Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
ment from yrwrryyyrrllgry. 1/91 Four letters picked without replacement from delllddelee. What is prob of sequence lldl? 1/110 Three letters picked without replacement from {g: 1, n: 2, w: 2, z: 1}. Give prob of sequence nzn. 1/60 Calculate prob of sequence gg when two letters picked without replacement from {c: 7, g: 1, s: 3, k: 2, r: 1}. 0 Calculate prob of sequence wp when two letters picked without replacement from {j: 6, w: 2, p: 2, o: 9}. 2/171 Calculate prob of sequence pgpp when four letters picked without replacement from pppgpgppgpggppgpggg. 45/646 What is prob of sequence lms when three letters picked without replacement from jssjssjssjjjmjls? 1/480 Four letters picked without replacement from {g: 1, l: 1, r: 2, m: 1}. What is prob of sequence mgrr? 1/60 Two letters picked without replacement from {e: 4, m: 6, d: 3, u: 4}. What is prob of sequence um? 3/34 Three letters picked without replacement from {s: 1, y: 4, i: 2, x: 3}. Give prob of sequence yii. 1/90 What is prob of sequence fyn when three letters picked without replacement from {y: 4, f: 3, n: 1}? 1/28 Two letters picked without replacement from ttyyy. What is prob of sequence yt? 3/10 Two letters picked without replacement from uyyyyqqyyyuyy. Give prob of sequence yy. 6/13 Calculate prob of sequence gg when two letters picked without replacement from {q: 1, s: 1, d: 3, z: 3, g: 6}. 15/91 What is prob of sequence pll when three letters picked without replacement from llllpplpllppp? 21/143 Four letters picked without replacement from fdxffxdfddddprfffr. What is prob of sequence rrxp? 1/18360 Calculate prob of sequence gowh when four letters picked without replacement from {w: 1, u: 3, o: 2, g: 8, j: 1, h: 1}. 1/2730 Three letters picked without replacement from blvvltbmtvbtvbtbptbv. What is prob of sequence lmm? 0 Two letters picked without replacement from mwme. Give prob of sequence mw. 1/6 Two letters picked without replacement from {p: 1, q: 4, x: 3, g: 2, h: 4, s: 1}. Give prob of sequence gg. 1/105 What is prob of sequence awa when three letters picked without replacement from vwnaawvan? 1/42 What is prob of sequence ifi when three letters picked without replacement from {i: 2, f: 4}? 1/15 Calculate prob of sequence ew when two letters picked without replacement from emmfmjmewejm. 1/44 Calculate prob of sequence ch when two letters picked without replacement from hfhfffchfhhffhqfi. 3/136 What is prob of sequence hwqr when four letters picked without replacement from {g: 1, h: 1, q: 1, z: 5, w: 3, r: 2}? 1/2860 Three letters picked without replacement from eveemeeikm. What is prob of sequence vmm? 1/360 Three letters picked without replacement from eeeeeee. What is prob of sequence eee? 1 Three letters picked without replacement from gigi. What is prob of sequence iig? 1/6 Three letters picked without replacement from nwzzc. Give prob of sequence zcn. 1/30 Four letters picked without replacement from rerqrrueererreqdde. Give prob of sequence ueqd. 1/3060 Four letters picked without replacement from bqdmbnln. What is prob of sequence ndql? 1/840 What is prob of sequence wn when two letters picked without replacement from wyynw? 1/10 What is prob of sequence rr when two letters picked without replacement from rddrrdddrd? 2/15 Four letters picked without replacement from nnnnnnnntnnnnnnttt. Give prob of sequence ttnt. 7/1530 Three letters picked without replacement from {q: 1, p: 3, x: 1, o: 2, l: 1, m: 11}. What is prob of sequence mqo? 11/2907 Calculate prob of sequence ay when two letters picked without replacement from {m: 1, y: 2, a: 3, k: 1}. 1/7 Three letters picked without replacement from {b: 1, z: 1, q: 1, v: 1, t: 1}. Give prob of sequence qzv. 1/60 Three letters picked without replacement from {j: 5, p: 1, m: 1, k: 5, a: 3}. Give prob of sequence pjk. 5/546 Three letters picked without replacement from lllprcctlllrkkk. What is prob of sequence cpc? 1/1365 What is prob of sequence ggk when three letters picked without replacement from {c: 1, k: 1, g: 4, l: 1, b: 1}? 1/28 What is prob of sequence iik when three letters picked without replacement from {k: 7, i: 7}? 7/52 Calculate prob of sequence kek when three letters picked without replacement from ekekkkeekekee. 35/286 Four letters picked without replacement from nnnnnnnnnnnnnnnnnxnx. What is prob of sequence nnxx? 1/190 Calculate prob of sequence um when two letters picked without replacement from kmkukukumuummkkmmkm. 35/342 Three letters picked without replacement from yyttyytbbbybttt. Give prob of sequence tyb. 4/91 Four letters picked without replacement from zvavzzzsvsa. Give prob of sequence avsz. 1/165 Calculate prob of sequence ghhh when four letters picked without replacement from vgvghhghgvvhhg. 25/2002 Four letters picked without replacement from {w: 5, f: 1, p: 1, l: 2}. Give prob of sequence lwfw. 5/378 Three letters picked without replacement from qqwwwwwwjwqjjwjq. What is prob of sequence wwq? 1/15 Four letters picked without replacement from rlalrllpppplpaplaa. What is prob of sequence lraa? 1/510 Two letters picked without replacement from {i: 7, a: 1, x: 2, h: 4}. What is prob of sequence hh? 6/91 Two letters picked without replacement from ehohkhhehohhohhohheo. What is prob of sequence oe? 3/76 Four letters picked without replacement from wawwazeazaewawawaaa. What is prob of sequence azaz? 1/646 Calculate prob of sequence se when two letters picked without replacement from {s: 9, e: 3}. 9/44 Two letters picked without replacement from {m: 4, d: 2, j: 1, u: 1, k: 1}. Give prob of sequence um. 1/18 Four letters picked without replacement from {z: 2, m: 2, q: 4, d: 1, r: 3, h: 2}. What is prob of sequence mdmh? 1/6006 Three letters picked without replacement from {f: 12, g: 1}. What is prob of sequence ffg? 1/13 Calculate prob of sequence qfq when three letters picked without replacement from juukkfujququqq. 1/182 Two letters picked without replacement from wwwwwyywwywyzw. Give prob of sequence zw. 9/182 Two letters picked without replacement from tttttttxttttt. What is prob of sequence tt? 11/13 Calculate prob of sequence lk when two letters picked without replacement from {k: 1, u: 3, l: 1}. 1/20 Three letters picked without replacement from {w: 3, g: 7}. Give prob of sequence wgw. 7/120 What is prob of sequence zj when two letters picked without replacement from {j: 12, z: 6}? 4/17 Calculate prob of sequence sj when two letters picked without replacement from {s: 12, j: 3}. 6/35 Two letters picked without replacement from {k: 2, l: 11}. What is prob of sequence ll? 55/78 Four letters picked without replacement from bbdddd. Give prob of sequence bddb. 1/15 What is prob of sequence xd when two letters picked without replacement from ddddddxxdddddddddx? 5/34 What is prob of sequence mpdp when four letters picked without replacement from {p: 5, m: 1, d: 1, e: 4}? 1/396 Calculate prob of sequence tu when two letters picked without replacement from {t: 12, u: 7}. 14/57 Two letters picked without replacement from {k: 2, h: 1, n: 2, u: 4, p: 1, y: 2}. What is prob of sequence ky? 1/33 Two letters picked without replacement from {e: 3, b: 1, t: 1, m: 1, x: 1}. What is prob of sequence xb? 1/42 What is prob of sequence xbxx when four letters picked without replacement from xxxxxxxxxxxxxxxxxxbx? 1/20 Two letters picked without replacement from {i: 2, z: 7}. What is prob of sequence zi? 7/36 What is prob of sequence dmhh when four letters picked without replacement from hmmhmmmhdmhhhmmhh? 2/255 Calculate prob of sequence du when two letters picked without replacement from {u: 7, d: 5}. 35/132 Calculate prob of sequence zszz when four letters picked without replacement from {z: 5, s: 3}. 3/28 What is prob of sequence jt when two letters picked without replacement from {p: 8, t: 2, j: 2}? 1/33 Three letters picked without replacement from {s: 4, p: 4, k: 3, e: 6}. Give prob of sequence ksp. 1/85 Three letters picked without replacement from {z: 2, f: 1, g: 1, u: 1, m: 2, i: 1}. What is prob of sequence uzi? 1/168 Two letters picked without replacement from {l: 4, m: 5, k: 3}. Give prob of sequence km. 5/44 Calculate prob of sequence tqqh when four letters picked without replacement from htdthqhmtxqm.	{ "pile_set_name": "DM Mathematics" }
replacement from mnnmnppnz? 1/126 Calculate prob of sequence ctt when three letters picked without replacement from ttttcctiicci. 2/33 Calculate prob of sequence sc when two letters picked without replacement from {c: 3, m: 2, s: 5}. 1/6 What is prob of sequence mmt when three letters picked without replacement from {u: 2, s: 7, m: 7, t: 2}? 7/408 Calculate prob of sequence qfh when three letters picked without replacement from feqbshh. 1/105 Two letters picked without replacement from kgr. What is prob of sequence gk? 1/6 Four letters picked without replacement from ddzddddzddddd. Give prob of sequence dzdz. 1/78 Three letters picked without replacement from aaaaaajaaajajaaaaa. What is prob of sequence aaj? 35/272 Two letters picked without replacement from {r: 7, g: 2, h: 5}. What is prob of sequence hr? 5/26 Four letters picked without replacement from ikjpeypyyiyyi. Give prob of sequence kepp. 1/8580 Calculate prob of sequence zo when two letters picked without replacement from {s: 4, z: 2, f: 1, o: 1, l: 9}. 1/136 Three letters picked without replacement from {v: 2, c: 2, l: 4, m: 1}. Give prob of sequence vlm. 1/63 Two letters picked without replacement from aaqk. Give prob of sequence kq. 1/12 Two letters picked without replacement from xfzf. Give prob of sequence zf. 1/6 Two letters picked without replacement from {w: 3, n: 2, j: 6, g: 8}. Give prob of sequence jw. 1/19 Calculate prob of sequence lfl when three letters picked without replacement from fffffflflf. 1/45 Calculate prob of sequence fl when two letters picked without replacement from {l: 2, f: 8}. 8/45 Calculate prob of sequence zl when two letters picked without replacement from {l: 1, d: 1, t: 1, p: 2, z: 1, s: 1}. 1/42 Three letters picked without replacement from hhhhqhhhhhzj. Give prob of sequence zhq. 3/440 What is prob of sequence mvvg when four letters picked without replacement from vevvgmgvevgvvgvvvgv? 275/46512 Four letters picked without replacement from {z: 5, a: 5}. What is prob of sequence zaaz? 5/63 What is prob of sequence fl when two letters picked without replacement from fwlww? 1/20 Two letters picked without replacement from {a: 7, q: 2}. Give prob of sequence aq. 7/36 Calculate prob of sequence qrrq when four letters picked without replacement from {r: 2, k: 4, a: 5, q: 3, u: 5}. 1/7752 Four letters picked without replacement from {v: 1, j: 1, z: 1, m: 4, h: 2}. Give prob of sequence vhhz. 1/1512 Calculate prob of sequence nthh when four letters picked without replacement from tchnnzzthdtc. 1/990 Calculate prob of sequence tt when two letters picked without replacement from {x: 2, d: 1, m: 1, o: 2, t: 4}. 2/15 Three letters picked without replacement from {s: 4, k: 2, c: 2, q: 4}. Give prob of sequence cqc. 1/165 Four letters picked without replacement from {d: 1, g: 2, i: 1, l: 13}. Give prob of sequence llgl. 143/2380 What is prob of sequence ssgg when four letters picked without replacement from ggss? 1/6 Two letters picked without replacement from {d: 2, l: 5, h: 6}. Give prob of sequence dh. 1/13 Calculate prob of sequence nnkr when four letters picked without replacement from {h: 3, k: 4, n: 2, r: 1}. 1/630 Calculate prob of sequence eqv when three letters picked without replacement from iqevkqiqqkih. 1/330 Three letters picked without replacement from {v: 2, r: 6, k: 10}. What is prob of sequence krk? 15/136 Three letters picked without replacement from bqbbbbqqbq. What is prob of sequence bqq? 1/10 Calculate prob of sequence txx when three letters picked without replacement from {t: 3, x: 17}. 34/285 Four letters picked without replacement from {r: 14, y: 5}. What is prob of sequence yyyr? 35/3876 Three letters picked without replacement from efaeaeaeeaeae. What is prob of sequence aef? 35/1716 Two letters picked without replacement from {a: 1, q: 3}. Give prob of sequence qq. 1/2 Two letters picked without replacement from mxmmmmmm. Give prob of sequence mm. 3/4 Three letters picked without replacement from {f: 3, s: 1}. Give prob of sequence fff. 1/4 Calculate prob of sequence llwl when four letters picked without replacement from llwllwllllllwwldllwl. 91/969 What is prob of sequence flqu when four letters picked without replacement from lfuflfqlfl? 1/315 What is prob of sequence tthv when four letters picked without replacement from vttttvh? 1/35 Two letters picked without replacement from {a: 2, i: 2, h: 9}. What is prob of sequence ha? 3/26 Two letters picked without replacement from {k: 6, c: 4, x: 6, z: 1}. What is prob of sequence ck? 3/34 Calculate prob of sequence pspf when four letters picked without replacement from psfppppsssp. 1/66 Two letters picked without replacement from {v: 2, m: 4, c: 8}. Give prob of sequence cc. 4/13 Four letters picked without replacement from ovveeoeoeegoeaooo. What is prob of sequence vego? 1/680 Four letters picked without replacement from {f: 8, u: 3, z: 2, j: 3}. Give prob of sequence zuzf. 1/910 Two letters picked without replacement from {w: 4, n: 2, u: 2}. Give prob of sequence nu. 1/14 Three letters picked without replacement from qlqqlqqlqolol. What is prob of sequence lqq? 25/286 Four letters picked without replacement from {a: 1, g: 5, z: 2, w: 1}. What is prob of sequence gazz? 5/1512 What is prob of sequence hxh when three letters picked without replacement from {h: 2, q: 1, x: 1, k: 1}? 1/30 Four letters picked without replacement from {r: 5, f: 3, d: 4, z: 3, w: 3}. Give prob of sequence zfrd. 1/408 What is prob of sequence cltq when four letters picked without replacement from {q: 1, e: 3, t: 2, l: 1, c: 7}? 1/1716 What is prob of sequence vzn when three letters picked without replacement from {n: 4, z: 2, v: 1}? 4/105 Two letters picked without replacement from nnzjzinzjjzjzzzif. Give prob of sequence iz. 7/136 Two letters picked without replacement from svfjnaja. Give prob of sequence an. 1/28 What is prob of sequence dmwd when four letters picked without replacement from {m: 5, w: 2, d: 4}? 1/66 Two letters picked without replacement from zgzzzgz. Give prob of sequence zg. 5/21 Calculate prob of sequence ooa when three letters picked without replacement from oaaoaa. 1/15 Two letters picked without replacement from {i: 2, o: 4, p: 3}. What is prob of sequence pp? 1/12 Two letters picked without replacement from oqoooq. Give prob of sequence oo. 2/5 Calculate prob of sequence uy when two letters picked without replacement from kkkkgnuknykugukgyg. 1/51 Four letters picked without replacement from {r: 8, y: 2, c: 2, h: 1}. What is prob of sequence hcrr? 14/2145 Calculate prob of sequence ppl when three letters picked without replacement from pplpkkdpp. 5/126 Four letters picked without replacement from {w: 3, z: 1}. What is prob of sequence zwww? 1/4 Three letters picked without replacement from {j: 1, b: 14}. What is prob of sequence bbj? 1/15 What is prob of sequence wvv when three letters picked without replacement from vpwvvpvvppvvvvvvp? 11/408 Calculate prob of sequence wwwg when four letters picked without replacement from wwwwwwgwwwgwwgww. 33/280 What is prob of sequence vj when two letters picked without replacement from {g: 4, d: 4, v: 9, l: 1, j: 2}? 9/190 What is prob of sequence ttt when three letters picked without replacement from {l: 13, t: 3, r: 1}? 1/680 What is prob of sequence xxdd when four letters picked without replacement from {x: 2, h: 7, d: 3}? 1/990 Three letters picked without replacement from cdvqhcs. What is prob of sequence vqh? 1/210 Two letters picked without replacement from ihishjii. Give prob of sequence ij. 1/14 Three letters picked without replacement from kikfkatffifkfpa. Give prob of sequence tkp. 2/1365 Calculate prob of sequence eg when two letters picked without replacement from aqmqqmeaagq. 1/110 What is prob of sequence hh when two letters picked without replacement from hshf? 1/6 Four letters picked without replacement from {c: 3, v: 4, y: 5}. Give prob of sequence ycvv. 1/66 Calculate prob of sequence kork when four letters picked without replacement from {z: 2, m: 2, o: 4, r: 2, k: 3}. 2/715 What is prob of sequence dyll when four letters picked without replacement from lllxdlxxldyydlylddll? 3/323 Three letters picked without replacement f	{ "pile_set_name": "DM Mathematics" }
2 Let f(j) = j2. Let k(o) = -5o2 + 5o + 5. Let u(g) = -6 - 2g + 4 + g2 + 2g*2. Let x(b) = -2k(b) - 5u(b). What is x(f(r))? -5r*4 Let j(t) = -2t*2. Let r be 1/24 + 8. Let u = r - 4. Let q(p) = -up2 - 9p*2 + 13p*2. Give j(q(g)). -8g*4 Let o(i) = -20i*2 + 250i - 1. Let t(j) = -22j2. Determine o(t(h)). -9680h*4 - 5500h*2 - 1 Let p(x) be the third derivative of -3x5/20 + x4/12 - 107x2. Let m(r) = -4r*2. Give m(p(w)). -324w*4 + 144w*3 - 16w*2 Let o be (6/(-1))/6(-4 + 1). Let t(y) be the third derivative of 0yo + 0y*4 - 3y*2 + 0 + 1/20y*5 + 0y. Let p(a) = -a*2. What is t(p(s))? 3s*4 Let x(v) = 2v2. Let i(r) be the first derivative of r2/2 + 8r - 3. Let y be i(8). Let q(p) = -16 - 3p + y. Give x(q(u)). 18u2 Let w(a) = -3a. Let k(f) = -13f2 + 12f*2 + 2f*2 + 78. Give k(w(z)). 9z*2 + 78 Let h(n) be the second derivative of 425n*4/12 + n + 88. Let i(y) = 2y*2. Calculate i(h(g)). 361250g*4 Let f(a) be the second derivative of -5a*4/6 - a. Let z(i) = -3i - 7. Let b be z(-3). Let y(v) = 0v2 + 0v*2 + 3v*2 - 4v*b. Calculate y(f(t)). -100t4 Let i(m) = m2 + m + 1. Let f(l) = 6l2 - 6l - 6. Let z(k) = f(k) + 6i(k). Let v(n) = 110n*2 + 97n*2 - 210n*2. Give z(v(c)). 108c*4 Let t(y) = 13y. Let z(j) = j*2 - 5j. Let c(i) = -i. Let o(x) = x*3 + 6x*2 + 3x + 8. Let h be o(-6). Let w(a) = hc(a) + 2z(a). Determine t(w(s)). 26s2 Let x(o) = -2o*2. Let a(m) = 2m. Let f(y) = 11y + 3. Let u(r) = 14a(r) - 2f(r). Give x(u(v)). -72v*2 + 144v - 72 Suppose -22 = -13o + 11o. Let j(i) = -3i + oi - 6i. Let n(x) = -12x*2. Give n(j(k)). -48k*2 Let c(z) be the second derivative of 1/6z*3 + 0 + 0z2 - z. Let k(o) = -o2. Let j(r) = 16r2. Let m(u) = 2j(u) + 36k(u). What is c(m(x))? -4x*2 Let u(h) = -h. Let y(l) = 28683l + 2. Calculate y(u(g)). -28683g + 2 Let k(g) = 3g2 + 13. Let o(l) be the third derivative of -l5/30 + 144l2. What is k(o(w))? 12w*4 + 13 Let v(s) = -2s. Let r(z) = -78z. Let i(p) = -7175p. Let m(g) = 6i(g) - 550r(g). Determine v(m(j)). 300j Let h(g) = 55g - 11. Let s(t) = -12t - 6t + 7t + 2. Let q(c) = 2h(c) + 11s(c). Let p(j) = j2. Calculate q(p(l)). -11l*2 Let d(r) = -r - 4. Let x(q) = -2341q*2 - q. Give d(x(g)). 2341g*2 + g - 4 Let m(z) = 11z - 1. Suppose 0 = -g + 4k - k + 5, 5k = -3g + 1. Let d(t) = 2t*g + 4104 - 4104. Give m(d(l)). 22l*2 - 1 Let z(u) = -3u. Suppose 0 = 4x - 128 + 20. Let j(b) = 12b + 27. Let t(o) = -o - 2. Let a(k) = xt(k) + 2j(k). Calculate z(a(q)). 9q Let z(i) = i2. Let m be 12/(-24)3-7. Let l(j) be the first derivative of 0j - 12 + mj2. Give z(l(q)). 441q2 Let l(j) be the first derivative of -j3/6 + j + 1. Let w(d) be the first derivative of l(d). Let g(t) = 151t2 - 320t*2 + 162t*2. What is w(g(m))? 7m*2 Let k(i) = -264i*2 + 20i + 1. Let n(l) = l + 31. Give n(k(h)). -264h2 + 20h + 32 Let x(r) = -4r2. Let f(s) = -5617s. Give x(f(o)). -126202756o2 Let c(a) = -3a. Let o(u) be the first derivative of -u*5/15 - 9u*2/2 - 5. Let i(q) be the second derivative of o(q). Give i(c(s)). -36s*2 Let t(a) = 4879a*2 - 3. Let s(w) = -8w. Determine t(s(h)). 312256h2 - 3 Let d(p) = 700p*2 + 684p*2 - 1386p*2. Let s(v) = -2 + 12v + 2. Calculate s(d(a)). -24a2 Let r(t) = t2. Let w(l) = -2l. Let u(m) = 14m - 2. Let d(i) = 2u(i) + 12w(i). Let h(c) = -c2 - 11c + 11. Let y(k) = -11d(k) - 4h(k). Give r(y(z)). 16z4 Let p(r) = 3r*2 + 3r. Let c(h) = 3810h. Calculate p(c(g)). 43548300g*2 + 11430g Let c(q) be the third derivative of q5/5 + q4/6 + 293q2. Let r(f) = 4f*2. What is c(r(i))? 192i*4 + 16i*2 Let h(p) = -58p + 14. Let z(s) = 20s - 5. Let o(d) = -3h(d) - 8z(d). Let w(j) = -j. Calculate w(o(u)). -14u + 2 Let x(r) be the second derivative of 0r2 + 1/3r*3 + 0 + 4r. Let f(k) = 5k2. Give x(f(m)). 10m*2 Let b = 5 - -8. Let m(p) = -26 + b + 13 + p. Let u(t) = -19t. Determine u(m(q)). -19q Let u(b) = -152b. Let y(z) = -1699z. Determine u(y(m)). 258248m Let h(b) be the second derivative of -b*3/6 - 5b. Let a(l) = -3l + 2. Let j(t) = 48t - 33. Let f(u) = -66a(u) - 4j(u). Give f(h(o)). -6o Let n(w) = 15 + w - 12 - 3. Let x be (-43)/(-4) + 5/20. Let d(q) = -19q + xq + 5q. What is n(d(z))? -3z Let n(v) = -v2 + 1613v. Let g(j) = j. Calculate n(g(y)). -y*2 + 1613y Let z(o) = 36 - 23 - 9o2 - 13. Let d(x) = 9x*2. Give d(z(h)). 729h*4 Let x be 3 + 6/126. Let p(l) = 9l - 26l + 9l + xl. Let o(t) = 67t2. Calculate o(p(r)). 268r*2 Let s(h) = -40h + 13h + 14h + 3h + 12h. Let y(m) = 181m. Calculate y(s(n)). 362n Let g(u) be the second derivative of u*3/2 - 101u. Let z(k) = -7k2 - 16k. What is g(z(d))? -21d2 - 48d Let x(v) = 23v2 - 2v - 2. Let s(f) = 510f2 - 45f - 45. Let o(k) = -2s(k) + 45x(k). Let j(d) be the second derivative of -d*3/3 + d. Give j(o(p)). -30p*2 Let q(c) = -4c2. Let b(t) = -t2 + 75040. Give b(q(w)). -16w4 + 75040 Let w(r) = -2030r*2. Let i(f) = 124f*2 - 2f. What is i(w(t))? 510991600t4 + 4060t*2 Let n(u) = -11u - 13. Let m(l) = 5l + 6. Suppose 0 = 7j - 6j - 13. Let x(q) = jm(q) + 6n(q). Let f(a) = -5a. Calculate f(x(s)). 5s Let c(u) be the third derivative of -17u5/60 + u3/6 + 7u2 - 50u. Let f(r) = r*2. Calculate c(f(w)). -17w*4 + 1 Let c(i) = 27i. Let k(j) = 63j2 - 2. Give c(k(b)). 1701b*2 - 54 Let u(m) = -3m. Let k(s) = -s. Let r = 0 - 1. Let d(t) = ru(t) - 3k(t). Let i(b) = 6b2. Determine i(d(w)). 216w*2 Let m(b) = 66b. Let u(l) = 169l + 9. Calculate m(u(s)). 11154s + 594 Let q(m) = -793444m2. Let o(k) = 6k*2. What is q(o(r))? -28563984r*4 Let s(d) = -122d - 2. Let f(o) = 326 + 6o2 - 7o*2 - 326. What is f(s(n))? -14884n*2 - 488n - 4 Let l(w) be the first derivative of -9w2/2 - 1. Let p(b) be the second derivative of -5b*3/6 - 281b. Determine l(p(a)). 45a Let x be 196/(-42)(-54)/4. Let k(a) = -xa + 2a*2 + 63a. Let u(s) = s. Let n(w) = -3w. Let b(l) = -3n(l) - 5u(l). Calculate b(k(y)). 8y*2 Let v(x) = 0 + 3 - 3 - 4x. Let w(r) be the second derivative of -r*4/12 + 2r*2 + 9r. Let t(u) = -3u2 + 9. Let m(i) = 4t(i) - 9w(i). What is v(m(o))? 12o*2 Let c(y) = 606y*2. Let x(s) = -33s + 1. What is c(x(r))? 659934r2 - 39996r + 606 Let u(o) = 3o. Let w(s) = -22688s*2 + s - 2. Calculate w(u(j)). -204192j*2 + 3j - 2 Let q(j) = -j. Let f = -17 + 58. Let k(t) = -17t2 - 16t*2 - 10t*2 + ft*2. What is q(k(b))? 2b*2 Let u(l) = l. Let d(q) be the third derivative of -7/20q*5 + 0 + 0q - 13q2 + 0q*3 + 0q*4. Give d(u(j)). -21j*2 Let s(j) = j. Let b(o) = 5471692o. Calculate s(b(r)). 5471692r Let q(b) = -7b - 1478. Let k(x) = -27x. Calculate k(q(g)). 189g + 39906 Let q(p) = p*2. Let w = -41 + 71. Let l(g) = -54g - 24g2 + 24g + wg. Determine l(q(c)). -24c*4 Let a(t) = -2t*2 + 28t - 134. Let p(v) = -v. What is a(p(l))? -2l2 - 28l - 134 Let b(k) be the third derivative of -3k4/8 - 2k*3/3 + 289k*2. Let a(d) = -3d. Determine b(a(h)). 27h - 4 Let l(t) = -4t. Let y(r) = 25r2 - 36r + 17. Calculate l(y(w)). -100w2 + 144w - 68 Let g(l) be the second derivative of l*3/6 - 518l. Let b(j) be the third derivative of -j5/30 - j2. Give g(b(y)). -2y2 Let l(y) = 64y. Let x(n) = -3n2 + 24524. What is l(x(r))? -192r2 + 1569536 Let h(n) be the second derivative of -n3/3 + 2n. Suppose 0 = g + 4g, 0 = 2f - 3g - 60. Let u(i) = -10i + 19i - fi - 3i. Give h(u(z)). 48z Let f(i) be the third derivative of i5/30 - 49i*2. Let d = 1 + 1. Let a(b) = 5b*2 - 2b2 + bd. Calculate f(a(u)). 32u4 Let u(x) = -15x*2 + 10x + 20. Let l(p) = -46p2 + 32p + 64. Let j(g) = 5l(g) - 16u(g). Let r(b) be the first derivative of b*2/2 - 1. Give j(r(h)). 10h*2 Let v(d) = 9d. Let s(c) be the third derivative of -7c4/24 + 45c*2 - 2. Calculate s(v(j)). -63j Let h(n) = 3n. Let i(b) = -216209b. Calculate i(h(t)). -648627t Let k(w) = 2w - 2. Let x(y) = -10y + 12. Let f(b) = 6k(b) + x(b). Let l(a) = 13*a + 26. Let d(s) = -s + 1. Let i(u) =	{ "pile_set_name": "DM Mathematics" }
7 dps. -0.0000012 Let c = -0.0871 - 466.9129. Let r = c + 529.6. Let j = -58 + r. What is j rounded to the nearest integer? 5 Let r be (-9)/4-62. Suppose 4x + 8 = 3b, 5x = -5b + r - 2. Suppose -5o + s = 6664 + 3233, -o + bs = 1968. Round o to the nearest 100. -2000 Let b(h) = -2h3 - 8h*2 + 7h - 9. Let k be b(-7). Suppose 0 = 244i - ki - 768. What is i rounded to the nearest 100? 100 Let h = -14684688252.600002036 + 14684688199. Let o = h + 53.6. What is o rounded to 7 decimal places? -0.000002 Suppose -251l - 15504720 = -229l. What is l rounded to the nearest 100000? -700000 Let j = -0.00103729 + 0.001563. What is j rounded to six decimal places? 0.000526 Let q(n) = -5n3 - 3n*2 - 34n + 96. Let b(i) = 2i3 + i2 + 16i - 46. Let l(v) = 9b(v) + 4q(v). Let h be l(7). Round h to the nearest ten. -810 Let v(y) = 621y3 - 4y*2 - 12y - 85. Let s be v(-5). Round s to the nearest 10000. -80000 Let f = -884924.00002 + 884858. Let t = 66 + f. What is t rounded to four dps? 0 Let w = 8729.001732 - 8729. What is w rounded to five decimal places? 0.00173 Let y = 40.3619 - 0.1319. Round y to the nearest 10. 40 Let b(s) = 322s2 + 69. Let t(l) = 321l*2 - l + 72. Let z(u) = -4b(u) + 3t(u). Let o be z(-20). What is o rounded to the nearest ten thousand? -130000 Let x(v) = v + 5v*2 - 2v*2 - 7 + 293v*3 + v + 0v*2. Let f be x(3). Suppose -2r + f = -5z - 63573, -3z + 5r = 42925. Round z to the nearest 1000. -14000 Let c = -90142 + 136347. Let i be (2/5)/1 + (-57)/(-95). Let n be (c/(-3) - (-8)/12) + i. What is n rounded to the nearest 1000? -15000 Let r(j) = 54401j + 1077. Let b be r(23). What is b rounded to the nearest 10000? 1250000 Let i = -0.5391 + 0.53915082. Round i to six dps. 0.000051 Suppose -16 = -4r, -t + 11 = -2t + 4r. Suppose -6790 = -2o + tj, -2o - 4j + 6428 = -380. Let m = o - 1380. What is m rounded to the nearest 100? 2000 Let w = -845.16028 - -796.979749. Let q = 0.970769 - w. Let s = q + 0.0487. Round s to the nearest 10. 50 Let p = -67182 + 67168.3215. Let l = p - -72.509. Let s = l - -0.0695. What is s rounded to the nearest 10? 60 Let q = -331 - -307.8. Let y = q - 10.6. What is y rounded to the nearest ten? -30 Let f = -21003.091 - -20979. Let y = -0.091 - f. Let o = 24.0000019 - y. Round o to six decimal places. 0.000002 Let k = 117748466 + -117747817.99893. Let w = k - 635. Let u = -13 + w. Round u to four decimal places. 0.0011 Let a = 13.808 - -2311.392. What is a rounded to the nearest 10? 2330 Let o = -132.76357 - -132.66. What is o rounded to 2 dps? -0.1 Let w = -3936.23 - -4262. Let l = 341.6 - w. Round l to 1 dp. 15.8 Let i = -0.116 - -0.051. Let c = -33 - -33.0668. Let p = i + c. What is p rounded to three decimal places? 0.002 Let v(u) = u2 + 45u - 51. Let r be v(-45). Let l be (-340)/r(-186)/(-8). Round l to the nearest one hundred. 200 Let c = 6789.24 - 7380. What is c rounded to the nearest 10? -590 Let c = 11253 + -11112.34. Let f = 147 - c. What is f rounded to 1 dp? 6.3 Let u = 12.29344894 - 12.405158. Let s = 0.1117 + u. Round s to 7 dps. -0.0000091 Let c = 234.878 + -235. Let p = -0.404 - c. Round p to 2 decimal places. -0.28 Let y = -13852790481 + 13852790877.99998653. Let d = y - 397. Round d to 6 dps. -0.000013 Let w = -15976112.497638 - -15975982.7. Let m = w + -0.129362. Let h = 130 + m. What is h rounded to 2 dps? 0.07 Suppose 4j = 2i - 10, -4 - 6 = -2i - j. Let t(f) = 115f2 - 27f - 1. Let d be t(i). Round d to the nearest one hundred. 2700 Let s = -9.2676 + 573.8776. Round s to the nearest 100. 600 Let o = -1.0108 + 1.07573. Round o to 3 decimal places. 0.065 Let h be (-145/(-15))/(2/9). Let g = -22 + h. Let u be 1/g17-500. What is u rounded to the nearest 1000? 9000 Suppose 18636840 = -12r + 21r. Let m = 1240760 - r. What is m rounded to the nearest one million? -1000000 Let r = 34 - 34. Suppose 77814 = 4t - 2j, 3j = t - rj - 19451. Let i = 5254 - t. Round i to the nearest 1000. -14000 Let i = -33.0021 + 33. Let w = i - 78.8379. Let z = 84 + w. What is z rounded to 1 decimal place? 5.2 Let a be (-80)/61056/110. Let w = 51 - 58. Let r be (-307 - w)(0 - a/(-1)). Round r to the nearest ten thousand. 40000 Let f = 436410754 - -11219246. Round f to the nearest 1000000. 448000000 Let c(f) = -f3 + 4f*2 - 1. Let n be c(4). Let s = 4 + n. Suppose 45900003 = 2d + d + 3q, -3d + 45899997 = -sq. What is d rounded to the nearest 1000000? 15000000 Suppose 20o - 19o = 12. Suppose 0 = -2j + oj - 24120880. Suppose -7n = -j - 1717912. What is n rounded to the nearest one hundred thousand? 600000 Let d = 4504 + -4504.004917. What is d rounded to three decimal places? -0.005 Let x = -0.474899219 + 0.47486. What is x rounded to 6 dps? -0.000039 Let w = -92.08 - -2.08. Let h = -90.58 - w. Let d = h + 0.522. Round d to two decimal places. -0.06 Let w = 42256.05050024 + -42219.0505. Let y = -37 + w. What is y rounded to seven dps? 0.0000002 Let m = -3888 + 3928. Let g = -2623015087 - -2623015047.00000017. Let y = m + g. What is y rounded to 7 dps? 0.0000002 Suppose -12v = 22238 - 74. Round v to the nearest 10. -1850 Let f(w) = 239w*3 + 2w*2 + 7w + 4. Suppose -10 = -3p + 2. Let k be f(p). Let z = -25660 + k. Round z to the nearest 1000. -10000 Let g = -0.0337 + 8.5537. Let z = -8.5199817 + g. What is z rounded to six decimal places? 0.000018 Let j = -1 + 5.3. Let m = 6 - j. Let v = m + -1.699. What is v rounded to 2 decimal places? 0 Let c = 27417498492.499999759 - 27417498045.5. Let j = 447 - c. What is j rounded to 7 dps? 0.0000002 Let g = 4701.999985909 + -4702. Round g to six decimal places. -0.000014 Suppose -120 = -12d + 60. Let k be -1062500((-5)/(-15) + 1/d). Round k to the nearest ten thousand. -430000 Let t = 0.901 - -624.099. Let j = t - 624.99749. Round j to four decimal places. 0.0025 Let t = -277188437.9999356 - -277188254. Let a = t + 184. What is a rounded to five dps? 0.00006 Let v = 26999.8325 - 27039. Let q = v + 39.1. What is q rounded to 3 dps? -0.068 Let f = 372.36 - 332.797. Round f to the nearest integer. 40 Suppose 3t - 5t - 2p = -350, 2t = 4p + 362. Suppose -k + 284 = 2d - 5k, -2k + 548 = 4d. Suppose -5w + t = -d. What is w rounded to the nearest 10? 60 Suppose -5i - 5r + 9 = -11, -2i = -2r - 8. Suppose 10531 = 3v - 5h - 247749, ih = 4v - 344384. Round v to the nearest 10000. 90000 Let a be ((-169)/39)/((2/2)/153). Let b = a + 596. What is b rounded to the nearest ten? -70 Let q = -431.681 + 459.27. Let f = -24.9 - 2.5. Let c = q + f. What is c rounded to 2 dps? 0.19 Let m = -11.85 - 1.15. Let a = 12.9999876 + m. What is a rounded to five dps? -0.00001 Let y = 105409777 - -83400223. Round y to the nearest 1000000. 189000000 Let y = -10212 + 10213.1031. What is y rounded to 2 decimal places? 1.1 Suppose -120185669 = 125x + 12x - 43431419. What is x rounded to the nearest ten thousand? -560000 Let k = -8329590 + 8329710.9999825. Let z = k - 121. What is z rounded to six dps? -0.000018 Let l = 18756.999966039 + -18757. Round l to five decimal places. -0.00003 Let q(l) = 215541l*2 - 9l + 4. Let w be q(-3). What is w rounded to the nearest ten thousand? 1940000 Let z = -34.2 - -38. Let r = -6265003.7999978 - -6265000. Let t = r + z. What is t rounded to 6 decimal places? 0.000002 Let k(o) = -9884o2 + 78o - 144. Let j be k(36). What is j rounded to the nearest 1000000? -13000000 Suppose -28n + 6837846 = -25n. Let a = n - 1589282. Suppose a = 8r - 7r. What is r rounded to the nearest 100000? 700000 Let p(t) = 11503t2 + 258t + 13. Let z be p(-3). Round z to the nearest 1000. 103000 Let q = 0.572 - -88.428. Let x = q + -88.99999421. Round x to seven decimal places. 0.0000058 Let n = -27016 - -27016.0010901. What is n rounded to 4 dps? 0.0011 Let t = 23.542 + -0.542. Let v = 23.01674 - t. What is v rounded to three dps? 0.017 Let x = -598.041 + 541.0403. Let f = -6.5 + -50.5. Let k = f - x. Round k to three dps. 0.001 Let m = 43.30610743 + -43.34731. Let h = 0.01706 - 0.05826. Let f = h - m. What is f rounded to seven decimal places? 0.0000026 Let s = 1.619306757 - 1.6193. What is s rounded to 7 dps? 0.0000068 Let v = 13208176 + -20978182. Let y be 2*2/14 - v/(-21). Round y to the ne	{ "pile_set_name": "DM Mathematics" }
ine r(f(y)). 540y2 Let w(v) = 2v. Suppose -40 = 5n - r + 66, 0 = -4n - 5r - 79. Let p(x) = -3x - 5. Let d(b) = 14b + 21. Let z(a) = np(a) - 5d(a). What is w(z(h))? -14h Let u(k) = 2k + 44. Let l be u(8). Let n(f) = -lf - 75f + 143f. Let o(i) be the third derivative of i*4/8 - 2i*2. Determine o(n(w)). 24w Let o(z) = -2z. Let q(h) = 146606755h. Calculate o(q(f)). -293213510f Suppose -129 = -102n + 177. Let l(x) be the first derivative of 10 + 0x + 0x*2 + 2/3x*n. Let a(u) = 20u. Determine a(l(k)). 40k2 Suppose 0 = 2c - 325 + 313. Let r(g) = -14g + 17. Let v(m) = 5m - 6. Let k(q) = cr(q) + 17v(q). Let s(b) = 11b - 5. Calculate k(s(l)). 11l - 5 Let f(a) = -4a2 + 2a*2 + 4a*2. Suppose 0 = 13m + m - 490. Let t(x) = 8527x - 8527x + mx2. Calculate t(f(b)). 140b*4 Let v(b) = -2318096b. Let x(i) = -15i. Determine x(v(p)). 34771440p Let d(s) = -s. Suppose 659 = 4j + 27. Let p(f) = 2f*2 - 158 - 38f + j. Determine d(p(z)). -2z2 + 38z Let n(l) = -610782l2 + 31l + 2. Let d(s) = -s*2. What is n(d(p))? -610782p*4 - 31p*2 + 2 Suppose -5z - 24 = 2y, -157y + 158y - 4z = 27. Let t(s) be the second derivative of 0 + 29s + 1/6s*y + 0s*2. Let v(l) = -30l. Determine t(v(b)). -30b Let o(f) = -2f. Let c(x) = 214x2 - x + 349x*2 + 5x + 13x2 + 853x*2. What is c(o(t))? 5716t*2 - 8t Let j = 155 - 61. Let g(r) = -jr - 81r + 23r - 52r. Let u(m) = 2m. Calculate u(g(c)). -408c Let n(s) be the third derivative of 131s4/12 + 138s*2 - 7s. Let k(c) = -15c. Determine k(n(q)). -3930q Let d(n) = -n*2. Let f(o) = -4981529o. Determine f(d(l)). 4981529l2 Let n(r) be the first derivative of 1/3r*3 + 49 + 0r + 0r2. Let a(p) = -144p*2 - 33. Let t(x) = -9x*2 - 2. Let f(z) = 2a(z) - 33t(z). Give n(f(b)). 81b*4 Let g(u) = -7u. Let k(o) = 451o - 852o + 4 + 413o. Calculate k(g(z)). -84z + 4 Let g(w) = -4945w - 21 + 160w + 10 + 11. Let y(q) = -q*2. What is g(y(u))? 4785u*2 Let o(q) = 14q. Let j(d) = 142d2 - 28448. Determine j(o(c)). 27832c*2 - 28448 Let r(a) = -249255a*2 + 12a. Let o(k) = 43k. Give r(o(w)). -460872495w*2 + 516w Let l(m) = -434347m. Let w(u) = 18u - 1. Give w(l(q)). -7818246q - 1 Let v(w) = 23w*2. Let c(x) = 6x - 6. Let d(q) = q - 3. Let r(k) = -11k - 81. Let s be r(-7). Let f(i) = sd(i) + 2c(i). Calculate v(f(j)). 1472j*2 Let u(t) = 7t*2. Let n = -1560 - -1560. Let k(v) be the second derivative of n + 0v*2 - 18v + 1/3v3. What is k(u(h))? 14h*2 Let b(x) be the third derivative of 0x*4 + 0x + 0 + 0x3 + 2/15x*5 + 241x*2. Let t(v) = -4v*2 + v. Give t(b(f)). -256f*4 + 8f*2 Suppose -57j = -11j - 22034. Let g(m) = -234m*2 - 248m*2 + jm*2. Let c(l) = -60l*2. Determine g(c(v)). -10800v*4 Let v(a) = -14 + 5a*2 + 11a*2 + 183 - 169. Let g(m) = 119m*2. Determine g(v(n)). 30464n*4 Let f(l) = 3 - l - 3. Let c(i) be the first derivative of -48 + 0i - 25/2i2. Give f(c(w)). 25w Let p(x) be the second derivative of -29x4/6 + 1803x. Let w(b) = 33b2. Calculate w(p(k)). 111012k*4 Let a(d) = 6d*2 - 7d*2 - 4d*2 + 3d*2. Let r(b) = -663b. What is r(a(p))? 1326p2 Let n(t) = -2t*2 - 5t - 5. Let g(u) = 7 - 3u2 + 5u*2 + 0u + 7u + u2. Let b(h) = 5g(h) + 7n(h). Let f(a) = 16a*2. Give f(b(m)). 16m*4 Let z(x) = 368x*2 + 2x. Let d(u) be the third derivative of -u*4/6 + 201u*2 - 4u. Calculate z(d(a)). 5888a2 - 8a Let p(h) = 2h2. Let w(k) = -57k*2 + 259k - 124. Let b(q) = -74q2 + 345q - 166. Let u(r) = 10b(r) - 13w(r). Give u(p(j)). 4j4 + 166j2 - 48 Let q(x) be the first derivative of -x2/2 + 25. Let n(k) = 1080k. Let y(h) = 226439h. Let p(b) = -1468n(b) + 7y(b). What is q(p(o))? 367o Let w(b) = 54b*2 - 4. Let m(j) = -655j*2 + 1170j*2 - 516j*2. What is w(m(o))? 54o*4 - 4 Let n(t) = 27t*2. Let w(d) = -7925254d. What is n(w(y))? 1695860576041932y2 Let i(y) = 12419y*2. Let m(s) = -8s*2 - 24. Calculate m(i(g)). -1233852488g*4 - 24 Let p(s) = s - 3s + 0s. Let f(w) = w2 + 121w + 24. Let r(u) = u*2 + 153u + 32. Let b(g) = -4f(g) + 3r(g). What is p(b(v))? 2v2 + 50v Let m(y) = -145y + 150y + y*2 + 2y*2. Let u(q) = -9q - 4. Let v(o) = 16o + 7. Let n(a) = 7u(a) + 4v(a). Give n(m(p)). 3p*2 + 5p Let h(k) = -31935945k2. Let x(f) = -2f. Calculate h(x(y)). -127743780y2 Let k(m) = -5076m. Let a(t) = 3996t + 4. Calculate a(k(i)). -20283696i + 4 Let p(b) = 5b + 2. Let s(c) = -22c - 7. Let g(k) = -4p(k) - s(k). Let u(z) be the third derivative of -z4/24 + 6z*2. Calculate u(g(y)). -2y + 1 Let x(d) = -46813d. Let f(p) = 879p. Calculate x(f(h)). -41148627h Let q(g) = 137g. Let z(f) = 40f. Let j(a) = -2q(a) + 7z(a). Let n(d) = -21d + 1. Calculate j(n(p)). -126p + 6 Let u(r) be the first derivative of -r6/360 + r3/3 - 15r - 8. Let f(k) be the third derivative of u(k). Let h(m) = -2m2 + 6m. Calculate h(f(w)). -2w4 - 6w*2 Let d(c) be the second derivative of 5c*4/12 - 16c. Let k(w) = 9w2 + 11. Let y(u) = -9u*2 - 10. Let a(b) = -6k(b) - 7y(b). Calculate a(d(t)). 225t*4 + 4 Let p(d) = -4176d. Let u(w) = 10w - 318. Determine p(u(i)). -41760i + 1327968 Let j(p) = -14p - 1. Let f(c) = 325c + 26. Let q(h) = -f(h) - 26j(h). Let v(y) = -20y. Determine q(v(s)). -780s Suppose 0 = 5x - 5c - 0c - 2250, -2x + 5c + 912 = 0. Let w(q) = -q + 446 - x. Let z(s) = -2s2 - 3s. Calculate z(w(r)). -2r2 + 3r Let t(x) = 6x2 - 13x2 - x2 + x*2. Let q(n) = -21n + 13n - 6 + 3 + 3. Calculate q(t(h)). 56h*2 Let i(o) be the third derivative of -455o*4/24 - 1856o*2. Let t(a) = a. What is i(t(x))? -455x Let v(y) = 12y2. Let n(b) = 71b + 929. Let z be n(-13). Let t(s) = 3 - 1 + 4 - 7s. Let u(q) = 15q - 13. Let l(g) = zu(g) + 13t(g). Calculate l(v(c)). -12c2 Let t(u) = -16u. Let p(s) be the first derivative of -s*5/10 + 4s*2 - 18. Let x(h) be the second derivative of p(h). Give x(t(r)). -1536r*2 Let t(u) = 67u*2. Let y(x) = x - 6. Let k(o) = 3o + 36. Let r(g) = k(g) + 6y(g). Give t(r(f)). 5427f*2 Let z be 6/7(-7)/(-1). Let d(l) = -l + z - 6. Let t(q) = 888684q + 14q*2 - 888684q. What is t(d(p))? 14p2 Let x(p) = 29145p*2. Let n(m) = 13268m. Give n(x(q)). 386695860q2 Let j(f) be the third derivative of -15f4/2 + f3/3 + 4173f2. Let t(u) = -7u*2. Give j(t(y)). 1260y*2 + 2 Let d(b) = -53b*2 + 24b - 30b + 6b + 276b2. Let o(u) = 4u. What is d(o(q))? 3568q2 Let n(u) be the first derivative of -2u*3/3 + 1035. Let f(z) = -524z*2. Give n(f(w)). -549152w*4 Suppose -5n + n = -68. Let w = 18 - n. Let x(d) = d - 1. Let c(v) = 11v2 - 66v + 66. Let f(q) = wc(q) + 66x(q). Let m(t) = -t. Give m(f(l)). -11l2 Let b = -177 + 189. Let t(l) = -bl + 15l + 4l. Let o(f) = -f. Give o(t(w)). -7w Let q(a) be the first derivative of -8a*3/3 - 1805. Let h(k) = -85k*2. Give q(h(z)). -57800z*4 Let j(g) = 2g*2. Let a = 40 - 18. Let o = a + 49. Let d(k) = o - 4k - 71. Give d(j(s)). -8s2 Let f(q) = -171q - 856. Let k(t) = 8t + 41. Let n(u) = 2f(u) + 43k(u). Let r(w) = 6w*2 - 2w2 - w2. Calculate n(r(i)). 6i2 + 51 Let h(p) be the third derivative of -p7/840 + 59p4/24 - p3/6 - 53p2. Let z(r) be the second derivative of h(r). Let v(b) = 70b*2. Calculate v(z(s)). 630s*4 Let w(o) = 10o. Let x(h) be the second derivative of 55h3/6 + 765h. What is w(x(c))? 550c Let o(z) be the third derivative of 0z - 27 - z*2 + 3/5z*5 + 0z*3 + 0z*4. Let i(x) = -6x. Determine o(i(v)). 1296v2 Let t(n) = 839610n. Let z(g) = 242g2. What is z(t(q))? 170596678408200q*2 Let s(j) = 3j - 6. Let r = 31 - 37. Let n be -10 - -5 - -8 - r/2. Let c(v) = -v + 1. Let w(d) = nc(d) + s(d). Let y(a) = 10a. Give y(w(q)). -30q Let s(r) = 24r*2. Let x(j) = 2901268j*2. What is x(s(t))? 1671130368t*4 Let d(m) = m. Let l(t) = -t - 2. Let g(c) be the third derivative of 5c*4/24 - 2c*3/3 + 4c*2. Let n(o) = -g(o) + 2l(o). Calculate n(d(x)). -7x Let k(m) = 6m*2 + 0m*2 - 8m2 + m2. Let f(w) = w. Let n(b) = -6b + 3b - 3b + 2b. Let a(d) = -5*f(d) + n(d). Determine k(a(s)	{ "pile_set_name": "DM Mathematics" }
rrrbb. What is prob of picking 1 b and 1 k? 5/68 Calculate prob of picking 1 e and 2 c when three letters picked without replacement from {d: 2, c: 2, r: 1, e: 1}. 1/20 What is prob of picking 3 t and 1 z when four letters picked without replacement from zttttzttzzttz? 56/143 Three letters picked without replacement from fkfenkk. Give prob of picking 2 k and 1 e. 3/35 Three letters picked without replacement from {i: 1, a: 3, p: 1, z: 5, w: 1, t: 2}. Give prob of picking 2 z and 1 w. 5/143 Four letters picked without replacement from {v: 1, t: 1, y: 2, n: 3, j: 3, h: 7}. Give prob of picking 1 h, 1 t, and 2 y. 1/340 What is prob of picking 1 a, 1 y, and 1 l when three letters picked without replacement from yaaatuyuylauyylyuau? 20/323 Calculate prob of picking 1 g, 1 u, and 1 r when three letters picked without replacement from rrnannugngg. 2/55 Two letters picked without replacement from {u: 3, s: 4, o: 1, f: 6}. What is prob of picking 1 u and 1 f? 18/91 Two letters picked without replacement from {l: 1, g: 1, k: 1, b: 1, j: 1}. Give prob of picking 1 l and 1 b. 1/10 What is prob of picking 2 j when two letters picked without replacement from eejejpjzjezjecss? 1/12 Four letters picked without replacement from {b: 7, k: 4, p: 4, e: 1, i: 1}. Give prob of picking 1 i, 1 k, 1 e, and 1 p. 4/595 Calculate prob of picking 1 d, 1 r, and 1 x when three letters picked without replacement from {r: 2, d: 7, x: 3}. 21/110 Calculate prob of picking 2 y and 2 x when four letters picked without replacement from {y: 7, x: 2}. 1/6 What is prob of picking 1 j and 1 c when two letters picked without replacement from rreeejpjcjejeecjjrj? 14/171 Two letters picked without replacement from {m: 2, r: 2, j: 1, q: 1, c: 6}. Give prob of picking 2 r. 1/66 Four letters picked without replacement from {c: 5, s: 1, u: 12}. What is prob of picking 1 s and 3 u? 11/153 Three letters picked without replacement from {k: 4, v: 3, y: 2, f: 1, q: 1}. What is prob of picking 1 k, 1 v, and 1 f? 4/55 Two letters picked without replacement from {p: 4, b: 1, m: 1, c: 5}. What is prob of picking 2 p? 6/55 Three letters picked without replacement from kekeejjejeejje. What is prob of picking 2 j and 1 k? 5/91 What is prob of picking 2 q when two letters picked without replacement from {q: 3, i: 1}? 1/2 Three letters picked without replacement from jjgjggjjjj. Give prob of picking 2 g and 1 j. 7/40 What is prob of picking 3 h when three letters picked without replacement from hhhmmmmmbhrmmmmb? 1/140 Calculate prob of picking 2 b and 1 x when three letters picked without replacement from {r: 2, x: 2, b: 9}. 36/143 Three letters picked without replacement from {n: 6, z: 2, d: 1, s: 4, v: 2, a: 2}. Give prob of picking 2 z and 1 a. 1/340 Calculate prob of picking 1 e and 1 k when two letters picked without replacement from kzeetz. 2/15 What is prob of picking 1 q and 1 w when two letters picked without replacement from ccnnnckcnnncwqcnqccn? 1/95 What is prob of picking 1 a, 1 n, and 2 c when four letters picked without replacement from {d: 4, a: 3, n: 5, c: 5, b: 1}? 5/102 Two letters picked without replacement from {a: 3, e: 4, s: 4, w: 6}. What is prob of picking 1 a and 1 w? 9/68 Three letters picked without replacement from {j: 2, w: 1, q: 1, l: 3, u: 3}. Give prob of picking 3 u. 1/120 Three letters picked without replacement from {e: 10, s: 2}. What is prob of picking 2 e and 1 s? 9/22 Three letters picked without replacement from {h: 7, n: 3, u: 1, m: 2, y: 1}. What is prob of picking 1 h, 1 n, and 1 m? 3/26 Three letters picked without replacement from {q: 1, z: 7}. What is prob of picking 3 z? 5/8 What is prob of picking 1 n and 1 p when two letters picked without replacement from nnrzrnnuzrpznruzuurr? 1/38 Two letters picked without replacement from {t: 2, x: 3, m: 1, i: 5, b: 1}. What is prob of picking 2 t? 1/66 Three letters picked without replacement from {g: 1, j: 7, p: 6}. What is prob of picking 2 j and 1 g? 3/52 Three letters picked without replacement from {c: 1, q: 3, v: 5}. What is prob of picking 2 q and 1 c? 1/28 Four letters picked without replacement from {h: 1, t: 5, y: 1, x: 1, g: 1}. Give prob of picking 1 x, 1 y, 1 g, and 1 t. 5/126 What is prob of picking 4 w when four letters picked without replacement from bwwkwwkbkwbkkbwkbbk? 5/1292 Calculate prob of picking 1 r and 1 k when two letters picked without replacement from {r: 5, k: 2, e: 13}. 1/19 Calculate prob of picking 1 m and 1 i when two letters picked without replacement from {h: 6, i: 3, m: 2, e: 1, b: 1}. 1/13 Calculate prob of picking 2 o and 2 l when four letters picked without replacement from {l: 2, m: 4, o: 5}. 1/33 What is prob of picking 1 r, 1 f, and 1 d when three letters picked without replacement from crdfrfdcdffcdufd? 5/56 Three letters picked without replacement from yffffyfffffffyffff. Give prob of picking 1 y and 2 f. 105/272 Two letters picked without replacement from {i: 4, u: 8, y: 3, e: 2}. What is prob of picking 2 e? 1/136 Calculate prob of picking 1 m, 1 t, and 2 o when four letters picked without replacement from {t: 2, m: 6, o: 4, y: 1}. 72/715 Calculate prob of picking 1 r and 1 c when two letters picked without replacement from {w: 1, k: 2, n: 2, r: 1, c: 1}. 1/21 What is prob of picking 1 f and 1 e when two letters picked without replacement from eknkfekknknkeee? 1/21 Four letters picked without replacement from cctctcchcccccp. Give prob of picking 1 p, 2 c, and 1 t. 90/1001 Calculate prob of picking 1 e and 2 h when three letters picked without replacement from eeheeeheehheeeheee. 65/408 Calculate prob of picking 1 i and 1 z when two letters picked without replacement from {k: 4, i: 1, z: 2, h: 1, j: 1, b: 6}. 2/105 Four letters picked without replacement from mvvvxmvkkvnmkxmk. What is prob of picking 1 k, 1 n, and 2 m? 6/455 What is prob of picking 2 p and 2 v when four letters picked without replacement from {v: 2, k: 1, g: 4, o: 4, p: 3}? 3/1001 Calculate prob of picking 1 g and 2 t when three letters picked without replacement from ggtggggggtgtgggg. 39/560 Calculate prob of picking 1 w and 2 o when three letters picked without replacement from oofomwomfdf. 2/55 Calculate prob of picking 1 u and 1 d when two letters picked without replacement from oucodonnnnooo. 1/78 What is prob of picking 1 w and 1 u when two letters picked without replacement from {c: 1, u: 2, w: 1, y: 1}? 1/5 What is prob of picking 2 d when two letters picked without replacement from {u: 2, d: 7, g: 11}? 21/190 Calculate prob of picking 1 l and 1 h when two letters picked without replacement from {h: 6, c: 2, l: 1, j: 3, y: 1}. 1/13 Calculate prob of picking 1 i and 1 g when two letters picked without replacement from ggig. 1/2 Three letters picked without replacement from {t: 11, h: 3}. What is prob of picking 3 t? 165/364 Calculate prob of picking 1 j, 1 c, and 1 h when three letters picked without replacement from richjjj. 3/35 Four letters picked without replacement from {p: 4, y: 7}. Give prob of picking 2 p and 2 y. 21/55 Two letters picked without replacement from {g: 1, s: 5, f: 3, p: 1}. What is prob of picking 1 f and 1 p? 1/15 Four letters picked without replacement from ilninilliipyn. What is prob of picking 2 i, 1 y, and 1 l? 6/143 What is prob of picking 1 q and 2 y when three letters picked without replacement from {q: 10, p: 2, h: 2, y: 6}? 5/38 Two letters picked without replacement from {g: 1, y: 2, o: 1, q: 4}. Give prob of picking 1 o and 1 q. 1/7 Calculate prob of picking 2 l when two letters picked without replacement from nylelxxp. 1/28 What is prob of picking 1 h, 1 t, 1 p, and 1 r when four letters picked without replacement from prrytyhoyyyyyrpoytry? 16/4845 Calculate prob of picking 1 b and 1 r when two letters picked without replacement from rshbhhhbrasb. 1/11 Four letters picked without replacement from {k: 2, g: 2, b: 1, h: 1, a: 1}. What is prob of picking 1 h, 1 a, 1 b, and 1 g? 2/35 What is prob of picking 2 y, 1 s, and 1 r when four letters picked without replacement from {s: 10, d: 4, y: 2, e: 2, r: 1}? 5/1938 Two letters picked without replacement from ctcctccctttctcttct. What is prob of picking 2 c? 4/17 What is prob of picking 2 x, 1 g, and 1 a when four let	{ "pile_set_name": "DM Mathematics" }
6z - 3z*2 + 5z*2 + 4z2 + z3 - 2. What is the remainder when y is divided by t(-2)? 0 Let a(i) = i*2 - 9i - 20. Let u = 71 + -60. Let v be a(u). Suppose 3z + 133 = vg, -5g + 253 = -2z - 85. Calculate the remainder when g is divided by 14. 12 Suppose -5h + 15 + 140 = 3t, -h + 43 = 3t. Let y be -8 + (3 - -3 - 0). Calculate the remainder when (-1)/y-3 + (-26414)/(-188) is divided by h. 27 Suppose 3d - 73 = i, 4i - 7i = -4d + 104. Let q be 3 + (196/(-42))/((-1)/(-3)). Let a = d + q. What is the remainder when 35 is divided by a? 11 Let r(l) = 136l - 1199. What is the remainder when 32075 is divided by r(11)? 296 Let f(g) = -2g. Suppose 464 + 760 = 12w. What is the remainder when w is divided by f(-13)? 24 Suppose -5p + 2 = 3y - 2, p + 4y + 6 = 0. Let x = 2510 + -2494. What is the remainder when (p - -3)/((-3)/(-18)) is divided by x? 14 Let o(z) = -z*3 - 7z2 + 8. Let t(b) = -b2 - 5b + 29. Let l be t(-9). Let r be o(l). Let h(u) = -u + 22. What is the remainder when h(r) is divided by 3? 2 Suppose 2y + 2b - 2 = 0, b + 3639 = y + 3630. Let t(m) = m - 3. Let c(j) = 1. Let u(q) = -3c(q) - t(q). Calculate the remainder when y is divided by u(-5). 0 Let i = -4 - -14. Suppose -3m - n - 4 = -15, 2n + 28 = 4m. Suppose md = 6d - 127. Calculate the remainder when d is divided by i. 7 Calculate the remainder when 356 is divided by 4 - 4 - -22 - (-60)/15. 18 Let w = -227 + 713. Suppose 8n - w = -n. Calculate the remainder when 98 is divided by n. 44 Suppose 3j - 5 = -3h + 2h, -3j + 20 = 4h. Suppose 4z - 4 = j, -43f + 5z = -41f - 5. Let u = 7 + -4. Calculate the remainder when f is divided by u. 2 Let n(r) = -r3 + 6r*2 - 7r + 8. Let k be n(4). Suppose kf = 13f - 30. Suppose fj + 243 = 33j. Calculate the remainder when j is divided by 42. 39 Let m(v) = -51v2 - v3 - 19 + 95v*2 - 52v*2 - 3v. Suppose -21 = -4n - 5y, 42 = 3n - y - 4y. Calculate the remainder when n is divided by m(-8). 4 Suppose -74 = 4t - 5t. What is the remainder when t is divided by 27 - 311/(-33)? 18 Let y = 573 - 221. Let a = -337 + y. Suppose -3f + 285 = 2f. What is the remainder when f is divided by a? 12 Let d = -2 - -5. Suppose 0 = -5h + dh + 70. Suppose 4n - n = 2j - 35, 0 = -5j + 2n + 93. Calculate the remainder when h is divided by j. 16 Let v(p) = -p + 14. Let t be v(10). What is the remainder when 2296/32 - (-1)/t is divided by 70/26/10 + (0 - -6)? 18 What is the remainder when 117 is divided by (-132)/(-12) - (2 + -2)? 7 Suppose 17467 = 4m - w, 24094 = 5m + 5w + 2279. What is the remainder when m is divided by 21? 19 Let g = 58 - 329. Let h = -254 - g. Calculate the remainder when 95 is divided by h. 10 What is the remainder when -24 + 800/25 + (-13152)/(-4) is divided by 138? 122 Let m(t) = 17t - 62. Suppose x = b + 598, 5x + 30b - 26b = 2963. Calculate the remainder when x is divided by m(5). 20 Let n be 0(-2)/(-4) - 0. Suppose n = -2i + 8. Suppose ih - 57 - 103 = 0. Calculate the remainder when h is divided by 11. 7 Let z be (-1)/(9/(-2)) - 22/18. Let u(d) = 7d2 - 1. Suppose -3n = -i - 74, 5n - 3i + i - 125 = 0. What is the remainder when n is divided by u(z)? 5 Let q = 316 - 313. What is the remainder when (-8 + q)(1 + 2)-1 is divided by 8? 7 Let c be ((-109)/(-2))/((-22)/44). Calculate the remainder when 106 is divided by (-9)/(-45) - 0 - c/5. 18 Suppose -6a + a = 5i - 5680, -5i + 5645 = -2a. What is the remainder when i is divided by 111? 21 Let h = 875 + -826. Suppose 3559 = hi + 276. What is the remainder when 182 is divided by i? 48 Suppose 0 = 10t + 1066 + 1006 - 3252. Suppose -w + 4v + 21 = -0v, -42 = -2w - 5v. Calculate the remainder when t is divided by w. 13 Let l(j) = 2j2 - 26j + 253. Calculate the remainder when l(10) is divided by 32. 1 Let d be 9/(27/6) + (-474)/(-2). Let f = 357 - d. What is the remainder when f is divided by 31? 25 Calculate the remainder when 1147 is divided by (25/2)/((-2)/(-2)) + (-6)/(-4). 13 Suppose 9u + 3g + 96 = 13u, 6u - 144 = 4g. What is the remainder when 258 is divided by u? 18 Let h = 107 + -6. Let i be 26/4 + 93. Suppose iw + 90 = hw. Calculate the remainder when 71 is divided by w. 17 Let c be (6/7)/3 - 1172/(-14). Let i = c - 73. Suppose -30 - 56 = -2u. What is the remainder when u is divided by i? 10 Let n = -4416 + 4550. What is the remainder when 529 is divided by n? 127 Let c = -302 + 494. Let x = 9 + 19. What is the remainder when c is divided by x? 24 Let b(l) = -2l*3 + 15l*2 + 66l + 143. Let h(j) = -2j3 - 8j*2 + 2j - 5. What is the remainder when h(-6) is divided by b(11)? 17 Suppose -44f + 8370 = -5f - 3408. Calculate the remainder when f is divided by 129. 44 Suppose -13l + 33 = 7, 0 = 5t - 2l - 351. What is the remainder when 457 is divided by t? 31 Suppose 3g + 15 = 4g + 3q, -q + 4 = 0. Suppose 0 = -4l + gv - 2v + 287, 0 = 2l + 2v - 146. Calculate the remainder when 573 is divided by l. 69 Let p be 2/(-6)4462/(-88). Suppose 2f - 23 = 27. Calculate the remainder when f is divided by p(7 - 3 - 3). 4 Suppose -4v = -5 + 25, 0 = 3f - 3v - 72. Suppose 3i - f = 4t + 14, 4t + i = -21. What is the remainder when 12/(-8) + 573/t-1 is divided by 32? 30 Let z be ((4/(-6))/2)/(86/(-7224)). Suppose 10d + 2196 = zd. Calculate the remainder when d is divided by 14. 10 Let q(n) = n. Let o(s) = -4s + 6. Let l(t) = -o(t) - 10q(t). Let p be l(-3). What is the remainder when p/(-3)(-11 + 1) is divided by 14? 12 Let a = -14 + 22. What is the remainder when 23 + 11 + -18 - 8 is divided by a? 0 Suppose 3j = 3 - 27. Calculate the remainder when 25 is divided by (j/24)/((-3)/54). 1 Let z(h) be the first derivative of -13h2/2 + 313h - 121. Calculate the remainder when z(-45) is divided by 60. 58 Let u = -35 + 28. What is the remainder when 65 is divided by -1 + (u/2)/(1/(-2))? 5 Suppose 9d - 330 = 4d. What is the remainder when 47 is divided by 4/(-8) - d/(-4)? 15 Let u = 47087 + -47071. Suppose 0 = 4w - 5l - 198, -4w - l + 2l + 190 = 0. What is the remainder when w is divided by u? 15 Suppose c + 6 - 2 = 3a, -26 = -c - 3a. Let z(p) = p*2 - 2p*2 - 3 - 8 + 6 + 10p. Calculate the remainder when z(5) is divided by c. 9 Let t = -3 + -7. Let n(i) = i*3 + 11i*2 + 10i + 9. Calculate the remainder when (10642/221 - 6) + 2/(-13) is divided by n(t). 6 What is the remainder when ((-10)/2130 - -10)-273 is divided by 584? 2 What is the remainder when 1(106 + (1 - 1)) is divided by 18/(-630) + (-3712)/(-70)? 0 Calculate the remainder when 274 is divided by (25/(-50))/(2/(-616)). 120 Let x(f) = 83f. Let y(n) = -n*3 + 41n*2 + 40n + 87. Let k be y(42). What is the remainder when x(2) is divided by (k - 10/15)18? 40 Suppose -17 = 3u + 2a - 228, a - 209 = -3u. What is the remainder when u is divided by 24? 21 What is the remainder when (401 - (1 + -1)) + -12 is divided by 193? 3 Let m = -15 + 22. What is the remainder when -1(-98)/(-245) - (1404/(-10) - 1) is divided by m? 1 What is the remainder when 1 + -12 - (0/3 - 7100) is divided by 10? 9 Suppose 240 = 4k + 8k. Suppose -5u - k = -5o + 190, 5o + 5u = 240. What is the remainder when 222 is divided by o? 42 Let z = 6975 - 6152. Calculate the remainder when z is divided by 94. 71 What is the remainder when 106 is divided by (72 + -22)/((-5)/(-10))? 6 Suppose 0 = -4n, -257 = -3f + 4n - 71. Let w(a) = -a*3 - 12a*2 + 21a - 63. Let t = -380 - -366. Calculate the remainder when f is divided by w(t). 27 Let u(p) = 11p2 + 1. Let x be u(1). Suppose -72 = 4o - xo. Let z = -3 + o. What is the remainder when 29 is divided by z? 5 Let a = 93 - -40. Let w = -100 + a. Suppose m = 3m - 24. What is the remainder when w is divided by m? 9 Let b(n) = -n*3 + 27n*2 + 59n - 749. Calculate the remainder when b(26) is divided by 58. 11 Suppose -4s + 0s = 4s. Suppose -19j + 3j + 320 = s. What is the remainder when j is divided by 33/6 + (-2)/4? 0 Let x(p) = 3p + 33. Let i = -67 - -113. Calculate the remainder when i is divided by x(-7). 10 Suppose 74j + 25 = 79j. Let l(c) = 7c2 - 3c + 17. Let t be l(j). What is the remainder when (t - (-6)/(-3)) + 3 is divided by 30? 28 Suppose 0 = 18r - 4r - 140. C	{ "pile_set_name": "DM Mathematics" }
2 = -5c. Let k(i) = -i - 1 + c. Determine k(r(a)). 2a Let u(a) = a - 215. Let l(t) = t. Determine u(l(m)). m - 215 Let b(m) = 2095m. Let j(i) = 5i. Give j(b(y)). 10475y Let q(l) = -110l. Let m(v) = -18v. What is q(m(w))? 1980w Let o(v) = 14v. Let y(u) = 6u*2. What is y(o(m))? 1176m*2 Let p(d) = -d. Let q(x) = -16 + 9 + 7 - 2x. Let f(l) = 3l. Let t = 15 - 11. Let i(h) = tf(h) + 5q(h). Calculate i(p(v)). -2v Let j(f) be the first derivative of 0f - 2 + 0f*2 + 2/3f*3. Let w(i) = -3i. Give j(w(o)). 18o2 Let p(j) = -4j. Let o(w) = -2w - 495. Give p(o(z)). 8z + 1980 Let v(u) = 2u2. Let t(y) = -3y*2 - 5y. Determine v(t(i)). 18i4 + 60i*3 + 50i*2 Let o(v) be the first derivative of 3/2v*2 + 0v - 1. Let p(x) be the second derivative of x*3/6 + 3x. What is o(p(d))? 3d Let m(w) be the third derivative of w4/12 + w2. Let v be -11(-28 - -6). Let u(c) = vc - 12c - 13c. Determine u(m(i)). -6i Let a(x) = 2x. Let l be 18/5 - (-2)/5. Let g(j) be the second derivative of 0j3 + 0 + 1/6j*l - j + 0j*2. Calculate a(g(k)). 4k*2 Let i = -5 + 7. Let m(q) = 5q*2 - 2 - 4q2 + i. Let l(v) be the third derivative of v5/60 + v2. Calculate m(l(k)). k4 Let n(v) = -306v. Let r(t) = -17t*2. Determine r(n(j)). -1591812j*2 Let t(d) = 5d*2. Let m(z) = 181z*2. What is t(m(s))? 163805s*4 Let y(r) = -3r. Let l(w) = 7w2 - 4w. Give l(y(m)). 63m2 + 12m Let r(f) = 0f + 0f + 2f2. Let d(i) be the second derivative of -3i + 0 + 0i3 + 1/12i*4 + 0i*2. What is r(d(p))? 2p*4 Let k(y) = 3y + 2y + 0y. Let c(h) be the second derivative of -h*4/12 + 3h. Determine c(k(j)). -25j2 Let i = 15 - 9. Let h(s) = -2s + 2. Let v(r) = r*2 + 3r - 3. Let b(w) = ih(w) + 4v(w). Let y(a) = -a*2. Give y(b(x)). -16x*4 Let z(p) = -2p*2. Let h(f) be the third derivative of 0f - 4f2 + 0f*3 - 1/24f*4 + 0. What is z(h(j))? -2j2 Let l(o) be the third derivative of -o6/180 - o3/6 + o2. Let f(i) be the first derivative of l(i). Let v(x) = 2x2. Give v(f(y)). 8y*4 Let y(z) = -19z - 6. Let b(t) = -t. Determine b(y(s)). 19s + 6 Let x(m) = -3m. Let l(c) = 2c3 + c2 - 2c + 1. Let v be l(1). Let g(b) = 0 + 0 - 2b2 - 3b*v. What is x(g(o))? 15o*2 Suppose -4j + n + 7 + 5 = 0, 4n = 2j - 20. Suppose j + 2 = 2y. Let w(r) = 3 - 3 - yr*2. Let f(g) = -2g. Calculate w(f(q)). -8q2 Let l(o) = -5o*2. Let t(h) = -8h - 9. Let u(k) = -k - 1. Let n(m) = -4t(m) + 36u(m). Determine l(n(c)). -80c2 Let n(v) = -3v. Let l(y) = y - 28. Give l(n(k)). -3k - 28 Let i(o) = 3o*2. Let q(j) = -36j - 6773 + 6773. Give q(i(x)). -108x2 Let b(m) = -17m*2. Let w(f) = 331f*2. Determine w(b(o)). 95659o4 Let t(u) = -u. Let d(z) = -z2 + 3z. Let r(y) = d(y) + 3t(y). Let c(x) = 2x2. What is r(c(i))? -4i4 Let g(d) = -d2. Let k(n) be the second derivative of 0n2 + 1/6n*4 + 2n + 0n3 + 0. Determine g(k(x)). -4x*4 Let z(y) = 1555y*2. Let j(k) = 2k*2. Give j(z(m)). 4836050m*4 Let g(m) be the first derivative of 4m*3/3 + 48. Let s(n) = 6n - 5. Let a(j) = j - 1. Let b(l) = 10a(l) - 2s(l). What is b(g(o))? -8o2 Suppose -4 = -5n + 6. Let u(d) = n - 14d2 + 10d*2 - 2. Let c(m) = 3m. Determine u(c(o)). -36o2 Let n(h) = h - 297. Let r(v) = 11v*2. What is n(r(y))? 11y*2 - 297 Let g(k) = 956k. Let m(v) = v. What is m(g(c))? 956c Let s(n) = -5n*2 - 6n*2 + 4n*2. Let w(c) = -3c*2. Let v(d) = -4s(d) + 10w(d). Let m(b) = -b. Give v(m(t)). -2t*2 Let z(n) = -4n - n + 3n. Let k(b) = -3b + 2b + 2b. What is k(z(f))? -2f Let i(p) = 2257p*2. Let h(j) = -j. What is i(h(u))? 2257u*2 Let m(q) = 1077q - 4q2 + 2q*2 - 1077q. Let x(j) be the third derivative of -5j4/12 - 3j*2. What is m(x(y))? -200y*2 Let a(s) = 3s. Let n(i) = 2i. Let m(c) = -5a(c) + 8n(c). Let k(t) = 54t. Calculate k(m(q)). 54q Let v(k) = -4k. Let j(x) = x*2 - 3x - 3. Let n(s) = -3s2 + 8s + 8. Let a(o) = -8j(o) - 3n(o). Determine v(a(r)). -4r2 Let d(q) = q2. Let n(o) = 0 - 2 + 4o + 2. What is n(d(b))? 4b2 Let q(f) = -1166f*2. Let y(n) = 4n*2. Give q(y(k)). -18656k*4 Let x(n) = 2n*2. Let i(o) be the second derivative of 35o*4/6 + 12o. Calculate i(x(k)). 280k4 Let h(g) = 2g. Suppose 5d - 28 = -8. Suppose u = 2t + d, u + 2t + 3 = -3t. Let c(q) = 0q2 - 3q2 - q2 + q*u. What is h(c(i))? -6i*2 Suppose -v + 10 = v. Let p(s) = s - vs + 2s. Let h(a) be the third derivative of a4/12 + 2a*2. Determine h(p(x)). -4x Let a(d) = 1113d. Let c(z) = -6z. What is c(a(b))? -6678b Let w(l) = -l2 - 9l - 14. Let u be w(-7). Let x(f) = f + uf + f - f. Let c(g) = -g2. Calculate c(x(h)). -h2 Let f(y) = -60y*2 + 12y + 24. Let b(j) = 24j2 - 5j - 10. Let t(i) = 12b(i) + 5f(i). Let v(m) = 5m. What is t(v(o))? -300o*2 Let k(s) = -s. Let f(y) = -3y + 96. Give k(f(q)). 3q - 96 Suppose r - 6 = -5k - 3r, -2r - 12 = -5k. Let b(y) = y - y + ky. Let o(q) = -5q. Give b(o(l)). -10l Let y(v) = 221v. Let x(k) = -2k*2. Determine y(x(f)). -442f2 Let q(k) = -k2 - 3k. Let b(d) = -3d*2 - 8d. Let n(y) = -3b(y) + 8q(y). Let r = -5 + 9. Let v(u) = u*2 + 5u - u - ru. Calculate v(n(g)). g4 Let u(c) be the first derivative of 5c*3/3 - 2. Let p(v) = -2v. Determine u(p(l)). 20l2 Let w(s) = -4s*2. Let l = -2 - -4. Let k(y) = ly*2 - 3y2 - y2. Give k(w(t)). -32t4 Let m(r) = -304r + 8r2 + 304r. Let a(g) = g. Give a(m(h)). 8h2 Let o(y) = -2y*2. Let r(z) be the second derivative of -5z*4/12 + 6z. Calculate r(o(m)). -20m4 Let m(v) be the first derivative of 0v - 1 - v*2 + 7/3v*3. Let n(t) = 36t*2 - 11t. Let k(g) = 11m(g) - 2n(g). Let o(w) = -2w. Give k(o(b)). 20b*2 Let q(d) = 2d*2. Let r(a) = 3a. Let j(k) = -11k + 3. Let b(g) = -g + 1. Let c(l) = -3b(l) + j(l). Let v(f) = 5c(f) + 14r(f). Determine v(q(m)). 4m2 Let z(g) = -2g*2 - 17g. Let j(m) = 73m2. Determine z(j(s)). -10658s*4 - 1241s2 Let j(q) be the third derivative of q4/4 - 2q2. Let u(v) = 7v. Let t(p) = 3p. Let d(z) = 9t(z) - 4u(z). Determine j(d(l)). -6l Let h(b) = 127b + 1. Let t(s) = 12s. Give t(h(a)). 1524a + 12 Suppose 0 = 3n + n - 40. Let l(k) = nk2 - 8k*2 + 3k*2. Let h(g) = -g. What is h(l(c))? -5c*2 Let s(j) be the second derivative of 1/6j*4 + 0 + 0j*3 + 0j*2 - 2j. Let y(f) = -3f - 2f + 3f. Calculate y(s(c)). -4c*2 Let m(p) = 5p - 6. Let b(r) be the second derivative of -7r3/3 + 17r*2/2 - 6r. Let h(j) = 6b(j) + 17m(j). Let z(y) = -3y. Calculate z(h(f)). -3f Let y(s) = -s. Let x(u) = -4u2 + 16u2 - u2. Determine y(x(j)). -11j2 Let z(r) = -2r. Let b(j) = -9j2 - 166j. Determine z(b(i)). 18i2 + 332i Let o(m) = 4m2. Let j(l) be the first derivative of 2l*3/3 - 12. Calculate j(o(q)). 32q*4 Let r(p) = -3266p. Let m(w) = 2w2. Calculate m(r(f)). 21333512f*2 Let g(z) = -2z*2. Let b(n) = -2n2 - 7. Let p(i) be the first derivative of i3/3 + 2i - 2. Let y = 1 + -3. Let j(x) = yb(x) - 7p(x). Determine g(j(u)). -18u*4 Let v(c) = 13c. Let y(k) = 2k. What is v(y(p))? 26p Let s(m) be the first derivative of -3m2 - 1. Let l(z) = z2 + 2z - 2z + 0z*2. What is s(l(o))? -6o*2 Let q(s) = -23s + 3. Let z(k) = 3k. Determine z(q(a)). -69a + 9 Let l(f) = -1683f2 + 2. Let x(d) = 2d. Give l(x(p)). -6732p2 + 2 Let p(j) be the second derivative of -j6/180 - j3/6 - 2j. Let i(z) be the second derivative of p(z). Let v(s) = s*2. Give v(i(d)). 4d*4 Let c(k) = -2k. Let b(r) = 6r - 4. Let f(z) = -11z + 7. Suppose d + o + 2o = 1, 0 = -2o - 4. Let a(j) = db(j) + 4f(j). Determine a(c(u)). 4u Let n(q) be the third derivative of -q6/720 + q4/24 - q2. Let w(a) be the second derivative of n(a). Let k(r) = r. What is k(w(f))? -f Let h(p) = -p2. Let a(v) be the first derivative of -3v*2/2 - 1. Give a(h(n)). 3n*2 Let k(y) = -10y2. Let f(u) = u2 + 3u. Let r be f(-4). Let v(b) = -18b + rb + 7b + 6b. Give k(v(h)). -10h*2 Let v(y) = 7y - 2. Let q(h) = 217h - 63. Let c(r) = 2q(r) - 63v(r). Let m(p) = -p2. Determine m(c(x)). -49x*2 Let d(x) = 2x**2. Let p(l) be t	{ "pile_set_name": "DM Mathematics" }
n 4n3 + 500n*2 - 2052n + 1548 = 0? -129, 1, 3 Factor r*3 - 367r*2 + 731r - 365. (r - 365)(r - 1)2 What is h in -4h*3/7 - 11h*2/7 + 43h/7 - 10/7 = 0? -5, 1/4, 2 Determine k so that -k5/4 - k4 - k3/2 + k2 + 3k/4 = 0. -3, -1, 0, 1 Find w, given that -4w*4 + 76w*3 + 4w*2 - 76w = 0. -1, 0, 1, 19 Solve 2c2/3 - 82c/3 + 476/3 = 0 for c. 7, 34 Factor 408608j2/21 - 5424j/7 + 54/7. 2(452j - 9)2/21 Factor -g2/3 - 58g/3 - 112/3. -(g + 2)(g + 56)/3 Find f such that -f*4 + 7f3 + f2 - 7f = 0. -1, 0, 1, 7 Factor -3b*2 - 99b + 4104. -3(b - 24)(b + 57) Factor 5y4 - 165y*3 + 1900y*2 - 8880y + 14400. 5(y - 12)2(y - 5)(y - 4) Factor -c2/8 + 33c/2 + 133/8. -(c - 133)(c + 1)/8 Factor -2i*2/3 + 532i/3 - 35378/3. -2(i - 133)2/3 Determine u so that 3u*5/4 + 249u*4/4 - 789u*3/4 - 1281u*2/4 + 393u/2 + 258 = 0. -86, -1, 1, 4 Solve 210p5 - 2185p*4/2 + 1730p*3 - 2255p*2/2 + 310p - 30 = 0. 1/4, 2/7, 2/3, 1, 3 Factor -2z2/3 + 96z - 3456. -2(z - 72)2/3 Factor z5/3 - 9z*4 + 46z*3 + 586z*2/3 + 215z + 75. (z - 15)*2(z + 1)*3/3 Solve 25q*5 + 190q*4 + 320q*3 - 160q*2 = 0. -4, 0, 2/5 Factor 2l*4/3 - 14l*3/3 - 56l*2/3 - 40l/3. 2l(l - 10)(l + 1)(l + 2)/3 Determine c so that 5184c3 + 9072c*2 + 5292c + 1029 = 0. -7/12 Solve 3k3 + 33k*2 + 57k + 27 = 0 for k. -9, -1 Factor -32g4/5 + 48g*3/5 - 18g*2/5. -2g*2(4g - 3)2/5 Factor -l5/2 - 2l*4 - 2l3 + l2 + 5l/2 + 1. -(l - 1)(l + 1)*3(l + 2)/2 Let -2t2/3 + 50t - 148/3 = 0. Calculate t. 1, 74 Factor p*5 - 19p*4 + 103p*3 - 57p*2 - 504p - 324. (p - 9)(p - 6)2(p + 1)*2 Factor -2z*4/11 + 8z*3/11 + 6z*2/11 - 36z/11. -2z(z - 3)*2(z + 2)/11 Factor w*3/4 + 19w*2/4 - w/4 - 19/4. (w - 1)(w + 1)(w + 19)/4 Find o, given that o3/4 + 103o*2/4 + 2703o/4 + 2601/4 = 0. -51, -1 Factor 15z3 - 470z*2 + 145z + 310. 5(z - 31)(z - 1)(3z + 2) Solve -4b2 + 20b + 1064 = 0. -14, 19 What is j in 52j5 - 21j*4 - 50j*3 + 21j*2 - 2j = 0? -1, 0, 2/13, 1/4, 1 Let -4c5/7 + 24c*4/7 - 24c*3/7 - 64c*2/7 + 60c/7 + 72/7 = 0. Calculate c. -1, 2, 3 Factor 2u5 - 12u*4 + 22u*3 - 12u*2. 2u*2(u - 3)(u - 2)(u - 1) Solve 4b3 - 104b*2 + 100b = 0 for b. 0, 1, 25 Factor 2t5 + 52t*4 + 386t*3 + 624t*2 + 288t. 2t(t + 1)*2(t + 12)*2 Factor -2l*2 - 7876l - 7753922. -2(l + 1969)2 What is h in h4 - 12h*3 + 39h*2 - 8h - 60 = 0? -1, 2, 5, 6 Factor -21u4/2 + 18u*3 - 9u*2/2 - 3u. -3u(u - 1)*2(7u + 2)/2 Suppose 5a*4/2 + 85a*3/2 + 75a*2/2 - 85a/2 - 40 = 0. Calculate a. -16, -1, 1 Suppose 2s4/5 - 6s*3/5 - 18s*2/5 - 2s = 0. What is s? -1, 0, 5 Factor -4z3 + 28z*2 - 40z. -4z(z - 5)(z - 2) Find u, given that -u4 + 6u*3 - 11u*2 + 6u = 0. 0, 1, 2, 3 Determine o, given that 2o5/15 - 28o*4/15 + 24o*3/5 - 68o*2/15 + 22o/15 = 0. 0, 1, 11 Factor -l*3 + 3l*2 + 4l. -l(l - 4)(l + 1) Find l, given that -4l3 - 76l*2 + 280l + 352 = 0. -22, -1, 4 Factor 3w3/2 + 127w*2 - 877w/2 + 132. (w - 3)(w + 88)(3w - 1)/2 Factor 25a*2 + 11490a - 4600. 5(a + 460)(5a - 2) Factor -4p*3/3 + 1700p*2 - 722500p + 307062500/3. -4(p - 425)3/3 Determine z so that -2z*3/13 + 200z*2/13 + 406z/13 + 204/13 = 0. -1, 102 Factor -5p5 - 40p*4 - 110p*3 - 140p*2 - 85p - 20. -5(p + 1)4(p + 4) Factor -4c2 - 712c - 1408. -4(c + 2)(c + 176) Factor -i*5 - 13i*4 - 11i*3 + 13i*2 + 12i. -i(i - 1)(i + 1)*2(i + 12) Determine m, given that 6m3/5 + 118m*2/5 - 644m/5 - 96 = 0. -24, -2/3, 5 Let 3h2 - 2484h = 0. What is h? 0, 828 Factor -m3/6 + m2/2 + 11m/3 - 4. -(m - 6)(m - 1)(m + 4)/6 Find k such that 2k*3/15 - 656k*2/5 + 215168k/5 - 70575104/15 = 0. 328 What is n in 3n3 - 885n*2 + 3504n - 3492 = 0? 2, 291 Solve 12a2 + 207a + 51 = 0 for a. -17, -1/4 Let -12b5/17 + 134b*4/17 - 486b*3/17 + 574b*2/17 + 66b/17 - 180/17 = 0. Calculate b. -1/2, 2/3, 3, 5 Factor 1058r3/3 + 6164r*2/3 - 1096r/3 + 16. 2(r + 6)(23r - 2)2/3 What is r in 2r*2 - 116r - 118 = 0? -1, 59 Factor -2k2 - 3174k - 3172. -2(k + 1)(k + 1586) Find w, given that -w*5 + 5w*3 - 4w = 0. -2, -1, 0, 1, 2 Suppose 5x2 - 6635x + 6630 = 0. Calculate x. 1, 1326 Solve 3p5/7 + 6p*4/7 - 24p*3/7 - 48p*2/7 + 48p/7 + 96/7 = 0 for p. -2, 2 Suppose 5c2 + 115c - 2100 = 0. What is c? -35, 12 Suppose -h*2/3 - 7246h/3 - 13126129/3 = 0. Calculate h. -3623 Factor -3s4 - 141s*3 - 405s*2 - 399s - 132. -3(s + 1)3(s + 44) Factor -z*3/4 - 463z2/4. -z2(z + 463)/4 Let -3h*3/4 - 1055h*2/4 + 1411h/4 - 353/4 = 0. Calculate h. -353, 1/3, 1 Find c such that 4c2 + 2984c - 8988 = 0. -749, 3 Suppose 5i3/2 - 395i*2/2 + 4180i - 10830 = 0. What is i? 3, 38 Determine c, given that 21c5 - 90c*4 - 186c*3 + 648c*2 - 483c + 90 = 0. -3, 2/7, 1, 5 Factor -3k4/7 + 540k*3/7 - 537k*2/7. -3k*2(k - 179)(k - 1)/7 Find i such that -5i*5/2 - 123i*4/2 - 197i*3 - 168i2 = 0. -21, -2, -8/5, 0 Let r3/6 + 20r2/3 + 200r/3 = 0. Calculate r. -20, 0 Determine h, given that 2h5/7 - 120h*4/7 + 2362h*3/7 - 17644h*2/7 + 5448h - 3248 = 0. 1, 2, 14, 29 Suppose -3n4/5 + 57n*3/5 + 714n*2/5 + 1176n/5 = 0. Calculate n. -7, -2, 0, 28 Suppose l*4/5 + 34l*3 + 501l*2/5 - 4l/5 - 668/5 = 0. Calculate l. -167, -2, 1 Let 2k4/3 + 10k*3/3 + 4k*2 = 0. Calculate k. -3, -2, 0 Factor -5184200x*4 - 367080x*3 + 6382x*2 + 456x - 8. -2(35x + 2)*2(46x - 1)2 Determine z, given that -z4 - 28z*3 + 3z*2 + 86z + 56 = 0. -28, -1, 2 Let -5v2 + 466v - 93 = 0. What is v? 1/5, 93 Solve -3y3/2 - 21491y*2/2 - 19242504y + 6415362 = 0 for y. -3582, 1/3 Factor -3y3/10 - 2y*2 - 31y/10 - 7/5. -(y + 1)*2(3y + 14)/10 Let o2/5 + 3o/5 - 2 = 0. What is o? -5, 2 Factor i5/3 - i4/3 - i*3 + 5i*2/3 - 2i/3. i(i - 1)3(i + 2)/3 Factor 147d4 - 525d*3 + 264d*2 - 36d. 3d(d - 3)(7d - 2)*2 What is d in -2d*4/5 - 502d*3/5 + 930d*2 - 1570d - 2600 = 0? -260, -1, 5 Factor -147p4/5 - 8652p*3/5 - 1467p*2 - 1566p/5. -3p(p + 58)(7p + 3)*2/5 What is p in -50p*4/9 - 4640p*3/9 - 36496p*2/3 - 85376p/9 - 16928/9 = 0? -46, -2/5 Determine k, given that -2k2/19 - 110k/19 + 12 = 0. -57, 2 Factor 5l5 - 15l*3 - 10l*2. 5l*2(l - 2)(l + 1)2 Factor -2x*3/7 + 38x/7 - 60/7. -2(x - 3)(x - 2)(x + 5)/7 Factor -4d*3 + 3772d*2 - 887360d - 891136. -4(d - 472)2(d + 1) Factor -2i3/15 - 134i*2/15. -2i*2(i + 67)/15 Suppose 18m5/11 - 6m*4/11 - 16m*3/11 + 8m*2/11 = 0. What is m? -1, 0, 2/3 Solve 5b*4 + 130b*3 - 285b*2 - 130b + 280 = 0 for b. -28, -1, 1, 2 Find f, given that -f*2/10 - 23f/10 - 21/5 = 0. -21, -2 Factor 2c3/7 - 50c*2/7 + 296c/7 - 408/7. 2(c - 17)(c - 6)(c - 2)/7 Factor -4s*3 + 24s*2 - 128. -4(s - 4)*2(s + 2) Find x such that -5x5/6 + 155x*4/2 + 2575x*3/2 + 39875x*2/6 + 11250x = 0. -5, 0, 108 Let 4m4/9 - 64m*3/3 + 1888m*2/9 + 3328m/3 + 10816/9 = 0. What is m? -2, 26 Factor -5g2 + 210g - 585. -5(g - 39)(g - 3) Factor 5j2 - 340j + 335. 5(j - 67)(j - 1) Suppose 2v4/23 - 1382v*3/23 + 236658v*2/23 + 719678v/23 + 481636/23 = 0. What is v? -2, -1, 347 Suppose -3y5/2 - 35y*4 + 62y*3 - 13y*2 - 25y/2 = 0. What is y? -25, -1/3, 0, 1 Factor -n*4/2 + 5n*3 + 26n*2 + 28n. -n(n - 14)(n + 2)2/2 Suppose -s3/2 + s*2 - s/2 = 0. What is s? 0, 1 Factor -5v*2 - 3215v. -5v(v + 643) Let -4f4 - 112f*3 + 148f*2 + 880f - 1392 = 0. What is f? -29, -3, 2 Factor -4i5 - 68i*4 - 384i*3 - 720i*2. -4i*2(i + 5)(i + 6)2 Suppose 2d*5/5 + 56d*4/5 + 396d*3/5 + 216d*2 + 1026d/5 = 0. Calculate d. -19, -3, 0 Factor 5p4 - 20p*3 - 25p*2. 5p*2(p - 5)(p + 1) Factor -2j*2 - 7782j. -2j(j + 3891) Factor -i*4/5 - 2i*3 + 23i*2/5 - 12i/5. -i(i - 1)2(i + 12)/5 Solve f*2/4 - 6f = 0. 0, 24 Solve -5f5 + 20f*4 - 15f*3 = 0. 0, 1, 3 Let 4m*2 + 8800m = 0. Calculate m. -2200, 0 Find v, given that 6v5 + 86v*4 - 624v*	{ "pile_set_name": "DM Mathematics" }
1 + 0)? 3, 13 Let m(u) = -794u + 10920. List the prime factors of m(-26). 2, 13, 607 Suppose -3l + j + 15 = 0, -4l - l + j + 23 = 0. Let k be (l - (-1 + -35))/(-1 - -2). Suppose -x + k = 1. What are the prime factors of x? 3, 13 Let d = -4932 + 7873. What are the prime factors of d? 17, 173 Let t be (-1 - 3) + 264 + 1 + 0. Suppose -1674 = -9y - t. List the prime factors of (-2)/(y/(-39) - -4). 2, 3, 13 What are the prime factors of (-9601)/((-2 - 2) + 704/192)? 3, 9601 Let x be (-60)/15 + 19. Suppose -xc + 67 = -38. Suppose -39 = -3w + c. What are the prime factors of w? 2, 5 List the prime factors of -11 + -10 + 101335/13. 2, 13, 23 Suppose -3z - 6 = -2k - 14, -3z = -4k - 10. Let q(c) = 461c*2 + 7c - 14. What are the prime factors of q(z)? 2, 461 Suppose -u + 5q + 26184 = 0, -4u + 5q + 63274 = -41327. List the prime factors of u. 3, 8713 Let h(w) = w2 - 10w + 19. Let z be h(9). What are the prime factors of z1505/30 + 6/(-9)? 3, 167 What are the prime factors of 76704-6(-4)/120? 2, 13, 59 Let t = 970 + 232. Suppose -35f - t = -37f. List the prime factors of f. 601 Suppose -3k - 243 = -258. Suppose 4w = -kj + 1074, -2j - j = 3w - 804. List the prime factors of w. 2, 7, 19 Suppose -2i = -i - 2. Suppose 141 = ib - 419. Let d = b + -189. List the prime factors of d. 7, 13 Let z = -844 + 11621. List the prime factors of z. 13, 829 Let j(m) = 16m*2 + 28m + 1434. What are the prime factors of j(-26)? 2, 7, 823 Let b(w) = 12w2 + 5w - w - 8w + 5w + 9. List the prime factors of b(-6). 3, 5, 29 What are the prime factors of (-4 - -88226)(-12 + (-25)/(-2))? 44111 Let x(i) be the third derivative of -65i*4/24 - 7i*3 + 46i*2. Let k be x(-4). Suppose -k = -s + 4h, 8h = 3h - 15. List the prime factors of s. 2, 103 Suppose b = -8 + 13. Suppose 4t - bl - 155 = -t, -4 = -4l. Let r = t - 2. List the prime factors of r. 2, 3, 5 Suppose -4s - 6182 + 498 = 0. Let r = -895 - s. List the prime factors of r. 2, 263 Let r(l) = 4l3 + 6l*2 - l - 9. Let t(h) = -3h*3 - 4h*2 + h + 6. Let a(g) = 5r(g) + 8t(g). List the prime factors of a(-3). 2, 3, 7 Let m = 1618 - 3198. Let t = -1039 - m. List the prime factors of t. 541 Let t(q) = 22q + 54q + 100q*2 + 11 + 31 - 100q. List the prime factors of t(2). 2, 197 Let q = -89 + 92. Suppose -60 = -y + qj, 4y - 3j - 179 = 34. List the prime factors of y. 3, 17 Suppose 8d - 66 = 6. Suppose -12v + dv = -2112. List the prime factors of v. 2, 11 Let d(l) = 6894l + 272. What are the prime factors of d(2)? 2, 5, 19, 37 List the prime factors of 1097 + 4 - (-2 - -17 - 7). 1093 List the prime factors of (23/(-7) - 0) + 3 + (-17991202)/(-238). 7, 10799 Let h(x) = -x3 - 27x*2 - 25x + 18. Let l be h(-26). List the prime factors of 42/l(1 + 455)/(-6). 3, 7, 19 Let d(j) = 1249j - 2. Let w be d(-1). Let l = w + 1764. Suppose -11y + l = -411. List the prime factors of y. 2, 3, 7 Let v(p) = -3p*3 + 7p*2 + 9p + 133. Let w = 789 + -796. List the prime factors of v(w). 2, 7, 103 Let n(c) = 1779c2 + 847c - 3. What are the prime factors of n(-4)? 25073 Suppose 8p = 10n - 5n - 5559, 3p - 5471 = -5n. List the prime factors of n. 7, 157 Let g = -51621 + 102873. List the prime factors of g. 2, 3, 4271 Let k(w) = -2w*2 + 5w*2 + 2w - 3w - 4. Let i = -760 - -756. List the prime factors of k(i). 2, 3 Let n(i) = 22822i - 1307. List the prime factors of n(3). 239, 281 Let b be (-480010)/92(-4)/10. Suppose -s + x + 517 - 105 = 0, 4x - b = -5s. What are the prime factors of s? 5, 83 Suppose 57l = 53l - 4n + 28880, 2n - 12 = 0. What are the prime factors of l? 2, 3607 Let x be (6/7)/((-12)/(-56)). Suppose -2i + 5d + 271 = -792, xd = -5i + 2674. List the prime factors of i. 2, 3, 89 Suppose -107723 = 100a - 111a. List the prime factors of a. 7, 1399 Let p = 151 - -1508. What are the prime factors of p? 3, 7, 79 Let d = 736 - 192. Suppose 0 = 6i - d - 308. List the prime factors of i. 2, 71 What are the prime factors of (44 + -398)32/(-6)? 2, 59 Let y be 8/44 - (-196)/11. Let f(r) = 2r - 26. Let w be f(y). Suppose 234 = -7l + wl. What are the prime factors of l? 2, 3, 13 Let p = 141 - 137. Suppose -4k + 3k - 3z = -316, 0 = -pk + 2z + 1236. What are the prime factors of k? 2, 5, 31 Let p = -737 - -551. Suppose 3l - 6l + 1479 = 0. Let n = p + l. List the prime factors of n. 307 Suppose o + 2h = 5h + 779, 3156 = 4o - 4h. Let g = o + -504. List the prime factors of g. 2, 5, 29 Suppose t = 7, -4y - t + 60982 = t. List the prime factors of y. 2, 7621 Suppose 23319 + 43043 = 19z - 109958. List the prime factors of z. 2, 5, 29 Suppose 0 = 14b + 24084 - 63256. Let h = b + -1377. List the prime factors of h. 7, 29 Let z = -99 + 104. Let a(l) = 3l2 - 7l - 19. Let h be a(z). Let v = 140 + h. List the prime factors of v. 7, 23 Let g(q) = -q*3 + 11q*2 + 3q + 35. Suppose 3o - 22 = -2r, -4r + 52 - 8 = 2o. Let i be g(r). Let f = -55 + i. List the prime factors of f. 13 Suppose 135d - 136d = 328. List the prime factors of 2706/d104/(-3). 2, 11, 13 List the prime factors of (-36 + -18747)-434/72. 2, 3, 2087 Suppose -254p + 252p + 520 = 0. Let y be 4/10 + (-2)/5. Suppose -p = -5d - n, -d - 2d - 4n + 156 = y. What are the prime factors of d? 2, 13 Let v be 46-3220/8. Let u = -356 - v. What are the prime factors of u? 2, 167 List the prime factors of (10 - 9)/(31/17511). 13, 449 Let t = 935 + 835. Suppose 11w - 8w - t = 0. List the prime factors of w. 2, 5, 59 Let v = -35760 - -55908. List the prime factors of v. 2, 3, 23, 73 Suppose -3l - 63 = -2f - 4l, -f - 3l = -39. Let s be f(0 + (4 - -1) + -4). List the prime factors of (56/8)/(1/s). 2, 3, 5, 7 Suppose 64 - 23 = s. Let o = 44 - s. Suppose -3h + 577 = op - p, 0 = 3p + 5h - 866. What are the prime factors of p? 7, 41 Suppose 10 = 2d + u - 2u, -3d + 2u = -15. List the prime factors of 654/4 + 3 - d. 3, 7 Suppose 7g + 7 + 105 = 0. What are the prime factors of (8/g)/(3/(-3036)2)? 11, 23 Suppose -3r = -4w + 50637, -2495w - 4r - 50632 = -2499w. List the prime factors of w. 3, 7, 67 Let k = 52 - 50. Let y(q) = -23q + 7. Let x be y(k). What are the prime factors of (-4 + x/(-9))30? 2, 5 Let t = -17690 + 19745. What are the prime factors of t? 3, 5, 137 Let t(o) = -o*2 + 16o - 14. Let r be t(15). Let z be ((-111)/15 - r)/((-2)/165). Suppose -z - 359 = -4l. What are the prime factors of l? 263 Suppose -35b - 10b + 416766 = -3b. What are the prime factors of b? 9923 Suppose 0 = 511m - 480m - 420174. List the prime factors of m. 2, 3, 251 Suppose 0 = 5r + 5w + 30, -4w - w = 4r + 28. What are the prime factors of -3 - (3921/(-6) - r/(-4))? 3, 7, 31 Suppose 5g - 7g = 2y - 2, -y - 2g = -2. Suppose y = k + 10k - 5148. What are the prime factors of k? 2, 3, 13 Let t(z) = 22z + 34z - 781 + 795 - 10z. What are the prime factors of t(9)? 2, 107 Let y(g) = -5g2 - g + 1. Let n(m) = -8m*2 - 15m + 4. Let b(x) = n(x) - 5y(x). What are the prime factors of b(5)? 2, 11, 17 Suppose -4h - 5l = -178693, 5l + 178763 = 65h - 61h. What are the prime factors of h? 2, 3, 11, 677 Let b(d) = 2d3 - 2d*2 + 2. Let i be b(2). Let v be (i/(-20) - 1/2) + 102. Let m = v + -76. What are the prime factors of m? 5 Suppose -500 = -11p - 9p. Suppose -24f + pf = 337. What are the prime factors of f? 337 Let a = 5262 + -1952. What are the prime factors of a? 2, 5, 331 Suppose 14024y - 14002y - 359458 = 0. List the prime factors of y. 16339 Suppose d - 6d = 30. Let m(p) = 2p - 14. Let q be m(6). List the prime factors of (261/d)/(q/4). 3, 29 Let h = -133 - -133. Suppose h = 33l - 28l - 2260. List the prime factors of l. 2, 113 Suppose m + 2a = 3104, 6m + 3122 = 7m - a. List the prime factors of m. 2, 19, 41 Let a(i) = 115i2 - 12 + 8i + 9i - 45i*2. What are the prime factors of a(4)? 2, 3, 7 Suppose 6903g - 6907g + 17136 = 0. List the prime factors of g. 2, 3, 7, 17 Suppose 20617 = -2w - 4z + 176297, -4w - 2z = -311414. What are the prime factors of w? 2, 11, 3539 Let f(d) = 6d*2 + 308d - 107. What are the prime factors of f(-127)? 13, 19, 233 Let c(w) = -w*3 - 41w*2 + 30w + 267. What are the prime factors of c(-45)? 3, 2339	{ "pile_set_name": "DM Mathematics" }
(c) n c Let p = -70 - -137/2. Suppose 15 = -5w, -w = -4t - 4w - 5. Let l be t/5 + 9/105. What is the nearest to 0.1 in 3, p, l? l Let a = 971 + -966. Suppose 4q = 15 + 17. Let x be (3/(-4))/((-2)/q). What is the closest to -3 in x, a, -1? -1 Let h = -4.3 - -3.3. Which is the nearest to 1? (a) 0.2 (b) h (c) 0 (d) -3 a Let t = -9290 + 65034/7. Let b be (-2)/(2 + -4) - 0. What is the closest to -1 in t, b, -4/5? -4/5 Let a be (4/(-30))/(4/(-6)). Suppose 0 = 93s - 442 - 23. What is the nearest to 0 in s, a, 1? a Let m be (27/63)/(9/(-6)). Let t = -12 + 8. Let q = -3.6 - t. Which is the closest to -2/9? (a) m (b) -2 (c) q a Let v = 0.4 + -1.6. Let g = 2.2 + v. Let t = 1.942 + 0.058. What is the nearest to g in 0.3, 4, t? 0.3 Let v be ((-20)/575)/(3/((-60)/8)). Let m(t) = -t3 - t + 4. Let y be m(0). Which is the closest to 2/5? (a) -1 (b) v (c) y b Let b = 1.225 + -1.725. Let a = 0.1 - -0.3. What is the closest to 0.1 in a, -0.1, b? -0.1 Let i = -7 - -4. Let g be (-2)/7 + 15/(-70). What is the closest to 1 in g, i, 3? g Let j = -76 + 108. Let g = -56 + j. Let h = g + 24. Which is the nearest to 0? (a) h (b) 0.1 (c) -2/9 a Let y be (-8)/915/260. Let j = y - -47/156. Which is the nearest to j? (a) 2/5 (b) -5 (c) -0.2 a Let l = -28 - -26. Let m = -0.3 + 2.3. Which is the closest to m? (a) -3 (b) 0.1 (c) l b Let u = 0.2 + 0.3. Let t = -21.1 - -10.8. Let j = 10 + t. Which is the nearest to 1? (a) 4 (b) j (c) u c Let w(x) = x*3 - 4x*2 - 3x + 13. Let k be w(4). Suppose 3b = f - 0 - 2, 5b - 3f = -2. What is the closest to k in b, -1/7, 1/9? 1/9 Let z = -80 + 5358/67. Let u = 104/1005 - z. Let j = 236 - 234. What is the closest to -0.1 in u, j, 5? u Let z = 5 - 0. Let y = 4.27 + -4.17. Let t = -4.55 + -0.45. Which is the nearest to t? (a) y (b) z (c) -1/8 c Suppose 7 = k + 8. Let d be k - 0 - (6 - 5). Let x = -2090/9 + 232. Which is the nearest to d? (a) -0.5 (b) x (c) -2 c Let t = -20143 + 20145. Let d = -2.5 + 2. What is the closest to -3.4 in 5, t, d? d Let z = -215 + 219. Which is the closest to -2/5? (a) -3 (b) -4 (c) z a Let f = 0.381 - 0.363. What is the closest to 4 in 2/5, f, -1/4? 2/5 Let a = -410 - -410. What is the closest to 0.03 in -2/3, a, 19? a Suppose 4g + 5p - 37 = 2p, -3g + 15 = -2p. Suppose 2s - m + g = 18, -4s - 5m - 13 = 0. What is the closest to 1/4 in s, -5, 6/11? 6/11 Let n = -191.1 + 191. Which is the nearest to -1? (a) n (b) -2 (c) 0.5 (d) -0.06 a Let p = 1704 - 1707. Which is the closest to p? (a) 1/5 (b) 3/8 (c) -1 c Let k be 11/((-132)/(-64)) + -8 + 2. Which is the closest to k? (a) 6 (b) 1 (c) 0.2 c Let i = 144 - 144. Let a = 0.1 + -0.2. Let m = -3 - -3. What is the closest to i in 3, a, m? m Let f be -3 + 120/28 + -1. Let y = 45.6 + -46.1. What is the nearest to f in 0, -24, y? 0 Let z = 8 + -25/3. Let u be (-74/(-98))/(18/7). Which is the nearest to 5/3? (a) 3 (b) z (c) u a Let v = 11 + -18. Let o be -39(-4 - v)/(-9). Which is the nearest to 1? (a) o (b) 2 (c) -0.2 b Let v = 7/11 + -2/55. Let o = 0 - 0. Which is the closest to o? (a) v (b) -3 (c) -0.5 c Let o = 0.4 + -0.8. Let x = -184 - -1658/9. Let v = -54 + 54.1. Which is the nearest to v? (a) x (b) o (c) -0.2 a Let x = 766 + -765. What is the nearest to x in 7, -1/6, 0.3, -4? 0.3 Let f be 3/(45/6) + (-42)/(-105). What is the closest to f in -2, -1, 0.1? 0.1 Let l = -69.5 - -68.7. What is the closest to 0 in -3, l, -1/4? -1/4 Let q be (1/2)/((-18)/60). Let j be ((-3)/7)/(33/22). What is the nearest to 0 in j, 4, q? j Let p = -2.55 + 0.05. Let o = p - 0.5. Suppose -388 = 2h - 392. Which is the closest to 0? (a) o (b) 0.2 (c) h b Let x = -10 - -10.1. Let r = -0.8 + 0.3. Let g = r + 0.6. Which is the closest to g? (a) x (b) 0 (c) -3/5 a Let i = 223 + -2005/9. Let x = -44 - -46. What is the nearest to i in 1/3, x, 1? 1/3 Let x = 46 - 55. Which is the nearest to -0.3? (a) 0.1 (b) x (c) -1 a Let g be (-5 - -79)2/4. Suppose -3c + 6c - 5z = g, 0 = 5c + 4z. Let r = -103/3 - -34. What is the closest to 0.1 in -0.2, r, c? -0.2 Suppose -2u = -3u. Let m = -1759 + 1761. What is the nearest to 0.1 in -2/9, u, m? u Let j = -1437 + 1423. What is the nearest to 0.1 in -0.1, -2, j? -0.1 Suppose 14 = -3k + 2. Let r(y) = y2 - 5y - 49. Let i be r(10). Let q be k/i - 25/(-6). Which is the nearest to -1/3? (a) q (b) -1/2 (c) 3 b Let i = 0.93 + -139.93. Let g = i - -138.9. Which is the nearest to -1? (a) -16 (b) g (c) 5 b Let d = -0.5611 - -0.0611. What is the closest to 1 in -0.2, 7/2, d? -0.2 Let t(p) = -10p + 2. Let k be t(-1). Suppose -13w = -kw. Suppose wj - 12 = 3j. Which is the closest to -0.5? (a) 2 (b) j (c) -1 c Let p be 1-2 + 2 - 1. Let d = 0 - p. Let v = -4363/6 - -727. Which is the nearest to d? (a) v (b) -2 (c) 3 a Suppose -43p + 5 = -16p - 22p. Let m = -2 - -2.3. Let z = -0.4 + m. Which is the nearest to p? (a) z (b) 4/3 (c) -0.2 b Let z = 10/19 + 8/57. Which is the nearest to -1? (a) z (b) 15/2 (c) -4 a Let r be (0 - -1) + -5 - 1. Suppose -n = -3n - 14. Let k be 6/(-4)n/(-42). What is the nearest to -2/3 in r, -4, k? k Let t = -136.6 + 134.6. Which is the closest to 0.33? (a) t (b) 3/5 (c) 4 (d) -3 b Let z = -1.154 - -0.654. Which is the nearest to -1/2? (a) z (b) -0.3 (c) 0 (d) -3 a Let k = -0.352 + 0.252. Which is the closest to -2/7? (a) k (b) 0.1 (c) -1 a Let u = -2.87 - -2.67. Let b be (0 - 0) + 0 + 2. What is the nearest to 1/4 in b, u, -3? u Let l be 2/(-90) + (-3)/15. Suppose -5k + 12k = 0. Let d be 1/(-3) + -3 + 3. Which is the nearest to -2/3? (a) l (b) k (c) d c Let j = -1.1 + 1.2. Suppose -4h - 15 = -7. Let f = -0.2 + 0. Which is the nearest to -1? (a) h (b) f (c) j b Let t = 35 - 141/4. Let i = 13.9 + -9.9. Which is the closest to -0.1? (a) -0.5 (b) i (c) t c Suppose -8 = -t - 2y, 2t + 3t = -4y + 10. Let c = 0.204 - -0.046. Let o = -0.45 + c. What is the nearest to -0.1 in -3, t, o? o Let u = 119.9 - 123.9. Which is the nearest to 5/3? (a) u (b) -0.3 (c) -0.1 (d) 0 d Let p = -28 + 21. Let t be 0 + (-5)/p(-8)/20. Let l = -4/49 + 134/441. Which is the nearest to l? (a) t (b) 5 (c) 1/10 c Let j be 2/(-5)(-10)/24. Let q = -12.4 - -15. Let v = 2.7 - q. What is the closest to v in 0.3, j, -4? j Let y = -2504 + 2504.5. Which is the closest to -0.1? (a) 5/4 (b) y (c) 1/6 c Let u = 0.9 - 1. Let i = 615 - 614. What is the nearest to u in -2/7, -4/7, i? -2/7 Let t(u) = u*3 + 2u*2 + 2u + 1. Let v be t(-2). Let p = -1/4670 + -9319/98070. Which is the closest to p? (a) 0 (b) v (c) -1/7 c Let w = -54.2 - -54. Let a = -2178 - -6719/3. Let r = 61 - a. What is the nearest to 0 in -5, r, w? w Let p = -0.1 - 0.1. Let m = -527/7 - -75. Let x = 28 + -28. What is the closest to p in m, 4, x? m Let m = -0.0041 + 0.1041. Which is the nearest to -4? (a) m (b) -0.01 (c) -4/3 c Let m be 63/42(-12)/(-45). Which is the closest to 0? (a) m (b) -0.1 (c) -5 b Suppose -3a - 7 = -g, -5g - 4a - 41 = -0a. What is the closest to 3/17 in g, -3, -1/4? -1/4 Let p = 7678 + -7678. Let d = 0.8 + 0.2. Which is the closest to p? (a) -5 (b) d (c) 0 c Let u = 38 + -265/7. Which is the closest to -1? (a) u (b) 4 (c) 0.034 c Suppose -10m = 21m + 155. What is the nearest to 0 in 2, m, -1? -1 Let w = 1/32 - -59/160. Let f = 2615 + -2611. Which is the nearest to -3? (a) 12 (b) f (c) w c Let b = -94 - -101. Suppose 3l = -6, -l = 6t - bt. What is the nearest to -1 in t, -5, -1? -1 Let k = -11.53 + 11.03. Which is the nearest to -2? (a) -0.4 (b) 2 (c) k (d) 1/2 c Let i = 30 + -43. What is the nearest to -1/2 in 2/9, i, -3? 2/9 Let v = -1.8 - 0.2. Let h = v + 1. Let y = 0.114 + 0.286. Which is the closest to h? (a) -4 (b) -3 (c) y c Let h = 404 + -404.1. What is the closest to h in 2/7, -1, -34? 2/7 Let t = -478 + 477. What is the closest to 2 in 0.3, -2/5, -1/7, t? 0.3 Let a be -19/(-60)-28 - -4. What is the closest to -1 in -0.17, 0, a? a Let h = 1.2289 - 0.0289. Which is the closest to h? (a) 3 (b) 0.2 (c) -0.2 b Let u = -249 - -248. Which is the nearest to u? (a) -2/9 (b) -24 (c) 0.5 a Let s = -53 - -90. Let m = s + -36.5. What is the nearest to 3 in -2/11, m, 0.1? m Let d = 39 - 38.9. Let f(s) = s + 5.	{ "pile_set_name": "DM Mathematics" }
j(-1)? 0 Let c(x) = -2x3 - 4x*2 - 2x. Let i be (-18)/(-15)(-30)/(-18). Let j = 5 + -2. Suppose -j = il + 1. Give c(l). 4 Let u be (-1 - -3)(-9)/6. Let p be (-4)/(-6)(0 - u). Let g(j) = 9j + 5. Let b(c) = 12c + 7. Let w(x) = -2b(x) + 3g(x). Calculate w(p). 7 Let c(f) = f - 7. Let v(x) = -9. Let d(w) = c(w) - v(w). Let u be 4/(-22) - 96/(-44). Calculate d(u). 4 Let s(f) = -2f3 + 4f*2 + 2f. Let g = -3 - 4. Let r(y) = -6y3 + 13y*2 + 6y. Let i(b) = gs(b) + 2r(b). Calculate i(2). 4 Suppose 5 = -h + 4z - z, -2z + 2 = -h. Let y(s) = hs - 6s - 3s - 1. Determine y(-1). 4 Let z(d) = d3 - 4d*2 + 2d + 1. Let o(v) = 23v2 + 3v - 3. Let t be o(1). Let c = t + -20. Determine z(c). -2 Let m(x) = -27x - 15. Let s(c) = -14c - 9. Let u(a) = 6m(a) - 11s(a). Calculate u(1). 1 Let o(q) = -q*3 - 6q*2 + q. Let d be o(-6). Let n(a) = -7a + 139a2 + 132a*2 - 272a*2 - 4. Let f be n(d). Let i(x) = 3x + 1. What is i(f)? 7 Suppose -3c + 4c = z + 6, -4c = 2z - 18. Let n(p) = 0p3 + 4p*3 + 0p*3. Give n(z). -4 Let j(y) be the first derivative of -4y*2 - 95y + 133. What is j(-12)? 1 Suppose -a = b + 40, 2a + 3a + 2b = -197. Let u = a + 35. Let l(j) = j. Determine l(u). -4 Let v(w) = w. Let n(q) = 9q + 17. Let a(d) = -n(d) + 8v(d). Determine a(-8). -9 Let x(d) = 3d - 5. Suppose 5v - 2p - 18 = 0, -5v = 3p + 3 - 1. Let i be (7/v)/(2/(-4)). Let b = i + 11. Calculate x(b). 7 Let q(z) be the second derivative of -7z3/6 + 3z*2 + 6z. Let r(y) be the second derivative of y*3/6 + 4y. Let o(f) = q(f) + 5r(f). What is o(4)? -2 Let o = 489 - 496. Let g(a) = a2 + 9a + 4. Calculate g(o). -10 Let l(r) be the first derivative of r*2/2 + r - 1. Suppose 4h + 30f - 16 = 26f, 0 = -5h + 2f + 27. Calculate l(h). 6 Let h(n) be the second derivative of -n*7/840 - 7n*6/360 + 7n5/120 - n4/8 + 11n3/6 + 2n. Let m(w) be the second derivative of h(w). Give m(-8). 5 Let y(f) be the third derivative of f5/40 + f4/12 - 11f3/6 + 13f*2. Let w(r) be the first derivative of y(r). Determine w(-6). -16 Suppose 2u + 240 = 6u. Suppose 2h + 2w = -2w, -5h + u = -5w. Let o(x) = h + 7 - 14 + 2x - 16x*3. Determine o(-1). 15 Let n(d) = 1 - 32d*2 + 16d*2 - 4d*2 + 19d*2. Calculate n(4). -15 Let w be (1 - -1)/((-10)/(-15)). Let u(z) = -z + 3. Let f(p) = 4p - 15. Let o(q) = -1. Let x(i) = -f(i) + 5o(i). Let l(j) = 7u(j) - 2x(j). Determine l(w). 4 Let j(m) = 6m + 2. Let n(f) = -11f - 4. Let s(b) = 5j(b) + 3n(b). Suppose 14 = -10u + 3u. Calculate s(u). 4 Let f(y) = -79y*3 + y + 4y*2 - 4016 + 78y3 + 4013. Let m(z) = z2 - 3z - 7. Let o be m(5). Suppose -n + on = 6. Determine f(n). 9 Let m(s) be the second derivative of -s*3/6 + 2s*2 + 80s. Give m(11). -7 Let d be 4 + (-11 - -10)/(-1). Let f(l) = l - 11. Determine f(d). -6 Let k(c) be the third derivative of c6/120 + c5/5 + 11c4/24 + 8c*3/3 - 43c*2 + 3. Determine k(-11). 16 Let i(m) = 11m*3 + 2m*2 - 4m + 8. Let p(x) = -9x3 - x2 + 4x - 6. Let d(b) = -5i(b) - 6p(b). Determine d(-3). -1 Let m be ((-154)/(-110))/((-6)/60). Let o(r) = -r + 12. Give o(m). 26 Suppose -6i + i = 0. Suppose i = 3k - 0k - 6. Let d(a) = 0 - 1 - k + a. Determine d(-3). -6 Let j be ((-220)/(-66))/(2/3). Let i(b) = -jb*2 + 0b*2 + 4b*2 - b + 2b2 - 2. Give i(4). 10 Let u(t) be the second derivative of t5/20 - t4/3 + t3/6 - 3t2/2 + 44t. Calculate u(4). 1 Let j(u) = -u - 1. Let y(w) be the first derivative of -3w2/2 - 9w + 5. Let b(z) = 2j(z) - y(z). Let a = -7 + 1. Calculate b(a). 1 Let q(o) be the third derivative of -o5/60 - 7o4/8 - o3/6 + 775o2. Give q(-21). -1 Let w(g) = -g2 + 2g + 3. Let f be w(-1). Let j be (-8 + 1)/(-5 - -4). Let l(d) = -d*3 + 0d - d*2 - j + 0d. Give l(f). -7 Let l(t) be the first derivative of -t*3/3 - 4t*2 + 2t + 170. Give l(-8). 2 Let m(n) = -n*2 - 5n + 2. Suppose i + 5q - 3 = -2i, -5 = -5i + 2q. Let v be (1 + 1/(-1))i. Suppose v = -2h + c - 9, -5h - 5c = -0h. Calculate m(h). 8 Suppose 4g - m + 14 = 0, -4g - 4m + 1 = 5. Let j(l) be the first derivative of -3l2/2 - 3l + 1. Let d(b) = b. Let t(w) = -4d(w) - j(w). Give t(g). 6 Let r(x) be the first derivative of 0 - x2 - 1 + 4x*2 - 5x2. Determine r(5). -20 Let v(x) = x3 + 3 + 18x - 24x + 2x2 + 8x. What is v(-2)? -1 Let o be 2((-4)/(-8) - -2). Suppose -oh + 12 = 22. Let c be (8/(-2) - -2)/h. Let i(s) = -12s3 + 1. Give i(c). -11 Let n(o) = 4o + 4 - 7o2 + 5 - 2 + o3. Let a = 238 + -232. Determine n(a). -5 Let d(h) = -3h + 3h - 2h - 2 + 4h - 3h. Give d(-3). 1 Suppose -5k + 17 = -13. Let d = -4 + k. Let g(u) = u2 + 2u - 3u2 + 0u*2 + 0u*2 - 2. Determine g(d). -6 Let k(n) be the first derivative of -9n*2/2 - n - 197. Calculate k(1). -10 Let o(f) = -2f + 19. Let k be o(10). Let p be 2 + (2 + k)(15 - 12). Let t(i) = -i2 + 6i - 5. Give t(p). 0 Let a(p) = -6p. Let w(t) = -5t + 1. Let y(g) = 6a(g) - 7w(g). Let c = -9 + 5. Give y(c). -3 Let f(g) = -2g2 + 9g + 4. Let h(q) = -5q2 + 18q + 7. Let z(t) = 7f(t) - 3h(t). What is z(-8)? -1 Let n(j) = 23j - 187. Let w be n(8). Let y(o) = -o2 - 4o - 1. What is y(w)? 2 Let a(x) = -13x - 5. Let d(i) be the second derivative of 11i*3/6 + 2i*2 - 22i. Let b(o) = 5a(o) + 6d(o). Let f = -11 - -6. Give b(f). -6 Let g(p) = 2p3 - 2p. Let q(i) = -i*3 + 14i*2 + 15i - 2. Let l be q(15). Calculate g(l). -12 Let d(h) = h*2 + 5h - 2. Let t(i) = -i*3 + 13i*2 - 13i + 7. Let v = 38 + -26. Let l be t(v). Give d(l). -2 Let l(d) = -20d + 5. Let x(c) = 11c - 4. Let y(i) = 6l(i) + 11x(i). Give y(14). 0 Let m = 2894 - 2901. Let j(r) = -2r2 - 12r + 6. Calculate j(m). -8 Suppose -2w + 10 = -2o + 2, 0 = 4o - w + 13. Let k(j) = j2 + 6j + 3. Calculate k(o). -6 Let k(v) = v*3 + 3v*2 - v + 1. Let l(i) = 3i*2 + 6i - 17. Let t be l(5). Let f = t - 90. Give k(f). 7 Let l(v) be the first derivative of v3/3 - v2 - 3v + 115. Give l(-2). 5 Let n(j) = -j2 - 8j - 8. Let g be (3 - (-93)/(-21))/(1/(-7)). Suppose -g = 3q - o + 11, -4q - 2o - 38 = 0. Determine n(q). -8 Let t be 3(-4)/6 + -3. Let o(i) = 5i - 34 - i3 + 7i*2 + 33 + 12i*3. Let b(c) = 7c*3 + 5c*2 + 3c - 1. Let m(l) = 8b(l) - 5o(l). Give m(t). 2 Let y(v) = -4v2 + v. Suppose -2 = 3l - 17. Suppose -o + 6 = l. Give y(o). -3 Let v(k) = -27k - 2. Let c(g) = -18g - 1. Let p(u) = 7c(u) - 5v(u). Suppose 9 = -13j - 17. Calculate p(j). -15 Let c(f) = -f3 - 19f*2 - f - 5. Suppose 0 = -11b + 17b + 114. What is c(b)? 14 Let r(b) be the second derivative of -b5/20 + 5b*4/6 - 3b*3/2 - 3b*2 - 3b - 22. Give r(9). -6 Let v = -125/9 - -277/18. Let f(l) be the first derivative of 2l + 0l*3 + vl*2 + 12 - 1/4l4. What is f(-2)? 4 Let y(b) be the second derivative of -b4/12 - 7b3/6 - 3b*2 + 306b. Calculate y(-5). 4 Suppose -40 = -9i - 4. Suppose -b - 8d + 6 = -id, -3d = -3b + 3. Let g(o) = 3o - 3. What is g(b)? 3 Let l(g) = 589g2 - 290g2 - g - 1 - g3 - 300g2. Let j be (-5 - -5)/(1/(-1)). Give l(j). -1 Let h(r) = 5r2 + 1. Let s = -29 - -20. Let w(j) = -j3 - 9j2 - j - 7. Let c be w(s). Suppose cp + 0p = -2. Calculate h(p). 6 Let i(k) be the first derivative of k4/4 + 5k*3/3 - 7k*2/2 - 8k - 1855. Suppose 4y = -23 - 1. Calculate i(y). -2 Let f = -8 + 10. Let d(x) = 3x. Let g be d(f). Let z(b) = -21b + 11b + 9b. Give z(g). -6 Let o(d) = d2 + 66d - 210. Let a be o(-69). Let y(k) = 7k - 6. What is y(a)? -27 Let t(q) = q3 - 18q*2 + 1. Let m be t(18). Let d(u) = -2 - 4u + 3u + 2 - m. Give d(-4). 3 Let c(o) = -5o*2 - 226o + 4o2 + 244o + 7. Determine c(19). -12 Let q(r) = 15r + 11. Let x(t) = -t - t - 5t + 3 - 8. Let j(n) = -6q(n) - 13x(n). Calculate j(-1). -2 Let x(g) = -g*2 - 90g - 89g + 180g. Suppose 3 = 5n + 2k - 2, 0 = -2n + 2k + 2. Give x(n). 0 Let i = -2 - 2. Let x(z) = 4z + 2. Let s be x(0). Let j(n) = 28 - 24 + 3n - 9 + n + ns. Give j(i). -5 Let h(m) be the second derivative of m5/60 - m*4/8 + 9m*3/2 - 11m. Let d(c) be the second derivative of h(c). Give d(5). 7 Let a(s) = 5s2 - s + 5. Let l(h) = 4h**2 + 4. Suppose -35 =	{ "pile_set_name": "DM Mathematics" }
