Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
ter: -2621/4 or -654? -654 Which is smaller: 1 or 30/190117? 30/190117 Is 1.5 at least -2/845645? True Which is smaller: 0.0226925 or -2? -2 Are 31357 and 31358 equal? False Are -32781 and -32773 equal? False Which is smaller: 257 or -0.11? -0.11 Is 13407 at most as big as 13407? True Is 121 greater than 0.9574? True Which is smaller: -102087 or -102085? -102087 Is 2/11 smaller than -0.5037? False Is -119608/113 < -1057? True Which is greater: -12 or -4310/323? -12 Is -6 at most as big as 12603? True Which is smaller: -4887316 or -4887317? -4887317 Which is smaller: -4598 or -4648? -4648 Which is greater: 2122231 or 2122230? 2122231 Is -2962966 less than -2962964? True Which is greater: -1 or 1/1200859? 1/1200859 Which is greater: 18 or 4? 18 Are -163/9 and 48 equal? False Is 1222191 < 1222194? True Is -5012156 < -5012155? True Is 24363/341 >= 72? False Is 13189.67 greater than or equal to 1? True Which is greater: -831/7 or -90/11? -90/11 Is -204 at most -3277/16? False Is 161778 bigger than 161778? False Is 2978.9 greater than or equal to 4? True Is -212 != -24/877? True Is -1420 less than 455? True Is 424/2117 bigger than 0? True Which is greater: 27 or -7/11? 27 Which is smaller: 0 or 94150? 0 Which is greater: -2/32535 or -1? -2/32535 Which is smaller: -59022 or -59055? -59055 Which is bigger: 0 or -821547? 0 Which is greater: -1277/3 or -6.66? -6.66 Which is smaller: -434 or -483? -483 Is -59993 at most as big as -59993? True Is -1062167 not equal to -1062167? False Is -850 < -851? False Which is smaller: 4/410711 or 1? 4/410711 Which is smaller: 1166032 or 1166027? 1166027 Which is smaller: -1957 or -1958? -1958 Is -37967 < 2/31? True Which is smaller: 295.98 or -0.1? -0.1 Is -2/2075877 less than or equal to -1? False Is 55844/7 less than 7977? False Is -193369 < -193372? False Are -6190 and -62 equal? False Is -1708 equal to -1725? False Is -415 smaller than 11/6? True Is 66438 equal to -24? False Is 1/6 not equal to 18228? True Is -1/4 <= -41001? False Which is bigger: 2908 or 2885? 2908 Is -145998 not equal to -145996? True Is -2410 at most -2285? True Is 883/3 less than or equal to -3? False Which is smaller: 3/9277816 or 1? 3/9277816 Is 5574 > 5571? True Is 4/9 at least 1712? False Are 0.14 and 0.4787 non-equal? True Is 2/5324769 at most 0? False Is -3431753/3 at most as big as -1143917? True Which is smaller: 10390 or 10359? 10359 Is 0 at most -1949/2510? False Which is greater: -2751 or -1842? -1842 Which is smaller: 1/637886 or 0? 0 Which is bigger: -171 or 1276? 1276 Is -77479 not equal to -77479? False Which is smaller: -6.6 or 641/4? -6.6 Which is smaller: 69/31 or -0.022? -0.022 Which is smaller: 370 or 804? 370 Is -10944 bigger than -109437/10? False Is 1 > 33049? False Which is smaller: 41096 or 41094? 41094 Is 3747 >= 101176/27? False Which is bigger: 114.5 or 20? 114.5 Is -2/589 at least as big as 25? False Do 1 and -6/2621 have the same value? False Which is smaller: 118103 or 118101? 118101 Which is bigger: 454 or 10455/23? 10455/23 Is -1759 < -6397? False Which is greater: -1 or -4/9375233? -4/9375233 Are 7683 and 7683 unequal? False Which is smaller: -502 or -269? -502 Which is smaller: -7375 or -12? -7375 Is 6 smaller than 519/104? False Which is smaller: 18576 or 18581? 18576 Which is greater: -29/3 or 348? 348 Which is smaller: 1981.8 or -13/4? -13/4 Which is smaller: 54 or 2550? 54 Are 313 and 0.0068 nonequal? True Are -2/17547 and -39 equal? False Is 1 >= 11/36893? True Does 1 = -2/8459? False Which is bigger: -33/23563 or -1? -33/23563 Which is greater: -81222 or -243662/3? -243662/3 Which is smaller: -593017 or -593004? -593017 Which is greater: 191288/3 or 63764? 63764 Is 186835 at most as big as -1/2? False Which is smaller: -1107 or 145? -1107 Is 49565 > -1? True Is 2/903 at most as big as 3? True Is 3 at most as big as 5/348? False Which is smaller: -120/9991 or 0? -120/9991 Which is bigger: -732 or -670? -670 Which is bigger: 4/4510595 or -1? 4/4510595 Which is bigger: 2/490123 or 1? 1 Is 1358 > 1367? False Is -7 smaller than 3634/7? True Does 215/33 = 13? False Is 3896.24 at least as big as -2? True Is -10/84791 >= -1? True Do -7.88 and -0.0378 have the same value? False Is -1236741/2 less than or equal to -618372? False Is -150 >= -3445/23? False Which is smaller: -456315 or -456317? -456317 Is 9/127 less than 1? True Which is greater: 3 or 5182/3295? 3 Which is bigger: 2226/5 or 30? 2226/5 Are -8 and -1274/157 equal? False Which is greater: 0 or -244/7115? 0 Is 5 <= -2799? False Is -95232 at most -95232? True Which is greater: 1057/790 or 2? 2 Is 0 >= -28/16913? True Is -28895 bigger than -28897? True Are 0 and -112/419 nonequal? True Is -23404 less than -23404? False Which is bigger: -0.12 or 17301.7? 17301.7 Is -4183/72 > -59? True Is -30800 greater than -215605/7? True Is -175 at least as big as -51984/295? True Which is greater: -22 or 25.4? 25.4 Which is bigger: 1139 or 1334? 1334 Does 40 = 104/71? False Is -111 > -3414/31? False Is -1419 equal to -1233? False Which is greater: 10 or 1045? 1045 Which is greater: 149473 or 149461? 149473 Which is smaller: -12510 or -12511? -12511 Is -4.1 at most -0.01236? True Is 0.2 >= 30336/19? False Is 706 at least 751? False Is -227 <= -3081? False Which is smaller: -1265/304 or -4? -1265/304 Which is greater: 23920 or 23917? 23920 Is -42/227 less than -43? False Is -1019 bigger than -36? False Which is greater: 1 or 135/1291? 1 Is 52789 equal to 52790? False Is 0 bigger than -8/9157? True Is 707 smaller than 2/47? False Is 0 greater than 68/291521? False Are 108/3341 and -1 non-equal? True Do -212878 and -425757/2 have the same value? False Is -85941 < -85938? True Which is greater: 78 or 7476/97? 78 Which is smaller: -5723/139 or -41? -5723/139 Which is bigger: -1/4855 or 0? 0 Is 100/25949 at most 0? False Which is bigger: 58508 or -6? 58508 Which is smaller: 92/28559 or 0? 0 Are -112/1283 and -1 non-equal? True Which is smaller: 1 or 6816166? 1 Which is smaller: 40806/23 or 1774? 1774 Which is bigger: 1 or -6/6017? 1 Which is smaller: -0.14623 or 0.4? -0.14623 Is 0.1 <= 718717? True Which is greater: -170/6237 or 0? 0 Which is smaller: 17012 or -1/3? -1/3 Does 0 = -21/4421? False Is 257483 less than or equal to -1/2? False Are 354887 and 354887 non-equal? False Is -5115 less than -5395? False Are -1 and 14/43423 equal? False Which is smaller: -48288 or -338024/7? -338024/7 Which is smaller: -1/2614450 or -1? -1 Is 28240 greater than 28240? False Which is bigger: 4 or 5727? 5727 Do 41/2504 and -1 have the same value? False Is 37 bigger than 2047? False Is -142313 > -142313? False Which is smaller: -1 or -66/58375? -1 Which is smaller: -0.2 or -11/818? -0.2 Is -32 <= -0.1912? True Are -0.0017 and 12686 equal? False Are 68941 and 68939 unequal? True Is -6 smaller than -243779? False Are 2915 and 18 non-equal? True Which is bigger: -2/204407 or 0? 0 Is -42/3559 not equal to -1? True Which is greater: 11854 or -3/5? 11854 Is 1631 at most as big as -14? False Which is smaller: -24912/29 or -1? -24912/29 Which is bigger: -348793 or -348795? -348793 Is 1 greater than or equal to -49/15945? True Is 0 smaller than -24/24173? False Is 1419600 less than or equal to 1419599? False Which is bigger: 2/23453 or 1? 1 Which is bigger: -0.3 or -63556? -0.3 Which is smaller: 1 or 7/177522? 7/177522 Is 1 greater than or equal to -250/699? True Which is greater: 65999 or 66000? 66000 Are -10171/5 and -1.7 equal? False Is 2 != -3612538? True Is -236/33595 at most as big as -1? False Which is smaller: 2839 or 1382? 1382 Which is greater: -1 or -6/80995? -6/80995 Which is bigger: 2/21319 or 40? 40 Is 34597 at least as big as 34585? True Is -194/5 not equal to 142? True Does 751514/9 = 83503? False Are -143947 and -143955 unequal? True Which is greater: 1826298 or 1826297? 1826298 Does 105/5396 = 0? False Is -13251364 at most as big as -13251364? True Which is bigger: -240 or 118? 118 Is -94256 bigger than -94259? True Which is smaller: -26 or -8754/335? -8754/335 Which is greater: -956 or -655? -655 Which is greater: -1 or -76/157751? -76/157751 Which is smaller: 1/3506 or 520? 1/3506 Are 21176/19 and 1116 equal? False Are -3/47495 and 1 non-equal? True Which is greater: 90796	{ "pile_set_name": "DM Mathematics" }
b2 + fb*3 + ab*4 + ub and give a. -10 Express -9p3 - p4 + 9p*3 + (-4p + 0p + 2p)(0p + 2p3 + 0p) - 2p4 + 0p*4 + 0p*4 in the form qp + bp4 + tp*3 + l + jp*2 and give b. -7 Rearrange -36q + 34q - 8q*2 - 3q*2 - 4q*2 to the form i + cq*2 + xq and give x. -2 Rearrange -2c + 9c*2 + 7c2 - c4 - 2 - 12c2 to the form nc*4 + j + xc*2 + oc + ic3 and give j. -2 Rearrange -v3 - 8v*2 + 8v*2 + 2v*4 + 6v*2 to d + qv*3 + hv*4 + tv*2 + jv and give j. 0 Express ((0 + 4 - 6)(-3q + 3q - q) - 4 + 4 + 2q)(4 + 2 + 2) as x + yq and give x. 0 Rearrange -6 + 2x2 + 2x*3 + 6 + 3x*2 to the form bx*3 + ox*2 + sx + d and give b. 2 Rearrange -18v - 8v + 14v to the form kv + x and give x. 0 Express 8y2 + 6y*2 - 15y*2 - y + 4y*2 in the form hy + wy2 + n and give h. -1 Express (2u + 3 - 3)(4 - 4 + 1) - 4u + 2u + u + 2u - u + 2u + 3u - 3 + u - 5u in the form b + xu and give x. 3 Express (1 + 1 + 0 + (2 - 3 + 2)(-6 + 3 + 2) - 6 + 8 - 5)(-4 + 4 + 2d3) in the form qd*3 + zd + m + wd2 and give q. -4 Express (-m2 + m2 + m2)(3m + 2m - 3m)(1 + 5 + 0) as jm2 + w + im*3 + lm and give i. 12 Rearrange 34x3 - 26x*3 - 6 + 2x*2 + 1 to vx*3 + cx + j + wx2 and give w. 2 Rearrange (-4g*2 - 2g*2 + 8g*2)(0g2 + 4g*2 - 2g*2) + 4g*4 + 4g*4 - 3g*4 to qg*3 + o + tg + kg2 + ug*4 and give u. 9 Express 2v*4 - 3v*4 + 3v*4 + (-19 + 19 - 14v*2)(-4v2 - 3v*2 + 5v*2) as k + bv*2 + ov*4 + xv + gv3 and give k. 0 Express -4i + 3i + 3i + (0 - 1 + 2)(-2i + 2i + 2i) - 5i + 2i + i + (-i + i + 2i)(-4 + 3 + 3) - 16 + 4i + 16 as n + li and give l. 10 Rearrange -2 - 2c + 14 - 2 + (0c - 3c + 6c)(3 - 4 - 1) to the form q + dc and give q. 10 Express m - 2m + 5m2 - m4 + 0m2 + 2m*3 - 2m*2 as zm*3 + xm + dm4 + sm2 + l and give d. -1 Rearrange 43 - 38 - h3 + 0h3 to i + wh*2 + zh + vh3 and give v. -1 Rearrange -14g + 2 + 8g + 4g - 7g2 to the form v + kg + dg2 and give v. 2 Express -37m + 15 - 22 - 2m3 + 6 as z + cm*3 + jm*2 + pm and give z. -1 Express -2351 + x2 + 2351 + x2 as zx + mx*2 + i and give m. 2 Rearrange (-1 - 1 + 0)(g*3 + 2g*4 + 559 + 552 - 1125) to the form a + ng + wg2 + rg*4 + pg*3 and give a. 28 Rearrange (6 - 3 - 2)(0o - 2o + o) - 9o + 18 - 18 + 3o + o - 3o to k + so and give s. -9 Rearrange 4c2 + 19 - 6c*2 + 14 to the form v + dc*2 + sc and give d. -2 Express b2 - b2 - 3b2 + 1 + 5b*3 as o + tb*2 + yb + zb3 and give t. -3 Express (-i + 0i - i)(-3 + 1 + 1) - 103 - 4i + 5i + 53 in the form mi + s and give m. 3 Rearrange 2f3 - 3f*3 - 4f*3 + (2f + f + 3f)(f*2 - 3f*2 + 0f*2) to if*2 + af*3 + d + gf and give a. -17 Express -2m - 14m*2 + 10 - 12 + 4m + 0m in the form lm + bm2 + n and give b. -14 Rearrange 2f + 3 - 3 + (5 - 1 - 3)(4f - f - 4f + (-2 + 4 - 3)(-f - 3f + 2f)) - 9f + 29 - 29 to i + kf and give i. 0 Rearrange t*3 - 17t + 13t + 2t - 1 to ht2 + j + pt*3 + dt and give j. -1 Express (3 + n - 3)(5 - 2 - 5) - 3n + 3n + n - 2n + 0n + 3n + (0 + n + 0)(-2 - 1 + 2) - n + 3n - 4n as q + ln and give l. -3 Express (10 + 3i - 10 + (-2 + 2 - 2i)(1 - 5 + 2) + 2i - 3 + 3)(-2 + 0 - 1) as zi + q and give z. -27 Express (-18n - 6n + 2n + (-n + 3n + 0n)(-2 + 5 - 1) - 3 - n + 3)(2n + 0n - 5 + 3) as jn*2 + gn + f and give j. -38 Rearrange -20h + 24h - 11h to the form ch + j and give c. -7 Rearrange 0i + 20i*3 + 2i + 1 - 2i2 - 41i*3 + 19i*3 to the form li*3 + ji*2 + g + fi and give l. -2 Rearrange 0n2 - n2 - 2 - 1 + 0 to the form q + jn*2 + cn and give j. -1 Express 3p4 - 15p*3 - 5p + 3p + 17p*3 - 4 in the form qp + cp4 + tp*2 + b + sp*3 and give q. -2 Rearrange -2d*2 - 10d + 7d3 + 23d - 6d3 to rd + vd2 + nd*3 + s and give r. 13 Rearrange 14q + 0q + 37q to r + fq and give f. 51 Express 1 - 8i + 0 - 1 in the form t + vi and give v. -8 Rearrange (5 - 3 - 4)(2i2 - 3i2 - i2) + (2 - 1 + 1)(-1 + 1 - 3i*2) to the form oi + ai2 + t and give a. -2 Express 20c - 127c3 - 2c*2 - 135c*3 + 261c*3 as m + uc + nc2 + wc*3 and give n. -2 Rearrange 3v*3 + 0v + 4v3 - 4v to gv2 + hv*3 + pv + l and give p. -4 Rearrange -4r + 5 - 5 to c + gr and give g. -4 Rearrange -18 - 3f2 + 11 + f2 - 2f*3 to tf*2 + nf + kf3 + b and give b. -7 Rearrange (42 - 42 - 6y*4)(-6 - 1 + 5 + 0 - 4 + 3 + (0 + 3 - 4)(-2 + 3 + 0) + 1 + 3 - 3)(-2 + 1 - 2) to p + zy + gy*3 + ry*4 + ty*2 and give r. -54 Express -54 - s + 54 - 21s*2 as j + rs*2 + us and give u. -1 Express (-o*3 + 5o*3 - 2o*3 + (2 + 1 - 5)(-2o3 - 3o*3 + 4o*3))(-964o + 0 - 2 + 883o) as t + io3 + bo + co2 + so*4 and give i. -8 Express (-3o + 0o + o)(4 - 5 + 2)(-3o + 4o + 0o) + 0 + 0 + 2o2 - 6o*2 + 8 - 8 + (0o + 6o - 4o)(-3o - 2o + 6o) as q + io + fo*2 and give f. -4 Express (m - m - m)(-m + 0m + 2m) + m*2 + 5m*2 - 3m*2 + (m + 3m - m)(-m + 2m - 5m) in the form pm*2 + s + fm and give p. -10 Express -5z + 3z + z*2 - z + 3z*2 in the form t + kz*2 + fz and give k. 4 Express -259o2 - o4 + 243o2 + o3 + 0o4 + o as yo + zo3 + ho*4 + uo*2 + t and give z. 1 Rearrange (-1 + 4 - 2)(-174c + 6c*2 + 174c) + c*2 + 0c + 0c to vc + oc2 + f and give o. 7 Rearrange ((0 - 1 - 2)(-2f + 0f + f) - f + 3f - 4f)(5 - 4 + 2f - 3) to s + zf2 + cf and give z. 2 Express (5h - 2h + h + (4h - 3h - 2h)(0 - 5 + 6) - 2h + 2h + 2h)(-1 - 3 - 2) as r + dh and give r. 0 Express -3a*2 + 2a*2 - 163a - a*2 + 27a as da2 + m + za and give d. -2 Rearrange (-2 + 1 + 3)(-4v*4 - 7v*4 + 4v*4) + (v + 0v - 3v)(-2v2 - v3 + 2v*2) to the form tv*2 + kv + m + wv4 + nv*3 and give w. -12 Rearrange (-4 + 4 + 6w*3)(-5 - 5 + 0) to jw3 + y + gw + rw2 and give g. 0 Express 4g + 3 - 3 + g*2 in the form q + hg*2 + ug and give u. 4 Express -13j + 8j + 2j2 + 1 - 1 as nj + kj2 + c and give k. 2 Rearrange 5m*3 + 195m*2 - 9m - 195m2 to cm + zm2 + i + nm*3 and give n. 5 Rearrange (r - 3r + 0r)(576r + 568r - 1 - 1084r) to the form ir + br2 + l and give b. -120 Rearrange (78c*3 - 160c*3 - 36c*3)(-2 + 2 + 4c) to bc*3 + l + ac*4 + dc + hc2 and give a. -472 Express (-16q + 6q - 11q)(0q*3 - 3q*3 + 0q*3) in the form oq + i + vq2 + yq*3 + kq*4 and give k. 63 Express (3p*4 + p - p)(3 + 0 - 2) + 7p4 - 3p + 2p + 2p as ip + xp*3 + a + dp*4 + up*2 and give d. 10 Express (1 - 5 - 2)(-7g + 6 - 6) as c + og and give o. 42 Rearrange -6w2 - 2 + 2 + 10w*2 to aw + rw2 + j and give r. 4 Rearrange w3 + w3 - 6w*3 + (2w + 2 - 2)(-3w - 5w + 9w)(-3 + 4 - 2)(3 - 3w - 3) to rw*2 + s + mw + fw3 and give f. 2 Rearrange 0f*2 - 6f*2 + 6f*2 - 6f*2 - 7f*3 to vf*3 + z + nf + if2 and give n. 0 Rearrange 23 - 4a - 8a2 - 23 to ca*2 + q + da and give d. -4 Express (u - 2 + 2)(-2u + 6u + 5u) + 2 + u*2 - 2 - u + u - 3u*2 in the form f + ku + pu2 and give p. 7 Express -2w*2 - w + w + 1 + 2w*4 + 3w*2 in the form gw*2 + dw + k + cw4 + jw*3 and give c. 2 Express -3i*4 - 1 + 2i*3 - 7i*4 + 0i3 - i3 as j + yi4 + wi*3 + gi + ki2 and give g. 0 Rearrange -l + l - 5l*2 - 4l*2 to the form s + cl*2 + ml and give c. -9 Express -2 - 12y - 25y + 69y as o + wy and give w. 32 Express 4 + 12 - 3 + q*3 as l + uq + xq3 + mq*2 and give x. 1 Express i + 115 + 4i*4 - 114 + i as ti*3 + di*2 + v + mi*4 + ki and give v. 1 Rearrange 46w2 - 137w*2 + w + 46w*2 + 9 + 47w*2 to the form q + iw + xw2 and give q. 9 Rearrange 1964x - 1 - 41x2 - 1964x to the form nx + kx*2 + u and give k. -41 Rearrange -1 - 7f + 1 + 22f to the form y + sf and give s. 15 Rearrange 2j2 - 3j*3 + 2j*3 - 3 + 7j*4 - 3j*4 to q + cj + vj2 + lj*4 + yj*3 and give q. -3 Express 4 - 2t*2 + 0 + t - 15 - 14 as u + zt*	{ "pile_set_name": "DM Mathematics" }
- 3. Let s(j) = -4 + 2j2 + j + 7j + 14 - j*2. Let i be s(-7). Determine f(i). 3 Let d(p) = -4p + 3. Let h(q) be the second derivative of 11q3/6 - 9q*2/2 + 4q. Let a(c) = -17d(c) - 6h(c). Determine a(-4). -5 Suppose -h - m = 4m - 27, -7 = -h - m. Let d(y) = 3y + 0y2 + 5 - yh + 0. Suppose 3k - 2 = 4u - 12, 2k + 16 = 5u. What is d(u)? 1 Let k(a) = 5a*2 + 2a - 1. Let v be k(1). Suppose -v = -0w + 2w. Let i(g) = g - 1. What is i(w)? -4 Let t(n) = 4 + 2n + 3 - 3 - n - n2. Determine t(0). 4 Let f be (-190)/6 + 2/(-6). Let y be f/(-18) + 2/9. Let m(x) be the first derivative of -x4/4 + x3/3 - x2/2 + 2x - 37. Determine m(y). -4 Suppose -f - x + 2 - 6 = 0, 0 = 2x - 4. Let o(q) = q + 7. Give o(f). 1 Let d(p) = p2 - p - 1. Let s(o) = 3o*2 + 4o - 16. Let t(i) = 4d(i) - s(i). Give t(9). 21 Let m(w) be the second derivative of -w4/12 - w3/3 - w2/2 + 2w. Suppose -3y = -p - 1, 8y = 4y + 4. Determine m(p). -9 Let x(m) = -14m - 38. Let o(w) = 5w + 0w + 15 - 2. Let b(d) = -17o(d) - 6x(d). Determine b(0). 7 Let k = 25 + 0. Suppose -k = 6q - q. Let y(v) = -v3 - 5v + 5v - 2v - 7 - 5v2. What is y(q)? 3 Let w(g) = -g2 + 6g - 5. Let i be w(5). Let m(f) = 2f2 + 2f + 7. Let b(t) = 53t2 - 1 - 52t*2 + t + 0. Let h(k) = 3b(k) - m(k). What is h(i)? -10 Let u be (0/3 - -1) + 3. Let f(m) = 3m2 + 12m + 10. Let i(r) = -2r2 - 6r - 5. Let b(s) = -3f(s) - 5i(s). Calculate b(u). -13 Let u(a) = 3a + 4. Let v(q) = q3 + 2q*2 - 2q - 2. Let f be v(-2). Suppose 4x - t - 1 = 0, 4x = -3t + ft + 7. Suppose 5z + x = -19. Determine u(z). -8 Let l(y) = y3 + 2y + 3. Suppose 21 = -3q + 2q + 3n, 0 = n - 5. Let u = q + 4. What is l(u)? -9 Let o(s) = s3 + 6s*2 + s + 2. Suppose -3b + b = 40. Let y = b - -14. What is o(y)? -4 Let c(o) = -o - 1. Let p(d) = 2d + 1. Let y(r) = c(r) + p(r). Let u be y(5). Suppose -5x - 10 = ua, -4x + 13 + 7 = -3a. Let i(w) = 4w + 2. Determine i(x). 10 Let j(k) be the second derivative of k*3/2 - 3k*2/2 + 20k. What is j(3)? 6 Let i(u) = -u*3 + 7u*2 - 6u - 5. Suppose -70 = 4h - 6h. Let z be 10/h + (-40)/(-7). Determine i(z). -5 Suppose -13 = 4a + 3. Let p(t) = -3 + t2 + 0t + 5t - 2t. Calculate p(a). 1 Let r(x) = 4x - 10. Let f(q) = 2q - 5. Let z(h) = -13f(h) + 6r(h). Calculate z(-4). 13 Let c(d) be the second derivative of -d*2 + 1/6d*3 + 0 - 4d. Calculate c(6). 4 Let c(n) = -1 - 7n + 1 + 8n. Let r be (1 - (-2 + 4))1. Let m = 1 - r. Calculate c(m). 2 Let v(f) = -2 + 3f*3 - 2f*3 + f - 3f. Suppose 0a = -a + 6. Suppose 2g - 8 = ag. What is v(g)? -6 Let t(d) be the third derivative of d6/24 + d4/24 - 3d*2. Let j = 3 + 0. Suppose -ja + 4 = a. Determine t(a). 6 Let a(h) = -h3 + h2 + h - 7. Let k(o) = -2o + 5o - o*2 + 1 - 3o. Let f(j) = -a(j) - 5k(j). Suppose 3y = y + 4, 5d = -3y - 14. Give f(d). 6 Let w(k) = -k3 - k2 + k + 5. Let z(a) = -a*2 - 8a + 9. Let x be z(-9). Give w(x). 5 Let f(s) be the first derivative of -s*4/4 + 2s3/3 - s2 + s - 22. Calculate f(2). -3 Let n = 5 + -3. Let l(q) = q*2 - 2q - 2. Let a(h) = 2h2 - 4h - 5. Let i(y) = 2a(y) - 5l(y). What is i(n)? 0 Let s(t) = t3 - t2 - 3t - 4. Let q(l) = l2 - 9l - 10. Let h be q(10). Suppose -6 = -hn - 2n. Give s(n). 5 Let r(i) = i - i + 0i + i2 + 5 - 10i. Calculate r(10). 5 Let n(u) = -u - 6. Let d be -2((-36)/(-8) + -3). Give n(d). -3 Suppose -5m + 14 = 4b, -11 = -b - 7m + 2m. Let x(h) = -7h*2 - h + 1. Let p(a) = -1 + 3a + 7a2 + 2a - 4a. Let u(n) = 5p(n) + 4x(n). Determine u(b). 7 Let g(x) = -x2 + x. Let m(t) = -5t*2 + 6t - 7. Let j(a) = 6g(a) - m(a). Suppose 0 = 2l - 2 - 6. Suppose 0c + c = 2n + 10, -4c + ln = -20. Give j(c). 7 Let m(i) be the third derivative of -1/12i4 - 1/6i*3 + 0i - 5i2 + 0. Calculate m(-1). 1 Suppose -9a = -7a - 6. Suppose 3s = -aq, -5 - 3 = -4q - 2s. Let l(t) = -t. Calculate l(q). -4 Suppose c = -4c - 35. Let g(k) = 2k + 9. Calculate g(c). -5 Let o(f) = f + 2. Suppose -5i + 5x = -45, -3i - 3x = -0 + 3. Let q = 1 + i. Suppose 8z = 3z - q. What is o(z)? 1 Let u = -20 - -35. Suppose l + u = 4l. Let q(z) = z*3 + 0z + 1 - z - 3z2 - 2z*2. Calculate q(l). -4 Let w(y) = 1 + 1 + 0 - y. Let m(p) = -2p + 5. Let g be m(4). What is w(g)? 5 Let c(q) be the second derivative of q*4/12 + 5q*3/6 - 3q*2 - 6q. What is c(-5)? -6 Suppose 6h - y - 29 = 3h, 4y + 52 = 4h. Let v(o) = o - 6. Let n be v(h). Let c(a) be the third derivative of -a5/60 - a3/3 + a2. Calculate c(n). -6 Let x(m) be the first derivative of m3/3 + 3m2 - 4m + 3. Let a = 2 + -8. Let n be x(a). Let u(k) = 2k + 1. Determine u(n). -7 Let v(l) = 8l*3 - 2l*2 - 11l - 6. Let b(u) = -7u3 + 2u*2 + 9u + 5. Let y(o) = 6b(o) + 5v(o). Suppose 0 = a + 5z + 4, -a - 2z = 1. What is y(a)? -1 Let s(p) be the first derivative of -p*4/4 - 7p*3/3 + 4p*2 + 3p + 8. What is s(-8)? 3 Let t(a) = a*2 - 2a. Let g be 4(-1 - 0)-1. Calculate t(g). 8 Suppose 0 = 5l + 1 - 11. Let m(z) = -13z*3 + 7z*2 - 12z + 9. Let b(y) = 3y3 - 2y*2 + 3y - 2. Let c(i) = 9b(i) + 2m(i). Determine c(l). -2 Let k(m) be the third derivative of 0m + 3m*2 + 0 + 1/60m*5 + 1/3m*3 + 11/24m4. Let n be k(-11). Let o(u) = u2 - 3u - 2. Determine o(n). -4 Let c(k) = 6 + 5k - 9k - 3k + 8k. Give c(-6). 0 Let u(f) = -2f*3 + 7f*2 - 73f + 3f3 + 79f. Calculate u(-6). 0 Suppose 4l + 2 = 6l. Let x(o) = -4o2 + 2o - 1. Give x(l). -3 Let d be 3 + (-11)/4 - (-1)/(-4). Let q(b) be the third derivative of -2b2 + 0b + d - 1/6b3 + 1/8b*4. What is q(-3)? -10 Let x(l) be the third derivative of 1/24l*4 + 0 + 1/60l*5 + 0l*3 + 0l + 2l2. Give x(-3). 6 Let k = -7 - -1. Let p(t) = -4t - 4. Let j(g) = g + 1. Let o(i) = kj(i) - p(i). Suppose -8d = -3d + 20, 4x + 20 = -2d. What is o(x)? 4 Let h(u) = u3 + 4u*2 - 2u + 4. Suppose -3j = 7 + 2. Let x(d) = d3 + 2d*2 - 2d - 1. Let y be x(j). What is h(y)? 12 Let f(c) be the third derivative of c5/30 + c4/8 - c*3/3 + 10c*2. What is f(2)? 12 Let c(n) = 2n*2 + 2n - 2. Let m be c(-2). Suppose 5f = -3i + 20, -4f - i + 10 = 1. Let p = m - f. Let t(y) = 3y*3 - 2y2 + 1. Give t(p). 2 Let w(b) be the second derivative of -b3/6 - 7b2/2 + 5b. Calculate w(-6). -1 Let l(z) = 7z2 + 7z - 7. Let y(u) = u*2 + u - 1. Let q(n) = -l(n) + 6y(n). Let m(i) = 4i2 + 8i + 1. Let j(x) = m(x) + 5q(x). Give j(5). -4 Let z(s) = s2 + 5s - 2. Suppose 2d = -4l - 6, 5d + 7 = -4l + 2l. Let m be d/5 + 114/(-30). Give z(m). -6 Let b = -93 + 94. Let l(x) = -11x*2 - 1. What is l(b)? -12 Let x be 1 - (1-6 + 2). Let p(j) = -7 + 7j - 2j2 + j2 + 3. Determine p(x). 6 Let g(c) be the second derivative of c6/180 - c5/40 + c4/12 + c3/6 + 2c. Let i(n) be the second derivative of g(n). Give i(2). 4 Suppose 4s - l + 4l = 2, 2l = 4. Let z be (2 + (s - -2))2. Let i(p) = -2p*2 - 4 - 3 - 2p*3 + 2p + z. Determine i(1). -3 Let l(v) be the third derivative of -v6/120 - v5/10 + 5v3/6 + v2. Let b = 13 + -19. Give l(b). 5 Let s(y) = y2 - y - 2. Let i be s(2). Let k be (-3)/((i - -1)1). Let w(x) be the third derivative of x4/12 + x3/3 - 2x2. Calculate w(k). -4 Let v(y) = -y2 - y - 7. Let g(t) = -9 - 4t - 3t - 3t - t2. Let p(k) = k2 + 12k + 2. Let l be p(-11). Let r be g(l). Determine v(r). -7 Suppose -16 = -4y + 12. Suppose 2p = 4i - 23 - y, 0 = 4i - p - 25. Let b(r) = -r + 8. Calculate b(i). 3 Let c(y) = -2y + y + 5 - 11. What is c(-4)? -2 Let p(a) = a. Let j(d) = -2d - 1. Let t(g) = -2j(g) - 3p(g). Give t(-4). -2 Let s = 2 - 2. Let l(g) = -g3 - 2g*2 + g + 1. Let h(c) = 2c*3 + 3c*2 - 2c - 3. Let b(a) = -3h(a) - 5l(a). Calculate b(s). 4 Let a(v) = -2v - 8. Let t(d) = 6d + 23. Suppose 5r + 44 = r. Suppose 0 = -s + 3s + 8. Let b(x) = ra(x) + st(x). What is b(-5)? 6 Let n(s) = s*3 + 2s*2 + 1. Let c be n(-2). Let b(t) = 1 + 4t - 3t + 9t*2 - 2t. Give b(c). 9 Let c(u) = u3 - u2 - u + 2. Suppose -2h - 3n = 21, 2n - n = 5h + 27. Let d be 2/h - (-14)/6. What is c(d)? 4 Suppose o + 4q = 13, -5q + 4 = -16. Let a(s) = s*3 + 2s**2 - s +	{ "pile_set_name": "DM Mathematics" }
n 3302962 is divided by 612. 610 Calculate the remainder when 6741 is divided by 2212. 105 What is the remainder when 371320 is divided by 449? 446 What is the remainder when 92882 is divided by 76? 10 What is the remainder when 2740 is divided by 47? 14 Calculate the remainder when 12408 is divided by 365. 363 Calculate the remainder when 2197211 is divided by 3. 2 What is the remainder when 319356 is divided by 63866? 26 What is the remainder when 46240 is divided by 2312? 0 What is the remainder when 343871 is divided by 7475? 21 Calculate the remainder when 4743 is divided by 296. 7 Calculate the remainder when 9342 is divided by 1037. 9 What is the remainder when 22592 is divided by 230? 52 What is the remainder when 9877 is divided by 1633? 79 What is the remainder when 18592 is divided by 52? 28 Calculate the remainder when 547 is divided by 139. 130 What is the remainder when 16722 is divided by 431? 344 Calculate the remainder when 16234 is divided by 1360. 1274 Calculate the remainder when 51577 is divided by 163. 69 Calculate the remainder when 281261 is divided by 22. 13 What is the remainder when 10877 is divided by 259? 258 Calculate the remainder when 16398 is divided by 5. 3 What is the remainder when 391 is divided by 119? 34 What is the remainder when 251803 is divided by 782? 781 Calculate the remainder when 2855 is divided by 2289. 566 Calculate the remainder when 240928 is divided by 60223. 36 Calculate the remainder when 24535 is divided by 193. 24 What is the remainder when 1337 is divided by 187? 28 Calculate the remainder when 1573 is divided by 98. 5 What is the remainder when 675 is divided by 229? 217 What is the remainder when 278890 is divided by 61? 59 What is the remainder when 203194 is divided by 2309? 2 What is the remainder when 4462 is divided by 1115? 2 Calculate the remainder when 10290 is divided by 12. 6 Calculate the remainder when 142670 is divided by 258. 254 Calculate the remainder when 4046 is divided by 8. 6 What is the remainder when 411559 is divided by 27? 25 What is the remainder when 72061 is divided by 17890? 501 What is the remainder when 5644 is divided by 39? 28 What is the remainder when 1548 is divided by 177? 132 Calculate the remainder when 1375 is divided by 309. 139 Calculate the remainder when 24681 is divided by 132. 129 What is the remainder when 5923 is divided by 2905? 113 What is the remainder when 2180 is divided by 433? 15 Calculate the remainder when 11335 is divided by 285. 220 Calculate the remainder when 762 is divided by 97. 83 What is the remainder when 1263505 is divided by 111? 103 What is the remainder when 1919 is divided by 383? 4 What is the remainder when 270828 is divided by 95? 78 What is the remainder when 631071 is divided by 1635? 1596 What is the remainder when 5973 is divided by 231? 198 Calculate the remainder when 14017 is divided by 14. 3 Calculate the remainder when 56099 is divided by 790. 9 Calculate the remainder when 659998 is divided by 150. 148 Calculate the remainder when 17126 is divided by 99. 98 What is the remainder when 162325 is divided by 413? 16 Calculate the remainder when 5783 is divided by 477. 59 Calculate the remainder when 12107 is divided by 21. 11 Calculate the remainder when 3534 is divided by 413. 230 What is the remainder when 43606 is divided by 46? 44 Calculate the remainder when 4189 is divided by 75. 64 Calculate the remainder when 18660 is divided by 6215. 15 What is the remainder when 1362601 is divided by 38? 35 Calculate the remainder when 5687 is divided by 263. 164 Calculate the remainder when 10328 is divided by 45. 23 Calculate the remainder when 6764 is divided by 957. 65 What is the remainder when 394852 is divided by 56406? 10 Calculate the remainder when 7044 is divided by 708. 672 Calculate the remainder when 55917 is divided by 20. 17 What is the remainder when 38591 is divided by 2411? 15 Calculate the remainder when 642 is divided by 608. 34 Calculate the remainder when 1288 is divided by 66. 34 Calculate the remainder when 3295923 is divided by 306. 303 What is the remainder when 58993 is divided by 11? 0 Calculate the remainder when 22897 is divided by 1092. 1057 Calculate the remainder when 4458 is divided by 1027. 350 Calculate the remainder when 331737 is divided by 58. 35 Calculate the remainder when 17120 is divided by 350. 320 Calculate the remainder when 1249 is divided by 83. 4 What is the remainder when 1666 is divided by 639? 388 What is the remainder when 31622 is divided by 472? 470 Calculate the remainder when 34791 is divided by 2271. 726 What is the remainder when 40782 is divided by 10195? 2 What is the remainder when 709 is divided by 150? 109 What is the remainder when 1199 is divided by 90? 29 What is the remainder when 87846 is divided by 31? 23 Calculate the remainder when 841426 is divided by 841415. 11 What is the remainder when 99325 is divided by 24831? 1 Calculate the remainder when 1972869 is divided by 212. 209 What is the remainder when 367289 is divided by 165? 164 Calculate the remainder when 1889 is divided by 421. 205 Calculate the remainder when 18113 is divided by 43. 10 What is the remainder when 771243 is divided by 172? 167 Calculate the remainder when 56785 is divided by 617. 21 What is the remainder when 10068 is divided by 55? 3 What is the remainder when 467805 is divided by 176? 173 Calculate the remainder when 782332 is divided by 1766. 1760 What is the remainder when 11754 is divided by 80? 74 Calculate the remainder when 79345 is divided by 204. 193 What is the remainder when 349989 is divided by 9997? 94 Calculate the remainder when 800 is divided by 354. 92 Calculate the remainder when 6231 is divided by 297. 291 What is the remainder when 5305 is divided by 18? 13 Calculate the remainder when 5941 is divided by 104. 13 Calculate the remainder when 255933 is divided by 2169. 2160 What is the remainder when 823 is divided by 189? 67 What is the remainder when 592 is divided by 48? 16 Calculate the remainder when 23732 is divided by 746. 606 What is the remainder when 27251 is divided by 34? 17 What is the remainder when 437 is divided by 426? 11 Calculate the remainder when 1307 is divided by 919. 388 What is the remainder when 1622331 is divided by 642? 639 What is the remainder when 178236 is divided by 61? 55 What is the remainder when 84868 is divided by 309? 202 Calculate the remainder when 352196 is divided by 347. 338 Calculate the remainder when 559 is divided by 33. 31 Calculate the remainder when 10510 is divided by 219. 217 Calculate the remainder when 20860 is divided by 71. 57 What is the remainder when 69677 is divided by 61? 15 Calculate the remainder when 764 is divided by 11. 5 What is the remainder when 119696 is divided by 140? 136 Calculate the remainder when 14415 is divided by 82. 65 Calculate the remainder when 213359 is divided by 30. 29 What is the remainder when 235163 is divided by 58788? 11 Calculate the remainder when 68718 is divided by 36. 30 Calculate the remainder when 49100 is divided by 4908. 20 What is the remainder when 1270303 is divided by 423433? 4 What is the remainder when 3096148 is divided by 15? 13 What is the remainder when 10786 is divided by 67? 66 What is the remainder when 661333 is divided by 106? 105 Calculate the remainder when 76322 is divided by 127. 122 What is the remainder when 467 is divided by 71? 41 What is the remainder when 11303 is divided by 23? 10 Calculate the remainder when 5590 is divided by 505. 35 What is the remainder when 200848 is divided by 298? 294 Calculate the remainder when 19754 is divided by 386. 68 Calculate the remainder when 6639 is divided by 252. 87 What is the remainder when 21303 is divided by 425? 53 What is the remainder when 137285 is divided by 18? 17 Calculate the remainder when 77868 is divided by 282. 36 Calculate the remainder when 109673 is divided by 5220. 53 What is the remainder when 2283 is divided by 284? 11 What is the remainder when 23173 is divided by 77? 73 What is the remainder when 2138 is divided by 89? 2 What is the remainder when 91753 is divided by 250? 3 Calculate the remainder when 26789 is divided by 75. 14 Calculate the remainder when 8518	{ "pile_set_name": "DM Mathematics" }
or y. -2 Let z(w) = w*3 - 7w*2 - 12w + 35. Let b be z(8). Suppose 2l - g = 11 + 46, -2g + 6 = 0. Solve -5 = 4c - 2c + u, bc - 3u + l = 0 for c. -5 Let d(q) = 3q - 26. Let f be d(13). Solve 3s - f = 2x, -x + 2x = 1 for s. 5 Suppose 4b - 26 = 2b - a, 2b - 3a = 42. Solve -2i = 2s + 14, 8i - 5s - b = 3i for i. -2 Let o(f) = -4f - 1. Let k be o(-1). Let d be 1/k + 16/(-3). Let v = 0 - d. Solve -2y - 12 = vr + 9, 6 = 3y - 5r for y. -3 Let a be 1 + 4/(1 - -3). Suppose 2c - c - w - a = 0, 3c = 2w + 10. Solve -3i - 7 = -2n, 2i + c + 16 = -3n for n. -4 Suppose 2r + 2r - 23 = -u, 20 = u + 3r. Let q(z) = 2z + 9. Let j be q(-8). Let m = u + j. Solve 2 = -l, -14 = mc - 0l - l for c. -4 Suppose -10 = -5g + 20. Let t = g - 3. Solve 0 = th, 2r - 6r + 2h - 20 = 0 for r. -5 Suppose -c - 2h - 14 = -4c, h + 17 = 4c. Let q be (-4)/6 + 106/6. Solve -y - 4y - cs - 13 = 0, -4y - s = q for y. -5 Suppose -3v = d - 15 + 1, 2v = -3d + 35. Suppose -y + 5 = 0, 0 = 4a - 2y + 1 + 1. Let t = a + d. Solve -3 - 3 = 3x - 4z, -x = -5z + t for x. 2 Let j = -15 - -30. Suppose 0 = -2h - h + j. Suppose 2a + a - 3f - 45 = 0, 0 = -4a - 5f + 60. Solve 2p + p + a = -d, -4d - 32 = hp for d. -3 Let n(u) = -u*2 - 5u - 1. Let k be n(-2). Suppose 2i + i = 0. Suppose 2j - 58 = -i. Solve 5m = -3d - j, -km + 0d - 26 = 2d for m. -4 Let t(i) = i3 - i2 - 4i + 3. Let n be t(2). Let b(f) = -f3 - f2 - f - 1. Let p be b(n). Solve 0 = -4c - 3v - 32, 3c - 3v + 3 = -p for c. -5 Let h = -3 + 2. Let w be (-3)/h11/3. Suppose 4o = -w + 27. Solve om + 11 = -i, 3m + 5i + 13 = 4m for m. -2 Suppose 0 = 4p - 28 + 8, -f - 10 = -2p. Let c be -1 - (-2 - (0 + 2)). Solve -n - ct + 8 = -2t, f = 4n + 3t - 28 for n. 4 Let f(v) = v*2 + 5v + 10. Let d be f(-3). Solve 2p + 3o - 15 = 0, -4p = -3p - do + 20 for p. 0 Let z be ((-123)/3 + 3)/(-2). Solve -8 = n + 2i - 4i, -z = -2n - 3i for n. 2 Let a = -9 - -20. Solve q - 5u + 23 = 0, -a = 5q - 5u + 4 for q. 2 Suppose -3f + 24 = -0f. Suppose 2t + f = 5i - 3i, -4t - 4 = 0. Solve 0v + 10 = 4o - v, 2 = io + 2v for o. 2 Suppose 3l = l + 5c + 34, c = -3l + 17. Suppose 4b - lb + 18 = 0. Solve -3h + 0a + 4a = -13, -b = -2h + 2a for h. -1 Let a be 1/5 + 5/(-25). Let l(b) = -5b - 3. Let t(y) = -11y - 7. Let k(j) = 13l(j) - 6t(j). Let n be k(a). Solve nq + 3s = 4q, q + 1 = 4s for q. 3 Let s be 1/3 - (11/(-3) - 1). Solve -2y + h - 13 = -4y, -h = -s for y. 4 Suppose 0 = -2h + 9 - 3. Suppose 2n + x - 1 = 0, -n + 5 = -2x - 2x. Let u = n + h. Solve 3 = 3g - 6, -3g - 3 = -uf for f. 3 Let d = 84 - 74. Solve -2s - 4 = -2a, s + 4a = -s - d for s. -3 Suppose 3u = g + 15, 3g + 8 + 1 = 0. Let k(d) = 7d + 31. Let r be k(-4). Solve -o + 5o - 20 = ub, ro - 15 = -5b for b. 0 Suppose 5t = 17 - 77. Let q(m) = m*3 + 13m*2 + 13m + 16. Let k be q(t). Solve 0 = -2y + 6, 0y = -r + 2y - k for r. 2 Let o = 9 - 13. Let t be (1 - (-3)/(-2))-8. Let c = o + t. Solve -j + 3 = -4m, cm + 4j + 2 = 2m for m. -1 Let b(d) = d*2 - 5d + 2. Let r be b(5). Suppose rn - 2 - 2 = 0. Solve 0k - 6 = nk, -2x - 10 = 2k for x. -2 Suppose -2r - 16 = -3f, 19f + 2 = 15f - 2r. Solve -5n + fh = 4, 0 = -n + 4h - 11 + 3 for n. 0 Let w = 91 - 147. Let z be ((-9)/(-6))/((-3)/w). Solve 0 = -3l - 12, 4j + 2l + z = 8 for j. -3 Suppose -2a = -10, -3a = -4h - 2a + 11. Solve -v - 4k - 2 = -k, -3k = hv + 17 for v. -5 Let n(r) = 2r - 5. Let o be n(5). Let v(c) = -c + 4. Let d be v(0). Solve 14 = -y + ot - 11, -20 = dy - 4t for y. 0 Let o(u) = -u2 + 2u - 3. Let x be o(3). Let k = 13 + x. Solve -2d = 5z + 11, 4d = 4z + z - k for z. -1 Let v = -54 + 54. Solve 5 = -2j - j + t, -4j + t - 7 = v for j. -2 Let v be -3 + 1 + (-6 - -11). Suppose vc = -c. Solve 3g + u - 10 = c, -2g - 3g = 5u for g. 5 Let w(d) = d3 - 4d*2 + 6d - 7. Let t be w(3). Solve -4v = -q - 5, -4v = -tq - 3 - 3 for q. -1 Let k be ((-3)/(-3))/1 - -16. Suppose -2a - 2a + k = x, -5x + 4a = -13. Suppose -xy = -y. Solve y = -3t + 2p + 10, 4t - p - 11 = t for t. 4 Suppose 0 = 10a - 8a - 8. Solve -4k - 3x = -2, -k - 13 + 4 = -ax for k. -1 Let h(w) = -4w3 - w2 + 9w3 + w - w2. Let d(s) = s*2 - 7s + 7. Let z be d(6). Let j be h(z). Solve 3l = 6l + r + 8, -4 = -jl - 5r for l. -4 Let c(k) be the second derivative of -k*3/6 + 9k*2/2 + 10k. Let s be c(9). Solve -u = -5j + 24, s = 3j + u - 2 - 14 for j. 5 Let u be (-60)/(-14) + (-8)/28. Solve 8 + 11 = -ua + q, 3q = 9 for a. -4 Let c(b) = -b*3 - 4b*2 + 4b - 7. Let m be c(-5). Let h be 0/(-1) + (-20)/m. Suppose -5p + 0 = -h. Solve -4n - po = -3n + 11, -3n + o - 12 = 0 for n. -5 Let r(s) = -s2 + 3s + 8. Let c be r(4). Suppose 2l - 14 = -c. Solve -41 = -lj - 4b, 5j - 4 - 25 = -b for j. 5 Suppose 0k + 34 = 3k + 5t, -5t + 19 = -2k. Solve -y = kj - 2 + 6, 0 = 4j + 5y + 9 for j. -1 Let y = 6 + -18. Let a = 17 + y. Let t be 6/15 + (-2)/a. Solve h - 14 = -5d, -d = -th - 2h + 6 for h. 4 Suppose -3a + 6 = w - 9, 2w + 15 = 3a. Let k be (-2 + 1)/((-1)/6). Solve -2i + 3i = -3u - a, -2i - k = 2u for u. -1 Let x be 12/(-18) - 20/(-3). Let h = -1 + x. Solve -3 = -3c - g, h = 5c - 0c + 3g for c. 1 Let n(m) = 2m*3 - 2m*2 + m. Let c be n(1). Let u = 2 + c. Suppose -6s - 10 = -7s - 2b, 0 = -2s + ub - 8. Solve k + 2 = -4q - 0k, sq = 4k + 8 for q. 0 Suppose -o = 4l - 13 - 9, 4o + 3l = 23. Suppose ob = b. Solve 0 = t - bh - 3h - 17, 2h = -t - 3 for t. 5 Suppose -4o - 3 - 5 = 0. Let c = o - -3. Let r be (c/(-2))/((-3)/18). Solve -8 = 3w + 2s, 0s + 7 = -5w + rs for w. -2 Suppose 3q - 10 = q. Suppose 2c - 3c = -4w - 5, -c + 3w = -q. Let t(r) = -r*2 + 5r + 1. Let y be t(4). Solve 5k - yz = -c, 4k + 0 + 3 = 3z for k. 0 Let i = 14 - 17. Let v be (-3 - i)/(2/2). Solve 2l - g - 7 = v, -5 = 2l + 3g - 0 for l. 2 Suppose -4 = a + 5q, 0 = -4a - q + 5 - 2. Let f(m) = 3m - 1 - a + 3m - 5m. Let v be f(6). Solve 2d + 10 = 7h - 3h, 5h + vd - 6 = 0 for h. 2 Let h be (-30)/(-9)(-12)/(-5). Let s be (-2)/(-4) - (-36)/h. Solve 22 = -5u + r + 4, 4u + sr = 3 for u. -3 Suppose 0 = 5g - 3 - 7. Suppose -h = r - 5h + 21, gr - h = -14. Let t(j) = -j*2 - 6j + 3. Let m be t(r). Solve s = 3c + 9, 5s + m = -5c - 27 for c. -4 Suppose 3f - 22 = -5s - 0f, 0 = -5f + 20. Solve 2h = sx, 4h - 2 = x - 5 for h. -1 Suppose 3i - 36 = -5w, -3i - 4w = 2i - 73. Let u = i + -13. Solve f - uf - 5c - 10 = 0, -2f = -c - 15 for f. 5 Let i be 6/(-10) - (-128)/5. Let a be i/10(-8)/(-10). Suppose 2c = 7c - 20. Solve -ad = cv - 2, 3d = 2d + v - 5 for d. -3 Let h(p) = p2 + 6p - 5. Let j be h(-7). Solve 4f = 4z - 8 - 8, -5z + 6 = jf for f. -2 Suppose -3n = 4d + 24, -9 = -d + n + 2n. Let z be (-2 - -1 - d)/1. Suppose zt - 2 = t. Solve 3v + 7 = 5q, -3v = -tq + v for q. 2 Suppose 18s - 32 = 14s. Solve -4y = -2y + s, -4f + 5y = -28 for f. 2 Let d = 63 - 60. Solve 2u + 2u + 4y - 40 = 0, 10 = du - y for u. 5 Suppose 3c + 0c - 3 = 0. Solve -7 - c = -w + l, 3w = -3l for w. 4 Let r = -16 + 23. Suppose x + 5m - r = 0, 4x + x - 5m = 5. Solve -xl - 4s + 16 = 0, -s - 1 = -5l + 2s for l. 2 Let d = -9 - -16. Solve -3 = -a + 2p, 5a - da - 5p = 30 for a. -5 Let o be (1/3)/((-2)/18). Let g be (o/(-2))/((-15)/(-20)). Solve 5p = 4l - 35, -gl + 4p = -0p - 22 for l. 5 Let n = 7 - 4. Suppose -86 = -3o + d, nd + d = 4o - 112. Solve 24 = 4v + 2p, 3v + 4p = o - 6 for v. 5 Suppose 0 = 2t - 2n + 12, -2n - 25 = 4t - 7n. Let a = -14 + 5. Let o = t - a. Solve -of - r + 5 = 0, 2r = -2f - f + 5 for f. 1 Suppose a - 231 + 229 = 0. Solve 5n = l - 7, l = -0n + an + 1 for n. -2 Let a be 7 + -1 + -16 + 15. Solve 2m = 4z, az - 3m = 3z for z. 0 Let r(h) = h + 5. Let n be r(-3). Solve d + 2z + n = 0, 4 = -4d - 3z - 4 for d. -2 Let y(r) = -2r - 4. Let x be y(-4). Solve 2l = z + 5, -z + xl - 6 = 5 for z. 1 Suppose -3v + 30 = 3f, 0f + 5f = 2v + 64. Solve -3t - 22 = -4p, -f - 6 = 3t - 3p for t. -2 Let a(u) = u*3 - 2u*2 - 2u. Let j be a(3). Let v = 48 + -14. Let s be (1 - v)/(-3)j. Solve 4b + 5*g = -s - 0, -b - 2	{ "pile_set_name": "DM Mathematics" }
. Determine w(h(l)). 8l4 Let g(t) = -9t*2 + 3710338t + 10t2 - 3710338t. Let o(x) = -25x + 97x + 79x. What is o(g(i))? 151i*2 Let u(q) = 8q + 666523800 - 666523800. Let r(i) = -397i + 1. Determine u(r(l)). -3176l + 8 Let l(f) = -3f - 3f + 10f - 5f. Let c(o) = -8o + 9. Let x(s) = -2s. Let g(j) = c(j) - 6x(j). What is l(g(u))? -4u - 9 Let x(g) = 1053g. Let r(l) = 37456l. Calculate r(x(u)). 39441168u Let x(q) = -398905q - 4. Let n(i) = 30i. Give x(n(m)). -11967150m - 4 Let i(h) = -h*2. Let n(p) be the third derivative of -431p5/30 + p2 - p - 82. What is i(n(m))? -743044m4 Let o(z) = -5z*2. Suppose -287d = 247d - 2670. Let h(k) be the third derivative of 1/20k*d + 0k*4 + 19k*2 + 0k*3 + 0k + 0. Determine h(o(l)). 75l4 Let l(i) = -144i - 252. Let b(s) = 17s + 30. Let d(z) = -42b(z) - 5l(z). Let q(p) = p + 11. What is d(q(c))? 6c + 66 Suppose -i + 0i = 2i + 7i. Let h(j) be the second derivative of ij*2 - 35j - 5/6j3 + 0. Let d(s) = -4s*2. Determine h(d(f)). 20f2 Let x(b) = b2 + 305. Let j(m) = m2 - 2775. Calculate j(x(o)). o4 + 610o2 + 90250 Let p(b) be the second derivative of 121b*3/3 - 561b. Let w(s) = -3s2. Determine p(w(t)). -726t*2 Let i(t) be the third derivative of -14t*4/3 + 141t*2. Let u(o) = 5o*2. Determine i(u(b)). -560b*2 Let s(m) = -96m*2 + 75m + 15. Let q(a) = 25a2 - 20a - 4. Let r(y) = -15q(y) - 4s(y). Let o(u) = -30u2. Determine r(o(w)). 8100w4 Let m(z) be the third derivative of z7/70 - 15z4/8 + 2z*2 + 25. Let d(r) be the second derivative of m(r). Let v(x) = -x. Determine v(d(w)). -36w2 Let g(d) = d + 71. Let m(n) be the third derivative of -n4/24 - 827n2. Determine g(m(p)). -p + 71 Let n(h) = -947782h*2. Let q(s) = 7s. Determine n(q(g)). -46441318g2 Let r(l) = -l + 2. Let i(k) = -4k + 2. Let w(y) = i(y) - r(y). Let o(z) be the third derivative of 0z3 + 0z - 6z2 - 5/24z*4 + 0. Calculate o(w(q)). 15q Let g(w) = -2w2 + 3w + 72. Let b(j) = -13j. Determine b(g(q)). 26q*2 - 39q - 936 Let z(u) be the first derivative of -2u3/3 - 6826. Let g(a) be the second derivative of 34a*3/3 - 6a. Give g(z(x)). -136x2 Let s(f) be the third derivative of 13f*5/60 + 7100f*2. Let r(l) = -l + 115. What is r(s(w))? -13w*2 + 115 Let q(d) = -3d. Let i(n) = n*3 - 7n*2 - 13n - 7. Let z be i(9). Let v(w) = -zw - 14w + 10w - 68w - 2. Give q(v(f)). 330f + 6 Let x(r) = 2r*2 - 1026r. Let q(y) be the second derivative of -y*4/12 - 960y. What is x(q(n))? 2n4 + 1026n*2 Let m(b) = -1910284b. Let s(y) = 6y2. Determine s(m(t)). 21895109763936t*2 Let g(o) = 2o + 33. Let b(m) = -44074m. Determine g(b(p)). -88148p + 33 Let d(z) = 165z - 25. Let g(t) = -39t. Calculate d(g(u)). -6435u - 25 Let t(k) = 2k. Let c(q) = -q - 863245. Calculate c(t(j)). -2j - 863245 Let d(b) be the third derivative of b4/8 - 5802b*2. Let l(z) = -351z - 65. Let j(v) = 16v + 3. Let s(n) = -65j(n) - 3l(n). Calculate s(d(k)). 39k Let l(c) = -179 - 4c + 180 - 183. Let p(d) = -2d. Give p(l(b)). 8b + 364 Suppose -4l - 2q + 12 = 0, -11l + 9l - 3q + 10 = 0. Let w(c) = 12 - 13 + c*l + 1. Let g(p) = -2p*2 + 2. Give g(w(h)). -2h*4 + 2 Let n(s) = 3s*2. Suppose -96 = -4h - 4q, 41 = 4h - 4q - 79. Suppose 3t = 3 + h. Let i(v) = 11v - 10v + tv. Calculate n(i(r)). 363r*2 Let v(p) = 9p - 3. Let q(c) = -2397 + 2399 + 86c2 + 13c*2. Give q(v(o)). 8019o*2 - 5346o + 893 Let w(y) = 2y2. Let v(t) = 5t + 38. Let r be v(-7). Let o be (r - (-22)/(-10))/(4/10). Let q(l) = 4l - l - ol + 4l. What is w(q(a))? 50a*2 Let a(n) = -2n2. Let v(h) = h2 + 2h + 1. Let p(l) = -100l*2 + 2l + 1. Let o(k) = 9k - 1. Let y be o(0). Let i(t) = yv(t) + p(t). Calculate a(i(u)). -20402u4 Let l(m) be the second derivative of -m4/3 + 67m*3/3 + 2m - 328. Let y(i) = 2i2. Give l(y(k)). -16k*4 + 268k*2 Let p(l) be the first derivative of -12l*3 - 2l - 3. Let y(j) = 12 + 2j - 3j - 11. Let m(r) = -2r2 - r + 1. Let v(a) = -m(a) + y(a). Determine v(p(d)). 2592d*4 + 288d*2 + 8 Let o(j) = -29j + 3. Let z(f) be the third derivative of -f*4/24 + 16f3/3 + f2 - 8f + 46. Give o(z(i)). 29i - 925 Suppose 4t + 4t = 2t. Let s be (-2664)/(-10) + (-9)/(-15) + t. Let z(p) = -p - 267 + s. Let d(v) = -v. Calculate d(z(m)). m Let m(j) = 2j + 20. Let q be m(-9). Let a(h) = 3 - 3 + 249h2 - 252h*q. Let c(w) = -11w. Give a(c(o)). -363o2 Let p(j) = 2j*2. Let s(k) = 438k - 560085. What is s(p(m))? 876m2 - 560085 Let u(h) = -14h*2. Let m(y) = 163460y*2. What is m(u(x))? 32038160x*4 Let c(v) = 3295v. Let g(h) = -19307h. Calculate c(g(j)). -63616565j Let v(o) = -240o2 - 616o + 88. Let d(n) = -16n2 - 42n + 6. Let j(t) = -88d(t) + 6v(t). Let m(r) = 40r. Give m(j(l)). -1280l*2 Let q(r) = 571r*2 - 5. Let z(p) = -891p*2. Determine q(z(f)). 453306051f*4 - 5 Let y(f) = -13f + 2. Let k(b) = -27b + 5. Let d(g) = 2k(g) - 5y(g). Let c = 177 - 157. Let p(i) = 11i*2 - ci*2 + 11i*2. What is p(d(v))? 242v*2 Let z(f) = -6f + 8. Let g(y) = 2y - 3. Let l be -52(0 - (1 + (-1)/2)). Let o = l - 29. Let p(a) = oz(a) - 8g(a). Let m(j) = 2j2. Determine m(p(q)). 8q2 Let c(o) be the first derivative of o2 + 3035. Let u(k) = 18k + 2k2 - k2 - 5k. Determine u(c(n)). 4n*2 + 26n Let x(r) = -14r. Let s(g) = -3g + 2. Let m(z) = -3 + 64z + 4 - 65z. Let k(n) = 2m(n) - s(n). Let a(q) = 7q. Let f(u) = a(u) - 6k(u). Determine x(f(w)). -14w Let v(r) = 3 - 594r + 1845r - 3 - 626r - 620r. Let m(z) = -2 + z*2 + 2 - 33z. Determine m(v(f)). 25f2 - 165f Let h(y) = -15y. Let f = 58 + -45. Let w(l) = 48l - fl2 - 7l - 41l. What is w(h(i))? -2925i*2 Let z(j) = -3j*2. Let l(b) = -9576985b*2 + b - 1. Calculate l(z(m)). -86192865m*4 - 3m*2 - 1 Let h(k) = -13k*2. Let b(p) = -57p*2 + 5p + 72. Let n(q) = q + 12. Let t(g) = -b(g) + 6n(g). Determine t(h(o)). 9633o*4 - 13o*2 Let b(f) = 2f*2 - 1149. Let q(y) = 147y - 8. Let z(c) = 184c - 10. Let x(l) = 5q(l) - 4z(l). Give x(b(h)). -2h*2 + 1149 Let f(k) = -19k*2 + 3. Let n(c) = -495c*2 + 77. Let h(z) = 77f(z) - 3n(z). Let m be ((-8)/(-4))/(4/24). Let b(q) = q2 + mq*2 - 11q*2. Give h(b(d)). 88d*4 Let w(a) = 4a*2 + 56a - 4503. Let b(u) = -3u. Calculate b(w(o)). -12o*2 - 168o + 13509 Let c(h) = 78h + 14. Let f(x) = -34x - 6. Let t(n) = -3c(n) - 7f(n). Let i(z) = 4044z2. What is t(i(j))? 16176j*2 Let u = -41 - -64. Suppose 6k = -11 + u. Let o(s) = -17s2 - 10s*2 + 5s*k. Let a(n) = -2n. Give a(o(z)). 44z2 Let w(y) = -y2. Let l = -101 - -129. Let f(d) = -22d + ld + 0 + 0. Determine w(f(a)). -36a*2 Let c = 120 - 88. Let y(f) = 21f*2 - 40228 + 40228 + cf*2. Let n(o) = 3o*2. Determine n(y(l)). 8427l4 Let s(x) = x2 - 41x. Let f = -62 - -67. Let d(u) = -fu + 18u - 16u. Calculate d(s(r)). -3r2 + 123r Let s(a) = -10a. Let g(x) be the second derivative of -3 + 2/3x*4 - 11x + 0x2 + 0x*3. What is s(g(k))? -80k2 Let l(s) = -s2 - 31s - 238. Let k be l(-15). Let o(a) = 143a*2 + 101a*k + 93a*2 + 75a*2 - 327a*2. Let b(q) = -2q. What is o(b(j))? 340j2 Let t(b) be the first derivative of 0b*2 - 27 + 0b + 1/3b3. Let a(s) = 9s*2. Determine a(t(d)). 9d*4 Let h(j) = -72369 - 7j + 72371 + 31j. Let w(b) = -4b*2. What is h(w(k))? -96k*2 + 2 Let k = -29808 + 58483. Let z(c) = 28675 - k - 4c*2. Let m(g) = 5g + 6. Let l(o) = 9o + 11. Let j(i) = 6l(i) - 11m(i). Determine j(z(y)). 4y*2 Let j(u) = -54u*2 + 84u - 12. Let a(s) = 32s2 - 49s + 7. Let x(p) = -12a(p) - 7j(p). Let g(h) = 970h. What is g(x(v))? -5820v*2 Let s(f) = -156f. Let x(h) = 2h + 12h + 8h + 4h - 14h. Determine s(x(b)). -1872b Let x(p) = -2p + 110789. Let u(f) = -16f*2 - 3f. What is x(u(a))? 32a2 + 6a + 110789 Let h(y) = 60284y + 21. Let i(q) = q2. Determine h(i(t)). 60284t*2 + 21 Let m(h) = -10h*2. Suppose -3n - 75 = -2a - a, -35 = -a - n. Let z(w) = aw*2 + 24w*2 - 50w*2. Determine z(m(t)). 400t*4 Let g(v) = -v - v + 0v - v. Let j(a) be the second derivative of -17a	{ "pile_set_name": "DM Mathematics" }
16s2 + 21s + 6. What is zk(p) + 2b(p)? p*2 - 2p + 1 Let n = -460 - -455. Let s(d) = -5d. Let u(q) = 6q. What is ns(a) - 4u(a)? a Let r(q) be the third derivative of 19q5/60 - 5q*4/24 + 3q*2 - 23q. Let y(k) = -180k2 + 48k. What is 48r(l) + 5y(l)? 12l2 Let n(s) = 2s + 5. Let j(y) = -y + 1. Let c(g) = -4j(g) - n(g). Let l(d) be the second derivative of 5/2d*2 + 7d - 1/6d3 + 0. Give -4c(o) - 7l(o). -o + 1 Let n(z) = -7z*3 - 37z*2 - 22z - 11. Let o(m) = -4m3 - 19m*2 - 12m - 6. Determine -6n(g) + 11o(g). -2g3 + 13g*2 Suppose 5c - 60 = -0c. Suppose -15f - 18 = -cf. Let h(b) = -4b - 1. Let l(s) = -4s - 1. Calculate fl(w) + 5h(w). 4w + 1 Let b(x) = 9x - 636. Let y(j) = 4j - 272. Let d(k) = -3b(k) + 7y(k). Suppose -t + 5t - 4 = 0. Let o(a) = 1. What is to(l) + d(l)? l + 5 Let i(t) = 1728t2 - 14t - 3. Let m(n) = 1152n2 - 10n - 2. Give 5i(j) - 7m(j). 576j2 - 1 Let z(w) = w3 - w + 1. Let s(q) = 27q*3 + 40q*2 - 26q + 17. Let d(f) = 13f3 + 18f*2 - 12f + 8. Let m(g) = -9d(g) + 4s(g). What is -m(x) - 4z(x)? 5x*3 + 2x*2 Let p(a) = -1. Let f(j) = 42j + 6. Give f(m) + 8p(m). 42m - 2 Let b(t) = 5t2 + 856t. Let u(d) = -2d2 - 285d. What is 3b(p) + 8u(p)? -p*2 + 288p Let w(z) = -z2 - z - 2. Let x(i) = i2 + 3. Let a(u) = -3w(u) - 2x(u). Let q(l) = -3l2 + l2 - 10l - 2l2. What is -10a(c) - 3q(c)? 2c*2 Let t(m) = 7m*3 - 5m*2 - 5m + 5. Let a(p) = 3p3 - 3p*2 - 3p + 3. Suppose -8r + 49 - 9 = 0. Determine ra(i) - 3t(i). -6i*3 Suppose 3z + 25 = n, 47 = -5z + n + 2n. Let t(x) = 3x2 - 6x - 6. Let m = 8 - 1. Let l(b) = b*2 - 2 - 4b2 + 9 - b2 + mb. Determine zt(o) - 6l(o). 3o*2 Suppose 5d - 5w + 24 = 14, -3d = 4w - 22. Let l(t) = -8t*3 - 3t*2 + 3t. Let h(x) = -8x3 - 2x*2 + 2x. What is dl(y) - 3h(y)? 8y3 Let g(a) = -8a*2. Let p(y) be the second derivative of -7y*4/12 - 4y - 12. Give -2g(s) + 3p(s). -5s2 Let t be (-215)/45 - 6/27. Let w = 6 + t. Let q(j) = -j. Let s(f) = 2f*2 - 2f + 1. Give ws(d) - 4q(d). 2d2 + 2d + 1 Let o(k) = 3k3 + 11k + 11. Let x = -133 - -122. Let a(b) = -b*3 - 4b - 4. Let u(w) = -w - 4. Let j be u(0). What is jo(m) + xa(m)? -m*3 Let p(w) = -22w*3 + 5w. Let b(f) = -20f3 + 5f. Give 5b(t) - 4p(t). -12t3 + 5t Let s(u) be the third derivative of -u4/4 - u2. Let t = 4 - 7. Let m(w) = 5w. Let x(q) = 65q - 522. Let b be x(8). Give bs(i) + tm(i). -3i Suppose -10 - 14 = -2t. Let a = 10 - t. Let f(v) = 1. Let m(h) = -9h - 16. Let q(l) = af(l) - m(l). Let u(d) = 3d + 5. Give 3q(r) - 8u(r). 3r + 2 Let z(s) = -24s2 - 14 + 980s - 988s + 3s*2. Let l(d) = 7d*2 + 3d + 5. Give 8l(y) + 3z(y). -7y2 - 2 Let t(y) = 261. Let k(p) = 209. Let i(a) = -5k(a) + 4t(a). Let o = 3 + -8. Let l(z) = z2 + z - 4. What is oi(f) + l(f)? f*2 + f + 1 Let l(v) = -16v*2 + 9v + 17. Let f(a) = -7a2 + 4a + 8. What is -5f(n) + 2l(n)? 3n2 - 2n - 6 Suppose 31 - 1 = -5y. Let p(c) = 1. Suppose o - 3h - 10 = 0, 2h - 21 = -27. Let n(r) = r + 9. Determine on(v) + yp(v). v + 3 Let n(h) = -h3 - h2. Let j(d) = 7d*3 - 14d*2 + d. What is j(k) + 6n(k)? k*3 - 20k*2 + k Let o(k) = -2k3 + k2 + k. Let m(g) = 4g3 - g2 + 3g - 5. Calculate m(u) + o(u). 2u3 + 4u - 5 Let r(l) = -2881l2 - 201l + 201. Let w(i) = -72i2 - 5i + 5. What is 5r(u) - 201w(u)? 67u2 Let i(m) = m - 2. Let d(t) = -2t + 1. Suppose 3n + 19 = r, r + n + 0 = -1. Give ri(w) + 3d(w). -2w - 5 Let c(f) = 10f - 4. Let m(w) = -11w + 6. Give 6c(g) + 5m(g). 5g + 6 Let n(h) = 3h*2 - 4h + 8. Let g(x) = 2x2 - 3x + 8. Give 6g(f) - 5n(f). -3f2 + 2f + 8 Let z(w) = -11w3 - 3. Let i(d) = -54d*3 - 2d*2 + 2d - 14. Let c(o) = -107o3 - 5o*2 + 5o - 28. Let g(s) = 2c(s) - 5i(s). Give -3g(t) - 14z(t). -14t3 Let q(k) = -60k*2 + 6. Let w(v) = -240v*2 + 25. What is 9q(z) - 2w(z)? -60z*2 + 4 Let h(d) = 24d*2 - 5. Let l(r) = -551r*2 + 114. Let w(t) = -14t*2 - 161t - 30. Let p be w(-12). Calculate ph(n) - 5l(n). 19n2 Let v(q) = -2q - 4. Let r = -52 - -79. Suppose -4i = -7i - r. Let z(t) be the first derivative of 2t2 + 9t - 33. Determine iv(x) - 4z(x). 2x Let u(c) = 16c - 5. Let y(o) = 6 - 13o - 6o + 2o. Determine 6u(w) + 5y(w). 11w Let n(g) = 94g3 - 3g*2 + 3. Let a(k) = -39479k*3 + 1261k*2 - 1261. Give 6a(w) + 2522n(w). 194w*3 Let x(z) = -4 + 3 - 21z - 1 + 26z - 2. Let g(l) = 4l - 4. Give 7g(w) - 6x(w). -2w - 4 Suppose -3 = -c - 2. Suppose 5t + 111 = 8t. Let m(j) = tj - 23j + 4 - 21j. Let u(a) = a - 1. Give cm(d) + 5u(d). -2d - 1 Let o(a) = a + 1. Let z(d) = -9d3 + d2 + 7d + 7. What is 21o(b) - 3z(b)? 27b*3 - 3b*2 Let x(p) = -37p*3 + 8p*2 - 2p + 8. Let b(g) = -36g3 + 6g*2 - g + 6. Give -4b(k) + 3x(k). 33k*3 - 2k Let x be 4 + 6/(-18)15. Let r(q) = 7q. Let j(v) = 1. What is xr(i) - 2j(i)? -7i - 2 Let c(f) = 9. Let d(v) = -v + 1. Determine -c(w) + 3d(w). -3w - 6 Suppose 2 = -2b + 2q, -4q = 51 - 31. Let l(t) = 5t2 + 4. Let a(y) = y2 + 1. Calculate bl(g) + 26a(g). -4g*2 + 2 Let o(l) = 3l*2 - 43281l + 43281l - 3. Let d(q) = -q2 - q + 1. What is -4d(s) - o(s)? s*2 + 4s - 1 Let l(p) = 57p3 + 6p*2 - 5p + 6. Let z(h) = h3 - h2 + h - 1. Give l(q) + 6z(q). 63q*3 + q Let f(z) = 5z*2 + 173z. Let m(x) = x*2 + 43x. What is -2f(o) + 9m(o)? -o*2 + 41o Let r(v) = -4v3 + 2v*2 - 13v - 26. Let s(j) = -j*3 - 2j - 1. Give r(g) - 6s(g). 2g*3 + 2g2 - g - 20 Let z(m) = -m + 5 + 10 - 17 - 4. Let j(o) = -o3 - 8o2 + o + 4. Let p be j(-8). Let c(i) = -i - 5. Determine pc(k) + 3z(k). k + 2 Let i(b) = -22b*2 + 7b + 3. Let w(c) = -76 - 56c2 - 5c + 71c2 + 151 - 77. Calculate 5i(q) + 7w(q). -5q*2 + 1 Let i(n) = 11n*3 - 7. Let a = 196 - 191. Let w(r) = -5r*3 + 3. Let z be (2 - -1) + (-7 - -6). What is aw(h) + zi(h)? -3h*3 + 1 Let h(g) be the second derivative of 5g4/12 - g3/3 + 3g2 - 2g. Let j(s) = s*2 - s + 1. Let u(r) = -135r + 266. Let m be u(2). What is mj(k) + h(k)? k2 + 2k + 2 Let k(m) = 6m2 + 2m - 7. Let j(s) = -29s2 - s + 24. Let c(f) = -19f*2 - f + 16. Let a(o) = -8c(o) + 5j(o). Determine 5a(q) - 6k(q). -q2 + 3q + 2 Let m(p) = p - 5. Suppose 0 = -37c + 256 + 77. Let u(l) = -l + 2. What is cu(w) + 4m(w)? -5w - 2 Let n(g) = 4g. Let j(k) = -k - 11. Let s(d) = -6d - 31. Let h(b) = 17j(b) - 6s(b). Calculate 2h(o) - 11n(o). -6o - 2 Let f(t) = -25 - 24 - 19 + 72. Let p(r) = r - 1. What is -f(l) - 4p(l)? -4l Let k(r) = -66r*3 - 55r + 55. Let c(d) = d*3 + d - 1. What is -55c(v) - k(v)? 11v3 Let v(o) = -13. Let x(i) = -11. Let u(f) = -6v(f) + 7x(f). Let l(m) = 2m - 15. Calculate -l(h) - 6u(h). -2h + 9 Let d(y) = -4y3 - 6y*2 - 6y. Let l(t) = -13t3 - 17t*2 - 16t. Give 17d(u) - 6l(u). 10u3 - 6u Let d(f) = -3f2 + 1. Let b(v) = 13v*2 - 4. Suppose 0 = 2y + y + 6, 4y = -4a - 44. Let g be -6 - -8 - 4 - (-1 - -1). Calculate ad(z) + gb(z). z2 - 1 Let y(b) = 4 - b - 6 + 1 + b2. Let s(j) = -j*2 + j + 5. Let n(r) = 4r*2 - 3r - 35. Let h(c) = -n(c) - 8s(c). What is -3h(f) + 15y(f)? 3f*2 Let u(v) = 8v*2 + 19v - 57. Let d(f) = 3f2 + 7f - 19. What is 11d(n) - 4u(n)? n*2 + n + 19 Let w(z) = 14z3 + z2 + z - 30. Let q(m) = -16m3 - m2 - m + 31. Give -6q(s) - 7w(s). -2s3 - s2 - s + 24 Let d(c) = -3c2 - 48c + 5. Let x(h) = -h*2 + h - 1. Give -d(q) - 5x(q). 8q2 + 43q Let t(u) = -u + 1. Let p(k) = 12k + 12. Give p(c) + 2t(c). 10c + 14 Let b be 6/4(-8)/6. Let w(c) = -4c3 - 1. Let o(h) = h - 6. Let z be o(9). Let v(i) = 7 - 4i*3 + 33i*z - 12i*3 + i - 3. What is bv(n) - 9w(n)? 2n*3 - 2n + 1 Let i(p) = -6p + 6 - 2 - 5 - 4 + p. Let n(c) = 0 - 2 + 3c + 4. Calculate -2i(q) - 5n(q). -5q Let f(w) = 15w*3 + 13w*2 + 9w - 15. Let m(q) = -7q3 - 6q*2 - 4q + 7. Calculate -6f(z) - 13m(z). z*3 - 2z - 1 Let q(z) = -z*3 - 3z*2 + 4z - 2. Let b(k) be the second derivative of -k4/12 + k3/6 - k*2/2 + 1703k. Let c = -1 + -1. Determine c*q(d)	{ "pile_set_name": "DM Mathematics" }
11988 and 4844. 4829.9488012 Subtract -3913 from -14419539. -14415626 What is 47547458610823 minus 8? 47547458610815 What is -1770.68959 take away -28? -1742.68959 Work out -47640870281 - 0.24. -47640870281.24 What is -6.94 minus -263.64073? 256.70073 Work out -0.11631909244 + 14. 13.88368090756 Work out -4286.5 + -87.71689. -4374.21689 -16.83618672+5.139 -11.69718672 Work out -23703 + 456525835. 456502132 Work out -1019076698529 - -104. -1019076698425 1.05 + -328051.4426084 -328050.3926084 Add together 2253642198648 and 0.14. 2253642198648.14 Calculate -1238356155127 + 0.054. -1238356155126.946 Work out -0.66856 - -2.3758. 1.70724 Add 2949944 and -7495258. -4545314 What is the distance between 309.449 and -1231150.85? 1231460.299 Calculate 0.5 - -8704905540871. 8704905540871.5 Calculate -133794688751 - 0.5. -133794688751.5 Work out 736 + -164.816874. 571.183126 Sum -113.64 and 163460424.9. 163460311.26 Subtract 95777580 from -282139. -96059719 What is the distance between 196.66149009548 and -0.2? 196.86149009548 Add -8558528.8 and 3402. -8555126.8 Add -0.03 and 34516383360726. 34516383360725.97 Calculate 3009818209 - -6.301. 3009818215.301 Calculate -4 - 8940462.0378. -8940466.0378 Calculate -6807477057312 - -2. -6807477057310 What is 0.58 less than 9488326018.6? 9488326018.02 Add together -0.09 and -21228723516. -21228723516.09 51863+-0.883347 51862.116653 Put together -71806 and 3438.526. -68367.474 Total of -0.043 and -957381717.5. -957381717.543 What is -0.0116810764 minus 0.196534? -0.2082150764 Add together -1268.8 and 15272730142. 15272728873.2 What is 73 plus 151.03805475? 224.03805475 Calculate 24 + 65788754455. 65788754479 Calculate -27.592429278 + -2545. -2572.592429278 Add together -55170453873833 and 4. -55170453873829 What is -87102115 - -5676164? -81425951 Work out 0.061 + 794079108. 794079108.061 -27057648501.34+0 -27057648501.34 Add -2 and -4214451324938. -4214451324940 Work out 3 + -123066.89876. -123063.89876 What is the difference between -16320001483 and -252? 16320001231 Add together -2 and 8597476409821. 8597476409819 What is the distance between 386.6 and 105422355? 105421968.4 Calculate 16.7290240671615 + -0.3. 16.4290240671615 Subtract 14.73054 from 0.213695031. -14.516844969 -5636372+910.7773 -5635461.2227 What is the difference between 11 and 182.5106605? 171.5106605 Calculate 11995375.1 - -5252682. 17248057.1 What is 7207700488 plus 375? 7207700863 Add together -1000720 and 11397. -989323 What is the difference between -34 and -6074.856827? 6040.856827 What is -9920862 take away 0.0131402? -9920862.0131402 Work out -269 + 35763033540. 35763033271 Add together 0.1014007818 and 1769. 1769.1014007818 Sum 904.2123 and 0.08983897. 904.30213897 1333 - -18567.0608 19900.0608 Calculate 1.9 + -409.1729348. -407.2729348 Total of 0.020362 and -260891513. -260891512.979638 What is the distance between 745710182 and -440? 745710622 What is the distance between 0.069724 and -7585245069? 7585245069.069724 Calculate -2436.7 - 348816783. -348819219.7 1244488705 + 10257 1244498962 1997383 + -944773 1052610 Add together -5077.141 and -626.5317. -5703.6727 What is -4.01 plus 343643944? 343643939.99 Work out -104119.3543378 + 86. -104033.3543378 What is 489.92 - -73246.81? 73736.73 -19030832.3 - 2013 -19032845.3 Calculate -40.17 - -566.83695. 526.66695 Work out -0.5 + -26359373393. -26359373393.5 What is -1664593 minus 1392188? -3056781 Sum 0.1745275 and 121500.82. 121500.9945275 Work out 8125612726543 - 0. 8125612726543 10+4144417789 4144417799 Total of 15927065.44671 and -0.5. 15927064.94671 Total of 34.5742657 and 1.6. 36.1742657 Total of 0.0159436679 and -1.48. -1.4640563321 Work out 5 - -39396443064. 39396443069 What is the difference between 177 and -63481275397? 63481275574 What is -253 - 0.05709525212? -253.05709525212 What is -20.4 - 87419126548? -87419126568.4 Calculate 130.658553 + 40. 170.658553 What is -48568365785322 - 5? -48568365785327 Work out -37410.55291 - -50887. 13476.44709 What is 158251 less than -229252.741? -387503.741 Put together 920488863 and 2381. 920491244 Calculate 8585392039 + 0.0083. 8585392039.0083 Subtract -4.62787629 from 0.2079. 4.83577629 What is 4102840045 minus 29145? 4102810900 Work out 0.5 - -143.23937748171. 143.73937748171 What is -11539269980 - 0.088? -11539269980.088 Work out -24180143901 - -10. -24180143891 What is the distance between 36125186 and -0.0823? 36125186.0823 Add 91899358.248 and 0.1. 91899358.348 Work out -0.02554420139853 + 0.4. 0.37445579860147 What is 0.01 plus -1607836838? -1607836837.99 4155 + 1014918927 1014923082 Add together 29432490 and -7738333. 21694157 Add 731.756 and -579752933. -579752201.244 What is -1190732.2785554 + 4? -1190728.2785554 Work out -0.1654 - 10146290808. -10146290808.1654 What is 12.176493 + -2834? -2821.823507 Add together 221532573 and 1279.33. 221533852.33 What is 254015.32 - -3.878165? 254019.198165 What is the distance between -163436273.65 and 0.26? 163436273.91 What is -65 + -268200394371? -268200394436 Subtract 5412534778 from -0.09684. -5412534778.09684 Add together 10.934223 and -124199. -124188.065777 What is -0.2 take away 51978.316612? -51978.516612 Sum -47123349867 and 5. -47123349862 Sum -4 and -862.556906809. -866.556906809 Work out -30275377992 - 133. -30275378125 What is -55347628326 take away 75? -55347628401 Work out -0.15 + -919179807510. -919179807510.15 What is -0.68 take away 1009626816? -1009626816.68 What is the difference between 5.83 and 710110.48515? 710104.65515 Add together 5715730057 and 0.089. 5715730057.089 Calculate -1 - 52178961348. -52178961349 What is -260.8 minus 4064.00499? -4324.80499 35.3423283 - -3715618 3715653.3423283 Calculate -46.6 - 25263515752. -25263515798.6 Total of -4.137270599 and 0.5732. -3.564070599 -101515 - -9718791242 9718689727 3391876 - 287.02434 3391588.97566 What is 66625335.9242 minus 0.07? 66625335.8542 What is 36.6317528 less than -45088? -45124.6317528 What is the distance between -11035468957.8 and 8? 11035468965.8 132.470115097+-0.04 132.430115097 What is 1 less than -130862792867.07? -130862792868.07 Work out -66159571 + 315472. -65844099 Calculate 2676431828493 + 0.04. 2676431828493.04 Work out 30.73 - 164.5975576. -133.8675576 What is the distance between -4.834282261 and -0.5? 4.334282261 What is -1167 plus -120144694? -120145861 What is -15 plus -246.36735766? -261.36735766 What is the difference between 6 and 12.8970524073? 6.8970524073 What is -1307533919.6 - -170.4? -1307533749.2 What is -20306930680.7 less than 1354? 20306932034.7 Put together 0.5 and -162313141661. -162313141660.5 0.286173427 + -26.492 -26.205826573 Total of 181415 and -22843114. -22661699 What is 19.5 less than 158360154443? 158360154423.5 Calculate -4.61797210092 - -0.3. -4.31797210092 Add together 1153368.44 and -2.121. 1153366.319 Work out 2227111 + 436521. 2663632 88.51 - -0.007785061356 88.517785061356 Subtract 0.0235247435779 from 0.1. 0.0764752564221 Subtract -152.2 from 688350713. 688350865.2 What is -4 take away 796.986734979? -800.986734979 What is -227657580135 plus 0.17? -227657580134.83 Calculate -0.83 + 5459532250. 5459532249.17 Put together 0.092 and -0.0352390172. 0.0567609828 What is -752073 + -25.773755? -752098.773755 Work out 0.300068 + 15.304096. 15.604164 Sum 9.3 and 46514413.32. 46514422.62 Subtract 1272.446 from 171.297. -1101.149 Subtract -6835332324030 from -2. 6835332324028 Put together 3430146 and -1148158. 2281988 Work out -0.066408 + -2912.3367. -2912.403108 Work out -5654.83 - -1340084184. 1340078529.17 Put together 45926602.25 and -106. 45926496.25 Sum 0.3 and -15827.37455. -15827.07455 Subtract 7.71 from 2678589863. 2678589855.29 Work out -0.018957991728 + 2. 1.981042008272 Calculate 0.3445599 - 0.0995. 0.2450599 Subtract 3192173599 from 475.9. -3192173123.1 Work out -3469 + 176006986. 176003517 Calculate 14960 - -2048631.765. 2063591.765 2 - -86.355955351 88.355955351 Total of 3 and 17699.663360831. 17702.663360831 0.08550082 + 356772 356772.08550082 What is -0.19 take away 0.02424547627? -0.21424547627 What is 3 take away 120951831931? -120951831928 Add together 3239994532 and 0.1682. 3239994532.1682 Calculate 608021325 - -65.7083. 608021390.7083 What is the dis	{ "pile_set_name": "DM Mathematics" }
3 - 7q. -(q - 3)(q - 1)*2 Let s(m) = -5m*3 - 12m*2 - 11m. Let d(x) = x*3. Let i(c) = -4d(c) - s(c). Suppose i(q) = 0. Calculate q. -11, -1, 0 Let d(l) be the second derivative of 21 - 139l3 - 25l*5 - 21 - 21l*3 + 100l*4 - 25l + 128l2. Suppose d(h) = 0. Calculate h. 4/5 Let w(n) be the first derivative of -n5/5 - 3n4/4 + 20. Factor w(j). -j3(j + 3) Let r(t) be the second derivative of -3t*5/50 - 2t4/5 - t3/5 + 18t2/5 + 85t. Determine w so that r(w) = 0. -3, -2, 1 Factor -19x2 + 6x*4 - 23/2x*3 + 0 - 3/2x. x(x - 3)(x + 1)(12x + 1)/2 Let q(r) be the third derivative of r5/30 - r4/12 + 5r3/6 - 2r*2. Let m be q(-3). Find n such that -mn - 38n2 + 33n + 16n2 = 0. 0, 2/11 Suppose -d + s = 4, 0 = 2d + 4s + 1 - 5. Let h be d/(-12)(21 - 19). Suppose 2/3f + hf*2 + 0 = 0. Calculate f. -2, 0 Let t(y) be the first derivative of 1/12y*3 + 1/20y*5 - 1/8y*2 - 9 + 7/48y*4 - 1/6y. Find u such that t(u) = 0. -1, 2/3 Let b(i) be the second derivative of i*5/80 - 3i*4/16 + 5i*3/6 + 2i + 148. Find n, given that b(n) = 0. 0, 4, 5 Let m(y) be the second derivative of y*6/50 - 9y5/100 + y4/10 + 404y. Factor m(r). 3r*2(r - 2)(r - 1)/5 Let z(d) be the second derivative of 3d*5/140 + 2d*4 + 56d*3 - 765d. Determine x, given that z(x) = 0. -28, 0 Let w(a) be the second derivative of -1/3a2 - 4/9a*4 - 11/18a*3 - 16a - 7/60a5 + 0. Factor w(h). -(h + 1)2(7h + 2)/3 Let x(c) = 18c*2 - 4886c - 600222. Let i(f) = -4f2 + 977f + 120044. Let j(p) = -28i(p) - 6x(p). Factor j(l). 4(l + 245)2 Let l(n) = -3n*4 + 7n*3 + 3n*2 - 7n - 5. Let c(i) = -3i3 + 2 - 6i - 3i2 + 9i + 2i2 + 2i*4. Let o(q) = 5c(q) + 3l(q). Solve o(y) = 0 for y. -5, -1, 1 Suppose i - 15 = -a - 4i, -5i = -5a + 105. Suppose -15m = -am + 10. Find d such that 1/3d3 + 0d + 0d4 + 0 + 0d*m - 16/3d*5 = 0. -1/4, 0, 1/4 Let a(w) be the second derivative of 1/30w*5 + 1/6w*4 - 1/45w*6 - 10w + 0 + 0w2 + 1/6w*3. Let s(t) be the second derivative of a(t). Factor s(r). -4(r - 1)(2r + 1) Let x(f) = -2f - 2. Let j be (-42)/3(-6)/(-12). Let z be x(j). Let -2w4 - 63w*3 - 8w*2 + 60w*2 - 4w*2 - zw + 29w4 = 0. Calculate w. 0, 2/3, 1 Let l(c) be the second derivative of c6/15 + c5/4 - c4/4 - 37c - 3. Factor l(x). x*2(x + 3)(2x - 1) Let f(w) be the third derivative of -w*6/8 + 5w*5/3 + 155w*4/24 + 20w*3/3 + 14w*2 - 3w. Determine z, given that f(z) = 0. -1, -1/3, 8 Determine g, given that 783/4g - 391/2g*3 - 337/2g*2 + 729/4 - 55/4g*4 - 1/4g*5 = 0. -27, -1, 1 Determine z, given that -2/5z*4 + 2/5z*5 - 8/5 + 2z*2 - 2z*3 + 8/5z = 0. -2, -1, 1, 2 Let -16/7g + 16/7 - 12/7g*5 - 36/7g*2 + 4/7g*4 + 44/7g*3 = 0. What is g? -2, -2/3, 1 Suppose 3o + 25 + 29 = 0. Let d be 2 - (3 + -2(-15)/o). Factor 1/3r + 0r2 + 0r*4 + 0 + 1/3r*5 - dr*3. r(r - 1)*2(r + 1)*2/3 Let w = 705121/1594065 + 4/48305. Let y = w - 8/33. Factor 0j - yj4 + 0 - 2/5j*3 - 1/5j2. -j2(j + 1)2/5 Let 0 - 68/7p*4 - 52/7p*2 + 8/7p + 96/7p3 + 16/7p*5 = 0. What is p? 0, 1/4, 1, 2 Let x(u) be the third derivative of 0u*3 + 0u + 0u5 + 0u*4 - 1/720u*6 + 1/1260u*7 + 0 + 6u*2. Find h such that x(h) = 0. 0, 1 Let s(b) = 15b*2 - 55b + 50. Let j(a) be the first derivative of 2a3/3 - 7a*2/2 + 6a + 34. Let p(l) = 25j(l) - 3s(l). Let p(d) = 0. What is d? 0, 2 Let l(b) = -7b3 - 260b*2 + 5564b - 5297. Let r(k) = -2k3 - k2 + 4k - 1. Let g(c) = -l(c) + 5r(c). Factor g(t). -3(t - 42)*2(t - 1) Suppose 0 = -f + 10 - 4. Suppose f - 6 = 8d. Suppose -1/2t*4 - 3/2t3 - t2 + 0 + dt = 0. Calculate t. -2, -1, 0 Suppose -21r = 12r + 4r. Factor -8/5m - 4/5m*2 + r. -4m(m + 2)/5 Suppose -2x - q + 7 = 0, 5q - 3 = -2x - 0. Suppose 4/3 + 2/3p3 - 4/3p + 1/3px - p2 = 0. Calculate p. -2, 1 Let g(x) be the third derivative of -x8/336 - x7/105 + x6/40 + x5/15 - x4/6 - x2 + 33. Factor g(a). -a(a - 1)*2(a + 2)*2 Determine i, given that 7993 + 3i*3 + 15i*4 + 6i*2 + 30i3 - 7993 = 0. -2, -1/5, 0 Let g(r) be the first derivative of -r5/15 + 5r4/6 + 4r*3/3 - 5r*2/3 - 11r/3 - 16. Factor g(q). -(q - 11)(q - 1)(q + 1)*2/3 Let m(z) be the third derivative of 0z - 1/21z7 - 11z*2 + 2/3z*4 + 2/15z*5 - 1/168z*8 + 0z*3 - 1/10z*6 + 0. Factor m(b). -2b(b - 1)(b + 2)*3 Suppose -2b + 7 = 3. Let g = 2/1535 - -3044/19955. Factor 2/13a3 + ga*b + 0 - 4/13a. 2a(a - 1)(a + 2)/13 Let g(x) be the third derivative of x5/100 - 7x*4/20 - 3x*3/2 + 2x*2 - 58. What is q in g(q) = 0? -1, 15 Let c = -38 - -27. Let p = c + 15. Find y such that 11y*2 - py + 0y - 4y*3 - 3y*2 = 0. 0, 1 Let q = -944 - -947. Let -2/5t - 2/5tq + 0 + 4/5t2 = 0. What is t? 0, 1 Let s(i) be the third derivative of -i7/42 + i*5/12 + 43i*2. Factor s(n). -5n*2(n - 1)(n + 1) Let g(m) be the second derivative of -m7/84 - 7m*6/80 - 33m*5/160 - 19m4/96 - m3/16 + 72m. Find c such that g(c) = 0. -3, -1, -1/4, 0 Let h(a) be the third derivative of 1/48a*4 + 0a - 1/840a7 + 1/240a*5 - 1/240a*6 + 0a*3 + 7a*2 + 0. Suppose h(s) = 0. What is s? -2, -1, 0, 1 Let j be (-8)/28 - 264/(-770). Let p(s) be the first derivative of -2/21s*3 + 0s*4 + js*5 + 0s*2 - 8 + 0s. Factor p(q). 2q2(q - 1)(q + 1)/7 Let m(d) be the second derivative of 0 + 0d*3 + 19d + 0d4 + 1/30d*6 + 3/20d*5 + 0d2. What is k in m(k) = 0? -3, 0 Let x(m) be the second derivative of m6/120 - 3m5/80 - m4/12 - 2m - 80. Factor x(u). u*2(u - 4)(u + 1)/4 Let y(w) be the third derivative of w8/4032 + w7/504 + 11w*5/60 + 42w*2. Let f(v) be the third derivative of y(v). Find n such that f(n) = 0. -2, 0 Let n(u) = 40u + 440. Let x be n(-11). Factor 3/2f4 + 0f*2 + xf - 3/2f3 + 0. 3f*3(f - 1)/2 Factor -2/7g2 + 0 - 106/7g + 106/7g3 + 2/7g*4. 2g(g - 1)(g + 1)(g + 53)/7 Let a(o) be the first derivative of 2/13o - 1/13o4 + 2/13o*2 + 0o*3 - 2 - 2/65o*5. Factor a(x). -2(x - 1)(x + 1)3/13 Factor 16/7 - 12/7l - 54/7l2. -2(3l + 2)(9l - 4)/7 Find u such that -1/5u*3 + 2/5u*2 + 0u + 0 = 0. 0, 2 Let o(c) = c + 1. Let v be o(1). Factor 12 + 2d3 - 17d*2 - 8d + 21dv - 28. 2(d - 2)(d + 2)2 Let y(s) be the first derivative of -s7/560 + s5/80 - s3/16 + 6s*2 - 3. Let m(n) be the second derivative of y(n). Factor m(z). -3(z - 1)*2(z + 1)*2/8 Let w(z) be the first derivative of -1/6z*3 - 1/6z4 + z2 + 1/20z5 - 4 + z. Let m(d) be the first derivative of w(d). Factor m(y). (y - 2)(y - 1)(y + 1) Suppose 5 = -4g + 17. Let z(u) = 4u - 33. Let p be z(14). Determine t so that 0t*4 + 0t*4 + 18t*g + 59t*2 + 24t + 3t4 - pt*2 = 0. -2, 0 Let x(a) be the first derivative of 16/5a + 11 + 4/3a3 - 1/10a*4 - 17/5a*2. Factor x(h). -2(h - 8)(h - 1)2/5 Let h = -43723 - -43728. Let -20/7q*3 - 2/7q*h + 10/7 - 2q*4 + 4/7q*2 + 22/7q = 0. What is q? -5, -1, 1 Let -408/7s2 - 15/7s*4 - 699/7s*3 + 276/7s + 0 = 0. Calculate s. -46, -1, 0, 2/5 Let j(c) be the second derivative of -1/8c4 + 0 - 8c + 1/2c3 + 9/4c*2. Factor j(z). -3(z - 3)(z + 1)/2 Factor -130150c + c*3 + 7c*4 + 130150c. c*3(7c + 1) Let i(c) be the second derivative of 5/6c*4 + 0c*2 - 5/42c*7 + 7c + 5/6c3 + 0c*5 - 1/3c*6 + 0. Factor i(y). -5y(y - 1)(y + 1)*3 Let k be (-8 + 147/35)/(-1) - 3. Let 2/5v*2 + kv - 2/5v3 + 0 = 0. Calculate v. -1, 0, 2 Let b(o) = -o3 + 3o*2 + 5o - 2. Let i be b(4). Factor -4ri - 4r*3 + 10r*3 - 4r*3. 2r*2(r - 2) Let a(g) be the second derivative of 1/90g6 + 0 - 3g - 2/15g5 + 11/18g*4 + 3/2g*2 - 4/3g*3. Solve a(t) = 0. 1, 3 Let v = 292 - 288. Factor 0 - 5/2j*2 + 5j + 15/2jv - 10j*3. 5j(j - 1)2(3j + 2)/2 Suppose -3p*2 + 96p*5 - 99p*5 + 9p*4 + 3p*2 = 0. Calculate p. 0, 3 Let y(p) = 18p*4 - 27p*3 + 12p*2 + 27p - 15. Let u(f) = f*4 - 2f3 + f2 + 2f - 1. Let k(d) = 15u(d) - y(d). Factor k(r). -3r(r - 1)(r + 1)2 Let w be (-6)/(-27) - 10/(-6)(-36)/270. Fa	{ "pile_set_name": "DM Mathematics" }
rounded to the nearest 10? 708890 What is 0.0459602937 rounded to 6 decimal places? 0.04596 What is -1460924.174 rounded to the nearest 10000? -1460000 What is -0.0569806776 rounded to six dps? -0.056981 What is -3.601746555 rounded to the nearest integer? -4 What is -153.8434499 rounded to 2 dps? -153.84 What is 1936.0254 rounded to the nearest 10? 1940 Round 0.002574587377 to four dps. 0.0026 Round -1004578103 to the nearest 100000. -1004600000 Round 10.7657278 to 1 dp. 10.8 What is -9589.1246 rounded to the nearest 10? -9590 What is 0.0291984808 rounded to three decimal places? 0.029 What is 2035800.54 rounded to the nearest one hundred? 2035800 Round 1.147244506 to 1 decimal place. 1.1 Round -222649.514 to the nearest 1000. -223000 Round 0.542310139 to 4 decimal places. 0.5423 Round 0.076362848 to six dps. 0.076363 Round -330203.715 to the nearest one thousand. -330000 What is -104468706.4 rounded to the nearest one hundred thousand? -104500000 Round -50851.491 to the nearest 10000. -50000 What is 48598.6807 rounded to the nearest integer? 48599 What is 0.00001879883987 rounded to 6 dps? 0.000019 What is 0.0000925095092 rounded to seven decimal places? 0.0000925 What is 1.27137916 rounded to two dps? 1.27 What is 39.445762 rounded to one dp? 39.4 What is -0.00059148828 rounded to 6 dps? -0.000591 What is -41355114.56 rounded to the nearest one hundred thousand? -41400000 Round -1.2072160729 to one dp. -1.2 What is -617.52933 rounded to the nearest one hundred? -600 Round -0.0203204587 to 3 decimal places. -0.02 What is 0.00000258242268 rounded to 7 dps? 0.0000026 What is -529.915198 rounded to the nearest one hundred? -500 What is -130311.857 rounded to the nearest ten thousand? -130000 Round 1396929.4244 to the nearest ten. 1396930 What is -0.00004238029196 rounded to 7 decimal places? -0.0000424 What is -4022388.9 rounded to the nearest 1000000? -4000000 What is -665.332743 rounded to the nearest integer? -665 Round -67.085826 to 2 decimal places. -67.09 What is -240799.485 rounded to the nearest 10000? -240000 What is -4897845.703 rounded to the nearest one hundred thousand? -4900000 Round -53921.1237 to zero decimal places. -53921 What is -845238.2 rounded to the nearest one hundred thousand? -800000 What is 0.3096828111 rounded to one decimal place? 0.3 Round -0.00057553992 to 5 decimal places. -0.00058 What is 7223.17027 rounded to one dp? 7223.2 Round 0.2045744528 to 4 decimal places. 0.2046 Round 225018.939 to the nearest 100. 225000 What is -0.00421777635 rounded to seven dps? -0.0042178 Round -0.002546784852 to four dps. -0.0025 Round -3831.482728 to the nearest 10. -3830 Round 3.1688724 to four decimal places. 3.1689 What is 114108.8485 rounded to the nearest ten thousand? 110000 Round 394.940136 to the nearest integer. 395 Round 0.00079806283 to four decimal places. 0.0008 What is -1329194140 rounded to the nearest one million? -1329000000 Round 888.356627 to two decimal places. 888.36 Round 0.000000357887638 to seven decimal places. 0.0000004 Round -2080581.037 to the nearest 100000. -2100000 Round -10.8711259 to two dps. -10.87 Round 0.1974726213 to 3 dps. 0.197 What is -7620576 rounded to the nearest 1000000? -8000000 Round 351.35842 to 1 dp. 351.4 Round -28.84890221 to 4 dps. -28.8489 What is 77194662 rounded to the nearest one million? 77000000 What is 0.00000406646225 rounded to 7 dps? 0.0000041 What is 0.0000398229781 rounded to six dps? 0.00004 What is -0.00690056351 rounded to 3 dps? -0.007 Round -2082617.48 to the nearest one hundred thousand. -2100000 Round -3766.447956 to the nearest ten. -3770 What is 24669588.471 rounded to the nearest 1000? 24670000 Round 0.001094782163 to six dps. 0.001095 Round -1449.096277 to 1 decimal place. -1449.1 Round 10628.41242 to one dp. 10628.4 Round 0.086139391 to four decimal places. 0.0861 What is -40863.769 rounded to the nearest ten thousand? -40000 What is -3724.10729 rounded to the nearest ten? -3720 What is 148.40824453 rounded to the nearest integer? 148 What is 379903790 rounded to the nearest one hundred thousand? 379900000 What is -1734555979.5 rounded to the nearest 1000000? -1735000000 Round 6771235.59 to the nearest 1000000. 7000000 Round 97.25718905 to the nearest 10. 100 Round -0.33491633107 to 5 decimal places. -0.33492 What is -0.000437197953 rounded to 5 dps? -0.00044 What is 12655605500 rounded to the nearest 1000000? 12656000000 What is 0.0003069552083 rounded to 6 decimal places? 0.000307 Round 60979671.6 to the nearest one million. 61000000 What is -70.916286 rounded to zero decimal places? -71 What is 38.5081706 rounded to the nearest integer? 39 Round -75.010309 to three dps. -75.01 What is 132.505473 rounded to 1 decimal place? 132.5 Round 38752396.4 to the nearest one hundred thousand. 38800000 Round -13.26221412 to 2 dps. -13.26 What is -3.45002382 rounded to three decimal places? -3.45 Round 1.925979594 to four dps. 1.926 Round -0.03766343511 to five decimal places. -0.03766 Round 0.01541701195 to three dps. 0.015 What is 1.26449821 rounded to 1 dp? 1.3 What is 5786.882 rounded to the nearest 10? 5790 Round -633.85682 to 1 dp. -633.9 Round 222561.699 to the nearest one hundred. 222600 What is 2.678494521 rounded to 3 dps? 2.678 What is 665724140 rounded to the nearest one million? 666000000 What is -179137564.1 rounded to the nearest 1000000? -179000000 Round -102613.811 to the nearest ten thousand. -100000 Round 1080.9909939 to one dp. 1081 What is 2338.36985 rounded to the nearest ten? 2340 Round 0.00000303786123 to 7 dps. 0.000003 What is 0.1741477008 rounded to 5 dps? 0.17415 What is -8606119.5 rounded to the nearest 10000? -8610000 Round -0.00000933281178 to 7 decimal places. -0.0000093 What is 35.2956935 rounded to zero decimal places? 35 What is 104067.0811 rounded to the nearest ten? 104070 What is 258.09587 rounded to 0 decimal places? 258 Round 96918.673 to the nearest 10000. 100000 What is -0.00003200107 rounded to seven decimal places? -0.000032 Round 0.62619513 to three dps. 0.626 Round -5446.023 to the nearest ten thousand. -10000 Round -1473728.7 to the nearest 10000. -1470000 What is 508.45623 rounded to the nearest integer? 508 What is -194.9531026 rounded to the nearest integer? -195 What is -201237.263 rounded to the nearest 10000? -200000 Round -18407571.3 to the nearest 10000. -18410000 Round 0.00747688796 to six dps. 0.007477 What is -6.0738371 rounded to one dp? -6.1 Round -907.361849 to two decimal places. -907.36 Round -1379665.086 to the nearest one hundred thousand. -1400000 Round -0.0004929061 to six dps. -0.000493 Round -1644704.299 to the nearest ten thousand. -1640000 Round -51.0385265 to two dps. -51.04 What is 0.000353262773 rounded to 6 dps? 0.000353 Round 87986341 to the nearest 1000000. 88000000 Round -1.11854632 to 2 decimal places. -1.12 Round -78.5210408 to two decimal places. -78.52 Round 244.2279365 to 2 decimal places. 244.23 Round 3373963.48 to the nearest 10000. 3370000 Round 0.000003169686548 to 7 decimal places. 0.0000032 Round -1722.98743 to the nearest one thousand. -2000 What is 0.0234947966 rounded to four decimal places? 0.0235 What is 1043.931602 rounded to one decimal place? 1043.9 Round -14915274.6 to the nearest 100000. -14900000 Round 0.050323975 to three dps. 0.05 What is -285.14015 rounded to two decimal places? -285.14 Round 173.215587 to one decimal place. 173.2 What is -2515.7827 rounded to one decimal place? -2515.8 What is -76.9215892 rounded to the nearest integer? -77 Round -25.2517134 to the nearest 10. -30 What is 0.000091029514 rounded to five dps? 0.00009 Round 472.654036 to the nearest 100. 500 What is -0.00009732952 rounded to seven decimal places? -0.0000973 Round 380.75589 to the nearest 100. 400 What is 3628225194 rounded to the nearest 1000000? 3628000000 Round -1831086.1974 to the nearest ten thousand. -1830000 Round -0.32510691 to 2 decimal places. -0.33 Round -0.000011422085 to 5 dps. -0.00001 Round 114507.137 to the nearest one thousand. 115000 Round -4154946.98 to the nearest ten thousand. -4150000 What is -1218412.954 rounded to the nearest 1000000? -1000000 Round -1939031.6 to the nearest ten thousand. -1940000 Round 129875.29413 to the nearest 10000. 130000 Round -1.0	{ "pile_set_name": "DM Mathematics" }
-1/3 Let d = -2 - 1. Are -18/7 and d equal? False Let m(j) = j*3 + 5j*2 - j + 5. Let v be m(-5). Let g be 3/(36/60). Is v at most as big as g? True Suppose i + 1 - 4 = 0. Suppose -ix - 8 = -2k, -3k - 5x - 8 = 18. Let m be k/10 + 5/25. Is 1/4 != m? True Let i be 45/2 + -3 + (-3)/6. Which is smaller: 35/2 or i? 35/2 Suppose -4q + 11 = -5. Suppose r + qr - 15 = -5z, 0 = -r + 3. Is 0 bigger than z? False Let h = -73.5 - -74. Is h not equal to -2/9? True Let j(b) = b - 8. Suppose 4 = -x - 5r, 5x = -r - 3r + 22. Let o be j(x). Are o and -5/2 equal? False Let i be (-9)/(-7) + (-4)/14. Suppose -4 = m + i. Is m smaller than -6? False Let x = -65 + 197/3. Suppose 3n + n - 5 = -j, 5n = 4j + 1. Does n = x? False Let q be (-56)/221880/24. Let l = -976/11 - q. Let x = l - 112. Which is smaller: -2 or x? -2 Let n = 1/62 - -115/558. Let v be 1/(-4) + 7/28. Which is bigger: v or n? n Let z = -1.15 - -0.15. Are 1 and z unequal? True Let r = -8 + 11. Is 4 at least r? True Let u be 6-34/(-18). Let i(b) = b*2 - 3b - 4. Let c be i(u). Is c bigger than -3/5? True Suppose 12r = 16r. Does 0 = r? True Let c = -16 - -33. Is 2 > c? False Let c = 1.2 - 1.3. Is 0.08 != c? True Let c be 2/6 + (-2)/(-3). Let a = 1/135 - 11/27. Which is smaller: a or c? a Let i be (-3 + 280/95)/((-2)/10). Is i greater than or equal to 1? False Let i = -66/35 - -8/5. Is -33 != i? True Let q be (73 - -10)1/(-3). Let v(k) = 26k*3 + 1. Let n be v(1). Let l = q + n. Which is bigger: 0.1 or l? 0.1 Let b be ((-2)/(-4))/(4/8). Which is smaller: 5/3 or b? b Let y = 16 + -20. Let p = -5/14 + -209/42. Which is greater: p or y? y Suppose -2p + 1 = -1. Let a(j) = -j*2 + 6j + 1. Let d be a(5). Let z be 1/(-1)1/d. Is z at most as big as p? True Let k = 1.5 + -1.4. Is -7 smaller than k? True Let k = 0.72 + -0.7. Let g = k - 0.22. Which is smaller: g or 0.1? g Let z(m) be the first derivative of -2m - 1/2m2 + 3. Let t be z(-3). Which is bigger: -2/7 or t? t Let l be 15/6(-48)/110. Is l >= -1? False Let f(r) = r + 3. Let h be f(0). Suppose -h = 5v - 58. Which is greater: 12 or v? 12 Let d(b) = b - 5. Let w be d(7). Suppose -3q - 3s + 3 = 0, 3 = 5q + ws - 2. Let l = -1/369 - 241/1845. Is q >= l? True Suppose 0 = -3v + 17 + 28. Which is greater: v or 14? v Let g = -4 + 10. Which is greater: g or 5? g Suppose -8 = -2w - 2. Let s be ((-8)/40)/(w/(-5)). Which is greater: s or -1? s Let g be -2(6/(-3) + -2). Let k = g + -7. Which is bigger: k or 2/11? k Suppose -10 = z - 3b + b, 4z + 84 = -3b. Let j = -17 - z. Do 3 and j have the same value? False Suppose 0 = -4h + v + 406 + 5, 2v - 10 = 0. Let c = h - 730/7. Let n be (3 - 4)(-4 - -5). Which is smaller: c or n? n Suppose -60 = 5r - 2h, r = 2h - 7h + 15. Which is bigger: r or -12? r Let n be (-6)/9 - 36/4. Let l = 25 - 35. Let i = l - n. Which is greater: -1 or i? i Let p = -61 + 51. Which is bigger: 2 or p? 2 Let b(d) = d*3 + 2. Let s be b(0). Suppose 533 = 3f - 0t + 2t, 2f + 3t - 362 = 0. Let j = 705/4 - f. Which is bigger: j or s? s Let m = -9 + 10. Let t = 2 - m. Is t greater than or equal to 5/4? False Suppose 3g + 3n = 0, -4n + 5 = -5n. Suppose -42 = -2y - 5y. Is y bigger than g? True Let n(x) = -3 + 6 - 2x + 1. Let u be n(3). Let j be (8/(-10))/(u/(-5)). Which is bigger: j or -0.2? -0.2 Suppose j - 3j - 4n - 12 = 0, -4j - 5n = 9. Suppose js + 10 = -s + c, 4s + 4c = 16. Which is smaller: s or -0.05? s Let t = 5 - 7. Let q = -27/10 - -11/5. Are t and q non-equal? True Let j = -14 - -20. Let h be (-12)/(-16)10/j. Which is smaller: 1 or h? 1 Let n be (-6)/(-4)(-2)/6. Are n and -1 equal? False Let b = -11 + 10.6. Let w = -2.4 - b. Is w >= -5? True Let y(k) = k*2 - 4k - 4. Let a(x) = -3x3 - x2 + x + 1. Let m be a(-1). Let b = 3 + m. Let s be y(b). Is 1/3 at least s? False Let s be (-341)/(4/6). Which is greater: -50 or s? -50 Suppose x + 12 = 5x. Let u = x + -2. Which is greater: u or 1/8? u Let f = -2 + 1. Let t(z) = -z2 - 10z - 7. Let l be t(-9). Let a(y) = y - 2. Let q be a(l). Which is bigger: f or q? q Let b = -0.07 + 2.07. Let h = b + -2. Let d = -0.01 + 2.01. Are d and h non-equal? True Suppose -5j - 9 = -2r, 9r = 4r - 5j + 110. Which is smaller: 16 or r? 16 Suppose 0 = 2a + 8 - 2. Let s be 3((-20)/a)/(-5). Which is greater: -6 or s? s Let k(o) = o3 - 4o*2 + 2o. Suppose w + 19 = 5s, -4w - 7 = s + 6. Let q be k(s). Let c(d) = d*2 + 2d - 2. Let y be c(q). Is y greater than 1/4? True Let y = 17 + -15. Which is smaller: 20/9 or y? y Suppose 6q - 33 = -165. Is 0.1 != q? True Suppose -2i + g - 3 = 3i, 0 = -4g + 12. Suppose i = -0j - 5j - 20. Do j and -4 have different values? False Let s = -7.5 - 1.5. Is -1/4 less than s? False Suppose y = -1 + 6. Let q(f) = -8f - 2. Let z be q(-1). Which is greater: z or y? z Let j = 48 + -42. Is 1 at least j? False Let a(q) = q - 5. Let g be (5 - -3) + 1 - 3. Let k be a(g). Let r(x) = x + 2. Let m be r(0). Which is smaller: m or k? k Suppose -5o = -97 + 22. Is 15 less than o? False Let k = -1.1 - -8.1. Let q = k + -6.4. Let u = q - 0.7. Is 1 > u? True Let d be (-8)/(-30)(-15)/(-10). Which is greater: d or 5? 5 Let y = -25 + 30. Is 0 <= y? True Let n = 0.1 + 0.06. Let l = n + -0.06. Is l bigger than -1/3? True Let i be 17 + (0/(-1) - -2). Suppose 0 = -ia + 18a - 2. Which is greater: -1 or a? -1 Let c be (10 + -2)(-2)/12. Let x = -4 + -3. Let k = x + 7. Are c and k non-equal? True Let y(s) = s*3 + 5s*2 - 7s - 5. Let a = 1 - 7. Let i be y(a). Let k be (i + 9/6)2. Which is smaller: 4 or k? 4 Suppose 2b - 7 = -1. Suppose 6 = c - bm, -3m = 4c - 22 - 2. Which is bigger: c or 4? c Let u = 1 - 1. Suppose b + 5d - 5 = u, 0d = -4b - d + 39. Let a be b/(-35) + (-32)/(-63). Is a at least 1? False Let n = -1 - -3. Let r = -0.13 + 2.23. Let c = -0.1 + r. Is c at most n? True Suppose 3j + 2 = 4n - 0, 4j - n + 7 = 0. Let d be 0 - 5/(75/j). Is d at most as big as 0? False Let y = -2/189 - 52/189. Which is bigger: 7 or y? 7 Suppose 4f - 24 = 6f. Let h = 10 + f. Let o be (-3)/4 + (h - -3). Does -3 = o? False Let y(a) = -23a - 9. Let z be y(-6). Let c = z + -647/5. Is -1 less than or equal to c? True Suppose 5v - 20 = -4u + 2u, -2u - 20 = -5v. Let x be (u - 0 - 1) + 28. Suppose 2 - x = 5w. Are w and -6 equal? False Let o be (3 - 1)14/(-4). Let s be 6/15 - (-111)/(-15). Is o less than s? False Suppose u + 3u = 0. Which is bigger: u or 1/4? 1/4 Let o = 125 + 55. Let i be (o/8)/((-3)/6). Let n = 177/4 + i. Which is smaller: n or 0? n Let d = -9 - -8. Which is greater: d or -2/35? -2/35 Let o be -3 + 1(-1 + 2). Let u = 7 + -8. Let m = 1 + u. Is o at most m? True Let o = -19.53 + -0.47. Which is greater: 2 or o? 2 Let d(j) = 2j + 8. Let l be d(-6). Let w be (-1 + -3)5/l. Suppose -2t - 3s - w = 2t, -t - 2s - 5 = 0. Which is greater: t or 2/3? t Let h = 406 + -6898/17. Do 1 and h have different values? True Let v(l) = l3 - l2 - l. Let y(a) = 4a*2 + 4a + 8. Let q(n) = -v(n) + y(n). Let f be q(6). Let i be (-1 + 2)/(2 - 1). Which is smaller: i or f? i Let x(r) = -r*2 + 13r + 3. Let i be x(13). Which is greater: i or 0.2? i Let y be 1(-3 - 24/(-3)). Suppose 5q + 0q - y = 0. Let k = 79/5 - 16. Is q >= k? True Let r = 14 + -9. Let j be (-2)/r(0 + 5). Suppose 5d + 5 = -0. Is j at most d? True Let c(b) be the first derivative of b4/4 - 11b*3/3 + 9b*2/2 + 5b + 3. Let p be c(10). Which is bigger: p or -4? -4 Let l be ((-6)/4)/((-2628)/48). Which is smaller: -1 or l? -1 Suppose -5r + 3n = 15 + 14, 0 = r - n + 7. Let m(h) = h*2 + 4h + 5. Let z be m(r). Let f = z + -2. Do f and 2 have different values? True Let r = -132 + 388/3. Let n = r + 2. Let x = 0.4 + 0.6. Is x smaller than n? False Let g be (-41)/8 - 6/(-48). Is g equal to -1/4? False Let z = 8.82 - -0.18. Let r = -7 + z. Which is smaller: -0.1 or r? -0.1 Let r be 3 - ((-4 - -1) + 1). Suppose -rj - n = n + 9, 0 = -3j - 4n - 11. Which is bigger: -3 or j? j Let s = 1.2 - 2.1. Let x = -3.1 + s. Let b = x - -2. Is -0.2 equal to b? False Let i = 309.6 + -282. Let z = i + -28. Let b = 0.2 + -0.3. Which is bigger: b or z? b Let i(l) = l2 - 12l + 3. Let n be i(11). Let a be (2/(-8))/(2/n). Suppose 2*w - 4 = 6. Which is smaller: a or w? a	{ "pile_set_name": "DM Mathematics" }
52 is divided by 162858. 104 What is the remainder when 11124470 is divided by 273? 266 Calculate the remainder when 90653254 is divided by 2109. 2107 Calculate the remainder when 157739142 is divided by 188. 186 Calculate the remainder when 4830915 is divided by 1610209. 288 What is the remainder when 14003373 is divided by 2800649? 128 Calculate the remainder when 10182383 is divided by 496. 495 What is the remainder when 418978 is divided by 19951? 7 What is the remainder when 1549965 is divided by 44? 21 Calculate the remainder when 104852 is divided by 26207. 24 Calculate the remainder when 5702305 is divided by 7066. 43 Calculate the remainder when 1041355 is divided by 35908. 23 What is the remainder when 15857442 is divided by 456? 42 What is the remainder when 50356374 is divided by 243? 213 Calculate the remainder when 1766227 is divided by 405. 22 What is the remainder when 517474 is divided by 114? 28 Calculate the remainder when 733152 is divided by 36. 12 Calculate the remainder when 1658204 is divided by 388. 280 Calculate the remainder when 87291040 is divided by 158. 148 Calculate the remainder when 33424943 is divided by 28. 27 Calculate the remainder when 5064513 is divided by 2. 1 Calculate the remainder when 59486 is divided by 2232. 1454 What is the remainder when 1387720 is divided by 346924? 24 Calculate the remainder when 237324 is divided by 2242. 1914 What is the remainder when 33605935 is divided by 701? 696 Calculate the remainder when 15101936 is divided by 81. 53 What is the remainder when 7705049 is divided by 782? 3 Calculate the remainder when 4711742 is divided by 83. 81 Calculate the remainder when 41336 is divided by 2500. 1336 What is the remainder when 42354 is divided by 187? 92 Calculate the remainder when 7242100 is divided by 161. 159 Calculate the remainder when 2543327 is divided by 838. 835 Calculate the remainder when 18016 is divided by 14584. 3432 Calculate the remainder when 587167 is divided by 159. 139 What is the remainder when 16454143 is divided by 48? 31 Calculate the remainder when 36868976 is divided by 56. 32 What is the remainder when 2816951 is divided by 47? 6 What is the remainder when 11531790 is divided by 51945? 0 What is the remainder when 9993194 is divided by 234? 224 Calculate the remainder when 42822811 is divided by 1385. 1381 What is the remainder when 67216076 is divided by 35? 11 What is the remainder when 145541 is divided by 4846? 161 Calculate the remainder when 30788395 is divided by 1504. 11 What is the remainder when 1901990 is divided by 475462? 142 What is the remainder when 653244 is divided by 7338? 162 What is the remainder when 107091 is divided by 2727? 738 What is the remainder when 44538 is divided by 142? 92 What is the remainder when 6882383 is divided by 16827? 140 Calculate the remainder when 4558943 is divided by 314. 291 What is the remainder when 3604 is divided by 3366? 238 Calculate the remainder when 315124 is divided by 157322. 480 Calculate the remainder when 86952 is divided by 636. 456 Calculate the remainder when 120132 is divided by 66. 12 Calculate the remainder when 3307889 is divided by 831. 509 Calculate the remainder when 170205 is divided by 5318. 29 What is the remainder when 41914 is divided by 4600? 514 Calculate the remainder when 92261 is divided by 9. 2 Calculate the remainder when 21221 is divided by 577. 449 What is the remainder when 74980 is divided by 37486? 8 What is the remainder when 3016273 is divided by 1312? 1297 What is the remainder when 1175836 is divided by 1175754? 82 What is the remainder when 11168 is divided by 10804? 364 Calculate the remainder when 73925994 is divided by 1500. 1494 Calculate the remainder when 2753304 is divided by 105. 99 What is the remainder when 2156441 is divided by 1078220? 1 What is the remainder when 1555524 is divided by 3749? 3438 Calculate the remainder when 2001158 is divided by 41682. 422 Calculate the remainder when 4042586 is divided by 673728. 218 Calculate the remainder when 70371890 is divided by 50. 40 Calculate the remainder when 776866 is divided by 29. 14 Calculate the remainder when 772636 is divided by 772601. 35 What is the remainder when 2698963 is divided by 6599? 6571 What is the remainder when 119929 is divided by 79? 7 Calculate the remainder when 258777 is divided by 85741. 1554 What is the remainder when 8975 is divided by 3521? 1933 What is the remainder when 426402335 is divided by 29? 23 Calculate the remainder when 12662903 is divided by 297. 11 Calculate the remainder when 2035664 is divided by 635. 489 Calculate the remainder when 5527660 is divided by 1381905. 40 Calculate the remainder when 381684 is divided by 646. 544 What is the remainder when 2248378 is divided by 107061? 97 What is the remainder when 47297 is divided by 9356? 517 What is the remainder when 6731919 is divided by 10? 9 What is the remainder when 172778377 is divided by 1350? 1327 What is the remainder when 32457363 is divided by 1893? 1878 Calculate the remainder when 92716 is divided by 22122. 4228 Calculate the remainder when 192531 is divided by 4913. 924 Calculate the remainder when 29650954 is divided by 3. 1 What is the remainder when 823222 is divided by 342? 28 Calculate the remainder when 40514 is divided by 164. 6 Calculate the remainder when 290108654 is divided by 7. 3 What is the remainder when 82146221 is divided by 1252? 1249 Calculate the remainder when 2343461 is divided by 1722. 1541 What is the remainder when 79272 is divided by 682? 160 What is the remainder when 1133161 is divided by 30? 1 Calculate the remainder when 62705 is divided by 10445. 35 Calculate the remainder when 97604 is divided by 2268. 80 Calculate the remainder when 468979 is divided by 15. 4 What is the remainder when 346191 is divided by 3316? 1327 What is the remainder when 12430 is divided by 2999? 434 What is the remainder when 3674454 is divided by 282650? 4 What is the remainder when 1530219 is divided by 19? 16 Calculate the remainder when 138358 is divided by 1116. 1090 What is the remainder when 19156 is divided by 1432? 540 What is the remainder when 3700723 is divided by 264334? 47 What is the remainder when 5818302 is divided by 32? 30 What is the remainder when 3827199 is divided by 537? 0 Calculate the remainder when 12590903 is divided by 21. 17 What is the remainder when 98019 is divided by 45938? 6143 What is the remainder when 8996613 is divided by 18? 15 What is the remainder when 46115732 is divided by 41? 39 What is the remainder when 56996470 is divided by 42? 34 Calculate the remainder when 2899710 is divided by 263609. 11 Calculate the remainder when 462813178 is divided by 12. 10 Calculate the remainder when 1172805 is divided by 3723. 60 Calculate the remainder when 5307527 is divided by 209. 181 What is the remainder when 3499737 is divided by 583286? 21 Calculate the remainder when 527188 is divided by 527058. 130 What is the remainder when 59145 is divided by 264? 9 Calculate the remainder when 521787 is divided by 7052. 6991 What is the remainder when 17568368 is divided by 172? 116 What is the remainder when 90363 is divided by 9996? 399 What is the remainder when 1141125 is divided by 190185? 15 What is the remainder when 421584 is divided by 22822? 10788 What is the remainder when 433652114 is divided by 584? 578 What is the remainder when 433013 is divided by 47880? 2093 Calculate the remainder when 3588831 is divided by 3034. 2643 What is the remainder when 1148134 is divided by 140? 134 Calculate the remainder when 740361 is divided by 740343. 18 What is the remainder when 24782381 is divided by 54110? 1 Calculate the remainder when 43900 is divided by 337. 90 Calculate the remainder when 584208 is divided by 1765. 1758 Calculate the remainder when 796072 is divided by 99509. 0 Calculate the remainder when 377476 is divided by 188447. 582 Calculate the remainder when 1109085 is divided by 1469. 1459 Calculate the remainder when 597504 is divided by 595938. 1566 Calculate the remainder when 271032 is divided by 88933. 4233 Calculate the remainder when 9241725 is divided by 822. 801 What is the remainder when 94452 is divided by 2306? 2212 What is the rem	{ "pile_set_name": "DM Mathematics" }
