Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
= 0. -12, -1, 1, 13 Suppose 3y2 + 39492y + 129968172 = 0. Calculate y. -6582 Let -m*2/4 - 3111m/4 - 98995/2 = 0. What is m? -3046, -65 Find u, given that u*4 + 26u*3 - 403u*2 + 208u + 2220 = 0. -37, -2, 3, 10 Factor 2f2 + 43572f. 2f(f + 21786) Factor 2k4/9 + 440k*3/9 + 22376k*2/9 - 66880k/3 + 46208. 2(k - 4)2(k + 114)2/9 Solve z2/3 - 6296z - 18889/3 = 0 for z. -1, 18889 Suppose 4t*2/3 + 176t/3 + 640/3 = 0. Calculate t. -40, -4 Factor -4v2 - 660v + 2016. -4(v - 3)(v + 168) Solve -2l4 + 12160l*3 - 17827484l*2 - 1993376640l - 53745434082 = 0. -53, 3093 Factor p*2/5 - 968p/5 - 969/5. (p - 969)(p + 1)/5 Determine v, given that 2v*4/11 - 52v*3/11 - 42v*2 - 72v/11 + 216 = 0. -6, -3, 2, 33 Factor -5a3/2 + 2210a*2 - 56815a/2 + 87100. -5(a - 871)(a - 8)(a - 5)/2 What is k in -k2 - 4028k - 4056196 = 0? -2014 Factor 2a2/7 - 95936a/7 - 95938/7. 2(a - 47969)(a + 1)/7 Factor -w*3/3 - 223496w*2 + 893988w - 2681968/3. -(w - 2)*2(w + 670492)/3 Factor 3o4 - 129o*3 + 774o*2 + 6240o - 45696. 3(o - 34)(o - 8)*2(o + 7) Suppose 3k4/5 + 477k*3/5 + 18564k2/5 = 0. Calculate k. -91, -68, 0 Factor n3/9 + 1595n2/3 + 636272n + 5721664/9. (n + 1)(n + 2392)2/9 Suppose -2h*2/7 + 52h/7 + 1462/7 = 0. What is h? -17, 43 Factor -f*3/10 + 27f*2/10 - 108f/5 + 216/5. -(f - 12)*2(f - 3)/10 Find m, given that m*4/3 + 964m*3/3 + 100674m*2 + 28142660m/3 - 819059647/3 = 0. -329, 23 Factor 7n3 + 2560n*2 + 24188n - 7120. (n + 10)(n + 356)(7n - 2) Factor -3044p*3 + 176544p*2 - 2559540p - 6728. -4(p - 29)2(761p + 2) Factor -5a*2 + 1260a + 21440. -5(a - 268)(a + 16) Factor 2w2/7 - 199620w/7 + 4981018050/7. 2(w - 49905)2/7 Determine u, given that 2u*4/19 - 172u*3/19 - 1094u*2/19 - 920u/19 = 0. -5, -1, 0, 92 Factor -5g2 - 6595g - 39390. -5(g + 6)(g + 1313) Factor -33s2 - 50157s/4 + 285. -3(s + 380)(44s - 1)/4 Suppose -c3/7 - 2496c*2/7 + 4995c/7 - 2498/7 = 0. Calculate c. -2498, 1 What is h in 6h5 - 740h*4 - 5998h*3 - 3668h*2 = 0? -7, -2/3, 0, 131 Factor -5l*3 - 775l*2 - 2290l - 1520. -5(l + 1)(l + 2)(l + 152) Let 5b*5 + 610b*4 + 6315b*3 + 23630b*2 + 35680b + 17760 = 0. Calculate b. -111, -4, -2, -1 Factor -2l2/7 + 2566l/7 - 2564/7. -2(l - 1282)(l - 1)/7 Let 556l3 - 28360l*2 + 204l = 0. Calculate l. 0, 1/139, 51 Determine r, given that 17r4/6 + 2505r*3 + 3307877r*2/6 - 1047252r - 392498/3 = 0. -443, -2/17, 2 Factor -3a3 - 216a*2 + 927a + 1140. -3(a - 5)(a + 1)(a + 76) Determine d so that 2d*2/9 - 1204d/9 + 18400/3 = 0. 50, 552 Factor 2j3/5 + 1678j*2/5 - 74004j/5. 2j(j - 42)(j + 881)/5 What is k in -3k*3 - 237k*2 - 1314k = 0? -73, -6, 0 Suppose 2i3/9 + 824i*2/9 - 69554i/9 + 68728/9 = 0. What is i? -484, 1, 71 Factor -4l2 - 3932l + 3936. -4(l - 1)(l + 984) Factor -y*4/4 + 1961y*3/2 - 3849441y*2/4 + 1921780y - 960400. -(y - 1960)*2(y - 1)2/4 Factor n2/3 + 7952n/3. n(n + 7952)/3 Factor -2w2/17 + 144492w/17 - 2609742258/17. -2(w - 36123)2/17 Solve 10n*3/7 + 17848n*2/7 = 0 for n. -8924/5, 0 Find d such that 2d*4/5 + 13884d*3/5 + 27762d*2/5 + 2776d = 0. -6940, -1, 0 Suppose i*3/2 + 121i*2/2 - 442i + 768 = 0. What is i? -128, 3, 4 Determine z so that z*2 - 285586z + 20389840849 = 0. 142793 Find n such that -2n4 + 102n*3 - 1576n*2 + 7944n - 10368 = 0. 2, 6, 16, 27 Find t such that 2t2 - 67340t + 566834450 = 0. 