4/5)/z5))/((z(2/5)/z)(15/7)(z/z*(2/7)z)23) assuming z is positive. z(-992/35) Simplify ((qq/q(-2))(-8/9)/(q/(q18/q)q(-19)/q))(2/7) assuming q is positive. q(584/63) Simplify (h1)30/((h/(h(2/75)/hhh))/(hh(-2/13))) assuming h is positive. h(30101/975) Simplify (((kk*(-3/7))/(kk*(2/9)/kk))/(k*6k((k/(k/(k/(k/(k(-1/14)k)k))))/k)/kk))/((k(-2))(4/11))(-1/31) assuming k is positive. k(-283697/42966) Simplify ((g*(-7/6)/gg/g(-3/4))/(g(11/2))39)(-2/117) assuming g is positive. g*(2579/702) Simplify (((pp4)/p(-9))/((p*(-1/7)p)/p9))/((p8(p/p(-3/7))/p)/(p(1/6)/p((p/(((p(p/(p(1/7)p)p)/pp)/p)/p))/p)/p)) assuming p is positive. p(505/42) Simplify ((l7/l(3/7))/((l/((l/l(-2/5))/l))/l*(-6)))/((ll(1/4))(-31))(-1) assuming l is positive. l(-5429/140) Simplify ((t(-2/7))(-45))*(-3/19)tt((t/((tt(3/5))/tt)tt)/t)/tt/((t5t)/tt)tt(((tt/(t5/t))/t)/tt)/(tt/(t3t)) assuming t is positive. t(-3079/665) Simplify (j6j(-2/7))/(((j/j(5/4))/j)/j(-3/2))j3/j(2/7)j0/(j/(jjj(-6)/j)) assuming j is positive. j(61/28) Simplify ((u/(((u/(uu(-1/2)))/u)/u))34)*(3/41)((u/(uuu*0u))/u)50/((u/u(4/3)u)/(uu*(-6)u)) assuming u is positive. u*(-18259/123) Simplify ((s(ss(-3))/s)/s(1/6))(14/3)((s/((sss/((s*6/s)/s))/s))/ss(-7)/s)/(s(2/13)s0) assuming s is positive. s(-1903/117) Simplify (i2ii)19(iii/(i*(-5)/i)i)/i*(1/12)(i*(1/6)i/((i((i(i*(9/2)i)/iii)/i)/i)/ii))(2/143) assuming i is positive. i(147305/1716) Simplify (p(-1/6)/pp/(p/p*(-11))p*(1/7)/(p/(ppp11)))(2/55) assuming p is positive. p(-1/1155) Simplify (x(-2/5))(-1/14)(x/x1)(9/10)(x(-4)/x)/x(-2/5)x*(5/4)x/(x/x(1/3)) assuming x is positive. x(-251/84) Simplify (s1)(-42)(s1s)*42(s/(s/(s/(ss(-5)/s)s))s(-6))(13/5) assuming s is positive. s(223/5) Simplify ((a(-1/3))(-9))(22/9)((a	{ "pile_set_name": "DM Mathematics" }
Let w(j) = 5j - 2. Suppose -3t + 2y = -10, -t = t + 3y - 11. What is tp(a) + 7w(a)? -9a - 2 Let d(c) = 0c - 3c - c + 8 + c. Let h(y) = -20 + 40 + 12023y - 12024y - 17. Calculate 3d(p) - 8h(p). -p Let u(a) = -13a*3 + 9a*2 - 56a - 9. Let h(p) be the first derivative of 3p4/4 - 2p*3/3 + 7p*2 + 2p + 690. Determine 9h(r) + 2u(r). r*3 + 14r Let w(c) = -91c3 + 5c*2 - 17c + 2. Let d(j) = 136j3 - 7j*2 + 27j - 3. Calculate 5d(v) + 8w(v). -48v3 + 5v2 - v + 1 Let t(i) be the second derivative of i4/3 + i3/2 - i2 - 13i. Let g(f) = f2. Let o(d) = 229d + 5272. Let l be o(-23). Give lg(q) - t(q). q2 - 3q + 2 Let u(w) = -4w + 1. Let x(f) = -1455f*2 - 132f + 33. What is -132u(z) + 4x(z)? -5820z2 Let n(l) = -6l*2 + 8l - 75. Let u(b) = -b*2 + b + 18. Determine n(s) + 4u(s). -10s2 + 12s - 3 Let b(r) = -27r2 + 2r. Let p(n) be the second derivative of 1089n4/4 - 81n*3/2 - 26n - 21. What is -243b(o) - 2p(o)? 27o2 Let b(c) = -10c*2 - 26c + 8. Let s(d) = 22d2 + 49d - 18. What is -9b(m) - 4s(m)? 2m2 + 38m Let y = -4 + 5. Let z(s) = 2s - 2. Let l(b) = 5b*2 + 2. Let r(h) = -2h*2 - 1. Let v(k) = l(k) + 2r(k). What is yz(d) + v(d)? d2 + 2d - 2 Let a(v) = 3v3 - 55v*2 - 5v. Let d(q) = -11q + 13q + 27q2 - 136q*3 + 48q*3 + 48q*3 + 39q*3. Determine -2a(f) - 5d(f). -f3 - 25f*2 Let i(u) = 7u*3 + 6u*2 - 5u + 3. Let d(a) = -20a3 - 17a*2 + 14a - 8. Let n(w) = 41w + 557. Let g be n(-14). Give gi(t) - 6d(t). t3 + t - 3 Let x(o) = 14o. Let q(a) = 47a + 61. Determine q(i) - 6x(i). -37i + 61 Let j(u) = u2 + u + 2. Let o be (38 - 37)(6/9)/(2/3). Let n(m) = m*2. What is oj(k) - 2n(k)? -k2 + k + 2 Let a(s) = 4s + 2. Suppose 0 = -5r - 33 + 183. Let k = 2404 - 2401. Suppose -r = -2f - kf. Let g(d) = 25d + 13. What is fg(u) - 39a(u)? -6u Let y(w) = w2 + w - 1. Let c(o) = 10o*2 - 12o - 8. Let a(b) = -b*2 + 3b + 1. Let m(z) = -5a(z) - c(z). What is -2m(v) - 9y(v)? v2 - 3v + 3 Let b(r) be the first derivative of 66 + 1/4r4 + 1/2r*2 + r + 0r*3. Let c(u) = 4u*3 + 7u + 6. Give 6b(h) - c(h). 2h*3 - h Let a(b) = 15781b*2 + 25b. Let j(v) = 15781v2 + 20v. Determine 4a(z) - 5j(z). -15781z2 Let w = -32162 + 32156. Let v(k) = -2k + 2. Let n(q) = -2 + 2 + 2q - 2. Determine wn(p) - 7v(p). 2p - 2 Let n(m) be the first derivative of 9m4/4 - 5m*3/3 + 4m + 3486. Let k(z) = 19z3 - 11z*2 + 9. What is 4k(b) - 9n(b)? -5b3 + b2 Let y(s) = 1324s + 11 + 3s*2 - 4s*2 - 1323s - 3. Let p(k) = -2k2 + 2k + 17. Give 4p(g) - 10y(g). 2g2 - 2g - 12 Let m(y) = -40y - 6776. Let g(w) = 29w + 5084. What is 11g(t) + 8m(t)? -t + 1716 Let l(m) = m. Let t = -28 - -73. Let g(q) = -tq - 4 + 48q - 2q. Calculate -g(i) + 2l(i). i + 4 Let v(w) = -w*2 + w - 4002. Let r(s) = -797. Give -11r(l) + 2v(l). -2l*2 + 2l + 763 Let b(s) = 3s2 + s2 + 5 - 6s*2 - 6s*2 - 5s. Let m = -58 - -37. Suppose -290 + 285 = o. Let g(q) = 33q2 + 21q - 21. Determine mb(v) + og(v). 3v2 Suppose -4w - 7 = a, 12w = -2a + 16w - 14. Let z(v) = -9v*2 - v - 9. Let n(k) = -13k*2 - k - 13. Determine az(p) + 5n(p). -2p*2 + 2p - 2 Let x(m) = 4m3 - 4m*2 - 11m. Let v(l) = -14l2 - 56 + 12l + 34 + 19l2 - 5l*3 + 22. What is 2v(f) + 3x(f)? 2f*3 - 2f*2 - 9f Let k(y) = -7y3 + 6y*2 + 8. Let n(w) be the second derivative of -2w*5/5 + 7w*4/12 + 4w*2 - w + 1888. What is 6k(g) - 5n(g)? -2g3 + g2 + 8 Let l(g) = g*2 + 1. Let y(n) = 8475n*2 + 2 - 16942n*2 + 8470n2 + n3 + n. Determine -2l(t) + y(t). t3 + t2 + t Suppose -3h + 11 + 7 = 0. Let q(g) = -12g2 - 10. Let v(x) = -19x*2 - 15. Let i(a) = 8q(a) - 5v(a). Let f(j) = -2j*2 - 11. What is hf(c) - 13i(c)? c2 - 1 Let z(l) = -22l*2 + 7l - 35. Let f(n) = n + 1. Calculate 5f(o) - z(o). 22o*2 - 2o + 40 Let f(k) = -k - 2. Let z(u) = 1. Let r = -89 - -90. Let l = 1029 + -1027. What is lz(b) + rf(b)? -b Let t(w) = -4048590w3 - 16313w. Let p(m) = -1489m3 - 6m. What is 16313p(o) - 6t(o)? 1483o3 Let d(r) = -r - 3. Let c(k) be the second derivative of k3/3 + 3k*2 + 36k - 25. What is -6c(a) - 15d(a)? 3a + 9 Let h(s) = -s3 - 4s + 4. Suppose 12 = -8v + 14v. Let m(a) = 3a3 + 17a - 17. Calculate vm(y) + 9h(y). -3y3 - 2y + 2 Let h(d) = -7d3 + 6d*2. Let l(k) = 152k + 3945. Let p be l(-26). Let r(b) = 8b3 - 7b*2. Give ph(a) - 6r(a). a3 Let k(l) = -20l + 1227. Let f(a) = 13a - 817. Calculate 10f(v) + 7k(v). -10v + 419 Let r(c) = -c*2 - 159c + 34. Let w(v) = -133v + 35. Determine -5r(g) + 6w(g). 5g*2 - 3g + 40 Let k(v) = -3728v - 3. Let b(l) = -7454l - 8. What is 3b(n) - 7k(n)? 3734n - 3 Let k(g) be the first derivative of -3g*2/2 - 2g - 2. Let r(z) = 48z + 33. Let w = -99774 + 99768. Give wr(m) - 99k(m). 9m Let h(g) = -8g2 + g + 2. Let k(x) = -38x*2 + 123x + 8. Determine -5h(z) + k(z). 2z*2 + 118z - 2 Let i(g) = g*2 + 15g - 1431. Let n be i(-46). Let j(y) = -y*3 + 3y*2 - 5y - 14. Let p(q) = -q*3 + 5q*2 - 8q - 21. Give np(k) + 8j(k). -3k3 - k2 - 7 Let w(d) = -2d*2 + 5d - 2. Suppose -185 - 205 = 112n + 170. Let k(t) = t2 - 4t + 1. Determine nk(r) - 4w(r). 3r2 + 3 Suppose -6f + 4i - 12 = -9f, 3i + 12 = 3f. Let x(j) = 9j - 8j*3 + 25j - 1 - 29j. Let q(v) = 7v*3 - 4v. Give fx(d) + 5q(d). 3d3 - 4 Let u(p) = -355p + 12. Let o(v) = -379v + 14. Determine 3o(n) - 4u(n). 283n - 6 Let f(v) = -4v - 10. Let m(d) = 3d + 9. Suppose 4h - 8 = -l, -h + 6l + 7 = 5l. Suppose 2q = 5q - 4c - 17, 0 = -3q + hc + 18. Give qm(u) + 6f(u). -3u + 3 Let w(h) = 3h*2 + 2. Let a be (-4)/1212 + 6. Let n(l) = 30 - 13 + l - 13l2 - 26. Give an(i) + 9w(i). i2 + 2i Let q(t) = -14t + 1052. Let x(a) = 38a - 3158. Determine 8q(w) + 3x(w). 2w - 1058 Let q(b) = -495344b*2 + 12b*3 + 495344b*2 + 4b. Let i be (-7)/(-14) - (-3)/(-2). Let y(t) = t*3 + t. What is iq(u) + 4y(u)? -8u*3 Let o(b) = 7b*2 + 2b - 3. Suppose 207 - 1565 = -7t. Let d = t + -187. Let j(g) = -13g*2 - 4g + 5. Calculate do(w) + 4j(w). -3w2 - 2w - 1 Let y(u) = -15u - 906. Let r be y(-60). Let m(v) = 5v*3 - 15v*2 - 2v + 6. Let k(i) = -9i3 + 29i*2 + 4i - 11. Determine rk(o) - 11m(o). -o*3 - 9o*2 - 2o Let g(q) = 16q3 - 107q*2 - 19q + 4. Let n(x) = -79x3 + 533x*2 + 105x - 21. Calculate 11g(c) + 2n(c). 18c3 - 111c2 + c + 2 Let c(f) be the third derivative of f6/120 + f5/60 + f4/24 - f3/6 + f2 - 695. Let r(b) = 19b3 + 5b*2 + 5b - 5. Calculate 5c(i) - r(i). -14i*3 Suppose -6w = -13w + 126. Let z = 15 - w. Let h(a) = 2a*2 + 3a - 3. Let d(i) = 3i2 + 7i - 7. Give zd(y) + 7h(y). 5y2 Let g(x) = 3x + 3x - x - 3x. Let y(j) = 6j + 1 - 1 + 0 - 2. Let h(r) = 4g(r) - 2y(r). Let d(k) = -2k + 2. Give -11d(v) + 6h(v). -2v + 2 Let w(f) = 931f*2 - 63. Let d(q) = 30q*2 - 2. Let u(o) = -2o*3 - 46o*2 + 46o - 111. Let y be u(-24). What is yd(r) + 2w(r)? -28r2 Let s(a) = 9a*3 - 5. Let t(l) = 58l*3 + 6l*2 - 8. Let g(n) = 105n*3 + 11n*2 - 14. Let d(j) = -6g(j) + 11t(j). Determine -4d(h) + 3s(h). -5h*3 + 1 Let i(m) = -m - 871. Let x(y) = y + 850. Give 2i(d) + 3x(d). d + 808 Suppose -3w + w = -2. Let v(s) = 1 + 40679315552s - 1 + 13s*3 - 40679315557s. Let q(n) = n. Give wv(d) + 5q(d). 13d3 Suppose -44 = 4y - 12, -2o - 42 = 4y. Let m(l) = -2l3 + l2 + 5l + 5. Let h(n) = 0n + 1 + n2 + n + 0n. What is oh(x) + m(x)? -2x*3 - 4x*2 Let w(l) = 54l*3 + 9l*2 + 9l. Let s(t) = -27t3 - 5t*2 - 5t. Let p(m) = 328m + 2629. Let d be p(-8). Determine dw(g) + 9s(g). 27g*3 Let x be (3/2)/(39/(-130)) + 6. Let y(m) = -6m*2 - 2m. Let j(s) be the third derivative of s5/60 + s4/24 - s*3/6 - 857s*2. What is xy(u) + 2j(u)? -4u2 - 2 Let n = 34496 + -34500. Let w(g) = -g2 - g - 5. Let o(t) = 2t2 + 3t + 11. What is no(z) - 10w(z)? 2z2 - 2z + 6 Let w(q) = 3q3 - 16q*2 + 3q + 6. Let k be w(5). Let f(b) = 2b3 + 4b*2 + 4b - 4. Let g(a) = -4a3 - 8a*2 - 9	{ "pile_set_name": "DM Mathematics" }
rder. 6, -20, -48796 Sort -347, 362, 2. -347, 2, 362 Sort -9, -3, 0, -59, 76, -4 in ascending order. -59, -9, -4, -3, 0, 76 Sort -4, 139, -2, -21, -13/5 in ascending order. -21, -4, -13/5, -2, 139 Sort 1, 1715835, -28 in decreasing order. 1715835, 1, -28 Sort 6806, -5, -515 in ascending order. -515, -5, 6806 Put -80884, 1, 2, -8.6, 0.2 in increasing order. -80884, -8.6, 0.2, 1, 2 Sort 1683, 4, 9, 3, -8, 1 in descending order. 1683, 9, 4, 3, 1, -8 Sort 5, 2, 16, -2, 87, 1, -10 in descending order. 87, 16, 5, 2, 1, -2, -10 Sort -9, -6.25, -1651 in decreasing order. -6.25, -9, -1651 Put 4, 5.8267, -5 in descending order. 5.8267, 4, -5 Sort 2024, 6, 209. 6, 209, 2024 Sort -100, -4, 0, -202, 5 in descending order. 5, 0, -4, -100, -202 Sort 53868, -9, 5. -9, 5, 53868 Sort 3117, 216, 2. 2, 216, 3117 Put -0.5, -1/4, -21, -87/22, -9 in decreasing order. -1/4, -0.5, -87/22, -9, -21 Sort 8, 440, -2, 21/10 in descending order. 440, 8, 21/10, -2 Put 1, 0.56, 5, -0.04, 0.6406 in decreasing order. 5, 1, 0.6406, 0.56, -0.04 Sort -7, -0.151, -0.28, 0.09 in increasing order. -7, -0.28, -0.151, 0.09 Put -0.26, 1.2, -62, -0.03 in descending order. 1.2, -0.03, -0.26, -62 Sort -14, -2558872, -1/4, 3 in decreasing order. 3, -1/4, -14, -2558872 Sort -25665, 29, -0.03. -25665, -0.03, 29 Sort -7, 1325, 0, -524, -5 in descending order. 1325, 0, -5, -7, -524 Sort 0.1, 355, 0.2, 2, 47, -2. -2, 0.1, 0.2, 2, 47, 355 Put 0.1, -424950, 12 in ascending order. -424950, 0.1, 12 Sort -5, 28/5, -255/478, 1/15, -1/4 in descending order. 28/5, 1/15, -1/4, -255/478, -5 Sort 1/48, -2/7, -3, 5, 4, -52, -2 in ascending order. -52, -3, -2, -2/7, 1/48, 4, 5 Put -2, -4, 0, 2, 5, -15 in descending order. 5, 2, 0, -2, -4, -15 Sort 0.5, 0, -52, -16, 5, -0.03 in decreasing order. 5, 0.5, 0, -0.03, -16, -52 Sort -14213, -0.864, -0.1 in ascending order. -14213, -0.864, -0.1 Put 2/3, -2/11, 4, 5/191, 173 in increasing order. -2/11, 5/191, 2/3, 4, 173 Sort -4, -2.7021, -5, 7/404. -5, -4, -2.7021, 7/404 Put 4, 108, 0.5, 0.058, -0.5, 2 in decreasing order. 108, 4, 2, 0.5, 0.058, -0.5 Sort -1, -5557, 5, -5, 6, 0 in decreasing order. 6, 5, 0, -1, -5, -5557 Sort -1, -2, 17884, 2, 6, 1 in decreasing order. 17884, 6, 2, 1, -1, -2 Put 3, -26, 8, -2323, -5, 5 in descending order. 8, 5, 3, -5, -26, -2323 Sort -3, -4, -6, 3, 1017, 14. -6, -4, -3, 3, 14, 1017 Put 1, 5, 9422706, -2, -16 in ascending order. -16, -2, 1, 5, 9422706 Put -2, -13, 58919, 8, 3, 4, 1 in increasing order. -13, -2, 1, 3, 4, 8, 58919 Put 15, 3, -942, 5 in decreasing order. 15, 5, 3, -942 Sort 5, -737522, -17, 1 in decreasing order. 5, 1, -17, -737522 Sort -48, -1217, -3, 4, -4 in decreasing order. 4, -3, -4, -48, -1217 Put 1, 649922, -2 in descending order. 649922, 1, -2 Put 2, 1, -6, -3, 25887, -4 in decreasing order. 25887, 2, 1, -3, -4, -6 Sort 61544, 38, -50. -50, 38, 61544 Put 11/27, -4, 0, 1/7, -0.3 in descending order. 11/27, 1/7, 0, -0.3, -4 Sort -1/4, 6/5, 5, 243079. -1/4, 6/5, 5, 243079 Sort -4, -153, 4, 90, -3 in descending order. 90, 4, -3, -4, -153 Sort -8, 121, 0.2, 425, 3/7, -50. -50, -8, 0.2, 3/7, 121, 425 Sort -5, -1, 3, 251, -383, -4, 2 in ascending order. -383, -5, -4, -1, 2, 3, 251 Sort -2, -13, 57, -17, -30 in ascending order. -30, -17, -13, -2, 57 Put 5, 29, -2, -606, 4 in descending order. 29, 5, 4, -2, -606 Sort 1, 0.87349, -0.07, 2.4, -2/9. -2/9, -0.07, 0.87349, 1, 2.4 Sort -14, 2, -20, -1357 in descending order. 2, -14, -20, -1357 Put 0, 1, 73, -29, 86 in descending order. 86, 73, 1, 0, -29 Sort 2, -82, 2527089, 0 in decreasing order. 2527089, 2, 0, -82 Sort -724, -2, 14, 2, 0, -4, -2609. -2609, -724, -4, -2, 0, 2, 14 Sort -1, 1, -113, -4, 0, -5 in descending order. 1, 0, -1, -4, -5, -113 Sort -0.48051, -1, 0.4, 0.03, -0.59. -1, -0.59, -0.48051, 0.03, 0.4 Sort -369, 0, 11, 493 in decreasing order. 493, 11, 0, -369 Sort -5, -1/2, 10/3457, -8, -112 in decreasing order. 10/3457, -1/2, -5, -8, -112 Sort -25.4, 2/27, 5, 558. -25.4, 2/27, 5, 558 Sort 0, -3, 210995, -6, -2 in ascending order. -6, -3, -2, 0, 210995 Sort 1, 41, 0.1, -0.5, -12.4, 308 in decreasing order. 308, 41, 1, 0.1, -0.5, -12.4 Put 6820, 24, -4, 151 in decreasing order. 6820, 151, 24, -4 Sort 0, 9538090, 0.2 in increasing order. 0, 0.2, 9538090 Sort 6, 1, -9171692 in descending order. 6, 1, -9171692 Put -8/5, -67, -5, 3, -34, 4 in descending order. 4, 3, -8/5, -5, -34, -67 Put 3, 504, -4, -1, -3874, 1 in decreasing order. 504, 3, 1, -1, -4, -3874 Put -162, 13272, 123 in decreasing order. 13272, 123, -162 Sort -6, 4, -3, 1892, 2, 1, 0 in decreasing order. 1892, 4, 2, 1, 0, -3, -6 Put 1/2, 0, -0.02273, 1, 0.2, 3/2 in ascending order. -0.02273, 0, 0.2, 1/2, 1, 3/2 Put 4, -4, 123, -6, -23, -11, 5 in descending order. 123, 5, 4, -4, -6, -11, -23 Put 14, -4, 5, 23, 96, 1, -3 in descending order. 96, 23, 14, 5, 1, -3, -4 Sort -1/58, 2, -2, -3/2831 in descending order. 2, -3/2831, -1/58, -2 Sort -3, -1/4, -3/2, -104, -138.2 in descending order. -1/4, -3/2, -3, -104, -138.2 Put -0.444, -2/7, 805, -2/11 in ascending order. -0.444, -2/7, -2/11, 805 Put 0.4, 1, 1.5, -0.86, 11, -2.2 in ascending order. -2.2, -0.86, 0.4, 1, 1.5, 11 Sort 2, -130024, 74 in decreasing order. 74, 2, -130024 Sort -5, -3/5, 163048/59 in descending order. 163048/59, -3/5, -5 Put 2, 42, 0.4, 0.5, 4.02, 312 in decreasing order. 312, 42, 4.02, 2, 0.5, 0.4 Put 57, -2748, 1792 in decreasing order. 1792, 57, -2748 Put -2, -11, 30821.4, -1/3 in decreasing order. 30821.4, -1/3, -2, -11 Put 25, -4, 3, 1, 9, -6 in decreasing order. 25, 9, 3, 1, -4, -6 Sort -4, 0, -1, 2, -2, 4, -1492 in descending order. 4, 2, 0, -1, -2, -4, -1492 Sort -7, -4, 1, 1527, -17, 2, -5 in ascending order. -17, -7, -5, -4, 1, 2, 1527 Sort 4, -18, -6939, -3 in decreasing order. 4, -3, -18, -6939 Put -3/49, -0.1, 5, -4.8, 70, -1 in ascending order. -4.8, -1, -0.1, -3/49, 5, 70 Put -1, 0.5, 1/5, -41, 16, -118 in increasing order. -118, -41, -1, 1/5, 0.5, 16 Sort 17, 85, -2, -4, 84, -5. -5, -4, -2, 17, 84, 85 Sort 8/5, 0, 10, -2/5, -14, -0.3 in decreasing order. 10, 8/5, 0, -0.3, -2/5, -14 Sort 143, -115, -4, -5, 0 in ascending order. -115, -5, -4, 0, 143 Sort 3, 94, -2, 0, -1, -199 in increasing order. -199, -2, -1, 0, 3, 94 Put -1, -176, -4, -386, -12 in decreasing order. -1, -4, -12, -176, -386 Sort 7/2, -4, -4739, 5 in descending order. 5, 7/2, -4, -4739 Sort 5/3, -5, -0.5, -3, -52, 2858 in ascending order. -52, -5, -3, -0.5, 5/3, 2858 Put -3, 18737, 77, 18 in increasing order. -3, 18, 77, 18737 Sort -1, -0.3, 6, -0.217, 30 in decreasing order. 30, 6, -0.217, -0.3, -1 Sort 4, -5, 3, -129, -1, -14 in descending order. 4, 3, -1, -5, -14, -129 Sort 904, 9, -7, 7 in decreasing order. 904, 9, 7, -7 Sort -4, 4, -63, -2, 1177, 6, -5 in increasing order. -63, -5, -4, -2, 4, 6, 1177 Put -3, 43904, 1, -62, -7, -2 in increasing order. -62, -7, -3, -2, 1, 43904 Sort 994, 0.2, -17, 2/5, 4, 5, 2 in ascending order. -17, 0.2, 2/5, 2, 4, 5, 994 Sort -1/28, 25, -2, -3, -0.7, 5, 1 in ascending order. -3, -2, -0.7, -1/28, 1, 5, 25 Sort -6, -3, -101, -4, -18 in decreasing order. -3, -4, -6, -18, -101 Put -62, 5, -910, -5, 100 in descending order. 100, 5, -5, -62, -910 Sort 0.1, 0.3, 9886893. 0.1, 0.3, 9886893 Sort -34, -5, 2.12574 in descending order. 2.12574, -5, -34 Put 893, 3, 67334 in descending order. 67334, 893, 3 Put 2805, 2, -1, 48 in descending order. 2805, 48, 2, -1 Put -2/3, -581861, -1, -0.5 in increasing order. -581861, -1, -2/3, -0.5 Sort -29, -5, -81316, 16 in descending order. 16, -5, -29, -81316 Put 1, 7, 12, 6, -93, 5, -4 in decreasing order. 12, 7, 6, 5, 1, -4, -93 Sort -4, -25, -1, -24, -10, 7. -25, -24, -10, -4, -1, 7 Sort -4, 0, 15, -37138 in increasing order. -37138, -4, 0, 15 Sort -10, 1008, -3, -2, 5, 1 in descending order. 1008, 5, 1, -2, -3, -10 Sort 1, -17856, 41 in decreasing order. 41, 1, -17856 Sort -1, -196959/11, -3 in descending order. -1, -3, -196959/11 Put 2512, -417, -0.049 in decreasing order. 2512, -0.049, -417 Put 31, -4, 1154, -2, 5, 2, 4 in increasing order. -4, -2, 2, 4, 5, 31, 1154 Put 1, -284, -4663 in decreasing order. 1, -284, -4663 Sort 0, 26, 20, 5, 30, 128. 0, 5, 20, 26, 30, 128 Sort 2312, 3, -2, -1, 0 in descending order. 2312, 3, 0, -1, -2 Put 2/29, 0.1, 113/281 in descending order. 11	{ "pile_set_name": "DM Mathematics" }
vided by 15. 0 Let j = -11961 + 11985. Let i = 12 + -22. What is the remainder when 688/20 + 4/i is divided by j? 10 What is the remainder when 718 is divided by 6-1 - (-3472)/48(-5 - -8)? 85 Suppose -2b + 7b + 266 = 3u, 4u + 3b = 374. Calculate the remainder when 381 is divided by u. 13 Let q be (-1 - -9) + (-8 - -2). Suppose c = -3r + 6, 3r - r = 2c - 44. Suppose qm - c = 18. What is the remainder when 71 is divided by m? 17 Suppose 1463 = 4r + 209u - 204u, -3r + 1098 = 3u. What is the remainder when r is divided by (7/(-3) + -1)-3? 7 Let b(y) = 202y*3 - 29y + 202y3 - 18 - 403y*3 + 10y*2. Calculate the remainder when b(-12) is divided by 15. 12 Let c(d) = 176d + 18047. Calculate the remainder when c(-91) is divided by 5. 1 Suppose -38649 + 255712 = 2679i + 140i. Let k(h) = -4h - 3. Calculate the remainder when i is divided by k(-4). 12 Suppose -4i + 349 + 183 = -3g, 2g + 665 = 5i. Calculate the remainder when 163 is divided by i. 30 Let g = -67 - -70. Suppose gr - 155 + 56 = 0. What is the remainder when 130 is divided by r? 31 Suppose 5z - 3b + 3 = 3z, 4z - 4b + 4 = 0. Suppose 4a + 40 = 4w, -2w - w - 3a = z. What is the remainder when 29 is divided by 5/w81? 5 Let u(o) = 2o - 6. Let s be (-100)/(-15) - (-2)/(-3). Let q be u(s). Suppose qc - 18 = 5c. What is the remainder when 69 is divided by c? 15 Let d(u) = -u*3 - 9u*2 + 6u - 3. Let b be d(-10). Let r = b + -23. Calculate the remainder when 6 is divided by 2/3 + 0 + r/6. 0 Suppose -1429 = 34v - 2007. What is the remainder when 413 is divided by v? 5 Suppose 17i = 14i - 18i + 3990. Calculate the remainder when 238 is divided by i. 48 Let q(x) = x*2 - x + 5. Let a be (3/(-9))/((-3)/36). Calculate the remainder when (3 - 940/(-14) - 4) + (-2)/14 is divided by q(a). 15 Suppose 21v = 20v. Suppose -16t - 298 + 730 = v. Calculate the remainder when 103 is divided by t. 22 Let z(r) = r*2 + 10r + 54. Calculate the remainder when 430 is divided by z(-9). 25 Suppose 0 = 2268y - 2546y + 1837024. Calculate the remainder when y is divided by 76. 72 Let w = -72 - -156. Suppose -2h - 28 = -w. What is the remainder when h is divided by 2? 0 Let h = -146 - -177. Suppose -4u - 2d + 6d + 40 = 0, 3d + 15 = 2u. Suppose -uc + h = -89. Calculate the remainder when 19 is divided by c. 3 Let u = -234 - -38. Let x = u + 200. Calculate the remainder when (-10 + -1)/(1/(-2)) is divided by x. 2 Let l = 59 + -39. Suppose lu - 8u = 132. Calculate the remainder when 1/3 - (-53)/3 is divided by u. 7 Suppose -18s - 4i + 52 = -16s, -2i - 6 = -s. Let c be (-2)/7 + (-1280)/(-70). What is the remainder when (-695)/(-9) + (-4)/c is divided by s? 13 Let v = 11 - 7. Suppose 0 = 5j - j - 40. Let k = 17 - j. Calculate the remainder when k is divided by v. 3 Let k(y) = -y*3 - 4y*2 + 3y - 106. Let n be k(0). What is the remainder when 194 is divided by -2(n/4 + -7)? 60 Let b(o) = o2 - 20o + 9. Calculate the remainder when b(22) is divided by (11 - 0) + (2 - 0 - 7). 5 Let g(r) = r*2 + 18r - 224. What is the remainder when 1442 is divided by g(-27)? 17 Let n = -30804 + 48621. Calculate the remainder when n is divided by 60. 57 Suppose -19q + 73 + 115 = -78. What is the remainder when 1340 is divided by q? 10 Let l = -9 - -18. What is the remainder when (-2)/(8/(-62))2/1 is divided by l? 4 Let g(z) = -z*3 - 2z*2 - 3z - 2. Let k = -354 + 604. Suppose -kn + 255n = 50. What is the remainder when n is divided by g(-2)? 2 Let o = -24 - -24. Suppose -4l + o + 52 = 0. Calculate the remainder when 102 is divided by l. 11 Suppose 14n - 10n + 326 = 5t, 2n - 178 = -3t. What is the remainder when 2167 is divided by t? 59 Let u = -13189 + 13358. Calculate the remainder when 646 is divided by u. 139 Let m = -4670 + 4964. What is the remainder when m is divided by 27? 24 Let w be (-1 - (2 - 2)) + -4 + 12. What is the remainder when 39 is divided by 2/w-1270/(-40)? 3 Let b(d) = -d*3 + 3d*2 - 3d + 4. Let n be b(4). What is the remainder when n/132 - (-501)/33 is divided by 3? 0 Calculate the remainder when ((-107433)/346)/((-1)/2) is divided by 37. 29 Let h = 5851 + -5826. What is the remainder when 792 is divided by h? 17 Suppose 46g + 0g = -92. Calculate the remainder when 47 is divided by 2/(4 + g) + (-27 - -39). 8 Suppose -1 = q + 8f, -4f + 764 - 822 = -2q. What is the remainder when 563 is divided by q? 11 Suppose 4b = -b + 25. Suppose 5n - 530 = -bz, z = 3z - 4n - 218. Suppose 147a - 132a = 540. What is the remainder when z is divided by a? 35 Suppose 15 = -5i, -5i = 5w - 0i - 20. Let u(t) = -3t3 + 21t*2 + 6t + 1. What is the remainder when u(w) is divided by 13? 4 Suppose 7t - 20 = -4u + 11t, 2u + t = 1. Calculate the remainder when u + -2 + 392 + (-3 - -5) is divided by 36. 34 Let d(h) = 40h - 530. Calculate the remainder when d(16) is divided by 37. 36 Suppose -9b = -20293 - 3305. Calculate the remainder when b is divided by 35. 32 Let b(y) = 225y - 3912. What is the remainder when b(29) is divided by 869? 6 Let k = -25 - -36. Suppose 234 = 5o - k. Let h(i) = 2i + 7. What is the remainder when o is divided by h(3)? 10 Let l(u) = u2 + 4u + 6. Let n be l(-4). Suppose n - 4 = -x. Calculate the remainder when ((-1 - -1)/x)/2 - -56 is divided by 15. 11 Let v(q) = -q + 20. Suppose 0z + 3z - 33 = 0. What is the remainder when -1 + 12 + 12/(-2) - -12 is divided by v(z)? 8 Let y(f) = -f*2 - 9f + 8. Calculate the remainder when y(-6) is divided by -4 - 60/(-7) - ((-12)/28 - 0). 1 Suppose 0 = -11i + 647 + 1366. Let k = i - 134. Calculate the remainder when k is divided by 9. 4 What is the remainder when 7028 is divided by 64/(-48)-12 - -63? 76 Suppose -63c + 62c = -83. Let b = 91 - c. Calculate the remainder when 103 is divided by b. 7 Suppose -3a = -3, -8r = -3r + 3a + 112. Let w = r + 130. What is the remainder when w is divided by 36? 35 Let g = 9 - -5. Suppose -gs + 11s = -285. What is the remainder when s is divided by (-6 + 10)((-99)/(-12) + -2)? 20 Let o(v) = 11v*2 - 443v + 167. What is the remainder when o(65) is divided by 102? 99 Suppose 3c - 12c = -27c + 95130. What is the remainder when c is divided by 17? 15 Suppose -2l + 3v - 914 = 7v, v + 4 = 0. Let h = l - -461. Calculate the remainder when 332 is divided by h. 8 Let c = 101 + -95. Suppose 0 = 2d + 5q + 23, -3q - 16 = -1. Calculate the remainder when (3/(-6))/((-3)/c) is divided by d. 0 Let j = 123 - 117. What is the remainder when 108 is divided by 938/112 + j/(-16)? 4 Suppose 4z = -5x + 4, -2x + 3z = -0 + 3. Let o be (x + -2)(36 + 3/(-3)). Calculate the remainder when o/(-35) + 376/(12) is divided by 49. 43 Suppose -4q - 12 = -a + 15, 41 = a + 3q. Calculate the remainder when 588 is divided by a. 28 Let l = 70 + -56. Let m(g) be the second derivative of g4/12 - 5g*3/2 + 13g*2 - 20g. Calculate the remainder when m(l) is divided by 6. 0 What is the remainder when 2951 is divided by 1/9 + (-181384)/(-1476)? 122 Suppose -32o + 1761 + 607 = 0. Calculate the remainder when 3180 is divided by o. 72 Let m(o) = -460o*3 - 4o*2 + 6o + 3. What is the remainder when m(-1) is divided by 47? 30 Let t be ((1/3)/(4/(-12)))/(-1). Suppose -6h + 11h = 240. What is the remainder when h is divided by (13 + -3)(2 - t)? 8 Let u(h) = 2h*2 + 10h - 995. Suppose 4p = 8 + 8. What is the remainder when u(-25) is divided by p? 1 Let x(u) = -65u*2 + 34u*2 + 2 - 11u + 34u2 - 4u. Suppose 5t = 64 - 4. Calculate the remainder when x(6) is divided by t. 8 Suppose 596m + 3785 = 65918 + 17135. Let t(u) = -4u + 5. Calculate the remainder when m is divided by t(-10). 43 Calculate the remainder when 481 is divided by 5/45 - 222(-12)/81. 19 Let z(j) = 32j - 51. Suppose 0 = -4t - h + 6, -5h - 4 = -t + 8. Let f(g) = 2g*2 + 10g - 6. What is the remainder when f(-8) is divided by z(t)? 3 Let i be (-48)/32-2155. Suppose 0 = 5p - k - i, p - 2k + 0k = 93. Calculate the remainder when p is divided by 12. 9 Suppose 0 = 17z - 12z - 265. Suppose -13 = 2p - z. Let a = 163 - 125. Calculate the remainder when a is divided by p. 18 Let z = 13 + 18. Let b(c) = -118c3 - 32c**2 - c + 1. Calculate the remainder when b	{ "pile_set_name": "DM Mathematics" }
z = -21z - 32. Calculate the lowest common multiple of z and q. 24 Calculate the common denominator of -93/20 and (-3411)/(-4536) + (-2)/4. 2520 Suppose -4b - p + 4 = -6, 4b = p + 14. Suppose 2n + 9 = -l + 3n, 2l + 22 = bn. Let a = l - -11. What is the smallest common multiple of 4 and a? 12 Calculate the common denominator of (30/80)/((-40)/(-38) + -1) and 35/24 + 2/(-6). 8 Suppose 3o - 267 = -6h, -5o + 5h = -3o - 223. What is the least common multiple of 162 and o? 1782 Suppose 0 = 4a - 4x - 2240, 1136 = a + a + 2x. Suppose a = i - 4r, -471 = -2i + r + 650. Calculate the common denominator of 3/(-7) + 604/i and -83/18. 180 Suppose d = -8d + 594. What is the smallest common multiple of d and 60? 660 Find the common denominator of -1(0 - (-71)/(-6)) and -69(-1)/(-168)-20. 42 Suppose u = -44 + 50. Calculate the lowest common multiple of u and 12. 12 Let i = 13 + 56. What is the smallest common multiple of (-52)/(-6) - (-4)/(-6) and i/18 - 2/(-12)? 8 Let l(j) = -j2 + 2j + 3. Let i be l(3). Suppose i = 4p + 9 - 49. Calculate the least common multiple of p and 7. 70 Let o = 70 + -35. Calculate the least common multiple of 70 and o. 70 Let d = 26 - 13. Suppose -n + g = -7, 0n + g - d = -n. What is the lowest common multiple of n and 10? 10 Suppose 540 = 2t + 1890. Calculate the common denominator of (t/(-10))/(-9) - -4 and (-1 - 0)(-93)/8. 8 Let t = 3038965/722136 - -1/30089. Calculate the common denominator of t and -7/9. 72 Let f be 3(2 - 13537/(-3)). Let b = -1/6173746 - -502039764107/37042476. Let g = f - b. Calculate the common denominator of g and 57/14. 84 Suppose 8i - 55 - 57 = 0. Let p(c) = c. Calculate the lowest common multiple of p(4) and i. 28 Let t = -1 - -4. Let y(m) = -2m + 1. Let l be y(2). Let x(p) = 2p*2 + 5p + 5. What is the smallest common multiple of x(l) and t? 24 Let g(a) = a*2 - a + 4. Let n be g(-3). Suppose 8 + n = 3d. What is the smallest common multiple of d and (-30)/(-4)(-4 + (-80)/(-12))? 40 Let v(x) = -x - 7. Let s be v(-8). What is the common denominator of (s - (-51)/2)-1 and 91/8? 8 Let u be 7561/(-3443)(1 + 0). Let i = -24/313 + u. Find the common denominator of -20/7 and i. 77 Let k = 29/747 + 23/12948. Calculate the common denominator of k and 133/30. 2340 Suppose -9 = 2f + f, -k - 3f = 6. Let r(q) = q2 - 3q. Let i be r(k). Let m = -11 + i. Calculate the common denominator of 39/11 and m. 11 Calculate the common denominator of 6/(-3) - (-4)/((-1232)/(-636)) and 101/14. 154 Suppose 3x = -3x + 24. What is the lowest common multiple of 12 and 9 + (8/2)/x? 60 Let g = -96 - -106. What is the least common multiple of (8/g)/(-4) - 36/(-5) and 1? 7 Let j(h) = -h*2 + 15h + 38. What is the least common multiple of 240 and j(17)? 240 Suppose -2s = -s - 1. Let x be (s - 1) + -3 + 6. Suppose -xk = -2k - 2. What is the smallest common multiple of 4 and k? 4 Let c(y) = -y2 + 11y - 20. Suppose -5u - 8 = -u. Let g = 1 - u. Calculate the smallest common multiple of c(7) and g. 24 Let u(g) = -g + 1. Let c be (-1 + (-40)/(-4))-1. Let w be u(c). Suppose -3o + w = 2o. Calculate the lowest common multiple of 1 and o. 2 Let n = -30935 - -3217313/104. Calculate the common denominator of 19/26 and n. 104 Suppose 43 = 4l - 4065. Calculate the common denominator of 1/(-2) - l/390 and -107/18. 90 Let s = -23 + 15. Calculate the common denominator of -52/5 and (-3)/4 + 29/s. 40 Let a = 76 - 36. Suppose -a = -7l + 3l. Suppose 4c + c - 5d = l, 0 = 4c + d - 3. What is the least common multiple of c and 2? 2 Let a be (-3)/(182/88 - 2). Let b = 93 + a. Calculate the lowest common multiple of 11 and b. 539 Suppose -o + d - 6d + 33 = 0, 35 = 5o - d. Calculate the smallest common multiple of 40 and o. 40 Let a(p) = 15p. Suppose -2q - 12 = -18. Suppose -f + 2z = 0, -4f = -3z - 7 - q. What is the least common multiple of f and a(1)? 60 Let z(n) = 16n*2. Let t be z(-1). Suppose -3l = -2h + 14, 5h + 59 = -5l - 6. Calculate the least common multiple of -4(-4)/t - l and 11. 99 Let l be 4/2282 - (-1 + 1/1). Let n be (-1)/4 - (-133489)/(-4564). Let h = l - n. What is the common denominator of h and -24/13? 26 Suppose 12 = q - 6b + 4b, 0 = -3q + b + 61. Suppose 0y + 20 = y + 5s, 0 = s - 2. Let h = y + 2. Calculate the lowest common multiple of q and h. 132 Let k(c) = 7c + 163. Calculate the smallest common multiple of 231 and k(-22). 693 Let p = 22 - 14. Suppose -2z + 32 = -2d - 14, 5d = -z - 109. Let x = 31 + d. What is the least common multiple of x and p? 72 Let a(v) = -v3 + 6v*2 - 4v - 3. Let r be a(5). Calculate the common denominator of 149/6 and ((-184)/(-44))/r - -3. 66 Let m be (-274)/14 + 12/(-28). What is the common denominator of 23/4 and (45/m)/(30/(-92))? 20 Let q(d) = d*3 - 2d + 50. Let r = -5 - -5. What is the smallest common multiple of 22 and q(r)? 550 Let c(z) = z*2 + 2z + 3. Let v be c(0). Suppose 3h = -vx + 426, -2h - 4x + 145 = -h. Find the common denominator of 91/4 and (13/(-39))/((-2)/h). 4 Let p = -2/801 - 21607/8010. Find the common denominator of p and 97/8. 40 Let k(c) = -3c2 + 18c + 13. Let q be k(7). Let u = 22 - 8. Calculate the common denominator of -63/8 and (u/(-21))/(q/206). 24 Let u = 1264 - 936. Calculate the lowest common multiple of 80 and u. 3280 Let h(q) = -q*3 + 8q*2 + 4q - 4. Let i be h(7). Suppose 0 = 4d - i + 1. Let y = -394 + 402. What is the smallest common multiple of y and d? 72 Let u = -329/710 + 70139/110760. Find the common denominator of 13/18 and u. 936 Let v(i) = 2i - i - 146i2 + 16i*3 + 0i + 143i2. What is the lowest common multiple of v(1) and 16? 112 Suppose -y + 5p = 17, -3y + 7p = 2p + 11. Suppose 6w - yw - 30 = 0. Calculate the least common multiple of 22 and w. 110 Let b be (36/(-12))/((-3)/4). Suppose -5o - 2y + by = -23, 0 = -3o + 2y + 13. Calculate the smallest common multiple of 14 and o. 70 Let k(h) be the third derivative of h*4/8 + 5h*3/3 - 5h2. Let r be k(-4). Calculate the smallest common multiple of 10 and 10/(20/8 + r). 20 Let c be (-2)/(-9) + (-15540)/66285. Let h = c - 29903/3928. Find the common denominator of h and 29/4. 8 Calculate the common denominator of -87/22 and ((-66)/(-220))/(62/30). 682 Let c = -6067 - -6076. Let v(d) = -d2 - 3d - 3. Let h be v(3). Calculate the smallest common multiple of c and (-51)/(-7) + 6/h. 63 What is the common denominator of ((-1521)/2886)/(21/5) and 123/70? 2590 Let l(y) = y3 + 15y*2 + 54y + 46. Calculate the smallest common multiple of l(-10) and 7 + 0 + 1 + -2. 6 Calculate the common denominator of -35/6 and 5/((-840)/(-9))(-278)/(-9). 84 Let p(c) be the third derivative of -c4/24 + c3/3 + 7c*2. What is the smallest common multiple of 4 and p(-6)? 8 Let k = -21945656396/118437958485 + -11/16628706. Let o = -401/40810 + 8/583. Let g = o - k. What is the common denominator of g and 79/2? 74 Let n(q) = 52q3 + q2 - 2q + 1. Let c be n(1). Let s = -30 + c. Calculate the smallest common multiple of s and 12. 132 Suppose 5 = -5q, 0 = -2v + 3q - 15 - 6. Let p(u) = -67u + 14. What is the least common multiple of -4(-10)/v-3 and p(0)? 70 Calculate the lowest common multiple of 76 and (-12 - -2) + (121 - -3). 228 What is the common denominator of -59/20 and (20/25)/(16/24)? 20 Suppose 5z + 20 = s, 10s - 5s + 3z = -12. Let l = 5 + s. Suppose -lt + 30 = -25. What is the smallest common multiple of 5 and t? 55 Let o = 3075 + -21477/7. Let k = -1217/154 + o. Calculate the common denominator of k and 97/6. 66 Let l(c) = -c + 9. Let u be l(-9). Let q be 60/u3879/(-13). Let z = 231245/234 + q. What is the common denominator of z and 63/20? 180 Let d = 2177 + -2171. Suppose -3m + 66 = -0m. Calculate the least common multiple of m and d. 66 Let g be -82/(-8) + 12/2. Suppose 21x = 13x + g. What is the lowest common multiple of x and 6? 6 Let z = 14689/66 - 668/3. Calculate the common denominator of 11/42 and z. 462 Let w(n) = n*2 - n + 11. Let t be w(0). Suppose 2u - 33 + t = 0. Let p(l) = l*2 - 29l - 251. What is the lowest common multiple of u and p(36)? 11 Let b(p) = p*2 + p + 5. Let l be b(4). Suppose -5q + 0*q = -l. Let v = 19 - 10. What is the least common multiple of q and v?	{ "pile_set_name": "DM Mathematics" }
letters picked without replacement from {d: 2, y: 1, q: 4}? 1/105 Four letters picked without replacement from {h: 1, w: 2, x: 2, l: 1, i: 2, y: 1}. Give prob of sequence liih. 1/1512 Four letters picked without replacement from {g: 2, m: 3, t: 5}. What is prob of sequence tmmm? 1/168 Calculate prob of sequence nd when two letters picked without replacement from {g: 4, d: 3, n: 1, e: 2}. 1/30 What is prob of sequence wxw when three letters picked without replacement from {w: 4, k: 3, x: 4, q: 3, l: 5}? 8/969 What is prob of sequence so when two letters picked without replacement from ossssosss? 7/36 What is prob of sequence rvvr when four letters picked without replacement from {v: 2, e: 2, r: 8, m: 3}? 2/585 Three letters picked without replacement from hcscscssyh. Give prob of sequence hyh. 1/360 Calculate prob of sequence jvj when three letters picked without replacement from pjjqhvvvjpqppipppv. 1/204 Two letters picked without replacement from bbkbkbpbubkbukb. Give prob of sequence ku. 4/105 Calculate prob of sequence eiai when four letters picked without replacement from {c: 4, e: 1, o: 1, i: 2, a: 3, t: 1}. 1/1980 Two letters picked without replacement from nnnnnnbbnnnnrnnbn. What is prob of sequence rb? 3/272 Calculate prob of sequence le when two letters picked without replacement from lklte. 1/10 Three letters picked without replacement from {w: 9, v: 9}. Give prob of sequence vww. 9/68 What is prob of sequence qqh when three letters picked without replacement from ahaqhqaqhaa? 1/55 Four letters picked without replacement from iczirzcziix. What is prob of sequence rzzc? 1/660 Calculate prob of sequence yjy when three letters picked without replacement from {j: 2, y: 5}. 4/21 Calculate prob of sequence os when two letters picked without replacement from {n: 4, h: 3, o: 1, x: 2, s: 2, q: 2}. 1/91 Two letters picked without replacement from rrrrrrrrrffrfrr. Give prob of sequence rr. 22/35 Calculate prob of sequence hhhh when four letters picked without replacement from {v: 3, e: 1, h: 5}. 5/126 Calculate prob of sequence pdp when three letters picked without replacement from odpoppopp. 5/126 Three letters picked without replacement from {g: 1, h: 2}. Give prob of sequence hhg. 1/3 What is prob of sequence iii when three letters picked without replacement from {i: 3}? 1 Four letters picked without replacement from ozooooozozzoozoyzo. What is prob of sequence yzoo? 11/1224 Four letters picked without replacement from brsnohrn. Give prob of sequence hnso. 1/840 Three letters picked without replacement from {e: 1, k: 1, j: 2, y: 1, z: 1, d: 1}. What is prob of sequence dey? 1/210 Calculate prob of sequence pa when two letters picked without replacement from ppooobbopaabobaa. 1/20 Four letters picked without replacement from {g: 8, x: 4, y: 1}. What is prob of sequence xygg? 28/2145 Four letters picked without replacement from fffffffqffqff. What is prob of sequence qffq? 1/78 Calculate prob of sequence uby when three letters picked without replacement from {y: 1, r: 1, o: 5, b: 2, a: 3, u: 1}. 1/858 What is prob of sequence zzz when three letters picked without replacement from {z: 6, e: 2}? 5/14 Calculate prob of sequence ek when two letters picked without replacement from {k: 2, t: 4, r: 1, e: 8}. 8/105 Four letters picked without replacement from cszzzsgzzzszgszgzgzs. What is prob of sequence zczz? 2/323 What is prob of sequence jjvj when four letters picked without replacement from {j: 6, v: 2}? 1/7 Calculate prob of sequence el when two letters picked without replacement from eeeenlleeelennnn. 1/10 What is prob of sequence bbj when three letters picked without replacement from {j: 11, b: 7, e: 1}? 77/969 Two letters picked without replacement from xbddddxdxxd. Give prob of sequence dd. 3/11 Calculate prob of sequence pjrx when four letters picked without replacement from pjxpjjjrj. 5/1512 Three letters picked without replacement from {l: 2, q: 6, f: 2, j: 2}. What is prob of sequence qll? 1/110 What is prob of sequence hc when two letters picked without replacement from bcccnczzcczznhhzzcn? 7/171 What is prob of sequence rx when two letters picked without replacement from {x: 7, r: 7}? 7/26 Two letters picked without replacement from {j: 1, n: 2}. Give prob of sequence nj. 1/3 Four letters picked without replacement from vlmvllmllvvlmmmhlllv. Give prob of sequence vvlm. 5/646 What is prob of sequence vzyv when four letters picked without replacement from tyaydvvaz? 1/756 What is prob of sequence dadt when four letters picked without replacement from tbdjjaj? 0 Calculate prob of sequence vt when two letters picked without replacement from {v: 2, t: 4, g: 1, b: 1}. 1/7 Four letters picked without replacement from ppwphhewpwzhhe. Give prob of sequence whwe. 2/1001 Four letters picked without replacement from eeeeneneeeeee. What is prob of sequence nene? 1/78 What is prob of sequence sd when two letters picked without replacement from {s: 2, d: 1, y: 2, k: 1, l: 2}? 1/28 What is prob of sequence xvv when three letters picked without replacement from uuuxuxuuxuvuvuux? 1/420 Two letters picked without replacement from {t: 8, r: 2}. What is prob of sequence tt? 28/45 Calculate prob of sequence yeye when four letters picked without replacement from {e: 15, y: 4}. 35/1292 What is prob of sequence zx when two letters picked without replacement from {x: 1, z: 1, o: 1}? 1/6 What is prob of sequence auk when three letters picked without replacement from kbbkubbab? 1/252 Calculate prob of sequence hoo when three letters picked without replacement from ooooooooohoooooooho. 16/171 Three letters picked without replacement from autaxqqvatq. Give prob of sequence qvv. 0 Three letters picked without replacement from {c: 9, a: 9}. What is prob of sequence aac? 9/68 What is prob of sequence qvyu when four letters picked without replacement from {u: 1, q: 1, y: 12, v: 1}? 1/2730 Two letters picked without replacement from jjjrrmrjrrmmrjmmrjrj. What is prob of sequence jm? 7/76 Calculate prob of sequence iyiy when four letters picked without replacement from {i: 3, y: 2}. 1/10 Two letters picked without replacement from {b: 3, z: 1, c: 1, m: 2, r: 3, t: 5}. What is prob of sequence tb? 1/14 Calculate prob of sequence kvm when three letters picked without replacement from mvmmnknmmkmkvmm. 8/455 Calculate prob of sequence mqqr when four letters picked without replacement from qqqqrmrqr. 5/252 Four letters picked without replacement from {n: 3, z: 2, v: 3}. What is prob of sequence vzzv? 1/140 Calculate prob of sequence acqa when four letters picked without replacement from cjjqcjwamjjaa. 1/1430 Four letters picked without replacement from wwwgwggglwwjgwwwgggl. Give prob of sequence gwlw. 16/1615 Two letters picked without replacement from {c: 3, b: 2, z: 1, p: 1, l: 3}. What is prob of sequence lb? 1/15 Two letters picked without replacement from {g: 2, a: 2, m: 5, k: 3}. What is prob of sequence kg? 1/22 Three letters picked without replacement from brbrgrrrguubuggrgg. Give prob of sequence uuu. 1/816 Four letters picked without replacement from rqsqcqdqqcdc. What is prob of sequence sqqd? 1/297 Calculate prob of sequence mrr when three letters picked without replacement from {r: 1, m: 5, f: 4}. 0 What is prob of sequence qb when two letters picked without replacement from ccqbqqqqqbbbqqb? 4/21 Calculate prob of sequence ss when two letters picked without replacement from {s: 7, b: 1, p: 1}. 7/12 Calculate prob of sequence ak when two letters picked without replacement from {k: 8, a: 4, r: 5}. 2/17 Calculate prob of sequence be when two letters picked without replacement from ezboa. 1/20 What is prob of sequence gss when three letters picked without replacement from sgsgsgssgsssssssss? 91/612 Calculate prob of sequence bl when two letters picked without replacement from lpb. 1/6 Four letters picked without replacement from uuuuuaaaauuuuu. Give prob of sequence aaau. 10/1001 What is prob of sequence occ when three letters picked without replacement from {o: 3, c: 2}? 1/10 What is prob of sequence bn when two letters picked without replacement from nhvvvyytvbvty? 1/156 Calculate prob of sequence aa when two letters picked without replacement from dadadddddd	{ "pile_set_name": "DM Mathematics" }
lve 12 = -10m + 22m for m. 1 Solve 1397w - 1390w = 7 for w. 1 Solve 0 = 426t - 422t - 8 for t. 2 Solve -532 + 28 = 63r for r. -8 Solve -15r = -8r - 28 for r. 4 Solve 0a = -3a + 11a for a. 0 Solve 32 = 70b + 522 for b. -7 Solve 83 = k + 78 for k. 5 Solve -3t = -36 + 39 for t. -1 Solve -205d + 203d = 6 for d. -3 Solve 0 = 6v + 7 + 11 for v. -3 Solve 11b + 473 = 495 for b. 2 Solve 222 = 91b - 324 for b. 6 Solve 9w - 10 = 11w for w. -5 Solve 20z = -117 - 23 for z. -7 Solve -4o + 7 + 5 = 0 for o. 3 Solve 262 = 4u + 258 for u. 1 Solve 41 - 45 = -2a for a. 2 Solve -20d = -9d - 11 for d. 1 Solve -623a = -583a - 80 for a. 2 Solve 327c = 316c - 110 for c. -10 Solve 154l = 153l + 2 for l. 2 Solve -24w = -18w - 24 for w. 4 Solve -4f + 17f = 52 for f. 4 Solve 0 = -448b + 451b + 18 for b. -6 Solve w - 2 = 3 for w. 5 Solve 5o + 8 = o for o. -2 Solve 13 = -9p - 5 for p. -2 Solve -16 = -14j - 2 for j. 1 Solve -3a + 12 = -6a for a. -4 Solve 0 = -3g + 548 - 557 for g. -3 Solve -8 = 8s - 10s for s. 4 Solve 20w = 17w + 15 for w. 5 Solve -11 + 23 = -4l for l. -3 Solve -30n - 20 = -20n for n. -2 Solve 35u - 34u - 4 = 0 for u. 4 Solve 9x - 44x = 0 for x. 0 Solve 23r + 30 = 17r for r. -5 Solve 5s + 10 = 15 for s. 1 Solve 9h - 4 = -22 for h. -2 Solve 0 = -6m + 5 - 11 for m. -1 Solve -3x = -7x for x. 0 Solve 0 = -14p + 6p for p. 0 Solve 0 = -12j + 5j + 21 for j. 3 Solve -18p + 5p = -13 for p. 1 Solve -78i - 22i + 200 = 0 for i. 2 Solve -148 = 27t - 418 for t. 10 Solve -18i + 23i = 20 for i. 4 Solve 61z - 332 = -88 for z. 4 Solve 0 = -20p + 23p + 9 for p. -3 Solve -42p + 62 = -274 for p. 8 Solve -66c = -80c for c. 0 Solve -41d + 26 = -138 for d. 4 Solve 6z + 42 = -8z for z. -3 Solve 0 = -145w + 154w + 54 for w. -6 Solve 15z - 20 + 5 = 0 for z. 1 Solve -69p + 198 = -3p for p. 3 Solve 10 = -1052s + 1051s for s. -10 Solve 0 = 22t - 141 + 361 for t. -10 Solve -5o + 6 + 9 = 0 for o. 3 Solve -19v + 12v = 35 for v. -5 Solve 1602l = 1610l + 16 for l. -2 Solve j + 0 - 3 = 0 for j. 3 Solve 0 = -4f - 17 - 3 for f. -5 Solve 24r = 27r + 6 for r. -2 Solve -12 - 8 = -4q for q. 5 Solve -55t - 981 = 54t for t. -9 Solve 0 = 15h - 6 - 84 for h. 6 Solve 0 = i - 8i + 42 for i. 6 Solve -422 = -21o - 485 for o. -3 Solve -8z - 3z = -22 for z. 2 Solve 1127 = p + 1119 for p. 8 Solve 4w + 888 = 904 for w. 4 Solve -32u + 112 = 16 for u. 3 Solve 0 = 17g + 41 - 7 for g. -2 Solve 19h = 45 + 12 for h. 3 Solve -41t - 182 = 105 for t. -7 Solve -k = -0k - 3 for k. 3 Solve 0x - 16 = 8x for x. -2 Solve 4i + 180 = 34i for i. 6 Solve 0 = 3t - 971 + 950 for t. 7 Solve -81 + 84 = 3r for r. 1 Solve 8p - 2p = 0 for p. 0 Solve -24x = 30 + 66 for x. -4 Solve -5x + 18 = 4x for x. 2 Solve 0 = -4p - 57 + 81 for p. 6 Solve 77 = 2n + 75 for n. 1 Solve -2r = 2r for r. 0 Solve 0 = 11l + 5l for l. 0 Solve -3g + 1 + 5 = 0 for g. 2 Solve 358 - 288 = 7q for q. 10 Solve -23n + 15 = -8n for n. 1 Solve 2t = 2 - 12 for t. -5 Solve 2v = 5v + 15 for v. -5 Solve 20 = 5j + 5 for j. 3 Solve -26v - 57 = -7v for v. -3 Solve -832 = 4u - 804 for u. -7 Solve 4i + 12 = -2i for i. -2 Solve 53q = 52q for q. 0 Solve 18p = -4p + 88 for p. 4 Solve 0 = -7p - 18 - 10 for p. -4 Solve -5x + 2x = 12 for x. -4 Solve -9m = 213 - 240 for m. 3 Solve -9u = -26 - 1 for u. 3 Solve 12g = 9g + 9 for g. 3 Solve -159q = -177q - 36 for q. -2 Solve 36 = 7z + 64 for z. -4 Solve -32t + 35t + 15 = 0 for t. -5 Solve -53h + 59h + 12 = 0 for h. -2 Solve 26n - 34n - 48 = 0 for n. -6 Solve -28r = -0r - 112 for r. 4 Solve 7a - 51 = -114 for a. -9 Solve 0 = -13i + 10i - 3 for i. -1 Solve 27h + 27 - 108 = 0 for h. 3 Solve 0 = v + 9 - 4 for v. -5 Solve -4t + 12202 = 12234 for t. -8 Solve 0 = -29i - 4i - 132 for i. -4 Solve 16w = -14w + 11w for w. 0 Solve 0 = 39s - 33s - 6 for s. 1 Solve -4h - h = -15 for h. 3 Solve 1852h - 1868h - 48 = 0 for h. -3 Solve 13c + 12 = -40 for c. -4 Solve -35f = -40f + 30 for f. 6 Solve 0 = -2u + 53 - 51 for u. 1 Solve -73c - 21 = -313 for c. 4 Solve -287q = -290q - 15 for q. -5 Solve 345x + 126 = 363x for x. 7 Solve 17 - 29 = 4r for r. -3 Solve a = 1 + 2 for a. 3 Solve 60o + 400 = 10o for o. -8 Solve 0 = -5s + 83 - 88 for s. -1 Solve 10z = -1503 + 1463 for z. -4 Solve -7d - 3 = -17 for d. 2 Solve 16l - 13l + 15l = 0 for l. 0 Solve 4h = 2h + 4 for h. 2 Solve -84g + 10 = -74g for g. 1 Solve 9k - 10k = 0 for k. 0 Solve 0 = -1172y + 1207y + 315 for y. -9 Solve -8k = -28 - 20 for k. 6 Solve -8j + 387 - 427 = 0 for j. -5 Solve 17b + 8 = 76 for b. 4 Solve -11u + 9 - 42 = 0 for u. -3 Solve 5r - 1 = -6 for r. -1 Solve 5q - 360 = 50q for q. -8 Solve 22p = -38p + 420 for p. 7 Solve -102o - 8 = -98o for o. -2 Solve 0 = -30p - p - 155 for p. -5 Solve 7h + 1552 - 1517 = 0 for h. -5 Solve 6q + 2 = -10 for q. -2 Solve -12 + 20 = -4c for c. -2 Solve -3164y + 3161y = 3 for y. -1 Solve -4a - 13 - 7 = 0 for a. -5 Solve o = 368 - 365 for o. 3 Solve -136l = -94l - 378 for l. 9 Solve 56s + 18 = 65s for s. 2 Solve 0 = 50b - 57b + 28 for b. 4 Solve -113f - 192 = -137f for f. 8 Solve -8h + 7h - 1 = 0 for h. -1 Solve -156j - 10 = -154j for j. -5 Solve -4 + 44 = -8o for o. -5 Solve 8a = 3a for a. 0 Solve 0 = 18w - 14w - 20 for w. 5 Solve 19w = 30w for w. 0 Solve -325r + 333r + 48 = 0 for r. -6 Solve -17v = 10v for v. 0 Solve -197v = -199v for v. 0 Solve -10 + 5 = 5m for m. -1 Solve 114 = -67k + 48k for k. -6 Solve 0 = -11i + 6i for i. 0 Solve 103i - 444 = 277 for i. 7 Solve -10f = -530 + 610 for f. -8 Solve -76 = 15x - 46 for x. -2 Solve 0 = -4m - 2m - 6 for m. -1 Solve -76w = -75w - 2 for w. 2 Solve 38i - 53i = 30 for i. -2 Solve 0 = -3l + 16l + 26 for l. -2 Solve -161 - 82 = -27z for z. 9 Solve -53a = -47a + 12 for a. -2 Solve 112n = 130n + 144 for n. -8 Solve -40 = -761h + 769h for h. -5 Solve -11 = s - 9 for s. -2 Solve 15i = -5i + 80 for i. 4 Solve 23l - 5 = 24l for l. -5 Solve 78 = -19c - 17 for c. -5 Solve 2r = r - 1 for r. -1 Solve 42 = 84n - 90n for n. -7 Solve -2z - 16 = 2z for z. -4 Solve 118 = -46c - 13c for c. -2 Solve 20l = -23l + 344 for l. 8 Solve -369k + 375k = -6 for k. -1 Solve -26 = 38x + 12 for x. -1 Solve -3 = 5n + 12 for n. -3 Solve -12v + 383 - 323 = 0 for v. 5 Solve 10n - 40 = -10 for n. 3 Solve -40n = -45n + 15 for n. 3 Solve 109r + 3 = 110r for r. 3 Solve 0 = -6p + 5p - 1 for p. -1 Solve 45 = 43h - 52h for h. -5 Solve 2y + 10 = 4 for y. -3 Solve f - 3f - 10 = 0 for f. -5 Solve 0 = -55s - 4s - 295 for s. -5 Solve -39o + 35 = -82 for o. 3 Solve 13m + 64 = -14 for m. -6 Solve b - 2b - 1 = 0 for b. -1 Solve 40b - 35b = 30 for b. 6 Solve -269 + 371 = -17w for w. -6 Solve -9k = -12k for k. 0 Solve 0 = y - 328 + 327 for y. 1 Solve 0 = -3t - 1939 + 1957 for t. 6 Solve -17f - 17 = -0 for f. -1 Solve -293z + 288z - 20 = 0 for z. -4 Solve 5m - 10 = 7m for m. -5 Solve -10k + 99 = 39 for k. 6 Solve 80 - 82 = -2z for z. 1 Solve -7h - 7 + 21 = 0 for h. 2 Solve 2g - 2 - 8 = 0 for g. 5 Solve 20i + 48i - 680 = 0 for i. 10 Solve 3o - 4 = 2o for o. 4 Solve 7o = 4o + 15 for o. 5 Solve 49 = -7p + 14 for p. -5 Solve 3c = -3c - 6 for c. -1 Solve -2y - 12 = -6y for y. 3 Solve 0 = 102c - 83c + 114 for c. -6 Solve 74 = 9u + 11 for u. 7 Solve -13 = 19i - 32i for i. 1 Solve 94 = -5o + 69 for o. -5 Solve 239j - 238j - 5 = 0 for j. 5 Solve 0w = w + 2 for w. -2 Solve -30 = 4b + 6b for b. -3 Solve 68 = -16p - 28 for p. -6 Solve -170y = -131y + 312 for y. -8 Solve -4z - 16z - 40 = 0 for z. -2 Solve -14l + 42 = -0l for l. 3 Solve -4n = -11 + 23 for n. -3 Solve -3f + 72 = 63 for f. 3 Solve 6x = -9x - 60 for x. -4 Solve 0 = -7x + 13x for x. 0 Solve -2d = -2 + 12 for d. -5 Solve 58 = 16m + 122 for m. -4 Solve -583r + 20 = -587r for r. -5 Solve -4d = 1 - 9 for d. 2 Solve 0 = -10c + 21 - 61 for c. -4 Solve 6 + 30 = 12a for a. 3 Solve 14 = -10y - 16 for y. -3 Solve -17 + 15 = s for s. -2 Solve 3r + 62 - 50 = 0 for r. -4 Solve 116i + 60 = 128i for i. 5 Solve -b - 17 + 13 = 0 for b. -4 Solve 16*q - 3 - 29 = 0 for q. 2 Solv	{ "pile_set_name": "DM Mathematics" }
3l3 + 346 - 6l*4 - 346 - 2l*5 + (3l - 3l - l)(-2l + l4 + 2l) + l*5 - 2l*5 + 3l5 + l5 + 4l5 - 3l*5 + 2l*5 + l - l. 3l*5 - 6l*4 + 3l*3 Expand -2t3 + t3 + 2t3 + (t - t2 - t)(-t + 6t - 2t). -2t3 Expand (0m + 2m - 3m)(6m*3 + 2m*3 + 3m*3 + (4 - 3 + 0)(2 - 2 - 2m3) + 0m*3 - 5m*3 + 4m*3). -8m*4 Expand (-4u + 1 - 1)(u + u + 0u - 2u2). 8u*3 - 8u*2 Expand (-2 - 5 - 3)(6 - 4 - 4)(o + 0o - 2o). -20o Expand (-19j - 12j + 13j)(2j2 + 2 - 2). -36j*3 Expand 5y*4 - 6y*3 + 0y*3 - 3y*4 + (-2y + 2 - 2)(2y*3 - 8y3 + y3). 12y4 - 6y*3 Expand (-3 + w + 3)(-1 - 5 + 3)(1 - 1 + 2w)(-8 + 10w + 8). -60w3 Expand (0 - 2x + 0)(1 + 2 + 4 - 2 + 2 + 1 + 4 - 1 - 5 - 2 + 2 + 2 - 6 + 4 + 0 + (0 + 1 + 0)(0 + 0 + 1) - 1 - 2 + 1). -10x Expand (-2b + b + 3b)(-3 + 2 + 10)(0b*3 + 5b*3 - 3b*3) + (-2 + 3 - 3)(2b4 + 0b*2 + 0b*2) - 3b4 - b4 + 6b4. 34b4 Expand -v2 + v*2 - 3v*4 + (0 + 2 + 0)(3v3 + v4 - 3v*3) - 3v - v*4 + 3v + 0v4 + v4 + 0v4. -v4 Expand (0 + 2 - 5)((1 + 1 - 4)(3 + 3 - 4) + 5 - 2 - 2)(-2q + 3q - 2q). -9q Expand (-4 + 1 + 1 + (-3 + 1 + 1)(-3 + 6 - 4))(4 - 4 + 2y*2). -2y2 Expand (-1 + r2 + 1)(-3 + 3 - 2r)(4r - 2r - 4r). 4r4 Expand (33 - 69 + 37 - y)(0 + 0 + 2y). -2y*2 + 2y Expand (-3 + b + 1 - 2b)(-3b3 + 0b*3 - 4b*3). 7b*4 + 14b*3 Expand (1 - 1 + 2c)(3c*2 - 4c2 - c2) + 37c - 37c + 13c3 + 0c*2 + 0c*2 + 2c*3 - 4 - 4c*3 + 4. 7c3 Expand (-j3 - j*3 + 3j*3)(-1 + 1 + 2j)(-1 + 4 - 1). 4j4 Expand (-30u - 42 + 42 - u)(-1 - 2 + 2). 31u Expand (-j2 + j2 + 2j2)(-20j2 + 19 - 19 + 2j). -40j4 + 4j*3 Expand (3d - 3d - d)(-4 + 4 - d)(-3d + 3d + d) - d3 + d3 + 2d*3. 3d*3 Expand (4 - 6 + 14)(0l + 5l - 4l). 12l Expand (-68 + 68 - 18q)(2q + 3q - 7q). 36q*2 Expand (2 - 5 + 1)(-2h5 + 7h*5 + 3h*5)(-6 + 0 + 2). 64h5 Expand (-l2 - l + l)(-l - 2l + l)(5 - 5 + 7l). 14l*4 Expand (3b*2 - 3b*2 - 2b*5 - 3b + 2b5 + 3b + (-3b4 + 6b*4 - 2b*4)(3b + 0b - b))(-1 - 6 + 3)(2 + 3 - 4). -8b5 Expand (-2y + y + 3y)(-2y + y4 + 2y) - 10y5 - 6y5 + y5 - 5y5 + y2 + 5y5 - y5. -14y5 + y2 Expand (-3q - 4q + 5q)(3 - 5 + 3)(5q2 + 2q2 + q2). -16q3 Expand ((3 + 0 - 4)(-2o + 0o - o) - 2o - 2 + 2)(4 + 0 - 6 - 2 + 2 + 2 + (-4 + 0 + 3)(-1 + 1 + 1) - 2 + 3 + 1). o Expand (0n*2 - 4n*2 + 6n*2)(-4n3 + 5n3 + n3) + 3n5 - n5 + 2n5 + n2 - n*2 - 2n5 - n5 + 2n5 + n5. 8n*5 Expand 2z + 2z - 3z + 3z + z - 6z + (2z - 3z + 2z)(-2 + 2 - 1) - 2z - 2z + 2z + (0 + 0 + 2)(-z + 2z + z) - z + 3z + 0z. 2z Expand (0g2 + 7g2 - g2)(-2 - 2 + 0). -24g*2 Expand (1 - 3 + 6 + (-3 + 2 + 2)(-4 + 6 + 0))(-6i*5 + 3i*5 + 2i*5). -6i*5 Expand (6r*2 - 13 + 13)(4 - r - 4) + 0r3 - r3 - r3. -8r*3 Expand 2x*5 + 3x*5 - 6x*5 + (-x + 3x - x)(-4x4 + x4 - x*4) - 4x*5 - 5x*5 + 5x*5. -9x*5 Expand (-3 - 2 + 3)(131 - 401 + 85)(-3g + 3g - 2g*2). -740g*2 Expand (1 - 1 + 2g)(0 - 1 - 1) - 4g + 4g + 3g + 23 + 12g - 23. 11g Expand 2l2 - 3 - 2l4 + 3 + (l2 + l*2 - 3l*2)(-17l + l2 + 17l). -3l4 + 2l*2 Expand (-t + 2t + 0t)(-t - 3t + 3t - t + 4t - 6t + (3 - 5 + 1)(-3t + 0t + t)). -2t*2 Expand 3u*3 - 6u3 + u3 + (4 + u - 4)(-16u*2 - 2u*2 + 9u*2) + 3u*3 - 3u3 - u3. -12u3 Expand 2w - 3w5 + 0w + 4w5 + (w4 + 2w*3 - 2w*3)(2w - 2w + 3w). 4w*5 + 2w Expand -3y4 + 5y*4 + 0y*4 + (-2y*3 + 0y3 + y3)(-4y + 3 - 3). 6y4 Expand (1 - 2u - 1)(-19u*2 - u + 2u + 16u2). 6u*3 - 2u*2 Expand (2u - 4u + u)(-2 + 5 + 1). -4u Expand (-2j + 5j - j)(2j + 0j + j)(9j + 6j - 3j). 72j3 Expand 2k*3 + 3k*3 + 5k*3 + (4k - 4k + 2k*2)(0k + 4k - 2k) - 2k + 2k3 + 2k. 16k3 Expand (-1 + 1 - 2)(i - 2 + 2)(-3i + 3i2 - 6i*2 + 4i*2). -2i*3 + 6i*2 Expand (10b + b + 3b)(-2 + b*2 + 2). 14b*3 Expand (3l - l - 3l)(-3 + 2 + 0)(-3 + 8 - 1) + 9 - 3l - 9. l Expand -2b + 2b + b*2 + (-4b + b + b)(-2 + 2 - 2b) + b*2 - 4b2 + b2 + 26b2 - 24b*2 + 12b*2 + 2b*2 - 6b*2 + 2b*2. 15b*2 Expand -4x*2 - 2x*2 + 4x2 + 0 + 0 + x2 + (-x*2 + 2x*2 + 0x*2)(-6 + 3 + 1) - x2 + x2 + 2x2 + 22x*2 - 5x*2 + 3x*2. 19x2 Expand (-k + k + k2)(3 + 0 - 1)(-2k - k2 + 2k) - 3k4 + 0k*4 + 2k*4. -3k*4 Expand -3h - 4h + 5h + (4h + 4h - 7h)(1 + 3 + 1). 3h Expand (-11f*3 + 2f - 2f)(-2 - 1 + 0) + (-2 + 2 + 2f)(-f2 - f2 + f*2). 31f*3 Expand -5a*2 - 5a*2 + 4a*2 + (-3 + 2a + 3)(a - 2a - a). -10a2 Expand (-x2 - 1 + 1)(6x - 5x - 4x)(9 - 2x + 6 - 13). -6x*4 + 6x*3 Expand (-1 - 1 - 1)(-4 + 4 + 2j2) - 2j*2 + j - j + (-5j + 2j + 2j)(j + 0 + 0) - 3j*2 + 5j*2 - 3j*2. -10j*2 Expand (3 + 0 + 1)(-1 - 2x2 + 1)(-2x2 + x2 + 0x*2) - 4x*3 + 4x*3 + 4x*4 + 2x*4 - x + x. 14x*4 Expand (5h*2 - 9h*2 - 3h*2)(-2h2 - 2 + 2). 14h*4 Expand (3g + 0 + 0)(6 - 3 - 1)(-13g3 - 14g*3 + 43g*3)(-g + 4g - 4g). -96g5 Expand -1 - p + 1 + (-3 + 3 + p)(-1 + 0 + 0) + (4p - p - 6p)(1 + 0 + 0). -5p Expand (0t2 + 6t*2 - 3t*2)(2t - 7t + 3t) + 0 + 0 + t3. -5t*3 Expand 3b2 - b2 + 0b2 + (23b + 3b - 7b)(-2b + 2 - 2). -36b2 Expand (3 - 5 + 0)(-2 - 2l + 2) - l + l - 2l + l + 3l - 3l + (l - l + 3l)(5 + 1 - 3). 12l Expand (0 - 1 - 2)(l - 4l - l + (-4 + 5 + 0)(-l - 2l + l) - 5l + l + 0l). 30l Expand (-27h + 32 - 32)(0 + 3 - 1). -54h Expand (-3p + 3p + p)(-p + 3p3 + p) + 3p*4 + 2p*4 - 4p*4. 4p*4 Expand (o + 2 - 2)(2 + 7o - 2) - 4o*2 + 2 - 5 - o + 6o*2. 9o*2 - o - 3 Expand (-6m*3 + 9m3 + m3 - 8m2)(3 - 2m - 3). -8m*4 + 16m*3 Expand (5m*4 - 5m*2 - 4m*4 + 69m*3 - 70m*3)(-2 + 0 + 0)(2 + 2m - 2). -4m5 + 4m*4 + 20m*3 Expand (0 + j + 0)(2 + 3 - 6 + (-2 + 1 - 1)(-3 + 1 + 4) + 0 + 5 - 3 - 4 - 3 + 5 + (2 + 3 - 3)(1 + 8 - 5)). 3j Expand (0x - 4x + 3x)(-x - x - 3x)(-2x2 + x2 - x*2). -10x*4 Expand (-2q*3 + 2q*3 + 4q*4)(q - 2q + 2 + 4q). 12q5 + 8q*4 Expand (-103 - 215 + 449)(3 - 3 + y). 131y Expand ((-r - 9r + 4r)(2r - 5r - r) - 2r2 + 0r*2 - 2r*2 + 3r2 - r2 - r*2)(0 + 4 - 2). 42r2 Expand (-v2 + v2 - v2)(-1410 + 1410 + 56v3). -56v*5 Expand 10 - 6u - 10 + (4 - 4 + 2u)(2 - 5 + 1) + u + u - 4u + (-u + 0 + 0)(0 - 1 - 1). -10u Expand 5z*5 - 5z*5 + 9z*5 + (-2z*3 + 5z*3 - 2z*3)(-4z2 + z - z). 5z*5 Expand (1 - 1 - c)((1 + 2c - 1)(-2 + 0 + 0) + 2c + c - c - c + 4 - 4 + 0 - 2c + 0 - 10c + 61 - 61). 15c*2 Expand (-3z - 1 + 3z + 2z)(3z + 2 - 2 - z - 2z + z + (0 + 2z + 0)(0 + 0 - 2) - 4z + 0z + 5z - z - 3z + 3z). -6z2 + 3z Expand -f*2 + 3f2 - f2 + (-3f + f + 0f)(-3f - 2f + 4f) - 813f + 29f*2 + 813f. 32f2 Expand (2i*3 + 0i3 - i3)((-3i + 7i - 3i)(2i - 3i + 2i) - 2i2 - 3i + 3i). -i5 Expand (4v3 - v3 - 4v3)(-1 - 1 + 0)(-1 - 1 + 5) + (-6v*3 + 2v*3 + 3v*3)(0 - 4 + 6). 4v3 Expand (-6l + 0l - 4l)(-4 + 5 + 0 - 2l*4). 20l*5 - 10l Expand (-3z4 + 2z*4 + 3z*4)(4z + 3z - 6z) - 12z*5 - 6z*5 + 23z*5. 7z*5 Expand (10l*3 + 3l*3 + 2l*3)(0l2 + l2 - 4l*2). -45l5 Expand (x2 + 5x2 - x2)(2x2 + 3x*2 + 0x*2)(-3x + x + 4x). 50x5 Expand (-46m + 46m - 2m*2)(m + 0m + m) + m3 + 0m + 0m + (0 - 1 + 2)(-m + 2m3 + m) + 1 - 1 + m3 - 2m*3 + 5m*3 - 4m3. -m3 Expand (-1 - 1 + 4)(6g*4 - 4g*4 + 4g*4). 12g*4 Expand (2y2 + y2 + 0y2)(-1 + 5 - 2)(-3 + 3 - 1)(-y*3 + 0y + 0y). 6y*5 Expand -12 - 12v2 + 12 + v2 + v*2 - 4v*2 + (-2v + 0v + 4v)(0v + 0v - 2v) + 2v2 + 0v*2 - 3v*2. -19v*2 Expand (6 + 0 + 0)(-3 + 4j + 3). 24j Expand -2m5 + 2m5 + m5 - m*5 + 5m*4 - 5m*4 + (0 - 2m*3 + 0)(2m2 - 3m*2 + 2m2) - m5 - 4*	{ "pile_set_name": "DM Mathematics" }
5x2 - 2x*2)(2x3 - 2x + 2x) + 2 - 2 + 2x5. x5 Expand (2q - 4q + 3q)(0 + 0 + 2) + (6q - 4q - q)(1 + 13 - 4) + (0q + 0q - 2q)(-5 + 1 + 0). 20q Expand (22q3 - 11q*3 + 10q*3)((2 + 1 - 2)(-7 - 2 + 2) + 0 - 4 - 4). -315q*3 Expand (-5k*2 + 2k2 + k2)(0k - k + 0k) + 1171k*3 - 2337k*3 + 1189k*3 - 2k*2. 25k*3 - 2k*2 Expand -2u*4 + 3u*4 + 0u*4 + (2u + u - u)(19u*3 - 9u*3 - 41u*3). -61u*4 Expand (2j3 - j3 + 16j3)(6 + 0 - 4) - 1 - 2j3 + 1. 32j*3 Expand (1 + 634z - 634z + 826z*2)(4 - 4 + 1). 826z2 + 1 Expand (-3 + 2k + 3)(4k + 3k - 5k) - 2k2 + 2k*2 + 2k*2 + (-k - 2k + 7k)(-2k + 0k + k) - 3k2 - 31 + 31 + k. -k2 + k Expand (-i - 2i + i)(3i - 1 + 1) + (7i2 + 110 - 110)(0 + 1 - 2). -13i2 Expand (-4m + 0m + 3m)(-5m*2 - m - 1878 + 937 + 946). 5m3 + m2 - 5m Expand (4c - c + 6c)(-5 + 1 + 2) - c + 0c - c - c + 2c + c + (1 - 1 - 2c)(2 - 5 + 2) - 2c + 2c + 2c + 0c + c + 5c. -8c Expand (-6p + 25p + 50p)(p + 2p2 - p). 138p*3 Expand (221a - 26 + 15 + 12)(0a - a - a). -442a2 - 2a Expand (4d4 + 0d*4 - 2d*4)(2 - 1 - 3)(1554d + 344d + 639d). -10148d5 Expand (2u - 3u + 4u + (0 - 1 - 1)(0u + u + u) + 57u + 499 - 499)(0 + 2 - 1). 56u Expand (-619 - 803 + 36 + 240)((x2 - x2 - 2x2)(-2 - 1 + 1) - 2x2 + 0 + 0). -2292x*2 Expand (-4 + 2z + 4)(-2 + 2 - z2) + (-4z*2 - 10z*2 + 0z*2)(-12z - 4z + 7z). 124z*3 Expand (-3 - 2 + 6)(1 - 1 + 2)(8g*3 + 0g3 - g3) - 4g3 + 29g*3 + 18g*3. 57g*3 Expand -3x + 3x - 8x - x - 3x + 3x + (4x + 4x - 4x)(2 - 3 + 2) - 6 - x + 6. -6x Expand (2k*5 + 2k*5 - 2k*5)(39 + 88 - 71). 112k5 Expand (-2x + x + 0x)(4 + x*3 - 4) + 13x*2 + 15x*4 - 13x*2. 14x*4 Expand -2v*2 + 2v*2 + 2v*2 + 0v*2 + 4v*2 - 3v*2 + (2v - 6v + 2v)(4v - 4v + v) + 2v - 2v + 2v*2 + 196v*2 + 235v*2 - 46v*2. 388v*2 Expand (0q + q + q)(1 + 0 - 3) - q + 2q - 2q + 0q + 0q + 2q - 435 + 435 - 12q. -15q Expand (-5 - 1 + 3 + (1 - 3 + 1)(2 - 4 + 4) - 28 - 27 + 43)(-2c + 4c - c)(-c4 + 0c*4 + 2c*4). -17c*5 Expand (-j - 2j + 2j)(-6j - 8j - 8j) + (0j*2 + 2j*2 - 3j*2)(6 - 6 + 10). 12j2 Expand (y3 + y3 + 0y*3 + (2y*2 - 2y2 + y2)(-y + y + 5y))((-6y + 3y + y)(3y + 0y - 2y) - 8 + 8 + 3y*2). 7y*5 Expand (3n + 4n - 5n)(11 - 9 - 12) - 5n + n + n + (0n - 5n + 6n)(1 - 2 - 1) + 2 - 2n - 2. -27n Expand (-2l3 + 3l*3 + 3 - 6)(-14 + 264 + 298). 548l3 - 1644 Expand (0b - 4b + 3b + (4 - 2 - 3)(b - b - 3b) - b + 0b + 3b)(8b3 + b4 - 8b3). 4b5 Expand -j2 - j3 + j2 + 8 + (6j - 3j + 3j)(2j2 - 2j*2 - 2j*2). -13j*3 + 8 Expand -5s + 0s + 3s - 3 - s + 3 + (-1 - 2s + 1)(0 + 1 + 0) + s + s + 0s - 10s + 61 + 621 + 9s + 0s. -4s + 682 Expand 179v*3 + 32v*4 - 179v*3 + (3 - 4 + 0)(-1 + v + 1)(4v*3 - 2v*3 - 3v*3). 33v*4 Expand (73z*2 + 43z*2 - 28z*2)(0z + 0z - z*2) + 0z*4 + 2z*4 - 3z*4. -89z*4 Expand -68b*2 + 118b*4 + 68b*2 + (-b - 2b + 2b)(3b3 - b3 - b3) + (5 - 5 - b4)(2 + 0 - 4) + b*4 - 3b4 + b4. 118b4 Expand (44u*2 - 62u*2 - 81u*2)(0u - 2u + 0u). 198u*3 Expand (16t*3 + 55t*2 - 15t*3 + 22t*2)(3 - 3 + t) - 18t3 - 5t*4 + 18t*3. -4t*4 + 77t*3 Expand (3 + 0 - 2)(1 + 1 - 1)(-19h - h - 5h)(3h + h - 3h). -25h2 Expand (-2 - 3g + 7 - 3)(-5g*4 + 10g*4 + 4g*4). -27g*5 + 18g4 Expand 0 + a5 + 0 + (2a5 + 2a*5 - 2a*5)(11 + 19 - 5). 51a5 Expand (f3 + 2f3 - f3)(-3f*2 - 81f + 82f - 6f*2). -18f*5 + 2f*4 Expand (-3 - 1 + 1)(-292 - 49l + 292). 147l Expand (-h + 0 + 0 + (-1 - 2 + 2)(h - 2h + 2h))(-3h3 + 5 - 5)(-15h + 13h - 15h). -102h*5 Expand ((3 + m - 3)(-3m2 + 4m*2 - 3m*2) + 36m*3 + 50m*3 - 1723m - 85m3)(4m2 + 0m*2 - 3m2). -m5 - 1723m3 Expand (-4v2 - v2 + 3v2)(5v - 6v - 6v)(6 + 2 - 3)(2 + 0 + 0). 140v*3 Expand -5t + 2t + t - 2 + 22t - 41t + 0 + (1 + 3 - 2)(3t + 5t - 6t) - t - 3t + 2t + 0t - 2t + t. -20t - 2 Expand (-5v + 6v + 5v)(7v3 + 9v*3 - 25v*3). -54v*4 Expand (2 + c - 2)(2c3 + 4c*3 - 4c*3) - 439c + 2c4 + 439c - 247. 4c4 - 247 Expand (-2g + 0g + 0g)(5g*2 - 3g2 - g2) + 17470g - 8951g - 8798g + g3. -g3 - 279g Expand -2 - a*2 + 4 - 12 - a + (a - 1 + 1)(a - 5a + 2a). -3a2 - a - 10 Expand (-t + 1 - 1)(4t - 4t - 2t2) - 215 + 215 - 89t*3. -87t*3 Expand (-2l + 0l + 3l)(80 - 133 - 93) + (1 - 1 - l)(0 + 0 - 2). -144l Expand (1 - 15 + 3)(b*2 - 1 + 1) + 16b*2 - 14b*2 - 23b*2. -32b*2 Expand (4 + 2n - 4)(-4n*2 + 2n*2 + 0n2) + n3 + 0n3 - 2n*3 + (864 - 478n - 864)(5 - 5 + 2n*2). -961n3 Expand ((-1 + l3 + 1)(-1 + 4 - 1) - 3l*3 + 5l*3 - 172 + 182)(l - l - 2l). -8l*4 - 20l Expand (-3b - 4 - 4 - 2)(-2 - 3b3 + 2 + (-2b*2 - 1 + 1)(b + 2b - b) + 2b*3 + 4 - 4 + 4b3 - b2 + b*2). 3b*4 + 10b*3 Expand (-2x + x + 0x)(4x3 + 0x*3 - 2x*3) + 7x*4 + 38x - 38x - 3x4 - x4 + 3x4 + (2x*3 + 2 - 2)(19x - 198 + 198). 42x*4 Expand (-v - 6v + 3v)(11v - 19v - 57v2 + 8v). 228v3 Expand (-146u + 107u - 702u)(-2u + 4u - u). -741u*2 Expand (3a2 - a2 - a*2)(0 - 2a + 0) + 133a*3 - 329a*3 + 106a*3. -92a*3 Expand (52 - 106 + 87)(9q - q + 2q). 330q Expand -190m*4 + 102m*4 - 172m*4 + (2m + m - 5m)(-m3 - m3 + 0m3). -256m*4 Expand 22 - 33 + u - 1 + (2u - 2u - u)(-4 + 0 + 3) + 2u + 4 - 4. 4u - 12 Expand g*5 - 2g*2 + 2g5 - g5 + (-g*2 + 3g - 3g)(g + g*3 - g) + 1889g*2 - 1889g*2 + 102g*5. 103g*5 - 2g*2 Expand -89u*2 - 2213u + 2213u + (-3u + 3u - 3u)(0u + 3 - u - 1). -86u2 - 6u Expand (-5 + 18 + 18)(-k - 4k + 3k). -62k Expand (-2p + 1 - 1)(5 - 61 - 122). 356p Expand 6v - 3v + 7v + (-1 - 2 - 7)(3v - 3v - 2v). 30v Expand w5 + 2w*5 + 0w*5 + 0w5 + w5 + 0w5 - w5 + 2w*2 - 2w*2 + (0 + 2 + 0)(-w*5 - 4w + 4w). w5 Expand (-6f*2 - 2f*2 + 4f*2 + (2f + f - 5f)(-f + f + f))((f + 2f - 2f)(-4 + 4 - f) - 3f2 - 2f*2 + 4f2 - f2 + 0f2 + 0f*2). 18f4 Expand (-1 + 1 - k2)(-12k - 3k3 + 4k - 30k). 3k*5 + 38k*3 Expand (-2q*2 + 4 - 4)(2 - 2 - 2q2) - 3q*4 + 11q - 11q + (q2 + q3 - q2)(2 + q - 2) - 3q4 - q4 + 5q*4 - 3q*4 + 13q*4 + 9q*4. 22q*4 Expand -4y*2 + 5y*2 - 2y*2 + (-6y + 6y + 2y)(-2y + 0y + y) + (10y + 11y + 0y)(y + y + 0y) + (5 - y - 5)(-3y + 0y + 2y). 40y2 Expand (-91 - 286 + 20)(-2o3 - 2o3 + o3). 1071o3 Expand (0 + 1 + 1)(-3p2 + 4p2 + p2) + (4 - 2 - 1)(2605p*2 - 7 + 1 - 2579p*2 + 2p). 30p2 + 2p - 6 Expand ((0 + 0 + 2t2)(-1 + 0 + 2) - 15t2 - 39 + 39 + 29t*2 + 5t - 5t)(-2 + 2 - 2t3). -32t*5 Expand (-3x*2 - x - 13 + 13)(3 - 1 - 3 + (2 - 4 + 1)(2 + 1 - 1)). 9x*2 + 3x Expand (-3 - 12 + 0)((b + 0b + b)(4 + 1 - 6) + 0 - 4b + 0). 90b Expand ((0o - 2o + 4o)(-3 + 2 + 2) + 4o + 0o - 3o - 22o + 8o - 6o)(-1 - 3 + 6). -34o Expand (3k2 - k2 + 3k2)(3 - 6 - 11). -70k2 Expand -1 - 2y*2 + 1 + (2 - 1 - 2)(0y - y2 + 0y + (y + 0y - 4y)(0 + 0 + 2y) - 6y2 + 0y*2 - 6y*2). 17y*2 Expand (3s - s + s)(-73 - 192 - 609 + 31). -2529s Expand (a + a + 0a)(a - 3a + 0a) + (1570 - 1570 + 82a)(0a - 2a + a) + (-5a + 0a + 3a)(a + 0a + 0a). -88a2 Expand (-76 + 329 - 598)(0n4 - 2n*4 + 3n*4). -345n*4 Expand (3m - 4m + 0m)(0 - 2 + 3) + (-4 + 0 + 3)(2 - 2 + m) + 70m - 13m + 25m. 80m Expand -3v2 + 4v*2 + 4v*2 + 3 - 3 - 2v*2 + (2v + v - 2v)(2v - v - 2v) - 5v2 + 6v*2 - 2v*2 - 11v*2 + 33 - 33. -10v2 Expand q2 - q - q2 - q4 + 191q4 + 205q*4 - 41q*4 + (0q + q + q)(-2q*3 - 2q*3 + 2q*3) + 0q4 - q4 + 2q4. 351q*4 - q Expand (-21m + 33m - 298 - 13m)(0 + 2 - 1). -m - 298 Expand (2c4 - c4 + 0c4)(-6 - 6 + 3) + 94c4 - 37c*4 - 148c**4. -1	{ "pile_set_name": "DM Mathematics" }
- 38, -2s - 249m + 250m - 7 = 0 for s. 2 Solve -20 = 5t - 2h, 1841t + 5h = 1843t + 29 for t. -2 Solve 5f + 1736u = 1741u - 5, 5u = -4f - 4 for f. -1 Solve 7i - 31 = -4z, 48z - 20 = 45z - 2i for z. 6 Solve -82 + 4 = 4a + 9j, -2a + 4j + 46 = 0 for a. 3 Solve 0m + 3m - 2r - 30 = 0, 8m = -3r - 45 for m. 0 Solve 3s - 1124 + 1073 = 0, 2j - 3s + 61 = 0 for j. -5 Solve 0 = 5m + 5h + 50, -m - 52 = -3h - 94 for m. 3 Solve 0 = 24o - 3l + 102, 0l - 50 - 2 = -2l for o. -1 Solve 0 = -5z + 2v + 6, 3z = 4v - 1 - 1 for z. 2 Solve j - 2 = -2y - 4j, y + 13j - 22 = 0 for y. -4 Solve -3x = -2u - 10, -2u + 1309x - 7 = 1313x + 3 for u. -5 Solve -i - 22h + 18h = -15, h - 5 = i for i. -1 Solve 30 = -3r - 6426h + 6423h, -5h + 4 = -r for r. -9 Solve 4v - 24 = 0, -2y - 2v - 5 = -7 for y. -5 Solve 4c - 34 + 37 = -3o, 9o + 54 = 3c for o. -5 Solve -53l + 37 = -58l + 3p, -4p - 44 = 5l for l. -8 Solve -b = 4l - 3, 128 = -b - 3l + 130 for b. -1 Solve 4f - 30 + 36 = -3c, 4f + 12 = -4c for c. -6 Solve 1476u - s = 1481u - 1, 0 = -4u - 4s - 12 for u. 1 Solve t - 2v - 6 = 0, 4t = 3v - 352 + 371 for t. 4 Solve -2b = 7w - 71, -19w + 48 = 3b - 15w for b. 4 Solve 5j = 5u - 15, -2 = -814j + 812j for u. 4 Solve 460o - 460o + 4d = 8, -2o = 3d + 14 for o. -10 Solve -2v - 8380m - 36 = -8378m, 2v + 5m + 93 = 0 for v. 1 Solve 8 = -i - 3j, -2i = -2j - 10 + 2 for i. 1 Solve 0 = -4i + 15c - 17c - 6, 63 = -9c for i. 2 Solve b + 5 = y + 1, 3b + 31 = 19 for y. 0 Solve 4k + 22 = -x, -44x = -62x - 5k - 61 for x. -2 Solve p + 14m - 19m - 22 = 0, -3m - 9 = -2p for p. -3 Solve 2f = 8t - 90, 192f = -5t + 191f + 45 for t. 10 Solve -13l + 46 = -59i + 62i, 0 = -l + 4 for i. -2 Solve -y - 1402 + 1398 = -12d, 2d - 8 = 2y for d. 0 Solve b + 2v = 19, -3b + v + 127 = 126 for b. 3 Solve 54 = 5k - 740w + 743w, -2w + 32 = 3k for k. 12 Solve -378g + 4u + 4 = -381g, 0 = 5g + 2u + 2 for g. 0 Solve 5w + n + 4n + 40 = 0, -5w - 42 = 15n - 11n for w. -10 Solve 0 = -5j + 437v - 444v + 33, -2v = -4j - 4 for j. 1 Solve 5s = -2c - 5, 4c + 8 = -124s + 116s for c. 0 Solve -3p = 2b + 1, -382 = 7b - p - 367 for b. -2 Solve 28a + 13 - 82 = -5t, 12 = -3t + 2 + 1 for a. 3 Solve -19 = 4f - k, 5k = f - 1348 + 1367 for f. -4 Solve -2l + 1 = -3f, 3l - 6 = 5f - 4 for f. -1 Solve 5k = 4n, 4k - 4n = -7n for k. 0 Solve 0 = -4j + 3z + 35, 5j - 34z + 35z - 20 = 0 for j. 5 Solve 3a - 220j + 223j - 18 = 0, -3a = -3j for a. 3 Solve -16 = 3f + m, m + 6750 = 6749 for f. -5 Solve 2o - 5q - 16 = -50, 2o + 22 = 2q for o. -7 Solve 11u - 54 = 2b, -5b + 6 - 39 = -2u for b. -5 Solve -t + 13u - 35 = 0, 3t = -4u + 10 + 14 for t. 4 Solve w - 4k = -25k + 65, 5 = w + k for w. 2 Solve -q = 5t + 24, -43t = -4q - 38t + 29 for q. 1 Solve -3o = 5v - 49, -2v + 58o + 13 = 57o for v. 8 Solve j = -5s + 14, -s + 190j = 185j - 8 for s. 3 Solve 8221l + 13 = 8224l + 4b, -4l + 2b = 34 for l. -5 Solve 0 = 5b + 5f - 10, 48530b - 9f + 39 = 48532b for b. -3 Solve -5v - 532 = 4i - 517, 2i - 12v + 22 = 0 for i. -5 Solve 3s + 43 = 5n, 3106s + 6n - 51 = 3109s for s. -1 Solve -3l - 17 = 2v, -4v + 25l = 28l + 31 for v. -7 Solve -7a - 7 = -3a + 1, 5n - 4a - 28 = 0 for n. 4 Solve 25 = -10m + 7m - 4j, 6j + 12 = 4m for m. -3 Solve -449x + 445x + 12 = -4w, 5x + 5 = w for w. -5 Solve -172 = 41l - 4d, -4l + 5d - 30 + 4 = 0 for l. -4 Solve -2s - 12 = -2f, 44 - 28 = -3s + 2f for s. -4 Solve -4v = w + 37, -3v - 25 = 17w - 19w for v. -9 Solve -2m = -5k - 42, 36 = 2k - 7130m + 7134m for k. -4 Solve -5q - 20 = -5b + 10b, -2q = -3b + 8 for b. 0 Solve 2s - 3t = 9, -515t + 518t = s - 9 for s. 0 Solve -2t = -97h + 102h + 7, -3 = -2t + 5h for t. -1 Solve 0 = 2n + 4b - 12, 143b - 144b + 37 = 9n for n. 4 Solve -4n - 8 = 0, -4n + 229 - 198 = 13j for j. 3 Solve 5k - 230 = 4r + k - 491 + 229, -3k = 18 for r. 2 Solve 0 = -462y + 465y - 3t + 9, -3t - 26 = 4y for y. -5 Solve -3s - 55 = -5t, 183t - 187t + 5s = -83 for t. 2 Solve 0 = 5l - 3o - 11, -2l - 424o + 428o = -10 for l. 1 Solve 96 - 26 = -4a - 15m, 0 = -a - 2m - 7 for a. 5 Solve 0 = 3p + p + 40, -12p = -4t + 5t + 121 for t. -1 Solve 0 = -4s + 16, -3i - 14s - 14s = -25s - 12 for i. 0 Solve 4s + 194l + 20 = 190l, 0 = -5s + l - 19 for s. -4 Solve 0 = -4c - s - 41, -4c - 95 - 15 = -22s for c. -11 Solve 5x = 4c - 21, 93 = 2c + x + 72 for c. 9 Solve 0 = 4b + 2k + 96, -62712b + 62707b + 4k = 94 for b. -22 Solve 4i - 5r + 44 = 0, -37i - 2r = -33i + 44 for i. -11 Solve 0 = 3s + 4l + 14, -9658s + 9657s - 2l = 2 for s. -10 Solve 0 = -v + f - 9, 123v + 4f = 125v + 32 for v. -2 Solve n - b + 2309 = 2312, -3n + 15 = -5b for n. 0 Solve -2s = -46o + 47o + 8, 32 = -2o + 4s for o. -12 Solve -4r = 2i - 14, 19r - 1 = 20r + 2i for r. 5 Solve 4c = o - 2, -5c - 18o + 52 = 16 for c. 0 Solve 5n - 1161h - 23 = -1162h, -3h + 41 = n for n. 2 Solve 2675 = -3y + 3m + 2693, 6y - 1 = -m for y. 1 Solve 11l + 13 = 4w, 2l = -4w + 27 - 53 for l. -3 Solve -49 = 2b + 6m - 123, 0 = -3m + 36 for b. 1 Solve 0 = -3s - 3q - 723 + 738, s - 5 = 3q for s. 5 Solve -168d + 16 = -164d + 2m, -24 = -4d - 4m for d. 2 Solve 7 + 53 = 2g + 10d, 4g = 3d + 5 for g. 5 Solve y - 10 = -2p, 0 = -450y + 454y - 3p + 4 for y. 2 Solve 0 = 4v + 3t + 36 - 7, 15 = -5t for v. -5 Solve -15 = 5p - 9m + 12, 0 = -2p - 2m + 6 for p. 0 Solve -c - 10 = -3z, -5c + 40 = 25089z - 25086z for z. 5 Solve -q + 122n + 16 = 119n, q + 5n = -24 for q. 1 Solve -8c = -12c - 10z - 40, -5c - 27 = z for c. -5 Solve 106j = 54h + 109j + 111, 5h - j + 9 = 0 for h. -2 Solve 2u + 7n = -110 + 84, 19 = 3u - 4n for u. 1 Solve 5 = 49a - 48a - c, -100a + 95a + 13 = -c for a. 2 Solve -7y - 73 = 5i, 15 + 5 + 0 = -5y for i. -9 Solve -3b + 28o - 29o = -1, 0 = b - 4o + 4 for b. 0 Solve 101r - 46r = -y + 54r - 4, 5r - 96 = 24y for y. -4 Solve 26w - 40 = 22w + 4a, -3w + 60 = 3a for w. 15 Solve -2i = z - 8, -5z + 8 = i + i for i. 4 Solve -1029h - 4 = -1024h - m, -2h = 5m + 7 for h. -1 Solve 2p - 3v = 7, v = -p + 6v for p. 5 Solve -24s = 4l - 23s - 4, 0 = -4l + 2s - 20 for l. -1 Solve -12 = -4v - 2s, -s + 54 = -2v + 52 for v. 1 Solve -9v - o + 39 = 0, -2v - 3o = -87 + 70 for v. 4 Solve 2h = 4y + 34, 212 = 2y + 4h + 214 for y. -7 Solve 6 = 4t - 2x, -466t = -457t - 3x - 18 for t. 3 Solve -6h = -2s - 4h, -18 = -s - 5h for s. 3 Solve -2j - u - 5 = 0, 26j = 27j + 2u + 4 for j. -2 Solve 4r - 2b = 12, 6r + 5b = 9r - 44 for r. -2 Solve -10g + 3r = -14, -2r - 1 = 3g - 11 for g. 2 Solve -5q - 24 + 33 + 26 = -z - 30, 5z = 0 for q. 13 Solve -13f + 13 = -10f - l, 0 = 4f - 2l - 14 for f. 6 Solve -4 = -m + k, -227m + 14 = -223m - 2k for m. 3 Solve 479d - 483d - 23 = -y + 5, -24 = 3d for y. -4 Solve 152o - 14 = 2z + 153o, 5z + 5o = -45 for z. -5 Solve -g + 1 = t, -g + 6g = 4t + 14 for t. -1 Solve -33 = -5v + 7p - 41, 0 = -5v - 5p + 40 for v. 4 Solve -3k = -t - 27, -4k - 4t - 217 = -237 for k. 8 Solve 72h = 70h - 8, -4v = -5h - 40 for v. 5 Solve -2m + 2 = 0, -2k - 111 = -m - 120 for k. 5 Solve -3g - 9 = 0, 35 = -6y + y - 5g for y. -4 Solve 2c + b - 10 = 0, -71c + 44 = -72c + 3b for c. -2 Solve 235 - 250 = -5n - 2s, -s = -11n + 6 for n. 1 Solve -3l = 19s + 67, -4s - 31l - 4 = -27l for s. -4 Solve 5r - 47 = 3b + 12r, 4r = -5b - 40 for b. -4 Solve -4079g - 4q = -4080g - 33, -4g + 3q = 119 for g. -29 Solve 2a + 1918 - 1916 = r, -7 = -5a + 4r for a. -5 Solve 0 = -7r + 8r - 4a - 8, -2a - 48 = 5r for r. -8 Solve -5l - 633v = -632v + 3, l - 5v = -63 for l. -3 Solve -7g - 77i = -74i + 15, -g - 4i + 5 = 0 for g. -3 Solve 4o - 15 + 27 = -4r, o = 4r + 12 for r. -3 Solve 4p = 3v - 31, 166v - 158v - 1 = -p for v. 1 Solve -3x - 8 = 7q, 138x = 2q + 141x - 2 for q. -2 Solve -5q - 4t - 245 = -257, 20 = 4q - 2t for q. 4 Solve -f = -4n + 14, 0 = n + 3f + 263 - 273 for n. 4 Solve -10l + 14l = -3m - 25, 16 = -4l for m. -3 Solve -2m	{ "pile_set_name": "DM Mathematics" }
l6/4 - l4/24 + 24l2 - 2l. What is k(i)? -29 Suppose 3r - 11 = 25m - 30m, 5m - 3r = 59. Let g(i) = i2 + 4i - 72. Give g(m). 5 Let d(w) be the first derivative of -2 - 3w2 + 2w - 1/3w3. Let x be (15 - 8)(-19 - -8 - -10). Calculate d(x). -5 Let f(d) be the second derivative of -d4/12 + d3 + 2d. Let b = -124 - -228. Suppose 20 = -14z + b. Determine f(z). 0 Let h = -13107 + 13106. Let k(f) = 26f - 2. What is k(h)? -28 Suppose 3w = 10w - 126. Suppose -wq - 80 = -8q. Let g(s) = -3s + 8. Give g(q). 32 Let z(d) = d*2 + 16d + 43. Let a(l) = -982l - 2959. Let i be a(-3). What is z(i)? 4 Let z = 283 + -283. Suppose -6g + 3g - 4x - 32 = z, 6g = 5x - 116. Let c(h) = -2h - 39. Calculate c(g). -7 Let d(m) = -555m*3 + 3m - 6m2 + 72 - 65 + 556m*3. Let s be (-21)/(-4) + (-1)/4. Calculate d(s). -3 Let u(p) = 2p*2 - 738601 + 2p*2 + 19p + 738583. Determine u(1). 5 Let z(v) = -4v - 1. Suppose j = -2g + 65, -4j + 43 = 2g - g. Suppose -35 = -4m - g. Give z(m). -5 Let l(r) = -10r + 165 - 324 + 163. Let i(n) = 2n - 1. Let v(q) = -16i(q) - 3l(q). What is v(-7)? 18 Let s(y) = -y2 + 63y - 179. Let o be s(3). Let a(b) = -6b - 1. Let v(i) = 7i + 1. Let k be (-8)/(-6)(-6)/4. Let t(q) = kv(q) - 3a(q). What is t(o)? 5 Let m(o) = -6o*2 + 11o*2 + 8o + 14 + 9o - 8o2. Let j be m(6). Let r(v) = -v2 + 7v + 9. Give r(j). 1 Let p(c) be the third derivative of c4/24 - 17c3/3 - c2. Let x = 46741 - 46741. Determine p(x). -34 Let z be 0/(-2 - 1) - -14. Suppose -y + z = -1. Let x be 12(40/y - 3). Let u(l) = -2l - 2. Calculate u(x). 6 Let r = -76 - -399. Let w = -320 + r. Let v(q) = 4q. Let a(d) = 7d. Let n(y) = 6a(y) - 11v(y). Calculate n(w). -6 Suppose 9c - 4c + 5q - 25 = 0, 0 = -c + 2q - 1. Let h(r) be the third derivative of 1/12r4 + 0 - 3r*2 + 0r - 2/3r3. Give h(c). 2 Suppose u - 78 = -q - 4q, -4q = u - 63. Let o = -9 + q. Let y(z) = 7z*2 + z - o + 47z*3 + 3z - 46z3. What is y(-6)? 6 Let q(b) be the first derivative of 0b + 1/24b4 + 20 + 6b*2 + 1/6b*3. Let h(l) be the second derivative of q(l). Calculate h(0). 1 Let l(v) = 3v - 2 - 3v2 + 9v + 2v2. Let b = 149952 + -149943. Calculate l(b). 25 Suppose -4 = 2o - 2. Let q(x) = 9x + 1. Let y(u) = u2 - 11u - 76. Let i be y(-5). Let s(n) = 13n + 1. Let f(p) = is(p) - 5q(p). Calculate f(o). -8 Let z(f) be the second derivative of -f5/20 + 5f*4/4 - 13f*3/6 - 6f*2 + 263f. What is z(14)? 2 Suppose -4y + 3a = -7y + 12, -y - 5a = 4. Suppose 66 = 10i - 4. Let w(c) = -6 + 2c + 4c - 2c*3 - ic*2 + 3c*3. Determine w(y). -6 Let v = -5965 + 5964. Let f(r) = 5r*2 + 16r + 16. Determine f(v). 5 Let j be 31/3 + ((-8)/24 - -1). Suppose 13d = 102 - j. Let h(s) = s2 - 3s + 3. Let u(z) = -z*2 + 4z - 4. Let c(r) = 4h(r) + 5u(r). Calculate c(d). -1 Let c(s) = 4s + 96. Let q = 1549 - 1573. Give c(q). 0 Let s(m) = m3 + 231m - 2m2 - 229m - 1 + m*3 + 3m*3. Let v = 9 + 1. Suppose 6y - v = -4. Give s(y). 4 Let n(o) = -166o - 2990. Let i be n(-18). Let r(c) = -45c - 1. Give r(i). 89 Let t(c) = -c*3 - 4c*2 + 4c + 5. Suppose 60z + 15600 = 12z. Let g = z + 320. Calculate t(g). 10 Let a(m) = -m3 + m2 + 10m + 6. Let l(b) = -b2 + 55b - 336. Let c be l(7). Determine a(c). 6 Let w(r) = 4r. Suppose 5x - 162 = 2h + 198, -3x + 182 = -h. Let p = h + 167. Give w(p). -12 Let a be (-116)/1614. Let b = 25 + a. Let n(i) be the third derivative of i6/120 + i5/30 - 5i4/24 + i3/3 - 25i2 - 1. Calculate n(b). -10 Let n(k) = -k3 + 5k2 + 10k - 11. Let j = -373 + 387. Suppose j = 3c - i, 5c - 2c - 5i = -2. Calculate n(c). 13 Let y(s) = 2s - 1. Let z be y(6). Suppose x + z - 10 = 0. Let i(n) = 3n + 5. Let w(g) = 3g + 6. Let f(l) = -7i(l) + 6w(l). Give f(x). 4 Let w = -5374 - -5368. Suppose 3q + 2 + 50 = 5h, 5q = -20. Let s(r) = 0r2 + hr + 8r2 + 4r2 + r3 + 7 - 5r2. Calculate s(w). -5 Let u(l) = -84l*2 + 2l + 1. Suppose 8m + 11 = 4q + 13m, 4m - 17 = 5q. What is u(q)? -85 Let q(a) be the first derivative of 0a + 70 - 3a2 + 1/3a3. Determine q(3). -9 Let g(v) be the third derivative of v5/6 - 73v4/24 + 3v*3 + 4113v2. What is g(7)? -3 Let i(r) be the first derivative of r2 - 3r + 2321. Suppose 0u + 10 = 5u. Calculate i(u). 1 Let m be (1 - 3/5)/((-5)/600). Let u be ((-8)/16)/(0 - (-2)/m). Suppose b + 5 = 4y + u, 3y + b = 0. Let h(l) = -l. Determine h(y). 1 Let v(o) = o3 + o2 - 1. Let p be v(0). Let m(h) = -h + 4. Let c(i) = -i. Let t(y) = pm(y) + 4c(y). Let d be 2 + (-92)/14 - 468/(-819). Give t(d). 8 Let x(k) = k3 + 19k*2 - 40k + 50. Let v = -21553 - -21532. Determine x(v). 8 Let l(b) be the first derivative of -1/8b4 - 1/3b*3 + 0b + 7/2b2 + 10. Let s(y) be the second derivative of l(y). Determine s(-3). 7 Let v(x) = 6x + 51. Let r be v(-8). Let y be r/(9/(-12)) + 3. Let a(z) = 7z3. What is a(y)? -7 Let w be 15/9(-408)/(-20). Let l(u) = 1 + 34u + wu + u*3 - 66u + u2. Let y(v) = -v3 - 5v2 - 3v + 3. Let h be y(-4). Calculate l(h). -1 Let c(i) = -i*3 - 22i*2 - i - 22. Let t be c(-22). Suppose 0 = -ty + 6y - 30. Let k(r) = 5r*2 + 5r*2 - 5r*2 - 4r*2 - y. Give k(5). 20 Let v(o) = 18o*2 - 217o - 217. Let k be v(-1). Let r(q) = -q*3 + 16q*2 + 34q + 39. What is r(k)? 3 Let r(b) be the third derivative of -b*4/2 + 77b*3/6 + 3b*2 + b. Let k be r(6). Let a(v) = -v + 14. Calculate a(k). 9 Let f(k) = k + 19. Let a(g) = -g - 4g2 - g3 - 7g2 + 0 - 13g*2 - 32. Let i be a(-24). What is f(i)? 11 Suppose -209g + 208g - 8 = 0. Let t(u) = -u2 - 9u - 5. Let w be t(g). Let r(v) = -2v2 + 2v + 4. Calculate r(w). -8 Let b(a) = -11a2 - 4a + 2. Let i be 7 - 11 - (-4 - 1). Determine b(i). -13 Let n = 233 + -230. Suppose 0 = -2l + 4k + 6 + 16, 0 = -nk - 12. Let o(h) = h + 2. Give o(l). 5 Let f be (1/1)/(21/147). Let j be (f + (-78)/12)-6. Let s(y) = y*3 + 6 - 3y*3 + y + 0 - 5 - 3y*2. What is s(j)? 25 Suppose -5h + 8h - 48 = 0. Let r(q) = h + q + 0 - q2 - 8 - 4. Suppose 5z + 9 = -4d, 0 = d - z + 1 - 10. Give r(d). -8 Let o(c) be the first derivative of 33c3 + c2 - 3c + 2092. What is o(1)? 98 Let m(k) = 19k*2 + 4k + 15. Let d(s) = s3 - s2 - 14. Let t(w) = d(w) + m(w). Calculate t(-18). -71 Suppose -c = 4v - 30, -c + 4c = 5v - 46. Suppose -5h + 7 = 3u, u - 1 = 5h + v. Let d(l) = -l*3 + 4l*2 + 2. Give d(u). 2 Suppose 29q - 30q + 8 = 0. Suppose 0 = -p, -2p + p = 2t - q. Suppose 35 = 11a - ta. Let i(w) = w3 - 7w*2 + 4w + 6. Give i(a). -24 Let x(u) = u - 1. Let c(g) be the first derivative of 5g2/2 + 5g + 36. Let o(p) = c(p) - 6x(p). Calculate o(6). 5 Let f(k) = -k3 - 3k*2 + k - 8. Suppose -p - 4l - 46 + 35 = 0, 4p + 6 = 3l. What is f(p)? -11 Let g = 18 + 46. Let a = 66 - g. Let b(p) = -21p2 - 5p - 21. Let l(i) = 4i2 + i + 4. Let r(v) = ab(v) + 11l(v). What is r(2)? 12 Suppose p = 4h + 13 + 19, -2p = -2h - 28. Let q(j) be the first derivative of -j*4/4 - 7j*3/3 - 5j*2/2 - 9j + 1. Calculate q(h). -15 Let y(i) = -5i3 - i. Let b = 19 + -8. Suppose 0 = -6f + bf + 240. Let m = -47 - f. What is y(m)? -6 Let i(f) be the third derivative of -f7/840 - 7f6/360 + f5/20 - f*4/3 + 12f*3 + 85f2. Let h(p) be the first derivative of i(p). Calculate h(-8). 8 Let b(t) = t2 + t - 17. Let v(q) = 5q2 - 1. Let f be v(1). Let y be b(f). Let j(g) = 9 - 15 + 6 - yg. What is j(-4)? 12 Let t(x) = -85x2 - 98x*2 - 96x*2 + 267x*2 + 1 + 14x + x3. What is t(10)? -59 Let f(h) = -h3 + 11h + 7. Let v be ((-280)/(-24) - 11) + (-80)/(-24). Determine f(v). -13 Let x(g) = g2 + 10g + 11. Let t(j) = 2j + 10. Let w be ((-4)/38 + 2208/(-684))3. Let f be t(w). Determine x(f). 11 Suppose 5i - 19 = 2o, 524o - 522o = 3i - 17. Let u(l) be the third derivative of l6/40 - l5/60 + l4/24 + l2. What is u(i)? 3 Let c = -5 - -6. Suppose -5 = 2s + c. Let l(o) = -2 + 5035o + o2 - 5035o. Calculate l(s). 7 Let q(s) = 4s - 6. Let j be q(-7). Let h = j + 44. Let w(p) = 2 - 9p + 1 + hp. Give w(0). 3 Let b(l) be the second derivative of l3/6 - 6l*2 + 2762l. Suppose 2a - 31 = -a - 2p	{ "pile_set_name": "DM Mathematics" }
1.02 rounded to 2 decimal places? 1.02 Round -121 to the nearest 10. -120 What is -582.1 rounded to the nearest one hundred? -600 Round -2886000 to the nearest ten thousand. -2890000 Round 1435 to the nearest one hundred. 1400 What is 703400 rounded to the nearest 100000? 700000 What is 0.00003693 rounded to 6 dps? 0.000037 Round 0.111683 to four decimal places. 0.1117 Round -31.899 to one decimal place. -31.9 Round -6.833 to one decimal place. -6.8 What is -0.0020553 rounded to three dps? -0.002 Round 7.0375 to the nearest integer. 7 What is -5468870 rounded to the nearest ten thousand? -5470000 What is -1696.2 rounded to the nearest 10? -1700 Round 23.31 to the nearest integer. 23 What is -560 rounded to the nearest 1000? -1000 Round 95500 to the nearest 10000. 100000 What is 0.000019091 rounded to 6 dps? 0.000019 What is -0.00034971 rounded to 6 decimal places? -0.00035 Round -9871.4 to the nearest 1000. -10000 Round -0.000383 to 4 dps. -0.0004 Round 37090000 to the nearest 1000000. 37000000 What is 0.4955 rounded to two decimal places? 0.5 What is 0.00007204 rounded to six decimal places? 0.000072 Round -1647 to the nearest 100. -1600 What is 0.003863 rounded to 4 decimal places? 0.0039 What is -5.074 rounded to the nearest integer? -5 What is 1661000 rounded to the nearest one hundred thousand? 1700000 What is 111.66 rounded to the nearest integer? 112 Round -57209.1 to the nearest 100. -57200 What is 2817 rounded to the nearest one thousand? 3000 Round -0.002511 to 4 decimal places. -0.0025 What is 2.405 rounded to 1 decimal place? 2.4 Round -0.618 to one decimal place. -0.6 Round -3474 to the nearest one hundred. -3500 What is -0.0005674 rounded to five dps? -0.00057 What is -223250 rounded to the nearest 1000? -223000 What is 0.6209 rounded to 2 decimal places? 0.62 What is 0.002623 rounded to four decimal places? 0.0026 Round 131000 to the nearest ten thousand. 130000 Round 232.53 to the nearest integer. 233 Round 952260000 to the nearest one million. 952000000 Round -0.046785 to three decimal places. -0.047 Round 0.000553 to 4 decimal places. 0.0006 Round 8.843 to 1 decimal place. 8.8 What is -1031.92 rounded to the nearest ten? -1030 What is -1611.7 rounded to the nearest one hundred? -1600 Round -1.843 to one decimal place. -1.8 Round -8.276 to one dp. -8.3 What is 43.72 rounded to the nearest 10? 40 Round 1.56015 to one dp. 1.6 Round 288031 to the nearest one thousand. 288000 Round -0.00023214 to four dps. -0.0002 Round -23.7916 to one decimal place. -23.8 What is -0.00003344 rounded to 6 decimal places? -0.000033 Round -0.1727 to 2 dps. -0.17 Round -9660 to the nearest 100. -9700 Round 0.00006577 to 5 decimal places. 0.00007 What is 4971400 rounded to the nearest ten thousand? 4970000 Round 9760000 to the nearest 1000000. 10000000 What is -10139 rounded to the nearest one thousand? -10000 What is -4000 rounded to the nearest one thousand? -4000 What is -477200 rounded to the nearest 10000? -480000 Round -19440000 to the nearest 1000000. -19000000 What is -26440 rounded to the nearest ten thousand? -30000 What is -8908 rounded to the nearest one hundred? -8900 What is 604000 rounded to the nearest one hundred thousand? 600000 What is -0.00010038 rounded to 6 decimal places? -0.0001 Round 10280 to the nearest 10000. 10000 What is 4824 rounded to the nearest 100? 4800 Round 0.000061402 to five dps. 0.00006 What is 6299 rounded to the nearest one hundred? 6300 What is 63.4267 rounded to zero decimal places? 63 What is 0.544 rounded to 1 dp? 0.5 Round 47797.2 to the nearest 100. 47800 What is -200.1 rounded to the nearest ten? -200 What is 52.782 rounded to the nearest ten? 50 Round 0.000022992 to five dps. 0.00002 Round -190 to the nearest one thousand. 0 Round 0.02699 to 3 dps. 0.027 Round 0.000004133 to 6 dps. 0.000004 Round -0.0066305 to 3 dps. -0.007 Round 0.000000788 to 7 dps. 0.0000008 Round -0.00001357 to 6 decimal places. -0.000014 Round 158.347 to the nearest ten. 160 Round -0.000014676 to 5 decimal places. -0.00001 Round 0.2173 to 2 decimal places. 0.22 Round -82040 to the nearest ten thousand. -80000 Round 10.186 to 1 dp. 10.2 Round -0.004567 to 3 decimal places. -0.005 What is 736000 rounded to the nearest one hundred thousand? 700000 What is 196.54 rounded to the nearest 10? 200 What is -10255800 rounded to the nearest ten thousand? -10260000 What is 0.05186 rounded to 2 dps? 0.05 What is -0.00572 rounded to four dps? -0.0057 Round 0.000177313 to 5 decimal places. 0.00018 Round -85579 to the nearest 10000. -90000 Round -61.36 to 0 dps. -61 Round 149438 to the nearest 10000. 150000 Round -0.000747 to four decimal places. -0.0007 Round 0.2039 to two decimal places. 0.2 Round 10735000 to the nearest one million. 11000000 Round 30406 to the nearest ten thousand. 30000 What is -0.00023399 rounded to 4 dps? -0.0002 What is -75.13 rounded to the nearest ten? -80 Round 3333.11 to the nearest 100. 3300 Round -0.000003092 to 7 decimal places. -0.0000031 What is 54170 rounded to the nearest one thousand? 54000 Round 731600 to the nearest 10000. 730000 Round -0.0000139082 to six decimal places. -0.000014 Round 0.0000012191 to six decimal places. 0.000001 What is 93.58 rounded to the nearest ten? 90 What is -56.5 rounded to the nearest integer? -57 What is -448700 rounded to the nearest one hundred thousand? -400000 Round -5260 to the nearest one hundred. -5300 Round 2713 to the nearest 100. 2700 Round 328000 to the nearest ten thousand. 330000 Round -0.57559 to 1 dp. -0.6 What is 0.0007632 rounded to four decimal places? 0.0008 Round -0.0074 to 3 decimal places. -0.007 Round -0.0005607 to four dps. -0.0006 Round 6637000 to the nearest ten thousand. 6640000 Round -0.000003838 to seven dps. -0.0000038 What is -0.0000038431 rounded to six dps? -0.000004 What is -0.0000030325 rounded to 7 decimal places? -0.000003 What is -12300 rounded to the nearest one thousand? -12000 Round -0.0051143 to 5 dps. -0.00511 What is 510 rounded to the nearest 1000? 1000 Round 471400000 to the nearest one million. 471000000 What is -957000 rounded to the nearest one hundred thousand? -1000000 Round -0.0000173 to 6 decimal places. -0.000017 What is 0.007589 rounded to four decimal places? 0.0076 Round 0.0000009852 to 7 decimal places. 0.000001 What is 130630000 rounded to the nearest 1000000? 131000000 Round -48260 to the nearest 1000. -48000 What is 0.00000254 rounded to five decimal places? 0 What is -0.033282 rounded to four decimal places? -0.0333 Round -0.0008968 to four dps. -0.0009 Round 1.5386 to the nearest integer. 2 Round -4.6328 to two decimal places. -4.63 What is 58000 rounded to the nearest one hundred thousand? 100000 What is -233 rounded to the nearest 10000? 0 Round 356199 to the nearest one hundred thousand. 400000 What is 0.0007424 rounded to four decimal places? 0.0007 What is 3944 rounded to the nearest one thousand? 4000 Round -1723900 to the nearest ten thousand. -1720000 What is -0.06684 rounded to four decimal places? -0.0668 Round 333281 to the nearest ten thousand. 330000 What is -0.493 rounded to 2 dps? -0.49 Round 218800 to the nearest ten thousand. 220000 Round -1323400 to the nearest one hundred thousand. -1300000 Round 3.4347 to 1 decimal place. 3.4 What is -0.00352 rounded to 3 decimal places? -0.004 What is -115980000 rounded to the nearest one million? -116000000 What is -4362110 rounded to the nearest ten thousand? -4360000 What is -0.00006631 rounded to 4 decimal places? -0.0001 What is 140683 rounded to the nearest 10000? 140000 What is -250.2 rounded to the nearest ten? -250 What is 486000 rounded to the nearest one hundred thousand? 500000 Round -588600 to the nearest 10000. -590000 What is 23.7 rounded to the nearest integer? 24 Round -45167000 to the nearest one hundred thousand. -45200000 Round -0.000094472 to 6 dps. -0.000094 What is -44870 rounded to the nearest ten thousand? -40000 What is 0.10979 rounded to 2 decimal places? 0.11 Round -492 to the nearest 10. -490 Round 0.36918 to 3 decimal places. 0.369 Round -0.0000411109 to 7 dps. -0.0000411 What is 33793000 rounded to the nearest 100000? 33800000 What is -0.068731 rounded to three dps? -0.069 Round 5.80452 to 1 decimal place. 5.8 What is 2893000 rou	{ "pile_set_name": "DM Mathematics" }