24/282/81. Let c = r - q. Is c greater than or equal to -3? True Let n be -7 + -1 + 3 + 7 - 52. Let m = -50 - n. Let i be ((-28)/18)/(1 - -1). Is i smaller than m? True Let w(q) = q2 + q. Let v be w(1). Suppose 8k + 412 = -95k. Let a be vk/(-8)1. Which is greater: -2/69 or a? a Suppose 0 = -4t + 11 + 13. Suppose tx = -3x + 135. Is 15 at most x? True Let v(h) = 2h2 - 16h + 30. Suppose -10x + 48 = 6x. Let r be v(x). Which is smaller: r or 2/11? r Suppose 35u = 33u - q + 1028, -3q = 3u - 1554. Are u and 531 unequal? True Suppose -5m = g - 260, 178 = 3m + 50g - 45g. Are m and -4 non-equal? True Let y be 364/(-65)2/4. Suppose -d + 1 + 0 = 0. Let q(p) = -4p3 + p2 + p - 1. Let h be q(d). Which is smaller: h or y? h Let r be 19/1 + 2 + -1. Suppose 8x - 12 = -4c + 4x, 4c = -2x + 8. Let k be 4 - c - -21 - 4. Is k <= r? True Let x(k) = -20k + 263. Let v(z) = -25z + 333. Let w be v(12). Let r be x(w). Is -396 greater than r? True Let v(i) = -i3 + 80i*2 + 21i + 28. Let c be v(80). Is 1709 at least c? True Let x = -552.9784 + 553. Let f = 0.0784 + x. Which is smaller: f or 0.001? 0.001 Let j = -2/1375 - 2716/23375. Let v be ((-384)/(-85) - 6) + 2. Let s = j + v. Which is greater: 15 or s? 15 Suppose 0 = 4z + 4i - 3724, 0 = z - 5i - 234 - 697. Which is smaller: z or 10? 10 Let b = -5/6 - -1/3. Let a(o) = 3o - 51. Let y(j) = j - 17. Let w(r) = -2a(r) + 7y(r). Let l be w(16). Which is smaller: l or b? l Let h = -4209 - -4210. Does h = -21/67? False Let y(h) = h*2 + 9h + 2. Let u be y(-9). Suppose 15 = -2d + 5b, -12 - 3 = -ud - b. Suppose 2p - 4 = p, dp + 133 = -3a. Is a < -51? False Let c = 50 + -34. Let l(k) = -12k + 16. Let x(i) = 4i - 5. Let d(y) = -3l(y) - 10x(y). Let a be d(-3). Is a bigger than c? False Let d = 1324/5 + -269. Let c = -6/127 + 320/1397. Is d <= c? True Suppose -4 = -w + 2g, -w - 5g + 42 = 3. Is w less than or equal to 14? True Let m = 1396 + -1396. Which is smaller: -12/691 or m? -12/691 Let l = 35 - 36. Let h be -1 - (8 + l - 4). Let n(y) = -y + 6. Let i be n(h). Which is bigger: i or 7? i Let j(k) = k*2 - 14k + 12. Let x be j(13). Let z = -204.117 + 204. Let h = z + -8.883. Is x less than h? False Let b = 867 - 864. Let j = -0.003 + -0.057. Is j greater than b? False Let b be (-13)/((-364)/(-70)) - (0 - 24/10). Which is greater: b or 0.9? 0.9 Suppose 0 = -93s + 825178 + 497096. Is -1/2 > s? False Suppose -30h + 23h = -56. Let g be (h/42)/(6/27). Is -1/5 less than g? True Let c(j) = 4j*2 + j. Let x be c(1). Suppose 6 = -m + g - 6, -m - xg - 24 = 0. Which is smaller: m or 0.5? m Suppose 0l - 3t - 66 = -3l, 4l + 5t = 133. Suppose -9v + 0 = l. Which is smaller: -38/11 or v? -38/11 Let q = 178 + -177. Let f be q + 28/(-8) + 93/48. Does f = -0.4? False Suppose 0 = 9t - 118t - 1526. Is t greater than or equal to -157/11? True Suppose 125 = -2x - x + 2s, -5x - 207 = -3s. Let f = x - -43. Let z be ((-2)/f)/((-1)/2). Which is greater: z or 2/49? z Let f = 10778/3 + -3599. Is 70 greater than or equal to f? True Let n = -856071/1581349 - -39/13069. Let i = n - 4/121. Which is bigger: -8 or i? i Let f = -228.72 + 140.09. Let l = f + 88. Which is greater: l or -0.4? -0.4 Suppose 5s + 5275 = 5d, 60s = 65s + 5d + 5225. Are -1051 and s equal? False Suppose 2q = -5t - 275, -2q = 5t - t + 218. Suppose d = -76 + 361. Suppose 4n = -n - d. Is t != n? False Let f be -957 - (20/(-25))/(4/20). Is -954 less than f? True Let r be (-9558)/12555 + -32/(-10). Are r and 1 nonequal? True Let k = -0.084 - 5.226. Let y = 5.57 + k. Is y > -0.04? True Let m(y) = -9y + 40. Let s be m(5). Let v be 0/(((-50)/s)/(-5)). Is v smaller than 2? True Let o(i) = -2i2 + 3i + 118. Let m(h) = -2h2 + h. Let n(v) = -2m(v) + o(v). Let f be n(0). Which is smaller: f or 117? 117 Let o = -1406 + 797. Let c = 1016 + o. Is c less than or equal to 408? True Let d(g) = 32g2 - 83g - 138. Let h be d(3). Let r be 1(-2 - -3)-97. Which is smaller: r or h? h Let h be (-1 - (0 - 0))(-105)/(2100/(-113480)). Which is smaller: -5673 or h? h Let l = 0.2 - 0.2. Let a = 3.32 + -1. Let m = -19.32 + a. Is m greater than l? False Suppose 9 = -3o + 3g, 2g + g = 3. Let x be 3o(-10)/(-12). Let w(y) = -3y - 18. Let v be w(x). Which is greater: v or -6? v Suppose h + 10 = -2j, -2h + 3j = j - 10. Let t be (6/12)/((-1)/4). Let c be (-2 - t) + (-3)/(-27). Is c > h? True Let z be (-3)/(-6) + (-42)/68. Let y = z - -21/34. Let f = -1.89 + 1.9. Are y and f unequal? True Suppose 5k + 1402 = 3y, -3k - 3y = 2k + 1408. Let r = -20846 - -20565. Is k > r? False Let c(w) = w3 + 8w*2 + 3w. Let a be c(-8). Let f = 2 + -5. Let k be f + 7 - a/(-7). Which is greater: k or 1? 1 Let h be 8/(-2) - -23 - -5. Let l be h/(-276)(-2)/22. Is l >= 1? False Suppose 14i - 13i + 204 = 0. Which is smaller: -613/3 or i? -613/3 Suppose -3j + x = 5x - 9, -x = -2j + 6. Suppose -jk + 31 = 298. Let n = 47 + k. Do -41 and n have the same value? False Let s be (-3)/9 + (-19)/(-66). Let h(q) = -6q*2 + 15q + 27. Let j(w) = w*2 - 2w - 4. Let m(p) = 4h(p) + 27j(p). Let z be m(-2). Which is greater: z or s? z Let y be 6/14 - (-320074)/133. Which is smaller: 2408 or y? y Let n = 26 + -16. Let c be (28/n)/((-32)/(-8)). Let q = 50 + -49. Are q and c non-equal? True Let k = 115.56 - 112.56. Suppose 4o = -w - 25, o + 3o = -12. Let d = w + 24. Is k greater than or equal to d? False Suppose 8332 - 8320 = 12n. Is n smaller than -21/130? False Let f = -435286914908748125653112283614025/5164168514 + 84289835571533041117353. Let b = f + 2/69786061. Let u = 1631/2 + b. Is 1 less than u? False Suppose 24r - 20r = 0. Suppose r = 5c - 5y - 105, 2c + 3y = y + 58. Let x = c - 17. Is x at most as big as 9? True Let k be -2 + 2 + 2/107. Let u be (18/(-11))/(24/16) + (-33)/(-363). Which is smaller: u or k? u Let s be (-181)/(3 + -18). Let p = 43811 - 43776. Are s and p nonequal? True Let r = -2921 - -40913/14. Is 1 at least r? False Suppose -4h = 3y + 209, y = 5h - h + 213. Let q = -51 - h. Suppose q = -7t - 5. Which is smaller: t or -6/7? t Let r = 0.006 + 0.494. Let j = -7 + 6. Let m = j + 1.06. Which is bigger: m or r? r Let d = -83/34 - -4295/102. Which is greater: d or 41? 41 Suppose 0 = -287v + 325v + 2812. Suppose w - 87 = -1. Let o = v + w. Which is bigger: o or -1/2? o Let v = 34 + -47. Let i be ((-182)/(-13) + v)(5 - 0). Are 21/5 and i equal? False Let h(t) = -11t - 39. Let k be h(-5). Let x be (4 - (3 + -2)) + -2. Let o be (-536)/(-36) - x/(-9). Which is greater: o or k? k Suppose -46n + 44n + 4o + 24 = 0, -2o = -4n + 12. Let d be (11/96)/6. Which is smaller: n or d? n Let y be (0 + -3)1/3. Let n be -1 - (5742/(-1152) + 4). Which is bigger: n or y? n Let p(m) be the first derivative of -m3/3 + 15m*2/2 - 51m + 273. Let q be p(10). Let z be (-2)/(-3) - 2/4. Which is greater: q or z? z Let a = 29142 - 29137.5. Are a and 192 unequal? True Suppose 2r - 4 = -2z, 5 + 5 = 2z - r. Let f be z1 + 22 + -18. Is f bigger than 6? True Let h be (971/(-1379) - (-560)/784)/(-12). Which is smaller: h or 0? h Let u = 1.4532 + -75.4532. Is -43 at least as big as u? True Let i(a) = a2 - 3a - 13. Let x be i(6). Suppose -5s + xb = -370, -s + 120 - 48 = -2b. Let p = -307/4 + s. Which is bigger: 0 or p? 0 Let l(m) = 99m + 45. Suppose 0 = 50g - 51g - 4. Let p be l(g). Do p and -350 have different values? True Let n = -322 + 324. Let t(p) = 5p2 - 11p + 3. Let x be t(n). Which is bigger: x or 5/12? x Let j = -0.3467 + 1664.3467. Is 1 <= j? True Let h = 98 - 96. Suppose a + 2 = j, -a - j - j = h. Let i be 3 - (a - 247/(-49)). Is -1 at least i? False Let v be 9 + (-6 - -5) + 9/(-1). Is v >= 3/1681? False Suppose -3a - 48 = -45, -4u + 4a = -988. Which is smaller: u or 241? 241 Let k = -17615 + 17615.9. Are -427/4 and k unequal? True Suppose 138k = 150k + 3588. Which is bigger: k or -0.1? -0.1 Let y = -2273/1254 + 5/66. Is -7 <= y? True Suppose -53 = 3r - 107. Let h be (0 - 2) + 6 - 204/r. Which is greater: -8 or h? h Let p(y) = 6y2 + 5y - 5. Let d be p(8). Let q(j) = 5j3 - 28j**2 - j + 83. Let s be q(7). Is s <= d? True Let t = -195 - -254. Let i = -173 + t. Which is smaller: -115 or i? -115 Let	{ "pile_set_name": "DM Mathematics" }
1? True Is 282157284 a multiple of 23? True Does 8162 divide 934951060? False Is 66 a factor of 50804886? True Is 461532078 a multiple of 15? False Does 13 divide 21200645? False Is 1986 a factor of 68590221? False Is 63300791 a multiple of 13? False Does 10 divide 35506000? True Is 16 a factor of 101244624? True Does 2933 divide 800753628? False Does 82 divide 63562874? True Is 29411472 a multiple of 10? False Is 147 a factor of 417516897? True Is 4 a factor of 126768488? True Is 8 a factor of 106013384? True Is 204656012 a multiple of 484? True Is 2312 a factor of 759461944? True Is 3007602 a multiple of 900? False Does 67 divide 396042427? True Is 48128619 a multiple of 10? False Does 63 divide 108171000? True Does 25 divide 1822813489? False Does 6 divide 38627956? False Is 292213221 a multiple of 53? True Does 3263 divide 831859431? True Is 885592935 a multiple of 603? True Is 13 a factor of 93751515? True Is 945899013 a multiple of 4? False Is 1245 a factor of 182002472? False Is 89 a factor of 27248863? True Is 1399 a factor of 42828385? False Is 396 a factor of 3962160972? True Is 190 a factor of 4106477? False Is 108939139 a multiple of 3? False Is 12591000 a multiple of 120? True Is 21304714 a multiple of 21? False Is 93069779 a multiple of 2321? True Does 472 divide 55681368? True Does 146 divide 31652105? False Is 39 a factor of 513789044? False Does 3138 divide 124632826? False Is 61 a factor of 702537714? False Does 2623 divide 1067141320? True Does 17 divide 892635864? True Is 51507456 a multiple of 32? True Is 5499 a factor of 1812767346? True Is 171725740 a multiple of 915? False Is 1873 a factor of 724320941? True Does 228 divide 749047260? True Is 1455481718 a multiple of 13? False Is 7119 a factor of 1882425009? False Is 114666014 a multiple of 127? True Is 584316432 a multiple of 111? True Is 24 a factor of 452573705? False Does 174 divide 14779908? True Is 479 a factor of 20389593? True Does 261 divide 93895811? False Is 127 a factor of 221682925? False Is 80 a factor of 30031543? False Is 1063896001 a multiple of 46? False Does 1317 divide 4395352186? False Does 5 divide 999440272? False Does 2 divide 5682680? True Is 10 a factor of 636999411? False Does 16 divide 226411371? False Does 9 divide 39139659? True Does 1962 divide 5409234? True Is 1287580812 a multiple of 218? True Is 1075844319 a multiple of 4213? True Does 218 divide 100122822? True Does 1752 divide 88759824? True Does 808 divide 460412485? False Is 95403111 a multiple of 43? True Is 596308765 a multiple of 157? True Is 7106 a factor of 4183773842? False Is 28451699 a multiple of 513? False Is 22 a factor of 3059335246? True Is 3163008250 a multiple of 58? True Does 66 divide 148588270? False Is 5614 a factor of 239914290? True Is 106559925 a multiple of 1095? True Does 682 divide 4012888? True Is 76950989 a multiple of 5? False Is 398 a factor of 27050958? False Is 10 a factor of 1598420? True Is 2403 a factor of 62083908? True Is 639 a factor of 71127090? True Is 7 a factor of 66409760? False Is 920631300 a multiple of 282? True Is 57322346 a multiple of 33? False Is 12 a factor of 137811153? False Is 4367 a factor of 2465844018? True Does 23 divide 282488723? False Does 29 divide 932007112? False Is 334 a factor of 25308850? True Is 15 a factor of 1006380262? False Does 1309 divide 21616082? False Is 90378954 a multiple of 3323? True Does 5 divide 144360456? False Is 2757 a factor of 60381057? True Is 37 a factor of 18645613? False Does 28 divide 296107731? False Is 15 a factor of 2068452141? False Is 15 a factor of 840167744? False Is 5 a factor of 146604272? False Is 9389715 a multiple of 1005? True Is 8 a factor of 351616976? True Is 67450129 a multiple of 5? False Is 2001938787 a multiple of 787? False Does 2831 divide 79140065? False Is 555874 a multiple of 121? True Is 375 a factor of 1350909750? True Does 600 divide 14245843? False Is 302338240 a multiple of 16? True Does 2711 divide 206052266? True Is 235 a factor of 2053469480? True Does 138 divide 27172426? False Is 62711184 a multiple of 48? True Is 251552444 a multiple of 26? True Is 81106670 a multiple of 7? False Is 3409858063 a multiple of 88? False Is 12059776 a multiple of 16? True Does 1166 divide 41357639? False Does 471 divide 411793982? False Does 134 divide 1602281282? True Is 1497835757 a multiple of 101? True Does 1436 divide 771054471? False Is 88054845 a multiple of 45? False Does 11 divide 765087180? True Does 1414 divide 49398937? False Is 49777791 a multiple of 1363? False Does 15 divide 29273119? False Does 260 divide 10245040? True Is 1403148721 a multiple of 114? False Does 197 divide 3017375? False Is 52 a factor of 343982392? True Does 3133 divide 371821048? False Does 332 divide 5747501996? True Is 154 a factor of 67351284? True Is 135 a factor of 2298768? False Is 71387779 a multiple of 2? False Does 97 divide 31544822? False Is 35699906 a multiple of 779? False Is 23495304 a multiple of 147? True Does 74 divide 380317194? False Is 1094 a factor of 443786796? False Does 7 divide 24303525? False Is 267 a factor of 153705462? False Does 217 divide 79805656? True Does 81 divide 29316168? True Is 20 a factor of 83496520? True Is 90 a factor of 5836953806? False Is 4168179 a multiple of 49? False Does 5529 divide 1786237443? True Does 31 divide 158211383? True Is 87 a factor of 2137898605? False Is 22 a factor of 35656310? False Is 2552755440 a multiple of 120? True Does 1184 divide 583180110? False Does 222 divide 103871528? False Does 5375 divide 1184822000? True Does 37 divide 474896? False Is 1146496 a multiple of 32? True Does 19 divide 2849392? True Is 92 a factor of 432267380? False Does 154 divide 30176454? True Is 3307199 a multiple of 97? False Is 125 a factor of 317847750? True Is 5143632 a multiple of 39? True Is 137966373 a multiple of 37? False Does 12 divide 64370833? False Is 13147396 a multiple of 503? False Is 13904170 a multiple of 5? True Is 37 a factor of 834683? True Is 1025 a factor of 172472650? True Does 29 divide 44188064? False Is 22 a factor of 48047301? False Is 13192790 a multiple of 13? True Is 286 a factor of 42830502? True Does 256 divide 7138304? True Does 78 divide 330537090? True Does 126 divide 561188958? False Is 167904064 a multiple of 608? True Does 2527 divide 234121496? True Is 26 a factor of 23025355? False Does 328 divide 66522992? True Does 19 divide 708339? True Is 571743260 a multiple of 17? False Is 123947197 a multiple of 11? True Is 99570644 a multiple of 5? False Is 11864832 a multiple of 21? True Is 20376258 a multiple of 21? True Is 1965 a factor of 311727600? True Does 2667 divide 203696531? False Does 85 divide 1153972438? False Is 21190381 a multiple of 1788? False Does 46 divide 8700798? False Is 24603304 a multiple of 1234? False Is 25188919 a multiple of 210? False Is 47 a factor of 8394858? True Does 11 divide 6018055? False Is 35 a factor of 202226430? True Is 58 a factor of 1028420388? True Is 347372337 a multiple of 23? False Does 75 divide 4425825? True Is 2490449790 a multiple of 3748? False Does 5545 divide 1171945236? False Is 1329 a factor of 172316811? True Is 3 a factor of 35813926? False Is 101 a factor of 13502791? True Does 84 divide 521278183? False Does 408 divide 231318507? False Does 47 divide 289991598? True Does 5018 divide 794881308? True Is 368 a factor of 4717010? False Is 37 a factor of 12265204? True Is 650 a factor of 71774586? False Does 64 divide 4558912? True Is 2188157553 a multiple of 219? True Does 44 divide 1010275917? False Is 706 a factor of 35861272? False Is 87 a factor of 109378228? False Is 83 a factor of 728708918? False Is 297308790 a multiple of 9? True Is 38008585 a multiple of 571? False Is 61725683 a multiple of 4? False Does 3016 divide 74027720? True Does 24 divide 485578488? True Is 4467 a factor of 460078665? True Is 40250022 a multiple of 419? False Is 89902953 a multiple of 459? True Does 25 divide 11637466? False Does 1307 divide 17408228? False Is 3 a factor of 86242197? True Is 168 a factor of 23783511? False Is 23 a factor of 1730647? False Is 319215512 a multiple of 28? True Is 25326673 a multiple of 177? False Is 73948972 a multiple of 1706? False Is 3387	{ "pile_set_name": "DM Mathematics" }
ive j. 2 Rearrange -13938m3 + 6969m*3 + 6976m*3 + 7m - 35m2 to the form cm + am2 + s + um*3 and give u. 7 Express (13322 + 19303 - 1406 + 70462 - 6844)(0 - 2u4 + 0) in the form au*3 + qu*2 + m + ju*4 + ou and give j. -189674 Express 2969t - 1228t + 2989t + 113t as a + nt and give n. 4843 Rearrange 73 + 554 - 942v + 944v to j + wv and give j. 627 Express 2 + 13z4 - 5z*4 + 2z*2 + 0z*4 + 2z - 2z4 - 3z*4 - 124z*3 in the form hz*3 + kz*4 + gz + fz2 + p and give h. -124 Rearrange -80d*2 - 30d*2 - 10 + 107d*2 + 51d to vd + u + fd*2 and give f. -3 Rearrange -2r - 268r2 - 9r*4 - 6r*4 - 46r*3 - 272r*2 + 543r*2 + 200r*3 to the form ir*2 + tr*3 + jr*4 + w + hr and give i. 3 Rearrange (-8186u + 306579 - 306579)(1 + u - 1)(2 + 3 - 4) to the form k + iu*2 + cu and give i. -8186 Express (-2g2 + 2g2 + g2 + 2g3)(-38g + 212 - 348 - 7g) as n + hg2 + og + ig4 + bg*3 and give n. 0 Rearrange 228g + 0g2 + 3g2 + g2 - 2g2 - 221g to i + jg + hg*2 and give j. 7 Rearrange (-22 - 5 + 3)(-716x + 719x - 2 - 6) to wx + v and give v. 192 Rearrange (-3h + 3h + h)(6 - 3 - 4) - 7176 + 3592 + 127h + 3585 to x + lh and give x. 1 Rearrange 365d3 + 319d*3 - 15 + 3d - 685d3 - 12d*2 to cd + ad3 + t + xd*2 and give a. -1 Rearrange -385v - 1012v - 2445v + 124v to the form rv + t and give r. -3718 Express ((2 - 1 - 3)(-3p + 2p + 3p) + 65p - 2217 + 1106 + 1120)(3p + 2 - 2) as i + gp + mp2 and give m. 183 Express -9 + 46r + 3r + 6 - 1 + 1 in the form v + hr and give v. -3 Rearrange -418 - 593 + 3c + 190 + 277 - 509 to the form n + hc and give h. 3 Rearrange -12 + 10 + x*2 - 3 + 3879x - 3853x to c + ox*2 + px and give c. -5 Express -7o - 28o - 135o3 - 10o + o*2 + 4 + 46o in the form zo2 + no + t + fo3 and give t. 4 Express (-4j - 3j + 3j)(7 - 9 - 22) + (-2 - 4 + 4)(-j + 3j + 2 - 5j) as gj + k and give g. 102 Express (-11w + 18w + 127w)(-8 - 3 + 1) + 3 + 2w - 3 + 2 - 2 + 2w as i + vw and give v. -1336 Express 32l2 - 18l*2 + 66492l + l*3 - 14l*2 - 66725l + 10 in the form t + yl2 + wl + xl3 and give t. 10 Rearrange 1336 - 4010 + 18380w + 1336 + 1338 to the form f + vw and give v. 18380 Express -927s + 894s - 5573s - 1887s in the form y + fs and give f. -7493 Express -3623458k + 0k*2 + 3623425k + 13k3 - 2k*2 in the form x + dk*2 + bk + tk3 and give d. -2 Express (-1 + 1 - 2l)(35l*2 + 16l*2 + 26l*2 + (-1 - 2l + 1)(4l + 17l - l)) in the form r + il*3 + cl*2 + sl and give i. -74 Rearrange -2v3 - 4v*3 - 173 + 8v*2 + 3v*4 + 349 - 173 to dv*4 + uv + yv2 + lv*3 + b and give b. 3 Rearrange -2p*2 + 4 + 24p + 61p + 0 - 2 to the form up + x + ip2 and give x. 2 Rearrange (-7534 + 462 - 3735 - 3241 + 2282)(0 - 4l + 1 + 3l) to w + zl and give w. -11766 Express 0p - 2p - 7 + 4p - 116p2 + 7p*2 + 8p*2 as np + up2 + h and give n. 2 Rearrange (-48671 - 27179 - 41711 + 2347 + 16443)(h*3 + 2h4 - h3) to qh3 + yh*4 + rh*2 + oh + u and give u. 0 Express (5 + 115i - 5 - 5990i)(0i - i + 0i) as zi*2 + qi + f and give z. 5875 Rearrange (-20s + 7s + 1497 - 1614)(2 - 3 + 2)(1 + 2 - 4) to the form vs + p and give v. 13 Rearrange -60f*4 - 177f*4 - 44f*4 + (-f + 2f + 2f)(-3f3 - f3 + 8f*3) to the form if + tf2 + sf*3 + vf4 + j and give v. -269 Express ((5 + s2 - 5)(4s - 58s + 4s) + 8s3 - 1 + 1)(3 - 6 + 1) as ls + zs*3 + as*2 + h and give z. 84 Express -231 - 16i*3 + 24i2 + 198 - i4 - i + 34 in the form ri2 + a + ui + qi3 + hi*4 and give a. 1 Rearrange (78c - 78c + 50c*2)(588 - 313 - 316)(c2 + 4 - 4)(3 - 3 - 1) to the form vc2 + kc*4 + oc*3 + mc + u and give k. 2050 Express (37c + 2c - 6c)(-2c2 - 2c2 - c2) + (-3c + c + 0c)(-1 + 1 + 2c2) + 4 - c3 - 4 as lc + rc*2 + x + uc*3 and give u. -170 Rearrange (2x*2 - 5x*2 + 0x*2)(-46077x + 92272x - 49296x) to yx*3 + u + lx + vx2 and give y. 9303 Rearrange (-o2 - 2o*2 + 5o*2)(351 - 795 - 175o + 401 - 165o) to the form y + zo + bo*2 + so*3 and give z. 0 Express (-d + 2d*2 + d)(19 + 14d2 - 24 + 6) - 33d*3 - 20d*4 + 33d*3 as zd*2 + h + bd*3 + ld*4 + td and give z. 2 Rearrange ((-1 - 2 + 4)(-9o - 144 + 144) + (-1 - 1 + 1)(-2 + o + 2) + 0 - o + 0 + o + 2 - 2)(40 - 169 - 168) to the form t + do and give d. 2970 Express 6150p - 34300p + 11382p as j + vp and give v. -16768 Rearrange (a - a + 2a*2)(-a - 2a + 2a) - 42a2 + 41a*2 + 214a*3 - 245a - 210a3 to q + da*2 + va*3 + na and give d. -1 Rearrange -98h2 - 2h - 1048 + 197h2 - 101h*2 + 3h + 11h3 - 8h*3 to dh*2 + p + nh*3 + gh and give d. -2 Rearrange -7856 + 417d2 + 15705 - 7851 to the form zd*2 + hd + s and give s. -2 Rearrange -35t2 + t3 - 2453t + 7370t - 2461t - 2453t - 26t*4 to the form yt*4 + st + p + lt2 + it3 and give y. -26 Express (1 - r2 - 1)(0 - 2r*2 + 0) - 58r*4 + 63r*4 + 49r*4 - 21r*4 - 29r*4 + 15r*4 in the form c + zr + qr2 + ir*4 + or*3 and give i. 21 Express -2h + 4201201h3 - 5 - 4201276h3 + h2 + 2 in the form sh + gh*2 + th*3 + j and give g. 1 Rearrange -3105g + 11432g + 11730g - 3454g to the form d + bg and give b. 16603 Express 154k3 + 151k*3 + 6 - 455k*3 + 43k + 149k3 - k2 + 1 in the form yk + sk3 + m + qk*2 and give y. 43 Express -8605z*2 + 73468377z - 73468377z in the form wz*2 + r + oz and give w. -8605 Rearrange 3b3 - 6b - 18b3 - 2b*2 + 4b*3 + 20b*4 - 1 + 5b - 6b3 to f + hb + qb3 + tb*2 + zb*4 and give h. -1 Express 56w*2 - 134 + 97 - 12w*2 in the form lw + o + bw2 and give o. -37 Express f + 2267f*2 - 1100f*2 - 1131f*2 - 7 in the form gf + of2 + x and give o. 36 Rearrange -94 + 35 - 1864c + 57 - 3308c to mc + k and give k. -2 Express (4j - 198j*2 + 2j*4 + 198j*2)(1536 + 340 + 576 + 3037) as lj4 + mj*3 + y + aj*2 + bj and give b. 21956 Rearrange -684n2 + 130329 - 65161 - 65168 to r + in + bn2 and give b. -684 Express 212 - v - 89 + 3v*4 + v - 2v + 2v3 + 99 as f + jv + kv2 + lv*3 + iv*4 and give j. -2 Rearrange (-365 - 654 - 171)(4 + 2w - 3w - 1)(3w - 3w - w2) to aw*3 + bw + x + dw2 and give a. -1190 Rearrange -21903 + 21903 + 990z*2 - 4403z*2 to the form vz + mz2 + w and give m. -3413 Express (-318 - 132 + 79)(5g2 + 25g*2 + 37g*2) as n + ag + sg2 and give s. -24857 Express -603d + 613d - 108 + 3 as l + bd and give b. 10 Express (-2 + 1 + 0)(5h + 9h2 - 3h - h*2) + 472 - 803 + 333 - 352h - 2h2 as oh*2 + d + lh and give d. 2 Rearrange -262a - 8a*3 + 12a*3 + 273a - 7a2 to the form va + ya3 + ba*2 + x and give y. 4 Rearrange -23w*2 + 4w*3 + 5w + 30082 - 7w + w3 - 30082 to gw*3 + lw*2 + dw + r and give d. -2 Rearrange -5 + 6 + 5891z - 9565z - 1 - 2 to cz + g and give c. -3674 Rearrange (-1 - 1 + 1)((1 + 0 - 3)(-5d - 100 + 4d - 1) - 4d + 33d - 13d)(-7 - 16 + 7) to c + qd and give c. 3232 Express -68 + 26 + 7d - 10d + 42 - 2884d2 as fd + t + ad2 and give t. 0 Express 3 - 53l - 4l3 - 3l*2 + 946l*4 + 2l*3 + 23l + 28l in the form ql*3 + p + ml + fl4 + dl*2 and give m. -2 Express -283 + 431 - 3i + 3i + 568 - 3i as ri + x and give r. -3 Rearrange 0u + 4u + 7u + (u - 2u - u)(4 - 3 + 1) + 13u - 17u - 33u to the form t + vu and give v. -30 Express 0w4 + 7w*2 - 677w*3 + 654w*3 + 2w*4 + 2 + 0 in the form mw + u + sw2 + vw*4 + dw3 and give s. 7 Express u2 - 2u2 - 543u*4 + 266u*4 + 53u*3 + 279u*4 as tu*4 + d + lu*2 + mu*3 + ju and give l. -1 Express -1 + z - 3 + 3 + (393 + 215 + 31)(-26z + 11z + 22z) as o + gz and give g. 4474 Express 168270a - 62330a - 78720a as ca + l and give c. 27220 Rearrange -35 + 166 - 55 + 19 - 8w + 117 to x + pw and give x. 212 Rearrange 52 + 993p - 52 - 4956p to the form sp + b and give s. -3963 Rearrange 31p2 + 6p +	{ "pile_set_name": "DM Mathematics" }
ob of sequence cll when three letters picked without replacement from pclpcl. 1/30 What is prob of sequence jhdl when four letters picked without replacement from {l: 7, h: 2, j: 1, d: 2}? 7/2970 Three letters picked without replacement from nrnsrnrsrnnnrrr. What is prob of sequence srn? 2/65 Calculate prob of sequence oe when two letters picked without replacement from {e: 2, s: 2, o: 1, j: 2, r: 1, h: 1}. 1/36 Calculate prob of sequence zu when two letters picked without replacement from {d: 5, k: 10, z: 4, u: 1}. 1/95 Three letters picked without replacement from {g: 1, p: 2, v: 1, j: 1, f: 2, m: 2}. Give prob of sequence ppg. 1/252 Three letters picked without replacement from zykyybkkkyzbzykyy. What is prob of sequence kzz? 1/136 Two letters picked without replacement from vmmmomvmmmommm. What is prob of sequence oo? 1/91 Four letters picked without replacement from gymvvvm. What is prob of sequence ymvm? 1/140 Calculate prob of sequence qtp when three letters picked without replacement from {p: 1, q: 1, t: 3}. 1/20 Two letters picked without replacement from eereretreeett. What is prob of sequence tr? 3/52 Four letters picked without replacement from {t: 1, i: 3, f: 1, k: 7, j: 2}. What is prob of sequence ikkt? 3/572 Calculate prob of sequence tjjz when four letters picked without replacement from tjjz. 1/12 Three letters picked without replacement from {e: 1, p: 4, a: 7, u: 2, g: 2, c: 4}. What is prob of sequence pap? 7/570 Four letters picked without replacement from rerrerrrrcrrercrrrc. Give prob of sequence cerr. 39/2584 Calculate prob of sequence jj when two letters picked without replacement from zzzzzzjjzz. 1/45 Four letters picked without replacement from {z: 2, k: 10, p: 6}. Give prob of sequence pppk. 5/306 What is prob of sequence xuwu when four letters picked without replacement from uuwnwxwuwwxwxnwwww? 1/408 What is prob of sequence yq when two letters picked without replacement from qqqqyqqqqqqyq? 11/78 Four letters picked without replacement from {e: 1, c: 3, y: 1}. What is prob of sequence eyec? 0 Three letters picked without replacement from {z: 6, v: 2, h: 11}. What is prob of sequence hvh? 110/2907 Two letters picked without replacement from pppppp. What is prob of sequence pp? 1 Four letters picked without replacement from gkkgkgkgkggg. Give prob of sequence gggg. 7/99 Two letters picked without replacement from pbaabbpab. Give prob of sequence pp. 1/36 What is prob of sequence csxx when four letters picked without replacement from {s: 1, c: 1, x: 4, l: 2}? 1/140 Calculate prob of sequence gauu when four letters picked without replacement from {u: 6, a: 9, g: 2}. 9/952 Three letters picked without replacement from {h: 3, w: 3}. Give prob of sequence whw. 3/20 Four letters picked without replacement from {k: 2, x: 1, l: 1, b: 1, e: 1, y: 1}. Give prob of sequence xkkl. 1/420 Three letters picked without replacement from blfgbnbfbl. Give prob of sequence flf. 1/180 What is prob of sequence wwl when three letters picked without replacement from {e: 4, w: 2, l: 1, n: 2}? 1/252 Three letters picked without replacement from {g: 1, o: 1, f: 2, u: 2}. What is prob of sequence guo? 1/60 Calculate prob of sequence ppgp when four letters picked without replacement from pppgpgp. 1/7 Three letters picked without replacement from rkrrkrrrrk. Give prob of sequence krk. 7/120 Calculate prob of sequence xx when two letters picked without replacement from {x: 2, n: 3}. 1/10 Three letters picked without replacement from {d: 13, k: 3, f: 4}. What is prob of sequence dff? 13/570 Two letters picked without replacement from zbororrdrd. Give prob of sequence br. 2/45 Two letters picked without replacement from {c: 16, l: 4}. Give prob of sequence cc. 12/19 Three letters picked without replacement from {i: 10, e: 4, q: 5}. Give prob of sequence eqe. 10/969 What is prob of sequence prpp when four letters picked without replacement from prgrr? 0 What is prob of sequence yy when two letters picked without replacement from {v: 1, h: 2, y: 2, t: 1}? 1/15 What is prob of sequence vvvn when four letters picked without replacement from {n: 4, a: 2, v: 5, o: 4}? 2/273 Calculate prob of sequence kli when three letters picked without replacement from {l: 7, k: 2, i: 5}. 5/156 What is prob of sequence hrh when three letters picked without replacement from {h: 2, r: 18}? 1/190 What is prob of sequence qqqn when four letters picked without replacement from {t: 3, q: 5, n: 8}? 1/91 Three letters picked without replacement from {o: 6, a: 6, v: 1, x: 1, e: 1}. Give prob of sequence vae. 1/455 What is prob of sequence crv when three letters picked without replacement from vvcvgrckv? 1/63 What is prob of sequence bh when two letters picked without replacement from bhbhbhb? 2/7 Three letters picked without replacement from aaiiiih. What is prob of sequence aii? 4/35 Three letters picked without replacement from ujjjjujuuuuuuuuuuu. What is prob of sequence jju? 65/1224 Calculate prob of sequence cr when two letters picked without replacement from xxccsxcccxcccxckrccs. 11/380 Two letters picked without replacement from rrkrrkkrkkkrkkkkkkk. What is prob of sequence rr? 5/57 Four letters picked without replacement from fnmmmsmffmsmsnsmgmmf. Give prob of sequence sgms. 3/3230 What is prob of sequence fffc when four letters picked without replacement from {c: 3, f: 8}? 7/55 Calculate prob of sequence eg when two letters picked without replacement from zgedtdn. 1/42 What is prob of sequence mhn when three letters picked without replacement from yyfymhyyyyny? 1/1320 Calculate prob of sequence cl when two letters picked without replacement from caaacccaal. 2/45 Two letters picked without replacement from {t: 13, e: 3, a: 3}. Give prob of sequence ee. 1/57 Four letters picked without replacement from wvgggivvvggiwgggvxgg. Give prob of sequence igvv. 10/2907 Calculate prob of sequence or when two letters picked without replacement from {r: 3, x: 1, c: 1, f: 6, i: 1, o: 1}. 1/52 Calculate prob of sequence jy when two letters picked without replacement from xzxzjxxxzjzxzjxjjyj. 1/57 Calculate prob of sequence jj when two letters picked without replacement from {e: 1, b: 3, j: 5, f: 4}. 5/39 What is prob of sequence oox when three letters picked without replacement from ojxjojjjojhozxzojooz? 7/570 Two letters picked without replacement from {j: 6, r: 4, i: 5}. What is prob of sequence jj? 1/7 What is prob of sequence yddy when four letters picked without replacement from ydyyydyyyy? 1/45 Two letters picked without replacement from {q: 1, l: 4, o: 8, p: 2, i: 4, r: 1}. What is prob of sequence ip? 2/95 Two letters picked without replacement from tyetttbbeybbb. Give prob of sequence be. 5/78 Calculate prob of sequence cv when two letters picked without replacement from {x: 11, c: 1, m: 1, v: 3, o: 1, q: 2}. 1/114 What is prob of sequence jn when two letters picked without replacement from vnvjnz? 1/15 Calculate prob of sequence ww when two letters picked without replacement from nwnnnwnnnannnnnnn. 1/136 Two letters picked without replacement from {z: 15, x: 3}. What is prob of sequence xx? 1/51 What is prob of sequence goog when four letters picked without replacement from {o: 9, g: 10}? 45/646 Three letters picked without replacement from {n: 2, l: 8, r: 2, z: 2, s: 1, a: 2}. Give prob of sequence szl. 1/255 Four letters picked without replacement from llalalllllllhlall. What is prob of sequence alah? 13/9520 Calculate prob of sequence ggg when three letters picked without replacement from {g: 5, l: 4, m: 2, r: 4}. 2/91 Three letters picked without replacement from xnxxxnx. What is prob of sequence nnx? 1/21 What is prob of sequence pok when three letters picked without replacement from pkoyozd? 1/105 Two letters picked without replacement from nttxxtnddnxxnntntt. What is prob of sequence dx? 4/153 What is prob of sequence fhhf when four letters picked without replacement from {h: 4, b: 1, o: 1, f: 3, d: 2, k: 4}? 1/455 Three letters picked without replacement from vvrrvvtvvrvctcvvt. What is prob of sequence tcc? 1/680 Four letters picked without replacement from {n: 3, o: 7, y: 2}. What is prob of sequence nono? 7/330 Four letters picked without replacement from {e: 1,	{ "pile_set_name": "DM Mathematics" }
s the common denominator of 29/485 and -2/97? 485 Calculate the least common multiple of 189 and 351. 2457 Find the common denominator of 22/207 and -28/115. 1035 What is the common denominator of 3/910 and 87/22? 10010 Find the common denominator of 23/1674 and -53/372. 3348 Calculate the common denominator of -87/310 and 91/186. 930 Calculate the lowest common multiple of 36 and 2. 36 Find the common denominator of -31/309 and 53/2. 618 Calculate the common denominator of -91/12 and 79/1182. 2364 What is the least common multiple of 1050 and 6? 1050 Calculate the smallest common multiple of 31 and 217. 217 What is the least common multiple of 3696 and 1344? 14784 Calculate the least common multiple of 4 and 6. 12 What is the common denominator of -76/15 and 68/15? 15 What is the least common multiple of 1029 and 35? 5145 Calculate the least common multiple of 995 and 1. 995 Calculate the smallest common multiple of 140 and 420. 420 Find the common denominator of 19/27 and -58/11529. 11529 Calculate the common denominator of -19/153 and -26/1071. 1071 What is the smallest common multiple of 112 and 4228? 16912 Calculate the common denominator of 73/860 and 119/6. 2580 What is the least common multiple of 5226 and 7? 36582 What is the lowest common multiple of 14 and 33? 462 Calculate the common denominator of 25/972 and 109/18. 972 What is the common denominator of -11/1136 and 101/994? 7952 Calculate the common denominator of -32/69 and -5/7. 483 What is the smallest common multiple of 69 and 12? 276 What is the common denominator of 137/60 and 41/162? 1620 Calculate the lowest common multiple of 10 and 40. 40 What is the common denominator of 80/57 and -46/27? 513 What is the smallest common multiple of 66 and 924? 924 What is the lowest common multiple of 6180 and 12? 6180 Calculate the common denominator of 55/321 and -7/6. 642 Calculate the least common multiple of 6 and 70. 210 What is the lowest common multiple of 16 and 40? 80 What is the least common multiple of 81 and 189? 567 What is the common denominator of 34/89 and 99/890? 890 What is the lowest common multiple of 28 and 280? 280 Calculate the lowest common multiple of 116 and 18. 1044 Calculate the lowest common multiple of 1 and 553. 553 Calculate the common denominator of -15/13013 and 103/11830. 130130 Find the common denominator of 95/144 and 49/45. 720 What is the common denominator of -133/12 and -61/64? 192 Calculate the lowest common multiple of 54 and 81. 162 What is the common denominator of -103/72 and 3/4712? 42408 What is the smallest common multiple of 704 and 572? 9152 What is the least common multiple of 11 and 31? 341 Calculate the common denominator of -39/2 and 1/7999. 15998 What is the common denominator of 1/8 and -89/158? 632 Calculate the smallest common multiple of 24 and 3. 24 Calculate the smallest common multiple of 5120 and 1536. 15360 Find the common denominator of -56/649 and 121/354. 3894 Find the common denominator of 151/414 and 133/24. 1656 What is the smallest common multiple of 3 and 150? 150 Find the common denominator of 97/54 and 83/12. 108 Find the common denominator of 93/16 and 145/144. 144 Find the common denominator of -83/4 and 24/145. 580 Calculate the common denominator of -81/676 and 57/364. 4732 Calculate the smallest common multiple of 18 and 972. 972 What is the smallest common multiple of 55 and 22? 110 Find the common denominator of 68/3 and -23/7663. 22989 Calculate the common denominator of -9/6952 and 61/12. 20856 What is the lowest common multiple of 3 and 144? 144 What is the lowest common multiple of 63 and 147? 441 What is the lowest common multiple of 2 and 28? 28 Find the common denominator of 42/5 and -157/60. 60 Find the common denominator of 55/1424 and -79/356. 1424 What is the smallest common multiple of 1414 and 707? 1414 What is the least common multiple of 8 and 284? 568 Calculate the least common multiple of 32 and 38. 608 What is the common denominator of 23/1638 and 5/112? 13104 What is the common denominator of 89/2016 and 53/231? 22176 Calculate the least common multiple of 98 and 1281. 17934 Calculate the least common multiple of 78 and 156. 156 Find the common denominator of 34/855 and -48/1615. 14535 Calculate the smallest common multiple of 99 and 432. 4752 Find the common denominator of 31/798 and -20/63. 2394 Calculate the least common multiple of 4300 and 20. 4300 Find the common denominator of 143/6 and 22/39. 78 Calculate the least common multiple of 1278 and 75. 31950 Calculate the common denominator of -67/5428 and -29/16. 21712 What is the common denominator of -97/708 and 61/30? 3540 Find the common denominator of 157/6018 and -39/34. 6018 Calculate the common denominator of -9/760 and 131/30. 2280 Calculate the smallest common multiple of 25 and 10. 50 What is the common denominator of 32/9 and -59/78? 234 Calculate the lowest common multiple of 387 and 396. 17028 Find the common denominator of -97/258 and -115/516. 516 What is the least common multiple of 58 and 28? 812 Calculate the common denominator of 111/40 and -31/25. 200 Calculate the lowest common multiple of 450 and 150. 450 Calculate the lowest common multiple of 6 and 1168. 3504 Calculate the least common multiple of 12 and 170. 1020 Find the common denominator of 2/49 and 25/9. 441 Calculate the common denominator of 113/20 and -11/60. 60 Find the common denominator of 115/6 and -43/288. 288 What is the common denominator of -7/85 and 52/11? 935 Calculate the lowest common multiple of 1140 and 540. 10260 What is the lowest common multiple of 322 and 3234? 74382 Find the common denominator of 47/1088 and -77/2720. 5440 Calculate the common denominator of -25/4456 and -73/8. 4456 Calculate the smallest common multiple of 649 and 9. 5841 Calculate the lowest common multiple of 72 and 810. 3240 Calculate the least common multiple of 21 and 19710. 137970 What is the common denominator of 43/240 and -45/16? 240 What is the common denominator of -47/243 and 52/9? 243 Calculate the common denominator of 67/36 and 83/12. 36 Calculate the lowest common multiple of 12 and 7766. 46596 What is the smallest common multiple of 8 and 2160? 2160 What is the common denominator of -1/1152 and -77/768? 2304 What is the common denominator of 71/152 and 87/250? 19000 Find the common denominator of 113/552 and -45/2. 552 Find the common denominator of -97/6 and 109/48. 48 Calculate the common denominator of -145/96 and -46/75. 2400 What is the lowest common multiple of 3 and 11? 33 Calculate the common denominator of 7/1080 and -93/680. 18360 What is the least common multiple of 10 and 988? 4940 What is the least common multiple of 558 and 57? 10602 Calculate the common denominator of -30/13 and -32/17. 221 Calculate the lowest common multiple of 560 and 3216. 112560 Calculate the common denominator of -19/12 and -49/66. 132 Find the common denominator of 71/675 and 49/825. 7425 Calculate the lowest common multiple of 27 and 78. 702 What is the common denominator of 47/90 and 107/110? 990 What is the common denominator of -61/404 and 15/16? 1616 Calculate the lowest common multiple of 159 and 1272. 1272 Calculate the smallest common multiple of 2088 and 432. 12528 Calculate the lowest common multiple of 1971 and 657. 1971 Calculate the smallest common multiple of 9 and 150. 450 Find the common denominator of 73/32 and -113/160. 160 Calculate the common denominator of 31/7 and 91/178. 1246 Calculate the common denominator of -52/141 and 20/81. 3807 Find the common denominator of 31/5 and -7/221. 1105 Calculate the least common multiple of 117 and 90. 1170 Find the common denominator of 24/497 and -69/4. 1988 Calculate the least common multiple of 72 and 291. 6984 What is the lowest common multiple of 4 and 804? 804 What is the lowest common multiple of 54 and 2142? 6426 What is the least common multiple of 90 and 693? 6930 Calculate the common denominator of 29/767 and 5/3. 2301 Find the common denominator of 4/11 and 44/493. 5423 Calculate the common denominator of 69/134 and -119/1130. 75710 What is the common denominator of 33/4 and -7/24? 24 Find the common denominator of 145/72 and 41/272. 2448 What is the common denominator of 7/2900 and 4	{ "pile_set_name": "DM Mathematics" }
, -20902, -20900, -20898? 2v - 20908 What is the g'th term of 126, 154, 202, 276, 382? g3 + 4g*2 + 9g + 112 What is the p'th term of -97, -187, -271, -349, -421, -487, -547? 3p2 - 99p - 1 What is the p'th term of 182, 355, 502, 611, 670, 667, 590? -2p3 - p2 + 190p - 5 What is the d'th term of 392, 389, 386? -3d + 395 What is the j'th term of -4, -38, -98, -184, -296? -13j*2 + 5j + 4 What is the k'th term of -8056, -8055, -8054? k - 8057 What is the w'th term of 894, 3557, 7990, 14193, 22166? 885w2 + 8w + 1 What is the p'th term of -187, -357, -515, -655, -771, -857, -907, -915? p*3 - 177p - 11 What is the i'th term of 280, 276, 270, 262, 252, 240, 226? -i2 - i + 282 What is the i'th term of -57, -87, -129, -177, -225? i3 - 12i2 - i - 45 What is the p'th term of -19, -29, -61, -127, -239, -409, -649, -971? -2p3 + p2 + p - 19 What is the r'th term of -821, -825, -831, -839? -r*2 - r - 819 What is the r'th term of 15, 5, -5, -15, -25? -10r + 25 What is the y'th term of 229, 454, 679? 225y + 4 What is the n'th term of 71, 104, 187, 344, 599, 976, 1499, 2192? 4n3 + n2 + 2n + 64 What is the v'th term of 28, 22, 16, 10? -6v + 34 What is the h'th term of -353, -349, -347, -347, -349, -353, -359? -h*2 + 7h - 359 What is the n'th term of 83, 79, 75? -4n + 87 What is the n'th term of 3453, 3449, 3445, 3441, 3437, 3433? -4n + 3457 What is the b'th term of 105, 406, 915, 1638, 2581, 3750? b*3 + 98b2 + 6 What is the w'th term of 223, 253, 271, 271, 247? -w3 + 37w + 187 What is the b'th term of 6, 24, 78, 186, 366? 3b*3 - 3b + 6 What is the d'th term of -6, -14, -32, -66, -122? -d3 + d2 - 4d - 2 What is the u'th term of -10, -9, -8, -7, -6, -5? u - 11 What is the f'th term of -15601, -31203, -46805, -62407, -78009, -93611? -15602f + 1 What is the a'th term of 96, 144, 194, 246? a*2 + 45a + 50 What is the y'th term of -198, -127, -56? 71y - 269 What is the u'th term of -184, -376, -570, -772, -988? -u3 + 5u*2 - 200u + 12 What is the r'th term of -59, -65, -71, -77? -6r - 53 What is the h'th term of 7327, 7325, 7325, 7327, 7331, 7337, 7345? h2 - 5h + 7331 What is the f'th term of 33, 59, 111, 195, 317? f*3 + 7f*2 - 2f + 27 What is the l'th term of -6, -20, -44, -78, -122, -176? -5l2 + l - 2 What is the f'th term of 587, 590, 595, 602, 611? f2 + 586 What is the m'th term of -470, -974, -1488, -2018, -2570? -m3 + m2 - 500m + 30 What is the j'th term of 17, 22, 29, 38? j*2 + 2j + 14 What is the s'th term of 9624, 19247, 28868, 38487, 48104? -s*2 + 9626s - 1 What is the s'th term of 10, 11, 4, -11, -34, -65? -4s2 + 13s + 1 What is the g'th term of -32, -81, -130? -49g + 17 What is the l'th term of -50, -53, -56? -3l - 47 What is the h'th term of 44, 99, 154, 209, 264? 55h - 11 What is the z'th term of 54, 145, 246, 363, 502? z3 - z2 + 87z - 33 What is the b'th term of 742, 729, 718, 709, 702, 697? b*2 - 16b + 757 What is the p'th term of -448, -921, -1398, -1879, -2364, -2853, -3346? -2p2 - 467p + 21 What is the n'th term of -3, 38, 95, 162, 233, 302, 363, 410? -n*3 + 14n*2 + 6n - 22 What is the o'th term of -192, -196, -200, -204, -208, -212? -4o - 188 What is the p'th term of 75, 550, 1839, 4350, 8491, 14670? 68p3 - p2 + 2p + 6 What is the n'th term of 1082, 2163, 3244? 1081n + 1 What is the l'th term of 383, 770, 1161, 1556, 1955, 2358? 2l2 + 381l What is the m'th term of 189, 375, 559, 741, 921, 1099, 1275? -m*2 + 189m + 1 What is the z'th term of -1132, -1134, -1136, -1138, -1140? -2z - 1130 What is the q'th term of -148, -302, -456, -610, -764? -154q + 6 What is the a'th term of -4, -19, -50, -103, -184, -299, -454, -655? -a*3 - 2a*2 - 2a + 1 What is the v'th term of 1834, 1826, 1814, 1798, 1778, 1754? -2v2 - 2v + 1838 What is the v'th term of 208, 267, 326, 385, 444? 59v + 149 What is the p'th term of -2872, -2870, -2868? 2p - 2874 What is the a'th term of 77, 154, 235, 320, 409, 502, 599? 2a2 + 71a + 4 What is the z'th term of 160, 331, 502, 673? 171z - 11 What is the y'th term of 112, 247, 404, 583? 11y*2 + 102y - 1 What is the n'th term of -29899, -29895, -29889, -29881, -29871, -29859? n*2 + n - 29901 What is the j'th term of -5, -12, -25, -44, -69? -3j*2 + 2j - 4 What is the o'th term of 149, 300, 453, 608, 765? o*2 + 148o What is the l'th term of -12, -216, -802, -1962, -3888, -6772? -32l3 + l2 + 17l + 2 What is the f'th term of -135, -268, -413, -576, -763? -f*3 - 126f - 8 What is the z'th term of -7, 15, 39, 65? z*2 + 19z - 27 What is the h'th term of -467, -460, -443, -410, -355? h3 - h2 + 3h - 470 What is the f'th term of -51, -54, -57, -60, -63? -3f - 48 What is the c'th term of 606, 622, 638, 654, 670, 686? 16c + 590 What is the o'th term of -42, -44, -46, -48, -50, -52? -2o - 40 What is the w'th term of 13, 52, 113, 196, 301, 428? 11w2 + 6w - 4 What is the j'th term of 4, -115, -446, -1097, -2176, -3791? -18j3 + 2j*2 + j + 19 What is the b'th term of -7, 17, 57, 113, 185, 273? 8b2 - 15 What is the s'th term of 75, 76, 77, 78, 79? s + 74 What is the l'th term of -321, -489, -647, -789, -909? l3 - l*2 - 172l - 149 What is the j'th term of -50, -31, -50, -125, -274, -515, -866? -3j3 - j2 + 43j - 89 What is the k'th term of 744, 1484, 2224? 740k + 4 What is the c'th term of 9, 14, 31, 66, 125, 214, 339? c3 - 2c + 10 What is the b'th term of -547, -1095, -1641, -2185? b*2 - 551b + 3 What is the c'th term of -15, -65, -149, -267, -419? -17c2 + c + 1 What is the p'th term of -11, -10, -9, -8, -7? p - 12 What is the s'th term of 8, 9, 10, 11? s + 7 What is the w'th term of 10713, 21420, 32123, 42822, 53517? -2w*2 + 10713w + 2 What is the z'th term of 2, 14, 50, 122, 242, 422? 2z3 - 2z + 2 What is the x'th term of 1300, 2615, 3930, 5245, 6560? 1315x - 15 What is the w'th term of -42, -67, -56, 9, 146, 373, 708? 3w*3 - 46w + 1 What is the v'th term of -2649, -2648, -2647? v - 2650 What is the u'th term of 1214, 1207, 1192, 1163, 1114, 1039, 932? -u*3 + 2u*2 - 6u + 1219 What is the f'th term of 19, 80, 175, 298, 443? -f*3 + 23f2 - f - 2 What is the y'th term of -642, -1277, -1906, -2523, -3122, -3697, -4242? y3 - 3y2 - 633y - 7 What is the p'th term of -71, -93, -113, -131, -147? p*2 - 25p - 47 What is the o'th term of 179, 639, 1395, 2441, 3771? -o*3 + 154o*2 + 5o + 21 What is the o'th term of 79, 106, 133, 160, 187, 214? 27o + 52 What is the j'th term of 4258, 4259, 4264, 4273, 4286, 4303, 4324? 2j*2 - 5j + 4261 What is the z'th term of 6, 14, 34, 72, 134, 226? z3 + z + 4 What is the l'th term of -821, -902, -981, -1058, -1133? l2 - 84l - 738 What is the n'th term of 102, 188, 278, 372, 470, 572, 678? 2n*2 + 80n + 20 What is the a'th term of -168, -324, -478, -630, -780, -928? a*2 - 159a - 10 What is the z'th term of 187, 183, 177, 169, 159? -z*2 - z + 189 What is the c'th term of 23, 56, 89, 122, 155? 33c - 10 What is the a'th term of 114, 171, 266, 399? 19a2 + 95 What is the z'th term of 14, 4, -36, -118, -254? -2z*3 - 3z*2 + 13z + 6 What is the j'th term of -529, -1055, -1579, -2101, -2621? j*2 - 529j - 1 What is the y'th term of -122, -291, -460, -629, -798, -967? -169y + 47 What is the q'th term of -591, -1177, -1763, -2349? -586q - 5 What is the v'th term of 490, 497, 506, 517? v*2 + 4v + 485 What is the r'th term of 10, 29, 34, 19, -22, -95, -206? -r3 - r2 + 29r - 17 What is the i'th term of -255, -514, -773? -259i + 4 What is the m'th term of -154, -268, -386, -508? -2m2 - 108m - 44 What is the h'th term of 20, -8, -50, -112, -200? -h3 - h2 - 18h + 40 What is the c'th term of 500, 516, 542, 584, 648, 740, 866, 1032? c3 - c2 + 12c + 488 What is the z'th term of 98, 90, 68, 26, -42, -142, -280, -462? -z3 - z2 + 2z + 98 What is the s'th term of -10932, -21861, -32790, -43719, -54648, -65577? -10929s - 3 What is the q'th term of 1936, 1935, 1934? -q + 1937 What is the f'th term of 77, 301, 673, 1193, 1861, 2677? 74f2 + 2f + 1 What is the j'th term of 2978, 5964, 8950, 11936, 14922, 17908? 2986j - 8 What is the x'th term of 17, 29, 57, 107, 185? x*3	{ "pile_set_name": "DM Mathematics" }
ative of u(a) wrt a. -1320a3 What is the second derivative of 26x*5 - 49x*5 - 9x - 5x wrt x? -460x3 Let r(d) be the second derivative of -d7/42 + 2d3/3 - 4d. What is the second derivative of r(m) wrt m? -20m3 Let q(n) = -n - 1. Let b(h) = h + 1. Let x(k) = 3b(k) + 4q(k). What is the derivative of x(m) wrt m? -1 Let f(q) be the second derivative of 5q8/336 + q5/30 + 5q2/2 - 4q. Let o(c) be the first derivative of f(c). Find the third derivative of o(h) wrt h. 300h2 Suppose 0 = -3t + 1 + 5. Let k be ((-12)/4)/(6/(-8)). Differentiate 2pt - 2p*2 - 4 - 3p*k + 0p*2 with respect to p. -12p*3 Find the second derivative of -2j*3 - 51j - 9j3 - 19j + 10j wrt j. -66j Suppose 0 = -o + 2. Let u(s) = s*2 + 2s - 3. Let y be u(o). Find the second derivative of -2ly + l + l + 5l*5 wrt l. 60l*3 Let n(d) be the second derivative of -7d*6/30 + 19d*3/6 + 25d. What is the second derivative of n(f) wrt f? -84f2 Suppose 3v = v. Differentiate -1 + v - 4l + 0 wrt l. -4 Let g(s) = s2 - s. Let x(h) = 9h3 - h2 - 14h. Let w(o) = g(o) + x(o). Find the second derivative of w(a) wrt a. 54a Let g(x) = -7x - 2. Let y(w) = -11w - 3. Let v(k) = -8g(k) + 5y(k). Find the first derivative of v(l) wrt l. 1 Let l(n) be the second derivative of -8n3/3 + 2n*2 + 12n. Find the first derivative of l(h) wrt h. -16 Let q be -6 - 4/(-4 + 2). Let p = q + 6. What is the second derivative of 3a2 - 2a*2 - pa + a2 + a2 wrt a? 6 Let l(a) be the second derivative of 2a6/5 + 3a*2/2 + 5a. What is the derivative of l(v) wrt v? 48v3 Let u = 5 - 3. What is the third derivative of 4n*2 - un2 + n6 + 2n2 - 6n*6 wrt n? -600n*3 Find the second derivative of -8i*3 + 8i*3 + 19i*4 + 19i wrt i. 228i2 Let b be (6/(-2))/(-5 - -4). Find the first derivative of -5y3 + 0 + yb + 2 wrt y. -12y2 Let k(l) = -l2 - 7l + 3. Let h be k(-7). Let u(f) be the third derivative of 2f2 + 0f + 0 - 1/6fh + 1/24f*4. What is the derivative of u(a) wrt a? 1 Let n(l) = -3l. Let g be n(-1). What is the second derivative of 2vg - v - 3v*3 + 0v*3 - 3v wrt v? -6v Let c(f) = -3f + 2. Let l(w) = -3w + 1. Let y(s) = s3 + 2s*2 + 2s - 2. Let n be y(-2). Let h(a) = nc(a) + 7l(a). Differentiate h(u) with respect to u. -3 Let j(n) = 5n - 1. Let z be j(1). Differentiate 1 + 2 - 2y*z - 2y*4 with respect to y. -16y*3 Let t be (5 - 1) + 2 + 0. Let j = t + -4. Find the second derivative of jg - g - 2g2 + 2g wrt g. -4 Let j(r) be the first derivative of 5r2/2 - 4r + 4. Find the first derivative of j(x) wrt x. 5 Let p = 4 + -2. What is the second derivative of -4z - 4z*p + 5z*3 + 4z*2 wrt z? 30z Let r(o) = 5o3 - 12o*2 + 9o - 3. Let n(m) = 4m3 - 12m*2 + 7m - 2. Let x(z) = 3n(z) - 2r(z). What is the second derivative of x(y) wrt y? 12y - 24 Let j(c) = 2c - 11. Let d be j(8). Suppose 4 = -3n + dn. Find the second derivative of -3u5 - 3u + 6u2 - 6u*n wrt u. -60u*3 Let m = 6 - 2. What is the third derivative of 0r*2 + 0rm + r4 - 4r4 - 3r*2 wrt r? -72r Suppose 6 = -2f + 4f + u, -5u = -3f + 9. What is the third derivative of m2 + m2 + 3mf - 2m + 2m wrt m? 18 Let t(o) be the second derivative of o5/5 + 6o*2 - 2o. Find the first derivative of t(g) wrt g. 12g2 Let s(y) = y3 - 9y*2 - y + 10. Let g be s(9). What is the first derivative of g + 7v*2 - 7v*2 - 3v*3 wrt v? -9v2 Let d(f) be the first derivative of -1 - 3 - f2 + 1 + 0f - 3f. Differentiate d(b) wrt b. -2 Let z be (-5)/((-10)/(-8))1. Let f be 40/16z/(-5). What is the third derivative of -2n2 + n2 - 3n5 + n2 + 2nf wrt n? -180n*2 Let y be -1 + 4 - (-3 + 1). What is the second derivative of -2d + 4dy - 6d*5 - d wrt d? -40d*3 Suppose -1 - 14 = -5i. Find the second derivative of -9w2 - 3w + w + iw2 wrt w. -12 Let n(v) be the third derivative of 4v*2 - 1/2v*3 + 1/30v*6 + 0v + 0v4 + 0 + 0v*5. Differentiate n(f) with respect to f. 12f2 Let r(o) = o3 - 6o2 - 7o + 1. Let y be r(7). Differentiate 0 - v + 2 - 2v + y with respect to v. -3 Let n(c) = -c + 2. Let l be n(-3). Find the third derivative of -3w*2 + lw6 - w6 - 11w6 wrt w. -840w3 Let z(u) be the first derivative of -u7/14 - u*3/3 - 3u + 2. Let c(s) be the first derivative of z(s). What is the second derivative of c(q) wrt q? -60q3 Let h(k) be the first derivative of 0k*3 + 3/4k4 + 2 - k2 + 0k. What is the second derivative of h(g) wrt g? 18g Suppose 0 = -3i + 5b + 19, 11i = 6i - 4b + 7. What is the derivative of -20s + 4 + 24s - i wrt s? 4 Differentiate 7 + 43t*3 - 43t*3 + 4t*4 wrt t. 16t*3 Let q(p) be the first derivative of 1/24p*4 + 0p + 3/2p2 + 1/6p*3 - 4. Let z(a) be the second derivative of q(a). Differentiate z(f) with respect to f. 1 Suppose 3q = 2 + 13. Find the second derivative of -6t5 + 0t + qt5 + 2t wrt t. -20t3 Let x(t) = 2t - 4. Let s be x(4). Suppose s + 9 = k. Find the third derivative of k - 13 + 2n3 - 2n*2 wrt n. 12 Let j(s) be the first derivative of 0s + 3/4s4 + 5/3s*3 - 1 + 0s2. What is the third derivative of j(z) wrt z? 18 Let t(w) = -w2 + 5w - 1. Let q = -7 - -11. Let b be t(q). Find the second derivative of -bh*3 + 3h3 + h3 - h wrt h. 6h Let x(g) = 27g*2 - 25. Let f(j) = 54j*2 - 48. Let y(s) = 4f(s) - 7x(s). Differentiate y(l) wrt l. 54l Let t(x) = -x5 - x4 + x*2 - x. Let r(y) = -19y*5 - 2y*4 + 2y*2. Let n(l) = r(l) - 2t(l). What is the second derivative of n(c) wrt c? -340c3 Let n(f) be the second derivative of 0 + 0f*3 - 1/6f*4 + 2f*2 - 4f. What is the first derivative of n(t) wrt t? -4t Let k(a) be the first derivative of -1 + a + 0a3 - a2 - 1/12a4. Let o(z) be the first derivative of k(z). What is the first derivative of o(x) wrt x? -2x Let p be 0 - (0/(-3))/(2/2). Let t(o) be the first derivative of -4 + 0o3 + 1/2o*4 - 1/2o*2 + po. Find the second derivative of t(l) wrt l. 12l Let j(v) be the first derivative of 3v*4 + 16v*3/3 + 12. Find the third derivative of j(u) wrt u. 72 Let k(u) be the second derivative of 0 + 0u*3 + 0u*2 + 1/4u*4 - 2u - 1/10u5. What is the third derivative of k(j) wrt j? -12 Let r(u) be the third derivative of 0u*5 + 0u*3 + 0u*6 + 0 + 0u - 1/12u4 + 0u*7 - 1/336u8 + u2. What is the second derivative of r(w) wrt w? -20w3 What is the first derivative of -51s*4 - 45s*4 + 30 + 64s*4 wrt s? -128s3 Let b(l) = l2 + 3l - 3. Let h be b(-3). Let s = h + 5. What is the third derivative of -2p*2 + 2p*2 - 2p*2 - sp*5 wrt p? -120p*2 What is the third derivative of -11r*3 - 8r*2 + 38r*3 - 17r*3 wrt r? 60 Let w = 7 + -3. What is the third derivative of -1 + 0 + wu*3 - 2u*2 + 1 wrt u? 24 Suppose 2v = -n + 9, -2v + 18 + 0 = 4n. Let t = 6 + -3. Find the second derivative of 0ot - 2o*3 - no + 5o + 5o*3 wrt o. 18o Find the second derivative of 2y - 8y*2 - 27y - 8y2 wrt y. -32 Let h(j) be the third derivative of -2j8/21 + j5/10 - 31j2. Find the third derivative of h(m) wrt m. -1920m2 Let h = -15 - -9. Let k(c) = c2 - c - 1. Let l(p) = -9p2 + 6p + 9. Let y(n) = hk(n) - l(n). Find the first derivative of y(o) wrt o. 6o Let o(q) = -11q3 + 95q*2 + 49q - 3. Let g(b) = -7b3 + 63b*2 + 33b - 2. Let w(c) = -8g(c) + 5o(c). Find the second derivative of w(i) wrt i. 6i - 58 Let u(c) be the second derivative of -19c*5/20 - 13c*4/12 - 28c. What is the third derivative of u(g) wrt g? -114 Let z(r) be the third derivative of 0r3 + 0r*4 - 1/12r*5 + 0r - 7r2 + 0 + 1/60r*6. Find the third derivative of z(a) wrt a. 12 Let a = -16 - -19. What is the second derivative of -3k*a - 4k*3 + 5k - 4k + 3k wrt k? -42k Let k(p) = -2p - 12. Let n be k(-6). Let i(z) be the first derivative of -2 + nz3 - 1/2z*4 + 0z*2 + 2z. What is the derivative of i(s) wrt s? -6s2 Suppose 0 = -2n - 3 + 9. What is the derivative of -1 + z*n + 3 + 1 + 0z*3 wrt z? 3z2 Let v(a) be the third derivative of -a7/15 - 17a3/6 - 13a**2. Differentiate v(l	{ "pile_set_name": "DM Mathematics" }
. Which is the closest to o? (a) -1 (b) 0.1 (c) z c Let f = 0.2 - 0.8. Let t = f + 1.6. What is the nearest to t in -2, 5, 3? 3 Let g = 23 - 22. Which is the nearest to -1? (a) 0 (b) 3/8 (c) g a Let w = 0.3 - 0.1. Let p = -118 + 124. What is the nearest to p in 0, w, 3/2? 3/2 Let z be 7/(-21) - (-53)/(-3). Let h be (-1)/(z/(0 - 3)). Let t(b) = -b*2 - 5b + 6. Let q be t(-6). What is the closest to 0 in 1, h, q? q Let x(i) = -3i2 + 4i + 5. Let w be x(4). Let n be 33/w - (1 + -2). What is the closest to 0.1 in -5, 5, n? n Let x = 128/325 - 6/25. Let r = -0.07 + -0.03. What is the closest to 2 in r, -5, x? x Suppose -3z = 2z. Let q = 1.6 - 5.4. Let m = q + 4. Which is the nearest to z? (a) -1 (b) -2/5 (c) m c Let r = 18 + -13. Let w = 0.3 + -0.29. Let v = -0.41 + w. Which is the nearest to 2/7? (a) 3/5 (b) r (c) v a Let h = 0.4 - 0.6. Let w be (0 + 3)/((-357)/(-14)). Let u = -1 + 1.1. Which is the nearest to u? (a) w (b) h (c) -2 a Let h = -331 - -328.23. Let t = 0.23 - h. What is the closest to -0.1 in -2, -3/2, t? -3/2 Let z be (12/10)/((-8)/(-60)). Suppose 3x = 3n - 0x + z, 8 = -2n + 4x. Let b be 8/(-44) + n/110. What is the nearest to b in -0.5, 5, -0.1? -0.1 Let k = -35 - -32. Which is the nearest to 4? (a) 0 (b) 4 (c) k b Let p be 4 - ((-1)/(-1) - 1). Let v = -226 - -226.1. What is the closest to v in 0.3, p, -3? 0.3 Suppose -2h = -4q + 18, -2h - 23 = -7q + 2q. Which is the closest to -1/2? (a) -2/7 (b) 0.14 (c) q a Let z = -0.44 + 0.42. What is the nearest to 1 in 4/5, -3, z? 4/5 Let z = 6.6 + -10.6. Which is the nearest to -2? (a) -2 (b) z (c) -2/15 a Let o = 2 - 0. Let z = -4 - -3.99. Let t = z + -0.39. What is the closest to o in 0, t, 1? 1 Let l(r) = -r*3 - r - 1. Suppose 5 = -5t + v, -4t - 6v + 15 = -3v. Let j be l(t). Let i = -82 + 84. Which is the closest to j? (a) -0.4 (b) i (c) -1 c Let v be (6/(-28))/((-5)/10). Let k(h) = -h3 - 6h*2 + 4. Let p be k(-6). Suppose 5s - p = s. Which is the closest to -1/3? (a) s (b) v (c) -4 b Let v = 1.99 + -0.19. Let h = v - -0.2. What is the nearest to 0 in 3, h, -0.5? -0.5 Let z = 7.5 - 1.5. Let d = -4 + z. Which is the nearest to -0.2? (a) 0.2 (b) 0.4 (c) d a Let i be 1324/324. Let d be 9/(-3)4/(-3). Which is the nearest to -0.1? (a) d (b) i (c) -0.5 b Let t = -28 - -28. Which is the nearest to 0.1? (a) 1/3 (b) 2/5 (c) t c Let u = -215 - -1937/9. Let q be -1(0 - 1/5). Which is the closest to u? (a) 3 (b) 0 (c) q c Let t = -1.067 - -0.067. Which is the closest to -3? (a) -0.2 (b) -4 (c) t b Let q = 0.07 - -0.33. Which is the nearest to 15? (a) q (b) 3/5 (c) -5 b Let p = -0.06 + 4.06. Let m = -2 + 0. What is the nearest to m in 0.3, p, 0? 0 Suppose 0 = -6i + i - 20. Which is the nearest to -1/4? (a) 3 (b) 2/3 (c) i b Let p be (-1(1 - 5))/2. Let t = 13 + -3. Let d = 15 - t. What is the nearest to p in 1/2, d, 0.2? 1/2 Let s = -3 + 4. Let m = 2.1 + -2. Let r = 26.9 - 27. Which is the closest to m? (a) s (b) -0.5 (c) r c Let g = -2 + 2. Let d(j) = -j*3 - 6j*2 + 5j + 4. Let l be d(-7). Suppose -4f = -2 - l. Which is the closest to g? (a) f (b) 2/5 (c) 2 b Let g = 0.002 + -3.002. Which is the closest to 1? (a) g (b) -1/2 (c) -0.2 c Let u = -2/55 - 47/220. Which is the closest to -1? (a) 1/3 (b) u (c) -0.1 b Let z be (-1)/(-12/4). Suppose -4u - 8n - 4 = -4n, -5n - 41 = -4u. What is the nearest to 0 in -5, z, u? z Let r = -26 - -25. Which is the nearest to -1/3? (a) -0.3 (b) r (c) -2/5 a Let p = -383/2760 - -1/184. Let i = -1 - -2. Let v = 2.3 + -2. What is the nearest to i in v, 2, p? v Let v = -5 + 5. Which is the closest to 0.1? (a) 2 (b) v (c) -2/3 b Suppose -3k - 2k + 3x = -12, 0 = 3k + 5x - 14. Which is the nearest to k? (a) -5 (b) 0.4 (c) 4 c Let l = 78 - 79. Which is the closest to -2? (a) 1 (b) -4 (c) l c Let w = 43 + -27. Let x = 18 - w. What is the closest to 3 in 2/3, -2, x? x Let o = -1/151 + 309/1057. Let l(m) = -m*2 + m - 3. Let q be l(0). Let d be (6/(-9))/((-5)/q). What is the nearest to -1 in -1/4, d, o? d Let z = 0.13 - -0.37. Which is the nearest to 1/3? (a) 5 (b) z (c) -0.1 b Let v be (2/(-6))/(7 - 8). Let o = -0.1 + 0.1. Which is the nearest to v? (a) -2/5 (b) 1 (c) o c Let z = 12 - 9. Suppose g - 28 = -2g + 5s, -g + 3s + 16 = 0. Let p(t) = -t*3 - 6t*2 - 3t + 5. Let i be p(-5). What is the nearest to g in 1, z, i? 1 Suppose 5p = -3g - 10 - 0, 25 = -5g. Let h be 5/60(-3)/2. What is the closest to 0 in p, 5, h? h Let v = 15 + -25. Let j be 4/v5/(-6). What is the closest to 1 in j, 0, 0.4? 0.4 Let x = -33.58 - -35. Let q = -0.18 - x. Let y = q - 0.4. What is the closest to y in -1/3, -5, 0.5? -1/3 Let d be (-16)/18(-3)/(-4). Suppose -1 - 1 = -2y. Let n be y(26/14 + -2). What is the closest to -1 in n, 0.5, d? d Let d = -415138/19665 - 4/6555. Let s = -21 - d. Suppose 0 = 5l - 1 + 26. Which is the nearest to -0.1? (a) s (b) l (c) 2/7 a Suppose 1 = 7s - 6. What is the closest to s in 2, -0.4, 1/8? 1/8 Suppose 0 = -7b + 2b. What is the closest to -1 in -2/5, -4, b? -2/5 Let v = -1.004 + 0.004. What is the nearest to -3 in -2/3, -2/9, v? v Let c = -2 - -1.7. What is the nearest to -2 in c, -6, 0.2? c Let m be 4/(-63) - 6/27. Let u be -3(32/12 - 2). Which is the closest to 1? (a) -1 (b) m (c) u b Let t = 17 + -11. Let i = -5.4 + t. Let h = 3.6 - i. What is the closest to 1 in h, -3/2, -2/13? -2/13 Let m = -4 + 4.1. What is the closest to m in 5, -1/2, -0.4? -0.4 Let i = 12 + -17. What is the closest to 0.1 in -2/21, i, 0.19? 0.19 Let p = -22 - -43/2. Let h = 0.3 - 2.3. Which is the nearest to p? (a) 4 (b) -3 (c) h c Let s = 18 - 16. Let k = -500/3 - -168. What is the closest to s in 0, 5, k? k Let n(x) = x3 - 4x*2 - 4x - 4. Let d be n(5). Let r be (4/(-120) + 0)/((-3)/(-12)). Which is the nearest to -1? (a) -5 (b) r (c) d b Let j be (-34)/(-48) + (-2)/6. Let q be (-12)/(-30)2/123. Which is the closest to 1? (a) q (b) 0.4 (c) j b Let n = -181/3 - -61. Let r = -0.03 + -2.97. Which is the nearest to 0? (a) r (b) n (c) 0 c Let j = -0.2 + 0. Let w = -0.2 - -0.6. Let r be (-16)/40(-3)/6. What is the closest to r in w, j, -1? w Let c = -11.8 + 12. What is the nearest to c in 0.1, 4, -2/7? 0.1 Let y = 1.15 + -0.15. Which is the nearest to y? (a) -6 (b) 5/4 (c) -5/4 b Let y be ((-33)/(-55))/((-1)/5). Let m be 3/(-2)(-2)/(-8). What is the nearest to 0 in y, -5, m? m Let o = -7 + 5. Let x = 8 - 5. Suppose -2s - x = 9. Which is the closest to -0.1? (a) -0.4 (b) s (c) o a Let z = 4.87 - -0.13. Which is the closest to -2/9? (a) 2/7 (b) z (c) 1 a Let q be (14/(-10) + 1)-5. Let w be 6/4q/15. Which is the nearest to -1/2? (a) 2/3 (b) w (c) -0.3 c Let p be 3/1515/(-3)-1. Which is the nearest to p? (a) -3/7 (b) 0.4 (c) 25 b Suppose 3s - 2s + 4y = 23, -3y = 3s - 24. Let m be (s - 4)3/9. Let l(v) = -v + 9. Let j be l(6). Which is the nearest to 1/2? (a) m (b) 0.1 (c) j b Let u = -33 + 32. Let a = 2 + 2. What is the nearest to u in a, 3, 0.06? 0.06 Let v(o) = -o - 2. Let z be v(-3). What is the nearest to z in -1/2, -0.3, 1? 1 Let t = 1 - 0. Let y = -4 - -10. Let i be (-2)/y + 42/(-36). Which is the closest to -0.2? (a) t (b) i (c) -2/15 c Let f be 0 + 0 + 5/40. Which is the nearest to -17? (a) -5 (b) f (c) 1 a Let v be (14/8 + -1)/((-9)/36). Which is the nearest to -1? (a) 1/2 (b) v (c) 0 c Let z = -6 - -8. Let s = 13 + -9. Suppose -5p = 3f + 1, -sp + 3f = -0p + 17. What is the nearest to p in -6/5, 5, z? -6/5 Let j = 22.5 + -22. What is the closest to j in -3, 0.4, -1? 0.4 Let r = 0.7 + -3.7. Let j = -3 - r. Which is the nearest to j? (a) -2/5 (b) 0.3 (c) 0.1 c Suppose p - 4a - 12 = -0p, -6 = 5p + 2a. Let j = -79 + 551/7. What is the closest to j in p, 4, 1? p Let o(w) = -w*3 - 5w*2 - 3w + 4. Let h be o(-4). Let i be (20/135)/((-4)/(-6)). Which is the nearest to i? (a) 5 (b) 3 (c) h c Let z = -8.1 - -8. Which is the closest to z? (a) 0 (b) -0.1 (c) 1/3 b Let i = -0.64 + 0.6. Let f = -5.04 - i. Which is the nearest to -1? (a) f (b) 2 (c) -3 c Let r = -0.1 + 0.1. Let x = 18 + -15. What is the closest to r in -0.2, x, 4? -0.2 Let x be 3 + (-7)/(21/8). Suppose -5*m - 36 =	{ "pile_set_name": "DM Mathematics" }
7 composite? True Is 66592139 prime? True Is 11386055 a composite number? True Is 3474335 prime? False Is 7695197 a prime number? True Is 1245261 a composite number? True Is 37969229 a composite number? False Is 404802103 prime? False Is 1373959 a composite number? False Is 131322667 a composite number? True Is 42811547 a composite number? True Is 28088729 composite? False Is 11865439 a prime number? False Is 226715261 composite? False Is 473602697 prime? True Is 63378941 a composite number? True Is 6704185 prime? False Is 3406703 a prime number? True Is 47150863 a composite number? False Is 44071 a prime number? True Is 665669 composite? True Is 276851 a prime number? False Is 161278291 a prime number? False Is 164113769 composite? False Is 132463691 a prime number? True Is 9242489 composite? True Is 27720983 a composite number? False Is 327790933 a prime number? False Is 6006941 prime? True Is 3685973 a composite number? False Is 916843 composite? True Is 413467801 a prime number? False Is 29441387 a prime number? True Is 3594194 prime? False Is 103151031 a prime number? False Is 5131313 a composite number? True Is 22410239 prime? True Is 1964891 a prime number? False Is 19211939 a prime number? True Is 273024779 a composite number? True Is 589349 a composite number? False Is 10212463 a prime number? True Is 39677699 a composite number? False Is 25759507 a composite number? True Is 28429273 a composite number? False Is 18474833 a composite number? True Is 59348047 a composite number? True Is 20622817 a prime number? False Is 1309751 a prime number? False Is 4192157 composite? False Is 60535711 composite? True Is 48992269 a composite number? True Is 554942953 composite? False Is 1407569 prime? True Is 81291713 a composite number? False Is 184942843 a prime number? True Is 29386061 composite? False Is 26227297 a composite number? False Is 8207327 prime? True Is 91313203 a prime number? True Is 16118359 prime? True Is 3847199 composite? True Is 8356567 a composite number? True Is 2290817 composite? False Is 186590869 prime? False Is 3094607 a composite number? False Is 126563494 composite? True Is 912945887 a prime number? False Is 612923 a composite number? False Is 28727459 a prime number? True Is 37729039 a prime number? False Is 3292307 prime? False Is 19774739 a composite number? False Is 47668541 composite? True Is 7176317 a composite number? False Is 1259413 prime? True Is 968417831 a prime number? False Is 4997887 composite? False Is 36178279 prime? False Is 14485351 a prime number? True Is 4100879 a prime number? True Is 54837877 a composite number? True Is 359215 prime? False Is 533879 prime? True Is 108203897 a prime number? True Is 19945 composite? True Is 38769865 a prime number? False Is 6737231 a prime number? True Is 249191963 composite? False Is 43548311 a composite number? True Is 1502960335 composite? True Is 16318279 composite? True Is 352539685 composite? True Is 13709695 a composite number? True Is 1164029 prime? True Is 984373 composite? True Is 236000419 a prime number? True Is 153735347 a composite number? False Is 58641173 prime? False Is 23642453 a prime number? False Is 4511971 composite? False Is 2535985 composite? True Is 5297233 a prime number? True Is 227657 a prime number? False Is 52875401 a prime number? True Is 381679 composite? True Is 13381217 composite? False Is 48972117 a prime number? False Is 145811189 prime? True Is 13375693 a prime number? True Is 5702 composite? True Is 390787 composite? True Is 8685307 composite? True Is 27110261 prime? False Is 96520841 a composite number? False Is 283524667 a composite number? True Is 42196499 prime? False Is 3664409 composite? True Is 390046 prime? False Is 221927683 prime? True Is 6788641 prime? False Is 7269181 prime? True Is 1618183 composite? True Is 28167661 prime? True Is 653507381 a prime number? False Is 1228979 prime? False Is 2053357 prime? True Is 3788747 prime? True Is 855697 prime? True Is 10242679 a prime number? False Is 4832347 prime? False Is 208567 a composite number? True Is 58741121 a composite number? False Is 14433359 a composite number? False Is 1523777 composite? True Is 60889 a composite number? False Is 8105947 prime? False Is 73653379 a prime number? True Is 2657063 composite? True Is 402332815 prime? False Is 357366143 prime? True Is 831605029 a composite number? False Is 1900397 composite? False Is 2068487 prime? True Is 915881 prime? True Is 1414883 a composite number? True Is 12504391 a composite number? False Is 223985173 a composite number? True Is 499805 prime? False Is 1156151 a prime number? True Is 13972403 a composite number? True Is 2170949 a composite number? True Is 85979 a composite number? True Is 278027 prime? False Is 800866765 a prime number? False Is 428563 a prime number? True Is 4998731 a prime number? False Is 34692989 composite? False Is 49588057 a prime number? False Is 1302689 prime? True Is 98325287 composite? False Is 7097341 composite? False Is 67333529 a composite number? False Is 358217 composite? True Is 8380469 a prime number? True Is 2242517 prime? True Is 1623 composite? True Is 40292423 a composite number? True Is 2298691 prime? True Is 3225181 a composite number? False Is 17405737 composite? True Is 30988201 prime? False Is 6896371 composite? False Is 40937149 prime? False Is 15347413 a composite number? True Is 1660987 prime? False Is 231011 a prime number? False Is 184462523 a prime number? False Is 13270357 composite? True Is 34562039 prime? True Is 903373 a composite number? True Is 1102013 composite? True Is 2832329 a prime number? True Is 4397089 composite? True Is 241219 a composite number? True Is 78229 prime? True Is 62761 composite? False Is 3752351 a prime number? True Is 102020867 prime? False Is 56807821 a composite number? True Is 2198779 composite? True Is 26855863 a composite number? False Is 155828227 a composite number? True Is 27438757 prime? True Is 24995161 a composite number? False Is 27116729 a composite number? False Is 1103827103 a prime number? True Is 29792089 a composite number? True Is 145230454 a prime number? False Is 724187 a composite number? False Is 12170167 a composite number? False Is 137694787 composite? False Is 4394129 composite? True Is 881471 a prime number? True Is 494453819 a composite number? False Is 26233043 a prime number? True Is 877739 a composite number? False Is 36883163 a composite number? True Is 47427767 a composite number? False Is 112459 a prime number? True Is 15033649 a prime number? True Is 24590933 a prime number? False Is 10464511 composite? True Is 246391 composite? False Is 62107271 prime? False Is 124224091 composite? False Is 11100913 a composite number? False Is 47161 prime? True Is 2467631 composite? True Is 4192667 prime? True Is 27165482 a prime number? False Is 6181793 composite? True Is 170669 composite? False Is 6169591 composite? False Is 3510337 composite? True Is 14277565 prime? False Is 54709 a composite number? False Is 1481723 prime? False Is 2592055 prime? False Is 781853 composite? False Is 34351523 prime? True Is 8866139 composite? False Is 4051261 prime? True Is 64835465 a composite number? True Is 58355201 a composite number? False Is 97206281 a prime number? False Is 241354741 composite? True Is 26271277 a composite number? True Is 81413317 a composite number? True Is 4717697 a composite number? True Is 2967209 a composite number? True Is 73218947 a composite number? False Is 603673 composite? True Is 15545513 a prime number? False Is 27435557 composite? False Is 57054667 a prime number? False Is 5978449 a prime number? True Is 8867843 prime? True Is 21751747 a prime number? False Is 7879853 composite? True Is 4961413 composite? True Is 8749787 a composite number? False Is 210236129 a composite number? False Is 1358791193 prime? True Is 4342657 a prime number? False Is 102471823 prime? True Is 4247405 composite? True Is 87342703 composite? True Is 69163043 prime? True Is 3901589 a prime number? True Is 30755533 prime? False Is 14304571 a composite number? False Is 67438927 prime? False Is 127253681 prime? False Is 21152171 a composite number? True Is 32826107 composite? True Is 27099847 prime? False Is 1376719 a	{ "pile_set_name": "DM Mathematics" }
r*3 Collect the terms in -152 + 14265v - 399 - 14262v + 34. 3v - 517 Collect the terms in 6166561 - 7w - 3083268 - 3083293. -7w Collect the terms in -109x - 221x - 8 + 696x + 559x. 925x - 8 Collect the terms in -3i + 3i + 6811313i*2 - 13622594i*2 + 6811283i*2. 2i*2 Collect the terms in 1 + 2397k + 2864k + 599k + 1195k. 7055k + 1 Collect the terms in 545489m2 + 4m - 4m - 33. 545489m2 - 33 Collect the terms in 0 - k3 - 9k - 111518k*2 - 1 + 111518k*2 - 57k*3. -58k*3 - 9k - 1 Collect the terms in -2850p - 2840p + 11374p - 1221 - 2841p - 2841p. 2p - 1221 Collect the terms in 22088621h - 4h*3 + 3046687h + 5h3. h3 + 25135308h Collect the terms in -3 + 3 + 13576i - 4891i. 8685i Collect the terms in 12p*3 - 9p*3 + 9p*3 - 1253232 + 2p*3 + 1253233. 14p*3 + 1 Collect the terms in 7460z - 1669z - 2068z - 2262z. 1461z Collect the terms in -5733 - 40s + 41s + 2792 + 2941. s Collect the terms in 6 + 439p3 + 721p*3 + 2633p*3 - 6. 3793p*3 Collect the terms in 26v + 37v + 276v + 31v + 20v - 415v + 24v. -v Collect the terms in -291235u - 5u*3 + 582443u - 291222u + 3. -5u*3 - 14u + 3 Collect the terms in 1747m2 + 205m + 494m2 - 781m*2 + 811m*2 - 205m. 2271m2 Collect the terms in 419971v*3 + 419744v*3 + 419745v*3 - 1259458v*3. 2v*3 Collect the terms in -477p*2 + 8212 + 244p*2 + 238p*2. 5p*2 + 8212 Collect the terms in 3i - 49811696 - i + 99623393 - 49811697. 2i Collect the terms in 2i - 32890i2 - 21045i*2 + 69i. -53935i2 + 71i Collect the terms in 3g + 2682 + 2680 - 10622 + 2676 + 2584. 3g Collect the terms in -4 + 705y - 1490y + 788y + 2. 3y - 2 Collect the terms in -5 + 5 - 6o2 - 120o*2 + 64o*2 - 4o*2 + 65o2. -o2 Collect the terms in -1326 - 49y - 1322 + 5264 - 1287 - 1327. -49y + 2 Collect the terms in -228686 + 228686 - 167s2. -167s*2 Collect the terms in 1843 - l + 5421 + 1229 + 1781. -l + 10274 Collect the terms in 21866902v*3 + 21866601v*3 - 43733504v3. -v3 Collect the terms in 4503h + 9282h + 15597h + 2h*2 - 4917h - 4. 2h2 + 24465h - 4 Collect the terms in 6 - 9 + 11505q - 11274q. 231q - 3 Collect the terms in 198707x*2 - 198707x*2 + 62x*3. 62x*3 Collect the terms in 16u*2 + 42 + 18 + 14u*2 + 90 - 4u*2. 26u*2 + 150 Collect the terms in 55w*2 - 86w*2 + 49w + 0 - 5 - 34w - 15w. -31w2 - 5 Collect the terms in 2178388338 - 2178388338 + 8j - 8j + 10j*2. 10j*2 Collect the terms in -2994a*2 + 1767273279 - 1767273279. -2994a2 Collect the terms in h3 - 7h3 - 56343585h*2 + 112687182h*2 - 56343597h*2 - 3h*3. -9h*3 Collect the terms in -49u*2 + 317 - 88 - 89 - 92 + 42 - 90. -49u*2 Collect the terms in -2433r + 552r + 470r + 1410r. -r Collect the terms in -41249 - 41251 - 41258 - 4m*2 + 123758 - 3m*2. -7m*2 Collect the terms in -38575 - 175x*3 + 87x*3 - 38548 + 87x3 + 77123. -x3 Collect the terms in 6 + 29d + 2d*3 + 11d*3 + 0d*3 - 48d*2. 13d*3 - 48d*2 + 29d + 6 Collect the terms in -55x - 71x - 80x - 130x + 3. -336x + 3 Collect the terms in 478412 - 14508x*2 - 478412 + 5136x*2. -9372x*2 Collect the terms in -186 - 196 - 551n*2 + 382. -551n*2 Collect the terms in -859581z - 14849 + 14849. -859581z Collect the terms in 1 + 6871u - 1 - 3585u - 3281u. 5u Collect the terms in 11 + 5q*2 - 216q + 1 + 2 - 23q2. -18q*2 - 216q + 14 Collect the terms in 9152n3 + 9274n*3 - 18461n*3. -35n*3 Collect the terms in -308602c - 365457c - 20048c. -694107c Collect the terms in 17530t + 7970t + 0 + 959t + 0. 26459t Collect the terms in 2q*2 - 5q*2 - 24q*3 + 2q*2 - 4q*3 - 60. -28q3 - q2 - 60 Collect the terms in 237f + 32f - 662 + 594. 269f - 68 Collect the terms in -5452 - 5408 + 21686 - 5415 - 5411 - 2i*3. -2i*3 Collect the terms in 13924r*2 + 8659r*2 + 7350r*2 + 2568r*2. 32501r*2 Collect the terms in -2917145196o*2 + 2917145196o*2 - 32o*3. -32o*3 Collect the terms in 364m*2 - 364m*2 + 1329m*3 - 2 - 4270m*3. -2941m*3 - 2 Collect the terms in 2941t - 1 + 3032t + 4687t + 1. 10660t Collect the terms in -6 + 18 - 7m + 34m - 21m - 5m - 12. m Collect the terms in 41b + 60b - 111b + 22b - 13b. -b Collect the terms in 5o3 - 97836 - 3o*3 - 97840 + 195676 + 4o*3. 6o*3 Collect the terms in -24917 + 3h*2 - 6127 - 4886 - h. 3h*2 - h - 35930 Collect the terms in -145y + 87y - 37y + 54y + 79y. 38y Collect the terms in -61o + 330 + 55o - 253o. -259o + 330 Collect the terms in 123b*3 + 311830 - 252b*3 + 115b*3 - 155921 - 155909. -14b*3 Collect the terms in -5783342 + 2891686 + 9d + 2891651. 9d - 5 Collect the terms in 6687599v*3 - 2229200v*3 - 2229187v*3 - 2229185v*3. 27v*3 Collect the terms in 13492 - 2u*2 - 3u*2 + 4u*2 - 2u*2 + 13510 - 26987. -3u*2 + 15 Collect the terms in 4537 + 4531 - 5m + 4532 - 22750 + 4614 + 4536. -5m Collect the terms in -21a*2 - 21a*2 - 20 + 16 + 69a*2 - 26a2. a2 - 4 Collect the terms in -2v3 + 23068v + 21877v2 - 23068v. -2v3 + 21877v*2 Collect the terms in -17723p + 113921p - 2238p + 26808p + 57730p. 178498p Collect the terms in 1001r + 1001r + 1005r - 3982r + 980r. 5r Collect the terms in 2147o*3 + 251 - 253 - 2371o*3. -224o*3 - 2 Collect the terms in -3z + 16z2 - 6 - 23z*2 + 9z*2 + 2z*2. 4z*2 - 3z - 6 Collect the terms in 2 - 563z - 1 + 586z - 2 - 4 + 2. 23z - 3 Collect the terms in 554 - 281 - 273 - 257f. -257f Collect the terms in 3285s + 4 + 15041s + 34066s. 52392s + 4 Collect the terms in -1865d - 19 + 2 + 17 + 1931d. 66d Collect the terms in -30009 - 30023 + 90040 - 30008 + 204g2. 204g*2 Collect the terms in -11417i*2 - 4 - 1422i*2 - i - 9317i*2 + 1729i*2. -20427i*2 - i - 4 Collect the terms in -33t + 291 + 33t - 291 - 4268t*2. -4268t*2 Collect the terms in -4050q + 1631q + 5905q + 11059q. 14545q Collect the terms in -3660g - 3651g - 3650g + 18286g - 3663g - 3642g. 20g Collect the terms in -8015856h - 8014618h + 16030474h - 21h2. -21h*2 Collect the terms in 12z*2 - 1225101z*3 - 12z*2 + 3z. -1225101z3 + 3z Collect the terms in -1597f2 - 4f*3 + 3179f*2 - 1582f*2. -4f*3 Collect the terms in 2340 + 2337 + 1453i*3 - 7015 - 1459i*3 + 2338. -6i*3 Collect the terms in 2300458101 - 2300458101 - 13o. -13o Collect the terms in 49t*3 - 61t*3 - 28 - 30t*3 + 29. -42t*3 + 1 Collect the terms in 135185c*3 + 135998c*3 - 271168c*3. 15c*3 Collect the terms in 1349c - 5 - 1333c - 78. 16c - 83 Collect the terms in 40876h2 - 20681h*2 + 31425h*2 + 10610h*2. 62230h*2 Collect the terms in 60 + 44 - 17d + 58 - 224 + 62. -17d Collect the terms in 509v*2 + 132 - 32 - 33 - 29 - 40. 509v*2 - 2 Collect the terms in -141678i*3 - 141665i*3 - 141737i*3 + 425062i*3. -18i*3 Collect the terms in -33k + 11k - 1 - 70k - 14k. -106k - 1 Collect the terms in -93826f3 + 2 - 290257f*3 - 2 + 44718f*3. -339365f*3 Collect the terms in 17 + 1 - 3 - 15 - 11281j*2. -11281j*2 Collect the terms in -26 + 327846j - 47697j + 17. 280149j - 9 Collect the terms in -380d - 850d - 439d - 714d. -2383d Collect the terms in -191y + 536y + 311y + 920y. 1576y Collect the terms in -188 - 171 - 172 + 61x + 711 - 178. 61x + 2 Collect the terms in -632h2 - 637h*2 - 633h*2 - 625h*2 - 632h*2 - 634h*2 + 3795h*2. 2h*2 Collect the terms in -3 - 49y*2 + 0y - 25y2 - 167y*3 - 47y*2 - 8y. -167y3 - 121y*2 - 8y - 3 Collect the terms in 63771i3 - 230 - 63769i*3 + 0i*2 + 714 + 0i*2. 2i*3 + 484 Collect the terms in 2234 - 6700 + 2234 + 4869x + 2232 - 389x. 4480x Collect the terms in 840805y2 + 400615y*2 - 222199y*2 + 2700358y*2. 3719579y*2 Collect the terms in 7981913g*2 - 7981933g*2 + 15 - 2g - 53. -20g2 - 2g - 38 Collect the terms in 5q + 49816 - 49816 - 5q + 0q2 - 2q*2. -2q*2 Collect the terms in -2582 + 3n*2 + 2582 - 2n*2 + 132n. n*2 + 132n Collect the terms in -2 + 49y2 + 175y*3 - 109y*3 - 67y**	{ "pile_set_name": "DM Mathematics" }
.1 Sort 1, -858, -0.3, 1/2, -4 in decreasing order. 1, 1/2, -0.3, -4, -858 Put 2/7, 3, -9/2, 5, 4/7 in increasing order. -9/2, 2/7, 4/7, 3, 5 Sort -40, 540, -1, 0 in increasing order. -40, -1, 0, 540 Sort 0.67, 1/2, -1/7, -1/5, 47, 0. -1/5, -1/7, 0, 1/2, 0.67, 47 Put 0, -14, 3, 8, 2 in descending order. 8, 3, 2, 0, -14 Put 0.04492, -3, 1.9, 3/4 in decreasing order. 1.9, 3/4, 0.04492, -3 Sort 6864, 2, 1/9, 3. 1/9, 2, 3, 6864 Sort -0.3, 2/2657, 2/7 in increasing order. -0.3, 2/2657, 2/7 Sort -4, 3, 5, 1, -8, 0. -8, -4, 0, 1, 3, 5 Put -10, 163, 46, -5 in descending order. 163, 46, -5, -10 Sort 8/21, 2.39, -2/19, 0.5. -2/19, 8/21, 0.5, 2.39 Put -67, 1, -164, -3 in increasing order. -164, -67, -3, 1 Sort 9, -195, -4 in increasing order. -195, -4, 9 Sort 0.3, 21, -4524, -0.4, -3 in increasing order. -4524, -3, -0.4, 0.3, 21 Sort -4, 99523, 1. -4, 1, 99523 Sort -3, -1, -124034 in ascending order. -124034, -3, -1 Put 129, -5, 76, 4 in decreasing order. 129, 76, 4, -5 Put -2/11, -4, -3/2, -1, -0.43, -2 in descending order. -2/11, -0.43, -1, -3/2, -2, -4 Sort -13, 0.07, 2/9, 1/4, 3/7. -13, 0.07, 2/9, 1/4, 3/7 Sort -2, 0.5, 4076, -1, -0.08 in increasing order. -2, -1, -0.08, 0.5, 4076 Put 2/9, -2, 1/2, 3955 in ascending order. -2, 2/9, 1/2, 3955 Sort -6, -33, 2, -10, -2, 37 in descending order. 37, 2, -2, -6, -10, -33 Sort -12, 0.5, 482 in increasing order. -12, 0.5, 482 Put -0.83, -190, 4, -0.5 in descending order. 4, -0.5, -0.83, -190 Put 10, 9, -1, 1, 45 in ascending order. -1, 1, 9, 10, 45 Sort 0.09, 61/42, 5 in descending order. 5, 61/42, 0.09 Put -1, -9, -3, -635, -4, -11 in decreasing order. -1, -3, -4, -9, -11, -635 Sort 13, -2, -1, -10, 4 in descending order. 13, 4, -1, -2, -10 Put -10, -1, 2, 3, -580, -4 in descending order. 3, 2, -1, -4, -10, -580 Sort 6/13, 2/17, 1823 in ascending order. 2/17, 6/13, 1823 Sort -2, -79, 4, 54, -5, 11 in increasing order. -79, -5, -2, 4, 11, 54 Sort -64, 5, 1, 0 in increasing order. -64, 0, 1, 5 Put -61741, 2, -0.5, 3, -3, 5 in descending order. 5, 3, 2, -0.5, -3, -61741 Put -5, 10, 5, 36, -27, -3 in increasing order. -27, -5, -3, 5, 10, 36 Put 2, -40, 3, -1, -31 in descending order. 3, 2, -1, -31, -40 Sort -4/19, -3, 0.55 in ascending order. -3, -4/19, 0.55 Sort -345, 4, -1 in decreasing order. 4, -1, -345 Sort 5, 7/12, 181 in increasing order. 7/12, 5, 181 Put 0, -976, -2, -8, 2 in ascending order. -976, -8, -2, 0, 2 Put -1/100, 0.0714, -3 in descending order. 0.0714, -1/100, -3 Sort -1/6, -2/11, -1/73, 34. -2/11, -1/6, -1/73, 34 Sort -2, -5, 1164, 4, -65 in decreasing order. 1164, 4, -2, -5, -65 Sort -2/7, -3/4, 57, 9, 2/9. -3/4, -2/7, 2/9, 9, 57 Sort -1, 48, 4 in ascending order. -1, 4, 48 Put 7, -1, 899/4, 1, 4 in decreasing order. 899/4, 7, 4, 1, -1 Sort 0.4, -0.1, -6, -5, -2/13, -24 in ascending order. -24, -6, -5, -2/13, -0.1, 0.4 Put -3, -1, 191, 2, 5 in descending order. 191, 5, 2, -1, -3 Sort 5, -5, 3, -1167. -1167, -5, 3, 5 Put 0, 6, 2661, 3, -2 in descending order. 2661, 6, 3, 0, -2 Put -1.1, -0.5, 2/7, 5, 6 in decreasing order. 6, 5, 2/7, -0.5, -1.1 Sort -6, 1, 0, 883, 4, -3. -6, -3, 0, 1, 4, 883 Put -5, 25, -4, 5, -13 in descending order. 25, 5, -4, -5, -13 Put 0, -3015, -5, -50 in decreasing order. 0, -5, -50, -3015 Sort -2/3, -1, -2/13, 2. -1, -2/3, -2/13, 2 Sort 2/11, 5, 2, 3, 122 in ascending order. 2/11, 2, 3, 5, 122 Put -11930.3, -4/7, 4/3, -0.3 in descending order. 4/3, -0.3, -4/7, -11930.3 Sort 1/20, 6, -2/3, 1/2, 9 in descending order. 9, 6, 1/2, 1/20, -2/3 Sort 3, 5, 2, -3, -20, 556 in increasing order. -20, -3, 2, 3, 5, 556 Sort -10, -3/10, -154, -4, 1 in increasing order. -154, -10, -4, -3/10, 1 Sort -179, 3/7, 12.1 in descending order. 12.1, 3/7, -179 Sort 182, 317, 1 in ascending order. 1, 182, 317 Sort -6, 13, -20, 0, 5. -20, -6, 0, 5, 13 Put -4/9, -0.7, -2/63, 1, 0.4 in ascending order. -0.7, -4/9, -2/63, 0.4, 1 Put -1/21, 1/3, 12.69, 0.5 in decreasing order. 12.69, 0.5, 1/3, -1/21 Sort 9, 0, -515 in descending order. 9, 0, -515 Sort -1/3, 516758, 1/5, -4, -1/5 in decreasing order. 516758, 1/5, -1/5, -1/3, -4 Sort -901, -7, -0.4, -0.3, -9. -901, -9, -7, -0.4, -0.3 Put 33950, -3, 0.07 in descending order. 33950, 0.07, -3 Sort -1, -4, 2, 3, 1017 in ascending order. -4, -1, 2, 3, 1017 Sort 7720, -1/6, 1, 0.3, -0.4 in increasing order. -0.4, -1/6, 0.3, 1, 7720 Sort 3, 55, 37, -50, -1, -2. -50, -2, -1, 3, 37, 55 Sort 31.6, 2/17, 0, 3 in increasing order. 0, 2/17, 3, 31.6 Sort -3, -0.1, -5.57, -2/11, -0.04 in increasing order. -5.57, -3, -2/11, -0.1, -0.04 Sort 3, 5/2, 4, 3/16, 5, 1/49. 1/49, 3/16, 5/2, 3, 4, 5 Sort -0.2, 1, 2/5, 9/7, 16, -1/7 in descending order. 16, 9/7, 1, 2/5, -1/7, -0.2 Put -125798, -1, -4 in decreasing order. -1, -4, -125798 Put -1/4, -2/7, -1/3, -1/8, -1692 in descending order. -1/8, -1/4, -2/7, -1/3, -1692 Put -6, -2, 6, 85 in increasing order. -6, -2, 6, 85 Sort 1194, 5, -13, 2 in ascending order. -13, 2, 5, 1194 Put -1144, -116, -2 in increasing order. -1144, -116, -2 Put -2, 347, -7 in descending order. 347, -2, -7 Sort -2, -304, 4, -4 in ascending order. -304, -4, -2, 4 Sort -2/3, 0.3, 2, 6/23, 0.1, 5/83 in ascending order. -2/3, 5/83, 0.1, 6/23, 0.3, 2 Put -3228, -5, 1 in decreasing order. 1, -5, -3228 Put -2, 0.1, -1, -4/2407 in increasing order. -2, -1, -4/2407, 0.1 Sort 1/5, 130, -8, 0, -5 in descending order. 130, 1/5, 0, -5, -8 Sort 4.21, -5, -2, 0.4 in ascending order. -5, -2, 0.4, 4.21 Sort -1624, 1, 4, 0. -1624, 0, 1, 4 Sort 2, -489293, 3 in decreasing order. 3, 2, -489293 Put 162, -27, -5 in decreasing order. 162, -5, -27 Put -1/2, 2/7, 4, -0.3, -2/7, 0.01 in decreasing order. 4, 2/7, 0.01, -2/7, -0.3, -1/2 Sort 10/103, -2.2, -2/7. -2.2, -2/7, 10/103 Sort -6, 3, -2, 0.164, 1/2 in increasing order. -6, -2, 0.164, 1/2, 3 Put -239, -1, 0.4, -2, 7 in descending order. 7, 0.4, -1, -2, -239 Sort -124, 0, 801 in decreasing order. 801, 0, -124 Sort -5, 3, -2, -9570. -9570, -5, -2, 3 Sort -16259, 1, -5 in ascending order. -16259, -5, 1 Put 126, 0.5, -2/21, 0.3, 6, 0.2 in decreasing order. 126, 6, 0.5, 0.3, 0.2, -2/21 Put -27, 23, 23/3 in increasing order. -27, 23/3, 23 Sort 2/9, -3, -20, 97/4 in descending order. 97/4, 2/9, -3, -20 Sort 5, 8277, 16, -2, 4, -13 in descending order. 8277, 16, 5, 4, -2, -13 Put -3, 70865, -1 in decreasing order. 70865, -1, -3 Sort -3, 0.21, -1117. -1117, -3, 0.21 Sort -5, -3, -4, 59, 4 in descending order. 59, 4, -3, -4, -5 Put 2, -3, 16414, 0.2 in decreasing order. 16414, 2, 0.2, -3 Put 2, 27, 0, -10 in decreasing order. 27, 2, 0, -10 Put -7, -259, 5, -10 in decreasing order. 5, -7, -10, -259 Put -0.4, -0.2, 4101, 2/7, 0.1 in descending order. 4101, 2/7, 0.1, -0.2, -0.4 Put -4, 3, -156790 in descending order. 3, -4, -156790 Put 363, 1, -3, -4, 1/5 in descending order. 363, 1, 1/5, -3, -4 Put 2, -3, -49, 3, -6, 1 in increasing order. -49, -6, -3, 1, 2, 3 Put 4, -13.668, 3, -0.2, 0.3 in decreasing order. 4, 3, 0.3, -0.2, -13.668 Sort 3, -11/5, 10, -0.5, 0.5 in increasing order. -11/5, -0.5, 0.5, 3, 10 Sort -1, 0, 7, 720 in increasing order. -1, 0, 7, 720 Sort 136, -3196, -3. -3196, -3, 136 Put 107, -5, 4, -189 in descending order. 107, 4, -5, -189 Put -3, -5, -1, 7, -4, 1 in decreasing order. 7, 1, -1, -3, -4, -5 Sort -7, 21, 70. -7, 21, 70 Sort -1/3, -55, 2, -3, -8, -4/7 in descending order. 2, -1/3, -4/7, -3, -8, -55 Sort -0.3, -4.7, -0.5, -3/4, -3 in decreasing order. -0.3, -0.5, -3/4, -3, -4.7 Put -8, -6/145, 4.2, -1/4 in descending order. 4.2, -6/145, -1/4, -8 Put 2, 4, -41, 3, 61 in decreasing order. 61, 4, 3, 2, -41 Sort -1, -6, 0, 1, 10 in descending order. 10, 1, 0, -1, -6 Sort -2135, 0, -4 in decreasing order. 0, -4, -2135 Put 14, 1, 0, 10, -58 in decreasing order. 14, 10, 1, 0, -58 Sort -2, 15, 89, 0, 3 in ascending order. -2, 0, 3, 15, 89 Sort 94, 43, 1. 1, 43, 94 Sort 2/9, -3, -1, -11.43 in decreasing order. 2/9, -1, -3, -11.43 Sort -1/5, 1480, 10, -5 in decreasing order. 1480, 10, -1/5, -5 Sort 21, -59, -26, 0 in decreasing order. 21, 0, -26, -59 Put 23, -5, -2, -10, -27 in descending order. 23, -2, -5, -10, -27 Put 1, -379, -6 in descending order. 1, -6, -379 Put -0.1, -57, -14/3, -7/45 in descending order. -0.1, -7/45, -14/3, -57 Put 245, -5, 1, 19 in decreasing order. 245, 19, 1, -5 Put -40, -41, -6, 4, -1	{ "pile_set_name": "DM Mathematics" }
c) 8 a Let y = -18904.2 - -18904. Which is the nearest to y? (a) -0.19 (b) -2/9 (c) -2 (d) -0.5 a Let z = 3077 - 3077.4. Which is the closest to -2/5? (a) z (b) 3 (c) -0.2 (d) -1 a Suppose 2 + 10 = -3o. Let w = -0.389 - -208.389. Let c = -208.3 + w. What is the closest to -0.1 in c, 1/3, o? c Let s = 146.2 - 146.4. Let f = -12 - -6. Let u be 18/84/f. Which is the closest to 2? (a) u (b) s (c) 0.04 c Let v = -1998.2 - -1998.4. Let b(z) = z*2 + 5z + 1. Let l be b(-5). What is the nearest to l in v, -0.3, 0.14? v Let h = 0.52 + -0.62. Let s = -6.14 + 1.98. Let u = s + 0.16. What is the nearest to 0.1 in 2.2, h, u? h Let v = -307.74 + 307.6. What is the nearest to 0.5 in 2, 3, v? v Let w = 0.0556 + 571.9444. Let h = -572.4 + w. Let q be 3-1 + (-78)/(-24). What is the nearest to 1 in -5, q, h? q Let u = -6.56 - -130.96. Let d = u + -125. What is the closest to d in -3/7, -2/7, -3? -3/7 Let f = 5.091 + -5.2. Let r = -0.009 - f. What is the closest to r in 1.1, 1, 0.5? 0.5 Let s = -0.12507 - -0.02507. Which is the closest to s? (a) 3/4 (b) 5.6 (c) 0.1 (d) 0 d Let v(s) = 57s - 284. Let q be v(5). Which is the nearest to 3? (a) -6 (b) q (c) -2 (d) -4 b Let f be 23/15 - 4/10. Let g be (-54)/(-12)((-14)/35 - (-56)/90). Which is the nearest to f? (a) 12 (b) g (c) -5 b Let h = -107.76 + 113. Let b = 0.06 + h. Let k = b + -3.3. What is the closest to k in -3, 0.3, -1? 0.3 Let v = 0.4658 - 0.4658. What is the closest to 0.1 in -6, v, -2/3, 0.055? 0.055 Let y = -269 + 770. Let i = 499.8 - y. Which is the closest to 2/5? (a) -4/7 (b) 0.3 (c) i b Let w = 14083 - 13945. What is the nearest to -2/3 in -3, w, -2? -2 Let i = 7.6 - 71. Let s = -63 - i. What is the closest to 1 in s, -4.3, -1/4? s Suppose 0 = 5n - 0n + 4v + 82, 0 = -3n - v - 45. Let r = 1751/318 + -283/53. What is the nearest to r in n, 5, -4? -4 Let u = 5865.5 - 5866. Let j be (-6)/48/(-30). Let q = -30.5 + 31. Which is the nearest to j? (a) u (b) 0 (c) q c Let k = -0.1 - 0.9. Let o = -13247.9 + 13248. Which is the closest to -3? (a) -0.4 (b) k (c) -2 (d) o c Let p be 6 + 72/121/(-2). Let q be ((-8)/(-24))/(8/p - 2). Let o = -0.12 + 0.02. What is the closest to o in 1, 0.2, q? 0.2 Let v = -157.4 + 158.4. What is the nearest to 1 in -1/2, -277, v? v Let c = -7 - -5. Suppose 67q + 140q + 428q = 3175. What is the closest to -0.1 in q, c, -0.63? -0.63 Let y(o) = o3 + o2 - 4o + 1. Let k be y(-3). Suppose 94c = -188c - 1128. What is the closest to -1/5 in 4, k, c? c Let w = -0.725 + 1.83. Let n = w + -0.105. Which is the closest to n? (a) 0.4 (b) 4 (c) -4 a Let h(n) = 2n + 9. Let o be h(0). Let t be (-2)/o9/(-12). Let i be ((-10)/(-5))/(3/39). What is the closest to -6 in i, t, 2? t Let z be 6/(-13)1/3. Let a = 353 + -116. Let w = a + -223. What is the closest to w in 2/3, 1/4, z? 2/3 Let x = -253/20 + 191/12. Let j = x + -17/5. Which is the nearest to -6/7? (a) 0.06 (b) -0.5 (c) j b Let a = 637.4 + -636.4. What is the closest to a in 0.17, -0.24, -0.3? 0.17 Let m = -9.081 - -9.161. What is the nearest to 0.3 in -0.3, 5, m? m Let a(w) = 4w2 + 21w + 8. Suppose 0t + t = -5c - 10, -t = -5c. Let p be a(t). What is the nearest to -16 in p, -2/13, -2/11, -1? -1 Let t = -325 - -5523/17. Let w be (-13 + 10 - 15)/((-4)/8 + -4). Which is the nearest to -2? (a) -6 (b) t (c) w b Let o = -12087 - -12128. What is the closest to o in -4/7, -1/6, 3, 7? 7 Let a = -0.33 + 0.03. Let y = 2.54 + 0.46. Let q = -286.9 + 286.5. What is the closest to a in y, q, -4? q Let x(i) = -i3 - 7i*2 + 8. Let g be x(-7). Suppose 5j = -25, -3y - 6j + 5j - 20 = 0. Which is the closest to 1/5? (a) y (b) 0.1 (c) g b Let m = -24922 + 24922. What is the nearest to 2/17 in m, 2, -4, 2/77? 2/77 Let w = -9912 + 99119/10. Which is the closest to w? (a) -0.1 (b) -2/3 (c) -5 a Let i = -4 - -1. Let x = 40.5 - 34.6. Let j = x - 6.2. What is the nearest to 0 in j, 0, i? 0 Let u = 500 - 498. Which is the closest to u? (a) 10 (b) 0 (c) 0.4 c Let v(d) = -5d*2 + 6d. Suppose 6 - 11 = -r. Let s be v(r). Let z = s + 663/7. What is the closest to -0.1 in -3, 2/17, z? z Let i = 6 + -5. Let x = 0.958 - -644.042. Let n = x - 635. What is the closest to 0 in i, -5, n? i Let x = -34.3 + 34. Let y = 2/14717 + 103011/58868. What is the nearest to 3 in y, x, 0? y Let w(g) = -28g - 37. Suppose 2h - u = 6, -3h - 5u + 30 + 5 = 0. Let o be w(h). Let p = 889/5 + o. Which is the nearest to -0.1? (a) -2/11 (b) 2/3 (c) p a Let g = -459.4 - -459.4. Which is the nearest to -47? (a) 2/17 (b) 0.2 (c) g (d) -0.2 d Let k be 2/(-13) + (-28)/(-13). Let l = 0.0385 + -0.4385. What is the closest to k in -2, -1, l? l Let u = -2489 + 2484. What is the nearest to 2/71 in 0.3, -25, u? 0.3 Let v = -3.8 + 45. Let z = 6.5 - 47.5. Let n = z + v. Which is the nearest to -1/5? (a) 0 (b) n (c) 1/3 a Let b = -4.66 - -0.46. Let p = 0.2 + b. Let q be (((-12)/40)/(9/36))/((-36)/(-24)). What is the closest to -0.15 in q, 4, p? q Let q = 3.22 + -98.22. Let f = -93 - q. What is the closest to 2 in -0.5, 3, f? f Let b be 0 - (-80)/144-9. What is the closest to -0.4 in 0.3, b, -2/3? -2/3 Let v = -8.931 - -9.013. Which is the closest to 0.2? (a) v (b) 1 (c) -6/5 (d) -1 a Let o be 74 + -24 + 5/1. Let n be (50 - o) + 11 + -1. What is the nearest to -0.1 in 0, -1, n? 0 Let d = -27372.2 + 27372. Which is the nearest to 5? (a) -1 (b) -16 (c) d c Let p = 165.56 + -2.56. Let x = 165 - p. Let q = -4.4 + 4. Which is the closest to x? (a) 4/3 (b) -3 (c) q a Let g = 3.17 + -0.17. Let y be -314/21-2 + 0. What is the closest to g in -4/5, y, 0.2? y Suppose -3 = -q - 0. Let m = 0.171 - 186.171. Let y = -182 - m. Which is the nearest to 0.1? (a) 1 (b) y (c) q a Suppose 7q - 2q = 15. Let j be 3 + 1 + (-18)/9. Suppose qg + c = -13, -3c = -jg + c - 4. What is the nearest to g in -4, 1, 2? -4 Let k = -144.8 + 144.5. Which is the closest to k? (a) 0 (b) -1 (c) 0.3 a Let o = -8665 - -8658. Which is the closest to -1? (a) -1 (b) -0.25 (c) o (d) 3 a Let u = -36.3 + 206.3. Let l = u + -170.2. Let v = -0.2 + 0.7. What is the closest to -2 in -0.3, l, v? -0.3 Let b = 1312 - 1308. Let p = 273.8 + -274. What is the closest to 0 in 4/7, p, -0.4, b? p Let s = 27 + -43.7. Let r = s - -17.2. Which is the nearest to 1/3? (a) -0.4 (b) 1 (c) r c Let o = 15 - 8. Let d = o + -3. Let p = 57.571 + -58.071. Which is the closest to 0.4? (a) p (b) -2 (c) d a Let v be -4(-2)/(-36)3. Let i be (3/7)/(-3)-2. Let y = -1467 + 1468. Which is the nearest to i? (a) y (b) v (c) -1 a Let d be (9/(-3) + (-6)/(-2))/2. Suppose 14i = -di + 28. Which is the nearest to 3? (a) 5 (b) 1/7 (c) i c Let v = -20245 + 20244. Let u = 0.07 - 5.07. What is the closest to v in 1/3, -11, u? 1/3 Suppose 4w + 0y - 636 = -3y, -4y - 318 = -2w. Let z = -472/3 + w. Let d = 5/2 - 9/4. Which is the closest to d? (a) 2/9 (b) 1/4 (c) z b Let v = -1.4 + 1.7. Let q = 3.7 + v. What is the nearest to q in -4, -5, 4/7? 4/7 Let a(v) = -2v + 13. Let i be a(8). Let w = 7/2 + i. Let p = 49.6 - 50. What is the closest to -2/3 in p, -0.5, w? -0.5 Let d be 15 - 3 - (21 - (-616)/(-66)). Let l be 132/(-9) - (-2)/3. Which is the nearest to 0.3? (a) 3 (b) l (c) d c Let y be ((-12)/27)/((1440/81)/(-16)). Which is the nearest to 2/5? (a) 0.13 (b) 0.3 (c) 0 (d) y d Let s = 10433.6 - 10536. Which is the closest to -2/5? (a) 1 (b) s (c) 1/5 c Let b(g) = 6g*2 - 200g - 137. Let k be b(34). What is the nearest to 0 in k, -0.5, 20? -0.5 Let b(k) = k*3 + 6k*2 + 10k + 61. Let q(u) = 32u + 58. Let r be q(-2). Let m be b(r). Suppose 6v - 2v - 4 = 0. What is the nearest to v in -4, m, 2? m Let q = -21.97 + -2.33. Let g = q + 13.2. Let x = -11.2 - g. Which is the nearest to x? (a) 0.7 (b) 2 (c) -1/6 c Let m be 6/9(-60)/760. What is the closest to -2/3 in 1/4, -59, m, -3? m Let k = -10767 + 10765. What is the nearest to k in 19, -3/2, -0.2, -0.01? -3/2 Let r = -87.3 - -87. Let n = -20.3 - -20.3. Which is the nearest to -0.1? (a) 15 (b) n (c) r b Let f = 1 - 2. Suppose -2h - 17 = 2u - 91, -5h + 145 = -3u. Let x be (-10)/(-2) - h/60*10. Which is the nearest to -2/11? (a) -0.4 (b) f (c) x c Let f be (-3)/4 + (-35)/(-40). Let	{ "pile_set_name": "DM Mathematics" }
t is 0 + 15413? 15413 In base 7, what is 13564502 + 4? 13564506 In base 15, what is 7241 - -5? 7246 In base 11, what is -232 - -167? -76 In base 6, what is -14042431 + 3? -14042424 In base 13, what is -38cc9c + -1? -38cca0 In base 9, what is 12202 - 5? 12186 In base 3, what is -11011 - -222101? 211020 In base 12, what is 176 + -684? -50a In base 2, what is 0 - -1010110011011011? 1010110011011011 In base 12, what is -7759 + 2? -7757 In base 7, what is 11 - 32150? -32136 In base 7, what is 124 + -5214? -5060 In base 14, what is -304d6 - 3? -304d9 In base 7, what is 22 + 111206? 111231 In base 4, what is 202311 - -1033? 210010 In base 6, what is -2152213 - -1? -2152212 In base 16, what is 5 - 5da3? -5d9e In base 11, what is -25 - -1140? 1116 In base 10, what is 530 + 82? 612 In base 6, what is 23432 - -10? 23442 In base 6, what is -2 - 11111211? -11111213 In base 14, what is -26 - -42? 1a In base 3, what is 1012 + -221111? -220022 In base 4, what is 2 - 112101222? -112101220 In base 2, what is -1000001101 - -100001100? -100000001 In base 2, what is 10011000 + -11011110011? -11001011011 In base 14, what is 779 - -3c? 7b7 In base 6, what is 303523 - 14? 303505 In base 8, what is -11024 + 6? -11016 In base 2, what is -10110000101 + -111000110? -11101001011 In base 12, what is -1a8a9 + 1? -1a8a8 In base 11, what is 614 - -5? 619 In base 15, what is 1 - -748ad? 748ae In base 3, what is 10001022011120 - -11? 10001022011201 In base 11, what is 88 + -7839? -7761 In base 15, what is -8 + 626? 61d In base 8, what is 1223 + -1? 1222 In base 12, what is -1863 - 277? -1b1a In base 3, what is -1001 + 2002002? 2001001 In base 16, what is -e70 - -3? -e6d In base 7, what is 12 + 4005524? 4005536 In base 4, what is -230120 + 301? -223213 In base 13, what is -254c - -67? -24b5 In base 14, what is -1 - 275a? -275b In base 6, what is 11535 + -230? 11305 In base 7, what is -3 + -135653? -135656 In base 5, what is 0 - -41201? 41201 In base 11, what is -6 - 359? -364 In base 5, what is -2432031 + -10? -2432041 In base 14, what is 8 + -2b1? -2a7 In base 5, what is 10 - -1004331401? 1004331411 In base 16, what is 6a0 - -a3? 743 In base 12, what is -2b + -211? -240 In base 13, what is -420a + 28? -41b2 In base 13, what is -1045 - 132? -1177 In base 13, what is b - -5042? 5050 In base 2, what is -11 + -10011111101111? -10011111110010 In base 8, what is -360 - 66? -446 In base 14, what is -7 + -1764? -176b In base 13, what is 73aa94 + 3? 73aa97 In base 6, what is 11 - 54551? -54540 In base 12, what is -15011 + 3? -1500a In base 16, what is 1 - 24b2? -24b1 In base 3, what is 112112021 - 110? 112111211 In base 8, what is 3 + 625076? 625101 In base 2, what is 11000 - -111101111010? 111110010010 In base 14, what is 3c + -d30? -cd2 In base 15, what is -e8 - 8c? -185 In base 14, what is 2bb - -1494? 1771 In base 5, what is -1044 + -323? -1422 In base 14, what is -6 - 1d2757? -1d275d In base 16, what is -57 + -1779? -17d0 In base 4, what is 20002111 - -13? 20002130 In base 5, what is 121 - -112003? 112124 In base 2, what is -10100011101100000 - 1110? -10100011101101110 In base 10, what is 11601 - 4? 11597 In base 3, what is 1002 + -2200101021? -2200100012 In base 10, what is -55 - -485? 430 In base 15, what is 336d + 1c? 338a In base 3, what is -1 + 210011000? 210010222 In base 14, what is -4 + 7324? 7320 In base 10, what is 24666 - 3? 24663 In base 16, what is -62b8 + 2? -62b6 In base 3, what is -1100200 + -122120? -2000020 In base 16, what is 96 - 1ab2? -1a1c In base 11, what is -237 + 21? -216 In base 15, what is 15453 + 2? 15455 In base 15, what is 2e6 + -287? 5e In base 5, what is -314314 + 40? -314224 In base 10, what is -82 + -1898? -1980 In base 12, what is 1 + 776b9? 776ba In base 2, what is -11 + -10011010011110100000? -10011010011110100011 In base 10, what is -45612 + -39? -45651 In base 11, what is -999 - 1492? -2380 In base 2, what is 0 + 1000011111110001? 1000011111110001 In base 2, what is 100111000 - -100000101111? 100101100111 In base 13, what is 6329 - -5? 6331 In base 10, what is 465 - 83? 382 In base 13, what is 536 - -647? b80 In base 4, what is -31 + 31310303? 31310212 In base 2, what is -1100000101 + 1111011? -1010001010 In base 16, what is -1d98b - 4? -1d98f In base 12, what is -15b10 - -5? -15b07 In base 6, what is -40144 - -25? -40115 In base 16, what is -360 + 7? -359 In base 3, what is 1010021 + -120? 1002201 In base 14, what is 6aa - d5? 5b5 In base 15, what is 227d5 - -4? 227d9 In base 7, what is -206602 - -2? -206600 In base 5, what is 11043034 - -4? 11043043 In base 11, what is -2a8 + -71? -369 In base 5, what is -1141 + 33100? 31404 In base 7, what is 552125 + 0? 552125 In base 15, what is -1428 - -6? -1422 In base 2, what is -100 + 1000011110010000100? 1000011110010000000 In base 6, what is 123411 - 13? 123354 In base 7, what is -20 + -414544? -414564 In base 15, what is 17e2 - -13a? 192c In base 3, what is 10 - 2200222212011? -2200222212001 In base 10, what is -16541 + -39? -16580 In base 2, what is 1001010100011110 - 1010100? 1001010011001010 In base 12, what is 18ba36 - -4? 18ba3a In base 4, what is -1220223 - 101? -1220330 In base 9, what is 2 - -115756? 115758 In base 10, what is 7 + -19895? -19888 In base 9, what is -2408 + 6? -2402 In base 10, what is 38 + -6733? -6695 In base 5, what is 0 - -21400142? 21400142 In base 6, what is 30343 - -24? 30411 In base 6, what is 203 + -1241? -1034 In base 14, what is a - bc40? -bc34 In base 15, what is d - 2d0d? -2d00 In base 11, what is -9 + -986? -994 In base 16, what is 47f4 - 6a? 478a In base 3, what is 1 - -1100211222? 1100212000 In base 14, what is 10 + -1a1b9? -1a1a9 In base 2, what is -1010 - -10001111001110? 10001111000100 In base 15, what is 419 + 17? 431 In base 10, what is 90 - 1347? -1257 In base 14, what is 130 + -39c? -26c In base 2, what is 0 + -1010101011110? -1010101011110 In base 6, what is 0 - -555411? 555411 In base 4, what is 10 - -31011021? 31011031 In base 4, what is 3 + -11303232? -11303223 In base 6, what is -12 + 4532? 4520 In base 16, what is -5 - 4f42? -4f47 In base 11, what is -5a656 + 9? -5a648 In base 10, what is 194 - -122? 316 In base 15, what is -4 - -ea354? ea350 In base 15, what is 4513 + 4? 4517 In base 7, what is -526255 + 0? -526255 In base 14, what is -46 + -191d? -1965 In base 13, what is 2 - 22c3c? -22c3a In base 2, what is -1100001111010111 - -101110? -1100001110101001 In base 11, what is -10692 + -1? -10693 In base 13, what is -14cb - 1? -14cc In base 11, what is 9 + -1815a5? -181597 In base 6, what is -2153555 + 10? -2153545 In base 9, what is 0 - -87486? 87486 In base 15, what is -d99e - 2? -d9a1 In base 10, what is 2 + -114033? -114031 In base 2, what is -100 + 100110111011001? 100110111010101 In base 2, what is -100010 + -10001110011100? -10001110111110 In base 14, what is -30390 - -3? -3038b In base 4, what is -10 + -3212220? -3212230 In base 6, what is 10235 - 1514? 4321 In base 12, what is 5 - 227480? -227477 In base 12, what is a27180 - 3? a27179 In base 4, what is 223122 - 132? 222330 In base 16, what is -2a + -3c6? -3f0 In base 12, what is 26b8 + 53? 274b In base 8, what is -56267 - 5? -56274 In base 4, what is 20133102 - -220? 20133322 In base 6, what is 11520 + 15? 11535 In base 10, what is 150 + 5710? 5860 In base 10, what is -21315 + -4? -21319 In base 5, what is -132 + 3211? 3024 In base 16, what is -8 - 155ed? -155f5 In base 10, what is -2041 - -85? -1956 In base 11, what is 2127a + -8? 21272 In base 16, what is 14f - -2e3? 432 In base 2, what is -100010000010110011 - 1110? -100010000011000001 In base 3, what is 1112212022 + 11102? 1120000201 In base 15, what is -5 + 243e? 2439 In base 2, what is 10010010110100101001 - -1? 10010010110100101010 In base 16, what is 636 + -43? 5f3 In base 14, what is 15246 + 2? 15248 In base 3, what is 12012210121 - 1? 12012210120 In base 15, what is -9c - 1e0? -28c In base 4, what is -2 - 1233323? -1233331 In base 9, what is -2 - 233165? -233167 In base 12, what is -76513 - 1a? -76531 In base 16, what is -1 - cd94? -cd95 In base 14, what is -5 - -3aac? 3aa7 In base 7, what is -3 + 236533? 236530 In base 3, what is 12121202010 - -2? 12121202012 In base 10, what is -4 - 291683? -291687 In base 13, what is -16	{ "pile_set_name": "DM Mathematics" }