16835 Let 5r5 + 250r*4 - 4960r*3 + 21120r*2 = 0. What is r? -66, 0, 8 Factor -2u*3/3 + 26u*2 + 3380u/3. -2u(u - 65)(u + 26)/3 Factor q3/2 + 13409q*2/2 + 13407q. q(q + 2)(q + 13407)/2 Factor -4u3 + 25372u*2 - 40246332u + 40220964. -4(u - 3171)2(u - 1) Factor -7l3 - 15475l*2 + 66442l - 17720. -(l - 4)(l + 2215)(7l - 2) Let -5w*2 + 588005w = 0. Calculate w. 0, 117601 Factor 3u3/8 + 33u*2 - 5481u/8 + 12879/4. 3(u - 9)2(u + 106)/8 Factor 5d5 - 87755d*4 - 351070d*3 - 526630d*2 - 351095d - 87775. 5(d - 17555)(d + 1)4 Determine r, given that -r4/8 + 309r3/4 - 92341r*2/8 - 242565r/2 - 616225/2 = 0. -5, 314 Factor q*4 - 12473q*3 + 224286q*2 - 1195808q + 1594240. (q - 12455)(q - 8)2(q - 2) Factor 2y2/3 - 552y - 1658/3. 2(y - 829)(y + 1)/3 Factor -2d2/3 - 19820d/3 + 19822/3. -2(d - 1)(d + 9911)/3 Factor -a*2/10 + 14762a/5. -a(a - 29524)/10 Determine v, given that -4v*3 - 1400v*2 - 16112v + 37856 = 0. -338, -14, 2 Solve -144l4 + 3408l*3 - 15988l*2 - 5616l - 476 = 0 for l. -1/6, 7, 17 Determine f so that 2f3 - 17794f*2 + 35582f - 17790 = 0. 1, 8895 What is i in 5242322i2 + 64760i + 200 = 0? -10/1619 Let -4o4 - 2900o*3 - 721656o*2 - 66364272o - 1178787168 = 0. What is o? -234, -23 Determine w so that 4w3 - 402908w*2 + 10145727072w + 10146129984 = 0. -1, 50364 Determine h so that -2h5/9 - 74h*4 + 6850h*3/9 - 1210h*2/3 - 68768h/9 - 19208/3 = 0. -343, -2, -1, 6, 7 Let 2k5/3 + 2078k*4/3 - 25312k*3/3 - 91528k*2/3 + 1012160k/3 + 3363200/3 = 0. Calculate k. -1051, -4, 10 Determine t, given that 39t4 - 20937t*3 + 120759t*2 + 164037t + 22302 = 0. -1, -2/13, 7, 531 Factor 2q3 + 716q*2 + 57970q - 1119008. 2(q - 16)(q + 187)*2 Factor -2v*4/25 - 15124v*3/25 + 30254v*2/25 - 15128v/25. -2v(v - 1)*2(v + 7564)/25 Find j such that j*2/2 + 19420j + 188568200 = 0. -19420 Factor -2v2/13 + 1324v/13 + 209616/13. -2(v - 794)(v + 132)/13 Find g, given that -g*5/4 - 55g*4/4 + 723g*3/2 + 2479g*2 + 5158g + 3504 = 0. -73, -2, 24 Suppose -2a3/5 + 8556a*2/5 - 5130a = 0. Calculate a. 0, 3, 4275 Factor -938p3/9 - 50648p*2/9 - 75954p + 324. -2(p + 27)2(469p - 2)/9 Factor 5v*2 - 400800v + 8032032000. 5(v - 40080)2 Factor -m2/3 + 6332m/3 + 12668/3. -(m - 6334)(m + 2)/3 Factor -3i*4 - 14631i*3 + 219915i*2 - 1100325i + 1834500. -3(i - 5)3(i + 4892) Factor 3j2 - 63804j + 339245868. 3(j - 10634)2 Factor 4i*3/3 - 364i*2 + 26068i - 1680700/3. 4(i - 175)(i - 49)*2/3 Suppose 2w*3/3 + 964w*2 + 25590w + 68112 = 0. Calculate w. -1419, -24, -3 Factor 2o2/3 + 1622o + 106084/3. 2(o + 22)(o + 2411)/3 Determine w so that -w*2/6 + 203w/3 - 404/3 = 0. 2, 404 Let -2c2 + 542212c - 36749231618 = 0. What is c? 135553 Factor 3q3 + 54q*2 - 597q - 3960. 3(q - 11)(q + 5)(q + 24) Factor -3f*2/7 - 4650f/7 - 20181. -3(f + 31)(f + 1519)/7 Find t, given that t*3/3 - 2071t*2/3 + 292805t + 69703629 = 0. -167, 1119 Solve -14p5 + 752p*4 + 1910p*3 - 6320p*2 - 16056p - 4032 = 0 for p. -3, -2, -2/7, 3, 56 Determine r so that -2r4/5 - 548r*3/5 - 34944r*2/5 + 548r/5 + 34946/5 = 0. -173, -101, -1, 1 Suppose -2b3 - 11276b*2/11 - 17386b/11 - 6132/11 = 0. What is b? -511, -1, -6/11 Find x such that 4x3 + 3292x*2 - 74552x - 162240 = 0. -845, -2, 24 Factor j*2 + 51736j - 51737. (j - 1)(j + 51737) Factor -i4 - 31i*3 - 276i*2 - 976i - 1216. -(i + 4)*3(i + 19) Factor 4z3 - 12z*2 - 952z. 4z(z - 17)(z + 14) Solve 21p*2/4 - 98367p/4 + 3513 = 0. 1/7, 4684 Solve 2p2 - 970p + 23868 = 0 for p. 26, 459 Solve -2u5/3 + 6346u*4/3 - 5030788u*3/3 - 5043484u*2/3 + 1676930u + 1679046 = 0 for u. -1, 1, 1587 Let c*4/5 - 98c*3/5 + 2144c*2/5 + 98c/5 - 429 = 0. Calculate c. -1, 1, 33, 65 Factor 4v4 + 512v*3 + 2004v*2 + 2488v + 992. 