) -5 (e) 2/7 e What is the nearest to -2 in -2, 7, 0.2, 2568, -5? -2 What is the closest to -0.13 in -0.4, -43.5084, 2/7? -0.4 What is the nearest to 0.1 in 2/13, -1.85, -9, 1, -0.25? 2/13 What is the closest to -15 in 3.8, 834, 5? 3.8 What is the nearest to 0.1 in -4, 0, 0.0286, -0.3, 10, -1? 0.0286 What is the closest to 2 in -5434, 34, 12? 12 What is the nearest to -671/7 in -3, -8.2, -1, 0.29? -8.2 Which is the nearest to 2/5? (a) 48 (b) -4/39 (c) -1/6 (d) -37 (e) 4 (f) 1/2 f What is the closest to -57 in 3, -2, 1/25, -1.54? -2 What is the nearest to -0.2 in -5, 9718/11, 0.055? 0.055 What is the nearest to 2/5 in 1/6, 0.8, 6098, 1? 1/6 What is the nearest to -7572/319 in 0.5, 3/8, -1? -1 What is the nearest to -1 in -1/342, 0.19, -1, -3/2, 10/9? -1 Which is the nearest to -1704? (a) -1/54 (b) 2/3 (c) -5 c What is the nearest to 0.2 in -3, 3/1450, 4, 1.2, -3/5? 3/1450 Which is the closest to -0.0659? (a) -0.5 (b) -4 (c) -0.2 (d) -2/61 (e) 3 d Which is the nearest to 2? (a) 1 (b) 2/7 (c) 140 (d) 49/4 (e) -0.04 a What is the closest to -0.04 in 7, -1, -2/23, 7/694? -2/23 What is the nearest to 2 in -2/33, 40/3, 7, 0.5, -11? 0.5 What is the nearest to 1 in 1/2, 0.1, 724, 0.03, -1? 1/2 Which is the closest to -1/12? (a) -132 (b) 5 (c) -2/77 (d) 0.03 (e) -3 c What is the nearest to -1 in 0.3, -5, -8, -38, 74, 0.5? 0.3 Which is the nearest to 0.8? (a) 0.5 (b) -1919 (c) 17.4 (d) -0.5 a Which is the nearest to 57? (a) 2/7 (b) 0.1 (c) -59 (d) 6 d What is the closest to -1/4 in 1560, -0.1, -76, 13, 0.4? -0.1 Which is the nearest to -13? (a) -0.058 (b) 1201 (c) 0.5 a What is the closest to 4 in -0.6, -1/2, -1, -15, 13/96? 13/96 What is the closest to 2/5 in 5.5, 2.6, -2, 996? 2.6 Which is the nearest to -1? (a) 6/11 (b) 2/1563 (c) -4 (d) 0.14 b Which is the nearest to -0.1? (a) 3 (b) -0.5 (c) 3716 (d) -626/57 b What is the closest to 1 in -2, -1/4, -1.3673, -5? -1/4 What is the nearest to -0.13 in -1/2, 1764, 4, 2? -1/2 Which is the nearest to 2/790781? (a) -4 (b) 0.1 (c) 4 (d) 0.26 (e) -2/7 b What is the nearest to 2 in -4, -5, 0.1, -67657, 0? 0.1 What is the closest to -3/50 in 4, -1, -0.3, 297? -0.3 Which is the nearest to -1? (a) -5 (b) 180 (c) 30141 a What is the closest to 0.26 in 0.27, 24, -0.5, 5, -0.3? 0.27 What is the nearest to 1 in -3, -1, -6.2, -5, 236? -1 Which is the closest to -3? (a) -67836/5 (b) -4 (c) 0 b What is the closest to -2 in -14, 8, -2, 137, -2/9? -2 What is the nearest to 7/8 in 1/5, -17, -3821? 1/5 What is the nearest to 50 in 128, 0.5, -4, 1, -2/11? 1 Which is the nearest to -0.1? (a) -0.4 (b) 1/2 (c) 149 (d) -0.2 (e) -13/9 (f) 6 d Which is the closest to 1? (a) 10 (b) 0.229 (c) -7/2 (d) 0.1 (e) -0.2 (f) -3/5 b What is the nearest to 77935 in -1/3, -3/2, 0.5, -5? 0.5 Which is the nearest to 8? (a) -634 (b) -0.4 (c) 1 (d) -0.2 (e) 0.1 c What is the nearest to 53 in -14/5, 1/6, 2/11, -96? 2/11 Which is the closest to 0.078? (a) -1/2 (b) 1.2 (c) -2/11 (d) -2/9 c Which is the closest to -3366? (a) 0.05 (b) 1 (c) 0.5 (d) 5 (e) 0.1 a What is the nearest to 1.58 in 12.03, 1, -2? 1 What is the nearest to -2/7 in -71.36, 0, -3, -6/49? -6/49 What is the closest to 0 in -13, 44, 9/10, -0.072? -0.072 What is the closest to -49 in 3/2, 2, 2/5, 87236? 2/5 What is the nearest to 1/3 in 2/13, -475, 2/7, -2/7, -12/11? 2/7 What is the nearest to 2 in -42.3, -141/4, -4? -4 Which is the nearest to 0? (a) 1 (b) -0.4 (c) 0.01 (d) -3/373 (e) -21/17 d Which is the nearest to 0? (a) 83 (b) 19006 (c) 0 c What is the closest to 12 in 8/9, -10, 9, -5, 1/30? 9 Which is the closest to 4? (a) -16355 (b) -1/2 (c) -4 b Which is the nearest to 10? (a) -4/5 (b) -2/15 (c) 3034 b Which is the nearest to -11? (a) -7/3 (b) -1 (c) -29 (d) -2 (e) 0 a Which is the nearest to 0.4? (a) -3/758 (b) 20/13 (c) 0.05 c Which is the closest to -4/23? (a) -1/5 (b) 26/5 (c) 5.9 (d) -2/9 a What is the nearest to 2/5 in 6, 3, -2, 2302? -2 What is the nearest to 0 in -2/11, -0.17, -4, 89, 17? -0.17 What is the closest to 0.1 in -297, -1/9, -7.65? -1/9 Which is the closest to 938? (a) 0.08 (b) 1/6 (c) 9/8 (d) 2 d Which is the nearest to 2? (a) -1432184 (b) -0.1 (c) 14 b Which is the nearest to -0.05516? (a) 0.3 (b) 0 (c) 4 (d) -0.8 b Which is the nearest to -2/9? (a) -7 (b) 8 (c) -2/62871 (d) -6/5 c What is the nearest to 13/4 in 4, 0, 3, -0.01, 2? 3 Which is the closest to 58.1? (a) 8/5 (b) 3/4 (c) 0 (d) -1 a What is the closest to -357488 in -1, 1, -2, -2/9? -2 Which is the closest to 7/4? (a) -0.6 (b) -1/11 (c) 7.48 b Which is the closest to -17/3? (a) 1 (b) -6 (c) -2/3 (d) -18 (e) 0.04 b What is the nearest to -5 in 5, -3, -1, 1/4643, -5/4? -3 Which is the nearest to -3? (a) -5 (b) -16 (c) 6/757 (d) -2/7 a What is the closest to 2 in -4, 0.5, -1/92, 0.1, -2/3? 0.5 Which is the closest to 0.2? (a) 1453/4 (b) -3 (c) 0.23 c Which is the nearest to -0.1? (a) -5 (b) 2 (c) -313 (d) 47 b What is the nearest to -3 in -65, -0.2, -1331? -0.2 Which is the nearest to 1? (a) -254.3 (b) -0.4 (c) 5/12 c Which is the closest to -1/2? (a) 0.02 (b) 0.3 (c) -315583 a Which is the closest to 1.3? (a) 3 (b) -1319 (c) 28 a What is the closest to 2/6547 in 2/7, 0.2, -1/7, 1/3, -0.4? -1/7 What is the nearest to 0.2 in -9154, -2, 608? -2 Which is the closest to 0.3? (a) -0.2 (b) -0.14 (c) -1 (d) -4/7 (e) -5865/7 (f) -2/5 b What is the closest to 0.4 in -0.141, 3, -3/7, -0.09, -2/13? -0.09 Which is the nearest to -57? (a) -3.6 (b) 2/27 (c) -2/7 (d) 26 a What is the nearest to -0.0416 in -1, 0.565, 0, 3? 0 Which is the closest to -3/5? (a) -3 (b) 2 (c) 0.07 (d) 3/2 (e) -936 (f) 237 c What is the nearest to -7 in 6, -0.5, 2/7, -3/5, 31/2? -3/5 Which is the nearest to 56.5? (a) 0 (b) -2 (c) -3/7 (d) 3 (e) 0.02 d Which is the nearest to 27460? (a) 16 (b) -0.4 (c) 5 (d) 2 (e) -5 a Which is the nearest to 3/2? (a) -3 (b) -202 (c) -338/5 a What is the closest to -19 in -323/12, -1/201, -0.3? -323/12 Which is the closest to 5? (a) -350 (b) -1/2 (c) 4.7 (d) 4 (e) -2 c Which is the closest to -0.3? (a) -8 (b) -55 (c) -3026 (d) 1 d Which is the closest to -3? (a) -2 (b) -0.06 (c) 0.6 (d) -0.089007 a What is the closest to 1/4 in -13, 20/99, 0.5, -0.42? 20/99 What is the closest to 2.2678 in -397, 5, -1? 5 What is the nearest to -109.4 in -2, -2/133, 22? -2 Which is the closest to 1? (a) 211 (b) -0.5 (c) 120/17 b What is the closest to -0.1 in -0.1, -0.82, 20, -1? -0.1 What is the closest to 84 in -1/4, -6.978, -5? -1/4 Which is the nearest to 0.2? (a) 26661 (b) -4 (c) -0.685 c What is the closest to 3 in 12734, -3/4, 1/4, 5, -1? 5 Which is the closest to -1/27? (a) 4 (b) 0.1198 (c) 5.3 b Which is the nearest to -0.033? (a) 4 (b) 62 (c) 0.077 c What is the closest to 1.1 in -0.26, 4, -0.236994, 2? 2 What is the closest to -1 in 8, 2/27885, 3/5, 25? 2/27885 What is the closest to 6 in -90, -2, 263, -0.5? -0.5 Which is the nearest to 0.1? (a) -0.036 (b) 483.5 (c) -2/11 a Which is the nearest to 1? (a) -507/2 (b) -3/5 (c) -0.07 c What is the closest to -1 in -0.4, 63/5, -137469? -0.4 Which is the closest to -0.01? (a) -2 (b) 2445 (c) 436 a Which is the nearest to -1/4? (a) 3 (b) -1 (c) -5 (d) -134/155 (e) -25 d Which is the nearest to -8/7? (a) 2/5 (b) 43 (c) -23/3 (d) -1.2 d What is the nearest to -2/9 in 6, -0.3, -1/8, 51, -11167? -0.3 What is the nearest to 0.0349 in -3/4, 2/3, 44? 2/3 Which is the nearest to 2? (a) 0.053 (b) 1.091 (c) 9 b What is the nearest to 6652 in -3, 20, -1? 20 Which is the nearest to 1? (a) 8 (b) 0 (c) -8 (d) 614 (e) 4 b What is the nearest to -549 in -2/3, 0.03, 0.06, 1, 10? -2/3 Which is the nearest to 2? (a) 18/11 (b) 6.71 (c) -863/4 (d) 0.2 a What is the nearest to 0.1 in -2, -0.5, -1.13, -4, 3/7, -6/7? 3/7 What is the nearest to 5621 in -6, -53, -1, 0.1? 0.1 Which is the closest to 0.6178? (a) 51 (b) -0.5 (c) 4/3 c Which is the closest to -439? (a) 18 (b) -1.2 (c) -5 (d) -13 d What is the closest to -1 in 0.01, -1, -4/583, 13, 1? -1 Which is the nearest to -1? (a) 2 (b) -2/5 (c) -101/3989 b Which is the nearest to -0.1? (a) 0.3 (b	{ "pile_set_name": "DM Mathematics" }
v is divided by u? 27 Suppose 48b - 65 + 17 = 0. What is the remainder when 77/11 - (0 + 0) is divided by b? 0 Suppose 3l - 88 = c - 3c, 8c + 3l - 334 = 0. Calculate the remainder when 145 is divided by c. 22 Suppose -2842 - 10469 = -62i + 11i. Calculate the remainder when i is divided by 139. 122 Suppose -3m - 59 = -d + 139, 5d - m = 1018. What is the remainder when d is divided by 51? 0 Let u(m) = 167m - 2060. Calculate the remainder when u(14) is divided by 73. 59 Let c(l) = 20l2 + 1. Suppose 2u - 3u - 5b = -21, -2u + 27 = -5b. Suppose 20x = ux + 236. What is the remainder when x is divided by c(1)? 17 Let w(a) = a*2 - 2a + 12. Calculate the remainder when w(6) is divided by ((-85)/(-20) - 4)/((-4)/(-208)). 10 Let a be (5/((-10)/(-33)))/(3/8). Suppose -5q + 4h + a = -4q, -3h - 12 = 0. Calculate the remainder when 33 is divided by 42/324/q. 9 Let y = 378 - 300. Calculate the remainder when 166 is divided by y. 10 Suppose -942 = -3o - y, 2y = -6o + 3o + 939. Let p = 411 - o. Calculate the remainder when p is divided by 90. 6 Calculate the remainder when 4265 is divided by (-60)/(-50) + 1476/20. 65 What is the remainder when (537 + 18/(4 + -10))(-60)/(-45) is divided by 208? 88 Let r(o) = -11o + 13. Let d(u) = 3 - 3u*2 - 5 + 2u*2 - 7u. Calculate the remainder when r(-2) is divided by d(-5). 3 Let i(y) = y*2 + 4y - 2. Calculate the remainder when 720700/8100 + (-20)/(-810) is divided by i(-5). 2 Let k(h) = -h*2 + 13h - 15. Let n be (-8)/(-10) + 648/90. What is the remainder when 49 is divided by k(n)? 24 Let l(x) = -12x2 - 5x + 40. Let p be l(9). Let g = -780 - p. What is the remainder when g is divided by 29? 23 Let n(q) = -4q + 23. Let y(k) = 2k*2 - 3k - 4. Let g be y(4). Suppose 2h + g = -28. Calculate the remainder when n(h) is divided by 14. 13 Let s = -314 + 441. Suppose -712 = -13c - s. What is the remainder when 73 is divided by c? 28 Let t = -9662 + 9792. Calculate the remainder when 10659 is divided by t. 129 Suppose -446 = 16q - 1774. Suppose -16 = 8o - 104. Calculate the remainder when q is divided by o. 6 Suppose -483g = -318g - 330. What is the remainder when 143 is divided by g? 1 Suppose -9 - 11 = -2s. Let v(i) = 4i - i + 30 - 8i + 8i. What is the remainder when s is divided by v(-9)? 1 Suppose 5p + 3p - 112 = 0. Let m(f) = -2f + 16. Let r be m(6). Suppose rw = 15w - 451. Calculate the remainder when w is divided by p. 13 Suppose -17h - 17 = -119. Calculate the remainder when 1/((-2620)/(-436) - h) is divided by 14. 11 Let u = -8919 + 13769. What is the remainder when u is divided by 21? 20 Let b = 15478 + -15421. Calculate the remainder when 1424 is divided by b. 56 Let m = -641 - -1235. Suppose -2h = -192 - m. Suppose -14y = -17y + h. What is the remainder when y is divided by 33? 32 Let f(o) = 24o - 18. Let h(t) = -12t + 9. Let d(a) = 3f(a) + 5h(a). Let w(q) = 5q + 81. Calculate the remainder when d(6) is divided by w(-13). 15 Suppose 4l = 3f - 124, 0 = -393f + 396f + 2l - 100. What is the remainder when 931 is divided by f? 31 Suppose -10q + 11q = 2. Suppose -s = -qy - 8, 46 + 18 = 3s + 2y. What is the remainder when 60 is divided by s - (-2 + 1)-2? 12 Let n(a) = -2a + 386. Calculate the remainder when 437 is divided by n(-19). 13 Let d(q) = 14q2 - 216q + 857. What is the remainder when d(4) is divided by 17? 13 Let w = -18295 - -19146. Calculate the remainder when w is divided by 125. 101 Let r(j) = j*2 - 12j + 29. Let x be r(6). Let i(y) = -8y - 45. Calculate the remainder when 61 is divided by i(x). 6 Suppose -5184 = -56w - 7w - 99w. What is the remainder when 703 is divided by w? 31 Let w = 4 - -6. Let m = 15405 - 15066. What is the remainder when m is divided by w? 9 Suppose m - w = 90, 13m = 17m - w - 375. What is the remainder when m is divided by 50? 45 Suppose -4c - i - 20 = 50, -3c = -2i + 58. Let h be (-3)/18 - (219/c - -4). Suppose -176 = -hr + 4r. Calculate the remainder when r is divided by 23. 21 Let g = 332 + -317. Suppose -y - l = -83, g = -4l + 11. What is the remainder when 332 is divided by y? 80 Suppose -4a - 15w + 14w + 149 = 0, a = 4w + 33. Calculate the remainder when 666 is divided by a. 0 Let w = 191 + -194. Let o(k) = -12k - 18. Calculate the remainder when ((-5)/15)/((-4)/1908) is divided by o(w). 15 Suppose -17p = 9p - 16068. Suppose w = -594 + p. Calculate the remainder when 36 is divided by w. 12 Suppose -2w = -2p - 5717 - 4247, 19926 = 4w - 2p. Calculate the remainder when w is divided by 94. 93 Suppose -17 + 113 = 6m. What is the remainder when 24 is divided by (36/(-8))/((-6)/m)? 0 Let a be 60/(-1) - (3 + -2 + -1). Let c = a + 75. Suppose -2l + 33 = 2i - c, 0 = 2l. Calculate the remainder when 69 is divided by i. 21 Suppose -147b = -4253 - 9712. What is the remainder when 303 is divided by b? 18 Suppose 0 = 2z + 12 - 2. Let l = z - -84. What is the remainder when l is divided by (4 - 48/20)/((-6)/75-1)? 19 Let f = -69 - -36. Let q = f - -38. Suppose 74 = -ql + 204. Calculate the remainder when 51 is divided by l. 25 Suppose 3x = 6x - 21. Suppose -3c = 4c - 280. Suppose 2t + a - 7 = -2, 3a = 5t - c. What is the remainder when x is divided by t? 2 Let y = -41 - -141. Suppose 0 = -19f + 15f + y. What is the remainder when 116 is divided by f? 16 Let h be 60/866/55. What is the remainder when 324 is divided by (-348)/(-14) + 0 + h/63? 24 Let y = 59 + -10. Let m = y + -49. Calculate the remainder when 114 is divided by 279/9 - (2 + m). 27 Suppose 0 = 4k + 37k - 5535. What is the remainder when 184 is divided by k? 49 Let t(u) be the first derivative of u2 + 2u - 29. Let y be t(7). Suppose -204 = ym - 20m. Calculate the remainder when m is divided by 13. 12 Let y(z) = -z*3 - 25z*2 - 75z + 52. Calculate the remainder when y(-22) is divided by 21. 19 Suppose 0 = -u - 54 + 50, 0 = 2s + 3u - 190. Calculate the remainder when s is divided by 78. 23 Let f(y) = y*2 - 21y + 23. Let i be f(20). Let c(s) = 4 - is - 62s*2 + 61s*2 - 9s. What is the remainder when c(-7) is divided by 10? 9 Let g = 1335 - 1323. What is the remainder when 416 is divided by g? 8 Let f(o) = o*3 + 13o*2 - 8o + 2. Let g be f(-11). What is the remainder when (g/6)/(14/21) is divided by 3 - -3 - ((-6)/(-2) + 36/(-4))? 11 Let a = -7149 + 7907. What is the remainder when 2281 is divided by a? 7 Let r(y) = 241y - 1305. What is the remainder when r(9) is divided by 214? 8 Let p = 96 - 312. What is the remainder when 63 is divided by (p/(-12))/((-6)/(-9))? 9 Suppose -144x - 315 = -153x. What is the remainder when 270 is divided by x? 25 Let i(l) = -2l*3 - 6l*2 + 12l + 14. Let g be i(-4). Let s(j) = 3j2 - 6j - 10. Calculate the remainder when 40 is divided by s(g). 12 Suppose 0 = 3c + 5b - 7 - 100, 2c - 5b - 88 = 0. Calculate the remainder when (-304)/6(4/8 + -2) is divided by c. 37 Let c = -161 - -352. Let d = -144 + c. What is the remainder when 59 is divided by d? 12 Suppose -15p - 1098 = 1197. Let f = p - -164. What is the remainder when 30 is divided by f? 8 Let g = -499 + 985. Calculate the remainder when 75 is divided by 6/(-9)g/(-12). 21 Suppose k + 0k = -2x + 56, 3k = 3x - 66. Let v(w) = 0w - 1 - w - 10w + x. Calculate the remainder when v(-5) is divided by 21. 17 Suppose 48m = 51m - 114. What is the remainder when 105 is divided by m? 29 Suppose -24p + 3p + 6009 = -123. Calculate the remainder when 1155 is divided by p. 279 Calculate the remainder when 980 is divided by 7 + (-225)/(-12) + 1 + 28/(-16). 5 Suppose 5h - 26 = 69. Suppose -115t = -75t + 240. Let v = h + t. Calculate the remainder when 89 is divided by v. 11 Let k(w) = -382w - 3541. What is the remainder when k(-16) is divided by 16? 11 Let s(a) = -19a + 1. Suppose 17 = 3j + 5. Suppose -jd = 2d - 96. Calculate the remainder when s(-4) is divided by d. 13 Suppose 70 - 5 = 13j. Suppose 5i + 40 = 5r - 0i, -i = -jr + 36. Calculate the remainder when r is divided by 2/(-10)4-5. 3 Suppose 230 = 203r - 193r. What is the remainder when 5218 is divided by r? 20 Let l = -13 + 15. Suppose -lo = -6, -1211 = -2x + 9o - 4o. What is the remainder when x is divided by 28? 25 C	{ "pile_set_name": "DM Mathematics" }
+ b. What is the least common multiple of 11 and p? 110 What is the least common multiple of 8 and 488/20(-15)/(-6)? 488 Let z(o) = -o - 4. Let n be z(-7). What is the least common multiple of 4 and -2(-16 + n + 3)? 20 Calculate the common denominator of 89/6 and (97 - 11)1/(-6). 6 Suppose -4z + 67168 = 13940. Let r = z - 212985/16. What is the common denominator of r and -67/4? 16 What is the smallest common multiple of 12 and 2/((-1)/69/(-24))? 96 Let u = -28097/88 - -2535/8. What is the common denominator of -99/20 and u? 220 Find the common denominator of 79/4 and 52/65 - (-6)/4. 20 Let m = 6 - -8. Let y = -33 + m. Let j = -13 - y. Calculate the lowest common multiple of 20 and j. 60 Suppose -42n + 41n = -21. What is the common denominator of -8/9 and n? 9 Let q be 0 + -3 - (-10 - -3). Find the common denominator of 5 - q - 38/(-22) and 26/5. 55 Let r(o) = 1668o*3 - 2o*2 - o. Let g be r(-1). Let w be g/(-53) + 6/3. Let b = w - -1/106. Calculate the common denominator of b and -4/11. 22 Let c be ((-68)/6)/((-8)/12). Let q = c - 6. What is the lowest common multiple of q and 2? 22 Let c = 28 + -17. Calculate the smallest common multiple of c and 11. 11 Let l = -2/11159 - -613781/200862. What is the common denominator of l and (-6)/(-27) - 397/126? 126 Find the common denominator of -97/4 and -5 + 2 + (-48)/28. 28 Suppose -12 = 2f - 6f. Suppose -fd + 18 = 5t, t - 3d - 3 - 15 = 0. What is the lowest common multiple of t and 10? 30 Calculate the common denominator of 28/3 and (602/105)/(4/3). 30 Calculate the common denominator of 2/12 + (-1825)/420 + 0 and -32/9. 252 Suppose -20 = -3b + 4w, -5b - 2w + 0 + 16 = 0. What is the smallest common multiple of b and 4? 4 Let p(s) = s + 8. Let l be p(-5). Calculate the common denominator of -59/2 and (26 - 3)l/60. 20 Let y be 2/5 + (-192)/30. Suppose 2l + 12 = 5l. What is the lowest common multiple of ((-8)/y)/(10/150) and l? 20 Let r be (-14 - 1)(-24)/18. What is the smallest common multiple of 8 and (r/7)/((-18)/(-63))? 40 Suppose -3p = -22 - 62. Suppose -3a + a + p = 0. What is the smallest common multiple of a and 8? 56 Let k be 49919/(-10) - 0. Let i = k + 4495. Calculate the common denominator of i and -55/8. 40 Suppose 3q + 1 = 2v, -q + 4q + 21 = -3v. Calculate the lowest common multiple of 8 and (-35)/(-3) - 1/q. 24 Find the common denominator of -1 + 1 + 20/(-6) and -1 + 8 + (-184)/14. 21 Let z(k) = 7k*3 - 2k*2 + 3k - 2. Let i be z(2). Let j = i - 30. What is the least common multiple of 20 and j? 220 Suppose -5n - 2i = -45, 4n - 29 = -0n - 3i. Let w = n - 7. Let u = 25 - 15. Calculate the lowest common multiple of u and w. 20 Suppose 5l - 36 = -k, l - 6 - 6 = -5k. Let w = 2 - -2. Calculate the least common multiple of w/(-8) + 6/4 and l. 7 Let a be 284(-4 + 3)/(-4). What is the common denominator of 45/22 and a((-2)/(-28))/(-1)? 154 Let d = 18 + -29. Let j = 29 + d. Find the common denominator of 109/20 and 1442/72 - (-4)/j. 20 Let n = 20 - 14. Let j(k) = -9k + 4. Let g be j(-3). Suppose 0 = -3a - 4i + g, 0a - 5i + 30 = 2a. What is the least common multiple of n and a? 30 Let x = -236/67 + 10427/1876. Calculate the common denominator of x and 38/5. 140 Let v(t) = t2 + 2t + 2. Let b be v(-1). Suppose 4y - b = 7. Calculate the lowest common multiple of 2 and y. 2 What is the least common multiple of 18 and 33((-14)/(-3) - 4)? 198 Suppose -6r + 9 = -3. What is the least common multiple of r and 16? 16 Let c = -21 - -31. Let t be 3/(-6) - c/(-4). Find the common denominator of (-4)/t - 32/(-7) and -97/4. 28 Let g = 19/134 - -2671/536. What is the common denominator of -59/9 and g? 72 Let q(u) = 0u*2 - 2u - 2u + 1 + u3 - u + 4u*2. Let y be q(-5). Suppose 3r + y = 13. Calculate the least common multiple of 10 and r. 20 Let g = 3919 - 27514/7. Let v = g + 447/35. Let d = -4074 + 44844/11. Calculate the common denominator of d and v. 55 What is the common denominator of (-106)/96/4 and ((-16)/10)/(3 - (-15)/(-6))? 15 Find the common denominator of (-22/100)/((-2)/(-265)) and -43/11. 110 Suppose j + 0q = -4q - 6, -3q - 57 = -3j. Let b(x) = -x*3 + 7x*2 + 17x + 12. Calculate the least common multiple of j and b(9). 42 Let d = 261433/22 - 11886. Let u = -1738 - -7001/4. Calculate the common denominator of u and d. 44 Let z = -2376 + 4661/2. Find the common denominator of z and 19/33 + (-4)/(-12). 22 Suppose -64 = 31q - 35q. What is the lowest common multiple of q and 20? 80 Suppose 3 = 2z - 5f, -z = -2z + 3f. Let m = 2 + z. Calculate the lowest common multiple of 2 and m. 22 Let i(j) = -j*2 - 6j - 8. Let r be i(-13). Find the common denominator of (-60)/r27/(-6) and 85/(-6) + 6/9. 22 Find the common denominator of -57/8 and 2 - (-12)/(-80)86. 40 Let n = 10761694991/3189690 + 10/318969. Let x = n + -3382. Find the common denominator of x and 11/20. 20 Suppose 0 = -2t + 5t. Let u be ((-1 - -2) + -2)5. What is the common denominator of 2 - (t - 11/u) and -47/5? 5 Suppose -4a + l = -111 - 59, -5a - 2l + 206 = 0. Calculate the smallest common multiple of 8 and a. 168 What is the common denominator of (-79)/(-6) + (6 + -10 - -6) and 109/18? 18 Suppose 4q + 11 = -89. Suppose 3t + 28 = 3m - 4m, -5m = -t - 36. Find the common denominator of q/8 - (-2 + 5) and t. 8 Calculate the common denominator of -91/8 and 470/116 - (-5 + 10). 232 Let w = -3826/37 + 387743/3700. Let j = 51/25 - w. Calculate the common denominator of 33/4 and j. 20 Calculate the common denominator of -87/62 and (296/(-72) + 4)/((-4)/(-186)). 186 Let l(r) = 0r + r + 10r. Calculate the lowest common multiple of 2 and l(1). 22 Let t = 4666 - 32610/7. Find the common denominator of t and 48/5. 35 Suppose 34 = 4h + 2r, h - 4r - 4 + 18 = 0. Calculate the lowest common multiple of 18 and 0 - -129/h. 18 Suppose -3o - 5 = -8o. What is the least common multiple of 16 and o3/28? 48 Let m(l) = -3l*3 - 5l*2 + l + 5. Let c(j) = 2j*3 + 4j*2 - j - 4. Let o(w) = -4c(w) - 3m(w). What is the smallest common multiple of o(0) and 1? 1 Let l be (-4)/6 + (-1640)/6. Find the common denominator of 3/4 + (-70)/6 and (1/2)/(18/l). 36 Let t = 17 - 13. Calculate the lowest common multiple of 4 and t. 4 Let p = -2 + 10. Calculate the lowest common multiple of 20 and p. 40 Let a be 1673/7488 - 4/18. Let v = 6759/832 + a. Let j = 4/123 + 1948/615. Find the common denominator of v and j. 40 Let b = 36 - -14. What is the least common multiple of 10 and b? 50 Let k = 53538/5 + -10658. Let j = k - 1941/35. Calculate the common denominator of 61/9 and j. 63 Let h = 7951/10 - 801. Find the common denominator of h and (-125)/(-22) + 2 - 3. 110 Suppose -4b + 16 = 0, b + 2 = 4t - 10. What is the least common multiple of t and 10? 20 Let m(g) = -g2 - 6g + 5. Let b = -69 + 75. Calculate the least common multiple of m(-5) and b. 30 Let v = -2 + 8. Let l = -3 + v. Calculate the lowest common multiple of l and 11. 33 Let m be 14 - 0(-1 - 0). Suppose -m + 2 = -4t. Suppose 0 = tw - 18 - 9. Calculate the smallest common multiple of w and 5. 45 Let o = -38 - -27. Calculate the common denominator of 3/o68/12 and 49/3. 33 Suppose 2s = -0s + 28. Let b be (-2)/s + (-184)/(-1533). Let i = b + -13787/438. What is the common denominator of -137/6 and i? 6 Suppose -4x + 3q + q = 4, 0 = -5q + 25. Calculate the smallest common multiple of (-25)/(-3) + x/6 and ((-4)/10)/((-5)/75). 18 Calculate the common denominator of (-1)/((-95)/(-79) - 1) and -139/30. 240 Let k = 1129339/98916 + -4/8243. Find the common denominator of 2/15 and k. 60 Find the common denominator of -1/20 and 690/(-48) + -1 + 4 + -1. 40 Suppose 4a + a - 10 = 0. Suppose -ap - p = -66. Calculate the least common multiple of p and 22. 22 Suppose -a + 3a = 4. Let h = -31 - -47. What is the least common multiple of a and h? 16 Let x(n) = n*3 - 6n*2 + 6n + 3. Suppose -3c - 2c + 25 = 0. What is the lowest common multiple of 14 and x(c)? 56 Suppose -d = 4f + 57 - 299, 5f = 25. What is the common denominator of (-6)/(-132)*d/2 and 37/22? 22 Let u be 14/(-35) - 844626/(-140). Let t = 12220 - 6180. Let l = t - u. What is the common denominator of 29/22 and l? 154 What is the lowest common multiple of 6 a	{ "pile_set_name": "DM Mathematics" }
19 a factor of g(-2)? True Let x = -1114 + 1674. Does 35 divide x? True Suppose -4 = -4p, 19262 = 5o - 7p + 9p. Is o a multiple of 21? False Let h = 4 - 1. Suppose 0 = -i - hi + f + 10, -5i = 3f - 21. Suppose -i = -4g + 85. Is g a multiple of 11? True Suppose -544p - 676 = -546p. Is p a multiple of 26? True Suppose -2u + 3575 = 5q, -3576 = -3u + u - 4q. Is u a multiple of 23? False Let z be (1044/60)/(2/10). Suppose 310 = 2h - 5f - z, 2f = 4h - 770. Is 11 a factor of h? False Let s(r) = -5r3 + 6r3 + r2 - 2r3 + 2r*3 + 12. Let q be s(0). Suppose 0 = 5o - 77 + q. Is o a multiple of 13? True Suppose 3g = 6g - 24. Let v(p) = -2p + 3. Let i be v(g). Let u = i + 25. Does 12 divide u? True Is 7 a factor of 72/(-33) + 2 + 695/11? True Suppose 5v = 3v + 6. Suppose -4k + 2t + 15 - 5 = 0, -vk = 2t - 4. Suppose kn - 26 = -2h + 6n, 0 = -2h - 4n + 42. Does 6 divide h? False Let m(h) = -8h - 4. Let z(t) = -8t - 3 + 5 - 5. Let c(s) = -3m(s) + 2z(s). Is c(3) a multiple of 16? False Suppose -2t + 4k - 194 = 0, -3k = -2t - 87 - 109. Let a = 433 + t. Does 12 divide a? False Let m = 57 - 8. Let n = 17 - m. Is 6 a factor of (-27)/(-12)n/(-6)? True Suppose -32j - 158 = -2y - 33j, 4y + 3j - 316 = 0. Is 2 a factor of y? False Let j(r) = -11r + 9. Let y(i) = 12i - 10. Let f(o) = -5j(o) - 4y(o). Does 13 divide f(10)? True Suppose -8a + 3a = 265. Let w = -23 - a. Let d = w + -21. Is 8 a factor of d? False Suppose 0 = 4p - s + 27, 2s = -4p - 24 - 6. Let g(k) = 2k*2 + 4k - 8. Is 9 a factor of g(p)? False Let j be 6/27 - 7526/(-477). Suppose -2 - 2 = -v, -2z + 2v + 96 = 0. Let m = z - j. Does 9 divide m? True Let j = -5 - 0. Let k(l) = 49l - 62. Let y be k(1). Let t = j - y. Does 4 divide t? True Suppose 18 = 243n - 234n. Suppose 2f = -f + 3. Is 32 - 1/(f/n) a multiple of 6? True Does 19 divide 68/(-120) - 109068/(-20)? True Suppose o - 2m - 2m + 2 = 0, -4 = -4m. Suppose 3d = -od + 940. Suppose -4b = -2b - d. Does 14 divide b? False Suppose -52n + 128484 = 34n. Is 18 a factor of n? True Suppose 4r = 2q - 28, 5r + 5 = -5q - 0r. Suppose -3h = -qh - 3. Does 18 divide 14(8 + h) - 0? False Let c(x) = 24x3 - x2 - 16x - 21. Let b(j) = -5j3 + 3j + 4. Let h(r) = 11b(r) + 2c(r). Is h(-1) a multiple of 6? True Does 15 divide (1 + 4 - 8) + 74 + -1? False Let n(s) = 145s3 - 2s*2 + 1. Is 2 a factor of n(1)? True Let y be (6/10)/(5/50). Suppose 10 = m + y. Suppose -5x + 103 = mz, z - 31 = -2x - x. Is 12 a factor of z? False Is (24/20)/((-27)/30)-249 a multiple of 46? False Let b be ((-6)/18)/(2/(-12)). Suppose bw - 2x - 6 = 0, -2w + 5w + 5x = 9. Suppose -4 = wu - 4u. Does 4 divide u? True Suppose 0 = -4v - 4a + 6a + 52, -3a = 3v - 30. Is v a multiple of 2? True Suppose -2d = -6d + 32. Let n(y) = 7y*2 - 156 + 158 + 2y2 - y3 - 5y. Is n(d) a multiple of 14? False Suppose 0 = s - 1. Let a be s/(-3)(-45)/(-3). Let w(d) = -8d - 7. Does 6 divide w(a)? False Is 4 - 0 - (-10)/(70/3549) a multiple of 36? False Let g = 21 + 18. Suppose -5t + 239 = g. Is t a multiple of 20? True Suppose -87 = 3t + 147. Let j = t - -162. Does 7 divide j? True Does 11 divide 28/16 + ((-3051)/(-12) - -6)? False Let o = -44 - -46. Let u(h) = 14h3 - h2 - 4h + 2. Does 19 divide u(o)? False Does 4 divide (45 - -738)/(10/(-8) + 2)? True Suppose -66 = 9l - 20l. Is 6 a factor of l? True Let b = -7860 + 11804. Is 116 a factor of b? True Let v(w) = 37w*2 + 22w - 15. Is v(5) a multiple of 4? True Suppose 0 = 5n - 30 - 590. Let s = n - 68. Does 8 divide s? True Let n be 8/40 + 189/5. Suppose -s - n = -122. Is s a multiple of 14? True Suppose -7b + 826 = 2443. Let n = 331 + b. Is 14 a factor of n? False Is ((-117)/(-52))/(1/56) a multiple of 14? True Let v be 288/15 + (-4)/20. Suppose -5m + 97 = 4h - h, v = m + h. Does 10 divide m? True Let l(s) = s*3 + 14s*2 + s + 3. Let v be l(-14). Let p = v - -29. Is p a multiple of 9? True Suppose -22 = 12g - 10g. Let t = g + 16. Suppose -2f = tq - 19, -4f = f + 5q - 85. Is 4 a factor of f? False Let v = -80 + 82. Suppose 0 = vm - 69 - 101. Is m a multiple of 36? False Let a be (-15)/652/(-10). Let m(k) be the third derivative of -k6/120 + 13k5/60 + k4/24 - 4k3/3 + k2. Is m(a) a multiple of 5? True Let c(n) = n3 + 11n*2 + 18n + 3. Let z be c(-9). Let u(b) = 32b - 12. Does 28 divide u(z)? True Let l be 0 - 1 - (-2 + 0). Suppose -73 = -g + s, -2s - 5 = -l. Does 16 divide g? False Suppose -c + i - 15 = 0, -3c + i + 105 = -8c. Does 3 divide (12/(-20))/(4/c)? True Let q = 2790 + -1726. Is 50 a factor of q? False Let u = 382 + -338. Is 11 a factor of u? True Let u(j) = -3j - 8. Let q be u(-4). Let y be 3(q/3 - 1). Is (2 + (76 - -3))y a multiple of 15? False Let a = 12 - -2. Does 6 divide (-6)/42 - (-296)/a? False Is 26 a factor of 4604(8 - (-248)/(-32))? False Let r(s) = s + 2. Let y be r(-4). Let d be y/26/(-3). Suppose dc = 144 - 0. Is c a multiple of 24? True Let g = 194 - 174. Is 7 a factor of g? False Let z(n) = 2n2 - 4n + 4. Suppose -3i + 4v = 2i - 6, 3i + 3v = 9. Let l be z(i). Suppose -j - 5q = -22 - 50, lq + 36 = j. Is 13 a factor of j? True Let r = 8 - 12. Let k = r - -4. Suppose k = -q + 16 + 44. Is 20 a factor of q? True Suppose 397u - 403u = -894. Is 15 a factor of u? False Suppose 0 = 4a + 938 - 2410. Is a a multiple of 16? True Let m(r) = -r + 9. Let d be m(9). Suppose d = g - 5c - 23, -4g + c + 0c = -111. Does 17 divide g? False Let c(t) = -61t*3 - 17t*2 + 3t + 13. Let v(j) = 15j3 + 4j*2 - j - 3. Let d(u) = 2c(u) + 9v(u). Is 12 a factor of d(2)? False Let h be 2/((-45)/(-23) - 2). Suppose -13k = -5k - 608. Let x = h + k. Does 6 divide x? True Suppose -101 = 7u - 731. Does 15 divide u? True Suppose -2y = 0, 2m - 2y - 78 = -0m. Let r be 1 + 13/(m/360). Suppose 3a = o - 35, 4o - r = -o - 3a. Is o a multiple of 26? True Let w = -817 - -1666. Does 35 divide w? False Let n(j) = 32j + 8. Let t be n(6). Let w = 4 + -1. Suppose t = c + wc. Is 10 a factor of c? True Suppose -3050 = -4z - z. Let s = -420 + z. Is 38 a factor of s? True Let q = -904 - -1665. Suppose 0 = 4b - q + 173. Is b a multiple of 18? False Suppose 0p = -5p. Suppose 0 = 5r - k - 23, -3r - 5k + 1 - 4 = p. Is r a multiple of 4? True Suppose -15p = -17585 + 2345. Is p a multiple of 8? True Suppose 2u + f - 4424 = 0, 3f + 11060 = 5u - 0u. Is u a multiple of 49? False Let c(z) = -9 + z - 20 - z - 9z. Does 34 divide c(-7)? True Let u = -319 - -361. Does 21 divide u? True Suppose 0 = -3x + 4t + 6, -6x + 2x = 2t - 8. Let p = 7 + x. Let l = 37 - p. Is 28 a factor of l? True Suppose 3s + 0v + 2v + 160 = 0, 0 = -3v + 3. Let l be 312/(-8)(-2 + 16/6). Let b = l - s. Does 14 divide b? True Let k = 17 + -17. Suppose 4g - 19 - 37 = k. Does 2 divide 0 + 0 + (g - 12)? True Let m = 1127 - 1829. Let c be (-2)/5 - m/(-45). Let y = c + 27. Is 11 a factor of y? True Suppose -4x - s + 225 = -6s, 0 = 4x + 3s - 217. Suppose 0 = -n + l + 92, 3l - 37 = -n + x. Let a = -27 + n. Is a a multiple of 19? False Let p(r) be the first derivative of -12r2 - 3r + 2. Does 11 divide p(-2)? False Suppose 5n = 3n + 14. Is 356/28 - (-2)/n a multiple of 3? False Is (-250)/(-150) - (13240/(-3))/4 a multiple of 85? True Is 17 a factor of (-1605)/10-12? False Let q(h) = h + 1. Let z(d) = 11d + 42. Let r(l) = -4q(l) + z(l). Is 16 a factor of r(6)? True Suppose 278 = 11k - 9k. Is 15 a factor of k? False Suppose f = -5g + 639, -2g - 2f + 176 = -86. Suppose -51 = -3l + 108. Suppose 5y - g - l = 0. Does 12 divide y? True Let w = 1139 + -810. Suppose -w = -4g - 81. Does 8 divide g? False Suppose 8 = 3z + z. Suppose -zi = -3k - 83, 0 = 2i - i + k - 34. Is i a multiple of 37? True Let k be (-1 - (1 - 2)) + 47. Suppose u + 3j = k - 14, -u + 2j + 28 = 0. Does 6 divide u? True Let t be 8/(3 - 33/12). Let n be (-26)/(-8) + (-8)/t. Is 1(3 - n) + 42 a multiple of 21? True Suppose 0 = 11u + 80 + 30. Does 20 divide (1 - 2194/u) + (-16)/40? True Let x be 8/(-3)(1 - 655/10). Suppose -x - 143 = -3g. Is 15 a factor of g? True Let f = -175 + 239. Is 32 a factor of f? True Suppose -2*h + h + 4 = 0.	{ "pile_set_name": "DM Mathematics" }
o - 5j, 4o = -3j - 12. Suppose o = -0l - l + 4. Solve -lu - u = v for u. -2 Let l be (-14)/(-6 - -4)3/(-1). Let h be (-175)/(-49) + 12/l. Solve 10 = -hd + d for d. -5 Suppose -6x - 405 = 195. Let o = x + 104. Solve oi = i + 6 for i. 2 Let l = 561 - 508. Solve 0 = -5t - 43 + l for t. 2 Suppose 4m + 4r = 6r + 4, -6 = 2m - 3r. Suppose mz + 3z = 30. Solve -zb + 1 = 16 for b. -3 Let f = 1 - -1. Suppose fz - 6 = -86. Let j = -30 - z. Solve 0 = 3y - 8y - j for y. -2 Let b be (-94)/(-10) + (-244)/610. Solve 8f - b = 15 for f. 3 Suppose 0 = 5n - 7n + 10. Suppose nh - 1 = -z, 0 = 2z - 2h + 4 - 6. Solve -5v + 4 = -z for v. 1 Let y(b) be the second derivative of b3/2 - 3b*2 - 2b. Let g be y(8). Let r = -16 + g. Solve -rw = -w + 3 for w. -3 Let g = 34 + -14. Suppose -11 = -5z - 1. Suppose -1 = -zq - 3c, 2c = q + 6c + 7. Solve -j = -qj + g for j. 5 Suppose 8 = 4j - 8. Let n be 1/(-11) + (-552)/(-264). Solve jp + n = 6 for p. 1 Let i = -1 - -2. Suppose 2 + 8 = 10c. Solve c = -m - i for m. -2 Suppose -134 = 3m - m. Let d = -65 - m. Solve -ds + 13 - 5 = 0 for s. 4 Let l be (9/(-4))/((-38)/16 + 2). Let s be -2 + (l - (1 + (3 - 5))). Solve s = 2r + 1 for r. 2 Let f(a) = -19a - 206. Let h be f(-11). Solve 2q - hq - 2 = 0 for q. -2 Suppose 4d + 22 = t + 108, -3t + 3d - 222 = 0. Let g = -50 - t. Solve 0y - 4y + g = 0 for y. 5 Let w(a) = -a3 + 13a*2 + 32. Let f be w(13). Let j = f - 25. Solve -3v = -jv - 12 for v. -3 Let d be -3(-3)/((-9)/(-19)). Solve da = 4a for a. 0 Suppose -130c = -128c - 8. Solve -cw = -7w - 9 for w. -3 Let b(t) = t*3 + 4t*2 + 1 + 6t + 3t3 - 5t*3. Let y be ((-5)/3)/(4/(-12)). Let v be b(y). Solve -2 + v = -c for c. -4 Let k be 0 + 0 - (2 - 5 - 1). Solve kh = -0h - 16 for h. -4 Let b = -45 + 52. Suppose bt = 24 + 4. Solve 2x = t + 2 for x. 3 Suppose 4 = -4s - 4c, 5s + 2c - 3 + 5 = 0. Let i(h) = h2 - h + 10. Let q be i(s). Solve 2u - 7u = -q for u. 2 Let k(p) = -p2 + 16p - 27. Let q be k(16). Let b be 2/3q/(-6). Solve -2z + b = z for z. 1 Suppose -4n = -2n - 2l, -16 = n - 5l. Let y be 3 - ((-13)/4)/(1/n). Solve -y = -k - 3k for k. 4 Let o(g) = -g3 + 6g*2 + 7g + 3. Let m = 38 - 31. Let b be o(m). Suppose 0 = bc + c. Solve c = t - 0t for t. 0 Let f be 40/(-5 + 14/2). Solve -fs = -19s - 3 for s. 3 Let z be (-136)/748 + -2(-2)/22. Solve 0j - j + 4 = z for j. 4 Let g(p) = -7p - 13. Let s be g(-3). Suppose -187m + s = -185m. Solve 5 = -mk + 3k for k. -5 Let s(d) = d2 + 3d - 16. Let t be s(-6). Solve 0 = 3n - n - t for n. 1 Let c(a) = -6a - 40. Let x be c(-7). Solve 0d - xd - 6 = 0 for d. -3 Suppose -p - 10 = 5r, 15 = 4r - 9r. Let l be 24/20p/2. Solve -lx + 5x + 10 = 0 for x. -5 Suppose -7 = -4p + 13. Suppose -3l + 5n = 5, l = -2n + 1 + 1. Solve pw + l - 5 = 0 for w. 1 Let i be ((-1)/2)/(73/(-798)). Solve -19 - 38 = iq for q. -3 Let m be 6/(-9) - 11/(-3). Suppose b = mo + 14, -b + 5 = -2o - 6. Suppose 2l - 7l + 20 = 0. Solve -15 = -lv + b for v. 5 Suppose z + q = 3 + 5, -3z - 4q = -24. Solve zb - 6b = 8 for b. 4 Suppose -39k + 12k + 81 = 0. Suppose 5c = h + 4h + 20, 0 = 2h + 4. Suppose 0v = -ct - 2v + 10, kt - 3v + 3 = 0. Solve tq + q = 0 for q. 0 Let v = 66 + -56. Let o be ((-45)/(-25))/(6/v). Solve -oc = c - 8 for c. 2 Let y be 680/(-85) - -46. Solve -7o + y = 23 for o. -1 Let b = -73 + 82. Let w be (21/(-12))/(b/(-72)). Solve 11 = 5o - w for o. 5 Suppose 3t - 5q - 20 = 0, q - 1 + 5 = -5t. Suppose tg = 2g - 12. Solve r = gr for r. 0 Let x be (3 - 5)(1 + 15/(-5)). Solve -4v + 24 = x for v. 5 Let x be (5 - -8) + (3 - 2) + -1. Solve 0 = -4r - 9 + x for r. 1 Suppose 60 = -35x + 50x. Solve 0 = -xz + 4 - 8 for z. -1 Let c(m) = -m2 - 6m + 1. Let r be c(-6). Let q = r - -5. Suppose h = 2h - 5g + q, h = 2g. Solve -3s + hs = 1 for s. 1 Let o(u) = u3 - u2 + 5u + 4. Let q(s) = 5s3 - 3s*2 + 20s + 15. Let w(l) = 9o(l) - 2q(l). Let k be w(-4). Solve kz = -3z for z. 0 Let b(s) = -s*3 + 10s*2 - 8s - 4. Let j be b(9). Suppose x + 20 = jx. Suppose 2g + 4v = -2g - 12, -xg - 4v = 12. Solve 0 = -f - gf for f. 0 Let k be 0(9/36)/(-1 + 2). Solve -4o + o = k for o. 0 Let c = 44 - 31. Solve -4v + c = 9 for v. 1 Let u be ((-28)/(-6))/(6 - (-35)/(-6)). Solve 3p + u = 16 for p. -4 Let l(y) = y3 - 6y*2 + 5y + 4. Let m be l(5). Suppose 0 = -26c + 7c. Solve c = -b - b - m for b. -2 Let z = 35 - 33. Let a(h) be the first derivative of -h*4/4 + 5h*3/3 + 3h*2 + 6h - 1. Let j be a(6). Solve r - j = -zr for r. 2 Let y(n) = 33n + 350. Let v be y(-10). Solve -v = 7b - 3b for b. -5 Suppose q - 5 + 3 = 0. Suppose q = 5b - 8. Let v = 107 + -107. Solve vn + 6 = -bn for n. -3 Let m(z) = 2z + 20. Let g be m(-15). Let y be (-42)/35g/3. Suppose -yc + 6 = -2. Solve -cq - 12 = -5q for q. 4 Let t(s) = s*2 - 2s - 3. Let h be t(-2). Suppose 7k = 2k - h, 5 = -5g - 5k. Suppose g = -2d - 2d + 12. Solve 15 = di + 3 for i. 4 Suppose -60 = -3s - s. Let o = 17 - s. Suppose 0 = -3j + 3g + 9, -2j - og - 1 = -3. Solve -jv + 0 = 8 for v. -4 Let z = 35 + -15. Suppose -z + 5 = -3w. Solve -wj = -j for j. 0 Let g(k) = k - 22. Let v be g(18). Let o be 1/v01. Suppose o = 27w - 30w. Solve -m = -wm - 2 for m. 2 Suppose 0 = -4m + 14 - 10, 3m = -4p + 191. Solve -pc - 12 = -50c for c. 4 Suppose 0 = 5i + 3j - 21, -5i - 2j - 3j = -15. Suppose 0 = z + 2 - i. Solve zm + 6 = -14 for m. -5 Let r(c) = c3 + c. Let o = -29 - -29. Let n be r(o). Solve n = -4y + 3 - 11 for y. -2 Suppose a + 0a - 37 = -3m, 3a = -5m + 59. Suppose -14k + 9 = -mk. Solve 0 = 4g - g + k for g. -3 Suppose -9d + 13d - 24 = 0. Let g = d - 23. Let s = -12 - g. Solve -18 - 7 = sw for w. -5 Let p be (5 - 2) + 0 + 4. Suppose pl = 4l + 24. Solve -2 = 5d + l for d. -2 Suppose 0 = 4y - 9 - 15. Suppose -2m + i - 17 = -ym, -m - i + 8 = 0. Solve 2c = mc for c. 0 Let m(l) = 2l3 - l2 - l. Let n be m(2). Let a = -2 - n. Let y be (-3)/(4 - (-57)/a). Solve -o = 3o + y for o. -1 Let b(v) = 4v2 + 3v. Let x be b(2). Let n be (-9)/(-18)(-2 - -6). Solve -4g - x = -n for g. -5 Suppose -17 = -2u + 5. Let r(x) = -x + 14. Let v be r(u). Suppose vg = 10 - 1. Solve 0 = 2n + g - 1 for n. -1 Let i be (-11)/(-3) + -3 - 16/(-12). Let o be ((-8)/12)/(2/(-36)). Solve -5y = -o + i for y. 2 Let j(i) be the first derivative of -i*2 - 22i + 12. Let t be j(-11). Solve t - 5 = -d for d. 5 Let v(n) = -n*2 + 11n - 15. Let t be v(6). Suppose -5d - 5w - 25 = -2d, -5d - t = 3w. Solve -5b + 4b = d for b. 0 Suppose -25 = -11a + 6a. Let t = -1 - -9. Solve -t = aw + 2 for w. -2 Suppose -25 = -4p + m + 2m, 4p = 4m + 24. Solve -pf - 4f = 0 for f. 0 Let z = 254 - 243. Solve -zs = -14s + 12 for s. 4 Let f(k) = -2k + 34. Let l be -2 + 57/(3 - 0). Let c be f(l). Let s be (-2)/(-2) - (-3)/1. Solve cn - s = -4n for n. 1 Let l(i) = i3 - 2i*2 - i - 1. Let y be l(3). Suppose -3x + p = -17, -5 = -yp - 0. Let w = 338 - 336. Solve -4j = -w + x for j. -1 Let h be 1 + -2(-1)/2. Let x = -604 + 605. Suppose d = x, 3s - 98 = -hs + 2d. Solve 3j + s = -j for j. -5 Let d = -16 + 19. Suppose -dw = -5u - 12, 4w + 0u - 2u - 16 = 0. Solve 4 = wi - 0 for i. 1 Let i be (7 + (-6)/(72/78))0. Solve i = -4s + 21 - 17 for s. 1 Let r(z) = -11z*3 + 13z*2 + 31z + 21. Let q(p) = 5p3 - 7p*2 - 15p - 11. Let d(m) = -9q(m) - 4r(m). Let k be d(12). Solve -2h = 7 - k for h. -2 Let r = 34 + -24. Let a = 9 + -16. Let o be (-11)/22 - a/2. Solve oc + r = -2c for c. -2 Let o = -308 + 191. Let v = o + 125. Solve 6g = 2g + v for g. 2 Let x be (2/(-4) + 1)-18. Suppose 0 = -i + 3i - 24. Let j = x + i. Solve -o - jo - 20 = 0 for o. -5 Suppose 2a - 6 = 4a. Let p be 6((-1)/a - (-2 + 2)). Solve -5r = -4r + p for r. -2 Let l(t) = t2 + 5t + 1. Let n be l(-4). Let c be (4 - 3) + -4 - n. Solve q + 0 - 4 = c for q. 4 Suppose 5d - 22 = 3. Suppose -16 - 4 = -dm. Let w(o) = o*2 - 20o + 66. Let p be w(16). Solve pj = j - m for j. -4 Let t be 96/10 - (-8)/20. Let m = 54 + -45. Solve -tw = -7w + m for w. -3 Let g(k) = -k2 - 13k + 8. Let c be g(-14). Let y = c - -9. Solve -y*x = -x for x	{ "pile_set_name": "DM Mathematics" }
-2s4/11 + 1184s*3/11 - 166908s*2/11 + 1562976s/11 - 1397250/11 = 0? 1, 9, 207, 375 Find z such that -134925z5 + 1898095z*4 + 4189560z*3 - 292500z*2 + 320z = 0. -2, 0, 2/1799, 1/15, 16 Let -2c2 + 64300c - 2504658 = 0. What is c? 39, 32111 Let -2l4 - 1472l*3 - 43510l*2 + 140864l - 95880 = 0. Calculate l. -705, -34, 1, 2 Factor 33u2/7 + 3407961u/7 + 265554. 3(u + 103271)(11u + 6)/7 Find n such that -5n*5 - 237575n*4 - 2823162935n*3 - 25394926225n*2 - 67709351680n - 56420500900 = 0. -23753, -5, -2 Find q such that -2q5/9 + 40046q*4/9 - 200560310q*3/9 + 1001160074q*2/9 + 3208965472q/9 - 16028812960/9 = 0. -4, 4, 5, 10009 Let 3w3 - 91707w*2 + 735456312w - 522272268720 = 0. What is w? 785, 14892 Factor 2u3/5 + 4704592u*2/5 - 28227606u/5 + 42341436/5. 2(u - 3)2(u + 2352302)/5 Let -2h3 + 1334818h*2 - 222942133120h + 74979981461504 = 0. Calculate h. 337, 333536 Factor l*2/2 - 30350920l + 460589172423200. (l - 30350920)*2/2 What is q in 1012479q*2/2 + 1012547q + 136 = 0? -2, -136/1012479 Find q, given that q*3/4 - 40875q*2/2 + 418201875q - 20859031250 = 0. 50, 40850 Suppose -8l2 + 308l + 52480 = 0. What is l? -64, 205/2 Let g*2/4 - 80g - 2289/4 = 0. What is g? -7, 327 Factor -5u2 - 78996105u + 157992230. -5(u - 2)(u + 15799223) Let p*4/5 - 11339p*3 + 56694p*2/5 = 0. What is p? 0, 1, 56694 Let -4u*3 + 36376216u*2 - 72752420u + 36376208 = 0. What is u? 1, 9094052 Factor p*4/3 + 26306p*3/3 + 170421500p*2/3 - 34059125000p/3. p(p - 194)(p + 13250)*2/3 Factor 2j*2/3 - 1156136j/3 - 1156138/3. 2(j - 578069)(j + 1)/3 Let -21b2/5 + 34518096b/5 - 6903615 = 0. Calculate b. 1, 11506025/7 Find x such that -x*3 - 17067052x*2 - 72821065992676x = 0. -8533526, 0 Factor -363f3 + 1498992f*2 - 1535443200f - 24952320000. -3(f + 16)(11f - 22800)2 Find a, given that -a2/8 + 9167675a/4 - 84046264905625/8 = 0. 9167675 Suppose -2j4/5 + 1014j*3/5 - 17316j*2/5 - 140832j/5 = 0. What is j? -6, 0, 24, 489 Factor y*2/2 + 681669y + 464672625561/2. (y + 681669)*2/2 Factor -25g*2 - 3416615g - 46461340. -5(g + 136651)(5g + 68) Solve 2t*4 - 450t*3 - 15086t*2 - 54414t - 39780 = 0 for t. -26, -3, -1, 255 Factor -2s2/15 + 250s/3 + 158004/5. -2(s - 891)(s + 266)/15 Suppose -120g5/7 - 3946g*4/7 - 3662g*3 + 113292g*2/7 - 71928g/7 - 11664/7 = 0. What is g? -18, -2/15, 1, 9/4 Factor 128u2/9 - 2098400u/9 + 8600161250/9. 2(8u - 65575)*2/9 Factor 2t*2/9 + 591694t/9 - 6508876/9. 2(t - 11)(t + 295858)/9 Factor 2z2 + 312922z + 625836. 2(z + 2)(z + 156459) Factor -3b2 - 25953576b - 56132342265648. -3(b + 4325596)2 Determine i, given that -3i*2/5 - 15369i - 18620100 = 0. -24340, -1275 Determine d so that 16d4 - 14819d*3 + 32106d*2 + 216261d - 41580 = 0. -3, 3/16, 5, 924 Factor -14w3/9 + 2299984w*2/9 - 94463628568w/9 + 53978465312/9. -2(w - 82142)2(7w - 4)/9 Let -4o*4 - 3979536o*3 + 39795760o*2 = 0. Calculate o. -994894, 0, 10 Determine l, given that -2l*2 - 48702l - 1702120 = 0. -24316, -35 Find t, given that 3t5 + 1416t*4 + 100092t*3 + 2393424t*2 + 14135040t - 101606400 = 0. -392, -30, -24, 4 What is b in 2b2/3 + 28263164b/3 + 99850804911362/3 = 0? -7065791 Suppose -4t5 - 195276t*4 - 58419260t*3 - 174086164t*2 - 173695632t - 57833456 = 0. Calculate t. -48518, -298, -1 Factor 2r3 - 926482r*2 + 6485300r - 11117616. 2(r - 463234)(r - 4)(r - 3) Factor -2u*2/3 + 297088u/3 - 297086/3. -2(u - 148543)(u - 1)/3 Solve -5y5 + 98620y*4 + 98625y*3 = 0 for y. -1, 0, 19725 Determine y so that -7y*5 - 5y*4 + 2802y*3 + 17708y*2 - 53336y + 13728 = 0. -13, -12, 2/7, 2, 22 Determine p, given that -4p3/7 - 154780p*2/7 - 213889376p + 213911488 = 0. -19348, 1 What is y in 5y5 - 270y*4 - 1467900y*3 - 282123250y*2 - 280655625y = 0? -295, -1, 0, 645 Determine h so that 25h5 + 8690h*4 + 548270h*3 + 2723200h*2 - 4681935h + 1401750 = 0. -267, -75, -7, 2/5, 1 Determine k, given that 4k5 - 1224k*4 + 122672k*3 - 5023000k*2 + 70841100k + 75988000 = 0. -1, 40, 55, 157 Solve -2y3/5 - 2716y*2/5 - 138570y - 679320 = 0 for y. -1020, -333, -5 Determine m so that -5m4 + 3900m*3 - 347565m*2 - 742130m + 2843400 = 0. -4, 2, 105, 677 Determine r so that -r*2/6 + 37388513r/3 - 1397900904351169/6 = 0. 37388513 Factor -2w3/19 - 4424212w*2/19 - 2446702053400w/19 + 4893421803664/19. -2(w - 2)(w + 1106054)*2/19 Determine v, given that -4v*3 - 23449440v*2 - 34367288219028v - 68734482640328 = 0. -2931179, -2 Let 2d2/3 - 556221424d/3 + 38672784064573472/3 = 0. What is d? 139055356 Let -4608n5 + 118182n*4/7 - 132278n*3/7 + 53390n*2/7 - 7018n/7 - 20/7 = 0. Calculate n. -5/1792, 1/3, 1, 2 Suppose -r*3/2 - 395r*2/2 + 4341r - 11232 = 0. What is r? -416, 3, 18 Let s*2/4 - 1755s/2 + 2430389/4 = 0. What is s? 949, 2561 Let -s*4/2 - 142171s*3 - 10106580958s*2 - 40424475629s - 60636073683/2 = 0. What is s? -142169, -3, -1 Determine q, given that 2q4/3 - 97468q*3/3 - 53966624q2 = 0. -1608, 0, 50342 Determine u so that -u4 + 1920398u3 - 921976358389u*2 - 5531910001188u - 8297890927236 = 0. -3, 960202 Suppose -4k2 - 146246320k + 584985344 = 0. Calculate k. -36561584, 4 Factor 45k3 + 15815k*2 + 38430k + 13960. 5(k + 2)(k + 349)(9k + 4) Suppose -25g4 - 1252770g*3 - 3507545g*2 + 751620g = 0. What is g? -50108, -3, 0, 1/5 Factor m*2/2 + 1963m/2 - 40060. (m - 40)(m + 2003)/2 Factor -28i*2 - 393356i - 168576. -4(i + 14048)(7i + 3) Suppose r5/7 + 7530r*4/7 - 196796r*3 + 78666360r*2/7 - 210783872r + 1246922880 = 0. Calculate r. -7710, 14, 76 Suppose -3h3/2 - 9201h*2/2 + 1652607h - 41237100 = 0. What is h? -3394, 27, 300 Determine w so that -w*5/3 + 2230w*4 + 499243w*3/3 + 8748664w*2/3 - 6340604w + 9767216/3 = 0. -38, 1, 6764 Let -5q3 + 6765q*2 - 959560q = 0. What is q? 0, 161, 1192 Let -36h5 + 1134h*4 - 530h*3 - 130478h*2 - 64490h + 36000 = 0. Calculate h. -9, -5/6, 1/3, 16, 25 Suppose -84k4/5 - 1120636k*3/5 + 18056184k*2/5 - 33125136k/5 + 2991968/5 = 0. Calculate k. -13357, 2/21, 2, 14 Find y, given that -4y3 + 603716y*2 + 603728y - 1207440 = 0. -2, 1, 150930 Factor -3s4/5 - 13934511s*3/5 - 21574510756569s*2/5 - 11134453979889964917s/5. -3s(s + 1548279)*3/5 Find h such that -2h*2/3 + 3880672h/3 - 3880666 = 0. 3, 1940333 Solve 2x5 - 8292x*4 - 9472832x*3 - 3252253172x*2 - 362252536002x + 365514270296 = 0. -329, 1, 5132 Factor -w*2/6 - 14790497w/3. -w(w + 29580994)/6 What is a in 4a*3 + 810392a*2 + 810380a - 1620776 = 0? -202597, -2, 1 Factor 2s2/11 + 9793444s/11 + 11988943172642/11. 2(s + 2448361)2/11 Factor 3c*4/5 - 1953c*3/5 - 338328c*2/5 + 56516016c. 3c(c - 508)*2(c + 365)/5 Find q such that q*3/5 - 9898q*2/5 + 79127q/5 - 13846 = 0. 1, 7, 9890 Factor 4r2 + 12839544r. 4r(r + 3209886) Suppose 35c5 + 9895c*4 + 74615c*3 + 100105c*2 - 74650c - 110000 = 0. What is c? -275, -40/7, -2, -1, 1 What is z in -z*2 + 12199z + 1118390 = 0? -91, 12290 Suppose -3v3 + 50145v*2 - 32021241v + 5214077211 = 0. Calculate v. 329, 16057 Solve -4m5 - 1460m*4 - 140064m*3 - 1761712m*2 + 2189248m + 3812352 = 0 for m. -204, -146, -16, -1, 2 Determine d so that -5d5 - 660d*4 - 7845d*3 + 164750d*2 - 208080d - 1127520 = 0. -116, -27, -2, 4, 9 Solve -795y4/4 + 3139857y*3/4 + 10980225y*2/4 + 4779087y/4 + 177885/2 = 0 for y. -3, -2/5, -5/53, 3953 Factor -4j2/5 - 173872j/5 + 36192996. -4(j - 1017)(j + 44485)/5 Factor 5b3 + 17195b*2 + 14791995b + 14774805. 5(b + 1)(b + 1719)2 Let -t2 + 579928t - 1739775 = 0. What is t? 3, 579925 Determine g, given that -g3/4 + 15881g*2/4 - 285615g/4 + 1284903/4 = 0. 9, 15863 Solve -6216338h5/9 - 161681204h*4/9 - 144442718h*3/9 + 309516004h*2/9 + 2817856h/9 + 6400/9 = 0. -25, -2, -8/1763, 1 Suppose 16h2/7 + 67446h/7 - 25308 = 0. Calculate h. -4218, 21/8 Factor 29c3 - 4614c*2 + 182887c - 18870. (c - 85)(c - 74)(29c - 3) Solve -16c*5/5 + 8444c**4	{ "pile_set_name": "DM Mathematics" }
be (-2156)/(-21)(-6)/4. Let h be 1/(-4) + n/(-8). Suppose -l + 40 = 2f, f = -l + 57 - h. Does 18 divide l? True Suppose -i - 27 = 4i + 2z, 5z = i. Is 16 a factor of i/(-10) + (-174)/(-4)? False Let k(h) = h3 + 11h*2 + 11h - 5. Is 39 a factor of k(-6)? False Suppose 0 = -0h - 5h + 30. Let t be 2/(-3) - (-16)/h. Suppose -4j - 4i = -116, -3i = ti + 5. Is j a multiple of 10? True Suppose 2f = 4 - 0. Let v be (-6)/(-1 + 0) - f. Suppose -s - v = -18. Is s a multiple of 14? True Suppose 5u - 283 = 2j, -5j + 176 = 4u - 24. Is 22 a factor of u? False Suppose -4v = -324 + 108. Is v a multiple of 17? False Suppose -4n + 0t + 2t = 12, -14 = 3n + t. Let z = 2 + n. Is 3 a factor of (z - 0)-31? True Let c = 1 + 3. Let t be 23/(-3)(c + -1). Let l = 0 - t. Does 15 divide l? False Let j be -20(-2 + (-9)/(-6)). Does 8 divide (1 - 16)(-6)/j? False Let y(w) = -w2 - 13w + 24. Is y(-14) a multiple of 10? True Let s(b) = b3 + b2 - b + 4. Let f be s(0). Suppose 0 = -0k + 4k. Suppose fl - 114 - 2 = k. Is l a multiple of 10? False Suppose -7j = -3j. Suppose -2z + jz - 5k = -513, 5z - 4k = 1200. Is 9 a factor of 4/14 - z/(-28)? True Let d(g) = 2g3 - 3g*2 + g - 2. Let q be d(2). Suppose -93 = -4o - qw - 13, -2w = -4o + 80. Let a = o + 4. Is a a multiple of 12? True Let i = -25 + 49. Let w(d) = 3d*2 + d - 4. Let m be w(3). Suppose 0 = 2j - m - i. Is 15 a factor of j? False Suppose 100 = 3z - 98. Is z a multiple of 21? False Let i(t) = -t3 - t2 - 3. Let s be i(-3). Suppose -3r + 0r = 3n - s, 11 = 3r + 4n. Does 3 divide r? True Suppose -3f = f + 5d - 57, 0 = d - 1. Is ((-2)/(-6))/(f/1482) a multiple of 19? True Let b be (-880)/(-12) + (-2)/(-3). Let a = b + -52. Does 6 divide a? False Let o = 96 - 51. Is 16 a factor of o? False Let f(d) = 8d3 + 2d*2 - 2d + 3. Is 36 a factor of f(2)? False Suppose -k - 12 = -2z + z, 0 = -4k + z - 33. Let l = k + 1. Let o = 6 - l. Does 12 divide o? True Suppose 3j + 4h - 61 = 0, h + 4 = j - 21. Is 14 a factor of j? False Let f(b) = b*2 + 8b + 10. Suppose 6n = 2n. Suppose n = 4q + 20, -4q = 2x - 0x + 36. Is 5 a factor of f(x)? True Suppose 4z - 148 = -4j, z - 38 + 5 = j. Does 35 divide z? True Let x(z) = 7z + 127. Is x(0) a multiple of 42? False Let x = -136 + 196. Is 10 a factor of x? True Let u be (-78)/(-18) + 2/3. Suppose 9 = uw - 11. Is 2 a factor of w? True Let i(z) = 4z + 16. Does 10 divide i(11)? True Let o = -4 + 80. Is o a multiple of 17? False Suppose -2n - 15 = n. Does 21 divide ((-21)/n)/((-3)/(-15))? True Let a = 53 + 13. Is a a multiple of 16? False Let z(u) be the third derivative of u7/2520 + u6/120 + u5/20 + u4/24 + 2u2. Let c(k) be the second derivative of z(k). Is c(-8) a multiple of 11? True Let k be (-5 - -4)/(1/(-2)). Suppose -ky + 3m = -61, -m - 9 = 3y - 84. Is 13 a factor of y? True Suppose 5b - 875 = 625. Does 15 divide b? True Is ((-2)/2)/((-8)/608) a multiple of 19? True Let p be 15/10(-50)/(-3). Suppose 5g - 2g - 3 = 0, p = t + 4g. Is 21 a factor of t? True Suppose -5q + 14 = -6. Is q even? True Is 5/((-30)/(-9))20 a multiple of 10? True Let g be 3/1 + -3 - -33. Suppose 2p = 5p - g. Does 11 divide p? True Let s(d) = 40d. Suppose 3x - 4x + 11 = f, 3x + 5f - 35 = 0. Let b(g) = -g*2 + 10g + 1. Let q be b(x). Does 11 divide s(q)? False Let x(d) = -5d - 1. Let h be x(-1). Suppose -hp + 15 = 3. Is 3 a factor of p? True Let m = 5 - 2. Does 8 divide 6/(-9) - (-65)/m? False Let w be 120/8(-2)/(-6). Suppose -wt = -10t. Suppose t = 4y - 17 - 3. Is 2 a factor of y? False Let c(v) = 7v - 13. Let u(r) = -11r + 20. Let h(s) = -8c(s) - 5u(s). Let y be h(6). Does 14 divide (y - 0)/((-4)/62)? False Does 30 divide (-1136)/(-5) + 1/5-1? False Let q = 7 + -10. Let k = 6 + q. Suppose 0 = -kf - 15, -3y = -3f + 11 - 44. Does 6 divide y? True Let v = 10 - 2. Let t = -5 + v. Let y(k) = 4k + 2. Is y(t) a multiple of 7? True Is 18 a factor of (-18)/3 + 2 - -77? False Let s = 71 - 7. Does 17 divide s? False Let c(k) = -46k - 2. Let r be c(-2). Suppose -3i = 2u - 60, 5i = 3u + i - r. Does 5 divide ((-2)/(-6))/(2/u)? True Suppose -2b + 5 = -b. Suppose 5g - 2j - 101 = 0, bg = 4g + j + 19. Is 21 a factor of g? True Let a(c) = -4c*3 + 12c*2 - 6c - 1. Let l(z) = -5z3 + 13z*2 - 6z - 1. Let f(y) = 4a(y) - 3l(y). Does 5 divide f(8)? True Let y(u) = u*2 + 9u + 6. Let d = -34 + 22. Does 21 divide y(d)? True Let j = -6 - -8. Suppose 27 = jx - x. Is x a multiple of 19? False Suppose w - 136 = -2d - 0d, -2d = -3w + 376. Is (1/2)/(4/w) a multiple of 6? False Let y(l) = 20l*2 + l + 1. Is y(-1) a multiple of 5? True Suppose 13i - 9i - 184 = 0. Is 18 a factor of i? False Suppose -4s - 105 = -9s. Does 16 divide 42(-4 - (-120)/s)? False Suppose 4v - 5v = -52. Is v a multiple of 13? True Let u be 5/(-14/(-56)). Suppose -3b - z = 98, z + 2z = 12. Let g = u + b. Is 12 a factor of g? True Suppose 3w = -5c + 1303 - 186, -2c + 10 = 0. Is w a multiple of 58? False Let n(y) = 3y - 4. Is n(4) a multiple of 4? True Let i = 75 - 39. Does 9 divide i? True Suppose -2n + 458 = -2t, -n + 0t + 219 = t. Does 25 divide n? False Let a be 752/18 + (-2)/(-9). Let k = 6 + a. Let w = -12 + k. Is w a multiple of 13? False Let u(m) = 2m2 - 3m + 3. Suppose 4z - 5y = -2, -5z + 15 - 7 = -y. Suppose 0 = -zn - 3n + 15. Is 12 a factor of u(n)? True Let t(p) = -p2 - 13p + 3. Let w be t(-11). Suppose w = -4l + 81. Is 4 a factor of l? False Let z(t) = -2t + 40. Does 10 divide z(9)? False Is 20 a factor of 15/(-20)-4 - -157? True Suppose 171x + 588 = 173x. Is x a multiple of 35? False Let w be 5/15 + 5/3. Is (w17)/1 - -2 a multiple of 18? True Suppose -63 - 18 = -3s. Let a = s + -9. Is a a multiple of 7? False Let l(b) be the second derivative of b5/10 - b4/3 + b3/3 + b2/2 + 4b. Is l(3) a multiple of 6? False Suppose i = 4i - 3c - 15, -5c - 25 = 4i. Suppose -2u + i = -2. Does 9 divide 36(u + 1/(-2))? True Suppose 2g - 4g = -20. Let z be (5/g)/((-2)/(-24)). Let i(b) = b*3 - 5b*2 - 2b - 1. Does 15 divide i(z)? False Let f be 52 - (-2 + 0/3). Suppose 2o = -o + f. Does 9 divide o? True Suppose -1 = -z - 0z, -4x = 2z - 50. Suppose -3m - 78 = -5c, 2c - 3m + x = 3c. Let g = c - 7. Is g a multiple of 3? False Let m(p) = p2 - 2p - 5. Is m(-5) a multiple of 30? True Is 10 a factor of (20/(-3))/(4/(-42))? True Suppose 3d - 8 = -4l + 4d, -20 = -4l - 2d. Suppose -u = lz - 40 + 8, -z = -u - 8. Is z a multiple of 10? True Let p be -3(-1 - -2) - -6. Suppose -pa - 176 = -4a. Does 4 divide a/12 - 2/(-6)? False Let s(b) = b3 - 5b*2 - 3b + 7. Let i be s(7). Suppose i - 3 = 5c - 3p, 2c - 2p = 34. Does 4 divide c? False Suppose 0 = 2t + t - 150. Is t a multiple of 19? False Let s be ((-98)/4)/(1/(-2)). Let o = s - 15. Does 14 divide o? False Let n(s) = s3 + 4s*2 + 2. Let v be n(-4). Is 28 a factor of v(1 + -2) - -86? True Let h be 1/7 + 318/(-21). Let f = -10 - h. Is 5 a factor of f? True Let o(i) = 2i3 - i2 + 7i - 8. Does 18 divide o(5)? True Let k(z) = 21z3 + z2 - z. Does 15 divide k(1)? False Let u(n) = n3 + 8n*2 + 8n + 9. Let h be u(-7). Suppose -hj = -4d + 148, 4d - 80 - 60 = -2j. Does 12 divide d? True Suppose 0d + 2d - x - 21 = 0, -x - 29 = -3d. Does 6 divide d? False Does 16 divide 3 - 3/((-9)/231)? True Let t(q) = q + 2. Let m = -13 + 27. Let l = m + -6. Is t(l) a multiple of 10? True Let b(c) = -c2 - 5c - 1. Let x be b(-4). Let w = -5 + 7. Suppose 5j = -20, -xg - wj - 47 + 153 = 0. Does 14 divide g? False Let o(r) = r3 - 7r*2 + r + 2. Let g be o(7). Suppose -5v - 4a - g = -233, -4v - 4a + 176 = 0. Is 24 a factor of v? True Suppose -5h = 4p - 88, 8h - 3h + 3p = 91. Let l = -68 + 120. Let w = l - h. Does 16 divide w? True Suppose -5 + 27 = 5u + n, -9 = 3n. Let i be 80/(-25) - (-1)/u. Does 14 divide i - -2 - (-17 + 0)? False Let k be 4/(-12) + (-26)/(-6). Suppose t = -2b + 5, 5b = -t + kt - 15. Suppose 41 = d - bd. Does 19 divide d? False Suppose 0 = -0c + 4c - 40. Is c a multiple of 3? False Suppose -5o = 3v + 53, -v - 3v + 3 = o. Let x = o - -21. Is x a multiple of 3? False Let n(r) = -r*2 +	{ "pile_set_name": "DM Mathematics" }
? False Is 13777 a prime number? False Is 33591 composite? True Is 114299 prime? True Is 72213 prime? False Is 24953 a prime number? True Is 206699 a prime number? True Is 90941 a prime number? False Is 110743 a prime number? False Is 36589 composite? True Is 38111 composite? True Is 9897 a composite number? True Is 298669 composite? True Is 83 composite? False Is 2129 a composite number? False Is 269617 a composite number? False Is 188323 a composite number? False Is 4876849 a prime number? True Is 1854563 a composite number? False Is 36523 composite? False Is 1901 composite? False Is 1636439 a prime number? False Is 510841 composite? True Is 425071 composite? False Is 26671 a composite number? True Is 39289 a prime number? False Is 92405 a composite number? True Is 47471 composite? True Is 11057 prime? True Is 850933 prime? True Is 10279 a prime number? False Is 27043 a prime number? True Is 482435 a composite number? True Is 49103 composite? False Is 2631 a composite number? True Is 2941 a prime number? False Is 28001 a prime number? True Is 22009 prime? False Is 4111 a prime number? True Is 797 composite? False Is 198863 composite? True Is 11185 a composite number? True Is 1393835 composite? True Is 23 prime? True Is 50277 prime? False Is 9587 composite? False Is 3049 a prime number? True Is 822581 a prime number? True Is 391247 a prime number? True Is 1123 a prime number? True Is 25537 a prime number? True Is 161771 a composite number? False Is 82591 a composite number? False Is 16921 prime? True Is 66835 a prime number? False Is 7283 a prime number? True Is 210437 composite? False Is 25697 prime? False Is 834817 composite? True Is 8779 a prime number? True Is 22609 a composite number? True Is 112433 a prime number? False Is 16658 a composite number? True Is 904987 composite? False Is 211 prime? True Is 7003 a prime number? False Is 12827 a composite number? True Is 270527 a prime number? True Is 7159 prime? True Is 3639 prime? False Is 8605 a prime number? False Is 81761 prime? True Is 3953 a composite number? True Is 21685 prime? False Is 21767 a prime number? True Is 621211 composite? True Is 12603 composite? True Is 259253 prime? False Is 2302 prime? False Is 7593 a composite number? True Is 43391 a prime number? True Is 1649393 composite? False Is 1276451 a prime number? False Is 13001 a composite number? False Is 601529 composite? True Is 1658137 a composite number? True Is 352862 prime? False Is 152753 a composite number? False Is 85663 a composite number? True Is 11281 a composite number? True Is 4419353 a composite number? False Is 14969 a composite number? False Is 678811 prime? False Is 438279 composite? True Is 9598 a composite number? True Is 19957 a prime number? False Is 618595 prime? False Is 675391 a prime number? True Is 136319 prime? True Is 601943 a composite number? False Is 15299 a prime number? True Is 4727 a composite number? True Is 121981 prime? False Is 67801 composite? False Is 18191 composite? False Is 13094 composite? True Is 4857 a composite number? True Is 224335 composite? True Is 80363 a composite number? False Is 72809 a prime number? False Is 10831 a prime number? True Is 17551 composite? False Is 2863 a prime number? False Is 11957 a prime number? False Is 145261 prime? False Is 67951 composite? True Is 329045 composite? True Is 90634 a prime number? False Is 257245 composite? True Is 4547 a prime number? True Is 67223 prime? False Is 115831 a prime number? True Is 746101 a composite number? False Is 3691 prime? True Is 33961 prime? True Is 1099817 composite? False Is 1897 composite? True Is 3909 a composite number? True Is 84691 prime? True Is 30029 a prime number? True Is 551339 composite? False Is 16781 a composite number? True Is 330983 a prime number? True Is 545795 prime? False Is 97949 composite? True Is 2407 a prime number? False Is 8147 prime? True Is 545243 a prime number? False Is 706723 a prime number? False Is 40231 prime? True Is 12689 prime? True Is 517255 composite? True Is 53203 prime? False Is 335021 a composite number? False Is 289907 a composite number? True Is 110419 a composite number? False Is 138053 prime? True Is 27143 a prime number? True Is 731501 composite? False Is 73153 a composite number? True Is 25879 composite? True Is 178661 a prime number? False Is 16729 a composite number? False Is 19777 composite? False Is 21355 a composite number? True Is 36658 a composite number? True Is 282259 a prime number? False Is 9895 prime? False Is 69097 a composite number? True Is 505877 a composite number? False Is 24317 a composite number? False Is 84401 a prime number? True Is 41579 composite? False Is 59003 a prime number? False Is 5197 prime? True Is 63577 prime? True Is 12361 a prime number? False Is 57413 composite? False Is 190049 composite? True Is 95339 prime? True Is 24437 a composite number? True Is 15049 a prime number? False Is 895 prime? False Is 32831 composite? False Is 74653 a composite number? False Is 62423 composite? False Is 536021 prime? False Is 52879 prime? True Is 49507 a prime number? False Is 22199 prime? False Is 143779 prime? True Is 27623 a composite number? True Is 50983 prime? False Is 31643 composite? False Is 219423 composite? True Is 158737 a prime number? False Is 11009 composite? True Is 17693 a composite number? True Is 65973 prime? False Is 2437 a prime number? True Is 1003 a prime number? False Is 70349 a prime number? False Is 1596767 prime? True Is 67593 prime? False Is 194573 a prime number? False Is 192161 a prime number? True Is 249 a prime number? False Is 10903 composite? False Is 27631 a composite number? False Is 2263 a composite number? True Is 469069 prime? True Is 207559 a prime number? False Is 14107 prime? True Is 1280033 a prime number? False Is 73223 a composite number? True Is 57779 composite? True Is 341423 a prime number? True Is 108239 a prime number? False Is 6159 prime? False Is 49451 a composite number? False Is 680263 composite? False Is 3899 a composite number? True Is 3821 prime? True Is 6373 prime? True Is 265774 prime? False Is 134569 prime? False Is 5223907 composite? True Is 9107 a composite number? True Is 5407 composite? False Is 3011027 composite? False Is 13523 composite? False Is 2459 composite? False Is 28639 composite? True Is 627773 a composite number? False Is 948601 a prime number? False Is 719 a composite number? False Is 1797277 prime? True Is 20095 prime? False Is 4109 prime? False Is 10799 a prime number? True Is 119661 a prime number? False Is 13901 composite? False Is 124121 composite? False Is 54941 prime? True Is 190945 a composite number? True Is 14351 prime? False Is 149629 prime? True Is 138157 a composite number? False Is 14077 a prime number? False Is 57779 composite? True Is 1783591 a composite number? True Is 16413 composite? True Is 206179 a composite number? False Is 90353 composite? False Is 392871 prime? False Is 4421 prime? True Is 85109 a composite number? False Is 22217 a prime number? False Is 296117 a prime number? True Is 55043 composite? True Is 1190423 a composite number? True Is 5923 composite? False Is 225257 prime? True Is 45001 composite? True Is 715529 composite? True Is 80593 composite? True Is 16183 composite? False Is 13085 composite? True Is 149 a composite number? False Is 47213 composite? True Is 24385 a composite number? True Is 6007 a composite number? False Is 64951 composite? False Is 108787 a composite number? True Is 13751 a composite number? False Is 2063 a composite number? False Is 366127 composite? False Is 139169 a composite number? False Is 887 a composite number? False Is 47623 composite? False Is 144703 a prime number? False Is 29641 composite? False Is 78907 a prime number? False Is 2459 composite? False Is 4577 prime? False Is 398037 a prime number? False Is 53681 a composite number? False Is 40483 prime? True Is 1455185 prime? False Is 235 a prime number? False Is 193253 prime? False Is 10589 a prime number? True Is 227615 prime? False Is 24713 a composite number? True Is 578167 composite? False Is 253709 a composite number? True Is 21211 composite? False Is 867431 a prime number? True Is 70765 a composite number? True Is 3022 composite? True Is 5047	{ "pile_set_name": "DM Mathematics" }
ue? (a) 4/3 (b) 2.2 (c) -0.02 (d) -4 a What is the biggest value in 0.02, 2/3, -4, 2? 2 Which is the biggest value? (a) 8 (b) -29 (c) -1 a What is the biggest value in 5, -20, 3, 5/6, -2? 5 What is the smallest value in 2, -55, -3, 1/5? -55 What is the fourth biggest value in -2, 1.1, 0.2, 1/6? -2 What is the second smallest value in 3/8, -3/8, 2703? 3/8 Which is the fourth biggest value? (a) -5 (b) -0.12 (c) 0.4 (d) -2 (e) -1/5 d Which is the second biggest value? (a) 1/4 (b) -26 (c) 2 a What is the fifth smallest value in 281, 5, 2/7, -0.4, 1? 281 What is the second smallest value in -1/5, -5, -49, -25, 4? -25 Which is the fourth biggest value? (a) 6 (b) -5 (c) 0.4 (d) 0.2 b What is the biggest value in 4, -5, 6? 6 What is the biggest value in 11, 4/9, 1/4? 11 What is the biggest value in -1, -4/9, -1.38? -4/9 Which is the second smallest value? (a) 2 (b) 31 (c) 1 (d) 1/8 c Which is the biggest value? (a) -0.012 (b) 2/3 (c) -0.4 b What is the biggest value in -783, -1, 1? 1 What is the third smallest value in 0.3, 0.5, -600, 0? 0.3 What is the fourth smallest value in 0.16, -0.5, 2/7, 2? 2 Which is the third biggest value? (a) -1/2 (b) 1 (c) -0.3 (d) 126/11 c Which is the smallest value? (a) 0.4 (b) 0.5 (c) -6 (d) -0.1 (e) 0 c Which is the third smallest value? (a) 2 (b) -1 (c) 2/59 a What is the second biggest value in 3/4, -2/9, -4/29, 0.2, -2? 0.2 Which is the second smallest value? (a) -2/5 (b) 12/19 (c) -3 a What is the third smallest value in 3, -2/5, 1.26? 3 What is the biggest value in 1/7, -25/11, 0.2, 1? 1 Which is the second smallest value? (a) 1/4 (b) -0.3 (c) 39 (d) -2 b Which is the fourth smallest value? (a) -7 (b) -0.03 (c) 5/4 (d) 1.8 d What is the biggest value in -2/11, 14, -0.1, -39/5? 14 Which is the second biggest value? (a) -10 (b) 0.1 (c) 2/7 b What is the second biggest value in -2/3, 0.07, -6, 1, -0.5? 0.07 Which is the fourth biggest value? (a) 5/7 (b) -29 (c) -4 (d) -0.3 b What is the smallest value in -2, 2/9, 4, 1/3, -1/17? -2 Which is the second biggest value? (a) -0.17 (b) -4 (c) -0.5 (d) -1 (e) -0.6 c Which is the biggest value? (a) -5 (b) 1/30 (c) -0.2 b What is the third smallest value in 1.1, 4, -2/7, -33, -2/5? -2/7 What is the biggest value in -0.2, 0.2, 6/13? 6/13 Which is the second smallest value? (a) -0.6 (b) 24/13 (c) -5 (d) -2 d What is the fourth smallest value in -0.2, 1, -3, -0.03, -1? -0.03 Which is the second smallest value? (a) -2 (b) -1/8 (c) 0.1 (d) 0.055 b Which is the fourth smallest value? (a) 3 (b) 0.4 (c) 39/7 (d) 1 c What is the third biggest value in 3/2, -36, -1/10? -36 What is the smallest value in 3, -1/7, -556? -556 What is the smallest value in -1/9, 1, -32? -32 What is the third biggest value in -364/25, -2, 0? -364/25 Which is the third smallest value? (a) 0 (b) 0.1 (c) -0.168 b Which is the third smallest value? (a) -5 (b) 0 (c) 39 (d) -34 (e) 2 b What is the smallest value in -0.8, 0, -1? -1 What is the third biggest value in -0.3, -3/2, 0.78, -2/15? -0.3 Which is the third smallest value? (a) -5 (b) 5/2 (c) -0.14 (d) 1/7 (e) 0.4 d What is the third biggest value in 0.07, -0.3, 3/4? -0.3 What is the biggest value in 2/19, -0.2, 4? 4 Which is the smallest value? (a) 1 (b) -1 (c) 0.2 b What is the smallest value in 5, -86, -0.2? -86 What is the smallest value in 4, 6/7, 66? 6/7 What is the second biggest value in -12, 5/14, 2? 5/14 Which is the fifth biggest value? (a) -0.022 (b) 3 (c) -4 (d) 0.2 (e) -1/2 c Which is the third smallest value? (a) 2 (b) 0.3 (c) 0.115 a What is the third smallest value in 0.1, 2/3, -0.41? 2/3 Which is the second smallest value? (a) -2/1855 (b) 0 (c) 5 b What is the third smallest value in 5, 2/29, 3, 0.4, -2? 0.4 What is the fourth smallest value in 5, -3, -6, -3/4, -0.03? -0.03 Which is the second smallest value? (a) 2 (b) 0.4 (c) 111 a Which is the third biggest value? (a) -0.2 (b) 16 (c) -5/13 (d) -2/13 (e) -3 a Which is the second biggest value? (a) -1 (b) -48 (c) 17 a What is the fourth biggest value in -0.648, -0.1, -4, 11? -4 What is the second biggest value in 3/2, -0.9, 16? 3/2 What is the biggest value in 5, 0.6, -0.4, -1? 5 What is the biggest value in -1/6, -4, -6? -1/6 Which is the fourth smallest value? (a) -0.213 (b) 2 (c) -9/2 (d) -3 b Which is the second biggest value? (a) 7 (b) 6 (c) 3 b What is the smallest value in -75, 5, -4? -75 Which is the second smallest value? (a) 0.2 (b) 1/3 (c) -0.2 (d) 0 (e) -1035 c Which is the second biggest value? (a) -2 (b) 1.2 (c) -5 (d) 1/3 d What is the third smallest value in 6, 626, -5? 626 Which is the smallest value? (a) 0.6 (b) 1 (c) -0.06 (d) -1 (e) -4/3 e What is the second biggest value in -0.05, 3, -0.5? -0.05 Which is the fourth smallest value? (a) 120 (b) 0.36 (c) -0.3 (d) 1/2 a Which is the second biggest value? (a) 10 (b) -3 (c) -0.09 (d) 1 (e) 4 e Which is the second smallest value? (a) -3 (b) 3 (c) -35 a What is the third smallest value in -4/5, -4, 0.46? 0.46 What is the third biggest value in -0.016, -2/13, -1? -1 Which is the biggest value? (a) -2/85 (b) 5 (c) -1/3 (d) -1/7 b What is the biggest value in -6, -0.4, 4/3, 0.4? 4/3 What is the fifth biggest value in -3, 3, -16, -0.2, -2? -16 Which is the second smallest value? (a) -0.05 (b) -1/7 (c) 5 (d) 1/5 (e) 137 a Which is the biggest value? (a) 3/7 (b) -5 (c) 95 (d) 4 c What is the biggest value in 0.2, 3, -1, 2/7? 3 What is the second smallest value in 2/17, -2/171, -3/4? -2/171 Which is the second biggest value? (a) -4 (b) -4/3 (c) 0.02 (d) -0.3 (e) 0.3 c Which is the third biggest value? (a) -221 (b) -0.2 (c) -0.5 a What is the second smallest value in 10, 0, 2, 0.3? 0.3 Which is the smallest value? (a) -0.1 (b) -0.14 (c) 1 (d) 129 b What is the fourth biggest value in 6, 1.34, -3, -4/7? -3 Which is the second biggest value? (a) 0 (b) -4/3 (c) -9/5 (d) 3 a What is the second smallest value in 99, -1/4, 2, -0.4? -1/4 Which is the third smallest value? (a) 0.3 (b) -10 (c) 0.7 (d) 2 c What is the second smallest value in 2, -1/4, -2/557? -2/557 What is the third smallest value in -0.5, 1, 10.96? 10.96 What is the third biggest value in 7, 2, -0.4, -0.024? -0.024 Which is the fifth biggest value? (a) 0.4 (b) 3/5 (c) -2/5 (d) 1.69 (e) 1 c Which is the second biggest value? (a) 0.1 (b) 9 (c) 2/7 (d) 2/5 d What is the second biggest value in 2, -2/5, 0.5, 317, 1? 2 Which is the smallest value? (a) -2/21 (b) 5 (c) 13 a What is the biggest value in 0.3, 5, 0.7, 56, -1/4? 56 Which is the third smallest value? (a) 2 (b) -2 (c) 3/7 (d) 2/21 c What is the third smallest value in -19, -0.06, -3, 0.1? -0.06 What is the fourth biggest value in -0.3, 18, -6/11, 0? -6/11 Which is the fourth smallest value? (a) -5/3 (b) 0.3 (c) -0.4 (d) -31 b Which is the third smallest value? (a) -4 (b) -20 (c) 0 (d) -2/27 d Which is the fourth smallest value? (a) -3 (b) -0.5 (c) -0.1 (d) 1/7 d Which is the second smallest value? (a) -2/3 (b) 0.2 (c) -12 (d) -0.1 a What is the biggest value in -0.06, 30, 3/2, 5? 30 Which is the second biggest value? (a) -2/7 (b) -32.2 (c) 0 a Which is the fourth smallest value? (a) -2/3 (b) 4142 (c) 2 (d) -2/15 b What is the third biggest value in -0.2, -7, -5? -7 What is the biggest value in -1/30, 2/7, 2? 2 Which is the smallest value? (a) 1/30 (b) -34 (c) -3 b What is the biggest value in -32, 3/2, -2/19, 1? 3/2 What is the third smallest value in 0.09, -4, -2, -3? -2 What is the second biggest value in -5, 2, 43, 14? 14 Which is the biggest value? (a) 0.3 (b) 135 (c) -4 (d) 0.5 b What is the third biggest value in 0.3, 0.4, -1/4? -1/4 Which is the second biggest value? (a) 0.2 (b) 35 (c) -1 a What is the second biggest value in -3.4, 0, -1/9, -5? -1/9 Which is the third biggest value? (a) 6/25 (b) 3 (c) 0.5 a Which is the third smallest value? (a) 1/7 (b) -0.2 (c) 0 (d) -0.16 c Which is the smallest value? (a) -1 (b) -0.4 (c) -0.2 (d) -0.07 (e) 2/29 a Which is the second smallest value? (a) 5 (b) 2 (c) 1 (d) -4 c What is the third smallest value in 18, 3, -1/2? 18 What is t	{ "pile_set_name": "DM Mathematics" }
by 135. -1281743 635971 divided by 110 635971/110 0 divided by 244501 0 Divide 161919534 by 53973178. 3 Calculate -379 divided by -228706. 379/228706 Calculate -38721025 divided by 31609. -1225 Calculate 5 divided by 318473. 5/318473 Divide 489 by -11573. -3/71 Calculate -10612205 divided by 2122441. -5 Calculate 48961881 divided by -3187. -15363 Calculate -297181624 divided by -4. 74295406 -39357826 divided by -934 42139 Calculate 83301492 divided by -7019. -11868 Calculate -833571 divided by -6777. 123 48 divided by 21096 2/879 Calculate 14382 divided by 993. 4794/331 Calculate 291938960 divided by 85. 3434576 37775906 divided by 5396558 7 Divide 321816298 by 74374. 4327 Divide 183300850 by -27815. -6590 Divide -4382721 by 7. -626103 What is 1537776 divided by 192222? 8 Calculate -13482064 divided by -1685258. 8 What is -31428632 divided by 15714316? -2 Calculate 1324919064 divided by 4. 331229766 Calculate -3126566 divided by -157. 3126566/157 What is -5 divided by 6148130? -1/1229626 1829014 divided by -108 -914507/54 What is 4 divided by -176194276? -1/44048569 -67 divided by 729477 -67/729477 Divide 2057034 by -1. -2057034 Calculate -285189096 divided by 6. -47531516 What is -11332266 divided by -5666133? 2 14585537 divided by 9 14585537/9 What is 44512408 divided by 8? 5564051 Divide -16957666 by -121. 140146 Calculate 5 divided by 2866983. 5/2866983 Divide 1581919083 by -3. -527306361 Calculate 16 divided by -4728645. -16/4728645 Calculate 2089852 divided by 3. 2089852/3 Calculate 6838 divided by -10261. -6838/10261 -37156238 divided by 27361 -1358 -5 divided by 1239529 -5/1239529 What is -801951035 divided by -5? 160390207 Calculate 12008304 divided by 55594. 216 Calculate 945 divided by 5823. 105/647 -243776 divided by -60944 4 15 divided by -1590164 -15/1590164 41 divided by 109797 41/109797 Divide -5665374 by 279. -20306 Calculate -7 divided by -485672. 7/485672 Calculate 495120 divided by 15. 33008 Divide -7248 by 211. -7248/211 What is -410396 divided by 6? -205198/3 Calculate -377809512 divided by -31484126. 12 Divide -3324671 by -11347. 293 Divide -1 by 549181. -1/549181 Divide 40354654 by 4. 20177327/2 8282106 divided by 9 920234 Calculate 29 divided by 200874. 29/200874 What is 600152 divided by 107? 600152/107 What is -385601374 divided by -192800687? 2 Divide 55720896 by 158298. 352 What is -90432342 divided by 693? -130494 Calculate -101707388 divided by 11521. -8828 Divide -60818345 by -8688335. 7 Calculate -6601100 divided by -35300. 187 What is 81907815 divided by 27302605? 3 What is -37287 divided by 44? -37287/44 Calculate 25316655 divided by -5. -5063331 Divide -1891 by -23925. 1891/23925 Divide -5338882 by 2. -2669441 What is 56552368 divided by -5? -56552368/5 Divide -716413 by 5. -716413/5 -1139252004 divided by -379750668 3 4 divided by 63559996 1/15889999 -7324714 divided by 6 -3662357/3 Divide 10023778 by 17. 589634 Divide 46202578 by -34949. -1322 What is 942798 divided by -3? -314266 What is 1472090 divided by 294418? 5 -292724205 divided by 97574735 -3 What is -625 divided by -211? 625/211 -159339860 divided by -460 346391 341999358 divided by -6 -56999893 -3 divided by -126748 3/126748 What is -3612184 divided by -4? 903046 Calculate 2620919 divided by 35903. 73 Calculate 5 divided by -7432326. -5/7432326 Calculate 57 divided by -106399. -57/106399 Divide 3 by -29167181. -3/29167181 -13295877 divided by 633137 -21 -35314065 divided by 35314065 -1 What is -325 divided by 5137? -325/5137 -40079 divided by -656 40079/656 Calculate 51451597 divided by -43273. -1189 Calculate 812136300 divided by 560094. 1450 What is 396150431 divided by 6? 396150431/6 Divide -54353 by 1449. -54353/1449 128389 divided by 1810 128389/1810 Calculate -16965600 divided by 3. -5655200 Divide 49992532 by 1. 49992532 -1009 divided by 15 -1009/15 What is 38371731 divided by 12790577? 3 Calculate 5 divided by -29232575. -1/5846515 Divide -4361901 by -1453967. 3 Divide -21357606 by -3. 7119202 -11641228 divided by -4 2910307 -334 divided by -304 167/152 What is 5 divided by -2797949? -5/2797949 What is -112863 divided by 1008? -37621/336 What is -41235572 divided by -6431? 6412 Divide -2742336 by 1242. -2208 Calculate -30704040 divided by 1479. -20760 Divide -39341001 by 2293. -17157 Calculate 3400 divided by -18164. -850/4541 -164063649 divided by 54687883 -3 What is 11429 divided by -319? -1039/29 Calculate 71342 divided by 14. 35671/7 79525 divided by 12015 15905/2403 Divide -6800111 by -1709. 3979 4 divided by -284406 -2/142203 What is 4 divided by -18705653? -4/18705653 -479904850 divided by -95 5051630 Calculate -80 divided by 84988. -20/21247 What is 214 divided by 889973? 214/889973 Divide 38781 by 1308. 12927/436 Calculate 37461540 divided by -17. -2203620 Calculate -77689264 divided by -8. 9711158 Divide -9804 by -5058. 1634/843 Divide 2 by -5758482. -1/2879241 Calculate -21582820 divided by -19892. 1085 Calculate -212836764 divided by -106418382. 2 Calculate -87209012 divided by -11. 7928092 What is -15483 divided by 241? -15483/241 Divide -5194890 by -2955. 1758 Calculate 146476736 divided by 105152. 1393 Calculate -156 divided by -951810. 26/158635 What is 17075739 divided by -5691913? -3 Calculate -26317353 divided by 3. -8772451 Calculate 15454 divided by -1569. -15454/1569 -3513371515 divided by 5 -702674303 Divide -175 by 23625. -1/135 Divide -698968410 by -23298947. 30 37 divided by -89436 -37/89436 Calculate -12720084 divided by 163078. -78 -1841 divided by 1734 -1841/1734 What is -77 divided by 486005? -77/486005 75294720 divided by 132096 570 -2446220 divided by 346 -7070 Divide 9899921 by -2. -9899921/2 -7 divided by -572841 7/572841 Divide -676753 by -9. 676753/9 Divide -1 by -112524982. 1/112524982 Calculate 14 divided by -768420. -7/384210 What is 633 divided by -1006? -633/1006 What is 419655990 divided by -32281230? -13 Calculate 12954867 divided by -12954867. -1 What is -160471900 divided by 4? -40117975 What is -7887196 divided by -4? 1971799 What is 98120640 divided by -4? -24530160 What is -264317585 divided by -77399? 3415 What is -15 divided by -435113? 15/435113 What is -149972 divided by 39? -149972/39 Calculate -8055565 divided by 2065. -3901 -3923234 divided by -817 4802 What is 6 divided by -1605791? -6/1605791 Divide -132 by 38881. -132/38881 35273680 divided by 542672 65 292063233 divided by -97354411 -3 What is 37298520 divided by -113715? -328 Divide -21300165 by 705. -30213 What is -4 divided by -18017757? 4/18017757 1344 divided by 29248 21/457 Calculate 295651359 divided by -2291871. -129 -15093556 divided by -44788 337 963807154 divided by -13024421 -74 7 divided by 30027489 7/30027489 Divide -436334 by -261. 15046/9 Calculate 18281 divided by 21575. 18281/21575 Divide -758995 by -1. 758995 56100 divided by -428 -14025/107 Divide 52422860 by 4340. 12079 What is -23093160 divided by 11546580? -2 What is 2207252 divided by 8? 551813/2 Divide -14753128 by 344. -42887 -382902520 divided by 524524 -730 What is -5 divided by -22553922? 5/22553922 -22461375 divided by -5 4492275 -15958984 divided by -17032 937 What is 179466 divided by -614? -89733/307 Divide 29507007 by -87. -339161 Calculate 2 divided by 40205260. 1/20102630 Divide 14 by 58384. 7/29192 Calculate -277 divided by 2523434. -277/2523434 Divide -243276 by -1007. 12804/53 Calculate 7088695 divided by 9389. 755 Calculate -21 divided by -10503137. 21/10503137 What is -132501 divided by -944? 132501/944 Calculate -97608 divided by 814. -48804/407 -2 divided by 32532470 -1/16266235 Calculate 11 divided by -17654398. -11/17654398 Divide 3279148 by 819787. 4 What is -93 divided by 141295? -93/141295 What is -4019085 divided by 34? -4019085/34 Calculate 67176296 divided by -1. -67176296 What is -8962836 divided by -4? 2240709 Calculate 91043 divided by 447. 91043/447 What is 1881 divided by -6216? -627/2072 58 divided by 96278 29/48139 Calculate 47944064 divided by 11986016. 4 Calculate -1 divided by 278636. -1/278636 2 divided by 1260826 1/630413 Calculate 478606561 divided by 19. 25189819 Divide -91419 by 31. -2949 What is -200128 divided by 64? -3127 Calculate -141 divided by -11429. 141/11429 Calculate 777772283 divided by 767791. 101	{ "pile_set_name": "DM Mathematics" }
s the nearest to 1/4? (a) 3 (b) u (c) v b Suppose 13 = -3t - 2k + 3k, -4k = -4. Let u = -5 + 6. Which is the nearest to u? (a) t (b) -0.4 (c) 3 b Let u = -2 - -10. Which is the nearest to u? (a) 0.3 (b) -1/6 (c) -1/3 a Let p = 0.3 - 0.4. Let g be -2 - -1 - 4/(-3). What is the closest to p in -3, g, 2/7? 2/7 Let y = -0.5 - 0. Let r = 3.129 + -0.129. What is the closest to 1 in y, r, 2? 2 Let p(h) = 5h. Let d be p(1). Let x = -1.4 + 0.4. What is the nearest to x in 1/3, -0.2, d? -0.2 Let i be ((-85)/(-33))/5 + 1/(-3). Which is the closest to -4? (a) i (b) 4/3 (c) 1/4 a Let j be (1 + 1)(-3)/54. Let o = 59/217 + -4/31. Which is the closest to -1/4? (a) j (b) 0 (c) o a Suppose -3s + 2s + i + 4 = 0, -5i = 4s - 7. Let n be 2/4 + s/(-10). Let h = 85/28 - 23/7. Which is the nearest to 1? (a) 2 (b) h (c) n c Let d be (-14)/(-4) + 3/6. Let g be -6(-3)/183. Suppose -dq = -3s + 11, q + gs - 17 = -q. Which is the nearest to -1/3? (a) -1/8 (b) q (c) -3 a Suppose -4 + 0 = -g. Let q = 2/3 + -4/15. What is the nearest to 0 in q, g, -5? q Suppose -4r = -4n + 32, -4r = 2n + n + 4. Let i = -0.4 + 5.4. What is the closest to 1 in 2/9, n, i? 2/9 Let r be 2/(-2) - (-14)/18. Let l = -0.6 + 2.6. Let c = l - 4. What is the nearest to 0.1 in 5, c, r? r Let g = -1/7 + 10/21. Let s = 0.5 + -1. Let d = -22 - -21. What is the closest to g in s, d, -0.4? -0.4 Let i = 2/43 + -47/86. Which is the nearest to 3? (a) i (b) 5 (c) -2 b Let t = -35/2 - -16. Let s = 0 - 1. What is the closest to s in t, 2, -1? -1 Suppose 0 = 2n + 5 - 11, 5i = -4n + 12. Let v be 1/30 + 3. Let g be i + 2/(-9)v. What is the nearest to -0.1 in 1/2, -2, g? g Let v = 166/57 - 30/19. Which is the nearest to 1? (a) 3 (b) 2 (c) v c Let d be -1 + 1(88/20 - 3). Which is the nearest to d? (a) -1/6 (b) 0.2 (c) 5 b Suppose 4x - 696 = -3s - x, -464 = -2s - 4x. Let d = -2086/9 + s. Let o be 42 - 37 - 7/(-1)-1. Which is the nearest to d? (a) o (b) 4 (c) -0.4 c Suppose -5s + 5p - p = -14, -5p + 3 = 4s. Which is the nearest to -3? (a) s (b) 0 (c) -2/7 c Let z = 28 - 17. Let k = -9 + z. What is the closest to -6 in -1/9, k, 0.2? -1/9 Let l = 0.35 + -0.05. What is the closest to -0.1 in 1, 0.5, l? l Let f = 0.2 - 0.2. Let k be 18/207 + 75/(-69). Which is the nearest to f? (a) 2/7 (b) 0.1 (c) k b Let d = -1/43 - 41/86. Let r = -686 - -680.91. Let x = r - -0.09. Which is the closest to d? (a) 5 (b) -3 (c) x b Let g be (4/(-2))/(4/10). Suppose -s - 1 + 2 = 0. Which is the closest to 2? (a) -5/4 (b) s (c) g b Let b(n) = -2n3 - 12n*2 - 12n - 7. Let k be b(-5). What is the nearest to -2/9 in k, -2/5, -3? -2/5 Let l be 72/4 - 1/1. Suppose -3z = -5w + l, 4w + 0z + z - 17 = 0. Which is the nearest to -1? (a) w (b) -0.5 (c) -0.3 b Let y = 0.3 - -2.7. Let f = 2 - y. Which is the closest to 0? (a) -4 (b) 2/3 (c) f b Let s = 3/70 - 111/140. What is the nearest to -2 in 2/15, s, -1/7? s Let j = 0.005 - -3.895. Let v = j - 4. Which is the nearest to v? (a) 0 (b) -5 (c) -4 a Let d = -25 - -24.56. Let l = 2.96 + -3. Let j = d - l. Which is the nearest to 0? (a) -0.3 (b) -3 (c) j a Let t = -6 - -19/3. Which is the closest to -0.4? (a) -0.3 (b) 0.1 (c) t a Suppose -2h = -2 - 6. Let d(t) = -t3 + 7t*2 + 6t + 10. Let j be d(8). Let i be (h/j)/((-1)/(-6)). What is the closest to 2/5 in i, 2/5, 0.2? 2/5 Let h be (2/(-42))/(5/(-30)). Which is the closest to h? (a) 3 (b) -2/11 (c) 9 b Let k = 1.6 + -1.8. Which is the closest to 5? (a) 5 (b) -0.1 (c) k a Suppose 9 + 6 = -5o. Let p be o/((-3)/(-2)) - -1. Let y be 0 + p/((-11)/(-2)). Which is the closest to -0.1? (a) y (b) -3 (c) 2/15 a Let k be (-4)/3 - (-3 - -2). Let h be (-2)/(-12)18/(-4). Let c be 12/(-8) + (-6)/(-4). What is the closest to c in k, h, -0.5? k Let n = -32 + 129/4. What is the closest to -1 in 5, n, -6? n Let k = 0.34 + -1.74. Let h = -0.35 - 0.05. Let f = k - h. Which is the nearest to f? (a) -1 (b) -1/2 (c) -5 a Let p = 0 - 0.1. Let q = p - 0.2. Let m = 48 - 49. Which is the closest to m? (a) -0.1 (b) 0.2 (c) q c Let v = 22.09 - 22. Let y = v + -5.09. Let k = -4 - y. Which is the closest to 0.1? (a) 3 (b) -5 (c) k c Suppose -2v = -z - 0z + 6, v + 9 = -z. Let s be ((3 + -4)1)/z. What is the closest to -1 in -2, s, -0.3? -0.3 Let l = -84 - -84.4. Which is the closest to 2/9? (a) 7 (b) l (c) -0.5 b Let h = 0.049 + -0.249. Let o = -1 + 0. What is the closest to o in 0.5, h, -1/3? -1/3 Let h be (1 - 1) + -1 + 1. Let u be 0((-2)/(-4) - h). Which is the closest to u? (a) -3 (b) 0.3 (c) 1/5 c Let a = -4.919 + -0.081. What is the nearest to 1/2 in -2/5, a, -2/73? -2/73 Let u = 0.19 + -3.19. What is the closest to 1 in u, -2/3, 0? 0 Let r = -9.09 - -9. Let n = r + -0.01. Which is the nearest to -1/2? (a) 2 (b) n (c) -0.2 c Suppose -17 = -5g + 3h, -4h + 6 = g - 2h. Let z = -4.4 + 4. Let p = -2/7 + 25/14. What is the nearest to -1 in p, z, g? z Let v = 14/17 - 36/85. What is the nearest to v in -2/17, -3/4, -2? -2/17 Let p = -8 - -7.91. Let o = p - 3.91. What is the closest to 2/5 in 3, o, 0? 0 Let j = -16 - -17. Let v be (j/4-2)/(-1). What is the nearest to -1 in -3, v, 2/5? 2/5 Suppose -3z + 16 = z. Let q = 0.5 - 0.3. Let u = 0 + q. Which is the nearest to -2/7? (a) z (b) u (c) 5 b Let x = 563/378 + 2/189. Which is the nearest to 1/4? (a) -2/13 (b) x (c) -0.3 a Let z(o) = o*3 + 3o*2 + o - 2. Suppose 0 = 3x + 2x + 15. Let c be z(x). Let h be (-3)/(-36) + (-1)/(-4). What is the closest to 0.1 in -0.1, h, c? -0.1 Let a(c) = c3 - 6c*2 - 8c + 9. Let k be a(7). Suppose -kn - 2n = 12. What is the closest to -0.1 in 2, n, -0.1? -0.1 Let x = -0.02 - -0.92. Let r = x - 1.9. Which is the closest to r? (a) -2 (b) -0.5 (c) -3/4 c Let l = 0.47 + -0.07. Which is the nearest to -2/5? (a) 2/3 (b) -2/11 (c) l b Let t = 3 - 2.99. Let v = t + 2.99. Which is the nearest to -2? (a) 0 (b) 1/9 (c) v a Let f = 15 - 15. Let z = 0.2 - 0.3. Which is the nearest to z? (a) -2 (b) 4 (c) f c Let j = -4 + 3.8. Let p = 7.8 + -7. Let l = p + 0.2. What is the closest to -1/2 in j, l, 3? j Let g = -8 - -10. What is the nearest to -0.2 in 0.2, -0.2, g? -0.2 Let d = -2 - -1. Let j be 2 + 8/26-5. Let n = 27/26 + j. Which is the closest to 0.2? (a) n (b) 0 (c) d b Let n = -5 + 1. Let p = 4.1 + n. Let g = 0.4 + p. What is the nearest to -2/7 in 3/4, 2, g? g Let y = -3/4 - -2. Let p = 0.52 - 0.52. What is the nearest to 1 in p, -3, y? y Let l = -18/37 - -272/407. Which is the nearest to -1/4? (a) -1/2 (b) 4 (c) l a Let s be 2/(-4) - 0 - (-14)/44. Which is the closest to -0.1? (a) 0.2 (b) -2 (c) s c Let i = -4 - -3.5. What is the closest to 1/6 in i, -1, -2/7? -2/7 Let f = 151 + -150.97. Which is the nearest to 0.1? (a) 1/4 (b) -1/2 (c) f c Let n = -2 - -1. Let s be (-5)/(-3)39/(-2). Let d = -33 - s. Which is the nearest to -0.1? (a) d (b) 5 (c) n a Let y(p) = -p*3 + 2p*2 + p + 5. Let u be y(0). What is the nearest to 0.1 in 0.4, u, 1/2? 0.4 Let r = 2/9 - 68/225. What is the closest to r in -0.1, 0.2, -1/6? -0.1 Let n be 14/4(-12)/(-6). Let m = n - 8. What is the nearest to 3 in 2/17, m, -0.5? 2/17 Let w = -0.4 + -1.6. Let b = w + 3. What is the nearest to b in 0, -0.4, 5? 0 Let w = -240 + 965/4. What is the nearest to 2 in 3, -0.4, w? w Let p be -2 + 1 + 30/26. Let g be 2/(-3) + 1/2. What is the closest to -2/7 in p, 2, g? g Let i = -0.3 + 0.1. Which is the nearest to i? (a) -2/7 (b) 0.2 (c) 3 a Let r(g) = -g*2 + 6g + 5. Let x be r(6). Suppose 0 = xp - 0 - 5. Which is the closest to p? (a) 2/3 (b) -2/7 (c) -0.2 a Let a = -8.7 - -9.2. What is the nearest to -3/5 in -1/2, 2/15, a? -1/2 Let o = -0.2 - 0.2. Which is the nearest to 0? (a) o (b) -1/6 (c) -0.1 c Let i = -63217 - -443501/7. Let s = i + -140. Let n = -116 - -116.4. Which is the closest to s? (a) -2 (b) n (c) -5/3 b Let x = 0.36 + -2.36. What is the nearest to 3 in -0.5, 0.1, x? 0.1 Let w be -4(-2)/(-12)60/8. What is the nearest to 2/3 in -0.5, 0, w? 0 Let s(x) = x2 + 6x - 3. Let p be s(-6). Let o = 2/271 + -283/1626. Which is the closest to 1? (a) -5 (b) p (c) o c Let l = -1.59 + 0.59. Which is the nearest to 0.1? (a) 2.4 (b) l (c) 0.2 c Let p = -	{ "pile_set_name": "DM Mathematics" }
- 2z - 129 = 2m. Let b be 2/9 + (-560)/m. Is b at least as big as 9? False Suppose -g = -4i + 7, -4g - 3i + 16 = -13. Suppose 25 = -gd - j + 3j, 0 = 5d + 2j + 25. Let h(o) = -o3 - 6o*2 - 4o + 7. Let z be h(d). Does 1 = z? False Let v(x) = -2x2 + 7x + 4. Let u be v(4). Which is bigger: u or 1/18? 1/18 Suppose 5i = p + 4, 0 = -2p - i - i + 16. Is p at least as big as 5? True Let a = 2 + -1. Let x = 5 + -3. Let m = 1 - x. Is m at least as big as a? False Let b(y) = y*2 + 4y + 3. Let w be b(-2). Let v = -1/350 + 103/1050. Is v at least as big as w? True Let k = 0 + 0. Let r be -1231 + (2 - 1). Let o = r - -1613/7. Are o and k nonequal? True Let n(t) = -t + 10. Let v be n(10). Let a be -1 + 1 - (-4)/6. Which is greater: v or a? a Let j(r) = -r2 - 4r + 5. Let u be j(-5). Let p = -1 - -1. Suppose pn - n = u. Which is bigger: -0.1 or n? n Let q = 0 - 0. Let p = q + 0. Suppose pu - 5 = 5u. Which is bigger: u or 0? 0 Let a = 8 + -12. Which is smaller: -7/2 or a? a Suppose 0 = t - 4z + 17, -2t = -z + 9 + 4. Is -50/9 < t? True Suppose 5k = k. Suppose k = 3w - 16 + 1. Let q = -2 - -1. Which is smaller: q or w? q Let m = -1 + 6. Let t = 3 - m. Let a = t - -1. Is -0.06 greater than a? True Let m be (5 + -1)2/(-4). Let t be (7/14)/(1/(-6)). Let f be 1 + (m - 4/t). Which is bigger: f or 1? 1 Let t = -27 - -63. Let l(y) = y*3 - 5y*2 + 5y - 5. Let n be l(4). Let x be 17/t - n/(-4). Which is smaller: x or 0? 0 Let u = 176.1 + -176. Which is greater: -28 or u? u Let f = -11 + 12. Is -2/59 >= f? False Let o = -2/27 - 4/27. Let p = 55/3936 + 1/96. Let z = 85/123 - p. Which is greater: o or z? z Let j be (-1)/3 - 2/(-15). Let n be (-2)/(-7) - 8/(-70). Is j equal to n? False Let b(k) be the first derivative of -k*4/4 + 5k*3/3 + 3k*2 + 4k + 1. Let d be (-8)/24 - (-38)/6. Let s be b(d). Is 5 at most as big as s? False Let u be (10/(-6) + 3)(-21 + 0). Is u at most -27? True Suppose -5p + 3 + 27 = 0. Let n be 2/(-8)-4 - p. Is -6 < n? True Let q = 2433/28 + -2408583/27748. Let w = -40109/202164 - q. Let x = w - -2/51. Is x smaller than 1? True Suppose 4g + 3g + 42 = 0. Is -6 less than or equal to g? True Let j(r) = r3 - 5r*2 - 2r + 6. Let m be j(5). Let i be 5/(-25)(-1 - 1). Which is smaller: m or i? m Let g(t) = -2t + 1. Let q be g(-2). Let j = q + 0. Suppose -6d - j = -7d. Which is bigger: 6 or d? 6 Let d be 8/((-15432)/3861) + 2. Let k = d + -4497/2572. Does k = -3? False Suppose 0s + 5u + 55 = -3s, 2s - 2u = -10. Let x be (-6 + 5)/((-2)/s). Does x = -5? True Let q be (0 + (0 - 2))-2. Let f(i) = i*3 - 3i*2 - 4i + 2. Let p be f(4). Which is bigger: p or q? q Suppose v = -1 - 2. Let y(h) = 10h2 + 5h + 16. Let o(f) = -3f2 - 2f - 5. Let t(k) = 7o(k) + 2y(k). Let z be t(v). Which is greater: 1/4 or z? 1/4 Suppose 0 = -3k + n - 4n - 12, -4k + 4n = 0. Let i = 1 + k. Which is bigger: i or -4/3? i Let x = 0.04 - 0.07. Let w = x + 1.03. Let k = 0 + w. Which is bigger: -0.2 or k? k Let t be (-3)/1 - -6 - 5. Let p(f) = -3f2 + 1. Let u(k) = k3 + 4k*2 - 1. Let m(j) = 4p(j) + 3u(j). Let l be m(-1). Is t > l? False Let z = 2.1 - 2. Suppose 3i - 9 = 0, 2w + 5i = i + 14. Which is smaller: z or w? z Let m(t) = t*3 + 7t*2 + 5t - 6. Let y be m(-6). Is y >= -2/17? True Let t = 4 + -14. Is t <= 1? True Let n be (-1 - (-33)/18) + -1. Let x(p) = -p*2 - 4p - 2. Let c be x(-3). Which is greater: n or c? c Suppose -5u - 90 = -10u. Suppose -4x + 3r = 0, -4x + u = 2r - 2. Is x bigger than 3? False Let n = -4 - -12. Suppose -n = -k - k. Let o be 2/(-7) + k/14. Which is smaller: o or 1? o Let w = 8 + -16. Let o = w - -13. Suppose -10 = 4d + p + 2p, d = -2p - o. Is 2/9 greater than d? True Let v = -12 - -12.1. Which is greater: -3/7 or v? v Suppose 5l = 4r - r - 16, 4r = -4l. Suppose -2s = rs - 20. Suppose 0 = -5v + s. Is v greater than or equal to -1? True Let a = -2365 - -357113/151. Is 0 not equal to a? True Let i be 0/(-2(0 - 8/4)). Which is smaller: i or 5/14? i Let p(f) = f3 - 6f*2 + 7f - 4. Let m be p(4). Let r be (9 + -12)m/(-6). Which is greater: r or -6? r Let k(y) = -y2 + 2y + 12. Let u be k(0). Let b be ((-22)/18)/((-4)/u). Which is bigger: 4 or b? 4 Let j = 0.05 - -1.55. Let c = 2.5 + j. Let a = c + -4. Which is bigger: -4 or a? a Suppose h - 3t + 11 = 0, -3h + 5t - 9 = 8. Suppose 0 = 2z - 1 - h. Let a = 43/4 - 32/3. Which is greater: z or a? z Let h(k) = k*2 - 2k - 2. Let c(m) = -m - 1. Let l(d) = 3c(d) + h(d). Let f be l(6). Is -1/2 greater than f? False Let s be -2 - (2 - 6/2). Do s and 4 have different values? True Let f(x) = -5x + 3. Let r be f(3). Is r greater than or equal to -13? True Suppose -2n + 5i - 18 = -4, 0 = n + 3i - 15. Let u = 10 + -7. Is n < u? False Let i = 36 + -10. Suppose 2x = 2q + 3q + 38, i = -3q + 2x. Suppose l + 3 = -3. Is q at most as big as l? True Suppose -k + 700 = 3u, -u + 2u + 4k = 226. Let j = 2108/9 - u. Is -6 at least as big as j? False Let d be (-21)/34 + (-16)/(-136). Which is greater: -2 or d? d Let m be 27/(-36) - (-2)/(16/(-10)). Let l(z) = -2z + 7. Let a be l(5). Is a smaller than m? True Let f be (-11)/(-4) - (-5)/20. Suppose j - 20 = 5j. Let l be 2/6 + j/(-3). Is l at least as big as f? False Let v(q) = -q + 11. Let u be v(8). Let g be 2 - -1 - (-9)/(-11). Is u > g? True Let w = 3.68 - 3. Let j = -0.08 + w. Let q = 0.1 - j. Is 0 at most q? False Let m = 217 - 217.2. Suppose 0 = -5y - 3q - q - 9, y = -3q + 7. Which is smaller: y or m? y Let n be 1 + 1 - (-38)/(-20). Suppose 0 = 5x - 3a + 14, -2x - 5a + 15 - 2 = 0. Which is smaller: n or x? x Let x = -1.1 + 0.1. Let i = -7.08 - -0.08. Let z = i - -6.3. Is z at least x? True Let x be (12/18)/(2/3). Let y = 7 + -6.1. Let s = -0.1 - y. Which is smaller: x or s? s Let h be -2 + 2 - 2/(-1). Let v(u) be the first derivative of u*4/4 - 2u3/3 - u2/2 + 2u - 7. Let o be v(h). Are o and 1/3 equal? False Let l = 4 - -12. Let r be (12/l)/(2/8). Is r equal to 4? False Suppose -45 = -4r + 7r. Which is smaller: -14 or r? r Let j be 2/(-5) - (-824)/2160. Suppose -w - 3z = -2w + 12, 0 = -2w - 2z - 8. Which is greater: j or w? w Let y = 22 - 18. Which is smaller: 0.3 or y? 0.3 Let a = -589 + 24147/41. Is -1 at most as big as a? True Let m be (2/(-3))/(8/(-18)). Suppose 7u = 19 - 5. Which is smaller: m or u? m Let f(m) = m*3 - 4m2 + m + 2. Let y = -2 - -5. Let u be f(y). Is -6 > u? False Let p(i) = -i3 - 8i2 + 10i + 11. Let s be p(-9). Suppose 0 = 3d - 2d - s. Let u be 0((-15)/6 + d). Which is greater: 2/13 or u? 2/13 Let f = 17 - 0. Suppose 4t = f - 5. Suppose 4z + 3h - 1 = 0, 4z - h = th + 8. Are -1 and z nonequal? True Suppose z + 4z + 23 = 2k, 4k - 6 = 2z. Let n be (0 + (-3)/30)-1. Which is smaller: k or n? k Let p = -144 - -869/6. Is -2 less than p? True Let a = 241 + -3855/16. Is 2 > a? True Let k = 4 + 3. Let o be -161/k - -2. Suppose -4z = -4 + 8. Are z and o nonequal? True Let s be (-4)/14 - (-303)/7. Suppose -2v - 8 = -0t + 3t, -s = 3t - 5v. Let r be (-2)/t - (-57)/(-90). Which is smaller: 0 or r? r Let t(u) = -u*2 + 5u - 2. Let x be t(3). Suppose 2m = 3m + 5q - 17, -xq = -5m - 2. Is m bigger than 3? False Let g = 4 - 0.4. Let t = 4 - g. Let b = t + 0.6. Is 0 at most as big as b? True Suppose -5f - 28 = -n + 2n, 3f = -n - 18. Let u = 13 + f. Is 6 >= u? False Let s(z) = -2z - 45. Let a be s(-16). Does a = -27/2? False Suppose 2 = -3x - x + u, -x + 4 = 2u. Is x greater than or equal to 0.13? False Let l(m) = 3m*2. Let x be l(1). Suppose 0 = 5s + x + 2. Is 0 <= s? False Let z = 12 - 12. Is z bigger than -1? True Suppose -z = 3k + 4, 3k - 2k - z = 0. Which is greater: 0 or k? 0 Let u = -21 - -22. Which is smaller: 19/4 or u? u Let c = -25 + 24. Let d = -2.2 + 3. Let m = d + c. Which is smaller: 1 or m? m Let k = 0.004 - 0.704. Are -1 and k equal? False Let h = -57 - -87. Which is greater: h or 31? 31 Let j(k) = -20k + 3. Let u be j(1). Which is smaller: u or 2? u Let v be (-2)/(-3) - 1221/9. Let n = v + 677/5. Let s = -1 - -2. Is n at most as big as s? True Suppose 0 = 2l - 1 - 1. Let h(z) = -z3 - z2 - z + 4. Let u be h(0). Let f be (-2 - (-6)/u)0. Does l = f? False Suppose 10 = 5*h - 1	{ "pile_set_name": "DM Mathematics" }