3m + 186q - 1756 - 308, 3q - 4q - 13 = -4m for m. 6 Solve -54o + 4v + 193 = -55o + 209, -4o - 4 = -v for o. 0 Solve -154z - 4r - 71 = -16z + 339, 30r - 33r = 2z + 3 for z. -3 Solve 4d - 9830s = -9869s - 293, 5d = s - 18 for d. -5 Solve 4w - 169 = 5t, -t - 246 + 40 = -5w for t. -1 Solve -5o - 87 = 6d, -270d = -2o - 274d - 62 for o. 3 Solve -3755s + 3753s = 5a + 142, 15s = 4a - 1148 for s. -76 Solve -2r - 215 = -71v, -20v - 15v + 45v - r = 13v - 8 for v. 3 Solve -j - 26c = -21c + 11, 5j + 11c = -10c - 47 for j. -1 Solve -5t = -4p - 38, -8034 + 8049 = -5p - 10t for p. -7 Solve 11m = 7j - 10j - 110, 5m - 7j + 3j - 68 = 0 for m. -4 Solve f + 3y - 1 = 2y, -9f + 59y = 111y - 54y + 24 for f. -2 Solve 0 = 3a + 12q - 12, 2q + 525 = 4a + 545 for a. -4 Solve -10s - 4 = 5b + 56, 3b + 27 + 19 = -3s + 13 for s. -1 Solve -5b - 3 = 2q, 5b - 9q + 10 + 14 - 10 = 0 for b. -1 Solve 15 = -5d + 5k, -8d + 5k = 167 - 149 for d. -1 Solve -242930h = -c - 242921h - 78, -109 = 3c - 2h for c. -33 Solve 31922i - 31920i = -14k - 476, 0 = -5k - 170 for i. 0 Solve -21s = -4b - 93, -2b - 19 = 7s - 12s for b. 3 Solve 0 = -4t - 54z + 53z, -5z + 3 + 3 = -6t + 6 for t. 0 Solve -p - j = -6p - 64, 60p + 108 = -15p + 71p + 15j for p. -12 Solve -2l - 3l - 21 - 8 = 1, 0 = 26a + 5l + 108 for a. -3 Solve 15 = 5i - 11p - 18, 119p + 9 = -3i - 0i + 116p for i. 0 Solve -h = -2s - 1068 + 1055, 0 = 3s - 3h + 12 for s. -9 Solve 282063 = -5n - 7q + 281998, -n + 2q + 4 = 0 for n. -6 Solve 2t = -5x - 112, 48t + 1 = 238x - 237x - 25 for t. -1 Solve -30 = -4o - 6l + 9l + 15, 19o + 30l - 156 = 25l for o. 9 Solve -1368t + 1369t - 8c = -48, -5c = -t - 0c - 42 for t. -32 Solve v - 2p + 195807 = 195804, 0 = 2v - 5p + 4 for v. -7 Solve -150 = 180j - 177j + 3c, 0 = 3j - 14c - 293 + 10 - 349 for j. -4 Solve -6 = 2j + 5s, 1887s - 1890s = 9j - 51 for j. 7 Solve -536b - 108 = -540b + y, -b + 0b + 50 = -6y for b. 26 Solve 39p + 3a = 410 + 28, 5p - 40 = 5a for p. 11 Solve -5l + 565i - 4 = 567i, -l - 2 = i for l. 0 Solve -6o = 2v + 16, 1098o - 1103o - 2v = 12 for o. -4 Solve z + 2p - p - 7p + 7 = -5p, 2z = -p + 4 for z. -1 Solve 0 = -66m - 5g - 2442, 2m - 262 = -3g - 836 + 257 + 243 for m. -37 Solve -4x - 2p + 0p = -4, -592 = -4x - 112p + 292 for x. -3 Solve 4g = 3w - 154, 10534w + 186 - 37 = g + 10537w for g. -1 Solve -91 = 23p + y, -9121y = 5p - 9130y + 29 for p. -4 Solve -5w + 7w - 8 = 0, -4z + 2z - 4w = 9 - 29 for z. 2 Solve -5q - q = -10q - 0m + 5m + 23, -4q - 56m - 404 = 0 for q. -3 Solve 4b = -4b + 6b + 2c - 8, -448 = 58b + 14c for b. -7 Solve -609j + 8 = -1214j + 606j - 3p, -15j + 164 = -p for j. 11 Solve 71j - 68j = 856m + 5130, -5j - 20 = 5m + 20 for j. -2 Solve 11 = -5p + d - 27, 120p + d - 78 = 246p - 129p for p. 5 Solve -2r + 4r - 24 = 17j, 3j + 15r - 12r = -21 for j. -2 Solve -3b - 17 = -5b + b - x, 4x + 179 = 9b for b. 19 Solve -p - 2p = -25r - 0p - 7p - 165, -3r + 67 = -2p for r. -1 Solve g - 30384 + 30355 = d, g = -4d - 106 for g. 2 Solve -5a - 8092c + 15 = -8115c, -3a - 5c = -9 for a. 3 Solve 3w - 22 = -2g, -2g + 105w + 38 = 110w for g. -1 Solve -120u - 40 = -130u + 4j, 3u - 17 = -3j + 26 - 31 for u. 4 Solve -5d + 45 = -5q, 3d + 5q = -1598 + 1553 for d. 0 Solve -3t = -35n + 71n + 192, -7t + 5n = 181 for t. -28 Solve -5c + 4c = 9 - 8, 75c - 166 = 5u - 11 for u. -46 Solve -3p + 455m - 452m + 45 = 0, -33p + 154 = -2m for p. 4 Solve 3x = -j + 2 - 6, -6j + 11j + 32x + 102 = -24x for j. 2 Solve -m - 67b + 32 = -60b, -139 + 41 = -2m + 3b for m. 46 Solve 4y - 2u = -20, 93331 - 93357 = -2y - 2u for y. 1 Solve 960 = 15i, 0 = -72755z + 72757z + 2i - 138 for z. 5 Solve -607r + 606r + 3i = 44, 11r = 4i - 49 for r. 1 Solve 99d - 199d + 102d + 18 = 2p - 50, -5p + 139 = -4d for d. -31 Solve 4d - 76 = 0, -4r + 10r - r - 3d = 2d - 80 for r. 3 Solve 3r + 27 = 11k + 109, 9k - 7k - 4r = -46 for k. -5 Solve -27w + 20 = 5j - 13w - 11w, 2w - 3w = -5w + 20 for j. 1 Solve 0 = 19m - 4b - 669, -6162m + 6160m + 3b + 73 = 0 for m. 35 Solve i - 6i = m + 13, m + 295244i = 295245i - 1 for m. -3 Solve 5n + 2p - p = -4, -356n + 339n + 62 = -5p for n. 1 Solve -2h - 432 + 445 = -k, 4h - 4k = 24 for h. 7 Solve 819 - 831 = 4t, -3t - 13 = q for q. -4 Solve 4y + 4f = -20, 7f - 4f = 2y - 13f - 44 for y. -2 Solve 109x - 1109 = -3z - 1548, -3z + 17 = -5x for x. -4 Solve 136 = 5b - 2j, -18j - 23j = 3b - 38j - 69 for b. 26 Solve -w - 265170c + 13 = -265175c, 0 = w + c - 1 for w. 3 Solve -2s - 21 = -3z + 2s + 23, 6z + 4s + 1 + 7 = 0 for z. 4 Solve 4q = 330d - 326d - 56, q + 139 = 26d for d. 5 Solve -7b + 6b + 40d - 1 = 10b - 9, -2b - d = b - 26 for b. 8 Solve -3j = -4u - 22 - 17, 127u = 131u + j + 35 for u. -9 Solve 270495x - 270497x + 2j = 2, 11j + 6 = -5x - 31 for x. -3 Solve 8w - f = -3w + 31, -3f = -45w + 48w - 87 for w. 5 Solve -6i = -4l - 200, -326i + 325i + 4l + 10 = -10 for i. 36 Solve 51999s + 42 = -11w + 51996s, 4s - 3 = 3w + 2w for w. -3 Solve 5h = q + 5, 54072q - 4h - 2 = 54070q for q. 5 Solve -4c + 119g - 715 = -5c, -4g - 1 = -3c + 3 - 16 - 9 for c. 1 Solve 0 = -a + u - 17, -4u + 88 = 13a + 39a - 51a for a. 4 Solve -2l = -24k + 6l - 11l - 66, -l - 2l - 122 = -4k for k. 2 Solve -5s + 0s + 400 = 6d, s - 32d + 34d - 186 = -54 for s. 2 Solve 30j = 5q - 80, j + 11416q + 6 = 11417q for j. -2 Solve -t - 12a = 869, 1078 = 5t - 3a + 528 + 359 for t. -5 Solve -2h = 2v + 17h + 28, 15v - 11v + 5h - 10 = 0 for v. 5 Solve 3m = s - 103, -76987m = -76989m - 3s - 65 for m. -34 Solve -4v + 3529 = x + 3567, -5v - 18x = -x + 394 for v. -4 Solve -z - 9t + 18 = 41, 0 = z - 3t - 1 for z. -5 Solve -4d + 3j - 4j = 0, -2d + 3d = -d + 53j + 642 for d. 3 Solve -2v - 6108w = -6107w + 5 - 3, 44 = -0v + v - 7w for v. 2 Solve -2b + 6010 = -5u + 6066, 2b = -15u + 184 for b. 2 Solve 17h - 4o + 298 = 0, -25o = -4h - 46o + 23o - 68 for h. -18 Solve -3y - 3u + 3u + 0u + 189 = 3u - 66, -4u + 12 = 0 for y. 82 Solve -584718y + 584719y - 7 = l, 5y = 8l + 35 for y. 7 Solve -15m + 2 = r, -4 = -3r + r - 0r - m for r. 2 Solve 2p + 2p - 64 = -v - 3v, 2620117p = 2v + 2620120p - 35 for v. 13 Solve -2q + 10a + 30 = 0, 4q = 227a - 226a - 16 for q. -5 Solve -240 = -30v + 2155i - 2154i, 0 = 32v - 3i - 256 for v. 8 Solve -5z - 37 = 9s, -567212z = -2s - 567207z + 4 for s. -3 Solve 1098s + g = 1095s + 2 + 3, g + 32 = 5g for s. -1 Solve -6 = 2d + 2f - 0, -5f = -15d + d - 137 for d. -8 Solve -5a - 23l = 114 - 2, -a - 2a - 2a = 5l + 40 for a. -4 Solve 4m - 12350 + 12308 = 7v, -4m + 36 = -4v for v. -2 Solve 13m = 77m - 4p - 152, -5p - 46 + 32 = 55 + 41 for m. 1 Solve -5t + 43990 = 5c + 43935, 0 = -t - 5c + 7 for t. 12 Solve f - 3c + 4c - 27 = 5c, -3c - 30 = 128f - 119f for f. -1 Solve -2y = -0y - 0y - y - 3, -3x - 24y - 194 + 53 = 0 for x. -71 Solve 110 = -2q - 6c, 7702745q + 3c + 287 = 7702740q for q. -58 Solve -5l = o - 99 + 87, -5o + 7l = 5l + 21 for o. -3 Solve 5t - 355k = -358k - 22, 3k = -2t - 16 for t. -2 Solve -5s = 178673j - 178671j + 6, -7j + 18 = -2s for s. -2 Solve -7189m = 2j - 7187m - 12, 3m - 18 = 5j for j. 0 Solve -245y + 122y + 118y + 48 = 3a, a = -4 for y. 12 Solve -5p = w + 72, 447 = -77309w + 77304w + 4p for w. -87 Solve -2732l - o - 2 = -2734l, -o - 2 = 5l for l. 0 Solve 4g + 11f - 11f = -4f + 4, -4g + 13 = f for g. 4 Solve -5t - 60 = -5r, 42 = 1775r - 1771r - 2t for r. 9 Solve 3b + 2b - 29 = -0b - 2u, -5b + 33 = 26u - 22u for b. 5 Solve 0 = -14u - 6z - 92, -110z + 106z = -4u + 88 for u. 2 Solve 7i - 3g - 34 = 5i - 53, -g + 9 = -2i for i. -2 Solve -56 = -17k - 4l, -k - 17168l + 16 = -17172l for k. 4 Solve -5d + 5i = 2i - 61, -5d = 144i - 128i - 23 for d. 11 Solve 17u + 3h - 486 + 546 = 0, 12 = -4h for u. -3 Solve 5a - a - 611n + 22 = -606n, a - 14 = -13n - 10 - 38 for a. -8 Solve	{ "pile_set_name": "DM Mathematics" }
). Let y(v) = bz(v) + w(v). Let d be y(-6). What is the highest common divisor of 36 and d? 12 Let s be (-1 - -2) + (48 - 1). Let w(k) = 8k*2 + 38k*3 - 3k + 0k - 57k*3 + 18k*3. Let f be w(3). Calculate the greatest common divisor of f and s. 12 Suppose -6d + 1970 + 2206 = 0. Suppose 5i - d = i. Suppose -2y = -4u + i, -5y - 90 = -2u + 9. Calculate the highest common divisor of 42 and u. 42 Let h(g) = -g3 + 11g2 - g - 40. Let a be h(10). Let s(x) = x2 - 52x + 163. Let c be s(a). Calculate the highest common factor of c and 7. 7 Let c be 35 + -1 + -28 - (1 + -413). What is the highest common factor of c and 110? 22 Let u(x) = 4x3 - x2 - 4. Let r be u(0). Let h be -3(7 + -5)r. Let d = 127 + 41. What is the highest common factor of h and d? 24 Let n be -7 + (1 - -24) + 6. Calculate the highest common factor of n and 9736. 8 Suppose 0 = 3m - 3n - 1557, -3m = -2n - 1136 - 422. Suppose -f + m = 376. Calculate the highest common divisor of f and 18. 18 Let r be (66/(-55))/(1 + (-313)/310). What is the greatest common divisor of r and 1209? 31 Let q(t) = t*2 + 2t - 7. Let w be q(-8). Suppose -574 = -21i + 7i. Calculate the greatest common factor of i and w. 41 Let y(v) = -611v - 2388. Let c be y(-4). What is the highest common divisor of c and 3962? 14 Suppose 225590 - 39119 + 233733 = 114n. Calculate the greatest common factor of n and 38. 38 Let r = 21 + 140. Let t = 29 - -19. Let l be t/2 + (-10 - -9). What is the highest common factor of r and l? 23 Let y(l) = 13l + 4198. Let u be y(64). What is the greatest common divisor of u and 10? 10 Let h = 69 + -45. Let x(c) = c3 + 6c - 2. Let o be x(5). Let p = -145 + o. What is the greatest common factor of h and p? 8 Let o = -37 - -73. Let x = 16170 - 16140. Calculate the greatest common divisor of o and x. 6 Let g(z) = -760 + 8z2 + 758 + 13z + 38z. Let s be g(-7). Calculate the greatest common divisor of s and 242. 11 Suppose -470 + 126 = -4h. Let k = h - 43. What is the highest common factor of k and 43? 43 Let m be 9/(-75)(-4 - -9) + 268401/35. What is the greatest common divisor of m and 4686? 426 Suppose 17f - 13f = 200. Suppose -4y + 524 = -4p, -4p = -5y - f + 706. Let l = y - 104. Calculate the highest common factor of 252 and l. 28 Let v = 801 + -857. Let j be -14(584/v - -9). What is the highest common divisor of 270 and j? 10 Let f(p) = -2p2 + p + 36. Let t be f(0). Let m(g) = -6g + 328. Let q be m(t). Calculate the highest common factor of q and 7. 7 Let g(q) = 44q2 - 8q - 2. Suppose -17d = -14d + 111. Let p = d - -34. Let t be g(p). Calculate the highest common divisor of 38 and t. 38 Suppose -5w = p - 75, -77 = -p + 2w - 5w. What is the greatest common divisor of 16 and p? 16 Let k = 3470 + 303. What is the highest common divisor of k and 66? 11 Let r be 5/(-30) + 62/12. Let a be ((-6)/(-5))/(3/r). Let z be -1 + (-50)/(-5) + a. Calculate the highest common factor of z and 99. 11 Let q(n) = n3 + 21n*2 + 62n - 352. Let y be q(-14). What is the highest common factor of y and 16? 8 Suppose 70c - 176c + 79344 = -77c. Calculate the greatest common divisor of c and 57. 57 Let x be -10 - -7 - (4 - (5 + -3)) - -241. Calculate the greatest common divisor of x and 20. 4 Suppose -1836 = 363d - 380d. Calculate the greatest common divisor of d and 3564. 108 Suppose 3q + 374 = 5g + 23, -4q = 4g + 436. Let f = q + 113. What is the greatest common factor of f and 11? 1 Let v = 4946 + -4810. What is the greatest common factor of v and 799? 17 Let i(r) = -r2 + 24r + 122. Let t be i(36). Let z = t + 334. Calculate the greatest common divisor of 200 and z. 8 Let o(s) = -11s - 8s + 69s2 + 14s - 5 + 19s2. Let d be o(-2). What is the greatest common divisor of 102 and d? 51 Let n(g) = -225g + 390. Let w be n(-14). What is the greatest common divisor of 12 and w? 12 Suppose 62u - 233 - 56 = 621 - 166. Let p = -14 + 34. Calculate the greatest common factor of u and p. 4 Let i = 114 - 105. Let b be (79 - 43)/(1/2). What is the greatest common factor of i and b? 9 Let h = 9689 + -9560. What is the highest common factor of 5805 and h? 129 Suppose 0 = -3b + 5x + 245, -x + 241 = 3b - 2x. Let h = 430 + -382. What is the greatest common factor of b and h? 16 Let t be 2/(-4) + (-21)/(-6). Let f be (-72)/(-108) + 2 + 2296/t. Calculate the greatest common divisor of f and 12. 12 Suppose 125 = 5b - 45. Let r(z) = z*3 + 29z*2 - 5z - 139. Let g be r(-29). Calculate the highest common factor of b and g. 2 Suppose 4v + 2p - 578 = 0, -p + 2 + 1 = 0. Let m = -92 - -93. Let g be 16 + -20 + 17m. Calculate the greatest common factor of g and v. 13 Let f(g) = 37g*2 + 103g - 1057. Let x be f(19). What is the greatest common divisor of x and 53? 53 Suppose y - 2q - 140 = 0, 19q + 141 = y + 16q. Calculate the greatest common divisor of y and 1863. 69 Let t be ((-160)/(-24))/(5/3 - 1). Let m = t - -42. Suppose g + 4s - 71 = m, -s = 5. Calculate the highest common divisor of 13 and g. 13 Suppose -555x + 550x = -3620. Let m = x + -625. What is the highest common factor of m and 55? 11 Suppose -23b = -114775 + 21142. Calculate the highest common divisor of b and 354. 177 Let l(r) = r3 + 15r*2 + 53r - 4. Let c = -605 + 597. Let z be l(c). What is the highest common divisor of 120 and z? 20 Suppose -62j = c - 59j - 18, -c + 28 = -2j. Calculate the greatest common factor of 48 and c. 24 Suppose 8s = -15s + 35849 + 26182. Calculate the highest common factor of 1023 and s. 93 Let c be (-3760)/(-60) + (-1)/(-3). Let y be (3444/c)/(((-12)/45)/(-2)). What is the highest common factor of y and 10? 10 Let c be 10/(-7)(20 + -62). Suppose -11r + 28 = -c. Calculate the greatest common divisor of 376 and r. 8 Let h = 18725 + -18699. What is the greatest common factor of h and 388? 2 Let b be (-2)/8 + (17622/88)/1. What is the greatest common divisor of 1900 and b? 100 Let b = 8596 - 7516. Calculate the highest common factor of b and 40. 40 Let c(t) = -2t + 10. Let m be c(9). Let o be 138/(m/(-3) + -2). Let d = -6099 - -6122. What is the highest common factor of d and o? 23 Let k = 91 + -11. Suppose -4y + k = -0y. Suppose -30a + 1131 = -437 + 68. What is the greatest common factor of a and y? 10 Let q = 20 - 20. Suppose q = 4r - 6r + 328. Let u = 90 - 49. Calculate the greatest common factor of u and r. 41 Let o(d) = d3 + d2 - 83d - 4. Let b = 155 + -146. Let p be o(b). Calculate the highest common factor of 177 and p. 59 Let m = -194 + 202. Let r(t) = 2t3 - 9t2 + 38 - 54 - t3 + 11t. Let s be r(8). Calculate the greatest common factor of m and s. 8 Suppose -a + 69 = 2k, -22a = -2k - 18a + 54. Calculate the greatest common divisor of 2431 and k. 11 Let o(g) = -16g + 64. Let f be o(2). Let c = -18 + f. Calculate the highest common divisor of c and 434. 14 Let s be 4 + 92/(-24) + ((-20944)/96)/(-11). Calculate the highest common divisor of s and 9140. 20 Let w(c) = -1811c + 3784. Let z be w(2). What is the highest common divisor of 3474 and z? 18 Let k be (-3 + 2)/((-1)/5). Suppose 4b = 37b - 1782. Suppose 141 = kh - b. Calculate the greatest common divisor of h and 26. 13 Suppose -4s + 9x = 5x - 864, -4x = 8. Let f = 33 + s. Calculate the greatest common divisor of f and 38. 19 Suppose 3p + 246 = 4f - 396, -5p - 328 = -2f. Let y = 289 - f. Calculate the greatest common divisor of y and 52. 26 Suppose -8k + 10k = -3z + 556, 2k = z - 164. What is the greatest common divisor of 1810 and z? 10 Let z be (1784/15)/8 + 8/60. Let m be 2(z/10)/(-4 + 7). Calculate the highest common divisor of 1 and m. 1 Let n(a) = -11a - 2. Let d be n(-10). Suppose -3c = -21 - d. Suppose -41 = -2m + c. Calculate the highest common divisor of m and 105. 21 Suppose -3c = -b + 119, b - 2c + 270 = 3b. Suppose -b + 83 = 3o. Let f = 48 + o. What is the greatest common factor of 96 and f? 32 Let y(j) = 2j3 - 35j*2 + 20j + 8. Let x be y(17). Let m = x + 21. Calculate the greatest common divisor of 100 and m. 20 Let v = 12775 - 9112. Calculate the highest common divisor of 165 and v. 33 Suppose b = q + 3q + 12, -4b + 2*q + 34 = 0. Let j = -57877 + 58109. What is the greatest common divisor of j and b? 8	{ "pile_set_name": "DM Mathematics" }
PM and 6:45 PM? 158 What is 373 minutes before 12:35 PM? 6:22 AM How many minutes are there between 8:33 AM and 6:09 PM? 576 What is 344 minutes after 9:48 PM? 3:32 AM What is 504 minutes before 6:00 PM? 9:36 AM How many minutes are there between 7:53 AM and 7:52 PM? 719 What is 321 minutes before 2:59 AM? 9:38 PM How many minutes are there between 3:45 PM and 11:58 PM? 493 How many minutes are there between 8:53 PM and 1:05 AM? 252 What is 406 minutes after 9:36 PM? 4:22 AM What is 702 minutes before 7:35 PM? 7:53 AM How many minutes are there between 2:27 AM and 4:52 AM? 145 What is 387 minutes after 1:46 PM? 8:13 PM How many minutes are there between 5:10 AM and 5:52 AM? 42 How many minutes are there between 7:33 AM and 8:17 AM? 44 How many minutes are there between 6:48 AM and 3:13 PM? 505 How many minutes are there between 8:51 AM and 4:56 PM? 485 How many minutes are there between 3:53 AM and 6:45 AM? 172 How many minutes are there between 7:30 PM and 4:18 AM? 528 How many minutes are there between 12:18 AM and 10:27 AM? 609 What is 173 minutes after 4:51 AM? 7:44 AM What is 466 minutes after 4:36 AM? 12:22 PM What is 672 minutes after 1:24 AM? 12:36 PM What is 318 minutes after 2:25 PM? 7:43 PM How many minutes are there between 3:48 PM and 3:03 AM? 675 How many minutes are there between 11:44 AM and 8:32 PM? 528 How many minutes are there between 1:50 PM and 12:31 AM? 641 How many minutes are there between 6:59 PM and 12:31 AM? 332 What is 589 minutes after 8:26 AM? 6:15 PM What is 110 minutes before 8:54 AM? 7:04 AM What is 101 minutes before 4:02 PM? 2:21 PM What is 576 minutes before 8:41 AM? 11:05 PM How many minutes are there between 4:25 AM and 3:40 PM? 675 What is 101 minutes after 9:42 PM? 11:23 PM What is 295 minutes before 5:44 AM? 12:49 AM How many minutes are there between 10:40 PM and 10:39 AM? 719 What is 459 minutes before 5:34 AM? 9:55 PM What is 418 minutes before 1:47 PM? 6:49 AM How many minutes are there between 9:31 AM and 11:07 AM? 96 How many minutes are there between 4:40 PM and 1:01 AM? 501 How many minutes are there between 9:28 AM and 10:12 AM? 44 What is 332 minutes after 11:37 AM? 5:09 PM How many minutes are there between 6:24 PM and 5:05 AM? 641 What is 291 minutes before 3:51 PM? 11:00 AM What is 90 minutes after 5:43 PM? 7:13 PM How many minutes are there between 1:39 PM and 6:18 PM? 279 How many minutes are there between 9:12 PM and 2:07 AM? 295 How many minutes are there between 12:05 PM and 5:32 PM? 327 How many minutes are there between 2:50 PM and 7:46 PM? 296 How many minutes are there between 8:09 AM and 4:43 PM? 514 What is 636 minutes before 1:34 AM? 2:58 PM What is 652 minutes after 5:07 PM? 3:59 AM What is 89 minutes after 6:29 PM? 7:58 PM What is 693 minutes before 5:48 AM? 6:15 PM How many minutes are there between 2:40 PM and 5:05 PM? 145 How many minutes are there between 6:25 AM and 1:06 PM? 401 What is 77 minutes before 5:18 AM? 4:01 AM How many minutes are there between 4:16 AM and 7:11 AM? 175 How many minutes are there between 9:36 PM and 1:46 AM? 250 How many minutes are there between 7:33 AM and 10:11 AM? 158 What is 719 minutes before 6:56 PM? 6:57 AM What is 458 minutes after 7:40 AM? 3:18 PM How many minutes are there between 10:41 PM and 7:40 AM? 539 How many minutes are there between 3:57 PM and 3:24 AM? 687 How many minutes are there between 12:25 AM and 3:42 AM? 197 How many minutes are there between 8:53 AM and 2:21 PM? 328 How many minutes are there between 12:47 PM and 11:52 PM? 665 What is 618 minutes after 10:41 AM? 8:59 PM What is 320 minutes after 6:37 AM? 11:57 AM What is 394 minutes after 3:14 AM? 9:48 AM What is 12 minutes after 4:52 PM? 5:04 PM How many minutes are there between 5:16 PM and 8:09 PM? 173 What is 97 minutes after 1:25 PM? 3:02 PM How many minutes are there between 10:22 AM and 10:17 PM? 715 What is 448 minutes before 9:15 PM? 1:47 PM What is 582 minutes after 7:39 PM? 5:21 AM What is 582 minutes after 4:14 PM? 1:56 AM How many minutes are there between 3:46 PM and 1:27 AM? 581 How many minutes are there between 2:09 AM and 1:12 PM? 663 How many minutes are there between 5:57 PM and 5:37 AM? 700 How many minutes are there between 7:05 PM and 10:48 PM? 223 What is 386 minutes before 6:29 AM? 12:03 AM How many minutes are there between 8:29 PM and 1:44 AM? 315 How many minutes are there between 9:29 PM and 9:31 PM? 2 What is 675 minutes before 3:53 AM? 4:38 PM How many minutes are there between 9:25 AM and 2:04 PM? 279 How many minutes are there between 8:57 AM and 11:04 AM? 127 What is 612 minutes after 9:22 PM? 7:34 AM How many minutes are there between 10:45 AM and 5:39 PM? 414 How many minutes are there between 3:31 PM and 1:23 AM? 592 What is 505 minutes before 8:08 AM? 11:43 PM What is 474 minutes before 6:25 PM? 10:31 AM How many minutes are there between 1:23 PM and 9:36 PM? 493 What is 404 minutes after 3:19 AM? 10:03 AM How many minutes are there between 9:11 AM and 4:15 PM? 424 What is 373 minutes before 8:48 PM? 2:35 PM How many minutes are there between 5:44 PM and 5:48 PM? 4 How many minutes are there between 10:04 PM and 3:58 AM? 354 What is 530 minutes after 9:50 AM? 6:40 PM How many minutes are there between 10:38 AM and 7:36 PM? 538 What is 50 minutes after 10:13 AM? 11:03 AM How many minutes are there between 1:19 PM and 7:13 PM? 354 What is 655 minutes before 1:44 AM? 2:49 PM How many minutes are there between 9:55 PM and 2:25 AM? 270 What is 154 minutes after 9:36 AM? 12:10 PM What is 691 minutes after 8:10 AM? 7:41 PM How many minutes are there between 12:34 PM and 5:13 PM? 279 How many minutes are there between 10:30 AM and 7:39 PM? 549 How many minutes are there between 5:08 PM and 2:07 AM? 539 How many minutes are there between 11:35 AM and 6:38 PM? 423 How many minutes are there between 3:07 AM and 1:23 PM? 616 What is 568 minutes after 8:18 AM? 5:46 PM What is 643 minutes before 7:45 PM? 9:02 AM What is 300 minutes after 9:31 PM? 2:31 AM How many minutes are there between 8:37 AM and 11:12 AM? 155 What is 444 minutes before 2:49 PM? 7:25 AM How many minutes are there between 6:55 PM and 6:49 AM? 714 What is 644 minutes after 10:06 PM? 8:50 AM How many minutes are there between 6:06 PM and 12:48 AM? 402 How many minutes are there between 7:43 AM and 6:40 PM? 657 How many minutes are there between 2:16 PM and 5:40 PM? 204 What is 672 minutes before 3:43 AM? 4:31 PM How many minutes are there between 1:57 AM and 9:00 AM? 423 How many minutes are there between 7:37 PM and 9:24 PM? 107 What is 643 minutes after 7:46 PM? 6:29 AM How many minutes are there between 12:21 AM and 2:54 AM? 153 What is 25 minutes after 9:54 PM? 10:19 PM How many minutes are there between 12:45 PM and 7:35 PM? 410 How many minutes are there between 9:11 AM and 12:03 PM? 172 How many minutes are there between 11:24 AM and 5:18 PM? 354 How many minutes are there between 10:12 AM and 1:03 PM? 171 What is 667 minutes after 2:58 AM? 2:05 PM What is 101 minutes before 8:44 PM? 7:03 PM How many minutes are there between 4:42 PM and 4:29 AM? 707 What is 472 minutes after 10:30 AM? 6:22 PM What is 610 minutes after 4:33 AM? 2:43 PM What is 136 minutes before 12:33 PM? 10:17 AM How many minutes are there between 3:58 PM and 3:13 AM? 675 What is 444 minutes after 10:13 AM? 5:37 PM What is 154 minutes before 2:39 AM? 12:05 AM How many minutes are there between 8:58 PM and 8:01 AM? 663 What is 41 minutes before 3:38 PM? 2:57 PM How many minutes are there between 8:17 PM and 1:03 AM? 286 What is 194 minutes before 8:41 PM? 5:27 PM How many minutes are there between 11:31 AM and 6:15 PM? 404 How many minutes are there between 1:07 AM and 4:31 AM? 204 What is 468 minutes after 10:06 PM? 5:54 AM What is 538 minutes after 3:01 AM? 11:59 AM What is 91 minutes before 9:35 AM? 8:04 AM What is 439 minutes before 2:46 AM? 7:27 PM How many minutes are there between 9:17 PM and 5:29 AM? 492 How many minutes are there between 6:25 PM and 12:07 AM? 342 What is 155 minutes after 2:59 AM? 5:34 AM What is 530 minutes after 10:47 PM? 7:37 AM How many minutes are there between 8:35 PM and 12:39 AM? 244 How many minutes are there between 7:45 AM and 12:10 PM? 265 What is 532 minutes	{ "pile_set_name": "DM Mathematics" }
15 = 0, c = -5f - 7. Let j(i) = -2i*2 - 1 + 4i2 + i2 - 13i + i3 + 11i. Is j(f) prime? True Let g(q) = 39q - 30. Let h(z) = -8z + 6. Let v(m) = 2g(m) + 11h(m). Let j(a) = -9a + 6. Let t(c) = -5j(c) + 4v(c). Is t(5) prime? True Suppose 5c + 3 - 43 = -5d, 2d = -4c + 24. Suppose -4f + o = -1713, 1600 = df + 2o - 98. Is f a composite number? True Let p be (7 - -3)(3 + -2). Suppose -5i = 10 + p. Let n(h) = 4h2 + 5h + 5. Is n(i) a prime number? False Suppose 0 = 3l - l + 14. Is 2 + 2 + l + 54 a prime number? False Let c be 1 - (-1 + 5 + -2). Is (25 + -2)-1c a composite number? False Suppose 0 = 3f - 2 - 592. Is -2(-1)/2 + f a composite number? False Suppose g - 714 = -4i, -3i - 3g + 693 = 162. Let l = i + -15. Suppose 3s - l = 469. Is s a composite number? False Suppose -l + 267 = 2l. Is l a composite number? False Let t = 91 + 23. Suppose -4y + 5l = -2 - 141, -3y - 3l = -t. Is y composite? False Suppose 1683 + 6372 = 15r. Is r prime? False Suppose -43 = 3l - 3f - 13, 0 = -4l + 3f - 38. Let y(g) = -g3 - 7g*2 + 5g - 10. Let v be y(l). Let x = v - -5. Is x composite? False Suppose 2z - 10 = 2w + 2w, -10 = z + w. Let x(v) = -9v + 2. Let n be x(z). Let f = n - 0. Is f composite? False Let l(x) = 2x2 + 3x + 1. Let o be l(-2). Suppose 7 = -b - s, -2b - os - 39 = -6s. Is (b/(-2))/(6/15) a prime number? False Let l(q) = -8q3 - q2 - 2q - 2. Let x = -2 + -1. Is l(x) prime? True Let l = 11 + -8. Suppose l = -4t - 1. Is (29 - t)2/4 composite? True Let x be (4(-3)/(-4))/1. Is 10(-3 + 1 + x) a prime number? False Suppose o + 34 - 92 = 0. Let a = o - 9. Is a a composite number? True Let k(n) = n2 - n + 7. Let q be k(-11). Suppose -4p + 399 - q = 0. Is p prime? False Suppose 2f + 14 = x + x, -5x - 14 = 2f. Let q = -4 - f. Is (-3)/3(-16 - q) a prime number? True Is 3/(-6)41-4 composite? True Let i(t) = 414t3 + t2 - 1. Let m be i(1). Suppose 4f - 208 - 226 = -5n, m = 4f - 5n. Is f a composite number? True Suppose 40q = 38q + 1802. Is q composite? True Let h(k) be the third derivative of k5/60 - k4/12 + k3 + 2k*2. Is h(4) a prime number? False Let j = -3 - -2. Is (-6)/(-3) - (-32 + j) composite? True Suppose 2q = -7 - 3. Let s(v) = v - v2 - 7 + 1 + v3 - 2v3. Is s(q) a prime number? True Suppose 0r - 5r + 25 = 5p, 2r + 5p - 19 = 0. Suppose -4s = -3l - 3s + 31, 3l - rs = 32. Is l composite? True Let o = -11 + 8. Let x = 0 - o. Is x prime? True Suppose 2n - 1 = 3m + 16, 2 = -3n - m. Is 0 + (-3 - -94)n a prime number? False Let m be -1(0 + (0 - 0)). Suppose 3l = -ml + 99. Is l composite? True Suppose -q - b + 70 + 1348 = 0, -q + 3b = -1406. Is q a prime number? False Let s(b) = 22b*2 + 1. Is s(2) composite? False Let j(i) = 331i*2 + i. Let k be j(-1). Suppose s = 4g - k, -68 + 242 = 2g - 5s. Is g a prime number? False Suppose -3d - 8 = 4. Let c = -2 - d. Suppose -k = 4r + 67 - 214, -2k = cr - 270. Is k prime? True Let a(w) = 7w3 + 2w*2 - 12w + 14. Is a(9) prime? True Let a(y) = -11y - 11. Suppose -3d - 16 = -d. Is a(d) a composite number? True Let l(g) = -2 + 3g - 2g + 5. Let a be 553/77 - 2/11. Is l(a) a composite number? True Let m(r) = -r. Let j(k) = 6k - 12. Let h(a) = -j(a) - 5m(a). Is h(-11) a prime number? True Suppose 2m = -4x + 6, 3m = x - 1 - 11. Let j be (-32)/(-18) - (-8)/36. Suppose 2t + 0t - 3a - 98 = 0, ja - 173 = -xt. Is t a prime number? False Suppose -109 = -3l - y, 2l - 7y - 84 = -2y. Is l prime? True Let u(x) be the second derivative of -3x5/20 - 5x4/12 + x3/6 + 3x2/2 + 8x. Suppose 0b + 4 = -b. Is u(b) composite? True Suppose -3f + f + 982 = 0. Is f a composite number? False Suppose -2z + 3y + 2124 = 0, -z + 0z + 3y + 1059 = 0. Is -2 - (-3)/(9/z) composite? False Let w(k) = 65k2. Let p be w(1). Let v = 105 - p. Suppose y + t = 4y - 35, -2y + v = -4t. Is y prime? False Let c be 2/(-4)(-428 - -6). Let f = -84 + c. Is f a prime number? True Let f(w) = -w3 - w2 - 1. Let n(p) = -4p*3 + 6p*2 - 17p - 17. Let s(c) = 5f(c) - n(c). Is s(-13) prime? False Is (912/2 + -4)/2 prime? False Let o(u) = u3 + 23u*2 + 21u + 17. Let b be o(-22). Let t = 57 - -15. Suppose 0 = -y - 4h + b, -4y + 3h = -t - 46. Is y composite? False Suppose 0 = -2l - 0l - 4n + 166, 4l - 5n - 293 = 0. Is l a prime number? False Suppose 7p = 3p + 2y + 14, -17 = -4p + 5y. Suppose 4w - 5k = 34 + 2, 0 = pk. Is w a prime number? False Suppose 0u + u = 44. Suppose 0 = -k - 7 + u. Is k a prime number? True Let o(x) = -2x*2 - 2x - 1. Let n be o(-2). Let b(w) = 7 + 2w + 0w + 2w + 2w2 - 2. Is b(n) prime? False Let k = 150 - 97. Is k a prime number? True Let r = 11 - 6. Let j be (-2)/r + 994/10. Let b = j - 22. Is b composite? True Let q = 2246 - 1107. Is q a composite number? True Let r = -759 + 1178. Is r prime? True Let h(g) = g2 + 2g - 3. Let x be h(-3). Suppose x = l - 8 + 63. Let j = 108 + l. Is j a composite number? False Suppose -2i + 420 = 2g, -1053 = -5i - 5g + 3g. Is i a prime number? True Suppose 4f = -3l + 2l + 17, 0 = -3l + f + 64. Is l prime? False Suppose 3j + 2c = -c + 744, -j + 244 = 5c. Is j composite? True Let w be (698/3)/(2/(-3)). Let y = w - -494. Is y prime? False Suppose -2i - c = 11, -5c - 1 - 24 = 0. Let r be (-7)/(-3)(-45)/i. Let p = r + -13. Is p composite? True Suppose 2u = 4u - 78. Is u a prime number? False Let o = 7 + -1. Is 195/o(1 - -1) a prime number? False Suppose -2r - 3r = -10. Let h(n) be the third derivative of n6/24 + n5/60 - n3/6 + n2. Is h(r) a composite number? False Let l = 237 - -80. Is l a prime number? True Let d(m) = 2m + 250. Let x be d(0). Let v = x - 123. Is v composite? False Let h be (-2)/(-4) - 3/(-2). Let r = 2 - h. Suppose r = 4k - 60. Is k a prime number? False Is 2/(-8) + (-22345)/(-20) composite? False Suppose -3f = 5c - 3 - 1, 0 = -5f - c + 14. Suppose -fp + 1 = 4. Is p + 5(-1 - -9) prime? False Let y(f) = -4f3 + f2 + f. Let x be y(-1). Suppose 0 = -2d + 5h + 37, -25 = -xh - h. Suppose -d - 75 = -2g. Is g a composite number? False Let d(t) = 0t*3 - 41t3 - t + t2 + 1 - 2 + 0t2. Let x be d(-1). Suppose -2l + 30 = 2o, l - o - x = -l. Is l a prime number? True Let m(k) = 1. Let d(w) = w + 1. Let y(u) = d(u) - 3m(u). Let x be y(7). Suppose 7 = -xp - 8, a = -3p + 22. Is a a prime number? True Let w(t) = 29t - 4. Suppose 0 = -4c + z + 2z + 5, 5z = 3c + 10. Suppose -2v - 1 - 1 = -4i, -4i = cv - 37. Is w(v) prime? False Let b = 4 - -2. Suppose -3n - b = 0, -3k = -k - 4n - 374. Let s = -22 + k. Is s prime? False Let j = 81 + -2. Is j a prime number? True Let s be (-20)/84/(-5). Suppose 0 = -4k + sk + 134. Is k a composite number? False Is 4 - 1647/6-2 prime? False Let z(d) = 9d2 + 5d - 7. Suppose 3k + a = 15, -4k + a = 4a - 25. Is z(k) composite? False Suppose -4l + 10 + 338 = 0. Is l a composite number? True Is (-60)/90(-4242)/4 a prime number? False Let p = 1111 + -792. Is p a composite number? True Suppose 3l - 380 = -2l. Suppose -3o + 4o = -l. Is 0 - (o - (0 - -3)) a composite number? False Let j = 7 - 12. Suppose -6t - 3 = -9t. Is (28 - j) + 1 + t a prime number? False Suppose 0 = -0l - 3l + 2193. Is l a prime number? False Let b = 177 + -50. Let g(a) = -19a*2 + 2. Let z be g(-2). Let m = z + b. Is m a prime number? True Suppose -4j = -4k + j + 767, 0 = 4k - 2j - 782. Let v = k - 129. Is v a prime number? False Let q(a) = -3a - 4. Let z(c) = -c - 1. Let o(r) = -3q(r) + 8z(r). Let i be o(-4). Suppose 0l - 2l + 12 = i. Is l prime? False Is 129/12 + 1/4 prime? True Suppose 5o = 7789 + 8506. Is o a composite number? False Let n = 2 + 0. Suppose 4m - 1060 = -5q, -3m + 1042 = nq + 247. Is m composite? True Let b(m) = 4m*2 + 2m - 1. Let i be b(1). Suppose 475 = -0y + iy. Is y a prime number? False Let h(m) = 52m2 + 3m - 3. Is h(2) prime? True Suppose 5f = 4n - 673, -5f + 0n - 694 = 3n. Let k = 720 + f. Is k a composite number? True Suppose -3i = -9, -2 - 7 = 2j - 5i. Suppose -3a + 73 = 2g - 0g, 5a + jg = 121. Is a a composite number? False Let h(p) = -93p + 10. Let t be h(-10). Suppose 3*o =	{ "pile_set_name": "DM Mathematics" }
ts digit of c? 9 Suppose 5g = -5r + 20, 3g + 27 = 3r + 9. Suppose s + r = -1. What is the units digit of 12/(s/(-33))? 1 Suppose 3096u - 210 = 3089u. What is the units digit of u? 0 What is the units digit of (-9)/(-54) + (-76342)/(-12)? 2 What is the hundreds digit of -5 + (-2 + 1455 - (0 + 2))? 4 Let w(f) = -3f + 27. Let h be w(8). What is the units digit of h - 2 - 1 - -71? 1 Let n(v) = 3 - 10 + 1 - 2v + 3. Let b be n(-4). What is the tens digit of (b/3)/(13/507)? 6 Let p(o) = 34o - 3. Let d be p(2). Let z = d + -29. What is the units digit of z? 6 What is the tens digit of (3 - (-64)/(-2))-1? 2 Let c be ((-546)/(-4) - 3) + (-2)/(-4). Suppose 0 = -3j + 5v + c, -j - v + 48 = 14. What is the units digit of j? 8 Let d be ((-51)/17)/(6/44). What is the tens digit of (-1 - d/18) + 1742/18? 9 Suppose -935 = -15r + 10r. What is the units digit of r? 7 Suppose -62 = 3n + 4q + 60, -2n = q + 83. Let b = 88 + n. What is the units digit of b? 6 Let t(v) = -200v + 39. What is the hundreds digit of t(-4)? 8 Suppose 2p - 424 = 340. What is the hundreds digit of p? 3 Let m be 2(2 - -4)/3. Suppose -mi + 68 = 5n, -i + 16 = i - 2n. What is the tens digit of i? 1 Let m be (-22)/(-1) - (-18 - -21). Suppose -12g + mg - 469 = 0. What is the units digit of g? 7 Suppose -7w + 2770 + 17908 = 0. What is the thousands digit of w? 2 Suppose -t + 9 = -c - c, -5t + 15 = -4c. What is the units digit of ((-66)/c)/((-7)/(-35))? 6 What is the tens digit of 11 + 1412 - (-60)/6? 3 Suppose -36 = -0x - 6x. Let v be (-1)/3 - (-20)/x. Suppose 0q + 15 = vq. What is the units digit of q? 5 Let i = -2168 - -3181. What is the thousands digit of i? 1 Suppose -61 = -x - 2g + 30, 5g = 0. Suppose 0 = -88z + xz - 1044. What is the units digit of z? 8 Let h = -6621 - -12798. What is the tens digit of h? 7 Suppose -4t - 3p + 3284 = 0, -4t - p + 3284 = -0p. What is the hundreds digit of t? 8 Let j(t) = t2 - 7t + 8. Let k be j(4). What is the units digit of (-117 - -1)/k + -2? 7 Suppose 0 = 2s + 1 - 5. Suppose -12 = -4m + sf, -3f = 2m + 5 - 3. Suppose -3h = mc - 50, 0c = 4h - c - 74. What is the tens digit of h? 1 Let n(r) = 10r*2 - r - 23. What is the units digit of n(-5)? 2 Let x(c) = 61c*2 - 21c - 7. What is the hundreds digit of x(3)? 4 Suppose 0 = -r - 7r + 56. Suppose -rz + 0z + 770 = 0. What is the hundreds digit of z? 1 Suppose -1487 = -53t + 48t + 4w, 3t + 2w - 879 = 0. What is the tens digit of t? 9 Suppose 6v = -11v + 34. Suppose -70 = -vh - 3t, -7 = -h + 5t + 28. What is the units digit of h? 5 Suppose 0 = -2z - 5s + 1228, z - 836 + 211 = 3s. What is the tens digit of z? 1 Let x = -139 - -316. Suppose x - 1 = 4z. What is the units digit of z? 4 Let b(s) be the first derivative of 3s*3/2 - 3s*2/2 + 9s + 6. Let k(n) be the first derivative of b(n). What is the units digit of k(1)? 6 Suppose -4s - s + 2l = -54, 0 = -3s - 3l + 45. Let z = 14 - s. What is the units digit of (-3)/z(-60)/18? 5 Suppose 0 = -4b - 3v - 6 + 33, -5b + 30 = 3v. Suppose -h + 104 = 4k, bh - 88 = -4k - 2h. Suppose s - 4 = k. What is the units digit of s? 1 Suppose 28u = -4u + 11456. What is the tens digit of u? 5 Let j(k) = -k3 + 9k*2 - 3k + 30. Let u be j(9). Let d be 5(-1 + 54/10). Suppose -uc = -c - d. What is the tens digit of c? 1 Suppose 0 = -4u - 0u - 5i - 57, 2u - 2i = -42. Let m = u - -13. Let o = 7 - m. What is the units digit of o? 2 Let u(r) be the second derivative of r3/6 + 3r*2/2 + 3r - 8. Let n be -1(0 - 6/2). What is the units digit of u(n)? 6 What is the units digit of 2665/12 + (-40)/480? 2 Let q(a) = a3 - 20a*2 + 4a - 42. Let j be q(20). Let b = 55 - j. What is the tens digit of b? 1 Let a(d) = -d*2 + 8d + 13. Suppose c + l = 4, 3c + 2l - 3 - 13 = 0. Let u be a(c). Suppose -u = 4z - 149. What is the units digit of z? 4 Let g(v) = 768v*2 - 4v + 2. What is the units digit of g(1)? 6 Let g = 34 - 31. Suppose -2f = 2m - 84, -3m + m + 81 = gf. What is the units digit of m? 5 Let y = 10 - 10. Let z be 1((2 - y) + 0). What is the units digit of (12/z)/((-33)/(-44))? 8 Suppose -4l = l, f - 5l - 2 = 0. Suppose -6i = -142 - f. What is the tens digit of i? 2 Suppose -198 = -5o + 222. What is the units digit of o? 4 Suppose -8217 = -31x + 7934. What is the hundreds digit of x? 5 Suppose -162d = -142d - 41020. What is the tens digit of d? 5 Let n(s) = -73s2 - 2s - 1. Let m(k) = 145k2 + 3k + 1. Let t(f) = -3m(f) - 5n(f). Let h be t(-1). What is the units digit of h/(3/(-1))1? 3 Let h(m) = -12m*3 + 13m*2 + 51m + 7. What is the thousands digit of h(-5)? 1 Let j be (0/4)/(0 - 1). Let r = 2 - j. What is the units digit of r + -2 + 1 + 5? 6 Let f(y) = -2y - 13 - 13y + 0y. What is the tens digit of f(-3)? 3 Let c(o) = 14o + 1. Let q(d) = 71d + 4. Let z be (-3)/12 + 86/(-8). Let k(f) = zc(f) + 2q(f). What is the tens digit of k(-2)? 2 Suppose -k + 6 - 4 = 0. Suppose 4s - 136 = q, -ks = 11q - 10q - 68. What is the units digit of s? 4 Suppose -a + 2k - 41 = 0, 147 = -3a + 3k - 5k. Let b = a - 9. Let l = 81 + b. What is the tens digit of l? 2 Let u(r) = -2r*2 - 38r + 2. What is the units digit of u(-14)? 2 Suppose b = 4b. Suppose -3v = 2s - b - 11, -4v = s - 13. What is the units digit of s? 1 Suppose -3x - 2x + 135 = 0. Suppose -l = d - 0l - x, -d + 33 = -5l. What is the units digit of d? 8 Suppose 4g = 58 + 34. Suppose 0 = -26x + gx + 12. What is the units digit of x? 4 Let t(w) = w + 23. Let j be t(-12). Suppose -7y + jy + 112 = 0. Let s = -26 - y. What is the units digit of s? 2 Let o = -4589 - -7390. What is the units digit of o? 1 Let m(d) = 43d*2 - d. Let j be m(1). Suppose c - j = -5u, 0 = -2c - 2u - 14 + 114. What is the tens digit of c? 5 Suppose 3w + 2v = 8426, 13w - 12w - v - 2802 = 0. What is the units digit of w? 6 Suppose 0 = 5p - 12 + 2. Suppose z = 4c, pc = 5z - 35 - 1. Suppose -2m - 3n = 18 - 58, 0 = -4n + z. What is the units digit of m? 7 Suppose 0 = 26l + 38l - 314112. What is the hundreds digit of l? 9 What is the hundreds digit of (-26)/(-65) + (-2366)/(-10)? 2 Let q(l) = 18l + 660. Let p be q(0). Let x = -410 + p. What is the hundreds digit of x? 2 Suppose 15 = -z + 23. Suppose -zy = -5y - 189. What is the tens digit of y? 6 Suppose -3z + 304 - 53 = -5u, -4z + 2u + 344 = 0. What is the units digit of z? 7 Suppose 71h + 3153 = 74h. What is the hundreds digit of h? 0 Suppose -33 - 47 = -5n. Suppose 0 = -5p + 4o + n, 2 = 3o - o. Suppose -pa = -0a - 32. What is the units digit of a? 8 Let n = 25 - 58. Let f be (-44)/n - (-4)/6. Suppose -fv = -2i + 36, -4v = 4i - 111 + 15. What is the tens digit of i? 2 Let w = -507 - -500. Let g(z) = -z*3 - 6z*2 - 4z + 4. Let f be g(-6). Let o = w + f. What is the tens digit of o? 2 Let k = -203 - -206. What is the units digit of k? 3 Let o be 91/(-5) + 1/5. Let t = -7 - o. Suppose -1 = -2f + t. What is the units digit of f? 6 Let y(w) = -19w*3 + 2 - 3w*2 - 4w - 22w3 + 7w*2 + 43w*3. What is the tens digit of y(2)? 2 Let k(s) be the second derivative of -1/20s*5 - 6s + 0 + 5/2s2 + 2/3s4 - s3. What is the tens digit of k(3)? 3 Let n(a) = -a*3 - 4a2 - 1. Let b be n(-4). Let l(u) = -u3 - 9u2 - 11u - 13. Let s be l(-8). Let j = b + s. What is the tens digit of j? 1 Let v(g) = -g*3 + 4g*2 - 2g + 11. Let m be v(4). Let d(c) = 5c2 + 2c - 6. What is the tens digit of d(m)? 4 Let z = 8205 - 4228. What is the units digit of z? 7 Let t(s) be the first derivative of -3s2/2 + 9s - 8. Let q be t(0). Suppose -q = -4m + 15. What is the units digit of m? 6 Let i = 6 - 9. What is the units digit of (4 - (-30)/i)-1? 6 Suppose 2r - 63 = 1493. What is the units digit of r? 8 Suppose 0 = -4y, -3y + 0y - 124 = 4l. Suppose -g + 5 = 21. Let v = g - l. What is the tens digit of v? 1 Let h(x) = 2x*2 + 10x - 9. What is the tens digit of h(14)? 2 Let g(m) = m*2 + 13m - 9. Let h be g(-13). Let f be 0 + -1 + (-16 - h). What is the tens digit of 138/9(-12)/f? 2 What is the units digit of 118 - (9/15 - 6/10)? 8 Suppose -3d - 2h + 2885 = -496, 2d + 3h = 2259. What is the tens digit of d? 2 Suppose -8m - 444 =	{ "pile_set_name": "DM Mathematics" }
c) be the first derivative of c*3/3 + 5c*2/2 + 10c - 1. Is f(g) composite? True Suppose -2d + 1955 - 669 = 0. Suppose -5m + d = -4o, -m - 3m + o + 510 = 0. Is m prime? True Let d = 14 - -1. Let j = d + 98. Is j a prime number? True Let o be (1 + -3)/(2/3). Is ((-2)/(-6))/(o/(-171)) a composite number? False Let k = 240 + 104. Let a = k + 143. Is a a composite number? False Is (27 + -13)2/((-8)/(-106)) composite? True Let j = -21 + 15. Is 62/j(-5 + 2) a composite number? False Let q(g) be the first derivative of -g4/4 - g3 - 5g2/2 + 4g - 3. Is q(-6) prime? False Suppose -4d + z - 1 + 5 = 0, -3z - 12 = 3d. Suppose 3h - 28 - 221 = d. Is h a prime number? True Suppose v - 5x + 166 = 0, 3v + 225 = -3x - 237. Is (-24)/v + (-8498)/(-26) a composite number? True Let x(m) = m3 - 4m*2 + m - 5. Let r be x(4). Is ((-633)/(-12))/(r/(-4)) a prime number? True Suppose 5g = 4p - 2p + 20, -3p = 0. Let v(a) = 2a*3 - 5a2 + 5. Is v(g) composite? False Let o(k) = -k2 - 7k + 10. Let c be o(-8). Let i be ((-4)/2)/(-2)c. Suppose -ib - 82 = -684. Is b prime? False Suppose 4j - 12 = 0, -9 = 3t - 4j + j. Suppose 0 = -tf - 5f + 2515. Is f a prime number? True Let c be (-6412)/(-10) - (-11)/(-55). Suppose 2j + f = c, 5j - 3f - 661 = 3j. Is j a composite number? True Suppose -k = k - 2, 2w - 108 = -2k. Is w a prime number? True Let d(z) = -z*3 - 6z*2 + 3z - 7. Let b be (42/24)/(2/(-8)). Is d(b) composite? True Let g be (2 - 0)/(6/3). Let t be (g8)/(6 - 4). Suppose -47 - 5 = -tz. Is z composite? False Let h(d) = -3d3 + 28d*2 + 3d + 39. Let q(j) = -j*3 + 14j*2 + 2j + 20. Let x(a) = 2h(a) - 5q(a). Is x(-15) prime? True Let t = 6 - 3. Suppose 0 = -w + tw - 382. Is w a prime number? True Is (-1080 + -4)/(-9 - -7) a composite number? True Suppose 5d + 559 = -5w + 1474, -4d - 584 = -3w. Suppose -6o = -2o - w. Is o prime? True Suppose -3x + 4 = -5. Suppose -xi - 75 = -8i. Is i a composite number? True Suppose 5b + 1162 = 7b. Is b a prime number? False Suppose 2x + 352 = 3x. Suppose -4u + x = -464. Suppose g + 2g = 2h + 201, 3g - 3h - u = 0. Is g composite? True Let k(i) = -79i - 5. Suppose -4b + 8 = -2b. Let u be k(b). Is 4/(-10) - u/15 a prime number? False Suppose 0 = 3u + u + 5v - 1642, -3u - 5v + 1229 = 0. Is u composite? True Let w be -1 + 0 - (-3 - -1). Let b(d) = 253d2 - d + 1. Is b(w) a prime number? False Let a = 3 - 1. Suppose 0 = -3r - 2r. Suppose 0k + 232 = 4p - 4k, 4p + ak - 202 = r. Is p a prime number? True Let c(z) = -z - 21. Let b(i) = -7. Let o(j) = -7b(j) + 2c(j). Suppose 0 = 3t + 10 + 8. Is o(t) a composite number? False Let z = 12 + -111. Suppose 3k = 3h - 9, 0 = -k - 2h - h - 15. Is ((-20)/k)/((-6)/z) a composite number? True Let v(u) = -6u + 1. Let q(j) = -j. Let b(t) = 20q(t) + 5v(t). Is b(-7) composite? True Is 2 - (2247/(-27) - 14/(-63)) composite? True Let l = -1549 + 2271. Suppose 5a + 207 = l. Is a composite? False Let f = 10 - 5. Suppose -4h - 140 = -4y, h - 140 = fh - 3y. Let i = 56 - h. Is i composite? True Let l be (0/(0 - 2))/(-3). Suppose lk + 4k = -w + 21, 123 = 3w - 3k. Is w composite? False Let z(j) = 4j2 - 2j*2 - 3j*2 - 1. Let b(g) = -5g*2 + 15g - 1. Let o(u) = -b(u) + 6z(u). Is o(-6) a prime number? False Suppose 5s - 690 = 2k - 2491, 0 = -k - 5s + 908. Suppose -4t + k = -481. Is t a prime number? False Let v(h) = 5h. Let y(d) = -18d + 1 - 4d + 6d. Let i(g) = 7v(g) + 2y(g). Is i(4) a composite number? True Let r be (-1 + (-22)/(-6))-6. Let c be ((-29)/2)/(4/(-8)). Let u = c + r. Is u composite? False Suppose 0 = -9s + 8s + 203. Is s prime? False Suppose 5w + 3 = 28. Suppose 4c + 156 = -y + wy, 4c - 188 = -4y. Is y composite? False Let i(v) = -3v. Let g be i(-2). Is (-635)/(-3) - g/9 composite? False Let i be (24/(-20))/(6/(-15)). Suppose -is + 40 = s. Is s composite? True Let w be ((-8)/(-6))/(4/1188). Suppose -32 + w = 4g. Is g prime? False Let w(o) = 5o3 + 7o*2 + 10o + 10. Let a(l) = 6l3 + 7l*2 + 11l + 11. Let q be ((-12)/(-8))/((-6)/16). Let d(g) = qa(g) + 5w(g). Is d(-5) prime? False Suppose 2x + 5b - 1624 = -362, 5b = -20. Is x a prime number? True Let f be 6/(-4)8/(-6). Suppose -245 = -fs - 3s. Is s prime? False Let m = -112 + 246. Is m a prime number? False Let c be 1 + -1 + (3 - 2). Is (2 - c) + (30 - 0) composite? False Let v(c) = -182c3 - c. Let s be v(-1). Suppose -4j = -s - 157. Suppose -260 = -5a - j. Is a prime? False Suppose 0 = 3g + 2g. Let z be (g - 3)(-108 - 3). Suppose z + 712 = 5l. Is l a prime number? False Suppose -c - c - 6 = 0. Let q be (-1 - c)1 - -11. Suppose 162 = 5d - q. Is d prime? False Suppose 5p = l - 116, 5p + l + 100 = p. Let j = p - -11. Is j(0/2 + -1) prime? True Suppose 9t - 7022 - 1771 = 0. Is t a prime number? True Suppose 83z + 365 = 84z. Is z prime? False Suppose 85 = -5n + 10. Is n/(-5)7/1 a composite number? True Let w(x) = x3 + 7x*2 - x - 9. Let u be w(-7). Let i = u + 4. Suppose -5d - c + ic = -724, 0 = -2d - 4c + 294. Is d a composite number? True Let m(k) be the first derivative of k4/4 - 4k*3/3 - 4k*2 + 6k + 6. Is m(7) a prime number? True Let r(m) = -21m3 - 2m*2 + m - 1. Let o be r(-2). Suppose -o = -2j + j. Is j prime? True Suppose 4g - 5h = -20, -3g + 5h - 12 = 2h. Suppose -4p = -r + 4r - 377, -3r + 5p + 386 = g. Is r a prime number? True Let d be (-2)/3(-5 + 2). Let t be -10(-2)/d13. Suppose 4g = -g + t. Is g a prime number? False Let i be (0/(2 - 1))/1. Is 3(i + 19/3) a composite number? False Let l = 12 + -7. Suppose -lb + 2n = -641, -2b = -b - 4n - 139. Is b a prime number? True Let s(z) = -7z2 + 5z + 19. Let m(r) = -3r2 + 3r + 9. Let v(a) = -5m(a) + 2s(a). Let q = -1 + -4. Is v(q) composite? False Let a = 4 + -7. Let r(j) = j*3 + 4j*2 + 4j. Let m be r(a). Let c = m + 10. Is c composite? False Suppose -6034 = -4j + 10. Is j a prime number? True Let f(v) = 27v*2 - 8v - 3. Is f(6) a composite number? True Let l = 97 - -90. Is l prime? False Let n be 1/(24/(-9) + 3). Suppose 0 = 4z + nh - 228 - 201, 545 = 5z + 2h. Is z a composite number? True Suppose 2i - 10 = -0i. Let g(b) = 65b + 2. Is g(i) prime? False Let y(j) = -j2 + j + 1. Let x(q) = -3q*2 - 3q - 10. Let z(w) = x(w) - 5y(w). Is z(11) a prime number? True Let k(b) = -b + 10. Let w be k(9). Is -1 + 2 - w - -33 a prime number? False Suppose 5r - 2p = 485, -3r = r + 5p - 388. Is r prime? True Suppose 0 = -4v + 7 + 9. Suppose 5n + 4t = -0t + 53, -5n + 77 = -vt. Is n composite? False Let p(l) = -11l + 3. Let r(y) = 4y + 1. Let k be r(-1). Let i be p(k). Let o = i + -26. Is o prime? False Let s = 4437 + -2688. Let g = 2470 - s. Is g prime? False Suppose 0 = w - 5b - 4, 0 = 4w - 0b + b + 89. Let a be (-6)/w - (-298)/(-14). Let q = -10 - a. Is q a composite number? False Let x(w) = -w*3 - 8w*2 + 23w + 45. Is x(-14) composite? True Let x = 12 - 7. Suppose s - 187 = -xw - 0w, -2w = 2s - 78. Is w prime? True Let v = 80 - 45. Is v prime? False Suppose 5b - 3b - 254 = 0. Is b a composite number? False Suppose -9852 = 10w - 14w. Is w a prime number? False Suppose 0 = -k - k + 10. Suppose -l = kg, l = -4l. Is 1 - 64/(g + -1) prime? False Let l be ((-2)/4)/(2/12792). Is (-3)/15 - l/15 a composite number? True Suppose -3z - 2 = -h, 5h + 5z - 20 = 2h. Suppose -hd + 29 - 9 = 0. Suppose df + 7y = 3y + 92, 2y - 109 = -5f. Is f composite? True Let o(q) = -2 + 13q - 1 + 7q. Is o(4) a composite number? True Suppose 3h = -0 - 3. Let d be (4 + -4)h1. Suppose 2j - 7j + 143 = 4r, d = 4r - j - 149. Is r composite? False Suppose -r - 4r = 0. Suppose -5i + 2 + 23 = r. Suppose -ig - 3u = -0g - 77, -4g - 3u + 64 = 0. Is g prime? True Let o be (-10 - -12) + (-8 - 0). Is 411 - -1 - (o - -5) prime? False Let j(s) = -s*3 - 2s*2 + 2s - 2. Suppose 0 = 4i + 5 + 7. Let p be j(i). Is 232/10 - p/5 a prime number? True Let n = -7 + 11. Let x be ((-2)/n)/((-1)/(-14)). Is (-6 - 5)1x a prime number? False Is (4 - 3)3 - -158 a composite number? True Let d = -19 - -9. Let o be (-4)/(-3 + d/(-4)). Is 6/o + 770/8 prime? True Let a be -118(-3 + 2). Let y	{ "pile_set_name": "DM Mathematics" }
. Let w be x(n + 0/1). What is the greatest common factor of 20 and w? 10 Let z(y) = -2y*2 - y + 30. Let q be z(0). Suppose 0 = 6t - 114 + q. What is the highest common divisor of t and 70? 14 Suppose 0 = 27u + 1667 - 16787. Calculate the greatest common divisor of 100 and u. 20 Suppose 39b - 72 - 903 = 0. Calculate the highest common divisor of b and 25. 25 Let m(k) be the first derivative of -k*2/2 - 6k + 3. Let a be m(-13). Suppose -y + 3 = -a. What is the highest common factor of 4 and y? 2 Suppose 4f - f - 4w - 135 = 0, -4f - w + 161 = 0. What is the greatest common factor of 123 and f? 41 Let f = 0 - -372. What is the greatest common factor of 12 and f? 12 Suppose -5o - 4p + 525 = 0, 5p - 244 - 71 = -3o. Calculate the greatest common divisor of o and 90. 15 Let n(y) = -37y - 6. Let l be n(-3). What is the highest common factor of l and 875? 35 Suppose 0 = -3w, -111 = -3q - 0w - 3w. Let j = 136 - q. What is the highest common factor of j and 11? 11 Let c(p) = -4p - 17. Let j be c(-5). Suppose -jh = -381 + 51. Calculate the greatest common factor of h and 10. 10 Let f = 79 - 68. Suppose -2a - f + 147 = 0. What is the highest common divisor of a and 170? 34 Suppose -14f - 270 = -32f. Let j(l) = l3 + 2l*2 - 2l + 1. Let c be j(-2). What is the highest common factor of f and c? 5 Let y(q) = 3q + 13. Let p be y(-3). Suppose -l = -pl + 5o + 268, o = -2. What is the highest common divisor of l and 129? 43 Let o(n) = -n3 + n2. Let u(b) = 101b*3 - 4b*2 + b. Let x(k) = 3o(k) + u(k). Let f be x(1). What is the greatest common factor of 28 and f? 14 Let n(p) = -p*2 - 13p - 11. Suppose -55 = -b + 6b. Let f be n(b). Let w = 158 + -114. What is the highest common factor of f and w? 11 Let g = -14 - -15. Let r be (g93)/(12/8). Let o = -44 + r. Calculate the greatest common factor of o and 45. 9 Let q(o) = 2o2 - 9o + 13. Let c be q(4). Calculate the greatest common divisor of c and 171. 9 Suppose 6p + 2g + 562 = 10p, p - 130 = -3g. What is the greatest common divisor of p and 2? 1 Let b(d) = -d*3 + 5d*2 + 4d + 3. Let j be b(-3). Calculate the greatest common factor of 27 and j. 9 Let r be 9 + 104/(9 - 1). Calculate the greatest common factor of r and 11. 11 Let p be 632/10 + 7/105-3. What is the highest common factor of p and 147? 21 Suppose 0 = -8g + 10g - 320. Calculate the highest common divisor of 20 and g. 20 Let v be ((-60)/(-45))/(2/249). Let r be v - (2 - 0) - 2. Suppose -49 = -10p + 131. Calculate the highest common divisor of r and p. 18 Suppose 4p + 2v = 26, 5v + 8 - 13 = 0. What is the highest common divisor of p and 111? 3 Let y = 1253 - 1099. What is the highest common factor of y and 14? 14 Let r be (80/24)/((-4)/(-3))96. Calculate the greatest common divisor of 45 and r. 15 Let h(p) be the second derivative of -p*4/12 + 17p*3/6 - 5p2/2 + p. Let r be h(16). Let f = r - 8. What is the highest common factor of f and 15? 3 Let r(k) = -k3 + 9k2 - 7k + 12. Let g be r(8). Suppose -3u = -2q + g, 6u - u + 38 = 4q. What is the highest common divisor of q and 35? 7 Let t be (1 - 1)/(-4 - -1). Suppose 4b - 5h - 561 = t, 0 = -3b + 2h - h + 429. Let r = 11 - -5. Calculate the greatest common divisor of r and b. 16 Let k = 1 + 3. Suppose 2s = ks - 4. Let t(y) = 17y2 + 5y + 2. Let q be t(-1). Calculate the greatest common divisor of q and s. 2 Suppose -96917 = -107p + 165340. Calculate the highest common divisor of 129 and p. 129 Suppose 11 + 25 = 3l. Let b(i) be the first derivative of -53i2/2 + 14i - 26. Let k be b(-2). Calculate the highest common divisor of l and k. 12 Let l(w) = w*3 - 5w*2 - 6w - 5. Let x be l(6). Let t be (-1)/(0 - (-1)/x). Let q be (-20)/(-8) - 10/20. What is the greatest common divisor of q and t? 1 Suppose -174t + 178t = 88. Calculate the greatest common factor of t and 8. 2 Let r be (1 - (1 + (-42)/(-98)))1-7. Let n = 0 + 1. Let z(g) = 26g + 1. Let i be z(n). Calculate the highest common divisor of i and r. 3 Let q(x) = -20x*2 - 17x - 36. Let u(d) = -7d2 - 6d - 12. Let m(t) = -6q(t) + 17u(t). Let a be m(0). Calculate the greatest common factor of a and 132. 12 Let q(h) = h - 1. Let v be q(11). Let i = 15 - v. Suppose 5k - 97 = -ia + 23, -5k + 57 = 2a. What is the highest common divisor of a and 168? 21 Let j(z) = 7z - 49. Let f be j(19). Let y(l) = 20l - 4. Let x be y(3). Calculate the highest common factor of f and x. 28 Suppose -5g = -11 + 91. Let n = g + 19. Let w(b) = 4b3 + b2 - 2b + 1. Let j be w(n). What is the highest common divisor of 14 and j? 14 Let a be (22/5)/((-1)/(-15)). Let h be 0 - -98 - (5 - 12)/7. Calculate the highest common factor of h and a. 33 Let j(d) = 2d*2 - 6d + 3. Let r be j(5). Let v be (3 + -4)/(2/(-548)). Let n = -113 + v. What is the greatest common divisor of n and r? 23 Let l(r) = -59r + 23. Let q be l(-12). What is the greatest common divisor of q and 86? 43 Let w(r) = -7r*2 - 3r*3 + 0r3 + r3 + 6 - 3r. Let s = 517 - 522. Let c be w(s). What is the greatest common factor of 12 and c? 12 Suppose a = -3a + 20. Let p(x) = x*2 - 1. Let o be p(-2). Suppose -oy = -196 + 61. Calculate the highest common divisor of a and y. 5 Let r be -114((-4)/(-26) - (-72)/208). Let l = -29 - r. Calculate the highest common factor of l and 196. 28 Let y be 18 + (6 - 3) + -6. Let x = -11 + y. Let p = x + 0. What is the greatest common factor of 36 and p? 4 Let v = -11 + 27. Let y = 242 - 242. Let p be (2 + y/2)/(39/1248). What is the greatest common factor of p and v? 16 Let v(m) = -m2 + 9m - 1. Let r = 10 + -4. Let l be v(r). Suppose -3h + 2i = -351, 5h = i - 3i + 601. Calculate the highest common divisor of h and l. 17 Let f = 55 - 30. Let n = f + -15. What is the greatest common factor of 50 and n? 10 Let s(t) = -46t + 11. Let m be s(0). Calculate the greatest common divisor of m and 209. 11 Let h = 493 - 343. What is the greatest common factor of 6 and h? 6 Let h = -8 + 20. Suppose -2f = 4t - 200, 2f = -3t - 0t + 152. What is the greatest common factor of t and h? 12 Suppose -669 = -3c + 3i, -c - 24i + 233 = -20i. Calculate the greatest common divisor of 90 and c. 45 Let i = -519 - -558. What is the greatest common divisor of i and 91? 13 Let r(t) = 22 - t - 46 + 83. Let l be r(-21). What is the highest common factor of l and 5? 5 Let r(h) = h*3 - 6h*2 + h - 1. Let v be r(6). Let t be 110/(-33)(-120)/20. Calculate the highest common divisor of t and v. 5 Suppose 3c - 621 = -4l, 2l - 328 = c + c. Suppose 2x - 61 = -3d, 0 = -5x + 4d - 5d + l. Calculate the highest common divisor of 8 and x. 8 Suppose 3i = -4s + 644, -3i + 4s = -s - 599. What is the highest common factor of i and 182? 26 Let i(x) = 9 - 155x + 75x + 78x. Let l be i(-8). Let k be (-2)/(-5) - (-23)/5. Calculate the highest common divisor of k and l. 5 Let t = 16 - 11. Suppose 0 = tr + 33 - 323. Suppose -r = -5s + 47. Calculate the highest common divisor of s and 3. 3 Let c be (-83)/(-3) + 5/(75/20). What is the highest common factor of 435 and c? 29 Suppose 5z - 2153 - 157 = 0. Calculate the highest common factor of 165 and z. 33 Let d be (-1)/(1/(-13)) + 0. Let c be -11/(-3 + 4). Let g = c + 92. What is the highest common divisor of d and g? 13 Suppose 0 = 17x + 329 - 4086. What is the highest common factor of x and 39? 13 Suppose -7 = -x + 5v, -5x = -0x - v - 59. Let g = x - -8. What is the highest common factor of 10 and g? 10 Let m be 3 - (-60 + (-8)/4). Let y = -108 + 121. What is the highest common factor of y and m? 13 Let y = -12 - -17. Suppose -4f + 13 + 9 = -3x, yx + 4 = 2f. Let w be 2 + f/(7/30). Calculate the highest common factor of 8 and w. 8 Suppose 9x + 16 = 11x. Suppose -4b - 116 = -xb. What is the greatest common factor of b and 203? 29 Let q be 1074200/700 + (0 - 8/14). Calculate the greatest common factor of q and 52. 26 Suppose -5j = 4x + 113, 0 = x - 2x + 5j - 22. Let q be (20(-6)/(-36))/((-2)/x). What is the greatest common divisor of 5 and q? 5 Let r = -209 - -217. What is the highest common divisor of 16 and r? 8 Suppose -m = -26 - 9. Let x(a) = a*3 + 9a*2 + 8a + 1. Let b be x(-8). Let o be b*15 - (33 - 32). Calculate the	{ "pile_set_name": "DM Mathematics" }
e tens digit of g(16)? 0 What is the ten thousands digit of (16/48 - (-478)/(-12))/(13/(-13936))? 4 Suppose -5t + 73 = -p + 16, t - 1 = -5p. Suppose -286 - t = -i. What is the hundreds digit of i? 2 Let j(p) = p*2 + 2p - 20. Suppose z = -0z - 4y + 15, -5y + 6 = -3z. Let w be (-10)/z(0 - 3). What is the hundreds digit of j(w)? 1 Suppose 10496 = 5m - 1189. Let b = -1489 + m. Suppose 7n - b = -n. What is the units digit of n? 6 Suppose -28o - 14o + 15312 = -18o. What is the units digit of o? 8 Let l(c) = -2c - 3 - 10 + c - 7. Let k be l(-21). What is the tens digit of (-10 - -81) + -3 + 2/k? 7 Let r(f) = -3f*3 + 2f + 1. Let n = 29 - 21. Suppose -2d + 4d + n = 0. What is the hundreds digit of r(d)? 1 Let y(f) be the second derivative of -f*3/3 - 25f*2/2 - 14f. Let v be y(-23). Suppose -60 = -vt + 18t. What is the units digit of t? 0 Suppose 2v + 3b + 2337 - 398 = 0, -3b = -9. Let c = 1750 + v. What is the hundreds digit of c? 7 Let l be ((-2)/(-3))/(6/9). Let m be 4(-14)/196 + (-737)/(-7). What is the hundreds digit of (l + -3)m4/(-8)? 1 Let c(t) = -27t - 12. Let h(g) = -g - 2. Let a(b) = -3c(b) + 6h(b). What is the hundreds digit of a(8)? 6 Suppose 0 = -76x + 1374475 + 2873. What is the units digit of x? 3 Suppose -3i + 28 - 16 = 0. Let w(v) = -5v*3 + 48 + iv*3 - v - 2v2 + 129 + v2. What is the units digit of w(0)? 7 Suppose 3l - y - 406 = 2337, 0 = l + 4y - 897. Suppose 16m - 17m + l = 0. What is the tens digit of m? 1 Let t(a) = 0 + 3 + 138a - 137a - 4. Let z(m) = 8m - 15. Let g(y) = 2t(y) + z(y). What is the units digit of g(2)? 3 What is the thousands digit of 15538 + 369/63 + (5 - 1)/28? 5 Let v(u) be the first derivative of -u*4/4 + 8u3/3 - u2/2 + 5u - 3. Let p be v(8). Let k(b) = -3b*3 - 5b*2 - 7b. What is the units digit of k(p)? 7 Let g = -11 + -14. Let z = -23 - g. Suppose -zq = -6q + 560. What is the tens digit of q? 4 Let y(c) be the first derivative of c*3 + 9c + 15. Let l be y(9). What is the units digit of 1/(l/(-255) - -1)? 5 Let b be -1(-8)/4 + 1. Let l be (-6)/(-3) - (-2 + (3 - b)). Suppose ls - 2s - 188 = 0. What is the units digit of s? 4 Let y = 4142 - 1465. What is the tens digit of y? 7 Suppose z - 282 = 884. Suppose 5p = y + 21, 5y + 186 = -4p + 168. Suppose -5n + z = -s, 0 = -pn - 2s - 3s + 694. What is the hundreds digit of n? 2 Suppose -n + 4882 = s - 945, 23292 = 4s + 12n. What is the units digit of s? 9 Suppose -91a + 92a - 5q - 16 = 0, 0 = -2a - 2q - 16. Let t(y) = 16y - 2. Let d(s) = -s. Let j(i) = 10d(i) - 2t(i). What is the hundreds digit of j(a)? 1 Let h = 390 + 3580. What is the thousands digit of h? 3 Let o = 920 - 917. Suppose -5n - op + 9869 = 0, 5n - 37p + 32p = 9845. What is the thousands digit of n? 1 What is the hundreds digit of 10234/301(-674)/(-4)? 7 Let o = 536 + -538. Let d(r) = 178r2 + 10r + 24. What is the units digit of d(o)? 6 Suppose -313 - 4038 = -s. Suppose s + 4319 = 10l. What is the units digit of l? 7 Suppose 3t = 39k - 42k + 105471, -3t - 70269 = -2k. What is the thousands digit of k? 5 Suppose -4u - 28 = -0. Let v be (-1)/4 + ((-1708)/16)/u. Suppose 13r - vr = -202. What is the units digit of r? 1 Suppose 2g = -2l + 10536, -g + 545 = 4l - 4741. What is the units digit of g? 2 Let r = 45 + -42. Let p(o) = -7o3 + 0o3 - or + o*2 + 23o*3 - 1. What is the units digit of p(1)? 5 Suppose 3q - 2 = -23. Let s(n) = n*2 + 7n + 15. Let l be s(q). Suppose lk = 13k + 372. What is the tens digit of k? 8 Suppose 891l - 3x + 4156 = 893l, 0 = 2l - 5x - 4172. What is the thousands digit of l? 2 Suppose 6m - 4m + 3x = 310, 606 = 4m - x. Suppose -160 - m = 4l. What is the hundreds digit of -3 + (-123)/(-39) + (-14886)/l? 1 Let f = 378 + -354. What is the hundreds digit of 162/f - 7 - 2645/(-4)? 6 Let r(o) = -o*2 - o + 9. Let t be r(-3). Suppose 3 - 6 = -ts, -3s + 5688 = 5g. What is the tens digit of g? 3 Suppose 15c - 2160 = 5c. Let j = c - -147. What is the hundreds digit of j? 3 Let x(u) = -u + 2. Let o be x(-4). Let g(a) = 2a2 - 3a - 4. Let n be g(o). Suppose -4b = b - n. What is the units digit of b? 0 What is the units digit of ((-5580)/70)/(2452/616 - 4) + -6? 6 Let g be (-4 + (3 - 1))/(-1) + -201. Let b = 368 + g. What is the tens digit of b? 6 Let p = 399 + -389. What is the tens digit of ((-265)/p)/((-5)/10)? 5 Suppose -3r = -9, -5r + 13 - 4 = 3u. What is the hundreds digit of u/21 - (-290925)/567? 5 Let q(a) = -a*3 + 4a*2 - 6a + 3. Let b be q(2). Let p be (-5 - (-5 + b))-3. What is the units digit of (-2)/p5976/48? 3 Suppose -13n = -30n + 52054. Suppose -19s + 11346 = n. What is the units digit of s? 6 Let i(w) = -438w - 4. Let s be i(-3). Suppose -11d - s = -d. Let m = d - -290. What is the tens digit of m? 5 Suppose -2k = 10, -3q + 5k - 4 = -41. Let p be 3/((-6)/(-2) + 0). What is the hundreds digit of p - q - (-125 + -5 - 6)? 1 Let q(b) = b*2 + 29b - 47. Let p(r) = -2r2 - 57r + 95. Let n(k) = -4p(k) - 9q(k). What is the units digit of n(-15)? 3 Suppose -i - 5545 = -4t, 0 = -2t + 3i + 1788 + 987. What is the tens digit of (36/(-42))/((-3)/t)? 9 Suppose 3804200 = -67i + 267i. What is the hundreds digit of i? 0 What is the units digit of (252/(-8))/(-21)(1 + 785)? 9 Suppose -11y + 6y + 15 = 0. Suppose -5p - 1047 = -4q, -p - 789 = -yq + 4p. What is the tens digit of q? 5 Suppose 5z - 45 = -5q, -4q - 2z - 10 = -6q. Let s be ((-6)/2 - 0) + q - 4. What is the units digit of (-2)/((-12)/(-18)) - (s - 50)? 7 Let u be (-30236)/(-18) + 2/(-54)-6. Suppose 7n - 2n + u = 4a, -3a + 1263 = -3n. What is the hundreds digit of a? 4 Suppose -3d - 60 = t, 0 = -5t - 0d + 2d - 249. Let v = t - -159. Suppose -8p = -12p + v. What is the tens digit of p? 2 Let v(q) = 486q - 1020. What is the tens digit of v(7)? 8 Suppose 3c - 28833 = -5k, 331 = -c + 337. What is the thousands digit of k? 5 What is the units digit of (3120 - 2/(-2)) + (-40)/(-4)? 1 Let g be (10 + -1744)/(1/(-1 - 1)). Suppose 0 = 8r + 4r - g. What is the units digit of r? 9 What is the tens digit of -1065(24/(-3) + 6 + -3)? 2 Let w = 753 - 359. Suppose 3n - w - 281 = 0. What is the hundreds digit of n? 2 Suppose 4r - 41 = -33. Suppose -4 = 4f, rj + 2f = -2j + 2282. What is the units digit of j? 1 Let p be (-355)/426 - (-35)/6. What is the tens digit of 3462/12 - p/(-10)? 8 Suppose 18250 = 9i - 38163 + 8470. What is the thousands digit of i? 5 Let c be -1 - (-15)/((-25)/5) - -5833. Suppose -3f - 5s + 9s = -c, 2f + 5s - 3886 = 0. What is the tens digit of f? 4 Let q = -6363 - -8006. What is the tens digit of q? 4 Let b(g) = -15g + 109. Let w be b(7). Suppose -118 = 12d - 13d - 5y, wd - 4y - 568 = 0. What is the tens digit of d? 3 Let t be 42211/102 - (26/(-12) - -2). Suppose -6p + 3090 = t. What is the hundreds digit of p? 4 What is the tens digit of 4/3 + (-12978)/(-189)? 7 Let c(y) = 128y2 + 10y - 15. Suppose 5o - 44 = 2p - 38, -5p - o = -12. What is the hundreds digit of c(p)? 5 Let j be 3/47128/243. Suppose 0 = jk - 23k + 1443. What is the hundreds digit of k? 4 Let r = 12566 - 5340. What is the thousands digit of r? 7 Let c be (4 + 1)/((-45)/(-18)). Suppose -5a - 5h - 5 = 0, -5h = ca - 8h + 7. What is the tens digit of ((-1)/a)/(-1)-278? 3 Let j(l) = -8l2 - l + 2. Let r be j(-2). Let k = 33 + r. Suppose 0 = -kd + 250 + 160. What is the tens digit of d? 8 Suppose 3n + 6y + 12 = 3y, -n = 4y + 1. Let k be (-1)/(3/(45/n)). Suppose 2w + ki - 179 = 0, 12 + 0 = 4i. What is the units digit of w? 5 What is the ten thousands digit of (5 + -10)(-7 + 174/30) - -25762? 2 Suppose 6c - 94787 = 5i, -3c - 5322 = 5i - 52663. What is the thousands digit of c? 5 Let q be 24280/2 + (-3 - (3 + -8)). Suppose -22n + q = -9n. What is the hundreds digit of n? 9 Let v(p) = -2p2 - p + 2. Let t be v(4). Let z = -134 - -244. Let n = z + t. What is the tens digit of n? 7 Suppose 8q - 11q = 12. What is the units digit of q/(-14) - 2595/(-7)? 1 Suppose -9j = -10j + 190. Suppose -jz + 1448 = -186z. What is the units digit of z? 2 Let d be (-34)/(-14) - 9/21. Suppose -2m - m - 2z = 8, 4 = dz. Let c = m - -140. What	{ "pile_set_name": "DM Mathematics" }
1 Suppose -12 = -40u + 36u. Suppose w = uj - 169, -w = -2 - 3. What is the remainder when j is divided by 31? 27 Let y(r) = -22r - 54. Calculate the remainder when y(-18) is divided by 23. 20 Let w(u) = -5u3 - 11u*2 + 17u + 3. Let o(f) = -3f3 - 7f*2 + 11f + 2. Let h(n) = 8o(n) - 5w(n). Calculate the remainder when 52 is divided by h(2). 8 Let g be (-192)/33 + (-6)/33. Let t(y) = 2y2 + y + 2. Calculate the remainder when t(2) is divided by g1/2 + 8. 2 Suppose 5a + 54 = 6a. Let r be (0 - -2 - 2) + 57. Suppose h - r = -2h. Calculate the remainder when a is divided by h. 16 Let w = -1970 + 1979. What is the remainder when ((-9)/(-3))/((-2)/(-6)) is divided by w? 0 Let h = 162 - 94. What is the remainder when 135 is divided by h? 67 Suppose t + 5 = 2. Suppose -1 + 16 = 3g. Let p = g + t. Calculate the remainder when 5 is divided by p. 1 Suppose -4z + s - 20 = 0, 0 = 3z - 0z - 5s + 15. Let j be (-1 + -35 + 0)76/(-114). Let v = j + z. Calculate the remainder when 35 is divided by v. 16 Let s(w) = -13w + 185. Calculate the remainder when 111 is divided by s(13). 15 Suppose -4g + 7g = 180. What is the remainder when g is divided by 21? 18 Suppose -o = -5t + 9t - 84, -3t = -o + 112. Calculate the remainder when 313 is divided by o. 13 Calculate the remainder when 446 is divided by -3 + 2 - (-99 + 7). 82 Let y(c) = 14c3 + 15 + c2 - 4c + 0c - 13. Calculate the remainder when 77 is divided by y(1). 12 Let i(g) = 2g2 + 3 + g + g3 - g2 + 4. What is the remainder when -26-2(-4)/(-16) is divided by i(0)? 6 Let a be ((-16)/6)/(4/(-6)). Suppose -3f - 5k + 103 = -f, 0 = -4f - ak + 188. Calculate the remainder when f is divided by 9. 8 Suppose 5c - a = 8c - 242, -4c = 5a - 341. Suppose -30 = -h - 5. Let k = 45 - h. Calculate the remainder when c is divided by k. 19 Suppose -2c = -3b - 95, -5b - 3 = -8. Let z = 65 - c. What is the remainder when 47 is divided by z? 15 Let f(g) = 9g - 4. Let k(d) = 2d*2 + 32d - 164. What is the remainder when k(7) is divided by f(4)? 30 Suppose -5p = 4p + 279. Let k = p - -27. What is the remainder when (-998)/(-10) + k/(-20) is divided by 26? 22 Let f(d) = 37 - 24 + d + 2. Let k be 1321/(-2). What is the remainder when f(k) is divided by 2? 0 Let i = 474 - 426. Calculate the remainder when i is divided by 3. 0 Suppose -100k + 96k = 12. Calculate the remainder when 122 is divided by (-4 - 10/k) + (-231)/(-9). 22 Let w = 2206 + -2190. Calculate the remainder when 327 is divided by w. 7 Calculate the remainder when -41(1/(-2))/((-15)/(-30)) is divided by 7. 6 What is the remainder when 372/3(-2)/(-4) is divided by 17? 11 Let z(b) = -b*3 + 15b*2 - 13b. Let h = 81 + -13. What is the remainder when h is divided by z(14)? 12 Let v = 151 - 108. Suppose 0 = 3k - n - 70 + 8, 0 = -2n + 8. Calculate the remainder when v is divided by k. 21 Let v = 36 - -7. Let m = 103 - -66. Calculate the remainder when m is divided by v. 40 Let z be (13/(-3) + -1)-3. Let i(s) = s3 - 17s*2 + 17s - 3. Calculate the remainder when i(z) is divided by 6. 1 Suppose v = 3v - 116. Suppose 4k - v = 5f, 19 = -3f + 4k - 11. Calculate the remainder when f/49 - 261/(-7) is divided by 13. 11 Let k be (52/7 + -2)7/1. Let o(u) = -u - 5. Let h be o(-8). Suppose hw - k = w. Calculate the remainder when w is divided by 5. 4 Suppose -34 = -0p - 2p + 3s, 0 = -2p - 4s + 20. Let j(y) = 3 + 2y2 - 10 - 4y - 1. What is the remainder when j(6) is divided by p? 12 Let w = 18 - 12. Let f be (12/8)/((-2)/4). Let b(x) = -2x - 2. What is the remainder when w is divided by b(f)? 2 Let j = -2232 + 2309. What is the remainder when j is divided by (0 - -1)/(1/16)? 13 Let b(w) = 3w*2 + 6w - 9w2 + 1 - 3w*3 + 11w*3 - 6w*3. What is the remainder when 6 is divided by b(2)? 1 Let j(l) = l + 1. Let y(p) = 4p + 8. Let a(f) = 3f + 3. Let v be a(-3). Let u(i) = vj(i) + 2y(i). What is the remainder when 26 is divided by u(0)? 6 Let m = 151 - 98. What is the remainder when m is divided by ((-8)/2 - -5)0 - -27? 26 Let m(w) = w*2 + 6w + 3. Let f be m(-6). Suppose -fk + x = -56, -4k = 4x - 54 + 6. What is the remainder when (-504)/(-10) - 4/10 is divided by k? 16 Let a be (-57)/((-44)/8 + 4). Suppose -4d + a = -3d. Calculate the remainder when d is divided by 8. 6 Suppose -3n + 76 = -194. Suppose -3m + n = 2m. Let k = 161 + -93. Calculate the remainder when k is divided by m. 14 Calculate the remainder when 25597/187 + -5 + (-2)/(-17) is divided by 26. 2 Suppose 2j = -8j + 20. Let x(g) = 142g + 2. Let r be x(4). Suppose 2i - 237 = 5d, 5i - r = 7d - jd. What is the remainder when i is divided by 28? 27 Let m(y) = 3y3 - y2 - 3y - 1. Let a = -13 - -21. Let n be 5 + a/(-4) + 0. What is the remainder when m(n) is divided by 9? 8 Suppose 4y - z - 2z + 9 = 0, -3y + 2z - 6 = 0. Let x = 20 + y. Calculate the remainder when x is divided by 11. 9 Let j = -2 - -3. Let l = 6 - 4. Calculate the remainder when 45/60(32/6)/l is divided by j. 0 Suppose 0 = -4f - 39 - 13. Let t = 15 + f. Suppose -5x - 6 = -tx, 20 = 2c - 4x. Calculate the remainder when 15 is divided by c. 3 Suppose -10 = -5w - 0w. What is the remainder when (-52)/5(w + -7) is divided by 11? 8 What is the remainder when 39 is divided by 4/2640 - 36/234? 3 Let v(b) = b + 1. Let t = -66 - -96. What is the remainder when t is divided by v(7)? 6 Calculate the remainder when ((-1310)/204)/(-1) is divided by 66. 64 Let y(z) = -6z + 53. Let p = 57 - 75. What is the remainder when y(p) is divided by 27? 26 Suppose k = t + 32, 13k = 9k + 3t + 128. What is the remainder when 75 is divided by k? 11 What is the remainder when 144 is divided by 262/12 - (-5 - 29/(-6))? 12 Let z be -6(-1)/(-6)10. Let l(v) = -4v - 27. What is the remainder when 38 is divided by l(z)? 12 Suppose q - 10 = -4y, -4y - 34 = 2q - 58. Calculate the remainder when 180 is divided by q. 12 Suppose 3k - 6k + 60 = 0. Let d = 442 - 435. What is the remainder when k is divided by d? 6 Suppose -42f = -45f + 24. Calculate the remainder when 422 is divided by f. 6 Calculate the remainder when 56 is divided by 3 + 1 + 1(4 + -5). 2 Let n(y) = 33y - 456. Calculate the remainder when 298 is divided by n(14). 4 Suppose -5f = -4r + 3r + 46, 0 = 4r - 2f - 130. What is the remainder when 146 is divided by r? 22 Suppose 5g - 7 = o, 3g - 48 = -4o - 7. What is the remainder when o is divided by (19/(-6) - 47/(-282)) + 7? 0 Let x(h) = -h2 - 4h. Let g be x(-5). Suppose 0 = -3o + 4w + 50, -18 = -o - 0o + 2w. What is the remainder when 208/5 - (-3)/g is divided by o? 13 Calculate the remainder when (-14)/21 + (-4614)/(-9) is divided by 27. 26 Suppose 2r + 8 = 0, -8i - r = -5i - 2. Suppose io + 5 = o, -3v - 4o + 37 = 0. Calculate the remainder when 37 is divided by v. 18 Let o(z) = -3z - 9. Let w be o(14). Let m = -25 - w. Calculate the remainder when 77 is divided by m. 25 What is the remainder when 756 is divided by (-4275)/(-18)12/30? 91 What is the remainder when (4 - 97)(-2 - 1) - 7 is divided by 48? 32 Let u be 319/77 - 2/14. Suppose ud = -3d + 84. What is the remainder when 67 is divided by d? 7 Suppose 2349 = 3f + 843. What is the remainder when f is divided by 72? 70 Suppose 4275 = 32o - 5741. Calculate the remainder when o is divided by 63. 61 Let l = 153 - 107. Calculate the remainder when 133 is divided by l. 41 Suppose 0 = -5w - 6 + 1. Suppose -58c = -57c - 4. What is the remainder when 14 is divided by 40/(-2)w/c? 4 Let l = -87 - -116. Suppose -lg + 18 = -26g. Let v(f) = -f + 2. Calculate the remainder when g is divided by v(-2). 2 Let p(d) = -d3 + 14d*2 - 20d - 18. Calculate the remainder when 58 is divided by p(12). 28 Suppose 3o = -2l - 7, -9 = 2l + 1. Let u = 6 - o. Let z = u - -16. What is the remainder when z is divided by 12? 9 Let i(v) = 4v*2 + 6v - 23. What is the remainder when i(-4) is divided by 8? 1 Let d = 37 - 36. Let y(l) = 59l2 - 2l. What is the remainder when y(d) is divided by 29? 28 Let a = 18 + -59. Let d = 43 - a. What is the remainder when d is divided by 43? 41 Let u be (-12)/7 + (-4)/14. Let x(y) be the first derivative of -19y*2/2 + y - 9. What is the remai	{ "pile_set_name": "DM Mathematics" }
and o? 1 Suppose 48 = -5l - 267. Let s = 8766 - 8801. Let t = s - l. Calculate the highest common factor of 84 and t. 28 Suppose -4o - 24 = -40. Suppose 4s - 4 = -oc, 0c + c = -5. What is the greatest common factor of 10 and s? 2 Suppose -13q - 2 = -14q. Let g be (5 + 56/(-16))q/1. Suppose -2b + gb + w = 23, b - w = 25. Calculate the highest common divisor of 120 and b. 24 Suppose -13l + 10l - 6 = 0, -l - 4102 = -m. What is the highest common divisor of 100 and m? 100 Suppose 14v - 38 = 480. Let i = v + 67. Calculate the highest common divisor of 52 and i. 52 Let o(q) = -4q*2 - 12q + 15. Let k be o(-3). Calculate the greatest common divisor of 405 and k. 15 Let j(t) = -2t2 - 74t - 544. Let p be j(-11). What is the greatest common divisor of 2548 and p? 28 Let h(s) = -7s - 32. Let b be h(-29). Calculate the highest common factor of b and 747. 9 Suppose -49t + 45t = -40. Suppose tb + 35 - 145 = 0. What is the highest common factor of 55 and b? 11 Let x = 486 - 273. Suppose 0 = -5w + 4g + 6055, -2w + 3g - 4875 = -6w. Suppose -14m + x = -w. What is the highest common factor of 17 and m? 17 Let b = 4137 + -1659. Calculate the greatest common factor of 42 and b. 42 Let b be (((-90)/12 + -3)/2)/((-2)/72). What is the greatest common divisor of b and 297? 27 Suppose 151 + 689 = -2i. Let o be (30/7)/((-18)/i). What is the greatest common divisor of o and 20? 20 Suppose 4l - 3p + 198 = 5l, 5p - 198 = -l. Let g be ((-12)/8)/((-3)/l). What is the greatest common divisor of 66 and g? 33 Let b = -24 - -26. Let p = b - -196. Calculate the highest common factor of p and 18. 18 Suppose 4s - 3p = 23, -3s + 5p + 14 + 17 = 0. Let y(g) = g2 + 2g - 5. Let b be y(4). Calculate the greatest common divisor of b and s. 1 Let i(f) = 1120f2 + 8f - 8. Let k be i(1). Calculate the highest common divisor of 98 and k. 14 Let b = 315 - 329. Let x(m) = -m*2 - 19m + 14. Let l be x(b). What is the highest common divisor of l and 96? 12 Suppose 124w - 121w = 2n + 16, 4w + 2n = 40. What is the greatest common factor of w and 3560? 8 Let o = 28 + -24. Suppose -2v - 2g - 8 = 0, -v = 2g - 3g - o. Let a be v + 7 + (2 - (-1)/1). What is the highest common factor of a and 80? 10 Let d be (30/25)/(48/3280). Calculate the highest common factor of d and 5. 1 Let y(v) = 5v + 741v3 + 723v*3 - 1533v3 + v2 + 4. Let i be y(-1). What is the highest common divisor of 23 and i? 23 Let d = -60740 + 60776. Suppose -5m - 5 + 0 = -5h, 0 = -5h + 15. Suppose mu + 218 = -s + 3s, 1 = -u. Calculate the highest common factor of d and s. 36 Let a(p) = 108p - 549. Let u be a(11). Suppose 2o = 5 + 13. Calculate the greatest common factor of o and u. 9 Let r(s) = -s2 + 9s - 13. Let x be r(6). Let j = 16 + x. Let q(b) = -b*2 + 9b - 7. Let u be q(7). Calculate the highest common divisor of j and u. 7 Suppose -235h + 85076 + 1924 = -177h. Calculate the highest common factor of 180 and h. 60 Let x(a) = 2a3 + 34a*2 + 3a + 52. Let s be x(-17). Let r be 36/(-9) + 116. Let w be ((-40)/r)/(6/(-9)). Calculate the greatest common divisor of s and w. 1 Let x = -243430 - -243435. Let v = 82 - 42. What is the greatest common divisor of x and v? 5 Let b(p) = 3p*2 + 11p - 79. Let y be b(20). What is the highest common divisor of 27 and y? 9 Suppose 40 = 2k - o, 2o + 0o + 8 = 0. Let b(q) = -q2 - 9 + 21q + 18q + 37q - 56q. Let y be b(k). What is the highest common factor of 18 and y? 9 Let x be (2/(-5))/(12/(-120)) - -12. Suppose -24s + 374 = u - 21s, 2u - 738 = -s. Calculate the highest common divisor of x and u. 16 Let b = -18506 + 18538. Let t be 6/(-1)28/(-6). Suppose 0 = r + 4m - t, 2r - m = m + 6. What is the highest common factor of r and b? 8 Suppose 5w + 5 = -0w. Let z = w - -118. Suppose o + 3b = -o + z, -o = 4b - 71. Calculate the highest common factor of o and 17. 17 Suppose 4b - 2z - 16 = -z, -4b + 16 = -5z. Suppose 2u + 24 = 4a + 6, 0 = ba - 3u - 19. Let c = 61 + -29. What is the highest common divisor of a and c? 4 Let a(y) = 16 - 24y + 2y2 - 3y*2 - 3y*2 + 8y2. Let d be a(8). What is the highest common divisor of d and 5? 5 Let g(j) = j2 + 2j + 402. Let u be g(0). Suppose 4b - 1014 = -u. Calculate the highest common divisor of 85 and b. 17 Suppose -40w - s - 451 = -44w, 10w + 5s = 1105. Calculate the highest common divisor of w and 112. 112 Let n be (-960)/(-180)-12273/(-12). Calculate the highest common divisor of n and 208. 16 Let q = 16498 - 16382. What is the highest common factor of q and 10? 2 Let c = 9250 - 7717. What is the greatest common divisor of c and 146? 73 Suppose 238 = 4h + 46. Let x = 28 - 41. Let g = x - -37. What is the highest common divisor of g and h? 24 Suppose -3r - 10u = -16u - 4293, 0 = -2r - u + 2862. What is the highest common factor of 2968 and r? 53 Let m(l) be the second derivative of 23l3 - 63l*2 - 2l + 18. Let c be m(5). What is the highest common factor of 12 and c? 12 Suppose 0v + 7v - 33v + 2860 = 0. Calculate the greatest common factor of 380 and v. 10 Suppose 0 = 3a - 63a + 357 + 1443. Suppose 87 + 153 = 3t. Calculate the highest common divisor of t and a. 10 Let n be ((-2100)/(-8))/(-117/(-154)). Calculate the greatest common factor of n and 21. 21 Let m(d) = -d + 1. Let g be m(5). Suppose 265 + 80 = 23a. Let n = g + a. Calculate the greatest common factor of n and 55. 11 Let i be (-1176)/(-6) - (-1 - 1)2. Suppose 35u - i = 30u. What is the highest common divisor of 30 and u? 10 Let h(s) = 1258s - 550. Let c be h(3). What is the highest common divisor of 208 and c? 104 Let g(f) be the third derivative of f6/120 - f5/15 - 7f4/6 - 2f*3/3 - 27f*2 - 1. Let m be g(8). What is the highest common divisor of m and 518? 14 Let f(s) = 171s - 42. Let d = -290 - -294. Let a be f(d). What is the greatest common divisor of 6 and a? 6 Let m be (-1845)/(-15)(0 - 1/(-3)). Suppose -3k = -u - 619, -4k = -2u + 3u - 816. What is the greatest common factor of k and m? 41 Let y(b) = 18b*2 + 2b + 6. Suppose 3z - z = -6. Let i be y(z). Suppose 21s - 238 - 140 = 0. Calculate the highest common divisor of s and i. 18 Suppose -5b - 3r + 2055 = 567, 1190 = 4b + 2r. Suppose 4n - 148 = -4a, 6 + 139 = 5n - 5a. What is the greatest common factor of b and n? 33 Suppose -90j = -98j - 16. Let x be -2 + (-1183)/(-133) + j/(-19). What is the highest common divisor of 2 and x? 1 Let w be (-1)/(-3)(-3 + 0)72. Let z = -40 - w. Let u be z/48 - (-194)/6. What is the greatest common factor of u and 165? 33 Suppose -g + 4k + 618 = 0, -3k = 217g - 214g - 1794. Calculate the highest common divisor of g and 35. 7 Let v(y) = 27y2 + 31y + 7. Let j be v(-4). Suppose -33a - 9 = -34a. Calculate the greatest common factor of a and j. 9 Suppose 168a - 135850 = -41a. What is the highest common factor of 450 and a? 50 Suppose 80r = 9048 + 1192. Let b be (-4)/((-2)/(-2))-8. What is the highest common factor of r and b? 32 Suppose 7s + 188 = 9s. Let x = 371 - 136. What is the greatest common divisor of s and x? 47 Let g(a) = -a*2 - 31a - 25. Let r be g(-30). Suppose -rs + 119 = y + 54, 15 = 3y. What is the greatest common factor of 20 and s? 4 Suppose -22q - 5t = -21q + 1, -111 = -5q + 4t. What is the highest common divisor of 1349 and q? 19 Let z(o) = -33o - 12. Let k be z(-8). Let b = -10229 - -10257. Calculate the highest common factor of k and b. 28 Let g(b) = b2 - b2 - 6b2 - b2 + b3 + 2 + 3b. Let c be g(7). Calculate the highest common divisor of 299 and c. 23 Suppose 0 = 3p + 2p - 880. Let s(c) = -20c2 + 139c - 204. Let x be s(4). Calculate the highest common divisor of x and p. 16 Suppose 1829 - 13671 = -62z. Calculate the highest common divisor of 1 and z. 1 Let d(k) = 3k*2 - 23k - 12. Let n be d(12). Suppose 4s = 4q - 56, 8s - 22 = -2q + 7s. What is the highest common factor of n and q? 12 Suppose -18 = -4x + 5y, 0 = -5x - 2y - 2 + 8. Let q be (-470)/(-15)9/x. Let t = q + -75. What is the greatest common divisor of 6 and t? 6 Suppose -9167 = -19q + 5919. Suppose -9t + 16 + q = 0. Calculate the greatest common divisor of 120 and t. 30 Suppose 378 + 37 = -o. Let c =	{ "pile_set_name": "DM Mathematics" }
actor -12x2 - 13x*t + 7x*2 - 2x*3. -5x*2(3x + 1) Let k be ((-6)/(-8))/((-8)/(-32)). Let j = 4 + -1. Solve jb*2 + 2b + 5bk - 3b3 + b2 = 0 for b. -1, 0 Let s(h) be the third derivative of 49h5/20 - 47h4/8 - h3 + 34h2. Factor s(g). 3(g - 1)(49g + 2) Factor 398q2 + 200q + 51 - 2q4 - 16 - 18 - 17 + 196q*3. -2q(q - 100)(q + 1)*2 Let c(j) be the first derivative of -2j5/15 + j4/6 + 2j3/9 - j2/3 - 223. Solve c(n) = 0. -1, 0, 1 Suppose -1704l - 34 = -1740l + 38. Factor -4/11p*4 + 0p + 6/11pl + 0 - 10/11p*3. -2p*2(p + 3)(2p - 1)/11 Let b(i) be the second derivative of 2i7/21 - 4i*6/15 - 3i*5/5 + 4i*4/3 + 8i*3/3 - 209i. What is t in b(t) = 0? -1, 0, 2 Let q = -22 + 27. Suppose qu - 5a - 4 = 26, 5a = 20. Find m such that 3m*5 + um*3 - 12m*4 + 6m*3 - 4m*3 - 15m + 6m2 + 6 = 0. -1, 1, 2 Let h be ((-8)/(-32))/((-1)/(-20)). Suppose hj = 12j - 21. What is g in 1/2g*4 - 3/2 + 0g*j + 4g - 3g2 = 0? -3, 1 Factor 0a - 4/9a5 + 0 + 4/9a*4 + 4/9a*3 - 4/9a*2. -4a*2(a - 1)*2(a + 1)/9 Let m = -331 - -336. Let z(b) be the third derivative of 0b + 0b*3 + 1/4b*4 - 7b*2 + 0 + 1/30bm. Suppose z(o) = 0. What is o? -3, 0 Let n(t) be the second derivative of -t6/90 + 121t5/30 - 540t*4 + 28431t*3 + 177147t*2/2 - 247t. Factor n(x). -(x - 81)*3(x + 1)/3 Let f be ((-2)/(-14) + (-927)/(-13699))1/2. Solve -14/19s - 20/19 - fs2 = 0. -5, -2 Let a(r) be the third derivative of r8/420 + 2r7/105 + r6/25 - 4r5/75 - 4r*4/15 - 59r*2. Factor a(l). 4l(l - 1)(l + 2)3/5 Let l(j) be the first derivative of -j4/4 - 3j3 - 3j*2 + 16j + 2. Let s be l(-8). Factor sp3 - 3/4p*4 + 3/4p*2 + 0 + 0p. -3p2(p - 1)(p + 1)/4 Factor 40/7o*3 - 78/7o*2 + 36/7o + 2/7. 2(o - 1)2(20o + 1)/7 Determine o, given that 2/11 + 2/11o*2 + 4/11o = 0. -1 Let u = 594 - 592. Let j(q) be the second derivative of -5q - 3/8q*4 + 1/2q*3 + 0q*u + 3/40q*5 + 0. Factor j(k). 3k(k - 2)(k - 1)/2 Let c be (1020/(-150))/(-2). Let f(d) be the first derivative of -d3 + 3 + 7/6d*2 - cd + 5/12d4 - 1/15d*5. Factor f(z). -(z - 2)(z - 1)*3/3 What is w in 0 + 39/2w + 45/4w2 - 3/4w*4 - 9w*3 = 0? -13, -1, 0, 2 Suppose -4 + 13/3v*2 - 11/3v*3 - 1/3v*4 + 11/3v = 0. What is v? -12, -1, 1 Let g = 1433 + -1429. Let r = -5/18 + 61/90. What is b in 0 + 0b - 4/5b*3 + rb*2 + 2/5b*g = 0? 0, 1 Let o be (2 + -8)(2 - 1). Let m be (4/o)/((-4)/30). Let -4h5 + 6h5 + hm - 3h3 + 3h*2 - 3h*4 = 0. Calculate h. -1, 0, 1 Let b(p) be the third derivative of 1/240p*6 + 8p*2 + 0 + 0p*5 - 1/16p*4 + 1/6p*3 + 0p. Suppose b(g) = 0. What is g? -2, 1 Let b(a) be the first derivative of 17 + 2/9a2 - 2/3a + 10/27a3. Factor b(q). 2(q + 1)(5q - 3)/9 Suppose 0 = -3h + 5h - 86. Let k = -43 + h. Factor 0 + kf + 2/9f*2 - 2/9f*3. -2f*2(f - 1)/9 Suppose 15 = 5m - 5o, -3 = -2m - 0m - o. Let j be m/(13/1 + (-11 - -9)). Factor -4/11u + ju*2 - 6/11. 2(u - 3)(u + 1)/11 Let a(s) be the third derivative of s6/180 + 91s*5/90 + 235s*4/4 + 225s*3 - 267s*2. Find q, given that a(q) = 0. -45, -1 Let k(y) be the first derivative of -20/7y*2 + 100/7y + 4/21y3 + 31. Factor k(i). 4(i - 5)*2/7 Factor 16c*2 + 4c*4 + 0 + 32/5c + 66/5c3 + 2/5c*5. 2c(c + 1)2(c + 4)*2/5 Factor 5m*4 + 3m*3 + 5m*4 + 5m*5 - 10m*3 - 8m*3. 5m*3(m - 1)(m + 3) Suppose 0 = 3q + 3a - 15, -4a - 4 = -2q + 12. Let z be 3/(-2)-2 + 0. Factor -qs3 - 5s + 5sz + 5s + s. -s(s - 1)(s + 1) Solve 167042/9 + 2/9d2 + 1156/9d = 0. -289 Suppose 0 = 3j + 2x - 31, -5x = 5j - 24 - 31. Let i(g) = 3g - 21. Let q be i(j). What is b in -2b*5 - 4 + 4 - 8b*4 - qb*3 + 2b*4 - 2b*2 = 0? -1, 0 Solve 37x*3 + 108x*2 + 4x*5 + 12098 - 12098 - 44x*4 + 29x*3 - 6x*3 = 0 for x. -1, 0, 3, 9 Let s = 10 - 7. Let l be (3 - -1 - s) + 1. Find j, given that -2j*2 + l - 2j*2 + 5j + 6j2 - j = 0. -1 Let w(t) be the first derivative of -98t*3/3 + 154t*2 - 242t + 158. Factor w(m). -2(7m - 11)*2 Suppose 3/5b*4 + 21b*2 + 15b + 0 + 33/5b3 = 0. What is b? -5, -1, 0 Let i be (15/(-4))/(5/((-40)/3)). Determine a, given that a2 + 21 - 12 - ia + a*2 - 1 = 0. 1, 4 Solve 3j*5 - 3526j4 - j5 - 2j5 - 448j*3 + 752j*2 + 256j - 1024 - 4j5 + 3602j*4 = 0 for j. -1, 2, 8 Let i(p) be the second derivative of 1/15p*3 + 1/10p*2 + 0 + 18p + 1/60p4. Solve i(m) = 0 for m. -1 What is u in -13/3u*2 + 1/3u*3 - 5 - 29/3u = 0? -1, 15 Let b be (9 - 2) + (-37 - -36). Let t(y) be the first derivative of -1/5y5 - 2 + y4 - y2 - y + 2/3y*3 - 1/3y*b. Suppose t(z) = 0. Calculate z. -1, -1/2, 1 Let a(i) = -46i + 48i + 3 + 2i*2 - 1. Let k be a(-1). Find d, given that -3d + 5d2 + dk - 4d*2 - 5d*2 = 0. -1, 0 Suppose 6k - 28 = 5k. Determine y so that -ky + 15y + 12y*2 - 4y*5 - 4y*3 + 21y - 12y4 = 0. -2, -1, 0, 1 Suppose 4v - 31 = -w, -6v - 12 = -7v + 4w. Suppose -5j + vj = 0. Find s such that s + 5/4s*3 + j + 2s*2 + 1/4s*4 = 0. -2, -1, 0 Factor 0 - 1/3i*4 - 25/3i + 25/3i2 + 1/3i*3. -i(i - 5)(i - 1)(i + 5)/3 Let d be 176/62 + -5 + -2 + 4. Let r = 46/93 + d. Factor rw2 - 2/3 + 1/3w. (w - 1)(w + 2)/3 Let f(c) be the first derivative of -3/2c*2 + 0c - 9/4c4 - 6 + 3/5c*5 + 3c*3. Suppose f(m) = 0. Calculate m. 0, 1 Let z(j) be the third derivative of -2j*2 + 0 - 1/20j*5 + 0j - 3/8j4 - j3. Factor z(l). -3(l + 1)(l + 2) Let b be 5 + -3 + (-96)/44 - 810/(-825). Factor br - 2/5r2 + 0. -2r(r - 2)/5 Let h be (12/36)/((-2)/(-18)). Suppose hs - 24 = 12. Factor -6r3 - sr + 2r2 - 4 - r4 - 4r*2 - 11r2. -(r + 1)2(r + 2)2 Factor -2/21x + 4/21x2 + 0x*3 + 2/21x*5 + 0 - 4/21x*4. 2x(x - 1)3(x + 1)/21 Let n(t) = t*3 + 2t*2 + 2t + 1. Let q be n(-1). Let b(u) be the second derivative of -3u - 1/2u*3 + 3/20u*5 + 0 + 0u*2 + qu*4. Factor b(g). 3g(g - 1)(g + 1) Let r(d) be the first derivative of -2d4/11 - 2d*3/3 + 19d*2/11 - 8d/11 + 78. Solve r(g) = 0. -4, 1/4, 1 Suppose 2r = 0, s - 4r + 2r = 3. Suppose 4h - 32 = -4c, -4c + 4h - 5 = s. Factor 2j4 + j4 - c + 11j - 5j + 0j3 - 6j*3. 3(j - 1)*3(j + 1) Let w(i) be the second derivative of 1/24i4 - 3i + 0 - 1/12i3 - 1/2i*2. Suppose w(o) = 0. Calculate o. -1, 2 Let x be 3/(-2 - -5 - 2). Let j(a) be the second derivative of -a + 5/12a*4 + 0a*2 + 0a*x + 0. Factor j(f). 5f*2 Suppose 52h - 68 = -4 + 40. Solve -2/11x - 1/11x*h - 1/11 = 0 for x. -1 Suppose 11r + 6r + 200 + 8r + 2r2 + 0r*2 + 15r = 0. What is r? -10 Let l(j) be the second derivative of -j5/60 + j4/12 + 5j3/9 + 395j. Let l(n) = 0. Calculate n. -2, 0, 5 Let f(i) be the second derivative of i7/1890 + i6/540 - i*5/45 + 3i*4 - 2i - 35. Let r(u) be the third derivative of f(u). Factor r(m). 4(m - 1)(m + 2)/3 Let x(j) = 5j2 - 23j - 195. Let s be x(9). Suppose -2/3gs + 0 + 0g - 8/3g2 = 0. What is g? -4, 0 Let x = -238 + 241. Suppose -2w - n + 2n + 1 = 0, -xw + 3n = -3. Factor -o3 + o4 + w + 3/4o*5 + 0o + 0o2. o3(o + 2)(3o - 2)/4 Let i(u) = -3u4 - 3u3 - u2 - 5u. Let f(p) = p4 + p3 + p. Let z = 33 + -29. Let v be 10/14 - (-4)/14. Let j(h) = vi(h) + zf(h). Factor j(q). q(q - 1)(q + 1)2 Let k be 3/521400/4494. Factor -24/7c + 0 + 4/7c*4 - kc*2 + 8/7c*3. 4c(c - 2)(c + 1)(c + 3)/7 Let v(b) be the first derivative of -12b*5/5 + 8b*4 - 28b*3/3 + 4b*2 - 127. Factor v(i). -4i(i - 1)2(3i - 2) Factor 324/7 - 72/7o + 4/7o2. 4(o - 9)*2/7 Let n = 0 - 1. Let b(r) = -4r*3 - r - 1. Let t be b(n). Factor -tg + g*2 - 7g*2 - 4g*3 + 3g3 - g3. -2g(g + 1)(g + 2) Suppose -w = -3a - 2, 6a = 4w + 11a - 8. Factor -6/7 + 8/7l - 2/7lw. -2(l - 3)(l - 1)/7 Let h = 2779/4 - 694. Factor h - 1/4p*2 - 1/2p. -(p - 1)(p + 3)/4 Suppose 12l + 11l + 0l = 0. Let p(b) be the third derivative of 1/630b7 + 0b*6 + 0b + 0b4 + l - 1/90b*5 - 3b*2 + 1/18b3. Factor p(o). (o - 1)2(o + 1)*2/3 Let y	{ "pile_set_name": "DM Mathematics" }
8879? 44425 What is next in -59, -81, -137, -245, -423, -689? -1061 What is the next term in -16, -8, 26, 86? 172 What comes next: -121, -136, -161, -196, -241, -296, -361? -436 What comes next: 4, 30, 76, 142, 228? 334 What is next in -11, -20, -31, -44, -59? -76 What is next in -461, -459, -457, -455, -453, -451? -449 What comes next: -89, -277, -591, -1031, -1597, -2289, -3107? -4051 What comes next: -33, -34, -35, -36, -37, -38? -39 What is the next term in 26, 70, 116, 164, 214, 266? 320 What comes next: 31, 51, 93, 163, 267, 411, 601? 843 What is the next term in -438, -1737, -3896, -6909, -10770? -15473 What is the next term in 18, 45, 88, 153, 246, 373, 540, 753? 1018 What comes next: 19, 37, 55, 73, 91, 109? 127 What is the next term in -16, -12, -4, 8, 24? 44 What comes next: -755, -734, -713, -692? -671 What comes next: -84, -161, -230, -285, -320, -329? -306 What is the next term in 351, 336, 307, 258, 183, 76? -69 What is the next term in -70, -77, -84? -91 What comes next: -598, -605, -608, -601, -578, -533, -460, -353? -206 What is next in -3593, -3591, -3587, -3581, -3573, -3563? -3551 What comes next: 288, 286, 284? 282 What comes next: -43, -136, -291, -508, -787? -1128 What is next in 37, 39, 47, 61, 81, 107? 139 What comes next: 389, 382, 373, 362, 349? 334 What comes next: -107, -111, -119, -131? -147 What is the next term in 38, 81, 138, 215, 318, 453? 626 What comes next: -2, -10, -24, -44, -70? -102 What comes next: -1041, -1043, -1045? -1047 What is next in 725, 726, 727, 728? 729 What comes next: -11, -51, -119, -215? -339 What is the next term in -21, -48, -75, -102, -129? -156 What is next in 85, 171, 261, 355, 453, 555? 661 What is the next term in 2, 11, 26, 47, 74, 107, 146? 191 What is the next term in -97, -394, -891, -1588? -2485 What is next in 39, 112, 183, 252, 319? 384 What is next in -17, -28, -37, -44, -49, -52, -53? -52 What is the next term in 33118, 33116, 33114, 33112, 33110, 33108? 33106 What is next in 22, 32, 46, 64, 86? 112 What is the next term in 23, 44, 65? 86 What is next in -64, -55, -44, -31, -16? 1 What is next in 577, 579, 581, 583? 585 What is the next term in 0, 38, 144, 354, 704, 1230, 1968, 2954? 4224 What comes next: 257, 310, 373, 452, 553? 682 What comes next: 592, 1182, 1758, 2314, 2844, 3342, 3802? 4218 What comes next: 58, 77, 118, 187, 290, 433, 622? 863 What is the next term in 675, 669, 651, 615, 555, 465, 339, 171? -45 What is next in 15, 28, 43, 60, 79, 100? 123 What is the next term in -122, -180, -240, -302, -366? -432 What is the next term in -12, -27, -52, -93, -156, -247? -372 What is next in 67, 325, 745, 1321, 2047? 2917 What comes next: 126, 268, 512, 864, 1330, 1916? 2628 What is the next term in 139, 149, 165, 187, 215, 249, 289? 335 What is next in 732, 730, 728, 726, 724, 722? 720 What is the next term in -586, -609, -636, -667? -702 What comes next: -21780, -21803, -21840, -21897, -21980? -22095 What comes next: -16, -67, -152, -271, -424? -611 What comes next: 7159, 14318, 21477? 28636 What is the next term in 134, 136, 138, 140, 142? 144 What is the next term in -53, -242, -557, -998, -1565, -2258? -3077 What is next in -56, -53, -48, -41, -32, -21, -8? 7 What is the next term in -24, -23, -22, -21, -20, -19? -18 What comes next: 573, 567, 561, 555? 549 What is the next term in -2791, -2792, -2793, -2794, -2795, -2796? -2797 What is next in -224, -446, -666, -884, -1100? -1314 What is next in -12, -18, -42, -90, -168, -282, -438? -642 What comes next: -103, -244, -383, -520? -655 What comes next: 50, 126, 256, 440? 678 What comes next: 5, -14, -53, -112, -191, -290, -409? -548 What is next in -347, -691, -1033, -1373, -1711, -2047? -2381 What comes next: 68, 144, 222, 302, 384? 468 What is the next term in 9, 4, -5, -18? -35 What is the next term in -913, -919, -937, -973, -1033, -1123, -1249? -1417 What is the next term in -5093, -10184, -15275, -20366, -25457? -30548 What is the next term in -1412, -2817, -4222, -5627, -7032? -8437 What is the next term in -281, -275, -259, -227, -173? -91 What is the next term in -307, -326, -345, -364? -383 What comes next: 664, 1330, 1996, 2662, 3328? 3994 What comes next: 6, 5, 4, 3, 2? 1 What is next in -1941, -3859, -5765, -7653, -9517, -11351, -13149? -14905 What comes next: 9692, 19391, 29100, 38825, 48572, 58347? 68156 What is next in 53, 89, 135, 197, 281, 393, 539, 725? 957 What is next in -17, -19, -31, -59, -109? -187 What is next in -1, 6, 25, 62, 123, 214? 341 What comes next: 8, 27, 52, 83? 120 What comes next: -46, -48, -76, -142, -258, -436? -688 What is the next term in -114, -240, -370, -504, -642, -784? -930 What comes next: -194, -197, -200, -203, -206, -209? -212 What is the next term in 40, 72, 106, 142, 180? 220 What is the next term in -13320, -13321, -13322, -13323, -13324? -13325 What comes next: 46, 96, 150, 208, 270, 336, 406? 480 What comes next: -109, -114, -131, -166, -225, -314, -439, -606? -821 What is the next term in 76, 119, 162, 205, 248? 291 What comes next: 155, 607, 1351, 2387? 3715 What is the next term in 8, 17, 26, 35, 44? 53 What is the next term in 19, 37, 45, 37, 7, -51, -143, -275? -453 What comes next: -192, -776, -1744, -3090, -4808? -6892 What is the next term in -23, -49, -81, -125, -187? -273 What is the next term in 440, 864, 1278, 1676, 2052, 2400, 2714? 2988 What is next in -859, -888, -937, -1006? -1095 What is next in 315, 633, 951? 1269 What is next in 418, 842, 1266, 1690, 2114, 2538? 2962 What is the next term in 45, 42, 39? 36 What is next in -17, -45, -83, -131, -189? -257 What comes next: -5413, -10825, -16237, -21649, -27061, -32473? -37885 What is the next term in 122, 126, 130, 134, 138? 142 What comes next: -163, -165, -167, -169? -171 What is the next term in 82, 158, 236, 316, 398, 482, 568? 656 What comes next: -246, -242, -236, -228, -218? -206 What is next in -5, -64, -231, -560, -1105, -1920, -3059, -4576? -6525 What is next in 280, 1119, 2510, 4447, 6924? 9935 What comes next: -3071, -3072, -3075, -3080? -3087 What is the next term in 490, 481, 458, 415, 346, 245, 106? -77 What is next in -366, -1463, -3290, -5847, -9134? -13151 What is the next term in 238, 478, 718, 958, 1198? 1438 What comes next: 7, 25, 69, 145, 259, 417, 625, 889? 1215 What is the next term in -31, -42, -67, -112, -183, -286, -427, -612? -847 What comes next: 29, 35, 43, 53? 65 What comes next: -130, -272, -428, -604, -806? -1040 What is the next term in 472, 942, 1412, 1882? 2352 What is next in 172, 343, 514, 685, 856, 1027? 1198 What is the next term in -5, 287, 1081, 2629, 5183, 8995? 14317 What comes next: -42, -607, -2142, -5133, -10066, -17427? -27702 What comes next: 28, 69, 128, 205? 300 What is the next term in -79, -599, -2017, -4783, -9347, -16159, -25669? -38327 What comes next: -688, -688, -686, -682, -676, -668? -658 What is the next term in -112, -199, -264, -313, -352, -387? -424 What is next in -11, -4, 9, 28, 53? 84 What comes next: 254, 257, 260, 263? 266 What comes next: 12048, 12050, 12052, 12054, 12056? 12058 What is the next term in 93, 185, 277, 369, 461, 553? 645 What is next in 41, 56, 105, 206, 377, 636? 1001 What is next in 1112, 1112, 1110, 1106, 1100? 1092 What comes next: 66, 69, 60, 33, -18, -99, -216, -375? -582 What comes next: 13, 5, -13, -47, -103, -187, -305, -463? -667 What is the next term in -859, -855, -849, -841? -831 What is next in -72, -143, -206, -261, -308, -347? -378 What comes next: 11, -22, -85, -184, -325? -514 What is next in 20, 0, -46, -130, -264? -460 What is the next term in 89, 140, 201, 272, 353? 444 What is next in 109, 253, 397? 541 What is the next term in 38, 38, 28, 2, -46, -122, -232, -382? -578 What is next in 287, 288, 289, 290? 291 What is the next term in 250, 492, 736, 982? 1230 What is next in -134, -133, -132, -131, -130, -129? -128 What is the next term in -23, -110, -255, -458, -719, -1038? -1415 What comes next: 123, 248, 373, 498? 623 What comes next: 9, 32, 53, 72, 89? 104 What is the next term in 22, 22, 20, 16, 10, 2, -8? -20 What is the next term in -578, -577, -574, -569? -562 What is the next term in -29, -50, -65, -80, -101? -134 What comes next: -84, -70, -42, 6, 80? 186 What comes next: -2	{ "pile_set_name": "DM Mathematics" }