418073? -4101680 What comes next: -1228, -4925, -14966, -34525, -66776, -114893? -182050 What is the next term in -152311, -152316, -152263, -152122, -151863? -151456 What is next in -319852875, -639705751, -959558627, -1279411503, -1599264379? -1919117255 What comes next: 5618, 8762, 17282, 33866, 61202, 101978? 158882 What comes next: 87444, 174670, 261890, 349104, 436312, 523514, 610710? 697900 What is next in -9741240, -9741243, -9741246, -9741249? -9741252 What is the next term in -165324, -164941, -164288, -163359, -162148? -160649 What is the next term in 69197, 276811, 622833, 1107263, 1730101, 2491347, 3391001? 4429063 What comes next: 7036, 27645, 62002, 110107, 171960, 247561? 336910 What comes next: 2616, 4656, 6696, 8736, 10776? 12816 What is next in -316295, -2530050, -8538817, -20240102, -39531411? -68310250 What is next in -64539796, -129079594, -193619392, -258159190, -322698988? -387238786 What is next in 287150, 574338, 861526, 1148714, 1435902, 1723090? 2010278 What comes next: -12082, -23458, -34834, -46210, -57586, -68962? -80338 What comes next: 7465, 29741, 66875, 118873, 185741, 267485, 364111? 475625 What comes next: 2669, 11167, 25333, 45173, 70693, 101899, 138797, 181393? 229693 What comes next: 10003, 20296, 30589, 40882, 51175, 61468? 71761 What is the next term in 1235626, 2471263, 3706900, 4942537, 6178174? 7413811 What is next in -5360, -10191, -15024, -19841, -24624, -29355, -34016? -38589 What is next in -9750, -9008, -8216, -7368, -6458, -5480, -4428, -3296? -2078 What comes next: 14219, 14120, 13953, 13718, 13415, 13044? 12605 What comes next: -4962, 4148, 19332, 40590, 67922, 101328, 140808? 186362 What is next in 7331, 12204, 20327, 31706, 46347, 64256, 85439? 109902 What is the next term in -5748, -5743, -5720, -5673, -5596? -5483 What comes next: -87, -487, -1203, -2235, -3583, -5247, -7227? -9523 What is next in 7686, 15004, 22308, 29604, 36898? 44196 What comes next: 492823, 1971085, 4434857, 7884145, 12318955, 17739293? 24145165 What comes next: -96, -249, -414, -603, -828, -1101, -1434, -1839? -2328 What is the next term in 184, 597, 1030, 1273, 1116, 349, -1238, -3855? -7712 What comes next: 892437, 892453, 892469? 892485 What is the next term in -203482, -406961, -610440, -813919? -1017398 What is next in 1285, 9175, 30593, 72301, 141061, 243635, 386785, 577273? 821861 What is the next term in 2322, 4547, 6970, 9591? 12410 What is next in -20194, -80828, -181884, -323362, -505262? -727584 What comes next: 1566955, 1566959, 1566961, 1566955, 1566935, 1566895, 1566829? 1566731 What is next in -2396671, -2396694, -2396717, -2396740, -2396763, -2396786? -2396809 What is the next term in 601509, 1203016, 1804523, 2406030? 3007537 What is next in -1114359, -1114364, -1114369, -1114374, -1114379, -1114384? -1114389 What is the next term in 93966, 187832, 281698, 375564, 469430? 563296 What is next in -731, -3527, -8163, -14621, -22883, -32931, -44747, -58313? -73611 What is the next term in 7496307, 14992615, 22488923? 29985231 What comes next: 2055319, 8221278, 18497875, 32885110, 51382983, 73991494? 100710643 What is next in 17740, 71785, 162158, 288859, 451888? 651245 What is next in -855, -3749, -8637, -15519, -24395, -35265? -48129 What is the next term in 22350, 21276, 20200, 19122? 18042 What is next in -30, 318, 1544, 4176, 8742? 15770 What is next in -108136, -108106, -108060, -107992, -107896, -107766, -107596, -107380? -107112 What is the next term in -56244, -225033, -506342, -900171, -1406520, -2025389? -2756778 What comes next: 38, 3020, 7998, 14978, 23966, 34968, 47990? 63038 What is the next term in 44535, 356369, 1202825, 2851221, 5568875, 9623105, 15281229, 22810565? 32478431 What comes next: -747938, -1495869, -2243822, -2991809, -3739842, -4487933, -5236094? -5984337 What is next in 6323, 6123, 5789, 5321? 4719 What is next in -3709, -7456, -11205, -14956, -18709? -22464 What is the next term in -157, -219, -259, -265, -225, -127, 41, 291? 635 What is next in 2490233, 2490243, 2490253, 2490263, 2490273, 2490283? 2490293 What is next in -8515, -8922, -9331, -9742, -10155, -10570? -10987 What comes next: -19012, -18973, -18920, -18847, -18748, -18617? -18448 What comes next: 56010165, 56010167, 56010169, 56010171? 56010173 What is next in 14362442, 28724882, 43087322? 57449762 What is next in -4731, -18534, -41521, -73692, -115047, -165586, -225309? -294216 What is next in -267404, -268455, -269506, -270557? -271608 What is next in 1572, 6007, 13292, 23427, 36412, 52247, 70932? 92467 What is next in 25217985, 50435964, 75653943, 100871922, 126089901? 151307880 What comes next: 1111, 1637, 2163, 2689? 3215 What is the next term in -14647, -14855, -15201, -15685, -16307? -17067 What is the next term in -8905189, -17810378, -26715567? -35620756 What comes next: -5915, -5928, -5929, -5918, -5895? -5860 What comes next: -236951, -473917, -710885, -947861, -1184851, -1421861, -1658897, -1895965? -2133071 What is the next term in -300, -539, -378, 639, 2968? 7065 What is next in -451931, -1807072, -4065641, -7227638, -11293063, -16261916, -22134197? -28909906 What comes next: 243933, 487866, 731809, 975768, 1219749, 1463758? 1707801 What comes next: -3132415, -6264832, -9397249, -12529666, -15662083, -18794500? -21926917 What is the next term in 259, 1299, 3579, 7549, 13659? 22359 What comes next: 160296680, 160296677, 160296674, 160296671? 160296668 What is the next term in -8153, -6317, -4481, -2645, -809? 1027 What comes next: 5162472, 10324955, 15487450, 20649963, 25812500, 30975067? 36137670 What is next in -219789, -439522, -659255? -878988 What is the next term in -6119, -12161, -18203? -24245 What is next in -960430, -1920867, -2881304, -3841741? -4802178 What is the next term in 170471, 340937, 511403, 681869, 852335? 1022801 What is next in 98937, 98954, 98977, 99006, 99041, 99082, 99129? 99182 What comes next: -10058, -10141, -10222, -10301, -10378, -10453? -10526 What is next in 10077, 10320, 10557, 10788, 11013? 11232 What comes next: -394, -3546, -6698, -9850? -13002 What is the next term in 289886, 579789, 869708, 1159643, 1449594, 1739561, 2029544? 2319543 What is next in -43829, -43792, -43729, -43628, -43477, -43264? -42977 What is next in 377, 293, 55, -415, -1195, -2363, -3997, -6175? -8975 What comes next: 518095, 517949, 517703, 517357, 516911, 516365? 515719 What is next in 46395598, 92791196, 139186794, 185582392, 231977990, 278373588? 324769186 What is the next term in 5850, 5219, 4588? 3957 What is next in 11307, 19725, 28155, 36603, 45075, 53577, 62115, 70695? 79323 What is next in 60869, 121838, 182807, 243776, 304745? 365714 What is next in -2029, -1865, -1591, -1207, -713, -109, 605? 1429 What is next in 34241506, 68483016, 102724528, 136966042, 171207558, 205449076, 239690596? 273932118 What is the next term in -432, -1046, -1682, -2352, -3068, -3842? -4686 What comes next: -1218, -5026, -11572, -21012, -33502? -49198 What is the next term in 16847229, 33694461, 50541693, 67388925, 84236157? 101083389 What is next in 52251, 104594, 157057, 209640, 262343, 315166, 368109? 421172 What is next in 71992, 73594, 75210, 76846, 78508? 80202 What is next in -172717, -172671, -172629, -172591? -172557 What is next in -28617, -28977, -29343, -29721, -30117, -30537, -30987, -31473? -32001 What is next in -99, -300, -707, -1416, -2523, -4124, -6315? -9192 What is next in -5913165, -5913166, -5913167, -5913168, -5913169, -5913170? -5913171 What comes next: -100607, -406308, -915809, -1629110? -2546211 What is next in -1150, -4004, -6860, -9706, -12530, -15320, -18064, -20750? -23366 What is the next term in 8706, 14264, 19822, 25380, 30938? 36496 What comes next: -63158, -69855, -76552, -83249? -89946 What comes next: 454, 515, 692, 1045, 1634, 2519? 3760 What is the next term in -3169, -3296, -3515, -3826, -4229? -4724 What comes next: 1237, 441, -871, -2687, -4995? -7783 What is next in 19740, -11065, -41880, -72711, -103564, -134445, -165360, -196315? -227316 What is the next term in 7187167, 14374367, 21561567, 28748767? 35935967 What is next in -59992, -120918, -181844, -242770, -303696, -364622? -425548 What is the next term in 14991, 15514, 16037? 16560 What comes	{ "pile_set_name": "DM Mathematics" }
*4 + 2 + 2t*3 - 3/2t*2 - jt = 0. -1, 1, 2 Let l(m) = 32m3 + 1176m*2 - 1495m + 389. Let z(h) = 4h3 + 147h*2 - 187h + 48. Let n(a) = 6l(a) - 51z(a). Let n(g) = 0. What is g? -38, 1/4, 1 Suppose 16/5t - 2/5t*2 - 32/5 = 0. What is t? 4 Let c = 1927 - 1924. Let -3/2h*2 - 3/8h - 7/8hc + 1/4 = 0. What is h? -1, 2/7 Let w be (-9)/(-6)28/2. Let b be 6/(-80)2-54. Factor -wk*4 + 7k*4 + 2k*4 + 10k*4 + 4k*b. -2k*3(k - 2) Let y(c) be the first derivative of c5/50 + c4/15 + c*3/15 + 10c - 43. Let a(t) be the first derivative of y(t). Find n such that a(n) = 0. -1, 0 Let p(w) be the second derivative of w8/840 - w7/420 - w6/60 + w5/60 + w*4/6 + 5w*3/3 + 10w. Let j(q) be the second derivative of p(q). Factor j(v). 2(v - 2)(v - 1)(v + 1)2 Factor -2/7i*2 + 2/7i*4 - 2/7i + 2/7i3 + 0. 2i(i - 1)(i + 1)2/7 Let z(s) be the second derivative of s6/15 + 4s5/5 - 8s*4 - 256s*3/3 + 1024s*2 - 18s - 2. Factor z(c). 2(c - 4)2(c + 8)*2 Let n = -204 + 204. Let m(q) be the first derivative of 0q*2 + 2/25q*5 + 5 + nq*4 + 2/5q - 4/15q3. Find h, given that m(h) = 0. -1, 1 Let o(i) = -13i*3 + 16i*2 - 4i + 4. Let u(t) = -69t3 + 81t*2 - 21t + 21. Let n(l) = 21o(l) - 4u(l). Determine d, given that n(d) = 0. -4, 0 Factor -3p2 + 69993p + 5292 - 12p3 - 1002p*2 - 90909p. -3(p + 42)2(4p - 1) Let d = 65 - 63. Factor -20z - 4z3 - 5 + 2z*2 - 20z*d - 1. -2(z + 1)(z + 3)(2z + 1) Let i be (-6)/(-9)(-9 + 132/14). What is q in 10/7q2 - 8/7q - i = 0? -1/5, 1 Let x be 4/18 + 4/(-18). Suppose -2l + 7 = 2h - 9, x = 4h + 5l - 37. Factor 6w3 - 5w*3 - 2w*3 + 6w - w*h + 4w*2. -2w(w - 3)(w + 1) Let d(i) = 6i3 - 2i - 654 + 2i3 + 654. Let n(b) = -17b3 + b2 + 5b. Let c(v) = 13d(v) + 6n(v). Let c(u) = 0. What is u? -2, -1, 0 Suppose -2v - 16 = -4i, 3v = -3i - 5 + 17. Suppose vs = -6s + 12. Suppose 3/2a*3 - 1 + 1/2a*4 - 3/2a + 1/2as = 0. Calculate a. -2, -1, 1 Suppose -5i - 4d + 7d = 45, -2d - 34 = 2i. Let w be (-8)/(-12) + i/126. Factor wf3 - 4/7f*2 + 4/7f*4 - 4/7f + 0. 4f(f - 1)(f + 1)2/7 Let t(w) be the first derivative of -25w*2 - 7 - 5/3w*3 - 125w. Factor t(f). -5(f + 5)2 Let m(a) be the first derivative of a7/42 - 27a*2/2 + 8. Let y(v) be the second derivative of m(v). Factor y(p). 5p4 Let w(h) be the first derivative of 8 - h5 + 0h4 + 5/3h*3 + 0h + 0h2. Suppose w(b) = 0. Calculate b. -1, 0, 1 Let n be 24/((-6)/(-3 - 0)). Let -3j*2 + 7j*2 + 2j*2 - nj - 2j2 - 16 = 0. What is j? -1, 4 Suppose 1024/3 - 20k*2 + 128k + 2/3k3 = 0. What is k? -2, 16 Let n(w) be the second derivative of -w5/120 - w4/12 + 5w*3/12 + 5w*2 - 14w. Let g(m) be the first derivative of n(m). Factor g(f). -(f - 1)(f + 5)/2 Let m(o) = 5o3 - o2 + o - 1. Let d(q) = -q*2 - 7q - 5. Let y be d(-6). Let n be m(y). Factor 4b + 4b*3 - 5b*3 + 2b*2 - b - nb. -b(b - 1)2 Let q = 22 + 33. Solve -15t*4 - 10t + 17t4 + 0t + qt2 + 33t*4 - 80t*3 = 0 for t. 0, 2/7, 1 Suppose -11u - 21 + 43 = 0. Factor j - 1/2 - 1/2ju. -(j - 1)2/2 Let t(d) be the first derivative of 0d*2 - 24 + 0d + 2/25d5 + 0d*3 + 1/5d*6 - 1/5d*4. Factor t(a). 2a*3(a + 1)(3a - 2)/5 Determine h, given that -7h2 - 30h - 18 + 21h2 - 2h*3 + 5h*2 - 33h*2 = 0. -3, -1 Let z(n) be the third derivative of 1/220n*6 - 1/165n*5 + 0n*4 + 0 + 7n*2 + 0n*3 + n + 1/231n*7. Suppose z(g) = 0. Calculate g. -1, 0, 2/5 Let g = 5/439 - -2165/2634. Factor -1 + 2m*2 - 11/6m + gm3. (m - 1)(m + 3)(5m + 2)/6 Let v(o) be the third derivative of -2o7/105 - o6/6 - 2o*5/5 + 2o*4/3 + 16o*3/3 + 303o*2. Find q such that v(q) = 0. -2, 1 Let u be (-9234)/648 + 18/1. Factor -7/4m*4 + 0 + um*3 - 9/4m*2 + 0m + 1/4m5. m2(m - 3)*2(m - 1)/4 Let d = 22 + -12. Let j be (-28)/(-8) - 12/(-8). Factor -jo2 + 22 + 25 - do - 52. -5(o + 1)2 Let m(g) be the first derivative of -g8/840 + g6/180 + 8g*3 + 48. Let u(z) be the third derivative of m(z). Let u(c) = 0. What is c? -1, 0, 1 Let u(x) = -2x*3 - 1. Let q(y) = 5y*3 + 75y*2 + 5y - 70. Let m(z) = -q(z) - 5u(z). Factor m(w). 5(w - 15)(w - 1)(w + 1) Let 162/5f3 + 258/5f*2 - 3/5f*5 + 9 + 177/5f + 33/5f4 = 0. Calculate f. -1, 15 Let s(b) be the second derivative of 2b*7/21 + 2b*6/15 - 3b*5/5 - 5b*4/3 - 4b*3/3 + 3b + 2. Factor s(m). 4m(m - 2)(m + 1)3 Let 19c + 21/2c2 + 0 + 1/2c*3 = 0. Calculate c. -19, -2, 0 Let b(k) be the third derivative of 3k*2 + 0k*3 - 1/105k*7 - 1/504k*8 - 1/90k*6 + 0k*4 + 0 + 0k + 0k5. Factor b(o). -2o*3(o + 1)(o + 2)/3 Let z(f) be the third derivative of f7/735 + f6/420 - f2 - 3f. Suppose z(b) = 0. Calculate b. -1, 0 Suppose 0 = -3r - 2r - r. Let n be ((-18)/8 - (-2 - r))-2. Factor 0g - 1/2g2 + n. -(g - 1)(g + 1)/2 Let u(b) be the first derivative of 16 - 1/15b2 + 0b*3 + 0b + 1/30b4. Factor u(n). 2n(n - 1)(n + 1)/15 Let n = 1/4 + -1/5. Let i(j) be the first derivative of 0j + 5 + 2/5j*2 + nj*4 + 4/15j*3. Let i(h) = 0. Calculate h. -2, 0 Let u(t) be the first derivative of 0t - 1/2t4 + 8/3t*3 - 15 - 4t*2. Factor u(k). -2k(k - 2)2 Solve 48/7f*4 - 3f*5 + 12/7f + 9/7f3 - 48/7f2 + 0 = 0. -1, 0, 2/7, 1, 2 Let g(x) be the first derivative of x5/120 - x*3/36 - 12x + 18. Let i(p) be the first derivative of g(p). Determine r so that i(r) = 0. -1, 0, 1 Let h(a) be the first derivative of -2/45a3 + 1/30a*4 - 1/45a*6 + 0a + 2/75a5 + 8 + 0a2. Find m, given that h(m) = 0. -1, 0, 1 Let r(t) = t3 - 18t2 + 3. Let i be r(18). Factor 9q*3 - 20q*3 + 6q*i. -5q*3 Let i(l) be the first derivative of 14/9l*2 - 4/3l - 3 + 1/9l4 - 20/27l*3. Let i(c) = 0. What is c? 1, 3 Suppose -3c - 5d = -32, 0 = 3c - 2d + 2 - 6. Factor -679 + 679 - 16f + cf3. 4f(f - 2)(f + 2) Let p(b) be the third derivative of -1/90b6 - 1/1008b*8 + 1/126b*7 + 0b*4 + 0b*3 + 0b*5 + 0 + 0b + 18b2. Factor p(c). -c3(c - 4)(c - 1)/3 Let n(p) be the first derivative of -p6/12 - p5/10 + p4/4 + p3/3 - p2/4 - p/2 + 73. Solve n(s) = 0. -1, 1 Suppose -20p + 188 - 148 = 0. Factor -56/3c + 4 - 20/3c*p. -4(c + 3)(5c - 1)/3 Let o(p) be the third derivative of -p*6/30 + 38p*5/15 - 45p*2. Find v, given that o(v) = 0. 0, 38 Factor 1/9d*2 - 5/9d - 2/3. (d - 6)(d + 1)/9 Suppose -168p*2 - 6p*3 + 19p*4 + 50p*3 + 2p*5 + 98p + 5p4 = 0. What is p? -7, 0, 1 Suppose 103l = 158l - 220. Factor -4/9j + 2/9j2 - 2/9j*l + 4/9j*3 + 0. -2j(j - 2)(j - 1)(j + 1)/9 Suppose o - 61 = 2o. Let k = -43 - o. Let -r + 5r - kr*3 + 2r + 3 + 12r - 3r2 = 0. Calculate r. -1, -1/6, 1 Let a(v) be the third derivative of v6/1140 - v*5/190 - 3v*4/38 - 5v*2 - v. Factor a(g). 2g(g - 6)(g + 3)/19 Let n = -138 + 140. What is b in 299 + 2bn - 15b - 57 + 59b = 0? -11 Let i be (-2)/((-20)/(-6)) - (-8)/(-20). Let r be 4(-11)/(-20) - i/(-5). Factor 6/7f + 3/7f*r + 3/7. 3(f + 1)*2/7 Let v(i) be the first derivative of 4/9i*3 - 28/3i*2 + 12 + 196/3i. Determine k so that v(k) = 0. 7 Let x(b) be the second derivative of -b*6/320 + 11b*5/160 - 35b*4/64 + 25b*3/16 - 5b*2/2 - b. Let j(n) be the first derivative of x(n). Factor j(c). -3(c - 5)*2(c - 1)/8 Let b = 4/5263 - -5247/21052. Let -bq + 1 + 1/4q3 - q2 = 0. What is q? -1, 1, 4 Factor -20/9o - 1/9o*2 - 17/3. -(o + 3)(o + 17)/9 Factor 0 - c*2 - 1/2c*3 + 3/2c. -c(c - 1)(c + 3)/2 Solve 265t4 - 1070 - 40t4 - t4 - 13208t2 + 17520t - 6130 + 2t5 + 2t*5 + 2660t3 = 0 for t. -30, 1, 2 Let u(i) = i2 + i. Let a(q) = -4q2 + 2q - 4. Let f(j) = 1 + j - 2j + j - j. Let b(h) = -a(h) - 4f(h). Let d(w) = 3b(w) - 10u(w). Factor d(r). 2r(r - 2) Let k = -14 + 14. Let h(w) be the first derivative of 3 - 2/3w3 + kw + 0w2. Factor h(p). -2p2 Let g(j) be the second derivative of j7/210 + j6/60 - j5/60 - j*4/12 - 5j*2 - 10j. Let t(r) be the first derivative of g(r). Factor t(s). s(s - 1)(s + 1)*(s + 2) Let v be ((-8)/(	{ "pile_set_name": "DM Mathematics" }
at is the nearest to 3 in 0.1, -2, -0.02, 1/4? 1/4 What is the nearest to -0.1 in 1/10, -1/10, 0.3, 53? -1/10 What is the closest to -0.2 in 0.5, 0.9, 5, 19? 0.5 Which is the nearest to -2? (a) -2/13 (b) 856 (c) 1/7 a Which is the closest to -33? (a) -2/25 (b) 2 (c) 5 a Which is the closest to -4/11? (a) 0.2 (b) -3 (c) -2/7 (d) 1 c Which is the closest to 0? (a) -19 (b) -2/13 (c) -0.1 (d) 1 c Which is the closest to -65? (a) -3 (b) 1/51 (c) -1/10 (d) 1/2 a Which is the nearest to -21? (a) -0.19 (b) 5 (c) -1/5 (d) 2 c What is the closest to 1/5 in -1/2, 107, -3? -1/2 Which is the nearest to -2? (a) 0.04 (b) -14 (c) 3 a Which is the closest to -1.97? (a) -0.4 (b) -1/4 (c) 0.5 a What is the closest to -7 in -0.9, 1, -1/6, -0.1? -0.9 What is the closest to 2 in 1/5, 2, -0.4? 2 What is the closest to -2/7 in 0.9, 0, 609? 0 Which is the nearest to 2? (a) 0.12 (b) -0.3 (c) -4 (d) -3 a Which is the closest to -2/5? (a) 1 (b) -4 (c) -29 (d) -0.5 d Which is the closest to -1/4? (a) 1/5 (b) -0.5 (c) -0.2 (d) -96 c What is the closest to 1 in 2, 0.13, 0.3, 6? 0.3 What is the nearest to -1 in 5, -2/13, 1/9? -2/13 What is the closest to 2 in -24, 0.3, -5? 0.3 What is the closest to -70 in 0.05, -2/9, 3, 2/13? -2/9 Which is the closest to 0.1? (a) -3/5 (b) 2/11 (c) -0.4 (d) -1/6 b What is the nearest to 11 in -2, 0.3, -0.2, -5? 0.3 Which is the nearest to 0.1? (a) -2/3 (b) 2/21 (c) -24/11 b What is the nearest to -0.2 in 3/43, 1/4, 2/11, 7? 3/43 What is the nearest to 1 in -4, -1/13, -5, -6? -1/13 What is the nearest to 10 in 7, 2, -0.019? 7 What is the closest to 0.06 in 1, -0.2, 3, 1/18? 1/18 What is the closest to 2/31 in -1, 1/10, -4, -0.2? 1/10 What is the closest to -1 in -0.1, -14/11, -0.5? -14/11 What is the nearest to 2/5 in 3/8, -4/27, -2/7? 3/8 What is the nearest to -8 in 5, 2, -0.2, 0.22? -0.2 Which is the nearest to -2.8? (a) -0.4 (b) -3 (c) 18 b What is the closest to 0.11 in -0.3, 5, -5.8, -1/4? -1/4 What is the nearest to 2 in -1/203, -4, 2, 0? 2 Which is the nearest to 1? (a) -22 (b) -3 (c) -1 c Which is the nearest to 1/4? (a) 21 (b) -2 (c) 3 (d) 0 d Which is the nearest to 0? (a) -2/5 (b) -11 (c) 0.1 (d) 17 c Which is the closest to -2/3? (a) -4/7 (b) 5 (c) 45 (d) 7 a What is the nearest to -0.1 in 0.2, 4/13, 8? 0.2 What is the nearest to -1 in 4/17, -3, -4? 4/17 What is the closest to -0.1 in 4, -0.1, -2, -122? -0.1 What is the nearest to -2/11 in -7, 0, -3? 0 What is the closest to 1/3 in -5, 0.2, 2? 0.2 What is the nearest to 0 in -0.5, -4, -6, -1/4? -1/4 Which is the nearest to 3/2? (a) 0.2 (b) -15 (c) -0.5 a Which is the nearest to 1? (a) 42/13 (b) -2/5 (c) 1/3 c What is the closest to 8/9 in -0.1, -3, 4? -0.1 Which is the nearest to 0.081? (a) -0.06 (b) 4 (c) 2 a Which is the nearest to 2/7? (a) -36 (b) 0.2 (c) 3 (d) -2/19 b Which is the closest to 15? (a) 1/7 (b) 1.3 (c) 8 (d) 3/8 c Which is the nearest to 1/2? (a) 5 (b) 0.037 (c) -8 b What is the closest to -0.1 in -1/4, -2, 58, 2/5? -1/4 What is the nearest to -1.12 in -2/11, 1/6, 2, -0.1? -2/11 What is the closest to 0 in 3/2, -1/8, -5? -1/8 What is the closest to -1 in -0.5, -5/3, 0? -0.5 Which is the nearest to 0.1? (a) -0.7 (b) 1 (c) -4.4 a Which is the closest to 2? (a) 0.4 (b) -2/13 (c) -8 a Which is the nearest to -88? (a) -8 (b) -4 (c) 5/4 (d) -0.2 a What is the nearest to 9/4 in -5, 74, 1/2? 1/2 What is the closest to -0.2 in -5, -0.4, -639, 4? -0.4 What is the nearest to 1/2 in -1, -4, 3/2, -0.3? -0.3 What is the nearest to -3 in -2/7, -2, -0.32, -3/11? -2 What is the nearest to -17 in -0.1, 2/5, 3/5, 2/37? -0.1 Which is the nearest to -2/7? (a) 0.3 (b) 8 (c) 1 (d) 0 d What is the closest to 0 in -1/9, -4, -0.3, -3/5? -1/9 What is the closest to 0.3 in -2.2, 0.08, 5? 0.08 What is the closest to 8 in 58, -1, -4, -2? -1 Which is the closest to 9? (a) -2 (b) 0.4 (c) 3/7 (d) 3 d What is the nearest to -1 in 0.8, 229, -4? 0.8 Which is the nearest to -0.4? (a) 0.5 (b) -5 (c) -0.5 c What is the nearest to 22 in -2/5, 0.2, 2, -0.3? 2 Which is the nearest to 0.1? (a) 1 (b) -8 (c) -4 (d) 4/5 d What is the closest to -2/5 in -4, 0.09, -0.14, -0.4? -0.4 Which is the nearest to -4? (a) -4/3 (b) -2.2 (c) -0.1 b What is the closest to -0.2 in 0.1, -3, -43.2? 0.1 What is the nearest to 0.3 in -4, 4, 2/11? 2/11 What is the closest to 3 in 54, -5, -0.2, 3? 3 Which is the closest to -32? (a) 0.4 (b) -3 (c) 2 b Which is the nearest to 0? (a) 3/4 (b) 15 (c) -5 a What is the nearest to 1 in -1, -2, 0.2, 40? 0.2 Which is the closest to -0.1? (a) -4 (b) -1 (c) 3 (d) 2/9 d Which is the nearest to 1.1? (a) 0 (b) -0.5 (c) 5 (d) -4 a Which is the nearest to -0.1? (a) -5 (b) -4 (c) -1/6 c Which is the closest to -5? (a) 0 (b) -3 (c) 0.5 b What is the nearest to 0 in -0.2, 0, -2/7, -3? 0 What is the nearest to -18 in -0.3, 0.64, 1/9? -0.3 What is the nearest to -15 in 1/6, -2, 0.09, 0.3? -2 Which is the closest to -52/9? (a) 5 (b) 0.3 (c) 6 b What is the nearest to -1/3 in -2/15, 1/2, -2/5, -1? -2/5 Which is the nearest to 3? (a) 4 (b) 5 (c) 7 a Which is the nearest to -5? (a) -0.4 (b) -2/15 (c) 4/7 (d) -2/13 a Which is the closest to -0.3? (a) 2/21 (b) -0.1 (c) -19 b What is the nearest to -13 in -0.2, 2/9, -3? -3 Which is the nearest to 2/7? (a) -11 (b) 3 (c) 4 (d) 2/11 d Which is the closest to 1/3? (a) -53 (b) -4.6 (c) -0.4 (d) 1/3 d Which is the nearest to 1/3? (a) -3 (b) -11 (c) 1 (d) 0.2 d Which is the closest to 0? (a) 2 (b) 4 (c) -3 (d) 1/5 d Which is the closest to -2/3? (a) 2/13 (b) -3/2 (c) 2/9 a Which is the nearest to 1/4? (a) 2/377 (b) 3 (c) -0.4 a What is the nearest to 1 in 0.2, -4, -6? 0.2 What is the nearest to 6236 in 4, 5, -1? 5 Which is the nearest to -1? (a) 236.3 (b) -2/23 (c) 3 b Which is the closest to 2/7? (a) 1 (b) 3 (c) -3/2 (d) 0 d What is the closest to -1/11 in -2/9, -0.12, 34? -0.12 What is the closest to -34/5 in 3, 1, -1/4? -1/4 Which is the closest to -5? (a) 1/4 (b) 5 (c) 118 a Which is the nearest to 21? (a) -5 (b) -3 (c) 0.05 (d) -2/15 c What is the nearest to -29/2 in 2/15, -1/11, -1/2, 5? -1/2 Which is the nearest to -0.1? (a) -6 (b) 0.2 (c) 2/15 (d) 5/2 c What is the nearest to 0.045 in 1/6, -0.1, 1/9, 1? 1/9 Which is the closest to 3? (a) 0.3 (b) 4 (c) 0.5 (d) -17/2 b What is the nearest to -0.8 in -4, -0.4, 1, 3? -0.4 What is the nearest to 2 in 5, 0.06, 0, 2? 2 Which is the closest to -0.5? (a) 11 (b) -1/4 (c) 4 (d) 5 b Which is the nearest to -2/5? (a) -3 (b) 2/1085 (c) -4/7 c Which is the nearest to 23? (a) -1 (b) 0.1 (c) 22 (d) 1 c Which is the nearest to -1? (a) 6 (b) -3 (c) -39 b Which is the closest to -0.5? (a) -1 (b) 2 (c) -2 (d) -2/17 d Which is the closest to -0.7? (a) -1 (b) 3/7 (c) -0.03 (d) 1/11 a Which is the closest to 3/11? (a) 1 (b) 5 (c) -2/11 c Which is the closest to 10/9? (a) 3 (b) 0.01 (c) -1/6 b What is the nearest to 1/2 in 0, -2, -3674? 0 Which is the closest to -5? (a) 0 (b) -2 (c) -6 c What is the closest to -2921 in -0.1, -0.5, 1/3? -0.5 What is the closest to 2/7 in -16, -70, 0.4, 5? 0.4 Which is the nearest to -21? (a) -0.3 (b) 0 (c) 13 (d) 3/5 a What is the closest to -6 in 0, -3, 3, 5/4? -3 What is the nearest to -2 in 2/5, 1/10, 2, -29? 1/10 What is the closest to 0.1 in -7/8, 0.1, -2/5, -0.2? 0.1 What is the nearest to -0.2 in 1/4, 0.1, -6, -5? 0.1 Which is the nearest to -1/2? (a) -1 (b) 5 (c) 23 (d) -2/9 d What is the closest to 6/11 in 2.2, 0.4, 2, 2/7? 0.4 What is the nearest to 0 in -3, -2139, 5? -3 Which is the closest to -1? (a) -1 (b) 0.3 (c) -46 a What is the closest to 0.5 in 8, 2, -0.5, -1/4? -1/4 What is the nearest to -1 in 1/5, -0.06, 10/3? -0.06 What is the closest to 2/7 in 0.03, -1/3, 1, 4/5? 0.03 Which is the nearest to 0? (a) -6 (b) 1/6 (c) -11/6 b Which is the closest to -1? (a) 3 (b) 1/5 (c) 1 (d) -10 b Which is the closest to 3? (a) 63 (b) -0.4 (c) -2/7 c Which is the closest to -0.4? (a) -0.07 (b) -5 (c) -3 (d) 1 a What is the closest to 6 in -2/187, 0.2, 2? 2 What is the nearest to -2/11 in 5, 1, 2, -2? 1 What is the closest to 1/11 in -0.04, 3/4, -5?	{ "pile_set_name": "DM Mathematics" }
when 17607 is divided by 30? 27 What is the remainder when 151 is divided by 17? 15 What is the remainder when 651 is divided by 229? 193 What is the remainder when 10792 is divided by 34? 14 Calculate the remainder when 59 is divided by 48. 11 What is the remainder when 588 is divided by 24? 12 What is the remainder when 129 is divided by 126? 3 What is the remainder when 1061 is divided by 263? 9 What is the remainder when 403 is divided by 31? 0 What is the remainder when 154 is divided by 11? 0 Calculate the remainder when 153 is divided by 16. 9 What is the remainder when 2081 is divided by 87? 80 What is the remainder when 1162 is divided by 379? 25 What is the remainder when 608 is divided by 514? 94 What is the remainder when 164 is divided by 115? 49 Calculate the remainder when 205 is divided by 95. 15 What is the remainder when 313 is divided by 172? 141 Calculate the remainder when 568 is divided by 178. 34 Calculate the remainder when 452 is divided by 96. 68 Calculate the remainder when 814 is divided by 12. 10 What is the remainder when 2481 is divided by 413? 3 Calculate the remainder when 349 is divided by 17. 9 What is the remainder when 874 is divided by 6? 4 What is the remainder when 498 is divided by 18? 12 What is the remainder when 381 is divided by 11? 7 What is the remainder when 3815 is divided by 89? 77 What is the remainder when 5630 is divided by 161? 156 What is the remainder when 165 is divided by 25? 15 Calculate the remainder when 458 is divided by 162. 134 Calculate the remainder when 2121 is divided by 118. 115 What is the remainder when 1340 is divided by 84? 80 What is the remainder when 1299 is divided by 16? 3 Calculate the remainder when 294 is divided by 92. 18 What is the remainder when 443 is divided by 43? 13 Calculate the remainder when 975 is divided by 315. 30 Calculate the remainder when 487 is divided by 35. 32 Calculate the remainder when 85 is divided by 38. 9 Calculate the remainder when 355 is divided by 66. 25 Calculate the remainder when 45 is divided by 15. 0 Calculate the remainder when 4877 is divided by 9. 8 What is the remainder when 148 is divided by 12? 4 Calculate the remainder when 81 is divided by 23. 12 Calculate the remainder when 203 is divided by 69. 65 Calculate the remainder when 1199 is divided by 7. 2 What is the remainder when 1860 is divided by 23? 20 Calculate the remainder when 922 is divided by 285. 67 What is the remainder when 16 is divided by 6? 4 What is the remainder when 193 is divided by 54? 31 What is the remainder when 133 is divided by 9? 7 What is the remainder when 231 is divided by 38? 3 Calculate the remainder when 141 is divided by 24. 21 What is the remainder when 9722 is divided by 13? 11 Calculate the remainder when 177 is divided by 15. 12 Calculate the remainder when 446 is divided by 30. 26 Calculate the remainder when 132 is divided by 19. 18 What is the remainder when 36 is divided by 21? 15 What is the remainder when 2414 is divided by 39? 35 What is the remainder when 149 is divided by 55? 39 Calculate the remainder when 1577 is divided by 20. 17 Calculate the remainder when 1915 is divided by 424. 219 What is the remainder when 15 is divided by 4? 3 Calculate the remainder when 179 is divided by 54. 17 Calculate the remainder when 1286 is divided by 34. 28 Calculate the remainder when 2885 is divided by 69. 56 What is the remainder when 627 is divided by 70? 67 Calculate the remainder when 146 is divided by 22. 14 Calculate the remainder when 103 is divided by 40. 23 What is the remainder when 433 is divided by 62? 61 What is the remainder when 1340 is divided by 28? 24 Calculate the remainder when 8519 is divided by 105. 14 Calculate the remainder when 798 is divided by 101. 91 What is the remainder when 391 is divided by 101? 88 Calculate the remainder when 123 is divided by 9. 6 What is the remainder when 306 is divided by 22? 20 Calculate the remainder when 129 is divided by 23. 14 What is the remainder when 425 is divided by 33? 29 What is the remainder when 3947 is divided by 84? 83 What is the remainder when 157 is divided by 16? 13 Calculate the remainder when 102 is divided by 13. 11 Calculate the remainder when 444 is divided by 149. 146 What is the remainder when 124 is divided by 115? 9 What is the remainder when 113 is divided by 23? 21 Calculate the remainder when 54 is divided by 32. 22 What is the remainder when 382 is divided by 26? 18 What is the remainder when 1598 is divided by 41? 40 Calculate the remainder when 2855 is divided by 18. 11 What is the remainder when 1288 is divided by 15? 13 Calculate the remainder when 574 is divided by 163. 85 What is the remainder when 191 is divided by 66? 59 What is the remainder when 83 is divided by 65? 18 Calculate the remainder when 270 is divided by 148. 122 What is the remainder when 697 is divided by 114? 13 Calculate the remainder when 253 is divided by 55. 33 What is the remainder when 8689 is divided by 82? 79 Calculate the remainder when 622 is divided by 42. 34 Calculate the remainder when 611 is divided by 301. 9 Calculate the remainder when 159 is divided by 40. 39 What is the remainder when 133 is divided by 72? 61 What is the remainder when 14806 is divided by 13? 12 What is the remainder when 8315 is divided by 66? 65 Calculate the remainder when 168 is divided by 84. 0 Calculate the remainder when 3626 is divided by 117. 116 Calculate the remainder when 272 is divided by 47. 37 Calculate the remainder when 1761 is divided by 240. 81 What is the remainder when 1746 is divided by 125? 121 Calculate the remainder when 784 is divided by 232. 88 Calculate the remainder when 248 is divided by 23. 18 Calculate the remainder when 3130 is divided by 35. 15 Calculate the remainder when 2555 is divided by 3. 2 Calculate the remainder when 79 is divided by 11. 2 What is the remainder when 837 is divided by 107? 88 What is the remainder when 2149 is divided by 9? 7 Calculate the remainder when 224 is divided by 5. 4 Calculate the remainder when 460 is divided by 2. 0 What is the remainder when 40 is divided by 32? 8 Calculate the remainder when 283 is divided by 11. 8 Calculate the remainder when 137 is divided by 126. 11 Calculate the remainder when 66 is divided by 19. 9 Calculate the remainder when 1701 is divided by 190. 181 What is the remainder when 4072 is divided by 73? 57 What is the remainder when 133 is divided by 74? 59 What is the remainder when 626 is divided by 229? 168 What is the remainder when 1983 is divided by 16? 15 What is the remainder when 189 is divided by 4? 1 What is the remainder when 34 is divided by 19? 15 Calculate the remainder when 677 is divided by 8. 5 Calculate the remainder when 448 is divided by 50. 48 What is the remainder when 4342 is divided by 79? 76 What is the remainder when 389 is divided by 7? 4 Calculate the remainder when 4270 is divided by 25. 20 What is the remainder when 2900 is divided by 117? 92 Calculate the remainder when 104 is divided by 37. 30 What is the remainder when 321 is divided by 6? 3 What is the remainder when 50 is divided by 13? 11 Calculate the remainder when 1757 is divided by 28. 21 What is the remainder when 592 is divided by 25? 17 What is the remainder when 208 is divided by 96? 16 Calculate the remainder when 815 is divided by 16. 15 What is the remainder when 207 is divided by 75? 57 Calculate the remainder when 335 is divided by 7. 6 What is the remainder when 1152 is divided by 5? 2 What is the remainder when 112 is divided by 9? 4 Calculate the remainder when 245 is divided by 36. 29 What is the remainder when 4143 is divided by 74? 73 Calculate the remainder when 159 is divided by 40. 39 What is the remainder when 30815 is divided by 19? 16 What is the remainder when 67 is divided by 34? 33 Calculate the remainder when 5 is divided by 2. 1 What is the remainder when 245 is divided by 1? 0 Calculate the remainder when 1876 is divided by 468. 4 What is the remainder when 4452 is divided by 33? 30 Calculate the remainder when 284 is divided by 13. 11 Calculate the remainder when 1329 is divided by 207. 87 Calculate the remainder when 101 is divided by 49. 3 What is the remainder when 3585 is divi	{ "pile_set_name": "DM Mathematics" }
714. 2, 3, 1619 List the prime factors of 859. 859 List the prime factors of 493. 17, 29 List the prime factors of 2131. 2131 List the prime factors of 2267. 2267 What are the prime factors of 42474? 2, 3, 7079 What are the prime factors of 15777? 3, 1753 List the prime factors of 57705. 3, 5, 3847 What are the prime factors of 850? 2, 5, 17 What are the prime factors of 6654? 2, 3, 1109 What are the prime factors of 1304? 2, 163 List the prime factors of 306. 2, 3, 17 List the prime factors of 644. 2, 7, 23 List the prime factors of 116. 2, 29 List the prime factors of 89603. 89603 List the prime factors of 40179. 3, 59, 227 What are the prime factors of 6069? 3, 7, 17 What are the prime factors of 794? 2, 397 What are the prime factors of 5056? 2, 79 List the prime factors of 18952. 2, 23, 103 What are the prime factors of 3607? 3607 List the prime factors of 2019. 3, 673 List the prime factors of 28069. 28069 What are the prime factors of 9149? 7, 1307 List the prime factors of 264. 2, 3, 11 List the prime factors of 10103. 10103 List the prime factors of 53209. 13, 4093 What are the prime factors of 14746? 2, 73, 101 List the prime factors of 45480. 2, 3, 5, 379 List the prime factors of 394. 2, 197 List the prime factors of 2240. 2, 5, 7 List the prime factors of 806. 2, 13, 31 List the prime factors of 27233. 113, 241 List the prime factors of 23555. 5, 7, 673 List the prime factors of 1347. 3, 449 What are the prime factors of 4148? 2, 17, 61 What are the prime factors of 5013? 3, 557 What are the prime factors of 733? 733 What are the prime factors of 62481? 3, 59, 353 What are the prime factors of 1261? 13, 97 List the prime factors of 35694. 2, 3, 661 What are the prime factors of 44403? 3, 19, 41 What are the prime factors of 3178? 2, 7, 227 List the prime factors of 642. 2, 3, 107 List the prime factors of 565. 5, 113 What are the prime factors of 40226? 2, 20113 List the prime factors of 539. 7, 11 What are the prime factors of 29042? 2, 13, 1117 List the prime factors of 271. 271 List the prime factors of 761. 761 List the prime factors of 2612. 2, 653 List the prime factors of 1134. 2, 3, 7 What are the prime factors of 6739? 23, 293 What are the prime factors of 1766? 2, 883 What are the prime factors of 6765? 3, 5, 11, 41 What are the prime factors of 110580? 2, 3, 5, 19, 97 List the prime factors of 1006. 2, 503 List the prime factors of 2528. 2, 79 What are the prime factors of 19094? 2, 9547 List the prime factors of 6404. 2, 1601 List the prime factors of 2431. 11, 13, 17 List the prime factors of 2914. 2, 31, 47 What are the prime factors of 773? 773 List the prime factors of 32874. 2, 3, 5479 List the prime factors of 358. 2, 179 List the prime factors of 1275. 3, 5, 17 List the prime factors of 76274. 2, 11, 3467 What are the prime factors of 1116? 2, 3, 31 What are the prime factors of 50305? 5, 10061 List the prime factors of 869. 11, 79 List the prime factors of 65892. 2, 3, 17, 19 List the prime factors of 17335. 5, 3467 List the prime factors of 1392. 2, 3, 29 What are the prime factors of 1080? 2, 3, 5 What are the prime factors of 335? 5, 67 List the prime factors of 43220. 2, 5, 2161 What are the prime factors of 2264? 2, 283 List the prime factors of 1945. 5, 389 What are the prime factors of 73457? 17, 29, 149 List the prime factors of 91. 7, 13 List the prime factors of 67570. 2, 5, 29, 233 List the prime factors of 101119. 101119 What are the prime factors of 12123? 3, 449 What are the prime factors of 12369? 3, 7, 19, 31 List the prime factors of 4005. 3, 5, 89 What are the prime factors of 1239? 3, 7, 59 List the prime factors of 65. 5, 13 List the prime factors of 25958. 2, 12979 List the prime factors of 1165. 5, 233 List the prime factors of 986. 2, 17, 29 List the prime factors of 641. 641 What are the prime factors of 28856? 2, 3607 What are the prime factors of 26529? 3, 37, 239 What are the prime factors of 998? 2, 499 What are the prime factors of 897? 3, 13, 23 What are the prime factors of 5953? 5953 List the prime factors of 15884. 2, 11, 19 What are the prime factors of 1038? 2, 3, 173 List the prime factors of 2021. 43, 47 List the prime factors of 46452. 2, 3, 7, 79 List the prime factors of 28928. 2, 113 What are the prime factors of 1796? 2, 449 What are the prime factors of 3468? 2, 3, 17 List the prime factors of 8349. 3, 11, 23 List the prime factors of 3789. 3, 421 List the prime factors of 988. 2, 13, 19 List the prime factors of 12802. 2, 37, 173 What are the prime factors of 118962? 2, 3, 2203 List the prime factors of 961. 31 List the prime factors of 13469. 13469 List the prime factors of 2990. 2, 5, 13, 23 What are the prime factors of 1505? 5, 7, 43 What are the prime factors of 2226? 2, 3, 7, 53 List the prime factors of 1655. 5, 331 What are the prime factors of 599? 599 List the prime factors of 52535. 5, 7, 19, 79 What are the prime factors of 7823? 7823 What are the prime factors of 4069? 13, 313 List the prime factors of 14388. 2, 3, 11, 109 What are the prime factors of 22115? 5, 4423 List the prime factors of 101306. 2, 37 What are the prime factors of 57548? 2, 14387 List the prime factors of 56433. 3, 13, 1447 What are the prime factors of 8580? 2, 3, 5, 11, 13 What are the prime factors of 61919? 11, 13, 433 List the prime factors of 6054. 2, 3, 1009 What are the prime factors of 245? 5, 7 What are the prime factors of 23514? 2, 3, 3919 List the prime factors of 441. 3, 7 List the prime factors of 98008. 2, 12251 List the prime factors of 116427. 3, 197 What are the prime factors of 2315? 5, 463 List the prime factors of 41757. 3, 31, 449 List the prime factors of 216. 2, 3 List the prime factors of 911. 911 What are the prime factors of 5594? 2, 2797 What are the prime factors of 1480? 2, 5, 37 What are the prime factors of 8136? 2, 3, 113 What are the prime factors of 12811? 23, 557 List the prime factors of 17287. 59, 293 List the prime factors of 9849. 3, 7, 67 List the prime factors of 578. 2, 17 What are the prime factors of 14499? 3, 179 What are the prime factors of 1107? 3, 41 List the prime factors of 1249. 1249 List the prime factors of 4215. 3, 5, 281 What are the prime factors of 6762? 2, 3, 7, 23 What are the prime factors of 161563? 161563 List the prime factors of 30277. 13, 17, 137 What are the prime factors of 40261? 13, 19, 163 What are the prime factors of 4810? 2, 5, 13, 37 What are the prime factors of 3771? 3, 419 What are the prime factors of 4077? 3, 151 What are the prime factors of 53326? 2, 7, 13, 293 List the prime factors of 11079. 3, 1231 What are the prime factors of 42396? 2, 3, 3533 What are the prime factors of 8397? 3, 311 What are the prime factors of 3116? 2, 19, 41 List the prime factors of 9259. 47, 197 List the prime factors of 99707. 99707 What are the prime factors of 6562? 2, 17, 193 List the prime factors of 9345. 3, 5, 7, 89 What are the prime factors of 168944? 2, 10559 What are the prime factors of 5232? 2, 3, 109 What are the prime factors of 4820? 2, 5, 241 What are the prime factors of 30350? 2, 5, 607 What are the prime factors of 14597? 11, 1327 List the prime factors of 8538. 2, 3, 1423 List the prime factors of 782. 2, 17, 23 List the prime factors of 629. 17, 37 List the prime factors of 4245. 3, 5, 283 List the prime factors of 17213. 7, 2459 List the prime factors of 515. 5, 103 List the prime factors of 5384. 2, 673 List the prime factors of 878. 2, 439 What are the prime factors of 3945? 3, 5, 263 What are the prime factors of 183595? 5, 73, 503 What are the prime factors of 1161? 3, 43 What are the prime factors of 10191? 3, 43, 79 List the prime factors of 21004. 2, 59, 89 List the prime factors of 11048. 2, 1381 List the prime factors of 418. 2, 11, 19 List the prime factors of 3921. 3, 1307 List the prime factors of 10334. 2, 5167 List the prime factors of 822. 2, 3, 137 What are the prime factors of 364? 2, 7, 13 What are the prime factors of 903? 3, 7, 43 What are the prime factors of 1985? 5, 397 What are the prime factors of 20226? 2, 3, 3371 What are the prime factors of 4961? 11, 41 What are the prime factors of 45029? 37, 1217 List the prime factors of 160. 2, 5 What are the prime factors of 12	{ "pile_set_name": "DM Mathematics" }
1.81126475 What is 45/8 of a gram in milligrams? 5625 What is three fifths of a milligram in micrograms? 600 How many decades are there in 800.692 centuries? 8006.92 How many litres are there in 7112.272ml? 7.112272 Convert 94.00887l to millilitres. 94008.87 How many litres are there in 3.606418ml? 0.003606418 How many months are there in 372365.4 years? 4468384.8 What is 1/64 of a kilogram in milligrams? 15625 Convert 39628.63 weeks to minutes. 399456590.4 How many grams are there in 20407.47t? 20407470000 How many millimeters are there in three fifths of a centimeter? 6 What is 8317.6 hours in milliseconds? 29943360000 What is 5.567281 tonnes in grams? 5567281 How many days are there in 27.794772ns? 0.00000000000032169875 What is 3620.167 nanometers in micrometers? 3.620167 How many nanoseconds are there in 14.78706ms? 14787060 What is 14/9 of a hour in seconds? 5600 Convert 6.975167 seconds to milliseconds. 6975.167 How many millilitres are there in 46/5 of a litre? 9200 What is 805.789 milliseconds in seconds? 0.805789 How many millilitres are there in 1/4 of a litre? 250 How many millilitres are there in fourty-four fifths of a litre? 8800 How many micrometers are there in 29/2 of a millimeter? 14500 How many milliseconds are there in 6738.632s? 6738632 Convert 392.076 centimeters to kilometers. 0.00392076 What is 47.01162km in micrometers? 47011620000 How many meters are there in 74.68935 nanometers? 0.00000007468935 Convert 1966.872 months to decades. 16.3906 What is 45/8 of a gram in milligrams? 5625 How many grams are there in 3/5 of a kilogram? 600 How many nanograms are there in 25/2 of a microgram? 12500 Convert 0.8524525 centuries to millennia. 0.08524525 How many seconds are there in 29/6 of a minute? 290 What is 3/25 of a millisecond in microseconds? 120 How many milligrams are there in 1/10 of a kilogram? 100000 How many millilitres are there in 21/2 of a litre? 10500 How many millimeters are there in 1/5 of a centimeter? 2 What is 37/2 of a litre in millilitres? 18500 What is 54/5 of a litre in millilitres? 10800 How many millilitres are there in 7/2 of a litre? 3500 How many litres are there in 9.063156ml? 0.009063156 Convert 0.3648127 centimeters to micrometers. 3648.127 Convert 614.914 minutes to nanoseconds. 36894840000000 Convert 0.6532836 months to millennia. 0.0000544403 What is 588.0645 litres in millilitres? 588064.5 What is eleven halves of a micrometer in nanometers? 5500 What is twenty-one quarters of a century in months? 6300 How many centimeters are there in three fifths of a kilometer? 60000 How many grams are there in twenty-five quarters of a kilogram? 6250 How many centimeters are there in 6/5 of a meter? 120 Convert 35.46287 meters to nanometers. 35462870000 How many years are there in 0.8195003 centuries? 81.95003 Convert 189781.62 hours to days. 7907.5675 What is 23909.3 milligrams in kilograms? 0.0239093 What is 51/2 of a millennium in centuries? 255 What is 1/60 of a hour in seconds? 60 How many millilitres are there in 3/25 of a litre? 120 How many minutes are there in 4296.189 weeks? 43305585.12 What is eleven eighths of a millennium in years? 1375 What is 7379.764nm in kilometers? 0.000000007379764 What is 5/8 of a centimeter in micrometers? 6250 How many decades are there in 102464.9 centuries? 1024649 How many centimeters are there in twenty-one halves of a meter? 1050 What is 74/5 of a millimeter in micrometers? 14800 What is eighty-one halves of a meter in centimeters? 4050 How many centimeters are there in 49.22837 nanometers? 0.000004922837 Convert 467.001171 minutes to weeks. 0.04632948125 What is 0.5737213nm in micrometers? 0.0005737213 How many centuries are there in 43/2 of a millennium? 215 How many millilitres are there in 1/20 of a litre? 50 What is eight thirds of a decade in months? 320 How many years are there in fourty-two fifths of a century? 840 How many centimeters are there in one tenth of a kilometer? 10000 How many centimeters are there in 0.2725623 millimeters? 0.02725623 How many millilitres are there in 46/5 of a litre? 9200 What is 58.63436 decades in centuries? 5.863436 How many micrograms are there in one twentieth of a gram? 50000 How many millilitres are there in eighteen fifths of a litre? 3600 What is eighty-seven quarters of a tonne in kilograms? 21750 How many months are there in twenty-one eighths of a century? 3150 What is 1/20 of a gram in micrograms? 50000 Convert 5.807211l to millilitres. 5807.211 Convert 2678.8581 months to millennia. 0.223238175 What is eighteen fifths of a litre in millilitres? 3600 What is seven sixths of a year in months? 14 What is seventeen quarters of a kilogram in grams? 4250 What is 3/5 of a hour in seconds? 2160 Convert 16.01237 days to seconds. 1383468.768 How many micrometers are there in 26/5 of a centimeter? 52000 How many millilitres are there in 6/25 of a litre? 240 How many meters are there in three fifths of a kilometer? 600 What is 12253.49ng in tonnes? 0.00000000001225349 What is 7/4 of a gram in milligrams? 1750 What is 1/4 of a day in minutes? 360 What is 37/2 of a centimeter in millimeters? 185 What is 1/10 of a decade in years? 1 What is seven eighths of a kilometer in meters? 875 How many micrometers are there in thirty-one fifths of a centimeter? 62000 What is 3/50 of a gram in milligrams? 60 How many months are there in 81/4 of a century? 24300 How many millennia are there in 0.0820932 centuries? 0.00820932 What is 365033.5 nanometers in centimeters? 0.03650335 How many years are there in 279.45948 months? 23.28829 What is 3/10 of a centimeter in millimeters? 3 How many millimeters are there in seven halves of a centimeter? 35 What is 11/4 of a milligram in micrograms? 2750 What is thirty-seven halves of a milligram in micrograms? 18500 What is one quarter of a litre in millilitres? 250 Convert 2.391258 centimeters to kilometers. 0.00002391258 How many millilitres are there in 5/8 of a litre? 625 Convert 45.06mg to micrograms. 45060 What is four sevenths of a week in hours? 96 What is 17637.11km in micrometers? 17637110000000 How many grams are there in 75250.61 micrograms? 0.07525061 Convert 2.5072326 months to decades. 0.020893605 How many seconds are there in 3/40 of a day? 6480 What is 1/15 of a minute in seconds? 4 How many litres are there in 87.20043 millilitres? 0.08720043 How many millennia are there in 5.186216 centuries? 0.5186216 How many micrograms are there in 836203.2 kilograms? 836203200000000 How many microseconds are there in 3.997287 hours? 14390233200 How many seconds are there in three tenths of a hour? 1080 What is one sixteenth of a century in months? 75 Convert 7433.562ug to tonnes. 0.000000007433562 Convert 94507.54 millilitres to litres. 94.50754 Convert 42.11062ug to nanograms. 42110.62 How many nanograms are there in twenty-nine halves of a microgram? 14500 What is 3/5 of a centimeter in micrometers? 6000 What is 0.179387 hours in seconds? 645.7932 What is 4.530367km in centimeters? 453036.7 What is eleven eighths of a litre in millilitres? 1375 What is 3/40 of a micrometer in nanometers? 75 How many litres are there in 3.99644ml? 0.00399644 How many weeks are there in 92.213436 hours? 0.5488895 Convert 14416.8066 microseconds to weeks. 0.0000000238373125 What is 2.521316 centuries in months? 3025.5792 Convert 0.4379413us to milliseconds. 0.0004379413 What is 241016.2 microseconds in milliseconds? 241.0162 What is 378.9252 weeks in microseconds? 229173960960000 How many meters are there in 490.2945cm? 4.902945 What is 7/2 of a kilometer in meters? 3500 How many nanograms are there in 93.30847 milligrams? 93308470 How many milligrams are there in three tenths of a gram? 300 How many millilitres are there in 6/5 of a litre? 1200 What is 8.372402 tonnes in nanograms? 8372402000000000 What is 0.7005126 litres in millilitres? 700.5126 What is fourty-one halves of a meter in centimeters? 2050 What is 6/5 of a kilogram in grams? 1200 How many millilitres are there in one fifth of a litre? 200 What is 27376.134 months in years? 2281.3445 How many millimeters are there in three fifths of a meter? 600 What is 25133.67 decades in centuries? 2513.367 What is 125273.3 weeks in days? 876913.1 What i	{ "pile_set_name": "DM Mathematics" }
76? -121607 In base 4, what is -10 - -13111020331? 13111020321 In base 15, what is 1cce982 - 4? 1cce97d In base 5, what is 2002 - -200323433? 200330440 In base 5, what is -20213132410 - -2? -20213132403 In base 15, what is 15128 - -b8? 151e1 In base 9, what is 4850174 - -17? 4850202 In base 3, what is 1 - 100200120220211? -100200120220210 In base 5, what is -2103014344 - 0? -2103014344 In base 7, what is 1225614 + -515? 1225066 In base 8, what is 13 - 4024152? -4024137 In base 5, what is -4140 + -24433? -34123 In base 16, what is b6f2 - -2d? b71f In base 8, what is -24 - -73602740? 73602714 In base 11, what is 0 - -42729318? 42729318 In base 9, what is -133 + 1317711? 1317567 In base 10, what is -2204 - -1232? -972 In base 14, what is -2a35772 + 3? -2a3576d In base 4, what is -3313032121113 + -1? -3313032121120 In base 12, what is -179bb14 - -a? -179bb06 In base 11, what is -5651a + -373? -56892 In base 13, what is 6c60489 + 2? 6c6048b In base 6, what is -10541340 - 34? -10541414 In base 15, what is e982 + 2a5? ec37 In base 10, what is 48 + -553045? -552997 In base 9, what is 33127 + -304? 32723 In base 4, what is -1122302232210 + 11? -1122302232133 In base 16, what is -17dd - 553? -1d30 In base 13, what is -27167 + 1497? -259a0 In base 5, what is 130220031 + -2? 130220024 In base 10, what is 3977972 - -19? 3977991 In base 12, what is 295919a + 3? 29591a1 In base 3, what is -1220011222202 - 20121? -1220012020100 In base 11, what is -1a036a85 + 3? -1a036a82 In base 10, what is 4 - -19766555? 19766559 In base 15, what is -55 + 6011d4? 60117e In base 5, what is 1024 - 214204000? -214202421 In base 12, what is 926b006 - -19? 926b023 In base 3, what is 1100 - -110201021122222? 110201021201022 In base 7, what is 100256636 - -405? 100260344 In base 7, what is -325 - -1111325? 1111000 In base 9, what is 2 + -203627426? -203627424 In base 9, what is -4 + 416757? 416753 In base 7, what is -42464344 + 20? -42464324 In base 6, what is -44431513 - 2? -44431515 In base 15, what is -b7469 - 3ca? -b7844 In base 2, what is 1111011010011101 + -10100100? 1111010111111001 In base 4, what is 112301013 + 223? 112301302 In base 4, what is -30 - -3311103022? 3311102332 In base 5, what is 30 - -30041101103? 30041101133 In base 8, what is 2 - 704752216? -704752214 In base 3, what is 12121001 + -1222011? 10121220 In base 14, what is 769c + -5a50? 1a4c In base 3, what is 12100220120211 + -122? 12100220120012 In base 7, what is 342 + -2016640? -2016265 In base 9, what is -7 - -182756? 182748 In base 4, what is -1121210222 - 2? -1121210230 In base 14, what is -10b - -5b8b? 5a80 In base 5, what is -2 - -213240421? 213240414 In base 7, what is -546 + 2450634? 2450055 In base 9, what is -1705 + -11840? -13645 In base 7, what is -6266526064 - -3? -6266526061 In base 2, what is 1110011001001101 + -11101111? 1110010101011110 In base 11, what is -26953283 + 4? -2695327a In base 14, what is 27d7 + 6d5c? 9755 In base 10, what is -84507 - 66? -84573 In base 13, what is -846038b3 - -2? -846038b1 In base 5, what is -2040341313034 + 0? -2040341313034 In base 3, what is 0 + -111010211102? -111010211102 In base 7, what is 136306123 - 40? 136306053 In base 5, what is 1343031220322 - -11? 1343031220333 In base 4, what is -133133 + 213101002? 212301203 In base 4, what is 320 + -1102232200? -1102231220 In base 16, what is 1 + 1d840f? 1d8410 In base 11, what is -73759 - 14? -73772 In base 12, what is -3 + -224859b6? -224859b9 In base 13, what is 12a1 - 905? 699 In base 3, what is -22 + -202200002200? -202200002222 In base 10, what is -768082842 - -1? -768082841 In base 5, what is -231212 + -11134? -242401 In base 8, what is 2734 - -316? 3252 In base 14, what is 4d4 - 4a? 488 In base 9, what is -4437 + -4052? -8500 In base 7, what is -510235 + -55? -510323 In base 7, what is 421 - -24113213? 24113634 In base 10, what is 689 - -216? 905 In base 4, what is -3223 + 1021103211? 1021033322 In base 11, what is 5 - -403a? 4044 In base 16, what is -4 - 990e02? -990e06 In base 9, what is -48806685 + 2? -48806683 In base 5, what is 124 + -112410234? -112410110 In base 11, what is 51372 + -1362? 50010 In base 8, what is 24747 - 1431? 23316 In base 2, what is -10010000 + -1011010011011101000000? -1011010011011111010000 In base 3, what is -10011121010221 + 12221? -10011120221000 In base 15, what is -5 - 292d2c7? -292d2cc In base 13, what is -136 - -5a867? 5a731 In base 6, what is -4 + 221413440? 221413432 In base 9, what is -1 - -17204250? 17204248 In base 10, what is 3148 + -12548? -9400 In base 5, what is 302034330 - 4? 302034321 In base 4, what is -102023 + 11233313? 11131230 In base 14, what is -4581db - -18? -4581c3 In base 14, what is 3220 - 44d? 2bb1 In base 6, what is -210 - 333543052? -333543302 In base 10, what is 659533 - 39? 659494 In base 8, what is -121352061 - -2? -121352057 In base 5, what is 232224322 - 2? 232224320 In base 7, what is -162441 - -30046? -132362 In base 10, what is 27163 - -844? 28007 In base 14, what is -cab92 + 4ad? -ca6c3 In base 5, what is 20 + -1422040142? -1422040122 In base 13, what is -3a57b5 + -121? -3a5906 In base 9, what is 1331728 - -17? 1331746 In base 4, what is -312 - -11131321? 11131003 In base 13, what is -4 - -30c4c73? 30c4c6c In base 16, what is -28 - -2dbcc? 2dba4 In base 8, what is 4 - 30667571? -30667565 In base 16, what is -1b2cf6 + 7? -1b2cef In base 13, what is 0 - aa78389? -aa78389 In base 3, what is 1100001122102 + -11? 1100001122021 In base 10, what is 6 + -35098977? -35098971 In base 2, what is -1111111001 + 101011011000110? 101001011001101 In base 5, what is 30 - 321113302? -321113222 In base 13, what is -3338 - 250? -3588 In base 6, what is 14204332 + -1005? 14203323 In base 10, what is -245 + 66215? 65970 In base 10, what is -405093 - -5? -405088 In base 10, what is 1 + 116838842? 116838843 In base 16, what is -4 + 5aa8ce? 5aa8ca In base 16, what is 1fb0b71 + 0? 1fb0b71 In base 3, what is -11 + -222102220200021? -222102220200102 In base 11, what is -2a - -a8a176? a8a147 In base 10, what is 1852496 - -92? 1852588 In base 12, what is -50a2 - -1379? -3925 In base 11, what is 11 - -8334a7? 833508 In base 14, what is 11a9a14 + -1? 11a9a13 In base 4, what is 3111131 - -2101? 3113232 In base 3, what is 200122210002120 + 100? 200122210002220 In base 11, what is -126a3 + -2587? -1517a In base 10, what is 2568 + -116696? -114128 In base 9, what is 2 - -5470788? 5470801 In base 14, what is 170da77 - -5? 170da7c In base 6, what is -55515342 + -3100? -55522442 In base 16, what is 9 - -1d169? 1d172 In base 16, what is 6d07 - -1a3? 6eaa In base 9, what is -17 - -77854? 77836 In base 8, what is -1643 - 340024? -341667 In base 15, what is -10 + db6cc? db6bc In base 14, what is 1 - ac5441? -ac5440 In base 7, what is 6 + -32162306? -32162300 In base 12, what is -21 + -264b34? -264b55 In base 3, what is 2102220 + 12121210? 22001200 In base 10, what is -272 - 48389? -48661 In base 8, what is 143367 - 671? 142476 In base 13, what is -3a69508 + 18? -3a694c0 In base 4, what is -10 + -323212221302? -323212221312 In base 3, what is -220122200220010020 + 12? -220122200220010001 In base 8, what is 5 - -43101640? 43101645 In base 12, what is -81b32 - 210b? -84041 In base 13, what is -5 + -23822b? -238233 In base 12, what is 84093 - -14b? 84222 In base 9, what is 44417 - 2860? 41447 In base 10, what is 9018 + 73397? 82415 In base 5, what is -31 - -111034304? 111034223 In base 5, what is 144212 + -4321? 134341 In base 3, what is -1000 + 10210121010122? 10210121002122 In base 4, what is 203112302332310 + 0? 203112302332310 In base 16, what is 9a - -1916c? 19206 In base 13, what is 4978aa9 + 3? 4978aac In base 8, what is 3605 + 433033? 436640 In base 5, what is 1310322300 - 222? 1310322023 In base 6, what is 5 + -11222324? -11222315 In base 16, what is 9a2 + -b33a? -a998 In base 16, what is 5 + -3589c2? -3589bd In base 4, what is -10211223 - -1032? -10210131 In base 10, what is -10 - -4994935? 4994925 In base 2, what is 10110010111001101 + 1111110110000? 11000010101111101 In base 14, what is -12bdb8 - -44a? -12b96c In base 6, what is 3 + 33054332200? 33054332203 In base 8, what is 13141600 + 25? 13141625 In base 8, what is 5132525312 - 0? 5132525312 In base 12, what is -	{ "pile_set_name": "DM Mathematics" }
? True Suppose 64 = 5s - s. Suppose 0 = 11b - sb + 145. Is b a multiple of 16? False Let p = 286 - -44. Is 33 a factor of p? True Let y = 1287 + -1257. Is y a multiple of 2? True Let k = 220 - 202. Is k a multiple of 7? False Let f = 147 - 102. Suppose -3p - 3x + 22 = -7x, 2 = 5p + 2x. Suppose 3g + pg = f. Does 3 divide g? True Let l(o) = -o*3 + 11o2 - 4. Let x be l(11). Let c = 13 + x. Let y(d) = d3 - 10d2 + 12d - 4. Does 23 divide y(c)? True Let n be 0 + (0 - -1)-10. Let x be (-4)/((-1)/n-4). Is 632/40 + (-8)/x a multiple of 15? True Let z be (-6 - -6) + (-6)/(-2). Suppose 202 + 53 = zp. Let o = p + -49. Is o a multiple of 12? True Suppose -3k - 2050 = -4q - 657, -q + 4k + 345 = 0. Is 4 a factor of q? False Let w = -413 + 488. Is 25 a factor of w? True Let d be 70/22 + (-4)/22. Suppose 0 = do - 6o. Suppose oh + 5h = 175. Does 29 divide h? False Suppose 2z = -h + 431, z = -3h - 0z + 1278. Is 18 a factor of h? False Let y(c) = c3 + 10c*2 - 8c + 2. Suppose 10 + 0 = -b. Is 20 a factor of y(b)? False Let x = 416 - 367. Is x a multiple of 5? False Suppose h - 3v - 4 + 2 = 0, 0 = 5v. Suppose -hd = -g - 9, -2g - 6d - 26 = -2d. Let q = 38 + g. Is 9 a factor of q? True Suppose 0 = -7u + 6u + 4. Suppose 5w + 13 = r, 2r + 2r - 20 = uw. Suppose -23 = -5t - r. Is t a multiple of 4? True Suppose 3548 - 767 = 3f. Does 13 divide f? False Let v be 0 + (-3)/4-4. Suppose r - 28 = -vm - 1, -3m + 42 = 2r. Is 5 a factor of r? True Suppose -5k = -16 + 36. Let x(f) = 3f*2 + 8f + 2. Does 18 divide x(k)? True Suppose -133 - 617 = -3u. Suppose 2y = -8y + u. Is 25 a factor of y? True Let u(m) be the second derivative of 5m*3/3 - 7m*2 + 20m. Does 19 divide u(9)? True Let n be (13 - 10)/(3/52). Let s = n - 37. Is 2s(-1)/(-2) a multiple of 15? True Suppose 3b = -5v + 57, 5b + 13 = 5v - 12. Suppose vi + 5h = 4i + 70, -2h - 62 = -3i. Is 8 a factor of i? False Let v(s) = -27s + 1. Let z(u) = -13u. Let g(f) = -2v(f) + 5z(f). Is g(-4) a multiple of 21? True Let r = -88 - -193. Does 15 divide r? True Suppose 2o = 2w - 586, -w - w = -4o - 592. Does 29 divide w? True Let z(k) = -k*3 + 12k*2 - 6k - 13. Let s be z(11). Let a be (35/21)/(2/s). Let l = a + -7. Is 14 a factor of l? True Let w = 1146 - 165. Is 91 a factor of w? False Suppose -p - 2t + 22 = -3t, 8 = -4t. Suppose 0 = -w + p - 15. Does 15 divide (-76)/(-5) - 1/w? True Suppose 2g - 5j - 939 = 0, -2g + 915 = -5j + 8j. Is 21 a factor of g? True Let z = 54 + -36. Suppose 6p + 20 = 7p. Suppose o - 4n - z = 2, 0 = -4n + p. Does 13 divide o? False Suppose 0u = -u + r + 2, 0 = 3r - 6. Suppose -4j = -uv + 88, 4v - 80 - 32 = -2j. Is v a multiple of 10? False Does 124 divide 15/(-12)(-11 - -15) + 3973? True Let m = 4 - 0. Let t be (m/(-20) + 1)5. Suppose 5g = -2i + 317, 4g + ti + i - 257 = 0. Is g a multiple of 21? True Let h be ((-24)/10)/((1 - 0)/(-25)). Let g = h - 8. Does 8 divide g? False Suppose 2b - 942 = -2l, 3l - 367 - 106 = -b. Does 10 divide b? True Suppose 0 = -16s + 44s - 10332. Does 8 divide s? False Let b be 96(24/(-9) - -3). Let v = b + 61. Is v a multiple of 31? True Let o(l) = -l*2 - 4l + 9. Let h be o(-7). Let c = h + 40. Is c a multiple of 14? True Suppose -216 = -75j + 69j. Does 6 divide j? True Suppose -2y = j - 14, -3j - 4y = 12 - 44. Suppose l + 2 = 5k, -3l - 3k + 34 = j. Is l a multiple of 3? False Let x(r) = 15r2 + 17r + r3 - r2 - 3r. Does 40 divide x(-9)? False Suppose 0a + 5a - 10 = 0. Suppose -13 = 3r + 2x - 4x, 5r = 3x - 21. Is 13 a factor of (-52(r + a))/2? True Suppose 4k + 3f - 9239 = 0, -11k + 3f = -13k + 4615. Is 41 a factor of k? False Let s be (-12)/(-24) - 18/(-4). Suppose -c + 10 - s = 0. Suppose ch - h = 4b + 80, -b - 50 = -3h. Is h a multiple of 5? True Suppose 13j = 11j + 3l + 2507, j - 1236 = -2l. Is 9 a factor of j? False Suppose 3c = 11c - 24. Suppose -v + x + 32 = 0, -14v - cx + 54 = -12v. Is v a multiple of 10? True Let j(o) = -170o + 208. Does 106 divide j(-10)? True Suppose 2a - 1 = 7. Suppose ai + 49 + 7 = 0. Let z(b) = -2b - 14. Is 14 a factor of z(i)? True Suppose 13 + 67 = -4v. Is 10 a factor of v/(-15) + (-466)/(-6)? False Suppose -2r + 194 = 2g, 9r - 7r - 214 = 3g. Is 7 a factor of r? False Is 17 a factor of (408/2)/(-2 - 72/(-30))? True Suppose 3p - 1597 = q, 4q = 4p + 6q - 2136. Is p a multiple of 7? False Let w(n) = 47n2 + 1. Suppose f + 2f - 54 = 0. Let u be (-2)/(-7) - f/14. Is 16 a factor of w(u)? True Let y = -2046 - -2470. Is 19 a factor of y? False Suppose -2g + 7g = 5. Let z be g(-5)/(25/(-5)). Does 6 divide 6 + (z - -3) + -4? True Let w = -234 - -358. Is 12 a factor of 4/(-2 - (-256)/w)? False Suppose 3 = 4b - 3i - 2, -7 = -5b + 3i. Suppose by + 423 = 5q, y - 324 = -4q - y. Is 15 a factor of q? False Let l = -773 - -914. Is 3 a factor of l? True Is 28 a factor of 4/4 + -5 + (230 - 3)? False Let m(g) = -g*3 + 7g*2 + 3g - 14. Let w be (14 - 2)/(-7 + 9). Is m(w) a multiple of 16? False Suppose -3u - 6a = -4a - 25, -13 = -2u - 5a. Suppose -3w = -2f - 196, -320 = -uw + 4w + 5f. Does 17 divide w? True Suppose -6k + 15 = -3. Suppose 64 = ku - 119. Is 21 a factor of u? False Let b(j) = -2j3 - 5j*2 + 12j + 6. Let p be b(-8). Suppose 0 = -3g + p - 110. Is g a multiple of 24? True Suppose 3 = f + 7. Is (-9 + 0)(f - 2/(-6)) a multiple of 33? True Suppose 197 + 41 = -4l - g, 4l = 3g - 230. Let a = 119 + l. Is 10 a factor of a? True Suppose -x - 33y + 37y = 7, 2x + 7 = y. Let s = -1 + -1. Is s/x + (-49)/(-3) a multiple of 7? False Let h(g) = 141g - 49. Is 22 a factor of h(3)? True Suppose 37j - 411 = 40j. Let t = -78 - j. Does 12 divide t? False Is ((2415/(-30))/((-1)/2))/1 a multiple of 7? True Let i = -123 - -293. Does 5 divide i? True Let w(z) = -z2 - 4z + 8. Let j be w(-4). Is 29 a factor of 965/20 + (30/j)/5? False Let d = -109 + 220. Is d a multiple of 5? False Let t(z) = -13 - 3z - 4z - 15z. Let b be t(-4). Let r = b - 51. Is r a multiple of 14? False Let m(d) = 29d + 8. Is 19 a factor of m(3)? True Let k(c) = 4c + 76. Is k(9) a multiple of 48? False Let w(l) = 13l*2 + 2l + 1. Is 12 a factor of w(-6)? False Let c = 358 - 292. Is 11 a factor of c? True Let o = 13 - 21. Let h be 7/28 + (-54)/o. Suppose 0 = -hs + 3s + 32. Is s even? True Suppose -15u = -21u + 384. Is 16 a factor of u? True Let p = 7397 + -3137. Is 41 a factor of p? False Suppose 4i + h = -0h + 57, 3i = -3h + 36. Let f(a) = a + 24. Let k be f(-8). Suppose is - ks = -39. Is 13 a factor of s? True Suppose 4q + 81 = -3f - 0f, 33 = -2q - 3f. Let k = -25 - q. Is 14 a factor of k/(2/(-88)2)? False Suppose 4x = -2x - 1302. Let v = 339 + x. Suppose 0 = 4b - v + 34. Is 22 a factor of b? True Suppose -2073 = -3m + 453. Is m a multiple of 32? False Let p(d) = 3d2 + 4d - 4. Let n be ((-36)/(-20))/(6/40). Let w = n + -10. Does 16 divide p(w)? True Suppose -4t + i = 4i - 337, 5t - 420 = -5i. Suppose 0 = tm - 87m + 54. Is 5 a factor of m? False Suppose 4y + 6 = 2v, -2y + 0v - 18 = -4v. Let j(x) = 100x + 1. Is j(y) a multiple of 38? False Let q(j) = 5j + 57. Does 15 divide q(37)? False Suppose 9f + 1075 = 4f. Let m = f + 383. Does 28 divide m? True Is ((3 - 1) + -891)/(-1) a multiple of 108? False Suppose -4c = -4l - 2680, 0l = l - 2. Does 14 divide c? True Let i(b) = -10b - 2b*2 + 0 - 8b2 - 3 + 2 - b3. Let w be i(-9). Is 8 a factor of 4/w + (-15)/(-2)? True Let m(r) = -r*2 + 29r + 15. Does 27 divide m(27)? False Suppose 4m = 4u + 804, 4u = -0m + m - 192. Is 6 a factor of m? True Let n(f) = -2f - 10. Let d(t) = -t3 + 9t*2 + 9t + 3. Let l be d(10). Let u be n(l). Suppose 5k = 5r + 49 + 21, -r + 31 = uk. Is k a multiple of 9? True Let v = -520 - -646. Is v a multiple of 5? False Let h be 12/(-8) + (-41)/2. Does 17 divide 11/((-605)/(-10)) - 1118/h? True Let b(f) = -1 - f2 - 6 - 4 - 9f + 3. Let s be b(-9). Let q(d) = -3d + 5. Is 5 a factor of q(s)? False Suppose 2925 = 24w - 9w. Does 22 divide w? False Suppose -2c - 1 = -c - 2i, -i - 4 = 0. Let o be (-6)/c29. Let y(z) = 4z + 5. Is y(o) a multiple of 11? False Let l(w) be	{ "pile_set_name": "DM Mathematics" }
and 69. 69 Let y = -199/118 - 4/295. Suppose -p + 2n - 48 = -5p, 0 = -3p - 4n + 41. Let i = p - 23/2. What is the common denominator of y and i? 10 Let i = 6731 - 3459735/514. Let m = i + 2835/4112. Calculate the common denominator of 43/10 and m. 80 Calculate the common denominator of (-8)/(-12)(0 - 34/(-3)) and 38/9. 9 Suppose -2s + 6c - 2c = 22, -2s - c - 2 = 0. Find the common denominator of 11/18 and 3/s115/6. 18 Let k(v) be the first derivative of 3v2 - 8v - 11. Calculate the lowest common multiple of (8/5)/(2/10) and k(4). 16 Suppose -5x + 0f + 2f + 12 = 0, 3x - 8 = 2f. What is the lowest common multiple of x and (30/(-35))/(((-30)/28)/5)? 4 What is the common denominator of (-13)/((2 + -12)/2) and (9/(-30))/((-2)/76)? 5 Let g = 203041/14 - 14511. Let m = 28817/8 + -3594. Calculate the common denominator of m and g. 56 Let m be -1 + (124/(-18))/(-2). Let w = m + 325/18. Find the common denominator of w and -95/18. 18 Let z be (-6761)/3 - (-8)/(-12). Let a = z + 2275. Calculate the common denominator of a and 273/15(-10)/16. 24 Suppose -j + 0j = -9. What is the smallest common multiple of 6 and j? 18 Suppose 0 = 4n, -3c + 10 = 2n - 5. Suppose 16 = -z - cu, u + 3u = -16. Calculate the lowest common multiple of (8 + 1 + 0)2 and z. 36 Let m = 7 - 5. Let u = -4 - -7. Suppose 0 = up - 44 + 8. What is the smallest common multiple of m and p? 12 What is the common denominator of 129/18 + 2 + 3 and -19/10? 30 Let f(o) = o*3 - 4o*2 + 4o - 3. Let d be f(6). Suppose -5y = -2y - d. Find the common denominator of -4 + ((-72)/28 - -3) and y. 7 Let d(o) = o*3 - 6o*2 - 7o - 1. Let g be d(7). Let b(w) = 15w2 - 3w - 2. Calculate the lowest common multiple of 8 and b(g). 16 Let t(z) = z*3 + 10z*2 - 10z + 7. Let i be t(-11). Calculate the lowest common multiple of 8 and ((-2)/4 + -1)i. 24 Let u = -124 + 134. Suppose 3k + 8 = 4i, 0 = 3k - 3i - 0 + 3. What is the smallest common multiple of k and u? 20 Let f be 0/(5/(5/2)). Let h(p) = p2 + p + 11. Let o be h(f). Suppose -i - o = 3w, 3i - 6i - 13 = 5w. What is the lowest common multiple of i and 10? 20 Suppose 5g + 12322 = -4p, 3g = 5p + 2g + 15388. Let x = p - -12213/4. What is the common denominator of 0 - 18/806 and x? 20 Suppose -w + 4 = w. Suppose u + wb + 2 = -3b, 2b = 2u - 44. What is the smallest common multiple of u and 6? 18 Calculate the least common multiple of 11 and 30/4(-60)/(-45). 110 Find the common denominator of 76/15 and (9 - 10) + 314/48. 120 Let w(c) = -12 + 4 - c*2 - 11c - 5. Calculate the lowest common multiple of 6 and w(-9). 30 Let m = 16 + -8. Let x = 13 - m. Suppose -9 - 11 = -xv. Calculate the lowest common multiple of 2 and v. 4 Suppose -4z - 4 = -0. Let r = 3 - z. Calculate the lowest common multiple of 3 + (1 - (1 + -1)) and r. 4 Let b(a) = a + 1. Let o be b(-3). What is the smallest common multiple of (2/(-6))/(o/24) and 6? 12 Suppose -26 = 4z + 3o, -z + o - 3o - 9 = 0. Let n = 15 + z. Let y = 2 - -4. What is the smallest common multiple of y and n? 30 Let r = 13/43 + 3629/86. Suppose -64 = -4c - 4. Find the common denominator of r and ((-20)/(-54))/((-10)/c). 18 Suppose -3r - 2r = -10. Let d = 9 - 8. What is the least common multiple of 5 and (d - (-19 - r))/2? 55 Let u = 1001 - 683. Let h = 71/7 - 45/14. Find the common denominator of h and ((-2)/(-60))/((-4)/u). 140 Let f be (1/2)/(84/184776). Let c = 1098 - f. Calculate the common denominator of c and -27. 7 Let r be 2/(-10) + (-4856)/120. Let k = r + 163/6. Calculate the common denominator of k and 43/18. 18 Let i(s) be the third derivative of -s6/120 + s5/10 + 3s4/8 - s3/3 - 4s*2. What is the least common multiple of i(7) and 4? 12 Find the common denominator of -49/10 and 2/7 + (-2385)/924. 220 Let a = 6026 + -96467/16. Calculate the common denominator of a and -49/10. 80 Let l = -6 + 16. What is the lowest common multiple of 6((-3)/(-9) + 3) and l? 20 Suppose -2v - 2b + 0b + 32 = 0, -2b - 16 = -2v. Calculate the lowest common multiple of 2 and v. 12 Let b(m) = 10m3 - m2 + 2m - 1. Let k be b(1). Find the common denominator of (-670)/(-4)(-4)/80 and 3 - 1 - (-1)/k. 40 Let w = -133/2750 - 8949343/11000. Let k = w + 809. Let c = 463/190 + 6/95. What is the common denominator of c and k? 8 Let y(u) = -u*3 + 9u*2 - 8u - 1. Let g be y(8). Let z be 42/9 + g/(-3). Suppose 64 = zq - 16. What is the smallest common multiple of 8 and q? 16 What is the common denominator of 91/36 and ((-4)/150-5)/((-1)/125)? 36 Let s(n) = 15n - 73. Calculate the lowest common multiple of 11 and s(8). 517 Let o = -67 + 91. Calculate the lowest common multiple of o and 15. 120 Suppose 3g + 14 = -4. Let k = g - -22. Calculate the least common multiple of 22 and k. 176 Suppose 5q = q - 8. Calculate the common denominator of 97/4 and 97/q - (-1 - 0). 4 Calculate the common denominator of 49/9 and 40/(-250)(-170)/4. 45 Suppose -3f + i = 4i + 42, 90 = -5f + 5i. Let g = f - -43. Let u = g + -18. Calculate the smallest common multiple of u and 9. 9 Let w = 7 + -11. Let c be (-8)/36 + w/(-18). Suppose -f - u + 1 + 4 = c, 5f = 4u + 34. Calculate the least common multiple of 14 and f. 42 Suppose b - 12 = 96. Let u = b + -492/5. Calculate the common denominator of u and -63/8. 40 Calculate the common denominator of -95/8 and (-1510)/(-1170) - 4/(-26). 72 Suppose 3a = 2m + 8, 0 = 2a - m - 5 - 1. Calculate the lowest common multiple of a and 7. 28 Suppose 0 = -v + 4 + 4. What is the lowest common multiple of v and 8? 8 Let w = 1 - 0. Calculate the common denominator of 43/3 and (w2)/((-18)/(-1)). 9 Let j = -2/3617 + 242357/32553. Calculate the common denominator of j and -26/11. 99 Let u = -3 + 6. Calculate the smallest common multiple of (3/(-6))/(3/(-30)) and u. 15 Let g(p) = 0p - 4p - 4p. Calculate the common denominator of -1/6 and g(-5). 6 Suppose 29 + 59 = 4f. What is the smallest common multiple of f and 42/5 - (-18)/(-45)? 88 Suppose -r + 4 = 2. Suppose -5h + 50 = 5t, 0 = -t + 5h - 12 - 8. What is the lowest common multiple of r and t? 10 Let w = 3874 + -46525/12. Find the common denominator of w and 121/12. 12 Suppose 0 = -4r - 2v - 2336, -3r + 2v = 1559 + 193. Let q = 2689 + r. Let j = 29579/14 - q. What is the common denominator of j and 79/2? 14 Suppose 4y = -0y + 8. Let p be 6(y/3 + 1). Suppose -d + p = 4d. What is the lowest common multiple of 2 and d? 2 Let a(x) = x2 + x + 10. Let y be (12/10)/(3/15). Let c be y/3 + -1 + -1. Calculate the lowest common multiple of a(c) and 6. 30 Suppose 4x = 6x + 12. Let k be (1222/(-4))/((-3)/x). Let p = -1181/2 - k. Find the common denominator of -29/12 and p. 12 Suppose 4a + 0a + k - 3 = 0, -3a - 3k = 0. Suppose -l = -3b - 16, -l - 5b = 3l + 21. What is the common denominator of -1/9 and a - l - 41/4? 36 Let a(m) = -5m - 2. Let v = 34 + -24. Calculate the smallest common multiple of a(-4) and v. 90 Suppose 0 = -4z + 6 + 2. What is the smallest common multiple of 2 and z? 2 Let q be ((-108)/(-16))/(3/8). Suppose 0 = -2p + p + q. What is the least common multiple of p and 8? 72 Suppose -b - i + 0 + 3 = 0, i + 3 = 0. What is the lowest common multiple of b and ((-8)/(-10))/(2/5)? 6 Let t = -21 - -6. Let p = t - -30. What is the smallest common multiple of 12 and (20/p)/(4/6)? 12 Let l be (543710/(-72))/(6/18). Let i = -22667 - l. What is the common denominator of i and -93/4? 12 Suppose -21 = -3o + 5x, -5o + 3x = 2 - 21. Calculate the least common multiple of 8 and o. 8 Suppose -98 = 8o - 114. What is the lowest common multiple of 13 and o? 26 Let w = 3719/5 - 4979751/6695. Let q = 25445/2678 + w. Calculate the common denominator of -17/18 and q. 18 Let x(b) = 2b3 - 6b*2 + b - 1. Let m be x(4). What is the common denominator of 3 - 0 - (-80)/m and 71/8? 56 What is the lowest common multiple of 22 and (-2)/5 + 216/15? 154 Suppose -k + 3k + 5y = -1, 0 = y + 1. What is the least common multiple of k and 2? 2 Let h = 1 - 0. Suppose 2p + 0 - 4 = 0. Suppose 5b + 0b = 0, 5b = pv - 8. What is the smallest common multiple of h and v? 4 Let h(u) = -166u2 - 4u - 3. Let j be h(-2). Let w = -1345/2 - j. What is the common denominator of w and 73/9? 18 Let	{ "pile_set_name": "DM Mathematics" }
nd 7m2 + 1 - 3m*2 - 3 + (0m + m + m)(-6m + 0 + 0). -8m2 - 2 Expand (3 + 2 - 3)(-2c + 4c - 4c)(-2 - c3 + 1 - c4 + 0c3). 4c*5 + 4c*4 + 4c Expand (-7a5 + 0a5 - a5)(2 + 20 - 3). -152a*5 Expand (5o - o - 2o)(-6o + 1 - 4o - 3o). -26o*2 + 2o Expand (2z + 2z*3 - 2z)(0z*2 + 4z*2 - 2z*2) - 19z*5 - 33z*5 + 138z*5 - 72z*5. 18z*5 Expand -26f*3 + 5133f - 5137f - f3 + (f + 2f*2 - f)(3f - 3f - f) + 3f - 3f + f*3. -28f*3 - 4f Expand (g*2 + 0g*2 - 2g*2)(-g3 - 3 + 3) - g2 - 2g5 + g2 + (-5g*2 + 3g2 + g2)(-g3 + 5g*3 - 3g*3) + 561g*5 + 661g*5 - 332g*5. 888g*5 Expand (2k*2 - 7k*2 - 12k*2)(-3k - 37k - 11k + 8k - 26k). 1173k*3 Expand -25r - 12r + r + (-1 + 3 - 1)(18 + 3r - 18). -33r Expand (-g - 2g + 4g)(-41g*3 - 64g + 43g3 - 843g). 2g4 - 907g*2 Expand (-2 + 4 + 0)(0p + 3p + 0p) + 258 - 24p - 258 + (-4 - 1 + 3)(-3p + p + 0p) + (-p + 0 + 0)(-4 + 3 + 4). -17p Expand (6 - 6 - 2t)(3 - 1063t + 0 + 1093t). -60t*2 - 6t Expand (-13h - 26h + 0h)(0h4 - 2h4 + h4) + (0 + 0 - 1)(-3h*5 - 2h*5 + 3h*5). 41h*5 Expand (2v - 2v - 6v)((-v + 4v - 2v)(2 - 6 + 2) - 3v + 7v - v)(1 - 2 + 3). -12v*2 Expand -4f*2 + 5f2 + f2 + (3f - f - f)(0f + 2f + 8f) + (3 - 3 + 3f)(-2f - 2 + 2). 6f2 Expand (-6 - 3 + 11 + 1 - 4 + 2 - 4 + 4 - 2 + (-2 + 1 + 0)(-4 + 3 + 3) + 5 - 5 + 1)(0s + 3s - 2s)(-1 - 2s + 1)(4 - 1 - 4). -4s*2 Expand ((d - 3d + 0d)(2d4 + 5d*2 - 5d*2) + 2d5 - d5 - 2d5 + 2d - 2d + d5 - d5 - d5 + 3d*5)(-1 - 18 + 1). 54d5 Expand (-44x*2 + 32x*2 + 24x*2)(-5x3 + x3 + x3). -36x*5 Expand (-5b*2 + 6b*2 + 2b*2)(-3b2 - b2 + 2b*2) + 7b*4 - 2b*4 - 8 - b - 7b*4. -8b*4 - b - 8 Expand (-4y + 3y - y)((1 + 1 - 1)(-45 + 48 - 45) - 1 + 2 + 1)(1 - 1 + 2y). 160y*2 Expand 0l3 - l5 + 0l3 + (-14l*3 - 41l*3 + 12l*3)(6l2 - 3l*2 - 6l*2). 128l*5 Expand (-3p3 + p3 + 0p3)(p*2 + 1 - 1) - 21p*5 + 96p*5 + 4p*5. 77p*5 Expand (-24u + 4u + 10u)(0 + 0 - u + (7u - 3u - 2u)(2 - 1 - 2)). 30u*2 Expand (4r - 2r3 - 8r + r*3)((-3r - 2r + 3r)(1 - 3 + 0) + 0r + 3r - 2r + 74 - 74 + 17r + 4r - 4r + 2r). -24r*4 - 96r*2 Expand (-4g*4 - 6g + 6g)(-3 + 4 + 1)(-84g + 181g - 92g). -40g5 Expand (g - 7g - 27g)((1 - 1 - 1)(-4g + 6g - 3g) - g + 3g - g + 88 + 7g - 88). -297g2 Expand -2a*3 + 5a*2 - 5a*2 - 5 + (-2a - a + 5a)(-2a2 + 3a - 3a) + 0a + 2a3 + 0a + 2a3 - 5a*3 + 2a*3 + 213a*3 + 4a - 210a3 + 7a. -2a3 + 11a - 5 Expand (224f + 386f - 1548f)(-1 + 1 + f). -938f2 Expand (-5a*2 + 2a*2 + 2a*2)(-217 + 24a + 217) - 2a*3 + 3a*3 + 0a*3. -23a*3 Expand (-2u + 3u + 3u + 6u)(16u2 - 12u*2 - 12u*2). -80u*3 Expand -8r*5 + 4r*5 - 10r*2 + 10r*2 + 5r5 - r5 - 6r5 + (-4r*2 + 4r*2 + 2r*2)(-r3 - r3 + 0r3) - 2r5 + r5 - r*5. -12r*5 Expand (-4 + 6 - 5)(u2 - u2 - 2u2 + (2u - 5u + 5u)(0u - 2u + 6u) - 4u + 4u + u*2 + 2u - 2u + 2u*2). -27u*2 Expand -4i*2 - 2i*2 + 3i*2 + (-2i + 2i - i)(-3i - 2i + 7i) + (12 - 12 - 16i)(i + 3 - 3) - 4i*2 + 4i2 - i2. -22i2 Expand (2 - 2 + 2)(67 - 41 - 35)(-1 + 1 + k). -18k Expand 0z + 0z - 3z3 + 1 - 1 + 2z3 + z3 - 4 + 4 + (-2z - z + z)(-2z2 + 0 + 0) - 613 - 133z*3 + 613 + 2z*3 + 0z*2 + 0z*2. -127z*3 Expand 23x*2 - 3459x + 3459x + (x + 2x*2 - x)(0 - 3 + 2). 21x2 Expand -3p*3 + 0p*3 + 4p*3 + 13p*3 - 6p3 + p2 + 0p2 + (p + 3p - 3p)(-3p2 - 3p*2 + 4p*2). 6p3 + p2 Expand (-2 + 3 - 6)(7 - 2 - 8)(-u + 4 - 4)(4 + 3 - 5). -30u Expand (-3a - 2a + 0a)(4 + 2 - 5)(3a*3 - 4a*3 - 10a*3). 55a*4 Expand (4w*2 + 2w*2 + 0w*2)(-2 + 1 - 1)(8 + 2 - 4)(0 + 7 - 4). -216w2 Expand -z + 3z + 3z + 3z + 3z - 4z - 3 - z + 3 + (3 - z - 3)(-2 + 2 + 2) - 2z + 5z - 4z - 9 + 19 - 11z - 6. -8z + 4 Expand (z + 2z - 2z)(90z*2 - 2z*2 - 8z*2 + (-2z*2 + 6z*2 - 2z*2)(0 - 2 + 1)). 78z3 Expand 2p2 + p2 - p*2 + 2p4 + 0 - p4 + 0 + (4p - p - 2p)(2p*3 + 4p*3 - 4p*3). 3p*4 + 2p*2 Expand 46u*4 + 37u*4 + 54u*4 + (3 + 2 - 3)(3u4 + u4 - 2u*4). 141u*4 Expand (-1 + 1 - 3a*2)(4 - 4a2 - 4)(0a - a - 7a) + (0a - 2a + 0a)(2a4 + 2 - 2). -100a*5 Expand (-7o + 2o + 2o)(2o*4 + 0o4 - o4) - 90o4 - 20o*5 + 90o*4. -23o*5 Expand (-2h - 3 + 3)(2 + 0 - 4)(2h - 4 + 4)(-6 - 7 + 3). -80h2 Expand (n + 2 - 2)(-20n2 + 9n*2 - 3n + 12n2) + (5n*2 - 7n*2 - 15n*2)(-3 + 2n + 3). -33n*3 - 3n*2 Expand (145 + 236 + 27 - 70)(-3o5 + 2o5 - o5). -676o5 Expand ((-3 + 0 + 1)(a*2 - 3 + 3) - 4a2 - a2 - a*2)(2a2 - 5a*2 + 4a*2). -8a*4 Expand (0u - u - 3u)((2 - 1 - 3)(4 - 4 - 2) + 2 - 1 - 3 + 0 + 3 - 4). -4u Expand (-4 + 4 - 2y2)(y*2 - 2y2 - y2) + y4 + y4 - y*4 - 5y + 5y - 8y*4. -3y*4 Expand -1 + 1 + h + (-1 - h + 1)(4 - 17 - 12 + 6). 20h Expand (581 - 290 - 374)(-2b2 + b - b). 166b*2 Expand (0v + 1070v3 + 2v - 1076v3)(0v2 + 3v*2 - 2v*2). -6v*5 + 2v*3 Expand (-220d*3 + 5990d - 5990d)(2 - 6 + 3) + (-4 - 2d + 4)(3d2 - 3d*2 + 2d*2). 216d*3 Expand (-26d + 127 - 10d - 126)(-3d - 8 + 8). 108d*2 - 3d Expand 2o3 + 3o*3 - 2o*3 + (0o + o*2 + 0o)(0 + 0 - o) - 46o - 70o3 + 46o. -68o3 Expand (1 - 1 + w2)(601w + 140268 - 140268). 601w*3 Expand (-2q*3 + 0q*3 + 0q*3)(-1 + 0 + 10) + q - q - q*3 + (2 - 2 + 2q)(0q2 + q2 + 2q2). -13q*3 Expand 5w - 2w + 0w - w + 6w + w + (-2w + w - w)(-1 + 1 - 1) + w - w - 4w + (3 + 1 - 2)(-2w + 3w + w). 11w Expand (-6a3 + 4a3 + a3)(2a*2 + 0a*2 + 0a*2) + (-3 - 3 + 3)(2a5 + a5 + 2a*5) - a - 2a*5 + a. -19a*5 Expand (-2t + t - 2t)(139 + 246 - 125). -780t Expand ((2 - 2 + 3)(s*3 - 2s*3 + 0s3) - s3 - 3s3 - s3)(-1 + s*2 + 1). -8s*5 Expand (14 + 15 - 17 + 0 + 0 + 1 + (2 - 2 - 1)(0 - 3 + 2))(u2 - u2 + 3u*2). 42u*2 Expand 85w + 1688 - 1688 + 3w + 0 + 0 + 3w - 2w + 0w - 2w - 2w + 2w + 2w + 1 - 1 + (1 - 3 + 3)(2w - 2w + 2w) + 2w + 0 + 0 + 0 + 2w + 0. 95w Expand (45 - 54 - 30)(v - v + v) - 4v - 3v + 4v. -42v Expand 1777a2 - 1777a*2 - 17a*5 + (0 - a - 1 + 0)(-a*4 - 2a4 + a4). -15a5 + 2a*4 Expand (-3 + 3 + 3a)(10 - 40 - 10). -120a Expand (-2x - x + 2x5 - x5)(2 + 1 - 2) - 8x*5 - 221x*4 + 221x*4 + 1. -7x*5 - 3x + 1 Expand ((-9t - 7 + 7)(0t + 0t + t) - t*2 - 4t2 - t2)(6t + 3t - 2t). -105t3 Expand (n + 0n + n)(-2n2 + n2 - n*2) + 0n3 - n3 - n*3 + 316n*3 - 4n*2 - 7n*2 - 314n*3. -4n*3 - 11n*2 Expand (2k - 1 + 1)(-35k + 15k - 25k). -90k2 Expand (11c*4 - 22c*4 + 6c*4)(2 + 0 + 0)(-2 + 8 + 2). -80c*4 Expand (-4 + 2 + 5 + 2r)(-1 - 2 + 4)(-29 + 5 + 4). -40r - 60 Expand (-3 - 3 + 3)(r + 1 - 1 + 0 + 0 - 2r + (0 + r + 0)(1 + 3 - 5) - 2r + 10r + 0r). -18r Expand (3 + 2 - 6)(7 - 100i*3 + 105i*3 - 49i*3). 44i*3 - 7 Expand (0d - 3d + 6d)((4 - 2 - 6)(1 - 2 + 2) + 3 - 2 + 1). -6d Expand (3k - k + 0k)((-2 + 2 - k)(4 - 3 + 1) + 6k + 8k - 4k). 16k2 Expand (26c*2 - 27c + 26c + 4c*2 + 7)(4 + c*3 - 4). 30c5 - c4 + 7c3 Expand (2z + 2z3 - 2z)(-1 - z + 1)(-119 + 9z + 119). -18z*5 Expand (2y*2 + 2y*2 + 0y*2)(4 - y2 - 4 - y2 + 6y2 - 2y*2 + (4 - 2 - 1)(10 - 10 - y*2)). 4y*4 Expand (-26 - 307 - 120 + 76)(2 + 4 - 3)(3 - 3 + i). -1131i Expand (24 - 17 - 21)(-5x + 6x - 2x)(0 - 5 + 4)(1 - 2x - 1). 28x*2 Expand -37g*3 + 8g - 8g - 2g*3 + g - g + (1 + 1 - 3)(2g3 - 3g + 3g) - 5g*3 + 4g*3 + 2g3 - g3 + g2 - g2. -41g3 Expand 9629t*3 + t - 9625t*3 + 13t + 3t3 + 0 + 0 + 3t - 2t3 - 3t + (3 - t - 3)(2t*2 + 2t - 2t). 3t*3 + 14t Expand (0t2 + 3t2 - t2)(-2 + 0 + 1) - 9t + 19t2 - 31t + 38t. 17t*2 - 2t Expand 9*m	{ "pile_set_name": "DM Mathematics" }
026 Express (-14786r + 159195r*2 - 34997r*2 + 14786r)(-2r + 2r - 2r) in the form yr + gr*3 + ir*2 + q and give g. -248396 Rearrange (5g - 5g + 18g)(137g - 41g - 35g)(6g - 3g + g) to ag*2 + xg*3 + dg + m and give x. 4392 Rearrange 9 - 110056v2 + 110290v*2 + 2v - 29 to the form rv2 + t + bv and give r. 234 Express -192y - 85y*2 + 380y*2 - 93y*2 - 89y*2 - 95y*2 in the form b + gy*2 + ny and give g. 18 Express f*2 - 40f - 787659 - 2f2 + 787365 in the form vf*2 + q + af and give v. -1 Rearrange 29o2 + 2036o - 21o2 - 12o*2 + 309o to the form ho + a + to*2 and give a. 0 Rearrange -42 + 28661d - 28661d - 63d*2 + 157d*2 to the form h + ud + zd2 and give z. 94 Express -36 + 45t*3 + 42t2 + 20 - t4 + 16 - 61t3 as at*2 + wt*4 + ct + b + zt3 and give a. 42 Rearrange (4 + 1 - 2)(-1 - 8636w + 5 + 8095w) to the form o + tw and give t. -1623 Express 42 + 121 - 4r*2 + 0r + 0r + 14r - 13r in the form lr*2 + ir + t and give l. -4 Express (-3t + t + 0t)(-64106 - 64350 + 126713)(-4t - 3t + 5t) as pt*2 + h + kt and give p. -6972 Express 2k3 - k + k + (-9k*2 + 20k*2 + 8k*2)(87 + 72k - 87) as qk*3 + wk + xk2 + l and give q. 1370 Express (-2 + 2 + q2)(37 - 15 + 57)(141q - 159q - 112q) as sq3 + yq + cq2 + l and give s. -10270 Express 26q*2 - 6q - 27q2 + 1463q*3 + 5 - 1462q*3 as u + dq*3 + nq*2 + yq and give n. -1 Rearrange -1519 + 3a2 + 2a + 1461 + 31a2 to fa + h + na2 and give n. 34 Express 525h*2 - 423724h - 14 + 423726h + 14 in the form ih + o + wh2 and give i. 2 Rearrange -61118h + 61120h + 3h2 + h4 + 18h3 + 3h*4 to the form vh*2 + fh*3 + o + th*4 + xh and give v. 3 Express (3067p2 - 510p + 301p + 209p)(3 + 1 + 0) as qp*2 + kp + r and give r. 0 Rearrange 15 + f + 18f4 - 58 + 2f*3 + 84 - 16f*4 + 76 + 2f*2 to the form nf*4 + uf*2 + s + yf*3 + tf and give s. 117 Express -299252s + 299281s + 57s3 - s2 + 3s*2 as hs*3 + b + rs + ns2 and give r. 29 Rearrange -78x - 794x + 2x*2 - 1075x to n + tx2 + sx and give s. -1947 Rearrange -3y2 + 284 + y4 - 281 + y - 4y*2 + 8y*2 + 80y*3 to dy*4 + fy + j + hy2 + ny*3 and give j. 3 Rearrange 1024q + 315q + 2 - 2 to the form d + cq and give c. 1339 Express 14s + 9s + 421 + 15s - 625 as v + gs and give g. 38 Express -21 + 1486c + 6c*2 - 2966c + 1482c as w + xc*2 + rc and give r. 2 Rearrange -2q3 - 13q*2 - 3578 - 7q*3 + 1189 + 7q + 1195 + 1192 to the form a + tq3 + nq*2 + oq and give a. -2 Rearrange -503x - 508x - 22 - 447x + 1560x to the form k + ax and give k. -22 Express (-342k + 54k - 161k)(0k + 9 - 5 - 2k) in the form f + gk + ok2 and give g. -1796 Express (-37j - 57 + 57)(6 - 6 + 9) + (0j + 2j + 0j)(-3 - 3 + 4) as f + wj and give w. -337 Express (5m + 4 - 4)(-2416m3 - 2492m*3 + 4905m*3 - 35m*2 + 54m) + 0m4 - m4 + 0m*4 in the form um*3 + w + sm*2 + xm + vm4 and give u. -175 Rearrange -643a + 2548a + 1827a to qa + c and give q. 3732 Express -38292d + 76822d - 40557d + 3 as t + od and give t. 3 Rearrange (1 + 2 + 0)(-104129h4 - 106794h*4 + 204478h*4) to the form t + ph*3 + gh*2 + dh + ch4 and give c. -19335 Express -682a + 233a + 225a + 5379 + 226a as n + ha and give h. 2 Rearrange -982n + 177973 - 177972 + 3274n to the form s + tn and give s. 1 Rearrange (3d - 5d + 4d)(31 - 560 - 4584 + (1 + 2 - 4)(0 - 4 + 2))(0 - 1 - 1) to the form c + nd and give n. 20444 Express -6 - 54l2 + 7l*2 + 68l*2 - 5l + 3 as gl2 + pl + t and give p. -5 Rearrange (0f2 + 0f*2 + 3f*2)(-15f + 23 - 23 - 144f + 305f + 214f + (-f + f + f)(-5 + 1 + 3)) to the form bf + cf2 + y + vf*3 and give v. 1077 Express 153s + 37s4 + 6 - 4s*2 - 84s - 4 - 65s + 5s*2 in the form x + ls*4 + zs*3 + gs*2 + bs and give l. 37 Express 4y + 1227y - 4810y - 3156y as j + wy and give w. -6735 Rearrange -1 + 3g*4 + 1 + (0g*2 - 17g*2 + 6g*2)(-g2 + g2 + 2g2) to og*2 + zg*3 + mg*4 + cg + h and give m. -19 Express -66t + 53 + 161t - 9 + 181t + 63t in the form wt + f and give f. 44 Rearrange 391t - 737t + 342t + 709 to the form nt + w and give n. -4 Rearrange -222140 + 2w*2 - 2w*2 + 7w*3 + 222192 to the form mw + p + vw2 + jw*3 and give j. 7 Express (-1 + 4 - 1)(0n2 + 0n2 - n3) + 146726n3 - 146077n*3 + 36n - 30n in the form xn*2 + jn + kn3 + q and give j. 6 Rearrange (-5b + 6b + 651451 - 651370)(0b + 0b + 3b2) + 0b*3 + 0b3 + b3 to the form a + tb3 + ub*2 + qb and give u. 243 Rearrange -15l2 - 4l*2 + 1539 - 3l3 - 1542 + l3 to rl3 + nl*2 + ql + y and give y. -3 Rearrange -2l + l + 0l + (2 - 5 + 1)(2l + 0l + 0l) - 3l + 0l + 2l - 28l + 9l + 435l to x + ul and give u. 410 Rearrange 65g*2 + 84g*2 + 28g*2 - g + 6861 + 6859 - 13730 to the form ng*2 + mg + x and give n. 177 Express (-x - 3 + 3)(-3708 + 7382 - 3674 + 22582x*3) in the form jx*3 + ux*2 + hx*4 + rx + v and give h. -22582 Express -8201v + 18706v + 11005v + 6259v in the form dv + n and give d. 27769 Rearrange -36p*2 - 56 - 1278p + 2508p - 1232p + 147p2 to the form qp*2 + gp + d and give d. -56 Rearrange (1 + 2 - 4)(f + 4f - 4f) + 10 - 4f - 10 + (243 - 1 - 118)(2 + f - 2) + 2 - f - 2 to sf + c and give s. 118 Express (-160x2 + 36x*2 + 45x*2)(43 + 3 - 1) in the form yx + sx*2 + r and give s. -3555 Express 7i*3 - 3i*3 + 47i*3 + (-40i + 40i - 6i*2)(2 + 2 - 1)(1 - 2i - 1)(1 + 1 - 3) as o + ui*2 + pi + fi3 and give f. 15 Rearrange -13236287 + 13236287 - 38529p to the form vp + r and give v. -38529 Express 861n + 6n4 - n2 + 4 - 854n - 3n3 + 9 - 4n*2 + 7n*2 in the form vn*4 + bn + zn3 + wn*2 + r and give v. 6 Express 32 - 20 - 2281i + 14 - 27 - 2116i in the form h + pi and give h. -1 Rearrange 10288h2 - 18527h*2 + 4563h*2 to the form kh*2 + fh + v and give k. -3676 Express 2b4 - 2 - 4394b + b*4 - 50b*3 - 111b*3 + 4394b as ob4 + gb*3 + hb*2 + lb + w and give w. -2 Rearrange (3y - 5y + 3y + (2y + 0y - 4y)(-1 + 0 - 2))(22y - 2 - 23y - 64) to the form jy + my2 + s and give s. 0 Express 3 + h4 - 3 + (-8 - 4h2 + 8)(h + 3h2 - h) + (-6h - 3h3 + 6h)(8h + 13 - 13) in the form ih3 + qh + rh4 + ch*2 + k and give r. -35 Rearrange 35r - 6r2 - 79r + 30r + 14r + 170 to fr + g + xr*2 and give g. 170 Express 1 + 1278608x*2 - 3 - 1278313x*2 in the form nx + f + wx2 and give f. -2 Rearrange -2441 - 2k*3 - 49k*2 + 9k*2 - 93k*2 + 2k + 2449 - 5k2 to the form sk + lk2 + b + hk*3 and give b. 8 Rearrange -226r*2 + 5409r*3 + r - 1796r*3 + 2r*4 - 1792r*3 - 1807r*3 to the form wr*4 + lr + or3 + x + vr*2 and give o. 14 Express (-3f + 3f - 2f)(5f - 2f - 4f) - 3f - 2f*2 + 3f*2 + 4f - 160f + f2 - 152f + 331f as h + df*2 + lf and give l. 20 Rearrange 325l + 283l - 1 - 25l + 110l - 280l to the form kl + d and give d. -1 Express ((2 - 1 + 0)(4v - 3v + v) - 28v - 21v + v)(19 + 4 - 53) as g + mv and give g. 0 Rearrange 1 - 10307b*2 + 3 - 4 + 14343b*2 to z + tb + kb2 and give k. 4036 Rearrange (-1 + 0 + 0)((-2 + 4 - 4)(-35i*3 - 20i*3 + 107i*3) + (5 + 1 - 5)(-3i3 + 0i*3 + 4i*3)) to ji*2 + si + ai3 + m and give a. 103 Express 2390r + 1042244 - 1042244 as h + ar and give a. 2390 Express -30q*4 + 10q*4 + 14q*4 + (-6q + 0q - 7q)(0q*3 - 2q*3 + 4q*3) + 2q*4 + 0q4 - q4 as oq2 + tq*3 + gq + b + iq4 and give g. 0 Rearrange -1 - 2g*3 + 1 + (g + 2g*2 - g)(3g - g - 3g) - 65g3 - 12g*3 - 20g*3 + g - 9g*3 - g to the form yg*2 + qg*3 + dg + r and give q. -110 Express (2o - 3o - 2o)(-6 + 2 + 1)(21186 - 21186 + 252o) in the form yo2 + n + go and give g. 0 Rearrange -57y - 51y - 50y - 56y + 218y + 6y*3 + 10y*2 to the form ay*2 + py + gy3 + b and give a. 10 Express -7x*2 + 300x*3 + 26x + 1	{ "pile_set_name": "DM Mathematics" }
84) + -4 + sqrt(684) + -1 - (4sqrt(684)1 + sqrt(684)). -18sqrt(19) - 5 Simplify (-2(-4sqrt(77)1 - sqrt(77))/sqrt(7))*2. 1100 Simplify (sqrt(5) + (1sqrt(30))/sqrt(6))*2 + 0 + ((-1sqrt(5)4)2 - (sqrt(320) + 0 + sqrt(320))). -16sqrt(5) + 100 Simplify (sqrt(117)11)/(sqrt(72)/(-1sqrt(8))). -sqrt(13) Simplify (sqrt(187)/(sqrt(33)/sqrt(3))5)*2. 425 Simplify sqrt(1300) - 3sqrt(1300)1. -20sqrt(13) Simplify ((sqrt(112) + 0)-2 + sqrt(112))2. 112 Simplify 1 + sqrt(704) + -3 + sqrt(704)1. -2 + 16sqrt(11) Simplify (2sqrt(12)-3)/sqrt(4). -6sqrt(3) Simplify (sqrt(104)-1-3)/sqrt(8) - sqrt(130)/(sqrt(110)/(sqrt(44)/sqrt(4) + sqrt(11) - sqrt(11)) + sqrt(10)). 5sqrt(13)/2 Simplify ((sqrt(612) + -1 - sqrt(17)) + -3 + -5)2. -90sqrt(17) + 506 Simplify (3(-1 + (sqrt(252)1 - sqrt(252)))3)2. 81 Simplify -2 + sqrt(98) + -1 - sqrt(98). -3 Simplify ((2sqrt(85) + sqrt(85) + sqrt(85) - sqrt(85))/sqrt(5) + (sqrt(85) + -1sqrt(85))/sqrt(5) + sqrt(17) + -1)2. -8sqrt(17) + 273 Simplify (((sqrt(63)/sqrt(3) - sqrt(21)) + sqrt(21) - sqrt(21))1)/sqrt(3). 0 Simplify (-4 + sqrt(300) + sqrt(3) + sqrt(15)/sqrt(125))2. -448sqrt(3)/5 + 9808/25 Simplify 5(sqrt(539) + 1 + sqrt(11)). 5 + 40sqrt(11) Simplify ((sqrt(5600)-2 - sqrt(5600)) + sqrt(56))/(sqrt(64)/(sqrt(8)3) - sqrt(8)). 87sqrt(7)/2 Simplify -4(0 + sqrt(33)/(sqrt(11)2 + sqrt(11))). -4sqrt(3)/3 Simplify (sqrt(156) - sqrt(156)-14)/sqrt(12). 5sqrt(13) Simplify sqrt(396)/(sqrt(9) + (sqrt(225) - (-4sqrt(225) - sqrt(225)))). 2sqrt(11)/31 Simplify (sqrt(5) + sqrt(15)/sqrt(3))-4 - (sqrt(180) + 1). -14sqrt(5) - 1 Simplify (sqrt(324)/(sqrt(36)/sqrt(4)) + sqrt(36))/(sqrt(12) + (sqrt(12) - (sqrt(144)-1 + sqrt(144) + sqrt(144))/sqrt(12))). 2sqrt(3) Simplify 1 + (sqrt(64) + sqrt(4))/sqrt(2) + (-2sqrt(648))/sqrt(9). -7sqrt(2) + 1 Simplify sqrt(68)/(1sqrt(4)) + (-4(sqrt(17) + sqrt(68) - sqrt(17)))2. sqrt(17) + 1088 Simplify 4 + sqrt(36)/sqrt(2). 4 + 3sqrt(2) Simplify (3(sqrt(2) + sqrt(8)/sqrt(4)))2 + -1. 71 Simplify ((sqrt(2880) - -1sqrt(2880)) + sqrt(2880) + sqrt(2880))/(sqrt(490)-2). -24sqrt(2)/7 Simplify (sqrt(153) - 1sqrt(153)-5)/(sqrt(54)/(sqrt(24)/sqrt(4))). 6sqrt(17) Simplify (-6((sqrt(7) - (sqrt(21)/sqrt(3) + -5)) + 2))*2-3. -5292 Simplify (0 + sqrt(700))-4. -40sqrt(7) Simplify ((sqrt(171) + 1sqrt(171))2 + sqrt(171) - (5 + sqrt(171) + sqrt(171)-1))2 + 4. -150sqrt(19) + 4304 Simplify 4(sqrt(135)/sqrt(5) + sqrt(27))4. 96sqrt(3) Simplify -5((-1(-1 + sqrt(847)) + sqrt(847) - sqrt(847)) + 1). -10 + 55sqrt(7) Simplify 4 + (0 + sqrt(1584) + sqrt(1584))*2 + -4. 6336 Simplify 1 + sqrt(78)/(sqrt(6) + sqrt(150)-1). -sqrt(13)/4 + 1 Simplify 0 + -4 + sqrt(11) + 4 + sqrt(99). 4sqrt(11) Simplify (-2 + -1(sqrt(2) + -2sqrt(2) + 3 + sqrt(2)) + -5)2. 100 Simplify 0 + (0 + sqrt(637)-2 + sqrt(637))*2. 637 Simplify sqrt(39)/(sqrt(12)/sqrt(4))-4. -4sqrt(13) Simplify (sqrt(2448) + 0 + 3)2. 72sqrt(17) + 2457 Simplify (sqrt(2695) - (sqrt(2695) - (-2sqrt(2695) + sqrt(2695))))/((sqrt(11) - (sqrt(11) + sqrt(55)/sqrt(20))) + sqrt(11)). -14sqrt(5) Simplify (6-2sqrt(1088)3)2. 1410048 Simplify -1(1 + sqrt(3)) + sqrt(3) + (1 + sqrt(300))*2 + sqrt(300). 30sqrt(3) + 300 Simplify -3 + (-2 + (sqrt(1900) + 1 - sqrt(1900)))*2. -2 Simplify -4-5sqrt(112)4. 320sqrt(7) Simplify ((sqrt(320) - sqrt(320)-4) + sqrt(320) + 2)*2-6. -69144 - 1152sqrt(5) Simplify 3 + (1sqrt(99)-4)/sqrt(9). -4sqrt(11) + 3 Simplify (-2sqrt(42))/sqrt(6)23. -12sqrt(7) Simplify 4sqrt(28)/((sqrt(8) + sqrt(48)/sqrt(6))/sqrt(2)). 2sqrt(7) Simplify (1sqrt(228))/sqrt(12) + sqrt(76)-1. -sqrt(19) Simplify -3 + -2-2sqrt(19). -3 + 4sqrt(19) Simplify sqrt(208) - (3 + -3sqrt(208)). -3 + 16sqrt(13) Simplify (sqrt(78)/(sqrt(18)/sqrt(3)) + sqrt(1872)2)*2. 8125 Simplify -4(3 + sqrt(2299) + (sqrt(2299)2)2 - sqrt(2299)). -36796 Simplify (sqrt(2448) + sqrt(2448) + (sqrt(2448) - sqrt(2448)-1))*2 + 1. 39169 Simplify (4(-4 + sqrt(192)))*2. -1024sqrt(3) + 3328 Simplify (sqrt(3402)-2 - sqrt(42))/((sqrt(24) + sqrt(72)/sqrt(3))/sqrt(4)). -19sqrt(7)/2 Simplify 1(sqrt(26)/sqrt(18) + sqrt(13))2. 208/9 Simplify (sqrt(8) + sqrt(128))5. 50sqrt(2) Simplify (42(sqrt(75) - (-1 + sqrt(75) + -3) - sqrt(75)))2. -2560sqrt(3) + 5824 Simplify 6(sqrt(66)/sqrt(6) + -1 + sqrt(11)) + -2. -8 + 12sqrt(11) Simplify sqrt(5) - (sqrt(5) + 2 + -5) - 2sqrt(125). -10sqrt(5) + 3 Simplify -1 + 2sqrt(605). -1 + 22sqrt(5) Simplify ((-2sqrt(70)6 - sqrt(70))/(-2sqrt(810) + sqrt(810) - sqrt(810)))2. 1183/324 Simplify 3 + (sqrt(99) + 1 + sqrt(99))2 + 4. 12sqrt(11) + 404 Simplify (-1sqrt(500) + 1 + 6(sqrt(500) - (sqrt(500) + 2) - sqrt(500)))*2. 1540sqrt(5) + 24621 Simplify (sqrt(200)/((sqrt(5)1 - sqrt(5)) + sqrt(5)))/(sqrt(72)2). sqrt(5)/6 Simplify (sqrt(147) + 0)-15. -35sqrt(3) Simplify -2 + (-2sqrt(243) + sqrt(243))*2 + sqrt(243). 9sqrt(3) + 241 Simplify (sqrt(325))*21 + sqrt(13) - (sqrt(1573)1 - sqrt(13)). -9sqrt(13) + 325 Simplify 5 + (sqrt(2) - (0 + sqrt(6)/sqrt(3))). 5 Simplify (sqrt(1617)1)/((sqrt(77) + (sqrt(77)2 + sqrt(77) - sqrt(77)))/sqrt(7)). 7sqrt(3)/3 Simplify (sqrt(70) + ((sqrt(70) - sqrt(70)-4 - sqrt(70))5 - sqrt(70) - sqrt(70)) - sqrt(70))/sqrt(10) + 5. 5 + 18sqrt(7) Simplify ((sqrt(76)-1 - sqrt(76))5)/(sqrt(196) + (sqrt(196)-3 + sqrt(196) - sqrt(196))). 5sqrt(19)/7 Simplify (sqrt(3) + 5 + (sqrt(27))*2)6. 6sqrt(3) + 192 Simplify 3((sqrt(6)/sqrt(3) + 1)*2 - (1 + sqrt(2) + 3 - sqrt(2))). -3 + 6sqrt(2) Simplify 2(sqrt(847) + 2) + ((sqrt(847) + 1)-4)*2. 374sqrt(7) + 13572 Simplify (-5(sqrt(1053)-2 - sqrt(1053)) + sqrt(1053) + 5)*24. 5760sqrt(13) + 1078372 Simplify -2(-2sqrt(252))2. -2016 Simplify (6sqrt(120)/sqrt(4))/((sqrt(60) + sqrt(960))/sqrt(10) - sqrt(6)). 3sqrt(5)/2 Simplify -5 + (sqrt(4) - (sqrt(4) + sqrt(64)))/sqrt(2)5 + 3. -20sqrt(2) - 2 Simplify (sqrt(1620) - (sqrt(1620) + sqrt(1620)-1 + sqrt(1620)))/((sqrt(10) + sqrt(90))2). 0 Simplify ((-5 + sqrt(78)/sqrt(6))6)*2. -360sqrt(13) + 1368 Simplify (1sqrt(144)/sqrt(6))/(sqrt(48)/(sqrt(18)/sqrt(3))). sqrt(3) Simplify 0 + sqrt(243) + (sqrt(9)/sqrt(3)2)*2. 12 + 9sqrt(3) Simplify ((sqrt(88)3)/sqrt(2))/sqrt(4). 3sqrt(11) Simplify (((0 + sqrt(176))5 - sqrt(176))2 - (3 + -1 + sqrt(176) - sqrt(176))2)6. 16872 Simplify (sqrt(21)/(-1sqrt(7)))2 + 0. 3 Simplify (sqrt(27) - (sqrt(135)/sqrt(5) + sqrt(27))-6) + 5 + sqrt(27)1. 5 + 42sqrt(3) Simplify sqrt(2448) + (sqrt(2448) + -1 + -1)*2. -36sqrt(17) + 2452 Simplify -1(sqrt(1700) + -2). -10sqrt(17) + 2 Simplify (sqrt(84)/(sqrt(36)/sqrt(3) - sqrt(12) - sqrt(12)) + (sqrt(7) - sqrt(35)/sqrt(5)5 - sqrt(7)))2. 252 Simplify ((sqrt(2057) - -5sqrt(2057)4) + sqrt(2057))2. 995588 Simplify -4 + sqrt(130)/(-5sqrt(20)/sqrt(2) - sqrt(10)). -4 - sqrt(13)/6 Simplify -6(3 + sqrt(13)) + -4. -22 - 6sqrt(13) Simplify 6(-3 + sqrt(7) + 2). -6 + 6sqrt(7) Simplify (sqrt(19)52 - 6sqrt(76)/sqrt(4))2. 304 Simplify 2 + -3 + sqrt(112) + 0. -1 + 4sqrt(7) Simplify -1(sqrt(17) + 0 + 4)3. -3sqrt(17) - 12 Simplify (1 + sqrt(5))2 + -3 + -3sqrt(5)2. -4sqrt(5) + 3 Simplify (sqrt(540)/sqrt(6))/(sqrt(5) + (sqrt(180) - (sqrt(180) - sqrt(180)-2)) + sqrt(5)) + 1. -3sqrt(2)/10 + 1 Simplify 4(-1 + sqrt(320) + 3). 8 + 32sqrt(5) Simplify ((sqrt(625) - sqrt(25))1)/(-4sqrt(605) + sqrt(605) - sqrt(5)). -2sqrt(5)/17 Simplify 1 + sqrt(2448)4. 1 + 48sqrt(17) Simplify (sqrt(77)/(sqrt(99)/sqrt(144)))23. 336 Simplify ((sqrt(245) + -1)2 - sqrt(5)) + -1 + sqrt(125) + ((sqrt(5) + (sqrt(5) - (sqrt(500) + 0)))2 + sqrt(5))1. -9sqrt(5) + 565 Simplify (-5 + (-2 + sqrt(252) - sqrt(252)))*2 + 0 + sqrt(252) + -5. 6sqrt(7) + 44 Simplify (sqrt(60) + sqrt(180)/sqrt(3))/sqrt(12) + -1 + sqrt(5) + -5. -6 + 3sqrt(5) Simplify 1 + (5(sqrt(2) + -1) - sqrt(2)). -4 + 4sqrt(2) Simplify 3((sqrt(49) - sqrt(196)/sqrt(4))/sqrt(7) + sqrt(7)). 3sqrt(7) Simplify ((-1sqrt(700) - sqrt(700)) + -3)*2. 120sqrt(7) + 2809 Simplify (-5sqrt(125)-1 + -4)*2. -200sqrt(5) + 3141 Simplify (((sqrt(26) - sqrt(416))4)/(5sqrt(32)))*2. 117/25 Simplify 2(sqrt(2448) + 0)35. 360sqrt(17) Simplify (sqrt(15)/(sqrt(147) + sqrt(3)) + -2)*2. -sqrt(5)/2 + 261	{ "pile_set_name": "DM Mathematics" }
-3. Sort f, 4, r in ascending order. r, f, 4 Let k = -41 - 11. Let j = 51.7 + k. Sort 2/11, j, 0.5, 0.2 in decreasing order. 0.5, 0.2, 2/11, j Suppose 0 = d + 4c + 7, -5d + 1 = -c - 27. Put d, 2/3, 0.5, 11 in descending order. 11, d, 2/3, 0.5 Let u(q) = -2q3 - 99q*2 + 53q + 150. Let m be u(-50). Put m, -59, -1 in descending order. m, -1, -59 Let g be (3 + -1)9/(-42). Let m = -278.1 + 253. Let u = 25 + m. Sort g, u, 0 in decreasing order. 0, u, g Let j = 0.3 - 0.1. Let v = 101 - 101.78. Let y = 0.38 + v. Put -2/7, y, j in ascending order. y, -2/7, j Let f = -5.4 + 5. Let u(l) = -4l*2 + 385l + 289. Let t be u(97). Put -1/11, f, -4, t in decreasing order. -1/11, f, t, -4 Let j be ((-36)/(-15))/((-3)/(-10)). Suppose 4 + j = 4a, -2a = -4o + 54. Let i = 11 - o. Put i, 2, 1 in descending order. 2, 1, i Suppose -108 = -21f + 9f. Put 4, -4, 5, f in descending order. f, 5, 4, -4 Let b = 40 + -36. Let d(i) = i3 - 8i*2 + 6i + 10. Let z be d(7). Sort 0, b, z in decreasing order. b, z, 0 Let k = 0.2 - 0.6. Let g = -0.8 - 0.2. Let r = -181 + 178. Sort g, k, r. r, g, k Let b = 96 + -91. Let z = 46 - 24. Sort z, -2/5, b in ascending order. -2/5, b, z Suppose -g + 0x = -3x + 1, -9 = 3g - 3x. Suppose 0 = -u - 3t - 8, -t - 4t = 20. Let s = -9 + u. Sort -3, g, s. s, g, -3 Let b be 14/21 - (-377)/(-39). Put -4, -5, b in descending order. -4, -5, b Let f(j) = -j*3 - 3j*2 - 2j - 10. Let y be f(-3). Sort 2/49, y, 2 in decreasing order. 2, 2/49, y Let o = -2.46 - -0.46. Let z be 4/1010/(-14). Sort o, z, 2. o, z, 2 Let c = 8 - 17. Let h = c - -7. Let d = 12 - 17. Sort -3, d, h in descending order. h, -3, d Let g = -0.2745 - 0.1255. Let a(o) = -o + 4. Let m be a(6). Sort 87, m, g in decreasing order. 87, g, m Let r = 0.1995 - -3.8005. Sort r, -1/2, -3.16 in increasing order. -3.16, -1/2, r Let k be -1 + 1 - (-4 + 8 + -9). Sort -2, 2, -1, k in ascending order. -2, -1, 2, k Let b be 3/9 + (-104)/(-12). Suppose -c - 11 = -b. Sort -11, -3, 1, c in increasing order. -11, -3, c, 1 Suppose 0p + 3p - 20 = -4w, -p + 5w = 6. Let x = 47 - 51. Let s be (-3)/(x/(2 + 2)). Put -3, p, s in increasing order. -3, s, p Let r = -11212/319 - -1014/29. Let h = -2/313 + -35989/939. Let x = 2191/57 + h. Put r, x, -0.4 in ascending order. -0.4, r, x Let d = -2 + 1. Let s(h) = -h2 - 12h - 8. Let b be 0/(-3 - 0) + (-9 - 1). Let f be s(b). Sort 2, d, f in decreasing order. f, 2, d Let n = -768 + 765. Sort 5, n, -6, 0.1 in decreasing order. 5, 0.1, n, -6 Let d = -11.2 - -11.5. Sort d, 4, -0.81 in ascending order. -0.81, d, 4 Let f = 10 + -13. Let p = f + 6. Suppose 2s - s = -5i + 16, 28 = -3s + 4i. Sort p, s, -2 in ascending order. s, -2, p Let d = 0.17 + -92.17. Let k = d - -96.7. Let z = -5 + k. Sort -2, -5, z. -5, -2, z Let y(i) = i*2 - i + 1. Let m be y(1). Let j be 2 + 0 + -1 + m. Suppose -5l + 299 = 4k + 290, 2l - 2k = 0. Put 4, l, j in descending order. 4, j, l Suppose 5t + 0t = 30. Suppose 4p - p = t. Put -3, p, -4 in decreasing order. p, -3, -4 Let b = -118.272 - -0.272. Let m = b + 117.7. Let t = -2 - -1. Put -1/2, t, m in decreasing order. m, -1/2, t Suppose -4n + 28 = -3n + 5v, n - 4v = -8. Suppose nj - 7 = -39. Put j, 5, 4 in ascending order. j, 4, 5 Let c = 2.017 - 1.617. Let p = -6 + 10. Sort -1/4, c, p, 0.1. -1/4, 0.1, c, p Let j = -217 + 217. Put 5, -2/9, j, 1 in decreasing order. 5, 1, j, -2/9 Let l = 2 + -2.98. Let t = l + -0.02. Sort 0.2, t, -0.1 in decreasing order. 0.2, -0.1, t Let c(i) = -19i + 582. Let r be c(31). Suppose -z - 2w + 10 = 0, 6w = -4z + w + 31. Put r, -4, z, 3 in decreasing order. z, 3, -4, r Let t = -969 + 972. Put 6/11, -2/3, t, -0.2 in increasing order. -2/3, -0.2, 6/11, t Let d(g) = 4g*2 + 117g - 88. Let q be d(-30). Let t be (-1 - 0) + 6 + 0. Put q, -3, t in descending order. t, q, -3 Let b(z) = z*3 - 18z*2 + 33z - 16. Let i be b(16). Sort -5, 24, 5, i. -5, i, 5, 24 Let u = -81 - -83. Let h be (105/6)/7(-4)/5. Put u, 3, h in ascending order. h, u, 3 Let v = -75 + 176. Let j = v - 103. Sort j, 4, 9 in descending order. 9, 4, j Let u(p) = p3 - p - 1. Let g be 3 - (-5 + (-42)/(-6)). Let a be u(g). Suppose -5n + 5q = 40, 5q - 27 + 7 = 0. Put n, a, 5 in ascending order. n, a, 5 Let r be ((-3600)/(-81))/16 + 6/(-2). Sort -0.1, -1, -77, r in increasing order. -77, -1, r, -0.1 Let l(g) = -g*3 + 6g*2 - 5g + 1. Let q be l(5). Let f(i) = i - q + 2 - 5. Let c be f(4). Sort c, -2, 3 in decreasing order. 3, c, -2 Let k(p) = p*2 - 3p - 6. Let y be k(5). Suppose -8 = 4z - 2v, -5z + 0z - v = 24. Sort y, z, 0 in increasing order. z, 0, y Let c = -0.9 - -1. Let j = 0.18 - c. Let z = 0.18 - j. Sort 5, 0, z in increasing order. 0, z, 5 Let a = 95 - 575/6. Let q be (84/50)/((-342)/(-60)). Let p = 2/19 + q. Put -4, p, a in descending order. p, a, -4 Suppose -u + 2g - 15 = -6u, 4u = -2g + 10. Let d = 8 + -2. Let b be (2/d)/(1 - (-4)/(-6)). Put -3, b, u in increasing order. -3, b, u Let v = -6 - -4. Suppose 0a = -10a + 50. Suppose 0t - 30 = 2t + 4b, -2t + 4b = -10. Sort v, a, t in increasing order. t, v, a Let t = 1 - 0.9. Let v = 170 - 387/2. Let c = -23 - v. Put c, t, 3 in decreasing order. 3, c, t Let o be -3 - 28/(-6) - 31/93. Put 1/21, 0.2, -5/6, o in descending order. o, 0.2, 1/21, -5/6 Let u = -18.7 + -57.3. Let y = u - -78. Let p = 6/7 - 31/28. Sort p, y, -1/2. -1/2, p, y Let a be -4 + 2/(-10) - -4. Let x = 3.81 - -0.19. Let d = -0.03 - -0.33. Sort a, d, x in descending order. x, d, a Let v(j) = -j3 + 12j*2 + j - 9. Let k be v(12). Suppose -kg = 1 - 16. Sort 3, 0.2, 1/8, g in decreasing order. g, 3, 0.2, 1/8 Let g = 124 + -111. Sort 2, 4, -3, g in increasing order. -3, 2, 4, g Let k(o) be the second derivative of -o4/12 + o3 + 6o2 + 17o. Let q be k(8). Sort 1, 2, q, 0 in ascending order. q, 0, 1, 2 Let l be 11/(-3) + 44/66. Let o(n) = -n - 19. Let k = -35 - -20. Let i be o(k). Sort l, 14, i in ascending order. i, l, 14 Suppose -3a = -2p + 21, -5p = 4a + 46 - 18. Let l be (a/(-21))/(1/(-9)). Let n = -34 - -28. Put l, n, -2 in decreasing order. -2, l, n Suppose -164 = 5s - 24. Let k be (-176)/s - 2/7. Sort 2, -1, k in increasing order. -1, 2, k Let r = -0.65 - -0.35. Let l = 28 + -28. Let m = -5 - -4.6. Sort r, l, m. m, r, l Let v = 11.8 - 13. Let a = v - -2.2. Sort a, 0.5, 0.9 in decreasing order. a, 0.9, 0.5 Let q = 470 + -465. Put -2/5, q, -1/3, -0.2 in decreasing order. q, -0.2, -1/3, -2/5 Let i = 16 - 16. Suppose -4a - 1 - 5 = -r, -4r + 5a = -13. Put r, 4, 5, i in decreasing order. 5, 4, r, i Suppose -2l = 5c - 4, -8c + 3c + l + 13 = 0. Suppose i = -ci + 18. Put -3, -1, i in ascending order. -3, -1, i Let z = 19.6 - 19.62. Sort 1/2, z, 4, 2/5 in decreasing order. 4, 1/2, 2/5, z Let o = 36 + -32. Let p be 3/((-1)/(o/6)). Put 0, 3, p in decreasing order. 3, 0, p Let t = 90 - 97. Put 7, -3, -1/3, t in descending order. 7, -1/3, -3, t Let a be ((-6 - -1) + -1)24/(-48). Let d(x) = 3x - 9. Let c be d(a). Let r(g) = g2 + 2g - 3. Let n be r(2). Put c, -2, n in decreasing order. n, c, -2 Let y(r) = r*2 - 5r + 3. Let d be y(5). Let o be (d + 87/(-30))1. Let a = 0.02 - 4.02. Sort 0.3, o, a in decreasing order. 0.3, o, a Let i(v) = -v2 + 4v + 1. Let z be i(5). Let w be 5/(-2)z/45. Sort -2, -1, w. -2, -1, w Suppose -12 = -4x - 2w - 0w, -w = -x. Suppose 0 = n + 3m + 8, -m = -x + 3. Let p(k) = k3 + k2 - 1. Let s be p(1). Sort n, -2, s in descending order. s, -2, n Let k(g) = g3 - 2g*2 + 6. Let r be k(0). Let d be (2/(-3))/(r/9). Sort 5, 4, d in descending order. 5, 4, d Let d(r) = -10r - 83. Let q be d(-9). Let a(g) = g*3 - 5g*2 - g. Let n = -8 - -13. Let c be a(n). Put 3, c, q in decreasing order. q, 3, c Let t = 1.671 + -1.471. Suppose -12 = 3n - 30. Sort 3/4, n, t in decreasing order. n, 3/4, t Let p = -0.19 + 9.99. Let r = 1.2 + p. Let g = 11.1 - r. Put -1/6, 1/5, g in ascending order. -1/6, g, 1/5 Let k(i) = -11i + 200. Let d be k(18). Sort d, -31, 3, 5 in increasing order. -31, d, 3, 5 Suppose 2y - 2g = -0 + 4, -4g - 8 = 0. Put -2/13, 0.5, y in ascending order. -2/13, y, 0.5 Let u = -10 + 18. Let w be (u - 10)/(12/15). Sort w, 2, 0.3 in decreasing order. 2, 0.3, w Let i be 1*((-27)/(-12) - 2). Let m be 6 + (-9 - 185/(-65)).	{ "pile_set_name": "DM Mathematics" }