4(v + 1)2(v + 2)(v + 124) Solve 20h*5 - 2775h*4 + 104740h*3 - 561660h*2 - 871200h = 0. -5/4, 0, 8, 66 Let -5b3 - 15b*2 + 1800b + 15120 = 0. What is b? -12, 21 Let 5a2 + 593110a + 593105 = 0. Calculate a. -118621, -1 Solve 2h5/5 - 116h*4/5 + 1296h*3/5 - 1188h*2 + 12366h/5 - 1944 = 0. 3, 4, 45 What is n in -12n5 + 1107n*4 + 2157n*3 - 17298n*2 + 8844n + 16920 = 0? -5, -3/4, 2, 94 Suppose -4n4 - 4368n*3 + 4376n*2 + 4368n - 4372 = 0. Calculate n. -1093, -1, 1 Solve -3t5/5 - 147t*4/5 - 1221t*3/5 - 1833t*2/5 + 6264t/5 + 1404 = 0 for t. -39, -6, -5, -1, 2 Determine j, given that 2j3/11 + 28j*2/11 - 70j/11 - 96/11 = 0. -16, -1, 3 Factor 2a*3 -	{ "pile_set_name": "DM Mathematics" }
5 = -3i, -5n + 4n - 2i = -47. Calculate the remainder when n is divided by (-101)/(-9) + (-4)/18. 8 Let a be 101/2 + 1/2. What is the remainder when a/9(-1 - -4) is divided by 9? 8 Suppose 3v - 5v = -6. Suppose t + 0 + 1 = 5n, 0 = 5t + n - 21. Calculate the remainder when t is divided by v. 1 Suppose -11f - 2f + 78 = 0. What is the remainder when 6 is divided by f? 0 Let y(d) = 8d*2 + 2d + 1. Calculate the remainder when 25 is divided by y(-1). 4 Let m = -27 + 19. Let f = -5 - m. Let q = 10 + -6. What is the remainder when q is divided by f? 1 Let d(v) = -5v2 - 92v - 26. Calculate the remainder when (58/(-6))/(1/(-3)) is divided by d(-18). 9 Suppose -3h = 5d - 35, 5d + 94 = 5h + 9. What is the remainder when 43 is divided by h? 13 Let g = 3 - 5. Let f be (-4)/1 + (-4)/g. What is the remainder when (-256)/(-6) + f/(-6) is divided by 15? 13 Let n = 94 - 92. What is the remainder when 17 is divided by n? 1 Suppose -17d = -19d + 4. What is the remainder when 2 is divided by d? 0 Let o(i) = 2i + 3. Let j(s) = s + 1. Let b(a) = 6j(a) - o(a). What is the remainder when b(4) is divided by -1(-136)/14 + (-266)/(-931)? 9 Suppose 0y = 3y - 9. Suppose -2x - 37 = -yx. Let t = 14 + -1. What is the remainder when x is divided by t? 11 Suppose 4d + 244 = 5g, 0 = 3g + 2d - 3d - 145. What is the remainder when g is divided by 10? 8 Let j = -1 - -2. Calculate the remainder when (j - (-11)/2)2 is divided by 5. 3 Let y(o) = 3o*2 - 4o + 7. What is the remainder when y(4) is divided by 14? 11 Let r(a) = -a + 1. Let s be r(-3). Let y(v) = -v. Calculate the remainder when 9/2 + (-2)/s is divided by y(-3). 1 Let n = -4 - -4. Suppose d + 2x - 16 = 0, nx - 14 = -4d + 2x. Suppose -57 = -dt + 3t. What is the remainder when 36 is divided by t? 17 Let k(w) = 7w - 1. Let q be k(1). Calculate the remainder when 49 - (-1 + q - 2) is divided by 12. 10 Let m(y) be the second derivative of -y4/12 - 4y*3/3 + 11y*2/2 + 3y. Calculate the remainder when 31 is divided by m(-8). 9 Let i(z) = -5z + 12. Let g(n) = -3n + 8. Let j(o) = -8g(o) + 5i(o). Let h be j(-6). Calculate the remainder when 17 is divided by (-1)/h - 52/(-8). 5 Suppose -5r = 2n + 9, n + r - 3 = -0. Suppose -3u = 5g - 84, -2u - 1 - n = -g. Calculate the remainder when g is divided by 6. 3 Suppose 150 + 414 = 4j. Suppose l - j = -2l + 3r, 0 = 3l - 5r - 143. Calculate the remainder when l is divided by 24. 22 Calculate the remainder when 104 is divided by -1 + -1 + 3 - -2 - -32. 34 Suppose 6 + 0 = 3f. Suppose fx - 26 = 10. Calculate the remainder when 52 is divided by x. 16 Suppose s - 14 = 4b - b, 4s - 96 = 4b. Calculate the remainder when s is divided by 16. 