divided by -4? 865 Divide 0 by -124. 0 Calculate 13 divided by -2222. -13/2222 Calculate 142 divided by -71. -2 Calculate -9168 divided by -3056. 3 3 divided by 262 3/262 256 divided by -2 -128 What is 21 divided by 12? 7/4 What is 72 divided by 24? 3 Calculate 1188 divided by 99. 12 Calculate -3 divided by -262. 3/262 12 divided by 859 12/859 Calculate -4158 divided by -594. 7 Divide 360 by -5. -72 -23983 divided by 3 -23983/3 Calculate 2076 divided by 4. 519 -2430 divided by -6 405 69 divided by 3 23 What is -21027 divided by -163? 129 What is -449 divided by 7? -449/7 Calculate 4 divided by 409. 4/409 Divide -5 by 8. -5/8 Divide 0 by 164. 0 What is 24686 divided by 2? 12343 What is 9788 divided by 4894? 2 1908 divided by -6 -318 -18 divided by -214 9/107 Calculate 736 divided by -32. -23 Divide -153 by -51. 3 0 divided by -642 0 Divide 1552 by 97. 16 What is 468 divided by -18? -26 Calculate 597 divided by -199. -3 Calculate 17 divided by 6. 17/6 What is 0 divided by 18? 0 Calculate -191 divided by -1. 191 Divide 104 by -10. -52/5 What is -168 divided by -2? 84 -34 divided by 226 -17/113 What is 1119 divided by -3? -373 Calculate -3633 divided by 3. -1211 16284 divided by -92 -177 Divide -15 by 17. -15/17 8418 divided by -122 -69 -2 divided by 23 -2/23 Divide -20 by -186. 10/93 Calculate 1286 divided by -3. -1286/3 What is -5 divided by 83? -5/83 Calculate 41 divided by 62. 41/62 What is -121 divided by -58? 121/58 Calculate -3 divided by -96. 1/32 Calculate 85 divided by 3. 85/3 What is 5 divided by -24? -5/24 What is 907 divided by 1? 907 Calculate -1189 divided by -1. 1189 Divide 1 by 272. 1/272 -1 divided by 795 -1/795 Calculate -116 divided by 11. -116/11 Divide 229 by -6. -229/6 What is -1222 divided by -1? 1222 Divide -34724 by 2. -17362 Calculate 37 divided by 1. 37 Divide -33092 by 1. -33092 Divide -4926 by -1642. 3 What is -813 divided by -3? 271 -30 divided by -6 5 Calculate -5 divided by -94. 5/94 1467 divided by -163 -9 -141 divided by 141 -1 Divide 333 by -4. -333/4 3 divided by -2236 -3/2236 What is -22723 divided by 733? -31 What is 95 divided by 19? 5 What is -75 divided by 3? -25 11 divided by -126 -11/126 Divide 19 by -1. -19 What is 1763 divided by -1763? -1 64 divided by 2 32 Calculate 134 divided by -2. -67 -201 divided by 5 -201/5 -1870 divided by 2 -935 Divide -3 by 6748. -3/6748 What is -1 divided by -1286? 1/1286 Divide -1 by 107. -1/107 Divide -3083 by 5. -3083/5 -89 divided by -5 89/5 What is 650 divided by 65? 10 -460 divided by -46 10 -41 divided by 3 -41/3 What is -4689 divided by -3? 1563 7 divided by -7 -1 Divide -1440 by 360. -4 290 divided by 2 145 What is -85 divided by -2? 85/2 What is 3333 divided by -3? -1111 -926 divided by -10 463/5 Calculate 13314 divided by -6. -2219 Calculate 1565 divided by 5. 313 What is -64 divided by 5? -64/5 -1 divided by -61 1/61 2028 divided by 507 4 Calculate 1 divided by -661. -1/661 -343 divided by -11 343/11 Calculate -349 divided by -1. 349 What is 405 divided by 81? 5 -108 divided by -3 36 Divide 561 by 3. 187 96 divided by 48 2 What is 1785 divided by -85? -21 Calculate 5664 divided by 4. 1416 Divide 763 by -13. -763/13 -1260 divided by -252 5 Divide 85 by -85. -1 Calculate 156 divided by -78. -2 What is 200 divided by 25? 8 Divide -8420 by -10. 842 Divide 8136 by 678. 12 Divide 5 by -330. -1/66 -613 divided by -7 613/7 Divide 216 by 12. 18 What is 2485 divided by 1? 2485 Calculate 1 divided by -88. -1/88 What is 7 divided by 2069? 7/2069 Calculate -4 divided by -1121. 4/1121 Divide 104 by 2. 52 Divide 2 by 74. 1/37 Calculate 6516 divided by 12. 543 What is 1698 divided by -6? -283 -4160 divided by 32 -130 Divide -4 by 25. -4/25 What is 750 divided by -1? -750 What is 1710 divided by 3? 570 Calculate 1 divided by 1852. 1/1852 85150 divided by 5 17030 What is -681 divided by 2? -681/2 Calculate 536 divided by -2. -268 Divide -80 by -16. 5 Calculate 303 divided by -4. -303/4 What is 3 divided by 758? 3/758 -365 divided by 5 -73 What is -16905 divided by -7? 2415 Divide -1288 by 184. -7 What is 4 divided by -41? -4/41 What is -61 divided by 211? -61/211 3720 divided by -1240 -3 37 divided by 242 37/242 What is 798 divided by -38? -21 Calculate 61 divided by 4. 61/4 What is 316 divided by 2? 158 Divide -960 by -15. 64 Divide 1659 by 5. 1659/5 22 divided by -1 -22 2 divided by -2755 -2/2755 What is 2090 divided by -5? -418 Calculate 1044 divided by 2. 522 Calculate -1136 divided by -4. 284 -30 divided by 8 -15/4 Divide 725 by -25. -29 2 divided by 2774 1/1387 What is 16752 divided by 4? 4188 Calculate 1 divided by -27. -1/27 Calculate 37 divided by -73. -37/73 Divide 12 by -3. -4 Calculate 339 divided by 1. 339 Divide 32640 by -340. -96 328 divided by 82 4 -1600 divided by -320 5 Calculate -158 divided by -158. 1 Calculate 1040 divided by 104. 10 Divide -93 by -3. 31 Calculate 7 divided by 36. 7/36 Calculate 3 divided by -72. -1/24 28368 divided by 3546 8 Divide -3100 by 2. -1550 Calculate 90 divided by 30. 3 What is 42 divided by -69? -14/23 Divide -351 by 24. -117/8 4151 divided by 6 4151/6 3 divided by -136 -3/136 Divide 696 by -24. -29 -2312 divided by 578 -4 459 divided by -4 -459/4 What is -5 divided by -163? 5/163 Calculate -5868 divided by 163. -36 What is 5 divided by 103? 5/103 Divide 1469 by -13. -113 2196 divided by -1 -2196 -8 divided by 25 -8/25 -3 divided by 134 -3/134 172 divided by 1 172 Divide -153 by 3. -51 Divide 65 by 105. 13/21 Calculate 13 divided by 22. 13/22 Divide 516 by -8. -129/2 Calculate -4 divided by -8. 1/2 Calculate -2 divided by 2. -1 -103056 divided by 4 -25764 Calculate 3 divided by 2433. 1/811 What is -26 divided by -2? 13 3800 divided by 95 40 What is 214 divided by 128? 107/64 -2594 divided by 1 -2594 What is 1 divided by -1782? -1/1782 What is -9684 divided by -3? 3228 Divide 131 by -1. -131 What is -336 divided by -112? 3 Calculate 1068 divided by -4. -267 Calculate -6960 divided by 464. -15 1037 divided by 2 1037/2 -506 divided by -253 2 Calculate 230 divided by 48. 115/24 Divide 82 by -92. -41/46 Calculate 2 divided by 2002. 1/1001 Divide 192 by -48. -4 Divide -485 by -97. 5 Calculate -1794 divided by 23. -78 Divide -1593 by 27. -59 Calculate -240 divided by -4. 60 Calculate 121 divided by -11. -11 Divide -1070 by -5. 214 Divide 805 by -12. -805/12 What is 84 divided by 42? 2 What is 1 divided by -1333? -1/1333 Calculate 175 divided by -5. -35 -5 divided by 123 -5/123 Calculate -948 divided by 1. -948 Divide -306 by 9. -34 Calculate 0 divided by -30. 0 What is 35 divided by 3? 35/3 Divide 660 by 6. 110 Calculate -50 divided by 3. -50/3 What is -1016 divided by 2? -508 Calculate -21365 divided by 4273. -5 Divide 306 by 3. 102 2367 divided by 2 2367/2 504 divided by 9 56 -186 divided by -62 3 What is -456 divided by 6? -76 Calculate -176 divided by 44. -4 Divide 4 by -392. -1/98 102 divided by -9 -34/3 What is 5 divided by -1173? -5/1173 Divide -18444 by -3. 6148 Divide 0 by -32. 0 What is 1976 divided by -38? -52 Calculate -7 divided by 53. -7/53 Calculate 4 divided by 224. 1/56 What is -43430 divided by 5? -8686 What is 487 divided by -2? -487/2 -8360 divided by -2 4180 82 divided by 41 2 -5 divided by 322 -5/322 Calculate 14 divided by -1309. -2/187 What is -1116 divided by 2? -558 228 divided by -7 -228/7 Divide -261 by 1. -261 What is 72 divided by -2? -36 Calculate -2849 divided by 259. -11 What is 0 divided by -1035? 0 Calculate 7 divided by -58. -7/58 3 divided by 42 1/14 What is -260 divided by 5? -52 What is -575 divided by 115? -5 What is -869 divided by 5? -869/5 2622 divided by -874 -3 Calculate 81 divided by 27. 3 -138 divided by 16 -69/8 What is 24 divided by 40? 3/5 Divide -96 by 6. -16 1 divided by 1078 1/1078 What is 0 divided by -25? 0 Divide -1 by -39. 1/39 -148 divided by -1 148 Divide -75 by 12. -25/4 Calculate 8463 divided by -13. -651 873 divided by -1 -873 Calculate 1264 divided by 4. 316 Calculate -3 divided by -790. 3/790 What is 1455 divided by 5? 291 Calculate 30 divided by -6. -5 What is 6086 divided by 2? 3043 Divide 72 by -6. -12 Calculate -1 divided by 1245. -1/1245 What is -26 divided by 777? -26/777 -884 divided by -52 17 3759 divided by -1 -3759 Divide -1185 by 395. -3 Calculate 0 divided b	{ "pile_set_name": "DM Mathematics" }
9.7 + z. Let a = 0.108 - 0.108. What is the biggest value in a, j, 0.5? 0.5 Let m = -0.1025 - -0.1125. Let y = 5/6 + -7/12. Which is the third smallest value? (a) y (b) -1/5 (c) m a Let o = 52.974 + -53. Let z = o + -22.974. Let d = -27 - z. What is the biggest value in -5, d, -2, 4? 4 Let a be (3/6)/(645/(-258)). Let w(y) = -y*3 - 3y*2 - 1. Let o be w(-3). What is the second smallest value in -2/9, o, a? -2/9 Let v = 54 + -54.5. Suppose -14c + 12c = -6. What is the fourth biggest value in 1, v, 0.09, c? v Let j = -315.626 - -316. Let o = j - 0.774. Which is the fourth biggest value? (a) 0.03 (b) o (c) -1/4 (d) 1 b Let t be -15(-6 + (2 + 1)/((-335)/(-804))). Which is the third biggest value? (a) 0.07 (b) -1 (c) t c Let f = -0.002 - 10.498. Let u = f + 7.4. Let c = u + 2.1. What is the second biggest value in 3, -2, c? c Let b = -935/2 - -455. Let v = 7.665 - 7.265. What is the smallest value in v, b, 2? b Let y = 55/4 + -14. Let o = 165 + -417. Let k = o + 1762/7. Which is the second smallest value? (a) k (b) -4 (c) y a Let p = 6816 - 6827. Which is the biggest value? (a) p (b) -13/3 (c) -1 (d) -2/5 d Let x = -0.2 - -0.3. Let y = 2303.6 - 2304.1. Which is the biggest value? (a) 1.2 (b) x (c) y a Let k be (2 + 16/(-3))/((-16)/24). Let s be k/((-1300)/(-8))(-4 - 1). Which is the fourth biggest value? (a) s (b) 0.3 (c) -16 (d) 3 c Let b = -2635 - -2640. What is the second biggest value in 15, b, -36? b Let w = 1.2 - 1.4. Suppose 0 = -16u + 11u + 25. Suppose m - 7 = -uj + 13, 4m = -20. What is the smallest value in j, 2, w? w Let k = 48073 - 48073. Let i = 8 + -4. What is the second biggest value in -0.4, i, k, 11? i Let p = -7816.8 - -7817. What is the fifth smallest value in p, -0.06, 96/5, -5, 0.3? 96/5 Let h = 0.2 + -0.3. Let j = -369 + 16604/45. Let l = 47/90 + j. Which is the third biggest value? (a) l (b) h (c) -2/9 c Let z = 233 - 564. Let v = z - -330.7. Suppose -3o - 8 = 4h, 6h - 3h + 1 = -o. What is the third biggest value in -1, v, o? o Let u = -17.5 - -18.03. Let z = u - 4.53. Which is the second biggest value? (a) 5 (b) -0.12 (c) z b Suppose 0m = -2p + m - 13, -4m = 3p + 14. Let h be (-2)/p2/6. Let n = 15062.5 + -15063. Which is the third biggest value? (a) n (b) h (c) 6 a Let t = 109 + -106. Suppose n = tn + 6. What is the third smallest value in n, -12, -0.2? -0.2 Let c = 571 + -2283/4. Let t = 449/3 - 150. What is the biggest value in 0, t, 0.5, c? 0.5 Let g = -4663 - -4663. Let x(p) = -2p + 13. Let l be x(5). Which is the second smallest value? (a) l (b) g (c) 0.4 c Let r be (9548/55)/(-31) + 20. Which is the fifth biggest value? (a) 1 (b) -4 (c) 0.1 (d) 0 (e) r b Suppose 1219m - 1210m - 9 = 0. Suppose 0 = -27r + 32r. Which is the second smallest value? (a) 0.5 (b) r (c) m a Let q = -327/5 - -65. Let z = -1.18 + 3.05. Let h = 1.37 - z. Which is the smallest value? (a) h (b) -0.2 (c) q a Let w = 61/2 + -675/22. Let h = -0.29 + 0.18. Let k = h - -4.11. Which is the third biggest value? (a) w (b) k (c) -1/3 c Let s = 11833.3 - 11833. What is the third smallest value in -7/241, 0.2, s? s Let o(n) = n*3 + 3n*2 - 14n - 10. Let v be o(-5). Suppose -608q - v = -613q. Let r = 1352/9 + -150. What is the second smallest value in q, r, 6, 2/7? 2/7 Let h = 0.3 + -0.1. Let f = 2/460835 + -1843354/3225845. Which is the third biggest value? (a) 0.3 (b) f (c) h (d) 4 c Let g = -3757 + 3752. Which is the third biggest value? (a) -2840 (b) g (c) 0.5 a Suppose -923 = 4l - 851. Let p be (l/15)/(16/20). What is the third biggest value in -0.11, -3, 0, p? p Let i = 5.4246 + -2.4246. Let h = 4.96 - -0.04. What is the smallest value in h, 0.09, i? 0.09 Let f(p) = -p3 - 59p*2 + 50p - 601. Let j be f(-60). Let y be (2/6)/(4/3). Which is the second smallest value? (a) j (b) y (c) 19/2 b Let t = 3254 + -3252. Which is the biggest value? (a) 1/9 (b) 1/18 (c) t (d) 2/37 c Let w = 3.9241 - -0.0759. What is the third biggest value in 0.1, -2/7, -4, -6.7, w? -2/7 Let z = 27/142 + -25/6106. What is the second smallest value in -4, -3, z? -3 Let t = 17474 - 17478. What is the biggest value in t, -1/3, -3? -1/3 Let m = 2402/21 + -26464/231. Which is the third biggest value? (a) -5 (b) -2/905 (c) m a Suppose -3n + 352 = 5a + 41, 4a - 2n - 262 = 0. Let i = -64 + a. Let z = 3.25 - 0.25. What is the biggest value in i, -4, z? z Let d = 544.2 - -10.8. Let f = d - 555.4. Which is the smallest value? (a) -3 (b) f (c) 523 a Let d = 3.925 + -6.425. What is the biggest value in d, 56, 2/11? 56 Let y = 0.1238 - -0.0762. What is the second biggest value in y, 8/5, -0.4, -5, 0.6? 0.6 Let k = -8.8 - -5.8. Suppose -4t + r = -10, -4 + 0 = 2r. Let x be (t/3)/(8/6). What is the fourth smallest value in k, 3, 0, x? 3 Let z = 32.5 - 32. Let n be 3/(-43) - (-59)/(-4). Let v be 0/(n/93). Which is the third smallest value? (a) v (b) z (c) -4 (d) -0.03 a Let r be (-14442)/(-783) + -36. Which is the smallest value? (a) -5/2 (b) -1.6 (c) r (d) -3 d Let d = 12.62 - 10.62. What is the biggest value in d, -0.5, -0.4, 17? 17 Let t = -2.6036 - 1.3964. What is the second biggest value in 2/7, t, -378, 3? 2/7 Let n = -22717 - -22712. Suppose q - 7 = 1. Which is the third biggest value? (a) -3 (b) q (c) n (d) -2/17 a Let v = -0.05 + 0.59. Let n = -1.04 + v. What is the biggest value in 12, n, 0.3, -4? 12 Let y = -4302.55 - -4303. Which is the second biggest value? (a) -2/5 (b) -2 (c) 2 (d) y (e) 3 c Let l = 266/9 - 584/9. Which is the third biggest value? (a) l (b) -1 (c) -2 a Let z be (-2)/(2 - (-1)/(-3)). Let n = -165 + 164.9. Let o be 1 + 5 + 125/(-20). What is the smallest value in n, z, 0, o? z Let q = -275 + -59. Let v = -334.1 - q. Let h = 1.4 + 0.6. Which is the second biggest value? (a) h (b) 0.2 (c) -1.1 (d) v b Suppose -1564 = -14r + 1418. Let f = r + -208. Let l be (-1)/((-3)/(-6)7). Which is the second biggest value? (a) 3/5 (b) f (c) l a Let x = -2283.3 - -2194. Let g = 89 + x. Which is the second smallest value? (a) 26 (b) g (c) -1/4 c Let t = 28163.94 + -28164. What is the biggest value in -0.1, -1, t, 8/5? 8/5 Let k = 5511 - 5514. Let z be (3 - 0)/(21/2). Which is the third smallest value? (a) 0.1 (b) k (c) z c Let t be 3/(-8)40/90. Suppose 5p - 34 = 3m, 60 = 4m - 5p + 97. Which is the third smallest value? (a) t (b) -0.17 (c) m a Let o = 349 + -254. Suppose 31 + o = 42p. Which is the second smallest value? (a) -3/8 (b) 10/3 (c) p (d) 4 c Suppose -j = -5b + 3, -4b - j + 0 = 3. Suppose b = h - 0h + 4m + 13, 5h = 5m - 15. Let c = 9/2 + h. What is the smallest value in c, -2, -14? -14 Let z = -2.4 + 2. Let w be 130/(-6) + 32/((-352)/(-231)). What is the third smallest value in -10, z, w? z Suppose 305 - 103 = -4z - 5l, 140 = -3z + 2l. Let q be (10 + 488/z)4/6. What is the second smallest value in 0.2, -2, q? q Let d = -4518 - -4539. What is the second biggest value in d, 1, -3? 1 Let n(g) = -19g2 - 127g - 84. Let t be n(-6). Which is the third smallest value? (a) 4.4 (b) 0.3 (c) t a Let v = 167.9 + -168. Suppose -2 = -6l + 4l. Let h be 1 - 2 - (l - 0). Which is the second smallest value? (a) v (b) -0.4 (c) -3 (d) h d Let o = 75.5 + -161. Let t = 85 + o. What is the second smallest value in -0.2, t, 1? -0.2 Suppose -w + 3z = -16, 340z - 8 = w + 343z. What is the second biggest value in -1.7, 0.1, w, -0.1? 0.1 Let d = -14.14 + 7.12. Let i = 1.02 + d. Let x = 1.7 + -2. Which is the third smallest value? (a) x (b) 0.5 (c) i b Let r = -201.2 - -24.2. Let t = -181 - r. What is the smallest value in 0, -6/11, t? t Let t = -7 - -2. Let w be ((-30)/(-105))/((-66)/(-42)). Which is the third smallest value? (a) -0.1 (b) w (c) t b Let b = 318 + -332.7. Let d = 15 + b. Let i be 0 - -2(-12)/264. What is the third smallest value in 3, i, d? 3 Let k be -4 + 1 - ((-4939)/990 + 2). Which is the biggest value? (a) k (b) -0.2 (c) 2 c Let u = -4.77 - -3.919. Let i = u + 0.841. Which is the third biggest value? (a) -3/2 (b) i (c) -3/5 (d) 3 c Let j be 2 - (2 - 25/10)/(7 - 8). Let q = 0.1 + 0. Let p = q - 0.4. Which is the second smallest value? (a) p (b) 2/7 (c) j b Let h be (-1 - 22/(-26))/(388/(	{ "pile_set_name": "DM Mathematics" }
175))*22. 20sqrt(7) + 352 Simplify (-2 + sqrt(1008)2)*2-1. -4036 + 96sqrt(7) Simplify 2(0 + sqrt(176))*2. 352 Simplify sqrt(12)/sqrt(216) - sqrt(16)/(sqrt(24)/sqrt(3) + sqrt(8)). -sqrt(2)/3 Simplify -32sqrt(5) + 1 - (-4 + 2sqrt(5) - (2sqrt(35))/sqrt(7)). -6sqrt(5) + 5 Simplify 5 + -1sqrt(612) - (sqrt(612) + 0 + sqrt(612)-1)*2. -6sqrt(17) + 5 Simplify ((sqrt(133) - sqrt(133)1)2 - sqrt(133))/(-2sqrt(14)/sqrt(2)). sqrt(19)/2 Simplify (-4-2sqrt(76) + 1)2 + 0. 32sqrt(19) + 4865 Simplify -3 + (sqrt(19) - ((sqrt(19) - sqrt(475)) + 1)) + sqrt(19). -4 + 6sqrt(19) Simplify -5 + (-2 + sqrt(13) + sqrt(1053) + 0)2. -40sqrt(13) + 1299 Simplify (3 + sqrt(6)/(sqrt(432) + (sqrt(432) + sqrt(432) + 2sqrt(432) + sqrt(432) - sqrt(432)) - sqrt(432) - sqrt(432) - sqrt(432)))2. sqrt(2)/4 + 2593/288 Simplify sqrt(19) + sqrt(76)/sqrt(4) + 1 - (3 + sqrt(19) + sqrt(76)). -sqrt(19) - 2 Simplify 4 + ((sqrt(30) + sqrt(120) + sqrt(30))/sqrt(6) - (sqrt(5) + -3 + sqrt(10)/sqrt(2)))2. 12sqrt(5) + 33 Simplify sqrt(15)/(sqrt(5) + 1sqrt(5) - sqrt(5)) + -1. -1 + sqrt(3) Simplify (sqrt(39)-2-5)/(sqrt(600)/sqrt(8) + sqrt(3)). 5sqrt(13)/3 Simplify (-2 + (sqrt(125) - sqrt(125)3))2. 40sqrt(5) + 504 Simplify -4 + (sqrt(252) + -5 + sqrt(252)1 + sqrt(252))3. -19 + 54sqrt(7) Simplify sqrt(50)/(sqrt(490) + (sqrt(490) - sqrt(490)-2) - sqrt(490)) + -1. -1 + sqrt(5)/21 Simplify 1 + sqrt(114)/((sqrt(6) + sqrt(18)/sqrt(3))-3). -sqrt(19)/6 + 1 Simplify -5sqrt(1053)-1 + 0. 45sqrt(13) Simplify (-4 + sqrt(684)-3)2. 144sqrt(19) + 6172 Simplify (2 + 6sqrt(300))2. 240sqrt(3) + 10804 Simplify (sqrt(128) - (sqrt(128) + sqrt(128)1-2))*2 + -4. 508 Simplify (2sqrt(32) + sqrt(2) - sqrt(2) - (-3sqrt(10) + sqrt(10))/sqrt(5))2. 200 Simplify ((sqrt(18) - (sqrt(18) + 1sqrt(18)))1)/(4sqrt(18)/sqrt(2)). -sqrt(2)/4 Simplify (sqrt(5) - sqrt(25)/sqrt(5))2 + sqrt(5)-4-3. 12sqrt(5) Simplify 21(-5 + sqrt(7) + -5). -20 + 2sqrt(7) Simplify ((sqrt(156) - (sqrt(156) + (sqrt(156)3 - sqrt(156) - sqrt(156))))-4)/((sqrt(60)-3)/sqrt(5)). -4sqrt(13)/3 Simplify 1(-5 + sqrt(19) + -1). -6 + sqrt(19) Simplify (-4 + (sqrt(637) - (1 + (sqrt(637) - (sqrt(637) + -2sqrt(637))) - sqrt(637))))2. 25 Simplify (0 + (sqrt(19) + 1)65)2. 1800sqrt(19) + 18000 Simplify ((sqrt(68) + -4(((sqrt(68)-1 - sqrt(68)) + sqrt(68) + sqrt(68) + sqrt(68) - sqrt(68)) + sqrt(68)) - sqrt(68)) + sqrt(68))/sqrt(4). -3sqrt(17) Simplify sqrt(156)/((sqrt(48)-5)/sqrt(4) - sqrt(12)). -sqrt(13)/6 Simplify 1(-4 + (2sqrt(17) - sqrt(17))*21). 13 Simplify ((-2sqrt(76))/sqrt(4))2 - (sqrt(19) - (sqrt(19) + 0))3. 76 Simplify (sqrt(204)21)/((sqrt(96)-3)/sqrt(8)). -2sqrt(17)/3 Simplify (sqrt(19) - sqrt(228)/(2sqrt(12)) - ((sqrt(19) - ((sqrt(171)2)/sqrt(9) + sqrt(19) - sqrt(19))) + sqrt(19)))*2. 19/4 Simplify 3(6sqrt(128) + sqrt(128))2. 18816 Simplify (sqrt(272) + (-1 + sqrt(272))2 + sqrt(272) - sqrt(272))*2. -48sqrt(17) + 2452 Simplify (sqrt(1800) + -1 + -4 + sqrt(50)2)2. -400sqrt(2) + 3225 Simplify -4sqrt(38)/sqrt(2) + 4. -4sqrt(19) + 4 Simplify (sqrt(128) + 2)*2. 32sqrt(2) + 132 Simplify ((sqrt(190)/(sqrt(80) - sqrt(5)))/(4sqrt(8)/sqrt(4)))2. 19/144 Simplify ((3 + sqrt(325))4)*2. 480sqrt(13) + 5344 Simplify -4 + (sqrt(11) - (sqrt(33)/(sqrt(3) - sqrt(3)-3))2). -75/16 + sqrt(11) Simplify (sqrt(33) - sqrt(1188)2)/sqrt(11). -11sqrt(3) Simplify -4 + ((sqrt(2268) + -1 - sqrt(2268)) + sqrt(2268))2 + sqrt(63). -33sqrt(7) + 2265 Simplify sqrt(108) + -3(sqrt(108) + (sqrt(108) - (0 + sqrt(108)) - sqrt(108)))2. 6sqrt(3) Simplify 5(-3(sqrt(4)/sqrt(2) + 5) + -2). -85 - 15sqrt(2) Simplify -4(-6sqrt(147) - sqrt(3)). 172sqrt(3) Simplify (sqrt(84)/(sqrt(12) + sqrt(2352)))*2. 7/225 Simplify (sqrt(240)/sqrt(6))/sqrt(8)-4. -4sqrt(5) Simplify 5(sqrt(2) + -2)*2 - (4(sqrt(2) - 1sqrt(2)))2. -20sqrt(2) + 30 Simplify ((sqrt(68) + 1)1)2. 4sqrt(17) + 69 Simplify (-4 + 1 + sqrt(704) + sqrt(704))*2. -96sqrt(11) + 2825 Simplify (sqrt(7) - sqrt(1008)-4)2 + 5. 16812 Simplify (4 + 6(-5 + 2sqrt(18)))2. -1872sqrt(2) + 3268 Simplify -3 + (4sqrt(19)-2)*2. 1213 Simplify (sqrt(33) + sqrt(132)-1)/(sqrt(22)/(sqrt(4)/sqrt(2))) + 0. -sqrt(3) Simplify (sqrt(27) + sqrt(675))/sqrt(9) + sqrt(24)/(sqrt(8) + sqrt(8)-3 + sqrt(8)). 5sqrt(3) Simplify (6sqrt(18)/(sqrt(1089) + sqrt(1089) + -1sqrt(1089) + sqrt(1089) + sqrt(1089) + sqrt(1089)))*2. 9/242 Simplify (sqrt(208) + -2sqrt(208))*2 - (-2sqrt(1872) + sqrt(1872)) - (-5 + sqrt(13)2 - (sqrt(39)/sqrt(3) + -4)). 11sqrt(13) + 209 Simplify -2(-3 + sqrt(2)-2). 4sqrt(2) + 6 Simplify sqrt(104)/(sqrt(288)3). sqrt(13)/18 Simplify ((sqrt(8208)-2 - sqrt(57))/(-6sqrt(12)/sqrt(4) + sqrt(3) + sqrt(3)))*2. 11875/16 Simplify 1sqrt(112) + 1. 1 + 4sqrt(7) Simplify (sqrt(88) - (sqrt(88) + -5(sqrt(88)1 - sqrt(88)) + sqrt(88)))/(sqrt(512)2). -sqrt(11)/16 Simplify 0 + (2 + sqrt(612))3. 6 + 18sqrt(17) Simplify ((sqrt(99) - (-1-2sqrt(99) - sqrt(99)))/(4sqrt(18)/sqrt(2)))2. 0 Simplify sqrt(24)/sqrt(3)-4. -8sqrt(2) Simplify -1 + -1((3sqrt(8)/sqrt(4))2 + -5). -14 Simplify (sqrt(2) - sqrt(32)2)-4. 28sqrt(2) Simplify ((sqrt(300) + -2)-6 - sqrt(300))2. -1680sqrt(3) + 14844 Simplify -1 + sqrt(720)3. -1 + 36sqrt(5) Simplify ((sqrt(7) - (-2 + sqrt(7))) + 0)2 - (sqrt(35)/(sqrt(5) - sqrt(80)))2. 29/9 Simplify sqrt(3) + 4 + sqrt(48) - (sqrt(243) + -2). -4sqrt(3) + 6 Simplify (-2 + 1sqrt(18) + sqrt(18))*2 - (1 + sqrt(72)/sqrt(4) + sqrt(18)). -30sqrt(2) + 75 Simplify sqrt(57)/sqrt(3)-1 - sqrt(684)2. -13sqrt(19) Simplify (sqrt(13)-1-4 + 2sqrt(1300))*2 - (sqrt(39)/sqrt(3) + 5)5. -5sqrt(13) + 7463 Simplify sqrt(44) + -2 + -5. -7 + 2sqrt(11) Simplify 2 + (sqrt(19) + -4 + sqrt(19))*2-2. -182 + 32sqrt(19) Simplify -3 + (sqrt(72)-2 + 4)*2. -96sqrt(2) + 301 Simplify sqrt(136)/(sqrt(72)/(sqrt(36)/sqrt(4))) + -3((sqrt(17) + -1)3)*2. -486 + 55sqrt(17) Simplify ((sqrt(125)-3 + sqrt(125))/sqrt(5))/((sqrt(60)-3)/sqrt(12)). 2sqrt(5)/3 Simplify (-4-4(sqrt(2) + -2))2. -1024sqrt(2) + 1536 Simplify -6((sqrt(76) - (sqrt(76) + ((sqrt(76) - (sqrt(76) + sqrt(76) + 0)) + sqrt(76))3 - sqrt(76))) + (-2sqrt(76))2-3). -12sqrt(19) + 5472 Simplify (sqrt(270)/sqrt(96))/(sqrt(9) + sqrt(441) + 2sqrt(441)). sqrt(5)/88 Simplify -1sqrt(19) + 4 + sqrt(190)/sqrt(90). -2sqrt(19)/3 + 4 Simplify (2sqrt(80))24 - ((sqrt(80)-1)2 + 5). 1195 Simplify (52(sqrt(448) - sqrt(448)-2))*2. 403200 Simplify (3(sqrt(13) + sqrt(13) + sqrt(832) + -1))*2. -180sqrt(13) + 11709 Simplify (sqrt(17) + (sqrt(34)/sqrt(32) - sqrt(17)))-4. -sqrt(17) Simplify sqrt(272) + 1sqrt(272)-1. 0 Simplify -3(sqrt(3) + (0 + sqrt(30)/sqrt(10) - sqrt(3))*2). -3sqrt(3) Simplify (sqrt(2057)-1 + sqrt(2057))4. 0 Simplify (-2(sqrt(325) + sqrt(325) + 0 + -1))2. -80sqrt(13) + 5204 Simplify (-1 + (sqrt(1377) - 2sqrt(1377)))2. 18sqrt(17) + 1378 Simplify ((sqrt(10)2)/sqrt(2))2 + -4. 16 Simplify (sqrt(24)/(sqrt(8) - (1sqrt(8) - sqrt(8))) + -1)5. -5 + 5sqrt(3) Simplify sqrt(4)/(1sqrt(2)4)3. 3sqrt(2)/4 Simplify 4-1(3 + sqrt(3) - sqrt(3)). -12 Simplify ((sqrt(2268) - (sqrt(2268) - (sqrt(2268) + -2sqrt(2268)))) + sqrt(2268) + sqrt(28))/((sqrt(32)1)/sqrt(8)). sqrt(7) Simplify sqrt(325) + 0 + (sqrt(13) - sqrt(143)/(sqrt(44)/sqrt(4)))*2. 5sqrt(13) Simplify (-1sqrt(171)-2)/(-3sqrt(144)). -sqrt(19)/6 Simplify (-53sqrt(363)-4)*2. 1306800 Simplify (1(2 + sqrt(891)) + 3sqrt(891) + -5)2. -216sqrt(11) + 14265 Simplify (sqrt(32)-3 + -1 + (2sqrt(2) + sqrt(2) - sqrt(2) - sqrt(2)))*2. 22sqrt(2) + 243 Simplify (sqrt(11) - (sqrt(11)1 - sqrt(11)) - sqrt(11))24 + sqrt(11) - (sqrt(176) + 1 - sqrt(176) - sqrt(11))*2. -12 + 3sqrt(11) Simplify (4(sqrt(95) + sqrt(95)-1))/sqrt(5) - (sqrt(228)/(sqrt(24)/sqrt(2)))*24. -76 Simplify ((-2sqrt(336))/(sqrt(1575)/sqrt(9) - sqrt(7)))2. 12 Simplify (6-2sqrt(22))/sqrt(11). -12sqrt(2) Simplify (sqrt(171)-1 + sqrt(171))4 + ((sqrt(171) - (sqrt(171)2 + sqrt(171)))5 - sqrt(171))2. 20691 Simplify (sqrt(22)/sqrt(32))2 - (-1 + sqrt(44)). -2sqrt(11) + 27/16 Simplify sqrt(63) - sqrt(63)1 - sqrt(21)/sqrt(108). -sqrt(7)/6 Simplify (1 + sqrt(245))*2-6*-6. 504	{ "pile_set_name": "DM Mathematics" }
Let c be (-4)/(-1) - (1 + (-10)/5). Suppose 96 = 4v + 3d - 80, 5d + 255 = cv. Does 26 divide v? False Let f(x) be the third derivative of -x*4/24 + 4x*3 + 11x*2. Is f(0) a multiple of 12? True Let g(i) = -2i*3 + 12i*2 + 13i - 54. Is 19 a factor of g(5)? False Let k be 333/(-12)(-32)/(-12). Let c = 122 + k. Is 3 a factor of c? True Suppose 8o - 152 - 352 = 0. Does 7 divide o? True Let i = -38 - -19. Let a = i + 13. Is (34-2)/(a + 4) a multiple of 17? True Suppose -5p + 10 = -10. Let b(g) = -9g + 2. Let f be b(p). Is f/(-3) - 6/(-9) a multiple of 12? True Suppose -5v + 814 = 59. Does 15 divide v? False Let s(c) be the second derivative of -c*4/12 - 3c*3/2 + 9c*2 + 18c. Is 9 a factor of s(-9)? True Suppose -8v + 9v - 5 = 0. Let w = 1 + -1. Suppose w = 5l - vi - 81 - 154, 2l - i - 93 = 0. Does 14 divide l? False Suppose n - 5 + 3 = 2a, -14 = -3n + 4a. Suppose ny = 5y + 670. Is 23 a factor of y? False Let n(l) be the third derivative of -l*6/120 + 11l5/60 - l4/3 + 2l3/3 + 8l*2. Is 24 a factor of n(7)? True Suppose -4314 - 1521 = -5t + 3b, 3t - 2b - 3500 = 0. Is t a multiple of 78? True Let y(l) = l3 - 24l*2 + 22l + 26. Let d be y(23). Suppose 2n - 145 = c, -dc = -4n - 0n + 285. Is 15 a factor of n? True Suppose u + 4t = 4u + 14, 5t - 31 = -3u. Let m(c) = -2c + 6c + 7 + 0cu + c2. Is 23 a factor of m(4)? False Suppose -246 = -4p + 114. Let n be -8 + 7 - 106/2. Let r = n + p. Does 18 divide r? True Let v = -388 + 728. Is v a multiple of 28? False Let w(v) = -11v + 15. Let y be (0 - 0) + (-35)/7. Is w(y) a multiple of 23? False Let y be 1 - (-3 - (1 - 2)). Let w be (-7)/y - (-9)/27. Is 16 a factor of (-2 - w) + 2 + 31? False Let j(l) = l3 - 8l*2 + 2l - 12. Let u be j(8). Let p(c) = 1 + c*2 + 7 - 5 - uc. Is 12 a factor of p(7)? True Let k(l) = 49l + 88. Is k(30) a multiple of 19? True Suppose 4v = 3l + 564, 4v = v - 2l + 440. Suppose 7s = 4s + v. Does 24 divide s? True Let a = -6 + 6. Suppose -2o + 35 + 5 = a. Does 14 divide o? False Let p(f) = -f + 13. Suppose 4j = -2j + 60. Let c be p(j). Is 1713/c a multiple of 17? True Let m(p) = 3p2 + 20p + 19. Let r(o) = -o*2 - o. Let d(n) = -m(n) - 2r(n). Does 19 divide d(-14)? False Suppose 6g + 2362 = f + 4g, 4f - 2g = 9466. Is f a multiple of 74? True Let t = 23 + -19. Suppose r = -p - 3p + 24, t = 2p. Is 8 a factor of r? True Suppose -44m + 223354 = -11210. Is m a multiple of 23? False Let u(p) = 23p + 10. Does 20 divide u(10)? True Let c(a) = -8a + 1. Let g be c(-1). Let h(v) be the third derivative of v4/8 - v3/6 - 23v*2. Does 13 divide h(g)? True Suppose -9c = -6c + 393. Let x = -51 - c. Does 16 divide x? True Let g(t) = -t3 + 7t*2 + 14t - 91. Let f be g(6). Let c(r) = r*3 - r + 4. Let z be c(0). Suppose -zj - f = -133. Does 13 divide j? True Let w(f) = 5f + 11. Let j be w(-7). Let c = j - -3. Is (-14)/c + 318/9 a multiple of 8? False Let p(o) = 17o + 93. Is 9 a factor of p(21)? True Suppose 107 + 101 = 4l. Suppose -2a = u - l + 11, -174 = -4u - 3a. Is 9 a factor of u? True Let y = -33 + 39. Suppose 0 = -3k - 5v + 448, k - 4v + 764 = yk. Is k a multiple of 39? True Let m be 981(2 - (-15)/(-9)) - -3. Suppose 44f = 41f + m. Is f a multiple of 11? True Suppose 19g - 18g - 2 = 0. Is 1 - ((-1)/(g - 3) + -165) a multiple of 33? True Let v be (4/8)/((-1)/(-6)). Suppose 5x = vb - 71, b + x + 4x - 17 = 0. Suppose -4i = -334 + b. Is 27 a factor of i? False Let x = 2 - -6. Let i(g) = g3 - 9g*2 + 8g + 5. Let u be i(x). Suppose m + 105 = ur - 2m, 0 = -5r - 3m + 135. Is r a multiple of 6? True Suppose -4d - 12 = -2d. Let s(q) = 2q2 + 5q - 1. Let b be s(d). Suppose -4 - b = -x. Does 15 divide x? True Let t be 46/(-3)(62 - 65). Let u(p) = -p2 + 6p - 5. Let w be u(4). Is t - (w + -8 - -1) a multiple of 25? True Suppose f + 5 = -4f. Suppose 7j + 10 = 12j. Is 6 a factor of j - (-22 + 0) - f? False Let n be (2/(-3))/(-1)3. Suppose r - nx = -r + 62, -r - 5x + 55 = 0. Does 14 divide r? False Let r = -2154 + 5634. Is 40 a factor of r? True Is 21 a factor of ((-49)/(-4))/((-4)/(-432))? True Does 117 divide (-6)/21 - -2(-22122)/(-63)? True Let n = 70 - 119. Suppose -4o + 2v = -394, -3o + 6o + 2v - 313 = 0. Let u = o + n. Does 10 divide u? False Let h = -356 + 524. Is h a multiple of 7? True Suppose 6l - 24 - 30 = 0. Suppose 1150 = lz - 389. Is z a multiple of 19? True Let c(r) = -r*3 + 20r*2 - 50r + 17. Does 3 divide c(15)? False Let k be (0 - (-4)/(-12))-21. Suppose ku - 5u = 0. Suppose -4v = j - 34, -5v = 3j - uv - 116. Is j a multiple of 26? False Suppose 9l = 4l + 10. Let i(n) = 36n - 3. Is 10 a factor of i(l)? False Suppose 0 = -2m - 2565 - 2101. Let i = m - -776. Does 8 divide i/(-54) + (-1)/(-6)? False Let d be (-18)/4 - (-2)/(-4). Let c = -1 - d. Suppose -25 = -cq + 19. Is q a multiple of 11? True Let o(f) = 2f3 - 3f*2 + 5f - 3. Does 12 divide o(6)? False Let y(v) = -20v - 95. Is y(-9) a multiple of 37? False Let a(u) = 2u*2 - 50u + 92. Is 7 a factor of a(30)? True Let k be 12/(-12)42/(-1). Suppose 3b = 2r + b - k, 4r = 2b + 74. Does 4 divide r? True Suppose 51 = 2l + 4q - 19, 5q + 75 = 4l. Suppose -6a = -a - l. Suppose -2c = 0, am + 2c - 35 - 5 = 0. Does 4 divide m? True Let k = -9 + 15. Is (k/10)/(14/350) even? False Let g = -236 - -589. Is 10 a factor of g? False Let p be 0 - 2 - (0 + 2). Let d = -4 - p. Let q(h) = h3 + 8. Is 8 a factor of q(d)? True Does 3 divide 3/(-3)29/(-1)? False Suppose 3q - 948 = -192. Suppose 4v - q = -4b, v = 3b - v - 169. Does 15 divide b? False Let h be 5158/5. Suppose 6 = -5a + 3a - 3r, -a - 2r - 3 = 0. Is a/(-9) + h/6 a multiple of 10? True Is 10 a factor of (-7 - (-4 - -2)) + (36 - -295)? False Suppose 9 + 19 = 4f - 4q, 0 = -3f - 2q + 6. Is (-1)/(-3f/588) a multiple of 49? True Let f be (-1)/(-3) - 14560/(-42). Suppose -2r = -t + 5t - 476, f = 3t - r. Suppose -5 = 4m - t. Is m a multiple of 14? True Let g(v) = -13v - 6v - 19 + 0v - v*2. Is 6 a factor of g(-13)? False Let t be ((-3)/(18/4))/(14/(-861)). Let f = t + 67. Does 12 divide f? True Let z = -4969 - -7324. Does 12 divide z? False Let i(w) = 9w*2 - 25w - 6. Let d(r) = 6r2 - 17r - 4. Let s(q) = -7d(q) + 5i(q). Is s(4) a multiple of 4? False Let v be (-2 + 156/15)-5. Let p = v + 15. Is (3 + p/6)-4 a multiple of 6? True Let l be (-3)/(-4) - 10/(-8). Suppose 5s - 17 + 397 = 5a, ls = -3a + 238. Is 26 a factor of a? True Let x(o) = -6o - 5. Let c be x(13). Let k = 22 + -147. Let t = c - k. Does 10 divide t? False Let o = 384 + -333. Is o a multiple of 2? False Let d(n) = 10n*2 + 7n + 109. Is 69 a factor of d(-11)? True Let g(w) = 5w2 - 2w - 3. Let s(c) = 2c3 - 2c2 - c + 1. Let n(j) = j3 + j*2 + 1. Let k(x) = n(x) - s(x). Let t be k(3). Is g(t) a multiple of 12? True Let h(s) = 152s*2 - 43s + 81. Does 67 divide h(2)? True Let s(h) = h*3 + 26h*2 + 10h + 103. Does 7 divide s(-24)? True Let c be -3(-4)/(-3) - 64/(-8). Does 29 divide 2/c - 11466/(-36)? True Suppose 3a - 25 = -4c + 120, 20 = 5c. Let h = a - -33. Is 17 a factor of h? False Suppose 5t + 5s - 10 = 0, t - 2s + 12 = 2. Is 20 a factor of -2 + t + 3 + 61? True Let y be 0/(7/((-7)/(-2))). Let r(b) = -2 + 10 - b + yb + 2b. Is r(6) a multiple of 7? True Is 24 a factor of ((-3288)/9)/((-3)/27)? True Let u(b) = -b3 - 7b*2 + 16b + 14. Let l be u(-7). Let p = -49 - l. Is p a multiple of 6? False Suppose -4u + 0u = 2g + 22, -3u + 2g = 34. Let r be -3 + -2 + 7 + u. Is 11 a factor of r(0 + (-33)/9)? True Let k be ((-16)/(-10))/(6/(-15)). Does 8 divide (66/k)/(4/(-8))? False Suppose c + 3f = 16, -c + 3f + 4 - 18 = 0. Suppose -c = 5g - 4g. Is (9 - (g - -4)) + 1 a multiple of 3? False Suppose 2m = -529 + 1617. Suppose -v + 47 = 5p - 104, -4v - 5p + m = 0. Is 7 a factor of v? False Suppose 2l = 3m + 22, -4l = 2m - 3m - 24. Suppose 6w + 230 = -ly + 3w, w + 48 = -y. Let d = y + 87. Is 22 a factor of d? True Let x be (180/8 + 4)/((-1)/(-6)). Suppose 0 = 5u - 3b - 560, -3u - x + 495 = b. Is 14 a factor of u? True Is (1 - 3140/8)(-112)/84 a multiple of 21? False Let v(g) = g*2 + 13g +	{ "pile_set_name": "DM Mathematics" }
) to base 3. 122110220 What is -68 (base 9) in base 2? -111110 Convert 244 (base 15) to base 14. 28a Convert -2300132 (base 4) to base 9. -16438 Convert 14 (base 10) to base 5. 24 Convert -350 (base 7) to base 3. -20202 What is -1132 (base 4) in base 9? -114 -4ce (base 16) to base 13 -738 What is -101011000110010 (base 2) in base 5? -1201231 1c1 (base 16) to base 14 241 Convert 200211010 (base 3) to base 5. 414334 What is -2320 (base 4) in base 9? -224 What is -8de (base 15) in base 3? -2202102 -102663 (base 8) to base 14 -c68b -22318 (base 13) to base 8 -171134 What is 162a (base 14) in base 2? 111101110110 Convert 6663 (base 7) to base 3. 10021210 What is 138 (base 13) in base 2? 11011000 Convert -107b5 (base 12) to base 16. -5579 Convert 36199 (base 12) to base 10. 72837 -1110111 (base 2) to base 5 -434 -4011430 (base 5) to base 13 -22ac3 3440344 (base 5) to base 12 2ba46 26770 (base 10) to base 7 141022 What is 2145 (base 6) in base 13? 2c3 35434 (base 6) to base 10 5134 What is -14365 (base 7) in base 3? -12102221 What is 10201 (base 4) in base 2? 100100001 What is -1252 (base 8) in base 10? -682 What is -110020212 (base 3) in base 15? -29a8 -526 (base 9) to base 5 -3204 6305 (base 7) to base 8 4242 1110110001011000 (base 2) to base 14 1809a Convert 46a2 (base 12) to base 11. 5a30 1645 (base 7) to base 6 3034 c3d (base 16) to base 12 1991 Convert 1081 (base 9) to base 2. 1100100010 1b07c (base 13) to base 14 15379 Convert -1d38 (base 14) to base 6. -40422 Convert -2021 (base 6) to base 3. -121111 Convert 9770 (base 14) to base 6. 321050 -220221 (base 3) to base 16 -2a1 What is -260536 (base 8) in base 5? -10343322 What is a12b (base 13) in base 14? 8120 Convert -729 (base 12) to base 6. -4453 What is 4d48 (base 16) in base 14? 72d2 Convert -43387 (base 9) to base 3. -1110102221 What is 89 (base 15) in base 5? 1004 -14049 (base 10) to base 14 -5197 Convert -31 (base 11) to base 9. -37 What is -2003 (base 4) in base 8? -203 What is 296b (base 13) in base 4? 1131310 Convert -4881 (base 13) to base 4. -2200011 What is -120541 (base 7) in base 15? -673d Convert 2a (base 14) to base 3. 1102 What is 1111110 (base 2) in base 6? 330 What is -324100 (base 6) in base 8? -64304 Convert 2026 (base 12) to base 11. 268a What is -6af (base 16) in base 14? -8a3 What is 5a5 (base 14) in base 11? 933 -10312 (base 5) to base 11 -593 What is a5 (base 14) in base 9? 171 What is -1301 (base 5) in base 15? -d6 -ed4 (base 16) to base 8 -7324 -11120120 (base 3) to base 9 -4516 Convert 110323 (base 6) to base 10. 9195 -210002 (base 4) to base 11 -1807 Convert -1568 (base 13) to base 4. -300320 What is -dd (base 14) in base 2? -11000011 What is -2223 (base 4) in base 5? -1141 -52580 (base 9) to base 11 -24112 Convert 12011120 (base 3) to base 2. 111010111000 -2702 (base 11) to base 5 -103021 What is -1000 (base 3) in base 15? -1c Convert 150200 (base 6) to base 15. 43a3 323 (base 6) to base 11 102 Convert 5c4 (base 13) to base 3. 1101020 Convert 43774 (base 8) to base 16. 47fc What is 748 (base 13) in base 10? 1243 What is 77e (base 16) in base 3? 2122001 What is 395 (base 14) in base 8? 1317 -821 (base 14) to base 12 -b11 3714 (base 13) to base 14 2ba7 Convert -2aa (base 11) to base 6. -1402 What is 4200 (base 5) in base 13? 334 -1241133 (base 6) to base 12 -331a9 What is 1555 (base 8) in base 10? 877 Convert 15a6 (base 12) to base 8. 5016 Convert -242 (base 15) to base 8. -1000 -1a81 (base 11) to base 16 -a46 What is 1202212 (base 3) in base 13? 785 57ac (base 13) to base 14 46b4 Convert -1434002 (base 5) to base 6. -353114 Convert 13874 (base 13) to base 3. 1212012112 What is -15116 (base 7) in base 15? -1388 Convert -2031001 (base 4) to base 10. -9025 3ca7 (base 14) to base 4 2213223 Convert -10169 (base 11) to base 16. -39f5 What is 11e (base 15) in base 11? 211 What is 2220 (base 7) in base 5? 11143 229 (base 14) to base 8 655 What is 102 (base 12) in base 2? 10010010 -102043 (base 5) to base 14 -134a -4260 (base 12) to base 16 -1c68 What is -533 (base 9) in base 4? -12303 What is -1118 (base 12) in base 11? -1470 Convert -7a2e (base 15) to base 16. -653f 34123 (base 5) to base 12 1491 71b (base 14) to base 4 111311 Convert -11254 (base 7) to base 6. -21201 -2100022 (base 3) to base 4 -122231 -5554 (base 6) to base 4 -110032 16226 (base 8) to base 4 1302112 346 (base 10) to base 6 1334 What is -11312323 (base 4) in base 13? -abca Convert -240a (base 14) to base 8. -14212 What is 34880 (base 12) in base 2? 10001001011100000 What is 270 (base 9) in base 13? 144 Convert 1500 (base 8) to base 5. 11312 What is b5 (base 16) in base 8? 265 What is 10000110010000111 (base 2) in base 7? 404263 -162446 (base 8) to base 11 -4008a What is -30211102 (base 4) in base 10? -51538 Convert -851 (base 16) to base 5. -32004 What is 53451 (base 6) in base 11? 553a Convert -637 (base 11) to base 4. -23332 -71 (base 8) to base 3 -2010 What is 65 (base 13) in base 7? 146 What is -303033 (base 4) in base 2? -110011001111 -30121 (base 4) to base 13 -490 -4034101 (base 5) to base 13 -23705 What is -90a8 (base 12) in base 6? -200332 Convert -4eb (base 15) to base 9. -1475 5154 (base 6) to base 10 1150 2651 (base 16) to base 2 10011001010001 Convert 23112 (base 4) to base 9. 886 What is -34f2 (base 16) in base 4? -3103302 185 (base 15) to base 10 350 -27b (base 13) to base 9 -538 What is -31102 (base 5) in base 6? -13215 -121 (base 4) to base 14 -1b -100476 (base 8) to base 5 -2024321 Convert 120 (base 5) to base 11. 32 -11111101 (base 3) to base 9 -4441 What is -111101010011 (base 2) in base 15? -1268 What is 50432 (base 7) in base 6? 132332 -1000113 (base 4) to base 5 -112434 What is 4b5 (base 15) in base 9? 1418 Convert -14034 (base 5) to base 13. -6a0 286 (base 16) to base 14 342 What is -1001100010111100 (base 2) in base 8? -114274 Convert -11000 (base 3) to base 6. -300 -4 (base 10) to base 11 -4 -188 (base 14) to base 12 -224 What is -101000011110 (base 2) in base 7? -10360 8e72 (base 16) to base 11 25441 Convert -497 (base 14) to base 6. -4125 Convert -1211212100 (base 3) to base 8. -106777 Convert -13971 (base 13) to base 15. -ad60 -122120 (base 3) to base 5 -3344 -430525 (base 6) to base 3 -1210021022 Convert 6201 (base 16) to base 13. b55c -1011101001110101 (base 2) to base 15 -e223 Convert 278 (base 11) to base 5. 2302 What is a438 (base 13) in base 3? 1011010111 -11003 (base 4) to base 10 -323 -30070 (base 9) to base 12 -b516 78b9 (base 12) to base 7 54015 Convert 1011021 (base 3) to base 16. 34c What is 131 (base 11) in base 12? 10b What is 1035 (base 8) in base 11? 452 What is -11414 (base 5) in base 14? -455 What is -1014211 (base 6) in base 2? -1011111011111111 Convert 617 (base 13) to base 11. 860 What is 32312 (base 6) in base 14? 188c What is 6065 (base 8) in base 12? 1985 -1475 (base 8) to base 9 -1121 What is -6fe (base 16) in base 12? -1052 Convert 625 (base 12) to base 10. 893 11341 (base 7) to base 8 5550 1216a (base 11) to base 7 102010 Convert 33113 (base 8) to base 14. 50cb What is -1ab (base 16) in base 2? -110101011 Convert 10104 (base 6) to base 15. 5e1 -853b (base 12) to base 2 -11100011111111 Convert -104152 (base 6) to base 16. -2204 Convert 42 (base 13) to base 12. 46 -10303 (base 6) to base 3 -1221010 Convert -55732 (base 10) to base 4. -31212310 -44223 (base 9) to base 5 -1414333 Convert -1223 (base 10) to base 7. -3365 -21f (base 16) to base 3 -202010 4367 (base 8) to base 11 17a7 Convert 63 (base 8) to base 5. 201 Convert 13144 (base 5) to base 9. 1385 Convert 503 (base 7) to base 14. 13a Convert 11050 (base 6) to base 9. 2103 Convert 182 (base 13) to base 15. 135 -a7 (base 15) to base 3 -12211 What is -1220231 (base 4) in base 16? -1a2d 355 (base 9) to base 11 247 What is -15436 (base 9) in base 14? -3bc7 What is -779 (base 13) in base 7? -3512 23224 (base 7) to base 13 2926 2982 (base 11) to base 15 1211 Convert 8ad (base 14) to base 5. 23341 What is -3132231 (base 4) in base 10? -14253 460 (base 9) to base 10 378 Convert 38715 (base 9) to base 16. 65f0 Convert 71405 (base 9) to base 16. b789 -6fe2 (base 16) to base 3 -1110021211 1192 (base 12) to base 15 8c2 What is -32616 (base 7) in base 14? -2db6 -1013113 (base 4) to base 6 -33051 Convert	{ "pile_set_name": "DM Mathematics" }
ppose -12300 + m = -9o. Is o a composite number? False Suppose 0 = 2g + 16, 11p - 8p = -4g + 66949. Is p a composite number? True Let n(z) = -2z + 7. Suppose 4p - 2v + 27 = 9, -3p + v - 15 = 0. Let y be n(p). Suppose -yt - 6964 = -23t. Is t composite? False Let r(j) = -17j + 9. Let n be r(15). Let a = 367 + n. Let v = 270 - a. Is v composite? False Let z be ((-1480)/(-4))/(1/6). Let h = -1526 + z. Let x = 1281 - h. Is x prime? True Suppose 3n = 5r + 173920 - 20118, 2n = 2r + 102540. Suppose -n = -7a - 12977. Is a a composite number? False Let o(d) = -289d + 7. Suppose -9c + 48 = -c. Let x be 3(-2)/c - 3. Is o(x) a prime number? True Suppose -2l - 7 = -3. Let k be 3639 + (1/l + 1)4. Suppose 5g + k = 16g. Is g composite? False Let v be ((-15)/40 - 21/8) + -7130. Let q = v + 22362. Is q a prime number? False Suppose -s + 74845 = 3x - 29306, 3s - 34717 = -x. Is x prime? False Is (-20 + 12 - (-17)/(-2))(-88318)/3 composite? True Suppose 44x = 3i + 41x - 129348, -2i + 3x = -86231. Is i a composite number? False Let d(w) = 568w3 - 41w*2 + 170w - 51. Is d(10) a composite number? False Let b(l) = -182l + 190l - 2 - 1. Let q be b(1). Suppose -2v - 3z + 107 = 0, v - 4z = -qz + 55. Is v prime? False Let s = -52 - -91. Suppose 9u = -s + 390. Is ((-13)/u)/(1/(-117)) prime? False Let q = 83 + -77. Let o(u) = 2u*2 - 6u + 33. Let r be o(q). Suppose 4c = -0c - g + 361, c = 4g + r. Is c a prime number? True Let y(v) = 902v*2 - 7v - 140. Let d be y(13). Suppose 16w - d = -44511. Is w a prime number? False Suppose 5u = 138 + 232. Is u a prime number? False Let u = 334111 - 220454. Is u a prime number? True Suppose -11d + 7d + 44 = 0. Let b = d + -11. Is (b - 1)(-3494 + (-3 - -6)) prime? True Suppose 139x = 45x + 66x + 1272796. Is x composite? True Suppose 1105s = 1108s - 119451. Is s a prime number? False Suppose -2d + 3711 = -10441. Let t = d - 987. Is t a prime number? True Suppose -2h = -19h + 656863. Is h prime? True Is 339/33 - -543268 composite? True Suppose w = -3q - 2990 + 52500, -5w = 2q - 247563. Is w composite? True Suppose 3d - 7161 + 551 = -5v, -1330 = -v + d. Let j = v + 564. Is j a composite number? False Let k = -353 - 129. Let q = -75 - k. Let j = q + -174. Is j a composite number? False Let c = 5 - -192. Let g = c - 83. Suppose -11x + 17x = g. Is x prime? True Let y = 1977843 - 954116. Is y composite? True Is (13 + (-189)/14)-721082 prime? True Is (36 - 37) + 0 + 4510 + -2 a composite number? False Is (18 + 272/(-16))(10032 - -1) a composite number? True Let x be 0/((-7)/(42/18)). Suppose x = -2z + 550 + 2496. Is z a prime number? True Let y be 3 + (1 - 1)/(-2). Suppose yp - 528 = p. Suppose -3q + p = 3w, -5w = -5q - 0q + 410. Is q a composite number? True Let y(w) = 6243w - 3818. Is y(43) a prime number? True Let c(h) = -h3 - 39h*2 - 50h - 35. Let k be c(-30). Suppose 5x + 26553 = 5w + 78708, 52149 = -5w + 3x. Let p = k - w. Is p prime? True Suppose 3m - 1427 = 5q, q - 461 = -m - q. Suppose 4r + 3v = 1314, -v + m = 3r - 514. Let l = -164 + r. Is l a composite number? False Let d(g) = g2 - 23g + 21. Let k be d(21). Is (-79578)/(-6)(-7)/k a composite number? False Suppose 311l + 11313391 = 332l + 3061042. Is l composite? False Let g(i) = 74i + 13. Let d(c) = -2. Let n(w) = 15d(w) - 3g(w). Is n(-15) composite? True Let r be (-5)/((-3)/(-3 + 6)). Let d(a) = -a*3 + 5a*2 + a - 5. Let i be d(r). Suppose 4j - 1599 - 2569 = i. Is j composite? True Let t = -8139 - -60148. Is t composite? False Let g = 1381699 + -194268. Is g prime? False Suppose 26r = 29r + 990. Let a be 2 + -32 + 2 + r. Is (a/(2 + -4))/((-20)/(-70)) composite? True Let f = -57982 - -98045. Is f composite? False Suppose -3j = -k + 6, 0 = -5k + j + 4j + 30. Let x(b) = 447b2 - 5 - kb - 27b2 - b. Is x(-2) a prime number? False Suppose 0 = -66o + 70o - 384. Suppose -h + 95 = -o. Is h a composite number? False Let m be (147/7 - -6)/((-3)/(-17132)). Suppose 69p = 81p - m. Is p a prime number? False Suppose 9 = 3y + 5z, -4y + 3y + 3z = -17. Suppose -4n - 19130 + 6976 = -5c, -y = -2n. Suppose -c = -j - j. Is j a prime number? True Let d(i) = -i3 + 27i*2 - 25i - 3. Let b = -463 + 486. Is d(b) a prime number? False Let i(p) = 147p2 - 14p + 66. Let d be i(15). Let y = d - 17860. Is y composite? True Let i(q) = 8q2 + 35q + 252. Let l be i(-25). Let y = l - 1324. Is y prime? False Suppose -4 = o, 3o - 11 = 2m - 19. Let q be m - (-3 - (-2 - -3)). Suppose 0 = -12j + qj + 1910. Is j composite? False Suppose -31 = -2j + 6k - k, -2j = 3k + 9. Suppose z + ji - 8612 = -3z, i = 0. Is z composite? False Let i = -2472 - -9543. Suppose -3r = t - i - 7275, 2r - 9547 = 5t. Is r a composite number? True Let p = 2804 - 1506. Suppose -p + 178 = -5s + 5m, 5s - 1102 = -m. Let n = s - 118. Is n composite? False Suppose -1089011 + 85673 = -18f. Is f composite? True Suppose 5 = -12u + 11u. Is 42/(-2)((-7180)/(-12))/u composite? True Let g = 46192 - 24125. Is g composite? False Let w be 22659/7 - (7 + (2 - 5)). Let m = 5194 - w. Is m a prime number? False Suppose u = -3l + 1028, 0 = -2u + 14 - 16. Suppose 14r - 15r + 4v = -l, 0 = -4v + 12. Is r a prime number? False Let v(o) = 12141o + 18. Let b be v(2). Let y = 37181 - b. Is y a composite number? True Let f(o) = o2 + 11o + 9. Let r = -40 - -33. Let w(p) = -3p2 - 22p - 19. Let n(m) = rf(m) - 4w(m). Is n(12) a prime number? False Let y be (-2 - -2)/(-2 + (-10)/(-2)). Suppose -9a + 14a - 4m - 3677 = y, 742 = a - 3m. Is a composite? False Is (1/4)/(-2125/(-1794405900)) prime? True Suppose -12i - 8 = -8. Suppose -j + 19 + 650 = i. Is j a prime number? False Is (3772561 - -12)3/21 a composite number? False Let k(c) = 8301c + 2401. Is k(28) a prime number? False Let l = 37 + -32. Suppose -2u + 3u = b, -30 = -lb - u. Suppose by + 4f = 173, 3f + 146 + 11 = 4y. Is y a prime number? True Suppose -10k + 16626019 = 9k + 10k. Is k a composite number? True Let a = 108 - 65. Suppose -49 = 4n + a. Let z = 186 + n. Is z a prime number? True Suppose 3h = 157 - 145, 147813 = d - h. Is d a prime number? False Suppose -4m + 3a + 9 = 0, -a - 7 = 27m - 29m. Suppose mz = 38z - 168544. Is z a prime number? False Let o = -152 + 279. Suppose os = 122s + 5585. Is s a composite number? False Suppose 13m = 393 + 127. Let t be (-2)/10 - 83352/m. Is (6/(-24))/(1/t) prime? True Suppose -4n - n + 7132945 = -6p, -4n - 4p + 5706312 = 0. Is n a composite number? False Suppose -3j - 10813 = 6647. Let n = -2033 - j. Is n prime? False Suppose -211m + 107m - 20965994 = -118m. Is m prime? True Let d = 27219 + 58618. Is d a prime number? True Suppose 2x = 3y + 407456, 611205 = -180x + 183x - y. Is x a prime number? False Let i(m) = -7m - 16. Let f be i(-3). Suppose 2n = -r + 11547, fr - 38824 = 5n + 18866. Is r a prime number? False Suppose c - 8 - 3 = -5w, 0 = 5w + 3c - 3. Suppose -2v - 2v - 3g = -17546, v - 4379 = wg. Is v a prime number? False Suppose -406s + 34003049 - 6255322 = -3094875. Is s composite? False Let x(n) = -34n - 314. Let f be x(-11). Is -9582((-8)/6 - (-70)/f) composite? False Let i = -11 + 14. Let p be (-8 - 16) + i + -2 + 2. Let v(l) = 2l*2 + 19l - 40. Is v(p) a prime number? True Is (-72)/(-39) + -2 - (-1163962445)/2171 a composite number? False Suppose 0 = 5x - 3d - 1445734, 2814x - 4d - 867447 = 2811x. Is x a prime number? False Let o(d) = 161d*2 - 377d - 159. Is o(-46) composite? False Let w(q) = -q - 11. Let j be w(-14). Let z = j + 14. Is (z + -19)(-1 + (-687)/2) a prime number? False Suppose 6r + 510 = 3r. Let y = 639 - r. Is y a composite number? False Suppose -10767983 = -253p + 163811378. Is p composite? False Let j be (-2078736)/(-27) + 36/(-162). Suppose 22o - 337712 = -j. Is o a composite number? True Let i(b) = 8601b + 517. Let n(z) = 100z + 6. Let c(p) = -6i(p) + 517n(p). Let f(o) = -o3 - 7o*2 - o - 6. Let y be f(-7). Is c(y) composite? True Suppose 3p + 990 = -4z, 0z - 3z - 5p = 748. Let t = -105 - z. Is t a composite number? True Let l(a) = -2a3 - 45a*2 - 15a - 407. Is l(-50) composite? True Let n(l)	{ "pile_set_name": "DM Mathematics" }
ommon divisor of z and 14? 14 Let z = 43 + -31. Suppose d - z = -2d. Suppose -56 = -5c - 0i - 2i, 4c = -4i + 40. Calculate the highest common divisor of c and d. 4 Let q be (55/10 - 3)10. Calculate the highest common divisor of q and 50. 25 Let r(p) = 6p - 15. Let a be r(4). Suppose 5b - 45 = 4b. What is the highest common divisor of b and a? 9 Suppose -2y - y + 30 = 5t, 3y - 27 = -4t. Calculate the highest common divisor of t and 3. 3 Let s = 68 - 61. What is the highest common factor of 35 and s? 7 Let x(i) = i + 7. Let j be x(-4). Suppose 0 = 2a - 1 - 5. Suppose -2u + 0y = ay - 42, -74 = -3u + y. What is the greatest common factor of u and j? 3 Let v be -2 + 6 - 2 - -4. Calculate the highest common divisor of 18 and v. 6 Let w = -18 + 52. Calculate the greatest common factor of 17 and w. 17 Suppose -2d - 8 = 2d. Let h be ((-9 - d)14)/(-2). Let v be 2/9 - (-122)/18. Calculate the highest common factor of h and v. 7 Suppose 7m = 2m + 5o + 40, 18 = 2m - 3o. Let v be -4(-18)/155. Calculate the greatest common factor of v and m. 6 Suppose -20 - 20 = -5b. What is the greatest common divisor of b and 24? 8 Let d(l) = -l + 2. Let n be d(-10). Suppose -2y = 3c - 42 - 4, c - 14 = -y. What is the greatest common divisor of n and c? 6 Suppose 0 = -5t + 3n + 765, 2t - t + n = 145. Calculate the greatest common factor of t and 30. 30 Let h = 0 + 25. Suppose -h = -3u - 7. Let j be (2 - 1)7 + 2. Calculate the highest common divisor of u and j. 3 Suppose -5o = -78 - 122. Let w(c) = 6 - 5c2 - 4 + c3 + 3. Let h be w(5). What is the highest common factor of h and o? 5 Let h(n) = -n3 - 7n*2 - n + 2. Let a be h(-7). What is the highest common factor of 6 and a? 3 Let k = 20 + -8. Suppose 5m - 2m - k = 0. Let w(z) = 3z*2 + 6z - 1. Let y be w(-5). What is the greatest common factor of y and m? 4 Let m(j) = -j*3 - 5j*2 + 8j + 4. Let d be m(-6). Let h be ((-68)/3)/(d/12). Calculate the highest common divisor of 85 and h. 17 Suppose 4i = -0i + 2g + 94, 0 = i + 2g - 16. What is the highest common factor of i and 22? 22 Let b(n) = n3 - n2 + 3n - 2. Let s be b(3). Suppose 0h - h = -175. What is the greatest common factor of h and s? 25 Let h = 35 + -26. What is the highest common divisor of 1 and h? 1 Suppose 0 = u - 18 + 10. Let c be (((-144)/2)/1)/(-1). What is the greatest common divisor of u and c? 8 Suppose -19 = -5z - 3a, -a = -3z - 7 + 24. What is the highest common divisor of 20 and z? 5 Let m(k) = k3 + k + 245. Let a be m(0). Let c = -165 + a. What is the highest common divisor of 16 and c? 16 Suppose -5q + 20 = -25. Calculate the highest common factor of q and 63. 9 Let n(x) = -x*2 + 11x + 1. Let r be (2 - 5)/(3/(-10)). Let m be n(r). What is the greatest common divisor of 1 and m? 1 Let f be 3514/26 - (-10)/(-65). Calculate the greatest common factor of f and 54. 27 Let w(a) = a*2 - a + 5. Let x = -1 + 5. Let r be w(x). Let l = r - 7. What is the highest common divisor of 20 and l? 10 Let v = -7 + 12. Let m = 9 - v. Let l = 4 - 2. Calculate the highest common factor of l and m. 2 Let t be ((-10)/(-8) - 2)/((-1)/360). What is the highest common factor of 27 and t? 27 Let o(b) = 5b*2 + b. Let u be o(-2). What is the highest common divisor of 27 and u? 9 Suppose -3c + l + l = -48, -3l = -3c + 51. What is the greatest common divisor of 14 and c? 14 Let k be 2/(-4) - 141/(-2). Let j be -2(-2)/(-4) - 8. Let i = j - -16. What is the highest common divisor of i and k? 7 Let d = -24 + 66. Suppose -3c = c, -3n = -c - d. Suppose -4l + 2y = -n, -2l + 5y - 7 = -6l. What is the highest common factor of 21 and l? 3 Suppose 0 = -2r - 5q + 14, -2r + 6q - q + 54 = 0. What is the highest common divisor of r and 51? 17 Suppose -17 = -v + 10. Calculate the greatest common divisor of 3 and v. 3 Let z = 136 - 91. What is the highest common divisor of z and 5? 5 Suppose 0 = -5q + 37 - 7. Let x(y) = -y3 + 5y*2 + 6y + 6. Let p be x(q). What is the highest common divisor of 48 and p? 6 Let i = -3 - -6. Suppose 0 = 2g - ig + 8. Suppose -23 - 25 = -3n. Calculate the greatest common divisor of g and n. 8 Suppose -5m - 2y + 2460 = 0, -m - m - 2y = -978. Let p = m - 274. What is the greatest common divisor of 20 and p? 20 Suppose -5t + 65 = 5m, -5m - 55 + 138 = -t. What is the greatest common factor of 24 and m? 8 Suppose 0 = -d + 2q + 12, 2q + 0 + 6 = -2d. What is the highest common factor of 2 and d? 2 Let p(u) be the second derivative of u*4/12 - 5u3/6 + u2 - 2u. Let f be p(7). Let l = f - 4. What is the highest common divisor of l and 12? 12 Let b = -3 + 2. Let l be (-26 + 3/(-3))b. Calculate the greatest common divisor of 9 and l. 9 Let z be (-20)/50 - 164/(-10). What is the greatest common factor of z and 4? 4 Let v = 2 - 0. Let w be (-2)/4 + 3/6. Let c = w + v. What is the highest common factor of c and 1? 1 Let l(d) = -d*3 - 7d*2 + 11d - 18. Let z be l(-9). What is the highest common divisor of 5 and z? 5 Let g be (-3)/((-2)/1526). Let j = g - 23. What is the highest common factor of j and 135? 15 Let j(a) = 2a + 28. Let v be j(-11). Calculate the highest common divisor of 54 and v. 6 Suppose -42y + 40y + 32 = 0. What is the greatest common divisor of 4 and y? 4 Suppose -3 = j - 4j. Let g = 15 - 2. Let w = g + j. What is the greatest common divisor of w and 112? 14 Let m(d) = d2 + 4d - 3. Let z be m(-6). What is the greatest common factor of 63 and z? 9 Let t be 5/(1 - (-8)/(-12)). What is the greatest common divisor of 6 and t? 3 Suppose -2r - 3r = -55. Let a = 15 - 191. Let z be (a/40)/((-4)/10). What is the greatest common factor of r and z? 11 Let r(z) = 2z2 - 2z - 4. Let n be r(-6). Suppose 1 - 11 = 2h. Let g(j) = j2 - j + 2. Let v be g(h). What is the greatest common divisor of n and v? 16 Let x(v) = -v + 8. Let c be 63/12 - (-2)/(-8). Let y be x(c). Suppose -3p + y = -9. What is the greatest common divisor of p and 28? 4 Suppose -3d + 5w + 48 = 0, -6w + w - 64 = -4d. Let i(h) = -h*2 - 9h + 4. Let z be i(-5). Let l = z - 8. What is the highest common divisor of l and d? 16 Let s = 178 + 144. What is the highest common divisor of 46 and s? 46 Let g = 127 - 115. What is the greatest common factor of 3 and g? 3 Suppose n + 3i = -0n - 12, 3i = -15. Suppose -2g - 2o + 40 = 0, ng - g - 5o = 54. Calculate the highest common divisor of 242 and g. 22 Let i(v) = -v + 5. Let u(l) = l2 + 2l - 4. Let x be u(-4). Let j be i(x). Suppose -2b = 3b - 15. What is the highest common factor of b and j? 1 Let h = -7 - -4. Let v = 6 + h. What is the greatest common divisor of v and 15? 3 Let g be (-2981)/(-44) - (-2)/8. Calculate the highest common divisor of g and 34. 34 Suppose y - 94 = -22. Let h = 24 - 15. What is the greatest common factor of y and h? 9 Suppose 0 = 4z + 2c - 1330, -1327 = -4z - 4c - c. What is the highest common factor of 37 and z? 37 Let a(q) = 2q + 4. Suppose 2f + 5x - 31 = 0, -3x = 4f - 13 - 14. Let j be a(f). Let v = 1 + j. Calculate the greatest common divisor of v and 121. 11 Let i be (1/2)/(2/4). Suppose -2f + 4f - 3l - 5 = 0, 2l - 10 = 0. Let y(c) = c + 1. Let p be y(f). What is the highest common divisor of p and i? 1 Let w be (-8)/44 + 312/22. Let f = 11 - 7. Suppose -4q - fu + 88 = 0, 3u = 4q - q - 60. What is the greatest common divisor of w and q? 7 Suppose -z - n = -4, -4n - n + 5 = 2z. Suppose -2t = t + 5x - 21, 0 = zt - 5x + 5. Calculate the highest common factor of 1 and t. 1 Let s be 21 + 273 - (-5)/1. What is the highest common divisor of s and 23? 23 Suppose -3u + 4 = -u. Suppose -2x - 3x = -4i - u, -2x - i = -6. Calculate the highest common factor of 2 and x. 2 Suppose 2p = 6p - 12. Suppose 0 = -pa - 2a + 405. What is the highest common factor of a and 9? 9 Let t = -29 - -43. Suppose 2h - 4o - 180 = 0, 0 = h + 2o - 41 - 65. What is the highest common divisor of t and h? 14 Let a be (9/6)/((-3)/(-32)). Suppose 3x = -i + 11 + 7, 4i = 4x - 8. Suppose 0 = -4w + xw - 16. What is the highest common divisor of a and w? 16 Let s be (2/3)/(8/228). Let i = s + -8. What is the greatest common factor of i and 1? 1 Let r be (-2)/3 + 22/6. Let c = -4 - -6. Let h be ((-6)/	{ "pile_set_name": "DM Mathematics" }
ne j(b(o)). 102434o Let q(i) be the third derivative of i6/240 - 3i*4/8 + 6i*2. Let u(t) be the second derivative of q(t). Let n(j) = 3j. Calculate u(n(p)). 9p Let h(j) be the first derivative of j5/30 + 13j*3/3 - 1. Let m(u) be the third derivative of h(u). Let p(t) = -5t*2. Give p(m(v)). -80v*2 Let t(d) = 7d*2. Let w be 901 + (2 - -2). Let i(c) = w + 4c - 94. What is i(t(g))? 28g*2 Let o(m) = 3m - 545. Let n(p) = 8p2. Calculate n(o(i)). 72i*2 - 26160i + 2376200 Let k(g) = 53g2 - 48g*2 - 25 + 23. Let n(i) = 2i. What is n(k(m))? 10m2 - 4 Let d(h) = -5h*2. Let s(k) = 14296k. Calculate s(d(b)). -71480b2 Let r(q) = 19q + 8. Let y(a) = 145a - 49a - 48a + 2a*2 - 48a. Give r(y(n)). 38n2 + 8 Let k(r) = 4r. Let z(f) = -11f + 12. Let y(h) = -h + 2. Let t(c) = 8y(c) - z(c). What is t(k(p))? 12p + 4 Let i(q) = 26241q*2 + 3. Let c(a) = -3a*2. Determine i(c(t)). 236169t*4 + 3 Let y(p) = -76802p + 15. Let g(s) = s*2. Determine y(g(t)). -76802t*2 + 15 Let o(x) = -294x*2 + 94x*2 + 94x*2 + 104x*2. Let l(m) = 65m + 9. Let i(v) = 98v + 13. Let k(p) = 5i(p) - 7l(p). Calculate k(o(n)). -70n*2 + 2 Let l(s) = 8s*2 - 31s. Let y(q) = q + 939. Determine l(y(x)). 8x2 + 14993x + 7024659 Let s(c) = 46695c + 1. Let n(a) = -a2. Give s(n(d)). -46695d*2 + 1 Let k(w) = -17335w - 7. Let v(p) = p. Calculate k(v(l)). -17335l - 7 Let q(j) = 2j. Let t(w) = 2w - 2. Suppose -x = -2 + 4, -4c + 2 = 3x. Let r(a) = 6a - 7. Let f(d) = cr(d) - 7t(d). Determine f(q(h)). -4h Let n(q) = q. Let p(y) be the first derivative of -3y*2 + 5 + 2y*2 + 3y - 2y2. Let o(a) = -a + 1. Let r(l) = 3o(l) - p(l). Give r(n(x)). 3x Let j(d) = -d2 - d - 1. Let h(i) = 4i*2 + 5i + 5. Let q(l) = -h(l) - 5j(l). Let z(b) be the third derivative of -b4/8 - 2b*2 - 36b. What is z(q(y))? -3y2 Let q(y) = -y2 + 9y - 8. Let t be q(7). Let z(b) = 18b2 - 39b. Let r(m) = m*2 - 2m. Let o(f) = tz(f) - 117r(f). Let n(w) = w*2. Determine o(n(d)). -9d*4 Let a(j) be the third derivative of 11j*4/24 - 3j2. Let t(i) be the first derivative of i3/3 - 26. Calculate t(a(u)). 121u2 Let p(g) = 2g*2. Let o(t) = -45795t. What is o(p(s))? -91590s2 Let n(r) = 0r - r + 5r - 2r. Let q(c) = 4c. Determine q(n(v)). 8v Let k(y) = y - 1. Let t(h) = -8h + 7. Let z(p) = 28k(p) + 4t(p). Let x be (3/2)/((-9)/(-42)). Let d(g) = 0g*2 - 11g*2 + xg*2 + 7g*2. What is z(d(j))? -12j2 Let z(g) be the second derivative of g6/120 + g*3/2 + 10g. Let h(m) be the second derivative of z(m). Let s(v) = -v*2 + 3v*2 - 4v*2. Give h(s(q)). 12q*4 Let u(m) = -7m. Suppose -q - 5 - 3 = -2o, 5o + 3q - 42 = 0. Let i(v) = 6v - ov - 2v + 3v. Determine u(i(x)). -7x Let m = -128 - -162. Let s(i) = -mi2 + 23i*2 + 20i*2. Let g(p) = -8p*2. What is g(s(q))? -648q4 Let d(x) = -x2 + 2x2 + 0x*2 + 13 - 13x. Let i(t) = t*2 - 6t + 6. Let l(v) = -6d(v) + 13i(v). Let f(m) = -2m. Calculate f(l(y)). -14y2 Let d(t) = -t2 + 9t + 3. Let n be d(9). Let z(f) = nf - 5f - 5f + 2f. Let i(y) be the second derivative of y3/6 + 3y. What is i(z(r))? -5r Let q(s) = -9s*2 + 4s - 4. Let f(j) = 425j2 - 187j + 187. Let i(x) = -4f(x) - 187q(x). Let d(b) = -6b2. Determine i(d(o)). -612o*4 Let c(x) = -5x. Let i(h) = 11h + 0 - 1 - 25h. Let b(d) = -8c(d) + 3i(d). Let a(y) = -y - 1. Let o(t) = 3a(t) - b(t). Let q(w) = w. Calculate o(q(p)). -p Let i = 59 + -42. Let p(z) = -iz - 12z + 30z. Let x(j) = -3j. What is x(p(r))? -3r Let m(d) be the third derivative of 2d4/3 - d3/2 - 4d*2 + 22d. Let g(c) = -2c2. Determine m(g(t)). -32t*2 - 3 Suppose -9g = -4g - 10. Let i(m) = 3 + 4m*2 + 3m*2 - 4 + gm*2. Let w(o) = -o. What is w(i(k))? -9k*2 + 1 Let s(y) be the first derivative of -19y*2/2 + 44. Suppose -2z = -7z. Let b(u) = zu - 3u + 4u. Calculate b(s(c)). -19c Let k(i) be the first derivative of i2/2 - 581. Let c(a) = 3a + 3a - a. Give c(k(z)). 5z Let g(b) = 65 - 14 + 15b2 - 51. Let p(m) be the second derivative of -m3/3 - 2m. What is p(g(w))? -30w2 Let f(o) = -86655o. Let n(t) = t. Determine n(f(r)). -86655r Let y(i) = 1. Let v(k) = 2k + 6. Let c(z) = v(z) - 6y(z). Let s(u) = 49u. Calculate s(c(d)). 98d Let g be 8 + 4 + -5 - (1 + -1). Let j(k) = -22k + 9k + 5k + gk. Let v(y) = -23y*2 + 2y. Give j(v(w)). 23w2 - 2w Let n(x) be the first derivative of -x*3/3 + 1. Suppose 0 = 4f - 9f + 35. Let m(h) = 9 - fh - 9. Calculate n(m(o)). -49o2 Let r(h) = h - 5. Let m be r(5). Suppose 0 = -mp + 5p. Let w(j) = p + 10j*2 + 0 - 7j*2. Let n(b) = b. What is n(w(k))? 3k*2 Let w(v) = 3v. Let j(x) = -55443x. Give w(j(r)). -166329r Let g(p) = p + 4. Let x(r) be the second derivative of r*3/6 + 3r*2/2 + 13r. Let n(m) = 3g(m) - 4x(m). Let s(y) = -19y2. Calculate n(s(a)). 19a*2 Let z(m) = 5m*2 + 6. Let v(o) = -11o*2 - 13. Let s(n) = -6v(n) - 13z(n). Let i(h) = -2h*2 - 4. Determine s(i(t)). 4t*4 + 16t2 + 16 Let f(a) be the first derivative of a2 + 1. Let w(m) be the first derivative of 0m + 37 + 5/2m*2. Give f(w(d)). 10d Let j(t) = -69t2. Let k(s) = s2 - 3. Let w(f) = -2f*2 + 4. Let u(d) = 4k(d) + 3w(d). Calculate u(j(a)). -9522a*4 Let b(x) = 2x + 7. Let u(v) = 469v. Give u(b(d)). 938d + 3283 Let f(g) = -5g. Let w(h) = -97h + 5 + 194h - 94h - 5. Calculate f(w(i)). -15i Let f(g) = g2 - 16. Let c(l) = 141l*2 + l. Give c(f(q)). 141q*4 - 4511q*2 + 36080 Let n(c) = c. Let g(o) = -7o*2 + 224o + 5. What is g(n(i))? -7i2 + 224i + 5 Let x(q) = -6q. Let c(w) = -4w - 4. Let k(l) = -8l - 9. Let b(j) = 9c(j) - 4k(j). Determine b(x(m)). 24m Let g(a) = -4a + 119. Let d(b) = -34b. Determine g(d(v)). 136v + 119 Let i(a) be the third derivative of a4/12 + 3a*2. Let w(p) = -4p + 11p + p + 7p + 3p. Determine w(i(l)). 36l Let z(r) = -5r. Let w(p) = 158655p. Determine w(z(d)). -793275d Let p(x) = -18x*2. Let k(n) be the second derivative of 2n*4/3 - 123n. Give p(k(r)). -1152r4 Let n(v) = 7v*2. Let f(c) = -778c. Calculate n(f(u)). 4236988u2 Let m be (-12)/(-20)(6 - 1). Let k(j) = mj - 2j + 3j - 2j. Let p(z) = 30z - 25. Let o(x) = 5x - 4. Let d(a) = 25o(a) - 4p(a). Calculate d(k(t)). 10t Let b(g) = -2g + 258. Let p(v) = -7v2 + 4. Calculate b(p(l)). 14l*2 + 250 Let t(l) = 5l*2. Let k(q) = q - 3. Let y be k(12). Suppose -3n = f - 2, -y = 5n - 5f + 1. Let h(g) = -g - 2 + 2 + n. What is h(t(p))? -5p2 Let w(i) be the second derivative of 0 + 0i*2 + 1/6i*3 + 6i. Let r(d) be the first derivative of 5d2 - 3. Calculate w(r(h)). 10h Let r(x) = 661981x2. Let f(v) = 2v. What is f(r(t))? 1323962t2 Let i(w) be the first derivative of w6/72 + w3/3 + 4. Let g(c) be the third derivative of i(c). Let v(k) = -4k + 4k + 3k*2 + 0k. What is v(g(q))? 75q4 Let p(h) = -h. Let j(x) = 76x - 15x - 15x. Calculate p(j(b)). -46b Suppose 0 = -k + 3 + 2. Let l(d) = -2d - 2. Let o(m) = -4m - 5. Let h(u) = kl(u) - 2o(u). Let b(x) = -4x + x - 4x. Determine h(b(f)). 14f Let o(g) = -841g2. Let u(a) = -44a*2. What is o(u(q))? -1628176q*4 Let k(w) = -5w - 6. Let u(t) = -t - 2. Let b(c) = -k(c) + 3u(c). Let a(j) = -32j. Give b(a(s)). -64s Let q(u) = 69u. Let p(f) = 4073f2. Calculate p(q(k)). 19391553k*2 Let o(s) be the second derivative of 0s*2 - s + 0 + 1/3s*3. Let n(b) = -16b*2 + 79429 - 39711 - 39718. What is o(n(r))? -32r*2 Suppose 0 = 10z - 11z + 3. Let t(m) = zm + 0m - 9m. Let j(y) = 4y2. Determine j(t(u)). 144u*2 Let l(u) = 3u. Let z be 40/10 - (20 - 1). Let w be (46/10)/((-3)/z). Let v(r) = -w - 5r + 23. What is v(l(f))? -15f Let t(a) = -7a + 3167. Let v(x) = 2x*2. Calculate t(v(k)). -14k*2 + 3167 Let g(u) = -3u*2. Let l(f) be the third derivative of 7f4/4 + f3/6 - 266f2. Give g(l(c)). -5292c*2 - 252c - 3 Let t(l) = -395l2 + 14l - 1. Let f(s) = -13s. Determine t(f(c)). -66755c*2 - 182c - 1 Let u(v) = -18v. Let k(b) be the third derivative of 11b*4/24 + 2b*2 + 12. Give u(k(d)). -198d Let g(v) be the third derivative of -v6/80 - v4/3 - 1	{ "pile_set_name": "DM Mathematics" }
rrrrjrrrrjrrr? 55/78 What is prob of picking 1 b, 1 j, and 1 x when three letters picked without replacement from {z: 1, x: 1, b: 3, m: 4, j: 1, r: 4}? 3/364 What is prob of picking 1 v and 3 n when four letters picked without replacement from {n: 15, v: 5}? 455/969 Four letters picked without replacement from ecaecauhaca. Give prob of picking 1 e, 2 c, and 1 h. 1/55 Calculate prob of picking 2 x when two letters picked without replacement from mamxaaamaxmamxamma. 1/51 What is prob of picking 1 z and 1 g when two letters picked without replacement from {z: 1, a: 2, g: 1}? 1/6 Two letters picked without replacement from rvvrk. What is prob of picking 1 v and 1 k? 1/5 Two letters picked without replacement from dqdqqnnccdncn. Give prob of picking 1 n and 1 d. 2/13 Three letters picked without replacement from {r: 3, l: 1}. What is prob of picking 3 r? 1/4 What is prob of picking 2 l when two letters picked without replacement from {l: 6}? 1 Two letters picked without replacement from ddddddddeddeedd. Give prob of picking 2 e. 1/35 What is prob of picking 2 h and 2 g when four letters picked without replacement from {h: 3, g: 2}? 3/5 Calculate prob of picking 2 h, 1 j, and 1 s when four letters picked without replacement from hlhjsjly. 1/35 What is prob of picking 1 r and 1 i when two letters picked without replacement from jrjjrrrxrxxjxjirj? 3/68 What is prob of picking 1 v and 1 l when two letters picked without replacement from yvxldva? 2/21 Four letters picked without replacement from qqpqpqqqppqqqq. What is prob of picking 1 q and 3 p? 40/1001 Calculate prob of picking 2 h and 1 s when three letters picked without replacement from {m: 4, h: 2, s: 2, i: 1}. 1/42 Two letters picked without replacement from {q: 2, a: 4, s: 3, n: 6}. Give prob of picking 2 s. 1/35 Four letters picked without replacement from gggrggrrgrrrgrggggg. Give prob of picking 3 r and 1 g. 35/323 What is prob of picking 1 x, 1 d, and 1 n when three letters picked without replacement from gnndnddhdnxd? 1/11 Three letters picked without replacement from bxtejyy. What is prob of picking 1 x, 1 y, and 1 j? 2/35 Calculate prob of picking 1 w and 1 l when two letters picked without replacement from ctcccctlcgtcgwcclg. 2/153 Two letters picked without replacement from ovooaxa. Give prob of picking 2 o. 1/7 Four letters picked without replacement from dzzzzzdzzzdzzzzzzz. Give prob of picking 3 z and 1 d. 91/204 Calculate prob of picking 4 h when four letters picked without replacement from hhhhh. 1 Calculate prob of picking 3 w when three letters picked without replacement from {w: 7}. 1 Calculate prob of picking 2 a when two letters picked without replacement from {h: 8, a: 2, q: 2}. 1/66 Two letters picked without replacement from {b: 2, u: 7}. Give prob of picking 2 b. 1/36 Calculate prob of picking 1 w and 1 o when two letters picked without replacement from wwwwowowwwwowwwwww. 5/17 Two letters picked without replacement from {d: 1, b: 3, m: 5, r: 2, a: 1}. What is prob of picking 1 r and 1 b? 1/11 What is prob of picking 1 e and 1 l when two letters picked without replacement from {h: 6, l: 2, e: 8, r: 2}? 16/153 Calculate prob of picking 1 z and 1 l when two letters picked without replacement from pludizuululdud. 3/91 What is prob of picking 1 a, 1 i, and 1 d when three letters picked without replacement from {a: 4, d: 2, i: 1, v: 2, g: 1, q: 7}? 1/85 Calculate prob of picking 1 z and 2 g when three letters picked without replacement from {y: 6, g: 7, z: 2}. 6/65 Three letters picked without replacement from tutttu. Give prob of picking 2 u and 1 t. 1/5 What is prob of picking 2 d and 2 v when four letters picked without replacement from vvdvd? 3/5 Three letters picked without replacement from {c: 2, z: 1, e: 3, x: 1, y: 7}. Give prob of picking 1 e, 1 x, and 1 z. 3/364 Two letters picked without replacement from {y: 7, u: 5}. What is prob of picking 1 u and 1 y? 35/66 Calculate prob of picking 2 r when two letters picked without replacement from qqrrrrq. 2/7 What is prob of picking 1 r, 1 d, 1 n, and 1 x when four letters picked without replacement from rwxnrxrwnjxxjrrxdxxn? 7/323 Four letters picked without replacement from yyyyyy. Give prob of picking 4 y. 1 Four letters picked without replacement from ffpeppfpfpcpc. What is prob of picking 1 e, 1 f, and 2 p? 12/143 Calculate prob of picking 1 e, 1 d, and 2 u when four letters picked without replacement from {n: 1, u: 9, d: 3, e: 6}. 54/323 Four letters picked without replacement from ehenhhetnteethutu. What is prob of picking 1 n, 2 t, and 1 u? 6/595 Four letters picked without replacement from {d: 9, b: 4, h: 4}. Give prob of picking 4 h. 1/2380 Two letters picked without replacement from {m: 2, r: 2, w: 4, d: 1}. Give prob of picking 1 w and 1 d. 1/9 Calculate prob of picking 4 p when four letters picked without replacement from {p: 4, x: 4, f: 2}. 1/210 Two letters picked without replacement from {s: 1, r: 4, y: 1, m: 1, q: 3, n: 6}. What is prob of picking 1 q and 1 s? 1/40 What is prob of picking 2 g, 1 s, and 1 o when four letters picked without replacement from lgpppooplpsgptpoll? 1/1020 Calculate prob of picking 1 o and 1 t when two letters picked without replacement from {o: 4, v: 5, t: 3}. 2/11 What is prob of picking 2 d when two letters picked without replacement from pdpppppppppppdpppp? 1/153 Calculate prob of picking 2 e, 1 k, and 1 v when four letters picked without replacement from {u: 1, k: 8, b: 3, v: 1, e: 4}. 12/595 Three letters picked without replacement from pwpgwpgpggw. What is prob of picking 3 p? 4/165 What is prob of picking 2 n and 1 b when three letters picked without replacement from nbbnbqbqnqnnbqnn? 3/16 Two letters picked without replacement from kkqkkqqkkq. What is prob of picking 2 q? 2/15 Four letters picked without replacement from dsbsbbdbsbbbbbb. Give prob of picking 2 b and 2 d. 3/91 Three letters picked without replacement from {a: 8, i: 2, v: 1, d: 6, x: 1}. Give prob of picking 3 a. 7/102 Calculate prob of picking 1 e and 1 k when two letters picked without replacement from kkgjeejssfkgeek. 16/105 Two letters picked without replacement from hkukckkbu. What is prob of picking 2 k? 1/6 Calculate prob of picking 1 q, 1 o, and 1 y when three letters picked without replacement from {l: 6, o: 4, y: 1, q: 7, e: 2}. 7/285 Calculate prob of picking 1 x and 1 l when two letters picked without replacement from {l: 6, x: 2}. 3/7 Four letters picked without replacement from {d: 6, k: 6}. Give prob of picking 3 d and 1 k. 8/33 Four letters picked without replacement from {l: 9, j: 5}. What is prob of picking 2 l and 2 j? 360/1001 Two letters picked without replacement from {m: 2, u: 2, n: 3, b: 4, z: 1}. Give prob of picking 1 m and 1 b. 4/33 Three letters picked without replacement from euubb. Give prob of picking 1 b and 2 u. 1/5 Calculate prob of picking 1 o, 2 q, and 1 c when four letters picked without replacement from yqqcbabqqaoobya. 4/455 Two letters picked without replacement from squssqzsuiq. What is prob of picking 2 s? 6/55 Two letters picked without replacement from pnnprewknep. What is prob of picking 1 n and 1 p? 9/55 Calculate prob of picking 2 j and 1 a when three letters picked without replacement from {p: 2, j: 2, a: 4, s: 4}. 1/55 Calculate prob of picking 2 k and 1 w when three letters picked without replacement from {w: 4, b: 3, n: 1, j: 1, k: 2}. 4/165 Three letters picked without replacement from vvzvudvvuzvvdvh. What is prob of picking 1 u, 1 h, and 1 d? 4/455 What is prob of picking 1 o and 1 l when two letters picked without replacement from {k: 2, h: 1, o: 3, p: 3, z: 3, l: 1}? 1/26 Two letters picked without replacement from kgggkygnykiggdk. Give prob of picking 1 i and 1 y. 2/105 Four letters picked without replacement from ffifffrffrirffffri. What is prob of picking 4 f? 11/102 Calculate prob of picking 1 b and 1 u when two letters picked without replacement from {u: 1, n: 2, m: 1, w: 1, b: 2, c: 1}. 1/14 Two letters picked without replacement from yfrjf. What is prob of picking 1 y and 1 r? 1/10 What is prob of picking 1 e and 1 a when two letters picked without replacement from ueazree? 1/7 Two letters picked without replacement from aaakpppa. What is pr	{ "pile_set_name": "DM Mathematics" }
? -2 Let y = -5250 + 5249. What is the biggest value in -40, 0.4, 0.12, y? 0.4 Let y = -294.11 - 4.89. Let f = -312 - y. Suppose n - 2k = -4, 0n + 6 = n + 3k. Which is the third biggest value? (a) 1 (b) f (c) n b Let u = 0.2686 - 0.0176. Let f = -0.251 + u. Which is the fourth biggest value? (a) -9 (b) 0.01 (c) 3 (d) f a Let o = -57.37 + 57. Let l = 0.022 + 0.848. Let r = o + l. What is the third biggest value in 1/4, r, 0, -4? 0 Let y = -308.9 - -307.9. What is the second smallest value in y, -207, 3? y Let l be (-7 + 1)(-170)/(-1020) + 10. Suppose 0 = -0w + 4w - 8. Which is the third smallest value? (a) 3 (b) w (c) l c Let i = 98993 - 98999. Let f = 103/3 + -34. Which is the second biggest value? (a) f (b) i (c) 0.1 c Let i = 58 - 62.55. Let k = -4.46 - i. Which is the fourth biggest value? (a) k (b) 1/2 (c) -10/7 (d) -0.1 c Let z = 2929 - 2928.7. What is the second biggest value in 152, -1, z? z Let d = 120.93 - 120.93. What is the fourth smallest value in d, 5/14, -0.1, 2? 2 Let t = -518 - -508. Let m = 29 + 5. Let k = m + -34. What is the third biggest value in k, -0.5, -0.2, t? -0.5 Let r = 476.442 - -18.558. Which is the third biggest value? (a) 1/3 (b) r (c) -5 c Suppose -75p - 32 = -91p. Let z be -1(36/30)/((-6)/(-20)). Which is the fourth smallest value? (a) -5 (b) z (c) 1/7 (d) p d Suppose 0 = i - 8 - 0. Let o(l) = 2l - 14. Let j be o(i). Suppose h + 0 = j. Which is the fourth biggest value? (a) h (b) -3/5 (c) 4/5 (d) 0.1 b Let h = 0.04 + -2.94. Let o = 14 - 16.5. Let m = o - h. What is the second smallest value in 1/5, -1/5, m? 1/5 Let x = 13.99 - 14. Let l = x - 0.043. Let w = l + -2.947. Which is the second smallest value? (a) 3 (b) 0.1 (c) 1 (d) w b Suppose 0 = -5h - 15, -3h = 2o - 6h - 7. Let x = -797.3 + 796.8. Which is the biggest value? (a) x (b) o (c) 2/11 c Let y = -10454 + 10456. What is the second smallest value in 2/469, y, 5? y Suppose -103r = -102r + 14. Let l = -2.988 - 0.012. Which is the third biggest value? (a) l (b) r (c) -1 b Let a = -4.89 - 0.51. Let s = -369 - -374. Let b = s + a. What is the third smallest value in 4, -1, -2/7, b? -2/7 Suppose 0 = -0y + 3y - 15. Let o = 524 - 523.92. What is the third biggest value in y, o, 2/11? o Let d = -2320 - -2318. What is the second biggest value in 2, d, 20, -0.6? 2 Let q = -114.06 + 114.1. Let i = -288 + 2307/8. Let u = 9.7 + -10. Which is the second biggest value? (a) u (b) i (c) q c Let p = -0.25272 - 2.74728. What is the third smallest value in p, -1/4, -0.11, 5, -1? -1/4 Let j = -23 + 1. Let i = 23 + j. Let o = 910/3 - 304. Which is the second smallest value? (a) 5 (b) i (c) o b Let w = -4.996 - -5. Let v = -0.0761 + 0.1801. Let j = w - v. Which is the fourth smallest value? (a) 0.5 (b) j (c) -0.08 (d) -2/9 a Let j = -0.31 - 0.06. Let g = 0.37 + j. Let f = -241 + 243. What is the third smallest value in g, 2/13, f, 1/2? 1/2 Let l = 16.15 - 0.15. Let j(k) = 12k - 66. Let o be j(7). Let d be 2/20o/(-3). Which is the second biggest value? (a) l (b) 3 (c) d b Let r(q) = -45q + 37. Let f(l) = 11l - 9. Let a(h) = 9f(h) + 2r(h). Let y be a(-5). What is the biggest value in -2, y, -0.2? -0.2 Let h = -117.0237 - -117. Let q = h + 0.4237. Which is the third biggest value? (a) 45 (b) -2/7 (c) q b Let o = 134.05 - 134.1. Let k = -1.3 + 2.3. Which is the third smallest value? (a) -5 (b) o (c) k (d) -4 b Let q = -182/3 - -62. Suppose 43p = 32p + 77. Let g be 82/484 - p. What is the fourth smallest value in 4, g, q, -1/2? 4 Let o = 3216 + -3220. What is the third smallest value in -0.4, 5, o, 4, 6? 4 Suppose -46k + 33k = 30 + 35. Which is the third biggest value? (a) -0.5 (b) -0.3 (c) k (d) -73 (e) -0.4 a Let n be 3/(-216)1254/(-8). Let k = 5/32 + n. What is the second biggest value in k, 0.4, -2/7? 0.4 Let n = -8041 + 8043. What is the third smallest value in -2/7, -0.61, 0.09, n, 5? 0.09 Let t = 13740.9 + -13741. What is the fifth biggest value in -1/11, 17, t, -1, 0.7? -1 Let j = 185.6 - 160. Let r = j - -3.4. Let n = 24 - r. Which is the smallest value? (a) n (b) -3 (c) -11 c Let w = -6.11 + -0.89. Let y = -73.5 + 73. What is the third smallest value in w, y, 2, 5? 2 Let u = -1.26 - 78.74. Let i = -82 - u. What is the biggest value in i, -4, 0.09? 0.09 Let v = -66 + 87. Let w = v - 20. Let o = 222 + -221.8. Which is the smallest value? (a) 8 (b) o (c) w b Let u = 23291/8 + -2911. Which is the biggest value? (a) 2/11 (b) 0.3 (c) u (d) 17 d Let l = -136 + 134. Let u = -22.311 - -22.2. Let p = 1.889 - u. Which is the second biggest value? (a) -4 (b) l (c) 0 (d) p c Let x be ((-9)/(-16)(-5 - (-34)/6))/(-3). Let r = -4 - -3. Let v = -0.56 - -0.06. Which is the third biggest value? (a) v (b) x (c) r c Let n = -9508/66677 - -48/299. What is the smallest value in -5, 0.4, n? -5 Let b = -0.9029 + -12.0971. What is the second smallest value in 7, -6, -3, b? -6 Let z = -22.8673 + -0.0327. Let c = 2.9 + z. Let m = -22 - c. What is the second smallest value in m, 0.04, 2/5, -0.3? -0.3 Let p be 11880/(-2412) - (-1 - 4). Let i = -221/268 + p. What is the second biggest value in -2, -0.3, i, -19? i Let p = -1 - -0.5. Let m be -18 + 53/3 - 2/(-10). Let g = -13 + 18. Which is the third smallest value? (a) m (b) p (c) -0.3 (d) g a Let u = -2510 - -10041/4. What is the smallest value in 1/108, 3/4, u? 1/108 Suppose -27q = -43q + 80. Let j be (4 - 8 - 0) + 9. Suppose 5o = js, -2s = 2o - qo - 5. What is the biggest value in 5, s, 0.4? 5 Let p = -29530 - -147647/5. What is the second biggest value in 114, 8, p? 8 Let z(x) = -2x2 + 9x - 6. Let n be z(3). Let y = 1069 - 1224. What is the smallest value in n, y, -1/3? y Let k = -45.36 + 44.76. What is the fifth smallest value in 5/6, 0.8, 4, k, 3/5? 4 Let t = 0.467 - -0.533. What is the fifth biggest value in 0.5, -16, 10/13, 0.4, t? -16 Let n be ((-16)/(-252))/(10/3). Let h = n - -46/35. Let s = -52832 - -52837. Which is the biggest value? (a) -2 (b) h (c) s c Let w = -11.379 - -10.879. Which is the fifth biggest value? (a) 2 (b) -7/6 (c) -0.3 (d) w (e) -0.1 b Let o = -2015 + 2008. Which is the second biggest value? (a) -5 (b) 4 (c) o a Let v = -3.283 + 0.023. Let k = v - -3.76. Which is the third biggest value? (a) 0.3 (b) k (c) 68 a Suppose 2h - 3l = 18, -39h - 5l - 5 = -34h. What is the smallest value in h, 2, -48? -48 Let p(j) = 3j + 7. Let d be p(5). Let x = -121999 + 121998.9. What is the third smallest value in -0.5, x, d? d Let g be 1/(6/4 + -1). Let r = 179/284 - 787/1136. Which is the smallest value? (a) -5 (b) 2/9 (c) g (d) r a Let a = 3.272 - 12.272. What is the fourth smallest value in -0.4, -2, -1/6, a, 0? -1/6 Let n = -41/182 + 1/14. Let g = 406/17 - 24. Which is the biggest value? (a) n (b) g (c) -3 (d) 70 d Let d = -0.7 + -0.3. Let r = -46.2 + 45.8. Let o be (84/20 - 4)/(8/50). What is the third biggest value in r, o, d? d Let h = 14.381 - -69.619. Which is the third biggest value? (a) -0.5 (b) h (c) -1/4 a Let r = 559/3642 - -8/607. Which is the third biggest value? (a) r (b) -35/4 (c) -21 (d) -1 (e) -1/3 d Let w be -3 + -2 + 12/(48/20). Let r = -12.1 + 12. Which is the fourth biggest value? (a) r (b) 1/2 (c) w (d) 1/5 a Let s = -99 - -104. Let t = -39 - -34. Let p = 3.7 - 4. What is the second biggest value in s, t, p? p Suppose -4m - r = 12, -7m + 5r + 30 = -12m. What is the third smallest value in 20, -3/10, m? 20 Let v = 41 - 24. Let d be (v/51)/(2/6). Suppose 4r = -j + 4 + 1, -j + 5 = 0. What is the fourth biggest value in 0.5, r, -5, d? -5 Let h = -6237 - -6237.2. Which is the third smallest value? (a) 4 (b) 5 (c) 4/13 (d) h a Let q = -5.7536 + -0.0664. Let f = 2.82 + q. What is the third biggest value in -2, f, 4, 2? -2 Let v = 321 - 330. Let w be 1/(-3)v/6. Let f = -2.3 + -0.7. Which is the third biggest value? (a) w (b) f (c) 19 b Let u(w) = -7w + 20w - 7 - 13w - 3w. Let p be u(-1). Which is the second biggest value? (a) 3 (b) 0 (c) p b Let p = 2.8 + -3. Let u = 0.7577 + -0.8377. Let w = 0.14 - -2.86. What is the fourth biggest value in p, w, 0, u? p Suppose -41 = -9s + 5s - 37. Let f = 0.5 - 0.78. Which is the biggest value? (a) 0	{ "pile_set_name": "DM Mathematics" }
98. Which is smaller: -253/17 or d? d Suppose -3q + 988 = 3r + 1471, -21 = 3r. Let g = -65335/426 - 28/213. Is q < g? True Let a be (2265/50)/(39/65). Which is smaller: 76 or a? a Let k = 4 + -2. Let t(s) = -6s*2 + 22s + 7. Let o be t(4). Let j be k/(-10) + 176/130 + o. Which is smaller: j or 1? j Let v = 46.9 + 19. Let z = -179 - -113. Let p = z + v. Which is smaller: -0.45 or p? -0.45 Let k be 1/(0 + 2/(-94)). Let g = 294 + -247. Let x = k + g. Do x and 0 have the same value? True Let l(i) = i*2 - 3i - 284. Let c be l(0). Let r be (-4)/((-836)/c - 3). Is r at least as big as 71? True Let b = 2 - 5. Let r = 151 - 139. Suppose -rh + 14h + 4 = 0. Which is bigger: b or h? h Suppose t = 5, -4166p + 25 = -4162p + 5t. Is -2754 > p? False Suppose 7j + 105 = 4j. Suppose 0 = -15l + 10l - 150. Let i = j - l. Is -3 > i? True Let o = -115.6 - -312.8. Let u = o + -197. Which is smaller: 7.1 or u? u Let g = -7900 - -434502/55. Suppose 0 = 2l - 7l - 5. Which is greater: l or g? g Suppose -x + 10212 = 2x. Let b be x/850 + (-16 - -12). Is b greater than -1? True Suppose -2047i + 2026i = 33999. Is -1616 at most as big as i? False Suppose 62c = 61c + 16988. Which is greater: 16987 or c? c Let d = -3297778/5 - -659556. Let m = 77 - 47. Is m less than or equal to d? False Let v be -1 + (-3601)/(-4488) - (-1)/3. Let r = v + -2/187. Suppose 15c = 12c - 3. Which is smaller: r or c? c Let k = -17858 + 17858. Is k < 14714/5? True Suppose 3u - 2 = -g, 5g = 32u - 29u + 82. Suppose -gh + 15428 = -42h. Which is smaller: -550 or h? h Let x = 1256 + -1099.7. Let v = x + -165. Let d = -8.6 - v. Which is bigger: -1.1 or d? d Suppose 80n + 256 = 88n. Suppose 0 = nl + 1655 + 265. Suppose -8o + 3o = 300. Is o at least as big as l? True Let z be 0 - -8 - (8 - (-42)/3936). Is z at most -1? False Let h be 4/10 + (-12)/(-20). Let x be (-66)/6 - 3h. Let s(u) = -967u + 3850. Let k be s(4). Is x at least k? True Let i be 2/(-8) - 2/(-4). Let l = -893 + 422. Let k = 469 + l. Do k and i have different values? True Let o be (117 + -135)(-1)/((-11)/4 + 2). Is 12 at least o? True Let y = -7 + -384. Let l = 391 + y. Is l less than 134? True Let q be 9/(-6)(-1)/((-3)/10184). Let x = -972574/191 - q. Is x less than -1? False Let z = 455 - -612. Let k = z + -1082. Let i = -34 - -21. Is k smaller than i? True Let l be (46/4 - -5)4. Suppose 0 = 12s - l + 18. Suppose 0 = -2i - 4m - 28, sm - 3m + 5 = 0. Which is smaller: i or -7? -7 Let a = -1004/7 - -10960/77. Suppose 0 = 4c - 19 + 23. Is c != a? True Let k be (-155 - -209) + (1 - 0)6. Let b = -106 - -70. Let f be k/b + (-242)/6. Are f and -41 equal? False Let y be 7/24(66 + -62). Which is bigger: y or 12.6? 12.6 Suppose 105 = -156j - 97 + 202. Is -4/3029 smaller than j? True Let v(i) = 3i - 2. Let k = 10 - 8. Let d be v(k). Suppose 0 = b - ds - 3, 10b = 5b + s - 4. Is b greater than or equal to 3/2? False Let i = -74 - -76. Suppose -7 = -il - k, -2l + k - 3k = -10. Suppose j + 3t = 4, -2t = -5j + t + l. Are j and -1/19 non-equal? True Let q = -74 - -152. Suppose -55 = -3m - 2c + 9, -4m + c + q = 0. Suppose w - 4r = -0w + m, w + 2r = -10. Is w greater than -74? True Let y = -41 - -44. Let q be (-2 - -31)24/y. Is q smaller than 232? False Suppose 93 = 2t - q, t - q - 11 = 37. Let a(h) = 156h*2 - 1087h + 9. Let m be a(7). Which is smaller: t or m? m Let a(l) = -121l2 + 451l. Let b be a(5). Is b < -773? False Let z = 374 - 99. Which is bigger: z or 271? z Let b = 289 + -287. Let h = -8 + 12. Suppose hr - 40 - 4 = 0. Which is greater: r or b? r Let m(u) = 16u + 64. Suppose 5x = -f - 25, 7 + 5 = -4f + 2x. Let j be m(f). Which is smaller: j or -13? j Let k = 300.4 + -520.4. Which is smaller: -4 or k? k Let o = 31.031 - 0.031. Let h = -45.1 + 0.1. Let n = 44 + h. Are o and n nonequal? True Suppose 8s = -146s - 188s - 1230516. Which is bigger: -3599 or s? s Let q = 4865 - 4865. Are q and 18/115 nonequal? True Let v = -19 - 15. Let w(x) = x*2 + 3x + 2. Let j be w(-3). Which is smaller: v or j? v Suppose 17585 = 4m + 3y, -9m + 19y - 18y + 39543 = 0. Is m greater than 4394? False Let q(a) = -6a + 8. Let p(z) = -25z + 31. Let g(o) = 2p(o) - 9q(o). Let u be g(21). Let c be 6/((-3)/(-1))(-2)/u. Is -1 greater than c? False Let t(v) be the second derivative of -v5/20 - v4/3 - v*3/6 - 2v*2 - 96v. Let a be t(-4). Let s be (4/(-4))/(2/90). Which is bigger: s or a? a Let v = 604 + -604. Suppose vc - 2q - 1169 = 5c, 0 = 4c + 3q + 938. Which is greater: -235 or c? c Let o(y) = -y2 - y + 56. Let a be o(-8). Let f be (24/8)/(a - (60 - 2)). Are 1 and f nonequal? True Let r be (21/6342)/(36/(-600)). Which is smaller: -1 or r? -1 Let y(j) = 21j - 266. Let z be y(12). Let d be 0(z/120 - 14/105). Is -2/33 < d? True Let b(w) = -22w - 175. Let o be b(-28). Suppose -479 - o = -8s. Do s and 115 have the same value? True Let f be (-15 + -13573)((-18)/8 - -2)-1. Are f and 2 equal? False Suppose 0 = 5k - 10, 0 = -5z - 5k + 3k + 2424. Let o = z - 106966/221. Which is bigger: 0 or o? 0 Let d(n) = -13n - 262n2 - 32 + 135n*2 + 129n*2. Let l be d(-3). Which is smaller: l or 165/7? 165/7 Let f(h) = -73h*2 - 32h - 35. Let x be f(-1). Are x and -38 non-equal? True Let d = -0.8 + 3.8. Let r = 9 - d. Let n = -4930 - -4931. Is n at most as big as r? True Let w = -20.07 - -20.848. Which is smaller: w or 2/7? 2/7 Suppose 3u + 24u - 540 = 0. Suppose r = -ur - 1638. Which is bigger: r or 2? 2 Let d = -22.4 + -33.6. Let v = d - -53. Is 20/13 at most v? False Let l = -9637 - -20384. Which is bigger: l or 10748? 10748 Let y be (-90)/(-1883)(-6552)/1404. Is y at most as big as 1? True Let o = -3.12 - -2.01. Let t = o - 1.89. Is -23 at least t? False Let l = 0 + -146. Let s = l - -145.59. Let a = -21 + 43/2. Is s >= a? False Let n = 53.2211 - 0.0211. Let p = 28 - -25. Let h = n - p. Is h at least as big as -2? True Let x = -101 - -105. Let a be -1 - (-1)/(x2/8). Is -5/14 < a? True Let t(k) = 5k3 - k2 - 3k + 4. Let o be t(1). Suppose 65 = -ov - 0. Which is greater: -8 or v? -8 Let j = -2.26 - -162.26. Let u = 139 - j. Let v be (2 + 0)(-1)/2. Which is smaller: u or v? u Let l = 3 - 2. Let z be -14 - (-15 - 1172/(-1170)). Is z bigger than l? False Let b(j) = 17j - 20. Let w be b(-2). Let r be (-675)/w16/5. Which is smaller: 46 or r? r Suppose -12i + 16146 = -246i. Is -40 greater than i? True Suppose -d = -0 - 3. Let l(g) = -5g + 17. Let a be l(d). Suppose -3f = 5t - 18, 4f - t - a = -f. Which is bigger: -2/123 or f? f Let s(a) = 2a*2 + 3a - 105. Let u be s(9). Let y = u + -84. Which is bigger: y or 10/9? 10/9 Let y be 0/((-6)/(-5) + (-1197)/285). Is 29/46 bigger than y? True Let a = 195 - 257. Let t be (1/1)/(31/a). Is -3/5 bigger than t? True Let j be 4 + 12/426 - 4. Let c = 4994 + -4994. Which is greater: c or j? j Let m = 11 - 9. Let f = -4 - m. Let u = -4134/161 + 446/23. Which is bigger: u or f? f Let c(h) = 4h2 + h + 4. Suppose -2 = 3r + 10. Let k be c(r). Let a = k - 64. Which is smaller: 2 or a? a Let y = -0.056 + 0.19. Let k = -1.866 - y. Are k and -0.2 nonequal? True Suppose -z + 4 = -r, 0 = -2z - 55r + 53r - 16. Is z != -22? True Suppose -114 = -35v - 110v + 321. Does v = 111/26? False Let c be 6 - ((-4635)/(-63) + 13)21/201. Which is bigger: -3 or c? -3 Let t(b) = 6b3 + b2 + 4b + 8. Let v(q) = q*3 + q. Let i(z) = -t(z) + 5v(z). Let l be i(0). Suppose -989 + 975 = 2o. Which is smaller: l or o? l Suppose 43f = -0f + 129. Suppose 0 = fz - 5s - 731, 3z - 41 = s + 674. Is z less than 238? True Suppose -16 = -2r + 14t, 3r - 47t = -46t + 4. Let w be (23/(-3))/(2/750). Let j = w - -330623/115. Which is smaller: j or r? j Let a = 2 + -1. Let z be (-96)/(-32)((-1186)/114 + 11). Which is smaller: a or z? a Let q = 15977 + -15891. Is q equal to -29? False Suppose 0 = 72v - 38604 + 170004. Which is greater: v or -1824? -1824 Suppose r - 2 + 3 = -2y, 0 = 4y - 2r - 10. Suppose 0s = 13s. Let o be s + 3 + (-32 - -26). Which is smaller: o or y? o Let z = 71503.03 + -71503. Let p be 2 - ((-264)/46)/(-3). Which is bigger: p or z? p Suppose -73v = -95v + 40*v + 8226. Which is smaller: -486 or v? -486 Let v = -512002/13	{ "pile_set_name": "DM Mathematics" }