0, -7/2, -51 Sort 1, -10, 0 in decreasing order. 1, 0, -10 Sort 5, -3, -2/15 in descending order. 5, -2/15, -3 Sort -2, 1, 2/71, 27. -2, 2/71, 1, 27 Sort 0.03, 4/5, 0.5, -1 in descending order. 4/5, 0.5, 0.03, -1 Sort 3/7, -3, -0.03, 4 in increasing order. -3, -0.03, 3/7, 4 Put -5, 8, -32, 2 in descending order. 8, 2, -5, -32 Sort -2/3, -0.2, 15 in increasing order. -2/3, -0.2, 15 Put 169, 2, 3 in increasing order. 2, 3, 169 Sort -0.1, 249, -4, -4/5 in ascending order. -4, -4/5, -0.1, 249 Put -5, -3, 2, 25 in descending order. 25, 2, -3, -5 Sort 3, -11, 0 in descending order. 3, 0, -11 Sort 0.08, -2/11, -0.3, 0.5, 8/5 in ascending order. -0.3, -2/11, 0.08, 0.5, 8/5 Sort -1, 2, -2657 in ascending order. -2657, -1, 2 Sort 1, -42, 83, -2 in descending order. 83, 1, -2, -42 Sort 3, -10, -1 in ascending order. -10, -1, 3 Put 2, 1, 24, -3 in increasing order. -3, 1, 2, 24 Sort -2/3, 1/4, -2/63. -2/3, -2/63, 1/4 Put -20, 0.016, -0.2 in descending order. 0.016, -0.2, -20 Put 13, 5, -1, 4 in descending order. 13, 5, 4, -1 Sort -2, -1/6, -2/5, 1/7 in descending order. 1/7, -1/6, -2/5, -2 Sort 0, 6, 2, -8, -5. -8, -5, 0, 2, 6 Sort -2, -21, 2, -3, -4 in ascending order. -21, -4, -3, -2, 2 Put 0.4, -32, -2, -4 in ascending order. -32, -4, -2, 0.4 Sort -0.4, 8, -0.6 in increasing order. -0.6, -0.4, 8 Sort -4, 10, 3, 4, 2. -4, 2, 3, 4, 10 Sort 2/15, -3, 30, 0. -3, 0, 2/15, 30 Sort -58, -13, 2 in increasing order. -58, -13, 2 Put 6, 7, 4, -4 in ascending order. -4, 4, 6, 7 Put 3, -1, -7, 1.6 in increasing order. -7, -1, 1.6, 3 Put -2, -5, 7, 5, 0 in ascending order. -5, -2, 0, 5, 7 Put 0.2, 1, 107 in decreasing order. 107, 1, 0.2 Put 1, 262, -3.6 in decreasing order. 262, 1, -3.6 Sort 113, -0.5, -1, 1/5 in decreasing order. 113, 1/5, -0.5, -1 Sort 37, -5, 3 in decreasing order. 37, 3, -5 Sort 19, -4/3, -4 in decreasing order. 19, -4/3, -4 Sort 0.03, -1/3, 2/17. -1/3, 0.03, 2/17 Sort 11, -1, -59, -3 in ascending order. -59, -3, -1, 11 Sort -57, -4, -5, 1/5, -3 in decreasing order. 1/5, -3, -4, -5, -57 Put 3, 1, -82 in decreasing order. 3, 1, -82 Put 10/9, -2, -5 in descending order. 10/9, -2, -5 Sort 4, 38, 128 in ascending order. 4, 38, 128 Sort 24, -2/9, 2 in decreasing order. 24, 2, -2/9 Sort -4, -0.2, -0.16, -0.1. -4, -0.2, -0.16, -0.1 Put -1, 7.1, -35, -4 in ascending order. -35, -4, -1, 7.1 Put 8, 13, 4, -1 in decreasing order. 13, 8, 4, -1 Sort 0.5, 39, 7, -0.4. -0.4, 0.5, 7, 39 Sort -2, -3, 9, -4, -14. -14, -4, -3, -2, 9 Put 6, -1122, -4 in decreasing order. 6, -4, -1122 Sort 4, 17, 3, 57. 3, 4, 17, 57 Sort 1, -42, -11 in descending order. 1, -11, -42 Sort 5, 4, 34 in decreasing order. 34, 5, 4 Put 5, 0.3, -454 in descending order. 5, 0.3, -454 Sort 1/3, -6/487, 1 in descending order. 1, 1/3, -6/487 Sort 7, 42, -2. -2, 7, 42 Sort -16, 5, -3 in decreasing order. 5, -3, -16 Sort -3, 0, 3, -5, 89 in descending order. 89, 3, 0, -3, -5 Sort -5, 36, 4, -21, -2 in decreasing order. 36, 4, -2, -5, -21 Sort 4, 55, -9, -3. -9, -3, 4, 55 Sort -34, 0, -2, -5. -34, -5, -2, 0 Sort 1/3, 493, -4/7 in decreasing order. 493, 1/3, -4/7 Sort 1/23, 0.5, -5, 0.063, 2/5. -5, 1/23, 0.063, 2/5, 0.5 Put 12.2, 55, 0.2 in decreasing order. 55, 12.2, 0.2 Put 3, 20, -7, 5 in descending order. 20, 5, 3, -7 Sort -13/5, -4, 0.5, -5/4 in increasing order. -4, -13/5, -5/4, 0.5 Put 1/8, 0.5, -4, -21 in increasing order. -21, -4, 1/8, 0.5 Sort -90, 0, -43. -90, -43, 0 Sort -4.4, 2, -2, 0.04 in decreasing order. 2, 0.04, -2, -4.4 Put -10, -5, 5, -105 in descending order. 5, -5, -10, -105 Put -4/15, 0.5, 3/8, -4 in descending order. 0.5, 3/8, -4/15, -4 Put 6, 4, 3 in ascending order. 3, 4, 6 Sort -61, 0.3, 0.5 in increasing order. -61, 0.3, 0.5 Sort 5, -5, 2, 105 in increasing order. -5, 2, 5, 105 Sort 9, 2, -11, -8 in decreasing order. 9, 2, -8, -11 Sort 5, -1, 87 in descending order. 87, 5, -1 Put 0, 0.3, -22, 3 in descending order. 3, 0.3, 0, -22 Put 8, 2, 6, 4 in decreasing order. 8, 6, 4, 2 Sort 3, 5, 1, 452. 1, 3, 5, 452 Put 5, -2, 3, 8 in ascending order. -2, 3, 5, 8 Sort -18, -3/4, 0, 0.4 in ascending order. -18, -3/4, 0, 0.4 Put -5, -4, 6, 186, -2 in increasing order. -5, -4, -2, 6, 186 Sort 7, -37, -5 in increasing order. -37, -5, 7 Put -2/19, -122, -9, 3/7 in decreasing order. 3/7, -2/19, -9, -122 Sort 5, 2, 102, 0, -2. -2, 0, 2, 5, 102 Put -1/2, 2/5, 1, 51 in increasing order. -1/2, 2/5, 1, 51 Put 4, -0.09, -7/19 in decreasing order. 4, -0.09, -7/19 Put -1/8, -0.1, 2, 3/2 in ascending order. -1/8, -0.1, 3/2, 2 Sort 1, -3, 1/2, 5. -3, 1/2, 1, 5 Sort -0.5, 3, 0.04 in descending order. 3, 0.04, -0.5 Sort 0, 1/28, 1 in descending order. 1, 1/28, 0 Put 1, 25, -1, 5 in descending order. 25, 5, 1, -1 Put -1, 6, -13, 0, 2 in decreasing order. 6, 2, 0, -1, -13 Put -2, 1, 2, 36 in ascending order. -2, 1, 2, 36 Sort -3, 2868, 2 in increasing order. -3, 2, 2868 Sort 4, 3, 13 in ascending order. 3, 4, 13 Sort 1/2, -10, 0.1, -0.06 in decreasing order. 1/2, 0.1, -0.06, -10 Sort 0, -3, -5, 30 in ascending order. -5, -3, 0, 30 Sort -2, 2/21, -4, 2/9, 2/11. -4, -2, 2/21, 2/11, 2/9 Sort 3, -23, -13, -5, 1 in ascending order. -23, -13, -5, 1, 3 Sort 3, -135, -4 in descending order. 3, -4, -135 Put -22, -4, 188/5 in decreasing order. 188/5, -4, -22 Put 4, -9, -77 in decreasing order. 4, -9, -77 Sort -3, 3, 6, 2, 20 in descending order. 20, 6, 3, 2, -3 Put 4, -0.4, -5, 8, 34 in decreasing order. 34, 8, 4, -0.4, -5 Put -11, -2/9, -2/17 in descending order. -2/17, -2/9, -11 Sort -3/4, 4/7, -2810. -2810, -3/4, 4/7 Put -2/53, -1/2, 3, -4 in ascending order. -4, -1/2, -2/53, 3 Put -14, -5, -3 in descending order. -3, -5, -14 Put -2, 2731, -1 in ascending order. -2, -1, 2731 Sort 95, 3, -0.2, -5. -5, -0.2, 3, 95 Put -3, -2/9, -3.7 in descending order. -2/9, -3, -3.7 Put 4, 1/8, -68/9, 8 in decreasing order. 8, 4, 1/8, -68/9 Sort -47, 2/17, -2, 3 in descending order. 3, 2/17, -2, -47 Put 5, 11, 2/7, -1 in decreasing order. 11, 5, 2/7, -1 Put 72/17, 0.4, -1/2 in ascending order. -1/2, 0.4, 72/17 Put 2, -3, -90, 3, 10 in decreasing order. 10, 3, 2, -3, -90 Sort -116, -2, -3, 4. -116, -3, -2, 4 Put -768, 0.4, 0, -1/3 in increasing order. -768, -1/3, 0, 0.4 Sort -1, 3, 37, 2 in descending order. 37, 3, 2, -1 Put 4, 5, -7, -6 in decreasing order. 5, 4, -6, -7 Put 0, -3, 30, -5, -2 in increasing order. -5, -3, -2, 0, 30 Put -4, 147, -19, -3 in ascending order. -19, -4, -3, 147 Put 1, -14, 4, 2.9 in increasing order. -14, 1, 2.9, 4 Sort -144, 1/6, 0 in ascending order. -144, 0, 1/6 Put 3, -2, 30 in descending order. 30, 3, -2 Sort -2, -6, 2, -5 in decreasing order. 2, -2, -5, -6 Sort -4, 0.01, -1/4, -16. -16, -4, -1/4, 0.01 Sort 9, 2, -3, -2 in ascending order. -3, -2, 2, 9 Sort -3, -4, 5, 1/2, -13 in decreasing order. 5, 1/2, -3, -4, -13 Sort -2/53, -4, 0.1, -3 in ascending order. -4, -3, -2/53, 0.1 Sort -5, -3/5, -81 in decreasing order. -3/5, -5, -81 Sort 2, -3, -109, 5 in descending order. 5, 2, -3, -109 Sort -354, -2/5, -0.1, -1, 0.1 in descending order. 0.1, -0.1, -2/5, -1, -354 Sort 0.3, -0.019, 4 in descending order. 4, 0.3, -0.019 Put 4, -7, 6, -4 in descending order. 6, 4, -4, -7 Put 0, 2, -1, 7 in increasing order. -1, 0, 2, 7 Sort -1, 3, -99 in decreasing order. 3, -1, -99 Sort -2, 1, -4, 5 in decreasing order. 5, 1, -2, -4 Put 2, 4, -3, 3 in descending order. 4, 3, 2, -3 Sort 3, -3, 11, 2.6. -3, 2.6, 3, 11 Sort 1573, 5, 1. 1, 5, 1573 Sort -2, 1/7, 2/3, -19 in descending order. 2/3, 1/7, -2, -19 Sort 3, 4, 268 in decreasing order. 268, 4, 3 Put 3, -29, 33 in descending order. 33, 3, -29 Sort -1/28, 0.3, -4 in increasing order. -4, -1/28, 0.3 Put -2, 2, 139, -1/3 in descending order. 139, 2, -1/3, -2 Sort 1, 34, 4 in decreasing order. 34, 4, 1 Put 4, 12, 0, -13, 1 in decreasing order. 12, 4, 1, 0, -13 Put 65, 0, 2, -2, 5 in decreasing order. 65, 5, 2, 0, -2 Put -54, 9, -5, -2 in descending order. 9, -2, -5, -54 Sort -10, 4, -0.3, -1, 0.09 in decreasing order. 4, 0.09, -0.3, -1, -10 Sort 9, 57, -2. -2, 9, 57 Put -4, 1, 5, 32 in descending order. 32, 5, 1, -4 Put 15/7, -5, -2 in decreasing order. 15/7, -2, -5 Put -4, 0.5, 20, 5 in decreasing order. 20, 5, 0.5, -4 Put -17, 1, 3, -2 in decreasing order. 3, 1, -2, -17 Put 31/2, -4, 5, -5 in descending order. 31/2, 5, -4, -5 Put 0, -26, 1, 2 in ascendin	{ "pile_set_name": "DM Mathematics" }
)2)2 + (2sqrt(5))*2 + 2 + -4. -44sqrt(5) + 627 Simplify -3((sqrt(2268)1 - (sqrt(28) + -4 + (sqrt(84)/sqrt(3) - sqrt(28)))) + 1)*2. -5451 - 480sqrt(7) Simplify sqrt(2) + (sqrt(6)/sqrt(3))*2 + 5 + (sqrt(8) - (sqrt(8) + sqrt(72) + sqrt(8)))/sqrt(4) - 2(0 + sqrt(288) + 0 + sqrt(288))*2. -2297 - 3sqrt(2) Simplify (((sqrt(56)/sqrt(7) - sqrt(8)) + -5 + 2sqrt(8)-2)-5)2. 2000sqrt(2) + 3825 Simplify ((4 + -1 + sqrt(704) + sqrt(704) + sqrt(704))*2 + sqrt(704) - (sqrt(704) + 0)3)-4 + 2. -25378 - 512sqrt(11) Simplify 4 + (1 + sqrt(2))5 + (4sqrt(16))/sqrt(8). 9 + 9sqrt(2) Simplify -4(sqrt(192) + -2sqrt(192)6 - sqrt(192) - (sqrt(192) + -1)-6)2. -27792 - 2304sqrt(3) Simplify -2 + 0 + (sqrt(5) + sqrt(35)/sqrt(847) + 4)*2. 96sqrt(5)/11 + 2414/121 Simplify (sqrt(468) + -5(1 + sqrt(468)) + sqrt(104)/(sqrt(40)/sqrt(5)) + -6(sqrt(13) + -1))*2. -58sqrt(13) + 10934 Simplify -5 + 0 + ((sqrt(425) - (sqrt(425) - sqrt(425)-5))2 + -2)1. 10618 Simplify -2(0 + ((sqrt(156) + -1sqrt(156))-4)/(sqrt(12) - (sqrt(588) + -1sqrt(588))))*2. 0 Simplify (sqrt(110)/(-4sqrt(90)) + -3(sqrt(1331) + -2) + 2)2. -1588sqrt(11)/3 + 1742915/144 Simplify (55sqrt(500))/(-3(sqrt(4) + sqrt(16)/sqrt(4)) + sqrt(4) + 5sqrt(64)). 25sqrt(5)/3 Simplify ((-2sqrt(640))/(4sqrt(50) - sqrt(50) - sqrt(50)))2. 64/5 Simplify (-6sqrt(1782)4 - sqrt(1782))/(sqrt(396)2-2). 75sqrt(2)/8 Simplify (6(-5 + 1sqrt(162)))*2 + sqrt(2) + -5 + sqrt(2) + -1 + -5 + -3. -3238sqrt(2) + 6718 Simplify (3sqrt(300)-1 - (-1sqrt(300) - sqrt(300))-3)*2 + sqrt(300) + sqrt(300) + -1 + 1 + -2sqrt(300)3. -40sqrt(3) + 24300 Simplify ((sqrt(28) + -2sqrt(1792))/(sqrt(4)-1-4 - sqrt(4)))2-4. -700 Simplify (4 + sqrt(200) + 4 - sqrt(200) - (sqrt(200)2-2 - sqrt(200) - sqrt(200)))*2. 960sqrt(2) + 7264 Simplify sqrt(1053) - (5(2 + sqrt(1053)) + sqrt(1053)) - ((sqrt(39)/sqrt(3))26 + sqrt(13))-5. -40sqrt(13) + 380 Simplify ((sqrt(72)/(-3sqrt(108)))/((sqrt(2187)3)/sqrt(9)))*2. 2/59049 Simplify 3 + (sqrt(39)/sqrt(48) - ((-2sqrt(104))/sqrt(8))*2 - 1sqrt(26)/(sqrt(2) + sqrt(20)/sqrt(10))). -49 - sqrt(13)/4 Simplify -4((sqrt(1088) + -1 + (sqrt(17) - (-3 + 2 + sqrt(17))))3 + 1). -96sqrt(17) - 4 Simplify -3 + ((sqrt(44) - sqrt(176)/sqrt(4) - sqrt(44))2 + sqrt(44))-1-4. 8sqrt(11) + 173 Simplify 6((sqrt(132)3-4)/(sqrt(24)/(sqrt(2)-1)))*2. 9504 Simplify ((sqrt(30) - sqrt(2430))66)/(sqrt(294) + (sqrt(294) - -6(-1sqrt(294) + sqrt(294)))). -144sqrt(5)/7 Simplify (((sqrt(77) + sqrt(77) + (sqrt(77) + -2sqrt(77) - sqrt(77)) + sqrt(77) - sqrt(77))6)/sqrt(11))*2 - (2 + (sqrt(252) - (2sqrt(252) + sqrt(252))))*2. -1012 + 48sqrt(7) Simplify (sqrt(68)/(sqrt(8)/sqrt(2)) + -3 + (sqrt(17)2 - sqrt(17)))2 + (2 + sqrt(2448) + 1)2. 60sqrt(17) + 2534 Simplify -2 + (3sqrt(38)-2)/(-1sqrt(32)). -2 + 3sqrt(19)/2 Simplify 5 + -5 + sqrt(10)/sqrt(2) - (-4(sqrt(60) - (sqrt(60) - sqrt(2940))))/sqrt(12). 29sqrt(5) Simplify sqrt(85)/sqrt(5) + 0 + sqrt(17) + 5 - ((sqrt(1377) - (sqrt(1377) - (sqrt(1377) + 1))) + 3)*2. -1388 - 70sqrt(17) Simplify -2(5(sqrt(143)/sqrt(11))*23 + 5). -400 Simplify 4(sqrt(396) + 3) - (((sqrt(1100) + -3 + -2)2 - sqrt(1100)) + sqrt(1100)). -1113 + 124sqrt(11) Simplify (-3 + sqrt(1377)4 - (sqrt(1377) - (sqrt(1377) - (3 + sqrt(1377) + 1 + sqrt(1377)))))2 + -2. -252sqrt(17) + 5555 Simplify (1 + (1((sqrt(425)1 + 3 - sqrt(425)) + 4))*2)6. 300 Simplify (-5 + -2sqrt(684)-6 + -2 + 2sqrt(684))2 + 3. -1176sqrt(19) + 134116 Simplify ((sqrt(28)/sqrt(4)3 - sqrt(7)) + sqrt(7)-2 + -1 + (sqrt(343) + 2sqrt(343))-2)*2. 84sqrt(7) + 12349 Simplify ((sqrt(150) - -3sqrt(150)-2) + sqrt(150))/(sqrt(20)/(sqrt(1440) + (sqrt(1440) - (sqrt(1440) + sqrt(1440)-2 + sqrt(1440) + sqrt(1440))))). -240sqrt(3) Simplify (3 + ((-2sqrt(88) + sqrt(88) - sqrt(88))-1)/(4sqrt(392)) + -3)2. 11/196 Simplify 6(1 + (sqrt(468)-1 + sqrt(468) + -5)2). 156 Simplify 2(sqrt(11)-25 + sqrt(11) + 0 + 5 + -4(-1 + sqrt(44)))2. -612sqrt(11) + 6520 Simplify (6(sqrt(153) - (sqrt(153) - (sqrt(153) + sqrt(153)-2))))/(2-3sqrt(9))-1. -sqrt(17) Simplify ((sqrt(70) - (5((sqrt(70) - (1sqrt(70) - sqrt(70))) + sqrt(70) - sqrt(70) - sqrt(70)) + sqrt(70)))3)/(-43sqrt(360)). 0 Simplify (sqrt(792)2)/((4sqrt(12))/sqrt(6)). 3sqrt(11) Simplify -5 + 5 + (4 + (sqrt(847) + -1)2)1. -22sqrt(7) + 852 Simplify (sqrt(33)252)/(-2(sqrt(44) - sqrt(11))5). -2sqrt(3) Simplify (-2 + sqrt(1792) + -4 + -1 + sqrt(1792) + -5 + -1)2. -832sqrt(7) + 7337 Simplify ((sqrt(13) - sqrt(26)/sqrt(18))6 + sqrt(52) + 0 + sqrt(13) + sqrt(39)/sqrt(3) + -2)2. -32sqrt(13) + 836 Simplify 3(-1 + -3(-2(sqrt(891) + (sqrt(891) - 2sqrt(891))))*2). -3 Simplify (63sqrt(76))/sqrt(4) - (1sqrt(3078))/sqrt(2). 9sqrt(19) Simplify (((sqrt(480) + -4sqrt(480))/sqrt(12) + sqrt(40))/(sqrt(88)/((sqrt(99) - sqrt(11)) + sqrt(11))))*2. 180 Simplify -14(0 + 0 + sqrt(98) + -3)2. -428 + 168sqrt(2) Simplify (sqrt(931) + 3 + -1sqrt(931) + sqrt(931) + sqrt(931)-1 + -1)*2 + 2. 6 Simplify ((5-3sqrt(18) - sqrt(18)) + 32sqrt(18))22. 3600 Simplify (3sqrt(190)1 + 2sqrt(190)-6 + sqrt(190))/(sqrt(10) - sqrt(40)/sqrt(16) - (sqrt(10) - (sqrt(10) - (sqrt(1210) - -2sqrt(1210)) - sqrt(10)))). 16sqrt(19)/67 Simplify -1 + (sqrt(720) - (2sqrt(720) + -1)2) + -1 + sqrt(720) + sqrt(720) + -3. -2886 + 84sqrt(5) Simplify (-1 + (sqrt(1300)-2 + sqrt(1300))5 + 3 + -1)*2. -100sqrt(13) + 32501 Simplify (3sqrt(180)/(sqrt(48)/sqrt(4)))/((sqrt(24)2)/sqrt(8)2). 3sqrt(5)/4 Simplify -6(0 + sqrt(147) + 1) + 0. -42sqrt(3) - 6 Simplify (4(sqrt(48)/sqrt(2))/(4sqrt(21)/sqrt(7) - sqrt(3)))*2. 128/9 Simplify -2 + (-5 + (sqrt(700) - (2sqrt(7) + -2)))2. -8 + 16sqrt(7) Simplify ((sqrt(567) - -2sqrt(567)) + 3 - (sqrt(567) - (1 + sqrt(567) + 0)))2-1. -5119 - 216sqrt(7) Simplify (6(-1 + sqrt(3)) - sqrt(96)/sqrt(2))*2 - ((sqrt(198)/sqrt(6))/sqrt(11) + 0). -25sqrt(3) + 48 Simplify (53sqrt(13)2 + -3 + sqrt(13)1-4)2 + 3. -156sqrt(13) + 8800 Simplify 2(4 + (-1 + 0 + sqrt(153))2). -12sqrt(17) + 316 Simplify (-2sqrt(2754)2)/(sqrt(224)/sqrt(7) - (sqrt(72) - sqrt(72)1)). -9sqrt(17) Simplify -3 + -5(sqrt(684) + 0) + (sqrt(684) + ((sqrt(684) - (-3 + sqrt(684) + 0)) + sqrt(684) - sqrt(684)) + -5 + sqrt(684) + 1)2 + 2. -54sqrt(19) + 2736 Simplify (-4sqrt(209)6 + sqrt(209))/(sqrt(11)46)-3. 23sqrt(19)/8 Simplify sqrt(153) + 2 + sqrt(153) + sqrt(153) + -2 - sqrt(102)/(-2sqrt(96)). 73sqrt(17)/8 Simplify -4sqrt(55)/sqrt(176) + 4 + sqrt(40)/(-1sqrt(8)) + -3. -2sqrt(5) + 1 Simplify (1 + 2(sqrt(75)-2 + sqrt(75)) + sqrt(75) + 3 + ((-1 + sqrt(75) - sqrt(75)) + -5 - sqrt(75)))2. 40sqrt(3) + 304 Simplify ((sqrt(700) + 0)-1)22 + 6(sqrt(700) + -2 - sqrt(700)) + (sqrt(700) - (0 + sqrt(700) - sqrt(700))-6). 10sqrt(7) + 1388 Simplify ((sqrt(1152)-1 - sqrt(1152))/(-3sqrt(400) + sqrt(400) - sqrt(4)))2. 128/49 Simplify (-5-51sqrt(68)-5-3)*2. 9562500 Simplify ((-3sqrt(1408)-3)/(sqrt(98) + -3(5sqrt(98) + sqrt(98))))2. 57024/14161 Simplify (((sqrt(36) + (sqrt(36) - (sqrt(36) + sqrt(1764) + sqrt(36)) - sqrt(36)))-13)/((sqrt(12) + -3(sqrt(12) - (sqrt(72)/sqrt(6) - sqrt(12))))2))2. 108 Simplify 3 + (sqrt(108) - (sqrt(108) + (sqrt(108) - (sqrt(108) + 4 + sqrt(108))2) + 5)) + 0. 90sqrt(3) + 446 Simplify -1 + (sqrt(3520)-2)/(2sqrt(10)/sqrt(2))6. -48sqrt(11) - 1 Simplify (-3 + -3 + -6(1 + sqrt(108)) + -1)2. 936sqrt(3) + 4057 Simplify (2 + (0 + sqrt(500))5)2 + (1(sqrt(5) + 1) + sqrt(5) + 0 + -2)*2. 196sqrt(5) + 12525 Simplify ((-2(sqrt(1700) + sqrt(1700) + -2) + sqrt(1700))3 + 3)*25-4. -2758500 + 54000sqrt(17) Simplify 5 + ((4(sqrt(13) + -1))2 + sqrt(13) + ((sqrt(637) - -1sqrt(637)) + sqrt(637))*2 - sqrt(26)/(2sqrt(98))). -435sqrt(13)/14 + 5962 Simplify (-2(5(sqrt(209) + sqrt(209)-4))/((sqrt(33)-3)/sqrt(3)))2. 1900 Simplify (6sqrt(117)-4 + sqrt(117))/(sqrt(9) + -5sqrt(225) + sqrt(9)). sqrt(13) Simplify 4((4 + -2 + sqrt(288))2 + sqrt(200) + (6(sqrt(200) + -2))*2). -5528sqrt(2) + 30544 Simplify (((sqrt(1216) - (-2 + sqrt(1216) + 4)) + 0)-2)2 + 3. 19 Simplify (sqrt(108))2 - (sqrt(21)/sqrt(28))*2 - (-2 + (	{ "pile_set_name": "DM Mathematics" }
ound -2446.6306 to the nearest 100. -2400 What is 516690.09 rounded to the nearest one hundred? 516700 Round 0.000175983742 to 6 decimal places. 0.000176 What is -569213.924 rounded to the nearest 10? -569210 Round 0.000374221285 to 6 dps. 0.000374 What is -9.7998149 rounded to 3 dps? -9.8 What is 0.0000093774723 rounded to seven dps? 0.0000094 What is -0.448423746 rounded to 4 decimal places? -0.4484 What is -0.0065392338 rounded to 6 decimal places? -0.006539 Round 12418235100 to the nearest 1000000. 12418000000 What is -0.00437639007 rounded to 3 dps? -0.004 Round 9262.461388 to one dp. 9262.5 What is 7099.5808 rounded to the nearest 100? 7100 Round 0.24669487 to two dps. 0.25 Round 34787.03809 to the nearest one hundred. 34800 Round 14253888.7 to the nearest 100000. 14300000 Round 225978.371 to the nearest 10000. 230000 Round 0.000004302212746 to seven dps. 0.0000043 What is 154500782.6 rounded to the nearest 100000? 154500000 Round 0.00000541494403 to 7 dps. 0.0000054 Round -35.357022 to one dp. -35.4 What is -2177011.21 rounded to the nearest one hundred? -2177000 What is 0.0092942394 rounded to four dps? 0.0093 What is 15.5634493 rounded to 3 dps? 15.563 Round -237268900 to the nearest one hundred thousand. -237300000 What is 0.617155023 rounded to 4 dps? 0.6172 Round 256.47664 to the nearest 100. 300 Round 41.76452057 to the nearest integer. 42 Round -1.31022218 to 4 decimal places. -1.3102 What is 949711.154 rounded to the nearest ten? 949710 Round 2492777120 to the nearest one hundred thousand. 2492800000 What is 0.0251957569 rounded to 5 dps? 0.0252 What is -6.00843705 rounded to four dps? -6.0084 Round 1101880009 to the nearest one million. 1102000000 What is 0.002792924646 rounded to 4 decimal places? 0.0028 Round 0.000214404648 to five decimal places. 0.00021 What is 47870078.21 rounded to the nearest 1000000? 48000000 Round 12525115.064 to the nearest ten thousand. 12530000 Round 1.886229702 to two dps. 1.89 What is 0.000078551577 rounded to six dps? 0.000079 What is 0.0000268661128 rounded to 7 decimal places? 0.0000269 What is -3544804.6 rounded to the nearest 1000? -3545000 What is -0.198248018 rounded to two decimal places? -0.2 Round -0.98450585 to 2 dps. -0.98 What is -4.24184048 rounded to 2 decimal places? -4.24 Round 0.0044538666 to five decimal places. 0.00445 Round 150500.145 to the nearest 100. 150500 What is -14.111566026 rounded to two decimal places? -14.11 What is -20223.40921 rounded to 0 decimal places? -20223 What is 42604.699 rounded to the nearest one thousand? 43000 What is 0.0004734158888 rounded to 4 dps? 0.0005 Round 18694.76067 to the nearest one thousand. 19000 What is -242167356.3 rounded to the nearest ten thousand? -242170000 What is -6001.913446 rounded to 1 decimal place? -6001.9 Round 14698486.8 to the nearest one hundred thousand. 14700000 What is 0.00882477248 rounded to five decimal places? 0.00882 Round 389083739 to the nearest 1000000. 389000000 What is 72.54147483 rounded to one decimal place? 72.5 Round 0.0023826755494 to 5 dps. 0.00238 What is -2414371.43 rounded to the nearest 1000? -2414000 What is -0.00222851295 rounded to 6 decimal places? -0.002229 Round 0.016851834 to 3 decimal places. 0.017 Round 12.43158408 to 3 dps. 12.432 Round -41.704995 to zero decimal places. -42 What is 2866354.97 rounded to the nearest 10000? 2870000 What is -0.0007247182 rounded to seven dps? -0.0007247 What is -0.0369310465 rounded to 3 decimal places? -0.037 What is 0.0026026879 rounded to four dps? 0.0026 Round -30.174476 to the nearest ten. -30 What is -0.00000045971734 rounded to 7 decimal places? -0.0000005 What is 2106.15603 rounded to the nearest 10? 2110 Round 0.000062524216 to seven dps. 0.0000625 What is -0.062113941 rounded to 4 decimal places? -0.0621 What is 18279768.7 rounded to the nearest one million? 18000000 What is 6515491.52 rounded to the nearest one million? 7000000 Round -0.004825930496 to 6 decimal places. -0.004826 What is -18225.948 rounded to the nearest 100? -18200 Round -0.000012905413732 to 6 decimal places. -0.000013 What is -2431782.493 rounded to the nearest one million? -2000000 Round 78.8869515 to 2 decimal places. 78.89 Round -35.473695 to zero dps. -35 What is -8950845.878 rounded to the nearest 1000? -8951000 Round -127.8343774 to the nearest 10. -130 Round -154232393.2 to the nearest 10000. -154230000 What is -0.0146310001 rounded to 5 dps? -0.01463 Round -0.79779128 to 4 decimal places. -0.7978 Round -1.1589484 to two dps. -1.16 Round -20979.8295 to the nearest one hundred. -21000 Round 0.000005825704 to 7 decimal places. 0.0000058 What is 50.612096 rounded to the nearest ten? 50 What is -224064.667 rounded to the nearest 10000? -220000 What is -27702850 rounded to the nearest one thousand? -27703000 What is 15077625.2 rounded to the nearest one hundred thousand? 15100000 Round -1183.32206 to one decimal place. -1183.3 Round 921004236 to the nearest 1000000. 921000000 What is -0.00000005737525 rounded to seven decimal places? -0.0000001 What is -3203.9857 rounded to the nearest 1000? -3000 Round -103531.047 to the nearest 10. -103530 Round -78573.4745 to the nearest 1000. -79000 Round -22405 to the nearest 10000. -20000 What is -18.2951276 rounded to three dps? -18.295 Round 3105.0857 to the nearest 10000. 0 What is -0.00572034474 rounded to 3 decimal places? -0.006 Round -40.1991523 to one decimal place. -40.2 Round 1477.86919 to the nearest one hundred. 1500 What is 198.169485 rounded to 2 dps? 198.17 Round -589397289 to the nearest 10000. -589400000 What is 0.00000206266636 rounded to seven decimal places? 0.0000021 Round -3101880.9 to the nearest 1000. -3102000 What is -43.4879654 rounded to 1 decimal place? -43.5 Round -43.9870319 to the nearest 10. -40 Round 635338910 to the nearest one million. 635000000 What is -0.09724461 rounded to one dp? -0.1 What is -4370.58911 rounded to the nearest ten? -4370 Round -40683.06785 to the nearest integer. -40683 Round -0.00520642 to 5 dps. -0.00521 Round -18.2907107 to the nearest integer. -18 Round 0.00135729533 to 7 dps. 0.0013573 What is -1508.983943 rounded to the nearest integer? -1509 What is -0.9848193042 rounded to 5 decimal places? -0.98482 What is -953564.6 rounded to the nearest 100? -953600 Round -4248.2539 to the nearest one hundred. -4200 What is 0.0000536959702 rounded to 7 decimal places? 0.0000537 What is 463.37373 rounded to the nearest 100? 500 What is -24.4074526 rounded to the nearest integer? -24 Round -259497300 to the nearest 100000. -259500000 Round -144.26088275 to one dp. -144.3 Round -0.001802577169 to three decimal places. -0.002 What is -18787249.55 rounded to the nearest 100000? -18800000 Round 12.1088743 to 0 decimal places. 12 What is 131326.8 rounded to the nearest one thousand? 131000 What is -0.09017721031 rounded to 5 dps? -0.09018 What is -0.162314986 rounded to two dps? -0.16 What is -0.000272786417 rounded to five dps? -0.00027 Round -1138.6536 to the nearest ten. -1140 Round 6220.802 to the nearest 10000. 10000 What is 25389683.69 rounded to the nearest ten thousand? 25390000 Round 28.070965 to the nearest ten. 30 Round 0.00001214956018 to six decimal places. 0.000012 Round -139.817116 to the nearest integer. -140 Round 0.00127964275 to six decimal places. 0.00128 Round -470102.117 to the nearest 10000. -470000 What is -0.00073643204 rounded to three decimal places? -0.001 What is -0.388801874 rounded to four decimal places? -0.3888 What is 84831.7467 rounded to the nearest 1000? 85000 Round 5973981940 to the nearest one million. 5974000000 Round 220.0961445 to the nearest 10. 220 Round 1192.51262 to the nearest 10. 1190 What is 0.03442525 rounded to two dps? 0.03 Round -2160073.89 to the nearest one hundred thousand. -2200000 Round -1.329702127 to 1 dp. -1.3 Round 0.00000524010594 to seven dps. 0.0000052 Round -0.00000034615591 to 7 dps. -0.0000003 Round -357049.02 to the nearest one hundred thousand. -400000 Round 29445289950 to the nearest 1000000. 29445000000 Round -19563970.2 to the nearest 1000000. -20000000 What is -369.72946 rounded to the nearest 100? -400 What is -7.30012069 rounded to two dps? -7.3 What is 0.0000969242542 rounded to 5 dps? 0.0001 Round -66083.4124 t	{ "pile_set_name": "DM Mathematics" }
, 4v - 2w = 90. Does 7 divide v? True Let w be 2/(4(-1)/(-58)). Let t = w - 23. Is t a multiple of 5? False Let g = -200 + 230. Is g a multiple of 15? True Let q = -162 - -307. Is 5 a factor of q? True Suppose 8z - 187 + 11 = 0. Does 2 divide z? True Suppose -z + 0z + 77 = 0. Let a = z + 53. Suppose 5n + 15 = 0, -5n - 20 = -5c + a. Is c a multiple of 11? False Let g = 17 + 3. Suppose -m + 6q - 2q = -g, 92 = 4m - 4q. Is m a multiple of 9? False Let v(x) = 4x2 - 7x + 12. Let m be v(4). Suppose 0 = -4z - 2r + m + 218, 5z = r + 336. Is 10 a factor of z? False Is (-14)/(-7) + -2 + 67 a multiple of 4? False Suppose -13n + 4552 = -5n. Suppose 9y - n - 322 = 0. Is 33 a factor of y? True Suppose -55p = -44p - 7425. Is p a multiple of 45? True Suppose c = 5c. Suppose 0 = 4u - 3m + 3, -4u - 2 = -5m + 3. Suppose u = -z - cz + 8. Is z a multiple of 8? True Let s = 68 + -33. Does 6 divide s? False Suppose -2z + 20 = 5d, -2d - 2 + 10 = -z. Suppose 20 = w + dw. Does 4 divide w? True Let u = 251 - 143. Suppose 27 + u = 3g. Is 9 a factor of g? True Let j(s) = 3s - 1. Let d be j(-1). Let p = d - -10. Suppose -4x + 2x + p = 0, 5f = -2x + 51. Does 9 divide f? True Let p(l) = -2l3 - 13l*2 - 9l - 5. Let g be p(-8). Let r = -179 + g. Is 16 a factor of r? True Suppose 1124 = 5c + 4b, -9c + 7c + 444 = -4b. Is c a multiple of 21? False Suppose 2a = o + 7 - 5, -5a + 10 = 0. Suppose 5c = -k - k + 645, oc - 258 = -k. Does 57 divide c? False Suppose 0 = -3i + 9, -i = -2h - 38 - 13. Suppose -o = 3o - 216. Let t = o + h. Is 10 a factor of t? True Is ((-95)/20 + 3)/((-3)/192) a multiple of 14? True Suppose 5a + 0a - 25 = 0. Suppose -5f + 2i + 26 = 0, -4f - f = 5i - a. Suppose fb - 2b - 246 = 4n, 15 = -3n. Is b a multiple of 31? False Let f be (-5)/(32/(-474)). Suppose 0 = -r + 3z + 21 + 116, f = 3r - 5z. Does 25 divide r? True Let p = -94 - -364. Does 15 divide p? True Suppose 0m = -9m + 423. Let y = 8 + m. Is 17 a factor of y? False Suppose -49j + 85j - 51192 = 0. Does 18 divide j? True Let c = -40 + 42. Suppose -a + 12 = 2o - 4, 41 = 5o + ca. Is 8 a factor of o? False Let d(m) = 32 + 6 + 2m*2 + 5m - 22. Is d(-7) a multiple of 5? False Let a = 3 + -7. Let y be (-1)/(-1) - 16/a. Suppose -2l - yk = -134, -13 - 3 = -4k. Is l a multiple of 19? True Let o = 661 + -288. Does 28 divide o? False Let u be ((-2)/(-3))/(4/6) + 25. Let s = u + -2. Does 12 divide s? True Let q(y) = -8y - 5. Let c be q(-4). Suppose -2p + 0j + c = -j, -5p = 3j - 40. Is p a multiple of 4? False Suppose -64 = -3i - i - 2p, -5p = 4i - 70. Suppose -m + 9 = 2g, -3m + 10 + i = 5g. Is (9/(-2))/(m/(-20)) a multiple of 9? True Suppose -13x = -5691 - 4059. Is x a multiple of 12? False Let r(a) = 2a - 10. Let l be r(7). Suppose 0b - 4 = lb. Let v(c) = -44c3 - c2 - c - 1. Is 9 a factor of v(b)? False Suppose 2j = -4n - 19 + 59, -j + 30 = 4n. Let h(u) = u3 - 9u*2 - 4u. Is h(j) a multiple of 19? False Suppose -108 = -4x + 5w, 8x - 3x - 135 = -3w. Does 3 divide x? True Is 14 a factor of (10/3 + 0)117/3? False Let s(q) = q*2 - 6q - 9. Let r(w) = 4w + 0w*2 - 5w + 2w2 - w2 + 3. Let j be r(3). Is 6 a factor of s(j)? True Suppose -5o + 684 = 2j - 71, -3j + 750 = 5o. Suppose 4g + 3w = 50 + o, 5 = 5w. Is g a multiple of 19? False Let q be (-1)/(-2)(0 - 0). Suppose q = -3k + k - 94. Let p = -2 - k. Is 24 a factor of p? False Suppose 4m = -5 - 7, 5m + 21 = -g. Does 17 divide 4 - (-844)/6(-9)/g? False Suppose -5z = -4a - 154, -2z - 2a = 2a - 84. Suppose -z = 7m - 118. Is m a multiple of 6? True Suppose 0b = -6b - 72. Is -98(10/b - (-20)/(-30)) a multiple of 49? True Let z = -183 + 1494. Suppose 0 = 2p - s - 525, 3p = -2p + 3s + z. Suppose 3w + w = p. Is w a multiple of 21? False Suppose 3y = -5r + 51 + 152, -3r + 115 = -5y. Suppose 3d + 115 = 2f + r, -4d - 20 = 0. Is f a multiple of 6? True Suppose 0 = -3c + r + 4r - 6, -4c - 43 = 5r. Let x(o) = o + 10. Let v be x(c). Suppose 3f = j + 48, -vf + 36 = 3j - 0j. Does 10 divide f? False Suppose -3f + 248 = -2q, 0q + 3q + 3f + 357 = 0. Let n = q - -200. Does 13 divide n? False Suppose u - 4j = 39, -5j + 72 = 2u + 2u. Suppose -2l + u = -13. Does 6 divide l? True Suppose 0 = 5p + 3c - 2040, p - 2c - 408 = -6c. Is 9 a factor of p? False Suppose 9 = -2w - 3n, w + 2n + 6 = 2w. Suppose 3c + 3q - 90 = w, 3c - 2c = -5q + 10. Is c a multiple of 5? True Let n be ((3 + 0)/1)/((-3)/3). Is 11072/88 - (-4)/22 - n a multiple of 26? False Let p(u) = 1 + 0u*2 - 11u + 2 + u*2. Does 3 divide p(11)? True Suppose -3p - 1 = 2w - 3w, p = -3w + 3. Is ((-210)/(-28))/(w/8) a multiple of 16? False Suppose 0 = t - 3q - 48, 4q + 97 = 5t - 121. Is t a multiple of 2? True Is (-10 + 1)/((8/178)/(-4)) a multiple of 41? False Suppose p + 5c - 119 + 34 = 0, 4c = -5p + 404. Suppose -5u - 5g + 65 = -p, 0 = 3u - 4g - 52. Is u a multiple of 23? False Let f = -1348 + 1910. Does 9 divide f? False Let u(b) = b3 - 3b*2 + 6. Let k be u(3). Let v(w) = 2w*3 + 3w*2 - 16w + 4. Is v(k) a multiple of 56? True Let w = 1266 + -252. Is 14 a factor of w? False Suppose -8f = -4f. Let k(g) = g*2 - g + 4. Let y be k(f). Is 11 a factor of 12y6/9? False Suppose 4h = 2h. Suppose -5z + 2i + 820 = h, 3z = 6i - i + 511. Is z a multiple of 27? True Let b(j) = -36j*3 - 2j*2 + j + 2. Suppose -3q = -7 + 10. Is 5 a factor of b(q)? True Let f(d) = 10d2 - 2d + 2. Let b be f(1). Suppose bx - 317 = 883. Is 30 a factor of x? True Suppose -3o = -21 - 84. Let g = o + -28. Is g even? False Let f(x) = 15x2 - 10x - 6. Let s be f(-4). Suppose -s = -4m + 374. Does 18 divide m? True Let l(r) = 2r*3 - 33r*2 + 51r + 22. Is l(17) a multiple of 19? True Let a(i) = -27i + 1. Let p be a(-4). Let q = p + 71. Is 19 a factor of q? False Let n(t) = -t3 - 8t*2 - 9t - 4. Let p be n(-7). Let y = 145 + -172. Does 25 divide y/(-18)p5? True Suppose 0 = z + 4z + 2q - 1068, -1040 = -5z + 5q. Suppose -4l + 5d + 347 - 123 = 0, -4l + 2d = -z. Is l a multiple of 5? False Let k be 36/8 + 15/(-10). Suppose kw - 268 - 47 = 0. Is 12 a factor of ((-10)/(-7))/(3/w)? False Let f = 87 + -30. Let w be f/12 - 3/4. Suppose -wz = -196 - 52. Does 17 divide z? False Let n = -112 + 80. Let r be (n/(-6))/((-18)/(-27)). Suppose -rm = -11m + 90. Is m a multiple of 10? True Suppose -8f = -6f. Let y(z) = z*3 + z + 276. Let o be y(f). Suppose 0 = -3d + 7d - o. Is 25 a factor of d? False Let p = -59 + 33. Suppose 149 = 5b - 46. Let g = b + p. Is 10 a factor of g? False Suppose 7s + 15 = 12s. Suppose 2m = 3 + s, 2m - 801 = -5y. Does 24 divide y? False Let z(a) = -a2 + 7a - 5. Let f(s) = -s*2 + 8s - 6. Let w(o) = -4f(o) + 5z(o). Let c be w(2). Let j = c - -5. Does 3 divide j? True Suppose -t - 267 - 446 = -5l, -3l - 5t = -411. Does 26 divide l? False Let x = 914 - 610. Is 8 a factor of x? True Let f(q) = -q3 + 11q*2 + 22q - 135. Does 9 divide f(7)? False Suppose -3s + 923 = 2l, -l + 3s + 461 = 5s. Does 68 divide l? False Suppose 4a + 206 = 302. Is a a multiple of 11? False Suppose 0o + 4y = 5o + 50, -2y - 10 = 0. Is (o/(-28))/((-1)/(-90)) a multiple of 15? True Let z(l) = l2 + 5l + 12. Let r be z(-8). Let o = 40 - r. Suppose op - 43 = 3p + 5d, p + 3d - 19 = 0. Is p a multiple of 7? True Let o(v) = -2 + 52v - 1 + 2 - 3. Is 17 a factor of o(1)? False Suppose c - 2w = 26, 5c + 2w = -w + 91. Suppose -4o - 5f + 23 = -3o, 0 = -5f + c. Is 3 a factor of o? True Let m = 188 + -153. Does 6 divide m? False Let k be 2/11 + (155/(-55))/(-1). Suppose -a + 5v + 80 = 0, ka - 200 = -2v + 23. Is 15 a factor of a? True Let z(s) = -s - 1. Let b be z(-5). Let a = 469 - 352. Suppose -bn - 5c + a = -91, 5n + 3c = 273. Does 19 divide n? True Let r be 26/(-4)(25 + 1). Let h = r + 272. Does 11 divide h? False Let o(y) = -3y + 8. Let x be -31 + (-335)/(-5). Let v be ((-9)/12)/(4/x). Is o(v) a multiple of 22? True Let f(z) = 67z + 1. Let h(p) = p2 - 9p + 13. Let i be h(9). Let n(k) = -k*2 + 14k - 12. Let x be n(i). Is f(x) a multiple of 31? False Let t be (36/(-126))/((-1)/14). Suppose -221 = -t*g + 3	{ "pile_set_name": "DM Mathematics" }
080v2 wrt v. -535877520v Find the third derivative of 452774b6 - 4361547b*2. 54332880b*3 Differentiate dk*2 - 819dk - 4d - 15303k2 - 30614120 wrt k. 2dk - 819d - 30606k Find the third derivative of -578n*4 + 800n*3 - 11n*2 - 258958n wrt n. -13872n + 4800 What is the third derivative of 187560726n*4s + n*3s*3 + 62768904n*2s*3 wrt n? 4501457424ns + 6s*3 Find the second derivative of -8315889g*3 - 14896062g. -49895334g What is the third derivative of -337l*6 + 10385l*4 + 3503439l*2 wrt l? -40440l*3 + 249240l Find the second derivative of -10808031p2 - 73048796p. -21616062 What is the third derivative of -5241187x3 + 340347x*2 wrt x? -31447122 Find the first derivative of 6q*3r + 3q3ux + q2ux + q2 + 1800qrux - 2qux + qx + 952ru - 231ux - 5u wrt r. 6q3 + 1800qux + 952u Find the second derivative of -2426323b*2g - 3b2 + 2193072b - g wrt b. -4852646g - 6 What is the second derivative of -1632548m*2 + 2073187m wrt m? -3265096 What is the derivative of -f*4 - 3882586f*3 - 2f*2 - 49417564 wrt f? -4f*3 - 11647758f*2 - 4f What is the first derivative of -3b3 - 30224897b*2 - 127641489 wrt b? -9b*2 - 60449794b What is the derivative of c*3 - 961c*2 - 4587c - 182877483 wrt c? 3c2 - 1922c - 4587 Find the second derivative of -149009901p3 + 88492014p wrt p. -894059406p What is the derivative of -4227chn - 6chw - 5ch - 3cnw - 406hnw - 13729h + 2w wrt n? -4227ch - 3cw - 406hw What is the first derivative of 339267q*3 + 2q*2 - 9q + 45430953? 1017801q2 + 4q - 9 Find the first derivative of -7526461p + 2013226. -7526461 Find the first derivative of -9717783s*2t*3 - 2431304s*2 - s - 4t*3 wrt t. -29153349s*2t*2 - 12t*2 Find the second derivative of 30139844c*3z*2 - 3c*3z + c*2 - 27823cz - z wrt z. 60279688c*3 Differentiate -213845738dw - 1206w + 104079 wrt d. -213845738w Find the first derivative of -909u*4 + 3123u*3 + 3u*2 - 47907579. -3636u*3 + 9369u*2 + 6u What is the first derivative of -542338884fm*2 - 7m*2 + 2725m - 5071 wrt f? -542338884m2 What is the derivative of 4j*4 + 293705j3 + j2 - 472609489 wrt j? 16j3 + 881115j*2 + 2j What is the third derivative of 1526306tw*3y*2 - 2twy*2 - 23ty2 - 14w*3y*2 - 28298w*2y*2 - 1 wrt w? 9157836ty2 - 84y*2 What is the second derivative of -33t*4 - 1064140t*2w + 7tw + 24t - 18w - 32 wrt t? -396t2 - 2128280w Find the first derivative of -9s2 + 125264s + 103313666. -18s + 125264 What is the third derivative of 34j*3x*4 + 287j*3x - 1057j3 - 5539j*2x*5 + 6j*2x*2 wrt x? 816j*3x - 332340j2x*2 What is the third derivative of -70245150y*3 - 2y*2 + 205y + 27342? -421470900 Find the first derivative of -14w4 + 6w*2 + 1517284w + 722916885. -56w3 + 12w + 1517284 What is the second derivative of -85078797q2 - 3875238q - 7 wrt q? -170157594 Differentiate -5o3 - 456079o - 12532891. -15o2 - 456079 What is the second derivative of -875617h*2vz - 2h*2v + 7h2 + 6hvz - 7hz + 4vz - 20720v wrt h? -1751234vz - 4v + 14 Find the third derivative of 8r4 - 53182709r*3 - 21934r*2 + 404r + 1. 192r - 319096254 Find the third derivative of 16j*2n*3 + 2j*2n - 8jn*3 - 281895jn2 - 50956n3 + n2 + 2n + 2 wrt n. 96j*2 - 48j - 305736 What is the derivative of 1271a3x*2 - 1420a3 + x2 + 899619 wrt a? 3813a2x*2 - 4260a*2 Find the second derivative of -2901m*3 + 1438m*2 - 3529099m wrt m. -17406m + 2876 Find the second derivative of 10cv2z + 4041cvz3 - 342279v*2z*3 + 215vz3 + vz*2 wrt v. 20cz - 684558z*3 Find the third derivative of 21503410t*6 - 371001t*2 - 2t + 1. 2580409200t3 What is the derivative of -193079270h + 142509304? -193079270 Find the second derivative of -14n3o*3 - 882627n*3o - no3 + 10o*3 + 1684o*2 wrt n. -84no3 - 5295762no What is the second derivative of 352986234a*2 - 2a + 215501195? 705972468 What is the third derivative of 2k4 + 6503727k*3 + 2k*2 + 94997949 wrt k? 48k + 39022362 What is the second derivative of 57i3x + 25651i2x + 2i2 + 15336249ix wrt i? 342ix + 51302x + 4 What is the third derivative of -4099787b3 + b2 - 5326b - 1487? -24598722 What is the second derivative of -1261709g3 - 25329g - 1583? -7570254g What is the third derivative of -334856884a*6 + 37651854a*2? -40182826080a*3 Find the first derivative of 12043r*2 - 941r + 78156489 wrt r. 24086r - 941 Find the third derivative of 102s*3w*3 + 2s*3w*2 + 3s*3 + 308sw2 + 178243w3 + w2 - 12w wrt w. 612s*3 + 1069458 What is the third derivative of 8g*5 + 19g*4 - 115g*3 + 437058g*2 - 10? 480g*2 + 456g - 690 What is the third derivative of 2dw*3 + 3dw2 + 8083dw - 4216852w*3 - 11w*2 wrt w? 12d - 25301112 What is the third derivative of 106y5 - 31y*4 + 8143y*3 - 5y*2 + 33y + 192190? 6360y2 - 744y + 48858 Differentiate -59829gk*3t - 71gk - 2k3 + 11k*2 + 75t*2 - 674 wrt t. -59829gk3 + 150t What is the first derivative of -226693298x + 65820659? -226693298 Differentiate 3az2 - 2712az - 56848235a + 45z2 - 5z with respect to z. 6az - 2712a + 90z - 5 What is the derivative of 2f3 - 11467f*2 - 60f + 4191743 wrt f? 6f2 - 22934f - 60 Find the third derivative of -918831103s3 - 725038874s*2. -5512986618 Differentiate -335743607p + 172930684 with respect to p. -335743607 Differentiate 7z4 - 312741z - 3312952. 28z3 - 312741 Find the second derivative of 55f*3 - 1499773f*2 + 51316f + 29 wrt f. 330f - 2999546 Differentiate 9mq2 + 6131mq - 7960660m - q*2 + q wrt q. 18mq + 6131m - 2q + 1 What is the derivative of 781y*3 + 58y*2 + 2y - 8979291 wrt y? 2343y2 + 116y + 2 What is the second derivative of -19f2gl2 - 604f*2gl + f2l*2 + 2f*2l - 143fg + 17047gl*2 + 2gl wrt l? -38f*2g + 2f2 + 34094g What is the second derivative of -109109710a2 + 56042412a wrt a? -218219420 What is the third derivative of 66978041q5 + 3q*4 - 721736028q*2? 4018682460q*2 + 72q What is the second derivative of -88179123t3 + 3879884t? -529074738t Find the second derivative of 920484542h*2 - 76541360h - 3 wrt h. 1840969084 What is the second derivative of 1002s4 - 982s*3 + 3880611s? 12024s2 - 5892s Find the second derivative of 12b2kv2 + 818b*2kv - 141b*2k - 126866bkv2 - 3bv - k wrt v. 24b*2k - 253732bk Find the first derivative of -68832442h3 - 62495707. -206497326h*2 What is the third derivative of 1667w*6 - 8179w*3 + 14w*2 + 28577w + 4? 200040w3 - 49074 What is the first derivative of -171329n*3r - 1539n3s + 2n3 - 29n*2rs - 5rs + 6r wrt s? -1539n3 - 29n*2r - 5r Differentiate 34825881d*2 + 49405477 wrt d. 69651762d What is the first derivative of 706756771q - 1194977952? 706756771 What is the second derivative of 62iw3 + 4iw2 + i + 9w*3 - 24w*2 - 5048989w wrt w? 372iw + 8i + 54w - 48 Find the third derivative of -6215359o3 - 2336903o*2 - 3o. -37292154 Differentiate 46986893lq + 78885l - 315 with respect to q. 46986893l Find the third derivative of -771oz*3 + 2oz2 - 621o + 2283z4 - z2 - 9z - 10 wrt z. -4626o + 54792z Find the third derivative of 61c2r*4 - 25c*2r + 4502cr*4 - 2cr2 + 4c - 406r + 10 wrt r. 1464c*2r + 108048cr Find the second derivative of -242400385t2 - 58t - 4506213 wrt t. -484800770 Find the second derivative of -3986877d4 + 5640375d wrt d. -47842524d2 What is the second derivative of -4409910j*2 - 341564j - 23 wrt j? -8819820 Find the third derivative of -3339873h3i*2 - 2h*3 + 3h*2i*2 - 98032h*2 + 18hi2 wrt h. -20039238i*2 - 12 What is the third derivative of 142356296q*5 - 604542760q*2? 8541377760q*2 Find the third derivative of 298322441r*3 + 3446684r*2 wrt r. 1789934646 Find the third derivative of 4257355n*3 + 1265441n**2 + 5. 25	{ "pile_set_name": "DM Mathematics" }
r - 0. Let w be (0 + 1 + -10 + 9)g. Solve w = -3b - 9 - 0 for b. -3 Let q be (11 - (8 - -8))28/(-20). Solve -51 + 30 = qg for g. -3 Let a be 30(-1 - 21/(-18)). Suppose 0 = ak - 3g - 14 - 4, 5 = -5g. Solve -k + 13 = 2x for x. 5 Suppose 0 = -2r + 2l - 4l + 22, 3l = -5r + 53. Suppose 42f - 7131 + 22251 = 0. Let o = 365 + f. Solve ob - r = 3b for b. 5 Let q(i) = 2i - 35. Let d be q(18). Let n be d(3 + -1 + (4 - 6)). Let l(a) = a3 - 7a*2 - 7a - 2. Let t be l(8). Solve 3r - tr - 3 = n for r. -1 Let u = -37898 + 37904. Solve -un + 40 = -8 for n. 8 Suppose 0 = c - 253 + 65. Let h = c - 163. Solve hf = 21f for f. 0 Suppose 3p + 125 = 2f, -2p + f = 2f + 95. Let j be (p/6)/((-6)/8). Solve 0n + jn = -20 for n. -2 Suppose -38 = -6s - 14. Suppose y + 2b = 14, -y - b = -sb + 6. Solve 0 = -8j + 11j - y for j. 2 Let u(r) be the first derivative of r*3/3 - r - 13. Let v be u(2). Suppose -vq = -3q + 3q. Solve qh = h for h. 0 Let h be 0 - -4 - (-4)/4-6. Let b be 1 + 3 + 1 + h. Suppose b - 3 = 6t. Solve -l = -tl for l. 0 Let z be (225/(-20))/34/(-3). Let n be 4 - (1560/z)/(-6). Solve -26 = -6f - n for f. -5 Let n(t) = -t*3 + 16t*2 - 6t + 41. Let s be n(13). Let m = 476 - s. Solve 25 = -a + ma for a. 5 Let i(l) = 3l*2 + 131l + 466. Let p be i(-40). Let b = 17 - -7. Solve -bc = -pc for c. 0 Let w be (((-3)/(-6))/(-1))/(2/(-116)). Let s = w - 24. Suppose sl = 2n - 29, 25 = 7n - 2n - 3l. Solve 0 = 6y - ny + 4 for y. -1 Let m = -129 + 134. Suppose 4z - 7z - t = -4, -22 = z + mt. Solve -o + 0 = z for o. -3 Let d be ((20/3)/4)/(513/2574). Solve 0 = -y + d - 68 for y. -2 Let p(t) be the second derivative of -t5/20 - 7t*4/12 - 13t*3/6 - 4t*2 - t - 8. Let g be p(-5). Solve -gc = -10c - 6 for c. -2 Suppose 51b + 17 = 228 + 197. Solve 6i = 44 - b for i. 6 Suppose 56v - 54v = 166. Let h = -141 + v. Let m = h + 65. Solve -m = 3k - 4 for k. -1 Let b = 195 - 195. Suppose 3a + 5r - 40 = b, -4a + 2r + 25 = 3r. Solve 7w + a = 2w for w. -1 Let o be 6/(-28)-2 - -180(-176)/(-1540). Solve 52 = og - 32 for g. 4 Suppose -52d + 19d = -264. Solve 4z = 6z - d for z. 4 Suppose -118y + 151y - 429 = 0. Solve yq + 52 - 13 = 0 for q. -3 Let n(r) = -r2 + 121r - 1393. Let m be n(13). Solve 46 = ms + 68 for s. -2 Let d(t) = 6t + 4 + 2 + 5 + 5t2 + t3 + 0. Let j be d(-4). Suppose -3s = 2r + jr - 10, -4s = -3r - 23. Solve 4m - 1 = -s for m. -1 Suppose -130f + 25f = 65f - 37060. Solve -227 = 9v - f for v. -1 Let n(y) = -2y*2 - 24y + 85. Let a be n(3). Let w(l) = -14l - 64. Let v be w(a). Solve -6t = -24 - v for t. 5 Let l be (-2)/5(0 + -5). Let a(p) = -17p + 4. Let d be a(-1). Suppose -3u + 26 = 2o, -3u = -0o + 3o - d. Solve ly + 2y = -u for y. -3 Let n(u) be the third derivative of -u5/60 - u4/3 + u3/6 + 10u*2. Let g be n(-7). Suppose g = x - 1. Solve 4t - 20 = xt for t. -4 Let x = 468 - 451. Suppose 2w - 21 = -b, b = 3w - x + 18. Solve 0 = 10f + 17 + b for f. -3 Let h be (32 - (-3744)/(-120))/(4/1010). Solve -15f - h = -217 for f. 1 Let g(m) = -12m*2 - 323m + 27. Let t be g(-27). Solve 55k + 6k + 244 = t for k. -4 Let a = -34189 + 34192. Let j be (-4)/10 - (-51)/15. Solve 0 = -0o + jo - a for o. 1 Let m be 40/4864. Solve -19x + mx = -5 for x. -5 Suppose 16w + 81 = 25w. Suppose wf - 36f + 108 = 0. Solve -32n = -34n - f for n. -2 Let r be (-22)/16-2 - (-51)/(-68). Suppose 4v - 3b = 67, 0 = -0v + v - rb - 23. Solve -vh = -7h - 24 for h. 4 Let h = 0 - -12. Let q(j) = -j3 - 7j*2 - 18j - 35. Suppose -104g - 45 = -95g. Let r be q(g). Solve -2m + rm = -h for m. -4 Suppose 97 - 124 = -9t. Suppose 0 = 4d + 2y - 8, 3d - y - t = 3. Solve -21g + d = -23g for g. -1 Let u be (-189 - -195)(2/(-3))/(2/(-5)). Solve uz = 26z + 48 for z. -3 Let j(l) = -7 - 31 + 2l + 119. Let s be j(-39). Solve 0 = 4z - 11 + s for z. 2 Let b = -499 + 954. Let y = -452 + b. Solve l - yl = 2l for l. 0 Let w = 55 + -210. Let b = w - -163. Solve -bn + 30 = -2n for n. 5 Let c = -72 + 38. Let k = -26 - c. Let p be 12/k - 1/2. Solve p = 4l + 13 for l. -3 Suppose 21s - 26s = 10. Let w = s - -20. Solve -10c - w = -4c for c. -3 Suppose 5s - 4p = 18, 0 = 5s - 5p - 20 + 5. Let u be (13/8 - 2) + s/16. Let y be (-8)/((-1)/(2/4)). Solve u = -f - yf for f. 0 Suppose -72k + 8242 + 1134 = -1136. Solve -101 = -15c - k for c. -3 Suppose 0 = 5t + 10, 6t - 2t = 3s - 2588. Solve su - 8 = 856u for u. 2 Let t(m) = m2 - 13m - 86. Let k be t(18). Suppose -5h + 6 = -2h - 2f, -kh + 2f + 8 = 0. Solve -hy = -y - 5 for y. 5 Let x(i) = -3i2 + 79i - 85. Let d be x(25). Solve 27c + d = 32c for c. 3 Let i(c) = 41c2 + 3c + 12. Let n(d) = 10d2 + d + 3. Let b(t) = -2i(t) + 9n(t). Let f = 416 - 417. Let k be b(f). Solve -3r - r = -k for r. 2 Let f(u) = u*2 + 18u + 6. Let z be f(-15). Suppose 2d - d + 36 = 0. Let r = d - z. Solve -a + ra = 0 for a. 0 Let d = 592 + -1051. Let s = d - -466. Solve -3k - 19 = -s for k. -4 Suppose -66 = -4i + 2o, 71i + 3o = 66i + 77. Solve 1714c - 1722c = -i for c. 2 Suppose 0 = 5s - w - 71, s - 88 + 53 = -5w. Solve -21f = -sf for f. 0 Let z(b) = -b*2 + 97b - 450. Let q be z(5). Solve -28w + 30w - q = 0 for w. 5 Suppose -5160 = -253y + 912. Solve ya - 273 = -15a for a. 7 Let p(f) = 2f*3 + 63f*2 + 16f - 301. Let n be p(-31). Solve -n = -2s - 164 for s. 0 Let b = 13064 + -12814. Solve -17l + 67l + b = 0 for l. -5 Let r be -9 - -13 - (-414)/(2 - 1). Suppose -16 = -420a + ra. Solve a = -s + 4 for s. -4 Suppose 5y - 40 = -7x + 2x, 0 = 2x - 8. Suppose -yq = 5c + 52, 5q = 5c + 23 + 2. Let g be 3 - c/(-8)(-1 + 0). Solve -3z + 5 = -gz for z. -5 Let b(w) = -w*3 + 8w*2 - 5w - 5. Let h be b(7). Suppose hj - 2j = 35. Suppose ju = 2o + 25, -3u + 3 = 4o + 14. Solve -5v = -uv for v. 0 Suppose 3g = 12 + 12. Suppose 2c + g - 12 = 0. Let l = 143 + -133. Solve 0 = -4h + ch - l for h. -5 Suppose -3i - 5z = -17, 5i + 2z + 19 = 79. Let w be 388/(-582)((-290)/14 + (-8)/28). Solve -4v = i - w for v. 0 Let p be (10 + -8 - -9) + -9. Solve pv + 7 = 17 for v. 5 Let k = -2929 + 2938. Solve ku + 13 = -14 for u. -3 Suppose -2j - 7u = -2u - 4, 0 = -5j + 2u + 68. Solve jd + 29 + 31 = 0 for d. -5 Suppose 0 = -4h + 5p + 1 + 14, -4h - 5p + 25 = 0. Suppose -2 = 551g - 567g - 2. Let l be (2 + -4)/(3/(-15)). Solve gq = -hq - l for q. -2 Let c = 33 + -16. Let i be 10 - (c - 2)/(3/1). Solve -6 + i = -w for w. 1 Let d(p) = 2p3 - 78p*2 + 8p - 274. Let j be d(39). Solve 0 = 39q + 1 + j for q. -1 Suppose -3p + 124 = -k - 6p, 0 = -4p - 20. Suppose 3h + 4n = -324, 10n = 3h + 12n + 324. Let c = h - k. Solve 3j + c = -2 for j. -1 Suppose -480 = -190x + 3890. Solve 119 = -xg + 6g for g. -7 Suppose 4s + 278 = -5m + 2m, 0 = 5s + 4m + 347. Let x = s - -62. Let b be (-4)/(-1 - x/12). Solve -w + b = -5w for w. -4 Suppose 10u - 270 = u. Let x be (12/10)/(42/u - 1). Solve -xv + 3 = -3 for v. 2 Let a be 82/(-88)-428 - (-4)/22. Let b = 405 - a. Solve 5h - b = -1 for h. 1 Suppose 0 = -4y - 5j - 122, -39 = -2y + 5j - 115. Let s = -26 - y. Solve 0 = b - s + 4 for b. 3 Suppose 0 = -104g + 3g - 187 - 318. Let l(q) = -15q - 3q2 + 4 - 2q*2 + 2q*2. Let p be l(g). Solve k = -pk for k. 0 Suppose 8579 = -16r + 8787. Solve -24z + 14z = -rz for z. 0 Suppose 3i - 4j - 19 = 0, j - 17 - 7 = -5i. Suppose -id - 1 = 4p - 3p, -d = -p + 11. Solve p = 5b - 6 for b. 3 Let o = 340 - 315. Suppose ol - 234 = 7l. Solve 3z - l = -25 for z. -4 Let t = 809 - 804. Let j = 38 - 34. Solve ti + j = -11 for i. -3 Let r = -206 + 87. Let z = r + 121. Solve -6 + 0 = -zy for y. 3 Let b(s) = -8s + 3. Let r be b(-13). Suppose rw = 101w + 54. Solve 0 = 5u - 2u - w for u. 3 Suppose 18w + 132 = 20w. Suppose -9r + w = -159. Solve rl = 28l for l. 0 Let t(k) = 15k + 79. Let c be t(-5). Suppose -cl = -l. Solve ln + 4n = 0 for n. 0 Let v(q) be the third derivative of -q*4/8 + 11q*3/6 - 14q*2. Let z(p) = -4p + 12. Let r(x) = -3v(x) + 2z(x). Let g be r(9). Solve 12 = 4b - gb for b. 3 Let y(l) = -7l2 - 19l - 34. Let c be y(-7). Let k = c + 249. Solve	{ "pile_set_name": "DM Mathematics" }
s of c. 2, 13 Let t(j) = j*2 - 12j + 3. Let r be t(12). Let m be (1r)/(21/(-280)). Let f = m - -59. What are the prime factors of f? 19 Let x be -2 + 19 - (-1 - 0). Suppose 4r - 2m + 0m = 20, -5m = -r + 14. List the prime factors of -3 + x10/r. 2, 3, 7 Suppose j - 2y = 22, -5y - 31 = -0j - j. Let c = -19 + j. What are the prime factors of 48 - (c + (3 - 0))? 2, 3 Suppose 11l - 16l + 6692 = 3b, -4b - 2682 = -2l. What are the prime factors of l? 13, 103 Suppose -4m - 5u = 7, 0 = 2m - u - u + 8. Let c be 35/10 - m/(-6). Suppose cf = 3t - 12, t - 16 = -3t + 5f. List the prime factors of t. 2 Let f(i) be the first derivative of 1/3i*3 - 1/2i*2 + 2 - 3i. List the prime factors of f(6). 3 Let p(b) = -b*3 - 12b*2 + 3b - 54. List the prime factors of p(-13). 2, 19 Suppose -r - 2f = -5, -2r - r = 4f - 21. Let s(j) = j + 25. Let h be s(-5). Let p = h + r. List the prime factors of p. 31 Let w = -5 - 7. Let p(o) = -2o*2 - 28o - 18. What are the prime factors of p(w)? 2, 3, 5 Let c(b) = b. Let f be c(3). Suppose 5u = fu - 82. Let g = u + 74. What are the prime factors of g? 3, 11 Let r(o) = 6o2 + 6o - 15. Let w be r(-8). Let h = w - 160. What are the prime factors of h? 7, 23 Suppose 89c + 4k - 13484 = 85c, 6 = -2k. List the prime factors of c. 2, 7, 241 Suppose 2r + 3r + 115 = 0. Suppose -2y + 10 = -0y. Let o = y - r. What are the prime factors of o? 2, 7 Let l = -20 + 11. Suppose -3g + 3h = h - 78, 0 = -2h. Let w = l + g. List the prime factors of w. 17 Let s be 0 - (-6 - -3 - -1). Let i(a) = 3a*3 - 2a*2 - a - 2. Let g be i(s). What are the prime factors of ((-4)/g)/((-1)/21)? 7 Suppose -3t + 5u = -14, 3t + u = 2t + 2. Suppose -tc = -c - 294. Suppose -4o + c = -57. List the prime factors of o. 3, 17 Let j be -10(4 - 112/20). What are the prime factors of (-312)/j(-3 - -1)? 3, 13 Suppose 0 = -b - 5b + 6. List the prime factors of (b + 2/(-10))/(4/710). 2, 71 Let k(s) = -s*3 + 6s*2 - 6s + 8. List the prime factors of k(5). 3 Let i(x) = -540x - 944. What are the prime factors of i(-6)? 2, 7, 41 Suppose t = 3h + 645 - 3170, 4h - 5t - 3374 = 0. List the prime factors of h. 29 Suppose -3f + 0f - 2h + 17 = 0, -2f - h = -11. Suppose fa - 2a = 21. List the prime factors of a. 7 Suppose 0 = -5b - c + 2c + 11344, -2b + c + 4537 = 0. List the prime factors of b. 2269 Let y be (14/35)/((-1)/(-5)). Suppose -yr + 132 = r. List the prime factors of r. 2, 11 Suppose 4p - 452 = 4n - 0n, -5p = 4n - 538. Let l = p + 57. What are the prime factors of l? 167 Let h = -21 - -34. Suppose 8u = 259 + h. List the prime factors of u. 2, 17 Let s be (-3815)/(-15) + (-33)/(-9) + -3. Suppose 11u = 6u + s. List the prime factors of u. 3, 17 Suppose -4b = -b - 12. Suppose 138 + 1214 = -bf. List the prime factors of 1/(-6) + f/(-12). 2, 7 Let j = -38 + 26. Let b(v) = 2v + 12. Let c(d) = d + 6. Let r(q) = -4b(q) + 7c(q). List the prime factors of r(j). 2, 3 List the prime factors of -2 - (5 - 65 - -6). 2, 13 Let b = 96 + -77. List the prime factors of (-5 + 44)b/3. 13, 19 Let d = 681 + -463. What are the prime factors of d? 2, 109 Suppose -79f + 86f - 14 = 0. Let o = -2 + 2. Suppose i + 5n - 2 = o, i - 42 = 3n + fn. List the prime factors of i. 2, 11 Let f(l) = -l + 1. Let n be f(0). Let h be n/(((-15)/174)/5). Let w = -39 - h. What are the prime factors of w? 19 Let f(g) = -33g + 130. List the prime factors of f(-12). 2, 263 Suppose -80t - 9432 = -88t. List the prime factors of t. 3, 131 Let n(h) = 2h2 - 11h - 5. Suppose -3r + 0u + u = -32, -5r = -4u - 65. List the prime factors of n(r). 2, 29 Let r be 884/(-24) - (-5)/6. List the prime factors of 2/(((-1)/(-183))/((-6)/r)). 61 Suppose 5r + 26 = 2z, -2z = -z + 2r - 31. Suppose -5 = j - z. List the prime factors of j. 2, 3 Let y be -3 + (2/(-4))/((-3)/(-1182)). Let x = y - -371. What are the prime factors of x? 3, 19 Let x be (-6)/((-3)/1) - -2. Suppose -2d - 16 = 2d, 3d + 84 = xk. Suppose -13b = -15b + k. List the prime factors of b. 3 Let b = -108 - -117. What are the prime factors of 1/(-12)-4 - (-897)/b? 2, 5 Suppose -5t + 3a + 10 + 10 = 0, t - 4 = -5a. Suppose -4r - 125 = -j - 2r, tj - 5r = 494. List the prime factors of j. 11 Let a be (0/15)/(1-3). Suppose a = -9b + 3b + 12. Suppose bg + 26 = n - 13, -4n + g + 142 = 0. List the prime factors of n. 5, 7 Let b be ((-4 - -1)/3)/(2/(-10)). Suppose -bj + 498 = 4t, -j - 4j = 10. What are the prime factors of t? 127 Suppose -9o - 956 = -1010. Let v = 3 - -30. Let b = o + v. List the prime factors of b. 3, 13 Let j be (-11 + 3 + 0)/(-2). Let n(z) = -5z + 1 + jz - 4 + 2. What are the prime factors of n(-6)? 5 List the prime factors of 49 + (-88)/22. 2 Let m(l) = l*3 + 9l*2 - 11l - 8. Let o be m(-10). Suppose 3c = 4i - 0i + 191, 3i = oc - 128. List the prime factors of c. 61 Suppose 443 = k + q, k = 4q + 199 + 249. Suppose 0 = -i + g + 295 - 73, -2i - 2g + k = 0. What are the prime factors of i? 2, 3, 37 Let z(n) = -n + 2. Let a(g) = -g + 2. Let d(m) = 4a(m) - 3z(m). Let w be d(-1). Suppose -24 - 36 = -ws. What are the prime factors of s? 2, 5 Let t = -14 - -15. Let k = t + -2. List the prime factors of -41(-2 - k) - 4. 37 Suppose -5y + 3u = -1804, 4y - 1451 = 3u + 2u. List the prime factors of y. 359 Let i = -933 + 3980. List the prime factors of i. 11, 277 Suppose -126l + 128l - 3088 = 0. What are the prime factors of l? 2, 193 Let s = -34 - -46. Let w be (11 - s)(-9 - 1). What are the prime factors of 3/5 - (-554)/w? 2, 7 Suppose -4c - 4f = -1050 - 266, 983 = 3c + f. List the prime factors of c. 3, 109 Suppose 5i + 128 = 9i. What are the prime factors of i? 2 Let p(k) = -1. Let b(d) = -2d*3 - 2d*2 + 3d + 2. Let s = -22 + 17. Let w(j) = sp(j) - b(j). What are the prime factors of w(2)? 3, 7 Let k(h) = -h2 - h + 16. Let w be k(-4). Let i(t) = -14. Let c(p) = -p + 1. Let n(o) = -3c(o) - i(o). What are the prime factors of n(w)? 23 Let a be -1 + (3 - (-4 - -2)). Let u = -124 + 128. Suppose 5j - 75 = -c + 37, -aj + 96 = uc. List the prime factors of j. 2, 11 Let r(s) = s2 - 4s - 14. Let o be r(7). Let i(w) = w*3 - 6w*2 + 4w - 4. What are the prime factors of i(o)? 73 Suppose -3k + 5w + 156 + 3465 = 0, 3k - 3w = 3621. What are the prime factors of k? 17, 71 Let z = -707 + 2351. What are the prime factors of z? 2, 3, 137 Let m(l) = l*3 - 2l*2 + l + 1. Let y be m(2). Suppose -3z - 2s + s = -13, 0 = -yz - 2s + 11. What are the prime factors of (1 - z6)/(-1)? 29 What are the prime factors of -6 + 1561 + 13 + 4? 2, 3, 131 Let s(h) be the third derivative of h5/60 + h4/12 + 5h3/6 - 8h*2. Let g = -6 - -2. What are the prime factors of s(g)? 13 Suppose 5o - 3s - 832 = -6s, -5o + 833 = 2s. What are the prime factors of o? 167 Suppose 21l - 22l + 142 = 0. List the prime factors of l. 2, 71 Suppose 1328 = -24x + 19472. What are the prime factors of x? 2, 3, 7 Let m(p) = -p. Let o(t) = -4t - 7. Let x(y) = -2m(y) - o(y). Let z be x(-4). Let g(r) = -2r + 10. List the prime factors of g(z). 2, 11 Let b = -10 - -14. Suppose bv = 2n + 18, -4v = -0v - 3n - 19. Suppose 2o - 36 = -t, vt - 10 - 14 = -2o. List the prime factors of o. 2, 5 Let x(q) = -3q - 4. Let s be x(8). List the prime factors of (-8)/s + (-178)/(-14). 13 Let x = 6 - -251. List the prime factors of x. 257 Suppose 0 = -4l - 4n + 14 + 6, 5l - 2n = 11. Suppose -2h + h + 7 = 3m, lm + 2h - 2 = 0. List the prime factors of m/(-8)4 + 38. 2, 3 Suppose -2y + 18 = y. Let h(r) = 2r*3 - 3r*3 - 5r*2 - 7r + 8 + 2r3. What are the prime factors of h(y)? 2 Let t = 57 + -55. Suppose 207 = tj - 161. What are the prime factors of j? 2, 23 Let f = 51 - 52. List the prime factors of (1 - f)(-9)/((-144)/536). 67 Let a(n) = 45n*2 + 146n - 4. What are the prime factors of a(6)? 2, 7, 89 Suppose 2s = -21a + 23a - 2604, 2a = s + 2603. What are the prime factors of a? 1301 Let g(t) = -t*3 + 15t*2 - 11t - 30. Let i be g(14). List the prime factors of (i/3)/(-1) + 90. 2, 43 Suppose 4b + 4x = 72, 4b - 6x = -x + 36. Let a be 4/b - 38/(-14). Suppose -4m = -8, 2m - 15 = -a*t - m. List the prime factors of t.	{ "pile_set_name": "DM Mathematics" }
))*2). -4700807 + 240sqrt(13) Simplify (-5-5(sqrt(363) + -1sqrt(363) + sqrt(363) + -3)1 + -4)3 + -5. -242 + 825sqrt(3) Simplify (((2-3sqrt(432) - sqrt(432)) + sqrt(432))/sqrt(12))/(-3sqrt(108)5). 2sqrt(3)/15 Simplify 4 + ((sqrt(1377) + -1 + -2 + -5)-5 - -2((sqrt(1377) + 0)-4)*2-5). -220276 - 45sqrt(17) Simplify (-2 + sqrt(2057)-2-2-3 + -3 + 3(-4 + 1sqrt(2057)-1))2. 5610sqrt(17) + 463114 Simplify -2 + (-1 + -22(sqrt(304) + 1 - (sqrt(931)2 - sqrt(931))))2. -120sqrt(19) + 2759 Simplify (-3((-52sqrt(84) + sqrt(84))4)/((sqrt(84) + ((sqrt(84) + -4sqrt(84))6 - sqrt(84)))/sqrt(7)))*2. 252 Simplify -5((3sqrt(3000)-1)/((sqrt(60) - (sqrt(60) - ((sqrt(60) - sqrt(240)/sqrt(4)) + sqrt(60))-3))/sqrt(10)) + -1 + -5). -50sqrt(5) + 30 Simplify ((1sqrt(153)-2 + sqrt(153))-4)/((-3(sqrt(90)2 + sqrt(90) + sqrt(90)))/sqrt(10))-6. 2sqrt(17) Simplify -2(-2 + (sqrt(80) + sqrt(80) + -1 + sqrt(80) + (sqrt(5) - (sqrt(5) - sqrt(15)/sqrt(3)))-1 + (sqrt(80) - (-5 + sqrt(80)-1)))*2). -3638 - 304sqrt(5) Simplify -1 + (3 + 3sqrt(637) + (sqrt(637) - (sqrt(637) + (5 + sqrt(637))-1)) + -3)*2. 280sqrt(13) + 10216 Simplify 5 + 5 + 4-6(-4(sqrt(27))2 + sqrt(3))5 + 3. -120sqrt(3) + 12973 Simplify ((sqrt(294) - (sqrt(294) - (sqrt(294)1 + sqrt(294))))-2)/(5sqrt(4)/sqrt(2) - -1sqrt(10)/sqrt(5)) + 5 + 0. -14sqrt(3)/3 + 5 Simplify ((sqrt(32) + -2sqrt(32) + -5 - (3sqrt(32) + 2)) + (-1sqrt(8)-3)/((3sqrt(576) - sqrt(576) - sqrt(576)) + sqrt(576)))2. 889sqrt(2)/4 + 17697/32 Simplify (4 + ((2 + 2 + sqrt(847))-6 - (sqrt(847) - 2(sqrt(847) + 0 - sqrt(847)) - ((0 + sqrt(847) - sqrt(847)) + -5))) + 3)*2. 3388sqrt(7) + 41987 Simplify (2(5 + 4 + (sqrt(27) - sqrt(3)))-5 - (3 + -2sqrt(75) + -3 + -4))2. 1720sqrt(3) + 7696 Simplify -2 + (-1(((sqrt(1584) - sqrt(1584)5 - sqrt(1584))-1 + sqrt(1584))2 - ((3 + sqrt(1584) - sqrt(1584)) + -2 + 1)))*2. -576sqrt(11) + 228098 Simplify ((1(sqrt(242) - (0 + sqrt(242))))2 + -1 - (4 + (sqrt(242) + 1 + sqrt(242) - sqrt(242)))22)4. -2140 - 880sqrt(2) Simplify (((sqrt(1200) - (sqrt(1200) - (2sqrt(1200) - sqrt(1200))))54)/(-3sqrt(24)/sqrt(6) + sqrt(4)-1-6))*2. 40000/3 Simplify 0 + (-1(-3 + sqrt(112)1 - -1sqrt(112)2)1-6-1)*2. -2592sqrt(7) + 36612 Simplify -4(-5 + (sqrt(176) + 1 + 1 - ((0 + sqrt(176) - sqrt(176)) + -2))2 + 5). -768 - 128sqrt(11) Simplify -5 + 5 + ((sqrt(24)/(-5sqrt(200)))2 - (-3 + (sqrt(48) + sqrt(3))2 + 3)) + -2. -48122/625 Simplify ((2 + ((sqrt(242) + -1)6 - -6(sqrt(242) + 0)) + -3)5 + 4)*2. -40920sqrt(2) + 872161 Simplify 5 + (32sqrt(1701))/(sqrt(48) + (2sqrt(192) + sqrt(192))/sqrt(4)) + 3 + 2. 27sqrt(7)/8 + 10 Simplify (2 + 4 + 0 + sqrt(75))*2 - (sqrt(2541) - (1sqrt(2541) - sqrt(2541)))/(sqrt(28)/(sqrt(8)/sqrt(2))). 49sqrt(3) + 111 Simplify 3sqrt(176) + sqrt(11) + (sqrt(1100) - (-4 + sqrt(1100)) - sqrt(1100))*2 + ((sqrt(1331)1)*2-1 - sqrt(1331))4. -4208 - 111sqrt(11) Simplify 1 + (-3 + sqrt(128) + -4 + -4 - 6((sqrt(128) + 3 - sqrt(128) - sqrt(128))2 + 4)) + -4. -860 + 296sqrt(2) Simplify (-6(11sqrt(119) - sqrt(119) - sqrt(119)24))/(sqrt(112) + (sqrt(7) - -2sqrt(343))). 48sqrt(17)/19 Simplify 1 + (-6(-1-2sqrt(2057) + 2sqrt(2057)-6) + -5)*2 + 1 + -3. -6600sqrt(17) + 7405224 Simplify (sqrt(720) - ((sqrt(720) - -3sqrt(720)) + sqrt(720)) - sqrt(720))/sqrt(10) + -3 - (3 + 3 + -3 + -4 + sqrt(2)). -31sqrt(2) - 2 Simplify -4(2 + (2 + -6((4(sqrt(3) + -1sqrt(3)) - sqrt(3)) + (sqrt(18)/sqrt(3))/sqrt(2))6)-1)*2. 0 Simplify -4(-2sqrt(1584) - sqrt(1584))2-3 - 21sqrt(99)/(1sqrt(9)). -2sqrt(11) + 171072 Simplify (-3(sqrt(225)-2 - sqrt(225)))/(sqrt(1500)/sqrt(12) + sqrt(5) - sqrt(20)/sqrt(4)-3) + -1. -1 + 3sqrt(5) Simplify -1((sqrt(10)/sqrt(125) - sqrt(8)/sqrt(16)) + (sqrt(180)-5)/sqrt(10))*2 + 4. -23209/50 Simplify -4((sqrt(300)/sqrt(20))/sqrt(10))/((sqrt(324)-6)/sqrt(12)) + 0. sqrt(2)/9 Simplify (1 + 3(3 + -3sqrt(1377)-1)3 + -2 + 5 + -2)2. 14094sqrt(17) + 1004674 Simplify -5 + (sqrt(364)/(sqrt(7) + sqrt(28)/sqrt(4)) - sqrt(52))-4 + (sqrt(65) + (sqrt(65) - -4sqrt(65)2) - sqrt(65))/(sqrt(20)/sqrt(196)). -5 + 67sqrt(13) Simplify (-3((sqrt(156) - -2sqrt(156)-2) + (sqrt(156)-1 + sqrt(156))5))/(-2((sqrt(1728)-3-5 + sqrt(1728) - sqrt(1728)) + sqrt(1728) + sqrt(1728))). -3sqrt(13)/136 Simplify ((3(-1sqrt(81) - sqrt(81)))/(sqrt(12)/sqrt(16)))/((sqrt(225) + sqrt(225) + -1sqrt(225) + sqrt(225))-5 - (1-1sqrt(225) - sqrt(225))). 3sqrt(3)/10 Simplify -2(sqrt(147)-1 - sqrt(3) - (sqrt(3) + sqrt(6)/sqrt(72) + sqrt(3)))*2 - (63sqrt(9) + sqrt(9))/(sqrt(3) + (sqrt(15)/sqrt(245) - sqrt(3)) - sqrt(3)). -3721/6 + 133sqrt(3)/6 Simplify (-3(-6(2 + 1 + sqrt(343)) - (sqrt(343) - (sqrt(343) - sqrt(343)3)2)4))2-4. -8358912 - 235872sqrt(7) Simplify (2 + (sqrt(176) - (sqrt(176)-5 - sqrt(176)))2 - ((1 + sqrt(1584))2 - (-3 + sqrt(44)/sqrt(4) - sqrt(11)))) + 0. -24sqrt(11) + 7038 Simplify (sqrt(1815) + (sqrt(1815) - (sqrt(1815) - (-3sqrt(1815) + sqrt(1815)))) - (sqrt(90) + 3sqrt(90))/sqrt(6))/((sqrt(55)1)/sqrt(11)-66). 5sqrt(3)/12 Simplify ((-2sqrt(35)2)/(-4sqrt(10)/sqrt(2)) - (-4sqrt(441)/sqrt(7) + 1))2. -26sqrt(7) + 1184 Simplify (sqrt(833)-1 - (sqrt(612) - (sqrt(612) + -1))2) + -1 - ((sqrt(51)/(sqrt(15)/sqrt(5)) - sqrt(17))-2 + 0). -7sqrt(17) - 2 Simplify (0 + ((sqrt(405) + 0)42 - (-6(sqrt(405) + 0) + 4 + sqrt(405)1)))2-6. -410766 + 5616sqrt(5) Simplify (((2sqrt(264)-4)/(sqrt(704) + (sqrt(704) - sqrt(704)-2)))/(sqrt(1452) - sqrt(1452)3 - sqrt(96)/(sqrt(24)/sqrt(3))))2. 1/4232 Simplify (61(1sqrt(136) - sqrt(136)))/(3sqrt(128)4). 0 Simplify (1(-4 + (6((sqrt(405) + 1)*2 + 1) - ((sqrt(405) - (1sqrt(405) + sqrt(405)))4 + -4)2)) + 1)-6. 1080sqrt(5) + 24342 Simplify ((5(-2sqrt(648) + sqrt(18)))/((sqrt(225) - sqrt(9))54))21 + 1. 249/128 Simplify -3 + sqrt(1088) + (4 + sqrt(1088))*2 + 5(sqrt(17) + sqrt(85)/sqrt(45) + -2(sqrt(17) + -2)) + -2. 206sqrt(17)/3 + 1119 Simplify -2 + -5 + (sqrt(76)/sqrt(4))*2 + (sqrt(95)2)/sqrt(5) + 2 + (sqrt(133)/(-2sqrt(7)) + 4 - (sqrt(76) + sqrt(76)-11)/sqrt(4))2. -2sqrt(19) + 139/4 Simplify -2 + (sqrt(18) - (2sqrt(18))2)5 + (-4 + sqrt(2) + 1 - 4sqrt(4)/sqrt(2))2 + -5. -340 + 33sqrt(2) Simplify 3(3sqrt(42)6-2)/(-2(sqrt(48)/sqrt(4) + sqrt(12))/sqrt(2)). 27sqrt(7) Simplify 5(sqrt(440)/(sqrt(50)/sqrt(5)-5))/(3sqrt(484)4). -sqrt(11)/132 Simplify (-4-3sqrt(209)-2)/(sqrt(77)/(sqrt(70)/sqrt(10)1)). -24sqrt(19) Simplify (((sqrt(567)-1 - sqrt(567))6-4)/(sqrt(441) - (-5(sqrt(441) + -2sqrt(441)) + sqrt(441))))*2-6. -124416/175 Simplify ((sqrt(308)16)/(sqrt(11) - (sqrt(1100)-2 - sqrt(1100))))/(-6(sqrt(36) + (-2sqrt(36) - sqrt(36))) - (sqrt(1296) - (sqrt(1296) + sqrt(1296)2))). sqrt(7)/372 Simplify 5(1-1(sqrt(68) + (sqrt(68) + sqrt(68)2-1 - sqrt(68))))/(-2sqrt(64) - sqrt(800)/sqrt(8)). -5sqrt(17)/13 Simplify (-5 + 1(4 + (sqrt(243) - (0 + sqrt(243) + -4)))3)2. 361 Simplify (-1 + -4(0 + sqrt(1900)1 + 3 + sqrt(1900) + -3(sqrt(1900) + -1)-5))2. -63920sqrt(19) + 8787809 Simplify (((sqrt(275) + -3)6)2 - sqrt(110)/((sqrt(110)3)/sqrt(11)))-3-1. -3241sqrt(11) + 30672 Simplify ((sqrt(1100) + 0)-3 + 5 - (sqrt(1100) + 0 + 5 - 1(0 + sqrt(1100) - sqrt(1100))) - (-4 + -1 + sqrt(1100) - (1 + sqrt(1100) + 0))-35)2. 7200sqrt(11) + 25700 Simplify (334(((-2sqrt(330))/sqrt(10) + sqrt(33))/sqrt(11) + -2 + 2sqrt(147)))2. -67392sqrt(3) + 662256 Simplify (0 + (-2sqrt(176)-1 - ((2 + sqrt(176) - sqrt(176)) + -5) - ((sqrt(176) - (sqrt(176) + 1 + sqrt(176)))2 + (sqrt(176) + sqrt(176)2)-2)))2. 400sqrt(11) + 17625 Simplify (1 + -5 + 5 + -6(0 + sqrt(684)))24. -288sqrt(19) + 98500 Simplify (sqrt(1134)2 - (1sqrt(504) - sqrt(504) - sqrt(504)))/(sqrt(18)/(-4sqrt(729) - sqrt(729))). -1080sqrt(7) Simplify -3(1 + (-2 + (sqrt(76) + sqrt(76) + sqrt(76) + 0 + sqrt(76))*2 + (2sqrt(76) + 5)*2)-63)6. 12960sqrt(19) + 499914 Simplify (3-5-52sqrt(78))/((sqrt(450)-2)/(2sqrt(147))). -210sqrt(13) Simplify (-6((sqrt(171)1 - sqrt(171)) + 0))*21 - ((-2(-1 + sqrt(171)) + (1sqrt(171) - sqrt(171))-3 + sqrt(171))*2 + 1). -176 + 1	{ "pile_set_name": "DM Mathematics" }
before 4:16 PM? 8:28 AM What is 514 minutes before 3:14 PM? 6:40 AM How many minutes are there between 10:38 AM and 4:10 PM? 332 How many minutes are there between 12:47 AM and 3:52 AM? 185 How many minutes are there between 2:18 PM and 4:50 PM? 152 How many minutes are there between 4:53 PM and 11:51 PM? 418 How many minutes are there between 11:48 AM and 6:48 PM? 420 How many minutes are there between 6:21 AM and 3:27 PM? 546 What is 697 minutes before 3:32 AM? 3:55 PM How many minutes are there between 4:31 AM and 7:04 AM? 153 What is 48 minutes before 2:00 AM? 1:12 AM How many minutes are there between 10:18 PM and 6:45 AM? 507 What is 625 minutes after 8:28 PM? 6:53 AM What is 12 minutes before 7:08 AM? 6:56 AM What is 115 minutes before 1:49 AM? 11:54 PM What is 568 minutes after 10:28 PM? 7:56 AM What is 144 minutes after 4:36 AM? 7:00 AM What is 194 minutes after 2:55 PM? 6:09 PM What is 584 minutes after 4:33 AM? 2:17 PM How many minutes are there between 8:46 AM and 9:25 AM? 39 How many minutes are there between 11:40 PM and 10:24 AM? 644 What is 423 minutes before 2:23 PM? 7:20 AM What is 252 minutes before 6:12 PM? 2:00 PM How many minutes are there between 5:47 PM and 4:14 AM? 627 How many minutes are there between 8:22 AM and 3:26 PM? 424 What is 310 minutes after 6:47 PM? 11:57 PM What is 714 minutes after 5:22 PM? 5:16 AM What is 463 minutes after 2:33 AM? 10:16 AM How many minutes are there between 2:17 AM and 7:08 AM? 291 How many minutes are there between 9:09 PM and 6:57 AM? 588 What is 485 minutes before 9:52 AM? 1:47 AM What is 584 minutes after 9:35 AM? 7:19 PM How many minutes are there between 1:44 PM and 4:50 PM? 186 What is 568 minutes before 11:17 AM? 1:49 AM What is 305 minutes before 5:11 AM? 12:06 AM What is 372 minutes after 4:33 AM? 10:45 AM How many minutes are there between 11:33 PM and 3:36 AM? 243 What is 429 minutes before 1:20 PM? 6:11 AM What is 549 minutes before 11:15 PM? 2:06 PM What is 420 minutes after 3:46 AM? 10:46 AM How many minutes are there between 1:22 PM and 6:43 PM? 321 What is 420 minutes before 6:58 AM? 11:58 PM What is 283 minutes after 9:56 PM? 2:39 AM What is 51 minutes before 10:10 AM? 9:19 AM What is 560 minutes after 6:21 PM? 3:41 AM How many minutes are there between 7:08 PM and 4:40 AM? 572 How many minutes are there between 4:14 AM and 10:56 AM? 402 What is 12 minutes after 6:14 AM? 6:26 AM What is 690 minutes after 3:44 PM? 3:14 AM How many minutes are there between 8:01 PM and 8:54 PM? 53 How many minutes are there between 6:45 PM and 4:54 AM? 609 What is 101 minutes after 11:11 PM? 12:52 AM What is 558 minutes after 6:41 PM? 3:59 AM How many minutes are there between 6:34 AM and 8:12 AM? 98 How many minutes are there between 9:12 PM and 2:07 AM? 295 How many minutes are there between 8:00 AM and 8:44 AM? 44 What is 628 minutes before 10:28 PM? 12:00 PM How many minutes are there between 7:32 AM and 9:54 AM? 142 How many minutes are there between 9:02 AM and 6:38 PM? 576 How many minutes are there between 9:36 PM and 1:46 AM? 250 What is 240 minutes after 5:16 AM? 9:16 AM How many minutes are there between 6:08 PM and 8:30 PM? 142 What is 279 minutes after 6:30 PM? 11:09 PM How many minutes are there between 12:20 PM and 3:16 PM? 176 What is 406 minutes before 11:33 PM? 4:47 PM How many minutes are there between 10:47 AM and 8:36 PM? 589 How many minutes are there between 1:53 PM and 8:43 PM? 410 How many minutes are there between 6:43 AM and 8:00 AM? 77 What is 104 minutes after 1:01 PM? 2:45 PM How many minutes are there between 9:09 AM and 5:30 PM? 501 What is 719 minutes before 7:29 AM? 7:30 PM What is 52 minutes before 10:47 PM? 9:55 PM What is 298 minutes before 11:56 PM? 6:58 PM What is 327 minutes before 9:04 AM? 3:37 AM How many minutes are there between 3:48 AM and 4:15 AM? 27 What is 121 minutes after 1:15 AM? 3:16 AM What is 54 minutes before 12:22 AM? 11:28 PM How many minutes are there between 10:03 AM and 6:14 PM? 491 How many minutes are there between 1:42 PM and 6:51 PM? 309 How many minutes are there between 8:42 AM and 10:33 AM? 111 How many minutes are there between 11:14 AM and 10:57 PM? 703 How many minutes are there between 10:46 AM and 1:47 PM? 181 What is 474 minutes before 12:05 PM? 4:11 AM What is 385 minutes before 12:22 PM? 5:57 AM How many minutes are there between 9:05 PM and 5:13 AM? 488 What is 251 minutes after 5:54 PM? 10:05 PM How many minutes are there between 2:09 PM and 6:21 PM? 252 How many minutes are there between 7:12 AM and 8:50 AM? 98 How many minutes are there between 8:20 AM and 3:23 PM? 423 What is 243 minutes after 11:39 PM? 3:42 AM How many minutes are there between 7:34 PM and 2:46 AM? 432 What is 310 minutes before 4:54 AM? 11:44 PM What is 14 minutes before 9:18 AM? 9:04 AM What is 270 minutes before 7:59 AM? 3:29 AM What is 463 minutes before 2:19 AM? 6:36 PM How many minutes are there between 5:23 PM and 5:22 AM? 719 How many minutes are there between 4:57 PM and 8:28 PM? 211 What is 90 minutes before 6:08 PM? 4:38 PM How many minutes are there between 10:31 PM and 10:19 AM? 708 How many minutes are there between 6:32 AM and 5:00 PM? 628 How many minutes are there between 7:04 AM and 6:06 PM? 662 What is 681 minutes before 3:45 AM? 4:24 PM How many minutes are there between 12:19 AM and 12:52 AM? 33 How many minutes are there between 9:56 PM and 7:16 AM? 560 How many minutes are there between 9:07 AM and 9:09 AM? 2 How many minutes are there between 3:20 PM and 9:54 PM? 394 How many minutes are there between 9:21 PM and 8:51 AM? 690 What is 142 minutes after 8:49 AM? 11:11 AM How many minutes are there between 7:17 PM and 5:01 AM? 584 How many minutes are there between 2:14 AM and 11:33 AM? 559 How many minutes are there between 12:04 AM and 6:32 AM? 388 How many minutes are there between 1:57 AM and 2:07 AM? 10 How many minutes are there between 7:15 PM and 10:26 PM? 191 How many minutes are there between 6:22 AM and 8:05 AM? 103 How many minutes are there between 11:17 AM and 8:26 PM? 549 How many minutes are there between 10:05 PM and 12:02 AM? 117 What is 101 minutes before 10:58 PM? 9:17 PM What is 467 minutes after 8:49 AM? 4:36 PM What is 366 minutes after 7:36 AM? 1:42 PM What is 628 minutes before 7:36 AM? 9:08 PM What is 643 minutes after 11:24 AM? 10:07 PM What is 132 minutes before 9:12 AM? 7:00 AM How many minutes are there between 1:10 AM and 10:55 AM? 585 How many minutes are there between 11:08 PM and 6:16 AM? 428 How many minutes are there between 12:25 AM and 4:16 AM? 231 How many minutes are there between 8:16 PM and 7:38 AM? 682 How many minutes are there between 1:03 AM and 1:12 AM? 9 What is 250 minutes before 10:44 PM? 6:34 PM How many minutes are there between 2:28 PM and 4:56 PM? 148 What is 366 minutes before 9:55 PM? 3:49 PM What is 195 minutes after 9:01 PM? 12:16 AM What is 444 minutes after 3:32 AM? 10:56 AM What is 491 minutes before 9:19 AM? 1:08 AM What is 553 minutes before 1:11 PM? 3:58 AM What is 152 minutes after 3:13 AM? 5:45 AM What is 283 minutes before 2:30 AM? 9:47 PM How many minutes are there between 9:43 PM and 3:54 AM? 371 What is 195 minutes after 4:59 AM? 8:14 AM How many minutes are there between 1:28 PM and 12:37 AM? 669 What is 244 minutes before 2:46 PM? 10:42 AM What is 197 minutes after 11:42 PM? 2:59 AM How many minutes are there between 10:30 PM and 9:47 AM? 677 What is 121 minutes before 1:04 AM? 11:03 PM What is 636 minutes after 6:02 AM? 4:38 PM How many minutes are there between 2:39 AM and 12:23 PM? 584 What is 588 minutes after 3:46 PM? 1:34 AM How many minutes are there between 10:49 AM and 7:33 PM? 524 How many minutes are there between 7:31 PM and 9:53 PM? 142 How many minutes are there between 7:01 PM and 4:17 AM? 556 How many minutes are there between 2:04 AM and 6:59 AM? 295 How many minutes are there between 12:00 PM and 2:25 PM? 145 What is 719 minutes after 1:07 PM? 1:06 AM How many minutes are there between 11:30 PM and 10:09 AM? 639 What is 453 minutes before 11:07 PM? 3:34 PM How many minutes are there between 10:40 PM and 1:04 AM? 144 How many minutes are there between 6:16 PM and 10:07 PM? 231 What is 391 minutes after 10:28 AM? 4:59 PM What is	{ "pile_set_name": "DM Mathematics" }
decimal places. 1.1 Round -0.00077565 to 5 dps. -0.00078 What is 0.000006082 rounded to six dps? 0.000006 Round 8076 to the nearest 1000. 8000 Round 0.014461 to 4 decimal places. 0.0145 Round -116100 to the nearest 1000. -116000 What is 840400 rounded to the nearest 100000? 800000 What is 289760000 rounded to the nearest one million? 290000000 Round -5846 to the nearest 100. -5800 What is 95.6 rounded to 0 dps? 96 Round -0.03277 to 2 dps. -0.03 Round 0.0000061 to 6 decimal places. 0.000006 Round 11.74 to the nearest integer. 12 Round 0.2524 to 2 decimal places. 0.25 What is 0.6131 rounded to two dps? 0.61 What is -330120 rounded to the nearest 1000? -330000 What is -1230.2 rounded to the nearest ten? -1230 What is -167830 rounded to the nearest one thousand? -168000 Round 1505630 to the nearest 10000. 1510000 What is -0.00006485 rounded to five dps? -0.00006 Round -1162000 to the nearest 10000. -1160000 Round -0.078665 to three dps. -0.079 Round 116400 to the nearest 100000. 100000 Round -1.129 to 1 decimal place. -1.1 What is 134.38 rounded to the nearest ten? 130 Round 15.5312 to 2 decimal places. 15.53 What is -4.963 rounded to one decimal place? -5 What is 0.04061 rounded to 2 dps? 0.04 Round 0.000006321 to seven dps. 0.0000063 What is 2.64 rounded to the nearest integer? 3 Round 0.07411 to two decimal places. 0.07 What is -5.4352 rounded to 1 dp? -5.4 What is -0.0000040306 rounded to six decimal places? -0.000004 Round 9766 to the nearest one hundred. 9800 Round -0.000003879 to six dps. -0.000004 Round 15650 to the nearest ten thousand. 20000 What is 0.0014332 rounded to 4 dps? 0.0014 Round 4182.4 to the nearest one hundred. 4200 What is -0.69314 rounded to one dp? -0.7 Round 588470 to the nearest one hundred thousand. 600000 What is 148.1 rounded to the nearest 10? 150 What is -0.006032 rounded to 4 dps? -0.006 What is 35.82 rounded to 0 decimal places? 36 Round 0.0046448 to 4 dps. 0.0046 Round -0.000007112 to six decimal places. -0.000007 Round -0.38126 to three decimal places. -0.381 Round -0.000004261 to 6 dps. -0.000004 What is 37400 rounded to the nearest 1000? 37000 Round -0.00002499 to 6 decimal places. -0.000025 What is -4085980 rounded to the nearest 100000? -4100000 Round -15040 to the nearest ten thousand. -20000 Round -142585 to the nearest one thousand. -143000 Round -4.7801 to 2 decimal places. -4.78 What is -0.0000020737 rounded to seven dps? -0.0000021 Round -21320 to the nearest one thousand. -21000 Round -65200 to the nearest one thousand. -65000 Round -136.79 to the nearest 10. -140 Round -0.000017334 to 7 dps. -0.0000173 Round -40.919 to zero dps. -41 What is -213690000 rounded to the nearest 1000000? -214000000 Round 0.00000115657 to seven dps. 0.0000012 What is 0.0000006206 rounded to 7 dps? 0.0000006 What is 759 rounded to the nearest 10? 760 What is 2874 rounded to the nearest 1000? 3000 What is -0.000046018 rounded to five decimal places? -0.00005 What is 25341000 rounded to the nearest one hundred thousand? 25300000 Round 245000 to the nearest one thousand. 245000 Round 0.00003252 to 5 decimal places. 0.00003 What is -0.00742 rounded to 3 dps? -0.007 What is 96520 rounded to the nearest 10000? 100000 Round -18760000 to the nearest 100000. -18800000 Round -0.003161 to five dps. -0.00316 What is -3.4 rounded to the nearest 10? 0 What is -15.71 rounded to the nearest integer? -16 What is -0.001273 rounded to 4 dps? -0.0013 What is 40300 rounded to the nearest 1000? 40000 What is -0.0000000986 rounded to seven decimal places? -0.0000001 What is 0.08788 rounded to three dps? 0.088 What is -0.0003901 rounded to 4 decimal places? -0.0004 Round 12.72 to the nearest integer. 13 What is -1849 rounded to the nearest 100? -1800 Round 2905 to the nearest 100. 2900 Round 33890 to the nearest 1000. 34000 What is -97731 rounded to the nearest ten thousand? -100000 What is -0.0000067779 rounded to six dps? -0.000007 What is 12.1721 rounded to the nearest integer? 12 Round 6700 to the nearest 100. 6700 What is 60410 rounded to the nearest one thousand? 60000 Round -0.000005999 to six dps. -0.000006 Round -6947 to the nearest one thousand. -7000 What is -0.00001772 rounded to seven decimal places? -0.0000177 Round -0.000276 to 5 dps. -0.00028 Round -583.7 to the nearest 100. -600 Round -79000000 to the nearest 1000000. -79000000 Round -3.596 to zero decimal places. -4 What is -14054 rounded to the nearest one thousand? -14000 What is -0.000005195 rounded to 7 decimal places? -0.0000052 What is -336010 rounded to the nearest ten thousand? -340000 Round -7399400 to the nearest 10000. -7400000 Round 0.016317 to 3 decimal places. 0.016 What is -50386 rounded to the nearest 1000? -50000 Round 0.0000005086 to seven dps. 0.0000005 Round -478.5 to the nearest 10. -480 What is -0.047747 rounded to 2 decimal places? -0.05 Round -0.00011399 to 5 decimal places. -0.00011 Round -0.00006429 to five dps. -0.00006 Round -0.00301 to four decimal places. -0.003 Round -0.28436 to three decimal places. -0.284 Round 7.962 to 1 decimal place. 8 What is -0.0000007641 rounded to 7 decimal places? -0.0000008 Round 5.955 to the nearest ten. 10 Round -727.3 to the nearest 10. -730 What is -0.015645 rounded to 4 dps? -0.0156 Round 0.000128 to 5 dps. 0.00013 What is 67570 rounded to the nearest ten thousand? 70000 What is -0.00014544 rounded to 4 decimal places? -0.0001 What is -0.0000002591 rounded to 6 decimal places? 0 Round -0.0027292 to four dps. -0.0027 Round -132400 to the nearest ten thousand. -130000 What is 746070000 rounded to the nearest one million? 746000000 Round 0.5526 to two decimal places. 0.55 Round -0.00001094 to six decimal places. -0.000011 Round -0.0063263 to three dps. -0.006 What is 0.03257 rounded to three dps? 0.033 What is -3.929 rounded to 0 decimal places? -4 What is 1264000 rounded to the nearest one hundred thousand? 1300000 What is 0.00659 rounded to three dps? 0.007 What is 37.1296 rounded to one decimal place? 37.1 What is -0.73747 rounded to three decimal places? -0.737 What is -2836 rounded to the nearest one thousand? -3000 Round -61677 to the nearest 10000. -60000 Round -0.0000000549 to 7 dps. -0.0000001 Round -590.51 to the nearest 100. -600 Round -34.9 to the nearest integer. -35 What is -0.04952 rounded to three dps? -0.05 What is -0.000002353 rounded to seven dps? -0.0000024 Round -0.000002756 to 7 dps. -0.0000028 Round -0.08213 to three dps. -0.082 Round 0.14232 to two decimal places. 0.14 What is -192550000 rounded to the nearest one million? -193000000 Round -30.03 to one dp. -30 Round 38.86 to the nearest integer. 39 What is -118500 rounded to the nearest ten thousand? -120000 Round -7951800 to the nearest 1000000. -8000000 Round 851 to the nearest 100. 900 What is 2774350 rounded to the nearest one hundred thousand? 2800000 Round -884040 to the nearest ten thousand. -880000 What is 987.1 rounded to the nearest 100? 1000 What is -0.0000052555 rounded to six decimal places? -0.000005 Round -0.0000003648 to seven decimal places. -0.0000004 Round 173515000 to the nearest 1000000. 174000000 What is 0.508 rounded to two decimal places? 0.51 Round -67.4 to the nearest 10. -70 What is 0.000002405 rounded to six dps? 0.000002 Round 1235.16 to the nearest one hundred. 1200 Round -108630 to the nearest 100000. -100000 Round 0.000080808 to five dps. 0.00008 Round -1250000 to the nearest 1000000. -1000000 What is 87170 rounded to the nearest 10000? 90000 What is 0.000045296 rounded to five decimal places? 0.00005 Round 12.0164 to two decimal places. 12.02 What is 0.00000909 rounded to seven decimal places? 0.0000091 What is 250.26 rounded to the nearest integer? 250 Round -15812000 to the nearest 1000000. -16000000 What is 584 rounded to the nearest one hundred? 600 Round -12928800 to the nearest 1000000. -13000000 Round -29524 to the nearest ten thousand. -30000 What is -9470 rounded to the nearest 10000? -10000 Round -0.0000067 to 6 decimal places. -0.000007 What is -11250000 rounded to the nearest one million? -11000000 What is 15247.3 rounded to the nearest 1000? 15000 Round 276.7 to the nearest 10. 280 Round 92230000 to the nearest 1000000. 92000000 Round 1547.4 to the nearest one hundred. 1500 What is 0.006707 ro	{ "pile_set_name": "DM Mathematics" }
4y - 75y + 152y. 3y Collect the terms in 356f3 - 84f*3 + 38f*3 + 431f*3. 741f3 Collect the terms in s2 + 5 + 9 - 12 - 2. s*2 Collect the terms in -26 - 14 - 6m + 40. -6m Collect the terms in 7b*2 - 12b*2 + b + 10b*2. 5b*2 + b Collect the terms in 37d + 65d - 105d. -3d Collect the terms in -17r + 13r + 6r. 2r Collect the terms in -11w + 16 - 16. -11w Collect the terms in -9 + 4 + 5 + 5a. 5a Collect the terms in -14908z + 14908z + 3z*2. 3z*2 Collect the terms in -12x*2 - 9x*2 + 19x*2. -2x*2 Collect the terms in 4p*3 - 3p*3 - 6p*3. -5p*3 Collect the terms in 29 + 12 - 3w + 2w. -w + 41 Collect the terms in 11b*2 - 37b*2 + 16b*2. -10b*2 Collect the terms in -7s + 3s - 4s + 2s. -6s Collect the terms in -168i3 + 165i*3 + 2i - 2i. -3i*3 Collect the terms in -67x - 5 + 74x + 10. 7x + 5 Collect the terms in 2b + 0b + 8b2 + 0b - b. 8b2 + b Collect the terms in 5u - 3u2 + 3u + 9u - 17u. -3u2 Collect the terms in 2307n - 2307n + n3. n3 Collect the terms in -2p*2 + 5 - 5 - 2p*2. -4p*2 Collect the terms in 48v*2 - 319v + 319v. 48v*2 Collect the terms in 73 - 73 + 31c. 31c Collect the terms in 8c*3 - 627748 + 627748. 8c*3 Collect the terms in 9 - 9 - 11s. -11s Collect the terms in -2c + 71c2 - 77c*2 + 2c. -6c2 Collect the terms in -v2 - 14v + 14v. -v2 Collect the terms in -10v*3 + 8v*3 + 22v*3. 20v*3 Collect the terms in -13 - b + 13. -b Collect the terms in 1 + 3t - 5 + 4. 3t Collect the terms in 2n*2 + 6n + 2n + 2n. 2n2 + 10n Collect the terms in 8s3 - 8s*3 - 3s*3. -3s*3 Collect the terms in 19t*2 - 11 + 11. 19t*2 Collect the terms in 24n - 44n + 21n. n Collect the terms in -2y2 - 4y*2 - 4y*2 + 5y*2. -5y*2 Collect the terms in -19 + 7m - 13 + 28. 7m - 4 Collect the terms in 41d*3 - 50d*3 + 36d*3. 27d*3 Collect the terms in l - 285l*3 - 74l*3 - l. -359l*3 Collect the terms in -8c*2 + 4c*2 - 2c*2 + 11c*2. 5c*2 Collect the terms in 12y*2 - 1085 - 10y*2 + 1085. 2y*2 Collect the terms in 161h*3 + 4h*2 - 4h*2. 161h*3 Collect the terms in -2x*3 + 424230 - 424230. -2x*3 Collect the terms in -300w + 3w2 + w2 + 300w - 3w2. w2 Collect the terms in -9g*2 + 26g*2 - 4g*2. 13g*2 Collect the terms in 10c*3 - 8c*3 - 5c*3 - 3c*3. -6c*3 Collect the terms in -2l - 3976 + 4l + 3976. 2l Collect the terms in 19k + 12k - 42k + 16k. 5k Collect the terms in 112f - 29f - 15f - 30f - 19f. 19f Collect the terms in 1593v + 1601v - 4796v + 1600v. -2v Collect the terms in 42x2 - 91x*2 + 54x*2. 5x*2 Collect the terms in 72w + 73w - 141w. 4w Collect the terms in 3336 - 6669 + 3333 - 4v + 3v. -v Collect the terms in 4u - 5u - 7u - 11u. -19u Collect the terms in 7v + 2v - 4v + 0v. 5v Collect the terms in -48o*3 + 0o*3 + 3o*2 - 11o*3. -59o*3 + 3o*2 Collect the terms in -51q*3 - 137q*3 - 100q*3. -288q*3 Collect the terms in -27x*2 - 25x*2 - 19x*2 + 11x*2. -60x*2 Collect the terms in 1 + 30r - 1. 30r Collect the terms in -3y*3 + 21y*3 - 6 + 6. 18y*3 Collect the terms in -119t - 124t + 238t. -5t Collect the terms in -2m*2 + 8m*2 + 0m*2 - 7m2. -m2 Collect the terms in -5642m2 + 11284m*2 - 5640m*2. 2m2 Collect the terms in -p2 - 3p2 + p2 + 4p2. p2 Collect the terms in 48 - 5b - 48. -5b Collect the terms in 40n3 + 3n*3 + 32n*3 + 18n*3 - 43n*3. 50n*3 Collect the terms in -71 + 2z + 35 + 36 - 3z. -z Collect the terms in q2 + 2q*2 - 4q*2 + 4q*2 - 86q. 3q2 - 86q Collect the terms in 16p2 - 17p - 10p + 27p. 16p2 Collect the terms in -20h*2 - 19h*2 - 29h*2 + 54h*2. -14h*2 Collect the terms in 35y - 12y - 13y - 10y + 8y*2. 8y*2 Collect the terms in 7k + 11 - 12k - 11. -5k Collect the terms in -4w - 4w + 6w. -2w Collect the terms in 14z - 14z + 226z2 - 209z*2. 17z*2 Collect the terms in -9 + 2 - 8p + 8. -8p + 1 Collect the terms in 122305 - 3w*2 - 122305. -3w*2 Collect the terms in -1 + 72p + 1. 72p Collect the terms in 5q*2 + 0q*2 + 4q*2. 9q*2 Collect the terms in 52g*3 - 87g*3 + 50g*3. 15g*3 Collect the terms in -808k*2 + 803k2 - k3 + 0k3. -k3 - 5k2 Collect the terms in z3 + z*3 + 12z*3 - 2z*3. 12z*3 Collect the terms in 2q*2 + 8q*2 + 2q*2 + 12q*2. 24q2 Collect the terms in -n2 - 6 - 3 - 2n2. -3n*2 - 9 Collect the terms in -21247p*3 + 10619p*3 + 10627p3. -p3 Collect the terms in 11t2 + 0t*2 + 6t*2. 17t*2 Collect the terms in -3v + 12344 - 12344. -3v Collect the terms in p - 3p + 9 + 6 + 10. -2p + 25 Collect the terms in 19g + 2g - 17g. 4g Collect the terms in 9q*2 + 1206 - 1206. 9q2 Collect the terms in -c2 + c*2 - c + 17c*2. 17c*2 - c Collect the terms in 6 - 1 - 5 - 1904w. -1904w Collect the terms in 23r*2 - 52r*2 + 27r*2. -2r*2 Collect the terms in -2k - 2k - 21 - 22 + 43. -4k Collect the terms in -2g3 - 4g*3 - 10g*3 + 6g*3. -10g*3 Collect the terms in 88r*2 + 7 - 7. 88r*2 Collect the terms in 74g*2 + 78g*2 - 155g*2. -3g*2 Collect the terms in -3b*3 - 2413 - 3b*2 + 2413. -3b*3 - 3b*2 Collect the terms in -358o - 354o - 358o + 1062o. -8o Collect the terms in -16q + 3q + 9q. -4q Collect the terms in l - 2l - l - 5l. -7l Collect the terms in 5a*3 - 33a*3 - 3a*2 + 3a*2. -28a*3 Collect the terms in 78 - 47 - 31 + 16o*2. 16o2 Collect the terms in -164 + 164 - h. -h Collect the terms in i3 - 5977i2 + 5977i2. i3 Collect the terms in 4o + 3o - 7o + o. o Collect the terms in -62f - 62f + 145f. 21f Collect the terms in -4m*2 - 5m + 3m - m3 + 77m*3. 76m*3 - 4m*2 - 2m Collect the terms in 4004g - 8019g + 4014g. -g Collect the terms in 10a + 8a - 18a - 4a2. -4a*2 Collect the terms in -51d*2 + 26d*2 + 25d*2 + 11d*3. 11d*3 Collect the terms in 5h*3 - 2663 - 4h*3 + 0h3 + 2663. h3 Collect the terms in 50 - 103 + 26 + 2y2 + 27. 2y*2 Collect the terms in -2r*2 + 5464911 - 5464911. -2r*2 Collect the terms in 0x - 4x + 7x. 3x Collect the terms in -42r*3 - 252r + 252r. -42r*3 Collect the terms in -3 - 7o + 2 + 1. -7o Collect the terms in 11 - 7v*2 - 45 + 34. -7v*2 Collect the terms in -681d*2 + 318d*2 + 336d*2. -27d*2 Collect the terms in -5w*2 - 3w*2 + 0w*2 - 10w*2 + 21w*2. 3w*2 Collect the terms in f - 35 - 33 + 68. f Collect the terms in -170 - 9p*3 - 168 + 338. -9p*3 Collect the terms in -21v*3 - 3v*3 + 31v*3 - 6v3. v3 Collect the terms in 3q2 + q2 + 1867q - 1867q + 2q*2. 6q*2 Collect the terms in 5y*2 + 0 - 3y*2 + 2. 2y*2 + 2 Collect the terms in -t - 617t*2 + 0t + 620t2 + t. 3t*2 Collect the terms in -225a*2 + 15 - 15. -225a*2 Collect the terms in 3q*3 - 8q*3 - 3q*3 + 0q*3. -8q*3 Collect the terms in -216g + 4g2 + 216g. 4g2 Collect the terms in -3n*3 + 38613 - 38613 + 6n*3. 3n*3 Collect the terms in -4n*2 + 4n*2 + 2n*3 + 0n*2. 2n*3 Collect the terms in -4q - q - 14q - 28q. -47q Collect the terms in -2t*2 + 31t*2 - 3t*2. 26t*2 Collect the terms in -12m - 177 - 174 - 175 + 526. -12m Collect the terms in -77c + 10c - 3c. -70c Collect the terms in 4k - 1995 + 1995 - k. 3k Collect the terms in 3l*3 - 349 + 349. 3l*3 Collect the terms in 1 + 5h*2 - 1. 5h*2 Collect the terms in 26l - 37l + 0 + 0. -11l Collect the terms in -10d + 10d + 33d3. 33d*3 Collect the terms in 15a*2 + 17a*2 - 33a2. -a2 Collect the terms in -1297q - 1295q + 2594q. 2q Collect the terms in v + 54 - 57 + 3. v Collect the terms in 22i3 - 4 - 25i*3 + 4. -3i*3 Collect the terms in -61 - 22 - 6s*2 + 83. -6s*2 Collect the terms in -272p*3 - 281p*3 + 550p*3. -3p*3 Collect the terms in 84f*3 - 8f + 68f3 + 8f. 152f3 Collect the terms in v - 46v*2 + 25v*2 + 20v2 - v. -v2 Collect the terms in -13x3 + 110x*3 + 167x*3. 264x*3 Collect the terms in -213u*3 - 2u	{ "pile_set_name": "DM Mathematics" }
2q((q/((((q*9q)/q)/q)/q))/q)/qq((q(3/7)/q)/q)(1/28) assuming q is positive. q*(-795/196) Simplify ttt(-2/41)t*(-9)/tt*(-9/2)tt/(t6/t) assuming t is positive. t(-1275/82) Simplify (qq(((q3/qq)/q)/q)/qqq)*36(q/(q/(q*(-1/3)q))q)(2/199) assuming q is positive. q(85978/597) Simplify (y(-6/11)/(((yyy(-7)y)/y)/y))/(y(-11)/y(1/9)) assuming y is positive. y*(1640/99) Simplify (aaaa*(1/2)/aa)*14aa/a(-2/11)aa(1/23) assuming a is positive. a(13213/253) Simplify (tt(-2/29))/(t/t(-2/13)t)t/t*(-1)(t*(2/5)t)/t assuming t is positive. t(2219/1885) Simplify t(-5/2)ttt/t9tt(-14)(ttt(-1/2))/t assuming t is positive. t(-21) Simplify ((c*(8/7)/c)/(cc/c33))(3/8) assuming c is positive. c(327/28) Simplify (((j/(j/(j/(j/j1j))))/j)(-8/7)j*(3/2)j5)(-47) assuming j is positive. j(-5029/14) Simplify (c(-1/30)/c)*(-33)/(ccc(12/7))(-10/9) assuming c is positive. c(24083/630) Simplify o(-26/5)/o(-14/3)o*(6/5)o(1/21)/o assuming o is positive. o(-2/7) Simplify (x(-10))(-30)(x/(xx*(-4)x))/(x*(1/4)x) assuming x is positive. x(1207/4) Simplify (x(2/11)(x/(x/x(8/3)))/x)/(((x/((x/(x/x(2/7)))/x))/x)/x)(-29/5) assuming x is positive. x(221/1155) Simplify s(-9/2)/(s(-1/3)s)(s(-3)s)(-3/10) assuming s is positive. s(-137/30) Simplify (q(1/7)/q)(-18)/(((q*(-34)/q)/q)/qq*(-4/7)qq) assuming q is positive. q51 Simplify m10/mm*12m/m*(6/11)m(1/13) assuming m is positive. m(3079/143) Simplify (((p(p(1/31)p)/p)/p)/p11)/((p/(p/(p(3/7)/p)))/(pp13)) assuming p is positive. p(782/217) Simplify (y(3/11)y)/(y/y*(9/7)yy)y19/y(4/5) assuming y is positive. y*(6837/385) Simplify ((yy/(y/(y/(y*4y)yyyy)))6)31 assuming y is positive. y*186 Simplify (vv*(-1/4)v)25/(v(-6)/(v/(vv/(v((vv(2/29))/vv)/v)))) assuming v is positive. v(5779/116) Simplify q(5/7)/(q/q*(-6))q(-11/2)/(q(-14)/q) assuming q is positive. q*(45/14) Simplify (vv/v(1/2))5/(vv/v2)(-2/9) assuming v is positive. v(15/2) Simplify (l/((l/(l/l(-20)))/l))/((l/((l/l(-1/7))/l))/l)l*(-1/9)/(l/(ll*(2/21)l)) assuming l is positive. l*(1457/63) Simplify (lll(3/40)ll(l*38l)/l)11 assuming l is positive. l(18513/40) Simplify ((k(-3)/k5)/((k/k*(2/11)k)/kkk/(k(k/k(-2/11))/k)))(-3/8) assuming k is positive. k(159/44) Simplify (((ff/(((f(1/7)/f)/f)/f))/f8)/(f(1/3)/f6))(-1/25) assuming f is positive. f(-53/525) Simplify (((rr(rr/(rr*(-10)r)rr)/r)/r)/r*(-1/8)r*(1/13)r(2/7)/r)(-1/41) assuming r is positive. r*(-8363/29848) Simplify ((ii(-5/9)/i)/(i15/i))/(i/(i/(ii/(i(-7)i)))ii/(i/i(-1))) assuming i is positive. i(-203/9) Simplify (((h(-2/5)/h)/h(4/5))/((h(-4)/h)/(h/h(-2/23))))(-2/15) assuming h is positive. h(-298/575) Simplify m27/m27(m/m(-4))/(m/((m(-3/11)/mmm)/mm)) assuming m is positive. m(52/11) Simplify (((d1/d)(10/3))(-2))*(-1/8) assuming d is positive. 1 Simplify ((zz/(((zz/(z(-1/4)/z))/z)/z))(-4/13))(2/19) assuming z is positive. z(-6/247) Simplify (((pp*(-2/23)p)/((p/((p/((p/p*(1/11))/p))/pp))/p))(-5/6))(-1/2) assuming p is positive. p*(950/759) Simplify kk*(2/27)k*(-2)(k(-5))(-3/11) assuming k is positive. k(130/297) Simplify v(4/19)v/(v(-12/13)/v)(vv/(vv/v*(4/23)))/v(v/v(-15))/v assuming v is positive. v(98324/5681) Simplify (i(-4))43/(i/(i/i*(9/4)ii)(i4/i)/i) assuming i is positive. i(-697/4) Simplify (d/d(1/5))(-8/17)(d/(d/(d(2/11)d)))(5/2) assuming d is positive. d(4821/1870) Simplify (v*5/(v/(vv(1/10))))/(v(-13)vvv(1/9)) assuming v is positive. v(1439/90) Simplify ((ff(12/7))(-2/25))(-1/18) assuming f is positive. f(19/1575) Simplify ((v/((v/(vvv*(-14/3)v)v)/vv))/v(3/13))/(v(-2/7)v(-3/10)v) assuming v is positive. v(-9041/2730) Simplify (s(10/13)/(s(ss/s*13)/ss))/(s(11/2)/(s/(s(-1/49)s))) assuming s is positive. s(6739/1274) Simplify (s1s)/s*(5/4)s*(-8)s(s/(ss*11/ss))/s assuming s is positive. s*(-73/4) Simplify (yy(y/y(1/35))/y(y/y(-12))/y)(-38) assuming y is positive. y(-18582/35) Simplify (m(4/3)mm)/((m/((m/(mm(-11)))/mm))/m)m(-8/7)/(m/(m/(m8/m))) assuming m is positive. m(130/21) Simplify c14c/((c/(cc(-17)))/c)(cc15)/(cc/(c(-8)/c)) assuming c is positive. c4 Simplify ((((hh0h)/h)/h5)/(h0)(-1/8))(12/7) assuming h is positive. h*(-48/7) Simplify ((zz*(8/11))/(zz(-27)))/(z(1/4))(-5/13) assuming z is positive. z(15915/572) Simplify (iii*(5/3)/iii(-1/2)/ii)/((i*(1/3)i)/(ii(-3/4))) assuming i is positive. i(25/12) Simplify (d12d)/d*18((d*(-3/7)d)/d)/(d/(d*(3/5)d)) assuming d is positive. d*(-169/35) Simplify m(m*29/mm)/m(m/(m/((mm*29)/m)))/m(m(m(-1/43)/m)/m)/((m1m)/m) assuming m is positive. m(2364/43) Simplify ((f(1/2))*17((f*(2/3)f)/f)(2/9))(-19) assuming f is positive. f(-8873/54) Simplify (z4)*(-14/3)(z(-1/3))17 assuming z is positive. z(-73/3) Simplify ((c(-1/5)c/(cc/((cc4)/c)))(-10/11))(-1/28) assuming c is positive. c(1/11) Simplify ((p((p/p*(1/34))/p)/p)/(ppp(3/13)))18 assuming p is positive. p(-8991/221) Simplify ((r/(rr(-22)))/(r/r17))/(rr/r(-1/4))(-2/53) assuming r is positive. r(4037/106) Simplify (w/w(-2/77)ww/(w/((ww(-13))/w)))(-10/17) assuming w is positive. w(8450/1309) Simplify w(-3/17)/((w/(w*(-3/16)/w))/w)((www/(w(w18/w)/w)ww)/w)/(w/(w(6/11)w)) assuming w is positive. w(-41345/2992) Simplify y14(y/(yy*33/y))/yy*17yy12y assuming y is positive. y12 Simplify (m(-6)/(m*(-6/7)m)(m(-8)/m)/(mmm4m))(2/21) assuming m is positive. m(-310/147) Simplify (((g*23g)/g)/gg/g(-1/18))(-19) assuming g is positive. g(-7885/18) Simplify ((c(2/11)/cc)*(-1/46)(c(-2/11))(-2))(-1/4) assuming c is positive. c(-91/1012) Simplify ((q/(q/q*0))/qq)/q*(-9)(q/(q/(q*(-5)q)))(-8/7) assuming q is positive. q(95/7) Simplify (x(-19/2)/x(-14))(-15) assuming x is positive. x(-135/2) Simplify (y/(yyy*(-4/11))y*26)/(yy/(yyy/(yyy/(y/y*(-7)y)))y/y(2/9)) assuming y is positive. y(3127/99) Simplify (f(2/5)/ff)(7/3)/(f(-15)/(fffffff(-6))) assuming f is positive. f(239/15) Simplify ((s*(2/9)/(sss1))/(s/(ss*(2/5))s(-2/3)))(1/14) assuming s is positive. s(-11/90) Simplify (k4/(kk15))/((kk*(-1/19)k)/k)(-6) assuming k is positive. k(-120/19) Simplify ((d(-2))(-10/9)d/d(-3)(ddd/(d*(-5/2)/dd)dd)/d)(2/25) assuming d is positive. d(229/225) Simplify ((u(u/(u/(uu*3)))/uu(-3/2)/u)(12/7))(-19) assuming u is positive. u(-342/7) Simplify (p(2/9))8p(-3/14)p(-1/2) assuming p is positive. p(67/63) Simplify (z/z5)11zz*(-4)z*(2/7)z assuming z is positive. z(-320/7) Simplify (u/u(-3/7)u7)/(u2uu12) assuming u is positive. u(-46/7) Simplify (w/((w(-13)w)/ww))/(w(www*(-21))/w)w*24/ww/(w((ww*(2/23)wwww)/w)/ww) assuming w is positive. w(1171/23) Simplify p(-2/13)/p*24p(-1/23)/p(-9) assuming p is positive. p(-4544/299) Simplify (w5/(w/w(2/17)))31 assuming w is positive. w(2170/17) Simplify (a(-2/23)a(-8/3))(8/5) assuming a is positive. a(-304/69) Simplify ((c(-4/9))(-5/8))15 assuming c is positive. c(25/6) Simplify ((oo/o(1/27))/o)/(o/o(4/11))(o((o/(o*0/o))/o)/o)/(o/(oo*(-33)o)) assuming o is positive. o*(-9110/297) Simplify (oo/o(-11))(6/23)(o/((o(-4)/oo)/o))/oo(1/43) assuming o is positive. o(8322/989) Simplify (((dd(-5/3))/d)(2/11))50 assuming d is positive. d(-500/33) Simplify l(7/8)/l(-8)l11ll(-18) assuming l is positive. l(23/8) Simplify ((n(nn(1/5))/n)(-23)n*(-1/13)n(-8))23 assuming n is positive. n(-53337/65) Simplify x26/x*(-22)x5/(x(-1/3)/x) assuming x is positive. x*(163/3) Simplify (dd/(d(d(-10)/d)/d))/((d(3/5)d)/d)((d/((d/(d/(dd*(-5)))dd)/d))/d)/d*13 assumi	{ "pile_set_name": "DM Mathematics" }