13 Suppose 2l = 6l - 36. What is the remainder when 15 is divided by l? 6 Suppose 2u = m, 3 = 2m + 5u - 6u. Suppose 0 = -2j - 5n + 30, -mj + 15 + 11 = 3n. Calculate the remainder when 28 is divided by j. 8 Let x = 344 - 330. What is the remainder when ((-4)/6)/((-2)/123) is divided by x? 13 Suppose -w + z = -6 - 0, 4z = 5w - 28. Suppose 2d + 40 = 3a, d + 15 = -2d. What is the remainder when a is divided by w? 2 Let o(g) = g*2 + 15g - 10. Let a be o(-14). Let y = -13 - a. What is the remainder when 30 is divided by y? 8 Let a = 60 + -16. Let r(o) = o*3 + 10o*2 - 25o + 4. Calculate the remainder when a is divided by r(-12). 12 Suppose -5f + 4c = -97, -7f + 94 = -3f + 5c. What is the remainder when 102 is divided by f? 18 Let h = -20 + 9. Let y = h + 36. What is the remainder when y is divided by 13? 12 Suppose -2n = -5i + 437 - 71, -129 = -2i - 5n. Calculate the remainder when i is divided by 25. 22 Suppose 0 = a - 5g - 42, 2g + 7 + 69 = 2a. Let z = -12 - -13. What is the remainder when a is divided by -22(-5)/10 - z? 7 Suppose 3s + 5 = 4s. Suppose -sb - 54 = -6b. Suppose -2t + 0 = -k - 27, -3t + 3k + 39 = 0. Calculate the remainder when b is divided by t. 12 Let s = 98 - 58. Suppose -g + s = 3g. What is the remainder when (28 - -1)7/7 is divided by g? 9 Let f(m) = m + 20. Let s be f(-11). Suppose 4z + s - 37 = 0. Let n(l) = 13l. Calculate the remainder when n(1) is divided by z. 6 Let l(s) = s - 10. Suppose -2f - 3i + 29 = 0, -f + 0i + i = -2. Let d be l(f). What is the remainder when d/(3/(-30)3) is divided by 6? 4 Suppose 5r - 4z + 4 = r, 2r - z = 3. Suppose 3i - 15 = -4n, i + 8 = 2n + 3i. Suppose no - 42 + 9 = 0. What is the remainder when o is divided by r? 3 Let i(g) = -2g3 + 3g*2 + 5g - 3. Let z be 2/(-4)(1 + -7). Let q be i(z). Let x = q - -35. Calculate the remainder when x is divided by 11. 9 Let i(w) = 4 + 17w + w*2 - 3w - 2w. Calculate the remainder when 49 is divided by i(-13). 15 Suppose 4s = 4j + 36, -2 + 3 = -s - j. What is the remainder when 6 is divided by s? 2 Suppose -3t - 3v + 6 = -0t, 4t - 6 = -3v. Let u be -3(t - 10/6). Let n(x) = x - 4. Calculate the remainder when n(u) is divided by 1. 0 Let r(f) = f3 + 4f*2 - 5f + 2. Let v be r(-5). Suppose -vn + n = -20. Let j = -45 - -52. Calculate the remainder when n is divided by j. 6 Suppose -3d = -0d - 117. Let b = 25 + -39. Let a = 24 + b. What is the remainder when d is divided by a? 9 Suppose 11 = -7h - 31. Let v(w) = w*3 + w + 7w*2 + 2w + w. What is the remainder when 34 is divided by v(h)? 10 Let n(w) = w*3 + 19w*2 + 18w + 19. What is the remainder when 73 is divided by n(-18)? 16 Calculate the remainder when 2(-57)/12-6 is divided by 29. 28 Suppose 0 = -6c + 54 + 516. What is the remainder when c is divided by 33? 29 Suppose -18i + 210 = -11i. What is the remainder when 119 is divided by i? 29 Let x = -10 + 15. Suppose -k - 1 = -x. Suppose 8a - 132 = ka. What is the remainder when a is divided by 17? 16 Suppose 7n + 208 = 15n. What is the remainder when 47 is divided by n? 21 What is the remainder when 428/1213 is divided by 22? 19 Suppose 2 = -6l + 50. Calculate the remainder when 38 is divided by l. 6 Suppose 0 = 2f - 4l - 40 - 60, -4l - 220 = -5f. Suppose -k + 5k - f = 0. Calculate the remainder when k is divided by (-100)/(-16) - 1/4. 