73 tonnes in nanograms? 1530173000000000 What is 3/25 of a millennium in months? 1440 Convert 74271.34 kilometers to micrometers. 74271340000000 Convert 2.365591 milligrams to kilograms. 0.000002365591 What is 47/4 of a litre in millilitres? 11750 Convert 8.924569 nanometers to kilometers. 0.000000000008924569 How many micrometers are there in eleven tenths of a millimeter? 1100 Convert 0.140416ug to nanograms. 140.416 What is 0.2206359 millilitres in litres? 0.0002206359 How many decades are there in 688.0283 centuries? 6880.283 What is 505713.5mm in nanometers? 505713500000 What is 8854.833g in nanograms? 8854833000000 How many nanograms are there in 3/25 of a microgram? 120 How many millilitres are there in eighty-one halves of a litre? 40500 Convert 3719.574m to kilometers. 3.719574 How many seconds are there in four fifteenths of a day? 23040 How many decades are there in 48/5 of a millennium? 960 Convert 158.1368 millennia to months. 1897641.6 How many millilitres are there in 13/4 of a litre? 3250 What is seventy-three quarters of a decade in months? 2190 What is 1/5 of a day in minutes? 288 How many weeks are there in 14585073.3s? 24.11553125 How many years are there in one fifth of a decade? 2 How many grams are there in 19/4 of a kilogram? 4750 How many years are there in 1/4 of a millennium? 250 What is 5979.85 decades in centuries? 597.985 What is 13/4 of a tonne in kilograms? 3250 What is 6.467919ml in litres? 0.006467919 How many years are there in 11/10 of a century? 110 How many millilitres are there in 13/8 of a litre? 1625 How many days are there in 8072.3115ns? 0.00000000009342953125 How many millilitres are there in 41.1967l? 41196.7 How many years are there in 1/4 of a century? 25 What is 0.3680219 centimeters in meters? 0.003680219 Convert 34.78987l to millilitres. 34789.87 What is 585.8294 litres in millilitres? 585829.4 How many millilitres are there in one quarter of a litre? 250 Convert 830.8651 weeks to nanoseconds. 502507212480000000 Convert 0.9884254g to milligrams. 988.4254 What is 757.7165 years in centuries? 7.577165 Convert 0.0008841 decades to months. 0.106092 What is 7/4 of a millennium in months? 21000 What is 7/4 of a milligram in micrograms? 1750 How many months are there in 5/4 of a century? 1500 What is 21.40243 tonnes in kilograms? 21402.43 What is 21/5 of a litre in millilitres? 4200 How many micrograms are there in 7/2 of a milligram? 3500 How many millilitres are there in 52477.74l? 52477740 Convert 68.01219 grams to milligrams. 68012.19 What is one tenth of a milligram in micrograms? 100 Convert 215.3712 tonnes to milligrams. 215371200000 What is 92.8856g in micrograms? 92885600 How many litres are there in 716070.8 millilitres? 716.0708 How many microseconds are there in 369.8416 milliseconds? 369841.6 Convert 1546.086 nanoseconds to milliseconds. 0.001546086 What is 17/2 of a milligram in micrograms? 8500 What is one fifth of a millennium in decades? 20 How many minutes are there in 13/9 of a day? 2080 Convert 559.773 meters to centimeters. 55977.3 What is 98/5 of a litre in millilitres? 19600 How many days are there in 588.91212 microseconds? 0.0000000068161125 Convert 894.3026 meters to centimeters. 89430.26 What is fifty-one fifths of a kilogram in grams? 10200 What is 7/4 of a centimeter in micrometers? 17500 What is 11/8 of a kilogram in grams? 1375 Convert 0.5838448 litres to millilitres. 583.8448 What is 6153.398 nanometers in meters? 0.000006153398 Convert 4.90055 kilometers to centimeters. 490055 What is one sixteenth of a millisecond in nanoseconds? 62500 How many microseconds are there in 0.722134 minutes? 43328040 What is seven thirds of a hour in seconds? 8400 How many centimeters are there in 8463.033 meters? 846303.3 How many days are there in 1979958.6us? 0.0000229161875 How many micrograms are there in 445964.2 kilograms? 445964200000000 How many nanograms are there in 3/5 of a microgram? 600 How many kilograms are there in 37/5 of a tonne? 7400 How many years are there in 750.3003 centuries? 75030.03 Convert 570634.3 decades to months. 68476116 What is 29/5 of a tonne in kilograms? 5800 How many millilitres are there in 21/4 of a litre? 5250 Convert 80.290863ns to hours. 0.0000000000223030175 How many micrograms are there in 27/2 of a milligram? 13500 How many nanograms are there in 21/5 of a microgram? 4200 What is 0.198279 decades in months? 23.79348 What is one fifth of a milligram in micrograms? 200 How many months are there in fourty-three halves of a year? 258 How many minutes are there in 266.85804us? 0.000004447634 What is 5967.738mg in grams? 5.967738 How many nanoseconds are there in seven halves of a microsecond? 3500 How many litres are there in 17913.01 millilitres? 17.91301 What is three tenths of a tonne in kilograms? 300 How many months are there in 3/50 of a millennium? 720 How many millilitres are there in 3/5 of a litre? 600 How many centimeters are there in 37/2 of a meter? 1850 Convert 0.8233541 centuries to decades. 8.233541 What is 4/3 of a minute in seconds? 80 How many years are there in 761.3543 millennia? 761354.3 What is 13/5 of a century in decades? 26 What is 9378.739 centuries in decades? 93787.39 How many decades are there in twenty-one fifths of a millennium? 420 What is 19.66986 milliseconds in hours? 0.00000546385 How many centuries are there in 10147.33 millennia? 101473.3 Convert 12281.02 millilitres to litres. 12.28102 How many decades are there in 45/4 of a millennium? 1125 What is 55/4 of a meter in centimeters? 1375 Convert 84727.32 years to millennia. 84.72732 How many micrograms are there in nine tenths of a milligram? 900 How many litres are there in 98.7553 millilitres? 0.0987553 What is 6937.48um in centimeters? 0.693748 How many decades are there in 594.1269 centuries? 5941.269 How many minutes are there in 6/5 of a week? 12096 What is 2.750462 millennia in decades? 275.0462 What is 970882.8 weeks in hours? 163108310.4 How many millilitres are there in 1.658059 litres? 1658.059 What is 624.1318mg in kilograms? 0.0006241318 Convert 4762.09 micrometers to kilometers. 0.00000476209 How many millilitres are there in three eighths of a litre? 375 Convert 9750.546 months to years. 812.5455 How many months are there in eleven halves of a decade? 660 Convert 683.9857um to millimeters. 0.6839857 How many millennia are there in 688.6859 decades? 6.886859 How many nanoseconds are there in 7.41217 minutes? 444730200000 What is one sixth of a week in hours? 28 What is 5823.831 nanograms in tonnes? 0.000000000005823831 How many millilitres are there in 75/2 of a litre? 37500 How many years are there in 3/50 of a century? 6 How many millilitres are there in thirteen quarters of a litre? 3250 What is 3/5 of a micrometer in nanometers? 600 How many years are there in 732930.9 months? 61077.575 What is 6.764451cm in kilometers? 0.00006764451 How many minutes are there in 52/5 of a day? 14976 How many hours are there in 59.857713us? 0.0000000166271425 Convert 237650.5 years to months. 2851806 What is 37859.12l in millilitres? 37859120 What is twenty-seven quarters of a meter in centimeters? 675 What is seventeen tenths of a microgram in nanograms? 1700 Convert 2401.671 centimeters to kilometers. 0.02401671 What is 0.3029715 years in millennia? 0.0003029715 How many meters are there in 7/8 of a kilometer? 875 How many months are there in 6/5 of a century? 1440 What is twenty-one halves of a microsecond in nanoseconds? 10500 What is six fifths of a litre in millilitres? 1200 What is 19/4 of a litre in millilitres? 4750 Convert 93.80189 millilitres to litres. 0.09380189 What is eleven quarters of a litre in millilitres? 2750 Convert 465385.3 decades to months. 55846236 What is 5/4 of a millennium in months? 15000 What is twenty-one fifths of a litre in millilitres? 4200 How many kilograms are there in fifty-four fifths of a tonne? 10800 Convert 385.8787 nanograms to tonnes. 0.0000000000003858787 What is 1/6 of a decade in months? 20 What is twenty-seven quarters of a litre in millilitres? 6750 What is 8.137548ns in hours? 0.00000000000226043 How many months are there in 51/4 of a year? 153 How many nanoseconds are there in 0.0949771ms? 94977.1 What i	{ "pile_set_name": "DM Mathematics" }
uming a is positive. a*(-19198/4275) Simplify ((o(o/o(2/25))/o)/o(-1/22)(o9/o)(-10))47 assuming o is positive. o(-2043043/550) Simplify (y(3/8)/yyyy*(2/7)yyyy/(y/(y(-1/5)y))(y(-2/17)y)/y)/(((y/(yy(-2/7)))/y)(1/47)y*5/((yy0/y)/y)) assuming y is positive. y(-143569/223720) Simplify (y/(((y(yyy0)/yyy)/y)/y))35y*(-1/3)/(yy*(2/7))y*(2/17)yy(-4)y*(-8/5)(y/y(-4/3))/y assuming y is positive. y(-23662/595) Simplify ((a*(9/8)a(-40))(-2/49))(-29) assuming a is positive. a(-9019/196) Simplify (a(2/7)/a)/(a2a)(aa/a2)/a(-2/3)(a*(1/4)/(a(aa12)/a))35 assuming a is positive. a(-37741/84) Simplify ((r/((r(r(rr((((rr*6)/r)/r)/rr)/r)/r)/r)/r)r)/(r(-3/2)r))(-1/83)/(r(-1/10)/(rr1/rrr)r*(-1/3)r*(5/3)r) assuming r is positive. r(992/1245) Simplify ((s(-19)s(-14))/(s(-2/11)s/s*(-21)s))(4/27) assuming s is positive. s(-2456/297) Simplify (x/x*6xx/(x/x10))27/((xx*(-2)/x)/(xx(-2/9)/x))(12/7) assuming x is positive. x*(3466/21) Simplify (((qq(2/7))/q)(-6/5))*(-4/15)(q(-8)/(q/(q/((q/q(-2/9))/q))))(2/19) assuming q is positive. q(-23164/29925) Simplify ((p*(-8)/pp*(-4))/(p/(ppp(-3/2)/p)p(p(-4)/p)/p))/((p0/((pppp(1/2))/p))/((p(4/9)p)/((p/p(-1/2))/p))) assuming p is positive. p(-109/18) Simplify (((x/(x1xx)xx)/x)23)(5/4)((xx((x2/x)/x)/x)(1/3))(6/25) assuming x is positive. x(-2867/100) Simplify q/(qq/(qq*(1/16)q)qq)q/q(1/2)(q(-2/25)/q)/(q(1/4)/qq)(q/q0)/q(-1/9)q(-7)/qq*9/qq assuming q is positive. q(1237/3600) Simplify (((i1i)/i)(-2/3))(-43)/(((i/(ii*(-3/7))i)/i*(-3))/(i(i*(-1/3)ii)/i)(-2/13)) assuming i is positive. i(6547/273) Simplify (((m/(m/m(-4)))/(m/m(-2/17)))/(m(-1/3))(19/4))/((m(-3)/m(-6))/(m3mmm/m(-3))) assuming m is positive. m(503/204) Simplify ((r/(r/r*20r)r(5/4))(-25))32 assuming r is positive. r(-16200) Simplify ((f/(f(-2/5)f))*21(f/f(-1))(3/13))/(f/(ff(-3)ff)fff(-9/2))(-5/12) assuming f is positive. f(4283/520) Simplify ((i/(i(2/11)i))/i(1/15)i*(-25)((i/(i/i(-3/2)))/i)/i)(-28) assuming i is positive. i*(132818/165) Simplify (uu*(-6/11)uu(1/7))(-3/8)(uu0u)9/(u(2/11)/((u/(uu/(((uuuu/u*(4/3)u)/u)/u)))/u)) assuming u is positive. u(31205/1848) Simplify ((m/m(2/57))/(mmm*31)(m/(m/(m/(mmmmm*(-9)m))))11)43 assuming m is positive. m(56287/57) Simplify (j6j/j(-6))(-33)((jj1)12)45 assuming j is positive. j651 Simplify ((p8/pp)/(p*29/pp)(p(p/(p/p*(-25)))/p)/(p/(pp/p*(3/10)pp)))14 assuming p is positive. p(-3031/5) Simplify ((w0)44/(((ww/((((w(1/2)/w)/w)/w)/w))/w)/w(-1)))(-36) assuming w is positive. w198 Simplify ((d*(-18)d)*(-3/29)(d(-4/7))(-1/13))(2/109) assuming d is positive. d(9514/287651) Simplify (w(w/w(-11))/www11(w(-1/7))(-43))33 assuming w is positive. w(6963/7) Simplify ((v(-1/4))(2/7)/(vv/((v(-1)/v)/v)vv)(-1/54))/((v0v)(-1/7))29 assuming v is positive. v*(794/189) Simplify ((ss/(s/s*(-1))s/s6)/((s(1/4)/ss)/s(-1/5)))/((s(-2))(-14)(ss(-2/3))(-7)) assuming s is positive. s(-1867/60) Simplify (((((((g(-2/29)g)/g)/g)/g)/(g/g(-3/8)))/(g5/gg/(g(-2/11)/g)))(-1/17))(-9/4) assuming g is positive. g(-13005/10208) Simplify ((y(-2/23)/((yyy/y(-1/2)yy)/y))/(y/y(-2))(-1/33))/((yyy(-2/5))(17/5)/((yy*(-1)y)/(y/y7))) assuming y is positive. y(-37141/12650) Simplify (((cc0/c)/c)22)(1/2)/(c(1/2)/(c/c6))(-9/4) assuming c is positive. c(11/8) Simplify (b/(b/(b/b(-6/11)b))b8)(-35)(bb(-2/7)bb/(b/(b/(bbb(b/(bb(-2/19)))/bb))))(-41) assuming b is positive. b(-516528/1463) Simplify l*(-2/43)/(l/(l/(((lll(-7/5)l)/ll)/l)))(l(-18)/l)45 assuming l is positive. l*(-183964/215) Simplify (qq*7qq(1/8)(q/(q*(1/3)q))(-6/5))/((q(2/7)q(-1/7))/(q1/q)(-5/4)) assuming q is positive. q(2627/280) Simplify ((c0)(1/6)/(c1)(14/11))/(c(-3/4)/c(-1/3)c*(-2/5)c/(c*(-2/7)c)) assuming c is positive. c(-3427/4620) Simplify (((f31fff(-20))(-9))10)42 assuming f is positive. f(-49140) Simplify (ii/(i(i/(i/(ii/(i*(-3)/i))))/i)i(-5)/i)20((ii/i1)/i)40/(i0/i)(-2) assuming i is positive. i(-202) Simplify ((p8/p(-2/9))/(p(2/3))*(-33))/(((p/(pp*3/pp))/(p/p(3/8)))/(p5pp(-2/5))) assuming p is positive. p(14201/360) Simplify ((h1)29/((hhhh(7/2)/hhh)/(hhhhh/((((h7/h)/h)/h)/h)hh)))/((h(-7)/(h/h(-1/5)))/(h0h)(-1/19)) assuming h is positive. h(6393/190) Simplify (r(-23))18rrr26/rrr9 assuming r is positive. r(-377) Simplify ((a33/a)(8/3)/(a(1/30)/(aa/(a*(-33)a)a)))(2/75) assuming a is positive. a(401/125) Simplify ((((p/p(2/17))/pp)/p(-8))46)(2/39) assuming p is positive. p(13892/663) Simplify ((pp31pp26)/(p/(ppp(-11/5)))(4/23))(3/8) assuming p is positive. p(20283/920) Simplify ((d(-4)/(d/(((d/(d/(d0/d)))/d)/d)))/(d4/(d/d(-2/5)d)))/((((d/(dd/d(1/4)))/d)/d)/(d/(((d1d)/d)/d)))27 assuming d is positive. d(1833/20) Simplify (v*(-4)vv11)/(v(2/35)v/(v*22v)) assuming v is positive. v(1048/35) Simplify ((k27(k/((k(3/5)k)/k))/k)13)41 assuming k is positive. k(70356/5) Simplify (s(-6)s)(-6/17)s(-1/6)/(s(-35)/s) assuming s is positive. s(3835/102) Simplify (i(-8/3)/i(-1/4))(-12/11)/(i/(i/(i/i*(-1)))i*(5/2)i(i(-1)i)/(iii*(-5)i)) assuming i is positive. i(-107/22) Simplify ((r(-19)/((rr23r)/r))/(r/(r(r(-10/7)r)/rr)r)(-23))(-1/4) assuming r is positive. r(71/28) Simplify (((d6d)/d)/d((d*(-2)d)/d)/dd(-3)d*2/dd)/((((d/(dd/(d0d)d))/d)/dd)*28d*(-1/4)/dd/d*(-1/3)d) assuming d is positive. d*(671/12) Simplify ((jjj(-5))/j6(j*(-8)/j)/jj(-8))/((j/j(1/14)(jj*(-1/15))/j)/((jj(2/3))/j(2/7))) assuming j is positive. j(-5561/210) Simplify (l(-2/5))*(-7/4)/((ll1/l)/(l/l6l))(lll/(l/(l/(l/l*(-2/11)llll)))l)/l*(-1/4)((ll0)/l)(-45) assuming l is positive. l(-1151/220) Simplify ((nn(-1/3))(-20))(-20)/(n3/n(n/(n/(nn*(-4/9))n)n)/n)(2/11) assuming n is positive. n(26372/99) Simplify ((q1)(2/31)/(qq*(2/17)q(-1/4)))/((q/(q/(q/(q(-2/7)q))))(8/19)/(qq(-2/7))(14/5)) assuming q is positive. q*(301831/280364) Simplify (dd/(dd(-6/11))dd/((d(5/8)d)/dd)d)/((d/d*5)/(d/(dd(3/26)))) assuming d is positive. d(7785/1144) Simplify (j(-24)/(j14j)(j41)(-26))(-3/4) assuming j is positive. j(3315/4) Simplify (((m(2/3)/m)/m)/m3)/(m/(m/(mmmm(1/5)/mm))m/m(-7))(m*(6/7)mmm/m(-5))(2/107) assuming m is positive. m(-172657/11235) Simplify ((z(5/4)z(zzz/(z/(zzz*(3/14))))/zz)/(z*(-34)z/z(-32)))(-1/23) assuming z is positive. z(-209/644) Simplify ((m(2/7)/m)*(-37)(m(-2/7))(-1/5))/((((m/(m/(m/(m/(((m(mm2)/m)/m)/m)))))/m)/m(-6/7))/((m(-6)/m)/(m(8/5)/m))) assuming m is positive. m*(631/35) Simplify ((rr/(r/(rr(-20)/rrr)))/(r/(r/r24rr))r*(-33)r/(r/r(2/13)))(-13/2) assuming r is positive. r*467 Simplify (((kk(-2)/k)(-48)((k(-2/3)k)/k)(7/6))(16/5))(-1/26) assuming k is positive. k(-6856/585) Simplify ((t*31tt(1/19))/((t39/tt)/t)(1/17))(2/17) assuming t is positive. t(19262/5491) Simplify (q(-3/2)/(q(-5)/q))(8/3)/((q(-1))(1/12)/((qq/(q/(qq(-3))))/(q8/qq))) assuming q is positive. q(37/12) Simplify ((g/(g(-1/10)gg)g)/(g/g*(-1)g)g/(g(-1)/g)g*4)/((gg*(1/4)g)*(-10/11)ggg*(-1/7)gg/g6) assuming g is positive. g(3191/385) Simplify (dd*(2/5)((d*17d)/d)/d(d/((d(d/(d*(1/7)d))/d)/d))(-5))(-47) assuming d is positive. d(-10998/35) Simplify h/((h/(h(-1/3)hhh))/h)hh0h((h/((h/(h(h/(h*(1/2)/h))/hh))/hh))/hh)*18((h*(-3/5)h)/h9)(-3/16) assuming h is positive. h*(12547/240) Simplify ((bbb/(b(-3)/b)bb/((bb*(-1))/b))/(b/(bb**(-1/2)	{ "pile_set_name": "DM Mathematics" }
68.21 to the nearest 1000. 4554000 What is -939522.23 rounded to the nearest one hundred thousand? -900000 What is -597381.292 rounded to the nearest 100000? -600000 What is 0.00029365858 rounded to five decimal places? 0.00029 What is -1889.832366 rounded to the nearest 10? -1890 Round 4815.861119 to the nearest one thousand. 5000 Round -685.3283587 to one decimal place. -685.3 Round -17879566.63 to the nearest one hundred thousand. -17900000 Round -47670.2 to the nearest 100000. 0 Round -64920573 to the nearest ten thousand. -64920000 What is -5258.8467 rounded to the nearest 100? -5300 Round 962272.575 to the nearest 10000. 960000 Round 0.001225299173 to six dps. 0.001225 Round -168556.82423 to 0 decimal places. -168557 Round -0.14666623727 to 6 dps. -0.146666 Round 0.00000086366425 to 7 decimal places. 0.0000009 Round 0.000040537761 to 6 dps. 0.000041 What is -57320189.8 rounded to the nearest 1000? -57320000 Round -4.73534639 to 3 dps. -4.735 Round -117971664 to the nearest 10000. -117970000 Round 0.926055627 to one dp. 0.9 What is -0.03434180461 rounded to six decimal places? -0.034342 Round 115181.16 to the nearest ten thousand. 120000 What is -22.68946816 rounded to one dp? -22.7 Round 95.218555 to 1 decimal place. 95.2 What is 0.1202443415 rounded to two decimal places? 0.12 Round -6290.153681 to the nearest 100. -6300 Round 0.0000219439418 to 6 decimal places. 0.000022 Round -46348657.2 to the nearest one million. -46000000 What is -10.1400954 rounded to 3 dps? -10.14 What is 1970333.44 rounded to the nearest 1000? 1970000 Round -1638.92267 to the nearest one hundred. -1600 Round 0.00875992339 to three decimal places. 0.009 Round -662.8663773 to two dps. -662.87 What is -0.29584689 rounded to 2 dps? -0.3 What is -0.00328040955 rounded to seven dps? -0.0032804 What is 1.548219225 rounded to 5 dps? 1.54822 What is 0.0000177100822 rounded to seven decimal places? 0.0000177 Round 0.86557428 to 1 decimal place. 0.9 What is -0.0000455689561 rounded to 7 decimal places? -0.0000456 Round 167731.9797 to the nearest 10000. 170000 Round 668.92306 to 0 dps. 669 Round -0.0000213295597 to 5 dps. -0.00002 Round 2607743337 to the nearest one million. 2608000000 What is -1298589.35 rounded to the nearest one hundred? -1298600 What is -28.15924903 rounded to the nearest 10? -30 Round 0.0482208838 to six dps. 0.048221 Round 0.2050178636 to four dps. 0.205 What is -0.000021153161 rounded to 5 decimal places? -0.00002 Round -25794.412 to the nearest one hundred. -25800 What is -585342.649 rounded to the nearest 100? -585300 What is 1.3671085 rounded to the nearest integer? 1 What is 6742744.4 rounded to the nearest one million? 7000000 What is 3425160570 rounded to the nearest one million? 3425000000 What is -500155.9746 rounded to the nearest ten thousand? -500000 Round 173204888 to the nearest one million. 173000000 Round -14619.6259 to the nearest 1000. -15000 What is -0.0000506205255 rounded to 5 decimal places? -0.00005 Round 828092.52 to the nearest 100. 828100 Round -0.2126504611 to four decimal places. -0.2127 Round 877.893634 to 1 dp. 877.9 What is -0.0305160116 rounded to four decimal places? -0.0305 What is -275.356944 rounded to the nearest ten? -280 What is 0.0005876285664 rounded to 4 dps? 0.0006 What is 0.0282556868 rounded to 5 decimal places? 0.02826 Round -40.6513965 to 1 decimal place. -40.7 Round -0.004623837051 to 4 dps. -0.0046 What is -169320.2351 rounded to the nearest 10? -169320 Round 1623.496555 to the nearest ten. 1620 What is -106712165 rounded to the nearest one hundred thousand? -106700000 What is 9588.79352 rounded to the nearest one thousand? 10000 Round 0.0184990181 to six dps. 0.018499 Round 0.048868884 to two dps. 0.05 Round 1.8650826 to 0 decimal places. 2 Round -23.118123 to 2 decimal places. -23.12 What is 4.3394512 rounded to 2 decimal places? 4.34 Round 250.0234159 to one dp. 250 What is 155418725.7 rounded to the nearest 10000? 155420000 What is -0.02131893862 rounded to two decimal places? -0.02 Round -27.8447229 to 3 dps. -27.845 Round 0.004028183 to 3 decimal places. 0.004 What is -1338.838535 rounded to the nearest ten? -1340 Round 0.06019540885 to six decimal places. 0.060195 What is 0.0935140798 rounded to two dps? 0.09 Round -0.00000310788724 to seven dps. -0.0000031 Round 0.729406494 to three dps. 0.729 Round 276114.79 to the nearest ten thousand. 280000 Round 1.06343778 to 1 decimal place. 1.1 What is 79.9236463 rounded to the nearest integer? 80 What is 55285.1072 rounded to the nearest ten thousand? 60000 What is -0.00138815192 rounded to 6 decimal places? -0.001388 Round 0.0028695458 to 5 dps. 0.00287 Round 6.320641 to one decimal place. 6.3 Round 10.461657 to one dp. 10.5 What is 8693722420 rounded to the nearest one million? 8694000000 What is 5557478.23 rounded to the nearest one hundred? 5557500 Round -346780.231 to the nearest one hundred. -346800 Round 80618.30419 to the nearest 10. 80620 What is -0.58228233 rounded to 1 dp? -0.6 Round -1.36043766 to four dps. -1.3604 Round 0.7980548 to 3 dps. 0.798 Round 134471.86741 to the nearest one hundred. 134500 What is -607702.4339 rounded to the nearest one hundred? -607700 What is -3155088.4 rounded to the nearest 10000? -3160000 What is -5.8056462 rounded to two decimal places? -5.81 What is 0.000107012829 rounded to seven dps? 0.000107 Round 61.41987475 to 3 dps. 61.42 Round -13162.89137 to 0 dps. -13163 What is -3.151207874 rounded to 2 decimal places? -3.15 Round -1122455.92 to the nearest 1000. -1122000 Round 0.126345455 to one decimal place. 0.1 Round -7.62610813 to three dps. -7.626 What is -24.53570909 rounded to zero dps? -25 What is -3.01454719 rounded to 1 decimal place? -3 What is -0.00054786863 rounded to 4 dps? -0.0005 Round -6103455051 to the nearest one hundred thousand. -6103500000 Round 0.0002472904653 to seven dps. 0.0002473 What is 0.0000001895321534 rounded to 7 dps? 0.0000002 What is 18751.3704 rounded to the nearest 10? 18750 What is 5535248.1 rounded to the nearest one million? 6000000 Round 422.004726 to the nearest one hundred. 400 What is 111001538.6 rounded to the nearest one million? 111000000 Round 0.1816725256 to 3 decimal places. 0.182 Round 0.907538 to 4 decimal places. 0.9075 What is 56949235.1 rounded to the nearest 10000? 56950000 What is 0.0000004283213869 rounded to seven dps? 0.0000004 What is 38527068 rounded to the nearest 10000? 38530000 Round 1225559.16 to the nearest 100. 1225600 Round 17346294.6 to the nearest 100000. 17300000 Round -380097.057 to the nearest 10000. -380000 What is 10995.9722 rounded to the nearest one hundred? 11000 Round -0.212297111 to 3 decimal places. -0.212 What is 0.146297423 rounded to five decimal places? 0.1463 Round -35.4647996 to the nearest 10. -40 Round -20119010 to the nearest 10000. -20120000 What is -56.5564239 rounded to the nearest integer? -57 Round -0.00001086784516 to six decimal places. -0.000011 What is 0.001092569654 rounded to 7 dps? 0.0010926 What is -29788262.978 rounded to the nearest 1000? -29788000 What is 0.2200113398 rounded to 2 dps? 0.22 Round -0.000008324372176 to 6 dps. -0.000008 Round 665.095477 to one decimal place. 665.1 What is -2585949.64 rounded to the nearest 10000? -2590000 Round 0.00004220771 to seven decimal places. 0.0000422 Round 3222614.31 to the nearest ten thousand. 3220000 What is 0.0023743407 rounded to four decimal places? 0.0024 Round -18850336.396 to the nearest 100. -18850300 Round 0.00006945648884 to five decimal places. 0.00007 Round 0.0000033873718 to 7 decimal places. 0.0000034 What is -24098427 rounded to the nearest one million? -24000000 Round -0.002243992403 to 7 decimal places. -0.002244 What is 740433.96 rounded to the nearest one hundred? 740400 Round -412.09116 to 2 dps. -412.09 Round -2317754.432 to the nearest ten. -2317750 What is -54.15966745 rounded to two decimal places? -54.16 What is -0.000103186306 rounded to 7 decimal places? -0.0001032 What is 3.1869163 rounded to the nearest integer? 3 What is 2100.586451 rounded to the nearest 10? 2100 What is 2597.9923 rounded to the nearest one hundred? 2600 Round 0.207485645 to 4 decimal places. 0.2075 What is -2.772072906 rounded to two dps? -2.77 Round 0.098578908 to	{ "pile_set_name": "DM Mathematics" }
(2 + (-20)/6). Let s be (-7)/(-15) - (-4)/(-6). Which is the nearest to 0? (a) 2/5 (b) s (c) k b Let i(b) = b2 + 8b + 2. Let h be i(-8). Suppose r - h = 3r. Let f = 1/74 + -155/518. What is the closest to r in 2/7, 1, f? f Let n be (-3)/(-6)(-3)/(-2). Let x = -4.32 - -4.52. Which is the nearest to 0? (a) x (b) 0.5 (c) n a Let m = 4.16 - 0.16. What is the closest to 8 in m, 3, -0.5? m Let n be 13 + -13 - (-4)/(-1). Let k be (n - -3)(-2)/8. Suppose 3b - 4s + 16 = 0, 0 = 2b + 3s - 0 - 12. What is the closest to b in k, -4/3, -0.2? -0.2 Suppose -6u + 7u + 34 = 3o, 4o + 2u - 52 = 0. Which is the closest to 0? (a) 1 (b) 3/2 (c) -2 (d) o a Suppose -3n = -5c + 13, 0c + 5c - 10 = 0. Suppose 2g - 10g = -8. What is the nearest to n in g, 2/11, 4? 2/11 Suppose -15c = -14c - 1. What is the nearest to 3 in 1/7, -2, c? c Let s = -191 - -574/3. Which is the nearest to -5? (a) 2/3 (b) 0.5 (c) s (d) -4 d Let x = -64653/5 - -13001. Let r = -70 + x. Which is the closest to r? (a) 2/15 (b) 0 (c) 0.1 a Let n = -2.26 + 2.36. Let u be -3 + -1(-147)/51. Which is the nearest to -1/3? (a) 5 (b) n (c) u c Let v = 59/10 - 37/5. Let k(s) = -9s - 14. Let f(p) = -19p - 28. Let o(l) = -6f(l) + 13k(l). Let g be o(-7). Which is the closest to 0? (a) 0 (b) v (c) g a Suppose 22x - 30 = 32x. Which is the closest to 0? (a) -0.3 (b) x (c) 124/7 a Let p be (-147)/(-30) + (-243)/54. What is the nearest to p in 0.2, -3, 1/15, 1/7? 0.2 Let y = 14 - 9. Let j = 5.79 + -5.39. Suppose -1 + 4 = 2d - 3s, 2d + 5s = -21. What is the nearest to 0.1 in y, j, d? j Let g = 406 + -405. Let h = 6 + -10. What is the nearest to h in g, 5, -4? -4 Let v = 902.9 - 903. Which is the closest to -0.1? (a) 2/7 (b) v (c) -10/9 (d) -0.2 b Let v be 1/(-2) + (-2)/(-4). Let l be (2 - 0) + v - (6 + -11). Which is the closest to -1? (a) 4 (b) 3 (c) l b Let n be (-50)/(-12) + -19 + 33 + -18. Which is the closest to -1/10? (a) 10 (b) 1/3 (c) n c Let i be (0 + -1)/(12/((-240)/(-35))). Which is the closest to -2? (a) i (b) 0 (c) -0.3 (d) -1 d Let q = 1249 + -1249.2. Which is the closest to q? (a) -29 (b) 0.1 (c) -3/7 c Suppose 0 = -0b - 2b. Let c be (-2)/(-12) - (-154)/(-24). Let t = 267/44 + c. What is the closest to 2/3 in t, b, 4? b Let k(j) = -j3 - 19j*2 - 39j - 105. Let o be k(-17). Which is the nearest to -1? (a) 1/6 (b) o (c) 0 c Let i be 5 - 13/124. Let j = 4.6 - 5. Let s = -0.2 + 0.3. What is the closest to s in i, j, 3/7? 3/7 Let z = 4 - -126. Let k = z - 781/6. Which is the nearest to 8? (a) k (b) -0.2 (c) 0.5 c Let s be (-19)/57 + 2/4. Let j be (42/140)/(9/4). Let x = 6 - 5.8. Which is the nearest to 2/5? (a) j (b) x (c) s b Let b = -10 - -8. Let f = -7.5 + 7. Let v be (-14)/6(-34)/(-357). What is the nearest to v in b, 2, f? f Let m = -717 + 13621/19. Which is the nearest to -0.1? (a) m (b) 0 (c) -36 a Let y = 1.8 + 11.2. Let w = y + -15. Which is the closest to 0? (a) 1 (b) 0.3 (c) w b Let x = -54.5 - -54.6. Which is the closest to -0.1? (a) -2/7 (b) x (c) -0.13 (d) -0.1 d Let y be 29/9 - (280/(-36) - -8). What is the closest to -0.1 in y, 3/4, -5, -3/103? -3/103 Let p(f) = -f*3 - 13f*2 - 2f - 21. Let q be p(-13). Which is the closest to 12? (a) 0.4 (b) q (c) -5 b Let q(x) = -x*3 + 5x*2 + 8x + 3. Let v be q(6). Suppose 11k = 14k + v. Suppose 0 = 3y + y. What is the closest to -1/5 in k, 0.3, y? y Let j be 93/(-4)18/(-27). Let s be (-100)/6 - 2/(-3). Let w = s + j. Which is the closest to 2/3? (a) w (b) -2 (c) 3 a Let o = 83 - 93. What is the nearest to -0.1 in o, -0.1, 1? -0.1 Let d = -41111/524 + -104/131. Let u = 79 + d. Which is the closest to 2? (a) 1 (b) -0.2 (c) u a Let d be (1 + 0)/((-13)/263). What is the closest to d in -13, -2/7, 1/5? -2/7 Let m = -11 - -89/8. Which is the nearest to 2.7? (a) -4/3 (b) m (c) 4 c Suppose 5y = -4 - 1. Let t be y - 114/(-10). Let s be (1/(-7))/(1/(-2)). Which is the closest to s? (a) 2 (b) t (c) 1/3 c Suppose -8 = 3m - 2. Let r = 6.417 + -0.417. Which is the nearest to 0.1? (a) m (b) 5 (c) r a Let l = 524 + -9958/19. Which is the closest to -1/6? (a) 0 (b) 0.3 (c) l (d) 2 c Let u(n) = -n*3 + 5n*2 - 5n - 2. Let h be u(2). Which is the closest to 9? (a) h (b) -5 (c) 4 (d) -3 c Let g = -107 + 108. Suppose g = -6x - 23. Which is the nearest to 2? (a) 3 (b) x (c) 15 a Let o(x) = -x3 - 8x*2 - 5x - 10. Let k be o(-8). Let n be ((-27)/k)/((-24)/(-10)). Let b = 5/8 + n. What is the nearest to b in 5, 0.4, -3/5? 0.4 Let o = 3 - 5. Let l = -0.183 - -0.183. Which is the nearest to -2/9? (a) -2/7 (b) l (c) o a Let d be ((-8)/(-6))/((-440)/(-180)). Let x = -0.3 - -0.26. Let g = x - -5.04. Which is the nearest to 0? (a) g (b) -2 (c) d c Let k = -2.8 - 0.2. Let f = 5.26 - 15.26. Let d = 165 + -1487/9. What is the nearest to 2/5 in f, k, d? d Let q = -1.3 + 0.8. Suppose 0 = -0o - 3o - 3. Which is the closest to o? (a) 1 (b) 0.4 (c) q c Let r be 23/14 - (-3 - 54/(-12)). Which is the closest to 0.1? (a) -0.4 (b) -2 (c) r c Let x be (1/3)/((-25)/45). Let n = 1/10 + x. Which is the nearest to -1? (a) -2 (b) 0.12 (c) n c Let d = 0 + 0.4. Let r = d + 0.1. Let z be 3/((-10)/2 - (-8)/2). What is the nearest to 0.1 in z, r, 0? 0 Let d be (-2 + (-4)/(-2))1/(-1). Let u be (-4 + 19)/3 + -1. What is the closest to d in u, 3, 2/25? 2/25 Suppose -9z = 14 - 5. Let w be -21 + 13z/(-5). Which is the nearest to 0? (a) -2/3 (b) w (c) -1/6 c Let g(x) = x*3 + 47x*2 - 4x - 191. Let h be g(-47). Let o = 12.94 - 13. Let l = -0.2 - -0.3. Which is the nearest to l? (a) h (b) -0.3 (c) o c Let c = -4.11 - -4.3. Let k = c + 0.11. What is the closest to -3/2 in -1, k, 1? -1 Let k = -36.1 + 36.1. Which is the closest to k? (a) 1.3 (b) 0.5 (c) -1 b Let t be (0 + 2)1/7. Let u be 684/(-2520) - 3/(-42). What is the closest to t in -4, 2, u? u Let i = -2.73 + 2.6. Let o = -5.13 - i. Which is the nearest to 0? (a) -1/2 (b) 0 (c) o b Let l = -62.2 + 52.2. What is the closest to l in -2/5, 3, -0.02, 1? -2/5 Let h = 13/42 + -1/6. Which is the nearest to 1? (a) -2/7 (b) -3 (c) h c Let t = 31 + -31.2. What is the closest to 1/5 in 2, t, -1? t Let u = 21.6 - 14.6. What is the nearest to u in 3/7, -2, 0? 3/7 Let r = 48 + -48. Let t = -1 + 1.4. Let u = t - -0.6. Which is the nearest to 0? (a) r (b) u (c) -2/7 a Let h = 101045/4 - 25401. Let n = h + 139. Let k = 194 - 1549/8. Which is the nearest to 2? (a) k (b) 2/3 (c) n b Let d = 3 + -4. Let p = 156 + -784/5. Let q = 0.9 - -4.1. Which is the closest to d? (a) p (b) q (c) 2/19 a Let a = 24 + -23.9. Let d = -9.02 - -0.02. Let p = d + 12. What is the closest to 0 in a, p, 2/17? a Suppose 4t - 4b + 0 - 8 = 0, 0 = 3t - b. Let o = -3.33 - -3.33. What is the nearest to 2 in 1/8, o, t? 1/8 Let q = -0.325 - -0.325. Let i = -5 - -4.4. Let r = i - -0.5. Which is the closest to 0.3? (a) 1 (b) q (c) r b Let v be ((-66)/55 - (-102)/(-15)) + -3. Which is the closest to 0.1? (a) -5 (b) v (c) 4 c Suppose -5u = -u. Suppose -4j - 3 - 7 = -2z, -2j - z + 1 = u. Let d be (-5 - -1)((-207)/42 - -5). What is the closest to j in 1, d, 0? d Let g = 24 + -23.7. Let z = 3.3 - g. Let y = 0.55 + -0.05. Which is the closest to -1? (a) y (b) -0.01 (c) z b Let k = -833/338 + -6/169. Let y = 0.04 - 0.34. Let o = 0.1 - 0.2. What is the closest to o in y, k, -2/3? y Let l be 2 - (-5)/(30/(-9)). Let v = -7.85 - 0.15. Suppose 3h + 3s + 24 = 0, -24s = 2h - 27s - 4. What is the nearest to 0.1 in v, l, h? l Let k be (9/(-21))/(3/2). Let z(n) = n*2 - n - 2. Let g be z(0). Let j be 5/g - 3/(-2). What is the closest to -1/4 in 5, j, k? k Let p be 1512/495170/4. Let k = 130 - p. Let m be 26/(-4) - 1/2. What is the closest to 0 in -4, k, m? k Let h = 22/7 + -65/14. Let p = -1.73 + -0.27. Which is the nearest to 0.2? (a) p (b) h (c) 2 b Let u = -145 + 94. Let p = u - -50.5. What is the nearest to -2/3 in 18, p, 0.5? p Let d = -0.9 - 0.1. Let m = 2.741 + 0.259. Which is the nearest to d? (a) -3 (b) -3/2 (c) m b Suppose 3f = 10 + 2, 0 = u + 5f - 15. Let t = 15 + u. Let p be (6/(-9))/(t/15). What is the closest to -2 in -0.1, -5, p? p Let m = 1.25 - 1.15. Which is the closest to m? (	{ "pile_set_name": "DM Mathematics" }
is the tens digit of g? 2 Let d be (-4)/18 + 266/63. Suppose -do - 2t = 42 - 152, -4t = -5o + 170. What is the tens digit of o? 3 Let k be (6 + 1)/(1/3). Suppose -12 = -o + m - 3m, -3o = 3m - k. What is the units digit of (-50)/(-6) + o/(-6)? 8 Suppose 4v - a = 4a + 73, 3a = -2v + 31. What is the tens digit of -4 + v + (-6)/2? 1 Let p be (-2)/((-2)/7) + 1. Let r be p/36 - 86/(-18). Suppose -v - 5o - 8 = -3v, v - 2o - r = 0. What is the units digit of v? 9 Let v be 24/9 + 4/(-6). Suppose 3r - vg - 38 = 0, -g - 15 - 10 = -2r. What is the tens digit of r - (-1 - (1 + -2))? 1 Suppose 0 = 5f - w - 373, -4w + 1 + 7 = 0. Let n = f + -54. What is the tens digit of n? 2 Suppose -4x + 56 = -0x. Let y = 2 + x. What is the tens digit of y? 1 Let q = 36 - 0. Suppose -5y = -q - 19. What is the tens digit of y? 1 Let w = 8 - 11. Suppose 0 = -5x - 4g - 120, 6x + 48 = 5x + 4g. What is the tens digit of w/(90/x - -3)? 1 Suppose 2c - 26 = 5x, 5x + 1 = 4c - 31. What is the units digit of 23 + (3 + x - 0)? 2 Let m = 10 + -5. Suppose 2c - x = c + 25, 4c - 64 = -mx. What is the tens digit of c? 2 What is the tens digit of (-11)/(-11) + (-236)/(-1)? 3 Let j = -232 - -473. What is the tens digit of j? 4 Let i = -8 + 13. Suppose ik - 10 = -0. What is the units digit of k? 2 What is the units digit of 42/9 - 3/(-9)? 5 Suppose 5m + 2l = 682, -3m - 38 + 441 = -5l. What is the tens digit of m? 3 Let v = 15 + -10. Suppose -vl + 86 = -149. What is the units digit of l? 7 Let r(d) = -d*2 - 9d + 3. Let p be r(-9). Suppose pa + 5h - 29 = -0a, -20 = -5h. Suppose -3q = 0, 0 = -5i + aq - 1 + 6. What is the units digit of i? 1 Suppose -10g = -1751 + 361. What is the units digit of g? 9 Suppose 4y - 1359 = -5y. What is the hundreds digit of y? 1 What is the hundreds digit of (4/7 - (-88)/(-56)) + 137? 1 Let d = -45 + 89. Suppose -t - 15 + d = 0. What is the units digit of t? 9 Suppose 0b - 5b = 170. Let t be 4/(-6) - b/6. Suppose 4x - 8 = 5p, -3x + 3 = -tp + 2. What is the units digit of x? 7 Suppose -2n + 2r + 218 = 0, 2n - 2r = -4r + 226. What is the hundreds digit of n? 1 Let l(h) = 3h - 3h + 2h - h + 1606. Let z be l(0). What is the units digit of (-4)/18 - z/(-99)? 6 Let f = -57 - -85. Let w = -7 + f. Suppose -6b + 3b + w = 0. What is the units digit of b? 7 Let i(o) = o + 1. Let t be i(5). What is the units digit of 1 - t(-6)/4? 0 Let x be ((-3)/2)/((-3)/2). Suppose d - 4 + x = 0. Let m = 3 + d. What is the units digit of m? 6 Let l(j) = -j2 + 5j + 4. Suppose -19 = -z + 4p + 4, 3z + 3p = -6. What is the units digit of l(z)? 0 Suppose 3u - 15 = -3d, 2u = -5d + 8 + 2. Suppose -3i + 6 + 3 = d. What is the units digit of i? 3 Let l(a) = -4a2 + 12a - 6. Let r(g) = g*2 - 1. Let k(v) = l(v) + 3r(v). What is the units digit of k(11)? 2 Let m(v) = 4v + 3 - v - 1 - 4v. What is the units digit of m(-6)? 8 What is the units digit of 352(-7)/(-14)? 5 Suppose 0v + 4v = 76. Let g = v + 15. What is the units digit of g? 4 Let i = 48 - 10. Suppose -5y + 158 - 23 = 4o, y - i = -3o. What is the tens digit of y? 2 Suppose -i - 1824 = -9i. What is the hundreds digit of i? 2 Let a = 13 - 33. What is the tens digit of (a/3)/(2/(-6))? 2 Suppose 15 = y + 3t, 3t - t - 10 = -y. Suppose 0 = w + 3w + b, -4w + 3b - 16 = y. Let u(x) = -6x + 1. What is the units digit of u(w)? 7 Let j = 28 - 23. Suppose 0n - 2u = -2n + 24, u - 2 = -n. Suppose f + n = -2s + 20, -60 = -5f - js. What is the tens digit of f? 1 Suppose -5m - 13 + 3 = 0. What is the units digit of (m + -1 - -4)8? 8 Suppose 106 = 3d - 68. What is the tens digit of d? 5 Let o(q) = 6q3 - q2 + q - 1. Let n be o(-2). Let a = -33 - n. Let c = a - 10. What is the tens digit of c? 1 Let b(f) = f*3 - 2f*2 - 9f + 12. What is the units digit of b(5)? 2 Let z = 183 - -25. What is the hundreds digit of z? 2 Suppose p + 10 = -r, 3r - 5p - 2 = 8. Let x(m) = m*2 + m - 4. What is the tens digit of x(r)? 1 Suppose -5n + 2f = -299, -173 - 61 = -4n - f. Let d = n - 35. Suppose -6a = -2a - d. What is the units digit of a? 6 Let c(u) = u*2 + 6u - 1. Let t be c(-6). Let w(z) = -31z - 1. What is the units digit of w(t)? 0 Let c = 1 + 8. Let x(q) = -q + 1. Let r be x(4). Let j = c + r. What is the units digit of j? 6 Let y(a) = 7a - 7. Let j = -13 + 20. What is the tens digit of y(j)? 4 Suppose -3d - 27 = -1215. What is the hundreds digit of d? 3 Suppose -3n - 45 + 159 = 0. What is the units digit of n? 8 Suppose -60 + 237 = 3t. What is the tens digit of t? 5 Let u(p) = -2p - 3. What is the units digit of u(-5)? 7 Suppose -3r - 4k - 10 = k, -2r = 4k + 4. Let y = r + 14. What is the units digit of y? 4 Let b = -3 - 1. Let o = b + -3. Let i = o + 11. What is the units digit of i? 4 Suppose -3c - 13 = -5k, -3k + c + 10 = -3c. Let d be (1 + -11)k/(-4). Let y(g) = 2g + 4. What is the tens digit of y(d)? 1 Suppose 2v - 4u + 3u - 791 = 0, 797 = 2v - 3u. What is the hundreds digit of v? 3 Let z(m) = m2 - 1. What is the units digit of z(10)? 9 Suppose 0 = -3b + b. Suppose z = -y + 10, 2 = y - bz - z. What is the units digit of y? 6 Let r(l) = l3 + 5l*2 - 6l + 2. Let v be r(-6). Suppose -4t = -vt - 70. What is the units digit of t? 5 Suppose -6 = -2b + 4i, 4b + i = -b + 15. Suppose 0t + 24 = bt. Let s = 15 - t. What is the units digit of s? 7 Let f be ((-50)/(-4))/(1/6). Suppose -4x + 1 + 19 = -4z, -5x - 5z = -f. What is the units digit of x? 0 Let j(l) = -l2 + 8l - 3. Let d be j(6). Let c = 1 - -12. Suppose 0 = 5m + 4p - c, 6m = 3m - 3p + d. What is the units digit of m? 1 Let j = 9 + -6. Suppose 2s - j = -s. What is the units digit of s? 1 Let b be (2/(-6))/(5/345). What is the units digit of (b/3)/(5/(-15))? 3 Let m(l) be the second derivative of l4/6 - l3/2 - 3l2/2 - 2l. Let i(u) be the first derivative of m(u). What is the units digit of i(2)? 5 Suppose 0 = -3r + r + 24. Suppose -j + 5n - 4n = -3, -2j = 4n + r. Suppose -3m + jm + 12 = 0. What is the units digit of m? 4 Let u = 3 - 8. Suppose 0 = -2s + 5z - 61, z + 3z = 2s + 60. What is the units digit of s/u - (-4)/10? 6 Let g(i) be the third derivative of i6/120 + i5/20 - i4/24 + i3/3 + 2i2. What is the units digit of g(-2)? 8 Let y(a) be the first derivative of a3/3 + 9a2/2 - 3. What is the units digit of y(-13)? 2 Let i = 19 + -2. What is the units digit of i? 7 Let a(t) = -5t - 11. Let g(p) = -11p - 22. Let f(i) = -13a(i) + 6g(i). Suppose 0 = -5d + s + 20, -5 - 10 = d - 4s. What is the units digit of f(d)? 6 Suppose -8 = -4c + 12. Suppose cp - 3p = 14. What is the units digit of p? 7 Let q(j) = 3j2 - 18j - 8. What is the tens digit of q(8)? 4 Let k be (-4)/18 - (-282)/54. Suppose 5h = u + 4, -4u + 17 = -2u - kh. What is the units digit of u? 1 Let s(u) be the second derivative of u4/12 + u2/2 - u. Let o be s(2). Suppose 0z - 2z - 14 = -2h, 4z = -oh + 35. What is the units digit of h? 7 Let p = -10 - -7. Let v(z) = -4z - 2. What is the tens digit of v(p)? 1 Let s(c) = 2c2 + 5c. Let j be s(5). Suppose -5u = -z + j, 4z = -5u + u + 324. Let d = z + -57. What is the units digit of d? 3 Let n = 39 - 16. What is the units digit of n? 3 Let q be 2 - 3/((-9)/6). Let d(v) = -v + 9. Let m be d(4). Suppose qu = -5r + 11, u + r - m = -2. What is the units digit of u? 4 Let k(u) = u2 + u + 23. Let f be k(0). Let v = f + -6. What is the tens digit of v? 1 Let h(u) = u2 - 4u - 2. What is the tens digit of h(6)? 1 Let k(h) = 253h3 + h2 + 4h - 5. What is the tens digit of k(1)? 5 Let y = -3 - -3. Suppose 4d - 2 - 6 = y. Suppose -dc - 4x - 4 + 12 = 0, c = 2x. What is the units digit of c? 2 Let c(w) = w - 6. Let j be c(6). Let q = j + 16. What is the units digit of q? 6 Suppose -7t + 4879 = 10t. What is the hundreds digit of t? 2 Let b(k) = -5k - 2. Suppose 4v + 6 = 2. What is the units digit of b(v)? 3 Let z(k) = k. Let b(d) = 3d - 12. Let c(f) = -b(f) + 4z(f). Let n be c(-9). Suppose 5w = nx + 2w, 15 = 5w. What is the units digit of x? 3 What is the units digit of (138/18)/(2/6)? 3 Suppose -7f = -4f - 6. Suppose -3i + 17 + 10 = 3b, -22 = -3b - 2i. Suppose -	{ "pile_set_name": "DM Mathematics" }
= -o*3 - 9o2 - o + 8. Give p(r). 17 Let b(r) be the third derivative of r5/30 + r*4/24 + 5r*2 + r. Let q(p) = -2p - 15. Suppose -2w = 7 + 7. Let c be q(w). Give b(c). 1 Suppose 2v = -2s + 28, 50v - s = 49v - 4. Let w(q) = -2q*2 + 19q - 13. Let h(u) = u*2 - 9u + 6. Let k(n) = -5h(n) - 2w(n). Determine k(v). 6 Let r(k) = -244k2 + 245k*2 + 431 + 141 + 62k. Calculate r(-51). 11 Let n(u) = 5u + 47. Let g(v) = -5v - 48. Let w(b) = -4g(b) - 5n(b). Determine w(-17). 42 Let x(b) = b*2 - 6b - 1. Let i = 256 - 224. Suppose -2s - 15 = -h - 1, 5s = 2h - i. Determine x(h). -1 Suppose -3p - 4n + 46 = 0, -12p - 4n + 32 = -10p. Let l(w) = -33 - pw + 36w + 32. Give l(1). 21 Let f(j) be the second derivative of 1/20j5 - 4/3j*3 - 8j + 0 - 5j2 + 7/12j*4. Suppose -64m - 21m = 680. Give f(m). -10 Let k(n) = 8n + 53. Let m be (2 - (-45)/30)/(((-5)/10)/1). Calculate k(m). -3 Let t = -4 + 7. Let r(i) = -18i3 + 0 + 3i*t - 2i + 1 + i*2. Suppose 29j - 12 = 17. Determine r(j). -15 Let u(j) be the first derivative of -j*3/6 - 13j*2 + 20j + 102. Let d(k) be the first derivative of u(k). Give d(-22). -4 Let p be (-1060)/(-3)8/((-96)/18). Let z = p - -532. Let k(j) = 4j*2 - 4j + 3. Calculate k(z). 11 Let z be (-3)/(-2) - 3915/(-90). Let s(j) = 81j + 6 - zj - 37j. Calculate s(5). 1 Let z(n) = -2n*2 - 24n + 18. Suppose -452 = -3b - j - 485, 0 = b + 4j - 11. What is z(b)? -8 Let n(h) = -h + 15 - 31 + 11h. Let p be n(4). Let u(f) = p + f + 2f - 23 - f. What is u(-2)? -3 Suppose 571 = -h - 38. Let c = h - -606. Let p(y) = 2y + 4. What is p(c)? -2 Let q = -26 + 29. Suppose 0 = 5m, -1 = -p + qm + m. Let w(j) = 49j*2 + 5j + 3. Let z(f) = 24f2 + 3f + 2. Let g(y) = 3w(y) - 5z(y). Determine g(p). 26 Suppose -57r + 60r - 4x = 8, -r = -5x - 10. Let q(t) = 11t. Give q(r). 0 Let w(p) = -2p*2 + 7p + 1. Let o be -90(30/(-12))/5. Let a = -39 + o. Determine w(a). -29 Let t be (9/36)/((-23)/276). Let f(n) = -n + 1. Let d(h) = -2h + 2 + 0h - 2h. Let r(j) = -2d(j) + 7f(j). Calculate r(t). 0 Let f(x) be the first derivative of -x + 1/4x4 - 7/3x*3 + 3 + 4x*2. Suppose h + 433 = 439. What is f(h)? 11 Suppose 0 = 2q + 32 - 36. Suppose -2n - 2n - qj + 28 = 0, n = -5j + 7. Let b(h) = 0 + 3 - 7h2 + h3 + 5 + 0. Calculate b(n). 8 Let r(g) = -4g*3 + 265g*2 + 56g + 13. Let b(n) = n*3 - 59n*2 - 13n - 3. Let p(t) = 9b(t) + 2r(t). Suppose 9 + 3 = 3s. Calculate p(s). 27 Let a(b) = 35b*2 + 47b - 543. Let i(h) = 18h2 + 1. Let k(l) = -a(l) + 2i(l). What is k(21)? -1 Let x(p) = -632p - 632p - 619p - 631p - 2 + 2481p. What is x(-1)? 31 Suppose -4n = n + 30. Let l(s) = s*2 + 86s - 3. Let f(g) = -g*2 - 127g + 5. Let m(q) = 2f(q) + 3l(q). What is m(n)? 13 Let j(z) be the second derivative of -1/3z3 + 27z - 3z2 + 0. Let t be j(0). Let u(v) = v + 1. What is u(t)? -5 Let m(c) = -5c + 2c - 8 + 5c + c + 6. What is m(-6)? -20 Let h(u) = -u*3 + 25u*2 + u - 25. Let x = 689 - 664. Determine h(x). 0 Suppose -40a + 747 = 43a. Let l = 2 + 9. Suppose l = -2g + a. Let c(i) = -5i - 1. Determine c(g). 4 Let o(t) be the second derivative of -t3/3 - 5t*2 + 12t - 4. Let u be (-18)/15(-10)/4. Let i = u - 11. What is o(i)? 6 Let z(f) = f3 + 9f*2 - 3f + 12. Suppose 116 - 256 = 52m + 224. Give z(m). 131 Let b(k) be the first derivative of k4/4 + 14k*3/3 + 15k*2/2 + 25k - 163. Let v be b(-13). Let w(y) = -8y2 - 2y - 1. Give w(v). -7 Let d(t) = -1 + 3t2 + t3 + t + 0 - 2t*2. Let f be d(1). Let o(g) be the second derivative of -7g*3/6 + g + 16. Give o(f). -14 Let q(d) = -8d*3 - 2d*2 - 5d + 3. Let w be q(-2). Let s(g) = -wg - 71g + 4 + 139g - 3. Calculate s(9). -8 Let r(a) = a3 - 7a*2 - 5a + 58. Let j(x) = 400x + 14404. Let b be j(-36). Give r(b). -10 Let i be (-36)/72(-2 + 16) - -10. Let u(j) be the first derivative of 10j + 5 - 7/3j*i + 1/4j*4 - 3/2j*2. Calculate u(7). -11 Suppose -3r - 2g + 241 = 0, -3g + 5g + 174 = 2r. Let b(l) = -66l2 + 4l - l - 2l + rl*2. Calculate b(1). 18 Let w(p) = 2p - 10. Let c(r) = -2r2 + 35r + 14. Let f be c(18). Let s be (-9)/(-18) + 30(-1)/f. Determine w(s). 6 Let g = -55 - -106. Let o = -45 + g. Let x(n) = 6n - on - 2n - 13 + 3n. What is x(0)? -13 Let w(t) = 4t. Suppose 5v = -2f + 9, -5v = -0f + f - 7. Let u be v-3 - (-33 + 40). Calculate w(u). -40 Let n(z) = -z3 + 7z*2 - 6z + 1. Suppose 5w - 67 - 183 = 0. Let d = 66 - w. Suppose -4l - 3q + q + 28 = 0, -3l + q + d = 0. Give n(l). 1 Let m(l) = -7l + 175. Let o be m(24). Let q(u) = 8u - 72u2 + 22u*2 - 4 + 20u*2 + 29u*2. Determine q(o). 3 Suppose -2m = 3m + 5. Let d(b) = b3 - b2. Let s(f) = 3f3 + 68 - f2 + 67 - 2f2 - 134. Let a(x) = -2d(x) + s(x). Give a(m). -1 Let y(j) = 10j - 3. Let a(t) = t - 1. Let x(m) = 3a(m) - y(m). Let h be (-1)/(-8) - (7 + 906/(-48)). Let c be 6/h - 18/(-12). Give x(c). -14 Let y(a) = -2a3 - 2a*2 + 1. Let n(c) = 16c*3 + 9c*2 + 3c - 3. Let r(k) = -n(k) - 7y(k). Calculate r(2). -6 Let j be (30/8)/(560/1344). Let n(w) = -j + 134w + 135w - 270w. Give n(9). -18 Let x(s) = -s*3 + 2s*2 + 2s + 1. Let g(u) = 4u2 - 13u - 10. Let q be g(4). What is x(q)? 5 Let n(p) = -8p2 + 9p - 19. Let r(a) = 7a2 - 9a + 18. Let t(b) = -6n(b) - 7r(b). Suppose -4y - 3c + 26 = -9, -3c - 29 = -4y. Give t(y). -4 Let j(k) = k*2 + 10k + 9. Suppose 2f - l + 31 = 688, 2f - 653 = -3l. Suppose -f = -0d + 41d. Determine j(d). -7 Let a be 4 + -6 + 8 + 1. Let s(g) = -21g + 11g - 7 - 3 - 3g. Let p(h) = -5h - 5. Let k(u) = 5p(u) - 2s(u). Determine k(a). 2 Let i(z) = z2 + 10z + 11. Suppose -36k - 26k - 546 = 12. Give i(k). 2 Let o(v) = -v*3 - 4v*2 + 2v + 4. Let j = 33 + -31. Let g(f) = 0 + 6fj + 2 - 7f*2 + 15f + 10. Let a be g(16). Give o(a). -4 Let d(y) = -15y3 - y2 - y - 1. Let g = 75 - 67. Let i = 108 + -109. Let m be (i/(-2))/((-4)/g). Give d(m). 14 Let y(x) be the first derivative of x2/2 - 4x + 6. Let z(u) = -u*3 - 90u*2 + 95u + 359. Let j be z(-91). Calculate y(j). -9 Let a(m) be the third derivative of -1/3m3 + 0m - 1/12m4 + 0 - 8m*2. Suppose -2 + 5 = -b. Give a(b). 4 Let f(s) = -2278 - 2s - 4s + 5s - 2284 + 4559. Let g = 0 + 5. Suppose -gm - 7 = y, -m + 6m = -10. Give f(y). -6 Let b(o) = 0 - o*3 + 0 + 4o*2 + 0 + 5o. Let u = -466 - -471. Give b(u). 0 Let h(g) = -g*3 + 40g*2 + 84g + 24. Suppose 3y - 5c - 156 = 0, -33y = -30y - 3c - 144. Calculate h(y). 24 Let l = -3 - -9. Let k(y) be the first derivative of -y3/3 + 4y2 - y - 8474. Calculate k(l). 11 Let g = -932 + 936. Let r(j) = -j3 + 5j2 + j - 32. Determine r(g). -12 Let p(i) be the second derivative of -i5/20 + 7i*4/12 + 3i*3 - 8i*2 + 89i + 9. Give p(8). 64 Let j(t) be the first derivative of -t*4/12 + 5t3/6 - t2/2 + 71t + 76. Let l(d) be the first derivative of j(d). Determine l(5). -1 Let i be 2(-5 + 25/10). Let f(k) = 4k - 4 - 4 + 3k - 9k. Determine f(i). 2 Suppose -39 = -4c + 21. Suppose -cr = -17r + 90. Let k = r + -50. Let b(n) = n*2 + 4n + 1. Calculate b(k). 6 Let v(y) = -2y2 - y + 17. Suppose 13t + 161 - 77 = -t. Give v(t). -49 Let y(w) = 4w + 36. Let f(j) = -j + 7. Let p(d) = -15f(d) + 3y(d). Give p(3). 84 Let s = -11 - -6. Let d = s + 9. Let m(b) = b3 - 7b*2 + 4b + 3. Let h(w) = -2w3 + 15w*2 - 9w - 8. Let y(k) = -3h(k) - 7m(k). Determine y(d). -1 Suppose 2s - 24 = 4u, 0 = 3s + 5u + 3 - 6. Let z(m) = sm + 26 + 1 + 2m - 7m. What is z(-20)? 7 Suppose 11 = i - 5q - 4, 0 = -3i - q + 93. Let u(y) = 2y*2 - y. Let j be u(-2). Suppose -jo = -5o - i. Let h(w) = -w3 + 7w*2 - 9w + 2. What is h(o)? -16 Let c be ((-276)/(-6))/1(-9)/6. Let n be (c + 1)(4 + 204/(-48)). Let l(a) = -a*2 + 17a + 9. What is l(n)? 9 Let f(x) = 2 + 84x - 7 - 83x + 5 - 5. What is f(5)? 0 Suppose 3z + 403 = 217. Let c be 1/((93/z)/((-6)/4)). Let j(t) = 9t + 2. Determine j(c). 11 Let u = -5632 - -5636. Let c(n) = n*3 - 4n*2 - 4n + 1. What is c(u)? -15 Let m(g) = 42g + 183. Let j(s) = -s3 - 6s*2 - 98s - 592. Let d be j(-6). What is m(d)? 15 Suppose 0 = -4r + 5t - 44, -2*r +	{ "pile_set_name": "DM Mathematics" }
l*(-4)/ll)/l)/ll)l))/(l*0ll(-1/2)) assuming l is positive. l(-59/18) Simplify i(i/i*(-3/2))/ii(-2)/i assuming i is positive. 1/sqrt(i) Simplify t/t(2/11)t(6/11) assuming t is positive. t(15/11) Simplify ((b(3/10)b)/bbb(-4/5))/(b(-7)b(-1/4)b) assuming b is positive. b(27/4) Simplify (m(-2/5)m(-1/6))/(m(-1)/mm*5/mmm) assuming m is positive. m(-137/30) Simplify (v/(vv(vvv(-2/19)v)/vvv)v)/(v(-1/2)/v)v*4vv(2/5) assuming v is positive. v(571/190) Simplify (((t5t)/tt)/t(-10))/(tt*(3/2)/tt)(-2/7) assuming t is positive. t(117/7) Simplify m*4m*(-7)/m(mmm/(m*(-1)m))/(m*(-3/5)m) assuming m is positive. m(-7/5) Simplify ((w/(w/w2))/w2)/(w/(w/w(-2/3)))(1/99) assuming w is positive. w(2/297) Simplify (f*(-5)/(((fff/f2)/f)/f))/((f/(f/(f(-4)/ff)))/ff(-3)f) assuming f is positive. f*3 Simplify ((r/(rrr(-1/2)))(-11/4))42 assuming r is positive. r(231/4) Simplify a1a27 assuming a is positive. a28 Simplify w(-9)/(w/((w/w(-1/11))/w)) assuming w is positive. w(-109/11) Simplify ((g(-1/8)/g)(-21))(1/11) assuming g is positive. g(189/88) Simplify (h(-3/8)h/h(-3)h)/(h(3/4)/(h/(h1/h))) assuming h is positive. h(39/8) Simplify (f(-3/4)f(-5))(-10) assuming f is positive. f(115/2) Simplify ((yy/y(2/35))/y)(-7/8) assuming y is positive. y*(-33/40) Simplify (yy20)/y(-12) assuming y is positive. y33 Simplify (d(1/3)d(-2/13))(-50) assuming d is positive. d(-350/39) Simplify t/t(-17)tt2/tt assuming t is positive. t21 Simplify (((p0/p)/p)/((p/p*(-2/13))/pp))/(p*(1/3)/ppp(1/7)p) assuming p is positive. p*(-1264/273) Simplify (y/(yy(2/5)))(4/35)y(-1)/y5 assuming y is positive. y(-1058/175) Simplify (b(2/3)/(b(bbb4)/b))/(b0)(-2/3) assuming b is positive. b(-16/3) Simplify (f*0/f)/(ff*2)(ff1)/f(-5) assuming f is positive. f3 Simplify s/s(-9)s(2/11) assuming s is positive. s(112/11) Simplify (n/((n/n*(-6)nn)/n))(-27) assuming n is positive. n189 Simplify c(1/3)cc/(c/((c/c11c)/c)) assuming c is positive. c(-26/3) Simplify f/(f/((f(-1/4)/f)/f))f(f/((((f/(ff((fff/f*16)/f)/ffff))/f)/f)/f))/f assuming f is positive. f*(-37/4) Simplify ((jj(2/15))/(j5/j))/(((j/j*(2/7))/jj)/j(3/5)) assuming j is positive. j(-313/105) Simplify (o3)(-1/2)/(oo(-2/3)/o)(36/7) assuming o is positive. o(27/14) Simplify (((qq(((qq/(qq(3/13)))/q)/q)/q)/q)(1/12))18 assuming q is positive. q(-24/13) Simplify z/(z/(z6/z))zz(-1/4)((z/(z(z/((((z/(z5z))/z)/z)/z))/z))/z)/(zzzz(5/3)zzz) assuming z is positive. z(-131/12) Simplify p(2/9)/p*(-1)(p/((p/(p/(pp/p3)))/pp))/((p*(-1/4)p)/p) assuming p is positive. p*(125/36) Simplify ((w(w(4/9)/w)/w)/(((w(2/3)/w)/w)/w))/(w1)(2/17) assuming w is positive. w(254/153) Simplify m(-9)/(m*14m) assuming m is positive. m*(-24) Simplify ll*21l(-10/13) assuming l is positive. l(276/13) Simplify x(3/8)/x12 assuming x is positive. x(-93/8) Simplify ((r/r(-1))(-41))(2/189) assuming r is positive. r(-164/189) Simplify (k(20/9)/k)/(kk(6/23)/k) assuming k is positive. k(199/207) Simplify (m(-1/9)mmmm(-7)/m)(7/4) assuming m is positive. m(-161/18) Simplify ((o/(o(-2/5)/o))/ooo(-4))/((((o(-5)o)/o)/o)/((o*(3/10)o)/oo)) assuming o is positive. o(57/10) Simplify q12/qqq(-6) assuming q is positive. q6 Simplify (lll1)20/(ll(-2/3))(-2/11) assuming l is positive. l*(1982/33) Simplify uu/(uu8/u)((u(-4/19)/u)/u)/u assuming u is positive. u(-175/19) Simplify (((tt(-3))/t)/t2)/(t/(t/(tt*(-2/7)t)))(-10) assuming t is positive. t(85/7) Simplify (m(-5/6))(-2/75) assuming m is positive. m(1/45) Simplify l(15/2)/l(-12) assuming l is positive. l(39/2) Simplify i*10ii(-16/7) assuming i is positive. i(61/7) Simplify ((i(-3/5)ii)/i0)41 assuming i is positive. i(287/5) Simplify ((x/(x(((x/(x/((xx(-3))/x))x)/x)/x)/x)x)/xxx/(x/((x(-2/7)x)/x)x))/(x(1/6)xx(x*(1/5)x)/x) assuming x is positive. x(493/210) Simplify ((y(-13/2)/y)/y)/y(1/5) assuming y is positive. y(-87/10) Simplify (s*(-1/50)/s)/((ss(-5))/s) assuming s is positive. s(199/50) Simplify ((hhh(-4))/h(-6))/(h*4h/h(-4)) assuming h is positive. h(-5) Simplify (r*(-10)r(-6/11))/(r2/r(-3/4)) assuming r is positive. r(-585/44) Simplify (l(-1))(38/3)(lll(-1))(8/5) assuming l is positive. l(-166/15) Simplify ((zz*1z)(7/6))(-13) assuming z is positive. z(-91/2) Simplify (w(1/3)/(ww(-4/3)/ww))(-2/5) assuming w is positive. w(-4/15) Simplify (a/(aa/(aa*0a)))*(-39)/(a/(aa/(a/((a/(a/(a*6a)))/a)))a(4/7)) assuming a is positive. a(-235/7) Simplify (((h(-11)/hh)/h)/hh)50 assuming h is positive. h(-600) Simplify (((d(d/(d*(2/5)d))/dd)/d)/((d/((d(-2/9)/d)/dd))/d))(-12/13) assuming d is positive. d(292/195) Simplify (i/(i/(i/(ii(-1/4)ii))))/i(i/(i/(i*(6/11)/i)i))/ii(-1/7)/ii2 assuming i is positive. i(-1339/308) Simplify (ss(-10/7)s)/((s/s(-13))/s) assuming s is positive. s(-87/7) Simplify (f(-5/2)/f)/f(-23) assuming f is positive. f*(39/2) Simplify (x/(xx/x(2/5)))(4/23)/(x*(-2/27)(x*0x)/x) assuming x is positive. x(-94/3105) Simplify (y(12/11)/y)/(((y*1y)/y)/yy) assuming y is positive. y(-10/11) Simplify x/(x5x)xxxx*(1/5)((x(1/2)/x)/x)(-31/5) assuming x is positive. x*(15/2) Simplify ((pp*(3/7))/(pp/((p*(-15/7)ppp)/p)pppp))(-42) assuming p is positive. p198 Simplify kk0(kk/k(-5/3)k)/kk assuming k is positive. k(17/3) Simplify (h(-2/5)/h)(-3/13)/((h/((hh1)/h))/h)(2/41) assuming h is positive. h(991/2665) Simplify (v(1/3)vvv(-2))(19/2) assuming v is positive. v(19/6) Simplify (j(1/9)j)/j(-23/4) assuming j is positive. j(247/36) Simplify (z/z2)49/(zzz*(2/5)zz)49 assuming z is positive. z(-1323/5) Simplify (n/(n/n6))/(n/(nnnn/(n*(-1/3)/n)n)n)((n/(n*(-1)/nn))/n)(-39) assuming n is positive. n(-86/3) Simplify (j(-10))(-3/13) assuming j is positive. j*(30/13) Simplify (s/(s/((ss*11/s)/ss)))/(ss(-5)) assuming s is positive. s15 Simplify ((d(2/35)dd)/d)/((d34d)/d) assuming d is positive. d*(-1153/35) Simplify (t(tt/t(-3)t)/t)/(t/(t/((ttt(t(-2/13)t)/t)/t)))t3tt7/t assuming t is positive. t(184/13) Simplify (h(-2/3)/h)(-25/2)/(h/h(1/4))(-21/5) assuming h is positive. h(1439/60) Simplify m3((m/m*(-2/17)m)/mm)/mmm(-1/10)mm/m(-1/2) assuming m is positive. m(639/85) Simplify (j/j(2/25))(-3) assuming j is positive. j(-69/25) Simplify (p(1/2))(-2/9)(p/((pp(-3))/p)p)/(pp2p) assuming p is positive. p*(8/9) Simplify ((bb/(b/(b(-4)/b)))/b5)(4/13) assuming b is positive. b(-36/13) Simplify gg/g(2/5)g/(g/g*6)gg assuming g is positive. g(48/5) Simplify (u/(uu*(15/2)u))/u6 assuming u is positive. u(-29/2) Simplify (g/((g/(g/g*(-2/5)g))/gg)(ggg/g(1/8))/g)/((((((g/(g7/g))/gg)/g)/g)/g)/(g/(gg*(-3/7))g)) assuming g is positive. g*(3837/280) Simplify (i/((i/(i/(ii*0/ii)))/i))34 assuming i is positive. i34 Simplify ((a(1/12)/a)/a17)(-5/4) assuming a is positive. a(1075/48) Simplify (m(1/7))(-40) assuming m is positive. m(-40/7) Simplify (z(1/4))(-4/13) assuming z is positive. z(-1/13) Simplify g/(((gg(6/5))/g)/g)gg(-4/5) assuming g is positive. g Simplify (w(-1/13)w)/(w/(w/(w/w*(-10/9)))w) assuming w is positive. w(-256/117) Simplify (m(2/19)m)49 assuming m is positive. m(1029/19) Simplify ((t(t*28/tt)/t)/t)/ttt(t/(t/(((t(-21)t)/t)/t)))/t assuming t is positive. t5 Simplify x(-12)/(xxx(2/9)/x) assuming x is positive. x(-119/9) Simplify ((m*9/mm)/(mm10))/((mm*3mm)/m(1/4)) assuming m is positive. m(-31/4) Simplify (f(1/4)f)*(-7/2)(f(1/6))(1/21) assuming f is positive. f(-2201/504) Simplify h4/(hh(-9)) assuming h is positive. h12 Simplify (((pp**(-	{ "pile_set_name": "DM Mathematics" }
50 = -27i. What is the greatest common divisor of i and 30? 10 Let v = 90 + -52. Suppose 5x - 175 = -2m, -4x + 0x - 297 = -3m. What is the highest common divisor of v and m? 19 Let y = -9 + 10. Suppose -n + y = -2. What is the greatest common factor of 24 and n? 3 Suppose 0 = -4n - 2k + 4, -2k = 3n - 0n - 5. Let o = n + 4. What is the highest common factor of 2 and o? 1 Let b = -561 - -840. Suppose -5m = 0, -4k - 88 = -2m - 852. Let y = b - k. What is the greatest common factor of y and 11? 11 Suppose -4j + 8 = 3w, w = 2j - j - 9. What is the greatest common divisor of j and 1? 1 Let n(s) = -s - 3. Let c be n(-7). Let j = 45 + 2. Suppose -41 - j = -cd. What is the highest common factor of 55 and d? 11 Let w = 56 + -28. Suppose 0 = -t + 3t - w. Calculate the greatest common factor of t and 56. 14 Let d(f) = f3 + 11f*2 + 9f + 17. Let q be d(-9). Calculate the greatest common factor of 28 and q. 14 Suppose 4q + 5 - 1 = 0. Let n(s) = -10s - 1. Let z be n(q). What is the highest common divisor of z and 99? 9 Suppose -5 = 5w - 0. Let j be 15/6(1 - w). What is the highest common factor of j and 25? 5 Let d = 41 + 64. What is the highest common factor of 15 and d? 15 Suppose -3m + 28 - 9 = 4b, -m + 19 = -5b. What is the highest common factor of m and 18? 9 Suppose n = 7 + 3. Calculate the highest common divisor of 4 and n. 2 Let o = 6 + 12. Calculate the greatest common divisor of o and 12. 6 Suppose -1 = -2v - 3. Let d(w) = 2w + 12. Let a be d(-8). Let z = v - a. Calculate the greatest common divisor of z and 12. 3 Let p(x) = -2x3 - x2 + 2. Let t be p(-2). Calculate the highest common divisor of t and 35. 7 Suppose -3d = y - 97, -2y = 6d - d - 195. Suppose 5f - 125 = -3l, 173 = 4l + 3f + 10. Calculate the highest common divisor of y and l. 20 Let u = -52 - -107. Let y(v) = v3 + 14v*2 + 10v - 28. Let a be y(-13). Calculate the greatest common divisor of a and u. 11 Let n be 10/3 - (-2)/3. Suppose -3y - 1 = -4, v - ny - 7 = 0. Let q(l) = 2l2 - 8l + 9. Let t be q(6). Calculate the greatest common divisor of t and v. 11 Suppose 2z - 505 = -5u, -2z - 102 + 508 = 4u. Suppose v = -4q - 0v + u, -2 = 2v. Calculate the greatest common factor of q and 10. 5 Let y = 14 - 12. Suppose 2d + yd - 32 = 0. Calculate the greatest common factor of d and 12. 4 Let c be 1448/20 - 12/30. What is the highest common divisor of 9 and c? 9 Let w be 2/(-9) - (-11)/9. Suppose 3d - 8 = w. Let a = 13 - 10. Calculate the greatest common divisor of a and d. 3 Suppose 4y - r - 39 = 0, -3y + 4r = -5y + 24. Let h be 38/8 - 2/(-8). Suppose 2d - h = -3d. Calculate the greatest common factor of d and y. 1 Suppose -6r = -83 - 133. Calculate the highest common divisor of r and 48. 12 Let i = -83 + 151. Let v be -1 + 4/(16/i). Calculate the greatest common divisor of 176 and v. 16 Let z be 1/(-4) + (-37)/(-4). Let a(t) = t. Let b be a(-3). Let y be (9 - (-6)/b) + 2. What is the highest common divisor of z and y? 9 Let n = -2 + 0. Let b be (n/4)/(2/(-60)). Suppose -7x + 0 = -105. Calculate the highest common factor of b and x. 15 Suppose -2s - 14 = -0t + 3t, -3t + 5s - 49 = 0. Let c = t + 26. Calculate the highest common divisor of c and 2. 2 Suppose 0 = 3m - 58 - 152. Let t(y) = -y*3 - 8y*2 - 9y. Let w be t(-7). Calculate the greatest common factor of w and m. 14 Let a(s) = s + 29. Let d be a(-22). Calculate the highest common divisor of 77 and d. 7 Suppose -4k + 104 = -2h, 4k + h - 113 + 21 = 0. What is the greatest common factor of k and 60? 12 Let j(r) = r3 + 2r + 1. Let c be j(0). Let w(y) = -2y3 - 3y*2 - 2y - 1. Let z be w(-2). Calculate the highest common factor of c and z. 1 Let a(z) = z*3 + 13. Let m be 0 - 0 - (9 + -9). Let p be a(m). What is the highest common factor of p and 39? 13 Let v be (8/(-3))/((-6)/153). Suppose -4m + 31 + 41 = -4f, 5m + 3f - 82 = 0. What is the greatest common factor of m and v? 17 Suppose -d + 1 = -5. Let r be (-77 + -1)/(d/(-4)). Suppose 2v - 24 = -o, 0o - 4o = 4v - 44. Calculate the highest common divisor of r and v. 13 Let n = 16 + -9. Calculate the highest common divisor of n and 49. 7 Let c = -1 - -5. Let v = 72 - 36. Calculate the highest common divisor of v and c. 4 Let l be ((-9)/(-15))/((-3)/(-75)). Suppose 0g - 240 = -2g. What is the greatest common divisor of g and l? 15 Let q = -5 + 13. Let x = 2 + q. What is the greatest common divisor of 25 and x? 5 Let c = -3 - -3. Let f = c - -3. Suppose -5v = fx + 4, -9 = -4x + 5v + 44. Calculate the greatest common factor of 1 and x. 1 Suppose 5t - 1 = 29. Calculate the greatest common factor of t and 30. 6 Suppose 0 = -3s + 5 + 37. Calculate the highest common factor of s and 14. 14 Let t = 154 - 69. Suppose 42 + 60 = 6k. What is the highest common divisor of t and k? 17 Let h = -7 - -12. Suppose 27 = hp - 2p. What is the greatest common factor of p and 1? 1 Suppose 5a - 4 = 11. Let y = 33 - 18. What is the highest common divisor of y and a? 3 Suppose 2t - 120 = -3t. Suppose 2g - 262 = -2p, -5g + 627 = -p - p. Let r = -67 + g. Calculate the highest common factor of r and t. 12 Let d(y) = -5y3 + y + 1. Let t be d(-1). Suppose 206 = tj - 34. Calculate the greatest common factor of 16 and j. 16 Let a(q) = 7q2 - 9. Let p be a(-3). Calculate the highest common divisor of 6 and p. 6 Let y be (4/(-6))/(1/(-105)). Calculate the highest common divisor of y and 10. 10 Suppose 0 = -5m + 4h + 3, -m = -5m + 3h + 3. Let b be 11 + (-9)/m + -3. Suppose 0 = -0x + bx - 180. What is the highest common factor of 12 and x? 12 Suppose 4j = -5r - 21 + 61, -4r + j + 11 = 0. What is the greatest common divisor of r and 36? 4 Let s(m) = -m3 - m2 - m - 1. Let y be s(-2). Suppose -3o - 3q = -9, -2q = yo - q - 31. Let h = 58 + -37. What is the highest common factor of o and h? 7 Let l = -11 - -13. Suppose 2k - 9 - 4 = 3j, 5k - 1 = -3j. Calculate the highest common factor of k and l. 2 Suppose -4i - 3t + 85 = -6, -3t + 34 = i. Suppose -5s + 56 = -324. Calculate the highest common divisor of s and i. 19 Suppose -2f + 5s = -f - 15, -f + 2s = -6. Suppose -r - 7 + 52 = f. Calculate the highest common factor of r and 5. 5 Let s be -2 - (0/(-2))/2. Let h = 3 + -5. Let w be s/(-4)h-11. What is the highest common factor of w and 33? 11 Suppose -18n = -17n - 72. Let l = 146 + -98. What is the highest common factor of l and n? 24 Let q(g) = g2 - 4g + 1. Let m be q(6). Let y = -53 + 92. Calculate the greatest common divisor of m and y. 13 Suppose -3r - 52 = -7r. Calculate the highest common factor of r and 117. 13 Let s = -131 - -155. Calculate the highest common divisor of s and 56. 8 Let m(d) = -d*2 - 6d - 2. Let p be m(-5). Calculate the greatest common factor of 27 and p. 3 Let c(b) = 9b - 6. Let z be c(7). Let a = -17 - -31. Let l = 33 - a. What is the greatest common factor of l and z? 19 Let o(j) = -2j + 4. Let t(z) = -z*2 + z - 1. Let f be t(2). Let h be o(f). Suppose s - 5 = 10. What is the highest common factor of h and s? 5 Suppose 0 = -2w - 3w + 130. Let u = w - 18. Calculate the greatest common factor of u and 4. 4 Let x(p) = 9p - 24. Let s be x(3). Let l = -59 - -83. What is the highest common divisor of s and l? 3 Let t be (17 - 5)26/3. Let f(g) = 2g + g*2 + 4 + g - 9. Let c be f(-6). What is the greatest common factor of c and t? 13 Suppose -3k = w - 4, 2w + 3 = 3k + 2. Let g = 4 + -1. What is the highest common divisor of g and w? 1 Suppose 1 = -3q + 4. Let d be (-5)/(2/4 - q). Suppose d = 4s + s. What is the greatest common divisor of 22 and s? 2 Let z = 5 - -7. Suppose -z = -l - 6. What is the highest common divisor of l and 30? 6 Let s(p) = -154p3 + p2 + p. Let l be (-3)/(-9)3-1. Let g be s(l). What is the greatest common factor of 14 and g? 14 Let a be ((-24)/20)/((-6)/20). Suppose 2m - am + 4 = 0. What is the greatest common divisor of m and 1? 1 Suppose -24 = -5t - 4q, -4t + 19 = q - 9. Let u(n) = -n**2 - n - 2. Let s be u(0). Let p = t + s. Calculate the highest common divisor of p and 15. 3 Let f = 32 - 63. Let z = f + 70. Calculate the greatest common factor of z and 26. 13 Let b be 2/(-1) + 190/19. Let n(r) be the first d	{ "pile_set_name": "DM Mathematics" }
93 What is 659026 to the power of 1/2, to the nearest integer? 812 What is the cube root of 4588775 to the nearest integer? 166 What is 263846 to the power of 1/6, to the nearest integer? 8 What is the eighth root of 1092048 to the nearest integer? 6 What is 195157 to the power of 1/2, to the nearest integer? 442 What is the square root of 1122567 to the nearest integer? 1060 What is the ninth root of 172359 to the nearest integer? 4 What is the square root of 178638 to the nearest integer? 423 What is the seventh root of 10675717 to the nearest integer? 10 What is 11228464 to the power of 1/9, to the nearest integer? 6 What is 209854 to the power of 1/5, to the nearest integer? 12 What is 35854712 to the power of 1/2, to the nearest integer? 5988 What is the third root of 7878342 to the nearest integer? 199 What is 3813979 to the power of 1/2, to the nearest integer? 1953 What is the square root of 36163 to the nearest integer? 190 What is the third root of 441808 to the nearest integer? 76 What is 36545577 to the power of 1/2, to the nearest integer? 6045 What is 486496 to the power of 1/3, to the nearest integer? 79 What is the cube root of 170696 to the nearest integer? 55 What is 1955175 to the power of 1/9, to the nearest integer? 5 What is the ninth root of 28466331 to the nearest integer? 7 What is the sixth root of 607534 to the nearest integer? 9 What is 902009 to the power of 1/8, to the nearest integer? 6 What is the ninth root of 8395841 to the nearest integer? 6 What is 59659 to the power of 1/9, to the nearest integer? 3 What is the cube root of 69932 to the nearest integer? 41 What is 11681634 to the power of 1/2, to the nearest integer? 3418 What is the square root of 3644338 to the nearest integer? 1909 What is 334927 to the power of 1/9, to the nearest integer? 4 What is the ninth root of 295474 to the nearest integer? 4 What is the square root of 2914579 to the nearest integer? 1707 What is the ninth root of 831851 to the nearest integer? 5 What is 172131 to the power of 1/10, to the nearest integer? 3 What is the ninth root of 4476821 to the nearest integer? 5 What is the square root of 5284638 to the nearest integer? 2299 What is the square root of 496429 to the nearest integer? 705 What is the square root of 1294068 to the nearest integer? 1138 What is the eighth root of 25299537 to the nearest integer? 8 What is the square root of 199570 to the nearest integer? 447 What is the third root of 9614926 to the nearest integer? 213 What is 10302131 to the power of 1/3, to the nearest integer? 218 What is 2085869 to the power of 1/2, to the nearest integer? 1444 What is the sixth root of 1710448 to the nearest integer? 11 What is 2234921 to the power of 1/2, to the nearest integer? 1495 What is the square root of 406286 to the nearest integer? 637 What is the square root of 11243023 to the nearest integer? 3353 What is the tenth root of 3672527 to the nearest integer? 5 What is 63078 to the power of 1/6, to the nearest integer? 6 What is 20227318 to the power of 1/3, to the nearest integer? 272 What is 268108 to the power of 1/3, to the nearest integer? 64 What is 565759 to the power of 1/2, to the nearest integer? 752 What is the third root of 1779625 to the nearest integer? 121 What is the cube root of 15918537 to the nearest integer? 252 What is the seventh root of 556693 to the nearest integer? 7 What is the square root of 12005745 to the nearest integer? 3465 What is the square root of 4969899 to the nearest integer? 2229 What is 4395950 to the power of 1/3, to the nearest integer? 164 What is 46058 to the power of 1/9, to the nearest integer? 3 What is 173271 to the power of 1/9, to the nearest integer? 4 What is the sixth root of 3570411 to the nearest integer? 12 What is the third root of 175990 to the nearest integer? 56 What is the square root of 818854 to the nearest integer? 905 What is 2605555 to the power of 1/2, to the nearest integer? 1614 What is 3185530 to the power of 1/3, to the nearest integer? 147 What is the seventh root of 506470 to the nearest integer? 7 What is 4858075 to the power of 1/8, to the nearest integer? 7 What is 2210332 to the power of 1/2, to the nearest integer? 1487 What is 27667141 to the power of 1/6, to the nearest integer? 17 What is the third root of 12990283 to the nearest integer? 235 What is the sixth root of 389584 to the nearest integer? 9 What is 2683586 to the power of 1/2, to the nearest integer? 1638 What is 18749398 to the power of 1/3, to the nearest integer? 266 What is 1015316 to the power of 1/3, to the nearest integer? 101 What is the third root of 1275139 to the nearest integer? 108 What is the square root of 698340 to the nearest integer? 836 What is the square root of 605228 to the nearest integer? 778 What is 195358 to the power of 1/5, to the nearest integer? 11 What is 700779 to the power of 1/10, to the nearest integer? 4 What is the eighth root of 8281507 to the nearest integer? 7 What is the third root of 107992 to the nearest integer? 48 What is the third root of 17113708 to the nearest integer? 258 What is the third root of 3174216 to the nearest integer? 147 What is 211689 to the power of 1/4, to the nearest integer? 21 What is 10478332 to the power of 1/2, to the nearest integer? 3237 What is 3477375 to the power of 1/2, to the nearest integer? 1865 What is the seventh root of 21669291 to the nearest integer? 11 What is 15421083 to the power of 1/3, to the nearest integer? 249 What is 7463936 to the power of 1/7, to the nearest integer? 10 What is the third root of 5698582 to the nearest integer? 179 What is 14602181 to the power of 1/2, to the nearest integer? 3821 What is 200541 to the power of 1/3, to the nearest integer? 59 What is 452747 to the power of 1/3, to the nearest integer? 77 What is 141492 to the power of 1/9, to the nearest integer? 4 What is 2425055 to the power of 1/2, to the nearest integer? 1557 What is the cube root of 2547389 to the nearest integer? 137 What is 260174 to the power of 1/3, to the nearest integer? 64 What is the ninth root of 16598 to the nearest integer? 3 What is the square root of 3118416 to the nearest integer? 1766 What is 4886239 to the power of 1/5, to the nearest integer? 22 What is the cube root of 72342 to the nearest integer? 42 What is 231686 to the power of 1/3, to the nearest integer? 61 What is the ninth root of 1519200 to the nearest integer? 5 What is the cube root of 6115045 to the nearest integer? 183 What is 4822220 to the power of 1/3, to the nearest integer? 169 What is 248866 to the power of 1/2, to the nearest integer? 499 What is the fourth root of 26981054 to the nearest integer? 72 What is the cube root of 198721 to the nearest integer? 58 What is the square root of 7298080 to the nearest integer? 2701 What is 9903716 to the power of 1/2, to the nearest integer? 3147 What is 166763 to the power of 1/4, to the nearest integer? 20 What is the seventh root of 150335 to the nearest integer? 5 What is the cube root of 3075282 to the nearest integer? 145 What is the ninth root of 2370451 to the nearest integer? 5 What is 340957 to the power of 1/3, to the nearest integer? 70 What is the cube root of 1892641 to the nearest integer? 124 What is 2899930 to the power of 1/3, to the nearest integer? 143 What is 13981820 to the power of 1/2, to the nearest integer? 3739 What is the square root of 1392067 to the nearest integer? 1180 What is 32127 to the power of 1/5, to the nearest integer? 8 What is the third root of 10393094 to the nearest integer? 218 What is 4622316 to the power of 1/2, to the nearest integer? 2150 What is 14113 to the power of 1/2, to the nearest integer? 119 What is 212439 to the power of 1/2, to the nearest integer? 461 What is the sixth root of 205310 to the nearest integer? 8 What is 73622 to the power of 1/8, to the nearest integer? 4 What is the seventh root of 190345 to the nearest integer? 6 What is 1072356 to the power of 1/2, to the nearest integer? 1036 What is the third root of 4702078 to the nearest integer? 168 What is the square root of 2213434 to the nearest integer? 1488 What is the square root of 187495 to the nearest integer? 433 What is the sixth root of 100	{ "pile_set_name": "DM Mathematics" }
ts digit of (2 - z/24)6? 7 Suppose -5r + 2i = -36, -21 = r - 6r - 3i. Let s be 314/r - (-2)/3. What is the units digit of (0 - -1) + 0 + s? 4 Let n be 2(-3 - 38/(-4)). Suppose 3 = 3i, -n = 4b + 4i + 7. What is the units digit of (4 - -2)(-2)/b? 2 Suppose -u + 0 = 5. Let t = 153 - 154. What is the units digit of t/u - 40/(-50)? 1 Suppose 21 = 7h - 0h. Let m(t) = -t*2 + 4t. What is the units digit of m(h)? 3 Let k = 4023 - 2291. What is the thousands digit of k? 1 Suppose -3q = 36q - 7761. What is the hundreds digit of q? 1 Suppose h + 5v - 522 = 0, -57h + 4v = -62h + 2694. What is the tens digit of h? 4 Let n be (-4)/14 - 2/21-3. Suppose 9q - 96 - 372 = n. What is the tens digit of q? 5 Let d(l) = -3l - 1. Let z be d(-1). Let q(i) = -i - z + i2 + 2. What is the units digit of q(3)? 6 Suppose 7k - 4k - 2z - 10163 = 0, k = -4z + 3397. What is the tens digit of k? 8 Let h(p) = -p. Let i be h(-5). Suppose 2v - 5a = 3, 3v - 2a + 24 = iv. Suppose -4t = -v - 123. What is the tens digit of t? 3 Let d = 3038 + -1918. What is the tens digit of d? 2 Suppose 7h - 210 = 2h. Suppose h = -5k - 48. Let o = k + 31. What is the tens digit of o? 1 Suppose 9m - 93 = -462. Let s = m - -105. What is the units digit of s? 4 Suppose 3q = 10a - 11a + 4903, a + 6549 = 4q. What is the thousands digit of q? 1 Suppose -4n - 5x = -829, 4n - 2x + 1032 = 9n. What is the tens digit of n? 0 Suppose -1 = -c, 5c - 3935 = -8y + 3y. What is the units digit of y? 6 What is the units digit of (-20512)/(-24) + 1/(-12)-4? 5 What is the units digit of (-3)/(9/(-3053)) - 15/(-45)? 8 Suppose -3t + 5t = -5o - 17, -3t + 9 = -4o. Let z(c) = -2c*3 + 3c*2 - 2c + 1. What is the units digit of z(o)? 8 Let k = -449 - -1068. What is the hundreds digit of k? 6 Suppose -5j - 23 = t + 17, 2j + t + 16 = 0. What is the tens digit of j/(-10)(95 + 10)? 8 Suppose -29657 = -10p + 3083. What is the tens digit of p? 7 Let j = 2 - 4. Let f be (j - 3) + 2 + 171. What is the tens digit of (12/16)/(3/f)? 4 Suppose -10 = -5q + 5. Suppose 10c + qk = 5c + 87, 0 = -4c - k + 64. What is the tens digit of c? 1 Let w = 1029 - 504. Suppose 0 = -3h + w + 6. What is the hundreds digit of h? 1 Let o = 27 + -14. Suppose of = 14f - 56. What is the tens digit of f? 5 Let z = -182 - -274. Let f = 160 - 110. Let b = z - f. What is the tens digit of b? 4 Suppose 4f + 5o = 523, -6o + o - 5 = 0. Suppose -f = -5g - g. Let x = 74 - g. What is the units digit of x? 2 Let v(b) = -3b2 - 5b + 4. Let p be v(-4). What is the units digit of (16/p)/(2/(-21))? 7 Suppose -3n - 5j + 578 = 0, 5j = -12n + 11n + 206. What is the hundreds digit of n? 1 Suppose 2r = -3r + 25. Suppose -3s + 2m = -11, -rs + 0m = m - 40. Let b = s - 0. What is the units digit of b? 7 Suppose 0 = -9v + 1003 + 2615. Suppose 93 = 5q - v. What is the tens digit of q? 9 Let w(s) = 26s*2 + 4. Let o be w(6). Suppose o = 4k + k. What is the units digit of k/8 + 6/(-4)? 2 Let x(v) = -v*3 + 9v*2 - 9v + 10. Let k(b) = b*2 - b - 4. Let z be k(4). Let t be x(z). What is the units digit of 4t(-1)/(-8)? 1 Let p = 14 + -16. What is the units digit of -1 + 48 - -1 - p? 0 Let z be (-1 - 107) + 6 + -4. Let u = 76 + z. Let h = -15 - u. What is the tens digit of h? 1 Suppose 5h + 516 + 429 = 0. Let d = -71 - h. What is the units digit of d? 8 Suppose 4 = d, 6i + 5d = 4i + 1448. What is the tens digit of i/15 + (-1)/15-6? 4 Let x = 104 - 107. Let y(p) = -30p + 35. What is the units digit of y(x)? 5 Let o(i) = i2 + 2i - 3. Let u(m) = -m*3 + 8m*2 - 6m - 3. Let g be u(7). Let j be o(g). Let w = 13 + j. What is the units digit of w? 4 Let r(q) = q*3 + 4q*2 - 6q + 1. Let p be r(-5). Let d = 10 - p. Suppose -dn + 3z = -15, 24 = 5n + 4z - 6z. What is the units digit of n? 6 Suppose 1007 = 12c - 385. What is the units digit of c? 6 Let r(o) be the first derivative of -o4/12 - o3/6 + o*2 - 5. Let k(l) be the second derivative of r(l). What is the units digit of k(-5)? 9 Suppose 3g + 0r - 8 = r, -2r + 17 = 5g. Suppose n - 5n + 5w = -4, -5n - gw + 5 = 0. Let a = 15 + n. What is the units digit of a? 6 Let h(y) = -y + 2. Let d be h(6). Let t be 1 + 2(d - -3). Let p = t - -20. What is the tens digit of p? 1 Suppose -4f - 5 = -5f. Let y be (-157)/f - (-16)/40. Let a = -8 - y. What is the tens digit of a? 2 Suppose -31352 = 15f - 93932. What is the hundreds digit of f? 1 Let o(z) = -z - 2. Let d be o(-9). Suppose dc - 448 = 3c. What is the hundreds digit of c? 1 Suppose t - 818 = 2r, -2t - 2r = -2063 + 415. What is the hundreds digit of t? 8 Suppose 2x = -2u + 18, 4u - 2u = 2x - 18. Suppose 0 = g - 3g - 8. What is the units digit of 3/(gx/(-48))? 4 Let k = 113 - 43. Suppose -3u - 19 = -k. What is the tens digit of u? 1 Let r = 10 - 4. Let v(b) = b. Let i be v(r). What is the units digit of ((-2)/i)/((-19)/627)? 1 Suppose -5m = -l - 1310, 0 = -4m + 3l + 689 + 370. Suppose 0 = -2s, 2n - 3s = -n + m. What is the tens digit of n? 8 Let t = 16 - 2. Let k(c) be the third derivative of -c*6/120 + 7c5/30 + c4/6 + 7c3/3 + c2 + 23. What is the tens digit of k(t)? 7 Suppose -5 = -j - 2, -4j = -2a + 1228. What is the tens digit of a? 2 Let r(u) = -3u2 - u - 2. Let n(z) = -z2. Let g(d) = -4n(d) + r(d). Let t be g(2). What is the units digit of t - -1 - 3-2? 7 Suppose -3r + 76 = o, -4r = 5o - 0o - 347. Let h = o - 34. Let a = 52 - h. What is the units digit of a? 9 Let a be (2/2)/((-4)/(-60)). Let x = 8 + -5. Let i = x + a. What is the tens digit of i? 1 Let s(w) = -14w + 6. Let y be s(-8). Let g = 268 - y. What is the hundreds digit of g? 1 Let c be (-32)/123/(-1). What is the tens digit of (-212)/6(-12)/c? 5 Let g(r) be the second derivative of -r5/20 - r4/4 + 3r. Let j be g(-3). Suppose 3f + 2s = 67, jf = f + 4s - 9. What is the units digit of f? 5 Let n = -4 - 10. Let v = n - -16. Suppose -vw + 4w = 24. What is the tens digit of w? 1 Let l(b) = 102b - 492. What is the hundreds digit of l(17)? 2 Let r = -601 + 1059. What is the hundreds digit of r? 4 What is the thousands digit of -1 - (1 + 0) - (-5772 - -1)? 5 Suppose 0y - 4y + 8 = 0. Suppose ys = -5o + 2o + 30, 5o - 50 = 4s. What is the units digit of o? 0 Let v(d) = -23d3 + 2d + 1. Let u be v(-1). Suppose -3w - 3l = -l - 14, -5w - 3l = -u. What is the tens digit of (-1)/((-6)/81)w? 2 Let b(j) be the second derivative of -23j*3/3 + 9j*2/2 + 12j. What is the tens digit of b(-3)? 4 Let g(c) = 53c - 198. What is the hundreds digit of g(17)? 7 Let h = 6249 - 2019. What is the thousands digit of h? 4 Suppose 54t - 58t + 176 = 0. What is the units digit of t? 4 Suppose -7s = -126 - 119. What is the tens digit of s? 3 Let g(b) = -3b + 2. Let y be g(-16). What is the units digit of (-61)/(-5) + 40/y? 3 Let h(i) = 5i2 - i + 1. Let t(v) = -v2 - 8v - 10. Let f be t(-7). What is the units digit of h(f)? 9 Suppose -22610 = 757b - 771b. What is the units digit of b? 5 Let w(q) = 33q + 6. Let n(f) = -f. Let h(b) = 18n(b) + w(b). What is the units digit of h(5)? 1 Suppose 3z - 2z - 13 = 0. Let l = z - 8. Suppose -5s = lw - 3s - 34, 2 = -w + 4s. What is the units digit of w? 6 Let q be ((-546)/(-63))/((-2)/(-12)). Let v = q - 12. What is the tens digit of v? 4 Let n(x) = 126x - 177. What is the hundreds digit of n(4)? 3 Suppose 3b - 115 = -3y + 80, b - 70 = -2y. Suppose -3t - 12 = -b. Suppose 2d + t = 6d. What is the units digit of d? 4 Let w be 87/29(-68)/3. Let u = -42 - w. What is the tens digit of u? 2 Suppose 10l + 2101 = 6181. What is the tens digit of l? 0 Let o(i) = i*3 - 24i*2 + 6i + 109. What is the hundreds digit of o(25)? 8 Let a(y) = 5y2 + 2. Let c be a(-3). Suppose 100 + 36 = 4t. Suppose 4g + 3j - c - t = 0, -2g + 39 = j. What is the units digit of g? 8 Let g = -62 + -156. What is the tens digit of (2/4)/((-655)/g + -3)? 0 Suppose -4n - d - 1 = 0, -29 = -4n + 4d + d. Let j be (-8)/2 + 3 + n. Suppose 2z + 2z - 120 = j. What is the units digit of z? 0 Let d = 3951 + 152. What is the hundreds digit of d? 1 Suppose 3x = -5c + 6, 8 = 2x + 2x + c. Suppose -5q + 3m + 165 = -m, -4m = -xq + 66. Wh	{ "pile_set_name": "DM Mathematics" }
1 What comes next: -1218079, -1218080, -1218081, -1218082, -1218083, -1218084? -1218085 What comes next: 1077, 1097, 1127, 1173, 1241, 1337, 1467, 1637? 1853 What is the next term in -600, -578, -574, -600, -668, -790? -978 What is the next term in 174063, 348128, 522193, 696258, 870323? 1044388 What comes next: 23561, 23558, 23555, 23552, 23549? 23546 What comes next: 13423, 26838, 40255, 53680, 67119, 80578, 94063? 107580 What is next in -2931, -5857, -8783, -11709, -14635, -17561? -20487 What is the next term in -407, -812, -1219, -1628, -2039? -2452 What comes next: 4445, 4515, 4585, 4655, 4725? 4795 What is the next term in 186, 154, 142, 162, 226, 346, 534, 802? 1162 What is the next term in -13315, -53285, -119909, -213193, -333143? -479765 What is next in -151, -319, -499, -691, -895, -1111? -1339 What is next in 120266, 240532, 360798? 481064 What is the next term in 3811, 7597, 11373, 15139, 18895? 22641 What comes next: -101085, -404559, -910357, -1618485, -2528949? -3641755 What is the next term in -154, -1734, -6028, -14392, -28182, -48754, -77464? -115668 What comes next: -6249, -6900, -7551, -8202, -8853? -9504 What comes next: 86255, 86265, 86265, 86249, 86211? 86145 What is the next term in -26, 64, 138, 190, 214, 204? 154 What is the next term in -44, -134, -270, -452, -680, -954? -1274 What is the next term in -16008, -32163, -48316, -64467? -80616 What is the next term in -4843, -4816, -4789, -4762, -4735, -4708? -4681 What comes next: -9148, -9308, -9470, -9634, -9800, -9968? -10138 What is next in 2225, 2182, 2123, 2042, 1933, 1790, 1607, 1378? 1097 What comes next: 2288, 2349, 2410, 2471, 2532? 2593 What is next in -238, -343, -530, -811, -1198? -1703 What is the next term in 124525, 249053, 373581? 498109 What comes next: -11590, -11572, -11536, -11476, -11386, -11260, -11092, -10876? -10606 What is the next term in -29453, -58905, -88347, -117773, -147177, -176553, -205895? -235197 What comes next: -123, -221, -321, -423, -527, -633? -741 What is the next term in -16204, -32449, -48694, -64939, -81184? -97429 What comes next: 176, 369, 562? 755 What comes next: 550, 1010, 1774, 2842, 4214? 5890 What is next in 55, 279, 659, 1195, 1887, 2735, 3739? 4899 What is next in -7658, -7667, -7698, -7763, -7874, -8043? -8282 What is next in 540, 481, 376, 219, 4, -275, -624, -1049? -1556 What is the next term in -108, -390, -830, -1428, -2184, -3098, -4170? -5400 What is the next term in -186906, -186901, -186892, -186879, -186862, -186841, -186816? -186787 What is next in -127004, -254034, -381046, -508034, -634992? -761914 What comes next: -79678, -79675, -79672, -79669, -79666, -79663? -79660 What is the next term in 177, 360, 549, 744? 945 What is next in -257, -2100, -7101, -16844, -32913, -56892, -90365, -134916? -192129 What is the next term in -325, -1333, -3015, -5365, -8377, -12045, -16363? -21325 What is next in 621, 2327, 5175, 9165, 14297, 20571, 27987? 36545 What is next in 75034, 150064, 225094, 300124, 375154, 450184? 525214 What comes next: 436, 399, 370, 355, 360, 391, 454, 555? 700 What is the next term in 10905, 43614, 98137, 174480, 272649, 392650? 534489 What is the next term in 12, 116, 370, 846, 1616? 2752 What comes next: -7093, -7458, -8067, -8920, -10017? -11358 What is next in -1322922, -1322921, -1322920, -1322919, -1322918? -1322917 What comes next: 445, 887, 1327, 1765, 2201? 2635 What is the next term in -574, -523, -456, -367, -250, -99, 92, 329? 618 What is the next term in 728, 576, 388, 164, -96, -392? -724 What comes next: 205, 411, 611, 805, 993, 1175, 1351? 1521 What comes next: 1456, 2924, 4392? 5860 What is the next term in 129, 232, 317, 384, 433, 464, 477? 472 What is the next term in -7544, -30172, -67892, -120710, -188632, -271664? -369812 What is the next term in 498, 830, 1156, 1476, 1790, 2098, 2400? 2696 What comes next: 233569, 233546, 233523? 233500 What is next in -497, -1519, -2541, -3563? -4585 What comes next: -1991, -4045, -6099, -8153? -10207 What is the next term in 224604, 224615, 224626? 224637 What is the next term in 165, 1272, 4259, 10062, 19617, 33860? 53727 What comes next: -2413, -4809, -7205, -9601, -11997, -14393? -16789 What comes next: 5406, 5416, 5440, 5484, 5554? 5656 What is next in 11088, 22203, 33316, 44427, 55536, 66643, 77748? 88851 What is next in 10649, 42556, 95719, 170138, 265813, 382744? 520931 What is next in -12121, -12123, -12125, -12127, -12129? -12131 What comes next: -149158, -149139, -149108, -149065, -149010, -148943? -148864 What comes next: -11993, -12204, -12415, -12626? -12837 What comes next: -78831, -157660, -236489, -315318? -394147 What is the next term in -8447, -8363, -8223, -8027? -7775 What comes next: -2122, -16871, -56904, -134863, -263390, -455127? -722716 What comes next: 616, 2428, 5446, 9664, 15076, 21676, 29458, 38416? 48544 What is next in -1802, -1688, -1498, -1232, -890? -472 What is next in -3488, -7344, -11198, -15050, -18900, -22748, -26594? -30438 What is next in -347, -479, -695, -989, -1355? -1787 What comes next: -79890, -159763, -239626, -319473, -399298? -479095 What is the next term in -481007, -481011, -481015, -481019? -481023 What is next in -163, -1355, -4561, -10789, -21047, -36343, -57685, -86081? -122539 What is next in -641876, -641888, -641910, -641948, -642008, -642096, -642218, -642380? -642588 What is next in 4012, 4001, 3990, 3979? 3968 What comes next: 1981, 1907, 1835, 1765, 1697, 1631? 1567 What is next in 7066, 7157, 7384, 7807, 8486, 9481? 10852 What is the next term in -360, -756, -1156, -1560, -1968? -2380 What is next in -15214, -15208, -15188, -15148, -15082, -14984, -14848? -14668 What is the next term in 555, 2183, 4875, 8631? 13451 What is next in -903, -3621, -8149, -14487, -22635? -32593 What is next in 67897, 135790, 203681, 271570, 339457? 407342 What comes next: -12098625, -12098629, -12098635, -12098643, -12098653, -12098665, -12098679? -12098695 What is next in -555, -1137, -1723, -2313, -2907, -3505? -4107 What comes next: -115892, -231766, -347642, -463520? -579400 What is the next term in -213, -1914, -6541, -15558, -30429, -52618, -83589? -124806 What is the next term in 72, 278, 578, 936, 1316? 1682 What is the next term in -7111, -14175, -21179, -28117, -34983, -41771, -48475, -55089? -61607 What is next in 1399, 1425, 1449, 1471, 1491, 1509, 1525? 1539 What is next in 687, 1437, 2187? 2937 What is the next term in 273, 446, 619, 792, 965, 1138? 1311 What comes next: -100438, -200905, -301372, -401839? -502306 What is next in 690, 1348, 1888, 2250, 2374, 2200, 1668, 718? -710 What comes next: -387, -649, -913, -1179, -1447, -1717? -1989 What is next in -3232, -6441, -9648, -12853? -16056 What is the next term in 13264, 13087, 12910, 12733, 12556? 12379 What is next in 22819, 45654, 68487, 91318, 114147, 136974? 159799 What is next in 845840, 845841, 845842? 845843 What is the next term in -550280, -550277, -550274, -550271, -550268? -550265 What comes next: 52484, 104968, 157452, 209936, 262420? 314904 What is the next term in 39906, 79805, 119704? 159603 What is next in -1032, -2142, -3332, -4608, -5976, -7442, -9012? -10692 What is next in 10037, 20076, 30115, 40154, 50193, 60232? 70271 What is the next term in -1047936, -1047942, -1047948, -1047954, -1047960? -1047966 What is the next term in 23621, 23632, 23643? 23654 What comes next: -6821, -13390, -19971, -26570, -33193, -39846, -46535? -53266 What is the next term in -7, -77, -207, -397, -647, -957? -1327 What is the next term in -60378, -60382, -60396, -60426, -60478, -60558, -60672? -60826 What comes next: -24917, -49848, -74779, -99710? -124641 What comes next: -102, -159, -192, -195, -162, -87, 36? 213 What is the next term in 96, 252, 440, 660, 912, 1196? 1512 What is next in -587, -4814, -16287, -38630, -75467, -130422, -207119, -309182? -440235 What is next in 163405, 163407, 163409? 163411 What comes next: -302, -302, -300, -296, -290? -282 What is the next term in -13234, -26464, -39694, -52924? -66154 What is next in -2695, -2714, -2745, -2788, -2843? -2910 What comes next: -780806, -1561617, -2342430, -3123245, -3904062, -4684881, -5465702? -6246525 What comes next: 76, -68, -298, -608, -992, -1444,	{ "pile_set_name": "DM Mathematics" }
. 44 Let i = -174343/151704 + -66/2107. Find the common denominator of (-6)/(-21) - (79/(-42) - 2) and i. 72 Let s = 2002 - 1980. What is the lowest common multiple of s and 11? 22 Calculate the common denominator of -97/50 and (-15)/(-5) + (-321)/120 + 2. 200 Let n be -40 + 4 + (-1 - -2). Let d = n - -317/9. Calculate the common denominator of d and 139/18. 18 Let a(x) = x*2 + 5x + 14. Calculate the lowest common multiple of 368 and a(0). 2576 Let l = -304 - -328. Calculate the least common multiple of 20 and l. 120 Suppose -127g + 120g = -21. Calculate the least common multiple of g and 22. 66 Let g(y) = -2y2 + 15y + 10. Let u be g(8). What is the common denominator of 58/40 + 35/(-10) + u and 67/14? 140 Suppose -4 = -4c - 2r, -c - 3r + 9 = 2c. What is the common denominator of (-3)/c + (-100)/21 and -29/15? 105 Let s be (-66)/8(-562)/117. Let w = s - 760/13. Calculate the common denominator of -2 + -1 - ((-712)/16 + 4) and w. 6 Let p be 141 - (-7 + 8 + -4). Suppose -3 - 2 = 5t. Find the common denominator of 111/14 and 2((-4)/t)/p. 126 Suppose 57 = -2j + 31. Let o be (1 + -23)/(-1) - -1. Let a = o + j. Calculate the lowest common multiple of 20 and a. 20 Suppose -2p + 2q - 371 - 9 = 0, 5q = -p - 202. Let j be 0/3 + (-24)/(-2). What is the common denominator of (p/(-45))/(8/j) and 9/11? 55 Suppose 3y + 3y = -24. What is the common denominator of (-1166)/(-154)(-14)/y and -51/22? 22 Let y = 33399205/245686092 - 1/457516. What is the common denominator of y and 23/6? 1074 Let p = -34 - -41. Suppose 5o + 2g - 1 - 1 = 0, g = -4o + 4. Suppose 12 = 5r + 4u - 43, 4r - ou - 18 = 0. Calculate the least common multiple of p and r. 7 Let p = 854 + -840. What is the smallest common multiple of 22 and p? 154 Suppose -12 = -4w + 5y, 34 = 5y + 14. Let a(v) = v*2 - 6v - 9. Let r be a(8). Let d = 3 + r. Calculate the smallest common multiple of w and d. 40 Let s = -105 + 116. Calculate the smallest common multiple of s and -2-9(-1)/(-2). 99 Let r = -1670 + 1686. Let m = 1 - -1. What is the lowest common multiple of r and m? 16 Let d = 19758583/10 + -1977608. Let w = d - -1756. What is the common denominator of w and (-176)/308 + 1558/(-140)? 10 Let j be 145/(-11) + (-6)/(-33). Let w = j - -17. Calculate the smallest common multiple of w + -1 - (-4)/2 and 6. 30 Let v = -7689 + 92215/12. Let c be 73948/(-72) - (3 - 6). Let u = -1025 - c. Find the common denominator of v and u. 36 Let r(a) = a*2 - 14a + 11. Let o be r(13). What is the least common multiple of ((-11)/(-22))/((-1)/(-2)) and 3(-1 + (-4)/o)? 3 Let l = -1/865 - 25079/5190. Let c = 7/212 - -14269/4452. Calculate the common denominator of c and l. 42 Let p(h) = 30h - 483. What is the smallest common multiple of p(27) and 15? 1635 Suppose -2 + 30 = 2v. Let f(g) = g2 - 25g + 9. Let s be f(18). Let d = 133 + s. Calculate the smallest common multiple of d and v. 112 Let n = -231028783/642 + 359858. Find the common denominator of n and -81/16. 5136 Suppose 8 = -2n, -1079j + 1084j - 5n - 200 = 0. Calculate the smallest common multiple of (-11)/(-1 - (-1)/2) and j. 396 Let l = -2/15519 + 688013/31038. Let t be 283/666 - 4/18. Let m = 1003/111 - t. Find the common denominator of l and m. 6 Suppose -4y + 5c + 717 = 0, -4y + 716 = -0y - 4c. What is the common denominator of -1 - (-1)/(4/y) and 8/9? 18 Let z = -9 - -25. Suppose 7u = z - 2. Let i(d) = 3d + 1. What is the least common multiple of u and i(1)? 4 Let z be (-5 + 4)/((-1)/(-39)). Calculate the common denominator of -27/14 and 15/(-15) - z/(-16). 112 Suppose -10 = 3s - 1. Let c be 1/(1(-1)/s). Suppose 2o = c + 37. What is the lowest common multiple of 8 and o? 40 Let v = 4/643 + -27713/10288. Let h(n) = 4n2 + 8n + 7. Let w be h(-5). Calculate the common denominator of -11 + 11 + w/(-8) and v. 16 Let i(t) = 2t2 - 19t - 4. Let r(u) = u*3 + 5u*2 - 7u - 5. Calculate the smallest common multiple of i(10) and r(-6). 6 Let f = 31/812 - 51643/3451. Let w be 4/6 + -1(-721)/714. Let l = f + w. What is the common denominator of -37/6 and l? 12 Let s(m) = 3m - 12. Let z be s(6). Let t = -4 - z. What is the smallest common multiple of (-6)/t + 444/60 and 8? 8 Let g be (2 + 4/(-3))24. Let z = 17 - 10. What is the smallest common multiple of g/48 + 52/6 and z? 63 What is the common denominator of 97/108 and (-60)/(-105) - (-118)/(-84)? 108 Suppose -m = -5h - 163, 2h = 28m - 31m + 472. What is the least common multiple of m and 4? 316 Suppose 4i + 0r - 16 = -4r, 3i - 4r = 26. Let c be (-9)/i(-2)/3. Let h = 7 + c. What is the least common multiple of 10 and h? 40 Let h(d) = -d3 - 17d*2 - d + 4. Suppose 10 = -b - 7. Calculate the smallest common multiple of 21 and h(b). 21 Suppose -62v = -52v - 50. Calculate the smallest common multiple of v and 34. 170 Let n(w) = -2w*2 - 67w - 87. Calculate the least common multiple of 66 and n(-32). 198 Suppose 2 = c - 20. Suppose 5v = -9 + 119. Let p(i) = -i2 + 22i + 14. Calculate the smallest common multiple of p(v) and c. 154 Let i be 3(-2)/24-28. Let t(a) = -a*2 + 8a - 4. Let h be t(i). What is the least common multiple of 8 and 8(3 - (h - 1))? 8 Let d(o) = -o2 - 4o + 7. Let c be d(-7). Let u be ((-7)/c)/((-1)/(-2)). What is the common denominator of 28 and u/(-3) + 385/30? 2 Let a(i) = 2i + 9. Let d be a(-18). Calculate the common denominator of (-3)/(d/(-82)) + 6/3 and 131/30. 90 Calculate the common denominator of -13/8 and -2 - -1 - (3135/2)/(-33). 8 Let v = 15040/11 - 542309/396. Suppose -r - r = -4250. Let o = r - 29735/14. What is the common denominator of o and v? 252 Let t = 41/2 + -13. Let r = -44 - -28. What is the common denominator of t and (140/r)/(1/(-4))? 2 Let c(t) = 5t*2 - t - 2. Let q be c(-1). Suppose -9o - q = -11o. Calculate the common denominator of -83/4 and (o/8)/(42/644). 12 Let a = -426 - -444. What is the smallest common multiple of 30 and a? 90 Let l(m) = 2m + 12. Let i be l(-4). Suppose 4s + 3w - i = -w, s + 3 = w. What is the common denominator of 1/(-36)(-194)/s and -83/6? 18 Let u = -5263/10 + 2121/4. Find the common denominator of -3 - ((-118)/(-8) + -2) and u. 20 Let t be (16 - 15)/(2/96). Find the common denominator of -56/33 and (132/9 + -2)/(t/30). 132 Let g = 2542 + -38111/15. What is the common denominator of -79/165 and g? 165 Let y = -520503/22 - -23655. Calculate the common denominator of (1 - -1)(-26)/96 and y. 264 Let u = 6 - -2. Let m be 0 + (-6)/122416. What is the common denominator of ((-3)/u)/(18/m) and -53/10? 30 Let h be (15/81)/(1/21057). Let o = -7807/2 + h. Calculate the common denominator of o and (1 - 2) + (-6)/44. 198 Let p be ((-2923739)/(-18))/13 - 0. Let s = -12498 + p. What is the common denominator of -103/6 and s? 18 Let d be (-8)/(-36) - (-14713)/9. Let o = 3343/2 - d. Find the common denominator of 53/9 and o. 18 What is the common denominator of (312/(-160))/(2/(-5)) and ((-21)/392)/(12/(-602))? 16 Let o = 2449 + -2465. Let d = -9/53 + 4153/424. Calculate the common denominator of o and d. 8 Let i(s) = -2s. Suppose -75 = -24f - 3. What is the lowest common multiple of i(-2) and f? 12 Let z = -3636 + 80059/22. Suppose -7g = -11g - 48. Calculate the common denominator of z and (-8)/(-56)(-161)/g. 132 Let b = -558622/105 + 106389/20. Let t = b + 1/105. What is the common denominator of t and 99/2? 4 Let m = 7 + 15. Let f = 100 - 54. Calculate the lowest common multiple of m and f. 506 Let l = -13 + 16. Suppose -ly = 2y. Suppose v - i = -2, -8v + 4v - i + 17 = y. Calculate the lowest common multiple of 9 and v. 9 Let y(i) = i*2 + 11 - 10i*2 + 2i*3 - 15i*2 + 5i*2 + 9i. What is the lowest common multiple of 9 and y(9)? 99 Let b = 7 + 0. Let y = b - 13. Find the common denominator of 115/6 and 9 + y - 14/4. 6 Let o = -8 - -6. Let u be ((-44)/o)/(40/(-1812)). Let h = -84516/85 - u. Find the common denominator of 19/3 and h. 51 Let o = 195 + -179. Calculate the lowest common multiple of 9 and o. 144 Suppose 0 = -42k + 15 + 69. Calculate the smallest common multiple of k and 3. 6 Let m = 58 - 33. Suppose -11u = 25u + 504. Let j = m + u. What is the lowest common multiple of 11 and j? 11 Let c(t) = t3 + 18t*2 - 11t + 12. What is the	{ "pile_set_name": "DM Mathematics" }