d(-1)? 2 Let q(o) = 673o + 59231. What is q(-88)? 7 Let u(o) = -4o*3 - 2o*2 - 4o + 11. What is u(-5)? 481 Let y(n) = 17n2 + n + 9. What is y(3)? 165 Let o(h) = h3 - 7h*2 + 104h - 569. Determine o(6). 19 Let p(f) = 212f + 6576. What is p(-31)? 4 Let k(b) = -b3 - 178b*2 - 156b + 3710. Calculate k(-177). -7 Let a(u) = u*3 + 22u2 + u + 21. What is a(-22)? -1 Let z(p) = -p3 + 20p2 - 14p + 57. Give z(20). -223 Let i(o) = -o*2 - o + 155. Calculate i(-12). 23 Let r(a) = 625a - 4982. Calculate r(8). 18 Let p(j) = 143j - 1740. Calculate p(12). -24 Let t(c) = -c2 - 44c + 330. What is t(7)? -27 Let m(y) = -y*2 + 10y - 71. What is m(17)? -190 Let z(k) = 4k2 - 98k - 27. Calculate z(23). -165 Let r(n) = n*3 + 33n*2 - 73n - 75. What is r(-35)? 30 Let k(z) = -11z + 454. Determine k(35). 69 Let d(w) = w2 + 50w - 1781. Determine d(-74). -5 Let j(w) = w*3 + 9w*2 - 18w. What is j(-7)? 224 Let a(m) = -m*3 + 8m*2 + 7m - 19. Determine a(10). -149 Let g(v) = 2444v - 34. Determine g(0). -34 Let z(h) = -h2 + 41h + 1178. Determine z(61). -42 Let r(a) = -468a - 3280. Determine r(-7). -4 Let s(y) = 2y*2 - 1242y + 6174. Give s(5). 14 Let k(v) = -2v2 + 7v + 63. Calculate k(-9). -162 Let f(k) = -3k - 75. Calculate f(-5). -60 Let y(a) = a2 - 1904a + 105283. What is y(57)? 4 Let l(z) = 3z3 - z2 - 4z + 3. What is l(4)? 163 Let z(a) = 11a2 + 524a + 821. Calculate z(-46). -7 Let w(c) = c*3 + 6c*2 - 10c + 8. Calculate w(-6). 68 Let u(t) = -140t3 + 3t*2 - 2t + 1. Calculate u(1). -138 Let w(f) = -f*2 + 926f + 13146. What is w(-14)? -14 Let r(p) = -p*3 - 56p*2 - 103p + 178. Calculate r(-54). -92 Let n(m) = -19m + 2885. Calculate n(151). 16 Let q(a) = a2 - 119a + 2728. Determine q(31). 0 Let x(b) = 61b3 + 5b*2 + 7b + 2. Give x(-1). -61 Let p(m) = 6737m + 20232. Give p(-3). 21 Let o(b) = -b2 - 6b + 181. Give o(-14). 69 Let q(i) = 247i2 + 2703i - 104. Give q(-11). 50 Let z(v) = 38v - 221. Calculate z(6). 7 Let y(u) = 70u + 60. Give y(-3). -150 Let q(j) = 41j + 3407. Give q(-83). 4 Let m(k) = k3 - 23k*2 - 38k + 368. Determine m(24). 32 Let g(h) = -h*2 - 9388h - 56283. Give g(-6). 9 Let s(f) = -f*2 - 13f + 61. What is s(4)? -7 Let r(x) = -4x2 + 130x - 32. What is r(32)? 32 Let b(v) = v*2 + 27v + 185. Determine b(-10). 15 Let t(o) = -10828o - 184066. Give t(-17). 10 Let f(z) = -z2 - 63z - 398. Calculate f(-7). -6 Let q(c) = 84c - 1738. Calculate q(20). -58 Let m(x) = 56x + 5465. Give m(-100). -135 Let o(r) = 270r2 + 2435r + 50. Give o(-9). 5 Let v(f) = -159f - 1586. Give v(-10). 4 Let u(s) = 84s + 1688. Give u(-20). 8 Let w(i) = 2i2 + 128i - 266. Calculate w(-66). -2 Let l(k) = 113k - 5407. What is l(48)? 17 Let n(y) = 25y*3 + 4y*2 - 3. Give n(1). 26 Let b(k) = -115k + 1227. Determine b(11). -38 Let w(s) = 140s2 - 597s + 150. Give w(4). 2 Let b(t) = 3t3 - 3t*2 + 4t - 2. Give b(1). 2 Let p(x) = -122x - 1233. Calculate p(-11). 109 Let m(x) = x2 + 99x - 1323. Give m(-111). 9 Let x(z) = 105z2 + 16z - 4. Determine x(-2). 384 Let x(t) = 3t3 - 6t*2 - 39t + 25. Determine x(-3). 7 Let r(x) = -x*2 + 38x + 1025. Determine r(-18). 17 Let a(m) = m*2 - 29m + 33. Determine a(25). -67 Let a(x) = 16x - 244. What is a(18)? 44 Let f(i) = 4i*2 + 25i - 79. What is f(3)? 32 Let w(g) = 7g2 + 102g + 392. Calculate w(-7). 21 Let r(b) = -123b - 45. Determine r(-3). 324 Let c(h) = 7h*2 - 498h + 245. Determine c(71). 174 Let o(l) = -33l - 178. Give o(-3). -79 Let i(p) = p2 - 278p + 5509. Determine i(22). -123 Let z(h) = 157h + 665. What is z(-4)? 37 Let i(t) = 15t - 156. Give i(6). -66 Let s(k) = -27k - 987. Determine s(-36). -15 Let y(w) = 28w - 602. Give y(-8). -826 Let l(u) = 3u2 + 125u + 761. Give l(-7). 33 Let k(s) = 23s3 - 22s*2 - 32s - 9. Determine k(-1). -22 Let q(z) = -29z - 2205. What is q(-77)? 28 Let h(a) = 37a - 845. Determine h(23). 6 Let i(x) = -4x + 4. Calculate i(10). -36 Let i(k) = 114k*2 - 1601k + 67. Determine i(14). -3 Let q(u) = -218u2 + 2u. Determine q(-1). -220 Let m(c) = 366c + 7681. What is m(-21)? -5 Let o(w) = -3w*3 - 4w*2 + 43w - 16. Determine o(5). -276 Let w(k) = -4k3 - 18k*2 + 22k + 61. Calculate w(-6). 145 Let r(x) = 212x - 1106. Give r(6). 166 Let o(a) = a2 + 512a + 61571. Calculate o(-319). 4 Let a(z) = -6z2 + 75z - 480. Determine a(7). -249 Let b(h) = -2h3 - 69h*2 - 243h - 701. Determine b(-31). 105 Let i(b) = 983b2 + 6b + 7. What is i(-1)? 984 Let y(s) = s*2 - 70s + 793. Give y(56). 9 Let i(y) = -y*2 - 57y - 484. Determine i(-11). 22 Let n(i) = 34i - 78. Determine n(4). 58 Let v(i) = 132i + 4590. Determine v(-34). 102 Let t(s) = s*3 - 24s*2 + 25s - 15. Determine t(23). 31 Let x(z) = -2z3 + 19z*2 + 26z - 372. Give x(10). -212 Let b(z) = -2z3 - 106z*2 + 456z + 82. Calculate b(-57). 82 Let w(b) = -69b2 - 15b - 11. Calculate w(-1). -65 Let b(n) = 6n2 + 10n - 203. Give b(-7). 21 Let c(a) = -433a + 873. Calculate c(2). 7 Let r(i) = -7i - 309. Give r(-46). 13 Let k(x) = -x*2 - 22x + 19. Determine k(-12). 139 Let c(k) = 3k3 + 16k*2 + 16k + 31. Calculate c(-2). 39 Let l(t) = t*3 + 15t*2 + 21t + 586. Give l(-16). -6 Let p(w) = -4w2 + 76w + 39. Give p(15). 279 Let f(k) = 5k2 + 158k - 57. Calculate f(-32). 7 Let l(g) = -7g2 + 4g - 7. What is l(0)? -7 Let h(l) = l*2 - 59l - 1212. What is h(-14)? -190 Let n(g) = -g*2 - 79g - 473. Give n(-6). -35 Let z(w) = 343w + 2387. Give z(-7). -14 Let f(d) = d3 - 176d*2 + 30d - 5382. Give f(176). -102 Let o(t) = 28t3 + 2t*2 + t - 1. Give o(1). 30 Let f(h) = 215h*3 + 15h*2 + 16h + 1. Give f(-1). -215 Let s(r) = -97r2 - 80r + 76. Give s(1). -101 Let r(y) = 275y + 120. Give r(-1). -155 Let v(o) = o3 + 5o*2 - 219o + 197. Give v(12). 17 Let o(i) = -i*3 + 9i*2 - 6i + 19. Calculate o(4). 75 Let m(s) = 7s2 - 1101s - 783. What is m(158)? 7 Let w(m) = -185m - 43469. Calculate w(-235). 6 Let y(i) = -484i + 82770. Determine y(171). 6 Let p(a) = 43a2 + 2496a + 77. What is p(-58)? -39 Let k(w) = 2w3 - 11w*2 - 73w + 21. Determine k(9). -69 Let j(a) = -134a + 945. Calculate j(7). 7 Let u(c) = 2c*2 - 18c + 171. Determine u(9). 171 Let g(n) = -n*3 + 2n*2 + 46n - 30. Determine g(-5). -85 Let s(t) = -70t + 1810. Calculate s(47). -1480 Let l(w) = 3547w + 7100. Calculate l(-2). 6 Let v(p) = 8p - 882. Give v(21). -714 Let p(f) = -7f*2 - 75f + 17. Give p(-11). -5 Let l(u) = -2u - 56. Give l(26). -108 Let v(m) = -m2 + 8m + 2. Calculate v(-9). -151 Let z(t) = -5t2 - 42t + 146. Give z(-11). 3 Let f(z) = 395z + 1196. What is f(-3)? 11 Let i(k) = -9k*2 - 98k - 270. Give i(-9). -117 Let a(s) = 14s3 + 2s*2 - 7s + 1. Calculate a(2). 107 Let d(o) = -55o + 685. What is d(12)? 25 Let l(i) = -i3 - 74i*2 - 22i - 1586. What is l(-74)? 42 Let z(b) = 336b - 18110. Give z(54). 34 Let r(i) = 15967i + 223550. What is r(-14)? 12 Let y(h) = h*3 - 119h*2 + 461h - 88. Calculate y(115). 27 Let t(q) = -q*3 - 47q*2 - 492q + 136. Calculate t(-31). 12 Let z(o) = 4466o + 35714. Determine z(-8). -14 Let l(y) = 50y*2 + 107y + 8. Determine l(-2). -6 Let h(k) = -1168k - 3495. Calculate h(-3). 9 Let t(p) = -p3 + 20p*2 - 17p + 23. What is t(20)? -317 Let v(g) = 20g2 - 34g + 102. Determine v(7). 844 Let n(y) = -y*3 + 42y*2 + 3y - 29. Give n(0). -29 Let h(r) = -6r + 69. Give h(100). -531 Let g(c) = c3 + c2 + 23c - 16. Give g(0). -16 Let m(f) = f*3 - 6f*2 + f + 49. Give m(8). 185 Let z(s) = -12s - 1008. Give z(-83). -12 Let y(c) = c*2 + 19c + 9. What is y(1)? 29 Let v(w) = 351w - 7377. Calculate v(21). -6 Let c(o) = -16o - 576. Determine c(-35). -16 Let i(o) = 846o + 11838. What is i(-14)? -6 Let l(w) = 3w*2 - 24w - 47. Calculate l(8). -47 Let h(p) = -205p + 212. Give h(1). 7 Let d(y) = 2y*3 + 3y*2 - 121y + 239. Give d(2). 25 Let b(p) = p*3 + 8p*2 + 12p + 24. What is b(-5)? 39 Let l(v) = -v*3 - 3v*2 - 26v - 229. Give l(-6). 35 Let y(w) = -w*2 - 110w - 715. Determine y(-103). 6 Let g(q) = -q*3 + 10q*2 + q - 14. What is g(9)? 76 Let w(c) = -4c*3 + 147c**2 +	{ "pile_set_name": "DM Mathematics" }
-2/5? (a) m (b) 1 (c) y c Let x(u) = 4u - 12. Let h be x(3). Which is the nearest to -2? (a) -0.2 (b) 0.17 (c) 2 (d) h a Let h = 46.6 - 47. What is the nearest to -1 in -1/3, 5, h? h Let s = -366 - -365.9. Suppose -12 = 3g - 6. What is the nearest to s in -0.5, 2, g? -0.5 Let o be ((-1)/10)/(3/(-2)). Let j = -1514 + 1512. What is the nearest to -0.1 in j, 0.3, o? o Let p = -6 + 11. Let o be (-1)/2 + 403/558. Let z = -0.3 + -0.7. Which is the closest to z? (a) o (b) -5 (c) p a Let k(h) be the second derivative of h5/20 + h4/6 - 4h3/3 + h2/2 - 7h. Let m be k(-4). What is the closest to m in -0.2, -0.1, 1? 1 Let f = 248 + -249. Which is the nearest to 2/9? (a) 0.06 (b) f (c) 0.4 a Suppose -5x = -3s - 0x + 9, 4s - x = 12. Suppose 0 = -5c + 2c + 768. Let k = c - 1788/7. What is the nearest to -2/9 in k, s, -1? -1 Let t = 6 - -134. Let s = t - 281/2. Suppose 0 = -4c - 3o - 3, -o - 1 = -5c - 0o. What is the nearest to 1 in -1, c, s? c Let u(g) = 2g + 9. Let r be -7 + (-6)/(-4)72/54. Let t be u(r). Let w = 0.2 - 0.1. What is the closest to w in 2, t, -4/7? -4/7 Let a = -18/11 - -32/33. Let s = 86 + -91. Let m be (-2)/(-6) - 3/36. What is the nearest to m in a, -1, s? a Let d = 1 - 2. Let k = 4.1 + 0.9. Let o = 126 - 126. What is the nearest to -0.1 in k, o, d? o Let q = -0.888 - -6.888. Which is the nearest to 2? (a) 3 (b) 4/3 (c) q (d) 2 d Let p be (-18)/(-3)-3(-3)/99. What is the closest to -1 in 3/7, p, 0.1? 0.1 Let d = -258.3 - -258. Which is the nearest to -0.01? (a) 5 (b) d (c) 1/2 b Let p = -6 + 6.4. Let d be 3/(-36) - (-115)/276. What is the closest to d in p, 3/2, -0.4? p Let n = 5.9 + -6.8. What is the closest to -1/3 in n, -4, 3/5? n Let x = 2 - 6.6. Let t = 3.6 + x. Which is the nearest to t? (a) 3/7 (b) 0.4 (c) -2/7 c Let h = -8911 + 8914. Let a = 4 - 9. Let l = -1 + 1.1. What is the closest to l in h, 0, a? 0 Let n be 1/84((-20)/6 + 2). Let p = 41/63 - n. Let y = 1.04 - 0.04. What is the nearest to y in p, -2, -2/7? p Let v(o) = -o - 21. Let w be v(-4). Let k be 174/70 + -2 + w/85. Which is the nearest to k? (a) 2/3 (b) -5 (c) 1/3 c Let g be (-6)/(-4)(-32)/384. Which is the closest to -0.1? (a) g (b) 2/9 (c) 1 a Let k = 111.719 + -1.619. Let z = 110 - k. Which is the closest to 0.1? (a) -2/7 (b) z (c) 3/2 b Let j be (-5080)/64 - 3/((-2)/2). Let l = -76 - j. What is the nearest to 0.1 in -0.05, l, 2/15? 2/15 Let i = -73 + 72.948. Let s = i - 0.098. Which is the nearest to -2? (a) -4 (b) -3 (c) s b Suppose -n + r + 40 = 0, 4r = -4n - r + 196. What is the closest to 0.2 in 2/5, 2/21, n? 2/21 Let w be (-6)/(-14)-1 + 1. Let m = -14 + 13.9. Let k = -5.5 + 6. Which is the closest to m? (a) w (b) k (c) -5 b Let o = 0.005 - 39.005. Let r = -32 - o. Which is the closest to -1? (a) 1 (b) r (c) -4 a Let k = -1 - -0.5. Suppose o - 15 = -2o. Which is the closest to 0.1? (a) o (b) 1/5 (c) k b Let g = -353/6 - 95/6. Let f = g - -75. What is the closest to -0.1 in 7, f, -2/9? -2/9 Suppose 3h = 3w - 6, -7 = -3h - h - w. Let t(o) be the first derivative of o4/4 - 5o*3/3 + 5o - 4. Let j be t(5). What is the nearest to h in 0.1, j, 1? 1 Let g = 401.8 - 402. Which is the nearest to 3/4? (a) 10 (b) 2/3 (c) g b Let y = 756.5 + -757. Suppose 3r + 2o - 13 = -0o, -3o + 18 = 3r. Which is the nearest to -3? (a) y (b) r (c) -0.9 c Let y be (-3)/(-7) - (-30)/28. Let g = -253 + 252. Let p = 3 + -3.1. What is the nearest to 1/6 in p, y, g? p Suppose 4w - 4m = -0 + 8, 3m = 0. Let y be (w/6)/((-5)/(-75)). What is the closest to -2 in y, -2, -5? -2 Let f = -33 - -19. Let j be (-31)/35 + f/(-49). What is the nearest to 1/3 in -1/5, j, -2/3? -1/5 Let b = -46/147 + -1/49. Let m = 111344/21 - 5302. What is the nearest to b in 3, m, -0.1? -0.1 Let x = -67.1 - -67. Let i = -6 - -4.9. Let d = i - -0.8. Which is the nearest to x? (a) 2 (b) -0.5 (c) d c Suppose -3o = d - 2, -5d = o - 5 + 9. Which is the nearest to o? (a) 0.5 (b) -1 (c) -8/9 a Let i = -2.38 + -0.62. Which is the closest to i? (a) 0 (b) 1/4 (c) 1 a Let i = 1.91 + -135.91. Let h = 134 + i. What is the closest to h in 1, -2, 0.5? 0.5 Let y = -0.06 + 2.06. Let x = y - 1.8. Suppose -23p - 547 = -432. Which is the closest to x? (a) p (b) -3 (c) 2/3 c Let r = -0.181 + 0.081. What is the nearest to r in 4, -2/9, 107, 3? -2/9 Let l = 385 - 385.3. What is the closest to l in 0, -1, -5? 0 Let j(k) = -1 + 2 - 57k + 78k. Let i be j(-1). Let y = 21 + i. What is the nearest to 1/6 in -1/7, y, 0.3? 0.3 Let p be (2925/(-490))/(-13) + 2/(-4). Which is the nearest to 0? (a) 0.3 (b) p (c) -2/9 b Let l be ((-2)/6)/(-1 + 7/(-6)). Suppose -2f = -4f - 12. Let q be (2 - 5)(-8)/f. Which is the nearest to 2/5? (a) l (b) q (c) 3 a Let j = -1.1 - -1. Let i = -29 + 30.4. Let m = 1 - i. Which is the closest to -1? (a) j (b) m (c) -5 b Let i = -55.64 - -55. What is the nearest to 0 in i, -2/9, -3, 0.1? 0.1 Let n = -0.79 + 0.09. Let o = n - -1. Suppose -5i = -b - 8, -2b + 1 = 2i - 7. What is the closest to b in -1, o, -4? o Let o(t) = 4t + 56. Let d be o(-13). Let k be 1 + -4 + 6 - 13/d. Which is the closest to 1/3? (a) -3/10 (b) -3 (c) k c Let v = -2.11717 + 0.11717. Let y(d) = -d - 1. Let o be y(-4). Let j be (o/(-5) + 1)/2. Which is the nearest to j? (a) -0.3 (b) v (c) 1/2 c Let s be 1 - (472/(-32) + 3 + 0). Suppose 0j - j - 13 = 0. Let h = s + j. Which is the closest to h? (a) -0.1 (b) -2/9 (c) 0.5 b Let u be (-1)/(-3 - (-1 - 1)). Let i(t) = t2 - 6t - 20. Let z be i(8). Let w be z/(32/(-18)) - (-2 + 4). What is the nearest to 2/3 in u, 0, w? u Suppose 0 = 5p - 3q + 27, 3q = 2p + 24 - 6. Let z = 8.93 - 12.93. What is the closest to -45 in 2/3, z, p? z Let j(y) = -y*2 - 9y - 20. Let q be j(-5). Let o = 8 + -8.2. What is the closest to o in q, -1/7, 0.05? -1/7 Let u = -147/1184 + -1/1184. Let f = -92/11 - -1726/209. Which is the closest to 1? (a) -6 (b) u (c) f c Let l be (28/(-35))/(126/35). Let s = -17 + 17. Which is the nearest to s? (a) -0.3 (b) -2/11 (c) l b Let r be (-6 + 2 - -2)20058/(-156). Let o = r + -257. Which is the nearest to 1? (a) 1/2 (b) 4 (c) o a Let h(l) = -l2 - 10l - 14. Let j be h(-7). Which is the nearest to 3? (a) -5 (b) j (c) -3/5 c Let h be (123/54)/(-1) + 14/(-63). Let p be (40/35)/414. What is the nearest to -0.2 in h, p, 3? h Let g = 33.045 + -0.045. Let j = g - 35. Which is the closest to 1? (a) -4 (b) j (c) 0.4 c Let q be (12/(-16) - -1)4. What is the nearest to -0.2 in 13, q, -4? q Let r(n) = 56n + 672. Let a be r(-12). Let p = 0 - 0.8. What is the closest to -0.1 in -1, a, p? a Let i = 13 + -28. Let l = 11 + i. Let p be (l - -5)2/(-4). What is the nearest to p in 4, -2, -4? -2 Suppose 2m - 3a + 3 = -m, 2m + 3 = 3a. Suppose m = 5v - 24 - 6. Let l be (-2)/v - (-12)/(-18). What is the nearest to l in 1/4, 2, -1/5? -1/5 Let g = -3787/60 - -253/4. Which is the nearest to 0? (a) g (b) 0.5 (c) -5/2 (d) 0.9 a Suppose -2 = 5g - 2x + 9, -3g - 15 = 3x. Let r be (-8)/(-9) + 2/(-3). What is the closest to 7 in r, -1/4, g? r Let f = -4.58 + -0.42. Which is the closest to -1/5? (a) 0.4 (b) f (c) -1/4 (d) 9 c Let l = -53.4 + 57.4. Which is the closest to 0.1? (a) 3 (b) l (c) -5 (d) 0.02 d Let t be ((-9)/12)/((-171)/(-114)). Let a = 0.02 - 0.06. What is the nearest to a in 2/11, t, 5? 2/11 Let l be (-50)/41696/112. Let p = l - -189. What is the nearest to 2 in p, -5, 4? 4 Let l = 1.66 + -1.36. What is the nearest to 0 in -3, -5, l? l Let u = -207 + 206.873. Let w = u + 0.227. What is the nearest to w in -0.2, 4, 1? -0.2 Let y be ((-8)/(-1))/(14/(-7)). Let z be y + 7 + 2 + -7 + 4. Let j = 0.1 - 0. What is the nearest to -1 in j, z, 0? 0 Let r = -1248 - -1256. Which is the closest to 3? (a) -0.3 (b) -1/7 (c) r (d) -4 b Let t = -0.06 + -1.94. Let l = 33/5 + -31/5. Which is the nearest to l? (a) -0.4 (b) t (c) 0.5 c Let z = 45 - 44.9. What is the closest to z in 2, 3, -0.4? -0.4 Let l = -14/9 - -37/18. Let m = 382/45 + -80/9. What is the nearest to l in 3, m, -1? m Let s = 560 + -2798/5. Let v = 0.11 - 0.08. Let x = 0.07 + v. What is the nearest to -2 in s, -2/15, x? -2/15 Let c = -10 + 6. Let d = 74.054 - 0.054. Let s = 72 - d. What	{ "pile_set_name": "DM Mathematics" }
000? 35000000 Round -16.95 to zero decimal places. -17 Round 84010 to the nearest 1000. 84000 What is -51.5 rounded to the nearest integer? -52 What is 7248 rounded to the nearest 100? 7200 Round 0.07072 to 2 decimal places. 0.07 What is -7.2298 rounded to one dp? -7.2 What is -0.338 rounded to 1 dp? -0.3 What is 1107000 rounded to the nearest 10000? 1110000 Round 0.0000005471 to 6 decimal places. 0.000001 Round 91.92 to the nearest one hundred. 100 Round -77300000 to the nearest 1000000. -77000000 Round -0.002729 to three decimal places. -0.003 What is -0.0002272 rounded to four dps? -0.0002 What is 74559000 rounded to the nearest 100000? 74600000 What is 831000 rounded to the nearest one hundred thousand? 800000 What is -18.1726 rounded to 1 decimal place? -18.2 What is -1203900 rounded to the nearest one hundred thousand? -1200000 What is -0.8482 rounded to 1 decimal place? -0.8 What is -7.105 rounded to one dp? -7.1 Round 7.3972 to the nearest integer. 7 What is -1235100 rounded to the nearest 10000? -1240000 What is -57.541 rounded to zero dps? -58 Round -0.0197 to 3 dps. -0.02 What is -3.4225 rounded to 1 dp? -3.4 Round -7.446 to the nearest integer. -7 Round 1818.1 to the nearest one hundred. 1800 Round -291.01 to the nearest one hundred. -300 What is 67.4 rounded to the nearest one hundred? 100 Round 6.96 to 1 decimal place. 7 What is 0.02269 rounded to three dps? 0.023 Round 14467900 to the nearest 100000. 14500000 What is -4409.38 rounded to the nearest 100? -4400 Round 66.673 to zero decimal places. 67 What is 0.000003838 rounded to seven dps? 0.0000038 What is -182600 rounded to the nearest one hundred thousand? -200000 What is -0.0001537 rounded to five decimal places? -0.00015 What is -0.00002 rounded to two dps? 0 Round 0.0004233 to 5 dps. 0.00042 Round 0.0000487 to 4 dps. 0 What is 0.12611 rounded to 2 dps? 0.13 What is -9097 rounded to the nearest one thousand? -9000 What is -0.00002427 rounded to 5 dps? -0.00002 What is 31310 rounded to the nearest 100? 31300 Round -396930 to the nearest 1000. -397000 What is 6680 rounded to the nearest 1000? 7000 What is 0.02423 rounded to 3 decimal places? 0.024 Round -19300000 to the nearest one million. -19000000 What is -554000 rounded to the nearest 100000? -600000 What is 5738 rounded to the nearest 100? 5700 Round -2.4 to one decimal place. -2.4 What is -32140 rounded to the nearest 1000? -32000 Round 0.00237563 to 5 dps. 0.00238 Round 0.04784 to two dps. 0.05 Round -0.06452 to two dps. -0.06 Round 13670000 to the nearest one million. 14000000 What is 302530 rounded to the nearest 10000? 300000 Round -0.000013 to four dps. 0 Round -0.00075 to 4 dps. -0.0008 Round -1359300 to the nearest 100000. -1400000 What is -0.000001678 rounded to seven dps? -0.0000017 What is -0.0034 rounded to 1 dp? 0 What is -0.01299 rounded to three dps? -0.013 Round 0.000035 to five dps. 0.00004 What is 0.000000072 rounded to 7 decimal places? 0.0000001 What is -0.00000839 rounded to 7 decimal places? -0.0000084 Round -154300 to the nearest 10000. -150000 Round 301800 to the nearest 100000. 300000 Round -4353000 to the nearest 1000000. -4000000 Round 0.456 to one decimal place. 0.5 Round -0.719 to 0 dps. -1 What is 3.791 rounded to 1 decimal place? 3.8 Round -4213000 to the nearest one million. -4000000 What is 10.19 rounded to the nearest integer? 10 What is -33803300 rounded to the nearest 1000000? -34000000 Round -0.0000007665 to 7 decimal places. -0.0000008 What is 169.8 rounded to the nearest 10? 170 Round 0.000000589 to seven dps. 0.0000006 Round -0.0235685 to 3 decimal places. -0.024 Round -12.1 to the nearest 10. -10 Round 39.485 to one decimal place. 39.5 Round 187100 to the nearest one thousand. 187000 What is 0.000001558 rounded to seven dps? 0.0000016 Round 1.3765 to 2 decimal places. 1.38 Round 1.29 to 1 dp. 1.3 Round 198400 to the nearest ten thousand. 200000 What is -0.6217 rounded to 2 decimal places? -0.62 What is -0.00042524 rounded to five decimal places? -0.00043 Round 0.000034196 to six decimal places. 0.000034 Round -0.002234 to 3 dps. -0.002 Round -172430 to the nearest 1000. -172000 What is 0.001349 rounded to four decimal places? 0.0013 What is 0.0111275 rounded to three dps? 0.011 Round -0.013421 to three decimal places. -0.013 What is -123.1 rounded to the nearest 10? -120 What is -0.00093111 rounded to 5 decimal places? -0.00093 Round -0.388 to one decimal place. -0.4 Round -61.831 to 1 decimal place. -61.8 What is 0.001806 rounded to 5 decimal places? 0.00181 Round -0.00131302 to 5 decimal places. -0.00131 Round 98.898 to zero dps. 99 What is 53.944 rounded to zero dps? 54 Round -23.93 to the nearest integer. -24 What is -93366 rounded to the nearest 1000? -93000 Round -0.4716 to one decimal place. -0.5 What is -0.2302 rounded to one decimal place? -0.2 Round 142.76 to the nearest 10. 140 Round -51.86 to zero decimal places. -52 Round 0.0000715 to 4 dps. 0.0001 What is -0.020146 rounded to three dps? -0.02 Round 0.0324 to 3 dps. 0.032 Round -280100 to the nearest 10000. -280000 What is -611100 rounded to the nearest ten thousand? -610000 Round -0.005871 to four dps. -0.0059 What is -0.000002112 rounded to 7 decimal places? -0.0000021 What is -9.284 rounded to 1 decimal place? -9.3 Round 0.0000888 to six dps. 0.000089 What is 0.005658 rounded to 3 decimal places? 0.006 Round -2876.8 to the nearest one hundred. -2900 Round 196.1 to the nearest ten. 200 Round -0.0000004211 to seven decimal places. -0.0000004 Round 0.823981 to 1 decimal place. 0.8 What is -4077.3 rounded to the nearest 100? -4100 What is -0.0033 rounded to 1 decimal place? 0 Round 750000 to the nearest one hundred thousand. 800000 Round -1307.5 to the nearest ten. -1310 What is -0.000001319 rounded to 7 decimal places? -0.0000013 Round 1.16732 to 2 dps. 1.17 Round 149000 to the nearest one thousand. 149000 What is 13917 rounded to the nearest one thousand? 14000 Round -103330000 to the nearest 1000000. -103000000 Round -45650000 to the nearest one million. -46000000 Round -63040 to the nearest 10000. -60000 What is 0.00051764 rounded to 4 decimal places? 0.0005 What is 4450 rounded to the nearest 1000? 4000 Round -0.00000017 to 6 decimal places. 0 What is -0.0000169 rounded to six dps? -0.000017 Round 210399 to the nearest one thousand. 210000 What is -28.9 rounded to the nearest ten? -30 Round 2761 to the nearest 100. 2800 Round -0.00055343 to 6 dps. -0.000553 What is -518.5 rounded to the nearest one thousand? -1000 What is -0.00001049 rounded to six dps? -0.00001 Round -0.0000143185 to six decimal places. -0.000014 Round 13115800 to the nearest 100000. 13100000 Round -145000 to the nearest 1000. -145000 Round 0.00508817 to five decimal places. 0.00509 Round -49708 to the nearest 100. -49700 What is 0.001916 rounded to 4 decimal places? 0.0019 What is -2956.3 rounded to the nearest ten? -2960 What is -153900000 rounded to the nearest one million? -154000000 Round -31.418 to the nearest ten. -30 What is -3.671 rounded to the nearest integer? -4 What is -0.00021746 rounded to six dps? -0.000217 Round -3.075 to 1 dp. -3.1 Round 1984000 to the nearest 100000. 2000000 What is -0.000904 rounded to 3 decimal places? -0.001 What is -288430000 rounded to the nearest 1000000? -288000000 Round -107900 to the nearest ten thousand. -110000 Round -0.499 to 2 decimal places. -0.5 Round 0.000028742 to 7 decimal places. 0.0000287 Round 0.08754 to 3 dps. 0.088 What is -0.0000006805 rounded to 7 decimal places? -0.0000007 What is -361 rounded to the nearest 100? -400 Round -7.69 to the nearest 10. -10 What is 0.007208 rounded to four decimal places? 0.0072 Round -53400 to the nearest 10000. -50000 What is -0.000274 rounded to 3 decimal places? 0 Round -546.7 to the nearest 10. -550 Round 213.7 to the nearest 100. 200 What is -30682.6 rounded to the nearest 1000? -31000 What is -1343.1 rounded to the nearest 100? -1300 Round 0.000000224 to 7 dps. 0.0000002 What is -0.057778 rounded to 2 dps? -0.06 What is 11640000 rounded to the nearest 100000? 11600000 What is 4.1702 rounded to zero decimal places? 4 What is -1000000 rounded to the nearest ten thousand? -1000000 What is 0.000011566 rounded to 7 decimal places? 0.0000116 Round 487	{ "pile_set_name": "DM Mathematics" }
? 630 Convert -1010110100111 (base 2) to base 12. -325b 20022122 (base 3) to base 6 33155 -242 (base 12) to base 9 -415 Convert 11253 (base 9) to base 8. 16514 Convert 18681 (base 10) to base 8. 44371 What is -620 (base 16) in base 11? -11a6 What is -15020 (base 7) in base 3? -12122222 -23030 (base 4) to base 6 -3152 -241421 (base 5) to base 2 -10001100011010 32543 (base 6) to base 10 4527 What is 5514 (base 9) in base 13? 1b07 Convert -14424 (base 11) to base 14. -7667 103510 (base 6) to base 7 34050 What is -ccc9 (base 13) in base 10? -28557 Convert 2202 (base 3) to base 7. 134 What is -122857 (base 9) in base 12? -37021 Convert -1012102 (base 3) to base 14. -467 What is -3a903 (base 11) in base 14? -17381 43225 (base 7) to base 9 15664 -204325 (base 6) to base 13 -76b5 55 (base 7) to base 14 2c -12202012 (base 3) to base 8 -10136 What is 38 (base 10) in base 12? 32 -20100 (base 3) to base 13 -102 Convert -111410 (base 5) to base 14. -1644 Convert -110000000000111 (base 2) to base 11. -17519 Convert 111111000101 (base 2) to base 14. 1685 What is 354 (base 14) in base 15? 2e2 Convert -557 (base 10) to base 9. -678 -28536 (base 10) to base 4 -12331320 Convert 3ab (base 16) to base 7. 2511 203400 (base 5) to base 15 1ed5 54c (base 16) to base 13 804 11b5 (base 15) to base 6 25242 -284 (base 9) to base 4 -3232 What is -14323 (base 5) in base 4? -102331 What is 1551 (base 8) in base 9? 1170 What is -2668 (base 11) in base 16? -d86 What is -12121002 (base 3) in base 14? -16b5 Convert -140252 (base 6) to base 15. -3d0e 40b (base 12) to base 15 292 What is 1401 (base 6) in base 3? 111101 Convert -1311042 (base 5) to base 11. -183aa What is -2607 (base 11) in base 9? -4582 Convert -17130 (base 8) to base 14. -2b8c Convert -a4 (base 13) to base 10. -134 Convert 46c5 (base 13) to base 3. 111200000 -20772 (base 8) to base 14 -3254 What is 10101001110 (base 2) in base 11? 1025 38282 (base 9) to base 14 9555 -111303 (base 4) to base 5 -21040 What is 22012211 (base 3) in base 9? 8184 -3fd8 (base 16) to base 4 -3333120 Convert -90c (base 16) to base 8. -4414 Convert -526 (base 12) to base 8. -1356 -562 (base 11) to base 12 -481 Convert -42130 (base 5) to base 2. -101011100110 Convert 11541 (base 7) to base 2. 101111001010 Convert -1333131 (base 4) to base 2. -1111111011101 -205 (base 8) to base 2 -10000101 Convert -a2b4 (base 12) to base 4. -10110220 -9a3 (base 14) to base 15 -872 Convert -21151 (base 11) to base 13. -11026 What is -53550 (base 8) in base 5? -1204001 21370 (base 9) to base 16 374d What is 1412 (base 6) in base 8? 560 What is -11220001 (base 3) in base 10? -3565 -2001111012 (base 3) to base 14 -10a55 What is 474 (base 8) in base 2? 100111100 -217 (base 13) to base 5 -2413 49b (base 15) to base 16 416 What is -350 (base 11) in base 4? -12202 Convert -2020 (base 12) to base 7. -13101 10002200 (base 3) to base 8 4323 Convert -24736 (base 8) to base 6. -121342 What is -1307 (base 8) in base 11? -597 Convert a88 (base 12) to base 10. 1544 Convert -2011000 (base 3) to base 8. -3036 -452551 (base 6) to base 12 -1a157 Convert 3042100 (base 5) to base 15. eaa0 80b (base 12) to base 7 3251 What is 543a (base 13) in base 3? 121001201 -24140 (base 5) to base 15 -7ea -335133 (base 6) to base 10 -28353 Convert 5848 (base 9) to base 2. 1000011110001 Convert -47d (base 16) to base 2. -10001111101 What is 62 (base 11) in base 5? 233 -153 (base 14) to base 6 -1125 What is -538 (base 14) in base 5? -13110 -552 (base 14) to base 3 -1102222 Convert -404404 (base 6) to base 2. -111110101110100 Convert -44425 (base 6) to base 11. -4735 What is -1112540 (base 6) in base 13? -1c869 Convert 30020 (base 7) to base 15. 2212 -203 (base 9) to base 6 -433 -8265 (base 13) to base 11 -12581 What is -80 (base 15) in base 8? -170 Convert 100100100011100 (base 2) to base 12. a9b8 Convert -10274 (base 8) to base 12. -2590 What is -12c (base 16) in base 5? -2200 -52c2 (base 15) to base 9 -26012 Convert -143 (base 9) to base 16. -78 Convert -97db (base 15) to base 9. -48088 3298 (base 12) to base 3 21122222 What is 2010 (base 5) in base 11? 212 1a4 (base 16) to base 5 3140 What is -1081 (base 9) in base 6? -3414 477 (base 15) to base 4 33310 Convert 3303333 (base 4) to base 5. 444430 Convert -100001000001111 (base 2) to base 11. -11784 Convert -20563 (base 7) to base 10. -5092 Convert -158a8 (base 14) to base 12. -271b8 What is -41020 (base 5) in base 13? -1279 What is -68404 (base 9) in base 2? -1011000111010110 What is -11344 (base 5) in base 7? -2322 What is 22101 (base 5) in base 9? 2075 880 (base 14) to base 2 11010010000 4376 (base 11) to base 13 281b Convert 20230 (base 5) to base 14. 69d 3320 (base 5) to base 14 24c What is 214236 (base 7) in base 11? 26202 Convert -9d6 (base 14) to base 7. -5456 What is -13431 (base 5) in base 16? -45c What is -2632 (base 8) in base 6? -10350 1be5 (base 16) to base 2 1101111100101 What is 3956 (base 11) in base 16? 1417 Convert -10000011101 (base 2) to base 16. -41d 8674 (base 11) to base 2 10110010111111 What is -111021021 (base 3) in base 14? -374d What is -12465 (base 8) in base 7? -21554 What is -143303 (base 6) in base 8? -32627 Convert 631 (base 15) to base 7. 4033 -10016 (base 7) to base 3 -10022102 What is 301022 (base 4) in base 6? 22322 What is 11305 (base 14) in base 4? 22030121 -3300 (base 16) to base 15 -3d06 What is 5245 (base 7) in base 4? 130312 -215 (base 8) to base 4 -2031 What is -23 (base 15) in base 7? -45 What is 2520 (base 7) in base 11? 78a 2212010 (base 3) to base 2 100000100010 920 (base 11) to base 2 10001010111 Convert 5a5 (base 13) to base 9. 1308 Convert 4024 (base 7) to base 16. 56e What is -637 (base 10) in base 16? -27d What is -23043 (base 5) in base 2? -11001110000 a6c9 (base 13) to base 4 11221231 Convert -211 (base 3) to base 11. -20 What is -274 (base 8) in base 9? -228 1307 (base 14) to base 6 23243 Convert -12663 (base 7) to base 3. -11200220 Convert 325 (base 9) to base 12. 1a2 Convert -43 (base 10) to base 2. -101011 Convert -1362 (base 9) to base 13. -611 -21000 (base 5) to base 7 -4003 What is 30305 (base 6) in base 13? 1a8a What is -4153 (base 6) in base 16? -3a5 What is 9345 (base 10) in base 2? 10010010000001 Convert -2b6d (base 14) to base 7. -31366 1279 (base 11) to base 3 2021110 What is -7642 (base 11) in base 5? -310324 -1d5 (base 15) to base 14 -225 What is -1252 (base 9) in base 4? -32222 What is -f8c (base 16) in base 3? -12110102 4456 (base 7) to base 14 82d -13f (base 16) to base 5 -2234 -a61 (base 11) to base 3 -1202022 -33333 (base 6) to base 3 -20101210 806 (base 12) to base 6 5210 Convert 1743 (base 11) to base 6. 14145 -27 (base 15) to base 10 -37 -11566 (base 7) to base 5 -44122 What is -1472 (base 15) in base 16? -111e What is 12023 (base 5) in base 7? 2406 -603 (base 14) to base 15 -539 -13210221 (base 4) to base 12 -15b49 Convert 27971 (base 10) to base 7. 144356 -109c (base 13) to base 11 -1825 What is -1240211 (base 5) in base 10? -24431 What is -4341 (base 7) in base 12? -a90 Convert 7ca (base 14) to base 7. 4343 What is -1568 (base 9) in base 8? -2254 What is -102403 (base 6) in base 2? -10000010100011 Convert 1468 (base 12) to base 2. 100101010000 What is 1134201 (base 5) in base 2? 101001010111000 -2561 (base 12) to base 5 -113444 What is 1920 (base 15) in base 14? 1d9c What is -1eac (base 16) in base 12? -4664 -3140 (base 5) to base 12 -2b0 -3629 (base 12) to base 11 -4629 What is -467 (base 8) in base 13? -1ac What is 2004 (base 9) in base 4? 112312 -859 (base 12) to base 5 -14341 -446 (base 10) to base 9 -545 Convert 235 (base 14) to base 9. 537 What is 11011110001 (base 2) in base 13? a69 What is 232 (base 5) in base 9? 74 What is 4601 (base 8) in base 15? ac3 Convert 6098 (base 13) to base 2. 11001111111011 Convert 1022 (base 8) to base 16. 212 Convert -2241 (base 5) to base 8. -501 -377c (base 16) to base 6 -145432 What is -2740b (base 12) in base 15? -110a5 4030 (base 7) to base 6 10241 What is 563 (base 14) in base 9? 1415 -1010101101 (base 2) to base 6 -3101 Convert 32023 (base 4) to base 9. 1217 153 (base 13) to base 12 179 Convert -1087 (base 12) to base 9. -2454 What is 2274 (base 10) in base 3? 10010020 What is 23420 (base 5) in base 11? 1338 What i	{ "pile_set_name": "DM Mathematics" }
iz when four letters picked without replacement from tttitiiztziitiit? 7/520 Three letters picked without replacement from qqiiviqkviilikivkvi. What is prob of sequence klv? 2/969 Calculate prob of sequence dbb when three letters picked without replacement from {b: 11, d: 2}. 5/39 What is prob of sequence qs when two letters picked without replacement from rccrsqssre? 1/30 Two letters picked without replacement from uuuuuuuuuuueuuuuuu. What is prob of sequence uu? 8/9 Calculate prob of sequence pvp when three letters picked without replacement from {r: 3, z: 1, c: 1, p: 6, n: 3, v: 1}. 1/91 Four letters picked without replacement from oooooxxxxxox. What is prob of sequence xoxx? 2/33 What is prob of sequence bi when two letters picked without replacement from {i: 2, b: 1, a: 1, f: 2, m: 1, x: 1}? 1/28 What is prob of sequence nm when two letters picked without replacement from nnznnmqzznzqqznn? 7/240 Three letters picked without replacement from nnneennnnnn. Give prob of sequence een. 1/55 Calculate prob of sequence mm when two letters picked without replacement from {m: 5, p: 2}. 10/21 Calculate prob of sequence een when three letters picked without replacement from {e: 2, n: 1}. 1/3 Calculate prob of sequence yvyv when four letters picked without replacement from uvvyvyyuv. 1/42 Three letters picked without replacement from {r: 3, d: 5}. What is prob of sequence rdr? 5/56 Calculate prob of sequence plpl when four letters picked without replacement from plpnlllpllllp. 28/715 Two letters picked without replacement from ttlltttltl. Give prob of sequence lt. 4/15 Three letters picked without replacement from srpli. Give prob of sequence rpl. 1/60 What is prob of sequence wcc when three letters picked without replacement from cllzqblcczw? 1/165 Three letters picked without replacement from ywggwwyyyyyy. Give prob of sequence ygg. 7/660 Two letters picked without replacement from {p: 15, a: 5}. What is prob of sequence ap? 15/76 Calculate prob of sequence cgva when four letters picked without replacement from tacvatccvcccccagcvc. 5/5168 What is prob of sequence dddb when four letters picked without replacement from dbdbddd? 1/7 What is prob of sequence aooo when four letters picked without replacement from oaorraoa? 3/280 What is prob of sequence jj when two letters picked without replacement from bbjsjjjr? 3/14 What is prob of sequence cnhy when four letters picked without replacement from {h: 5, x: 2, c: 2, y: 1, n: 7, e: 3}? 7/11628 Two letters picked without replacement from lllllbllllllllllllbl. Give prob of sequence ll. 153/190 Calculate prob of sequence iaa when three letters picked without replacement from ijiajiaa. 3/56 Four letters picked without replacement from zlvmm. What is prob of sequence llvz? 0 Two letters picked without replacement from {s: 2, p: 1, a: 1, n: 2}. What is prob of sequence ns? 2/15 Calculate prob of sequence bmmb when four letters picked without replacement from mbmmmbbbmmmmmmmmmmm. 35/1292 Four letters picked without replacement from {l: 3, s: 2, e: 1, g: 1}. Give prob of sequence essg. 1/420 Four letters picked without replacement from {e: 5, r: 4, b: 2, k: 2}. Give prob of sequence rber. 1/143 Calculate prob of sequence oddd when four letters picked without replacement from {o: 3, e: 1, d: 6, b: 1, c: 3, l: 3}. 3/476 Two letters picked without replacement from {q: 5, f: 3}. What is prob of sequence qq? 5/14 What is prob of sequence ggg when three letters picked without replacement from dgdgdggddddddd? 1/91 What is prob of sequence foo when three letters picked without replacement from ooffi? 1/15 Calculate prob of sequence sg when two letters picked without replacement from sssiississsisrgsr. 5/136 Four letters picked without replacement from {n: 1, d: 5, t: 5}. What is prob of sequence tdnd? 5/396 Three letters picked without replacement from vggnc. Give prob of sequence cgg. 1/30 What is prob of sequence wll when three letters picked without replacement from lyllwlwllllllllll? 91/1020 Two letters picked without replacement from jkksuoufsjfjjo. Give prob of sequence oo. 1/91 What is prob of sequence wiwl when four letters picked without replacement from lmiww? 1/60 What is prob of sequence ccvc when four letters picked without replacement from {v: 6, q: 1, c: 4}? 1/55 What is prob of sequence rd when two letters picked without replacement from {m: 6, p: 1, b: 2, d: 2, r: 1}? 1/66 Two letters picked without replacement from iljilbljjljjiyjill. What is prob of sequence iy? 2/153 Two letters picked without replacement from yuyyyyuyyyuuuyyyyuu. Give prob of sequence uu. 7/57 Three letters picked without replacement from bbbbbxbbbbbbxbbbbb. What is prob of sequence xbx? 1/153 Two letters picked without replacement from zzqgzzzzzzzzqrrpxqz. Give prob of sequence zx. 11/342 Two letters picked without replacement from rhrhl. What is prob of sequence rl? 1/10 Calculate prob of sequence gsc when three letters picked without replacement from zcxsg. 1/60 Two letters picked without replacement from httjjjwjtt. Give prob of sequence hj. 2/45 What is prob of sequence ssj when three letters picked without replacement from {s: 4, q: 1, v: 3, j: 2}? 1/30 What is prob of sequence cdg when three letters picked without replacement from {d: 1, n: 6, c: 3, g: 2}? 1/220 Three letters picked without replacement from wzwpiwwzpwwpp. Give prob of sequence wpz. 4/143 Calculate prob of sequence xo when two letters picked without replacement from hvvvvoxhvovhhvuovvo. 2/171 What is prob of sequence bo when two letters picked without replacement from {d: 2, o: 1, n: 1, b: 2, w: 1, u: 1}? 1/28 Calculate prob of sequence dww when three letters picked without replacement from vjdvgvtwwvwd. 1/110 Three letters picked without replacement from {d: 3, m: 1, j: 2, i: 1}. Give prob of sequence jmi. 1/105 Calculate prob of sequence cnc when three letters picked without replacement from innncncncncccnnnnn. 55/816 Four letters picked without replacement from {g: 3, a: 1, r: 4, f: 2, h: 1, n: 4}. What is prob of sequence nnan? 1/1365 Four letters picked without replacement from deeeeeeeeeeedeeeeee. Give prob of sequence dede. 1/171 Four letters picked without replacement from phppphppphh. Give prob of sequence phhh. 7/330 Calculate prob of sequence rrs when three letters picked without replacement from {v: 1, l: 4, r: 10, s: 2}. 3/68 Four letters picked without replacement from vvqqvvvvqv. What is prob of sequence qqvq? 1/120 Calculate prob of sequence pfi when three letters picked without replacement from {i: 1, u: 2, p: 3, f: 1}. 1/70 Four letters picked without replacement from {b: 3, o: 2}. Give prob of sequence obbb. 1/10 Three letters picked without replacement from rrirmirrai. What is prob of sequence iar? 1/48 Calculate prob of sequence mnn when three letters picked without replacement from xxzmxmjcxxmznnn. 3/455 Three letters picked without replacement from hhhhhhhhihhhhhihhhh. What is prob of sequence hhi? 16/171 Four letters picked without replacement from {g: 5, r: 11}. Give prob of sequence grgr. 55/1092 Calculate prob of sequence vvvo when four letters picked without replacement from ovovooovvooovoovovo. 35/1292 Four letters picked without replacement from jjjjojjjjjjjooj. What is prob of sequence jooj? 11/455 Three letters picked without replacement from dididdiidd. Give prob of sequence dii. 1/10 Four letters picked without replacement from {u: 1, t: 1, g: 2, d: 1}. Give prob of sequence utdg. 1/60 What is prob of sequence wj when two letters picked without replacement from jwwwjwjjww? 4/15 Calculate prob of sequence qn when two letters picked without replacement from {q: 2, n: 1, w: 5, z: 5, d: 3}. 1/120 Two letters picked without replacement from {g: 1, z: 1, q: 2}. Give prob of sequence gq. 1/6 Calculate prob of sequence rrrr when four letters picked without replacement from {r: 7, b: 6}. 7/143 What is prob of sequence wwzi when four letters picked without replacement from wyzsgiwz? 1/420 What is prob of sequence gqz when three letters picked without replacement from zzzgzzzixggqqxxxzq? 7/544 What is prob of sequence gggg when four letters picked without replacement from ghgghhghhghhghgh? 1/52 Calculate prob of sequence lchs when fo	{ "pile_set_name": "DM Mathematics" }
4 + 4) to the form z + yn and give y. 2 Rearrange -2 + 8 - 48j*2 - 6 to qj + k + bj2 and give b. -48 Rearrange -124i + 245i - 122i + 19 to the form xi + v and give x. -1 Express (0 + 3 - 1)(-3 - 8u + 3)(u*2 + 4u*2 - 2u*2) as gu*2 + hu*3 + q + tu and give h. -48 Rearrange (0 - 2 + 3)((-3 + 2n + 3)(-29n + 5n - 13n) + 3n - 3n + 2n2) to the form pn + fn2 + c and give f. -72 Rearrange -66j + 32j - 62j to the form gj + u and give g. -96 Rearrange 2o*3 - 642o*2 - 7 + 642o*2 to ao + qo2 + bo*3 + u and give b. 2 Rearrange 2v*4 - 25v*2 - 2v + 18 - 18 to y + iv + dv*3 + bv*2 + sv*4 and give s. 2 Express -1 + 4c*3 + 1 + 4 as qc + rc3 + a + ic*2 and give r. 4 Rearrange -26u*2 + 13u*2 + 11u*2 + 4u to the form yu2 + au + f and give y. -2 Rearrange (1 - t*2 - 1 - 2)(33t + 102t - 38t) to c + it*3 + xt + bt2 and give i. -97 Rearrange (5m - 4m + m)(-1 - 2 + 4) + 2m - 3m + 9m to the form qm + v and give q. 10 Express (5 - 14 - u + 0)((-3u*2 + 6u2 - u2)(0u - 6u + 0u) + 0u3 + u3 + 0u*3) in the form x + wu*3 + au*2 + mu + nu4 and give m. 0 Rearrange m + 3m - 4 - 5m - m2 + 20 to the form lm*2 + bm + n and give l. -1 Rearrange (8 - 16 - 11)(0g*3 - 5g*3 + 4g*3) + (2g + 2g - 2g)(-g2 - g + g) to ug*3 + i + mg + sg2 and give u. 17 Express 4n + 24n + 68n + (0 - 5 + 3)(2 + n - 2) + 6n - 3n - 4n - 2n + 0n + 0n as l + dn and give l. 0 Express 5 + 2r + 1 - 2 - r - r - r + (0r + r + r)(-3 + 2 - 1) as br + j and give b. -5 Express (s*2 - 3s*2 + 3s*2)(0s - s + 4 - 2) as t + ks*2 + os + bs3 and give b. -1 Express (-b + b + 4b)(4 - 2 - 1)(3 - 2b - 3) as wb + ib2 + m and give w. 0 Rearrange -36r*3 + 5r - 7r4 + 38r3 - r2 - 4r - 2r to the form v + hr4 + zr + xr2 + fr*3 and give f. 2 Express -3v*4 - 2 + 2v2 - v3 + v*4 + 5 - 3v*2 as rv*3 + z + jv*4 + fv*2 + pv and give p. 0 Express -2c3 - 8c + 0c3 - 2c + 2c2 in the form j + dc*3 + hc + ac2 and give d. -2 Rearrange -2t*2 + 9 - 9 to at*2 + f + ct and give a. -2 Express 17 - 36 - c + 17 as sc + b and give b. -2 Express (0 + 0 - d)(-129 - 127 - 24d + 251) in the form xd + a + pd2 and give x. 5 Rearrange -17q + 4 + 0 - 6 - 3 to the form kq + m and give k. -17 Express d - 3d*2 + 3d*2 - 4d*2 as md + rd2 + s and give r. -4 Express -2z*4 - 113z - 5z2 + 2z*3 + 113z as iz2 + pz + w + mz3 + gz*4 and give i. -5 Express (-15c*2 + 6 - 6)(2c - 2c*2 + 0c + 0c) in the form uc*4 + rc + h + zc3 + vc*2 and give u. 30 Rearrange 7 - 68n*2 + 68n*2 + 4n*3 - 5 to the form tn*3 + k + sn*2 + pn and give t. 4 Express 94k - 21k - 4k in the form sk + d and give s. 69 Rearrange (0 - 3 + 2)(-2l + 37 - 37) to k + wl and give w. 2 Express -1 + 5 + 2w*3 + 4 - 4 as c + nw*2 + rw + yw3 and give c. 4 Rearrange (-2 + 3 + 0)(12s + 3s + 37s + (4 - 4 - 1)(0s + 0s - 2s) + 0 + 0 - s - 2 + 2 - 2s) to gs + u and give g. 51 Express 1 + 1 - d - 2 in the form n + ld and give l. -1 Express (-29b + 29b + 14b2)(-3 + 5 - 1)(b - 1 + 1)(-b + 3b - b) in the form k + qb + mb4 + ob*3 + gb*2 and give m. 14 Rearrange (-4 + 1 + 2)(-1 - 2 - 1)(3b - 3b - b) to the form y + ub and give u. -4 Rearrange 3g2 - 5 + 2g + 3g2 + 3 to zg*2 + vg + l and give v. 2 Express (-2u2 + 2u*2 - 2u*2 + (u - 2u + 0u)(0u + 0u + 2u))(8 - 9 - 5 + (1 + 4 - 3)(-3 - 1 + 2)) in the form du + hu2 + w and give w. 0 Express (20 - 8 + 91)(-1 + 1 - 1)(2 + r4 - 2 + (r3 + 4r*3 - 6r*3)(5 - 5 + 2r)) as kr*3 + pr*4 + yr*2 + dr + x and give p. 103 Rearrange (u - 2u - u)(9 + u - 9) + 1 + u*2 - 1 to the form v + mu + pu2 and give m. 0 Rearrange -d2 - 2 + 4d*2 + 2 + (4d + 4d - 4d)(-2d - d + 2d) to g + md*2 + ud and give m. -1 Rearrange (-2 + 2 - 2)(-2 + 0 + 6)(-9d + 8d + 4d) - 4 - d + 4 to q + id and give i. -25 Rearrange (i - 2i + 3i)(-1 + 3 + 1)(-2i - i + i) to the form ui + f + ti2 and give t. -12 Express 2 - 2 - 46f*2 + 20f*2 in the form lf*2 + rf + p and give l. -26 Rearrange ((-1 - 2 + 0)(1 + 2 + 0) - 4 + 1 + 2 + 1 - 1 - 1)(-j*4 - 2j*4 + 2j*4) to zj*3 + xj*2 + uj + ij4 + n and give i. 11 Express (3b - 5b + 3b)(5b*2 - 3b*2 - 3b*2) + 349b*3 - 2318 + 2318 + 562b*3 in the form yb*3 + db + o + vb2 and give y. 910 Rearrange 0s*3 + 3s*3 - 10s + 0s + s2 - s3 to x + os*2 + ms*3 + ys and give m. 2 Express (-o*2 + 5o - 5o)(-4o + 0o + 2o)(-3 + 4 + 0) as uo + wo*3 + m + vo*2 and give w. 2 Rearrange -81l + 351 - 351 to kl + i and give k. -81 Rearrange (2 + 0 + 0)(3 - 3 + 2a)(-2a2 + 7a*2 + 6a*2) to ya + q + ua2 + za*3 and give z. 44 Express -21 + 3q2 + q2 - 3q2 in the form aq*2 + g + rq and give g. -21 Express (i*2 - 5 + 5)(0 + 0 + 2i) + (-2i2 - i2 + i*2)(-1 + 1 + 3i) as ci*2 + si*3 + t + ui and give s. -4 Express 5n2 - 12n + 2n4 + n3 + 12n - 4n2 as an + h + yn2 + fn*4 + kn*3 and give y. 1 Rearrange 2o - 28o2 - 26o2 - 1 - o3 + 55o2 - 18o to the form v + po + co*2 + jo*3 and give p. -16 Express 1 + 1 + 2u - 4 + (-3 + 1 + 5)(2u + 0 + 0) as zu + p and give p. -2 Express (2 + 0 - 3)(-126u + 33u - 132u) as pu + o and give p. 225 Express (3u + 0u - 4u)(-10u3 + 12u*3 + 11u3) + u2 + 2u4 - u2 as hu + au2 + ju*3 + d + ou4 and give o. -11 Rearrange (-z3 - 3z3 + 5z*3)(-2 + 0 + 1)(-10z + 2z - 3z) to g + dz2 + wz + vz4 + az*3 and give v. 11 Express 82 + 0q2 - q2 - 83 in the form bq + yq2 + w and give w. -1 Rearrange i2 - 12i3 + i + i4 + 12i*3 - 2 to the form w + vi*2 + li + pi4 + ri*3 and give l. 1 Express -127j - 879 + 879 as u + mj and give m. -127 Express -42o4 + o3 - 19o2 + 13o*4 + 30o*4 + 1 as xo*3 + h + go + wo2 + bo*4 and give w. -19 Express (0 + 5 - 4)(-72w - 82w + 100w)(3w3 + w3 - 2w*3) in the form pw*2 + rw*3 + vw + jw4 + c and give j. -108 Rearrange (4z*3 - 6z*3 - 4z*3)(-2z + 2 - 2)(-6 + 3 + 5) to gz3 + jz*2 + uz + xz4 + i and give x. 24 Rearrange 0s + s2 - s3 + 9s + 7s - 19s to the form ds + l + rs2 + ks*3 and give r. 1 Express z + 0z - 5z2 - 2 + z - 2z*3 + 0z*3 as uz*3 + v + lz + sz2 and give l. 2 Express -5o*4 + 31o*3 + 16o*4 - 29o*3 + (2o4 - o4 + 0o4)(4 + 0 - 1) in the form lo + x + wo*3 + io*4 + do*2 and give w. 2 Rearrange -114w - w*2 + 0w2 - 7 + w3 + 114w to the form nw + rw2 + pw*3 + v and give v. -7 Express (-m + 3m + 0m)(17m + 3m*2 - 9 - 31m + 12m) as sm + wm3 + j + tm2 and give s. -18 Express -9 - 1 + t3 - 2t + t3 in the form rt*3 + it*2 + p + zt and give p. -10 Rearrange (-1 + 2 - 2)(-1 - 1 + 4)(3y - y + 9y + (-7 + 4 + 1)(0y - 4y + 2y)) to ry + k and give r. -30 Express 102g + 1 + 1 + 3g2 - 4g4 + g3 - 103g as tg*3 + dg + yg4 + fg*2 + b and give b. 2 Express -8v - v + 3v + (-10 - 2 + 2)(3v - v + 0v) as x + mv and give x. 0 Express ((-5 - 1 + 3)(-4 + 4 + 1) + 3 - 1 - 1)(-2m2 + m2 - 3m2) + m2 + m2 - 5m*2 in the form cm + om2 + p and give o. 5 Rearrange -3 - 1 - 7q*2 + 3 - 1 to the form r + mq + nq2 and give m. 0 Express -4 + 0 + 4w*4 + 2w + 68w2 - 67w*2 in the form mw*2 + t + jw + gw3 + iw*4 and give i. 4 Rearrange (-11t + 11t - 9t + (-t + 4 - 4)(-4 + 2 + 3))(-t2 - t2 + 3t2) to a + wt + gt3 + nt*2 and give n. 0 Rearrange -3172d - 3d3 + 3175d + 4 + d*2 + 5d*3 to rd*2 + m + wd*3 + sd and give m. 4 Express -34m - 13m + 65m as pm + y and give p. 18 Express ((5a - 2a - a)(a2 - 2a2 - a2) - 4a3 - 3a3 + a3)(-1 + 4 - 2) in the form la + w + za3 + da*2 and give l. 0 Rearrange 10i*2 + 8i*2 + 6i*2 - 2 + 9i*3 - 25i*2 to the form ti*2 + bi*3 + j + ci and give t. -1 Express (-4 - 1 + 3)(-2 + 2 + 2g)(4 - 6 + 3)(-14 - 11 + 24) in the form j + ug and give u. 4 Rearrange (2 - 1 + 1)	{ "pile_set_name": "DM Mathematics" }
s positive. d(74/7) Simplify (((n/n6n)/n)/n)/nn*4((n/(nn(1/3)))/n)8 assuming n is positive. n(-41/3) Simplify a/(a/(aa*9/aa))aaa(-7)(a(-2/9))(-1/33) assuming a is positive. a(1487/297) Simplify (f(-2/9)ff5/f)/(f(1/3))(-4/7) assuming f is positive. f(313/63) Simplify (s*(-4)ss6s)(1/14) assuming s is positive. s(2/7) Simplify (v*(1/5)v)/vv/v(-3/16)v assuming v is positive. v*(191/80) Simplify (f/(ffff(-3/8)/f))(-13/2) assuming f is positive. f(65/16) Simplify ((y1y)(-44))(-7) assuming y is positive. y616 Simplify u(1/9)/((u/(uu/(u/(u*(-4)u)uu)))/uu) assuming u is positive. u(-44/9) Simplify (q(-1))(-34)/((q7/q)/q(-2)) assuming q is positive. q26 Simplify (p(-5))0 assuming p is positive. 1 Simplify (i(2/5)i)(-2/27) assuming i is positive. i(-14/135) Simplify (xx(-2/3))/x6x(1/4)/x(-2) assuming x is positive. x*(-41/12) Simplify (ll(1/3))37 assuming l is positive. l*(148/3) Simplify (zz*(-6)z*(-9))/(zz(-1/2))(-50) assuming z is positive. z11 Simplify (r(1/9))(3/16) assuming r is positive. r(1/48) Simplify ((z*(-3/8)z)/z)(6/11) assuming z is positive. z(-9/44) Simplify ((qq(-2/5)q)/q)/((qq(-2)/q)/q)((q*(1/4)/q)/qqq)(-23) assuming q is positive. q(-43/20) Simplify ((b/(b/(bb*(5/4))b))/(b/b5))(-36) assuming b is positive. b(-189) Simplify (k(-7)/kk(2/11))/(k(3/7)/((k/k(1/8))/k)) assuming k is positive. k(-5157/616) Simplify (aa*26/a)/(aaa5/a) assuming a is positive. a20 Simplify (z(-2/5))13/(z/(z(-2/3)/zz))(-9) assuming z is positive. z(49/5) Simplify v(4/11)/((v(4/9)/v)/v)v2/v(-8) assuming v is positive. v(1180/99) Simplify ((h/(hh/(h*1h))h)(-3/11))(5/8) assuming h is positive. h(-15/44) Simplify ((d/(dd(dd*(-11))/ddd))/d3)/(d(1/3)/(d(-10)/d)) assuming d is positive. d(-19/3) Simplify (h(1/5))(2/17)(h/h*(5/6))/(h/(hhhh*(-6/7)h)) assuming h is positive. h(8329/3570) Simplify f0/(f/(f*2f))(f/(ff/f1))(2/29) assuming f is positive. f2 Simplify z(-2/13)/(z/(z/(z/(zzzz(-2/5))z)z))(z*(2/5)/zz)(6/13) assuming z is positive. z(106/65) Simplify (d/d*(-1/7)d*(-5/2)d)(-14) assuming d is positive. d5 Simplify (((p/p*(3/2))/p)/p)/p(p*3/p)/pp/(ppp/p*(1/3)p)p1 assuming p is positive. p(-25/6) Simplify ((dd*7)/(d(dd(2/3))/d))/((d(3/4)d)/d(8/3)) assuming d is positive. d(29/4) Simplify (gg/g1g)(-7/9)/(g(1/16)(g/g(-7))/g) assuming g is positive. g(-1241/144) Simplify (bb(2/39))(2/57) assuming b is positive. b(82/2223) Simplify (t2)(3/49)/(t(-3)t)(-12/17) assuming t is positive. t(-1074/833) Simplify n/(n/n(5/4))n/(n*6/n)nn(2/25)/n0 assuming n is positive. n(-167/100) Simplify (w/w(-2)ww4)/(w0)(-1/13) assuming w is positive. w8 Simplify ((a(-3/5)/a)/(aa(-14)))16 assuming a is positive. a*(912/5) Simplify (ggg/(g/g(-7))ggg)/gg/(g(-7)g)g/(gggg(g/g(-2))/ggggggg)g/((g/g(-1/6))/g) assuming g is positive. g(-37/6) Simplify ((w(-2)/w)(2/9))(-48) assuming w is positive. w32 Simplify ((uu/(uu/(uu(-12)uu)))/(uu7/u))8 assuming u is positive. u(-128) Simplify z/z(-13)z7 assuming z is positive. z21 Simplify ((ll/(l/(l/l(-13/3))))/l)/(l(-1/4)/l) assuming l is positive. l(79/12) Simplify ((c(-1))(-39))1 assuming c is positive. c39 Simplify (n0n)(17/5)((n(2/3)/n)/n)(-2/91) assuming n is positive. n*(4681/1365) Simplify (mm*(-4)m)/m(-1/16) assuming m is positive. m(-31/16) Simplify z(-20)/(z(-3/16)z) assuming z is positive. z(-333/16) Simplify (l(-5/4))(-2/101) assuming l is positive. l(5/202) Simplify v/(v/((vv*9)/v))v*(-1/10)v assuming v is positive. v(99/10) Simplify (c/c(-2/7))*(-30)/((ccc(3/4)c)/(cccc(-2/7))) assuming c is positive. c(-1109/28) Simplify (k(2/15)k)/k*(-5/3)k*(-1)/(kkkkk5k) assuming k is positive. k(-41/5) Simplify (g(-6)g/g(-1/9))/((gg/g(-6))/(g/(g/(g/(g/(g(-3)/g)))g))) assuming g is positive. g(-161/9) Simplify ((i(-2/23))(-5/3))(-2/17) assuming i is positive. i(-20/1173) Simplify ((ll(-10))/l(-1))(-4/13) assuming l is positive. l(32/13) Simplify (c/c(3/16))/c1 assuming c is positive. c*(-3/16) Simplify ((w/(ww(3/8)))/w)40 assuming w is positive. w*(-55) Simplify (((((zz*(3/5)/z)/z)/z)/z)/(zz(-4/11)))/((z/(z(-1/6)z))/zz(-2/5)) assuming z is positive. z(-119/66) Simplify ((c1)(-5))(-23) assuming c is positive. c115 Simplify (qq/(q0/q)q)(-8/5) assuming q is positive. q(-32/5) Simplify ((aa(-1/6)a)(-1/2))(-2/137) assuming a is positive. a*(11/822) Simplify (((jj/(j/j*4)j)/j)/((((j11/j)/j)/j)/j))(2/27) assuming j is positive. j*(-4/27) Simplify (hh*8hh)(-1/27) assuming h is positive. h(-11/27) Simplify f/(fff/f(-6/11))ff16/f assuming f is positive. f(148/11) Simplify (n(1/11))(-1/22) assuming n is positive. n(-1/242) Simplify (x6x/x*(-1/4))/(xx(x0/xx)/xx)(-1/54) assuming x is positive. x(787/108) Simplify ((v/(v/(v(1/11)v)))/v(2/7))(-2/153) assuming v is positive. v(-124/11781) Simplify (t/(t(2/39)/tt))/(t(-12)t) assuming t is positive. t*(466/39) Simplify ((z(zz(zz6)/z)/z)/(z4/z))(-10/7) assuming z is positive. z(-50/7) Simplify b(-2/5)/(bb*(-1)b)bb/b*(-1/6)bbb/(b*(3/2)/bb) assuming b is positive. b(34/15) Simplify (d(-39)/d)/d(-3/2) assuming d is positive. d(-77/2) Simplify (y(-2/7))(-46)yy*(-3/2)yy(1/4) assuming y is positive. y(389/28) Simplify (i1)32/(iii(-2/7)ii)3 assuming i is positive. i(146/7) Simplify (mmm(-6)((mm(-4))/mm)/m)/(m*1mm/m6) assuming m is positive. m(-5) Simplify (g(-1/2)/g)(1/20)/(g(-1/2))(1/2) assuming g is positive. g(7/40) Simplify nn*2nnn/n*(-2/11)n*(-1)n/(nn1) assuming n is positive. n(46/11) Simplify (kk*(-3/2)/kk)(-43) assuming k is positive. k(43/2) Simplify ((r/r(1/4))/r(-2/5))/((r/((r*(-2/23)/rr)/r))/((r/r(-4))/r)) assuming r is positive. r(1409/460) Simplify (ll/(ll/(ll5l))llll*1)/(ll/l*(2/5)l)30 assuming l is positive. l(-67) Simplify (t*(3/4)ttt/t2)36 assuming t is positive. t63 Simplify (d/d(-8))/dd1(d*(-3)/d)/d((d(d9/d)/d)/d)/d assuming d is positive. d10 Simplify (b/(b(-4/7)/b)b(3/10)/b)11 assuming b is positive. b(1441/70) Simplify (l(-1/3))(1/34) assuming l is positive. l(-1/102) Simplify n*(4/5)/(n/(((nn/n1)/n)/n)) assuming n is positive. n(-6/5) Simplify (s11)(-17/4) assuming s is positive. s*(-187/4) Simplify ((((ll/(l*(-7)l))/l)/l)/l(5/7))31 assuming l is positive. l(1147/7) Simplify (h(-17))(-5/6) assuming h is positive. h(85/6) Simplify ((uu(1/12))/u8)(-40) assuming u is positive. u(830/3) Simplify ((kk/(k/k*(-1)))/kk(-2)/k)(-6) assuming k is positive. k*24 Simplify ll*(-1)l*4/ll(l6/l)/(l10/ll) assuming l is positive. 1/l Simplify kkk*(-1/6)kk3((k*2k)/k)(2/109) assuming k is positive. k(3839/654) Simplify (g*(-1/3)ggg)*(2/9)g*6g/(g/((g0/g)/g)) assuming g is positive. g(124/27) Simplify ll(-32)l/((l(l/(((l/(l/l(5/8)))/l)/l))/l)/l) assuming l is positive. l(-251/8) Simplify ((hhh0)/((h/((h/(h(1/6)/h))/hh))/h))(18/11) assuming h is positive. h(69/11) Simplify (w/((w(-6)/w)/w))(-45) assuming w is positive. w(-405) Simplify (k(1/3)/k(-2))(4/5) assuming k is positive. k*(28/15) Simplify ((ii*(-1/4)i)46)(5/2) assuming i is positive. i(805/4) Simplify (g/g(-5)g(1/8))/(g3(g/g*(-2/3))/gg) assuming g is positive. g(35/24) Simplify (a(2/39))(-2/11) assuming a is positive. a(-4/429) Simplify (f/f(-1/18))/f(-6) assuming f is positive. f(127/18) Simplify (y/y(1/4))/((yy(2/21))/y)(y/(y/(y/(((yyyyyy(-1)y)/y)/yyy)))y)/yy(4/7) assuming y is positive. y(-233/84) Simplify (n*(-3)n)*1(n(-1/5))(-36) assuming n is positive. n(26/5) Simplify w(2/19)/(w	{ "pile_set_name": "DM Mathematics" }
digit of l? 1 Suppose y + 4y - 15 = 0. What is the units digit of y? 3 Let n(i) = i3 + i2 - i. Let x be n(3). Let m = x + -21. What is the units digit of m? 2 Suppose -281 = -3k + 2g, 99 = k - g - g. What is the units digit of k? 1 Suppose -4f + 10 = 3w - 50, -12 = -4f. What is the units digit of w? 6 Suppose 0 = 4a + 3n - 5n - 430, -n = -1. What is the units digit of a? 8 Suppose -4l = k - 14, 0 = -k - 0 - 2. What is the units digit of l? 4 Suppose -5a + 5 = 3o, 0o = 3a - 3o - 27. Suppose 19 = b + 2z - 0z, 0 = ab + 2z - 100. What is the units digit of b? 7 Suppose -5g - 3i = -16, -3g + 16 = -0g + 5i. What is the tens digit of (12/(-9))/(g/(-18))? 1 Suppose -334 = -5n + 476. What is the tens digit of n? 6 Let h be 21/(-2)-5. Suppose -21 = -hq + 2q. What is the units digit of q? 7 What is the tens digit of (-1173)/(-4) + (-30)/(-320)8? 9 Let l(a) be the second derivative of -1/12a4 + 2a + 0 + 1/6a3 + 7/2a*2. What is the units digit of l(0)? 7 Suppose 0 = 5w - 2 - 8. Suppose 5 = b - w. Suppose 3c = 2s - 2c + 18, 0 = s - 2c + b. What is the units digit of s? 1 Let t(r) = r*3 - 6r*2 - 7r + 12. Let j be t(8). Let k = j - 59. What is the units digit of k? 5 Let i(d) = 21d. What is the tens digit of i(1)? 2 Suppose -3o = 2o - 3p - 419, 4o - 346 = -3p. Suppose 4d - o = -d. What is the tens digit of d? 1 Let q be 0/2(-2)/(-4). Let j = q + 4. Suppose -jn = 2 - 30. What is the units digit of n? 7 Suppose -30 = -x + 32. What is the units digit of x? 2 Let h be 1/(-2)-23. Suppose -6b + 1 = -7b. What is the units digit of h + 3 - b/1? 7 Let c(u) = -37u3 - u2. Let b be c(-1). Let j = b - 63. What is the units digit of 6/9(-3 - j)? 6 Suppose 0b = -b - 2. Let y be (1 + 0)(6 + b). Suppose yk - 10 = 14. What is the units digit of k? 6 Suppose -5h + 2y = -0h - 363, 8 = -2y. What is the units digit of h? 1 Let g be -1 + (-3 + 1 - -8). Suppose r = -gf + 19, -11 = -f - r - 4. Suppose 0 = fj - 11 - 25. What is the units digit of j? 2 Let x(a) = -a - 5. Let m be x(-4). What is the tens digit of (2 + 20 - m)1? 2 Let z(r) = -r2 + 3r + 8. Let b be z(7). Let o = b + 31. What is the units digit of o? 1 Let c(z) = z*2 + 2z - 2. Let x(a) = -3a2 + 5a*2 + a + 2a*2 - 3a*2. Let d(t) = -c(t) + 2x(t). What is the units digit of d(0)? 2 Suppose -16 = 4w, 2t + t + 4w = 158. What is the tens digit of t? 5 Let o(u) = u2 + 11u + 7. Let q be o(-8). Let n = -4 - q. What is the units digit of n? 3 Let s = 2 - -3. Suppose so - 2o - 120 = 0. What is the tens digit of o? 4 Suppose 0b - 5b = 2t - 197, 5b + 4t - 199 = 0. What is the units digit of b? 9 Let i(k) = 2k3 - k2. Let z be i(3). What is the tens digit of 18/((z/6)/5)? 1 Suppose z + 0z + 59 = -3r, -3z = 3r + 57. Let v be (3/(-4))/(1/r). Suppose -4l - l = -v. What is the units digit of l? 3 Let j(b) = b2 - 2b - 6. What is the units digit of j(4)? 2 Suppose -6l + l + 45 = 0. What is the units digit of l? 9 Let i = -8 - -4. Let f = i + 6. Suppose 0w = 2a - 4w + f, -5w = -5. What is the units digit of a? 1 Suppose 3c + 5t = 128, -c + 6c - t - 176 = 0. What is the units digit of c? 6 Let d = 3 - 1. Suppose 0m + 4 = -dm. What is the units digit of (m/(-4))/(6/12)? 1 Let r(o) = o*2 + 9o + 4. Let a be r(-4). Let l = 33 + a. What is the tens digit of l? 1 Suppose 4f = -117 + 453. What is the units digit of f? 4 Let r(o) = o2 - 8o + 10. Let m be r(7). Suppose -5f = 5d, 2f + mf = -4d. Suppose i = t - 3t + 16, -2t + i + 20 = f. What is the units digit of t? 9 Let j(c) = -c - 5. What is the units digit of j(-13)? 8 Let r(q) = -q2 - 5q - 3. Let a be r(-3). What is the units digit of 36 + a + -2 + 3? 0 Let z = 8 - 4. Let x(m) = -2 - zm2 - m2 - m3 + 8m - 3m2. What is the units digit of x(-9)? 7 Let i be 1/2 + (-1)/2. Suppose 0 = -2y + 79 - 31. Suppose -4u = -iu - y. What is the units digit of u? 6 Let d(g) = -6g + 1. Let l be d(-1). Let j = -7 - -4. Let p = l - j. What is the tens digit of p? 1 Let p(n) = n2 + 4n + 1. What is the units digit of p(3)? 2 Suppose 0 = -0r - 5r + 220. Suppose g = -3g + r. What is the units digit of g? 1 Let z be (32/20)/((-2)/10). What is the units digit of (-268)/(-9) - z/36? 0 Suppose i + 2v = 5, 2v + v + 60 = 3i. Suppose -2q - 5 = -i. What is the units digit of q? 5 Let u(s) = 12s - 2s2 - 14 + s2 + 0s*2 + 0s*2. What is the units digit of u(10)? 6 What is the tens digit of 12 - 4/(-1 + 3)? 1 Suppose -a + 7 = 2m, 5m - a - 24 = 3a. What is the units digit of 5/(-3 + m/1)? 5 Suppose -3p + 3 + 3 = 0. Let n(a) = -a3 + a2 + 2a + 1. What is the units digit of n(p)? 1 Let m(p) = p*2 + p - 1. Let d be m(-3). Suppose -4g + 3w = 32, -g - dw - 7 = 1. What is the units digit of (g/(-12))/((-4)/(-18))? 3 Suppose 4u - 112 + 40 = 0. What is the units digit of u? 8 Suppose -4q + k + 177 = -2k, 0 = -5k + 25. Suppose -3x - 3b + q = 0, 2b + b = 2x - 12. What is the units digit of x? 2 What is the units digit of (-5 + 7)/(2/9)? 9 Let c = -13 + -2. Let i = c - -31. What is the tens digit of i? 1 Suppose -4b + 83 = 11. Suppose -4u + b = -u. What is the units digit of u? 6 Let t be (2/7)/(4/28). Suppose -tb - 2b = -72. Let y = 30 - b. What is the tens digit of y? 1 Let h(q) = q*2 - 14q + 13. Suppose 0 = 4a - 0a - 56. What is the units digit of h(a)? 3 Suppose 5r + 15 = 40. Suppose 5c = -rt + 40, c + t = -t + 13. Suppose -cq + 32 = 4j, -5q + 16 + 19 = 3j. What is the units digit of q? 4 Let a(t) = t2 - 5t + 3. Let g be a(3). Let h be -4 - (-7)/((-7)/(-10)). What is the units digit of ((-1)/g)/(1/h)? 2 Let q(b) = 2b3 + 4b*2 + b - 2. Let m be q(-2). What is the tens digit of 2/m - 75/(-6)? 1 Let l = 1 + 2. Suppose -lg = 2g. What is the units digit of (22/4 + g)2? 1 What is the hundreds digit of (0 + 357)(32/6 - 5)? 1 Let b = 0 - 2. Let w(t) = t - 3. Let n(f) = -1. Let q(h) = -6n(h) + w(h). What is the units digit of q(b)? 1 Let f(i) = -i*3 + 8i*2 - 6i + 6. What is the units digit of f(7)? 3 Let q be (22/3)/((-4)/(-6)). What is the tens digit of q/(-2)(1 + -7)? 3 Let h be 2/2 - (-1)/(-1). What is the units digit of (-3)/6h + 8? 8 Let k(w) = -w. Let j = -7 + 4. Let u be k(j). What is the units digit of 1/u - (-10)/6? 2 Let q = 81 + -40. What is the tens digit of q? 4 Let j(v) = v*2 - 4v - 3. Suppose -2b = -7b + 20. Suppose -bt + 16 = 0, 5h - 34 = -0t - t. What is the units digit of j(h)? 9 Let c(h) = h + 8. What is the units digit of c(0)? 8 Let p(k) = 6k - 2. Suppose -z + 54 = 5z. What is the units digit of p(z)? 2 Suppose -45 = -l + 4z, -2l - 100 = -6l - 4z. Let f = l + -53. Let s = -14 - f. What is the units digit of s? 0 Let w(f) = -27f - 37. What is the tens digit of w(-5)? 9 Let v = 8 + -6. Let s(t) be the first derivative of t4/2 - t3 + t2 - 8. What is the units digit of s(v)? 8 Let a = 4 + -13. Let q = a + 12. What is the units digit of q? 3 Let c(f) = f3 - 2f2 + f - 1. Let m be c(3). Let v = m + -7. Suppose v = s - 2k, -2k - k + 59 = 5s. What is the units digit of s? 0 Let f be 2/(-7) - 72/(-7). Suppose 6l = l - f. What is the units digit of (-1)/(-1 - 1/l)? 2 Suppose -2u + 3i + 294 = 67, 5i - 388 = -3u. What is the units digit of u? 1 Suppose 5c - 2d = 79, 8 = -5d + 23. Suppose -2h + 5 = -c. Let o = -5 + h. What is the units digit of o? 6 Suppose 3d - 151 = 3v - 520, 2d + 484 = 4v. What is the tens digit of v? 1 What is the units digit of (-14728)/(-91) - (-6)/39? 2 Let q = 2 + -1. Let r = q + 3. Suppose -4y = rb, b + 36 = 5y - 3b. What is the units digit of y? 4 Suppose 3z - 243 = -0z. What is the units digit of z? 1 Suppose 0 = -3l - 3y, -5l - 3y + y = -15. Let u be ((-4)/l)/(10/(-25)). Let o = 11 - u. What is the units digit of o? 9 Suppose 3y + 81 = 5h, -y = -2y + 3. Suppose 2v = 12 + h. What is the tens digit of v? 1 Let c = -39 - -74. What is the units digit of c? 5 Suppose 7b = 2b - 25. Let m(v) = 2v*2 + 6v - 6. What is the tens digit of m(b)? 1 Let n = 356 - 127. What is the tens digit of n? 2 Suppose 2h + 8 = 6h. Suppose -3 + 5 = -hu. What is the units digit of 4 + u3/(-1)? 7 Let l = -32 - -57. Suppose -5x + 2o + 3o = -l, 4o	{ "pile_set_name": "DM Mathematics" }
letters picked without replacement from {f: 2, n: 1, z: 3, r: 4, j: 4}. 4/1001 Two letters picked without replacement from {z: 8, j: 1, q: 4}. What is prob of sequence jq? 1/39 Calculate prob of sequence aax when three letters picked without replacement from xxxaxxxxxxxax. 1/78 Two letters picked without replacement from mvmmmmvm. Give prob of sequence vm. 3/14 Four letters picked without replacement from {w: 7, n: 5, j: 4, m: 3}. Give prob of sequence jnwm. 35/7752 Calculate prob of sequence xxs when three letters picked without replacement from ssssssxxssx. 8/165 Two letters picked without replacement from {g: 2, q: 1, s: 1, d: 2}. Give prob of sequence dd. 1/15 What is prob of sequence squ when three letters picked without replacement from uqssqssustqsduqt? 3/140 Calculate prob of sequence rf when two letters picked without replacement from {r: 1, v: 1, f: 1}. 1/6 Three letters picked without replacement from {z: 2, b: 4, l: 2}. Give prob of sequence llb. 1/42 Two letters picked without replacement from {q: 2, r: 2}. What is prob of sequence rq? 1/3 What is prob of sequence wsww when four letters picked without replacement from sssuwwsscwswsc? 1/143 Three letters picked without replacement from {f: 1, g: 4, z: 1, o: 2}. Give prob of sequence fgz. 1/84 Three letters picked without replacement from {z: 3, q: 1, x: 1, v: 10}. Give prob of sequence qvz. 1/91 Calculate prob of sequence bn when two letters picked without replacement from ibkddnf. 1/42 Calculate prob of sequence if when two letters picked without replacement from pllvlfi. 1/42 What is prob of sequence jxj when three letters picked without replacement from jjxjjjjxxjj? 28/165 Two letters picked without replacement from {d: 8, k: 6, e: 1, w: 3, o: 1}. What is prob of sequence wo? 1/114 Four letters picked without replacement from {k: 15, f: 3}. Give prob of sequence fffk. 1/816 What is prob of sequence zwz when three letters picked without replacement from ojzwwowwwwwwwjzz? 9/560 What is prob of sequence kvvv when four letters picked without replacement from kkvvkkkkvvvk? 7/198 What is prob of sequence fa when two letters picked without replacement from {o: 2, f: 5, y: 5, a: 7}? 35/342 Four letters picked without replacement from {a: 1, c: 1, q: 1, s: 6, i: 5, t: 2}. What is prob of sequence sqas? 1/1456 What is prob of sequence bj when two letters picked without replacement from {i: 2, b: 1, v: 2, d: 2, j: 10, z: 2}? 5/171 What is prob of sequence bumk when four letters picked without replacement from fmbbkkuffffbbkfkfm? 1/2295 What is prob of sequence nn when two letters picked without replacement from zzannnnnnnzuuu? 3/13 Calculate prob of sequence ib when two letters picked without replacement from isbiboboooko. 1/22 Two letters picked without replacement from {g: 4, r: 15}. Give prob of sequence gr. 10/57 What is prob of sequence fnn when three letters picked without replacement from bbnnbbbbbf? 1/360 Two letters picked without replacement from {b: 11, z: 1, q: 1}. Give prob of sequence bb. 55/78 Three letters picked without replacement from {g: 2, k: 3, f: 2, e: 2, u: 4, n: 1}. What is prob of sequence gek? 1/182 Calculate prob of sequence eevz when four letters picked without replacement from {z: 1, g: 7, e: 5, v: 3, m: 3}. 5/7752 Two letters picked without replacement from cctqqqcqiqqqqec. What is prob of sequence eq? 4/105 Three letters picked without replacement from xxxsqxspzxzzssj. Give prob of sequence zqs. 2/455 Two letters picked without replacement from jgggghjgjkhgkhjgggg. What is prob of sequence gj? 20/171 What is prob of sequence fi when two letters picked without replacement from {f: 1, o: 2, g: 1, r: 1, a: 1, i: 1}? 1/42 Calculate prob of sequence xvu when three letters picked without replacement from uxyvn. 1/60 Two letters picked without replacement from {g: 1, o: 4, a: 6, z: 4, s: 2, h: 2}. What is prob of sequence gs? 1/171 Four letters picked without replacement from {z: 4, n: 7}. Give prob of sequence znzz. 7/330 What is prob of sequence nhn when three letters picked without replacement from nsunfhsfusuo? 1/660 Calculate prob of sequence mrhr when four letters picked without replacement from rtrmtrtmtttthrrthtth. 1/969 Two letters picked without replacement from {o: 4, f: 2}. What is prob of sequence of? 4/15 Two letters picked without replacement from ppppkpplppppplppl. What is prob of sequence ll? 3/136 Calculate prob of sequence ppp when three letters picked without replacement from aapaaaapapaaaaaapp. 5/408 Three letters picked without replacement from {v: 1, i: 1, w: 3}. What is prob of sequence wvi? 1/20 What is prob of sequence pppt when four letters picked without replacement from {d: 1, y: 1, n: 1, t: 1, p: 5}? 5/252 What is prob of sequence zzff when four letters picked without replacement from zztzffppmztfzzfyzt? 7/1020 Four letters picked without replacement from {r: 5, k: 1, h: 3, c: 1, v: 2}. Give prob of sequence vvrh. 1/396 What is prob of sequence ovf when three letters picked without replacement from ccfffcfcvcozccofvf? 1/204 Two letters picked without replacement from {g: 1, n: 1, e: 1, d: 1, j: 1}. What is prob of sequence dj? 1/20 Three letters picked without replacement from ggqqgqqqggqqq. Give prob of sequence gqg. 40/429 Calculate prob of sequence ghq when three letters picked without replacement from glkqhtk. 1/210 Calculate prob of sequence sf when two letters picked without replacement from {s: 1, f: 1, v: 3, m: 1, w: 1}. 1/42 Four letters picked without replacement from {e: 5, y: 4, u: 3}. What is prob of sequence uyyu? 1/165 Two letters picked without replacement from {z: 9, j: 3, a: 2, p: 5}. Give prob of sequence zp. 5/38 Calculate prob of sequence pnn when three letters picked without replacement from {k: 2, r: 1, f: 7, n: 3, p: 1}. 1/364 Calculate prob of sequence ccc when three letters picked without replacement from {c: 4, t: 3}. 4/35 Three letters picked without replacement from acia. What is prob of sequence aca? 1/12 Calculate prob of sequence tt when two letters picked without replacement from fttffff. 1/21 What is prob of sequence yyyy when four letters picked without replacement from yyyyyyyyyy? 1 Four letters picked without replacement from {p: 2, w: 7, h: 4, v: 1}. Give prob of sequence whwv. 1/143 Two letters picked without replacement from wiwiwlywmwzlwiww. What is prob of sequence wz? 1/30 What is prob of sequence llll when four letters picked without replacement from {l: 5}? 1 Calculate prob of sequence ej when two letters picked without replacement from yvbeyjeebvbe. 1/33 What is prob of sequence yw when two letters picked without replacement from {y: 1, w: 1, g: 1}? 1/6 Three letters picked without replacement from {g: 1, d: 2, v: 1, i: 2}. What is prob of sequence gvd? 1/60 Two letters picked without replacement from muohcjo. Give prob of sequence ju. 1/42 Two letters picked without replacement from {v: 11, f: 3, s: 1, w: 4}. What is prob of sequence ww? 2/57 Four letters picked without replacement from ryly. What is prob of sequence yryl? 1/12 Two letters picked without replacement from fmznmf. What is prob of sequence mf? 2/15 What is prob of sequence iki when three letters picked without replacement from {h: 3, i: 2, k: 5, m: 2}? 1/132 What is prob of sequence va when two letters picked without replacement from {v: 4, a: 6, l: 2}? 2/11 Four letters picked without replacement from tgggggtgggggggggtggg. What is prob of sequence gttg? 4/285 Two letters picked without replacement from {t: 2, z: 1, v: 4, g: 1, x: 7}. Give prob of sequence zg. 1/210 Calculate prob of sequence lgg when three letters picked without replacement from {g: 4, l: 3}. 6/35 Three letters picked without replacement from qcftppdt. What is prob of sequence pqf? 1/168 Two letters picked without replacement from {v: 1, p: 3, f: 1, k: 5, d: 4}. Give prob of sequence fd. 2/91 Two letters picked without replacement from {f: 1, u: 1, c: 3, j: 1, t: 2, q: 4}. What is prob of sequence cq? 1/11 What is prob of sequence rg when two letters picked without replacement from {g: 3, e: 1, r: 5, q: 1}? 1/6 Two letters picked without replacement from aadddtdta. Give prob of sequence ad. 1/6 Three letters picked without replacement from mmmmnnnnnmmn	{ "pile_set_name": "DM Mathematics" }
he value of ((-96)/2)/(40/(-24)(-6)/(-5))? 24 Calculate (480/(-84))/((-8)/(-28)). -20 Calculate 4/((792/(-110))/18). -10 Calculate (-627)/2717-1((-6)/2)/(-3). 3/13 (-30)/225((-198)/12)/11 1/5 Calculate (-12)/5-24(-35)/(-5040). 2/5 What is (4/(36/(-18)))/((-5)/(-35))? -28 (-36)/108(-120)/1100 2/55 (12/(-3))/(-24)(-435)/29 -5/2 ((-164)/(-369))/(1/(-3)) -4/3 3/(-126)-6(10/(-2))/5 -1/7 ((246/451)/(25/11))/((-12)/(-20)) 2/5 What is (-6)/(-4)(1/(-4))/(12/(-256))? 8 Calculate 2/(-1)(-2912)/728. 8 Calculate ((-63)/420)/((-60)/(-250)). -5/8 Evaluate (((-637)/(-28))/(-7))/(((-12)/4)/(-12)). -13 Evaluate ((-6)/80)/((-606)/1515). 3/16 (-186/(-18))/(-4(-12)/(-128)) -16 What is 24/(-24)9/(-15)? 3/5 What is 1(-13)/(-3)2268/1638? 6 Calculate (-24)/(-36)(126/(-8))/3. -7/2 What is (-114)/(-4)(100/250)/((-9)/15)? -19 Calculate 4/18-123/(-24). 1/3 Evaluate 2976/5589/4. 12 What is ((-31)/(-93))/(((-4)/(-14))/(1/42))? 1/36 Calculate ((-56)/(-1064))/(2/19)2-1. -1 What is the value of (((-22)/(-154))/((-2)/(-2)))/((-2)/(-77))? 11/2 Calculate 2/((-9)/1205)(-9)/2. 24 Evaluate (-2)/(-6)(418/407)/19. 2/111 What is ((-6318)/7722)/((-6)/(-8)-2)? 6/11 What is ((2/4)/((-747)/166))/((-3)/6)? 2/9 2070/45((-4)/32)/((-1)/(-4)) -23 Calculate (11/(616/(-48)))/(((-6)/2)/(-42)). -12 What is the value of (-378)/70((-980)/42)/7? 18 What is ((-2)/(-5))/(((-14)/(-20))/(623/(-1068)))? -1/3 (22/12)/(15/126070) 11/5 3/(-300)-15(-5)/1 -3/4 What is (-5)/((-240)/32)(-45)/6? -5 What is 4/((-240)/18)((-90)/(-4))/9? -3/4 (14/(-1))/(((-6)/3)/1) 7 Evaluate (((-2)/1)/((-21)/12))/(1050/1225). 4/3 What is the value of (734/(-1101))/((-44)/(-108))? -18/11 Calculate (-63)/48(-16)/6. 7/2 What is ((-18)/8)/(((-369)/(-36))/(-41))? 9 11/((-66)/(-20))(-801)/(-445) 6 Evaluate (-1232)/66013/((-364)/24). 8/5 What is the value of ((-8)/(-60)9)/(126/60)? 4/7 Calculate 1918/(-1026)(-5)/(5/(-6)). -2 (-53)/2703859-1 15 2/(-8(-8)/(-480)) -15 ((-1)/21-14)/(2/(-4))9 -12 What is the value of (17550/36)/(-13)6/60? -15/4 Evaluate ((-104)/70)/(5128/(-8974)). 13/5 (7/(-420)5)/(82/(-28536)) 29 What is -155/22-2? 5 (-30)/8(-672)/3024 5/6 Evaluate (-96)/128(-132)/(-9). -11 Calculate ((((-728)/(-13))/7)/7)/((-12)/(-42)). 4 Evaluate (-240)/964/(-10)-17. -17 1057/380(-8)/(-42) 2/7 What is the value of ((-15)/(-1575)14)/((-8)/(-5))4? 1/3 What is ((-6)/(-7))/((240/16)/105)? 6 Evaluate ((-1)/52)/((-10)/36(-255)/(-1700)). 6/13 Evaluate 2(-4)/(-86)43/(-86). -2/43 What is 012/(-240)-12/4? 0 What is the value of 63/((4/2)/(8/12))? 21 What is 6((-336)/63)/(-16)? 2 What is ((-500)/(-420))/(5/3)? 5/7 (-6)/(-102)2567/4228 1/28 What is ((-7)/(56/66))/(((-741)/(-52))/(-19))? 11 What is 44(-28)/(-280)(-5)/(-2)? 11 ((-5)/7)/((-190)/76) 2/7 Calculate 20/418/(-15)2. -12 Evaluate 3/(-90)5(18/2)/3. -1/2 (90/(-8))/(35/(-168)6) 9 Calculate -1060/50(-4)/(-8). -6 Evaluate (-3(-8)/96-4)/((-1)/(-23)). -23 What is (56/(-539))/((-56)/98)? 2/11 What is the value of (((-432)/(-15))/9)/(28/(-140))? -16 What is -52/56? -12 What is the value of (-112)/(-546)73/(-292)? -2/39 Calculate 2((-18)/(-315))/2. 2/35 Evaluate -29(-10)/4(-38)/95. -29 What is (-9)/705642/161232/(-6)? 12/5 What is the value of ((-91)/(-13))/(280/760)? 19 (-45)/549(-8)/(-2)(-100)/(-1000) -2/61 Evaluate (-77)/(8316/(-72))-1. -2/3 Evaluate 3/18((-17100)/(-25))/(-6). -19 What is the value of (-3)/1(2/15)/(66/99)? -3/5 What is the value of (-34)/20(-3684)/15657? 2/5 What is (0/(-4))/((-52)/(-26))? 0 Evaluate (920/75)/((-3)/((-45)/(-6))). -6 Evaluate (-2(-4)/(-16))/((-38)/(-988)). -13 Calculate 13/195-5(-10)/(-15). -2/9 Calculate (-2)/((2/9)/((-680)/(-360))). -17 Calculate (-20)/450(-4617)/114. 9/5 (-1440)/(-9120)(-2)/(-6)-1 -1/19 15/6144/(-18) -20 6/(-12)((-4)/28)/(4/14) 1/4 Evaluate (-14)/(-35)(-35)/(-147)3. 2/7 Evaluate (2/(-6))/(2091/738). -2/17 Calculate 4(38/(-171))/(8/30). -10/3 Evaluate (-9)/5428(-54)/(-144). -7/4 What is (11/(-8))/(44/(-704)16)? 1/8 What is the value of (-40)/4(-1284)/(-535)? -24 What is -5(-15)/(195/13)? 5 What is 5/10-1723/(69/(-6))? 17 Evaluate ((-3)/(-6))/(24/(-240))1. -5 Calculate ((-3192)/80)/21-103/(-3). -19 (-18)/(-72)624/(-12) -13 8/967/(56/(-16)) -1/6 ((2320/87)/(-16))/(-11) 5/3 Calculate (-9)/91596/(-80). 6 What is 17/1105-202/2? -4/13 What is the value of (-176)/(-8)17/(-34)? -11 ((-3)/(-1))/(824/448) 7 (3/(-28))/((-366)/(-1952)) -4/7 Calculate ((-1)/((-2)/(-1)))/(12/(2304/84)). -8/7 Calculate -264/(-32)(-19)/((-228)/(-48)). -13 What is the value of (821/140)/(12/(-40))? -4 (13(-270)/(-1872))/(9/(-12)) -5/2 What is the value of ((-306)/1702/(-9))/((-2)/80)? -16 What is the value of 37920/(-11376)72/10? -24 1((-72)/(-48))/((-1)/6)1 -9 ((6/9)/(-1))/(175/(-210)) 4/5 Evaluate ((-50)/(-75))/((-3)/(-36)2-5). -4/5 16114/276246/2 7/4 Calculate (((-2)/(-8))/((-21)/84))/(1/1). -1 (91)/(((-198)/(-11))/(-18)) -9 Evaluate (36/(-21))/((-96)/(-672)). -12 What is ((-108)/15)/6(-40)/24? 2 What is (((-1)/6)/(33/44))/((-5)/30)? 4/3 What is the value of (-36)/75(-5955)/(-19056)? -3/20 What is the value of (-218)/(-327)1/6? 1/9 What is the value of (11/(-44))/((15/(-2))/5)? 1/6 ((-6)/32)/(-5(-72)/(-2400)) 5/4 What is the value of 2/(-34)(-969)/171? 1/3 What is the value of ((-21)/(-99))/7(-144)/24? -2/11 Calculate -1-1613/(-2808). -2/27 Evaluate (-6)/(-88)2368/(-888). -2/11 Calculate ((-7)/2)/(-7)-15(-16)/84. 10/7 (-3)/(-2)((-4)/9)/2-15 5 Evaluate 105/(-168)(-2)/(-5). -1/4 Calculate 11/(330/(-2))-35/15. 1/15 Calculate (-72)/864(18/3)/31. -1/6 (-28)/(-8)12/(-84)27/(-27) 1/2 What is ((-99)/132)/((-1)/(-4))? -3 Calculate (20/6)/(5/(-18)). -12 What is 8/12735/(-35)? -14 (721/(-49))/((-3)/2) 2 What is (9(-16)/96)/(306/(-8))? 2/51 ((-12)/482)/((-2)/(-20)) -5 What is (20/225)/(102/(-255))? -2/9 What is 1/((-30)/(-102))517/(-85)? -17/5 What is (315/(-140))/((-6)/(-48))? -18 ((-4)/((-8)/(-3)))/(-4035/(-16800)) -18 What is ((-221)/(-51))/((-22)/66)? -13 What is (-2(-25)/10)/5-7? -7 What is the value of (-180)/40208/108-3? 26 What is the value of 60-24(-19)/3420? 8 Calculate (8/1015)/((-4)/(-2)). 6 Evaluate 5(555/1295)/((-15)/(-14)). 2 What is the value of ((6/6)/(-10))/(20/40)? -1/5 (2751/(-262))/((-8)/(-16)) -21 Calculate 24/(-14)(-280)/4005. 6 What is ((-490)/4557)/(-2)4(-12)/(-40)? 2/31 Calculate (18/12(-3)/(-9))/((-4)/(-8)). 1 Evaluate 20/1352(45/(-10))/3. -4/9 Calculate ((-6)/12)/((-252)/(-144)). -2/7 Calculate (-3190)/58(-4)/(-11). -20 ((-10)/4-8)/((-73)/(3504/288)) -10/3 ((-18)/((-6)/(-3)))/(12(-5)/15) 9/4 What is (-1212)/2020(-20)/1? 12 What is the value of (-4(-3)/18)/(20/(-90))? -3 (7/(238/17))/(1/(114/3)) 19 ((-275)/(-150))/(2/14(-14)/12) -11 What is ((-16)/(-10))/((1380/200)/(-69))? -16 What is ((-2)/2)/(132/(-165)(-75)/156)? -13/5 What is the value of -44(168/(-14))/(-48)? -11 Evaluate ((-14688)/(-272))/((-36)/(-16)). 24 Calculate (-37/(-12))/(12/(-144)). -21 What is ((95/(-2))/(-19))/(-15)? -1/6 What is the value of ((-2960)/(-1110))/((-2)/6)? -8 What is the value of 7(-44)/(241164/27)? -1/29 What is (23(-29)/(-16008))/((-2)/54)? -9/8 Evaluate (2/(-3))/(126/1512). -8 Calculate -21/((-30)/(-105)). -7 (28/11)/((-496)/(-2728)) 14 What is 1/(-3)24111/(-10716)? 3/4 What is the value of ((-44)/792)/((-4)/6(-2)/(-4))? 1/6 What is the value of (880/140)/(4/(-56)-4)? 22 (180/(-441))/(135/(-189)) 4/7 Evaluate (39/(1209/31))/((-4)/200-2). 25 What is the value of 2/(-72)-8-915? -10 Calculate 1/((-3)/(-8))-7211/(-5808). 4/11 What is 1/(7/35)(-210)/(-70)? 15 What is ((-12)/((-8)/2))/((-9)/(-63))? 21 Evaluate (189/(-18))/((-13)/((-156)/9)). -14 What is the value of (-320)/50205/(-82)? 16 What is the value of 435/(-1015)140/(-12)? 5 210/(-350)15 -3 What is the value of (-3)/((26/(6084/27))/(2/(-4)))? 13 Evaluate (-4)/930/(-840)-42. -2/3 What is (-216)/1894/(-16)-14? -4 (-21)/((3600/125)/48) -35 Calculate (4/14)/((-64)/128)(-4)/(-2). -8/7 Evaluate (-2(-2)/(-60)5)/((-16)/(-384)). -8 Evaluate (18/(-30))/((1170/(-25))/(-18)). -3/13 0/(18/(-9)1) 0 (705/(-141))/((-10)/(-4)) -2 Evaluate (((-1)/(-3))/(93/54))/11. 2/33 ((-1)/(-12)*-4)/(48/9) -1/16 What is ((22/2618)/((-10)/(-20)))/(	{ "pile_set_name": "DM Mathematics" }
ending order. 4, 3, 1.4, -2/31, -0.1 Put -0.49, -4, 3, 4/3, 70 in decreasing order. 70, 3, 4/3, -0.49, -4 Sort 4, -50, 5, 203, -5 in descending order. 203, 5, 4, -5, -50 Put 4, -4, 3, 2, 71, 37 in ascending order. -4, 2, 3, 4, 37, 71 Sort -37, -4, 1584 in decreasing order. 1584, -4, -37 Put 3, -4, -1, 26, 7, -5 in decreasing order. 26, 7, 3, -1, -4, -5 Sort -2/7, -4/9, 58/14987. -4/9, -2/7, 58/14987 Put 2, -184, 5, -90 in decreasing order. 5, 2, -90, -184 Sort -4, -0.4, -0.3, -313/9, 1. -313/9, -4, -0.4, -0.3, 1 Sort -14/9, -1/6, -0.4, 0.5, 0.1 in descending order. 0.5, 0.1, -1/6, -0.4, -14/9 Put 4/7, 0.1, -2/41, 4, 0, 2/7 in descending order. 4, 4/7, 2/7, 0.1, 0, -2/41 Sort 1301/5, -0.4, -5 in ascending order. -5, -0.4, 1301/5 Sort 3, -3, -30384, 1, 4 in descending order. 4, 3, 1, -3, -30384 Sort -7, -83, 6, -3, 0. -83, -7, -3, 0, 6 Put -3, 3, 8, 522 in decreasing order. 522, 8, 3, -3 Sort 4/7, 0.3, 1/6, 115815, 1/5 in decreasing order. 115815, 4/7, 0.3, 1/5, 1/6 Sort -4, -12059, 0.1, 3, 0.07 in increasing order. -12059, -4, 0.07, 0.1, 3 Put -41, 3/5, 0.034, -2 in decreasing order. 3/5, 0.034, -2, -41 Sort -4, -1841, 46, 0 in ascending order. -1841, -4, 0, 46 Put -0.1, 3, 2/7, -4, -7/180, 0.1 in increasing order. -4, -0.1, -7/180, 0.1, 2/7, 3 Sort -2, -3, 103, 2, 0, -6 in descending order. 103, 2, 0, -2, -3, -6 Sort -1671, -4, -1/18. -1671, -4, -1/18 Put -5, -1, -12, 10, 3 in decreasing order. 10, 3, -1, -5, -12 Sort 2/3, 21/2, 0, -4, 10 in decreasing order. 21/2, 10, 2/3, 0, -4 Sort -0.2, -1/3, -4, -2/317 in decreasing order. -2/317, -0.2, -1/3, -4 Sort 0.1, -0.5, 80/29. -0.5, 0.1, 80/29 Put 24, 2, 3, 4, 1, -42 in descending order. 24, 4, 3, 2, 1, -42 Sort -23, 14, 3, -467 in ascending order. -467, -23, 3, 14 Put -1/27, -5, -1/5, 0.4, 2, -1 in ascending order. -5, -1, -1/5, -1/27, 0.4, 2 Sort 11, 2, -2, -3, -78, 14. -78, -3, -2, 2, 11, 14 Sort -1, -90/173, 2/17 in descending order. 2/17, -90/173, -1 Sort 44, 2, -10, -7. -10, -7, 2, 44 Sort 1/2, 0, -2, 2098, 6 in descending order. 2098, 6, 1/2, 0, -2 Sort 4, 32, -9, 2 in decreasing order. 32, 4, 2, -9 Put -0.4, -7.45, 1, -2.6 in decreasing order. 1, -0.4, -2.6, -7.45 Put 1434, -30, -5 in decreasing order. 1434, -5, -30 Sort -12, -40, 3, -1/8, -0.16, 2/5 in decreasing order. 3, 2/5, -1/8, -0.16, -12, -40 Put -0.04, 0.5, -6, -4/59 in decreasing order. 0.5, -0.04, -4/59, -6 Sort -0.5, 171, -9474. -9474, -0.5, 171 Sort -4.0415, 1/7, -4. -4.0415, -4, 1/7 Put -416, -3, -9 in decreasing order. -3, -9, -416 Sort -1, 171, -4, 8, 0. -4, -1, 0, 8, 171 Put -7/8, 0, -5, 2/15 in decreasing order. 2/15, 0, -7/8, -5 Sort -5, 551, -1, 2, 4. -5, -1, 2, 4, 551 Sort 1, 137, 1386. 1, 137, 1386 Put -2, 32, 0, -23 in decreasing order. 32, 0, -2, -23 Sort -38/3, -1, 2 in descending order. 2, -1, -38/3 Put 2, 30, -11, 64 in increasing order. -11, 2, 30, 64 Sort -5616, -3, -1, 1, 4 in increasing order. -5616, -3, -1, 1, 4 Sort 3, -2107, -7/2, -2. -2107, -7/2, -2, 3 Put 38, 0.6, -7, 6, 2/5 in descending order. 38, 6, 0.6, 2/5, -7 Sort -4, -1/68, -34/305 in descending order. -1/68, -34/305, -4 Put -15, -5, -1127 in ascending order. -1127, -15, -5 Sort -0.121, 105/4, 2/13 in ascending order. -0.121, 2/13, 105/4 Sort -37, -26/31, -2 in descending order. -26/31, -2, -37 Sort -0.4, -2, 3.6, -1 in increasing order. -2, -1, -0.4, 3.6 Put 4, 3, -25297, -3, -4 in decreasing order. 4, 3, -3, -4, -25297 Put -0.05, 1, 0.4, -5, 15 in decreasing order. 15, 1, 0.4, -0.05, -5 Sort -4, -5, -3, -2, -115. -115, -5, -4, -3, -2 Sort 21, -1, -14, 9, 3, 17. -14, -1, 3, 9, 17, 21 Put 533, -5, -22, -14 in increasing order. -22, -14, -5, 533 Sort -21.93, -8, -2 in increasing order. -21.93, -8, -2 Sort -2, -11, -0.8, 10, 4, 1/2 in decreasing order. 10, 4, 1/2, -0.8, -2, -11 Put -5, -3, -4, 4, 7, -26 in descending order. 7, 4, -3, -4, -5, -26 Put 2, -0.1077, -4, 12.4, -2 in ascending order. -4, -2, -0.1077, 2, 12.4 Sort -8, -10/3, -2/11, 6. -8, -10/3, -2/11, 6 Sort -0.69, 0.2, 6016 in ascending order. -0.69, 0.2, 6016 Sort 3, 110820, 1, 0 in descending order. 110820, 3, 1, 0 Put 4, -1, -4, 1, 5, -31 in decreasing order. 5, 4, 1, -1, -4, -31 Put 10, -1.3, 2216 in ascending order. -1.3, 10, 2216 Put 2/7, -2, 0.23, 14, 1 in decreasing order. 14, 1, 2/7, 0.23, -2 Sort -36, -0.092, -2/11, 1/6 in descending order. 1/6, -0.092, -2/11, -36 Put -2/5, 67/13, 0.2, 5, 17 in decreasing order. 17, 67/13, 5, 0.2, -2/5 Sort -47, -2, -5, 3, 2, 15 in decreasing order. 15, 3, 2, -2, -5, -47 Sort 5, -5, 19, 124, -3 in decreasing order. 124, 19, 5, -3, -5 Put 5/17, -7, -88.5 in increasing order. -88.5, -7, 5/17 Sort 5, 39307, 1 in descending order. 39307, 5, 1 Sort 303, 3/5, -62 in descending order. 303, 3/5, -62 Put -1331, 4/3, 5, -2/15, 1/3 in increasing order. -1331, -2/15, 1/3, 4/3, 5 Sort -6, -1, 1, -2, -13, 4 in descending order. 4, 1, -1, -2, -6, -13 Sort 41, 4, 5, 3, -203 in increasing order. -203, 3, 4, 5, 41 Sort -28, 0, -11, -3, 5 in descending order. 5, 0, -3, -11, -28 Sort 5, 1.4, 12, -4, 47. -4, 1.4, 5, 12, 47 Sort 4122, 0.5, -1/2, -4. -4, -1/2, 0.5, 4122 Sort 0, 83, 40, 4. 0, 4, 40, 83 Sort -10, -0.2, 1, -0.3, -4, -11 in ascending order. -11, -10, -4, -0.3, -0.2, 1 Put 1, -2/7, -2, -5, -0.11, 0.019 in increasing order. -5, -2, -2/7, -0.11, 0.019, 1 Put 2/13, -42291, -2/7 in decreasing order. 2/13, -2/7, -42291 Put -719, 83, -4 in decreasing order. 83, -4, -719 Put -3, -9110, 4 in decreasing order. 4, -3, -9110 Sort 1/6, 0.3, -5, -1/6, 11 in increasing order. -5, -1/6, 1/6, 0.3, 11 Put 4, -20570, 2, 5, 3 in increasing order. -20570, 2, 3, 4, 5 Put 4931, 0.5, 4 in decreasing order. 4931, 4, 0.5 Put 23, -131, 2 in descending order. 23, 2, -131 Put -5, 574, 2, -2, 3 in decreasing order. 574, 3, 2, -2, -5 Put 2, -21, 41, -4, -1 in ascending order. -21, -4, -1, 2, 41 Put 62, 0, -12870 in increasing order. -12870, 0, 62 Sort -6383, 0, -5, 6 in ascending order. -6383, -5, 0, 6 Sort -78, -3, -5 in descending order. -3, -5, -78 Put 5, -3, 2, 0.5, -10 in decreasing order. 5, 2, 0.5, -3, -10 Sort -15, -2, 66, -148 in increasing order. -148, -15, -2, 66 Put 1/4, 4, -4, -1/6, -0.3, -3/7 in descending order. 4, 1/4, -1/6, -0.3, -3/7, -4 Sort -135, 33, -1 in descending order. 33, -1, -135 Put 2/19, 121, 4/9, 17 in descending order. 121, 17, 4/9, 2/19 Sort -0.3, 0.3, 1, -76, 10. -76, -0.3, 0.3, 1, 10 Sort -5, 41, -236 in descending order. 41, -5, -236 Sort 99, 8, 4, -2, -46 in descending order. 99, 8, 4, -2, -46 Sort 2/17, 2, 3, -0.084, 0 in descending order. 3, 2, 2/17, 0, -0.084 Put -13, 538, 5 in descending order. 538, 5, -13 Sort 4, -0.008, 218 in increasing order. -0.008, 4, 218 Put -3, -516, 17, 0 in decreasing order. 17, 0, -3, -516 Sort 3, 0.5, 4/9, -0.04, 1/126, 5 in descending order. 5, 3, 0.5, 4/9, 1/126, -0.04 Sort 0.5, -0.3237, 4 in ascending order. -0.3237, 0.5, 4 Sort 0, -5, 54, 11 in decreasing order. 54, 11, 0, -5 Sort 1, 5, -57, -0.029 in decreasing order. 5, 1, -0.029, -57 Put 1, -3, 1799 in ascending order. -3, 1, 1799 Sort 18.566, 0, -1/12. -1/12, 0, 18.566 Sort -6, 3, -71, -67 in increasing order. -71, -67, -6, 3 Sort 1/52, -1/4, -1/3, 0, -4, 1/4. -4, -1/3, -1/4, 0, 1/52, 1/4 Put -1, 5, -3, 2, -23, -57 in descending order. 5, 2, -1, -3, -23, -57 Sort -2, 1297, 20. -2, 20, 1297 Sort -0.4, 2/99, 34, 0.2. -0.4, 2/99, 0.2, 34 Sort 1, -3, 5, -4, -2.1, -0.43 in decreasing order. 5, 1, -0.43, -2.1, -3, -4 Put -5, 12, 0, 0.10961, -3/7 in ascending order. -5, -3/7, 0, 0.10961, 12 Sort -5, 1, -3, -2521, -9, -1 in decreasing order. 1, -1, -3, -5, -9, -2521 Sort -299, 3, -12/5, 0, -5 in increasing order. -299, -5, -12/5, 0, 3 Sort -89, -3/22, 1, 2/3 in descending order. 1, 2/3, -3/22, -89 Put 5, -5, 0.2, -94 in descending order. 5, 0.2, -5, -94 Put -16/51, 3, -0.03, -2, -3 in ascending order. -3, -2, -16/51, -0.03, 3 Put -0.4, -12/7, -3, 3, 12, 2/35 in decreasing order. 12, 3, 2/35, -0.4, -12/7, -3 Sort 4, 5, -12, 96, 3 in increasing order. -12, 3, 4, 5, 96 Sort -44, 4, -73, -2, 10 in ascending order. -73, -44, -2, 4, 10 Put -70, 291, 9, -6 in decreasing order. 291, 9, -6, -70 Sort 6, 32, -5, -66 in ascending order. -66, -5, 6, 32 Sort 49, -3, 520. -3, 49, 520 Sort 21318, 0.3, 1/2 in increasing order. 0.3, 1/2, 21318 Sort 3, 32, 13, -6 in descending orde	{ "pile_set_name": "DM Mathematics" }
7, what is 23242 + 134? 23406 In base 16, what is 1785 + -c8? 16bd In base 10, what is 17029 + -76? 16953 In base 11, what is -269680 - -4? -269677 In base 7, what is 1436 + -213? 1223 In base 16, what is -6b2 - -91? -621 In base 4, what is 11 + 2100203232? 2100203303 In base 14, what is -1009 + -321? -132a In base 5, what is 10112043031 - -10? 10112043041 In base 13, what is 17871 - 3? 1786b In base 13, what is -11cc8 + 2? -11cc6 In base 10, what is 2583 + -22? 2561 In base 3, what is 2111221 - 1? 2111220 In base 7, what is 3016 + -14? 3002 In base 8, what is -10775 - 137? -11134 In base 8, what is 10102 + -166? 7714 In base 13, what is -16 + 2a17? 2a01 In base 5, what is 41 + -134122? -134031 In base 4, what is 110313221 + -10? 110313211 In base 11, what is 24 - 113963? -11393a In base 3, what is 101 + -101200101? -101200000 In base 11, what is -68a85 + 5? -68a80 In base 7, what is 144305 + 2? 144310 In base 9, what is -2206 - 30? -2236 In base 7, what is 2 + -12132? -12130 In base 15, what is -36c1 + 1? -36c0 In base 5, what is 44 + -14042011? -14041412 In base 6, what is 13 + -32431? -32414 In base 12, what is -39743 - 4? -39747 In base 11, what is 13 - 13052? -1303a In base 6, what is 41 + -451051? -451010 In base 16, what is 148394 + 3? 148397 In base 2, what is -11 - 1001010110001110101? -1001010110001111000 In base 2, what is -1 - 1000001110? -1000001111 In base 5, what is 4 - 1134324? -1134320 In base 5, what is -223010 - -3? -223002 In base 4, what is 323213322102 - 1? 323213322101 In base 6, what is -114223 + 34? -114145 In base 9, what is 5 + 462815? 462821 In base 9, what is 31 - 55771? -55740 In base 12, what is -9 - 74b? -758 In base 9, what is -270467 - 11? -270478 In base 16, what is -168 - -127? -41 In base 14, what is -c64 - c? -c72 In base 8, what is 40301 + 4? 40305 In base 5, what is -123410240 + -2? -123410242 In base 4, what is -3 - 311? -320 In base 14, what is 7 + -591aa? -591a3 In base 8, what is -1 - 2174672? -2174673 In base 14, what is -23 - 1511? -1534 In base 14, what is 28141 + -1? 28140 In base 16, what is -1c34d + 1? -1c34c In base 10, what is 836017 - 2? 836015 In base 7, what is -3001 - -421? -2250 In base 8, what is 22 - -4426? 4450 In base 6, what is 0 + -40121? -40121 In base 7, what is 1123 - 2050? -624 In base 9, what is 0 - -2171235? 2171235 In base 10, what is -65 - 445? -510 In base 9, what is -4 - 221712? -221716 In base 14, what is a1cd7 + -2? a1cd5 In base 12, what is 8889 + -2? 8887 In base 16, what is d8 - -87? 15f In base 13, what is 409 - 24c? 18a In base 16, what is 322 + -8? 31a In base 14, what is -bb - -3cd5? 3c18 In base 13, what is 2 + -29751? -2974c In base 15, what is -c2 - -3c? -85 In base 9, what is -37856 - 0? -37856 In base 15, what is 60 + 24d57? 24db7 In base 9, what is -5 - 2646581? -2646586 In base 3, what is -10 + 10010121102? 10010121022 In base 4, what is 33013112 - -1? 33013113 In base 2, what is 1110101101 - 110100? 1101111001 In base 3, what is 1100022 - -10011? 1110110 In base 11, what is 513 + -82a? -317 In base 8, what is -237 + 35146? 34707 In base 9, what is 24 + -240? -215 In base 8, what is 0 - -30707? 30707 In base 3, what is 100101220 - -2111? 100111101 In base 12, what is -aa732 + -10? -aa742 In base 15, what is -3 - 1ce0? -1ce3 In base 11, what is 2 + 19aaa? 1a001 In base 5, what is 3403243 + 31? 3403324 In base 6, what is -213131 + -42? -213213 In base 5, what is 33140320 - 10? 33140310 In base 14, what is 360ba + -5? 360b5 In base 11, what is -5 + -157a8? -15802 In base 6, what is 45413 - 104? 45305 In base 9, what is 0 - 25208? -25208 In base 7, what is 10 + 1225356? 1225366 In base 15, what is 17c5 - -3e? 1814 In base 15, what is -1 - 24796? -24797 In base 11, what is 2 + a3836? a3838 In base 9, what is -1 + -7613? -7614 In base 10, what is -4 + -275183? -275187 In base 2, what is -110 + -110010000010011? -110010000011001 In base 12, what is -69 + 242? 195 In base 2, what is -101111111 - 11010111? -1001010110 In base 14, what is 1c6c + 7? 1c75 In base 12, what is 1832 - -1? 1833 In base 14, what is 606 - 4a? 59a In base 11, what is -1 + 4a3? 4a2 In base 5, what is -144003113 + 4? -144003104 In base 15, what is 21 - -1763? 1784 In base 12, what is 45135 - -4? 45139 In base 11, what is -3 - 2224? -2227 In base 14, what is b3d + -d8? a45 In base 13, what is aa7c + 5? aa84 In base 6, what is -4005 - 1114? -5123 In base 16, what is 843 + 7? 84a In base 3, what is -202211120 + 1? -202211112 In base 4, what is 211223130 + 11? 211223201 In base 16, what is -16586 + -3? -16589 In base 5, what is 1443 - 132? 1311 In base 5, what is 12 - 134011? -133444 In base 11, what is -5 - -7323? 7319 In base 14, what is -183d - -7? -1836 In base 6, what is 313322 + 21? 313343 In base 13, what is -43 + -461? -4a4 In base 4, what is -220102223133 + -10? -220102223203 In base 15, what is 840 + 6? 846 In base 16, what is -349 - -7d? -2cc In base 7, what is -335 + 3123? 2455 In base 5, what is 12201 + 11? 12212 In base 9, what is -4 - 36457? -36462 In base 12, what is 28588 - -3? 2858b In base 12, what is -288202a - -4? -2882026 In base 14, what is -126d5 + 5? -126d0 In base 3, what is -101111202 - 11020? -101122222 In base 6, what is 222 - -150322? 150544 In base 11, what is 1396 - 1337? 5a In base 10, what is -1 - 10109? -10110 In base 13, what is -3 - 2575? -2578 In base 6, what is -1001014 + -3? -1001021 In base 15, what is 1476 - 1b6? 12b0 In base 13, what is 3a43b - 5? 3a436 In base 16, what is -2 - -3091c? 3091a In base 13, what is -1 - -6bc24? 6bc23 In base 7, what is 2343 + -116? 2224 In base 3, what is 21 + 10002211212? 10002212010 In base 15, what is 1a - -56ab? 56c6 In base 12, what is 48574 - -3? 48577 In base 7, what is -15433462 + -5? -15433500 In base 2, what is 1011001101011 - -100110? 1011010010001 In base 10, what is -2226 - 293? -2519 In base 10, what is -4 - 358007? -358011 In base 11, what is 54 + 910a? 9163 In base 8, what is 1 + -17352? -17351 In base 15, what is 1 - -23eb? 23ec In base 6, what is 32 + -1223? -1151 In base 14, what is -77b3 + 3d? -7774 In base 13, what is 5 - -1629? 1631 In base 8, what is 3163061 + 4? 3163065 In base 13, what is -8 - -3361? 3356 In base 8, what is 5326 - 606? 4520 In base 14, what is -48a920 - 5? -48a925 In base 2, what is -1011111101110 - 10000? -1011111111110 In base 5, what is -2220010224 - 4? -2220010233 In base 13, what is 3 - 14780? -1477a In base 7, what is -63231 + 34? -63164 In base 10, what is 2 + 4241? 4243 In base 8, what is 4425 - 145? 4260 In base 8, what is -1 + -5720? -5721 In base 5, what is 4344330 - -1? 4344331 In base 12, what is 162b + 0? 162b In base 15, what is -3b9 - -83? -336 In base 9, what is 100 + 21? 121 In base 10, what is -5812 - -9? -5803 In base 9, what is -7282 - -8? -7273 In base 15, what is -1 - 57e01? -57e02 In base 9, what is -78 - 7007? -7086 In base 3, what is 10 - -111210120? 111210200 In base 14, what is 1d78 + -59? 1d1d In base 8, what is 14 + -3647? -3633 In base 7, what is 14 + 351565? 351612 In base 8, what is 64412 + 120? 64532 In base 4, what is -11003301013 + -1? -11003301020 In base 12, what is 8182 + -1a2? 7ba0 In base 5, what is 0 - -21101214? 21101214 In base 9, what is -5600 + -1? -5601 In base 6, what is 102 - 4122? -4020 In base 3, what is 22222 + 121220020? 122020012 In base 7, what is -13434 - 651? -14415 In base 2, what is 0 + 110011001010111110? 110011001010111110 In base 4, what is -103 + -1003002? -1003111 In base 6, what is -124 - 135? -303 In base 5, what is -2 - -10430124? 10430122 In base 5, what is -144 + 1432? 1233 In base 11, what is -207 + -3234? -3440 In base 6, what is 15250 + -1321? 13525 In base 13, what is -17538 - -12? -17526 In base 8, what is 73 - 12171? -12076 In base 8, what is 3351 - -27? 3400 In base 10, what is -9 + -54612? -54621 In base 8, what is 21 - -15563? 15604 In base 9, what is -172786 - 4? -172801 In base 9, what is -2 - -405258? 405256 In base 7, what is 11334 - -22? 11356 In base 12, what is 15a13 + -5? 15a0a In base 2, what is 1110 + 10100100010100011? 10100100010110001 In base 16, what is 10 - 38? -28 In base 7, what is -442341 + 5? -442333 In base 16, what is -17a - -998? 81e In base 10, what is 948884 - -4? 948888 In base	{ "pile_set_name": "DM Mathematics" }
- 3. Let n be k(2). Determine x so that 1/2x2 - n + 1/2x = 0. -2, 1 Let i be (26/91)/((-1)/(-14)). Suppose -11 = 3s - ip, 5p = 5s - 0s + 10. Factor 2f*2 + s - 3 + 2f*2 + 4f. 4f(f + 1) Let c(h) = -34h3 + 60h*2 - 32h - 2. Let m(g) = 69g3 - 119g*2 + 66g + 4. Let d(n) = -5c(n) - 2m(n). Solve d(j) = 0. -1/16, 1 Let c be (-12 + 12)56/(-60). Factor 1/3v3 + c + 1/3v*2 - 2v. v(v - 2)(v + 3)/3 Let w be ((-3)/24)/(93/(-496)). Factor wd + 1/3d3 - d2 + 0. d(d - 2)(d - 1)/3 Let z(v) be the second derivative of 1/15v6 + 0 + 1/2v*4 + 0v*3 - 25v - 2/5v5 + 0v*2. Factor z(o). 2o*2(o - 3)(o - 1) Let f = -1918 + 3837/2. Factor -2p*4 + 2p*2 + 3/2p*3 - 2p + 0 + fp5. p(p - 2)*2(p - 1)(p + 1)/2 Solve -6/7k*4 - 8/7k*5 + 72/7 + 138/7k*3 - 330/7k + 134/7k2 = 0. -3, 1/4, 1, 4 Let q(i) = -2i*3 + 6i*2 - 5i - 1. Let j be q(5). Let v = -628/5 - j. Factor -vp - 2/5p*3 + 0 + 4/5p*2. -2p(p - 1)2/5 Let c(z) be the first derivative of z5/10 - 5z*4/8 - 4z*3/3 + 3z2 - 97. Find x, given that c(x) = 0. -2, 0, 1, 6 Let x(w) = w3 + 2w2 - w + 1. Let f(c) = 8c*3 + 52c*2 + 194c + 6. Let z(r) = f(r) - 6x(r). Find b such that z(b) = 0. -10, 0 Suppose -3c - 29 - 91 = 0. Let f be (-3)/4c/15. Factor 3u*2 - 2u - 6u2 - u3 - 2u*3 + fu*3. -u(u + 1)(u + 2) Let d(c) = c4 - 2c3 + c2 + c. Let k(y) = 3y4 + 3y*3 - 38y*2 + 68y - 32. Let u(g) = 12d(g) - 3k(g). Solve u(r) = 0 for r. 1, 2, 4 Let f(s) be the second derivative of -s*6/165 - 5s*5/2 - 4186s*4/11 - 753296s*3/33 + 778688s*2/11 + 2s + 18. Factor f(l). -2(l - 1)(l + 92)3/11 Let b(l) = l3 + 3l2 + 4. Let i be b(-3). Determine z so that -28z*2 + 0z - 20z3 + z - 4z - 9z - 4z*i = 0. -3, -1, 0 Solve -12s + 3/5s2 + 0 = 0 for s. 0, 20 Let h = 20493/95 - 1068/5. Let m = 44/19 - h. Factor 3/5f*4 + mf*3 - 3/5f*2 + 1/5f*5 - 2/5f + 0. f(f - 1)(f + 1)*2(f + 2)/5 Let o be 38/16 - (786/48 - 16). Suppose -2/3 - 10/3xo - 4x = 0. Calculate x. -1, -1/5 Let b(k) be the first derivative of 2k3/3 + 17k*2 + 32k + 92. Solve b(d) = 0. -16, -1 Let u be (-6)/15 + (-88)/(-20). Let l(d) be the second derivative of 1/2d3 - 3d*2 + 0 + 1/2d*u - 6d - 3/20d5. Factor l(q). -3(q - 2)(q - 1)(q + 1) Let h(r) = 3r4 + 20r - 6r - r2 - 8 - 4. Let u(z) = -z4 - z3 + z2 - z + 1. Let i(y) = -h(y) - 4u(y). Determine d so that i(d) = 0. -4, -2, 1 Suppose 0 = -p + 3r + 9, -2p = 2p - 4r - 20. Suppose p + 5 = 4y. Factor -2/3c*4 + 0 - 2c*y - 2c*3 - 2/3c. -2c(c + 1)*3/3 Let h(o) = 2o*2 + 21o - 11. Let p be h(-11). Let m(t) be the first derivative of 1/5t2 + pt - 5 - 1/20t4 - 1/15t*3. Factor m(g). -g(g - 1)(g + 2)/5 Let x be 16/(-28) + 76/35. Determine s so that 2/5s*2 + 8/5 + xs = 0. -2 Let y(s) = -s*3 + 17s*2 - 29s - 12. Let c be y(15). Solve 5p3 - pc + 4p*3 - 3p*3 = 0 for p. 0 Let 32z*4 - 11z*2 + 150z*3 + 5z*5 + 151z*2 - 29z + 28z4 + 74z = 0. What is z? -9, -1, 0 Let d(o) = 4o3 - 40o*2 + 36o. Suppose -54 = -4k - 2u + 5u, -5k - 4u = -52. Let i(j) = j2 - j. Let a(b) = ki(b) + d(b). Factor a(v). 4v(v - 6)(v - 1) Let c(i) be the first derivative of -i3/24 + 67i*2/16 - 65i/4 + 91. Factor c(q). -(q - 65)(q - 2)/8 Let d(x) be the first derivative of x4/2 + 2x3/3 - x2 - 2x - 7. Find c, given that d(c) = 0. -1, 1 Let j = 58 + 45. Let 20w*2 - 20w*4 + 6w + 98w3 - w - jw*3 = 0. Calculate w. -1, -1/4, 0, 1 Let 30/7 + 3/7m*2 + 3m = 0. What is m? -5, -2 Let a = 5921/5 + -1184. Solve -1/5y3 + ay*2 - 1/5 + 1/5y = 0. -1, 1 What is t in -5/3t2 - 69360 + 680t = 0? 204 Factor k*3 + 0k - 1/5k4 - 6/5k2 + 0. -k2(k - 3)(k - 2)/5 Find a, given that -144 + 9a3 + 81a*2 + 3a*3 - 30a - a3 + a3 - 108a = 0. -8, -3/4, 2 Suppose 5/4g*5 + 5/4 + 5/4g - 5/2g3 + 5/4g*4 - 5/2g*2 = 0. What is g? -1, 1 Let b(x) = -x - 1. Let k be (-8)/3 + 2/(-6). Let r be b(k). Factor -2p + p + 0p - pr. -p(p + 1) Let 46/17a2 + 22/17a + 26/17a3 + 0 + 2/17a*4 = 0. Calculate a. -11, -1, 0 Let n(u) be the second derivative of -2/3u*3 - 26u + 1/15u6 + 3u*2 + 1/5u*5 + 0 - 2/3u*4. What is r in n(r) = 0? -3, -1, 1 Let f(o) be the first derivative of 2o*3/3 - 9o*2 - 72o + 228. Determine w, given that f(w) = 0. -3, 12 Let w(a) be the third derivative of -a*6/30 + 2a*5/15 + 2a*4/3 - 16a3/3 + a2 + 2. Solve w(m) = 0 for m. -2, 2 Let l(s) be the third derivative of -s8/60480 + s6/540 - s*5/60 - 20s*2. Let m(r) be the third derivative of l(r). Solve m(p) = 0. -2, 2 Let a be ((-1)/(-6)2)/(-11 + 646/51). Suppose 0 + 0w + aw*3 + 4/5w2 = 0. Calculate w. -4, 0 Let s(l) be the first derivative of l7/525 - l6/300 - l5/50 + l*4/12 - 2l*3/15 - 6l*2 - 7. Let m(j) be the second derivative of s(j). Factor m(x). 2(x - 1)*3(x + 2)/5 Let a(f) be the third derivative of -f*5/30 + 9f*4/4 - 131f*2. Factor a(w). -2w(w - 27) Factor 8v + 38v - 10v + 4v2 - 4v. 4v(v + 8) Suppose 0 = -9f - 18 - 9. Let z(a) = -3a*3 + 2a*2 - 2a - 1. Let o be z(f). Factor o - 12y3 - 4y*4 + 0y*4 - 104. -4y*3(y + 3) Let j(u) be the third derivative of u7/11340 + u6/540 + u*5/108 + 7u*4/24 + 16u2. Let x(n) be the second derivative of j(n). Solve x(p) = 0 for p. -5, -1 Let o(i) be the second derivative of i4/4 - 2i3 - 15i*2/2 + 7i - 3. Suppose o(s) = 0. What is s? -1, 5 Let q = 3989/8 - 19921/40. Factor 0 + 4/5x + 1/5x*4 - qx*3 + 0x*2. x(x - 2)*2(x + 1)/5 Let 0u + 0u*2 - 3/5u*4 + 1/5u*5 + 0u*3 + 0 = 0. Calculate u. 0, 3 Suppose 32 = 4h - 7t + 4t, 2t + 13 = h. Let u(w) = 4w - 18. Let x be u(h). Solve 2/7r5 - 54/7r - 36/7rx + 2r*4 + 20/7r*3 + 54/7 = 0 for r. -3, 1 Suppose -5t - 5t = -210. Suppose -t = 19j - 26j. Find y such that -2/3y + 0 - 10/9yj + 2/9y*4 + 14/9y*2 = 0. 0, 1, 3 Let z be (-2)/215. Let r(x) = 1 + 64x + 52x - 115x. Let b(v) = 3v2 + 5v + 2. Let c(t) = zr(t) + b(t). Determine w, given that c(w) = 0. -1, 1 Factor 3/2f*4 + 45/2f*3 + 21f*2 + 0f + 0. 3f2(f + 1)(f + 14)/2 Suppose -127 + 7 = -5r. Let o(s) = -2s2 + s + 3. Let v(c) = 9c*2 - 6c - 15. Let n(t) = ro(t) + 5v(t). Determine i so that n(i) = 0. -1 Let y = -208 - -210. Let l(p) be the first derivative of 0p2 + 0p + 1/16p4 + y + 1/12p3. Factor l(z). z2(z + 1)/4 Let a(z) be the third derivative of 0z - 1/1176z8 + 1/735z*7 + 0z*4 + 0 + 1/420z*6 - 1/210z*5 + 21z*2 + 0z*3. Factor a(t). -2t*2(t - 1)*2(t + 1)/7 What is a in -501a3 - 1995a*3 - 478a*3 - 492a*3 - 80a*4 - 31512a*2 + 3200 + 278a*3 + 5120a = 0? -20, -1/4, 2/5 Let q(z) be the first derivative of 2z5/35 - z4/7 + 89. Factor q(v). 2v*3(v - 2)/7 Factor m*2 + 0 + 6/5m*3 + 0m + 1/5m4. m2(m + 1)(m + 5)/5 Let q(h) be the first derivative of -8h*3/3 + 31h*2 + 16h + 140. Factor q(d). -2(d - 8)(4d + 1) Let y = -15341/3 + 5114. Suppose -1/3w*3 + 1/6w*5 + 1/6w*4 - yw*2 + 1/6w + 1/6 = 0. Calculate w. -1, 1 Factor 0m3 - 2/3m + 0 + m*2 - 1/3m*4. -m(m - 1)*2(m + 2)/3 Let u(d) be the first derivative of d*6/7 + 57d*5/35 + 45d*4/14 - 4d*3/7 - 48d*2/7 - 45d/7 - 98. Let u(g) = 0. Calculate g. -15/2, -1, 1 Let r(u) be the third derivative of u*5/90 - 13u*4/36 + 4u*3/3 + 50u*2. Suppose r(x) = 0. What is x? 1, 12 Factor 176/3g - 172/3g2 + 0 - 4/3g*3. -4g(g - 1)(g + 44)/3 Let r(g) be the third derivative of g*5/45 + 17g*4/18 + 140g*3/9 - 6g*2 + 51. Factor r(y). 4(y + 7)(y + 10)/3 Suppose g + 56 = 15g. Let w be ((-172)/(-42) - g)(-6)/(-1). Factor -wb*4 + 4/7b + 4/7b2 - 4/7b*3 + 0. -4b(b - 1)(b + 1)2/7 Let b(n) be the first derivative of n6/3 + 22n5/5 + 18n*4 + 32n*3/3 - 64n*2 + 217. Suppose b(x) = 0. What is x? -4, 0, 1 Let d = 569/68 + -138/17. Find g, given that -3/4g*2 + 1/2 + 1/4g*4 + 1/4g*3 - dg = 0. -2, -1, 1 Let i(m) be the second derivative of m7/105 - m6/30 + m4/6 - m3/3 + 10m2 - m. Let p(o) be the first derivative of i(o). Factor p(b). 2(b - 1)*3(b + 1) Suppose 290	{ "pile_set_name": "DM Mathematics" }