4 Let m be 3/(-1) + 88/2. Let n = m - 27. Calculate the remainder when 2/9 - 232/(-9) is divided by n. 12 Let j(w) = 11w - 3. What is the remainder when j(2) is divided by 3/((-42)/(-4)) + (-1836)/(-189)? 9 Let p(q) = q*3 - 17q*2 + 15q + 20. What is the remainder when 8 is divided by p(16)? 0 Let s be 6/(-15) - 244/(-10). Let g be ((-32)/(-12))/((-4)/(-6)). Suppose -gb + s = -2b. Calculate the remainder when 22 is divided by b. 10 Calculate the remainder when (1 - 1) + 330/6 is divided by 31. 24 Let i(s) = -3s + 83. What is the remainder when i(19) is divided by 14? 12 Let l(i) = 14i*2 + i - 4. Suppose 0t + 3 = -t. What is the remainder when l(t) is divided by 30? 29 Suppose 4o - 5 = -o. What is the remainder when 46/6 - o/(-3) is divided by 7 - (-3 - 1)-1? 2 Let w = 20 + 15. Suppose -2u + 77 + w = 0. What is the remainder when u is divided by 19? 18 Let h(t) = 48t + 2. Calculate the remainder when h(1) is divided by 26. 24 Suppose 16o = 19o - 51. What is the remainder when o is divided by 8? 1 Let s(w) = w*2 + 10. What is the remainder when s(3) is divided by 13? 6 Let s(h) = -18h3 + h2 - 1. Let o be s(1). Let c = o + 103. Suppose -4p + 27 = 3d - 38, 2p - c = -5d. What is the remainder when 28 is divided by d? 13 Let q = 91 - 58. What is the remainder when q is divided by 12? 9 Suppose -2j - 24 = 28. What is the remainder when j/(-10) + (-4)/(-10) is divided by 2? 1 Let g(l) = -l + 10. Let y be g(8). Let w = y + 21. What is the remainder when 68 is divided by w? 22 What is the remainder when (-5 - -3)/(4/(-14)) is divided by 2? 1 Suppose 5c - 14 - 66 = 0. Suppose 4o - 2 + 14 = 4t, 9 = 3o. Let u(y) = y2 - 7. Calculate the remainder when u(t) is divided by c. 13 Let h(i) = -i - 6. What is the remainder when -4-11 - -1 is divided by h(-9)? 2 Suppose 0c - 3c = -15. Suppose 2p - 117 = -p - 3d, 0 = -cp + 2d + 160. What is the remainder when p is divided by (-1)/1 + (-26)/(-2)? 10 Let t(j) = 3 + 3j - 4 + j*2 - 2. Suppose -6n = n + 35. Calculate the remainder when 11 is divided by t(n). 4 Suppose 0 = 3*s - 71 - 82. What is the remainder when	{ "pile_set_name": "DM Mathematics" }
the o'th term of -437, -876, -1321, -1772? -3o2 - 430o - 4 What is the g'th term of -93, 291, 675, 1059? 384g - 477 What is the i'th term of -28, 186, 624, 1280, 2148, 3222? -i3 + 118i*2 - 133i - 12 What is the f'th term of -6056, -24227, -54514, -96917, -151436, -218071? -6058f2 + 3f - 1 What is the a'th term of -138, -51, 242, 861, 1926, 3557, 5874, 8997? 20a3 - 17a*2 - 2a - 139 What is the b'th term of -843, -740, -569, -330? 34b2 + b - 878 What is the w'th term of -142, -209, -286, -379, -494? -w3 + w2 - 63w - 79 What is the y'th term of 949, 972, 995, 1018? 23y + 926 What is the x'th term of -119, -174, -315, -542, -855? -43x*2 + 74x - 150 What is the p'th term of -27769, -27774, -27779, -27784, -27789? -5p - 27764 What is the j'th term of 1576, 1581, 1586, 1591, 1596, 1601? 5j + 1571 What is the i'th term of 3401, 3388, 3365, 3326, 3265? -i3 + i2 - 9i + 3410 What is the y'th term of 1602, 1621, 1642, 1665? y2 + 16y + 1585 What is the k'th term of -7639, -7642, -7645, -7648? -3k - 7636 What is the m'th term of -46, -82, -42, 152, 578, 1314, 2438, 4028? 13m*3 - 40m*2 - 7m - 12 What is the h'th term of -2257, -4602, -6949, -9298, -11649, -14002, -16357? -h*2 - 2342h + 86 What is the p'th term of 1034, 2085, 3154, 4241, 5346, 6469? 9p2 + 1024p + 1 What is the f'th term of 59537, 59531, 59519, 59501? -3f2 + 3f + 59537 What is the t'th term of 387, 1135, 2241, 3705, 5527, 7707? 