000). Round m to the nearest one hundred thousand. 1400000 Let r = 0.072082 + -0.072. Round r to five dps. 0.00008 Let y = -36.2442 - -59.159. Let x = y + -0.0148. Let t = x - 21.87. Round t to 1 decimal place. 1 Suppose -3u - 4q = -0q + 23, 5u + q = -10. Let g(c) = -24502c2. Let j be g(u). Let k be j/(-7) + (-4)/14. What is k rounded to the nearest one thousand? 4000 Let m = -226360.499991 - -226359.1. Let x = 37 + -35.6. Let g = m + x. Round g to six dps. 0.000009 Let z = -7.8488 + -0.2072. Let a = z - -8. Let t = a - -0.056137. What is t rounded to 5 dps? 0.00014 Let j(v) = -2v*2 - 40v - 24. Let r be j(-16). Round r to the nearest 10. 100 Let g = 12.25 + 1.45. What is g rounded to the nearest integer? 14 Let w = 60 + -60.029. What is w rounded to three dps? -0.029 Let u = -0.3500024 + 0.35. Round u to 6 dps. -0.000002 Let h(n) = -n*2 - n - 12862900. Let k be h(0). Suppose -5r - 32814485 = -5v, 5v = 3r - 0r + 32814491. Let j = k + v. Round j to the nearest one million. -6000000 Let a = -65015729.000017 + 65015696. Let y = 33 + a. What is y rounded to five decimal places? -0.00002 Let r = -0.18100086 + 0.181. Round r to seven dps. -0.0000009 Let z(q) = q*3 + q - 93. Let l be z(0). Round l to the nearest ten. -90 Let r = -236.99859 - -237. Round r to four dps. 0.0014 Suppose -2h + 1988 = -6098. Let r = h - 7143. What is r rounded to the nearest one thousand? -3000 Let q = -0.025553 + 0.0253. What is q rounded to five decimal places? -0.00025 Suppose 0 = -2y - 5r - 16, 4y - 6y - 8 = r. Let a be (-929)/((1-3)/y). Let w = 429 + a. What is w rounded to the nearest one thousand? -1000 Suppose -4w = w. Suppose 5g - 15 = -w. Let b be g/9 + 436/6. What is b rounded to the nearest 10? 70 Let w = -4549 - -2449. What is w rounded to the nearest 1000? -2000 Let l(m) = -2m - 181372m2 - 5 - 396405m*2 + 4. Let k be l(3). Round k to the nearest one million. -5000000 Let w = 34 - 33.99969. Round w to 4 decimal places. 0.0003 Let r = -5 + 4. Let b = -0.91 - r. What is b rounded to one dp? 0.1 Let a = -388 - -257. Let f = 14998092 - 14997960.99882. Let c = a + f. Round c to four dps. 0.0012 Let n = 50777 - 50776.74997. Let z = -0.25 + n. What is z rounded to four dps? 0 Let b = -52 + -14. What is b rounded to the nearest ten? -70 Suppose -5o - 77004 = -g, g = -0o + 3o + 46204. Round o to the nearest 1000. -15000 Suppose -3d = 3c - 6, -3d + 0d + 10 = 5c. Suppose 4z - 152980 = -cs - s, 5z = 5s - 255025. What is s rounded to the nearest ten thousand? 50000 Let x = 2238.06 - 2243.86109. Let d = 5.8 + x. Round d to 4 dps. -0.0011 Let v = 1.39476 + -1.594702. Let x = -2.2 - -2. Let y = x - v. What is y rounded to five dps? -0.00006 Let z = -4850525 - -4850525.10000068. Let o = -0.1 + z. Round o to seven dps. 0.0000007 Let s = 3.94 + -4. Let d = -619327 - -619327.06000104. Let n = d + s. Round n to seven dps. 0.000001 Let q = 52 - 77. Let g = 7 + q. Let w = -18.00000022 - g. What is w rounded to 7 decimal places? -0.0000002 Let o(d) = 3 + 24d*2 - 2d - 7 + 35d2. Let r be o(-7). Suppose -t - r - 4199 = 0. What is t rounded to the nearest 1000? -7000 Let w(l) = -31999l + 2. Let f be w(-2). What is f rounded to the nearest 10000? 60000 Let q = -263 + 402. Let p = 2657688409.40000061 - 2657688548.4. Let z = p + q. Round z to seven decimal places. 0.0000006 Let g = -12.0000003 + 12. Round g to six dps. 0 Let t = 219.5 + -213. Round t to the nearest integer. 7 Let b = 178 - 42. Let d = b + -135.9999881. Round d to six dps. 0.000012 Let h(i) = -2i. Let p(q) = 2q + 1. Let n(v) = -3h(v) - 4p(v). Let o be n(-2). Round o to six decimal places. 0 Let u = 1.01 - 0.62. Let h = u - 0.352. Round h to 2 dps. 0.04 Let k = -0.15449 - -0.156. Round k to 4 decimal places. 0.0015 Let l(c) = -599c3 - c. Let y be l(-1). Suppose n - y = 2n. What is n rounded to the nearest one thousand? -1000 Let m = 12905.26 - 9011.93. Let w = m - 3917. Let n = w + 25.5. Round n to one dp. 1.8 Let z = 0 - 0.1. Let d = 9.0975 - 9. Let p = z + d. Round p to 3 dps. -0.003 Let q be (2/(-2))/3-3. Let f(n) = -5400001n*2 + 2n - 1. Let h be f(q). Round h to the nearest 1000000. -5000000 Let i = -0.09999965 + 0.1. Round i to 7 decimal places. 0.0000004 Let j = -2.26 + -0.34. Let f = -16423.4037 + 16426. Let l = f + j. Round l to three decimal places. -0.004 Let b be (-288000016)/48 - (-2)/6. Round b to the nearest one million. -6000000 Let u = -0.01 + -0.19. What is u rounded to 0 dps? 0 Let r = 24037692 - 14237692. What is r rounded to the nearest 1000000? 10000000 Let r = -6 - -7. Suppose t = -r - 1. Let z(a) = -876a3 - 2a*2 - a - 2. Let c be z(t). Round c to the nearest ten thousand. 10000 Let q = 32.21 + 0.79. Let m = q - 39.7. What is m rounded to the nearest integer? -7 Let a = -8.84 + -0.16. Let m = 8.99995 + a. Round m to 4 decimal places. -0.0001 Suppose 158 = 4y - 5y - n, 0 = -2y + 3n - 311. Let k = 33 - y. What is k rounded to the nearest ten? 190 Let x = 36.5 + -22. Let b = 12 - x. Let i = b + 2.5086. What is i rounded to three dps? 0.009 Suppose 0 = 3h - 4i - 12, 2h + 4i = -h + 12. Suppose 4y - 40 - 36 = 0. Let t be (y/(-2))/((-2)/h). Round t to the nearest ten. 20 Let t = -71.99999971 + 72. Round t to seven decimal places. 0.0000003 Let a(j) = -6887j + 9. Let i be a(-9). Suppose 4h + i = y, 0 = -h + 3h - 4. Suppose -6b - y = -4q - b, b = -q + 15500. Round q to the nearest 1000. 16000 Let y(v) = 5 - 4 - 1 + 16v - 4. Let q be y(4). Round q to the nearest 10. 60 Let m = -0.09 - -0.154. What is m rounded to two dps? 0.06 Let a(f) = -f3 + f2. Let l(u) = -u*3 + 8u*2 + 3u + 2. Let n(m) = 2a(m) - l(m). Let g = 12 - 15. Let k be n(g). Round k to the nearest 10. -20 Let h = -0.009 - -0.008999682. Round h to seven dps. -0.0000003 Let v = 0 + -0.4. Let x = -0.1 - v. Let g = -0.2972 + x. What is g rounded to three dps? 0.003 Let n = -6 + 3. Let a be (-8)/n - (-6)/18. Suppose -at - 190 = -t. What is t rounded to the nearest ten? -100 Let w = 59.1 + -65. Let m = w - -6. What is m rounded to two decimal places? 0.1 Let k(m) = -m - 14. Let g be k(-14). Suppose -2n + 0n + 114000 = g. What is n rounded to the nearest ten thousand? 60000 Let c = 14 - 9. Suppose 5u - 4v + 339996 = 3u, -u - 170005 = cv. What is u rounded to the nearest one hundred thousand? -200000 Let x be 2 - 0/(-5 + 2). Suppose 27 - 139 = -xp. What is p rounded to the nearest 10? 60 Let x = 236 - 259.4. Let i = 4.4 + x. Let v = -19.000052 - i. Round v to 5 dps. -0.00005 Let g = -0.97 - -1. Let c = -363134 + 363133.96999984. Let k = c + g. Round k to 7 decimal places. -0.0000002 Let q = -150 - -150.00139. What is q rounded to 4 decimal places? 0.0014 Let k = 21 + -20.75. What is k rounded to 1 dp? 0.3 Suppose -14 = 3a + 4. Let q(o) = -172459o. Let c be q(a). Suppose -13965246 = 3x + c. Round x to the nearest one million. -5000000 Suppose g - 63 = -0g. What is g rounded to the nearest 10? 60 Let s = 4598.58864 - 4599. Let c = s - -0.41. What is c rounded to 4 decimal places? -0.0014 Let m = 19 + -14. Suppose 0 = -u - 4u + q + 1226, mu - 1227 = 2q. What is u rounded to the nearest 10? 250 Let f = 31 + -12. Let x = f + -12. Let o(p) = 7p2 + 2p - 7. Let q be o(x). What is q rounded to the nearest one hundred? 400 Let p be -128999 + -6 - (1 + -6). What is p rounded to the nearest 10000? -130000 Suppose -4p = -6 + 26. Let b be (-2)/p - 3156/15. What is b rounded to the nearest 100? -200 Let s be (-4 - -1)/(-1) - 2. Let h be (269993s - -2) + 1. Suppose 5a + 2x = -h, -a - 3a - 215994 = 3x. What is a rounded to the nearest 10000? -50000 Let y = 0.1 - 0.1024. What is y rounded to three decimal places? -0.002 Let f(u) = -1 + u*2 + 750u*3 - 5 + 5. Let j be f(1). Let s be (4/(-3))/(4/j). Round s to the nearest 100. -300 Let q = -0.952 + 0.599. Let n = -81.063 - -81. Let f = n - q. What is f rounded to one decimal place? 0.3 Let v = 0.2 - 0.20031. What is v rounded to four decimal places? -0.0003 Let x = -0.07 - -0.87. Let j = x - 0.8000065. Round j to six dps. -0.000007 Suppose 0 = -5v + 3t, -3v - 2v + 25 = 2t. Let b(a) = 5005a3 + 11657a*3 + 2245a*v + 3a**2. Let m be b(-4). What is m rounded to the nearest 100000? -1200000 Let b be 0/(-	{ "pile_set_name": "DM Mathematics" }
-1 Let p(v) = -3762v - 22569. Determine p(-6). 3 Let s(a) = a3 + 4a*2 - 20a - 70. What is s(-6)? -22 Let t(p) = 67p - 374. Calculate t(0). -374 Let o(z) = -8z*3 - 88z*2 - 16z - 38. What is o(-11)? 138 Let s(t) = 115t + 194. Determine s(-4). -266 Let i(r) = -233r + 574. Calculate i(3). -125 Let l(y) = 2y3 - y2 + 2y + 120. Calculate l(0). 120 Let f(i) = -15i2 - 233i - 747. Determine f(-11). 1 Let n(l) = 199l + 13000. Determine n(-65). 65 Let m(f) = -44f - 3838. Give m(-87). -10 Let j(n) = -39n - 3263. What is j(-84)? 13 Let g(o) = -o3 + 7o*2 + 91o - 641. Give g(10). -31 Let j(v) = -22v + 1863. Give j(85). -7 Let c(p) = -63p*2 + 3466p - 57. Determine c(55). -2 Let c(t) = -238t + 948. Give c(4). -4 Let w(h) = 20h + 391. What is w(-22)? -49 Let h(y) = -56y - 283. Calculate h(-5). -3 Let v(q) = -q3 + 24q*2 - 101q - 1. Give v(6). 41 Let h(u) = -20u3 - 82u*2 - 7u + 9. Determine h(-4). 5 Let c(z) = -110z + 988. What is c(9)? -2 Let c(z) = 2z*3 + 110z*2 + z + 36. Calculate c(-55). -19 Let c(f) = 37f*3 + 2f*2 + 6f + 5. Calculate c(-1). -36 Let a(j) = 3203j + 9620. Give a(-3). 11 Let r(i) = -i3 - 4i*2 + 10i + 26. What is r(-5)? 1 Let l(i) = -i*2 + 2658i + 34710. What is l(-13)? -13 Let k(g) = -13g2 + 274g - 19. Calculate k(23). -594 Let x(s) = 4s2 + 90s + 44. Calculate x(-22). 0 Let b(j) = 14j2 - 28j + 14. Give b(6). 350 Let v(g) = 5g2 + 210g + 221. Give v(-41). 16 Let o(u) = -u*3 - 11u*2 - 2u - 13. Give o(-8). -189 Let b(g) = g*3 - 11g*2 - 3g + 17. Determine b(11). -16 Let t(c) = -4c - 28. Calculate t(-1). -24 Let b(k) = -k3 - 35k*2 + 550k - 660. Determine b(-47). -2 Let d(c) = -c*3 + 7c*2 - 26c + 160. Calculate d(7). -22 Let r(l) = 121l3 + 2l*2 - 24l + 22. What is r(1)? 121 Let l(v) = -6v2 - 159v - 690. Calculate l(-21). 3 Let c(l) = 5l + 28. Give c(1). 33 Let z(l) = l + 79. Determine z(-10). 69 Let o(y) = -1430y - 60058. What is o(-42)? 2 Let b(w) = -w*2 + 9w - 17. Determine b(5). 3 Let j(s) = 306s + 1847. Give j(-6). 11 Let i(v) = 144v*2 - 26v + 44. Determine i(2). 568 Let h(n) = 3n3 - 119n*2 + 76n + 79. What is h(39)? 1 Let a(k) = k*2 - 19k + 79. Calculate a(16). 31 Let j(y) = 69y + 74. Determine j(7). 557 Let r(w) = -2w*2 - 27w - 59. Give r(-3). 4 Let p(g) = -g*2 + 104g - 488. Calculate p(5). 7 Let w(i) = i*2 - 105i + 479. Give w(5). -21 Let t(c) = 3c2 - 10c - 25. What is t(6)? 23 Let n(x) = 5x3 - 157x*2 + 66x - 127. Determine n(31). -3 Let j(l) = l*3 - 25l*2 + 25l + 26. What is j(24)? 50 Let y(f) = f*2 + 84f + 19. Determine y(0). 19 Let y(b) = 3b3 + 37b*2 + 12b + 9. What is y(-12)? 9 Let j(g) = g*3 - 110g*2 + 996g - 227. Calculate j(100). -627 Let s(y) = 3y3 + 15y*2 - 42y - 14. Calculate s(-7). -14 Let o(s) = -s*3 - 5s*2 + 568s + 2280. Give o(-4). -8 Let t(f) = -2f3 + 60f*2 - 58f - 3. What is t(29)? -3 Let l(g) = -8g2 + 445g - 444. What is l(1)? -7 Let t(b) = -991b + 5. Calculate t(0). 5 Let d(g) = 15g + 148. What is d(-5)? 73 Let r(l) = -l*3 + 84l*2 - 88l + 404. Give r(83). -11 Let s(x) = -66x2 - 6346x - 959. Determine s(-96). 1 Let h(z) = -z*3 - 62z*2 + 130z - 16. Give h(2). -12 Let m(d) = d*3 + 48d*2 + 592d + 1925. Calculate m(-12). 5 Let y(r) = -6r + 25. Give y(6). -11 Let o(t) = t3 + 10t*2 + 29t + 15. Determine o(-7). -41 Let s(g) = -5g2 - 235g - 72. Give s(-46). 158 Let x(s) = -2s2 + 23s + 756. Calculate x(26). 2 Let v(i) = i*3 - 13i*2 - 17i + 61. Determine v(14). 19 Let d(b) = 391b + 3975. Calculate d(-10). 65 Let v(c) = c3 + 33c2 - c + 205. Determine v(-33). 238 Let z(h) = -h2 + 37h - 167. Determine z(29). 65 Let r(w) = -w3 + 29w*2 - 152w - 12. What is r(7)? 2 Let z(p) = 172p - 2023. Give z(10). -303 Let j(x) = x3 + 15x*2 - 36x - 33. What is j(-13)? 773 Let m(r) = 44r3 + 3r*2 + 35r + 37. Determine m(-1). -39 Let g(f) = -6f3 - 26f*2 - 43f + 19. What is g(-2)? 49 Let c(p) = p*3 - 10p*2 - 42p - 6. Calculate c(13). -45 Let l(f) = 3f3 + 6f + 562. Determine l(0). 562 Let o(g) = g3 + g2 + 6g + 33. Calculate o(-3). -3 Let x(p) = 53p3 + p2 + 3p + 1. Give x(-1). -54 Let t(i) = -i2 + 32i - 99. What is t(31)? -68 Let m(r) = r*3 + 2r*2 - 211r - 1153. Calculate m(-6). -31 Let w(i) = 15i3 + 2i*2 + 2i - 1. Calculate w(1). 18 Let b(y) = -9y2 + 273y + 192. What is b(31)? 6 Let u(w) = 482w - 487. Give u(1). -5 Let o(x) = 304x + 1236. What is o(-5)? -284 Let t(g) = g*3 - 35g*2 + 66g - 2. Calculate t(33). -2 Let z(y) = y*3 + 7y*2 - 33y - 177. What is z(-6)? 57 Let v(l) = -l*3 - 3l*2 - 13l - 16. Calculate v(-4). 52 Let n(q) = -814q - 16302. Calculate n(-20). -22 Let g(b) = 36b3 - b2 + 65b - 125. Determine g(2). 289 Let l(r) = 2r*2 - 284r + 9442. Give l(89). 8 Let o(z) = 63z - 671. What is o(11)? 22 Let x(s) = 29s + 7. Calculate x(5). 152 Let h(o) = 16713o + 33414. Calculate h(-2). -12 Let x(c) = -c3 - 26c*2 + 289c + 1902. Calculate x(-33). -12 Let f(v) = -v*3 - 14v*2 - 7v + 91. Determine f(-11). -195 Let i(f) = f*3 + 11f*2 - 30f - 73. Give i(-11). 257 Let a(p) = -3p3 - 3p*2 - 4p + 3. Calculate a(-5). 323 Let u(s) = -3s2 - 194s + 474. What is u(-65)? 409 Let s(q) = 2q2 + 237q + 1961. Give s(-8). 193 Let c(j) = -127j3 - 2j*2 + 3j + 4. Calculate c(-1). 126 Let w(x) = -10x2 + 124x - 57. Calculate w(12). -9 Let f(q) = 7q3 + 247q*2 + 71q + 27. What is f(-35)? -8 Let v(p) = 405p + 2037. What is v(-5)? 12 Let v(d) = d2 + 41d + 140. Calculate v(-4). -8 Let y(p) = -p*2 + 278p - 18031. Give y(175). -6 Let l(c) = c*2 + 3c + 1. Give l(-2). -1 Let z(p) = -4p3 + 9p*2 - 30p + 50. Calculate z(3). -67 Let z(o) = 705o + 4189. Give z(-6). -41 Let t(i) = -35i2 + i - 19. Give t(3). -331 Let p(c) = c2 + 259c + 6866. What is p(-30)? -4 Let n(h) = -33h*3 + 8h*2 - 22h + 13. Determine n(1). -34 Let c(r) = 52r + 1602. Determine c(-30). 42 Let i(s) = s3 - 5s*2 + 21s - 69. Give i(5). 36 Let c(i) = 5i3 + 7i*2 + 5i - 7. Give c(3). 206 Let n(u) = -7u + 430. Give n(63). -11 Let s(m) = -3m*3 - 14m*2 - 16m - 5. Give s(-5). 100 Let b(t) = 57t3 + 2t*2 - 7t - 9. Give b(-1). -57 Let l(d) = -2d2 + 12d + 97. Calculate l(18). -335 Let r(x) = 3x + 72. Give r(-22). 6 Let x(a) = a3 + 734a*2 + 2194a + 13. Give x(-3). 10 Let k(a) = 167a + 8. What is k(-1)? -159 Let q(u) = u2 + u + 7. Calculate q(8). 79 Let x(m) = -m3 + 16m*2 + 216m + 232. Give x(25). 7 Let y(c) = -38c - 3092. What is y(-81)? -14 Let f(t) = 1055t - 24249. Give f(23). 16 Let h(o) = -424o + 17391. Calculate h(41). 7 Let o(w) = -2w*3 - 12w*2 - 68w - 416. What is o(-6)? -8 Let y(x) = x*3 - 6x*2 - 11x + 62. Give y(8). 102 Let o(x) = -3x3 - 110x*2 + 9x - 1022. Calculate o(-37). 14 Let k(h) = h*3 + 14h*2 - 7h + 127. Calculate k(-15). 7 Let k(w) = -412w + 1535. Give k(5). -525 Let d(y) = -174y + 1701. Calculate d(10). -39 Let o(z) = z*2 + 1216z - 14735. Calculate o(12). 1 Let d(q) = q*2 + q - 5. What is d(-4)? 7 Let q(m) = -4m + 143. Calculate q(22). 55 Let h(s) = -13920s + 264484. Give h(19). 4 Let z(c) = c3 + 58c*2 + 2c + 90. Calculate z(-58). -26 Let i(c) = -60c + 6909. Calculate i(115). 9 Let t(k) = 142k + 1003. Determine t(-7). 9 Let z(n) = n3 + n2 - 8n + 2. What is z(2)? -2 Let g(s) = -5s*2 - 83s + 9198. What is g(-52)? -6 Let s(p) = 2p3 - 318p*2 + 1829p + 1082. Determine s(153). 11 Let b(s) = -85s - 1699. Give b(-20). 1 Let z(f) = -f2 + 60f + 534. What is z(68)? -10 Let z(k) = -k*2 + 35k + 194. Give z(-5). -6 Let s(v) = 13v2 - 245v + 25. Determine s(19). 63 Let f(t) = 333t - 3002. Determine f(9). -5 Let q(a) = -3a*3 + 19a*2 + 24a - 60. Calculate q(7). 10 Let a(c) = -15c - 283. Calculate a(-14). -73 Let d(i) = -3i + 143. What is d(42)? 17 Let u(o) = -o*3 + 12o*2 - 24o - 65. What is u(10)? -105 Let l(a) = -5a2 - 34a + 55. What is l(-8)? 7 Let a(b) = b*2 - 45b + 321. What is a(23)? -185 Let y(q) = -6q2 + 39q + 302. Determine y(-5). -43 Let k(w) = -3w2 + 73w - 288. What is k(5)? 2 Let j(f) = -12f3 + 13f*2 + 18f - 4. Calculate j(1). 15 L	{ "pile_set_name": "DM Mathematics" }
-5 Sort -17, -0.1, 294. -17, -0.1, 294 Sort -475, 2, 16. -475, 2, 16 Sort -57, -0.1, 4, -5/28 in ascending order. -57, -5/28, -0.1, 4 Sort 42, 3, -1, -4, 765, -5. -5, -4, -1, 3, 42, 765 Sort -4, -2, 524, 5, -184 in descending order. 524, 5, -2, -4, -184 Sort -3107, -6, -4 in ascending order. -3107, -6, -4 Put 1, 2, 0, 2/41, -361 in decreasing order. 2, 1, 2/41, 0, -361 Put 96, -3, 2, 3, -4 in descending order. 96, 3, 2, -3, -4 Sort -2, 26, 12, 5, -4 in descending order. 26, 12, 5, -2, -4 Sort -0.08, -0.4, -4/5, 0.09889, -3 in descending order. 0.09889, -0.08, -0.4, -4/5, -3 Put -4, 4, -383774 in descending order. 4, -4, -383774 Sort 9/7, 3/5, -4, -3, -3/5 in decreasing order. 9/7, 3/5, -3/5, -3, -4 Sort 4, 10, -2, 1348, -5. -5, -2, 4, 10, 1348 Put -2, 57, 0, 1, -39 in decreasing order. 57, 1, 0, -2, -39 Sort 5, 31, 0, 13. 0, 5, 13, 31 Sort -1, -29045, 4. -29045, -1, 4 Sort -0.5, 23, -1/3, -4/3, -14 in descending order. 23, -1/3, -0.5, -4/3, -14 Sort -5160, -3, -164 in decreasing order. -3, -164, -5160 Put -4, 0.2, 8, -3/5, 5 in increasing order. -4, -3/5, 0.2, 5, 8 Sort 16, 2, 9, 0, 43, 1 in decreasing order. 43, 16, 9, 2, 1, 0 Sort -1, -5, 0.4, 8, -3/5, 3/2. -5, -1, -3/5, 0.4, 3/2, 8 Sort -5, -488, -3 in descending order. -3, -5, -488 Put -2231, -4, 2/11, -4/5, 34/7 in ascending order. -2231, -4, -4/5, 2/11, 34/7 Sort 21, -2748, 2. -2748, 2, 21 Sort 4, 518, 8. 4, 8, 518 Put 4, -13/674, 1.4, 1/5 in ascending order. -13/674, 1/5, 1.4, 4 Sort -6, 3, -5, -25, 19 in decreasing order. 19, 3, -5, -6, -25 Put -3, 27, -770 in descending order. 27, -3, -770 Sort 0, -3, -5869 in increasing order. -5869, -3, 0 Put -2/5, 18/11, 0.4, -0.164 in increasing order. -2/5, -0.164, 0.4, 18/11 Sort 5, -0.061, 2/5, -1928 in descending order. 5, 2/5, -0.061, -1928 Sort 1, -82, -1224, 2 in increasing order. -1224, -82, 1, 2 Put 1/12, -2, 0.0498 in decreasing order. 1/12, 0.0498, -2 Sort -21, 1/3, -10, -1/2, 0.6, 4/7 in increasing order. -21, -10, -1/2, 1/3, 4/7, 0.6 Put 1, 2, 4, -21, -63 in decreasing order. 4, 2, 1, -21, -63 Sort 15/7, 7, -1/3, 2/9, -9 in ascending order. -9, -1/3, 2/9, 15/7, 7 Sort 10, 2, 4, 23, 0, -4 in descending order. 23, 10, 4, 2, 0, -4 Sort -3/10, 0.4, -2/15, 1, 4 in ascending order. -3/10, -2/15, 0.4, 1, 4 Sort 1, 3, -20, 141 in decreasing order. 141, 3, 1, -20 Sort -1, 7, 2, -5, 1, 6211. -5, -1, 1, 2, 7, 6211 Put -3/55, -6, 11, 0.1 in descending order. 11, 0.1, -3/55, -6 Sort -6, -4, -2/7, 905, -2 in ascending order. -6, -4, -2, -2/7, 905 Sort -6, 74, 5, 3, 0, 7. -6, 0, 3, 5, 7, 74 Sort 5, -5, 3, -4, 2, 2019 in decreasing order. 2019, 5, 3, 2, -4, -5 Sort 1, -4, -5, -28, 3. -28, -5, -4, 1, 3 Sort -1/40, 1.1, 0.2, -2/7, 2 in decreasing order. 2, 1.1, 0.2, -1/40, -2/7 Sort -93, 19, -24, 5. -93, -24, 5, 19 Put -2, 7, 1, 1408 in increasing order. -2, 1, 7, 1408 Sort 166, 1, 4, 7, -3, 0. -3, 0, 1, 4, 7, 166 Put -2/11, 6/5, -469/2 in increasing order. -469/2, -2/11, 6/5 Put 5, -0.5, 0.07, 6/23, -1 in ascending order. -1, -0.5, 0.07, 6/23, 5 Sort -2, -4, -32, -1, 74, 1 in increasing order. -32, -4, -2, -1, 1, 74 Sort 143, 5, -2. -2, 5, 143 Put 2, 1, -29, -20, 4, -1 in descending order. 4, 2, 1, -1, -20, -29 Put 272, 3, -1, -3, -103 in decreasing order. 272, 3, -1, -3, -103 Put 4, 3, -0.3, -3, 1/2, -129 in decreasing order. 4, 3, 1/2, -0.3, -3, -129 Sort 1951, -3, -5. -5, -3, 1951 Put -49, -11, -245 in descending order. -11, -49, -245 Put -60, 18, 53 in descending order. 53, 18, -60 Put 3/2, -2/1229, 1370 in decreasing order. 1370, 3/2, -2/1229 Sort -3/13, 1/2, 1/9, -6. -6, -3/13, 1/9, 1/2 Sort -4, 3, 301, -2 in increasing order. -4, -2, 3, 301 Put 0, 19, -20, -2, -62, 2 in ascending order. -62, -20, -2, 0, 2, 19 Put -3495, 1, -7 in decreasing order. 1, -7, -3495 Put 0, -2, 4, -3948 in increasing order. -3948, -2, 0, 4 Sort 44, -2, -0.079 in increasing order. -2, -0.079, 44 Put 332, 4, -1435, -4 in increasing order. -1435, -4, 4, 332 Sort 3, -2, -8, -29, 77. -29, -8, -2, 3, 77 Sort 2, 5, 1, 136, -645 in ascending order. -645, 1, 2, 5, 136 Sort -0.4, -0.5, -3/5, -128/205 in ascending order. -128/205, -3/5, -0.5, -0.4 Sort -35859, 7, -9. -35859, -9, 7 Sort 769, -3, 3, 25, -5 in increasing order. -5, -3, 3, 25, 769 Sort -2, -11, 1, -1, 5, 59 in increasing order. -11, -2, -1, 1, 5, 59 Put -4, -7, 2, 6, 4, -17 in descending order. 6, 4, 2, -4, -7, -17 Put -1/2, 2/7, 1, 2/11, 92, 4 in ascending order. -1/2, 2/11, 2/7, 1, 4, 92 Put -6, -3, -313, 13 in descending order. 13, -3, -6, -313 Sort 3, 100, -1, 6. -1, 3, 6, 100 Put -1516, 4/11, -0.2, 3/5, 0.4 in decreasing order. 3/5, 0.4, 4/11, -0.2, -1516 Put -33, 3, -7, -3, -50 in descending order. 3, -3, -7, -33, -50 Put 7, -0.1, 13/4, 0, -2/11, 0.2 in decreasing order. 7, 13/4, 0.2, 0, -0.1, -2/11 Sort -3, 54, -12, 5, 28 in decreasing order. 54, 28, 5, -3, -12 Sort -5, -3, 53, 3, 1, 0 in decreasing order. 53, 3, 1, 0, -3, -5 Sort 8/21, -1, -12, -1/4 in ascending order. -12, -1, -1/4, 8/21 Sort -2/143, 2, -0.2, 0, 2/57. -0.2, -2/143, 0, 2/57, 2 Sort -4, -8, -25, 4, 3, -5. -25, -8, -5, -4, 3, 4 Sort 1, -10, 2, -1, 129, 5. -10, -1, 1, 2, 5, 129 Sort 2, 0.03, 0.31 in descending order. 2, 0.31, 0.03 Put -5, -2/3, 0.3, -0.8, 5/3 in descending order. 5/3, 0.3, -2/3, -0.8, -5 Sort 37, 21, 1, -834 in descending order. 37, 21, 1, -834 Put 10451, 5, 0.8 in descending order. 10451, 5, 0.8 Put -0.0986, -4, -1 in decreasing order. -0.0986, -1, -4 Put 1/2, -0.6, -14/125, 2 in ascending order. -0.6, -14/125, 1/2, 2 Put -4, 0.4, 1.33, 4/15, -5 in ascending order. -5, -4, 4/15, 0.4, 1.33 Put 0, 3, 20854 in decreasing order. 20854, 3, 0 Sort -2, 5, -3, -32000 in decreasing order. 5, -2, -3, -32000 Put -9, -0.5, 9, -19, 6, -6 in decreasing order. 9, 6, -0.5, -6, -9, -19 Sort -2, -6, 0.03, 11, -4, -128. -128, -6, -4, -2, 0.03, 11 Put -1, -2/3, 56307 in increasing order. -1, -2/3, 56307 Sort -3, 105, -44, 0, 4, -5 in descending order. 105, 4, 0, -3, -5, -44 Sort 1, 3, -2877, 2 in ascending order. -2877, 1, 2, 3 Put 22/5, 9, 2/3, -0.4, -61 in increasing order. -61, -0.4, 2/3, 22/5, 9 Sort -1087, 2/9, -1/4, 0.2, 2 in increasing order. -1087, -1/4, 0.2, 2/9, 2 Put 2, -362, -4, 5, 9, 19 in decreasing order. 19, 9, 5, 2, -4, -362 Put -4, 2, 5, -1/5, -59.8, 0.2 in decreasing order. 5, 2, 0.2, -1/5, -4, -59.8 Sort -5, 17, -2, -49, -1 in ascending order. -49, -5, -2, -1, 17 Sort -2, 5, 8, -23, -418, 2 in decreasing order. 8, 5, 2, -2, -23, -418 Put 2/117, 3/28, -1, 5 in ascending order. -1, 2/117, 3/28, 5 Sort -5, 12, 0, 4, -6, -9 in increasing order. -9, -6, -5, 0, 4, 12 Put 1, -3750, -4 in descending order. 1, -4, -3750 Sort -0.3, -1530/13, -89 in increasing order. -1530/13, -89, -0.3 Sort -221, 0.1, -459. -459, -221, 0.1 Put -54938, -1/4, -2 in ascending order. -54938, -2, -1/4 Sort -1/6, 53, -99, 0.3, 5, -3 in increasing order. -99, -3, -1/6, 0.3, 5, 53 Put 3/2, 5, 842.32, 0.1 in increasing order. 0.1, 3/2, 5, 842.32 Sort -4/3, -5, 2/321, -0.03, -3 in ascending order. -5, -3, -4/3, -0.03, 2/321 Sort -3, -16, 3, 107, 4 in decreasing order. 107, 4, 3, -3, -16 Put -10, 4, -5, 35, -16, -2 in increasing order. -16, -10, -5, -2, 4, 35 Sort 4/3, 7888, 1.4 in ascending order. 4/3, 1.4, 7888 Put -13399, -3/7, -1, 4/5 in increasing order. -13399, -1, -3/7, 4/5 Sort 4, 81, 0.2, -4/3, 0.08 in ascending order. -4/3, 0.08, 0.2, 4, 81 Put 27, 1, -62864 in increasing order. -62864, 1, 27 Put -0.4, 14, -12, 3, -2/19, -0.2 in increasing order. -12, -0.4, -0.2, -2/19, 3, 14 Put 4/95, -3/8, -5, 0.3, 2/9 in descending order. 0.3, 2/9, 4/95, -3/8, -5 Put -5, -69, 0.7, 4, 0.8 in increasing order. -69, -5, 0.7, 0.8, 4 Sort -326, -1, 0, 2, 3 in ascending order. -326, -1, 0, 2, 3 Put 0, -2, 16867 in ascending order. -2, 0, 16867 Put 23, -7, -5, -4, -10 in descending order. 23, -4, -5, -7, -10 Put -2, 5, 20, -19, -23 in decreasing order. 20, 5, -2, -19, -23 Sort 1610/11, 0.2, -14. -14, 0.2, 1610/11 Put 40/11, 41, 2, -2/7, 1/5 in increasing order. -2/7, 1/5, 2, 40/11, 41 Sort -4, 2, -3/7, 22/9. -4, -3/7, 2, 22/9 Put 0, 302, 2, 4, -7, -2 in increasing order. -7, -2, 0, 2, 4, 302 Sort -8, 102, -1, -16. -16, -8, -1, 102 Put -5, 3, 32, 15 in decreasing order. 32, 15, 3, -5 Sort -4, -0.2, -7, 2/11, 77, 2/89 in descending order. 77, 2/11, 2/89, -0.2, -4, -7 Put	{ "pile_set_name": "DM Mathematics" }
ng 1 n and 2 r. 3/55 Calculate prob of picking 1 m, 1 t, 1 f, and 1 v when four letters picked without replacement from {t: 4, m: 2, i: 9, v: 4, f: 1}. 32/4845 Three letters picked without replacement from aawawwawwwwaa. Give prob of picking 3 a. 10/143 Calculate prob of picking 2 f and 1 u when three letters picked without replacement from {f: 5, t: 8, u: 3}. 3/56 Two letters picked without replacement from rrr. Give prob of picking 2 r. 1 Two letters picked without replacement from {u: 16, y: 4}. Give prob of picking 2 y. 3/95 Calculate prob of picking 1 c and 1 t when two letters picked without replacement from ccocctoooooocooocoo. 2/57 Two letters picked without replacement from tdtdtdttftdddt. What is prob of picking 1 f and 1 t? 1/13 Calculate prob of picking 1 y and 3 o when four letters picked without replacement from soyddvddosvsovvdov. 1/765 Two letters picked without replacement from {m: 2, q: 5, v: 5}. Give prob of picking 1 q and 1 m. 5/33 Calculate prob of picking 2 n when two letters picked without replacement from {n: 15, j: 5}. 21/38 Three letters picked without replacement from hjrrd. What is prob of picking 1 d, 1 h, and 1 r? 1/5 What is prob of picking 1 o and 1 l when two letters picked without replacement from lokvvjvoolvjvvjk? 1/20 Four letters picked without replacement from {v: 3, y: 4, n: 3, s: 1}. Give prob of picking 3 n and 1 v. 1/110 What is prob of picking 1 y, 1 n, and 1 w when three letters picked without replacement from {g: 2, n: 4, o: 2, y: 1, w: 1}? 1/30 Calculate prob of picking 1 v and 2 t when three letters picked without replacement from tgjvgtjtgtjgt. 5/143 Two letters picked without replacement from {e: 4, t: 1, l: 2}. What is prob of picking 2 e? 2/7 Calculate prob of picking 1 c and 1 j when two letters picked without replacement from {q: 1, c: 2, j: 1}. 1/3 Calculate prob of picking 2 o when two letters picked without replacement from {o: 9, n: 7}. 3/10 Four letters picked without replacement from {n: 1, a: 7, p: 2, v: 3, t: 1}. Give prob of picking 1 v, 1 a, and 2 p. 3/143 Calculate prob of picking 1 g, 1 j, and 1 z when three letters picked without replacement from {g: 1, z: 3, j: 1, e: 2}. 3/35 Three letters picked without replacement from xsggsssqxsgqgsx. What is prob of picking 1 x and 2 s? 9/91 What is prob of picking 2 a when two letters picked without replacement from {a: 2, n: 1}? 1/3 Calculate prob of picking 1 o and 3 l when four letters picked without replacement from lollllllllollllllo. 91/204 What is prob of picking 1 a and 1 n when two letters picked without replacement from naz? 1/3 Calculate prob of picking 2 k and 1 m when three letters picked without replacement from {j: 1, y: 3, a: 2, d: 1, m: 1, k: 3}. 1/55 Calculate prob of picking 2 o, 1 r, and 1 e when four letters picked without replacement from {h: 1, v: 2, e: 1, r: 1, o: 9, b: 1}. 12/455 Calculate prob of picking 2 w when two letters picked without replacement from wwkwkwkwkwwwkkwk. 3/10 Calculate prob of picking 4 v when four letters picked without replacement from vvfvmncv. 1/70 What is prob of picking 1 j and 3 q when four letters picked without replacement from jqqqj? 2/5 Two letters picked without replacement from pspws. Give prob of picking 2 s. 1/10 Calculate prob of picking 1 b and 1 c when two letters picked without replacement from {q: 3, b: 1, s: 5, i: 2, c: 5}. 1/24 Two letters picked without replacement from {i: 12, l: 7}. What is prob of picking 2 l? 7/57 Four letters picked without replacement from {o: 1, z: 2, d: 7}. Give prob of picking 1 z and 3 d. 1/3 Calculate prob of picking 1 h and 1 t when two letters picked without replacement from htotoohoh. 1/6 Calculate prob of picking 2 c and 1 k when three letters picked without replacement from {h: 1, k: 1, c: 2, z: 2, e: 1, y: 1}. 1/56 Calculate prob of picking 1 f, 1 q, and 1 t when three letters picked without replacement from {t: 3, y: 10, q: 2, v: 1, h: 2, f: 1}. 2/323 Calculate prob of picking 1 y and 1 r when two letters picked without replacement from rrryrrrrrkrkkyrkrrk. 8/57 What is prob of picking 1 v, 1 p, 1 x, and 1 g when four letters picked without replacement from {h: 1, j: 2, p: 1, g: 1, x: 1, v: 1}? 1/35 What is prob of picking 1 c and 1 t when two letters picked without replacement from cctcccccccqccc? 12/91 Two letters picked without replacement from oereoreofooo. What is prob of picking 1 e and 1 r? 1/11 Calculate prob of picking 3 d and 1 t when four letters picked without replacement from tdsddsds. 2/35 What is prob of picking 1 v and 2 o when three letters picked without replacement from oocbbbbocbobvbbkb? 3/340 Four letters picked without replacement from hssjshjjs. Give prob of picking 3 s and 1 h. 4/63 Four letters picked without replacement from sssiiisisiiisiis. What is prob of picking 4 s? 1/52 Two letters picked without replacement from efvsfvgggg. What is prob of picking 1 g and 1 e? 4/45 Three letters picked without replacement from uuuuu. Give prob of picking 3 u. 1 Calculate prob of picking 3 v when three letters picked without replacement from {v: 9, m: 1, g: 1}. 28/55 What is prob of picking 1 x and 1 q when two letters picked without replacement from qxx? 2/3 Calculate prob of picking 2 n and 2 a when four letters picked without replacement from {n: 2, c: 1, d: 1, a: 2}. 1/15 What is prob of picking 1 p and 1 b when two letters picked without replacement from {b: 2, n: 1, p: 1, s: 1}? 1/5 Calculate prob of picking 3 a when three letters picked without replacement from aaa. 1 Four letters picked without replacement from {q: 2, u: 1, z: 3, o: 3, p: 6}. What is prob of picking 1 p, 1 z, and 2 o? 18/455 Calculate prob of picking 2 b when two letters picked without replacement from {c: 1, b: 17}. 8/9 What is prob of picking 2 b and 1 a when three letters picked without replacement from {b: 2, t: 8, a: 3, h: 4}? 3/680 Three letters picked without replacement from ynmmhmynzm. What is prob of picking 1 n, 1 y, and 1 m? 2/15 Calculate prob of picking 1 o, 2 d, and 1 v when four letters picked without replacement from wovgvdugwogwdv. 6/1001 Calculate prob of picking 3 x when three letters picked without replacement from {u: 7, x: 1}. 0 Three letters picked without replacement from {n: 12, j: 3, d: 2}. What is prob of picking 2 d and 1 n? 3/170 Calculate prob of picking 1 v, 1 s, and 1 d when three letters picked without replacement from {s: 3, v: 6, w: 3, d: 2, a: 1}. 36/455 Calculate prob of picking 1 j and 2 y when three letters picked without replacement from {j: 2, r: 3, y: 1, u: 4, t: 1, p: 1}. 0 Two letters picked without replacement from hjjhccbhnhnhnbjnbn. What is prob of picking 1 n and 1 b? 5/51 Four letters picked without replacement from {d: 1, l: 2, k: 6, j: 3, p: 2, g: 1}. What is prob of picking 1 d, 2 p, and 1 l? 2/1365 Calculate prob of picking 1 q, 1 c, and 1 f when three letters picked without replacement from {s: 1, m: 2, f: 2, c: 1, i: 1, q: 8}. 16/455 Calculate prob of picking 2 x, 1 q, and 1 u when four letters picked without replacement from {x: 9, q: 1, u: 5, z: 1}. 9/91 Calculate prob of picking 1 x and 1 n when two letters picked without replacement from nnnnnnnnnnnxnnnnnn. 1/9 Two letters picked without replacement from lllellllleellll. What is prob of picking 2 e? 1/35 Calculate prob of picking 1 z, 1 r, and 2 c when four letters picked without replacement from {z: 1, n: 1, r: 3, c: 2}. 3/35 Four letters picked without replacement from lvlclbsslbb. What is prob of picking 1 s, 1 l, and 2 b? 4/55 Calculate prob of picking 1 z, 2 c, and 1 k when four letters picked without replacement from {k: 4, r: 6, z: 3, c: 1}. 0 What is prob of picking 1 z and 2 x when three letters picked without replacement from xzddvzddxddddvvdddv? 2/969 Three letters picked without replacement from {c: 8, k: 3, m: 4, j: 2}. Give prob of picking 2 k and 1 j. 3/340 Two letters picked without replacement from ncozrzfc. Give prob of picking 1 n and 1 z. 1/14 Three letters picked without replacement from {w: 1, u: 6, e: 3, x: 7}. What is prob of picking 2 e and 1 x? 21/680 Four letters picked without replacement from {x: 3, l: 1, h: 5, t: 8, w: 1, d: 2}. Give prob of picking 2 x, 1 w, and 1 h. 1/323 Calculate prob of picking 1 l	{ "pile_set_name": "DM Mathematics" }
z*7 - 1 + 0z + 0z5 - 4/15z*6 + 61/12z*4 - 16z*2. Find the second derivative of l(p) wrt p. -12p*2 - 192p Let z(d) = -8d4 + 125d*3 - 280d*2 + 6. Let n(f) = -2f4 - f3 + 2. Let s(r) = 3n(r) - z(r). Find the third derivative of s(c) wrt c. 48c - 768 Let i(b) = -b*3 + 31b*2 + 33b - 28. Let o be i(32). Find the third derivative of -7s4 + 27s*2 + 7s*4 + 32s*o - 2s*3 wrt s. 768s - 12 Let q(w) = -173w3 - 7w*2 - 170w + 2. Let p(o) = -174o3 - 5o*2 - 171o + 1. Let l(m) = 3p(m) - 2q(m). Find the second derivative of l(s) wrt s. -1056s - 2 Let t(k) be the first derivative of 13/2k*2 - 11 + 31k + 2/3k3. Differentiate t(m) wrt m. 4m + 13 Let r(w) be the second derivative of 3563w4/6 + 9211w*2/2 - 42w. Find the first derivative of r(t) wrt t. 14252t Suppose 12r - 418 = 242. Differentiate -ri3 - i4 + 5i*2 + 17i*3 + 38i*3 + 59 with respect to i. -4i*3 + 10i Suppose 2w = -5z + 15, -3z + 9 = -3w - w. Suppose -5n + 4b = w, -3b = 5n - 0n. What is the first derivative of 12a + 3 - 4 + n wrt a? 12 Let d(r) = -11r - 174. Let j be d(-16). Differentiate 108 - 3v*2 - 3v*j - 65 - 2v*3 + 78 with respect to v. -6v*2 - 12v Let j(m) be the third derivative of -157m7/35 - m4/12 + m3/6 - 2353m*2. Differentiate j(h) wrt h. -3768h*3 - 2 Let d(k) be the third derivative of -79k*6/8 + 85k*4/6 - 33k*2 + 2k. What is the second derivative of d(c) wrt c? -7110c Suppose -4 + 16 = 4p. What is the second derivative of -po2 - 1 - 1186o*5 + 2319o*5 - 4o - 1169o5 wrt o? -720o*3 - 6 Suppose 0 = -26t - 79 + 1. Let s(b) = 117. Let z(p) = -p3 - p2 + 235. Let m(g) = tz(g) + 5s(g). Find the first derivative of m(h) wrt h. 9h2 + 6h What is the third derivative of 3d - 35 - 2d*4 - 266d*2 + 860d*3 + 61d*2 + 35 - 43d*2 wrt d? -48d + 5160 What is the third derivative of 102 + 930x3 + 55x*2 + 89 - 190 wrt x? 5580 Let r(q) be the second derivative of -135q5/2 + q3/6 - 299q2/2 - 1574q. Find the second derivative of r(o) wrt o. -8100o Let w(z) be the first derivative of 1462z5/5 + z2/2 + 3959z + 14230. Find the second derivative of w(a) wrt a. 17544a*2 What is the second derivative of 1914o2 + o4 - 358 - 4753o2 + 3o*4 - 7o*4 + 2107o*2 - o wrt o? -36o*2 - 1464 Let c(v) be the second derivative of 59v*6/2 + 6784v*3/3 - 10832v. What is the second derivative of c(q) wrt q? 10620q2 Let r(t) be the first derivative of 79t*8/1680 + 31t*4/12 + 27t*3 - 49. Let q(g) be the third derivative of r(g). What is the derivative of q(i) wrt i? 316i*3 Let n(w) be the first derivative of -129 - 81 + 4w*5 + 117w*3 - 55w - 23 + 34 - 116w3. Differentiate n(v) wrt v. 80v*3 + 6v What is the first derivative of 0s2 + 164s*3 + 0s*2 + 5s + 168s3 - 8s + 6656 wrt s? 996s2 - 3 Let n(b) be the third derivative of 2b*7 + 3b*4 - 175b*2 + 3. What is the second derivative of n(j) wrt j? 5040j*2 Suppose -35 = -17a + 10a. Find the third derivative of -3812m*3 + 3749m3 - m2 + am2 wrt m. -378 Let o(h) = 2h - 6. Let l be o(-4). Let r = -12 - l. Differentiate 1 - 9p3 + r + 0 + 29p*3 with respect to p. 60p*2 Let w(d) = -456d*2 + 1242. Let q(s) = 1368s*2 - 3721. Let j(g) = -2q(g) - 7w(g). What is the first derivative of j(f) wrt f? 912f Let i(a) be the first derivative of 677a6/6 - 10a*3 + 11a*2/2 + 517. What is the third derivative of i(q) wrt q? 40620q*2 Let x be (6/(-4))/(-3(-12)/(-48)). What is the second derivative of 2 + 0a2 - 94a*2 + 243a + 4ax - 15a*2 wrt a? -210 Find the second derivative of -278a*2 - 9a*4 - 312a + 5a4 - 66a + 2a4 wrt a. -24a*2 - 556 Find the third derivative of -4539m*6 - 271495m*5 + 2300m*2 + 271495m*5 + 2m - 3524m6 wrt m. -967560m*3 Let g(y) be the third derivative of 413y*6/40 - 1267y*4/24 - 51y*2 - 8y. Find the second derivative of g(a) wrt a. 7434a Let t = 39 + -4. Let o = t - 31. What is the derivative of 3714a - 3714a + 33 - 8a*o wrt a? -32a*3 Let z(p) = -2p*3. Let m be (-4 - -4 - -3)/(-1)-1. Let r(s) = 5s3 + 4s + 73. Let b(i) = mz(i) + r(i). Differentiate b(y) with respect to y. -3y*2 + 4 Let l(s) be the second derivative of -583s*4/6 - 328s*3/3 + 5s*2/2 + 1332s + 1. What is the second derivative of l(o) wrt o? -2332 Let i(h) = -2236h2 - 2h - 2289. Let z(u) = 13443u2 + 13u + 13735. Let g(l) = -19i(l) - 3z(l). What is the second derivative of g(d) wrt d? 4310 Let w be -4 + 17 + (-4 - -1). Differentiate 9v + 102 + 50 + w wrt v. 9 Suppose -4x + 102 = 5t, 4t + 36 = 5x - 112. Suppose 0 = -i + x - 22. Find the third derivative of -27p*2 + 516p*i - 485p*6 - 7p*2 wrt p. 3720p*3 Let b(z) be the second derivative of -56z6/15 - z5/5 + z*4/2 - 28z*2 - 34z - 31. What is the third derivative of b(r) wrt r? -2688r - 24 Let d(c) be the first derivative of 11c*6/30 - 13c*2/2 + 53c + 21. Let q(w) be the first derivative of d(w). Differentiate q(y) wrt y. 44y3 Find the third derivative of 293p*2 - 86p*3 + 2p*4 + 3938141p - 923p3 - 3938151p wrt p. 48p - 6054 Find the second derivative of -1 + 78u + 3 + 2089u2 + 1368u*2 - 1240u*2 wrt u. 4434 Let r be ((-18)/(-4))/(3/2). Suppose 0b + 4y - 8 = rb, -5y + 13 = -3b. What is the second derivative of -7i - 7i4 - ib - 5i wrt i? -96i*2 Let u(a) be the first derivative of 2549a*4/2 + 3a*3 + 62a - 3699. Find the third derivative of u(z) wrt z. 30588 Let u(z) be the first derivative of z*3/3 - 5z*2/2 + 9z + 19. Let i be u(4). Differentiate i + 3 + 6 + 5 - 44c2 wrt c. -88c Let x(k) be the second derivative of -25k - 2 + 1/30k*6 - 95/2k*2 + 0k*4 + 0k*5 - 91/6k*3. Find the first derivative of x(h) wrt h. 4h*3 - 91 Let k(j) = 2j + 24. Let r be k(-12). Suppose 0 = -s - 5t - 17, -3s + t + 7 + 6 = r. Find the second derivative of o + 5o2 + so*2 + 0o - 2o wrt o. 16 Let n(d) be the second derivative of 1373d*3/3 + 54d*2 - 118d + 30. Differentiate n(z) with respect to z. 2746 Let j be 12 + -18 + 81. What is the derivative of -1350 + 631 - 149r*j + 623 wrt r? -298r What is the second derivative of 127 + 410n2 - 45 - 318n*2 - 777n*2 + 42n - 402n2 wrt n? -2174 Let d(r) = 101r + 77. Let x(o) = -1. Let s(k) = 304k + 225. Let i(a) = -s(a) + 5x(a). Let q(y) = -8d(y) - 3i(y). Differentiate q(m) with respect to m. 104 Suppose -3f - 2f + 2o = -507, f + o - 107 = 0. Let t = -70 + f. Find the third derivative of -4k*2 - tk*3 + 42k*3 + 22k*2 wrt k. 54 Let z(t) be the third derivative of 59/24t*4 + 20t*2 + 0 + 0t - 17/30t5 + 1/3t*3. Find the second derivative of z(k) wrt k. -68 Let h(f) be the third derivative of 0f*3 + 0f + 0 + 0f4 + 236f*2 + 0f*6 - 29/105f*7 + 101/60f*5. What is the third derivative of h(t) wrt t? -1392t Suppose -12 = 4r - 7r. Suppose 0 = -k - 2c + 6, -5k - rc - 6 = -24. What is the first derivative of 0 + k - 7g - 3g - 12 wrt g? -10 Let a(o) be the second derivative of -2003o*4/4 - 5o*3/6 + 139o*2/2 - 18o - 2. Find the second derivative of a(q) wrt q. -12018 Let y be ((-90)/((-3)/1))/1. What is the second derivative of -6g + 76g*2 + 24g + yg wrt g? 152 Let v(t) be the third derivative of -1/6t*4 - 6t*2 - 1/3t*5 + 0 + 91/6t*3 + 2t. What is the first derivative of v(x) wrt x? -40x - 4 Find the second derivative of 4u*2 - 2992u + 0u2 + 9u*3 + 347 - 349 - 6u*5 + 8u*3 + 424u wrt u. -120u3 + 102u + 8 Suppose -2x - 5u = 55, -2x + 3u = -5x - 60. Let q be (-1)/(1/(-3)) + (-15 - x). What is the third derivative of 3m*6 - 2m*2 + qm*2 + 5m*2 wrt m? 360m*3 Let m(h) = 12h*2 + 13h + 3711. Let w(q) = -13q2 - 2q - 3710. Let o(p) = -3m(p) - 2w(p). Differentiate o(a) with respect to a. -20a - 35 Suppose -164 = 422c - 463c. Let w(h) be the third derivative of 0h + 0 - 9/8hc + 23/6h*3 + 26h*2. Differentiate w(m) wrt m. -27 Let j(x) = 2x - 6. Let w be j(7). Suppose -115 + w = -3l - 4t, -l = 3t - 34. Find the third derivative of 29u*6 - 2u*2 - lu*6 - 10u*2 wrt u. -960u3 Let v(u) = -u3 + 2*u. Let r(z)	{ "pile_set_name": "DM Mathematics" }
5837 Is 55 != 220? True Which is smaller: 7397 or 7398? 7397 Is -394 at most as big as -0.13? True Is 0.4 less than -1/6? False Are -43 and -214/5 unequal? True Which is smaller: -8 or 59? -8 Which is bigger: 205 or 8? 205 Which is bigger: -6564 or -6565? -6564 Which is smaller: 23 or 27? 23 Which is bigger: 0 or -122/343? 0 Which is smaller: 0 or 1/62? 0 Is -2/23 at most as big as -85? False Is 809/6 less than or equal to 135? True Which is greater: 0 or -1/10386? 0 Is -1 at least -86? True Is 256 < 256? False Which is greater: 971 or 972? 972 Which is bigger: 91 or 86? 91 Which is bigger: -497 or -496? -496 Is 11255 less than 11255? False Is -1/2 less than -2398? False Which is bigger: -0.1 or 2081? 2081 Is -3384 at least as big as -3386? True Which is smaller: 14 or 1/30? 1/30 Is 18 at least as big as -7? True Is -17 less than -17? False Which is bigger: -80 or 0.118? 0.118 Is -1 at most as big as -430/11? False Is 1/4 < -6/17? False Which is smaller: 1/20438 or -1? -1 Is 0 < 92/149? True Which is bigger: -2976 or -2977? -2976 Which is greater: -21/8 or -0.12? -0.12 Which is greater: -382/9 or -43? -382/9 Which is smaller: 2 or 0.0696? 0.0696 Which is greater: 398 or 405? 405 Which is bigger: -1 or 3/64? 3/64 Are -3 and -1 non-equal? True Is -4/41 at least as big as 1? False Is -26 greater than -2/9? False Are 1 and -4/2175 unequal? True Which is smaller: 149 or 150? 149 Which is greater: 2 or 111/38? 111/38 Which is bigger: 2 or 459? 459 Is -3952 bigger than -19754/5? False Which is greater: -25 or -34? -25 Which is smaller: 0 or 1/27402? 0 Which is smaller: -4/7 or 8/7? -4/7 Which is bigger: -10576 or 3? 3 Is -0.5 at least as big as 169/3? False Is -16 > -480/29? True Which is greater: -22199 or -22200? -22199 Is 285 bigger than 283? True Which is smaller: 0 or 22784? 0 Is -35/16 at least as big as -3? True Which is bigger: -15 or -27/2? -27/2 Is -172 bigger than -70? False Is -86/7 < -11? True Is 1309 > 5231/4? True Are 1 and -937 equal? False Which is bigger: -15 or -0.1? -0.1 Which is greater: -4023 or 0? 0 Is 1229 greater than or equal to 1228? True Does -457 = -456? False Is 116 > 113? True Is -0.4041 at most -6? False Which is smaller: 78 or 74? 74 Are 4/5 and -3346 unequal? True Do -5/6 and -2/281 have the same value? False Which is bigger: 211 or 213? 213 Which is bigger: -1 or 2/9009? 2/9009 Are -2/1869 and -1 unequal? True Which is smaller: -69 or -54? -69 Which is smaller: 241/8 or 29? 29 Which is smaller: 889 or 884? 884 Which is smaller: 11/1410 or 1? 11/1410 Is -215 less than -2? True Is 1 < 2/1465? False Which is greater: -3/2246 or 0? 0 Which is smaller: 1 or 1/60? 1/60 Which is greater: -113 or -112? -112 Is 686/9 not equal to 75? True Is -3002 at most -3000? True Which is greater: -1 or 2657? 2657 Which is greater: -4 or 3.901? 3.901 Is -67 greater than or equal to -2/3? False Are 0.1 and -28.2 unequal? True Which is greater: 2/8543 or 1? 1 Which is greater: -101/5 or -21? -101/5 Which is greater: -5200 or 0.01? 0.01 Is -37 smaller than -36? True Is 1 less than 118/127? False Are 1 and -5/2912 equal? False Is 0.15 > 42? False Is 0 bigger than 3/1544? False Are 84 and 83 non-equal? True Which is greater: 6/4379 or 1? 1 Is -598 greater than or equal to -598? True Do 272 and 1362/5 have the same value? False Which is bigger: 0 or 1/1666? 1/1666 Which is greater: 2896 or 2892? 2896 Are 0.02 and -30 nonequal? True Which is bigger: 186 or 1123/6? 1123/6 Which is smaller: 2/5 or 0.07? 0.07 Is -5 > 0.125? False Which is smaller: -1/1116 or 1? -1/1116 Which is bigger: -931 or -930? -930 Is -33 bigger than -225/7? False Which is smaller: 0.105 or 5/46? 0.105 Is -2.2 greater than or equal to -0.139? False Do -4000 and -4004 have the same value? False Which is bigger: -5593 or -5594? -5593 Is 211/3 <= 1? False Which is bigger: 0.1 or 2916/7? 2916/7 Which is bigger: 75 or 0.5? 75 Which is bigger: -1 or 5? 5 Is -1 at least as big as -5/16752? False Are 236 and 221 nonequal? True Which is bigger: -7 or -60? -7 Which is bigger: -15 or -8? -8 Which is greater: -39 or -42? -39 Which is bigger: -3/13 or -0.12? -0.12 Which is greater: -11 or -251/21? -11 Is 1 smaller than 170? True Is 2/567 > 1/5? False Which is smaller: -7928 or 0.4? -7928 Does -2 = -158? False Is 318 at least as big as 318? True Which is bigger: 9 or -35? 9 Do -11177 and -11177 have the same value? True Which is smaller: -25 or 5/3? -25 Is 1 bigger than -2/235? True Does 985 = -3? False Is 277 at least as big as 277? True Are 2 and -591 equal? False Which is greater: -34 or 20? 20 Which is smaller: 101 or 104? 101 Is -167 equal to -167? True Is 0 greater than 2/3437? False Which is smaller: 2 or 33/13? 2 Is 119 less than or equal to 3/5? False Is -196 != -196? False Which is greater: 141 or -2/7? 141 Is -0.2 > 174? False Which is bigger: -22/43 or 0? 0 Do 5893 and 5892 have the same value? False Which is bigger: 421 or 423? 423 Which is greater: 8 or 493/52? 493/52 Is 169 at least 169? True Does 24 = 379? False Is 2/5 >= 1/90? True Is -0.22924 at most as big as -1? False Is 2274/19 greater than or equal to 121? False Is 19 at least -3? True Which is bigger: 4053 or 4052? 4053 Which is smaller: -3/737 or 7? -3/737 Is 11963 > 1/4? True Do 1 and -1/832 have different values? True Is -153.5 less than or equal to -0.1? True Are 0 and -1/135 nonequal? True Is 111 not equal to 107? True Is 55/3 >= 18? True Which is bigger: 76/169 or -1? 76/169 Is -343 smaller than -353? False Which is greater: 905/12 or 75? 905/12 Which is bigger: -235 or -237? -235 Is 42794 at least as big as -0.1? True Which is smaller: -49 or -1148/23? -1148/23 Which is bigger: 1 or 64.03? 64.03 Which is smaller: 319 or 317? 317 Is 2/78303 <= 0? False Which is smaller: -39 or -188/5? -39 Is 20/1551 greater than -1? True Is -159/4 <= -41? False Which is smaller: 1/4 or 1/109? 1/109 Which is bigger: 56 or 58? 58 Is -1/9 <= -122? False Is 5/91 >= 2/7? False Is -5436/11 < -494? True Which is smaller: -3 or 2/11? -3 Is 7/16 at least 1? False Which is smaller: 68 or 63? 63 Do -9 and -7 have the same value? False Which is greater: 24 or 9? 24 Is -8/63 <= -1? False Are 30 and 2/15 equal? False Is -742 > -738? False Which is smaller: 74 or 72? 72 Which is smaller: -0.5 or 41? -0.5 Which is greater: -1/5 or -34? -1/5 Which is greater: 29 or -13? 29 Which is smaller: 2/65 or 0? 0 Is 6/869 greater than 0? True Which is smaller: 888 or 893? 888 Which is greater: -1/212 or 20? 20 Are 206 and 207 equal? False Which is bigger: 355 or 356? 356 Which is smaller: -178 or -173? -178 Is 2/3 at least as big as -4955? True Which is greater: -1056 or -1057? -1056 Which is smaller: 2.5353 or 2/5? 2/5 Which is bigger: -0.1 or -554? -0.1 Is -2/1777 >= -1? True Which is greater: -176 or -178? -176 Which is smaller: 340 or 341? 340 Which is greater: -1 or 9/133? 9/133 Which is bigger: -7 or -88/15? -88/15 Is 2292/29 != 78? True Is -2/1849 bigger than 1? False Is 83/6 < 15? True Which is smaller: -1 or -21/10? -21/10 Which is bigger: 0 or 6/563? 6/563 Which is greater: -1/3 or 4991? 4991 Is -20/571 at least 0? False Is -8/1711 >= 0? False Which is smaller: 10159 or -1/2? -1/2 Is 248 > 1243/5? False Is -647 less than 2/25? True Which is smaller: -210 or -18? -210 Which is bigger: 19 or -295? 19 Which is bigger: -2/3117 or 0? 0 Which is smaller: -0.01 or 1/4? -0.01 Which is smaller: -71 or -44? -71 Which is smaller: 31/9 or 3? 3 Which is smaller: -15 or -1/18? -15 Is -7/68 at least 0? False Which is smaller: 101 or 1120/11? 101 Are -1 and -5/16 unequal? True Which is smaller: 0 or 1/608? 0 Which is greater: -0.0177 or 0? 0 Which is smaller: -32 or -29? -32 Which is smaller: 25/32 or 0? 0 Which is smaller: -0.1 or 1/7963? -0.1 Which is smaller: 825 or 829? 825 Which is greater: -28 or -82/3? -82/3 Does 0 = 465? False Is 718/55 equal to 12? False Which is greater: 14 or 16? 16 Are -1 and 4/435 non-equal? True Is -20/143 < 1? True Is 10333 at least as big as -1? True Which is smaller: 110/9 or -2/95? -2/95 Which is smaller: -2 or -12.301? -12.301 Are 3216 and 3217 equal? False Which is smaller: -2804 or -9? -2804 Is -3.6 != -1/7? True Is 141 < 0.5? False Is -464 at least -0.01? False Which is bigger: 304 or 908/3? 304 Is -9/16 at most -2?	{ "pile_set_name": "DM Mathematics" }
1 PM? 8:20 AM How many minutes are there between 8:26 PM and 2:26 AM? 360 How many minutes are there between 11:21 AM and 5:49 PM? 388 What is 693 minutes before 2:53 PM? 3:20 AM How many minutes are there between 9:05 PM and 2:46 AM? 341 What is 6 minutes before 7:25 AM? 7:19 AM How many minutes are there between 2:00 AM and 2:27 AM? 27 What is 703 minutes after 11:04 PM? 10:47 AM What is 662 minutes after 8:25 AM? 7:27 PM How many minutes are there between 9:25 PM and 8:26 AM? 661 What is 689 minutes after 4:10 AM? 3:39 PM How many minutes are there between 10:06 PM and 11:23 PM? 77 What is 320 minutes before 12:38 PM? 7:18 AM What is 209 minutes before 4:48 AM? 1:19 AM What is 669 minutes after 1:00 AM? 12:09 PM How many minutes are there between 1:48 AM and 2:24 AM? 36 What is 456 minutes after 3:54 PM? 11:30 PM How many minutes are there between 1:41 AM and 3:38 AM? 117 What is 703 minutes after 9:25 AM? 9:08 PM How many minutes are there between 11:13 AM and 12:57 PM? 104 What is 325 minutes before 7:24 AM? 1:59 AM How many minutes are there between 3:40 AM and 9:56 AM? 376 How many minutes are there between 6:49 PM and 11:04 PM? 255 How many minutes are there between 2:10 AM and 12:07 PM? 597 How many minutes are there between 7:49 PM and 5:25 AM? 576 What is 655 minutes after 3:15 AM? 2:10 PM How many minutes are there between 4:20 PM and 7:21 PM? 181 How many minutes are there between 1:22 PM and 1:05 AM? 703 What is 528 minutes after 10:00 AM? 6:48 PM How many minutes are there between 12:00 PM and 1:11 PM? 71 How many minutes are there between 9:54 AM and 2:59 PM? 305 What is 149 minutes before 7:03 AM? 4:34 AM What is 160 minutes before 4:35 PM? 1:55 PM How many minutes are there between 6:35 PM and 4:44 AM? 609 How many minutes are there between 5:02 PM and 12:25 AM? 443 How many minutes are there between 4:43 AM and 9:07 AM? 264 What is 398 minutes after 3:22 AM? 10:00 AM How many minutes are there between 7:29 AM and 8:25 AM? 56 What is 446 minutes before 6:36 PM? 11:10 AM How many minutes are there between 5:45 AM and 1:35 PM? 470 How many minutes are there between 11:57 PM and 12:48 AM? 51 What is 517 minutes after 7:45 AM? 4:22 PM What is 360 minutes before 7:52 PM? 1:52 PM How many minutes are there between 10:23 AM and 2:26 PM? 243 What is 493 minutes after 1:08 PM? 9:21 PM What is 293 minutes before 2:32 AM? 9:39 PM How many minutes are there between 4:07 PM and 3:24 AM? 677 What is 556 minutes before 6:40 AM? 9:24 PM How many minutes are there between 9:48 PM and 2:53 AM? 305 What is 418 minutes before 5:15 PM? 10:17 AM How many minutes are there between 8:22 PM and 4:38 AM? 496 How many minutes are there between 6:56 PM and 10:56 PM? 240 How many minutes are there between 8:52 AM and 6:43 PM? 591 How many minutes are there between 10:44 AM and 1:22 PM? 158 What is 688 minutes before 7:27 PM? 7:59 AM How many minutes are there between 2:19 AM and 4:16 AM? 117 What is 664 minutes after 12:05 AM? 11:09 AM How many minutes are there between 7:50 AM and 10:14 AM? 144 What is 443 minutes after 5:47 AM? 1:10 PM How many minutes are there between 6:03 AM and 5:05 PM? 662 How many minutes are there between 11:45 PM and 11:47 PM? 2 How many minutes are there between 3:46 AM and 5:02 AM? 76 How many minutes are there between 8:32 PM and 1:25 AM? 293 What is 279 minutes after 9:15 AM? 1:54 PM What is 643 minutes before 2:15 PM? 3:32 AM How many minutes are there between 11:37 PM and 10:57 AM? 680 What is 639 minutes after 2:00 AM? 12:39 PM What is 148 minutes before 11:02 AM? 8:34 AM How many minutes are there between 5:10 AM and 6:40 AM? 90 How many minutes are there between 9:10 AM and 3:48 PM? 398 What is 42 minutes after 12:54 PM? 1:36 PM How many minutes are there between 8:02 PM and 4:18 AM? 496 What is 610 minutes after 5:36 AM? 3:46 PM How many minutes are there between 10:15 PM and 9:47 AM? 692 What is 697 minutes after 11:23 AM? 11:00 PM What is 325 minutes after 9:07 PM? 2:32 AM How many minutes are there between 5:34 PM and 7:58 PM? 144 What is 11 minutes after 5:44 PM? 5:55 PM What is 400 minutes before 6:47 AM? 12:07 AM What is 676 minutes before 11:16 PM? 12:00 PM What is 605 minutes after 11:08 AM? 9:13 PM What is 251 minutes after 10:17 PM? 2:28 AM How many minutes are there between 11:50 AM and 12:57 PM? 67 How many minutes are there between 5:14 PM and 10:27 PM? 313 How many minutes are there between 3:20 AM and 6:05 AM? 165 How many minutes are there between 3:58 PM and 1:31 AM? 573 What is 564 minutes after 3:07 AM? 12:31 PM What is 19 minutes before 2:25 PM? 2:06 PM What is 91 minutes after 10:38 PM? 12:09 AM How many minutes are there between 4:06 PM and 12:19 AM? 493 How many minutes are there between 11:11 PM and 3:54 AM? 283 How many minutes are there between 4:10 PM and 2:38 AM? 628 How many minutes are there between 11:39 PM and 3:54 AM? 255 What is 664 minutes before 10:36 AM? 11:32 PM How many minutes are there between 3:03 PM and 5:06 PM? 123 What is 588 minutes after 12:59 AM? 10:47 AM How many minutes are there between 2:09 AM and 9:52 AM? 463 How many minutes are there between 1:07 PM and 1:55 PM? 48 How many minutes are there between 9:41 PM and 7:36 AM? 595 What is 235 minutes after 4:09 PM? 8:04 PM What is 38 minutes after 8:00 PM? 8:38 PM How many minutes are there between 1:08 PM and 6:06 PM? 298 What is 610 minutes after 3:46 PM? 1:56 AM What is 366 minutes before 4:41 PM? 10:35 AM What is 142 minutes after 1:15 AM? 3:37 AM How many minutes are there between 3:18 AM and 11:29 AM? 491 What is 535 minutes before 2:26 AM? 5:31 PM How many minutes are there between 3:47 PM and 9:07 PM? 320 How many minutes are there between 5:57 AM and 5:41 PM? 704 What is 354 minutes before 9:13 PM? 3:19 PM How many minutes are there between 4:51 PM and 2:42 AM? 591 How many minutes are there between 7:57 PM and 1:52 AM? 355 How many minutes are there between 4:03 AM and 12:31 PM? 508 What is 676 minutes before 3:27 AM? 4:11 PM How many minutes are there between 8:31 PM and 11:55 PM? 204 How many minutes are there between 6:48 PM and 12:01 AM? 313 How many minutes are there between 8:40 AM and 5:03 PM? 503 What is 344 minutes before 11:23 AM? 5:39 AM How many minutes are there between 2:31 PM and 12:54 AM? 623 How many minutes are there between 8:54 PM and 12:11 AM? 197 How many minutes are there between 10:08 AM and 9:23 PM? 675 What is 277 minutes after 3:46 PM? 8:23 PM What is 681 minutes before 10:05 AM? 10:44 PM What is 6 minutes before 6:34 PM? 6:28 PM What is 207 minutes before 2:43 PM? 11:16 AM How many minutes are there between 1:00 AM and 4:37 AM? 217 What is 485 minutes before 8:44 PM? 12:39 PM How many minutes are there between 1:07 PM and 12:08 AM? 661 How many minutes are there between 11:33 AM and 12:33 PM? 60 What is 145 minutes before 5:12 AM? 2:47 AM What is 677 minutes after 12:45 PM? 12:02 AM How many minutes are there between 12:51 PM and 10:09 PM? 558 What is 657 minutes after 7:23 PM? 6:20 AM How many minutes are there between 4:24 AM and 10:49 AM? 385 What is 128 minutes before 11:21 PM? 9:13 PM What is 35 minutes before 8:05 AM? 7:30 AM How many minutes are there between 8:35 PM and 1:56 AM? 321 What is 490 minutes after 12:37 AM? 8:47 AM What is 76 minutes before 12:00 PM? 10:44 AM What is 148 minutes before 6:34 PM? 4:06 PM What is 56 minutes after 7:39 PM? 8:35 PM How many minutes are there between 12:22 PM and 2:50 PM? 148 How many minutes are there between 3:43 PM and 4:31 PM? 48 What is 374 minutes before 2:48 PM? 8:34 AM How many minutes are there between 2:06 AM and 9:53 AM? 467 What is 371 minutes after 2:35 AM? 8:46 AM What is 552 minutes after 9:25 PM? 6:37 AM What is 691 minutes after 9:55 AM? 9:26 PM What is 549 minutes after 8:30 AM? 5:39 PM What is 466 minutes after 1:48 PM? 9:34 PM How many minutes are there between 12:27 AM and 7:35 AM? 428 How many minutes are there between 2:29 PM and 5:20 PM? 171 How many minutes are there between 2:45 AM and 8:40 AM? 355 What is 300 minutes before 1:30 PM? 8:30 AM How many minutes are there between 3:29 PM and 1:56 AM? 627 What is 110 minutes before 11:04 AM? 9:14 AM What is 404 minutes before 9:07 PM? 2:23 PM How many minutes ar	{ "pile_set_name": "DM Mathematics" }
ivative of j*5/12 + 5j*4/6 + 10j*3/3 - 6j*2. Factor v(w). 5(w + 2)*2 Factor 2z*2 + 4z*3 + 1 + 2z*2 - z - 5 - 3z. 4(z - 1)(z + 1)*2 Determine g, given that 0g*3 + 1/2g*4 - 1/2g*2 + 0g + 0 = 0. -1, 0, 1 Let j be 3/(-9) - 30/(-9). Suppose -5y = -3g + g + 4, -jy = 3g - 6. Determine d so that 0d + 0d*2 - 1/3d*3 + y = 0. 0 Suppose 0w - 1 = 2w - u, 5w + 2u - 11 = 0. Let y = 4 - w. Find a such that -2a*5 + 2a*y - 4a*3 + 4a*3 = 0. -1, 0, 1 Let k(t) = 3t3 - t2 + 1. Let q = 3 + -2. Let l be k(q). Factor -8/9xl + 0x*2 + 0 + 0x - 70/9x5 + 16/3x*4. -2x*3(5x - 2)(7x - 2)/9 Suppose -79x + 2z = -78x - 2, 3x = -z + 20. Find l, given that 22/3l*4 + 4/3l*3 + xl*5 + 0l + 0 + 0l2 = 0. -1, -2/9, 0 Let i(f) = -7f*4 + 53f*2 - 22f - 8. Let s(c) = 2c4 - 18c*2 + 7c + 3. Let z(w) = 3i(w) + 8s(w). Factor z(j). -5j(j - 1)*2(j + 2) Let u(y) be the third derivative of -y*5/540 + 11y*4/108 - 121y*3/54 - 24y2. Factor u(j). -(j - 11)2/9 Let x(y) be the first derivative of y5/20 - y4/2 + 2y3 + 3y*2/2 - 7. Let h(z) be the second derivative of x(z). Factor h(a). 3(a - 2)*2 Let z = -25 - -25. Factor 4/11o - 4/11o3 + zo*2 - 2/11 + 2/11o*4. 2(o - 1)*3(o + 1)/11 Let f(n) = -n*3 - 8n*2 - 3. Let w be f(-8). Let a = 5 + w. Factor -3q*3 + aq3 + q2 + 0q5 + q5 - q4. q2(q - 1)*2(q + 1) Let b(j) = j*3 - 5j*2 - 5j - 2. Let n be b(5). Let i be 0 + (-2)/(30/n). Factor i + 6/5s + 1/5s2. (s + 3)2/5 Let k(a) be the first derivative of -3/5a5 + 0a - 6 + 5/6a6 + 0a*2 - 1/2a*4 + 0a3. Factor k(l). l3(l - 1)(5l + 2) Let l(f) be the third derivative of f6/280 - f5/210 - f4/168 - 2f*2. Suppose l(y) = 0. What is y? -1/3, 0, 1 Suppose -3r*2 + 0r*2 + 4r + 0 - r*2 + 8 = 0. Calculate r. -1, 2 Factor 4t*3 + 0 + 16/11t - 56/11t2 - 10/11t*4. -2t(t - 2)2(5t - 2)/11 Suppose 5a + 279 + 891 = 0. Let t be (-4)/(-18) - 767/a. Determine r so that -7/4r - 7/4r*5 + tr3 - r2 + 1/2 + 1/2r4 = 0. -1, 2/7, 1 Factor -o - 4o*2 - o + 0o - 2o3. -2o(o + 1)2 Factor 0g*2 + 3g*2 - 857g + 902g. 3g(g + 15) Find b such that 5/8b*2 - 1/8b*3 - 1/2b + 0 = 0. 0, 1, 4 Let j be (-2)/(-11) - (-1840)/44. Let h = j - 25. Factor -16w + 4w*2 + 2w*4 + 1 + 3 - 11w*3 + hw2. (w - 2)2(w - 1)(2w - 1) Suppose 0j + 9 = 3j. Let r = 1 + 1. Suppose -ji2 - 1 + i4 + 2 + ir = 0. What is i? -1, 1 Let c = -7 + 9. Factor -b2 - 3b + b2 - 5b*c + 2b*2. -3b(b + 1) Suppose 65j*2 - 75j*2 + 5j*5 - 5j - j*4 + 11j*4 = 0. What is j? -1, 0, 1 Let p be 1/(-165)9195/(-10). Let l = -43/10 + p. Solve -lw2 + 18/11w - 4/11 = 0 for w. 2/7, 1 Suppose -2o - 8 = -6o. Let p be o/8 + 21/12. Let 0n2 + n4 + 0n*4 + 3n*3 + 4n*p - 2n*2 = 0. What is n? -2, -1, 0 What is k in -4/3 - 2/3k*2 + 2k = 0? 1, 2 Let y = 974/2497 + -6/227. Let b = 3/22 + y. Find n such that 1/4n3 + 0n*2 + 1/4n*5 + 0 - bn*4 + 0n = 0. 0, 1 Let d(k) be the first derivative of 1/7k3 - 1/70k*5 + 2 + 0k*4 - 2k + 2/7k2. Let g(y) be the first derivative of d(y). Factor g(t). -2(t - 2)(t + 1)2/7 Let a(i) = -10i*5 - 10i*4 + 4i*3 - 20i*2 + 12i. Let j be 4/(-2) - 56/(-4). Let o(d) = d5 + d3 + d*2 - d. Let y(f) = jo(f) + a(f). Factor y(s). 2s2(s - 2)*2(s - 1) Let r(f) be the first derivative of -f6/360 - f5/60 - f4/24 + f3 + 3. Let t(v) be the third derivative of r(v). Determine c so that t(c) = 0. -1 Let z = -3 + -2. Let t(r) = -2r - 7. Let m be t(z). Suppose -2j2 + m - 1 + 0 = 0. What is j? -1, 1 Let t(y) be the first derivative of y4/42 - 2y3/7 + 9y*2/7 - 3y + 2. Let z(g) be the first derivative of t(g). Factor z(o). 2(o - 3)2/7 Let x(m) be the third derivative of 0 + 5/24m*4 + 1/3m*3 + 1/15m*5 + 0m + 1/120m6 - 6m2. Factor x(k). (k + 1)2(k + 2) Let b(x) be the first derivative of -1/2x*4 + x + 1/12x*6 - 1/3x*3 + 0x*5 + 3/4x2 + 5. Suppose b(q) = 0. What is q? -1, 1, 2 Let o(s) be the first derivative of -s5/10 + 5s4/8 - s3/2 - 5s*2/4 + 2s + 12. Let o(w) = 0. Calculate w. -1, 1, 4 Let -18/7 + 3/7a3 - 15/7a + 6/7a2 = 0. What is a? -3, -1, 2 Factor 4/5n + 3/5 + 1/5n2. (n + 1)(n + 3)/5 Factor 20/19f + 0 + 2/19f*2. 2f(f + 10)/19 Let a(n) be the first derivative of 7n*4/2 - 4n*3/3 - 7n*2 + 4n - 44. Solve a(l) = 0 for l. -1, 2/7, 1 Determine u, given that 14/5u5 - 4/5u*2 + 4/5u*4 - 14/5u*3 + 0u + 0 = 0. -1, -2/7, 0, 1 Suppose -2/17h5 - 2/17h*4 - 2/17 + 4/17h*2 + 4/17h*3 - 2/17h = 0. Calculate h. -1, 1 Let z(r) be the first derivative of r3/24 - r2/16 + 1. Solve z(k) = 0 for k. 0, 1 Let l(j) = j*2 - j. Let g(h) = -7h*2 + 6h. Let m(d) = g(d) + 6l(d). Let z(w) = -3w*2 + 3w + 2. Let x(p) = 4m(p) - z(p). Factor x(r). -(r + 1)(r + 2) Let w(d) be the second derivative of 2d + 1/24d*3 - 1/80d*5 - 1/48d*4 + 1/120d*6 + 0d*2 + 0. Determine k so that w(k) = 0. -1, 0, 1 Determine j so that 14j*2 - 3j*3 + 5j*5 - 7j*2 - 2j + 7j4 - 5j*2 - 9j*2 = 0. -1, -2/5, 0, 1 Let a = 18 - 12. Let d(y) be the second derivative of 1/4y*4 + 0y*2 + 1/3y*3 + 0 - 7/20y*5 + 5/42y*7 - 1/10y*a - y. Factor d(w). w(w - 1)*2(w + 1)(5w + 2) Suppose 2/3u4 - 2/3u*2 - 2/3u*3 + 2/3u + 0 = 0. What is u? -1, 0, 1 Factor 16y + 3y2 - 16673 + 16689 + y2. 4(y + 2)2 Let i = 68 + -63. Let n(o) be the third derivative of 0o + 7/48o4 + 1/60o*i + 2o*2 - 7/240o*6 + 0 - 1/6o3. Suppose n(k) = 0. Calculate k. -1, 2/7, 1 Let g(m) be the third derivative of m8/1512 - 4m7/945 + m6/135 + m5/135 - 5m*4/108 + 2m*3/27 + 6m*2. Determine d so that g(d) = 0. -1, 1, 2 Solve -35l*3 - 4l - 3l3 - 40l*4 - 6l*4 + 2l + 50l2 - 4 + 40l5 = 0 for l. -1, -1/4, 2/5, 1 Let g(a) be the second derivative of -a5/20 - a4/4 - a3/3 - 11a. Factor g(c). -c(c + 1)(c + 2) Let q(r) = -57r*2 + 57r + 33. Let c(t) = -7t2 + 7t + 4. Let l(b) = -33c(b) + 4q(b). Factor l(n). 3n(n - 1) Let k(f) be the third derivative of -f8/2856 - f7/1785 + f*6/510 - 15f2. Solve k(b) = 0 for b. -2, 0, 1 Let c(j) be the third derivative of j6/840 + j5/210 - j4/168 - j*3/21 + 3j*2. Factor c(i). (i - 1)(i + 1)(i + 2)/7 Let c(j) = -j + 13. Suppose -5f = -10f - 5o + 70, -3f + 32 = o. Let b be c(f). Determine u, given that 4u - 2u3 - 2u*3 + 0u*4 + 2u*4 + 2 - b = 0. -1, 1 Let r(i) = -3i + 1. Let j(m) = 16m - 5. Let a(n) = 2j(n) + 11r(n). Let s be a(-1). Suppose 1/4p*s - 1/4p - 1/2 = 0. What is p? -1, 2 Let c(r) = 6r3 - 6r*2 - 6r - 16. Let z(o) = -o3 + o2 + o + 3. Let y(f) = -6c(f) - 33z(f). Let y(n) = 0. Calculate n. -1, 1 Let a(h) = 2h2 + 2h - 1. Let b be a(-2). Suppose -r + 2 = -b. Let 2/9y3 - 2/9y*r - 2/9y*4 + 0y + 2/9y2 + 0 = 0. Calculate y. -1, 0, 1 Let x(v) be the first derivative of -5v*7/63 - 7v6/45 - v5/15 - 4v - 5. Let j(c) be the first derivative of x(c). Factor j(d). -2d*3(d + 1)(5d + 2)/3 Let h(v) be the third derivative of -v7/2940 + v5/420 + v*3/3 + 3v*2. Let a(g) be the first derivative of h(g). Solve a(f) = 0. -1, 0, 1 Let w(c) be the second derivative of 25c*7/42 - 17c*6/3 + 249c*5/20 - 31c*4/3 + 10c*3/3 + 13c. Factor w(v). v(v - 5)(v - 1)(5v - 2)2 Let a(b) = b2 + 9b + 6. Let v be a(-8). Let p be v/(-2(2 - -1)). Factor -1/3c2 + 1/3c*4 - 1/3c*3 + 0 + pc. c(c - 1)2(c + 1)/3 Let k be 2/3 + 28/12. Factor -r*3 - 10r*5 + 2r*k + 9r5. -r3(r - 1)(r + 1) Let h(r) be the second derivative of -r8/3080 + r7/2310 + r*3/6 - 2r. Let c(z) be the second derivative of h(z). Suppose c(f) = 0. What is f? 0, 2/3 Suppose 2r = -3r. Let n(x) be the third derivative of 1/120x6 + 1/24x*4 + 0x + r + 0x3 - 1/30x5 - x2. Factor n(a). a(a - 1)2 Let d be ((-130)/(-39))/(2/3)1. Let j(w) be the second derivative of 0 + 3w + 0w*2 - 1/9w*3 + 1/90w*6 + 0w*d - 1/12w*4. Factor j(g). g(g - 2)(g + 1)2/3 Let y be 33/198(17 + 1)1. Let a(r) = r2 - 5r. Let g be a(5). Factor 0s + 1/4s*y + g - 1/2s2. s2*(s - 2)/4	{ "pile_set_name": "DM Mathematics" }
d) -1 (e) 0.44 (f) 1311 b What is the third smallest value in -42/13, 8, 1/3, 7, -1, 4, 0.1? 0.1 Which is the fifth smallest value? (a) -5 (b) 2 (c) 11/2 (d) -15 (e) -355 (f) 1/3 b What is the second biggest value in 0.1, 2, 272, 1, 7, -142, -0.3? 7 Which is the third biggest value? (a) -3 (b) 811/2 (c) 2442.68 a Which is the smallest value? (a) -1/2 (b) 12.3 (c) 80 (d) -1 d What is the biggest value in 0.12, 0, 210791? 210791 What is the second smallest value in 5, 576457, -4? 5 What is the fourth smallest value in -5042, 12, -0.2, -0.1? 12 Which is the second smallest value? (a) -1460657 (b) 1/5 (c) 11 (d) -0.3 d What is the biggest value in 45.7, 0.018414, -0.3? 45.7 What is the sixth smallest value in 20462, -2/15, 3/8, -5, 3, 5, -3? 5 What is the biggest value in 0, -503, -563? 0 Which is the fourth biggest value? (a) 0.5 (b) 0.1 (c) 49 (d) -1 (e) 20638 (f) -0.2 (g) 0 b Which is the second biggest value? (a) -0.07 (b) -162742 (c) 0.19 a What is the fifth biggest value in 5, 1.4, 3/10, 19.4, 0.2, 1? 3/10 Which is the third biggest value? (a) 194.49 (b) -17735 (c) 2/17 b Which is the third smallest value? (a) 0.4 (b) -0.6 (c) -14 (d) -0.2 (e) -44 b What is the smallest value in -6, 2, 22, -328, 0.5? -328 What is the fifth smallest value in 13, 5, -2.6, 0, 1, -9/2? 5 What is the biggest value in 0.076, 1/7, 8/2759? 1/7 What is the fifth smallest value in 6, -0.2, 0.6, -96, -1/209? 6 What is the third biggest value in 2, -16297, 0.021? -16297 What is the seventh smallest value in -2, -3, 0.2, 178, 0, 2/9, -15? 178 Which is the second biggest value? (a) 0.086 (b) 0.5 (c) 150 (d) 3 (e) 15 e Which is the second biggest value? (a) -74 (b) -0.3 (c) -7/6 (d) -2/19 (e) -3 (f) -9 b Which is the third biggest value? (a) -4 (b) -5 (c) -0.5 (d) 11/3 (e) 2/17 c Which is the second smallest value? (a) 0.544 (b) 1/3 (c) 0.1 (d) 7773 (e) 0.5 b Which is the fifth biggest value? (a) -2/5 (b) 57376 (c) 0.4 (d) 0.29 (e) -0.5 e Which is the third biggest value? (a) 188 (b) 1 (c) 0.9 (d) -15 (e) 0 (f) 5 b What is the fifth smallest value in -10954, -0.2, -1, -2, -3, 0.15? -0.2 Which is the seventh smallest value? (a) 2/11 (b) -3 (c) 18 (d) -0.3 (e) 2/537 (f) 4 (g) 1.3 c Which is the fifth biggest value? (a) -1/4 (b) 568 (c) -2 (d) -1781 (e) -16 d What is the fifth biggest value in -1/3, 1, -48631, 2/3, -3, -0.1? -3 What is the fourth smallest value in 6, -10.9, -2/27, 87/11? 87/11 Which is the third biggest value? (a) 71 (b) -41 (c) -1876 c Which is the fourth biggest value? (a) -2/7 (b) 3/25 (c) 17/4 (d) -51 (e) -2 (f) -1/3 f What is the biggest value in -13, 43, 378, 1/2? 378 What is the third smallest value in -2, -0.1, -223071, 2/119? -0.1 Which is the biggest value? (a) 1145 (b) -138 (c) -19 a What is the third smallest value in -0.6, -0.1, 6, 77875/4, -0.4? -0.1 Which is the third biggest value? (a) 22.7 (b) -4/5 (c) -89510 c What is the third smallest value in 0.3, -24, -180722? 0.3 What is the fifth biggest value in -72, 6, -1, -2/9, 5226? -72 What is the second smallest value in -270/7, 3, 0, -7, 0.5, 4/17? -7 Which is the smallest value? (a) -0.05 (b) 5 (c) 0.05 (d) 4 (e) -0.8 (f) 2/3 e Which is the biggest value? (a) -6537 (b) -25/4 (c) 2.2 c Which is the smallest value? (a) 0.4 (b) -12 (c) -1424 (d) 0.1091 c What is the second smallest value in 34, 17, -4/3, -139, -7? -7 Which is the second biggest value? (a) 2/7 (b) -1607551/4 (c) 1/21 c Which is the second biggest value? (a) -17.7 (b) -5 (c) -0.23338 b Which is the second smallest value? (a) 2/9 (b) -2/3 (c) -12/17 (d) 1529 (e) -14 c Which is the second biggest value? (a) -4/9 (b) -7 (c) -2/9 (d) -371 (e) 0.3 (f) -0.2 (g) 10 e What is the third smallest value in 5, -11/9, 0.11988? 5 What is the fourth smallest value in -3/7, 18843, -138.9, -1? 18843 What is the third smallest value in 0.5, 1, 0.31, -0.56, 9? 0.5 What is the biggest value in -1/981, 274, -298.6? 274 What is the third biggest value in 1/2, 0.6, -60, -5/3? -5/3 Which is the third biggest value? (a) 113/78 (b) 4/11 (c) 0 (d) 4 b What is the second smallest value in 1, 5, -0.1, -106, 0.6, -0.0502? -0.1 Which is the second smallest value? (a) -2/207 (b) -114043 (c) -2/7 (d) -11 d Which is the second smallest value? (a) 315 (b) 14 (c) 4 (d) 0.11 (e) 3 (f) -2 (g) -4 f Which is the second smallest value? (a) -2 (b) 0.5 (c) -221.92 (d) 4 (e) 0.1 a Which is the biggest value? (a) -3/23 (b) 227 (c) 205 (d) 2.5 b Which is the third biggest value? (a) 1 (b) -12 (c) -0.3 (d) 54 (e) 4/3 (f) -0.1 a What is the biggest value in 5/4, -10102189, 3? 3 What is the second biggest value in -3, -1.4, -6.9, -0.087? -1.4 Which is the biggest value? (a) -4 (b) 0.2 (c) 26/7 (d) 292 (e) -459 d What is the smallest value in 237, 11668, -0.4? -0.4 Which is the fourth smallest value? (a) -2/7 (b) -0.89 (c) -49 (d) -21.27 (e) 3 (f) 4/5 a Which is the smallest value? (a) -4 (b) -70/19 (c) 0.765 a Which is the biggest value? (a) 4/3365 (b) 0.01 (c) 1/5 c What is the fifth smallest value in 1/6, -0.3, 293, 5/4, -1/7, 2, -2? 5/4 What is the third biggest value in -115, -16/9, 2/9, 7, 926? 2/9 What is the biggest value in 0, 2/11, -1/7, 1, -4685? 1 What is the smallest value in 2.64, -89, 13.4? -89 Which is the fifth smallest value? (a) -5/3 (b) -3354 (c) -0.5 (d) 3/7 (e) -0.1 d Which is the fifth smallest value? (a) -1/2537 (b) 3/4 (c) -8 (d) 8 (e) 0 (f) 0.3 b Which is the fourth biggest value? (a) 198 (b) 2.5 (c) -5/6 (d) 5 (e) -0.2 (f) 4/7 f Which is the third smallest value? (a) 680892 (b) 4/3 (c) -0.3 a Which is the second biggest value? (a) -0.53 (b) 2 (c) 1 (d) -534/7 c What is the third biggest value in 27, 5, -1660, -0.4? -0.4 Which is the fourth smallest value? (a) -8 (b) -0.06 (c) 41 (d) -11 (e) -4 (f) 5 (g) -0.3 g Which is the second smallest value? (a) 3 (b) 0.010007 (c) -15 (d) -0.04 (e) -1/4 e What is the fourth smallest value in -5/6, 96, -8169, -2? 96 What is the fourth smallest value in 3/2, 2/3, -0.04, 1/4, 389.3, -0.12? 2/3 What is the sixth biggest value in 41, -2/13, -0.5, 2, -1, -13? -13 What is the biggest value in 43, -91, -1543/2? 43 Which is the third biggest value? (a) 7 (b) 5 (c) -2/823485 (d) -1/4 c Which is the smallest value? (a) 0.23937 (b) 9/2 (c) -0.011 c What is the third biggest value in -5/7, 3, 0.302, 1434.8? 0.302 Which is the sixth smallest value? (a) -3/8 (b) -1/8 (c) -2/7 (d) -0.27 (e) -17 (f) -4.3 (g) 76 b What is the fifth smallest value in 23, 51, 1/4, 201, -3? 201 What is the smallest value in -0.4, 15752, 2/21, 3? -0.4 What is the fifth biggest value in -13.4, -3, -0.4, -0.2, 1/11, 3/11, 197? -0.4 What is the fourth smallest value in 1/4, -0.4, 2.1, 22198, -5? 2.1 What is the smallest value in -9.6, 0.2, -3/8, 1/12, 39, -2? -9.6 Which is the third biggest value? (a) -1/3402 (b) 3 (c) -0.9 (d) -0.03 (e) -2/3 d What is the sixth biggest value in 0.1, -8/131, 0.3, 0, -0.609, -0.4, -4/7? -4/7 Which is the second smallest value? (a) 27 (b) -1 (c) -4.3 (d) 0 (e) 1/51 b What is the fifth biggest value in 22, 26042, 5, 6, 2? 2 Which is the second smallest value? (a) -1/4 (b) 79 (c) 413 (d) 5 (e) -4 (f) -0.3 f What is the smallest value in 0.2, -2/15, -0.3, 5.7, -5, 24.326? -5 What is the second biggest value in 6/11, 0.1, 4.7, -1080, 8, -3? 4.7 Which is the smallest value? (a) -3 (b) 6 (c) 0 (d) -0.3 (e) 118769 (f) -1/3 a Which is the sixth biggest value? (a) 0.1 (b) -2 (c) -0.0275 (d) 0.04 (e) 7/2 (f) 2 (g) 3/2 c Which is the third biggest value? (a) -323 (b) -1/11 (c) 4 (d) 0.04 (e) -3/43 (f) -1 (g) 2/13 d Which is the third smallest value? (a) -0.01 (b) 0.3 (c) -543.44 (d) 3/19 d Which is the biggest value? (a) -0.3 (b) 500 (c) 7/2 (d) -10 (e) -1 (f) -1/4 b What is the biggest value in -5, 15056, -0.05, 10/7? 15056 Which is the second biggest value? (a) 286.9 (b) 4/27 (c) 6/5 c What is the third smallest value in -0.2, 161834, -3, -0.1, 2/7? -0.1 What is the third smallest value in 0.01, 5, 0.0612, 4, 1/2, 3? 1/2 Which is the fourth biggest value? (a) -25	{ "pile_set_name": "DM Mathematics" }
-198c. What is the least common multiple of 48 and f? 96 Calculate the common denominator of 31/294 and (-32)/((-34560)/(-546)) - 3/10. 1764 Let o = 257380175/2738 + -94003. Find the common denominator of o and 43/592. 21904 Let p(o) = 610o*2 + 19o - 5. Let j be p(-6). Let v = -9876 + j. Let r = 287113/24 - v. Find the common denominator of 31/36 and r. 72 Let a = 5495 - 38505/7. Calculate the common denominator of a and -32/1135. 7945 Let i(g) = -g*2 - 4g + 7. Let t be i(-5). What is the common denominator of (-9)/((-207)/115) + (-110)/36 and (235/34 - t) + -2? 306 Let w = -3450 + 117345/34. What is the common denominator of w and 41/294? 4998 Let c = -430390821/5861 - -73433. Let i = 697315/105498 - c. What is the common denominator of i and -101/838? 7542 Let v(r) = r*3 + 3r*2 - 2r - 3. Suppose h - 22 = -22. Suppose -5u - 4f = -hu - 16, -7 = -2u - f. Calculate the least common multiple of u and v(-2). 20 Suppose 101 + 4 = -5y. Calculate the common denominator of (-68)/(-50)1/2 and (3/y)/(1/(-32)). 175 What is the common denominator of (-14096)/25088 - (-1)/2 and 101/588? 4704 Let x(c) = -c3 + c2 + 15c - 6. Let n be x(-3). Calculate the common denominator of -1/9 and n/9130/25. 9 Let q(h) = 48h - 283. Let d be q(6). What is the smallest common multiple of ((-96)/(-320))/((-3)/(-4))d and 2? 2 Suppose 26r + 1346 = 33638. Let a = r - 22373/18. Calculate the common denominator of a and -1/93. 558 Suppose -4d + 175 = 3r, 3r - 155 = -4d + 4r. Let y = 562 + -560. What is the least common multiple of y and d? 40 Suppose -2x - 5m = -90, -4m - 154 = -4x - m. What is the smallest common multiple of 4/26 - 300/(-78) and x? 40 Suppose 0a - 4a + 4331 = -w, -w - 5414 = -5a. What is the least common multiple of 5 and a? 5415 Find the common denominator of 41/741 and (8/78)/(197/(-310) + 16/(-248)). 5187 Let o(j) = -437j - 52. Calculate the lowest common multiple of o(-2) and 3. 822 Suppose 9z = 12z + 69. Find the common denominator of 2/(-12) - -5z/12 and (243/(-60))/((-10)/(-25)). 8 Let h = 1706899/378 - 4516. Calculate the common denominator of -23/1386 and h. 4158 Let q = 2058/11 + -261036/1397. Calculate the common denominator of q and 57/4. 508 Let l(k) = -k3 - 23k*2 - 4k - 4. Let i be l(-23). Let q = i - 103. What is the common denominator of -91/12 and ((q - 4)1)/((-6)/9)? 12 Let k be 791(108/(-14) - -8). Let z = -206 + k. Calculate the lowest common multiple of 9 and z. 180 Let u be 430/129(2551/5 + 1). Let l = u - 30691/18. Find the common denominator of 59/20 and l. 180 Find the common denominator of -109(11/(-308))/((-243)/6) and -13/1890. 5670 Let n = 1104657/294448 + -872/239. Find the common denominator of n and 23/1232. 1232 Let z = 46 - 36. Let g be (-2)/z + 13595/15975. Let a = g + 9/71. Find the common denominator of 15/4 and a. 36 Let l = -14103/340 + 638/17. Let b = -80 - -73/2. What is the common denominator of l and b? 20 Suppose 3d + w - 51 - 85 = 0, 0 = -3w + 12. What is the lowest common multiple of 608 and d? 6688 Suppose -3k - 2k = d - 10, -2d + 76 = -4k. Suppose dg = 44g - 560. What is the least common multiple of g and 35? 280 Let s = -7742279941/3640 + 2127000. Calculate the common denominator of s and -47/8008. 40040 Let r = -356/171 + -28/19. Let x = 16717/6 + -2806. What is the common denominator of x and r? 18 Suppose 0 = -6k + 207 + 1413. Let s(p) = p3 - p2 - 3p. Calculate the least common multiple of s(3) and (k/(-12))/((-2)/4). 45 Suppose 27t = -0t - 648. Calculate the lowest common multiple of 388 and t/10((-304)/24 + 6). 1552 Suppose 3004u - 83 = 3003u. Calculate the smallest common multiple of 11 and u. 913 Suppose 6x + 2862 = 786. What is the common denominator of (-20)/(-5) + 33/(-60) and (-5 - x/40)-2? 20 Suppose -2u = 10 + 12. Let f = -6 - u. Calculate the common denominator of 3 - f - (-285)/10 and -9. 2 Find the common denominator of (-1)/(198/(-55)) + -8 and -17/50. 450 What is the smallest common multiple of 528 and (-68)/(-2) + 45 + -49? 2640 Let c = -12883 - -8644491/671. Let j = -6007/10736 + c. What is the common denominator of j and 95/188? 752 Suppose -3a = -12, -f = 4f - 2a - 12. Let t be f15/20 - 3024/1010. Let n = -24778/5555 + t. What is the common denominator of 91/16 and n? 176 Suppose 1 = -5f - 9, -2y + f = -8. Suppose -yx + 231 = 4r, -12r + 10r + 132 = -4x. Calculate the least common multiple of 24 and r. 120 Suppose 0 = 5k + 2k - 5k. Let y(a) = 2a2 + 2a. Let p be y(k). Suppose 4b + d + 79 = 0, b + 3d + pd = -17. Find the common denominator of b and -33/8. 8 Suppose 0 = 4z - 937 - 1543. What is the common denominator of 143/30 and 1829/z + 2/(-6)? 60 Let t(p) = 70. Let i(v) = v + 142. Let b(h) = 3i(h) - 5t(h). Find the common denominator of 64/111 and b(-25). 111 What is the lowest common multiple of (-1 - -3)/(34/204) and 204? 204 Let z = -30 + 145/4. Calculate the common denominator of 111/494 and z. 988 Suppose -1350 = 284k + 272k - 565k. What is the least common multiple of 180 and k? 900 Suppose 5b + 3y = 7y + 1092, y + 218 = b. What is the common denominator of 138/56 - 2/8 and 230/b - (2 - 3)? 154 Suppose 0 = 25i - 1035 + 160. Suppose -32g - 162 = -ig. Calculate the least common multiple of g and 22. 594 Let m = 82/7 - 746/35. Let p = -1169/3 - -395. What is the common denominator of m and p? 15 Let l = -5409 - -10189. Let i = l + -28567/6. What is the common denominator of 20/63 and i? 126 Suppose 103i - 120 - 912 = 1028. Let p(b) = 37b2 - 3b + 4. What is the least common multiple of i and p(-4)? 3040 Let y = -544/305 + -1/61. Let l = -18337319/6 + 45751479109/14970. Let u = -2/499 - l. Calculate the common denominator of y and u. 5 Let q = 4584/211 - 12752957/586791. Find the common denominator of q and -11/324. 33372 Let o = -1742 - -31337/18. Calculate the common denominator of ((-529137)/1386)/227-11/8 and o. 1584 Let h(y) = 4y2 + 56y + 747. What is the least common multiple of 2 and h(-23)? 3150 Let w(x) = x*2 + 13x + 18. Let k be w(-12). Suppose -z = 5m + 129, -4z + 3 = -m - k. Find the common denominator of (m/(-10))/5-81 and 67/18. 18 Suppose 4h + 4s = 0, -3h - 2s + 6 = 3s. Find the common denominator of 37/32 and 1/h - 66/8. 96 What is the common denominator of 54/540 + (-3 - -4 - 2129/2030) and 98/1305? 9135 What is the least common multiple of 21 and 162/(-729) - (-102070)/45? 2268 Suppose -3v - 2x = 10, 0v + 4v + x = -15. Calculate the common denominator of (3/4 - 1) + (-94)/v and 8/5(-28)/(-49). 140 Let b = 121222202 + -175773457. Let m = b + 37094839301/680. Let t = -203/10 - m. Calculate the common denominator of t and 85/8. 136 Let c = -5592 + 257249/46. Find the common denominator of 67/224 and c. 5152 Let d = -17 - -19. Let s = 682/27 + -3655/108. What is the common denominator of ((-18)/81)/(29/13 - d) and s? 108 Suppose 926 = 79l + 19l - 838. Let a = 423 - 233. Calculate the smallest common multiple of a and l. 1710 Suppose -3r + 2g = -490, 5r + g - 294 - 501 = 0. Let y be ((-902)/5)/((r/75)/(-8)). Let l = y - 634. Find the common denominator of l and -49/16. 16 Let p = -6551 + 7036. What is the least common multiple of p and 35? 3395 Let t = -4020901/99 - -40616. What is the common denominator of -47/9 and t? 99 Let j = -24625/9 + 2740. Find the common denominator of j and -32/2441. 21969 Let x be (-5)/(-6 + 2463/411). Let p = 863 - x. What is the lowest common multiple of p and 8? 712 Let p = -954 - -956. Calculate the common denominator of 2/(-8) - (-32)/(-10) and (p/(-2) + 2)(-3145)/(-222). 60 Suppose 14 = 2s - 2d, 22 = s + 9d - 7d. Suppose -3k = -6 - 12. Suppose -2v = -2 - k. Calculate the least common multiple of s and v. 12 Let m = -7388034639 + 157217377060481/21280. Let n = -13/665 + m. What is the common denominator of 139/84 and n? 672 Suppose 2w - 4 = -0. Let t(n) = -9n + 4 - 11n*2 + 10n*w - 3. Calculate the lowest common multiple of t(-9) and 18. 18 Suppose -2g + 0g = -4992. Let v = 35232 - 35212. What is the lowest common multiple of g and v? 12480 Let i be 2822/(-288) - 2/(-9). Let u = -104/9 - i. Calculate the common denominator of u and 33/40. 240 Let x = -2609 - -2705. Let t(l) = l3 - 10l**2 + 8	{ "pile_set_name": "DM Mathematics" }
-n = 2n + 21. Calculate the least common multiple of o(-15) and t(n). 44 Let m = 100 - 72. Suppose m = 8k - k. What is the lowest common multiple of 10 and k? 20 Let x = -201827 - -107775545/534. What is the common denominator of -73/3 and x? 534 Suppose -q - 3 + 7 = 0. Let i(g) = -g*3 + 16g*2 + 22g - 544. What is the smallest common multiple of q and i(15)? 44 Let r(k) = -4k - 13. Suppose 3l + 2j = 3j - 16, 8 = -3l + 5j. Calculate the lowest common multiple of 2 and r(l). 22 Suppose -4c + 5l - 4 = 0, -4c - c - l = 5. Calculate the common denominator of c/((-20)/(-3))765/(-18) and 30/(-11) + (2 - 1). 88 Suppose k + 229 = 715. What is the lowest common multiple of k and 21? 3402 Let j = 62378/9 + -6938. Find the common denominator of j and -73/9. 9 Let n = 83 + -35. Find the common denominator of (178/n)/(15/(-45)) and -1 - 233/12. 8 Suppose -327 - 69 = 4y. Let t = y + 878/9. Find the common denominator of -25/13 and t. 117 Let j be ((-2)/(-6))/((-1)/949). Let b = -9319/30 - j. Find the common denominator of b and (-124)/(-22) - (1 - 0). 110 Let k be -1213/(-9). Calculate the common denominator of (6/90)/(10/(-1185)) and -2 + 71/k + 0. 20 Suppose -o - 2 = 0, 2t + 2t = -o + 10. Let j(z) = -5z2 + 6z + 69. Calculate the lowest common multiple of j(-3) and ((-3)/2)/(t/(-8)). 12 Suppose -1524 = -14k + 2172. Calculate the smallest common multiple of k and 16. 528 Suppose f + 1 - 19 = 0. Let g be f/(-99) + (-24)/(-11). Suppose 0 = -2b - d + 18, -2 = b - 7d + gd. What is the least common multiple of 4 and b? 8 Let m = 3807605/66 - 57689. Calculate the common denominator of m and 93/16. 528 Let c be -3(16060/(-6150) - (-1)/3). Let w be 528/(-574) - 4/(-14). Let s = w + c. Find the common denominator of s and -1/7. 35 Suppose -4s = 3n + 15 - 58, -n - s = -15. Let v = -8 + n. Calculate the smallest common multiple of v and 24. 72 Let n(r) = 506r*2 - 3r - 6. Let l be n(-5). Let i = l + -227723/18. Find the common denominator of 254/36 - (1 + -1) and i. 18 Find the common denominator of 61/3 and ((-12)/50)/(255/400). 255 Let b be 5/5 + (-2477)/6. Let z = 423 + b. Calculate the common denominator of -15/8 and z. 24 Let z = 56605/11 - 5150. Let m be (-8)/16 - 545/(-58)1. Let c = -1555/174 - m. What is the common denominator of c and z? 66 Calculate the common denominator of -7 + 3 + 4543/1320 and 13/72. 360 Let h = -20 - -20. Suppose h = -4q - 6 - 146. Let m = q - -41. Find the common denominator of m and -12/7. 7 Calculate the lowest common multiple of 36 and (-57)/(-38) + 93/2. 144 Let i = -733/8 - -92. Let a = -1881 + 71469/38. Calculate the common denominator of i and a. 152 Let u(b) = b*3 + 2. Let t be u(0). Suppose -18 = -2p - 2x, -tp + 7x - 3x = -12. What is the lowest common multiple of p and 10? 40 Let b = 19 - 37. Let t(o) = o*3 + 17o*2 - 20o - 24. Suppose -20 = -p - p. Calculate the least common multiple of t(b) and p. 60 Let b = -3292 - -559513/170. Calculate the common denominator of 48/187 and b. 1870 Let o = 39/88 - -3/8. Find the common denominator of 47/11 and o. 11 Let h = 3/2185 - -128891/17480. Find the common denominator of h and -67/46. 184 Let k(m) = -7m + 120. Let l(x) = -x3 + 6x*2 + 7. What is the least common multiple of l(6) and k(16)? 56 Let y = 1033 - 1012. What is the smallest common multiple of y and 3? 21 Let a = -4381 - -2131. Let o be 4/(-12) + 26809/12. Let f = a + o. What is the common denominator of f and -119/20? 20 Calculate the common denominator of -92/315 and ((-116)/(-1450))/((-84)/2055). 630 What is the least common multiple of ((-120)/18)/((-1)/3) and -12(-16 + 7)? 180 Let u = -381/37 + 9441/518. What is the common denominator of 3((-41)/18 - 4) and u? 42 Let g = 115 - 92. Let a(i) = -i - 1. What is the least common multiple of a(-7) and g? 138 Let n = 25/197 + -19903/3152. Calculate the common denominator of n and 59/18. 144 Let s = -140/9 + 2339/144. Let n = -27325/6 - -4538. What is the common denominator of n and s? 48 What is the lowest common multiple of (-24)/14(-112)/726 and 856? 1712 Let d be 1 + 3 + 1 + -3. Suppose -90 = -3v - 4j, -4j + 0j - 80 = -dv. What is the least common multiple of (8/10)/(2/5) and v? 34 What is the common denominator of -20/11 and 26/(-4) - -355/(-25)? 22 Calculate the common denominator of (2(-10)/(-72))/((-20)/(-25)) and 97/18. 72 Calculate the common denominator of -1/9 and (6/378)/(-4 + (-1972)/(-492)). 63 Let c = -10 + 30. Let t = c + -15. What is the lowest common multiple of 2 and t? 10 Let u(l) = l2 - 3l + 4. Let d(m) = m3 + m2 - m + 3. Let t be d(0). Let s(c) = -223c + 229. What is the lowest common multiple of u(t) and s(1)? 12 Suppose 3 = -b + 23. Calculate the least common multiple of b and -4 + 5 + -1 + 4. 20 Suppose 5z - 46 = -n, 0z - z + 2 = 2n. Let b(p) = -9p - 3p*2 + 2p*2 + 7 - 3p + 12. Calculate the lowest common multiple of b(-13) and z. 30 Let t(w) = 2w + 6. Let p be t(-2). Let m = -2716 - -43477/16. Find the common denominator of m and (p/3)/(48/(-738)). 16 Let z = -10544 - -295139/28. Calculate the common denominator of -127/140 and z. 140 Let k = -141/5 + 2114/75. Find the common denominator of k and -69/2. 150 Let l(o) = o - 2. Let n be l(9). Suppose nz - 5 = 9. Calculate the lowest common multiple of 4 and z. 4 Suppose -v = -5v + 40. Suppose -w = 7 - v. Suppose 3c = -wc + 108. Calculate the least common multiple of c and 4. 36 Let i = -8 + 19. Let g be ((-2)/(-4))/(2/20). Suppose -gb + 39 = -i. Calculate the smallest common multiple of 5 and b. 10 Let s = -56 - -7. Let m = 16423 + -230607/14. Let v = m - s. Find the common denominator of v and -21/16. 112 Let x = 1913 + -1911. What is the smallest common multiple of x and 1956? 1956 Let j = 7550/4257 + 2/473. Find the common denominator of (-6)/18150/(-22) and j. 99 Suppose 3j - 4j - 13 = 4o, 5o + 5 = -5j. Calculate the common denominator of -55/108 and (2/8)/(o + 1746/444). 540 Let j = 18 - 14. Suppose -8 - 6 = -5v + 2k, jv + 5k = -2. What is the lowest common multiple of (3 - 1/(-1))/v and 18? 18 Let a(i) = -i*3 - 12i*2 + 8i - 12. Let m be a(-9). What is the common denominator of m/(-6)(-5)/30 and -13/3? 12 Suppose 3l = 5w + 70, -3l + w + 66 = -20. Suppose -5z = 5p + l, -10 = z + 3p - 0p. What is the common denominator of ((-34)/(-11) - z) + -4 and -31/20? 220 Let y = -15091 + 324. Let k be 4/6y/6. Let p = k - -1637. What is the common denominator of -121/10 and p? 90 Let k(n) = -n2 + 1. Let v(x) = 7x*2 + 2x - 6. Let y(c) = -6k(c) - v(c). Calculate the smallest common multiple of y(-1) and 10. 10 Let s be (3/(-3))/((-1)/5). Let v be (1 + 10/(-8))0. Suppose sr + 20 = v, -4a + 126 = a - 4r. Calculate the least common multiple of 6 and a. 66 Let p = 32/9328205 - -12819388329841/485066660. Let l = p - 26427. What is the common denominator of -81/10 and l? 260 Suppose -40x + 55x - 360 = 0. Calculate the least common multiple of 333 and x. 2664 Let w be 4/6(-18)/(-1). Find the common denominator of (-7)/175(-365)/2 and 17/(-5) + (-6)/w. 10 Let b(t) = -15t + 3. Let z(c) = -c*2 + 10c - 18. Let f be z(8). Let y be b(f). Let j = -21 + y. Calculate the smallest common multiple of 10 and j. 60 Let b(g) = -2g + 3g - 4 + 2. Let p(r) = 2r2 + 1. What is the least common multiple of b(4) and p(-1)? 6 Let j be 240/((-5 - -9)/(-4)). Calculate the common denominator of j/102 - -22 and 67/2. 34 Let n(y) = 9 - y - y + y. Suppose 97x - 204 = 63x. Calculate the smallest common multiple of x and n(4). 30 Let j = 18329/70 - 1779/7. Calculate the common denominator of 10/109 and j. 1090 Suppose q = -5w + 424, -5w + 23 = -4q - 381. Calculate the smallest common multiple of 8 and w. 168 Suppose q = -5r - 16, -5q - 3 = -5r - 43. Find the common denominator of (-5)/(-6) + 6/9 and (-46)/r(-12)/30. 10 Let j(m) = -6m*2 + 5m - 4. Let z be j(2). Let w = 23 + z. Suppose -3 = wa - 63. Calculate the least common multiple of 14 and a. 84 Suppose -4t = 2l - 40, -l + 4l - 35 = -t. Suppose -l = 20x - 21x. Calculate the lowest common multiple of 2 and x. 10 Suppose 6l - 21 = 3l. Let f = -45 - -64. What is the least common multiple of l and f? 133 Let t = -51 - -121. What is the smallest comm	{ "pile_set_name": "DM Mathematics" }