k to the nearest 100000. 1500000 Let g(m) = -m*2 - 5m + 7. Suppose 0 = 2q - 4c + 22, 3 = -3q - 6c + 2c. Let j be g(q). Suppose 3k + 2880 = jk. What is k rounded to the nearest 100? 700 Let o = 348 + -144. Let s = o + -204.00000226. What is s rounded to 7 dps? -0.0000023 Let h = 13 - 6. Suppose -h = -5j + 8. Suppose -jk = 2k - 7300. What is k rounded to the nearest one hundred? 1500 Let j be (4 - 0)/(-2) - -4. Suppose -jr - 9929 = 3l + 18871, 0 = -5r - l - 72000. Round r to the nearest one thousand. -14000 Let b be -2 + -795000 - (3 - 5). What is b rounded to the nearest one hundred thousand? -800000 Suppose -5r = 2l - 12 - 25, 4l + r = 29. Let o be (-16)/(-10) + 2/5. Let b be 6753/9 - o/l. Round b to the nearest 100. 800 Let x = -166.7 + 160.756. Let w = -6.2 - x. Let v = w + 0.2. Round v to two dps. -0.06 Let x = 1.34 - 93.34. Let d = x + 9. Let g = d - -109.6. What is g rounded to zero dps? 27 Suppose z + 24390 = -h - 12593, -2z = -2h + 73958. Let b = z - 83019. Round b to the nearest one hundred thousand. -100000 Let b = -84.35 - -84. Let x = 14.716 - 14.4. Let l = x + b. What is l rounded to 2 dps? -0.03 Suppose 3z + 104686 = 24406. What is z rounded to the nearest 10000? -30000 Suppose -2x - 101 = 1023. Let h = x - 98. Round h to the nearest one hundred. -700 Let a = 1.57796 + -1.578. Round a to 5 decimal places. -0.00004 Let k = -5613.996819 - -5614. What is k rounded to 4 dps? 0.0032 Let n = 32 + -67. Round n to the nearest ten. -40 Let y = 2743 + -2687.68. Let w = y - 52. Let v = 4.2 - w. Round v to 1 decimal place. 0.9 Let m = -424 - -424.0000306. What is m rounded to 6 dps? 0.000031 Suppose -2m = -3f - 3m + 79203, -4f + 5m = -105623. Suppose s - f = 4r, -r - s - 357 = 6241. What is r rounded to the nearest 1000? -7000 Let q(i) = i*2 - 8i + 4. Let d be q(8). Suppose 4v + 0v = d. Let r be -3 - v - (2 + 10099994). Round r to the nearest 1000000. -10000000 Let j = -0.95998206 - -0.96. Round j to 6 decimal places. 0.000018 Let l = -11.2 - -13.28. Let y = l - 2. Let k = y - 0.075. What is k rounded to 3 decimal places? 0.005 Let m = -2931 + 2931.00001409. What is m rounded to six dps? 0.000014 Let t(b) = -153b - 125. Let h be t(15). What is h rounded to the nearest 100? -2400 Let n be 10/(-3)1548/(-24). Suppose 21s - 16s + n = 0. Round s to the nearest ten. -40 Let d = 113 - 114. Let g be 276/6(-12499 - (0 - d)). Round g to the nearest 10000. -580000 Let c = -0.8018894 + -8.1981176. Let z = 0 - 9. Let n = c - z. What is n rounded to 6 decimal places? -0.000007 Suppose -7h + 705482115 + 237067885 = 0. Round h to the nearest 1000000. 135000000 Suppose -218a + 230a = -2280240. What is a rounded to the nearest ten thousand? -190000 Let y = 15.069 + -43.072. Let u = -28 - y. Round u to two dps. 0 Let t = 7.24 - -1.06. Let m = t + -8.7. What is m rounded to the nearest 10? 0 Let p(m) = 3m3 - 13m*2 - 21m - 10. Let n be ((-80)/(-6))/((-2)/6). Let y = n - -30. Let q be p(y). Round q to the nearest one thousand. -4000 Let d = -1421.24 - -1392. Round d to the nearest ten. -30 Let m = 0.1541 - -906.8459. Let f = m + -905.607. Let i = -1.5 + f. What is i rounded to two dps? -0.11 Let o = 6 - 6. Suppose o = 5r - 37178 - 4072. Let w be -6r/(-4 + 1). What is w rounded to the nearest one thousand? 17000 Suppose -3352 = -7n - 13. Round n to the nearest one hundred. 500 Suppose -3m - 5a + 224660 = -14759, 0 = 5m - 2a - 399073. Let b = -19873 + 68686. Let r = m - b. What is r rounded to the nearest ten thousand? 30000 Let p = 0.02 + -17.52. Let m = -16.9519 + -0.0481. Let h = m - p. What is h rounded to 1 decimal place? 0.5 Let n = 324.9308 - 325. Let m = -0.06 - n. What is m rounded to three decimal places? 0.009 Let h = 0.7 + -10.7. Let f = 4 + h. Let u = f - -5.824. What is u rounded to two dps? -0.18 Let d = -8054479.01000268 + 8054409.01. Let a = 70 + d. Round a to 7 dps. -0.0000027 Let t = -0.409 + 0.410716. Round t to 4 dps. 0.0017 Let u = -31 - -34. Suppose -2a = -y - uy - 3928, 2a + 2932 = -3y. What is y rounded to the nearest 100? -1000 Let z = -15 + 17. Suppose -3w = 5l - 1, -l + 11 - z = 5w. Round w to 0 dps. 2 Let c = -0.32 + 0.501. Let m = c - 0.126. Round m to two dps. 0.06 Let y = 3472 + -3471.99992558. What is y rounded to six dps? 0.000074 Let t = -17.901099 - -17.9. What is t rounded to 4 decimal places? -0.0011 Let c(b) = 2b2 + 12b + 16. Let n be c(-8). Let a be -2(395/2)/((-8)/n). What is a rounded to the nearest 1000? 2000 Suppose 270000000 = -13j - 2j. What is j rounded to the nearest one million? -18000000 Let c(o) be the third derivative of 493o6/60 + o4/6 + 2o3/3 - 2o*2 + 7o. Let b be c(2). What is b rounded to the nearest one thousand? 8000 Let v = 176 + -175.998545. What is v rounded to 4 dps? 0.0015 Let u = 31116 - 61866. Round u to the nearest one thousand. -31000 Let h = 132 + -136.2. Let m = h - -4.200045. What is m rounded to five decimal places? 0.00005 Let x(o) = 5835975o2 - 124o + 5. Let p be x(-5). What is p rounded to the nearest 1000000? 146000000 Let j(h) = -48h - 14. Let f = 9 - 6. Let c be -4 - -19 - 1f. Let d be j(c). What is d rounded to the nearest 100? -600 Let b = 8.19508 + -8.2. What is b rounded to four dps? -0.0049 Let j = 38 + -34. Suppose 6 = -3o, 0 = -7c + 6c - jo + 11799992. What is c rounded to the nearest 1000000? 12000000 Let n = 0.0922887 - -60.9124113. Let a = n - 61. Round a to 3 dps. 0.005 Suppose -7c = 6c - 52. Suppose 4o - 376 = -4s, 0o + 379 = co + s. What is o rounded to the nearest 100? 100 Suppose 3v + 2p = 3p + 4, -5v - p = -20. Suppose -12f - 8f = -80. Suppose z - 1700008 = 2k, k = vz + fk - 5099988. Round z to the nearest one million. 2000000 Let d = -1642 + 1641.94339. Round d to three decimal places. -0.057 Let v = -3331.000002403 - -3331. Round v to 7 dps. -0.0000024 Let d be (-12360001)/(-6) - (-9)/(-54). Suppose 0y + 2y = -d. What is y rounded to the nearest 100000? -1000000 Let k = 505 - 807. Let j = -302.695 - k. Let a = j - -0.7. Round a to 3 decimal places. 0.005 Suppose 0 = 3x + 2z - 2505, x - 1663 = -x + z. Round x to the nearest one thousand. 1000 Let b(a) = -16477a*3 + 12a*2 - 8a - 11. Let x be b(-3). Round x to the nearest ten thousand. 450000 Suppose -202268 - 16331742 = -5q. Suppose 0 = -t + 6t - 10834010. Let j = q - t. Round j to the nearest 100000. 1100000 Let x = -106 + 106. Let m = 0.70000004 + -0.7. Let w = m + x. What is w rounded to seven decimal places? 0 Let q = -462 + -345. What is q rounded to the nearest 100? -800 Let j = -11.5464 - -11.6. Let v = j + -0.06. What is v rounded to three dps? -0.006 Let o = -0.274 + 23.244. What is o rounded to one dp? 23 Let b(j) = 7 - 8 + 1 - 1297543j2 + 3j. Let i be b(2). Let l = i - -11390166. What is l rounded to the nearest one million? 6000000 Let h = -303.99574 + 304. Round h to four decimal places. 0.0043 Let d = 551.077 - 550. Let p = -147 + 147.107. Let a = p - d. Round a to one decimal place. -1 Let l = 40.8537 + -40.9. What is l rounded to two dps? -0.05 Let s(j) = -290j2 - 11j - 11. Let q = 36 + -54. Let l = q + 27. Let p be s(l). Round p to the nearest one thousand. -24000 Let f = 12.23 - 10.46. What is f rounded to 1 decimal place? 1.8 Let l = -5.01 - -0.01. Let o = -43 - l. Let r = o - -37.99977. What is r rounded to four decimal places? -0.0002 Let v = -7829903998 - -7829904157.75266761. Let z = v + -145.9526682. Let x = z + -13.8. What is x rounded to 7 decimal places? -0.0000006 Let q = 0.321 - 0.33375. Round q to four decimal places. -0.0128 Let u = -0.00267 - -0.0037. What is u rounded to 4 dps? 0.001 Let y = -2.509 + 20.299. Let t = 18 - y. Round t to 1 dp. 0.2 Let b(u) = u*3 - 4u*2 - 5u + 3. Let t be b(5). Suppose -tf + 34663755 + 72598758 = 0. Let c = 50854171 - f. What is c rounded to the nearest 1000000? 15000000 Let j = 954.2 + -1146. Let i = j + 231.96. Let t = 39 - i. What is t rounded to 1 dp? -1.2 Let b = -5 - -5.00000448. What is b rounded to 6 dps? 0.000004 Let u be 20/30 + (-32)/(-6). Let x be (16/6)/((-4)/u). Let b be 200022/x*2. Round b to the nearest ten thousand. -20000 Let v = 841387212294787.31000302 + -841387129949328. Let x = v + -82345460. Let i = x + 0.69.	{ "pile_set_name": "DM Mathematics" }
15/4))(-1/28)/(m(-20)m(-1/13)) assuming m is positive. m(28985/1456) Simplify ((z(2/11)/((z(3/8)/z)/z))(-2/5))(-9) assuming z is positive. z(1431/220) Simplify ((pp(p6p)/ppp)/p)(-7/4)/(p(3/7)p/p5) assuming p is positive. p(-341/28) Simplify h/(h/((h(-12)h)/h))h2h*2hhh/((h/(h(-2/5)/h))/h) assuming h is positive. h(-32/5) Simplify (k/k*(2/5)k)*10k*13k(-2/11) assuming k is positive. k(317/11) Simplify (i*(-1)/ii)/(ii/i(2/35))ii(5/2)i/i(1/6) assuming i is positive. i(146/105) Simplify (q*(-8)q*(-1/4))/((qq*(-1/3))/(q/(qq*(-2/3)/q)q)) assuming q is positive. q(-25/4) Simplify ((w/w1w/(ww*(1/3))w)(9/2))(-1/50) assuming w is positive. w(-3/50) Simplify a8/a*(1/3)(a/a(4/5))/(a/(a(-20)a)) assuming a is positive. a(-182/15) Simplify (a(9/7)aa11)/(a/((a6/a)/a))(1/24) assuming a is positive. a(751/56) Simplify (q(-6))(-3/5)/(q(-22)q/(q/q(-3/7))) assuming q is positive. q(911/35) Simplify (o*(-7)o*(-1/2)o)/(o5)13 assuming o is positive. o*(-143/2) Simplify ii*0i/(i*(7/6)i)i8i/i(-18) assuming i is positive. i(161/6) Simplify (r*(1/4)r*(1/7)r(r1)(-2/3))(2/85) assuming r is positive. r(61/3570) Simplify (h(-2/11))(2/73)/((h/(h(-2/55)/h)hh)/hh(-13)) assuming h is positive. h(39984/4015) Simplify (((d/(d/(d*(-6)d))d)/dd(d(-6)/d)/d)/(d(-1/5)/d(2/15)))(-36) assuming d is positive. d420 Simplify (d(-17))29d*1d(-4/5)/d assuming d is positive. d(-2469/5) Simplify ((r*(2/3)r)(-16)/(r3r/(r(-3)/r)r))(-32) assuming r is positive. r(3424/3) Simplify (((o(-3/11)/o)/o(2/39))(-1/23))(-27) assuming o is positive. o*(-5112/3289) Simplify (u/(uu5))37(u/(u(-1/3)/u))/(u(2/45)/u) assuming u is positive. u(-8177/45) Simplify (p0)(-17/3)/(p14p*13p) assuming p is positive. p(-28) Simplify (t34/(t*16t))/(t/t25)(-21) assuming t is positive. t(-487) Simplify (b(-5))*(15/7)(b*(-3/2)/bb)/bb29 assuming b is positive. b(221/14) Simplify (x(x*(-5/3)/x)/xx)*(-2/107)(x*(1/2)x)(2/57) assuming x is positive. x(511/6099) Simplify (f*(2/3)f)(-23/4)/(f6)(-50) assuming f is positive. f(3485/12) Simplify z*2/(z((z*27zz)/zz)/z)z(-5/7)z(-5/3) assuming z is positive. z(-617/21) Simplify (h*(-12)hhhh(-33)/h)(-2/29) assuming h is positive. h(86/29) Simplify (d(-1)d)/(d/(d/(d*(-1/3)d)))(d0/dd)0 assuming d is positive. d(-2/3) Simplify ((d(1/7)/d)/d)(-1/4)/((((d/d*(2/3))/d)/d)/((dd*(1/3)d)/d)) assuming d is positive. d*(97/28) Simplify (((cc*2)/(cc(-2/7)))(-7))(-30) assuming c is positive. c480 Simplify ((jj(-3)j(2/11))/(j(-2/3)j)(-1))(-4/5) assuming j is positive. j(196/165) Simplify (u(-5/2)/(u(1/4)/u))/(u(-2/3)u)(-15) assuming u is positive. u(13/4) Simplify ((ll(2/9))/ll*(-13))/(llll4/l)(-38) assuming l is positive. l*(1937/9) Simplify (dd*(-15)/d(d/(d(d(dd/((d(-19)/d)/d))/ddddd)/d))/d)/(d/(d/d(-1/5)d)dd/d14) assuming d is positive. d(-144/5) Simplify ((s(s(2/5)s)/sss)*(-2/73)/(ss*2sss*13ss))44 assuming s is positive. s(-322696/365) Simplify g11/gg((gg/g*(-1/8))/g)/g(ggg*(3/7))/(ggg15/gg) assuming g is positive. g(-193/56) Simplify ((l/(l(-5)/l))/(ll0))/(l(-13)(l/((((ll(-8))/l)/l)/l))/l) assuming l is positive. l9 Simplify ((ll(-1/7))/l)(3/10)(l(2/11))(-48) assuming l is positive. l(-6753/770) Simplify (((h/h(-15/8))/h)/h)/h10h(2/11)/h(13/2) assuming h is positive. h(-1359/88) Simplify ((l21l(l(-15)/l)/l)(-50))(-1/13) assuming l is positive. l(250/13) Simplify (hhh*4hhh)/hhh*(-7)(hhh1)(-2/11) assuming h is positive. h(16/11) Simplify (n(-10)n(n/(nn2n))/nnn)/((n/((n/(n/(nn/(n(-1/18)/n))n))/n))/n(-3/10)) assuming n is positive. n(-506/45) Simplify (n/((n*(-12)/n)/n)nn/n15n)/((n/n*(12/13))/nnn(-27)) assuming n is positive. n(389/13) Simplify (n/(n5n)n(1/2)n(n(-1/11)/nn)/(n/n(2/5)))(-13) assuming n is positive. n(5993/110) Simplify ((((m1mm)/m)/m)/m)*(-35)(mmmm(1/4))5 assuming m is positive. m(65/4) Simplify (b(1/4)b)*16(b/((b*(1/6)b)/b))/b(2/17) assuming b is positive. b(2113/102) Simplify (d*(1/5)(d/(d/((d(d(-1)/dddd)/d)/d)))/d(d2)(1/26))(2/45) assuming d is positive. d(-94/2925) Simplify ((z(-2/21)/((zz*(3/14)z)/z))/(z/z(-2/7))(-39))(-6/5) assuming z is positive. z(-293/5) Simplify (t*3t*(-9)t*(-11)t(t/t(-4/7))/t)(-26) assuming t is positive. t(2808/7) Simplify (q/q(2/7))(-3/4)(qq(-7))/(q(-1/4)/qq) assuming q is positive. q*(-44/7) Simplify (pp/p*(-2/9)p)*(-3/31)pp(7/3)p(-4) assuming p is positive. p(-91/93) Simplify (((x(2/3))5)(1/7))(-27) assuming x is positive. x(-90/7) Simplify c(-1/13)/c*(1/2)c/(cc/(cc/(c*(-1/15)/c)c))c(-11) assuming c is positive. c(-3319/390) Simplify (l(9/4)ll5)(-2/25) assuming l is positive. l(-33/50) Simplify (i/(i/(i/(i/(i/i(-3)i)))i)i)*(-1/46)(ii/i1i)43 assuming i is positive. i(3951/46) Simplify ((u/u*(-4/7))/(uu(2/47)/u))/(u8u(-11)) assuming u is positive. u(1490/329) Simplify ((t(-6)/(t((t/t*(-2))/t)/ttt))/(t(-2/7)t/(tt/(t(t/t*5tt)/tt))))(-2/45) assuming t is positive. t(12/35) Simplify ((p(-4)/(p1/p))(-44))(-7/4) assuming p is positive. p*(-308) Simplify (((o(o/(oo(2/9)))/o)(1/12))5)39 assuming o is positive. o(-65/18) Simplify ((aa*(2/3)/aa)*(-17)(a/(a*8/a)a)/a(-4/3))34 assuming a is positive. a*(-1088) Simplify ((hh/(hh/(h(-2/9)/h))h/h8)/(h/(h(-3/2)h)(h(-4)/h)/h))(-42) assuming h is positive. h*(469/3) Simplify ((f/(f(f*5/f)/f))/ff*(-3)(f(-4)/f)/f(-5))(-43) assuming f is positive. f301 Simplify (a/a18)(-20)(a(-1)a)/a(-2) assuming a is positive. a342 Simplify (f*(-3/11)f(7/5))/((f(2/13)/f)/(ffff7)) assuming f is positive. f(8561/715) Simplify ((t/(t/t(-8/7)tt)t)/t(-13))/(t(-4/3)ttt/(t1/t)) assuming t is positive. t(193/21) Simplify (w(4/5))(6/13)/((ww(-1/14))/((w/w25w)/w)) assuming w is positive. w(-22349/910) Simplify (((hh(-1/12))/(h/(h/((h2/h)/h))h))/(h/h(-3))(-20))(-39) assuming h is positive. h(-12467/4) Simplify t(3/10)t/t*(1/16)t/t*(4/5)t(-6/13) assuming t is positive. t(203/208) Simplify tt/t(-1/11)t/t*(3/17)ttt*(-8/5)t12/t assuming t is positive. t(13384/935) Simplify (u*(3/11)u/(u(u/u(-18)u)/uu)u)/(u*18u/u(19/2)) assuming u is positive. u(-621/22) Simplify (q/(q/(q(qq/q*22q)/q)))/q((((((q/q(-3/4))/q)/q)/qq)/qq)/q)/qqq0qq7 assuming q is positive. q(-53/4) Simplify (r(-27))(-11/4)/(r(-29)(rr41r)/r) assuming r is positive. r(245/4) Simplify ((u(2/7))(-1)/(u(-1/2)u(u/(uuuuu/(uu(-8))))/uu))23 assuming u is positive. u(3289/14) Simplify ((yy(-2/13))/yy2)/((y(18/13)/y)/(y*23y)) assuming y is positive. y(331/13) Simplify g/g(2/3)g(1/2)(((g/(gggg(-8/3)/gg))/g)/ggg)(-8) assuming g is positive. g(-9/2) Simplify (hh(-5/2)/h)(40/9)h(-30)/h(-27) assuming h is positive. h(-127/9) Simplify ((t(2/23)/t)(4/3))18 assuming t is positive. t(-504/23) Simplify ((u/(u/u(-2)uu)uuu)(1/10)/(u(1/3))(-1/52))(2/45) assuming u is positive. u(-73/17550) Simplify ((tt*(-2/15))/(tt(4/3)))/(t/((t/(t/t(-9)))/t))30 assuming t is positive. t(-4972/15) Simplify g*(-1)/ggg(-8)g*(1/4)g(-1/2) assuming g is positive. g(-37/4) Simplify (((c/c3)/(c/c(1/7)))/(cc(cc/(c0/c))/c)(3/5))(-9/8) assuming c is positive. c(207/35) Simplify (((q8/qq)/(qqq/(qq(2/3)q)))/(q/((q/q*(-1))/q)q)(1/17))(-4) assuming q is positive. q(-1552/51) Simplify (((u/u(1/4))/(u(u/(u/((u/(u(3/5)u))/u)))/uu))/(uuu(1/4))32)(11/3) assuming u is positive. u(-5181/20) Simplify (((h/(((hh(-20))/h)/h))/h(2/15))(4/3))(-13/3) assuming h is positive. h**(-17056/1	{ "pile_set_name": "DM Mathematics" }
+ 8s3 + (-s2 - 5s*2 + 4s*2)(0s - 4s + 2s))(-2s2 + s2 + 2s*2). 17s*5 Expand (-1090k*2 + 5k*5 + 547k*2 + 547k*2 - 10k)(-1 - 3 + 2). -10k*5 - 8k*2 + 20k Expand 0l3 - 2l*3 + 4l*3 + (-2 + 0 - 2)(-8l3 + 0l*3 + 2l*3) + l - l + 2l*3 + 1 + 2l*3 - 1. 30l3 Expand (p2 - 5p2 + 2p*2)(-p*3 - 4p + 4p + (-5 + 5 - 2p*2)(44 - 44 - 11p)). -42p*5 Expand 3b*5 - 4b5 - b5 + (-b*3 + 2b*3 - 8b*3)(6 + 9b2 - 6) + (b2 - 5b*2 + 2b*2)(-2b3 - 2b3 + b3). -59b5 Expand (-16i - 11i + 30i + 38)(3i - i - i)(-i + i - 3i). -9i3 - 114i*2 Expand (-65 - 142u + 65)(1 + 0 + 0) - 2u + 5u - 5u. -144u Expand (-17 + 6 - 14u + 5)(-u4 + 3u4 - u4) + (-u*2 + 2u*2 + 0u*2)(-4u3 + 3u3 - u3). -16u5 - 6u*4 Expand (3a - 17a - a)(-2a2 - 6a - 2 + 18a - 9a). 30a3 - 45a*2 + 30a Expand (3f2 + 2 - 4f*2 - 2f*2)(-f + 2f - 3f). 6f3 - 4f Expand (-5f2 + 0f*2 - 16f*2)(-2 + 7 - 2)(-2 - 5 + 1) + 4f*2 - 4f*2 - 2f*2. 376f*2 Expand (-5r*2 + 8r*2 + 4r*2)(-3r3 - 12r*3 - 12r*3). -189r*5 Expand -2v2 + v3 + 2v2 + (-17v + 67 - 67)(3v - 3v + 2v*2) + (0v*2 - 2v*2 + 3v*2)(0v + v + v) + 6v3 + v3 - 3v3. -27v*3 Expand (5z*2 - 5z*2 + 5z*3)(1 + 1 - 3)(11z - z*2 - 11z) - z*5 - 3z*5 + 2z*5. 3z*5 Expand 47m*4 - 48m*4 + 36m*4 + 1 - 1 - 2m*4 + (-2m*3 + 4 - 4)(0m - 2m - m). 39m4 Expand (-4 + 3 - 1)(4 + 2 - 4)((-v + v + 2v)(2 - 4 + 4) - 5v + 0v + 4v + (v - 4v + v)(-13 - 1 + 0)). -124v Expand 2h*3 + 1 - 1 + (-h - 5h + h)(-2h*2 - 3 + 3) + 12h*3 + 4h*2 + 8h - 3h2 - 10h. 24h3 + h2 - 2h Expand (-4s + 2s - s)(-8 - 9 + 0) + (2 + 0 - 4)(3s + 2s - 4s). 49s Expand (3m + m - 3m)(-3 + 4 - 2) + (45 - 49 - 39)(-4m + 5m + 2m). -130m Expand (4r - 2r - 3r)(86 - 251 - 1497). 1662r Expand (-3i + i + 5i)(-16i3 + 4i*3 - 5i*3) + (1 - 2 + 2)(4i4 - 4 + 4). -47i*4 Expand (-3 + 12 + 2)(163m2 - 5 - 79m*2 - 81m*2). 33m*2 - 55 Expand (9 - 29 - 1 + (-4 + 2 + 0)(1 - 1 - 2) - 1 + 1 - 5)(2w - 2w - w3). 22w*3 Expand -3s*5 - 2s5 - s5 + (0s4 - s4 + 5s*4)(7s + 3 - 3). 22s*5 Expand (-6m + 5 - 5)(-22m - 32m2 + 22m). 192m3 Expand (13t - 8t + 0t)(-1 - 45 + 12). -170t Expand (130 - 21u - 130)((1 - 1 + u)(3u + u - 2u) + 12u*2 + 4u*2 - 7u*2). -231u*3 Expand (-138y - 159y + 302y + 52)(0y - 2y + y)(3 - 2y - 3). 10y*3 + 104y2 Expand (-j2 + 3j2 + 0j*2)(10j - 75j + 5j)(-1 + 1 - 4j). 480j*4 Expand (-328l*2 + 6l*4 - 4l*4 - 10l*3 + 329l*2)(0 + 4 - 3). 2l4 - 10l3 + l2 Expand (-289 + 38m + 289)(m + m - 6m)(-4m + 3m + 0m). 152m*3 Expand (115v*2 - 230v*2 - 93v*2 + (v - 2v + 0v)(3v + v - 5v))(5v*3 - 6v*3 + 3v*3). -414v*5 Expand (23s*3 + 3s*3 + 0s*3)(-7 + 2 + 3) + 0s3 + 0s*3 - 3s*3. -55s*3 Expand (0 + 0 - h)(41h3 - 136h*2 + 136h*2) + (0 + 0 + h)(-8h3 + 2h*3 + 0h*3). -47h*4 Expand (1 - 1 + 4b*3)(10 - 17 - 139b + 6). -556b*4 - 4b*3 Expand (-2 + 2 + 9d)(-20 - 7 - 9). -324d Expand (2 - 1 + 0)(-21 + 42 + 2g - 26 + (0g + 0g - g)(-1 - 1 + 7) + 3g - g - 3g). -4g - 5 Expand (0i - 3i - i + (2 - 2 - 1)(-2i + 8i + 0i) + 0i + 2i - 3i)(-2 - 1 + 2)(0 + 2 - 3). -11i Expand (-28j + 18j - 13j)(-j + 4j - 2j) - 4 + 5 + j*2 + 4. -22j*2 + 5 Expand (1 + 0b + 3b + 0b)(-14b - 38b - 15b). -201b2 - 67b Expand (-8v - 5v + 4v)(0v + 3v + 4v). -63v*2 Expand (-5 + 1 + 2)(599q3 - 16q + 1 + 17q - 6q*2 - 596q*3). -6q*3 + 12q*2 - 2q - 2 Expand (-46 - 276 - 10 - 37)(-2 - 3u + 2). 1107u Expand (1 - 1 + 2l)(-31l*3 + 229l3 + l3) + (l*3 + 2l*3 - 4l*3)(1 - 2l - 1). 400l*4 Expand (0d - 2d + d)(-3d2 + 4d2 + d2) + 2d3 + 2d*3 + 2d*3. 4d*3 Expand (-17y*2 + 6y*2 + 0y*2 + (3 - 2y - 3)(2y - 5y + y))(-4 - 1 + 4 + (-1 - 2 + 4)(2 - 2 + 4)). -21y*2 Expand (-7k + 15k + 3 - 7k)(k + k - 8k + (3k - 4k + 0k)(-4 + 2 + 4) + 1 + k - 1). -7k2 - 21k Expand f + 5f - 5f - f + 3f - f + (0 + 0 + 2)(-4f - 2f + 4f) + 2f - 5f + 4f - f + f - 2f + (2f + 2f + 4f)(-3 + 7 + 2)(-1 + 1 + 2). 93f Expand (8y*3 - 8y3 + y4 + (3y - 15y - 3y)(y*3 + 0y*3 - 3y*3))(-6 + 1 + 3). -62y4 Expand (11x - 11x + 2x*2)(9 - 8 - 4). -6x2 Expand (-40 + 40 - 14b)(-8b - 5b - 5b + 2). 252b2 - 28b Expand (3h2 - 3h*2 + 2h*3 + (0 - 2h + 0)(0h2 + h2 + h*2))(-5h + 1 - 1)(-7h + 9h - 3h). -10h*5 Expand (0n - 2n + 0n)(-3 - 6 - 3)(-4 + 59 + 24). 1896n Expand (16 - j - 20 - 22)(0j + 3j - 2j). -j2 - 26j Expand 1 - 1 + 3y3 + (-y3 - 5y*2 + 5y*2)(-2 - 4 + 5) - 2y2 + 403y*3 - 378y*3 + 0y*2. 29y*3 - 2y*2 Expand (-2i + 5i - i)(-34 + 104 + 29)(2 + 1 - 2)(3i + 2 - 2). 594i*2 Expand -2g - g + 2g + (-2 + 7 - 2)(-2g + 0 + 0) + (2 - 1 + 0)(-2g + 2g - 2g). -9g Expand (-u2 + u2 - u*2)(-2 + 4 + 1)(174u*3 - 307u*3 + 154u*3)(-4 - 3 + 5). 126u5 Expand (-1 - 1 + 5)(1 + 2 - 2)(6o*2 - 10o*2 - 2o*3 - 12o*2). -6o*3 - 48o2 Expand (-o4 + o*4 - 3o*4)(4 - 4 + o) + (-2o4 + 0o4 + o4)(o - 7 + 7) + 2o*5 - 2o*4 + 2o*4 + (3o - 4o - o)(o - o - 2o4). 2o*5 Expand (3b*2 + 2b*2 - 4b*2 + (0b - 3b + 4b)(-3b - 4b + 3b))(-75b - 68b + 113b + (4 - 1 - 1)(-5b + 5b - b)). 96b*3 Expand (480n + 43n - 160n)(-6 + 4 + 1)(0n + 4n - 3n). -363n*2 Expand (2v + v - 4v + (-1 + 1 + 1)(0v + 3v - 6v))(-19 + v + 8 + 9). -4v2 + 8v Expand t4 - t4 - t*4 + (2 - 5 + 1)(t*4 + 2t*4 - 5t*4) + 3t*4 - 5t*4 + 4t4 + t4 + 0 + 0 - t*4 + 4t*4 - 5t*4 + 3t - 2t4 + 0t*4 - t. 2t*4 + 2t Expand (1 - 1 - x*3)(-2 + 2 - x*2 + (-16x - 18x + 13x)(-4x + x + x) + 16x2 + 24x - 24x). -57x*5 Expand (7s*4 - 5s*4 + 7s*4)(8s - 7s + 6 + 8). 9s5 + 126s*4 Expand 4i4 - i4 - i*4 - 60i*4 - 4i*4 + 14i*4 + (-2i*2 + 4i*2 - 3i*2)(2i2 - i2 + i2). -50i4 Expand (-q3 - q + q + (1 + 3 - 1)(q3 + 0q*2 + 0q*2) - 3q3 - q3 + 5q3)(20 - 20 - 11q). -33q*4 Expand 57g - 18g - 20g + (-2 + g + 2)(-5 + 3 + 4) + 2 - 2 + 4g. 25g Expand -2b - 4b + 5b + (265b - 28 + 28)(3 - 3 - 1). -266b Expand (0 + 0 + 2)(-w - 8 + 8) - 3w + 7w - 16w. -14w Expand (-6d + 114189d*2 - 2 + 4d - 114273d2)(3d - d - 4d). 168d3 + 4d*2 + 4d Expand 5a2 - 5a + 5a + (-1 + 0 + 3)(9a2 - 4a*2 + 5a*2) - 2a*2 + 5a2 - a2. 27a2 Expand (n - 2 + 2 + 3)(-29 - 50 + 1). -78n - 234 Expand (4 + 12 - 6)(0d - 2d + 0d + (5 + 2 - 2)(0d + 0d + d)). 30d Expand (1 + 2t*3 - 1)(0t2 - 3t2 + t2) + 8t5 + 27t*5 + 2t*5 - 2t + 2t + t5. 34t*5 Expand 140a*2 - 140a*2 - 18a*3 + (-4a2 - a2 + 4a2)(3 + a - 3) + (-3a + 5 - 5)(-3a + 3a + 2a2) + a - a + 3a*3. -22a*3 Expand -16 + 9452j*3 + 5j*4 - 9452j*3 + (2j*2 - 4j2 + j2)(2 - 2 + 2j*2). 3j*4 - 16 Expand (c - 4c + 5c)(c*2 - 2c2 - c2) + 1092 - 1090 - 95c3 + 92c*3 + 25c*2 + 4c*3 - 4c3 - c3 + (3c + 2c*2 - 3c)(c - 2c - c). -12c3 + 25c*2 + 2 Expand ((1 + 2r - 1)(-2r - 2 + 2) + 1 - 2r2 - 1 + 0 + 0 - 4r*2)(-80 + 80 - 18r3). 180r*5 Expand (0j*3 + 0j*3 - 2j*3)(-44j2 + 26j*2 - 46j*2). 128j*5 Expand (1 + 2h - 1)(3h3 - h3 - 3h3)(-11 + 11 - 9h). 18h*5 Expand (5 + 2 - 6 - w - 5 - 3w + 5 + (1 + 0 + 0)(2w - w - 2w) - 1 + 1 - 2w)(110w - 110w + 25w*3). -175w*4 + 25w*3 Expand (-71f*3 + 45f*3 + 55f*3)((-f*2 + 3f*2 - 3f*2)(0 + 0 - 2) - 3 + 3 - f*2 + 2 + 2f2 - 2 - f2 + 4f - 4f). 58f5 Expand (-13q + q + 2q)(8 - 6 + 4)(2 - 2q - 2)(-q2 - q2 - 3q*2). -600q*4 Expand -4r + 4r - 6r*4 + (1 + 2 + 0)(-3r + r4 + 3r) + 3r4 - r4 + 6r*4 + 2r*4 - 2r*4 - 2r*4. 3r*4 Expand (-4 + 5 - 2)(466 + 14137g - 7069g - 7066g). -2g - 466 Expand (c*2 + 2c*2 - 4c*2)(3 - 6 + 0)(-3c + 2c - 8c). -27c*3	{ "pile_set_name": "DM Mathematics" }
d without replacement from fkkkkfdgkgkkuaa? 1/455 Four letters picked without replacement from dzrzddrzrrzddr. Give prob of picking 1 d and 3 r. 50/1001 Two letters picked without replacement from jpyvpj. Give prob of picking 2 j. 1/15 What is prob of picking 2 a and 1 q when three letters picked without replacement from odqrmaa? 1/35 What is prob of picking 3 s when three letters picked without replacement from {z: 1, f: 3, s: 6, x: 4, b: 1, p: 1}? 1/28 What is prob of picking 3 a and 1 e when four letters picked without replacement from yyauuuayyyyeyuuua? 1/2380 What is prob of picking 4 g when four letters picked without replacement from ggqgqgggqggggggggg? 91/204 Four letters picked without replacement from ddkkddgg. Give prob of picking 3 d and 1 g. 4/35 Two letters picked without replacement from ggxnsnyx. What is prob of picking 1 y and 1 g? 1/14 What is prob of picking 1 f, 1 k, and 2 l when four letters picked without replacement from flzlzizlzzkflf? 18/1001 Four letters picked without replacement from {s: 4, w: 10}. What is prob of picking 4 w? 30/143 Two letters picked without replacement from {e: 1, b: 2}. Give prob of picking 2 b. 1/3 Three letters picked without replacement from iiiwiwiiiiiwwiwdi. Give prob of picking 1 d, 1 i, and 1 w. 11/136 What is prob of picking 1 z and 1 h when two letters picked without replacement from zhz? 2/3 What is prob of picking 1 j and 1 u when two letters picked without replacement from ufhhrrj? 1/21 Two letters picked without replacement from obfbfoddfobofbo. Give prob of picking 1 f and 1 b. 16/105 Four letters picked without replacement from {m: 2, b: 3}. Give prob of picking 1 m and 3 b. 2/5 Calculate prob of picking 1 s and 2 r when three letters picked without replacement from {r: 1, s: 1, y: 1}. 0 What is prob of picking 2 p and 2 v when four letters picked without replacement from {v: 10, p: 4, z: 4, a: 1}? 45/646 Two letters picked without replacement from {v: 2, d: 3, k: 2, p: 5}. Give prob of picking 2 p. 5/33 Two letters picked without replacement from iiriiry. Give prob of picking 2 r. 1/21 Calculate prob of picking 1 q and 1 d when two letters picked without replacement from vvlvkvddhklq. 1/33 Two letters picked without replacement from amn. Give prob of picking 1 n and 1 a. 1/3 Calculate prob of picking 2 s when two letters picked without replacement from nsnnosnnnosoonnsn. 3/68 Two letters picked without replacement from fxfxxsjkx. Give prob of picking 1 x and 1 k. 1/9 What is prob of picking 1 j and 1 x when two letters picked without replacement from {x: 2, j: 5, y: 1, v: 7, b: 1}? 1/12 Three letters picked without replacement from hhojoonnhmmh. Give prob of picking 1 n, 1 m, and 1 o. 3/55 What is prob of picking 2 b and 1 k when three letters picked without replacement from {k: 2, b: 10}? 9/22 Three letters picked without replacement from bwvvvbbbb. Give prob of picking 1 w and 2 v. 1/28 What is prob of picking 3 p when three letters picked without replacement from vppppoppppp? 28/55 Four letters picked without replacement from {s: 3, g: 7}. Give prob of picking 1 g and 3 s. 1/30 Four letters picked without replacement from yyayayyaya. What is prob of picking 4 y? 1/14 Two letters picked without replacement from qzqqqqqqqwtqlqtqtt. Give prob of picking 1 z and 1 q. 11/153 Calculate prob of picking 3 j and 1 g when four letters picked without replacement from {j: 17, g: 1}. 2/9 What is prob of picking 1 x, 2 r, and 1 s when four letters picked without replacement from {l: 4, r: 6, e: 2, x: 4, s: 1}? 3/119 Two letters picked without replacement from tetzie. Give prob of picking 1 i and 1 e. 2/15 Four letters picked without replacement from {l: 10, x: 6, z: 4}. Give prob of picking 3 x and 1 z. 16/969 Calculate prob of picking 2 x when two letters picked without replacement from {w: 11, r: 4, x: 3}. 1/51 Three letters picked without replacement from huhoohhuoohyohyyyuh. Give prob of picking 3 y. 4/969 Two letters picked without replacement from {s: 1, k: 6, x: 10}. Give prob of picking 1 s and 1 k. 3/68 What is prob of picking 2 r and 1 i when three letters picked without replacement from {i: 6, r: 2}? 3/28 What is prob of picking 2 k when two letters picked without replacement from kekkkekkkkkkkkekkek? 35/57 Four letters picked without replacement from {r: 7, i: 3, t: 3}. What is prob of picking 2 i and 2 r? 63/715 Calculate prob of picking 1 v and 1 t when two letters picked without replacement from {v: 1, r: 16, t: 1}. 1/153 Two letters picked without replacement from ifvtwmtw. Give prob of picking 1 f and 1 v. 1/28 What is prob of picking 1 n and 1 k when two letters picked without replacement from nkkkknnnnnkk? 6/11 What is prob of picking 1 c and 1 w when two letters picked without replacement from xcxkcxwpx? 1/18 Two letters picked without replacement from mblmmmkkmmmblmbmmkv. What is prob of picking 2 m? 5/19 Two letters picked without replacement from {x: 6, j: 4, h: 1}. Give prob of picking 2 x. 3/11 What is prob of picking 1 q and 2 y when three letters picked without replacement from {q: 2, y: 8, m: 7, w: 1}? 7/102 What is prob of picking 1 m, 1 h, and 1 w when three letters picked without replacement from fwhhhlwhlshhllsmh? 7/340 What is prob of picking 1 p, 1 y, and 2 e when four letters picked without replacement from ppyyeppyyeyyypctyeey? 18/323 Four letters picked without replacement from yyyyyyyyyy. Give prob of picking 4 y. 1 Calculate prob of picking 1 n, 1 q, and 2 t when four letters picked without replacement from {g: 2, n: 2, t: 4, l: 5, q: 1}. 12/1001 Two letters picked without replacement from {a: 1, d: 2, y: 1, f: 1, b: 4}. Give prob of picking 1 a and 1 b. 1/9 What is prob of picking 1 y, 1 j, 1 h, and 1 z when four letters picked without replacement from {y: 2, j: 2, h: 2, z: 1, f: 1}? 4/35 Two letters picked without replacement from tttttvnsstsosqnnnto. Give prob of picking 1 q and 1 s. 4/171 Two letters picked without replacement from imtccfnfmfiff. Give prob of picking 1 m and 1 n. 1/39 What is prob of picking 2 w when two letters picked without replacement from wnnnnnnnnwnn? 1/66 What is prob of picking 2 v and 1 r when three letters picked without replacement from {r: 9, v: 2, n: 5}? 9/560 What is prob of picking 1 c and 1 i when two letters picked without replacement from ciceidi? 2/7 Calculate prob of picking 1 c and 1 n when two letters picked without replacement from wwwwcnnnnwwwcwwcww. 4/51 Three letters picked without replacement from kbdybydbbbbhdhd. What is prob of picking 1 y, 1 b, and 1 k? 12/455 Two letters picked without replacement from cccvvvvcvvx. What is prob of picking 1 v and 1 c? 24/55 Calculate prob of picking 2 k and 2 g when four letters picked without replacement from kwaakaggwgg. 1/55 Calculate prob of picking 1 i and 1 d when two letters picked without replacement from caiiiidcaiiaaiacdaw. 14/171 What is prob of picking 1 q and 1 o when two letters picked without replacement from {q: 1, h: 1, o: 1, m: 5, r: 1}? 1/36 Calculate prob of picking 3 c and 1 r when four letters picked without replacement from {c: 9, r: 3}. 28/55 Four letters picked without replacement from tnetnnjjtttntnnnin. What is prob of picking 2 n and 2 t? 7/51 Two letters picked without replacement from {m: 1, q: 11}. Give prob of picking 2 q. 5/6 Calculate prob of picking 2 v when two letters picked without replacement from {v: 2, i: 8}. 1/45 What is prob of picking 2 e and 1 j when three letters picked without replacement from jejjjjejejeeeejjejje? 33/95 Three letters picked without replacement from {c: 1, p: 2, m: 3, b: 6, z: 3}. What is prob of picking 2 b and 1 p? 6/91 What is prob of picking 2 h when two letters picked without replacement from xxxhxxhx? 1/28 What is prob of picking 1 e and 3 c when four letters picked without replacement from gcwglcgggccewgcgegll? 4/969 Calculate prob of picking 1 z and 1 e when two letters picked without replacement from {z: 3, e: 3}. 3/5 Two letters picked without replacement from ssibbicbbr. Give prob of picking 1 i and 1 b. 8/45 Three letters picked without replacement from {c: 5, u: 1, r: 3, i: 1, g: 4, f: 3}. What is prob of picking 1 c, 1 g, and 1 i? 1/34 Four letters picked without replacement from ssllns	{ "pile_set_name": "DM Mathematics" }
6.7 What is -84.8 less than -228822.1706? -228737.3706 Calculate 71879.3814043 + 40. 71919.3814043 Total of -101 and 198426.8304076. 198325.8304076 Calculate 550465908703 - -0.6. 550465908703.6 What is -851636 - 23516.67? -875152.67 Calculate -2946 - 606093603. -606096549 What is -18931405223 minus -1515? -18931403708 What is the distance between -40795 and 13680290? 13721085 Subtract -0.04161 from 0.3195119254. 0.3611219254 What is 16631 plus 398.164012? 17029.164012 Total of 0.18 and -182320887984. -182320887983.82 What is -29 plus -0.23346486268? -29.23346486268 Add together -0.149039 and -128.281336. -128.430375 Calculate 4.1307 + 0.67415049. 4.80485049 Sum 20823416 and -3098.7. 20820317.3 Work out -9269125.56 - -1.38939. -9269124.17061 What is 20 - 125069218499? -125069218479 Add 0.4071 and 2.030360862. 2.437460862 -0.1 - 23.910443056215 -24.010443056215 623855410.872 + -2 623855408.872 What is -0.092164455 less than -8232? -8231.907835545 Sum -1591639 and 0.69821928. -1591638.30178072 What is 767683349.1 less than -0.264? -767683349.364 Add together 14001 and -45299443873. -45299429872 Work out 390 - 453441172335. -453441171945 100801.6453 + -1029.37 99772.2753 -0.032685+41313058.3 41313058.267315 What is 0.166 plus 195316907.863? 195316908.029 Work out 0.21 + 129.033187512. 129.243187512 Calculate 0 - 356041721219. -356041721219 Add -11.6329 and 5539890.8. 5539879.1671 Work out -109043.60014 - 73. -109116.60014 What is the distance between -7030192.98 and -11229? 7018963.98 Work out -4847351.54551 - 49. -4847400.54551 Add together 1489 and 1544553011. 1544554500 Put together -0.02 and 8502986200432. 8502986200431.98 Add 2121977059 and -148. 2121976911 -4349 + 25348.7623861 20999.7623861 Add together -0.3 and 980941132108.45. 980941132108.15 What is -1 minus 239858753748? -239858753749 What is -7593055655 minus 3528? -7593059183 Sum 0.1 and -5350025181502. -5350025181501.9 What is 0.4 plus -562253346772? -562253346771.6 What is 1711 less than 496.55918? -1214.44082 What is -10.2 + 2992353387.007? 2992353376.807 -8.109+43194781 43194772.891 Put together 10.9791798419786 and -0.4. 10.5791798419786 360097.03 - 5.7446 360091.2854 Calculate -3.823206834551 + -6. -9.823206834551 Add together -4.1397 and -0.1254683402. -4.2651683402 Calculate -854.0823885 - -1. -853.0823885 What is the difference between 14671940991 and 1.11? 14671940989.89 What is 0.2 + -71450991088.69? -71450991088.49 Put together -19080.9274 and 1.052. -19079.8754 Subtract 1755.708139487 from -4. -1759.708139487 What is 1 plus 34113.26139376? 34114.26139376 Add 108.8780206922 and -3.1. 105.7780206922 What is -1417259.54184151 minus 1? -1417260.54184151 What is 372.6574083 + -390? -17.3425917 187 - -2258136.074 2258323.074 What is -2.52 plus -1655129911? -1655129913.52 What is 310 less than 8775667281? 8775666971 Add together -480525.3 and 726.7. -479798.6 Sum 17 and 469928812352. 469928812369 Put together -137538079.85 and 5329. -137532750.85 Total of -245 and -0.27910396969. -245.27910396969 -1.1693988324 - 4.4 -5.5693988324 Calculate -16589660776 + -1838. -16589662614 What is -46.11 plus -13612029.497? -13612075.607 What is -0.05 + 5280535088325? 5280535088324.95 -0.1 - 1249817.7016654 -1249817.8016654 Work out -0.43 - 693604.009. -693604.439 Work out -53571.16121 - 1.61. -53572.77121 What is the difference between -2438.001 and -2808072? 2805633.999 Sum 0.054 and 12079781422. 12079781422.054 What is 85.64817 take away 588.1? -502.45183 What is 30 + 0.6510396142161? 30.6510396142161 What is -3 take away 1050722504899? -1050722504902 Put together -5949 and 83267945910. 83267939961 Work out 20.5 - -1910005386.2. 1910005406.7 What is 4896621 take away 86398? 4810223 What is 385736848 - -3402.9? 385740250.9 What is 72358832 plus 1264.2? 72360096.2 -23.2878 - 22636.6 -22659.8878 Work out 3631.3959675 + 28. 3659.3959675 What is -39301976967737 - 0.33? -39301976967737.33 What is 1736 minus -1947145493? 1947147229 What is 65.5 minus -74.5570564897? 140.0570564897 Add -4 and 1429956985170. 1429956985166 Total of 1805276 and 0.231035. 1805276.231035 What is -12055.2601678 minus 0.1? -12055.3601678 What is -6642348.599527 take away -0.17? -6642348.429527 What is 1287956738 plus -12.9? 1287956725.1 Add -1649938924.88 and -2. -1649938926.88 What is 71 - -11186804.8045? 11186875.8045 What is 61.4082 take away -0.3958867? 61.8040867 Subtract 39496 from 12.18023. -39483.81977 Put together 1.06 and -2424604188. -2424604186.94 What is -6 less than 174417955426? 174417955432 Calculate -14 - -0.02385002799. -13.97614997201 Add -64765.80538815 and -0.1. -64765.90538815 Work out -61813.571 + -1.244. -61814.815 Work out -886021011694.5 - 1. -886021011695.5 Add -14431397135 and 0.1. -14431397134.9 Work out 255558 + -262609785. -262354227 Work out 20500854 - 10711478. 9789376 Work out -0.01 - 15.170395164. -15.180395164 Add together 0.00512383 and 0.14767679. 0.15280062 Work out 14 + 12329244966. 12329244980 Sum 1.143804828004 and 4. 5.143804828004 Add together 5.6018 and -6924894. -6924888.3982 -14867.83 + 36.8921 -14830.9379 Put together 1176.5903768 and -0.28. 1176.3103768 Subtract 21 from -1001206458.7. -1001206479.7 Add together 0.029169097 and -661. -660.970830903 Calculate 4621 + 0.048443599. 4621.048443599 What is -51088407830 minus -0.5? -51088407829.5 -7.8213178176 - 0.3 -8.1213178176 Add together 1573 and -23875.265. -22302.265 Work out -5071121951258 + -0.4. -5071121951258.4 What is the difference between -18251.2310132 and 5? 18256.2310132 -31174609 + -2418.57 -31177027.57 Calculate 3.039 - 6760795.764. -6760792.725 Subtract 0.1 from 98608879623.1. 98608879623 Calculate -593241817 - -143575. -593098242 What is 96879471.5417 minus 1? 96879470.5417 Work out 56.033 - 374879.28. -374823.247 Subtract -1454.31562572 from 2.6. 1456.91562572 What is 0.0201774578 minus -120? 120.0201774578 What is -154156953120 take away 4? -154156953124 What is -18.3587205307 + -0.024? -18.3827205307 Add -15896530944 and -83. -15896531027 Calculate -0.3 - 31192971948. -31192971948.3 What is 85730000.22 take away 163.27? 85729836.95 Work out -70387800782 - 0.06. -70387800782.06 0.033+59.3124862058 59.3454862058 Put together -0.4 and -363.27217562. -363.67217562 What is -4001271367 less than 0.112? 4001271367.112 Add together 846541197.2 and -3. 846541194.2 Calculate -3 + 114433988385739. 114433988385736 Total of -4095003.164 and -1.4. -4095004.564 -24 + 254188092.1646 254188068.1646 Calculate 38453571.9 - 2.152. 38453569.748 What is 271748 plus -7.06648? 271740.93352 5 + -13808.027705686 -13803.027705686 What is 531.022422 + -93? 438.022422 Add 1527 and 7839424003. 7839425530 Work out -29106771.2 - 0.0966. -29106771.2966 Sum -5 and 197272861766680. 197272861766675 Add 0.2172 and -140093342. -140093341.7828 1.932+68116.719 68118.651 Subtract 34828830 from -3003.8. -34831833.8 What is the difference between -103955724 and -759934? 103195790 Total of -2.7164 and 202510.53. 202507.8136 Calculate 2725 - 67145380. -67142655 Work out -8429178 - -128380. -8300798 What is -171.715848 + -6498? -6669.715848 -510456+43.5627 -510412.4373 What is the distance between 193910067.277 and 5? 193910062.277 What is 5.977251601 minus -0.6523? 6.629551601 Subtract 5234762.97994 from 4. -5234758.97994 1.69288 + -122772 -122770.30712 What is 0.6 take away -3602.53975117? 3603.13975117 Sum -9158146110 and 1065. -9158145045 What is the difference between 256 and 132187704421? 132187704165 Put together 0.8334 and -35406.048. -35405.2146 Total of -16.9 and 0.01705229029. -16.88294770971 -254.9605343 - 1.893 -256.8535343 Subtract -0.435 from 116067628192. 116067628192.435 Work out -12519659555 - -4. -12519659551 Total of -0.2 and 84130951950. 84130951949.8 Calculate 34 - 42306126652. -42306126618 Total of -10.97129915 and -0.132945. -11.10424415 Put together 0.006 and 6253081475. 6253081475.006 What is -42539 minus -20109989? 20067450 Sum -323957158372 and 5. -323957158367 -42863002848 + 0.419 -42863002847.581 Calculate 0.7584 - -100055062. 100055062.7584 What is 0.02431412407 - -0.05731? 0.08162412407 0.3523 + 1954893.5 1954893.8523 Add -7178.763 and -676727. -683905.763 Add -1090682.648 and 0.1382. -1090682.5098 Subtract 7 from -17	{ "pile_set_name": "DM Mathematics" }
-95/8? -95/8 Which is smaller: 2 or 15? 2 Which is bigger: -446 or -445? -445 Is -707 >= 20? False Which is bigger: -17585 or -17587? -17585 Is -1.4 at least -8.5? True Which is greater: 0 or -34/37? 0 Which is smaller: -591/28 or -21? -591/28 Which is bigger: 52 or 41? 52 Is 2423 less than 2423? False Is -782 <= 13? True Which is bigger: 227 or 230? 230 Are 1.6 and -14 equal? False Which is bigger: -20 or -32? -20 Are 0 and -1/167 unequal? True Which is smaller: -1 or -2/83? -1 Which is greater: 0 or -2/10223? 0 Which is smaller: 2 or 4380? 2 Which is bigger: 1 or -2/16773? 1 Is -23 at most 0.24? True Does 292/17 = 18? False Which is smaller: 738 or 1/3? 1/3 Is -202 greater than or equal to -194? False Is 1.1 at most as big as 9.66? True Which is smaller: 0 or -8/37? -8/37 Does -1427 = -1427? True Which is smaller: -7969 or -7970? -7970 Is 806 > 806? False Which is smaller: 13 or 178? 13 Are 1/30151 and -1 equal? False Which is greater: 0.04 or -31/4? 0.04 Is -1 > 1/645? False Which is greater: -0.4 or -0.76? -0.4 Is 1096 less than or equal to 1097? True Is -114/29 >= -4? True Is -1 > 1/7053? False Is -17/60 less than or equal to 0? True Is -61 >= -9? False Which is bigger: -2339/5 or -469? -2339/5 Is 3/11 >= -470? True Is -6134 smaller than -6130? True Which is bigger: 313 or 314? 314 Is 29 != -43? True Is -618 bigger than -4939/8? False Which is smaller: 36 or -19? -19 Which is greater: 1 or -12? 1 Which is smaller: 1522 or 1512? 1512 Which is smaller: -3/4181 or -1? -1 Which is smaller: 1 or 9? 1 Is -0.19 equal to 32? False Which is greater: 1/4 or 5.5? 5.5 Which is greater: -3/317 or -1? -3/317 Is -5/237 at most 1? True Is 1946 at least as big as 1946? True Which is smaller: 1/3 or -2769? -2769 Do -1 and 1/5802 have the same value? False Do -726/5 and -144 have the same value? False Which is bigger: 2/1331 or 1? 1 Is -593 at most 2? True Which is greater: -380 or 6/13? 6/13 Is -13/30 smaller than -10/7? False Is 1 greater than 76/579? True Which is bigger: 0.506 or 4/7? 4/7 Is 1/1328 != 0? True Which is bigger: 321 or 319? 321 Is -4 <= 72/31? True Which is smaller: -2432 or -3? -2432 Is 18 not equal to 0.42? True Are 1186 and 1185 unequal? True Is 587 >= 587? True Is 613/5 <= 122? False Is -508/7 < -74? False Is -3343 > -3342? False Is -243 greater than or equal to -240? False Is -1025 <= -1025? True Is -1 > 2/3175? False Which is bigger: -46 or -44? -44 Which is smaller: -2/5 or 2104? -2/5 Is 68 equal to 67? False Is 2/1139 at least as big as -1? True Which is smaller: -1/12479 or -1? -1 Is 164 at least as big as -2? True Which is smaller: 14306 or 28611/2? 28611/2 Which is smaller: 309 or 0? 0 Is -1 greater than or equal to 489/10? False Which is greater: -34/9 or -3? -3 Is -15475/3 > -5159? True Is 4525 at least 4524? True Which is bigger: -55/3 or -19? -55/3 Which is smaller: 63 or 62? 62 Which is bigger: 2263 or -1/6? 2263 Is 2/3 not equal to 5/107? True Does -27 = 0? False Which is smaller: -3 or -58? -58 Is 2/1113 not equal to 1? True Is 44 > 42? True Which is smaller: -22 or -23? -23 Is -0.05 > -15.8? True Is 0 less than or equal to 12/209? True Is -53 less than -1/6? True Which is smaller: -1 or 2/13537? -1 Which is bigger: -1 or 14/333? 14/333 Which is smaller: 14878/3 or 4959? 4959 Are -947 and -948 nonequal? True Is 62 >= 495/8? True Are 0 and 3/73 equal? False Are 1 and -20/77 non-equal? True Is -8388 < -8388? False Which is bigger: 41 or 1/302? 41 Which is smaller: -705 or -676? -705 Is 26 less than or equal to 132/5? True Which is greater: 4/9 or -4? 4/9 Which is smaller: -5912 or -5911? -5912 Do 22/5 and 1 have different values? True Which is smaller: 15 or 14? 14 Which is greater: -1 or -6/65? -6/65 Which is smaller: 41 or 26? 26 Which is bigger: -3123 or 0.3? 0.3 Which is smaller: -460 or -464? -464 Is 3 != 5/2? True Are 2 and 0.03 unequal? True Which is smaller: 1/179 or -3? -3 Which is greater: 10287 or 10289? 10289 Which is bigger: 0 or -1/28? 0 Are 538 and 538 equal? True Which is smaller: 1 or 1/307? 1/307 Which is greater: -1 or -5912? -1 Is -34 less than or equal to -869/25? False Are -8/2143 and 1 nonequal? True Is -27 at least as big as -1482/53? True Which is smaller: -462 or -3/10? -462 Does -8426 = -8426? True Which is smaller: -2/7 or -1/27094? -2/7 Which is smaller: -7/50 or 0.2? -7/50 Which is smaller: 0 or -4/105? -4/105 Is -239 greater than or equal to -0.2? False Which is bigger: -13/2 or -8? -13/2 Which is bigger: -450 or -452? -450 Is 23/16 >= 2? False Which is greater: -29 or -1? -1 Is -26 at most -26? True Which is smaller: -539/3 or -179? -539/3 Which is bigger: 24 or 4? 24 Which is greater: 0.2 or 683? 683 Is -202 equal to -1415/7? False Which is bigger: 1 or 6/1343? 1 Which is smaller: -209 or -213? -213 Which is bigger: -1291 or -1292? -1291 Which is greater: 444 or 429? 444 Is 1 less than 465? True Which is bigger: 0.13 or 2? 2 Which is smaller: -7 or -60? -60 Which is bigger: 2 or -494? 2 Is -38/45 equal to -1? False Which is bigger: -1 or -2/947? -2/947 Is 2 not equal to -153? True Is -588 at most 1/4? True Which is smaller: 884 or 883? 883 Which is bigger: 1077 or 1074? 1077 Do 9 and 17 have different values? True Which is greater: 183 or 917/5? 917/5 Are 2 and -2.97 equal? False Is -126 != -1396/11? True Is 0 < 3/20? True Is 1 > -2/43747? True Which is greater: 17/139 or -1? 17/139 Which is greater: 42 or 108? 108 Is -2089 less than or equal to -2089? True Is 747 >= 749? False Which is smaller: 261 or 265? 261 Is -16/6715 at least as big as 1? False Which is smaller: -1/4 or 0? -1/4 Is 202 < 157? False Which is smaller: 1/28 or -4? -4 Is -11 smaller than -17? False Which is bigger: -8 or 230? 230 Is -1905/8 at least as big as -239? True Which is bigger: 72 or -4? 72 Are -935/24 and -38 nonequal? True Is 390 equal to 0? False Is 1 greater than or equal to -2.08? True Which is smaller: 0.004 or 0.33? 0.004 Is 2001 less than or equal to 2001? True Is 5173 < 5172? False Which is smaller: -34 or -106/3? -106/3 Which is smaller: -8 or 106? -8 Are 155 and 155 nonequal? False Which is smaller: -599 or -596? -599 Is 35 >= 34? True Do -2 and -7/4 have the same value? False Which is greater: -1 or -52/43? -1 Is 6910 less than 6910? False Which is smaller: -3514 or 1/3? -3514 Is 267 less than or equal to 270? True Which is smaller: 43 or 2? 2 Is 2118 greater than or equal to 2118? True Is 909 less than 912? True Is 1/145 at least as big as 1? False Is -3/44 less than -7? False Are 1 and -2/25 unequal? True Which is smaller: 827 or 832? 827 Is 5 less than -71? False Which is greater: 4 or 175/67? 4 Is 273 > 273? False Is 4454 not equal to -3? True Which is smaller: -1 or 459? -1 Which is smaller: -89/47 or -2? -2 Is 1 >= 180? False Is -486 bigger than -490? True Is 1 smaller than 37.29? True Is -1 < 3/11? True Which is smaller: 3/152 or -1? -1 Is -2/17 bigger than 81? False Is 1/4 at most as big as -146? False Is -136.39 bigger than -1? False Is -45 != -269/6? True Is -69/146 bigger than -1? True Is -27 less than -25? True Is -3351 bigger than -3348? False Is -5697 != -5698? True Which is smaller: 17630 or 0.1? 0.1 Which is smaller: -0.1 or 37? -0.1 Are 1/27 and 2/183 unequal? True Are 2 and -8 non-equal? True Is -1840 < -5521/3? False Is -1 greater than or equal to 0.4? False Which is smaller: -836 or -835? -836 Which is greater: 1 or 1/886? 1 Is 438 smaller than 1? False Is -1 bigger than 1/74? False Which is smaller: -315/4 or -79? -79 Which is smaller: -338 or -673/2? -338 Is -687 bigger than -689? True Which is smaller: -212/5 or -1? -212/5 Is -0.122 less than or equal to 10? True Is -6/5 greater than -2? True Which is greater: -1112/5 or -221? -221 Which is greater: -3/133 or -1? -3/133 Which is bigger: 3846 or 1/2? 3846 Is 25 equal to 263/11? False Is 2 at least 122/47? False Which is bigger: 8322 or -1/2? 8322 Is 1/2 bigger than -5241? True Which is greater: 0 or -8/165? 0 Is 189/13 smaller than 15? True Which is bigger: 11/12 or -0.1? 11/12 Which is greater: -170 or -514/3? -170 Does 2524 = 2527? False Is 18 smaller than -65? False Do 38/289 and 0 have the same value? False Which is smaller: 1 or -3/170? -3/170 Which is smaller: 696 or -5? -5 Is -10 greater than -4? False Do -894/49 and -1	{ "pile_set_name": "DM Mathematics" }
Let f be g/(-20) - -3 - -2. Which is greater: -1 or f? f Let x = -1327 - -6612/5. Suppose -6 = t + r, -3t - 11 = -t + r. Are t and x nonequal? True Let c(x) = -x3 - 5x*2 - 6x - 2. Let d be c(-4). Let t(j) = -j*2 + 9j - 8. Let i be t(d). Suppose 3z + i = -2. Is z > -1? False Let q = 281/45 + -55/9. Let z = 49/30 - q. Which is greater: 1 or z? z Let i = -921 + 919. Which is smaller: i or -77/25? -77/25 Let l be (3-16)/((-48)/32). Let u be l/14 + 2/(-7). Is u less than 7? True Let d = -791 + 718. Is d at least as big as -73? True Let a be (140/21)/5 - 1. Let o = -164 + 242. Are o and a equal? False Suppose 0 = 8t - 494 + 558. Suppose 2o = -5g - 13 - 28, 0 = o + 4g + 28. Is t smaller than o? False Let v(l) = 30l + 137. Let a be v(-6). Is a at least -38? False Suppose 4n = 5n - 4. Suppose -v - 2k = 4, nv + k - 5 = 7. Suppose 0 = 2g - 6g - v. Which is smaller: g or 2? g Suppose 2q - 4 = -6. Suppose 4k + 0o - 16 = -4o, 1 = o. Let t be (k/9)/((-4)/15). Are q and t equal? False Let m = -4 + -7. Let f(y) = 5y + 128. Let t be f(-8). Let q be (-3)/m - 16/t. Is 0 at most q? True Let y = 53.009 + -53. Let g = 0.991 + y. Which is smaller: g or -3? -3 Let w = 4 + -74. Let j be (-20)/70 - 34/w. Which is smaller: j or 1? j Let x = -3.68 + 38.68. Which is greater: x or -2.2? x Let g be (-618)/2 - ((-3)/(-3) + -4). Is -305 equal to g? False Let u = -48 + 47. Let a be (24/(-15) + (-1)/u)-35. Are a and 20 unequal? True Let c be (1 - 4) + (-1 - -17). Suppose -c - 2 = -5w. Suppose x + 0x = w. Which is bigger: 0 or x? x Let i = -25 - -41. Suppose 0 = -c - 3c + i. Let a be c/6 - (-8)/(-12). Is 5 greater than a? True Let g = 425 - 418. Which is bigger: g or 0? g Suppose -3a - 2k - 73 = 0, -23a + k - 112 = -19a. Suppose -4z = -7 - 1. Let j be (-172)/6 - z/(-3). Which is smaller: a or j? j Suppose -b + 28 + 5 = 0. Let f be 44/b - (-112)/(-3). Let y = f - -25. Is -10 greater than y? True Let q = -5 + 5. Let z(l) = 2l*3 - 3l*2 - 7. Let k be z(3). Suppose -7r + 12r = -k. Is q at least as big as r? True Let d(p) = p2 + 5p + 4. Let x(v) = v + 9. Let u be x(-14). Let b be d(u). Let f = -6 - b. Are -11 and f unequal? True Let y(b) = -3b - 2. Let l be y(-1). Let f be (-16)/(-28)l/2. Is f smaller than 3? True Let p = -0.02 - -1.22. Let i = p + 0. Let m = 14 - 13. Is i != m? True Let q = -720/17 - -323983/7650. Which is greater: -1 or q? q Suppose -192 = -4b - 4. Suppose -b = -3s - 3z - 5, s - z - 4 = 0. Let h be 2(1 - s/2). Which is greater: -1 or h? -1 Suppose -2297 = 12d - 677. Are -136 and d unequal? True Let y = -178 + 192. Do y and -2 have the same value? False Suppose -4m + 29 = j, 4j - m + 14 = 5j. Suppose -4y - 45 = -5n, -4n - n - 4y = -45. Is n less than j? False Let w = 77 - 77.73. Let o = w + -7.77. Are o and -0.1 equal? False Let i = 13978 - 601016/43. Which is greater: 0 or i? i Let i be 2/(-3)30/(-4)2. Which is smaller: 75/8 or i? 75/8 Suppose 12 = -j + 4j. Let y be j/(-5)245/(-14). Let n be (-143)/154 + 6/y. Which is smaller: 1 or n? n Suppose 0 = -2y + 75 - 69. Let p be y/(12/(-28)) - (1 + -3). Let s be 0 + 14/(-4)1. Which is smaller: s or p? p Let a(x) be the second derivative of -x*3/6 - 6x*2 + x. Let d be a(-12). Let n = 3 - d. Is 4 at least as big as n? True Suppose -2h + 34 = -3u - 711, -2h + 5u = -735. Are h and 0.5 equal? False Suppose 2u = 117 + 11. Let o be (-7 - u) + 1 + 2. Let a = o + 478/7. Is a less than 1? True Suppose -5n = -6b + b - 15, b = -3n - 3. Which is smaller: -6 or n? -6 Let j be -38(-2 + 10884/784). Let l = -903/2 - j. Is l less than 0? False Let l(k) = k + 5. Let o be l(5). Let j be 6/(-2) + (13 - o). Let i be (-1)/2 + (-72)/176. Is i > j? False Let b be -1 - ((-5)/25)/((-3)/(-9)). Which is smaller: -3/4 or b? -3/4 Let y = -6/2452385623 - -16306601127689787/1113383072842. Let n = -14646 + y. Let s = n - 6329/4086. Is -1 greater than s? True Let z be (-4 + (-13)/(-3))0. Suppose 2m = 6 - z, -3w = -m + 87. Let b be ((-2)/(-26))/((-7)/w). Which is smaller: -1 or b? -1 Let v be 27/(-36) - (-3)/4. Let w = v - -3. Suppose 5k = wk. Is k > 1.1? False Let g = -15 - -17. Let t(m) = -m3 + m2 - 3m + 3. Let b be t(g). Suppose 3p - 5p = 4. Which is smaller: b or p? b Let k(d) = 3d3 + 16d*2 + 9d + 16. Let c be k(-5). Let z = 6 - 2. Suppose -2m - 2 - z = 0. Is m greater than c? True Let p = 30 - 19. Let b = -4 + 4.2. Which is smaller: b or p? b Suppose 2i - 5i - 93 = 0. Let k = i + 56. Which is smaller: 26 or k? k Let f(b) = 8b - 13. Let h be f(6). Let r = -36 + h. Which is greater: r or -6/11? -6/11 Let n = 2 - 2.1. Let z = 11.136 + 1.404. Let r = z - 0.54. Which is greater: r or n? r Let z(y) = -7y2 + y - 1. Let l be z(1). Let k = 1749 - 1753. Which is greater: k or l? k Suppose 0 = u + 4s + 12, -4u + 15 = -8s + 3s. Are 12/55 and u unequal? True Let x = 82 + -6. Suppose 3y = 2u - 147, -3u + 373 = 2u - 2y. Which is smaller: u or x? u Let q = 17 - 15. Suppose 0 = z - 3o + 16, z - 3o = -qz - 72. Let l be (-37)/(-7) + 8/z. Is 5 at most as big as l? True Suppose 4j - 12 = 3a, -5a - 5j - 20 = -10j. Let l be a/(-10) - (-130)/(-75). Are -1 and l unequal? True Let s = -51345/38 - -1351. Which is bigger: s or 0? 0 Let d = -5229/632 - 8/79. Is -7 equal to d? False Let m = -1309/3 - -857/2. Which is smaller: m or -8? -8 Let d = 2027 + -14191/7. Which is greater: d or 5/117? 5/117 Let q = -9514 - -28547/3. Suppose 0 = -5k + 2k + 3. Which is smaller: k or q? k Let f be 80(-3)/24/108. Are f and -4 non-equal? True Let c be (-7)/(-21)24/20. Which is smaller: c or 201? c Let b = 164.4 - 166. Which is greater: -3/4 or b? -3/4 Suppose -32g = -35g + 3a - 135, 4g = -5a - 153. Is -380/9 at least as big as g? False Let a be ((-9)/3)/((-6)/(-4)). Let h be a/(-3) - 26/(-6). Let f(q) = -q + 17. Let y be f(12). Are h and y unequal? False Suppose -3n - 15 = 2n. Let c = 118 - 1064/9. Is n bigger than c? False Let p = -77.4 + 31.4. Which is bigger: 2/21 or p? 2/21 Let z = -129 + 233. Let i = 106 - z. Is i smaller than 2? False Let z = 0.55 + -0.5. Let s = -75.95 - -73. Let i = z - s. Which is smaller: -2/3 or i? -2/3 Let o = 0 + -15. Let s be (o - -14) + (0 - 4). Is -13/3 at most as big as s? False Let r = -1257/4 - -322. Let n be (-2 - 26)193/(-386). Which is greater: n or r? r Let d = 18 - 59/4. Let z(v) = v*3 - 24v*2 + 44v + 2. Let q be z(22). Is d less than or equal to q? False Let g = 9 - 9. Let m be (20/75)/((36/15)/(-2)). Which is smaller: g or m? m Let s be (0 - 152/12)-3. Suppose -7y - 101 = -3r - 2y, 2r = -4y + s. Let w = r - 26. Are w and 2 nonequal? True Let r = -1172 + 1467. Is 294 at most as big as r? True Suppose -7l = 10l + 1020. Is -61 at most l? True Let p = -81 + 147. Let s = p + -113. Is -46 equal to s? False Suppose 60q - 754 = 47q. Is q at most 514/9? False Suppose 4c + 48 = -m, -4m - 14 - 2 = 0. Suppose 2o = 5o + 81. Let n = -38 - o. Does n = c? True Let h be (-74)/12 + -3 + (-45)/(-18). Which is smaller: -2/7 or h? h Let w be (1 - 1100/1096)426. Let y = w + -8709/2329. Let d = y + 1209/238. Are -1 and d nonequal? True Let x be 3106/24 + 20/(-16). Which is greater: 14 or x? 14 Suppose -3n = 6d - 5d - 34, d - 4n - 62 = 0. Which is smaller: 223/5 or d? 223/5 Suppose 2p - 7p = 3o - 20, 3p + 22 = 5o. Suppose 5y + 2j - 30 = 0, 3y = oj + 21 + 28. Is 6 > y? False Suppose 0 = -3v - 15 + 42. Let h be (-4)/(-8) + (-30)/(-4). Which is smaller: h or v? h Let i(r) = -58r - 105. Let c be i(6). Which is greater: -452 or c? -452 Let w(u) = -u3 - u2 - u - 1. Let h be w(-1). Suppose 4n = 5a + 28, hn - 5n + 6 = a. Is 2 greater than or equal to a? True Let y = 7 + -604. Are y and -1 unequal? True Suppose 4b = j + 12 - 5, -b + 10 = -3j. Is b < -42? False Let o be (-20)/(-6) + 442/(-102). Is -10/169 bigger than o? True Let w be (-678)/(-8)52/78. Is w < 57? True Suppose 0 = 23n - 702 - 2564. Is 140 < n? True Suppose -3r = -y + 156, 2r + 2r = 3y - 203. Let f be 3/(-6)1492/14. Let d = f - r. Is -9 smaller than d? True Suppose 0 = 11j - 0j + 11. Which is smaller: j or 519? j Let f be (8/(-2))/((-16)/12). Let r be f/1 + (8 - 12). Which is smaller: r or -4? -4 Let p(f) = 12f - 17 + 38 + 482f**2 - 48	{ "pile_set_name": "DM Mathematics" }
b(s) = 3s2 - 2s - 2. Let j(u) = b(u) - 2g(u). List the prime factors of j(-3). 23 Let b(a) be the first derivative of 3a*2 + 14a - 7. List the prime factors of b(5). 2, 11 Let v be -1 + ((-4)/(-2))/(-1). Let r be 11/(-5) - v/15. Let u(k) = -3k - 3. What are the prime factors of u(r)? 3 Let g be 1/6 + 37/(-6). Let b be g/(-2)(-8)/12. Let a = 12 + b. What are the prime factors of a? 2, 5 Let i = 15 - 22. Let a = -28 - i. Let g = 29 + a. List the prime factors of g. 2 Let a(g) be the third derivative of -g6/120 + g5/12 + 7g4/24 - 4g*2. List the prime factors of a(6). 2, 3 Let d(f) = -2f*2 - 6f + f*2 - 4f. List the prime factors of d(-7). 3, 7 Let a(d) = d*2 + 10d + 12. List the prime factors of a(-12). 2, 3 Let f(i) = i - 2. Let w be f(6). Suppose -wl - 18 = -62. Suppose -5d + 1 = -3t, -2d = -3t - 3d + l. What are the prime factors of t? 3 Suppose -11 - 58 = -5u + 3g, -2u - 2g = -18. Let w = u + -6. List the prime factors of w. 2, 3 Let p(x) = x. Let n(c) = 5c - 5. Let h(s) = n(s) - 4p(s). What are the prime factors of h(7)? 2 Suppose 0 = 2v + 5 - 1. Let z(j) = j2 + 11j + 6. Let r(o) = 3o2 + 23o + 12. Let s(l) = vr(l) + 5z(l). What are the prime factors of s(9)? 2, 3 Suppose w + 2w - 396 = 0. Suppose 0r + 4r = -5g + w, -r = 5g - 123. Suppose 0 = -4p + g. List the prime factors of p. 2, 3 Let x = -18 - -66. List the prime factors of x. 2, 3 What are the prime factors of 12/(-4)-10? 5 Suppose 3s = -0s - 6. Let p be 5 - 2/(-2)s. List the prime factors of p + -3 - -21. 2 Let g(k) = k. Let s be g(3). Let w be -3(48/(-9) + 4). Suppose 0 = wa - sz - 22, 8a - 3a - 33 = z. What are the prime factors of a? 7 Suppose 3x = -5t + 16, 10 = t - 0t + 4x. What are the prime factors of t/4(-58)/(-1)? 29 Let s(q) = -q + 12. Let j(x) = -3x - 2. Let i(l) = -l2 + l + 3. Let v be i(3). Let h be j(v). What are the prime factors of s(h)? 5 Let b(g) = 2g*3 - 5g*2 - 3g - 2. Let m be b(5). Let u = -77 + m. What are the prime factors of u? 31 Let l(c) = -c*3 - 5c*2 + 4c - 7. Let n be l(-6). Suppose -j + 1 - 4 = -2r, 6 = nr - 3j. Suppose 12 = rq + 3. List the prime factors of q. 3 Let p be (-4)/(-3)(-3)/1. Let f = p - -2. List the prime factors of (12 - 0)(f + 3). 2, 3 Suppose 3n + 12 = 0, -58 = 3j - 2n - 195. Let q(i) = -i2 + 5i + 6. Let x be q(-4). Let z = j + x. What are the prime factors of z? 13 What are the prime factors of 10 - (-2 + -2)-1? 2, 3 Suppose -4o + o = -2p + 36, 2p = -3o + 12. What are the prime factors of p? 2, 3 Let m = 9 + -4. Suppose -20 = -5d - mq, -5d + q = -2q - 20. List the prime factors of d. 2 Let b(w) = w2 + 4w + 1. Let i be b(-3). Let x be -213/i. Suppose -g - xg + 28 = 0. List the prime factors of g. 7 Let n(z) = -5z*3 - 3z*2 + 11z - 10. Let c(v) = -2v3 - 2v*2 + 5v - 5. Let t(l) = -7c(l) + 3n(l). What are the prime factors of t(4)? 13 Let l(a) be the second derivative of -a*6/720 + 7a5/60 - a4/6 + 2a. Let u(n) be the third derivative of l(n). List the prime factors of u(10). 2 Let l(a) = -a2 + 7a + 10. Let q be l(8). Suppose 22 = 4u + r, -u - r + 16 = qu. List the prime factors of u. 2, 3 Let t(k) = 10k3 + 2k*2 + 2k - 2. What are the prime factors of t(2)? 2, 3, 5 Suppose -4r + 69 = -35. Suppose 2m - 2y - 6 = 0, -4y = 5m - 7 - r. Suppose mg - 35 = -5j, 5j - 6j = 5g - 19. List the prime factors of g. 3 Let d(k) = k + 13. Let i = -3 - 4. Let r be d(i). Suppose 2l = l + r. What are the prime factors of l? 2, 3 Let z(p) be the second derivative of -3p5/20 - p4/12 + p*3/6 - 3p. Let u be z(-2). What are the prime factors of 9(-3)/u-2? 3 Let b(w) = w*3 - 4w*2 - 4w - 1. Let m be b(5). Let s = 9 - m. List the prime factors of s. 5 Suppose -3t + 5f + 64 = 0, 0t = -3t - 4f + 19. List the prime factors of t. 13 Let q be -1 + 30/3 + -1. Suppose -q = -5h + 3h. List the prime factors of h. 2 Let n be (7/2 - 1)-6. Let y = 23 + n. Suppose -y = r - 4m, 4r = -3m + 31 - 6. What are the prime factors of r? 2 Let u = -10 + 14. Suppose -ug + 20 = 0, -2c - 40 = -5g + g. Let s = c - -22. List the prime factors of s. 2, 3 Let k(r) = -3r3 - 1. Let f be k(1). Let x be 94/f(-1 + -13). List the prime factors of x/35 - (-3)/5. 2, 5 List the prime factors of ((-3)/6 + -1)76/(-6). 19 Let f = -21 + 0. Let x be (-6)/f + 52/14. Suppose xn = 2h + 4, 2h = h + 3n - 5. List the prime factors of h. 2 Let s = -7 - -10. Suppose sv = 3z - 0v - 129, -z - v + 35 = 0. What are the prime factors of z? 3, 13 Let r = 5 - 5. List the prime factors of r + 2/414. 7 Suppose -2d - d - 14 = -2b, b + 4d + 15 = 0. What are the prime factors of (0 - b) + 9/3? 2 Suppose 8z + 138 = 11z. List the prime factors of z. 2, 23 Let a(j) = j*2 + 7j. Let w be a(-7). Suppose -4k - 16 = -5c - 3, w = -k + 3c - 12. What are the prime factors of k? 3 Let p(o) = 8 + 4o + 2 - 3 - 3o. Let s be p(0). Let j = s - 3. What are the prime factors of j? 2 Suppose 2o - 5 = o. Suppose oc = 11 + 74. What are the prime factors of c? 17 Let d(k) be the first derivative of -k4/4 - 3k*3 - 4k*2 + 8k + 1. Suppose -7z - 32 = -3z. What are the prime factors of d(z)? 2 Let s(d) = -12d. Let w be -5 - -3 - (-1)/1. List the prime factors of s(w). 2, 3 Suppose y = 4y, 4y + 40 = 2i. Let j = -4 + i. What are the prime factors of j? 2 Let s(l) = l - 4. Let i be s(3). Let r be i/((-2)/(2-1)). Let k = 9 - r. List the prime factors of k. 2, 5 List the prime factors of (36/24)/(21/148). 3, 37 Let w be (-69)/21 - 8/(-28). Let y(n) = n*2 - 4n - 4. What are the prime factors of y(w)? 17 Suppose l - 6l = -340. What are the prime factors of l? 2, 17 Let a = 5 - -18. List the prime factors of a. 23 Suppose 6q - 9q = -216. List the prime factors of q. 2, 3 Let d = 29 + -41. Let c(v) = v2 + 13v + 14. Let i be c(d). Suppose -4 + 26 = if. What are the prime factors of f? 11 Let v = -39 + 20. Let q = -35 + 4. Let o = v - q. List the prime factors of o. 2, 3 What are the prime factors of 136 - (4/(-3) + 1/3)? 137 Let v = 7 - -9. What are the prime factors of v? 2 Let h(a) = 14a - 1. Let w be h(1). Suppose 3k - 109 = -w. What are the prime factors of k? 2 Suppose -2o = 2o. Let b(n) = n2 - 3n - 4. Let y be b(4). Suppose y = s - o - 9. What are the prime factors of s? 3 Let g = 7 + 20. Suppose g = -0o + 2o + 3y, -25 = -2o - 5y. Suppose t - 5 = o. List the prime factors of t. 2, 5 Suppose 2d - 667 = -81. List the prime factors of d. 293 Suppose 0 = -4b + 29 - 5. Let j(t) = t2 - 4t - 3. List the prime factors of j(b). 3 Let f = 1491 - 1021. Let d be 1/(-5) - f/25. Let m = d + 33. List the prime factors of m. 2, 7 Let g(r) = r - 3. Let y(n) = -n + 3. Let d(j) = -3g(j) - 2y(j). Let f be d(-4). Suppose 5l - fl + 4 = 0. What are the prime factors of l? 2 Let m(u) = 14u2 - 5u - 8. List the prime factors of m(-3). 7, 19 What are the prime factors of (-14)/(-4)(7 + -1)? 3, 7 Suppose -4a = u + 3, -4a + 7a = -3u - 9. Suppose -l + al = -3. What are the prime factors of l? 3 Let b be (2 - -1) + -2 - -3. Suppose bw + h = 2h + 47, 0 = -4w - 2h + 50. List the prime factors of w. 2, 3 Suppose s - 2t = 10, 3t - 4t = s + 5. Let n = s - -4. Suppose 0 = -ng + 5w - 5 - 7, 0 = -3g + 2w - 2. List the prime factors of g. 2 Let i = -308 - -431. List the prime factors of i. 3, 41 Suppose -3r - 135 = -3m, 3r = -2r - 5. Let c = -23 + m. List the prime factors of c. 3, 7 Suppose 5 = 5j - 10. Suppose 0 = jc + 3n - 18, 0 = 4c - 0n + 2n - 16. List the prime factors of c. 2 Suppose f = t - 17, 0 = -0t - 3t - f + 51. List the prime factors of t. 17 Let v = 0 + 3. Suppose -3j = -5i - j - 33, -vi - 4j + 1 = 0. What are the prime factors of -3(2 + i)1? 3 Let l = 1 - -3. Let c be l/22 - (-786)/33. Suppose -6o + c = -2o. List the prime factors of o. 2, 3 Let w be (-16)/(-6) - (-2)/6. Suppose 5m + wp - 4 = 0, -4p = 2m + 2m - 8. List the prime factors of ((-9)/(-3) - 26)/m. 23 Let d = -5 - -8. What are the prime factors of 33/d + 1-3? 2 Suppose -3u + 160 = 2u. What are the prime factors of u? 2 Suppose 0 = -2w - 2y + 28, 0 = 5w - y - 9 - 31. Let b = w + -5. What are the prime factors of b? 2 Let j = 411 +	{ "pile_set_name": "DM Mathematics" }
-13k(u) - 6n(u). Give q(3). 4 Let s be (0 - 3/(-4))4. Let p(o) = 87o*3 - 1 + 2o*2 - 2 + 92o*3 - 180o*3. Give p(s). -12 Suppose -3 + 13 = r - 3d, -20 = 3r + d. Let l(f) = -f - 12. What is l(r)? -7 Let u(j) be the third derivative of -j5/120 + 11j4/24 + j3/6 - 5j2. Let z(o) be the first derivative of u(o). What is z(5)? 6 Let i = 2 + -2. Let z(r) be the third derivative of 0 + 0r5 + r2 + 0r - 1/24r*4 + 1/3r*3 - 1/120r*6. Calculate z(i). 2 Let z(i) = -8i + 4. Let q(v) = -8v + 3. Let a(y) = -3q(y) + 2z(y). Suppose -7k = -3 - 4. What is a(k)? 7 Let m(k) = -k*2 - 4k + 4. Let z be (-2)/6 + 110/33. Suppose 19 = 4l + z, -4l = -3g - 31. Calculate m(g). -1 Suppose -24 = -8b + 8. Let c(z) = -z - 3. Let t be c(-6). Let j(d) = -d*2 + d + td - d - 3. Give j(b). -7 Let r = -1 - -7. Let f(h) = 7h2 + h + 4. Let k(b) = 20b*2 + 2b + 11. Let l(w) = -17f(w) + 6k(w). Give l(r). 4 Let h be ((0/3)/(-3))/2. Suppose -5a = -5 - h. Let g(z) = 2z*3 + 1 - 2z*2 + 5z*3 + 0z*2. What is g(a)? 6 Let u = 5 - 1. Let c(z) = 0z + 6z - 3 - 5z. What is c(u)? 1 Suppose 0 = -0g + 4g - 3c + 3, 0 = -c + 5. Let o(b) = -b2 + 2b - b + g + 0b2. Suppose 5z = 5n + 20, 3n = -4z + 2n - 4. What is o(z)? 3 Let j(d) = -5d2 + 5. Let h(x) = x2 - x. Let a(i) = 6h(i) + j(i). Let r be a(6). Let s(b) = -6 + 2b - 2b + b. Give s(r). -1 Let q = 9 + -7. Let i be 2 + 1 - (-1 + q). Let p(x) = 2 - 3xi - 3x + 0x + 2x*2 + 8x. What is p(6)? -4 Suppose 4g + 2h + 2h - 4 = 0, 2h = 10. Let r(o) = -o*3 - 5o*2 - 6o - 1. What is r(g)? 7 Let n(k) be the third derivative of -k4/24 + k3/6 + k2. Let x be n(-4). Let d(u) = -u3 + 4u2 + 6u - 7. Give d(x). -2 Let g be 2/(4 + (-36)/8). Let t(z) = 5z2 + z - 3. Let u(m) = -6m*2 + 4. Let a(v) = 5t(v) + 4u(v). What is a(g)? -3 Let w(i) be the second derivative of -i3/6 - 3i*2/2 + 40i. Give w(3). -6 Let d(w) = -w*2 - 3w + 5. Let y be -2 - -411. Suppose 5z + 4m + 32 = 0, z = yz + m + 7. Calculate d(z). 1 Let q(b) = b2 + 5b + 3. Let o be (2/(-4))/((-2)/(-24)). Let m = -12 - o. Let r be (-16)/6(-9)/m. Calculate q(r). -1 Suppose -q = 5u - 1 - 6, q - 2u = 0. Let z(c) = -c2 + 4c - c*q + 0c2. Determine z(3). -6 Let j(f) = f3 + f*2 + f + 1. Let o(a) = 3a*3 + 8a*2 + 10a - 2. Let g(d) = -4j(d) + o(d). Give g(5). -1 Suppose -3q - 5m - 33 = -3, 0 = -2q + 3m - 20. Let x(u) = u + 5. Calculate x(q). -5 Let q(z) = -z3 + 12z*2 + 13z + 10. Let l be q(13). Suppose -9d + 3 = -ld. Let x(b) be the third derivative of -b*4/8 - 2b3/3 - b2. Determine x(d). 5 Let m = 107 + -109. Let o(i) = -i + 2. Give o(m). 4 Let r(h) = -2h2 + 6h + 6. Suppose -o = o - 10. What is r(o)? -14 Let f be 6/(-27) - (-2)/9. Suppose fu + 6 = 2u. Let v(y) = y + uy - 7y. What is v(2)? -6 Let w(i) = 3i + 1. Let x = 5 - 4. Let o be x(-6 + -1 - -1). Let q = o - -4. Give w(q). -5 Let v(z) be the first derivative of -9z4/4 + z3/3 + z2/2 - 1. Let d = 7 - 5. Let h(f) = -f2 + f + 1. Let m be h(d). Determine v(m). 9 Let r(g) be the first derivative of -g4/4 + g2/2 - g + 1. Suppose 12 = i - 2o, -i - 2o + 1 - 9 = 0. Calculate r(i). -7 Let h(f) be the second derivative of -f6/60 + f5/60 - 3f*2 + f. Let d(t) be the first derivative of h(t). Give d(1). -1 Let b(g) = -7g + 1. Let r(q) = 36q - 4. Let d(t) = 11b(t) + 2r(t). Let x = -2 - -2. Suppose 4c - 4f = x, -c - 4f + 3 = -7. Determine d(c). -7 Let t be -3 - (3 - 6 - 0). Let y(x) be the third derivative of 0 - 2x2 - 1/24x*4 + tx*3 + 0x + 1/60x5. Give y(0). 0 Let v(m) = 5m*2 + 2 + 2m - 3m2 + m3 + m2. Let r = -20 - -17. Give v(r). -4 Let j(h) = -h2 - 4h + 2. Let x(y) = -1. Let o(g) = -j(g) - 6x(g). Calculate o(-3). 1 Let s(j) = -j3 + 4j*2 - 2j - 3. Let o(a) = 9 + 0 + 3a + 1 - 4a. Let v be o(7). Calculate s(v). 0 Let a(s) = -s3 + s2 + s + 1. Let r(z) = -4z3 + 11z. Let v(m) = 5a(m) - r(m). Let t be 3(0 + 8/6). Let b be v(t). Let h(y) = -y + 1. Determine h(b). 4 Let k(c) be the third derivative of -c6/180 + c5/40 - c*4/12 - 2c*3/3 - 3c*2. Let p(j) be the first derivative of k(j). Calculate p(2). -4 Let n be ((-2)/14)/(36/(-21)). Let b(d) be the second derivative of nd*4 + 0 - 2/3d3 + d2 - d. Determine b(5). 7 Suppose -2b + 2z + 3 = 5, -11 = -b - 5z. Let s(n) be the second derivative of -3n5/5 + n4/12 - n3/6 + n2/2 + 2n - 5. Determine s(b). -11 Let j(f) be the second derivative of -f4/12 + 2f*3/3 - 3f*2/2 + 9f. Let g be 0 + (-1 - -7) - 2. Determine j(g). -3 Let d(c) = c + 2. Let y = 2 - 1. Let t be -1 + (-2)/1 + y. Let k be (t1 + -1)1. Give d(k). -1 Let p(r) = r*3 + 6r*2 + 4r - 5. Let f be (-80)/(-30) - (-2)/6. Suppose fi + 0i + 15 = 0. Calculate p(i). 0 Let g(r) = r. Let x(f) = 5f. Let i(q) = 6g(q) - x(q). What is i(-1)? -1 Let v(a) = a*3 - 5a*2 - 5a + 3. Suppose 0 = -3x + 18 - 3. Suppose w - 2 = -5, -xw = -2k + 27. Determine v(k). 9 Let u = -8 - -5. Let f(v) = 10v + 2. Let r(c) = -4c. Let i(p) = f(p) + 2r(p). Give i(u). -4 Let b(z) = -z*2 - 18. Suppose -3 + 7 = w - k, -20 = 5k. Give b(w). -18 Let r(d) = -d + 11. Let m be r(7). Let a(k) = k + k*2 + 5k + 3 + m. Calculate a(-5). 2 Let g(u) = -u*3 - 2u*2 - 4u - 3. Suppose 0 = -5j + 3 - 18. Calculate g(j). 18 Let d(z) be the first derivative of z2/2 + 11z - 6. Calculate d(-5). 6 Let z(i) = 12i + 1084i*2 - 2 - 5i - 1085i2. Give z(8). -10 Let u be (-3)/9 + (-4)/6. Let w(q) = 8q2 - q - 1. What is w(u)? 8 Let g(n) = -n3 - 5n2 - 6n - 5. Let r(i) = 4i. Let x be r(4). Suppose 0u - x = 4u. Give g(u). 3 Let l = -2 - -27. Suppose 0 = -0t + 5t + l. Let j(y) = 3 + 3y + y2 - 5 + y. Give j(t). 3 Let j(n) = -n2 - 8n - 6. Suppose u = -4w - 34, -8w - 36 = -3w - 2u. Give j(w). -6 Let b(j) be the first derivative of j5/60 - j4/24 - j2/2 + 2. Let p(z) be the second derivative of b(z). Suppose -3 - 3 = -2l. Give p(l). 6 Let z(f) = -f3 + f2 + 1. Let a(b) = 6b3 - 8b*2 - 3b - 6. Let t(p) = a(p) + 5z(p). What is t(4)? 3 Let c = 42 + -43. Let d(b) = -8b*2 - b - 1. Calculate d(c). -8 Let q(m) = -2m - 26. Let t be q(-14). Let v(y) be the first derivative of y - 1/3y3 - 1 - ty*2. What is v(-4)? 1 Let w(s) = -2s*3 + 1. Suppose 0 = -11x - 22 - 0. Determine w(x). 17 Let f = 17 - 22. Let b(h) = h*2 - 3h - 10. Let g(n) = n*2 - 4n - 11. Let s(i) = 7b(i) - 6g(i). Give s(f). 6 Let h(z) = -6z2 + 3z + 7z2 - 2z*2 - 1. Calculate h(2). 1 Let w = -12 - -12. Let y(c) = c + 3 + 1 + w. Determine y(-3). 1 Suppose 5r + 5 = -3a + 2, 4r + 3 = -3a. Let b(l) be the second derivative of l - 1/2l*2 - 1/12l*4 + r - 1/2l*3. Calculate b(-4). -5 Suppose -10 = -3q - 2f, -3q + 8q - 2f - 38 = 0. Let o(v) = v*3 - 7v*2 + 8v - 2. Determine o(q). 10 Let t(y) be the third derivative of -y8/6720 + y7/2520 - y6/720 + y5/60 - y4/8 - y2. Let u(k) be the second derivative of t(k). Determine u(2). -4 Let x(o) = -o2 + o + 7. Let f be x(4). Let z(a) = -a3 - 4a2 + 6a + 3. Calculate z(f). -2 Let b = 5 + 0. Let n(f) = f3 - f2 - f. Let g = 4 + 2. Let r(k) = 7k3 - 11k*2 - 5k - 3. Let x(m) = gn(m) - r(m). Give x(b). -2 Let l(s) be the first derivative of -s4/2 - s3 - s2 - 35. What is l(-2)? 8 Let h(f) = -3f*2 + 6f*2 + 2f3 - f3 + 3f + 2. Calculate h(-2). 0 Let i(s) = 2s + 2. Suppose 3y - 9 = 0, 10m = 5m + 5y. Determine i(m). 8 Let g be 2(-2 + 1)-1. Suppose 12 = 2p + 2q, -q - 4q - 12 = -2p. Let o(a) = 26 - pa2 + ag - 31 + 4a + a*3. Calculate o(4). -5 Suppose -2p - 9 = -o, 0 = 3p - 8p - 2o - 9. Let r(g) = -3g*2 + 4g + 7. Let a(u) = 2u2 - 4u - 6. Let q(h) = 4a(h) + 3r(h). Determine q(p). 0 Let q(i) = -2i2 + 3i + 4. Let w(h) = -h*2 + 2h + 2. Let d(y) = 3q(y) - 7w(y). Give d(4). -6 Let v(f) be the second derivative of -f4/12 + f3/2 - 5f2/2 + 2f. Let k(u) = -u*2 + 2u - 5. Let t(n) = 6k(n) - 5v(n). Let y = -4 + 0. What is t(y)? -9 Suppose -10 = 4g - 126. Let h = -13 + g. Suppose -5r = -r + h. Let z(k) = -k*2 - 6k - 2. Determine z(r). 6 Let r(b) = 10 - 3b2 - b3 + 3b*2 - b - 17. Suppose 0 = l - 2 - 1. Suppose 0v = -l*v. What	{ "pile_set_name": "DM Mathematics" }
= -4m, a + 0a + 4m = 12. Let l(k) = 2k*2 - 2. Let j(r) = ac(r) + zl(r). Differentiate j(g) wrt g. -4g Let u(c) be the third derivative of 0c5 - 1/12c*6 + 0c*3 + 0 + 0c - 1/3c4 - 9c*2. What is the second derivative of u(y) wrt y? -60y Let q(d) be the third derivative of 0d + 0 + 1/60d*6 + 0d*5 - 3d*2 + 1/24d*4 + 0d*3. Find the second derivative of q(s) wrt s. 12s Let y(w) = -8w3 - 3w*2 + w + 3. Let s(o) = -16o*3 - 5o*2 + 2o + 5. Let d(n) = 6s(n) - 10y(n). What is the second derivative of d(r) wrt r? -96r Differentiate 2 - 4t - 3 + 15 with respect to t. -4 Differentiate 51 - 40 + 10q4 - 36q*4 with respect to q. -104q3 Let n(m) be the first derivative of -m2 - 5 - 4/3m3 + 0m. Find the second derivative of n(r) wrt r. -8 Let g(d) = 23d4 - 3d*3 - 3d*2 - 3d - 18. Let i(j) = 23j4 - 4j*3 - 4j*2 - 4j - 19. Let y(z) = -4g(z) + 3i(z). Differentiate y(f) wrt f. -92f3 Suppose 5f - 1 = 3m + 7, 4m - f = 12. Let d(x) = -2x3 - 2x*2 + 3x + 2. Let w be d(-2). What is the second derivative of w - o - 2om - 4 wrt o? -24o*2 Suppose 4y = -3w + 29, -y = -w - 4w + 10. Suppose -i = 4k, -yk = -4i - 0k + 21. Find the second derivative of 4 - 4 - j*i + 2j wrt j. -12j2 Let k(g) be the second derivative of 2/15g*6 + 0g*2 + 0g*4 - 6g - 2/3g3 + 0 + 0g*5. What is the second derivative of k(n) wrt n? 48n*2 Let w(p) = -25p*3 - 9p - 40. Let b(f) = 6f3 + 2f + 10. Let g(v) = -9b(v) - 2w(v). What is the derivative of g(d) wrt d? -12d2 Let j(d) be the first derivative of -2d*7/7 - 14d*3/3 + 1. What is the third derivative of j(u) wrt u? -240u*3 Let z = -3 + 7. Let h = 8 - 3. What is the derivative of zo + ho - 4o - 4o + 3 wrt o? 1 Let z(a) be the second derivative of -a4/2 + 12a*2 + 3a. What is the derivative of z(x) wrt x? -12x Let h(t) = 22t*4 + 2t*3 - 15t - 2. Let z(b) = -b*3 + 1. Let x(p) = h(p) + 2z(p). Find the second derivative of x(s) wrt s. 264s2 Let c(n) be the second derivative of 0n*3 + 0 + 1/3n*4 - 4n + 3n2. Differentiate c(v) wrt v. 8v Let p be (-11 - -13) + (-1 - -3). Find the third derivative of 2t5 + t2 + 5t*5 + pt - 4t wrt t. 420t*2 What is the third derivative of 12s*5 + 0s*2 + 3s*2 + 6s*2 + 12s*5 wrt s? 1440s*2 Let d(g) = -7g*3 - 2g + 3. Let f(w) = -22w3 - 7w + 9. Let n(y) = 7d(y) - 2f(y). Differentiate n(o) with respect to o. -15o2 Let x(r) be the second derivative of 0r*2 + 0r*4 - 1/20r*5 - 2r + 1/3r3 + 0. Find the second derivative of x(w) wrt w. -6w Suppose 5 = -l + 10. Find the second derivative of -3u5 - u - 3u*l + 4u*5 wrt u. -40u*3 Let k(m) be the first derivative of 0m*5 + 5 + 3m*2 + 0m - 4/3m6 + 0m*3 + 0m*4. What is the second derivative of k(o) wrt o? -160o3 Let p(v) = v2 - v. Let i(d) = 8d3 + 6d*2 - 3d. Let q(f) = -i(f) + 6p(f). What is the second derivative of q(o) wrt o? -48o Let y be (-1)/(7/2)-7. Let j be 2/3(-9)/(-3). What is the first derivative of 2zj - 3z*y + 2 - 2z*2 - 1 wrt z? -6z Suppose -m + 24 = n - 5n, -4m + 72 = -4n. Suppose 2l - 3t + 7 = 23, -4l + 2t = -m. Find the second derivative of 17i*4 - 2i - li5 - 17i*4 wrt i. -40i3 Let f(s) be the first derivative of -s8/14 - s*4/12 + s - 3. Let z(p) be the first derivative of f(p). Find the third derivative of z(h) wrt h. -480h*3 Let g(m) = -8m*3 - 6m*2 + 18m + 6. Let z(l) = l3 + l2 - l - 1. Let i(t) = g(t) + 6z(t). What is the second derivative of i(a) wrt a? -12a Suppose -8x + 6x + 6 = 0. Find the first derivative of -4 + 0 + 9 - r*x wrt r. -3r*2 Suppose -2l = 2m + 6, -3m - l + 2 = 1. What is the derivative of 3 + f*2 - 3f2 + f2 - mf2 wrt f? -6f Let j(p) be the second derivative of p8/28 + p5/20 - 53p4/12 - 56p - 2. What is the third derivative of j(b) wrt b? 240b3 + 6 What is the third derivative of 33x*2 + 56x*3 - 2x*6 - 42x*3 + 24x*3 wrt x? -240x3 + 228 Let u(g) = g3 + g2. Let d(r) = -r2 - r. Let z(j) = -4d(j) - 4u(j). What is the second derivative of z(h) wrt h? -24h Suppose s + 4 = -u, 5u - 7 = -4s + 8s. Let y = 5 + s. What is the third derivative of yb2 - b4 - 2b*4 + 0b*4 wrt b? -72b Let q(j) be the third derivative of 0j - 1/10j*5 - 5/24j*4 + 0 - 4j*2 + 0j*3. Find the second derivative of q(r) wrt r. -12 Suppose -4i - 3c + 6c = -41, 0 = 2i + 5c - 1. Let x be i/20 + 13/5. Find the first derivative of -8 + 4 + 4w3 - 5w*x wrt w. -3w*2 Let x be (-4)/(22/(-18)). Let r be (-1 + 8)x/21. What is the first derivative of -r + 7 + 3w - 2w wrt w? 1 Let r(w) be the second derivative of 41w*6/30 - 5w*3/3 + 3w. Find the second derivative of r(n) wrt n. 492n2 Let n(o) be the third derivative of -8o*2 + 0o*5 + 0 + 0o*4 + 0o - 3/2o3 + 1/24o*6. Differentiate n(q) wrt q. 15q*2 Let y(z) be the second derivative of -z + 0 + 0z*3 + 0z*2 + 1/20z*5 - 1/3z*4. Find the third derivative of y(m) wrt m. 6 Let m(c) = -5c*2 + 21 - 6c*2 - 10c*2. Let f(j) = -5j*2 + 5. Let v(q) = -18f(q) + 4m(q). Find the first derivative of v(l) wrt l. 12l Let k(p) be the third derivative of p6/180 - p5/30 - p*3/2 + 2p*2. Let s(q) be the first derivative of k(q). What is the second derivative of s(v) wrt v? 4 Let z be 2/(-7) + 74/14. What is the first derivative of -10l*3 + 18l*3 - 8l*3 + zl*4 + 3 wrt l? 20l*3 Let h = -3 + 5. Find the third derivative of -8r*6 + 4r6 - rh - r*2 wrt r. -480r*3 Let m(s) be the second derivative of 4s*6/5 + 9s*2 + 27s. What is the derivative of m(o) wrt o? 96o3 Find the third derivative of 17f*2 + 97f*3 - 97f*3 - 12f*4 wrt f. -288f Let d(r) be the third derivative of -r*9/504 - 23r5/20 + r2 - 4. Find the third derivative of d(v) wrt v. -120v3 Let v(t) be the first derivative of -t7/420 - t5/60 - 2t*3/3 + 2. Let p(u) be the third derivative of v(u). Find the second derivative of p(b) wrt b. -12b Let r(b) be the second derivative of -b6/120 - b4/12 - 3b2/2 + b. Let k(h) be the first derivative of r(h). Find the second derivative of k(f) wrt f. -6f Suppose -r + 24 = -6. Suppose -4v + 0 = -o + 6, -r = -5o - 3v. What is the second derivative of -2b - 6b2 - b3 + ob*2 wrt b? -6b Let f = 28 + -25. Find the second derivative of j*4 + 4j3 - j3 - fj3 - 3j wrt j. 12j2 Let p(w) be the second derivative of 1/12w*4 + 0w*7 + 0w*3 + w + 0w*6 + 0w*5 + 1/56w*8 + 0 + 0w*2. Find the third derivative of p(b) wrt b. 120b*3 Let n = 4 - 7. Let l(q) = -9q*4 - 4q*2 - 1. Let y(c) = 9c*4 + 3c*2 + 2. Let x(p) = nl(p) - 4y(p). Differentiate x(v) wrt v. -36v3 Let p(t) = -t3 + t. Let i(r) = 3r3 + 4r*2 - 6r. Let n(a) = i(a) + 6p(a). What is the third derivative of n(k) wrt k? -18 Find the third derivative of -s2 + 6s*2 + 2s*3 - 2s*3 + 12s*4 wrt s. 288s What is the first derivative of -496c4 - 17 - 10 - c + 532c*4 wrt c? 144c*3 - 1 What is the third derivative of -12z*2 - 5z*3 + 6z*2 - 2z*3 wrt z? -42 Let b be -3(-4 + -3 + 6). What is the third derivative of 61w - 7w*b - 61w - 2w2 wrt w? -42 Let a(o) be the first derivative of -16o*5/5 - 13o*3/3 - 7. What is the third derivative of a(q) wrt q? -384q Suppose 0 = -0x + 3x. Let h = 3 - x. What is the second derivative of 2i3 - 4i3 + ih - 2i wrt i? -6i Let r = 5 + -3. Let c(y) = -y + 4. Let i be c(2). What is the third derivative of -v*2 - iv5 - vr + 0v5 wrt v? -120v2 Let u(i) be the third derivative of -i6/72 - i*5/30 - 2i*3/3 - 3i2. Let m(p) be the first derivative of u(p). Find the second derivative of m(z) wrt z. -10 Let m(x) be the first derivative of x6/2 - 5x3/3 + 2. Find the third derivative of m(g) wrt g. 180g*2 Let v(y) = -10y*2 - 17y + 11. Let h(d) = -5d2 - 9d + 6. Let i(u) = 11h(u) - 6v(u). What is the second derivative of i(t) wrt t? 10 What is the second derivative of -28k2 - 27k - 30k2 + 58k*2 + 15k*4 wrt k? 180k*2 Let w be 39/9 + (-2)/6. Suppose 0 = 4v - wn - 24, -2v - 7 = 5n + 9. Find the third derivative of 0g - vg3 + 2g	{ "pile_set_name": "DM Mathematics" }
t? False Is (-3678)/(-16) - ((-115)/(-40) - 3) a multiple of 23? True Let x = 1 - 1. Suppose 3r - 4o - 3 = x, -3o - 7 = -2r - 2o. Suppose -5b = -3n + 34, 3n - b = -rb + 16. Does 8 divide n? True Let s = 32 - 61. Let c = s + 62. Does 11 divide c? True Suppose 3 = 2v - 2t + 1, v + 3t - 1 = 0. Does 8 divide (136/16)/(v/2)? False Suppose 4 = -3j + 2m + 8, 0 = 3j + 2m + 4. Suppose -6 = -2d + c - jc, 5c - 40 = -4d. Suppose -3l - 2v + 9 = -dv, 5l + 2v = 15. Is 2 a factor of l? False Let m be 4(2 - 1)/1. Suppose -6 - 14 = -2s - 4g, 2g + 6 = 0. Suppose 4o = 8, q - mo - s = o. Is 14 a factor of q? False Is ((-4)/5)/(13/(-390)) a multiple of 4? True Let k = 20 - -63. Suppose -7t + 2t - z = -k, -4t - z + 66 = 0. Is 14 a factor of t? False Is ((-2)/6)/(3 - (-1028)/(-342)) a multiple of 19? True Suppose 5f = 7f - 4. Suppose -fa + 2g + 12 = 0, 2a - 7a = 3g - 30. Suppose m = am - 290. Is m a multiple of 17? False Suppose -4a = 0, 3o - o - 8 = -a. Suppose 14 = i + o. Let m = 14 - i. Is m a multiple of 2? True Let i be (-5)/10(-3 + -1). Suppose 0v = iv - 56. Does 14 divide v? True Suppose 3t - 3m = -m - 71, -4t + 4m - 100 = 0. Let c be t/(-6) + (-4)/(-8). Does 13 divide ((-39)/4)/(c/(-16))? True Suppose -3 = 2o - 23. Let h be (-3)/6 - o/(-4). Suppose g + j = 26, g - j = 16 + h. Is g a multiple of 11? True Suppose 5v + 148 = 4s, 5v = 5s - 2s - 116. Let o be (7/(-4))/((-4)/s). Suppose -3y - l + o = l, -3l + 19 = 4y. Is 3 a factor of y? False Let h(a) = 15a - 2. Let g be h(2). Let p = g - 44. Is 5 a factor of (15/4)/((-6)/p)? True Suppose 0 = -a - 4a - 30. Let v be a/15 + 2/5. Suppose r = -h + 21, v = 3r - 2h - 2h - 70. Is r a multiple of 9? False Suppose 7 = -s + m + 3, -4s = -5m + 19. Is (s + (-23)/4)-4 a multiple of 9? True Let y(h) = -5h + 156. Is 39 a factor of y(0)? True Is (-1 + 0)1-14 a multiple of 7? True Let w(r) = 3r*2 + 5r - 1. Let t = -15 - -11. Does 7 divide w(t)? False Let j = -34 - 2. Let g = 62 + j. Suppose -g = -3l + x, -3l - 2x = 2l - 25. Is l a multiple of 7? True Suppose 5n = -7 - 3. Let f = 24 + -12. Is 5 a factor of n/(-8) + 93/f? False Is ((-10)/(-6))/((-5)/(-45)) a multiple of 3? True Suppose 8 = t - 48. Does 14 divide t? True Let d(f) = -f3 - 4f*2 + 4f - 1. Is 2 a factor of d(-5)? True Suppose 2q - 18 = -2b + 8, q - 1 = 0. Is b a multiple of 5? False Suppose 2r = -d + 66, d - 3r = 5d - 289. Is 27 a factor of d? False Let k = -9 - 11. Does 5 divide 6k/(-6)1? True Let w = 6 - 6. Is (-1 - w)/((-1)/16) a multiple of 8? True Let q(d) = -4d - 5. Let u be q(12). Let k = u + 10. Let s = k - -88. Is s a multiple of 20? False Let q be 0 + 12 + 1 - 0. Let k = -8 + 3. Let z = k + q. Is z a multiple of 3? False Let j(p) = -p*2 + 8p - 2. Let v be j(6). Let m(n) = 2n + 7. Is m(v) a multiple of 11? False Let a(h) = 36h*2. Let j be a(-1). Suppose 4b = -4v + j, 3b = -2v + v + 13. Is v a multiple of 7? True Let g(h) = 8h - 1. Let i be g(1). Let l(u) = u*3 - 5u*2 - u - 1. Let z be l(i). Suppose 0 = -5v + 10 + z. Is v a multiple of 20? True Let j = -26 + 61. Suppose -l + 5h - 17 = 0, j = -3l - h - 0h. Let k = l - -26. Does 14 divide k? True Let f = 166 + 15. Is f a multiple of 16? False Is -1 + 95 + -3 + 1 a multiple of 23? True Suppose -3q - 36 = -7q + 3f, 3q = 2f + 26. Suppose 0 = g - qg + 325. Is g a multiple of 26? False Let p(i) = i - 1. Let y(l) = -l2 - 5l + 8. Let n(w) = -p(w) - y(w). Let m be n(-5). Is (4/(-3))/(m/6) a multiple of 3? False Suppose 2v = -2o + 20, 27 = 5v - 5o - 3. Suppose 201 = 5q - k + v, 2q + 3k - 67 = 0. Does 8 divide q? False Let u = 8 - -10. Does 14 divide 6/(-4)(-372)/u? False Suppose 8 = -4n - 0. Let p be (-2 + 1)/(1/(-2)). Is p - n(-25)/(-2) a multiple of 12? False Suppose 2s - 12 = -5c - 0, -5s = 2c - 9. Suppose 0 = 3y + 3w - 72, -5y + 3w + 114 - c = 0. Is 9 a factor of y? False Let r(f) = -f*3 - 4f*2 + 5f - 3. Let o be r(-5). Let g = o + 5. Suppose 5w - 15 = 2q, 0 = 3w + q + gq - 30. Does 3 divide w? False Let v = -2 + 1. Let a be 1/(v3/(-36)). Suppose 0 = -5k + 2c + 20, -k + 5c = 2k - a. Does 3 divide k? False Let j(l) = -7l*2 - 1. Let d be j(1). Is 23 a factor of 2/d - 1108/(-16)? True Suppose -y - 51 = -4y. Does 9 divide y? False Let a(u) be the second derivative of 11u4/12 + 2u*3/3 + 3u*2/2 + 5u. Is a(-2) a multiple of 11? False Is (-2)/7 - (-230)/(-35)-11 a multiple of 13? False Suppose 0 = 5j + h - 264, -7j + 207 = -3j + 5h. Is 21 a factor of j? False Suppose -3n - 153 = 5s - 478, 4n = -20. Is 34 a factor of s? True Let t = 6 + -4. Suppose 0 = -7b + 3b + 3s + 18, -tb = 4s + 2. Suppose 0 = n - 5x - 31, -bn + 43 = 2x - 7x. Is 6 a factor of n? True Let p(x) = 2x*2 - 2x - 4. Let b be p(2). Suppose bn - 4n = -112. Is 11 a factor of n? False Let m = 111 + -46. Let c = m + -25. Let y = c + -22. Is 6 a factor of y? True Let g(c) = 11c2 - 4c + 5. Does 10 divide g(2)? False Let r = -12 - -13. Let y(f) = 54f2 - 2f + 1. Does 20 divide y(r)? False Suppose -37 = -5f - 4d, 5d + 17 - 7 = 0. Let l = -4 + f. Is l a multiple of 5? True Let t(a) = -a3 - 12a*2 - 11a - 2. Let b be t(-11). Let n = 2 - b. Suppose 44 = 4m - n. Is m a multiple of 6? True Suppose 0 = -u + 1, -3u - 2u = 5r - 185. Let f be 5(r/(-15) - -2). Let d = f + 21. Is 7 a factor of d? False Suppose -5j = -c - 17, 2c = 4 + 2. Suppose -z + 28 = j. Is 6 a factor of z? True Suppose 0 = 2x + 5l - 91, 5x + 0x - 193 = -l. Suppose -4a = -3a - x. Is 19 a factor of a? True Suppose 0 = 2v + 2v - p - 754, 0 = 4v + 3p - 746. Is v a multiple of 37? False Suppose 42 = -2f - f. Let d = f - -20. Is 6 a factor of d? True Suppose 2t = 4t - 2g - 128, 118 = 2t - 4g. Is t a multiple of 7? False Let u be 0 + (0/(-1))/(-2). Suppose 3y + p - 32 = u, -y + 36 = y - 3p. Is 3 a factor of y? True Let u = 3 + -1. Suppose uo + 2 = -6. Is (8/6)/(o/(-66)) a multiple of 11? True Let w = -459 - -691. Suppose 6m - 4u = 2m + 184, 5m - 4u - w = 0. Is 22 a factor of m? False Let i(q) = 5q - 4q + 21 - 9. Let o be i(-7). Suppose ol = -25 + 80. Is 11 a factor of l? True Let v = 0 + 59. Let y = v - 38. Is 11 a factor of y? False Let i(v) = -v + 10. Let h be i(7). Suppose -4k + r + r + 8 = 0, -6 = -hk - 2r. Suppose -2b = -5y + 13 - 4, -b = ky - 18. Is b a multiple of 8? True Does 18 divide (108 + -1)/((-10)/(-10))? False Let c = 9 - 3. Suppose -4a - u - 4u - c = 0, -a - 3u = 5. Is 19 a factor of a/(-4) + (-459)/(-12)? True Let g = 4 - 1. Suppose -gp + 88 = -p. Is 19 a factor of p? False Suppose 96 + 315 = 3h - 2a, 408 = 3h - a. Is h a multiple of 31? False Let o(s) = -s3 + 19s*2 + 2s - 14. Is o(19) a multiple of 4? True Let c = 9 - 5. Suppose q + c - 31 = 0. Is 8 a factor of q? False Suppose -r = r + 6, 4d - 228 = 4r. Let z = d - 21. Does 17 divide z? False Suppose -2s = 5z - 194, -4z = 2s - s - 103. Suppose 3g + s = 2x, 0 = -2x + 6x - 5g - 175. Does 9 divide x? True Suppose -3t - 5k - 2 = 0, 3t - 7 = t + 5k. Let x = t - -2. Suppose 3u + 2h - 39 = 0, -u + xh + 1 = -1. Does 11 divide u? True Suppose 73j + 72 = 76j. Does 2 divide j? True Suppose -3n = -0n - 4s - 309, 4n - 399 = s. Is 33 a factor of n? True Let f(i) = -2i2 + 2i + 2. Let p be f(-2). Let a be 61/(-3) + 8/(-12). Is p/(-6) - 7/a even? True Does 3 divide 21 + 1 - ((-6)/(-1) - 2)? True Let w(q) = 2q3 + 4q - 2. Is 4 a factor of w(2)? False Suppose 3n - 18 = -4j - 0n, -25 = -5j - 5n. Is 3 a factor of 1 - (j - -3)/(-2)? False Does 22 divide (-211)/((-11)/22)? False Let o be 38/10 - 1/(-5). Suppose -2a = -oa + 44. Is 11 a factor of a? True Suppose 0 = -f + 6 - 8. Does 5 divide ((-105)/14)/(1/f)? True Let g(h) = -4 + 1 - h + 2. Let v be g(-7). Does 13 divide 3/(9/v)13? True Let d(u) = -9u3 - u2 - 2u. Let c be d(-2). Let w = c - 48. Is 24 a factor of w? True Let a = -8 - -3. Let y = 3 + a. Let w(s) = 7s*2 - 2s - 2. Does 16 divide w(y)? False Let t = -81 - -179. Does 14 divide t? True Suppose -2d - g + 6 = 3g, -4d = g - 12. Suppose -t = d - 16. Is t a multiple of 4? False Let k = -13 + 23. Is 15 a factor of k - 11 - -153? False Suppose -6i - t + 453 = -5i, -3*t	{ "pile_set_name": "DM Mathematics" }
- 325d2 + 5d*4 + 835d*3 - 444d*3 - 446d*3. 5d(d - 15)(d - 1)(d + 5) Let o(m) be the third derivative of -11m*2 - 3/160m*6 - 1/32m*4 + 1/280m*7 + 0 + 3/80m*5 + 0m*3 + 0m. Let o(k) = 0. Calculate k. 0, 1 Factor -80h - 1/5h*5 + 0 - 42/5h*4 - 481/5h*3 - 168h*2. -h(h + 1)*2(h + 20)*2/5 Let n be (6/(-4))/(3/30). Let f be n/34(-3)/30. Suppose 0 - 4/3r - 14/3rf = 0. Calculate r. -2/7, 0 Let f(s) = s2 - 18s - 35. Let u be f(20). Let n(i) be the first derivative of -1 + 0i2 - 2/35i*u + 0i - 2/21i3 - 1/7i*4. Factor n(y). -2y*2(y + 1)*2/7 Let o(c) = -12c*4 - 63c*3 - 84c*2 - 27c + 6. Let s(x) = -x*3 - 2x*2 - x. Let a(t) = -2o(t) + 10s(t). Factor a(m). 4(m + 1)*2(m + 3)(6m - 1) Suppose 0 = -5o + 3027z - 3031z + 14, -2z + 2 = 0. Factor 0 + 2/7wo + 6/7w*4 + 0w - 8/7w3. 2w*2(w - 1)(3w - 1)/7 Let z(y) be the second derivative of y7/840 - y6/360 - y5/24 - y4/8 + y*3/2 - 5y. Let p(m) be the second derivative of z(m). Let p(l) = 0. What is l? -1, 3 Let y(c) = -6c - 38. Let f be y(-7). Let r(d) be the second derivative of -1/4d*2 - 2d + 0 + 1/24d3 + 1/48d*f. Factor r(h). (h - 1)(h + 2)/4 Determine x so that 3x + 1/2x*3 - 7/2x2 + 0 = 0. 0, 1, 6 Let h(b) = b3 - 19b2 - 20b - 20. Let k be h(20). Let z be k2/(-16) - (2 + -1). Factor 3q + z + 3/2q2. 3(q + 1)2/2 Let k(c) be the first derivative of -c4/6 + 28c3/9 - 25c*2/3 + 8c + 91. Factor k(b). -2(b - 12)(b - 1)2/3 Let x(a) be the second derivative of -a6/15 - 41a5/10 - 220a*4/3 - 400a*3/3 + 110a + 3. Factor x(c). -2c(c + 1)(c + 20)2 Let r(m) = -51m*2 + 42m*2 - 8m + 0 + 4 - m3. Let a be r(-8). Factor -i2 + 5i2 + ai*2 + 4i. 4i(2i + 1) Solve -17/5x*2 - 1/5x*3 + 17/5 + 1/5x = 0 for x. -17, -1, 1 Let m(o) = -28o4 - 104o*3 - 80o*2 + 48o + 8. Let u(v) = -2v - 1. Let r(c) = m(c) + 8u(c). Let r(k) = 0. Calculate k. -2, 0, 2/7 Find a such that -44 - 335a + 45a*3 - 196 - 100a*2 + 63a*3 - 113a*3 = 0. -16, -3, -1 Let a(x) = 30x*4 + 10x*3 - 25x*2. Let p = 37 - 33. Let l(q) = 29q*4 + 9q*3 - 25q*2 - q. Let m(o) = pa(o) - 5l(o). Let m(c) = 0. What is c? -1, -1/5, 0, 1 Let r(t) be the first derivative of -t3/2 - 117t*2/4 - 198. Factor r(j). -3j(j + 39)/2 Let v(n) be the second derivative of 2n*5/85 + 14n*4/51 + 25n*3/51 + 6n*2/17 - 88n. Let v(q) = 0. Calculate q. -6, -1/2 Suppose 0 = 2i - g - 11, -8i - g = -7i - 7. Let h(z) be the first derivative of -9/2z2 - z3 - iz - 5. Factor h(t). -3(t + 1)(t + 2) Let r(p) = -p4 + p3 + 2p2 + p + 1. Let y(k) = k5 + 2k4 - 16k*3 - 7k*2 + 5k - 5. Let n(f) = 5r(f) + y(f). Determine q so that n(q) = 0. -2, -1, 0, 1, 5 Let y = -315 + 318. Let z(q) be the first derivative of 8/15q*3 + 0q + 0q2 + 6/5q*4 - y - 14/25q*5. Factor z(w). -2w*2(w - 2)(7w + 2)/5 Let c(i) be the first derivative of -2i5/25 + 3i*4/5 - 14i*3/15 - 6i*2/5 + 16i/5 - 142. Solve c(j) = 0 for j. -1, 1, 2, 4 Suppose -5l = 3t - t + 40, 3t = -3l - 24. Let x be (-1)/(-4) + (44/l)/(-11). Factor 0 + xh2 - 9/4h. 3h(h - 3)/4 Let m(g) be the third derivative of 0g - 28g*2 + 1/110g*6 + 0 - 1/385g*7 + 0g*3 - 1/110g*5 + 0g*4. Determine p, given that m(p) = 0. 0, 1 Suppose 44q - 12q = 64. Factor -20/7d*3 - 8/7d*q + 0 + 0d. -4d2(5d + 2)/7 Suppose -4y = -4n - 80, 4y - 3 - 65 = -2n. What is x in -3x - 3x5 - 17x*2 - yx*3 + 29x*2 + 7x*4 + 5x*4 = 0? 0, 1 Let j(n) be the first derivative of 0n + 1/4n4 + 0n*2 - 1/12n*6 - 1/10n*5 - 29 + 0n3. Factor j(a). -a3(a - 1)(a + 2)/2 Let u(t) be the second derivative of -t8/336 - t7/56 + t*5/6 - 5t*3/3 + 4t. Let m(p) be the second derivative of u(p). What is o in m(o) = 0? -2, 0, 1 Suppose -3w - 3x + 6 = 0, w - 3x - 6 = -2w. Let g be (6/(-14) - 66/(-105))w. Factor 0 + gk + 2/5k3 - 4/5k*2. 2k(k - 1)2/5 Let v(t) be the first derivative of -9/4t*4 + 6 + 9/2t*2 - 6t + t*3 + 3/5t*5. Factor v(j). 3(j - 2)(j - 1)2(j + 1) Solve -75/2r3 + 5/4r*4 + 2025r + 585/4r2 + 3645 = 0. -3, 18 Let p be (-110)/(-176)72/50. Let u(c) be the first derivative of -c + pc5 - 11/4c*2 - 7/6c*3 + 11/8c*4 + 10. Factor u(z). (z - 1)(z + 1)*2(9z + 2)/2 Let t(i) be the first derivative of -5i*3/3 + 5i*2 + 15i + 130. Determine a, given that t(a) = 0. -1, 3 Factor -2 + 42/11w - 18/11w*2 - 2/11w*3. -2(w - 1)*2(w + 11)/11 Let y(u) be the first derivative of -3/4u4 + 0u - 9/5u5 + 39 - 1/2u*2 + 5/3u*3. Find c such that y(c) = 0. -1, 0, 1/3 Let h = -35 - -37. Factor 0u - 10u + 2u*h + 2u*2 + 6u. 4u(u - 1) Let t = 28704 - 315740/11. Let r be (-64)/(-77) + (-2)/7. Suppose tl + 2/11l*3 + 0 + rl2 = 0. What is l? -2, -1, 0 Let q(a) = -a2 + 12a + 6. Let i be q(12). Let z(b) = -5b*2 + 8. Let f(s) = 19s*2 - 32. Let v(l) = if(l) + 22z(l). Factor v(k). 4(k - 2)(k + 2) Let w(n) = n3 + 1. Let d(i) = 8i*3 - 10i*2 - 5i + 13. Suppose s - 2k = -2s + 3, -5s + 4k + 3 = 0. Let g(r) = sw(r) - d(r). What is l in g(l) = 0? -1, 1, 2 Let i = 43 + 24. Let -15q*2 + 5q + 5q4 + 69 - 126 - 5q3 + i = 0. Calculate q. -1, 1, 2 Let c(i) be the second derivative of i6/90 - i5/6 - i4/3 + 52i3/9 + 80i*2/3 + 282i. What is p in c(p) = 0? -2, 4, 10 Let r(g) = -2g3 + 6g*2 - 8. Let x be 90/27 - (-4)/6. Suppose 2 = xz - 10. Let w(s) = -s*3 + 3s*2 - 4. Let q(i) = zr(i) - 5w(i). Factor q(o). -(o - 2)2(o + 1) What is g in 169g - 160g + 0g2 - 3g*2 = 0? 0, 3 Let c(r) = -46r - 2. Let m be c(-1). Factor 47s4 - ms4 - s2 - 3s3 + s2. 3s*3(s - 1) Let g(f) = -2f - 7. Let x be g(-5). Suppose -4u = -3k + 22, u - 4 = 2u. Factor -m*4 + xm*4 + 16m*k - 18m*2. 2m*2(m - 1)(m + 1) Let k(g) = -g3 + 7g*2 - 10g - 8. Let t be k(6). Let n = t + 32. Factor nl2 + 3l3 + l2 - 4l2. 3l*2(l - 1) Suppose -2/3a3 + 32/3a + 20/3 - 17/3a2 = 0. What is a? -10, -1/2, 2 Suppose -13w + 54 = -50. Suppose 5j = -5r, 2j = 3r + j - w. Factor 6/5z3 - 3/5z*r - 3/5z*4 + 0z + 0. -3z2(z - 1)*2/5 Factor -52/5g*2 + 0 + 4/5g*3 + 24g. 4g(g - 10)(g - 3)/5 Let x(f) be the third derivative of -f5/60 - f4/6 + 2f*2 - 79f. Suppose x(d) = 0. Calculate d. -4, 0 Suppose g = -g - 8. Let f(t) be the second derivative of t4/6 - t3 - 4t2 + 2t. Let h(z) = -z*2 + 1. Let x(i) = gh(i) - f(i). Factor x(y). 2(y + 1)(y + 2) Let q(c) be the second derivative of -c6/300 - c5/150 + c*4/30 + 5c*2 - 4c. Let m(u) be the first derivative of q(u). Solve m(j) = 0 for j. -2, 0, 1 What is i in 72/7 + 102/7i + 33/7i*2 + 3/7i*3 = 0? -6, -4, -1 Let k(y) be the first derivative of -4y*3/3 + 28y*2 + 60y + 216. Factor k(b). -4(b - 15)(b + 1) Let 1/3i3 + 6348 + 6256i - 275/3i2 = 0. What is i? -1, 138 Let x(r) be the second derivative of -5/2r*2 + 0 + 23r + 35/36r3 + 25/72r*4. Factor x(t). 5(t + 2)(5t - 3)/6 Suppose -3x = 9m - 4m - 11, -m + 7 = 3x. Suppose -14j3 + j4 - jx - 9j*3 + 3j + 20j3 = 0. What is j? -1, 0, 1, 3 Let p(i) = i4 - i3 - i2 + i. Let d(z) = 11z*4 - 8z*3 - 14z*2 + 8z + 3. Let l = -19 + 20. Let w(u) = ld(u) - 5p(u). Solve w(t) = 0. -1, -1/2, 1 Let y(a) be the first derivative of 1/7a4 - 4/7a*3 + 6/7a*2 - 4/7a - 2. Factor y(s). 4(s - 1)3/7 Suppose 0 = 3s - 2s + 5i + 95, 0 = -2s + 5i - 115. Let p = -279/4 - s. Factor -pj3 - 1/4j + 0 + 1/2j2. -j(j - 1)*2/4 Let y be (0/10)/((-6)/(-2)). Let z(h) be the second derivative of -1/6h*4 + 0 + 0h*2 + yh*3 - 3h. Factor z(t). -2t2 Let t(j) = -9j*2 - 712j - 14392. Let s(l) = -6l2 - 475l - 9595. Let g(m) = 8s(m) - 5t(m). Let g(h) = 0. What is h? -40 Suppose -2g = 3g - 15. Suppose 0 = 4v + 4d + 24, -5d - 23 - 7 = 0. Factor 0 + vq*4 + 0q*2 + 1/2q*5 + 0q - 1/2qg. q3(q - 1)(q + 1)/2 Let j(v) be the second derivative of -v7/42 + v6/30 + v5/4 - v4/12 - 4v*3/3 - 2v2 + v + 25. Factor j(n). -(n - 2)2(n + 1)3 Find u, given that 288/5u - 1036u2 + 5184/5 - 288/5u*3 - 4/5u**4 = 0. -36, -	{ "pile_set_name": "DM Mathematics" }