179t2 + 211t - 3 What is the q'th term of 560, 616, 638, 608, 508, 320, 26? -3q3 + q2 + 74q + 488 What is the o'th term of 1385, 3366, 5335, 7286, 9213, 11110, 12971? -o*3 + 1988o - 602 What is the v'th term of 349, -398, -1649, -3410, -5687, -8486, -11813, -15674? -v*3 - 246v*2 - 2v + 598 What is the c'th term of -115968, -115970, -115972, -115974, -115976, -115978? -2c - 115966 What is the o'th term of 131423, 262694, 393977, 525278, 656603, 787958, 919349, 1050782? o3 + 131264o + 158 What is the j'th term of 52, 145, 266, 409, 568, 737, 910, 1081? -j*3 + 20j*2 + 40j - 7 What is the o'th term of -14887, -29813, -44737, -59659? o*2 - 14929o + 41 What is the c'th term of 6230, 12473, 18714, 24953, 31190, 37425? -c*2 + 6246c - 15 What is the j'th term of 39, 460, 1593, 3792, 7411, 12804, 20325, 30328? 59j3 + 2j*2 + 2j - 24 What is the z'th term of -703512, -1407024, -2110536, -2814048, -3517560, -4221072? -703512z What is the r'th term of 1, -74, -243, -518, -911? -2r*3 - 35r*2 + 44r - 6 What is the t'th term of -57, -87, -103, -105, -93? 7t2 - 51t - 13 What is the d'th term of 22768, 45540, 68312, 91084, 113856, 136628? 22772d - 4 What is the o'th term of 1141, 4554, 10257, 18256, 28557, 41166? o3 + 1139o*2 - 11o + 12 What is the j'th term of -33090, -33083, -33076, -33069? 7j - 33097 What is the h'th term of 12696, 12801, 12922, 13065, 13236, 13441? h3 + 2h*2 + 92h + 12601 What is the n'th term of -5028, -20293, -45740, -81375, -127204? -n*3 - 5085n*2 - 3n + 61 What is the h'th term of -170, -883, -2142, -3947, -6298, -9195? -273h2 + 106h - 3 What is the o'th term of 434, 903, 1684, 2777, 4182, 5899, 7928? 156o2 + o + 277 What is the n'th term of -236, -103, 162, 595, 1232, 2109? 6n*3 + 30n*2 + n - 273 What is the l'th term of 179289, 179292, 179295, 179298, 179301? 3l + 179286 What is the q'th term of 15395, 15378, 15361? -17q + 15412 What is the p'th term of 123, 156, 205, 264, 327, 388, 441? -p3 + 14p*2 - 2p + 112 What is the s'th term of 6776, 13511, 20246, 26981? 6735s + 41 What is the v'th term of 2441, 19504, 65821, 156020, 304729, 526576? 2438v3 - v2 + 4 What is the v'th term of 2788, 5589, 8390, 11191, 13992? 2801v - 13 What is the q'th term of -281, -181, -51, 103, 275, 459, 649, 839? -q3 + 21q*2 + 44q - 345 What is the n'th term of 3528, 6888, 10220, 13518, 16776, 19988? -n*3 - 8n*2 + 3391n + 146 What is the f'th term of -36287, -72585, -108883? -36298f + 11 What is the g'th term of 1067, 1115, 1249, 1511, 1943, 2587? 7g3 + g2 - 4g + 1063 What is the x'th term of -1217, -4924, -11237, -20264, -32113, -46892, -64709, -85672? -18x*3 - 1195x*2 + 4x - 8 What is the i'th term of 298, 783, 1266, 1747? -i*2 + 488i - 189 What is the c'th term of -4100, -8175, -12250, -16325? -4075c - 25 What is the t'th term of -121, -227, -331, -433, -533? t2 - 109t - 13 What is the a'th term of 1417, 2833, 4249, 5665, 7081? 1416a + 1 What is the d'th term of -134, -350, -712, -1226, -1898? -d3 - 67d*2 - 8d - 58 What is the d'th term of 24, -4, -52, -120, -208? -10d2 + 2d + 32 What is the a'th term of -279444, -279446, -279448, -279450, -279452, -279454? -2a - 279442 What is the m'th term of -33, -77, -139, -219, -317, -433? -9m*2 - 17m - 7 What is the s'th term of -14592, -29178, -43764? -14586s - 6 What is the o'th term of -734, -1473, -2212, -2951? -739o + 5 What is the o'th term of 278318, 556637, 834956, 1113275, 1391594? 