divided by 320. 316 What is the remainder when 36953 is divided by 3686? 93 What is the remainder when 9416158 is divided by 168140? 318 What is the remainder when 58468497 is divided by 71? 68 Calculate the remainder when 413617 is divided by 1137. 886 Calculate the remainder when 11189758 is divided by 248. 246 Calculate the remainder when 72299 is divided by 896. 619 Calculate the remainder when 361351 is divided by 28. 11 What is the remainder when 5976835 is divided by 1287? 7 Calculate the remainder when 397716 is divided by 191. 54 What is the remainder when 22031174 is divided by 310298? 16 What is the remainder when 124811206 is divided by 1116? 1114 Calculate the remainder when 1000345 is divided by 712. 697 What is the remainder when 280052 is divided by 93349? 5 What is the remainder when 13668227 is divided by 4556069? 20 Calculate the remainder when 10150671 is divided by 3051. 3045 Calculate the remainder when 10046492 is divided by 16. 12 What is the remainder when 415267 is divided by 59? 25 Calculate the remainder when 18045742 is divided by 15. 7 Calculate the remainder when 986518 is divided by 3008. 2902 Calculate the remainder when 18781 is divided by 5622. 1915 Calculate the remainder when 84409 is divided by 888. 49 Calculate the remainder when 904675 is divided by 301171. 1162 What is the remainder when 4295065 is divided by 23? 22 What is the remainder when 990748 is divided by 43? 28 Calculate the remainder when 21457710 is divided by 5921. 6 Calculate the remainder when 20855260 is divided by 160425. 10 What is the remainder when 140588 is divided by 17459? 916 What is the remainder when 1882620 is divided by 941294? 32 What is the remainder when 1287606 is divided by 25? 6 Calculate the remainder when 3159245 is divided by 1053073. 26 Calculate the remainder when 162754 is divided by 4068. 34 What is the remainder when 34003470 is divided by 26? 20 Calculate the remainder when 2678024 is divided by 1339001. 22 Calculate the remainder when 69695 is divided by 269. 24 Calculate the remainder when 108494 is divided by 36121. 131 What is the remainder when 1096998 is divided by 36566? 18 Calculate the remainder when 178213 is divided by 771. 112 Calculate the remainder when 479511 is divided by 53277. 18 What is the remainder when 78052 is divided by 11126? 170 What is the remainder when 34705035 is divided by 323? 300 Calculate the remainder when 810724 is divided by 1682. 0 What is the remainder when 18840819 is divided by 1906? 9 What is the remainder when 7816659 is divided by 815? 809 Calculate the remainder when 11288430 is divided by 76. 74 What is the remainder when 6055624 is divided by 14698? 48 What is the remainder when 206667 is divided by 1033? 67 What is the remainder when 99645 is divided by 32477? 2214 What is the remainder when 4570952 is divided by 2149? 29 What is the remainder when 305177 is divided by 116? 97 Calculate the remainder when 352466 is divided by 70479. 71 Calculate the remainder when 12082 is divided by 5983. 116 Calculate the remainder when 645849 is divided by 31. 26 Calculate the remainder when 2068980 is divided by 406. 4 What is the remainder when 303156509 is divided by 34? 31 What is the remainder when 389109 is divided by 8268? 513 What is the remainder when 1231943 is divided by 102659? 35 Calculate the remainder when 1443947 is divided by 44. 43 What is the remainder when 7194781 is divided by 3597373? 35 What is the remainder when 138694 is divided by 133925? 4769 Calculate the remainder when 39343 is divided by 2291. 396 What is the remainder when 1101135 is divided by 364195? 8550 What is the remainder when 120700410 is divided by 1432? 1426 What is the remainder when 858961 is divided by 286275? 136 What is the remainder when 11004400 is divided by 897? 4 Calculate the remainder when 230414 is divided by 17721. 41 What is the remainder when 1138234 is divided by 72? 58 What is the remainder when 76174 is divided by 1873? 1254 Calculate the remainder when 593672 is divided by 79. 66 Calculate the remainder when 140409 is divided by 2007. 1926 What is the remainder when 1753916 is divided by 870? 866 What is the remainder when 3871395 is divided by 6? 3 Calculate the remainder when 210299 is divided by 1945. 239 What is the remainder when 209398368 is divided by 122? 8 Calculate the remainder when 441555 is divided by 1322. 7 Calculate the remainder when 22013075 is divided by 646. 625 Calculate the remainder when 1712806 is divided by 309. 19 What is the remainder when 7985509 is divided by 3319? 3314 Calculate the remainder when 276780 is divided by 4854. 102 What is the remainder when 3315733 is divided by 1105236? 25 What is the remainder when 65582 is divided by 21523? 1013 Calculate the remainder when 47583 is divided by 14211. 4950 Calculate the remainder when 349357 is divided by 519. 70 Calculate the remainder when 12794906 is divided by 1204. 1202 What is the remainder when 3337047 is divided by 7085? 12 What is the remainder when 4291619 is divided by 238422? 23 What is the remainder when 352708 is divided by 121? 114 What is the remainder when 1263154 is divided by 157891? 26 Calculate the remainder when 155496 is divided by 154077. 1419 Calculate the remainder when 55259 is divided by 2298. 107 Calculate the remainder when 70753974 is divided by 23. 17 Calculate the remainder when 355488 is divided by 128. 32 Calculate the remainder when 3696107 is divided by 19. 18 What is the remainder when 4862935 is divided by 1620978? 1 Calculate the remainder when 103176 is divided by 33409. 2949 What is the remainder when 331157 is divided by 2207? 107 What is the remainder when 265107 is divided by 19? 0 Calculate the remainder when 449834 is divided by 11223. 914 What is the remainder when 30787976 is divided by 17735? 16 Calculate the remainder when 197279 is divided by 1996. 1671 Calculate the remainder when 17743664 is divided by 548. 520 Calculate the remainder when 284226 is divided by 293. 16 What is the remainder when 340856 is divided by 15493? 10 What is the remainder when 1438941 is divided by 79938? 57 Calculate the remainder when 34631444 is divided by 88. 12 Calculate the remainder when 74753440 is divided by 27. 25 What is the remainder when 14054680 is divided by 184? 24 What is the remainder when 217956 is divided by 54? 12 What is the remainder when 60085 is divided by 60048? 37 Calculate the remainder when 3625243 is divided by 906304. 27 What is the remainder when 51717393 is divided by 18083? 13 What is the remainder when 108471 is divided by 8232? 1455 What is the remainder when 28137926 is divided by 67? 3 Calculate the remainder when 505972 is divided by 411. 31 Calculate the remainder when 258614 is divided by 8916. 50 What is the remainder when 10002274 is divided by 418? 370 Calculate the remainder when 10134048 is divided by 205. 78 What is the remainder when 14764531 is divided by 44741? 1 What is the remainder when 29267518 is divided by 38? 32 Calculate the remainder when 2494756 is divided by 70. 26 Calculate the remainder when 55415334 is divided by 1185. 1179 What is the remainder when 8943355 is divided by 104? 83 Calculate the remainder when 14031554 is divided by 215870. 4 Calculate the remainder when 103974555 is divided by 3637. 3636 What is the remainder when 5150272 is divided by 2341? 72 What is the remainder when 1235901 is divided by 15043? 2375 Calculate the remainder when 1638798 is divided by 331. 17 Calculate the remainder when 1401749 is divided by 623. 622 Calculate the remainder when 3324586411 is divided by 8549. 8546 What is the remainder when 7976167 is divided by 121? 89 Calculate the remainder when 30823597 is divided by 4404. 1 What is the remainder when 34139546 is divided by 76546? 30 Calculate the remainder when 2332809 is divided by 139. 111 Calculate the remainder when 5026262 is divided by 1675416. 14 Calculate the remainder when 1844114 is divided by 36882. 14 What is the remainder when 53663935 is divided by 8943988? 7 Calculate the remainder when 559820 is divided by 2856. 44 Calculate the remainder when 257222 is divided by 5818. 1230 What is the remainder when 27634304 is divided by 42? 26 What is	{ "pile_set_name": "DM Mathematics" }
2i2 - 3i - 1. Let h be o(-1). Let y be 119/(-245) - 2/h. Which is the smallest value? (a) -0.5 (b) y (c) 4 a Let l = -0.0504 - 0.2496. Which is the third biggest value? (a) -16 (b) -0.5 (c) l (d) 0.5 b Let c = 1.239 + -1.539. What is the third biggest value in 3.8, -0.1, c? c Let h = -2734/5 - -550. Suppose 0 = -7b - 3b - 30. Let u = b + h. What is the third smallest value in -0.3, u, 5? 5 Let u = 0.064 - 5.764. Let b = u - 1.3. Let h = b - -9. What is the third biggest value in -0.4, h, -6/7? -6/7 Let m = -36.94 + -0.06. Let s = 42 + m. What is the biggest value in 3, s, 1/7? s Let x = -1.26 - -0.06. Let q = 1 + x. Let u = -8006 + 8001. Which is the third biggest value? (a) q (b) u (c) 0 b Suppose 3t + 4i - 2i = -197, 2t = -5i - 146. Let y be 2 - ((-51)/t - 8/(-6)). What is the fourth biggest value in y, -2/7, -1/2, 0? -1/2 Suppose -5b + b = 16. Let k(v) = -v + 6v - v - 1 - 2v. Let o be k(1). What is the smallest value in 5, o, b? b Suppose 3g - 1 = 11. Let r = -97 - -100.2. Which is the second smallest value? (a) -5 (b) g (c) r c Suppose 5o - 9u + 5u - 20 = 0, 10 = 4o - 2u. What is the third smallest value in -9, -4/15, o? o Let v = 6 + -6.04. Let h = 128 - 131. Which is the smallest value? (a) -1 (b) h (c) v b Let g = -9.9142 - 0.0858. Which is the smallest value? (a) g (b) -4 (c) -3 a Let f = -816 + 8978/11. Which is the second smallest value? (a) f (b) -1 (c) 2 (d) 170 a Let l = 14 + -11. Let z be (3 - (-34)/(-20)) + l/15. Let n = 3.1 + -3. Which is the smallest value? (a) n (b) -1/6 (c) z b Let x = 26 - 30. Let k = -6.2 + 4.2. What is the third biggest value in k, 21, x? x Let u = -15.12 - -13.9. Let o = 1.1 + u. Let d = o - -0.42. Which is the smallest value? (a) d (b) 0.2 (c) 3 b Let d = -12.79 - -13. Let c = -0.51 + d. What is the third smallest value in -8/7, 1/5, c? 1/5 Let m = 612.7 - 553. Let z = m - 60. Let j = -7 + 4. What is the second smallest value in -1, z, j? -1 Let j = 19 - 136. Let r be (-2)/((-4)/(-4)) + j. Let s = r + 353/3. Which is the second biggest value? (a) -3 (b) -2/9 (c) s c Let r = 6500 - 6499.6. Let q be 33/(-4) - (-4)/16. Which is the third biggest value? (a) 0.3 (b) r (c) q c Let z be (-6105)/(-74)(-4)/(-6). Suppose 20 = zd - 59d. Let t = 4 - 4.08. Which is the third biggest value? (a) 1/3 (b) t (c) d c Let w = 5/23 - -8/69. Which is the third smallest value? (a) -7 (b) -1/4 (c) 5/2 (d) w d Let h = 3.6 - 8.6. Let n = 0.3 + -0.15. Let x = 4.15 - n. Which is the third smallest value? (a) -0.03 (b) x (c) h b Let l = -1.4 + 1.4. Suppose 11 = -5g + 4k, -8 = 3g - 3k + 1. Let n be (g/(-3))/1(4 + -2). Which is the biggest value? (a) n (b) 1/2 (c) l b Let u = 5 + -3. Let m = -5.57 + 50.97. Let n = m + -45. Which is the biggest value? (a) 1 (b) u (c) n b Suppose 3q + 4f - 27 = 2q, 5q = 3f + 89. Suppose -i = 2x + q, -3i - 50 = 2i + x. What is the second biggest value in -5, -0.03, i? -5 Let h = -561.7 - -562. What is the smallest value in 0.02, h, -2? -2 Suppose -15 = s - 5h, 9s + h - 45 = 5s. What is the biggest value in s, -2, -3? s Let w = 51 - 23. What is the third smallest value in 0.1, 4, w? w Let i be -6 - (-17)/2 - 27/6. What is the fourth smallest value in 0.5, i, 6/11, -0.5? 6/11 Suppose h + i + 90 = 0, -3h = -5i + 342 - 64. What is the second biggest value in h, -1/3, 0.3? -1/3 Let o be -6 + (414/48 - 3). What is the second biggest value in 1, o, -5? o Let o = -19899 + 19895. Let z be 74/160 + 4/(-10). Which is the fourth biggest value? (a) 0.2 (b) o (c) -2 (d) z b Let f = -65 - -37. Let o = -26 - f. Let w = 2.3 - o. Which is the third smallest value? (a) w (b) 0.4 (c) 1.3 c Let m = 64.1 + -63.7. What is the second biggest value in m, 0, 61/6? m Let u = 8.1 - -2.9. Let i = u + -16. Let k = i + 5.2. Which is the second biggest value? (a) -1/2 (b) -4 (c) k a Let f = 714 + -710. What is the second biggest value in 3, 5, f, -3/2? f Let d = -67.7 - -0.7. Let i = -67 - d. Which is the biggest value? (a) 1 (b) -1/4 (c) i a Let i = -13.908 + -0.092. Let v = 0.217 + 13.733. Let t = v + i. Which is the biggest value? (a) 2/3 (b) t (c) 1/2 a Let j = -277 + 277.3. Which is the third biggest value? (a) j (b) -2/7 (c) 0.4 (d) 2/15 d Let a = 0.73 + -30.73. Let c = -48 - a. Let d = 0.1195 + 4.8805. What is the biggest value in c, 4, d? d Let i = 0.1 + 0.4. Let v be 2367/(-2808) + 4/(-6). Let f = 18/13 + v. Which is the biggest value? (a) f (b) i (c) -2/3 b Let t = 15 + -11. Let w = 16/5 + -4. What is the fourth smallest value in w, t, -1, 3? t Let q = -0.8 - -0.4. Suppose -4f - 25 = -9f. Let r be 12 + (-180)/42 + -8. What is the biggest value in f, r, q? f Let k = 155/18 - 64/9. What is the second smallest value in k, -2.6, 4/9? 4/9 Let q = 0.17 - 0.07. Let u = -245 - -2203/9. Which is the biggest value? (a) q (b) u (c) 7 c Let l be (3/(-4))/(19/(760/(-75))). What is the fourth smallest value in 2/3, -1/6, 2, l? 2 Let w be 1(-26)/91 + 8/126. What is the fourth biggest value in -4, 3/5, w, 5/2? -4 Suppose -22 = -12p + 26. What is the biggest value in -0.5, p, 0.14? p Let s = -10/27 + 28/27. What is the smallest value in -2/5, -5, s, 0.1? -5 Let i = 2.89 + 16.11. Let y = -11 + -13. Let a = y + i. What is the third biggest value in a, 1, -1? a Let i = 2704 - 2720. Which is the third biggest value? (a) -1 (b) i (c) -2/3 (d) -3/4 a Suppose 43s = 25s. Suppose -3l + 49 = -20. Suppose 3d + l = 2w, -2 = 2w + 4d + 10. Which is the third biggest value? (a) w (b) 3 (c) s c Let o = -174 - -1216/7. Let w = 3.3 - 7.3. What is the fourth smallest value in w, -3, o, 0.4? 0.4 Let o = -353 + 352. What is the second biggest value in 0.07, o, -32? o Let v be (5/(-3))/(135/(-486)). Let t be 22/(-99)(-1 + 15/v). What is the smallest value in -4, t, 1? -4 Let m = 243 - 1943/8. What is the second biggest value in -2, 2/3, -5, m? m Let m(y) = -y - 8. Let o be m(-7). Let x = -75.4 - -54. Let z = 21 + x. What is the biggest value in z, -1/8, o? -1/8 Let l = -2 - -23. Let v = -17 + l. Which is the biggest value? (a) -10 (b) -5 (c) v c Let x = 12.98 - 13. Let j = x - -0.01. Let g = j - -0.51. Which is the biggest value? (a) -2/17 (b) g (c) 4/3 c Let w be 6/14 - ((-92)/14 - -2). Let n be 2/(-8) + (-42)/(-40). What is the second biggest value in w, 4, n? 4 Let n = 18.3 + -3.3. Let v = 0.58 - -15.42. Let w = v - n. Which is the biggest value? (a) w (b) 0.1 (c) -1 a Let l = 9 - -2. Let m = 10.34 - -0.46. Let r = l - m. Which is the biggest value? (a) r (b) -4 (c) 2/9 c Let u = -6 + 3. Let m = -13.1 - u. Let t = -10 - m. Which is the third smallest value? (a) -0.1 (b) t (c) 5/3 c Let x = 39 - 38. Let z = 1357/3576 + -2/447. Which is the second smallest value? (a) -0.1 (b) x (c) z (d) -4 a Let r = 22 - 19. Suppose rk + 15 = 3l, 0 = -8k + 3k - 5l + 25. Let y be 3/(-2)(-8)/6. Which is the biggest value? (a) 3 (b) y (c) k a Let p = -3.84 - -3.54. Which is the biggest value? (a) -2/5 (b) p (c) 0 (d) 3 d Let n = 4 - 0. Suppose 23o = 14o - 18. Let v be 1 + o(-21)/(-36). Which is the third smallest value? (a) n (b) v (c) -4/7 a Let i = 8 - -13. Let v = -7 - i. Let d be 1/(4/(32/v)). Which is the second biggest value? (a) -0.2 (b) d (c) -2/3 b Let h(u) = -u3 + u2 + 39u - 102. Let m be h(4). Which is the fourth smallest value? (a) 4 (b) m (c) 29 (d) -4 c Let m be -2(-4 - (-5)/2). Suppose mw = -3a + w - 12, -2w - 16 = 5a. What is the second biggest value in -5, a, 3? a Let r = 425.5 + -426. What is the biggest value in r, 1, 7? 7 Let a = 87 - 59. Let y = a + -25. Let v = -1.2 - -0.2. What is the third smallest value in y, v, 2? y Let z = -9 + 9. Let r = -607 + 609. What is the fourth smallest value in -5, r, 0.5, z? r Let s = -20.2 + 35.5. Let g = 0.7 - -14.3. Let x = s - g. Which is the third smallest value? (a) -0.1 (b) x (c) -0.2 b Let l = -57 + 57.1. Let x = -2 - -2.2. What is the fourth smallest value in x, 0.03, l, -1/5? x Let q(c) = c*2 + 8c - 7. Let l be q(-9). Suppose -b - 3 - l = 0. What is the smallest value in 1, -1, b? b Let b = 0.232 - 0.632. What is the third smallest value in b, 3/2, -3, 2? 3/2 Let g be 58/203 + 39/21. What is the second smallest value in	{ "pile_set_name": "DM Mathematics" }
is divided by 30? 21 Calculate the remainder when 1448570 is divided by 961. 343 Calculate the remainder when 8945083 is divided by 344041. 17 Calculate the remainder when 40951260 is divided by 3602. 122 What is the remainder when 625018 is divided by 2881? 2722 Calculate the remainder when 478977974 is divided by 801. 800 Calculate the remainder when 277618 is divided by 778. 650 Calculate the remainder when 106639587 is divided by 27. 9 Calculate the remainder when 72543948 is divided by 481. 9 What is the remainder when 23474 is divided by 21510? 1964 Calculate the remainder when 709115 is divided by 4297. 110 What is the remainder when 286258 is divided by 1322? 706 Calculate the remainder when 51390 is divided by 10213. 325 What is the remainder when 1789667 is divided by 119? 26 Calculate the remainder when 13900839 is divided by 6950078. 683 Calculate the remainder when 782485 is divided by 5472. 5461 Calculate the remainder when 566865 is divided by 105. 75 Calculate the remainder when 11426269 is divided by 88. 85 What is the remainder when 2119412 is divided by 1479? 5 Calculate the remainder when 195883 is divided by 64983. 934 What is the remainder when 55802 is divided by 23466? 8870 Calculate the remainder when 5304014 is divided by 2727. 2726 Calculate the remainder when 47547173 is divided by 2796891. 26 What is the remainder when 2425750 is divided by 8853? 28 Calculate the remainder when 130303 is divided by 1776. 655 Calculate the remainder when 211145 is divided by 873. 752 What is the remainder when 10228414 is divided by 2045679? 19 What is the remainder when 747351 is divided by 1271? 3 What is the remainder when 432593 is divided by 3326? 213 What is the remainder when 63554960 is divided by 253207? 3 What is the remainder when 927262 is divided by 18922? 84 What is the remainder when 93433638 is divided by 31144542? 12 Calculate the remainder when 19965 is divided by 2707. 1016 What is the remainder when 88297 is divided by 446? 435 What is the remainder when 383039 is divided by 47014? 6927 What is the remainder when 7870490 is divided by 160622? 12 What is the remainder when 2792320 is divided by 595? 580 Calculate the remainder when 8014750 is divided by 667895. 10 Calculate the remainder when 1856872 is divided by 14737. 10 Calculate the remainder when 21120693 is divided by 718. 5 Calculate the remainder when 1036253 is divided by 115138. 11 Calculate the remainder when 7179323 is divided by 421. 10 Calculate the remainder when 88020 is divided by 1301. 853 What is the remainder when 23438 is divided by 250? 188 Calculate the remainder when 259002 is divided by 7. 2 Calculate the remainder when 5643 is divided by 2771. 101 What is the remainder when 85179 is divided by 515? 204 Calculate the remainder when 5835 is divided by 867. 633 Calculate the remainder when 3401168 is divided by 532. 92 What is the remainder when 42753190 is divided by 4028? 4026 Calculate the remainder when 2157668 is divided by 22953. 86 What is the remainder when 12906099 is divided by 193? 189 Calculate the remainder when 4546268 is divided by 378844. 140 What is the remainder when 15053133 is divided by 1447? 1439 What is the remainder when 1808966 is divided by 634? 164 Calculate the remainder when 950887 is divided by 949281. 1606 What is the remainder when 7455575 is divided by 1900? 1875 Calculate the remainder when 9484386 is divided by 4742175. 36 What is the remainder when 1227770 is divided by 231? 5 Calculate the remainder when 12424038 is divided by 153383. 15 Calculate the remainder when 287395 is divided by 13038. 559 What is the remainder when 12457 is divided by 6132? 193 What is the remainder when 3720524 is divided by 43? 35 What is the remainder when 143617140 is divided by 2503? 6 Calculate the remainder when 1503763 is divided by 1488. 883 What is the remainder when 1339204 is divided by 1339197? 7 Calculate the remainder when 1583907 is divided by 217. 24 What is the remainder when 264603230 is divided by 131? 129 What is the remainder when 3323446 is divided by 558? 556 What is the remainder when 9289688 is divided by 194? 192 What is the remainder when 281049 is divided by 70249? 53 What is the remainder when 36104832 is divided by 1900254? 6 Calculate the remainder when 36406294 is divided by 17. 12 What is the remainder when 443416 is divided by 29534? 406 What is the remainder when 4241087 is divided by 315? 242 Calculate the remainder when 360224 is divided by 119993. 245 What is the remainder when 91308 is divided by 3990? 3528 What is the remainder when 135894 is divided by 67774? 346 Calculate the remainder when 866742 is divided by 2. 0 What is the remainder when 29295564 is divided by 951? 9 Calculate the remainder when 3689349 is divided by 103. 95 Calculate the remainder when 387264 is divided by 817. 6 What is the remainder when 41428 is divided by 4471? 1189 What is the remainder when 1012251 is divided by 27? 21 Calculate the remainder when 17674504 is divided by 11425. 29 What is the remainder when 226517 is divided by 256? 213 Calculate the remainder when 10669236 is divided by 53885. 6 What is the remainder when 20196363 is divided by 10806? 10755 Calculate the remainder when 4362710 is divided by 750. 710 Calculate the remainder when 1732775 is divided by 1994. 1983 Calculate the remainder when 508153775 is divided by 1392. 1391 What is the remainder when 47262333 is divided by 501? 498 What is the remainder when 30554407 is divided by 4364914? 9 Calculate the remainder when 5866280 is divided by 409. 402 What is the remainder when 437289 is divided by 217939? 1411 Calculate the remainder when 7569911 is divided by 628. 627 What is the remainder when 1562723 is divided by 306? 287 Calculate the remainder when 25490 is divided by 3922. 1958 What is the remainder when 267269 is divided by 3560? 269 Calculate the remainder when 580783 is divided by 6879. 2947 Calculate the remainder when 880067 is divided by 145. 62 Calculate the remainder when 3016217 is divided by 1508108. 1 What is the remainder when 101104 is divided by 5042? 264 Calculate the remainder when 275535 is divided by 5838. 1149 What is the remainder when 23195995 is divided by 217? 214 Calculate the remainder when 171588145 is divided by 537. 535 What is the remainder when 741114 is divided by 1229? 27 Calculate the remainder when 987598 is divided by 881. 878 What is the remainder when 11107083 is divided by 11? 9 Calculate the remainder when 106492 is divided by 484. 12 Calculate the remainder when 56902 is divided by 58. 4 Calculate the remainder when 12109583 is divided by 158. 147 What is the remainder when 23861641 is divided by 18077? 1 Calculate the remainder when 1138305 is divided by 398. 25 What is the remainder when 3903872 is divided by 1001? 973 What is the remainder when 14242 is divided by 11420? 2822 Calculate the remainder when 8220 is divided by 1438. 1030 What is the remainder when 1276526 is divided by 89? 88 What is the remainder when 810266 is divided by 9? 5 Calculate the remainder when 215808 is divided by 107888. 32 What is the remainder when 310888 is divided by 62140? 188 Calculate the remainder when 41861 is divided by 6751. 1355 What is the remainder when 2350873 is divided by 1401? 1396 Calculate the remainder when 10804328 is divided by 240096. 8 Calculate the remainder when 39839671 is divided by 95. 91 Calculate the remainder when 21628 is divided by 3521. 502 Calculate the remainder when 265638 is divided by 12404. 5154 What is the remainder when 124689 is divided by 166? 23 Calculate the remainder when 342686 is divided by 114142. 260 Calculate the remainder when 1475855 is divided by 1475829. 26 Calculate the remainder when 2244668 is divided by 290. 68 What is the remainder when 29107 is divided by 1058? 541 What is the remainder when 5900504 is divided by 3475? 3429 What is the remainder when 146300 is divided by 72933? 434 What is the remainder when 2182765 is divided by 727581? 22 Calculate the remainder when 29825181 is divided by 7. 1 Calculate the remainder when 66187 is divided by 416. 43 Calculate the remainder when 34302166 is divided by 60. 46 Calculate the remainder when 404146 is	{ "pile_set_name": "DM Mathematics" }
rrange 6f2 + 5f*3 + 3f*4 - 2f*2 - 10f*3 - 21f + 48f - 25f to the form jf3 + w + rf + pf2 + gf*4 and give r. 2 Express -10563z + 4804z + 3136z + 8114z in the form q + fz and give f. 5491 Express 439j3 - 2 + 3j*4 - 440j*3 - 1091j*2 + 403j*2 in the form cj*4 + g + xj*3 + kj + uj2 and give u. -688 Express (-18 + 18 - 71w)((3w + w - 2w)(-5w + 4w + 3w) - 8w2 + w2 - 2w2 - 2w*2 + 0 + 0) as uw*2 + pw*3 + a + qw and give p. 497 Express (90h2 - 9h*2 - 3h*2)(-3 - 9 + 3)(-15h + 21h + 1 + 16h*2 - 8h) as ch + jh*2 + zh*3 + g + vh*4 and give z. 1404 Rearrange -2a*3 + 1228a*2 - 6a*3 - 1193a*2 + 4 + 0 to ta*3 + u + ca*2 + va and give c. 35 Rearrange (-30010 + 2364a + 30010 + (1 + 0 + 1)(a + 0a - 2a))(-2 + 2 - 1) to the form ya + t and give t. 0 Express -117n - 54n + 5n3 + 144n in the form w + zn3 + yn*2 + mn and give m. -27 Rearrange -4i - i + 4i + (-71 - 1826 + 434)(3i - 5i - i) to the form li + y and give y. 0 Rearrange (-4 - 3 + 5)(48o - 6o - 713130o*3 + 712341o*3) to the form d + mo*3 + bo + so2 and give b. -84 Express -146t - 87 + 42 - 678t + 42 as q + pt and give p. -824 Express -22t2 + 14 - 28 + 72t*4 + 36t*2 + 2t*3 + 12 - 25t*2 as mt*2 + kt + zt3 + ot*4 + b and give z. 2 Rearrange (5a*3 - 2a*2 + 2a*2)(-2 + 1 + 4 + (1 + 2 + 0)(-4 - 1 + 3))(5a + a + 0a) to the form z + sa2 + pa*3 + ya*4 + ta and give y. -90 Rearrange 11 - 59p2 + 15 - 3p - 9 to cp2 + op + x and give x. 17 Express -976 + 5r2 + r3 - 3r*3 + 488 - 13r*4 + 484 in the form mr*4 + gr*3 + b + hr + pr2 and give g. -2 Rearrange 105q + 17q - 5q*2 - 124q + 1510 - 111 to v + bq + nq*2 and give v. 1399 Express (5 + 1 - 3)(-12n - 9n + 6n)(3 - 5 + 0) + 36n + 13n - 15n in the form b + fn and give f. 124 Rearrange -784u - 11 - 768u + 2355u - 779u to the form k + au and give a. 24 Express 4c*3 - 234 + 7c*3 + 236 + 12c*2 - 6c*2 as jc + tc2 + xc*3 + y and give x. 11 Rearrange -309 + 86 + 83 + 98 - 42x + 55 to s + dx and give d. -42 Rearrange -44 - 307a + 154a + 156a + (-2a + 0a - a)(1 - 3 + 5) + 2a + 7a - 3a + (-2a - 1 + 1)(-1 - 3 + 2) to the form q + ya and give y. 4 Rearrange (1987 - 5429 - 3658 - 1565)(12c3 + 3c*3 - 4c*3) to gc + f + ic2 + vc*3 and give g. 0 Express -630l + 2708l + 4546 + 874l - 4546 as c + jl and give j. 2952 Rearrange 11o*3 - o + 4o + 29o + 8o to co + ao*2 + wo*3 + l and give w. 11 Rearrange (7 - 4 - 1)(-2830 + 2830 - 3381j) to b + uj and give u. -6762 Rearrange (-13r3 + 6r*2 + 13r*2 + 15r*3)(-10r + 4r - 4r) to ir*2 + kr*3 + c + vr*4 + zr and give v. -20 Express 553o - 9 + 21 - 7 - 11 in the form c + no and give c. -6 Express -9z2 + 14 + 24z + z*4 - 25z + 12z3 + z4 - 12 as tz*4 + c + bz*3 + iz*2 + xz and give c. 2 Express -2k + 0 - 2 - 2 + 5868k*2 - 5871k*2 in the form v + uk*2 + lk and give l. -2 Rearrange (d + 2d4 - 2d4 - 2 - d4)(-15615 + 9832 - 335 - 40782) to i + fd*3 + kd*2 + yd*4 + jd and give j. -46900 Express -3m - 3m - 117 + 3m + 30 in the form jm + d and give j. -3 Rearrange 33695 - 16848 - 16847 + 714u to h + pu and give p. 714 Express -85315515 + 105w2 + 85315515 - 27w as vw + b + fw*2 and give v. -27 Express ((3n + n - 6n)(5 - 5 - 1) + (4n - 2n - 7n)(0 - 7 + 20))(4n*2 + 5 - 4n*2 - 3n*2) in the form o + tn*2 + fn*3 + xn and give x. -315 Express -376y2 - 99y*3 + 0y*4 - 926y2 + y4 + 93y3 in the form hy*4 + ay + py2 + x + fy*3 and give f. -6 Rearrange -192b*2 + 11 - 145b*3 + 147b*3 + 106b*2 - 101b*2 to lb*3 + xb + db2 + f and give f. 11 Express 1565s*3 - 3s - 3123s3 + s2 - 79 - 2s*2 + 19 + 1556s*3 in the form ks + us3 + zs*2 + j and give k. -3 Express 0b3 + b3 - 2b + 115 + 4b*2 + 0b - 151b4 - 113 in the form z + yb*2 + kb + hb3 + nb*4 and give n. -151 Express -m + 4m - 6m + (m - m + m)(1084 - 630 + 1384) as om + w and give o. 1835 Rearrange (-13t - 34t - 30t)(2 - 3 - 3)(2 - 6 + 5) to k + jt and give j. 308 Express 9011w + 1892w - 4776w + 12314w + 9848w in the form t + nw and give n. 28289 Rearrange (27i - 154i - 472i)(-4 + 0 + 3 + (1 - 2 + 0)(4 + 0 - 5) + (0 + 3 - 1)(-5 + 3 + 1) - 3 + 1 + 3) to the form b + ci and give c. 599 Rearrange -250d2 - 3d*3 + 0d*3 - 248d*2 + 6 + 750d*2 - 3d - 254d2 to the form r + kd*2 + sd*3 + wd and give w. -3 Express -4 + 4 - 2 + 2o2 + (277o + 758o + 269o)(4o - 2o - 6o) in the form yo + l + to*2 and give t. -5214 Express (-2 - 1 + 2)(0x - 2x + x) + (0 + 3 - 5)(43x + 98 - 98) - 3x - 1 + 1 as wx + f and give w. -88 Express -4s3 + 8s3 - s3 - 8s4 - 138s*2 - 5s*3 + 5s*4 as hs*3 + xs*4 + js + qs2 + o and give h. -2 Rearrange -17 + 3 + 4 + 3 + 6 - 1083o*2 to s + to + po2 and give s. -1 Rearrange (1 - 3 + 3)(1005 - 998 - 1526 - 1114)((2 + 3 - 2)(2 + 2g - 2) + 18 - 7g - 18) to q + fg and give f. 2633 Rearrange (1209w*3 - 1973w*3 - 254w*3 - 3097w*3)(w + 9w - w) to nw*2 + zw*3 + gw + y + sw4 and give s. -37035 Express -19p - 2p2 - 48p + 3p2 + 2367 - 2345 - 2p*2 as op + lp2 + s and give s. 22 Express 1767 - 1764 - 213p*2 - 47p*3 + 45p*3 - 4p in the form i + zp2 + qp*3 + up and give u. -4 Rearrange -2w3 + 3w*2 - 25391w + 2 - 4w4 + 332w*4 + 25391w to cw + dw*3 + v + tw*4 + hw*2 and give h. 3 Rearrange 6 + 5 + 38 + 366q*2 - 48 to xq*2 + vq + b and give b. 1 Rearrange (-5p + 2p - p)(2 + 0 - 5 - 1 + 0 + 0 + 1 + 1 + 5 + (1 + 1 + 1)(2 + 2 + 2)) to b + dp and give d. -84 Rearrange (24 - 2 + 6)(136w + 1658w + 139w) to hw + s and give h. 54124 Rearrange (2 - 4 + 1)(-27349k*2 - 27324k*2 + 54641k*2 - 4k*3 - k + 3) to vk*2 + fk + o + tk3 and give t. 4 Express 271f - f*4 + 190f*2 - 188f*2 + 9 - 270f + 9f3 in the form qf*4 + sf + gf2 + d + cf*3 and give d. 9 Express (-154 + 69 - 348)(-36 + y*3 + 64 - 2y - 40 - 2y2) as fy*2 + jy*3 + iy + s and give f. 866 Rearrange 21 + 1103c + 0c*2 - 28c*3 + 18c*3 - 1103c - 2c2 to the form z + uc + sc2 + tc*3 and give t. -10 Express 27r*2 - 3 - 3r*4 - 2 + 104r*3 - 22r*2 - 6r*2 as or + cr4 + kr*3 + q + ur2 and give q. -5 Express (h2 - h + 5 - 4 - 4 + (0 + 0 - 2h)(8h + 9h - 3h))(13h2 - 25h*2 + 45h + 11h2) in the form ah*4 + vh + z + bh2 + wh*3 and give b. -42 Express 17 - 41930p*3 - 2p + 24p2 + 41934p*3 - 13p*2 in the form gp + n + up3 + tp*2 and give n. 17 Rearrange (4 - 2 - 4 + (-14 + 102 + 10)(6 - 3 - 1) - 3 - 3 - 1)(-2i + 0i + 0i) to di + p and give d. -374 Rearrange 136 + 8o*3 - 2o*3 - 21o*3 - 135 - 285o*4 to the form jo + ko4 + m + io*2 + ro*3 and give r. -15 Express (-11568i - 65 - 26 - 25 + 116)(-4i*2 + 2i*2 - 2i*2) as k + si*3 + fi + li2 and give s. 46272 Express -1365 + 685 + 681 + 185v + 48v + 2v*2 in the form z + lv*2 + iv and give i. 233 Express -4d3 + 511d*4 + 2d*2 + 2 + 4d*3 - 41d*4 - d as pd*2 + jd + sd3 + od*4 + t and give p. 2 Rearrange (2 - 1 + 0)(0q + 130117646q*3 - 130109125q*3 + 0q) to the form fq3 + m + nq*2 + sq and give f. 8521 Express (4 + 5 - 1)(-3 + 4 + 0)(0 - 6 + 2)(-2g + 0g - 2g)(3 + 0 + 1) as ug + j and give j. 0 Express 3027l2 + 2l - 2423l2 - 6l + 2l in the form pl + dl2 + b and give b. 0 Express (10068b - 5662b - 5272b)(-1 - 3 + 2)(-3 + 4 - 2) - 5b - 14 + 14 in the form r + ab and give r. 0 Rearrange -q2 - q2 + 1 - 2 + (13 + 5q - 13)(2 - q - 2) - 12q2 - 12q*2 - 6q*2 to the form kq*2 + iq + p and give k. -37 Rearrange 11b2 + b3 + 11b + 64 + 0b3 - 3b*3 - 3b*4 - 62 + 2b*4 to the form tb*2 + fb + zb4 + mb*3 + k and give k. 2 Express 2 - 38b*2 + 12b*2 - 693b - 735b + 1452b in the form vb2 + o + nb and give o. 2 Rearrange ((347 + 111 + 904)(5s - s - 2s) - 5 + 5 + 2s)(5s + 0s - 3s) to as2 + ks + p and give a	{ "pile_set_name": "DM Mathematics" }
03 AM? 7:22 AM How many minutes are there between 5:33 PM and 4:19 AM? 646 How many minutes are there between 9:41 AM and 10:25 AM? 44 What is 176 minutes after 11:43 AM? 2:39 PM What is 532 minutes before 4:10 PM? 7:18 AM What is 135 minutes before 6:36 AM? 4:21 AM What is 702 minutes after 8:50 AM? 8:32 PM How many minutes are there between 12:44 PM and 11:48 PM? 664 How many minutes are there between 2:29 AM and 3:46 AM? 77 What is 678 minutes after 4:03 PM? 3:21 AM What is 655 minutes after 9:43 AM? 8:38 PM How many minutes are there between 9:52 PM and 4:40 AM? 408 What is 254 minutes before 3:54 AM? 11:40 PM What is 691 minutes before 8:50 PM? 9:19 AM What is 583 minutes before 9:36 PM? 11:53 AM How many minutes are there between 2:14 AM and 1:17 PM? 663 What is 62 minutes before 8:16 PM? 7:14 PM How many minutes are there between 4:21 AM and 12:09 PM? 468 What is 76 minutes after 4:06 PM? 5:22 PM What is 485 minutes before 9:46 AM? 1:41 AM What is 418 minutes before 12:53 AM? 5:55 PM What is 332 minutes before 4:33 AM? 11:01 PM What is 677 minutes after 11:46 PM? 11:03 AM How many minutes are there between 4:54 PM and 2:42 AM? 588 How many minutes are there between 2:15 PM and 11:28 PM? 553 How many minutes are there between 11:58 AM and 11:37 PM? 699 How many minutes are there between 11:29 AM and 8:14 PM? 525 How many minutes are there between 2:42 PM and 2:21 AM? 699 How many minutes are there between 4:20 PM and 6:20 PM? 120 How many minutes are there between 11:37 PM and 6:05 AM? 388 What is 467 minutes after 2:04 PM? 9:51 PM What is 609 minutes before 8:24 AM? 10:15 PM How many minutes are there between 12:26 PM and 6:10 PM? 344 How many minutes are there between 10:55 AM and 11:58 AM? 63 How many minutes are there between 8:19 AM and 10:51 AM? 152 How many minutes are there between 3:24 PM and 7:19 PM? 235 How many minutes are there between 4:39 AM and 11:37 AM? 418 What is 652 minutes after 8:06 PM? 6:58 AM What is 128 minutes before 5:13 PM? 3:05 PM What is 309 minutes before 2:13 PM? 9:04 AM What is 97 minutes after 5:22 PM? 6:59 PM How many minutes are there between 5:04 PM and 1:52 AM? 528 How many minutes are there between 12:55 PM and 9:53 PM? 538 How many minutes are there between 10:36 PM and 3:22 AM? 286 What is 546 minutes after 2:35 PM? 11:41 PM What is 296 minutes before 5:17 PM? 12:21 PM How many minutes are there between 5:47 PM and 5:16 AM? 689 How many minutes are there between 5:33 PM and 3:22 AM? 589 What is 432 minutes before 10:25 PM? 3:13 PM What is 636 minutes after 11:55 PM? 10:31 AM How many minutes are there between 1:45 AM and 3:26 AM? 101 How many minutes are there between 7:23 PM and 11:34 PM? 251 What is 36 minutes after 6:56 AM? 7:32 AM How many minutes are there between 3:34 PM and 7:11 PM? 217 What is 688 minutes before 12:19 AM? 12:51 PM What is 667 minutes after 8:15 AM? 7:22 PM How many minutes are there between 5:12 PM and 5:54 PM? 42 What is 181 minutes after 11:49 PM? 2:50 AM How many minutes are there between 8:37 PM and 2:02 AM? 325 What is 130 minutes after 3:46 PM? 5:56 PM How many minutes are there between 12:54 AM and 1:54 AM? 60 How many minutes are there between 6:04 PM and 8:04 PM? 120 How many minutes are there between 3:46 AM and 8:10 AM? 264 How many minutes are there between 3:39 PM and 11:27 PM? 468 What is 237 minutes after 8:42 PM? 12:39 AM How many minutes are there between 8:32 PM and 11:00 PM? 148 How many minutes are there between 3:11 PM and 3:46 PM? 35 How many minutes are there between 1:05 AM and 3:26 AM? 141 How many minutes are there between 8:48 PM and 7:50 AM? 662 What is 41 minutes after 3:33 PM? 4:14 PM What is 217 minutes after 10:31 AM? 2:08 PM How many minutes are there between 2:39 AM and 1:48 PM? 669 How many minutes are there between 4:23 PM and 8:21 PM? 238 How many minutes are there between 9:08 AM and 1:47 PM? 279 How many minutes are there between 4:12 PM and 9:17 PM? 305 How many minutes are there between 11:51 AM and 1:28 PM? 97 What is 107 minutes before 1:55 AM? 12:08 AM What is 419 minutes after 12:16 PM? 7:15 PM What is 172 minutes before 12:57 AM? 10:05 PM What is 283 minutes after 2:15 PM? 6:58 PM How many minutes are there between 10:33 AM and 12:57 PM? 144 What is 418 minutes after 10:41 AM? 5:39 PM What is 38 minutes after 6:59 AM? 7:37 AM What is 313 minutes after 10:41 PM? 3:54 AM What is 52 minutes after 11:58 AM? 12:50 PM How many minutes are there between 4:55 AM and 2:51 PM? 596 What is 599 minutes before 6:38 PM? 8:39 AM What is 318 minutes after 9:35 AM? 2:53 PM What is 458 minutes before 6:57 PM? 11:19 AM How many minutes are there between 11:42 AM and 9:53 PM? 611 What is 167 minutes before 4:50 PM? 2:03 PM What is 111 minutes after 11:28 AM? 1:19 PM How many minutes are there between 7:55 PM and 12:15 AM? 260 What is 517 minutes before 11:28 AM? 2:51 AM What is 144 minutes after 12:34 PM? 2:58 PM How many minutes are there between 8:39 AM and 6:26 PM? 587 What is 148 minutes after 3:12 PM? 5:40 PM How many minutes are there between 5:42 AM and 9:55 AM? 253 How many minutes are there between 4:57 AM and 4:30 PM? 693 What is 582 minutes after 10:29 AM? 8:11 PM How many minutes are there between 5:07 PM and 9:58 PM? 291 What is 588 minutes after 9:37 AM? 7:25 PM What is 322 minutes after 12:18 AM? 5:40 AM What is 408 minutes before 8:22 AM? 1:34 AM What is 472 minutes after 9:57 PM? 5:49 AM How many minutes are there between 7:23 AM and 8:51 AM? 88 What is 2 minutes after 12:58 PM? 1:00 PM What is 703 minutes before 7:47 PM? 8:04 AM What is 296 minutes after 9:20 PM? 2:16 AM What is 454 minutes before 11:23 PM? 3:49 PM How many minutes are there between 9:09 AM and 12:14 PM? 185 What is 101 minutes before 2:57 AM? 1:16 AM What is 589 minutes before 7:23 AM? 9:34 PM How many minutes are there between 2:03 PM and 9:50 PM? 467 What is 185 minutes after 3:26 AM? 6:31 AM What is 235 minutes after 3:40 AM? 7:35 AM What is 51 minutes after 9:35 PM? 10:26 PM What is 421 minutes after 5:17 AM? 12:18 PM What is 51 minutes before 10:17 PM? 9:26 PM How many minutes are there between 12:42 PM and 9:40 PM? 538 What is 605 minutes before 5:05 AM? 7:00 PM How many minutes are there between 12:23 PM and 4:14 PM? 231 How many minutes are there between 6:41 AM and 8:41 AM? 120 What is 202 minutes after 4:58 PM? 8:20 PM What is 620 minutes after 2:49 PM? 1:09 AM How many minutes are there between 11:33 PM and 12:40 AM? 67 How many minutes are there between 8:55 AM and 12:50 PM? 235 How many minutes are there between 2:29 PM and 7:39 PM? 310 What is 238 minutes after 1:24 AM? 5:22 AM How many minutes are there between 7:33 AM and 3:09 PM? 456 How many minutes are there between 12:43 PM and 7:46 PM? 423 What is 305 minutes after 11:05 AM? 4:10 PM How many minutes are there between 3:32 PM and 5:33 PM? 121 What is 576 minutes before 4:05 PM? 6:29 AM How many minutes are there between 4:45 AM and 12:23 PM? 458 How many minutes are there between 11:32 PM and 10:24 AM? 652 What is 625 minutes before 2:38 AM? 4:13 PM What is 207 minutes before 12:51 PM? 9:24 AM How many minutes are there between 8:24 PM and 10:32 PM? 128 What is 466 minutes before 9:24 AM? 1:38 AM How many minutes are there between 2:34 AM and 3:12 AM? 38 How many minutes are there between 9:37 PM and 4:23 AM? 406 How many minutes are there between 11:45 AM and 10:45 PM? 660 How many minutes are there between 2:27 AM and 1:57 PM? 690 How many minutes are there between 3:47 AM and 11:10 AM? 443 How many minutes are there between 1:37 AM and 2:54 AM? 77 How many minutes are there between 8:15 PM and 8:01 AM? 706 What is 496 minutes after 6:37 AM? 2:53 PM What is 54 minutes after 5:29 AM? 6:23 AM How many minutes are there between 8:00 AM and 2:31 PM? 391 How many minutes are there between 1:58 AM and 4:51 AM? 173 What is 38 minutes after 6:25 PM? 7:03 PM What is 41 minutes after 6:42 AM? 7:23 AM How many minutes are there between 3:04 AM and 7:59 AM? 295 What is 597 minutes after 7:35 AM? 5:32 PM What is 400 minutes before 8:15 PM? 1:35 PM How many minutes are there between 1:02 AM and 12:22 PM? 680 How many minutes are there between 4:48 PM and 5:59 PM? 71 What is 402 minutes before 7:47 P	{ "pile_set_name": "DM Mathematics" }
se 5p - s = p. Calculate the smallest common multiple of p and 14. 154 Let q = -3 + 8. What is the smallest common multiple of q and 9? 45 Let j = 152 - 119. Calculate the lowest common multiple of 33 and j. 33 Let b = 27/73829 - -1972784493/590632. Let a = b + -3345. Find the common denominator of -69/4 and a. 8 Let o = 2/33899 + 3288131/1220364. What is the common denominator of -65/4 and o? 36 Let o = 2/825 - -2839/1100. Let n be (197674/(-8))/(-1 + -3). Let k = n - 6171. What is the common denominator of k and o? 48 Let m(t) = t + 19. Calculate the lowest common multiple of m(-3) and 12. 48 Let t = 8537/5 - 1700. Calculate the common denominator of 22 and t. 5 Let s(d) = -d2 - 2d - 5. Let h be s(6). What is the common denominator of -25/6 and 6/10h/12? 60 Suppose 5m = -k + 135, 5m - 95 = 3k - 400. Suppose -2g - 4h = k - 398, 4g = -h + 548. Let j = g + -2149/16. Find the common denominator of -95/12 and j. 48 Suppose -2f = -6f + 56. Let o(r) = 15 - 13 + 17r*2 + 8 + 0r3 - r3. Calculate the smallest common multiple of o(17) and f. 70 Let x = -2 - -5. Find the common denominator of 273/(-9)x/(-22) and 85/4. 44 Let j = 13 + 23. Find the common denominator of (154/(-6))/((-120)/36) and -1 + -1(-393)/j. 60 Let z(a) = -a*2 + 9a - 16. What is the smallest common multiple of z(4) and 12? 12 Let w be 81 - (2 - 3). Let f be (w/9)/(1/(-3)). Calculate the common denominator of -73/3 and 6/f - (-34)/14. 21 Let a = 63413/10 + -6336. Let w = -10/3 - -37/12. Calculate the common denominator of w and a. 20 Suppose 50 = x + 4x. Let b = 1 - -3. What is the lowest common multiple of x and b? 20 Let l = -47429/10 - -4747. What is the common denominator of l and 64/3? 30 Let t(s) = -5s + s - 4 + 3s. Let j be t(-2). Calculate the smallest common multiple of 9 and (5 - j/2) + -2. 36 Suppose 0 = m + 6. Let b be (-122)/m - 4/(-6). Suppose 0 = -3g - 12, -j + 2g = -3g - b. Calculate the smallest common multiple of j and 4. 4 Let c(m) = 3m*2 - 3m + 3. Calculate the least common multiple of 11 and c(2). 99 Let t = -1/454 - -18843/908. What is the common denominator of 102/905 + 2/2 and t? 12 Let b(f) = f3 - 3f*2 - 3f + 2. Let w(v) = v - 1. Calculate the lowest common multiple of b(4) and w(13). 12 Let x = 20 - 18. Calculate the lowest common multiple of x and 14. 14 What is the lowest common multiple of 1(-1 - (1 + -7)) and 2? 10 Suppose -2b = -2f - 20, 5b - b - 36 = 2f. Suppose bh = 3h + 10. What is the smallest common multiple of 12 and (-3 + h)-12 - 0? 12 What is the lowest common multiple of (-1)/(-1) - 7/(21/(-69)) and 33? 264 What is the common denominator of (-142)/(-4)5/10 and -31? 4 Let k = -37 + 22. What is the common denominator of ((-151)/(-2))/(k/5) and -37/16? 48 Let q(r) = -r3 + 5r*2 - r - 4. Let a be q(4). Suppose 3h - 8 = -2f, 3h + a - 19 = -5f. What is the lowest common multiple of h and 4? 4 Let n = 1921/6 - 312. Let w = -2537/130 - -307/13. Calculate the common denominator of w and n. 30 Let z = -2006 + 7953/4. Let a = -22007/18 + 1228. What is the common denominator of z and a? 36 Let w = 5/249 - -9661/2490. Let h be (3 + (-78)/10)-65. Find the common denominator of h/(-18) - (3 - 2) and w. 30 Calculate the common denominator of (-1)/8-2 - 18 and (-657)/(-180) + (-1)/((-10)/6). 4 Let j = 75 - 11. Calculate the common denominator of -2 - (4/j + -1) and -61/14. 112 Let u = 7 - -3. Suppose 3q - u + 4 = 0. What is the lowest common multiple of 7 and q? 14 Suppose 4o = o + 27. Let g(i) = -i2 + 8i + 12. Let d be g(o). Suppose r + dh - 9 = -0r, -5r - 5h = -35. Find the common denominator of r and 39/5. 5 What is the common denominator of 51/14 and 63/(-120)(-24)/(-4)? 140 Let t = -11 - -9. Let o be (t + 2-8)1. Find the common denominator of (-146)/(-24) + o/(-24) and -125/6. 6 Let x be (9/21)/((-1)/(-7)). Suppose -xb = -b - 36. Calculate the smallest common multiple of b and 16. 144 What is the lowest common multiple of 22 and (-111)/(-8) + 7/56? 154 Let u = 4 - 0. Suppose us = 2 + 6. Calculate the smallest common multiple of s and (4/6)/23. 2 Let w(v) = -7v - 15. Calculate the least common multiple of w(-6) and 33. 297 Let f(u) = 2u*2 - 2u + 2. Let l be f(2). Calculate the common denominator of -91/10 and l/27 + 143/18. 30 What is the common denominator of ((-2)/(-70))/(8/(-20)) and -83/2? 14 Let q = 11/145 + -5119/580. What is the common denominator of 1/20 and q? 20 Let u(b) = -b*2 + 9b + 5. Calculate the common denominator of 11/8 and u(11). 8 Let w = -1343/2 + 624. Let m = 349/7 - 271/14. Calculate the common denominator of w and m. 2 Let b = 0 - -3. Let n be 141b/91. Calculate the least common multiple of 10 and n/5 - 6/(-10). 10 Let s(n) = 0 + 1 + 1 + 5n - n. Suppose 0 = 2z + 4a + 6 + 10, 0 = -2z - 5a - 21. What is the least common multiple of s(z) and 16? 80 Let r = -7 - -5. Find the common denominator of 99/8 and (-3 - -2)r/14. 56 Let q(c) = -c*2 - 23c + 2. Calculate the least common multiple of 24 and q(-21). 264 Suppose 0 = d - 6d - 4m + 36, 5m - 40 = -5d. What is the common denominator of 0 + 1 - (-126)/d and 0 + (-128)/6 + -8 + 5? 6 Let n = -373/92 - 25/69. Find the common denominator of 22/9 and n. 36 Calculate the common denominator of 19/2 and 159/27(-2 + 0 - -1). 18 Calculate the common denominator of ((-2)/12)/((-2)/(-212)) and (-294)/483/3. 24 Suppose 73 + 26 = 3t. Calculate the lowest common multiple of t and 15. 165 Let f = -397 + -21790. Let p be 799013/(-108)10. Let x = f - p. What is the common denominator of x and 11/8? 72 Let p = -18696863/24 - -778918. Let f = -95441/120 + p. Let c = -923 - f. What is the common denominator of c and -3/2? 10 Let n = -3887 + 31157/8. Find the common denominator of -45/4 and n. 8 Let s = -72 - -87. Calculate the smallest common multiple of 21 and s. 105 Let k = 3814 - 23009/6. Calculate the common denominator of k and (-178)/40 - 23/6. 60 Let g(f) = f*2 - 2. Let j be (-3 - 0) + 5 + -2. Suppose 2u - 3u + 11 = j. Calculate the least common multiple of g(-2) and u. 22 Let c = -26431/8 - -3298. Let r = -207/5 + -21/10. Calculate the common denominator of r and c. 8 Let a = -7 - -12. Suppose 0 = -2z + 73 + a. Find the common denominator of -41/2 and z. 2 Suppose -81 = -5u + 19. Suppose -1 - 11 = 2k. Calculate the lowest common multiple of u and (20/3)/((-2)/k). 20 Suppose 5 = -3p + 5s - s, -2p + 3s - 3 = 0. Suppose -6 = -d - 0. What is the least common multiple of 4/(-2)p/d and 1? 1 Let j(o) = -8o - 27. Calculate the smallest common multiple of j(-9) and 10. 90 Let u = 1473 + -5947/4. Let l = 2/7571 + 355813/90852. What is the common denominator of l and u? 12 Let v = -1 + 6. What is the smallest common multiple of 7 and v? 35 Suppose -2y = b + 2b - 12, 2y - 10 = -2b. What is the smallest common multiple of 28 and y? 84 Suppose -h - 10 = -6h. Let n = h - -1. Suppose -q - 5l - 11 = n, l = q - 10. What is the least common multiple of q and 16? 48 Find the common denominator of -107/20 and (5/9)/(32/(-48)). 60 Suppose -2 = a + 4b + 2, -b + 41 = -5a. Let p = -4 - a. Calculate the least common multiple of p and 18. 36 Let v = 14/43 + 875/86. What is the common denominator of v and 0 - (-339)/18 - 1? 6 Suppose 11 = -5a - 19. Let s(k) = -5k. Calculate the lowest common multiple of s(-4) and 2/6 + (-10)/a. 20 What is the lowest common multiple of 20 and (-36)/(-10) - (-14)/35? 20 Suppose -3n + 1 = -80. Let g be 66/n(-53)/(-30). Let h = 40/27 + g. Calculate the common denominator of 7/12 and h. 60 Let w be 3(1 - -1)/(-6). Let l = 0 - w. Suppose 3p + 2k - 11 = 0, 2k - 5 = 33p - 34p. Calculate the least common multiple of l and p. 3 What is the lowest common multiple of ((-27)/12)/(6/(-16)) and 8? 24 Find the common denominator of 38/5 + (-5)/(-25) and -17/2. 10 Let p(m) = m*2 + 9m + 16. Calculate the least common multiple of 16 and p(-8). 16 What is the common denominator of ((-490)/(-56))/(0 - 33/4) and -107/12? 132 Let t = -4153/6003 + -1/261. What is the common denominator of t and 49/11? 253 Let h = -1045/14 + 73. Calculate the common denominator of h and 73/3. 42 Let i be 1 + -1 + (-4)/(-2). Suppose 0j = -ij + 20. What is the smallest common multiple of j and 1? 10 Let a b	{ "pile_set_name": "DM Mathematics" }
et o = n + -43. Does 17 divide 951/o + (-2)/9? False Let w be 4/6 + 176/(-12) + 0. Does 14 divide (-15 - -9)/(2/w)? True Let h(r) = 4r + 24. Let z be h(-5). Does 36 divide ((-126)/(-8))/(z12/128)? False Suppose -a - 5x - 20 = -4a, -4 = -5a + x. Suppose -2j + 13 - 3 = a, p + 4j = 23. Suppose b - 2m - 36 = 0, pm = 3b + 30 - 129. Is 10 a factor of b? True Suppose 2n - 678 = -2a, -3a = -2a - 3. Is n a multiple of 12? True Let y = -75 - -135. Let g be 221y/(-70). Is (-567)/g + 1/4 a multiple of 13? False Let d(f) = f*2 - 2f + 12. Let y(b) = b*2 - 11b + 8. Let o be y(12). Let n be (45/o)/(6/16). Is 5 a factor of d(n)? False Let r = -634 - -950. Does 79 divide r? True Let i(s) = -s*2 - 21s - 15. Is 7 a factor of i(-11)? False Let x(w) = 16w + 18. Let i be -6(-1 + (-7)/(-6) + -1). Does 14 divide x(i)? True Let f(q) = 4q + 37. Let t be f(-10). Let o(w) = -15w + 11. Is 28 a factor of o(t)? True Suppose -2d = -k + 296, 168k - 167k - 3d - 291 = 0. Is k a multiple of 102? True Suppose -7w - 2z + 58 = -6w, -3z + 255 = 5w. Let f be (45/12)/((-6)/w). Let m = f + 86. Does 25 divide m? False Suppose -5z = z - 6. Does 37 divide z143 - (4 - 2)? False Let z be (-506)/6 + (-2)/3 + 0. Let t(j) = -8j*2 - 2j + 1. Let m be t(1). Let a = m - z. Is 23 a factor of a? False Let s be (-4)/(-8)4 - 6/(-2). Suppose r - 293 = -d, 0d = d - sr - 317. Does 33 divide d? True Let v = 10 + -84. Let x = 112 + v. Is 28 a factor of x? False Suppose 5v - 893 = 4n, 2n - 5n + 525 = 3v. Suppose -2c + v = -2m + 5m, -5m + 3c + 276 = 0. Does 19 divide m? True Let x be (0/(-1))/(6/(-3)). Suppose b - h - 8 = 0, 4h + xh = 3b - 22. Does 6 divide b? False Let p = -123 - -396. Is p a multiple of 39? True Let g(s) = -s - 1. Let i be g(3). Let l = -13 + i. Let h = l + 28. Does 5 divide h? False Suppose 134 = 3d + 4u, -5d + 110 = 4u - 108. Let q = d + -30. Is q a multiple of 6? True Suppose -36 = 4t - s - 3, 5t - s = -42. Let z be t1/(3/(-2)). Is 26 a factor of z/39 - (-1103)/13? False Is 34 a factor of 5709/4 + 610/80? True Let x = 801 + -596. Does 18 divide x? False Is 9 a factor of 0 + 596/14 + (-234)/(-546)? False Let z = 147 + -145. Does 8 divide (z/(28/(-21)))/((-3)/26)? False Suppose c - 5k = 43, -3c - 3k + 39 = -0k. Let s(d) = 3d2 + 12d - 4. Let n be s(-6). Suppose c = h - n. Does 25 divide h? True Let b = 8 - 6. Suppose -bl = -4l + 98. Is 21 a factor of l? False Let x(t) = 2t3 + 2t*2 - t + 8. Let y(i) = -3i*3 - 3i*2 + 2i - 8. Let j(z) = 4x(z) + 3y(z). Does 44 divide j(-6)? True Suppose 4c - 20 = -0c. Suppose 0 = -5o + l + 159, -co - 4l = -165 + 26. Does 24 divide (o/(-4))/(10/(-80))? False Let k(q) = -2q*3 - 5q2 + 3. Let y be k(4). Let s = y + -515. Is 15 a factor of s/(-21) + 4/(-14)? False Let o(w) = w3 + 30w2 - 51w - 24. Is 40 a factor of o(-31)? False Suppose -5f + 4g + 323 = 81, 0 = -f - 4g + 58. Is 10 a factor of f? True Suppose -9u = -506 + 101. Does 5 divide u? True Suppose 28348 = 11t + 27t. Is 18 a factor of t? False Let f(k) = 5k + 2. Let j be f(-1). Let i be 8/j(-189)/36. Suppose -im + 260 = -9m. Does 13 divide m? True Let y be (-4 - (-32)/4) + -11. Let l(q) = -q*3 - 4q*2 + 8q - 4. Let p be l(y). Let i = p + -7. Does 12 divide i? False Is (21 + -16 + 1 + -4)550 a multiple of 11? True Let u = 623 + -29. Is u a multiple of 22? True Suppose 2h = -0h + 496. Suppose 2m + 88 = -h. Is 2/(-4) - m/16 a multiple of 4? False Let v = 1457 + 271. Does 6 divide v? True Suppose -3a = -3n + 18, 3a + 36 = 8n - 11n. Suppose -4o + c = -27, -5c - 9 = -2o + 18. Is o(2 + a/6) a multiple of 3? True Suppose 15 = t + 3g, 0t - 4g + 24 = 2t. Suppose 4q - 2j + t = 4, 8 = -q + 2j. Is 20 a factor of 2 + (40 - q) - 0? True Let h(w) = w*2 - w - 81. Let i be h(0). Let c = -29 - i. Is 10 a factor of c? False Suppose 12z - 16 = 16z. Let j be (z/(-8))/((-1)/24). Is 6 a factor of 0 + 0/4 - j? True Suppose 30q - 2458 = 842. Is 22 a factor of q? True Suppose -4352 = -11p - 6p. Is 31 a factor of p? False Is 3 a factor of (-2)/(4 - 1/(116/472))? False Suppose m + 3h - 243 = -87, m - 2h - 171 = 0. Suppose -5l = -5, 4l = -5q - l + m. Is (q/6)/((-3)/(-9)) a multiple of 13? False Suppose -606 - 42 = -3m. Let w = m + -125. Is w a multiple of 13? True Suppose -75 = -18d + 69. Suppose -2n - d = -2g, -4g - n + 25 = 9. Does 4 divide g? True Suppose -4j = -540 - 6972. Is 9 a factor of j? False Let u(p) = -p2 + p + 1 + 14p*2 - 2p*2. Let m be (-6)/12 - 9/(-6). Is u(m) a multiple of 13? True Let j be 3/(-18) + (-207)/54. Let n = 0 - j. Let r = 8 + n. Is r a multiple of 12? True Suppose 3t + u - 322 = 0, -4t + u = 2u - 430. Suppose -3f + 504 = t. Let s = f + -56. Is s a multiple of 25? False Let r(p) = 36p3 + p2 + 2p. Let t be r(-2). Let c = t + 476. Suppose -3u + 7u = c. Does 22 divide u? False Let s = -1594 - -2286. Is s a multiple of 23? False Suppose -28 = 4l - 6z + 2z, -5l = 4z + 17. Let i(c) = c*2 - 3c - 18. Is i(l) a multiple of 11? True Let g(l) = 76l2 + 4l + 10. Let r be g(-2). Let x = r - 187. Does 17 divide x? True Suppose 55 = 5m - 3c, 0 = -m - 4c + 3 + 8. Suppose 0 = -7s + ms - 448. Is 17 a factor of s? False Let y(r) = r2 - 3r + 4. Let o be y(3). Suppose -5d = -od + 9. Let w = d + 30. Does 7 divide w? True Let t = 3 - 0. Suppose 8i = 2i. Suppose to + o - 206 = 3z, 3o + 3z - 165 = i. Does 22 divide o? False Let s = -8 + 11. Suppose 3j - sg - 7 = 2g, -4g - 16 = -5j. Suppose -4n = -3u + 68, -jn + 8 = 2u - 4. Is 8 a factor of u? True Suppose 0 = -4l + 8l + 24. Is (-77 - l)/(-2 + 1) a multiple of 17? False Let z(g) = 7g*2 - 7g + 11. Let i be z(5). Let u = 309 - i. Is u a multiple of 25? False Suppose 15 = -3z + 8z. Suppose zm + i - 24 = -2i, -4 = i. Is m a multiple of 9? False Suppose d + 2d = -5y + 140, 0 = 3d. Let r = -65 + y. Let j = r + 73. Is j a multiple of 12? True Let b be ((-15)/6)/((-6)/12). Suppose 3 = -z, -bg + 119 = -2z - z. Is 11 a factor of g? True Let g(v) = v2 - 3v - 3. Let i be (-150)/(-14) - (-10)/35. Let l = i + -6. Is 7 a factor of g(l)? True Suppose 8b + 0b = -1200. Let n = -92 - b. Does 18 divide n? False Suppose -34 = 5r - 169. Does 2 divide r? False Let m = 11 - 11. Suppose mo - o = -60. Does 22 divide (-1)/(-4) - (-3945)/o? True Let m(n) = -7 - 9 - 6 - 5n + 15. Suppose -4c - 17 = 11. Is 7 a factor of m(c)? True Let i be 46/1 - (-8)/(-2). Let u = i + 3. Is u a multiple of 15? True Let z(p) = -p*2 - 11p + 2. Let j(a) = -a*3 + 5a*2 - 4a + 3. Let c be j(4). Suppose cb + 40 = -b. Does 4 divide z(b)? True Is 26 a factor of (0 - 1) + (750 - 4) + -12? False Let u = 32 + -27. Suppose -23 = -2j + 2k - uk, 0 = -3j - k + 45. Does 16 divide j? True Let b = -416 + 641. Is b a multiple of 29? False Is 4/(8/206) - -3 a multiple of 53? True Let v(n) = -10n + 2n2 - 169 - n2 + 196. Is v(7) a multiple of 6? True Let j be 0 + (-2 + 1 - 75). Suppose -3l = 5a - 2l - 809, 5a = 5l + 785. Let o = j + a. Does 19 divide o? False Let m(t) = -2t3 + 43t*2 - 17t + 42. Is 18 a factor of m(21)? True Let b(h) = h*2 - 2. Let z(f) = -2f + 1. Let x be z(2). Let m be b(x). Suppose -d + 28 + m = 0. Is 13 a factor of d? False Let r = 3357 - 1369. Is r a multiple of 14? True Let d = 30 + -61. Let j = -7 - d. Is 11 a factor of j? False Suppose 186 = f - 5h, 0 = 12f - 11f + 2h - 200. Is 49 a factor of f? True Suppose 2w + w = 9. Let o be 1/(20/(-16))-5. Suppose 5c - wc + d - 1 = 0, oc = -d + 7. Is 2 a factor of c? False Let k = 6573 - 3245. Is k a multiple of 85? False Let s = 3037 - 2482. Is 34 a factor of s? False Let s = 1467 - 942. Is 40 a factor of s? False Let d be 2/(-4) + 475/10. Let w = 13 + d. Does 10 divide w? True Let k = 50 + 1999. Is 105 a factor of k? False Suppose y + 10 - 71 = 0. Let j = y - 19. Is 14 a factor of j? True Let p(o) = -o3 + 3o*2 + 2o - 2. Suppose 0 = -2c - 2y + 8, 4c - y - 2 = 2c. Let h be p(c). Let s = h + 8. Is s a multiple of 7? True Let f be (88 + 3 + 1)/(-1). Let m = -23 - f. Is m a multiple of 31? False Suppose -1910 = 5w + 4i, 0 = -i + 3i + 10. Let b = 659 + w. Does 28 divide b? False Suppose -45a + 42432 = -28*a. Is a a mult	{ "pile_set_name": "DM Mathematics" }
f picking 1 h and 2 m? 12/35 Three letters picked without replacement from {s: 2, d: 1, o: 2, q: 1, t: 2}. What is prob of picking 1 q, 1 t, and 1 s? 1/14 Calculate prob of picking 1 u and 2 z when three letters picked without replacement from {l: 3, z: 3, u: 2}. 3/28 Calculate prob of picking 2 j when two letters picked without replacement from jjjjj. 1 Two letters picked without replacement from {g: 3, z: 2}. What is prob of picking 1 z and 1 g? 3/5 Four letters picked without replacement from {j: 4, a: 14}. Give prob of picking 4 a. 1001/3060 Four letters picked without replacement from ssqnbxnsnqqstxt. Give prob of picking 2 t, 1 x, and 1 n. 2/455 Three letters picked without replacement from pfqdfdfddf. Give prob of picking 2 f and 1 q. 1/20 What is prob of picking 1 i and 1 n when two letters picked without replacement from inyyyyiiiyyyyxyx? 1/30 Three letters picked without replacement from kmyssksnns. Give prob of picking 1 y and 2 n. 1/120 Three letters picked without replacement from {y: 6, d: 2, u: 7}. What is prob of picking 1 d, 1 y, and 1 u? 12/65 Calculate prob of picking 2 o when two letters picked without replacement from voxoooxoxoowvk. 3/13 What is prob of picking 2 p when two letters picked without replacement from {i: 4, s: 1, p: 2}? 1/21 What is prob of picking 2 j and 1 m when three letters picked without replacement from {j: 2, m: 1, i: 1, f: 1}? 1/10 What is prob of picking 1 f, 2 y, and 1 i when four letters picked without replacement from {f: 1, i: 3, y: 5, q: 6, p: 2}? 3/238 Calculate prob of picking 1 c, 1 a, and 2 j when four letters picked without replacement from jjcajajcjcajjccj. 3/13 Calculate prob of picking 2 m and 2 n when four letters picked without replacement from mffmfmlfnmfmffnmmmmm. 3/323 Calculate prob of picking 1 f and 1 q when two letters picked without replacement from {q: 4, n: 3, f: 11}. 44/153 Three letters picked without replacement from bwwwbwwwwwaaw. What is prob of picking 2 a and 1 b? 1/143 Four letters picked without replacement from ffaafdfd. Give prob of picking 1 a, 1 d, and 2 f. 12/35 Three letters picked without replacement from zzzzzzzzzqzzzzzzzz. Give prob of picking 3 z. 5/6 What is prob of picking 1 t and 1 m when two letters picked without replacement from mat? 1/3 What is prob of picking 2 t and 2 d when four letters picked without replacement from dttttdtdtttttttttdd? 455/1938 Calculate prob of picking 1 j and 1 t when two letters picked without replacement from tjbbvtxa. 1/14 Four letters picked without replacement from {m: 2, s: 6}. Give prob of picking 4 s. 3/14 Calculate prob of picking 1 k and 1 i when two letters picked without replacement from {i: 4, y: 2, k: 4, l: 6, t: 1}. 2/17 Calculate prob of picking 1 y, 2 r, and 1 w when four letters picked without replacement from ryywryyd. 2/35 Four letters picked without replacement from {u: 5}. Give prob of picking 4 u. 1 Three letters picked without replacement from wfwpwpphwhpww. Give prob of picking 1 f, 1 h, and 1 p. 4/143 Two letters picked without replacement from ddddddddd. What is prob of picking 2 d? 1 Three letters picked without replacement from {k: 4, h: 1, y: 11, x: 3}. Give prob of picking 2 k and 1 h. 2/323 Three letters picked without replacement from ffffzfzfzzffzzyffzzz. What is prob of picking 3 f? 2/19 What is prob of picking 2 d when two letters picked without replacement from {d: 19, e: 1}? 9/10 Two letters picked without replacement from kfbfbbbbfbbfbsbfbkff. Give prob of picking 2 b. 9/38 Two letters picked without replacement from qqccpqciqqpqicccggi. What is prob of picking 2 c? 5/57 What is prob of picking 2 w when two letters picked without replacement from llwlwllw? 3/28 Two letters picked without replacement from edeeeeeeeeeeeeedeee. What is prob of picking 2 e? 136/171 What is prob of picking 1 r and 1 v when two letters picked without replacement from uruszzvw? 1/28 What is prob of picking 1 p and 2 q when three letters picked without replacement from nnpnqnnpnppnnnqnnnnp? 1/228 Three letters picked without replacement from oomjmxmomjo. Give prob of picking 1 j, 1 x, and 1 o. 8/165 What is prob of picking 1 f and 2 k when three letters picked without replacement from {k: 6, f: 7}? 105/286 Three letters picked without replacement from {v: 8, n: 5, t: 4}. Give prob of picking 2 v and 1 t. 14/85 Calculate prob of picking 1 i and 3 y when four letters picked without replacement from yyyyiyytv. 10/63 Three letters picked without replacement from {y: 2, k: 2, q: 8, h: 2}. What is prob of picking 2 k and 1 q? 2/91 Calculate prob of picking 2 z when two letters picked without replacement from {z: 3, r: 8}. 3/55 Four letters picked without replacement from {e: 2, g: 1, y: 1, q: 7, r: 3}. What is prob of picking 1 e, 1 y, and 2 r? 6/1001 What is prob of picking 2 j and 2 c when four letters picked without replacement from ujjujucuc? 1/42 What is prob of picking 1 q, 1 b, 1 k, and 1 v when four letters picked without replacement from {b: 1, k: 1, v: 7, q: 4, c: 1, d: 4}? 7/765 Calculate prob of picking 2 w and 1 b when three letters picked without replacement from tmmtmttttmtwmtbtmwr. 1/969 Three letters picked without replacement from srsiigssiiriisrss. Give prob of picking 2 s and 1 r. 63/680 Two letters picked without replacement from {m: 6, j: 1, v: 1, l: 1, b: 1, r: 1}. Give prob of picking 1 m and 1 v. 6/55 What is prob of picking 1 a, 1 q, and 2 u when four letters picked without replacement from {u: 2, q: 1, a: 2}? 2/5 Two letters picked without replacement from bluul. Give prob of picking 1 l and 1 b. 1/5 Four letters picked without replacement from {c: 7, a: 7}. What is prob of picking 4 c? 5/143 What is prob of picking 1 t and 1 f when two letters picked without replacement from fttmmct? 1/7 Calculate prob of picking 2 f and 1 e when three letters picked without replacement from afffaae. 3/35 Four letters picked without replacement from {a: 4, t: 3}. Give prob of picking 2 t and 2 a. 18/35 What is prob of picking 2 v and 2 b when four letters picked without replacement from ttttvvbvb? 1/42 What is prob of picking 1 a and 1 o when two letters picked without replacement from oaookakoakaa? 10/33 Two letters picked without replacement from {v: 4, c: 7, h: 1, u: 2, o: 2}. What is prob of picking 1 o and 1 v? 1/15 Four letters picked without replacement from {b: 8, r: 4, e: 2, k: 1}. Give prob of picking 1 b, 1 k, and 2 e. 8/1365 Four letters picked without replacement from hnpshhrhhs. What is prob of picking 1 p, 1 h, 1 s, and 1 n? 1/21 Two letters picked without replacement from mhfymmmya. Give prob of picking 1 a and 1 h. 1/36 What is prob of picking 2 s when two letters picked without replacement from {t: 9, r: 1, q: 2, u: 3, s: 2}? 1/136 What is prob of picking 4 w when four letters picked without replacement from {j: 6, w: 7}? 7/143 Calculate prob of picking 4 z when four letters picked without replacement from {a: 3, z: 7}. 1/6 Three letters picked without replacement from uwuuuwuu. Give prob of picking 2 u and 1 w. 15/28 Two letters picked without replacement from auauaaa. Give prob of picking 2 u. 1/21 Two letters picked without replacement from {t: 8, o: 5}. What is prob of picking 1 t and 1 o? 20/39 What is prob of picking 2 q when two letters picked without replacement from nbpbssnqnspsbn? 0 Two letters picked without replacement from {v: 1, y: 6, r: 1, a: 2, n: 5}. What is prob of picking 1 n and 1 y? 2/7 What is prob of picking 2 e and 1 c when three letters picked without replacement from {m: 1, c: 1, o: 4, i: 1, e: 2}? 1/84 Three letters picked without replacement from bebbbebbbbbpbebbbbpb. What is prob of picking 2 b and 1 p? 7/38 Three letters picked without replacement from kkekkkkkkkekkkkkekkk. What is prob of picking 3 k? 34/57 Four letters picked without replacement from {e: 3, c: 4, u: 1}. Give prob of picking 3 c and 1 e. 6/35 What is prob of picking 1 u, 2 c, and 1 s when four letters picked without replacement from ucccvcccccuscu? 108/1001 Two letters picked without replacement from gbbdkinidkik. What is prob of picking 1 n and 1 d? 1/33 Two letters picked without replacement from {e: 2, i: 4, s: 2, d: 4}. What is prob of picking 2 i? 1/11 Two letters picked without re	{ "pile_set_name": "DM Mathematics" }
i2 + 4fi3 + 26g*2i*3 + 2g*2 wrt i? -18fg2 + 24f + 156g2 What is the third derivative of 12196t*3 + 786t*2 wrt t? 73176 Find the first derivative of 58l*4 + 10l - 724. 232l3 + 10 What is the third derivative of 5k*3m*3t + k*3t*2 - 173k*3 - 53k*2m*3t - 2k2t + 3m2t*2 wrt k? 30m*3t + 6t2 - 1038 What is the second derivative of f5r + f*3 - 330f*2r + 2f2 + 3fr - 2f + 58r wrt f? 20f*3r + 6f - 660r + 4 What is the first derivative of 563c3p + 289c3r*2 - 8pr2 + 4p wrt r? 578c3r - 16pr Find the third derivative of -2b6 + 82b*4 - 18b*2 wrt b. -240b*3 + 1968b Find the third derivative of 2f3k*3z + f*3kz - 2f*2k2 + f2z2 - 296fk3z*3 + 2381fz3 wrt k. 12f*3z - 1776fz*3 Differentiate 20s*3 - 60s*2 + 5799. 60s*2 - 120s Find the third derivative of 189h4 - 10h*3 - 5568h*2 wrt h. 4536h - 60 What is the derivative of 2336cj*3 + 1374j*3 wrt c? 2336j*3 What is the third derivative of 5021q*4 + 2483q*2? 120504q Find the first derivative of -11270v + 13721. -11270 What is the third derivative of -2l*5 - 2l*4 + 301l*3 + 4949l*2 wrt l? -120l*2 - 48l + 1806 Find the third derivative of 37x5 - 48x*2 - 4 wrt x. 2220x*2 Find the second derivative of -48kp5 + 1942kp - 6p*5 wrt p. -960kp3 - 120p*3 Find the second derivative of 3z*5 - 68z*2 + 168z. 60z3 - 136 What is the second derivative of -86s*4 + 451s? -1032s2 Differentiate 78q*3 + 529. 234q*2 Differentiate 8b*3 + 36b*2j*2 + 9j*2 - 11 with respect to b. 24b*2 + 72bj2 What is the second derivative of -1734f*2 + 2f + 994? -3468 What is the third derivative of 24mr*4 - mr*2 - 8m - 12r5 + 31r*2 wrt r? 576mr - 720r*2 What is the second derivative of -76p*3 - 16p + 5? -456p What is the second derivative of -117v*2y*3 + 2v*2y*2 - 9v*2 - 6vy3 + 2v + 8y3 + y2 wrt v? -234y*3 + 4y*2 - 18 What is the second derivative of 67a*3cd2 + 2a*3cdi*3 - 3a*3ci2 + 2a*3 - 2a*2ci3 - 3acd + 4cd*2i*3 + 2cd2 wrt d? 134a*3c + 8ci*3 + 4c Find the second derivative of 6589d2f*3 - 3df3 + 4df - 93d wrt d. 13178f3 Differentiate 10g*3 + 154g - 7370 wrt g. 30g2 + 154 What is the derivative of 268mp2 + 3023m - 3p wrt p? 536mp - 3 What is the third derivative of -5a*5 - 737a*4 - 6a*2 + 804a - 1? -300a2 - 17688a Differentiate -b*2q*2 + 1035b2 - q2 - 71q wrt b. -2bq2 + 2070b Differentiate 3au*4 - 94au3 - au - 1205a - 2 wrt u. 12au3 - 282au2 - a What is the first derivative of 65bh - 267b - 3h4 wrt h? 65b - 12h3 What is the second derivative of -2k*3nz + 13k*3n + 5k2nz - 9knz + kz - k + 11n wrt k? -12knz + 78kn + 10nz Find the second derivative of -174w*2 + 192w. -348 What is the second derivative of 8h2x*5 - 66h*2x*4 + 32h*2x + 49h2 wrt x? 160h*2x*3 - 792h*2x*2 Differentiate 1806t + 1573. 1806 What is the second derivative of 785n2o*2 - 86no2 + 3no - 2o wrt n? 1570o2 Find the third derivative of 7l*4z*2 + 12l*3z*3 - 78l*2z*2 + lz*3 wrt l. 168lz2 + 72z*3 Find the third derivative of -1938fr5 - 2fr2 + 585fr - r6 wrt r. -116280fr2 - 120r*3 What is the third derivative of 2f*3jo + 50f*3j - 4f3m + 44f2jo - 3f*2 + 4fjm + 2j wrt f? 12jo + 300j - 24m Find the second derivative of -4r*5 + 105r*4 + 2r + 145. -80r3 + 1260r*2 What is the first derivative of -109i*2o + 2io - i - 1712o wrt i? -218io + 2o - 1 What is the third derivative of 221osz4 + osz2 - 22o + 2sz2 - z2 wrt z? 5304osz Differentiate 3565rt3 + 58t*3 - 16 with respect to r. 3565t*3 What is the first derivative of 801c*3 + 1703? 2403c*2 Find the second derivative of -6701i*3 + 6i - 385. -40206i What is the derivative of 5f*2 - 288f - 444? 10f - 288 Find the first derivative of -21197g + 15634. -21197 Differentiate -23w2 + 193w - 2784. -46w + 193 What is the derivative of -tx*4 - 9tx2 + 13147t + 126x wrt x? -4tx3 - 18tx + 126 What is the derivative of -7cq2v + 14cqv3 - 13q*2v*2 + 2v*3 + 5v wrt c? -7q2v + 14qv3 What is the third derivative of p5 + 8p4t*2 - 9p*3u + 3p2t*2u - 44p2t*2 - 2p*2tu + 3u wrt p? 60p2 + 192pt2 - 54u What is the third derivative of 1271cf*2q*3 + cfq2 + 54cfq + 2c + f2q wrt q? 7626cf*2 What is the third derivative of -2k*3x*4 + 23k*3x*3 - 2k*3x - 14k3 + 2x*4 + 9x*2 wrt x? -48k*3x + 138k3 + 48x What is the second derivative of -3j3r*3 - 2j*3r*2 + 2jr3 + 2r*3 + 19r*2 wrt j? -18jr3 - 12jr2 What is the second derivative of -10349x*2 + 9737x + 1 wrt x? -20698 Find the third derivative of -a*6 + 83a*4 - 16a*2. -120a*3 + 1992a Find the third derivative of 5r3z*6 - 9r*3z3 + r3z2 - 14z wrt z. 600r3z*3 - 54r*3 Find the third derivative of 6520p*3 + 205p*2 - 2p. 39120 Differentiate 1266p2 - 448. 2532p What is the first derivative of 953sv + 9051s wrt v? 953s What is the derivative of -5n3z*2 - 4n*3 + 12n*2 - 6nz2 wrt z? -10n*3z - 12nz What is the second derivative of 19d3m*2 + 2d*3m - 7d2m*2 + 33d*2m wrt m? 38d3 - 14d*2 What is the first derivative of 411o + 51 wrt o? 411 What is the second derivative of -97m4 - 5m3 + m2 + 2823m? -1164m*2 - 30m + 2 Find the second derivative of ay3 - ay*2z*2 - 4ay2z + 5ayz2 + 3y*3z*2 - 37y*2z wrt z. -2ay*2 + 10ay + 6y*3 Find the third derivative of 122p*5 + 2p*2 + 2 wrt p. 7320p*2 Find the third derivative of 8h5 + h3 + 369h2 wrt h. 480h*2 + 6 What is the first derivative of 91b*2kt - 3b*2k - 2b2t + 5bk*2t + 121bk*2 wrt t? 91b*2k - 2b2 + 5bk2 Find the third derivative of -1851i*6 + 2i*2 - 40 wrt i. -222120i*3 Differentiate 382f + 2438 wrt f. 382 What is the derivative of -47s4 - s3 - 162 wrt s? -188s*3 - 3s*2 Find the second derivative of 1325v*3 - 4v - 206. 7950v What is the second derivative of -6x*4 - 173x? -72x2 What is the second derivative of -1217g*4 + 381g wrt g? -14604g2 Find the first derivative of 2077x*3 + 1195. 6231x*2 Find the third derivative of -38q*3s*3 - 2q*2s*3 - 22s*3 + 4s*2 wrt q. -228s*3 Find the second derivative of 4482c*3 + 1022c + 2 wrt c. 26892c What is the second derivative of -33s*3t2 - s3 + 74st - t*2 wrt t? -66s*3 - 2 What is the derivative of 3h*2t*3 + 6h*2 + 343ht3 - 5h wrt t? 9h2t*2 + 1029ht2 Find the second derivative of 2o*5 - 160o*4 - o - 155. 40o*3 - 1920o*2 Find the third derivative of -20306dk5 - 271dk2 + 22k*2 wrt k. -1218360dk2 What is the second derivative of -209o*3 + 8o - 32 wrt o? -1254o What is the third derivative of 2klmq - klq3 + 2klq*2 - 2kq + 49lmq*5 + 2lmq - 9mq*3 + 229m + q*2 wrt q? -6kl + 2940lmq*2 - 54m Find the first derivative of 2451z2 - 4722. 4902z Find the second derivative of c*2y + 12c2z*2 - 37c*2 - 4cy2 + 26cz3 - 2y*2z*2 - 5yz wrt z. 24c*2 + 156cz - 4y2 Find the second derivative of -m5 + 53m3 - 3m + 31 wrt m. -20m3 + 318m What is the second derivative of -263im*2o - io - 2m*2 + 5mo + m wrt m? -526io - 4 What is the third derivative of j2m*3 + 230j*2m*2 - 4jm2 - 2591m3 + m2 wrt m? 6j2 - 15546 Find the second derivative of -2u*3 + 262u*2 + 16u - 9 wrt u. -12u + 524 Find the third derivative of -455l*6 + 6l5 + l3 - 2l2 - 14885. -54600l*3 + 360l*2 + 6 Differentiate 3f*3z - 7f2z*3 - 15z*3 with respect to f. 9f*2z - 14fz*3 Differentiate 1623l*2 + 4206 wrt l. 3246l What is the derivative of -1963m + 6702 wrt m? -1963 Differentiate -182m*4 + 5m3 + m2 - 7796 with respect to m. -728m3 + 15m*2 + 2m What is the third derivative of 137h4 + h	{ "pile_set_name": "DM Mathematics" }
the remainder when 72098 is divided by 345. 338 What is the remainder when 10373 is divided by 225? 23 Calculate the remainder when 1179 is divided by 564. 51 Calculate the remainder when 68110 is divided by 68108. 2 What is the remainder when 5680 is divided by 34? 2 Calculate the remainder when 20733 is divided by 68. 61 Calculate the remainder when 9330 is divided by 405. 15 Calculate the remainder when 9411 is divided by 19. 6 What is the remainder when 361 is divided by 28? 25 Calculate the remainder when 498023 is divided by 68. 59 What is the remainder when 18423 is divided by 185? 108 What is the remainder when 1532 is divided by 1514? 18 Calculate the remainder when 13474 is divided by 49. 48 What is the remainder when 1096900 is divided by 81? 79 Calculate the remainder when 5182 is divided by 2586. 10 What is the remainder when 13374576 is divided by 31? 29 What is the remainder when 7000238 is divided by 1016? 1014 Calculate the remainder when 18423 is divided by 196. 195 Calculate the remainder when 15655 is divided by 30. 25 What is the remainder when 10173 is divided by 675? 48 Calculate the remainder when 35636 is divided by 1886. 1688 What is the remainder when 710374 is divided by 355181? 12 What is the remainder when 237027 is divided by 19752? 3 Calculate the remainder when 32924 is divided by 168. 164 Calculate the remainder when 98120 is divided by 28. 8 What is the remainder when 4630 is divided by 2786? 1844 What is the remainder when 1194814 is divided by 98? 96 Calculate the remainder when 12918 is divided by 1415. 183 Calculate the remainder when 5412 is divided by 1799. 15 Calculate the remainder when 9793 is divided by 7. 0 Calculate the remainder when 84794 is divided by 43. 41 Calculate the remainder when 5898 is divided by 958. 150 What is the remainder when 44213 is divided by 220? 213 Calculate the remainder when 166052 is divided by 173. 145 What is the remainder when 70139 is divided by 662? 629 What is the remainder when 976 is divided by 799? 177 Calculate the remainder when 17412 is divided by 5800. 12 What is the remainder when 181889 is divided by 206? 197 What is the remainder when 30006 is divided by 967? 29 What is the remainder when 10350 is divided by 45? 0 Calculate the remainder when 61832 is divided by 966. 8 What is the remainder when 125648 is divided by 12? 8 What is the remainder when 1600556 is divided by 195? 191 What is the remainder when 12169 is divided by 461? 183 Calculate the remainder when 459535 is divided by 229761. 13 Calculate the remainder when 18283 is divided by 3499. 788 What is the remainder when 153910 is divided by 51303? 1 What is the remainder when 480318 is divided by 16010? 18 What is the remainder when 201 is divided by 24? 9 What is the remainder when 22797 is divided by 40? 37 Calculate the remainder when 6303 is divided by 556. 187 What is the remainder when 53076 is divided by 31? 4 What is the remainder when 90631 is divided by 364? 359 What is the remainder when 9007 is divided by 7? 5 What is the remainder when 70139 is divided by 30? 29 What is the remainder when 10734 is divided by 182? 178 What is the remainder when 423 is divided by 162? 99 What is the remainder when 313680 is divided by 47? 2 What is the remainder when 83004 is divided by 539? 537 What is the remainder when 131773 is divided by 35? 33 Calculate the remainder when 28835 is divided by 958. 95 What is the remainder when 49907 is divided by 16619? 50 Calculate the remainder when 19450 is divided by 174. 136 What is the remainder when 11613 is divided by 528? 525 What is the remainder when 8549 is divided by 71? 29 What is the remainder when 26587 is divided by 34? 33 What is the remainder when 12832 is divided by 32? 0 What is the remainder when 30758 is divided by 15373? 12 What is the remainder when 323500 is divided by 6? 4 Calculate the remainder when 6477 is divided by 3. 0 Calculate the remainder when 475929 is divided by 13. 12 Calculate the remainder when 96720 is divided by 1362. 18 What is the remainder when 15715 is divided by 3142? 5 What is the remainder when 683 is divided by 153? 71 Calculate the remainder when 727 is divided by 40. 7 What is the remainder when 13148 is divided by 6558? 32 Calculate the remainder when 661232 is divided by 220408. 8 What is the remainder when 183842 is divided by 5252? 22 What is the remainder when 27907 is divided by 63? 61 Calculate the remainder when 10233 is divided by 44. 25 What is the remainder when 20479 is divided by 85? 79 What is the remainder when 67921 is divided by 441? 7 What is the remainder when 5336 is divided by 3? 2 Calculate the remainder when 138617 is divided by 153. 152 Calculate the remainder when 20067 is divided by 979. 487 What is the remainder when 44087 is divided by 630? 617 Calculate the remainder when 27900 is divided by 109. 105 What is the remainder when 3703 is divided by 1548? 607 Calculate the remainder when 920 is divided by 887. 33 Calculate the remainder when 11758 is divided by 655. 623 What is the remainder when 7622 is divided by 332? 318 What is the remainder when 18380 is divided by 259? 250 What is the remainder when 61463 is divided by 230? 53 What is the remainder when 1252 is divided by 308? 20 What is the remainder when 2050 is divided by 14? 6 Calculate the remainder when 20419 is divided by 353. 298 What is the remainder when 220582 is divided by 156? 154 Calculate the remainder when 6218738 is divided by 220. 218 What is the remainder when 280577 is divided by 200? 177 Calculate the remainder when 4022 is divided by 563. 81 What is the remainder when 645465 is divided by 35? 30 Calculate the remainder when 4588 is divided by 1406. 370 What is the remainder when 25593 is divided by 8528? 9 What is the remainder when 376 is divided by 288? 88 What is the remainder when 3027 is divided by 525? 402 Calculate the remainder when 134275 is divided by 22373. 37 What is the remainder when 129127 is divided by 16127? 111 What is the remainder when 3463 is divided by 1718? 27 What is the remainder when 33149 is divided by 130? 129 Calculate the remainder when 70556 is divided by 10078. 10 What is the remainder when 10332 is divided by 5142? 48 Calculate the remainder when 29697 is divided by 35. 17 What is the remainder when 112448 is divided by 459? 452 What is the remainder when 9521 is divided by 1581? 35 What is the remainder when 33967 is divided by 580? 327 What is the remainder when 12915 is divided by 1838? 49 What is the remainder when 25194 is divided by 2517? 24 Calculate the remainder when 4794 is divided by 1588. 30 Calculate the remainder when 11513 is divided by 384. 377 What is the remainder when 45819 is divided by 22893? 33 Calculate the remainder when 3768 is divided by 66. 6 Calculate the remainder when 115621 is divided by 185. 181 What is the remainder when 27397 is divided by 832? 773 Calculate the remainder when 69127 is divided by 3005. 12 What is the remainder when 2010 is divided by 335? 0 What is the remainder when 1369879 is divided by 184? 183 Calculate the remainder when 189599 is divided by 1036. 11 What is the remainder when 226070 is divided by 77? 75 Calculate the remainder when 3823 is divided by 483. 442 What is the remainder when 19733 is divided by 153? 149 What is the remainder when 9216 is divided by 861? 606 Calculate the remainder when 15709 is divided by 1208. 5 Calculate the remainder when 36032 is divided by 44. 40 Calculate the remainder when 480393 is divided by 400. 393 What is the remainder when 6288 is divided by 3140? 8 Calculate the remainder when 38111 is divided by 34. 31 What is the remainder when 5673 is divided by 203? 192 Calculate the remainder when 132604 is divided by 1700. 4 Calculate the remainder when 8816 is divided by 1101. 8 Calculate the remainder when 2611 is divided by 3. 1 What is the remainder when 43956 is divided by 117? 81 What is the remainder when 109570 is divided by 735? 55 Calculate the remainder when 29731 is divided by 44. 31 Calculate the remainder when 13413 is divided by 85. 68 Calculate the remainder when 16653 is divided by 40. 13 What is the remainder when 235158 is divided by 49? 7 Calculate the remainder when	{ "pile_set_name": "DM Mathematics" }
0.04 - 47.96. Let b = 0.4466663 - 48.4463963. Let d = b - z. Round d to four decimal places. 0.0003 Let v = -0.98714 + 0.6805. Let b = 6.28356 - v. Let o = -6.6 + b. Round o to three dps. -0.01 Let s = 2.49 + -0.09. Let q = -2.8 - s. Round q to the nearest integer. -5 Let a = 119.4323 + -276.43159. Let p = 157 + a. What is p rounded to four dps? 0.0007 Let s be -138 + 0 - -2 - 1. Let k = s - -210. Round k to the nearest 10. 70 Suppose 58737 + 27257 = m - 2k, -k = -3. What is m rounded to the nearest ten thousand? 90000 Let c = 1.48 + -3.8. Round c to the nearest integer. -2 Let c be 4371 + -7 + -41. Round c to the nearest one thousand. 4000 Let q be 31(-9 + 6). Let a(g) = -g*2 - 6g + 12. Let z be a(q). Let r be -1460(2 - z/(-6)). What is r rounded to the nearest 100? 700 Let i = 0.4 + 0.03. Round i to 1 dp. 0.4 Let a = 0.14 - 0.15225. Round a to 3 decimal places. -0.012 Let j = 1.23 - 1.23123. What is j rounded to four decimal places? -0.0012 Suppose -2u + n = -5, 4u - 4 = -3n + 1. Suppose 0w = -uw + 1500000. What is w rounded to the nearest one hundred thousand? 800000 Let i = 3252423 - 3252409.999982. Let r = 13 - i. What is r rounded to 5 decimal places? -0.00002 Let g = 450.167 + -487.1712. Let o = g + 37. What is o rounded to three decimal places? -0.004 Suppose -2i + 0i + 18 = 0. Let a(b) = 701b3 - 12b*2 - 7b + 6. Let j be a(i). Round j to the nearest one hundred thousand. 500000 Suppose 3w + 6300 = 5u - 447, -5u - w = -6751. What is u rounded to the nearest 100? 1400 Let y = 102 - 102.00047. What is y rounded to 4 decimal places? -0.0005 Suppose v = -0v - 12. Let b be ((-362500)/v)/(1/(-288)). What is b rounded to the nearest one million? -9000000 Let t = -1.7 + 2. Let l = 0.2 - t. Let x = l - -0.099924. Round x to five decimal places. -0.00008 Let t = 264498 - 132624. Let y = -79874 + t. Round y to the nearest ten thousand. 50000 Let j = 11.3 - 11.300000079. What is j rounded to 7 decimal places? -0.0000001 Let x = 226145 + -226146.9999936. Let l = -0.03 + -1.97. Let n = x - l. Round n to six dps. 0.000006 Suppose 2o = -0o - 24. Let y be 2/(-8) + (-20745303)/o. Let k = 288775 - y. What is k rounded to the nearest one hundred thousand? -1400000 Let u = -7914.49944 - -7916. Let b = -1.5 + u. Round b to 4 decimal places. 0.0006 Let s = -4282573 - -4282573.02104549. Let r = -2.67888751 - s. Let w = -2.7 - r. Round w to five dps. -0.00007 Let b = 30 + -18. Let c = b - 24. Let y = 11.999912 + c. Round y to five dps. -0.00009 Suppose -2974 = 2f - k, -4232 = 4f - k + 1718. Suppose 0 = 3j + 2y - 2734, 1703 = 3j - 2y - 1011. Let x = j + f. Round x to the nearest 100. -600 Let b = 0.33 + -0.33000259. Round b to 7 dps. -0.0000026 Let u = -7.605 - -7.1. Let c = 0.41 + u. What is c rounded to 2 dps? -0.1 Let t = 109 + -109.000049. What is t rounded to 6 dps? -0.000049 Let k = -156 + 271. Round k to the nearest ten. 120 Let w = 80 + -79.86. What is w rounded to one decimal place? 0.1 Let f be (-6629998)/13 + (-2)/13. What is f rounded to the nearest 100000? -500000 Let g = 224 + -224.091. What is g rounded to 2 dps? -0.09 Let c = -32 + 31.9999974. What is c rounded to 6 decimal places? -0.000003 Let y = -49802.788215 + 49818.46. Let q = 16.0917 - y. Let c = 0.42 - q. What is c rounded to 5 dps? 0.00009 Let b = 2584 + -2449.7. Let k = b - -19.7. Let g = 153.99999937 - k. What is g rounded to 7 decimal places? -0.0000006 Let k = 0.55 - 0.6. Let f = k + -0.07. Let r = f + 0.119901. Round r to 5 decimal places. -0.0001 Let y = 0.89 - 0.88963. Round y to 4 decimal places. 0.0004 Let g = -0.3 + 0.3. Let p = 0.17 - g. Let y = p + -0.169986. Round y to 5 decimal places. 0.00001 Let k = 0.94484 + -7.94473. Let m = -0.15 + 7.15. Let h = k + m. What is h rounded to 4 dps? 0.0001 Suppose 4 = -o - 3o. Let q = o + 9. Suppose -10799980 = -3k - qf + 3f, -2k = 5f - 7199980. Round k to the nearest 1000000. 4000000 Let y = -4514667.200127 + 4514681. Let n = 13.8 - y. Round n to 5 decimal places. 0.00013 Let d(r) = 27602r2 + 10r. Let y be d(-5). What is y rounded to the nearest one hundred thousand? 700000 Let j be ((-4000)/3)/((-7)/1260). Round j to the nearest 100000. 200000 Suppose 4u - 60000 = 2u. Round u to the nearest 100000. 0 Suppose -1886795 = 3z - 8z. Suppose l - 77359 = -z. What is l rounded to the nearest one hundred thousand? -300000 Let q be (1/3)/((-1)/(-6)) - -3. Round q to 0 dps. 5 Let k(j) = j*3 - 3j*2 + 3. Let f be k(3). Suppose 2n = -z - fn + 70015, -3z + 210012 = 4n. What is z rounded to the nearest ten thousand? 70000 Let x = 3.30968 - 3.34. Let b = x - -0.03. What is b rounded to four decimal places? -0.0003 Suppose -2w - 8 = 54. What is w rounded to the nearest 10? -30 Let o = 1.7811 - 1.581. Let s = 3.2 - 3. Let h = s - o. What is h rounded to 3 decimal places? 0 Let v = -0.49954 - -0.5. What is v rounded to 4 dps? 0.0005 Suppose -2t = -5c - t + 80, 3t + 80 = 5c. Suppose 0 = a - 3a + c. Suppose -aw = -7w - 160000. What is w rounded to the nearest one hundred thousand? 200000 Suppose -d = -2, 0v + 2v + 200002 = d. Round v to the nearest 1000000. 0 Suppose -1983 = 5z + 207. What is z rounded to the nearest 10? -440 Let l = -2.6 - -1.3. Let p = l - -1. Let f = -0.29999875 - p. Round f to 7 dps. 0.0000013 Suppose 2g - 32 - 96 = 0. Suppose -3b = -g - 143. Round b to the nearest 10. 70 Let h = -2.0000385 + 2. Round h to 6 dps. -0.000039 Suppose 3k + 3i - 24 = -2i, -30 = -5k - 5i. Suppose -6b + kb = -12000. Round b to the nearest 10000. 0 Let u(f) = -55f*2 - 2f + 2. Let x be u(-4). Let y = x - -1470. Round y to the nearest 100. 600 Let x = -508.2 + 553. Let l = 130 - 90. Let q = x - l. What is q rounded to zero decimal places? 5 Let o = -53515 - -53516.19905. Let n = 5 - 3.8. Let q = o - n. Round q to four dps. -0.001 Let j = -72317985.70000001 - -72317986. Let g = j - 0.3. Let x = g + 0. What is x rounded to seven decimal places? 0 Let i = 0.121 - 0.06. Round i to two decimal places. 0.06 Suppose -5t = -4g - 45, -t - 4 = 4g - 13. Suppose -4j = 5n - 5180, 0j - 4n = j - 1306. Let r be (j/t)/(1/(-3)). What is r rounded to the nearest 100? -400 Let j = 3.76 - 6.79. Let b = j + 6.16. Let n = b - 3.7. What is n rounded to 1 decimal place? -0.6 Let g be (27125/(-2))/(6/(-96)). Round g to the nearest 10000. 220000 Let f = -11.7 - -11.056. Let t = -5.896 + f. Let l = 7 + t. Round l to 1 decimal place. 0.5 Let h = 0.911 + -0.9. Let f = 5.589 + h. What is f rounded to zero dps? 6 Suppose 2d = 7d - 90000000. Suppose d = -h + 3h. What is h rounded to the nearest one million? 9000000 Let m = -0.3 + -0.1. Let d = m + 0. Let y = -0.3996 - d. What is y rounded to 3 dps? 0 Let z be (-1)/4 + 131138/8. Suppose -2b + 5q = z - 125409, 2b - 3q - 109011 = 0. Let y be -1 + -1 + b2. Round y to the nearest 10000. 110000 Let s = 2031.14324 - 2031. Let v = s + -7.143176. Let r = v - -7. Round r to 5 decimal places. 0.00006 Let m = -0.45 + 0.45000115. Round m to seven dps. 0.0000012 Let l = -852 - -345. Round l to the nearest one hundred. -500 Let i = -55416636 - -15616636. Round i to the nearest 1000000. -40000000 Let h = 0.03 - 0.73. Let p = h - -0.69959. What is p rounded to 4 decimal places? -0.0004 Let a = 138 + -231. Let r = a - -87.7. Round r to zero dps. -5 Let t = 167 + 103. What is t rounded to the nearest 100? 300 Let f = 1202220.000003 - 1202221. Let m = 1 + f. What is m rounded to five dps? 0 Let c = 12 + -12.00000115. Round c to seven dps. -0.0000012 Let s = 1.490569 + -2.0705435. Let r = 0.0101235 - s. Let t = r + -0.59. What is t rounded to five decimal places? 0.0001 Let n = 210 + -191.6. Round n to the nearest 10. 20 Let d(x) = 599995x + 8. Let u(l) = 599996l + 7. Let n(k) = -5d(k) + 6u(k). Let f be n(-2). What is f rounded to the nearest 1000000? -1000000 Suppose -4p = -3p - 2190. What is p rounded to the nearest 100? 2200 Let h = 26740 - 26751.027. Let a = h + 11. Round a to 2 dps. -0.03 Let c = -13.6 - -19.7. Let w = -6.100039 + c. Round w to 5 decimal places. -0.00004 Let b(n) = 503n*3 + 2n*2 + 7n. Let a be b(5). Let w = a - 132695. Let z = w - -110735. What is z rounded to the nearest ten thousand? 40000 Let n = 5.37983 + -5.39. Let c = n + 0.01. What i	{ "pile_set_name": "DM Mathematics" }