at is the value of (-3)/(-1) + (-545)/545? 2 What is the value of (24/36)/(3 + 28/(-6))? -2/5 What is 6 + -1 + (480/(-3600))/(12/370)? 8/9 What is the value of (-147)/(-539)-66 + (-150)/(-8)? 3/4 Evaluate 100/96 - ((-6)/(-4) - 36/72). 1/24 Evaluate (-24)/(-2) + -24 - -11. -1 (((-288)/(-60))/(-12))/(8/110) - -5 -1/2 Calculate 25 - (1 - -9) - 22. -7 Calculate (-100)/(-15)11150/440. 25 (-90 - -73) + (4 - -15) 2 What is the value of -110(-51)/((-23001)/(-82))? 20 (-756)/65 - -1 - (-32)/80 - -11 10/13 10 - (-9 - -14) - ((-8 - -7) + -4) 10 Calculate (-1462)/(-43)1/(-4) + 9. 1/2 What is the value of (-403/(-18))/(-3 - (-13)/3)? 5 ((-129)/172 - 94/(-104)) + 88/(-234) -2/9 Evaluate (30 + -33)/((-1)/9)2/9. 6 What is (-72)/5 - -11 - 16/(-40)? -3 Calculate 18/(-28)(-77)/12(-374)/(-2057). 3/4 2/5 + (146/10 - 6) 9 Evaluate (-84)/3480-10(-8)/28. -2/29 (-12)/(-28) + (3/(-4))/(81/54) -1/14 Evaluate (8 - (-9 + 24))/1. -7 Evaluate (205 + -206)/(0 + (-1)/(-2)). -2 What is (2 - 0)/(15 - 1976/133)? 14 (-2712)/1243(-33)/6 12 What is (18 - -3)(-35 - -37)/(-63)? -7/3 Evaluate (-6 + 63/12)(3 - 25/9). -1/6 -16 + -3 + (32 + 0 - -1) 14 (4/(-22) - (-7413)/539) + 21/49 14 (-2)/24(-1680)/(-252)3 -5/3 Evaluate ((-132)/(-396))/((-20)/6). -1/10 What is 531/18 + (209/(-22) - -7)? 27 Evaluate ((-16)/80)/(6/60) - 2. -4 What is the value of (-33)/(((-8)/(-24))/((-12)/54))? 22 (-5 - 648/(-56))5/((-10)/(-7)) 23 Calculate 1 + 582/(-48) - -11. -1/8 Calculate -45 + 125 + -84 + (-2)/(4/(-6)). -1 What is the value of (-25053)/(-1911) + -15 - 36/(-78)? -10/7 What is 2/(-25) + (-89948)/(-4975)? 18 Evaluate (200/16 + -8)((-328)/(-156) + -2). 6/13 Evaluate -2 + (-53)/(-28) + (-55)/385. -1/4 Evaluate ((-2)/(-6))/(-3(-15)/45). 1/3 What is the value of (8250/(-363) - -23)/((-3)/42)? -2/11 What is (3/(-10))/(258/24 + -11)? 6/5 What is (-3)/(-4) - 744/992? 0 (-4565)/(-830)(-24)/(-154)(-1 - 13) -12 Evaluate 212/(-477) - (-1)/(-3 - -12). -1/3 What is (2215/(-1329))/((-5)/(-6))? -2 2(-11)/(990/170)(-33)/44 17/6 2/10(-108)/270 -2/25 (46398/(-190))/33 + (1 + -17)/(-2) 3/5 Calculate (7 - (-10 + (-407)/(-22)))/((-6)/(-36)). -9 What is 17/26 - (275/(-220) + (-73)/(-52))? 1/2 Calculate 12 - ((-861)/9)/(-7). -5/3 What is (29/2 - (26 + -25))(-19)/228? -9/8 Evaluate (-1136)/4828 + (-251)/17. -15 What is 13 + (32 - 27) + -14 + 0? 4 12560/(-8400) - ((-17)/5 + 2) -2/21 2 - (36/(-8)-2 + (3 - 0)) -10 (-638)/198 - 10 - -13 -2/9 Calculate (-782)/2346 + 68/6. 11 Evaluate (-275)/(-1540)(-40)/125. -2/35 What is the value of ((-3)/12)/((-39)/(-52))? -1/3 Evaluate (752/1128)/((-3)/(54/15)). -4/5 What is ((-33)/(-24))/(737/(-938))? -7/4 Evaluate (7 - 272/40)/((-198)/(-30) + -4). 1/13 What is (4/8-12)/((-222)/185)? 5 (96/189)/((-4)/266-1) 19 Calculate (-9 - -8)/((-5)/(-25)) - -3. -2 Evaluate ((-20)/18)/(-412/864). 20 Calculate (14/(-98) - 408/(-2660))10. 2/19 Evaluate ((-3)/(-2))/(1/4 - (-364)/224). 4/5 What is (3/9)/((-2)/8) + 90/(-135)? -2 Calculate 17 - (-5287)/(-306) - (-1)/2. 2/9 ((-42)/(-12) - 3)(-2)/4 -1/4 What is 0/(-1) - 64/(-322) - (-1236)/(-4326)? -2/23 What is the value of 2416/(1600/75)? 18 Evaluate (-16/(-34))/((-30)/(-20)). 2/17 Calculate (-7)/((-630)/(-1535)) - -17. -1/18 What is the value of 3944/646 + (2/(-5))/(2/30)? 2/19 Calculate (-3)/(-5) - (-11 - (-249)/15 - -6). -11 Calculate (63/(-45))/(57/(-15) - -4). -7 -52/(-140)63/(-18) -1/4 What is the value of 7(-11 - (-900)/84)? -2 What is the value of ((-5)/(-25))/(30/(-1050))? -7 (41/287 - (-2)/14)/((-12)/(-28)) 2/3 -6 - 6/(288/(-80))(-126)/15 -20 What is ((-7)/3)/((-2145)/135 - -16)? -21 What is the value of 7 - (72/20 + (-31 - -32))? 12/5 Calculate (-28)/(-126) + (-2)/(18/47) + 17. 12 What is (-6)/64150/225? -1/16 154/(-18) + 51/(-297) + (-189)/693 -9 What is 0/(7(7 - (6 - 70/(-49))))? 0 What is ((-22)/10 - -3)(-4180)/152? -22 What is the value of 5/4(31 - 35)? -5 What is ((-90)/25)/(8(-3)/60)? 9 Calculate (999/(-108) + 8)/(((-3)/6)/(-1)). -5/2 1(4 - (-76)/(-20))45/9 1 What is the value of (-21150)/(-45825)(1 + 4/(-6))? 2/13 What is the value of (-448)/168 + 380/30? 10 What is the value of 4 + (210/168)/(-2(-1)/(-24))? -11 Calculate (-70)/28 - (2 + 170/(-36)). 2/9 What is (-25)/(1575/(-36)) + 0? 4/7 What is ((-6)/126/4)/((-81)/96)? 8/9 What is the value of (30/(-4))/((-497)/(-994))? -15 63504/(-72072) + (-2)/(-13) -8/11 Calculate 48/12 - -672/(-220) - 2. 2/55 What is the value of ((-6)/9)/((-1392)/(-234) + -6)? 13 Evaluate (135/18)/(66/44). 5 22 + (-24 - (-40 - -21)) 17 (-30)/((-2)/(-3) - (-465)/(-90)) 20/3 Calculate 6 + 90/35 - (-30)/70. 9 What is (50 + (-32332)/649)/((-16)/(-66))? 3/4 What is the value of 11/((-2090)/57)(-28)/21? 2/5 ((-3024)/300 + 10)(-2 - -3) -2/25 Calculate (1/(-21))/(16/(-280)5). 1/6 What is the value of 150/3375 + 3/945? 1/21 Evaluate (-200)/56 + 4 - 180/28. -6 What is the value of (-2)/35 - 10988/8610 - (-93)/63? 1/7 Calculate (-4213)/(-2298)((0 + 1)-1)/1. -11/6 Calculate (8/40)/(3 - 4 - -2). 1/5 Calculate -2 + 1 - (7/((-70)/(-110)) + -8). -4 (-52432)/(-2320) + (-4)/(-10) 23 (-5)/2 - (-5)/33 5/2 1266/(-1116) - 15/465 -7/6 (2795/1290)/((-1)/(-6)) 13 What is ((-32)/96)/(3/(-81))? 9 (33/55 + 126/(-35))/((-3)/2) 2 Evaluate 3 - 20 - (-34)/((-22440)/(-11130)). -3/22 What is (-20)/15 + 97/21 - 2? 9/7 ((432/60)/12)/(102/(-20)) -2/17 Calculate ((-3)/((-63)/(-14)))/((-7)/21 - 5). 1/8 What is the value of 48/144(36 - 6)? 10 What is (3615/(-402) - (-324)/36)(-4)/1? -2/67 What is ((-7)/(-4))/(54 + -37 + 27/(-2))? 1/2 Evaluate (-21)/(-35)120/(-12) + 7. 1 -353525/6125 -5 What is (40/32)/((-23)/(-24) + (-95)/95)? -30 1852/1389 - 38/6 -5 41/(-46125)25-30 2/3 Evaluate (20/42)/5 + (12815/(-105))/11. -11 What is (-2)/1015 - -2? -1 Calculate (-16)/(-18) + (-24000)/(-3375). 8 -187/4(-8)/18 14 -27 + (0 + 244/(-62) - (-1472)/(-22816)) -31 Calculate 4(17 + (-1384)/80). -6/5 What is the value of ((-9)/15 + 1)-15(-14)/420? 1/5 Calculate (2164/301 - 7) + 1/(-7). 2/43 Calculate -6 + 2 - (2 + -3 + -8). 5 -15 - (2574/15)/(-11) 3/5 What is -1 + 8 + 2-6 + -1 - 2? -8 (-22)/(-10)5 - (-18)/(-2) 2 What is 238/26 - 48/312? 9 What is (4104/16)/19 + -13? 1/2 6 + 198/55 - 36/4 3/5 Evaluate -8 - 58/(-87)99/6. 3 Evaluate (-144)/15 + (-6)/15. -10 (-1(-1)/(-3))/(15/450-1) 10 What is (376/329)/((-3)/42)? -16 Calculate (189/140 - 1)/((-3)/12 + 0). -7/5 What is (-20)/(-80)(-72)/261? -2/29 Calculate (-6)/7(-2170)/6200. 3/10 Calculate ((-8)/46)/(73/((-365)/(-10))). -2/23 What is the value of (78/10)/((-135)/(-225))? 13 Calculate (-23)/((-322)/28)(-17)/(-2). 17 What is the value of (-1 + 7/3)/(26/6 + -4)? 4 Calculate (52/(-130))/(5 + (-273)/60) + 1. 1/9 Calculate (-3)/2(-14)/(-63)21. -7 Calculate (101/2)/((-110)/184814). -6 Calculate (-396)/(-80) - (1 - -7) - 12/10. -17/4 Evaluate -32/(-3) + -10100/625. 2/5 What is (-209 - -184)(-3)/5? 15 (20/3)/(-20)5 -5/3 What is the value of (-3 - -5 - (34 - 32)) + 7? 7 (-122)/(-671) + ((-9)/(-110))/(42/35) 1/4 Evaluate 4/20 - 580/(-100). 6 What is the value of ((-640)/(-70) - 9)-1 + -2 + 2? -1/7 What is (7/(-56) - 15610/(-1232)) + -12? 6/11 11/2((-32)/8 - -2) -11 47/11 - 60/220 4 120(-16)/40 - -24 -24 What is the value of (24/40)/(2/(-5) - (-21)/35)? 3 Evaluate 5 - (26 - 150/15). -11 -8 - (10/(-25))/((36/(-285))/(-2)) -5/3 Calculate (42/16)/(-21)0. 0 4/35307/(-614) -2/35 (0 - (-124)/(-8)) + (-30)/40-2 -14 What is (-90)/(-120)160/(-270)? -4/9 7/(1120/1752) - (10 + 1) -1/20 (-2)/(-5)20/(-6)(-12)/44 4/11 (8/(-3) + 0)/(-176 - -175) - -2 14/3 What is -1 - (39/182)/((-126)/637)? 1/12 Calculate (440/33)/8 + (-86)/(-6). 16 What is (-104)/(-13) + 0 + 2? 10 What is 12/(-2) + (-8)/(14 - 13)? -14 Calculate (4 - 2) + 11 + 1026/(-513). 11 What is (156/(-56))/((-9)/(-24)) + 7? -3/7 13/6 - ((-1659)/(-63) + -24) -1/6 Evaluate 16/(-12)(-1)/((-176)/24). -2/11 Evaluate 16/(-1) - (-448)/32. -2 (-266 + 265)/(1/(-5)-3) -5/3 (99 - 93)/(15/(-2)) -4/5 Evaluate (75/21 - 3) + (-2304)/112. -20 Evaluate (1 - -4) + 364/52. 12 What is the value of 938/(-402)*(-14 + 0 + 2)? 28 Calculate (-684)/(-126) - (-4)/7. 6 What is the value of 301/(-12) - (-679)/8148? -25 Calculate ((-47112)/(-13776))/(-13) + 10/205. -3/14 What is the value of 256/(-36) - (3 + (-3)/27 + -3)? -7 Calcul	{ "pile_set_name": "DM Mathematics" }
Suppose -479 + 39 = -db - 5h, -4b = h - 358. Calculate the remainder when b is divided by 23. 21 Calculate the remainder when 178 is divided by 13 + (3 - (-3 - -4)). 13 Suppose 17 - 7 = 5w. Suppose 25 = wb + 17. Calculate the remainder when 16 is divided by b. 0 Let s = -233 - -240. What is the remainder when 87 is divided by s? 3 Suppose 5f = -59d + 54d + 95, 0 = -4d + 3f + 90. Calculate the remainder when d is divided by 7. 0 Let j be (7/(-3))/(3/(-108)). Suppose -j = -2o - 2. Calculate the remainder when o is divided by (14 - 3)(-3 + 4). 8 Suppose 4p + g + 9 - 60 = 0, 5p + 5g - 45 = 0. What is the remainder when (-33)/(-7) - (-4)/14 is divided by 0 + 2 - (p + -14)? 1 Suppose 0 = 5g - 0g - 10. Suppose 2d + 32 - 190 = 0. Calculate the remainder when d is divided by 40/66/g. 19 Suppose -v - 8 = 2m, 4v + 0m - 12 = 3m. Suppose v = 2x - 25 - 33. What is the remainder when 115 is divided by x? 28 Let w = -94 - -102. What is the remainder when 39 is divided by w? 7 Let t be 1(2 - 31 - 0). Let g = t + 33. Suppose gw - 3w - 81 = 0. What is the remainder when w is divided by 21? 18 Let c = 1394 - 1388. Calculate the remainder when 119 is divided by c. 5 Suppose -2l + 21 = 4u + 3l, 5u = 4l + 16. Let o = 701 + -682. Calculate the remainder when o is divided by u. 3 Let g = -80 + 118. What is the remainder when 69 is divided by g? 31 Suppose -10i = -8i - 768. Calculate the remainder when i is divided by 11. 10 Suppose 0 = -3i + 15, -9p - 3i + 327 = -7p. Calculate the remainder when p is divided by 33. 24 Let c(o) = -o*3 + 15o*2 - 14o + 4. Let h be c(14). Let l(v) = 2v. What is the remainder when l(h) is divided by (10/(-4))/((-2)/4)? 3 Suppose -3a - 6 = -0a. Let y(r) = r3 + 8r*2 - 27. Calculate the remainder when y(-7) is divided by 18(12/(-9) - a). 10 Suppose 5r + 0n = 4n + 117, 0 = 5r - 3n - 119. Suppose u - r = -4u - 5g, 4g - 8 = -u. What is the remainder when 13 is divided by u? 1 Let y(m) = -m*2 - 10m + 22. Let h be y(-13). Calculate the remainder when (-134)/(-17) - (0 - (-2)/h) is divided by 5. 3 Let d = 112 - 93. Suppose 0 = 15r - dr + 120. Calculate the remainder when 147 is divided by r. 27 Suppose 0 = -55s + 56s - 12. Calculate the remainder when 46 is divided by s. 10 Suppose 5f - 5 = -5c, f - 5f = -3c + 38. Let l be (-59)/2(2 + -3 - 1). Let m = l - 36. What is the remainder when m is divided by c? 5 Suppose 0 = -18j + 45j - 2133. Calculate the remainder when j is divided by 4/6 + (-276)/(-18). 15 Suppose j = 2j - 8. Let z = -18 + -2. Calculate the remainder when (z/6)/(-5) + (-575)/(-15) is divided by j. 7 Let r = 56 + -24. Suppose 5h = 2h + c + r, 0 = -3h - 5c + 2. What is the remainder when 49 is divided by h? 4 Suppose 73 + 31 = -2m. Let k be ((-17)/3)/(6/36). Let h = k - m. Calculate the remainder when h is divided by 5. 3 Suppose j + 0 - 4 = 0, 4j = -u + 80. Let z(x) = -3x3 + 3x*2 - 4x - 11. What is the remainder when u is divided by z(-2)? 31 Suppose 0 = -17l + 3l + 9002. Calculate the remainder when l is divided by 54. 49 Let l(t) = -t*2 + 41t - 122. Calculate the remainder when 69 is divided by l(37). 17 Suppose -14 + 5 = -v. Calculate the remainder when 10 is divided by (v/6)/(7/14). 1 Let a be (-14 - -208)/(-1 - 1). Let r = -90 - a. What is the remainder when r is divided by 5? 2 Suppose 39t = 44t + 20. Let j = 14 - t. What is the remainder when 51 is divided by j? 15 Suppose -22p + 206 = -212. What is the remainder when 57 is divided by p? 0 Suppose -36j + 616 = -68. Calculate the remainder when 43 is divided by j. 5 Suppose 0 = 4y + 5n + 5, 2n = -3y - 3n - 10. Suppose -4i = y - 9. Calculate the remainder when i is divided by 1. 0 Calculate the remainder when ((-163890)/(-225))/(6/10) is divided by 32. 30 Suppose 13c - 32c = -3325. What is the remainder when c is divided by 45? 40 Let u(o) = -o*3 - 2o*2 - 13o - 15. What is the remainder when u(-5) is divided by 43? 39 Suppose -o + r = -23, -1 - 2 = 3r. Calculate the remainder when 28 is divided by o. 6 Suppose 35o = 213 + 382. Calculate the remainder when 75 is divided by o. 7 Let d = 3 + 1. Let f = 8 - 6. Suppose -34 = -3g - fh, -g + 3g - 5h = 10. Calculate the remainder when g is divided by d. 2 Suppose 1 = -4c + 197. Let z(q) = q3 - 2q + 25. Calculate the remainder when c is divided by z(0). 24 Suppose -3d = 4w - 247, -3w + 86 + 80 = 2d. What is the remainder when d is divided by 18? 5 Let x(f) = 18f + 137. What is the remainder when 65 is divided by x(-6)? 7 Suppose 3t = -2w + 277, w - 3t + 7t = 131. What is the remainder when w is divided by 48? 47 Let b(q) = q3 + 8q*2 - 9q + 1. Let k be b(-9). Let u be 3/2 + (-5)/(-10). What is the remainder when 50 is divided by 21/3u - k? 11 Let n = -34 + 45. Calculate the remainder when 31 is divided by -12(3 - n/3). 7 Suppose g = 26 + 72. Suppose 7o + 0o = g. What is the remainder when 152 is divided by o? 12 Suppose 2w = 14 + 4. Suppose 5t - 353 = -2z, 2t - 2z = -2t + 268. What is the remainder when t is divided by w? 6 Let b(q) = -q*2 - 4q + 1. Let l = 13 + -16. Let s be b(l). Suppose -sg - 2v = -46, 0 = -4g + 3v + 28 + 23. What is the remainder when 44 is divided by g? 8 Let a = 16 + -10. Suppose 0j = r + 4j - 5, 2j = -a. Calculate the remainder when -130(0 + (-2)/4) is divided by r. 14 Let q = -345 + 648. Let n = q - 155. Suppose -4k - a = 4a - 199, n = 3k + 5a. What is the remainder when k is divided by 13? 12 Let q(b) = 2b3 + b + 199. Calculate the remainder when q(0) is divided by 20. 19 Suppose 3p = 3t + 160 + 68, -3p - 5t = -252. What is the remainder when p is divided by 68? 11 Suppose -19q = q - 1200. What is the remainder when 477 is divided by q? 57 Suppose -5m + 335 = -6x + 11x, 2x + 221 = 3m. Calculate the remainder when m is divided by 18. 17 Suppose -5h + b - 42 = 0, 4h - 5b + 3 + 18 = 0. Let r = 9 + h. Let x(s) = s3 + s2 - s + 21. Calculate the remainder when 62 is divided by x(r). 20 Suppose 2y = 3 + 3. Suppose -6t + y = -3. Let u(a) = 11a - 1. Calculate the remainder when 17 is divided by u(t). 7 Suppose 0r - r = -17. Suppose -24q = -rq - 105. What is the remainder when 74 is divided by q? 14 Let p(r) be the first derivative of -37r2/2 + r - 15. What is the remainder when p(-1) is divided by 14? 10 Let d(s) = -2s + 19. Let q be d(9). Let w(m) = -m*3 + 6m*2 - 3m - 6. What is the remainder when 200/14 - q - (-30)/(-105) is divided by w(5)? 1 Suppose -5c - 123 = 402. Let k = c - -116. What is the remainder when 35 is divided by k? 2 Let x(w) = -w2 - 7w + 27. Let a = 8 - -26. Calculate the remainder when a/1232 is divided by x(-9). 8 Let p(l) = -l*2 - 7l - 4. Let w be p(-5). Suppose -10 = -f + 1. Calculate the remainder when f is divided by 90/52/w. 5 Suppose 12y - 4r - 47 = 11y, 3y = 5r + 141. Calculate the remainder when 87 is divided by y. 40 Suppose 20 = 2i - 4u, i + 2u + 8 = -2. Suppose -4q + iq = -3s - 115, 3q + 3s = 102. Calculate the remainder when q is divided by (-51)/12(4 + 0)-1. 14 Let o = -101 - -149. What is the remainder when o is divided by 25? 23 Suppose -8u - 6 = -9u. Let l be (-52)/(1(-3)/u). Suppose -4s + 84 + l = 0. What is the remainder when s is divided by 16? 15 Suppose 12j - 2465 = -557. What is the remainder when j is divided by 72? 15 Suppose -30d = -3104 - 3436. What is the remainder when d is divided by 23? 11 Let w(g) = -g*3 - 34g*2 + 36g + 59. Calculate the remainder when w(-35) is divided by 8. 0 Let u(f) = 19f2 + 10f - 55. Calculate the remainder when u(3) is divided by 10. 6 Let q = -493 + 518. Calculate the remainder when q is divided by 10. 5 Suppose -f = -0f + 196. Let o = f - -306. What is the remainder when o is divided by 37? 36 Let r(j) be the first derivative of 3j*2/2 - 7j - 16. Suppose -18 = -0t - 3t. What is the remainder when 42 is divided by r(t)? 9 Let c = 553 - 539. Calculate the remainder when 601 is divided by c. 13 Suppose -3b = 21 - 87. Calculate the remainder when 744 is divided by b. 18 What is the remainder when 58 is divided by (15 - 17)/((-2)/22)? 14 Suppose 1593 = 3s - 42. What is the remainder when s is divided by 79? 71 Let h(r)	{ "pile_set_name": "DM Mathematics" }
+ 3sqrt(11) Simplify -1sqrt(7)-2 + sqrt(7) + sqrt(63)-2. -3sqrt(7) Simplify sqrt(133)/(sqrt(7) - (sqrt(112) + sqrt(7))) + sqrt(152)/(sqrt(8) - sqrt(8)-3). 0 Simplify -5((sqrt(11) - sqrt(11)-3) + -3)*2. -925 + 120sqrt(11) Simplify ((sqrt(275) - sqrt(11)) + 0 + (sqrt(11) - (sqrt(99) + sqrt(99) + sqrt(99) + sqrt(99) + sqrt(99)1)))2. 1100 Simplify (-2sqrt(539)5)2 + 1(sqrt(539) + 1sqrt(539))2. 56056 Simplify (2sqrt(832))2 + -5. 3323 Simplify (sqrt(50) + -1)23. -30sqrt(2) + 153 Simplify 1((6sqrt(300)-2 - sqrt(300)) + sqrt(300) + 0 + sqrt(300) + -5)2. 1100sqrt(3) + 36325 Simplify sqrt(40)/sqrt(128) - 2(sqrt(25)/sqrt(5) + sqrt(5)). -15sqrt(5)/4 Simplify ((sqrt(605) + -1 + sqrt(605))*2 - sqrt(605))-3. -7263 + 165sqrt(5) Simplify ((-2 + sqrt(243))-1-4)2. -576sqrt(3) + 3952 Simplify 3-5sqrt(52)/sqrt(4). -15sqrt(13) Simplify (sqrt(132)/(sqrt(4) + sqrt(28)/sqrt(7)) + sqrt(33))/(sqrt(9)/(sqrt(21)/sqrt(7)) + sqrt(3)). 3sqrt(11)/4 Simplify 4sqrt(896)/sqrt(2). 32sqrt(7) Simplify (sqrt(425) + 4 + (sqrt(425)2 - sqrt(425) - sqrt(425)) - sqrt(425))2. 16 Simplify (-6(sqrt(85) - ((sqrt(85) - (sqrt(85)-2 + sqrt(85))) + sqrt(85))))/(sqrt(60)/sqrt(48)). 24sqrt(17) Simplify 4 + sqrt(17) + -2 - sqrt(136)/(sqrt(24)/sqrt(3)). 2 Simplify -4 + (sqrt(1900) - (4 + (sqrt(1900) + 0 - sqrt(1900))*2)). -8 + 10sqrt(19) Simplify -3sqrt(20) + (sqrt(405)-1)*2. -6sqrt(5) + 405 Simplify -4 + (4(sqrt(5) + sqrt(5)2) + -2)*2. -48sqrt(5) + 720 Simplify (-2 + (sqrt(13) - (sqrt(13) + (sqrt(13) - (sqrt(13) - sqrt(52)/sqrt(4))))) + sqrt(13))2 + sqrt(39)/sqrt(3) + 2. sqrt(13) + 6 Simplify (sqrt(847) - ((sqrt(847) - (sqrt(847) + -2)) + -3 + sqrt(847)) - sqrt(847))2 + 5. -22sqrt(7) + 853 Simplify 0 + (2(0 + sqrt(243)))*2. 972 Simplify (sqrt(320) + (sqrt(320)4 - sqrt(320)) + 0)*2. 5120 Simplify (-33((sqrt(11) - sqrt(44)/sqrt(4)) + -4))2. 1296 Simplify 5 + -1 + (sqrt(2) + (sqrt(2) - sqrt(8)/sqrt(4)3))*2 + 1. 7 Simplify 1((sqrt(325))*2 + 0 + sqrt(117)/sqrt(144)). sqrt(13)/4 + 325 Simplify (-3 + sqrt(3))-1 + -3 + sqrt(243). 8sqrt(3) Simplify sqrt(76)/(sqrt(8)/sqrt(2))-5. -5sqrt(19) Simplify sqrt(20)/(-2sqrt(640)) + -2(sqrt(32)-6)*2. -2304 - sqrt(2)/16 Simplify (sqrt(6) - (sqrt(6) - (sqrt(36)/sqrt(3))/sqrt(2)))/(sqrt(300) + sqrt(300) + sqrt(300) + (sqrt(300) - 2sqrt(300)) + sqrt(300)). sqrt(2)/30 Simplify -6-1sqrt(11) + (-5 + sqrt(11) + 1)*2. -2sqrt(11) + 27 Simplify ((-5 + sqrt(78)/(3sqrt(6)))-4)*2. -160sqrt(13)/3 + 3808/9 Simplify sqrt(19) + (sqrt(133)/sqrt(7)2)2 - sqrt(19) - (sqrt(1216)3)*2. -10868 Simplify (2sqrt(180)-2)2. 2880 Simplify (4sqrt(26)-2)/sqrt(2). -8sqrt(13) Simplify (sqrt(1300) + -1 + 1)*2 + sqrt(1300) + sqrt(1300)1-4. -30sqrt(13) + 1300 Simplify (sqrt(52) - (sqrt(52) - -1sqrt(52)))/sqrt(4) + 1. -sqrt(13) + 1 Simplify -2(sqrt(42)/sqrt(6)-4)2. -224 Simplify 5(-2sqrt(171))/sqrt(9). -10sqrt(19) Simplify (sqrt(66)/(-3sqrt(864)))2. 11/1296 Simplify ((-1sqrt(297) + sqrt(297))/sqrt(11))/sqrt(9). 0 Simplify ((-1sqrt(605) - sqrt(605)) + 5 + sqrt(605))2. -110sqrt(5) + 630 Simplify (sqrt(18) - -3sqrt(54)/sqrt(3))/(sqrt(36)/(sqrt(20)/sqrt(5)) + sqrt(9)). 2sqrt(2) Simplify -4 + sqrt(432) + 2 + -3. -5 + 12sqrt(3) Simplify (6sqrt(35)-2)/(sqrt(896)/sqrt(8)). -3sqrt(5) Simplify (0 + sqrt(475) - sqrt(19))1. 4sqrt(19) Simplify sqrt(36)/(-4sqrt(12)-2). sqrt(3)/8 Simplify (sqrt(51)2-5)/(-1sqrt(147)). 10sqrt(17)/7 Simplify (sqrt(784)1)/sqrt(8). 7sqrt(2) Simplify ((sqrt(117) + (sqrt(117) - -2sqrt(117) - sqrt(117)))/sqrt(9) + 0)2. 117 Simplify 1sqrt(17)-5 + ((2 + sqrt(17))-5)*2. 95sqrt(17) + 525 Simplify -5 + sqrt(52)/sqrt(4) - ((sqrt(13) - sqrt(13)-2)2 + sqrt(13) + sqrt(13))1. -122 - sqrt(13) Simplify (sqrt(153) + sqrt(153) + sqrt(153)1 + -4 + -4)2. -144sqrt(17) + 1441 Simplify (-3(sqrt(1728) + sqrt(1728)-2 + 5))*2. -2160sqrt(3) + 15777 Simplify (5 + -1 + sqrt(468) + 3)*2. 84sqrt(13) + 517 Simplify (-3(sqrt(26) + sqrt(104)))/(sqrt(162) + -3sqrt(162)). sqrt(13)/2 Simplify -1 + (sqrt(19)2 + -5 - (sqrt(513) + sqrt(57))/sqrt(3)). -2sqrt(19) - 6 Simplify (sqrt(242) - -2(1sqrt(242) + sqrt(242) + sqrt(242)))*2 + (-3 + 2sqrt(242))*2. -132sqrt(2) + 12835 Simplify -2sqrt(35)/(sqrt(14)/sqrt(2)). -2sqrt(5) Simplify (2(0 + sqrt(13)2 + sqrt(13)) + 5)*2. 60sqrt(13) + 493 Simplify (-3 + -2sqrt(147) + (sqrt(147) + (1 + sqrt(147))-5 - sqrt(147)))*2. 784sqrt(3) + 7267 Simplify 2sqrt(2592) - 1(sqrt(18) + 2). -2 + 69sqrt(2) Simplify (sqrt(48))2 + -5 - sqrt(75)1. -5sqrt(3) + 43 Simplify (1sqrt(27)5)/(-3sqrt(576)). -5sqrt(3)/24 Simplify (sqrt(147) + 3 + (sqrt(3) - (-1 + sqrt(12) - sqrt(3))))2. 56sqrt(3) + 163 Simplify -2(sqrt(50) - sqrt(200)/sqrt(4))/sqrt(10). 0 Simplify (sqrt(605) + ((sqrt(605) + -4)4 - sqrt(605)) + -4)*2. -1760sqrt(5) + 10080 Simplify (-2sqrt(567) - (sqrt(224) + sqrt(14))/sqrt(2)) + -5. -23sqrt(7) - 5 Simplify (-2sqrt(84)2 + sqrt(84) - sqrt(84))/(sqrt(12) - (sqrt(972) + 2sqrt(972))). 2sqrt(7)/13 Simplify 5 + (sqrt(288) + 0)*2 + sqrt(288) + (sqrt(288) - (sqrt(288) + (sqrt(288) - (1sqrt(288))*2))-3). -571 + 96sqrt(2) Simplify (-4sqrt(228))/(sqrt(192) + sqrt(192)3 + sqrt(192) + sqrt(192) + sqrt(192)). -sqrt(19)/7 Simplify (sqrt(175) + -1)4. -4 + 20sqrt(7) Simplify (sqrt(44) - sqrt(704))/sqrt(4) + (sqrt(275) + (sqrt(275) - sqrt(275)5))*2. -3sqrt(11) + 2475 Simplify ((sqrt(42)/sqrt(3))/sqrt(7) - sqrt(10)/(sqrt(20)/sqrt(4))) + 2. 2 Simplify (3 + sqrt(7)-2)-3. -9 + 6sqrt(7) Simplify (-3sqrt(84))/sqrt(12) + 2. -3sqrt(7) + 2 Simplify (4 + (sqrt(7) - -6(sqrt(7) - sqrt(252))) + 1sqrt(1008) + sqrt(7))2. -128sqrt(7) + 1808 Simplify (6(sqrt(720) - (sqrt(720) + 1) - sqrt(720)) + 0)2. 864sqrt(5) + 25956 Simplify (-4 + (-2sqrt(11)6 - sqrt(11)))*2. 104sqrt(11) + 1875 Simplify 6sqrt(33)/sqrt(3)5. 30sqrt(11) Simplify (sqrt(65) - 2sqrt(65)2)/(sqrt(5) - (sqrt(5) + sqrt(80) + sqrt(5))3). 3sqrt(13)/17 Simplify (sqrt(5)-16 - (sqrt(45) + 0))2. 405 Simplify -3(1 + 62sqrt(7)). -36sqrt(7) - 3 Simplify -5 + sqrt(275) + -1 + sqrt(275) + -5(sqrt(275) + 1). -15sqrt(11) - 11 Simplify (((sqrt(1872)-1-3 + sqrt(1872) - sqrt(1872)) + 6sqrt(1872)-2 + sqrt(1872) + sqrt(1872))3)*2. 825552 Simplify -44sqrt(117)/(-2sqrt(1296)). 2sqrt(13)/3 Simplify (sqrt(11) + (sqrt(11) - sqrt(99)/(3sqrt(9)))*2)2 + 2. 2sqrt(11) + 106/9 Simplify ((sqrt(12)-2)/sqrt(4))*2 + ((1sqrt(33))/sqrt(11))*2. 15 Simplify (sqrt(66)/sqrt(6) + 2 + sqrt(99)-2)*2. -20sqrt(11) + 279 Simplify sqrt(1300)/sqrt(4)-5. -25sqrt(13) Simplify (5 + sqrt(125) + sqrt(125) + (1sqrt(125) - sqrt(125) - sqrt(125))-1)*2. 150sqrt(5) + 1150 Simplify -3(-1 + sqrt(175)2)*21. -2103 + 60sqrt(7) Simplify (sqrt(39)/sqrt(27))2 - sqrt(13) - (-5(sqrt(13) - sqrt(52)/sqrt(4)) + sqrt(13)). -2sqrt(13) + 13/9 Simplify (sqrt(14)/sqrt(2))21 - (sqrt(14)/sqrt(8))*2. 21/4 Simplify -4(2 + sqrt(104)/sqrt(8))1. -4sqrt(13) - 8 Simplify (sqrt(63))2 + 0 + (sqrt(175) + 0 + sqrt(175))2. 763 Simplify 6sqrt(7)2 - (sqrt(700) + 2sqrt(700))2. -6300 + 12sqrt(7) Simplify ((sqrt(468) + -1 + 5)-1 + 2)2. 24sqrt(13) + 472 Simplify -1sqrt(112) + sqrt(112) + -1. -1 Simplify sqrt(25)/(-5sqrt(500)). -sqrt(5)/50 Simplify (sqrt(36)/sqrt(2)-4)/((sqrt(81) + (sqrt(81) - (-1sqrt(81) - sqrt(81))) - sqrt(81)) + sqrt(81) - sqrt(81)). -4sqrt(2)/9 Simplify (-1sqrt(192) - (sqrt(21)4)/sqrt(7))2. 432 Simplify (sqrt(351)-4)/(sqrt(3) - (sqrt(3) + sqrt(6)/(-1sqrt(2)))). -12sqrt(13) Simplify ((2 + sqrt(14)/sqrt(2) - sqrt(63)-6) + -3 + -2)2. -114sqrt(7) + 2536 Simplify -3 + sqrt(300) - (sqrt(3) + 4 + sqrt(3)2 - sqrt(3)). -7 + 8sqrt(3) Simplify 1 + (-2 + sqrt(833) - (sqrt(17)-1)2-6). 7sqrt(17) + 101 Simplify (4(sqrt(13) + 3))*2 + 1. 96sqrt(13) + 353 Simplify ((4 + sqrt(18) - sqrt(18)4) + -3)2. -18sqrt(2) + 163 Simplify 3sqrt(13)6 - sqrt(65)/(sqrt(5) + sqrt(125)). 107sqrt(13)/6 Simplify ((4sqrt(220)/sqrt(10))/sqrt(2))*2. 176 Simplify (sqrt(660)/(2sqrt(11)))/((sqrt(60) - (sqrt(60) - sqrt(60)2))/sqrt(5) - sqrt(12)). sqrt(5)/2 Simplify -2 + sqrt(1053) - sqrt(91)/sqrt(7)1. -2 + 8*sqrt(13) Simplify (sqrt(117)/(sqrt(1296)	{ "pile_set_name": "DM Mathematics" }
4. 4 Calculate the remainder when 40226422 is divided by 1297624. 78 What is the remainder when 1781122 is divided by 1780835? 287 What is the remainder when 2024275 is divided by 1012098? 79 What is the remainder when 931910 is divided by 5480? 310 Calculate the remainder when 1722675 is divided by 639. 570 Calculate the remainder when 225743 is divided by 2427. 32 Calculate the remainder when 67716 is divided by 699. 612 What is the remainder when 8479279 is divided by 4239623? 33 Calculate the remainder when 372812 is divided by 221. 206 What is the remainder when 6139703 is divided by 277? 275 What is the remainder when 30160 is divided by 27686? 2474 Calculate the remainder when 1611530 is divided by 265. 65 What is the remainder when 23094898 is divided by 3837? 3832 What is the remainder when 58501 is divided by 58122? 379 What is the remainder when 159563 is divided by 22555? 1678 What is the remainder when 44315322 is divided by 1261? 1260 What is the remainder when 4407627 is divided by 3601? 3 What is the remainder when 4683 is divided by 2296? 91 What is the remainder when 6205984 is divided by 517165? 4 Calculate the remainder when 488574 is divided by 24417. 234 What is the remainder when 112148 is divided by 28001? 144 Calculate the remainder when 10567 is divided by 10409. 158 Calculate the remainder when 630083 is divided by 2409. 1334 What is the remainder when 1359325 is divided by 339830? 5 Calculate the remainder when 728401 is divided by 69. 37 What is the remainder when 146188 is divided by 72937? 314 What is the remainder when 31307704 is divided by 55? 54 What is the remainder when 7332396 is divided by 299? 19 What is the remainder when 54275351 is divided by 986? 981 Calculate the remainder when 250262 is divided by 671. 650 What is the remainder when 331487 is divided by 165639? 209 What is the remainder when 79572776 is divided by 84? 80 Calculate the remainder when 191752 is divided by 372. 172 Calculate the remainder when 3413318 is divided by 18652. 2 Calculate the remainder when 215974 is divided by 4955. 2909 Calculate the remainder when 7935129 is divided by 7935126. 3 Calculate the remainder when 834353 is divided by 2357. 2332 Calculate the remainder when 6904614 is divided by 60. 54 What is the remainder when 12236748 is divided by 12512? 12 Calculate the remainder when 24967377 is divided by 756587. 6 Calculate the remainder when 606801 is divided by 2650. 2601 Calculate the remainder when 8488836 is divided by 460. 456 What is the remainder when 334659 is divided by 3984? 3 Calculate the remainder when 938218 is divided by 7811. 898 What is the remainder when 464240 is divided by 152596? 6452 What is the remainder when 302516 is divided by 100757? 245 Calculate the remainder when 704674 is divided by 352287. 100 Calculate the remainder when 85677 is divided by 481. 59 Calculate the remainder when 88510677 is divided by 15. 12 What is the remainder when 1191236 is divided by 5821? 3752 What is the remainder when 48976214 is divided by 9795241? 9 What is the remainder when 859532 is divided by 2032? 2028 Calculate the remainder when 23211404 is divided by 67. 58 Calculate the remainder when 19527 is divided by 485. 127 What is the remainder when 3988158 is divided by 3988148? 10 What is the remainder when 4131395 is divided by 511? 471 What is the remainder when 98260 is divided by 840? 820 Calculate the remainder when 160851 is divided by 338. 301 Calculate the remainder when 5665083 is divided by 28. 11 Calculate the remainder when 3819310 is divided by 580. 10 What is the remainder when 40425596 is divided by 232331? 2 Calculate the remainder when 96499 is divided by 593. 433 Calculate the remainder when 389389 is divided by 483. 91 What is the remainder when 672042 is divided by 333? 48 Calculate the remainder when 769396 is divided by 13989. 1 Calculate the remainder when 1412229 is divided by 353056. 5 Calculate the remainder when 121690 is divided by 1603. 1465 What is the remainder when 117924 is divided by 1142? 298 Calculate the remainder when 3196821 is divided by 799181. 97 Calculate the remainder when 71122366 is divided by 1165940. 26 Calculate the remainder when 6341 is divided by 5660. 681 Calculate the remainder when 105654 is divided by 6663. 5709 What is the remainder when 78268059 is divided by 335? 334 Calculate the remainder when 4707930 is divided by 11427. 6 Calculate the remainder when 556785 is divided by 3985. 2870 Calculate the remainder when 1126212 is divided by 2371. 2358 What is the remainder when 18594861 is divided by 26? 25 What is the remainder when 116812 is divided by 11561? 1202 What is the remainder when 278138 is divided by 138971? 196 Calculate the remainder when 44588 is divided by 37. 3 Calculate the remainder when 8368730 is divided by 35. 20 Calculate the remainder when 3171049 is divided by 103. 91 What is the remainder when 15722633 is divided by 7060? 13 Calculate the remainder when 36457254 is divided by 143. 119 Calculate the remainder when 8764408 is divided by 9187. 10 What is the remainder when 76817226 is divided by 302430? 6 What is the remainder when 440869 is divided by 110175? 169 Calculate the remainder when 937953 is divided by 34. 29 Calculate the remainder when 578680 is divided by 314. 292 What is the remainder when 1827239 is divided by 17238? 11 Calculate the remainder when 4321981 is divided by 138. 97 What is the remainder when 961079 is divided by 159951? 1373 What is the remainder when 199165 is divided by 8128? 4093 Calculate the remainder when 1425849 is divided by 278. 265 Calculate the remainder when 265666 is divided by 524. 522 What is the remainder when 28873352 is divided by 128? 8 What is the remainder when 570999 is divided by 190320? 39 What is the remainder when 45226942 is divided by 1008? 1006 Calculate the remainder when 21669 is divided by 564. 237 What is the remainder when 1312976408 is divided by 66? 62 Calculate the remainder when 959460 is divided by 2008. 1644 What is the remainder when 29964543 is divided by 134? 133 Calculate the remainder when 146130639 is divided by 54. 51 What is the remainder when 583172 is divided by 127? 115 Calculate the remainder when 13213580 is divided by 432. 428 Calculate the remainder when 91598626 is divided by 3498. 3496 What is the remainder when 447987 is divided by 4025? 1212 What is the remainder when 6465300 is divided by 68? 64 Calculate the remainder when 163785 is divided by 1725. 1635 What is the remainder when 196944437 is divided by 117649? 11 Calculate the remainder when 102752 is divided by 33759. 1475 What is the remainder when 11659271 is divided by 253? 19 Calculate the remainder when 442799 is divided by 62752. 3535 Calculate the remainder when 969034 is divided by 161504. 10 What is the remainder when 8434833 is divided by 276? 273 What is the remainder when 41511717 is divided by 107? 104 What is the remainder when 1000490 is divided by 1806? 1772 What is the remainder when 146775 is divided by 36673? 83 What is the remainder when 365878 is divided by 9? 1 What is the remainder when 8880 is divided by 3414? 2052 Calculate the remainder when 331571553 is divided by 94. 89 Calculate the remainder when 2352394 is divided by 491. 13 Calculate the remainder when 96082 is divided by 23. 11 What is the remainder when 130858359 is divided by 192? 183 Calculate the remainder when 1568928 is divided by 237. 225 Calculate the remainder when 367188 is divided by 344. 140 Calculate the remainder when 29338 is divided by 933. 415 What is the remainder when 2948564 is divided by 7719? 7625 Calculate the remainder when 69920709 is divided by 3. 0 What is the remainder when 542017 is divided by 6022? 37 Calculate the remainder when 5546607 is divided by 155. 87 Calculate the remainder when 53359 is divided by 47124. 6235 What is the remainder when 874872 is divided by 7171? 10 What is the remainder when 74617 is divided by 1051? 1047 What is the remainder when 2486454 is divided by 6702? 12 What is the remainder when 9167929 is divided by 20464? 57 What is the remainder when 18027118 is divided by 2575302? 4 Calculate the remainder when 5313801 is divided by 16. 9 What is the	{ "pile_set_name": "DM Mathematics" }
5 (b) -2/3 (c) m (d) 2/11 b Suppose 2x = 5x. Let i be -34/(3 - 7). What is the second biggest value in -3, x, i? x Let r = -47 - -45. Let z(k) = -2k*3 + k + 1. Let i be z(-1). Suppose -it = 3h + 15, 3h + t - 2t + 15 = 0. What is the second smallest value in 2, r, h? r Let j(z) = -z2 - 9z + 38. Let k be j(-12). Which is the biggest value? (a) k (b) -0.2 (c) -2 a Let f = 696 - 695. Let h = 5.94 + -6. What is the biggest value in h, f, -3/2? f Let z = 0.9 - 0.8. Which is the second smallest value? (a) 3 (b) -2 (c) z c Let u be 2 - 0 - (-1 + -1). Suppose 5g - 4g - 46 = -m, 2m - u = 0. Let n be g/(-56) + 2/4. Which is the smallest value? (a) 3 (b) -2 (c) n b Let t be (3/(-6))/(3/(-5)). Let l = -2/159 + 55/159. What is the second biggest value in t, l, -4? l Let y = 8 - 11. Let p = -14 + 14. Let u = 0 - 0.1. What is the third smallest value in y, p, u? p Let p = 0 - -0.3. Let n = -1 - -4. Which is the third biggest value? (a) p (b) 0.5 (c) n a Let p(m) = -m + 2. Let q be p(0). Suppose -2h - qh = 32. Let o = -12 - h. Which is the third smallest value? (a) 0.3 (b) o (c) 1/5 a Let m = 22.3 - 22. Let t be (-18)/(-14) - (0 - -1). Which is the third biggest value? (a) t (b) 5 (c) m a Let x = 0.247 - -0.053. What is the smallest value in x, 2/5, 3/7? x Suppose -2p + 0p - 4s + 12 = 0, 5s = -p + 18. Let f be ((-1)/3)/(14/12). What is the smallest value in p, f, 0.3? p Let t = -7 + 12. Suppose -4m = ts - 4 - 1, -4s = 4m - 4. Let f = 3 - 5. Which is the biggest value? (a) s (b) f (c) 0.3 a Let p = 13 - 18. Which is the third biggest value? (a) 0 (b) -3 (c) p c Let i = 439/8 + -55. Let v = 0 - 0.2. What is the second biggest value in v, i, -5? v Let s = -4 + -1. Let v = 3 + s. Let n = -24 + 19. Which is the third smallest value? (a) n (b) v (c) -0.5 c Let i = -92 - -96. Which is the third smallest value? (a) 1 (b) -5 (c) i c Let r = 18 - 25. Let i = -9.4 - -2.9. Let k = r - i. Which is the second smallest value? (a) k (b) -1/5 (c) -5 a Let p = 28 + -27.6. Which is the second smallest value? (a) 5 (b) p (c) -3 b Let x = 1 - 0.6. Let g = 2.3 + -3.5. Let w = 3.2 + g. Which is the third smallest value? (a) 0 (b) w (c) x b Let x(u) = 2u - 4. Let y be x(0). Which is the biggest value? (a) y (b) -0.1 (c) 9 c Let m = -14.5 - -15. What is the second smallest value in 1/3, -3, m? 1/3 Let d be ((-1)/(-2))/((-2)/8). Let p be (2/(-46))/(-2 + 3). Let h = p + -65/92. Which is the biggest value? (a) d (b) h (c) -1 b Suppose -2i - 1 = -5p, 5i = -2p + 2 + 10. What is the second smallest value in -1, 8, i? i Suppose 5v + 4z + 25 = 0, -v + 2 - 7 = -4z. Which is the second biggest value? (a) 1/5 (b) -0.1 (c) v b Let o be 1/(-2)(1 - 7). Let s = -0.6 + 0.4. Let u = s - 0.3. What is the smallest value in u, o, 1? u Let l(o) = o*2 - 5o - 4. Let f be l(6). Let r = 4 - f. Which is the third biggest value? (a) 0.5 (b) r (c) -5 c Let x = 160 - 165. What is the third smallest value in x, 0.4, 0, -1? 0 Let u = 0.27 - 15.27. Let s = u + 13. Let k = -0.4 - 0.1. What is the second smallest value in s, 0.5, k? k Let l(m) = 2m. Let p be l(1). Let g be (p/6)/(2/(-4)). Let r = -47 + 46.5. Which is the smallest value? (a) r (b) g (c) -1/6 b Let i = 12 - 7. Let v = i + -8. What is the biggest value in v, -2, -0.4? -0.4 Let h = -3642/55 + 163/11. Let l = h + 52. What is the smallest value in -2, -1/7, l? -2 Let u = -10 + 16. Let v = u - 2. Let l = -3 + 2.9. Which is the second biggest value? (a) l (b) v (c) -4 a Let z = -359/54 + -12499/378. Let b = -40 - z. Let q = 1 + -0.8. What is the biggest value in q, b, 1? 1 Let p = 4 + -8. Let m = 2.1 + -1.6. Which is the third smallest value? (a) -0.3 (b) p (c) m c Let g = -29/21 - -5/7. Let s = 2 + 3. Let k(r) = -3r - 20. Let t be k(-7). Which is the third biggest value? (a) s (b) t (c) g c Let d be (-1 - 1)1/(-12). Suppose -2j + 4j - 10 = 0. Suppose 0b = -b - 3. What is the second biggest value in j, b, d? d Let i = 138 - 138.4. Which is the third biggest value? (a) -0.2 (b) i (c) -4 c Let t = -19 + 18. What is the second biggest value in t, -5, -0.2? t Let h = -132.35 - -132. Which is the second biggest value? (a) 0.1 (b) h (c) 4 a Let u be 4/(-26) - 5/52. Which is the smallest value? (a) u (b) -0.3 (c) -5 c Let l(w) = 6w - 51. Let f be l(8). Which is the smallest value? (a) 1/2 (b) 1/3 (c) f c Let v = 0.9 + -0.2. Which is the third smallest value? (a) v (b) -2/5 (c) 0.4 a Let t = 2/53 - 116/265. Which is the biggest value? (a) 3 (b) t (c) -5 a Let p = -93/212 + 10/53. Which is the second biggest value? (a) p (b) 5 (c) -1/11 c Let q be 1/106/(-3). Let g = -5 + 1. Let z = -4.5 - g. Which is the second biggest value? (a) -1 (b) z (c) q b Let k be (3/(84/(-16)))/(-1). Which is the second smallest value? (a) k (b) 0.5 (c) -0.1 b Let p = 12 - 8. Let c be (-2)/(-2) - (0 + -1). Suppose -3s = -c - 1. What is the third biggest value in -5, p, s? -5 Let l be ((-2)/(-4))/(3/18). Let n = 12.3 + -12. Which is the smallest value? (a) n (b) l (c) 0.4 a Let h = 0.06 + -0.11. What is the biggest value in -3, h, 0.2? 0.2 Let r = 0.1 + 0.9. Let y = r - 1. Which is the third biggest value? (a) -0.5 (b) -5 (c) y b Let i = 1.9 + -1.3. Let t = i + -0.5. Which is the third smallest value? (a) -3/4 (b) 6 (c) t b Let g be -36/(-4)6/9. Let s be (-8)/(-6)(-21)/(-2). Suppose 0 = -gx - 1 - s. Which is the smallest value? (a) -3/8 (b) x (c) -2 b Suppose -2q - 2l = -3q - 20, 2l = 4. Let t be 4/(q/2) - -2. Which is the third biggest value? (a) t (b) 17 (c) -0.3 c Let l = -28 + 29. Which is the smallest value? (a) -3 (b) l (c) 4 a Let q = -36.09 - -36. Which is the smallest value? (a) -2/3 (b) q (c) 1 a Let k = 1.03 - 0.13. Let u = -0.6 + k. What is the biggest value in -3, u, 2? 2 Suppose 4w = -3o + 9, -5o = -13 - 2. Let j = 0.4 + -2.4. Let q = 2 + -2.4. What is the second biggest value in w, j, q? q Let h = -114 - -1252/11. Let u = 9 - 6. Let j = 1 + u. Which is the second biggest value? (a) 0.2 (b) h (c) j a Let m(h) = -h*2 + 14h + 17. Let f be m(15). What is the smallest value in 3, f, 10, 5? f Let w = -2 - -6. Let b = w + -4.3. Let p = b + -0.7. What is the second smallest value in p, -2, -1/5? p Let k = 0.3 + -0.4. Let j = 737/5 + -147. Which is the third smallest value? (a) k (b) 14 (c) j b Let n be (-2)/(-12)(-16)/12. Suppose 4 = -v + 1. What is the second smallest value in -1, n, v? -1 Let r = -3.44 + 4. Let u = -0.16 + r. Let a = -4.96 - 0.04. What is the smallest value in a, u, 0.3? a Let k = -15 + 13.3. Let l = k + 2. Let g = 4.5 + -4. What is the third biggest value in g, l, 3? l Suppose 18 = -x + 5m, -8 - 10 = -3x - 3m. Let j be x/(-10)(4 - 7). Let w = j + 1/15. Which is the second biggest value? (a) 1/7 (b) -3/5 (c) w a Let j = 3.9 - 2.9. Which is the second biggest value? (a) j (b) -3/5 (c) -5 b Let y = -0.6 - -0.64. Let x = 0.36 + -0.3. Let d = x + y. Which is the biggest value? (a) 1 (b) -2 (c) d a Let l = -1 + 3. Let f = l - 2. What is the third biggest value in f, -3/2, 5? -3/2 Let f be 4/10 + (-19)/60. What is the second smallest value in 3, -4, f? f Let h(x) = 5x*2 - 2x. Let o be h(1). Let r be o1 - 114/42. Which is the third smallest value? (a) -1/8 (b) r (c) 3 c Let w = -8 - -12. Suppose -16r + 18 + 14 = 0. What is the smallest value in w, r, 1? 1 Let n = 1.1 - 0.5. Let x = 0.1 - n. Let w = 3.95 + -4. Which is the biggest value? (a) 0.4 (b) w (c) x a Let y be (-1)/(-3) - 3/27. Let l = 0.04 + -0.11. Let h = -2.93 + l. What is the smallest value in y, h, -5? -5 Let q = -167/12 + 41/3. What is the third smallest value in q, 4/3, -0.2? 4/3 Let d be (-4)/(-6) - 4/12. Let y = -12 + 17. Let h = 5.5 - y. What is the second smallest value in d, 1, h? h Let n = 12 + -13. What is the smallest value in 1/5, 0.4, n? n Let k = -17 - -21. Which is the third smallest value? (a) 1 (b) k (c) -0.1 b Let a = -1 + -1. Let k = a + 0. Let r be 3 - -2*(-1 - k). What is the second smallest value in 2, -2/9, r? 2 Let x be 1/(-2) + (-5364)/(-1848). Let z = x + -28/11. Let u = 1003/10 + -203/2. Which is the second biggest value? (a) u (b) 2/21 (c) z c Let s = 7 + -9. What is the seco	{ "pile_set_name": "DM Mathematics" }
z + 9. What is ni(k) - 18a(k)? 6k2 Let c(j) = -j2 - 4j. Let d(a) = 5a. Determine 5c(o) + 4d(o). -5o2 Let r(a) = 10a + 1. Let k(i) be the second derivative of i*3/6 + 15i. What is -22k(m) + 2r(m)? -2m + 2 Let c(v) = -3v*2 + v - 5. Suppose 4t = 7t + 15. Let k(z) = 1 + 5 + 2 + 5z*2 - 2z. Determine tk(x) - 8c(x). -x*2 + 2x Let x(z) = 2z2 - 2z + 2. Let g(w) = -7w2 + 5w - 2. Let f = -3 - -2. Let r(h) = h*2 - 1. Let o(s) = fg(s) - 3r(s). What is -2o(b) + 5x(b)? 2b*2 Let u(s) = -6s + 17. Let q(p) = -3p + 9. Calculate 11q(z) - 6u(z). 3z - 3 Let m(c) = c*3 + 4c*2 - 6c + 5. Let z(x) be the first derivative of -7/2x2 + 5/3x*3 + 6x + 1/4x4 + 1. Determine -5m(w) + 4z(w). -w3 + 2w - 1 Let l(t) = 12t3 - 6t*2 - 7t - 6. Let z(y) = -11y3 + 5y*2 + 6y + 5. Calculate 5l(u) + 6z(u). -6u3 + u Let h(o) = 3o*2 - 2 - 18o + 18o. Let l(m) = 10m*2 - 7. Determine -21h(c) + 6l(c). -3c*2 Let y(r) be the first derivative of 3r*3 + 4r*2 - 8r + 13. Let v(a) = 6a2 + 5a - 5. Determine 8v(l) - 5y(l). 3l2 Let r(t) = t3 + 2t - 3. Let f(k) = -k*3 - 13 + 12k*3 - 6k*3 + 9k. Determine -4f(d) + 18r(d). -2d3 - 2 Let z(d) = d - 3. Let x be z(5). Let j(p) be the second derivative of 3p + 0 + 1/2px + 1/6p*3. Let q(y) = -y - 1. Calculate -5j(w) - 4q(w). -w - 1 Let a(i) = 0i + 8 - i + 2i. Let c be a(-7). Let w = 2 + c. Let m(s) = 5s + 5. Let v(k) = -14k - 14. Determine wv(d) + 8m(d). -2d - 2 Let u(b) = 8b + 6. Let r(i) = -7i - 6. Let z(m) = -7r(m) - 6u(m). Let s(k) = -2k - 11. Calculate 3s(g) + 5z(g). -g - 3 Let t(q) = 4q - 6. Let i(n) = -4n + 5. Let v(c) = -2i(c) - 3t(c). Let b(j) = j - 3. Determine -8b(d) - 3v(d). 4d Suppose 0 = -4i + 5i - 5. Let k(t) = 2t3 - 4t*2 - 4t + 4. Let x(v) = -3v3 + 5v*2 + 5v - 5. Calculate ik(d) + 4x(d). -2d3 Let y(v) = 7v. Let b(d) = -35d. What is -2b(x) - 11y(x)? -7x Let x(l) = -7l2 + 2l - 6. Let y(p) = 35p - 104p - 1 - p*2 + 39p + 31p. Calculate -x(z) + 4y(z). 3z2 + 2z + 2 Let m(t) = -14t2 - 3t + 20. Let g(x) = -5x2 - x + 7. Let b(y) = 17g(y) - 6m(y). Let c(u) = -2u*2 + 6u - 6. Determine -6b(w) + c(w). 4w*2 Let y(v) = 5v*3 + 6v*2 + 6v - 6. Let x(s) = -s2 - s3 + 1 - 315s - 326s + 640s. Let l = -15 + 9. Give lx(b) - y(b). b*3 Let v(s) = s - 1. Let p(u) = 8u - 13. Determine -p(n) + 5v(n). -3n + 8 Let z(v) = -6v3 - 2v + 4. Let r(y) = -7y3 + y2 - 2y + 4. Determine 2r(o) - 3z(o). 4o3 + 2o*2 + 2o - 4 Let h(l) = 8l2 - 3. Let j(m) = 41m*2 - 14. Calculate 11h(q) - 2j(q). 6q2 - 5 Let q(o) = o3 - 6o2 + 6o + 6. Let k(n) = -3n3 + 17n*2 - 17n - 17. Suppose 3j - 7j = -64. Let m = -11 + j. Let t = m + -11. Give tk(l) - 17q(l). l*3 Let v(a) = -2a*3 - 4a. Let z(k) = k*3 + 3k. Give 3v(g) + 4z(g). -2g3 Let m(u) = -5u*2 - 7u. Suppose z + 7 = 4t, 2z - 5 = -2t + 1. Suppose 0 = -6n - 28 - t. Let f(c) = -4c2 - 6c. Determine nm(p) + 6f(p). p*2 - p Let d(m) = -6m2 + 3. Let s = -71 + 77. Let g(o) = o2 - 1. Give sg(p) + 2d(p). -6p2 Let d = 2 + 3. Let v(w) = -w + w3 - 1 + w. Let s(u) be the third derivative of -u6/40 + 5u*3/6 + 2u*2. Calculate dv(f) + s(f). 2f3 Let q(d) = 20d*3 + 100d*2 + 100d - 100. Let i(w) = w*2 + w - 1. Calculate 100i(z) - q(z). -20z3 Let h(o) = -71o + 3. Let f(q) = -143q + 5. What is 3f(p) - 5h(p)? -74p Let i(s) = -s*2 - s + 1. Let r(m) = -2m*2 - 4m + 4. Give -5i(c) + r(c). 3c2 + c - 1 Let h(y) = -y + 1. Let f(i) = -i2 + 4i - 3. Let m be f(3). Suppose 0 = -4l, -w + l + m = -1. Let u(x) = -5x + 4. Calculate wu(d) - 4h(d). -d Let a(u) = -u2 + u + 1. Let g(w) = -4w*2 + 1. Let m be (-6)/(-10) - (-10)/25. Suppose -3l + m = -2l. Determine lg(o) - 2a(o). -2o*2 - 2o - 1 Let d(h) = -4h2 + 3h + 4. Let j be ((-1)/2)/((-2)/(-36)). Let b be -2 - (j - -21). Let p = -3 - -11. Let i(a) = 6a*2 - 5a - 6. Give bi(x) + pd(x). -2x2 - x + 2 Let u(y) = -y2 + 6y + 2. Let a be u(6). Let j(l) = 3l2 + 1 + l2 + 0l - l - 5la. Let i(m) = 2m*2 + 4m - 4. Determine i(v) + 4j(v). -2v*2 Let c(y) = -6y*3 - 6y*2 + 5y. Let q(g) = 5g3 + 5g*2 - 4g. Let b be (-4)/12 + (-16)/(-3). Determine bq(k) + 4c(k). k3 + k2 Let p(l) = -7l - 5. Let w(u) = -4u - 3. Let o = 17 - 22. What is ow(z) + 3p(z)? -z Let z(h) = -h + 6. Let i be (49/(-35) - -5) + (-2)/(-5). Let f(t) = -t + 7. What is if(j) - 5z(j)? j - 2 Let z(f) = 3f2 - 3f + 5. Let w(s) = 2s2 - 2s + 4. Let d(o) = -o*2 - 5o + 46. Let y be d(-10). Determine yw(m) + 3z(m). m2 - m - 1 Let z(v) = -v2 - 1. Let a(c) = -c*2. Determine 4a(g) - z(g). -3g2 + 1 Let g(d) = -95d*3 - 9d + 7. Let c(o) = -47o3 - 4o + 3. Give 9c(h) - 4g(h). -43h3 - 1 Let w(o) = 2o. Let z(r) = -195r - 1. Let n be z(-1). Let p(y) = 4y - 194 + n. Determine -3p(u) + 7w(u). 2u Let v(x) = -2x + 3. Let d be 5/(30/(-12))2/2. Let p(s) = -1. Determine dv(f) - 6p(f). 4f Let o(r) = -7r3 + 5r*2 + 5r. Let y(k) = -3k3 + 3k*2 + 3k. Give 3o(m) - 5y(m). -6m3 Let a be 3 - 0(1 + -2). Let u(s) = -88 + 174 - 89 - 4s2. Let n(b) = -3b*2 - 2. Determine an(t) - 2u(t). -t2 Let c(n) = -n3 + 6n*2 - 6n + 7. Let f(s) = s*2 - s + 1. Suppose 5b + 1 = -4. Determine bc(d) + 6f(d). d*3 - 1 Let z be 2/1(-1)/(-2). Let q(j) be the first derivative of 2j3/3 + j2 + 2j + 78. Let f(o) = o + 0 - 1 + 2. What is zq(l) - 2f(l)? 2l2 Suppose t = -1, 3f + t + t = -5. Let w(u) = u - 1. Let m(v) = 2v2 + 4v - 6. What is fm(x) + 6w(x)? -2x2 + 2x Let p(w) be the second derivative of w*5/20 + 2w*3/3 - 2w*2 + 7w. Let c(b) = -b*3 - 3b + 3. Determine -4c(r) - 3p(r). r*3 Let u(v) = v. Let x(a) = a - 1. Let q(j) = 5j*2 + 7. Let p(h) = q(h) + 6x(h). Calculate -p(f) + 6u(f). -5f*2 - 1 Let z(m) = 57m*2. Let a(p) = -28p*2. Give 10a(c) + 6z(c). 62c*2 Suppose 0 = -2i + i + 5. Suppose h + j = -j + 6, -3j - 30 = -ih. Let f(t) = t + t - 3 + 0. Let o(w) = -9w + 13. Give ho(q) + 26f(q). -2q Let z(q) = 5q3 + 4q*2 - 4q + 1. Let i be (5 + 2 - 2) + 0. Let p = 2 - i. Let u(n) = -4n3 - 3n*2 + 3n - 1. Give pz(l) - 4u(l). l3 + 1 Let z(p) = -p3 + 1. Let h be z(2). Let r(g) = -2g - 3. Let x(v) = 3v + v - 3v + 2. Give hx(w) - 4r(w). w - 2 Let g(s) = -4s. Let a(r) be the third derivative of -r*4/24 - 15r*2. What is 7a(n) - 2g(n)? n Suppose 4n - 2q = q - 8, 4q + 8 = -4n. Let l = n + -4. Let w(t) = 5t + 2. Let c(k) = -4k - 2. Give lw(v) - 7c(v). -2v + 2 Let w(d) = -5d3 - 11d*2 - 31d - 11. Let r(o) = o*3 + 2o*2 + 6o + 2. Calculate -11r(t) - 2w(t). -t*3 - 4t Let b(h) = 1. Let x(y) = y*2 + 14y + 1. Let k be x(-14). Let l(a) = -3a - 1. Give kl(d) + 3b(d). -3d + 2 Let x(y) = 12y3 + 10. Let r(l) = l3 + 1. Let z(i) = -i - 8. Let w be z(-11). Let o be ((w + 17)-1)/(-2). Calculate or(a) - x(a). -2a*3 Let q(s) = 2s*3 + 3s2 - 3. Let o(f) be the third derivative of -f6/24 - 2f5/15 + 4f*3/3 + 2f*2. Let j = 8 + 0. Give jq(y) + 3o(y). y3 Let f(x) = -4x - 4. Let t = 23 + -14. Let l(m) = -5m + 6m - 8 + t. What is -f(s) - 2l(s)? 2s + 2 Let o = 89 - 85. Let c be (0 - -1)/(2/4). Let f(t) = -t + 1. Let k(n) = -1. Calculate cf(d) + ok(d). -2d - 2 Let x(q) be the third derivative of q6/120 - q3/6 + 7q*2. Let m(j) = -8j*3 + 7. What is 4m(f) + 28x(f)? -4f3 Let p(d) = d3 + d*2 + d - 1. Let m(q) = 5q*3 + 6q*2 + 6q - 5. Determine m(g) - 6p(g). -g3 + 1 Let b(w) = w - 7. Suppose 2f - 30 = -3f. Let h(v) = v - 8. Determine fb(k) - 5h(k). k - 2 Let m(l) be the first derivative of -18l*4 - 28l - 37. Let k(j) = 13j3 + 5. What is -28k(s) - 5m(s)? -4s3 Let m(p) = -p3 - 2p2. Let z = 20 + -22. Let u(s) = -s3 - s2. What is zu(b) + m(b)? b*3 Let n(d) = 13d*2 + 11. Let b(u) = -6u*2 - 6. Give 11b(l) + 6n(l). 12l*2 Suppose -5k + 5o = 20, -k + 6o = 2o + 19. Let n(f) = 6f*2 + 4 - 2f + 4 - 4. Let u(c) be the first derivative of -c*3/3 - c + 1. What is kn(r) + 5u(r)? r2 - 2r - 1 Let a(g) be the second derivative of -g*3/3 + 7g**2/2	{ "pile_set_name": "DM Mathematics" }
from {x: 2, m: 3, i: 1, q: 6, j: 7}? 0 Two letters picked without replacement from yryxy. Give prob of picking 1 y and 1 x. 3/10 Four letters picked without replacement from {i: 2, p: 16}. Give prob of picking 1 i and 3 p. 56/153 Four letters picked without replacement from {e: 2, s: 3, f: 1, k: 4, t: 4, b: 3}. Give prob of picking 1 f, 1 e, 1 s, and 1 t. 6/595 Calculate prob of picking 2 d and 1 m when three letters picked without replacement from {m: 4, g: 1, d: 6}. 4/11 What is prob of picking 1 h and 3 r when four letters picked without replacement from hrrrrh? 8/15 Calculate prob of picking 4 v when four letters picked without replacement from {e: 1, v: 1, q: 1, c: 2, y: 4}. 0 What is prob of picking 1 k and 1 c when two letters picked without replacement from {o: 1, k: 1, c: 3, p: 1, g: 1}? 1/7 Three letters picked without replacement from eywioeyoryew. Give prob of picking 3 e. 1/220 Calculate prob of picking 1 o and 1 c when two letters picked without replacement from soscooloolossls. 2/35 Two letters picked without replacement from pppffpf. Give prob of picking 2 p. 2/7 Two letters picked without replacement from aafaffaaafaffafaff. Give prob of picking 2 f. 4/17 What is prob of picking 1 d, 1 p, and 1 o when three letters picked without replacement from ooloyypyyhyldlo? 4/455 Three letters picked without replacement from {n: 1, b: 3, w: 2, q: 1, j: 3}. Give prob of picking 2 j and 1 b. 3/40 Three letters picked without replacement from {r: 1, u: 2, x: 1, e: 2, w: 3, g: 6}. Give prob of picking 1 e, 1 u, and 1 r. 4/455 Three letters picked without replacement from {m: 12, k: 1, n: 5}. Give prob of picking 1 n and 2 k. 0 Calculate prob of picking 3 y when three letters picked without replacement from yyyyyy. 1 Calculate prob of picking 1 k and 2 s when three letters picked without replacement from ssssssksssss. 1/4 What is prob of picking 2 d and 1 s when three letters picked without replacement from qbsdqsddqss? 4/55 Three letters picked without replacement from wwfswffffzssfwwf. Give prob of picking 3 w. 1/56 What is prob of picking 1 a and 1 x when two letters picked without replacement from {x: 2, d: 1, a: 3, p: 2, r: 2, e: 4}? 6/91 Three letters picked without replacement from etytn. What is prob of picking 1 e, 1 n, and 1 t? 1/5 Two letters picked without replacement from {j: 1, g: 5, w: 2, p: 1, k: 9}. Give prob of picking 1 j and 1 g. 5/153 Calculate prob of picking 3 i when three letters picked without replacement from ihhihrhhhhhiiii. 4/91 Two letters picked without replacement from kssssssssssssssssss. Give prob of picking 2 s. 17/19 What is prob of picking 3 r when three letters picked without replacement from {t: 4, y: 4, r: 9}? 21/170 Two letters picked without replacement from {r: 1, f: 4, n: 2, i: 1, g: 3}. Give prob of picking 1 f and 1 i. 4/55 Two letters picked without replacement from {r: 3, m: 6, y: 3, d: 3}. Give prob of picking 1 d and 1 y. 3/35 Two letters picked without replacement from {w: 3, a: 5, r: 1}. What is prob of picking 1 w and 1 r? 1/12 Calculate prob of picking 1 k and 3 b when four letters picked without replacement from bbkbkbbbkbkkkbkbbkkb. 99/323 Calculate prob of picking 3 m when three letters picked without replacement from mhmmummmmmm. 28/55 What is prob of picking 1 p and 3 t when four letters picked without replacement from {t: 3, p: 3, u: 2}? 3/70 Calculate prob of picking 4 b when four letters picked without replacement from hbbhhbshbbhsh. 1/143 Two letters picked without replacement from glkqs. What is prob of picking 1 l and 1 q? 1/10 Two letters picked without replacement from lccc. Give prob of picking 2 c. 1/2 What is prob of picking 1 y and 1 x when two letters picked without replacement from ayyybaxayaaxayx? 1/7 Calculate prob of picking 2 b and 1 n when three letters picked without replacement from bbnbbbbbbbbbbbbbbbb. 3/19 Three letters picked without replacement from ssmssssmsssssmssmsss. What is prob of picking 1 s and 2 m? 8/95 Calculate prob of picking 1 j and 1 l when two letters picked without replacement from {q: 2, i: 1, j: 2, s: 1, l: 1, h: 1}. 1/14 What is prob of picking 2 v when two letters picked without replacement from {g: 2, x: 2, v: 2, u: 4}? 1/45 Two letters picked without replacement from {s: 2, h: 2, l: 4}. Give prob of picking 1 s and 1 h. 1/7 Three letters picked without replacement from {u: 7, h: 2, r: 6}. Give prob of picking 1 h and 2 u. 6/65 What is prob of picking 2 h when two letters picked without replacement from hhchhhhhchhhch? 55/91 Calculate prob of picking 1 y and 1 z when two letters picked without replacement from ffzyzffyz. 1/6 What is prob of picking 1 b, 1 i, and 1 j when three letters picked without replacement from {j: 2, u: 2, b: 3, k: 2, e: 1, i: 2}? 3/55 Four letters picked without replacement from loolllllol. Give prob of picking 3 l and 1 o. 1/2 Calculate prob of picking 2 j and 2 c when four letters picked without replacement from jelcjjcjsjccllejjljs. 56/1615 Calculate prob of picking 1 n, 1 f, 1 i, and 1 q when four letters picked without replacement from {q: 2, i: 1, f: 2, n: 2, h: 1}. 4/35 What is prob of picking 1 u and 1 c when two letters picked without replacement from cuictytytyj? 2/55 Four letters picked without replacement from gnnnngg. What is prob of picking 2 g and 2 n? 18/35 Calculate prob of picking 1 y and 1 a when two letters picked without replacement from ayayyaaaaay. 28/55 Calculate prob of picking 1 n and 1 t when two letters picked without replacement from gyyyntt. 2/21 Four letters picked without replacement from dwwodiqdoodqddqqwq. What is prob of picking 1 w, 1 q, 1 i, and 1 o? 1/68 Two letters picked without replacement from {l: 1, k: 1, s: 1, o: 1, t: 1}. Give prob of picking 1 s and 1 l. 1/10 Two letters picked without replacement from {m: 3, b: 9}. Give prob of picking 2 m. 1/22 Calculate prob of picking 1 f, 1 j, 1 b, and 1 w when four letters picked without replacement from {j: 2, w: 4, f: 1, b: 2}. 8/63 Two letters picked without replacement from ybbyb. Give prob of picking 2 b. 3/10 Four letters picked without replacement from fuzuflfffffz. Give prob of picking 1 u, 1 f, and 2 z. 14/495 Three letters picked without replacement from osooosssos. Give prob of picking 2 s and 1 o. 5/12 Three letters picked without replacement from sssssmsssssmssms. Give prob of picking 3 m. 1/560 Calculate prob of picking 3 z when three letters picked without replacement from lzqzzzl. 4/35 Two letters picked without replacement from nwnwiiwnnnwnu. Give prob of picking 1 u and 1 w. 2/39 Two letters picked without replacement from nnrmmrcd. What is prob of picking 1 d and 1 c? 1/28 Calculate prob of picking 1 n and 1 k when two letters picked without replacement from {u: 1, n: 1, k: 1}. 1/3 Two letters picked without replacement from xnxpnpxppxnppn. What is prob of picking 2 x? 6/91 Four letters picked without replacement from ueueeueuee. What is prob of picking 4 u? 1/210 Three letters picked without replacement from mfzszlzsz. What is prob of picking 1 l, 1 z, and 1 s? 2/21 Four letters picked without replacement from {q: 2, t: 4, b: 1, e: 1, i: 1, p: 6}. What is prob of picking 1 b, 1 e, 1 p, and 1 q? 4/455 Three letters picked without replacement from guuubbbbggubugubgug. Give prob of picking 1 u and 2 b. 35/323 What is prob of picking 2 v when two letters picked without replacement from vssvsvvsvvssvs? 3/13 Calculate prob of picking 1 r and 1 i when two letters picked without replacement from {d: 1, o: 1, i: 1, r: 1, x: 1}. 1/10 What is prob of picking 3 w and 1 v when four letters picked without replacement from wvwwwwwwwwwwwww? 4/15 What is prob of picking 1 r and 1 i when two letters picked without replacement from {w: 4, i: 1, u: 4, r: 1}? 1/45 Calculate prob of picking 1 n, 1 m, and 2 x when four letters picked without replacement from {m: 8, x: 2, n: 1, f: 1, b: 1, r: 1}. 8/1001 Calculate prob of picking 1 m and 1 r when two letters picked without replacement from {n: 1, l: 1, w: 1, r: 1, m: 2, j: 1}. 2/21 Calculate prob of picking 1 q and 1 n when two letters picked without replacement from qsbnn. 1/5 Three letters picked without replacement from tltelcretrlllrcl. Give prob of picking 2 l and 1 r. 9/112 Wh	{ "pile_set_name": "DM Mathematics" }
for i. -3 Solve 1319 = 3a + 166u, -2a = -18u + 19u - 2 for a. -3 Solve t - 14t = 2q - 8t - 29, 0 = 72q + 2t - 510 for q. 7 Solve -2g + 2r + 19324 = 19340, 0 = -22g + 3r - 62 for g. -2 Solve -5v - 7v = 5r - 26v + 10v + 95, 0 = -v + 17 + 13 for r. 5 Solve -5 = -28m + 26m - 1, -p + 3 + 0 = 4m for p. -5 Solve 0 = 2x - 5s - 35, 4x + 116s - 119s = -0x + 35 for x. 5 Solve p - 3c + 4 = 0, -18 + 50 = -4p + 4c for p. -10 Solve -6m + 2m = 16, -5n + 295m + 141 = 291m for n. 25 Solve 13d - 11d - 4p - 39 = -201, 4d + d = -3p + 102 for d. -3 Solve 2y + 1 = -3i, 1094y - 218 = 70i + 1092y for i. -3 Solve i + 3j = 84630 - 84643, -2i - 18 = 4j for i. -1 Solve -2w + 170 = 3m, 84w - 79w = -2m + m + 35 for w. -5 Solve 5o = 8c, -2c + 47o + 50o = 98o for c. 0 Solve 12158q + 33 = 12161q + 2t, 3q - 6t = -7t + 24 for q. 5 Solve -5h - 5t = -60, 2461h - t + 71 = 2464h + 25 for h. 17 Solve -80 = 2j + 1420d - 1418d, 0 = -3j + 2d + 75 for j. -1 Solve -3o = 127q - 30q - 218, 3q + 2 = o for o. 8 Solve 106 = -4u - 2l, 37u + 0l - 5l + 50 = -954 for u. -27 Solve 916k - v - 78 = 919k, -3v = -11k - 286 for k. -26 Solve -51d + 50d = -u + 4, d + 5u = 38 for d. 3 Solve -2831h - k + 0 = -2835h + 2k - 58, -5h = 11k + 102 for h. -16 Solve -1300o + 1305o + 55 = 0, 8 = -7a - 5o - 40 for a. 1 Solve -111 - 30 = -z + n - 14n, -2z - 5n = -51 for z. -2 Solve -6x - 2n + 11 = -x - 2x, -18x - 4n + 56 = -n - n for x. 3 Solve 5v + 4b = -50 - 73, 8v = -5b - 242 + 39 + 51 for v. 1 Solve 38q - 28q - 9l - 57 = 9q, -4l = 20 for q. 12 Solve 21320030g + 0 + 5 = -3c + 21320031g, 2c - 2 = -2g for c. -1 Solve 231b - 5v = 228b - 65, -5b - 83 = -2v for b. -15 Solve 5o - l = 1, -179o = -268o + l + 85 for o. 1 Solve 3u - 2o = 61, -37315o + 37313o = -4u + 58 for u. -3 Solve -3151i = 4q - 1577i - 1573i + 22, i + 16 = -2q for q. -3 Solve -5o - 4j = 157 - 185, 11o - 16j = -7o + 14o - 16 for o. 4 Solve -r = -12426a + 12425a + 4, 8 = 2a - r for a. 4 Solve z - 5y - 78 = -0z - 2y, 10401 = 2y + 10451 for z. 3 Solve -3z + 4o - 6 - 1 = z + 45, -8 = -3z + 4o - 61 for z. 1 Solve -3a = a + 4l + 44, -8a - l + 178 = 210 for a. -3 Solve 853n - 1699n + 78 = 8v - 843n, -4v + 26 = -2n - 3n for v. 9 Solve 5r + 4u + 72 = 0, 3u + 55 = 149r - 153r for r. -4 Solve -3k = 24k - 2q - 26, 5k - 10k - 90 = 2q for k. -2 Solve -2803q + 47 = -2810q + 6w, -5w + 45 = 0 for q. 1 Solve 1803o - 1808o + 2l = -10, 5o = 37l + 185 for o. 0 Solve -r + 10d = 1634 - 1570, -2r - 3d + 10 = 0 for r. -4 Solve 4n = -3s + 12, -7n + 4s = -1338822 + 1338875 for n. -3 Solve 0 = -2f + 6f + 187z + 286, z + 38 = 4f - 52 for f. 22 Solve 0 = -x - 5, -m + 368 - 383 = 3x for m. 0 Solve -3j - 32 - 30 = -f, -2j + j - 26 = 5f for j. -21 Solve -3j - 271 = -5d - 362, 47 = d - 6d + j for d. -5 Solve 266467s - 266470s + 81 = -3p, 7p - 10 - 47 = 2p - s for p. 5 Solve 9564f = -5a + 9567f - 65, 0 = -a - 4f + 56 for a. -4 Solve 99q - 160q = -59q + h - 13, -4q + 5h + 19 = 0 for q. 6 Solve -55s + 72s + 5f - 27 = 78, -53 = 2s - 3f + 71 for s. -5 Solve 4t = -2c - 36, 141t + 363 = 1721c - 1716c for c. -12 Solve -j + 2j - 3j + s - 76 = 2j + 6s, -j + 8 = -s for j. -4 Solve -2z = 6r - 10, 7z - 1 = 8z - 0 for r. 2 Solve 3i + 27 - 97 - 51 - 6 = -22g, -4g + 220 = 4i for i. 57 Solve 44961 = 7a - 5z + 45478, 15 = -5z for a. -76 Solve -z - 3h + 8 = 0, 8z = -2z + 12z - 5h - 38 for z. 14 Solve 3g + 31 = -4m, 4g - 52 = 101763m - 101759m for g. 3 Solve -3i + 2c - 78c + 62 = -5i, 5i + 5c = 76 - 35 - 1 for i. 7 Solve -9b - 5a + 4778 = 4625, -127 = 4b - 5a for b. 2 Solve -2y + 5x + 502 = 2y, 0 = 4x + 1934 - 1526 for y. -2 Solve 9 = -3d - 14510k + 14511k, -16 = 4d + 3d - 4k for d. -4 Solve -3336f + 3334f + 2w + 38 = 0, 0 = w + 22 for f. -3 Solve 4b - 549275v - 30 = -549277v, -18b + 5v = -65 for b. 5 Solve 0 = 2p - 4j - 60, 0 = -38p + 37p + 5j + 13 + 32 for p. 20 Solve 4s = 4w, -154860s + 33 = -154850s + w for s. 3 Solve b = 4y + 81, -129773y + 129771y = -3b + 33 for b. -3 Solve -13g + 72 = -5f - 94, 8g - 45 = f + 53 for f. -2 Solve 3y + 32s - 14 = 31s - 0, 4s = -42y + 56 for y. 0 Solve a - 104 = 237z - 10294, -5z + 212 = -0z - 3a for z. 43 Solve 20p = 20p - 3n - 3, -3n = -p - 5n - 7 + 10 for p. 5 Solve -2859l = q - 2855l + 50, -4q - 95 = -5l for q. -30 Solve -4z + 72 = 4y, 318y + 186 = 13z + 631y - 314y - 20 for z. 16 Solve 2s + 2969 - 2953 = -g, -3s = 13 - 7 for g. -12 Solve 7l - 2w - 182 = -22l - 3l, -w = -3l + 26 for l. 5 Solve -97y + 86 - 18 = -92y + 12k - 30k, -68 = y + 10k for y. -8 Solve -5y = -2k + 21, 5k = 95y - 78586 + 78226 for k. 23 Solve 185q - 188q = 5u + 185, 0 = -4q - 2u - 88 for q. -5 Solve -6x + 84 = 3o, -20o + 132 = -2x - 16o for x. -2 Solve 222u = -2k + 220u + 36, k - 3u = -34 for k. 5 Solve -5c - 4o - 37 = 0, 0 = 4c - 2068660o + 2068667o + 41 for c. -5 Solve -18y - 167 = -t - 257 - 453, 159 = -3t + 5y for t. -3 Solve 16w - b + 264 = 6w, -21 = -5w - 4b - 119 - 16 for w. -26 Solve -2p + 5v + 2v - 66 = 0, 0 = -345p + 346p + 5v - 1 for p. -19 Solve -23 + 40 = 2m - 2y - 63, m - 3y = 42 for m. 39 Solve -40775b + 6 + 5 = w - 40772b, 4w + 5b - 23 = 0 for w. 2 Solve -3s - 23f - 3 = -26f, 2s + 206f + 130f = -1354 for s. -5 Solve 20m - 45m = -9k - 24m - 46, -5m + 95 = 0 for k. -3 Solve -11g - 156 = -5q, 6797q - 6794q = -12 for g. -16 Solve b - 3b - 3h = 25, 8b - 25h = 6b + 59 for b. -8 Solve -146d - 24q - 78 = -150d - 21q, 3d = q + 31 for d. 3 Solve l = 7, 70k - 132k + 10l - 64 = -65k for k. -2 Solve -3h + 4b = -106, -3h + 168149b - 168144b = -134 for h. -2 Solve 4y + 96 = -4s, 0 = -40s + 35s - 3y - 308 + 188 for s. -24 Solve 43 = -5t - 3b, 7890 - 7982 = 8t - b for t. -11 Solve -s - 12 - 2 - 12 = -42x + 11, 0 = -2s - 74 for x. 0 Solve 4 = -r - 4q, 0 = 24r + 696q - 699q - 3 for r. 0 Solve 10756 - 10760 = 2q, -3w - 3q = 0 for w. 2 Solve 4w - 5n - 43 - 18 = 0, -24w - 2n + 335 = -n for w. 14 Solve 8 = 4n - 4s + 48, 309s - 305s = 2n + 38 for n. -1 Solve s - i + 2 = 3, -32i + 37i = -0s + 10s + 12s + 97 for s. -6 Solve i - 25916 = 3g - 25929, -5i - 9g = 17 for i. -7 Solve -3b - 72u - 244 = -b - 67u, -20b - 5u = -21b + 253 for b. 3 Solve -3l + 11 = 2b, 12l - 3b + 153 + 154 + 168 - 508 = 0 for l. 3 Solve -4w - 239o = -235o + 236, 3o + 187 = -5w for w. -5 Solve -3p + 9l = 10l - 62, 2p + 68l + 97 = -54l - 17l for p. 21 Solve -4h = -4m, 18m - 8m - 2m - 12m = h - 25 for m. 5 Solve -5n + 20847899u - 20847892u + 381 = 0, -55 = -n + u for n. 2 Solve 0 = 4m - 59n + 98, -3m + 0 + 9 = 2n - 10 for m. 5 Solve 0 = -3z - 3i + 78, -2z + 20995i = 20991i + 134 for z. -5 Solve -3w + 31978 - 32212 = -3x, 0 = -w for x. 78 Solve -11 = -5y + 5x - 1, 77x = 75x - 8 for y. -2 Solve -2t + 2d + 6 - 14 - 14 = 0, 5d = -t - 4t + 85 for t. 3 Solve -2h - 49 + 52 = t - 32, -2h = -6t - 42 for h. 18 Solve -143a = -45a - 97a + m - 6, 3a + 2m = 13 for a. 1 Solve -2i - 76 = -3g - 2g + 27, 251i + 2g - 45 = 248i for i. 1 Solve 0 = 101z - 114z - 6y - 184, -3y = -4z + 50 for z. -4 Solve 10 = -r + 5t - 2t, -t = -73705r + 73702r + 2 for r. 2 Solve -2i - y = 5, -2035313y + 17 = -2i - 2035318y for i. -1 Solve -7 = -a + 3o + 6, 6a = -9859o + 9857o + 38 for a. 7 Solve 0b - 3g + 8 = -2b + 78, -2b - 2g + 91 - 141 = 0 for b. -1 Solve h - 6h = 4z - 44 + 126, 9h = -3z - 156 for z. 2 Solve -8l = -4v + 7 - 36 - 7, -3v = v - 6 - 6 for l. 6 Solve 9i - 78 = 4w + 74 - 52, -99w + 5i = 1604 for w. -16 Solve -x = 4n + 96, -5n - 83x + 84x = 129 for n. -25 Solve 11g = -u - 14g - 11g + 95 + 101, 2g - 10 = 0 for u. 16 Solve 3m = 5w - 77, 0 = 7926w - 7922w + 3m - 67 for w. 16 Solve 0 = -1033b + 1030b + 5n + 28, -2b - 3b + 5n + 40 = 0 for b. 6 Solve 0 = 14h + 3s - 135, 96 = 9h + 381s - 376s for h. 9 Solve 2b = -2y + 4b - 16, 35y - 31y - 64b - 268 = 0 for y. -13 Solve -83u - 86u + 2f = -170u - 6, 2*u =	{ "pile_set_name": "DM Mathematics" }
9, w, y Let s = -1 - -4. Suppose 2w - 18 + 5 = 3d, -3d - 12 = -3w. Put w, 1, s in decreasing order. s, 1, w Let k = -2.2 + 2. Let h = 3 - -1. Let s = -1 - h. Sort s, 0.3, k in increasing order. s, k, 0.3 Let j = -6 + 5. Let l = 5 + j. Put l, -2, 1/4 in descending order. l, 1/4, -2 Suppose 3 = -5k + 4t - 1, -4t + 4 = 3k. Suppose kj = 4j - 20. Suppose -3z - j = 1. Sort z, 1, 3 in ascending order. z, 1, 3 Let m = -3 + 3.2. Let s = -12 - -10. Let t be 11/(-3) - (s - 1). Put m, t, -1/3 in decreasing order. m, -1/3, t Let u(p) = 8p*2 + 2 - 13p*2 + 0 - 8p + 6p2. Let k = 4 + 3. Let j be u(k). Put j, -4, 5 in decreasing order. 5, -4, j Let h = -0.3 - -0.2. Let a = h - 0. Let n = -0.001 + 0.301. Sort n, -4, a. -4, a, n Suppose 3x + 57 = -3t + 6t, t = 5x + 23. Suppose -2o + 3l = t, -5l - 20 = 3o + 2o. Let g be 1 - (o/(-4) - 1). Put -0.5, g, -1/10 in decreasing order. g, -1/10, -0.5 Suppose 3g + 3 = -2a, -4g - 9 = a + 5. Suppose 0 = -2d + 2b + 12, 3b - 3 = -a. Put 3, -2, d in increasing order. -2, 3, d Let y = 2.3 - 2.5. Put 0.5, 0.3, y in ascending order. y, 0.3, 0.5 Let u = 0.3 + -4.3. Put 3, u, -2/5, -2 in decreasing order. 3, -2/5, -2, u Let z(u) = u*2 - 7u + 9. Let h be z(6). Put 5, h, -4 in ascending order. -4, h, 5 Let u(r) = -r + 5. Let w be u(6). Let z be 5 - 2 - 0 - 0. Let v be (3/(-5))/(z/(-15)). Sort 5, v, w. w, v, 5 Let z = -12 + 16. Put -2, z, -1 in descending order. z, -1, -2 Let q = -11 - -7. Let t be (2/30)/(q/(-24)). Let y = -2/253 + 532/3289. Put t, y, -5 in descending order. t, y, -5 Let b = 0.6 + 1.4. Sort -0.14, -0.1, 1, b. -0.14, -0.1, 1, b Suppose -x + 3b = -0b - 12, -4 = b. Let w(a) = xa + 0 - 1 + a. Let t be w(5). Sort t, -5, -3. -5, -3, t Let y(f) = f - 1. Let t be y(4). Let r be 2/5 - (-81)/(-15). Sort -4, t, r in increasing order. r, -4, t Let c(b) = -b - 5b + 47 - 40 - b*2. Let d be c(-7). Suppose -5 + 1 = 4t. Sort 4, t, d in increasing order. t, d, 4 Let n(y) = 5y + 7. Let s(j) = j + 1. Let r(d) = n(d) - 6s(d). Let c be r(1). Suppose c - 3 = -x, -3b = x - 15. Sort -2, 5, b in ascending order. -2, b, 5 Suppose -24 = 2g - 16. Put 3, -1, g in descending order. 3, -1, g Let j = 119 + -121. Let v = -4 - -8. Put j, -9, v in decreasing order. v, j, -9 Suppose 0 = t - 3t - 10, 0 = -2a - 4t - 38. Sort -2, a, 1 in descending order. 1, -2, a Let a = -14 + 16.9. Let d = a + -3. Sort -3, 0.4, d in descending order. 0.4, d, -3 Let t be 2/(-13) + (-16424)/52. Let a = 2531/8 + t. Let g = -11 - -15. Sort g, 0.5, a. a, 0.5, g Let o = 29 - 21. Let r be 1 + -1 - (-12)/o. Put r, 5, 0.2 in decreasing order. 5, r, 0.2 Let b = -10 - -6. Let t be (-30)/8 + 1/b. Sort -2/5, -1, t. t, -1, -2/5 Let i(t) = -t2 - 4t + 3. Let l be i(-6). Let r = l + 5. Suppose -4h - 20 = 4u, 10h = 5h. Put 3, u, r in ascending order. u, r, 3 Let g = -9 + 9. Suppose g = 2u, -5u - 9 = 2n - 3. Sort -1, -5, n in decreasing order. -1, n, -5 Suppose 3r = -4c - 7 + 3, 5r = 4c + 4. Suppose 11 = 5y - 2i - 4, y + i - 10 = 0. Sort y, c, -4 in increasing order. -4, c, y Let k = 64 - 190/3. Let y be 20/(-10) + (-6)/(-4). Put y, 0.4, k in decreasing order. k, 0.4, y Let v = 7 - -3. Let w = v + -5. Put -1, w, -5 in ascending order. -5, -1, w Let s = 0.16 - 0.49. Let a = s - -0.03. Sort -4, a, 0.3 in decreasing order. 0.3, a, -4 Let w(f) = 3f*2 + 1 + 8 - 2f*2 + 8f. Let b be w(-7). Let m(n) = -n*2 - 11n - 17. Let a be m(-9). Put a, b, -3 in decreasing order. b, a, -3 Let m be ((-8)/(-2) - 3)-2. Suppose -b + 35 = 4b. Suppose -3z - 2a = -ba - 20, -4a = -z + 9. Put m, 0, z in decreasing order. z, 0, m Let x = -5.6 + 4. Let l = x - 0.4. Let j = l - -4. Put -3, j, 1 in increasing order. -3, 1, j Suppose 6 - 2 = 2d. Let f be 7/((-3)/3) - -2. Sort -0.3, d, f. f, -0.3, d Let a(n) = -2n*2 + n + 1. Let k be a(2). Suppose -3r = 3, -3z + 3 = -4r + 7r. Suppose -f = -zf + 3. Sort f, k, -4 in decreasing order. f, -4, k Let d = -53 - -21. Let t = -45 - d. Put 2, -3, t in descending order. 2, -3, t Let y be 124/32. Let l be ((-6)/(-165))/((-4)/20). Let n be (-1 - 1) + (-16)/(-6). Sort y, n, l in descending order. n, y, l Let z(j) = -j*3 - 5j*2 + 5j - 6. Let f be z(-6). Sort -0.3, f, 0.5, -2/3 in descending order. 0.5, f, -0.3, -2/3 Let y = -4/25 - 38/75. Sort y, 0.04, -5 in ascending order. -5, y, 0.04 Let p be (2/10)/(5/25). Sort -4, -17, p. -17, -4, p Let o = 10 - 10. Suppose 5u - 8 = 7. Suppose o = ut - 6t + 6. Put -1, t, -3 in descending order. t, -1, -3 Let y be (-2 - (-7)/4)23. Let d = -2/255 + 39071/7140. Let g = y + d. Sort -2/3, g, -5. -5, -2/3, g Suppose 0 = 4i - 20, z = -2z + 4i - 14. Suppose -12 = -2v - zv. Suppose -d = -5a - 3, -5a - d = -4d + 9. Put a, v, 1 in descending order. v, 1, a Let s be (-1)/3 - (-4)/(-6). Suppose 2o + 0o - i = 3, 4o = -i + 3. Suppose 16 = 5h + o. Put 5, s, h in decreasing order. 5, h, s Suppose -2z + 4 = -2m, -z = 2m - 1 - 10. Sort m, -3, -2 in increasing order. -3, -2, m Suppose -c + u - 3 = 4u, -2u = -c + 7. Let h(i) = -i + 5. Let t be h(4). Let m = t + 0. Sort c, 2, m. m, 2, c Suppose 4m = -3f + 3m - 12, -2m = 2f + 4. Let q = -29 - -27. Sort -1, q, f in decreasing order. -1, q, f Suppose -3f = -4j + 5j + 16, 3f - 4j + 11 = 0. Sort -1, f, 3, 1 in increasing order. f, -1, 1, 3 Let h(o) = -o3 + 10o*2 + o - 10. Let u be h(10). Put -1, u, 4 in decreasing order. 4, u, -1 Let i(g) = -g + 30. Let o be i(19). Let s = o - 9. Put 4, s, -4 in increasing order. -4, s, 4 Let k be 1/(-5)10/(-8). Let m = -9 + 8. Sort m, k, -2 in increasing order. -2, m, k Suppose -3n = -0n - 3. Sort -2, n, 2 in descending order. 2, n, -2 Let x = 0.02 - 5.02. Let k = 0.12 + -0.02. Sort x, 2, k in decreasing order. 2, k, x Suppose -2t = 5g + 31 - 11, -3g - 4t - 26 = 0. Let r be 0(3 - 5)/g. Suppose r = -5j - 1 - 4. Sort -5, j, -3. -5, -3, j Let b = 1 + 0. Let d = 1132 + -1131.7. Put -0.3, b, d in decreasing order. b, d, -0.3 Let b = -1 + -1. Suppose w + 5y = 1 + 6, 3w + y - 7 = 0. Suppose wf + 10 - 2 = 0. Put b, 0, f in descending order. 0, b, f Let l be (0/2)/(-2 + -1). Let o be 2(1 - 3/6). Suppose -5n - 11 = -o. Sort l, n, 4. n, l, 4 Let t be (-1)/(-8)21. Let a = -0.3 - 0.7. Sort a, t, 0.4 in ascending order. a, t, 0.4 Let j = -22 + 24. Put -2/13, j, 0.1 in ascending order. -2/13, 0.1, j Let w = 7/24 + -19/120. Sort w, -0.2, 10, 1. -0.2, w, 1, 10 Let p(r) = r3 + 5r*2 + 3r - 3. Let x be p(-4). Let h = 7 - -8. Let b = -17 + h. Sort b, 5, x in decreasing order. 5, x, b Let p = 49/20 + -9/4. Suppose 28 = -3k + 19. Sort 4, p, k in descending order. 4, p, k Suppose -4y + 1 + 15 = 0. Sort -8, 3, y. -8, 3, y Suppose 0 = 3b - 15, -b = 2m - 0b - 7. Let q = 0 - m. Let a be (1 - 3)/(2/3). Put q, a, 5 in descending order. 5, q, a Let c = -5641/19 + 297. Let y(s) = 12s - 2. Let i be y(-2). Let r be (56/i + 2)1. Put r, 1, c in decreasing order. 1, c, r Let r = -30 - -27. Suppose -3z + 13 = 4m, 0 - 11 = -5z - 4m. Put z, -2, r in descending order. z, -2, r Let m = -0.2 - 3.8. Let c = m - -3.4. Let d = c + 1. Sort -2/3, -2, d in descending order. d, -2/3, -2 Let z = 32.5 + -32. Put -2/7, -2, z, -2/5 in increasing order. -2, -2/5, -2/7, z Let t = 163 + -159. Put t, 2, 1 in increasing order. 1, 2, t Suppose 5s + 39 = -3k, -17 - 35 = 4k - 4s. Let o = -14 - k. Sort o, 1, 3. o, 1, 3 Let b(p) = p2 + p - 2. Let r be b(2). Suppose c - 10 = 3c. Let q(a) = -a*3 - 4a*2 + 5a - 2. Let x be q(c). Sort -4, r, x in descending order. r, x, -4 Suppose 2a - 2 = -8. Put 5, a, 4 in ascending order. a, 4, 5 Let b(f) = f - 2. Let d be b(5). Suppose 0 = -4i - 2m + 22, -m - 13 - 4 = -5i. Suppose -4p + 16 = 0, 2t = t + ip - 14. Put 4, d, t in ascending order. t, d, 4 Let d be ((-50)/(-1))/(-4 + 5). Suppose -h = h - p - d, 0 = 5h + 2p - 125. Suppose 10 - h = -3i. Sort i, 0, -4 in descending order. i, 0, -4 Let r be 1/(-3 - 36/(-8)). Put r, 0.2, 0.4 in decreasing order. r, 0.4, 0.2 Let g = 0.28 + -1.38. Let r = g + 1.6. Sort -0.4, -3, r. -3, -0.4, r Suppose -13f + 12f + 3 = 0. Suppose l - 20 = 5l. Sort l, f, -3/2. l, -3/2, f Let c = 20 - 15. Suppose -20 = -o + 5o. Let p = o + c. Put 2, -4, p in increasing order. -4, p, 2 Suppose -7b + 4b + 5h - 22 = 0, 4	{ "pile_set_name": "DM Mathematics" }
j(v). -2v(v - 6)(v - 1) Let m(p) be the second derivative of -p4/30 - 5p*3/6 - 33p*2/10 + 4106p. Find u, given that m(u) = 0. -11, -3/2 Suppose 24q3 + 138q*2 + 4q*3 + 77163q*4 - 77161q*4 + 288q + 216 = 0. Calculate q. -6, -3, -2 Let g(u) = 2u2 + 6u - 2. Let i be g(-4). Suppose 2 = -is + 14. Factor 74 - 74 + 8m + 42m3 - 98m*4 + 48m*s. -2m(m - 1)(7m + 2)2 Let j(c) = 14c*2 + 31c - 9. Let x(s) = s*2 - s + 2. Let g(z) = -j(z) - 4x(z). Let m(y) = 9y2 + 13y. Let i(n) = -2g(n) - 5m(n). Factor i(o). -(o + 1)(9o + 2) Let b(v) be the second derivative of -7/9v3 + v + 1/30v*5 + 26 - 1/9v*4 - 4/3v*2. Factor b(w). 2(w - 4)(w + 1)2/3 Let n = 13974/11 + -41834/33. Let h = -2 - -6. Factor hk*3 + 2/3k*5 + 2/3k + 8/3k4 + 0 + nk*2. 2k(k + 1)4/3 Determine x, given that -5x*4 + 578/7x - 221/7x2 + 0 - 1/7x*5 - 321/7x*3 = 0. -17, -2, 0, 1 Let b be (6 - 5)/((-2)/(-318)). Let d = 430 - 271. Let -d + b + 0n*3 + 4n - n*3 = 0. What is n? -2, 0, 2 Let z be ((-120)/(-144) + -1)-60. Factor zo2 - 175o*3 - 2695/6o*4 + 20/3o + 0. -5o(7o + 2)2(11o - 2)/6 Let s(f) be the third derivative of 0 + 2/9f*4 + 16/45f*5 + 0f*3 - 32/315f*7 + 1/30f*6 + 0f - 1/36f8 - 149f*2. Find j, given that s(j) = 0. -2, -1, -2/7, 0, 1 Let t be (48/1216)/(3/8). Let v be -6(7 + (-135)/19). Factor -vi - ti*2 + 14/19. -2(i - 1)(i + 7)/19 Let q = 147 - 144. Determine s so that -22s + s5 + s5 - 2s4 - 33s*3 + 96s*q + 6 + 28s*2 - 41s*3 - 34s*3 = 0. -3, 1 Let f(z) be the second derivative of -1/12z*3 + 1/2z*2 - 3z + 1/40z5 + 9 - 1/8z*4 + 1/60z6. Factor f(o). (o - 1)2(o + 1)(o + 2)/2 Let o(x) be the first derivative of -x*4/6 - 20x*3/9 + 91x*2/3 - 160x/3 - 2102. Find u, given that o(u) = 0. -16, 1, 5 Let k = -13052 + 65269/5. Let p be (4/(-10))/(4/(-20)). Solve kz + 3/5z*3 + 27/5 - 3z*p = 0 for z. -1, 3 Suppose 6k + 2k - 27 = -11. Let a(u) be the first derivative of -5u*4 - 4 - 2/3u*6 + 8/3u*3 + 16/5u*5 + 0u*k + 0u. Suppose a(p) = 0. Calculate p. 0, 1, 2 Let c(o) be the third derivative of -1/120o6 - o2 + 4o - 13/12o4 - 8/3o*3 + 0 - 11/60o*5. Factor c(t). -(t + 1)(t + 2)(t + 8) Let r(m) be the third derivative of m5/30 + 39m*4/4 + 230m*3/3 + 13686m*2. Factor r(q). 2(q + 2)(q + 115) Let u(k) = 6041k - 6036. Let p be u(1). Solve 0d4 + 0 - 1/3d + 8/9d2 + 1/9d*p - 2/3d3 = 0 for d. -3, 0, 1 Let q(d) be the second derivative of -d4/42 - 5d3/21 + 24d*2/7 + 3359d + 1. What is b in q(b) = 0? -8, 3 Let s be -3 - 55/(-20) - 297/(-324). Let r(p) be the second derivative of -sp3 - 12p*2 + 33p + 1/3p4 + 0. Factor r(v). 4(v - 3)(v + 2) Suppose 19j - 37 = 1. Let -22 - 2dj - 9 - d3 - 10 + d + 43 = 0. Calculate d. -2, -1, 1 Let g(s) be the third derivative of s7/420 - s6/30 + s5/20 + s4/6 - 7s*3/12 + 354s*2 + s. Suppose g(w) = 0. Calculate w. -1, 1, 7 Let r(p) = 2p*2 + 4p - 1. Let q(j) = 16j2 + 76j + 79. Let m(d) = -2q(d) + 18r(d). Let m(h) = 0. Calculate h. -2, 22 Let 2z2 - 213z - 77 + 114z - 279z - 303 = 0. Calculate z. -1, 190 Factor 8762043 + 3/4m2 - 5127m. 3(m - 3418)2/4 Let r be ((-22)/40)/((-902)/6765). Factor -9/4 + 3/8w*4 + rw - 9/8w3 - 9/8w*2. 3(w - 3)(w - 1)2(w + 2)/8 Suppose -68v4 + 18494 - 1950v3 + 63814 - v5 - 62453v - 18088v*2 + 252v*3 = 0. What is v? -19, -12, 1 Let k(u) = -3160u*2 + 1390u + 25. Let s(o) be the first derivative of -81o3 + 107o*2/2 + 2o + 239. Let p(v) = -3k(v) + 40s(v). Factor p(m). -5(2m - 1)(24m + 1) Let s(v) be the first derivative of -5/2v4 + 0v*2 + 19 + 0v - v*5 - 5/3v*3. Factor s(m). -5m*2(m + 1)*2 Let m(h) = -17h*3 - 34h*2 - 21h + 4. Let n(i) = 37i3 + 69i*2 + 41i - 9. Let j(u) = -9m(u) - 4n(u). Factor j(z). 5z(z + 1)(z + 5) Let b(d) = d3 + 6d*2 - 3d - 20. Let o be b(-6). Let f(g) = g*2 + 247g - 266. Let s(w) = 62w - 66. Let v(q) = of(q) + 9s(q). Solve v(x) = 0 for x. 1, 31 Suppose -5u + 18 - 70 = -3r, -5r - 2u + 97 = 0. Factor -5g*4 + rg - 9g - 2g*4 - 1 + 5g*3 - 24g*2 + 17g3. -(g - 1)3(7g - 1) Let h(b) be the second derivative of -b*4/66 + 125b*3/33 + 126b*2/11 - b - 1055. Factor h(t). -2(t - 126)(t + 1)/11 Suppose -216/7m + 4/7m2 + 2916/7 = 0. Calculate m. 27 Let a(y) be the second derivative of 221y4/60 - y3/30 - 2y + 21. Factor a(q). q(221q - 1)/5 Let n(a) = -4a + 29. Let s be n(6). Let f be 0(s + 33/(-6)). Solve 0w*3 + 0w*2 + 2/3w*4 + f + 2/3w*5 + 0w = 0 for w. -1, 0 Factor 6w2 - 192/7 + 152/7w - 2/7w3. -2(w - 24)(w - 1)(w + 4)/7 Let d be (-9 - (-153)/18)/((-1)/4). Let z(m) be the first derivative of -8/21m3 - 25 + 1/14m*4 - 5/7m*d + 0m. Factor z(l). 2l(l - 5)(l + 1)/7 Let o(l) be the third derivative of l8/336 + 8l*7/105 - 3l*6/20 - 4l*5/15 + 17l*4/24 - 455l*2. Let o(q) = 0. What is q? -17, -1, 0, 1 Let i = -107 - -111. Factor 2x*4 + 20x3 + x4 + x*i + 2x4 - x4. 5x3(x + 4) Let n(p) = -6p + 11. Let h be n(-5). Find w such that -w2 + 102 - 140w + 5w2 + h - 14 + 7 = 0. 1, 34 Let w(i) be the first derivative of i6/72 + 5i*5/24 + 5i*4/6 - 5i*3/3 + 3. Let y(c) be the third derivative of w(c). Factor y(b). 5(b + 1)(b + 4) Suppose 128h = 123h + 50. Suppose 70n*3 + 132n + 356n4 - 723n*4 - 188n*2 + 363n*4 - hn3 = 0. Calculate n. 0, 1, 3, 11 Let o(y) be the first derivative of -y7/84 - y6/20 + y5/40 + y*4/8 + 21y + 40. Let c(l) be the first derivative of o(l). Solve c(d) = 0. -3, -1, 0, 1 Let d be (((-40)/45)/(-4) - 4/18)1. Let v(z) be the third derivative of 1/240z*5 + 0z*3 + 0z*4 - 25z*2 + 0z + 1/320z6 + d. Factor v(k). k2(3k + 2)/8 Determine l so that 1119744/7 - 3360960/7l - 1124930/7l3 - 2/21l*5 + 1730/7l*4 + 10093250/21l2 = 0. 1, 1296 Let v(k) be the first derivative of k6/84 + 4k5/105 - k4/21 - 2k*2 - 129. Let r(i) be the second derivative of v(i). Find w, given that r(w) = 0. -2, 0, 2/5 Let j(x) = 2x*3 - 9x*2 - 4x - 1. Let v be j(5). Suppose 88c - 27 = 79c. Factor 1/6wv + 8/3 - 4w + 1/6w2 + wc. (w - 1)2(w + 4)*2/6 Let t(f) be the second derivative of 5/14f*2 + 1/12f*4 - 2 - 16f - 11/42f3 - 1/140f*5. Factor t(d). -(d - 5)(d - 1)*2/7 Let q = 195220 + -390439/2. Factor 0 + qp*2 + 1/3p*3 + 1/6p. p(p + 1)(2p + 1)/6 Let d(o) = 2o*2 - 6840o - 20536. Let n be d(-3). Factor 0 + 1/4k3 + 121/4k - 11/2kn. k(k - 11)*2/4 Let v = -10/827 + 857/2481. Let p(c) be the third derivative of -19c*2 - 1/6c*4 + 0c + 0 - 1/30c5 - vc*3. Factor p(h). -2(h + 1)*2 Let x(f) be the first derivative of -2f*3/15 + 36f*2/5 - 448f/5 + 503. Determine y so that x(y) = 0. 8, 28 Suppose o - 25 = 6o + 3v, 25 = -5o - 2v. Let y(j) = j*2 + 18j + 32. Let p(l) = 2l2 + 46l + 80. Let z(d) = op(d) + 12y(d). Factor z(f). 2(f - 8)(f + 1) Let p = -1115 - -1109. Let d be (-52)/22 + (p - -4)-2. Factor -62/11m + 32/11m2 + dm*3 + 12/11. 2(m - 1)(m + 3)(9m - 2)/11 Let t = -16308 + 16310. Factor -6/11 + 2/11n*t - 4/11n. 2(n - 3)(n + 1)/11 Let w = -21 + 26. Let z be (16 - 15) + (-41)/(-8) - w. Find m such that -zm - 3/4 - 3/8m*2 = 0. -2, -1 Let b(o) be the second derivative of 75o*6 - 615o*5/2 + 925o*4/3 - 416o*3/3 + 32o*2 - 236o + 2. Find w such that b(w) = 0. 1/5, 4/15, 2 Let t(s) be the third derivative of s*9/5544 + 3s8/3080 - s6/165 + 89s3/6 + 4s*2 - 4. Let k(u) be the first derivative of t(u). Factor k(o). 6o*2(o - 1)(o + 2)2/11 Suppose -a = -13q + 15q - 9, 3q = -3a + 15. Let w = 5/422 - -4112/211. Find j, given that -9/2j*q - wj*3 + 6j*5 - 9/2j + 51/2j2 - 3 = 0. -2, -1/4, 1 Factor -44 + 1/2w*2 - 791/6w. (w - 264)(3w + 1)/6 Let s be 16/636/16. Let z(c) = 5c*4 - 11c*3 - 15c*2 + 11c + 16. Let y = 86 + -85. Let i(o) = o*3 - o - 1. Let m(d) = si(d) + yz(d). Factor m(g). 5(g - 2)(g - 1)(g + 1)*2 Let x = 7167 + -7165. Let m(d) be the first derivative of 1/6d*x - 1/3d - 3 + 1/12d3. Find p, given that m(p) = 0. -2, 2/3 Let d(r) = r*2 + 2	{ "pile_set_name": "DM Mathematics" }
in 58, 86, 114? 142 What is next in 5, 7, 5, -1, -11, -25? -43 What comes next: -1738, -3474, -5204, -6928, -8646, -10358, -12064? -13764 What is the next term in 4022, 8042, 12062? 16082 What is the next term in -22, -47, -58, -49, -14, 53, 158? 307 What comes next: 51, 10, -53, -138, -245, -374, -525? -698 What is next in 205, 218, 231, 238, 233, 210? 163 What is next in 66, 129, 202, 291, 402, 541, 714, 927? 1186 What comes next: -136, -99, 10, 227, 588? 1129 What is next in -56, -215, -650, -1499, -2900? -4991 What is the next term in -466, -469, -472, -475, -478, -481? -484 What comes next: 113, 715, 1719, 3125, 4933, 7143, 9755? 12769 What comes next: 5010, 5004, 4996, 4986, 4974, 4960, 4944? 4926 What is next in 40, 32, 18, -2? -28 What is next in 33, 78, 137, 216, 321, 458, 633, 852? 1121 What is the next term in -41, -45, -51, -59, -69, -81? -95 What is the next term in 1, -10, -43, -110, -223, -394, -635? -958 What comes next: -86, -152, -218, -284, -350, -416? -482 What is the next term in 6, -6, -22, -42, -66, -94, -126? -162 What is the next term in 139, 143, 155, 175, 203, 239? 283 What comes next: 1480, 1479, 1466, 1435, 1380, 1295? 1174 What comes next: 420, 419, 418, 417, 416, 415? 414 What comes next: -83, -354, -805, -1436, -2247, -3238? -4409 What comes next: 12173, 12171, 12169, 12167? 12165 What is the next term in -42180, -42182, -42184, -42186, -42188? -42190 What comes next: -322, -299, -266, -217, -146, -47, 86? 259 What is next in 84, 81, 64, 27, -36, -131, -264, -441? -668 What comes next: 2, -2, -6? -10 What is next in -299, -597, -883, -1151, -1395? -1609 What comes next: 18, 19, 20, 21, 22? 23 What comes next: -6, -14, -22? -30 What is the next term in -3141, -6280, -9419, -12558? -15697 What is next in -24, -99, -224, -399, -624, -899? -1224 What comes next: 662, 666, 672, 680, 690, 702? 716 What comes next: -12, -31, -56, -87, -124, -167? -216 What is the next term in 65, 64, 63, 62, 61? 60 What is the next term in -26, -302, -1056, -2528, -4958, -8586, -13652? -20396 What is next in 60197, 60195, 60193, 60191, 60189? 60187 What is the next term in 25, 26, 39, 70, 125, 210? 331 What is next in -47281, -47292, -47317, -47362, -47433, -47536, -47677, -47862? -48097 What comes next: 102, 202, 368, 600, 898, 1262? 1692 What is the next term in -174, -181, -188, -195? -202 What comes next: -374, -756, -1138, -1520? -1902 What comes next: -1747, -3501, -5255, -7009? -8763 What comes next: 4928, 9850, 14770, 19688, 24604, 29518? 34430 What comes next: -18, -34, -76, -156, -286, -478, -744, -1096? -1546 What is the next term in 22, 42, 62, 82, 102? 122 What is next in -386, -771, -1156, -1541, -1926, -2311? -2696 What is the next term in 471, 469, 465, 459? 451 What is the next term in -249, -499, -747, -993, -1237, -1479? -1719 What is the next term in 499, 1002, 1519, 2056, 2619, 3214, 3847, 4524? 5251 What is next in 21, 34, 57, 90? 133 What is next in -49, -91, -133? -175 What is next in 85, 170, 255, 340, 425? 510 What is the next term in -10, -62, -128, -190, -230, -230, -172? -38 What is next in -48, -76, -122, -186? -268 What is the next term in 310, 312, 338, 400, 510, 680? 922 What is next in 177, 167, 147, 111, 53, -33? -153 What is the next term in 23, 37, 51, 65, 79? 93 What comes next: -66612, -66613, -66614, -66615, -66616? -66617 What is next in 178, 188, 200, 214, 230, 248, 268? 290 What is the next term in 21, 25, 29? 33 What is the next term in 51, 54, 57, 60, 63? 66 What comes next: -21, -21, -31, -57, -105? -181 What is the next term in -186, -173, -160, -147, -134, -121? -108 What is next in 27262, 27261, 27260, 27259, 27258? 27257 What is the next term in 48, 372, 1248, 2952, 5760, 9948, 15792, 23568? 33552 What is the next term in 1061, 1049, 1029, 1001? 965 What is next in -383, -339, -257, -131, 45, 277? 571 What comes next: -100, -96, -92, -88, -84? -80 What is the next term in 1674, 1673, 1672, 1671? 1670 What comes next: -93, -91, -87, -81, -73, -63, -51? -37 What is the next term in -12, -38, -104, -228, -428, -722, -1128? -1664 What is the next term in 20, 28, 40, 56? 76 What comes next: 6498, 6502, 6508, 6516, 6526? 6538 What is the next term in 83, 84, 81, 74, 63, 48, 29? 6 What is the next term in 91, 85, 79, 73, 67? 61 What is the next term in 283, 276, 263, 244? 219 What is next in 13, -1, -23, -53, -91, -137? -191 What comes next: -65, -63, -61, -59, -57, -55? -53 What comes next: 43, 33, 17, -5? -33 What is the next term in 2, -8, -18, -28, -38? -48 What is next in -101, -803, -2713, -6437, -12581, -21751, -34553? -51593 What is next in 98, 173, 262, 371, 506, 673, 878, 1127? 1426 What is next in -130, -256, -378, -496, -610, -720? -826 What is the next term in 3634, 3635, 3636, 3637? 3638 What is next in 545, 530, 497, 440, 353? 230 What comes next: -1, -19, -51, -97, -157, -231? -319 What is the next term in 146, 142, 138, 134, 130, 126? 122 What is the next term in 25, 119, 277, 499, 785, 1135, 1549? 2027 What is the next term in -107, -188, -281, -392, -527? -692 What is next in 879, 884, 889, 894, 899, 904? 909 What comes next: -58, -128, -208, -298, -398, -508? -628 What is the next term in -26, -4, 16, 34, 50, 64? 76 What comes next: -31, -24, -13, 2, 21, 44, 71? 102 What is next in 1, 1, -3, -11, -23, -39? -59 What comes next: -329, -327, -325, -323, -321? -319 What is next in -39, -74, -109? -144 What comes next: 66, 139, 212, 285, 358, 431? 504 What is next in 1476, 1478, 1480, 1482, 1484? 1486 What is the next term in -6, -38, -118, -270, -518? -886 What comes next: 304, 587, 870, 1153? 1436 What comes next: 694, 693, 692, 691? 690 What is next in 369, 1507, 3397, 6033, 9409, 13519, 18357? 23917 What is the next term in 962, 954, 940, 920? 894 What is next in -1036, -2069, -3102, -4135, -5168, -6201? -7234 What is the next term in 26, 9, -46, -139, -270, -439? -646 What is the next term in 569, 1115, 1661? 2207 What comes next: -136, -137, -140, -145, -152, -161, -172? -185 What is next in 4, 12, 24, 40, 60, 84? 112 What comes next: -64, -124, -194, -280, -388? -524 What is next in -25, -62, -125, -226, -377, -590? -877 What is the next term in -379, -386, -405, -442, -503, -594? -721 What comes next: -194, -196, -198? -200 What is the next term in -35, -32, -33, -38, -47? -60 What is the next term in 91, 195, 321, 481, 687, 951, 1285, 1701? 2211 What is the next term in -24, -15, -10, -15, -36, -79? -150 What is the next term in 774, 1550, 2326, 3102, 3878? 4654 What comes next: -51, -91, -119, -129, -115, -71, 9, 131? 301 What comes next: 45, 305, 1017, 2409, 4709, 8145? 12945 What is next in 133, 131, 127, 121, 113, 103, 91? 77 What comes next: -9, -13, -27, -57, -109, -189, -303? -457 What comes next: -7816, -15633, -23450, -31267, -39084? -46901 What is next in 1025, 1027, 1029? 1031 What is next in 15, 20, 17, -6, -61, -160? -315 What comes next: 8, 40, 106, 224, 412, 688, 1070? 1576 What is next in 45, 50, 67, 102, 161, 250, 375, 542? 757 What is next in -122, -213, -304? -395 What comes next: 79, 175, 289, 427, 595, 799? 1045 What comes next: -65, -145, -239, -347, -469? -605 What comes next: -51, -43, -31, -15, 5, 29? 57 What comes next: 270, 259, 232, 183, 106, -5, -156, -353? -602 What is next in -3, 19, 65, 147, 277, 467? 729 What is next in 91, 160, 229, 298, 367, 436? 505 What comes next: 1, 5, 15, 31, 53, 81, 115? 155 What comes next: 8, 21, 36, 53? 72 What is next in 2232, 2245, 2266, 2295? 2332 What is the next term in 59, 265, 607, 1085, 1699, 2449? 3335 What is the next term in 15, 6, -15, -54, -117, -210, -339? -510 What comes next: 1292, 1286, 1266, 1226, 1160, 1062? 926 What comes next: -3388, -3397, -3408, -3421, -3436? -3453 What is next in 165, 341, 521, 705, 893, 1085, 1281? 1481 What is next in 0, 14, 48, 108, 200? 330 What comes next: 38, 86, 158, 248, 350? 458 What is the next term in -55, -429, -1441, -3409, -6651, -11485? -18229 What comes next: -47, -78, -109, -140? -171 What is the next term in -13, -30, -57, -100, -165, -258, -385? -552 What is next in 281, 544, 785, 992, 1153, 1256, 1289? 1240 What is next in -240, -1004, -2292, -4116, -6488, -9420, -12924? -17012 What is the next term in -91, -81, -71, -61? -51 What comes next: -1	{ "pile_set_name": "DM Mathematics" }
-2)/(-6) + (-140)/(-30). Let b = 6 - m. What is the units digit of (175/28)/(b/4)? 5 Let z(n) be the first derivative of -4n2 + 18n + 4. What is the tens digit of z(-8)? 8 Let q(d) be the third derivative of 5/6d3 + 7/24d*4 + 0d + 0 - 1/120d6 - 7d*2 - 3/20d5. What is the tens digit of q(-10)? 3 Let c(d) = d3 - 5d2 + 2d + 4. Let s be c(4). Let r be s29/2 + 3. Let f = 77 + r. What is the tens digit of f? 2 Suppose 2p + 9 = -3v + 4p, -2p = -6. Let i be 3 + 2 + (-3 - v). Suppose q + iq - 12 = 0. What is the units digit of q? 3 Suppose 3g - 2g - 24 = 0. Suppose -a + 5o = -5a + 11, -3o = a - 1. What is the tens digit of a + (0 - 1) + g? 2 Let y be 5/(-1) + 40/5. Suppose 55 = -4i + r + 708, -461 = -yi - 5r. What is the tens digit of i? 6 Let l(n) = -42n. Suppose 5z - 28 = -103. Let j be (-6)/10 - (-6)/z. What is the units digit of l(j)? 2 Suppose 13h - 33 = 10h. Let p = 49 + h. What is the units digit of p? 0 Let z(u) = -u*3 - 2u*2 + 1. What is the tens digit of z(-5)? 7 What is the hundreds digit of 210/(46/80)? 7 Let z = 17 - 6. Suppose -5j - z = 29. Let x = 12 + j. What is the units digit of x? 4 Suppose 1011 = -7h + 4427. What is the hundreds digit of h? 4 Let y be 1 + ((-22)/2)/((-2)/34). Suppose 0 = -42f + 38f + y. What is the units digit of f? 7 Suppose -5g + 48 = 3g. Suppose -25 = -gq + 233. What is the tens digit of q? 4 Suppose 12h - 2148 - 4224 = 0. What is the tens digit of h? 3 Let r = -12 + 12. Suppose -l + 3 = -rl. Suppose -5t + 2b = -52, 6t - 2b - 32 = lt. What is the units digit of t? 0 Suppose 0x + 15x = 9450. What is the tens digit of x? 3 Let x(n) = -2n3 + 26n*2 - 16n - 39. Let c(b) = b*3 - 13b*2 + 8b + 19. Let k(z) = 13c(z) + 6x(z). What is the hundreds digit of k(13)? 1 Suppose 703 = 17x + 20x. What is the tens digit of x? 1 Let w(y) = -3y - 21. Let d be w(-9). Suppose k - 5 = dk, -5f + 105 = -5k. What is the tens digit of f? 2 What is the units digit of 975 - 2/46? 2 Let t(u) = -u3 + 4u*2 - 3u + 1. Let l be t(2). What is the tens digit of 10 + 0 - (-2 + l + -2)? 1 Let f(w) = w3 - w2 + w. Let o(j) = 27j3 + j. Let h(y) = -2f(y) + o(y). What is the tens digit of h(1)? 2 Let o(f) = f*3 + 4f*2 + 5f + 5. Let b be o(-3). What is the units digit of (((-8)/12)/((-4)/(-426)))/b? 1 Let i(d) = -8d3 - 11d*2 - 22d + 1. What is the thousands digit of i(-8)? 3 Suppose -j + 1 = 3y, 2j - 7j + 2y = 29. Let d be (j/3)/(3/(-9)). Suppose -3a = -m - 7, -4m + 3 + d = -3a. What is the units digit of a? 4 What is the hundreds digit of 4/18 - 528814/(-198)? 6 Let l be (-74)/(-3) - (-1)/3. Suppose 3p + n - 13 = 0, -n + 5n = -3p + l. Suppose -3k + 3z = -30, -k + 4 - 2 = pz. What is the units digit of k? 8 Let g(f) = 3f + 4. Let b be g(0). Let d(o) = 5o + 7. What is the units digit of d(b)? 7 Let x(i) = 8i - 16. Let z(k) = k*2 - 2k. Let f be z(3). Suppose 0 = d - 4 - f. What is the units digit of x(d)? 0 Let i = 3 - -32. Let g be i/15 - (-2)/3. Suppose 3m - g = -2k + 8, 0 = -5m - 25. What is the units digit of k? 3 Let m(l) = -2l - 6. Suppose -3g + 15 = 0, 3s - 3g = 4s - 15. Let v be m(s). Let k = v + 35. What is the tens digit of k? 2 Let k(l) = 3l2 - 3l2 - l3 + 0l + 4l - 5 - 8l2. Let v be k(-9). Suppose -6c = -2c - v. What is the tens digit of c? 1 Suppose -b - 295 = -1531. What is the units digit of b? 6 Let l = -357 - -416. What is the tens digit of l? 5 Suppose -3n + 0i - 2i + 10 = 0, 0 = 2n + 4i - 12. Let a be 18/(-33/(-66)). Suppose nr = -r + a. What is the tens digit of r? 4 Suppose w + 3w + 5j - 52 = 0, -5w + 65 = -2j. Suppose -2c = -wc + 2365. What is the hundreds digit of c? 2 Let r = -134 - -45. Let a = r + 93. What is the units digit of a? 4 What is the tens digit of ((-6)/9)/((-13)/5538)? 8 What is the hundreds digit of (310/(-1))/(-610/330)? 7 Let b = 885 - -3010. What is the units digit of b? 5 Suppose -9268 = 177l - 184l. What is the thousands digit of l? 1 Let l = 1319 + -848. What is the units digit of l? 1 Let x(q) = -q3 + 6q*2 - 4q - 2. Suppose 6i - 9i = -15. Let f be x(i). Suppose -4t + 96 = -fb, -4t + b + 60 = -28. What is the units digit of t? 1 Suppose -29p = -4173 - 32. What is the tens digit of p? 4 Let s be 31(3 + -3 + 1). Let l = -91 - -91. Suppose -y + ly = -s. What is the units digit of y? 1 Let y = 550 - 254. What is the hundreds digit of y? 2 Suppose -3p = 2a - 11 - 29, 2p + 2a - 24 = 0. Let b = 1 - 14. Let h = p + b. What is the units digit of h? 3 Let f = 2366 - 48. What is the units digit of f? 8 Let c(t) = -2 + 2t + 2t*2 + 8 + 5t - 2. Let z be 68/(-18) + 24/(-108). What is the units digit of c(z)? 8 Let g = -7 + 70. What is the units digit of 356/3 + (-3)/g-7? 9 Let s(c) = -3c - 10. Let i = -26 + 21. Let f = -18 - i. What is the tens digit of s(f)? 2 Let g = 2348 + -705. What is the units digit of g? 3 Let n(w) = -w*3 - 22w*2 - 55w + 13. What is the units digit of n(-23)? 7 Suppose 4f = 3f + 40. Suppose -5p + p = -f. Suppose -5x - 4v - 126 = -px, -2x + 3v = -49. What is the tens digit of x? 2 Let h be (-1)/(-3) + (-40)/12. Let s(n) = -4n3 - 3n*2 + n - 7. What is the units digit of s(h)? 1 Suppose 2k - 12594 = -4q, 16k = 14k + 2. What is the thousands digit of q? 3 Let j(r) be the second derivative of 0 - 1/4r*5 - 1/2r*2 + 1/12r*4 - 1/2r*3 - 6r. What is the tens digit of j(-2)? 4 Suppose 5i + 3 = 3h - 3, -4i - 2h + 4 = 0. Let t = 61 + -56. Suppose -5u + 3a + 3 = i, -tu + a - 4a + 27 = 0. What is the units digit of u? 3 Let o = -30 + 16. What is the tens digit of ((20/(-8) - 0) + -2)o? 6 Let a(h) = -h3 + 4h*2 - 3h + 1. Let g be a(2). Suppose 0 = -6j + gj + 48. Suppose -4d + 0 - 4 = 3f, -4d - j = 0. What is the units digit of f? 4 Let x be (-7)/(-22/12). Suppose c - 5n - 7 = -3n, c + 5n - x = 0. Let g = 21 - c. What is the tens digit of g? 1 Suppose -1548s + 1541s = -13510. What is the thousands digit of s? 1 Suppose 2a = 52 + 44. What is the tens digit of (-1488)/a-1(1 - 0)? 3 Let a(y) = 427y2 + 14y + 40. What is the tens digit of a(-2)? 2 Let x(y) = 8y3 + y2. Let v be x(-1). Let k = -7 - v. Suppose kh = -3h + 114. What is the tens digit of h? 3 Let u = -583 + 3414. What is the tens digit of u? 3 Suppose 62l - 59l = 0, 3426 = 3o + 2l. What is the hundreds digit of o? 1 Let j be (-1)/(12/(-36704)) - (-8)/6. What is the tens digit of 8/52 + j/52? 5 Let x(t) = -9t*3 - 3t*2 - t - 7. What is the tens digit of x(-3)? 1 Let u be 6/(-4)(1 + 978/(-18)). Let g = 87 - u. What is the units digit of g? 7 Suppose 11c = -84 + 95. Let k(h) = 55h + 15. Let a(t) = -28t - 7. Let j(v) = -9a(v) - 4k(v). What is the units digit of j(c)? 5 Suppose -8836 + 36252 = 8h. What is the units digit of h? 7 Suppose -2s - 34 = -10. Let i(w) = w3 + 12w*2 - 1. Let n be i(s). What is the units digit of n - (-3 - (7 - -2))? 1 Let r(c) = -12c - 19. Let y(q) = 13q + 20. Let o(i) = -6r(i) - 5y(i). What is the units digit of o(5)? 9 Let i(b) = 22b*2 + 9b + 24. Let s be i(-4). Suppose -l - l + 215 = -3g, 3l = g + s. What is the hundreds digit of l? 1 Suppose 2z - 2 - 2 = 0. What is the units digit of 43 + 3 + (z - 2)? 6 Suppose -790 = 65t - 67t. What is the tens digit of t? 9 Suppose 116h - 124h + 256 = 0. What is the units digit of h? 2 Let n(y) = 331y*3 + 2y*2 - 1. What is the hundreds digit of n(1)? 3 Suppose -2r + 3w = -1615, -r + 4w + 777 = -33. What is the units digit of r? 6 Suppose 0b + 16b - 2912 = 0. Suppose 139 = 4l - 4k - 73, -2k + b = 4l. What is the units digit of l? 8 Let k(u) = u*2 - 9u + 12. Suppose 3q = -q - o + 23, o = -3q + 18. Let d be k(q). Let r(t) = 2t2 + 10t - 8. What is the tens digit of r(d)? 4 Suppose 78 = 3f + j - 178, -1 = -j. What is the units digit of f? 5 Suppose 0 = -5k + 5t + 605, 3k - 351 = 2t + 9. What is the tens digit of k? 1 Suppose -26i = -7i - 4959. What is the units digit of i? 1 Let q be ((-2)/4)/(2/(-8)). Let r(t) = -2t*2 + 12t + 12. Let b be r(6). What is the tens digit of 123/b(q - -2)? 4 Let c = 39 - 14. Let d be (1/3)/(((-3)/(-306))/1). Let k = d - c. What is the units digit of k? 9 Let o(y) = y*2	{ "pile_set_name": "DM Mathematics" }
f for o. -1 Let o(f) = -2f3 - 21f*2 + 10f - 11. Let c be o(-11). Solve 1 + c = -s for s. -1 Suppose 5v = -y + 19, 0 = -0v + 3v + 3y - 21. Solve -vl = -4l for l. 0 Let r be 4/((-1)/(-1 + 0)). Suppose 0 = -rx + 5x - 8. Solve -xd = -3d + 10 for d. -2 Let n be (-13 - -1)2/(-8). Solve -6 - 6 = -nl for l. 4 Let w(s) = 2s - 4. Let a be w(3). Suppose 0 = -3d + 4d - 4. Let z = a + d. Solve 4p = -z - 6 for p. -3 Let w(t) = t3 - t2 + 2. Suppose -3c + 2c = 0. Let f be w(c). Solve -fi = i for i. 0 Let j be ((-2)/3)/((-2)/(-6)). Let o be ((-5)/2)/(j/4). Solve -2s + 3s = -o for s. -5 Suppose -2l - n = -4n - 2, -l - 5n = 12. Let a(h) = -3h - h2 + 0h - h2 + 2 - h3 + 2h. Let c be a(l). Solve -cd = d - 25 for d. 5 Suppose 4h + 9 = -11. Let l = h + 8. Solve 0p = lp for p. 0 Suppose 0 = -2x - 3a + 45, -5x + a + 29 = -41. Solve -5j - x - 10 = 0 for j. -5 Let m(i) = 6i*2 - i. Let y be m(1). Let r = 7 - y. Solve t + rt + 12 = 0 for t. -4 Suppose -4u = g + 2 - 3, 0 = 2u + g - 1. Suppose 0 = -uy - 2y + 8. Solve y = -2q + 14 for q. 5 Let s = -7 + 11. Suppose 3w + 0w = 18. Suppose -5p + w = -s. Solve 0 = pf - 0 + 8 for f. -4 Let a(m) = -7m + 44. Let i be a(6). Solve -r - i = -2r for r. 2 Let m(n) = -3n - 6. Let c be m(4). Let x = c + 20. Solve -r - 5 = -x for r. -3 Suppose 5 - 1 = y - 3g, 0 = -y - 4g - 3. Solve 1 = w - y for w. 2 Let v(f) = f*3 - 2f*2 - 2f - 3. Let n be v(3). Let h = 4 + n. Solve -13 + 1 = hm for m. -3 Let f be -6(-1 - 2/12). Solve -4h = -9 - f for h. 4 Let q(s) = -3. Let j(k) = 1. Let f(t) = -17j(t) - 6q(t). Let p(v) = v2 - 3. Let w(u) = 4f(u) + p(u). Let l be w(-2). Solve 0d = ld + 10 for d. -2 Let q = 3 + -1. Suppose -5j + qy = 0, y + 0y + 5 = 5j. Solve k = -0 - j for k. -2 Suppose 0 = 3v + 6y - y + 9, -4v + 3y = -17. Solve 4u - 10 = v for u. 3 Suppose -4x = 4s - 44, -x = -2x. Let b = s + 5. Suppose 0 = -5z - 5, -2u - z - 3z + b = 0. Solve -u = -3r + 2 for r. 4 Let a be 2 + 2/((-6)/9). Let v = 2 - a. Solve 3b - 12 = v for b. 5 Let n(u) = u3 + u2 - u. Let p be n(-2). Let h be ((-9)/3 - 25)/p. Suppose -2 + h = 4x. Solve -xw = -5 - 7 for w. 4 Let p(f) = f3 + 4f*2 + 2f + 5. Let i be p(-4). Let k(x) = x*2 + 2x - 3. Let u be k(i). Solve ut + 4 = 2t for t. 2 Let t be 7/((-14)/6) + 3. Solve -5a - 1 - 9 = t for a. -2 Suppose j = 2a - 4, -4j + 28 = -9j + 2a. Let i be j/(-8) - 6/(-24). Solve l = -0 + i for l. 1 Let l = 8 + -3. Let i = -4 + l. Let q = -1 + i. Solve q = -0b - 4b - 20 for b. -5 Let o = 25 + -22. Solve -4w + ow + 1 = 0 for w. 1 Let m = -15 - -17. Solve -mu = -0u - 6 for u. 3 Let a(c) = -6c2 - c + 9. Let i(u) = u2 - 1. Let j(f) = -a(f) - 5i(f). Let p be j(-3). Suppose -px + 10 = 3x. Solve 0 = -g + 2 + x for g. 4 Suppose z + 0z - 2 = 0. Suppose c - z = -3s + 11, 21 = 4s + 5c. Suppose 4u - 18 = sq - 6, 2q + 4 = u. Solve 0 = 2m - 0 + u for m. -1 Let f = 22 + -20. Solve fu = 5u - 3 for u. 1 Suppose -3u + 19 = -0d + 5d, 9 = u - d. Suppose 4a + u = -44. Let h = a - -21. Solve 23 = -3n + h for n. -5 Suppose 0 = -2v - 4j + 54, 2j + 103 = 3v - 3j. Let y = 47 - v. Solve -4r + 0 = y for r. -4 Let y(c) = 11c + 3. Let u(j) = 78j + 21. Let k(w) = 2u(w) - 15y(w). Let r be k(-2). Suppose x - r = -3t, 2x = -2x + t + 8. Solve 0 = xd - 2d + 5 for d. -5 Suppose f = -0f + 4. Solve fk - 6k = 0 for k. 0 Let x(i) = i3 + i2 + i + 9. Let o be x(0). Let q be (-1)/(-4) + o/12. Solve a + 2 + q = 0 for a. -3 Let q = -4 - -10. Let y = q - 2. Solve yr - 4 = -0r for r. 1 Let v be ((-4)/(-10))/((-6)/30). Let a be 10 - 0/(-2) - v. Solve -a = 3c - 0c for c. -4 Let j = -8 - -2. Let v = j - -8. Let d = 5 - -7. Solve -2g - d = vg for g. -3 Suppose -5m + 0m - 5 = 0. Let j = m - -4. Let r(h) = h - 3. Let z be r(j). Solve zv = v for v. 0 Suppose 2r = -s + 3s + 46, 0 = 3r + 5s - 45. Solve 4v + r = -0v for v. -5 Let s be 7 - 2 - (0 - 0). Solve -st - 13 - 7 = 0 for t. -4 Let w be (-17)/(-22/8). Let b = w + -30. Solve -3 - 5 = -bu for u. 2 Let u = 8 + -15. Let v = -2 - u. Suppose 4g = -5t + 12 + 9, vg = -t. Solve -6o = -o - t for o. 1 Let d(v) = v*3 + 14v*2 - 15v. Let q be d(-15). Solve q = -3b + 3 - 9 for b. -2 Let b be (0 - (-2 - 1))/(-2 + 3). Solve bi - 6 = i for i. 3 Let h be (-2)/7 + (-95)/35. Let w be (h - 0/(-2))/(-1). Solve 5y = -w - 22 for y. -5 Let l = 16 + -11. Suppose -5f = a + 18, -3a - 16 + 42 = -lf. Solve -9 = -ab - b for b. 3 Let v = -13 + 18. Solve -4 - 1 = vy for y. -1 Suppose 3f = v - 17 + 2, 5v - 3f = 15. Suppose -20 = -5z - v. Solve 6 = -2r + zr for r. 3 Let i = 5 - 0. Suppose -3g + 11 = 3j + j, -5g - ij + 20 = 0. Solve 0 = -gd - 10 for d. -2 Suppose 0 = 4u - 31 + 11. Suppose 3d + 5f = d + 22, 0 = -4d - uf + 24. Solve -d - 2 = -o for o. 3 Let b be 22 + -2 + (2 - 6). Let x = -14 + b. Suppose 3t = t + 24. Solve i - t = -xi for i. 4 Suppose 0 = -2c - 0c + 30. Solve 0 = 3j - 0 - c for j. 5 Let f(x) = -x - 3. Let r be f(-10). Let p = r + -3. Solve -21 = -pl - 9 for l. 3 Let u be (5 - -1)/(-3)-2. Solve uj - 23 = -3 for j. 5 Let j(h) = 2h + 28. Let f be j(-13). Let w = 25 + -10. Solve w = fn + n for n. 5 Suppose 4l = 3g + 10 - 3, -l - 2g + 10 = 0. Solve 0 = 2w - 8 + l for w. 2 Suppose -2r = -5r + 57. Let f = r + -11. Let q = 2 - 0. Solve -q + f = -3t for t. -2 Let f(b) = b - 6. Let q be f(9). Suppose 2c + 5u = 25, c + qc + 5u - 25 = 0. Solve 2j + j + 9 = c for j. -3 Suppose 8l - 8 = 4l. Let b be -3 - -3 - (-8)/2. Solve ly = y + b for y. 4 Suppose 0 = -n, -7 - 5 = 4a - 2n. Let d(f) = f3 + 4f*2 + 3f + 2. Let m be d(a). Solve 0x - 10 = mx for x. -5 Suppose -3o + 6 = -o. Let s = o - -5. Solve 0 = 4v - s + 4 for v. 1 Let l = 52 - 36. Suppose 0 = 4f - l, -14 = -2b - 2f + 2. Solve 5g + b = 9 for g. 1 Let w = 8 - 3. Let r = 5 + -7. Let t(s) = -s - 2. Let k be t(r). Solve -10 = wc - k for c. -2 Let l = -49 + 33. Let r = l - -22. Solve -rs + s = 10 for s. -2 Let j(d) = -d*2 - 7d + 11. Let z be j(-8). Suppose 4f + x = -3x + 88, 4x - z = f. Solve -4n + f + 3 = 0 for n. 5 Suppose 2s + 5m - 25 = 0, 25s = 30s - 2m + 10. Let l(o) = -o + 7. Let f be l(5). Solve s = fd - 0 + 10 for d. -5 Suppose g - p - 3 = -2p, 3g + 2p = 9. Solve -gu + 9 = -0 for u. 3 Let m(w) = w*2 - 8w - 6. Let t be m(10). Solve 3v = t + 1 for v. 5 Let h be 6 + 0 + (-5 - -2). Solve -2x = -hx for x. 0 Suppose -k = -4k - 3. Let c = 3 - k. Solve 2j + c = -2j for j. -1 Suppose -6h + 9h - 24 = 0. Solve 0 = 2o + h - 2 for o. -3 Suppose -5b + 29 = -0d + 2d, -4d = -5b - 13. Solve 6g - 3 = dg for g. -3 Suppose 0 = -7n + 5n - 28. Let h be 0/(-2)(-14)/n. Solve h = -2z + 5z + 12 for z. -4 Let c = 0 - -3. Suppose 4g = g + 12. Solve 9 + c = -gy for y. -3 Suppose -5d + 38 + 27 = 0. Suppose 4a + 5c = 6a + 6, -50 = 5a + 5c. Let f = d + a. Solve j + 0j = f for j. 5 Let u be 3/(-12) + 7/(-4). Let v = u + 2. Let s be (-3)/(-21) + -512/(-21). Solve v = -3r + s + 10 for r. 5 Let m(d) = 5d3 + 2d*2 - d. Let a be m(1). Let x be 1/((-2)/(-5))2. Let z = x - 3. Solve a = 2c - z for c. 4 Suppose 11 - 19 = -4d. Solve -dl - 12 = 2l for l. -3 Let o = -4 + 5. Let d be o + (0 + 0)/(-4). Solve d = -5n - 9 for n. -2 Suppose 20 = 3q - 4. Let c = 15 - 11. Let l = -27 + 51. Solve cv = l - q for v. 4 Let t be (-20)/(-70) + (-66)/(-14). Suppose 8f = tf. Solve f = 5l - l + 8 for l. -2 Suppose -8q - 3q = -8q. Solve qr + 10 = -5r for r. -2 Let f = -60 - -62. Solve f = -5h + 12 for h. 2 Let f be (-2)/(-7) + 2/(-7). Let a = 6 - 2. Suppose ak + 3x = 43, -k + 2k + x - 12 = f. Solve -kn + 3n = 4 for n. -1 Suppose -o = o. Suppose 6b - 2b = 2z + 20, -4b + 3z + 20 = o. Suppose 0 = 4f - 14 - 46. Solve -bc = -2c - f for c. 5 Suppose 2v + 64 = -4i + i, -2i = -4v - 96. Let a = -23 - v. Solve -ak = 2k - 15 for k. 3 Let k be (16/12)/(4/6). Suppose 5h = o + 3 + 9, -ko = h - 9. Suppose 0 = -hq + 5 + 1. Solve -ql - 8 = -0 for l. -4 Let v be 3(-1)/(-3) + 2. Let x be (-2)/(-8) - 9/(-12). Let t = v + x. Solve 0h + 4h = -t for h. -1 Let c(y) = y*2 + 17y + 16. Let z be c(-16). Solve k + 0k = z for k. 0 Suppose 2b + 0s - 14 = -2s,	{ "pile_set_name": "DM Mathematics" }