278319o - 1 What is the c'th term of 8593, 17192, 25791, 34390, 42989, 51588? 8599c - 6 What is the o'th term of -922, -2531, -4834, -7837, -11546? -o*3 - 341o*2 - 579o - 1 What is the c'th term of 86092, 172186, 258280? 86094c - 2 What is the f'th term of -42, 18, 78, 138, 198? 60f - 102 What is the x'th term of 389, 886, 1715, 2876, 4369, 6194? 166x2 - x + 224 What is the q'th term of -34, -149, -310, -517, -770? -23q*2 - 46q + 35 What is the o'th term of -551, -4420, -14923, -35378, -69103, -119416? -553o3 + o2 - o + 2 What is the u'th term of -284, -1956, -6484, -15296, -29820, -51484, -81716? -238u*3 - 6u - 40 What is the c'th term of 41, 19, -75, -277, -623, -1149, -1891, -2885? -6c3 + 20c + 27 What is the u'th term of 9387, 18765, 28141, 37515? -u*2 + 9381u + 7 What is the m'th term of -2485, -4977, -7453, -9907, -12333, -14725, -17077, -19383? m*3 + 2m*2 - 2505m + 17 What is the i'th term of -3161, -6317, -9471, -12623, -15773? i*2 - 3159i - 3 What is the n'th term of 653, 1176, 1699? 523n + 130 What is the x'th term of 1049375, 1049377, 1049379, 1049381, 1049383? 2x + 1049373 What is the k'th term of 602734, 1205469, 1808204, 2410939? 602735k - 1 What is the g'th term of -1259, -1264, -1269? -5g - 1254 What is the p'th term of 1635, 1632, 1629, 1626? -3p + 1638 What is the b'th term of 17127, 33806, 50483, 67158, 83831? -b2 + 16682b + 446 What is the n'th term of 266, 2179, 4094, 6011, 7930? n*2 + 1910n - 1645 What is the o'th term of -45688, -182722, -411112, -730858, -1141960, -1644418? -45678o2 - 10 What is the a'th term of 1426308, 2852619, 4278930, 5705241, 7131552, 8557863? 1426311a - 3 What is the s'th term of 6461, 6446, 6431, 6416, 6401? -15s + 6476 What is the x'th term of 2208836, 2208826, 2208814, 2208800, 2208784, 2208766? -x2 - 7x + 2208844 What is the r'th term of 3780, 3761, 3732, 3693, 3644, 3585? -5r2 - 4r + 3789 What is the q'th term of -985, -918, -851, -784? 67q - 1052 What is the f'th term of 65694, 262765, 591216, 1051047, 1642258, 2364849? 65690f*2 + f + 3 What is the t'th term of 186, 155, 104, 33, -58, -169, -300? -10t*2 - t + 197 What is the f'th term of -82, -245, -556, -1051, -1766, -2737, -4000? -6f*3 - 38f*2 - 7f - 31 What is the w'th term of -137, -259, -587, -1223, -2269? -17w3 - w2 - 119 What is the i'th term of 512, 4649, 11544, 21197, 33608? 1379i2 - 867 What is the i'th term of 496, 923, 1324, 1693, 2024? -i3 - 7i2 + 455i + 49 What is the z'th term of 19588, 19590, 19592, 19594, 19596? 2z + 19586 What is the y'th term of 31, 214, 397, 580, 763, 946? 183y - 152 What is the u'th term of 284, 1278, 2922, 5210, 8136, 11694, 15878, 20682? -u*3 + 331u*2 + 8u - 54 What is the s'th term of -705, -686, -641, -558, -425, -230, 39, 394? 2s3 + s2 + 2s - 710 What is the z'th term of 378929, 757837, 1136731, 1515605, 1894453, 2273269, 2652047, 3030781? -z3 - z2 + 378918z + 13 What is the i'th term of 79, 266, 603, 1108, 1799? 3i*3 + 57i*2 - 5i + 24 What is the q'th term of -15687, -63171, -142305, -253083, -395499? q*3 - 15831q*2 + 2q + 141 What is the r'th term of -324, -658, -992, -1326, -1660, -1994? -334*r + 10 What is the y'th ter	{ "pile_set_name": "DM Mathematics" }