111111111 -214124332 (base 5) to base 9 -1662344 -a631a3 (base 11) to base 7 -20320541 What is 908a7 (base 14) in base 9? 578555 Convert -723107 (base 8) to base 4. -322121013 -37469 (base 10) to base 2 -1001001001011101 What is -a92d57 (base 16) in base 15? -e90161 Convert -110101111010 (base 3) to base 15. -4c3b0 Convert -5d0bac (base 14) to base 2. -1100001011000000110100 What is 113243130 (base 6) in base 8? 10056376 391229 (base 14) to base 7 22452152 1020331130 (base 4) to base 11 194587 Convert -a1b5 (base 12) to base 5. -1030221 -b0277 (base 13) to base 3 -120222120010 What is -fba7 (base 16) in base 2? -1111101110100111 What is -12020100011001 (base 3) in base 6? -135343301 Convert 14341341 (base 6) to base 2. 1111000111100111101 -200412200 (base 5) to base 12 -323a6b 15419994 (base 10) to base 15 1548d49 -333144012 (base 5) to base 4 -11210100321 -12424044 (base 6) to base 12 -178024 -25288 (base 15) to base 10 -118703 What is -98268 (base 13) in base 12? -113209 246383 (base 10) to base 16 3c26f Convert 43891 (base 11) to base 3. 10020021111 Convert -23375c (base 15) to base 2. -110011010101111101100 What is 34721 (base 10) in base 12? 18115 What is 256051 (base 8) in base 12? 436b5 20221221102210 (base 3) to base 10 3699264 Convert -1111001001001101111000 (base 2) to base 10. -3969912 Convert 100111100101101001010 (base 2) to base 4. 10330231022 What is 186a028 (base 12) in base 10? 5118368 What is 523130244 (base 6) in base 4? 202300002310 What is -d2842 (base 14) in base 12? -205162 -2201330131 (base 4) to base 5 -132211300 Convert -b08ebd (base 15) to base 16. -7febdd Convert 1036b20 (base 12) to base 6. 145331240 133102020 (base 4) to base 15 27e76 What is -155417 (base 11) in base 12? -b7859 -90b862 (base 14) to base 5 -2221403004 What is 1f0a3 (base 16) in base 3? 20110101212 Convert -11212000111111 (base 3) to base 16. -275995 What is -2868b (base 13) in base 9? -125012 What is -1030022202 (base 4) in base 9? -524843 What is 10122112120 (base 3) in base 6? 1312323 Convert 1459ba5 (base 14) to base 5. 10013244114 -3a8680 (base 12) to base 6 -32432240 Convert -316865 (base 13) to base 7. -12556226 Convert -147688 (base 9) to base 5. -10402322 Convert -4653b (base 13) to base 4. -133111001 What is 133a1 (base 11) in base 14? 6d6c -10011000110100110 (base 2) to base 14 -20730 1101100111011110100 (base 2) to base 16 6cef4 2400531 (base 6) to base 14 335b1 Convert 3005540 (base 6) to base 8. 423704 What is 5514223 (base 9) in base 7? 34114614 What is -45aa7 (base 16) in base 13? -9cb61 Convert 472687 (base 9) to base 2. 1000101010111110010 What is -112132132 (base 4) in base 14? -2579c What is 22113510 (base 6) in base 10? 663090 What is 364542 (base 9) in base 2? 110101101011100000 What is 12ab4c2 (base 13) in base 7? 100656606 14124342 (base 5) to base 7 1144324 What is 2011202100 (base 3) in base 8? 123517 What is 48da11 (base 16) in base 3? 22222120021021 What is 5c4014 (base 14) in base 2? 1100000011110000010010 -22261623 (base 7) to base 6 -105220030 What is -136705 (base 9) in base 7? -465650 -41339d (base 16) to base 11 -2459454 -10cadb (base 16) to base 11 -691911 Convert a002b4 (base 13) to base 9. 6878756 What is 57d27d (base 14) in base 8? 13330037 Convert -497228 (base 10) to base 3. -221021001212 What is 667856 (base 10) in base 8? 2430320 a13440 (base 13) to base 15 4e0b5a What is 448074 (base 9) in base 8? 1014063 -2343224412 (base 5) to base 13 -118886b What is -4865667 (base 9) in base 3? -11222012202021 707240 (base 8) to base 11 14a168 -a87ef (base 16) to base 8 -2503757 250095 (base 10) to base 8 750357 266b43 (base 14) to base 9 2438275 Convert -34004523 (base 7) to base 5. -1223132414 What is 1363577 (base 11) in base 16? 23d0ea What is -2111002022 (base 3) in base 11? -3381a What is -a6153 (base 12) in base 6? -4400543 What is 12002202100 (base 3) in base 11? 694a3 -33010123 (base 4) to base 16 -f11b What is -a5a48 (base 16) in base 8? -2455110 Convert 282372 (base 9) to base 16. 2a140 What is 664650 (base 7) in base 11? 7a958 Convert 11210013321 (base 4) to base 14. 29d837 -25310134 (base 7) to base 9 -4266764 Convert -144b257 (base 12) to base 8. -17447643 What is 11001000110111110001 (base 2) in base 16? c8df1 What is -11121220010210 (base 3) in base 5? -1112131130 -30cb98 (base 13) to base 11 -710199 Convert 17a4 (base 16) to base 5. 143202 What is -138423 (base 13) in base 8? -1640171 133111013 (base 5) to base 8 2447656 Convert 62edf (base 16) to base 12. 1765bb Convert 26a36 (base 12) to base 8. 150112 Convert -14c22 (base 16) to base 14. -22db4 What is -293eb9 (base 15) in base 2? -111100101010011110000 -101111000010000001011 (base 2) to base 16 -17840b Convert -1331213020 (base 4) to base 3. -222010202201 Convert 1dba47 (base 16) to base 14. 389dd5 81788 (base 10) to base 8 237574 Convert 134e29 (base 15) to base 12. 389003 -10042330 (base 5) to base 11 -55915 Convert -1bbb1 (base 16) to base 14. -2d573 What is 30164552 (base 7) in base 8? 11431510 -1134313 (base 5) to base 14 -7a2c Convert -927069 (base 11) to base 5. -340110013 What is 10000100000111100 (base 2) in base 4? 100200330 Convert -1168561 (base 9) to base 15. -c874d Convert 4354541 (base 7) to base 15. a8648 Convert -26329d (base 14) to base 3. -2110210201021 What is -17aba0 (base 16) in base 13? -424110 Convert -252397 (base 11) to base 2. -1100001010001100110 What is -113933 (base 11) in base 10? -180810 What is -1273594 (base 11) in base 7? -24464322 What is -1031300223 (base 4) in base 16? -4dc2b Convert -23552004 (base 6) to base 2. -10110110000010100100 Convert -10031042 (base 5) to base 4. -103210103 -9c53 (base 15) to base 2 -1000000110000001 Convert 9260f8 (base 16) to base 6. 541340224 What is -120036 (base 9) in base 14? -1c456 Convert 2127291 (base 10) to base 16. 2075bb What is 1212355 (base 6) in base 4? 33221033 1334121421 (base 5) to base 13 92c80b 71061626 (base 8) to base 12 5019a46 -1983634 (base 10) to base 16 -1e4492 What is -1021231103 (base 4) in base 8? -1115523 -1093894 (base 16) to base 9 -35631864 What is -53304 (base 11) in base 2? -10010111011111101 -210c67 (base 14) to base 6 -35533003 -1186822 (base 9) to base 16 -9e354 What is 221b20 (base 13) in base 8? 3041716 -975030 (base 10) to base 2 -11101110000010110110 Convert -121478 (base 11) to base 6. -4041545 Convert 3610 (base 14) to base 10. 9422 197a442 (base 11) to base 16 32ec83 Convert 153100402 (base 6) to base 3. 20001221212102 Convert 12213032 (base 4) to base 12. 13812 What is 22313033 (base 5) in base 2? 110000010100000101 Convert 72550 (base 8) to base 13. 108b0 What is 442289 (base 10) in base 3? 211110201002 Convert -33360 (base 10) to base 16. -8250 Convert 113010002 (base 4) to base 3. 11210120202 Convert 7918814 (base 10) to base 12. 279a792 231411 (base 8) to base 7 445105 What is -1241203312 (base 5) in base 12? -10401b3 What is af0958 (base 16) in base 12? 3a12508 What is 32753 (base 15) in base 11? aa468 Convert -330542 (base 8) to base 15. -22d16 Convert 2401102 (base 8) to base 2. 10100000001001000010 Convert -263bd8 (base 16) to base 9. -4638137 Convert 544453 (base 8) to base 16. 2c92b Convert -2044324 (base 6) to base 4. -120102130 What is -768a1 (base 14) in base 4? -1012011231 1122102122110 (base 3) to base 2 11010101100000101110 Convert -23131341 (base 5) to base 8. -626732 Convert -26611662 (base 7) to base 16. -257d48 Convert 1022854 (base 10) to base 11. 639538 442040411 (base 5) to base 14 37990c Convert 10204333231 (base 5) to base 16. a2108a What is 1011110000111110001 (base 2) in base 14? a06d3 What is -7402234 (base 9) in base 2? -1111000110010010101110 Convert -101101001100011101011001 (base 2) to base 15. -1090593 What is -10130451 (base 6) in base 14? -78491 Convert -20703 (base 10) to base 7. -114234 67663 (base 9) to base 2 1010111111010100 386529 (base 11) to base 2 10010100101010000111 Convert 7383878 (base 10) to base 11. 4193687 Convert -1da3 (base 14) to base 8. -12473 Convert 43894 (base 10) to base 8. 125566 What is 44ac61 (base 13) in base 16? 18c5c5 -1c6348 (base 15) to base 16 -152d5c -352155 (base 8) to base 16 -1d46d Convert -12210120122 (base 3) to base 5. -12123041 What is 32434 (base 10) in base	{ "pile_set_name": "DM Mathematics" }
0)(2a - 3a + 3a)(-8 + 2 + 4 + (0 + 1 + 0)(-1 + 3 - 4))(-174 + 45 - 214). -2744a*3 Expand (-1 + 4 - 1)(2 - 2 + 5m)(67 - 192 + 60 + 65 + 7130m). 71300m*2 Expand (-44 + 6793f*3 - 13607f*3 + 6866f*3 - 1)(-2f + f + 0f). -52f4 + 45f Expand (-17 - 22 - 96)((-2 + 2 + p)(-2 + 3 - 2) + 9p - 5p - 7p)(1 - 2 - 2)(2 + 3 - 4). -1620p Expand (-5871k4 - 16648k*2 - 3397k*4 + 16648k*2 - 3243k*4)(-1 - k + 1). 12511k5 Expand (-4 + 2 - 3)(5 - i - 5) + (-i - 4i + 4i)(-3 + 2 - 1) + 86i + 91i - 44i. 140i Expand (-2z - z*3 + 2z)(-3z*2 - 4z*2 + 5z2) - z4 + z*4 + 2z*5 + 4z4 + z5 - 4z4 + 112z + 0z5 - 114z + 13z2 - 2z*5. 3z*5 + 13z*2 - 2z Expand (4 - 2g - 4 - 4g + 4 - 4 + 0g + 4g - 2g + (3 + g - 3)(2 + 0 - 1))(-15 + 5 - 3)(5 - g*2 - 5). -39g*3 Expand (-1 + l + 1)(-5l - 2l + 0l) - 3l*2 - 4l*2 - 2l2 + l2 - 3 - 14l + 15l - 5. -15l2 + l - 8 Expand (15c*4 - 14c*4 - 109c + 74c)(2 - 1 + 0 - 4c) + (-c4 - 4c*2 + 4c*2)(-2c + c + 0c) - c*5 + 2c5 + c5. -c5 + c4 + 140c2 - 35c Expand (0 + 2 - 1)(-4s + 3s + 5s) + (-15 - 4s + 15)(0 - 1 + 2) - 4s + 2s - 4s. -6s Expand (36l2 + 28l*2 + 32l*2)(l + 9l + 3l - 2l + 3 - 3 + (-4l + 3l + 0l)(-1 - 3 + 3) - 2l + l + 0l + l - l - 2l). 864l3 Expand 1327 - 2611 + 1319 + 7z + (4 - 3 - 2)(-2z + 6z - 2z). 5z + 35 Expand (-h + h + h + (-2h - 2 + 2)(-2 + 3 - 2))(23h4 + 35h*4 - 11h*4). 141h5 Expand (x2 - 2x2 - 5x*2)(-x*2 - 2x3 + x2) + x*5 + 4x*2 - 4x*2 + 65x*5 + 8125x*4 - 8125x*4. 78x*5 Expand (723804 - 723804 + 4760i)((-5i - i + 4i)(2 - 4 + 1) + 5i - 4i + i) + 0i2 - i2 + 0i*2 + (4 - 4 + 2)(3i2 + 0i*2 - 5i*2). 19035i*2 Expand (1212b - 604b + 3828b)(0 - 1 + 6). 22180b Expand (-3i3 + 4i*3 - 2i*3)(2 + 1 - 2)(326911i - 326911i - 671i*2). 671i*5 Expand (2 + 4 - 5)(0 - 2 - 8)(218 + 17r*4 - 218). -170r*4 Expand (-1 - 2 + 1)(3m - 4m + 3m) + 146 + 200 + 202 + m. -3m + 548 Expand (8j2 + 930j*4 - 9j*2 - 1878j*4)(-2 + 3 + 1)(4 - 5 + 2). -1896j*4 - 2j*2 Expand (-13w*3 + 8 - 8)(-148w2 - 2028w + 2028w - 2). 1924w*5 + 26w*3 Expand (-4j*4 + 4j4 + j4)(-3 - 1 + 5) - 275j*2 - 276j*2 + 834j*2 - 986j*4 - 284j*2. -985j4 - j2 Expand (29b + 127b + 66b + 25b)(-16b + 7b - 3b). -2964b2 Expand (-5u + 0u + 0u)(5u + u*3 - 5u) + 47u + 4u*4 - 47u + (-u*4 - 2u*4 + 6u*4)(-3 + 0 - 1). -13u4 Expand ((s + 3 - 3)(4 - 2 + 4s + 2s) + 2s2 + 0s*2 - 6s*2 + (-2 - 1 + 1)(4 - 4 + s2) - s2 + 4s - 4s)(-3 + 3 - 1). s2 - 2s Expand (-4c + 4c - c)(2c - c*2 - 2c) + (-239c3 - 473c*3 + 1182c*3)(0 + 1 - 4). -1409c3 Expand ((3x - x - x)(2 - 4 + 0) - 25x - 8 + 8)(x2 - 1 + 1). -27x*3 Expand 2d + 4d2 - 2d2 + d2 - d*4 - 50d*4 + 93d*4 + 52d4 + (-d3 + 0d3 + 3d*3)(-4d + 0d + 0d). 86d*4 + 3d*2 + 2d Expand 47n + 45 - 39n - 9n + (-4 + 4 - n)(3 - 1 - 4). n + 45 Expand (-233 + 4q + 649 - 280)(-1 + 2 + 1). 8q + 272 Expand (-152d + 164d - 413d)(2d - 2d - d2) + 4 - 2d*3 - 4. 399d*3 Expand (2 - 3r*2 - 2)(-r*2 - 3r*2 + 3r*2) + (-205 - 218 + 430)(3r3 - 3r*3 - 2r*4). -11r*4 Expand (2y + y - 3y - 4y*2)(145 - 11 - 721)(-2 - y2 + 2)(-3 + 2y + 3). -4696y*5 Expand (3j + 12j - 3j)(-2j*2 + 0j*2 + 3j*2) + 121j*3 - 96j*3 - 106j*3. -69j*3 Expand 22v*4 - 22v*4 - 12v*5 + (-2 + 5 - 1)(-v5 - v3 + v*3) + 3v*5 + 4v*5 - 2v*5 - 5 - 2v*5 + 3 + 13v*4 - 8v*4. -11v*5 + 5v*4 - 2 Expand (-2 + 2 + p + (-1 - 1 - 1)(-2p + 3p + 0p))(16p + 5p + 2p). -46p*2 Expand (-5z*2 + 1 + 10728z - 10760z + 20z*2)(9z - 15 + 15). 135z*3 - 288z*2 + 9z Expand (1264a4 - 951a*4 - 691a*4)(-3 - 2 + 4). 378a4 Expand (-62s - 100s + 12s - 65s)(-7s3 + 8s*3 + 8s*3). -1935s*4 Expand (-3 - 4 + 3)(0t - 3t + 2t) - 3t + 3t - t + (t - 6t + 2t)(2 - 3 + 3) - 2 - 2t + 2 + (-2 - 2 + 3)(-t - t + 0t) - 23t + 23t + 12t. 9t Expand (0z - 2z + 0z)(-7 + 4 + 0) + (-4 - 2 + 5)(1 - 1 + 2z) + 2z + 0z - 7z + (-z + 2 - 2)(-2 - 2 + 3) + 3z + 2z + 42z. 47z Expand -a4 - 2a*4 + 4a*4 + (0 + 3 - 5)(-2269a4 - 2795a*4 + 235a*4). 9659a*4 Expand (3r*2 - 7r*2 + 3r*2)(-r + 3r + 0r) + 0r3 - 4r*3 + 5r*3 - 3 - 48272096r*2 - 1466r*3 + 0 + 211r*3 + 48272086r*2. -1256r*3 - 10r*2 - 3 Expand (2 - 6 + 3)(-32k - 2909 + 5882 - 2923) + 5k - k - 3k. 33k - 50 Expand -4b5 + 12b*5 + 3b*5 + (-28b - 7b + 12b)(-b - b + 7b)(-2b3 - b2 + b2) - b4 - b5 + b4 - 3b5 + b5 + b5. 239b*5 Expand (2x*3 + 3x*3 - 3x*3)(15x + 55x - 4x)(-3 + 2 + 0)(5 - 6 + 6). -660x*4 Expand (-351 + 84 + 147)(-2 + 1 + 5)(-4c*3 + 0c*3 + 6c*3). -960c*3 Expand -4h + 2h + h + 2h - 2h + h + (2 - 1 - 2)(-3043h + 1597h + 1050h). 396h Expand ((-2 + 0 + 0)(-4 + 1 + 5) - 4 + 0 + 1)(-2 + 2 - 8j + (0 + 3 - 2)(12j + 5j - 8j)). -7j Expand (21909 - 21909 + 310d)(8d - 5d*4 - 51d*3 + 51d*3 + 1). -1550d*5 + 2480d*2 + 310d Expand 2b - 3 + 3 + (-3 - 1 + 0)(2 - 2 + 2b) + (-7 + 1 - 2)(-4b + 4b - 3b) + b + 2b + 3b. 24b Expand (0p2 - 2p*2 + 3p*2)(-p - 3 - 1 - 5)((-p + p - 2p)(-2 + 0 + 0) + 6074 - 6074 + 46p)(0 + 0 - p). 50p*5 + 450p*4 Expand -2t - 4t + 2t + (2 - 1 + 1)(-5t + t + t) + (1 + 2 - 4)(-6t - 4t - 2t) - 3t - 1 + 1 + 0t + 2t - 3t. -2t Expand (11n*3 + 17n*3 - 5n*3)(-34 - 11 + 0). -1035n3 Expand (-k - 3k + 5k)(4 + 2 - 4)(72 + 40 - 101 - 2 - 1 + 1 - 6 + 4 + 0 + (-1 - 1 + 3)(-4 + 1 + 4)). 16k Expand 0 - y2 + 0 + (-y2 + y2 - y2)(3 - 2 - 2) + 0 + y*2 + 0 + 2y*2 - 4y2 + y2 + 17y2 - 7y*2 + 15y*2. 25y*2 Expand (1 + 0 + 1)(-10s5 + 2s*5 + 5s*5) - 5s*5 + 0s*5 - 29s*5 - 2s*5 + 5s5 - s5 + (2s2 + 0s*2 - 4s*2)(0s3 - 8s*3 + 0s*3). -22s*5 Expand (2g*2 + 4g*2 - 3g*2)(-4g2 + g2 + 2g2 - g2 + 0g2 + 5g*2 + (3g + g - 2g)(-3 + 3 + g)) - 4g4 + g4 + 0g*4. 12g4 Expand (y2 + 4y2 - 3y*2)(0 - 1 - 1 - 3 - 2 + 3 + (1 + 2 - 2)(4 - 1 - 4) + 2 + 3 - 3 + 0 + 8 + 7) + 0 + 0 - y2. 23y*2 Expand (-9943 + 21m + 9936 + 17m - 14m)(-2m + m + 3m) + (0m + 3m - 2m)(-4m + 1 - 1). 44m2 - 14m Expand -563 + 10r2 - 604 + 1120 + (3r - 3r + r)(2 - 2 + 2r) - 2r*2 - 2r*2 + 3r*2. 11r*2 - 47 Expand (-4 + 4q*2 + 4)(342q3 - 3615q + 3615q). 1368q*5 Expand 2w*4 + 4w*2 - 4w*2 + (11w - 22w + 9w)(7w*3 + 0w3 + w3) + (-w2 - w2 + 4w2)(-w*2 + 6w*2 - 3w*2). -10w*4 Expand (-3z + 2 - 2)(1134z - 27z2 - 1134z)(-8 + 19 + 7). 1458z*3 Expand (-2d*2 - 2d*2 - 4d*2)(-3d2 + 2d*2 + 5d*2) - 2d*4 + 0d*4 - 2d*4. -36d*4 Expand (-24 + 89h + 24)(28 - 4h - 29 + h). -267h2 - 89h Expand (-25k + 17k + 14k)(-4 + 2 + 4)(15k*4 - 11k*4 + k + 2k*3 - 4k*3). 48k*5 - 24k*4 + 12k2 Expand (-j2 + 3 - 3)(2j3 + j3 - 2j3) + 131j - 131j + 21j*5 + (-3j*3 - 1 + 1)(-j*2 + 3j*2 - 3j*2). 23j*5 Expand -11g + 11g + g2 + (-g - 2g + 2g)(-1 - 3 - 1)(253g - 487g + 128g). -529g2 Expand -3f - 3f5 + 3f + (6f2 + 8f*5 - 6f*2)(-5 - 5 + 5) + (0 + f + 0)(-f4 + 4f*4 - 2f*4). -42f*5 Expand ((-3 + 5 + 0)(-f - 1 + 1) + 2 + f - 2)(254f*2 + 61 - 53f*2 - 59). -201f*3 - 2f Expand (-14 + 64 + 56)(-78r*3 + 4r*3 - 3r*3). -8162r*3 Expand (-2 + 3 + 1)(-n3 - n3 + 0n3) - 3n*3 + 4n*3 + 0n*3 + (-8n*2 + 87n*2 + 43n*2)(-6n + 2n + 2n + (0 + 0 - n)(4 - 3 + 0)). -369n3 Expand (-2g + g + 2g)(1759g + 2227g + 1638g). 5624g*2 Expand (7z*4 + 23z - 23z)(21 - 19 - 37z - z) - 17z*5 - 8z + 8z. -283z*5 + 14z*4 Expand (4n*3 - 2n*3 + 2n*3)(6n2 - 2n*2 - 2n*2) + (-7n + 15 - 15)(8273n*3 + 91n*4 - 8273n*3). -629n*5 Expand (0 + 1 + 5)((5k - 3k + 4k)(-29 + 17 - 8) + k - 3k - k)(-4k2 + 2k2 + k2). 738k3 Expand (-12m*3 + 91m*3 + 6m**4 +	{ "pile_set_name": "DM Mathematics" }
uct of -0.3 and -0.00748? 0.002244 2832.957 * 0.1 283.2957 What is -180 times 2438? -438840 What is the product of 151.844 and -0.01? -1.51844 What is 3 times 1.7842? 5.3526 -105.8073-0.4 42.32292 Multiply 1 and -3913. -3913 -1124614 -124614 Multiply -0.3 and -11.5283. 3.45849 Work out 774 * -30. -23220 Multiply -0.075 and 50. -3.75 -2 * 5419 -10838 10-0.44 -4.4 0.01301 -35 -0.45535 What is the product of 2587 and -66.3? -171518.1 Multiply -64467 and 24. -1547208 Work out 66 * -4. -264 Product of -0.1 and 468177. -46817.7 What is the product of -3 and 6.45125? -19.35375 Product of 0.291542 and 5. 1.45771 Calculate -40.761.33. -54.2108 What is 20 times 3600.9? 72018 Work out 296 0.0885. 26.196 Work out 1.7 * -0.495. -0.8415 Calculate -0.2818.1. -5.068 Multiply -24 and -97351. 2336424 What is 549 times 227? 124623 Product of -45881 and 5. -229405 Multiply 1 and 16.179. 16.179 Work out 0.75 -11.8. -8.85 Product of 5 and 1.44988. 7.2494 -756 * -8 6048 -0.77 * 0.05216 -0.0401632 Multiply 8786.2 and -0.041. -360.2342 -0.6 * -19314 11588.4 -0.31930.35 -0.111755 Product of 123 and -425. -52275 Product of 2.73864 and -3. -8.21592 -169090.2 -3381.8 Product of 18 and 530985. 9557730 -266.6 * -0.1 26.66 0.277 times 168 46.536 Calculate 228-14.08. -3210.24 Multiply 0.2 and -1.0916. -0.21832 0.3 -340.11 -102.033 Product of -14991 and -2. 29982 What is -882 times 0.022? -19.404 Work out -2 * 1.906. -3.812 Product of -8097 and -43. 348171 Product of 55183 and 0.3. 16554.9 What is -39.1652 times 0.3? -11.74956 Multiply 210 and 75. 15750 1.17 times -1193 -1395.81 What is the product of -0.67 and -1.21? 0.8107 Calculate 238218. 51884 Multiply -25.74 and 926. -23835.24 Multiply -10.99 and 0.12. -1.3188 What is the product of 5603 and 0.289? 1619.267 5 times 10390 51950 -0.1953.2 -0.624 2.54.3372 10.843 Calculate -6692. -6072 -39.2 * -73.7 2889.04 Work out -0.02 * -1.3874. 0.027748 Product of -231745 and 0.2. -46349 Multiply -2 and -288.35. 576.7 Calculate -0.38-7427. 2822.26 Product of -29 and 4488. -130152 0.4 29336.9 11734.76 Product of 1632048.1 and -0.4. -652819.24 Product of 862522 and -3. -2587566 What is 4189.11 times 0.4? 1675.644 Work out -42.602 * -7. 298.214 Product of 827 and 0.585. 483.795 -0.3-79793 23937.9 Product of -0.3 and -125982. 37794.6 What is 1329 times -2911? -3868719 Work out 0.5 7541. 3770.5 Multiply -0.0307 and -5.5. 0.16885 What is the product of 0.08 and -3135? -250.8 Multiply -34 and -26418. 898212 0.7 * 23349 16344.3 Calculate -65-6265. 407225 Multiply 0.025 and -1628.1. -40.7025 Calculate 06031. 0 What is -0.05 times -313739? 15686.95 193 times 217 41881 What is 7 times -52846? -369922 -0.04 times 8387.7 -335.508 4153 times 0.2 830.6 -1 * 1901.3 -1901.3 5 * -9714 -48570 Calculate 15-7576. -113640 Product of 16 and 1016.4. 16262.4 Work out -0.03 3. -0.09 -0.2 * 503 -100.6 Work out -9435 * -0.1. 943.5 Product of -37354 and 29. -1083266 -1 times 39.221 -39.221 Product of 7 and 1827. 12789 Calculate 2.630.67. 79.742 Multiply 0.03882 and 641. 24.88362 -0.33018 times 0.06 -0.0198108 What is 1731 times -0.23? -398.13 -58.42 47 -2745.74 Work out -923.616 * -0.1. 92.3616 -359.41 times -0.3 107.823 157 * 101.1 15872.7 Work out 427 * 0.348. 148.596 Calculate 51.413. 7.065 What is the product of 0.2 and -43829? -8765.8 Product of -0.5 and -211134. 105567 Calculate 427-76. -32452 6.586 39.48 -5 times -84.37 421.85 Product of 57.11 and 0.032. 1.82752 Product of -35567 and -0.3. 10670.1 Product of 2 and 0.063772. 0.127544 What is the product of -0.4 and 6663.2? -2665.28 0.107 53.4 5.7138 122.84 * 0.8 98.272 Multiply -85297 and -0.029. 2473.613 Multiply -0.0065 and 78. -0.507 What is the product of -6 and -1.91601? 11.49606 Work out -128 * -12.65. 1619.2 660 * -0.35 -231 Multiply 0.4 and 80.805. 32.322 Calculate -603700.4. -24148 What is the product of 0.3746 and 0.3? 0.11238 Calculate -0.1-5285. 528.5 169-0.1 -16.9 -1.539-259 398.601 Multiply 1237 and 0.27. 333.99 142526 times -0.5 -71263 What is 1063 times 39? 41457 What is the product of -1710.29 and 0.1? -171.029 Work out 311 * -643. -199973 0.09 * 0.304069 0.02736621 Work out -473 * 0.0625. -29.5625 What is -109 times 958? -104422 What is 44 times -1500? -66000 Calculate -1.83-100. 183 What is 43046 times -0.31? -13344.26 What is the product of 2.3 and 1.758? 4.0434 218.95 times 0.2 43.79 -458.52 times 36 -16506.72 Product of 732 and 128.8. 94281.6 What is -50 times -0.82? 41 Work out -0.44 -380.7. 167.508 -0.5645-47 26.5315 Multiply -617434 and 5. -3087170 -0.308140 -43.12 Product of 0.03 and 7386. 221.58 What is 267 times 191? 50997 Multiply 2 and -48443. -96886 Product of -4 and 113597. -454388 -569.74 times -0.1 56.974 What is the product of -2.6 and 2343.27? -6092.502 What is -95059 times -2? 190118 186.2 * -0.03 -5.586 0.334 * -0.12 -0.04008 Product of -1 and 53.943. -53.943 Calculate 17-558. -9486 102.4 0.159 16.2816 Multiply -8051 and -0.235. 1891.985 Product of -1146.556 and -0.3. 343.9668 Calculate 217.453. 34.906 -34.75622-0.3 10.426866 What is the product of 5 and -3.4359? -17.1795 Multiply -0.5 and -1338.5. 669.25 Work out 0.3 * 718780. 215634 What is the product of -16538 and -191? 3158758 Calculate 22-6.2. -136.4 Work out 0.2122 3.4. 0.72148 Work out 0.4 * 21143. 8457.2 Calculate 406-0.02. -8.12 -0.4 -0.5232 0.20928 Calculate 2.30.01587. 0.036501 Product of 0.8 and 0.01249. 0.009992 What is the product of -306924 and -0.3? 92077.2 What is 21.7611 times -0.06? -1.305666 What is the product of -2970705 and -5? 14853525 2 times 0.058128 0.116256 Multiply -213 and -0.01207. 2.57091 Calculate -0.85-2806. 2385.1 Work out -24 * 9587. -230088 What is 7785.3 times -2? -15570.6 Multiply -25923.8 and 2. -51847.6 Work out 0.5 * 350.69. 175.345 What is the product of 0.04 and -56316? -2252.64 Product of 17388 and -1. -17388 Product of 143 and -13.75. -1966.25 Work out -4444.936 * -0.3. 1333.4808 Work out 0.6 * -0.5516. -0.33096 What is the product of -733099 and -0.2? 146619.8 What is the product of -78 and -0.3915? 30.537 Multiply 0.008 and -969. -7.752 -184379 * 0.2 -36875.8 Calculate -0.03321-0.1. 0.003321 Work out 215 -0.2. -43 What is 1650105 times 0.3? 495031.5 Calculate 0.228253.8. 5650.76 -7226.9 -1936.8 Work out -0.0027406 * 0.05. -0.00013703 -0.0624.38 -0.27156 Calculate -10822-1.4. 15150.8 Work out -18807.96 * 1. -18807.96 -39.52.305 -91.0475 Product of 64 and 79. 5056 Product of -6 and -51847. 311082 Work out -0.273171 12. -3.278052 -0.3196831 -0.319683 0.412055 times -1.1 -0.4532605 Calculate 115282. 32430 0.1280.9 9.708 Calculate 31-991.4. -30733.4 -321 * -0.255 81.855 Work out 0.243 * -205. -49.815 Product of 0.08 and -335.2. -26.816 -0.1 * -26.5209 2.65209 Work out 20.81 * 17. 353.77 4.6064 times -0.44 -2.026816 1097911 120769 Product of 2 and 1560818. 3121636 What is 2 times -57303? -114606 -0.96023 -5420.7 Calculate 1-16240. -16240 What is -5 times 642055? -3210275 What is -8.6 times -0.0779? 0.66994 -0.072985 times 0.4 -0.029194 0.15 times -12681 -1902.15 0.4322 times -18.3 -7.90926 23380.078 182.364 Calculate 812-73. -59276 Work out 136.8 16. 2188.8 Product of 0.02 and -0.04183. -0.0008366 -4 times 6.4839 -25.9356 What is 321 times -142? -45582 -12 * 0.4975 -5.97 Work out 65242 * 0.1. 6524.2 Calculate 33070.7. 2314.9 Calculate 0.449590.4. 0.179836 Work out 0.5 * -56.932. -28.466 What is -0.745 times -127? 94.615 What is the product of 136 and 5764? 783904 6-172.2 -1033.2 Multiply -6.8 and 56495. -384166 -8042 times -3.2 25734.4 What is the product of 0.5 and 1324465? 662232.5 -32282 -6846 What is the product of -10752.71 and 0.2? -2150.542 20507 * 5 102535 -485.3013 times -0.5 242.65065 What is 0.31 times -0.0386? -0.011966 What is -13860 times 0.2? -2772 Work out -2115 * 0.3. -634.5 -30550 times 20 -611000 What is the product of -5 and -1.6604? 8.302 -77-143.98 11086.46 -0.5-211683 105841.5 What is -5 times 0.06015? -0.30075 1 times -29.983 -29.983 -0.347411 -3.8214 Product of -58 and 12.821. -743.618 -2188 90 -196920 7850.65 * -1 -7850.65 Calculate 220.982*-5. -1104.91 What is the product of 65304 and 0.7? 45712.8 What is 6.18396 times 0.3? 1.855188 What is the product of 2.	{ "pile_set_name": "DM Mathematics" }
of picking 3 i when three letters picked without replacement from {i: 14, l: 2, y: 1}. 91/170 Calculate prob of picking 1 r and 1 i when two letters picked without replacement from jjxsixsjssyr. 1/66 Three letters picked without replacement from {a: 1, v: 1, s: 5, u: 3, f: 2}. Give prob of picking 1 f and 2 u. 3/110 Calculate prob of picking 1 k and 1 j when two letters picked without replacement from jukupub. 1/21 Four letters picked without replacement from {c: 4, l: 6}. Give prob of picking 4 c. 1/210 Three letters picked without replacement from ooepiieiioiiopeii. Give prob of picking 2 p and 1 o. 1/170 Calculate prob of picking 1 h and 1 q when two letters picked without replacement from ihiqhhhhqhhqhihhhh. 4/17 Calculate prob of picking 1 b and 2 n when three letters picked without replacement from nnnbnnb. 4/7 What is prob of picking 3 u and 1 h when four letters picked without replacement from {h: 1, u: 6, i: 2, t: 3}? 4/99 Calculate prob of picking 1 h and 1 n when two letters picked without replacement from {h: 11, n: 3}. 33/91 What is prob of picking 2 p and 1 y when three letters picked without replacement from {c: 2, y: 1, p: 2}? 1/10 What is prob of picking 2 q and 1 l when three letters picked without replacement from {l: 1, q: 7}? 3/8 What is prob of picking 3 w and 1 h when four letters picked without replacement from wwhwwwwhw? 5/9 Two letters picked without replacement from {t: 1, x: 2, v: 6, l: 4}. Give prob of picking 1 l and 1 t. 2/39 Four letters picked without replacement from {i: 1, f: 1, k: 1, g: 2, j: 2}. What is prob of picking 1 f, 1 k, 1 j, and 1 g? 4/35 Calculate prob of picking 2 p when two letters picked without replacement from pppaj. 3/10 Three letters picked without replacement from {q: 3, z: 8}. Give prob of picking 3 z. 56/165 Three letters picked without replacement from {f: 4, x: 3, z: 3, c: 2, i: 4, p: 2}. Give prob of picking 2 c and 1 f. 1/204 Calculate prob of picking 2 f when two letters picked without replacement from tysqqdfqtfsyfs. 3/91 Four letters picked without replacement from ggzggzzgggz. What is prob of picking 4 g? 7/66 Two letters picked without replacement from qqqhqqkqhkqq. What is prob of picking 1 q and 1 k? 8/33 Two letters picked without replacement from {c: 9}. Give prob of picking 2 c. 1 Three letters picked without replacement from avovytdt. Give prob of picking 1 a, 1 o, and 1 d. 1/56 Calculate prob of picking 1 s and 1 v when two letters picked without replacement from vvvvvvsssv. 7/15 Calculate prob of picking 1 r and 3 f when four letters picked without replacement from {f: 5, v: 3, r: 2}. 2/21 Two letters picked without replacement from {n: 1, g: 3, e: 2, c: 1, z: 3, j: 2}. Give prob of picking 2 j. 1/66 Three letters picked without replacement from jajjqaaaranjjarjuu. Give prob of picking 1 u, 1 q, and 1 n. 1/408 Three letters picked without replacement from nnjynncnccynjjn. What is prob of picking 2 c and 1 y? 6/455 Two letters picked without replacement from oozxztzszz. Give prob of picking 1 t and 1 x. 1/45 What is prob of picking 2 z when two letters picked without replacement from {b: 1, z: 1, p: 1, s: 1, c: 1}? 0 What is prob of picking 1 w, 1 z, and 2 g when four letters picked without replacement from {r: 1, w: 3, g: 3, b: 1, z: 2}? 3/35 Calculate prob of picking 2 v, 1 j, and 1 u when four letters picked without replacement from vjjnjumujuynuyjnvjy. 2/323 Four letters picked without replacement from {s: 4, f: 7}. Give prob of picking 4 s. 1/330 Four letters picked without replacement from {y: 1, r: 1, p: 3}. What is prob of picking 3 p and 1 r? 1/5 Three letters picked without replacement from {h: 1, n: 3, f: 1, u: 1, d: 6}. Give prob of picking 1 h, 1 d, and 1 n. 9/110 Three letters picked without replacement from mgufsggugugm. What is prob of picking 2 u and 1 s? 3/220 Calculate prob of picking 2 a when two letters picked without replacement from annkyooyoooaknayaa. 10/153 Three letters picked without replacement from uucccul. Give prob of picking 3 l. 0 Four letters picked without replacement from {x: 3, r: 2, k: 3}. Give prob of picking 3 k and 1 x. 3/70 Three letters picked without replacement from xebxbmxjx. Give prob of picking 1 m and 2 b. 1/84 Calculate prob of picking 1 i and 3 w when four letters picked without replacement from {i: 2, w: 5, r: 3}. 2/21 Four letters picked without replacement from orovrzouzzvvzvaouoro. Give prob of picking 2 z, 1 r, and 1 v. 24/1615 Calculate prob of picking 3 g when three letters picked without replacement from {v: 2, g: 2}. 0 Three letters picked without replacement from wywlwlbzlllywyfywyf. Give prob of picking 3 w. 10/969 What is prob of picking 2 v, 1 q, and 1 x when four letters picked without replacement from {b: 6, q: 1, t: 1, k: 1, v: 1, x: 3}? 0 What is prob of picking 1 w and 1 t when two letters picked without replacement from wuwbuqurwtrrur? 3/91 What is prob of picking 2 a and 1 u when three letters picked without replacement from uaafauu? 9/35 Two letters picked without replacement from {p: 7, d: 7}. What is prob of picking 2 d? 3/13 Three letters picked without replacement from {b: 1, l: 4, o: 5, u: 1, r: 7, t: 1}. Give prob of picking 1 u, 1 r, and 1 l. 28/969 Calculate prob of picking 1 j and 3 o when four letters picked without replacement from jbfjbfbbojjjfbojob. 1/510 Two letters picked without replacement from {u: 2, j: 5}. What is prob of picking 2 j? 10/21 Two letters picked without replacement from qquduqquq. Give prob of picking 1 u and 1 d. 1/12 What is prob of picking 1 g, 1 l, and 1 j when three letters picked without replacement from {y: 1, l: 4, u: 2, j: 7, g: 1}? 4/65 Four letters picked without replacement from {d: 12, j: 2, w: 4, h: 1}. Give prob of picking 3 d and 1 w. 220/969 Two letters picked without replacement from vvvhvhvvvvvv. What is prob of picking 1 h and 1 v? 10/33 Three letters picked without replacement from {i: 6, y: 5, m: 3, h: 1, x: 3}. Give prob of picking 1 h and 2 m. 1/272 Calculate prob of picking 1 i and 1 t when two letters picked without replacement from ixeonintinntinnnxeie. 1/19 What is prob of picking 1 u and 1 g when two letters picked without replacement from {j: 3, g: 1, s: 1, w: 1, q: 2, u: 4}? 2/33 Four letters picked without replacement from {q: 2, i: 1, x: 3, j: 1, g: 10, n: 2}. What is prob of picking 1 q and 3 i? 0 Two letters picked without replacement from byybydyd. What is prob of picking 1 y and 1 d? 2/7 Calculate prob of picking 3 r when three letters picked without replacement from ffrfffrrff. 1/120 Three letters picked without replacement from bmrwl. Give prob of picking 1 b, 1 m, and 1 r. 1/10 What is prob of picking 1 b, 1 k, and 2 d when four letters picked without replacement from bkdxxxbkbxdbdbbbxxb? 4/323 Three letters picked without replacement from {d: 4, c: 8, t: 4, h: 2, n: 1}. Give prob of picking 1 h, 1 t, and 1 d. 32/969 Calculate prob of picking 3 a when three letters picked without replacement from {a: 4, e: 15}. 4/969 Calculate prob of picking 2 y, 1 r, and 1 c when four letters picked without replacement from yycsrycyycccyy. 15/143 Two letters picked without replacement from {c: 5, p: 11}. What is prob of picking 2 c? 1/12 What is prob of picking 4 q when four letters picked without replacement from qrqqqr? 1/15 Three letters picked without replacement from xfhzozzxzhx. Give prob of picking 2 z and 1 h. 4/55 Three letters picked without replacement from {z: 7}. What is prob of picking 3 z? 1 Four letters picked without replacement from {n: 3, k: 2, x: 6, r: 1, b: 1}. What is prob of picking 1 r, 1 x, 1 k, and 1 n? 36/715 Two letters picked without replacement from {u: 3, b: 2, g: 5, h: 2}. Give prob of picking 1 g and 1 h. 5/33 Four letters picked without replacement from emqmqqqmpmhq. What is prob of picking 2 q, 1 e, and 1 m? 8/99 Calculate prob of picking 1 n and 1 m when two letters picked without replacement from mnnn. 1/2 Calculate prob of picking 2 u when two letters picked without replacement from uubbbbu. 1/7 Calculate prob of picking 2 f, 1 p, and 1 u when four letters picked without replacement from ufpffddxxx. 1/70 Calculate prob of picking 2 o when two letters picked without replacement from {u: 11, o: 3}. 3/91	{ "pile_set_name": "DM Mathematics" }
ivative of -307491l3 - 17621l*2 wrt l? -1844946 What is the second derivative of 380075wy2 - 7wy - 146w - 4y2 - 7y - 1 wrt y? 760150w - 8 Find the second derivative of 515l5 - l4 - 63l3 + 58259l wrt l. 10300l3 - 12l*2 - 378l What is the third derivative of 329l5 + 2l*4 - 67207l*2 - 2? 19740l*2 + 48l Differentiate -3npx2 + 128npx - 29np - n - 73x2 + 4x wrt p. -3nx*2 + 128nx - 29n What is the first derivative of 26556b4y*3 + 98b*2y*3 + 104262y*3 + 2y*2 + y - 1 wrt b? 106224b*3y*3 + 196by3 Find the third derivative of -3i*3x*3 - 2i*3x + 13i2x*3 + 8x*3 - 10270x*2 wrt x. -18i*3 + 78i*2 + 48 Find the second derivative of 4230869b*3 + 1598758b wrt b. 25385214b What is the second derivative of -123857v*3x*2 + 50v*3 + 106v*2 + 2x*2 + x wrt x? -247714v*3 + 4 What is the derivative of -2254d*2w - 2d2 + 167dw + 2191w - 254 wrt d? -4508dw - 4d + 167w What is the second derivative of -17707x4 - 132383x wrt x? -212484x2 Differentiate -128925o + 62367. -128925 Find the second derivative of -11428c5u3 - c2u3 - 9cu - 4u*3 + 85u wrt c. -228560c3u*3 - 2u*3 Find the first derivative of 34p*3y - 1562823p3 + 375py + 2p - 7y wrt y. 34p*3 + 375p - 7 Find the first derivative of 5201723i - 3245602. 5201723 What is the second derivative of -1396f*3 - 72f*2 + 526895f? -8376f - 144 Differentiate 4tz2 + 228tz + 36t + 6z2 + 7531z with respect to t. 4z2 + 228z + 36 Differentiate -63g4 - 8g*2 + g - 54298 with respect to g. -252g*3 - 16g + 1 What is the second derivative of 19256h2 - 5h + 39527? 38512 What is the second derivative of 2862570t2u*3 + tu*2 + 689430u*3 wrt t? 5725140u*3 What is the derivative of -ps*2v + 57ps*2 - 25psv + p + 890283s2v wrt p? -s*2v + 57s2 - 25sv + 1 What is the third derivative of -38928m*4 + 753m*2 - 7m? -934272m What is the second derivative of -10649n*3 + 5515n? -63894n Find the second derivative of 2h*2ju - 2h*2j - 25473h2u + 63hj + 35ju - 2j + 2u - 1 wrt h. 4ju - 4j - 50946u What is the first derivative of 9l3z + 4180l3 - 2l*2z + lz + 195l + 3235z wrt z? 9l*3 - 2l*2 + l + 3235 Find the third derivative of -18606z6 - z4 - 125z2 + 110. -2232720z*3 - 24z Find the first derivative of cqy - 21587cq - cy - 324qy - y wrt y. cq - c - 324q - 1 Find the second derivative of 11022x*2 + 2x + 62284 wrt x. 22044 Differentiate -26d3ko + 560d*2ko + dk - 27ko - 22k + o wrt d. -78d*2ko + 1120dko + k Find the second derivative of -1060c3g*2 - 34543c*3 - cg + 2g4 wrt g. -2120c*3 + 24g*2 Differentiate 1092867jp + 748977p wrt j. 1092867p Find the third derivative of -3a*2h*2s*3 + 3a*2h*2v + a*2hsv + 8a2s*2 - 3ah2s*2v - ahv*2 + 3h*2sv2 - 2775hs3v*2 wrt s. -18a*2h*2 - 16650hv2 Find the third derivative of -1511632g*3p - 65g2 + gp + 133p + 6 wrt g. -9069792p Find the first derivative of -16917b3d*2 + 654864b*3dq - 2b*3d + b*2d*2 - 2bd2 - d2q wrt q. 654864b3d - d*2 What is the derivative of -404618lpv - 3202lp - 29 wrt v? -404618lp What is the third derivative of -73162g5 - 4g*4 - 560g*2 - 3g + 2 wrt g? -4389720g2 - 96g What is the third derivative of -116056i5 + 5i*4 - 84i*2 + 37i - 3? -6963360i2 + 120i Find the second derivative of 5784a4g - 20a3g - 2ag - 12825a - g wrt a. 69408a*2g - 120ag What is the third derivative of v*4 + 103652v*3 + 1043v*2 + 31 wrt v? 24v + 621912 Differentiate 1740g3z2 - g3z + 463g*3 + 3g*2 - gz - 46g + 3z*2 - 1 with respect to z. 3480g*3z - g*3 - g + 6z What is the first derivative of -9l3u*3 - 2l*3u + 1259516l3 + 2633u wrt u? -27l3u*2 - 2l*3 + 2633 What is the third derivative of 57z*5 + 1649z*4 + 104964z*2 wrt z? 3420z*2 + 39576z Find the second derivative of 489089o3 - 57787o - 2 wrt o. 2934534o What is the third derivative of 217u*5 + 7u*4 + 17u*3 - 1552u*2 - 153 wrt u? 13020u*2 + 168u + 102 Differentiate 2413cg*3 + 2cgo - 48624co - c wrt g. 7239cg*2 + 2co Find the third derivative of -3lv3 + 2lv2 - l + 14807v*3 + 70v wrt v. -18l + 88842 What is the second derivative of 515h*5y*2 + 15h*3y*3 - 2hy3 - 51hy + 100y*3 wrt h? 10300h*3y*2 + 90hy3 Find the third derivative of -153218l*3 - 47l*2 + 10 wrt l. -919308 What is the first derivative of 171122k*3 + 127212 wrt k? 513366k*2 Find the first derivative of -11a*3l + 913a3 - 564a*2l*4 + 2l - 11 wrt l. -11a3 - 2256a*2l*3 + 2 What is the second derivative of -120a*5 + 131a*2 - 571313a? -2400a3 + 262 What is the derivative of -cvw + 2cv + 9991cw - 85c + 2v2w + 76v2 - 8vw wrt w? -cv + 9991c + 2v*2 - 8v Find the second derivative of -19535i2 + 109i + 33. -39070 What is the third derivative of -397y6 - 4y*4 + 100y3 + y2 - 561y + 60? -47640y*3 - 96y + 600 Find the second derivative of -41159v4 + 4830v + 4. -493908v2 What is the second derivative of 419309q*2 + 16575q - 21 wrt q? 838618 What is the first derivative of -387150n + 366982 wrt n? -387150 Find the first derivative of 4m*3 + 2369m*2 + 164311 wrt m. 12m*2 + 4738m What is the second derivative of 3n4 + 63075n*2 + 2615n + 162? 36n2 + 126150 Find the second derivative of f4z - 132f4 - 2fz + 4747z wrt f. 12f2z - 1584f2 What is the first derivative of -524o*3 + 41o*2 + 66378 wrt o? -1572o*2 + 82o Differentiate 400060k - 1207716 wrt k. 400060 What is the derivative of 23rz4 - 22rz - 109020r + 3z3 wrt z? 92rz3 - 22r + 9z2 Find the third derivative of -98484s*3 + 365473s*2. -590904 What is the third derivative of -92074gx3 + 103131gx2 - x2 wrt x? -552444g Find the third derivative of -7928u4 + 25u*3 + 294540u*2 wrt u. -190272u + 150 Differentiate -19ip*3u + 9957iu + 2p3u - 35781u with respect to i. -19p*3u + 9957u Find the second derivative of 687371a*2 - 538316a wrt a. 1374742 Find the first derivative of -207705l4 - 7615. -830820l*3 Find the first derivative of 14v*4 - 48v*3 + 3v*2 + 2v - 2395893. 56v3 - 144v*2 + 6v + 2 Find the third derivative of -l*6 - 4087l*3 + 12l*2 + 835l. -120l3 - 24522 Find the first derivative of -82276u + 1311525. -82276 Differentiate -96723w4y + 3w2y*3 + 168y*3 + 2y*2 - 7y + 7 wrt w. -386892w3y + 6wy*3 What is the third derivative of 929740t*2y6 - t2y2 + ty*2 - ty + 18t + 659y*2 wrt y? 111568800t*2y*3 What is the third derivative of 2t*6 + 83624t*4 + 179405t*2 wrt t? 240t*3 + 2006976t What is the second derivative of -3773v4x*3 + 15v*4x - vx3 - vx - 349v + 2x*3 wrt v? -45276v*2x*3 + 180v*2x Find the second derivative of -77812m5 + 6m*3 - 1406747m. -1556240m3 + 36m What is the third derivative of -16069w4 - 2w*2 + 5103w wrt w? -385656w What is the second derivative of 4483k*3y2 - k3y - k3 + 4k*2y + 1640ky - 4y2 wrt y? 8966k*3 - 8 What is the third derivative of 166760u*3 + 2u*2 + 25297? 1000560 What is the second derivative of 1986820j*2 + 1143086j? 3973640 Find the second derivative of -2a3 - 460a*2 + 10067a. -12a - 920 Find the first derivative of -15230j*3 + 156906. -45690j*2 Find the third derivative of -228n*6 + 85n*3 - 2093n*2 + 15 wrt n. -27360n*3 + 510 Find the first derivative of -265l*2n*4 + 58l*2n*2 - 88557l*2 wrt n. -1060l*2n*3 + 116l*2n What is the third derivative of -1022962dn*3 + 7dn - 20d + 18n2 + 3n - 2 wrt n? -6137772d Differentiate -69b*3t - 2b2t*2 + 2b*2 - 34t*2 + 19t - 23 with respect to b. -207b2t - 4bt*2 + 4b Find the third derivative of 9n4w - 42472n3w - n*2w - 76n2 - nw - 189 wrt n. 216nw - 254832w What is the first derivative of -5y*2 - 570y + 27985? -10*y - 570 What is the second derivat	{ "pile_set_name": "DM Mathematics" }
= 2c(p) + 11m(p). Let h(x) = -3x2. Determine h(a(o)). -3o*2 Let h(j) = -j. Let s(g) = 36g - 27. Let f(m) = 5m - 4. Let n(u) = -27f(u) + 4s(u). What is h(n(c))? -9c Let z(g) = 4g. Let l(d) = d2 - 15d - 32. Let k be l(17). Let o(n) be the third derivative of 0n + 0n3 - nk + 0 + 1/12n4. Calculate z(o(y)). 8y Let q(b) = -b*2. Let v = 11 + -9. Let d(n) be the first derivative of -5/2n*v + 0n + 3. Calculate d(q(g)). 5g2 Let s(i) be the third derivative of -i8/6720 - i5/15 - 2i*2. Let k(w) be the third derivative of s(w). Let y(g) = -g. Give y(k(h)). 3h*2 Let m(g) = -2g. Let s(r) = -r2. Let w(b) be the first derivative of b3/3 - 2. Let y(o) = -s(o) - 2w(o). Give y(m(a)). -4a*2 Let v(y) = 3y. Suppose 0 = -3p + 5q + 31, -5p = -7q + 2q - 35. Let k(x) = 3x*p + 4 - 4x*2 - 4. Give v(k(a)). -3a*2 Let p(n) = -2n*2. Suppose 5v = -0v + 10. Let h(u) = 4u2 + 11. Let b(m) = -m2 - 2. Let s(k) = vh(k) + 11b(k). What is s(p(f))? -12f4 Let v(n) = n. Let t(o) be the second derivative of -o5/120 - o3/3 + 4o. Let p(l) be the second derivative of t(l). Calculate v(p(y)). -y Let p(y) be the third derivative of y*4/24 - 24y*2. Let m(b) = -11b. Let g(q) = 77q. Let s(c) = -3g(c) - 22m(c). Give s(p(j)). 11j Let a(n) = 117n2. Let m(d) = 2d*2. Calculate m(a(c)). 27378c*4 Let w(g) = 4g. Suppose -14d = -18d - 36. Let k(v) = v. Let f(m) = dk(m) + 2w(m). Let c(h) be the third derivative of 3h4/8 + h2. Determine c(f(j)). -9j Suppose 0 = -2o + 4 + 8. Let r(i) = oi*2 + 0i*2 - 4i*2. Let c(z) = -z. What is c(r(x))? -2x2 Let r(p) = p3 - 2p2 - 3p + 2. Let q be r(3). Let b(o) = -3o2 + 5o*q + 8o2. Let h(n) = -n2. Calculate b(h(j)). 10j4 Let g(n) = -9n*2 - 8n*2 + 29n*2 - 9n*2. Let j(z) = z. Determine j(g(a)). 3a*2 Let l(d) = -8d. Let i(w) = w. Let f(u) = -6i(u) - l(u). Let k(q) = -22 - q + 22. Calculate k(f(z)). -2z Let v(f) be the first derivative of -5f2/2 - 21. Let w(c) = c2 - 2c. Let u(n) = 2n2 - 3n. Let l(d) = 2u(d) - 3w(d). What is v(l(i))? -5i2 Let v(n) = -n2 + 1. Let l(k) = -6k*2 + 3. Let t(m) = -l(m) + 3v(m). Let r(f) = 3f. What is r(t(g))? 9g*2 Let p(t) = 3t*2 - 614t. Let m(h) = 2h. Calculate m(p(r)). 6r*2 - 1228r Let i(g) = -g2. Let t(l) be the first derivative of -l6/60 - 2l3/3 - 7. Let o(k) be the third derivative of t(k). Determine o(i(z)). -6z*4 Let c(y) = -2y*2. Let m = 15 + -14. Let a(p) = -1 + 0 + m - 3p*2. Calculate c(a(f)). -18f*4 Let y(t) = 1. Let q(i) = i - 3. Let o(h) = -q(h) - 3y(h). Let z(w) = -w + w2 + w. Calculate o(z(r)). -r2 Let w(d) = 2. Let q = -4 + 5. Let v(g) = g*2 - 1. Let u(z) = qw(z) + 2v(z). Let b(s) = 2s. What is u(b(p))? 8p2 Let u(l) be the first derivative of -l4/6 + 2l + 2. Let d(r) be the first derivative of u(r). Let f(x) = 3x. Give f(d(m)). -6m2 Let k(h) = h2. Let n(t) be the second derivative of 0t2 + 0 + 3t - 5/3t3. What is k(n(f))? 100f*2 Let i(s) = 2s*2. Let d(u) = 6u*2 - 3. Let g be (4 + -1)(-2 - -3). Let r(f) = -13f2 + 7. Let b(v) = gr(v) + 7d(v). Determine i(b(t)). 18t4 Let c(o) be the third derivative of -o4/24 + 24o2. Let n(q) = 2q. Calculate n(c(u)). -2u Let s(c) = -82c + 32c + 27c + 21c. Let w(j) = 7j*2 + 0j + 0j. Calculate s(w(z)). -14z*2 Let t(s) = 2s + 254. Let y(g) = 10g. What is t(y(z))? 20z + 254 Let j(m) = -5m. Let w be (-1 - (-18)/1) + -4. Let s(r) = 17r. Let f(v) = 8v. Let a(o) = wf(o) - 6s(o). Determine j(a(b)). -10b Let h(x) = -2x2. Let y(m) = -84m + 1. Calculate h(y(n)). -14112n2 + 336n - 2 Let k(z) = 4z2 - 2 + 2 + 0. Let p(v) = -2v. Determine p(k(w)). -8w2 Let j(z) be the first derivative of -4 + 0z*2 + 0z + 2/3z3. Let v(f) = 2f. Determine v(j(o)). 4o2 Let u(f) = -3f - 5. Let h(l) = -l + 1. Let k(y) = -5h(y) - u(y). Let i(v) = -2v*2. Calculate k(i(s)). -16s*2 Let j(d) = 7d + 2. Let x(n) = 124n. Determine x(j(r)). 868r + 248 Let r(s) = 2s2. Let x(t) = t - 4901. Determine x(r(u)). 2u*2 - 4901 Let s(c) = 3 + 2c - 7 + 4. Let k(g) = -6g2. Calculate k(s(n)). -24n*2 Let t(c) = -15c2. Let k(h) be the first derivative of h2 - 32. What is k(t(y))? -30y2 Let j(h) = -3h. Let s(k) = k - 3. Let m(r) = 4r - 11. Let z(x) = -6m(x) + 22s(x). Give z(j(b)). 6b Let l(i) = -i*2. Let k = 2 - -1. Suppose -4h - 3h + 21 = 0. Let u(x) = -k - 2x + h. Determine l(u(y)). -4y2 Let c(z) = -z. Let b(i) = -23 + 16 - 16i + 7. Give b(c(m)). 16m Let q(o) = 2o - 330. Let t(i) = -2i. What is t(q(h))? -4h + 660 Let c(q) = -3q. Let z be 1(0 - 1)0. Let d(h) = zh - 5h + 3h. Give c(d(a)). 6a Let p(q) = -q2. Let a(u) = u + 1. Let f(b) = -14b*2 - 21b - 21. Let m(c) = -21a(c) - f(c). Calculate m(p(h)). 14h*4 Let i(g) = 2g. Let q(a) = -14a2 + 3a + 6. Let c(b) = 561b2 - 121b - 242. Let f(y) = 6c(y) + 242q(y). Calculate i(f(o)). -44o2 Let x(r) = 2r + 2. Let u(d) = 33d. Calculate x(u(g)). 66g + 2 Let m(b) = -3b. Let t(q) = 59q*2. What is t(m(l))? 531l*2 Let p(l) = l. Let b be (-4)/(0 - (1 + 1)). Let t(j) = 2j*b - 3j + 3j. What is p(t(i))? 2i*2 Let v(t) = 1261t*2. Let d(f) = -3f*2. Give v(d(h)). 11349h4 Let r(g) = g2 + 17. Let h(d) = -d. Give r(h(p)). p*2 + 17 Suppose 5a - 17 = 8. Let l(s) be the third derivative of 0s - 1/30s*a + 0 + 0s*3 + 0s4 + s2. Let c(f) = -5f2. Determine l(c(i)). -50i*4 Let y(v) = -v. Let p(x) = -254x*2 + 3. What is p(y(s))? -254s2 + 3 Let n(g) = -g2 - 60g - 5. Let k(i) = -2i*2. Determine n(k(c)). -4c*4 + 120c*2 - 5 Let m(p) = -28p*2. Let z(h) = 28h*2. Let t(o) = -3m(o) - 4z(o). Let c(n) = n2. Determine t(c(v)). -28v*4 Suppose -p + 2 = -1, 3p = 4d + 25. Let y(x) = x. Let t(n) = 5n. Suppose -4 = -2i - 2. Let m(q) = dy(q) + it(q). Let v(j) = -2j*2. Give v(m(c)). -2c*2 Let p(s) = 3s. Let l(g) = 10g. Suppose -3f = -2i, -6 = 5f + 2i + 10. Suppose -21 = -3d - 0d. Let r(a) = dp(a) + fl(a). Let w(h) = h. Give w(r(z)). z Let v(k) = 19k*2 - 4k - 4. Let i(j) = -18j2 + 3j + 3. Let p(x) = 4i(x) + 3v(x). Let c(u) = -u. Let t(y) = 8y. Let h(q) = -6c(q) - t(q). Give p(h(m)). -60m2 Let u(j) = -22j - 1. Let h(z) = -3786z + 3786z + 2z2. Calculate u(h(g)). -44g*2 - 1 Let n(q) = -3q. Suppose 3v = -v + 24. Let g(j) = j - vj + 3j. Determine n(g(p)). 6p Let d(u) be the third derivative of u*5/60 + 14u*2. Let n(j) = 0j - 2j + 3j. What is d(n(b))? b*2 Let r(f) = 896f*2. Let l(y) = -3y. Determine r(l(b)). 8064b2 Suppose -2q = -t, -5q + q + 6 = t. Let l(p) = 0p*t - 5p*2 - 3p*2 + 5p*2. Let z(j) = -3j. Determine l(z(x)). -27x2 Let x(j) = -6j*2. Let g(w) = -1173w. What is g(x(n))? 7038n2 Let j(l) be the second derivative of l4/3 - 7l. Let h(c) = 2c2. Calculate h(j(g)). 32g*4 Let j(o) = 2o*2. Let m(d) = -11d*2 + 6. Let a(w) = -10w*2 + 5. Let b(y) = -6a(y) + 5m(y). Calculate b(j(p)). 20p*4 Let x be (-6 - -5) + 24. Let b(g) = xg2 + 6 - 6. Let p(j) = -j2. Give p(b(h)). -49h*4 Let b(p) = -2p + 3. Let a(d) = -3d + 4. Let r(s) = -3a(s) + 4b(s). Let n(w) be the second derivative of -1/6w*3 + 0 + 5w + 0w2. Calculate n(r(f)). -f Let s(r) = 3r. Let a(m) be the first derivative of -2m3/3 - 6. Determine a(s(k)). -18k*2 Let o(s) = -1382s - 2s2 + 1382s. Let q(u) = -u*2 + 5u*2 - 2u*2. Calculate o(q(n)). -8n*4 Let o(w) = -2w*2. Let b(q) be the second derivative of -5q*4/12 + 8q. Determine b(o(t)). -20t4 Let m(d) = 5d*2. Let c(u) be the second derivative of 2u*3/3 + 8u. Determine c(m(g)). 20g2 Let l(i) = -5i*2. Let n(r) = 3r - 12. Calculate n(l(m)). -15m2 - 12 Let w(g) = -2g*2. Let u(j) be the first derivative of 0j*2 - 1/2j*3 + 3 + 2j. Let a(l) be the first derivative of u(l). Determine a(w(t)). 6t2 Let d(c) = -21c*2. Let z(y) = -13y + 2. Determine d(z(i)). -3549i2 + 1092i - 84 Let g(z) be the second derivative of z*4/6 + 4z. Let k(q) be the first derivative of 0q2 - 4 + 3 - q2. Calculate k(g(v)). -4v*2 Let m(k) = 2k. Let l(s) = 2239s2. Give l(m(x)). 8956x*2 Let u(q) = 6q2. Let s(l) = l3	{ "pile_set_name": "DM Mathematics" }
be t(10). Suppose -qu = -424u - 5180. What is the units digit of u? 8 Suppose 0 = 5a - 4a. Let s(h) = 2h3 + h2 + h + 3. Let v be s(0). Suppose -vj + 44 + 97 = a. What is the tens digit of j? 4 Let u be (3048/20)/(9/60). Suppose -2g + 1266 = -4y, y - 1498 - u = -4g. What is the hundreds digit of g? 6 Let g(f) = f2 - f3 + 13f - 13f2 + 1 - 12. Let w = -3996 + 3982. What is the tens digit of g(w)? 9 Let h = 98 - 85. Suppose -10k - 1764 = -hk. What is the hundreds digit of k? 5 Suppose 0 = -24h + 22h - 438. Let g = -53 - h. What is the hundreds digit of g? 1 Let v be (-5)/5 + 14(-3)/6. Let r(z) = z*3 + 5z*2 - 16z + 16. Let l be r(v). Let i = l + 62. What is the units digit of i? 4 What is the tens digit of 5/(-15)(22 + 5) - -29055? 4 Let p(o) = 6o + 44. Let b be p(-6). Let x = 4 + 0. What is the units digit of x/b-2 + 83 + 3? 5 Suppose 0q = 2q - 16. Suppose -q + 0 = f. Let x(u) = -12u - 22. What is the units digit of x(f)? 4 Suppose o = -5, -a + 197 = 2o - o. Suppose -b + 0b - 4n + 110 = 0, -532 = -5b - 2n. Let s = a - b. What is the units digit of s? 6 Suppose 0j - 4645 = -5j. Suppose -8h + j = -6h - n, -5h + 2310 = -5n. What is the tens digit of h? 6 Suppose -2q + 96997 = -u, -24u + 10 = -22u. What is the ten thousands digit of q? 4 Let o(a) = -a3 + a2 + 5a - 4. Let m be o(2). Suppose -3k + 0 - 4 = -5j, -mk - 4 = -4j. What is the units digit of 3j/3 + 76? 8 Let i(x) = 228x - 2666. What is the thousands digit of i(47)? 8 Suppose 5b - 62 - 3 = 0. Let x(a) = a*2 - 13a - 10. Let v be x(b). Let u = 41 - v. What is the tens digit of u? 5 Let h = 1096 - 1633. Let p = -304 - h. What is the units digit of p? 3 Suppose 14j - 266 = 209 - 69. What is the units digit of j? 9 Let f = -9452 + 24457. What is the tens digit of f? 0 Let o = 85 + -35. Suppose 0 = -2z + o + 36. Suppose -47w + zw = -232. What is the tens digit of w? 5 Let l be (-1)/(-1)40/(-40). What is the tens digit of (-2)/((-1)/(-71)l)? 4 Let s = -63914 - -115070. What is the thousands digit of s? 1 Let x(v) = -v*2 - 23v - 56. Let c be x(-5). Suppose 51n - cn - 14246 = 0. What is the tens digit of n? 3 Suppose 0 = 35z - 26334 - 128191. Suppose 0 = -12s + 4105 + z. What is the tens digit of s? 1 Suppose 0i + 2i - k = 32453, 32463 = 2i + k. What is the ten thousands digit of i? 1 Suppose -s = c - 4 + 7, 10 = -4c - 5s. Let u be -67/(-105) + 12/c. What is the tens digit of (140/(-49))/(u/35)? 5 Suppose 2304 = 4h + 3d, -79d + 78d - 2861 = -5h. What is the units digit of h? 3 Suppose 5c - 35982 = -3a, -4c = 3a - 35635 + 6847. Suppose 5r + 1059 = c. What is the tens digit of r? 2 Let q = -81 + 86. Let k be (18/(-24) - (-1)/(-4)) + q. What is the units digit of k/14 + (-1336)/(-28)? 8 Let b = -2 + 7. Suppose -1 = -j, 10j - 5j = -3r + 122. Suppose -z = -r - b. What is the tens digit of z? 4 Suppose -3r = q - 39425, 159r - 158r + 197013 = 5q. What is the hundreds digit of q? 4 Let v = -20952 - -48963. What is the thousands digit of v? 8 Let v be (-442)/(-130) - (0 + (-4)/(-10)). Suppose vu - 4u = -4q + 1487, -2q - 4u = -730. Suppose 5y + 6 = q. What is the units digit of y? 3 Suppose 2d = -5p + 5, -d - 4p = -3d - 22. Let o(c) = -6c*3 - 6c*2 + 20c + 31. What is the units digit of o(d)? 1 Let o = 3221 + -4807. What is the hundreds digit of 3/(-9) - (o/6 + 2)? 2 Let u = 66591 - 9838. What is the ten thousands digit of u? 5 Suppose 7y - 73335 = -0y + 11498. What is the hundreds digit of y? 1 Suppose 0b = -5b + 4a + 116, a = b - 24. Suppose -7i = -b - 29. Suppose in = n + 654. What is the units digit of n? 9 Let o be (-64 - -64) + (0 + 1)(-4400)/(-20). Let k be (1 - 0)/(2/10). Suppose -4f + kd + o = 0, -6f + 252 = -2f + 3d. What is the tens digit of f? 6 Let a be (12/15)/(32/20)6. What is the thousands digit of (-14 - a)/((-3)/330)? 1 Let n(y) = -2y3 + 6y*2 + 2y + 9. Let x be n(5). Let r = 21 + x. Let m = r + 155. What is the units digit of m? 5 Suppose 33 = -21g + 10g. Let r be 4/g + (-1208)/(-6). Let t = r + -51. What is the tens digit of t? 4 Suppose -8i + 12 = -5i. Suppose is + 0h - 2h = 0, -2 = -3s + h. Suppose 0n - n = -5w + 127, sw - 56 = 3n. What is the units digit of w? 5 Let p = -9765 + 20824. What is the thousands digit of p? 1 Let z(p) = -60p3 + p2 + p - 1. Let a be z(1). Let j = -51 - a. What is the tens digit of ((-645)/(-20))/(((-15)/j)/(-5))? 8 Let r(n) = 2n*2 + 27n - 8. Suppose -150 = 6m - 12. What is the tens digit of r(m)? 2 Let l(r) = -395r + 8336. What is the thousands digit of l(-63)? 3 Let n be 3 - 0/(5 + (-4 - 0)). Suppose -5b + 1590 = 5t, 3t + 8b - 948 = nb. What is the units digit of t? 1 Let t(b) = b3 + 7b*2 - 16b + 15. Let s be t(-9). What is the hundreds digit of ((-5788)/(-6))/2 - 2/s? 4 Let a(r) = 5r2 - 7r - 140. What is the units digit of a(-55)? 0 Let r be (-2)/((-39)/(-20) + -2). Let t = 40 + -29. Suppose 15z - tz - r = 0. What is the units digit of z? 0 Let d = -331 - -482. Let q = d + 269. What is the units digit of q? 0 Let y(a) = 664a2 - 845a + 5046. What is the tens digit of y(6)? 8 Let l(h) = -4h + 17. Let a(k) = 2k + 1. Let f(t) = 4a(t) + 4l(t). What is the tens digit of f(-14)? 8 Let k(d) = -4d + 728. What is the tens digit of k(53)? 1 Suppose 182g + 118080 = 194g. What is the units digit of g? 0 Suppose 3y - 4 = 2q + 1, 4q = 2y - 14. What is the hundreds digit of (-6630)/q + (-11)/22? 6 Suppose -1 = p, 5y + 0p - 8 = 3p. What is the hundreds digit of y1222 - 3/(-12)-8? 2 Let f(t) = 9t + 78. Let w be f(-9). Let p(v) = 15v*2 + 2v - 4. What is the hundreds digit of p(w)? 1 Suppose 17r - 34389 + 5693 = 0. Suppose 2p + 5z - r = 0, -10p + 5z - 2527 = -13p. What is the tens digit of p? 3 Suppose -2645266 = -365a + 8228449. What is the ten thousands digit of a? 2 Let f(w) = w3 + w + 2. Let v(s) = 2s*2 + 13s + 1. Let y be v(-7). What is the tens digit of f(y)? 2 Suppose 65i - 59i = 12. Let y(z) = 165z - 3. What is the units digit of y(i)? 7 Suppose 24x - 7x = 272. Suppose -8450 = -9u - xu. What is the hundreds digit of u? 3 Suppose 0 = -0n - 43n + 30143. Let r = n - 413. What is the tens digit of r? 8 Suppose 2651106 - 371387 = 377y. What is the units digit of y? 7 Suppose y = -452y + 2731137. What is the hundreds digit of y? 0 Let k be (-2 - -2 - 2)4. Suppose -51 + 47 = 2c, p - 1 = 2c. What is the units digit of (-478)/p - ((-48)/18)/k? 9 Let l(x) = -x*3 + 11x*2 - 7x - 14. Let j be l(10). Let r = 0 + j. Suppose 5w - r - 4 = 0, 4q - 200 = -5w. What is the tens digit of q? 4 Suppose -4x + 52k - 56k = -47212, 3x - 3k - 35433 = 0. What is the tens digit of x? 0 Suppose 3w = -3i + 5i + 3, 9 = -w + 4i. Suppose 46 = -4l + wn + 1454, -2l = -3n - 704. What is the hundreds digit of l? 3 Suppose -m + 32 = -3m + g, 3g = -m - 2. Let a = 16 + m. Suppose -80 = -ao + 2z, 5o + 4z - 220 = 5z. What is the units digit of o? 5 Let w(a) = -a2 + 10a + 7. Let z be w(9). Let s(i) = -i*3 + 17i*2 - 17i + 26. Let r be s(z). What is the tens digit of (30 + -2)(r + -9)? 2 Let d = 627 + -125. Let v = d + -332. What is the hundreds digit of v? 1 Let j = -38 - -42. Suppose 5i + 4 = -2d + 35, 14 = ji - 2d. Suppose -2t + 122 = 5v, it + 0v - 2v = 334. What is the tens digit of t? 6 Let t(m) = m*3 + 2m*2 - 13m - 14. Let u be t(-4). What is the tens digit of (15 - (9 - u))178? 5 Suppose 0 = -13q + 14q - 5. Suppose -x = -ql + 3x + 75, -50 = -5l - x. Let m = 52 - l. What is the tens digit of m? 4 Suppose 3l = -3o - 3801, 14o - 16o + 2 = 0. Let t = l - -2623. What is the hundreds digit of t? 3 Suppose 4q = 9 - 1. Suppose 2y = -qj - 4, 3j + 1 = -5. Suppose 2k - 550 + 38 = y. What is the units digit of k? 6 Let w = -4527 - -19291. What is the units digit of w? 4 Suppose 5s + 3i = 52560 - 8568, -2i - 12 = 0. What is the thousands digit of s? 8 Let p(g) = -33g - 262. Let h be p(-8). What is the tens digit of (1 - h/10)/(39/43290)? 8 Let n(g) = -17g2 + 14g + 7g2 + g3 - 2 - 13. Let d be n(9). Suppose 768 = di - 24i. What is the units digit of i? 8 Suppose 0z = -3*z - 342. Let x = 6478 - 6428. Let k = x - z. What is the te	{ "pile_set_name": "DM Mathematics" }
= 6v. Let n(t) be the third derivative of t4 - 4t*2 + 5t. Calculate n(g(x)). 144x Let l(s) = 5s*2 - 3s. Let u(m) = m*2 - m. Let c(r) = 2l(r) - 6u(r). Let t(n) be the third derivative of -n5/4 + 34n*2. Determine c(t(d)). 900d*4 Let q(u) = -8u2. Let o(h) be the second derivative of -h3/3 + 143h2/2 - 4h - 57. Calculate o(q(p)). 16p2 + 143 Let x(r) = 311r*2. Let h(p) = 147p - 2. Give h(x(v)). 45717v2 - 2 Let f(k) = -398k*2. Let b(j) = -130j*2. What is b(f(o))? -20592520o*4 Let x(y) = -132y*2 + 18y - 9. Let f(c) = 67c2 - 8c + 4. Let p(g) = 9f(g) + 4x(g). Let v(b) = -2b. Give p(v(h)). 300h*2 Let u(f) be the first derivative of -6f*2 - 169. Let x(z) = 4z. What is u(x(w))? -48w Let k(d) = -d. Suppose 0 = t + 4q - 2 - 8, -22 = t - 4q. Let u = 8 + t. Let w(a) = -a2 - 3a2 + au + 2a2. Determine k(w(b)). b2 Let l(q) = -3q - 5. Let m(t) = 2t2 + 30t. Give l(m(n)). -6n2 - 90n - 5 Let j = 6 - -1. Let l(q) = 7q2 + jq*2 - 6q*2. Let z(b) = -34b + 17b + 16b. What is l(z(d))? 8d2 Let w(s) = s + 3738. Let o(z) = 2z. Calculate o(w(q)). 2q + 7476 Let i(l) = -2l. Let f be (-8)/(-20) + (-16)/(-10). Let w be (f/(-5))/((-2)/70). Let u(q) = -w + 14 + q. Determine i(u(r)). -2r Let l = 5 - 9. Let x be (-15)/(-5)l/(-3). Let d(w) = xw - w + 0w. Let h(s) = 4s. Determine h(d(n)). 12n Let t be 1/((-108)/52 - -2). Let x be (-1 + 2 + t)/(-2). Let u(l) = xl - 2l*2 - 6l. Let h(y) = 4y. What is u(h(m))? -32m*2 Let a(x) = 12x. Let f(k) be the third derivative of k*6/360 + 5k*3/3 - 10k*2. Let y(j) be the first derivative of f(j). Determine y(a(c)). 144c*2 Let l(m) = -4m. Let y(s) be the first derivative of -s*3 + 7s*2/2 - 7s - 10. Let c(j) = 2j2 - 5j + 5. Let v(r) = 7c(r) + 5y(r). Calculate l(v(x)). 4x2 Let l(w) = 5w. Let s(m) = 3m2 - 15m. Let i(v) = -v*2 + v. Let u(p) = 15i(p) + s(p). Determine l(u(z)). -60z2 Let f(c) = -11c*2 + 2c. Suppose j = 2o - 14 - 9, -5j = -5o + 55. Let r(n) = 19n - 29n + on. What is r(f(z))? -22z2 + 4z Let k(s) = 12s2. Suppose -x - 4 = -2r + 4, 3x - 18 = -r. Let m be (9/r)/((-24)/(-32)). Let v(y) = -6y*m - 2y*2 + 10y*2. What is k(v(b))? 48b*4 Let r(g) = -11g*2. Let c(z) = -114098z. Determine r(c(i)). -143201889644i2 Let p(r) = 27r*2 - 26r*2 + 8 + 10r - 2r. Let g be p(-7). Let k(s) = s + 2 - g - 1. Let x(d) = -18d*2. Give x(k(t)). -18t*2 Let r(h) = h. Let n(t) be the second derivative of 145t4/12 - t2/2 - 661t. Determine n(r(y)). 145y*2 - 1 Let d(b) be the first derivative of 22b*3/3 + 62. Let n(i) = -2i*2. What is n(d(l))? -968l*4 Let k(l) = 16l. Let i(t) = 71t2 - 80. Calculate i(k(x)). 18176x2 - 80 Let n(v) be the second derivative of -v3/6 - v. Let t(j) be the third derivative of j*5/2 - 92j*2 + 12j. Determine t(n(w)). 30w2 Suppose -3q + 28 = u - 3u, -5q + 5 = 5u. Let d(c) = c + 7 - 1 - q. Let m(o) = -2o*2. What is d(m(v))? -2v*2 Let r(z) = -14z. Let d(w) be the third derivative of 0w + 0w*3 + 22w*2 + 1/6w*4 + 0. Give r(d(t)). -56t Let s(b) = -25b - 10. Let d(j) = -31j - 12. Let f(y) = 5d(y) - 6s(y). Let x(c) = -208c. Give f(x(l)). 1040l Let k(m) = 2 + 3m - 7 + 5. Let c(d) = -6d - 15. Give c(k(f)). -18f - 15 Let y(l) = -3l. Let f(r) = 34829r + 7. Give y(f(p)). -104487p - 21 Let a(x) = -68x - 92x + 155x. Let d(t) = -5t*2 + 4. Give d(a(n)). -125n*2 + 4 Let k(q) = -8q. Let h(x) = x - 7x + 0x. Determine h(k(l)). 48l Let b(y) be the third derivative of 7y5/60 - y3/6 + 19y2 - 3y. Let n(o) = 3o. Give n(b(g)). 21g*2 - 3 Let p(o) = -6o*2 + 8993o - 2. Let j(g) = -2g. What is p(j(k))? -24k*2 - 17986k - 2 Let o(g) = -2g - 1. Let v(p) = 30p + 5. Let j(c) = 6o(c) + v(c). Let q(n) = -n2. Give q(j(l)). -324l*2 + 36l - 1 Let r(g) = 34g2. Let x(v) be the third derivative of -v5/15 + 11v*2 + 12. What is x(r(b))? -4624b*4 Let y(x) = 2x*2. Let q(s) be the third derivative of 4s*7/315 + 3s*4/8 - 12s*2. Let f(l) be the second derivative of q(l). Calculate f(y(t)). 128t*4 Let f be ((-24)/(-28))/((-2)/(-14)). Let b(a) = 0 - fa*2 + 0 + 7a2. Let v(k) = -k. Determine v(b(p)). -p2 Let s(v) be the second derivative of 0v2 - 11v + 0 + 7/6v3. Let r(d) = 5d*2. Calculate s(r(l)). 35l*2 Let t(k) = 36k + 4. Let x(b) = 13b2. Give t(x(w)). 468w*2 + 4 Let r(m) = -2 + 2 + 2m*2. Suppose -2x + 190 = -2y - 158, 2x - 336 = 5y. Let k(n) = -xn + 85n + 85n. Give r(k(g)). 128g2 Let p(w) = -2 + 3w + 6w - 9w + 23w2. Let a(u) = -u - 1367 + 1367. Determine a(p(t)). -23t*2 + 2 Let s(a) = -24a + 70a - 28a - 20a. Let b(m) be the first derivative of -m6/120 - 2m*3/3 + 2. Let w(l) be the third derivative of b(l). Give s(w(h)). 6h*2 Let h(p) = -7p. Let c(m) be the third derivative of 4m2 + 0m*3 + 0m + 13/24m4 + 0. Let x(a) = 6c(a) + 11h(a). Let r(g) = -5g. Determine x(r(o)). -5o Let g(n) = -3n*2. Let o(i) = 12i + 6i - 4 - 4 - 19 - 20i. Give o(g(s)). 6s2 - 27 Let s(v) = -31v*2 + 6v + 12. Let h(i) = 5i2 - i - 2. Let n(o) = -30h(o) - 5s(o). Let m(y) = -2y - 41. Give m(n(l)). -10l2 - 41 Let l(m) = -104227m*2. Let y(f) = 2f. Give l(y(r)). -416908r2 Let s(m) = 38m*2 - 2. Let u(h) = 2h - 235. Calculate s(u(g)). 152g2 - 35720g + 2098548 Let h(l) = -24l2. Let g(q) = 6q*2 - 1. Let y(d) = 5d*2 - 1. Let k(f) = 2g(f) - 2y(f). Give k(h(m)). 1152m*4 Let s(a) = 434a*2 + 1. Let x(d) = 7d - 5. Calculate x(s(j)). 3038j2 + 2 Let n(w) = -85w + 180. Let g(x) = 6. Let i(h) = -30g(h) + n(h). Let a(f) = f2. What is a(i(r))? 7225r*2 Let t(m) = -6m. Let k(x) = -251x + 23. What is k(t(y))? 1506y + 23 Let s(w) = 117w. Let x(a) be the third derivative of a5/30 - 7a*2 - 7a. What is x(s(o))? 27378o2 Let m(x) = 7x + 3. Let h(d) = -5d - 2. Let l(n) = -3h(n) - 2m(n). Let j(o) = -24o*2 - 2o. What is j(l(b))? -24b2 - 2b Let k(i) be the second derivative of -i*4/6 + 22i. Let m(h) = -3 - 4 + 2h + 0h + 0h. What is m(k(j))? -4j2 - 7 Let u(l) be the second derivative of -l7/2520 + 7l4/6 - 18l. Let a(k) be the third derivative of u(k). Let f(v) = 26v2. What is a(f(m))? -676m*4 Let j be 7/14 - (7/(-2))/1. Let x(q) = -5q*2 - 5. Let g(b) = 5b*2 + 4. Let d(v) = jx(v) + 5g(v). Let u(n) = -12n. What is d(u(w))? 720w2 Let w(k) = -25k - 266. Let y(g) = 9g + 88. Let j(l) = 4w(l) + 11y(l). Let f(b) = b2. What is j(f(o))? -o2 - 96 Let j(u) = 15u*2 + 14. Let s(l) = -8l*2 - 8. Let t(i) = 4j(i) + 7s(i). Let q(p) = 30p*2. Give t(q(d)). 3600d*4 Let r(p) = -31p + 9. Let k(q) = 67q. Let w(c) = 11c. Let x(v) = -k(v) + 6w(v). Determine r(x(m)). 31m + 9 Let c(y) = -151y. Let u(b) = -29b - 6. Let m(v) = 19v + 4. Let f(t) = -3m(t) - 2u(t). Give c(f(d)). -151d Let x be 5 - (-4)/(4/(-3)). Let y(n) = -35n2 + 12n*x + 13n*2 + 8n*2. Let u(t) = -3t*2. Calculate y(u(k)). -18k*4 Let s(p) = p. Let h(j) = 144j*2 - 279j*2 + 155j*2. Give h(s(z)). 20z*2 Let u(a) = -10a. Let h(z) = 3z2 - 3 - 8z + 0 - 1. Let y(c) = -5c2 + 14c + 7. Let r(p) = -7h(p) - 4y(p). What is u(r(g))? 10g2 Let z(b) be the third derivative of -b4/24 + 3b*2 + 45. Let u(c) = -64c - 8. Let d(w) = 43w + 5. Let h(j) = 8d(j) + 5u(j). Give z(h(q)). -24q Let r = 42 + -40. Let m(i) = i + 1. Let h(t) = t*2 - 2t - 2. Let d(z) = rm(z) + h(z). Let b(c) = -37c*2. Give d(b(q)). 1369q*4 Let n(o) = o. Let l(m) = 56m - 2. Let s(y) = -729y + 27. Suppose 20b = 25b - 135. Let g(t) = bl(t) + 2s(t). Calculate g(n(x)). 54x Let p(l) = -l*2. Let w(a) be the first derivative of -109a*2/2 + 2a + 123. Determine p(w(r)). -11881r2 + 436r - 4 Let x(p) = 3p. Let y(r) = r - r2 + 6r - 1 + 5r. Let s be y(8). Let t(c) = -sc + 31c + 3c*2. What is x(t(v))? 9v*2 Let s(x) = 8x*2 + 6. Let w(f) = 15f*2 + 11. Let z = 7 + 4. Let l(i) = zs(i) - 6w(i). Let q(n) = 20n. Calculate q(l(h)). -40h2 Let t(z) = 161z*2. Let f(n) = -243n. Give t(f(k)). 9506889k2 Let m(l) be the first derivative of -1294l*3/3 - 281. Let q(k) = -2k*2. Calculate q(m(v)). -3348872v*4 Let w(h) = 4h - 10	{ "pile_set_name": "DM Mathematics" }
50v for t. -8 Solve 4j + f - 16 = 0, 157j - 162j = 4f - 20 for j. 4 Solve -1144 = 4p - 3t - 1171, 0 = -2p + 42t + 54 for p. 6 Solve 2d - 27 = 3a, 396d = -5a + 394d - 13 for a. -5 Solve -m - 6 = -272b + 274b, 0 = 7b for m. -6 Solve 88u - p - 14 = 83u, u + 5p = 8 for u. 3 Solve 2a - 25 = -3t, -8a = -37t + 32t - 15 for t. 5 Solve 15 = 4m + q, 63m + 34q + 27q - 250 = 59q for m. 4 Solve q - 392d = -373d + 18, -4q - 2d - d = 7 for q. -1 Solve 4p + 2c = -16, 0 = -5p + 187c - 185c + 34 for p. 2 Solve 1 = -n - 4k, 0 = -11n - 2k + 692 - 703 for n. -1 Solve 3r + 3 = -3b - 2b + 2b, 5r + 7 = -4b for b. 2 Solve 395 = -5c - 2r + 403, 8 = 2c + 2r for c. 0 Solve -5n + 1300 = -2g + 1284, 4g - 28 = -5n for g. 2 Solve 13q - 11k = -6k + 64, q - 4q + 14 = -k for q. 3 Solve 2u - 55 = -3v, 0 = -34u + 31u + 3v - 30 for u. 5 Solve -3m + 5c - 34 = 0, -m - 4c + 3263 - 3246 = 0 for m. -3 Solve -4w + 1 = u, 2u + w - 7 = 2 for u. 5 Solve 0 = 2p - 11z - 37, -4p - 6z + 11z + 57 = 0 for p. 13 Solve -k = -7a + 15 - 30, 0 = 4k - 4 for a. -2 Solve 20d = -5n - 425, 110 = -5n - 1591d + 1586d for n. -1 Solve 4f - 61 = s, -2f + 48 = -328s + 324s for f. 14 Solve -13i + 2t - 11 = -10i, 5i + 21 = 4t for i. -1 Solve 4q - 37v + 36v = 10, 0 = -2q - 2v for q. 2 Solve -10w + 11w = -3w - t - 10, -7t + 4t = -3w for w. -2 Solve -2z = -3s - 11, -5z + 52 = 39s + 71 for s. -1 Solve 3u = k - 15, 2u = -2k - 26 + 16 for k. 0 Solve -4 = -i + 1828s - 1829s, 2i - 8 = s for i. 4 Solve -b + 39 = 4c, 0 = -22b + 20b + 4c - 30 for b. 3 Solve -9r - 81 = 3t - 12, -4r = t + 32 for r. -9 Solve -14p + 11p = -3b + 6, -8 = p + 2b for p. -4 Solve -g = 4h - 13, 91h - 154 = 2g + 54h for g. -3 Solve 2t + 33 = -3k, 60t = -k + 59t - 14 for k. -5 Solve -12f + 3k + 36 = 0, -4f + 5k - 26 + 134 = 0 for f. -3 Solve -m - 90 + 93 = -3f, -10f + 9 = 3m for m. 3 Solve 5z + 6 = a + 12, 5a - 5z + 90 = 0 for a. -21 Solve -630 + 633 = k + l, 4 = -2l for k. 5 Solve 24 = 2s + 26, o = -s for o. 1 Solve 2a = 11d - 54, 1231a - 1227a + 12 = -2d for d. 4 Solve m + 2708 - 2689 = -5q, -7 = 2q + m for q. -4 Solve -3q + 2q + 159 = 10q - 5m, -m = 1 for q. 14 Solve -5j - 3x + 48 = 0, -597x = 2j - 600x - 15 for j. 9 Solve -2b - 2l = -18, 3l = -b + 254 - 231 for b. 2 Solve 0 = 5z - d + 25, 10 = 458z - 460z + 3d for z. -5 Solve 158y - 8 = 161y - 4m, -30 = 5y - 15m for y. 0 Solve 9309n + 2r = 9306n - 29, n = 2r + 33 for n. 1 Solve 12 = 5s + 2h, -3s + 5h + 221 = 189 for s. 4 Solve 3z = -2q - 31, 3q - 15034z = -15032z + 12 for q. -2 Solve 0 = 4h - 261g + 258g - 39, 0 = -3h + 4g + 38 for h. 6 Solve -26n - 128 = -2a, 2n = 4a + 19 - 25 for a. -1 Solve 0 = -4m + 3s + 15, -3m + 4m - 2s - 5 = 0 for m. 3 Solve 0 = 4t - c + 39, -3t - c + 1564 = 1602 for t. -11 Solve 0 = 5g + 3l + 6, -414 + 435 = -2g + 5l for g. -3 Solve -2a - 5w = 14 - 33, -4a + 5w - 37 = 0 for a. -3 Solve 6 = -2y + 8d, 221y + 2d - 9 = 224y for y. -3 Solve 3u - 19 = -4f, 18147u + 5f = 18146u + 10 for u. 5 Solve 2f = 21235d - 21232d + 14, -13f = -d - 91 for f. 7 Solve -2w = -5z + 11, -2w - 1807 + 1808 = -z for z. 3 Solve 4z - 962n - 16 = -960n, -n = 2 for z. 3 Solve -9u + 51 = 3k, 42k - 2 = 40k + 2u for k. 5 Solve -58i - 60 = -9u - 53i, -5u = -5i - 40 for u. 5 Solve -6 = 6m - a, -5m - 46a + 47a - 5 = 0 for m. -1 Solve -312v + 309v - 2w - 10 = 0, 4v = -4w - 8 for v. -6 Solve 2i + 16 = -4c, -c = -3i + 27 - 16 for i. 2 Solve -5l + 24 = -4x, 5816l - 5817l + 6 = -2x for l. 4 Solve -j + 55 = 4m + 30, 0 = 2m + 4j - 30 for m. 5 Solve 5g = 6k - 7k - 14, -10 = 5k + 5g for k. 1 Solve -906w = -909w - i + 23, -33 = -3w - 3i for w. 6 Solve 0 = 5f - 34m + 30m - 1, -4f - 3m + 7 = 0 for f. 1 Solve -b - 6 = 2v, -306b + 310b - 6 = 2v for b. 0 Solve -3b + 17 = v + 22, 0 = 4b - v + 16 for b. -3 Solve 22 = 2f + 3m, -m = -2276f + 2288f - 64 for f. 5 Solve 2d - 37u = -32u + 38, 12u = 4d - 84 for d. 9 Solve 0 = -j - 5k + 2, 43k - 4 = -2j + 42k for j. 2 Solve -5a = -63 + 38, 17c = a - 56 for c. -3 Solve 9f + 263q - 3 = 258q, -4f + 5q + 23 = 0 for f. 2 Solve -k + 11 - 47 = 5p, -3p = 5k + 4 for p. -8 Solve -3k = 128g - 130g + 22, 0 = -3g + 4k + 31 for g. 5 Solve -2j = 2c - 20, 20 = 3c + 149j - 151j for c. 8 Solve -3h + r + 21 = 0, 3h + 58r - 61r - 27 = 0 for h. 6 Solve 0 = -5t - 20g + 52 - 32, -4 = -t + 2g for t. 4 Solve 4b - 2i + 3 = -7, 19 = -4b - i for b. -4 Solve 3m - 2g + 3 = 0, 139 = -22m - g + 117 for m. -1 Solve -33 = 5v + q - 30, -v + q = 3 for v. -1 Solve x = -3f - 18, -1045x = -1042x - 2f - 12 for x. 0 Solve 0 = 4p + 4r - 8, 5p - r - 50 + 70 = 0 for p. -3 Solve 4h + 134x - 139x + 17 = 0, 4h + 12 = 4x for h. 2 Solve -134c = 2s - 133c - 3, 0 = -4s - 4c - 4 for s. 4 Solve 0 = -2v - 2o + 141 - 159, -v + 5o = -27 for v. -3 Solve 4f - 112u + 47 = 111u - 218u, 5f - 5u + 50 = 0 for f. -3 Solve 0 = 4n + 3x + 11, -2x - 7 - 33 = -4n - 46 for n. -2 Solve -3i = 2y + 4, 14y + 14y - 51y - 3i + 80 = 0 for y. 4 Solve -2k - 20 = 162p - 158p, -5p + 2k = 7 for p. -3 Solve 0 = -5v - 10197s + 10192s - 10, -16 = -4v + 4s for v. 1 Solve 3l - 3s = 3, -1461l + 1463l + 5s = -12 for l. -1 Solve 5r - 6244c + 6248c + 10 = 0, 2c = 3r + 6 for r. -2 Solve -3m - 2m + 15 = 0, 3m + 43 - 40 = -6s for s. -2 Solve -7y = 2l - 4, 1905y - 1910y = 2l for y. 2 Solve 0 = 3f + f + 4l - 8, 2f - 72l - 5 = -75l for f. 1 Solve -9h = -10h + 17c + 36, 8h - 6 = -5c for h. 2 Solve 16r + 27 = -4x + 21r, 0 = -3x + 2r - 22 for x. -8 Solve 0 = -4c - 3p - 44, -22p = -23p - 4 for c. -8 Solve 0 = -8x + 4u - 16, 3u - 166 = -2x - 154 for x. 0 Solve 5j - 9 = o, 0 = -9o + 3j - 6j + 24 - 9 for o. 1 Solve 9x = 10x - 3m + 19, -8x + 10 = 3m for x. -1 Solve z - 2a + 18 = 0, -5z + 1828a - 1827a = 27 for z. -4 Solve -5w + 0 + 15 = -5p, -p - 9 = 2w for w. -2 Solve 21x - 23x - 30 = -n, 2n - 46 = 3x for n. 2 Solve -4286u + 4285u + 4r = 33, 0 = -3u - 3r + 6 for u. -5 Solve -4p - 2t + 32 = 0, 0 = -6p + 5p + 3t - 13 for p. 5 Solve -2i + k - 2 = 0, 78i - 79i + 6k + 21 = 0 for i. -3 Solve -2m - 16 = -k, 3k + 549m = 550m + 13 for k. 2 Solve -6993o + 6989o - z + 1 = 0, 0 = -5o - 2z - 1 for o. 1 Solve 0 = 3x - w - 13, -101x + 102x + 4w = -13 for x. 3 Solve -3m - 3 = 0, -5c - 33m - 69 = -c - 32m for c. -17 Solve d - 2c - 4 = 0, -5c + 3c - 4 = 3d for d. 0 Solve 322h - 321h + 2a - 11 = 0, 0 = 3h - 3a - 6 for h. 5 Solve -26u + 140 = -2q, 3q = -341 + 326 for u. 5 Solve -10h + 5f + 39 = -13h, -2f - 5 - 7 = 0 for h. -3 Solve 240 = -30y - 5i, 17y + 3i + 49 = 18y for y. -5 Solve 4c = g - 21, 25 = 3g + c + 40 for g. -3 Solve -60i + 57i = 2x + 5, -2x = 4i + 6 for x. -1 Solve 66r = 71r + 4a - 7, -2r = -3a + 11 for r. -1 Solve a = 27t - 32t + 23, 0 = a + t - 3 for a. -2 Solve -2n + 61b + 14 = 68b, -5n = -4b + 8 for n. 0 Solve -4 = -2s - 6d, 21s - 16s - 10 = -2d for s. 2 Solve -3k + 5u = 36, -2u = k - 5u + 24 for k. 3 Solve -4b = 4c - 52, -5b - 761 + 778 = -c for b. 5 Solve -13 = 3h - b, 38262 = -2h + 4b + 38220 for h. -1 Solve -v = 2x + 28, -77x + 79x = 2v - 28 for v. 0 Solve -102a + 101a - 3 = -x, 2x + 12 = -4a for a. -3 Solve -5c = 0, -3j = -2c + 13 - 19 for j. 2 Solve -94d = -92d - 6g + 12, 0 = 2d - 4g + 12 for d. -6 Solve -4h - 12 = -4g, 5h - 154g + 157g = -23 for h. -4 Solve -f = -4f - 6, -f = 5z + 7 for z. -1 Solve -15l - 3d - 2d + 3 = 7l, -2l = 3d - 13 for l. -1 Solve 20 = -53u + 49u - q, 4u - q - 4 = 0 for u. -2 Solve 5n - 37 = -2s, -4n - 299s - 28 = -301s for n. 1 Solve -r = -18h + 67, 13h - 18h + 30 = 2r for h. 4 Solve 522p - 521p - 13 = 3q, -8 = -3q - 2p for q. -2 Solve 0 = -c - 3v - 31, -13v = -c - 9v + 32 for c. -4 Solve -3z + 5s = 1, 7z = 3z - 5s + 22 for z. 3 Solve 3d = -u - 40, 57041d - 57044d = -5u + 16 for u. -4 Solve 248x - 250x + 3y - 8 = 0, -5x - 20 = -12y for x. -4 Solve 5g + 19 = 2u, 5g + 291 = -4*u + 284	{ "pile_set_name": "DM Mathematics" }
3a Convert 312323 (base 4) to base 6. 24135 -4524 (base 15) to base 13 -6898 Convert 10100000010 (base 2) to base 9. 1674 Convert -1404 (base 6) to base 2. -101101100 -10cc (base 13) to base 12 -1451 Convert 220311 (base 4) to base 9. 3523 Convert -1132 (base 8) to base 5. -4402 Convert 2135 (base 12) to base 6. 24505 -27451 (base 8) to base 16 -2f29 98b (base 12) to base 6 10255 What is -333 (base 9) in base 14? -157 Convert -101111 (base 3) to base 14. -163 What is -164 (base 9) in base 6? -351 What is -40 (base 13) in base 10? -52 Convert -1b87 (base 14) to base 9. -6786 -1122111112 (base 3) to base 13 -119c6 -11d8 (base 16) to base 10 -4568 What is -3a1 (base 13) in base 8? -1176 Convert 1131240 (base 5) to base 14. 7832 -429 (base 15) to base 14 -4b1 Convert 113 (base 4) to base 15. 18 What is -1172 (base 14) in base 8? -5740 What is 100001001110 (base 2) in base 9? 2822 Convert 72745 (base 8) to base 4. 13113211 What is -1ce2 (base 15) in base 10? -6287 What is -10136 (base 7) in base 10? -2477 Convert -10240 (base 9) to base 15. -2009 -4327 (base 8) to base 12 -1387 1011010101 (base 2) to base 11 5aa What is -b435 (base 14) in base 16? -7927 Convert d45d (base 14) to base 8. 107273 What is 2404 (base 12) in base 4? 333010 3554 (base 11) to base 13 2173 2921 (base 14) to base 3 100222200 -3100 (base 8) to base 16 -640 -1131 (base 11) to base 9 -2031 Convert -16224 (base 7) to base 12. -2793 1436 (base 8) to base 13 495 Convert 1 (base 3) to base 2. 1 What is -311 (base 15) in base 16? -2b3 -367 (base 15) to base 11 -642 What is 1716 (base 9) in base 4? 110133 What is -5cc8 (base 16) in base 8? -56310 -127b (base 15) to base 10 -3941 Convert -23e (base 15) to base 10. -509 Convert 626 (base 11) to base 5. 11004 What is -100101011 (base 2) in base 8? -453 54422 (base 6) to base 3 101021212 -481 (base 14) to base 3 -1020020 What is 100111010110101 (base 2) in base 3? 1000122021 Convert 2265 (base 8) to base 12. 845 What is -230 (base 12) in base 8? -504 What is -528 (base 11) in base 12? -44b Convert -123 (base 12) to base 6. -443 What is 1000001001 (base 2) in base 4? 20021 What is -4972 (base 12) in base 14? -3046 What is -234 (base 6) in base 4? -1132 -1bc7 (base 14) to base 3 -20221222 What is 21304 (base 5) in base 16? 5ae -9478 (base 10) to base 7 -36430 Convert -3323 (base 8) to base 6. -12031 What is -1c3 (base 15) in base 6? -1520 5183 (base 10) to base 12 2bbb What is -7702 (base 9) in base 13? -2774 3a (base 16) to base 14 42 2130 (base 6) to base 2 111100110 Convert -34330 (base 6) to base 11. -3735 Convert -2531 (base 10) to base 13. -11c9 Convert 302 (base 8) to base 3. 21012 What is -21045 (base 6) in base 5? -42322 What is -1000100001110111 (base 2) in base 9? -52826 What is 73505 (base 8) in base 9? 45785 What is -1379c (base 13) in base 14? -d408 644 (base 12) to base 3 1020221 What is 22026 (base 7) in base 12? 3230 -12 (base 13) to base 6 -23 Convert 110010001100 (base 2) to base 8. 6214 -40207 (base 8) to base 14 -603d -111ca (base 14) to base 12 -20052 What is -1479 (base 10) in base 16? -5c7 110241 (base 5) to base 8 7355 2036 (base 7) to base 11 599 What is 143 (base 16) in base 5? 2243 Convert -350 (base 6) to base 11. -116 -1013211 (base 4) to base 12 -2799 What is -2011110 (base 3) in base 16? -62a Convert 2055 (base 7) to base 3. 222220 Convert 1000001101101 (base 2) to base 10. 4205 Convert 1505524 (base 6) to base 11. 5a250 Convert 23302 (base 8) to base 12. 58aa -2045 (base 10) to base 8 -3775 -3340 (base 6) to base 5 -11110 Convert -1233023 (base 4) to base 3. -100202112 What is 1c3 (base 16) in base 5? 3301 6c0 (base 13) to base 14 5d8 Convert -1122330 (base 4) to base 8. -13274 What is 102350 (base 6) in base 13? 3a50 1515 (base 7) to base 5 4400 6fe (base 16) to base 4 123332 -44b (base 14) to base 13 -506 -145154 (base 6) to base 13 -6565 What is 10201110 (base 3) in base 12? 16a0 What is -1792 (base 12) in base 13? -13ac What is -da (base 14) in base 5? -1232 What is 22020 (base 5) in base 8? 2746 33012 (base 6) to base 14 1928 Convert -54684 (base 9) to base 3. -1211202211 -43ca (base 16) to base 11 -12047 Convert 2628 (base 11) to base 2. 110101011010 -8a (base 11) to base 7 -200 What is 26e0 (base 15) in base 11? 6275 Convert -77 (base 16) to base 11. -a9 Convert 19a (base 15) to base 2. 101110010 1605 (base 14) to base 12 2331 What is -1111011 (base 3) in base 4? -100330 What is -1661 (base 8) in base 12? -669 Convert 3a9 (base 15) to base 7. 2301 What is 105 (base 8) in base 12? 59 What is 28c (base 16) in base 4? 22030 What is 227 (base 9) in base 12? 137 What is 4483 (base 13) in base 14? 36b9 Convert -133032 (base 4) to base 6. -13130 What is 222232 (base 5) in base 16? 1e89 What is -1110011101 (base 2) in base 8? -1635 Convert -10433 (base 5) to base 12. -51b Convert a76 (base 14) to base 11. 1607 214 (base 10) to base 15 e4 14211 (base 5) to base 6 5245 -310320 (base 4) to base 10 -3384 -45 (base 9) to base 6 -105 What is 8a (base 14) in base 13? 95 -611 (base 11) to base 14 -3aa -194 (base 14) to base 7 -644 Convert -196 (base 13) to base 11. -246 -1009 (base 10) to base 6 -4401 What is 2121120101 (base 3) in base 11? 35719 Convert -16840 (base 10) to base 7. -100045 Convert 145b (base 12) to base 16. 947 What is 2ab (base 14) in base 13? 32a What is -5 (base 16) in base 8? -5 -2b06 (base 12) to base 6 -35210 -10279 (base 13) to base 12 -14947 Convert -b2aa (base 15) to base 3. -1220202121 What is 25386 (base 9) in base 4? 10023000 What is -46c (base 15) in base 12? -6b6 What is 499c (base 14) in base 6? 135342 Convert 120210001 (base 3) to base 12. 67a7 What is 6117 (base 10) in base 3? 22101120 Convert 1044 (base 13) to base 11. 1769 Convert -771 (base 9) to base 11. -524 What is -1313 (base 5) in base 6? -544 What is 1100110 (base 3) in base 14? 504 Convert 7629 (base 14) to base 16. 4fc5 Convert 3346 (base 7) to base 8. 2272 What is -1023222 (base 4) in base 16? -12ea What is 101201122 (base 3) in base 5? 222240 Convert -2cc (base 15) to base 6. -2550 6493 (base 10) to base 6 50021 Convert 31444 (base 5) to base 11. 1661 Convert -2a1 (base 13) to base 10. -469 Convert -451330 (base 6) to base 12. -19b46 What is 2442 (base 9) in base 7? 5210 727 (base 12) to base 10 1039 -30ac (base 16) to base 8 -30254 What is 26d3 (base 16) in base 11? 7516 What is -1bbb (base 16) in base 8? -15673 What is 626a (base 11) in base 2? 10000001110000 Convert -509 (base 10) to base 2. -111111101 Convert -3c7a (base 14) to base 5. -320232 What is 1032201 (base 4) in base 13? 2397 What is -3a0 (base 14) in base 11? -602 -223125 (base 6) to base 3 -221211222 What is -1408 (base 11) in base 3? -2111112 Convert -12f (base 16) to base 5. -2203 10212 (base 4) to base 15 149 12022200 (base 3) to base 4 330213 What is 2575 (base 13) in base 2? 1010011010111 324b (base 15) to base 16 2996 Convert -112120212 (base 3) to base 6. -121122 What is f9b (base 16) in base 11? 3002 What is -201200220 (base 3) in base 10? -14361 Convert -581 (base 12) to base 14. -425 Convert -4206 (base 7) to base 11. -1122 What is 4c63 (base 13) in base 9? 15847 -6110 (base 12) to base 14 -3b9a What is -1022012110 (base 3) in base 13? -b8b0 Convert -1144 (base 8) to base 4. -21210 Convert -fa9 (base 16) to base 13. -1a95 Convert -114301 (base 5) to base 3. -12221020 What is 461 (base 13) in base 11? 627 421120 (base 5) to base 16 3656 What is -3386 (base 13) in base 16? -1c28 What is 34100 (base 8) in base 9? 21670 What is c140 (base 13) in base 14? 998d Convert -227 (base 8) to base 6. -411 Convert -546 (base 13) to base 11. -751 Convert -223544 (base 7) to base 14. -10694 Convert -2825 (base 9) to base 2. -100001010001 -645 (base 8) to base 15 -1d1 -24077 (base 9) to base 5 -1003413 What is -124 (base 15) in base 11? -216 What is d86 (base 15) in base 11? 2324 What is -2115 (base 6) in base 14? -263 Convert 3010220 (base 5) to base 13. 18856 Convert -629 (base 15) to base 8. -2555 What is 2120 (base 6) in base 2? 111100000 Convert -2323030 (base 4) to base 16. -2ecc Convert 689 (base 16) to base 2. 11010001001 -ca3 (base 13) to base 8 -4161 -3cc9 (base 16) to base 2 -11110011001001 What is 10260 (base 9) in base 13? 3114 23221 (base 4) t	{ "pile_set_name": "DM Mathematics" }
-gm - 10 = 10 for m. -4 Let b(j) = 36j - 164. Let y be b(6). Solve -w = 12w - y for w. 4 Suppose -3p = -9p. Let j = -11 - -15. Let c be (j - 4)(-1 + 2). Solve c = -pz - z - 2 for z. -2 Let f = -4 + 9. Suppose -5b = -2b - x - 13, 4b - 2x - 16 = 0. Suppose bz = -5d + 55, 2d + 0z - 32 = -4z. Solve fr + 14 = -d for r. -4 Let u be (42/8)/((-30)/(-80)). Solve -5j = 11 + u for j. -5 Suppose -7o = -40 + 12. Solve ob + 1 = 9 for b. 2 Suppose -82 = -3m + 5n - 5, n = -4. Solve 6 + m = 5v for v. 5 Let i be -9 - (7 + -5 - 13). Solve -4x - ix = -x for x. 0 Let m = 9 + -6. Solve -13 = -mn - 7 for n. 2 Suppose 4z + 14 = 2m, -4m + 0 = -2z - 4. Let b(s) = -s*3 - 2s*2 - 3s - 1. Let q be b(m). Suppose -5n - 1 = 4h, -n = 3n + 4. Solve h + q = o for o. 2 Suppose -3h - 55 = -6h - w, 30 = 2h + 2w. Suppose -h = -21q + 16q. Solve -qz = -2z for z. 0 Let g be -12/(-1) + 2. Suppose -14 = -gt + 2. Suppose 24 = -ti + 8i. Solve -2s + i = 2 for s. 2 Let u be 33/2733. Let z(j) = 17 + 6j + 6j - uj. Let p be z(-11). Solve -pn = -4n for n. 0 Let o be (-3)/(30/4) + (-17)/(-5). Suppose 2g + 5 = or, -2g = 2r - 0g. Solve 3 + r = -s for s. -4 Let c(g) be the second derivative of g5/20 - g4/2 + 5g3/6 + g2 + 8g. Let v be c(6). Let m be v/(-24)(0 + -3). Solve -mo - 1 = -17 for o. 4 Suppose -12 = -n - 3x, 0n + x = -3n + 20. Suppose 0 = d + 4d. Suppose 3s - 4z = n, 5z = -3s - d + 6. Solve 0w - w - s = 0 for w. -2 Let a be (-3)/(1 + 0) + (5 - 4). Let o be a(-3 - 15/(-10)). Solve 3 = ou - 0 for u. 1 Suppose 6t = -2d + 5t - 4, -3d - 12 = 3t. Let q(l) = l*3 + 2l*2 - 4l - 1. Let w be q(-3). Suppose 6j = 5j + w. Solve jc + c = d for c. 0 Let a(v) = 2v*3 - 26v*2 + 48v + 20. Let c be a(11). Solve -j - c = -17j for j. 4 Let s(z) be the first derivative of -z3/3 + 6z*2 - 11z + 2. Let o be s(9). Let x be 0 + 0 + -2 + 6. Solve xh - o = -0h for h. 4 Suppose 2b + 11 + 13 = 0. Suppose -4u - 2g + 0g = 58, 10 = -u - 5g. Let t = b - u. Solve -tk - 3 = 6 for k. -3 Suppose -x + 4x = 66. Let q = 20 - x. Let u be (-1)/q-6 - -10. Solve 20 = 2y - uy for y. -4 Let b be (10(-2)/(-12))/(1/3). Solve -6d + b = -d for d. 1 Let l(f) = -18f2 - 4f. Let h(r) = 12r2 + 3r. Let n(m) = 7h(m) + 5l(m). Let c be n(-1). Let k be (1 + -11)c/14. Solve 0 = -kb + 25 - 5 for b. 4 Let u be 10/(-4)40/(-25). Let a(q) = 2q - 2. Let h(p) = 3p - 5. Let o(y) = -5a(y) + 3h(y). Let d be o(-5). Solve d = -0i - ui + 16 for i. 4 Let k be 1 + 1/1 - -2. Let t(b) = 9b*2 - 52b - 68. Let g be t(7). Solve -f - k = -g for f. 5 Let l(g) = 2g2 - 151g + 367. Let b be l(73). Let o = 1 - -2. Let n = 9 - o. Solve -bt - t = -n for t. 2 Let r be (-2)/(-8)-1(7 - 15). Solve ry = 2 - 4 for y. -1 Let d(h) = 0h + 0h + 3 - 3h3 + 2h*3. Let i be d(0). Let a be ((-60)/20)/(6/(-8)). Solve iz = az for z. 0 Let s = 18 - 16. Suppose -10 = -5p, -38 = -0c - sc - 4p. Let b = 0 + 2. Solve h + bh = c for h. 5 Let f be 12/3 - (-8 - -10). Solve 0 = i + fi for i. 0 Let s be 3/1 + 0/(49/(-7)). Suppose 5j = 47 + 18. Solve j - s = 5l for l. 2 Let i = 22 - 17. Let p(t) = -t3 + 2t + 1. Let n be p(-1). Suppose -4c + 5u = n, 0c = -2c + 3u. Solve c = ix - 3x + 6 for x. -3 Let j be ((-3)/3)/(2/(-10)). Suppose 2m = 2t + 7m + 14, 5t - 27 = 3m. Suppose i = -ti. Solve 0 = -ir + r - j for r. 5 Let i = 32 + -29. Suppose 5m - i = -0w + 3w, -2m = -3w - 3. Let z(s) = s3 + 5s*2 + 3s + 1. Let n be z(-4). Solve ng = -mg for g. 0 Let i(m) be the third derivative of -1/120m6 + 0m + 0m5 + 6m*2 + 1/2m*3 + 0m*4 + 0. Let p be i(0). Solve pj = -0j for j. 0 Suppose 49 = 3z + 5s, s + 4 = -0. Solve -3 + z = -4v for v. -5 Let t(o) = -o*3 - 8o*2 - 17o - 42. Let j be t(-7). Solve j = q + 32 for q. -4 Let m(l) = -2l2 + 3 + 5l*2 - 4. Let b be m(1). Suppose 12 = 4x, -32 - b = -5j - 3x. Solve jh - 6 = 14 for h. 4 Let g(k) = k3 - 9k*2 + 5. Let d be g(9). Let p(u) = 2u - 7. Let q be p(d). Let c = 1 - -2. Solve 0 = cy + q + 6 for y. -3 Let p be ((-18)/4)/(2/4). Let k be (-2)/p33. Suppose kz = -z. Solve -u + 4 = -zu for u. 4 Suppose 4t - 4m + 342 = -6m, -5m = -t - 58. Let c = t + 87. Solve co = 11 + 1 for o. 3 Let l(q) = q*3 - 5q*2 + 6q - 4. Let t be l(4). Solve -3y + 5 = -ty for y. -5 Let x(b) = 16b + 658. Let g be x(-41). Let u = -1 + 2. Solve u = gz - 7 for z. 4 Let g be (67 - 69)6/(-1). Solve -1 = -gk + 59 for k. 5 Let h = -37 + -47. Let b be h/(-7) - 3 - (-1 + 2). Solve -2j = -0j + b for j. -4 Let f be (-6)/(-8) + 45/(-12) + 48. Let i = f - 43. Solve -is = -7s + 10 for s. 2 Suppose 5a - 3a = 20. Suppose -26 = -3h + a. Suppose h = 4c - z, -3c + 28 = c + 3z. Solve 0 = -ci - 2 - 6 for i. -2 Let n be (0 - -1) + (-5)/(-5). Let y be (21/2)/(9/12). Suppose -4g = -y + 6. Solve g = nc + 12 for c. -5 Suppose 27j - 74 = 88. Solve -3 = -t - j for t. -3 Let s(w) = 3w - 3w*2 + 0w - w*3 + 3 - 1. Let c be s(-3). Let h = c - -11. Solve y + y + h = 0 for y. -2 Let k = 3 - 2. Let f(o) = 31o*2 + 495o - 12. Let q be f(-16). Solve -i - k = q for i. -5 Let j(p) be the third derivative of p5/120 - p4/12 - p*3/3 - 4p*2. Let o(y) be the first derivative of j(y). Let z be o(5). Solve 16 - 4 = zh for h. 4 Let w be (1 + 6/(-3))/(4/(-20)). Let j be -15(-5 + (-3)/(-1))/w. Solve x + x = j for x. 3 Let y(l) = -l2 + 17l + 14. Let w be y(0). Solve wa = 16a + 2 for a. -1 Let f(s) = -s*2 - 23s - 57. Let g be f(-20). Solve -5q = -gq + 6 for q. -3 Let s be (74 - 51)/(1 - 0). Solve 6r + 5 = s for r. 3 Suppose j + 7 = -3i, -j + 0j - 1 = -3i. Let d be ((1 - -2) + 7)/i. Let p be ((-9)/(-6))/(-3)d. Solve -23 = -pu - 3 for u. 4 Let n = -730 - -730. Solve n = 14i + 10 + 4 for i. -1 Let c(i) = 11i*2 + 1. Let y be c(-1). Let s be y/9(-21)/(-14). Solve -4 = sv + 2v for v. -1 Suppose -15 = -11n + 6n, 0 = -5i - 5n + 30. Let c be (-25)/(-4) + i/(-12). Solve 3o = 6 + c for o. 4 Let l = 20 - 20. Suppose 8 = b - k, -2 = -b - lb - k. Solve 0 = -bc + 2c + 6 for c. 2 Let o = 15 - 10. Let g = -2 + o. Suppose gx = -3x. Solve n - 2 = -x for n. 2 Let j(f) = f*2 - 7f + 13. Let g be j(3). Solve -2d - 3 = -g for d. -1 Let p(w) = -2w + 14. Let l(d) = -d - 1. Let v(x) = l(x) - p(x). Let z be v(11). Let s be 42/5 - z/(-10). Solve -s = -4g + 4 for g. 3 Let o(p) = -p3 - 3p*2 + 8p + 3. Let m be o(-5). Let x(a) = 26 - 4 + 2 - a. Let j be x(17). Solve -j - m = -5b for b. 4 Suppose -4p - 2m - 10 = 0, -2p + 2m = 3p + 8. Let u be 3/(p - (0/4 - 3)). Solve 5r + u - 18 = 0 for r. 3 Let u = 2 - -5. Let p be 5/206(-8)/(-2). Solve p = 4t - ut for t. -2 Let y(v) be the third derivative of -v5/60 + 5v*4/12 + 4v*3/3 - 12v*2. Let r be y(10). Suppose -1 = g - r. Solve -gb + 3b - 4 = 0 for b. -1 Suppose -12l - 49 = -19l. Solve 0 = lb - 4 + 18 for b. -2 Suppose -w + 4b = -32, -2w + w = 4b + 8. Suppose 12 = 8u - w. Solve uv - 6v - 15 = 0 for v. -5 Let f = -64 - -34. Let o = -53 - -84. Let k = o + f. Solve j - 2 = -k for j. 1 Let b = 58 - 55. Solve -2p = bp + 15 for p. -3 Let d(n) = n + 9. Let p be d(-7). Let b be 3 + -2 + p + (-3 - 0). Solve -4j - j = b for j. 0 Let t = 436 - 434. Solve -4s + 6 = t for s. 1 Let b = 63 - 59. Suppose 5k - b = 16. Solve 25 = -ky - y for y. -5 Let b be -1(48/(-4) + 3). Suppose 0 = 6o - b + 3. Solve -q + o = -3 for q. 4 Suppose 5m + 2m = 217. Let b = -23 + m. Solve -4j + 0 = b for j. -2 Suppose -2f - 3f + 59 = g, 0 = -f + 3g + 15. Let r be 1f(-1)/(-2). Suppose -l + 3l - r = 0. Solve 0 = -u + lu - 8 for u. 4 Let d = -151 + 244. Let f = d + -90. Solve 2 = -5u - f for u. -1 Let h = -22 - -8. Let b = h + 17. Suppose 4s = 6g - 2g, 3 = 4s - bg. Solve -2r = s - 1 for r. -1 Let l(q) = -q3 - q2 + q + 1. Let b(f) = -4f*3 - 10f*2 + 5f + 11. Let m(t) = b(t) - 5l(t). Let v be m(5). Solve -c + v = -3c for c. -3 Let v = 1 - -4. Suppose -13w + 17w + 12 = 2t, 5t + 3 = -w. Solve -v + t = f for f. -5 Let o be (-5)/2(-4)/5. Suppose 2v + 117b - 10 = 112b, 2v - 10 = 5b. Solve -7l = -ol + v for l. -1 Let l(p) = p*2 + 10p. Let f be l(6). Suppose -f = 5*m - m. Let d = m - -30. Solve -n = n + d for n.	{ "pile_set_name": "DM Mathematics" }
+ 9w = -3x, -l = 5x - 3w for x. -2 Let y be 8/10 - 36386/(-15). Let w be y/98 + (-2)/(-14). Solve -5j - 13 = -2v, 4v + w = v - 4j for v. -1 Let l = -58 + 46. Let k = l + 21. Suppose -11 = -5n + k. Solve -ny + 5y + 2i = 3, 37 = -5y + 3i for y. -5 Suppose 48p + 4 = 49p. Suppose pc = 34 + 22. Let j be 2(-3)/((-12)/c). Solve -3z = -2l - 15 - 6, j = l + 2z for l. -3 Let u = 249 + -243. Suppose uv + 1563 - 1587 = 0. Solve 0 = 4b + 2d + 16, -vb - b - 29 = -2d for b. -5 Suppose j = 2i - 18, -5i + 68 = j + 16. Let p(w) = -w3 - 2w*2 + w - 3. Let x be p(-3). Solve 0d = -d - xl + i, 0 = -5d + 2l + 16 for d. 4 Let z(a) = a2 - 9a + 8. Let k be z(8). Let p(j) = 34j2 + 9j - 8. Let x be p(1). Solve x = 5q + 5n, -q + kq - 5n + 23 = 0 for q. 3 Suppose -5f + 11 + 11 = 2p, 3f = -4p + 58. Let x(y) = 2y + 39. Let h be x(p). Let u = h - 41. Solve -r - u = -0t - 5t, 5t = 4r + 45 for t. 5 Let p(l) = l2 + 4l - 120. Let v be p(-13). Let o(u) = u*3 + 4u*2 + 5u + 10. Let y be o(v). Solve h + 3g = -10, 0h - h = -yg - 11 for h. -1 Let u = 187 - 186. Suppose 4l - 13 = -5o + 4, l - 2o - u = 0. Solve 2h + 4 = a - l, h = -4 for a. -1 Suppose -155m = -10m - 109 - 616. Solve -4i = -4l - 16, -4l + 0i = -mi + 21 for l. 1 Suppose -5u + 2g = -32, -18u + 5g = -15u - 23. Solve -3b - w = -u - 7, 22 = 4b - w for b. 5 Suppose 2r = -0r + 2. Suppose -519 = -90h - 69. Solve -15 = 2b + 3b + hq, -b - 3q - r = 0 for b. -4 Let j = 138 - 287. Let t = -149 - j. Solve u = 4m - t + 3, 2m = 5u - 15 for u. 3 Let v = -2325 + 2328. Solve -4l + l - 4h + 32 = 0, -4l = vh - 31 for l. 4 Let f(u) = 10u + 13u - 5u + 5 - 3u2 + 4. Let h be f(6). Solve 14 = -5w - 4c, -c - h = -2w + 6w for w. -2 Let x(k) be the third derivative of k5/60 + 7k*4/24 + 14k*3/3 + 133k*2. Let q be x(-4). Solve -4g - q = 2a, 0 = 2a + 3a - g + 7 for a. -2 Suppose 5 = 3b - 1. Let l = 22 - 19. Suppose 0 = 8c - lc - 25. Solve 0 = 2j - ck - 0 - 4, -bj + 4 = -k for j. 2 Let n = -31 + 37. Suppose 0 = -no - 2o - 64. Let l be (12/24)/((-2)/o). Solve b = -v - v - 6, -6 = lv - 3b for v. -3 Let l(x) = 97x - 2615. Let b be l(27). Solve 3q - 6 = -r, bq - 10 - 5 = r for r. -3 Suppose -44 = -6b - 14. Suppose -bs + 9s - 4 = 0. Solve u = r + r + s, u + 5r - 8 = 0 for u. 3 Let r be 165/55 - -63. Suppose 19 = 2y + 5k, -k + 11 = -17y + ry. Solve u + 2u + 2 = -yp, 0 = -5u + 3p + 3 for u. 0 Suppose -72 = -23l - l. Let m be (l/(6/2))/((-6)/(-12)). Solve 0 = -4g + mz - 12, 6g + z + 14 = 4g for g. -5 Let j be -72((-40)/12 - 1). Suppose 139q = 133q + j. Suppose -4k + q = 5w, -w + 0 - 1 = -3k. Solve 4g + 3v = -1 - 13, w = g - 5v for g. -2 Suppose -619w - 168 = -626w. Solve 3o + 33 = -3s + w, -s + o = -7 for s. 2 Suppose 129 = 22j - 245. Let o(d) = 2d3 - 34d*2 - d + 24. Let t be o(j). Solve a + 5c - t = 0, a - 12 = -3a - 4c for a. 2 Let s be (2 - 1)/(-1) + 5 + -1. Suppose sc - 15 = 0, 0 = 3y - c - 1 - 0. Suppose -5d + 26 = -54. Solve d = -5a + 2n, -3a = -n + 8 + y for a. -4 Suppose -16l = 31l + 15463. Let s = 352 + l. Solve -3x + n = 15, -5x + 0n + n - s = 0 for x. -4 Let v = -3101 + 3105. Solve 4 = -vs, s + 14 = 4u - s for u. 3 Let d = 2734 - 2722. Solve -24 = -n + 5s, 14s - 12s + d = n for n. 4 Suppose 3c = -2c + 25. Let o(x) = -2x2 - 23x - 29. Let y be o(-17). Let m = 216 + y. Solve mh - h - cj = -7, 8 = 3h + 2j for h. 2 Let t(g) = 3g - 1. Let h be t(2). Let r = 2307 + -2304. Solve c + hb = 4c - 22, -rb - 19 = 4c for c. -1 Let v(m) = 2m*2 + 2. Let z(f) = 5f*2 - 24f - 33. Let b(l) = -3v(l) + z(l). Let c be b(-22). Solve 0 = -co + 5h - 15 - 5, -o = h - 4 for o. 0 Let r(p) = 242p + 10407. Let q be r(-43). Let d be 3/6 + (-25)/(-2). Solve 3a - c = q - d, 0 = 2a - 4c - 2 for a. -5 Suppose 3x + 18 + 0 = 0. Let p be (-4)/x(-1 - -4). Suppose -105 = 108z - 129z. Solve 5y + pf - 21 = 0, 9 - 39 = -5y - zf for y. 3 Let d(q) = 4q - 127. Suppose 2w - 72 = -2x + 5w, 0 = -4x - 2w + 128. Let a be d(x). Solve -p - 3z + 1 = -az, 0 = -p + z + 3 for p. 5 Let m = -2341 - -2344. Solve 0 = -4z + 3s - 15, 14 = -5z + 2s - ms for z. -3 Let b(o) = -o*3 + 7o*2 + 11o - 9. Let h be b(8). Suppose -4x = t - 3, -t + 4x + h = 4t. Solve -tr - 4i = 1, -2r = 3r + 4i - 9 for r. 5 Suppose d - 2n - 3n = -1, 5d - 25 = -5n. Let r be ((-16)/(-6) - 2)(-10 - -16). Suppose d = rj - 4. Solve 0 = -5t - 20, -jt = 5l + t + 22 for l. -2 Suppose 5m - 2 = 4m, 2m = -w + 18. Let s be (21/w - 2)0. Solve s = -i + 1 - 4, -l + 5i + 10 = 0 for l. -5 Let f be 3(-7)/(-62/4). Suppose fu - 40 = -u. Solve -4 + 1 = b - 2g, 3b - ug = -10 for b. -5 Let j(q) = q*3 - 8q*2 - 15q - 29. Let c be j(10). Let g be (-2 + -1)(c - 22). Solve -5x - n + 28 = 0, -3x + g = -n - 3n for x. 5 Let q be ((-4)/(-5))/((-16)/(-40)). Suppose r - 7 = -qt + 3, -4 = 2r - 4t. Solve -5j = -rm - j - 24, -3m = -j + 16 for m. -5 Let t(m) = m*2 - m - 6. Let h be t(4). Let l be (h - 1)/(18/(-6) + 4). Solve -3z - 2 = g, -2z + 20 = -7z - lg for z. 1 Let l(d) be the second derivative of d4/2 + 5d*3/6 - 4d*2 - 2d - 33. Let b be l(1). Solve -2q + x = -4, q + 4x = -4 - b for q. 1 Let b = -22443 - -22659. Solve r = -3p - 1, -r + b - 218 = 2p for r. -4 Suppose 35d = 28d - 98. Let x = -75 - d. Let g = -58 - x. Solve b = 0, 5p - gb - 2b = 20 for p. 4 Suppose 7q - 33 = -4q. Let m(v) = -v2 + 14v. Let g be m(14). Suppose 13 = k - 3j, k + qj + j + 8 = g. Solve 0 = -ka - o + 4, o - 4 + 12 = 2a for a. 2 Let p(b) = 4b - 47. Let h be p(10). Let y be (-119)/h(0 + 1). Solve -g - 14 = 5q, -2g - 3g + y = -4q for g. 1 Suppose -2j - 32 + 17 = -3v, -20 = -5j - 4v. Solve -o + 31 = -10f - 0o, 2f + 2o + 4 = j for f. -3 Let h = 154 + -146. Suppose -2j = -h + 2. Solve 3y + 3u + 3 = -6, 0 = -5y - 2u - j for y. 1 Suppose 0 = -d - 8 + 9. Let y be (10 - 4/d)/(-2) + 7. Solve 5f = -5s + f + 28, 0 = -2s - yf + 16 for s. 4 Let j = -38 - -62. Let h be ((-7)/(-21))/(2/j). Suppose -2o - 3v = -5o + 21, 4o - v = 19. Solve 2q - ol - 5 = q, -hq + 3 = l for q. 1 Let p(b) = -8b3 + 35b*2 + 9b - 49. Let v be p(4). Solve 38g + 5 = vg - 5w, 0 = -3g - w - 13 for g. -5 Let c(x) = x*3 - 2x*2 - 4x + 6. Let b be c(3). Suppose -2w + bj = -3, -5j + 1 - 2 = -2w. Solve 0 = -4i - 4l - 8, -11 = 2i - wl - 2l for i. -3 Suppose 0 = 4052c - 4043c. Solve -2u + 3 = -d - 0u, -5d - 2u + 9 = c for d. 1 Let a be (-2323)/15 + 10/(-75). Let o = a + 165. Solve 3b = -m + b + 6, 2m = -2b + o for m. 4 Let t be (2 + -1)221/14. Suppose -7 = -2g - t. Suppose -3z - g = -14. Solve 5r + 29 = zf, -4r - 28 = r - 3f for r. -5 Suppose -8o = -37o - 24o. Solve -2i = 4f + 20, 2i - 4i - 2f - 10 = o for i. 0 Suppose -3d - 80 = 17d. Let j be 2/3(23 + 1) - d. Suppose 0 = -0g + 2g - 6. Solve -j = 4n + 4y, 2n + 5 = n - gy for n. -5 Let m be -17 - 3/((-12)/8). Let l = m - -17. Let c(y) = 14y + 117. Let b be c(-8). Solve 0f = lf + 4g - 10, -4g + b = -3f for f. 1 Suppose -5c = -4t + 66, -2237c = -4t - 2239c + 80. Solve 0q = -2q + 5p + t, -q + 4p + 14 = 0 for q. 2 Suppose g + 110 = 5c, -5g + c - 610 = 6c. Let w be (g/36)/(30/(-36)). Solve -9 = -2o - 3d, -2o - wd = -12 - 2 for o. -3 Let d(r) = -r2 + 10r - 7. Let l be d(9). Let z be (-2 - 72/(-33)) + (-3784)/(-484). Solve 4s + z = f - 5f, 4f - 2 = -ls for s. -5 Let p(s) = 2s. Let m be p(6). Suppose g + 10 = m. Let n = 157 - 157. Solve gt + 3 = 3f, 5t - 12 = -nf + f for t. 3 Let x be (-1 + -1)(-56)/(-21)-3. Let o = x - 8. Let j be 8/(-4) + o + -1. Solve 0r = r + jg - 10, -4r + g = 23 for r. -5 Let c(w) = -52w + 101. Let q be c(-5). Let a = -359 + q. Solve -5t + 7 = d + 1, 3d - 1 = at for t. 1 Let z(v) = -57v + 5761. Let l be z(101). Solve 36h - i + 8 = 39h, -h - i = -l for h. 2 Suppose 170f = 109f + 305. Let q be (-1)/4 - (-78)/(-8). Let l be 8/5(-25)/q. Solve -5a - fn = 5, 0 = -la + n - 9 for a. -2 Suppose -16 = -4r + 4. Suppose -13n + 554 = -44. Let w = -34 + n. Solve p + p - 12 = 2c, w = -rc - 4p for c. -4 Let k(m) = 2m2 - 6m - 1. Let u be k(5). Let l be	{ "pile_set_name": "DM Mathematics" }
21g2 + 54g wrt g. 4080g + 6 What is the third derivative of -215v*3 + 21v*2 + 1 wrt v? -1290 What is the second derivative of 57i*3s*2 + 2i*3 - 60is2 - 2i + 2s2 wrt i? 342is2 + 12i What is the second derivative of -171nz*2 + 104nz wrt z? -342n What is the second derivative of -qy5 - 5734qy2 - 13001qy wrt y? -20qy3 - 11468q Find the second derivative of 105u5 + 9u + 7. 2100u3 Find the first derivative of 49afhj + 54afj + 29ahj - aj - 56a - fhj wrt f. 49ahj + 54aj - hj Differentiate 26fi3 - 309f + 2i3 + 2i with respect to i. 78fi*2 + 6i*2 + 2 What is the second derivative of 47i*4 - 3i*2l*2 + il + 140l2 wrt i? 564i*2 - 6l*2 Find the third derivative of -2l*6w + 118l5w*2 + 113l*2w + 6w2 wrt l. -240l*3w + 7080l2w*2 What is the third derivative of -1622g*3 + 1592g*2 wrt g? -9732 What is the second derivative of -171l*4 + 43l - 2? -2052l2 What is the third derivative of 8v*2z*4 + 5v*2z*2 - 9v*2 + 4v - 101z4 + 2z*2 wrt z? 192v*2z - 2424z Find the first derivative of -5385d*2x2 + x2 + 348x wrt d. -10770dx2 Find the third derivative of -1901x*6 + 331x*2. -228120x*3 What is the third derivative of 817i*3u*2 + 410i*2u*2 + 2iu - 2u*2 wrt i? 4902u*2 What is the third derivative of 12486n6 + n2 - 19019 wrt n? 1498320n3 Find the third derivative of -478jr3 + j - 3r*2 wrt r. -2868j Find the second derivative of 36u3 + 2u - 185. 216u Differentiate 5f*3 - 5f*2 - 10f - 2272 with respect to f. 15f2 - 10f - 10 Find the first derivative of -38o3 + 13o*2 - 5997 wrt o. -114o*2 + 26o What is the third derivative of -65f3x4 + f3x - 9f*2x*2 - 36fx5 + fx*2 + 10fx wrt x? -1560f*3x - 2160fx*2 Find the third derivative of 71t*4 + 8t*2 + 16t. 1704t Differentiate -6r*3v*3 - 161r*3 - 15r*2v*3 wrt v. -18r*3v*2 - 45r*2v*2 Find the first derivative of 27t*4 - 20t*2 - 27943 wrt t. 108t*3 - 40t Find the first derivative of 308c + 803 wrt c. 308 What is the derivative of -f4 + 17f*2 - 121fy - 961y + 3 wrt f? -4f3 + 34f - 121y What is the derivative of -598f*3 - 10262 wrt f? -1794f*2 Find the second derivative of -14g*2x*2 - 2464g*2x + gx + 18x*5 wrt x. -28g*2 + 360x*3 Differentiate 145d*3s2 - d3s - 618s*2 wrt d. 435d*2s*2 - 3d*2s Find the third derivative of -11412t4 - 218t*2 - 4t - 5. -273888t What is the second derivative of 25k*2uv2 + 3k*2uv + 2k*2v + 56k2 - 12kuv*2 - 1 wrt v? 50k*2u - 24ku Find the second derivative of 413l2 + 53l. 826 What is the third derivative of 13pz*6 + 4pz4 - pz*2 - 975pz wrt z? 1560pz3 + 96pz What is the second derivative of -510d4 + d3 - 15d + 15 wrt d? -6120d*2 + 6d Find the second derivative of -325n3 - 4n - 42. -1950n What is the third derivative of 56f*3r*3 + 2f*3r - 3f2r*5 - 5fr2 - 2r*2 wrt r? 336f*3 - 180f*2r*2 Find the first derivative of -24hl2 + hl - 1060h - l wrt l. -48hl + h - 1 What is the first derivative of -355n*2 - 6777 wrt n? -710n Differentiate 202cm*2 + 5m*2 - 5 wrt c. 202m*2 What is the derivative of 474m + 6100? 474 Find the third derivative of -3hr*2v*3 - hr*2v*2 + 2hrv*3 - 3hrv - 58hv*3 - 4hv2 + r2v wrt v. -18hr*2 + 12hr - 348h Find the first derivative of -9o2 - 222. -18o What is the third derivative of -176b3p*2 - 3b*3w3 - b3w2 + 2b*2p*2 - 10b*2pw3 + 2bp2w*3 + bw*3 wrt b? -1056p*2 - 18w*3 - 6w2 What is the second derivative of s3v2 + 56s*3v + sv2 + 66v*2 wrt s? 6sv2 + 336sv What is the derivative of 1850i3 - i2 + 2337? 5550i2 - 2i Find the third derivative of -4n3 + 445n2 wrt n. -24 What is the third derivative of s4y2 + 5s*4y - 12s3y*2 - 4s*2 + 9sy2 wrt s? 24sy2 + 120sy - 72y*2 What is the second derivative of -17778n2 - n - 21811? -35556 What is the derivative of -n3 + 4285n2 - 607? -3n*2 + 8570n Find the first derivative of u*2 - 33u + 35 wrt u. 2u - 33 What is the first derivative of -k2pu3v + 2k2pu3 + 15k*2u*3 - kpu3 - 18kpv wrt v? -k*2pu3 - 18kp Find the third derivative of 20x*4 + 4x*3 + 426x*2 + 7x wrt x. 480x + 24 Differentiate -16ns2 - 43ns - 87n - s*2 - 2 wrt s. -32ns - 43n - 2s What is the third derivative of -y3 + 188y*2? -6 Find the second derivative of -682q*4s - 2q2 - qs + 140s + 2 wrt q. -8184q*2s - 4 Differentiate 397i3z + 186i3 wrt z. 397i*3 Differentiate -3hk - 19h + 134k wrt h. -3k - 19 What is the second derivative of -z*4 + 964z*3 - 3z*2 + 107z - 4? -12z2 + 5784z - 6 Find the second derivative of -469j5 + 374j wrt j. -9380j3 What is the third derivative of -6t*4 + 13t*3u + 213t2u wrt t? -144t + 78u What is the second derivative of -35o5 - o3 + 64o + 3? -700o3 - 6o Find the third derivative of -6m2u*3 - 2m*2u*2 - 60m*2u + 47mu*4 wrt u. -36m*2 + 1128mu What is the third derivative of -u5 - 8u*4 - 694u*3 + 6u*2 + u + 387 wrt u? -60u*2 - 192u - 4164 Find the second derivative of 77i2 + 179i. 154 Find the third derivative of 79m3w + 6m3 + 10m*2w - 62w wrt m. 474w + 36 Find the second derivative of -s*4u + 39s4 + 38s*2u + su + 60s - 27 wrt s. -12s2u + 468s2 + 76u Find the third derivative of -450v5 - 400v*2 wrt v. -27000v*2 What is the third derivative of -4v*6 - 537v*5 - 305v*2 wrt v? -480v*3 - 32220v*2 Find the second derivative of 48g*2i*2j - 2g2i*2 + 4g*2i + 14g2j + 6gi*2 + 3gj wrt i. 96g*2j - 4g2 + 12g Find the second derivative of -819p2 - 1212p. -1638 What is the third derivative of 221s5 + 147s*2? 13260s*2 What is the third derivative of -2y*6 - 2y*5 + 72y4 + y2 + 125y? -240y*3 - 120y*2 + 1728y Find the third derivative of z*6 + 14z*4 - 14z*2 + 3. 120z*3 + 336z Differentiate -6cf*2 + 2f*2 - 112 with respect to c. -6f*2 Find the third derivative of -1857u*3w + 2u2w + 4u2 + 5uw + 32u wrt u. -11142w Differentiate 18455k*2w + 24369k2 with respect to w. 18455k*2 Find the second derivative of 9s*3z*2 - 3s*2z3 + s2z + 2s - 256z3 wrt s. 54sz2 - 6z*3 + 2z Find the first derivative of 841q2 - 3562. 1682q What is the second derivative of -846i3 - 2i*2 + 1388i - 3? -5076i - 4 What is the third derivative of -13291c*6s - 2c2s + 8cs + 56 wrt c? -1594920c3s What is the second derivative of 99l3 - 2l + 27? 594l Find the first derivative of -2177y*3 - 4016 wrt y. -6531y*2 Differentiate -999a*2 - 1657. -1998a Differentiate 7825x + 861 with respect to x. 7825 What is the second derivative of 64i*2o*3y*3 - 2i*2y*3 + 51io3 - 2io2y*3 wrt i? 128o*3y*3 - 4y*3 Find the third derivative of -52v*6 + 30v*5 - 13v*2 + 41 wrt v. -6240v*3 + 1800v*2 What is the third derivative of -jo*3y*5 - 15jo3y*4 + jo*3y - 13jo*2y*2 + 2jo2y - o*3y wrt y? -60jo*3y*2 - 360jo3y Differentiate -141l3y + 13l3 + 2ly4 + 11l with respect to y. -141l3 + 8ly3 Differentiate 9766q*2 - 1880 wrt q. 19532q What is the third derivative of 2j4 + 297j*3s + 5j2s + 26j2 + 5s wrt j? 48j + 1782s Differentiate 63hw*2 + 17hw + 4h + 7872w2 with respect to h. 63w*2 + 17w + 4 Find the third derivative of 139x5 + 2x*3 + 3x*2 - 69 wrt x. 8340x*2 + 12 Find the second derivative of -2b*4m*3 + 60b*4 + 7b + m*3 wrt b. -24b*2m*3 + 720b*2 Differentiate 682l - 855 wrt l. 682 What is the third derivative of -399h4j*2 + 8h*3j3 - h2j3 - 84hj3 + 4j*3 wrt h? -9576hj2 + 48j*3 Find the first derivative of 3900d + 4156 wrt d. 3900 What is the second derivative of 26d4 + 4d*3x + 4d2x - 3d + 155x wrt d? 312d2 + 24dx + 8x What is the derivative of -31b4u*2 + 7bu2 + 2u**	{ "pile_set_name": "DM Mathematics" }