visor of 1872800 and 21600? 800 Calculate the greatest common divisor of 2384 and 165008. 16 What is the greatest common divisor of 13754 and 265018? 26 Calculate the greatest common factor of 19402944 and 8. 8 Calculate the greatest common divisor of 1291 and 719346491. 1291 Calculate the greatest common factor of 372 and 2673841326. 186 Calculate the greatest common divisor of 387013 and 702262. 2563 What is the greatest common divisor of 102114 and 133407? 1647 What is the greatest common divisor of 13 and 221499863? 13 Calculate the highest common factor of 9272199 and 796893. 1623 What is the highest common divisor of 10 and 72155905? 5 Calculate the highest common factor of 5260130 and 4580. 2290 Calculate the greatest common divisor of 454 and 26861137. 227 Calculate the highest common divisor of 688653 and 4743. 153 Calculate the highest common factor of 732135 and 15315. 15 What is the greatest common factor of 69158 and 874894? 302 Calculate the highest common factor of 747 and 38425. 1 What is the greatest common factor of 225032 and 251666? 46 Calculate the highest common divisor of 17316845 and 4165. 245 Calculate the greatest common divisor of 82993482 and 2926. 418 What is the greatest common factor of 7883460 and 325260? 2340 Calculate the greatest common divisor of 14928 and 9074980. 1244 What is the highest common divisor of 9101919 and 102? 51 What is the greatest common divisor of 269595 and 3105? 135 Calculate the greatest common factor of 1770 and 187815231. 177 Calculate the greatest common factor of 84136 and 126360. 104 Calculate the greatest common factor of 390111 and 1725078. 3579 Calculate the highest common divisor of 5921640 and 6840. 360 What is the greatest common divisor of 3861 and 30208893? 429 Calculate the highest common factor of 270 and 15767200. 10 Calculate the greatest common divisor of 5138 and 577658. 734 What is the highest common factor of 17457 and 733953? 759 What is the highest common factor of 561 and 232313313? 51 What is the highest common divisor of 54 and 413773884? 18 Calculate the greatest common factor of 3393333 and 405. 81 What is the greatest common divisor of 407 and 31125288? 37 Calculate the greatest common factor of 479570 and 1309. 119 What is the highest common divisor of 1313100 and 16? 4 What is the greatest common factor of 32940 and 3085155? 135 Calculate the highest common factor of 8818626 and 710. 142 What is the greatest common factor of 837240 and 1920? 120 Calculate the greatest common factor of 228 and 55590884. 76 What is the greatest common factor of 1483 and 114053081? 1483 Calculate the highest common factor of 14 and 3023756246. 14 Calculate the highest common factor of 11800544 and 672. 224 What is the greatest common factor of 5730496 and 36800? 1472 What is the greatest common divisor of 529288 and 5312? 8 What is the highest common factor of 4555571 and 1835? 367 Calculate the greatest common divisor of 61507897 and 12782. 913 Calculate the greatest common factor of 22 and 536338. 22 Calculate the greatest common factor of 8579 and 6210823. 373 Calculate the highest common divisor of 263711799 and 78. 39 What is the highest common factor of 13 and 56308759? 13 Calculate the greatest common divisor of 606797 and 1696. 53 What is the highest common divisor of 23639196 and 84? 84 What is the greatest common factor of 52548177 and 1961? 37 What is the highest common factor of 560082 and 760? 38 Calculate the highest common factor of 72704 and 992. 32 What is the greatest common factor of 2685 and 178221171? 537 Calculate the greatest common factor of 4046 and 13584156. 578 Calculate the highest common divisor of 1132 and 224. 4 What is the highest common factor of 750492184 and 8? 8 What is the highest common divisor of 1404 and 2793908? 52 Calculate the greatest common factor of 20 and 2423556. 4 Calculate the highest common divisor of 1 and 82852803. 1 What is the highest common divisor of 50542 and 326474? 1366 What is the highest common factor of 18372930 and 100? 10 Calculate the greatest common factor of 14885115 and 1785. 1785 What is the greatest common divisor of 20758 and 135994? 194 What is the highest common divisor of 3737332 and 711? 79 Calculate the highest common factor of 8357200 and 6200. 200 What is the highest common divisor of 468061 and 238? 17 Calculate the highest common divisor of 118827 and 76773. 489 What is the highest common divisor of 413193 and 516021? 627 Calculate the highest common factor of 9786417 and 96. 3 What is the highest common divisor of 3665695 and 7865? 605 What is the greatest common divisor of 102 and 290986314? 102 Calculate the highest common divisor of 596 and 10380383. 149 What is the highest common divisor of 12515 and 3984776? 2503 What is the highest common factor of 1953 and 150563? 7 Calculate the greatest common factor of 27625004 and 1023. 11 What is the greatest common divisor of 287687128 and 4232? 4232 Calculate the highest common factor of 14271 and 335067. 201 What is the greatest common factor of 18 and 102229749? 9 What is the greatest common divisor of 1943 and 19456651? 29 What is the highest common divisor of 71824 and 141638? 134 Calculate the greatest common factor of 31454720 and 1760. 1760 What is the highest common factor of 4643025 and 6975? 2325 Calculate the greatest common divisor of 824 and 1776208. 8 What is the greatest common divisor of 1 and 24618544? 1 What is the highest common factor of 25821 and 264765? 57 What is the greatest common factor of 2823509 and 559? 559 Calculate the highest common divisor of 960 and 1514460. 60 What is the greatest common factor of 45 and 61529415? 15 What is the greatest common divisor of 1546233 and 16523? 533 Calculate the greatest common factor of 117 and 9927593. 13 Calculate the highest common divisor of 196906428 and 18. 18 Calculate the greatest common factor of 1661809 and 192329. 2161 What is the greatest common factor of 140 and 7973630? 70 What is the greatest common factor of 452 and 526644? 4 What is the greatest common factor of 2091950 and 164045? 1505 What is the highest common divisor of 10176 and 823832? 424 Calculate the highest common factor of 7560 and 2412520. 40 What is the highest common divisor of 6263519 and 403? 31 What is the highest common divisor of 273154009 and 3138? 523 Calculate the greatest common divisor of 19045 and 1980387. 293 Calculate the greatest common factor of 1102714226 and 6662. 6662 Calculate the greatest common divisor of 30 and 93729590. 10 Calculate the greatest common divisor of 1321 and 29360546. 1321 Calculate the highest common divisor of 82603773 and 21546. 3591 What is the highest common divisor of 305 and 22536145? 305 What is the highest common factor of 172823 and 2107? 49 What is the highest common divisor of 5 and 37802255? 5 Calculate the greatest common divisor of 108837 and 3587590. 4031 What is the greatest common divisor of 124 and 12340201? 31 What is the greatest common factor of 2927 and 966632969? 2927 Calculate the greatest common factor of 6251 and 50535763. 893 Calculate the highest common factor of 3181991 and 1351. 193 What is the greatest common factor of 1562 and 18281648? 1562 What is the greatest common factor of 1281860 and 1926? 214 What is the highest common divisor of 62361 and 20549979? 369 What is the greatest common factor of 18908890 and 202930? 910 Calculate the greatest common factor of 2140380 and 553190. 5170 Calculate the highest common factor of 176751 and 14473. 41 Calculate the greatest common factor of 10813 and 560556733. 10813 Calculate the greatest common factor of 122122 and 167258. 182 What is the highest common divisor of 18988 and 13348? 188 Calculate the greatest common factor of 283880 and 79124. 604 What is the greatest common divisor of 29138 and 2289904? 1714 What is the highest common factor of 73831 and 337? 1 Calculate the highest common divisor of 88 and 8179432. 8 What is the greatest common factor of 1099805 and 14204? 67 Calculate the highest common factor of 2925 and 1096329. 39 What is the highest common divisor of 597772 and 20572? 148 What is the greatest common factor of 25392 and 6708249? 1587 What is the highest common div	{ "pile_set_name": "DM Mathematics" }
thout replacement from rrrrreriitrrrtri. What is prob of picking 2 t and 2 i? 3/1820 Two letters picked without replacement from dkkkkkdhhkkkkdbdkh. What is prob of picking 1 d and 1 b? 4/153 Two letters picked without replacement from ssssssssss. What is prob of picking 2 s? 1 Four letters picked without replacement from nknknnnknk. What is prob of picking 4 k? 1/210 What is prob of picking 1 b and 1 m when two letters picked without replacement from xhxbxmxmmmxbbxb? 16/105 Calculate prob of picking 1 e and 2 j when three letters picked without replacement from aajxeeajoea. 1/55 Calculate prob of picking 1 g and 1 a when two letters picked without replacement from {g: 1, a: 1, r: 1, f: 1, v: 1, h: 2}. 1/21 What is prob of picking 1 c and 3 r when four letters picked without replacement from rcrccrcrcrccrrrrcc? 21/85 What is prob of picking 1 d and 3 y when four letters picked without replacement from {y: 6, d: 1, p: 3, n: 2}? 4/99 Four letters picked without replacement from gyfnnsysnfsngfynsgpg. Give prob of picking 1 n, 2 y, and 1 s. 4/323 What is prob of picking 1 m and 3 c when four letters picked without replacement from mwywczzcmwccy? 8/715 Calculate prob of picking 2 d when two letters picked without replacement from dddadladla. 2/9 Four letters picked without replacement from zjquyjyqjyzy. Give prob of picking 4 y. 1/495 Three letters picked without replacement from {l: 1, e: 2, m: 1, b: 2}. What is prob of picking 1 m, 1 b, and 1 l? 1/10 Three letters picked without replacement from wqwqmqqmmb. What is prob of picking 1 m and 2 w? 1/40 Four letters picked without replacement from wkkkxxxswsswwwhw. Give prob of picking 1 k, 2 w, and 1 s. 27/364 What is prob of picking 1 x and 1 b when two letters picked without replacement from bxxxxxxxxxxx? 1/6 Three letters picked without replacement from gagaaggagggagg. Give prob of picking 2 a and 1 g. 45/182 Calculate prob of picking 1 u and 1 e when two letters picked without replacement from {e: 3, k: 3, u: 1, b: 2, v: 1}. 1/15 Two letters picked without replacement from {t: 1, x: 1, s: 2}. What is prob of picking 1 x and 1 t? 1/6 Four letters picked without replacement from {x: 2, q: 4, i: 2, y: 1, v: 1}. What is prob of picking 2 x, 1 y, and 1 i? 1/105 Four letters picked without replacement from {b: 13, q: 3}. What is prob of picking 2 b and 2 q? 9/70 Three letters picked without replacement from {c: 6, j: 1, t: 2, o: 2, k: 1}. Give prob of picking 1 k and 2 o. 1/220 What is prob of picking 1 i and 2 f when three letters picked without replacement from puifsffupstu? 3/220 Two letters picked without replacement from {n: 9, k: 2}. What is prob of picking 2 n? 36/55 Calculate prob of picking 1 z, 1 e, and 1 u when three letters picked without replacement from {u: 2, e: 8, h: 4, z: 2, o: 4}. 8/285 Three letters picked without replacement from {s: 11, j: 3}. What is prob of picking 3 j? 1/364 Three letters picked without replacement from spppusspu. Give prob of picking 2 p and 1 u. 1/7 Calculate prob of picking 2 t when two letters picked without replacement from xkkktxkkxkxkjjtk. 1/120 Three letters picked without replacement from {n: 2, y: 4}. Give prob of picking 2 n and 1 y. 1/5 Two letters picked without replacement from vyoovovjootz. Give prob of picking 1 y and 1 j. 1/66 Three letters picked without replacement from mmjdqajjppjjpqj. What is prob of picking 1 j, 1 m, and 1 q? 24/455 What is prob of picking 3 g and 1 e when four letters picked without replacement from {g: 3, e: 1, o: 4, q: 2, n: 2, s: 3}? 1/1365 Three letters picked without replacement from amrrmrmarzamrzza. What is prob of picking 3 z? 1/560 Four letters picked without replacement from {p: 2, g: 1, f: 7, c: 3, t: 1}. What is prob of picking 1 g, 1 p, and 2 c? 6/1001 Calculate prob of picking 1 w and 1 t when two letters picked without replacement from {n: 1, t: 3, c: 2, w: 1}. 1/7 Three letters picked without replacement from ccvqcvqvccqvvjcc. Give prob of picking 1 j and 2 c. 3/80 What is prob of picking 1 v and 1 c when two letters picked without replacement from baamcvcbmbbcjcm? 4/105 Three letters picked without replacement from cqqqqccqccx. Give prob of picking 1 q and 2 c. 10/33 What is prob of picking 1 l and 2 k when three letters picked without replacement from elkbbkklllk? 8/55 Four letters picked without replacement from drdrlzllllzrddd. Give prob of picking 1 r and 3 l. 2/91 Three letters picked without replacement from kkkpkkkkkkpkppppkppp. What is prob of picking 3 p? 7/95 Three letters picked without replacement from bzyveke. What is prob of picking 1 y, 1 b, and 1 v? 1/35 Calculate prob of picking 3 r and 1 j when four letters picked without replacement from {r: 3, n: 9, j: 5, k: 2}. 5/3876 What is prob of picking 1 y and 1 u when two letters picked without replacement from uucyuuyucyuycc? 24/91 Two letters picked without replacement from oneeiaeonninnyeonoaa. Give prob of picking 2 n. 3/38 Two letters picked without replacement from xxxxxxxexxxx. What is prob of picking 1 e and 1 x? 1/6 Three letters picked without replacement from wjwwwwwj. What is prob of picking 1 w and 2 j? 3/28 Three letters picked without replacement from geegghee. Give prob of picking 3 e. 1/14 What is prob of picking 2 v when two letters picked without replacement from {v: 10, z: 9, f: 1}? 9/38 Three letters picked without replacement from xbbnbbkbr. Give prob of picking 1 b, 1 k, and 1 x. 5/84 Three letters picked without replacement from tpwpgpgtpoppttpwwx. What is prob of picking 1 w and 2 t? 3/136 Calculate prob of picking 1 u, 1 p, and 1 i when three letters picked without replacement from {i: 2, u: 1, y: 2, p: 6, k: 4}. 12/455 What is prob of picking 3 h when three letters picked without replacement from {c: 7, g: 6, d: 3, h: 3}? 1/969 Four letters picked without replacement from wssmwmnsfwefmwssnsms. Give prob of picking 1 m and 3 s. 28/969 Calculate prob of picking 1 e and 3 g when four letters picked without replacement from {g: 3, e: 3}. 1/5 Four letters picked without replacement from {h: 1, a: 1, j: 2, y: 1, o: 1, c: 2}. What is prob of picking 1 c, 1 y, and 2 j? 1/35 Calculate prob of picking 1 z, 1 u, and 1 a when three letters picked without replacement from zuauaaa. 8/35 What is prob of picking 1 s and 1 i when two letters picked without replacement from {i: 17, s: 2}? 34/171 What is prob of picking 1 z and 1 f when two letters picked without replacement from {f: 2, z: 2}? 2/3 Two letters picked without replacement from {c: 1, f: 1, x: 1, a: 1, j: 3}. Give prob of picking 1 j and 1 f. 1/7 Three letters picked without replacement from jyvyycs. Give prob of picking 1 s and 2 y. 3/35 Calculate prob of picking 2 v and 2 r when four letters picked without replacement from rrvvdrvvdrvvv. 126/715 Calculate prob of picking 1 p and 1 l when two letters picked without replacement from lqphqpvhhqvh. 1/33 Calculate prob of picking 1 i, 1 a, and 2 m when four letters picked without replacement from {a: 8, m: 5, i: 5}. 20/153 What is prob of picking 1 k and 1 y when two letters picked without replacement from {y: 2, e: 3, k: 5, x: 2}? 5/33 Two letters picked without replacement from {k: 1, m: 3, s: 1, q: 4, n: 2}. What is prob of picking 2 q? 6/55 Calculate prob of picking 2 t when two letters picked without replacement from {v: 6, x: 2, e: 2, t: 3, h: 1, p: 1}. 1/35 Two letters picked without replacement from ebfepmpppef. What is prob of picking 2 e? 3/55 Two letters picked without replacement from {d: 2, i: 4}. What is prob of picking 2 d? 1/15 Calculate prob of picking 2 x and 2 s when four letters picked without replacement from {c: 1, x: 4, s: 3}. 9/35 Three letters picked without replacement from iuiui. What is prob of picking 1 u and 2 i? 3/5 Three letters picked without replacement from hxrhvvxjvvvv. Give prob of picking 1 j, 1 r, and 1 v. 3/110 Four letters picked without replacement from hrrusseuswssuue. What is prob of picking 1 s, 2 e, and 1 u? 4/273 Four letters picked without replacement from lqnnnlqnnqnqnnqql. Give prob of picking 1 n, 1 q, and 2 l. 36/595 What is prob of picking 1 m, 1 z, and 1 s when three letters picked without replacement from {z: 6, v: 1, w: 1, s: 2, m: 3}? 18/143 Two letters picked withou	{ "pile_set_name": "DM Mathematics" }
+ 6j - 1. Let r be s(6). Let x(u) = 6u3 - u2 - u. Calculate x(r). -6 Let v be (-17 + 2)2/(-5). Let p(d) = -2d + 7. Let o be p(v). Let u(i) = -i*3 - 4i*2 + 3i - 3. Determine u(o). 7 Let x(r) = r3 + r2 + r - 1. Let q(a) = -a*3 + 4a*2 + 5a + 1. Let h be q(5). Let j(i) = 2i3 + 4i*2 + 2i. Let m(v) = hj(v) - x(v). What is m(-2)? 3 Let a(j) be the second derivative of j3/6 + 2j*2 + 8j. Determine a(-4). 0 Let k be 440/45 + 4/18. Suppose 3q - 5i + k = 0, -4q - 6i + 5i - 21 = 0. Let u = 2 + q. Let y(r) = r + 3. Give y(u). 0 Let i(p) = -14p + 1. Let y be 1(2/4 + 7/14). Determine i(y). -13 Suppose 3b = 8 - 2. Suppose -y + 4h + 1 = -17, -4y = bh. Let f(z) = -3z + z - z*y + 0z2 + 1. Give f(-2). 1 Let y(b) be the third derivative of b4/6 + 7b3/6 - 18b*2. Let l(s) = s. Suppose 3n + 2n = -25. Let h(m) = nl(m) + y(m). Determine h(5). 2 Suppose 5w = o - 12, w + 3o + 18 = -2o. Let m(q) = 4 + 4q*2 - 7 + 2q + q3 + 1. Determine m(w). 1 Let q(r) = r3 - 5r2 - 3r + 6. Let d be (-5)/6-4(-225)/(-125). What is q(d)? 24 Let o be (-1 - -3)(-48)/(-32). Let l(y) = -y3 + 3y*2 + 5y - 2. Calculate l(o). 13 Let l(i) be the second derivative of i5/10 - i4/3 + i3/6 + i2 - 13i. What is l(2)? 4 Let l be (8/1)/(-3 - -4). Let v = l + 0. Suppose 0w - v = 2w. Let r(q) = q2 + 5q + 5. Calculate r(w). 1 Let u(y) = -6y2 - 16. Let h(m) = -m2 - 3. Let t(q) = -11h(q) + 2u(q). Let g(x) = -7x*2 - 7x + 1. Let r(o) = -g(o) + 6t(o). Give r(-6). -1 Let r(i) = 15i + 24. Let m(z) = 3z + 5. Let d(k) = 24m(k) - 5r(k). Suppose s - 8b + 18 = -3b, 4b = -s + 18. Calculate d(s). -6 Suppose 0 = -5u - 6 + 11. Let y(d) = -d2 + d + 1. Calculate y(u). 1 Let y be ((-2)/1)/(4/(-14)). Let c(u) = -u3 - 5u*3 - 1 + yu*3 - u - 4u*2. Determine c(4). -5 Let s(y) = -6y + 34. Let h be s(6). Let w(k) = k - 2. Give w(h). -4 Let t be 1-3(-2 - 3). Suppose -3o - 2o - t = 0. Let k(j) = j + 1. Calculate k(o). -2 Suppose 0h = -3r - 5h + 31, -4r + 5h = -18. Suppose 3 = -b + r. Let d(v) = -2v*3 - bv2 + 0 + 2 + v3. Determine d(-2). -6 Let v(d) = -4d - 2d - 2d + d2 - 6 + 9. Calculate v(3). -12 Suppose 0 = -5a - 19 - 6. Let h(s) = -2s - 7. What is h(a)? 3 Let c(u) = -u - 6. Suppose -3h = -5h + 10. Suppose 4l = r - 23, hr + 17 = l - 3l. Determine c(l). 0 Let k(q) = 4q2 - 2q + 1. Let s(n) be the third derivative of n*2 + 1/6n*3 + 0n - 1/60n5 - 1/24n*4 + 0. Let p be s(0). Determine k(p). 3 Let l be (4/6)/((-2)/6). Let x be (l - (-6)/3)-1. Let f(r) = -r*2 - r + 2. What is f(x)? 2 Suppose 0 = x, -5n - 4x - 8 = -18. Let t = -13 - -19. Let z(a) = -2a*3 - 2 - ta*3 + 9a*3. Give z(n). 6 Let h(i) be the third derivative of 5i*5/12 + 2i*3/3 - 3i*2. Let c(k) = -6k*2 - 1. Let o(s) = -9c(s) - 2h(s). Give o(1). 5 Let b be 2/8 - 102/24. Let z be 2 - 2/b-10. Let a(t) = -2t - 4. Calculate a(z). 2 Let w(j) = 3j + 3. Let u be ((-2)/(-6))/((-2)/(-12)). Suppose g - 2 = ug. Give w(g). -3 Let z(p) = -3p - 4. Let l be -1 - -1 - 1 - 4. Let t(d) = d*3 - 6d*2 - 8d + 5. Let s be t(7). Let o = l - s. What is z(o)? 5 Let k(n) be the first derivative of -n*3/3 - 2n*2 + 5n + 1. Suppose -15v = 12v + 135. What is k(v)? 0 Suppose 2d + 5 - 1 = 0. Let g(u) = -2u - 2 - 3u + 6u. Calculate g(d). -4 Let q(g) = -g + 1. Suppose 9 - 7 = 2t. Determine q(t). 0 Let o(j) = -5j*3 + 8j*2 - 2j - 14. Let k(h) = -2h3 + 3h*2 - h - 5. Let l(m) = -8k(m) + 3o(m). Determine l(2). 10 Suppose 0 = 2w - 0w - 2. Let j(k) = -24k + 45k - 21k + 5k3 + 1. Determine j(w). 6 Let y(r) = -r + 3. Let v(m) be the first derivative of m3/3 + 2m*2 + 4m - 4. Let w be v(-3). Let z be (-10)/(2/(0 - w)). Give y(z). -2 Suppose 0 = 2x + x + 2s - 3, -5x - 11 = -2s. Let t be 2 + (3 + x)1. Let d(y) = -y3 + 3y*2 + 2y + 1. What is d(t)? -7 Let v be (7/(-3) - -2)6. Let l = 5 + v. Let o(a) = l + 4 - a - 9. Determine o(5). -7 Let o(v) be the second derivative of -v3/6 + v2/2 - 3v. Suppose -3d + 30 = -6. Suppose 0 = -k - 2k - d. Calculate o(k). 5 Let p = -3 - -3. Suppose -u - u + 10 = p. Let b(f) = -f - 1. Let j(a) = 4a + 13. Let y(s) = -5b(s) - j(s). Determine y(u). -3 Let p(t) be the third derivative of t*5/60 + 5t*4/24 + 2t*3/3 + 4t*2. Calculate p(-5). 4 Let b(l) = 2l*2 - l - 1. Let p be (-10)/45 - (-16)/(-9). Let z be b(p). Let f be (z/6)/(9/12). Let o(t) = -3t*2 + t + 1. What is o(f)? -9 Let c(j) = -4j. Suppose u + 2u - 18 = 0. Let t = u + -7. Determine c(t). 4 Let h be 2-1 - -2 - 9. Let l = 7 + h. Let b = l + 5. Let g(p) = -2p + 1. Determine g(b). -5 Let g(s) be the first derivative of s3/3 + 5s*2/2 + 6s - 1. Let a be ((-10)/6 - 0)3. Calculate g(a). 6 Let s(n) = 6 - 4n - 13n2 + 14n2 - n. Calculate s(6). 12 Let n(b) = -b2 + b + 1. Let w be (1/(-3))/((-2 + 3)/3). What is n(w)? -1 Let n(b) be the third derivative of b4/8 + b3/6 - 24b2. Give n(-3). -8 Let k(i) be the second derivative of 3i3/2 - i2 + 18i. Give k(-2). -20 Let f(n) be the first derivative of n5/20 + n4/4 - 7n*3/6 - 5n*2/2 + 5n - 1. Let u(w) be the first derivative of f(w). Give u(-4). 7 Let z = 17 + -15. Let j(g) = g*2 + 0g*2 + 0g*z + 6g. Let i(y) = y - 5. Let l be i(0). Determine j(l). -5 Let b(f) = -f + 6. Let n(g) = -g. Let j(i) = -b(i) + 2n(i). Give j(-6). 0 Let q(p) = 5p - 2p3 - 5p*3 - 2 + 6p*3 - 3p2 - p. What is q(-4)? -2 Let m(y) = y3 + 2y2 + y - 7. Let w(p) = p3 + 2p*2 + p - 6. Let h(k) = 6m(k) - 7w(k). Give h(-2). 2 Let q(b) = -b3 + 6b*2 - 7b - 1. Suppose 5w = 4o + 10, 0 - 10 = -2o. Let h be (20/w)/(4/6). Determine q(h). -11 Let n be 60/(-18)(-6)/(-5). Let o(g) = g*2 + 4g + 2. What is o(n)? 2 Let r(n) be the first derivative of -n*3/3 + 7n*2/2 - 4n + 34. Calculate r(5). 6 Suppose -2s - 2s = 4n - 52, -2s = -3n - 6. Let y = -3 + s. Let c(j) = 3j + y - 5 - 4j - 3j2 - j. Determine c(-2). -7 Let c be ((-21)/6)/((-1)/2). Suppose c = w + 2. Let d(n) be the first derivative of n2/2 - 5n + 2. Determine d(w). 0 Let m(f) = 5f2. Let b be m(-1). Let i(k) = -k2 - 5k - 1. Let g(a) = 2a*2 + 10a + 1. Let z(y) = bi(y) + 2g(y). Determine z(-4). 1 Let v(n) = -6n3 + 1 - 20n + 15n + 5n. Calculate v(1). -5 Suppose 0 = z + 2z - 7z. Let c(p) = -p*2 + 2. Calculate c(z). 2 Let u(a) = -a + 7. Let k be u(5). Suppose -6 = -ky - 2. Let q(r) = r + r + yr - 5r + 5. What is q(5)? 0 Let x(r) = r - 2 + 3 + 0r + 0r. Let t(d) = d*3 + 4d*2 - d + 2. Let p(s) = t(s) - 4x(s). What is p(-5)? -2 Let n(t) = t*2 + 8t - 4. Let y(v) = -v + 10. Let q be y(6). Let s = q + -12. Determine n(s). -4 Suppose -4w - 1 = 3p, 3 = -3w - 0w. Let h(x) = -1 - p + 5x + 4 - x3 - x2 - x. Calculate h(-3). 8 Let b(j) = j3 - 7j*2 + 8j - 4. Suppose 51 = 5s - 9. Suppose z + a = 5, 5z + s - 47 = 5a. Give b(z). 8 Let s(l) = -l + 12. Let o be s(14). Let d(v) = 5v - 1. Calculate d(o). -11 Let o(m) = 2m - 18. Let t be o(7). Let u be (3/4)/((-2)/(-8)). Let b(d) = -4 - ud*2 + 2d - 1 + d - d*3. Give b(t). -1 Let t be 1((-4)/(-1))/(7 - 9). Let b(w) = 2w3 - w2 - 2w. Determine b(t). -16 Suppose -5l + 2 = 4v, -4l + v + 2 = -8. Let n(p) = pl + p2 - p2 + 1 - 6p. Let c(b) = -3b - 1. Let j be c(-2). Calculate n(j). -4 Suppose -5m + 3b - 28 + 6 = 0, -b - 1 = 0. Let s(a) = a2 - 1. Let d be s(-1). Let k(c) = c - 2 + 4 + dc. Give k(m). -3 Suppose 3f + 0f - 6 = 3w, -3w - 11 = -4f. Let m(l) = l3 - 5l2 + l + 5. Give m(f). 10 Let u(y) be the first derivative of y6/120 - y5/15 - y4/4 - y*3/3 + 2y2 + 4. Let o(w) be the second derivative of u(w). Give o(5). -7 Let i = 10 - 4. Let l(t) = t3 - 6t2 - 2t + 6. Determine l(i). -6 Let j(w) be the first derivative of w*3/3 + 2w*2 - 5w - 16. What is j(-4)? -5 Let y(c) = 44c2 + 11c - 11. Let h(r) = 15r2 + 4r - 4. Let o(v) = -11h(v) + 4y(v). Suppose 0 = 5z + z - 24. Suppose -3 = zb + 1. Determine o(b). 11 Let s be (-26)/(-5) + 2/(-10). Suppose 0 = sn - 3v + 5, 9 + 4 = -2n - v. Let a be n/14 - 4/(-14). Let c(f) = f3 - f2 - 1. Calculate c(a). -1 Let v(g) = -3 + 4g*3 + 4g - 5g3 - 6g - 1 + 4g*2. Determine v(3). -1 Let y(r) =	{ "pile_set_name": "DM Mathematics" }
umber? True Is 925982429 composite? True Is 12050587 a composite number? False Is 234787711 a composite number? False Is 604585 a prime number? False Is 30827249 composite? False Is 20893817 a composite number? True Is 89491 prime? True Is 367670417 a prime number? True Is 5573849 composite? False Is 614267 a prime number? True Is 31859279 composite? True Is 137316199 prime? False Is 14135921 composite? False Is 3531647 prime? False Is 111547 prime? False Is 64599089 a composite number? True Is 42512891 prime? True Is 346039 composite? False Is 703433 composite? True Is 15198847 composite? False Is 281657503 a prime number? True Is 29891 a composite number? True Is 481663147 prime? False Is 10816121 a composite number? True Is 201066983 composite? True Is 4682903 a composite number? False Is 9595423 prime? True Is 24013091 a composite number? False Is 312956407 a composite number? False Is 46857373 prime? False Is 100048373 composite? True Is 509885 a composite number? True Is 3004493 a composite number? False Is 314265841 a prime number? True Is 1481 composite? False Is 7979441 prime? True Is 198249157 a prime number? False Is 29972389 a prime number? True Is 158847841 prime? False Is 44604167 a prime number? True Is 911503 a prime number? True Is 10745293 composite? True Is 579203 a prime number? False Is 18995246 prime? False Is 6477011 a prime number? True Is 1641797 a composite number? False Is 452671 a prime number? True Is 39441 composite? True Is 7034593 a composite number? False Is 26423819 prime? True Is 20819486 prime? False Is 12004877 composite? True Is 767951 a composite number? False Is 24170981 composite? False Is 6653 a prime number? True Is 193342397 a composite number? False Is 153191 a prime number? True Is 9282067 a prime number? False Is 154219 composite? True Is 275135533 a prime number? True Is 202505399 prime? True Is 425939 composite? False Is 54684443 prime? False Is 2343589 prime? True Is 5106301 a composite number? True Is 2269931 composite? False Is 32434049 a prime number? True Is 1971091 prime? True Is 163183789 composite? False Is 889841 prime? False Is 20023037 composite? False Is 58381931 a composite number? False Is 141012917 a prime number? True Is 758060701 a prime number? False Is 10468643 a prime number? False Is 2857297 a prime number? True Is 366491 a composite number? True Is 128541397 a composite number? True Is 346739 prime? True Is 22070239 prime? False Is 11294089 prime? False Is 92905093 a prime number? True Is 372641 prime? False Is 338359 a composite number? True Is 2449973 composite? True Is 28820617 a composite number? True Is 535915131 prime? False Is 80330281 prime? False Is 210136741 a composite number? False Is 142638997 composite? False Is 90672971 prime? True Is 131365561 a composite number? False Is 1180369 a composite number? False Is 1661749 a composite number? True Is 20757907 prime? True Is 313612973 prime? True Is 107499029 a prime number? False Is 55554593 a prime number? True Is 264241 a prime number? False Is 2597857 prime? True Is 118584181 composite? False Is 7904333 composite? False Is 224578469 a composite number? False Is 87791471 composite? False Is 56571641 prime? False Is 50466529 prime? True Is 74131 prime? True Is 19162238 a prime number? False Is 86897207 a prime number? True Is 39125129 prime? False Is 368273 a prime number? True Is 197386229 a prime number? False Is 3169703 a prime number? False Is 51481343 a composite number? False Is 408592697 prime? True Is 40523177 composite? True Is 165508393 composite? True Is 12490571 a prime number? False Is 20595349 a prime number? True Is 81777513 composite? True Is 2842937 composite? False Is 142079902 a composite number? True Is 7745701 a composite number? False Is 119882687 prime? True Is 44847787 composite? False Is 4179673 a composite number? False Is 54291163 prime? True Is 9696265 a prime number? False Is 11865289 composite? False Is 212609 a prime number? False Is 212171 a composite number? True Is 52754371 a prime number? True Is 23629343 a composite number? False Is 5169127 composite? True Is 20326559 a prime number? False Is 154354831 a composite number? False Is 60688547 a prime number? False Is 948167 a composite number? True Is 111232721 a prime number? True Is 136892411 a composite number? True Is 4779739 a composite number? True Is 2404151 prime? True Is 1567321 a prime number? False Is 5258441 composite? True Is 5850521 composite? True Is 681874807 composite? False Is 1390237 a prime number? False Is 70520987 prime? True Is 230858959 a composite number? True Is 1565867 prime? True Is 2253261 a prime number? False Is 219911 a composite number? False Is 37724369 composite? False Is 11976967 prime? False Is 11723273 composite? True Is 270952351 composite? True Is 11921633 composite? False Is 7167151 composite? False Is 5974249 prime? True Is 1262909 composite? True Is 8669159 prime? True Is 9798531 a composite number? True Is 21229865 prime? False Is 1678169 a prime number? False Is 5194829 a composite number? True Is 183037 prime? True Is 201803002 composite? True Is 17500589 a composite number? False Is 133030255 a composite number? True Is 12657283 composite? False Is 91588891 prime? True Is 148324929 a composite number? True Is 29835613 prime? True Is 1062599 prime? True Is 138093877 composite? True Is 5261638 a prime number? False Is 29260123 composite? False Is 39816557 composite? True Is 3031139 a composite number? True Is 22850411 prime? True Is 13223077 a composite number? True Is 56527333 composite? False Is 392479721 composite? False Is 9864119 prime? True Is 22529399 a prime number? False Is 183225821 composite? True Is 55187137 prime? False Is 909373 a prime number? False Is 6848351 a composite number? False Is 96810085 a composite number? True Is 801496079 a prime number? True Is 7579193 a prime number? True Is 227267 a prime number? True Is 2305883 composite? False Is 18722987 a prime number? True Is 2323829 a composite number? True Is 246649 composite? True Is 1172063 composite? False Is 112089 composite? True Is 51054481 a composite number? False Is 169941397 a prime number? True Is 2400793 a prime number? True Is 171802199 a prime number? False Is 21955589 a prime number? True Is 3580529 a composite number? True Is 4115863 a composite number? False Is 8069497 a composite number? True Is 3958527 a prime number? False Is 42065681 a composite number? True Is 478324349 composite? False Is 118794119 a prime number? True Is 35540839 a composite number? False Is 7155843 a composite number? True Is 56867249 a composite number? False Is 2890949 a prime number? True Is 7385557 composite? False Is 1367519 prime? True Is 986449 a composite number? True Is 4296661 prime? False Is 315411487 a prime number? True Is 2075599 prime? True Is 8852791 prime? True Is 8276483 composite? True Is 69419033 composite? False Is 8284363 composite? False Is 113244481 composite? True Is 2305937 a prime number? False Is 7398073 a composite number? True Is 70215449 a composite number? False Is 20085353 a composite number? False Is 28750873 prime? True Is 90589871 composite? False Is 20636227 a prime number? True Is 62468527 a prime number? False Is 11692873 a composite number? False Is 3343817 a composite number? False Is 517981 a composite number? False Is 5533027 composite? True Is 13319297 a composite number? True Is 2700179 a prime number? True Is 811908401 a prime number? True Is 7455389 a prime number? False Is 16863433 a composite number? True Is 10706429 prime? True Is 1707751 composite? True Is 44882449 a prime number? True Is 70197293 a composite number? True Is 1789291 a prime number? False Is 5177413 a prime number? True Is 4349927 a prime number? True Is 260032613 prime? False Is 8233091 a composite number? False Is 14965381 a prime number? False Is 8867542 a composite number? True Is 5668919 a prime number? True Is 108393973 prime? True Is 5677957 prime? True Is 451189 a prime number? False Is 4740639 composite? True Is 38078669 a composite number? False Is 100907 a prime number? True Is 2829041 a prime number? False Is 1866457 composite? False Is 18526663 composite? False Is 36134017 a prime number? Tru	{ "pile_set_name": "DM Mathematics" }
4c3. What is x(3)? 21 Suppose -2l = 3l. Suppose l = -5x + 4j - 16, -x = 4j - 2 - 14. Let q(n) = 8 - 4n2 - 3n*2 + 6n2 + n. Calculate q(x). 8 Let l(g) = -g3 + 5g2 - 2g - 3. Let v = 11 + -7. Suppose -3y + 8 = -2o, vy - 3 = -3o + 2. Let a = 2 + y. Give l(a). 5 Let a(c) = 5c - 2 - 2c - c. Let u be 14 + -2 - (-1)/1. Suppose -2b + 2 - u = -3z, 4z - 10 = -2b. Determine a(z). 4 Let l(p) = p*2 - 5p - 7. Suppose 5c - 23 = 4d, 2c + d - 17 = -0d. Calculate l(c). 7 Let z be 3 + 4 + -7 - -21. Suppose 0c - 3c = -z. Let i(f) = f*3 - 7f2 - f + 6. Give i(c). -1 Let x(l) be the first derivative of l6/30 - l5/60 - l4/24 - l2/2 - 2. Let a(q) be the second derivative of x(q). Let p = -7 + 6. Calculate a(p). -4 Let f = -23 + 21. Let u(a) be the first derivative of a4/12 + a*3/2 - a - 1. Let s(l) be the first derivative of u(l). Determine s(f). -2 Let u = 0 + -1. Let b(j) be the second derivative of -1/5j*5 - j + 1/2j*2 + 0j*3 - 1/12j*4 + 0. Calculate b(u). 4 Let s(b) be the first derivative of 0b*2 + 1/4b*4 + 4 - 1/3b*3 + 4b. Determine s(0). 4 Let j(g) = -18 + g*2 - 33 + 6g + 50. Suppose -3h - 15 = 4y, 12 + 3 = -3h + 2y. What is j(h)? -6 Let d = 21 + -21. Let l(z) = -2z + 2z + 3 + 7 + z. Determine l(d). 10 Let l(p) = -1 + 4p2 + 1 + 0p*2. Suppose -4r - 11 = s - 6s, 0 = -3r - 12. What is l(s)? 4 Let u = -6 + -9. Let s(i) = -i*2 - 15i + 1. Calculate s(u). 1 Let d(c) be the second derivative of -c3/6 + c2 - c. What is d(-7)? 9 Let z(v) = 4v. Suppose -3 = 19k - 18k. Give z(k). -12 Let m(q) = -5q3 + q2 + q - 1. Let l be (1 + -2)/(1/(-1)). Give m(l). -4 Let q = -25 + 29. Let f(c) = -c + 3. Give f(q). -1 Let t(a) = 4a2 + 1. Let d be t(1). Let b = 2 - d. Let q(h) = h2 + 2h + 2. Let v be q(b). Let p(o) = -o + 11. Give p(v). 6 Suppose 4i + 1 = -55. Let x = i + 13. Let n(y) be the second derivative of -9y5/20 + y3/3 + y*2/2 - y. Give n(x). 8 Suppose -3x = -0x - 9. Let u(m) = m + 2 - x + 0. Calculate u(5). 4 Let b(t) = -3t*3 - 5t*2 - 2t + 3. Let r(g) = -13g3 - 19g*2 - 9g + 12. Let q(w) = 9b(w) - 2r(w). Give q(-7). 3 Let n(m) = -1 + 143m - 47m - 42m - 49m + 2m2. What is n(-4)? 11 Let j be 4 + (-7 - 1 - -4). Let w = 6 + j. Let u(r) = -3r + 9. Determine u(w). -9 Let q be ((-5 + 2)1)/((-21)/56). Let v(g) = -2g - 7. Calculate v(q). -23 Let v(o) be the third derivative of 0 + 0o4 + o2 + 0o + 4/3o3 - 1/60o*5. Calculate v(0). 8 Let v(a) = -a - 15. Let d = -91 - -83. Calculate v(d). -7 Let f(q) = 2q*2 - 2q. Let v(g) = -4g - 8. Let u be v(6). Let a be 72/u + 2/8. What is f(a)? 12 Let a(y) = -4y*3 - 7y*2 + 4y + 4. Let m(b) = -3b3 - 6b*2 + 3b + 3. Let s(i) = -4a(i) + 5m(i). What is s(2)? -3 Let b(q) = -2q2 + 2q*3 - 2 + 0q + 2 - q. Determine b(2). 6 Suppose 0 = o - 4o. Let h(a) = -2a*3 - 2a*2 + 15a - 13. Let z(m) = m3 + m2 - 7m + 7. Let j(u) = -6h(u) - 13z(u). Calculate j(o). -13 Let l(k) = k2 + 3k. Let u be l(-5). Suppose -5t = 10 + u. Let y(c) = -c - 8. What is y(t)? -4 Let p be (-3 - 10/(-3))15. Let d(s) = -s - 2. Let c(f) = f. Let u(o) = pc(o) - d(o). Calculate u(-2). -10 Let y(s) = -2s*2 + 6s - 2. Let h(t) = t*2 - 6t + 1. Let i(u) = 3h(u) + 2y(u). Let m(v) = v + 1. Let d(a) = -i(a) - 3m(a). Let o = -4 - -1. What is d(o)? -2 Let y(o) = -o - 3 - o - o2 + 2o - 3o. Let i(z) = -z2 - z - 1. Let l(x) = -5i(x) + 2y(x). Determine l(-1). 3 Let x = 3 - 4. Let m(b) = b. Give m(x). -1 Let z be 9/(-60)(-50)/36. Let b(r) be the third derivative of -r*2 + 0r + zr4 + 0 - 1/60r*5 - 1/6r3. What is b(2)? 5 Let l(g) be the second derivative of -g4/12 + g3/6 + g2 + 2g. Let h(q) = q - 14. Let j be h(7). Let f = -3 - j. What is l(f)? -10 Let h be (1/(-2))/(2/16). Let k(y) = 6y*2 - 13y - 3. Let n(a) = 5a2 - 12a - 3. Let o(u) = 6k(u) - 7n(u). What is o(h)? -5 Let o(q) = 4q - 5q - 12 + 0q. Give o(0). -12 Let o(i) = -2i*3 + 3i*2 - i. Suppose -3d - 2u = -25, 47 = 5d - 3u + u. Let r = d - 7. Determine o(r). -6 Let k(a) = -a2 - 14a + 12. Let s(b) = b*2 + 13b - 12. Let c(r) = 2k(r) + 3s(r). Calculate c(-11). -12 Let m(s) = -s3 + s. Let k(i) = -i3 - 4i2 + i + 2. Let b be k(-3). Let q be 14/b + 4/10. Determine m(q). 0 Suppose -5i + 3x = -5, 6i + 23 = 2i - 3x. Let h(j) = -2j + 1. Let y(w) = -8w + 4. Let n(d) = -5h(d) + y(d). What is n(i)? -5 Let z(u) be the first derivative of -u3/3 - 7u*2/2 - 9u - 2. Let a = -49 - -43. What is z(a)? -3 Let j(u) be the first derivative of 5u3/3 + u2 + u + 26. Determine j(-1). 4 Let f be 84/(-10) + 18/45. Let n(p) = -p2 - 7p + 10. Let u be n(f). Let r(w) = 5w + 2 + wu - 2w2 + 4 + 0. Calculate r(5). 6 Let c(q) be the first derivative of -q4/4 - 4q3/3 + q2/2 + 2q + 2. Let u(x) = -4x + 4. Let b be u(2). Calculate c(b). -2 Let w(c) = 4c*3 + 5c*2 - 4c + 16. Let v(x) = x*3 + 2x*2 - x + 5. Let h(j) = -7v(j) + 2w(j). Let y = 8 - 13. Let m be (-1)/(5/4)y. Calculate h(m). -7 Let m = -14 + 18. Let r(d) = 2d - 6. Let h(b) = -3b + 5. Let y(i) = mh(i) + 5r(i). What is y(-7)? 4 Let d(o) = -3o3 + 6o*2 - 6o - 4. Let s(g) = -4g3 + 6g*2 - 7g - 3. Let v = 3 - -1. Suppose -vx + x = 9. Let p(h) = xd(h) + 2s(h). Calculate p(5). 1 Let r = -18 - -24. Let u(d) = -d + 2. Give u(r). -4 Let i = -24 - -24. Let x(q) = q3 + q2 + i + 2 + 0 - 2q - 1. Determine x(1). 1 Let s = -18 - -17. Let z(j) = -1 + 8j3 + j2 + 2 - 2j*2 + j. Give z(s). -9 Suppose 0 = 5s - 10. Suppose -2v + sg - 20 = -2g, -4v + 5 = g. Let x(q) = 4 - 4q2 + q3 + v - 3 - 6q. Give x(5). -4 Let i(c) = 2 - c*3 + 11c*3 - 3 + 2c - 2c2. Let s be 2(0 - -13) - 2. Let b = -23 + s. What is i(b)? 9 Suppose 0a + 7 = a. Let j be 1/(-2) + a/(-14). Let s(z) = 12z*2 + z. Calculate s(j). 11 Let q(s) = 2 + 0s - 5s - 9 + 4s. What is q(-6)? -1 Let x(l) be the third derivative of -l5/60 - l4/4 - l3/2 + l2. Let t be x(-5). Let d(i) = -3i - 5i*3 + 5i*2 - 3i*2 + i + 4i3. What is d(t)? -4 Let m(b) = -b3 + 5b2 - 6b + 2. Suppose -20 = -s - 3s. Suppose 4v + sy = 6, 3v + 0v = y + 14. Calculate m(v). -6 Let x(f) be the first derivative of -2f*2 - 3f + 22. Suppose 3i - n + 12 = -2n, -5i = 4n + 27. Give x(i). 9 Let m(h) = h + 2. Let x be m(4). Let f(t) = -t + 5. What is f(x)? -1 Let r(i) be the third derivative of i6/120 - i5/12 - 7i4/24 + 4i3/3 - i2. Let f(h) = -h*2 + 4h + 27. Let g be f(7). Give r(g). 2 Let f(y) = -y*3 - 6y*2 - 7y - 4. Suppose -4g + 5m - 1 = 0, -1 = -2m + 9. Let u(d) = -1 + 11 - d - 9. Let n be u(g). What is f(n)? 6 Let z be 86/18 - (-10)/45. Suppose -7 = -4g + 3y + 6, 4g = -3y - z. Let x(r) = -5r3 - r2 + r - 1. What is x(g)? -6 Let a be (1 + 1)/2-3. Let y(d) be the second derivative of -3d - 1/6d4 + 0d*2 - 1/20d*5 + 2/3d3 + 0. What is y(a)? -3 Let k(n) = -n3 - 21. Let z(w) = w*3 - 10w*2 + 10w - 9. Let y be z(9). Calculate k(y). -21 Suppose -2s = 2s - 20. Let q(l) be the first derivative of -2 - 3l + 3l*2 - 1/3l*3. Give q(s). 2 Let p(c) = c - 5. Suppose -4t - t = 3j + 75, 4t + 2j + 62 = 0. Let v = t + 18. What is p(v)? -5 Let g(k) = 2k + 5. Let v(l) = l*2 + 3l - 2. Let i be v(-2). Calculate g(i). -3 Let y(l) = 2l - 4. Suppose -2d + 2f = -0d + 6, d + 11 = -f. Let g = -6 - d. Let i be (2/(-5))/(g/(-10)). Give y(i). 4 Let o(x) = x*2 - 14x + 40. Let f be o(10). Let w(y) = -y. Give w(f). 0 Let q(n) be the first derivative of -n*4/4 - 2n*3/3 - 4n + 1. Let l be 68/(-20) + 8/20. Calculate q(l). 5 Let u(b) be the second derivative of b*3/6 + 3b*2/2 - 2b. Calculate u(-5). -2 Let m(a) = a*2 - 2a. Suppose 3z + 10 = 1. What is m(z)? 15 Let x(u) = -6u - 23 + 48 - 32 + 7u. What is x(8)? 1 Let u(p) = -2p*2 - 5 - 3p + 0p3 + 7p2 - p3 + 3. What is u(4)? 2 Let p(j) be the third derivative of j5/60 - j4/6 - 7j3/6 - 4j*2. Give p(6). 5 Let b(x) = -x - 5. Let g be (-11)/(-4) + 1/4. Suppose gk = -3d + 3, 0 = 2k - 3k - 3d - 5. Determine b(k). -9 Let g(a) = -a*2 + a + 1. Suppose 4u = 3u + 3, -3l = -4u + 21. Give g(l). -11 Let b = 4 - 7. Let d be ((-1)/(b + 2))/1. Let l = 0 + d. Let n(o) = 3o	{ "pile_set_name": "DM Mathematics" }
v be a(-9). What is the nearest to -1/5 in 0.4, 55/2, -0.2, v? -0.2 Let c = -2 - 0. Let s = 109 + -109.102. Let f = s - -0.142. What is the closest to c in f, -0.5, -0.3? -0.5 Let m = -722939 - -305080043/422. Let r = 2/211 + m. Which is the closest to r? (a) 17 (b) 4 (c) 5 b Let c(l) = -5l2 + 111l - 21. Let v be c(22). What is the closest to -1/3 in -0.5, 26, v? -0.5 Let s be (-7)/(7/(-4)) + 63. Suppose -s - 125 = 8k. Let x be ((-1)/(-8))/(8/k). What is the nearest to -1/3 in -0.5, 4, x? x Let k be -1 + (-12)/(-3) + -12. Let q be 21/(-14)(-12)/k. Suppose l + 0l - 4 = 0. Which is the nearest to q? (a) 4/3 (b) 2/3 (c) l b Let m = -247 + 246.849. Let o = m - -0.151. What is the closest to 2/9 in o, -3, 2? o Let i = 9.21545 - 9.31545. Let b be (4/15)/((-12)/10). Let w = -17 + 33/2. What is the nearest to i in b, 1/9, w? b Let h = -167 + 166. Which is the nearest to -1? (a) h (b) 3.6 (c) 0 (d) -13 a Let h = 8082.96 + -8083. What is the nearest to -0.47 in 0, -3/4, h? -3/4 Let m be 1/(-1) + (-363)/(-12). Let j = m + -29. Let i = -0.6536 + 0.7536. What is the nearest to j in -3, i, 3? i Let p = -401 + 3607/9. Let z = 16 + -10. Let u be (-12)/80z/(-9). Which is the nearest to p? (a) 0.4 (b) -1/5 (c) u b Let j = 2/19089 - -38168/95445. Which is the closest to -1/9? (a) 219 (b) j (c) -4 b Let y = -3.8 + 2.8. Let l = 0.406 + -0.706. Which is the closest to y? (a) 12 (b) 0.5 (c) l c Let d = 0.3 + 0.7. Suppose 3072 - 157 + 385 = -75f. What is the nearest to d in f, -3/5, -5? -3/5 Let o(z) = 41310z - 82624. Let m be o(2). Let t be (-1)/(-2) + (-2)/6. What is the closest to -5/4 in 0.4, t, -2/3, m? -2/3 Let u = 2.35 - 2.45. Which is the closest to u? (a) 3/2 (b) -3 (c) 0.52 c Suppose -204r + 213r + 36 = 0. Which is the closest to -1/6? (a) 2/385 (b) 3 (c) r a Let h be (-9)/15(-90)/216. Which is the closest to -1/2? (a) h (b) 0.49 (c) 12 a Let j = -41/116 - -3/29. Let x = 2.496 + -3.5375. Let y = x + 0.0415. Which is the closest to y? (a) j (b) -2/9 (c) -11 a Let l = -6.7 + 6. Let q = -0.8 - l. Let c = 36.4 + -41.4. What is the nearest to q in c, 0, -10? 0 Let d = -1157.1 - -1157.2. What is the closest to 3 in 5, d, -62, 4? 4 Let i be ((-14)/28)/(6/(-3) - -3). Let f be (3 - 13/4)/(-1). Which is the nearest to f? (a) i (b) 0 (c) 2/5 c Let i = -0.8 - -0.7. Let k be 14/(-161) + 132/(-69). Let q be (-8 - -4)3/108k. Which is the closest to 1/2? (a) q (b) -9 (c) i a Let p = -621/3005 + 4/601. What is the nearest to p in -1/7, 1/4, 63, -1? -1/7 Let x = -21.117 + 1.117. What is the closest to -1 in -1, x, -3? -1 Let y = 13 + 3. Let j = 10.252 - -0.748. Let s = j - y. What is the closest to -2/3 in s, 18, -1? -1 Let d = -37 - 461. Let f = 493 + d. Which is the nearest to -0.9? (a) -1 (b) 1 (c) f a Let k = -23.3 + 23.39. Which is the nearest to 7? (a) 0.1 (b) 0.4 (c) k b Let w = 16/11 + -53/44. Let t = -16 + 13. Which is the nearest to 2/19? (a) w (b) -0.3 (c) t a Let q = -10843 + 130115/12. What is the nearest to 2 in q, -5/2, -119? q Let y be ((-5)/((-25)/4))/((-1260)/(-150)). Let o = -98 + 103. What is the nearest to -1 in -1/5, y, o? -1/5 Suppose 5f - 76 = -14f. Let u = 45 + -47.3. Let y = 1.3 + u. What is the nearest to 1/5 in y, -0.4, f? -0.4 Let x(m) = 245m - 3427. Let l be x(14). What is the nearest to l in -1, -8, -3, 1/7? 1/7 Let x = -0.57 + -0.43. Let f = -0.06 + -2.94. Let m = -2536 - -17754/7. Which is the closest to f? (a) m (b) x (c) 1 b Suppose -2l = 5y - 40, -65 = -5l - 11y + 16y. Suppose -6k - 5 = -r - 3k, 3r = -k + l. What is the closest to 5 in -3, 0.4, r? r Let x = -41 + 50. Let y = -11377/6 + 1896. What is the nearest to x in -2/7, -5, y? y Let r = -0.1 - -0.2. Let v = 0.232224 + 2.767776. Let h = 1.97 - -0.03. Which is the nearest to r? (a) v (b) -2 (c) h c Let i = -209.04 - -209. Let t be ((-24)/(-18))/(-23). Let k = -1.1 + 0.7. Which is the nearest to i? (a) 0.1 (b) k (c) t a Suppose 211w + 151w - 175 = 1273. Let a be 2/3 + -1 - 0. What is the closest to 0 in a, w, 1, 0? 0 Let n = -11532 - -11532. Which is the nearest to n? (a) -1 (b) -5 (c) 16 (d) 2/15 d Let m = -1589 - -1588.5. Which is the nearest to 2? (a) 1/4 (b) 2.6 (c) 2/7 (d) m b Let o = 2542/19 - 10149/76. What is the nearest to -0.2 in -2, -5, o, 2? o Suppose 35 = 163r - 168r, -3r = -3p + 9. Which is the closest to 0.1? (a) 1 (b) p (c) -2/5 (d) 16 c Let v = -19587.14 + 19587. What is the closest to -2 in -0.2, 1, v, 2? -0.2 Let d = 4811.08 + -4811. Which is the nearest to d? (a) -2/9 (b) -2 (c) 2 a Let w = -0.45804 + -0.04196. Let r = -58 - -59. Which is the nearest to 0.2? (a) w (b) 1/4 (c) r (d) -0.1 b Suppose 0i = 3i - 15. Let x = 72.9 - 10.9. Let l = 62.4 - x. Which is the nearest to l? (a) 1/5 (b) i (c) 0.5 c Let m = 0.06 + -0.26. Let j(i) = i2 + i + 1. Let w be j(0). Let d = -4132/13 + 318. Which is the nearest to w? (a) d (b) m (c) -2 a Let t = -0.2312 - -0.5312. Let b = -6 - -5. What is the nearest to 1 in -2/7, b, t? t Let r = 28.7 + -29.105. Let k = -0.305 - r. Which is the closest to 12? (a) 0.3 (b) k (c) 1/6 a Let o = -1.053 + 1.553. Which is the closest to o? (a) 0 (b) -110 (c) 2/17 c Suppose -5h - 5n = -40, -4n + 8 = -4h - 0n. Suppose 0 = 5b - 3t, -b - t = ht. Let j = -3.5546 + -1.4454. What is the closest to b in -3, -1/5, j? -1/5 Let f(g) = g3 - 8g*2 - 24g + 39. Suppose 11l = 4l + 70. Let w be f(l). Which is the nearest to -3/8? (a) 2/7 (b) w (c) 2 b Let r = -619 - -619.4. Which is the nearest to 1/34? (a) 3/2 (b) r (c) 1/6 (d) 2/77 d Let g be (-4)/(-54) + (-735)/2268. Let o(l) = -l + 25. Let z be o(11). Let w be ((-10)/4)/(21/z). Which is the closest to g? (a) 0.5 (b) w (c) -3/8 c Let t = -25763 + 25762.6. Which is the nearest to 0? (a) -9/5 (b) -1 (c) -5 (d) t d Let u = -13508 - -13508.3. Let x be -1 + 2 + 2/(-4). What is the closest to x in 1/8, u, -1? u Let l be (-106)/72-4 + 5/45. What is the closest to -2/3 in l, -1/8, 0.4? -1/8 Let u = -6 + -55. Let k = u + 59. What is the nearest to -27 in 0.4, k, -4? -4 Let r = -99948 + 99947. Suppose 0 = y - 3y - 10. Let a = -0.1 - 3.9. What is the closest to -2/3 in a, y, r? r Let d = 31245 - 31244.6. Let m = 1.4 + -0.4. Let v = m + -0.8. What is the closest to 1 in v, d, 6? d Let z be 140/105((-17)/10 + 1/5). Which is the closest to -3? (a) z (b) -62 (c) -1/3 a Let m = -18 - -9. Let q = -0.71 - 8.49. Let l = q - m. What is the nearest to -2/3 in 1/2, 4, l? l Let a(j) = -j3 + 26j*2 - 25j - 8. Let o be a(25). Let z be o + -1 + (-20)/(-4). What is the closest to -2/3 in -3/2, z, 1? -3/2 Let h = 64538.0483 - 64547. Let t = 0.0483 - h. What is the nearest to 0.1 in 2, -3/8, t? -3/8 Let w(g) = 92g + 921. Let b be w(-10). What is the nearest to b in 9, -3, 0.5, -3/11? 0.5 Let p be 6/28(-594)/(-891). Which is the closest to -3/10? (a) 8 (b) 3 (c) p (d) 0.1 d Let v = 3406 - 64712/19. Which is the closest to 7? (a) v (b) -1/3 (c) 0.049 a Let y be -1(-15 + (-58)/(-4)). Which is the nearest to -2/7? (a) 4 (b) -2.2 (c) 2 (d) y d Let n = -282 - -309. Suppose -13 = nv - 14v. Which is the closest to v? (a) -1/5 (b) 0.3 (c) -4 (d) -7/5 d Let v = -17 + 16. Let g be 910/(-5) + (9/(-1))/(-3). Let l = 176 + g. Which is the closest to v? (a) 0 (b) -1/3 (c) l b Let v = -41.84 + -1. Let l = v - -42.8. Which is the closest to -2? (a) 2 (b) 4 (c) l c Let z = -2757 - -2763. Which is the closest to 46? (a) z (b) 0.5 (c) 5 (d) -0.2 a Let z be (448/(-40) + 12)(-2)/(-4). Which is the nearest to -6? (a) z (b) 22 (c) -2/9 c Let v = 209.17 - 209. What is the nearest to -3 in v, -12, 3? v Let z = -28.17 - -31.17. Let b = 0 - 0. Let o = 0.995 + 0.005. What is the nearest to b in o, z, -0.3? -0.3 Let d = 4466 - 4519. What is the nearest to d in 0.04, 0.4, -3? -3 Let f = -0.11 + 0.09. Let a = 122.4 - 121.9. What is the nearest to f in -0.2, a, 0.4? -0.2 Let p = -334/2079 - 4/189. Which is the nearest to 1? (a) p (b) 10/9 (c) 0.2 (d) 2/11 b Let q = -1529 + 1517. What is the closest to -1 in 4, q, 3/4, -0.5? -0.5 Let y = -10291.5 - -10291. Let l = 2.4 - -0.6. Let p = l + -3.2. Which is the nearest to p? (a) 3 (b) y (c) -5 b Let c(y) = y*3 + 7y**2 - 2. Le	{ "pile_set_name": "DM Mathematics" }
tonne in kilograms? 3300 What is 1/6 of a decade in months? 20 What is one quarter of a litre in millilitres? 250 What is 0.6923044 hours in nanoseconds? 2492295840000 How many grams are there in 3/10 of a kilogram? 300 How many months are there in thirty-two fifths of a millennium? 76800 What is 2182.968 minutes in hours? 36.3828 How many decades are there in twenty-nine halves of a century? 145 What is 5/4 of a millimeter in micrometers? 1250 How many seconds are there in fourty-eight fifths of a hour? 34560 How many centuries are there in one tenth of a millennium? 1 How many decades are there in 3.167721 months? 0.026397675 How many milligrams are there in fourty-six fifths of a gram? 9200 What is 11/10 of a meter in millimeters? 1100 Convert 4.746665t to grams. 4746665 What is 4/15 of a millennium in months? 3200 What is 3/25 of a kilogram in grams? 120 What is one twentieth of a kilogram in grams? 50 Convert 161.0754 decades to millennia. 1.610754 What is 97.8409 nanometers in micrometers? 0.0978409 How many millilitres are there in 21/4 of a litre? 5250 What is 3/50 of a milligram in nanograms? 60000 How many months are there in 34/5 of a century? 8160 What is 5.320208 decades in years? 53.20208 How many months are there in twenty-one halves of a year? 126 What is five eighths of a gram in milligrams? 625 Convert 34.86187 milliseconds to seconds. 0.03486187 What is 0.2458337 decades in years? 2.458337 What is 92633.34l in millilitres? 92633340 How many minutes are there in 55/2 of a day? 39600 How many kilometers are there in 527.1358 centimeters? 0.005271358 Convert 398746.4um to meters. 0.3987464 How many litres are there in 0.8601928ml? 0.0008601928 How many months are there in 92.14262 centuries? 110571.144 How many minutes are there in nine tenths of a week? 9072 How many months are there in 7/3 of a decade? 280 What is 5.08337 millimeters in kilometers? 0.00000508337 How many decades are there in seventy-five halves of a millennium? 3750 How many tonnes are there in 3.115665ng? 0.000000000000003115665 What is 8256.4641 seconds in hours? 2.29346225 How many millilitres are there in 245960.5l? 245960500 What is twenty-one eighths of a micrometer in nanometers? 2625 How many milligrams are there in 1/16 of a kilogram? 62500 What is twenty-six fifths of a week in minutes? 52416 How many months are there in twenty-six fifths of a century? 6240 How many years are there in 1/5 of a decade? 2 What is fourty-five halves of a decade in months? 2700 How many tonnes are there in 99.79542mg? 0.00000009979542 How many meters are there in 75.8458 centimeters? 0.758458 What is 42387.05 millimeters in nanometers? 42387050000 How many litres are there in 0.2900306ml? 0.0002900306 How many micrometers are there in five eighths of a millimeter? 625 Convert 36772.83 years to millennia. 36.77283 What is 48/5 of a millennium in centuries? 96 What is 3/10 of a centimeter in millimeters? 3 Convert 716.1724 millilitres to litres. 0.7161724 How many millilitres are there in 3/25 of a litre? 120 How many litres are there in 738570.7 millilitres? 738.5707 How many meters are there in 1/20 of a kilometer? 50 What is 61.92474 kilograms in nanograms? 61924740000000 What is eleven tenths of a centimeter in millimeters? 11 How many decades are there in 710186.9 millennia? 71018690 How many nanometers are there in 0.597493cm? 5974930 Convert 603.041 years to months. 7236.492 What is 294669.7 millimeters in kilometers? 0.2946697 How many minutes are there in 6.857056 days? 9874.16064 How many tonnes are there in 750.7339mg? 0.0000007507339 What is 499364.9 grams in nanograms? 499364900000000 What is 7.177505ml in litres? 0.007177505 How many years are there in 562265.2 millennia? 562265200 How many micrometers are there in one twentieth of a meter? 50000 How many centimeters are there in 49476.19 meters? 4947619 Convert 264.8051 kilometers to centimeters. 26480510 How many months are there in 78.42781 years? 941.13372 How many millennia are there in 29084.445 months? 2.42370375 What is 1016.616cm in meters? 10.16616 Convert 98.49796ml to litres. 0.09849796 How many micrograms are there in 3/40 of a milligram? 75 How many months are there in one fifth of a decade? 24 How many milliseconds are there in 0.0695482 hours? 250373.52 What is 7.781885 litres in millilitres? 7781.885 What is 960.6798ms in seconds? 0.9606798 How many seconds are there in 138363.3 hours? 498107880 Convert 85128.37 litres to millilitres. 85128370 How many minutes are there in ten sevenths of a week? 14400 How many litres are there in 3.38393 millilitres? 0.00338393 What is twenty-one quarters of a second in milliseconds? 5250 How many grams are there in 77/2 of a kilogram? 38500 What is 27/5 of a centimeter in micrometers? 54000 Convert 36482.95cm to nanometers. 364829500000 How many minutes are there in ten thirds of a day? 4800 How many micrometers are there in 2.012259 kilometers? 2012259000 Convert 995534.9 weeks to minutes. 10034991792 How many hours are there in 166347.72 minutes? 2772.462 Convert 4.04353l to millilitres. 4043.53 What is 25/2 of a meter in centimeters? 1250 What is 700205.5 kilometers in micrometers? 700205500000000 How many millimeters are there in one tenth of a centimeter? 1 Convert 822525.8 weeks to nanoseconds. 497463603840000000000 What is 4/3 of a year in months? 16 What is thirteen quarters of a kilometer in meters? 3250 How many millilitres are there in 6/5 of a litre? 1200 What is 0.1070607 kilometers in micrometers? 107060700 How many millimeters are there in one twentieth of a kilometer? 50000 How many millilitres are there in 2338.67 litres? 2338670 How many grams are there in one sixteenth of a tonne? 62500 What is 264351.1 days in nanoseconds? 22839935040000000000 How many litres are there in 1883.623 millilitres? 1.883623 How many litres are there in 91.84472ml? 0.09184472 What is thirty-three fifths of a millennium in centuries? 66 What is 1/20 of a milligram in micrograms? 50 Convert 9412.211 micrograms to kilograms. 0.000009412211 What is 8824.616 centuries in decades? 88246.16 Convert 23870.3 nanometers to meters. 0.0000238703 How many years are there in 96.35859 millennia? 96358.59 Convert 102.219ml to litres. 0.102219 What is thirty-seven fifths of a litre in millilitres? 7400 Convert 449.8441l to millilitres. 449844.1 How many nanoseconds are there in 849414.1 days? 73389378240000000000 Convert 9414.339nm to meters. 0.000009414339 Convert 52271.88ml to litres. 52.27188 What is 769406.1 meters in nanometers? 769406100000000 How many litres are there in 0.0032723ml? 0.0000032723 What is 11.971935 months in years? 0.99766125 What is 33/5 of a millennium in months? 79200 What is 43317.95l in millilitres? 43317950 How many months are there in twenty-nine thirds of a decade? 1160 Convert 12845.2 seconds to nanoseconds. 12845200000000 How many micrograms are there in eleven halves of a milligram? 5500 What is 74648.42ml in litres? 74.64842 What is one tenth of a tonne in grams? 100000 What is eleven halves of a hour in minutes? 330 Convert 78.22764m to centimeters. 7822.764 How many kilograms are there in 21/4 of a tonne? 5250 How many millilitres are there in five eighths of a litre? 625 How many millilitres are there in one twentieth of a litre? 50 What is 236761.7 years in millennia? 236.7617 Convert 0.5158882 microseconds to milliseconds. 0.0005158882 What is 31054.8 litres in millilitres? 31054800 What is seventy-seven thirds of a century in months? 30800 Convert 0.1257754 millilitres to litres. 0.0001257754 How many millilitres are there in 6/25 of a litre? 240 What is 283371.72 months in centuries? 236.1431 Convert 0.6627411 millilitres to litres. 0.0006627411 How many decades are there in three fifths of a millennium? 60 How many litres are there in 91.22975ml? 0.09122975 How many nanograms are there in 21/8 of a microgram? 2625 What is 70694.3 weeks in microseconds? 42755912640000000 Convert 439236.6ml to litres. 439.2366 What is 46/5 of a meter in millimeters? 9200 What is 3/5 of a meter in centimeters? 60 How many nanoseconds are there in 444.5756 hours? 1600472160000000 What is 3/25 of a kilogram in grams? 120 How many millimeters are ther	{ "pile_set_name": "DM Mathematics" }
t d be y(16). Suppose -k = 2k - 81. What is the remainder when k is divided by (d - 0)/((-6)/4)? 7 Let z be (-45)/10(-4)/(-6). Let m(f) = -f. What is the remainder when m(z) is divided by 2/8 - (-3)/4? 0 Suppose 9b - 176 = b. Calculate the remainder when 109 is divided by b. 21 Suppose 0w - w + 17 = 0. Suppose 0r + 5r = -5y + 45, -r + 21 = 5y. Calculate the remainder when w is divided by r. 5 Let q be (-1)/(2/11 + 45/55). What is the remainder when 89 is divided by q/18-3 + 53/6? 8 Let q(j) = -j2 - 4j + 1. Let r be q(-4). Let c be r + -1 + 8-8. Let u = -36 - c. What is the remainder when u is divided by 10? 8 Let b = 813 - 504. What is the remainder when b is divided by 35? 29 Let b(s) = -s2 + 7s + 7. Let f be b(5). Suppose -f = -c - 7. Calculate the remainder when c is divided by (4/((-16)/3))/(5/(-40)). 4 Let i(a) = -a*2 - 50a - 323. What is the remainder when 817 is divided by i(-42)? 11 Calculate the remainder when 555 is divided by (-219)/(-6) + (-147)/(-42). 35 Suppose -2h = 3h + l - 110, -3l = -3h + 84. Suppose 0 = 5u + d - 2d - 215, 15 = 3d. Calculate the remainder when u is divided by h. 21 Let v = -84 - -106. Suppose 5j = 72 - v. Calculate the remainder when 26 is divided by j. 6 Suppose 13z - 17z = -156. Suppose 2m + 16 = -0m. Let s(t) = t + 15. Calculate the remainder when z is divided by s(m). 4 Suppose 2t + 2t - 28 = -4i, 2t + 16 = i. Suppose 0 = -16p + ip + 72. Calculate the remainder when 31 is divided by p. 7 Let z(v) = 99v + 76. Calculate the remainder when z(1) is divided by 48. 31 Let u = -76 + 112. What is the remainder when 140 is divided by u? 32 Let w = 201 + -141. Suppose -y = 5v - w, 4y - 120 = v + 57. Let r = y + -31. Calculate the remainder when r is divided by 5. 4 Suppose -5k - 4i = -130, 0 = -3k - 2i + 65 + 11. What is the remainder when k is divided by 10? 2 Suppose 30i = i + 2726. What is the remainder when 296 is divided by i? 14 Suppose 0 = -3h - 18 + 39. Let z(b) = 2b*3 + 3b*2 - 2b + 1. What is the remainder when z(2) is divided by h? 4 Let j(k) = k*3 + 6k*2 + 2k + 7. Let p be j(-5). Suppose 2y - p = -2. What is the remainder when 39 is divided by y? 9 Let y(o) = o + 10. Let g = 48 + -44. What is the remainder when ((-32)/(-12))/(g/6) is divided by y(-7)? 1 Let l(h) = h3 - 9h*2 + 21h + 5. What is the remainder when 97 is divided by l(5)? 7 What is the remainder when -11 + (1 - -121) is divided by (-1)/2(192 + -254)? 28 Suppose 0 = 212j - 205j - 140. Calculate the remainder when 397 is divided by j. 17 Suppose 0 = -3m - 2m + 2r + 65, 4m - 52 = 3r. Let w(y) = y2 - 1. Let g be w(-2). Calculate the remainder when (-15)/(g/30-3) is divided by m. 11 Let l(s) = -s*2 - 13s - 16. Let k(m) = -12m2 + 1. Let n be k(-1). Let b be l(n). Suppose b = d - 3. Calculate the remainder when d is divided by 5. 4 What is the remainder when (-8)/5(-85)/2 is divided by (-43)/(215/(-50)) - -2? 8 What is the remainder when 63 is divided by -3 - (-72 + -8)/5? 11 Let c = 1986 - 1951. Calculate the remainder when (1 + 0)(0 + 103) is divided by c. 33 Let f = 1121 + -160. What is the remainder when f is divided by 74? 73 Let f be (4/(-4))/((-3)/(-18)). Calculate the remainder when (-4)/8(0 - 30) is divided by (f/(-4))/((-24)/(-64)). 3 Suppose 2x - 7x - 45 = 0. Let n(b) = b*3 + 9b*2 - b + 12. Suppose 3p = 53 + 193. What is the remainder when p is divided by n(x)? 19 Suppose -10r + 10506 = 41r. What is the remainder when r is divided by 96? 14 Let i(r) = 2r + 2. Let a be i(0). Let m(y) = -2y + 2y - 4y - a + 3y. What is the remainder when 22 is divided by m(-7)? 2 Suppose -3t - f = 2f, -5t + 4f + 36 = 0. Suppose 3j + 4o - 22 = j, to + 97 = 5j. What is the remainder when 67 is divided by j? 16 Let q(p) = 2p*2 - 5p + 6. Let n be q(3). Let f = 11 - n. Suppose 0s + fs - 10 = 0. What is the remainder when 9 is divided by s? 4 Suppose 3o + 271 = 4x, 0 = 3x - 2o + 54 - 256. Calculate the remainder when x is divided by 26. 12 Let d(w) = -2w + 30. Let v be -3 + 6 - 9/3. Let j be d(v). Calculate the remainder when 27 is divided by ((-2)/6)/((-1)/j). 7 Let f(l) = -l2 - 10l. Let w be f(-6). Let z = w + -21. What is the remainder when z is divided by 2? 1 Calculate the remainder when 147 is divided by (-12)/9(-36)/83. 3 Suppose -8w = -23w + 105. Calculate the remainder when 9 is divided by w. 2 Let d = -7 + 14. Let x be (30 - d) + 4 + -1. Suppose -134 + x = -4k. Calculate the remainder when k is divided by 15. 12 Suppose 4c = 3u - 11, 3c = -5u + 6c + 22. What is the remainder when 64 is divided by (u + -3)(21/2 + -4)? 12 Suppose 0 = t - 2m - 114, -4m = 5t - 7m - 535. Suppose -r + 9r - t = 0. What is the remainder when 218 is divided by r? 10 Suppose 0 = -2r + 3r + 2c - 9, -5c = -4r + 23. Calculate the remainder when 39 is divided by r. 4 Let c(n) = -n2 - n + 1 + 7n2 - n2 + 4n2. Suppose 0x = -2x + 2. Calculate the remainder when 52 is divided by c(x). 7 What is the remainder when (-1)/(1 + 1300/(-1296)) is divided by 11? 5 Let x(v) = v3 - 8v*2 + 5v + 5. What is the remainder when x(8) is divided by 36? 9 Suppose a - 423 = -8a. Calculate the remainder when a is divided by 27. 20 Let z = -230 - -354. Let a = -111 + z. Calculate the remainder when 22 is divided by a. 9 Let t = 9 - 6. Suppose u + tg - 42 = 0, 2u + 4g + 10 - 104 = 0. What is the remainder when u is divided by 15? 12 Let v = -21 + 23. Suppose -vb = -10, -2b = 4m + 2b + 68. Let y = -12 - m. Calculate the remainder when 35 is divided by y. 5 Let i = 20 + -1. Let o = i - 18. Suppose 3v - 38 - o = 0. What is the remainder when v is divided by 5? 3 Suppose 0 = 2k + 2k - 3m + 6, -k - m + 2 = 0. Suppose -v + 3 = -k. What is the remainder when 14/21 + 94/v is divided by 11? 10 Let f be -2 + 1(-6)/2. Let d be (f/(-2))/(10/20). Suppose 3w - 8a + 3a = 184, -dw + 245 = 4a. Calculate the remainder when w is divided by 14. 11 Suppose -9t + 6t - 5w = -234, 0 = t + 5w - 88. What is the remainder when t is divided by 40? 33 Suppose 25r - 1565 + 365 = 0. Calculate the remainder when 239 is divided by r. 47 Suppose 23w + 24w = 1081. What is the remainder when 413 is divided by w? 22 What is the remainder when 29 is divided by (-18)/12 - ((-66)/4 + -2)? 12 Let p(x) = x2 - 6x + 1. Let l be p(6). What is the remainder when (-1)/4 - 122/(-8) is divided by -7 - -4 - (-11l - -2)? 3 Let j be (3 + 0)/((-7)/(28/6)). Calculate the remainder when ((225/(-20))/(-15))/(j/(-72)) is divided by 8. 3 Let x(u) = u3 - u - 1. Let s = 18 - 3. Suppose s = -g + 6g. Calculate the remainder when 44 is divided by x(g). 21 Suppose 4k - 2634 = 7k. Calculate the remainder when k/(-18) + -10(-5)/225 is divided by 5. 4 Let s = -1330 - -1475. Calculate the remainder when s is divided by 48. 1 Suppose 3g + 88 = g. Let d = -36 - g. What is the remainder when 15 is divided by d? 7 Let v = -1 - -1. Suppose v = -3r + 8r - w - 116, -r - w = -28. Suppose -87d + 93d = 420. What is the remainder when d is divided by r? 22 Let a(n) = -n*3 - n + 2. Let d be a(0). Suppose -4y = -dy - 124. What is the remainder when y is divided by 16? 14 Let d(s) = 435s + 2627. Let x(p) = -p - 2. Let v be x(-6). Let q(u) = -u*3 + 4u*2 + 2u + 2. Calculate the remainder when d(-6) is divided by q(v). 7 Let w be (32/10)/(7/(-35)). Let g = 26 + w. Let b(s) = -6s. What is the remainder when b(-3) is divided by g? 8 Suppose 8 = -5f - 4a + 66, -f = -2a - 6. Suppose -16y + 2y = -1358. What is the remainder when y is divided by f? 7 Let o(i) = 13i3 + 3i - 2. Suppose n + w = 22, w + 12 = 4n - 86. Calculate the remainder when n is divided by o(1). 10 Suppose 6v = 5v - 2c + 1381, -5c + 6925 = 5v. What is the remainder when v is divided by 58? 55 Suppose 5c - 705 = 5k, c - 3k = -0k + 145. Let p = -409 + 437. What is the remainder when c is divided by p? 27 Let s(w) = 8w - 57. Suppose 2b - 2q - 20 = 12, b - 5q - 20 = 0. Calculate the remainder when s(b) is divided by 22. 19 Let g = -18 + 23. What is the remainder when (429/44)/((-6)/(-16)) is divided by g? 1 Let z = 11 + -5. Calculate the remainder when z/33 + 4 + (-3956)/(-22) is divided by 37. 36 Let d be (-3)/	{ "pile_set_name": "DM Mathematics" }
ivative of 0c + 0c*g + 0c*3 + 1/60c5 + 0 - c2. Factor u(y). y*2 Let p be -49714/10. Let w = -194 - p. Factor -3/5x*3 + 3x*2 + 12/5 - wx. -3(x - 2)2(x - 1)/5 Let p(m) be the second derivative of m*7/7 - 2m*6/15 - 3m*5/5 + 2m4/3 + m3 - 2m2 + 5m. Let p(s) = 0. Calculate s. -1, 2/3, 1 Suppose 4o + 3 = 5o. Factor -6l2 - 2 + o + 5l*2. -(l - 1)(l + 1) Let a(v) = 14v2 + 14v - 17. Let d(g) = -5g2 - 5g + 6. Let n(k) = 6a(k) + 17d(k). Factor n(p). -p(p + 1) Let x(o) be the first derivative of 2o*3 + 6 - 4o - 1/2o4 - 2/5o5 + o2. Suppose x(f) = 0. Calculate f. -2, -1, 1 Factor 3j3 + 9 - 4j - 5j - 6j*2 - 3 + 6j. 3(j - 2)(j - 1)(j + 1) Let q be 4/(-11)((-165)/6)/5. Suppose 9/2 + 1/2rq - 3r = 0. What is r? 3 Let r(t) be the third derivative of t4/8 - t3/3 - t*2. Let i be r(2). Factor -3c*4 - 3c*2 + 2c*2 - ic3 - c5 + c3. -c2(c + 1)3 Let s(f) = 7f*2 + 9f + 30. Let l(z) = 20z2 + 28z + 88. Let k(q) = -5l(q) + 14s(q). Let k(d) = 0. What is d? -5, -2 Suppose 2o - 29 - 35 = -4l, 4l - 2o = 64. Let a = 2 - -6. Factor -4r - ar*3 + 2r*2 + 8r*4 + 0r - lr2. 2r(r - 2)(2r + 1)2 Factor -1 - 3r + 9r + 4r*2 + 2 + 1. 2(r + 1)(2r + 1) Let g(p) be the third derivative of 0p - 1/48p*4 - 1/420p*7 + 0 - 6p*2 + 1/240p*6 + 0p*3 + 1/120p5. Suppose g(s) = 0. Calculate s. -1, 0, 1 Let s(k) be the first derivative of -k4/6 + k*2/3 + 16. Determine p so that s(p) = 0. -1, 0, 1 Let j be -1 + (3/(-6) + 0)-6. Factor 1/4xj + 0 - 1/4x. x(x - 1)/4 Let m(q) be the second derivative of 3q*5/80 - 3q4/16 - q3/2 + 20q. Determine w so that m(w) = 0. -1, 0, 4 Let h(r) = r3 + r2 + 5r - 7. Let b(p) = -3p3 + 0p*3 - 7p + p*3 + p + 8. Let g(v) = -3b(v) - 4h(v). Determine n so that g(n) = 0. -1, 1, 2 Let d(q) be the third derivative of -q5/600 + q4/80 - q3/30 - 7q*2. Let d(n) = 0. Calculate n. 1, 2 Factor -1/8y*2 + 3/8y + 1/2. -(y - 4)(y + 1)/8 Let i(r) = r + 1. Let t(w) = 3w*2 - 18w - 12. Let c(p) = -12i(p) - t(p). What is b in c(b) = 0? 0, 2 Suppose 2k = -17 + 21. Let c be 3/510/4. Factor 1 + cz + 1/2zk. (z + 1)(z + 2)/2 Let f(c) = -19c3 + 11c*2 + 19c. Let b(d) = -10d3 + 6d*2 + 10d. Let v(z) = 11b(z) - 6f(z). Factor v(a). 4a(a - 1)(a + 1) Let w(l) be the second derivative of 0 + 1/60l*5 - 1/45l*6 - 1/18l*3 + 1/18l*4 + 0l*2 + 3l. Factor w(g). -g(g - 1)(g + 1)(2g - 1)/3 Suppose 9 = -2f + 13. Let t(g) be the first derivative of -4 + 0g - 3/4g4 + g3 + 0g*f. Factor t(m). -3m*2(m - 1) Let w be (5 - 45/10)(-4)/(-3). Factor -1/3u4 - u3 + w + u - 1/3u2. -(u - 1)(u + 1)*2(u + 2)/3 Let t be (181/(-60) + 3)-2. Let h(q) be the second derivative of tq*4 + q + 0q*3 + 1/50q*5 + 0q*2 + 0. Factor h(y). 2y*2(y + 1)/5 Suppose 12s - 8s - 16 = 0. Let z(q) be the first derivative of -5q2 - 1/2q*4 + 1 + 8/3q*3 + sq. Find d, given that z(d) = 0. 1, 2 Let l(b) be the third derivative of 0 - 1/90b5 + 0b3 + b2 + 0b - 1/36b*4. Let l(w) = 0. Calculate w. -1, 0 Let k(i) = 3i*4 - 11i*3 - 49i*2 - 48i - 18. Let t(a) = -8a4 + 34a*3 + 146a*2 + 144a + 54. Let b(m) = 14k(m) + 5t(m). Factor b(w). 2(w + 1)2(w + 3)*2 Suppose -3j + 4 = 2f, 3j = 3f + 12 + 12. Let z be (5/10 - 0)j. Factor -y*4 - 5/4y*3 + 0y - 1/4y5 - 1/2yz + 0. -y2(y + 1)2(y + 2)/4 Let x(g) be the second derivative of -5/12g3 - 1/2g*2 - 1/40g*5 + 0 - 6g - 1/6g4. Solve x(q) = 0 for q. -2, -1 Let v(n) be the first derivative of 0n*3 - 3 + 0n + 1/2n2 - 1/84n*4 + 1/210n*5. Let z(t) be the second derivative of v(t). Factor z(a). 2a(a - 1)/7 Factor 2/21u*3 - 2/21u + 4/21u2 - 4/21. 2(u - 1)(u + 1)(u + 2)/21 Let g(c) be the first derivative of 2c5/5 - 7c*4/2 - 9. Find t, given that g(t) = 0. 0, 7 Let s(j) be the first derivative of 4/7j*2 - 8/7j - 2/21j3 + 2. Factor s(b). -2(b - 2)2/7 Let q(y) be the first derivative of y4/18 - y*2/3 - 4y/9 + 2. Let q(f) = 0. Calculate f. -1, 2 Determine c, given that -4c + 4c*3 + 6c*2 - 3c2 - 4 + c4 + 0c4 = 0. -2, -1, 1 Let f(o) be the third derivative of 2/15o*5 - 5/12o*4 + 2/3o*3 - 4o*2 + 0 + 0o - 1/60o6. Factor f(l). -2(l - 2)(l - 1)2 Suppose 20u = 16u + 8. Determine t, given that 8/9t - 2/9tu - 8/9 = 0. 2 Suppose 0 = 3v - v + 8. Let i be 12/28 + v/(-56). What is n in -1/4 - 1/2n3 - 1/4n*5 + 3/4n + 3/4n4 - in*2 = 0? -1, 1 Let q be ((66/(-44))/((-18)/(-16)))/(-2). Factor -8/9h*4 + 2/9h*2 + 0 + qh*3 + 0h. -2h2(h - 1)(4h + 1)/9 Let t be 15 + 23/(-6). Let o be (4/(-3))/(6/27). Let r(x) = 4x*2 - 4x. Let d(s) = 9s2 - 9s. Let m(g) = od(g) + tr(g). Solve m(y) = 0. 0, 1 Let u = -1847500/9 + 205492. Let b = -214 + u. Find x, given that 2/9x3 + 4/9x*2 - bx - 4/9 = 0. -2, -1, 1 Let r be (-11)/55 - (-2)/10. Suppose 2/9z2 + r - 2/9z = 0. What is z? 0, 1 Let t(a) = -a5 + a4 + a3 + a2 - a - 1. Let v(z) = -7z5 + 6z*4 + 8z*3 + 6z*2 - 7z - 6. Let y(h) = -6t(h) + v(h). Factor y(x). -x(x - 1)*2(x + 1)*2 Let o = 61/78 + -8/13. Let a(q) be the third derivative of -1/15q*6 + 0q*3 + 0q + 4q2 + 0 - 1/12q*4 + oq5. Let a(c) = 0. Calculate c. 0, 1/4, 1 Let s(o) be the third derivative of o9/7560 - o8/2100 + o6/450 - o*5/300 - 5o*3/3 + 4o2. Let q(l) be the first derivative of s(l). Solve q(y) = 0. -1, 0, 1 Let k(v) be the first derivative of -v7/1680 + v6/360 - v5/240 - 2v3/3 - 2. Let g(r) be the third derivative of k(r). What is q in g(q) = 0? 0, 1 Let f = 16 - 14. Let x(y) be the second derivative of 0 + fy + 1/70y5 + 1/7y*3 + 1/14y*4 + 1/7y*2. Solve x(q) = 0. -1 Let h(j) be the first derivative of 6j - 17j - 9j*2 - 16j + 2 - j*3. Solve h(s) = 0 for s. -3 Let v = -20/3 + 106/15. Factor 4/5y - vy2 - 2/5. -2(y - 1)2/5 Let x(o) = o3 + 5o2 + 5o + 4. Let a be x(-4). Suppose 5r - 15 = 0, -2y - 3r = 3y - 19. Factor yt2 - t5 + at*5 + 0t*5 - 2t*4 + t. -t(t - 1)(t + 1)3 Suppose -60t*4 + 22t*4 - 17t*4 - 15t*5 - 5t*2 - 55t*3 + 10t = 0. Calculate t. -2, -1, 0, 1/3 Let q be (2 + -1)/(3/6 - -5). Suppose -2w = -0w - 4. Determine y, given that 0y + 0 - 2/11y*4 + 0y*3 + qyw = 0. -1, 0, 1 Let n(j) = -j5 - 3j4 - 6j*3 + 6j2 - j - 3. Let r = 4 - 7. Let k(b) = -b5 - 3b4 - 5b*3 + 5b*2 - 2. Let f(o) = rn(o) + 4k(o). Factor f(u). -(u - 1)(u + 1)*4 Let c(t) be the first derivative of 1/25t*5 + 0t*2 - 1/30t*4 + 2 + 2t + 0t3. Let f(a) be the first derivative of c(a). Factor f(b). 2b*2(2b - 1)/5 Let q(o) be the first derivative of -1/16o*4 + 0o + 5 - 1/12o3 + 0o*2. Determine p, given that q(p) = 0. -1, 0 Factor 1/6 - 1/2i*2 + 1/3i*3 + 0i. (i - 1)*2(2i + 1)/6 Let g be (6/12)/(1/6). Suppose 9 = 5h - i - 2, -3h - 3 = -gi. Find c, given that 1/2c + 1/2ch + c2 + 0 = 0. -1, 0 Let f be 1/2 - 95/210. Let c(x) be the second derivative of -1/70x5 + 0x*2 - 1/105x*6 + 1/42x*4 + 0 + 2x + fx3. Find q such that c(q) = 0. -1, 0, 1 Find d such that 88d + 19d4 + 24d*4 + 156d*2 + 12d*4 + 16 + 122d*3 + 6d*5 - 11d*4 = 0. -2, -1, -1/3 Let t(f) = 5f*2 - 2f. Let y(j) = -4j2 + 2j. Let x(l) = -5t(l) - 6y(l). Find s, given that x(s) = 0. -2, 0 Factor -6/7 + 3/7d2 + 3/7d. 3(d - 1)(d + 2)/7 Let q(v) = -v - 3. Let g be q(-7). Suppose 2p3 + p2 + gp4 + p5 - p4 + p3 = 0. What is p? -1, 0 Let w(y) be the third derivative of y*5/60 - 6y2. Factor w(s). s2 Suppose -3i = -i - 2q + 6, 0 = 3i + 4q - 5. Let y(z) = 2z + 2. Let c be y(i). Factor -1/3h*3 + ch + 0 - 1/3h2. -h2(h + 1)/3 Factor -220a3 - 135a*4 - 126a*4 - 4a - 52a2 - 39a*4. -4a(3a + 1)(5a + 1)2 Let s(f) be the second derivative of f6/45 + f5/30 - f4/6 - f*3/9 + 2f*2/3 + 39f. Factor s(v). 2(v - 1)2(v + 1)(v + 2)/3 Let p(z) be the second derivative of 7z*6/30 + 19z5/20 - z4/2 - 14z3/3 + 4z*2 - 5z. Factor p(s). (s - 1)(s + 2)2(7s - 2) Factor -28y + 3 + 9 + 8y2 + 0y*2. 4(y - 3)(2y - 1) Let k be 15/(-9) +	{ "pile_set_name": "DM Mathematics" }
scending order. 1, -4, -26, -455 Sort -4, 4, 2, 1, 253 in descending order. 253, 4, 2, 1, -4 Put 6/7, -4, 350 in increasing order. -4, 6/7, 350 Put 5, -1, -9, 56, -4 in descending order. 56, 5, -1, -4, -9 Sort 11, -2, -9, 7, 36. -9, -2, 7, 11, 36 Put 32.6, -2/3, 0.036, 7 in decreasing order. 32.6, 7, 0.036, -2/3 Put 847.8, 4, -0.2 in increasing order. -0.2, 4, 847.8 Sort 10, 28, -1/7, 3, -3 in increasing order. -3, -1/7, 3, 10, 28 Put -24, 3, -1125, 2 in increasing order. -1125, -24, 2, 3 Put -5, 193, -59, -13, -3, 4 in increasing order. -59, -13, -5, -3, 4, 193 Put -4, 5, -75, 1433 in decreasing order. 1433, 5, -4, -75 Put -1, -7, -1/4, -39, 26 in descending order. 26, -1/4, -1, -7, -39 Sort -5/41, -25.4, 3/2 in increasing order. -25.4, -5/41, 3/2 Put 0, 16/7, 0.6, -1/3, -4, 0.08 in descending order. 16/7, 0.6, 0.08, 0, -1/3, -4 Sort -3/4, 45, -2, 1.111 in descending order. 45, 1.111, -3/4, -2 Sort 2, 5, -5, 88716, 0. -5, 0, 2, 5, 88716 Sort -314, 0, 6, -1.5. -314, -1.5, 0, 6 Put 2/11, 4/5, -2/7, 6, -5/4 in ascending order. -5/4, -2/7, 2/11, 4/5, 6 Put 47, 0.03, -2/247 in descending order. 47, 0.03, -2/247 Put 3, 5, -279, -13 in increasing order. -279, -13, 3, 5 Sort 82, -0.09, -0.45. -0.45, -0.09, 82 Sort -3387, -4, 114 in ascending order. -3387, -4, 114 Sort -3, 1201, -5, 2, 1 in ascending order. -5, -3, 1, 2, 1201 Sort 13, -43, -10, 43 in descending order. 43, 13, -10, -43 Sort -1, -87, -365. -365, -87, -1 Sort 38, 2, 2/11, 4, -4/215 in descending order. 38, 4, 2, 2/11, -4/215 Sort -2/5, 2, -7, 253, 0.06. -7, -2/5, 0.06, 2, 253 Put -25, -3, 743 in decreasing order. 743, -3, -25 Sort 22937, 8, -1 in ascending order. -1, 8, 22937 Put 0, -31, 0.1, 3/4, -61, -4 in increasing order. -61, -31, -4, 0, 0.1, 3/4 Sort -5, 2, -2401/55. -2401/55, -5, 2 Sort 689/9, -38, -1/5 in ascending order. -38, -1/5, 689/9 Sort -25, 262, 0 in descending order. 262, 0, -25 Sort -4/5, 4/5, -321/170 in increasing order. -321/170, -4/5, 4/5 Put -28, 319, 56 in decreasing order. 319, 56, -28 Put -4, -1, 0, 3, 2, -1534 in decreasing order. 3, 2, 0, -1, -4, -1534 Put 69, -3/2, -1.6106 in decreasing order. 69, -3/2, -1.6106 Sort -7, 311, 39, 1, -5. -7, -5, 1, 39, 311 Sort -0.3, 8740, 3/4, 5. -0.3, 3/4, 5, 8740 Put -34, 2, -4, 0, -1 in ascending order. -34, -4, -1, 0, 2 Sort -18212, 3, 0, -2 in decreasing order. 3, 0, -2, -18212 Put -1, -103, -61 in descending order. -1, -61, -103 Put 4, 769, -11 in increasing order. -11, 4, 769 Put 11, 8982, 5 in decreasing order. 8982, 11, 5 Put -5, 244, 1, 0, -2, -1 in descending order. 244, 1, 0, -1, -2, -5 Sort -5, -4, -78, -3, -2, 1 in decreasing order. 1, -2, -3, -4, -5, -78 Put 0.14, -2/7, -5, 4, 0 in increasing order. -5, -2/7, 0, 0.14, 4 Sort 1, 1/5, 13, 13/10. 1/5, 1, 13/10, 13 Put -17, -11, -1, 39, -3, 2 in decreasing order. 39, 2, -1, -3, -11, -17 Sort -12, 5, 1, 6786 in decreasing order. 6786, 5, 1, -12 Sort -2, -1/5, -3, 43087, 0.2. -3, -2, -1/5, 0.2, 43087 Sort -15, 65, -0.07, -2/13. -15, -2/13, -0.07, 65 Put -7, -1, 9, -20, -39 in descending order. 9, -1, -7, -20, -39 Sort -0.979, -0.7, 0.2, 5/3, 0 in ascending order. -0.979, -0.7, 0, 0.2, 5/3 Put -29, -9, 5, 4 in increasing order. -29, -9, 4, 5 Put -4, 13, -220, 6 in increasing order. -220, -4, 6, 13 Put -3, 0.08, -7.6, 5, -1/7 in increasing order. -7.6, -3, -1/7, 0.08, 5 Sort -6/23, 1/39, -1/3 in descending order. 1/39, -6/23, -1/3 Sort -5, -5551, 4/5. -5551, -5, 4/5 Sort -4, -12, -3, 8, -5 in decreasing order. 8, -3, -4, -5, -12 Put 0.4, 6/11, 35747 in decreasing order. 35747, 6/11, 0.4 Put -1/139, 8, -5, -2/5, -2/13 in descending order. 8, -1/139, -2/13, -2/5, -5 Put -1836, 15, -5 in decreasing order. 15, -5, -1836 Put 0.065, 2, -1/3, -3, 0.3 in decreasing order. 2, 0.3, 0.065, -1/3, -3 Sort -2/11, -3, 4, 3, -14.93, 0.03. -14.93, -3, -2/11, 0.03, 3, 4 Put 0.5, -5, 6/37, 2/9, -3 in decreasing order. 0.5, 2/9, 6/37, -3, -5 Put 4, -7541, 17, 3 in increasing order. -7541, 3, 4, 17 Put 12/5, 5, -0.146 in ascending order. -0.146, 12/5, 5 Put 90, -5, -2, 152 in decreasing order. 152, 90, -2, -5 Put 1, -50, 4450, 2 in decreasing order. 4450, 2, 1, -50 Sort -1/10, -2/3, 1.088, -148 in ascending order. -148, -2/3, -1/10, 1.088 Sort -5, 3, 1, 15552. -5, 1, 3, 15552 Put 5, -2, 0.5, -29.5, -6 in descending order. 5, 0.5, -2, -6, -29.5 Sort 0.6, -38/7, 0.1 in ascending order. -38/7, 0.1, 0.6 Sort 296, -3, -5, 1, -1, 17 in descending order. 296, 17, 1, -1, -3, -5 Put -7, 0, -1, -2, -28 in decreasing order. 0, -1, -2, -7, -28 Put -2, 4, -98, 2/13, 5, 0.06 in decreasing order. 5, 4, 2/13, 0.06, -2, -98 Put 3, -1, 0.2, 182 in descending order. 182, 3, 0.2, -1 Sort 1, 4088, -1, 5, -3 in decreasing order. 4088, 5, 1, -1, -3 Sort 232, -3, 5 in decreasing order. 232, 5, -3 Put 0, 1, 14, -5, 1480 in descending order. 1480, 14, 1, 0, -5 Sort -4, -3, -49, 31, -40 in ascending order. -49, -40, -4, -3, 31 Sort 6, 1, 8, 4. 1, 4, 6, 8 Sort 0.1, 4, 5/6, -6, -34, -0.6. -34, -6, -0.6, 0.1, 5/6, 4 Sort 28, -0.114, -1, -0.2 in descending order. 28, -0.114, -0.2, -1 Put 49, -0.3, -3.22, 2/13 in descending order. 49, 2/13, -0.3, -3.22 Sort -4, 6, 1, 7483 in descending order. 7483, 6, 1, -4 Put 0.001, 15/314, -0.5 in descending order. 15/314, 0.001, -0.5 Put -51, 4013, -3 in ascending order. -51, -3, 4013 Sort -2/7, -0.08, -0.135 in descending order. -0.08, -0.135, -2/7 Put -9, -1176, 3 in decreasing order. 3, -9, -1176 Put -49, -9, -1/5, -4, -3/8 in ascending order. -49, -9, -4, -3/8, -1/5 Put 5, 1/74, -28/11 in ascending order. -28/11, 1/74, 5 Put 82, -174, 2 in decreasing order. 82, 2, -174 Sort -2/29, 63/149, -2/17. -2/17, -2/29, 63/149 Put 452, 4, 2, -4, -6 in descending order. 452, 4, 2, -4, -6 Sort -3, -8, 2, -61. -61, -8, -3, 2 Sort -0.2, 2, -1/52, 501, 0.3 in increasing order. -0.2, -1/52, 0.3, 2, 501 Sort -0.3, 1/7, 32/7, -3/29 in descending order. 32/7, 1/7, -3/29, -0.3 Put 11, -1, 3, -7, -4, 5 in decreasing order. 11, 5, 3, -1, -4, -7 Sort -34, -104, 2, -4, 3. -104, -34, -4, 2, 3 Put 3, -0.5, 1/2, 20/47, 4/5 in decreasing order. 3, 4/5, 1/2, 20/47, -0.5 Sort -5, -38, -890 in decreasing order. -5, -38, -890 Put -9, 16, 37, -3, -5, 1 in increasing order. -9, -5, -3, 1, 16, 37 Put -2/5, 3, -3, -732, -1 in decreasing order. 3, -2/5, -1, -3, -732 Sort 1, -424, 22. -424, 1, 22 Put 1625, 0, -2 in increasing order. -2, 0, 1625 Sort 0, -8, -1/5, 8/3, 45. -8, -1/5, 0, 8/3, 45 Sort 521, -1, 2, 15, 1 in descending order. 521, 15, 2, 1, -1 Sort 1/5, -32, -8/9, -46, 3. -46, -32, -8/9, 1/5, 3 Put -0.044, -1/9, 3, -1.9 in descending order. 3, -0.044, -1/9, -1.9 Put 2, 8, 4, -3880 in descending order. 8, 4, 2, -3880 Put 0.99213, -0.2, 1/6, 5, -2 in increasing order. -2, -0.2, 1/6, 0.99213, 5 Sort 3, -5, 0, -143, 2 in decreasing order. 3, 2, 0, -5, -143 Sort -0.5, -0.2, 4, -81, 1/4, -5.15 in decreasing order. 4, 1/4, -0.2, -0.5, -5.15, -81 Put 45, -9, 0, 4, -4 in decreasing order. 45, 4, 0, -4, -9 Sort -5, 330, -15 in ascending order. -15, -5, 330 Sort -1, 17, -5, -6, 2 in ascending order. -6, -5, -1, 2, 17 Sort -1/6, 35, -6/7, -43, 1 in decreasing order. 35, 1, -1/6, -6/7, -43 Put -471, -7, -2, 5 in descending order. 5, -2, -7, -471 Sort -3, 2, 94, 10 in descending order. 94, 10, 2, -3 Sort 2, -57, -82. -82, -57, 2 Sort 1/8, -141, 5, -3, -6, -4 in increasing order. -141, -6, -4, -3, 1/8, 5 Sort -6, -2/3, 9, 2, -0.3, -0.2 in decreasing order. 9, 2, -0.2, -0.3, -2/3, -6 Sort -1, 677, 0.4, 0.1 in increasing order. -1, 0.1, 0.4, 677 Put -177, -3.9, -1/4, -1/6, -0.4 in decreasing order. -1/6, -1/4, -0.4, -3.9, -177 Sort -2, -1330, 6 in decreasing order. 6, -2, -1330 Put 3, 4, 435, -4 in decreasing order. 435, 4, 3, -4 Sort -6, -5/2, 0.2, -13 in decreasing order. 0.2, -5/2, -6, -13 Sort -9, -118, 2, -5, 0, 10. -118, -9, -5, 0, 2, 10 Sort -11, -1, -7, 1, 0 in decreasing order. 1, 0, -1, -7, -11 Sort 0.33, -3, 15/67, 0.2, -0.2. -3, -0.2, 0.2, 15/67, 0.33 Sort -5, -0.04, 2/7, 6, 2 in ascending order. -5, -0.04, 2/7, 2, 6 Sort -5, 507, -11, -7 in descending order. 507, -5, -7, -11 Put -5, 85, -4, 16, -1 in descending order. 85, 16, -1, -4, -5 Put 2, -4, -652, 0, -1 in descending order. 2, 0, -1, -4, -652 Sort -3, -5, 258, -1. -5, -3, -1, 258 Sort 0, -5, 3, -165, -31 in increasing order. -165, -31, -5, 0, 3 Sort -78	{ "pile_set_name": "DM Mathematics" }
q*2 + 1 - 1). -7q*3 Expand (-5s - 6 + 6)(-3s - s + 2s)(-1 - 3 + 2 + (5 + 1 - 3)(-3 + 3 + 2) + 3 - 1 - 1). 50s*2 Expand (152m*2 + 239m*2 + 12m*2 + 222m*2)(-2m2 - 2m + 2m). -1250m*4 Expand (-3130x + 3129x + 1 + 9)(2x - 2x + 6x)(2 - 1 - 3). 12x2 - 120x Expand (0l + 2l + 0l)(-2l + 2 - 2)(-617l - 62 - 3l2 + l2 + 616l). 8l*4 + 4l*3 + 248l*2 Expand -d + d - 2d*2 + (-d + 3d - d)(0d - 3d + 4d) + (17 - 11d - 17)(-3d + 5d + 0d). -23d*2 Expand (2b + 3 - 3)(-1 - 1 + 3) - 2 + 2b + 2 - b - 2b - 4b + (-4 - 1 + 1)(-4b + b + 2b) - b + 2b + b. 3b Expand (2i - 4 - 2i - 2i)(-79 - 80 + 52). 214i + 428 Expand (5 + 5 + 12)(0 - 3 + 4)(-1 + 1 - 2j) - 17j - 3j + 0j. -64j Expand (-2m - m + m)(-8 - 42 - 5)(1 - 7 + 2)(0m*2 + 0m2 - m4). 440m5 Expand (-4 + 0 + 2)(-10i2 - i2 + 11i*2 + 121i*3). -242i*3 Expand (-3 + 0 - 2 + 3a)(-20a - a + 5a). -48a*2 + 80a Expand (0q - 2 + q + 0q)((q + 1 - 1)(-3q + 3q + 2q) - 7q*2 - 9q*2 - 13q*2). -27q*3 + 54q*2 Expand (0 + 0 + 4v)(-2 + 0 + 1)(4 - 2 + 3)(-3 + 4 + 5). -120v Expand (4 - 2 + 0)(-11o + 11o2 - 7o*2 - 7o*2). -6o*2 - 22o Expand (63w + 73w + 141w - 71w)(0w + 2w + 6w). 1648w2 Expand (6q3 - q3 - 3q3)(2q2 - 3q*2 + 0q*2) + (3q*2 - 6q*2 + 4q*2)(-3025 - 86q3 + 3025). -88q*5 Expand (-442s*3 - 667s*3 + 130s*3 - 439s*3)(s - s - 2s). 2836s*4 Expand -6i*2 - 32 + 13 + 22 + (-i + 0i + 2 - 4)(0i - 2i + 0i). -4i2 + 4i + 3 Expand (402 - 176b - 402)(-3b4 + b4 - b4). 528b5 Expand x3 + x3 - x3 + (3x - 2x + x - 3x - x + 6x + (-2 + 2 + 2)(46 - 3x - 46) + 16x - 20x + 12x)(4x2 - 2x*2 + 0x*2). 13x*3 Expand (0v - v + 2v)(-6 - 9 + 17)(60v*4 - 26v*4 + 100v*4). 268v*5 Expand (5 - 87k + 180k - 90k)(3k + 16k - 6k). 39k2 + 65k Expand -g3 - g2 + g*2 + (5g - 3g - 4g)(-3g - 2g2 + 3g) + 5 + 2g3 + 9 - 2 + (-6 - 4g*2 + 6)(0g + 2g + 0g). -3g*3 + 12 Expand (0 + 0 + w)(-1 - 59 + 9)((-4 + 2 + 3)(-2 - 3 + 3) - 1 + 0 + 0). 153w Expand (1 + 1 + 0)(3l3 - 3l*3 + 7l*3)(-l*2 - 9l*2 + 3l2) + (l3 + 0 + 0)(0l - 2l2 + 0l). -100l5 Expand (-3z*3 + 4z*3 + 5z*3)(7 + 46 - 4) + 0 + 0 + 4z3. 298z*3 Expand (-o - 2o + 4o + (2o - 6o + 2o)(1 + 4 - 3))(-2o + 5o - 9o)(-3 - 3o + 3). -54o*3 Expand (-12v + 10v + 5v + 2)(177v + 193v + 3 - 351v). 57v2 + 47v + 6 Expand (2f3 - 3f*2 + 3f*2)(1 - 1 + f + (-1 + 1 + 2)(2f - 2f + 2f) + (-5f + 6f + 5f)(-4 - 3 + 1) - 6 + 6 - 7f). -76f*4 Expand (4 - 2 - 1)(-16 - i - 31 - 34) - 2i + 0 + 7i - 3. 4i - 84 Expand (3 - 1 - 4)(-13b - 3b + 13b - 109). 6b + 218 Expand (-3r4 - r4 + 3r*4)(-1 - 2 + 4) + 6r4 - 4r*4 + 0r*4 + (0r*4 + 7r*4 - 2r*4)(23 - 50 + 12). -74r4 Expand 69d*4 - 163d*4 + 47d*4 + (-d - 3d*2 + d)(-d*2 + 3d - 3d) + 2 - 2 - 3d*4. -47d*4 Expand (z + 1 - 1)(-6z + 7z + 6z) + 23 - 23 + 11z*2. 18z*2 Expand (2 - 6 + 2 + 2 + 1 - 2 - 3 + 1 + 0 + (-2 + 4 - 3)(1 + 2 - 1))(2x - 3x + 0x)(-3x + 2x - x). -10x2 Expand -u - u - u2 - u*2 + (-1 + 3u + 1)(-49 + 34u + 49). 100u2 - 2u Expand (-t*2 - 3t*2 + 3t*2)(t + 0 + 0) - t*3 + 8t*3 + 45t*3. 51t*3 Expand (2 + r - 2)(-3r2 + 6r*2 - 4r2) + r + 2 + r2 - 82r3 + 195r*3 - 93r*3. 19r3 + r2 + r + 2 Expand (-2 + 0 + 3)(-11s + 11 - 11) + 3s - 2s - 2s. -12s Expand (3f - 5f + f + (0 + 0 + 3f)(1 - 4 + 0) + (-11 + 4 + 2)(-2f + 5f - 2f))(2f + 3f - 6f). 15f2 Expand (-55254 + 55254 - 113d*2)(0d3 + 2d*3 + 2d*3) + 2d2 - d3 - 2d2 + 2d*5. -450d5 - d3 Expand (w*2 - 3w*2 + 0w*2)(2w + 0w - 4w) + (6w*3 - 4w*3 + 0w*3)(-260 - 177 + 521). 172w3 Expand (-p + 3p - 3p + (-p + 0 + 0)(-2 + 1 - 1))(198p*4 - 2p*2 + 247p*4 - 17p*4). 428p*5 - 2p*3 Expand (2v - 7v - v)(-2 + 3 + 1) + 2v - 9v + 13v. -6v Expand (83g - 228 + 228)(3 - 7 + 2)(-3g + 5g - 3g). 166g2 Expand 2 - 2b - 2 + (-2 + 2 - 3)(b - 2 + 2) - 2 - 2b + 1 - 2. -7b - 3 Expand (d2 + 2d2 - d2)(-2d*3 + 3d*3 - 3d*3) + 39d + 14d5 - 39d + (0d2 - d2 - d2)(-9 + 9 + 3d3). 4d*5 Expand (2 + 1 + 0)(-h5 - h4 + 43h4 - 6h*4) + 3h*5 - 4h*5 + 2h*5. -2h*5 + 108h*4 Expand (0f + 3f - f)(0f + 0f + f + f - f + f + 3f - f - 4f + (3f - 3f - 2f)(1 - 2 + 2) + 3f - 4f + 2f)(3 + 0 - 1)(547 - 13f*3 - 547). 52f*5 Expand 3i*5 + 2i*5 - 3i*5 + (3i5 - i5 - 4i5)(-2 + 2 + 2) - 2 + i*5 + 2 + 4 + 16546i + 2i2 + 2i*5 - 16546i. i*5 + 2i*2 + 4 Expand (4 + 3 - 5)(2p2 + 2p*2 - 5p*2) + 1 + 2 + 147p*2 - 2p - 133p2. 12p*2 - 2p + 3 Expand (0u + 2u - 156u2 + 113u*2)(-u*3 + 2u*3 - 3u*3). 86u*5 - 4u*4 Expand (45 - 17 - 5)(-34t3 + 5t*2 + 4t*5 - 2t*5 + 32t*3). 46t*5 - 46t*3 + 115t*2 Expand (1 - 1 - 2h*2)(-29h + 69 + 70 - 144). 58h*3 + 10h*2 Expand (0 - 2 + 0)(-2a - 2a - 5a)(-15 + 5 - 8). -324a Expand 0d2 + d2 - 2d2 + (2d*2 + 4d - 4d)(1 + 3 - 5) + d*2 + 0d*2 + 2d2 - d2 - 16d2 + 39d*2. 22d*2 Expand (2 - 16 - 2)(3n2 - 3n*3 - 3n2) + n3 + 5n3 - 4n*3. 50n*3 Expand (-7c*2 + 3c2 - c2)(-18 + 5 - 5) - 2c*2 - 10c + 10c. 88c*2 Expand (-3x*2 + 9 + 6x*2 - 4)((4 - 1 - 1)(x - 5x + x) + 1 - 5x + 2x + 0x). -27x*3 + 3x*2 - 45x + 5 Expand 5n3 - 2n3 - n3 + (-187n + 58n + 60n)(-4n2 - 2n2 + n2) + n - n - 2n3. 345n*3 Expand -v + 5v - 5v - 1 - 1 + 2v + 1 + (-2 + 0 + 3)(-2v + 2 - 2) - 2v + 2v - 8v. -9v - 1 Expand (2l + 0l - l)(11l - 11l - 2l*3) + 4l*2 - 2l*4 - 4l*2 + (-2l + l - l)(2l3 + 2 - 2) + l4 - 3l4 + 4l*4. -6l*4 Expand (-3h + 0h + 9h)(21 - 3h2 - 21) + h3 + 4h3 - h3. -14h*3 Expand ((0b + 4b - b)(4b - 5b - b) - 3b2 + b2 + b2)(-201b2 + 201b*2 - 15b*3). 105b*5 Expand (-1 - 2p + 1)(0p + 2p - 3p) - 3221 + 6448 - 3p2 - 3220. -p2 + 7 Expand -4 + 3z + 4 + (-13 + 54 + 22)(-2z - z + z). -123z Expand ((5m - 2m - m)(4m - m - m) + (-m + m - m)(9m + 13m + 2m) - 1 + 3m*2 + 1)(0m - m - m). 34m*3 Expand (-2 - 1 + 4)(-3c + 3c + 4c3 + (0 + 0 + 2c*3)(-1 + 2 + 1))(170c*2 + 849c - 849c). 1360c*5 Expand (-9j + 10j - 10j)(-1 - 2 + 2)(109j - 46j - 42j). 189j*2 Expand -3c*3 + 5c*3 + 0c*3 + (0c*2 - 3c*2 + 18c*2)(4c + c - 3c). 32c3 Expand (15 - 145 - 154)(2d2 - 3d + 3d). -568d*2 Expand (0 - 3g + 0)((-3 - 2 + 3)(4g - 2g + 0g) + g - g + 5g - g + 4g + 0g + g - g + g - 3g + 3g - g + (0 - 4 + 3)(-1 + 1 + 2g)). -6g2 Expand (-1 + g4 + 1)(-1 + 2g + 1) + (g + 7g + 0g)(g4 + g4 + 6g4). 66g*5 Expand (-73j + 173 - 173)(2j4 + j4 - 5j4). 146j*5 Expand (0 - 2 + 3 - 6y)(-3 - 24 + 6). 126y - 21 Expand (-2z2 + z3 + 2z*2)(-12z2 + 20z - 20z)(11 + 3 - 4). -120z5 Expand (-10r*2 + 6r*2 - 2r*2)(-39r + 22r + 10r)(-2 + 0 + 3). 42r3 Expand 2d*4 + 3d*5 - 2d*4 + (-5d + 2d + 2d)(d4 - 2d + 2d) + (-d2 + 5 - 5)(-1 + 1 + d*3) + 4d*5 + 7d*4 - 7d*4 + 4d - 11d5 - 4d. -6d5 Expand 3g + 4g + 2g - 2g + 3g - 2g + (2 - 2 - g)(-2 + 3 + 1). 6g Expand (-t2 - 9t + 9t)(-96t + 48t + 63t) - 2t*3 + 0t*3 + 4t*3 + (-1 + 2t*2 + 1)(t + 5t - 4t). -9t3 Expand (2g - 3g + 0g)(2g*4 - 3g*2 + 3g*2 + (-4g + g + 0g)(-5g3 + 2g*3 - 2g*3)) + (-1 + 1 + g)(-2g4 + 3g*4 - 4g*4). -20g*5 Expand (14l + 9l - 10l)(2 + 1 - 1)(-2 + 1 + 3). 52l Expand (-4m + 4m + 2m)(-127m*4 + 14170m*2 - 14170m2 + m3). -254m5 + 2m*4 Expand (-x - 3x*2 - 2 + 2)(-313 + 248x2 + 313 + 18x*2). -798x*4 - 266x*3 Expand (-x + x + x)(4x - 11x - 30x). -37x*2 Expand -11r - 41r - 13r + (-2 + 2 + 1)(2r + 2r - 2r) + r + 2 - 2 + (3r - r - 3r)(2 - 3 + 0) + 2 - 2 - r. -62r Expand (-58 + 5c2 + 58)(5c2 - 2c2 + c2) + (c + c*4 - c)(1 + 2 - 1). 22c4 Expand (-3 + 34 + 22)(t + t + t	{ "pile_set_name": "DM Mathematics" }
+ 12080y/3. y(y - 1510)(y - 2)(y + 4)/3 Factor -2v3/11 - 460v*2/11 + 9462v/11. -2v(v - 19)(v + 249)/11 Determine h, given that 38h*5/3 + 470h*4 + 11510h*3/3 + 10570h*2 + 23732h/3 + 720 = 0. -27, -5, -4, -1, -2/19 What is d in -2d4/7 + 516d*3/7 + 3152d*2/7 + 4224d/7 = 0? -4, -2, 0, 264 Find t, given that 5t3 - 85065t*2 = 0. 0, 17013 Solve -2v*3/13 - 138v*2/13 + 440v/13 + 576/13 = 0. -72, -1, 4 Determine d so that 16d3 - 106d*2 - 11460d + 7200 = 0. -24, 5/8, 30 Factor -z*3 - 687z*2 - 31248z - 368064. -(z + 24)*2(z + 639) Suppose -2o3/9 + 62o*2/3 + 632o/9 - 1792/3 = 0. What is o? -7, 4, 96 Solve -2j5/9 - 542j*4/9 - 1076j*3/9 + 4j*2/9 + 1078j/9 + 538/9 = 0. -269, -1, 1 Determine v so that 2v3/13 - 152v*2/13 - 372882v/13 + 373032/13 = 0. -396, 1, 471 Determine i so that 3i3 - 87i*2 + 693i - 1377 = 0. 3, 9, 17 Factor j*3 - 141j*2 + 1188j. j(j - 132)(j - 9) Factor -85l2 + 20090l - 7080. -5(l - 236)(17l - 6) Factor 7t*3/6 - 2543t*2/6 + 1630t/3 - 362/3. (t - 362)(t - 1)(7t - 2)/6 Suppose 3w*2/5 - 15471w/5 + 92718/5 = 0. What is w? 6, 5151 What is t in t*5 + 10t*4 - 288t*3 + 266t*2 + 287t - 276 = 0? -23, -1, 1, 12 Determine l so that 8l5/11 + 538l*4/11 + 2158l*3/11 + 962l*2/11 - 2910l/11 - 756/11 = 0. -63, -3, -2, -1/4, 1 Factor y*3/3 + 142y*2/3 + 2855y/3 + 2714/3. (y + 1)(y + 23)(y + 118)/3 Let 44y5 + 498816y*4 + 1885433632y*3 + 2377815653504y*2 + 6473676504768y + 3451165884928 = 0. Calculate y. -3778, -2, -8/11 Determine k, given that 477k4/4 + 951k*3/2 - 24351k*2/4 - 6363k + 81 = 0. -9, -1, 2/159, 6 Factor -i3 - i2 + 36i + 36. -(i - 6)(i + 1)(i + 6) Solve 18f*5/7 + 42f*4 + 1104f*3/7 - 168f*2 - 672f = 0 for f. -28/3, -7, -2, 0, 2 Find r, given that r*3/6 - 2551r*2/6 - 20504r/3 - 82144/3 = 0. -8, 2567 Let 2l2 + 2054992l + 527874015008 = 0. What is l? -513748 Determine f so that -11f4/5 - 864f*3/5 - 1293f*2/5 + 1244f/5 + 924/5 = 0. -77, -2, -6/11, 1 Factor 4q3/5 - 1092q*2/5 + 59984q/5 - 115632/5. 4(q - 198)(q - 73)(q - 2)/5 Solve -2l*2/7 - 1750760l/7 - 383145072200/7 = 0 for l. -437690 Factor -l*2/4 + 232615l/2 - 54109738225/4. -(l - 232615)2/4 Determine o, given that o5 + 5620o4 - 39377o*3 + 67528o*2 + 22492o - 90032 = 0. -5627, -1, 2, 4 Factor x*3 + 209x*2 + 4091x - 4301. (x - 1)(x + 23)(x + 187) Factor 2k2 - 816728k/21 - 3704. 2(k - 19446)(21k + 2)/21 Let g3/5 + 1333g*2/5 - 5344g/5 + 5348/5 = 0. What is g? -1337, 2 Let -2x2 + 65318x - 195936 = 0. Calculate x. 3, 32656 Determine f, given that -f*3 - 52f*2 + 465f - 900 = 0. -60, 3, 5 Determine c so that -20c2 - 4432c - 4412 = 0. -1103/5, -1 Factor 250j2/7 - 108j + 18/7. 2(j - 3)(125j - 3)/7 Determine m, given that 35m*5/4 - 13975m*4/2 - 11985m3/4 = 0. -3/7, 0, 799 Let -y3 + 1203y2 + 2410y = 0. Calculate y. -2, 0, 1205 Suppose -863272z5/11 - 648064z*4/11 + 197454z*3/11 - 1570z*2 + 44z = 0. Calculate z. -1, 0, 2/29, 11/122 Find f, given that 7f5/6 + 205f*4/6 + 75f*3 - 5810f*2/3 - 13436f/3 - 1120 = 0. -24, -10, -2, -2/7, 7 What is u in -u*5 - 869u*4 - 252297u*3 - 24638695u*2 - 48275138u = 0? -289, -2, 0 Factor 5r4 + 26220r*3 - 5157120r*2 + 332677120r - 7125073920. 5(r - 64)3(r + 5436) Factor m*3/5 - 613m*2/5 - 17752m/5 - 125636/5. (m - 641)(m + 14)2/5 Factor -2y*3/7 + 382y*2/7 + 1200y/7 - 6984/7. -2(y - 194)(y - 3)(y + 6)/7 Find r such that -2r*3/17 - 420r*2/17 + 3914r/17 - 6132/17 = 0. -219, 2, 7 What is d in 4d5/5 - 36353d*4/5 + 81650272d*3/5 + 4298934344d*2/5 + 11078586688d - 2823638480 = 0? -26, 1/4, 4570 Factor 5b3 - 22348b*2 + 24967185b + 9990450. (b - 2235)*2(5b + 2) Determine f so that -f2/8 - 11945f/8 - 133875/2 = 0. -11900, -45 Factor h*2/6 - 2401h + 17294403/2. (h - 7203)*2/6 Factor 5v*3 - 99005v*2 + 489950960v + 1470744060. 5(v - 9902)2(v + 3) What is v in 27v4/4 + 921v*3/4 + 1737v*2/2 + 1095v + 450 = 0? -30, -2, -10/9, -1 Factor 2m2 + 215430m - 215432. 2(m - 1)(m + 107716) Let 110a5 + 675a*4 + 1300a*3 + 825a*2 + 90a = 0. What is a? -3, -2, -1, -3/22, 0 Factor -12100i3 - 2927760i*2 + 106476i - 968. -4(i + 242)(55i - 1)2 What is x in -18x*2 - 988x/11 = 0? -494/99, 0 What is s in s*2/4 - 8407s/4 = 0? 0, 8407 What is z in -3z5 - 452z*4/7 - 169z*3/7 + 1378z*2/7 + 1620z/7 + 72 = 0? -21, -1, -6/7, -2/3, 2 Determine o, given that -3o3/8 - 123o*2/8 + 99o/4 + 2565 = 0. -38, -15, 12 Factor -16b3 - 172b*2 - 244b + 72. -4(b + 2)(b + 9)(4b - 1) Factor -5g2 - 2380g - 4740. -5(g + 2)(g + 474) Solve -2f3 + 8980f*2 - 17952f = 0. 0, 2, 4488 Solve -m*3/8 - 3419m*2/2 - 11689561m/2 = 0. -6838, 0 Solve u*3/3 - 586u*2 + 264435u - 6013512 = 0. 24, 867 Factor 5v2 + 2385435v - 2385440. 5(v - 1)(v + 477088) What is a in -2a3 - 6848a*2 - 5848168a + 23502368 = 0? -1714, 4 Solve 2x4/5 + 24x*3/5 - 1886x*2/5 + 3564x/5 + 5472/5 = 0. -38, -1, 3, 24 Factor 40y4 - 1555y*3 + 14200y*2 + 18000y. 5y(y - 20)*2(8y + 9) Factor 2w*3/5 - 1322w*2/5 + 36816w + 11779704/5. 2(w - 354)2(w + 47)/5 Factor 4o2 + 36352o. 4o(o + 9088) Find k, given that -36k5 + 661380k*4 - 3036891532k*3 - 7088505476k*2 - 5401368032k - 1350415504 = 0. -1, -2/3, 9187 Find p, given that -4p4 - 1896p*3 + 25248p*2 - 37144p - 64284 = 0. -487, -1, 3, 11 Determine r so that r*2 - 169r = 0. 0, 169 What is r in 2r4/11 + 174r*3/11 - 49428r*2/11 - 5031424r/11 - 4981824/11 = 0? -124, -1, 162 Factor 3n2/2 + 469700n/3 - 104378/3. (n + 104378)(9n - 2)/6 Suppose 21w4 - 681w*3 + 6609w*2 - 21231w + 7938 = 0. Calculate w. 3/7, 7, 18 Find y, given that 20y4 - 11845y*3 + 1790260y*2 - 10748705y + 2575470 = 0. 1/4, 6, 293 Let -16v3 + 216860v*2 - 162632v - 54212 = 0. Calculate v. -1/4, 1, 13553 Solve k*5 - 1630k*4 - 7k*3 + 11416k*2 - 9780k = 0 for k. -3, 0, 1, 2, 1630 Solve 507n4 + 66066n*3 - 387024n*2 + 740736n - 470016 = 0. -136, 24/13, 2 Let x*5/2 - 183x*4/2 + 1199x*3 - 2697x*2 - 2399x/2 + 5577/2 = 0. Calculate x. -1, 1, 3, 11, 169 Find o such that 3o2 - 1830o - 7368 = 0. -4, 614 Suppose -k*2/4 - 2815k/2 + 96866 = 0. Calculate k. -5698, 68 Suppose 2d3/7 - 636d*2 + 634d + 26700/7 = 0. What is d? -2, 3, 2225 Factor -3o2/5 - 7821o/5 - 7818/5. -3(o + 1)(o + 2606)/5 Solve -5v2 - 2395v + 2400 = 0 for v. -480, 1 Suppose -h*3/5 - 157906h*2/5 = 0. What is h? -157906, 0 What is j in 6j*5/5 + 1764j*4/5 + 702j*3 + 1752j*2/5 = 0? -292, -1, 0 Factor 3c*3 - 11961c*2 - 3c + 11961. 3(c - 3987)(c - 1)(c + 1) Factor -2y*3/9 - 476720y*2/9. -2y*2(y + 238360)/9 Find y, given that 2y3/5 + 942y*2/5 + 113238y/5 + 108578 = 0. -233, -5 Suppose -r*5 + 163r*4 - 303r*3 - 3127r*2 + 11008r - 9660 = 0. Calculate r. -5, 2, 3, 161 What is r in -3r4 + 135r*3 - 1401r*2 - 1215r + 12852 = 0? -3, 3, 17, 28 Suppose 2f2/9 - 2738f/3 + 57400/9 = 0. Calculate f. 7, 4100 Find q, given that 4010q2 + 16051q + 44 = 0. -4, -11/4010 Factor -2a2/3 - 376a/3 + 3392. -2(a - 24)(a + 212)/3 Factor a3/3 + a2/3 - 274a/3 - 544/3. (a - 17)(a + 2)(a + 16)/3 Determine k so that 32k*4/9 - 2223056k*3/9 + 12869919574k*2/3 - 19304462540k/9 + 2413040450/9 = 0. 1/4, 34735 Let 2w2/17 - 12w - 17270/17 = 0. Calculate w. -55, 157 Solve 3l5 + 39l*4 - 2538l*3 + 19734l*2 + 2535l - 19773 = 0 for l. -39, -1, 1, 13 Find k, given that -2k3 + 8646k*2 - 172320k + 860600 = 0. 10, 4303 Factor -i*3 + 52817i*2 - 105631i + 52815. -(i - 52815)(i - 1)2 Factor 5d*2 - 900d - 3680. 5(d - 184)(d + 4) Solve -2u4/7 - 1245448u*3/7 - 193893835532u*2/7 - 387783934728u/7 - 193891344642/7 = 0 for u. -311361, -1 What is g in -105g4 + 327g*3 + 4689g*2 + 7965g - 972 = 0? -3, 4/35, 9 Find v such that -4v4 - 152v*3 + 7616v*2 - 12072v - 108540 = 0. -67, -3, 5, 27 Solve 3o2 - 683250o + 38902546875 = 0. 113875 Let -2g2/3 + 73g/3 + 329 = 0. What is g? -21/2, 47 Find f, given t	{ "pile_set_name": "DM Mathematics" }