ort o, i, -0.4 in increasing order. -0.4, o, i Let r = 1.458 + -0.458. Put -5, -14, r, -2/5 in decreasing order. r, -2/5, -5, -14 Let n = 35 + -30. Let t = -0.22 - -1.02. Let p = t - 0.4. Sort -0.9, p, n. -0.9, p, n Let s = -210 + 206. Let h be 4/(-22) + (-2)/(-11). Let i be h + -1 - (-6)/10. Put s, 0.1, i in ascending order. s, i, 0.1 Let i be 6/42/(-3). Let r = 57.6 - -6.4. Let k = r + -64.4. Sort k, i, -7 in descending order. k, i, -7 Let i = -1097 + 1080. Put i, 4, -3 in increasing order. i, -3, 4 Let q be (-12)/5 + 14/35. Let n be -5 - -2 - 2-7. Suppose n = 2t + 3. Put t, -1, q in ascending order. q, -1, t Let x be 1/((-1)/(-2)) + -2. Suppose 0 = -4j + 3l + 23, j + xl = -2l - 8. Suppose n = 2n - 1. Put j, n, -2 in decreasing order. j, n, -2 Suppose 21w = 20w + 4. Suppose -wq = 4n - 20, n - q = 3n - 7. Put -1, 12, -5, n in increasing order. -5, -1, n, 12 Let b = -0.93 - -1.03. Sort -0.4, -6, b, 5 in descending order. 5, b, -0.4, -6 Let n = -490 + 492. Let u(a) = a3 + 4a*2 + 2a + 1. Let h be u(-3). Put h, n, 0.2, -1/8 in decreasing order. h, n, 0.2, -1/8 Let i be (3/(-12))/((-1)/(-16)-2). Let q be (i/16)/((-1)/(-6)). Let a = -0.6 + 0.6. Put 13, q, a in decreasing order. 13, q, a Let k = 300/11 - 3922/143. Sort 4, k, 1/3 in increasing order. k, 1/3, 4 Let s be (-10)/(-8)14. Suppose -3i - 5k + 44 = 0, 12 = 9i - 8i + k. Put 2, i, -4, s in increasing order. -4, 2, s, i Suppose -455 + 501 = 46q. Sort 97, q, -5, 0 in increasing order. -5, 0, q, 97 Let k(y) = y*3 + 9y*2 - 10y - 5. Let r be k(-10). Let g(v) = v*3 + 3v*2 - 2v + 4. Let h be g(-4). Suppose 4a - 15 = 1. Put a, r, h in descending order. a, h, r Suppose 0 = 2m - 90 + 18. Let b = m - 32. Sort b, -2, -1 in increasing order. -2, -1, b Let d = 2724 - 2744. Suppose -m + 6m - 31 = -2h, 4h + 2m - 22 = 0. Put d, 0, h in decreasing order. h, 0, d Let f be 6/15 - (-1596)/35. Suppose -3b - 2l + 17 = -30, 3b = -l + f. Sort -5, b, 1. -5, 1, b Suppose 0s - 2s - 4i = -18, -4i - 2 = -2s. Suppose -5r = -c + 4c - 2, -5r = 5c. Suppose -2m = -0m + 8. Sort s, c, m in increasing order. m, c, s Let u = -243 - -243. Sort -24, u, -3. -24, -3, u Suppose 5j + 144 = 2v, v = 2j + 99 - 26. Let l = 307/4 - v. Put l, -15/2, 3/7 in decreasing order. 3/7, l, -15/2 Let t = 13220893993/199452 - 175/16621. Let k = t + -66451. Let j = k - -165. Sort -1/8, 3/7, j in increasing order. -1/8, j, 3/7 Let r be (32/112)/((-2)/14). Sort -1, 3, r, 7 in descending order. 7, 3, -1, r Let r be -36 + (-1000)/(-30) - (13/3 - -1). Suppose -p + 4 + 2 = 0. Let j(i) = -i3 + 7i*2 - 5i - 7. Let t be j(p). Sort r, 1/3, t. r, t, 1/3 Let h(f) = 2f + 13. Let i be h(-9). Let z be ((-8)/20)/(2/20). Put -7, z, i in descending order. z, i, -7 Let y be 3(3 + 13/(-3)). Let w = -0.233 - 0.067. Sort y, w, 0.5 in decreasing order. 0.5, w, y Suppose 4w + 5n - 44 = 0, -w - 4n = -27 + 5. Suppose -3a + 5a - 4 = 0. Suppose a = -5y - 3r + 13, -r - 23 = -5y. Sort -2, y, w in ascending order. -2, y, w Let p = 1 + -0.6. Let m be (-132)/(-12) - (0 + 1). Let s be m/(-3)(-18)/(-15). Put p, -1, s in ascending order. s, -1, p Let b = -0.7 - 4.3. Sort 3/5, -2/17, b, -6 in descending order. 3/5, -2/17, b, -6 Let f be (-136)/238(-21)/6. Sort f, -11, -2 in decreasing order. f, -2, -11 Let o(s) = s*3 + 6s*2 + 5s. Let u be o(-5). Suppose 2v + 0v = u. Sort -4, 2, v in increasing order. -4, v, 2 Let s = -4489/7 + 641. Put s, 4/21, 0 in increasing order. s, 0, 4/21 Let f = 96 - 96.2. Put -0.1, 0.16, f, 3 in decreasing order. 3, 0.16, -0.1, f Suppose 0 = 3t + 4q - 24, -3 = 3t - 12q + 7q. Suppose f = -3f - 12. Sort t, f, -4. -4, f, t Let g(a) = a + 4. Let p be g(0). Let f be ((-108)/210)/9(p - -1). Let v be (0 - (-2)/10)/1. Sort 2/3, v, f in decreasing order. 2/3, v, f Let u(i) = i3 - 13i*2 - 50i + 36. Let j be u(16). Sort 75, -2, j in descending order. 75, j, -2 Let b be (-24)/1678/(-9). Let a = b + -16. Suppose j = -0 - 4. Put 0, a, j in ascending order. j, a, 0 Let f(l) = -l - 6. Let q be f(-5). Let p be -1 + q/(1/3). Let r = -7 - -12. Sort p, r, 3 in decreasing order. r, 3, p Suppose 0 = 5v + 2r - 2, -2r = -4v + 164 - 148. Sort -5, -4, 4, v in ascending order. -5, -4, v, 4 Suppose -3t + t + 14 = 4r, -3t + 2r = -5. Suppose 0 = 2p - 4 - 4. Sort p, t, 1, -1 in increasing order. -1, 1, t, p Let r = 3 - 2. Suppose -227 = -14n - 157. Put n, r, -5, 2 in decreasing order. n, 2, r, -5 Suppose h - 6h = 100. Suppose 2p - 32 = -0. Let r = h + p. Sort r, -2, 1 in decreasing order. 1, -2, r Let w = 15 - 11. Let i(s) = -s3 + 3s*2 + 5s - 3. Let t be i(w). Put -4, t, 5 in descending order. 5, t, -4 Suppose -7y + 30 = -145. Suppose -3d - y = 5c, 0d - 4c = 5d + 33. Put 6, 1, d, 2 in descending order. 6, 2, 1, d Let n(x) = -x*3 + 19x*2 - 22x + 72. Let q be n(18). Put -19, -1, q in ascending order. -19, -1, q Let b = -3.4 - -3.4. Let x = 7.3 - -1.7. Sort x, b, -0.5, -2 in increasing order. -2, -0.5, b, x Suppose q - 49 = 45. Let p = -64 + q. Let a = 33 - p. Sort -7, 2, a in decreasing order. a, 2, -7 Let j = -0.2 - -0.25. Let t = 146 + -165. Let d = t + 15. Put j, d, -1 in decreasing order. j, -1, d Let j(k) = -k*2 - 7k + 25. Let b be j(3). Sort b, 1, -2, -11. -11, b, -2, 1 Let l(s) = s*2 - 6s - 6. Let x be l(7). Let c = 0 + x. Let n = -18.3 - -14.3. Sort c, -0.1, n. n, -0.1, c Let x = -46 - -48. Let n = 1.01 + -1.21. Sort -0.5, -4/3, n, x in descending order. x, n, -0.5, -4/3 Let q = 219 + -221. Put -5, q, 2, 3 in decreasing order. 3, 2, q, -5 Let o = 0.2 + -0.4. Let r = -0.2 - o. Let c = -573 - -575. Sort c, r, -1/5 in descending order. c, r, -1/5 Let f(d) = -d*3 - 4d*2 + 6d + 1. Let n be f(-5). Let g be n/6(-2)/4. Let y = 1287.7 - 1287. Sort g, y, 0.3 in descending order. y, g, 0.3 Let y(s) = 3s - 5. Let b be y(2). Let g be 2 + -14/b. Put 0.8, -4, g in ascending order. -4, g, 0.8 Let s = 9.8 + -12. Sort 5/6, s, -5 in descending order. 5/6, s, -5 Let s(k) = k2 + 7k + 9. Let w be s(-6). Let x = w - -2. Let m = 80.5 + -83.5. Put 0.4, x, m in ascending order. m, 0.4, x Suppose 0 = -n + 4q - 7q + 64, -2n = -q - 107. Let x = -53 + n. Put 5, 3, x, 0 in decreasing order. 5, 3, x, 0 Suppose 54 = 6o + 6. Let m be (-4 - o)(-2)/(-3). Put 2, 4, -4, m in descending order. 4, 2, -4, m Let t = 0.0579 + 128.9421. Put 1/3, -4, t in ascending order. -4, 1/3, t Suppose 2c - 2t = 18, -8t = 4c - 9t - 24. Sort -2, 2, c in decreasing order. c, 2, -2 Let g = -0.0201 - -26.0201. Sort -0.1, -2/3, g in ascending order. -2/3, -0.1, g Suppose 22a + 16a - 152 = 0. Sort 18, -5, -3, a in decreasing order. 18, a, -3, -5 Let h = 23/42 + -8/21. Let z = 1 - -15. Suppose q = -5f + 27, -5q + 9 + z = 3f. Put 0, h, q in increasing order. 0, h, q Let y(t) = 6t + 26. Let p be y(15). Let s = 99 - p. Sort 3, s, 1, 0 in decreasing order. 3, 1, 0, s Let x = -1392 + 1388. Suppose 5j + 15 = 2j. Put j, 4, x, 5 in decreasing order. 5, 4, x, j Suppose 2 + 6 = -4x. Suppose 2m - 8m = -12. Let p be (-8 - -8)(-1)/(-2). Sort x, p, m. x, p, m Let m = 0.1 + 0.2. Let t = -8.43 - -0.63. Let o = t + 11.8. Put o, m, 3 in decreasing order. o, 3, m Let z be 30/(-70)63/(-27). Put 8, 0, z, 2 in decreasing order. 8, 2, z, 0 Let u = 2.9 + -3. Suppose -g + 9 = 5c, 0 = 2g + 5c - 3c - 26. Let s be 1 + (g - 12)(-10)/4. Put 0, s, u in decreasing order. 0, u, s Let a = -31 - -55. Suppose -174m = -168m - a. Put m, -1, 0 in decreasing order. m, 0, -1 Let b = 307/6 + -51. Suppose -2m + 3m = 2k + 3, 3k + 7 = 2m. Let x be 80/(-36) + (k - -1). Sort 2, x, b in decreasing order. 2, b, x Let w = -51.71 - -51.8. Let j = 17 + -13. Sort w, -3/2, j in decreasing order. j, w, -3/2 Let n = 3.9505 + 0.0495. Put n, 3/4, 0.5 in descending order. n, 3/4, 0.5 Let j(k) = -k2 - k + 3. Let p be j(-2). Put 2, -18, 11, p in decreasing order. 11, 2, p, -18 Suppose -91d + 88d + c - 4 = 0, -2c = -2. Let b = -12 - -13. Put d, b, 4 in ascending order. d, b, 4 Suppose -9v - 2109 = -2145. Let a(h) = h3 - 5h*2 + 5h - 6. Let w be a(4). Sort w, 5, v in descending order. 5, v, w Suppose 16 = 6r - 2r - u, -r + 3u + 15 = 0. Sort 4, r, 65 in ascending order. r, 4, 65 Let a = -3.21 + 2.91. Let z(k) = k3 - 5k**2 - 5. Let	{ "pile_set_name": "DM Mathematics" }
Let n be 43/9 - 22/(-99). Suppose 2x + 3w = -x + 45, w = x - n. What are the prime factors of x? 2, 5 Suppose 0 = -3h - 0h + 15. List the prime factors of h. 5 Let j = -8 - -50. What are the prime factors of j? 2, 3, 7 Suppose -5 = -5b + 15. Let p be (-6)/(-4)b/(-6). Let f(m) = 7m2 - 1. List the prime factors of f(p). 2, 3 Suppose 3v + 102 = 3u, -u = -2u + 3v + 24. What are the prime factors of u? 3, 13 Suppose 5 = 4y - 7. Suppose v + 8 = -v - 2f, 2v + 12 = -yf. Suppose -2u - 2u + 56 = v. What are the prime factors of u? 2, 7 Let k(b) = b - 3. What are the prime factors of k(5)? 2 Let z(u) = u3 + 5u*2 + 2u - 2. Let d(w) = w*2 - 12. Let y be d(0). Let i be (4/(-6))/((-2)/y). What are the prime factors of z(i)? 2, 3 Let i be (-1)/6 - (-26)/12. Suppose ig + g - 12 = 0. List the prime factors of g. 2 Suppose -5n - 4 = -7n. Suppose -2c = 3d - 67, 4c - 65 - 29 = nd. List the prime factors of c. 2, 13 Let d be (-2 - -3)/1 + 24. Let o = d + -12. List the prime factors of o. 13 Let j(q) = -6q - 7. Let b = 1 + -6. What are the prime factors of j(b)? 23 Suppose -7 + 111 = 2l. Suppose -4m + l = -2m. What are the prime factors of m? 2, 13 Suppose 0 = 5i - i - 20. Suppose -iy - 48 + 123 = 0. What are the prime factors of y? 3, 5 Let j(d) = 33d - 27. List the prime factors of j(9). 2, 3, 5 Let i = 75 + 19. What are the prime factors of i? 2, 47 Suppose a - 90 = -3w, -430 + 126 = -4a + 2w. What are the prime factors of a? 2, 3, 13 Let z(w) = -w*3 + 2w + 62. What are the prime factors of z(0)? 2, 31 Let p be (-1)/(-1(-2)/(-4)). Suppose 2f - 34 = -3l, -5l - f = -pf - 61. What are the prime factors of l? 2, 3 Let d = 46 - 16. List the prime factors of d. 2, 3, 5 Suppose -5k + 3 = -17. What are the prime factors of 15/(-2)k/(-3)? 2, 5 Let r = 3 - 2. List the prime factors of (12/1)/(r - -1). 2, 3 Suppose -2x = -72 + 22. Let k = 43 - x. Let a = k - 12. List the prime factors of a. 2, 3 Let x = -60 - -110. List the prime factors of x. 2, 5 Let w be ((-1)/(-2))/(1/(-12)). Let k = w - 6. Let t = -7 - k. What are the prime factors of t? 5 Let g(m) = m*3 + 5m*2 + 4m + 4. Let d be g(-4). Suppose -dz = -a + 6a - 144, 0 = 2a. List the prime factors of z. 2, 3 Let z = 209 - 39. List the prime factors of z. 2, 5, 17 Suppose -2j - 4c + 5 = -61, 4c = -4j + 120. List the prime factors of j. 3 Let n = -5 + 9. Suppose 5p + 3u - 42 = 33, 60 = np + 2u. List the prime factors of p. 3, 5 Suppose 3m = -4 - 11. What are the prime factors of m/((-20)/(-12)) - -7? 2 Let q = -8 + 34. What are the prime factors of 1/(-3) + q/6? 2 Let r = -87 - -160. List the prime factors of r. 73 Suppose 110 + 46 = 4r. Let s be r(2/(-6))/(-1). Suppose 5k - 17 = 4p + s, -2p = -3k + 20. List the prime factors of k. 2, 5 Let p = 134 - -14. List the prime factors of p. 2, 37 What are the prime factors of (-1661)/(-99) + 4/18? 17 Suppose 0g + 4g = 16. Let p be (-2 - 0)(-10)/g. Suppose 0 = -2a, 2l - 2a = p + 3. List the prime factors of l. 2 Suppose -2g = 4i - 163 + 31, -5g = 10. What are the prime factors of i? 2, 17 Let b(l) = 10l - 3. List the prime factors of b(6). 3, 19 Let g = 490 - 284. What are the prime factors of g? 2, 103 Let l(i) = 2i + 8. Let f be l(-8). Let w = 5 + f. What are the prime factors of (-3)/(w/2) - -10? 2, 3 Suppose 0n = -4n + 4s + 120, -2s = 4n - 108. What are the prime factors of n? 2, 7 Suppose -q + 29 = -3n, -4n + 9 + 39 = 3q. What are the prime factors of q? 2, 5 Let i = 15 + -11. Let o = -1 + i. Suppose -4p = k - 49, -op + 12 = -5k - 19. List the prime factors of p. 2, 3 Suppose 56 = -6b + 8b. List the prime factors of b. 2, 7 Let c be 36/15(7 - 2). Suppose f + c = 2f. List the prime factors of f. 2, 3 Suppose 3j - 111 = s, -3s + 42 = j - 5s. What are the prime factors of j? 2, 3 List the prime factors of (4 - 0) + (245 - 1) + -1. 13, 19 Suppose -2l = -0l - 30. Let o(u) = u - 2. Let g be o(-2). Let s = l + g. List the prime factors of s. 11 Suppose 0 = 2y - 3y. Suppose y = -3i - i. Let z = 9 + i. List the prime factors of z. 3 Let j = 215 + -103. What are the prime factors of j? 2, 7 Let y(g) = -2g + 4. Let h be y(-6). Let w = h + -10. List the prime factors of w. 2, 3 Suppose -4v = -10v + 414. What are the prime factors of v? 3, 23 Let p be (-9)/(-21) - (-2136)/14. Let o = p + -99. What are the prime factors of o? 2, 3 Suppose 13 = a - 2j, 5a = 3j + 23 + 7. Suppose -ay + 4 = -8. List the prime factors of y. 2 Let u = -55 + 59. What are the prime factors of u? 2 Let r be (-2)/4 + 38/4. Let c = r - 4. Suppose 0 = 3s + o - 35, s + s - 12 = co. What are the prime factors of s? 11 Let i be 6 - (2 - (-3)/(-3)). Suppose 0 = 2z - 4j + 4, -z + j - 10 = -iz. What are the prime factors of (z - (5 - 2))-11? 11 Suppose -5i + 3a - 2a = -295, 5a = -25. Let d = i + -32. What are the prime factors of d? 2, 13 Let d = 45 - 29. Suppose -6 = -2b + d. What are the prime factors of b? 11 Let m = 25 - 17. What are the prime factors of m? 2 List the prime factors of 33/((-1)/2-2). 3, 11 Let w = 147 - 67. What are the prime factors of w? 2, 5 Let z(v) = v + 1. Let a be z(0). Suppose y = a + 3. What are the prime factors of y? 2 What are the prime factors of 144 - 2/((-10)/25)? 149 List the prime factors of 2 - ((-1 - 25) + 4). 2, 3 Suppose 0 = -5i + i + 256. What are the prime factors of i? 2 Suppose 0 = -w - 12 + 12. Let t be -1(-5)/22. Suppose -tn + 55 = -wn. What are the prime factors of n? 11 Suppose 3a + 240 = 3k, 4k + k = -4a + 355. List the prime factors of k. 3, 5 Let n be (-304)/(-14) + 2/7. Suppose 2u + n = -2. Let a = 28 + u. List the prime factors of a. 2 Let m(l) = l + 8 - 3 - 2l. Let v be m(5). Suppose -3x + 4g + 17 = v, 0x = x - 3g + 1. List the prime factors of x. 11 Suppose 0g = -4g + 3k + 221, -5g + 284 = 4k. Suppose -2j + 2z - 4z - 26 = 0, 0 = -4j - 5z - g. Let l = -3 - j. What are the prime factors of l? 2, 3 Suppose -4y + 28 = 6m - m, -5y + 26 = 4m. Suppose -m = -s + 12. List the prime factors of s. 2 Let w(u) be the first derivative of -u4/4 - u3/3 + u*2/2 + 10u + 1. What are the prime factors of w(0)? 2, 5 Suppose -12 = 3x, -5z - 4x - 3 = -2. Suppose -6m = -11m + 4y + 134, 0 = -4m - zy + 101. List the prime factors of m. 2, 13 Let a(t) be the second derivative of -3t5/10 - t4/6 - t3/3 - t2/2 - 6t. List the prime factors of a(-1). 5 Suppose -u - 2h - 5 = -13, -9 = -3u - h. Suppose 2q - 33 = 5j, -27 = -2q + j - uj. List the prime factors of q. 2, 7 Let u = 48 + -35. List the prime factors of u. 13 Let l be (-67)/(9/(-12)). Suppose 4y - 4f = 77 + 7, 0 = -4y - 3f + l. What are the prime factors of y? 17 Suppose -9 - 15 = 3l. What are the prime factors of (-102)/l + (-3)/(-12)? 13 Suppose -2l = l. Let z(c) be the first derivative of -c3/3 - c2/2 + 2c - 1. What are the prime factors of z(l)? 2 Suppose -5d + 20 = -0d. Suppose 0 = g - dw + 17, 0g - w + 20 = -g. Let l = -7 - g. What are the prime factors of l? 2, 7 Let v(t) = -18t3 - t2 - 7t - 5. Let r(s) = -37s3 - 2s*2 - 15s - 11. Let x(w) = 6r(w) - 13v(w). What are the prime factors of x(1)? 13 Suppose -9y + 25 = -4y. List the prime factors of y. 5 Let j(a) = 15a2 + 6a - 3. What are the prime factors of j(4)? 3, 29 Suppose k + 210 = 6k. What are the prime factors of k? 2, 3, 7 Let l(a) = 24a - 2. What are the prime factors of l(5)? 2, 59 Let g(d) = -d*3 + 4d*2 - d + 2. Let t be g(3). Suppose -tq + 32 = -6q. Let p = q + -10. List the prime factors of p. 2, 3 Let u = -8 - -11. Suppose -2v + 3r + 50 + 22 = 0, -3r = 0. Suppose -um + v = 6. List the prime factors of m. 2, 5 Suppose -1679 = -4z - 555. List the prime factors of z. 281 Suppose 2y - y - 1 = -n, 5n + 2y = 11. Suppose k + 58 = no, -4o + 3k + 69 = -0o. What are the prime factors of o? 3, 7 Suppose -5q + q + 168 = 0. What are the prime factors of q? 2, 3, 7 Suppose -2 = 3m - 14. Suppose 0v + 12 = mv. Suppose -vb + 4 + 5 = 0. What are the prime factors of b? 3 Suppose -4k + 77 = 5. What are the prime factors of k? 2, 3 Suppose 4x - 1 = 11. Suppose 2d - 13 = -2f + xd, -5d = f + 21. Suppose 4p - o = 71, 0 = -fp + 3*o + 117 - 40. Li	{ "pile_set_name": "DM Mathematics" }
mmon factor of o and 56. 14 Suppose -28 = -z - 6z. What is the greatest common factor of 3 and z? 1 Suppose 0 = 3s - 7 - 50. Let f = 51 - s. Calculate the highest common factor of f and 16. 16 Let a = 46 + -13. Let z(q) = -q*3 + 4q*2 + 25q - 17. Let f be z(7). Calculate the highest common divisor of f and a. 11 Let r be (-28)/10 + (-2)/10. Let z be 0 - 57 - 1/(-1). Let q be r + z/(-2) + -1. What is the highest common factor of 16 and q? 8 Let a be -4 - ((-39)/26)/(1/4). What is the highest common factor of a and 224? 2 Let u(p) = 29p + 468. Let r be u(-12). What is the greatest common factor of r and 1140? 60 Let z = -66 + 66. Suppose -5i + 12 = c, z = -2i - 0c + 4c + 18. Calculate the greatest common factor of i and 3. 3 Suppose -200 = 62f - 758. Calculate the greatest common divisor of 333 and f. 9 Let m = -37 - -152. Let a = -24 - -55. Let d = -8 + a. What is the greatest common factor of m and d? 23 Let m = 573 + -517. Let z = -34 + 174. Calculate the greatest common factor of m and z. 28 Let y = 266 + -255. Suppose -m - 2d - 119 = -2m, 607 = 5m + 2d. What is the greatest common divisor of y and m? 11 Let m = -216 + 219. What is the greatest common factor of m and 11? 1 Let c = 2769 + -9077. Let j be 4/(-14) - c/28. Calculate the greatest common divisor of 25 and j. 25 Let q be 4((-5)/5 + 2). Suppose 0 = -qp + p - 2t + 773, 0 = 5p + 2t - 1295. Calculate the greatest common divisor of p and 29. 29 Let d(p) = 2p*2 - 26p + 1. Let r be d(14). Calculate the highest common divisor of r and 1247. 29 Let i(u) = 8u + 168. Let m be i(-19). What is the greatest common divisor of m and 64? 16 Suppose -15 = -5x - 2k, 7 = 3x - 2k - 2. Suppose -4z + xz = -42. Suppose 0 = -4g - z + 258. Calculate the highest common divisor of 18 and g. 18 Let z(l) = -l + 1. Let v be z(-4). Suppose -5q = -4q - 5. Suppose -421 + 146 = -qj. Calculate the greatest common factor of v and j. 5 Suppose 2g + 1528 = 4n, 2n - 3g - 216 - 544 = 0. Suppose 2v - 113 = n. Calculate the greatest common divisor of 31 and v. 31 Suppose -l = 4x + 8 + 1, x - 4l = 2. Let v(c) = 8c2 - 2c - 8. Let n be v(x). What is the greatest common factor of 224 and n? 28 Suppose -2j = -6h + 2h - 20, 4h = -2j + 52. What is the greatest common factor of 96 and j? 6 Let v be (1 - 3 - 6)3. Let x be 64/v + 2/(-6). Let o be x/9 + 50/6. What is the greatest common divisor of 24 and o? 8 Suppose -4w - 3j + 187 = -276, -w - 2j + 122 = 0. What is the greatest common factor of 14 and w? 14 Let m = 242 - 236. Let k = -22 - -46. Calculate the greatest common factor of k and m. 6 Suppose 190w - 1120 = 186w. Calculate the highest common divisor of 84 and w. 28 Suppose 6i - 237 = -87. What is the greatest common factor of 5 and i? 5 Suppose 5c - 11 = 19. What is the greatest common factor of 17 and c? 1 Let s(t) = -t3 + 11t*2 - 9t - 4. Let m be 78/8 + (-1)/(-4). Let x be s(m). Suppose -xa + 63 = -3a. Calculate the greatest common factor of a and 7. 7 Suppose -433p + 429p = -16. Calculate the highest common factor of p and 1. 1 Suppose -1000 + 64 = -12n. What is the highest common factor of n and 182? 26 Let p = -22 + 44. Suppose 0 = 24w - pw - 52. What is the highest common divisor of 52 and w? 26 Let q(m) be the first derivative of m3/3 + m2 + 2m - 6. Let c be q(0). Suppose 21 = h + ch. What is the greatest common factor of h and 7? 7 Let x(i) = 2i*2 + 20i - 522. Let n be x(-37). What is the highest common divisor of n and 41? 41 Let t be (1/(-1) - 3) + 1. Let z = 0 - t. Let b = 0 - -1. Calculate the greatest common divisor of z and b. 1 Let h = 7 + 0. Suppose w + 697 = 4b, 4b - 508 - 204 = -4w. What is the highest common factor of h and b? 7 Let k(u) = 89u - 101. Let v be k(16). What is the highest common factor of 21 and v? 21 Let n be 4/(-8)(-2 + 72/(-4)). Suppose -5y + 13 = 3l, -3l - 3y = l - n. Calculate the greatest common factor of 1 and l. 1 Suppose 3v = 2y - 563, -v + 575 = 78y - 76y. Calculate the highest common factor of y and 44. 22 Suppose -24p = -23p - 20. Suppose -3d + 3 = i - 54, i = 0. Suppose -d - 33 = -5k - b, -k = -5b. Calculate the greatest common factor of p and k. 10 Suppose 0 = -29q - 69q + 139650. Calculate the greatest common divisor of 190 and q. 95 Suppose 32r + 3125 = 58069. Calculate the highest common divisor of r and 17. 17 Let r be ((-28)/(-10))/(2/170). What is the highest common factor of r and 70? 14 Suppose -j = -4j - 4y - 97, -3j + 2y - 91 = 0. Let k = 38 + j. Calculate the highest common divisor of 28 and k. 7 Let q(w) = w3 + 5w*2 + 2w - 1. Let j be q(-3). Suppose 0 = jl - 12l + 6. Calculate the greatest common divisor of 48 and l. 6 Let z be 530/318 + 1/3. Let h be (-4)/14 + 44/7. Let t(n) = 2n - 8. Let c be t(h). What is the greatest common factor of c and z? 2 Let c(i) be the second derivative of -i4/6 + 19i*3/6 - 6i*2 + 10i. Let u be c(8). What is the highest common divisor of u and 48? 12 Suppose 0 = -5h + 2p + 6, h - 4p - 7 = 5. Suppose h = 3i - 4i + 162. What is the highest common divisor of i and 18? 18 Let b be (-81)/(-2) - (-5)/50-5. What is the greatest common divisor of 16 and b? 8 Suppose -948 = 16c - 22c. Calculate the greatest common factor of 711 and c. 79 Let u be (-33)/(-5)((-21)/91 + 417/117). Let i(a) = 32a + 2. Let v be i(4). Let g = -75 + v. Calculate the greatest common factor of g and u. 11 Let q(s) = -2s2 - 22s + 24. Let g be q(-12). Suppose -3k + 12 = g, -3k + 13 = h - 2k. Calculate the greatest common factor of h and 15. 3 Suppose -4s = 3o - 1546, o - 490 = -0o + 5s. What is the highest common divisor of o and 30? 30 Let n = -825 - -905. Calculate the highest common factor of 15 and n. 5 Suppose -5b = -0b - 825. Let q = b + -81. Let i = -10 - -22. Calculate the greatest common divisor of q and i. 12 Let f(q) = q + 41. Let g be f(-13). Calculate the greatest common divisor of g and 266. 14 Suppose 3g = -3s + 195, g + g = 4s - 278. Let o = -1538 + 1542. What is the greatest common factor of o and s? 4 Suppose -4o = 15o - 28o + 144. Let d = -4 - -6. What is the highest common divisor of d and o? 2 Let r(j) = 4j*3 + 7j - 3 - 3j2 - 3j + 1. Let m be r(2). Let k = 1269 - 1204. What is the highest common factor of m and k? 13 Let b = -21 - -33. Suppose -44 = -4x - 3p, 7 = 3x - p - 13. What is the highest common divisor of x and b? 4 Suppose 5t - 4u = 2513, 13t - 15t + 5u = -995. What is the highest common factor of 5 and t? 5 Suppose 0 = -r - 0r + 2. Suppose 24 = 5o - ro. Let v be (-102)/(-2)o/6. What is the highest common divisor of 17 and v? 17 Let t(y) = y*2 + 3y - 30. Let d be t(-10). What is the highest common divisor of 520 and d? 40 Suppose -7u - 1276 = -3u. Let c = u - -506. Let t be (-102)/(-4)(-2)/(-3). Calculate the greatest common factor of t and c. 17 Let c(m) be the first derivative of -1/3m*3 + 84m + 4 - 1/2m2. Let v be c(0). What is the highest common divisor of 21 and v? 21 Let y be 1(-4 + 3) - -183. Suppose 7j - 308 = y. What is the highest common factor of j and 10? 10 Suppose 2r = -5f + 63, -2r + f = -75 + 6. Calculate the highest common divisor of 68 and r. 34 Suppose 1355 = 11o - 1318. Calculate the greatest common divisor of 27 and o. 27 Let y(n) = -6n - 2. Let u be y(-5). What is the highest common factor of u and 7? 7 Suppose -27 = -2d + 9. Let b = d - 10. What is the greatest common divisor of b and 16? 8 Let h = -265 - -273. What is the highest common divisor of 34 and h? 2 Let c(d) = -5d - 3. Let p be c(-5). Suppose 2z - p - 44 = 0. Calculate the highest common factor of 66 and z. 33 Let c be 27/(-18) - (-778)/4. Suppose -194d + 22 = -cd. Suppose 4h - 320 + 100 = 0. Calculate the highest common factor of d and h. 11 Let p(f) be the second derivative of f4/12 - f3/6 - 3f. Let z be p(5). Let j be (-6)/(-9) - 52/(-12). Calculate the greatest common factor of z and j. 5 Let a = -80 - -168. Let k = a - 71. Calculate the highest common factor of k and 17. 17 Suppose -j - 6j + 1400 = 0. Let p be 33(j/6)/2. Suppose -b - 4b + p = 0. What is the highest common divisor of 10 and b? 10 Suppose 2n + 3304 = 3f, n = -4f + 5n + 4408. Suppose -11*z	{ "pile_set_name": "DM Mathematics" }
ps? -0.00006 Let b = 2285811 - 1311595. Suppose 6o - 2o - 4i - b = 0, 4o = -4i + 974216. Suppose 4y + o = -200446. What is y rounded to the nearest 10000? -110000 Let o = -1120 + 1590. Round o to the nearest 100. 500 Let z = 59.4 + -59.911. What is z rounded to two decimal places? -0.51 Let m = 0.14052253 + -193.14153253. Let g = 0.123 + -193.123. Let b = g - m. What is b rounded to 4 dps? 0.001 Suppose -g = 5p - 17, -2p + 4 = -0g - g. Let i(n) = 6n + 60n2 + 76n*g - 12n2. Let v be i(6). Round v to the nearest one thousand. 5000 Let r = -0.35760532 - -35.35763432. Let w = r + -35. What is w rounded to five dps? 0.00003 Let j(x) = -x2 - 6x - 5. Let v be j(-5). Let z(f) = f2 - 44. Let t be z(v). What is t rounded to the nearest 10? -40 Let k = -2.04 - -0.04. Let w = -1.9 - k. Let q = w + 0.1. What is q rounded to the nearest integer? 0 Suppose 2m = -m + 4800. What is m rounded to the nearest one thousand? 2000 Suppose -19223 = 8c + 33977. Round c to the nearest one thousand. -7000 Let y = 22906.021 + -22769. Let s = y - 0.021. Let o = -136.919 + s. Round o to 2 dps. 0.08 Let w = -9.4 + -44.6. Let m = 53.99999922 + w. Round m to 7 dps. -0.0000008 Let s = 0.26 + -0.244. Round s to 2 dps. 0.02 Let l = -109 + 110.32. Round l to 1 dp. 1.3 Let x = -11 + 14. Suppose -5g - 379995 = 2d, -2d = xg - 2g + 379999. What is d rounded to the nearest one hundred thousand? -200000 Let b = 59.5971461 + -59.85714. Let i = b - -0.26. Round i to 6 dps. 0.000006 Let u = 350873 - 670873. What is u rounded to the nearest one hundred thousand? -300000 Let v = 429.99533 + -430. Round v to three dps. -0.005 Let i = 0.26 - -17.14. Let l = i + -3.6. Round l to zero decimal places. 14 Let c = -10.9 + 3. Let z = 7.90132 + c. What is z rounded to four decimal places? 0.0013 Suppose -4o - 5200016 = 4w, -3w = 2w + o + 6500004. What is w rounded to the nearest one million? -1000000 Let z = -0.0099955 + 0.01. Round z to six dps. 0.000005 Let a = -36 - -35.612. Let v = 0.249 + a. Round v to two decimal places. -0.14 Suppose 59f = 62f - 498. Round f to the nearest one hundred. 200 Let h = 9439726 - 14759726. Round h to the nearest 1000000. -5000000 Let j = 14.25393 - 14.144. Let n = 7.85907 + j. Let h = -8 + n. Round h to 2 dps. -0.03 Let d = -0.618 + 0.34. What is d rounded to 2 dps? -0.28 Let b(a) be the third derivative of 1561a4/24 - a2. Let c be b(1). Let r = c - 35561. Round r to the nearest 10000. -30000 Let n(r) = 4066677r + 31. Let p be n(-3). What is p rounded to the nearest one million? -12000000 Let n = -1.6 - -1.4. Let b = 0.229 + n. Round b to two decimal places. 0.03 Let d = 28 - 28.55. Let q = 0.05 - d. Let l = q + -0.5988. Round l to three decimal places. 0.001 Let i = 139226438.999957 - 139226496. Let s = -63 + 120. Let p = s + i. Round p to five dps. -0.00004 Let v = -48.63 - -49. What is v rounded to one dp? 0.4 Let y = 1.58 - 1.377. Let v = -1.5704 - -20.1674. Let k = v + y. Round k to zero dps. 19 Let g = -7 - -12. Suppose -gk + 328 = -k. What is k rounded to the nearest ten? 80 Let f(a) = 583335a - 10. Let i be f(6). Round i to the nearest one million. 4000000 Suppose -94200 = 2g - 8g. What is g rounded to the nearest one thousand? 16000 Let z = 0.62 + -0.5. Let m = -50.68 + 50.80007. Let g = z - m. What is g rounded to 4 decimal places? -0.0001 Suppose 3v + 2729996 = -2r, -3r = -0v - v - 910006. Round v to the nearest 100000. -900000 Let b be (60/50)/(3/10). Let a(y) = -4y + 1. Let g be a(b). Round g to the nearest integer. -15 Let x = -11338882556.00000202 + 11338882450. Let t = x + 106. What is t rounded to 7 dps? -0.000002 Let t(r) = r3 - 15r*2 + 10r + 14. Suppose 3j - 48 = d, 2d = 4j - 51 - 13. Let i be t(j). Round i to the nearest one hundred. 400 Let x = -1.24 - -68.24. Let v = x - 172. Let g = v + 104.99999829. Round g to 7 decimal places. -0.0000017 Let b = 0.62902 - 0.63. Round b to 4 decimal places. -0.001 Suppose 5i - 48 = -8. Suppose 3v = 3p - 1259988, -5p - 1259984 = -ip + 4v. What is p rounded to the nearest 100000? 400000 Suppose 0 = 3x - 939971 + 3909971. Round x to the nearest 100000. -1000000 Let c = 0.80000036 + -0.8. What is c rounded to seven dps? 0.0000004 Let c = 233.9449 - 224.946. Let b = -9 + c. Round b to four dps. -0.0011 Let q = -154220 + 218220. What is q rounded to the nearest 10000? 60000 Let p(u) = 3300000u. Let c be p(-5). Round c to the nearest one million. -17000000 Let r = 6 - 9. Let l = r + 3. Suppose -2x = -lx - 5y - 16, y = x - 5. Round x to the nearest ten. 0 Suppose -3h + 2a - 5a = 729012, -728992 = 3h - 2a. What is h rounded to the nearest ten thousand? -240000 Let q = 0.07 + -0.04. Let j = q + -0.02999994. Round j to seven dps. 0.0000001 Let a(l) = -2840l*3 - 18l*2 + 10l - 8. Let m be a(12). What is m rounded to the nearest 100000? -4900000 Suppose 0 = -6c + 4c + 3f - 371, -c + 3f - 181 = 0. Round c to the nearest 100. -200 Let i(j) be the first derivative of -77j2/2 - 8j - 2. Let r be i(6). What is r rounded to the nearest one hundred? -500 Let p = -61.0018 + 61. What is p rounded to three dps? -0.002 Suppose -7m - 3m = 209000. What is m rounded to the nearest ten thousand? -20000 Let v = -19.71 + 20. Let m = v - 0.2968. What is m rounded to 3 dps? -0.007 Let d = -4495 + 27995. Round d to the nearest 1000. 24000 Let q = -3.95 + 4. Let a = 0.0500001 - q. Round a to seven decimal places. 0.0000001 Suppose 4u + 4650008 = -5i, -u + 5u = 3i + 2789992. Round i to the nearest 100000. -900000 Suppose 19 = 2x + 4f - 3f, 0 = -4x - 3f + 41. Round x to the nearest ten. 10 Let y = -65 - -116. Let q = -34 + y. Let n = -13.9 + q. What is n rounded to the nearest integer? 3 Let j = 16.79982 + -16.8. What is j rounded to four decimal places? -0.0002 Let z = 1.707 - -0.003. What is z rounded to 1 dp? 1.7 Let o = 461 + -461.000000782. Round o to 7 dps. -0.0000008 Let m(x) = -x3 + 4x*2 - x - 6. Let v be m(3). What is v rounded to the nearest 1000000? 0 Let b = -32 + 31.999963. Round b to five decimal places. -0.00004 Suppose 2r + a - 526 = 572, 2r + 2a = 1096. Suppose r = l + 4k, -k - 101 = 4l - 2376. Round l to the nearest one hundred. 600 Let p(w) = -w*3 + 3w*2 + 5w - 5. Let s be p(4). Let o = s + 1. Let c be -4 + 3 - (689999 - o). What is c rounded to the nearest one hundred thousand? -700000 Let v = 332422.586 - 332502.5859931. Let s = -80 - v. Round s to six dps. -0.000007 Suppose w + 6w + 854000 = 0. What is w rounded to the nearest 10000? -120000 Suppose -3x + 79 = -s - 8, x = 2s + 189. Let h be ((-25)/20)/(2/s). What is h rounded to the nearest 10? 60 Let a = 1844405916697 + -1844406407573.9700027. Let h = a + 490877. Let u = 0.03 - h. What is u rounded to 6 decimal places? 0.000003 Suppose -2h + 3 = -h. Suppose -hp + 0p + 4y = 1368, -p - 475 = 5y. What is p rounded to the nearest 100? -500 Let q = -261 - -284.6. Let g = q + -27. Round g to zero dps. -3 Let j = -58.8 + 47. Let k = 8.6 + -1.6. Let w = j + k. What is w rounded to the nearest integer? -5 Let m = 3 + -2.98. Let w = 0.095 - m. Round w to 2 dps. 0.08 Let l(q) = -q. Let c be l(-2). Suppose -cb = -2p + 1519994, 3b = 4b - 3. What is p rounded to the nearest 100000? 800000 Suppose -3w - 239 = -t, -4 = -2t + 6. What is w rounded to the nearest 10? -80 Let r = 78.01 - 77. Let j = 161490.99049 - 161492. Let l = j + r. Round l to 4 dps. 0.0005 Let n = -9882496 - -5529378. Let g = n + -3507451. Let r = 2860569 + g. Round r to the nearest 1000000. -5000000 Let n = 1.28 - -0.02. Let h = 37.7 + n. Let c = 39.00000037 - h. Round c to seven dps. 0.0000004 Let y = 2 + -6. Let u = -4.148 - y. Round u to two dps. -0.15 Let q(z) = 293z3 + z2 - 9z - 8. Let w be 3/(((-6)/(-16))/1). Let t be q(w). Round t to the nearest 100000. 200000 Let w = -0.04 - -2.71. Round w to 1 dp. 2.7 Let r = -112.4 + 123. What is r rounded to zero decimal places? 11 Let t = -93 + 65. Let g be (-1 + 3)/((-12)/318). Let i = t - g. Round i to the nearest 10. 30 Let p = 1 + 27. Let a = p + -28.0000088. What is a rounded to 6 decimal places? -0.000009 Let d = -0.51 - 28.49. Let c = d - -28.999971. What is c rounded to 5 decimal places? -0.00003 Let p = 1.79 + -2.047. Let a = -36.84	{ "pile_set_name": "DM Mathematics" }
re the prime factors of (15/(-3))/(-1) + g? 5 Let l be (((-6)/2)/(-3))/1. What are the prime factors of (-2 - l) + 26 + -6? 17 Let n(o) = 6o + 78o*2 + 3o - 85o2 + o3 - 9. Let l(x) = -x3 + 3x*2 + 5x + 2. Let s be l(4). List the prime factors of n(s). 3 Let j(a) = -2a2 + 13a + 11. What are the prime factors of j(7)? 2 Suppose 0 = -2k - 0k - 3z + 188, -449 = -5k + 3z. List the prime factors of k. 7, 13 Suppose 7f - 136 = 3f. List the prime factors of f. 2, 17 Suppose -3k + 32 = -13. Let j = k + 10. Suppose 2r = 4i - 32, -r + 0 = -3i + j. What are the prime factors of i? 3 Let u be (-1)/(-5) + 276/(-30). List the prime factors of ((-24)/u)/((-10)/(-105)). 2, 7 Let t(y) = y2 + 3y + 2. Let h be t(-3). Suppose g - 14 = -h. List the prime factors of g. 2, 3 Let k(f) = 3f + 1. Let c be k(3). Suppose 0 = -2b - 3b + c. What are the prime factors of b? 2 Let a(m) = -7m + 3. Let l be a(2). Let k(d) = 6d - 4. Let u be k(2). List the prime factors of l/(-2) + (-4)/u. 5 Suppose 0 = -3z - 2r + 55, 90 - 9 = 4z - 5r. List the prime factors of z. 19 Let n(b) be the second derivative of b3/6 + 3b*2 - 6b. List the prime factors of n(6). 2, 3 Let l(b) = -3b + 76. What are the prime factors of l(21)? 13 Let c(y) = -y. Let u(i) = -i2 + 5i - 16. Let m(r) = -6c(r) - u(r). List the prime factors of m(0). 2 Let t(r) = -r3 + 5r*2 - 3r - 2. Let a be -1(-15)/3 - 1. Let o be t(a). What are the prime factors of 3 + -2 + (o - 1)? 2 Let g(x) = -3x + 2. Let u(b) = b*2 + 6b + 2. Let k be u(-5). List the prime factors of g(k). 11 Let r(x) be the first derivative of -x*3/3 + 8x*2 - 7x - 3. List the prime factors of r(12). 41 Let q be (32/6)/4-3. List the prime factors of 2/8 + (-43)/q. 11 Let q be (-26)/(-8) + (-1)/4. Suppose 0 = d + 4 + q. Let w = d - -15. What are the prime factors of w? 2 Let u = 0 - -9. Let s = u - 4. List the prime factors of s. 5 Let y(b) = -3b*2 + b. Let v be y(-3). Let g = v - -51. What are the prime factors of g? 3, 7 Let b = 80 - -76. Let z be (2 - (1 - 0))2. What are the prime factors of z/(-5) - b/(-15)? 2, 5 Let s = -18 - -32. Suppose -z + 2z = 3k - 8, k + 4 = 2z. List the prime factors of (-48)/(-21) - z/s. 2 Let s(t) = -2t - 6. Let m be s(-4). Suppose mw - 1 = 5. What are the prime factors of 5 - w2/2? 2 List the prime factors of (7/2)/(10/40). 2, 7 List the prime factors of (-14)/(-6)(15 - 6). 3, 7 Let n = -13 - 11. Let s = -17 - n. What are the prime factors of s? 7 Suppose 4z = -4d + 920, -2d - 20 + 16 = 0. List the prime factors of z. 2, 29 Suppose d - 3d + 88 = 0. What are the prime factors of d? 2, 11 Let z(j) = j3 - 8j*2 + 2j - 7. Suppose 11 = 3w - 13. List the prime factors of z(w). 3 Suppose 4q = -4c, 2q = -q + 5c + 16. Suppose -3r + 260 = qr. List the prime factors of r. 2, 13 Let l be (-2 - 21)/(2 - 3). Suppose -4b = -2r, 3b - 4b + 2r = 0. Suppose b = -4o + l + 25. What are the prime factors of o? 2, 3 Let m(a) = -a3 + 3a*2 + 4a + 2. Let g be m(4). Suppose z = gz. Suppose -4u + 4 + 44 = z. What are the prime factors of u? 2, 3 Let y(w) be the third derivative of 1/8w4 + w2 + 0w + 0 + 2/3w3. List the prime factors of y(3). 13 Let j(k) = k3 + 6k*2 - 5k + 9. List the prime factors of j(-5). 59 Let p = 186 - 272. Let b = 168 + p. Suppose 2s + 4 = d - 2, 3s = -5d + b. What are the prime factors of d? 2, 7 Let t = 1 + 1. Suppose tr = 6r - 48. List the prime factors of r. 2, 3 Suppose -176 = -2h + x - 13, h = 3x + 89. List the prime factors of h. 2, 5 Suppose -5v + 22 = -3. Suppose -4u - vb + 3 = 0, -6b - 12 = -4u - 2b. Suppose -18 = -up - d, -3d - 6 = -p - 5d. List the prime factors of p. 2, 5 Suppose 5x = 4x - 5s - 1, -3x - 3 = -4s. List the prime factors of (x - -2)1 + 7. 2 Suppose 0 = -6y + 5y + 11. What are the prime factors of y? 11 List the prime factors of (1/20 - -1)90. 2, 3, 5 Let q = 50 + 25. What are the prime factors of q? 3, 5 Let l(x) = -x*2 + 11x - 13. Let z(g) = -2g + 3. Let o be z(-4). Let b be l(o). Let y = -8 - b. List the prime factors of y. 5 Let i(q) = 2q - 2. Let u be i(7). Let j = 24 - u. What are the prime factors of j? 2, 3 Let r = 2 + 0. Suppose -rd = 6j - j + 115, j - 2d + 23 = 0. Let i = j - -32. What are the prime factors of i? 3 Let p = -11 - -7. Let n = p - -7. Suppose -f + 6 + n = 0. List the prime factors of f. 3 Suppose -347 = -5j - 132. List the prime factors of j. 43 List the prime factors of -3 - (-3 + -128 - 0). 2 Let c = -20 - -14. What are the prime factors of (34/(-3))/(4/c)? 17 What are the prime factors of (-48)/(-216) - 1807/(-9)? 3, 67 Suppose 0 = 4u + 24 + 32. Let w be 3(u/6 + 1). Let o = w - -7. What are the prime factors of o? 3 Let h(z) = -z*3 + 8z*2 - 8z + 10. Let y be h(7). Suppose -48 = -4r - yf, r = 2r - f - 19. List the prime factors of r. 3, 5 Suppose -t + 12 = 2t + 3o, 2t - 4o + 4 = 0. Suppose -2d - 2c - 82 = 0, 4d - 4c = td - 106. What are the prime factors of ((-2)/((-6)/d))/(-1)? 3, 5 Let m = 115 - 58. Suppose -4u - 8 = -4j, 2j - 25 = u - 6u. Suppose jq - 28 = m. List the prime factors of q. 17 Let j(f) = -48f*2 + 1. Let p be j(1). Let d = 73 + p. List the prime factors of d. 2, 13 Let g = -21 + 65. List the prime factors of g. 2, 11 Let j = -1 + 6. Suppose j = k - 4. List the prime factors of k. 3 Suppose -5c - 25 + 0 = 0, 75 = 5l - 2c. List the prime factors of l. 13 Let k = -15 - -21. What are the prime factors of (k/(-9))/(6/(-81))? 3 Suppose -2r + 5f - 8 = -4r, 3f = 0. Suppose 0 = rq - 7 - 1. Suppose -s + 13 = qj, s + 4s - j = 76. List the prime factors of s. 3, 5 Suppose 4u = 5x - 2 + 3, 2x + 6 = -4u. Let n = u - -1. Suppose n = 4m - 34 + 10. List the prime factors of m. 2, 3 Let k = 35 - 19. Suppose 0 = -4q - 6u + 2u - 4, 0 = -q - 4u - k. Suppose q = 5t - 6. What are the prime factors of t? 2 Let o(q) = q2 + 3q + 1. Let g be o(-4). Suppose -gh - 39 = 2b, 3b + 52 = -h - 13. Let n = b + 32. List the prime factors of n. 2, 5 Let n(k) = k3 - 7k*2 - 9k + 24. What are the prime factors of n(10)? 2, 3, 13 Let a be (-7)/(-2)(-4)/2. Let m(v) = -v - 3. What are the prime factors of m(a)? 2 Let q = -8 + 4. Let b be (-2)/4 - (-526)/q. What are the prime factors of b/(-21) + (-2)/7? 2, 3 Let m(z) = -z3 - 6z*2 + 6z - 5. Let y = 24 + -6. Let f be -2132/y. What are the prime factors of m(f)? 2 Suppose -5x + 5o = 0, 2x + 3 - 23 = -3o. Suppose xk + 0 = 4. List the prime factors of (-3)/k - -1 - -14. 2, 3 Let q = 8 - 10. List the prime factors of 6/936 - q. 2, 13 Suppose -4p = -3u + 86, -4u + p + 0p + 106 = 0. Suppose -3c - 2d = -2c - 6, 2c - 3d = u. List the prime factors of c. 2, 5 Let m = -164 + 271. What are the prime factors of m? 107 Suppose -5r + r + 4 = 0. Let n(m) = r - m*2 - 6 - 10m + 3m. List the prime factors of n(-5). 5 Let t(z) = z3 - 8z*2 + 9z - 10. Let x be t(7). Let j = -18 - -70. Suppose y = -5m - 3 - 5, xy - m - j = 0. List the prime factors of y. 2, 3 Let x = -2 + -2. Let l = 1 - x. Suppose -lq + 10 = -0. List the prime factors of q. 2 Let w(n) = -n2 + 4n + 11. What are the prime factors of w(5)? 2, 3 What are the prime factors of 3(17 + (-2 - -6))? 3, 7 Suppose -2x = -2a - 8, 2a = x + 1 - 4. Suppose 0 = -xq + 103 - 13. What are the prime factors of q? 2, 3 Suppose v = b - 3v - 63, -5b + 4v = -315. Suppose -7n + 2n - g = -b, -n + 4g = 0. What are the prime factors of n? 2, 3 Suppose 4h - 153 = -5z, 2z - 4z - 3h + 64 = 0. Let i be (1/1)/(2/36). Let a = z - i. List the prime factors of a. 11 Let o(i) = i + 7. Let p be o(-6). Let r = p - -4. What are the prime factors of r? 5 Let a(h) = 2h - 12. Let k be a(9). Let t be (2 - 39/k)-2. List the prime factors of (8/2)/(3/t). 2, 3 Let o(u) = 3u2 - u - 1. Let d be o(-1). Let w = 7 - d. List the prime factors of w. 2 Let p = -62 + 113. What are the prime factors of p? 3, 17 Suppose -q - 2 = 6. Let s = 14 + q. List the prime factors of s. 2, 3 Let z be 5(-1 - (-2 + 2)). Let g be 19/5 - 1/z. Suppose -gj + 27 + 17 = 0. List the prime factors of j. 11 Suppose -5t + 2t = -408. Suppose -5s = -3o - o - 170, -4s = -4*o - t. List the prime factors of s. 2, 17 Let f(d) = d -	{ "pile_set_name": "DM Mathematics" }
2, 3, 391249 What are the prime factors of 169320? 2, 3, 5, 17, 83 List the prime factors of 812070. 2, 3, 5, 7, 1289 What are the prime factors of 1765192? 2, 11, 13, 1543 List the prime factors of 10801. 7, 1543 What are the prime factors of 1363224? 2, 3, 79, 719 List the prime factors of 4857558. 2, 3, 29, 27917 List the prime factors of 4955612. 2, 1238903 What are the prime factors of 554562? 2, 3, 30809 List the prime factors of 5372553. 3, 79, 22669 What are the prime factors of 31650113? 11, 2877283 What are the prime factors of 213720? 2, 3, 5, 13, 137 List the prime factors of 8948853. 3, 431, 769 List the prime factors of 731315. 5, 13, 11251 List the prime factors of 11045680. 2, 5, 138071 List the prime factors of 106322. 2, 53161 List the prime factors of 3507523. 23, 152501 List the prime factors of 14755100. 2, 5, 147551 What are the prime factors of 1770048? 2, 3, 7, 439 List the prime factors of 1275518. 2, 109, 5851 List the prime factors of 23079611. 101, 228511 What are the prime factors of 623487? 3, 37, 41, 137 What are the prime factors of 4028385? 3, 5, 101, 2659 What are the prime factors of 11713986? 2, 3, 17, 38281 What are the prime factors of 2398271? 29, 82699 List the prime factors of 966755. 5, 239, 809 What are the prime factors of 29105263? 11, 2645933 List the prime factors of 92878. 2, 46439 List the prime factors of 696433. 696433 List the prime factors of 13581. 3, 503 List the prime factors of 23284841. 977, 23833 What are the prime factors of 76000? 2, 5, 19 What are the prime factors of 344949? 3, 11, 10453 What are the prime factors of 2196421? 911, 2411 What are the prime factors of 1634032? 2, 73, 1399 What are the prime factors of 6060327? 3, 7, 13, 79, 281 List the prime factors of 1146464. 2, 11, 3257 What are the prime factors of 121078? 2, 60539 List the prime factors of 259571. 13, 41, 487 List the prime factors of 1118469. 3, 11, 33893 What are the prime factors of 622104? 2, 3, 7, 23 What are the prime factors of 10213368? 2, 3, 11, 3517 List the prime factors of 961701. 3, 13, 24659 List the prime factors of 4188578. 2, 631, 3319 List the prime factors of 901697. 17, 29, 31, 59 What are the prime factors of 10184973? 3, 293, 11587 List the prime factors of 10542091. 7, 17, 88589 What are the prime factors of 16111700? 2, 5, 11, 97, 151 List the prime factors of 2274234. 2, 3, 379039 List the prime factors of 609355. 5, 47, 2593 List the prime factors of 129803. 129803 What are the prime factors of 4607437? 31, 148627 List the prime factors of 26877593. 23, 419, 2789 What are the prime factors of 9857720? 2, 5, 59, 4177 List the prime factors of 1297183. 37, 35059 List the prime factors of 5783363. 5783363 List the prime factors of 483194. 2, 241597 List the prime factors of 1756651. 13, 163, 829 List the prime factors of 37801180. 2, 5, 41, 46099 What are the prime factors of 7229245? 5, 23, 37, 1699 What are the prime factors of 9366744? 2, 3, 390281 List the prime factors of 23343486. 2, 3, 3890581 List the prime factors of 8261357. 13, 59, 10771 List the prime factors of 254783. 254783 List the prime factors of 1520334. 2, 3, 84463 What are the prime factors of 2955738? 2, 3, 29, 16987 What are the prime factors of 152598? 2, 3, 29, 877 What are the prime factors of 241837? 257, 941 List the prime factors of 352623. 3, 117541 List the prime factors of 252201. 3, 84067 What are the prime factors of 11818? 2, 19, 311 What are the prime factors of 3301521? 3, 113, 9739 List the prime factors of 1714368. 2, 3, 8929 List the prime factors of 10916767. 10916767 What are the prime factors of 777104? 2, 17, 2857 What are the prime factors of 1391787? 3, 154643 What are the prime factors of 208779? 3, 69593 List the prime factors of 20596196. 2, 5149049 List the prime factors of 648948. 2, 3, 41, 1319 List the prime factors of 10070656. 2, 29, 2713 What are the prime factors of 2281600? 2, 5, 23, 31 List the prime factors of 528222. 2, 3, 88037 What are the prime factors of 299324? 2, 74831 What are the prime factors of 172215? 3, 5, 43, 89 List the prime factors of 4025659. 11, 365969 What are the prime factors of 179048? 2, 22381 List the prime factors of 10038765. 3, 5, 11, 5531 List the prime factors of 27201699. 3, 7, 113, 3821 What are the prime factors of 80365? 5, 16073 What are the prime factors of 391948? 2, 97987 What are the prime factors of 453850? 2, 5, 29, 313 What are the prime factors of 753279? 3, 193, 1301 What are the prime factors of 19670572? 2, 353, 13931 List the prime factors of 15301946. 2, 11, 23, 30241 List the prime factors of 1308116. 2, 17, 19237 What are the prime factors of 3117636? 2, 3, 28867 List the prime factors of 1460407. 13, 112339 List the prime factors of 3068671. 19, 373, 433 What are the prime factors of 100782? 2, 3, 11, 509 List the prime factors of 1603481. 11, 145771 List the prime factors of 2772174. 2, 3, 41, 59, 191 What are the prime factors of 71803? 59, 1217 List the prime factors of 74139. 3, 13, 1901 List the prime factors of 11148329. 149, 74821 What are the prime factors of 412214? 2, 11, 41, 457 What are the prime factors of 427301? 7, 61043 List the prime factors of 5993272. 2, 181, 4139 List the prime factors of 448946. 2, 224473 List the prime factors of 379895. 5, 75979 List the prime factors of 11675302. 2, 5837651 What are the prime factors of 1937180? 2, 5, 7, 101, 137 List the prime factors of 943109. 17, 29, 1913 What are the prime factors of 1784186? 2, 892093 List the prime factors of 5429718. 2, 3, 7, 43093 What are the prime factors of 5404670? 2, 5, 43, 12569 List the prime factors of 79153. 79153 What are the prime factors of 1929912? 2, 3, 97, 829 What are the prime factors of 460130? 2, 5, 11, 47, 89 What are the prime factors of 53149? 53149 List the prime factors of 115759. 7, 23, 719 What are the prime factors of 7922749? 131, 197, 307 List the prime factors of 4739785. 5, 113, 8389 What are the prime factors of 7516083? 3, 2505361 List the prime factors of 344670. 2, 3, 5, 11489 List the prime factors of 32049672. 2, 3, 23, 58061 What are the prime factors of 774009? 3, 109, 263 List the prime factors of 18912411. 3, 7, 89, 3373 What are the prime factors of 2723598? 2, 3, 31, 1627 List the prime factors of 18257430. 2, 3, 5, 608581 What are the prime factors of 7129358? 2, 17, 209687 What are the prime factors of 2019969? 3, 7, 32063 What are the prime factors of 16844957? 16844957 What are the prime factors of 527766? 2, 3, 87961 List the prime factors of 838196. 2, 209549 What are the prime factors of 6411374? 2, 3205687 List the prime factors of 350817. 3, 337, 347 What are the prime factors of 4741582? 2, 773, 3067 List the prime factors of 724591. 7, 17, 6089 List the prime factors of 237466. 2, 37, 3209 What are the prime factors of 1378739? 409, 3371 What are the prime factors of 22401? 3, 19, 131 What are the prime factors of 14096849? 13, 1084373 What are the prime factors of 193680? 2, 3, 5, 269 List the prime factors of 56478. 2, 3, 9413 What are the prime factors of 689668? 2, 7, 24631 What are the prime factors of 2232851? 73, 419 What are the prime factors of 53467? 127, 421 List the prime factors of 947618. 2, 7, 113, 599 List the prime factors of 760742. 2, 47, 8093 What are the prime factors of 3495376? 2, 218461 What are the prime factors of 188774? 2, 37, 2551 List the prime factors of 1978065. 3, 5, 113, 389 List the prime factors of 681062. 2, 503, 677 List the prime factors of 102915. 3, 5, 2287 What are the prime factors of 3823824? 2, 3, 29, 41, 67 List the prime factors of 823270. 2, 5, 7, 19, 619 List the prime factors of 36768. 2, 3, 383 What are the prime factors of 11276? 2, 2819 What are the prime factors of 200395? 5, 13, 3083 What are the prime factors of 26935912? 2, 3366989 List the prime factors of 20776552. 2, 661, 3929 What are the prime factors of 4385420? 2, 5, 13, 101, 167 What are the prime factors of 29267152? 2, 1829197 List the prime factors of 20423350. 2, 5, 97, 4211 List the prime factors of 134273. 19, 37, 191 List the prime factors of 54480. 2, 3, 5, 227 List the prime factors of 1166325. 3, 5, 15551 List the prime factors of 210684. 2, 3, 97, 181 List the prime	{ "pile_set_name": "DM Mathematics" }
7? 22494730 What comes next: 187975, 751949, 1691907, 3007849? 4699775 What is next in 3352633, 13410529, 30173689, 53642113, 83815801, 120694753? 164278969 What is the next term in -7363018, -7363016, -7363014, -7363012, -7363010? -7363008 What is the next term in 123614, 120937, 118260, 115583, 112906? 110229 What is the next term in -432081, -432140, -432225, -432336? -432473 What is next in 2708068256, 2708068256, 2708068258, 2708068262, 2708068268, 2708068276? 2708068286 What comes next: -1580160, -1580159, -1580156, -1580151, -1580144, -1580135? -1580124 What comes next: -466042, -1864255, -4194618, -7457131, -11651794, -16778607, -22837570? -29828683 What is the next term in 79068375, 79068374, 79068373, 79068372, 79068371? 79068370 What is the next term in -868132, -867814, -867284, -866542? -865588 What comes next: -4199399, -8398823, -12598249, -16797677, -20997107, -25196539, -29395973? -33595409 What is the next term in 447220372, 447220373, 447220374? 447220375 What is the next term in -120476, -120409, -120342? -120275 What is the next term in -1529071, -3058141, -4587211, -6116281, -7645351, -9174421? -10703491 What is the next term in 23669, 23705, 23759, 23843, 23969, 24149, 24395, 24719? 25133 What comes next: -658, -82, 696, 1778, 3266, 5262, 7868? 11186 What is next in -1904, -2764, -3646, -4562, -5524? -6544 What is the next term in -2911, -2855, -2755, -2611? -2423 What is the next term in -653694, -1307102, -1960512, -2613924, -3267338? -3920754 What comes next: -711, -1273, -1707, -2013? -2191 What is the next term in 18272084, 18272087, 18272090? 18272093 What comes next: -813375, -1626980, -2440585, -3254190, -4067795? -4881400 What is the next term in 659, 960, 1513, 2318, 3375, 4684, 6245? 8058 What comes next: 1430267, 1430288, 1430309? 1430330 What is next in 2504, 2634, 2788, 2960, 3144? 3334 What is next in 17904072, 35808144, 53712216? 71616288 What is the next term in 8717, 40405, 95061, 172691, 273301? 396897 What is the next term in 898, 1556, 1768, 1330, 38? -2312 What is next in -1823, -3318, -4827, -6350, -7887, -9438, -11003? -12582 What is next in 2116, 5281, 7998, 10261, 12064? 13401 What comes next: -3441, -6810, -10137, -13404, -16593? -19686 What comes next: -2916, -5899, -8886, -11877, -14872, -17871, -20874? -23881 What is the next term in -764441, -764491, -764541? -764591 What is next in -3293, 15539, 34371, 53203, 72035, 90867? 109699 What is next in -17186, -34488, -51838, -69242, -86706, -104236, -121838? -139518 What is next in -5512, -5550, -5614, -5704, -5820? -5962 What comes next: -275215, -275231, -275247, -275263, -275279, -275295? -275311 What is the next term in -113, -172, -227, -278, -325, -368, -407? -442 What is the next term in -4640, -9051, -13452, -17837, -22200? -26535 What comes next: -1525162, -3050312, -4575452, -6100582? -7625702 What is next in 65997132, 131994264, 197991396, 263988528, 329985660? 395982792 What is next in 36918, 36956, 36994, 37032, 37070? 37108 What is next in -2017939, -4035893, -6053847? -8071801 What comes next: -34374, -60616, -86848, -113064, -139258? -165424 What comes next: 1432, 9366, 17300? 25234 What is the next term in 49207254, 98414509, 147621764? 196829019 What is the next term in -17062, -17173, -17376, -17671, -18058, -18537, -19108? -19771 What comes next: 1114581, 2228378, 3342177, 4455978, 5569781, 6683586, 7797393? 8911202 What is next in 172582, 689920, 1552148, 2759266, 4311274, 6208172? 8449960 What comes next: -54426, -108913, -163500, -218235, -273166? -328341 What is next in -188357, -189205, -190053, -190901, -191749, -192597? -193445 What comes next: 2922486, 2922235, 2921984? 2921733 What is the next term in -2446, -3550, -4768, -6106, -7570, -9166, -10900, -12778? -14806 What is the next term in 939408, 3757640, 8454694, 15030570, 23485268, 33818788, 46031130? 60122294 What comes next: -5721, -24438, -56155, -100866, -158565, -229246, -312903, -409530? -519121 What is the next term in -4045293, -4045294, -4045295? -4045296 What is the next term in -1673267, -1673267, -1673259, -1673237, -1673195, -1673127, -1673027? -1672889 What is next in 1124465, 1124457, 1124449, 1124441? 1124433 What is next in 25531, 25421, 25311? 25201 What is next in -3911299, -3911288, -3911261, -3911212, -3911135, -3911024? -3910873 What is the next term in -4038, -8180, -12418, -16752, -21182? -25708 What comes next: 420, 1752, 3992, 7140, 11196, 16160, 22032? 28812 What comes next: 1799326, 3598510, 5397696, 7196884, 8996074, 10795266? 12594460 What is the next term in -988258, -988285, -988312, -988339? -988366 What is next in 10928, 14856, 18784? 22712 What comes next: 5734, 19868, 43424, 76402, 118802, 170624? 231868 What is the next term in -25715, -94457, -209025, -369413, -575615, -827625? -1125437 What comes next: -853, -571, -129, 479, 1259, 2217? 3359 What is next in 3882, 5971, 8060, 10149, 12238, 14327? 16416 What is next in 51203, 204853, 460911, 819371, 1280227? 1843473 What comes next: -13466, -52815, -118040, -209141? -326118 What is next in 3750974, 7501943, 11252912? 15003881 What comes next: 17909, 17789, 17655, 17501, 17321, 17109? 16859 What is next in 9505, 9453, 9391, 9319? 9237 What is next in -415460, -415435, -415392, -415331, -415252? -415155 What comes next: -130060152, -260120299, -390180444, -520240587, -650300728? -780360867 What is next in 17848, 71433, 160758, 285823, 446628? 643173 What is next in -48682, -48089, -47496, -46903? -46310 What comes next: -1896631, -1896792, -1896955, -1897120, -1897287, -1897456, -1897627? -1897800 What is the next term in 79365, 79545, 79831, 80217, 80697, 81265? 81915 What comes next: 11727, 46826, 105325, 187230, 292547? 421282 What is the next term in -31976673, -31976672, -31976671, -31976670? -31976669 What is next in -230620, -1845102, -6227278, -14760994, -28830096? -49818430 What is next in 3813, 7996, 12911, 18924, 26401, 35708, 47211, 61276? 78269 What is next in -1172766, -1171974, -1171182, -1170390, -1169598, -1168806? -1168014 What is next in -494396, -494478, -494630, -494858, -495168, -495566, -496058? -496650 What comes next: -1484, -2737, -6162, -12845, -23872, -40329, -63302, -93877? -133140 What is next in -615859212, -615859209, -615859206, -615859203, -615859200, -615859197? -615859194 What comes next: 9838692, 19677447, 29516202, 39354957, 49193712, 59032467? 68871222 What comes next: -720, -552, 504, 2448? 5280 What comes next: -6098, -25860, -58798, -104912, -164202? -236668 What is next in 2775351, 5550698, 8326045, 11101392, 13876739? 16652086 What is the next term in 42282249, 42282250, 42282251, 42282252, 42282253? 42282254 What is the next term in -1056, -1130, -1328, -1662, -2144, -2786, -3600, -4598? -5792 What comes next: -1502707, -1502707, -1502705, -1502701, -1502695, -1502687? -1502677 What is next in 724658, 1449259, 2173884, 2898533, 3623206, 4347903, 5072624? 5797369 What is the next term in -236604, -235911, -235218, -234525? -233832 What is the next term in -749108, -1498240, -2247372, -2996504? -3745636 What is the next term in 4439, 17429, 38955, 69017? 107615 What is next in 9865, 9933, 10059, 10243, 10485? 10785 What is the next term in 5187, 4789, 4391, 3993? 3595 What is next in 32997874, 65995745, 98993616? 131991487 What is the next term in -77963544, -155927088, -233890632? -311854176 What is next in -656623, -656636, -656649, -656662, -656675, -656688? -656701 What is the next term in 8193, 8247, 8313, 8391, 8481? 8583 What is the next term in -1821673, -1821660, -1821639, -1821610, -1821573, -1821528? -1821475 What is the next term in -35150, -140617, -316378, -562433, -878782? -1265425 What comes next: -786693, -3146769, -7080229, -12587073, -19667301, -28320913, -38547909? -50348289 What is the next term in 253688, 2029519, 6849640, 16236197, 31711336? 54797203 What is next in -15129, -15120, -15107, -15096, -15093? -15104 What comes next: -302460, -604917, -907374, -1209831? -1512288 What comes next: -3828, -9368, -18602, -31530, -48152? -68468 What is next in 66836775, 66836774, 66836773, 66836772, 66836771? 66836770 What is next in -1923, -2049, -2183, -2325, -2475, -2633? -2799 What comes next: 4713406, 9426826, 1414	{ "pile_set_name": "DM Mathematics" }
+ 2i + 62. What is q(0)? 62 Let o(n) = -37n - 10. Determine o(3). -121 Let z(d) = 3d3 - 4d*2 + 2d - 5. Give z(0). -5 Let f(c) = -c*3 - 14c*2 - 11c + 8. Determine f(-13). -18 Let o(t) = t*2 - 4t + 6. Determine o(4). 6 Let a(x) = x*3 + 6x*2 + 2x - 4. Calculate a(-6). -16 Let m(g) = -4g - 9. Determine m(1). -13 Let r(a) = -5a - 10. Give r(-2). 0 Let d(x) = -7x3 + 2x*2 + x + 1. What is d(-1)? 9 Let j(m) = -11m + 69. Determine j(7). -8 Let k(m) = -2m + 36. Determine k(0). 36 Let f(r) = -r3 - 26r*2 + 54r - 47. What is f(-28)? 9 Let z(s) = s*3 - 15s*2 + 42s - 7. Calculate z(12). 65 Let k(p) = -3p - 10. Give k(-4). 2 Let k(v) = 7v + 308. What is k(-44)? 0 Let h(y) = -y*3 - 7y*2 + 3y + 8. What is h(-6)? -46 Let w(v) = v*2 - 11v - 12. Calculate w(12). 0 Let n(g) = g*2 + 3g + 2. Calculate n(-5). 12 Let u(z) = 3z2 + 82z - 50. What is u(-28)? 6 Let l(y) = -y + 13. Determine l(3). 10 Let q(z) = z*3 + 5z*2 - 3z - 5. What is q(-6)? -23 Let o(x) = -7x3 - 2x*2 + 2x. Give o(2). -60 Let r(u) = -u*2 - 20u - 51. What is r(-17)? 0 Let m(g) = -11g + 4. Determine m(-3). 37 Let w(t) = 5t + 13. Give w(-3). -2 Let o(x) = 4x - 78. Give o(28). 34 Let g(a) = 4a*2 + 20a. Calculate g(-5). 0 Let n(m) = 4m - 14. Calculate n(1). -10 Let i(v) = v2 - 10v - 3. What is i(0)? -3 Let f(p) = -6p + 14. What is f(5)? -16 Let t(h) = h3 - 9h*2 + 14h + 34. Calculate t(5). 4 Let c(n) = -n*2 - 3n + 6. Give c(-6). -12 Let r(u) = 2u2 - 28u + 32. What is r(12)? -16 Let g(h) = h*3 + 9h*2 - 13h - 24. What is g(-10)? 6 Let g(f) = f*3 + 7f*2 + 6f + 1. Determine g(-5). 21 Let o(h) = -17h - 10. Determine o(3). -61 Let k(y) = y3 - 8y*2 + 10y + 1. Determine k(7). 22 Let m(c) = 2c + 18. Calculate m(0). 18 Let h(y) = -y2 - 4y + 9. Calculate h(6). -51 Let r(v) = 2v3 - 20v*2 + 2v - 18. What is r(10)? 2 Let b(g) = -g*2 + 21g - 3. Determine b(21). -3 Let p(r) = -r*3 + 7r*2 + 9r - 6. What is p(8)? 2 Let z(a) = a*2 - 19a + 75. Determine z(13). -3 Let c(g) = g*2 + 6g - 3. Give c(-7). 4 Let h(t) = t*2 + 6t. What is h(-8)? 16 Let b(i) = 5i + 36. Give b(-10). -14 Let q(c) = -3c*2 - 51c + 16. Determine q(-17). 16 Let m(d) = 5d2 + 9d - 9. Give m(1). 5 Let o(n) = n*3 + 17n*2 - 18n - 4. Calculate o(-18). -4 Let m(f) = 10f + 139. Determine m(-14). -1 Let j(t) = t3 - 10t*2 + 14t - 10. Give j(7). -59 Let k(x) = x + 2. Give k(1). 3 Let c(x) = x*2 + 16x + 56. What is c(-12)? 8 Let a(m) = 51m - 1070. Calculate a(21). 1 Let h(t) = 11t - 2. What is h(4)? 42 Let d(s) = s*3 + 4s*2 - 12s - 49. Calculate d(-4). -1 Let b(w) = -2w2 + 2w + 11. What is b(5)? -29 Let i(u) = u3 - u2 + 2. Determine i(0). 2 Let g(r) = 2r3 + 2r*2 - 3r - 3. Give g(-2). -5 Let h(w) = -5w2 - 9w. Calculate h(-2). -2 Let z(u) = -u*2 + 8u + 5. Determine z(6). 17 Let q(x) = -x*2 + 2x - 11. Give q(8). -59 Let a(g) = g*3 - 6g*2 + 14g - 7. Determine a(2). 5 Let y(d) = -4d + 19. Calculate y(-7). 47 Let i(k) = k2 + 16k - 23. Calculate i(-17). -6 Let v(k) = k*2 + 8k - 86. What is v(-15)? 19 Let v(n) = n*2 - 53n + 200. Determine v(4). 4 Let q(x) = 16x - 1. Calculate q(1). 15 Let d(h) = 4h - 28. Calculate d(9). 8 Let r(v) = -v*3 + 9v*2 - 14v - 24. Give r(6). 0 Let u(t) = t*3 - 8t*2 - 17t + 11. Determine u(10). 41 Let b(l) = 42l - 88. Give b(2). -4 Let u(x) = -x3 - 18x*2 - 23x - 27. Give u(-17). 75 Let c(n) = 2n2 - 13n + 9. What is c(5)? -6 Let n(y) = -y*2 + 5y - 6. Determine n(8). -30 Let c(r) = -9r - 17. Determine c(-6). 37 Let h(w) = -w3 - 12w*2 - 15w - 2. What is h(-11)? 42 Let v(l) = -l*2 + l + 3. Give v(0). 3 Let i(f) = -8f - 31. Determine i(-5). 9 Let f(n) = -n*3 - 10n*2 - 18n - 8. Give f(-8). 8 Let l(n) = -n2 - n - 5. Calculate l(-7). -47 Let l(p) = p2 + 6p + 3. What is l(-3)? -6 Let w(r) = -3r*3 - 3r*2 + 3r + 5. Calculate w(-1). 2 Let t(c) = -c*3 + 3c*2 + 4c + 3. Determine t(4). 3 Let x(t) = 2t - 12. Determine x(4). -4 Let r(f) = -f2 - 3f + 5. Give r(-5). -5 Let p(w) = w*3 - 7w*2 + 12w - 3. Determine p(5). 7 Let o(b) = b*2 + 8b - 1. What is o(-8)? -1 Let c(w) = w*2 + 18w - 6. What is c(-8)? -86 Let i(d) = -d*2 - 9d - 44. Calculate i(-13). -96 Let z(j) = -j*3 + 3j*2 + 9. What is z(3)? 9 Let q(g) = -43g - 297. Give q(-7). 4 Let u(x) = x*3 - 13x*2 - 89x - 18. What is u(18)? 0 Let o(i) = 22i + 86. What is o(-4)? -2 Let y(u) = 4u + 49. What is y(-8)? 17 Let o(p) = -11p + 8. Give o(2). -14 Let n(b) = b3 - 8b*2 + 6b + 2. What is n(7)? -5 Let f(q) = -3q + 7. What is f(-7)? 28 Let q(w) = 4w*3 + 31w*2 - 8w. What is q(-8)? 0 Let p(q) = -q*2 - 8q - 10. Give p(-4). 6 Let y(o) = -o - 2. What is y(2)? -4 Let n(x) = x*3 - 8x*2 + 7x + 7. Determine n(7). 7 Let x(k) = -k*2 - 29k - 211. Determine x(-15). -1 Let d(q) = 7q2 + 18q - 17. Give d(-5). 68 Let x(k) = k*3 + 14k*2 + 12k - 23. Give x(-13). -10 Let u(f) = f*3 + 5f2 - 12. Determine u(-4). 4 Let r(x) = x2 - 7x - 4. Calculate r(-1). 4 Let r(o) = -o - 2. Give r(0). -2 Let k(o) = -10o - 446. Give k(-43). -16 Let g(c) = -3c3 + 6c - 3. Calculate g(2). -15 Let j(r) = 3r + 3. Give j(2). 9 Let m(p) = p2 - 4p - 2. Determine m(-2). 10 Let v(z) = -16z - 14. Give v(-9). 130 Let g(v) = -v2 - 18v + 59. Calculate g(-21). -4 Let g(y) = y*2 - 13y + 37. What is g(10)? 7 Let t(c) = -c3 + c2 + 87. What is t(0)? 87 Let m(s) = s*3 + 12s*2 + 9s - 16. Give m(-11). 6 Let u(d) = d - 12. Give u(-10). -22 Let n(t) = 26t2 - 3t. Calculate n(0). 0 Let a(b) = -7b + 25. Calculate a(-11). 102 Let h(f) = -f2 + 3f + 2. Calculate h(2). 4 Let s(q) = -q*2 + 18q - 31. What is s(15)? 14 Let k(p) = p*3 + 9p*2 + 11p + 9. Calculate k(-8). -15 Let t(s) = -3s - 12. Calculate t(-10). 18 Let q(f) = -5f*3 - 2f*2 + 5f + 3. What is q(3)? -135 Let s(g) = g*3 + 9g*2 + 5g - 7. Give s(-8). 17 Let m(f) = f*2 - 24f + 14. What is m(23)? -9 Let a(q) = -q*2 - 10q - 10. Give a(-7). 11 Let g(p) = 2p2 - 16p - 20. Calculate g(9). -2 Let f(i) = i*3 + 8i*2 - 20i - 12. What is f(-10)? -12 Let b(r) = -r*2 + 12r - 12. Give b(9). 15 Let b(h) = 7h3 + h2 - 4h - 3. What is b(-1)? -5 Let p(u) = -10u2 + 8. Calculate p(3). -82 Let d(g) = 2g*2 + 4. Give d(0). 4 Let y(g) = -3g - 25. Determine y(12). -61 Let x(l) = -l*3 + 2l*2 + 5l - 3. Give x(4). -15 Let l(c) = c*2 + 5c + 24. Calculate l(-3). 18 Let g(b) = 4b. Give g(-3). -12 Let n(a) = -7a - 14. What is n(-6)? 28 Let a(s) = 5s. Give a(14). 70 Let w(r) = -r2 + 20r - 22. What is w(13)? 69 Let f(j) = -j*3 - 4j*2 + 29j + 104. Calculate f(-6). 2 Let j(o) = 10o - 60. Calculate j(6). 0 Let t(i) = i2 - 27i + 4. Determine t(27). 4 Let o(y) = 5y. What is o(5)? 25 Let g(w) = -w3 + 7w*2 - 7w + 3. Give g(5). 18 Let n(t) = -t*3 + 14t*2 - 5t - 12. Calculate n(14). -82 Let u(f) = 67f - 469. Determine u(7). 0 Let j(y) = y3 + 10y*2 + 6y - 1. Calculate j(-9). 26 Let w(f) = 6f3 - 2f + 2. Determine w(-2). -42 Let p(s) = -4s2 - 17s - 23. Give p(-3). -8 Let t(q) = -2q - 24. What is t(-8)? -8 Let m(w) = -w3 - 5w*2 + 3w + 5. Determine m(-6). 23 Let j(h) = -h*3 + 6h*2 + 4h - 10. What is j(7)? -31 Let o(k) = k + 8. Calculate o(-10). -2 Let b(t) = -t*3 + 5t2 + t - 12. Give b(5). -7 Let i(n) = -n2 - n + 23. Calculate i(0). 23 Let u(h) = h*3 + 3h*2 - 3h + 10. What is u(-4)? 6 Let l(d) = d*3 + 4d*2 + 2d - 12. What is l(-4)? -20 Let c(x) = -x*2 + 6x + 23. Determine c(-8). -89 Let w(a) = -a*3 - 5a*2 - 2a - 7. Calculate w(-5). 3 Let f(y) = -2y3 + 10y*2 - 13y + 12. What is f(4)? -8 Let k(d) = 30d - 1. Calculate k(0). -1 Let r(y) = y3 + y2 + y + 5. Give r(0). 5 Let b(j) = 2j*2 + 42j + 163. Determine b(-5). 3 Let k(j) = 2j2 - 10j - 6. Give k(6). 6 Let m(b) = 2b2 - 7b + 5. Calculate m(4). 9 Let u(o) = -o*2 + 4o - 2. Determine u(8). -34 Let u(n) = -n*2 + 41n + 48. Calculate u(42). 6 Let t(v) = -v*3 - 3v*2 + 1. What is t(-5)? 51 Let g(q) = -38q + 29. Calculate g(1). -9 Let y(i) = i*3 + 24i*2 + 45i + 21. Calculate y(-22). -1 Let b(t) = -2t3 - t2 - 3t - 4. What is b(-2)? 14 Let n(f) = -f*3 - 3f**2 - 3. Give n(-5). 47 Let i(s	{ "pile_set_name": "DM Mathematics" }
9195 or 1279194? 1279195 Which is smaller: 3/10777 or -0.1? -0.1 Is -134620 smaller than -134604? True Do 1 and -34/249 have different values? True Which is smaller: -435 or -501? -501 Which is smaller: -0.52 or 1933? -0.52 Is 3033271 equal to 3033271? True Is -16280 != -341890/21? True Is 1/495472 less than or equal to 0? False Which is smaller: 40 or -96/767? -96/767 Is -6432026 less than -6432026? False Which is bigger: 0 or 5/10136? 5/10136 Which is bigger: 874732 or 1? 874732 Which is bigger: -2/3277909 or -1? -2/3277909 Are 1 and 2/186025 unequal? True Which is greater: 1 or 192/869? 1 Which is greater: -199810 or -4? -4 Does -20/25099 = -1? False Which is smaller: 0 or -326/545? -326/545 Is -292/1253 equal to -1? False Is -31566 less than -31566? False Is -598782 >= -3592687/6? False Is -0.11424 >= 10/7? False Which is smaller: -0.398 or -81? -81 Which is smaller: -71193 or -1067902/15? -1067902/15 Which is bigger: 122549 or 122548? 122549 Are 3/13701401 and -1 equal? False Which is bigger: -599932 or -599931? -599931 Which is bigger: -1 or -41/8064? -41/8064 Which is bigger: 4/232743 or 0? 4/232743 Which is bigger: 1 or 24/14197? 1 Which is bigger: 0 or 69/43619? 69/43619 Is -30210 > -30231? True Which is smaller: 1/7758715 or 1? 1/7758715 Which is smaller: -2228 or -2229? -2229 Which is smaller: -2/35 or 1124? -2/35 Are 3080 and 95 nonequal? True Are 1179943/4 and 294987 equal? False Which is smaller: -158 or -7941/50? -7941/50 Is -21242 <= -21261? False Which is smaller: 28/3763 or 1? 28/3763 Is -1098 != -1541? True Is -152/889 equal to 1? False Is -646 greater than or equal to -695? True Is 6512 smaller than 332056/51? False Which is smaller: 1/22 or 142.78? 1/22 Is -11 smaller than -9459/802? False Is -20979/295 not equal to -72? True Is 2/874861 less than or equal to 1? True Which is smaller: -1 or -8/191287? -1 Is -52510 less than or equal to -52515? False Which is smaller: 1 or 3/76919? 3/76919 Which is smaller: 0.76013 or 0.2? 0.2 Is -121/346 less than -0.7? False Which is smaller: -68138 or -0.2? -68138 Which is smaller: -5685 or 337? -5685 Which is smaller: -267515 or -267519? -267519 Are -133985 and -133983 nonequal? True Which is greater: 28 or -23593? 28 Does 28/652847 = 1? False Do -392 and -785/2 have the same value? False Which is smaller: -82313 or 1? -82313 Is 81812 greater than 81817? False Is 1066548 < 1066548? False Which is greater: -22600/101 or -224? -22600/101 Is 2577 < 2291? False Which is smaller: 29 or 4477/157? 4477/157 Is -58/1765 > 0? False Which is smaller: 441567 or 441572? 441567 Is 0 < 248/32987? True Is -2/2279 at most -79? False Do -1/14 and 223922 have different values? True Which is smaller: 270/823 or 0? 0 Which is smaller: 1 or 1098914? 1 Is -791/3831 at least 0? False Which is bigger: 2/59639 or 0.1? 0.1 Which is bigger: 5462 or 0.2? 5462 Which is greater: -2 or -0.898? -0.898 Is 12 at most 17250? True Which is smaller: 199 or 501? 199 Is -136162 at least as big as -136166? True Is -253157 bigger than -253154? False Is -14732 <= -14747? False Is -1/224181 != -1? True Which is smaller: -14745/41 or -361? -361 Is -12127/16 at most as big as -758? False Which is greater: 17/2 or -10? 17/2 Which is smaller: 63512 or 63504? 63504 Which is smaller: -1 or 1/111491? -1 Are -329747 and -329747 nonequal? False Is -0.1 at most 26917? True Does -23659 = -23702? False Which is smaller: 110849 or 110850? 110849 Which is smaller: -579601 or -579599? -579601 Is -926 smaller than -1257? False Which is greater: -104/45561 or 0? 0 Is -200273 at most as big as -2? True Which is greater: 2740 or 2699? 2740 Which is smaller: 7 or 15185? 7 Is -57 greater than or equal to 50? False Which is greater: -11242/87 or -129? -129 Is -681 equal to -769? False Which is bigger: 37 or -8/109? 37 Is -2834 bigger than -2398? False Is 376720 not equal to 376720? False Are 242/875 and 1 unequal? True Which is smaller: -660/1559 or 0? -660/1559 Is -276634 greater than -276633? False Which is smaller: 146 or 147? 146 Is 2 less than or equal to 1810/787? True Which is smaller: 86 or 0.000614? 0.000614 Which is greater: 13/5 or 7575? 7575 Which is bigger: 9030 or 126401/14? 9030 Do -13952 and -13952 have the same value? True Which is smaller: 1812 or 1689? 1689 Is -89 bigger than -1007? True Which is smaller: -1378285 or -1378284? -1378285 Are -3/22198 and -48 unequal? True Which is smaller: 4 or 686/141? 4 Which is smaller: 1753 or 1722? 1722 Is 30021 bigger than 1? True Which is smaller: -136 or 3/193? -136 Are -1582/5 and 0.609 nonequal? True Which is smaller: 36780 or 36685? 36685 Is -0.1 equal to 1/189811? False Which is smaller: 10807 or 270212/25? 10807 Do 66847/20 and 3342 have the same value? False Is -0.21 equal to 0.45? False Which is bigger: -9 or -23092? -9 Which is smaller: 190980 or 190978? 190978 Is -10023282 not equal to -10023283? True Is 53229 != 1? True Which is smaller: 0.2 or -311690.6? -311690.6 Are 11236 and 11233 nonequal? True Which is smaller: -113 or 165/26? -113 Is 2446138 greater than or equal to 2446139? False Which is smaller: 57218/27 or 2120? 57218/27 Are 0.1 and -582956 equal? False Which is smaller: -36991 or 0.4? -36991 Which is greater: 128213 or 1666768/13? 128213 Which is smaller: 0.6 or -3218? -3218 Which is greater: 21788 or 21791? 21791 Is -590 < -1214? False Is -1 > 720517? False Which is greater: -6/589201 or 0? 0 Are 482650/17 and 28391 equal? False Which is smaller: 25316 or 25317? 25316 Which is smaller: -809445 or -809447? -809447 Is -89 at most as big as -8870? False Which is bigger: 156442 or 156441? 156442 Is 1 at least as big as -14/774033? True Which is bigger: -1 or 48219? 48219 Which is smaller: -3180 or -3208? -3208 Is -15 at least as big as -4/1899? False Is 165794/29 >= 5718? False Is -1419 < -89? True Which is greater: 1659921 or 1659922? 1659922 Is -26 > 873? False Which is smaller: -794312 or -794308? -794312 Is 18674.6 not equal to 0.2? True Which is smaller: 18631 or 18635? 18631 Is 1039024 > 1039024? False Is 8 >= 6668/823? False Is -13703/14 != -979? True Is 50290 at least as big as 0.3? True Is -36165 at most as big as -3? True Which is smaller: 245 or 212? 212 Is 0 greater than or equal to 674/3429? False Is -162106 > -162106? False Which is greater: 1297 or -434? 1297 Which is bigger: 3049 or 3317? 3317 Is 2 greater than or equal to 587/527? True Is -455485 less than -455484? True Do 1962 and 767 have the same value? False Is 1418220 != 1418223? True Which is bigger: -5718 or -11435/2? -11435/2 Which is smaller: 700 or 605? 605 Which is smaller: -709261 or -2? -709261 Is -1 != -2/43827? True Is 0 at least -1/17574? True Is 8641 not equal to 8648? True Which is bigger: -1/3 or -5628003? -1/3 Is -34766 > -34722? False Is -0.6 <= 2/2079? True Which is smaller: -89674 or -896753/10? -896753/10 Which is smaller: 270/91 or 1? 1 Which is smaller: 1 or 3/915733? 3/915733 Is -30 at least as big as -1034/35? False Which is smaller: 14/65 or 2? 14/65 Is -3066 at most as big as -71? True Which is bigger: -0.12 or 2/59853? 2/59853 Is -1 greater than 68/1369? False Which is bigger: 97547/8 or 12192? 97547/8 Are -1 and 789/308 unequal? True Which is smaller: 36160 or -9? -9 Which is greater: -2208 or -2494? -2208 Which is smaller: 7 or 481071? 7 Which is smaller: -572/67 or -8? -572/67 Is 1 greater than or equal to -821/1999? True Which is bigger: -5495/26 or -212? -5495/26 Is 15642 at least 172052/11? True Which is bigger: 169.65 or -1? 169.65 Which is smaller: -374665 or -16? -374665 Which is greater: -6696 or -6691? -6691 Does -1 = -241157? False Which is smaller: 866 or 749? 749 Is 1/2067781 at least 0? True Is -1267 <= 2/15? True Is 3737 smaller than 4261? True Which is greater: 0 or -3/1055450? 0 Is 1753 >= 1750? True Is -0.161904 <= 0.1? True Is -1 at least as big as 16/303? False Which is smaller: 14042 or 14044? 14042 Is 61578 <= 61584? True Is -64669 smaller than -64668? True Which is greater: -8264 or -8267? -8264 Which is smaller: -2/655 or 133/2? -2/655 Which is bigger: -842 or -22? -22 Is 621 <= 58383/94? True Is 245 at least as big as 290? False Do -0.102 and 0.4651 have the same value? False Which is smaller: -0.01462 or 2? -0.01462 Which is greater: -95/588 or 0	{ "pile_set_name": "DM Mathematics" }
king 2 v and 1 s when three letters picked without replacement from nhsiivnsvhsbnvsnvvii. 2/57 Three letters picked without replacement from zbbldzlolzzjlzo. What is prob of picking 2 o and 1 j? 1/455 Two letters picked without replacement from {k: 2, v: 1, y: 2, w: 4, b: 1, z: 4}. What is prob of picking 1 y and 1 z? 8/91 What is prob of picking 1 z, 1 i, and 1 w when three letters picked without replacement from zzwrawvzaivz? 2/55 Two letters picked without replacement from {s: 12, t: 1}. What is prob of picking 2 s? 11/13 Two letters picked without replacement from aahjhahajhajhaja. What is prob of picking 1 a and 1 h? 7/24 Calculate prob of picking 4 r when four letters picked without replacement from {r: 4, f: 7}. 1/330 Calculate prob of picking 1 c, 1 y, and 1 u when three letters picked without replacement from {w: 2, y: 2, c: 1, k: 1, u: 1, m: 1}. 1/28 Four letters picked without replacement from {n: 1, g: 3, q: 3, c: 1, r: 2, v: 8}. What is prob of picking 1 v, 2 g, and 1 c? 2/255 Two letters picked without replacement from {d: 1, p: 2, j: 2, k: 2, x: 1}. What is prob of picking 2 k? 1/28 Calculate prob of picking 1 q and 2 b when three letters picked without replacement from ggbvqqgqqvgvqqqbvqg. 8/969 What is prob of picking 1 r and 2 w when three letters picked without replacement from qajwhjjwrjaa? 1/220 What is prob of picking 2 t when two letters picked without replacement from kkkkkkktktkk? 1/66 Calculate prob of picking 4 i when four letters picked without replacement from ffiiiipipfpifc. 15/1001 Two letters picked without replacement from zchc. Give prob of picking 1 h and 1 z. 1/6 Four letters picked without replacement from cllbcacccccblbca. What is prob of picking 3 b and 1 l? 3/1820 Four letters picked without replacement from vlilvi. Give prob of picking 2 i, 1 v, and 1 l. 4/15 Calculate prob of picking 1 a, 2 i, and 1 x when four letters picked without replacement from {a: 4, x: 1, c: 7, i: 8}. 112/4845 Calculate prob of picking 2 v when two letters picked without replacement from mvvmmmmvmmvmmmmmmmmv. 1/19 What is prob of picking 1 x and 1 a when two letters picked without replacement from xxxaaaaaaaaaaaaaax? 56/153 What is prob of picking 1 b and 1 j when two letters picked without replacement from jjobbzq? 4/21 Two letters picked without replacement from {a: 4, k: 16}. What is prob of picking 1 a and 1 k? 32/95 What is prob of picking 2 g when two letters picked without replacement from {l: 7, y: 8, g: 2, d: 3}? 1/190 Three letters picked without replacement from {g: 2, u: 10, j: 3}. Give prob of picking 2 g and 1 u. 2/91 Four letters picked without replacement from sjfjsssjsssjjjjjssh. Give prob of picking 1 h and 3 j. 14/969 Two letters picked without replacement from eiggzggeg. What is prob of picking 1 e and 1 z? 1/18 Two letters picked without replacement from {x: 3, v: 2, w: 3, d: 1, u: 1}. What is prob of picking 2 x? 1/15 What is prob of picking 1 f, 1 b, and 2 v when four letters picked without replacement from bqbfbfffvvv? 6/55 What is prob of picking 2 q when two letters picked without replacement from rsqrrrrrrsqq? 1/22 Calculate prob of picking 1 f and 2 g when three letters picked without replacement from ggfgggfggggfgggfgg. 91/204 Three letters picked without replacement from ntvxtcnxnxtvtnxt. What is prob of picking 2 v and 1 n? 1/140 Three letters picked without replacement from mxhhxxbphhtp. What is prob of picking 1 b and 2 p? 1/220 Four letters picked without replacement from juouuuujuuuuuujjjj. What is prob of picking 2 j and 2 u? 55/204 Three letters picked without replacement from vvvvjvvvvvvvvjj. Give prob of picking 1 j and 2 v. 198/455 What is prob of picking 2 j and 2 r when four letters picked without replacement from {j: 8, r: 4, k: 4}? 6/65 What is prob of picking 2 k and 1 m when three letters picked without replacement from pebmkkb? 1/35 Three letters picked without replacement from dnvlcqdnlqqn. Give prob of picking 2 n and 1 l. 3/110 Two letters picked without replacement from smxxsccecx. Give prob of picking 2 c. 1/15 Calculate prob of picking 2 v when two letters picked without replacement from {v: 6, f: 2}. 15/28 Two letters picked without replacement from {q: 1, y: 1, r: 13}. Give prob of picking 1 r and 1 q. 13/105 Calculate prob of picking 2 t when two letters picked without replacement from {d: 2, t: 2}. 1/6 Calculate prob of picking 2 c and 2 z when four letters picked without replacement from {x: 1, z: 2, r: 1, c: 2}. 1/15 Three letters picked without replacement from rreec. Give prob of picking 1 e and 2 r. 1/5 Calculate prob of picking 1 c, 1 n, and 1 o when three letters picked without replacement from cnconnccmcnclnocomn. 42/323 Calculate prob of picking 1 a and 1 k when two letters picked without replacement from {a: 9, k: 5}. 45/91 Calculate prob of picking 2 x when two letters picked without replacement from {o: 9, x: 2}. 1/55 What is prob of picking 3 j and 1 q when four letters picked without replacement from {h: 3, i: 4, d: 2, q: 3, j: 6}? 1/51 Three letters picked without replacement from {j: 4, v: 5, o: 1, h: 4, f: 5}. What is prob of picking 1 o and 2 j? 2/323 Two letters picked without replacement from {l: 2, s: 7, h: 3}. What is prob of picking 1 s and 1 l? 7/33 Calculate prob of picking 1 o, 1 z, and 2 v when four letters picked without replacement from {z: 1, a: 1, o: 1, k: 2, v: 2, q: 1}. 1/70 Calculate prob of picking 1 y, 1 u, and 1 j when three letters picked without replacement from {w: 8, j: 1, z: 2, y: 2, u: 2}. 4/455 What is prob of picking 1 i and 1 f when two letters picked without replacement from fbivjwbfj? 1/18 Four letters picked without replacement from {a: 3, b: 1, h: 1}. Give prob of picking 3 a and 1 h. 1/5 Calculate prob of picking 1 n and 1 k when two letters picked without replacement from kknnkknnkknkkk. 45/91 What is prob of picking 3 y when three letters picked without replacement from cjyyyjjyy? 5/42 Two letters picked without replacement from {t: 4, l: 1, b: 2}. What is prob of picking 2 t? 2/7 Three letters picked without replacement from {j: 1, h: 3, y: 2, g: 1, t: 3}. Give prob of picking 2 y and 1 j. 1/120 Three letters picked without replacement from {a: 3, n: 1, f: 5}. Give prob of picking 3 a. 1/84 Three letters picked without replacement from {l: 1, s: 11, c: 1, q: 2}. Give prob of picking 1 s, 1 c, and 1 l. 11/455 What is prob of picking 1 i, 1 z, and 1 o when three letters picked without replacement from niifzoj? 2/35 Four letters picked without replacement from mnnnnnnymnnyynnnn. What is prob of picking 2 n and 2 m? 33/1190 Calculate prob of picking 1 f and 2 q when three letters picked without replacement from {c: 3, q: 5, j: 3, f: 2}. 10/143 Calculate prob of picking 1 m and 1 p when two letters picked without replacement from mxmmjyxyymfmypym. 1/20 Four letters picked without replacement from {a: 2, t: 2, h: 4, q: 1, e: 3}. Give prob of picking 2 a, 1 e, and 1 t. 2/165 What is prob of picking 1 n and 1 j when two letters picked without replacement from jjbjnbbbaneajbbjba? 10/153 Three letters picked without replacement from {n: 2, s: 2, f: 6, w: 1, d: 3, k: 5}. What is prob of picking 1 k and 2 n? 5/969 Two letters picked without replacement from {c: 10}. Give prob of picking 2 c. 1 Three letters picked without replacement from {z: 1, p: 1, g: 2}. What is prob of picking 1 p and 2 g? 1/4 Two letters picked without replacement from {n: 5, e: 3}. Give prob of picking 2 e. 3/28 What is prob of picking 1 g and 1 y when two letters picked without replacement from yygygggggybybggggggg? 13/38 Two letters picked without replacement from mrvdvgh. Give prob of picking 1 g and 1 d. 1/21 Calculate prob of picking 1 n and 1 b when two letters picked without replacement from unanbunnuubnbuubnu. 8/51 Three letters picked without replacement from hgpyyhogghhhpgyhdhyy. What is prob of picking 1 o, 1 h, and 1 y? 7/228 Two letters picked without replacement from {v: 5, z: 10, g: 4}. Give prob of picking 1 v and 1 z. 50/171 Calculate prob of picking 2 z and 2 t when four letters picked without replacement from {z: 4, w: 1, t: 5}. 2/7 What is prob of picking 2 l and 1 y when three letters picked without replacement from ttylltyyy? 1/21	{ "pile_set_name": "DM Mathematics" }
- 1. Let p(u) = 3u - 1. Let h be p(1). Let t(k) = -2k*2 - 2k - 2. Let z(m) = ht(m) - 6g(m). Determine z(-2). 6 Let p(i) = 7i3 - i2. Let o(t) = t2 + 4t - 5. Let s be o(-5). Let w = 1 - s. Determine p(w). 6 Let h(f) be the second derivative of -f7/2520 - f6/720 - f5/20 + f4/12 - f. Let z(v) be the third derivative of h(v). Give z(0). -6 Let x(k) = -1 - 4k2 + 9k*3 + 7k*2 - 2k2 - k3. What is x(1)? 8 Suppose -3d - 6 = 5b - 1, 2d + 4b + 4 = 0. Let g be (d - 0)/(0 + -2). Let m(i) = i*2 + 0i*2 + gi*2 - 2 + 3i + i. Determine m(-5). 3 Suppose -2q + 10 = -3f, 2q + 4f + f + 6 = 0. Let d(j) = -1 - 4j + 11 - j2 + qj - 3. Determine d(-5). -8 Suppose 0 = 3n + c - 10, -4n = -c - 11. Let y(k) be the second derivative of k3/2 - k2 + k. What is y(n)? 7 Suppose 5t = -18 + 13. Let r(b) = b - 1. Let w(i) = -12i + 5. Let l(u) = -5r(u) - w(u). What is l(t)? -7 Let k(f) = f3 + 14f*2 + 24f - 5. Let w be k(-12). Let l(n) = -n*3 - 4n*2 + 7n + 3. Determine l(w). -7 Let z be (-21)/(-14)(0 - -1). Let w(v) be the second derivative of 1/3v*3 + zv*2 + 0 - 2v. Calculate w(3). 9 Let c(z) be the third derivative of -z6/10 + z4/24 - z*3/6 + 9z*2. Calculate c(1). -12 Let t(a) = a + 12. Let l = 1 - 2. Let b(h) = -1. Let p(m) = lt(m) - 5b(m). Give p(5). -12 Let c(r) = -7r*2 + 6r + 6. Let t(l) = -11l2 + 10l + 9. Let u(b) = -8c(b) + 5t(b). Let m(o) = o*2 + 5o. Let j be m(-4). Calculate u(j). 5 Suppose -12j + 0j - 60 = 0. Let w(z) = -2z - 5. Let t(r) = 10r + 24. Let a(x) = -2t(x) - 11w(x). Calculate a(j). -3 Let r(s) = -s*2 - 6s + 0s + 2 - 3 + 0s. Give r(-4). 7 Let q(l) = l. Let c(j) = 7j + 8. Let o(f) = -c(f) + 6q(f). Suppose -g - 4m = 4, 2g + 1 - 4 = 3m. Calculate o(g). -8 Suppose 5i - 26 = 3i. Let h(o) = -7o*2 - 10o + 4. Let m(t) = 15t2 + 21t - 9. Let v(b) = ih(b) + 6m(b). What is v(-3)? 1 Let z(t) be the first derivative of -t*3/3 + 7t*2/2 + 2t + 4. Give z(6). 8 Let q = -4 - -3. Let r = -3 + q. Let x(y) = -7y + 2. Let o(f) = 6f - 1. Let m(d) = -5o(d) - 4x(d). Give m(r). 5 Suppose -3g = 3b - 1 - 5, -2 = -g - 3b. Suppose -4o = a - 0a - g, 5a - 10 = 4o. Let h(s) = -s2 + 1 - 2s + 2sa + 3s - 5s2. Calculate h(-1). -4 Let j(m) = -2m + 3. Let z be (-9)/(-4) - (-3)/(-12). Calculate j(z). -1 Let l(y) be the third derivative of y*6/120 - 7y5/60 + y4/6 + 7y3/6 - y2. Suppose 2j - 2 + 5 = -5k, -4j + 12 = 4k. What is l(j)? -5 Suppose d - 2r = -2d, -d + 4r = 0. Let y be ((-2)/(-4) + 0)d. Let n(q) = 3q + 5. Let c(g) = 7g + 10. Let l(z) = -2c(z) + 5n(z). Determine l(y). 5 Let r(x) be the second derivative of x8/6720 + x7/504 - x6/720 - x5/20 - x4/4 + 4x. Let u(a) be the third derivative of r(a). Calculate u(-5). -1 Let q(v) = 4 - 4v + 0 + 3v - 1. What is q(4)? -1 Let g be 376/(-12) + 2/6. Let x = g - -55. Let q be (-1)/(-5) + x/5. Let c(b) = b*3 - 4b*2 - 5b + 4. Calculate c(q). 4 Let f be 2 + -1 - (1 - 11). Let i = f + -10. Let u(d) = 13d - 1. What is u(i)? 12 Let r(m) be the first derivative of -m4/4 - m3/3 - m2/2 + 12m + 11. Calculate r(0). 12 Let q(f) be the second derivative of f*4/12 + 5f*3/6 - 2f*2 + 3f. Determine q(-6). 2 Let a(y) = y*3 + 4y*2 + 2y + 4. Suppose -2 = 2d, 4j + 17 = 3d - 4d. Calculate a(j). -4 Let d(l) be the second derivative of l*4/12 + 7l*3/6 - 4l*2 + 19l. What is d(-6)? -14 Let k(y) = y*3 + 5y*2 + 5y. Let g(j) = 19j2 - j. Let f be g(-1). Suppose -10m - f = -5m. Calculate k(m). -4 Let q = 3 + 0. Suppose -3n + 4n - m - 3 = 0, -7 = -5n - qm. Let z(g) = 3g*n + 0 - 2g - 1 + 0. What is z(2)? 7 Let h(u) = -2u2 + 2u + 6 - 6. What is h(2)? -4 Let u(t) = -9t + 4t - 1 + 4t. Let k be u(-6). Let f(x) = -4x - kx2 + 6x*2 + 5x. Determine f(1). 2 Let q(c) = 6c2 + c. Let r = 97 + -96. Calculate q(r). 7 Let d(z) = 2z*3 + 12z*2 + 5z - 14. Let a(j) = -3j3 - 18j*2 - 8j + 21. Let w(m) = -5a(m) - 7d(m). What is w(-5)? -7 Let h(r) = -r*3 + 9r*2 - 7r - 6. Let s(l) = 2l. Let b be s(4). Give h(b). 2 Let l(f) = f3 + 2f*2 + 3f + 2. Let q(j) = -j*3 + 3j*2 + 2j + 5. Let k be q(4). Calculate l(k). -16 Let w be (-2)/3 + 23/3. Let f = -27 - -19. Let c = f + w. Let t(i) = i - 1. Calculate t(c). -2 Let k(a) = -5a - 3. Let o(s) = 0s + s + 2s + 2 + s. Let d(g) = -6k(g) - 7o(g). Determine d(-4). -4 Let m = -11 + 15. Let n be 39/26 - (-2)/m. Let z(w) = -w3 + 2w - 2. Determine z(n). -6 Let s(o) be the second derivative of o6/120 + o5/12 - o4/24 - o3 - 3o2/2 - o. Let k(m) be the first derivative of s(m). What is k(-5)? -1 Let x(t) = t. Let k(s) = -2s - 6. Let y = 9 + -14. Let w be k(y). Let m = w + -1. What is x(m)? 3 Let k(h) be the second derivative of h3/2 - h2/2 - h. Suppose 0 = 3s - 4s + f, 4f = 8. Determine k(s). 5 Suppose -4o + 2o = 0. Suppose 2h = -0h + 4. Suppose ov - v = h. Let w(y) = -y*3 - 2y2 - y - 1. Calculate w(v). 1 Let w(i) = i3 + 3i2 + 2i + 3. Let j be w(-2). Suppose -c + 0c = -j. Let b(s) = -4s + c - s*2 + 1 - s. Determine b(-5). 4 Let m be 2/8 + 1/(-4). Let n(y) be the third derivative of 0 - 1/120y*6 - 2y*2 + 0y + 2/3y3 - 1/24y*4 + 1/60y5. Determine n(m). 4 Let t(b) be the first derivative of 3 + b3 - 1/4b4 - 4b + 5/2b2. Let h be t(4). Let s(k) = -k3 + k2 - k - 6. Calculate s(h). -6 Let x(z) = -3z*3 + 3z + 2z3 + 3 + 2z*3 + 0z*2 - 5z*2. Let r be x(4). Let f(c) be the second derivative of 5c3/6 - c2/2 + 2c. Calculate f(r). -6 Let r(c) = 5c*3 - 2c*2 - 2c - 1. Let m(d) = d - 8. Let i be m(7). Give r(i). -6 Let h(x) = 2x2 - 25x + 9. Let v be h(12). Let f(k) = k*2 + 4k. Determine f(v). -3 Let h be (-15)/3 + 1 + -1. Let k(o) be the second derivative of o*4/12 + 7o*3/6 + 3o*2/2 + 18o. Determine k(h). -7 Let u(c) = -c*2 + 6c - 7. Suppose 0t - 5 = -t. Determine u(t). -2 Let j(x) = -1 + 0x - x + 2. Let q(g) = -9g + 11. Let m(b) = -22j(b) + 2q(b). Suppose -5y + l = 11, -2y = -0y + 5l - 1. Calculate m(y). -8 Suppose -2 = -2a + v, -5a - 1 = -2v - 2v. Let k(m) be the first derivative of 1 + 0m2 - m3 + 1/4m4 - 3m. Determine k(a). -3 Let u(q) = -q*2 - 8q - 5. Let c(z) = -z - 18. Let i be c(-12). Calculate u(i). 7 Let g(b) = b*2 + 10b + 4. Let x be g(-10). Let y(n) = 3n - 5n2 + 2 + n3 + 4 - x. Calculate y(4). -2 Suppose -3l + 16 = l. Let c(b) = b2 - lb2 - b3 + 0b3. Let x be (6/(-10))/(8/40). Calculate c(x). 0 Let q(t) be the third derivative of -t5/60 - t4/4 + 5t*3/3 + 26t2. Calculate q(-8). -6 Let c(s) = s2 - 5s + 2. Let v(g) = -4g*2 + 15g - 6. Let f(r) = -7c(r) - 2v(r). Determine f(-5). -2 Let f be (-12)/(-7) + -2 + 171/(-63). Let d(b) = b*3 + 4b*2 + 5b + 3. Calculate d(f). -3 Let h(l) = l3 + l2 + l - 1. Let q be h(1). Let r be (q/5)/(1/10). Let n(o) = -o - 3. Determine n(r). -7 Suppose 0m - m + 7 = 5v, 4m - 9 = -v. Let g(w) = 0w + 3 + w - w + mw. What is g(-2)? -1 Let l(y) be the first derivative of -y2/2 + 2y - 30. Give l(0). 2 Let m(l) be the first derivative of 2 - 1/4l4 + 2l*3 + 1/2l*2 + 0l. Give m(6). 6 Let a = 3 + -5. Let l(z) = -5z. What is l(a)? 10 Let l(x) = -18x - 22x2 + 21x + 18x2 - x3. Let h be ((-15)/12)/((-2)/(-8)). Calculate l(h). 10 Let o(b) be the second derivative of -b4/12 + 7b*3/6 - 5b*2/2 - 4b. What is o(6)? 1 Let x(m) = m*3 - 7m*2 - 11m + 20. Let z be x(8). Let s(v) = -v*3 - 5v*2 + 3. Give s(z). -13 Let o(s) be the first derivative of -4s + 1/3s3 + 0s2 + 1. What is o(-3)? 5 Let t(l) = -l2 + 6l - 3. Let j(b) = -7b2 + 7 - b2 - 4b - b3 + 2b2. Let c(f) = f3 - 6f2 - 5. Let a be c(6). Let v be j(a). What is t(v)? 5 Let f(m) = 0m3 - 7 + m3 - 2m3. Suppose 3j = 5x, -4x = -3x + 3j. Give f(x). -7 Let f(g) = g3 - g2 + 8. Let d be f(0). Let p be -2(-12)/d1. Let l(y) = y - 2. Give l(p). 1 Let n(w) = 12w2 + w - 1. Let t be 2/(-2) - 5/(25/(-10)). Give n(t). 12 Let y(v) be the third derivative of -v5/30 + v4/3 - v3/2 - 5v*2. Give y(5). -13 Let i(b) = -10b*2 - 2b - 1. Suppose 5 = -0n + n. Suppose 2x = p - x, -p + n = 2*x. Let f = 2 - p. What is i(f)? -9 Suppose	{ "pile_set_name": "DM Mathematics" }
aces. 0.00012 What is -0.030973 rounded to 4 decimal places? -0.031 Round -38705.8 to the nearest 10000. -40000 What is 0.00005176 rounded to 5 dps? 0.00005 Round 0.00026896 to five decimal places. 0.00027 What is -75.252 rounded to the nearest 10? -80 Round -0.000029073 to 7 decimal places. -0.0000291 What is -744.2 rounded to the nearest 100? -700 Round 0.000023657 to 5 decimal places. 0.00002 What is 0.00000137 rounded to 6 dps? 0.000001 Round -0.075864 to four decimal places. -0.0759 What is -0.00150022 rounded to 5 dps? -0.0015 What is 0.1133 rounded to three dps? 0.113 Round -16.847 to the nearest integer. -17 What is -0.0833 rounded to three dps? -0.083 What is -0.0000424 rounded to 6 dps? -0.000042 What is -1.7374 rounded to two decimal places? -1.74 Round -1.6166 to one decimal place. -1.6 Round -221.28 to the nearest ten. -220 Round 0.0002405 to 5 decimal places. 0.00024 Round 122.9 to the nearest ten. 120 What is -7.9644 rounded to two decimal places? -7.96 What is 3857000 rounded to the nearest one hundred thousand? 3900000 What is -0.043064 rounded to 3 dps? -0.043 What is 13583 rounded to the nearest one thousand? 14000 What is -0.00008078 rounded to 6 dps? -0.000081 Round 0.0053679 to three dps. 0.005 What is -0.000001588 rounded to six dps? -0.000002 Round 301.2 to the nearest 10. 300 Round -3.8599 to one dp. -3.9 What is 0.0000055474 rounded to 7 decimal places? 0.0000055 What is -1870000 rounded to the nearest 1000000? -2000000 What is -2540 rounded to the nearest one hundred? -2500 What is 620000 rounded to the nearest 100000? 600000 Round -0.00024 to six dps. -0.00024 Round 93579000 to the nearest 100000. 93600000 What is 714100 rounded to the nearest ten thousand? 710000 Round -57.299 to the nearest integer. -57 What is 0.0001168 rounded to six decimal places? 0.000117 Round -294 to the nearest 1000. 0 What is 0.67083 rounded to 1 decimal place? 0.7 Round -2770 to the nearest 1000. -3000 Round 0.000002522 to seven dps. 0.0000025 Round 0.0000102206 to 6 decimal places. 0.00001 What is 9.5685 rounded to the nearest integer? 10 Round 0.01735 to three dps. 0.017 Round -9740 to the nearest one thousand. -10000 Round 41.4 to the nearest 10. 40 What is -0.00000682 rounded to 6 dps? -0.000007 Round -0.0000010636 to seven dps. -0.0000011 Round 18.72 to the nearest integer. 19 Round -213.34 to the nearest ten. -210 What is 2.6707 rounded to the nearest integer? 3 What is 349 rounded to the nearest one hundred? 300 Round 0.003051 to four decimal places. 0.0031 Round 0.0006881 to five decimal places. 0.00069 Round -2.11 to 1 decimal place. -2.1 Round -0.00114 to four decimal places. -0.0011 Round -0.0613 to 2 dps. -0.06 Round 0.03 to zero decimal places. 0 What is -19.2537 rounded to the nearest integer? -19 Round 1.118 to the nearest integer. 1 What is 1.3986 rounded to 2 dps? 1.4 Round 0.000000719 to 6 decimal places. 0.000001 Round 6.1192 to the nearest integer. 6 What is -3.7 rounded to the nearest ten? 0 Round 4444500 to the nearest ten thousand. 4440000 Round -0.000000969 to six dps. -0.000001 Round -0.0005578 to six decimal places. -0.000558 Round -0.000092 to five dps. -0.00009 Round -259.36 to zero dps. -259 Round 934700 to the nearest one hundred thousand. 900000 What is 76300 rounded to the nearest 10000? 80000 Round 2645000 to the nearest 100000. 2600000 Round 8860000 to the nearest one million. 9000000 What is 1300.6 rounded to the nearest 100? 1300 What is -12.7701 rounded to one dp? -12.8 Round 0.43106 to 2 dps. 0.43 What is 0.0000055336 rounded to seven decimal places? 0.0000055 What is 4.5448 rounded to 1 decimal place? 4.5 What is -0.00000021669 rounded to seven dps? -0.0000002 Round -198370000 to the nearest 1000000. -198000000 What is -371600 rounded to the nearest one hundred thousand? -400000 What is 0.000020353 rounded to 7 decimal places? 0.0000204 Round 150.6 to the nearest 10. 150 What is -83.778 rounded to the nearest integer? -84 What is -917000 rounded to the nearest one hundred thousand? -900000 Round 0.000003071 to 6 decimal places. 0.000003 What is -51390 rounded to the nearest 1000? -51000 What is 4250000 rounded to the nearest one million? 4000000 Round 1669000 to the nearest 100000. 1700000 What is 1333.43 rounded to the nearest ten? 1330 Round 530 to the nearest one hundred. 500 Round -0.00074231 to 4 decimal places. -0.0007 What is -0.7591 rounded to one decimal place? -0.8 What is 36778.8 rounded to the nearest one hundred? 36800 Round 20330000 to the nearest 1000000. 20000000 Round -13.54 to the nearest 10. -10 Round 0.000107578 to six dps. 0.000108 Round -154340 to the nearest one hundred thousand. -200000 What is -12100 rounded to the nearest 10000? -10000 Round -0.00011594 to five dps. -0.00012 Round -192800 to the nearest one hundred thousand. -200000 What is 819860 rounded to the nearest 100000? 800000 What is -0.09817 rounded to two decimal places? -0.1 What is -0.000006508 rounded to six decimal places? -0.000007 What is 27780000 rounded to the nearest one hundred thousand? 27800000 Round 524250 to the nearest one thousand. 524000 Round 0.01611 to three dps. 0.016 What is 37988 rounded to the nearest 1000? 38000 Round 327900 to the nearest one hundred thousand. 300000 Round 3948 to the nearest 100. 3900 What is 388890 rounded to the nearest ten thousand? 390000 What is 0.000548 rounded to 5 dps? 0.00055 What is 0.00027337 rounded to four dps? 0.0003 Round 0.02189 to 3 decimal places. 0.022 What is 160200 rounded to the nearest ten thousand? 160000 What is -19096000 rounded to the nearest 100000? -19100000 What is -123657 rounded to the nearest 1000? -124000 Round -0.00004181 to 6 decimal places. -0.000042 What is -1629100 rounded to the nearest 10000? -1630000 What is 731 rounded to the nearest ten? 730 What is 0.04786 rounded to two dps? 0.05 Round 0.0028165 to 3 dps. 0.003 What is 0.51452 rounded to 2 dps? 0.51 Round 0.00287466 to four dps. 0.0029 What is 112.159 rounded to the nearest integer? 112 Round 0.0175 to two decimal places. 0.02 Round -12231 to the nearest 1000. -12000 What is 0.0026627 rounded to four dps? 0.0027 What is -1025.31 rounded to the nearest integer? -1025 What is -0.0253618 rounded to 4 decimal places? -0.0254 Round -0.57032 to two dps. -0.57 Round -10764000 to the nearest one million. -11000000 What is -0.0024788 rounded to four decimal places? -0.0025 What is -0.1349 rounded to 2 decimal places? -0.13 What is -44.176 rounded to the nearest 10? -40 Round -0.000017778 to 5 decimal places. -0.00002 What is 0.445 rounded to 1 dp? 0.4 What is 93.834 rounded to zero dps? 94 What is 11847.1 rounded to the nearest 1000? 12000 Round -0.6616 to 2 dps. -0.66 What is -0.000000439 rounded to seven decimal places? -0.0000004 What is 4921 rounded to the nearest one hundred? 4900 Round 209630000 to the nearest one million. 210000000 Round -1.82627 to 2 dps. -1.83 Round -0.0025344 to four dps. -0.0025 What is 0.3677 rounded to two decimal places? 0.37 What is -99840 rounded to the nearest 10000? -100000 What is -0.039755 rounded to two dps? -0.04 Round 0.49 to 1 decimal place. 0.5 What is 68117000 rounded to the nearest one million? 68000000 What is -855300 rounded to the nearest 100000? -900000 Round 0.9414 to 2 decimal places. 0.94 What is -29776 rounded to the nearest one hundred? -29800 Round -0.01552 to one dp. 0 What is -15.36 rounded to 0 decimal places? -15 Round -0.000019079 to 6 decimal places. -0.000019 What is 0.000000639726 rounded to 7 dps? 0.0000006 What is -0.000000729 rounded to seven dps? -0.0000007 Round -0.000003255 to seven dps. -0.0000033 Round -6.9762 to one decimal place. -7 Round 0.0000432 to 5 decimal places. 0.00004 Round 0.00218 to 3 decimal places. 0.002 Round -0.0000668 to five dps. -0.00007 What is -14413000 rounded to the nearest one million? -14000000 What is -0.09649 rounded to two decimal places? -0.1 Round 0.058671 to three decimal places. 0.059 What is -360.54 rounded to the nearest integer? -361 What is -0.00003536 rounded to six decimal places? -0.000035 What is -0.00008987 rounded to 5 decimal places? -0.00009 Round -16000000 to the nearest 1000000. -16000000 What is 0.00041822 rounded to six decimal places? 0.000418 Round 11837.3 to t	{ "pile_set_name": "DM Mathematics" }