-2)*2. 16sqrt(13) + 833 Simplify sqrt(500) - (sqrt(500) + -3) - (sqrt(5) - (-2sqrt(50))/sqrt(10)). -3sqrt(5) + 3 Simplify ((sqrt(153)-2 - sqrt(153))5)/sqrt(9). -15sqrt(17) Simplify (-3sqrt(75)/sqrt(3))/(2sqrt(500)). -3sqrt(5)/20 Simplify (1 + sqrt(1872) + 3)*2. 96sqrt(13) + 1888 Simplify 3((sqrt(3) + sqrt(3) + (sqrt(75) + sqrt(3))3 - sqrt(3)) + 3)*2. 342sqrt(3) + 3276 Simplify (sqrt(77)/((sqrt(121) + 1sqrt(121))/sqrt(11)))2 - sqrt(49)/(sqrt(252) - (1sqrt(252) - sqrt(252))). -sqrt(7)/6 + 7/4 Simplify ((sqrt(42) - -1sqrt(42)) + sqrt(42) + sqrt(42))/sqrt(6) - (sqrt(7) + -2)24. -44 + 20sqrt(7) Simplify 1(-4 + sqrt(153) + 1). -3 + 3sqrt(17) Simplify (1sqrt(8)-5 + sqrt(8))/(sqrt(100)-1 - sqrt(4)). 2sqrt(2)/3 Simplify 3(1 + -4 + sqrt(833)). -9 + 21sqrt(17) Simplify (sqrt(162) + 1 - sqrt(2))42. 8 + 64sqrt(2) Simplify (sqrt(13) + sqrt(13) + sqrt(13) + sqrt(39)/sqrt(3)-6 + sqrt(13) - (0 + sqrt(1300))2)-63. 36sqrt(13) + 23400 Simplify ((sqrt(209) + (sqrt(209)1 + sqrt(209))4)/(sqrt(66)/sqrt(96)))2. 24624 Simplify (sqrt(539) + sqrt(539) + 2)21 - sqrt(539)-32. 98sqrt(11) + 2160 Simplify sqrt(121)/(sqrt(539)-1 - sqrt(11)). -sqrt(11)/8 Simplify (sqrt(15) + (sqrt(15) + -21sqrt(15) - sqrt(15)))/((-1sqrt(55))/sqrt(11)). sqrt(3) Simplify -2 + (1 + sqrt(1088) - (sqrt(17) - (sqrt(68) + sqrt(68)2 - sqrt(68))2)). 7sqrt(17) + 271 Simplify (-2sqrt(14)-5)/((sqrt(2) + 2sqrt(2))-6). -5sqrt(7)/9 Simplify 2 + 3sqrt(91)/sqrt(7). 2 + 3sqrt(13) Simplify (sqrt(567)1-4)2 + 2. 9074 Simplify 4 + (sqrt(17) + sqrt(204)/sqrt(12))1. 4 + 2sqrt(17) Simplify (-2sqrt(272) + -5)*2 + 3. 80sqrt(17) + 1116 Simplify -3 + 0 + (sqrt(171)-2)2 + sqrt(171) + -5 + (sqrt(171) + -1)2. -3sqrt(19) + 848 Simplify -5 + (-2sqrt(1300) - sqrt(1300)) + 1. -30sqrt(13) - 4 Simplify (2(sqrt(19) + sqrt(228)/(-2sqrt(12))))*2. 19 Simplify (sqrt(75)-1)*2 + -1sqrt(12). -2sqrt(3) + 75 Simplify -2(sqrt(49)/sqrt(63) - sqrt(7) - sqrt(7)). 10sqrt(7)/3 Simplify sqrt(28)/sqrt(4)5 + (sqrt(252)-2)2. 5sqrt(7) + 1008 Simplify (-6(sqrt(675) + -1))2. -1080sqrt(3) + 24336 Simplify (sqrt(33) + sqrt(165)/sqrt(5))/sqrt(3) - (-3sqrt(539))2. -4851 + 2sqrt(11) Simplify (sqrt(104)/sqrt(392)3)2 + 0. 117/49 Simplify (sqrt(240)/(2sqrt(4)))/(sqrt(84)/(sqrt(28)/sqrt(4))). sqrt(5)/2 Simplify -5((sqrt(12) - sqrt(108)) + (sqrt(3) - ((sqrt(12)/sqrt(4))2 + 1) - sqrt(3))). 20 + 20sqrt(3) Simplify -3(sqrt(7) - (sqrt(7) + sqrt(70)/(sqrt(20)/sqrt(2))) - sqrt(7)). 6sqrt(7) Simplify ((3sqrt(4455))/(1sqrt(180)))*2. 891/4 Simplify (3 + 3(1 + sqrt(17))-1)2. 153 Simplify 4(sqrt(44)/sqrt(4))*23. 132 Simplify (2(sqrt(18) + sqrt(162)))/sqrt(9)-4. -32sqrt(2) Simplify -5 + ((sqrt(35) + 1sqrt(35))1)/(-4sqrt(21)/sqrt(3)). -5 - sqrt(5)/2 Simplify (5(sqrt(117)2 + sqrt(117)))/sqrt(9) + 2. 2 + 15sqrt(13) Simplify (sqrt(539) + 0 + sqrt(11))2 - ((sqrt(11) + 2 - sqrt(11)) + 0 - sqrt(11)). sqrt(11) + 702 Simplify (sqrt(243) + -2sqrt(243))/sqrt(9). -3sqrt(3) Simplify -16-4(-2 + sqrt(19)). -48 + 24sqrt(19) Simplify (-2sqrt(448) + sqrt(448) + -5 - (sqrt(448) - (sqrt(448) + 0 + sqrt(448) + 0)))2. 25 Simplify sqrt(500) - (1 + sqrt(500) + sqrt(500))2-3. 130sqrt(5) + 6003 Simplify (-2(sqrt(5) + 0))2 + 5. 25 Simplify -4(-2sqrt(1053))2. -16848 Simplify ((sqrt(3) - (sqrt(12) + 4 + sqrt(3))) + (sqrt(3) + 0)-1)*2. 24sqrt(3) + 43 Simplify (sqrt(88)23)/(-4sqrt(48)/sqrt(6)). -3sqrt(11)/2 Simplify (sqrt(110)/(2sqrt(2)))/(sqrt(11) + sqrt(99)/(2sqrt(9))). sqrt(5)/3 Simplify (6sqrt(110)1)/(sqrt(810)1). 2sqrt(11)/3 Simplify ((-3 + 5sqrt(108)1)5)2. -4500sqrt(3) + 67725 Simplify (sqrt(162) - 3sqrt(162)) + 5 - (2 + (sqrt(162) + 2)2 - sqrt(162)). -163 - 45sqrt(2) Simplify sqrt(55)/sqrt(5)1 + (sqrt(11) - sqrt(1584)/sqrt(4)). -4sqrt(11) Simplify ((sqrt(68) - (sqrt(68) + sqrt(68)2 + sqrt(68) + sqrt(68))) + sqrt(68))/sqrt(4) + 2(0 + sqrt(17)). -sqrt(17) Simplify (sqrt(20)-4 + 4 + -2)2. -32sqrt(5) + 324 Simplify (-1 + 2 + (1 + sqrt(7) + 3 + sqrt(7) - sqrt(7) - sqrt(7)))*2. 25 Simplify ((-1sqrt(85) - sqrt(85))1 - sqrt(85))/sqrt(5). -3sqrt(17) Simplify 3(0 + (sqrt(17) + sqrt(34)/sqrt(2))2)-1. -204 Simplify -2sqrt(99)2. -12sqrt(11) Simplify 2(2 + (sqrt(396) + 1 - sqrt(396))). 6 Simplify sqrt(78)/(sqrt(18)/sqrt(3)) - (sqrt(832) - (sqrt(832) + 0)). sqrt(13) Simplify ((sqrt(90)/sqrt(3) + sqrt(30))4)/(1sqrt(1210)). 8sqrt(3)/11 Simplify (-1(sqrt(55) + ((1sqrt(385))/sqrt(7) - sqrt(55)) - sqrt(55))/(sqrt(40)/(-1sqrt(8))))*2. 0 Simplify (sqrt(320) + -1sqrt(320))/(sqrt(40)/(sqrt(10)2)). 0 Simplify (1sqrt(7) + 3)*2 + sqrt(700)-4. -34sqrt(7) + 16 Simplify sqrt(76)-3-3 + 1sqrt(2299)3. 51sqrt(19) Simplify (-2sqrt(200) + sqrt(200))2 + sqrt(32)5. 20sqrt(2) + 200 Simplify (sqrt(6)/sqrt(3) + sqrt(2) + -4 - (sqrt(2)-16 + sqrt(2)))2. -56sqrt(2) + 114 Simplify (sqrt(17) + 1)*24 + 0. 8sqrt(17) + 72 Simplify -224sqrt(567). -144sqrt(7) Simplify ((sqrt(189)3 + sqrt(21))/sqrt(7))*2 + 0. 300 Simplify (-5(sqrt(11) - (sqrt(11) + 1sqrt(11)-2)))*21. 1100 Simplify (sqrt(5) + 1 + -3)-6. -6sqrt(5) + 12 Simplify 4 + -2sqrt(8). -4sqrt(2) + 4 Simplify (sqrt(133)/sqrt(7) + -2 + (sqrt(209) + sqrt(209)-1)/sqrt(11))2. -4sqrt(19) + 23 Simplify ((sqrt(15) - (sqrt(120) + sqrt(30))/sqrt(2))/((sqrt(18)1)/sqrt(6)))2. 20 Simplify (sqrt(84) - -1sqrt(84))/sqrt(7). 4sqrt(3) Simplify -4 + 1 + sqrt(11) + sqrt(11) + 0 + 0. -3 + 2sqrt(11) Simplify -4 + sqrt(5)-1 + 1. -3 - sqrt(5) Simplify 2 + ((sqrt(432) - (0 + sqrt(432)))5)*2 + -4. -2 Simplify (sqrt(76)/sqrt(4)-4 + 4sqrt(931) + sqrt(931))2. 18259 Simplify (((sqrt(121) - (sqrt(121)-1 + sqrt(121)))-4)/sqrt(11))2 + -5. 171 Simplify -1sqrt(637) + (sqrt(156) - sqrt(39))/sqrt(3) + -3. -6sqrt(13) - 3 Simplify -2 + 3sqrt(7)2. -2 + 6sqrt(7) Simplify sqrt(637) + 1 + -1sqrt(117) - (-2 + -2sqrt(13)-2). 3 Simplify -4 + sqrt(13) + -1 + sqrt(468)2. -5 + 13sqrt(13) Simplify (3(2 + sqrt(3)))*2 + sqrt(24)/(sqrt(40)/sqrt(5)). 63 + 37sqrt(3) Simplify (-5 + (sqrt(126)-1 + sqrt(126) + sqrt(126) + sqrt(126) + sqrt(126))/(sqrt(8)/(2sqrt(4))))*2. -180sqrt(7) + 2293 Simplify sqrt(1300)3 + -1. -1 + 30sqrt(13) Simplify ((-1sqrt(126))/(((sqrt(77)1)/sqrt(11) - sqrt(7)) + sqrt(7)))2. 18 Simplify ((sqrt(17) + 1 + 3 + sqrt(17) - sqrt(17)) + 4 - (2 + 3 + sqrt(68)))2. -6sqrt(17) + 26 Simplify 5 + sqrt(252) + (sqrt(252) + sqrt(252) + 4 + sqrt(252))2. 150sqrt(7) + 2289 Simplify -2((sqrt(170) + -2sqrt(170)-4 + sqrt(170))/(4sqrt(20)/sqrt(2)))*2. -425/2 Simplify 1(sqrt(343) + 1sqrt(343) + sqrt(343) - sqrt(343)) + (-2sqrt(343))*2 + -1. 14sqrt(7) + 1371 Simplify -1 + sqrt(34)/sqrt(2)2. -1 + 2sqrt(17) Simplify (sqrt(432))*2 + (sqrt(432)-2)*2. 2160 Simplify 4 + (sqrt(76) + 1sqrt(76)1)/((sqrt(4) - ((sqrt(4) - (sqrt(4) - ((sqrt(160)/sqrt(4))/sqrt(10) - sqrt(4)))) + sqrt(4))) + sqrt(4)). 4 + 2sqrt(19) Simplify (-4 + sqrt(1008) - (sqrt(700) + 4 - sqrt(7)))*2. -48sqrt(7) + 127 Simplify (sqrt(605) + 2 - sqrt(605)) + sqrt(605) + -1. 1 + 11sqrt(5) Simplify (4(0 + sqrt(18)))*2. 288 Simplify 3(4 + (sqrt(2) + sqrt(2) + 4sqrt(18)/sqrt(9) + sqrt(2) - sqrt(2))). 12 + 18sqrt(2) Simplify 3 + (-2 + 1sqrt(13) - sqrt(13))2 + 2. 9 Simplify 4sqrt(171) + ((sqrt(19)-5 + sqrt(19))-1)*2. 12sqrt(19) + 304 Simplify 6(sqrt(5) - (2 + sqrt(605))2). -3654 - 258sqrt(5) Simplify (sqrt(1375) - sqrt(1375)1 - sqrt(55))/(sqrt(275) + 2sqrt(275)). -sqrt(5)/15 Simplify (-5 + (2 + sqrt(19))4)2. 24sqrt(19) + 313 Simplify (sqrt(39) + 2sqrt(1911) - sqrt(39))/(sqrt(108) - -2sqrt(108) - sqrt(108)). 7sqrt(13)/6 Simplify 2 + sqrt(3072). 2 + 32sqrt(3) Simplify 4sqrt(11)4 + 4. 4 + 16sqrt(11) Simplify (-3 + -22sqrt(19) + 1)2. 16sqrt(19) + 308 Simplify 4 + sqrt(102)/(sqrt(726) - -2sqrt(726) - sqrt(6)). sqrt(17)/32 + 4 Simplify ((-2sqrt(612) - sqrt(612))*2 + sqrt(612))-4. -22032 - 24sqrt(17) Simplify sqrt(16)/(sqrt(72)/(3sqrt(9))). 3sqrt(2) Simplify (sqrt(5)2 + 4 - (sqrt(405) + -2sqrt(405)))2 + (-4 + sqrt(45))-2. 82sqrt(5) + 629 Simplify -5-5sqrt(1900)-2. -500sqrt(19) Simplify ((sqrt(33) - -1sqrt(33))2)/sqrt(3). 4sqrt(11) Simplif	{ "pile_set_name": "DM Mathematics" }
ounded to three dps? -47.445 Round 1737276310 to the nearest 1000000. 1737000000 What is -0.00182341582 rounded to four dps? -0.0018 Round 0.0000069062939 to 6 dps. 0.000007 Round -0.267670643 to two dps. -0.27 What is -277188887.3 rounded to the nearest ten thousand? -277190000 What is 0.2397441731 rounded to 3 dps? 0.24 What is -981958.69 rounded to the nearest 1000? -982000 What is -7.88662618 rounded to two dps? -7.89 Round 0.0162682847 to 2 dps. 0.02 What is -0.05866539014 rounded to 2 decimal places? -0.06 What is 0.0200144307 rounded to five decimal places? 0.02001 Round 0.001357032195 to 7 dps. 0.001357 What is 53.860961 rounded to 3 dps? 53.861 What is 0.200981266 rounded to four dps? 0.201 Round 61596364.97 to the nearest one hundred thousand. 61600000 Round -0.000000704322487 to 7 dps. -0.0000007 What is -0.00044014387 rounded to four decimal places? -0.0004 Round -0.002457852731 to four decimal places. -0.0025 Round 749341.23 to the nearest one hundred. 749300 Round 0.0046389733 to 3 decimal places. 0.005 Round 0.000002697917609 to seven decimal places. 0.0000027 What is -0.00017353424 rounded to 5 decimal places? -0.00017 Round -89600.262 to the nearest 10. -89600 Round 3069.79244 to the nearest ten. 3070 What is 0.00580637911 rounded to 3 decimal places? 0.006 What is -0.0000709611337 rounded to 6 dps? -0.000071 Round -196.11868805 to three dps. -196.119 Round 13332847.6 to the nearest one million. 13000000 What is -54.37759773 rounded to two dps? -54.38 Round -76.816036 to the nearest integer. -77 What is -0.000212144421 rounded to five dps? -0.00021 Round 0.0025512654 to five dps. 0.00255 Round -1820392 to the nearest ten thousand. -1820000 What is -0.351714918 rounded to four decimal places? -0.3517 Round 57331794440 to the nearest one million. 57332000000 What is -26.914459 rounded to two dps? -26.91 Round -0.1184056506 to five dps. -0.11841 Round 0.0028654892 to four decimal places. 0.0029 What is 1340394.98 rounded to the nearest 10000? 1340000 What is -14998566.46 rounded to the nearest one million? -15000000 What is -0.000000000229296 rounded to six decimal places? 0 What is -920.556863 rounded to the nearest one hundred? -900 Round 0.00038607738 to 5 decimal places. 0.00039 What is -4244.20962 rounded to the nearest integer? -4244 What is 6340.47049 rounded to the nearest 10? 6340 What is 24399.9768 rounded to the nearest one thousand? 24000 What is 3.8123754 rounded to three decimal places? 3.812 Round 8440216.3 to the nearest 100000. 8400000 Round -4922.2571 to the nearest ten. -4920 What is 6868555.334 rounded to the nearest one hundred thousand? 6900000 What is -9684.873242 rounded to the nearest integer? -9685 What is -0.0014243574 rounded to 7 decimal places? -0.0014244 Round -3582.580268 to 1 decimal place. -3582.6 Round 3462845 to the nearest 10000. 3460000 Round -202.980231 to the nearest integer. -203 Round 0.0000158436588 to six dps. 0.000016 What is 28532.535 rounded to the nearest 1000? 29000 What is 164944.173 rounded to the nearest one thousand? 165000 What is -2226.67452 rounded to 1 decimal place? -2226.7 Round 138947021 to the nearest one hundred thousand. 138900000 What is -0.00198087463 rounded to seven dps? -0.0019809 Round 3976225.391 to the nearest one thousand. 3976000 Round 0.010626981 to 3 dps. 0.011 What is 1309.729572 rounded to the nearest one hundred? 1300 Round 0.00061276113 to seven dps. 0.0006128 Round 28544.2859 to the nearest 100. 28500 Round -0.05207733362 to five dps. -0.05208 Round 0.000199276437 to 5 dps. 0.0002 What is 7983530840 rounded to the nearest one hundred thousand? 7983500000 Round 796.87334 to 1 dp. 796.9 Round 0.01245696119 to six decimal places. 0.012457 What is -76.3739014 rounded to zero dps? -76 What is 0.00034796707 rounded to 6 dps? 0.000348 What is -0.18153202652 rounded to 5 dps? -0.18153 Round -274378003 to the nearest 10000. -274380000 What is -478700480 rounded to the nearest one million? -479000000 Round -178744.354 to the nearest ten. -178740 What is -10671.393724 rounded to the nearest ten? -10670 What is -1.4471052 rounded to 1 dp? -1.4 Round 183.74944 to 1 dp. 183.7 Round 10044511.644 to the nearest ten thousand. 10040000 What is -0.1142162516 rounded to 5 decimal places? -0.11422 Round -2604.548662 to zero decimal places. -2605 Round -2538.14486 to the nearest integer. -2538 What is -0.4872846299 rounded to 4 dps? -0.4873 What is 1003924322.1 rounded to the nearest 100000? 1003900000 What is -6845.39943 rounded to the nearest one thousand? -7000 Round 18.21636031 to the nearest ten. 20 What is -1587.50896 rounded to the nearest ten? -1590 What is -431.658721 rounded to 1 dp? -431.7 Round 0.000296872649 to 5 decimal places. 0.0003 What is -137.460768 rounded to three dps? -137.461 Round -23354760.71 to the nearest 1000. -23355000 Round -38391.5332 to the nearest 10000. -40000 What is 20227311.29 rounded to the nearest 1000? 20227000 What is 14291.37451 rounded to the nearest ten? 14290 Round 3880232.07 to the nearest 100. 3880200 Round -26.2322811 to 1 dp. -26.2 Round 0.28812189656 to three decimal places. 0.288 Round 26.51806119 to 3 dps. 26.518 What is -271949034 rounded to the nearest one hundred thousand? -271900000 What is -0.00000325256767 rounded to six decimal places? -0.000003 What is -0.005276858278 rounded to five decimal places? -0.00528 Round -0.13607138 to four decimal places. -0.1361 What is 8209616.5 rounded to the nearest ten thousand? 8210000 What is -0.00006577421209 rounded to seven decimal places? -0.0000658 Round 2611.069513 to the nearest 10. 2610 What is 0.0446020236 rounded to six decimal places? 0.044602 What is -0.075548027 rounded to 5 decimal places? -0.07555 Round -437842.216 to the nearest ten. -437840 Round -2012664100 to the nearest 1000000. -2013000000 What is 0.0004726889 rounded to three decimal places? 0 Round -0.00086476921 to five decimal places. -0.00086 Round -17387371.79 to the nearest 1000000. -17000000 What is -14.858327 rounded to 0 dps? -15 Round -2025194920 to the nearest 100000. -2025200000 What is -2926555673 rounded to the nearest one million? -2927000000 What is -6.34254491 rounded to zero decimal places? -6 What is -102.22565313 rounded to three dps? -102.226 Round -908.065306 to the nearest ten. -910 Round 0.0000009330491244 to seven dps. 0.0000009 What is -152773777 rounded to the nearest 100000? -152800000 Round 172.744242 to the nearest 10. 170 Round -280.266233 to one decimal place. -280.3 What is 174325.9504 rounded to the nearest ten? 174330 What is 0.000025540403 rounded to seven decimal places? 0.0000255 Round -32581.7648 to the nearest ten thousand. -30000 Round -2.11854039 to 4 dps. -2.1185 Round -0.02460680645 to 5 dps. -0.02461 What is -0.008912893119 rounded to six dps? -0.008913 Round -91.5091635 to the nearest 100. -100 Round -6.770285385 to four dps. -6.7703 What is -5351.786196 rounded to one decimal place? -5351.8 What is -11758303.49 rounded to the nearest 100000? -11800000 Round 1.0018306452 to 4 dps. 1.0018 What is -0.00000558763851 rounded to six dps? -0.000006 What is 476007439 rounded to the nearest ten thousand? 476010000 What is 56160.311 rounded to the nearest one hundred? 56200 Round 14031.1168 to the nearest 100. 14000 What is -101670678.7 rounded to the nearest 1000000? -102000000 What is 0.0241304268 rounded to five dps? 0.02413 What is -3162.6126 rounded to zero dps? -3163 What is -2304.291269 rounded to zero dps? -2304 Round -0.0035217993 to 6 decimal places. -0.003522 What is -20703.767 rounded to the nearest ten? -20700 What is 31.54120932 rounded to one decimal place? 31.5 What is -58.51492071 rounded to two decimal places? -58.51 What is 0.000000689682896 rounded to seven decimal places? 0.0000007 Round 1520327893 to the nearest 100000. 1520300000 What is 103.4690899 rounded to the nearest integer? 103 Round -0.00000015168172 to 7 dps. -0.0000002 Round -16405.21796 to the nearest 1000. -16000 Round -0.002233092655 to 4 dps. -0.0022 Round 610037.2 to the nearest 100000. 600000 What is 1506878674 rounded to the nearest 100000? 1506900000 What is 0.0000478154402 rounded to six dps? 0.000048 What is -44534986 rounded to the nearest one hundred thousand? -44500000 Wh	{ "pile_set_name": "DM Mathematics" }
3 - 28w*2 Expand (5p + 24 - 24)(0 + 0 - p). -5p*2 Expand (-4w + 11w + 3w)(-2w + 2 - 2 - 3w + 0w + w + 0 - w + 0 - 2w + 6w - 2w + (2 - 6 + 2)(4 - 2w - 4) - 3w + 5w + 0w). 30w2 Expand (-21 + 4 + 1)(-3z - z + 3z). 16z Expand (4j + j - 6j)(0j + 3j - j) + (j - 6j + 2j)(7j - 2j - 3j). -8j2 Expand (-2 + 1 + 3 + (0 - 1 - 1)(-1 + 1 - 1))(-11v - 16v + 22v) + 2v - 1 + 1. -18v Expand 0 - 2r - 3 - 1 + (-2r + 2r + 2r)(1 + 3 - 3) - 4 + r + 4. r - 4 Expand 1 - i - 1 + (-i + i - i)(-1 + 1 - 2) + 4 - 4 + 2i + 2 - 2 + i - 5 + 5 - 10i. -6i Expand (0q + 0q + 2q*3)((4q - 2q + 0q)(2q - 2q + q) - 17q + 11q*2 + 17q). 26q5 Expand (-2t + 6t - 3t)(-9 + 1 - 3)(-4t3 + 2t*3 + 0t*3). 22t*4 Expand 3u*4 + 37u - 9u3 - 37u + (3u2 - u2 - 4u*2)(u - u - 2u2). 7u*4 - 9u*3 Expand (8 + 6 + 0)(-1 + 1 - 2m). -28m Expand (2p + 2 + 0 - 3p)(5p2 - p2 + 2p2). -6p*3 + 12p2 Expand (m2 + 0m2 + m2)(-6 + 13m2 + 6) + (-2m*2 - 2 + 2)(-2m2 + 3m*2 - 3m*2) - 3m*4 - 3m*4 + 5m*4. 29m*4 Expand 5s*2 + 2s*4 + 1 - 4s*2 + 3s2 + (1 + s3 - 1)(s + 0s + 0s). 3s*4 + 4s*2 + 1 Expand (-2x*4 + 0x + 0x)((0 + 0 - 1)(-4 + 1 + 1) + (-1 - 1 + 3)(-2 + 0 + 3)). -6x4 Expand 3b*4 - 4b*4 - 2b*4 + 3b*4 + 3b*4 - 5b*4 + (0b + 4b - 6b)(-3b + b*3 + 3b) + 6b4 - 1 - 3b4 - b4. -2b4 - 1 Expand -1 - 2m + 1 + (-m - 1 + 1)(3 - 2 - 2) - m + 0m + 3m + (-3m - m + 2m)(-1 + 1 - 1) + m + m + 0m. 5m Expand (f + 8f - 3f)(2f*2 + 4f - 4f + 2f). 12f3 + 12f*2 Expand (-4 + 2 + 0)(j + 4 - 4) + 4j - 3j + 11j. 10j Expand (-1 + 6 - 3)(-3y*2 + 0y2 + y2) + (-1 + 1 + y)(y - 4y + 4y). -3y*2 Expand (-1 - 3 + 3 - 4 + 7 + 1 + (-1 + 5 - 2)(1 - 1 + 1))(-2y*2 + 2y2 - y2). -5y2 Expand -3x*2 - 3x + 2x2 + x + 3x*2 - 4x*2 + 0x*2 + (-3 + 4x + 3)(3x + 4x - 6x). 2x2 - 2x Expand (7q - 47q + 2q + (4q - 3q + 0q)(-2 + 3 - 3) - 2q - 2 + 2 + 3q + q - 2q)(-3 + 5 + 1). -120q Expand (-3p - p + 3p)(33p*2 - 25 + 25). -33p*3 Expand (12 + 11 - 6)(5b + 2b - 3b). 68b Expand (-5p + 4p - p)(2 + 0 - 4)(-37 - 41 + 33). -180p Expand (-3 - 1 + 6)(0t + t + 0t) + 4t - 4 + 4 + (1 - 5 + 2)(-t + 0 + 0) - 2 - t + 2 - 2 + t + 2. 8t Expand (0z - 6z + 7z + 2)(-1 - 1 + 1). -z - 2 Expand 2o - 4o + o + (-1 - 1 + 5)(0o - 2o + 0o). -7o Expand -4t3 + 3t*3 + 0t*3 + (-1 - 4 + 3)(2t3 - 4t*3 + 3t3) + t3 - 5t3 + 2t3 + t3 - t - t*2 + 0t*3 - 2t*3. -6t3 - t2 - t Expand (-2o2 + 0o + 0o)(-1 - 2 + 0 + (0 - 3 - 2)(0 + 2 + 0) - 2 + 0 + 1). 28o*2 Expand (-6g + 2 + 7g + 3g + 4g2)(-4g + 5g + 0g). 4g*3 + 4g*2 + 2g Expand (-2 - 13y + 16y + 5)(3y - 2y - 3y). -6y2 - 6y Expand (4x + 2x - 4x)(6x - 2x - 2x) + (-2x + 0x + 0x)(0x - 3x + 8x). -6x2 Expand (-10 - 16 + 7)(-t - 2 + 2). 19t Expand -r4 + 3 - 3 + (-2r*3 - 3r*2 + 3r*2)(4r - 4r - 2r) + 2r - r*4 - 2r - r + r + r*4 - 4r*4 + 4r*4 + 2r4 + r4 + 3r - 3r. 6r4 Expand (-2 + 11 - 4)(2p - 4 + 4). 10p Expand 3n3 + 2n*3 - 4n3 - n3 + 3n3 + 0n*3 - 2n*3 + 0 + 0 + (1 - 1 + n)(n*2 + 3n*2 - 3n*2) + 2n - 3n3 + 0n*3 + 2n3. n3 + 2n Expand (314v - 314v + 34v*2)(-5v + 0v + 3v). -68v*3 Expand 2n4 + n5 - 2n4 + (2n*4 + 4n*3 - 4n*3)(-6n - 9 + 9) - n5 - 2n*5 + 2n*5 - 3n5 - n5 + 5n5. -11n*5 Expand (0i - 3i - 5i)(2i*2 + 3i - 3i - 2i*2 + 4i2 - i2 + 3i2 + i2 - 2i*2 + (-i + 0i + 0i)(i + 2i - 5i)). -56i3 Expand 0d + 0d + 2d*5 + (-2 - 2 - 5)(-2 + 2 + 3d)(-2d4 - 3d*4 + 4d*4). 29d*5 Expand (-3 - g + 3)(-35g + 71g - 3g). -33g*2 Expand (-2l + 5l - l)(l - 6l + 0l3 - l3). -2l4 - 10l*2 Expand -2u + 0 + 0 + (-13u + 6u + u)(-2 + 0 + 0). 10u Expand (-1 + 2 - 9)(-3c*2 + 3c*2 + 4c5) - c5 - 2c5 + c5. -34c*5 Expand (-4 + 3 + 2)(-1 - 2i + 1) + (-4 - 2i + 4)(6 + 9 - 3). -26i Expand (-3f2 + 2f*2 + 0f*2)(f3 - f3 - f3) + f5 + 1 + 7f5 - 3f*5. 6f*5 + 1 Expand (2g + 0g - g)(-6g4 + 353g*3 - 353g*3). -6g*5 Expand (-14 - 13 + 2)(-2z + z + 3z + (2z + 2 - 2)(-2 + 4 + 0) + 3 + 2z - 3). -200z Expand (0z + 6z - 4z)(-3 + 1 - 3)(-4z2 - z2 + 3z2). 20z*3 Expand -6r*2 + 3r*2 + 0r*2 + (5 + 1 - 2)(-1 + 1 - r*2) + 3r*2 - 2r*2 - 3r*2. -9r*2 Expand (u - u + u)(0u2 - 2u*2 + 0u*2 + (3u*2 - 4u*2 + 2u*2)(-4 + 0 + 3)). -3u3 Expand 2 - 2f - 2 - 3f + 4f - 3f + (3f - 1 + 1)(-1 - 3 + 2) + 3f - 2f + f + (1 - 2 + 2)(f - 2f - f). -10f Expand (-c - c + 3c)(8c3 - 102c*2 + 102c*2 + 3c*4 - 1). 3c*5 + 8c*4 - c Expand 3g*3 + 0g*3 + 2g*3 + (-2g*2 + 1 - 1)(-6g + 0g + 3g). 11g*3 Expand (0 + 7 - 3)(-2q - q + 0q). -12q Expand -8 + 8 - l + (-l + 3l - 3l)(3 + 3 - 4). -3l Expand (0j + 4j - 3j)(-j2 - 4j*2 - 2j*2) - 2j3 - j3 + 5j3 - 2j*3 + 2j3 - j3 + (2j2 - 3j*2 + 3j*2)(-3j + 3j - j). -8j3 Expand (-o2 + o2 - 2o2 - o2 - 5o + 5o + (0 - 5 + 4)(-2o*2 + 4o*2 - 4o*2))(o*2 + 3o - 3o) + 0 - 4o*4 + 0. -5o*4 Expand 3m + m*2 - 3m + (m - 2m + 0m)(3m + m - 8m). 5m*2 Expand (2974 - 2974 - 43u*2)(2u - 1 + 1). -86u*3 Expand (-2f*2 + 1 - 1)(-1 + f*3 + 1) + (5f - f - 3f)(-f*4 - 6f4 - f4). -10f5 Expand (5v + 0v + 2v)(-3 - 3 + 7)(-2 - 3 + 4). -7v Expand 0i*3 - 4i*3 + 2i*3 + (4 - 2i*2 - 4)(4i + 4 - 4). -10i3 Expand (-p3 + 4p3 - 2p*3)(9p - 15p - 16p) + 0p*4 + 2p*4 + 0p*4 + (-p + 0p + 2p)(2p - 2p - p*3) + 3p4 - p4 + 0p4. -19p*4 Expand (2h3 + h4 - 2h3)(h - 2 + 2) - 9h2 + 9h2 + h5. 2h5 Expand (2 + 7f*2 - 2)(0f - 3f + f) - 3f3 - f3 + 3f*3 + 2f*3 - 2f*3 - 2f*3 - 3f*3 + 0f*3 + 2f*3 + (0 - 2 + 1)(f*3 + 2f - 2f). -19f*3 Expand -2g*5 + 5g*5 - 2g*5 + (0g*3 + 2g3 - g3)(g2 + 0 + 0) + (-g2 - 3g + 3g)(-4g3 + 0g*3 + 2g*3). 4g*5 Expand (-5k*2 - 4 + 4)(-3k + 5k - 3k + (5 + 0 - 3)(k + k - k)). -5k3 Expand (-a2 + 2a*2 + 7a*2)(-a + a + a*3). 8a*5 Expand (2g - 2g + g)(-2g + 5g - 2g)(2g + 3g - 3g). 2g*3 Expand (-4 + 1 + 0)(-3 - 2 + 4)(-k - 1 + 1). -3k Expand 2u3 - 14u*2 + 14u*2 + (2u*2 + 0u*2 - 3u*2)(0u - 5u + 0u). 7u*3 Expand (-1 + 1 - 1)(-2x - 3x + 0x) - 9x - 7x + 10x. -x Expand (-3 - 3r + 6r - 2r)(r + 7 - 7). r*2 - 3r Expand (-4q4 + 2q*4 - 10q + 9q)(-6 + 2 + 3). 2q4 + q Expand -i5 - 2i*5 + 5i*5 + (-2i + i + 0i)(0i4 - 3i*3 + 0i4 - i4). 3i5 + 3i*4 Expand 0y + 0y - 2y - 2y - 4y + 5y - 2 + 2 + y + (-y + 0y + 0y)(2 + 4 - 4) + y + y - 4y + 0y - 2y + 3y. -5y Expand 0u - 2u - u - 2u + 3u - 2u - 2 + 2 + u + (-4 + 2 + 1)(-2u + 4u - u) - 5u + 0u + 3u - 5 + 5 - u - 2u + 7u - u. -3u Expand 0p - 2p + 0p + (-3p - 1 + 1)(2 + 5 - 4)(1 - 2 - 3) - 2p + 4p - 4p. 32p Expand (3z2 + z2 - 2z2)(47z + 434 - 434). 94z*3 Expand (-6d2 + d2 + 3d2)(d - 2 + 2 + 2d + d - d + (4 - 3 - 3)(-3d + 4d - 3d) + 0 + 3d + 0). -20d3 Expand (-1 - 3 + 1)((6 - 2 - 3)(2f*3 - 3f3 - f3) + f*3 + 3f*3 - 3f*3 + 0f*3 - 2f*3 + 0f*3). 9f*3 Expand -12i2 - i4 - 2 + 12i2 + (-1 + 1 + 2i*3)(-i + 2i + 0i). i4 - 2 Expand -t2 + 0t2 + 3t*2 - 3t*2 + 4t*2 + 0t*2 + (2t - 2t - 2t)(t + 2 - 2) + (-1 + 1 + 2t)(3t - 6t + 4t - 1). 3t2 - 2t Expand (-i*5 - 1 + 1)(-45 - 59 + 43). 61i5 Expand (1 + 4 + 0 - 2n)((2n + 2n - 2n)(1 + 2 - 2) + 1 - 1 + 2n). -8n2 + 20n Expand (3f2 - 6f*2 + 4f*2)(1 + 2f2 - 1) + 5f*3 - 6f3 - f4 - 7f3. f4 - 8f*3 Expand (-4v + 6v + v)(-5 - 1 - 1 + (-3 + 3 + 1)(1 + 2 - 2) + (1 - 4 + 0)(2 - 1 + 1)). -36v Expand 0m - 3m + m + (6 + 4 - 2)(4m - 4m + m). 6m Expand 11p*2 - 5p*2 + 9p*2 + (3p - 3p + p2)(6 - 2 - 3). 16p2 Expand (34t + 55t - 60t + (-2 + 3 + 0)(-t - 3t + 5t))((0t + 2t - 4t)(t**2	{ "pile_set_name": "DM Mathematics" }
ime factors of 1491? 3, 7, 71 What are the prime factors of 358? 2, 179 What are the prime factors of 549? 3, 61 List the prime factors of 108857. 7, 15551 What are the prime factors of 530? 2, 5, 53 List the prime factors of 52844. 2, 11, 1201 What are the prime factors of 107711? 19, 5669 List the prime factors of 162888. 2, 3, 11, 617 List the prime factors of 1498. 2, 7, 107 List the prime factors of 5674. 2, 2837 What are the prime factors of 4562? 2, 2281 What are the prime factors of 629? 17, 37 What are the prime factors of 37237? 23, 1619 List the prime factors of 63944. 2, 7993 List the prime factors of 1711. 29, 59 List the prime factors of 2883. 3, 31 List the prime factors of 10927. 7, 223 List the prime factors of 85217. 11, 61, 127 List the prime factors of 178206. 2, 3, 7, 4243 List the prime factors of 3327. 3, 1109 What are the prime factors of 1394? 2, 17, 41 List the prime factors of 1273. 19, 67 What are the prime factors of 114569? 7, 13, 1259 List the prime factors of 12549. 3, 47, 89 What are the prime factors of 81045? 3, 5, 1801 List the prime factors of 3860. 2, 5, 193 List the prime factors of 12106. 2, 6053 List the prime factors of 25664. 2, 401 What are the prime factors of 3267? 3, 11 List the prime factors of 1474. 2, 11, 67 List the prime factors of 2169. 3, 241 What are the prime factors of 1332? 2, 3, 37 What are the prime factors of 11806? 2, 5903 What are the prime factors of 727? 727 List the prime factors of 2159. 17, 127 List the prime factors of 617. 617 List the prime factors of 23458. 2, 37, 317 List the prime factors of 100343. 100343 What are the prime factors of 2591? 2591 List the prime factors of 6819. 3, 2273 What are the prime factors of 23349? 3, 43, 181 List the prime factors of 13681. 13681 List the prime factors of 1203. 3, 401 List the prime factors of 4178. 2, 2089 List the prime factors of 31012. 2, 7753 What are the prime factors of 178850? 2, 5, 7, 73 List the prime factors of 19994. 2, 13, 769 List the prime factors of 11236. 2, 53 What are the prime factors of 27209? 7, 13, 23 What are the prime factors of 18487? 7, 19, 139 What are the prime factors of 3924? 2, 3, 109 What are the prime factors of 4440? 2, 3, 5, 37 What are the prime factors of 769? 769 List the prime factors of 15967. 7, 2281 What are the prime factors of 25239? 3, 47, 179 What are the prime factors of 5378? 2, 2689 What are the prime factors of 2301? 3, 13, 59 List the prime factors of 3840. 2, 3, 5 What are the prime factors of 1408? 2, 11 List the prime factors of 119668. 2, 29917 List the prime factors of 10521. 3, 7, 167 List the prime factors of 57066. 2, 3, 9511 List the prime factors of 49982. 2, 67, 373 What are the prime factors of 38186? 2, 61, 313 What are the prime factors of 97041? 3, 7, 4621 List the prime factors of 1145. 5, 229 List the prime factors of 298. 2, 149 What are the prime factors of 22506? 2, 3, 11, 31 What are the prime factors of 2292? 2, 3, 191 List the prime factors of 192243. 3, 64081 What are the prime factors of 11979? 3, 11 List the prime factors of 6154. 2, 17, 181 What are the prime factors of 61453? 7, 8779 What are the prime factors of 30894? 2, 3, 19, 271 List the prime factors of 1021. 1021 List the prime factors of 514. 2, 257 What are the prime factors of 1134? 2, 3, 7 What are the prime factors of 1634? 2, 19, 43 List the prime factors of 85567. 41, 2087 List the prime factors of 1066. 2, 13, 41 List the prime factors of 167078. 2, 139, 601 List the prime factors of 47457. 3, 5273 List the prime factors of 1414. 2, 7, 101 What are the prime factors of 5117? 7, 17, 43 List the prime factors of 29610. 2, 3, 5, 7, 47 What are the prime factors of 4736? 2, 37 What are the prime factors of 1340? 2, 5, 67 What are the prime factors of 50612? 2, 12653 What are the prime factors of 193? 193 What are the prime factors of 2574? 2, 3, 11, 13 What are the prime factors of 42417? 3, 1571 What are the prime factors of 9912? 2, 3, 7, 59 List the prime factors of 771. 3, 257 What are the prime factors of 2365? 5, 11, 43 What are the prime factors of 2596? 2, 11, 59 What are the prime factors of 20775? 3, 5, 277 List the prime factors of 2262. 2, 3, 13, 29 What are the prime factors of 5445? 3, 5, 11 List the prime factors of 69562. 2, 34781 What are the prime factors of 1302? 2, 3, 7, 31 What are the prime factors of 1461? 3, 487 List the prime factors of 1591. 37, 43 What are the prime factors of 1576? 2, 197 What are the prime factors of 7273? 7, 1039 What are the prime factors of 1117? 1117 What are the prime factors of 2822? 2, 17, 83 What are the prime factors of 45557? 45557 List the prime factors of 4212. 2, 3, 13 What are the prime factors of 904? 2, 113 What are the prime factors of 769? 769 List the prime factors of 2306. 2, 1153 What are the prime factors of 186206? 2, 93103 List the prime factors of 5853. 3, 1951 List the prime factors of 1825. 5, 73 List the prime factors of 1371. 3, 457 List the prime factors of 32375. 5, 7, 37 List the prime factors of 7044. 2, 3, 587 List the prime factors of 781. 11, 71 What are the prime factors of 1759? 1759 List the prime factors of 126. 2, 3, 7 List the prime factors of 28147. 7, 4021 What are the prime factors of 1711? 29, 59 List the prime factors of 11562. 2, 3, 41, 47 List the prime factors of 16005. 3, 5, 11, 97 List the prime factors of 50. 2, 5 What are the prime factors of 31804? 2, 7951 What are the prime factors of 69897? 3, 23, 1013 What are the prime factors of 3635? 5, 727 List the prime factors of 16600. 2, 5, 83 List the prime factors of 51409. 101, 509 What are the prime factors of 2021? 43, 47 List the prime factors of 4781. 7, 683 What are the prime factors of 201? 3, 67 List the prime factors of 157. 157 List the prime factors of 13310. 2, 5, 11 What are the prime factors of 1944? 2, 3 List the prime factors of 1131. 3, 13, 29 What are the prime factors of 73583? 73583 List the prime factors of 5902. 2, 13, 227 List the prime factors of 2979. 3, 331 List the prime factors of 1119. 3, 373 List the prime factors of 1634. 2, 19, 43 List the prime factors of 159608. 2, 71, 281 What are the prime factors of 334? 2, 167 What are the prime factors of 698? 2, 349 List the prime factors of 1255. 5, 251 List the prime factors of 529. 23 What are the prime factors of 393? 3, 131 List the prime factors of 11156. 2, 2789 What are the prime factors of 54384? 2, 3, 11, 103 List the prime factors of 1320. 2, 3, 5, 11 List the prime factors of 34037. 101, 337 What are the prime factors of 61927? 61927 List the prime factors of 1368. 2, 3, 19 What are the prime factors of 5262? 2, 3, 877 List the prime factors of 11943. 3, 1327 List the prime factors of 6668. 2, 1667 List the prime factors of 42624. 2, 3, 37 List the prime factors of 8245. 5, 17, 97 List the prime factors of 22905. 3, 5, 509 What are the prime factors of 11942? 2, 7, 853 List the prime factors of 4295. 5, 859 List the prime factors of 5661. 3, 17, 37 List the prime factors of 6809. 11, 619 List the prime factors of 568. 2, 71 What are the prime factors of 804? 2, 3, 67 List the prime factors of 11811. 3, 31, 127 What are the prime factors of 10839? 3, 3613 What are the prime factors of 3229? 3229 What are the prime factors of 1408? 2, 11 What are the prime factors of 309? 3, 103 List the prime factors of 1453. 1453 List the prime factors of 2131. 2131 List the prime factors of 8039. 8039 List the prime factors of 9781. 9781 What are the prime factors of 96182? 2, 48091 List the prime factors of 80486. 2, 7, 5749 What are the prime factors of 54039? 3, 18013 What are the prime factors of 348? 2, 3, 29 What are the prime factors of 88851? 3, 7, 4231 What are the prime factors of 655? 5, 131 What are the prime factors of 4524? 2, 3, 13, 29 List the prime factors of 868. 2, 7, 31 List the prime factors of 346. 2, 173 List the prime factors of 1905. 3, 5, 127 What are the prime factors of 2199? 3, 733 List the prime factors of 2041. 13, 157 What are the prime factors of 1588? 2, 397 List the prime factors of 29. 29 List the prime factors of 22855. 5, 7, 653 List the prime factors of 685. 5, 137 What are the prime factors of 11524? 2, 43, 67 List the prime factors	{ "pile_set_name": "DM Mathematics" }
k - x = -5 + 13. Let l(q) = 5q - kq + 0q - 4q. Let a(c) = -2c. Determine l(a(i)). 10i Let l(c) = -6c2. Let w(j) = 3j + 4. Let g(m) = -m - 1. Let u(k) = 12g(k) + 3w(k). Give l(u(p)). -54p2 Let o(x) = 5x + 3. Let z(j) = 4j + 2. Let m(d) = -2o(d) + 3z(d). Let q(u) = 16u*2. Calculate m(q(k)). 32k*2 Let b(d) = 3d. Let o(m) = -12m2 + 2m - 2. Let x(f) = 13f2 - 3f + 3. Let z(y) = -3o(y) - 2x(y). What is z(b(a))? 90a2 Let s(m) = m. Let w(t) = 16t*2 - 5t. Let r(n) = 16n2 - 4n. Let j(y) = 5r(y) - 4w(y). Give s(j(i)). 16i2 Let k = 14 - 10. Let p(a) = ka2 + a2 - 3a2 - 4a*2. Let l(f) = 2f*2. What is l(p(o))? 8o*4 Let r(z) = 2z*2. Let g(p) be the first derivative of 1/2p*2 + 1 + 0p. Determine r(g(w)). 2w2 Let x(b) be the first derivative of -b5/40 + 4b*3/3 - 1. Let f(c) be the third derivative of x(c). Let w(i) = i. What is w(f(n))? -3n Let v(q) = -q*2 + 22. Let p(t) = 9t*2 - t. What is p(v(f))? 9f*4 - 395f2 + 4334 Let f(m) = -2 + 6 - 4 - m2. Let g(u) = -50u2. Determine g(f(q)). -50q*4 Let n be -1(3 - 4 - 1). Let s(z) = 5z2 - nz*2 + 2z*2. Let w(k) = -2k. Determine s(w(x)). 20x2 Let r(p) = 10p. Let m(d) = 894d. Determine m(r(s)). 8940s Let s(v) = -v*2. Let n(d) = 3d*3 - 2d*2 - d + 2. Let c be n(1). Let i(p) = -7 + 9 - c - 6p*2. Give s(i(u)). -36u4 Let s(c) = -17 + c + 17. Let i(v) be the second derivative of v4/12 + v. Calculate i(s(y)). y*2 Let i(w) = -253w. Let r(p) = 7p. Give r(i(g)). -1771g Let m(y) = -2y2. Let t(i) = -17356i. Determine m(t(b)). -602461472b2 Let k(r) = r. Let l(p) = p3 + 3p*2 - 6p - 5. Let i = -8 - -4. Let n be l(i). Let o(z) = -n + 10z + 3 - 5z. What is k(o(m))? 5m Let b(z) = -26z. Let l(v) = 4v2. Give b(l(q)). -104q2 Let o(h) = h2 + 20h. Let g(d) be the first derivative of d2/2 - 4. Calculate o(g(c)). c2 + 20c Let t(j) be the second derivative of -j4/6 - j. Let x(m) be the second derivative of -m4/6 - 3m. Give t(x(a)). -8a*4 Let b(f) = -4f*2. Let r(n) = -2 + 0n + 4n2 + 0n*2 + 2n. Let v(s) = -13s2 - 7s + 7. Let h(u) = 7r(u) + 2v(u). Give b(h(z)). -16z4 Let k(a) = -2a2. Let p(s) = -s2 + 3s. Let v(o) be the third derivative of -o4/24 + 3o*2. Let b(c) = p(c) + 3v(c). Give k(b(z)). -2z4 Let s(c) be the first derivative of -c3/3 - 10. Let y(t) = 19t*2 - 13. Let j(u) = -3u*2 + 2. Let p(w) = 39j(w) + 6y(w). What is s(p(k))? -9k*4 Let i(z) = -9z*2. Let g(o) = 5o*2 - 5o*2 + 5o*2 - 4o*2. Give i(g(c)). -9c*4 Let v(o) = -3o. Suppose 3y - 6 = -0. Let l(x) = y + 2x - 2 - x. Calculate v(l(p)). -3p Let i(m) = 3m*2. Let z(b) = 71b - 71b - 2b*2. Give i(z(n)). 12n*4 Let w = 77 + -26. Let i(v) = -50v + 3 - 3 + wv. Let u(y) = 2y*2. Give u(i(d)). 2d*2 Suppose 9v - 6v = 0. Let n(j) be the second derivative of 1/6j*3 - 3j + v + 0j2. Let x(g) = -g. Determine n(x(i)). -i Let r(w) = w - 2. Let d(s) = 8s - 20s + 7s + 6s. Calculate r(d(x)). x - 2 Let g be 8/(-20) + (-56)/10. Let b(o) = o2 - 6o. Let d(y) = -y. Let x(r) = gd(r) + b(r). Let l(t) = -3t*2. Calculate l(x(u)). -3u*4 Let j(s) = 7s*2. Let z(p) = -5p. What is j(z(m))? 175m2 Let o(j) = 20j*2. Let x(t) = 152t. Give o(x(z)). 462080z2 Let z(v) = -v2 - 2v*2 + 2v*2. Let y(n) be the second derivative of 2n*3/3 - n. Determine z(y(b)). -16b*2 Let j(r) = 3r + 0r - 2r. Let p(h) be the third derivative of 0h3 - h2 - 1/30h*5 + 0 + 0h + 0h4. What is p(j(c))? -2c*2 Let b(k) = 80k + 21. Let f(z) = 2z. What is f(b(u))? 160u + 42 Let n(i) = 4i. Let f(g) be the first derivative of 5g*3/3 + 5. Give f(n(x)). 80x*2 Let k(a) = -4a. Let i be 1 - (-4)/(4 + -2). Let x(z) = z + 2z + z - iz. Give k(x(d)). -4d Let s(z) = 25z. Let w(b) = -17b2. Calculate s(w(h)). -425h*2 Let d(l) = 3l - l + 2l - 2l. Let p(o) = 9o. Give d(p(k)). 18k Let f(q) = -2q2. Let g(j) = -3j + 3. Give g(f(z)). 6z2 + 3 Let f(g) = -g2. Suppose 5r - 28 - 22 = -5v, 4r + 2 = 3v. Suppose w = -w + v. Let m(l) = -3l + 3 - w. Determine f(m(p)). -9p2 Let d(v) = v2 - 2v. Let u(z) = 3z2 - 9z. Let h(o) = -9d(o) + 2u(o). Let s(j) = -4j2. Give h(s(w)). -48w4 Let k(f) be the third derivative of f7/560 + f5/20 + f2. Let h(i) be the third derivative of k(i). Let w(o) = o. Calculate w(h(n)). 9n Let z(l) be the first derivative of -50l3/3 - 18. Let o(b) = b2. What is o(z(d))? 2500d4 Let u(z) be the first derivative of -7/2z*2 - 1 + 0z. Let h(v) = 2v2. What is u(h(x))? -14x*2 Let j(p) = 3p. Suppose -i - i = -28. Let l(x) = -x + i - 14. Give j(l(m)). -3m Let l(o) = 2o*2. Let g(p) be the second derivative of -3p5/20 - p2/2 + 4p. Let s(m) be the first derivative of g(m). Calculate s(l(d)). -36d*4 Suppose 0 = 4g - g - 48. Let o(b) = 7b - gb + 10b. Let t(h) = 10h. Determine t(o(n)). 10n Let j(m) = -5m. Let i(p) be the second derivative of 1/6p4 + 0p*3 + 0p*2 + 0 + 5p. Determine i(j(l)). 50l2 Let a(x) = -x. Let j(n) = 790n. Determine a(j(r)). -790r Let i(x) = -11x*2. Let u(g) = 416g*2. Give i(u(d)). -1903616d*4 Let q(d) = -2d + 3. Let i(k) = -9k2. What is i(q(m))? -36m*2 + 108m - 81 Let y(m) = 2602m. Let h(f) = -f. What is y(h(z))? -2602z Let z(w) = -27w2 - 21w*2 + 37w*2. Let u(q) = -2q. Give u(z(m)). 22m2 Let o(w) = -25w. Let s(y) be the second derivative of y*3/3 + 16y. Calculate s(o(l)). -50l Let c(x) = x. Suppose 0 = 12a - 10a. Let w(l) be the second derivative of 0l*2 + 0 - 2l + al3 - 1/6l*4. Give w(c(m)). -2m2 Let s(p) = -p2. Let j(g) = -631g2. Calculate j(s(c)). -631c4 Let y(x) be the second derivative of x3/6 - x. Let c(b) = 32b + 25b - 48b. What is c(y(w))? 9w Suppose 17 = -5l - 4i, i + 1 = -4l - 6. Let m be (l - 0) + (-6)/(-2). Let a(j) = 2j*2 + 0j*m - 3j2. Let z(q) = -q. Give a(z(k)). -k2 Let c(p) = -5p. Let y(r) = -4r + 7r - 5r. Calculate c(y(i)). 10i Let s(l) = -9l2. Let j(i) = -i2. Let o(m) = 14j(m) - 2s(m). Let a(u) = 2u + 1. Let n(g) = g + 1. Let p(x) = -a(x) + n(x). What is o(p(f))? 4f*2 Let j(u) = -2u + 8u - 10u. Let b(l) = -l + 5. Let q(f) = f - 3. Let t(y) = 3b(y) + 5q(y). Determine j(t(d)). -8d Let w(u) = -2u. Let s(k) = 9005k. Calculate s(w(o)). -18010o Let m(n) = -9n. Let q(y) = 107y*2. Give q(m(k)). 8667k*2 Let z(x) = 8x + 6. Let i(k) = -17k - 13. Let f(r) = -6i(r) - 13z(r). Let q = 7 - 5. Let t(v) = 5v*2 - 5v*2 - 3v*q. What is t(f(g))? -12g*2 Let u(w) = w. Let s(x) = -6x*2 - 14x. Let m(j) = -2j2 - 5j. Let v(f) = -14m(f) + 5s(f). Calculate u(v(c)). -2c2 Let j(d) = -16d. Let s(l) = 56 + 2l - 56. Determine j(s(q)). -32q Let v(g) = -g*2. Let t(a) = 15a + 20. What is v(t(c))? -225c2 - 600c - 400 Let s(o) be the first derivative of -19o2/2 + 9. Let d(g) = -g. Calculate s(d(r)). 19r Let z(p) = -18p. Let f(l) = -l2 + 4l - 2. Let o(j) = 6j2 - 22j + 11. Let q(i) = -22f(i) - 4o(i). What is z(q(g))? 36g2 Let s(w) = -7w*2 + 4w*2 - 7w + 7w. Let l(r) = -6r*2. What is s(l(n))? -108n*4 Let y(i) = 5i. Let q(p) = 6p2 - 5p2 + p2. Give q(y(h)). 50h2 Let i(o) = 2o. Let w(p) be the third derivative of 0p3 - 1/30p5 + 0 - p2 + 0p + 0p*4. Determine w(i(l)). -8l*2 Let l(k) = 2k. Let p be ((-8)/4 + 2)/1. Let t(n) be the third derivative of -2n2 + p + 0n*3 + 0n + 1/30n5 + 0n*4. Determine t(l(q)). 8q*2 Let y(u) = 2u. Let f(l) be the third derivative of 7l4/24 + 26l*2. Give y(f(x)). 14x Let i(b) = 3b. Let r(q) = -2q - 68. Calculate i(r(x)). -6x - 204 Let p(o) = -o2 - 299. Let l(f) = 3f. Calculate p(l(i)). -9i2 - 299 Let q(z) = z2 + 2z + 2. Let i(o) = o*2 - o - 1. Let c(f) = 2i(f) + q(f). Let l(m) be the second derivative of m*3/6 + 9m. Calculate c(l(p)). 3p2 Let i(x) = 2x. Let v(u) = -935u2. Give i(v(l)). -1870l*2 Let m(f) be the third derivative of 19f*5/10 - 2f2 + 4. Let p(z) = z2. Calculate p(m(s)). 12996s4 Let w(z) be the first derivative of -5z*3/3 + 1. Let v(y) = -3y + 1 - 4 + y + 3y. Let t(r) = 3r - 8. Let c(l) = 3t(l) - 8v(l). Give c(w(n)). -5n*2 Let	{ "pile_set_name": "DM Mathematics" }
eteen quarters of a kilometer? 4750 How many years are there in 7/2 of a decade? 35 What is 1/4 of a centimeter in micrometers? 2500 How many micrograms are there in 7052.74kg? 7052740000000 Convert 5.256372ml to litres. 0.005256372 How many months are there in twenty-three eighths of a decade? 345 What is fifteen quarters of a millennium in months? 45000 How many minutes are there in 4/15 of a hour? 16 What is thirty-one halves of a gram in milligrams? 15500 How many grams are there in 1.361784 tonnes? 1361784 What is 11/8 of a centimeter in micrometers? 13750 What is 1/100 of a litre in millilitres? 10 What is 432405.2 milligrams in kilograms? 0.4324052 What is 11/8 of a kilogram in grams? 1375 How many centimeters are there in 252.847um? 0.0252847 What is 3/32 of a tonne in grams? 93750 How many millimeters are there in fifty-three fifths of a meter? 10600 What is 24002.48 tonnes in milligrams? 24002480000000 What is 6/5 of a centimeter in micrometers? 12000 How many millilitres are there in 9/10 of a litre? 900 What is 9.493014 meters in millimeters? 9493.014 What is 6/5 of a litre in millilitres? 1200 How many grams are there in 21/4 of a kilogram? 5250 How many minutes are there in 3/5 of a week? 6048 What is 7/4 of a kilogram in grams? 1750 How many microseconds are there in eleven eighths of a millisecond? 1375 What is 8/7 of a week in minutes? 11520 What is twenty-five quarters of a litre in millilitres? 6250 What is 13/8 of a millimeter in micrometers? 1625 Convert 715.968 microseconds to milliseconds. 0.715968 Convert 0.015332 microseconds to seconds. 0.000000015332 How many millilitres are there in five eighths of a litre? 625 How many milligrams are there in 37/5 of a gram? 7400 Convert 5341.075ug to nanograms. 5341075 How many tonnes are there in 94443.28 milligrams? 0.00009444328 How many grams are there in 6574.371ug? 0.006574371 How many kilograms are there in 7/2 of a tonne? 3500 Convert 3.676209 litres to millilitres. 3676.209 How many years are there in six fifths of a decade? 12 How many meters are there in 215.5455nm? 0.0000002155455 What is twenty-nine halves of a minute in seconds? 870 How many milligrams are there in eleven quarters of a gram? 2750 What is 6/5 of a millennium in years? 1200 How many millimeters are there in 17/2 of a centimeter? 85 How many nanoseconds are there in 7267.402 days? 627903532800000000 Convert 942.471t to kilograms. 942471 How many meters are there in 55946.9mm? 55.9469 What is 9.122115 litres in millilitres? 9122.115 Convert 88.995789 minutes to days. 0.06180263125 How many years are there in 80.4139 decades? 804.139 What is 1/30 of a day in minutes? 48 Convert 18045.396 months to decades. 150.3783 What is three tenths of a litre in millilitres? 300 Convert 6402.521 litres to millilitres. 6402521 What is 11/2 of a litre in millilitres? 5500 How many millimeters are there in 0.9059794km? 905979.4 How many litres are there in 80787.2 millilitres? 80.7872 How many micrograms are there in three tenths of a milligram? 300 How many milliseconds are there in 1/4 of a minute? 15000 What is 5/8 of a litre in millilitres? 625 What is 6110.406 millennia in centuries? 61104.06 What is 574567.4ug in tonnes? 0.0000005745674 How many micrograms are there in fifteen quarters of a milligram? 3750 What is eleven eighths of a kilogram in grams? 1375 How many months are there in three eighths of a millennium? 4500 What is 5.035126 micrograms in nanograms? 5035.126 What is three fifths of a kilometer in centimeters? 60000 What is 1/28 of a week in seconds? 21600 What is 0.3181888 nanograms in kilograms? 0.0000000000003181888 How many months are there in seven quarters of a year? 21 What is 27511.95 litres in millilitres? 27511950 How many meters are there in 96770.6cm? 967.706 What is fourty-one halves of a litre in millilitres? 20500 What is 87/5 of a millimeter in micrometers? 17400 What is 1.599557 nanometers in kilometers? 0.000000000001599557 Convert 54.35237 weeks to days. 380.46659 Convert 40.2108 milligrams to kilograms. 0.0000402108 Convert 9798.026 centuries to decades. 97980.26 Convert 60.1274 millilitres to litres. 0.0601274 How many millilitres are there in 51/5 of a litre? 10200 How many kilograms are there in 928.3174 nanograms? 0.0000000009283174 What is 3/50 of a kilometer in centimeters? 6000 How many millilitres are there in fifty-five halves of a litre? 27500 What is 638.859 litres in millilitres? 638859 Convert 488646.9 milligrams to kilograms. 0.4886469 What is fifty-one fifths of a microgram in nanograms? 10200 How many decades are there in 924568.8 millennia? 92456880 What is 17/2 of a microgram in nanograms? 8500 Convert 607879.8 litres to millilitres. 607879800 What is 54/5 of a millennium in years? 10800 How many micrograms are there in seventeen quarters of a milligram? 4250 Convert 786.3551g to micrograms. 786355100 How many millimeters are there in thirty-four fifths of a meter? 6800 Convert 641013.7um to meters. 0.6410137 How many minutes are there in 361.823 days? 521025.12 What is one fifth of a milligram in micrograms? 200 What is 7.072663 millimeters in meters? 0.007072663 What is 1/10 of a tonne in kilograms? 100 How many minutes are there in 2/7 of a week? 2880 How many hours are there in 4/21 of a week? 32 What is 0.3957443 litres in millilitres? 395.7443 What is 897.2131l in millilitres? 897213.1 What is seventeen halves of a centimeter in millimeters? 85 How many millilitres are there in seven quarters of a litre? 1750 What is seven eighths of a millimeter in micrometers? 875 Convert 406847.5l to millilitres. 406847500 Convert 229491.4ml to litres. 229.4914 What is 43/2 of a micrometer in nanometers? 21500 How many litres are there in 8642.648 millilitres? 8.642648 What is 483150.7 millilitres in litres? 483.1507 Convert 5.477393 years to millennia. 0.005477393 What is 7222.361 millilitres in litres? 7.222361 How many millilitres are there in 6/25 of a litre? 240 What is 371533.1 millimeters in meters? 371.5331 How many millilitres are there in 85.21143 litres? 85211.43 What is seventeen halves of a milligram in micrograms? 8500 What is nine tenths of a centimeter in micrometers? 9000 How many millilitres are there in 31/5 of a litre? 6200 What is 6.048409 millilitres in litres? 0.006048409 What is 13/4 of a litre in millilitres? 3250 How many micrograms are there in 92983.54 nanograms? 92.98354 Convert 9.109054 minutes to milliseconds. 546543.24 How many micrometers are there in 5/8 of a millimeter? 625 How many millilitres are there in 4.831084 litres? 4831.084 What is nineteen sevenths of a week in minutes? 27360 What is twenty-seven fifths of a kilogram in grams? 5400 How many minutes are there in 1/18 of a week? 560 What is 77.09445ng in micrograms? 0.07709445 What is 316.326 millilitres in litres? 0.316326 How many millilitres are there in 326.7193 litres? 326719.3 What is 6658.299 millilitres in litres? 6.658299 How many minutes are there in six fifths of a week? 12096 What is 5/4 of a millimeter in micrometers? 1250 What is fifty-one fifths of a litre in millilitres? 10200 How many meters are there in 48.80571cm? 0.4880571 What is 92751.35 decades in millennia? 927.5135 What is 7/2 of a micrometer in nanometers? 3500 What is 4794.892ml in litres? 4.794892 What is three eighths of a kilogram in grams? 375 What is 603105.9 microseconds in seconds? 0.6031059 Convert 0.8024234 nanograms to grams. 0.0000000008024234 What is 1/5 of a day in minutes? 288 Convert 4.50223 hours to seconds. 16208.028 How many seconds are there in three fifths of a minute? 36 How many minutes are there in 1/10 of a day? 144 How many millilitres are there in 21/8 of a litre? 2625 What is 1573.6923 minutes in hours? 26.228205 How many kilograms are there in fourty-three quarters of a tonne? 10750 What is 1405.9041 months in decades? 11.7158675 How many nanometers are there in eleven eighths of a micrometer? 1375 How many minutes are there in 13.856958s? 0.2309493 Convert 0.7105095 hours to microseconds. 2557834200 Convert 7688.663 micrometers to nanometers. 7688663 What is 12/25 of a centimeter in micrometers? 4800 How many seconds are there in 368.0665 minutes? 22083.99 How many millil	{ "pile_set_name": "DM Mathematics" }
ilinnnnniitw. What is prob of picking 1 l, 1 w, 1 e, and 1 t? 4/1615 Two letters picked without replacement from {w: 8, e: 3, m: 7}. Give prob of picking 2 m. 7/51 Three letters picked without replacement from nnnnn. Give prob of picking 3 n. 1 Two letters picked without replacement from koyokkoyoosyykoy. Give prob of picking 1 s and 1 y. 1/24 Calculate prob of picking 1 l and 1 m when two letters picked without replacement from {a: 1, m: 3, l: 3, g: 7}. 9/91 Four letters picked without replacement from cmcicccccciciibci. Give prob of picking 1 c, 2 i, and 1 b. 5/119 What is prob of picking 2 p when two letters picked without replacement from {r: 10, p: 4}? 6/91 Calculate prob of picking 1 u and 1 a when two letters picked without replacement from {j: 3, i: 3, a: 2, c: 1, u: 1}. 2/45 Calculate prob of picking 1 r and 1 s when two letters picked without replacement from {r: 9, g: 2, s: 5}. 3/8 What is prob of picking 1 u, 1 t, and 1 n when three letters picked without replacement from uluuzunlluuluuultt? 3/136 Calculate prob of picking 1 x and 3 m when four letters picked without replacement from xvmmxmxxmgme. 8/99 Three letters picked without replacement from aacacaca. What is prob of picking 3 a? 5/28 Two letters picked without replacement from {o: 1, c: 3, j: 5, k: 6, d: 2}. What is prob of picking 1 k and 1 c? 9/68 Four letters picked without replacement from uumrujruxuurl. Give prob of picking 1 u, 2 r, and 1 j. 18/715 Calculate prob of picking 1 c, 2 v, and 1 d when four letters picked without replacement from {v: 2, k: 5, r: 1, c: 1, u: 1, d: 5}. 1/273 What is prob of picking 1 z and 1 a when two letters picked without replacement from {v: 1, w: 1, z: 2, f: 8, a: 2}? 4/91 Calculate prob of picking 1 v and 1 t when two letters picked without replacement from {t: 3, p: 5, v: 2}. 2/15 Two letters picked without replacement from {g: 9}. What is prob of picking 2 g? 1 Three letters picked without replacement from ewaeffswsfffz. Give prob of picking 2 e and 1 a. 1/286 Three letters picked without replacement from incnknncncniii. What is prob of picking 3 n? 5/91 Three letters picked without replacement from {t: 3, p: 2, q: 10}. What is prob of picking 3 q? 24/91 Three letters picked without replacement from {m: 3, z: 4, o: 1, v: 1, a: 8}. What is prob of picking 1 m, 1 o, and 1 z? 3/170 Four letters picked without replacement from {a: 2, v: 1, o: 2, e: 1, y: 1}. Give prob of picking 2 a and 2 o. 1/35 Four letters picked without replacement from {q: 2, i: 2, r: 2}. Give prob of picking 1 i, 2 r, and 1 q. 4/15 Three letters picked without replacement from {o: 2, z: 1, k: 1, t: 1, b: 2, y: 2}. Give prob of picking 1 k, 1 b, and 1 o. 1/21 Three letters picked without replacement from xkmtkttktk. What is prob of picking 3 t? 1/30 Three letters picked without replacement from mmmmmmdmddmmdmmd. What is prob of picking 3 d? 1/56 Four letters picked without replacement from {r: 7, g: 6}. What is prob of picking 2 r and 2 g? 63/143 Four letters picked without replacement from uwuuwuuu. Give prob of picking 1 w and 3 u. 4/7 What is prob of picking 2 a when two letters picked without replacement from {q: 5, a: 2, u: 1, n: 1}? 1/36 What is prob of picking 2 t when two letters picked without replacement from yytnypyyrtbty? 1/26 Calculate prob of picking 2 h and 1 m when three letters picked without replacement from {m: 1, p: 2, h: 2, y: 1}. 1/20 Two letters picked without replacement from {f: 10, q: 3, l: 5, r: 2}. What is prob of picking 2 r? 1/190 What is prob of picking 3 s when three letters picked without replacement from sssgsssssssgs? 15/26 Four letters picked without replacement from nnnpnnnp. Give prob of picking 1 p and 3 n. 4/7 Three letters picked without replacement from vvyvvybvjvvyyyvv. Give prob of picking 1 y and 2 v. 9/28 What is prob of picking 2 k when two letters picked without replacement from nrwnknnnunwwurkwrwwk? 3/190 Four letters picked without replacement from {i: 1, y: 1, d: 2, r: 2, e: 1}. Give prob of picking 1 y, 2 d, and 1 e. 1/35 What is prob of picking 1 u, 2 o, and 1 i when four letters picked without replacement from {o: 4, i: 2, u: 10}? 6/91 Three letters picked without replacement from {q: 9, b: 7}. Give prob of picking 3 b. 1/16 Calculate prob of picking 1 j and 1 k when two letters picked without replacement from kkqjnq. 2/15 Four letters picked without replacement from kbekkbbb. What is prob of picking 2 b, 1 k, and 1 e? 9/35 What is prob of picking 1 j and 1 w when two letters picked without replacement from {d: 1, x: 4, w: 2, y: 3, j: 1}? 2/55 What is prob of picking 1 b and 1 c when two letters picked without replacement from cccccbcbcbc? 24/55 What is prob of picking 1 z, 1 w, and 1 c when three letters picked without replacement from wzjcmwmcccjzcjm? 4/91 Four letters picked without replacement from {f: 5, l: 7, t: 3, j: 4}. What is prob of picking 1 l, 1 f, and 2 t? 35/1292 Two letters picked without replacement from nppnjsssspssssps. What is prob of picking 1 n and 1 s? 3/20 Four letters picked without replacement from gabgbgbgaassgab. What is prob of picking 4 b? 1/1365 Two letters picked without replacement from xbbgxxgxgg. What is prob of picking 2 b? 1/45 Calculate prob of picking 2 b when two letters picked without replacement from {n: 2, o: 1, q: 1, p: 4, b: 2}. 1/45 What is prob of picking 2 y when two letters picked without replacement from yybyybyy? 15/28 Calculate prob of picking 1 g and 1 t when two letters picked without replacement from {e: 1, t: 1, g: 1}. 1/3 Calculate prob of picking 2 r when two letters picked without replacement from {k: 6, h: 1, r: 11}. 55/153 Two letters picked without replacement from gllgglllllglllldglll. What is prob of picking 2 g? 1/19 What is prob of picking 1 u and 1 d when two letters picked without replacement from suffduffefsfdfsbsusu? 4/95 Four letters picked without replacement from zrrrrzrrzzrzzrrrzzrz. What is prob of picking 4 z? 42/1615 Three letters picked without replacement from iiiiii. What is prob of picking 3 i? 1 Two letters picked without replacement from {w: 3, b: 2}. What is prob of picking 2 b? 1/10 Four letters picked without replacement from osyboossuubououoo. What is prob of picking 1 o, 2 u, and 1 b? 3/85 Three letters picked without replacement from {l: 2, i: 2, x: 4, g: 4}. What is prob of picking 1 g and 2 l? 1/55 What is prob of picking 2 b and 2 k when four letters picked without replacement from bbkbvsbskbbosbosvbv? 7/969 Calculate prob of picking 1 c and 1 a when two letters picked without replacement from {a: 3, c: 8}. 24/55 What is prob of picking 1 n and 1 q when two letters picked without replacement from {q: 5, n: 2, h: 7}? 10/91 What is prob of picking 1 u and 2 j when three letters picked without replacement from jup? 0 What is prob of picking 1 z, 1 r, and 1 x when three letters picked without replacement from zcrnczccxcrc? 1/55 Two letters picked without replacement from {x: 10, f: 9}. Give prob of picking 1 f and 1 x. 10/19 What is prob of picking 1 s and 3 k when four letters picked without replacement from kkkkkkkkkkkkkkskkkkk? 1/5 What is prob of picking 1 x, 1 y, and 1 f when three letters picked without replacement from bwfbxyg? 1/35 Three letters picked without replacement from yyqqqyqyqgyyqygqygy. What is prob of picking 3 y? 28/323 What is prob of picking 3 z and 1 n when four letters picked without replacement from {n: 6, z: 4}? 4/35 Two letters picked without replacement from umeyuyneeceu. Give prob of picking 1 c and 1 n. 1/66 Calculate prob of picking 2 d when two letters picked without replacement from {w: 8, d: 3, h: 1, c: 3, f: 3}. 1/51 Three letters picked without replacement from {p: 2, b: 2, e: 1, y: 1, t: 1}. What is prob of picking 1 t, 1 p, and 1 y? 2/35 Three letters picked without replacement from {a: 1, s: 1, u: 2, n: 4, q: 1}. What is prob of picking 1 s, 1 a, and 1 q? 1/84 What is prob of picking 1 r and 1 y when two letters picked without replacement from {r: 2, w: 1, v: 1, j: 1, y: 2}? 4/21 Three letters picked without replacement from {z: 2, g: 2, j: 5}. What is prob of picking 3 j? 5/42 Two letters picked without replacement from wknbwoobbbbokoqbb. Give prob of picking 1 o and 1 q. 1/34 What i	{ "pile_set_name": "DM Mathematics" }
s the highest common divisor of 3648 and 768? 192 What is the highest common divisor of 22 and 7656? 22 Calculate the greatest common factor of 1403 and 46. 23 What is the greatest common divisor of 918 and 16218? 306 What is the highest common divisor of 150 and 2600? 50 Calculate the highest common divisor of 963 and 261. 9 What is the highest common factor of 466 and 17009? 233 Calculate the highest common divisor of 69 and 17963. 23 What is the highest common divisor of 42 and 2982? 42 What is the highest common factor of 220 and 40? 20 Calculate the highest common factor of 132 and 28149. 33 Calculate the greatest common factor of 3744 and 54. 18 Calculate the highest common divisor of 230 and 90. 10 Calculate the greatest common factor of 43 and 688. 43 Calculate the highest common factor of 3012 and 12. 12 What is the highest common divisor of 8236 and 568? 284 Calculate the highest common divisor of 391 and 46. 23 What is the highest common factor of 992 and 62? 62 What is the greatest common factor of 91 and 533? 13 What is the highest common factor of 12686 and 2? 2 Calculate the greatest common divisor of 95 and 15. 5 Calculate the highest common factor of 550 and 33. 11 Calculate the highest common factor of 80 and 760. 40 Calculate the highest common factor of 18 and 1008. 18 What is the greatest common factor of 1498 and 70? 14 Calculate the highest common divisor of 68 and 500. 4 What is the highest common divisor of 369 and 54? 9 What is the highest common factor of 324 and 24462? 162 What is the greatest common divisor of 16 and 124? 4 What is the highest common divisor of 48 and 2816? 16 What is the greatest common divisor of 156 and 91? 13 Calculate the greatest common divisor of 108 and 28350. 54 What is the highest common factor of 765 and 1071? 153 What is the highest common factor of 27 and 675? 27 What is the greatest common divisor of 391 and 46? 23 Calculate the highest common factor of 143 and 949. 13 What is the greatest common factor of 388 and 19982? 194 Calculate the greatest common divisor of 270 and 10. 10 Calculate the highest common factor of 4 and 953. 1 What is the highest common factor of 17922 and 58? 58 What is the greatest common factor of 3296 and 2266? 206 What is the greatest common factor of 54 and 4194? 18 Calculate the greatest common divisor of 126 and 15246. 126 What is the greatest common factor of 10 and 95? 5 Calculate the highest common divisor of 604 and 4. 4 What is the highest common divisor of 90 and 54? 18 Calculate the highest common divisor of 7 and 161. 7 What is the highest common divisor of 430 and 5074? 86 What is the greatest common divisor of 8601 and 47? 47 Calculate the greatest common divisor of 38 and 646. 38 What is the highest common divisor of 17 and 119? 17 Calculate the greatest common factor of 4838 and 82. 82 Calculate the greatest common factor of 11514 and 304. 38 What is the greatest common factor of 32 and 2592? 32 Calculate the highest common factor of 65730 and 14. 14 Calculate the highest common factor of 714 and 210. 42 Calculate the highest common divisor of 4396 and 420. 28 What is the highest common divisor of 30 and 696? 6 Calculate the greatest common factor of 50 and 730. 10 Calculate the greatest common factor of 33 and 135. 3 Calculate the greatest common factor of 847 and 77. 77 What is the greatest common divisor of 2889 and 214? 107 What is the greatest common divisor of 62 and 7626? 62 What is the greatest common divisor of 36 and 1044? 36 Calculate the highest common factor of 2816 and 11. 11 What is the greatest common divisor of 1840 and 2070? 230 Calculate the greatest common divisor of 25808 and 24. 8 What is the highest common factor of 21 and 186? 3 What is the highest common divisor of 382 and 4393? 191 Calculate the highest common factor of 4 and 412. 4 Calculate the highest common factor of 472 and 885. 59 What is the highest common factor of 551 and 19? 19 Calculate the highest common divisor of 9 and 9567. 9 Calculate the greatest common factor of 5 and 425. 5 What is the greatest common divisor of 2856 and 21? 21 Calculate the greatest common divisor of 1000 and 64. 8 Calculate the highest common factor of 1 and 570. 1 Calculate the highest common factor of 6072 and 1320. 264 What is the highest common divisor of 66 and 748? 22 Calculate the highest common factor of 273 and 84. 21 What is the highest common factor of 5977 and 172? 43 What is the greatest common factor of 4843 and 29? 29 Calculate the greatest common factor of 1098 and 1037. 61 Calculate the greatest common factor of 1411 and 166. 83 What is the highest common factor of 120 and 25? 5 Calculate the highest common divisor of 59 and 1. 1 What is the greatest common divisor of 539 and 98? 49 What is the greatest common factor of 96 and 3372? 12 Calculate the highest common factor of 31 and 2263. 31 What is the highest common factor of 615 and 123? 123 What is the greatest common factor of 10 and 18610? 10 Calculate the greatest common factor of 792 and 16. 8 Calculate the greatest common divisor of 376 and 4. 4 Calculate the highest common factor of 10736 and 264. 88 Calculate the highest common divisor of 6 and 72. 6 What is the greatest common divisor of 1072 and 16? 16 What is the greatest common factor of 77 and 1067? 11 What is the highest common factor of 81 and 702? 27 Calculate the highest common divisor of 54 and 18. 18 What is the highest common factor of 45 and 144? 9 What is the greatest common divisor of 10 and 810? 10 Calculate the greatest common divisor of 117 and 9204. 39 What is the greatest common factor of 70 and 80? 10 Calculate the highest common factor of 76 and 80. 4 Calculate the greatest common factor of 69 and 23. 23 Calculate the highest common factor of 55 and 28050. 55 Calculate the highest common divisor of 275 and 325. 25 Calculate the highest common factor of 2 and 3006. 2 Calculate the greatest common factor of 221 and 143. 13 What is the greatest common divisor of 5710 and 50? 10 Calculate the greatest common factor of 248 and 217. 31 What is the highest common factor of 744 and 155? 31 What is the greatest common divisor of 66 and 12? 6 Calculate the highest common factor of 357 and 3723. 51 What is the highest common factor of 13620 and 20? 20 What is the greatest common factor of 2456 and 40? 8 Calculate the highest common divisor of 775 and 558. 31 Calculate the highest common factor of 140 and 168. 28 What is the highest common divisor of 55 and 605? 55 What is the greatest common divisor of 35787 and 474? 237 What is the highest common factor of 17 and 4114? 17 What is the highest common factor of 248 and 1674? 62 Calculate the greatest common factor of 86047 and 13. 13 Calculate the highest common factor of 12 and 567. 3 What is the highest common divisor of 6846 and 6? 6 What is the highest common factor of 92 and 46? 46 What is the greatest common divisor of 675 and 1080? 135 Calculate the highest common factor of 646 and 34. 34 What is the greatest common factor of 96 and 1968? 48 Calculate the greatest common factor of 4640 and 160. 160 What is the greatest common divisor of 384 and 276? 12 Calculate the highest common factor of 1660 and 83. 83 Calculate the greatest common divisor of 12 and 246. 6 Calculate the greatest common divisor of 357 and 153. 51 Calculate the greatest common divisor of 156 and 3562. 26 What is the greatest common factor of 15 and 14515? 5 Calculate the greatest common divisor of 425 and 1530. 85 Calculate the greatest common divisor of 120 and 8130. 30 What is the highest common divisor of 9856 and 77? 77 What is the highest common divisor of 390 and 20? 10 What is the greatest common factor of 3905 and 2130? 355 What is the greatest common divisor of 115 and 506? 23 Calculate the highest common divisor of 1694 and 4774. 154 What is the highest common divisor of 336 and 3984? 48 What is the highest common factor of 5 and 15305? 5 What is the greatest common factor of 819 and 525? 21 Calculate the highest common divisor of 2975 and 238. 119 Calculate the highest common divisor of 47 and 38681. 47 Calculate the highest common divisor of 5 and 3205. 5 Calculate the highest common factor of 4 and 300.	{ "pile_set_name": "DM Mathematics" }
= w. Suppose 42j + 272 = 59j. What is the highest common divisor of w and j? 16 Let w(r) = 4r3 + 2r*2 - 7r + 3. Let p(c) = 3c2 - 6c + 3. Let o be p(2). Let f be w(o). What is the greatest common divisor of 27 and f? 27 Suppose 55 - 5 = -5x. Let z be (5/2)/((-5)/x). Let k be 2 + (-217)/(-28) - 2/(-8). Calculate the highest common factor of k and z. 5 Let f = -233 + 243. Calculate the highest common divisor of 55 and f. 5 Let y = 2 - -1. Suppose 4 - 19 = -yx. Suppose -6o + 5o + x = 0. Calculate the greatest common factor of 45 and o. 5 Let g(z) = -9z - 17. Let j be 8 - (0 + 2 + 2). Suppose 16 = -5c + 3u, jc + u + 32 = -3u. Let l be g(c). Calculate the greatest common factor of l and 14. 14 Suppose 4h - 6 = h. Let f(l) = -8l + 1. Let m be f(h). Let x be (-3)/m + 714/30. What is the highest common divisor of 6 and x? 6 Let i be 371(30/5 + 43). Let q be (-4)/(-18) + i/63. What is the greatest common divisor of q and 29? 29 Suppose x = 4y + 8, -3y - 6 = 5x - 2x. Let a be 117/(1 - (0 - x)). What is the greatest common divisor of a and 39? 39 Let h be 86880/204 + 1 + 45/(-51). Calculate the greatest common factor of 71 and h. 71 Suppose 5k = 3c - 7c + 18, c - 8 = -3k. Let u be k + -3 + 4 + 54 + -13. What is the highest common factor of u and 4? 4 Let z = 71 + -30. Let o = -69 + z. Let u = -19 - o. What is the greatest common factor of u and 36? 9 Let l(g) = -101g + 33. Let d be l(-3). What is the highest common divisor of d and 48? 48 Let s be ((-117)/(-156))/((-1)/(-128)). Calculate the greatest common divisor of 2208 and s. 96 Let g be 4 + 0 - (-5 - 6). Suppose g = -3r - 2r. Let c be (-87)/(-3) + r + 4. Calculate the highest common divisor of c and 20. 10 Let l = -40 + 63. Let r = l - -1. Let n be (-4)/(-14) - (-4020)/42. Calculate the greatest common factor of n and r. 24 Suppose g = 3d + 26, d = 6d - 2g + 42. Let a be ((-98)/35)/(1/d). Calculate the highest common factor of 7 and a. 7 Let f(a) = a2 - a - 54. Let p be f(8). Calculate the highest common divisor of p and 34. 2 Suppose w - 201 + 36 = 0. Suppose -w = -4f - 7f. What is the greatest common factor of 15 and f? 15 Suppose 3v + v - 151 = -3i, 3v + 5i - 116 = 0. Calculate the greatest common factor of v and 333. 37 Suppose 0 = h - 3j + 6j - 41, -15 = -5j. Suppose 2c = -2c + h. What is the greatest common factor of c and 2? 2 Let y = 102 - 63. Suppose -2o + 46 = 4g - 20, 4o + y = g. Calculate the highest common divisor of g and 133. 19 Suppose -7w + 14 + 77 = 0. Suppose 0 = -wa + 91 - 13. Calculate the highest common factor of a and 30. 6 Suppose -497 = -21d + 20d. Calculate the highest common factor of 71 and d. 71 Let n(l) = l2 + 3. Let k be n(-3). Suppose 4z + 2 - 84 = 2r, -65 = -5z - 5r. What is the highest common divisor of k and z? 6 Suppose 0 = -2h + 24 - 2. Let k = -8 + h. Suppose 5z - 110 = 4r, -z - 4r + 13 = -kr. What is the highest common divisor of z and 45? 9 Suppose -15 = 5l, -305k = -307k - 2l + 974. What is the greatest common divisor of 10 and k? 10 Suppose -3o = 4q - 46, -7 = 2o + 3q - 39. What is the highest common divisor of 830 and o? 10 Suppose q = -4q + 630. Let z be 6/14 + 814/77 - (-4 - -1). Calculate the highest common factor of z and q. 14 Suppose -3w = -0w - 150. Let k = w + -47. Calculate the greatest common factor of 27 and k. 3 Suppose 5 = -x, -3x = -n - 6x - 1. Let m = -11 + n. Let a be m/91315. What is the highest common divisor of a and 13? 13 Suppose -17h - 15972 + 39891 = 0. Calculate the highest common divisor of 21 and h. 21 Suppose 40 + 28 = 3o + 5h, -2h + 8 = 0. What is the highest common factor of o and 1? 1 Let z = 28 + 90. Suppose -175 = 113l - zl. What is the highest common divisor of l and 21? 7 Let s(j) = -j2 + j. Let i(m) = 3m*2 + 5m - 12. Let b(z) = -i(z) - 6s(z). Let t be b(5). Calculate the highest common factor of t and 24. 8 Let n = 744 + -654. What is the highest common divisor of n and 720? 90 Let z(o) = o3 - 5o*2 - 16o + 10. Let b be z(7). Let v(q) = q*2 + 3q + 3. Let g be v(b). What is the greatest common divisor of g and 1? 1 Let y be (-2)/10 + (-3)/(-15) - -40. What is the greatest common factor of 10 and y? 10 Suppose 3b = -2b + 10. Suppose -bo + 18 = -144. What is the highest common factor of o and 9? 9 Let a be 486 + (2(-4)/4 - 3). What is the greatest common factor of 37 and a? 37 Let a be (-87)/4(-40)/602. Calculate the greatest common factor of a and 435. 29 Let i = 105 - 82. Let w(d) = 5d3 + 3d*2 - 2d + 3. Let u be w(3). Let y = -21 + u. Calculate the highest common factor of i and y. 23 Suppose 6u = -a + 237, -6u + 2u + 159 = a. Calculate the greatest common factor of 182 and u. 13 Let u = -6 + 8. Suppose 52x = 166 + 198. Calculate the highest common divisor of u and x. 1 Let g(q) = -4q2 + 14q - 24. Let z be g(9). Let i = z + 318. Calculate the highest common divisor of 8 and i. 8 Let b(r) = r*3 + 16r*2 + 14r - 12. Let v be b(-15). Let p be (-3 - 44/(-12)) + 34/v. What is the highest common factor of p and 4? 4 Let h be 15/21 - 4/(-14). Let j(p) = 39p3 + 2p - 1. Let r be j(h). Let g = -2147 + 2155. What is the greatest common factor of g and r? 8 Let z be (326/(-14) + 1)/((-2)/14). Calculate the greatest common divisor of 832 and z. 52 Suppose p = 2s + 2p - 251, 0 = -4s - p + 499. What is the highest common divisor of 31 and s? 31 Suppose 31c + 273 = 33c - 3t, 4t - 252 = -2c. What is the highest common factor of c and 627? 33 Let i = -10 + 25. What is the greatest common divisor of 30 and i? 15 Let y be (-144)/(-2)3/6. Suppose 3w - y = -0. What is the highest common divisor of 30 and w? 6 Suppose s + 4i - 47 = 0, -3i = -2s + i + 118. Calculate the highest common factor of 110 and s. 55 Suppose -10 = -2y - 3l + 8, -2y = 2l - 14. Suppose -65 + 107 = yw. What is the greatest common divisor of 28 and w? 14 Suppose 2f = 4f. Suppose f = -3l - l + 48. Calculate the greatest common factor of l and 108. 12 Let g be (-5)/1(-19 + 18). Calculate the greatest common factor of g and 250. 5 Suppose -d - 494 = -5f + 234, 0 = -2d - 6. Calculate the greatest common factor of f and 58. 29 Suppose 0 = 11f - 15f + 12. Calculate the greatest common factor of f and 5. 1 Let a(l) = l*3 - 21l*2 - 20l - 19. Let t be a(22). Let r be -167(-2)/42. Let w = 317 - r. What is the greatest common factor of t and w? 25 Let g = 106 - 57. Calculate the highest common divisor of 14 and g. 7 Suppose 2a + 110 = 4d, 0 = 9a - 4a - 5. Suppose 0w - d = -2w. What is the greatest common factor of w and 126? 14 Let t(c) be the second derivative of c*4/2 - 4c*3/3 + 7c*2/2 + 27c. Let a be t(2). Calculate the greatest common factor of a and 255. 15 Suppose -3477 = -19x - 3078. Suppose 0 = -6s + 4s + 5u + 383, 3u - 186 = -s. What is the greatest common divisor of s and x? 21 Let n(o) = 40o*2 + 21o + 45. Let f be n(-5). Calculate the greatest common factor of 20 and f. 20 Let t = 30 + -11. Suppose 0s = s + 1, 4k = 3s + t. Suppose -j + 9 = k. Calculate the highest common factor of j and 35. 5 Suppose -13r - 134 = -c - 12r, -5r - 404 = -3c. Calculate the highest common divisor of c and 28. 7 Suppose 4t - 143 = 25. Let r(c) = 5c2 - c - 114. Let v be r(5). What is the highest common divisor of t and v? 6 Let v be (-1)/((-5)/(-30)) - -39. What is the highest common divisor of 3 and v? 3 Let i be -1 - (-30 - 1/1). Let q be 64/2i/8. Suppose -n - 6a = -2a - 28, -4n = 4a - 100. Calculate the greatest common divisor of n and q. 24 Let n = -135 + 145. What is the highest common divisor of 2 and n? 2 Suppose b + 34b - 735 = 0. What is the highest common factor of b and 1029? 21 Let j(h) = h3 + 3h*2 - 2h + 12. Let m be j(-4). Suppose -5y + 120 = mo, 21 + 3 = y - 2o. What is the highest common factor of y and 60? 12 Let d = -3 - -18. Suppose 2j - d = -13j. Calculate the highest common divisor of j and 11. 1 Suppose r = -j - 5, -25 = 2r + 5j - 0j. Suppose 5u - 18 - 122 = r. Suppose 1230 - 3190 = -28o. What is the highest common factor of o and u? 14 Let c(y) be the second derivative of 25y4/12 + y2/2 + 3y. Let d be c(1). Let i be -4*(-2)/(-4) + d. What is the greatest co	{ "pile_set_name": "DM Mathematics" }
4/(i1iii)*(-23)(i*0i/i(-9))38 assuming i is positive. i*(3312/7) Simplify (((gg*(3/5)g)/g37)/(g(-36)/(g*(7/9)/gg)))24 assuming g is positive. g(856/15) Simplify (n*(1/6)n*20/nnn(n(n(1/13)/nn)/n)(-37))15 assuming n is positive. n*(7145/26) Simplify (g/(((gg*0)/gg)/gggg)g/(g(-7)/g))(-1/10)((g/g(-1/15))/(g/(gg(-2/5))))/(g(2/7))(-14) assuming g is positive. g(119/30) Simplify ((m(3/13))(1/71)m/(m(40/3)/m)m/((m/m*(-9)m)/m))47 assuming m is positive. m(-2645818/2769) Simplify ((ff/(((f/(f1/f))/f)/ff))*26/((f(f/(ff/f(-1/10)))/fff)/f(1/6)))/((f(-1/3)/f)/f(1/3))(-27) assuming f is positive. f(94/15) Simplify ((z(-2/17)z(-2)/z)/(z(4/5)/z(-8)))/(z(-11)/zzz/(z/(zzzz(-6)z))z)(-2/27) assuming z is positive. z(-9797/765) Simplify ((kk(1/3))(-9))(-1/3)/((k/(k/k(-2/7))k(k*1k)/k)/(k*(2/3)k)(-1/32)) assuming k is positive. k(1501/672) Simplify t(-1/17)/(t/t(-8/3))t(-2/5)/t(-15) assuming t is positive. t(2773/255) Simplify (r9/(r/r(-4)))(10/11)(r/(r/(r/r1)))(-29)r(-1/4)/(rr*(1/7)r) assuming r is positive. r*(383/308) Simplify ((ff1)(-1/28))*(6/29)((f/f*(2/5)f)48)(-6) assuming f is positive. f(-467727/1015) Simplify ((x5)(-41)/(x4x(6/13)))(12/7) assuming x is positive. x(-4668/13) Simplify (s16/s(1/30))/(ss*(-3/32)/ss*18/ss) assuming s is positive. s*(-931/480) Simplify ((s/(ss/s*(-9)s)s)22(s(2/13))(-12))(-40) assuming s is positive. s(115360/13) Simplify ((p/(p/((p/((p*35/p)/p)p)/pp))p*(-1/4)pp)/((p11p)/p(-2/7)))(-3/4) assuming p is positive. p(3489/112) Simplify ((b/b(-1/11))/b*6(bb5b)/((b(-1)/b)/b))(1/30) assuming b is positive. b*(28/165) Simplify (((oo*(-1)o)/o)(2/45))2/((o*(-1/18)/o)/oooo/o(-2/21))(4/3) assuming o is positive. o*(-262/189) Simplify (((mmm/(m/m(2/3)))(-17/5))(1/53))32 assuming m is positive. m(-4352/795) Simplify ((w/w(-10))(-8/5)/(w(2/25)w)(8/9))(-10) assuming w is positive. w(928/5) Simplify l(-2/27)/ll/l(9/7)(l(4/31))12 assuming l is positive. l(1105/5859) Simplify ((j(1/6)/j(1/2))/((j/j(-2/9))/(j(j/(jj/(j*(-3)/j))j)/jjj)))/((j(2/3))(-1/19))(-4/27) assuming j is positive. j(-5480/1539) Simplify (a*(-23)/(((aaaa(-2/31))/a)/a))/((a(-38)a)/(a((a*(15/4)a)/a)/a)) assuming a is positive. a(2085/124) Simplify ((q/(q(-5)qqq))/qq/q*(-7))/((q/(qq(-1/4)/q))/q)(-31)((q(-7)q)/(qq(-1/13)))/(q(-6)/(qq0)) assuming q is positive. q(927/52) Simplify ((j*(-3)j)/jjj*(-2/5)j)/(j(-2/9))(2/17)(j/(j6j)j(-1)j)/(j*(1/4)j(j(-1/2)/j)/jj) assuming j is positive. j(-21799/3060) Simplify ((c(-1/11)cc)/(c*(-1/3)/cc))*(2/107)/((c/(cc*(1/11))c)/(cc6))(-2/89) assuming c is positive. c(-29842/314259) Simplify (b(2/15)bb(-8)(b/(b/(b(2/15)/b)))12)27 assuming b is positive. b(-2331/5) Simplify ((k/(k/k*9))/k(((k*1/k)/kk)/k)/k(k(-1/5)/k)(-50))(-20) assuming k is positive. k(-1320) Simplify ((r(-2/19))(-13)(r/(((rr5/rrr)/r)/r))(-29))44 assuming r is positive. r(98120/19) Simplify (nnnnn(-2/9)n)/(nn(-3/2))n/(n*(-1/2)n)n5(n/n1)(22/5)/(n4/n(-5/4)) assuming n is positive. n(199/36) Simplify (b/(b/b21)bb(b/(bbb(-12)b))/b)/(b/((b/(bb(-42)))/bb)b(-3/4)b) assuming b is positive. b(291/4) Simplify (c21/(c*28c)(c(-3/4))17)8 assuming c is positive. c(-166) Simplify (d(-1/2))(-4)((dd/((d(1/2)/d)/d))/d)9(d*(-1/2)d)*(2/13)(d*0/dd)/ddd*(-2/3)d assuming d is positive. d(1943/78) Simplify ((a(-3))*36a*(7/5)/(a(a/(a/a(1/30)))/a))(2/7) assuming a is positive. a*(-457/15) Simplify ((qqq/(q(-13)/q))38(q*(-4/7)/qq)33)(14/3) assuming q is positive. q*(8780/3) Simplify (vv(2/7))28/(v/(vvv(v/v(-3))/vv)vv*(2/11)vv)((v/v(2/9))(-4/15))44 assuming v is positive. v(44093/1485) Simplify ((d*24d)*(1/40)/((((ddd(11/4)d)/d)/d)/dd(-2/17)))(-25) assuming d is positive. d(6825/136) Simplify (l15/ll)/l*(-18)(l/(l/(l*7/l)lll))/((l/l11)/l) assuming l is positive. l47 Simplify ((ww(-2/7))37)(-2/53)((w0)(-21/4))(6/7) assuming w is positive. w(-370/371) Simplify (l/(l*(2/7)ll))/l(-1/7)ll0((l/l*3)/l)/l(l1)(40/7)/(l/(ll(-1)l))(15/11) assuming l is positive. l(11/7) Simplify ((nn/n(-15/7))/nn*17nnn)/((n/n(-2/37))/(((n/n(5/3))/n)/nn)) assuming n is positive. n(15868/777) Simplify (a(-1/4))(2/11)/(a/(aa0))(-32)(a(a/a*(-1))/aa/a(-4))/(a/((a/a4)/a)a/(aa/((((a2/a)/a)/a)/a))) assuming a is positive. a(109/22) Simplify ((aa/(aa(2/13)))(2/69)/(a(2/21))(-35))33 assuming a is positive. a(33132/299) Simplify ((v(2/21))(-16)/((v/(v/v(-8/9)))/v20))1 assuming v is positive. v(1220/63) Simplify ff(12/13)(f*19ff)/ff*(-30)ff(2/59) assuming f is positive. f(-5402/767) Simplify (k3/kk*(3/8)(k/(k*(-2/7)k))/(k/k2))/((((k2/k)/k)/k)(-6/7))(-37) assuming k is positive. k(283/8) Simplify (((m/(m/(m/m(-1))))/m)/m)/(mm(5/6))(m(-2/9))(-32)((mmm(-2/7)m)/m)/(mmm*4/m)mmm*(-6/5)m*(-1)mm assuming m is positive. m(2389/630) Simplify y/y(-5)y/y*(2/19)(y/y(-6))/y3((((yy*(1/3))/yy)/yy)/yyy)/yy*(-1/7)y/(y/(y*(-5)y))y(-3) assuming y is positive. y(2029/399) Simplify ((((w/(w/(ww/(w/((((ww(-2/107))/ww)/w)/w))))www)/w(3/2))21)49)8 assuming w is positive. w(1304772/107) Simplify ((ff*(2/3)f)30/(f(-3)ff(1/2)))/((f/f1)*(-40)f*(-1/3)/((f((ff(1/5)/f)/f)/f)/f)) assuming f is positive. f(2401/30) Simplify (ss*(3/23)ss(1/12))/(s/(s/s20))(-23) assuming s is positive. s(127571/276) Simplify ((((h(-1/4)/h)/hhh3)/(h8hh(-10)))(-6/29))(1/2) assuming h is positive. h(-33/116) Simplify ((u(-1/40)uu(-5/2))/((u(uu/u39)/uu)/(uu/(uu*30uu)uu)))(-2/9) assuming u is positive. u(-73/60) Simplify ((s(s*(-2)/s)/s)/(s(s/((s/((s/s*(-8))/s))/s)s)/ss))/(ss/s*(-2)s)*(-43)((s/s(-1))/s)(-34)(s(-2))(-15/4) assuming s is positive. s(349/2) Simplify ((r/(r/(r/(r/r(-1)r)r))rr)(5/13))(8/11)(r*(2/7)rrrrr/(rr(-2/3))r)(-12) assuming r is positive. r(-71220/1001) Simplify (((h*(1/82)/h)/hhhh)/h)/((h*19/hh)/h)(hh/h*42hhh)/(h/h(1/6)) assuming h is positive. h(-6866/123) Simplify ((o*(-15/8)oo4o)/(oo/((ooo/(o/((oo*(-1/39)/o)/o))o)/o)o/(oo(-1/42))))(1/82) assuming o is positive. o*(2239/59696) Simplify (((cc*(1/2)/cc(1/8))37)46)(-21) assuming c is positive. c*(-89355/4) Simplify ((rr(2/43))/(r/r(3/8))(rr(-9/4))/r(-10))19 assuming r is positive. r(59945/344) Simplify (g/(gg(2/29)g)g(-5))(12/7)(g/g*4g6)(-9/2) assuming g is positive. g(-9705/406) Simplify (v(-3/8)v5)/(((v/v4)/v)/(v(5/6)v))(vv*(-3)vv(1/2)v)/(((v*(-9)/v)/vv)/(v/v(2/9))) assuming v is positive. v(1565/72) Simplify (l(-6)/(l(3/8)ll))/(l*(-6)(l*2l)/ll)l*(1/4)l*(1/3)ll(-2/19)/lll(-1/2) assuming l is positive. l(-2005/456) Simplify (((c(1/23)/cc)/(cccc/(cc/(cc/(c/((c/(ccc(-15)cccc))/c)c)c)c)))/(c(c/c(-1/5))/cc)(2/39))(-12/13) assuming c is positive. c(198584/19435) Simplify (((a(-1)a)/(((a/a12)/a)/a)a(-1/13)/a(-7))(-33))24 assuming a is positive. a*(-205128/13) Simplify (((zzz(2/11)z)/z)/z*(-2/13)z*(-3/29)/(zz(-28)))(-19/4) assuming z is positive. z*(-1151647/8294) Simplify ((((ss(1/6)/s)/s0)(-2/67))(-6/5))(-42) assuming s is positive. s(-84/335) Simplify ((h*(2/3)h)/(h/(hh/h(-2)h)h))(-38)(h/((h/h*(-3)h)/h)h(-2/7))2 assuming h is positive. h(-3862/21) Simplify oo*(1/5)o/o*(1/4)((o/o*1)/ooo)/o(o/o*1o)/oo5/(o(-3/7)/o)(o/(o/(o/(((ooo*(1/2))/o)/o))o))(-20) assuming o is positive. o(2573/140) Simplify ((s*(-2)s)(-5/2)/((s/s(1/2)s)/((sss/(s/(s/s(-5))))/s)))*(20/9) assuming s	{ "pile_set_name": "DM Mathematics" }
149973 composite? True Is 245171 a composite number? False Is 6110179 a prime number? True Is 102548647 composite? True Is 11427131 a composite number? True Is 4823257 composite? True Is 183142187 composite? True Is 116759273 a composite number? False Is 1693543459 a composite number? False Is 636923 a prime number? False Is 5451473 composite? False Is 43457699 a prime number? False Is 620230895 a prime number? False Is 710093 a composite number? True Is 568786819 a prime number? True Is 5278223 a prime number? True Is 8050241 prime? True Is 798869 a composite number? True Is 13996993 composite? False Is 308125613 a composite number? False Is 447595727 a composite number? True Is 14863091 composite? True Is 9384626 composite? True Is 4106677 a composite number? False Is 10346173 a prime number? False Is 77476913 a composite number? False Is 32237627 prime? False Is 4050701 prime? True Is 11436209 composite? False Is 498235469 a prime number? True Is 40542041 prime? True Is 1289111 composite? False Is 11297329 a composite number? True Is 8532109 composite? True Is 111196451 a composite number? False Is 105551206 prime? False Is 394151 a prime number? False Is 84549251 a prime number? False Is 134929337 composite? True Is 579724289 composite? False Is 4666777 a prime number? True Is 139379171 a prime number? True Is 54158957 a composite number? True Is 8348222 a prime number? False Is 6450467 composite? False Is 18585309 composite? True Is 1153801 a prime number? False Is 305533177 a composite number? False Is 263843843 a prime number? True Is 12279779 a composite number? False Is 471742147 prime? True Is 27697603 a composite number? False Is 281339 a composite number? False Is 12044287 a composite number? True Is 13933483 prime? True Is 21639647 a prime number? True Is 1359803 a composite number? False Is 11655469 prime? False Is 286177 a prime number? False Is 43115239 composite? True Is 50465339 a composite number? True Is 4124114 prime? False Is 2207297 a composite number? True Is 55936151 prime? True Is 91206491 composite? False Is 30958097 prime? True Is 27727837 a prime number? False Is 2537453 prime? False Is 27198265 a prime number? False Is 16909 a prime number? False Is 48832753 composite? False Is 248108277 a prime number? False Is 73891033 a prime number? True Is 13751671 prime? False Is 1041265 a prime number? False Is 974707 a composite number? False Is 1729979 a composite number? True Is 75186341 prime? True Is 307120789 composite? False Is 1215329 prime? True Is 2819069 composite? True Is 4458007 prime? False Is 3538735 prime? False Is 364633079 prime? False Is 81941771 a prime number? True Is 191982041 a composite number? False Is 11270401 composite? True Is 4080994 composite? True Is 44908991 prime? False Is 66328393 a prime number? False Is 42852409 a composite number? False Is 2534871 composite? True Is 114572201 a composite number? False Is 5978737 composite? False Is 9746687 prime? False Is 3776631 a prime number? False Is 4145419 prime? True Is 8975753 prime? True Is 274723 a prime number? True Is 1006283 composite? True Is 1043249 composite? True Is 3185243 composite? False Is 5255407 a prime number? True Is 25951847 prime? False Is 41050183 composite? False Is 6158923 a composite number? False Is 151201 a composite number? False Is 240012623 prime? False Is 30998483 a composite number? False Is 549959 a prime number? False Is 118955717 a composite number? False Is 540343 prime? True Is 1014098 composite? True Is 25172486 prime? False Is 75795466 a composite number? True Is 6219049 a prime number? True Is 3277763 a composite number? False Is 1860107 a composite number? True Is 828254077 prime? False Is 2401889 a prime number? False Is 290401 a composite number? True Is 3212203 a prime number? False Is 3412811 composite? True Is 3681259 a composite number? True Is 7363403 composite? False Is 13594219 composite? True Is 35194697 composite? False Is 41586781 a prime number? False Is 6031837 a prime number? False Is 6997343 a composite number? False Is 308047921 a prime number? False Is 2133506 a prime number? False Is 3951719 composite? False Is 132897551 a prime number? False Is 14788211 a composite number? False Is 165697829 prime? False Is 1407443 a prime number? False Is 116005489 prime? True Is 63809861 prime? True Is 105725173 prime? False Is 293844829 a prime number? True Is 372321019 a composite number? True Is 14493 composite? True Is 11859817 composite? False Is 334903 prime? False Is 45459221 a composite number? False Is 421077689 a prime number? True Is 3173069 a composite number? False Is 771319 composite? True Is 701928023 prime? True Is 27902293 composite? False Is 41008234 prime? False Is 188038213 a composite number? True Is 23716673 a prime number? True Is 151408963 composite? False Is 103728607 prime? True Is 842953 a prime number? False Is 1100543 a prime number? True Is 6257089 prime? True Is 584083 a composite number? True Is 52015211 composite? False Is 2533651 prime? True Is 37406659 composite? False Is 1077431633 prime? True Is 2279311 prime? False Is 68036039 composite? True Is 25980359 a prime number? True Is 4720477 prime? True Is 6276607 a prime number? True Is 56044591 a prime number? True Is 6401983 a prime number? False Is 170699129 a prime number? True Is 28402097 prime? True Is 29809453 composite? False Is 2154797 prime? False Is 135214007 composite? True Is 2392657 a prime number? False Is 54949795 composite? True Is 9353667 composite? True Is 9661637 a prime number? True Is 1985407 a composite number? False Is 234673 a prime number? True Is 6279619 a prime number? True Is 1456309 a composite number? True Is 31550149 composite? False Is 2990423 a prime number? True Is 151603013 a composite number? False Is 1764713 composite? True Is 498643 a composite number? False Is 433991582 composite? True Is 13482901 a prime number? False Is 72265313 composite? True Is 34868929 prime? True Is 33940867 prime? True Is 97499 a prime number? True Is 1652237 composite? False Is 177141157 prime? True Is 594343 composite? True Is 3987689 a prime number? False Is 27505091 composite? True Is 38446379 a prime number? True Is 6592129 a composite number? True Is 525209 prime? True Is 57569737 a composite number? False Is 528469 a composite number? False Is 5286293 prime? True Is 35437301 prime? False Is 2179097 composite? False Is 20227817 prime? True Is 66527927 a composite number? False Is 533111 prime? True Is 5652649 prime? True Is 97461077 a prime number? False Is 639740531 composite? False Is 4812697 a composite number? True Is 2244779 composite? False Is 16812469 a composite number? False Is 59075035 composite? True Is 7635413 a composite number? True Is 286326151 a prime number? True Is 65552037 a prime number? False Is 51431 a composite number? False Is 33858205 composite? True Is 221047 a prime number? True Is 5525413 composite? True Is 543748379 composite? False Is 37691795 a composite number? True Is 31266943 composite? False Is 188427961 a composite number? False Is 12498947 a composite number? True Is 55844407 a prime number? True Is 25572451 prime? True Is 28101509 a prime number? True Is 7212599 prime? True Is 275651 prime? True Is 5206517 composite? True Is 4904197 prime? True Is 31704679 a prime number? True Is 23858771 a composite number? False Is 25985143 a prime number? False Is 32797031 a prime number? False Is 121803503 composite? True Is 21142259 prime? True Is 306076919 prime? False Is 323831 prime? False Is 1620943 composite? True Is 20441611 prime? True Is 872533 prime? True Is 1938301 a prime number? True Is 2433799 a composite number? True Is 4814503 a composite number? False Is 305999 a composite number? False Is 3901511 a composite number? False Is 228274489 composite? False Is 14319829 prime? True Is 47876291 prime? False Is 4167257 a prime number? True Is 321443 prime? True Is 1779283 a prime number? False Is 81390241 prime? False Is 25209397 prime? False Is 63991559 a composite number? False Is 1467517 prime? False Is 1821749 a composite number? False Is 157911653 a composite number? True Is 44669017 composite? True Is 2859019 a composite number? False Is 363156491 prime? Tr	{ "pile_set_name": "DM Mathematics" }
ommon multiple of r(-15) and 632. 632 Find the common denominator of (-8)/1962(-16)/((-96)/207) and -101/12. 1308 Let p(x) = x3 - 2x*2 - 6x + 6. Let t be p(4). Let a = t - 9. Suppose z + 12 = 3j + 2z, -15 = -az. Calculate the least common multiple of j and 16. 48 Let k = 6176 + -61677/10. Suppose 0 = -2y + 24 + 12. What is the common denominator of k and (y/(-28))/((-72)/21)? 80 What is the common denominator of -39/22 and (-3 - (-2 - 4)) + 610/(-280)? 308 Let n(h) = -7h + 2. Let k = 6817 + -6815. Calculate the least common multiple of k and n(-4). 30 Let g = -5145/286 + 264/13. Let h = -229649/19752 + 4/2469. Calculate the common denominator of h and g. 88 Suppose 5v + 117 - 227 = 0. Calculate the least common multiple of v and 304. 3344 Let n be (0 + 2)/(22/77). Let m = -40 - -53/2. Find the common denominator of 2 + n39/18 and m. 6 Suppose -2i + 10i = 0. Suppose v = 5q - i - 36, 3q - 2v - 23 = 0. Calculate the least common multiple of q and 2. 14 Calculate the common denominator of (-943)/720 - 5/90-4 and 17/50. 400 Suppose 44 = -u - 2t + 282, 0 = -3u + 3t + 759. Calculate the smallest common multiple of u and 20. 1240 Suppose -54 = 5a - 4z, -a + 4z + 6 = -2a. Let q = a + 17. What is the lowest common multiple of -1 + q + 12/(-3) and 18? 18 Let z(n) = 12n2 - 2n - 1. Suppose -114i + 131i - 51 = 0. Calculate the lowest common multiple of i and z(-2). 51 Suppose 32l - 37l = -i - 958, -2l = -i - 382. Calculate the lowest common multiple of 112 and l. 1344 Calculate the smallest common multiple of (-448)/(-20) + (-2)/5 and -15 + (-13 - -28). 110 Suppose -2r + 42 = -10. Let d = r + -20. Calculate the least common multiple of 6 and d. 6 Suppose 0 = 2x + 4v - 18, 7v = 2v - 10. Calculate the smallest common multiple of 260 and x. 260 Let l = -600 + 614. Calculate the least common multiple of l and 18/(-4)(-16)/6. 84 Let p(w) = -w*3 - 5w*2 - 5w - 7. Let z be p(-3). Find the common denominator of 12/11 and 12/(-90)z + (4 - 1). 33 Let m be -6((-4)/12)/(-1). Let l = m + 7. Suppose 0 = lb - 2b - 21. What is the least common multiple of 8 and b? 56 Let s = -6 - -8. Let z = -191 - -195. Calculate the least common multiple of z and s. 4 Suppose 3r + 4f + 144 = 0, -2r + 6r = f - 173. Let o = -6 + 20. Calculate the common denominator of (-8)/r - o/(-4) and 17/14. 154 Suppose 3n = -15, -424 - 366 = -2i - 4n. Calculate the lowest common multiple of i and 50. 4050 Suppose 0 = k - 4k + 42. Suppose 15w = 3w - 276. Let q = 47 + w. What is the smallest common multiple of k and q? 168 Let u = -7944/5 + 1594. Calculate the common denominator of 73/6 and u. 30 Let m = 11 - 8. Suppose 4k = mk. Find the common denominator of -15/14 and (-3 - k)(-118)/(-108). 126 Suppose 2b + 5a = -37 - 21, -a + 72 = -4b. Suppose -60 = -0l - 5l. What is the common denominator of -13/22 and (15/l)/((-8)/b)? 352 Let f(a) = a*2 + 16a - 17. Let k be f(-19). Let x = -24 + 97/4. Find the common denominator of 86/k(-8)/12 and x. 60 Find the common denominator of ((-219)/(-94))/(-103 + 106) and -57/235. 470 Let f = 15/2102 - 68908/9459. Let k = 21093/4910 - -2/491. What is the common denominator of k and f? 90 Let v = 906 + -842. What is the least common multiple of v and 152? 1216 Suppose -2h = 5p - 128, 4h - 25 = -p - 3. Calculate the lowest common multiple of p and 6. 78 Suppose -16o + 14o + 7724 = 0. Let k = 54141/14 - o. Calculate the common denominator of -47/46 and k. 322 Let r be (1 - 6)2/(-10). Let w(o) = 3o3 + o2 - 1. Let t be w(r). Calculate the common denominator of -93/20 and (-58)/(-44) - (-6)/t. 220 Suppose 2 = l, 4l - l = 2k - 42. Suppose 48 + k = 2i. Find the common denominator of -10/11 and i. 11 Let k = 2965/312 + -5/39. Let f = -194345/18 - -10802. Calculate the common denominator of f and k. 72 Let q = -29375/12 + 2455. Let n = 23841/307501 + 5730329117/6686301744. Let x = 4/1359 + n. Find the common denominator of x and q. 48 Let v = -1043809/100 + 10438. Calculate the common denominator of v and 2175/300 + 2/4-1. 100 Suppose 2c = -0c + 10. Let o be (-20)/6 + (-128)/(-96). What is the lowest common multiple of c and (-4)/(-16)(-6 - o) + 3? 10 Suppose -5h + 184 = 164, -3u + 1524 = 3h. Calculate the smallest common multiple of 28 and u. 504 Let p = -30057/72848 - 3/2512. Calculate the common denominator of 3/((-18)/(-88)) - (83 + -90) and p. 87 Calculate the lowest common multiple of 16 and (-7 - -5 - 1) + 41. 304 Let g = 405 + -393. Suppose 3t + 2j = -2j + 22, -2j - 44 = -4t. What is the lowest common multiple of t and g? 60 Suppose 2z = -4y + 12, -3y = -2z + 2y + 30. Calculate the least common multiple of z and 2. 10 Let r be 2 - ((-18)/(-12))/((-9)/(-1227)). Let x = r + 194. Calculate the common denominator of x and 0 + (-1)/((-14)/(-117)). 14 Suppose -4u + 352 = 5s, -4s + 142 + 154 = -4u. Let r(a) = -2a + 10. Calculate the lowest common multiple of s and r(-6). 792 Let w(g) = g2 + 11g + 13. Let y be w(-10). Suppose 0q = yq - 21. Calculate the smallest common multiple of 22 and 40/q - (-6)/21. 66 Let t = 3415/2 - 1742. Find the common denominator of t and ((-27651)/270)/13 - 20/50. 18 Let m = -21135/11 - -1923. Let a = -31 + 33. What is the common denominator of m and 6/9 - (a - 1)? 33 Suppose g + 2g - 12 = 0. Let m(x) = -2x*3 - 65x*2 + 28x - 59. What is the lowest common multiple of m(-33) and g? 212 Let w = -44 + 46. Suppose 2p - wv + 5 = p, 3p = -v + 6. What is the least common multiple of 13 and p? 13 Let q = -50677/10952 + 3/1369. Find the common denominator of q and 1/238. 952 Let b(u) = u3 + 50. Let j be b(0). Let m be 2/(-6) - (-13)/3. Suppose r - j = -mr. Calculate the smallest common multiple of r and 8. 40 Let i(l) = -3l2 + 2l + 6. Let f be i(6). Let b be (26/12)/(-13)530. Let o = b - f. Find the common denominator of -9/2 and o. 6 Let b = -170479/223722 - -72/1381. What is the common denominator of -19/18 and b? 162 Let f = -5903 + 3276. Let i = f - -15805/6. Suppose -4n - 4l - 44 = -0l, 5n = 5l - 5. Calculate the common denominator of n and i. 6 Calculate the common denominator of (6/(-216))/(5/28) and -103/50. 450 Let o = -41 - -65. Let k(b) = -9b + 8. What is the lowest common multiple of o and k(0)? 24 Let n(c) be the first derivative of -5 + 1 + 0 + 2c2. What is the smallest common multiple of n(2) and 11? 88 Let i(p) be the second derivative of -p5/20 - 13p4/12 + 29p*3/6 + 13p*2/2 - 16p. Calculate the least common multiple of 28 and i(-15). 28 Let x(b) = -74b - 421. Calculate the smallest common multiple of x(-6) and 6. 138 Suppose -5s - 4c + 5c + 425 = 0, s - 85 = -2c. Calculate the common denominator of ((-18)/(-4))/(55/45) and 5/s(-1)/(-2). 374 Let p be 4 + -1 - (-137760)/(-45836). Let k = 77137/36014 + p. Calculate the common denominator of k and -105/104. 1144 Let o = -10 - -12. Let r(f) = 43f - 43f + 18fo. What is the least common multiple of 16 and r(1)? 144 Suppose q - 36 = -2q. Suppose -q = -4l - 4a + 4, -5l + 4a + 20 = 0. What is the lowest common multiple of 14 and l? 28 Let i be -8(-15 + ((-12)/4)/3). Calculate the least common multiple of ((-4)/8)/((-2)/i) and 8. 32 Suppose -22 - 197 = -3y. Suppose 5a - y - 37 = 0. Calculate the lowest common multiple of 78 and a. 858 Suppose u - 10 = -u. Suppose -2l - 6042 = -ug + l, 0 = l + 4. What is the common denominator of g/1202/(-3) and 109/18? 90 Let v(g) = 5 - 24g + 54 - 18g*2 + 17g*2. Calculate the smallest common multiple of v(-26) and 14. 14 Let k = -918/7 - -885/7. Find the common denominator of -472/((-5)/((-35)/98)) and k. 7 Let i = -225 + 330. What is the smallest common multiple of 195 and i? 1365 Let d(r) = r*2 + 1. Let y(n) = -2n*2 - 15n + 1. Let u(l) = -3d(l) - y(l). Let o = 21 + -13. Calculate the least common multiple of o and u(13). 88 Calculate the smallest common multiple of 102/255 + (-69)/(-15) and 3. 15 Let f = 642 - 647. Suppose -u + 84 = y, -5u + 424 = 5y - 2u. Calculate the common denominator of 49/2 and (f - -2) + y/36. 18 Let g(d) = d*2 + 11d + 12. Let x be g(-7). Suppose 2u - 4y = y - 161, -2y = 6. Find the common denominator of (6/(-2))/(u/x) and 83/6. 66 Let z(c) = 19c3 - c2 - 2	{ "pile_set_name": "DM Mathematics" }