2q3 - h2q2 + 474h*2q + 13824hq*3 + 2hq2 + 46q*3 - 17119q - 3 wrt q? -36h2 + 82944h + 276 What is the derivative of -130843701xz + 8598x - 3667 wrt z? -130843701x Find the second derivative of 979528009p5 + 2p + 648553585 wrt p. 19590560180p3 Find the first derivative of r3u - 125822635r3 - 3r*2u - 597879ru + 3r wrt u. r3 - 3r*2 - 597879r Find the second derivative of 3a3 - 59788627a*2 - 1438495a - 10. 18a - 119577254 Find the third derivative of 105713354ou5 - 12ou2 - o + 5u*2 - 6u - 26 wrt u. 6342801240ou*2 Find the third derivative of 4903017x*3 + 3x*2 + 967x + 21. 29418102 Find the third derivative of -24495i5 + 20i*3 + 19i*2 - 7059i + 3 wrt i. -1469700i2 + 120 What is the third derivative of -4540353p*3u*3 + 10p*2u*3 + 9p*2u - 4090pu*3 wrt p? -27242118u*3 Find the third derivative of 469050y*3 - 2y*2 + 2944194y wrt y. 2814300 What is the derivative of -5305343a4 + 13436263 wrt a? -21221372a*3 Differentiate -432695761b + 128283123. -432695761 Find the first derivative of -984964qy*2 + 7y*2 - 2y - 53463 wrt q. -984964y2 Find the third derivative of 5n*6 - 60720n*3 - 26927n*2 + 462. 600n*3 - 364320 What is the first derivative of -160625952b*4 - 44366665 wrt b? -642503808b*3 Differentiate -371985935b*3 - 46054521 wrt b. -1115957805b*2 Find the third derivative of -423m*5 - 2598m*4 + 2m*3 - 114317835m*2 wrt m. -25380m*2 - 62352m + 12 Find the second derivative of 41b4 - b3 - 53177b*2 - 157810268b. 492b2 - 6b - 106354 Find the third derivative of -4073399u4 - 3u*2 + 1150243 wrt u. -97761576u What is the second derivative of 17o4 + 2o*3 + 197210o*2 + 1472o + 3144? 204o2 + 12o + 394420 What is the third derivative of 4529956a5 + 2a4 + a3 + a*2 - 92342314 wrt a? 271797360a*2 + 48a + 6 Find the first derivative of 10734390n2 - n - 361526255. 21468780n - 1 Find the third derivative of 8864984z3 - 7z*2 - 246805z - 1 wrt z. 53189904 What is the second derivative of -32r3 + 652330r*2 - 269678457r wrt r? -192r + 1304660 Differentiate 23478prs + 6437pr - 1601ps + 18p + 1087s wrt r. 23478ps + 6437p What is the second derivative of 866h*4 - 5703h*2 - 15529172h? 10392h2 - 11406 Find the first derivative of 243npv + 9np + 18786n + 33824pv + 115p wrt n. 243pv + 9p + 18786 What is the first derivative of 1497405n*3 + 82n*2 + 412945887 wrt n? 4492215n*2 + 164n What is the third derivative of -d*3p*3 + 250d*3p*2 - 7112d*3p - d*2p*3 - 11dp3 - 681p*3 wrt p? -6d*3 - 6d*2 - 66d - 4086 What is the second derivative of -2j2z - 285126j2 + j + 1609386z wrt j? -4z - 570252 Find the first derivative of 4h*4 - 1083848h*3 - 2h*2 + 9054907 wrt h. 16h*3 - 3251544h*2 - 4h What is the second derivative of 13lp*3 - 98779lp2 + 15lp - 89l - 48p3 - p2 + 40873p wrt p? 78lp - 197558l - 288p - 2 What is the third derivative of -49974176t4z + 6t2z - 1648t2 + 40tz - 3t wrt t? -1199380224tz What is the second derivative of 1842071j3 + 1137702j? 11052426j What is the second derivative of -31389941h*2r*2 + 19091h*2 + 452hr wrt r? -62779882h*2 What is the second derivative of 21210682qt2 + 6qt + 2q + 207t + 2503 wrt t? 42421364q What is the third derivative of -17471564i2y*6 - 140375i*2y + 5i2 + 2iy2 + y2 - 2y wrt y? -2096587680i2y*3 Find the second derivative of -3a*2st - 29943a*2t + 34a2 - 55as + 29at - a - 542st + 7s - 4t + 1 wrt a. -6st - 59886t + 68 Find the third derivative of 12xz*4 + 171xz2 + 36335z*4 - 6z*2 + 1123z wrt z. 288xz + 872040z What is the third derivative of 751v*6 - 23716v*5 - 126v*2 - 1258170 wrt v? 90120v*3 - 1422960v*2 What is the first derivative of 1073d*2 - 1946d - 11737930? 2146d - 1946 What is the derivative of -349459666a + 60875273 wrt a? -349459666 What is the second derivative of 150309632p2 - 364843836p? 300619264 Find the second derivative of 103294v4 + 40v*2 + 42024366v wrt v. 1239528v2 + 80 Find the second derivative of 195816412j*2y*2 + 2jy2 + 4668525jy + 2j + 7y2 - 2 wrt j. 391632824y*2 What is the third derivative of -328639493o*5 - 2o*2 - 54o - 13278? -19718369580o2 Find the third derivative of -5568161m*5 + 2m*3 + 2m*2 + 6917590m wrt m. -334089660m2 + 12 Find the second derivative of 26b*3d2 - b3 - 93b2d*2 - 110b*2d - 107103bd - 16165d2 + 1 wrt d. 52b*3 - 186b*2 - 32330 What is the second derivative of 2a*4 - 2a*3 - 74102a*2 - 1061062a + 2? 24a2 - 12a - 148204 What is the third derivative of 10916i3s*2 - 28i*3 + 4i*2s*2 - 15i*2s + 5i2 + 6i + 703s wrt i? 65496s*2 - 168 What is the second derivative of -3608q*3 - 6286q*2 - 7q - 1258379? -21648q - 12572 Find the second derivative of 435840888w*2 - 74694501w. 871681776 What is the derivative of -51072943r4 + 29803101 wrt r? -204291772r*3 What is the derivative of -11cl2 + 15cl - 104329588c - 4562l2 + 14l wrt l? -22cl + 15c - 9124l + 14 Find the second derivative of 74ao*2r - ao - 2653ar3 + 111744o*2r*3 + 6or3 - 19o wrt o. 148ar + 223488r3 Find the first derivative of -21s*4 - 29s*3 - 16s*2 - 6945218. -84s*3 - 87s*2 - 32s What is the third derivative of -9678km*3 + 2km2 - km - 9k - 1668m*3 - 2521m*2 + 18m wrt m? -58068k - 10008 Differentiate -137j*4 - 16118j - 12666888 wrt j. -548j3 - 16118 What is the second derivative of -13046895c*2z*3 - 579cz2 + 2cz + 180z*3 - 2 wrt c? -26093790z*3 Differentiate 769642561a*4 - 595687113 wrt a. 3078570244a*3 What is the third derivative of 52086156d*4z - 218d2z + d*2 - 10dz + 2d - 37z + 1 wrt d? 1250067744dz What is the third derivative of 39r*6 - 165r*5 + 26r*4 - 101r*2 + 2r - 2379? 4680r3 - 9900r*2 + 624r What is the second derivative of 53162a4 + 15a*3 + 2a*2 + 51020010a wrt a? 637944a2 + 90a + 4 Differentiate -2b2 - 89961318b - 228244102 with respect to b. -4b - 89961318 What is the second derivative of -5742454n*4 - 110219n + 11? -68909448n2 What is the second derivative of g2h*2 - 276g*2 - gh*3 + 879132gh2 - 2gh + 32g + 2h + 79 wrt h? 2g*2 - 6gh + 1758264g Find the second derivative of 33977670y5 - y + 8281115. 679553400y*3 Find the first derivative of -40130868j*4 + 37621533 wrt j. -160523472j*3 Find the third derivative of -178lx3 + 2lx2 + 2162lx - 16l - 25303x3 + x2 + 3x - 4 wrt x. -1068l - 151818 Find the first derivative of -4913z*3 - 1165z + 335048648 wrt z. -14739z2 - 1165 What is the third derivative of -218860b*3h*3 - 740b*3h*2 - 9b*3h - 104bh2 + h3 wrt h? -1313160b3 + 6 What is the third derivative of 1992233a*2y*3 - 2a*2y*2 - 2a*2y + 5a2 + 3368a + 3y3 - 1 wrt y? 11953398a*2 + 18 What is the first derivative of 2k*4 - 4k*3 - 1496313k*2 - 38085411? 8k*3 - 12k*2 - 2992626k What is the first derivative of -2118s3 - 9476s*2 + 9093806 wrt s? -6354s*2 - 18952s What is the third derivative of 9207805s6 - s5 - 1109159s*2 wrt s? 1104936600s*3 - 60s*2 What is the third derivative of -44h*3i + 3048h3o - 257h3 - 195410h*2io + 591h*2o + 2o wrt h? -264i + 18288o - 1542 Find the second derivative of 14246545f*2 + 663912f - 4. 28493090 What is the second derivative of 327712794i2 - 268583706i wrt i? 655425588 Find the second derivative of -7537355x4 + 48x - 3360. -90448260x2 Differentiate 16622m*4 - 276m*2u - 5914476u + 1 with respect to m. 66488m*3 - 552mu Find the third derivative of -216465x*3z*3 + 3x*3z*2 + 11x*2z*5 - 18520936x*2z*2 wrt z. -1298790x*3 + 660x*2z*2 What is the first derivative of 110840a*4 + 3a*3 - 97426 wrt a? 443360a*3 + 9a*2 Find the second derivative of 257808063b*3 + 161352872b. 1546848378b Find the second derivative of 26230585y*2 + 1120103y wrt y. 52461170 What i	{ "pile_set_name": "DM Mathematics" }
- 3t + 20, 2t = 3i - 0i + 7. Let y(o) = 2 + 2o2 - 1 - i. Calculate y(1). 2 Let p(t) = 5t*2 - 2t*2 + 15 - 4t2 + 5 + t. Give p(0). 20 Let h(a) = a3 + 10a2 - 11a - 5. Let g(w) = -2w3 + 16w2 + w - 19. Let n be g(8). What is h(n)? -5 Let q(t) = -t3 - 4t2 + 3. Let f(a) = a2 - a - 4. Suppose -4 = 2k - k. Let x be f(k). Suppose -3v - x = v. Give q(v). 3 Let c(g) = -6 + 0g*3 - 2g*3 - 2g + 4g2 + 3g*3. Let m be c(-4). Let n(o) = -m + 0 + 7o + 1. Calculate n(1). 6 Let r be 3 - (-4)/(-4) - 8. Let w(k) = -k*3 + 9k*2 - 8k + 4. Let z be w(8). Let t(m) = -zm - m - 3 + 7 - m2 + 1. Give t(r). -1 Let g(d) = -d3 - 8d*2 - 8d - 2. Let o(h) = h*3 + 8h*2 + 8h + 2. Let v(z) = 5g(z) + 4o(z). Calculate v(-7). 5 Let c(n) = 4n + 1. Let o be (-1)/3 - 5/(-15). Suppose -2h = -oh - 2. Give c(h). 5 Let a(q) = 2q + 2. Let i(w) = -1. Let u(d) = 6. Let n(h) = 5i(h) + u(h). Let l(s) = a(s) - 4n(s). Calculate l(6). 10 Let i(q) = -q + 4. Let g(p) = p*3 - 9p*2 - 3p. Let l be g(8). Let v be 4/(-14) - l/14. Suppose -s + v = 2s. Give i(s). 2 Let j(s) = -s2 + 3s + 1. Let y(g) = -g - 5. Let p be y(-8). Determine j(p). 1 Let d = -5 - -7. Let z be (4 - -3) + d-1. Let u(t) = 0t - 4t - 4t*2 + 2t3 - t3 - 2. Calculate u(z). 3 Let u(q) = -3q + 4q*2 - 11q*3 + 10q*3 + 0q*2 + 3. Suppose 2i - 4h - 12 - 2 = 0, 0 = 2i + 4h + 2. Calculate u(i). 3 Suppose -5s = -u - 31, 0u = 3s - u - 17. Let q(j) = -j2 - j + 13. Let w be q(0). Let o = s - w. Let p(n) = n2 + 5n - 3. Give p(o). 3 Let u(v) be the third derivative of v6/120 - v5/15 + v4/6 + 5v*3/6 + 36v2. What is u(4)? 21 Let a(j) be the second derivative of -j4/12 - 4j3/3 - 7j*2/2 - 42j. Give a(-5). 8 Suppose -5k + 17 = -4o, 0 + 11 = -5o - 4k. Let j(f) = -538 + 4f - 544 - 3f + 1084. Determine j(o). -1 Let a(x) = -2x - 1. Suppose -2 = 3d - d. Determine a(d). 1 Let z(q) = q*3 + 4q*2 + q - 2. Let n be z(-3). Let m(b) = b + b - nb - b. Let k = -2 + 0. Calculate m(k). 6 Let v(z) = -2z2 + 5z - 4. Let f(m) = m*2 - 4m + 4. Let s(d) = -3f(d) - 2v(d). Give s(-4). 4 Let y(l) = -l*3 - 11l*2 - 9l + 11. Let d(v) = 2v3 - 2v*2 - 5v + 4. Let f be d(-2). Calculate y(f). 1 Let o be (0 - (-4 + 3))1. Let v(l) = 33l*2 - 5l - 11. Let u(n) = 16n2 - 2n - 5. Let a(j) = -9u(j) + 4v(j). Calculate a(o). -13 Let s(n) = 6n2 + 2n - 1. Let p(o) = -6o2 - o + 1. Let q(r) = 3p(r) + 2s(r). Let y(u) = u3 + 5u*2 - 1. Let f be y(-5). Calculate q(f). -6 Let w(y) = -3y - 1. Let h(l) = 6l + 3. Let i(c) = 2h(c) + 5w(c). What is i(3)? -8 Let d(z) = 4z + 1. Suppose -4j - 4o = -244, 2o + 10 = -0o. Suppose -5c + 5y + 60 = 0, 3y + j = c + 4c. Let s be 1/3 - 35/c. Calculate d(s). -7 Let h(f) be the first derivative of f*4/4 + 2f*3 + 2f*2 - 3f - 1. Suppose -3z + q + 0q = 16, 3z = -q - 14. What is h(z)? 2 Let o(v) be the first derivative of v2 - 2v - 7. Let x = -7 + 11. Suppose -q + 6 = -xq. Calculate o(q). -6 Let h(w) = -w2 + 5w. Suppose -o = 2x - 7, -3x = -x - 3o - 27. Give h(x). -6 Let q = -47 - -50. Let n(c) = 2c + 2. Calculate n(q). 8 Let c(l) = l*2 + 5l - 8. Let y = 116 + -122. Calculate c(y). -2 Suppose -3x - 12 - 1 = 2v, 2x + 14 = -2v. Let r(k) = -6 + k*2 - 1 + 0k*2 + 7k. Let i be r(v). Let p(c) = -8c3 + c2 - 1. What is p(i)? -8 Suppose -2g = 2d - d - 7, 2g - d - 1 = 0. Let m(o) = -3 + 0o - go*2 - 3o + o2. Give m(-3). -3 Let c be -7 + 0 + 3/3. Let a(z) = -z2 - 6z - 3. Give a(c). -3 Let k be (-6)/(-24) + 27/4. Let h = k - 12. Let s(x) = -x3 - 5x*2 - x - 3. Calculate s(h). 2 Let x(o) = o - 2. Let u be ((-12)/8)/((-9)/12). Suppose -uv - 17 = r, -6v - 5 = -v - 5r. Determine x(v). -8 Let a(z) be the third derivative of -z6/120 - z5/10 - z*4/24 - 2z3/3 + z2. Calculate a(-6). 2 Suppose 78 = 2n + 6. Suppose 2c - 3w + n = 6, 3c + 4w = -11. Let b(d) = -d - 6. Let m be b(c). Let v(u) = u2 - 3u + 3. What is v(m)? 3 Suppose -m = 5q - 5m - 21, 0 = -q - 5m - 19. Let h be 2/5(4 + q). Let i(p) = 3p + 2 + p2 - 1 - p3 - 4. Give i(h). -1 Suppose 6s + 0 = 108. Let x(n) = -1 - 18n + 37n - sn + 6. Suppose 2f = 3f. Give x(f). 5 Let u(a) = -a3 - 5a*2 + 6. Let f be (-46)/8 + 21/28. Determine u(f). 6 Let s = 1 + 1. Let q(n) = 1 - 3n*3 + 3n*2 + 9n*3 - 4n*s. Give q(-1). -6 Suppose 2k - 18 = 4b, 4b = -k - k - 22. Let p(d) = -d*3 - 4d*2 + 7d + 7. What is p(b)? -3 Let d(r) = 7r + 6. Let j(k) be the third derivative of -5k*4/6 - 19k3/6 + k2. Let q(i) = -17d(i) - 6j(i). Give q(-6). 6 Let d(f) be the second derivative of f6/720 - f5/40 - 5f4/12 - 8f. Let h(m) be the third derivative of d(m). Determine h(6). 3 Let y = -9 - -12. Suppose yt = -3a + 21, -5t + a - 6 = -17. Let o(w) = 2w + 2. Give o(t). 8 Let q(o) = 3o2 + 60o + 2. Let b be q(-20). Let c(d) = 4d3 - 8d*2 + 1. Let k(g) = -5g*3 + 9g*2 + g - 2. Let z(s) = 4c(s) + 3k(s). What is z(b)? -8 Let h(k) = -3k*2 - k - 2k*2 + 5k*2 + 4k*2. Calculate h(-1). 5 Suppose -t + 5t + 12 = 0. Let s(v) = -3v + 1. Determine s(t). 10 Suppose 3p + p + 17 = 3d, -d = -5p - 24. Let j(b) = 4b2 + 16. Let i(y) = -y2 - 5. Let r(m) = 16i(m) + 5j(m). What is r(d)? 4 Let n be (10 - (-1 - 0)) + 3. Let l = n + 4. Suppose -4s - 10 - l = 3p, -3s = 5p + 32. Let y(w) = -w3 - 3w2 + w - 3. Determine y(p). 9 Let m(w) be the first derivative of -w7/840 + w6/90 + w4/24 - 5w3/3 - 4. Let c(l) be the third derivative of m(l). What is c(4)? 1 Let w = 1 + -2. Let l be w/2 + (-3)/(-2). Let g(n) be the third derivative of -5n4/24 - n3/6 - 2n2. Calculate g(l). -6 Let z(b) = -b2 - 26 + 8 + 16 - b. Let d = 0 + 0. Give z(d). -2 Let g be -2 + (-8)/(-12) + (-18)/27. Let x(c) = c2 + c + 2. Give x(g). 4 Let v(j) = j + 11. Suppose -1 = -3s - 22. Give v(s). 4 Let s(i) be the third derivative of i5/60 + i4/3 + 7i3/6 - i2. Suppose 7d = -147 + 105. Determine s(d). -5 Let a(f) be the second derivative of -f4/3 - f3/6 - f*2/2 - f. Suppose -2k - 3y = -5k - 12, 0 = -3y + 12. Let d = -1 + k. Determine a(d). -4 Let i(d) = d - 4. Let z be i(4). Suppose -5y - 5 + 25 = z. Let r(b) = -2 - 1 + y + 2b + 2 - b2. Give r(-2). -5 Suppose -7s + 13s = 12. Let w(n) = -5n + 1. Give w(s). -9 Let t(b) be the second derivative of b*5/20 - 7b*4/12 + 5b*2/2 + 39b. Determine t(7). 5 Let g be 56/20 + 2/10. Let n(d) be the second derivative of d*2 + 0 + d - 1/12d*4 + 1/6d3. Determine n(g). -4 Let h(v) = -v3 + 2v2 + 3v - 2. Let b be h(3). Let m(p) = 2p3 + 2p. Give m(b). -20 Let n(k) = 21k3 + 1 + 2k*2 - 2k + 10k3 - 17k*3. Calculate n(1). 15 Let x(n) = -8 - 2n*2 - 4n*2 - 3n2 + n3 + 4 + 8n. What is x(8)? -4 Suppose 3c + 11 = 4l, 3l + 6c = 5c + 18. Let u(h) = -h*3 + 4h*2 + h - 3. Calculate u(l). -23 Let l(a) = a - 4. Let u be (-2 - -10) + (-2 - 0). Suppose q = uq. Calculate l(q). -4 Let w(m) = 23m2 - m - 1. Let h = -34 - -33. What is w(h)? 23 Suppose 4r - 24 = -4b, r + 2r + 2b - 16 = 0. Let x = r + -4. Let m(l) = l3 - 18l*2 - 3 + 19l*2 + l - 2l3. Determine m(x). -3 Let b(t) = -t3 + 8t2 - 7t + 4. Let c be b(7). Suppose c = -4q + 36. Suppose -4s = -2s - q. Let o(n) = -n3 + 5n*2 - 2n - 4. Give o(s). 4 Let u(h) be the third derivative of h6/120 + h5/10 - h4/24 - h3/3 - 4h2. Calculate u(-6). 4 Let t(y) = -y3 - 6y*2 + 6y - 7. Let v(k) = k*2 - 5k - 1. Let g be v(3). Determine t(g). 0 Let t(l) = 4l2 - 25l + 2. Let x(b) = b*2 - 8b + 1. Let c(z) = 2t(z) - 7x(z). What is c(-5)? -8 Let j(c) be the first derivative of -c2/2 + c - 3. Let k(o) = o2 - 12o + 8. Let w be k(11). Give j(w). 4 Let n(x) = -2x + 5. Let k be -2(-4 - -3) + 38. Suppose 4w + 8 = k. Let s be 24/(-8)w/(-6). Determine n(s). -3 Let u(t) = -4t*2 - 4t*3 + 3t3 - t3 + t*3. Determine u(-5). 25 Let x(f) = -f + 3. Let b(h) = 2h - 55. Let j be b(30). Give x(j). -2 Let t(x) = 0x2 - 5x + x*2 + 0x + 1. What is t(5)? 1 Suppose 3z - 3g + 6 = -3, 3 = -z - 3g. Let c(t) = t2 + 8t + 3. Give c(z). -12 Let r(m) = -7m2 - m. Suppose 3 = -3k + 6. Determine r(k). -8 Let j(g) be the third deri	{ "pile_set_name": "DM Mathematics" }
u(f) be the first derivative of -f*3/3 + 3f*2 + 7f - 137. Let m = 11 + -5. Let t be 34/6 - (-2)/m. Give u(t). 7 Let j = -27 + 44. Suppose -j = -m - 14. Let h(s) = 2s - 4. What is h(m)? 2 Let x(m) = -451m - 3m2 + 450m + 4m2 - 12m2. What is x(-1)? -10 Let p(s) be the second derivative of -s5/20 + 3s4/4 - 4s*3/3 - 3s*2/2 + 92s. Calculate p(8). -3 Let m(l) be the third derivative of -3l4/4 + l3/6 + 2l*2 + 95l. Give m(-1). 19 Let h(m) = -5m + 6. Let i(u) = 4u - 7. Let k(x) = -x*3 + 5x*2 + 5x + 12. Let j be k(6). Let p(g) = ji(g) + 5h(g). What is p(-10)? -2 Suppose 126 = 253l - 239l. Let p(o) = -3o + 2. Calculate p(l). -25 Let q(m) = -m2 + 6m + 2. Let i(s) = s*2 - 17s + 21. Let h = 7 - -10. Let z be i(h). Suppose 0l = 3l - z. Calculate q(l). -5 Let o(v) = -10v + 77. Let s(c) = -7c + 76. Let r(d) = -2o(d) + 3s(d). What is r(0)? 74 Let w(b) be the second derivative of -b3/3 + b2/2 + b. Suppose -674 + 844 = -34d. Give w(d). 11 Let f(a) = -24a*3 - 12a*2 + 5 + 13a*2 + 5a + 27a3. What is f(-2)? -25 Let f(q) = -27 - 58q*2 + 15q*2 + 44q*2 - 9q. What is f(13)? 25 Let b(h) be the third derivative of -h*5/60 + 7h*4/12 - 3h*3/2 - 98h*2 - 1. What is b(10)? 31 Let h(l) = -37l*3 - 5l*2 - 41l*3 + 26 + 79l*3 - 24. Calculate h(2). -10 Suppose 9 = -2p - p - 3f, -4f = 2p. Let q(t) = t2 + 2t - 9. Give q(p). 15 Let t = -143 - -30. Let i = t + 119. Let u(l) = l*3 - 5l*2 - 5l - 8. Calculate u(i). -2 Let b(g) = -2g2 - 8g + 5. Let z be 12(6 - (-26)/(-4)). Determine b(z). -19 Let p(t) = t + 1 + 2 - 5. Let b be 184/(-32) - ((-15)/(-12) + -2). Calculate p(b). -7 Let j(r) be the second derivative of r3/6 - 37r. Let u(o) = 5o - 8. Let d be u(3). Determine j(d). 7 Let d(w) = -w + 5. Let k be d(9). Let p = 3 + k. Let v(o) = o + 1 + o3 + 0o*3 - 2o3. Calculate v(p). 1 Let s(w) = w3 + w + 7. Let j(t) = t*3 + 7t*2 + 9t - 12. Let r be j(-4). Determine s(r). 7 Let r(s) be the first derivative of 2s3/3 + 3s*2 + 4s - 221. Determine r(-3). 4 Let c(m) = m*2 - 3m - 3. Suppose -5b - 3p = -8 + 1, -5 = 5p. Let i(d) = -d3 + 4d*2 - d + 2. Let f be i(b). Let w be f/3 + (-2)/(-6). What is c(w)? -3 Suppose 4k - 12 = 2m, -179k - 5m = -178k - 3. Let r(t) = -6 + 1 + 3 + t. Give r(k). 1 Let d(n) = -n3 + n2 + 14n - 6. Let l be d(4). Let a(i) = -2i*2 + 2i - 2. What is a(l)? -6 Let f(z) = 4z3 + 9z*2 + 10z + 10. Let d(r) = 5r3 + 10r*2 + 11r + 11. Let q(i) = -3d(i) + 4f(i). Let y = 141 + -146. Give q(y). -3 Let a(q) be the second derivative of q5/60 + q4/24 - 5q2 - 48q. Let z(d) be the first derivative of a(d). Determine z(0). 0 Let k(g) = 4 + 25g3 - g - 2g*2 + 17g*3 + 19g*3 - 63g*3. Determine k(3). -71 Let z(g) = 9g*2 + 12g - 2. Let u(m) = 4m2 + 6m - 1. Let c(t) = 7u(t) - 3z(t). Let n be c(-7). Let p(d) = -d*2 + 5d + 1. Calculate p(n). -5 Let z(y) = y*3 + 4y*2 - 2y + 2. Let x = 407 + -411. Determine z(x). 10 Suppose -131j = -154j. Let x(t) be the third derivative of jt + 0 + 6t*2 + 5/6t*3 - 1/24t4. What is x(0)? 5 Let y(i) = i2 - 5i + 1. Suppose 6x = 3x + 12. Suppose 8j - 24 = xj. What is y(j)? 7 Let z(a) = 78 + 21a - 26a - 164 + 77. What is z(-8)? 31 Let n(r) = -7r + 3. Let b be n(2). Let l = 15 + b. Let h(g) = g2 - 2 - g2 + g*2 - 2g. Calculate h(l). 6 Let z(m) = 3. Let j(i) = -i - 27. Let x(f) = -2j(f) - 18z(f). What is x(10)? 20 Let f(c) = 77c + 1 - 36c - 40c. Give f(2). 3 Suppose f + 14 = 12, -3v - 5f = -8. Let h(w) = -6w*2 + 12w - 2. Let b(o) = 5o2 - 11o + 2. Let u(t) = -5b(t) - 4h(t). Give u(v). 4 Suppose -13 = -7x - 34. Let v(b) = 7b + 7. Let p(q) = 20q + 20. Let k(i) = 6p(i) - 17v(i). Give k(x). -2 Suppose -3x = 2w - 11 - 1, 20 = 4w + 4x. Let o(f) = 35f + f*w - 28f - 3 - 1 + 7f2. Let y be 5/(2/(-2)) + -1. Determine o(y). -10 Let j(v) = -3v. Suppose -x = 5 + 4. Let s = x - 6. Let u = s - -17. Give j(u). -6 Let k(a) be the third derivative of a6/120 - a5/5 + 13a4/24 - 19a*3/6 + 5a*2 + 59a. Give k(11). 3 Let l(z) be the third derivative of z7/840 - z6/60 + z*5/60 - 7z*4/24 - 11z*3/6 + 5z*2. Let i(y) be the first derivative of l(y). Give i(6). 5 Let u(y) = -2y*2 + 2y + 6. Let q(i) = i*3 + 13i*2 - 12i + 24. Let o be q(-14). What is u(o)? -34 Let z be (-8)/12(1 - -5). Let x(d) be the second derivative of -5d*3/6 - 5d + 18. Give x(z). 20 Let n(t) = -t*3 + 4t*2 + 5t - 6. Let m be (8/12)/(3/9). Suppose 0 = 2h - mv - 42, 2h + v - 63 = -9. Suppose -5r = -0r - h. What is n(r)? -6 Let h(y) = -y3 - 13y*2 + 16y + 31. Let z be h(-14). Let b(v) be the first derivative of v*3/3 - 3v*2/2 - 3v + 2. Give b(z). -3 Let u be 6-4(-1)/8. Let w(r) = -3 + 5 - ur - r + 5r. Give w(6). 8 Let u(y) = -28y - 44. Let v(l) = -5l - 9. Let x(o) = -2u(o) + 11v(o). Give x(8). -3 Let k(i) be the first derivative of i*4/4 - 4i*3/3 + 3i*2/2 - 5i - 1. Let j = 2072 + -2068. Determine k(j). 7 Let b(i) be the third derivative of 0 + 0i - 45i*2 - 1/60i*5 - 1/8i*4 - 1/6i*3. What is b(-2)? 1 Let y(l) = 4l - 4. Let r(t) = t*2 - 10t - 23. Let o be r(17). Suppose 7p - 3p = -o. Let m be p/32(-2 + -2). Give y(m). 8 Let k(f) be the third derivative of -f4/24 - f3/3 - f2. Suppose -4j - a + 20 = -3a, -3j + 6 = 3a. Determine k(j). -6 Let y(b) = -b2 - 17b - 21. Let g be y(-6). Suppose -3s + g = 5h, -h = h - 3s - 18. Let v(l) = -l2 + 8l - 3. Give v(h). -12 Let p(f) = 6f3 - f2 - 3f + 3. Let h(d) = 2d3 - 2d + 1. Let x(v) = 2h(v) - p(v). Determine x(-3). 65 Let q(b) = 5b. Let d = 30 - 16. Let z = d + -10. Suppose i = -i - z. What is q(i)? -10 Let l(k) = k*3 - 2k*2 - k - 1. Suppose 0c = 5c. Suppose 2i = -ci. Suppose 4 = 2v - i. What is l(v)? -3 Let g = -49 - -84. Let r(j) = -9 - 18 + j + g. What is r(-4)? 4 Let u(c) = 3c - 12. Let i be (9/(-6))/(252/80 + -3). Let h be -4(i/(-5) - 4). What is u(h)? 12 Let q(t) = t*2 + 5t + 1. Let j = 9 + -4. Suppose -jb + 0h = 4h, 4b + 5h + 9 = 0. Suppose -4a + 1 = -3d - 0, a = bd + 10. Determine q(d). -5 Let a(g) = -5g + 46 - 27 - 64. Determine a(-10). 5 Let o(q) be the second derivative of q3/2 + 7q*2/2 - 787q. What is o(4)? 19 Let j(u) be the third derivative of 1/6u4 - 11u*2 - 1/3u*3 + 0 + 0u. Calculate j(2). 6 Suppose -42 = 6s - 12. Let v(d) = d2 + 5d - 12. Calculate v(s). -12 Let f(k) = 13k - 14. Let g(s) = 6s - 7. Let x(v) = 4f(v) - 9g(v). Suppose 4r + 4n = 19 - 7, 0 = -3r + 5n + 33. Give x(r). -5 Let g(u) = -u*3 + 5u*2 - 2u - 4. Let y(t) = 3t3 + t2 - 5t + 3. Let d be y(2). Suppose d = -f + 8f. Give g(f). 8 Suppose 1586 - 1622 = 12d. Let f(q) = q*3 + 4q*2 + 11q + 21. What is f(d)? -3 Let j = -84 + 102. Let y be -21(-14)/4. Suppose j = -10k + yk. Let l(z) = -z*3 - 5z*2 + 7z + 7. Give l(k). 1 Let f(a) be the third derivative of 11a4/24 - a3/6 + 225a*2 + 2. Calculate f(-1). -12 Let h = 6 + -3. Let a be (3/9)/(1/h). Let i(c) = -371 - c - 374 + 7c2 + 745. Give i(a). 6 Let i be (2/4)/(122/(-1464)). Let o(t) = -t3 - 6t2 - 6. Determine o(i). -6 Let p be (3 - 3)(-5)/((-30)/(-3)). Let a(u) = 27u2 + 5 + 0u - 26u2 + u. Determine a(p). 5 Let m(y) = -4y - 11. Suppose -2t = -4t + n + 5, 4t + 2n - 22 = 0. Give m(t). -27 Let v = -85 - -86. Let k(d) = 9d3 - 3d2 - d - 2. Let t(z) = z3 - 2z3 + z + 3 - 2 + z2. Let f(u) = -k(u) - 2t(u). What is f(v)? -7 Let u(r) = r*2 + 9r + 1. Let n be u(-10). Let z(k) = nk - 8k - 2k. Determine z(3). 3 Let h(f) = 15f - 19. Let l(x) = -10x + 13. Let d(r) = -5h(r) - 7l(r). Suppose -3t = -z - 8, 10t + 4 = 11t + z. Calculate d(t). -11 Suppose 5k + 0k = 4l + 25, 0 = -2k + 4l + 10. Let p(m) = -m2 + 6m + 1. What is p(k)? 6 Suppose 4f = 291t - 292t, 4f = -3t. Let w(j) be the third derivative of f - 4j*2 + 0j - 1/3j3 + 1/24j*4. Calculate w(-7). -9 Let m be (-2)/(2/(-3))(-4)/(-4). Let w(u) = -15 + m + u + 0u. Calculate w(11). -1 Let t be ((-4)/((-32)/30))/((-1)/(-4)). Suppose 3g + t = -u + 2, 3u - 33 = 3g. Let a(j) = 3j + 7. What is a(g)? -11 Let m(x) = 816x + 3x2 - 1642x + 1 + 810*x. Determine m(6	{ "pile_set_name": "DM Mathematics" }
+ 2)-6. Suppose -3b = 4 - 13. Suppose 4h - 15 = -5w + b, 0 = 5w - 3h - 4. Solve -jz = -z + w for z. -1 Suppose -3k = -5w - 20, 0 = k - 2k + 5w - 10. Let v = 15 - k. Solve -6c + c + 5 = v for c. 1 Let v = -218 - -224. Solve 5o = 8o - v for o. 2 Let y(q) = 3q - q + 3 - q. Let n be y(-3). Let u be 2/89(-16)/(-12). Solve n = ur + r + 8 for r. -2 Let u = 1487 - 1397. Solve u = 2o + 88 for o. 1 Let b = -52 + 52. Suppose -3 = -y - b. Solve -2q - y = 3 for q. -3 Let n be 5/(-2 + (-22)/(-10)). Suppose 0 = 2g + 3g - n. Suppose 2l - 6 = 0, 33 = 2v - 0v + gl. Solve -k = 2k - v for k. 3 Let t(r) = r2 + 16r. Let v be t(0). Solve o + v = -2 for o. -2 Let j be (-2 + 0 + 1)/1. Let s be ((-24)/28)/(j/(-7)). Let x be 3 - 9(-2)/s. Solve x = 2n - 3 - 5 for n. 4 Let v be (3 - -4) + 0 + -12 + 14. Solve -vw - 4w = -8w for w. 0 Suppose 0 = -7l - 5 + 117. Suppose -l = 4j, 2z - j = -4j. Solve -2p + zp = 8 for p. 2 Let s be 2 + 2 - (2 - (-4)/(-1)). Suppose -4l = sl - 50. Solve -l = 6y - y for y. -1 Let b = -1 + 5. Suppose -2v = -bl - 8, -1 = 4l - v + 3. Suppose -3a + 6 + l = 0. Solve -ao + 3o - 2 = 0 for o. 2 Let d = 7 + -5. Suppose 0 = -76g + 73g + 12. Solve df + 10 = g for f. -3 Suppose 0 = p - 3n + 37, 234 = -5p + n + 63. Suppose 0 = -9g - 87 - 255. Let m = p - g. Solve -4 = -mi + 3i for i. 4 Let u be 3 - 5/(-2)(-76)/(-10). Solve -u - 8 = 6w for w. -5 Let n = 85 - 79. Solve -6x = 12 + n for x. -3 Let x = 55 - 52. Suppose -3g = -5p + 72, xp - 3g - 27 - 21 = 0. Solve 0 = -4a - 0a + p for a. 3 Let z(v) be the third derivative of v4/24 - 19v*3/6 + 11v*2. Let d be z(23). Solve -d = s - 2 for s. -2 Suppose 0 = 4l + 11h - 7h - 120, 5l - h = 120. Solve -12i - l - 11 = 0 for i. -3 Let m(p) = -2p3 - 28p*2 + 29p - 12. Let d be m(-15). Solve -2u + d - 9 = 0 for u. -3 Suppose -6 = 86f - 84f. Let n be 2(-1 + 0) - f. Solve -q + n = 3 for q. -2 Let w be (-4)/(-8) + 5/(-10). Suppose w = 2s - 5s + 30. Suppose -4r - 3f + 10 = 2f, 0 = -2r + 5f - s. Solve rq = -5q for q. 0 Let b(m) = 7m*2 + 2m - 18. Let g(h) = -13h2 - 3h + 37. Let s(y) = 11b(y) + 6g(y). Let f be s(7). Solve 0 = -5k + 2 + f for k. 1 Suppose -857l - 38 = -859l. Solve lx = 22x for x. 0 Let w(b) = -3b3 - b2 - b - 1. Let v be w(-3). Suppose -v - 38 = -7l. Suppose -4p = 4x - 28, 0 = -p + 3x + x - 18. Solve -ps + l = -6s for s. -4 Let y(o) = o + 3. Let c be y(-6). Let n be c/66 + 14. Solve 0 = 3r + 2 - n for r. 3 Suppose -5p - 8 = -3y + 27, 3p + 33 = 3y. Solve -10 = 15j - yj for j. -2 Let z = -30 - -73. Let k = -40 + z. Suppose -3f = -2f - 2. Solve -20 = -ks - fs for s. 4 Suppose 18 = 3v + 5b, 0 = -5v - b + 2b + 58. Suppose -v + 3 = -4m. Solve -3a = ma for a. 0 Let l(f) be the second derivative of f5/20 + 5f*4/12 - 7f*3/6 - 3f*2 - 10f. Let w be l(-6). Solve w = 4x + x + 10 for x. -2 Let p = 36 + -41. Let f(r) = 2r - 13. Let c be f(11). Let d = c + p. Solve -1 = y - d for y. 3 Suppose -3b = -6b + 9. Suppose 0 = bg + 6 - 30. Suppose 4o - 16 = -0v - 2v, 2o - 3v = -g. Solve -x = -2x - o for x. -2 Suppose 60 = h + 3z, 0 = 2h + 4z + 82 - 212. Let u = h + -73. Solve -ui - 10 = 3i for i. -2 Let o(h) = -2h + 32. Let t be o(19). Let m(g) = -2g - 6. Let j be m(t). Solve -4w - j = -2w for w. -3 Suppose -l - 5m = -25, m + 2m = 2l + 15. Let j(g) = -3g + 3. Let w be j(l). Solve 5h = wh - 4 for h. -2 Let h(p) = 5p + 40. Let u be h(0). Let j = -40 + u. Solve j = -2f + 3f for f. 0 Suppose -3 = -16d + 13d. Solve -d = i - 6 for i. 5 Suppose t = -v + 6, -t + v + 6 = 4. Suppose 4h = -3d + 16, -2h = -3h + t. Solve dp + 5 = -p for p. -5 Let f = 3 - -11. Let a be (-10)/(-35) - (-220)/f. Suppose 0 = 4d - a. Solve -5i - d - 1 = 0 for i. -1 Let d = 20 - 8. Let b = -16005 + 16009. Solve bk = -0k + d for k. 3 Let r(t) = -2t + 15. Let v be r(-13). Let z = v + -39. Solve -4g + z + 6 = 0 for g. 2 Let c = 71 - 38. Let v = 29 - c. Let m = 0 - v. Solve 5 = mn + 1 for n. 1 Let g be -1 + (-2 - (-13 + (-4)/4)). Let s be 2 - g/(-3) - (-24)/(-36). Solve 3j = -2j + s for j. 1 Suppose -15i + 10i + 36 = -3s, 0 = -i - 5s + 24. Solve -6x = -ix + 15 for x. 5 Let b be -9 + (2 - (5 + -3)). Let u be (1 + -1)/(b/(81/18)). Solve u = -0j - 4j + 4 for j. 1 Suppose c + 17h = 20h + 21, 3c - 3h = 45. Solve -ck = -7k + 25 for k. -5 Suppose 0 = t - 5 + 3. Let j be (416/40)/(t/5). Let a = j - 20. Solve n + a = 3 for n. -3 Let p(f) = -f3 - 6f*2 - 2f - 7. Let h be p(-6). Suppose -t + 6 = ht. Solve 0 = 4r + t + 3 for r. -1 Suppose 2n = 4n + 10. Let b(g) = g*3 + 5g*2 + 4. Let w be b(n). Suppose 0 = -2f - f - 2v + 7, 5 = 3f + wv. Solve 0 = -d - 2d - f for d. -1 Let u(d) be the first derivative of 4d3/3 - d2/2 - d - 11. Let n be u(-1). Solve 0 - n = t for t. -4 Let v = -56 + 59. Solve vk - 2k - 3 = 0 for k. 3 Suppose 3l - 4u + 4 = -0u, -4u = -l + 12. Let f = l + 9. Suppose 3z = f + 8. Solve b = 8 - z for b. 5 Let d(m) be the second derivative of 3m3/2 + 67m*2/2 + 26m. Let w be d(-7). Solve -4b + 8 + w = 0 for b. 3 Let z(t) = 2t*2 + 8t - 5. Let i be z(1). Solve 13 - i = -8y for y. -1 Let i(a) = a2 + 8a - 82. Let y be i(-14). Solve -yf = -0f - 10 for f. 5 Let b be 51 - (-7 - -7)/(1/(-1)). Let h = b - 49. Solve 2i - 4 = -h for i. 1 Let s(f) = -f2 - 18f + 18. Let j be s(-17). Suppose -2y + 5 = j. Let g be y/104/(-3). Solve -5k = -gk for k. 0 Let n = -27 - -28. Let h be 12 - 3 - (n - -2). Suppose 4k = h + 2. Solve kr = -2r + 8 for r. 2 Suppose -3a + 3u + 6 = 0, -2a + u = 3u - 8. Solve a = -j - 1 for j. -4 Suppose 0 = -75w + 77w - 14. Let a = -7 - -7. Let d = 5 + a. Solve -d - w = 4u for u. -3 Suppose 3p = -p + 8. Suppose -pr - 3y = -22, -2r = -3r + 3y - 7. Suppose r = 3u - 4. Solve -5t + 4t = u for t. -3 Suppose 163l - 165l + 4 = 0. Let v(p) = -p2 + 12p - 14. Let s be v(10). Solve -5w = -sw + l for w. 2 Let o(m) = 74m - 713. Let a be o(10). Solve -8b + 76 = -ab for b. -4 Suppose 3v + 2v = 0. Suppose 5k - 7 - 79 = -4n, 5n - 4k - 87 = 0. Let z = n + -10. Solve l + 2l - z = v for l. 3 Suppose o + 2 = -5z, -o - o - 4 = -5z. Let m be (-34)/(-12) - o/12. Solve -mw = -0w for w. 0 Let s(q) = q*3 + 11q - 25. Let t be s(2). Solve -9b = -tb for b. 0 Let v = -186 - -188. Solve h = vh for h. 0 Let k(r) = r2 - 28. Let b be k(8). Let p be 64/36 + 8/b. Suppose -5u + 8 = -u. Solve -16 = -pq - uq for q. 4 Let r(l) be the second derivative of l5/4 - l4/6 + l*3/6 - l. Let j(b) = b + 4. Let c be j(-3). Let k be r(c). Solve 15 = -i + ki for i. 5 Let y be (2 - -86)/(-4)1/(-2). Solve ys + 3 = 36 for s. 3 Let r be (5 + -4)(0/(-2) - -41). Suppose -12y = -7 - r. Solve 2u - u = -y for u. -4 Let z = 7 - 4. Let p be (-2)/(-15) + 22/(-165). Solve -zv = -pv for v. 0 Let a be 0 + (2 - 3)-4. Let i(x) = -6x + 19. Let c be i(3). Solve 0 = -al + 3 + c for l. 1 Let z be (-4)/(-1) + 2/(-2). Let k = 26 - -2. Let h be 9/(-4)k/(-21). Solve -2l + zl = h for l. 3 Let m(c) = c2 + 15c - 45. Let z be m(-18). Solve z = -4k + 1 for k. -2 Let p(n) = 111n + 559. Let r be p(-5). Let w = 0 - 0. Solve w = -6x + 2x - r for x. -1 Suppose -2q - 44 = -5b + 7, 0 = -b - q + 6. Let f be 16/24b/(-2). Let p be (3 - (-33)/(-9))f. Solve 2d + pd = 0 for d. 0 Let c be 10/5 + (-2)/(-2). Let p be 2 + (3 - c) - 2. Let j be (0/(-1))/(p - -2). Solve -2z + jz = 6 for z. -3 Let g be 5 - (-4 - (-30)/(-5)). Let b(a) = a + 7. Let k be b(-5). Solve c + g = -kc for c. -5 Let m be 2 - 14/4 - (-2)/4. Let c be ((-1)/2)/((-1)/(m - -7)). Solve -c = -q - 6 for q. -3 Let f = 19 - 5. Let d(r) = r - 4 - 8 + 3 - 4 + 2. Let o be d(f). Solve -oa + 8 = a for a. 2 Let x = -189 + 195. Solve 3g = 6g + x for g. -2 Let d = -45 + -4. Let n = d - -50. Solve c + n = -1 for c. -2 Let o = -3 - 20. Let h = -23 - o. Solve 0f + 2f - 10 = h for f. 5 Let b = -49 - -25. Let l = -19 - b. Suppose 0 = 3h - 0t - lt + 10, -6 = 4h - 3t. Solve -a - a = h for a. 0 Suppose 0 = -5h + 66 + 84. Suppose 2n - 7n = -h. Suppose -2g = -4g + n. Solve -gb + 15 = 3 for b. 4 Let r = -780 + 789. Solve r = 2b + 7 for b. 1 Suppose 4i - 4 - 12 = 0, -3u + 29 = 5*i.	{ "pile_set_name": "DM Mathematics" }
(-6)/(-45)m. Let h = b + 35. Does 28 divide h? False Let i = 3902 + -3302. Is 3 a factor of i? True Suppose 288b = 293b - 65. Suppose -894 = -16u + bu. Does 4 divide u? False Let p(q) = q*3 - 7q*2 + 9q + 2988. Is p(0) a multiple of 9? True Let l be -1 + 2 - (2 - -93). Let i(y) = y*2 + 53y + 528. Let n be i(-20). Let b = l - n. Does 3 divide b? False Is 9 a factor of 2870/(-3)((-49)/14 - 10)? True Suppose -6j + 19j - 197296 = -9j. Is 59 a factor of j? True Suppose 0 = -q + 214 - 166. Suppose -4z - q = -180. Is z a multiple of 10? False Suppose -45704 = -10k + 256576 + 169620. Is k a multiple of 130? True Suppose -5l + 5757 = 2b, -b + 11589 = 3b - 5l. Does 20 divide b? False Let a(s) = -4s3 - s2 - 4s - 4. Let b be a(-1). Suppose 2c - h + 6h - 1041 = 0, -bh + 2574 = 5c. Does 19 divide c? True Let q(f) = 4484f - 4460. Is 76 a factor of q(7)? False Let l = -12684 + 19412. Is 58 a factor of l? True Let f(u) be the first derivative of -u4/4 + 4u*3/3 + 7u*2 - 10u + 16. Is 7 a factor of f(5)? True Suppose -2k - 2i = -14, 0 = 2i + 1 - 9. Suppose g = -2m - 11 - 0, 5m = -kg - 31. Does 27 divide ((-36)/(-10))/((14/(-60))/g)? True Is 768/(-160)(-400)/12 a multiple of 3? False Suppose -2l - 20 = -26. Suppose -lw + 3b = 7b + 207, -2b = 2w + 136. Let q = w + 219. Is 22 a factor of q? True Let n be 15/(5/(25/3)). Let o(k) = -2k*2 + 51k + 9. Is 5 a factor of o(n)? False Let o = -248 - -257. Suppose of - 2020 = 5558. Is 74 a factor of f? False Suppose 12n - 25n = -21190. Let v = n - 963. Is 29 a factor of v? True Let l = 3 - 1. Let w(g) = g3 + 28g*2 - 27g + 63. Let a be w(-29). Suppose -au - b = -151, 5b - 33 = -u + lb. Is 14 a factor of u? False Is (-2)/(-25) + 291552/600 - 8 a multiple of 8? False Suppose -31 + 151 = 5c. Let n be (-80)/c + 4/(-6). Is (-6)/(-27) - n/36826 a multiple of 23? True Let u be -215/6 + 8 + 564. Let y = 1548 - u. Does 43 divide y? False Let s = 1068 - -948. Is s a multiple of 96? True Is 14 + (2786 - (-13 - -1)) a multiple of 74? True Suppose 10w - 1946 - 5234 = 0. Let s = w + -376. Is s a multiple of 19? True Is (0 - -98)40015/302 a multiple of 53? True Suppose 5n - 5w + w = 1943, 3n - w - 1163 = 0. Let x = 545 - n. Is 20 a factor of x? False Let p(h) = h3 + 22h*2 + 29h + 608. Is p(-16) a multiple of 24? True Let c be 507/27 - (-2)/9. Let i = 14 - c. Is 9 a factor of (i - -7)(-27)/(-6)? True Does 79 divide (-29682)/(-2) - (-96 - -85)? True Suppose 23 = 3s + 5i, 0 = -0i + 2i - 2. Let f be 30/4s(-92)/(-36). Suppose -f - 184 = -u. Is 29 a factor of u? False Let o(l) = 42l*2 - 18l - 52. Is o(-12) a multiple of 96? False Does 63 divide 40/30 - 828351/(-27)? True Suppose 89 = -b - 11m + 7m, -2m - 356 = 4b. Let r = 280 - b. Is 41 a factor of r? True Let f(c) = 36c2 - 8c. Suppose q = s + 5, -s + 13 = -0s + 5q. Let j be 4/(-1) - (-1 - s/(-2)). Does 25 divide f(j)? False Is (-58368)/(-30) - 14/(-35) a multiple of 15? False Suppose 2b = 25u - 21u + 1836, -4u + 8 = 0. Suppose b = n + 4i, 3n + 5i - 2545 = 200. Is n a multiple of 10? True Let j be 142 + -1 - (3 + -3). Let i(b) = -49b + 31. Let n be i(-2). Let w = j - n. Is w a multiple of 3? True Let a(f) = 2f2 - 2f + 3. Let n be a(1). Suppose 0 = -x - nd + 13, 2x + 2d + 7 = 7d. Is 1/(x/(-2 + 150)) a multiple of 13? False Let v(x) = -274x + 1755. Is v(-25) a multiple of 15? False Suppose 3k + 17384 = o, 3o - 5k - 22235 = 29901. Is o a multiple of 80? False Let k(m) = 2m3 + 9m*2 - 5m + 3. Let j be k(-5). Suppose -6d + 30 = 18. Suppose i - jv = 25, -di + 5v = -0i - 52. Is i a multiple of 13? False Suppose g = 2b - 36, 2b + b - 4g - 44 = 0. Let x = -7687 - -10855. Suppose -bm = -4m - x. Does 18 divide m? True Let q = 6357 - 6524. Suppose j = 4j + 213. Let y = j - q. Is y a multiple of 26? False Let w = 17 - 12. Let d be (96 + 1 - -3)/(w + -3). Suppose 128 = 2n + 4i, -5i + d = n - 17. Is 31 a factor of n? True Suppose 4l + 4966 - 5782 = 0. Is 9 a factor of l? False Does 44 divide (-1 - -155(7 + -6))108/21? True Let w(y) = 17y*2 - 5y - 4. Let z be w(4). Suppose 241f = zf - 3388. Does 15 divide f? False Suppose 0 = -3j - 5c + 71, 4j + 3c = -2c + 98. Suppose -ja + 27339 = 6198. Is a a multiple of 29? True Let c(f) = -270f - 245. Let p be c(-13). Let b = p - 2138. Does 23 divide b? True Let o = -5 - -7. Suppose 3u = -oq + 62, 3u = -4q + 3q + 31. Suppose 206 = 5t + q. Is t a multiple of 7? True Suppose 14 + 2 = 4t. Suppose -11 + 79 = tg. Let u = g - -22. Does 13 divide u? True Suppose -5q - 6912 = 5788. Let o = -1483 - q. Is 14 a factor of o? False Suppose 0k + 5312 = 4k + 2i, -5k - i + 6634 = 0. Is k a multiple of 39? True Let l = 15391 - 12163. Does 34 divide l? False Let s be (-2)/(-4 - (-4)/((-8)/(-10))). Is 9 a factor of (s + (-43 - -8))-2? False Suppose 4a - 15 - 13 = 0. Let u = -1 + a. Suppose -uy = y - 1008. Is y a multiple of 36? True Let d be (2 - 2 - -2)(-6)/(-4). Suppose -dr + 4r = 0. Suppose r = -5k + 7 + 48. Is k even? False Let x be 32178/(-10) - (-5)/(-375)15. Is (-4 - x/7) + 10/35 a multiple of 8? True Let d(p) = 3p2 + 2p + 5. Let f be d(0). Suppose -4t - 19 = -5a, 21 = fa - 2t + 4. Suppose 4q = -3v - 85 + 740, -v = a. Does 11 divide q? False Is (-20)/(-25)-7(-153 - 2) a multiple of 36? False Suppose -3n - 2q + 8825 = -985, -5n = -q - 16337. Is 57 a factor of n? False Suppose 128z = 123z + 30. Let h(r) = 72 - 3r*2 + 110 + z + r. Is 40 a factor of h(0)? False Suppose 280a - 276a = 40. Suppose -4m - 3h + 67 = 0, -4h - 9 = m - 42. Let w = m - a. Is w even? False Let x(p) = p*2 - 31p + 49. Let v be ((-384)/(-30))/(1 + 3/(-5)). Does 27 divide x(v)? True Let v be 2 + -5 - 8942/4. Let r(u) = 5u*2 + 4u + 2. Let o be r(-12). Let d = v + o. Is 14 a factor of d? True Let b(i) = -4i3 - i2 + 8i + 4. Let t be b(4). Let j = 124 - t. Is 15 a factor of j? True Suppose 0 = 14r - 21r + 175. Suppose -rh + 16h + 3123 = 0. Is 4 a factor of h? False Let j(w) = -166w3 + w2 - 2w - 2. Let a be j(-1). Let v = 303 - a. Is 34 a factor of v? True Let h be (-12)/(-36) - (-1)/(-3). Suppose 0 = 4v - 8, hv - v = 2s - 1140. Is 34 a factor of s? False Let i(k) = k3 + 3k*2 + 2k - 2. Suppose y - 8m + 9m - 5 = 0, 3y + 4m = 17. Does 4 divide i(y)? False Let z be (-118)/(-8)(1 - -3). Let o = z - 83. Let s(k) = k + 30. Is s(o) a multiple of 3? True Let m(i) = 43i - 36. Let p(o) = -6o - 38. Let l be p(-7). Is m(l) a multiple of 9? False Let p(h) = -13h + 11. Let r(z) = 25z - 20. Let y(d) = -11p(d) - 6r(d). Is 2 a factor of y(-1)? True Let a(y) be the second derivative of -y3 - 39y*2/2 + 16y + 3. Let q(p) = 3p + 14. Let l be q(-11). Is 24 a factor of a(l)? False Let y = 34436 - 7085. Is 46 a factor of y? False Let p(x) = -2x*2 - 88x - 260. Is p(-34) a multiple of 10? True Is 52 a factor of (12 + 610/(-50))-31165? False Suppose 26 = b - 5u + u, 2b + u = 7. Suppose -3m + 0 = b. Does 4 divide -2(m + 10/(-4))? False Suppose 28v = 3064 - 572. Suppose 3a + 5o + 0o = -104, -3a = -o + 116. Let u = a + v. Is 6 a factor of u? False Suppose -167c = -170c + 567. Let p = c + 97. Does 11 divide p? True Let p(d) = 23d3 - d2 + 2d + 2. Let u be p(-1). Does 16 divide 8((-834)/u - 4)? False Is 4/(-2) - (-476)/(-42)-204 a multiple of 88? False Let u = 41653 + -33942. Does 14 divide u? False Suppose -2v - 3i + 29 = 2i, 3v + 5i - 46 = 0. Suppose -6 = 20f - vf. Is 28 a factor of f/8(0 - 412)? False Let u(d) = d*2 + 2d. Let o(z) = -9z2 - 32z + 161. Let h(a) = -o(a) + u(a). Is h(5) a multiple of 15? False Let y(c) = 311c2 + 65c - 101. Is 19 a factor of y(5)? True Let z = 329 - 349. Is -5(-4)/z5 + 43 a multiple of 38? True Let t(q) = -181q3 + 261q + 531. Is 4 a factor of t(-2)? False Let m be (-15)/((-41)/(-205)). Let p(s) = s3 + 26s*2 + 18s - 64. Is 12 a factor of p(m)? False Let a be 1/(-11) - 15276/33. Let k = 533 + a. Does 9 divide k? False Suppose 86t - 83t - 5847 = -5l, 0 = 2l - 6. Is 12 a factor of t? True Suppose -5p + 318 = 58. Let j = 3 + p. Suppose -7k + j = -2k. Does 11 divide k? True Suppose -3n + 14112 = 3l, -4l + 11594 = n - 7228. Is 26	{ "pile_set_name": "DM Mathematics" }
he next term in 28, 53, 78, 103, 128, 153? 178 What is the next term in -54, -76, -66, -30, 26, 96? 174 What comes next: -75, -163, -309, -513? -775 What is the next term in -767, -766, -765? -764 What is next in 110, 108, 106, 104? 102 What comes next: -38, -180, -540, -1226, -2346? -4008 What is the next term in -49, -184, -513, -1132, -2137, -3624? -5689 What is the next term in 24, 205, 696, 1653, 3232? 5589 What comes next: -79, -292, -647, -1144, -1783, -2564, -3487? -4552 What is the next term in 81, 330, 747, 1332, 2085? 3006 What comes next: 29, 44, 71, 110, 161, 224? 299 What is next in 12, 31, 50, 69, 88? 107 What is next in 81, 78, 77, 78, 81, 86? 93 What comes next: -3, 24, 97, 240, 477? 832 What is next in -20, -67, -146, -257, -400? -575 What comes next: 295, 581, 867, 1153? 1439 What comes next: 62, 35, -52, -229, -526? -973 What is next in -19, -28, -35, -34, -19, 16, 77, 170? 301 What is next in 10077, 10079, 10081, 10083, 10085, 10087? 10089 What is the next term in 433, 449, 485, 547, 641, 773? 949 What is next in 418, 373, 256, 31, -338, -887? -1652 What comes next: -29, -46, -63? -80 What comes next: 5, 29, 67, 119, 185, 265, 359? 467 What is the next term in -116, -245, -388, -551, -740, -961? -1220 What is next in -9, -14, -39, -96, -197, -354, -579, -884? -1281 What is next in -365, -377, -413, -485, -605, -785, -1037? -1373 What comes next: 40, 27, 6, -23, -60? -105 What comes next: 31, -42, -237, -614, -1233, -2154? -3437 What is next in 6957, 6955, 6953, 6951, 6949? 6947 What comes next: 3212, 3209, 3206, 3203, 3200? 3197 What is the next term in -13, -24, -29, -28, -21? -8 What is the next term in 16, 21, 38, 73, 132? 221 What is the next term in -94, -96, -110, -142, -198? -284 What is the next term in -485, -490, -497, -506, -517? -530 What is the next term in -2726, -5453, -8180? -10907 What is the next term in -254, -266, -274, -278, -278? -274 What is next in 96, 64, 54, 78, 148, 276? 474 What comes next: -42, -58, -98, -174, -298? -482 What is next in 69, 145, 223, 303? 385 What is next in -76, -73, -70, -67? -64 What is next in -10, -28, -58, -100, -154, -220, -298? -388 What is next in 17, 19, 21, 23, 25, 27? 29 What is next in -22, -38, -68, -112, -170? -242 What comes next: 316, 618, 908, 1180, 1428, 1646, 1828, 1968? 2060 What comes next: -132, -555, -1262, -2253, -3528, -5087, -6930? -9057 What is next in -475, -473, -471, -469? -467 What is next in 4937, 4932, 4925, 4916, 4905? 4892 What comes next: 1149, 1133, 1117? 1101 What is the next term in 5068, 5063, 5058, 5053, 5048? 5043 What is the next term in 17, 11, -55, -211, -487, -913, -1519? -2335 What is the next term in -2119, -2120, -2121, -2122, -2123, -2124? -2125 What comes next: 2576, 2577, 2578, 2579, 2580, 2581? 2582 What comes next: 67, 148, 239, 340, 451? 572 What comes next: -29, -36, -43, -50, -57? -64 What comes next: -43, -60, -91, -142, -219, -328, -475, -666? -907 What is the next term in 0, 55, 218, 549, 1108? 1955 What is the next term in 1566, 3124, 4682? 6240 What comes next: -3066, -3068, -3070, -3072? -3074 What is next in -11, -34, -57? -80 What comes next: 47, 55, 85, 149, 259, 427, 665, 985? 1399 What is the next term in -2718, -5436, -8154, -10872, -13590? -16308 What comes next: -1044, -1033, -1022, -1011, -1000? -989 What is the next term in -3001, -3002, -3005, -3010, -3017, -3026? -3037 What is the next term in -148, -589, -1324, -2353? -3676 What comes next: -739, -737, -735? -733 What is next in 188, 173, 152, 125, 92, 53? 8 What is next in -5, -26, -61, -116, -197, -310? -461 What is next in -141, -161, -207, -285, -401, -561? -771 What is the next term in 16, 39, 62, 85? 108 What is the next term in -189, -176, -151, -108, -41? 56 What is the next term in 173, 173, 169, 161, 149? 133 What comes next: 7133, 7132, 7131, 7130, 7129, 7128? 7127 What comes next: -33, -58, -65, -36, 47? 202 What comes next: -64, -68, -72, -76, -80, -84? -88 What comes next: 445, 420, 395, 370? 345 What is the next term in 38, 72, 106, 140? 174 What is the next term in -6213, -6221, -6241, -6279, -6341? -6433 What is the next term in -23, -57, -79, -83, -63? -13 What comes next: -18, 48, 114, 180? 246 What is the next term in 506, 548, 590, 632, 674, 716? 758 What comes next: -110, -113, -118, -125? -134 What is the next term in -95, -94, -83, -56, -7, 70? 181 What is the next term in 322, 606, 890, 1174, 1458? 1742 What comes next: -38, -48, -80, -146, -258, -428? -668 What is the next term in -254, -507, -760? -1013 What is the next term in -7, -2, 23, 80, 181? 338 What is next in 179, 154, 129, 104? 79 What is the next term in -64, -66, -68, -70, -72, -74? -76 What is next in 174, 347, 508, 651, 770, 859, 912, 923? 886 What comes next: 25, 49, 77, 115, 169, 245, 349, 487? 665 What comes next: 523, 523, 525, 529, 535? 543 What is next in -172, -173, -174, -175? -176 What is the next term in -110, -113, -118, -125? -134 What is the next term in 46, 88, 132, 178, 226, 276? 328 What is the next term in 28, 13, -2? -17 What is next in -7481, -7477, -7471, -7463, -7453, -7441? -7427 What is the next term in -7, -5, -3? -1 What is next in 26, 75, 200, 437, 822? 1391 What comes next: 208, 431, 654, 877, 1100? 1323 What comes next: -11, -11, -19, -41, -83? -151 What is the next term in -88, -176, -264, -352, -440? -528 What is the next term in -83, -375, -867, -1565, -2475, -3603, -4955? -6537 What comes next: 120, 617, 1438, 2577, 4028, 5785, 7842? 10193 What is the next term in -325, -324, -323, -322, -321? -320 What is next in -3, 32, 121, 288, 557, 952? 1497 What is the next term in 7, -3, -31, -83, -165, -283? -443 What is next in 29, 46, 63, 80, 97? 114 What is next in 1, 0, -5, -14, -27, -44? -65 What is the next term in 175, 179, 183? 187 What is next in 664, 1322, 1980, 2638, 3296, 3954? 4612 What is next in 270, 366, 452, 522, 570, 590, 576, 522? 422 What comes next: 2815, 5634, 8453, 11272, 14091? 16910 What is next in 10881, 10874, 10855, 10818, 10757, 10666? 10539 What is next in -33, -28, -11, 24, 83, 172, 297, 464? 679 What is next in 179, 173, 157, 125, 71, -11, -127? -283 What is the next term in 24, 18, 2, -30, -84, -166, -282, -438? -640 What comes next: 80, 179, 292, 425, 584, 775, 1004, 1277? 1600 What is next in 31, 47, 67, 91? 119 What comes next: -245, -235, -225? -215 What is next in 21, 26, 35, 48, 65, 86? 111 What is the next term in 607, 610, 615, 622, 631? 642 What is next in -12, -19, -26, -33, -40, -47? -54 What is the next term in 1870, 1867, 1862, 1855, 1846? 1835 What comes next: -699, -2777, -6239, -11085? -17315 What is the next term in 114, 127, 158, 213, 298, 419, 582? 793 What comes next: -58, -97, -130, -163, -202? -253 What is the next term in 92, 171, 274, 413, 600, 847, 1166, 1569? 2068 What is next in 2260, 4521, 6782, 9043, 11304, 13565? 15826 What is the next term in -188, -741, -1662, -2951? -4608 What is the next term in 14651, 14649, 14637, 14609, 14559? 14481 What comes next: 6, 37, 104, 213, 370? 581 What is the next term in -1, -10, -33, -76, -145, -246, -385, -568? -801 What is next in -5425, -5423, -5419, -5413, -5405, -5395, -5383? -5369 What comes next: -91, -358, -831, -1534, -2491? -3726 What is next in 368, 354, 340? 326 What is the next term in -1661, -3328, -4999, -6674? -8353 What comes next: -2535, -5089, -7645, -10203? -12763 What comes next: -148, -279, -408, -535, -660, -783? -904 What is the next term in -20, 5, 40, 85, 140, 205? 280 What is next in -8051, -8049, -8047? -8045 What is next in 13, 19, 25, 31, 37? 43 What is the next term in 11615, 11613, 11611? 11609 What is the next term in -398, -796, -1192, -1586? -1978 What comes next: -639, -638, -637? -636 What comes next: 11881, 11884, 11887, 11890? 11893 What is next in -2, -12, -30, -56, -90, -132, -182? -240 What comes next: 101, 35, -61, -193, -367, -589, -865, -1201? -1603 What is the next term in -1, -13, -25, -37? -49 What is the next term in 208, 424, 640, 856? 1072 What comes next: -97, -192, -287, -382, -477? -572 What is next in -197, -287, -375, -461, -545, -627, -707? -785 What is the next term in -12, -25, -50, -93, -160, -257, -390, -565? -788 What is the next term in -20, -14, -2, 16, 40, 70, 106? 148 Wha	{ "pile_set_name": "DM Mathematics" }
t common multiple of 6246 and 28454000? 256086000 What is the lowest common multiple of 323257572 and 14? 2262803004 What is the common denominator of 69/34420 and 1/25594712? 127973560 Find the common denominator of -37/2624 and 1/3303944. 26431552 Calculate the lowest common multiple of 32648 and 2716. 3166856 What is the common denominator of 43/4942875 and -163/61291650? 306458250 Calculate the smallest common multiple of 10605 and 37238397. 186191985 Calculate the common denominator of 61/125523200 and 131/880. 125523200 Calculate the common denominator of -26/29589 and 139/656448. 6474546624 What is the lowest common multiple of 8470360 and 166? 703039880 Calculate the common denominator of 19/161136 and -79/41232. 138415824 Calculate the least common multiple of 6392056 and 792. 57528504 What is the least common multiple of 3975 and 2443650? 129513450 Calculate the smallest common multiple of 8060 and 3680196. 18400980 What is the least common multiple of 3091696 and 9? 27825264 Calculate the lowest common multiple of 376 and 316216. 316216 Calculate the lowest common multiple of 677019 and 700. 67701900 What is the lowest common multiple of 3068590 and 109221? 64440390 What is the common denominator of 23/162240813 and 97/89730? 1622408130 Calculate the common denominator of -31/31490 and -64/2912825. 5825650 What is the common denominator of -131/28264080 and -15/8? 28264080 What is the smallest common multiple of 4853772 and 90846? 33976404 Find the common denominator of 97/45992 and 11/137976. 137976 Calculate the smallest common multiple of 6 and 32773606. 98320818 Calculate the smallest common multiple of 4816512 and 13560. 24082560 Calculate the common denominator of 113/7761390 and -101/665262. 23284170 Calculate the smallest common multiple of 156880 and 3520. 6902720 What is the least common multiple of 428536 and 130424? 2999752 What is the common denominator of 83/202810320 and -37/48? 202810320 Find the common denominator of -45/128 and 61/3993360. 31946880 Calculate the least common multiple of 533 and 8657363. 354951883 Calculate the least common multiple of 2400 and 204352. 15326400 Find the common denominator of -133/5195010 and 25/5714511. 57145110 What is the common denominator of -81/52114 and -103/540958? 38408018 What is the smallest common multiple of 50768646 and 84614410? 253843230 Calculate the common denominator of -29/6663 and -55/2645211. 2645211 Calculate the smallest common multiple of 473121 and 6511428. 384174252 Calculate the common denominator of -123/236270 and -32/2480835. 4961670 Calculate the common denominator of -24/1103009 and 119/12. 13236108 Calculate the lowest common multiple of 25030536 and 1632. 1702076448 Find the common denominator of -13/42 and -39/324146. 6807066 Find the common denominator of 1/44394 and -57/794864. 16692144 Find the common denominator of 17/209430252 and 17/46540056. 418860504 Calculate the least common multiple of 69201 and 126819. 29548827 Calculate the least common multiple of 3084 and 571244. 440429124 What is the common denominator of -52/21008049 and 145/23898? 294112686 What is the common denominator of 16/9 and 79/13064528? 117580752 Calculate the common denominator of -41/578016 and 131/2013984. 449118432 Calculate the least common multiple of 11221 and 1202565. 1927711695 Find the common denominator of 21/10336 and -63/517106. 157200224 What is the smallest common multiple of 196 and 698916? 34246884 Calculate the smallest common multiple of 3954216 and 1129776. 7908432 Calculate the common denominator of 38/3151 and -16/339. 1068189 Calculate the lowest common multiple of 3211 and 34151. 8435297 Calculate the least common multiple of 45897369 and 19. 45897369 Find the common denominator of -59/337088 and -91/842720. 1685440 Calculate the least common multiple of 12376 and 91896. 20309016 Calculate the common denominator of 149/9936 and -109/132. 109296 What is the common denominator of 53/274 and 37/103715? 28417910 Calculate the smallest common multiple of 17045 and 40609. 692180405 What is the lowest common multiple of 158268 and 2988? 39408732 Calculate the common denominator of -37/268 and 11/9. 2412 Calculate the common denominator of 89/26850464 and 95/72416. 1960083872 What is the least common multiple of 9647261 and 29683880? 385890440 What is the common denominator of 131/3028560 and -187/1135710? 9085680 Calculate the common denominator of -3/146 and -37/11325804. 11325804 What is the smallest common multiple of 1804231 and 149110? 18042310 What is the lowest common multiple of 35 and 195377714? 976888570 What is the least common multiple of 2499 and 16076424? 112534968 What is the lowest common multiple of 10712 and 688246? 2752984 Find the common denominator of -55/25184 and 13/232952. 931808 Calculate the common denominator of 31/15676770 and 37/15676770. 15676770 Find the common denominator of 97/29862690 and 19/25268430. 328489590 Calculate the least common multiple of 72625157 and 22. 145250314 Calculate the least common multiple of 11775240 and 900. 58876200 What is the common denominator of 19/1755750 and -56/375? 1755750 Calculate the lowest common multiple of 10948200 and 565400. 120430200 Calculate the common denominator of 47/8 and -71/657978. 2631912 What is the common denominator of -17/4328 and -89/6138? 13282632 What is the common denominator of -22/15171 and 31/8271? 41826447 Calculate the lowest common multiple of 196881 and 137547. 10040931 Calculate the smallest common multiple of 8230840 and 20820. 24692520 Find the common denominator of 115/10734 and -79/15059802. 15059802 Calculate the smallest common multiple of 1936250 and 774500. 3872500 Calculate the least common multiple of 7957 and 2746625. 299382125 Calculate the lowest common multiple of 101034791 and 1122. 606208746 Calculate the lowest common multiple of 2188 and 3670784. 2007918848 What is the least common multiple of 302832 and 2376? 3331152 What is the lowest common multiple of 1651750 and 1684785? 84239250 What is the lowest common multiple of 14415759 and 1601751? 14415759 What is the lowest common multiple of 1881240 and 17568? 22574880 Calculate the common denominator of 107/408 and 11/4067165. 97611960 Calculate the common denominator of 103/487230 and -41/698214. 380526630 Find the common denominator of -4/9136205 and 21/7449521. 484218865 Calculate the common denominator of 59/286160 and -143/131400. 12877200 Calculate the common denominator of -57/2272 and 47/325551472. 651102944 Calculate the common denominator of -25/1842306 and -47/2. 1842306 What is the common denominator of 169/1035090 and -64/193347? 102473910 Calculate the smallest common multiple of 78255287 and 8. 626042296 What is the least common multiple of 595140 and 820225? 127955100 What is the lowest common multiple of 4462302 and 514881? 13386906 What is the least common multiple of 18936 and 18143055? 145144440 Calculate the least common multiple of 4244060 and 100. 21220300 Calculate the smallest common multiple of 11159316 and 66955896. 66955896 Find the common denominator of -111/39514330 and 31/6. 118542990 Find the common denominator of 41/38336 and 9/19168. 38336 What is the smallest common multiple of 2003434 and 3819? 114195738 Calculate the common denominator of 3/29344 and -13/54336. 49826112 Calculate the smallest common multiple of 3290895 and 57042180. 171126540 Calculate the common denominator of 109/1816914 and -3/44. 3633828 What is the common denominator of 103/709328 and -1/499004? 85828688 What is the common denominator of -161/6750 and 121/736700? 99454500 Calculate the smallest common multiple of 62748 and 13093416. 39280248 Calculate the least common multiple of 231895 and 45. 2087055 Calculate the common denominator of -49/76857427 and -13/760024. 614859416 What is the common denominator of 149/14712 and -61/1504302? 6017208 Calculate the least common multiple of 6467616 and 22032. 58208544 What is the smallest common multiple of 3138 and 11646687? 23293374 Calculate the common denominator of 47/8580 and -133/7260. 94380 What is the smallest common multiple of 588858 and 294? 28854042 Calculate the lowest common multiple of 1573648 and 23364. 155791152 Calcu	{ "pile_set_name": "DM Mathematics" }
mainder when 497 is divided by 101. 93 Calculate the remainder when 853 is divided by 121. 6 Calculate the remainder when 103 is divided by 15. 13 What is the remainder when 19284 is divided by 133? 132 Calculate the remainder when 1287 is divided by 215. 212 Calculate the remainder when 169 is divided by 7. 1 Calculate the remainder when 247 is divided by 39. 13 What is the remainder when 895 is divided by 182? 167 Calculate the remainder when 741 is divided by 27. 12 What is the remainder when 418 is divided by 17? 10 Calculate the remainder when 127 is divided by 5. 2 Calculate the remainder when 317 is divided by 113. 91 Calculate the remainder when 603 is divided by 34. 25 Calculate the remainder when 3134 is divided by 56. 54 What is the remainder when 1104 is divided by 221? 220 What is the remainder when 17349 is divided by 18? 15 What is the remainder when 288 is divided by 42? 36 What is the remainder when 144 is divided by 87? 57 What is the remainder when 220 is divided by 48? 28 Calculate the remainder when 335 is divided by 23. 13 What is the remainder when 159 is divided by 19? 7 What is the remainder when 873 is divided by 44? 37 What is the remainder when 110 is divided by 13? 6 What is the remainder when 861 is divided by 286? 3 What is the remainder when 32 is divided by 5? 2 What is the remainder when 20 is divided by 6? 2 What is the remainder when 717 is divided by 9? 6 What is the remainder when 333 is divided by 51? 27 What is the remainder when 542 is divided by 16? 14 What is the remainder when 74 is divided by 11? 8 Calculate the remainder when 1130 is divided by 14. 10 Calculate the remainder when 129 is divided by 26. 25 What is the remainder when 637 is divided by 137? 89 Calculate the remainder when 29 is divided by 6. 5 What is the remainder when 27002 is divided by 157? 155 What is the remainder when 1693 is divided by 100? 93 Calculate the remainder when 18 is divided by 11. 7 Calculate the remainder when 1298 is divided by 320. 18 What is the remainder when 18 is divided by 2? 0 Calculate the remainder when 987 is divided by 19. 18 Calculate the remainder when 842 is divided by 11. 6 What is the remainder when 3359 is divided by 558? 11 Calculate the remainder when 28482 is divided by 135. 132 Calculate the remainder when 2089 is divided by 17. 15 What is the remainder when 239 is divided by 6? 5 Calculate the remainder when 2565 is divided by 33. 24 What is the remainder when 3150 is divided by 16? 14 What is the remainder when 2811 is divided by 10? 1 What is the remainder when 214 is divided by 7? 4 Calculate the remainder when 111 is divided by 23. 19 What is the remainder when 94 is divided by 47? 0 What is the remainder when 134 is divided by 17? 15 What is the remainder when 1788 is divided by 180? 168 Calculate the remainder when 111 is divided by 11. 1 Calculate the remainder when 337 is divided by 94. 55 What is the remainder when 1091 is divided by 272? 3 What is the remainder when 487 is divided by 61? 60 Calculate the remainder when 95 is divided by 52. 43 Calculate the remainder when 656 is divided by 22. 18 Calculate the remainder when 83 is divided by 21. 20 What is the remainder when 560 is divided by 141? 137 What is the remainder when 192 is divided by 15? 12 Calculate the remainder when 541 is divided by 47. 24 Calculate the remainder when 60 is divided by 24. 12 Calculate the remainder when 172 is divided by 57. 1 What is the remainder when 1580 is divided by 88? 84 Calculate the remainder when 119 is divided by 47. 25 What is the remainder when 590 is divided by 87? 68 What is the remainder when 84 is divided by 13? 6 What is the remainder when 7500 is divided by 31? 29 What is the remainder when 21 is divided by 12? 9 What is the remainder when 74 is divided by 9? 2 Calculate the remainder when 165 is divided by 46. 27 What is the remainder when 467 is divided by 207? 53 What is the remainder when 419 is divided by 9? 5 Calculate the remainder when 69 is divided by 56. 13 What is the remainder when 3521 is divided by 6? 5 What is the remainder when 348 is divided by 36? 24 Calculate the remainder when 281 is divided by 43. 23 Calculate the remainder when 2838 is divided by 284. 282 What is the remainder when 399 is divided by 50? 49 Calculate the remainder when 5699 is divided by 163. 157 Calculate the remainder when 169 is divided by 62. 45 Calculate the remainder when 75 is divided by 20. 15 Calculate the remainder when 245 is divided by 19. 17 What is the remainder when 223 is divided by 17? 2 What is the remainder when 10897 is divided by 50? 47 Calculate the remainder when 135 is divided by 45. 0 Calculate the remainder when 347 is divided by 109. 20 Calculate the remainder when 4411 is divided by 1102. 3 Calculate the remainder when 48 is divided by 4. 0 Calculate the remainder when 93 is divided by 20. 13 What is the remainder when 3176 is divided by 53? 49 Calculate the remainder when 12991 is divided by 71. 69 What is the remainder when 843 is divided by 94? 91 Calculate the remainder when 5599 is divided by 80. 79 Calculate the remainder when 1041 is divided by 87. 84 Calculate the remainder when 346 is divided by 89. 79 Calculate the remainder when 70 is divided by 3. 1 What is the remainder when 198 is divided by 69? 60 What is the remainder when 256 is divided by 10? 6 What is the remainder when 111 is divided by 106? 5 What is the remainder when 213 is divided by 184? 29 What is the remainder when 167 is divided by 5? 2 Calculate the remainder when 1143 is divided by 143. 142 Calculate the remainder when 607 is divided by 47. 43 Calculate the remainder when 472 is divided by 76. 16 What is the remainder when 1284 is divided by 39? 36 What is the remainder when 662 is divided by 9? 5 Calculate the remainder when 74 is divided by 15. 14 Calculate the remainder when 732 is divided by 351. 30 Calculate the remainder when 479 is divided by 15. 14 Calculate the remainder when 567 is divided by 41. 34 Calculate the remainder when 257 is divided by 90. 77 Calculate the remainder when 505 is divided by 23. 22 Calculate the remainder when 167 is divided by 14. 13 What is the remainder when 1416 is divided by 95? 86 Calculate the remainder when 49 is divided by 5. 4 What is the remainder when 403 is divided by 14? 11 What is the remainder when 5082 is divided by 221? 220 What is the remainder when 325 is divided by 83? 76 What is the remainder when 1386 is divided by 139? 135 What is the remainder when 2949 is divided by 164? 161 Calculate the remainder when 111 is divided by 33. 12 Calculate the remainder when 414 is divided by 8. 6 Calculate the remainder when 6340 is divided by 14. 12 Calculate the remainder when 285 is divided by 248. 37 Calculate the remainder when 10 is divided by 2. 0 What is the remainder when 480 is divided by 466? 14 What is the remainder when 12043 is divided by 317? 314 What is the remainder when 7 is divided by 7? 0 What is the remainder when 2998 is divided by 40? 38 What is the remainder when 1653 is divided by 32? 21 What is the remainder when 2050 is divided by 76? 74 Calculate the remainder when 934 is divided by 27. 16 Calculate the remainder when 1149 is divided by 9. 6 Calculate the remainder when 191 is divided by 47. 3 What is the remainder when 588 is divided by 71? 20 What is the remainder when 39447 is divided by 15? 12 What is the remainder when 119 is divided by 71? 48 What is the remainder when 15 is divided by 12? 3 Calculate the remainder when 5003 is divided by 13. 11 What is the remainder when 6406 is divided by 13? 10 What is the remainder when 75 is divided by 42? 33 Calculate the remainder when 260 is divided by 77. 29 Calculate the remainder when 230 is divided by 47. 42 What is the remainder when 192 is divided by 13? 10 What is the remainder when 651 is divided by 95? 81 Calculate the remainder when 92 is divided by 16. 12 What is the remainder when 74 is divided by 19? 17 What is the remainder when 772 is divided by 365? 42 What is the remainder when 134 is divided by 46? 42 Calculate the remainder when 1255 is divided by 311. 11 What is the remainder when 45 is divided by 36? 9 Calculate the remainder when 167 is divided	{ "pile_set_name": "DM Mathematics" }
5j + 6. Let u(q) = 3i(q) + 5l(q). Let g(w) = w. Give u(g(b)). b2 + 612b Let u(z) = 2z2 - 684z. Let f(y) = 73409y. Calculate f(u(w)). 146818w*2 - 50211756w Let g(o) = -3o. Let s(i) = -7i*2 + 24i + 3884. Let v(d) = 9d2 - 32d - 3884. Let f(z) = 4s(z) + 3v(z). What is f(g(r))? -9r2 + 3884 Let z(l) = -2l*2. Let s be -10 - (1 - (6 - -8)). Let h(q) be the second derivative of 0 + 0q*2 + 5/3q*s - 11q. Calculate z(h(u)). -200u2 Let t(a) = -2a. Let f be (-57)/(14/35 - 38/20). Let b = -35 + f. Let x(l) = -b - 10 - 28l + 13. Give t(x(o)). 56o Let g(m) = 19m + 63m*2 - 16m + 18m2 - 3m. Let w(n) = 10n. Give g(w(h)). 8100h*2 Let v(o) = -128o*2 - 1103o + 2. Let j(n) = 22n2. What is v(j(l))? -61952l*4 - 24266l*2 + 2 Let b(r) = 36r*2 + 4r. Let k(t) = 204532t. Determine b(k(m)). 1506000204864m*2 + 818128m Let j(c) be the second derivative of -23c4/6 + c2 - 1346c + 5. Let h(r) = 6r2. Calculate j(h(u)). -1656u*4 + 2 Let q(z) = -2z*2 + z - 10644. Let u(b) = 85b*2. Give q(u(h)). -14450h*4 + 85h*2 - 10644 Let h(y) = y - 5. Let t(f) = 5f - 30. Let k(n) = -6h(n) + t(n). Let l(a) = -16a. Calculate k(l(o)). 16o Let v(d) = d2. Suppose 0 = 2t - 8, 0s + 64 = 4s - 2t. Let i(a) = -2a*2 + 23 + 20 + 79 - s. Give v(i(z)). 4z*4 - 416z2 + 10816 Let h(v) be the first derivative of v2/2 + 42. Let n(q) = -23q - 24. Let t(r) = 21r + 20. Let o(p) = 5n(p) + 6t(p). Determine o(h(u)). 11u Let z(t) = 6535784t. Let k(b) = -5b2. Determine z(k(l)). -32678920l2 Let f(x) be the first derivative of -x2/2 + 1. Let t(d) = 146d - 99519 + 99518 - 146d + 3d2. Determine t(f(g)). 3g*2 - 1 Let p(w) = 2w + 4. Let h(r) = -2r2 - 12r - 24. Let z(u) = -h(u) - 6p(u). Let o(k) = 2966k. Calculate o(z(s)). 5932s2 Let y(r) = -3r + 1426. Let o(z) = 10z + 1. Give o(y(k)). -30k + 14261 Let t(s) = -64s - 28 - 3s*2 + 35 + 5s*2 - 5 - 4. Let b(p) = -2p. What is t(b(n))? 8n2 + 128n - 2 Let d(s) = 2044s. Let l(b) = -16b*2 + 116. Calculate l(d(r)). -66846976r*2 + 116 Let t(n) = -969n. Let x(o) be the second derivative of o*3/6 + o + 66. Determine t(x(p)). -969p Let q(a) = -13a2. Let p(f) be the first derivative of 34 + 303f*2 - 296f*2 + 27. Give q(p(x)). -2548x*2 Let s(f) = -517f. Let u(y) = -144072y2 - 144093y*2 + 288146y*2. Determine s(u(t)). 9823t*2 Let d(t) = 37t*2 + 9t - 7. Suppose 0 = 90p - 96p + 54. Let o(h) = 9h2 + 2h - 2. Let u(x) = po(x) - 2d(x). Let k(q) = 2q2. Calculate k(u(v)). 98v*4 - 112v2 + 32 Let t(o) = -o3 + 8o2 + 5. Let f be t(8). Let l(u) = fu + 12u + 6u - 22u. Let j(c) = 8c. Let x(z) = -2z. Let d(b) = 2j(b) + 9x(b). Give l(d(y)). -2y Let x(u) = -u*2 - 3u. Let g(y) = -y. Let d = -65 + 68. Let n(w) = dg(w) - x(w). Let j(m) be the second derivative of -m3/2 + 4m. Calculate j(n(s)). -3s2 Let h(y) = 129 - 15 - 3y - 5y - 4y + 16. Let b(g) = 5g - 65. Let z(d) = 5b(d) + 2h(d). Let k(v) = v2. What is k(z(n))? n2 - 130n + 4225 Let q(g) = -15g2 + 36g - 7. Let n(f) = 25f2 - 62f + 12. Let p(w) = 7n(w) + 12q(w). Let t(i) = 3i + 5. Give t(p(c)). -15c*2 - 6c + 5 Let u(x) = x. Let a(m) be the second derivative of -m*6/240 - 17m*4/12 + 65m. Let t(g) be the third derivative of a(g). Determine u(t(h)). -3h Let r(b) be the first derivative of -2b*3 - 967. Let c(o) = 14o*2 + 3o. What is c(r(h))? 504h4 - 18h*2 Let l(c) = 30c. Let g(m) be the third derivative of 0m4 - 1/15m*5 + 0m + 0m3 + 6 - 6m*2. Calculate l(g(k)). -120k2 Let j(w) = -w2. Let b(l) be the third derivative of 57l4 - 691l*2. Give b(j(a)). -1368a*2 Let c(q) = 3q - 2. Let b(x) = -7x + 5. Let s be 41/(-2) + 7. Suppose 3u = -s - 10. Let h(n) = uc(n) - 2b(n). Let f(j) = -4j. Give f(h(i)). 4i Let w(o) be the third derivative of -o5/15 + o2. Let u(h) = 467h*2 + 6h - 19. Let k be u(3). Let p(x) = 8x2 + k - 4202. Determine w(p(l)). -256l*4 Let s(j) = 22j. Let p(n) = -8 - 9 + 7n - 23 - 6n*2 + 33. Let o(i) = 4i*2 - 6i + 6. Let t(u) = -7o(u) - 6p(u). Calculate s(t(x)). 176x2 Let h(d) = 24d + 2d + 9d + 5d. Let t(k) be the second derivative of 1/6k*3 + 0k*2 + 22k + 0. Calculate h(t(f)). 40f Let c(a) = -64a. Let r(w) = -7323w2 + 10w. What is c(r(b))? 468672b2 - 640b Let j = 117 + -107. Let n(f) = f*3 - 10f*2 - 2f + 22. Let p be n(j). Let y(g) = -33g2 + 24g*p + 12g*2. Let h(v) = v. What is y(h(i))? 3i*2 Let u(t) = 778696066t. Let s(j) = j. Give s(u(n)). 778696066n Let r(n) = -119 - 901n + 119 - 174n. Let i(j) = -7j. Give r(i(y)). 7525y Let g(b) = -2b + 12472. Let x(y) = -2y2 - 92. Calculate g(x(t)). 4t*2 + 12656 Let p(z) = -7z*2. Let n(d) = -156129 - 27d + 156129. Give p(n(i)). -5103i2 Let z(r) = -261r. Let l(g) = -3g + 10104. Give z(l(b)). 783b - 2637144 Let o(j) = -7j - 10j - 2891471j2 + 2891509j*2. Let r(v) = v. Give r(o(y)). 38y*2 - 17y Let p(g) = -2g - 15. Let u(c) = -16c + 2622. Calculate u(p(z)). 32z + 2862 Let i(p) be the first derivative of -3p*3 + 2. Let s(w) be the third derivative of -5w*4/8 + 845w*2. Calculate i(s(h)). -2025h*2 Let f(d) be the first derivative of 3d*2 - d + 1450. Let h(r) = 8r. Give h(f(p)). 48p - 8 Let d(g) = -39g*2. Let h(f) = 5f + 3. Let p(v) = 11v + 6. Let z(x) = -13h(x) + 6p(x). Let o(y) = -3y + 5. Let b(a) = 3o(a) + 5z(a). Calculate d(b(q)). -624q2 Let o(j) = -8j. Let g = -16481/3 - -5494. Let b(w) be the first derivative of gw3 + 0w*2 + 20 + 0w. Give o(b(t)). -8t2 Let t(o) = 269 - 117 - 155 - 19o. Let c(h) = -49h. Give t(c(x)). 931x - 3 Let s(a) be the first derivative of -3a2/2 - 998. Let v(k) = 35k. Give s(v(h)). -105h Let s(y) = -9y*2. Let d(g) = -23147980g*2. What is d(s(a))? -1874986380a*4 Let p(j) = 5j + 9. Let i(l) = -19l - 8105. What is p(i(y))? -95y - 40516 Let t(d) = 17d. Let r(a) = 62a + 101a + 14a - 86a + 27a. Give r(t(f)). 2006f Let i(d) = -d + 53. Let m(o) = 68. Let n(c) = 6i(c) - 5m(c). Let a(t) = 3t. Give a(n(b)). -18b - 66 Let n be (45)/(5/(-70)-2). Let v(s) = -3s - n + s + 140. Let i(t) = 8t2 - 16. Let m(l) = l2 - 1. Let r(z) = i(z) - 16m(z). Give v(r(k)). 16k2 Let s(h) = -2 + 2 + 18170h - 18176h. Let g(d) = 87d. Calculate s(g(x)). -522x Let m(s) = -2s*2 + 27554s - 27554s. Let z(d) = -d - 116. Calculate m(z(a)). -2a*2 - 464a - 26912 Let q(h) = -160h2 + 22. Let z(n) = 58n*2 - 8. Let r(a) = 4q(a) + 11z(a). Let d(m) = -612m*2 - 7. Calculate d(r(g)). -2448g*4 - 7 Let f(r) be the first derivative of -72 + 2533r*2 - 59 - 2538r*2. Let t(w) = -31w. Calculate t(f(z)). 310z Let q(l) = -2l*2. Let m = 9950 + -9947. Let d(c) be the first derivative of -22/3c*m + 25 + 2c + 0c2. Determine d(q(j)). -88j*4 + 2 Let p(q) = -4q*2. Let v(r) = -31955 + 380r + 31955. What is p(v(b))? -577600b2 Let s(q) = -2q*2 + 12q. Let u(b) be the third derivative of -1/30b5 + b + 0 + 0b*4 + 0b*3 - 48b*2. Determine u(s(n)). -8n*4 + 96n*3 - 288n*2 Let c(r) = -198r - 2. Let k(i) = -191085i2 - 3 + 191081i*2 + 3. Determine c(k(f)). 792f*2 - 2 Let u(j) be the first derivative of 0j*3 - 5 - 25j + 0j2 - 13/6j*4. Let f(y) be the first derivative of u(y). Let x(q) = q. Give x(f(v)). -26v*2 Let a(c) = -2c. Let j(g) = 12262529g. What is a(j(f))? -24525058f Let j(u) = u + 1. Let r(y) be the third derivative of -y5/20 + y4/6 + 2y3/3 - 63y*2. Let m(g) = 4j(g) - r(g). Let t(x) = -3x. What is t(m(q))? -9q*2 Let v(y) = -12y*2. Let g = 25 + -12. Suppose 6m + 4 = 8m. Let f(r) = -13r - 2rm + gr. What is f(v(h))? -288h4 Let y(v) = 5v + 1532066. Let s(p) = -3p2. Give y(s(n)). -15n*2 + 1532066 Let m(b) = 2b*2. Suppose -24l + 6490 = 6370. Let r(a) be the third derivative of 6a2 + 0a*4 + 0a*3 + 0a + 1/30al + 0. Calculate r(m(d)). 8d4 Let j(p) = p2. Let m(o) = -10595o - 326. Let i(y) = -196y - 6. Let u(v) = -163i(v) + 3m(v). What is u(j(g))? 163g2 Let k(q) = -106q - 2 + 3 - 71q + 31q + 4q. Let h(x) = -24x. Determine k(h(u)). 3408u + 1 Suppose -4c + 105 = -15. Let z(m) = -41m + 69m - c*m. L	{ "pile_set_name": "DM Mathematics" }
termine -a(m) - f(m). 1181m + 2 Let k(o) = 2o*2 - 36o + 20. Let b(m) = -6m2 + 101m - 62. What is 6b(j) + 17k(j)? -2j2 - 6j - 32 Let g(p) = -p*3 + 6p2 + 7. Let a(k) = k3 - 7k2 - k - 10. Let t(o) = 3a(o) + 4g(o). Let y(z) = z3 - 3z*2 + 3z + 2. Determine -3t(r) - 4y(r). -r*3 + 3r*2 - 3r - 2 Let n(z) = 124z2 + 17z - 17. Let l(d) = 560d - 3914. Let f be l(7). Let j(y) = 41y*2 + 6y - 6. Determine fn(m) - 17j(m). 47m2 Let j(q) be the second derivative of -q4/12 + q3/3 - 148q + 6. Suppose -4 = -2n - o, 10 = -2n + 2o + 2. Let g(k) = -k + n + 0. Give -6g(t) - j(t). t*2 + 4t Let p(s) be the second derivative of -2s5/5 - 7s*4/12 + 5s*3/2 - 7s*2/2 - 3856s. Let n(a) = 7a3 + 6a*2 - 15a + 6. Give -7n(q) - 6p(q). -q*3 + 15q Let x(s) = -s*2 - 2s - 4. Let k(i) = 472i2 + 1. Calculate k(d) - x(d). 473d*2 + 2d + 5 Let l(k) = -k*3 + 8k*2 + 1. Let g(d) = 24d*3 - 71d*2 + 2d - 9. Let t(s) = -g(s) - 9l(s). Let x(v) = 15v*3 + 2v*2 + 3v. What is -3t(r) - 2x(r)? 15r3 - r2 Let d(t) = -73t - 105. Let i(q) = -147q - 182. Calculate -7d(g) + 4i(g). -77g + 7 Let f(t) = 4t3 - 2t*2 + 23t. Let p be (42/(-12))/(77/(-44)). Let n(q) = -9q3 + 5q*2 - 47q. Calculate pn(m) + 5f(m). 2m3 + 21m Let n(l) = -15598l2 + 31183l*2 - 15592l*2. Let d(o) = 85o*2. Let z(g) = -2g. Let h be z(-1). What is hd(a) + 25n(a)? -5a2 Let c(z) = 2 + 129z + 138z - 393z + 131z. Let u(h) = -h. Suppose w + 3w = 4. Let a(p) = -4p. Let d(v) = wa(v) - 5u(v). Determine c(j) - 6d(j). -j + 2 Let q(f) = -4f3 + 31f*2 + 117f + 2. Let y(l) = -3l3 + 25l*2 + 112l + 2. What is 4q(z) - 5y(z)? -z3 - z2 - 92z - 2 Let i(p) = 4p*2 - 233p - 933. Let z be i(62). Let c(f) = 2f3 - 4f + 5. Let v(a) = -2a3 + 3a - 6. Determine zc(s) - 4v(s). 2s3 + 9 Let p = 3609 - 970. Let j(u) = u - 5u*2 + 4u*2 + 2637 - p. Let g(x) = -4x*2 - 9 + 3x + x + 0x2. Calculate -6g(a) + 26j(a). -2a*2 + 2a + 2 Let d(s) = s3 + s2 - 1. Let k(w) = 635w3 - 719w*3 - 73w*2 - 39w*2 + 112. Calculate -112d(v) - k(v). -28v3 Let i(q) be the second derivative of -5/2q*2 + q - 51 + 2/3q*4 - 11/6q*3. Let s(g) = 3g*2 - 4g - 2. Give 4i(p) - 11s(p). -p*2 + 2 Let x(h) = -42h*2 + 5h. Let d(b) = 21b2 - 3b. Let y be (72/80-2)/((-6)/20). Determine yx(c) + 10d(c). -42c*2 Let p(a) = 2a*2 - 4a. Let n(k) = 5331k2 + 16k - 1. Give -n(l) - 4p(l). -5339l*2 + 1 Let o(d) = 4d*2 - 4d + 12. Let t(f) = -2f2 - 2f + 3. Let c(z) = o(z) - 4t(z). Let p(m) = 12m*2 + 3m. What is 2c(s) - 3p(s)? -12s2 - s Let v(b) = 29809b2 - b3 - 59315b2 + 29505b*2. Suppose 1 = -3j + 13. Let x(h) = 5h2 + 5h*3 + 0h*3 + h - jh*2. What is -3v(f) - x(f)? -2f3 + 2f*2 - f Let p(l) = -3l3 + l2 + 86l - 2. Let b(h) = -6h*3 + 2h*2 + 170h - 4. What is -3b(s) + 5p(s)? 3s3 - s2 - 80s + 2 Let u(k) = 10k2 + 8k - 45. Let l(r) = 3r2 + r + 1. Give 5l(i) - u(i). 5i2 - 3i + 50 Let o(f) = f + 50. Let s(n) = n + 99. Suppose -90j - 55j = 212j + 1785. Determine jo(q) + 3s(q). -2q + 47 Let c(z) = 28z2 + 404z - 61. Let l(f) = 3f2 + 45f - 7. Determine -2c(t) + 19l(t). t*2 + 47t - 11 Let s(u) = 9u - 4. Suppose 5y + 3w = -14, 0 = -2w + 8 - 4. Let i(d) = 3d. Let x(p) = yi(p) + s(p). Let n(z) = -35z - 49. Determine -4n(k) + 49x(k). -7k Let t(x) = 17x2 + 9x + 1. Let h(b) = -21b2 - 10b - 2. Give -3h(v) - 4t(v). -5v2 - 6v + 2 Let l(f) = -11f3 - 6f*2 - 5. Let n(t) = -6t*3 - 3t*2 - 3. Suppose -12y + 36y - 66 = 2y. What is yl(p) - 5n(p)? -3p3 - 3p*2 Suppose 2u - 5 = -1. Let l(i) = -16i - 6. Suppose 14m = 13m - 3v + 18, -m + 23 = 4v. Let j(z) = 453 + 0z + mz - 452. Give ul(y) + 11j(y). y - 1 Let l(m) = 6m*3 + 17m*2 - 17m + 8. Let r(d) = 2d3 + 6d*2 - 6d + 3. Let t(g) = 477g - 9523. Let z be t(20). What is zr(y) - 6l(y)? -2y*3 + 3 Let y(g) = 411g*2 + 4g - 21. Let i(n) = -1233n2 - 13n + 73. What is 2i(f) + 7y(f)? 411f2 + 2f - 1 Let o(d) = -667d3 - 9 + 384d*3 - 5d*2 + 5d + 286d3. Let q(z) = -2z*3 + 3z*2 - 3z + 4. Calculate 3o(p) + 5q(p). -p3 - 7 Let b(t) be the third derivative of t5/60 - t*4/3 + 5t*3/6 + 286t2. Let z(q) = q2 - 7q + 5. Give -6b(o) + 7z(o). o2 - o + 5 Let v(j) = -7j - 11. Let b be v(1). Let i be b/540/96-4. Let n(w) = -5w + 4 + 4 - 3w - 5w2 - 1. Let k(x) = 4x*2 + 7x - 6. Calculate in(o) + 7k(o). -2o2 + o Let q(f) = -f2 + 34f + 201. Let o be q(-5). Let x(r) = 8r2 - 1. Let m(i) = 9i*2 - 1. What is ox(a) - 5m(a)? 3a2 - 1 Let n(z) be the second derivative of -z3/6 - z2/2 + z. Let g(a) be the second derivative of -a3/6 - a + 153. What is g(t) + 2n(t)? -3t - 2 Let i(w) = -4w2 - 5w - 11. Suppose -12t - 96 = -0. Let o be (8 - (-5 + 10)) + 0 - t. Let c(b) = -2b*2 - 3b - 6. Determine oc(n) - 6i(n). 2n2 - 3n Let y(n) = 143n2 - 17n - 514. Let k(s) = -86s2 + 10s + 309. Determine 17k(b) + 10y(b). -32b2 + 113 Let g be 1 + 1 - 4/(12/(-3)). Let w(p) = 0p - 7p - 1 - gp + 9p. Let n(b) = -b2 + 3b + 5. Let f = -27 + 31. What is fw(o) + n(o)? -o2 - o + 1 Let o(f) = f2 - f. Let x = 13 + -4. Let z(h) = 2h*2 - 23h - 4. Let n(k) = -24k2 + 306k + 54. Let y(g) = 2n(g) + 27z(g). Give xo(s) - y(s). 3s*2 Let h(b) = -5b*2 - 15 + 12 + 129b - 65b - 66b. Let w(s) = -9s2 - 5s - 5. Suppose 843n - 851n = 24. Calculate nw(g) + 5h(g). 2g2 + 5g Let c(k) = 9. Let r(s) = s + 64. Let n(o) = 7c(o) - r(o). Let a(y) = -76y - 38. What is -a(u) + 38n(u)? 38u Let t(l) = 637l. Let m(v) = 26v - 40v - 12v + 101v. What is 42m(q) - 5t(q)? -35q Let i(p) = -7p3 + p2 - 24p - 2. Let d(j) = -20j3 + 3j*2 - 74j - 5. Give -5d(r) + 14i(r). 2r3 - r2 + 34r - 3 Let n(x) = -3x2 - 16x - 4. Let l(o) = -2o2 - 15o - 3. Let r(m) = 2m3 - 10m*2 + 8m - 43. Let z be r(5). Determine zn(j) + 4l(j). j*2 - 12j Let k(b) = -b + 1. Suppose 2h - 2g = -3g + 279, -285 = -2h - 3g. Let d = h - 137. Let w(a) = 3a*2 + 3a - 4. What is dw(j) + 5k(j)? 3j2 - 2j + 1 Let l(m) = 9m + 835. Let b(v) = -27v - 2494. Give -2b(g) - 7l(g). -9g - 857 Let z(v) be the third derivative of 13v6/120 + v5/15 + v*4/8 - 2v*3/3 + 21v*2. Let j(f) = -13f*3 - 3f*2 - 2f + 3. What is 4j(y) + 3z(y)? -13y3 + y Let y(j) = -6j*2 + 5j + 6. Let v = -14214 - -14218. Let s(x) = 5x2 - 4x - 7. Calculate vy(g) + 5s(g). g*2 - 11 Let x(c) = 994c*2 - 15c + 5. Let a(z) = -497z2 + 6z - 2. Calculate -5a(g) - 2x(g). 497g2 Let f be (6/8)/(2/8). Let t(r) = 56rf - r2 + 4r2 - 49r*3. Let x(w) = -14w*3 - 7w*2. What is 7t(z) + 3x(z)? 7z*3 Let m(v) = 2v*2 + v - 5. Suppose -95 = 118905u - 118924u. Let b(k) = -2k*2 - 2k + 4. Determine ub(s) + 4m(s). -2s2 - 6s Let d(s) = -s - 2. Let a(x) = 1. Suppose 650 = 5v + 515. Suppose 25k = 34k + v. Let g = 3 + -5. Determine gd(y) + ka(y). 2y + 1 Let a(k) = -89k - 1424. Let d(s) = 38s + 713. What is 6a(z) + 14d(z)? -2z + 1438 Let o(p) = 41p + 6. Let n(q) = -40q - 10. Let z(c) = -2n(c) - 3o(c). Let a(w) = w. Determine -2a(x) - z(x). 41x - 2 Let d(x) be the first derivative of -x3 - 8x - 1. Let b(n) = 6611. Let k(i) = -1653. Let j(g) = b(g) + 4k(g). Calculate 3d(a) - 24j(a). -9a*2 Let g(q) = -q + 13. Let w(o) = -2130o - 1105. What is -510g(a) - 6w(a)? 13290a Let b(p) = -p2 + 18p - 59. Let k(c) = c + 3. Give b(u) - k(u). -u*2 + 17u - 62 Let m(v) = v*2 - 4v - 40. Let y be m(9). Let d be 1/y-2-10 - 8. Let w(l) = -3l + 1. Let i(o) = -3o + 1. Determine di(c) + 5w(c). -3c + 1 Let h = 139 - 130. Let d(j) = -1 + 40j*2 - hj - 41j2 + 1. Let w(k) = -k. Calculate d(n) - 6w(n). -n*2 - 3n Let n(r) = -r*3 + 6r*2 + r - 5. Let c(d) = 3d*3 - 17d*2 - 3d + 16. Let z be ((-12)/14)/((-121)/847). What is zc(f) + 17n(f)? f*3 - f + 11 Let g(d) = 8d - 11. Let v(c) = 6508c + 1 + 0 - 4 - 3 - 6504c. What is -4g(q) + 7v(q)? -4q + 2 Let h(i) = 106i - 147. Let q(u) = 73u - 101. Let f(x) = -11h(x) + 16*q(x). Let n(v)	{ "pile_set_name": "DM Mathematics" }
a) + 5p(a). Give v(q(n)). 8n Let u(w) = w. Let h(q) = -14373q2 + 6q. Calculate h(u(c)). -14373c2 + 6c Let l(q) be the third derivative of q*4/6 + 20q*2 + 4q. Let n(s) = -3s2 + 5. Determine l(n(t)). -12t*2 + 20 Let z(s) = -2s*2 + s - 1495. Let o(t) = -3t*2. Calculate z(o(p)). -18p*4 - 3p*2 - 1495 Let p(j) = -3j - 24. Let i be p(-9). Let h(m) = -im + 0m + 6m - m. Let k(c) = -8c*2. Give h(k(a)). -16a2 Let l(p) = -2 + 1 + 1 - p2. Let d(m) = 73m + 75m - 152m. Determine l(d(s)). -16s2 Let c(o) = -o2. Let w(y) = -52y2 + 10y + 40. Determine w(c(m)). -52m4 - 10m*2 + 40 Let l(m) = 264848m*2. Let s(k) = 4k. Give s(l(u)). 1059392u2 Let l(i) = 3i*2. Let b(n) = 15111n. Give l(b(f)). 685026963f2 Let n(d) = 21d*2 + 18d*2 - 5d*2. Let a(s) = -5s + 21. Let b(p) = -2p + 9. Let k(j) = -6a(j) + 14b(j). Calculate k(n(h)). 68h*2 Let s(d) = -6d + 331. Let i(t) = 2t - 20. Determine i(s(b)). -12b + 642 Let j(x) be the first derivative of 11x3/3 - 3x*2/2 - 161. Let z(o) = 4o*2. Determine z(j(b)). 484b*4 - 264b*3 + 36b*2 Let i(p) = p + 1. Let n(g) = 8g*2 - 24g - 24. Let l(k) = 24i(k) + n(k). Let m(z) = 3. Let w(u) = -u - 4. Let v(r) = -4m(r) - 3w(r). Calculate v(l(s)). 24s*2 Let o(v) = 0v*2 + 7v*2 - 11v*2 - 5v*2. Let r(x) = -5x - x + 4x + 4x. What is o(r(g))? -36g2 Let y be 6((-3)/(9/(-1)))/1. Let k(l) = -4l + 10l*2 + 9l*y + 4l. Let d(q) = q. Determine d(k(n)). 19n2 Let v(z) = 107600z*2 + 1600z. Let c(i) = 403i2 + 6i. Let j(p) = 800c(p) - 3v(p). Let b(l) = -2l. Give j(b(a)). -1600a*2 Let l(t) be the second derivative of -19t*3/6 + 67t. Let k(m) = -41m. What is k(l(r))? 779r Let r(j) be the second derivative of -5j3/3 - 3j + 37. Let t = 2 + 1. Let a(x) = tx - 2 - x + 2. What is a(r(z))? -20z Let s(n) = n*2. Let v(l) = 269600l. Let t(o) = 343o. Let i(k) = -2359t(k) + 3v(k). Give s(i(d)). 113569d2 Let u(t) be the first derivative of t3/2 + 10t - 12. Let h(l) be the first derivative of u(l). Let x(r) = -2r. Calculate h(x(g)). -6g Let i(k) = 2k. Let b(l) be the second derivative of -l*7/2520 + 5l*4/12 + 28l. Let g(r) be the third derivative of b(r). What is i(g(h))? -2h2 Let o(d) = 7d. Let s(z) = 2z - 52. Let h be s(26). Let r(b) = hb - 44b2 + 54b*2 + 0b. What is r(o(a))? 490a2 Let a(u) = u. Let r(s) = 8s*2 - 3s. Let q(i) = 6a(i) + 2r(i). Let l(m) = 8m2. Calculate l(q(f)). 2048f*4 Let z(q) = 386831q. Let p(b) = -2b. Determine p(z(j)). -773662j Let v(y) be the first derivative of -y*2/2 - 715. Let f(u) = -u + 96. Calculate v(f(a)). a - 96 Let t(h) = 37680h*2 + h. Let k(y) = y. What is t(k(g))? 37680g*2 + g Let v(z) = 6z*2. Let g(t) = 5t*2 - 7 - 9t*2 + 7 - 16t*2. Calculate v(g(w)). 2400w*4 Let l(f) = -4f*2. Let p be 0/24/8. Suppose p = 4r + 4, 2a + 3a - 14 = 4r. Let o(z) = 0z2 + za + z2. What is o(l(n))? 32n*4 Let z(y) = 298y - 143y - 133y. Let p(d) = 10d. Determine z(p(o)). 220o Let i(a) = a*2 - 3a - 3. Let d be i(5). Let n(y) = -dy + 7y - y + 0y. Let p(v) = 18v. Calculate p(n(s)). -18s Let h(u) = -142u*2. Let z(s) = 1379s*2. What is z(h(x))? 27806156x*4 Let x(k) = -30k - 3. Let a(r) = 24r2 - 18r - 54. Let b(t) = -7t2 + 5t + 15. Let v(s) = 5a(s) + 18b(s). Give x(v(q)). 180q2 - 3 Let n(g) = g2 + 5g + 5. Let i(r) = -4r - 4. Let u(b) = 7b + 7. Let w(m) = 5i(m) + 2u(m). Let x(q) = 6n(q) + 5w(q). Let j(t) = -t*2. Give x(j(a)). 6a*4 Let y(l) = -4l. Let r(b) = b*3 - 5b*2 + 5b + 1. Let g be r(4). Suppose -27 = -u - 5d, 15 + 11 = 3u + 4d. Let n(a) = 2a - u - 3 + g. Calculate n(y(k)). -8k Let q(v) be the third derivative of 11v*4/12 - 245v*2. Let d(l) = 0 + 0 - l. Calculate q(d(n)). -22n Let b be 1(1 + 1 + 0). Let o(l) = -2l2 - l2 + 11lb. Let c(m) = -11m. Let w(t) = 2t. Let n(h) = c(h) + 5w(h). Give o(n(r)). 8r2 Let k(h) = -4h2 - h2 + h*2 - 12 - 2h*2. Let x(b) = 2b*2. What is x(k(i))? 72i*4 + 288i*2 + 288 Let g(y) = -10y. Let o(j) = 20763j2. Calculate g(o(f)). -207630f*2 Let n(d) = -834d*2 - d - 833d*2 + d + 1661d*2. Suppose 20 = o + 4o. Let y(j) = 2j2 + oj*2 - 5j*2. Determine y(n(u)). 36u*4 Let f(z) = -10z2. Let h(v) = v2 - 3v + 3. Let q(p) = p2 - 4p + 4. Let b = 139 - 143. Let n = -6 - -9. Let c(i) = bh(i) + nq(i). Give c(f(y)). -100y4 Suppose -13d = -17d + 56. Let f(l) = -4l - 9l - 3l + dl. Let k(w) = 21w*2. Calculate f(k(q)). -42q2 Let t(s) be the first derivative of -s2/2 + 1. Let l(h) = -3571h - 3560h - 9h2 + 7131h. Give t(l(r)). 9r2 Let b(z) = -2z. Let w be (-64)/(-20) + 2/(-10). Let n = -1 + w. Let p(k) = 5kn + 2k*2 - 2k*2 - 3k*2. Give b(p(a)). -4a*2 Let d(y) = 3y. Let q(b) be the first derivative of 28b2 + 507. Determine d(q(w)). 168w Let z(f) = 2f + 28. Let r(i) = -4i - 1122. What is z(r(t))? -8t - 2216 Let f(o) be the first derivative of o5/60 + 3o*2 - 2. Let w(t) be the second derivative of f(t). Let b(q) = -2q*2. Calculate b(w(d)). -2d*4 Let h(i) = 2i2. Let f(x) = x2 - 4x - 1. Let r(p) = -180p*2 + 20p + 5. Let g(k) = -20f(k) - 4r(k). What is g(h(z))? 2800z4 Let u(a) = -2a. Let s(l) = 476l2 - 55l + 1. Calculate s(u(f)). 1904f2 + 110f + 1 Let h(j) = 10j2 + 10j. Let g(b) = -b*2 - 2b. Let z(t) = 10g(t) + 2h(t). Let i(d) = -7d. Calculate i(z(s)). -70s*2 Let f(g) = g. Let h(d) = 83d + 12997. Calculate h(f(m)). 83m + 12997 Let z(j) = -126j*2. Let f(y) = -103y*2. What is f(z(q))? -1635228q*4 Let d(q) = -14q. Let c(j) = -19j2 - 12j - 4. Let x(p) = -759p2 - 483p - 161. Let r(v) = -161c(v) + 4x(v). Give r(d(b)). 4508b2 Let c(f) = 49859f*2. Let s(w) = -9w*2. What is c(s(t))? 4038579t*4 Let l(g) = 4g*2 - 2g2 + g2. Let v(r) be the first derivative of r*2/2 - 10. Let z(k) = -3k. Let j(h) = 2v(h) + z(h). Calculate j(l(a)). -3a*2 Let w(d) = -178d. Let y(u) = -2079u2. Calculate y(w(f)). -65871036f2 Let q(g) = g2. Let n(i) = -2 - 7 - 3 - 58i + 14. Determine n(q(p)). -58p*2 + 2 Let z(q) = 11q*2. Let l(f) = -159f - 12. Determine l(z(h)). -1749h2 - 12 Let l(u) = 2u*2. Let g(b) = -243b + 36. Calculate g(l(j)). -486j2 + 36 Let k(j) = j. Let t(g) be the second derivative of -16g + 0g2 - 4/3g*4 + 0g*3 + 0. Give t(k(o)). -16o*2 Let s(o) be the third derivative of 0o*3 + 0o + 0o4 + 11/30o*5 - 9o*2 + 0. Let w(y) = 2y. What is s(w(m))? 88m2 Let v(a) = 20a*2 + 1. Let b(p) = 412p*2 - 2. Determine b(v(c)). 164800c*4 + 16480c*2 + 410 Let m(t) = -2t. Let y(p) = 9p2 - 3. Let v be (24/(-40))/((-1)/(-5)). Let s(r) = 18r*2 - 5. Let i(c) = vs(c) + 5y(c). What is i(m(x))? -36x2 Let b(s) = -s2. Let v(i) = -8i - 3115. Determine b(v(h)). -64h*2 - 49840h - 9703225 Let k(g) = 2417g. Let i(t) = -38t + 1. What is i(k(x))? -91846x + 1 Let b(p) = -958p + 955p - 3 + 3. Let i(l) = -2l + 145. Calculate b(i(y)). 6y - 435 Suppose 4m + 5p = 447 + 191, -802 = -5m - 4p. Let x(g) = g2 + 162g - mg. Let j(q) = 5q. Determine j(x(w)). 5w2 Let z(g) = -52g*2. Let f(p) = -75p + 21. Let c(x) = 18x - 5. Let s(n) = 21c(n) + 5f(n). Determine z(s(o)). -468o*2 Let j(r) = 2r - 3. Let w(t) = t - 1. Let z(b) = j(b) - 3w(b). Let u(k) = 4k*2 + 9k*2 + 7k*2. What is z(u(d))? -20d*2 Let h(w) = -3w*2 + 12w - 12w. Let c = -3 - -5. Let i(a) = -6a2 + ac + 1 - 1. Determine h(i(b)). -75b4 Let n(d) = 2d*2 - 49d. Let w(z) = -28z - 20z + 68z - 21z. Give n(w(q)). 2q2 + 49q Let m(w) = w. Let l = 251 - -95. Let j = l - 191. Let f(p) = -3p2 - jp + 155p. What is f(m(v))? -3v2 Let u(p) = -p2. Let s(i) = -5i2. Let w(t) = 2s(t) - 9u(t). Let c(y) be the first derivative of -3y*2/2 - 1329. Calculate w(c(r)). -9r*2 Let d(b) be the first derivative of 2b*3/3 + 82. Let g(x) = -9x - 11. Let z(k) = -5k - 6. Let c(y) = 6g(y) - 11z(y). What is d(c(h))? 2h*2 Let w(q) = -2q*2. Let t(u) = 6 + 7 + 11u - 13. Calculate t(w(z)). -22z2 Let p(z) = -5z - 1. Let x(i) = -126i - 9. Give x(p(c)). 630c + 117 Let p(y) = -76y - 2. Let q(v) = 6v*2 - 5v - 1	{ "pile_set_name": "DM Mathematics" }
. Find the first derivative of 4q2 + 5q + 214 - 11q2 + 2q - iq - 11q*2 wrt q. -36q + 4 Let o = 134 + -73. Suppose -4q - 3t + o - 6 = 0, -2t = 5q - 67. What is the first derivative of qa2 + 9a*2 + 0a*2 + 5 + 13 wrt a? 44a Let t(h) = 8448h - 14608. Let c(f) = 313f - 541. Let a(z) = -55c(z) + 2t(z). What is the first derivative of a(w) wrt w? -319 Find the third derivative of -7a2 + 79 - 73a*3 + 36a*5 - 11a*3 + 57a3 + a4 wrt a. 2160a2 + 24a - 162 Let q = -50 - -53. Suppose 4j + qj - 4j = 0. Find the first derivative of 5 + j - 16i + 3 wrt i. -16 Let m = -21 - -31. Let x = -250 + 252. Find the second derivative of 7i2 - 8i*2 + 6i - mi2 - 3ix wrt i. -28 Let b(h) be the third derivative of h9/252 + 229h8/84 - 13h*5/30 - 7h*3/2 - 1706h*2. What is the third derivative of b(l) wrt l? 240l*3 + 54960l2 Let w(q) be the first derivative of -q4 - 211q3 - 1143q*2/2 + 2q + 11285. Find the second derivative of w(r) wrt r. -24r - 1266 Differentiate -122 + 47w*2 - 116w*2 - 71 + 32w*2 - 6w - 47 wrt w. -74w - 6 Suppose -2 = -z, -18 = -5y - 0y + z. Find the third derivative of -9250j*4 - 64j*6 + 9250j*y + 397j*6 - 74j + j*2 wrt j. 39960j*3 Let u(z) = 1917z*3 - 218z*2 - z - 6. Let x(i) = -7668i*3 + 869i*2 + 3i + 27. Let a(s) = 9u(s) + 2x(s). What is the third derivative of a(l) wrt l? 11502 Let y(p) be the second derivative of 0 - 23/3p4 + 75p + 0p2 - 37/6p*3. Find the second derivative of y(s) wrt s. -184 Let m(a) be the second derivative of 143a*5/10 - 17a*4/4 + 4a*2 + 854a. What is the third derivative of m(r) wrt r? 1716 Let s be (-2)/(-2) + -2 + 24/6. Let x(d) = -4d - 45. Let m be x(-12). What is the second derivative of 9a + 26as - 13a*m + 14a + 18a3 wrt a? 186a Let t(c) be the first derivative of 112c4 - 1827c*2/2 + 1429. Find the second derivative of t(a) wrt a. 2688a Suppose 4g = q, 4q + 5g - 18 = 3g. Differentiate 140nq + 77 - 103 - 115 wrt n. 560n*3 Let m(i) = 9i*2 + 24i - 5. Let p(s) = 26s2 + 71s - 15. Let o(b) = -8m(b) + 3p(b). Let l be o(-4). Differentiate -la - 6a + 2a + 0a - 18 wrt a. -11 Let i(w) be the first derivative of -2579w3/3 - 3w*2 - 315w + 4473. What is the second derivative of i(k) wrt k? -5158 What is the third derivative of 100 + 344b2 + 1566b*3 - 100 + 1470b*2 wrt b? 9396 Let c = -463 - -474. Let u(z) = 260z*2 - 176z + 11. Let d(r) = -129r2 + 88r - 6. Let b(k) = cd(k) + 6u(k). Find the second derivative of b(p) wrt p. 282 Let s(o) = 3147o3 - 185o*2 + 5o. Let l(n) = -3145n3 + 184n*2 - 4n. Let i(z) = -3l(z) - 2s(z). What is the third derivative of i(d) wrt d? 18846 Suppose -s + 3y + 8 = 0, -2s = 14y - 18y - 12. What is the third derivative of 112i4 + 39i*s - 112i*4 + 172i*5 - 130i*2 wrt i? 10320i*2 Let y(i) = -3933i*2 + 10i + 12266. Let u(v) = 1966v2 - 6v - 6123. Let p(z) = 7u(z) + 4y(z). What is the first derivative of p(g) wrt g? -3940g - 2 What is the third derivative of 2q*2 - 2q*5 - 1608q*4 + 986q4 - q - 69 - q5 + q*2 wrt q? -180q*2 - 14928q What is the third derivative of 4t + 14396t*4 + 1 + 1093t*2 - 5t - 1559t2 + 763t*2 wrt t? 345504t Let l(o) be the first derivative of 31o3/3 - 7o*2/2 - 51o - 11. Let t(h) = 15h2 - 3h - 26. Let n(p) = 6l(p) - 14t(p). Differentiate n(s) wrt s. -48s Let z(x) = -32x + 192. Let v be z(6). Let l(q) be the third derivative of -5/24q4 + v + 0q - 13q2 + 11/6q*3. Find the first derivative of l(p) wrt p. -5 Suppose -16c = 15c - 992. What is the derivative of -25 - 41x + 40x - 11 - cx - 141x wrt x? -174 Suppose -3 = 3o - 12. Suppose -5g - ov + 33 = 0, -4g + 3v = -15 - 6. What is the third derivative of 4i2 + 2i*3 - 30i*g + 40i*6 - 2i*3 wrt i? 1200i*3 Let t(h) be the second derivative of -3h*8/28 + 55h7/42 - h4/12 - 65h3/6 - 312h - 2. What is the third derivative of t(c) wrt c? -720c3 + 3300c*2 Let o(z) = 7z*2 + 3z. Let c be o(-1). What is the third derivative of cj3 - 22j*2 - 5j*6 + 3j*6 + 55j*2 wrt j? -240j*3 + 24 Let w(p) be the second derivative of -11p*7/42 + 5p*4/12 - 917p*3/6 - 35p + 12. Find the second derivative of w(j) wrt j. -220j3 + 10 What is the second derivative of -9u*4 + 267u - 7u4 - 8u*4 + 22u*4 - 2080u*5 - 952u wrt u? -41600u3 - 24u*2 Let h = -86 - -227. Let v = 144 - h. Find the second derivative of -341x*v - 7x + 310x3 - 2x + 2x wrt x. -186x Suppose 3i + 0i = -i. Suppose 8q + iq = q. Find the first derivative of 4 - 4 + 2d4 + q - 6 wrt d. 8d*3 Let x(i) = -51i*4 - 6i3 + i + 2729. Let q(j) = -j4 - 2j3 + j. Let g(h) = 3q(h) - x(h). What is the first derivative of g(r) wrt r? 192r3 + 2 Let z(s) be the first derivative of 29s*4/2 + 5s3/3 + s2/2 + 1248s - 4844. Find the second derivative of z(c) wrt c. 348c + 10 Let s(k) = 5k - 26. Let i be s(6). What is the first derivative of 24vi + v4 + 9v4 + 82 + 28v*4 wrt v? 248v3 Let x(d) = d2 - 8d - 66. Let p be x(15). What is the second derivative of 24z*5 + 12z*5 + 1 - 304z - pz5 - 1 - 15z*4 wrt z? -60z*3 - 180z*2 Let t(y) = 15y - 9. Let b be t(4). Find the third derivative of 26 - 11h2 + 25 + 5h*4 - 3h - 2h6 - b wrt h. -240h*3 + 120h Let n(v) = 331v2 - 534v + 10. Let y(o) = -5628o2 + 9072o - 168. Let h(u) = -84n(u) - 5y(u). What is the second derivative of h(s) wrt s? 672 Let a = -85 + 289. Let n be (4/(-6))/((-17)/a). Find the second derivative of 3y - 215y*3 + 2 + 32y*4 - n + 215y*3 wrt y. 384y*2 Suppose -5k + 5 = 3m - 6m, m = -4k + 21. What is the third derivative of -18c*m + 44c*2 + 4c*5 - 12c*5 + 2c*5 wrt c? -1440c*2 Let l(n) = 25n + 1. Let w(c) = 4294c2 + 1411c - 5. Let x(t) = -5l(t) - w(t). What is the second derivative of x(a) wrt a? -8588 What is the second derivative of 0n + 40n5 - 58n*5 - 2n - 314 + 5n2 - 20n*2 wrt n? -360n*3 - 30 Let i(m) be the first derivative of -17m*4/12 + 27m*2 - 53m - 52. Let p(x) be the first derivative of i(x). Find the first derivative of p(v) wrt v. -34v Suppose -3z - 18 = -81. Suppose -3y = 0, -2u + 3u + 4y - 19 = 0. What is the second derivative of zq5 - 11q*5 - uq*5 - 23q wrt q? -180q3 What is the second derivative of -11g*3 - 4018g + 4017g + 9g*5 + 5g*4 - 2g*2 + 5g*2 + 11g*3 + 1104 wrt g? 180g*3 + 60g*2 + 6 Let a be 2 + 15/((-15)/(-4)). Let r(o) = 112o*2 + 7o + 40. Let n(p) = -p*2 + p - 1. Let c(b) = an(b) - r(b). Find the second derivative of c(d) wrt d. -236 Find the third derivative of 2775j2 + 8 + 13 - 2116j*4 + 15 - 36 wrt j. -50784j Let a(o) = 1066o3 + 5o*2 + 48o + 191. Let q(s) = s*2 + 9s. Let m(n) = -a(n) + 5q(n). Find the second derivative of m(g) wrt g. -6396g Find the third derivative of -173a5 + 552a*2 - 67a*5 - 1968a*2 wrt a. -14400a2 Let h(d) be the third derivative of -d6/120 - d*5/15 + 5d*4/12 - 5d*3/3 - 13d*2. Let y be h(-6). Differentiate 16 - 3m - ym + 6 with respect to m. -5 Find the second derivative of 4598o + 1 + 0o3 + 2993o*2 - 8o*3 - 3009o*2 - 1 wrt o. -48o - 32 Let o(y) be the second derivative of -7301y3/6 + 6253y*2/2 + 122y - 6. What is the first derivative of o(s) wrt s? -7301 Suppose -k + 4 = -c, 5c + 2 = k - 2. Let w(r) be the first derivative of cr*2 + 0r - 10/3r3 - 4r*4 - 5. What is the third derivative of w(q) wrt q? -96 What is the second derivative of 191034 - 2918m - 13050m2 - 382066 + 191033 wrt m? -26100 Let w = 219 + -145. Let r be -3 - 50/(-18) - w/(-9). What is the third derivative of 71l*3 - 50l*3 - 39l*3 + rl*2 wrt l? -108 Let g(h) = 1441h*4 - 9858h - 40. Let n(m) = -4323m4 + 29572m + 128. Let x(q) = 16g(q) + 5n(q). What is the second derivative of x(z) wrt z? 17292z2 Suppose 0 = 5v - 5w - 335, -2v + 58 + 58 = 4w. What is the first derivative of -4n*4 + 27 + 8n*4 + 21n*4 + v wrt n? 100n*3 Let f(r) = 1905r - 1767. Let h(g) = -2*g. Let y(n) = f(n) - h(n). Differentiate y(w) with respect to w. 1907 Find the second de	{ "pile_set_name": "DM Mathematics" }
2. 49 Simplify (sqrt(190) + -1sqrt(190)-3)/sqrt(10). 4sqrt(19) Simplify (-1 + sqrt(1377) + -1 + 2(-1 + sqrt(272)))*2. -136sqrt(17) + 4929 Simplify 3 + -4 + sqrt(304) + 4. 3 + 4sqrt(19) Simplify -1sqrt(45)6. -18sqrt(5) Simplify 1 + sqrt(512). 1 + 16sqrt(2) Simplify sqrt(38)/sqrt(2)62. 12sqrt(19) Simplify -5(sqrt(500) + (sqrt(500) - (sqrt(500) + 0)) + 2)2. -2520 - 200sqrt(5) Simplify (-2sqrt(3400) - sqrt(3400))/(sqrt(4)/sqrt(2)4). -15sqrt(17)/2 Simplify 1 + (sqrt(243) + 3)2. 54sqrt(3) + 253 Simplify (sqrt(65)/(sqrt(35)/(sqrt(7)2)))2. 52 Simplify -1sqrt(17) + sqrt(17) + -5 + sqrt(34)/sqrt(2) + 5. sqrt(17) Simplify 0 + (-2 + sqrt(17)-1 - (1 + sqrt(17) + -1)). -2sqrt(17) - 2 Simplify sqrt(45)/(sqrt(441)6 + sqrt(441)). sqrt(5)/49 Simplify (-5sqrt(16)2)/(sqrt(72)6). -5sqrt(2)/9 Simplify ((sqrt(500) + sqrt(500) + (sqrt(500) + sqrt(500) + 1 - sqrt(500)) + sqrt(500) + -4)-6)*2-4. -1153296 + 34560sqrt(5) Simplify (sqrt(56) + (2sqrt(5600) - sqrt(5600) - sqrt(5600)))/(-1sqrt(8)-1). sqrt(7) Simplify 3((sqrt(351)/(sqrt(27)/sqrt(3) + sqrt(9)))/sqrt(3))2. 39/4 Simplify (sqrt(204)2-4)/sqrt(12)3. -24sqrt(17) Simplify ((sqrt(12)25)/(sqrt(44)/(sqrt(44)/sqrt(4))) + 1)2. 20sqrt(3) + 301 Simplify (1-1sqrt(38)/sqrt(2)-5)2. 475 Simplify (sqrt(224)-1)/sqrt(7). -4sqrt(2) Simplify (sqrt(30) + -2sqrt(4320))/(sqrt(12)/sqrt(98)). -161sqrt(5) Simplify (0 + sqrt(1539)2 + sqrt(1539))3. 81sqrt(19) Simplify ((sqrt(180) + -1)-3 + sqrt(180))2. -72sqrt(5) + 729 Simplify (sqrt(51)/(sqrt(3) - (sqrt(3) - sqrt(75)3)))2. 17/225 Simplify (sqrt(320) - 2sqrt(320)4) + sqrt(20)/sqrt(4) + 2 + -5. -55sqrt(5) - 3 Simplify 1sqrt(27)-1 + sqrt(27). 0 Simplify -5(2 + sqrt(1584)). -60sqrt(11) - 10 Simplify 3 + (-5sqrt(13)-2)*2. 1303 Simplify (-1 + sqrt(5))4-6 + (1 + sqrt(5) + 3)2 + -4. -16sqrt(5) + 41 Simplify ((sqrt(84) - (sqrt(84) + 62sqrt(84))) + sqrt(84))/(6(sqrt(12) + sqrt(12)1 - sqrt(12)) + sqrt(12)). -11sqrt(7)/7 Simplify (sqrt(243)2 + 4)*2. 144sqrt(3) + 988 Simplify 4 + (-4 + -2sqrt(180) - (sqrt(180) - ((-1 + sqrt(180))2 + 1) - sqrt(180))). -24sqrt(5) + 182 Simplify (2sqrt(72)/sqrt(4))/sqrt(6)3. 6sqrt(3) Simplify (1 + sqrt(567)-2)*2. -36sqrt(7) + 2269 Simplify ((sqrt(21) - (-2(sqrt(63)/sqrt(3) + sqrt(21)) - sqrt(21)))/(-1sqrt(3)3))2. 28 Simplify (1 + sqrt(17))4 + -1 + sqrt(612). 3 + 10sqrt(17) Simplify -4(4sqrt(26))/sqrt(2). -16sqrt(13) Simplify (-4sqrt(7) - sqrt(7)) + -2 + 0. -5sqrt(7) - 2 Simplify (4 + sqrt(72) + -2 + sqrt(72) + sqrt(72))*2. 72sqrt(2) + 652 Simplify (sqrt(425) - (sqrt(425) + -1))-4 + 42(0 + sqrt(17) + sqrt(17)). -4 + 16sqrt(17) Simplify (-3 + (2 + sqrt(26)/sqrt(2) - sqrt(13)))*2. 1 Simplify 0 + sqrt(171) + -4. -4 + 3sqrt(19) Simplify (sqrt(275)-1)2-1 - (-1 + (sqrt(275) - (sqrt(275) - -3sqrt(275))))2. -2751 - 30sqrt(11) Simplify ((sqrt(304) + 1)*2 - sqrt(304) - sqrt(304)) + (sqrt(19) - (sqrt(19) + sqrt(2736)3)*2). -25706 + sqrt(19) Simplify (4 + (sqrt(7) - sqrt(7)-3))4. 16 + 16sqrt(7) Simplify sqrt(5) + (sqrt(320) - sqrt(5)) + -1 - (sqrt(5)2 + 4). -5 + 6sqrt(5) Simplify (sqrt(704) + 4(sqrt(704) - (sqrt(704) + -1)))2-46. -17280 - 1536sqrt(11) Simplify ((sqrt(847) + sqrt(847) + 4)6)2. 6336sqrt(7) + 122544 Simplify ((sqrt(135)/sqrt(3))*2 - sqrt(45)) + sqrt(80) + 2sqrt(80) + sqrt(80). 13sqrt(5) + 45 Simplify (sqrt(20)/(sqrt(28)/sqrt(175)))2. 125 Simplify ((-1sqrt(119))/sqrt(7))*2 + 5(sqrt(68))2. 357 Simplify (sqrt(567) - ((sqrt(567) - (sqrt(567) + 0)) + 1))2. -18sqrt(7) + 568 Simplify (-4 + sqrt(63)/(sqrt(9) - sqrt(18)/sqrt(2)-5))*2. -4sqrt(7)/3 + 583/36 Simplify (sqrt(34)/(sqrt(8)/sqrt(4)) - (sqrt(833) - (-2 + sqrt(833) - sqrt(833))))-6. 12 + 36sqrt(17) Simplify (sqrt(17)1)2 + 3 - (sqrt(34)/sqrt(2) + -2). -sqrt(17) + 22 Simplify (sqrt(684) - -2sqrt(684))*2 - (sqrt(19) + (sqrt(209) + sqrt(209)2 - sqrt(209))/sqrt(11)). -3sqrt(19) + 6156 Simplify sqrt(75) + sqrt(75) + -3 + -3. -6 + 10sqrt(3) Simplify sqrt(19) + (sqrt(19) - (sqrt(2736)-2 - sqrt(19)))2 - (sqrt(304) + 0)2. sqrt(19) + 12540 Simplify (((0 + sqrt(11))5-2)2 + -1)2. 2198 Simplify -22sqrt(1700). -40sqrt(17) Simplify -5 + 2sqrt(320). -5 + 16sqrt(5) Simplify -1 + (sqrt(76)1)/sqrt(4). -1 + sqrt(19) Simplify -5 + (2 + sqrt(245))*2. 28sqrt(5) + 244 Simplify (-52sqrt(119))/(2sqrt(7)2). -5sqrt(17)/2 Simplify (0 + sqrt(98) + 1sqrt(98))*2 + -5. 387 Simplify -5 + (5 + -4-3sqrt(44))2. 240sqrt(11) + 6356 Simplify 6(3 + 2 + sqrt(5)). 6sqrt(5) + 30 Simplify (2 + -1 + sqrt(147) + -4)*2-2. -312 + 84sqrt(3) Simplify 2 + (sqrt(19) + -1)3. -1 + 3sqrt(19) Simplify ((sqrt(5) + 1sqrt(5))-1)2 + -5. 15 Simplify 3(sqrt(20) + sqrt(5) + -5). -15 + 9sqrt(5) Simplify sqrt(91)/(sqrt(7) - (sqrt(378)/sqrt(6) + sqrt(63))). -sqrt(13)/5 Simplify ((sqrt(190) - sqrt(190)1)-4)/(sqrt(120)/sqrt(300)). 0 Simplify (sqrt(150)/sqrt(5)5 - sqrt(30))/(sqrt(6) + 2sqrt(54)). 4sqrt(5)/7 Simplify (1 + (((2sqrt(104))/sqrt(8))2 + sqrt(13) - sqrt(13)))-6. -318 Simplify (sqrt(288) - (sqrt(288) + -3))*2 - sqrt(4)/sqrt(2)6. -6sqrt(2) + 9 Simplify -2 + sqrt(12)/sqrt(100). -2 + sqrt(3)/5 Simplify (-2 + ((sqrt(33)1 - sqrt(33)) + sqrt(33))/sqrt(11))*2. -4sqrt(3) + 7 Simplify (sqrt(102) - 2sqrt(102)1)/(sqrt(30)/sqrt(5)-1). sqrt(17) Simplify (2 + sqrt(192)-2)*2 - sqrt(30)/(((sqrt(90) - sqrt(10)) + sqrt(10))5). -961sqrt(3)/15 + 772 Simplify ((sqrt(117) + sqrt(117)-1)6)/(sqrt(225)-2). 0 Simplify -4(-1 + 1sqrt(637)). -28sqrt(13) + 4 Simplify -3 + (sqrt(68)2 + sqrt(68) - sqrt(68))/sqrt(4). -3 + 2sqrt(17) Simplify ((sqrt(102)-2-5)/sqrt(6))2. 1700 Simplify sqrt(75) + (sqrt(75) + 2)-1 - (sqrt(75) + -1 + sqrt(75))6. -60sqrt(3) + 4 Simplify (sqrt(3) - 1sqrt(3)-2)-4. -12sqrt(3) Simplify (sqrt(448) + 0 + -6(1 + sqrt(7)))6. -36 + 12sqrt(7) Simplify sqrt(143)/(sqrt(11) + sqrt(99)/(3sqrt(9))). 3sqrt(13)/4 Simplify (sqrt(2) + 2 + 2)2 + -4. 8sqrt(2) + 14 Simplify 1 + (-1(-1 + sqrt(2)) + sqrt(2))2 + (sqrt(242) - (sqrt(242) + 0)). 2 Simplify (6(-1sqrt(91) + sqrt(91)))/(sqrt(875)/sqrt(5)). 0 Simplify ((sqrt(272) - -1sqrt(272)) + sqrt(425)-3)2. 833 Simplify ((sqrt(225)-5)/(sqrt(3) + sqrt(243)-1))2. 1875/64 Simplify (1sqrt(85)2 - sqrt(85))/(sqrt(25)/(-1sqrt(5)) - sqrt(5)). -sqrt(17)/2 Simplify (sqrt(891)2 + sqrt(891) + 5)2. 270sqrt(11) + 8044 Simplify sqrt(684)-3 - sqrt(19) - (sqrt(133)/(2sqrt(7)))*2. -19sqrt(19) - 19/4 Simplify (0 + sqrt(112) + 3)3. 9 + 12sqrt(7) Simplify -2 + sqrt(468) - (-3sqrt(1300) - sqrt(1300)). -2 + 46sqrt(13) Simplify (sqrt(250)-6)/(sqrt(2)-35). 2sqrt(5) Simplify (sqrt(68) + 4sqrt(68)6 + sqrt(68))/sqrt(4)-4. -104sqrt(17) Simplify ((2sqrt(119))/sqrt(7) - (sqrt(612)-2)*2) + -3. -2451 + 2sqrt(17) Simplify (-2 + sqrt(12) + 0)*2 - sqrt(12). -10sqrt(3) + 16 Simplify (sqrt(833) + sqrt(833) + -2)*2 - (-2sqrt(68))*2. -56sqrt(17) + 3064 Simplify -2sqrt(25)/(sqrt(20)/sqrt(4)). -2sqrt(5) Simplify ((sqrt(352) + sqrt(352)-2)/sqrt(8))/((sqrt(196) + (sqrt(196)1 - sqrt(196)) - sqrt(196) - sqrt(196)) + sqrt(4)). sqrt(11)/6 Simplify ((sqrt(18) - sqrt(2))*2 + -3 + -4 + sqrt(6)/sqrt(3))5. 5 + 5sqrt(2) Simplify (sqrt(3600)-2)/((sqrt(160)/sqrt(4))/sqrt(8)). -24sqrt(5) Simplify -3sqrt(1377)-4 + sqrt(1377). 117sqrt(17) Simplify sqrt(2736) - -53sqrt(2736) - sqrt(2736). 180sqrt(19) Simplify (sqrt(48)/sqrt(4) + 2)-1. -2sqrt(3) - 2 Simplify -1(0 + sqrt(11) + 0). -sqrt(11) Simplify (sqrt(800) + 2)*2. 80sqrt(2) + 804 Simplify (sqrt(26) - sqrt(156)/(sqrt(24)/sqrt(4)))/(sqrt(96)/sqrt(3)). 0 Simplify (sqrt(189)/(-2sqrt(7)))/sqrt(9) + 2. -sqrt(3)/2 + 2 Simplify (2sqrt(1134))/sqrt(2). 18sqrt(7) Simplify ((sqrt(7) + -1 + 2)3-4)2. 288sqrt(7) + 1152 Simplify sqrt(84)/sqrt(108) - (sqrt(175) - (sqrt(175) + -1 + sqrt(175)))*2. -176 + 31sqrt(7)/3 Simplify 0 + 3 + sqrt(441)/(sqrt(7) - sqrt(7)2). -3sqrt(7) + 3 Simplify (sqrt(539)3 - (sqrt(88)/(-1sqrt(8)))*2) + 5. -6 + 21sqrt(11) Simplify (sqrt(27) - (sqrt(243) + sqrt(243)-2))/((sqrt(90)2)/sqrt(10)). 2sqrt(3) Simplify ((sqrt(84) - sqrt(21))-6)/(2sqrt(147)). -3sqrt(7)/7 Simplify -3((sqrt(208) - (-41sqrt(208))*2) + -5	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.