the terms in 2m + 2m*2 - 2 - 6m*2 - 2m. -4m2 - 2 Collect the terms in -14 + 14 + 97f. 97f Collect the terms in 12 - 7t - 4t - 4 + t. -10t + 8 Collect the terms in -74s3 + 39s*3 + 41s*3. 6s*3 Collect the terms in 19114l - 4l2 - 19114l. -4l2 Collect the terms in -p3 - 6p*3 + 14p*3 - 6p3. p3 Collect the terms in -16t + 43t - 29t - 17t. -19t Collect the terms in -6 - 3 + 50z + 2 + 5. 50z - 2 Collect the terms in 0r*2 - 10 + 27 - 17 - 4r*2. -4r*2 Collect the terms in 16b - 2b + 4b. 18b Collect the terms in 106f + 22f + 103f + 160f. 391f Collect the terms in 2 + 0r2 - 4r + 4r - 2r*2. -2r*2 + 2 Collect the terms in 7w*2 + 216 - 216. 7w*2 Collect the terms in 25 + 17 - m + 15 - 54. -m + 3 Collect the terms in -5k2 + k2 - 4k2 + 5k*2. -3k*2 Collect the terms in -w + 163365 - 163365 - 2w. -3w Collect the terms in -5w*2 + 59w - 16w + 0w*2. -5w*2 + 43w Collect the terms in -6s3 + 16s*3 - 6s*3 - 11s*3. -7s*3 Collect the terms in -83 - 2g + 83. -2g Collect the terms in -x - 45 + x + 4x. 4x - 45 Collect the terms in -603w + 303w + 302w. 2w Collect the terms in -6s - 14s - 7s + 19s. -8s Collect the terms in 248w + 241w + 239w - 731w. -3w Collect the terms in -3c + 107c3 - 214c*3 + 105c*3 + 3c. -2c3 Collect the terms in -2g + 5g + 7g + 6g. 16g Collect the terms in 2k2 - k2 - 5k*2. -4k*2 Collect the terms in 9b - 18b - 17b + b. -25b Collect the terms in 39u*3 + 27u*3 + 53u*3. 119u*3 Collect the terms in 9l + 2l + 6l. 17l Collect the terms in -26h + 11h + 14h. -h Collect the terms in 183o2 + 175o*2 - 359o2. -o2 Collect the terms in 17m2 - 28m*2 + 11m*2 + 8m*3 - 12m*3. -4m*3 Collect the terms in 3o - 2o - 142o2 - o3 - o. -o*3 - 142o*2 Collect the terms in 498 - 247 - 251 + 4l*3. 4l*3 Collect the terms in -6z*3 + 16z - 16z + 8z*3. 2z*3 Collect the terms in 1 + 285x - 196x - 1. 89x Collect the terms in -x3 + x3 + 6x3. 6x*3 Collect the terms in -5867j*2 + 11771j*2 - 5888j*2. 16j*2 Collect the terms in -3n + 6n + 15n*3 - 3n. 15n3 Collect the terms in 1 - 1 + 312m - 367m. -55m Collect the terms in 309 - 197 - 112 - 2a + 3a. a Collect the terms in 34t + 137 - 137. 34t Collect the terms in -158x2 + 83x*2 + 80x*2. 5x*2 Collect the terms in -107 + 222 - 105 + 2u*2. 2u*2 + 10 Collect the terms in -12y*3 - 14y*3 - 20y*3 + 45y3. -y3 Collect the terms in 3 - 1 - 2 + 5n2. 5n*2 Collect the terms in -12z*2 + 15z*2 - 13z*2 - 5z*2. -15z*2 Collect the terms in 2n + n - 9n + n. -5n Collect the terms in -16h - 7h - 12h - 14h. -49h Collect the terms in 9r2 - r2 + r*2 - 2r*2 - 3r*2. 4r*2 Collect the terms in 52y + 137y + 158y. 347y Collect the terms in 2h - 4h - 3h + 8h. 3h Collect the terms in 2p3 + 18p*3 - 8p*3. 12p*3 Collect the terms in 5x - 17x - 4x*2 + 9x + 13x2. 9x*2 - 3x Collect the terms in 1 + 5 - 6 - 17j2. -17j2 Collect the terms in d2 - 7d3 + 3d3 - d2. -4d3 Collect the terms in -15s - 18s - 4s - 20s. -57s Collect the terms in 41j2 + j3 - 69j*2 + 28j2. j3 Collect the terms in 1 - 48u3 - 2 - 18u*3. -66u*3 - 1 Collect the terms in -228d + 29d - 75d. -274d Collect the terms in -2 + 0 + 2 + 29c. 29c Collect the terms in 41l*3 - 11l*3 + 20l*3. 50l*3 Collect the terms in -1 + 1 + 107b - 3b3 - 34b. -3b3 + 73b Collect the terms in -55z2 - 83z*2 - 3z*2 + 4z*2. -137z*2 Collect the terms in -72v*2 - 76v*2 + 4v*3 + 5v*3 + 148v*2. 9v*3 Collect the terms in 36 - 16 + 30 - n + 2n. n + 50 Collect the terms in 67341 - 67341 - 5h2. -5h*2 Collect the terms in 0 - 27l + 0 + 7l. -20l Collect the terms in -103744 + 103744 - 3z + 6z. 3z Collect the terms in 20a*3 - 52a*3 + 38a*3. 6a3 Collect the terms in j2 + 4j2 + 6j*2. 11j*2 Collect the terms in -8z*2 - 2z*2 + 4z*2. -6z*2 Collect the terms in 11z*3 - 33z*3 - 13z*3. -35z*3 Collect the terms in 2b*3 + 0b*3 + 14 - 14. 2b*3 Collect the terms in 4h*2 + 1996h - 1996h. 4h*2 Collect the terms in 124 + 6v*2 - 124. 6v*2 Collect the terms in 6a*2 - 5a*2 + 5 + 2a*2 - 4a2. -a2 + 5 Collect the terms in 9y2 - 9y2 - y2 - 5y2. -6y*2 Collect the terms in 26c + 47c - 14c + 37c. 96c Collect the terms in 9q3 - 17q*3 + 9q3 + q3. 2q3 Collect the terms in 16k - 8k - 9k - 8k. -9k Collect the terms in 301i2 - 301i*2 + 0i*3 + 3i*3. 3i*3 Collect the terms in 2s*2 + 23s*2 + 58s*2. 83s*2 Collect the terms in 113a*2 - 168a*2 - 695a*2. -750a*2 Collect the terms in 0u - 5u + 7u. 2u Collect the terms in 19n*2 + 15n*2 + 4n*2. 38n*2 Collect the terms in -8v*2 - 18v*2 + 7v*2. -19v*2 Collect the terms in -42x2 - x3 - 8x3 + 42x*2. -9x*3 Collect the terms in 15x - 29x + 8x - 2x + 9x + x. 2x Collect the terms in -6v*3 + 776688 - 776688. -6v*3 Collect the terms in 583z - 279z - 310z. -6z Collect the terms in -3h - h + 14h. 10h Collect the terms in 253s - 86 + 42 - 252s + 44. s Collect the terms in 147 - u + 140 - 287. -u Collect the terms in 6001 - 4j3 - 6001. -4j*3 Collect the terms in -2517 + 8n*3 + 2517. 8n*3 Collect the terms in 2y - 19y - 5y - 6y. -28y Collect the terms in -19j3 - 22j3 - j3 - 18j3 + 62j*3. 2j*3 Collect the terms in -52o*2 + 99o*2 - 46o2. o2 Collect the terms in 10t - 45 + 2t + 3t + 41. 15t - 4 Collect the terms in -3a2 + 17 - 16 + 2a*2 - 11a*2. -12a*2 + 1 Collect the terms in -906 + 3y - 899 + 2701 - 896. 3y Collect the terms in -9t*3 - 3922502t*2 + 3922502t*2. -9t*3 Collect the terms in 0 + 0 - 72v*3. -72v*3 Collect the terms in 1 + 1 - 2 + 18r. 18r Collect the terms in 199 - 199 + 2t*2. 2t2 Collect the terms in q2 - 339q - 3q*2 + 339q. -2q2 Collect the terms in -4t - 5t + 17t - 5t. 3t Collect the terms in 2r2 + 14287r - 14287r. 2r*2 Collect the terms in 8i - 3i + 4i. 9i Collect the terms in 8t + 10t + 188t. 206t Collect the terms in 63 + 107f - 63. 107f Collect the terms in -212r*2 + 114r*2 + 112r*2. 14r*2 Collect the terms in 462 + m - 151 - 159 - 152. m Collect the terms in -13h*2 - 13h*2 - 8h*2 + 35h2. h2 Collect the terms in 74k3 - 151k*3 + 85k*3. 8k*3 Collect the terms in -27v*3 - 86v*3 - 61v*3 - 1. -174v*3 - 1 Collect the terms in -4 - 9w + 4 + 57w. 48w Collect the terms in -6d2 - 6d*2 + 14d*2 - 3d2. -d2 Collect the terms in 0 + 216b3 + 0 - 225b*3. -9b*3 Collect the terms in 1148p*2 + 1126p*2 - 2276p*2. -2p*2 Collect the terms in -a + 12a - 7a + 10a. 14a Collect the terms in -51s*2 + 148s*2 - 70s*2. 27s*2 Collect the terms in -9j + 19j + 0j. 10j Collect the terms in 78 - 30 - 25 - 23 + 13m*2. 13m*2 Collect the terms in 5941i*3 - 1978i*3 - 1983i*3 - 1981i3. -i3 Collect the terms in -7y2 + 11y*2 + 7y*2. 11y*2 Collect the terms in -17u*2 + 0u*2 - 5u*2. -22u*2 Collect the terms in -8 - 132z + 8. -132z Collect the terms in -144c*2 + 92c*2 + 59c*2. 7c*2 Collect the terms in 0o + 18 + 24 - 42 + 6o. 6o Collect the terms in 0 + 0 - 46j. -46j Collect the terms in 32n - 62 + 62. 32n Collect the terms in 5u3 + 3u*3 + 6u*3 - 6u*3. 8u*3 Collect the terms in 4x*3 + 20x*3 - 5x*3 + 7x*3. 26x*3 Collect the terms in 7h - 28h2 + 10h*2 + 12h - 22h. -18h*2 - 3h Collect the terms in -9s3 - 2s*3 - 4s*3. -15s*3 Collect the terms in -242l*2 - 4l*2 - 119l*2. -365l*2 Collect the terms in 17i*2 + 365 - 365 - 19i*2. -2i*2 Collect the terms in 105a - 2 + 2. 105a Collect the terms in 12r*2 - 126r*2 - 8r*3 - 60r*2 + 10r*3. 2r*3 - 174r*2 Collect the terms in -260k*2 + 2k*3 + 260k*2. 2k*3 Collect the terms in -236j*3 - 910j*3 - 381j*3. -1527j*3 Collect the terms in -v + 7v + 2v + 12v. 20v Collect the terms in 21y*2 - 8y*2 - 13y*2 + 18y*3. 18y**3 Collect	{ "pile_set_name": "DM Mathematics" }
f*2 - 28f + 56. Let v(x) = 11x2 + 5x - 10. Let h(o) = -28v(o) - 5z(o). Let p(d) = 3d. Determine h(p(w)). -72w*2 Let x(z) = 5z*2. Let t(m) = 3435m*2. Calculate t(x(o)). 85875o*4 Let q(n) = -2n. Let x(w) = 50w2 + 511w - 511w. What is q(x(f))? -100f*2 Let r(g) = -2g*2. Let l(h) = -27h*2 + 27. Give l(r(y)). -108y*4 + 27 Let q(p) = 2p*2. Let l be (12/(-10))/((-2)/5). Let k(c) be the second derivative of 1/12c*4 + 0c*l + 0c*2 + 0 + 2c. What is q(k(s))? 2s4 Let h be -2 + 24/((-3)/(-1)). Let u(d) = -14d + 9d + hd. Let z(v) = v*2 + 11v - 11. Let k(n) = 2n - 2. Let o(s) = 11k(s) - 2z(s). Calculate o(u(m)). -2m*2 Let k(y) = -7y - 6. Let w(c) = -6c - 5. Let b(d) = -5k(d) + 6w(d). Let z(f) = 3f*2. Calculate z(b(n)). 3n*2 Let o(n) = -n. Let f(k) = 383k*2. Determine o(f(z)). -383z*2 Suppose 7a + 2 = 5a. Let t(f) = f. Let p(x) be the first derivative of -7x*2/2 - 2. Let m(w) = ap(w) - 5t(w). Let z(i) = -2i. What is m(z(n))? -4n Let k(l) be the third derivative of 0l*3 - 1/8l*4 + 0l + 0 + l2. Let x(f) be the first derivative of -f3/3 + 2. What is x(k(h))? -9h2 Let r(k) be the first derivative of 3 + 3k*3 - 2k + 2k - 2k*3. Let a(y) = -2y. What is a(r(p))? -6p2 Let m(o) = 0o + o - 3 + 4o. Let w be 78/24 - (-2)/(-8). Let a(r) = -6r + 4. Let b(v) = wa(v) + 4m(v). Let c(j) = -5j2. Calculate c(b(q)). -20q2 Let x(q) = -q3 + 2q2 - q. Let z be x(1). Let d(v) = 3v + z + 0. Let l(m) be the third derivative of m*5/30 - 16m*2. Calculate l(d(u)). 18u*2 Let h(v) = -6v. Let y(r) be the third derivative of r8/20160 + r5/60 + 5r2. Let i(d) be the third derivative of y(d). Give h(i(x)). -6x*2 Let l(h) = 5h*2. Let z(f) = -1669f + 1669f + 2f*2. Determine l(z(b)). 20b*4 Let k(s) = -7s*2. Let n(q) = 18q. Let l(y) = -y. Let b(r) = 12l(r) + n(r). Calculate b(k(j)). -42j*2 Let n(o) = -5o*2 + 2o*2 + 5o2. Let v(k) be the second derivative of -k4/4 - 2k. Give n(v(q)). 18q4 Let m(n) be the first derivative of n2/2 + 3. Let w(d) be the first derivative of 3 - 7/2d2 + 0d. Determine w(m(l)). -7l Let l(s) = 5s + 0s - 8s + 5s. Let x(v) = 3 + v2 - 3. Give l(x(b)). 2b*2 Let j(k) = -5k*2 - 10k + 10. Let f(l) = l - 1. Let o(r) = 10f(r) + j(r). Let m(n) = -3n*2. Calculate o(m(z)). -45z*4 Let j(h) = -6h - 5. Let t(a) = -7a - 6. Let r(c) = -6j(c) + 5t(c). Let n(i) = i - 1. Let k(s) = -15s + 11. Let y(m) = 2k(m) + 22n(m). Determine r(y(u)). -8u Let o(i) = 2i + 33. Let c(h) = 5h2. What is c(o(x))? 20x*2 + 660x + 5445 Let l(g) = 2g + g2 - 2g. Let n(a) = -2a - 4. Let s be n(-4). Let r(h) = h2. Let o(y) = 2y*2. Let z(w) = sr(w) - o(w). Determine l(z(b)). 4b4 Let w = 13 + -6. Let q(d) = 11d*2 - 7d + 7. Let v(x) = 5x2 - 3x + 3. Let m(a) = wv(a) - 3q(a). Let y(z) = 3z2. Determine m(y(k)). 18k4 Let a(z) = -z2 + 0z2 + 2z*2 - 3z2. Let f(b) be the first derivative of -b3/6 + b - 1. Let y(u) be the first derivative of f(u). Determine y(a(m)). 2m2 Let s(g) = -62g + 3g2 + 62g. Let j(x) = -2x - 4x - 9x. Let i(p) = p. Let k(a) = 18i(a) + j(a). Calculate s(k(c)). 27c2 Let s(i) = 21i. Let q(g) = 10g2. What is s(q(m))? 210m2 Let s(k) = k2. Let x = 1 - 2. Let c(f) = 2f2. Suppose 0 = v - 3. Let z(i) = vs(i) + xc(i). Let h(y) = 4y*2. Calculate h(z(r)). 4r*4 Let a(i) = i + 1. Let o(n) = 5n + 6. Let t(y) = 6a(y) - o(y). Let r(v) = 4v*2 + 4v*2 + 4 - 4. What is r(t(k))? 8k*2 Let p = 7 + -5. Let s(v) = 1 + pv*2 - 1. Let l(x) = -20x. Let n(h) = -7h. Let z(j) = -6l(j) + 17n(j). What is z(s(y))? 2y*2 Let u(p) = -5p*2 - 2. Let t(w) = 21w*2 + 9. Let y(b) = 2t(b) + 9u(b). Let j(f) = f2. What is y(j(c))? -3c*4 Let j(w) = 178w*2 + 2w. Let z(f) = -f. Determine j(z(l)). 178l2 - 2l Let x(h) = -39837h2. Let b(m) = 2m*2. Give b(x(j)). 3173973138j*4 Let t(l) = -9l*2. Let j(o) = -17o*2. Let x(u) = 6j(u) - 11t(u). Let b(n) be the first derivative of -n2 + 5. What is b(x(c))? 6c*2 Let y(v) = 3v*2. Let i(z) be the first derivative of 16z*3/3 + 33. What is y(i(w))? 768w*4 Let k(i) = -91i + 26. Let b(x) = -10x + 3. Let s(a) = 26b(a) - 3k(a). Let o(f) be the first derivative of -f2/2 - 3. Calculate o(s(l)). -13l Let r(j) be the third derivative of -2j5/15 + 8j2. Let i(f) be the first derivative of -f3/3 - 1. Determine r(i(u)). -8u4 Let c(l) = 2l*2 - 71l. Let b(o) = o. Give c(b(y)). 2y2 - 71y Let r(f) be the second derivative of -f*6/240 + 5f*4/12 + 2f. Let u(v) be the third derivative of r(v). Let y(z) = -3z. What is u(y(p))? 9p Let u(z) = 2z. Let o(q) be the first derivative of 0q*2 + 1/120q*5 - 2 - 1/3q*3 + 0q + 0q4. Let f(x) be the third derivative of o(x). Give u(f(n)). 2n Let y(m) = -2m2. Let t(r) = -400r. Determine y(t(f)). -320000f2 Let i(q) be the second derivative of -5q*3/6 + 8q. Let p(t) = t*2 - 3t + 3t. Calculate p(i(y)). 25y*2 Let r(q) = 3q. Let c(b) = -15b2 - 11b - 11. Let a(p) = 4p2 + 3p + 3. Let l(h) = -22a(h) - 6c(h). Determine l(r(g)). 18g2 Let x(j) = 130j*2 - 2. Let f(m) = 3m - 12. What is x(f(s))? 1170s2 - 9360s + 18718 Let u(m) = 2m2. Suppose 2g - 7 = 3, 0 = 5j + 3g - 155. Let o(h) = h + 1. Let f(w) = -6w - 7. Let t(v) = jo(v) + 4f(v). Calculate u(t(s)). 32s*2 Let i(r) = -2r. Let k(v) = -3v. Let o be k(-4). Suppose 2b + 2h = 0, 3b - 5h + 2h = o. Let y(l) = bl2 + 0l*2 + 0l*2. Determine i(y(n)). -4n*2 Let b(x) = -2x*2. Suppose 12a = 11a. Let i(r) be the third derivative of -r2 + 0r*3 + ar + 0 - 1/24r4. Calculate i(b(p)). 2p*2 Let h(j) = 3j*2. Suppose -6a + 5a + 4 = 0. Let w(k) = 0k - 2k + 0k + ak. Give h(w(v)). 12v*2 Let g = -6 - -10. Let y(q) be the first derivative of 3q*2 - 2 - gq2 + 0. Let z(j) = j2. What is y(z(k))? -2k2 Let h(j) = 14j*2. Let a(w) = 86w. Calculate a(h(i)). 1204i2 Let l(a) = 15a - 5a - 8a - 7a. Let i(w) = 12w. Determine l(i(m)). -60m Let o(d) = -d2 - 6. Let a(h) = -2h*2 - 11. Let y = 1 + -7. Let i(f) = ya(f) + 11o(f). Let n(k) be the second derivative of -k3/3 - 5k. Give n(i(x)). -2x2 Let o(n) = 46n. Let h(m) = m*2. Calculate h(o(x)). 2116x*2 Let h(t) = 2t*2. Let f(a) be the third derivative of -11a4/24 + a2. Determine h(f(w)). 242w2 Let f(z) = 86z*2. Let h(g) = 2g. Give f(h(j)). 344j2 Let o(d) = -7d*2 + 5d + 3. Let k(h) = -h. What is o(k(a))? -7a2 - 5a + 3 Let n(p) = 5p2 - 4. Let b(r) = 57r*2. Give n(b(y)). 16245y*4 - 4 Let w(z) = 6z2. Let r(b) be the second derivative of -b4/12 - b3/6 + b2/2 + 2b. Let s(q) = 2q - 2. Let v(f) = 2r(f) + s(f). Calculate w(v(p)). 24p*4 Let u(n) = 46n + 11. Let o(x) = 15x + 4. Let v(b) = 11o(b) - 4u(b). Let c(g) = g2. Determine v(c(i)). -19i*2 Suppose -2c + 9 = c. Let v(q) = cq2 - 2q*2 + 0q*2. Let g(t) = -3t. Let j(b) = -2b. Let f(o) = -4g(o) + 5j(o). Give v(f(n)). 4n*2 Let v(i) = i - 4. Let l(t) = t - 3. Let u(p) = 4l(p) - 3v(p). Let r(j) = 3j*2 + 0j*2 - 4j2. Calculate r(u(w)). -w2 Let a(w) = -w. Let f(l) be the first derivative of -l*4/6 - l - 1. Let x(t) be the first derivative of f(t). Determine a(x(i)). 2i*2 Let i(b) = 18b*2. Let w(a) = 192a. What is w(i(g))? 3456g2 Let t(y) = -3y*2. Suppose 5u = 3k - 6, 5k + 5u = -0u + 10. Let a(z) be the first derivative of 3 + 2z2 + 3z - 3zk - 3z. Determine a(t(d)). 6d2 Let y(v) = -2v - 3. Let j(l) = 2l2. What is y(j(w))? -4w*2 - 3 Let r(c) be the first derivative of 5c*3/3 + 2c - 7. Let y(f) be the first derivative of r(f). Let a(o) = o. What is y(a(n))? 10n Let q(b) = -2b*2 - 3. Let k(w) = 45w*2 + 65. Let a(v) = -6k(v) - 130q(v). Let t(n) = 3n. Give a(t(x)). -90x2 Let u = 25 - -19. Let d(w) = -44 + 3w + u. Let s(h) = 0h2 - 3h*2 + 5h*2. Calculate d(s(z)). 6z*2 Let a(r) = 5r. Let c(s) be the third derivative of 2s2 + 0s*3 + 0s*4 + 0 - 1/60s*5 + 0s. What is c(a(x))? -25x2 Let v(l) = 2666l*2. Let r(j) = -3j. Determine r(v(w)). -7998w2 Let y(c) = 10c*2. Let p(a) = -207a. What is y(p(r))? 428490r*2 Let	{ "pile_set_name": "DM Mathematics" }
3/6 - 153u2. What is h(-12)? 7 Suppose 2 = -3m + m, 4f - 4m = -36. Let l(w) = w*3 - 5w*2 + 7w - 4. Let i be l(4). Let h = i + f. Let g(v) = 2v2 + 3v + 2. What is g(h)? 4 Let k(i) = 3i2 - 17i + 34. Let o(b) = -b*2 + 6b - 11. Let x(u) = -2k(u) - 7o(u). Suppose -4r - w = -0w - 25, -r = -3w - 3. Calculate x(r). -3 Let o be (-5)/((-10)/(-8))(-1)/4. Let d(f) be the second derivative of 3f5/40 + 5f*3/6 - 4f. Let b(h) be the second derivative of d(h). Give b(o). 9 Let i(z) = 2z - 7. Let o(u) = u - 3. Suppose c - 8 = 5c, -m - 4c = 1. Let s(r) = mo(r) - 4i(r). Calculate s(6). 1 Let w(m) be the third derivative of 1/120m*6 + 3m*2 + 0m + 1/15m5 - 1/6m*4 + 0 + 7/6m*3. What is w(-5)? 2 Let h(r) be the third derivative of -7r4/12 - r3/2 + 3r2. Determine h(-3). 39 Let s(q) = -q2 + q3 - 2q*3 - 1 + 2q - 9q3. Suppose 5j - 74 = -24. Suppose l = 3v - 6, 2l - j = -4v + 4l. What is s(v)? -10 Let y(b) be the third derivative of b6/120 - b5/20 - b4/24 - b3/2 + 2b2 - 152. Give y(4). 9 Let o(z) = z3 - 6z*2 - z + 6. Let a be o(6). Let v(l) = 16 - 19 + 0l + l + al. Give v(7). 4 Suppose -7y = -3y - 156. Let p(w) = -2w - 18 + y - 14. What is p(9)? -11 Suppose -p + 3 = -4u, -p + 15 = 4p + 4u. Let o(a) = pa + 0a2 + 2a2 - a2 + 4. Give o(-4). 8 Suppose 29q = 8q + 84. Let f(g) = 125g + 70. Let z(r) = -14r - 8. Let a(w) = qf(w) + 35z(w). Let x = 1 - 2. Calculate a(x). -10 Let q(w) = -7w - 3. Let m(s) = -32s - 7. Let f(n) = 8n + 2. Let b(c) = -9f(c) - 2m(c). Let p(j) = -5b(j) + 6q(j). Give p(5). -8 Let r(i) be the second derivative of i7/840 + i6/90 - i5/120 + i4/6 + 13i*3/6 + 6i. Let t(g) be the second derivative of r(g). What is t(-5)? -16 Let c be (2/3)/((-4)/(-24)). Let t(q) = 11q3 + 4q*2 + 6q + 1. Let y(n) = -3n3 - n. Let i(k) = t(k) + 4y(k). Determine i(c). 9 Let z = 47 + -43. Let t(n) be the first derivative of 4 + 0n3 + 0n + 1/4nz - 1/2n*2. What is t(2)? 6 Let b(l) = -8l*2 + 8l - 5. Let m(s) = -95s2 + 95s - 60. Let v(q) = -35b(q) + 3m(q). Let z(y) = y*2 + 1. Let j(k) = v(k) + 4z(k). Give j(5). -1 Let n(j) = 4 - 3j - j2 + 3j. Let q = -945 - -942. Calculate n(q). -5 Let h = 62 + -58. Suppose -9 = -3a - 3. Let c(y) = y3 + y + 1. Let v(n) = -3n*3 + 4n*2 + 2. Let b(k) = ac(k) + v(k). Calculate b(h). 12 Let o be 17/((-187)/264)(-2)/4. Let t(n) = n3 - 11n*2 - 13n + 14. Calculate t(o). 2 Let s(z) = z*3 + 12z*2 + 2z + 31. Let h be s(-12). Let u(a) = -a - 8. Determine u(h). -15 Let z = -70 - -147. Let j = z + -77. Let g(w) = -w3 - w - 22. Give g(j). -22 Let f(q) = -q3 - 2q2 + 2q - 1. Let p(s) = -s*2 - 11s + 23. Let z be p(2). Calculate f(z). 2 Let x(n) be the third derivative of n*4/12 + 2n3/3 - n2. Let j(b) = 7b - 36. Let s be j(8). Let i be (-3 + 65/s)12. Determine x(i). 10 Let k(w) = 4w3 - 8w*2 + 4w - 4. Suppose 0 = 3s + d - 4, 11d = 4s + 8d - 14. Give k(s). 4 Let c(w) = 2w - 4. Let q be c(4). Suppose -7 = -o - qm, 4o - 5 = 2o + m. Let g(d) = -4 + 1 - d*2 + 0 + 2 - od. Calculate g(-4). -5 Let d(w) = -w*3 - 7w2 + 5. Let x be d(-7). Let f(c) = -c + 1. Let u(r) = -r2 + 6r - 3. Let h(s) = -2f(s) - u(s). Determine h(x). 6 Let j(z) = -z*2 + 4z + 1. Let v(d) = d*2 + 16d + 17. Let n be v(-15). Let k be (n + 1)(-32)/(-24). Suppose kx - x = 18. Give j(x). -11 Suppose -i = -2v + 13, 4i + 43 = 4v - 1. Let r = 15 + i. Suppose -ro + 4o = 2. Let t(n) = 7n3 + n2. What is t(o)? -6 Let z(t) be the second derivative of -1/3t3 + 5t + 1/12t4 + 0 - 5/2t2. Determine z(4). 3 Let v(o) = -o3 + 8o2 + 3o - 15. Suppose -2w - 5k = -11, 2w + 3 = -2k + 17. What is v(w)? 9 Let a(p) = -p - 9. Let j be 27/(-6)4/(-9). Suppose -jn = -0n. Suppose 2u + 13 - 3 = n. Determine a(u). -4 Let f(i) be the third derivative of -i*5/30 - 10i*3/3 - 554i*2. Calculate f(0). -20 Suppose -2s - 7 - 3 = 0. Let v(d) be the third derivative of -d5/60 - d4/6 + d3 - d2 + 982d - 1. What is v(s)? 1 Suppose 4v - 23v - 171 = 0. Let k(z) = z2 + 5z + 9. Determine k(v). 45 Let r be 18/(-9)(-6)/(4 - 1). Let l(q) = -q2 + q + 9. Determine l(r). -3 Let b(j) = -2j2 - j2 + 3j2 + 4j*2. What is b(2)? 16 Let z(b) = -6b + 4b + 5b - 4b - 3. Calculate z(-7). 4 Suppose -2l + 2759 = 5t, 4l - 5t - 4867 - 726 = 0. Let c = l + -943. Let n(a) = -c - 2a + 448 - a*3 + 0a - 3a2. Give n(-1). -1 Let x(d) = -4d*2 - 8d - 5. Let u(q) = -3q2 - 9q - 6. Let c(z) = 3u(z) - 2x(z). Calculate c(-7). 20 Let g(h) = -3h3 - 5h*2 + 2. Let w(v) = -4v*3 - 5v*2 - v + 3. Let j(i) = 3g(i) - 2w(i). What is j(-5)? -10 Suppose -5d + 4 = -21. Suppose i + 12 = -3i + 4w, dw = 2i + 12. Let y(o) be the second derivative of 3o3/2 + o2/2 - 49o - 1. Determine y(i). -8 Let k = 3 - -7. Suppose q = -2g - 7, -2g = -q + 3 - k. Let a(p) = p. Calculate a(q). -7 Let i(o) = o - 2. Suppose -5p + 8 + 47 = 0. Let a(f) = -10f + 12 + f - pf2 - f3 + 0f*3. Let n be a(-10). Calculate i(n). 0 Let v(t) be the second derivative of 5t + 0 + 1/20t5 + 1/3t*3 + 1/3t*4 + 2t2. Let s be v(-4). Let l(k) = k2 + 4k + 3. Determine l(s). 3 Let u(m) = -m2 - 6m + 4. Let z be 374/33486/4. Let g be z/(-189) - 4/(-14). Determine u(g). -3 Let r(j) = -j3 + j2 - j + 2. Let h be (-12)/14 + (-12)/(-14). Determine r(h). 2 Let k(f) = 5f + 19. Let z(c) = -c + 2. Let l(x) = -k(x) - 3z(x). Give l(-8). -9 Let b(w) = 7w. Let t(s) = -2s2 - 22s - 59. Let p be t(-6). Give b(p). 7 Let u(h) = -h*2 - 1. Let q(a) = 3a*2 - 9a - 3. Let b(o) = q(o) - 4u(o). Let c(p) = -3p*2 + 4p. Let n(i) = -2b(i) - 5c(i). Determine n(3). 1 Let z(x) = 2x + 1. Let p(o) = o + 1. Let q(n) = -5p(n) + 3z(n). Calculate q(1). -1 Let w(f) be the second derivative of f4/12 + f3/2 - f2 + 42f. What is w(-4)? 2 Let d = -5 + 11. Suppose 4b - 14 = d. Let h(x) = -18x*2 - 5 + 34x*2 - 15x*2 - 6x + 3. Calculate h(b). -7 Let w(z) = 13z2 + 3z - 28. Let m(a) = 15a2 + 4a - 29. Let b(g) = -6m(g) + 7w(g). Give b(7). 6 Let a(t) = -3t - 9t + 5t + 18t - 3t - 1. Suppose -5o = -4d + 10 - 29, -5d = -2o + 11. Calculate a(d). -9 Let y be -1 + -7(-4 - -7). Let a = y - -27. Let o(s) = s*2 - 4s - 2. What is o(a)? 3 Suppose 0 = -4s - s + 25. Suppose 4o + j - 99 = 0, 2o = o + sj + 30. Let z be 65/o + (-6)/(-15). Let t(m) = -m*3 + 2m*2 + 3m + 1. Give t(z). 1 Let p(k) = k*2 + 11k + 4. Let o be p(-11). Suppose -b - 2t = t + 15, -4t - 36 = ob. Let x(y) = 8y - 4y + 0 - 9 - 6y. Give x(b). 3 Suppose 0 = 4x + 4g - 108, -x + 57 = -3g - 2g. Let r be x/(-15) - ((-124)/30 + 4). Let z(p) = p*2 + 2p + 1. Calculate z(r). 1 Suppose -2b + 0x - 6 = 4x, -4x = -b - 9. Let c(y) = -7y - 7. Let i(a) = 6a + 6. Let w(z) = bc(z) - 6i(z). Calculate w(5). -6 Suppose 0 = -11y - 17 - 16. Suppose -4m + 10 = x, x = 3x + 2m - 8. Let w(z) = -3z - 3 + zx - 4z2 - 1 - z3. Give w(y). 5 Let o(a) be the first derivative of 4a2 + 6a - 81. What is o(-4)? -26 Let o(r) = -r*3 - 6r*2 + 8r - 9. Let m = 676 - 683. Give o(m). -16 Let g(z) = 3z2 + 6z + 54. Let i(n) = -7n2 - 12n - 121. Let p(u) = -9g(u) - 4i(u). Let v = 2 - -2. Determine p(v). -10 Let f(g) = -g*3 - 8g*2 + 5g - 37. Let d be f(-9). Let n(c) = -5c2 - 3c - 1. Calculate n(d). -3 Let q(t) = 23t + 81. Let h(u) = -12u - 43. Let i(o) = 11h(o) + 6q(o). What is i(-6)? -23 Let a(f) = f*3 + 6f + 15 - 9f2 + 6f*2 - 6f*2 + 0f + f. What is a(8)? 7 Let r(b) = -2b - 28. Let z be r(-15). Let y(p) = 1 + 5p + 18p2 - 3p - 25pz. What is y(-1)? -8 Let y(s) = -54 + 116 - 3s + 4s - 60. What is y(-3)? -1 Let c(w) = -w2 - 10w + 10. Suppose 880 = 129v + 2170. Determine c(v). 10 Let r(v) = -v + 4. Let u be 3 + 1(-2 + 0) + -3. Let n be (6 + -6)/((-4)/u). Determine r(n). 4 Let m = -29 + 33. Let o(j) be the first derivative of j5/40 - j4/12 - j*3 + 5. Let d(a) be the third derivative of o(a). Give d(m). 10 Suppose -f + 0f + 3v = 9, 2f + 15 = 5v. Let w(p) be the third derivative of -p3 - 1/24p*4 + 0 - 13p*2 + 0p. What is w(f)? -6 Let s(j) = j*2 + 2j + 7. Suppose -5z + 3 = 5r + 18, -3	{ "pile_set_name": "DM Mathematics" }
Let u = t - 5. Let h = u - -11. Calculate the remainder when 2 is divided by h. 0 Suppose -5a + 2v = -193, 196 = 5a - v + 2v. Calculate the remainder when a is divided by 20. 19 Suppose -219y + 1095 = -216y. Calculate the remainder when y is divided by 61. 60 Suppose -d = -4, 3y - d = 3 + 11. Suppose yj = -13 + 67. Calculate the remainder when 26 is divided by j. 8 Let u = 277 + -138. Calculate the remainder when u is divided by 26. 9 Suppose -4h - h + 35 = 0. Suppose -hs + s - 90 = 0. Let b = s + 30. What is the remainder when b is divided by 9? 6 Suppose 2w = 4r + 18, -w + 6w = r + 27. Suppose 39 = i - m, -wi + 2m + 207 = m. What is the remainder when i is divided by 15? 12 Let l be (-1575)/(-30)4/2. Suppose 0 = j + 2j - l. Let o = -21 + j. Calculate the remainder when o is divided by 4. 2 Let f(i) = -i + 3. Let q be f(3). Let j be 6 + (-8)/2 + 1. Let z = j + q. What is the remainder when 4 is divided by z? 1 Let w(m) = 25m*2 - 6m - 8. Let z be w(-6). Suppose 2p = -6p + z. What is the remainder when p is divided by 30? 26 Suppose 0 = -2o - 3p + 7, 5o + 2p - 22 = -p. Suppose 4m - 341 = -ob, -212 - 245 = -5m + 4b. Calculate the remainder when m is divided by 23. 20 Let f = -3 - -17. Let r = 125 - 122. Suppose 120 = d + 2d + 3a, 114 = 3d - ra. Calculate the remainder when d is divided by f. 11 Suppose -h = -3 - 2. Let s(i) = -i*3 - 9i*2 - 5i - 28. What is the remainder when (-5)/25 + 161/h is divided by s(-9)? 15 Let g = 66 - 40. Suppose 0 = -5y - 2c + 210, 0c - 29 = -y - 3c. What is the remainder when g is divided by (-3 + y/(-12))(-6)/4? 6 What is the remainder when 16 is divided by (-14)/(-18) + -1 + 552/54? 6 Let g(i) = i3 - 11i*2 + 18i + 14. Calculate the remainder when g(13) is divided by 31. 28 Suppose -g = -2g + y + 45, -5y - 78 = -2g. Calculate the remainder when g is divided by 17. 15 Suppose 0n = 2n + 2. What is the remainder when 32 is divided by 11 - (-3)/(-1) - n? 5 Let p = 432 - 181. Calculate the remainder when p is divided by 42. 41 Let d(s) = 5s*3 - s. Let v be d(1). Suppose 0 = vk - 3p + 159, 2p - 4 + 2 = 0. Let h = k + 68. What is the remainder when 57 is divided by h? 28 Let f(m) = -m*2 - 2m. Let z be f(-8). Let a = 129 + z. What is the remainder when a is divided by 28? 25 Suppose -13z = 29 - 2551. Let d = 25 + 3. Calculate the remainder when z is divided by d. 26 Suppose 2p = 18 - 0. Calculate the remainder when p is divided by (-69)/(-21) + 8/(-28). 0 Suppose 2j + 20 + 28 = 2y, 4j - 136 = -4y. Let l = 72 - -42. What is the remainder when l is divided by y? 27 Suppose 8m - 18 = 6. Suppose -md = -2p - 8, -3p - 3 = -4d + 7. What is the remainder when 6 is divided by p? 0 Suppose -13 = -8a + 3. Suppose -2z + z = -at - 167, 650 = 4z + t. Calculate the remainder when z is divided by 33. 31 Suppose 9b - 14b + 4f = -51, -4b + 2f = -42. Calculate the remainder when 9/6344/12 is divided by b. 10 Suppose -3s = -139 - 65. What is the remainder when s is divided by 10? 8 Let i = -12 - -23. Let o = 27 + -21. Calculate the remainder when (-5)/10 + 249/o is divided by i. 8 Suppose u + 2r = 30, -22 = -2u + 2r + 32. Suppose -ub + 26b = -138. What is the remainder when b is divided by 9? 6 Let h(y) = 3y + 38. Let a be h(-12). Let b = 9 + -6. Suppose 0 = q + 3g - b, -3q + 4g = aq - 34. Calculate the remainder when q is divided by 2. 0 Let q be (3 + 376/(-12))-3. Let b = q + -28. What is the remainder when b is divided by 15? 12 Let x = -256 + 269. Calculate the remainder when x is divided by 8. 5 What is the remainder when 112 is divided by 4/(476/92 + -5)? 20 Let m = -103 - -188. Let o(s) = -s2 + 30s - 43. Let y be o(30). Let i = y + m. What is the remainder when i is divided by 11? 9 Suppose 3c + 24 = -c. Let l(a) = a2 - 4a + 6. What is the remainder when 68(-1)/(8/c) is divided by l(6)? 15 Let v = -73 + 63. What is the remainder when 88 is divided by (-6)/v - 1470/(-50)? 28 Suppose -12 = -30m + 27m. Let u = 18 + m. Calculate the remainder when (90 - 2) + (-2 - 0) is divided by u. 20 Suppose -3y = 6, 9m - 5y = 11m - 16. What is the remainder when 135 is divided by m? 5 Suppose -1 = -2z + z. Let q(i) = 7i2 - 2i + 1. Let y be q(z). Suppose 3r + y = 0, 4g - 4r + 9 - 69 = 0. Calculate the remainder when 38 is divided by g. 12 Suppose -40t = 6t - 9844. Calculate the remainder when t is divided by 54. 52 Let v(x) = 2x*2 - 35x - 3. Let g be v(18). What is the remainder when (-761/(-6))/(10/g) is divided by 12? 7 Suppose -y - 8 = -2y. Calculate the remainder when ((-150)/48 - -3)-248 is divided by y. 7 Let l = -5 - -7. Suppose 0 + 4 = 4x. Calculate the remainder when (7 - 8)(-5 + x) is divided by l. 0 Let v(y) be the first derivative of y3/3 - 3y*2/2 - 6y - 1. Calculate the remainder when v(5) is divided by 2/324/16. 0 Let h(a) = -a + 9. Let l be h(4). Suppose 80 = 6t - 2t + 4u, -lu = -5t + 130. What is the remainder when 68 is divided by t? 22 Let v(l) = -10l + 123. Calculate the remainder when v(8) is divided by 19. 5 Suppose 0 = -6w - 0w - 744. Let t be (-5 - -3)(-67)/(-2). Let m = t - w. Calculate the remainder when m is divided by 30. 27 Let x(r) = 8r2 - r - 14. What is the remainder when 175 is divided by x(-3)? 53 Suppose -3s = -5s - 134. Let c = s - -103. Calculate the remainder when c is divided by 13. 10 Let h(b) = -6b - 42. Calculate the remainder when 149 is divided by h(-12). 29 Let k = -84 + 90. Calculate the remainder when 53 is divided by k. 5 Let b(z) = 2z3 - 15z*2 - 16z - 19. Suppose 0 = 5c + 3o - 129, -3c + 87 = -0c - 3o. What is the remainder when b(9) is divided by c? 26 Let g(l) = -5l + 59. What is the remainder when g(4) is divided by 25? 14 Let d = -19 - -35. Let a(m) = -m*2 - 10m + 25. What is the remainder when a(-7) is divided by d? 14 Suppose k = 5k. Suppose -i = -2q + 3i + 166, k = 5q + 4i - 471. What is the remainder when q is divided by 23? 22 Suppose 15 = -5n + a, n + n - 5a = 17. Suppose 5k - 59 = -3b, 3b = -2k + 12 + 8. What is the remainder when k is divided by 3 - (3/4)/(n/16)? 1 Let s(j) = -j - 24. Let h(q) = 2q + 36. Let f(v) = -5h(v) - 8s(v). What is the remainder when f(-21) is divided by 8? 6 Let l = -4 + 7. Suppose 0m - 39 = -lm. Calculate the remainder when (-45 + -31)12/(-4) is divided by m. 12 Suppose 5s - 188 = 3s + l, 461 = 5s + 2l. Calculate the remainder when s is divided by 22. 5 Suppose -2a + 16 = 2k + k, a = -5k + 8. Suppose 0 = -3r + 2 - a, 0 = -4n - r + 22. What is the remainder when -282/(-12) is divided by n? 4 Let v = 6 - -48. Suppose -2z = 7z - 360. Suppose 4n = 2f - 8, 0 = 2f + 3n - z - 3. Calculate the remainder when v is divided by f. 12 Let r(m) = -4m*3 - 10m*2 - 25m - 2. Calculate the remainder when r(-4) is divided by 58. 20 Let y(w) = w*3 + 4w*2 - 10w - 8. Calculate the remainder when y(-3) is divided by 20. 11 Let j = 6 - 6. Suppose j = -2n - 4z - 14, 5 = 6n - n + 2z. Calculate the remainder when 10 is divided by n. 1 Let u be (-10)/(-20)(1 - 1). Suppose -42 = -3g - ug - 3r, 4r = 5g - 43. Calculate the remainder when g is divided by 2. 1 Let v(u) = -u*2 - 41. Let r be v(-9). Let z = -78 - r. Calculate the remainder when 84 is divided by z. 40 Suppose 53 = 2x - 5. Suppose -a + 7 = -2q, 3a = -140q + 144q + 19. Calculate the remainder when x is divided by a. 4 Calculate the remainder when 123 is divided by (-2 + 3)25/1515. 23 Suppose s + 2x = 27, -3x = -0x - 6. Let z(p) = -12p + 4. Let w be z(3). Let k = 35 - w. Calculate the remainder when k is divided by s. 21 Let r = -202 - -216. Calculate the remainder when 21 is divided by r. 7 Let h(z) = 2z + 4. Suppose -24 = m - 4y - 6, 5m + 15 = 5y. Suppose -b + 4 + m = 2l, 4b - 18 = -5l. Calculate the remainder when h(0) is divided by l. 0 Let y(w) = -22w - 6. Let a be y(-4). Let i = a - 60. What is the remainder when 197 is divided by i? 21 Let z(k) = k - 5. Let c be z(6). Let s = 2 + c. What is the remainder when s/(-4) + 77/28 is divided by 1? 0 Let y(h) = 18h. Let b = 34 - 32. What is the remainder when 140 is divided by y(b)? 32 Let i be 1/((-1)/17) + 2. Suppose 20t - 225 = 5*t. Calculate the remainde	{ "pile_set_name": "DM Mathematics" }
3j, 0 = -i - j + 192. What is the highest common factor of i and 56? 7 Let g(j) = -j3 - 6j*2 + 14j - 1. Let d(o) = -o*3 + 5o*2 - 8o + 8. Let y be d(4). Let l be g(y). What is the greatest common factor of 65 and l? 5 Let f be ((-3)/(-6) - 1)(-3 - 5). Suppose -2u = 2u - 268. Suppose -u = -fm + 3p, -21 = -m + 5p - 0p. Calculate the highest common divisor of 128 and m. 16 Let w = 1114 + -924. Calculate the greatest common divisor of w and 100. 10 Let i(w) = -12w*2 - 3w + 4. Let r be i(1). Let x be (-2)/r - 12/(-66)395. What is the greatest common factor of 90 and x? 18 Let c = 1692 - 1428. What is the highest common factor of c and 276? 12 Let u(i) = 17i - 4. Let o be u(1). Suppose -2l + ol = 968. Calculate the highest common divisor of 198 and l. 22 Let i be 1/2 + (-3565)/(-10). Let v be 2/3i/7. Let y be v - (2/(6 - 4) - 4). Calculate the highest common factor of y and 333. 37 Suppose -i + 7131 = 3y, 7y - 2y - 30 = 0. Calculate the greatest common factor of 3 and i. 3 Suppose -2z = -14 - 54. Suppose -6o + 11 = -3x - 10o, 3x + o + 14 = 0. Let u be 2x/(-5) - -304. What is the greatest common divisor of z and u? 34 Let z(k) = -13k3 - 5k*2 + 15k + 22. Let u be z(-4). What is the greatest common divisor of 1218 and u? 42 Let s(g) = 2g2 - 9g - 30. Let f be s(8). Let c = -8 + 12. Suppose -125 - 31 = -ch. Calculate the greatest common divisor of h and f. 13 Let a = -68 + 42. Let w be a/8(-9348)/57. Calculate the highest common factor of 41 and w. 41 Suppose -m - 4 + 18 = 0. Suppose 6w - mw + 512 = 0. Let i = -47 + w. Calculate the greatest common divisor of 119 and i. 17 Let u = 936 - 521. What is the highest common divisor of u and 40? 5 Suppose 53974 + 32482 = 5l - 4834. Calculate the highest common divisor of l and 102. 102 Let n = 444 + 3324. Calculate the greatest common divisor of n and 24. 24 Let o = 60 - 49. Suppose 0 = 2x + 7 - 1, 2n - o = -x. Suppose nw - 160 = 3w. What is the highest common factor of 5 and w? 5 Let r be (-1)/(-1)(-86)/(-1). Let u(g) = 41g - 1925. Let v be u(47). What is the greatest common divisor of r and v? 2 Suppose -22 - 18 = -2z. Suppose 0 = -7i + z + 1. Suppose 0w + n - 454 = -5w, -88 = -w - in. Calculate the greatest common factor of w and 13. 13 Let u(h) be the third derivative of h5/20 + h4/8 + h*3 - 12h*2 - 1. Let n be u(5). What is the greatest common divisor of 6 and n? 6 Let l(s) = 5s*2 + 152s + 448. Let m be l(-3). What is the greatest common factor of m and 481? 37 Suppose 51s + 299 - 605 = 0. Let t = 16 - 11. Suppose -th + 3 = -3r, 2h - 6h = r - 16. What is the highest common divisor of r and s? 2 Let q be (2 + -6)/(1 + 1). Let g be q/6421/2. Let w = g - -22. What is the highest common factor of w and 64? 8 Suppose 5d = -5l + d - 54, -4l = -5d + 35. Let r be ((-50)/l)/((-10)/(-4)). Let s be r - (2 + (-3 - -1)). What is the highest common divisor of s and 6? 2 Let q be (2 + -1 + 0)11. Suppose 2h - 118 = 284. Let w = h - 124. What is the greatest common divisor of w and q? 11 Let d be 1/(-8) - (-10 - (-722)/(-16)). What is the greatest common divisor of 671 and d? 11 Let q = 59 - 59. Suppose q = -2j + 9j - 119. Suppose 692 = 5p + j. What is the highest common factor of 15 and p? 15 Let h(d) = 68d - 1351. Let c be h(20). Calculate the highest common factor of 2799 and c. 9 Suppose 0 = -32w - 43 + 299. Suppose 5n + 4a = 76, 2a + w = 2n - 8. What is the greatest common factor of 114 and n? 6 Let l(t) = -3 + 3 - 8t - 9t - 26 + 14t2. Let j be l(-5). Suppose -13n = -2229 + j. What is the highest common factor of n and 20? 20 Let t be -2 - (42-1 + 2). Let y = 2711 - 2521. What is the greatest common factor of t and y? 38 Let i = 3162 + -3111. Calculate the highest common factor of i and 147. 3 Let y = -459 - -976. Suppose 0 = -2w + 4u + 110, 0u + 20 = -5u. What is the greatest common divisor of y and w? 47 Let k be (-187341)/(-726) + (-1)/22. Calculate the highest common divisor of k and 13072. 86 Suppose -220 = 3k - 3j + 392, 5j = -4k - 780. Let c = k + 260. What is the highest common divisor of 40 and c? 20 Let d(p) = 51831p*2 - 42p + 43. Let c be d(1). Calculate the greatest common factor of c and 22. 22 Suppose -2v = 4a - 2324, 8v - 3v = -3a + 5796. Suppose -5p - 17 + 2 = 0, 5g + 4p - v = 0. What is the highest common factor of g and 36? 18 Let d = 4103 - 4040. What is the greatest common divisor of d and 2037? 21 Let t = 216 + -191. Let i = 46 - t. Suppose 3s + 741 = 4k, -5k - 3s - 2s = -970. Calculate the highest common divisor of i and k. 21 Let r = -35216 - -35306. Let a be 2-11 - 9. Let i = 29 + a. What is the highest common divisor of r and i? 18 Suppose 0 = -4v - 2g + 250, -3v = -2v + 3g - 60. Let h(n) = -14n - 38. Let o be h(-4). Calculate the highest common factor of v and o. 9 Let d(i) = -9i - 35. Let c be d(-8). Suppose -5s = -5o + 555, o - 6o + 2s = -555. Calculate the greatest common divisor of o and c. 37 Suppose 3v = -2j - 368 + 406, 4j - 40 = -3v. What is the highest common factor of 618 and v? 6 Let c(f) = f*2 - 3f + 7f - 16 + 2f. Let s be 399/49 + (-3)/21. Let d be c(s). What is the greatest common factor of d and 24? 24 Suppose 2u - 153 = 3s - 4s, 4s = 4u + 612. Let t = s - 118. Let q = 544 + -369. Calculate the highest common divisor of q and t. 35 Let u(s) = 16s - 4s3 - 2 - 3 + 3s*3 + 3s*2 - 3. Let h be u(-5). Calculate the greatest common divisor of 7 and h. 7 Suppose -11i - 14i + 2376 = -i. What is the highest common factor of 873 and i? 9 Let l = -5 - -8. Let v be 171/(3 + 228/(-80)). Let h be (v/133)/((-10)/(-28)). What is the greatest common factor of l and h? 3 Suppose -3x + 7 = 4h - 2, 2h = -4x + 12. Suppose -2885j + 3153j = 21708. Calculate the greatest common divisor of x and j. 3 Let i = -388 + 385. Let n be 7845/35 - i/(-21). Calculate the highest common divisor of 28 and n. 28 Suppose l = 15 + 13. Suppose -l - 7 = -7b. Suppose -bt = -4o + 115, t + 2t - 85 = -2o. What is the greatest common factor of 35 and o? 35 Let q = 493 + -438. Suppose -154 + 1144 = qg. Let i(p) = 2p3 - p2 - 4p - 7. Let j be i(5). Calculate the highest common divisor of g and j. 18 Suppose 3g - 30 = 2v + 189, -v = g - 68. Let w = 242932 + -242930. What is the highest common factor of g and w? 1 Let r be 5 - 4 - 1256/(-21). Calculate the greatest common factor of r and 37587. 33 Suppose -2339 = -10h + 421. Let j = 322 - h. What is the highest common divisor of 207 and j? 23 Let u = -1742 - -1763. Suppose s = 5s - 12. Suppose -d + sd = 12. What is the highest common divisor of d and u? 3 Suppose 0 = 5g + x - 5937, 2137g = 2138g + 2x - 1182. Calculate the highest common factor of 540 and g. 108 Let x(k) = -314k + 1928. Let i be x(6). Calculate the highest common divisor of 52228 and i. 44 Suppose 4y + 2a = -y + 17998, 2a = -2. What is the greatest common factor of 288 and y? 144 Let g = -747 - -1008. What is the highest common divisor of 279 and g? 9 Let m(y) = 812y + 623. Let j be m(12). What is the greatest common factor of j and 7? 7 Suppose 8p + 59 = 83. Suppose -5k + 2g = -275, -4k = -pk - g - 55. What is the highest common divisor of 275 and k? 55 Let l = -3641 - -3735. What is the highest common factor of l and 34? 2 Let g(z) = 6z + 232. Let l be g(-38). Suppose 186 = ln - 2p, 9n - 3p = 4n + 231. Calculate the greatest common factor of 96 and n. 48 Let u = -15875 - -46094. Calculate the greatest common factor of u and 7. 7 Let b(j) = -6j - 6. Let a be b(-16). Let d = a + -86. Suppose -3p + 561 = 4g, 0 = 3g - dp + 5p - 427. What is the greatest common factor of g and 18? 18 Suppose 732 = 12i + 60. Let u(b) = -2b3 - 52b*2 - 52b - 8. Let w be u(-25). What is the highest common factor of w and i? 14 Suppose -33a - u - 2167 = -38a, 4u + 1724 = 4a. What is the greatest common factor of 248 and a? 62 Let i = 48 - 49. Let m be 5/i(6 - 8). Suppose d + 5j = 10, -j - 40 = -4d - 5j. Calculate the highest common divisor of m and d. 10 Let l be -3 + 36/14 + (-4)/7. Let q be (-13915/5)/l. Calculate the highest common factor of 27 and q. 27 Suppose -3n = -76 - 122. Suppose -364790w = -364779w -	{ "pile_set_name": "DM Mathematics" }
v*2 + 3v - 204 What is the o'th term of -45, -42, -39, -36? 3o - 48 What is the a'th term of -68274, -68276, -68280, -68286, -68294? -a2 + a - 68274 What is the i'th term of -273, -272, -271, -270, -269, -268? i - 274 What is the x'th term of -112, -236, -358, -478, -596, -712, -826? x2 - 127x + 14 What is the t'th term of -98, -191, -290, -395, -506? -3t2 - 84t - 11 What is the c'th term of 57, 55, 53, 51? -2c + 59 What is the x'th term of 17, 80, 185, 332, 521, 752? 21x*2 - 4 What is the s'th term of 71, 36, -59, -244, -549, -1004? -5s*3 + 76 What is the v'th term of -290, -310, -374, -506, -730, -1070, -1550, -2194? -4v*3 + 2v*2 + 2v - 290 What is the u'th term of -28, -74, -120, -166, -212? -46u + 18 What is the b'th term of -23, -148, -503, -1208, -2383? -20b*3 + 5b*2 - 8 What is the q'th term of 45, 88, 131, 174, 217, 260? 43q + 2 What is the s'th term of 47, 80, 109, 134, 155? -2s2 + 39s + 10 What is the m'th term of -185, -762, -1723, -3068, -4797, -6910, -9407? -192m2 - m + 8 What is the d'th term of 473, 498, 533, 572, 609, 638? -d3 + 11d*2 - d + 464 What is the y'th term of 2330, 2321, 2312? -9y + 2339 What is the j'th term of 100, 174, 248, 322, 396? 74j + 26 What is the r'th term of -178, -174, -176, -190, -222, -278, -364, -486? -r3 + 3r*2 + 2r - 182 What is the h'th term of 17, 26, 39, 56, 77, 102, 131? 2h2 + 3h + 12 What is the a'th term of -15, -27, -53, -99, -171, -275, -417, -603? -a3 - a2 - 2a - 11 What is the j'th term of -105, -311, -651, -1125, -1733, -2475, -3351? -67j*2 - 5j - 33 What is the p'th term of 1381, 2765, 4149, 5533, 6917? 1384p - 3 What is the n'th term of 552, 1099, 1644, 2187, 2728, 3267? -n2 + 550n + 3 What is the l'th term of -38, -43, -48, -53? -5l - 33 What is the b'th term of 4511, 9016, 13519, 18020, 22519, 27016? -b2 + 4508b + 4 What is the a'th term of 299, 602, 903, 1202, 1499? -a*2 + 306a - 6 What is the c'th term of -1, -15, -51, -121, -237, -411, -655, -981? -2c3 + c2 - 3c + 3 What is the x'th term of -944, -939, -930, -917, -900, -879, -854? 2x2 - x - 945 What is the k'th term of -62, -102, -116, -92, -18, 118, 328? 2k3 + k2 - 57k - 8 What is the a'th term of -270, -278, -300, -342, -410, -510, -648, -830? -a3 - a2 + 2a - 270 What is the o'th term of -698, -1395, -2092, -2789, -3486? -697o - 1 What is the j'th term of -114, -107, -88, -51, 10, 101, 228? j3 - 115 What is the a'th term of -8492, -16988, -25484, -33980, -42476? -8496a + 4 What is the o'th term of 486, 947, 1380, 1779, 2138, 2451? -o*3 - 8o*2 + 492o + 3 What is the k'th term of -140, -133, -126, -119, -112, -105? 7k - 147 What is the g'th term of 37, 93, 247, 547, 1041? 8g3 + g2 - 3g + 31 What is the m'th term of -653, -647, -627, -587, -521, -423? m3 + m2 - 4m - 651 What is the g'th term of 26, 13, -18, -73, -158, -279, -442? -g*3 - 3g*2 + 3g + 27 What is the t'th term of 636, 1316, 2006, 2712, 3440, 4196? t3 - t2 + 676t - 40 What is the u'th term of -63, -114, -167, -222, -279? -u2 - 48u - 14 What is the b'th term of 7, -40, -87? -47b + 54 What is the w'th term of 87, 333, 743, 1317, 2055? 82w2 + 5 What is the l'th term of 1651, 1652, 1653, 1654, 1655? l + 1650 What is the b'th term of -27, -9, 23, 75, 153, 263, 411, 603? b3 + b*2 + 8b - 37 What is the k'th term of -120, -113, -94, -57, 4, 95, 222, 391? k*3 - 121 What is the i'th term of -107, -398, -877, -1544, -2399, -3442? -94i*2 - 9i - 4 What is the k'th term of -19, -29, -51, -91, -155, -249, -379, -551? -k*3 - 3k - 15 What is the x'th term of 123, 123, 125, 129, 135? x*2 - 3x + 125 What is the s'th term of -192, -390, -588? -198s + 6 What is the v'th term of -489, -492, -495, -498? -3v - 486 What is the n'th term of 589, 585, 579, 571, 561? -n2 - n + 591 What is the u'th term of 5863, 5863, 5865, 5869, 5875? u2 - 3u + 5865 What is the n'th term of 165, 305, 449, 597, 749, 905? 2n*2 + 134n + 29 What is the g'th term of 188, 184, 180, 176, 172, 168? -4g + 192 What is the w'th term of 24262, 24263, 24264, 24265, 24266? w + 24261 What is the m'th term of -245, -484, -713, -926, -1117? m3 - m2 - 243m - 2 What is the g'th term of 11, 19, 53, 131, 271, 491, 809? 3g3 - 5g*2 + 2g + 11 What is the w'th term of 117, 98, 79, 60? -19w + 136 What is the f'th term of -361, -652, -943, -1234? -291f - 70 What is the t'th term of 669, 1337, 2005, 2673? 668t + 1 What is the n'th term of 35, 19, 3, -13, -29, -45? -16n + 51 What is the t'th term of 366, 729, 1090, 1449, 1806, 2161, 2514? -t*2 + 366t + 1 What is the q'th term of 275, 272, 267, 260, 251, 240, 227? -q2 + 276 What is the x'th term of 13, 22, 19, -2, -47? -x3 + 16x - 2 What is the j'th term of 55, -22, -111, -218, -349, -510? -j3 - 70j + 126 What is the n'th term of -2, 6, 20, 40, 66? 3n2 - n - 4 What is the w'th term of -11, -28, -49, -74, -103, -136? -2w*2 - 11w + 2 What is the p'th term of 2, -4, -12, -22, -34? -p*2 - 3p + 6 What is the i'th term of -1143, -2291, -3439, -4587, -5735, -6883? -1148i + 5 What is the q'th term of -25, -42, -79, -142, -237, -370, -547, -774? -q3 - 4q*2 + 2q - 22 What is the l'th term of 43, -9, -115, -293, -561? -3l3 - 9l*2 - 4l + 59 What is the h'th term of -9313, -9315, -9317, -9319, -9321, -9323? -2h - 9311 What is the n'th term of 1730, 1744, 1770, 1814, 1882? n3 + 7n + 1722 What is the k'th term of 114, 115, 118, 123, 130, 139, 150? k*2 - 2k + 115 What is the a'th term of -19, -30, -47, -70, -99, -134, -175? -3a2 - 2a - 14 What is the d'th term of -1134, -2275, -3416, -4557? -1141d + 7 What is the z'th term of 171, 184, 193, 198, 199? -2z*2 + 19z + 154 What is the a'th term of 77, 98, 119? 21a + 56 What is the d'th term of 483, 480, 477, 474, 471? -3d + 486 What is the b'th term of 100, 119, 138, 157? 19b + 81 What is the a'th term of -72, -62, -52, -42? 10a - 82 What is the x'th term of 93, 185, 277, 369? 92x + 1 What is the k'th term of 245, 465, 685, 905, 1125? 220k + 25 What is the w'th term of -4, -73, -268, -655, -1300, -2269? -11w3 + 3w*2 - w + 5 What is the r'th term of 146, 151, 156, 161, 166? 5r + 141 What is the f'th term of 138, 547, 1230, 2187, 3418, 4923, 6702? 137f2 - 2f + 3 What is the h'th term of 16373, 16372, 16371? -h + 16374 What is the h'th term of 4, -13, -54, -131, -256, -441, -698? -2h3 - 3h + 9 What is the y'th term of -600, -599, -598? y - 601 What is the b'th term of 2843, 2841, 2839, 2837? -2b + 2845 What is the b'th term of -91, -162, -259, -388, -555? -b3 - 7b*2 - 43b - 40 What is the x'th term of 134, 280, 440, 620, 826? x3 + x2 + 136x - 4 What is the f'th term of -224, -438, -664, -908, -1176, -1474, -1808, -2184? -f3 - 207f - 16 What is the v'th term of -17, 3, 57, 145, 267, 423, 613? 17v2 - 31v - 3 What is the b'th term of 27, 35, 55, 93, 155, 247, 375, 545? b*3 + b + 25 What is the g'th term of 87, 99, 117, 141? 3g*2 + 3g + 81 What is the p'th term of -1020, -2039, -3058, -4077, -5096? -1019p - 1 What is the f'th term of -4, -32, -88, -178, -308, -484, -712? -f3 - 8f*2 + 3f + 2 What is the k'th term of 1712, 1717, 1724, 1733, 1744, 1757, 1772? k*2 + 2k + 1709 What is the h'th term of 25, 48, 75, 106? 2h2 + 17h + 6 What is the v'th term of 23, 103, 237, 425, 667? 27v2 - v - 3 What is the d'th term of 29, 105, 231, 407, 633, 909, 1235? 25d2 + d + 3 What is the n'th term of 154, 307, 454, 589, 706, 799? -n3 + 3n2 + 151n + 1 What is the x'th term of -49, -144, -309, -550, -873, -1284, -1789, -2394? -x*3 - 29x2 - x - 18 What is the d'th term of -17, 0, 19, 40, 63, 88? d2 + 14d - 32 What is the g'th term of -11, -146, -519, -1250, -2459, -4266, -6791, -10154? -20g3 + g2 + 2g + 6 What is the i'th term of -35, -65, -91, -113? 2i*2 - 36i - 1 What is the k'th term of 148, 151, 166, 199, 256, 343, 466? k*3 - 4k + 151 What is the c'th term of 785, 1574, 2363, 3152, 3941? 789c - 4 What is the i'th term of 38, 16, -42, -154, -338, -612, -994? -3i*3 - i + 42 What is the h'th term of 16, 79, 190, 349, 556, 811, 1114? 24h*2 - 9h + 1 What is the y'th term of 38, 79, 170, 335, 598?	{ "pile_set_name": "DM Mathematics" }
Suppose 5m - 1 = -16. Let n be ((-15)/9)/(1/m). Suppose -1061c + 1053c + 112 = 0. Solve -1 = np - i + 22, -2p - c = -2i for p. -4 Let a be (2/6)/((-2)/(-18)). Let g be -2(-5)/(-10)-9. Suppose -ai + 3t + 9 = 0, -5i - g = -4i + 5t. Solve -6 = 3c - 3l - 0l, -2l + i = c for c. -1 Suppose -411s - 2j = -406s - 9, 0 = 3s - 2j - 15. Solve -6h = -9h - 2v + 15, sv = 4h - 20 for h. 5 Let a be 710/26 - 916/2977. Solve -3m = m - g - 22, 5m - a = g for m. 5 Let w be ((200/16)/(-5))/((-15)/36) + -6. Solve 7k = 12k - 4y, 3y - 15 = w for k. 4 Let p be ((-34)/102)/((-2)/30). Suppose 2r - 3r - 3q + 17 = 0, -2r - q = -14. Solve m + 5n + 1 = 0, rn - 5 = pm - 0 for m. -1 Let h(m) = 44m + 984. Let y be h(-22). Solve 11s - ys = 2f + 9, 0 = -4s - 12 for f. 3 Suppose 0 = -45f - 83 + 308. Solve 0 = -5l + l - 5y - f, y = -1 for l. 0 Let d be 8/7(-1211)/(-692). Solve 4a + dq = -22, -2q + 6 = -4q for a. -4 Suppose -2i - p - 2 = 0, -2i - 2p = -0i + 2. Let l be (41 - 39)(-10)/4i. Solve 4u + 30 = -5c - 3, 4c = -lu - 30 for c. -5 Suppose 0 = k + 4f - 2, -2k - 3f = -8 + 14. Let i be ((-8)/k)/(-2 + (-91)/(-42)). Solve x - 2h - 6 = 0, 2x - 2h + 2 = i for x. 0 Suppose -16 = -20v + 16v. Suppose 2g - 7g - 4x + 131 = 0, 5x = -vg + 103. Let k be g/(-18)2-1. Solve ku + 4 = -5i - 9, -5u + 10 = 2i for u. 4 Let q = -3 - -3. Suppose 2 = h - 48. Let c = 53 - h. Solve ct - 3 = 2y, q = -0y + 5y - 3t + 3 for y. 0 Let g = -97 - -109. Let r be 81/g(-8)/(-3). Let w be 30/r(-18)/(-5). Solve 0q - 9 = -q - 2v, 2v - w = 2q for q. 1 Suppose 90 = -3k + 5s - 2s, -2s = -3k - 89. Let t(r) = -r*3 - 31r*2 - 60r - 54. Let n be t(k). Solve -h = -ni - 4, -2h + 16 = 2h + 2i for h. 4 Let a = -111 - -270. Let r = -159 + a. Solve 2h + 5n - 12 = 0, 2n = -rh + 3h + 1 for h. 1 Suppose 168a + 18 = 174a. Solve -3n - 13 = -i, -2n = -15i + 20i + a for i. 1 Let m(n) = -n2 - 16n - 7n + 23n - 12 - 21n. Let h be m(-20). Suppose -127o = -123o - h. Solve 2x + 2y - o = 0, 0y = -2x + y - 4 for x. -1 Let x = -552 - -554. Suppose -3y - q + 19 = 0, -xy + 12 = 3q - 10. Solve 2u + 6 = 0, yu - 4 + 10 = -3s for s. 3 Suppose 182f - 72f = 220. Let m be (-1)/(-2) + (-14)/(-4). Let b = m + -2. Solve -fo + 4 = -bg, 4g + 4o = o + 20 for g. 2 Let q(w) = 394w - 1573. Let f be q(4). Solve -8k - 3 = -fk + 2p, 0 = 3k - 5p + 8 for k. -1 Suppose -842b = -799b - 516. Solve 5h + 9 = 2d + b, h + 4 = 5d for d. 1 Suppose 0x = -3x + 27. Suppose -xj + 78 = 17j. Solve -3t - 35 = 5h + 2t, -3h - 3 = -jt for h. -4 Let s(i) = 161i + 4994. Let y be s(-31). Solve -7w = yj - 12w - 19, 3j - w = 11 for j. 3 Let v(w) = 4w3 - 17w2 + w + 13. Let m(l) = l3 + 7l2 + l + 11. Let z be m(-7). Let y be v(z). Solve -j - y = -5j - c, 1 = c for j. 0 Let m = -4 - -436. Let o = 435 - m. Solve s = -4w - 25, -3s = ow - 2w + 20 for s. -5 Let b be (5 - -7 - 4) + -6. Solve 0 = 4z - 2z - 4a + 22, -a = 3z - b for z. -1 Suppose p - 3 + 1 = -2v, -18 = 4p - 5v. Let u be (-2 - p) + 100/2. Let f = u - 45. Solve fl - 20 = 5q + 10, 2q - l + 7 = 0 for q. -1 Let d(a) = a*2 + 29a + 38. Let h be d(-28). Solve 11v - 5n = 13v + 6, 5n + h = 0 for v. 2 Suppose 0x + 6 = 3x. Let h be -24 + 22 + (-8)/(-1). Suppose -hc - 191 + 197 = 0. Solve -5y = v + 19, -v + c = y - xv for y. -3 Let s be (70/21)/((-1)/3). Let o be (88/(-40) - -1)s/4. Solve 23 = 3i - 2h, -oh - 8 - 19 = -3i for i. 5 Let c = 11 + -7. Let b(t) = -8t3 - 53t*2 - 11t - 17. Let y be b(-7). Suppose 0 = 197f - yf. Solve -5o - 2v + 4v - 15 = 0, f = -4o + cv - 12 for o. -3 Let u(o) = -6o - 94. Let n be u(-15). Let h be (-3(-1)/2)/((-2)/n). Solve 2p = -2p - 3w + h, p + 3 = 3w for p. 0 Let t = 23 + -12. Let w = 1320 + -1331. Let v = t + w. Solve -5a + 10 = 3g, v = -0g - 5g + 4a - 45 for g. -5 Let y(s) be the second derivative of s*4/12 - 2s*3/3 - 20s*2 - 73s. Let a be y(-7). Solve 0 = 3o + 5t + a, -4o = t + 21 for o. -4 Suppose 7u - 20 = 63 + 1. Solve -uo + 2f = -9o - 11, 4f = -16 for o. 1 Suppose 0 = -1079u + 1078u + 25. Solve u = b - 5z, -3b - 2b + z + 29 = 0 for b. 5 Let q(s) = -s3 + 95s*2 + 10s - 947. Let b be q(95). Let w be (2/2)/(2/6). Solve 5d - 12 = u, -u = -bd - wu + 2 for d. 2 Let u be 6/7 - (-570)/266. Suppose 5r - 3y = 11, 2r + 4y = 13 + 7. Solve 2b = -0t + 3t - r, 5b = ut - 10 for t. 0 Let t(q) = 2q2 + q - 10. Let w be t(5). Let f = w + -41. Solve 2 = 4n - fh + 6, 0 = 2h + 8 for n. -5 Let x be (10 - 24)/7 + -2 + 26. Solve -8 = -j - 3l - 0, x = 5j - 3l for j. 5 Let s be 7(-18)/(-567) - (0 + 32/(-18)). Solve 0 = sr + 5l - 8, -4r + 22l - 18l = 12 for r. -1 Let h be (-16)/(-6)(-12)/(-16)(-4 - -5). Solve -4p - 16 = -b, -8b + 14 = -hp - 9b for p. -5 Let r(s) = -2s*3 + 12s*2 - 9s - 24. Let m be r(4). Solve 8z - 4 = 4x + 7z, -4 = -mx + 3z for x. -2 Let k(c) = 153c*3 - 307c*3 - 20 + 2c - 5c2 + 155c*3 - 4c. Let r be k(6). Solve 0j - 2j = -rb - 18, 0 = 5b - 5j + 35 for b. -2 Let z be 7-714/(-343). Solve -2 = zy - 5j, 0 = -10y + 11y - j + 1 for y. -1 Suppose 10 = 4m + 2. Suppose 45 = -mr + 11r. Solve t = -3, -y + t + t + r = 0 for y. -1 Let w be 2/11 - 96/44. Let v be w/9 - (-6457)/99. Let o = 67 - v. Solve 4r + 12 = 3a - 5, -oa + 23 = -5r for a. -1 Let z(c) = c*3 + 2c*2 - 106c - 73. Let t be z(-11). Solve 12 = 3y + 2j, ty - j - 4j - 16 = 0 for y. 4 Let r(p) = -5p - 70. Let t be r(-14). Suppose 3m + 2 = -2f, -3m + 5m + 2f + 4 = t. Solve -3a + 2o = -3, 5o = ma + 11 - 2 for a. 3 Let i = 27497 - 27482. Let l be 6/(((-6)/(-4))/1). Solve -lz + i = 2w - 7, 0 = w + 5z - 20 for w. 5 Suppose -786z + 788z - 2 = 0. Suppose 11 = w - z. Solve -3u = 3t + w, -5u - 3t = -2t for u. 1 Let d = 17 + -10. Suppose -dc - 16 = c. Let m be -1 - -4 - 2 - c. Solve -3p = -5h - 3, 0h = p + mh - 1 for p. 1 Let j(n) = -n2 + n + 22. Let o be j(5). Suppose -og + 1 = 5. Let l be (g - -2) + 14. Solve -40 = -5z - lc, 3z - c - 22 = -3c for z. 4 Suppose 2w - k = w + 11, -3w + 2k = -31. Let n(a) = -2a + 34. Let r be n(w). Let v = 21 - 18. Solve r = -5x + c, 0 = 2x + 4c - vc + 5 for x. -3 Let v(a) = a2 - 30a + 107. Let u = 739 - 713. Let f be v(u). Solve -3t = -fi, -5t - 4i - 8 - 1 = 0 for t. -1 Suppose 101b - 71 = 86b + 79. Solve -4z - 36 = -5x + x, -2z + b = 5x for x. 4 Suppose 8t - 212 = 7t. Let v = -211 + t. Solve 2b = -4j + 11 - v, -j = -4b + 11 for b. 3 Let t(c) = -2c - 46. Let x be t(-25). Suppose 2l = xl - 3h - 20, -3l + 4 = 2h. Solve -lf - 2b = -6 - 12, 17 = 3f - 2b for f. 5 Let r = -6254 - -6284. Solve -2f = -6f + 2m + r, 9f - m = 50 for f. 5 Let r(s) = s2 - 5s + 4. Let p be r(5). Suppose -k + 3d = -2d - 12, -d - 10 = -pk. Solve kn + 2f + 4 + 4 = 0, -16 = -2n + 4f for n. 0 Let b be (28920/65)/6 - (-4)/(-26). Let r = b - 69. Solve h + 3s = -3h, -r = 3h + s for h. -3 Let i(p) = p*3 + 3p*2 + 3p + 6. Let x be i(-2). Suppose 2t - 17 = 2g - 5, 0 = t - 3g - 12. Solve -j - tk - 2 = 0, -2k - x = 2j - 0k for j. -2 Suppose 10 = 5o - 3n - 288, -5o - 10n = -220. Solve 5p - 5c + 5 = 0, c - 54 = -o for p. -3 Suppose -11456 = 582p - 52196. Solve m = -5x + p - 44, -16 = -m - 3x for m. 1 Let w = -109 + 107. Let u be -10 + 15 - w/((-6)/9). Solve um - g + 8 = 0, -2m + 4g - 2g - 8 = 0 for m. -4 Let m = 50 - 140. Let p be ((m/(-8))/5)/((-6)/(-40)). Solve -3g = 2g - p, 2y + 6 = 4g for y. 3 Let y(x) = 11x3 - 4x*3 - 5x*3 + 1 - 11x + 17x2 - 8. Let g be y(-9). Solve 2h - q + g = 0, -3h - h - 2q - 2 = 0 for h. -3 Let m(x) = 38x - 37. Let l(w) = -w3 - 16w*2 - 3w - 47. Let v be l(-16). Let j be m(v). Solve k = 2y + 1, y + j = -3k + 3y for k. -1 Let r be 4/3 + (-75)/9 + 7. Suppose p + 4v - 10 = -rv, 0 = 2p - v - 2. Solve 0 = 4w + 5b + 31, pw + 1 = b - 4 for w. -4 Suppose -45i + 1037 - 722 = 0. Solve 4t + 20 = -5j, 2j = it - 4t - 8 for t. 0 Suppose 0 = b + 4l - l + 15, 5b + 7 = 2l. Let i be (b + 12/9)-3. Suppose 3d = 15, 2p + 4d - 14 = 14. Solve -5 = -ph + w, 2h = 5h - 2w - i for h. 1 Let u(r) = 25*r + 314. Let w(z) =	{ "pile_set_name": "DM Mathematics" }
letters picked without replacement from {g: 6, l: 13}. Give prob of sequence lg. 13/57 Calculate prob of sequence scwk when four letters picked without replacement from {k: 2, t: 1, s: 4, c: 1, w: 2}. 1/315 Four letters picked without replacement from {j: 1, z: 3, l: 8, p: 2, k: 5}. What is prob of sequence kkjl? 5/2907 What is prob of sequence sxxs when four letters picked without replacement from xstssssxosissssssxt? 11/1292 Two letters picked without replacement from rrrrrrarar. Give prob of sequence ra. 8/45 Calculate prob of sequence kjjj when four letters picked without replacement from {k: 14, j: 5}. 35/3876 Three letters picked without replacement from dfzxfijdijiz. Give prob of sequence zdx. 1/330 What is prob of sequence nm when two letters picked without replacement from {n: 8, m: 4, r: 4}? 2/15 What is prob of sequence hsd when three letters picked without replacement from {h: 7, s: 2, d: 1}? 7/360 Four letters picked without replacement from {w: 2, k: 2, q: 4, b: 3, l: 2, o: 1}. What is prob of sequence bwkl? 1/1001 Two letters picked without replacement from qkyqkccyzcyqyyk. What is prob of sequence zk? 1/70 What is prob of sequence hqh when three letters picked without replacement from {y: 3, h: 4, q: 7}? 1/26 What is prob of sequence eea when three letters picked without replacement from {a: 9, e: 7}? 9/80 What is prob of sequence cl when two letters picked without replacement from yydzlydzycyzyzd? 1/210 Calculate prob of sequence pp when two letters picked without replacement from {p: 7, o: 3}. 7/15 What is prob of sequence vw when two letters picked without replacement from {w: 3, v: 5}? 15/56 Two letters picked without replacement from {i: 12, p: 4, s: 2, d: 2}. Give prob of sequence ii. 33/95 What is prob of sequence lq when two letters picked without replacement from {q: 1, l: 1, k: 1, e: 2}? 1/20 Calculate prob of sequence ssgg when four letters picked without replacement from ggsgsggg. 1/28 Calculate prob of sequence kmr when three letters picked without replacement from {m: 1, r: 1, k: 1}. 1/6 Two letters picked without replacement from {g: 10, x: 2}. Give prob of sequence xx. 1/66 What is prob of sequence la when two letters picked without replacement from {w: 1, j: 1, k: 2, l: 1, e: 1, a: 1}? 1/42 Three letters picked without replacement from {t: 5, j: 2, u: 2, s: 1, i: 1, x: 5}. What is prob of sequence ixu? 1/336 What is prob of sequence qqgi when four letters picked without replacement from {r: 3, q: 5, g: 2, i: 2}? 2/297 What is prob of sequence lc when two letters picked without replacement from xxlc? 1/12 Calculate prob of sequence zsmt when four letters picked without replacement from sbbstbtbbzbmbs. 1/4004 Four letters picked without replacement from {w: 5, e: 4, m: 6}. What is prob of sequence mmwe? 5/273 Calculate prob of sequence cgg when three letters picked without replacement from {i: 2, g: 5, c: 3}. 1/12 What is prob of sequence lllk when four letters picked without replacement from llllkllllllllllllllk? 8/95 Calculate prob of sequence mxxq when four letters picked without replacement from {m: 1, x: 4, q: 1, t: 1, h: 1}. 1/140 Calculate prob of sequence ff when two letters picked without replacement from gfffgg. 1/5 Calculate prob of sequence rnnn when four letters picked without replacement from nrnrnnnnn. 5/36 Calculate prob of sequence rk when two letters picked without replacement from {g: 1, p: 1, k: 13, r: 1, f: 2, s: 2}. 13/380 Calculate prob of sequence tt when two letters picked without replacement from {k: 4, t: 14}. 91/153 What is prob of sequence nemg when four letters picked without replacement from niigedmieiddidid? 1/21840 Calculate prob of sequence rr when two letters picked without replacement from fffrrffffrr. 6/55 What is prob of sequence zjz when three letters picked without replacement from czjcccjzzc? 1/60 What is prob of sequence qqq when three letters picked without replacement from qqyqqyyqqy? 1/6 Calculate prob of sequence ukd when three letters picked without replacement from {u: 1, k: 1, d: 3}. 1/20 Calculate prob of sequence yu when two letters picked without replacement from {u: 1, y: 1, g: 1}. 1/6 What is prob of sequence oy when two letters picked without replacement from {o: 1, y: 2}? 1/3 Two letters picked without replacement from {u: 1, d: 3}. What is prob of sequence dd? 1/2 Calculate prob of sequence tttt when four letters picked without replacement from ttttttt. 1 What is prob of sequence ax when two letters picked without replacement from wxwxwnawnwwwawwnwwn? 2/171 Four letters picked without replacement from gbbbbbbgbbggggbggggg. Give prob of sequence bggb. 22/323 What is prob of sequence hkeh when four letters picked without replacement from {h: 3, e: 7, k: 3, o: 2, z: 3}? 7/4080 What is prob of sequence bc when two letters picked without replacement from cccbcbcbbc? 4/15 Two letters picked without replacement from uddlued. What is prob of sequence ed? 1/14 What is prob of sequence uduj when four letters picked without replacement from vuldjjulvggvgjlgj? 1/7140 Calculate prob of sequence mi when two letters picked without replacement from {m: 5, o: 1, w: 2, i: 1}. 5/72 Calculate prob of sequence wd when two letters picked without replacement from ddwtvqw. 2/21 Calculate prob of sequence ggg when three letters picked without replacement from {i: 10, h: 1, g: 4, s: 3}. 1/204 Two letters picked without replacement from vvvlkfzvk. What is prob of sequence fk? 1/36 Three letters picked without replacement from vrrrrzvvz. What is prob of sequence zrr? 1/21 Two letters picked without replacement from unpum. What is prob of sequence up? 1/10 What is prob of sequence vhg when three letters picked without replacement from {e: 1, z: 1, h: 2, v: 2, g: 2, t: 5}? 2/429 Calculate prob of sequence bb when two letters picked without replacement from {v: 2, k: 2, f: 4, l: 2, b: 4}. 6/91 Calculate prob of sequence xcxx when four letters picked without replacement from {c: 9, x: 3}. 1/220 Three letters picked without replacement from rchnhnbabnrc. Give prob of sequence hbh. 1/330 Calculate prob of sequence jhf when three letters picked without replacement from hfhhhhjhfbjhhhhh. 11/840 Two letters picked without replacement from {k: 7, r: 9}. What is prob of sequence kk? 7/40 Two letters picked without replacement from {d: 1, o: 3, a: 1, s: 5}. Give prob of sequence ao. 1/30 Two letters picked without replacement from {h: 2, y: 2, m: 1, z: 3, c: 1, t: 3}. Give prob of sequence ty. 1/22 Two letters picked without replacement from wwmwwwmwmmwwwmwrwrww. Give prob of sequence rm. 1/38 Two letters picked without replacement from {q: 11, g: 2}. What is prob of sequence gg? 1/78 Four letters picked without replacement from {j: 5, e: 5}. What is prob of sequence jeej? 5/63 Four letters picked without replacement from wywwwwuywwwwywywwyy. Give prob of sequence uywy. 5/1292 Two letters picked without replacement from {r: 1, l: 3}. Give prob of sequence lr. 1/4 Calculate prob of sequence wb when two letters picked without replacement from {w: 1, a: 2, b: 1}. 1/12 Three letters picked without replacement from {t: 8, i: 3}. What is prob of sequence tit? 28/165 Two letters picked without replacement from tgt. What is prob of sequence tg? 1/3 What is prob of sequence lcl when three letters picked without replacement from llulckkclc? 1/20 Four letters picked without replacement from {d: 1, x: 2, q: 1, e: 3, m: 7, k: 4}. Give prob of sequence emqe. 7/12240 What is prob of sequence vj when two letters picked without replacement from {j: 1, v: 3, q: 1, r: 5}? 1/30 What is prob of sequence uguk when four letters picked without replacement from kggguukupk? 3/280 Calculate prob of sequence qaaq when four letters picked without replacement from {q: 5, a: 2, y: 3}. 1/126 Four letters picked without replacement from jjttttj. Give prob of sequence jtjj. 1/35 Two letters picked without replacement from ttctcxhxxccttt. Give prob of sequence cc. 6/91 Three letters picked without replacement from jdddejejeddkd. Give prob of sequence kdd. 5/286 What is prob of sequence kkk when three letters picked without replacement from kkkkskkkkkkkkkk? 4/5 What is prob of sequence qmi when three letters picked without re	{ "pile_set_name": "DM Mathematics" }
when two letters picked without replacement from {z: 3, d: 4, q: 3, u: 1, x: 2, c: 2}. 2/35 What is prob of sequence xqm when three letters picked without replacement from yxshxyssyymq? 1/660 What is prob of sequence llhl when four letters picked without replacement from {h: 1, m: 1, l: 2}? 0 Three letters picked without replacement from kddkiyiffkfyid. Give prob of sequence fyk. 3/364 What is prob of sequence yiil when four letters picked without replacement from {i: 5, l: 3, y: 6, n: 3}? 3/476 What is prob of sequence qx when two letters picked without replacement from wqwqqxww? 3/56 Two letters picked without replacement from uuu. Give prob of sequence uu. 1 Two letters picked without replacement from {u: 4, s: 2}. Give prob of sequence uu. 2/5 Three letters picked without replacement from {z: 1, x: 2, c: 1, v: 1}. Give prob of sequence xxz. 1/30 What is prob of sequence lruo when four letters picked without replacement from vuluovvudrvvv? 1/5720 Two letters picked without replacement from axaa. What is prob of sequence aa? 1/2 Two letters picked without replacement from {z: 1, p: 1, g: 4, o: 5, f: 3}. Give prob of sequence oo. 10/91 What is prob of sequence ee when two letters picked without replacement from {e: 5, u: 14}? 10/171 Two letters picked without replacement from ggggg. Give prob of sequence gg. 1 What is prob of sequence ric when three letters picked without replacement from {u: 1, s: 3, r: 1, i: 1, h: 1, c: 5}? 1/264 Four letters picked without replacement from {s: 3, f: 12}. What is prob of sequence sfff? 11/91 Calculate prob of sequence eej when three letters picked without replacement from {e: 5, j: 5}. 5/36 Three letters picked without replacement from {p: 1, s: 2, g: 1}. What is prob of sequence pss? 1/12 Two letters picked without replacement from xdgjgjg. Give prob of sequence dg. 1/14 Calculate prob of sequence medg when four letters picked without replacement from {e: 1, g: 4, m: 9, d: 1}. 1/910 Calculate prob of sequence za when two letters picked without replacement from aazaaaaaaaaaaaaaaaaz. 9/95 Three letters picked without replacement from iivbiivivivqoiivis. Give prob of sequence bib. 0 What is prob of sequence fkt when three letters picked without replacement from ttktftffkttktkkf? 1/24 Four letters picked without replacement from {f: 10, m: 2, b: 4}. Give prob of sequence mbfb. 1/182 What is prob of sequence ai when two letters picked without replacement from aliyskka? 1/28 Two letters picked without replacement from pswgwgg. What is prob of sequence ws? 1/21 Four letters picked without replacement from {d: 2, y: 9}. What is prob of sequence yyyd? 7/55 What is prob of sequence bp when two letters picked without replacement from {p: 7, j: 3, b: 2}? 7/66 Two letters picked without replacement from {f: 1, b: 5, n: 1, h: 1, w: 1}. What is prob of sequence bf? 5/72 What is prob of sequence qwbb when four letters picked without replacement from qwqbjabqwqqiqq? 1/858 What is prob of sequence cfuo when four letters picked without replacement from coffuu? 1/90 Two letters picked without replacement from cisssivws. What is prob of sequence wi? 1/36 Calculate prob of sequence rewi when four letters picked without replacement from {e: 1, l: 1, a: 2, i: 1, w: 2, r: 1}. 1/840 Two letters picked without replacement from nnnnxxnnn. Give prob of sequence nx. 7/36 Calculate prob of sequence wb when two letters picked without replacement from wwbwbbbwbwww. 35/132 Three letters picked without replacement from {k: 4, c: 3, p: 7}. What is prob of sequence kpc? 1/26 Calculate prob of sequence lon when three letters picked without replacement from onololoollo. 4/165 Three letters picked without replacement from {v: 2, j: 2, z: 1, p: 1, q: 1, e: 1}. Give prob of sequence vzv. 1/168 What is prob of sequence xyxv when four letters picked without replacement from {x: 2, v: 4, y: 1}? 1/105 Two letters picked without replacement from {p: 9, o: 5, y: 3, s: 3}. Give prob of sequence yo. 3/76 Calculate prob of sequence bbu when three letters picked without replacement from {b: 2, u: 1, s: 3, i: 1}. 1/105 What is prob of sequence ehqw when four letters picked without replacement from {e: 2, g: 1, n: 1, h: 3, q: 1, w: 5}? 1/572 Four letters picked without replacement from clblcccllllylcllyll. What is prob of sequence lylc? 275/23256 Four letters picked without replacement from {z: 3, j: 4, q: 11, s: 1}. Give prob of sequence zszq. 11/15504 Four letters picked without replacement from upkffxf. What is prob of sequence ufkf? 1/140 Two letters picked without replacement from {j: 1, u: 12, e: 5, t: 1}. What is prob of sequence je? 5/342 Three letters picked without replacement from qqqqq. Give prob of sequence qqq. 1 Four letters picked without replacement from jgjjgigijjtvtjt. What is prob of sequence jtij? 1/182 Three letters picked without replacement from qsztzqrsrtttrqqwwz. Give prob of sequence szs. 1/816 Three letters picked without replacement from {f: 1, o: 1, z: 1, v: 2, a: 1, s: 2}. What is prob of sequence afs? 1/168 Three letters picked without replacement from zgzdqqdzqzqg. Give prob of sequence gdd. 1/330 What is prob of sequence wqw when three letters picked without replacement from wowdwqddwdrd? 1/110 Two letters picked without replacement from {p: 4, s: 2}. Give prob of sequence pp. 2/5 Calculate prob of sequence rprp when four letters picked without replacement from rrprp. 1/10 What is prob of sequence pyc when three letters picked without replacement from {z: 1, c: 1, p: 2, y: 1}? 1/30 What is prob of sequence gy when two letters picked without replacement from gqgqggyy? 1/7 Three letters picked without replacement from kkqkkkkk. What is prob of sequence kqk? 1/8 What is prob of sequence xxtx when four letters picked without replacement from xzxxkztxzx? 1/84 Four letters picked without replacement from {g: 2, m: 8}. Give prob of sequence gmmm. 2/15 Calculate prob of sequence rmr when three letters picked without replacement from aranmddraaddrm. 1/182 Two letters picked without replacement from sossosoosohhssssos. What is prob of sequence os? 10/51 Two letters picked without replacement from {w: 1, y: 1, s: 1, m: 2}. What is prob of sequence ws? 1/20 Calculate prob of sequence osv when three letters picked without replacement from bovfqsf. 1/210 Three letters picked without replacement from hhihihiihhih. What is prob of sequence hii? 7/66 Four letters picked without replacement from {l: 13, a: 3}. Give prob of sequence laal. 3/140 Four letters picked without replacement from lhwhwwhlwhllhhwhlh. What is prob of sequence lwlw? 5/918 Two letters picked without replacement from {y: 8, v: 5}. What is prob of sequence yv? 10/39 What is prob of sequence ia when two letters picked without replacement from aaaaaaiaaaiaaaia? 13/80 Calculate prob of sequence mvt when three letters picked without replacement from {n: 2, k: 1, v: 6, t: 1, m: 3}. 3/286 What is prob of sequence jwcp when four letters picked without replacement from {c: 1, s: 1, p: 1, w: 1, j: 1}? 1/120 Calculate prob of sequence igxc when four letters picked without replacement from {i: 1, c: 3, d: 1, x: 1, g: 1}. 1/280 Four letters picked without replacement from {b: 1, h: 9, u: 2, v: 8}. Give prob of sequence buvu. 2/14535 Three letters picked without replacement from dzdlzzbbldzabqddqqqd. What is prob of sequence azl? 1/855 What is prob of sequence jsj when three letters picked without replacement from {s: 2, j: 5, c: 5}? 1/33 Four letters picked without replacement from xxexgxxxexxxgxx. What is prob of sequence exxx? 11/182 Two letters picked without replacement from ioijspa. What is prob of sequence io? 1/21 What is prob of sequence yk when two letters picked without replacement from bhbbiibiiky? 1/110 Four letters picked without replacement from {e: 3, h: 5}. Give prob of sequence ehhh. 3/28 Four letters picked without replacement from wwvwwvvwvww. Give prob of sequence vvvv. 1/330 Four letters picked without replacement from {p: 5, t: 4, g: 3, o: 4}. Give prob of sequence oooo. 1/1820 What is prob of sequence kcck when four letters picked without replacement from {k: 7, c: 9}? 9/130 Calculate prob of sequence ze when two letters picked without replacement from {e: 1,	{ "pile_set_name": "DM Mathematics" }
c. Calculate the remainder when c is divided by g. 12 Suppose 21z - 203 + 77 = 0. Let q(u) = 3u - 6. What is the remainder when q(5) is divided by z? 3 Suppose o - 12 = -3. Let w = 14 - 11. Calculate the remainder when (-160)/10w/(-2) is divided by o. 6 Suppose n = -2v + 144, 4n - 18 = 2v - 152. What is the remainder when 209 is divided by v? 67 Let f be ((-280)/25)/(4/(-30)). Let k be 4/(-14) + (-10224)/f. Let d = -55 - k. What is the remainder when d is divided by 17? 16 Suppose 1 = g + 6, -x = 4g + 15. Let j(h) = h2 - 3h + 1. What is the remainder when 4 - -1(0 + x) is divided by j(4)? 4 Let s(a) = 17a + 1. Let p be s(2). Let k = 6 + p. Calculate the remainder when k is divided by 11. 8 Let v be -2(2 - (-14)/(-4)). Let w(k) = 2k + 18. Let i be w(-6). Let r = v + i. Calculate the remainder when 14 is divided by r. 5 Let w(p) = 2p2 - 9p + 8. Let n be w(5). Let a = 7 + n. What is the remainder when 77 is divided by a? 17 Let s = 18 + -16. Let g(j) = -3j2 + 2j - 11. Let o(m) = 2m2 - m + 7. Let t(r) = 5g(r) + 8o(r). Calculate the remainder when s is divided by t(-2). 0 Let a = 9 - -3. Let q(n) = n2 + 17n + 32. Let r be q(-13). What is the remainder when a is divided by ((-7)/(-5))/((-4)/r)? 5 Suppose -4t + 9t - 50 = 0. Suppose -2n - 5u = -106, -2u - t = 4n - 254. What is the remainder when n is divided by 21 - 4/(-6 - -2)1? 19 Let k = -23 + 25. Let v(j) = j3 - j2 + 2j - 3. What is the remainder when v(k) is divided by 4? 1 Suppose -2297 = 29n - 4269. Let x = 18 - 11. Calculate the remainder when n is divided by x. 5 Suppose -9426 = -49t - 2468. Calculate the remainder when t is divided by 39. 25 Suppose -5x - 5h + 239 = -7h, 5h - 37 = -x. Calculate the remainder when x is divided by 2/3 - (-74)/6. 8 Let j(s) = -32s - 246. What is the remainder when j(-30) is divided by 16? 10 Suppose 3p = -3p + 24. Suppose 9j - pj - 420 = 0. Calculate the remainder when j is divided by 17. 16 What is the remainder when 133 is divided by (((-1620)/(-16))/(-9))/((-9)/36)? 43 Let a(r) = r3 + 3r*2 - 2r + 3. Let f(d) = 19d - 1117. What is the remainder when f(63) is divided by a(-3)? 8 Suppose 0 = 5h + 10, h = -8d + 11d - 158. Calculate the remainder when 362 is divided by d. 50 Let z(k) = 18k2 - 4k - 14. Calculate the remainder when z(-3) is divided by 11. 6 Let v = 871 - 836. What is the remainder when v is divided by 14? 7 Let c be 3/9151. Suppose -cp + 0x + 11 = -2x, p - 5x - 16 = 0. Calculate the remainder when 75 is divided by (p + (-7)/5)-65. 23 Let b = -106 + 147. What is the remainder when b is divided by 25? 16 Suppose 0 = 5y + 6u - u - 145, y = 5u + 29. What is the remainder when 260 is divided by y? 28 Calculate the remainder when 388 is divided by (24/(-16))/(((-38)/132)/19). 91 Let a(g) = g*3 - 11g*2 - 2g + 26. Let v be a(11). Suppose -128 = -3i - vw, -28 = i - 2i - 5w. What is the remainder when i is divided by 7? 6 Suppose z + 4n = 7, 3z - 2n - 57 - 20 = 0. Calculate the remainder when 65 is divided by z. 19 Let o = 414 + -407. Let r(k) = 6k*3 - k + 1. Let j be r(1). What is the remainder when j/333/2 is divided by o? 5 Let c(m) = -m*3 + 4m*2 - 4m + 3. Let n be c(3). Let w = -3 + n. Calculate the remainder when 61 is divided by 6((-2)/w + 2). 13 Suppose -o + 50 = -15. Suppose 4g - 192 = v, o = -g + 2g + 4v. Calculate the remainder when g is divided by 13. 10 Suppose -3u + 0s = 3s - 783, 3s = u - 277. What is the remainder when u is divided by 55? 45 Let q(i) = -i + 5. Calculate the remainder when (-5)/15 - 2/(-6) - -4 is divided by q(3). 0 Suppose -11y + 8y + 6 = 0. Let m = 13 - y. What is the remainder when 37 is divided by m? 4 Let d be 2 + 2 - (-4 + 5). Suppose dm - 210 - 291 = 0. What is the remainder when m is divided by 57? 53 Suppose -114s = -121s + 665. Calculate the remainder when s is divided by 33. 29 Let n = 20 - 17. Suppose -p = -0p - 3. Suppose 0f = -ps - 2f + 121, 4f - 119 = -ns. Calculate the remainder when s is divided by 21. 20 Let m = 41 - 31. Suppose 4c - c - a = 1, 5c - 4a = -m. Suppose -2z + 5 = 5j, 2j = cz + 7 + 9. What is the remainder when j is divided by 1? 0 Let j(v) = -7v + 5. Let l be j(-3). Let d = 4 + 11. Let b = l - d. What is the remainder when 30 is divided by b? 8 Suppose 32 = 30q - 448. Let x = 20 + -11. What is the remainder when q is divided by x? 7 Suppose q + c - 5 = 9, -5c = q - 30. Calculate the remainder when 306 is divided by q. 6 Calculate the remainder when (279 - -14)/(1 - 0) is divided by 103. 87 Let l(k) = 5k - 18. Let m be l(4). Suppose -1 = -mg + 9. Suppose 4d - 2y = 48, y = gy - 16. What is the remainder when 26 is divided by d? 12 Let w(c) = -8c + 32. Let y be w(-5). Calculate the remainder when 225/(-6)y/(-30) is divided by 7. 6 Suppose -4l + 455 = -56o + 57o, 0 = -2o - 10. Calculate the remainder when l is divided by 31. 22 Let r(b) = -b*3 - 4b*2 + 7b + 4. Suppose 4v + 10 = 2v. Let p be r(v). What is the remainder when (132/(-9))/(1/p) is divided by 15? 13 Let q(t) = 104t3 - 2t*2 + 3t - 1. Let i be q(1). Let u = -46 + i. Calculate the remainder when u is divided by 30. 28 Suppose -12 + 3 = -3p. Suppose po - 7 - 5 = 0. What is the remainder when 4 is divided by o? 0 Let b(k) = 15k - 74. What is the remainder when 42 is divided by b(7)? 11 Suppose -4y + 4 = -8y. What is the remainder when 2(-57)/6y is divided by 5? 4 Let z = -27 + 35. Let f(j) = -j2 + 7j - 3. Let y be f(6). Suppose yq + 4p = 3p + 62, 5p - 16 = -q. What is the remainder when q is divided by z? 5 Suppose 10w + 804 = 9w. What is the remainder when 19 is divided by -3 + 31/11 - w/66? 7 Let t(d) = -d - 2. Let x(f) = f*3 - 4f*2 + 4f - 5. Suppose -2r - 4w = -24, 4 = 3r + 4w - 6w. What is the remainder when x(r) is divided by t(-7)? 1 Suppose 123 = 2d + 4v - 49, 3v - 319 = -4d. Calculate the remainder when d is divided by 6. 4 Let g be (12/14)/(3/126). Let z = g + -26. Calculate the remainder when (-1)/((-2)/104)3/4 is divided by z. 9 Let y = -31 - -11. Calculate the remainder when ((-183)/6)/(5/y) is divided by 25. 22 Suppose 18n + 14n = 4032. What is the remainder when n is divided by 12? 6 Let v = 29 - 14. Let l = 7 + -1. Suppose -ly + 2y = -228. Calculate the remainder when y is divided by v. 12 Suppose 0 = 4o + 3v - 90, 2v = -4o - o + 109. Suppose -2z + 555 = 347. What is the remainder when z is divided by o? 20 Let f(l) = 37 + l + l2 - 37. Let t be f(3). Calculate the remainder when 1 + t/4 + 27 is divided by 8. 7 Suppose 0 = -19w + 13w + 102. Calculate the remainder when 82 is divided by w. 14 Calculate the remainder when 155 is divided by 24/(-20)-52. 11 Suppose 5t = t + 120. Let s = 58 + -53. What is the remainder when s is divided by -34/t-5? 1 Let z be ((-3)/(-24)14)/((-6)/168). Let m = z - -98. What is the remainder when m is divided by 13? 10 Suppose -s = 1 - 4. Suppose 4x - 180 = -4o, 5o + sx = -0o + 223. Let z = o + -6. Calculate the remainder when z is divided by 20. 18 Suppose 3m + 15 - 144 = 0. Let g = -31 + m. Calculate the remainder when g is divided by 8. 4 Let r(n) = n3 - 3n*2 + n + 3. Let j be r(3). Suppose ji - 40 = i. What is the remainder when 23 is divided by i? 7 Calculate the remainder when 136 is divided by 100/70-1-49. 66 Suppose 25i - 288 = -47i. Suppose 0 = 3q + 4 - 1, 5k - 2q = 72. Calculate the remainder when k is divided by i. 2 Suppose -117 = 2r + p + 28, 5r = 3p - 335. Let t = 120 + r. Calculate the remainder when t is divided by 21. 8 What is the remainder when 63 is divided by 2/16 - 1143/(-72)? 15 Let k(c) = c + 28. Suppose 8h - 54 = 2h. What is the remainder when k(15) is divided by h? 7 Let y = 44 - 41. Suppose 0 = j - 2c, -3c + 2 + 43 = yj. What is the remainder when 15 is divided by j? 5 Let s = -3 - -4. Calculate the remainder when 128 - (-3 + (-2)/s) is divided by 17. 14 Let r = 212 + -205. What is the remainder when (-4)/82 + 19 is divided by r? 4 Suppose -3o = -5i - 138, -2o + 131 = 3i + 20. Calculate the remainder when o is divided by (33/((-132)/(-8)))/(2/26). 25 Let w be ((-4)/(-8))/((-2)/244). Let s = w - -119. What is the remainder when s is divided by (-324)/(	{ "pile_set_name": "DM Mathematics" }
Which is bigger: 140/5279 or -1? 140/5279 Which is smaller: -1 or 0.0803853? -1 Which is greater: 2159 or 2077? 2159 Which is bigger: 2 or 10.172? 10.172 Is -66406 less than 0.1? True Which is smaller: 2 or 163/123? 163/123 Which is smaller: 193 or 214? 193 Which is bigger: -815 or -2? -2 Which is smaller: 73092 or 73087? 73087 Which is greater: -708229 or -708228? -708228 Which is smaller: -2477 or -1449? -2477 Is -5 <= -556/145? True Is 1 < -99825? False Are 449/4 and -275 non-equal? True Is 0.2 at most 30960/77? True Which is greater: 0 or -33/5024? 0 Which is smaller: 0.05 or -420/73? -420/73 Is -1984638 at most as big as -1984638? True Is -4 bigger than 8/6149? False Is -19815 < -19844? False Is -832 equal to -4157/5? False Are -2 and -156.414 unequal? True Is -2/290955 < 0? True Are -0.05 and 903 unequal? True Is -1 greater than 2/30447? False Which is bigger: 0 or 2/2810315? 2/2810315 Is 93297 smaller than 93298? True Is 7/80760 greater than or equal to 1? False Which is greater: 0.02126 or 0.6? 0.6 Which is bigger: -1196 or -1208? -1196 Which is smaller: 6217 or 62181/10? 6217 Which is smaller: 716934 or 0? 0 Which is greater: 2517/7 or 361? 361 Is 222684 < 222686? True Which is greater: 105/43 or 3? 3 Which is greater: 3919/45 or 1? 3919/45 Which is smaller: -5 or 0.013? -5 Is 19969 greater than or equal to 19971? False Is 267/14761 greater than -1? True Is 1406/47 > -0.2? True Is -53284 less than or equal to -53266? True Is 211 > 135/7? True Which is greater: -52.7 or 1846? 1846 Which is bigger: -152371 or 1.6? 1.6 Is -9430/11 greater than -857? False Is 25232 greater than -2? True Is 344/7437 equal to -1? False Which is greater: -0.58874 or -0.1? -0.1 Are 1016 and 966 equal? False Which is bigger: 21/51932 or 1? 1 Which is smaller: 498.583 or 3/4? 3/4 Is 0 smaller than 186/1775? True Is -6047/739 greater than or equal to -9? True Is 75312 not equal to 75312? False Which is smaller: 11997 or 11999? 11997 Which is bigger: 1 or -149/4129? 1 Which is bigger: 12148 or 36448/3? 36448/3 Which is bigger: 17 or 3547/209? 17 Which is smaller: 12 or 49560? 12 Which is bigger: 3152 or 148096/47? 3152 Is -68143 greater than or equal to -68143? True Is 295/9 > -15/13? True Which is smaller: 99 or 2875/29? 99 Which is greater: -124 or 13? 13 Which is smaller: -2/7 or 251775? -2/7 Does 538/813 = 1? False Is 3543 at least 87? True Which is smaller: 3/19 or 1/1819? 1/1819 Which is smaller: 56052/17 or 3298? 56052/17 Are -8188 and -8187 equal? False Which is bigger: -0.034 or 562? 562 Which is smaller: -4756 or -4830? -4830 Which is greater: 55/1037 or 0? 55/1037 Is -75704 at most as big as -75704? True Is -9 > -35/19? False Are -4136/265 and -15 equal? False Is -515423 less than or equal to -515428? False Are -1/292608 and 1 equal? False Which is greater: -45 or -19459? -45 Is 4715/2 greater than or equal to 2359? False Is 30 != 353/12? True Is -340/8629 bigger than -1? True Which is smaller: -1513679 or 2/5? -1513679 Which is bigger: 0 or -250/43127? 0 Is -2161 <= -2158? True Which is smaller: -59946 or -1? -59946 Is -1049/4 > 1.1? False Is 0 greater than -43/13868? True Is 27945 at most 28080? True Which is smaller: 0 or -1/410988? -1/410988 Which is greater: 28245 or 28247? 28247 Which is smaller: 60456 or 60454? 60454 Which is bigger: -10680 or -10657? -10657 Is 0 less than or equal to 4.777? True Which is bigger: 161062 or 161063? 161063 Is 1038.164 < -1/2? False Do -155434 and -155433 have the same value? False Is -78 > 16? False Is -4072 less than -4102? False Is -258 greater than or equal to 605.1? False Is 2 at most as big as 23889? True Do -238 and -402 have the same value? False Are 644 and 21287/33 non-equal? True Which is smaller: -1 or -89/447? -1 Is 1 >= 68/238737? True Which is smaller: -13/212965 or -1? -1 Which is bigger: -16126 or 3? 3 Which is bigger: 2129 or 78? 2129 Which is smaller: 147/2455 or -1? -1 Are -1/6 and -978 unequal? True Is 69417/5 greater than 13883? True Are 42741 and 128222/3 unequal? True Is 2265.16 greater than or equal to -4? True Is -62/7759 greater than 1? False Is 3 less than or equal to 1767/449? True Which is smaller: 234920 or 234921? 234920 Which is smaller: -42167 or -42128? -42167 Which is bigger: 1 or 55/183? 1 Is -48416 equal to -8? False Is -43337 at least as big as -43331? False Is -10057 < -10062? False Which is bigger: -81890 or -0.1? -0.1 Is -2/328331 equal to -1? False Is -1 at most as big as 2/43009? True Which is smaller: -61 or -279? -279 Which is bigger: -256238 or 2/3? 2/3 Which is smaller: 53220 or 53219? 53219 Which is bigger: -105 or -95? -95 Is -946 greater than or equal to -62.6? False Which is smaller: -5/563 or -1? -1 Is 1857724 >= 1857726? False Is -68699/3 bigger than -22901? True Is -57 >= -30358/523? True Which is smaller: 0 or 10/4647? 0 Is -3/169 at least as big as 107? False Which is smaller: 39088/65 or 601? 601 Which is smaller: 3 or -0.1356? -0.1356 Which is bigger: 1 or 205/17516? 1 Which is smaller: -19/12112 or 0? -19/12112 Is -2/11 at least as big as -18833? True Which is greater: 16427 or 16424? 16427 Which is bigger: 306/9293 or 1? 1 Which is bigger: 0 or 2/266563? 2/266563 Is -3592 smaller than -3596? False Is 0.118 bigger than -88.8? True Is 154646 not equal to 154638? True Which is smaller: 77666 or 77664? 77664 Which is smaller: -42497 or -127487/3? -42497 Are 1 and -4/222903 nonequal? True Which is smaller: -289 or -26289/91? -289 Is -49 greater than -60? True Which is greater: 222.87 or 9? 222.87 Which is smaller: 4495889 or 4495888? 4495888 Is -43916 > 2/7? False Is -205/2 at least as big as 10? False Are -2916 and -2925 nonequal? True Is 192293 at least 192292? True Which is greater: 256 or 89? 256 Which is greater: -1/12818 or 0? 0 Which is smaller: 395 or 305? 305 Is 1070 >= 939? True Is -3017 at most -3017? True Which is bigger: 5700 or 170? 5700 Is 77 at least as big as 2784? False Which is smaller: 573 or -11? -11 Which is greater: 1/9050 or -1? 1/9050 Is 1699097/9 bigger than 188790? False Which is smaller: 1 or -3/73972? -3/73972 Which is smaller: 6350 or -9? -9 Which is greater: 2/227 or 7345? 7345 Is 53815 not equal to 0.18? True Which is smaller: 6 or -3103? -3103 Are 2/252613 and 1 equal? False Which is greater: 553 or 1/146? 553 Does 144 = 125? False Which is smaller: -460532 or -460533? -460533 Is 54/5087 at least as big as 1? False Is 2/407107 greater than -2? True Which is smaller: -350 or 49? -350 Are -0.2 and 53662 equal? False Which is smaller: 145891 or 145900? 145891 Is 0 less than or equal to 10823/4? True Is -78617 at most as big as 0.9? True Is 661642 > 661641? True Which is bigger: 83830 or 83829? 83830 Which is bigger: 7982725/3 or 2660907? 7982725/3 Do -12 and -97 have the same value? False Are -5065/111 and -47 unequal? True Which is smaller: 25961 or 129806/5? 25961 Which is smaller: 1132/6321 or -1? -1 Is 1240 less than 1248? True Is 0.2599 > -0.2? True Is -2/207253 less than or equal to 1? True Which is smaller: -798407 or -798406? -798407 Is -120 equal to 178? False Are 0 and -20/206581 equal? False Are -40369 and -40367 unequal? True Which is greater: 0 or -2419/8? 0 Is 77 at most 123? True Do -14 and -20/47 have the same value? False Is 3 < 112757? True Which is bigger: 188 or 4319/23? 188 Which is smaller: 23848/131 or 182? 182 Which is smaller: -46/13 or 3/100? -46/13 Is -35 at least as big as -28? False Which is smaller: 41811/26 or 1609? 41811/26 Which is smaller: -7442 or 2/13? -7442 Is -66993 < -133985/2? True Which is greater: -1722891 or -1722893? -1722891 Is 0 greater than -13/70484? True Which is smaller: -10670/7 or -1525? -1525 Which is smaller: -2/892469 or -1? -1 Is 11 equal to 74? False Which is smaller: 21189/8 or 3/10? 3/10 Is 30767 < -11? False Which is smaller: 0 or 526/1961? 0 Which is smaller: 0 or 131/5386? 0 Is -16902 less than -16898? True Which is greater: -3138 or 89? 89 Which is smaller: -56309 or -56308? -56309 Which is smaller: -1078 or 36? -1078 Is 30 at most as big as 7/96? False Is -441131 greater than or equal to -441134? True Which is smaller: 180 or 227? 180 Which is smaller: 17819 or 17798? 17798 Which is greater: 7 or 1746? 1746 Which is greater: 1 or 104/58899? 1 Is -1496888 at most	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.