3/(-2)600/36. Let g = 25 + c. Let k(n) = 0 + 7 - 7n + g - 2n2 - 13. Calculate k(-4). -10 Let s = 53 + -50. Let n(y) = y. Let m(f) = 6 - f - f - 5. Let x(q) = sn(q) - m(q). What is x(-1)? -6 Let f = -704 + 704. Let w(d) be the second derivative of -3d + 1/6d*3 + 0 - 7/2d*2 - 1/12d*4. What is w(f)? -7 Let k(j) = -30j + 29. Let r(w) = 74w - 57. Let i(a) = 5k(a) + 2r(a). Determine i(13). 5 Let s = -48 + 49. Let o(m) = -23m - 89m + 3 + 113m. Calculate o(s). 4 Let i(g) = 18g3 + 2g*2 + 8g - 9. Let a = 6507 + -6506. Determine i(a). 19 Let p be (-2)/(-7) - 6/21. Suppose -41 = 37r - 152. Suppose 0h + ph = -rh. Let s(z) = z + 4. What is s(h)? 4 Suppose -3s + 13 = 10. Let g(x) = -s + 78x - 81x - 2. Give g(4). -15 Let y(x) = -2 + 522764x + 5 - 522771x + 2 + x2. Determine y(1). -1 Suppose -5m = -63y + 67y - 57, -5y + 66 = m. Let h(w) = w - 3. Determine h(y). 10 Let o = 14922 + -14922. Let f(i) = 44i - 1. Give f(o). -1 Let g = -6 - -11. Let b(o) = -21o2 - 2o - 23. Let k(h) = -16h2 - 19. Let u(f) = -3b(f) + 4k(f). Determine u(g). -2 Let l(x) = x2 + 18x + 4. Suppose 6q = -112 + 4. Let b be l(q). Let t(y) = -343y*2 + 330y*2 - 4y + by. Calculate t(1). -13 Let k(s) = -s3 - 4s*2 - 5. Let a(l) = -7l - 60. Suppose 33 = -4g + 1. Let v be a(g). Calculate k(v). -5 Let y = -16 - 0. Let h = y + 19. Let z(o) = -4o*2 + 3o + 4. Let a(r) = 3r2 - 3r - 4. Let u(g) = 3a(g) + 2z(g). What is u(h)? -4 Suppose 64 = -25t + 17t. Let p be (t/(-24))/(-4 + 295/75). Let a(n) = -n*3 - 4n*2 + 5n - 5. What is a(p)? -5 Let q(r) = 12r2 + 8r - 7. Let h(a) = 17a2 + 11a - 10. Let g(c) = 5h(c) - 7q(c). Let t(y) = -y + 3. Let z(o) = g(o) + t(o). Give z(-5). 37 Let y(o) = o*2 + 8o + 1. Suppose 3g + 75 = 1752. Let t be (-108)/26 - (-86)/g. Calculate y(t). -15 Let y(t) be the third derivative of -7t6/60 - t5/30 + t4/24 + t3/2 + 22t2. Let p be y(-1). Let r(a) = 16 + pa - 7 - 15a. Calculate r(7). 2 Suppose -17 + 5 = -3l. Let t = l + -5. Let v(b) = b*2 - b + 22. Let q(w) = -7w*2 - 7w + 132. Let h(s) = -q(s) + 6v(s). Determine h(t). 12 Let z = 4942 + -4943. Let b(a) = -6a - 4. Let r(k) = -17k - 11. Let s(l) = 8b(l) - 3r(l). Give s(z). -2 Let y be -9 + (-252)/(-27) + (-20)/(-3). Let g(q) be the second derivative of -q4/12 + 7q3/6 + q2/2 + 49q. Calculate g(y). 1 Let q(c) = -2c*2 + c. Let i(h) = 13h*2 - 7h - 20. Let v(m) = -i(m) - 6q(m). Give v(-6). -22 Let b(o) = 7o*3 + 12o*2 + 7o + 9. Let s = -733 - -728. Let x(k) = 11k3 + 10k + 6 + 18k2 + 11 - 3. Let c(n) = sx(n) + 8b(n). Determine c(-4). 10 Let o = 1983 - 1975. Let q(w) = -8w + 64. Give q(o). 0 Let r(z) = 3z - 9. Suppose 4q - q - a - 2 = 0, -q - 5a - 26 = 0. Let f(k) = -68k - 4. Let u be f(q). Let h = -57 + u. Give r(h). 12 Suppose -2o + 29j = 31j - 26, -5j = 3o - 47. Let y(p) = -p2 + 10p - 14. Calculate y(o). -5 Suppose -3g - 15 = 0, r + g + 8 = -24. Let s be (-21)/(3/(r/6)). Let f(j) = 7j2 - 7j + 4 + 1 - 5 - j*s - 2. Give f(6). -8 Let h(m) = 12m + 2 - 2m - 19m. Let r(l) = 3l2 + 5l + 3. Let c be r(-1). Calculate h(c). -7 Let w(r) = 183r2 + 179r*2 + 18r + 182r2 - 15 - 11 - 546r2. Determine w(6). 10 Let a(m) = m2 - 4m + 3 - 5m2 + m2. Suppose 4c + 5d = 18, -c + 10 = -120d + 124d. Determine a(c). -17 Let p = -16705 - -16703. Let y(u) = -16u3 + 3. What is y(p)? 131 Let i(c) = 4c3 - c - 2. Let k(n) = -n3 - n*2 - n - 2. Let l be k(-2). Suppose 0p - lt = 5p - 14, 2 = 2t. Calculate i(p). 28 Let f be ((-1)/6198/(-1320))/3. Let j(k) be the third derivative of 2k3 - k2 - fk*6 + 0k - 2/15k5 + 1/12k*4 + 0. What is j(-8)? -4 Suppose -5a + 135 = -15. Let b = 31 - a. Let k(c) = 7c - 4. Let w(u) = 1. Let j(h) = bk(h) + 6w(h). Give j(-3). -19 Let z(k) = -k3 - 13k*2 - 6k + 62. Let p(v) = -9v3 + 53v*2 - 5v + 54. Let r be p(6). Determine z(r). -10 Let r(u) be the third derivative of -u5/20 + u4/6 + u*3/2 - 3u*2 - 171u. Calculate r(-4). -61 Let z(i) = 17i - 4. Suppose -210t = 206t + 1664. What is z(t)? -72 Let l(y) = -y2 - 23y - 42. Suppose -3n + 129 = -b + 198, 9 = n + 5b. Determine l(n). 0 Let j(g) be the first derivative of g3 + g2/2 + 32g + 6171. Calculate j(0). 32 Let f(c) be the third derivative of c5/60 + 5c*4/12 - 5c*3 + 64c*2 - 13. What is f(-15)? 45 Let d(z) = -6z*2 - 5z + 1. Let a be d(-1). Let h(l) = -l2 + 3 - 8 - 5 + l - 7. Calculate h(a). -17 Let u be 13 - (2 - 6/(-3)). Let w(k) be the third derivative of -k4/24 + 13k3/6 - 6k*2 + 3. Calculate w(u). 4 Let d(v) = 9v*3 - 13v*2 - 26v + 9. Let i(u) = 11u3 - 14u*2 - 26u + 10. Let q(r) = 5d(r) - 4i(r). What is q(11)? -39 Let z(r) = 58r - 13r - 239 - 26r - 13r + 85. Calculate z(26). 2 Suppose 72 = 61n - 73n. Let q be (-24)/(-18)n/(-4). Let w(k) = -2k*3 + 2k*2 - 2k + 1. Calculate w(q). -11 Let u(a) be the first derivative of -a*3/3 + 11a*2/2 - 15a + 3401. What is u(10)? -5 Let a(x) be the third derivative of x*5/60 - 7x*4/24 + 13x*3/6 - 15x*2 + 228. Calculate a(4). 1 Suppose -4i + 5i + 3 = 0. Let y be 12 - 1(i - 100). Suppose -10k + y = 5k. Let r(b) = -b2 + 6b + 3. Give r(k). -4 Let l(o) = -o - 4. Let u(h) = 23h + 15. Let t(z) = 2l(z) + u(z). Give t(3). 70 Let t(i) be the first derivative of -i*4/4 - 16i*3/3 - 13i*2/2 + 29i - 206. Let g be t(-15). Let r(f) = -6f3 - 2f*2 + 1. What is r(g)? 5 Suppose -2n = 18n - 80. Let p be -2(2/n)/(1 + 0). Let k(t) = -4t3 + t2 - 1. Calculate k(p). 4 Let i be 2/(4 + 176/(-40)). Let s(f) = -5 - 2f*2 - 4f + f3 + f2 + 6f2. Give s(i). 15 Let n(h) = 2h + 2h - 7h + 6 + 0h. Suppose -10s - 554 = -604. Calculate n(s). -9 Let b(q) be the second derivative of -q7/840 - q6/72 - q5/120 - q4/6 + 253q3/6 - 343q. Let d(z) be the second derivative of b(z). What is d(-4)? -16 Let a = -246 - -244. Let z be 7/a + 375/(-50). Let v(j) = j*3 + 10j*2 - 11j + 1. Determine v(z). 1 Let j(p) = -7p2 + 11p + 285. Let f be j(7). Let s(z) = -z*2 + 15z + 70. What is s(f)? -6 Let u be -8 - (0 - (-4 + 0 - -8)). Let n(y) = 2y2 - y + 14. Determine n(u). 50 Let w(m) = m2 + 1. Let y(i) = 4i*2 + 3. Let s(z) = 3w(z) - y(z). Suppose 1 + 41 = 7r. Suppose -10n = rn - 32. What is s(n)? -4 Let z(w) = -w2 - w - 21. Suppose -1118d = -1123d + 10. Suppose -dh = -3y, 2y + 0h + 4h = 0. Determine z(y). -21 Let t(g) = g*2. Let i(z) = -3z*2 - 7z + 9. Let a(s) = -i(s) - 2t(s). Let w(d) = -d - 53. Let u be w(-45). Calculate a(u). -1 Let c be (-2)/5 + 132/(-20). Let j(y) = -4 - 4 - 11y + 6y + 5. Let d(l) = -4l - 4. Let i(b) = 4d(b) - 3j(b). Calculate i(c). 0 Let s(j) = 66j + 105. Let p(i) = -18i - 35. Let v(d) = 7p(d) + 2s(d). Give v(6). 1 Let d(b) be the third derivative of -b6/180 - b5/24 + b*4/3 + 49b*3/3 - 2b*2 - 15. Let o(f) be the first derivative of d(f). Determine o(-6). -34 Let l = 143 + -141. Let m(i) = 14i*2 - 7i - 3 - 9i2 - 2 - i3 - 11i*l. Determine m(-4). -9 Let y(d) = -5d*3 + 4d*2 + 4d - 1. Let b(m) be the first derivative of 5/2m2 - 3/2m*4 + 13 - m + 5/3m*3. Let x(l) = 4b(l) - 5y(l). Give x(2). 9 Suppose -7 = 22v - 21v. Let w(f) be the first derivative of 11 + 1/2f*2 + 7/3f*3 + 1/4f*4 + 8f. Determine w(v). 1 Let q(d) be the third derivative of -7d4/24 - 23d*3/6 - 25d*2 + 4d + 5. Calculate q(-3). -2 Let m(s) = -35s2 + 9s + 2. Let q(t) = 122t2 - 28t - 9. Let k(x) = -7m(x) - 2q(x). What is k(9)? 22 Let l be (-9)/(-36) + ((-2)/8)/1. Suppose -2p + 3 + 45 = l. Let c(r) = 17 - p - r2 + 0r*2 + 9r. What is c(8)? 1 Suppose 0 = -4n - 5f - 21, 3n + 3f + 30 - 18 = 0. Let z(r) be the first derivative of -7/2r2 + n + 1/3r*3 + 9r. What is z(6)? 3 Suppose 8x + 2213 = 2357. Let k(q) = q2 - 20q + 4. Determine k(x). -32 Let x(m) = -45m - 315. Let b be x(-7). Let v(a) = ba + 4a + 3a - 5a - 10. Suppose 0o - 3n = 3o - 24, 5o - 5n - 30 = 0. Give v(o). 4 Let y(q) = -30q2 - 4q + 18. Let d(h) = 15h2 + 2h - 8. Let v(o) = 9d(o) + 4y(o). Determine v(-2). 56 Suppose -3p - 9 = -5o, 2o - 2 + 0 = 2p. Let w(l) = ol + 8 + 3l - 5*l. Let k be 24/28	{ "pile_set_name": "DM Mathematics" }
losest to 2/51? (a) -0.5 (b) 3 (c) -0.6 a What is the closest to 0.1 in 3, -2/15, -13? -2/15 What is the closest to 2/7 in 5/78, 0.3, -0.1? 0.3 What is the closest to 5 in 32/5, -0.3, -0.2, 0? 32/5 What is the nearest to -3/2 in 3/5, -2/9, -3? -2/9 What is the nearest to 1 in -0.9, -0.4, -3/7, -5? -0.4 What is the nearest to -2 in 0, -2/55, -2/3, 0.0153? -2/3 What is the closest to -0.1 in -1, -3, 0, 12? 0 Which is the nearest to -1/3? (a) 1/4 (b) 29 (c) 0.4 (d) 2 a What is the closest to 36 in -3, -0.4, 1/3? 1/3 What is the nearest to 3 in 2/13, -2/13, -0.5, -2/5? 2/13 Which is the nearest to 1/3? (a) 0.4 (b) 0 (c) 0.014 a What is the closest to 6 in -7, 4, -1/5, 1? 4 Which is the nearest to -20? (a) -5 (b) 3/8 (c) 0.5 (d) 1/3 a Which is the closest to -10/3? (a) 0 (b) -1 (c) -0.1 b Which is the nearest to -0.1? (a) -5 (b) 1 (c) 74 b Which is the closest to -2? (a) 4 (b) -0.2 (c) -2 (d) -15 c What is the nearest to -1 in -9, -1/2, 1/12? -1/2 What is the nearest to 0.1 in -3/2, 0, -3/14, -2? 0 Which is the nearest to 1/4? (a) -0.4 (b) 1 (c) -4/7 a What is the closest to 0.4 in 2/13, -5, 2/15? 2/13 What is the nearest to -1 in 24, -1/6, 12? -1/6 Which is the closest to 1? (a) -1/4 (b) -245/2 (c) 6 a What is the closest to 0 in 1, 34, 0.4, 0.06? 0.06 What is the closest to -2/1105 in -3/5, -1, 2? -3/5 What is the nearest to 0.1 in -3/10, -71, -0.5? -3/10 Which is the closest to 1/3? (a) -3/2 (b) -13 (c) -2.4 a What is the closest to 0.2 in 1, -3, 0? 0 What is the closest to -2/3 in 0.1, -1, 1/4, 0? -1 What is the nearest to 69 in -7.2, 3/7, 1/4, -2? 3/7 What is the nearest to 1 in -5/2, 3/5, -0.06, 0? 3/5 Which is the closest to -2/7? (a) 5 (b) 0.7 (c) -1 (d) -0.334 d What is the nearest to -3/11 in -3, 0.4, -0.4, -1/2? -0.4 Which is the closest to 2/3? (a) 47 (b) -2/9 (c) -1/8 c Which is the closest to 21? (a) 0.4 (b) 1/5 (c) 1/7 (d) 0.1 a Which is the closest to 0.1? (a) 0.4 (b) 2/9 (c) 11 (d) -8 b What is the nearest to -2 in 0.5, -8, 2? 0.5 Which is the nearest to 0.2? (a) -5 (b) 0 (c) -0.038 b What is the closest to 0.05 in 0.9, -2/3, 3, -0.5? -0.5 What is the closest to 37 in -5, 0.3, -0.5? 0.3 What is the nearest to 1/4 in 1/13, -7/6, -0.5? 1/13 What is the closest to -1 in 1, 0.01, 0.2? 0.01 What is the nearest to 2/5 in -46, -1, 0.03, -3? 0.03 What is the nearest to -0.1 in -3, 0.1, 1.9? 0.1 What is the nearest to -1 in 5, -2, 0.937, 3? -2 Which is the closest to 2/5? (a) 2 (b) -0.3 (c) 4 b Which is the closest to -2? (a) -7 (b) 1/5 (c) -1/69 c What is the nearest to -1/6 in -5, -2/7, -0.3? -2/7 What is the nearest to 1 in 3.3, 2/21, 1/3, 1? 1 Which is the nearest to -6/7? (a) 1 (b) -0.2 (c) 0 (d) 3/7 b Which is the nearest to 0? (a) -1/4 (b) -2 (c) 4 (d) -5 a What is the closest to 0.1 in 1/3, 1/2, 1.5, 3/4? 1/3 Which is the closest to -1? (a) -3/5 (b) -3 (c) 31.8 (d) -0.4 a What is the closest to -6 in 2/13, -0.5, -0.9, 0.4? -0.9 Which is the nearest to 5? (a) 1.3 (b) 0.2 (c) 5 c Which is the closest to -0.05? (a) -0.2 (b) 28 (c) 0.4 a Which is the nearest to -2/3? (a) -11 (b) -2 (c) -3/2 (d) 9.1 c Which is the nearest to 2? (a) -2/19 (b) -7 (c) 0.5 c What is the nearest to 0 in 2/29, -9, -1/20? -1/20 What is the nearest to -2/17 in 3, 0.05, 5? 0.05 What is the nearest to -0.1 in 5, 231, 1/2, -4? 1/2 What is the nearest to -2/7 in 2/19, -6/7, -1.3, 1? 2/19 What is the nearest to 4 in -1.3, 1/2, -0.4? 1/2 What is the nearest to -1/2 in -0.08, 0.3, 6? -0.08 Which is the nearest to 3/2? (a) -0.1 (b) -2 (c) -1.5 a What is the nearest to -2/9 in -3/2, 0.3, 5, -5? 0.3 Which is the closest to 19? (a) 3 (b) 4 (c) -1 b What is the closest to 3 in -0.01, -5, 0.5? 0.5 What is the nearest to -2/7 in 0, 1/10, 6, -2/5? -2/5 What is the closest to 0.13 in 0.3, 2, -3? 0.3 Which is the nearest to 2? (a) -1/7 (b) 1.1 (c) 4 (d) -2 b Which is the nearest to 2? (a) -4 (b) 2 (c) -0.03 b What is the closest to 2 in -0.5, 2/5, -4, 3? 3 Which is the closest to 2? (a) -0.4 (b) -5 (c) -1 (d) -13 a Which is the closest to 103/3? (a) -3 (b) -43 (c) -2/15 c What is the nearest to -0.1 in -1/6, -1/9, -6/19? -1/9 What is the nearest to 17 in -4/9, -3, -0.1, -0.01? -0.01 Which is the nearest to 1? (a) 0.5 (b) 3 (c) 2/3 (d) -2/5 c Which is the closest to 1? (a) -5 (b) 18 (c) 5 (d) 1/2 d Which is the nearest to 0.2? (a) -2/5 (b) 6 (c) 2 a Which is the nearest to 3/2? (a) 2/11 (b) -0.383 (c) -2/3 a What is the nearest to 2/3 in -2.4, -2/7, -0.1, -2/13? -0.1 What is the nearest to 5 in 3, 0.5, -3.7? 3 What is the closest to 5 in 4/5, 2/3, 3? 3 What is the closest to -2 in -3/7, 1/9, -4, -0.3? -3/7 Which is the nearest to 6? (a) -3/7 (b) 4 (c) 1/7 b Which is the nearest to -3? (a) -6 (b) 1/4 (c) 5 (d) -25/2 a What is the nearest to 1 in 4, 189, -1? -1 What is the nearest to -3/2 in 0, 1/2, 0.07, 1/3? 0 What is the closest to -1 in -3, 0.1, -2/77? -2/77 What is the closest to -15/8 in 4, 1/3, -4/7? -4/7 What is the closest to 25 in -132, 2/7, 0.1? 2/7 Which is the nearest to 319? (a) -5 (b) -1 (c) 1/4 c Which is the closest to -0.4? (a) 0.1 (b) 0.3 (c) -3 a Which is the nearest to 2/5? (a) -3/16 (b) -0.1 (c) -3 (d) 5/3 b Which is the nearest to -2/5? (a) 0.1 (b) -0.3 (c) -3/20 b What is the nearest to 0.1 in 4, 1.75, -2/7, 3? -2/7 What is the nearest to -1 in 3, -0.2, -0.08? -0.2 Which is the nearest to 1? (a) 173 (b) 1 (c) 1/3 b What is the closest to -1 in 0.5, 3/113, 0? 0 Which is the nearest to 0? (a) 2/23 (b) 1/8 (c) -6 a Which is the closest to -1/3? (a) 0.4 (b) -25/6 (c) -0.1 c Which is the nearest to 19? (a) -4 (b) -3/2 (c) 0 c Which is the closest to -2? (a) 1 (b) -13 (c) 2/3 (d) 4/11 d Which is the closest to -1/4? (a) 0.5 (b) 3 (c) 1/5 c What is the closest to 2/5 in 3/8, -0.5, 0.2? 3/8 What is the closest to -15 in -9/25, 1, 1/5? -9/25 What is the nearest to 1/5 in -3/7, -2/29, 0? 0 What is the nearest to 0 in -26/9, -3, 6/7? 6/7 What is the closest to -2/3 in -0.2, -126, -2, 5? -0.2 What is the closest to -2/7 in 4, 0.2, 1, 61/5? 0.2 What is the closest to 0.1 in 0.4, 5, 289? 0.4 What is the nearest to 0 in -280, -0.01, 0.2? -0.01 What is the closest to 1/3 in 5, 0, 3/7, -1/3? 3/7 What is the nearest to 0 in 3, -1/3, -2/11, -2? -2/11 Which is the closest to 2/3? (a) 1/9 (b) 2/813 (c) -0.4 a What is the nearest to 0.09 in 1/6, -5, 5, 3? 1/6 Which is the closest to 2? (a) -4 (b) -1/6 (c) 1/4 (d) 5 c Which is the closest to 1/4? (a) 5/4 (b) -2/5 (c) -0.2 c Which is the nearest to -1/7? (a) 2 (b) 0.5 (c) -1 (d) -8/3 b What is the closest to -6/13 in 2, 0.4, 6, 1/4? 1/4 What is the closest to 4 in 5, -1/9, 4, 4/9? 4 What is the closest to -2/7 in 0.08, 9, -3, 2? 0.08 What is the closest to -2 in -2, -2/7, 1/2, 3/8? -2 Which is the nearest to -19.2? (a) -2/7 (b) 0.2 (c) 0.4 a Which is the closest to 11? (a) 0.8 (b) 1/4 (c) 1 c Which is the closest to -0.06? (a) 4 (b) 1 (c) 0.2 (d) 0 d What is the closest to -1/4 in 2/3, 5/12, 0.5? 5/12 What is the closest to 0 in -16, -3/2, 0.054? 0.054 Which is the closest to 0? (a) -2 (b) -6/5 (c) -12/17 (d) 2/7 d What is the closest to 0.4 in 4, 4/7, 6, -1/2? 4/7 What is the nearest to 1/3 in 2/3, -5, -2/9? 2/3 Which is the nearest to -4? (a) 6 (b) 1 (c) -6 (d) -0.4 c Which is the nearest to 6/11? (a) 1/9 (b) -0.4 (c) 1/3 (d) -5 c What is the closest to -1/5 in 5, -2/3, 4, -0.4? -0.4 Which is the closest to -2? (a) 5 (b) -6 (c) 213 b What is the nearest to 1/4 in -0.1, 0.4, 5? 0.4 Which is the nearest to 2/7? (a) 6 (b) -1/6 (c) -3 b Which is the closest to 2? (a) -0.2 (b) -0.01 (c) -4/7 (d) -3 b What is the nearest to 1/3 in 2/5, -1/2, -2/3, 14? 2/5 Which is the closest to -1? (a) 2/5 (b) -6 (c) -14 a What is the nearest to -0.1 in -282, -0.2, 0.1, -0.5? -0.2 What is the closest to -110 in 52/3, -4, 0.1, 1/2? -4 What is the nearest to -2/17 in -1/2, 1, -1/16, 0.5? -1/16 Which is the nearest to 0.01? (a) 0.4 (b) -0.18 (c) -3 (d) -2 b What is the nearest to 1 in -2, -4/17, -4? -4/17 Which is the nearest to 4/11? (a) 5 (b) 5/2 (c) -3 (d) 0.3 d What is the closest to 3 in -1/5, 10, -0.3, 0.3? 0.3 What is the nearest to -	{ "pile_set_name": "DM Mathematics" }
Collect the terms in -158u2 - 46u + 81u2 + 72u*2 + 2 + 12u*3. 12u*3 - 5u*2 - 46u + 2 Collect the terms in -28 + 40 + 371335d - 17 - 371336d. -d - 5 Collect the terms in -6z - 7z - 19z + 56 - 15. -32z + 41 Collect the terms in 6m + 2184 - 834 - 675 - 675. 6m Collect the terms in -9k - 1660 - 1668 + 4418 - 1090. -9k Collect the terms in -182438 + 365954 + 6x3 - 183516 + 2x*3. 8x*3 Collect the terms in -2091f*2 - 578f + 1250f2 - 6943f*2 + 578f. -7784f2 Collect the terms in 980345 + 51v*2 + 5v*2 - 980360. 56v*2 - 15 Collect the terms in -192241s - 194109s + 386340s. -10s Collect the terms in -13s + 4455508s3 - 4455539s*3 - 12s + 25s. -31s*3 Collect the terms in 6267w - 21576w + 7141w + 6786w. -1382w Collect the terms in 462 - 462 - 31126s2. -31126s2 Collect the terms in 13 + 22 + 3 + a2 + 18 - 6 + 6. a*2 + 56 Collect the terms in 13 - 103g - 363g + 133g - 493g. -826g + 13 Collect the terms in 15095x2 - 4 + 4 - 15552x*2. -457x*2 Collect the terms in -166273193256n*2 - 2 + 2 + 166273193265n*2. 9n*2 Collect the terms in -130o*2 - 4o - 8o + 5o + 5 + 7o. -130o*2 + 5 Collect the terms in -67i*3 + 442i*2 - 442i*2 + 261i*3 + 408i*3. 602i*3 Collect the terms in -13054 - 17z*2 - 26z*2 + 39z*2 - 13048 + 26102. -4z*2 Collect the terms in 230u + 2547u + 1089u - 9713u - 9845u. -15692u Collect the terms in 95o*2 + 598o - 5 - 5 + 4o3 + 12 - 6o*3. -2o*3 + 95o*2 + 598o + 2 Collect the terms in 240 - 8706 + 1610 - 3u + u. -2u - 6856 Collect the terms in 3508h - 7066h + 3500h. -58h Collect the terms in -1812241 + 164d3 - 69d*3 + 1812241. 95d*3 Collect the terms in 0b*3 - 40b*2 + 7b*3 - 394 - 7b*3 + 39b2 - b3. -b3 - b2 - 394 Collect the terms in -3894649t2 + 1947330t*2 - 44 - 20 + 1947321t*2. 2t*2 - 64 Collect the terms in 405793a - 103282a + 95892a - 127152a + 548915a. 820166a Collect the terms in -3 - 5 + 1 + 69157s. 69157s - 7 Collect the terms in -1754271p*2 - 1754258p*2 + 3508505p*2. -24p*2 Collect the terms in 44680 - 14894 - 1111d*3 - 14891 - 14895. -1111d*3 Collect the terms in 326116f + 7f3 - 326116f + 380f3. 387f*3 Collect the terms in y - 22y*2 + 72 + 2y*3 + 5y*2 - 5y*2 - 16. 2y*3 - 22y*2 + y + 56 Collect the terms in 49698b*3 + 66 + 74 - 140. 49698b*3 Collect the terms in -66c + 2 + 9c2 - 285c3 + c2 + 286c3. c3 + 10c*2 - 66c + 2 Collect the terms in -13 - 246398w + 246397w + 32 - 19. -w Collect the terms in 9 - 8481v - 9 + 3 + 0 - 1. -8481v + 2 Collect the terms in 480 - 759 + 87 + 5g2 + 84 + 108. 5g*2 Collect the terms in 26q*2 - 18620q + 2q3 - 5 + 7 + 3 + 0. 2q*3 + 26q*2 - 18620q + 5 Collect the terms in -76m + 0m*3 + 62m - m*3 - 4m*3 + 15m + 15. -5m3 + m + 15 Collect the terms in 27 - 5 + 360l - 13 + 62l - 9. 422l Collect the terms in -68 + 129 + 11d - 72 - 3d + d - 4d. 5d - 11 Collect the terms in 45 - 594d3 + d2 + 36d3 - d2 - 47. -558d3 - 2 Collect the terms in -297 + 234d + 588 - 294 + 36d + 86d. 356d - 3 Collect the terms in 0n + 2n + 221134205800n*2 - 221134205803n*2. -3n*2 + 2n Collect the terms in -880r2 - 522r*2 - 498r*2 + 579r*2. -1321r*2 Collect the terms in -80 + 48499k + 231 - 151 - 6765k. 41734k Collect the terms in 235y3 + 254y*3 - 1135y*3 + 307y*3 + 249y*3. -90y*3 Collect the terms in 467956m*2 + 449060m*2 - 917020m*2. -4m*2 Collect the terms in 8051b - 16286b + 7692b. -543b Collect the terms in -77w - 71w + 15w + 50w. -83w Collect the terms in -964 + 372 - 3f + 5f - 4f + 0f. -2f - 592 Collect the terms in 700791u*2 - 39u*3 - 1401595u*2 + 700804u*2. -39u*3 Collect the terms in -7o*3 + 1095820236093951 - 1095820236093951. -7o*3 Collect the terms in 101h + 48h + 395h - h*2 + 277h - 339h. -h2 + 482h Collect the terms in 30977p + 15 - 30977p - 12 + 372p2 - 3. 372p*2 Collect the terms in -47t*2 + 84t*2 + 13074t - 41t2. -4t*2 + 13074t Collect the terms in 8599m - 2869m - 2866m + 76m*3 - 2864m. 76m3 Collect the terms in -118 + 26 - 27210i*3 + 92 - 19705i*3. -46915i*3 Collect the terms in 15470y*2 + 15466y*2 - 46404y*2 + 15468y*2 - 116y*3 + 14y*3. -102y*3 Collect the terms in 4 - 631096b - 4 + 4107986b. 3476890b Collect the terms in 15653 - 1120d2 - 15653 + 823d*2 + 2d*3 + 297d*2. 2d*3 Collect the terms in -119v + 116v + 157v + 12v + 165v. 331v Collect the terms in 200 + 0g2 - g2 + 14 - 41 + 34. -g*2 + 207 Collect the terms in -54i + 11i - 6i + 14i - 73i - 22i. -130i Collect the terms in 1019 - 65l2 - 1023 - 14l*2 + 20l*2 + 22l*2. -37l*2 - 4 Collect the terms in -5a*3 - 66198 + 66196 + 62a*2 + 8a2 + a2. -5a3 + 71a*2 - 2 Collect the terms in -188 - 162 - t + 565 - 173. -t + 42 Collect the terms in 3816d + 15053d + 33414d - 13180d. 39103d Collect the terms in -66954y2 + 13761y*2 - 42601y*2. -95794y*2 Collect the terms in 142876h*2 - 428598h*2 + 142860h*2 + 142860h*2. -2h*2 Collect the terms in 92g - 52g - 66g - 27g - 61. -53g - 61 Collect the terms in -655x3 + 255 - 244x*3 + 251 - 504. -899x*3 + 2 Collect the terms in 15q*3 - 3q*2 + 316578084 - 316578084 - 4q*2. 15q*3 - 7q*2 Collect the terms in 118d*2 - 8608d*3 - 117d2 - d2. -8608d3 Collect the terms in 319g + 0g2 - 107g + 2g2 + 0g*2 - 97g - 115g. 2g*2 Collect the terms in 37l + 11 + 2l2 - 172l + 552 - 84l. 2l*2 - 219l + 563 Collect the terms in 119 + 99631n - 99631n - 2n2 + 3n2. n2 + 119 Collect the terms in a*2 - 143989911 - 143989911 + 287979822 + 2a. a*2 + 2a Collect the terms in 73900638z2 + 7z*3 - 73900638z*2. 7z*3 Collect the terms in -24 - 8 + 52 - 15f*3 - 5f*3. -20f*3 + 20 Collect the terms in -1954128i*2 + 977053i*2 + 977052i*2. -23i*2 Collect the terms in -4943000 - 3u*3 - 60u + 4943000. -3u3 - 60u Collect the terms in 79t - 319t + 48t + 346t - 3 + 3. 154t Collect the terms in -4353l - 7080l + 298l. -11135l Collect the terms in 7797072244277r - r*2 - 7797072244277r + 6r3 + r2 + 0 + 0. 6r*3 Collect the terms in 26 - 109 + 630w + 27 + 26 + 26. 630w - 4 Collect the terms in 687654 - 687654 - 1024n + 520n + 515n. 11n Collect the terms in 1095n - 353n - 373n - 352n + 2 - 45n. -28n + 2 Collect the terms in 517t*3 + 540t*3 - 422t*3 + 2650t*3. 3285t*3 Collect the terms in -1146t*2 - 1171t*2 - 1145t*2 + 5785t*2 - 1149t*2 - 1160t*2. 14t*2 Collect the terms in 1360m + 28464m3 - 3091m*3 - 1360m + 16357m3. 41730m*3 Collect the terms in 1459985v*3 + 404587v*3 - 225963v*3. 1638609v*3 Collect the terms in -188 + 573 + 386k - 192 - 192 - 415k. -29k + 1 Collect the terms in 4943c2 + 23c*3 - 36c*3 + 6 - 2458c*2 - 2485c*2. -13c*3 + 6 Collect the terms in 2324v*2 + 868844v - 434420v - 177v*2 - 434424v. 2147v2 Collect the terms in -24870772280 - 24o*2 + 24870772280. -24o*2 Collect the terms in y + 6718 - 6753 - 5y + 243y3 + 4y. 243y3 - 35 Collect the terms in -239 + 4958t + 234 + 6015t. 10973t - 5 Collect the terms in -39256l - 5 - 11302l + 4. -50558l - 1 Collect the terms in 43r*2 + 55r*2 + 10r - 354r2 + 274r*2. 18r*2 + 10r Collect the terms in -145l + 8l + 35l - 219l + 20l. -301l Collect the terms in 1570 - 39x + 1564 - 3132 - x2. -x2 - 39x + 2 Collect the terms in 198q2 + q - 12q*2 + 0q + 12q3. 12q*3 + 186q*2 + q Collect the terms in 468x - 1020x - 4853x + 242x - 3030x. -8193x Collect the terms in -1 + 333101c*2 + 6c + 1 - 11c. 333101c*2 - 5c Collect the terms in 3163t2 - 1 - 3163t*2 + 19t*3. 19t*3 - 1 Collect the terms in 763n*3 + 471n*3 + 760n*3 - 1986n*3. 8n*3 Collect the terms in -10s + 330058721 + 26s + 5s*3 - 11s - 330058721 - 5s. 5s3 Collect the terms in p3 - 3780p2 - 1351p*2 - 947p*2 + 371p2 - 1. p3 - 5707p2 - 1 Collect the terms in 612862o*2 + 9 - 9 + 3830701o*2. 4443563o**2	{ "pile_set_name": "DM Mathematics" }
ters picked without replacement from eikuciekqik. What is prob of sequence ek? 3/55 Two letters picked without replacement from trrrkrtjjwwwkjwwxjtw. What is prob of sequence tj? 3/95 Calculate prob of sequence zf when two letters picked without replacement from {x: 1, b: 1, e: 1, f: 1, z: 1}. 1/20 Two letters picked without replacement from zzazaaz. Give prob of sequence zz. 2/7 Calculate prob of sequence pp when two letters picked without replacement from ppp. 1 What is prob of sequence mmm when three letters picked without replacement from {z: 1, m: 1, r: 1, l: 1, b: 1}? 0 Three letters picked without replacement from oqooqoononqoqqqoqq. Give prob of sequence oqo. 14/153 Three letters picked without replacement from dhhhdhdhhorrrrdrrhd. What is prob of sequence rrh? 35/969 What is prob of sequence fwww when four letters picked without replacement from wwwwwwwwwwfwwwwwwww? 1/19 What is prob of sequence jw when two letters picked without replacement from {j: 7, w: 2, h: 4}? 7/78 What is prob of sequence zzz when three letters picked without replacement from {g: 4, z: 3, l: 8, p: 4}? 1/969 What is prob of sequence uuuo when four letters picked without replacement from xooxouoouxuuxxoxx? 3/1190 What is prob of sequence on when two letters picked without replacement from dnoddooddyydo? 1/39 Three letters picked without replacement from {k: 5, z: 1, t: 8, u: 2}. Give prob of sequence ukz. 1/336 Two letters picked without replacement from gzgzzzw. What is prob of sequence wg? 1/21 Calculate prob of sequence cs when two letters picked without replacement from szqdzcq. 1/42 Calculate prob of sequence tev when three letters picked without replacement from {e: 2, v: 1, t: 1}. 1/12 What is prob of sequence yo when two letters picked without replacement from {o: 6, y: 4}? 4/15 What is prob of sequence sssq when four letters picked without replacement from {b: 2, s: 4, t: 4, q: 2}? 2/495 What is prob of sequence ry when two letters picked without replacement from srzzqqyw? 1/56 Calculate prob of sequence fgi when three letters picked without replacement from fiifgeigi. 2/63 Four letters picked without replacement from {f: 1, i: 6, s: 1, q: 7}. Give prob of sequence siif. 1/1092 What is prob of sequence dm when two letters picked without replacement from {d: 3, t: 8, m: 2, h: 5, z: 2}? 3/190 Two letters picked without replacement from jjjjjjjjj. Give prob of sequence jj. 1 What is prob of sequence ho when two letters picked without replacement from ohhwohhhosf? 3/22 Calculate prob of sequence xxc when three letters picked without replacement from {n: 1, d: 1, x: 2, c: 1, j: 2}. 1/105 Three letters picked without replacement from smppsx. Give prob of sequence xpp. 1/60 Two letters picked without replacement from ppfprrrnryrrnylpr. Give prob of sequence fy. 1/136 Two letters picked without replacement from {t: 4, a: 3, e: 2, k: 2, y: 2, v: 2}. What is prob of sequence ky? 2/105 Two letters picked without replacement from {c: 2, l: 1}. What is prob of sequence cl? 1/3 Four letters picked without replacement from mmssszmssszsm. What is prob of sequence mssm? 21/715 What is prob of sequence qgqz when four letters picked without replacement from {z: 2, q: 2, g: 2, o: 2, e: 3, l: 6}? 1/7140 Three letters picked without replacement from nonmcmmommmocmcmm. Give prob of sequence nmc. 9/680 What is prob of sequence eimp when four letters picked without replacement from eipeiiiemi? 1/336 Two letters picked without replacement from ndsdnlmbsddlbn. What is prob of sequence bm? 1/91 What is prob of sequence fjpc when four letters picked without replacement from pfxffqxfccffppfpxxj? 7/11628 Calculate prob of sequence iwvv when four letters picked without replacement from {v: 2, i: 1, m: 1, w: 2}. 1/90 Four letters picked without replacement from luhuuluhllllsl. Give prob of sequence hslh. 1/1716 What is prob of sequence reee when four letters picked without replacement from eeeeeeeeeeerrr? 45/364 Calculate prob of sequence fsx when three letters picked without replacement from xfmnssn. 1/105 Calculate prob of sequence pg when two letters picked without replacement from ppgpegpv. 1/7 Two letters picked without replacement from {h: 1, v: 3}. Give prob of sequence vv. 1/2 What is prob of sequence aayt when four letters picked without replacement from yassasatkdktas? 1/1001 Three letters picked without replacement from qqpaq. Give prob of sequence qap. 1/20 What is prob of sequence yy when two letters picked without replacement from {g: 2, y: 7, a: 2}? 21/55 Two letters picked without replacement from eefpfefdefofy. Give prob of sequence do. 1/156 What is prob of sequence xx when two letters picked without replacement from {x: 2, e: 1}? 1/3 What is prob of sequence mu when two letters picked without replacement from mmummmuuummmu? 10/39 Two letters picked without replacement from qzzsnoqszooslno. What is prob of sequence zl? 1/70 Two letters picked without replacement from qsggrcuussu. What is prob of sequence rq? 1/110 What is prob of sequence bw when two letters picked without replacement from ubvbbubwtt? 2/45 What is prob of sequence wwww when four letters picked without replacement from {w: 7}? 1 Calculate prob of sequence nbn when three letters picked without replacement from {v: 1, n: 2, b: 1}. 1/12 Calculate prob of sequence xb when two letters picked without replacement from bbxx. 1/3 What is prob of sequence vvsv when four letters picked without replacement from dvsddvaaxvxdxxxvxddx? 1/4845 Calculate prob of sequence yvw when three letters picked without replacement from qvwcywvvqqe. 1/165 Calculate prob of sequence fsfs when four letters picked without replacement from qvffqsfsqfqff. 1/286 Three letters picked without replacement from {r: 5, q: 1, x: 1, t: 3}. Give prob of sequence ttt. 1/120 Calculate prob of sequence gggg when four letters picked without replacement from {g: 4, q: 2, y: 12, z: 2}. 1/4845 Two letters picked without replacement from gllpxxy. What is prob of sequence py? 1/42 What is prob of sequence pr when two letters picked without replacement from ojrprrkrjjrjjrrjj? 7/272 Two letters picked without replacement from nnnnnnnnn. Give prob of sequence nn. 1 What is prob of sequence hhdt when four letters picked without replacement from htkhhdhhhkhhdkhthd? 1/136 Calculate prob of sequence xv when two letters picked without replacement from vxxvixihihx. 4/55 Two letters picked without replacement from {f: 4, j: 1, n: 4, m: 5, s: 1}. Give prob of sequence mj. 1/42 Calculate prob of sequence stkk when four letters picked without replacement from ktsskss. 1/105 Four letters picked without replacement from dawmrwaradmmmab. Give prob of sequence mrrw. 2/4095 Three letters picked without replacement from pchhpchcchchhpp. What is prob of sequence hcp? 4/91 Three letters picked without replacement from {z: 10}. What is prob of sequence zzz? 1 Calculate prob of sequence vvsb when four letters picked without replacement from {b: 2, s: 2, v: 8}. 28/1485 Two letters picked without replacement from {q: 5, x: 3, k: 2, c: 2}. What is prob of sequence qk? 5/66 Two letters picked without replacement from rrsrrrrsrrrr. Give prob of sequence ss. 1/66 Four letters picked without replacement from {z: 2, c: 6, m: 1, b: 7, f: 1}. What is prob of sequence mfzb? 1/4080 Four letters picked without replacement from {i: 4, t: 2, a: 1, e: 2, q: 5, l: 1}. What is prob of sequence tetl? 1/8190 What is prob of sequence iigg when four letters picked without replacement from ggggigigggggiggggggg? 4/285 Four letters picked without replacement from nzzzpzzzzzxzxzzxxzn. What is prob of sequence xnpn? 1/11628 Three letters picked without replacement from hhwhtiwwwwgte. Give prob of sequence twg. 5/858 What is prob of sequence llvv when four letters picked without replacement from {l: 3, v: 1}? 0 Three letters picked without replacement from ksskkkskkkkkse. Give prob of sequence kke. 3/91 Calculate prob of sequence prp when three letters picked without replacement from pppppppppprpppp. 1/15 What is prob of sequence ssj when three letters picked without replacement from saajsasj? 1/28 Calculate prob of sequence kkh when three letters picked without replacement from gskhk. 1/30 Two lett	{ "pile_set_name": "DM Mathematics" }
- 12.488. Let g = 261 - 243. Let b = y + g. Round b to the nearest integer. 6 Let m = -699866621.180319344 - -699866616. Let l = -449.180359944 - m. Let c = l + 444. Round c to five decimal places. -0.00004 Let n = -4065145473.405175002 + -0.594824998. Let a = n + 4065145301.7000711. Let s = a - -172.3. Round s to 5 dps. 0.00007 Let u = -0.4396 + -0.4984. Let d = 117 + -117.122. Let s = u + d. What is s rounded to the nearest integer? -1 Let x = 0.022688 + 0.31525. Round x to two decimal places. 0.34 Suppose 5b = 2r + 138405, 5r + 6b - 3b = -345935. What is r rounded to the nearest ten thousand? -70000 Let y(n) = -3n + 18. Let l be y(7). Let p = 8 + l. Suppose pu - 23 + 145 = -4a, 25 = -u - a. Round u to the nearest ten. -20 Suppose -9x + 145 = 28. Suppose xh - 18h - 3500 = 0. What is h rounded to the nearest one thousand? -1000 Suppose 214624 + 1115926 = -38k - 808850. Round k to the nearest one hundred. -56300 Let y = 5397.1 - 5968. Round y to the nearest one hundred. -600 Let o = -137840 - 493360. Round o to the nearest ten thousand. -630000 Let d = 16112957507 - 16112957498.909999499. Let q = d - 8.09. Round q to 7 decimal places. 0.0000005 Let m = -6103 - -6103.0000017455. Round m to 7 dps. 0.0000017 Let w = 18.8964806 + -18.893. What is w rounded to 5 dps? 0.00348 Let w(o) = 523o2 + 36o + 76. Suppose 0 = -7b - 7 + 161. Let r be w(b). Round r to the nearest ten thousand. 250000 Let y(d) = 1588d*3 - 6d*2 + 5d + 1. Let l(p) = p3 - p2 + p. Let g(z) = -4l(z) + y(z). Let i be g(1). Let c = -3016 - i. Round c to the nearest 1000. -5000 Suppose 0 = 4s + 282 + 274. Suppose -42 = -u - 4c, u - 86 = -2u - 4c. Let f = u + s. Round f to the nearest 10. -120 Let s = 6367 + -4328.6. Round s to the nearest ten. 2040 Let l = -0.136 - 175.864. Let u = -177.41 - l. Let n = 0.44 + u. What is n rounded to one dp? -1 Let v = -138.63 + 138.62946042. What is v rounded to 4 decimal places? -0.0005 Let o = 34710 - 34709.99999904956. What is o rounded to seven dps? 0.000001 Let v = -5317.94562 + 5318. Round v to 3 dps. 0.054 Let w = -20.58 - -19.9. Let x = 0.6667 + w. What is x rounded to three dps? -0.013 Let x = -302321.3524 - -302230. Let d = -91.2 - x. Round d to 2 dps. 0.15 Let y = -16 + 50. Let t = -28 + y. Let r = -5.99999997 + t. What is r rounded to 7 dps? 0 Let i = -88738.9944 + 88774. Let u = -6.9 - -41.9. Let f = i - u. Round f to three decimal places. 0.006 Suppose 5568774 = -p - 57226. What is p rounded to the nearest 100000? -5600000 Let i = 13980523.00572 - 13981075. Let l = i + 552. What is l rounded to 4 dps? 0.0057 Let u = -1217.525 - -0.525. Let q = u - -1226.43. Round q to 0 dps. 9 Let l = 314.28 + -296. Let x = l + -32.6. What is x rounded to the nearest integer? -14 Suppose -16c - 7c + 32c = 84105. Round c to the nearest 1000. 9000 Let r(t) = 22315t2. Let k be r(-2). Let a = 97760 - 48054. Suppose -n - 3d = -a, -10132 - k = -2n + 4d. What is n rounded to the nearest 10000? 50000 Let s = 3120.864 + -3188. Let l = -0.036 - s. What is l rounded to the nearest integer? 67 Let y = -91.15444103 + 91.155. Round y to 5 decimal places. 0.00056 Let v = 96491764 - 96491764.079301009. Let j = -0.0793 - v. Round j to 7 dps. 0.000001 Suppose -147 = 7q - 483. Let j = q + 13. Suppose 3n + 2l - 184 = 7, -j = -n - 2l. What is n rounded to the nearest 10? 70 Let i = 562 - 561.9048. Let c = -0.095198985 + i. Round c to 7 dps. 0.000001 Let z = 5901 - 5901.062248. What is z rounded to four decimal places? -0.0622 Let a = 10703527461 - 10703527523.99999999. Let m = 61.6 - -1.4. Let t = a + m. Round t to seven dps. 0 Let y = -0.1180845 - -0.11851. What is y rounded to 6 decimal places? 0.000426 Let g be -500(-240)/(-540)65034/4. What is g rounded to the nearest 100000? -3600000 Let g = -3710.767 - -3728.9. Round g to zero dps. 18 Let x(r) = 30r2 - 8r + 51. Let v be x(16). What is v rounded to the nearest 100? 7600 Suppose 126b = 75b + 337288500. What is b rounded to the nearest ten thousand? 6610000 Let h = -1651.3539 + 0.3539. Let z = h + 1650.99997723. What is z rounded to six decimal places? -0.000023 Let i = 263171218.00839 - 263172307. Let t = 1089 + i. Round t to three decimal places. 0.008 Suppose 24u = 157u - 208810000. Round u to the nearest one million. 2000000 Let k be ((-8213220)/(-270))/(3/(-90)). What is k rounded to the nearest ten thousand? -910000 Let c = -467540097348.17 + 467559817117.769649. Let b = -19719160.6 + c. Let m = 609 - b. Round m to 5 decimal places. 0.00035 Let f(t) = -31t + 11. Let n(x) = 1. Let m(y) = f(y) - 6n(y). Let v = -234 + 237. Let w be m(v). Round w to the nearest ten. -90 Let f = 20488067 + -20487794.99758. Let a = -824 + 552. Let v = a + f. What is v rounded to 3 decimal places? 0.002 Let b = 634.9623 - 635. Let q = -22.8623 + b. What is q rounded to the nearest integer? -23 Let u be 3/5 - (-24)/10. Suppose -4q + uq + p = -6970006, 0 = -2q - 5p + 13939984. Let w be q/17 - (-8)/(-68). Round w to the nearest 100000. 400000 Let g = 6.7372 - 23.09. Round g to zero decimal places. -16 Let n = -1941821 + 2739522. Let i = n - 375701. What is i rounded to the nearest 100000? 400000 Let r = 9.96662 + -10.12. Round r to 3 dps. -0.153 Suppose -27o - 80205937 + 1205723769 = 77080832. What is o rounded to the nearest one hundred thousand? 38800000 Let c = -6.60962 - 1154.62638. Let x = c + 1161.7059749. Let r = 0.47 - x. What is r rounded to 6 decimal places? 0.000025 Let y(p) = 2p + 47. Let j = 76 + -98. Let t be y(j). Suppose -u = tu + 136000. Round u to the nearest 10000. -30000 Let z = 119.096 + -120. Let d = z + 0.9039114. What is d rounded to 6 dps? -0.000089 Let j = 1173370.9084 - 1172795. Let m = j - 576. Round m to 2 dps. -0.09 Let l = -25390 + 25390.0032566. What is l rounded to four decimal places? 0.0033 Let o = 1824.50261 - 0.00261. What is o rounded to the nearest one thousand? 2000 Let j(d) = 2d*3 - 67d*2 - 34d + 22. Let h be j(34). Let o be 1212199996/h - -22/22. Round o to the nearest 1000000. 55000000 Suppose 0 = v - x - 1845993, 5v = 72x - 77x + 9230035. What is v rounded to the nearest one hundred thousand? 1800000 Let j = -761 + 539. Let o = -16691.7107533 + 16469.71074. Let x = j - o. What is x rounded to 6 dps? 0.000013 Let l(f) = -f*3 - 26f*2 - 27f - 51. Let i be l(-25). Let q be (7 - 2) + i - 248004. What is q rounded to the nearest ten thousand? -250000 Let a(u) = 44u2 - 15u + 29. Let t be a(8). Let v be (t-62)/(39/(-130)). What is v rounded to the nearest 10000? 110000 Let x = 1.3736 + 640.5264. What is x rounded to the nearest 100? 600 Let l = 8089.0042992 + -8089. What is l rounded to 4 dps? 0.0043 Let r = 1578 + -305. Let n = -1273.003004 + r. What is n rounded to four decimal places? -0.003 Let o = 2.01 + -2. Let a = 1961.1099992 + -1961.1. Let m = a - o. Round m to 6 decimal places. -0.000001 Let h = 87.963 + -88. Let m = 4.237 + h. Let i = 4.2034 - m. What is i rounded to 3 decimal places? 0.003 Suppose 0p - 4p = -p. Suppose 2a + 6 = 0, -3a - 3269 = -pt + 2t. Round t to the nearest 1000. -2000 Let n = 77 - 40. Let s = 37.04 - n. Let c = s + -0.04058. Round c to 4 dps. -0.0006 Let n = -5710.9999983252 + 5711. Round n to 7 decimal places. 0.0000017 Let g = 3956.1 - 4135.83. Round g to the nearest ten. -180 Let n = 0.22713 + 410.01287. Let k = n + -403. What is k rounded to 1 dp? 7.2 Let i = 20 + -18. Suppose -620 = 3d + ij - j, 0 = -d - 3j - 204. Let b be d/(-23)74/6. What is b rounded to the nearest 10? 110 Let o(m) = -m*2 - 33m - 12. Suppose -12b + 0b - 84 = 0. Let d be o(b). What is d rounded to the nearest one hundred? 200 Suppose i = -4q + 10850037, -4i + 31631886 + 11768229 = 5q. Suppose -p - 5x = -i, x = 1 + 4. Round p to the nearest 1000000. 11000000 Suppose 2a - 339588 = -5x, 5a + 2x - 7x = 848970. Suppose -133861 = 4m - 5i - 473446, 2i + a = 2m. What is m rounded to the nearest 10000? 80000 Suppose 1412350 = -3b + 5q, 885455 = -3b - 5*q - 526935. Round b to the nearest one hundred thousand. -500000 Let c = -19286 + 74220. Round c to the nearest 100. 54900 Let h = 136.3314 - 0.3314. Let w = 656359118.9999751 - 656359255. Let r = w + h. Round r to 6 dps. -0.000025 Let v = -21 + 153.	{ "pile_set_name": "DM Mathematics" }
aluate -8 + -19 + 45 + -16 + -2 - -59. 59 29 + -23 + 43 + 31 80 106 - (61 - (16 + -1)) 60 What is the value of (-2 - 9) + (-44 + 1 - (-16 - -8 - -15))? -61 What is 61 - (-64 + (33 + -36 - -31))? 97 -4333 - -4284 - (-1 + -54) 6 What is the value of (71 - 150 - -84) + -2 + 1 + -60? -56 Evaluate 38 + (-31 - -1) - -22. 30 55 + -43 - (-22 + (-16 - (-16 + 14))) 48 What is the value of -1 + (8 - 2) - (-1 + 74 + (-408 - -393))? -53 What is -11 + (16 - (7 + (-11 - -14))) - 2? -7 Calculate 14 - (-79 + -40 + 17 - -26). 90 Calculate (-26 - -31) + (-4 - (6 + 4 + -2)) + -45. -52 What is the value of 31 + (48 - (62 + -6))? 23 Calculate -27 - ((-1 + -3 - -2) + 14 - (2928 + -2923)). -34 Calculate (3 - 7 - -5) + (-10 - -17 - (18 - 1)). -9 Evaluate (-15 - ((3 - -2) + 14)) + -4 + 15. -23 What is -1 + 73 + (287 + -272 - (28 + -1))? 60 -20 + 8 - ((6 - 83) + 28) 37 -34 - (2 - (107 - (-42 + 72))) 41 (14 + (-21 - 4) - 52) + (12 - -1) -50 What is 3 + (8 + -17 - -16) - -69 - 16? 63 Evaluate 0 - 165 - (4270 + -4574). 139 Calculate 57 - (9 - 4 - -22) - 36. -6 Calculate (-28 - 0) + (19 - (-9 + 15) - (18 - 12)). -21 Calculate 0 + (-50 - -6) - (-191 + 202). -55 Evaluate 99 + (70 - (-100 + 130)). 139 What is -20 + 2 + 4 + 18 + -2 - -13? 15 What is the value of -24 + 114 - 50 - 53? -13 What is -59 + (156 - 9 - 72)? 16 -36 - (-46 + 3 + 30) - -44 21 Evaluate 0 - 53 - (-366 - -372) - -18. -41 Calculate 72 - ((14 - 1) + (0 - (1 + 23 + -6))). 77 -7 + (4 - 1) - (-130 - -79) 47 66 - (89 - (3 - 10)) -30 What is the value of 4 + -18 + 1 - (-175 - -200)? -38 What is the value of 17 - (-7 + 109 - 5)? -80 -1 + 12 + 6 + 31 + -66 + 78 60 What is (-53 - -56) + -63 + 31? -29 Calculate 1 + -1 - (26 + -47 + 11) - 0 - 32. -22 What is the value of -69 - (-23 + (38 - (-10 - -6 - -26)))? -62 What is (-25 - (-27 + (-22 - (0 + -9)))) + -22? -7 What is the value of 23 - (83 + -28) - -6 - -85? 59 What is (-6 + 14 - (14 - 6)) + -42 + -12 - 8? -62 -6 + (2 - 1) + -328 + 314 - -69 50 What is the value of (2 - 51) + (220 - 211) + (17 - -1)? -22 Calculate 10 - (-12 + -2 + 0 - (-147 - -124)). 1 What is 25 - (3 + -1 - (-69 - -103))? 57 What is the value of 211 + -26 + (-776 - -665)? 74 Evaluate (-57 - 0) + (52 - 15) + -23. -43 Calculate 1 + (0 - -19) + -458 + (752 - 223). 91 Evaluate -2 + 25 + (25 - 20 - 3). 25 Evaluate -304 - -349 - (0 + 11 + 0). 34 What is (-14 - -46) + 98 + (-62 - -29)? 97 What is -5 + (-13 - 9) - (-7 - (4 - (-3 - -4)))? -17 Evaluate (-1 - -6 - -6) + (360 - 360). 11 What is the value of -31 - (-90 + 52) - -38? 45 What is -47 - -17 - 37 - -47? -20 (12 + -22 - -19) + (-8 - (-1 + 4)) - -52 50 What is (-87 - -248 - 243) + -29? -111 2 + 2 + -81 + -181 + 207 -51 What is the value of -7 + -5 + 25 + 6? 19 What is (-104 - (18 + -124)) + 59? 61 Evaluate -22 + (71 - (16 - -9 - 13)). 37 -5 + (64 + -2 - (5 + -16 + -1 + 12)) 57 What is the value of 2 + -4 + 2 - -6 - (77 + -56 + -3)? -12 What is the value of (-4 - ((3 - 20) + -1 + 34)) + 24? 4 Evaluate (-32 - (-50 + 21)) + -15 - 43. -61 What is (-5 - (-26 - -29)) + (4 - 45 - 3)? -52 Calculate -11 - (-18 + (-9 - -14 - -3 - 59)). 58 23 - (23 + -6 + 10 + -42) 38 (-28 - (128 + -131)) + 73 + -1 47 What is the value of (2726 - 2811) + (1 - -40)? -44 Calculate (4 - 6 - 7) + -17 - -57. 31 61 - ((-11 - (14 + -11)) + 28) - 15 32 What is (20 - (3 - 13)) + -64 + 67? 33 Evaluate 7 - 65 - (-38 + 2 - -17). -39 What is the value of 4 - 8 - (8 + 9 - 4 - (3 - -26))? 12 Calculate (2 - 8) + (4 - 3) - (36 + 9). -50 Evaluate -1067 + 1061 + (4 + -8 + 4 - -3 - -124). 121 What is 33 + -28 + -15 + 18 - (-65 + 0)? 73 Calculate -56 + 194 + -73 + 5. 70 (-1 - -120 - 2) + (-1911 - -1930) - (10 + 0) 126 3 + -10 + (-53 - -63) + -58 -55 Evaluate -71 - (-28 + 7 + 14) - -7. -57 Calculate (10 - 144) + 9 + -10 + (-34 - -43). -126 -8 + (8 - (-9 + 12)) - 26 -29 Calculate -4 - (5 - (5 + 1)) - (-2 + -44 + -1). 44 Evaluate (166 - (141 - -28)) + 2 + (1 - -75 - 0). 75 What is the value of -55 + -9 + (42 - -1)? -21 Calculate -38 + -45 + (142 - 78) - (7 - 1). -25 2345 + -2346 - (1 - -92) -94 What is the value of -123 + 0 - (12299 - 12346)? -76 Evaluate 1 + -1 + -56 - (-40 + 25 + 5). -46 111 - (-34 - -98) - 18 29 What is 45 + -53 + -7 + 64? 49 Evaluate -2 - 8 - (7 + -6) - (-94 + 50). 33 Calculate -863 + 856 + (-1 + 1 - (1 - 4) - -42). 38 Evaluate -19 + -21 + (9 - -35). 4 What is the value of (107 - (13 + (8 - 12)) - (28 - 16)) + 2? 88 Evaluate -168 + -15 - (-483 + 357). -57 -42 + 47 - (3 + -35 - (9 - 4)) 42 What is the value of 188 - (381 - 330 - (-1 - -18))? 154 What is the value of -6 + (-4 + -29 + 22 - -11)? -6 Calculate -62 + (-17 - (-24 - (0 + 6 + (-59 - -42)))). -66 Evaluate -13 - (-28 + -1 + 8) - -74 - -7. 89 What is the value of (-14 + 14 - -4) + 9 + 15? 28 What is the value of 43 + (-25 - (29 - 35))? 24 What is (-9 - (-1 + 8 - (-13 - -32))) + -2 + 121? 122 What is 7 - (-7 + ((-10 - -22) + 2 + 7 - 9))? 2 Calculate -6 + -28 - -34 - -13. 13 What is the value of 8 - (-16 + 40 - 35)? 19 What is (6 - (0 + -36 + 17)) + 21? 46 Evaluate (256 - 259) + (5 + 14 - 0). 16 -54 + 130 + 55 + -106 25 What is the value of -5 - -31 - -8 - 17? 17 -1064 + 1086 + (-1 + -2 - -21) 40 Evaluate (8 + 2 - (0 - -1)) + (-9 - (-70 + 15)). 55 (35 + -2 - 90) + 85 28 What is the value of (-23 - -17) + (-3 - -10 - (1 - -3)) + 23? 20 What is the value of (16 - 43) + 15 + 49? 37 2 + (2 - 9) + (16 - (26 - (1 + 28))) 14 Calculate 9 + (-10 + 3 - ((-8 - -11) + 8)). -9 Evaluate -109 + (-13 - (-17 - -2)). -107 What is 35 + 12 + 18 + 8 + -5? 68 Calculate 89 - (106 + -19) - (-7 + -1 - 2). 12 Evaluate 4 + -12 + -1 + 24. 15 What is 25 + (-128 - (-3 - (20 + -13) - -23))? -116 Calculate -12 - -17 - -16 - (-87 + 114). -6 Calculate 2 - (-142 + (-2 - (-32 - -2))). 116 What is the value of (7 - (1 + 5 + -10)) + 9 + 0 + 0? 20 Evaluate (31 + 2 - 40) + -1 + -36 + (-2 - -11). -35 What is -6 + 25 + -11 - (9 + (-3 - -8 - 88))? 82 What is -124 + (109 - (11 + -87))? 61 Calculate -25 + 21 + -10 + (-20 - 2). -36 Evaluate (-163 - (101 + -178)) + 135. 49 What is (6 - (-2 + -6)) + (1 - 44)? -29 What is 159 - (-72 - -127 - 20)? 124 Evaluate -5 + -4 + (-1227 - -1276). 40 Evaluate -138 + (-85 - -26) - -67. -130 -14 - 2 - -40 - 14 - (-8 + 5 + -34) 47 What is (-6 - -81) + -118 + 36? -7 What is 146 + -154 - (-33 + -5)? 30 Calculate -4226 - -4352 - (-2 + 18 + (1 - -1)). 108 What is the value of (5 - (6 + 39 + -18) - -11) + (133 - 0)? 122 Evaluate 133 + -234 - (7 + (-57 - -10)). -61 48 + (-32 - -12) + (30 - 35) 23 Evaluate ((17 - -4) + -2 - (25 - 7)) + 40. 41 -2 + -14 - (28 - 7) -37 Evaluate 4 + (-32 + -3 + -16 - -4). -43 What is (53 + (21 - 33) - 23) + 4 + 2? 24 What is the value of -38 - -155 - (58 - 3)? 62 What is -29 - -78 - 58 - 2? -11 What is the value of -3 + 2 - 3 - 5 - (-44 - 54)? 89 1339 + -1379 + -1 + 25 -16 -2 - ((-7 - -19 - 0) + (-55 - -2)) 39 Calculate -264 - -317 - (19 + -18 - (-2 - 6)). 44 What is (-65 - -114) + -121 + 63? -9 What is 6 + -11 + (-8 + 12 - 7) - 0? -8 What is the value of 51 - ((3 - -47) + (-57 - -30))? 28 What is -101 - (14 + 12 + (-34 - 0))? -93 Evaluate 0 + -9 + (-4 - 9 - 31 - (-80 + 90)). -63 What is (46 - (121 + -65)) + (-1 - (0 - -3)) + 53? 39 -23 - ((-18 - (18 - 14)) + 22) -23 What is the value of (11 + 12 - 10) + (3 - (13 + -2))? 5 What is the value of (-19 + (6 + 0 - 3) - -12) + 38? 34 Evaluate (-89 - -126) + 16 + -78. -25 What is -636 + 695 - (-61 + 17)? 103 What is the value of (-83 - 74) + 135 + -4 + (1 - -59)? 34 What is 3 + (5 + 8 - (2 + 15)) + 38? 37 Calculate 7 + -19 + (5 - (-18 + 19 - (-8 + 1))). -15 Calculate 10 + -7 + 4 + (-6 - 13 - -16). 4 3 + -1 + 1 + -3 + -1 + 41 40 What is -36 - (-2 + -20 + 40 + -37)? -17 Evaluate -1 - ((-13 + 24 - 10) + -14 - 34). 46 Evaluate (-47 + 33 - 11) + -8. -33 What is (0 - -40) + 14 - (4 - (3 + -1 + -3))? 49 What is 0 - -16 - (-23 + 0 + -23)? 62 -46 - 34 - -57 - -71 48 29 - (4 - -1 - (134 + -133)) 25 -9 + (-3 - (3 - 19)) - -14 18 What is -61 + (22 + -5 - 8 - 19 - (4 + -2))? -73 What is (-9 - (-51 - -7) - -3) + 4 + -1 + 2? 43 Calculate 47 + 90 - (117 - 38). 58 What is the value of -11 + 4 + 43 + 24 - 11? 49 Calculate (-2 - (-3 + 12 - (14 - 9))) + 50. 44 What is -2784 + 2798 - (-2 + 1 + 5)? 10 Calculate 17 + 2 + -4 + (-200 - -188). 3 What is the value of -1 + 54 + (14 - (-14 - (20 - 7 -	{ "pile_set_name": "DM Mathematics" }
5 What is (233/10252)/((-1)/(-12))? 3/11 ((-2)/(-6))/(6(-9)/162) -1 Calculate 2/4((-66)/(-9))/(-11). -1/3 What is 3((-66)/(-9))/(-11)? -2 What is 1/(4/(-8)-13)? 2/13 What is (-8)/(-54)(-108)/(-72)? 2/9 What is ((-22)/(-77))/((-5)/(-105))? 6 Evaluate (-6)/43/((-72)/(-16)). -1 What is the value of 0-55/25? 0 What is the value of (-1)/20/(-13)? 0 Evaluate ((-210)/175)/((-3)/10). 4 What is (-9)/(-15)(-6)/(-54)-2? -2/15 What is 33/(-88)(-24)/54? 1/6 Calculate (-18)/150-1510/(-21). -6/7 What is (1/65-4)/((-52)/(-130))? -2/13 What is 65/(-195)90/3? -10 (-5)/((-10)/2)3 3 Calculate (-2)/8(-64)/(-40). -2/5 What is the value of 9/(-3)(-28)/3153? 4/5 Evaluate (76/38)/((-4)/(-10)). 5 Calculate ((-2)/5-3)/((-1)/5). -6 Evaluate (2/4)/((-235)/94). -1/5 What is the value of (-2)/15(400/15)/8? -4/9 Evaluate 3/1(-2)/6. -1 3(16/(-6))/(-8) 1 Evaluate ((-2)/3)/(496/(-93)). 1/8 Calculate (-22)/33189/(-14). 9 What is (-5)/(((-6)/(-8))/(189/(-210)))? 6 What is (15/18)/(-1)3/20? -1/8 What is the value of ((-4)/(-10))/(7/(-35))? -2 What is the value of -814/843/(-22)? 2/11 What is 3/(30/(-4))250/25? -4 What is the value of (17/(-68))/(2/(-24))? 3 (((-27)/(-9))/(-15))/(-1) 1/5 Calculate 28/(-10)(-25)/40. 7/4 What is (-16)/7-728/56? 8 ((-195)/(-650))/(12/(-10)) -1/4 What is the value of (3/(-2))/((-42)/140)? 5 Calculate ((-1)/(9/(-12)))/((-6)/(-27)). 6 What is 35/(-45)-3? 1 Calculate (-4)/4(-10)/(-2). -5 Calculate ((-10)/51)/(-9). 2/9 -3-16/(-54)-18 6 What is ((-6)/2)/(-36)(-160)/120? -1/9 Evaluate -10(-5)/(-30)(-3)/(-1). -5 What is the value of (-2)/3(-12)/(-20)? -2/5 What is the value of ((-3)/(-153))/((-3)/18)? -2/17 What is 18/368/14? 2/7 Evaluate (-34)/(-170)6/3. 2/5 (((-175)/(-14))/(-5))/((-3)/(-6)) -5 Calculate (-1)/232/(-2). 8 Calculate (((-6)/(-4))/1)/((-567)/(-1890)). 5 What is the value of (-12)/(-12)(-10)/45-3? 2/3 ((-2)/(-3))/(6/(-54)) -6 What is ((-13)/130)/(1/(-15))? 3/2 Evaluate (-6)/(-21)9/((-45)/10). -4/7 What is the value of (((-2)/(-3))/(-2))/(76/24)? -2/19 What is ((-6)/((-18)/(-24)-2))/(-3)? -4/3 Calculate 15/4252/(-65). -2/7 Evaluate 1((-13)/52)/((-1)/12). 3 What is 4/49(-70)/60? -2/21 What is (28/(-48))/(-7)4/(-2)? -1/6 What is ((-32)/56)/(24/(-12))? 2/7 ((-9)/(-45)20)/((-2)/1) -2 Calculate 16/1290/24. 5 (((-10)/16)/(-1))/((-265)/(-318)) 3/4 What is ((-2)/(-2))/(21/(-63))? -3 Evaluate 2(14/4)/(-7). -1 Calculate ((-3)/(-3))/(2/4). 2 What is the value of 3/(-45/40-3)? 2 Evaluate (-2)/(40/(-6))8/6. 2/5 What is the value of 18/273/1? 2 2/((-12)/5)54/(-120) 3/8 Evaluate (-1)/((21/3)/28). -4 Calculate (6/(-8))/((-36)/(-24)). -1/2 What is ((-204)/357)/(10/28)? -8/5 Calculate (-216)/96(32/3)/4. -6 Calculate 65/105(-14)/16. -1/4 What is 14/(-4)(-28)/(-14)? -7 Evaluate 4/(-14)56/64. -1/4 (-2)/((-8)/30)(-2)/3 -5 Calculate ((-18)/(-15))/(11/(110/(-3))). -4 Calculate (0/(-1)15/30)/3. 0 What is ((-189)/(-36))/(-21)21? -1/2 What is the value of ((-3)/5)/(16/20)4? -3 Calculate (-1)/((-3)/(-9)15). -1/5 Evaluate ((-16)/28)/((-20)/(-70)). -2 What is the value of (8(-6)/(-72)3)/(-6)? -1/3 What is 6/3621(-12)/(-21)? 2 Calculate (-35/30)/(4/(-40)). 5 Evaluate (50/(-35))/5(-7)/(-15). -2/15 What is the value of ((-3290)/(-60))/(-47)(-6)/14? 1/2 What is the value of (-8)/(-28)7/(-3)? -2/3 6((-18)/(-9))/(-4) -3 What is the value of (-18)/(-8)(-4)/(-1)? 9 ((-7)/((-28)/6))/(-33) -1/6 What is the value of 45/(-25)(-5)/3? 3 Calculate ((-4)/(-6))/((-5)/15). -2 Evaluate ((-22)/66)/((-34)/12). 2/17 Evaluate (-6)/(-3)-225/(-300). 1/3 What is ((-3)/(6/(-28)))/((-18)/(-9))? 7 (((-2)/1)/(-8))/(53/212) 1 What is (-222/(-77))/((-12)/14)? -2/3 (0(-3)/(6/(-2)))/(-2) 0 Calculate ((18/9)/(-6))/(-3). 1/9 (64/360)/(-2)5/6 -2/27 Calculate (12/(-21))/(2/(-7)). 2 What is the value of 4/(-2)19/(-6)? 3 ((-3)/(-12))/(1/(-8)2) -1 Evaluate 12/201/1. 3/5 What is (-3)/92-1? 2/3 What is 5/10(-10)/5? -1 (-20)/34512/(-8) 2/23 Evaluate 6/68((-308)/(-33))/7. 2/17 124/93(-3)/((-2)/(-2)) -4 (-10)/1827/(-45) 1/3 What is 0(-1)/((-8)/(-4))? 0 Evaluate 245/(-162)2/5. -2/9 Evaluate (2/(-3))/(1(-4)/(-3)). -1/2 1/((((-108)/(-8))/9)/(-6)) -4 What is the value of 3/(-15)((-40)/(-6))/4? -1/3 Evaluate (20/15)/((-12)/(-9)). 1 (15/81)/(125/(-150)) -2/9 Evaluate ((-42)/147)/((-8)/140). 5 What is the value of ((-160)/(-6))/1012/(-16)? -2 15/(-6)4/(-2) 5 What is (32/(-24)6/2)/(-1)? 4 What is (18/12)/11/3? 1/2 What is the value of ((-3)/6)/(5/4)? -2/5 What is (-2)/(-12)((-30)/(-4))/(-5)? -1/4 Calculate (32/120)/((-4)/10). -2/3 Calculate (6/(-15))/(-43/30). 1 What is ((270/20)/9)/(15/4)? 2/5 Evaluate (((-4)/(-3))/(-2))/(2/(-12)). 4 Calculate 1488/620(-10)/(-4). 6 What is (-145)/29((-6)/65)/3? 2/13 What is the value of -1(16/8)/(-4)? 1/2 Evaluate -1(-14)/(-7)4/(-10). 4/5 94/(-329)(-7)/29 2/29 Calculate (-212/176)/(6/(-8)). 2/11 Calculate (-1)/(-5)(-1400)/210. -4/3 What is ((-22)/60)/(-11)18? 3/5 What is the value of (-196)/(-147)(6/(-20))/(-3)? 2/15 Evaluate ((-3)/6-3)/((-12)/1). -1/8 Calculate (15/(-24))/512/(-2). 3/4 (-11)/1110/(-2) 5 Evaluate (-5)/(-150)-110/4. -1/12 What is (3/3-5)/(-1)? 5 Calculate 504/(-336)1/3-4. 2 Calculate ((-1)/(-3))/((-49)/(-21)). 1/7 Calculate ((-6)/724)/((-2)/3). 1/2 Evaluate (18/(-81))/((-1)/((-1)/(-1))). 2/9 (((-33)/6)/11)/(2/(-12)) 3 Calculate (((-4)/2)/(-4))/((-30)/(-15)). 1/4 Calculate ((24/(-9))/(-2))/(4/6). 2 What is the value of (-8)/48/(-8)? 2 What is the value of 11/213? 1/7 What is the value of (58/20)/(63/21)? 2/3 What is the value of (((-336)/(-20))/(-7))/((-62)/155)? 6 (30/40)/((-126)/48) -2/7 What is (((-12)/81)/4)/(7/21)? -1/9 (42/8)/(-1) -1 Evaluate (-2)/(-4)3664/(-249). -4 What is the value of (-2)/(4/(-18))(-16)/16? -9 What is (-40)/3218/(-5)? 9/2 What is the value of ((-34)/170)/(12/(-15))? 1/4 Calculate (-90)/(-255)2/(-6). -2/17 What is the value of 10/(-18)((-390)/(-100))/13? -1/6 What is the value of (-27)/613/(351/36)? -6 What is the value of (-1)/((-3)/6)(-21)/14? -3 (4/((-24)/30))/1 -5 Calculate 1/(6/(-288)6). -8 Evaluate 21/288(-2)/(-6). 2 Calculate ((-5)/4)/((-2860)/416). 2/11 Calculate 3((-16)/12)/1. -4 ((-12)/(-10))/((-8)/60-21) 3/7 Calculate (18/4)/((-630)/(-280)). 2 Evaluate (12/6)/((-4)/1). -1/2 What is ((-30)/(-18))/(8/(-24))? -5 What is the value of (-295)/(-118)(-8)/(-50)? 2/5 -750/(-5)(-4)/28 -10 ((-4)/(-18))/(87/2349) 6 What is the value of 1/((-1)/((-9)/(-3)))? -3 (-3)/(12/(-10))8/(-30) -2/3 What is (1-3)/(65/(-13))? 3/5 ((-30)/8)/(-5)48/90 2/5 Calculate ((-7)/42)/((-5)/10). 1/3 What is the value of 112/(-28)14/8? -7 Calculate (4/(-3))/(132/198). -2 Calculate 47/(-308)(-2)/(-1). -2/11 Calculate (-12)/89/6-4. 9 Evaluate 92/(-1265)(-2)/(-4)-5. 2/11 (-6)/(-1)9/((-243)/(-18)) 4 What is the value of (415/(-2324))/(10/(-7))? 1/8 What is the value of (-40)/(-90)(-36)/(-40)? 2/5 (-2)/(-1)3(-4)/12 -2 Calculate (3/(-6)10)/1. -5 Calculate (-15)/(-110)(-24)/(-18). 2/11 Calculate (6/(-10))/((-8)/10)-2. -3/2 What is the value of 11(-10)/(-220)-8? -4 Evaluate (-135)/(-81)6/(-2). -5 Evaluate 3/((-81)/9)-9. 3 Evaluate 1/(-4)(-168)/(-6). -7 What is ((-20)/35)/((-18)/(-63))? -2 Evaluate (0(-2)/10)/(-5). 0 Calculate (-12)/16(-64)/60. 4/5 What is ((-10)/(-6))/(365/(-438))? -2 Evaluate (-1)/((-12)/8)(-27)/(-6). 3 Calculate (2/10)/(18/(-15)-1). 1/6 Evaluate ((-9)/(-27))/(8/6). 1/4 What is the value of 11/(-22)5/((-45)/(-4))? -2/9 What is the value of (-5)/((125/10)/25)? -10 (-6)/1(-4)/8 3 What is (-6)/8(280/(-195))/(-7)? -2/13 Evaluate ((-6)/(-63))/((-3)/(-21)). 2/3 (((-18)/(-10))/3)/(5/25) 3 Calculate ((-804)/(-1005))/((-14)/(-5)). 2/7 What is 30/45(-6)/10? -2/5 What is 4/(-20)5-1? 1 Evaluate -2(-5)/(200/(-8)). -2/5 Evaluate -8(-2)/(-112)1. -1/7 Evaluate ((-6)/15)/(((-6)/15)/(-2)). -2 What is (32/60)/(14/(-21))? -4/5 Evaluate ((-4)/(-18))/(17/306). 4 What is (-15)/10(-1)/18-15? -5/4 ((-6)/4)/((-36)/40) 5/3 What is ((-2)/(-3))/((-2)/48-8)? 2 ((-70)/(-21))/(4/(-6)) -5 Calculate ((14/(-36))/7)/(17/68). -2/9 8/(-8)(-3)/3-1 -1 Evaluate (-18)/15(-30)/(-9). -4 What is the value of -12(-6)/12-1? -6 What is (-9)/4214/123? -3/4 Calculate 4/2015/9. 1/3 What is the value of (-4)/(-18)*(-24)/8?	{ "pile_set_name": "DM Mathematics" }
(a) -4 (b) 0 (c) x b Let w = 0.089 - -0.411. Let a = -2 + 1.5. Let y = a - -0.1. What is the nearest to 0 in 5, y, w? y Let d be 2 + -1 - (1 - (2 + -1)). Which is the closest to d? (a) -0.4 (b) 2 (c) 8/7 c Let x = 8 + -7. Let l = 0.17 - 0.05. Let y = l + 0.08. What is the closest to 2 in x, y, 5? x Let t = 7.7 - 7.8. Let d = 12 + -12.5. What is the closest to t in -5, -2, d? d Let p be -2 - ((-16)/4 - 0). Suppose 4y + 6 = -p. What is the nearest to -0.2 in 4/7, 2, y? 4/7 Let g(b) = 85b3 - b2 + 2b. Let w be g(1). Let c = 431/5 - w. What is the nearest to 0.1 in -1/3, c, -4? c Let t = 31 + -125. Let f = 375/4 + t. Which is the closest to 2/15? (a) f (b) 0 (c) 7 b Suppose -5g + 12 = -3f, g + 9 = -5f - 11. Let s be (-5 - -2)(-6 - 2). Let y be 16/s3/8. Which is the closest to g? (a) -0.4 (b) -1 (c) y c Let j = 0.1 + 0.1. Let p = 3.41 - 2.91. What is the closest to 4 in j, 0.4, p? p Let q = -18 + 17. What is the nearest to q in -0.2, -34, 2? -0.2 Let y = 175/2 - 88. Let q = -23/4 + 6. Which is the closest to q? (a) 0 (b) -1/9 (c) y a Let s = -97.2 + 98.2. Which is the nearest to s? (a) -0.3 (b) -1/5 (c) -3 b Let p = -3.4 - -3.9. Let v = -1.9 + 3.9. Let q = 328/5 + -66. What is the closest to q in 3, v, p? p Let j = 202 + -201. What is the nearest to -0.2 in j, 2/9, 0.5? 2/9 Let x = 10 - 6. Let f be -9 + x + 2 + 2. Which is the closest to f? (a) 5 (b) -0.1 (c) -0.4 c Let q = 0.59 - -2.41. Which is the nearest to 2? (a) 15 (b) -2 (c) q c Let i = -145 + 159. Which is the closest to -1/5? (a) i (b) -1 (c) -0.5 c Let c = 0.89 - -2.41. Let b = 5.3 - c. What is the nearest to 12 in b, -1, 5? 5 Let r = -0.06 - 0.44. Which is the nearest to r? (a) -0.2 (b) 0.5 (c) 0 (d) 0.4 a Let o = 181.26 + 19.14. Let y = o + -200. Let i = 1.5 + -2. Which is the closest to -2/7? (a) y (b) i (c) 3/5 b Let s = 0.4 + 1. Let d = s - 0.4. Let u = -4.28 - -0.28. Which is the closest to d? (a) 0.1 (b) u (c) 1/4 c Let z be 6 + -4 + 4017/(-9). Let l = 456 + z. Let i = l + -12. What is the nearest to i in -3, -2, 0.5? 0.5 Let d = -13 - -15. Let z = -0.07 + 3.07. Let k = z + d. Which is the nearest to 1? (a) k (b) -3/2 (c) -0.05 c Suppose 3u + 3g - 13 = 101, 5g = 2u - 62. Let w be (u/(-495))/((-2)/(-5)). Which is the closest to 0.1? (a) w (b) 5 (c) -1/3 a Let n = 229 + -1141/5. Let t(a) = a + 6. Suppose -i + 2x = 10, -2x - 19 = 2i - 5x. Let m be t(i). What is the closest to m in 0.5, n, 2? 0.5 Let o be (1 - 2) + 48/80. What is the nearest to -1 in -6, -0.5, o? -0.5 Let s = -146 + 148. Suppose 0 = 2u + 3u - g - 35, g + 11 = 2u. Which is the closest to 2/3? (a) s (b) u (c) -3/5 c Let q = -149 - -223. Let y = q + -72. Which is the closest to -3/5? (a) y (b) -0.5 (c) -1/5 b Suppose -4v + 2q + 12 = 0, -v + 6 = v + 5q. Suppose -4i = -5l - 12, -19i + 5l - 9 = -22i. What is the nearest to v in i, -5, -2/5? i Let r be (-2)/((60/20)/((-9)/(-24))). Which is the nearest to r? (a) -3 (b) 2/191 (c) -3/7 (d) -2 c Let k = 56 + -61. Let b = 12.4 - 11. Let g = 1.5 - b. What is the closest to g in -1, -2/13, k? -2/13 Suppose -g - 2 = -2q, -3g - 1 = 3q - 4. Let j be (-6)/18 - -3(-35)/(-180). Which is the closest to j? (a) -3 (b) -1/13 (c) q b Let p = -0.0641 - -0.0641. Which is the nearest to 2/7? (a) -1 (b) p (c) 1/8 (d) 0.12 c Let g be 13/(-39) + 13/3. Suppose g - 9 = -w. Let k be (-3)/(-6)(-3)/2. Which is the closest to -0.5? (a) w (b) 0.5 (c) k c Let o = -8.16 + 8. Let a = 4.84 - o. Let k = -0.1 + 0.2. What is the nearest to a in k, -4/3, -2/13? k Let v = -0.3586 + -0.0414. Which is the nearest to 1? (a) -5 (b) 0.87 (c) v b Let w = -3922/9 + 7853/18. Let m = 1 - 5. What is the closest to 2/7 in -2/7, m, w? w Let s be 6/2 - ((-458)/(-154) + 0). What is the closest to s in -2, 1/2, 3/4? 1/2 Let v = -1681/11 - -153. Which is the nearest to -5? (a) v (b) -3/8 (c) 3 b Let y be 2 - 2 - ((-39)/(-6) + -3). Which is the nearest to -1? (a) -0.4 (b) y (c) -3/5 c Let w = -287.8 - -325. Let v = w + -37. Which is the closest to 2/7? (a) -2/5 (b) 3 (c) v c Let w = 3 + -7. Let g = -20/13 - -232/117. Let j = -3 - -3.2. Which is the nearest to j? (a) g (b) w (c) 0.5 a Let q = 1773.9 + -1772. Which is the nearest to -3? (a) 0.1 (b) 5 (c) q a Let h = 19711/7 + -2816. Which is the nearest to 0.1? (a) -2 (b) 1 (c) -5 (d) h d Let q be 74/1488/22. Let g = -0.2 + 0.3. Which is the nearest to 4? (a) g (b) q (c) 4 c Let z = -0.1 + 0.69. Let x = 0.29 - z. Which is the closest to -1/4? (a) -2 (b) x (c) 2 b Let i = -401/520 + -3/104. Let k = 1/118 - 241/590. Let l be (1/(-9))/((-2)/(-4)). Which is the nearest to -1? (a) l (b) i (c) k b Suppose -7c + y = -11c + 27, -2y = 2. What is the nearest to -1/7 in c, -2/5, 1? -2/5 Let f = 13/315 + 10/63. Which is the nearest to 1? (a) 2 (b) -6 (c) f c Let z = 8 + 3. Let r = z + -12. What is the nearest to 0.2 in -0.4, 4, r? -0.4 Let f = -148 + 147.99. Which is the nearest to 3? (a) -0.2 (b) -0.3 (c) -3 (d) f d Let g = 0.04 - 2.04. Let w = -165.9 + 166.1. Which is the nearest to -0.1? (a) w (b) -2/9 (c) g b Let s = 370 - 366. Which is the nearest to 9? (a) s (b) 3 (c) 0.2 (d) -2 a Let x = -491 - -504. What is the nearest to 2/3 in x, -1, 0.2? 0.2 Suppose -31z - 37 = 6z. What is the nearest to z in 3/4, -1, 7, 0.3? -1 Let r(f) = -f*2 + 18f - 31. Let j be r(16). What is the nearest to -2/5 in j, -3, 4? j Let u be 2/2 + (-1)/2. Let s = 0.26 + -0.32. Let v = s + 1.06. Which is the closest to v? (a) u (b) 2 (c) -3 a Suppose -7 = -u - w - 3w, 2w = 2. Let i = -1898/5 + 380. What is the nearest to i in 3/4, 0, u? 3/4 Let u = 36.8 - 38. Let g = 0.2 + u. What is the closest to g in -0.4, 1/2, -2/51? -0.4 Suppose 6n + p - 9 = 4n, 3n - 16 = p. Let f = -26 + 23. Let v be (4 - (-65)/(-15))/(4/f). Which is the closest to 1? (a) v (b) n (c) 0.1 a Let k = 87 - 90. What is the nearest to 3 in -0.5, 2/3, k? 2/3 Suppose 34w + 282 = 146. What is the nearest to -0.56 in w, -2, 1/5? 1/5 Let x = -2/1193 - -1217/14316. What is the closest to -1 in 5, -2, -2/3, x? -2/3 Suppose -l + 0l - 4 = -3h, 2l = 5h - 8. Suppose g + 4g - 20 = h. Suppose 3 = ga + 19. What is the closest to 1 in a, -0.2, 0? 0 Let z be (-11)/(-13) + (-1)/1. Let j = 3381 - 3383. What is the closest to 1 in z, -1, j? z Let u = 535 - 539. What is the nearest to -1.2 in -0.3, -5, u? -0.3 Let v = 0.3186 - 4.3186. Let g = -5.5 + -0.5. Let u = 9 + g. Which is the nearest to 0? (a) v (b) u (c) -0.2 c Let q = 5/47 - -79/141. Let p be (1 - 2)(0 + 5). Let w be ((-9)/(-10))/((-156)/130). What is the closest to q in p, -0.4, w? -0.4 Suppose -8 = 4o + 4y + 8, 2o + 5y = -2. Let u be o/(-27) - 40/99. Let t = 0.1468 + -0.0468. Which is the nearest to t? (a) u (b) 0 (c) -4 b Let y = 65 + -194/3. Which is the closest to y? (a) 3/4 (b) -10 (c) -0.1 (d) 3 a Let r = 1042 - 1040. Which is the closest to -68? (a) -5 (b) 3 (c) 4 (d) r a Let u(r) = -r2 - 3r - 8. Let t = 14 + -7. Let p be u(t). Let y = p + 236/3. Which is the closest to y? (a) -1 (b) -4/3 (c) 0 c Let w be (-9)/(-2286)1-86. Let j = w + 2/381. What is the closest to -2/3 in j, 0.3, -1/2? -1/2 Let x = -5128768 - -394848078/77. Let a = -8838/11 - x. Let h = -67 + a. What is the closest to 2 in h, -4, 2? 2 Let a = -570 + 570. What is the nearest to a in -4, 0.3, 1, 2/33? 2/33 Suppose p + 8 + 42 = 2g, 8 = -4p. Let k be ((-4)/18)/(g/(-216)). What is the nearest to -12 in k, -1, 3? -1 Let u = -71.8 + 71.8. Let h = -2 + 6. Which is the closest to -2/5? (a) 5 (b) u (c) h b Let d = -0.4513 + -0.0487. Let y = -4.02 - -0.02. Which is the closest to 0? (a) y (b) d (c) 1/9 c Let h be 36/2 + -6(-6)/18. Which is the closest to -20? (a) -2/11 (b) -2 (c) h b Let k(o) = -22o + 2. Suppose 1 = -5b + 6b. Let x be k(b). Let c be (18/(-24))/((-6)/x). What is the closest to c in 2, 0.4, -0.1? -0.1 Let l = 28 - 26. Let d = -61/114 - -2/57. What is the closest to 0.3 in l, d, -2/9? -2/9 Let t = -11 - -40. Let c = t - 34. Let a(j) = -j*3 + 7j*2 - 7j + 5. Let i be a(6). What is the closest to i in 2, c, -1/7? -1/7 Let n = -2.7 - 0.3. Suppose 2*z - 15 = -z. Let b = 5.87 - 6.07. What is the closest to 2/7 in n, z, b? b Le	{ "pile_set_name": "DM Mathematics" }
lacement from {l: 4, b: 4, c: 2, f: 2, q: 1, j: 6}. Give prob of sequence blf. 16/2907 Calculate prob of sequence uhpu when four letters picked without replacement from pduhduuuu. 5/756 What is prob of sequence itt when three letters picked without replacement from tti? 1/3 What is prob of sequence bcba when four letters picked without replacement from bubaduudddcaddau? 1/7280 Calculate prob of sequence ddkq when four letters picked without replacement from bjbqddckc. 1/1512 Three letters picked without replacement from tjttjtjttjjdt. Give prob of sequence ttd. 7/286 Two letters picked without replacement from jjjjjjjjjkjjjjjjjjk. Give prob of sequence jj. 136/171 Two letters picked without replacement from uxxuu. Give prob of sequence xu. 3/10 Two letters picked without replacement from {b: 1, w: 4, d: 3}. What is prob of sequence db? 3/56 What is prob of sequence uu when two letters picked without replacement from {u: 2, o: 3, a: 2, q: 2, h: 2, t: 1}? 1/66 Three letters picked without replacement from {n: 3, s: 4}. Give prob of sequence sss. 4/35 What is prob of sequence tag when three letters picked without replacement from abgfbabggfgtbf? 1/273 What is prob of sequence dkjd when four letters picked without replacement from {b: 1, k: 1, j: 2, c: 2, d: 2, w: 1}? 1/756 Four letters picked without replacement from crmse. What is prob of sequence rmce? 1/120 Four letters picked without replacement from lloolpoplllf. Give prob of sequence flpp. 1/990 Calculate prob of sequence uo when two letters picked without replacement from tbrtout. 1/42 Four letters picked without replacement from dngneeeenhhhgdgnigeg. What is prob of sequence dede? 1/2907 What is prob of sequence pdpy when four letters picked without replacement from ypppddd? 3/140 Calculate prob of sequence pff when three letters picked without replacement from offofpooopdodfp. 6/455 Calculate prob of sequence ncni when four letters picked without replacement from nnnnnnnncnnnnnncniii. 7/646 Calculate prob of sequence sdwq when four letters picked without replacement from jjtdqjdwjdjtjsdsj. 1/7140 What is prob of sequence affa when four letters picked without replacement from {a: 12, f: 3}? 11/455 Two letters picked without replacement from {i: 7, m: 6, c: 4}. What is prob of sequence mi? 21/136 Four letters picked without replacement from {v: 16, j: 4}. What is prob of sequence vvvj? 112/969 Three letters picked without replacement from {b: 3, s: 1, u: 7, r: 3}. Give prob of sequence brs. 3/728 What is prob of sequence rrr when three letters picked without replacement from {i: 2, r: 4, y: 4}? 1/30 What is prob of sequence rgpr when four letters picked without replacement from {k: 1, p: 2, r: 7, g: 2}? 7/495 Three letters picked without replacement from {h: 4, q: 2, n: 2, j: 3, f: 1}. What is prob of sequence qhh? 1/55 Calculate prob of sequence niv when three letters picked without replacement from iiwvnnibnb. 1/80 Three letters picked without replacement from ffjyfjyyffjff. What is prob of sequence ffj? 21/286 Two letters picked without replacement from {a: 2, w: 5, x: 7, k: 3}. Give prob of sequence wa. 5/136 Two letters picked without replacement from {a: 4, e: 2}. What is prob of sequence aa? 2/5 What is prob of sequence www when three letters picked without replacement from {h: 4, w: 14}? 91/204 What is prob of sequence cf when two letters picked without replacement from {c: 2, x: 2, i: 1, f: 2, j: 1, k: 1}? 1/18 Two letters picked without replacement from bpbpbhpb. What is prob of sequence bh? 1/14 Calculate prob of sequence mm when two letters picked without replacement from {z: 9, m: 7, d: 3}. 7/57 What is prob of sequence inpw when four letters picked without replacement from wsijwnp? 1/420 Calculate prob of sequence axx when three letters picked without replacement from xaaxaaxa. 5/56 What is prob of sequence kkkk when four letters picked without replacement from kkkkkkk? 1 Calculate prob of sequence fnfn when four letters picked without replacement from nnnffffffvvffvfffv. 11/1224 What is prob of sequence ttsl when four letters picked without replacement from {l: 1, t: 11, s: 5}? 55/5712 Three letters picked without replacement from {o: 6, j: 2, x: 2, e: 1}. What is prob of sequence ejx? 2/495 Calculate prob of sequence quq when three letters picked without replacement from uubuuquuqbbu. 7/660 Calculate prob of sequence rjnr when four letters picked without replacement from xjixrxjjjnxrr. 1/715 What is prob of sequence ttv when three letters picked without replacement from vvtvttvvvt? 1/10 Calculate prob of sequence rb when two letters picked without replacement from qbgzgrf. 1/42 What is prob of sequence vu when two letters picked without replacement from bjvjjuvuubjbvbv? 2/35 Two letters picked without replacement from lakjljjvkkjjkv. Give prob of sequence kv. 4/91 Calculate prob of sequence pdp when three letters picked without replacement from dpttetddppedte. 1/91 Calculate prob of sequence tt when two letters picked without replacement from {d: 1, i: 1, t: 2}. 1/6 What is prob of sequence gr when two letters picked without replacement from {g: 1, n: 1, e: 1, r: 2}? 1/10 Four letters picked without replacement from tsstitssststtti. Give prob of sequence ssti. 1/78 What is prob of sequence gg when two letters picked without replacement from {q: 2, n: 3, g: 3}? 3/28 Four letters picked without replacement from {d: 2, g: 3, v: 1, n: 1}. What is prob of sequence gvdg? 1/70 What is prob of sequence vv when two letters picked without replacement from vxcv? 1/6 Calculate prob of sequence uw when two letters picked without replacement from {u: 10, w: 2}. 5/33 Four letters picked without replacement from {v: 7, i: 4, n: 1, x: 3, t: 1}. What is prob of sequence invv? 1/260 Four letters picked without replacement from {o: 3, x: 4, g: 2}. What is prob of sequence xxxo? 1/42 What is prob of sequence qbg when three letters picked without replacement from {w: 1, b: 2, q: 1, g: 1}? 1/30 Three letters picked without replacement from {c: 1, o: 2, h: 4, e: 3, q: 6}. What is prob of sequence ceo? 1/560 Four letters picked without replacement from mccisna. Give prob of sequence casc. 1/420 Calculate prob of sequence ccc when three letters picked without replacement from cccccccccc. 1 What is prob of sequence dnd when three letters picked without replacement from ddddddddnddd? 1/12 Calculate prob of sequence jmj when three letters picked without replacement from vjftktfttmfvtkmvvt. 0 Calculate prob of sequence qig when three letters picked without replacement from ittxgttqxqq. 1/330 What is prob of sequence kku when three letters picked without replacement from uuuukk? 1/15 Four letters picked without replacement from {y: 5, f: 1, t: 2, c: 1, a: 8}. Give prob of sequence aaft. 1/510 Calculate prob of sequence gj when two letters picked without replacement from urrggjrjgurgg. 5/78 Four letters picked without replacement from {w: 1, m: 5, a: 1, n: 7, y: 5, g: 1}. Give prob of sequence namg. 7/23256 Calculate prob of sequence oho when three letters picked without replacement from {i: 1, o: 2, h: 2, g: 1}. 1/30 Two letters picked without replacement from wxwwwwxxxw. Give prob of sequence xx. 2/15 What is prob of sequence agg when three letters picked without replacement from aagallgaal? 1/72 Three letters picked without replacement from qqjsewqqwwqwqwjqw. What is prob of sequence qww? 7/136 What is prob of sequence rnn when three letters picked without replacement from {n: 3, r: 4}? 4/35 Two letters picked without replacement from ppdppdpp. Give prob of sequence dd. 1/28 Two letters picked without replacement from {q: 6, w: 1, m: 2, b: 4, v: 4}. What is prob of sequence qw? 3/136 Four letters picked without replacement from {t: 4, r: 2, b: 3}. Give prob of sequence rttt. 1/63 What is prob of sequence qe when two letters picked without replacement from {q: 15, e: 3}? 5/34 What is prob of sequence sss when three letters picked without replacement from {i: 12, s: 6}? 5/204 Three letters picked without replacement from {g: 1, d: 2}. What is prob of sequence gdd? 1/3 What is prob of sequence uym when three letters picked without replacement from mrbbbrbbyrbrmrnunr? 1/2448 Two letters picked without	{ "pile_set_name": "DM Mathematics" }
072. Let u = 97 + -681/7. Which is the closest to r? (a) 2 (b) u (c) -1 c Let f = 0.06 + -0.05. Let d = 0.49 + f. Let w = -158/5 + 31. Which is the closest to w? (a) d (b) -1/3 (c) -3/4 c Let i = 2147/160 + -423/32. What is the closest to 3 in -19, i, -8? i Let o = 2003.4 - 2003.5. Which is the closest to o? (a) -3 (b) 0.124 (c) -5 b Suppose -4h + 0r = 3r - 22, h + 6 = 5r. Let a = -198.99 - -199. What is the nearest to a in -1, h, -0.4? -0.4 Let a = 2/10769 - 22008/2530715. Let s = -139/235 + a. What is the closest to -8 in -3, s, 0.2? -3 Let h = -0.3 + 0.1. Let d = 1682.3 + -1922. Let y = -240 - d. Which is the closest to 0.1? (a) h (b) -2/3 (c) y a Let l = -3.05 - -0.05. Let j(z) = 1. Let i(y) = -2y + 7. Let h(p) = -i(p) - 6j(p). Let g be h(7). Which is the closest to 1? (a) 3/8 (b) l (c) g c Let f(o) = o*2 - 6o - 19. Let x be f(-2). Which is the nearest to 1.7? (a) 0.3 (b) x (c) -0.5 (d) 0 a Let u = -3390 + 23728/7. Which is the closest to u? (a) -7 (b) 2/7 (c) -0.2 c Let t be 10/6((-36)/5)/(-2). Suppose 0 = -4x + v - 3 + 7, 4v = 5x + t. Which is the nearest to x? (a) 0.1 (b) 5/4 (c) 4 b Let n = 5.11 + -5. Let o = -0.01 + n. Let k = -254 - -253. Which is the nearest to o? (a) -2/11 (b) 2 (c) k a Let b = 1255/7 - 179. Let z = -619120 - -619130. Let a be (-2)/2821. What is the closest to b in z, -1, a? a Let x = 0.23 + -0.03. Let s = 8.2 - x. Let v = -2029.1 + 2029. What is the nearest to -2 in s, v, 4? v Let l = -4.02 - 38.08. Let v = l - -42. Let s = 28 - 29. What is the nearest to v in s, -2, 3? s Let m = -3029.6 + 3029.3. What is the closest to m in 0.4, -2/5, 0, -5/8? -2/5 Let j = 0.0566 + -0.5566. Which is the nearest to -1? (a) -14 (b) -1/3 (c) j c Let o(m) = m*3 - 3m*2 - 2m - 7. Let v be o(4). Which is the nearest to 2/3? (a) v (b) -0.26 (c) 1/8 a Suppose 0 = 2j - 5g + 10, 0 = 5g - 9g + 8. Let n be 5/(-20) + (3/12 - j). Which is the closest to n? (a) 0.2 (b) 11 (c) -4 a Let n = -1714721/65 - -342378/13. Let h = -217/5 - n. Let l be 6((-60)/(-24) + -3) - (-30)/8. Which is the closest to -1? (a) h (b) -9 (c) l a Suppose 0 = 4y - 2y + 4. Let t be (7(-6)/210)/((12/(-5))/(-4)). What is the closest to -2/7 in 5, t, y? t Let o = -0.58 - -0.48. Let i = 10.3 - 15.3. What is the nearest to 0 in 4, o, i? o Let n = 0.0896 + -410.0896. Let h = -414 - n. Which is the nearest to -2/9? (a) 5 (b) h (c) 1/4 (d) -2 c Let i(r) = -5 + 7r2 - 8r + 2r - 4r*3 + 3r*3 + 3. Let u be i(6). Let z = -2747/10 - -275. What is the nearest to 2/3 in z, u, -5? z Let g = -12694 - -12693.5. Which is the closest to -2/7? (a) 1/3 (b) -3/4 (c) -381 (d) g d Let n = 44 - 36. Let k be (-4)/n(34 - 1). Let d = 15 + k. Which is the closest to -4/3? (a) 4 (b) d (c) 3 b Let h = 302/41 - 947/123. Which is the closest to 16? (a) -1/5 (b) h (c) 1/2 c Suppose -26m - 93 = -171. Which is the closest to -1/3? (a) -6/7 (b) -0.3 (c) m (d) 96 b Suppose -107o - 89 = 3 + 122. Which is the closest to o? (a) 6 (b) -1/3 (c) -4/91 b Let q = 7 - 7.2. Let x = q - -8.2. Let z be (2/(-7))/((-46)/14). Which is the closest to x? (a) -1 (b) z (c) 0 b Let b be 3(1/11 - 480/(-6336)). What is the closest to b in 4/109, -1/2, 9? 4/109 Let m = 6 - 8. Let s be 74/72 + ((-66)/(-24) - 4). Let u = 109 - 109.4. Which is the closest to 2/7? (a) s (b) u (c) m a Let l = -31746 + 31752. Which is the nearest to l? (a) -2/7 (b) 1/4 (c) 1 c Let i be (-959)/1370(-16)/14. Which is the nearest to 468? (a) -2 (b) 0.4 (c) i c Suppose 8h + 5 = 9h, 0 = 4y + 5h - 25. Let a(k) = -k*3 - 6k*2 + 3k - 10. Let q be a(-7). Let c = q - 9. What is the nearest to y in -4, 1, c? 1 Let a = 23 + -22.8. Let s = 5383 + -5381. What is the closest to -2/5 in -5, s, a? a Let q = -1498.2 + 1500.2. What is the nearest to -0.1 in 2/3, -1/4, 1/19, q? -1/4 Let q = -351.25 + 1.15. Let f = 350 + q. Let s = 40/329 - -1/47. Which is the closest to f? (a) s (b) -2 (c) -4 a Let b = 1.0179 + -0.8179. Let j = 3 + -12. What is the closest to b in j, -2/3, -2/19? -2/19 Let w = -900 + 900.3. What is the nearest to 0 in w, -32, 1/3, 2/5? w Let n = 121/273 - -5/39. Let j = 791.2 - 1131. Let a = 340 + j. What is the closest to -4 in a, n, -3/4? -3/4 Let x = 299 - 159. Let n = 24436 - 24296.3. Let o = x - n. Which is the closest to -4? (a) o (b) -1 (c) -5 c Let o = -5.59 - -5.49. Let q be 31 - 351/57. Let s = -616/171 - q. Which is the nearest to o? (a) s (b) -0.4 (c) -3 b Let p = 236.4 - 236. Let r = 57.68 - -0.32. Let y = r + -56. What is the nearest to -2 in -5, p, y? p Let q = -0.65 - -0.21. Let n = q + 0.04. Let r(m) = 8m - 33. Let d be r(4). Which is the closest to d? (a) n (b) -5 (c) -6/5 c Let q = -19 - -16. Which is the closest to 0.1? (a) 179 (b) -0.1 (c) q b Let w = -158.02 + 160. Let s = w + 0.02. Let o = 765 - 764.6. Which is the nearest to s? (a) -1 (b) o (c) -0.3 b Let s = 21 - 25. Let g be s - -8(-4)/8. Let v be 6 + (g - (-2 - 2)). Which is the closest to -1? (a) -3 (b) 29 (c) v a Let r = -13463.02 - -13463. Which is the nearest to 1? (a) r (b) -0.15 (c) 15 a Let u(v) = v3 + 95v*2 + 99v + 474. Let m be u(-94). Which is the nearest to 3? (a) m (b) -0.001 (c) 0.2 (d) 0.3 a Let s(x) = -x*3 - 4x*2 - x - 3. Let r be s(-4). Let b = -31169 - -31166. What is the closest to -2 in r, b, -0.5, 2? b Let u = -1108/3351 - 3/1117. Which is the closest to -38? (a) 0.4 (b) -2/5 (c) u b Let d = -25903/10 - -12959/5. Suppose w + 5 = 1. Let z = -0.46 - -0.06. Which is the closest to -0.1? (a) d (b) w (c) z c Suppose 0 = 30b + 6 - 96. Suppose -2t + 1 = bx, -3x + 2t = -3t + 34. What is the closest to -6 in 1, x, 2/13? x Let h = -0.06 + -0.44. Let s be 4/5 - (-104)/20. Suppose -2x = 5v + 2, 0 = -2x - sv + 3v - 2. Which is the closest to x? (a) 1/7 (b) 2/9 (c) h c Let l = 4.4 + -4. Let x = 448 - 276. Let r = -167 + x. Which is the nearest to r? (a) -2 (b) l (c) -0.2 b Suppose 15t + 23 = -6t + 2. Let h = -0.1 - 1.9. Let w = h + 3. What is the closest to t in -1/5, w, -7? -1/5 Let k = 0.361 + -0.161. Suppose -g + 5 - 8 = 0. Let z be -1g/(6 - 3). Which is the nearest to z? (a) k (b) 2/3 (c) -0.2 b Let b = 0.9194 - 0.5194. What is the nearest to -5 in 167, 0, b? 0 Let l = 0.412 - 0.512. Let i = 5.56 + -5.26. What is the nearest to l in i, 10, 1, -4? i Let s = 1050 - 1050.28. Let n = 3/46 + -13/23. Which is the closest to s? (a) 3/7 (b) 0.2 (c) n (d) -1/3 d Let i = -22.264 + -2.736. What is the closest to i in -5, 0.4, -1, -2? -5 Let h = -15.6 - 6.9. Let g = h - -26.5. What is the closest to 0.02 in -1/3, -0.2, g? -0.2 Let x = 6612 - 19838/3. What is the nearest to 1 in 2, 12, -5/3, x? 2 Suppose -h - 16 = 3h. Suppose -29227 = 4x + 2u - 29841, 3x - 3u - 465 = 0. Which is the nearest to x? (a) h (b) 5 (c) -2 (d) -1 b Let q be (3 - (-10)/(-3))1. Let t = -8 + 54. Let u = 43 - t. Which is the nearest to 0? (a) u (b) q (c) 0.3 c Let q = -150351/68 - -2211. Let n = q + -127/204. What is the nearest to 0 in -1, n, -7? n Let o = 1.607 + -3.607. Which is the nearest to 3? (a) -5 (b) 0.14 (c) o (d) 0.2 d Let i = 74 + -517/7. Let n = -875.713 - -0.713. Let k = -875.5 - n. What is the nearest to 2/3 in k, 2/7, i? 2/7 Let y = 3.2698 + -3.3298. What is the closest to 8 in -2, y, 1/2, 2/9? 1/2 Let d = -7811 - -7815. What is the closest to 2/167 in d, 2, -0.2, -2/11? -2/11 Suppose s - 2r + 10 = -4s, 10 = -5s - 4r. Let o(k) = 2k + 40. Let d be (-86)/4 - 1/(-2). Let u be o(d). Which is the closest to u? (a) -1 (b) 0.4 (c) s c Let d = -6.0318 - -6.0318. Let y = 362/35 + -51/5. What is the nearest to 0.1 in -41, d, y? y Let v = -0.08089 - -4.08089. What is the nearest to -0.05 in -2/33, -4, -2/5, v? -2/33 Let x be ((-66)/2079)/(1/7). What is the nearest to 507 in x, 0.1, 0? 0.1 Let g = -208.97 + 207. Let x = 0.03 - g. Let l = -9/340 - 143/1020. What is the nearest to 0.2 in -1, l, x? l Let v = 0.08 - -0.02. Let t = -1919 - -1915. Let c = -6.7 + 7. What is the closest to c in t, v, -2? v Let f = 0.06547 + 0.00453. Which is the nearest to -2/3? (a) f (b) 0.4 (c) 3 a Suppose f + 77 = 67. Let r be 2/f-1(-35)/(-35). Let n = 12/7 + -102/35. What is the nearest to n in r, 3/2, -0.2?	{ "pile_set_name": "DM Mathematics" }
6z(a)? 2a*2 Let k(r) = -6r*3 - 5r + 5. Suppose 0 = -17q - 76 - 9. Let t(y) = 6y*3 + 6y - 6. Give qt(x) - 6k(x). 6x3 Let k(r) = -8 + 4r*2 + 77r*3 - 5r2 + r2 - 71r3. Let b(x) = 4x*3 - 5. Calculate -8b(g) + 5k(g). -2g3 Let f(n) = n3 + 4n2 - 2n - 4. Let h(b) = -5b3 - 21b*2 + 11b + 21. Determine 11f(l) + 2h(l). l*3 + 2l2 - 2 Let x(k) = k3 + k*2 + k + 2. Let d(u) = 58u*3 - 5u*2 - 6u - 14. What is -d(o) - 6x(o)? -64o3 - o2 + 2 Let g(m) = -38m3 + 5m + 5. Let a(y) = -874y3 + 114y + 114. Determine 5a(x) - 114g(x). -38x3 Let r(p) = -3p - 3. Let m(i) be the second derivative of -i*3 - 3i*2 - 20i. Determine 4m(a) - 9r(a). 3a + 3 Let z(j) = -9j*2 - 4j + 9. Let r(n) = -29n2 - 11n + 26. Determine -4r(x) + 11z(x). 17x2 - 5 Let k = -327 + 323. Let w(o) = 6o - 2. Let m(h) = 5h - 2. Calculate kw(v) + 3m(v). -9v + 2 Let l be 78/(-13) + (-4)/(-1) - -1. Let o be 5/((-5 - l)/4). Let u(g) = 3g2 + 4g + 4. Let i(a) = a*2 + a + 1. What is ou(c) + 20i(c)? 5c*2 Let r(f) = -11f - 5. Let c(s) = s - 4s - 2s + 2 + 0 + 10s. Suppose o = -0 - 5. Determine oc(b) - 2r(b). -3b Let u(n) = -63n2 - 3n + 187. Let g(s) = 22s2 + s - 63. Give 17g(i) + 6u(i). -4i*2 - i + 51 Let p(d) = -5d*3 - 25d + 16. Let o(i) = -5i3 - 24i + 19. Determine -5o(j) + 6p(j). -5j3 - 30j + 1 Let q be 820/260 - (12/26)/3. Let h(n) = 2n3 - 3n*2 - 3. Let b(j) = -2j*3 + 4j*2 + 4. Determine qb(g) + 4h(g). 2g*3 Let c(b) = 40b*3 + 2b2 + b + 4. Let w(r) = r3 - 1. What is c(p) + 2w(p)? 42p*3 + 2p*2 + p + 2 Let v(s) = -s - 1. Let i be ((-1)/(-5))/((-8)/40). Let y(g) = -7g*3 - 4g - 2. Give iy(a) + 4v(a). 7a3 - 2 Let v(s) = s3 - 4s*2 - 11s - 3. Let l be v(-2). Let c(q) = -3q3 + 5q*2 + 15q. Let h(m) = -4m3 + 7m*2 + 22m. Determine lh(i) + 7c(i). -i*3 - 5i Let l(f) = -35f3 + 11f*2 - 22f - 17. Let s(n) = -12n3 + 4n*2 - 8n - 6. Give -6l(o) + 17s(o). 6o3 + 2o*2 - 4o Let v(h) = -h*3 + 2h2 - h2 + 3h - 4h. Let d = -30 + 33. Let f(c) = -2c2 + 6c*d + 0c*3 - 3c*2 + 0c*3 + 3c. What is f(u) + 4v(u)? 2u3 - u2 - u Let r(y) = 20y2 - 6y - 2. Let w(k) = -k. Determine -r(x) + 8w(x). -20x*2 - 2x + 2 Let p be -1(0 + -4 + -2). Let z = p + -9. Let g(x) = -x - 1. Let h be 64/20(-30)/4. Let a(t) = 9t + 8. Give hg(b) + za(b). -3b Let s(i) = i2. Let k(d) be the second derivative of d5/10 + 3d4/2 + 2d - 35. Calculate k(z) - 12s(z). 2z*3 + 6z*2 Let t(n) = 9n + 11. Let p(r) = -4r - 5. Suppose -2z - 2z = -20. Suppose -3j - 4 = -2o - 2, -2j + 2o = 4. Give jt(v) + zp(v). -2v - 3 Let i(f) = 9f. Let q be 15 - 16264/209 - (-2)/(-11). Let t(o) = -280o. Calculate qi(u) - 2t(u). -7u Let j(a) = a2 - 104. Let n(x) = -35. What is 3j(y) - 8n(y)? 3y*2 - 32 Let d = 30 + -21. Suppose 0 = y + 2y - d. Let b(m) = 1 - ym2 - 3m*2 + 4m - m*2. Let a(k) = 6k*2 - 3k - 1. Calculate 6a(j) + 5b(j). j*2 + 2j - 1 Let x(w) = -2w2 - 6w. Let m(k) = -6k2 - 17k + 1. Give -6m(p) + 17x(p). 2p2 - 6 Let w(b) = 11b - 9. Let p(n) = -11n + 9. Let u(f) = -4p(f) - 5w(f). Let g(j) = 5 - 5j - 1 + 2 - 2. Determine -7g(q) + 3u(q). 2q - 1 Let l(t) = 31t*2 + 3t. Let a(b) = -31b2 - 3b. What is -4a(r) - 5l(r)? -31r2 - 3r Suppose 2s + 3 = 3p, 4s - 2p - 3p = -3. Let y(w) = w3 - 7w*2 + 5w - 5. Let c(k) = 4k2 - 3k + 3. Give sy(b) + 5c(b). 3b3 - b2 Let b(i) = 2i*3 + 3i*2 + 2i. Let p = 1 + 2. Suppose pk + k - 12 = 0. Suppose -10 = -ku + 5. Let a(j) = -3j3 - 4j*2 - 3j. What is ua(h) + 7b(h)? -h3 + h2 - h Let w(r) = 2r - 5. Let u(f) = -19f - 10. Let a(h) = -31h - 14. Let m(x) = 5a(x) - 8u(x). What is -4m(d) - 7w(d)? -2d - 5 Let j(r) = -15r + 6. Let q(y) = -2y + 1. Let m(d) = -j(d) + 4q(d). Let x(k) = 36k - 11. Calculate 11m(f) - 2x(f). 5f Suppose 2g = 2u + 4, -g - 4 = -2u - u. Let p(a) = a + 727 - 365 - 360. Let m(v) = 1. What is up(j) - 4m(j)? 3j + 2 Let y(o) = -5o - 4. Let x(m) = 4m + 2m - 1 + 6. Suppose k + 7 - 4 = -v, 21 = 5k - 4v. Let p be 5 + (-5)/k + -41. Determine py(s) - 3x(s). 2s + 1 Let b(w) = -2w2. Let a(l) = 43l*2 + 48l*2 - 92l*2. Calculate 4a(h) - b(h). -2h2 Let d(n) = -n - 2. Let c(q) = -q2 - 34q - 86. Let h be c(-31). Let w(r) = 2r + 5. What is hd(b) + 3w(b)? -b + 1 Let q(y) = 5y*2 - 2y + 2. Let m(a) = -15a2 + 7a + 142 - 289 + 141. Determine 2m(p) + 7q(p). 5p2 + 2 Let w(c) = -1406c*3 + 6c*2. Let f(y) = 1407y*3 - 5y*2. What is -6f(x) - 5w(x)? -1412x3 Let s(w) = w2. Let d(t) = -2t2 - 112. Calculate -2d(c) - 2s(c). 2c*2 + 224 Let m(n) = 9n*3 - 9n*2 + 7n + 4. Let g(l) = -4l3 + 4l*2 - 3l - 2. Suppose -6o - 29 = 13. Determine og(u) - 3m(u). u3 - u2 + 2 Let v(y) = -34y*3 + 3y*2 - 7y - 15. Let n(j) = 17j3 - 2j*2 + 4j + 8. What is 7n(u) + 4v(u)? -17u3 - 2u*2 - 4 Let r(a) = -61a*2 + 33a*2 + 31a*2. Let q(j) = -4j*2 - 5j*2 + 0j*2. Determine 4q(h) + 11r(h). -3h*2 Let g(r) = -10r + 19. Let k(j) = -19j + 36. Determine -7g(t) + 4k(t). -6t + 11 Let k(c) = 2c2 + 4c. Let a(o) = 7o - 6. Let d(r) = 12r - 10. Let p(u) = -5a(u) + 3d(u). Determine k(y) - 3p(y). 2y2 + y Let m(j) = j2 + 21j + 107. Let b be m(-7). Let i(p) = 4p - 4. Let u(t) = -17t + 16. Calculate bi(r) + 2u(r). 2r - 4 Let h(x) = -2x - 1. Let k(w) be the third derivative of -w4/24 + 5w*3/6 - 11w*2. Let b(p) = 2p - 6. Let c(l) = -3b(l) - 4k(l). Give 4c(n) - 5h(n). 2n - 3 Let j(z) = -8. Let s(q) = -q + 32. Let i(h) = -4j(h) - s(h). Let l(v) = -2v. Give 15i(n) - 3l(n). 21n Let a(m) = m3 + m2 - m. Let g(i) = 12i3 + 11i*2 - 13i. Give -22a(q) + 2g(q). 2q3 - 4q Let d = 921 - 922. Let n(l) = -2l3 + 6l*2 + 5l + 6. Let w(j) = -j*2 - 1. Determine dn(z) - 6w(z). 2z*3 - 5z Let i(u) = -2u + 1. Let j(c) = c2 + 2c - 1. Let f = -194 + 190. Give fi(b) - 3j(b). -3b2 + 2b - 1 Let k(w) = w*2 + 1. Let r(g) = -2g*2 + 5g - 5. Calculate -5k(y) - r(y). -3y*2 - 5y Let m(g) = -89g - 87g - 9 - 89g + 261g. Let w(s) = 3s + 10. What is -2m(u) - 3w(u)? -u - 12 Let y(k) = -25k*3 - 10k*2 + 5k - 1. Let m(n) = -24n3 - 8n*2 + 4n - 1. What is 5m(x) - 4y(x)? -20x3 - 1 Let p(d) = -6d - 4. Let u(h) = 10h + 8. Let b(k) = -11k - 9. Let n(j) = -5b(j) - 6u(j). Determine 3n(r) - 2p(r). -3r - 1 Let w(q) be the third derivative of -q4/24 + q3/6 - 65q2 - q. Let u(k) = -k2 + k - 1. Determine 2u(j) + 2w(j). -2j2 Let s(n) = -7n*2 - 3n + 1. Let v(m) = 15m2 - 13m - 18. Let d(p) = 6p2 - 6p - 8. Let r(f) = -9d(f) + 4v(f). Give 3r(g) + 2s(g). 4g2 + 2 Let l(g) = -6g*2 + 5g - 30. Let h(w) = 24w2 - 22w + 120. What is -2h(x) - 9l(x)? 6x2 - x + 30 Let z(q) = q - 13. Let i(f) = -4f + 53. Give 2i(n) + 9z(n). n - 11 Let x(w) = 16w + 3. Let p(k) = -2k. Give 6p(y) - x(y). -28y - 3 Let o = 18 + -11. Suppose 0 = 3k + o + 2. Let c = 14 + -13. Let j(h) = h2 - h - 1. Let q(d) = d2 - 4d - 3. What is cq(g) + kj(g)? -2g2 - g Let r(k) = -k. Let t(z) be the first derivative of 5z*2/2 - 2z - 197. Give 4r(s) + t(s). s - 2 Let p(u) = -u3 + u2 - u - 1. Suppose 0 = 2k - 2 - 2. Let v(b) = -18b3 + 4b*3 + 11b*2 - 13 - 11b + 2. What is kv(i) - 22p(i)? -6i3 Let u(k) = -11k*3 + 4k*2 - 9. Let q(c) = -5c*3 + 2c*2 - 4. Suppose 2h + w = -w + 16, -h + 4w = -8. Suppose -ht + 8 = -10t. What is tu(d) + 9q(d)? -d3 + 2d*2 Let b(n) = -19401n*2 - 446n. Let s(k) = -218k2 - 5k. Determine 5b(i) - 446s(i). 223i2 Let i = 483 - 487. Let y(h) be the second derivative of -3h5/20 + h4/6 + 5h3/6 + 13h. Let m(r) = -r3 + r2 + r. What is im(u) + y(u)? u3 - 2u*2 + u Let j(u) = -4u*3 + 77u*2 - 10u. Let m(o) = o*3 - 26o*2 + 3o. What is 2j(p) + 7m(p)? -p*3 - 28p*2 + p Let k(z) = -20z. Let r(b) = -2b + 1. Calculate k(p) - r(p). -18p - 1 Suppose 73z + 28 - 320 = 0. Let l(f) = -2f*2 + 14f - 26. Let x(b) = b*2 - 5b + 9. Give zl(w) + 11x(w). 3w2 + w - 5 Let x = 18 + -19. Let c(k) = 2k**3 +	{ "pile_set_name": "DM Mathematics" }
198. Let q(t) = 3t. Give q(g(l)). 9l*2 + 594 Let t(r) = 122r*2. Let x(m) = 65m. Determine x(t(h)). 7930h2 Let w(j) = 3j. Let r(h) = 12h. Let s(d) = -5r(d) + 21w(d). Let l(x) = -x2 - 6x - 3. Let y be l(-5). Let q(p) = 0p2 - 2p*2 + 0p*y. Give q(s(b)). -18b2 Let q(u) be the first derivative of u2/2 + 2. Let r(s) = s + 2s - s. What is r(q(x))? 2x Let k = -26 - -31. Let h(f) = 5 + 27f - k + 0. Let v(w) = -w2. Calculate h(v(l)). -27l*2 Let q(g) = 4g*2. Let y(k) = -1260k*2. What is y(q(h))? -20160h*4 Let i(k) = -17k*2. Let b(z) = -17z. Give b(i(d)). 289d2 Let o(g) = -g2. Let u(q) be the second derivative of -q5/60 - q3/6 - 3q. Let z(w) be the second derivative of u(w). Give z(o(b)). 2b2 Let j(i) be the third derivative of -i5/30 + 7i2. Let z(x) be the third derivative of -x5/6 + 2x2. Determine z(j(b)). -40b4 Let w(c) be the third derivative of -c6/180 + c*3/6 - 2c*2. Let o(u) be the first derivative of w(u). Let i(s) = -3 + s + 3. What is i(o(t))? -2t*2 Suppose 35 = g + 4g. Let z be 19/g + (-4)/(-14). Let x(f) = 10f2. Let w(c) = -2c*2. Let y(q) = zx(q) + 14w(q). Let a(h) = -2h. Determine y(a(r)). 8r2 Let u(g) = 2g. Let k(m) be the second derivative of -m6/180 - m4/2 + 2m. Let f(q) be the third derivative of k(q). What is f(u(y))? -8y Let l(h) = 15h. Let w(f) be the third derivative of -f5/60 - 25f*2. What is l(w(b))? -15b2 Let s(n) be the second derivative of -n4/12 - n3/2 + n2 - n. Let f be s(-3). Let j(g) = -3g + 3g + fg2. Let k(m) = -m. Calculate j(k(d)). 2d*2 Let b(i) = -2i*2. Let f(k) = 12k + 5. Let c(l) be the second derivative of l3 + l2 + 7l. Let x(g) = -10c(g) + 4f(g). Give x(b(s)). 24s*2 Let n(z) = -1523z. Let w(q) = -2q2. Give w(n(k)). -4639058k*2 Let a(s) = -11s - 7. Let c(z) = -5z - 3. Let t(o) = 3a(o) - 7c(o). Let k(g) be the second derivative of -g4/12 + 4g. Calculate t(k(y)). -2y2 Let q(z) be the third derivative of -z8/10080 - z5/30 - z2. Let s(a) be the third derivative of q(a). Let c(i) = i2. Give c(s(o)). 4o*4 Let a(c) = -7c*2. Let t(p) = -30p. Determine t(a(k)). 210k2 Let c(a) = -16a. Let f(h) = -46h. Determine f(c(b)). 736b Let u(f) = -f*2 + 3. Let r(w) = -1. Let v(j) = -3r(j) - u(j). Suppose 0 = 4h - 0h - 24. Let d(t) = -ht + 2t + 7t. Determine v(d(n)). 9n*2 Let o(s) = -4s + 5. Let m(z) = -z + 1. Let i(q) = -5m(q) + o(q). Let a(u) = 8u*2 + 3u. Calculate a(i(b)). 8b2 + 3b Let j(v) = -v*2. Let o(z) = -1. Let w(m) = -m + 4. Let u(p) = -4o(p) - w(p). What is u(j(c))? -c*2 Let k(q) = -1219q. Let r(f) = -2f2. Calculate r(k(n)). -2971922n*2 Let s(k) = 3k + 5. Let y(i) = -2i - 3. Let b(x) = -3s(x) - 5y(x). Let l(w) = -2w*2. Give l(b(t)). -2t*2 Let m(n) = 2n. Let g = -11 - -13. Let v(c) = 17c2 - 2. Let b(x) = -1. Let k(i) = gb(i) - v(i). Determine m(k(z)). -34z2 Let r(w) = w. Let b(o) be the first derivative of 6 - 2o*2 - 15 + 7o*2 + 2o*2. Give b(r(k)). 14k Let n(d) = 4d2. Let a(j) = -8j. Let y(h) = 4h. Let t(v) = 2a(v) + 5y(v). Determine t(n(c)). 16c*2 Let z(p) = 0p + 3p + 4p - 3p. Let h(t) = t. Give z(h(y)). 4y Let x(y) = 14y - 4. Let i(s) = -4s*2 - 5. Calculate i(x(h)). -784h*2 + 448h - 69 Let x(s) = 3s. Let p(n) = -252n. Calculate x(p(t)). -756t Let d(v) = 72v*2 - 36v*2 - 33v*2. Let w(g) = -5g. Calculate d(w(l)). 75l2 Let x(q) be the first derivative of -q4/4 - 5q - 2. Let w(c) be the first derivative of x(c). Let b(p) = p. Calculate w(b(l)). -3l2 Let r(k) = -k2. Let c(o) be the first derivative of -13o*2/2 - 19. Calculate r(c(d)). -169d*2 Let h(r) = 4r*2. Let i(s) = 6s2 - s2 - 8s2. Give h(i(y)). 36y*4 Let s(i) = 2i - 379. Let j(x) = 2x. What is s(j(n))? 4n - 379 Let q(y) = 195y2 - 6y + 1. Let t(c) = -c. Calculate q(t(r)). 195r2 + 6r + 1 Let m(k) = -13k. Let r(d) = 36d. What is m(r(c))? -468c Let t(b) = -b2. Let x = 5 - 1. Suppose -3v + 4z + 16 = -z, -xv + 4 = 2z. Let k(i) = 0i*v - 6i*2 + 4i*2. Determine k(t(p)). -2p*4 Let y(w) = -w. Let r(n) = 1396n. What is r(y(o))? -1396o Suppose 2p = -p - 18. Let t(r) = 5r2 - 6r + 6. Let v(o) = -4o2 + 5o - 5. Let q(a) = pv(a) - 5t(a). Let c(y) = -5y. Give c(q(i)). 5i*2 Let b(g) = 2g - 108. Let t(m) = -4m. Determine b(t(v)). -8v - 108 Let p(q) = 536q + 3. Let t(x) = 5x*2. What is p(t(o))? 2680o*2 + 3 Let n(a) = a. Let j(h) = 1948h*2. Determine j(n(m)). 1948m2 Let y(s) be the third derivative of s4/24 - s*2. Let c(q) = 19q*2 + 13 - 4q*2 - 13. Determine y(c(p)). 15p*2 Let p(v) = 8v*2. Let h(w) = 4w*2 - 9w. Let q(y) = 2y2 - 4y. Let i(d) = -4h(d) + 9q(d). Calculate i(p(j)). 128j4 Let s(n) be the third derivative of -n5/60 - 2n*2 + 70. Let l(t) = 2t. Let h(a) = a. Let u(y) = -4h(y) - 2l(y). Calculate u(s(z)). 8z2 Let z(d) = 3d. Suppose -2w + 12 = -0w. Let i(o) = 0o + o + wo - 3o. What is z(i(c))? 12c Let a(t) = 4t - 7. Let p(j) = 3j - 6. Let u(x) = -6a(x) + 7p(x). Let l(q) = -9q2. What is u(l(d))? 27d*2 Let v(f) = -105f*2 - 49f + 49. Let p(r) = 13r2 + 6r - 6. Let t = -45 - -94. Let h(q) = tp(q) + 6v(q). Let c(s) = -2s. What is c(h(l))? -14l*2 Let b(q) = 3q. Let u be (2 + -3)/((-1)/(-2)). Let v(k) = k*2 + 2k - 2. Let t(j) = -3j2 - 5j + 5. Let r(x) = ut(x) - 5v(x). Determine b(r(m)). 3m2 Let c(o) = 3o. Let k(n) = -n. Let d(h) = -h + 0h + 3h + h. Let t(b) = -2d(b) - 7k(b). Give t(c(g)). 3g Let x(t) = -4t*2 - 2t. Let u(h) = 159h2 - 79h*2 - 82h*2. Give u(x(w)). -32w*4 - 32w*3 - 8w*2 Let o(r) = 4r. Let x(w) = -5w2 + 2w*2 + 2w*2 + 2w*2. Give o(x(v)). 4v*2 Let l(t) = -3t*2. Let r(u) = 1275u. Give l(r(m)). -4876875m2 Let n(q) be the third derivative of q4/6 + 2q2. Let l(u) be the second derivative of u4/6 + u. Give n(l(f)). 8f2 Let g(t) = 3t*2 - 5t. Let c(v) = 2v2 - 4v. Let u(r) = 5c(r) - 4g(r). Let q(x) = -2x2 + 0x*2 - 3x*2. Determine q(u(o)). -20o*4 Let f(z) = -2z + 1. Let y be f(-3). Let x(b) = -4b - yb - 9b + 18b. Let t(p) = -18p. What is x(t(n))? 36n Let v(q) = -3q2 + 5q - 5. Let u(l) = -5l2 + 8l - 8. Let p(j) = -5u(j) + 8v(j). Let m(b) = b + 0b - 4b*2 - b. Determine m(p(i)). -4i*4 Let m(t) = 2t. Let v(p) be the second derivative of 1/6p3 - p + 0p*2 + 0. Give m(v(j)). 2j Let v(h) = -12h. Let s(a) be the first derivative of 2a*3/3 - 26. Give s(v(c)). 288c*2 Let w(c) = 3c. Let i(g) = 6g. Suppose a + 5n + 22 = 0, 0a - 2a - 20 = 4n. Let o(h) = ai(h) + 5w(h). Let p(s) = 2s. What is p(o(x))? 6x Suppose 19 = 4a + u, 0u - 2 = -2a + 2u. Suppose -av = -8 - 0. Let f(o) = -vo + 3 + 1 - 4. Let l(q) = 2q. What is l(f(s))? -4s Suppose 3j = 2h + 12 - 0, 0 = 2j + h - 1. Let u(r) = -6r2 + jr*2 + 3r*2. Let b(k) = 10k. Give u(b(d)). -100d2 Let a(f) = -f2. Let g(l) be the first derivative of 0l - 11 + 0l2 - 4/3l*3. Determine a(g(q)). -16q*4 Let v(k) = -2k*2. Let a(s) = -153s + 3. Calculate a(v(r)). 306r2 + 3 Let v(t) = t. Let k(f) be the third derivative of -f4/12 - f3/3 + 29f*2. Determine v(k(p)). -2p - 2 Let m = 5 - 1. Let k(l) = -ml + 0 + 0. Let r(d) = -3d + 4d + 2d - 2d. Determine r(k(s)). -4s Let b(t) = t - 6. Let f be b(5). Let u = 2 - f. Let o(h) = h + 4h - uh - 5h. Let i(g) = -2g*2. Determine i(o(a)). -18a*2 Let z(i) = i. Let j(a) = 1. Let r(d) = -8d + 28. Let c(u) = 56j(u) - 2r(u). Determine z(c(q)). 16q Let j(n) = 2n - 6. Let b(c) = -12c. Give b(j(m)). -24m + 72 Let q(m) = 2678 + 4m2 - 2678. Let j(f) = -2f. What is q(j(i))? 16i2 Let h(m) = m2. Let n(p) = -718p. Give h(n(o)). 515524o2 Let s(g) be the first derivative of -2 + 0g + 0g2 + 1/3g3. Let u(y) = -y. Determine u(s(j)). -j2 Let y(a) = a*2 + 13a + 15. Let j be y(-12). Let f = 2 + 1. Let b(v) = 3 - fv - j. Let l(u) = -u. Determine l(b(m)). 3m Let m(i) = 1. Let o(k) = -k - 1. Let s(g) = 2g + 1. Let h(t) = 3o(t) + s(t). Let v(b) = 3h(b) + 6m(b). Let d(z) = z*2. Give d(v(f)). 9f2 Let d(i) = -i2. Let w(x) be the third derivative of x5/30 - x2. Let g(t) =	{ "pile_set_name": "DM Mathematics" }
What is the thousands digit of 250026448? 6 What is the hundreds digit of 2185225184? 1 What is the ten thousands digit of 4660811099? 1 What is the ten thousands digit of 82567267? 6 What is the ten thousands digit of 121628013? 2 What is the tens digit of 14199054? 5 What is the thousands digit of 25611504? 1 What is the tens digit of 2782164994? 9 What is the hundred thousands digit of 93226017? 2 What is the hundred millions digit of 200520232? 2 What is the units digit of 643261? 1 What is the ten millions digit of 51447872? 5 What is the hundreds digit of 117620510? 5 What is the millions digit of 381195020? 1 What is the units digit of 59290288? 8 What is the tens digit of 43888245? 4 What is the tens digit of 10098601? 0 What is the tens digit of 1092280376? 7 What is the tens digit of 60696754? 5 What is the ten millions digit of 470538759? 7 What is the ten millions digit of 15681941? 1 What is the hundred thousands digit of 8096484792? 4 What is the hundred millions digit of 1429071254? 4 What is the millions digit of 71110241? 1 What is the hundreds digit of 128958018? 0 What is the hundred thousands digit of 111276120? 2 What is the thousands digit of 19122447? 2 What is the tens digit of 32226951? 5 What is the thousands digit of 36953918? 3 What is the ten thousands digit of 61922227? 2 What is the ten thousands digit of 1239728902? 2 What is the millions digit of 38372215? 8 What is the units digit of 125918903? 3 What is the units digit of 724877868? 8 What is the tens digit of 358502856? 5 What is the hundreds digit of 1563842455? 4 What is the units digit of 1677072288? 8 What is the units digit of 204375387? 7 What is the units digit of 48016833? 3 What is the thousands digit of 829891796? 1 What is the ten thousands digit of 166429129? 2 What is the ten millions digit of 185974033? 8 What is the millions digit of 72625158? 2 What is the units digit of 93978469? 9 What is the hundred millions digit of 2667516471? 6 What is the ten thousands digit of 32582845? 8 What is the ten thousands digit of 782603568? 0 What is the tens digit of 20481435? 3 What is the ten millions digit of 310844125? 1 What is the millions digit of 88758043? 8 What is the thousands digit of 777598166? 8 What is the hundred thousands digit of 56345088? 3 What is the tens digit of 2014494328? 2 What is the hundreds digit of 161803102? 1 What is the hundreds digit of 413388878? 8 What is the thousands digit of 187309233? 9 What is the thousands digit of 83578775? 8 What is the tens digit of 66175528? 2 What is the hundred thousands digit of 549570732? 5 What is the units digit of 82484853? 3 What is the billions digit of 1506499426? 1 What is the hundred thousands digit of 7123295784? 2 What is the tens digit of 98152449? 4 What is the tens digit of 4209614? 1 What is the ten millions digit of 42737509? 4 What is the hundred thousands digit of 1060581378? 5 What is the ten thousands digit of 3279311919? 1 What is the millions digit of 922299207? 2 What is the hundred millions digit of 626313531? 6 What is the ten millions digit of 140208102? 4 What is the hundred thousands digit of 149601741? 6 What is the ten millions digit of 610735646? 1 What is the thousands digit of 60241684? 1 What is the units digit of 35618032? 2 What is the hundreds digit of 170414835? 8 What is the millions digit of 7199781570? 9 What is the hundreds digit of 432561006? 0 What is the ten thousands digit of 376381696? 8 What is the hundred millions digit of 503473182? 5 What is the tens digit of 74041082? 8 What is the units digit of 99663374? 4 What is the hundreds digit of 281121416? 4 What is the millions digit of 23154411? 3 What is the ten millions digit of 39143903? 3 What is the hundred thousands digit of 742723298? 7 What is the millions digit of 705179005? 5 What is the ten millions digit of 122562101? 2 What is the ten millions digit of 170490442? 7 What is the ten thousands digit of 238626? 3 What is the ten millions digit of 61308984? 6 What is the thousands digit of 486995505? 5 What is the millions digit of 183292956? 3 What is the millions digit of 138612377? 8 What is the units digit of 18161621? 1 What is the hundred thousands digit of 7699230? 6 What is the thousands digit of 108549371? 9 What is the hundred millions digit of 219032462? 2 What is the hundred thousands digit of 18322121? 3 What is the units digit of 55658308? 8 What is the ten millions digit of 1360568992? 6 What is the millions digit of 7050594646? 0 What is the hundred thousands digit of 102908311? 9 What is the units digit of 37032226? 6 What is the ten thousands digit of 11264872? 6 What is the ten millions digit of 532950710? 3 What is the thousands digit of 6114352777? 2 What is the billions digit of 2534968804? 2 What is the ten thousands digit of 60735509? 3 What is the hundred thousands digit of 11384604? 3 What is the millions digit of 116822591? 6 What is the millions digit of 48379491? 8 What is the units digit of 1820042053? 3 What is the thousands digit of 2817708978? 8 What is the ten millions digit of 38943447? 3 What is the hundreds digit of 813702255? 2 What is the millions digit of 45085518? 5 What is the millions digit of 401043072? 1 What is the units digit of 739657753? 3 What is the hundred millions digit of 879598718? 8 What is the units digit of 4257525040? 0 What is the units digit of 394744136? 6 What is the thousands digit of 40272367? 2 What is the ten thousands digit of 302233512? 3 What is the hundred millions digit of 4311730387? 3 What is the thousands digit of 8085140? 5 What is the thousands digit of 842081036? 1 What is the hundred thousands digit of 1310805101? 8 What is the hundreds digit of 1033288517? 5 What is the tens digit of 2172397721? 2 What is the thousands digit of 1943242? 3 What is the hundred millions digit of 123529657? 1 What is the ten millions digit of 95560597? 9 What is the ten thousands digit of 4064415809? 1 What is the hundreds digit of 309653651? 6 What is the units digit of 173829252? 2 What is the hundred millions digit of 571159308? 5 What is the ten thousands digit of 5134506293? 0 What is the ten thousands digit of 192764268? 6 What is the ten thousands digit of 51386094? 8 What is the thousands digit of 224269582? 9 What is the hundreds digit of 2559159638? 6 What is the hundred thousands digit of 49844963? 8 What is the ten thousands digit of 58062705? 6 What is the thousands digit of 1540004501? 4 What is the hundreds digit of 27822551? 5 What is the thousands digit of 145206472? 6 What is the millions digit of 541193506? 1 What is the units digit of 9040210488? 8 What is the millions digit of 33303958? 3 What is the hundred millions digit of 400888354? 4 What is the ten millions digit of 56742809? 5 What is the hundreds digit of 59062873? 8 What is the ten millions digit of 2685292585? 8 What is the hundreds digit of 27474568? 5 What is the units digit of 62598954? 4 What is the ten thousands digit of 6817317? 1 What is the ten thousands digit of 583687022? 8 What is the ten thousands digit of 19655476? 5 What is the ten millions digit of 52206990? 5 What is the billions digit of 3649648939? 3 What is the hundred thousands digit of 2809638568? 6 What is the hundred millions digit of 124938695? 1 What is the millions digit of 545807963? 5 What is the thousands digit of 212694459? 4 What is the ten thousands digit of 18500425? 0 What is the tens digit of 123613? 1 What is the units digit of 72300300? 0 What is the ten millions digit of 46523521? 4 What is the tens digit of 5559810528? 2 What is the millions digit of 394266995? 4 What is the hundreds digit of 67641319? 3 What is the thousands digit of 1772328154? 8 What is the thousands digit of 1546125? 6 What is the millions digit of 1914705142? 4 What is the millions digit of 522501377? 2 What is the hundreds digit of 307661904? 9 What is the thousands digit of 14232749? 2 What is the thousands digit of 55707376? 7 What is the ten millions digit of 15498890? 1 What is the thousands digit of 2425130? 5 What is the millions digit of 190986656? 0 What is the ten thousands digit of 55676426? 7 What is the thousands digit of 168068304? 8 What is the hundred millions digit of	{ "pile_set_name": "DM Mathematics" }
in 4 - 1 - 3 + 18f2. 18f*2 Collect the terms in -9d*3 - 25d*3 - 55d*3 - 10d*3. -99d*3 Collect the terms in 2x*2 - 35x + 51x - 50x - 56x. 2x*2 - 90x Collect the terms in -6r + 4r*2 - 4r - r*3 - 4r2. -r3 - 10r Collect the terms in k + 9k*3 - k. 9k*3 Collect the terms in -4 + 4 + 26t - 25t. t Collect the terms in 577u*2 - 66u*3 - 577u*2. -66u*3 Collect the terms in -2296d*3 + 0 + 2292d*3 + 2 - 2. -4d*3 Collect the terms in 2u + u + 2u. 5u Collect the terms in 43k + 31k + 14k + 22k. 110k Collect the terms in 8334 + 2q - 8334. 2q Collect the terms in 32r + 19945 - 19945. 32r Collect the terms in 15d - 47d + 14d + 13d. -5d Collect the terms in 41h - 18h - 53h - 49h. -79h Collect the terms in 4v*3 - 14v*3 + 6v*3. -4v*3 Collect the terms in 16p3 - p3 - 2p3. 13p*3 Collect the terms in -293z*3 - 286z*3 + 573z*3. -6z*3 Collect the terms in -206g + 424g - 219g. -g Collect the terms in 258 - 258 - 452g2. -452g*2 Collect the terms in 2q*3 - 200q*2 + 200q*2 - 11q*3. -9q*3 Collect the terms in 122h*2 - 59h*2 - 58h*2. 5h*2 Collect the terms in -20s*2 - 77 + 41 + 36. -20s*2 Collect the terms in -36r + 34r - 46r - 60r. -108r Collect the terms in 5669o2 + 3 - 3. 5669o*2 Collect the terms in -31q*3 + 86q*3 - 27q*3 - 29q3. -q3 Collect the terms in -21 + 2y2 - 3y2 - y2 + 119. -2y2 + 98 Collect the terms in -299s*3 - 283s*3 - 67s*3. -649s*3 Collect the terms in 111o*2 + 80o*2 - 209o*2. -18o*2 Collect the terms in 2i2 - i2 - i*2 - 11i - 2i3. -2i*3 - 11i Collect the terms in 58 + 3d3 + 49 - 107. 3d*3 Collect the terms in 9 + 2 - 60l - 11 + 1. -60l + 1 Collect the terms in 3y - 313449 + 313449. 3y Collect the terms in 1 - 1 - 10i3 + i3. -9i3 Collect the terms in -120g - 107g - 119g + 87g. -259g Collect the terms in 3p2 + 4 - 4. 3p*2 Collect the terms in -67n - 113n + 138n. -42n Collect the terms in -32t*2 + 0 + 30t*2 + 52. -2t*2 + 52 Collect the terms in 3 - 5 - 5y + 2. -5y Collect the terms in -8f + 3 - 15f2 + 8f. -15f2 + 3 Collect the terms in -250 - 14b + 250. -14b Collect the terms in 6d*3 + 2d3 + d3. 9d3 Collect the terms in -107m*3 + 51m*3 + 52m*3. -4m*3 Collect the terms in 3z + 1 + z + 4z - 7z. z + 1 Collect the terms in -1209l + 1209l + 2l2. 2l*2 Collect the terms in 5f - 3f - f + 2f. 3f Collect the terms in 213h - 8 + 13 - 5. 213h Collect the terms in 27i + 5 - 2 - 23i. 4i + 3 Collect the terms in -3 + 44b3 + 3 - 14b*3. 30b*3 Collect the terms in -3v + 3v + 427v*2 - 433v*2. -6v*2 Collect the terms in 43m*2 + 397m - 397m. 43m*2 Collect the terms in 36c - 13c - 15c - 19c. -11c Collect the terms in g2 - 2 - 2 + 5 + 0. g2 + 1 Collect the terms in -2 + 239u - 598u + 2. -359u Collect the terms in -86m*2 + m + m + 85m*2 - 2m. -m*2 Collect the terms in 3n*2 - 3n*2 - 87n - 3n3. -3n*3 - 87n Collect the terms in 2q - 9q*2 - 3q*2 - 3q. -12q2 - q Collect the terms in -168z*2 - 2z + 3z3 + 176z*2 + 2z. 3z3 + 8z*2 Collect the terms in -2 - 1 + 648p + 3 - 664p. -16p Collect the terms in -x - 2 - 3 - 3 + 8. -x Collect the terms in k*3 - 7k + k*3 - 6k. 2k3 - 13k Collect the terms in -10m + 13m - 3m - 5m*3. -5m*3 Collect the terms in -63d*2 - 59d*2 + 240d*2 - 61d*2 - 59d*2. -2d*2 Collect the terms in -605v + 604v + 0 + 0. -v Collect the terms in -332j*3 + 1333j + 331j3 - 1333j. -j*3 Collect the terms in -u - 2 + 19u + 11u. 29u - 2 Collect the terms in 2y3 + 27y + 28y - 55y. 2y3 Collect the terms in -7b - 88b2 + 2 + 7b. -88b2 + 2 Collect the terms in -u3 + 18u*3 + 3u*3. 20u*3 Collect the terms in 10p*3 + 69p*3 - 63p*3. 16p*3 Collect the terms in -10 + 0i - 14 + 13 + 4i. 4i - 11 Collect the terms in -2s2 - 4s*2 + 7s*2 + 2 + 8s*2. 9s2 + 2 Collect the terms in -m3 - 6m3 - 3m*3 + 4m*3. -6m*3 Collect the terms in 22 - 15 + h - 7. h Collect the terms in -1853h + 3712h - 1873h. -14h Collect the terms in 0 + 1 - 67y*3 - 19y*3. -86y*3 + 1 Collect the terms in 4 - 36x - 4 + 24x. -12x Collect the terms in -26r3 - 31r*3 - 26r*3 - 27r*3 + 84r*3. -26r*3 Collect the terms in 19 + 6n*3 - 2n*3 - 19. 4n*3 Collect the terms in 21g*2 + 3g + 8g - 11g. 21g2 Collect the terms in -2a + 345958 - 345958. -2a Collect the terms in -1 + 2 + 0 - 38p*3 + 10p*3. -28p*3 + 1 Collect the terms in 7l*2 - 34l*2 + 9l*2 + 17l2. -l2 Collect the terms in -15j3 - 3j*3 + 28j*3 - 3j*3. 7j*3 Collect the terms in 5 - 5 + 0 - 18h*3. -18h*3 Collect the terms in -138j*3 - 73j*3 - 2j*2 + 2j*2. -211j*3 Collect the terms in -4l*2 - 2l*2 + 2l*2 + 0l*2. -4l*2 Collect the terms in -h + 5h*3 + 22h*2 - 22h*2. 5h*3 - h Collect the terms in -37d + 14d + 7d + 14d. -2d Collect the terms in -377b + 612b - 237b. -2b Collect the terms in -i*2 + 0i*2 + 0i2. -i2 Collect the terms in d*3 + 76d*2 - 85d*2 + 9d2. d3 Collect the terms in x*3 - 3x*2 + 152 - 153 + 3x2. x3 - 1 Collect the terms in -25w3 + 37w*3 - 13w3. -w3 Collect the terms in -8 + 15l - 8l + l - 10l. -2l - 8 Collect the terms in 0l3 - l3 - 21l*3. -22l*3 Collect the terms in 2 - 10v - 4v + 5v - 2. -9v Collect the terms in 884g - 163g3 - 884g. -163g3 Collect the terms in 4o - 4o + 5o*3 + 12o*3. 17o*3 Collect the terms in -396t + 149t + 96t - 399t. -550t Collect the terms in 0y2 - y2 - 2y*2 + 4y2. y2 Collect the terms in 2292i - 1143i - 1147i. 2i Collect the terms in h*3 - 3h*3 + 6h*3. 4h*3 Collect the terms in 3037o*3 + 3013o*3 - 6034o*3. 16o*3 Collect the terms in -5i + 14i - 4i - 7i. -2i Collect the terms in 3q2 - 3q*2 + 6q*2 + 0q*2. 6q*2 Collect the terms in -11h + 4h + 4h + h. -2h Collect the terms in 4y + 10y - 3y. 11y Collect the terms in -57f - 39f + 73f. -23f Collect the terms in 86i*2 - 2i + 2i - 67i*2. 19i*2 Collect the terms in 47c*3 - 63c*3 + 38c*3. 22c*3 Collect the terms in 22o - 3o - 12o - 5o. 2o Collect the terms in -2c2 - 850 + 850. -2c*2 Collect the terms in 8n - n*2 + 2n3 + n2 + 13n. 2n*3 + 21n Collect the terms in -79i2 - 83i*2 + 159i*2. -3i*2 Collect the terms in z - z - 2z - 6z. -8z Collect the terms in -52g - 13g - 68g. -133g Collect the terms in -20f + 10f - 18f - 13f. -41f Collect the terms in -98r*2 + 4 - 4 + 197r*2 - 95r*2. 4r*2 Collect the terms in 9t*3 + 18t3 + t3 - 25t3. 3t*3 Collect the terms in 149f*3 - 313f*3 + 159f*3. -5f*3 Collect the terms in -2 + 3 - 3 + 7 + 5k. 5k + 5 Collect the terms in 6s*3 + 0s*3 - 4s*3. 2s*3 Collect the terms in -11 + 19q*2 - 2q*2 + 11. 17q*2 Collect the terms in 42m - 72m + 25m. -5m Collect the terms in 85y*2 + 8y - 8y - 84y2. y2 Collect the terms in -27o3 + 28o*3 + 16o*2 - 30o*2 + 14o2. o3 Collect the terms in 9i - 3i - 2i + 18i. 22i Collect the terms in 14 - 4w + 9 - 21. -4w + 2 Collect the terms in -40u*3 + 5u*3 + 17u*3 + 13u*3. -5u*3 Collect the terms in -2s*2 + 27666 - 27666. -2s*2 Collect the terms in -14y + 13y + y + 167y*2. 167y*2 Collect the terms in 1067t - 539t - 534t. -6t Collect the terms in 2s*3 - 3s*3 + 2s3 + 7. s3 + 7 Collect the terms in 14b - 9b - 3b3 + 16b - 21b. -3b*3 Collect the terms in -2v*3 - 400048v + 400048v. -2v*3 Collect the terms in -4k*3 + 26k*3 - 13k*3 - 14k*3. -5k*3 Collect the terms in 9c + 13987 - 13987. 9c Collect the terms in 64s + 72s - 198s + 65s. 3s Collect the terms in 2 - 4 + 667z + 2. 667z Collect the terms in -5u + 0u - 2u. -7u Collect the terms in 5s3 + s3 + 4s*3. 10s*3 Collect the terms in -5 + 2h - 2h + 13h*2. 13h*2 - 5 Collect the terms in 331r - 164r - 167r - 2r2. -2r*2 Collect the terms in -31m - 24m + 77m - 23m. -m Collect the terms in 147 - 4r**3 - 147. -4	{ "pile_set_name": "DM Mathematics" }
1. -21381 Calculate -1232729 divided by 190. -1232729/190 Calculate 143873687 divided by -4. -143873687/4 What is -1734195 divided by -162? 578065/54 Divide 2 by -3093052. -1/1546526 Divide 329087 by 22. 29917/2 What is 2 divided by -2454864? -1/1227432 Divide 1579705 by -1. -1579705 What is -20 divided by 37603? -20/37603 Calculate -2026530 divided by 99. -20470 What is -81227853 divided by 243? -334271 Divide -3569 by -3972. 3569/3972 -76999069 divided by 7 -10999867 Calculate 56699 divided by 224. 56699/224 Divide 13 by -136453. -13/136453 Divide -169224 by 605. -15384/55 Divide -94 by 203221. -94/203221 What is -487 divided by 31133? -487/31133 -142251450 divided by -75 1896686 Divide 17613932 by 98. 179734 Divide -20206965 by 4. -20206965/4 Divide -327 by -650722. 327/650722 Calculate -16771795 divided by 3354359. -5 Divide 4109180 by -23. -178660 Divide -5 by -35952081. 5/35952081 -4 divided by -485352 1/121338 Calculate 13315488 divided by 246. 54128 Calculate -55 divided by 1447369. -5/131579 What is 2 divided by 56279007? 2/56279007 2909257 divided by 13 223789 What is -193 divided by 1146? -193/1146 Calculate -6370 divided by 8903. -6370/8903 -250884 divided by 200 -62721/50 Calculate 0 divided by 6351171. 0 What is 546850 divided by -80? -54685/8 Divide -68012065 by 6182915. -11 Divide 15052 by 21765. 15052/21765 What is -20090022 divided by -17? 1181766 4476 divided by -27489 -1492/9163 What is -13088228 divided by 8? -3272057/2 -54415 divided by 1946 -54415/1946 -610046 divided by 182 -305023/91 Calculate 1176 divided by -201145. -24/4105 What is 483697 divided by -7? -483697/7 67393 divided by -98 -67393/98 Calculate -263 divided by 41527. -263/41527 Divide 137028798 by 1062. 129029 Calculate -2585128 divided by -46163. 56 What is -106961700 divided by 196260? -545 Calculate -792455340 divided by 23460. -33779 9 divided by -118094 -9/118094 What is 1666084 divided by -14? -119006 Calculate -5 divided by -17630091. 5/17630091 What is -1474 divided by 2391? -1474/2391 What is 8112089 divided by 5? 8112089/5 15071387 divided by 52 15071387/52 Divide -141519950 by -989650. 143 Divide -6275430 by -1045905. 6 Divide 591 by -78309. -197/26103 Divide 791 by -11446. -791/11446 What is 4 divided by -524082? -2/262041 What is 149148060 divided by -14914806? -10 Calculate 250360113 divided by 3. 83453371 -170460 divided by -28410 6 Calculate -5596 divided by 355. -5596/355 Divide 6384 by 276490. 3192/138245 What is 1076971840 divided by -19231640? -56 1757608 divided by 1 1757608 -5 divided by 1207133 -5/1207133 12505192 divided by -152 -82271 Calculate -8460440 divided by 32920. -257 What is 5 divided by -25639760? -1/5127952 Calculate -4 divided by -479396. 1/119849 Divide -47181671 by 23. -2051377 What is -7703 divided by -859? 7703/859 Divide -1621 by -29794. 1621/29794 Divide -4 by -752096. 1/188024 121946136 divided by 4 30486534 Calculate 213943 divided by 24. 213943/24 Calculate 2297 divided by -1206. -2297/1206 Divide 64886 by -22. -32443/11 What is 2091 divided by -357026? -2091/357026 3 divided by -17391333 -1/5797111 What is -45884853 divided by 45884853? -1 -931927290 divided by 186385458 -5 -265787389 divided by -59 4504871 33546516 divided by -4 -8386629 What is -362 divided by -8850? 181/4425 Divide 13511 by -643. -13511/643 Divide 78244309 by -11. -7113119 Calculate 2153520 divided by 1. 2153520 Divide 11615996 by 2. 5807998 What is 556975760 divided by -7480? -74462 Divide -3161 by 1935. -3161/1935 Calculate 39 divided by 3221276. 39/3221276 Divide 29 by 13177223. 1/454387 What is -1511400 divided by -2748? 550 Calculate 392887689 divided by -130962563. -3 Calculate 17968034 divided by 434. 41401 Divide 8924 by 55405. 8924/55405 What is 963939168 divided by 852? 1131384 Calculate 69 divided by 26658398. 69/26658398 Calculate -314945838 divided by -2. 157472919 Divide -143659328 by 35914832. -4 Divide 16584204 by 84. 197431 Divide 2385710 by -2385710. -1 140 divided by -267104 -35/66776 Divide -35472003 by 23. -1542261 -4135253 divided by -2 4135253/2 Calculate -28619724 divided by -146019. 196 35606220 divided by 456490 78 What is -58062656 divided by -8? 7257832 What is 21661789 divided by 53? 408713 -13 divided by 5145456 -13/5145456 29670403 divided by -4238629 -7 What is 16680976 divided by 8340488? 2 Calculate -765782 divided by -539. 765782/539 Calculate 19612796 divided by -700457. -28 Calculate 4362644 divided by 638. 6838 Calculate -5 divided by 297049741. -5/297049741 Calculate 799403 divided by 11. 72673 Calculate 98880096 divided by -224. -441429 Calculate -4850259 divided by 3. -1616753 Divide 4700384 by 361568. 13 Calculate -11433756 divided by 6. -1905626 Divide 109291367 by 3. 109291367/3 What is 89376606 divided by 66? 1354191 Divide 5861688 by -7544. -777 137403 divided by -934 -137403/934 Divide 879060 by 42. 20930 What is 339308 divided by 339308? 1 Calculate 151595348 divided by 37898837. 4 What is 74 divided by 307296? 37/153648 Divide -1152876 by -764. 1509 What is 451703 divided by 42? 64529/6 -3 divided by -29252906 3/29252906 Divide 0 by -16560907. 0 Calculate 5 divided by -1289663. -5/1289663 2371 divided by 501 2371/501 Calculate 21791 divided by -22. -1981/2 14 divided by 43499360 7/21749680 Divide 118966200 by 9913850. 12 162869954 divided by 5 162869954/5 Divide -134930069 by -2. 134930069/2 What is -3697554 divided by -42? 88037 226611241 divided by 1 226611241 Divide 6610663 by 35. 6610663/35 Divide 8431079 by 4. 8431079/4 Calculate 22797783 divided by -43. -530181 Calculate -171032316 divided by 6. -28505386 Calculate -14625 divided by -5297. 14625/5297 -30644835 divided by 3 -10214945 Calculate 3199680 divided by -1056. -3030 -7943 divided by 63010 -7943/63010 -324605169 divided by -3 108201723 Calculate 42784920 divided by 120. 356541 What is -1 divided by -2470697? 1/2470697 Calculate 182331870 divided by -60777290. -3 Calculate -3759800 divided by 93995. -40 -89276820 divided by -15 5951788 Divide 43373 by 13. 43373/13 Calculate -49818090 divided by -3889. 12810 -42549132 divided by 10637283 -4 Calculate -1067070428 divided by -116. 9198883 What is -5 divided by 16508800? -1/3301760 What is 42 divided by -14041437? -14/4680479 What is 300292569 divided by -7503? -40023 Divide -7234500 by -1378. 5250 What is -2465357 divided by -5? 2465357/5 Calculate -60396733 divided by -17. 3552749 Divide 7909440 by -94160. -84 3449274 divided by -1 -3449274 Calculate 420655 divided by 420655. 1 Calculate -9469877 divided by -34. 9469877/34 What is -527820 divided by -395? 105564/79 Calculate -232719 divided by 101. -232719/101 Divide 1657476 by -14. -828738/7 Calculate 331 divided by 4897. 331/4897 -816 divided by -22170 136/3695 Divide -3395 by -19505. 679/3901 What is -56316 divided by 6685? -56316/6685 What is -152688 divided by 12? -12724 -218590206 divided by 1194482 -183 87972150 divided by -2 -43986075 Divide 1 by -192535. -1/192535 What is -764796 divided by -1? 764796 Divide 74924417 by -6. -74924417/6 Calculate 12774780 divided by 94628. 135 Divide 448226 by -11. -448226/11 What is -349398 divided by -38822? 9 -3287 divided by 28693 -3287/28693 12044538 divided by 364986 33 Divide 103012680 by 4. 25753170 -7551920 divided by 24 -943990/3 What is -9723384 divided by -63? 1080376/7 -2011 divided by 5279 -2011/5279 What is 31889 divided by 1091? 31889/1091 What is 8088880 divided by 23? 8088880/23 Calculate 746660 divided by -3. -746660/3 Divide -5042790 by -5. 1008558 What is 455639 divided by -455639? -1 What is 1108953 divided by 5? 1108953/5 What is 2274786 divided by -129? -17634 What is 169862 divided by 120? 84931/60 15893492 divided by 20803 764 Divide -12353144 by 12353144. -1 Divide 2492922 by -415487. -6 Calculate 1338160 divided by 43. 31120 What is 19135107 divided by 2126123? 9 Divide 207 by 135140. 207/135140 What is 113172134 divided by -31? -3650714 1253338464 divided by 188076 6664 Divide 1094652 by -39. -28068 Calculate -2 divided by 38160080. -1/19080040 178700311 divided by -17 -10511783 Divide 4676886 by -2. -2338443 Divide -331842175 by 5. -66368435 What is -363843813 divided by -4? 363843813/4 What is 71596 divided by -258? -35798/129 Divide 122066546 by -4753. -25	{ "pile_set_name": "DM Mathematics" }
j + h + 11 = -2j. Let r(x) = 10xj - x2 - 10x2. What is r(t(m))? -81m*4 Let d(v) = 2v*2 - 41. Let w(u) = -42u*2. Calculate d(w(j)). 3528j*4 - 41 Let v(h) = 4h - 9h + h. Let k(m) = -m + 12. Let i(n) = n - 14. Let y(q) = 6i(q) + 7k(q). Calculate y(v(a)). 4a Let z(t) = 3t + 0t + 17t. Let a(n) = -3n*2 + 4n + 2. Let h(q) = -14q2 + 18q + 9. Let c(m) = 18a(m) - 4h(m). Give c(z(d)). 800d2 Let g(m) = 10m*2 + 10. Let z(w) = 15w*2 + 14. Let v(h) = 7g(h) - 5z(h). Let b(j) = j2 - 34j. What is b(v(r))? 25r4 + 170r2 Let a(j) be the third derivative of j5/30 + j*4/3 + 7j*3/6 + 33j*2. Let k(l) be the first derivative of a(l). Let z(t) = -2t*2. Give z(k(b)). -32b*2 - 128b - 128 Let z(h) = 1327h. Let y(f) = -15f. What is z(y(s))? -19905s Let a(d) = 2 - 5d - 3d2 + 3 + 10d*2. Let x(s) = -6s*2 + 4s - 4. Let c(k) = 4a(k) + 5x(k). Let y(j) = -9j. Calculate y(c(g)). 18g*2 Let j(o) = -2o*2. Let w(d) = 173697d. Give w(j(h)). -347394h2 Let q(x) = -x. Let m(y) = 1035y*2 + 45y. Let t(o) = -47o2 - 2o. Let p(w) = 2m(w) + 45t(w). Give p(q(a)). -45a2 Let c(r) = -3r. Let a(i) = 2i2 - 3997i + 2. What is a(c(t))? 18t2 + 11991t + 2 Let j(m) = -2m. Let q(c) = c + 0c - 5c. Let i(a) be the third derivative of a4/24 + 6a*2 + 3a. Let g(f) = 6i(f) + 2q(f). Determine g(j(b)). 4b Let v(x) = 11x + 4. Let a(w) = -11w - 3. Let g = 19 + -22. Let m(b) = gv(b) - 4a(b). Let y(l) = -2l. Calculate m(y(f)). -22f Let p(k) be the second derivative of -k3/3 - 2k. Let d(l) be the second derivative of -15l - 5/3l*3 + 0 + 0l*2. Determine d(p(y)). 20y Let f(k) = 3614k2 - 139k + 139. Let g(m) = 129m2 - 5m + 5. Let n(h) = 5f(h) - 139g(h). Let l(x) = 6x. Give l(n(p)). 834p*2 Let r(o) = -2o*2 - 4 + 4. Let a(s) = -5s - 19s + 17s - 3. Let w(g) = 14g + 7. Let k(m) = -7a(m) - 3w(m). Calculate k(r(l)). -14l*2 Let n(y) = -78y. Let s(z) = -10 + z - 3z + 4 + 6. Determine n(s(g)). 156g Let b(v) = 25v + 6. Let h(f) = -19f - 7. Let q(a) = -3b(a) - 4h(a). Let w(j) = 3j2. What is q(w(p))? 3p*2 + 10 Let b(s) = -7s. Suppose 4w + 66 - 21 = 5g, 30 = 3g - 3w. Let x(a) = -2a + 3a + ga - 3a. Give x(b(u)). -21u Let d(v) = v2. Let y(w) = 1022w*2 + 2. Calculate y(d(i)). 1022i*4 + 2 Let t(f) = -11534f. Let u(v) = -v. Determine u(t(w)). 11534w Let x(u) = -28u - 8. Let y(h) = -8h - 5. Calculate x(y(r)). 224r + 132 Let w(f) = 9f2 - 7f*2 - 27 + 27. Let p(k) be the first derivative of -7k*4/6 - 6k - 4. Let c(l) be the first derivative of p(l). Give w(c(x)). 392x4 Let l(o) = 2o*2. Let h(s) be the first derivative of -553s*3/3 - 705. Calculate l(h(m)). 611618m*4 Let l(c) = -c. Let m be (-910)/(-8) - (-12)/(-16). Suppose -r + 6r - m = 3z, -5z - 115 = -5r. Let y(i) = -6i*2 - ri + 22i. Give l(y(f)). 6f*2 Let r(m) = 263m*3 - 2m*2 + m + 1. Let h be r(2). Let k(l) = -2099 + h + l. Let g(d) = 4d*2 + 14d. Determine k(g(w)). 4w2 + 14w Suppose 46 = 2u + 46. Let f(y) be the first derivative of -8 + uy - 5/2y2. Let t(r) = -2r. Give t(f(g)). 10g Let u(f) = f. Let m(k) be the third derivative of k7/420 + 2k*5/5 + 12k*2. Let x(z) be the third derivative of m(z). Give u(x(r)). 12r Let r(a) = -18a2. Let n(u) be the second derivative of -u3/2 - 197u. Calculate n(r(v)). 54v2 Let o(d) = -2d. Let x(i) = 4i2 + 462i. What is x(o(u))? 16u2 - 924u Let n(g) = 2g2 - 4. Let v(t) = 3t*2 + 391. Give n(v(x)). 18x*4 + 4692x*2 + 305758 Let g(z) = 4z*2 + 4z + 10. Let f(h) = 2h. Determine g(f(x)). 16x*2 + 8x + 10 Let v(c) be the first derivative of 6 - 20 + 4 + 12 + 4c2. Let x(n) = 3n. What is v(x(g))? 24g Let v(u) = 5u*2 - 1. Let w(q) = -917q. Give w(v(b)). -4585b2 + 917 Let w(b) be the first derivative of b3 + 5. Let z(o) be the third derivative of -3o*2 + 0 + 0o - 1/24o4 + 0o*3. Give w(z(p)). 3p*2 Let t(d) = 2d*2. Let p = -6 + 9. Let y(v) = -9v - pv - 7v + 22v. What is y(t(o))? 6o*2 Let f(c) = -17c*2. Let l(n) = 5n - 24. Let y(o) = -o + 8. Let j(i) = -2l(i) - 6y(i). Give f(j(b)). -272b2 Let f(j) = 24j*2 - 14j. Let l(m) = 124m - 1. What is l(f(b))? 2976b*2 - 1736b - 1 Let q(j) = 20j + 3. Let a(v) = -13v*2 + 4. Give q(a(t)). -260t*2 + 83 Let b(m) = 3m. Let a(g) be the first derivative of 45g2 - 277. Determine a(b(z)). 270z Let z(j) = -18j2 - 2j. Let g(w) = 10w2 + 3w. Let u(o) = 14o2 + 4o. Let v(a) = -4g(a) + 3u(a). What is z(v(c))? -72c4 - 4c2 Let b(v) = v2. Let t(l) = -l - 19. Let o be t(-14). Let d(f) = -22 + 22 - 12f. Let k(a) = 35a. Let z(g) = ok(g) - 14d(g). Determine b(z(p)). 49p2 Let b(z) = 5z*2. Let a = -5753 + 9710. Let r(o) = -a + 3957 - o. What is b(r(c))? 5c*2 Let r(s) = 15s*2 - 5s - 5. Let c(f) = 22f2 - 7f - 7. Let b(a) = -5c(a) + 7r(a). Let t(v) = -4v2. Give b(t(x)). -80x*4 Let a(n) = 1521n + 1. Let p(d) = -3d2 - 100. Determine p(a(l)). -6940323l*2 - 9126l - 103 Let m(k) = k. Let d(u) = -u*2 - 3u. Let t(b) = d(b) + 3m(b). Let g(i) = 74i*2. Give g(t(n)). 74n*4 Let z(d) = -152d - 143. Let k(p) = -4p + 4. Calculate z(k(a)). 608a - 751 Let c(n) = 38n. Let s = 22 - -241. Let u(j) = sj - j*2 - 263j. Calculate c(u(d)). -38d2 Let m(p) = -1340253p. Let n(q) = -2q. Give m(n(w)). 2680506w Let r(v) = 2v. Let p(h) = -71h*2 + 6h + 3. Let z(y) = 140y2 - 14y - 7. Let s(l) = 14p(l) + 6z(l). What is r(s(f))? -308f2 Let t(a) = -12a2. Let b(q) be the third derivative of q4/4 - 135q2. Determine t(b(v)). -432v*2 Let f(p) = 11p*2. Let b(m) = 8 - m + 7 + 9 - 27. Suppose 4v + 3r = 23, v + 3r - 9 = -r. Let h(d) = -d - 5. Let a(o) = vb(o) - 3h(o). Determine f(a(j)). 44j2 Let a(s) = -39881s*2. Let m(y) = -3y*2. Give m(a(v)). -4771482483v4 Let h(r) be the first derivative of -r6/180 - 7r3/3 - 2. Let b(k) be the third derivative of h(k). Let s(g) = -14g. Give b(s(m)). -392m2 Let t(y) = 7y + 4. Let c(o) = 13o + 7. Let v = 87 + -83. Let i(a) = vc(a) - 7t(a). Let h(q) = -3q*2 + 0q + 0q. Calculate i(h(p)). -9p2 Let q(w) = -w2. Let u(m) = -249151m2. Determine q(u(n)). -62076220801n4 Let x(z) be the second derivative of z4/3 + 3z. Suppose 5p - 29 = 116. Let s(b) = 30b - 2 + 2 - pb. What is s(x(w))? 4w2 Let y(l) = -9l - 48. Let u(i) = 2i + 1. Let b(h) = 4u(h) + y(h). Let g(s) = 2s2. Determine b(g(x)). -2x*2 - 44 Let n = -3 - -5. Let w(h) = 5h*n - 4h*2 - 2h*2. Let i(b) = -1. Let m(p) = -6p + 15. Let d(s) = -30i(s) - 2m(s). Calculate w(d(y)). -144y2 Let c(n) be the first derivative of 0n + 15 + 0n2 - n2 + 0n. Let i(a) = 4a + 0 + 0. Give i(c(z)). -8z Let i(y) be the third derivative of -y*5/60 - 28y*2 + 2y. Let r(h) be the second derivative of -23h4/6 + 13h. Give i(r(t)). -2116t4 Let u(n) = -2n*2 + 2n - 4. Let l(r) = 7r2 - 12r + 24. Let y(a) = -l(a) - 6u(a). Let t(g) = -3g - g + 12g. Calculate t(y(k)). 40k*2 Let l(z) = 15934z + 2. Let q(n) = -3n. Determine l(q(h)). -47802h + 2 Let o(n) be the first derivative of -n*2/2 - 16. Let p(c) = 7c*2 + 6c*2 - 10c*2. Determine p(o(v)). 3v*2 Let d(h) = -3h. Let u(k) = 141k2 - 32k - 1. Give d(u(n)). -423n2 + 96n + 3 Let h(b) = -17b2 + 2b. Let u(a) = 1740a2. Give h(u(o)). -51469200o*4 + 3480o2 Let h(g) be the first derivative of g2 - 51. Suppose -4 = -2z - j, 3j + j = 0. Let r(q) = q*2 - zq*2 - 2q*2 - 7q*2. What is r(h(v))? -40v*2 Let t(l) = -1708l - 4l2 + 1708l. Let z(f) = 28f2. Calculate z(t(d)). 448d4 Let t(w) be the third derivative of -w5/60 + 21w2 + w. Let q(d) = d2 + 152d. Determine t(q(o)). -o*4 - 304o*3 - 23104o*2 Let f(s) = 8s + 9s + 5s - 21s. Let q(o) = 24o + 1. Calculate q(f(m)). 24m + 1 Suppose -4m - 23 = -2z - z, 3m = 4z - 26. Let r(a) = -10a*2 - za + 2a + 3a. Let c(i) = 4i2. Calculate r(c(q)). -160q4 Let u(o) be the second derivative of o3/3 + 47o - 4. Let f(r) be the third derivative of -r5/10 + 2r*2. Give u(f(b)). -12b*2 Let c(k) = 471k + 39. Let v(y) = 2y. Give c(v(p)). 942p + 39 Let a(l) = 2*l. Let c(p) be the fir	{ "pile_set_name": "DM Mathematics" }
pose 7l = -fl + q. Is l prime? False Suppose -2z - 7 = 1, 4z + 36 = 4r. Suppose 5c - 10 = 0, 0 = -5q + 5c + 5 + r. Suppose 0l + 4d = -2l + 410, -qd + 619 = 3l. Is l composite? True Let h = 7113 + -4934. Is h a prime number? True Suppose -39r = -183r - 96r + 86947440. Is r a prime number? True Let c be 74/7 - 4 - (-18)/42. Suppose cv = 11793 + 3922. Is v a composite number? True Let z(r) = 15293r*2 - 56r - 241. Is z(10) prime? False Let i be (-3)/((-9)/2)181. Let f be (8/i)/((-6)/(-9)) - -5. Suppose -4k = p - 137, 0 = -4p + f - 18. Is k prime? False Let n be 245/98(-332)/(-10). Suppose 62s - ns = -13209. Is s composite? True Let n = -119 - -161. Suppose 0 = -nk + 48k - 12762. Is k prime? False Let v(r) = r3 - 16r*2 - 18r - 29. Let m be v(17). Let i be 8/6 - (-388)/(-24)m. Let k = i + -438. Is k prime? True Let n(l) be the first derivative of 53l*4/12 - 11l*3/3 - 13l*2/2 + 18l - 14. Let k(u) be the first derivative of n(u). Is k(-10) composite? False Let a = -45440 - -89661. Is a a prime number? True Suppose 3b - 5b = -3m + 7, 2b - 13 = -m. Suppose -ma + 3k = -46, a - 24 = -2a + 3k. Let q(c) = 80c - 17. Is q(a) prime? True Suppose -992214 - 655531 = -55f. Is f a prime number? True Let w(y) = -13y + 28. Let n(s) = 19s - 42. Let d(z) = -5n(z) - 7w(z). Let f be d(-11). Suppose 53 = 3x - f. Is x a prime number? True Let d = -6875 + 27748. Is d a composite number? False Suppose 4d - 24 = -4b, 3 = 5b + d - 15. Suppose -120 = 114v - 138v. Suppose 3h - vh = 0, bh = -3f + 261. Is f a prime number? False Let s(f) = 72f - 356. Let p be s(9). Let k = 81 + p. Is k a prime number? True Suppose -2s - 2k = -108152, -8s + 12s - 2k - 216346 = 0. Is s composite? False Let h = 655 + -650. Suppose 5s - 35163 = -2x, hs - 24694 - 10453 = 2x. Is s a prime number? False Let r(b) = b*2 - 20b + 35. Let f be r(18). Let t(s) = -367s + 4. Is t(f) composite? True Suppose 0 = -35p + 36p + 4r - 43927, 5p - r - 219572 = 0. Is p a composite number? True Let o be (2 + -1)913 + -3. Is 13/(o/30) + (-40646)/(-7) a composite number? False Suppose -161n + 166n + 2p - 862547 = 0, 3n = -2p + 517533. Is n prime? True Let l be (41 - 8/4) + (-3 - 0). Let i be (-2)/(-9) + (-8)/l. Suppose i = 41v - 42v + 353. Is v prime? True Let k be -4(-1 + (-920)/(-16)). Suppose 3z + 4i = 1, -z - 4i = -8i + 5. Is (z/2)/((-3)/(-18)) - k a prime number? True Suppose -3l = 35 - 8. Is 60/36 + (-34068)/l a prime number? False Let p(o) = -o2 + 7o - 7. Let z be p(4). Suppose -2479 - 2010 = 5m - a, -zm + 5a - 4505 = 0. Let s = -360 - m. Is s composite? True Let m(i) = 13551i*2 + 37i - 135. Is m(4) a composite number? False Suppose 4w + 994231 = 8i - 3i, 12i = 3w + 2386194. Is i composite? False Suppose -359 = 4g - 5567. Let z = g - -4199. Is z a composite number? False Suppose -5a + 5s + 4220 = s, a - 4s - 844 = 0. Suppose 17u = 18u + 5w - 9, -2w = -3u + 10. Suppose -2g = uy - 862, g + g - a = 5y. Is g prime? False Let m be 146018/18 - (-12)/(-9). Suppose -1094 = 6p - m. Is p a composite number? True Let u(b) = -297b - 21. Let v(d) = 4d - 24. Let f be v(5). Is u(f) a prime number? False Let m = 3002 + -917. Suppose 2n = -271 + m. Is n a composite number? False Suppose 0 = -37v - 77471 + 635172. Is v a composite number? False Suppose 62g = 35g + 270. Suppose -83315 = -gl + 5l. Is l a composite number? True Let q be 4 - (0/(-1))/(-12 + 13). Is -1 - (q + -2163 + -3) a prime number? True Let c(d) = 140d*2 + 2d + 151. Is c(-7) composite? False Let t be -3 + -832 + (-4)/1. Let o = 1243 + t. Is 2 + -4 + 1 + o a composite number? True Let t(f) = 12 - f*2 - 10f - 23 + 1 + 0f2. Let w be t(-9). Let l(i) = -308i - 1. Is l(w) a prime number? True Let r be 448/12 + (-2)/(-3). Let t = -38 + r. Is t + (-2 - (2 - 86 - 3)) prime? False Let k(t) = 6t3 - 4t*2 + 4t - 3. Let d be (-4)/(((-8)/3)/4). Suppose 0 = 4p - p - d. Is k(p) a prime number? True Suppose 4735092 + 2816131 = -974w + 1003w. Is w a composite number? False Suppose 9m = 4m + 25. Suppose 4r + r - 530 = -ml, 4r - 410 = 3l. Let b = r - 51. Is b prime? True Suppose 0 = 5a + 57 + 13. Let q(x) = x*3 + 15x*2 + 16x + 32. Let b be q(a). Is -4 + (b - -1183) prime? False Let a be (17 + 0)/((-12)/(-24)). Let d(j) = 2j*2 + 6j + 75. Is d(a) composite? False Let m(o) = 7o2 + 46o + 15. Let h be m(-6). Is 2617 + 11 + h/(-5 + 2) prime? False Suppose 289j - 295j + 38658 = 0. Is j prime? False Let f be (5 - -3)/(-2 - -4). Suppose 6k - 4k = 5x - 275, fk + 544 = 4x. Is k/90 - (0 - (-334)/(-4)) composite? True Let g = -6610 + 12581. Is g composite? True Let d = -85 - -80. Let z(x) = -x3 - 11x*2 + x + 21. Let q(m) = -2m*3 - 21m*2 + m + 43. Let g(p) = dz(p) + 3q(p). Is g(-11) a composite number? False Let u(x) = x3 + 35x*2 + 66x + 8. Let v be u(-33). Suppose -3h + 2681 = -7q + vq, 4q + 5h = 10696. Is q composite? True Suppose 9v - 12 = 7v. Suppose 2370 = 5r - 5z, vr + 3z - 923 = 4r. Is r a prime number? False Suppose -4a + 472819 = 3c, 27673 + 129952 = c + 4a. Is c composite? True Let r be 36/27/21. Suppose 4j - 2a - 17156 = 5870, 5a + 28770 = 5j. Suppose -rq = -20203 - j. Is q a composite number? False Let n = 683 - 1312. Suppose -4d - 2h + 9072 = 0, 5d + 3h = 3d + 4536. Let j = d + n. Is j a prime number? False Suppose 2d - 48 = -2d. Suppose -2l - 2l + d = 0. Suppose -u = -l, -3g + u = -0g - 282. Is g composite? True Suppose 5h - 644089 = 4z, -83069 + 469490 = 3h + 3z. Is h a prime number? True Let i = -180 - -105. Let f = -75 - i. Suppose 0 = -5v - 5h + 5275, 5283 = 5v + 3h - fh. Is v composite? True Let k = 233954 + 84955. Is k prime? False Suppose -7 = -k + 89. Let o = k + 733. Suppose 3h + 4t - 1282 = o, 3h - 2095 = 4t. Is h composite? False Let s(z) = -8z - 326. Let u be s(-40). Is (-20730)/u + (-6)/(-3) a composite number? False Suppose 11f = -0f + 10901. Let p = f - 489. Is p a composite number? True Suppose -4c - 99 + 91 = 0. Is c/((-8)/23)148 prime? False Let h = 137 + -135. Suppose 16y - hy = 47446. Is y a prime number? True Let y(g) = 178g3 + g2 - 2g + 2. Let a(o) = 2o + 22. Let c be a(-8). Let w = 7 - c. Is y(w) a composite number? False Let w(f) = f2 + 37. Let z(r) = r2 - r + 74. Let h(p) = -5w(p) + 3z(p). Let x be h(0). Let t = x - -16. Is t prime? True Suppose 3f + 73 = 5n, -2n - f = -7 - 20. Suppose -11d - 2031 = -nd. Is d prime? True Suppose 5x + 5u = -1015, 5x - 5u + 942 + 63 = 0. Let g be ((2 - 6) + 2)x. Let z = -213 + g. Is z prime? True Let w(z) = -z3 - z2 + z - 1. Let a be w(1). Let x(l) = 5l*2 + 4l. Let j be x(a). Suppose 6b + 7158 = jb. Is b a composite number? False Let k(x) = 22x2 - 2x + 7. Let v(q) = 65q2 - 7q + 21. Let b(p) = -8k(p) + 3v(p). Suppose -d + h + 14 = 12, -d - 4h = -7. Is b(d) prime? True Let x be 1/25568/(-16). Is ((-87)/x)/(2/32876) composite? False Is (-22)/4 + (-13)/26 + 834919 a composite number? False Let n = -362842 + 549291. Is n a prime number? False Let p be -2(-2)/(-1) - (255 - 1366). Suppose -940 - 482 = 3i. Let k = i + p. Is k prime? False Let h(s) = -s + 43. Let m be h(38). Suppose -20z + 21z - mb - 3683 = 0, 0 = -5z - 3b + 18415. Is z a composite number? True Suppose -5v + 2v + 3p - 9 = 0, 0 = -2v + 5p - 15. Suppose v = -28o + 93486 + 195278. Is o prime? True Suppose 3s + 11s - 9154 = 498892. Is s composite? True Let d(n) be the third derivative of 59n*5/15 - 49n*4/24 - 4n*3/3 - 18n*2. Is d(-6) a composite number? True Let r(m) = -4m*2 + 2. Let d be r(-3). Let g = 39 + d. Suppose y - 7 = -2, -gy = -2c + 633. Is c prime? False Let s be 1628/8 + 7/14. Let p = s + 3455. Is p prime? True Let n(p) = 1745p*2 - 3p - 6. Let s(m) = 1745m2 - 2m - 5. Let x(o) = -4n(o) + 5s(o). Is x(2) composite? False Suppose -11v + 16589 = -271644. Is v composite? False Let s be (-1)/2(23 - 43389)7. Suppose 0 = -5h - 2h + s. Is h composite? False Let s(u) = -u - 22. Let g be s(-22). Suppose 0 = -3n - gn + 2694. Is n a prime number? False Suppose 37b - 79b + 126 = 0. Is 179/b(1 - -122) a prime number? False Let a(n) be the second der	{ "pile_set_name": "DM Mathematics" }
, -l + 33 = -8u + 3u. Solve -3q = -lq for q. 0 Suppose -y + 4b - 4 - 2 = 0, 0 = 5b - 10. Solve 0 = -3x + x - y for x. -1 Suppose 3x + 0x - 5f = 35, -3f - 65 = -4x. Suppose 2z - 7z + x = 0. Solve zj - 13 = 3 for j. 4 Let t(o) = -o2 - o + 7. Let j be t(0). Let b = -1 + j. Solve -b = -3m - 0 for m. 2 Let a be (-24)/(-42)(-7)/(-2). Solve 5n = -13 - a for n. -3 Suppose 0 = 3f + 2x - 11, -5x + 19 = -f. Let s be (-39)/(-18) + f/(-6). Solve 0 = si + 3i + 20 for i. -4 Suppose 0q + 16 = 4q. Solve qt + 0t = -20 for t. -5 Let g(k) = k2 - 3k + 3. Let t be g(3). Suppose -5y = -41 + 6. Let f(o) = -5o. Let m be f(-1). Solve -tu = y + m for u. -4 Suppose -3b + p = -10, 0p = -b + p + 4. Let s be (-9)/27 + (-4)/(-3). Solve 2j - b - s = 0 for j. 2 Suppose 0f - 3z + 3 = 3f, -24 = 4f - 3z. Let w be 1 - 0/(f/(-1)). Let a = 6 - w. Solve -b = -ab + 8 for b. 2 Let c = -5 + 9. Solve -1 = -3o - c for o. -1 Suppose 6f + 14 = 68. Solve -5b - 24 = -f for b. -3 Let c(x) = -x3 - 8x*2 + 10x + 11. Let m be c(-9). Suppose 0 = mt + 2t. Solve tj = j - 4 for j. 4 Let c = 17 + -2. Suppose -5 - c = -4f. Suppose fu + 26 = 3l, -3u + 1 + 5 = 0. Solve 5t + 3 = -l for t. -3 Let s(v) = -13v - 4. Let l be s(-3). Suppose -2u + l = -0b + 5b, 2u - 20 = -2b. Suppose 0 = -0m - um + 10. Solve 0 - m = -j for j. 2 Let k = -4 - -8. Suppose -3x + 55 = -x + 5q, -45 = -kx + 3q. Solve 5t + x = 2t for t. -5 Let v(h) = -h*3 + 2h*2 + 2h - 1. Let u be v(2). Suppose 16 = 5y + 2c, uy - 5c - 20 = -c. Solve y = -5j + 6j for j. 4 Suppose 5m - 2 = 28. Let u be (2/(-6))/((-1)/m). Suppose 65a - 32 = 61a. Solve up = -0p + a for p. 4 Suppose -i - 4i = r, 5i = -3r - 10. Let h be -1 + 6 + i + -1. Solve 0 = -hg - 1 - 9 for g. -2 Let c be (-2)/(2 - 1) - 9. Let p = 13 + c. Solve s - 3s + p = 0 for s. 1 Let s(k) = k*2 + 12k + 14. Let v be s(-10). Let i be 1 - (-2)/v3. Solve 3l - 2 - 1 = i for l. 1 Let t be 2 - -1(0 - -1). Solve -4 = f + tf for f. -1 Let r be (-1 + 1)(-4 - -5). Suppose -2n = -r - 6. Solve -c - 2 = n for c. -5 Suppose 2k - 4 = -2. Let p = -7 + 13. Suppose -u = -4u + p. Solve f + k = uf for f. 1 Let m be ((2 + -2)/(-1))/1. Solve m = 3d + 6 for d. -2 Let x(c) = -c*3 + 6c*2 - 4c - 2. Let i be x(5). Suppose -4s - 3g = i - 10, -2g - 3 = -5s. Let o(j) = -j + 2. Let n be o(-3). Solve -3h + s = -n for h. 2 Let f be (2/4)/((-1)/(-142)). Suppose -79 = -5h + f. Suppose -u = u - h. Solve 2l = -l + u for l. 5 Let c(i) = i - 12. Let p be c(7). Let d be 9/5 - 1/p. Solve d = 3x - 10 for x. 4 Let g = -4 - 2. Let z be (-8)/39/g. Suppose -5n + n - zi = 12, 5n = 4i + 12. Solve nl + 12 = 4l for l. 3 Suppose 6u - u = 0. Suppose 0 = r - ur. Solve -2p - p - 9 = r for p. -3 Suppose 21 = 5b + 11. Solve -bh + 5 = -3 for h. 4 Suppose 4r = -0r. Suppose r = -0m - 4m. Let p be (1 - 12)-4. Solve -po + mo = -12 for o. 3 Let z(a) = a. Let r be z(1). Solve -r = -v - 0 for v. 1 Let x be 3/2 - 10/20. Solve -1 - x = -2g for g. 1 Suppose k + 3k = 0. Solve -5 = g - k for g. -5 Suppose -j - 10 = -6j. Let f be -3 + (-7)/(-7) + 6. Solve fz = jz - 2 for z. -1 Suppose p = 3p. Let z = -3 - -5. Suppose 0 = zh - 0h - 8. Solve p = 2x - x + h for x. -4 Suppose 0y + 4y = -3i + 20, y = -4i + 18. Solve -c = 3c - i for c. 1 Let h = -1 - -1. Suppose h = -a - 2a + 27. Let q be (-6)/2 - a/(-3). Solve z + z + 6 = q for z. -3 Suppose -4i + i = 0. Let l(j) = j*3 + 11j*2 + 9j - 5. Let b be l(-10). Solve d - b = -i for d. 5 Suppose -5x = z + 3z - 3, 0 = -2x - 2z. Suppose 0 = -xq, 3d + 0d = q + 15. Solve -2o = -do + 6 for o. 2 Let a = 2 + -1. Let r be (-1 - (-21)/2)(-14)/(-7). Solve 4j - r = a for j. 5 Let o be (48/(-32))/(2/(-16)). Solve -v = -5v + o for v. 3 Let p(w) = w - 5. Let a be (4/6)/((-1)/(-12)). Let g be p(a). Let j(z) = -5z - 1. Let v be j(-1). Solve -vd - g = 5 for d. -2 Let d = 6 - 8. Let k be 2 + (-2 + 2)/d. Suppose -4u + 5u + 4 = -kr, 0 = -2u - r + 1. Solve 4 = uj - 0j for j. 2 Suppose 0 = -2l + b, 0l + 22 = 5l + 3b. Let r = l + 1. Let o = r + -1. Solve 4 = d + o for d. 2 Suppose -5t = -2g - 10 + 1, 3 = g. Suppose 0q - 4r - 16 = 2q, -3r - 12 = -tq. Solve q = p - 6p for p. 0 Suppose t - 4 = 0, -t = 2f - 4t + 16. Let s be (4/(-2))/(0 - f). Let b be (s3)/(6/(-4)). Solve -1 = bp - 9 for p. 4 Suppose 5f = -5, 0 = 3z - 2f - f - 6. Suppose 3o - 5 = z. Let d = 1 + 5. Solve 0x - d = -ox for x. 3 Suppose 2 - 2 = 5m. Solve m = -h + 4h + 15 for h. -5 Let d(b) = -b*3 + 5b*2 - 3b - 4. Let o be d(3). Let g = o - 5. Solve gn = n for n. 0 Suppose 5n + 3x - 51 = 27, -2n + 44 = -2x. Solve 2l - n + 8 = 0 for l. 5 Let b be 84/(7 - -1). Suppose -bw + 3r + 15 = 0, 2w + 2w = 4r + 20. Solve -4i + wi = 0 for i. 0 Suppose 10 + 15 = 5s. Suppose -sd + 4 + 15 = 2p, 4d - 16 = -2p. Solve 4 = -pm - 2 for m. -3 Suppose 4c + 33 - 11 = 5q, c = -4q + 5. Let a = 2 - -24. Suppose i + 0 - 7 = -y, 4y - a = -3i. Solve -ib = -q + 6 for b. -2 Let m(j) be the second derivative of -j*5/120 + 13j4/12 - j3/3 + 2j. Let l(k) be the second derivative of m(k). Let s be l(0). Solve -4c + s = 6 for c. 5 Let m(d) = -d*2 - 7d - 6. Let l be m(-5). Suppose 0v = 2u - 2v - 8, u = -lv + 14. Solve 0 = -uc + 4c - 4 for c. -2 Suppose x - 6 = -1. Let o = x + -2. Suppose -h + 51 = 3f, 0 = 2f + of + 5h - 85. Solve -1 = -4r - f for r. -4 Let z(s) = s3 - 7s*2 - 9s + 4. Let l be z(8). Let q = -2 - l. Solve -qr + 5 = -3 for r. 4 Let y be (8/(-10))/(2/(-5)). Solve -yx = -x + 4 for x. -4 Let z(y) = -y + 3. Let q be z(0). Let s = -9 - -29. Solve -qi + 7i = -s for i. -5 Let w = -17 + 22. Solve -1 + w = -u for u. -4 Let s(t) = t*3 - 3t*2 + 4. Let z be s(3). Solve -5q - 14 = -z for q. -2 Let g(d) be the third derivative of -d*4/12 + 13d3/6 - d2. Let k be g(-6). Solve 0p + 5p = k for p. 5 Suppose -3h = 2h + v - 19, -v = 3h - 13. Solve 5c - 8 = hc for c. 4 Suppose 5k - 12 = -2. Suppose kj - 31 = -3f + 6j, -5f + 29 = -j. Solve 12 - 27 = ft for t. -3 Suppose -90 = -3i - 39. Solve -12u + 5 = -iu for u. -1 Let l be 4/5 - (-2)/10. Let s(c) = -c*3 + 2c*2 + 3c - 2. Let u be s(3). Let y = -2 - u. Solve y = -3z + 4 - l for z. 1 Suppose 3f - 4 = 5f, 0 = 4g - 2f - 16. Solve -g = 2k - 3k for k. 3 Suppose -2v = 2m - 10 - 8, -4 = 4m. Let d(z) = z*2 - 6z - 5. Let x be d(5). Let h = -7 - x. Solve q = hq - v for q. 5 Suppose -7 + 47 = 4r. Suppose -2n - 4y = -9 - 15, 3n + 19 = 5y. Let t be (-1)/n + 14/4. Solve r = -ti + 8i for i. 2 Let n = 12 + -12. Solve 5b + nb = 10 for b. 2 Suppose -2q + 0q - 7 = -3b, 2b - 2 = 2q. Solve -15 - 1 = -qr for r. 4 Suppose -5x - 2 = 5l - 7, -4l = -3x + 3. Suppose 3f = -3 - l. Let p be 01/(-3 - f). Solve s - 5 = -ps for s. 5 Let n be 4/(-5)(-30)/4. Suppose -7 = c - 5b + 23, -b = -2c - 15. Let p = c + 8. Solve 0 = -po - 0o - n for o. -2 Suppose -5y = -7 - 3. Suppose 0 = n + ym - 7 - 2, -m = -n. Solve -10 - 5 = nt for t. -5 Let q(m) = -m2 - 12m - 34. Let j be q(-5). Solve -2d + j + 1 = 0 for d. 1 Let n be -2 - (2 + 2)/(-1). Let x = 0 - 0. Let c = n + x. Solve -cf + 4f = 0 for f. 0 Let k be (0 - (-1 - 1))30. Suppose -t = 4t + k. Let f = 20 + t. Solve 0 = -4r - f - 4 for r. -3 Let u be ((-6)/7)/((-4)/28). Suppose 3p + 3y - 2 = -p, -6 = -5p - 2y. Suppose 0k - 20 = -5k. Solve u + p = kd for d. 2 Let i(u) = -2u*2 + 14u + 2. Let r be i(7). Solve -4 = q - rq for q. 4 Let z(q) = -q3 + 3q*2 + 9q + 5. Let o be z(5). Solve -3s = -3 - o for s. 1 Let x(i) = -11i*2 + 27i + 16. Let j(r) = -5r2 + 13r + 8. Let s(a) = 13j(a) - 6x(a). Let d be s(-6). Solve -n - 3 = dn for n. -1 Suppose -f - d = 3, 0 = -4d + 9d + 25. Solve 0 = fp + 2 for p. -1 Let d(g) = g*2 - 18g + 4. Let v be d(18). Solve 0 = vn - n for n. 0 Suppose -2f = -4 + 16. Let g = 7 + f. Solve -2h = 1 + g for h. -1 Let n be (9 + -1)(4 + -2). Solve 0k = 4k - n for k. 4 Suppose 0 = 3s - 9, -2r - s + 14 = 3s. Let d be 18 + 2 - (r + -1). Solve -2b + 7b + d = 0 for b. -4 Let r = 5 - -3. Solve 0 = -p + 3p + r for p. -4 Let l = -132 + 132. Let v = 4 - 3. Solve l = -2w - 3 - v for w. -2 Let t(k) = 4k -	{ "pile_set_name": "DM Mathematics" }
(98)1 - sqrt(2) - sqrt(2)))2 - (sqrt(605) + 1)25. -110sqrt(5) - 41/5 Simplify sqrt(34)/(1sqrt(242)) + (4 + -6sqrt(17) + 1)*2. -659sqrt(17)/11 + 637 Simplify (sqrt(144)/(sqrt(1296)/sqrt(3)))/((3sqrt(1728) - sqrt(1728))/sqrt(3)). sqrt(3)/144 Simplify ((sqrt(99) + -2)-1 - (-1 + sqrt(99) + -2 + sqrt(99)) - (-2sqrt(99) + 0 + -6-2sqrt(99)))2. -390sqrt(11) + 16756 Simplify ((sqrt(200) - (-1 + sqrt(200) + sqrt(200) - sqrt(200)) - (-2 + (sqrt(32) - sqrt(2))))*2 + sqrt(10)/(sqrt(20)/sqrt(4)-2))-1. -27 + 37sqrt(2)/2 Simplify 5 + (sqrt(35) + sqrt(105)/(sqrt(9)/sqrt(3)))/((1sqrt(28))/sqrt(4)). 2sqrt(5) + 5 Simplify (1 + sqrt(14)/sqrt(2) + 5 + 4sqrt(567) + -3 + sqrt(567))2. 276sqrt(7) + 14821 Simplify 5 + ((sqrt(12)2)21 - ((4 + sqrt(27))-1)2). -24sqrt(3) + 10 Simplify (-4-6((1sqrt(77) - sqrt(77)) + sqrt(77)))/((sqrt(175) - -1sqrt(175))3). 4sqrt(11)/5 Simplify ((sqrt(242)-1 - sqrt(2)) + (sqrt(6)/sqrt(3) + 1 - sqrt(2)))2 - ((0 + sqrt(2))22 + 5). -24sqrt(2) + 280 Simplify -1 + ((sqrt(147)-3)/sqrt(7))/(sqrt(7) - (sqrt(14) - sqrt(98)/sqrt(7))/sqrt(2)). -3sqrt(3) - 1 Simplify ((5(sqrt(20)2 + sqrt(20)) - (sqrt(180) - (2sqrt(180) + sqrt(180))))/((sqrt(10) - (sqrt(10) - 5(sqrt(10) + sqrt(10)-2)))-6))2 + -2. -51/50 Simplify ((sqrt(11) - 2sqrt(396) - ((2 + sqrt(275))*2 - sqrt(11))) + -3)3. -846 - 90sqrt(11) Simplify (sqrt(171) + (-1sqrt(171) - sqrt(171))-3 - sqrt(171) - (2sqrt(171) - sqrt(171))-3)/((1(sqrt(90)2 + sqrt(90)) + sqrt(90) - sqrt(90))/sqrt(10)). 3sqrt(19) Simplify 4((sqrt(228)/(3(sqrt(12) - (1sqrt(12) - sqrt(12) - sqrt(12)))) + (2sqrt(209)5)/sqrt(11))-1)*2. 70699/9 Simplify 1 + sqrt(833) + (sqrt(17)-3 + sqrt(17))-1 + -4. -3 + 9sqrt(17) Simplify 3(-1 + sqrt(1700)-152). -300sqrt(17) - 3 Simplify ((sqrt(11) - (sqrt(11) + 0)) + -5)2 + sqrt(121)/(sqrt(22)/sqrt(2)) + 5 + ((1 + sqrt(275))-4 + sqrt(275))*2. 121sqrt(11) + 2521 Simplify -1(2 + (sqrt(3) + -3)3 + sqrt(3) + 0)*2. -97 + 56sqrt(3) Simplify ((-5 + sqrt(612) + -2)-6)2 - (sqrt(34) + ((2sqrt(4896) - sqrt(4896)) + sqrt(4896) - sqrt(4896)))/(sqrt(6)/(-1sqrt(3) - sqrt(3))). -2998sqrt(17) + 23796 Simplify ((sqrt(51) + -1sqrt(459))4)/(sqrt(36)/(3sqrt(12)2)). -48sqrt(17) Simplify (1 + 6(sqrt(171) - sqrt(171)1)3 + (-1-1sqrt(171) + sqrt(171))3)2. 36sqrt(19) + 6157 Simplify (1 + sqrt(117) + -2 + sqrt(117) + -1 + 1)*2. -12sqrt(13) + 469 Simplify ((sqrt(300) + -6(sqrt(300) + (sqrt(300) + 3 - sqrt(300))) + sqrt(300))2 + 4)*2. 5120sqrt(3) + 20224 Simplify (6(sqrt(152) - sqrt(152)-1) - (((sqrt(152)2 - sqrt(152)) + sqrt(152))-1 + sqrt(152)))/(-4(-1sqrt(80))/sqrt(10)). 13sqrt(19)/4 Simplify 5(sqrt(363) - (sqrt(363)2 - sqrt(363))-6)*22-2. -355740 Simplify (sqrt(400)/(2sqrt(10)) + sqrt(1000) + sqrt(1000)1 + sqrt(1000))/(-3sqrt(32) + sqrt(8) + sqrt(48)/(sqrt(6)1)). -31sqrt(5)/8 Simplify (2 + ((5 + sqrt(20))-4 - -16(-1sqrt(5) + sqrt(5))))*2. 288sqrt(5) + 644 Simplify (sqrt(36)/(sqrt(8)/sqrt(4)5))/(2sqrt(81)-2). -sqrt(2)/60 Simplify -5 + (3 + -3sqrt(99) + sqrt(99) + sqrt(99))*2 + 3 + -1. -18sqrt(11) + 105 Simplify 4 + (sqrt(931) - -3sqrt(931)1 - (-5 + sqrt(931) + 3 + sqrt(931))). 6 + 14sqrt(19) Simplify 3 + ((sqrt(931)-6)*2 + sqrt(931) - sqrt(19)) + 5 + -5sqrt(19) + sqrt(19). 2sqrt(19) + 33524 Simplify (sqrt(352)-3)/(1sqrt(2)-6)-1 + -1. -2sqrt(11) - 1 Simplify (sqrt(78)1-4)/(2sqrt(54))-1. 2sqrt(13)/3 Simplify (5 + sqrt(405) + 0 - ((sqrt(45)-1)/sqrt(9) + (sqrt(90)/sqrt(3))/sqrt(6))*2) + 1. 6 + 9sqrt(5) Simplify (3(sqrt(204)15 + sqrt(204)))/((sqrt(12) - (sqrt(12) + sqrt(24)/sqrt(2)))-3 - (sqrt(60)/(sqrt(10)/sqrt(2)) - sqrt(12))). 6sqrt(17) Simplify (sqrt(11)-1-3 + 3)2 + -3sqrt(11)-16. 108 + 36sqrt(11) Simplify ((sqrt(1573) + 2 + sqrt(1573) + 1)2 + -1)-1. -6300 - 132sqrt(13) Simplify ((-1 + sqrt(252) - (1 + sqrt(112))) + ((sqrt(567) - (2 + (sqrt(567)3 - sqrt(567))))*2 - sqrt(567)))-4. -2276 - 116sqrt(7) Simplify (4-1sqrt(912))/((2sqrt(48) - sqrt(48))-1). 4sqrt(19) Simplify (3 + ((sqrt(208) - -2sqrt(208)-2) + sqrt(208) + sqrt(208) + ((sqrt(208) + sqrt(208) + -1)2 - sqrt(208)))-61)2. -1440sqrt(13) + 30177 Simplify (-5(5 + -2sqrt(425) + -5 + -5))*2. 2500sqrt(17) + 43125 Simplify ((sqrt(133) - (sqrt(133) - (-6(sqrt(133) - sqrt(133)1) + sqrt(133) - sqrt(133))) - sqrt(133))-2)/(sqrt(28)/(-1sqrt(400) + sqrt(4))). -18sqrt(19) Simplify 3(sqrt(17) - (sqrt(17) + -2))4-41. -96 Simplify 16((-2sqrt(275) - sqrt(275))*26 + (sqrt(275) - (5 + -2sqrt(275) - sqrt(275)))2) + 2. -1200sqrt(11) + 115652 Simplify (sqrt(425)-26 - (sqrt(68)/sqrt(36) + -3)) + 3 + -4. -181sqrt(17)/3 + 2 Simplify 5 + (-2 + 2(sqrt(2057) + 1)6)2 + 2. 2640sqrt(17) + 296315 Simplify (1sqrt(98)-26 + -1)2. 168sqrt(2) + 14113 Simplify -5((sqrt(8)/sqrt(4)4)*2 + -4) + -5. -145 Simplify (sqrt(425) + -4 + (sqrt(136) - (sqrt(136) + (sqrt(136) - 2sqrt(136))))/sqrt(8))-33. -54sqrt(17) + 36 Simplify (sqrt(4)/sqrt(2) + -5 - 3(2 + sqrt(2)))*2 + (1sqrt(18)-2)/(sqrt(90)/(sqrt(90) + sqrt(10)) + sqrt(9) - sqrt(9)). 36sqrt(2) + 129 Simplify (-1 + (sqrt(2736)-1 - sqrt(2736) - sqrt(2736)) - sqrt(2736) - (1 + -2 + sqrt(475) + sqrt(475)))2-2. -127832 Simplify ((sqrt(63)3 + 1 - ((sqrt(7) - (-4 + sqrt(28))) + sqrt(7) + (sqrt(63)/(sqrt(45)/sqrt(5)) - sqrt(7))))2)*2. -216sqrt(7) + 2304 Simplify -1 + -1 + ((sqrt(95)-1 - sqrt(95))-1)/sqrt(5). -2 + 2sqrt(19) Simplify -4((2 + sqrt(304) + sqrt(304))*2-2 + -3(0 + sqrt(304))). 304sqrt(19) + 9760 Simplify (-3(sqrt(468) - (sqrt(468) + (sqrt(468) - 1sqrt(468)))) + 5 - (-1 + (sqrt(1872) - -1(sqrt(1872) - (sqrt(1872) + sqrt(1872)2)))))*2. 144sqrt(13) + 1908 Simplify (sqrt(1216) - (sqrt(1216) - (sqrt(1216) + (sqrt(1216) - (0 + -2sqrt(1216) - sqrt(1216))))2) - -6-1sqrt(1216))-6 + -2. -182402 + 288sqrt(19) Simplify ((sqrt(325)2 + 5 - sqrt(325)) + 3 + 1sqrt(325) + 2 + -2)2. 160sqrt(13) + 1364 Simplify ((2 + 1sqrt(539))2 - (-3 + -1sqrt(539)))-3. -1638 - 105sqrt(11) Simplify (((1sqrt(66)-1 - sqrt(66)) + sqrt(66) + sqrt(66) - (1sqrt(66) + sqrt(66))4)/(-42sqrt(486) + sqrt(486)))*2. 704/3969 Simplify ((sqrt(187)12)/(2sqrt(1331)) + -5)*2. -10sqrt(17)/11 + 3042/121 Simplify ((-2sqrt(960) + sqrt(960))-3)/((sqrt(12) + -1sqrt(432))-5). 12sqrt(5)/25 Simplify 3((sqrt(275)-3 + sqrt(275) - sqrt(275))2 + -3 + 2 + sqrt(11)). 3sqrt(11) + 7422 Simplify 0 + ((sqrt(448) + 3)2 + 0 - (sqrt(448) - (sqrt(448) + -2)2-2)). -447 + 104sqrt(7) Simplify (((sqrt(190) - 6(sqrt(190)-1 + sqrt(190) + sqrt(190)))-6)/((1sqrt(100)6 - sqrt(100))/sqrt(10)))2. 684 Simplify 2 + 1 + sqrt(1573) + 0 + ((-5 + (sqrt(1573) - (-2 + sqrt(1573) + sqrt(1573))) - sqrt(1573))2)*2. 539sqrt(13) + 25207 Simplify -1(4 + 5 + ((sqrt(208) + 1 + sqrt(208) - sqrt(208))2)*2). -845 - 32sqrt(13) Simplify -1(-4 + sqrt(2)-1) - sqrt(400)/(sqrt(8) + sqrt(8)-2). 4 + 6sqrt(2) Simplify 4(sqrt(2673)2 - sqrt(33))/(-1(-1sqrt(3) - sqrt(3))). 34sqrt(11) Simplify (sqrt(832)-1 - sqrt(832))-3-3 + 1 + (sqrt(13) + sqrt(39)/sqrt(3))*21-5. -144sqrt(13) - 259 Simplify -3 + (sqrt(56) + sqrt(56) + sqrt(280)/(sqrt(10)/sqrt(2)))/(sqrt(32)/(sqrt(8)/sqrt(2))). -3 + 3sqrt(7) Simplify (sqrt(156)/(sqrt(150) - sqrt(150)-2))/(sqrt(20)/(1sqrt(810))) + 2. 2 + 3sqrt(13)/5 Simplify -3(sqrt(425)2 + -4sqrt(68) + sqrt(119)/(sqrt(63)/(sqrt(18)/sqrt(2)))). -9sqrt(17) Simplify (4 + (-1(-1sqrt(180) - sqrt(180)) + sqrt(180)1-5)-5)2. 720sqrt(5) + 40516 Simplify -5 + (((sqrt(66)3 - sqrt(66) - sqrt(66))-2)/sqrt(6) - (sqrt(99) - ((sqrt(99) + sqrt(99)-1)-5 + sqrt(99)))/sqrt(9))*2. 39 Simplify (2sqrt(2448) + -2 + sqrt(68)/(sqrt(12)/sqrt(3)) + 2sqrt(68))2. -116sqrt(17) + 14301 Simplify ((1sqrt(240)-3 - sqrt(240) - sqrt(240)) + sqrt(240))/(5(sqrt(3) + sqrt(900)/sqrt(12))). -8sqrt(5)/15 Simplify (sqrt(45)/(-2sqrt(3)))/sqrt(3) + (sqrt(480)/sqrt(8)5 + sqrt(60))/sqrt(12). 11sqrt(5)/2 Simplify -4(-4 + -1 + -2 + (-1sqrt(720))2) + -1. -2853 Simplify -5(-3sqrt(6)3)/(sqrt(75)-3)-6. 18sqrt(2) Simplify 3 + (-6(-2 + sqrt(2592) - sqrt(2592)) + -4 + 1sqrt(2592))2. 576sqrt(2) + 2659 Simplify (-6*(sqrt(66) +	{ "pile_set_name": "DM Mathematics" }
. -6 Express 3n2 + 5n3 + n - n4 - 6n3 - 3 - 3n*2 in the form q + xn*4 + gn + hn2 + jn*3 and give x. -1 Express (7b*2 - 7b*2 - 3b*2)(-3b2 + 7b*2 - 2b*2) in the form w + hb*2 + pb + tb3 + ub*4 and give u. -6 Rearrange (3c - 3c - c)(-22c - 5c + 7c)(-5c + 2c + 2c) to hc*2 + rc + ic3 + j and give i. -20 Rearrange 2 + 114l*3 + 6l - 3l - 115l*3 to b + ol + sl3 + cl*2 and give s. -1 Express -13 + 5 + 8 + 10h*2 in the form wh*2 + dh + b and give w. 10 Express (-4 + 3 - 7)(19z - 28z - 5z)(2z2 - z2 + z*2 + (z - 2z + 2z)(0z + z + z)) in the form dz*3 + c + hz + az2 and give d. 448 Express (-2b*2 + 3b*2 - 4b*2)(3 - 1 - 4)(-1 + 1 + 4b) as x + lb2 + gb + zb3 and give z. 24 Rearrange (2r - 2 + 2)(-2 + 0 + 4)(17 - 20 - 30) to the form ur + z and give u. -132 Rearrange -3y*3 - 3y*2 + 0y*3 + 5y*3 + 2 + 5y*2 to fy*3 + by*2 + o + ay and give f. 2 Express 0j + 0j + 13j3 - 2j*2 - 22j*3 as hj + cj3 + b + gj2 and give g. -2 Rearrange -x4 + 6x4 - 3x*4 + (-3x + 0x - 2x)(x3 - 2 + 2) - 2x*4 - 3x + 3x to the form f + jx*4 + sx + bx3 + cx*2 and give j. -5 Rearrange -7s - 11s - 10s - 14s to j + bs and give b. -42 Express (s*3 + 0s*2 + 0s*2)(-5 + 3 + 0)(1 - 1 + 2s + (0s + s + s)(-2 + 2 + 2) + 24s + 2 - 2) as ms*4 + i + bs*2 + os + ds3 and give m. -60 Express 23i - 6 + 6 in the form m + ri and give r. 23 Express (1 + 0 - 2k + 0k)(2 + 6 + 0) as s + nk and give n. -16 Express (2c*2 - 2c3 - c2 + c*2)(-4c - 5c + 15c) as x + gc*2 + fc + zc3 + ac*4 and give a. -12 Rearrange (-5 + 0 + 2)(-2d + 2d - 2d2)(-7d + 18d - 5d) to the form x + gd*3 + sd + td2 and give g. 36 Rearrange (6r*3 + 3r3 + r3)(2r + 0 + 0)(-5 + 2 + 4)(-6 + 4 + 4) - 2r + 2r*4 + 2r to the form ir + xr*4 + sr*2 + hr*3 + t and give x. 42 Rearrange (-12j*3 + 25j - 25j)(10j - 4j + 8j - 3j) to the form i + bj + kj*4 + wj*3 + pj*2 and give k. -132 Rearrange -16s + 0s - s + 0s to w + is and give w. 0 Express -3 + 0g*2 + 2 - 16g*2 + 2 as d + fg + og2 and give d. 1 Rearrange 44m*2 + 3m*2 - 12m*2 to the form im + w + rm2 and give r. 35 Express 58z*2 + 1 - 10z*2 - 1 in the form s + dz + tz2 and give t. 48 Rearrange -3z + 2z + 18z + 5 - 3z - 5 - z + 2z + 0z - z + 3z - 3z + (-2 - 2 + 6)(-z + 0 + 0) - z - 5z + 4z to bz + y and give b. 10 Express 10y - 17y + 11y + 2 in the form d + zy and give d. 2 Rearrange -5g*3 + 7g*3 - 1 + 8g*4 - 7g*4 to the form l + xg*3 + rg*4 + jg + hg2 and give h. 0 Rearrange (16 - 73 + 21 - 2h)(-h + h + 2h) to the form a + ph + mh2 and give a. 0 Express -j3 - 2j4 + 5j + 2j + 0j - 5j as xj + sj2 + f + vj*3 + uj*4 and give u. -2 Rearrange (-22l + 22l + 4 - l2)(5 + 2 - 3) to f + vl2 + wl and give f. 16 Rearrange (5k3 + k3 + k - k3)(-4 - 4k + 4) to the form rk + ok4 + zk*2 + vk*3 + a and give z. -4 Express (-2m + 4m + 5m)(-1 - 3 + 2) - 3m + m + 3m as y + im and give i. -13 Rearrange -5a4 - 20 + a3 + a3 + 19 - 2a*2 to na + qa3 + wa*2 + pa4 + d and give d. -1 Express -u2 - 7u - 6u + 11u in the form lu + hu2 + p and give l. -2 Rearrange (10 + 3o - 10)(2o + 0 + 0)(0 + 0 + 3o*2)(-1 - 3 + 3) to the form h + do3 + lo*2 + mo + so4 and give s. -18 Rearrange (-17 - 10 - 18)(-t*4 + 5t*4 - 3t*4) to it*3 + a + rt*4 + ft + kt2 and give r. -45 Express (1794 + y2 - 1794)(2 + 3y - 1 - 5y) in the form cy + h + ky*2 + gy3 and give k. 1 Express -s3 - s3 + s4 + 2 - 3 + 3s2 - s2 in the form ms + u + is2 + gs*3 + rs*4 and give i. 2 Rearrange -m + 2m4 - m2 - 1 + 3 - 4 + 3m2 to dm + om2 + cm*3 + am*4 + f and give a. 2 Rearrange -20n*3 - 1 - 17n*3 + 0 to kn*2 + z + wn + sn3 and give s. -37 Rearrange r + 3r*4 + 0r - 3r - 5r4 + r3 + 3r2 to the form fr*3 + br*4 + i + kr + cr2 and give k. -2 Rearrange (6x - 2x - 2x)(0 - 3 + 2)(0 - 2 + 1)(-1 - x + 1) to the form ax*2 + m + cx and give a. -2 Express 2s - 2 - 454s*2 - 5s*3 + 454s*2 in the form hs*2 + gs*3 + k + ds and give g. -5 Express -3p + 5p - p as qp + d and give q. 1 Rearrange (0o - o - o)(8 - 1 - 1)(-3o + 1 - 1) to the form m + wo*2 + so and give w. 36 Rearrange (11f2 + 3f*3 - 11f*2)(13 - 3 + 0)(0 + 0 - 2f) to sf3 + z + hf*4 + af*2 + of and give h. -60 Rearrange -2 - a*2 - 4a3 - a4 + 4a4 - 2a*4 - 3a*4 to sa*2 + fa + k + ga4 + la*3 and give g. -2 Rearrange 3d + 58d2 - 4d + 3d - d to the form cd*2 + ud + h and give c. 58 Rearrange -13n + 9n + 11n to the form mn + b and give m. 7 Rearrange -3 + 266j + 7j*2 - 266j to cj2 + s + fj and give s. -3 Express 3v2 - 25 + 5v*3 + 29 + 2v - 3v3 as u + fv*3 + wv*2 + kv and give k. 2 Rearrange 6n - 61n + 25n to the form pn + a and give p. -30 Express 26k + 6k - 11k as r + vk and give v. 21 Rearrange -17v2 + 31v*2 - 26v*2 to zv*2 + av + b and give z. -12 Express -x + 13x + 3x as k + vx and give v. 15 Rearrange 963 - 16z*2 - z - 963 to the form wz + x + iz2 and give w. -1 Rearrange (1 - 1 + 15o*2)(-3 + 0 + 2)(-5 - 2 + 2) to mo + co2 + t and give c. 75 Rearrange -13j*3 + 6 + 0 - 4 + 36j*3 to the form kj*3 + hj + fj2 + m and give k. 23 Express -33 + 32 - 2z*2 - 3z*3 - 2z*2 in the form lz*2 + rz + m + pz3 and give m. -1 Rearrange (-2y - y + 4y)(7y - 2y - y) + (-2y - 2 + 2)(-2y + 3y + y) + y*2 + 2y2 - y2 - 2y2 + 6y*2 - 2y*2 to i + zy + vy2 and give v. 4 Rearrange (3 - 3 - 1)(0o2 + o2 + 0o*2) + 49o*2 - 25o*2 - 20o*2 - 4o*2 + 3o*2 + 2o*2 to the form do + a + qo2 and give q. 4 Express -3s + 49s + 66s as v + cs and give v. 0 Rearrange (0n + 2n - 3n)(-4 + 5 - 3) + 88 - 88 + 199n to zn + i and give z. 201 Rearrange -d2 + 4d3 + d3 - d + 6d2 to the form a + xd*2 + zd*3 + jd and give x. 5 Express -6u - 2u + u + u as du + r and give d. -6 Express -1815 + 96o*2 + 1815 as z + bo*2 + lo and give b. 96 Express (-y*2 + 2 - 2)((-5 + 2 + 2)(-4 + 2 + 0) - 3 + 25 - 4) in the form sy + iy2 + c and give i. -20 Rearrange -3 + 3 - 2f + (-4 + 1 + 2)(-2 + 3f + 2)(-1 + 2 + 1) to u + qf and give q. -8 Express 8x3 + 101x*2 + 4x3 - x3 - 99x2 as l + nx*2 + cx*3 + zx and give c. 11 Express -8c - 8 - c - 2c*2 - 9c + 17c as lc*2 + nc + u and give l. -2 Rearrange ((0 + 4 - 2)(3 + 1 - 6) - 1 - 1 + 0 + 1 - 5 + 2)(-h + 4h + h)(-4 + 2 + 4) to the form b + mh and give b. 0 Express -3z*3 + 5z4 - z4 - 3z4 + 3 - z in the form c + fz*4 + pz*2 + bz*3 + gz and give g. -1 Rearrange 3173 - 3173 - 138w to the form qw + m and give q. -138 Rearrange (-1 - 2 - 1)((l - 3l + 7l)(-2 + 2 - 2l) + (-3l + 0l + l)(-3l + l + 4l)) to the form z + wl + pl*2 and give p. 56 Express 2q + q*2 - 5q*2 - 2q + 5 in the form o + dq + rq*2 and give d. 0 Rearrange -j + 4 - 10 + 10 + 4j*2 to cj + i + sj2 and give s. 4 Rearrange 1 + s2 + 0 - 2s*3 + 3 - 2 to as + cs3 + n + fs*2 and give n. 2 Rearrange (0r*3 + 5r*3 - 3r*3)(0r - 2r + r) + 4r4 + 0r*4 + 2r*4 to kr + yr3 + j + ar*4 + gr*2 and give k. 0 Express 4t - 4t - 57t*2 - 3t*3 + 59t*2 + 2 in the form ft*2 + ht + zt3 + n and give f. 2 Express -4a + 7a2 - 6a*2 + 2 - 3a*2 - 3a*3 in the form wa*3 + ga*2 + za + h and give h. 2 Express 197h2 - h - 57h*2 - 98h*2 in the form oh*2 + jh + y and give o. 42 Express (-6v - 2v + 7v + 3)(5v - 96 - 4v*2 + 96) in the form o + rv + fv2 + zv*3 and give z. 4 Rearrange 31 - 23 - 8 - 205w to kw + h and give k. -205 Rearrange (2n3 + n3 - n*3)(1 - 3 - 1) - 2n3 + 2 - 2 + (3n - 8n + 2n)(-4n*2 - 2n*2 + 4n*2) to the form jn*2 + h + fn + yn3 and give f. 0 Express 14o*3 - 2o - 15o3 + 15 + 1 in the form fo*2 + x + io*3 + jo and give i. -1 Rearrange (-14 + 14 + 6x)(2x2 - 5x*2 + 5x**2)	{ "pile_set_name": "DM Mathematics" }
(7) Simplify sqrt(27)2-2. -12sqrt(3) Simplify (sqrt(143)/(1sqrt(11)) + -2 + sqrt(325))*2. -24sqrt(13) + 472 Simplify (4(sqrt(5) - (-1 + sqrt(5))) + -3)2 + 5. 6 Simplify (sqrt(110) - (sqrt(110)1 + sqrt(110))-4)/sqrt(10). 9sqrt(11) Simplify (5-2sqrt(108) + 4(sqrt(108) + -1sqrt(108)))2. 10800 Simplify (-1 + sqrt(833))2 + 4. -14sqrt(17) + 838 Simplify -2(-6(-6sqrt(119) + sqrt(119)))/sqrt(7). -60sqrt(17) Simplify (5 + -2sqrt(180)-4)2. 480sqrt(5) + 11545 Simplify (sqrt(95)/sqrt(5)3 - (-2 + sqrt(171) + sqrt(171) + sqrt(171))2)4. -6172 + 156sqrt(19) Simplify sqrt(91)/((-1sqrt(63))/sqrt(9))4. -4sqrt(13) Simplify (5 + (sqrt(200)/(sqrt(10) + sqrt(40)/sqrt(4)))/((-2sqrt(36))/sqrt(9)))2. -5sqrt(5)/2 + 405/16 Simplify (sqrt(176) - (1 + sqrt(176))) + (sqrt(11) - ((2 + sqrt(99) - sqrt(11)) + sqrt(11))). -2sqrt(11) - 3 Simplify ((sqrt(1053) - (sqrt(1053) + -1)4) + 2)*2. -324sqrt(13) + 9513 Simplify 2(4 + ((sqrt(2) + (sqrt(6)/sqrt(3))2)2 - sqrt(2))-5). -32 - 10sqrt(2) Simplify (sqrt(1700) - (-4 + sqrt(1700)))4. 16 Simplify sqrt(99)/(sqrt(27)/sqrt(3)2). sqrt(11)/2 Simplify (sqrt(152)-2-2)/sqrt(8). 4sqrt(19) Simplify 2(1 + sqrt(6)/sqrt(2))1. 2 + 2sqrt(3) Simplify sqrt(39)/(sqrt(27)-1). -sqrt(13)/3 Simplify (sqrt(7) - (1sqrt(21))/sqrt(3))2 + 0. 0 Simplify (-2(sqrt(17) + ((1sqrt(17) - sqrt(17)) + -4 - sqrt(17))))2. 64 Simplify ((sqrt(304) - (-3 + (-1sqrt(304) - sqrt(304)))) + (-1 + sqrt(304))-4)2. -56sqrt(19) + 353 Simplify (sqrt(3) - (4 + sqrt(147))) + 2. -6sqrt(3) - 2 Simplify (5 + sqrt(5) + sqrt(5) + 0)2 - -5sqrt(45). 45 + 35sqrt(5) Simplify (1(sqrt(19)5)2 + -5)-2. -940 Simplify sqrt(51)/(sqrt(2187) + sqrt(27)). sqrt(17)/30 Simplify ((sqrt(1331) + 0)1-2)*2. 5324 Simplify (sqrt(1372)1)/(sqrt(4) + 2sqrt(4)1). 7sqrt(7)/3 Simplify sqrt(343)21. 14sqrt(7) Simplify (((sqrt(19) - (sqrt(19) + sqrt(152)/sqrt(8))) + 1)*2 + -1)5. -10sqrt(19) + 95 Simplify (-4 + sqrt(2448) + -2)2. -144sqrt(17) + 2484 Simplify (sqrt(95)-1-3 - sqrt(95))/(sqrt(35)/(sqrt(7)-2)). -4sqrt(19) Simplify ((-1 + sqrt(637)-2 - sqrt(637) - -3(sqrt(637) + 0 + sqrt(637))) + 2)*2. 42sqrt(13) + 5734 Simplify (sqrt(99) - (sqrt(99) + (sqrt(99) + sqrt(99)-1 + sqrt(99))-1 - sqrt(99)) - sqrt(99))/sqrt(9)-4. -4sqrt(11) Simplify (4 + sqrt(4)/(-4sqrt(2))3)*2. -6sqrt(2) + 137/8 Simplify 1 + sqrt(612) + -1. 6sqrt(17) Simplify -4sqrt(66)/sqrt(54). -4sqrt(11)/3 Simplify 3sqrt(2) + sqrt(2) + -3 + sqrt(2) + (sqrt(288) - sqrt(288)-1). -3 + 29sqrt(2) Simplify 3((sqrt(272))2 + 4). 828 Simplify 1 + ((sqrt(20) - (1 + sqrt(720))) + -1 + sqrt(20) + 1)2. 16sqrt(5) + 322 Simplify (sqrt(1088) - 2sqrt(1088))-2. 16sqrt(17) Simplify (-5(-2 + sqrt(176)) + -5)*2. -200sqrt(11) + 4425 Simplify 3(2 + sqrt(288)). 6 + 36sqrt(2) Simplify (sqrt(10)/sqrt(2) + 2)6. 12 + 6sqrt(5) Simplify (sqrt(13) + -1 + 2 - (sqrt(1573) + 0)*2)-6. -6sqrt(13) + 9432 Simplify (sqrt(171)/sqrt(9) + sqrt(19) + 2)2 - 2sqrt(475). -2sqrt(19) + 80 Simplify sqrt(13) + 1 + -4 + (sqrt(104)/sqrt(8))2-5. -68 + sqrt(13) Simplify -1 + sqrt(3) + (sqrt(9)/sqrt(3))2 - (-1 + sqrt(192))2. -191 + 17sqrt(3) Simplify (3sqrt(5))*2-5 + 1 + sqrt(20). -224 + 2sqrt(5) Simplify (sqrt(56)4)/sqrt(8) + sqrt(28) + -2. -2 + 6sqrt(7) Simplify 1 + (-3sqrt(270))/sqrt(10). -9sqrt(3) + 1 Simplify 43(0 + sqrt(425))-2. -120sqrt(17) Simplify 4 + sqrt(3)1 - (sqrt(27) + -5)*2. -48 + 31sqrt(3) Simplify -4 + (3 + sqrt(288) - sqrt(288))*2. 5 Simplify 6sqrt(12)/((sqrt(60)/sqrt(3))/sqrt(5)). 6sqrt(3) Simplify (sqrt(2000) - sqrt(2000)-3)/(sqrt(4) - 4-1sqrt(4)). 8sqrt(5) Simplify 4 + 0 + (sqrt(13)-3-6)2. 4216 Simplify ((0 + sqrt(468))-12)2. 1872 Simplify sqrt(52)/sqrt(4)-1 + -4 + (0 + sqrt(117) + sqrt(13) + -5)*2. -41sqrt(13) + 229 Simplify (0 + sqrt(75))*254. 1500 Simplify (2sqrt(288)2 - sqrt(288))/sqrt(6). 12sqrt(3) Simplify sqrt(1008)-2 + -5 - sqrt(1008) - 6-2sqrt(252). -5 + 36sqrt(7) Simplify (-3sqrt(120)/sqrt(2))/(sqrt(36)/sqrt(3)5). -3sqrt(5)/5 Simplify -1 + sqrt(800) - (5sqrt(6)/sqrt(3) - ((-1 + sqrt(2) - sqrt(2))1)2). 15sqrt(2) Simplify 4 + sqrt(1584) + 1 + 5 + 1. 11 + 12sqrt(11) Simplify (sqrt(22) - sqrt(88)-2)/sqrt(11). 5sqrt(2) Simplify (sqrt(39)/(3sqrt(12) - sqrt(3)))2. 13/25 Simplify (sqrt(11) + sqrt(77)/(sqrt(21)/sqrt(3) + sqrt(7)))2 + (sqrt(396) - (sqrt(396) + sqrt(396) + sqrt(396) + 0)). -12sqrt(11) + 99/4 Simplify ((sqrt(1700) + 1 - sqrt(1700)) + -2)2. 1 Simplify (-1(sqrt(175) - ((sqrt(175) + 1 - sqrt(175)) + sqrt(175) - sqrt(175)) - sqrt(175)))*2. 1 Simplify ((sqrt(20) - sqrt(720))-3)/(sqrt(4) + ((sqrt(64)-2 - sqrt(64)) + sqrt(4) + sqrt(4) - sqrt(4))). -3sqrt(5)/2 Simplify sqrt(19) + -1 + 0 + 2sqrt(19)2. -1 + 5sqrt(19) Simplify sqrt(2299)2 + 4 + -1. 3 + 22sqrt(19) Simplify sqrt(10)/(sqrt(245) + 2sqrt(245) + sqrt(245)). sqrt(2)/28 Simplify -1(sqrt(7) - (1 + sqrt(63)))-4. -8sqrt(7) - 4 Simplify (0 + sqrt(72)-2)2. 288 Simplify sqrt(396) + (2 + sqrt(396))2 - ((sqrt(1100) + (2 + sqrt(1100) - sqrt(1100)))*2 - sqrt(11)). -704 - 9sqrt(11) Simplify (sqrt(405)-3)/(sqrt(90)/sqrt(160)) + 4. -36sqrt(5) + 4 Simplify (2sqrt(171)-6)/(sqrt(9) + sqrt(108)/sqrt(3)). -4sqrt(19) Simplify (sqrt(5)3 + 0)2 - (sqrt(5) - (2 + -1 + sqrt(5) + sqrt(5))). sqrt(5) + 46 Simplify sqrt(1872) - (-5 + (sqrt(1872) + (sqrt(1872) + sqrt(1872) + -4)2 - sqrt(1872))). -7499 + 204sqrt(13) Simplify (sqrt(2057)-2 + -2 - (4 + sqrt(2057) + sqrt(2057)2))2. 660sqrt(17) + 51461 Simplify 3sqrt(588) + 3. 3 + 42sqrt(3) Simplify sqrt(30)/(-2sqrt(6)) + -4(sqrt(5) + 2 + sqrt(5)). -17sqrt(5)/2 - 8 Simplify ((-1sqrt(450) - sqrt(450))/((sqrt(6) - sqrt(96))-5))2. 4/3 Simplify (-6sqrt(57)/sqrt(3) + (sqrt(209) - sqrt(209)1)/sqrt(11))2. 684 Simplify 5sqrt(26)/(sqrt(22)/sqrt(176)). 20sqrt(13) Simplify 2 + (-1 + sqrt(171))2. -6sqrt(19) + 174 Simplify (3 + (sqrt(833) - (sqrt(833) + (sqrt(833)1 - sqrt(833))))-4)*2. 9 Simplify sqrt(18)/(2sqrt(6)) + (sqrt(6)/sqrt(2))*2 + -5. -2 + sqrt(3)/2 Simplify (3 + (sqrt(1900) - (0 + sqrt(1900))) + (sqrt(1900) - (sqrt(1900) + 0 - sqrt(1900))1))*2 + 3. 60sqrt(19) + 1912 Simplify (2sqrt(15)/(sqrt(5)-2))*2. 3 Simplify (sqrt(500) + 0 + sqrt(500))56. 600sqrt(5) Simplify -2 + ((-1 + sqrt(99) - sqrt(11)) + 1)*2. 42 Simplify 4 + (sqrt(11) + 2)-6. -6sqrt(11) - 8 Simplify (sqrt(9)/sqrt(3)-3 - sqrt(768))*2-4 + 5. -4327 Simplify 1 + 5(sqrt(5) + 2 + sqrt(5) + -2). 1 + 10sqrt(5) Simplify 5 + (sqrt(300)-2)2 + sqrt(300). 10sqrt(3) + 1205 Simplify -4(sqrt(2299) + -1)2 - sqrt(2299) - sqrt(209)/(-1sqrt(891) - sqrt(891)). -9200 + 1387sqrt(19)/18 Simplify (-1 + 0 + sqrt(3388))2. -44sqrt(7) + 3389 Simplify (6(3 + sqrt(11)-1)-6)2 + 1. -7776sqrt(11) + 25921 Simplify 3 + (sqrt(5)-1-6)*2. 183 Simplify (-1 + 1 + sqrt(720)-1)*2. 720 Simplify 0 + 3 + 3sqrt(125). 3 + 15sqrt(5) Simplify sqrt(5)2 + 1 + sqrt(5) - -3(sqrt(45))2. 3sqrt(5) + 136 Simplify 0 + sqrt(176) + -4 + sqrt(11) + sqrt(22)/sqrt(2). -4 + 6sqrt(11) Simplify ((0 + sqrt(539))-4)*2 + -1. 8623 Simplify -1 + (sqrt(34) + sqrt(34)1)/sqrt(2)1. -1 + 2sqrt(17) Simplify -5(-4 + (sqrt(9)/(sqrt(3)2))2). 65/4 Simplify ((2 + sqrt(612))2 + sqrt(612))-6. -3696 - 180sqrt(17) Simplify sqrt(78)/(sqrt(486)2). sqrt(13)/18 Simplify (0 + sqrt(76) + 3)2. 6 + 4sqrt(19) Simplify (2 + (sqrt(13) + sqrt(91)/(sqrt(112) + sqrt(7) - sqrt(7)) - (-5 + sqrt(52))))2. -21sqrt(13)/2 + 901/16 Simplify ((sqrt(88)1)/sqrt(2))/(sqrt(48)/sqrt(48)). 2sqrt(11) Simplify (sqrt(132)/sqrt(48))*22 + (0 + sqrt(396))*2 + -5sqrt(44)/sqrt(4). -5sqrt(11) + 803/2 Simplify ((sqrt(875) - (sqrt(875) + -1sqrt(875)) - sqrt(875)) + sqrt(35))/(sqrt(28) + sqrt(112)). sqrt(5)/6 Simplify sqrt(4)/(sqrt(12)/(sqrt(6)3)). 3sqrt(2) Simplify ((sqrt(12)/sqrt(54) - sqrt(2)) + 1)*2 + 5. -4sqrt(2)/3 + 62/9 Simplify (sqrt(176)/(sqrt(20)/sqrt(5)))*2. 44 Simplify (sqrt(2) + -3sqrt(2)2)-2 + (3sqrt(2)1 - (sqrt(2) + (sqrt(242) + 1)*2)). -243 - 10sqrt(2) Simplify (1(-1 + sqrt(11)) + sqrt(891)2)*2. -38sqrt(11) + 3972 Simplify ((sqrt(117) - 6(sqrt(117) - (3sqrt(117) - sqrt(117))))/sqrt(9))*2. 637 Simplify (3(s	{ "pile_set_name": "DM Mathematics" }
- 4b - 3b*2)(0b2 + 2b*2 - 3b*2). 4b4 + b3 Expand (-3 + 2 - 14j + 3 + (2 - 2 + 2j)(-2 + 5 - 5))(5j4 + 17j*2 - 17j*2). -90j*5 + 10j*4 Expand (-3 + 2 - 1)(j2 - j2 + j*3) - 431j*3 - 804 + 804. -433j*3 Expand 0y + y*3 + 0y + y*2 + 2 + 2y*3 + 40y - 40y + (6y*2 + y - y)(-2y - 3y + 2y). -15y3 + y2 + 2 Expand (0 + 23 + 2)(0 - 7 + 3)(-n + 0n + 2n). -100n Expand (-2g + 2g3 + 2g + (1 - 6 + 2)(22 - 22 + 37g*3))(-4 + 2g + 3 + 0). -218g*4 + 109g*3 Expand (-32 + 32 - 5m*3)(-2m + 1 - 1 + (-6m + 0m + 2m)(2 - 2 - 3)). -50m*4 Expand (2 + 1 + 3)(146 - 146 + 10w + (-2w - 2 + 2)(-2 + 4 - 1)). 48w Expand (-2h3 - 2 + 2)(2 + 2 + 0 + (2 - 5 + 1)(3 - 5 + 3))(-3h2 + 4h*2 - 3h*2). 8h*5 Expand ((4 - 4 + 2)(2 + 1 - 4) - 4 - 1 + 4 + (-24 + 5 + 4)(0 + 1 + 0))(-3m + 0m + 2m). 18m Expand (3 + 14 + 13)(-17t*2 + 184 - 184). -510t2 Expand (w3 + 0w3 - 3w*3)(-w*2 + 0w*2 + 0w*2) - 5w*5 + 3w5 + w5 + (55w3 - 7w*3 - 25w*3)(1 + w*2 - 1). 24w*5 Expand (-80t - 81t - 15t)((-t - t + 0t)(0t2 + t2 - 2t2) - t3 - 3 + 3). -176t*4 Expand (-34x - 1525 + 1525)(-2 + 3x - 3x - 3x)(-1 + 2x + 1)(x - 1 + 1). 204x*4 + 136x*3 Expand (9 + 13 - 14)(x*4 + 2x*4 + 3x*4). 48x*4 Expand (-10d - 20d - 18d + (-2 + 1 + 0)(0d + d - 3d))(2d + 0d - d). -46d2 Expand (c - 2c + 3c)(-c - 3c2 + c) + (c - 6c + 3c)(39c2 - 43c*2 + 137c*2). -272c*3 Expand -4c - 2c + 4c + (3c + 4c - 5c)(-2 + 5 - 1) + (0c - 4c + 6c)(4 - 3 - 3) + 6225 - 98c - 6225. -100c Expand -3s3 + 2s*3 - 5s3 + (s2 + s*2 + 0s*2)(-1 + 1 + s) - 11s - s3 + 0 + 3 - 2. -5s*3 - 11s + 1 Expand -165i2 + 63i*5 + 165i2 + (i4 - 3i4 + 4i*4)(2i + i - i). 67i5 Expand (1 - 1 + t2)(-791t + 164t3 + 791t). 164t5 Expand (-4b + 5b + 0b)(-43b3 - b3 + 4b3) + 4b*4 - 3b4 + b4. -38b4 Expand ((0 + 6 + 1)(-l + 3l - l) - 3l - l + 13l)(0l2 + 3l2 - l2). 32l3 Expand 63z*4 - 8z*4 + 34z4 - z4 + 0z4 + 0z4 + (1 + z4 - 1)(0 + 0 + 2). 90z*4 Expand ((0 - c + 0)(0 + 3c + 0) + 0c*2 - 8c2 + c2)(-8c*2 - 2 - 2c*3 + 7c*2 + 7c*3). -50c*5 + 10c*4 + 20c*2 Expand (-4 + 3 + 3)(26 + 4 + 0)(3m*4 + 5m*4 + 5m*4). 780m*4 Expand 2p*3 - 5p*3 + 0p*3 + (-8p*3 + 41p*3 + 5p*3)(2 - 2 + 3). 111p3 Expand 2y3 + y2 - y*2 + (0 + 1 - 3)(-4y3 + 16y*3 + 12y*3). -46y*3 Expand (-3 + 2 - 1)(-2r - r - r + 4). 8r - 8 Expand (2 + 2q2 - 2)(-q + 2 - 2) + 0q3 + q3 - 4q*3. -5q*3 Expand -3a4 + a4 + a*4 - 9 + 9 + 3a*4 + (-56a - 18a2 + 56a)(-3a*2 + 0a*2 + 5a*2). -34a*4 Expand (d + d + 0d)(3 + 4 - 4)(7d - d - 2d)(0 - 1 + 3)(16 + 23 - 28)(-4d - d + 3d). -1056d*3 Expand (14v*2 + 9v*2 - 48v*2)(-3v + v + 5 - 4). 50v*3 - 25v*2 Expand (0 + 0 - 2)(3y + 0y - 2y) + (16y - 8 - 9y - 4y)(5 - 2 - 4)(4 + 0 - 2). -8y + 16 Expand (5d + 4 - 5 - 1)(d - 2d - 5d). -30d*2 + 12d Expand (10i + i - 2i)(3i - 5i + 4i + i*3). 9i*4 + 18i*2 Expand -2d + 2d + 5d*3 + (2 - 6 + 1)(1 - 1 + 4d)(3d - 3d - d*2). 17d*3 Expand (b - 2b + 0b)(b - 2 + 2) - 12b2 - 4b*2 - 3b*2. -20b*2 Expand (8x*2 + 11x*2 - 6x*2)(30x - 17x - 23x - 1). -130x*3 - 13x*2 Expand ((2j*3 - 2j3 - j3)(-2 - 4 + 3) - j3 - 5j + 5j)(2j - 2j + j)(3j + j - 3j + (-j - 5 + 5)(-4 + 3 + 5)). -6j5 Expand (0f - 7f3 + 0f)(21 - 43 - 17). 273f*3 Expand 6o - 3o - 8o*5 - 5o + (4 - o*4 - 4)(2o - o - 4o). -5o5 - 2o Expand (-2p3 + p3 - p3)(2 - 3 + 0) - 1888p3 - 78828 + 78828. -1886p*3 Expand (3 - 2q - 3)(0q + 0q + 4q*4) - 9q*5 + 0q*5 - 27q*5 - 2q + 2q5 + q - q. -42q*5 - 2q Expand -5a2 + 5a*2 - 2a*5 + (-1 - 2a*4 + 1)(-2a - 2a + 6a) + 1 - 1 + 2a*5 + 4a*5 - 30a*5 - 12a*5. -42a*5 Expand (0h + h - 3h)(58h3 - 30h*3 - 32h*3). 8h*4 Expand (33v - 118v + 27v)(-1 - 2 + 1). 116v Expand (3t - t + 40t)(-t - 2t + 4t) + (-1 + 1 - t + (0t + t + t)(2 - 1 + 0) - 2 + 2 + t - t - 3t + 5t)(-4 + 4 - t). 39t2 Expand (5 + 0 - 3)(42y + 41y - 45y)(-2 + 5 - 4) + 2y + y - 2y + (5 - 3 - 3)(2y - 6y + 2y). -73y Expand (2 + 1 - 5)(2a3 - 11365a - 2a2 - a4 + 11365a). 2a4 - 4a*3 + 4a*2 Expand (-2z + 8z + 3z)(-z2 + 0z*2 + 3z*2)(z - 2z + 4z). 54z4 Expand (2 + 1566p - 791p - 756p)(-p - 2p + 0p). -57p*2 - 6p Expand (679o3 + 1012o*3 - 2229o*3)(3 + 0 - 2). -538o3 Expand (-1 - 18 - 6)(31x + 10x - 7x + 43x). -1925x Expand ((-3u + 0u + u)(-1 - 3 + 3) - 2 + 6u + 2 + 4u + 0 + 0 + (-4 + 4 + u)(-5 + 4 + 2))(-3 - 1 + 3). -13u Expand j + 2j - j - 3j - 2j + 7j + j + j - 3j + (0 + 4 - 3)(0 + 2j + 0) + j - 4j + 4j + 2j - 2j + 2j + 273j + 279j - 545j - 3. 15j - 3 Expand (-3 + 9 + 8)((-2 - 4b + 2)(0 - b + 0) + 3b2 - 6b2 + b2 - b2 - b2 + b*2). 14b*2 Expand (0w + w + 0w)(554w - 188w + 498w). 864w*2 Expand (-6x + 4x + 4x + (-2 + 0 + 1)(2x + x + 0x + (3 + 1 - 3)(2x + x - 2x) + 2x - 2x - 2x + x - 3x + 4x))(0x - 4x + 0x). 8x*2 Expand (-3m - 4 + 4)(2m*3 - 7m3 + m3)(3m + 7m - 4m). 72m5 Expand (-27m - 25m + 208m)(-m + 1 + 0m - 7m). -1248m*2 + 156m Expand o + 0o + o - o - 4o + 3o + (-o + o + 2o)(3 + 1 - 6) - 3 + 3 - 2o - o - 2o + o + (o + 3o - 3o)(-6 + 3 + 2) + 4o - o - o. -7o Expand (-387j - 450j + 223j - 47j)(-7 - j - 1 + 3). 661j*2 + 3305j Expand (-s - 2s + s)(-2s2 + 0 + 0) + 14292s + 36 + 5s3 - 14292s. 9s3 + 36 Expand q4 + 2q4 - q4 - q4 - q3 + q*3 + (3q2 + q2 - 6q2)(0 + 2q2 + 0) + 4q - 4q4 + q4 + 2q*4 - 2q*3 - 2q3 + q4 + 2q3. -3q*4 - 2q*3 + 4q Expand (3 - 5 + 0)(-2m + 6 - 2 + 5) - m + 3m + 0m. 6m - 18 Expand (-606b - 366b2 + 142b*2 + 609b)(0b - b - b)(-1 + 2b*2 + 1). 896b*5 - 12b*4 Expand (-887 - 1052 - 1514 - 1243)(2r2 + 0r*2 - 4r*2). 9392r2 Expand (z3 - 3z4 - z4 - 2z*3)(-32 + 31 + 37). -144z4 - 36z*3 Expand (-2 - 2 + 3 + (-2 + 0 + 3)(0 + 1 + 1) - 1 + 10 - 1)(-j + 0j - 3j). -36j Expand (2o - 3o - o)(2 + 6 - 7)(-1 - 10 + 8). 6o Expand (0h*4 + 2h*4 - 3h*4)(4h - h - 5h) - 5h4 - 2h*5 + 5h4 - h5 + 0h5 - 6h*5 + (3h + 3h - 4h)(2h4 - h4 - 2h4). -9h5 Expand (-h3 - 3 + 3)(2 - 4 + 1) + h3 - 2h*3 + 3h*3 - 2h*2 + 2h*2 - 2h*3 + (-3h2 + h2 + 4h2)(312 - 123h - 312). -245h*3 Expand (-1 + 6 - 4)(2 + 2h - 2) + (0 - 14 + 7)(-2h - 2 + 2). 16h Expand (4f2 - f2 - f2)(-6f + 4 - 4) + 7f*3 - 7f*3 + 2f*3. -10f*3 Expand 11i*3 - 110778i*2 + 110778i*2 + (4i - 5i + 3i)(i2 - 3 + 3) - i + i3 + i. 14i3 Expand -20 - u3 + 20 + (5u - u - 3u)(-2 + 2u*2 + 2) + 2u*2 - 2u*2 + 2u*3 + u + 2u*3 - u + (8u + 0u - 4u)(0u*2 - 2u*2 + 3u*2). 9u*3 Expand (25x*2 - 23x*2 + 29x*2)(-5 - 5x2 + 5). -155x*4 Expand -5z + z + 3z + (-4z + 9 - 9)(18 + 2 - 38). 71z Expand ((-4 + 6 - 1)(1 - 1 - c) + 5 - 5 - 2c)(-14c2 + c3 - 5c3 + 12c*2). 12c*4 + 6c*3 Expand (-1 + 1 + 2m)(3m + 2m - 3m)(0 - 3 + 1 + (1 - 4 + 2)(2 - 4 + 0) + 0 + 0 + 1)(-3 + 2 + 2). 4m*2 Expand 3110v - 3110v - 12v*2 + 1 + (1 - 1 + 1)(-2v2 - v2 + 2v*2) + (-5v + 3v + v)(-2 + 2 + v). -14v2 + 1 Expand (2w - w + 2w)((-2w + 2w - 2w2)(w*2 + 0w2 + w2) - w + w - w4) + w3 - 4897w5 + 0w*4 + 2w*4 + 4902w*5. -10w*5 + 2w4 + w3 Expand (3f4 - 4f + 4f - 11f)(9 + 0 + 9). 54f*4 - 198f Expand (4z4 + z4 - z4 - 5z*4 + 3z*4 + 3z*4 + (2z - 6z + 5z)(3z*3 - 5z*3 + 0z*3))(26z - 53z + 83z). 168z*5 Expand 14c*2 - 80c + 80c + (-5 - c + 5)(c - 3c + 4c). 12c2 Expand (6z - 3z - z)(0z2 + z2 + 4z*2 + 1 + (5z - 6z + 30z)(-2 - z + 2)). -48z*3 + 2z Expand (3t2 - t2 + t2)(-26 + 35 + 4t - 42). 12t*3 - 99t*2 Expand (0v - v - v)(-3 + 4 + 2) - v + 3v + 0v + 0v + 6v - 3v +	{ "pile_set_name": "DM Mathematics" }
). Calculate a(j(o)). -25o4 Let j = -6 - -10. Let x(o) = -3o*2 - 2o*2 + jo*2 + 0o*2. Let z(y) = -6y. Calculate z(x(c)). 6c2 Let q(r) = r3 + r - 2. Let g be q(0). Let m(f) = f3 + 2f*2. Let u be m(g). Let h(y) = uy*2 + 2y2 + y2 - y2. Let k(z) = -z2. Determine k(h(l)). -4l4 Let v(u) = -6u + 29. Let w(x) = -x*2. What is w(v(n))? -36n*2 + 348n - 841 Let y(p) = -p. Let d(t) = t + 1937. Calculate y(d(b)). -b - 1937 Let f(j) = -4j2 - 2. Let b(h) = -17h + 56h - 20h - 18h. What is b(f(s))? -4s2 - 2 Let v(b) be the second derivative of b3/2 + 32b. Let j(u) = 52u. Determine v(j(t)). 156t Let h(c) be the third derivative of c4/6 - 5c*2. Let v(s) = 3s*2. Calculate h(v(t)). 12t*2 Let x(b) = -b. Let k(w) = -6w*2. Determine x(k(z)). 6z*2 Let a(i) = 6i. Let p(y) = y*2 + 10y. Give a(p(f)). 6f2 + 60f Let s(n) = -5n2. Let g(p) = p2 + 212. Calculate g(s(d)). 25d4 + 212 Let s(k) = -k2. Let m(g) be the third derivative of 0g4 + 0g + 0g3 + 0 - 1/60g*5 + 5g2. Give s(m(y)). -y4 Let s(x) be the third derivative of -x4/6 - x2. Let r(d) = d - 1. Let f(t) = 5t - 4. Let v(b) = -f(b) + 4r(b). What is s(v(a))? 4a Let v(s) = s2 - 7s. Let h(y) = -2y. Let a(b) = 7h(b) - 2v(b). Let q(c) = 4c. Calculate q(a(i)). -8i2 Let g(c) = -32c. Let i(s) = -2s2. Determine i(g(p)). -2048p*2 Let y(j) be the second derivative of -3j + 1/4j4 + 0j*3 + 0 + 0j2. Let u(s) = -s2. Determine u(y(l)). -9l4 Let u(g) = 82g2. Let f(c) be the second derivative of -c4/12 + 14c. What is u(f(l))? 82l*4 Let r(j) = -3 + 3 + 2j*2. Let g(y) = -5y + 6 - 6. What is r(g(d))? 50d2 Let s(k) = 7k. Let t(v) = -266v. Let j(q) = 77s(q) + 2t(q). Let d(n) be the third derivative of -n5/30 - 3n*2. Determine j(d(h)). -14h*2 Let w = 3 - 1. Let d(x) = -4x*2 + 2x - x*2 - wx. Let r(o) = 2o. Give r(d(n)). -10n*2 Let y(h) = -h - 1. Let p(r) = r - 2. Let x = -1 - 0. Let z(b) = xp(b) + 2y(b). Let s(w) = w. What is z(s(l))? -3l Let u(h) = 15h + 2. Let v(q) = -q. Calculate v(u(m)). -15m - 2 Let w(j) = j*2. Let n(b) be the third derivative of -2b*2 + 1/60b*5 + 0 + 0b + 0b3 + 0b4. Determine w(n(p)). p4 Let l(x) = -4x + x + 3x + 3x. Let o(c) be the second derivative of c4/12 + 2c. Calculate o(l(k)). 9k2 Let n(k) = -2k*2. Let m(z) = 768z. What is m(n(q))? -1536q2 Let j(h) = -5h*2. Let w(y) = -2y. Let d(z) = 2z. Let l(o) = -5d(o) - 6w(o). Give j(l(k)). -20k*2 Let q(x) = 4x. Let z(j) = 11j2 + 2. Determine z(q(h)). 176h*2 + 2 Let m(z) be the third derivative of -5z4/24 + z2. Let i(x) = 4x + 2. Let o(q) = -9q - 5. Let d(l) = 5i(l) + 2o(l). Determine d(m(y)). -10y Let p(i) = 3i. Let u be (0 - 6)2/(-6). Let v(j) = -ju + 8 - 8. Calculate p(v(t)). -3t2 Let z(w) be the second derivative of -w4/12 - 3w. Let p(d) = 9d*2. Determine p(z(x)). 9x*4 Let g(t) = -77t*2. Let p(x) = -7x*2. Calculate p(g(r)). -41503r*4 Let i = 0 + 2. Let o(m) = 0m - 3m - im + 6m. Let r(j) = -2j*2. Calculate o(r(k)). -2k*2 Let y(k) = -1. Let z(a) = -3a - 3. Let w(p) = 3y(p) - z(p). Let v(q) = -19 + 2q + 19. What is v(w(b))? 6b Let l(n) be the second derivative of 0 - 1/3n*3 - 3n + 0n2. Let w(h) = 7h. Calculate l(w(k)). -14k Let p(q) = -q + 11. Let t be p(9). Let x(d) = d2 + 2d*t + 3d*2 - 4d*2. Let g(f) = 4f + 0 + 0. What is g(x(k))? 8k2 Let t(f) = 2f*2. Let d(y) be the first derivative of 8/3y*3 - 5 + 0y + 0y2. Give d(t(b)). 32b*4 Let g(a) = -3a. Let z(i) = -9i2 - 11i*2 + 23i*2. Determine z(g(h)). 27h*2 Let v(u) = -2u*2. Let p(g) = -138g*2 - 13g + 13. Let l(z) = -23z2 - 2z + 2. Let o(w) = -39l(w) + 6p(w). Give o(v(b)). 276b4 Let z(q) = -1. Let m(v) = v2 + 5. Let s(o) = m(o) + 5z(o). Let f(d) = -31d. Give f(s(x)). -31x*2 Let g(h) = -179h + 4 + 182h - 4. Let t be 1(-6)/(1-2). Let z(b) = tb - b - b. What is z(g(v))? 3v Let r(p) = -100p. Let y(i) = -6i. Give r(y(n)). 600n Let p(r) = -r. Let u be (-3)/4 - (-19)/4. Let q(z) = uz2 - 5z*2 - 2z*2. What is q(p(k))? -3k2 Let h(s) be the first derivative of -s3/3 + 1. Let y(b) = 2b2 + 3b. Let p(t) = 6t2 + 8t. Let r(l) = 3p(l) - 8y(l). Give r(h(n)). 2n4 Suppose 0 = -5u - 3d + 3, 2u = 3d - 2 - 1. Let o(z) = 0z*2 + uz*2 - 3z*2. Let a(n) = -2n*2. Determine a(o(k)). -18k4 Let v(x) be the third derivative of -x7/840 + x*4/12 + 9x*2. Let l(b) be the second derivative of v(b). Let w(f) = -f. Determine l(w(h)). -3h*2 Let m(x) = 5x. Let r(a) = 4a2 - 6. What is m(r(u))? 20u*2 - 30 Let k(p) = -2p. Suppose 3m + m + 24 = 2a, 2m - 8 = -4a. Let c(g) = -2g + ag - g - 4g. Determine k(c(l)). 6l Let a(k) = 8k + 7. Let x(h) = -2h. Calculate a(x(d)). -16d + 7 Let h(y) = -3y*2. Suppose 16s - 57 = 7. Let f(q) be the third derivative of 0 + 1/8qs + q2 + 0q*3 + 0q. Determine f(h(g)). -9g2 Let l(o) = -2o*2 - 22o + 22o. Let a(y) be the first derivative of 4 - 1 - 1 + y2. Determine l(a(d)). -8d*2 Let n(z) = 13z. Let p(u) = -36u2. Give p(n(l)). -6084l*2 Let b(z) = -10z*2 - 7z. Let a(y) = -7y2 - 5y. Let g(k) = 7a(k) - 5b(k). Let s(h) = -3h + 7h + h*2 - 4h. Determine s(g(m)). m*4 Let f(o) be the first derivative of 0o*2 - 2/3o*3 - 1 + 0o. Let a(u) = -5u2. Determine f(a(g)). -50g*4 Suppose -b + 3 = -d, d - 3d + 8 = 5b. Suppose 0 + b = q. Let n(v) = 5v + 2v - qv. Let a(r) = -2r2. Determine n(a(h)). -10h2 Let i(b) be the third derivative of b5/30 + b*2. Let v(q) be the first derivative of 1/3q*3 + 0q + 1 + 0q2. What is v(i(y))? 4y*4 Let i(s) = -2s2. Let r(p) be the third derivative of p5/20 - 12p2. What is r(i(a))? 12a*4 Let i(s) be the first derivative of 2 + 0s - 1/2s2. Let o(k) = -14k. What is i(o(p))? 14p Let g(q) = 5q - 6. Let o(z) be the second derivative of z*3/3 - 11z - 1. What is g(o(r))? 10r - 6 Let c(z) = -5z - 589. Let a(y) = -y. Determine c(a(v)). 5v - 589 Let h(g) = -4g*2. Suppose 5 = 5l + 3d - 16, -4d + 2 = -2l. Let y(j) = -j + 3j + 0j - lj. Calculate y(h(p)). 4p2 Let d(y) = -y + 7. Let l be d(6). Let g(p) be the first derivative of p3 - l + 0p*3 + 0. Let u(x) = -2x. Calculate u(g(w)). -6w2 Let q(s) = -25 + 10 - s + 15. Let y(d) = 7d. Let o(k) be the second derivative of k*3/6 + 3k. Let g(j) = -18o(j) + 2y(j). Determine g(q(a)). 4a Let w(u) be the first derivative of -u2 + 5. Let q(m) be the third derivative of -m5/12 - m2. Calculate q(w(s)). -20s*2 Let b(o) = -8o. Suppose 24 = -3p + 6p + 3q, -2q + 12 = p. Let g(v) = -11 + 2v2 + p + 7. Give b(g(a)). -16a*2 Let i(l) be the first derivative of 0l2 + l2 + 0l2 + 0 + 2. Let y(g) = 5g. Give y(i(u)). 10u Let a(h) = 6h*2. Let x(c) = 3164c*2. Calculate x(a(d)). 113904d*4 Let g be 9/(-6)16/(-6). Let t = g + -1. Let n(p) = -3 + p + t. Let b(s) = -3s. Determine b(n(h)). -3h Let h(o) be the second derivative of -o*4/12 - o. Suppose -2y - 9 = -5y. Let v(m) = -2m - 3m + ym. Give h(v(i)). -4i2 Let r(p) be the first derivative of -11p*2/2 - 9. Let w(k) = 2k*2. Calculate r(w(h)). -22h*2 Let a(i) = -9i*2 + 2i - 2i. Let x(c) = -8c*2. What is x(a(d))? -648d*4 Let o(n) = 5n + 9. Let v(w) = w + 2. Let q(d) = -2o(d) + 9v(d). Let l(m) = 8m2. Determine q(l(s)). -8s2 Let v(m) = m2. Let u(j) = 31j + 3j - 2j. Determine v(u(d)). 1024d2 Let x(p) be the first derivative of p4/24 + p*2/2 - 1. Let n(m) be the second derivative of x(m). Let s(i) = 2i*2. Give n(s(w)). 2w*2 Let y(c) = -2c. Let x be 0/((12/2)/3). Let g(v) = xv2 - 2v*2 + 2v*2 + 2v*2. Give g(y(u)). 8u2 Let f(u) = -u3 - 5u2 - 7u - 6. Let b be f(-4). Let c(q) = -q + 2q - bq. Let w(t) = -t*2. What is w(c(m))? -25m*2 Let l = -5 + 6. Let b(y) = -y - 1. Let d(j) = 4j + 3. Let p(w) = ld(w) + 3b(w). Let x(o) = 2o2. Give x(p(g)). 2g*2 Let n(r) = -114r*2. Let v(h) = 2h. Determine v(n(c)). -228c2 Let s(n) = 2n*2. Let v(p) be the third derivative of -5p*4/24 - 7p*2. Give v(s(b)). -10b*2 Let k(t) = 11t + 30. Let c(d) = -5d2. What is c(k(p))? -605p**2 - 3300	{ "pile_set_name": "DM Mathematics" }
t + 1 - 1)(0t + 3t - 5t) - 2t + 2t2 + 2t + 0t - 2t*2 + 0t in the form lt2 + v + ut and give l. -6 Rearrange -9h + 2h - 10h to bh + i and give b. -17 Rearrange -5t2 + t2 - 737t + 743t to ut + ft2 + h and give f. -4 Rearrange (3v*2 - 3v2 + v2)(-2v + 0v + 0v) + (-2v2 + 8v - 8v)(0v - v - v) to the form lv*3 + bv + rv2 + s and give l. 2 Express -2480h + 2480h - 4h*2 - 14 as c + yh + gh2 and give g. -4 Rearrange (-5 + 5 - 2w)(-25w*3 - 14w*3 - 52w*3) to the form xw*3 + uw*4 + mw + gw2 + r and give u. 182 Rearrange 0f*4 - 81f - 1 + 83f - 2f*3 + 2f*4 + 2f*2 to df*4 + lf*2 + z + nf + kf3 and give l. 2 Express (1 - g2 - 1)(52 + 8 - 145) as pg + yg*2 + m and give y. 85 Express 16x*2 + 3 - 32x*2 - 3 in the form sx + h + bx2 and give s. 0 Rearrange -10c2 + c3 + c + 13c2 + 10c*2 + 10c*2 to fc + sc3 + qc2 + y and give q. 23 Rearrange -b3 + 8b2 - b - 4b*2 + 0b + 11b2 to vb*2 + hb + yb3 + j and give y. -1 Rearrange 16l*2 + 2l + 15l2 + 7 + 21l*2 - 50l*2 to the form tl*2 + j + vl and give t. 2 Rearrange (481 - 481 - 21t2)(-3 + 3 + 3t2) to zt + pt4 + nt*3 + bt*2 + r and give p. -63 Express (0d + 3d - d)(-4d + 5d*3 + 4d + 0d - d3 + 0d + (-4d2 + 0d2 + d2)(0 + 0 + 2d)) as yd4 + md + ld3 + i + qd*2 and give l. 0 Express -3n*3 + 0n*3 + 2n*3 + 2n*4 + 2 as z + hn*2 + cn*3 + on*4 + mn and give z. 2 Express -2p4 + 1 + 3p*3 - 7p + 8p + 3p*4 in the form q + tp*2 + op*4 + up*3 + yp and give o. 1 Rearrange 18c - 40c + 8c to fc + r and give f. -14 Express (2v2 + 0v*2 + 0v - 2v)(-18 + 18 - v) as iv + g + cv*2 + sv*3 and give c. 2 Express (-3m + m - 2m)((5 - 3 - 4)(-2 + 0 + 3) - 5 - 3 + 4) as bm + k and give b. 24 Rearrange ((-4 - 2z + 4)(3z + 0z - z) + z*2 + 10z*2 - 5z*2)(4 + 3z - 4) to jz*3 + lz*2 + mz + a and give j. 6 Rearrange 20 + 174l - 83l - 89l to the form jl + o and give j. 2 Express -3q + 4q + 12q + 7q as a + hq and give h. 20 Express -6u*2 - 7u2 - u2 in the form ru + f + yu*2 and give y. -14 Rearrange (2n + n - 4n)(-3n - 13n - n) to w + jn2 + cn and give j. 17 Express 883a - 880a + a3 - a3 + 2a2 + 4a*4 as ja*3 + za*2 + ka + qa4 + t and give j. 0 Express (-2d*3 - 4d*3 + 5d*3)(37d - 10d - 13d - 2) as jd*4 + qd + yd2 + nd*3 + l and give n. 2 Rearrange -h - 3h + 6h - 2h + 2 - 2 + (-12 + 39 - 9)(2h - h + h) to the form x + vh and give v. 36 Rearrange (13h*4 - 5h - 6h2 - 18h*4 + 3h*4)(-1 + 1 + 1) to the form ch2 + nh*4 + g + uh + zh3 and give n. -2 Express (0h*2 - 14h + 2h2 + 7h)(-5 + 2 + 2) as s + zh + bh2 and give z. 7 Rearrange (4 - 2 + 0 + a)(11 + a - 11) to ba + o + fa*2 and give f. 1 Express -6q + 139q - 8q in the form gq + u and give g. 125 Express -k + k + 0k + 3k as zk + w and give z. 3 Rearrange 2t + 0t - 4t + (-30t + 60t - 39t)(-1 + 1 - 2) + (2 - 2 - 2)(5t - 3t - 4t) to the form vt + u and give v. 20 Express 12r2 + 5 + 4 - 11r*2 in the form qr + y + hr2 and give h. 1 Rearrange 10 - 6 - 5f + 21f to tf + z and give t. 16 Express -15z2 - z2 + 4z*2 + (z + 0 + 0)(-6z + 0 - 2 - z) in the form wz*2 + k + mz and give m. -2 Express (2q - 3q + 2q)(-5 - 2 + 25) + 6 + q - 5 + 0q in the form y + rq and give r. 19 Rearrange (0h2 - h2 + 0h*2)(-3 - 1 + 2)(3 + 5h - 3) to the form zh + xh*3 + bh*2 + v and give b. 0 Rearrange ((1 - 1 + 1)(4 - 1 - 2) + 2 + 1 - 2)(0 + 1 + 0)(-5i2 + 2i*2 + 0i*2) to si + j + zi2 and give z. -6 Express (-4 + 4 - 3)((3g2 - 5g*2 + 4g*2)(40g2 + 27g*2 - 32g*2) + 3g*4 - 3g*4 - 2g*4) as lg*2 + v + fg*3 + ug + wg4 and give w. -204 Rearrange (2j2 + j2 - 5j2)(0 + 7 - 11)(-2 + 4 - 5)(0 + 3 - 5) to kj + a + bj*2 and give b. 48 Rearrange (0 - 3 + 5)((-5 - 1 + 16)(s3 - 3s*3 + 0s*3) + 3s*3 + 2s*3 - 3s*3) to the form rs*3 + ps + gs2 + j and give r. -36 Rearrange -3l + l*3 + 13l - l*3 + 2l*3 to the form sl*3 + gl*2 + v + tl and give s. 2 Express -6q + 3q + q - 5q2 + 4q as kq2 + u + fq and give f. 2 Express -w2 + w2 - 7w2 as iw + nw2 + k and give n. -7 Rearrange -19t*2 + 19t*2 + 8t*3 + (-2t2 - t2 + 2t2)(0t - 2t - 7t) to dt*3 + ct*2 + m + kt and give d. 17 Rearrange (-16h + 2 - 34h + 100h)(4h2 + h2 - 6h*2) to q + rh*3 + wh*2 + vh and give r. -50 Express 6 + 39k + 8 - 14 as t + hk and give h. 39 Express 1 - 3 - 3b + 5b in the form mb + o and give m. 2 Express 47p - 104p + 11p as jp + d and give j. -46 Rearrange -6i3 - 574 - i2 + 573 - i*3 to the form x + ji + yi2 + hi*3 and give x. -1 Rearrange 14 - 26 + 2r + 13 + 3r3 to fr*2 + vr + wr3 + h and give w. 3 Express -3u + 5u - 2u - 3u as lu + a and give l. -3 Rearrange (18 - 36 + 15 - 33w)(0w + 3w - w) - 2w2 + 3w*2 + 0w*2 to aw + ow2 + u and give a. -6 Rearrange (-s4 - 2s*4 + 6s*4)(0 + 9 - 2) to the form l + ds2 + zs*3 + is*4 + hs and give i. 21 Rearrange 0k3 + 2k*3 + 0k*3 + (3k*2 + 2k*2 + 2k*2)(-2 + 8k + 2 + 1) to the form z + fk + jk2 + sk*3 and give j. 7 Express 4 - 4 - 2y4 + (-2 + 2 + y2)(-2y*2 + 1 - 1) as cy*3 + ly*4 + w + ry*2 + oy and give l. -4 Express -31v - 53v*2 + v - 1 + 30v as t + fv + gv*2 and give t. -1 Express (-8n + 2n + 3n)(-10n - 20 + 20) as s + pn2 + jn and give p. 30 Rearrange -w4 - w4 + 3w4 + 2 + w + w3 + 0w to v + xw4 + hw*3 + mw*2 + iw and give m. 0 Rearrange 2 - 24r + 24r - 3r3 to the form g + xr*3 + ir + dr2 and give x. -3 Rearrange (5u + u - 2u)(3 - 1 - 4)(-3 + 3 + 2)(1 + 2 + 0) to yu + t and give y. -48 Rearrange 5h - 2h - 4h - 4h to the form vh + q and give v. -5 Rearrange (-j2 + j2 + j*2)(0j2 + 3j*2 - 4j2) + j2 - j2 - j4 - 5j4 + 4j*4 - 17j*4 to m + pj + bj2 + wj*4 + tj*3 and give w. -20 Rearrange -4s2 - s - s2 + 2s - s4 - 5s*2 to the form ps*4 + y + os*3 + bs*2 + ms and give m. 1 Express 5 + h + 3h3 - 3 - 5h*4 - 4h - 4h3 as wh*4 + dh*3 + bh + zh2 + n and give d. -1 Express 32 - 32 + 5h*2 + 5h*3 as g + dh + qh2 + mh*3 and give m. 5 Express (-2d*2 + 4d*2 - 3d*2)(-2 - 2 + 6) - 4d2 + 2d*2 + 3d*2 + 59 - 59 + 21d*2 in the form md*2 + x + cd and give m. 20 Rearrange (191 - 191 + 150b)(b + 3b - 3b) to the form r + cb + mb*2 and give m. 150 Express (-4 + 7 - 2)(2a + 182 - 182) + 2a - 3a + 0a as ma + q and give m. 1 Express 3o - 3 - 5o - 4o in the form bo + g and give g. -3 Rearrange i - 54i*2 + 53i2 + i - 1 - i3 to the form ci2 + qi + z + fi3 and give f. -1 Express (-365 + 29y + 365)(-6y*3 + 4y3 + y3) as py + ny*2 + wy*4 + z + ay*3 and give w. -29 Express -3n + 2 + 8 - 8 as c + dn and give d. -3 Express (a4 + a4 - 3a*4)(2 - 1 + 1) + 24a4 + 5a*4 - 12a*4 + 4a*4 - 2a*4 + 0a*4 as ta*3 + ha*4 + ya + da2 + l and give h. 17 Rearrange 19m*2 - 4m + 5m - 5m*2 to jm*2 + y + im and give i. 1 Express (5g2 - 2g*2 - 2g*2)(-g - 3g + 5g) - 5g3 + 2g*3 - 5g + 7g in the form i + cg + hg2 + jg*3 and give c. 2 Rearrange (-1 + 2z + 1)(z - 5z + 2z) + 68z*2 - 60z*2 + 43z*2 to the form xz + b + az2 and give a. 47 Express -m - 2m*2 + 5 + 3m - 2m as rm + b + jm2 and give b. 5 Express (10k + 11k + 9k)((-2k + 0k + 3k)(-4 - 3 + 5) + 3k - 3k + k + (2k - 3k - k)(0 + 0 + 1)) in the form ak2 + nk + t and give a. -90 Express -5v2 - 5v*2 - 12v2 + v2 in the form jv2 + y + av and give j. -21 Express 2l2 - 1 - 7 + 1 as kl*2 + jl + o and give o. -7 Express -9j + 3j - 5j2 + 3j2 + j2 as p + qj2 + rj and give r. -6 Rearrange w*2 - 3w2 - w2 + (0w2 + 4w*2 - 3w*2)(-6 + 2 + 2) - 2 + 2 + 4w2 to the form aw*2 + yw + r and give y. 0 Express 5w + 11w - 14w as v + cw and give c. 2 Rearrange -23 + 2p + 23 + 9p**3	{ "pile_set_name": "DM Mathematics" }
False Which is greater: -239 or 0.044? 0.044 Which is bigger: -7/3 or -800? -7/3 Is 621 < 622? True Which is greater: 283/3 or 93? 283/3 Are -39 and -307/8 unequal? True Is 5238 at least as big as 5239? False Are -72/35 and -2 non-equal? True Which is smaller: 68 or 72? 68 Is -11/78 smaller than -1? False Which is greater: -52/9 or -1/2? -1/2 Which is smaller: 7665 or 7664? 7664 Is 4066 greater than or equal to 4065? True Which is smaller: 183 or 178? 178 Which is smaller: 161 or 126? 126 Is -661 less than -666? False Which is smaller: -4 or -78? -78 Which is bigger: -169 or -170? -169 Is -9237 at most as big as -9236? True Which is greater: 1/16 or -1? 1/16 Is 1 at least 1/1419? True Which is bigger: -59/28 or -4? -59/28 Which is smaller: 20 or -3? -3 Is -36 smaller than -36? False Which is smaller: 0 or -3/196? -3/196 Which is greater: -263 or -265? -263 Which is smaller: 588 or -0.3? -0.3 Which is smaller: -17.6 or -1? -17.6 Which is bigger: -27192 or -27194? -27192 Is -51 less than or equal to -50? True Which is smaller: -69 or -307? -307 Which is smaller: 0.2 or 164? 0.2 Are -2 and -25/22 unequal? True Which is greater: -1587 or -1601? -1587 Which is bigger: 405 or 393? 405 Does -8/5 = -0.054? False Is 3101/2 <= 1552? True Is 13 less than or equal to 396/29? True Is 2/86539 equal to -1? False Is 641 > 658? False Which is greater: -360 or -364? -360 Which is smaller: -1291 or -1290? -1291 Which is smaller: 7 or -3? -3 Which is bigger: 76/53 or 2? 2 Is -111 at least -109? False Is -2 < -3/2? True Is 12645 equal to 1? False Is 0.1 smaller than 7.3? True Does -86/105 = 0? False Do 1/5 and -144 have the same value? False Which is smaller: -333 or -334? -334 Is -64/73 < -2? False Is 1 equal to 2/25835? False Which is greater: -1/8368 or 0? 0 Is 256 less than or equal to 255? False Is -4/57 at least 1/105? False Which is greater: 7 or 182/29? 7 Is 1/3 <= 5/53? False Which is smaller: 0 or -219? -219 Is 364/5 at least 74? False Which is smaller: 0 or -1/3? -1/3 Is 253 smaller than 252? False Which is smaller: 59 or 530/9? 530/9 Which is greater: 84 or 80? 84 Are 219 and 217 equal? False Is 111/7 bigger than 15? True Is -2/20373 != 0? True Which is bigger: -45/1211 or -1? -45/1211 Is 73 less than or equal to 73? True Is -2/5695 <= 0? True Which is greater: 0.1 or 1604? 1604 Which is greater: -1 or -44/123? -44/123 Is -1 bigger than -37/27? True Does -269 = 0.4? False Is -13 > -123/10? False Which is smaller: -114 or -126? -126 Are 206 and 206 unequal? False Which is greater: -3/3101 or 0? 0 Which is smaller: -57 or -1/3? -57 Are -1/17 and 119 non-equal? True Is -471 bigger than -473? True Is -29865 greater than -29865? False Is 159 less than or equal to 0.01? False Are -24 and -23 nonequal? True Is -705/14 greater than or equal to -49? False Which is greater: -9 or -7? -7 Which is bigger: 2/9 or -1016/11? 2/9 Does -5/87 = -1? False Is -210 less than -4? True Does 3/2110 = 1? False Is -563 >= -7869/14? False Is 1 <= 14/197? False Is -152 less than -0.2? True Which is bigger: -6084 or 1? 1 Which is bigger: -26/147 or -1? -26/147 Which is bigger: -35 or -34? -34 Does -2/693 = 0? False Which is smaller: -2/221 or 1? -2/221 Which is bigger: 8 or -30/13? 8 Is 19 greater than 266/15? True Is -6 at least as big as -90/19? False Which is bigger: -1 or 6/55? 6/55 Is -392 greater than or equal to -392? True Do 299 and 299 have the same value? True Is -1 smaller than 492? True Is 27 < 14? False Which is greater: -232 or -1161/5? -232 Which is smaller: -1 or -5/723? -1 Which is smaller: -350 or -351? -351 Is 265 <= 263? False Which is greater: 297 or 289? 297 Is 2 less than or equal to -726? False Which is smaller: -1/5 or 8/13? -1/5 Is -6 smaller than -3/16? True Which is bigger: -1/4 or 3522/23? 3522/23 Which is smaller: 783 or -5? -5 Is -87 at least as big as -92? True Is 34 > -3? True Which is smaller: 0 or 1/76? 0 Is 0 at least as big as 4.08? False Which is greater: 12/307 or 0? 12/307 Is -6592 smaller than -6591? True Which is smaller: -1089 or 1? -1089 Which is greater: -7.6 or 9/5? 9/5 Which is smaller: 101 or 115? 101 Is -13729 < -13728? True Is -65 > -34? False Are 68/29 and 2 equal? False Which is greater: 1 or -181? 1 Is -320/77 smaller than -4? True Is -210/11 at least as big as -18? False Which is smaller: -1 or -2/31777? -1 Is 7102 equal to 7102? True Which is smaller: -8 or 13? -8 Which is greater: -8 or -9? -8 Which is smaller: 4/593 or -1? -1 Is -98 less than -103? False Which is smaller: -333/16 or -22? -22 Is 0 > 84? False Which is bigger: 501 or 504? 504 Is 340 bigger than 409? False Which is smaller: 2/147 or -1? -1 Are 1 and 1/595 nonequal? True Which is bigger: -155 or 20? 20 Does 523 = 522? False Is 127 >= -0.1? True Which is smaller: 15 or 25? 15 Which is smaller: 3/2 or 441? 3/2 Are -9/7 and 58 unequal? True Which is greater: 526 or 5? 526 Which is smaller: 59 or -1.45? -1.45 Which is smaller: 277/5 or 56? 277/5 Which is smaller: -9.94 or -1? -9.94 Are 42 and 367/9 non-equal? True Is 30 >= 237/8? True Which is greater: 2/4363 or 0? 2/4363 Which is smaller: 10 or -69? -69 Which is smaller: 285 or 282? 282 Which is smaller: -1 or -22/9? -22/9 Is -1 not equal to -2/8749? True Is 1/3 greater than -895? True Which is bigger: 7 or 253/41? 7 Is 25 less than or equal to -8? False Is -21 > -632/29? True Is 76 > 78? False Is -1 != 2/6697? True Which is smaller: -6 or -0.29? -6 Is 25 smaller than 5? False Does -90 = -91? False Is -2/19273 greater than or equal to 0? False Which is greater: 1/5 or 5614? 5614 Are -4461 and -4463 equal? False Is -1 < 3/3041? True Is 0 > -1/20955? True Which is greater: 0 or -3/1327? 0 Is 316 not equal to 3? True Is 1 greater than 1/64? True Which is smaller: 0.05836 or -0.1? -0.1 Which is smaller: -243/2 or -123? -123 Which is bigger: 0 or -14/145? 0 Is 31 not equal to 31? False Which is smaller: 958/5 or 191? 191 Are -2352 and -2353 non-equal? True Which is smaller: -211 or -210? -211 Which is greater: -6/397 or 0? 0 Is -7/3 less than or equal to 0.7? True Are -2/3795 and -1 non-equal? True Which is smaller: 52 or 364? 52 Is 2510 <= 2510? True Which is bigger: 24366 or 24365? 24366 Which is bigger: -1/1573 or -1? -1/1573 Is 74/289 <= 1? True Is 4199/4 less than or equal to 1051? True Is -2/83 at least as big as 0.02? False Which is bigger: 8/63 or 0? 8/63 Which is bigger: 147 or 1/4? 147 Is 1/36 >= -1? True Is -14 less than or equal to -68/5? True Is -220 smaller than 4? True Which is greater: 36/73 or -1? 36/73 Is 2 greater than or equal to 618? False Is 326 <= 327? True Is -2 <= 1383? True Is 37.2 > 7? True Which is bigger: 20 or 19? 20 Is -1/5 smaller than -70/57? False Are -405 and -445 non-equal? True Which is smaller: -108 or -98? -108 Are -1 and 15/38 non-equal? True Is 72 > 67? True Does 1 = 8/7323? False Is 1463 smaller than 10233/7? False Does -8/603 = -1? False Is -1/36 less than 3? True Which is smaller: 11281 or 11283? 11281 Which is smaller: 3346 or 0? 0 Is -414/13 greater than -33? True Which is greater: 1 or 19/8? 19/8 Do 2544 and 2544 have different values? False Which is bigger: -1.119 or 0.07? 0.07 Which is greater: 135/34 or 3? 135/34 Which is smaller: -1 or 570/11? -1 Is 1 less than or equal to -282? False Which is bigger: -105 or -104? -104 Is -41 != -5? True Which is bigger: 8 or 216? 216 Which is bigger: 0.4 or -2.2? 0.4 Which is smaller: -3472 or -3470? -3472 Is -0.1 not equal to 1/25? True Is -18/3401 > 0? False Which is bigger: -2 or -21/4? -2 Is 7/93 > 1? False Which is smaller: 57 or -7? -7 Do -100 and 6 have different values? True Which is smaller: 2/37 or 3? 2/37 Do 681/2 and -3 have the same value? False Is -4/6379 < 1? True Is 13 less than or equal to 6? False Is 780 bigger than 781? False Is -18 less than or equal to -13? True Is 4760 >= 4761? False Is 58 smaller than 23? False Is 246 at most as big as 252? True Which is bigger: -18 or -192/11? -192/11 Which is greater: 0.78 or -25? 0.78 Do -14723 and -1/2 have the same value? False Is -2628 < -2623? True Are -4/9 and -253 equal? False Is -101 less than or equal to -112? False Which is smaller: 6 or 80/13? 6 Which is smaller: -1452 or -1451? -1452 Is -0.014 at least as big as 39? False Is 1 greater than or equal to -3/3464	{ "pile_set_name": "DM Mathematics" }
s u = -3? False Let j(b) = -b - 9. Let v be j(-4). Let y = v - -7. Suppose f + 3 = yg, -g + 2f = -0f. Which is smaller: 3 or g? g Let u(s) = -s + 2. Let r be u(3). Let c be 0 + (-3)/r + -1. Let d = c - 3. Which is greater: d or 1/3? 1/3 Let j = -89/135 + -20/27. Is j greater than or equal to -2? True Suppose 0 = 2d - 4h - 8, -2d + 2h + 3h + 11 = 0. Let o be 5/d(-5)/50. Let l be -1(-3 + 2)/(-1). Is o less than l? False Let w be ((-4)/6)/(3/45). Let t(c) = -c*3 - 9c*2 + 11c + 8. Let x be t(w). Let b be (-9)/(-15)x/(-3). Is b >= -1? True Let s be -3(-3 - (-412)/36). Let h = s + 25. Which is smaller: -5 or h? -5 Let a = 94663/5 + -19015. Let v = a + 3401/40. Let k = -97/40 + v. Which is bigger: 0 or k? k Suppose 4p - 4d = 2p + 14, -d - 1 = -3p. Let g = p + 4. Let a be g/(-2) + (-45)/(-10). Is -0.1 <= a? True Let g(x) = x*3 + 9x*2 - 12x - 21. Let t be g(-10). Which is bigger: t or 3/7? 3/7 Suppose -2b = 5w + 25, -5w - 25 = -3b + 2b. Which is smaller: -3 or b? -3 Let u(q) = -q3 + 8q*2 - 8q + 7. Let w be u(7). Suppose -5t + 3 - 8 = w. Are -1 and t equal? True Let h(n) = -n3 - 5n*2 - n. Let p be h(-5). Let z be 1/p - 17/35. Is -2 > z? False Let p be (-300)/(-21) - 4/14. Suppose a = 5t - p - 6, 5t - 20 = 0. Let c(y) = -y + 6. Let z be c(6). Are z and a non-equal? False Let z(u) be the third derivative of u4/24 + u3/3 + 2u*2. Let l be z(-3). Are l and -1/6 equal? False Let j = -102 + 32. Let f be j/30(-6)/(-4). Which is greater: f or -5? f Let c = 1175/17 - 69. Let o(l) = -l*3 + 5l*2 - 4l + 5. Let u be o(4). Suppose -9 = us - 4. Is s at least c? False Let d = 3/47 + -338/141. Is d equal to -2? False Suppose 5k = -0k. Suppose m + 2 = -km. Let v = m - 0. Which is smaller: 0 or v? v Suppose 4m + 0m = 0. Suppose -t - t + 8 = m. Let o be ((-4)/(-8))/(t/6). Which is smaller: o or -1? -1 Let d = 6 + -8. Suppose 3 = 5c - 7. Suppose -2m + 4 = 4r, 4m - 8 = cm. Does r = d? False Let n = -10/37 + 87/185. Let o be (-1)/(-4) + (-1)/4. Is n at most as big as o? False Let l = -0.98 - -1.08. Which is bigger: l or 4/47? l Suppose 0 = 6c - 4c + k + 5, 2c - 4k - 20 = 0. Suppose c = r + r. Let o = 0 + r. Which is smaller: 2 or o? o Let g be (-497)/(-2835) + (-2)/10. Are -1 and g nonequal? True Let h = 0.06 - 0.14. Let s = h - -0.38. Let l = 0.2 - s. Are -0.3 and l equal? False Let z = -4 + 14. Is 10 at most as big as z? True Let p = 2.89 - 4.89. Let x = 7/4 - 57/28. Which is bigger: p or x? x Let p be 1/3 - (-26)/(-42). Suppose 0 = 5r - 5f - 15, -20 = 3r + r + 4f. Which is greater: r or p? p Let m be 358/(-8) - (-6)/8. Is m greater than -43? False Let n be (-2 - -2) + 2 + -4. Let v be 1(-3 - -2 - n). Let b = -198 - -1384/7. Which is bigger: b or v? v Let s be (4 - 2 - 0) + -2. Let p(u) = 2u2 - 9u. Let c(h) = -h*2 + 4h. Let k(n) = 13c(n) + 6p(n). Let r be k(-2). Is s > r? False Let g(n) = n*3 + 5n*2 + n - 2. Let t be g(-2). Suppose a - 24 = -4h, 12 = -2a + a + 5h. Is a not equal to t? False Suppose 3v + v + 32 = 0. Let o = v + 11. Suppose 2q = oq - 2. Which is smaller: 1 or q? 1 Let f(d) = d3 - 13d*2 - 31d + 16. Let r be f(15). Is 2/83 less than or equal to r? True Let d(l) = 5l + 14. Let x be d(-3). Which is bigger: 37 or x? 37 Let d = -13 + 14. Suppose 3k = -4w + 19, 3w - k = 4w - 6. Let l be 0 + 1 - w/(-2). Is d >= l? False Let z(b) = -b2 + 8b + 1. Let y(l) = -4l - 7. Let v(q) = q + 1. Let s(n) = -5v(n) - y(n). Let h be s(-6). Let u be z(h). Which is smaller: u or -2/7? -2/7 Let i be (3 - -13)/4-2. Let z(q) = -q3 - 1. Let n(x) = -6x*3 - 7x*2 + 8x - 5. Let g(l) = -n(l) + 5z(l). Let f be g(i). Is f less than 2/3? True Suppose -3c + 13 = -n + 2n, -5n + 5 = -5c. Suppose -nw = w. Is 2/7 less than w? False Let x be 3/(-7) - 3/(-14)-16. Which is bigger: x or -5? x Let r = -9.15 + 9. Which is smaller: r or 2/3? r Let t(z) = -2z*3 - 8z*2 - 8z - 3. Let s be t(-3). Are s and -13 unequal? True Let o = 3.7 + -4. Suppose f - 5f = -148. Let r = f - 109/3. Which is greater: r or o? r Let m be 3 + (-2 - (-12)/(-3)). Let j be 4/8(-1)/m. Is -1 <= j? True Let y be (1 - 1)/(6/3). Let g(f) = -2f2 - 5f - 6. Let t be g(-2). Is t bigger than y? False Let x(q) = q*3 + 4q*2 + 2q + 1. Let r be x(-2). Suppose 4k + 4z - 4 = 0, -1 = -3k - 2z + r. Let f = k + -3. Which is greater: -3/7 or f? f Suppose 2z - 3 = 5s, -s + z - 4 = 4s. Which is smaller: s or -1/19? s Let z be (-2)/(66/(-97)) + -3. Which is greater: -3 or z? z Let c = -0.5 + 0.3. Let i = 0.3 + c. Let p = 0.05 + -0.15. Which is bigger: p or i? i Let l(q) = q3 - 3q*2 + 4. Let m be l(4). Let g be (-3 + m/8)0. Let f = 5/14 + -6/7. Is g > f? True Let a be (-8)/(-5) + (-2)/(-5). Let u(x) = -x + 6x + xa - 1 - 2x. Let s be u(-4). Which is greater: 2 or s? s Let i(h) = h*2 - 7h - 3. Let p be i(7). Suppose 4q + 2x = -26, -2q - q + 2x = 9. Let l be (3/q)/(11/55). Is l less than p? False Let q be 22/77 + (-18)/14 + 2. Is -5/8 > q? False Let m be (0 + 12)/((-14)/(-16)). Let d = m + -1035/28. Let j = d + 23. Is j equal to -0.04? False Suppose -8 - 80 = -4j. Is 22 at least as big as j? True Suppose 2r + 5 - 4 = -n, 2r + 2n = -6. Suppose -2l + r + 0 = 0. Let j be 2/(2 + -5 + l). Which is bigger: j or 2/9? 2/9 Let t(h) = 4 + h - 4. Let x be t(2). Suppose 0 = xo + 3o. Is o at most as big as 2/13? True Let a be (-45)/68554/(-6). Which is greater: 0 or a? a Let b(g) = -g - 2. Let v be b(-2). Suppose 2u + 3u - 40 = v. Let c be 2/(-12)(-36)/u. Which is smaller: 0 or c? 0 Let z = 18 + -9. Is 1 at most z? True Let t(s) = 8 + 8s*2 + 2s3 - s3 - 8s - 2s3. Let q be t(7). Which is smaller: q or -1? -1 Let q(g) = -g3 + 1. Let s be q(0). Let h = 1 + -17. Let y be h/(-20)(-10)/(-4). Are s and y non-equal? True Let w = -12459/16 + 779. Is -1 < w? True Let d = 28 + 298. Let m = -327.99 + d. Let s = m - 0.01. Which is smaller: 1 or s? s Suppose c = -5i - 41, -2c + 53 = -3i - 2i. Let s = i + 5. Suppose 0n = -5n - 15. Are n and s equal? False Let y = -0.6 + 1.9. Let k = y - -0.7. Is 1 smaller than k? True Let w(x) = 3x - 6. Let p(t) = -t + 1. Let i(a) = -6p(a) - w(a). Let b be i(1). Let u be -6((-5)/20 + 0). Is b less than or equal to u? False Let c be 2/42(-22)/3. Let z = -7/9 - c. Which is greater: 1 or z? 1 Let t = 0 + -4. Suppose 4c + 8 = -8. Is t > c? False Let d = 178/15 + -35/3. Let h be (-1)/(-5) - (-32)/40. Is h < d? False Let x = -54.094 + 54. Let b = x + 3.994. Let r = 4 - b. Is 0.5 at most as big as r? False Let n(r) = 2r + 7. Let k be n(-6). Do k and -3 have the same value? False Let p = -23 - -23.3. Which is greater: 0.8 or p? 0.8 Suppose 82 - 324 = -2h. Let p = h - 285. Let t = p - -823/5. Which is bigger: 2 or t? 2 Let t be (-3)/4 - (-42)/(-8). Let w be (12/(-117))/((-2)/t). Suppose 11 = -g + 12. Is w equal to g? False Let f be 6/(-4)61/3. Are f and -4 nonequal? True Let j be 12(0 + 1). Let n(f) = 0fj - 8f*2 + 8f - 8 + f*3 + 1. Let m be n(7). Is -2/9 less than m? True Let n = -34 - -35. Let h = -457/7 - -65. Is h >= n? False Let q = -19 - -17. Suppose -74 = 3f + 5r, r - 100 = 5f + 42. Let t = 82/3 + f. Is t bigger than q? True Suppose f + 3f - 3u = -20, f + 4u = 14. Is f at least 1/12? False Let h(b) = 3b - 1. Let m be h(1). Suppose 5y = 2c - 8, c - 12 = -2y - mc. Suppose 5t + 4j = t, 4j + 9 = 5t. Which is smaller: y or t? y Let n be (-8)/4 - -2 - -15. Suppose -11 = 4a + 3p, -5a + 2p = -0a - n. Let y = -128 + 1154/9. Are a and y unequal? True Suppose -5g = 33 - 13. Which is smaller: g or -3? g Let x be 3/(-2)2 + 3. Suppose 4c = 13 - 5, 3c = 2b + 10. Which is greater: x or b? x Suppose 0 = -2x + 8, -6s - 4x = -s - 51. Let b = s - 7. Is b less than 2/3? True Suppose -7n = -2n. Let m = -1 + n. Let c(w) = -w3 + 7w*2 + 2w - 15. Let x be c(7). Is x < m? False Let c be 1/3 - 6/(-9). Let x(z) be the second derivative of z5/20 - z4/2 + 2z3/3 + 3z2 + z. Let m be x(5). Are c and m nonequal? False Let v = 4 + -12. Let q(t) = t2 + 6t - 10. Let w be q(v). Is w greater than or equal to 5? True Let y(i) = -i2 - 5i - 4. Let q be y(-3). Let r be 16/(-15) + q/5. Let g = -3 - -1. Which is smaller: g or r? g Suppose 2i - 2p +	{ "pile_set_name": "DM Mathematics" }
112 Product of 1.5 and -2.3. -3.45 28 * -0.3 -8.4 Work out -277 * 0.3. -83.1 Multiply -59 and -1.19. 70.21 What is -0.187 times -5? 0.935 -22 times -4.9 107.8 Work out -1 * 0.029. -0.029 62.2 times -12 -746.4 Multiply 6.1 and 0. 0 0.05 * 3160 158 -24625 -12310 -19.4 times -0.1 1.94 Work out -6 -5.64. 33.84 Calculate -9-0.17. 1.53 What is -0.9 times -8? 7.2 Multiply 0.18 and -154.2. -27.756 What is the product of -21 and 1319? -27699 -256403 -76920 What is -26 times 22? -572 133 times 0 0 Multiply -281 and 7. -1967 What is the product of 0.1 and 115? 11.5 Multiply 546 and 0.05. 27.3 What is the product of -108 and 5? -540 1 times 60 60 Multiply -0.01 and 254. -2.54 Calculate 0.553-1. -0.553 -0.051 times 2.1 -0.1071 What is 0.043 times 95? 4.085 What is the product of -15160 and 0.3? -4548 Work out -2.73 4. -10.92 Work out 49 * -0.1. -4.9 Calculate -0.1-21. 2.1 What is -4 times -81? 324 What is 4 times -3795? -15180 Product of -0.1 and -11. 1.1 Product of 28 and -6. -168 Work out 1096 0.4. 438.4 -42 * 13 -546 2.5 * 0.027 0.0675 Multiply 3426.4 and -0.3. -1027.92 0.4 times 167 66.8 Product of -35 and 0.1. -3.5 4284-0.3 -1285.2 4 times 6 24 0.36116 41.76 Multiply -5 and -60. 300 -4 times 37.16 -148.64 Calculate 3348. 1044 0.1647 3 0.4941 -0.1 times -0.00263 0.000263 Product of 5 and 4.928. 24.64 -0.40.04 -0.016 Calculate -0.060.3. -0.018 What is 4504 times 5? 22520 -0.02-0.0155 0.00031 Work out 18122 -0.1. -1812.2 What is 3 times 6083? 18249 1 * -0.0021 -0.0021 Multiply -0.3 and -4.29. 1.287 0.1 * -8.6 -0.86 What is the product of 2 and 186? 372 3.38 * -0.3 -1.014 Multiply 0.113 and 0.019. 0.002147 What is 2894 times 4? 11576 What is the product of 1 and -0.61? -0.61 Product of 3 and -0.032. -0.096 Calculate 3.312. 6.62 Product of 0.321 and -12. -3.852 Work out 0.06 -103.4. -6.204 Calculate 621.5. 93 Work out -242 2. -484 What is the product of 825 and -0.3? -247.5 42133 8532 Work out 14.1 -8. -112.8 Calculate -1.7-0.492. 0.8364 Work out -0.5 87. -43.5 -0.49-1 0.49 -1.06-5 5.3 0.487 * 3 1.461 0.3 * 23.6 7.08 What is the product of 0.4 and -0.31? -0.124 What is -0.068 times -31? 2.108 Calculate 0.62-10.4. -6.448 What is -3 times 30? -90 Work out 0.1 0.73. 0.073 What is -5 times 408? -2040 What is the product of 0.4 and -5720? -2288 11 * 8.4 92.4 Work out 12 * -9. -108 8.78-4 -35.12 -0.4 times -178 71.2 Product of 2159 and 5. 10795 -1 times 2321 -2321 Work out 0 3.418. 0 Work out -5 * -169. 845 Product of -4 and 72. -288 5 times -0.012 -0.06 What is 0.4 times -36? -14.4 What is the product of 0.1 and 0.08? 0.008 -28 * 22 -616 Product of 1.9 and -1.5. -2.85 Work out -0.02 * -0.81. 0.0162 Product of 6 and -1.284. -7.704 Calculate 0.35.7. 1.71 Calculate -0.0450.13. -0.00585 What is 0.0824 times -1? -0.0824 Work out 0.03 * 6. 0.18 -208 times 0.3 -62.4 What is 0.45 times -7? -3.15 -0.5-39 19.5 -9 times 2.105 -18.945 3 times 0.436 1.308 8.13 0.3 2.439 -0.4 times -72 28.8 -0.1 times 15 -1.5 0.07 times -0.007 -0.00049 Work out -2 * 0.214. -0.428 -221-5 1105 Work out -26 -18.6. 483.6 What is the product of -5 and -0.03656? 0.1828 Calculate -292-3.5. 1022 Calculate 0.60.024. 0.0144 -0.6 * 10.5 -6.3 Product of 5 and 163. 815 0.3 * 0.00069 0.000207 -643 times -0.2 128.6 -0.65 * 0.045 -0.02925 0.34 times -14 -4.76 Work out 60 * -0.01. -0.6 Calculate 3-0.277. -0.831 Work out 379 54. 20466 Calculate -15.5-97. 1503.5 Multiply -0.1113 and -2. 0.2226 Multiply -5772 and 0.1. -577.2 Calculate 93.49-0.3. -28.047 Product of -1195 and -3. 3585 Multiply -46 and 2. -92 What is the product of 0.2 and 0.47? 0.094 Work out 1 * 165. 165 Work out -915 * 2. -1830 Product of 5 and 7.1. 35.5 -0.25 * -1.1 0.275 What is the product of 0.06 and 40.34? 2.4204 -5 * -2.022 10.11 Product of 0.07 and 0.077. 0.00539 Multiply -0.1 and 3388. -338.8 Work out -29.9 * -0.6. 17.94 Calculate -0.1-0.162. 0.0162 40.23 0.92 Product of -5 and 80.8. -404 Product of 0.1 and -0.0009. -0.00009 What is the product of -21 and -0.4? 8.4 Multiply 2.7 and -0.06. -0.162 Multiply -2.23 and -0.2. 0.446 -10.397 times -0.3 3.1191 Product of -0.1 and 3553. -355.3 Calculate -258-3.5. 903 What is the product of -57 and -0.4? 22.8 -13-222 2886 Work out 218 * 3. 654 -10180.3 -305.4 Work out 3 121. 363 Calculate 420-5. -2100 Calculate -8-5. 40 Work out 22463 * -3. -67389 Work out 1.1 * -0.72. -0.792 140.06 0.84 241 times -0.2 -48.2 -3 times 0.04388 -0.13164 Calculate -0.142.1. -0.294 0.182 * 0.3 0.0546 -466-0.6 279.6 What is -0.07 times -1.45? 0.1015 0.013-0.3 -0.0039 0.0752.35 0.17625 Work out 0.08 0.063. 0.00504 Work out 0.0426 * 0.23. 0.009798 -4.1-2 8.2 What is 0.54 times -165? -89.1 What is the product of 523 and -0.5? -261.5 Product of -1.5 and -0.1. 0.15 Product of -1.3 and 179. -232.7 Calculate 0.9-7.8. -7.02 Multiply 8 and 2137. 17096 Calculate -32.60.05. -1.63 -4 times -0.0001 0.0004 Multiply 67.5 and 8. 540 Calculate -10.97. -0.97 Work out -36.5 * 0.3. -10.95 Product of -7326 and 0.3. -2197.8 Multiply -20 and -114. 2280 -0.0676 times 0.1 -0.00676 -29 * -9 261 77 * 1 77 What is the product of 628 and -2? -1256 0.2 * 1355 271 What is 0.4 times -0.489? -0.1956 What is -66 times 0.152? -10.032 Multiply 0.5 and -0.064. -0.032 0.2041 * 5 1.0205 Calculate -0.5-0.459. 0.2295 Calculate 0.18.5. 0.85 Work out -17 * 0.01. -0.17 Calculate 0.542. 21 Product of -2313 and 4. -9252 403-0.6 -241.8 What is 37 times 0? 0 What is the product of -0.7674 and 0.01? -0.007674 Work out 377 * 1. 377 What is the product of 0.9692 and -4? -3.8768 554 * 0.15 83.1 Multiply -1.6 and -9. 14.4 Multiply -0.3 and 9.4. -2.82 -298 * 3 -894 3717 629 Product of -10 and -357. 3570 -18 times 0.3 -5.4 Multiply 5 and 94. 470 Multiply 1 and 3.8. 3.8 Work out -0.1 0.48. -0.048 Product of 0.074 and -77. -5.698 -293 -87 Product of 3 and -637. -1911 155 75 -1.20.16 -0.192 -9.3 times 0.01 -0.093 What is -0.5 times -8.3? 4.15 What is the product of 0.5 and 0.579? 0.2895 -0.006-0.6 0.0036 Work out 0.0838 * -3. -0.2514 0.0257 * 2 0.0514 Work out 185 * -3. -555 54 times 0.1 5.4 -906-1 906 0.063-4 -0.252 What is 246 times -0.03? -7.38 -0.2-1228 245.6 What is -0.1 times 410? -41 What is 621 times -8? -4968 -1 471 -471 Multiply 0.1 and -152. -15.2 Product of -5 and -0.075. 0.375 -190.4 * -0.4 76.16 Work out -2 * -2. 4 Work out 0.1 * 31. 3.1 Calculate -253. -106 Product of 1.39 and 3. 4.17 What is the product of 1552.3 and -4? -6209.2 -0.3 3.01 -0.903 0.2-0.0865 -0.0173 Work out -14.8 0.1. -1.48 -51 times 0.1 -5.1 What is the product of -1 and -946? 946 0.40.69 0.276 Product of 0.1 and 7.6. 0.76 1 times 0.11 0.11 -25 times -61 1525 1161 116 212 times -1 -212 Multiply -4 and 4.01. -16.04 Calculate -3-3.64. 10.92 Work out -4077 2. -8154 Product of -0.06 and 1569. -94.14 Calculate 65.6-2.3. -150.88 Multiply -2 and 111. -222 -57080.2 -1141.6 What is the product of 1.2 and 0.05? 0.06 Multiply -2 and 970. -1940 0.036 times 4 0.144 -12.5 times 0.8 -10 What is the product of 0.1 and 0.116? 0.0116 Calculate -0.0240.29. -0.00696 Work out -0.32 -0.5. 0.16 Multiply 150 and -0.2. -30 What is -0.0064 times 0.1? -0.00064 What is -27 times 0.5? -13.5 -0.01-34 0.34 Work out -0.23 0.23. -0.0529 0.3 * -1.54 -0.462 Calculate -0.025-1. 0.025 Multiply 708 and -1. -708 -4.131 -4.13 4 times 0.074 0.296 What is the product of 86 and -2? -172 Work out -0.8 * 505. -404 Calculate -240.405. -9.72 Product of -15 and 286. -4290 What is the product of 0.3 and 0.73? 0.219 53.3 16.5 Product of -2 and -54. 108 Product of -0.3 and 60. -18 25-1.01 -25.25 -3490 -0.3 1047 What is 0.218 times -0.4? -0.0872 0.0647 2.82 24 -237 -5688 -0.06 * 0.07 -0.0042 Work out -4 * 0.18. -0.72 Work out 1.91 * -0.4. -0.764 Work out -14 * -21.3. 298.2 Multiply -59.5 and 0.1. -5.95 Multiply 0 and -2. 0 What is -0.3 times 68? -20.4 Product of 0.2 and 0.055. 0.011 Product of -0.2 and -3. 0.6 What is 1287 times -2? -2574 0.11-166 -18.26 Work out -107.93 0.2. -21.586 4 * 89 356 -0.01 * -0.0963 0.000963 Work out -0.23 * -0.08. 0.0184 Product of 5.997 and -0.5. -2.9985 -0.165 times -9 1.485 -10-543 5430 -1.215 -18 Calculate -72*-0.5. 36 -3 times 154.5 -463.5 What is the product of -6333 and -0.1? 633.3	{ "pile_set_name": "DM Mathematics" }
3 + -2. Suppose 4g - 7 = -4m + w, m + 1 = 0. Calculate the highest common divisor of p and g. 3 Suppose -8u + 7u = -26. Let d = u + -15. What is the greatest common factor of d and 110? 11 Suppose 5m + 2h - 102 = -h, -4m - 2h + 80 = 0. Suppose -60 = -3d + m. Let p be (6/1)/(6/52). What is the highest common factor of d and p? 26 Suppose 2d + 218 = -2i - 2i, -3d - 156 = 3i. Suppose -m + 36 = -4m. Let q = m - i. Calculate the greatest common divisor of 30 and q. 15 Let b be 6/(-9)(-15 + 6). Let t be 74/(-8) + 4/16. Let g = 15 + t. Calculate the greatest common factor of g and b. 6 Suppose r = -5s - 192 + 1016, 7s - 1136 = 3r. What is the greatest common factor of s and 697? 41 Suppose 3d = 2x - x + 6, -15 = -4x - d. Suppose -a - 15 = -6a. What is the highest common factor of a and x? 3 Suppose d = -0d + 37. Let p = -6 - d. Let i = p - -72. What is the highest common factor of 58 and i? 29 Suppose -4i + l + 12 = 3l, 45 = 5i - 5l. Let f(m) = -3m - 15. Let z be f(-10). What is the highest common factor of i and z? 5 Let r be -154/183. Let y(l) = l2 + 4l + 31. Let o be y(r). Calculate the highest common divisor of 13 and o. 13 Let s = -549 - -607. Calculate the highest common factor of s and 145. 29 Let a = -49 + 63. Let i = 228 + -130. What is the greatest common factor of a and i? 14 Suppose -36 + 39 = r. Let v(b) = b*3 + 12b*2 - 2b - 11. Let m be v(-12). Let d(s) = 3s - 18. Let w be d(m). What is the highest common factor of w and r? 3 Let x(c) = -7c - 8. Let v be x(7). Let z = -32 - v. What is the greatest common factor of 25 and z? 25 Let c(n) = n*3 + 20n*2 - 25n - 17. Let o be c(-20). Calculate the greatest common divisor of o and 126. 21 Let g = -162 + 90. Suppose c - 3c = 3w - 537, -c = w - 269. Let i = g + c. Calculate the highest common divisor of 18 and i. 18 Let u = -2526 - -2534. What is the highest common factor of u and 1448? 8 Let w(o) = -4o3 - o2 - o. Let v be w(-1). Suppose -4c = -z + 206 - 616, 3c - 314 = vz. Calculate the highest common divisor of 17 and c. 17 Let y be -30(11 + -5)(-6)/45. What is the greatest common divisor of y and 36? 12 Let y = 587 - 539. Suppose -23 = -3t - 5. What is the greatest common factor of y and t? 6 Suppose 5d - 9 = -4f, -37 = -5d - 0d + 3f. Suppose -db + 6 + 24 = 0. Suppose 51 - 21 = 2r. What is the greatest common factor of r and b? 3 Suppose 5 = -3s - 4, 102 = 2i + 4s. Suppose -d + 4 = 3d, 0 = -5o - 3d + 98. Calculate the greatest common divisor of o and i. 19 Suppose 0 = -4a, 0 = s - 3a - 9 - 19. What is the greatest common factor of 28 and s? 28 Suppose -2o - 48 = -10o. Let z be 644/o6/4. What is the greatest common divisor of z and 23? 23 Let c = 48 + -34. Let w = c + -11. Suppose -2u + wg + 54 = 0, 3u + 4g - g - 81 = 0. Calculate the highest common factor of 18 and u. 9 Suppose -3w = r - 84, -7r - 5w + 329 = -3r. Suppose -q = -4q + r. Calculate the highest common factor of q and 18. 9 Suppose -2z - 10c + 9c = -1155, -2z - 4c = -1164. What is the greatest common divisor of 9 and z? 9 Suppose -4c = -5j + 27 - 4, 0 = -4j + 2c + 16. Suppose jh = 5r + 5h - 1443, -5r = h - 1444. What is the greatest common factor of 17 and r? 17 Suppose 24i - 15i = 279. What is the highest common factor of 62 and i? 31 Let f = 0 + -12. Let z(k) = -k3 + 25k*2 - 23k - 7. Let o be z(24). Let u = f + o. Calculate the greatest common factor of 35 and u. 5 Suppose -p = -k - 2p + 2415, k - 2p = 2424. Let f be k/11 + (-2)/(-11). Calculate the greatest common divisor of 20 and f. 20 Let p(w) = 3w2 - 2w + 27. Let g be p(-5). Calculate the highest common factor of 16 and g. 16 Let u(l) = 2l2 - 10l - 23. Let z be u(7). Calculate the greatest common factor of z and 40. 5 Let y(l) = l + 7 + 0l - 7. Let o be y(1). Let p = 25 - o. Calculate the highest common factor of 36 and p. 12 Let n(k) be the first derivative of -k4/4 + 5k*3 - 6k*2 + 8k + 4. Let m be n(14). What is the greatest common divisor of 12 and m? 12 Let z = 617 - 41. Let j be z/99 - (-6)/33. Calculate the highest common factor of j and 54. 6 Let s(d) = 3d - 64. Let i be s(15). Let r = 18 + -31. Let c = r - i. What is the highest common divisor of c and 3? 3 Let z = -249 - -327. Calculate the highest common factor of z and 130. 26 Let l(f) = -f3 - 12f*2 - 40f - 22. Let p be l(-8). Calculate the greatest common divisor of p and 224. 14 Let w(l) = l*2 - 3. Let c be w(4). Let r be c + 0/(0 - 3). Let f be (-18)/15(-71 - -6). Calculate the highest common factor of r and f. 13 Suppose 2p + f - 20 = -3f, 0 = -2p + 3f + 34. Calculate the greatest common factor of p and 406. 14 Let b be 3 - (-40 - 6/6). What is the greatest common divisor of b and 99? 11 Let r be (10-2)/(-31 - -29). What is the greatest common factor of r and 430? 10 Let a(h) be the second derivative of -h4/12 + 3h*3/2 + 8h*2 + 8h. Let f be a(10). Calculate the greatest common divisor of 18 and f. 6 Let u = -14 - -11. Let d be u/(-2)(-60)/(-9). Calculate the greatest common factor of 90 and d. 10 Let v(i) = -2i*2 - 19i + 25. Let s be v(-10). What is the highest common divisor of s and 9? 3 Let i be (-537)/(-21) - ((-189)/(-49))/(-9). What is the highest common factor of i and 1222? 26 Let j(g) = -g*3 + 11g*2 + 18g - 6. Let c be j(12). Suppose 244 = 10d - c. What is the greatest common factor of d and 124? 31 Let o = -153 + 531. What is the highest common factor of 12 and o? 6 Suppose 2t - 4t + 6 = 0. Suppose tu - 180 = -3u. Calculate the greatest common factor of 12 and u. 6 Suppose -3x = -6x + 96. Suppose 0 = 4c - 4i - x, -6c + 5i = -2c - 32. Calculate the highest common factor of c and 4. 4 Suppose 1100 = 665r - 645r. Calculate the greatest common factor of 517 and r. 11 Let b be (-2 + -1)22/(-6). Let q be 165/918(-7)/(-21). Calculate the greatest common factor of b and q. 11 Let g = -373 + 703. Calculate the highest common divisor of g and 220. 110 Suppose 5v = 2z + 4963 + 1143, 0 = -3z + 6. Calculate the highest common factor of 26 and v. 26 Suppose 0 = 22i - 50i + 4144. What is the highest common factor of i and 8? 4 Let w be (4/(-6))/(21 + (-63510)/3024). Let k be (2 - 1 - 3)-21. Calculate the greatest common factor of k and w. 42 Let i(q) = -5q - 7. Let u be i(-3). Suppose -32 = -4j - u. Let p = 10 - j. What is the highest common factor of 20 and p? 4 Let p(i) = i3 - 5i*2 - i - 17. Let k be p(6). Let d be 104 + -3 + 5 + 1. Suppose 49 + d = 4w. Calculate the greatest common divisor of k and w. 13 Suppose -4b - 9 = 2c - 23, -5c = -3b - 9. Let a be (-380)/(-12) + 1/c. Calculate the greatest common divisor of a and 4. 4 Suppose 2u - 707 = -25. Suppose -d - 1 = 0, 3a + 10 = d + u. Calculate the greatest common divisor of 10 and a. 10 Let z = 95 - 95. Suppose -3p + 356 = r, -3r - 2r - 5 = z. What is the highest common factor of p and 17? 17 Suppose f = -2f + 4l + 153, -3l + 284 = 5f. Calculate the highest common factor of 15 and f. 5 Let r = -61 + 84. What is the highest common divisor of 115 and r? 23 Suppose 3z = -5y + 32, 8 + 4 = 4y - z. Suppose 0 = 5m - 136 - 14. Let f be -48(9/15 + (-38)/m). What is the highest common factor of y and f? 4 Let w = 436 - 241. Calculate the greatest common factor of 39 and w. 39 Let r(h) = 6h2 + 29h + 577. Let m be r(-16). Calculate the highest common factor of 194 and m. 97 Let m(g) = 2g3 - 5g*2 + 5g. Let j be m(5). Let o = 853 - 753. Calculate the greatest common divisor of o and j. 50 Suppose 3m - 44i - 145 = -46i, 3m - 2i = 161. Calculate the highest common factor of 3 and m. 3 Let u = 222 - 201. Calculate the highest common divisor of 651 and u. 21 Let y = -18 - -16. Let m be (-1)/(-1)(y + 5). Suppose -mq = 2q - 115. What is the highest common divisor of 69 and q? 23 Suppose m + 33 = 42. Calculate the highest common divisor of m and 24. 3 Suppose -x - 23 = -61. What is the highest common divisor of 266 and x? 38 Let u be (-70)/(-6) - (-26)/(-39). Let p(r) = -24r2 - 3r + 4. Let q be p(3). Let o = 342 + q. What is the highest common factor of o and u? 11 Let s(b) = b*3 + 4b*2 - 4b + 1. Suppose -15r = -18r - 12. Let m be s(r). Let f = -170 + 28	{ "pile_set_name": "DM Mathematics" }
ve of d(k) wrt k. 96k Suppose -17 = -11x + 27. What is the first derivative of 25 + 43z4 + 40z*x + 6 - 55z*4 wrt z? 112z3 Find the second derivative of -w3 + w*3 - 11 - 506w*4 + 18w + 614w4 wrt w. 1296w*2 Find the third derivative of -16h*5 + 0h*6 - 4 + 11h*5 - 3h*2 + 3h*6 + 2h*5 wrt h. 360h*3 - 180h*2 Find the first derivative of -192h - 197h + 66 + 262h wrt h. -127 Suppose 2a - 1 = 5. Suppose ab = 3w, 4w + 10 = 3w + 3b. Differentiate -8p + 3p + 3p - w with respect to p. -2 Let x(u) be the second derivative of 0u*4 - 6u - 27/2u2 + 1/3u*3 + 13/30u*6 - 3 + 0u*5. Find the first derivative of x(k) wrt k. 52k*3 + 2 Suppose 0 = 5a - 17 - 463. Let l be 1/7 + a/14. Find the first derivative of l - 2 + 29g4 - 34g*4 wrt g. -20g*3 Let y = -1613 + 1617. Let r(d) be the first derivative of 0d*3 - 2/5d*5 - 7 + 0d*y - 6d*2 + 0d. Find the second derivative of r(m) wrt m. -24m2 What is the third derivative of d3 - 23d*2 - 4d*4 - 2d*3 + 12d*4 - 36d*2 wrt d? 192d - 6 What is the first derivative of -53 + 211x2 + 1313x - 93 - 1313x wrt x? 422x Differentiate 55s - 43s + 65s + 96 wrt s. 77 Suppose -4 = -3i - 0i + 5m, 0 = -4i - 5m - 18. Let x = 9 + i. What is the third derivative of xg2 - 4g4 - g2 - 3g2 wrt g? -96g Let y(j) be the third derivative of -151j7/210 + 8j*4/3 + 72j*2. What is the second derivative of y(v) wrt v? -1812v*2 Suppose 2u = 3j + 2j - 19, 2j - 5u + 5 = 0. Suppose -8 = -jw + w. Differentiate 2 - 3a2 + aw - 1 + 0a2 with respect to a. -4a Let j(m) = -192m3 - 2m*2 + 2m + 49. Let y(a) = -a*3 - 2a*2 + a - 3. Let s(r) = j(r) - y(r). Find the second derivative of s(c) wrt c. -1146c Let g(v) = -9v4 - 2v*2. Suppose -5h + 16 = -h. Let m(u) = -u2 + 5 - 1 - uh - 4. Let r(p) = g(p) - 4m(p). What is the third derivative of r(z) wrt z? -120z Let l(x) be the third derivative of 19x6/20 + 86x*3/3 + 182x*2. Differentiate l(k) wrt k. 342k*2 Suppose 2 = -46p + 47p. Let r(w) = -w3 + w - 1. Let m(d) = -15d*5 + 2d*3 + 24d + 2. Let f(j) = pr(j) + m(j). Find the second derivative of f(x) wrt x. -300x*3 Suppose 144 = -n + 7n. What is the third derivative of g*2 + ng*5 + 18g*5 + 9g*5 + 1 wrt g? 3060g*2 What is the derivative of 68u*4 - 168 - 1246u + 39u4 + 627u + 619u wrt u? 428u*3 Let n(c) = 104c*2 + 4c - 24. Let k(x) = 2x2 - 1. Let o(w) = 3k(w) - n(w). What is the second derivative of o(a) wrt a? -196 Let q(m) be the third derivative of -5m8/112 - m4/12 + 4m*3 + 2m*2 - 8. What is the second derivative of q(u) wrt u? -300u*3 Let h(n) be the second derivative of 0n*7 + 2/7n*8 + 0n*3 + 0n*6 + 0n*5 - 3n*4 + 0n*2 + 24n + 0. What is the third derivative of h(v) wrt v? 1920v3 Differentiate -63 + 422z*4 - 226 - 81 - 52z*4 - 5z*4 with respect to z. 1460z*3 Let w(x) = -3073x*4 - 23x*3 + 15x + 351. Let i(y) = -384y4 - 3y*3 + 2y + 44. Let q(l) = -46i(l) + 6w(l). Find the second derivative of q(h) wrt h. -9288h2 Find the first derivative of 55j + 43 - 34 - 25j + 38j wrt j. 68 Let z(b) be the third derivative of 0 + 0b + 0b*3 - 32b*2 - 13/20b*5 + 5/12b*4. What is the second derivative of z(x) wrt x? -78 Find the third derivative of 512 + 703v*5 - 11v*2 - 14v*2 + 23v*2 - 18 + 40 wrt v. 42180v*2 Let v(h) be the third derivative of 65h*8/112 - 7h*5/20 + 169h*2. Find the third derivative of v(r) wrt r. 11700r*2 Find the third derivative of -352f*5 - 154f*2 - 4f3 + f3 + 463f5 + 3f*3 wrt f. 6660f*2 Let w(t) be the first derivative of -9t*5/40 - 5t*4/4 - 2t*3 + 3. Let r(v) be the third derivative of w(v). Differentiate r(b) wrt b. -27 Let x be (-2)/315/(-10). What is the first derivative of x - 2 + 1 + 5 + 3y wrt y? 3 Suppose 3v + 5r - 35 = 0, 5v - 3r = -0r + 13. Suppose 8 = 7w - 2w + 4n, -n = -vw + 23. Differentiate -2 + 0 + a*w - 7a*4 + 0 with respect to a. -24a*3 Let c be (-6)/(-5)(-10)/(-4). Let o = -1159 - -1162. Differentiate 5 + 6r3 - 8 - 5r*c + 4r*o with respect to r. 15r*2 What is the third derivative of 286q*2 - 126q*3 - 135q*2 + 21q2 wrt q? -756 Let b(m) = -m3 + 12m2 + 4m - 54. Let n(f) = -2f3 + 23f*2 + 7f - 107. Let x(c) = -5b(c) + 3n(c). Find the second derivative of x(v) wrt v. -6v + 18 Let j(r) be the second derivative of r7/21 - r6/3 + 79r*3 + 366r. Find the second derivative of j(m) wrt m. 40m3 - 120m2 Let f(o) be the third derivative of -o5/20 - o*4/3 - 17o*3 + 67o*2. Differentiate f(d) with respect to d. -6d - 8 Let n(o) be the third derivative of 0 + 0o4 + 0o - 13o2 + 1/210o*7 + 0o*6 - 7/6o*3 + 0o*5. What is the derivative of n(j) wrt j? 4j*3 Let s = -114 - -141. Find the second derivative of 12m*5 + sm - 12646m3 + 12646m*3 wrt m. 240m*3 What is the third derivative of 79c*2 + 57c*5 - 33c*5 - 10c*6 - 24c*5 + 36c*2 wrt c? -1200c3 Let k(m) be the third derivative of m5/6 + 19m4/24 - 370m*3/3 - 45m*2. Find the first derivative of k(x) wrt x. 20x + 19 Let d(w) be the second derivative of -5w4/3 + 73w*3/6 - 6w - 2. Find the second derivative of d(p) wrt p. -40 What is the third derivative of -4t - 4325 - 191t*3 + 4325 + 4t + 326t2 wrt t? -1146 Let h(m) be the first derivative of -87m*2/2 - 18m - 44. What is the derivative of h(r) wrt r? -87 Let n(u) = -4u3 - 31u2. Let j(a) = -a3 - 5a3 + 7a*3 - 2a*3. Let m(o) = 6j(o) - n(o). Find the third derivative of m(h) wrt h. -12 Let c(s) be the third derivative of 0s3 + 17s*2 + 0s*5 - 43/24s*4 + 0s + 0 - 41/210s7 + 0s*6. Find the second derivative of c(f) wrt f. -492f*2 Let t be 9 + 0 + 1-1. Let b be ((-6)/(-4) + -1)/(170/680). What is the second derivative of n - 9nb - n + tn wrt n? -18 Let i(d) be the third derivative of 43d2 + 13/336d*8 + 0d*4 + 0d + 0d3 + 0d*6 - 23/60d*5 + 0 + 0d*7. Find the third derivative of i(b) wrt b. 780b*2 Let l(i) be the first derivative of -46i*5/5 + 148i + 84. Differentiate l(m) wrt m. -184m3 What is the third derivative of 0x*5 + 69x*4 + 495x*2 - 2x*5 + 149x*4 - 319x*4 wrt x? -120x*2 - 2424x Let s be 176/28 - 6/21. Let p(q) = -q*3 + 7q*2 - 4q - 8. Let r be p(s). Find the first derivative of 0 + 8 + 2wr + 8 - 22 wrt w. 8w*3 Let l(k) = 15k*3 + 8k*2 + 5k + 78. Let u(q) = 17q3 + 9q*2 + 6q + 79. Let g(f) = 6l(f) - 5u(f). Differentiate g(x) with respect to x. 15x2 + 6x Suppose v - 6 = 7. Suppose 2j = 3n - 33 + v, -4j + 4 = 5n. Find the second derivative of -6w + 4w - 2wn - 6w*4 + 2w*4 wrt w. -72w2 Let g(y) be the third derivative of y2 + 0 + 0y3 + 7/60y*5 + 0y + 11/24y4. Find the second derivative of g(x) wrt x. 14 Let s(d) be the third derivative of -1/40d*6 + 0d*4 + 3/2d*3 + 0d + 9d2 + 0 + 0d*5. What is the derivative of s(w) wrt w? -9w*2 Let v(y) be the first derivative of -37y5/20 - y2/2 - 41y + 15. Let b(f) be the first derivative of v(f). What is the derivative of b(p) wrt p? -111p*2 Let p = -12 + 13. Differentiate p - 3 + 10c*2 + 5 with respect to c. 20c What is the second derivative of -33s + 3 + 6 - 111s*2 - 4 - 36s*2 + 11s*2 wrt s? -272 Let w(b) = -1155b*2 - 1006b - 9. Let r(f) = -289f2 - 251f - 2. Let l(q) = 9r(q) - 2w(q). What is the second derivative of l(v) wrt v? -582 Let g(v) be the second derivative of v7/14 - v4/4 - 20v3/3 + 285v. What is the second derivative of g(l) wrt l? 60l3 - 6 Let n = 7 + -5. Let i be 0(3 + -2) + n. What is the second derivative of q + iq2 + 5q - 3q2 + 5q*2 wrt q? 8 Let u(p) = p + 2. Let o be u(2). What is the second derivative of -5n - 7n4 - 5n + n*o + n wrt n? -72n*2 Suppose -33 = -3c - 5k + 2k, -4c + 4k + 52 = 0. What is the second derivative of -20b5 + 26b*5 - 3b + cb + 9b wrt b? 120b3 Let l be ((4 + -5)/(-1))/((-2)/(-8)). Find the second derivative of 3k - 7k2 - 5k*l + 8k2 - k2 wrt k. -60k2 Differentiate 37a + 7a + 468 - 576 wrt a. 44 Let a(r) be the third derivative of 267r**5/	{ "pile_set_name": "DM Mathematics" }
order. 1, u, -2/7, d Let n = -517.239 + 517. Let q = n + 0.039. Sort q, 3, -2/15, 1 in decreasing order. 3, 1, -2/15, q Let d be 60/(-25)80/24. Put 5, 1, 0.5, d in decreasing order. 5, 1, 0.5, d Let r = 53.2 + -53.2. Sort 5, 2, r, 3/22 in ascending order. r, 3/22, 2, 5 Let r(i) = -i2 + 3i + 5. Let l be r(4). Let q(y) = -4y2 - 40y + 39. Let g be q(1). Put 3, l, g in decreasing order. 3, l, g Let t be (1 - (-63)/(-6))/(2/4). Put 4, -5, t, -22 in descending order. 4, -5, t, -22 Let i = 149 - 131. Sort -4, i, 5. -4, 5, i Let q = -3851/77 + 547/11. Let z = -23 - -55. Sort q, z, 5. q, 5, z Let w be 2/(13/(-2) - -6). Sort -1, w, 30 in decreasing order. 30, -1, w Suppose -5p - 4j - 17 = -6j, j = 2p + 6. Sort 1, -1, p, -18 in increasing order. -18, p, -1, 1 Let j = -29.9 + 31.57. Let v = j + -1.6. Let r = 10.9 + -10.7. Sort r, v, 2/5 in descending order. 2/5, r, v Let i be 0(-325/(-15) - 4). Put i, -15, 4, -2 in ascending order. -15, -2, i, 4 Let x = 191.18 - 195. Let z = x + -0.18. Sort 2/7, 0.1, z. z, 0.1, 2/7 Let h(x) = -27x - 128. Let f be h(-5). Suppose 0 = 2b + 5l + 18, -3b + 0 = l + 1. Put b, -5, f in descending order. f, b, -5 Suppose 96u - 20 = 116u. Put 1, 11, u in descending order. 11, 1, u Suppose -3i + 1316 = -2v, 0 = -4i + 53v - 57v + 1748. Put -2, i, 4 in decreasing order. i, 4, -2 Let v = 0.32 + -0.82. Let m = 1 + v. Sort -3, m, 19 in ascending order. -3, m, 19 Suppose -4p - 58 = -3a, 2p - 4a + 7 = -27. Put 3, p, -6 in descending order. 3, -6, p Let n = 85 - 85. Let y be 2/(-1 + 5)0. Let g be 2/(-4)4 - y. Put g, n, -4 in descending order. n, g, -4 Let x be (-2)/4(2 + -2). Suppose 4z + 33 = 3u - 2, -30 = 2z - 4u. Let b(v) = v*2 - 6v - 4. Let c be b(6). Sort c, x, z in increasing order. z, c, x Let y = -33.035 + 0.035. Let n = y - -33. Let j = 0.3 - 0.2. Sort j, n, -3. -3, n, j Let q(s) = -s + 6. Let i be q(6). Let l be (4/(i + 4) - -1) + -3. Put -3, -2, l, 4 in ascending order. -3, -2, l, 4 Let k be -91/2 - (-1)/(-2). Let q be 5 - 8/2 - 2. Put k, -3, 0.5, q in descending order. 0.5, q, -3, k Suppose -7p - 22 = -9p. Suppose 0 = 15s - ps. Sort -12, s, -2 in decreasing order. s, -2, -12 Let k be 0 + ((-2)/4)/((-6)/12). Sort k, 115, -1 in decreasing order. 115, k, -1 Suppose 16 = 2s - 5p, 5s - 25 = 4p - 2. Let y be (4 + 0/s)-1. Let a be (-9 + 3)y/6. Sort a, 1, -5 in increasing order. -5, 1, a Suppose r = 2j - 152, -5j - 2r = -10j + 380. Suppose jk = 72k + 60. Put -1, -2, k, -3 in decreasing order. k, -1, -2, -3 Let p = -1862 + 1861. Sort 3, -0.04, -12, p in increasing order. -12, p, -0.04, 3 Let v(m) = -m2 - 6m + 1. Suppose 0 = -r + 5c - 5, c - 6c - 15 = 3r. Let l be v(r). Let u = l - 23/4. Put 1/2, u, -0.4 in decreasing order. 1/2, u, -0.4 Suppose 18 = 4w - 2w. Let h = 19 - w. Suppose 4n = h + 6. Sort -2, n, -5 in increasing order. -5, -2, n Let r = 0.19 + 0.17. Let x = -0.04 - r. Let z = 1660/1841 + -162/263. Put 0.2, z, x in decreasing order. z, 0.2, x Let r = -3.1 + -2.9. Let n = -10 - r. Let w = -4.2 - n. Put 2/11, 6, w in ascending order. w, 2/11, 6 Let z = 171 + -140. Let n = z + -32. Sort 0, -5, -4, n. -5, -4, n, 0 Let o = -1494 - -1809. Put -3, o, -1 in ascending order. -3, -1, o Let r = -1.9 - -2. Let f = r + -3.1. Put f, 5, 2/7 in descending order. 5, 2/7, f Suppose 2g + 2k = -2k, 0 = 5g - 3k - 13. Suppose -2p + p = -g. Put -5, p, 3 in decreasing order. 3, p, -5 Let z(y) = y*3 + 11y*2 - 24y + 28. Suppose -2a - 15 = t, 29 = -5t - a - 37. Let g be z(t). Sort 12, g, 1 in descending order. 12, g, 1 Suppose -8i + 21i = 117. Put -3, i, -34 in ascending order. -34, -3, i Let r(b) = b*3 + 6b*2 - 7b + 2. Let p be r(-7). Let a(u) = -2u + 0 + 2 + 6 - 1. Let n be a(5). Sort n, -5, p in increasing order. -5, n, p Let k(o) be the third derivative of -o5/60 - 11o*4/24 - 10o*3/3 - 7o*2. Let q be k(-8). Let m = -10 + 6. Sort q, 2/9, m in ascending order. m, 2/9, q Let p = 28.8 + -29. Put 3, 0, -0.15, p in increasing order. p, -0.15, 0, 3 Suppose 0 = 3y - 35o + 30o + 10, -o = 3y + 16. Sort -4, 14, -3, y in decreasing order. 14, -3, -4, y Let i = -1 + 3. Let g = 59.02 - 0.02. Let m = g - 58. Sort m, i, 0.2 in ascending order. 0.2, m, i Let v = -0.21 - 8.79. Let b = v - -1. Let g = -2378/5 + 476. Put -0.2, g, b in descending order. g, -0.2, b Let s(b) be the first derivative of -b2/2 - 3b + 5. Let f be s(-3). Suppose 3q = -3z + z + 19, f = -2q - z + 11. Put q, -2, -4 in ascending order. -4, -2, q Let y(w) = w2 - 10w + 21. Let n be y(6). Suppose -r - 15 = -4r. Suppose 2v + 6 = rv. Sort v, n, -7 in decreasing order. v, n, -7 Let m(a) = 7a + 3. Let q be m(-1). Suppose -5n + 16 = -n. Suppose -y - 11 = -o - o, 0 = no + y - 19. Put 1, q, o in ascending order. q, 1, o Suppose -4 = 2k, -2b - 3k - 22 - 14 = 0. Suppose -6j - 8 - 16 = 0. Put b, -2, -1, j in decreasing order. -1, -2, j, b Suppose -5f - 9 = -8f. Suppose 0 = fn - 6n - 12. Sort 3, 1, n in ascending order. n, 1, 3 Let y(z) = z*2 + 34z - 192. Let m be y(5). Put -5, m, 8 in descending order. 8, m, -5 Let d = 5.33 - 3.33. Let b = 18 - 11. Sort -4, d, b. -4, d, b Suppose -5t + 26 = -4y + y, -20 = 4y - 3t. Let b = 0 + 1. Suppose -i + 6w + 7 = 3w, 3i + 2w + b = 0. Put i, 2, y in descending order. 2, i, y Let w = 259/82 - 68/41. Let s = -2.02 - -0.02. Put s, 3, w in ascending order. s, w, 3 Let m(f) = f*3 - 4f*2 - 18f + 15. Let n be m(7). Put 1, -1, 5, n in descending order. n, 5, 1, -1 Let x = -392 - -388. Put x, 4, 10 in descending order. 10, 4, x Let p = 23.954 - -0.046. Let c = p + -24. Sort c, -4, 1 in ascending order. -4, c, 1 Let x = -1 + 13. Let n = x - 20. Let a = 7.9 + n. Sort 1/6, 0.1, a. a, 0.1, 1/6 Let c = -255.89 - -256. Put 0.4, -4, c in increasing order. -4, c, 0.4 Let r be (-1995)/2628 + (-6 - (-162)/24). Put 5, -2/5, r in descending order. 5, r, -2/5 Let w(v) = -6v - 16. Let n be w(-8). Let d = 27 - n. Put d, 0, -2, 4 in descending order. 4, 0, -2, d Let m = -32.002 - -32. Let b = -3.002 - m. Let a = -0.2 - -0.4. Put -0.2, a, b in decreasing order. a, -0.2, b Suppose 3 = -3a - 0a. Let x = 0.4 + -0.1. Sort x, -2/7, a in decreasing order. x, -2/7, a Let t = -13 + 12.92. Let l = t - -0.14. Let j = l + -0.56. Sort j, -1, -0.2 in descending order. -0.2, j, -1 Let a = -272 + 265. Put 2, 1, a, 4 in increasing order. a, 1, 2, 4 Let w = 2.623 - -0.747. Let d = 3.4 - w. Put d, 1/5, -5/3 in ascending order. -5/3, d, 1/5 Let b be ((-444)/(-84))/(2/44). Let y = -116 + b. Let t = -0.8 + 1. Sort t, 1/2, y in descending order. 1/2, y, t Let o = 0 - 3. Let j = 6 + o. Let s = -106 - -102. Sort j, -5, s. -5, s, j Let u = -471.4 - -471. Let w = -0.2 + -0.3. Sort w, u, -0.01 in descending order. -0.01, u, w Let v = 2 - 3. Let s be (80/50)/(2/(-40)). Let q = s + 34. Put v, 0, q in descending order. q, 0, v Let j = -1268 + 1268. Sort j, 193, 3 in decreasing order. 193, 3, j Let p = 1.94 + 0.06. Let d = -87 - -90. Sort d, p, -7/6 in increasing order. -7/6, p, d Suppose 0 = -w - 1 - 0. Let c = -156 + 161. Sort c, 1, w in descending order. c, 1, w Let v = -167 - -189. Put -0.5, v, -2/11 in descending order. v, -2/11, -0.5 Suppose 10r = 3r. Let g be ((-45)/(-6))/((-3)/(-6)). Let d be 12/15g/(-3). Sort r, d, 5 in descending order. 5, r, d Let t = 0.0901 + -203.0901. Sort t, 1, 2/11 in decreasing order. 1, 2/11, t Let k = -1.1452 - -0.1452. Sort -1/4, k, 1, -10. -10, k, -1/4, 1 Let u(y) = -y - 10. Let p be u(-8). Let f be (4 - (26/3 - 4))6. Put f, -16, p in increasing order. -16, f, p Suppose 4f = -f + 105. Let p be 2/3 - 245/f. Let s be (-6)/(-2) + p - -3. Sort -2, s, 0. s, -2, 0 Let g = -759 - -5314/7. Let o = 2.5 - 2. Put 2/9, g, o in descending order. o, 2/9, g Let c = 2383 - 2382. Let i = 50 - 47.7. Put i, -2/9, c in descending order. i, c, -2/9 Let b = 383 + -382. Put -24, b, 0, -1 in descending order. b, 0, -1, -24 Let p = 27.9544 - -0.0456. Sort 3/2, 2/25, -1/4, p in decreasing order. p, 3/2, 2/25, -1/4 Suppose 31o = 23o + 1072. Put 1, 0, o in ascending order. 0, 1, o Let w = 0.04135 + 0.45865. Let g = -14/3 - -44/9. Put w, -7, g in decreasing order. w, g, -7 Let j be ((-18)/(-5))/((-4)/10). Let b(p) = 6 + p*2 - 3 + 13p - 5*p. Let c be b(-8). Sort 1, c, j. j, 1,	{ "pile_set_name": "DM Mathematics" }
Let b(h) = 7h3 + 2h*2 - h - 2. Give -3b(i) - 2g(i). -7i*3 + i Let m(n) = -11n*2 + 20n - 15. Let b(o) = 6o2 - 12o + 8. Let w(t) = 5b(t) + 3m(t). Let z(d) = -4d2 + d - 6. Calculate -3w(p) + 2z(p). p2 + 2p + 3 Let y(j) = -7j2 + 6j - 4. Let k(x) = -8x2 + 7x - 4. Calculate -3k(g) + 4y(g). -4g2 + 3g - 4 Let w(g) = 138g - 11. Let x(y) = -3. Calculate -w(i) + 5x(i). -138i - 4 Let z(y) be the first derivative of 10y*3/3 - 3y*2 - 3y - 245. Let w(j) = 11j2 - 7j - 4. Give 5w(p) - 6z(p). -5p2 + p - 2 Let c = 82 - 85. Let s(k) = -5k - 4. Let z(u) = -4u - 5. Determine cs(l) + 2z(l). 7l + 2 Let p(k) = -109k + 16. Let b(g) = -38g + 5. Determine -8b(q) + 3p(q). -23q + 8 Let x(d) = -6d - 3. Let y(u) = -9u - 5. Let p(n) = -5n*3 + 46n*2 - 6n - 19. Let f be p(9). Give fx(k) - 5y(k). -3k + 1 Let y(z) = -4z*3 + 7z*2 + z + 9. Let x(q) = 2q + 5q2 - 3q*3 + 120484 - q - 120478. Give 7x(o) - 5y(o). -o3 + 2o - 3 Let h(o) = 4o2 + 1. Let j(r) be the third derivative of -r5/15 + 26r*2 - 2r. What is -4h(g) - 3j(g)? -4g2 - 4 Let t(h) = -h3 + 9h*2 - 71h - 35. Let r(c) = c*3 - 5c*2 + 36c + 20. What is -7r(n) - 4t(n)? -3n3 - n2 + 32n Let q(z) = z*2 - 2z - 40. Let j be q(7). Let t(d) = 7d2 - 3d. Let h(y) = -10y2 + 5y. What is jh(p) - 7t(p)? p*2 - 4p Let s(p) = 35p2 - 2p + 2. Let b(h) = 70h2 - 5h + 5. What is 2b(l) - 5s(l)? -35l2 Let z(b) be the first derivative of -5b*4/2 - 3b*2/2 + 3b + 123. Let r(s) = 29s3 + 8s - 8. Calculate -3r(m) - 8z(m). -7m3 Let q(f) = -7f*2 + 2. Let p(w) = -2w*2 - 57w - 87. Let h be p(-27). Let b(n) = 43n2 - 13. Give hb(v) - 39q(v). 15v*2 Let m(i) = 4i - 2. Let s(d) = -29d2 + 15d - 10. Determine -5m(h) + s(h). -29h*2 - 5h Let k(y) be the third derivative of y4/24 + y3/6 + 86y2. Let a(u) = u3 - 2u*2 - u. Calculate 2a(z) + 2k(z). 2z*3 - 4z*2 + 2 Suppose 0 = 3n - 3. Let p(a) = -a + 3a - n + 2a. Let l be 27/64/(-6). Let x(f) = 7f - 1. Give lx(z) + 5p(z). -z - 2 Let b(h) = -h - 3. Let y(z) = -6. Let f(o) = 1. Let u be -43/(-24)-20. Let d = u - -5. Let p(s) = df(s) - y(s). Give -b(i) - 5p(i). i - 2 Let a(g) = -29 + 4g2 + 26 + 8 + 5g. Let r(j) = -4j2 - 6j - 6. Give -6a(q) - 5r(q). -4q2 Let y(i) be the third derivative of 0i*3 - 5i*2 - 1/12i*5 + 7/120i*6 + 0i + 0 - 5/24i4. Let v(p) = -4p*3 + 3p*2 + 3p. What is -5v(j) - 3y(j)? -j*3 Let w(k) = 12k. Let d(l) = -l. Let u = -17 + 14. What is uw(i) - 42d(i)? 6i Let s(c) = -5c*2 + 6c - 2. Let x(p) = -8p2 + 9p + 1. Let n(u) = -33u2 + 37u + 6. Let h(l) = 2n(l) - 9x(l). Let z = -18 - -13. Give zs(t) - 4h(t). t*2 - 2t - 2 Let u(j) = 18j2 - 416j + 16. Let g(b) = -2b2 - b - 2. What is 8g(y) + u(y)? 2y2 - 424y Let a(k) = -3k2 + 11k - 3. Let v(d) = 2d2 - 7d + 2. Let n(i) = -2i + 23. Let q be n(8). Determine qv(l) + 5a(l). -l2 + 6l - 1 Let f(s) = -s + 1. Let x = -56 - -57. Let l(o) = -o - 1. Let z(i) = 2i + 9. Let k(v) = -5l(v) - z(v). Give xk(b) + 5f(b). -2b + 1 Let z(p) = -88p + 7. Let q(s) = -133s + 10. Calculate -5q(r) + 7z(r). 49r - 1 Let f(l) = 3l2 - 5l - 4. Let g(k) = -16k2 - 28k*2 + 8 - 3 + 5k - 24k2 + 64k*2. Calculate -5f(c) - 4g(c). c2 + 5c Let k(s) = 8s - 11. Let x(g) = -7g + 10. Suppose -2n - 288 = -278. Calculate nk(j) - 6x(j). 2j - 5 Let o(g) = g*2 - g. Suppose 61 - 54 = -7b. Let m = 10 - 1. Let t(n) = 10n2 + 2 - 4n - mn + 3n. Determine bt(i) + 12o(i). 2i2 - 2i - 2 Let i(m) = -5m + 4. Let r(q) = -20q + 17. Calculate -18i(z) + 4r(z). 10z - 4 Let l(q) = -q - 1. Let i(f) = -23f + 7. What is i(s) + 6l(s)? -29s + 1 Let k(f) = -2f + 2. Let n(i) = 177i - 1. What is -2k(v) - n(v)? -173v - 3 Let d(f) = f*2 + 4f - 3. Let r(c) = 3c - 1 - 7 - 4 + 10. What is -2d(g) + 3r(g)? -2g*2 + g Let z(m) = 5m - 3. Let r(o) = 20 - 10o - 14o + 12 - 32o. Give 3r(y) + 32z(y). -8y Let n(u) = -45u + 30. Let v(g) = -10g + 3. Let h(b) = -n(b) + 5v(b). Let r(l) = -2l - 5. Let f be (3 + 0)(-16)/6. Give fr(d) + 3h(d). d - 5 Let s(c) = -c + 4. Let g(a) be the third derivative of a3/6 - 3a*2. Let w(q) = 30q + 1. Let y be w(0). What is ys(i) - 2g(i)? -i + 2 Let m be 5-1(-4 - -3). Let l(f) = -2f - 1. Let j = -20 + 28. Suppose 0 = 2v + 2v + j. Let b(t) = -4t - 2. Calculate ml(a) + vb(a). -2a - 1 Let r(u) = -2u*2 - 108u + 4. Let j(b) = 3b2 + 110b - 5. What is 4j(k) + 5r(k)? 2k2 - 100k Let z(q) = -13q3 + 15q*2 + 41q - 5. Let x(n) = 6n3 - 6n*2 - 20n + 2. Calculate -5x(c) - 2z(c). -4c3 + 18c Let v(p) = 6p + 1. Let m(a) = -a - 1. Let w(s) = -3m(s) - v(s). Suppose 24d + 36 = -60. Let t(r) = 4r - 3. Determine dt(b) - 6w(b). 2b Let x(g) = -2g*2 - 2g. Let d(f) = -f*3 + 8f*2 - 8f + 2. Let s be d(1). Let b(o) = o*2 - o. Give sx(q) - 2b(q). -4q*2 Let y(j) = -j. Let r(c) = -5c. Suppose 146 = -6f - 22. Let v = f + 18. What is vy(u) + r(u)? 5u Let a(r) = 19r*3 - 5r*2 - 5r - 5. Let d(y) = 210y3 - 56y*2 - 56y - 56. Let t be -3(-3)/(99/616). Determine ta(c) - 5d(c). 14c3 Let g = 122 + -120. Let v(a) = -a3 - a*2 + a. Let n(q) = 3q*3 + 2q*2 - 2q. Suppose 5h + 1 = 6. What is gv(x) + hn(x)? x3 Suppose -3s + 4 = 1. Let q(k) be the second derivative of k*3/3 + 3k*2/2 - 2k. Let a be (9 - 4)1 - 4. Let u(j) = -1. Determine aq(p) + su(p). 2p + 2 Let w(u) = 596u + 15. Let h(p) = 597p + 10. Determine -3h(a) + 2w(a). -599a Let y(o) = -7o - 9. Let i(b) be the third derivative of -13b4/24 - 17b*3/6 + 22b*2. Calculate 6i(k) - 11y(k). -k - 3 Let b(i) = 2 + 2 - 4i + 0i - 1. Let o(j) = 18j - 16j - 11j + 6. Give -5b(c) + 2o(c). 2c - 3 Let o(v) = 11v - 3v3 + 53v*2 - 4 - 57v*2 + 5v*3. Let h(z) = -2z*3 + 3z*2 - 11z + 3. Calculate -4h(p) - 3o(p). 2p3 + 11p Suppose -12 = 4a - 48. Let l(b) = 1. Let t be 2/(-5) + (-12)/(-5). Let w(p) = -3. Let n(g) = al(g) + tw(g). Let v(i) = -i - 1. Give n(z) + 2v(z). -2z + 1 Let k(h) = 12h - 29. Let a be k(3). Let z(t) = -2t2 + 6t + 4. Let q(o) = -4o2 + 11o + 7. Give az(d) - 4q(d). 2d2 - 2d Let s(n) = -8n - 20. Let b(f) = 5f + 10. Calculate -7b(a) - 4s(a). -3a + 10 Let r(x) be the third derivative of -x5/10 - x4/6 + 146x2 - 3. Let w(m) = m2 - m. Determine r(s) - 3w(s). -9s*2 - s Let h be (300/(-7))/(-4) - 2/(-7). Suppose -7s - 20 = -hs. Let m(n) = -n2 + n - 2. Let p(b) = -b2 + b - 3. Determine sm(d) - 4p(d). -d2 + d + 2 Let m be 4 + (-1 + 4 - 4). Suppose 2v - 22 = -3n, -mn = n - 16. Let i(p) = -2p2 - 5p + 7. Let f(z) = -3z2 - 7z + 10. Determine vf(o) - 7i(o). -o*2 + 1 Let z(w) = 612w*3 - 51w*2 - 17. Let d(n) = 408n*3 - 32n*2 - 11. What is 8d(i) - 5z(i)? 204i3 - i2 - 3 Let a(d) = -d - 1. Let r(l) = l. Let n(f) be the first derivative of -5f2/2 - 31f - 8. Let c be n(-6). Calculate ca(j) + r(j). 2j + 1 Let v(z) = -z*2 + 23z - 4. Let b(x) = -3x2 + 69x - 11. Give 4b(m) - 11v(m). -m*2 + 23m Let y(o) = 5 - 20 + 12 - 2o2 + 3o*3 + 7 + 6o. Suppose 0 = -p + 3p + 8. Let j(w) = -w3 + w2 - w - 1. Give pj(t) - y(t). t*3 - 2t*2 - 2t Suppose -y - 40 = 4m - 6, -y = 6. Let v(p) = 2p2 - p + 4. Let x(a) = a2 - 2a2 - 1 - 1. Determine mx(b) - 3v(b). b2 + 3b + 2 Let j(p) = 20p2 + 5. Let r(u) = 19u*2 + 4. Let d(x) = 19x - 42. Let h be d(2). Calculate hj(g) + 5r(g). 15g2 Let k(q) = -q2 + q + 5. Let p(u) = -u2 + u + 4. Let c(i) = -5k(i) + 6p(i). Let d(z) = -3z*2 + 6z - 6. Calculate 6c(r) - d(r). -3r*2 Let x(o) = 4o*3 - 5o*2 - 6o. Let y(i) = -5i3 + 6i*2 + 7i. Let w = 16 + -22. Let n be (7/(-2) - -1)/(2/4). What is ny(h) + wx(h)? h*3 + h Let r be ((-13)/39)/(2/(-6)). Let v(o) = 4o*3 + 2o2 + o + 1. Let p(j) = j2 + 0j + j3 + 0 + j + 1 + 0j. Calculate rp(i) - v(i). -3i3 - i2 Let k(l) = -l*3 + 11l*2 - 11. Let s = 797 + -791. Let z(v) = 2v*2 - 2. Calculate sk(d) - 33z(d). -6d*3 Let l(s) = -s + 6. Let h = 14 - 26. Let i be 42 + -34/h. Suppose -2f - i = -5t, -2t - 2f + 8 - 2 = 0. Let o(a) =	{ "pile_set_name": "DM Mathematics" }
5r = 55. Calculate the lowest common multiple of b and m. 30 Let t = -17593/2052 + -5/513. Find the common denominator of 4/(-2) + (-206)/12 and t. 12 Let t(w) = -w3 + 6w*2 + w - 5. Let g = 5 - 1. Let n be t(g). Suppose -3c = 1 - n. Find the common denominator of c and 46/3. 3 Let d be ((-21)/(-14))/(1/2). Suppose s - 21 = -dx, -4s + 6x + 67 = x. Calculate the lowest common multiple of 22 and s. 198 Let c be (-1562)/(-8) - (-2)/(-8). Find the common denominator of -95/18 and 3 - 2c/(-12). 18 Let t = -3 + 3. Calculate the least common multiple of 2/((-2)/(-3) - t) and (-6 - -7)/(1/1). 3 Let b(k) = 0k + k2 + k2 - 1 - k. Let q be b(-3). Suppose 0g - 2g = -q. What is the smallest common multiple of 22 and g? 110 Suppose 0 - 2 = 2f. What is the smallest common multiple of 16 and f/(0 + (-3)/12)? 16 Suppose -m - 4t = -9t - 6721, 5t - 5 = 0. Let p = m - 67197/10. Let v = -22903/12 + 1899. Calculate the common denominator of v and p. 60 Let x = 11409/10 - 1137. Calculate the common denominator of 2 - 3 - 11/5 and x. 10 Let a(j) = -j2 + 6j + 7. Suppose -4x + 34 = 3q, -9 = -2x - 1. Calculate the lowest common multiple of 9 and a(q). 63 Suppose 4r = 4q + 285 - 81, 3q = 5r - 249. Calculate the smallest common multiple of 22 and r. 528 Let q = 100699/28 + -3597. Calculate the common denominator of q and -45/16. 112 Let g be ((-12)/(-8))/(3/8). Calculate the least common multiple of 12 and (g/5)/(10/275). 132 Calculate the least common multiple of (-15)/(-2) + 4/8 and 1. 8 What is the common denominator of 11/8 and (-1)/2 + 1 - 89/8? 8 Let l = 9 - -7. What is the smallest common multiple of l and 20? 80 Let j be (-1)/3348678/20. Let s = 19498 - 13682. Let g = s + j. Find the common denominator of g and -17/6. 30 Suppose 2q = -10, 4a + q - 1 = 18. Calculate the lowest common multiple of a and 3. 6 Suppose -3 + 0 = -u. What is the least common multiple of 8 and (u + 0)/((-21)/(-49))? 56 Let c be 2/1 + 1551/36. Let q = c - 137/4. What is the common denominator of q and -23/7? 42 What is the smallest common multiple of 1 and 1/((-1)/(3 + -56))? 53 Suppose -12 - 2 = -a. What is the least common multiple of a and 12? 84 Suppose -6 + 0 = 2l. Calculate the common denominator of (-1)/l - 1883/168 and -91/18. 72 Let z = 198618972479431/30954586001532 - 45/1048171001. Let u = 1/4922 + z. What is the common denominator of 30/11 and u? 132 Suppose -a + 33 = 2a. Let h be 3 + 0/(-5 + 2). Suppose 4i = 5 + h. What is the lowest common multiple of a and i? 22 Suppose 0 = -b + 5u, 11 = -b + u + 3. Find the common denominator of 37/2 and 0/(-13) - (-101)/b. 10 Find the common denominator of 103/40 and (3 - 5) + (-535)/30. 120 Let g(n) be the second derivative of n3/6 - n2 + n. Let x be g(5). Let q = 1 + x. What is the smallest common multiple of 9 and q? 36 Let g be (-1)/(-3 + (-25400)/(-8466)). Let v = -93037/22 - g. Calculate the common denominator of (2 - 2) + (-51)/(-8) and v. 88 Let h = 1863/35 + -234/5. Let j(k) = 2k + 3. Let v be j(-5). Calculate the common denominator of h and (-31)/v + 3/3. 7 Let p = 22 - 16. Let m be (4/3)/(4/p). Suppose 2 = 2v - n, 2v - 3n + 14 = mn. Calculate the lowest common multiple of 8 and v. 24 Let y(d) = -6d*2 - 2d + 1. Let f be y(1). Let l be f/12(-341305)/35. Let v = -5676 + l. Find the common denominator of v and 75/22. 132 Let q(o) = 2o*2 - 4o. What is the lowest common multiple of q(4) and 4? 16 Find the common denominator of 2(-2 - (-162)/(-8)) and (-3 - -2)129/(-24). 8 Calculate the smallest common multiple of 18 and (-16)/(-10)15/63. 36 Let m be (3 + -3)2/6. Suppose -2h - 2 = -4b, b = -2h - mb + 3. What is the common denominator of (-5 - 0)2/(-6) and h? 3 Let v = -8248671 + 2977772223/361. Let b = v - 56239414/10192113. Let y = b - 3416233/564660. Calculate the common denominator of 21/4 and y. 20 Let n = 273617/19900 - -2/4975. Let h = 91 + -65. Find the common denominator of n and 2 + -3 + h/(-16). 8 Let w = -5397 - -48631/9. Calculate the common denominator of -77/6 and w. 18 Suppose 4h + 55 = 315. Suppose -g - 18 - h = -5s, 0 = -2s + 5g + 24. What is the least common multiple of s and 7? 119 Let n(j) = -j - 3. Let m be n(-4). Let i = m + 5. Calculate the smallest common multiple of i and -1((-2)/(-1) + -6). 12 Let u = 15/791 - 80011/6328. Calculate the common denominator of u and 39/2(-2)/22. 88 Let v = -147139/31660 + -4/1583. What is the common denominator of v and -65/6? 60 Let i be (-7)/28 - (-17106)/8. What is the common denominator of (-6)/21 + i/84 and 9/2? 6 Let c(l) = 15l3 + l2 - 3l - 1. Let f be c(-3). Let m be f/585(-83)/16. Let j = 1/260 + m. What is the common denominator of 34/3 and j? 9 Let w be ((-10)/40)/(22/(-55522)). Let c = w - 2521/4. What is the common denominator of 1-2194/(-56) and c? 154 Let k = -333 - -1658/5. Suppose -5n + 28 = 5r - 142, 2n - 2r = 64. Calculate the common denominator of 2 + (-27)/n + 2 and k. 55 Suppose -r = 3r + 64. Find the common denominator of r and (4/(-6))/((-21)/(-261)). 7 Let v(n) = 0n2 + n2 - 3 - 10n - 2n2. Let u be v(-6). Suppose 3b + 3 - u = 0. Calculate the least common multiple of b and 12. 12 Let r = -11189/473 - -262/11. Let k = r + 1263/430. Let l(h) = -6h. Find the common denominator of l(5) and k. 10 Suppose 3m - 8 = 22. Calculate the smallest common multiple of m and 4. 20 Let n = 26843/6 + -4484. Calculate the common denominator of n and 70/(-18)(-2 + 1). 18 Let g = -4514/9 - -496. Find the common denominator of 91/24 and g. 72 Suppose 1818 = 5n + 118. Suppose 2t - n = -0t. Find the common denominator of -2 - (1 - t/4) and 1/9. 18 Let v = 2 - -3. Suppose 0 = -2m - d - 17, 22 = m + vd + 53. Let b = m - -10. What is the smallest common multiple of 18 and b? 36 What is the common denominator of 4/2 - (-78)/(-22) and (-40)/(-300) - (-77)/10? 66 Find the common denominator of -3 + ((-82)/16 - -4) and 117/28. 56 Let w = 562999/76 - 7408. What is the common denominator of 7/22 and w? 836 Let t = 63271968967/2772 + -22825389. Let o = 13/252 + t. What is the common denominator of -109/12 and o? 132 What is the common denominator of (15/2)/((-288)/160) and (-30)/(-4)(-6)/4? 12 What is the common denominator of 14/(-105)1030/8 and -9/5? 30 Let r = 105887/9012 + 1/2253. Calculate the common denominator of 50/11 and r. 44 Suppose -3b + 3s - 4 + 25 = 0, 0 = -3s + 15. Let x = -9 - -2. Let j = 11 + x. Calculate the smallest common multiple of j and b. 12 Let i = 5 + -5. Suppose -5v + 3v = i. Suppose -16 = -2p - 2u + 10, 2u - 6 = v. Calculate the lowest common multiple of p and 6. 30 Suppose -6 + 3 = -3l. Suppose 0r + 3r = 30. What is the lowest common multiple of r and (-8)/(-1) - (0 + l)? 70 Let p = 2149/30 - 247/3. Suppose -h + 6 = -3h. What is the common denominator of p and 114/8h/15? 20 Suppose -3p - 4y = -74, 3y - 23 - 28 = -2p. Suppose p = -3q + q. Find the common denominator of -57/4 and (-1454)/(-180) + (-2)/q. 20 Let y = 11 - 6. Suppose 2k = yk - 2z - 18, -4k = 4z - 4. Calculate the least common multiple of 4 and k. 4 Let f(z) = z3 - 2z*2 - 4z. Let c be ((-24)/96)/((-1)/28). Suppose -cv = v - 176. Calculate the least common multiple of f(4) and v. 176 Calculate the common denominator of ((-1278)/(-720))/(1/4) and (-93)/51/6. 10 Let w = 96 + -76. What is the smallest common multiple of 80 and w? 80 Let i = -48 - -56. Calculate the smallest common multiple of i and 20. 40 Let p = -1/2246 + -67373/15722. Find the common denominator of -30/13 and p. 91 Suppose 2q - 2 = -4x - 4, q + 2 = -x. Let u be -1(x + -10)/1. Find the common denominator of -14/9 and ((-14)/4)/(u/(-14)). 9 Suppose -7x - 3v + 44 = -3x, 44 = 4x + 4v. Suppose 0 = -0l + 3l - 18. Let s = x - l. Calculate the smallest common multiple of s and 7. 35 Let w = -2 - -7. Suppose wd - 8 = d. Suppose 3y - dy - 5 = 0. Calculate the least common multiple of 4 and y. 20 Let f(l) be the third derivative of -l6/24 + l4/24 - 7l2. What is the least common multiple of 6 and f(-1)? 12 Let d = -89 - -116. Calculate the smallest common multiple of 3 and d. 27 Let f(t) be the second derivative of -t4/12 - 2t3/3 + t2 + 2t. Let y be f(-5). Let s = y - -15. What is the sm	{ "pile_set_name": "DM Mathematics" }
pand ((0o + o - 3o)(-o2 + 3o*2 - 3o*2) - 338o*2 + 17o*3 - 59o*3 + 340o*2)(2o2 - 4o*2 + 3o*2). -40o*5 + 2o*4 Expand (-12 - 8 + 10)(0s + 2s + s) + (-4 + 0 + 2)(2s + 1 - 1). -34s Expand (179 + 19l - 179)(0 - 2 + 4). 38l Expand (-z2 - z2 + 0z2)(0 + 0 + 2). -4z2 Expand (2 - 2 + k)(-3 + 5 - 1) + 0k - 2k + 4k - 1 + k + 1 + 2 - 2 + k. 5k Expand (3 - 5 + 5 + 2f2)(5f2 + f2 + 0f*2)(-2 + 1 - 1). -24f4 - 36f2 Expand y3 + 2y3 - 5y3 + (-38 + 38 - y3)(-1 - 1 - 1) + (-3y2 - y2 + 6y2)(3y + 4y - 6y) + y3 + 0y*3 - 2y*3. 2y*3 Expand (0g - g + 4g)(2 - 11 - 6)(g + 4 + g - 5). -90g*2 + 45g Expand -z*3 - 3z3 + z3 + (-z - 5z + 4z)(z - z2 - z) + 1 - 1 - z3. -2z*3 Expand (2x + 0 + 0)(-10 - 5 - 2)(-3 + 5 + 1). -102x Expand (-1 + 5 + 3)(2t2 + 2t*2 - 2t*2). 14t*2 Expand (2 - 6 + 3)(-s + s - s + (2s + 3s - 3s)(-2 - 1 + 1)). 5s Expand (0z*2 - 2z*2 + 0z*2)(5z - 3z - z) - 7z3 - 3z*3 + 0z*3. -12z*3 Expand (0k*2 - 3k2 + k2)(0 - 2 + 3)(0k - 4k*3 + 0k). 8k5 Expand (-n - 1 + 1)(3n2 - 563n + 6 + 563n). -3n*3 - 6n Expand ((2 + 2 - 2)(-3 + 1 + 1) + 4 + 1 + 4)(r + 5r - 4r). 14r Expand (-4d + 3d + 2d)(21d + 43d - 26d). 38d2 Expand (-3j + 3j - j2)(j - 3j + 1 + 6). 2j*3 - 7j*2 Expand (-4u + 3u - u)(-7 + 18 - 9 - 2u). 4u*2 - 4u Expand (x - 5x + 2x)(x3 + 5x*3 - 4x*3) + 2x*4 + 3x*3 - 3x*3 + 6x - 6x - 3x*4 + (-2x*2 - 3x*3 + 2x*2)(0x + 5x - 4x). -8x*4 Expand (-32m + 7m + 5m)(0 - 2m*2 + 0). 40m*3 Expand (-1 - 1 - 1)(-1 + 0 + 3)(-3 + 0 + 1)(o - o + 2o)(-o + 1 - 1). -24o2 Expand (-4d2 + d2 + d*2)((5 - 3 - 1)(-4 + 4 - 1) + 1 + 1 - 4 - 6 + 7 + 6). -8d*2 Expand (1 + 3 - 2)(3m + 3 - 3)(-1 + 2 - 3) - 1 + 3 + 2m - 4m. -14m + 2 Expand (2 - 1 + 0)(t*5 - 2t*3 + 2t*3) + (2t*4 + 2t*4 + 0t*4)(-3 + 3 - 2t). -7t*5 Expand 2y*2 - 17y*4 - 2y*2 + y + 2y - 4y + y4 + (0 - 6 + 4)(-2y4 + 3y*3 - 3y*3). -12y*4 - y Expand (-125 + 125 + 5z*2)(3z2 + 0z2 - z2)(7 - 6 + 0). 10z*4 Expand (5h*4 - 3h*4 - 3h*4)(-2h + 0 + 0) + h5 + 4h*5 - 4h*5. 3h*5 Expand 5 - 3o3 + 1 + o3 + (0 + 2 - 3)(3o*3 + 4 - 4) - 5 - 2o*3 + 5. -7o*3 + 6 Expand -12v*2 - 17v*4 + 12v2 + v3 - v*3 - 2v*4 + (6v*3 - 3v3 - v3)(v + 1 - 1) + 0v2 + v4 + 0v2 + 2v*2 + 2v*4 - 2v*2. -14v*4 Expand (-5 + 2 + 1)(-t2 + t2 - t*3) - 2t*3 - 4t*3 + 3t3. -t3 Expand (1 - 1 + 1)(f4 - 3f*4 + 0f*4)(3f + 2f - 3f) - 9f*3 + 9f*3 + 16f*5. 12f5 Expand -z - z4 + z + (1 - 1 + z*2)(-3z2 + 2z2 - z2) + (-z2 + z2 + 2z2)(2z2 - z2 - 3z*2). -7z*4 Expand (15i - 15i + i3)(i2 - 3 + 2 + 3). i5 + 2i3 Expand 1 - 1 - l3 + (2l - 3l + 0l)(l2 + 2l*2 - 2l2) - l3 - 2l + 2l - 179 - 17l3 + 179. -20l3 Expand (r2 + 3r2 - 3r*2)(5 - 4 + 0)(2 - 1 - 2). -r2 Expand (-480s*2 + 19 + 480s*2 + 2s*3)(-2 - s + 2). -2s4 - 19s Expand -2l5 - 2 + 2 + (-6l2 - l2 + 4l2)(0l - 2l*3 + 0l) - l5 + l5 + l5 + (1 - 1 - l4)(4 - 4 + l). 4l*5 Expand (-11l*2 + 58l - 58l)(-2l3 + 4l*3 - 4l*3). 22l*5 Expand (0l + 3l - l + 1)(2l - 3l + 3l). 4l*2 + 2l Expand (0g4 + 3g*4 - 4g*4)(g - g + 3g). -3g*5 Expand (-4y*2 + 7y*2 - 2y*2 + (0y - 3y + y)(4y - 5y - y) + 2y2 - 3y2 - y2 - 4y2 + y2 + 4y*2)(0y3 + y3 + y3). 8y*5 Expand (0r + 0r + r)(-2 + 5 - 1) - 2r - 4r + 3r + (1 - 1 - 1)(-r - 5r + 4r) - 3r - r + 3r + (1 - 1 - 2r)(-1 + 0 - 1) + 1 - 1 + 2r. 6r Expand (0i3 - 2i*3 + 10i*3)(-2i - 3i + 3i) + (0 + 3 - 5)(-5i4 - i4 + 4i4) - i4 - 10i2 + 1 + 10i*2. -13i*4 + 1 Expand (-2 + 3 + 2)(-5f5 - f2 - f3 + f3). -15f*5 - 3f*2 Expand (-3338 + 3338 - 57h)(3h*2 - 2h*2 - 2h*2). 57h*3 Expand (t - 39 + 2t + 38)(2t + t - 2t). 3t*2 - t Expand (4q - q - q)(2 - 2 - q) + 0q + 0q + q2 - 9 + 11q2 + 9 - q2 + q*2 + 2q*2 + (2 - 2 - 2q)(2q - 5q + q) + 2q*2 - 1 + 1. 18q*2 Expand (-2c + 4c - c)(-3c2 + 2c*3 + 3c*2) - 19c*2 + 19c*2 + 7c*4. 9c4 Expand (h3 - 2h3 + 0h*3)((h + 20h - 5h)(h + h - 4h) + 2h2 - 3h*2 + 2h*2). 31h*5 Expand 3f*2 + 38 + 5f*3 - 38 + (-3f - 2f2 + 3f)(-2 + 2f + 2). f*3 + 3f*2 Expand (-1 + 1 - 7q)(-9 - 6q + 9) - 1 + q*2 + 0q*2 - 2q + 3. 43q2 - 2q + 2 Expand (-191 + 191 - 25t)(2t2 + t2 - 4t*2). 25t*3 Expand (4n2 - n2 - n*2)(0n + n - 3n) - 2n3 - n2 + n2 + n3 + 2n3 - n3 + (0n + 0n + 2n2)(-5 + 4 - 2n + 5). -8n*3 + 8n*2 Expand -3 + 6 - 4 - 3n*2 + (-n + 0n + 0n)(-n + 3 - 3). -2n2 - 1 Expand (4q3 - q2 + q*2 + (3q - 2q - 3q)(-2q*2 - 10q*2 + 6q*2))(-q*2 + 1 - 1). -16q*5 Expand (0 + 3 - 1)(-2g + 3 - 3)(g - g + g). -4g2 Expand 0b - 2b + 0b - 2b + 0b + 0b + (1 - 1 + b)(4 + 1 - 4) + b - 3b + b + 3b + 5b - b. 3b Expand (-7 + 7 - 17u)(-3 - 2 + 4). 17u Expand ((-o - 4o + 4o)(-o*2 + 2o2 + o2) - 6o3 + 2o3 + o3)(3o + o - 2o). -10o*4 Expand (-5 + 1 + 6 - i)(-2 + 8 - 3). -3i + 6 Expand 3i2 + i5 - 3i2 + (-22 + 22 - 2i*2)(0i + 0i + 2i3) - 3i*5 + 2i*5 - 2i*5. -6i*5 Expand -3t*2 - 2t*3 + 3t*2 + (5t + 5t - 2t)(2t - 2t + 2t*2). 14t*3 Expand (5k2 + k2 - 5k2)(-2 + 2 - 2k2) + (2k*3 - 4k*3 - 2k*3)(-8 - 3k + 8). 10k*4 Expand (21f + 24f - 30f - 3f2)(-f + 3 - 3 + (2 - 2 + 2)(f - f + 2f)). -9f3 + 45f*2 Expand (-4 - v + 4)(-4 - 5 - 1 + 11). -v Expand (11c - 5c - 4c)(2 + 2 - 1). 6c Expand (-4f*3 - 3 + 1 + 9f*3)(2f2 + 2f2 - f2). 15f5 - 6f*2 Expand 4q*4 - 2q*2 + 2q*2 - 2q*3 + 2q3 - q4 + (1 - 1 - 2q)(-1 - q3 + 1) - 1 + q4 + 1 - q*4 - 3q*4 + 2q4 - q2 - q4 + q2. 3q4 Expand (1 - g - g + g)(8g3 + 2g*4 - 5g*3 + 3g*3). -2g*5 - 4g*4 + 6g*3 Expand (-3o + 5o - o)(-3 - 4o - 8o*3 + 3o + 7o3). -o4 - o2 - 3o Expand (4 + s - 4)(-85 + 171 - 14s + 12s). -2s*2 + 86s Expand (-5 + 1 - 2)(-4j + 0j + 6j) + j - 4j + 5j. -10j Expand 4l - 1 + 1 + (2 + 1 - 1)(3l - 2l + l) + 2l + 0l - 5l + (-1 + 3 - 1)(-l - 4l + 6l). 6l Expand ((-2f2 + 5f2 - f2)(4f - 2f + 0f) + 9f3 - 5f*2 + 5f*2)(-2 + 4 - 3). -13f3 Expand (22 - 13 - 14)(3o3 - o3 - o3) + 3o - 2o3 - 3o. -7o3 Expand (2k - 7k + 2k)(1 - 2 + 2)(-9 + 8k + 9). -24k*2 Expand -2i*2 + 7i*2 + 3i*2 + (3 + 2i - 3)(-2i + 0i + 4i) + (-5i + i + 3i)(0i + 3i - 4i) - 2 - 2i2 + 2. 11i*2 Expand (-2v - 2v + 3v)(0 + 0 + 3v*2) + 3v*3 + 0v*3 - 2v*3 + (2v*2 - 3v*2 - 2v*2)(3v - 3v - v). v*3 Expand (6a - 24a + 5a)(a + 1 - 1). -13a*2 Expand 3p*3 + 2p*3 - 4p*3 - 4p*3 + 4p*3 + 4p3 + (-4 + p2 + 4)(-2p + 2p - 2p). 3p3 Expand (o + o + o)(2o + o - 2 - 4o). -3o2 - 6o Expand (-31 - 2m + 31)(3m + 5m + 5m). -26m*2 Expand (p - 2p + 0p)(-79p + 20p - 19p). 78p*2 Expand (n + 2n*2 - n)(-19n2 + 33n*2 - 3 - 15n*2) + 0n*4 + 0n4 - n4. -3n4 - 6n2 Expand a4 + 0 + 0 + (a + 2a - 2a)(5a*3 - 4a*3 - 3a3) + a3 - a3 - a4. -2a4 Expand (3k + 0k + 0k)(-4k + 7k2 + 6k - 3k - 2k*3). -6k*4 + 21k*3 - 3k*2 Expand (5 + 2 - 3)(0q2 + 0q2 - q2). -4q2 Expand -c2 + 2c2 + c2 - c*2 - 4 + 4 + (-4c + 0c + 3c)(-4c - 138 + 138). 5c2 Expand (-4x + 3x - x)(0 + 0 + 2)(-4 + 1 + 1). 8x Expand (0 - d + 0)(-2d*2 - 5d*2 - 4d*2). 11d*3 Expand -3k + 3k + k + (4 + 2 - 4)(k - 2k + 0k) + (-3k + k + k)(-1 + 1 + 1). -2k Expand 0i*2 + 3i*2 + 2i*3 + 2i2 - i3 + 3 - 3 + (5i + i - 4i)(3 - 3 - i2). -i3 + 5i*2 Expand (0o + 0o - o3)(36 + o - 36). -o*4 Expand (-2w + 2w + 2w)(3w3 + w3 - 2w3) + 0w + 3w4 + 0w + (2 - 2 - 1)(0w3 + w4 + 0w3) + w2 - 3w4 - w2. 3w4 Expand (-7w + 7w - 7w*4)(-5 - 3 + 0 + 0). 56w*4 Expand	{ "pile_set_name": "DM Mathematics" }
o + 204 = -ko. What is the tens digit of o? 6 Suppose -333 = d - 3c, 0 = -4c - 11 + 3. Let p = 524 - d. What is the units digit of p? 3 What is the hundreds digit of -5 + 442/65 - 1/(-5) - -3136? 1 Let u(s) = s2 - 3013s + 29694. What is the hundreds digit of u(0)? 6 Let v(c) = -135c2 + c + 1. Let m be v(-1). Suppose -20 = -5k, 60k - 59k - 194 = -n. Let u = n + m. What is the tens digit of u? 5 Let a be (-14)/(-21) - -22402/12. Let w = 219 - a. Let n = w + 300. What is the tens digit of n? 1 Let w be (-2 - -5)(-3560)/(-15). What is the hundreds digit of -6 + w + (1 - 2)? 7 Suppose -3431 = 3x + 2g - 9745, 4191 = 2x + 5g. Suppose -f - 458 = -x. What is the units digit of f? 0 Let u be -132 + (-4)/(-5)5. Let b = 68 - 140. Let s = b - u. What is the units digit of s? 6 Let u(s) = -20s - 55. Let b be u(-3). What is the units digit of b/260844/205? 2 Suppose 5s - 16576 - 3507 = u, -s - 3u + 4023 = 0. What is the thousands digit of s? 4 Let j be (-12)/(-22) - 297/(-121). Suppose -3f - jc + 819 = -393, 5c - 1614 = -4f. What is the units digit of f? 6 Suppose 158397 - 99167 = 10q. What is the tens digit of q? 2 Let n = -15 + 19. Suppose u = n - 5. What is the tens digit of (2 - (u + 1))/((-4)/(-98))? 4 Suppose 3i + 4s - 2317 = 0, -1573 = 9i - 11i + 3s. Suppose 5g - 6g + i = -5r, -4g - 3r = -3162. What is the units digit of g? 9 Let f(s) = 9s2 - 122s + 4. What is the hundreds digit of f(-6)? 0 Suppose -464097 = -22q - 51q + 965170. What is the thousands digit of q? 9 Let c(f) = f*3 + 15f*2 + 5f + 18. Let l be c(-15). Let r = 62 + l. Suppose -126 = -ro - t + 556, -4t = -8. What is the hundreds digit of o? 1 Suppose -2a + 27 = -1. Let c be (11 - (1 + 0))/(a/7). Suppose 0m - 256 = -cn - 4m, -m - 105 = -2n. What is the units digit of n? 2 What is the ten thousands digit of (135/30(-16)/(-108))/((-4)/(-97098))? 1 Let t(u) = -u*3 + 101u*2 - 2u + 111. What is the hundreds digit of t(100)? 9 Let i(r) = 7r2 - 3r - 12. Suppose -x = 9x + 60. What is the units digit of i(x)? 8 What is the units digit of 35391/2((-42)/(-54))/(-7)-6? 7 Suppose 2y + 2w + 2 = y, 3y - 5w - 38 = 0. Suppose 771 = -ys + 9s. Let l = -58 + s. What is the tens digit of l? 9 What is the tens digit of ((-160)/6)/(((-70)/(-5))/(-1092)) - -1? 8 Suppose -52 = -9m + 56. Let k be 0((-10)/m + (-2)/(-6)). Suppose k = -7h + 168 + 112. What is the units digit of h? 0 Let r = 250 + -244. Suppose 0 = ra - 2793 - 1989. What is the units digit of a? 7 Let k(c) = -c3 + 23c*2 + 23c + 59. Let z be k(24). Suppose 2f - 4x - 35 = x, -3f + 4x = -z. What is the units digit of f? 5 Suppose -4k = 2o + 6, 5o + 25 + 0 = 0. Let r be (-1 + -7)/(-4)k. Suppose 53 + 41 = 2q + 2g, -82 = -rq + 4g. What is the tens digit of q? 4 Suppose -d + 4q + 227 = 0, -d - 5q = -351 + 79. What is the units digit of 4/2 + (1 - d)/(-1)? 8 Suppose 9a - 179477 = 210097. What is the units digit of a? 6 Let r(x) = 8x*2 + 97x + 38. What is the thousands digit of r(20)? 5 Suppose -57c - 1112412 = -99c. What is the thousands digit of c? 6 Let h(m) = 2088m + 12077. What is the tens digit of h(20)? 3 Let v be (-1 - -2)/((-15)/45). Let d be (-38 + (-1 - v))-1. Suppose -3 = -3y, 5y + d + 13 = 2c. What is the units digit of c? 7 Let k = 23659 + -3633. What is the hundreds digit of k? 0 What is the tens digit of ((-541250)/(-15))/5 + 7/21? 1 Suppose -2v + 4p - 6 = 8p, -4p - 12 = 0. Let k be 239/v - 10/(-30). What is the hundreds digit of 1k/15(0 + 24)? 1 Suppose -12y + 765 = -231. What is the hundreds digit of 172 + 1 - (y - 81)? 1 Suppose 30m - 18m = 33272 + 44500. What is the thousands digit of m? 6 Let s = 3389 + 938. What is the tens digit of s? 2 Let x = -25 + 27. Suppose 0u = 4p - u - 17, 3u = -3. Suppose -3k - 4v = -4k + 37, -xk = -pv - 94. What is the units digit of k? 7 Suppose 152894 - 11342 = 12u. What is the hundreds digit of u? 7 Suppose -4g = -n - 208, -3g + 92 = 4n - 83. Suppose 0 = 48k - gk + 880. Suppose -7o = o - k. What is the tens digit of o? 2 Let k(q) = 49q*3 - 14q - 25q - 50q*3 - 29q*2 + 19. What is the hundreds digit of k(-28)? 3 Suppose -496t + 170t + 10050580 = 0. What is the ten thousands digit of t? 3 Let z be -10 + 2/(-15) + (-128)/(-60). Let f = 17 - 9. What is the units digit of (-54)/((18/f)/(12/z))? 6 Suppose -4n + 922 = -1450. Suppose 9b - n = 4015. What is the hundreds digit of b? 5 Let c(q) = q2 - 4q + 19. Let p be c(6). Suppose -6739 = -px + 8x. What is the units digit of x? 3 Let u = -49411 - -105823. What is the thousands digit of u? 6 Let h(a) = -2a - 3a - 114 + 113 + 3a. Let d be h(4). What is the tens digit of (-225)/(-2) + (1 - d/(-6))? 1 Let o(x) = 44x + 235. Let g be o(-5). Suppose -1888 = -gv + 18527. What is the tens digit of v? 6 Let u(b) = -88b - 133. Let o(k) = 173k + 266. Let s(r) = 6o(r) + 13u(r). What is the tens digit of s(-6)? 0 Suppose -63j + 61j + 4d = -4, 28 = 4j + 2d. Suppose jv - 12030 - 774 = 0. What is the units digit of v? 4 Let g = 3197 + -4562. What is the units digit of 8(-3)/(-60) - g/25? 5 Let b(p) = -16p - 504. Let a be b(0). What is the units digit of ((-40)/(-24))/(2/a-1)? 0 Suppose -g + 2x - 2 = 0, 0 + 1 = g + x. Suppose g = 4f + m - 78, 5f - 2m - 97 = 7. What is the hundreds digit of 10/f + 570/4? 1 Let g(t) = t*2 + 2t - 4. Let p = -90 - -95. Let u be g(p). Suppose 19 = q - u. What is the units digit of q? 0 Let v(r) = -13r3 + 15r*2 + 45r - 63. What is the units digit of v(-11)? 0 Let q(w) = -36w + 142. Suppose 4s + 20 = -3r - 35, 73 = -4s + 3r. What is the hundreds digit of q(s)? 7 Let h(b) = 28b + 28. Suppose 2r + 0a = -5a + 190, -2a = 0. Let c = r - 91. What is the hundreds digit of h(c)? 1 Let w(o) = 26o. Let l(q) = 11 + q - 2 - 4 - 6. Let r(h) = 10l(h) - w(h). What is the tens digit of r(-5)? 7 Let t(u) = -u*3 - 8u*2 - 14u - 12. Let b be t(-6). Suppose -335 = -2h - c, 667 = -bh + 4h + 5c. Suppose -f - 5f = -h. What is the units digit of f? 8 Suppose -2d = q - 13423, -6709 = -d + 20q - 21q. What is the units digit of d? 4 Let y = 48689 - 20126. What is the tens digit of y? 6 Let w(c) = -c*3 + 13c*2 + 17c - 16. Let l be w(14). Suppose 28t - lt = 6. Suppose 0 = 5i + tq - 835, 0 = -0q + q. What is the hundreds digit of i? 1 Suppose -10q - 5 = -9q, -f + 7q + 27300 = 0. What is the thousands digit of f? 7 Suppose -6q = 8680 + 12110. What is the hundreds digit of q/(-6) + 12/(-8)? 5 What is the units digit of (78296/(-32))/(11/(-44))? 7 Let k = -182 - -189. Suppose 0 = kw - 1330 - 182. What is the units digit of w? 6 Let h(q) = 4q + 12. Let l = -374 - -389. What is the tens digit of h(l)? 7 Suppose f + 4x - 40 = -3f, -30 = -5f + 5x. What is the tens digit of f/52 - (-1098)/134? 3 Suppose -p - 3g + 1268 = 0, -2p - 2p + 3g + 5057 = 0. Suppose 7r - 3866 = p. What is the tens digit of r? 3 What is the ten thousands digit of 134/(-268) + (-423945)/(-6)(-3)/(-9)? 2 What is the hundreds digit of (697/51 - 14)/((-2)/91272)? 2 Let o(v) be the second derivative of -2v4/3 + 161v*3/6 + 12v*2 + 235v. What is the tens digit of o(16)? 5 Let d = 7242 - 1541. What is the tens digit of d? 0 Let h = -1581 - -9062. What is the tens digit of h? 8 Let s = 515 - 465. Suppose 0 = sl + 8837 - 59587. What is the thousands digit of l? 1 Suppose 65r - 14 = 58r. What is the units digit of (-98 - (0 - 0))(-15)/r? 5 Let c(d) = 593d - 2d2 - 110 + d3 + 595d + 0d*3 - 1157d. What is the tens digit of c(9)? 3 Let g be (-2)/((-19)/(-9) - (-13)/(-117)). Let l be 14/2 + g + 100/(-25). Suppose -2 = 5s - lq - 412, 3s = -2q + 262. What is the units digit of s? 4 Let g = 30 + -40. Let v = g + 248. What is the tens digit of v? 3 What is the tens digit of 2 + 7339 + 2 - 21(-16)/(-56)? 3 Let q(z) = -z3 + 4z*2 + 6z - 5. Let w be q(5). Suppose w = -i - 27 + 11. Let y(r) = r + 38. What is the tens digit of y(i)? 2 Suppose -2v = 4h - 20, -v - h + 2h = 2. Suppose 0g - 5f + 200 = g, -335 = -vg + 3f. What is the units digit of g? 5 Let s(m) = -m3 - 4m*2 + 2m - 12. Let z be s(-5). Let l(x) = -177x3 - 5 - 7x*2 + 88x*3 + 7x + 91x*z - 4. What is the tens digit	{ "pile_set_name": "DM Mathematics" }
(uu/u2u)(-5/12) assuming u is positive. u(-111/260) Simplify (x*(-15)x/(xxx(-3/5)))/(x(4/9)/x(-2/49)) assuming x is positive. x(-35027/2205) Simplify (a*(3/2)/(aa*(-14/5)a))/(aa5/a)(-27) assuming a is positive. a(1373/10) Simplify ((m(-35)/m)42)(2/43) assuming m is positive. m(-3024/43) Simplify (t(-1/4))(-11)(t*8t)/(t(4/9)/t) assuming t is positive. t(443/36) Simplify (((v/(vv(-1/2))v)(11/8))(-13))43 assuming v is positive. v(-18447/16) Simplify (t(-11))(-3/10)(t(8/9))(-39) assuming t is positive. t(-941/30) Simplify ((f/(ff(-3)))/f14)/(f((f/(ff*(-2/35)))/f)/ff29) assuming f is positive. f(-1367/35) Simplify m*5mmm*(15/4)(mmm(-5))(-33) assuming m is positive. m*(439/4) Simplify ((kk*(-3/4)kk/(k/(k(-3)k))k)14)(-12) assuming k is positive. k(-42) Simplify (j(1/5))(-2/49)(j(-4))45 assuming j is positive. j*(-44102/245) Simplify zzz(-1/8)z*0(z/z2)(-9/8) assuming z is positive. z3 Simplify (y(1/5)y4)/((yy*(-4/5))/yy2) assuming y is positive. y3 Simplify (((h(h/h2)/h)/(h(-4)h))9)(-13/3) assuming h is positive. h(-78) Simplify ((z(-2/15)z)/z)(-4/27)/(z/(zz/(zz/z3zz)))(-3/44) assuming z is positive. z(8/405) Simplify ((g(-1/16)g/g(-2/11))/(g/(g5gg)g/(g(1/5)/g)))(-13) assuming g is positive. g(-60853/880) Simplify (ww(2/9))(12/13)/(w/(w*8/w)w*(2/11)/wwwww) assuming w is positive. w(1693/429) Simplify (((i/(i/(ii/(iii*1)i)i)i)(-12))(3/17))16 assuming i is positive. 1 Simplify (s4s0ss/(s/((s(-2/7)/s)/s))s1)(-33) assuming s is positive. s*(-858/7) Simplify ((nn*(-4)n5)(-13))(-31) assuming n is positive. n806 Simplify l*(-6)/(lll(-10))((l/(l/(ll/(l/(l4l)l)l)))/l)(-16) assuming l is positive. l(-78) Simplify (((q/(q/(qq(-1/7))q))(-14))(-6/11))34 assuming q is positive. q(-408/11) Simplify (r24/(r(-4/3)/rrr))/((r*(-7/5)/r)/rrrr*21r) assuming r is positive. r(56/15) Simplify (g(1/4)gg*16/g)/(gg*(1/28)g(g(-3)/g)/g) assuming g is positive. g(269/14) Simplify (((q(7/4)/q)/q)/(q/(q/(q/q11q))))/((q/(q(q6q)/q))/(qq(-1/3)q)) assuming q is positive. q(197/12) Simplify (x3x)(-3/5)x11/(x9/xx) assuming x is positive. x(-2/5) Simplify w(-1/5)/w14w*0(ww/(ww(-19)))/w assuming w is positive. w(24/5) Simplify (d(5/6))(-4/11)(d/d(-19))19 assuming d is positive. d(12530/33) Simplify ((g(3/4)g*(1/5)g)/(gg/g0(g*8g)/ggg))(-4) assuming g is positive. g(201/5) Simplify z33/z27z/(z(-12)/z)(z/(z*(2/115)z)z)/z assuming z is positive. z(2298/115) Simplify (o(-1)o/(((o/(oo/(o/o(2/11)o)o))/o)/o)(o(-2/7))42)(1/68) assuming o is positive. o(-27/187) Simplify t*22(t/(t/((t*(-5/12)/t)/t))tt)/t(tt/((t/((t/(t/((t(1/21)t)/t)t))/t))/t))(-2/79) assuming t is positive. t(136583/6636) Simplify ((g/g(-4)g)/g(4/3))/(((g(-1)/g)/gg)/(gg*(-3)g)) assuming g is positive. g(17/3) Simplify b17b/(bbb3b)b((b/(b(b/(b/b11)b)/b))/b)(-9) assuming b is positive. b121 Simplify (n*(-2/59)n(-2))(-1/21) assuming n is positive. n(40/413) Simplify (c(3/13)/c*(-3))/(((cc/c(-1/14))/c)/c(-4/9)) assuming c is positive. c(2809/1638) Simplify g16/g*(2/5)(g(1/8))(3/10) assuming g is positive. g*(1251/80) Simplify (qq*(-4/15)/qqqq(2/111))(2/15) assuming q is positive. q(216/925) Simplify (d(2/25)/dd(6/13))/(d(-2/49)dd(-1/23)d) assuming d is positive. d*(-869598/366275) Simplify (((jj(-8/5)/j)/j)/(j/j(2/33)))/((j/(jj(-14)))/j(-19)) assuming j is positive. j(-6029/165) Simplify ((gg*(-6)ggg(-6)/g)/(g(-2))(-16))(-43) assuming g is positive. g1806 Simplify (i25i(-19))/((ii(3/10))/(i/(i/i(-2/15)i)i)) assuming i is positive. i*(137/30) Simplify (((((zz*(2/107)/z)/z)/zzz)/z)/(z/(z/(z/(zz*(-5/9)))z)))/(z*(-34)z(-37)) assuming z is positive. z(67856/963) Simplify c*(6/13)cc/c(-2/25)c(cc*(3/4)cc)24 assuming c is positive. c(30401/325) Simplify (((d(-4)d)/(ddd*(-4/3)d))/((dd2d)/d)(5/2))(-10/3) assuming d is positive. d(365/9) Simplify r/r(-3/8)rrr/((r(3/5)/r)/r)r*(-3)r(rr*(2/31)rr)/r assuming r is positive. r(7241/1240) Simplify (((x(-2/23))(2/13))(-1/25))(-2/59) assuming x is positive. x(-8/441025) Simplify (o(-2/17)/(oo*(-3)))/((oo(-2/5))/o)19 assuming o is positive. o(806/85) Simplify (l/((l(-1/8)/l)/l))*(-17)(ll17l)/(l/(l/l(2/9))) assuming l is positive. l(-2473/72) Simplify (ff/(f/(f(-5/3)/f))ff/(ff*18)f)/(f*(-12)f)(44/7) assuming f is positive. f(1081/21) Simplify (((x/(x/(x/(xx/(x/(xx*9x))))))/(x/x10))(-2/101))28 assuming x is positive. x(112/101) Simplify ((k/k(-18))/(k/k11))/((k/(kk/(k(-14)k)k))/k(-13)) assuming k is positive. k31 Simplify ((f(-9)ff(-7))/((ff(-2/9))/f(-1)))3 assuming f is positive. f(-151/3) Simplify (m4)(-8/7)(mm(-3/7))/m(-1/22) assuming m is positive. m(-87/22) Simplify ((m/m(10/9))/m(-1/18))(-6/17) assuming m is positive. m(1/51) Simplify ((((d/d2)/d)/d(1/26))(5/7))(1/11) assuming d is positive. d(-265/2002) Simplify (nn9)(2/45)n*(-2/19)n(1/8) assuming n is positive. n(635/1368) Simplify ((uuuu(1/9)/uuuuu/u(-18/11)u)(1/70))46 assuming u is positive. u(19918/3465) Simplify ((z(-16)/zz)(-5))36 assuming z is positive. z2880 Simplify ((m(1/18)/m)(-16))(-8/3) assuming m is positive. m(-1088/27) Simplify p(-3/8)(ppp*(-1/7)/p)/pp*(-21)p14 assuming p is positive. p(-421/56) Simplify ((h/((h/h(3/7))/h))16)(-47) assuming h is positive. h(-7520/7) Simplify (r/(r/(r*(1/13)r)r))(-35)(r*3r)14 assuming r is positive. r(693/13) Simplify ((xx(-11/5))/xxx(7/12))(-2/29) assuming x is positive. x(37/870) Simplify ii*(-9)/ii*(-4)/i(i/((ii(-12))/ii))/i(6/11) assuming i is positive. i(-28/11) Simplify (a(-1/12))(2/87)/((a*(-2/27)a)/a(a10/a)/a) assuming a is positive. a(-12415/1566) Simplify (n(2/7))30((nn(12/13))/n)/(n(-16/3)n) assuming n is positive. n(3775/273) Simplify (((k(-2))(-11/2))(-3/28))13 assuming k is positive. k(-429/28) Simplify m/(m*(-2/5)m)m8(m(2/29)/m)46 assuming m is positive. m(-4992/145) Simplify ((y/y(-24))/y)/(y/y*(-12))(yyy(y(-16/5)/yy)/y)(-2/33) assuming y is positive. y(609/55) Simplify ((w(2/9)/w(3/4))/(w(w1w)/w)(8/3))(-3/11) assuming w is positive. w*(211/132) Simplify ((ll(((ll*(-2/5)l)/l)/l)/ll)(1/67)(l*(-1)l)16)(-7) assuming l is positive. l(-56/335) Simplify n14/n*(-4/13)n*(-3/2)n*(2/13)/nnn assuming n is positive. n(363/26) Simplify ((v/((v0v)/v))*(2/11)(vv/v3)/((((v(2/5)v)/v)/vv)/v))(1/5) assuming v is positive. v(-12/275) Simplify (t(1/8)/(tt*(-2/3))t*(-8)/t((t/(t/(t*(8/3)/tt)))/t)/t)(10/11) assuming t is positive. t(-1025/132) Simplify (i(-29)/i(7/4))/((i(2/63)/i)/(i/i(1/8)i)) assuming i is positive. i(-14065/504) Simplify (fff/f(-1/10))(-8/5)(f/(f/(f*(-27)f)f))/(f/((f/(fff(ff16ff)/f))/f)f) assuming f is positive. f(-1374/25) Simplify (r(-22)/(r(rr(-12))/r))/(r(-15/4)/(((rrrr/r(3/11)r)/r)/rr)) assuming r is positive. r(-155/44) Simplify (m(-3))(7/2)/(m9mmm(-11)) assuming m is positive. m(-21/2) Simplify (((dd6/dddd)/((d/(dd/d(-1/4))dd)/d))/((dd4)/d4))(4/7) assuming d is positive. d(33/7) Simplify (ooooo*(-15)oo(o/(ooo(-1/2)/o))/o)(-34) assuming o is positive. o323 Simplify (((j(3/4)/j)(-35))13)(-19) assuming j is positive. j(-8645/4) Simplify ((d1)(-1/73)(d(-1))3)(-47) assuming d is positive. d(10340/73) Simplify ((w(-4/7)/w)/w(-3/5))/((w0/ww)/ww(-17)) assuming w is positive. w(596/35) Simplify (yy*(4/13)yyy(-20))17 assuming y is positive. y(-3689/13) Simplify ((f/(f6f))/(f/(fff(f*3f)/ff)f)(f/f(-2))(-8))*(	{ "pile_set_name": "DM Mathematics" }
p. Calculate -2c(k) - 3w(k). k*2 - k + 1 Let i(t) = -4t*3 + 6t*2 + 7t + 7. Let b(d) = 2d2 + 44d - 903. Let g be b(13). Let q(z) = 3z3 - 4z*2 - 5z - 5. Give gq(m) + 5i(m). m*3 + 2m*2 Let u(z) = -50z*2 + 24z - 14. Let y(n) = 100n2 - 48n + 26. Give 11u(m) + 6y(m). 50m2 - 24m + 2 Let n(z) = 24z3 - z2 - 21z + 249. Let t(c) = -35c3 + 2c*2 + 29c - 373. Give 7n(y) + 5t(y). -7y3 + 3y*2 - 2y - 122 Let u(z) = -3z + 1. Let l(j) be the first derivative of -2j*2 + j + 624. Give -5l(a) + 6u(a). 2a + 1 Let t(k) = -5k - 5. Let a(x) be the second derivative of x2/2 - 931x. What is 5a(m) + t(m)? -5m Let o(k) = -3k3 + k2 - k - 1. Suppose -5v - 16n + 14n = -23, 0 = 2v - n - 11. Let u(q) = q3 - q2 + q + 1. Calculate vo(g) + 5u(g). -10g*3 Let c(f) = -18346f. Let t(q) = -753983948q. Determine 82197c(n) - 2t(n). -18266n Suppose 6l - 289 = -37. Let i be (23/7 - 30/105) + l. Let w(z) = iz - 16z - 17z - 11z. Let g(p) = 1. Determine 3g(r) + 2w(r). 2r + 3 Suppose 141w - 9685 = 6812. Let u(j) = -61j + 4. Let m(q) = 1768q - 117. Give wu(g) + 4m(g). -65g Let t(n) = n - 1. Let z(j) = 79j2 - 24j - 3. Let k(l) = -12l2 + 3l + 1. Let w(q) = -6k(q) - z(q). What is -3t(r) + w(r)? -7r2 + 3r Suppose 610i - 617i = 0. Suppose v + 8 = -2t, -3v - 2v - t - 13 = i. Let r(x) = 32x*2 + 9x + 9. Let u(h) = -8h2 - 2h - 2. Give vr(a) - 9u(a). 8a2 Suppose 0 = -5v + 3a + 23, 287v + 2a - 6 = 285v. Let t(l) = -3l3 + 4l*2 - 9l. Let c(u) = -u*2. Give vc(f) + t(f). -3f3 - 9f Suppose -2j + 4 = 0, -10 = c + 3c - j. Let f(g) = -4g3 + 3g*2 - 5g + 15. Let o(u) = -2u3 + u2 - 2u + 7. Determine cf(r) + 5o(r). -2r3 - r2 + 5 Let u(w) = w + 1. Let i(k) = 22. Let c(m) = 5m - 131. Let a(t) = c(t) + 6i(t). Let l(f) = f3 + 7f*2 + 6f + 4. Let j be l(-6). Calculate ju(n) - a(n). -n + 3 Let s(b) = 265b + 53. Let h(c) = 354c + 72. What is 8h(j) - 11s(j)? -83j - 7 Let g(t) = 10. Let c(y) = y + 1803. Determine -c(r) + 6g(r). -r - 1743 Suppose 0 = -3554s + 3686s - 2640. Let o(u) = u3 - u2 + u - 1. Let h(n) = -10n*3 + 5n*2 - 5n + 5. What is so(j) + 4h(j)? -20j3 Let s(d) = -397d3 + d2 + 45d - 9. Let a(r) = 199r*3 - 27r + 5. Give -5a(c) - 3s(c). 196c3 - 3c2 + 2 Let d(i) be the third derivative of i6/120 - i5/60 - i3/6 - 68i2. Let g(l) = -11l*3 + 4l*2 + 4. Let m = -36 - -37. Determine mg(j) + 4d(j). -7j*3 Let h(j) = -3j*2 - 48j + 84. Let n(k) = 5k2 + 42k - 84. Give 7h(s) + 8n(s). 19s2 - 84 Let v(h) = 8h*2 - 4h - 5. Suppose 3q + 12 = 5q, -2j + 5q = 12. Suppose 0 = 4d + 2 + 6. Let w(t) = 2t*2 - t - 1. What is dv(n) + jw(n)? 2n*2 - n + 1 Let j(h) = 12h*3 + 2h*2 - 3h + 3. Let i(s) = s2 - s2 - s*2 - 1 + 1244s - 623s - 620s. Determine -3i(g) - j(g). -12g3 + g2 Let r(a) = -12a. Suppose 0 = 2c - 0 - 12. Let s(y) = 4y. Suppose 148n + 24n + 25n - 3349 = 0. What is cr(o) + ns(o)? -4o Suppose 6z - 80 = -50. Suppose -3x = zw - 6w + 7, -3x = -4w + 10. Let i(a) = a - 7. Let t(c) = -2c + 8. What is xt(o) - 3i(o)? o + 5 Let x(f) = -5f3. Let l(u) be the first derivative of u4/4 + 1090. Determine 21l(n) + 3x(n). 6n*3 Let y(c) = -17c*2 - 3c + 14439 - 7218 - 7221. Let w(x) = -273x2 - 49x. Calculate -3w(i) + 49y(i). -14i2 Let j(x) = -3x*2 + 3x - 1. Let a(n) = 112n2 - 24n + 16. Calculate -a(l) - 16j(l). -64l*2 - 24l Suppose 10 = -2i + 2h, i = -i - 3h + 5. Let p(j) = -30 + j + 3j2 + j2 + 35. Let o = 7 + -4. Let f(k) = 3k2 + 4. Calculate ip(y) + of(y). y2 - 2y + 2 Suppose -2v - 32 = 4b - 4, 16 = -4b + v. Let i(f) = -19f. Let p(u) = -4u - 11u + 2u. Give bi(j) + 8p(j). -9j Let h(l) = 1. Let a(d) be the second derivative of -3d3/2 + d2 - 2279d. Calculate 3a(x) - 6h(x). -27x Let r(i) = 5i*3 + 1. Let z(c) = 36c*3 - 9c*2 + 2c + 6. Determine 4r(f) - z(f). -16f*3 + 9f*2 - 2f - 2 Let w(u) = 6u2 - u + 1322. Let q(h) = -14h*2 + 2h - 2648. Give 4q(p) + 9w(p). -2p2 - p + 1306 Let t(m) = 12m*2 + 36m + 31. Let k(p) = 3p2 + 9p + 7. Let o(u) = 9k(u) - 2t(u). Let f(l) = 5l2 + 13l + 2. Give -5f(q) + 8o(q). -q*2 + 7q - 2 Let k(c) = 1. Let f(m) = 6m + 10. Let q(n) = 24n + 448 - 776 + n*2 + 437. Let d be q(-6). What is df(p) - 8k(p)? 6p + 2 Let w(h) be the third derivative of h4/12 - h3/3 - 4h2 + 12. Let d(b) = -1. Give 4d(q) + w(q). 2q - 6 Let o be (-2)/3 - (-88)/(-66). Let m = 13 + -12. Let n(v) be the third derivative of v5/60 - v3/2 - 15v2. Let r(w) = w2. Calculate mn(g) + or(g). -g*2 - 3 Let f(b) = -9b*2 + 7b + 3. Suppose -12 = -4v - 4h, v + 4h - 6 + 0 = 0. Let y be v + (-2)/(-6)9. Let j(u) = -4u2 + 3u + 1. Give yj(n) - 2f(n). -2n2 + n - 1 Let t = 8 + -7. Suppose -230 = -33m + 28m. Suppose 0 = -2b - m + 58. Let o(j) = j + 1. Let c(n) = -9n - 8. What is bo(v) + tc(v)? -3v - 2 Let c(p) = 4p3 - 5p*2 - p - 2. Let n = 3174 - 3169. Let a(m) = 2m*3 - 3m*2 - m - 1. What is na(h) - 3c(h)? -2h*3 - 2h + 1 Let i be 1/((-11)/(55/10))-14. Let q(d) = -2d*2 + 4d - 1. Let a(l) be the second derivative of l*4/3 - 3l*3/2 + 3l*2/2 - 34l. Give iq(n) + 3a(n). -2n2 + n + 2 Let w(l) = -l2 + l + 1. Let s(j) = 3j*2 - 6j - 4. Let y(k) = -244k + 1225. Let v be y(5). Calculate vw(h) + s(h). -2h2 - h + 1 Let s(v) = -v2 - 44v - 486. Let h be s(-22). Let u(d) = -7d2 + 3d - 3. Let z(m) = 15m2 - 7m + 7. Determine hz(n) - 5u(n). 5n2 - n + 1 Let z(m) = 65m*2 + 35m + 35. Let v(g) = g + 6 + 5g - 365g*2 + 376g*2. Suppose 0 = w - 4w + 105. Give wv(s) - 6z(s). -5s2 Let h be (-2 + (-3)/(-6))24/(-36). Let a(m) = -3m3 + 7m*2 + 10m + 4. Let t(z) = -z3 + z2 + z + 1. What is ha(g) - 4t(g)? g*3 + 3g*2 + 6g Let n = 16861 - 16806. Let t(p) = 15p2. Let u(i) = -i2. Let g(a) = -5t(a) - 30u(a). Let d(h) = -5h*2. Determine nd(o) - 6g(o). -5o*2 Let s(w) = 5w*3 + 6w + 14. Let d(g) be the first derivative of 0g3 - 3/4g*4 + 58 - 2g*2 - 9g. Determine 8d(j) + 5s(j). j*3 - 2j - 2 Let o(v) = 2v. Let b(c) = -71 + 148 + c - 77. Let y(u) = -4b(u) + o(u). Let z(q) = q. Let p be (-26)/10 - 4/10. Determine py(t) - 7z(t). -t Let t(r) = -7r - 1. Let v(l) = l. Suppose -9o - 10 = -4o. Let k be o/(-4) - (-81)/6. Suppose 3u + 0p + 12 = 5p, 5u + 3p = k. Determine ut(s) + 5v(s). -2s - 1 Let v(f) = 2f*3 + 9f*2 - 10f + 4. Let z(j) = -10j2 + 14j - 6. What is 4v(r) + 3z(r)? 8r3 + 6r*2 + 2r - 2 Let x(a) = -4a - 3. Let o(q) = 155q + 8. Calculate -o(l) - 3x(l). -143l + 1 Let s(h) = 26295974h2 + 23902h + 11951. Let l(w) = -4401w2 - 4w - 2. What is 11951l(p) + 2s(p)? -4403p2 Let u(o) = -2o*3 + 11o*2 + 2o + 4. Let f(y) = y*2 + y + 1. Suppose -67p + 12 = 79. Determine pu(b) + 2f(b). 2b3 - 9b*2 - 2 Let v(f) = -3039f - 4. Let o(c) = 3042c + 3. Calculate 4o(u) + 3v(u). 3051u Let j(z) = 58z - 12. Let p(s) = -1216s + 256. Calculate 64j(v) + 3p(v). 64v Let m(i) = -13i*2 + 6i - 168. Let p(x) = 15x2 - 7x + 168. Give -6m(b) - 5p(b). 3b2 - b + 168 Let c(s) = -5s + 8660. Let p(d) = d - 1441. Calculate 6c(o) + 34p(o). 4o + 2966 Let n(k) = -2485k*3 - 6k*2 + 3k - 6. Let m(a) = -1471120a3 - 3550a*2 + 1775a - 3550. Give -3m(l) + 1775n(l). 2485l3 Let b(d) = 286d*2 - 68d - 42. Let c(i) = -i*2 - 5i - 3. Determine b(w) - 14c(w). 300w*2 + 2w Let a(u) = 2u3 - u2 - u - 3. Let v(m) = -m2 - 1. Let n(l) = -2l*2 - 8l - 3. Let h = 469 + -472. Let i be n(h). Give iv(q) - a(q). -2q*3 - 2q*2 + q Let k(z) = 10z - 4 + 0 - 8z. Let c(w) be the first derivative of -3w*2 + 11w - 7. Let d = 0 - 8. Calculate dk(x) - 3c(x). 2x - 1 Let r(d) = -3d*3 + 322d - 2. Let x(y) = 16y3 - y2 - 1617y + 10. Determine 11r(s) + 2x(s). -s*3 - 2s*2 + 308s - 2 Let q(p) = 2p3 + 5p3 + 4 - p2 + p3 - 8. Let t(k) = -k3 + 1. Suppose -13 = 4i - 25. Suppose 0 = f - x - 4, 0 = -if - x. What is fq(y) + 4t(y)? 4y3 - y2 Let d(k) be the first derivative of 2k**2 - k + 16. Let w(x) be the th	{ "pile_set_name": "DM Mathematics" }
comes next: -13932, -29097, -44258, -59415, -74568, -89717? -104862 What is the next term in -1021, -2116, -3383, -4834, -6481? -8336 What is the next term in -1689, -8, 2791, 6708, 11743? 17896 What is next in 25762, 51516, 77268, 103018, 128766, 154512? 180256 What is next in -25256, -52267, -79278, -106289, -133300? -160311 What comes next: -2648, -21113, -71254, -168911, -329924? -570133 What comes next: -75595, -302399, -680405, -1209613, -1890023, -2721635, -3704449? -4838465 What is next in 7051, 5630, 3299, 58, -4093, -9154? -15125 What is the next term in 20107661, 20107651, 20107635, 20107613, 20107585, 20107551, 20107511? 20107465 What comes next: -2412, -4373, -5878, -6927? -7520 What comes next: -79895, -79338, -78415, -77132, -75495, -73510, -71183? -68520 What is next in 56216, 224476, 504780, 897128, 1401520, 2017956, 2746436? 3586960 What comes next: 1937, -4207, -10361, -16531, -22723, -28943, -35197, -41491? -47831 What is next in -86988, -87020, -87042, -87054, -87056? -87048 What is next in -341358, -682652, -1023948, -1365246, -1706546, -2047848, -2389152? -2730458 What comes next: 8313536, 8313502, 8313482, 8313482, 8313508, 8313566, 8313662, 8313802? 8313992 What comes next: -12592, -43889, -96046, -169057, -262916, -377617, -513154, -669521? -846712 What is the next term in 45908, 183545, 412904, 733955, 1146668, 1651013, 2246960? 2934479 What is the next term in 210637, 421174, 631711, 842248? 1052785 What is the next term in 82510, 82364, 82206, 82030, 81830, 81600, 81334? 81026 What is next in 7695, 30902, 69671, 124008, 193919, 279410, 380487? 497156 What is next in 335, 899, 2391, 5273, 10007, 17055, 26879? 39941 What is next in 927, 1918, 2917, 3924? 4939 What is the next term in -3493, -4242, -5505, -7288, -9597, -12438, -15817? -19740 What is next in -17011, -111716, -269557, -490534, -774647, -1121896? -1532281 What is next in -518750, -1037496, -1556236, -2074970, -2593698, -3112420? -3631136 What is next in -11055, -11148, -11253, -11376, -11523, -11700? -11913 What is the next term in 1921, -1870, -5661? -9452 What is next in -54199, -108597, -162995, -217393, -271791? -326189 What is the next term in 1474218, 2948396, 4422574? 5896752 What comes next: -720489, -720538, -720585, -720630, -720673? -720714 What is the next term in 52808206, 52808128, 52808036, 52807924, 52807786, 52807616, 52807408? 52807156 What is next in -1226478, -9811730, -33114550, -78493722, -153308030, -264916258, -420677190? -627949610 What comes next: 248975, 249018, 249059, 249098, 249135? 249170 What comes next: -6368, -25610, -57678, -102572, -160292, -230838, -314210? -410408 What is the next term in 151951, 303934, 455903, 607852, 759775? 911666 What is next in -4070, -4810, -6018, -7928, -10774, -14790, -20210, -27268? -36198 What is next in -17410, -34877, -52322, -69745, -87146, -104525? -121882 What comes next: 291135, 582343, 873617, 1164951, 1456339, 1747775, 2039253? 2330767 What comes next: -2576, -6619, -12314, -19667, -28684? -39371 What comes next: -1106456, -1106550, -1106644, -1106738? -1106832 What is the next term in -12520, -25108, -37654, -50158, -62620? -75040 What is the next term in -514223, -4113807, -13884105, -32910473, -64278267, -111072843, -176379557, -263283765? -374870823 What is next in 3579, 7192, 10773, 14322, 17839, 21324, 24777? 28198 What is the next term in 735614, 735645, 735676? 735707 What is the next term in -10878, -20219, -45578, -94965, -176390, -297863, -467394, -692993? -982670 What is next in 2355, 10405, 24083, 43383, 68299, 98825, 134955, 176683? 224003 What comes next: 1109, 1358, 1571, 1730, 1817, 1814, 1703? 1466 What comes next: 1428, 1402, 1360, 1302, 1228, 1138? 1032 What is the next term in -493, -1521, -3141, -5413, -8397, -12153, -16741? -22221 What is the next term in -199227738, -398455476, -597683214, -796910952, -996138690? -1195366428 What comes next: 316037, 632073, 948115, 1264163, 1580217, 1896277, 2212343? 2528415 What is the next term in -2763, -8301, -13839, -19377, -24915, -30453? -35991 What comes next: -38220, -76214, -114204, -152190? -190172 What comes next: 238271, 476719, 715167, 953615, 1192063, 1430511? 1668959 What comes next: 102238, 101768, 101298, 100828? 100358 What is next in -85898, -337256, -756186, -1342688, -2096762, -3018408? -4107626 What is the next term in -66375, -66530, -66783, -67128, -67559, -68070? -68655 What is the next term in 11217, 24036, 36855, 49674, 62493, 75312? 88131 What comes next: 695, 2128, 3561, 4994, 6427, 7860? 9293 What comes next: -25328, -50741, -76238, -101819, -127484? -153233 What is the next term in 18809, 150670, 508635, 1205762, 2355109, 4069734, 6462695, 9647050? 13735857 What is the next term in -619737859, -1239475716, -1859213573? -2478951430 What is the next term in -27013947, -27013953, -27013963, -27013977, -27013995, -27014017? -27014043 What comes next: 21445, 20883, 20321, 19759, 19197, 18635? 18073 What comes next: 75, 42, -89, -318, -645, -1070? -1593 What is next in -7664, -14846, -22028, -29210, -36392? -43574 What comes next: -1336, -803, 70, 1271, 2788, 4609, 6722? 9115 What comes next: 13026583, 13026624, 13026663, 13026700? 13026735 What comes next: 14403, 28607, 42809, 57009? 71207 What is the next term in -25995, -26081, -26225, -26427, -26687, -27005? -27381 What comes next: -1870739, -1870760, -1870773, -1870760, -1870703, -1870584, -1870385? -1870088 What is next in -212, -3331, -8544, -15851, -25252, -36747? -50336 What is the next term in -405, -513, -745, -1101, -1581, -2185? -2913 What is next in -170712, -341421, -512130, -682839, -853548? -1024257 What comes next: 124389, 495765, 1114723, 1981263, 3095385, 4457089, 6066375? 7923243 What comes next: -396116, -792242, -1188342, -1584404, -1980416, -2376366, -2772242? -3168032 What is the next term in 57974, 115698, 172966, 229550, 285222, 339754, 392918? 444486 What is the next term in 111073082, 222146166, 333219250? 444292334 What is the next term in -1315, -12064, -41687, -99622, -195307, -338180, -537679, -803242? -1144307 What is the next term in -344506909, -344506906, -344506901, -344506894, -344506885, -344506874? -344506861 What is the next term in 125048, 499865, 1124560, 1999133, 3123584, 4497913, 6122120? 7996205 What is the next term in 15810, 62992, 141560, 251514? 392854 What comes next: 53713, 53945, 54339, 54901, 55637, 56553, 57655? 58949 What comes next: 8858, 8933, 9008, 9083, 9158, 9233? 9308 What comes next: -7473, -29558, -66337, -117810, -183977, -264838? -360393 What is next in 410234, 410222, 410210? 410198 What comes next: 482576, 482588, 482600? 482612 What is next in -17605, -17593, -17583, -17569, -17545? -17505 What is next in -4286286, -4286281, -4286272, -4286259, -4286242? -4286221 What comes next: -62566, -62486, -62406? -62326 What comes next: -2238706, -8954841, -20148398, -35819371, -55967754, -80593541, -109696726, -143277303? -181335266 What is the next term in 1055, 3069, 6035, 9953? 14823 What is next in -102762, -205548, -308334, -411120, -513906, -616692? -719478 What is the next term in 1007399, 1007459, 1007519? 1007579 What comes next: 3045, 8449, 17445, 30027, 46189, 65925, 89229, 116095? 146517 What comes next: 2901656, 2901648, 2901640? 2901632 What comes next: -10171350, -10171351, -10171350, -10171347, -10171342, -10171335? -10171326 What comes next: -1120761, -4483066, -10086907, -17932284, -28019197, -40347646? -54917631 What is the next term in -93, -375, -665, -957, -1245, -1523? -1785 What comes next: -485, -1054, -1961, -3374, -5461, -8390, -12329, -17446? -23909 What comes next: -2023, -4118, -6275, -8488, -10751, -13058, -15403, -17780? -20183 What is next in 237852, 476806, 715760? 954714 What is the next term in 13474852, 13474854, 13474858, 13474864? 13474872 What comes next: 1316315, 2632628, 3948939, 5265248, 6581555, 7897860? 9214163 What comes next: -4280, -8384, -12352, -16190, -19904, -23500, -26984, -30362? -33640 What is next in 4719482, 4719481, 4719476, 4719467? 4719454 What is the next term in 118851, 237781, 356865, 476181, 595807, 715821, 836301, 957325? 1078971 What is the next term in 314281, 629416, 944551, 1259686, 1574821, 1889956? 2205091 What is	{ "pile_set_name": "DM Mathematics" }
ding order. -6/7, w, -5 Let w be (11/(-3) - -4) + 8/(-6). Sort -3, 14, w in ascending order. -3, w, 14 Let l = -0.1 + -1.9. Let i = 7 - 4. Sort -0.3, i, l in increasing order. l, -0.3, i Let x be 7 - 0 - (-2 - -1). Suppose 3p = p + x. Sort p, -5, 2 in decreasing order. p, 2, -5 Suppose 15 = -6b - 21. Sort -3, 1, b, 0.5 in decreasing order. 1, 0.5, -3, b Suppose -14 = z - 4q, 0q = -4z - 4q + 24. Suppose 2 + 2 = -4b. Sort 4, b, z in decreasing order. 4, z, b Let c be (-5)/(-5)(1 - 8). Let f = c + 4. Let t = 2 + -3. Sort f, 0, t in descending order. 0, t, f Let o(h) = -8h. Let n be o(-2). Suppose 3t + 4r = n, r - 4 = -t - 0t. Suppose 2u = 3 - 13. Put u, t, 2 in ascending order. u, t, 2 Suppose l + l = 0. Let a be (-2 + l)2/4. Let n(c) = c*2 + 7c + 5. Let b be n(-5). Sort a, 4, b. b, a, 4 Let f = -5.1 - -5. Let q be (3/21)/(2/4). Put q, f, -2/19 in descending order. q, f, -2/19 Let c = 0.1 - -0.1. Let z = -1.29 + -1.67. Let o = 0.04 - z. Put -2/17, o, c in decreasing order. o, c, -2/17 Let a be 6 + -3 + (3 - 2). Suppose 11 = 5m - an, -5n + 2 = -4m + 3m. Suppose 2b = -2y - 12, mb - b + 8 = 0. Sort y, 1, 5 in descending order. 5, 1, y Let c = -9 - -8.89. Let p = c + 4.11. Let i = 0 + 0.1. Put i, -3, p in decreasing order. p, i, -3 Let i(t) = -3t - 2. Let c = -11 + 9. Let b be i(c). Let j(x) = -x + 5. Let f be j(b). Sort 0, f, 2. 0, f, 2 Suppose -3x = -2q + 1, 5x = 2q + 1 - 0. Suppose 0 = -qg + 2 - 6. Put 5, 0.1, g in decreasing order. 5, 0.1, g Let v(r) = 5r3 + 3r*2 - 4r3 - 1 + 0. Let p be v(-1). Let u = 7 - 11. Sort u, -1, p in ascending order. u, -1, p Let j = 1.96 + 0.04. Let d be ((-5)/35)/(24/(-14)). Let n = d + 1/6. Sort n, 3, j. n, j, 3 Let j be 2/((-44)/26) + 1. Let m(i) = -i3 - 4i2 - 2i - 5. Let d be m(-4). Suppose -c + 4 = d. Sort 1/2, c, j. j, 1/2, c Let v = -19 - -24. Sort -0.7, -3, -2/13, v in increasing order. -3, -0.7, -2/13, v Let o be -7 - (-5 + 4 - 5). Put -16, 2, o, 4 in decreasing order. 4, 2, o, -16 Suppose -30 = -5o - 5s, o - 4s = -7s + 10. Let w = 5 - o. Let d = w - 3. Sort -1, d, 0 in decreasing order. 0, -1, d Let d = -203.6 + 182. Let i = d + 19. Let b = 0.4 - i. Sort b, 0.4, 2 in decreasing order. b, 2, 0.4 Let n = 11 - 10.5. Let r = 0.61 - 0.21. Sort -5, r, n in ascending order. -5, r, n Suppose 4y - 6 = -2, 134 = -g + 2y. Let z be (-1)/(-3) - (-68)/g. Let d = -13 - -8. Sort -1/7, d, z. d, z, -1/7 Let w = -1.1 - 2.9. Let b = -76.2 - -76. Sort b, -3, w in decreasing order. b, -3, w Let s = 0 + -3. Let j = 3.5 - 4. Put j, s, 0.3 in ascending order. s, j, 0.3 Let s = -162 + 166. Sort -4, 3, s. -4, 3, s Suppose -10 + 6 = -z. Let k(n) = -6n2 - n. Let r be k(-1). Sort z, r, -4 in increasing order. r, -4, z Let n be ((-14)/35)/((-2)/20). Suppose 0 = -5v - 5g + 5 - 0, -4 = -nv + 3g. Let i be (2 + (-10)/4)8. Put v, 4, i in decreasing order. 4, v, i Suppose -8 = c + c. Put c, -0.1, 3 in increasing order. c, -0.1, 3 Let m(x) = -x*3 - 11x*2 + 13x - 10. Let n be m(-12). Put 1, -5, n in descending order. 1, -5, n Let r = -19 - -34. Let j be 54/r + 9/(-15). Sort j, 0, -2 in ascending order. -2, 0, j Suppose 0q + 2q = 0. Suppose 3f - 2v = q, -4v + 3 = -3f - 3v. Let s = -1 - -1. Sort 5, s, f. f, s, 5 Let f = 0.1 + 1.1. Let i = 0.7 - f. Sort 2, -3, i. -3, i, 2 Let g = -22 - -18. Sort 5, g, -3. g, -3, 5 Let d = -17 + 22. Sort d, 1/9, -2/11. -2/11, 1/9, d Let h(m) = -3m - 1. Let c be h(1). Let y be (-15)/(-4) - 2/(-8). Suppose j = a + yj + 6, -4a = -j + 11. Sort a, 3, c in decreasing order. 3, a, c Suppose -20l + 7l = 13. Put l, 2, -2, -3 in decreasing order. 2, l, -2, -3 Suppose 12 + 4 = 4y. Put y, 5, -3 in ascending order. -3, y, 5 Suppose 2r + 9 = 17. Put r, -0.1, -3.3 in decreasing order. r, -0.1, -3.3 Let a = 1 - 0.4. Let g = -9.9 - -10. Let d = a - g. Sort d, -3, 0 in decreasing order. d, 0, -3 Let j = -2 - -5. Let d = 3 - 1. Let i = -2.5 + d. Put i, j, 5 in ascending order. i, j, 5 Let m = -0.9 - -1. Let k = m + 0.4. Let f = k + 0.5. Sort -2/11, f, 0.5 in increasing order. -2/11, 0.5, f Let f = -21 - -18.95. Let z = -0.05 - f. Sort 0.3, z, -1/5 in descending order. z, 0.3, -1/5 Let n = -239/56 - -29/7. Put 0.1, n, -2 in decreasing order. 0.1, n, -2 Let n(s) = -s*2 + 2s + 6. Let z be n(-6). Let p be z/36 + (-1)/(-6). Let f(d) = -d*3 + 2d*2 - 2d + 1. Let u be f(2). Put p, u, 3 in decreasing order. 3, p, u Let j(m) be the first derivative of -m + m*2 - 2/3m*3 - 3 + 1/2m*4. Let o be j(1). Sort 0.4, o, -1/2. -1/2, 0.4, o Let k = 17.5 + -17. Sort -1/3, 0, k in increasing order. -1/3, 0, k Let y = 34 - 35. Sort -5, 4, y, -10 in descending order. 4, y, -5, -10 Let v = -6 - -7. Put -1, -5, v in ascending order. -5, -1, v Let c(f) = -8f + 6f2 + 1 + 3f2 - 3 + f - f3. Let v be c(8). Sort -2, v, -1. -2, -1, v Let d = 20.6 + -12.9. Let y = d + -8. Let b = -0.1 + 0.1. Sort y, -3, b in ascending order. -3, y, b Let z = 20 + -15. Let r = 4 + -1. Put -1, z, r in decreasing order. z, r, -1 Let w(s) = -s*3 - 2s*2 + 2s + 1. Let d be w(-3). Sort d, 3, -2. -2, 3, d Let z = 71 - 354/5. Suppose -q - 15 = -20. Sort z, 0.5, q in ascending order. z, 0.5, q Suppose -3r + 14 - 5 = 0. Let j be 6/9 - 7/(-3). Suppose 0 = -g + jg. Sort 5, r, g in increasing order. g, r, 5 Let r = -0.37 - 0.33. Sort r, 0.4, -4 in ascending order. -4, r, 0.4 Suppose 81 = 12l + 285. Sort -1, l, -5 in descending order. -1, -5, l Suppose -1 = s + 1. Let k be 1s(-1)/2. Let p be 0 + (1 - (-2)/2). Put -5, k, p in decreasing order. p, k, -5 Let b be (20/(-12))/5 + 24/(-9). Let g be -2 + 141/2. Put 7, g, b in increasing order. b, g, 7 Let m be 5/25516/(-2). Let r = m - -51. Let b(f) = f3 - 4f*2 + 1. Let p be b(4). Put -0.4, p, r in decreasing order. p, -0.4, r Let i = 0 - -0.4. Let h = 0.4 - i. Let l = 1/80 + 31/80. Sort l, 1, h. h, l, 1 Suppose -14 = 5p + x, p + 0p - 2x = 6. Let w be 0 - (4 + p/2). Let s = 14 - 10. Put w, s, -5 in ascending order. -5, w, s Let z = 0.08 + 3.92. Let p = 2 - z. Suppose -1 = 7v - 3v - 3s, 4s = 5v. Put -0.5, v, p in descending order. -0.5, p, v Let u = 4.3 - 2.3. Put u, -0.4, -0.5 in increasing order. -0.5, -0.4, u Let q = -7/18 - -23/36. Let m = 7 + -10. Sort m, q, 4 in increasing order. m, q, 4 Let f = 0.077 - 1.077. Sort -0.11, -3, f in increasing order. -3, f, -0.11 Let p = 2.2 + -0.2. Let c = -3126/11 - -284. Sort c, -5, p. -5, c, p Suppose h + a - 2 = 0, 0 = -3a - a + 20. Let s be 12/(-20) - (-56)/10. Put h, s, -4 in descending order. s, h, -4 Let d = -1.6 - -7.6. Let b = -4 + d. Sort -0.5, 0.1, b. -0.5, 0.1, b Let s(p) = -4p + 1. Let g be s(-1). Put g, 1, 3 in decreasing order. g, 3, 1 Suppose 0 = -4i + 22 - 2. Suppose iw - 5 + 0 = 0. Let s(f) = 3f*2 - 2f + 1. Let g be s(w). Put 4, g, -3 in ascending order. -3, g, 4 Let g = 5 - 19. Let b = g - -19. Put -6, b, 2 in ascending order. -6, 2, b Let a be (-1)/(14/4 + -3). Sort 1, a, -4. -4, a, 1 Suppose 5u - 1 = 4s, 0 = 5u - 2u - 2s + 1. Suppose -41a + 39a - 4 = 3k, -10 = 5a. Sort k, -9, u in descending order. k, u, -9 Let m = 2.8 + 0.2. Let x(b) = -4 + b + 4b + b*2 - 2b. Let p be x(-4). Put 4/3, m, p in increasing order. p, 4/3, m Let w = -11 - -11. Put 1/2, w, -9/2 in ascending order. -9/2, w, 1/2 Suppose -2a = -0a. Let t(g) = -g*2 + 5g - 7. Let v be t(3). Sort 1, a, v. v, a, 1 Let x = 0.75 - 7.75. Let g = 0.6 - 1. Sort g, x, 2. x, g, 2 Let s(u) = u*2 - 8u - 14. Let l be s(10). Let x be (-12)/8 + l/(-4). Sort x, -5, -4 in decreasing order. x, -4, -5 Suppose 5s - 27 = i, 5i + 77 = -3s - s. Put 0, 4, i, -2 in decreasing order. 4, 0, -2, i Let z be ((-18)/12)/((-6)/(-8)). Sort z, 5, -1 in ascending order. z, -1, 5 Suppose 3z - 2z - 4j - 25 = 0, -5 = 3z + 4j. Suppose 0 = -2i + zi - 9. Sort -2, i, 0 in ascending order. -2, 0, i Let f = 0.5 - 0. Let r = 0.2 - f. Let i = 7 - 3. Sort 3, r, i in increasing order. r, 3, i Let r be 2 + -1 - (-10)/(-2). Let z = 6 + r. Suppose zo = 4x + 4, 0 = -2o - 2x + 9 + 1. Sort 3, o, -4. -4, 3, o Let y = -22 + 21. Let m = y - -2. Let k = 0.05 + -3.05. Sort m, -1/2, k in descending order. m, -1/2, k Let l be (16/(-24))/(4/318). Let r = l + 38. Let u be (-10)/(-4) + r/5. Put 0.5, u, -1/5 in ascending order. u, -1/5, 0.5 Let v(j)	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.