by 718. -5 Calculate 0 divided by -230. 0 Divide 618 by 3. 206 What is -13014 divided by -3? 4338 What is 42 divided by -2? -21 Calculate 604 divided by -4. -151 Calculate -561 divided by 561. -1 What is -11855 divided by -2371? 5 -308 divided by -77 4 4432 divided by -16 -277 -111 divided by -1 111 What is -8592 divided by -16? 537 Divide 66 by -9. -22/3 Calculate -5 divided by -165. 1/33 Divide 21 by -21. -1 Calculate 264 divided by -10. -132/5 Calculate 1908 divided by 9. 212 Calculate 36 divided by 8. 9/2 Calculate 16107 divided by 273. 59 42 divided by -3 -14 Divide 515 by 5. 103 Calculate -9439 divided by -4. 9439/4 Calculate -12529 divided by 67. -187 Calculate -2 divided by -170. 1/85 What is -123 divided by 41? -3 -643 divided by 643 -1 What is 336 divided by 2? 168 -4 divided by -98 2/49 170 divided by 85 2 Divide -2673 by 6. -891/2 Divide 73 by 73. 1 Calculate 207 divided by 3. 69 1080 divided by -4 -270 What is -958 divided by -479? 2 Calculate 3 divided by 57. 1/19 Calculate 10 divided by 65. 2/13 Calculate 39 divided by 87. 13/29 Divide -9 by -26. 9/26 What is -19 divided by -190? 1/10 Divide 7 by -13. -7/13 Divide -1 by 124. -1/124 Calculate 1299 divided by 433. 3 -621 divided by -9 69 Divide -20 by 5. -4 What is -5 divided by 760? -1/152 What is 4598 divided by -2299? -2 What is -208 divided by -8? 26 Calculate -7587 divided by -6. 2529/2 Calculate 1881 divided by -1881. -1 Calculate -58 divided by -29. 2 -30 divided by -102 5/17 What is -17955 divided by -5985? 3 Calculate 2727 divided by 3. 909 Calculate 3930 divided by 3. 1310 196 divided by -49 -4 6 divided by 41 6/41 Divide 4 by 18. 2/9 What is 5 divided by 57? 5/57 What is 640 divided by -8? -80 Calculate -281 divided by -5. 281/5 What is 385 divided by -4? -385/4 548 divided by -137 -4 What is -5 divided by -5966? 5/5966 3 divided by 56 3/56 Divide -6 by -24. 1/4 What is 695 divided by 2? 695/2 What is -1310 divided by 10? -131 Divide -2520 by -63. 40 Divide 235 by 47. 5 Divide 0 by 158. 0 -8 divided by -10 4/5 Calculate -7529 divided by -4. 7529/4 Calculate -2 divided by -57. 2/57 Divide -12 by -6. 2 9496 divided by 3 9496/3 What is -9646 divided by 5? -9646/5 -5 divided by -130 1/26 Divide 0 by 4519. 0 -4 divided by 44 -1/11 What is 10604 divided by 2651? 4 Calculate -727 divided by -32. 727/32 -61 divided by -3 61/3 What is 68 divided by 2? 34 What is 86 divided by 36? 43/18 Divide 1 by 245. 1/245 2 divided by -204 -1/102 -105 divided by 105 -1 -911 divided by 6 -911/6 Calculate -7868 divided by 7. -1124 -1108 divided by -1 1108 What is -7277 divided by 383? -19 Divide -54 by -54. 1 -47 divided by 23 -47/23 -492 divided by 12 -41 Calculate 9100 divided by 13. 700 Divide -5 by -474. 5/474 -14522 divided by -6 7261/3 What is 0 divided by 470? 0 0 divided by 24 0 -1866 divided by -1 1866 What is -1792 divided by -4? 448 Divide 156 by -13. -12 3096 divided by 1548 2 Divide 7 by 4. 7/4 Divide -3 by 53. -3/53 Calculate 5800 divided by -58. -100 426 divided by -17 -426/17 What is 11 divided by 3? 11/3 What is -529 divided by 1? -529 What is -4929 divided by -1643? 3 Divide -4 by -25. 4/25 What is -13479 divided by 3? -4493 Calculate -16806 divided by 6. -2801 Calculate -16 divided by 22. -8/11 366 divided by 183 2 Calculate 6912 divided by 2304. 3 225 divided by -1 -225 -157 divided by 3 -157/3 What is 1820 divided by -7? -260 Calculate 45 divided by -9. -5 What is 1329 divided by 1329? 1 What is -222 divided by -15? 74/5 What is 470 divided by -1? -470 Divide -11639 by 1. -11639 Divide -90 by 90. -1 Divide 559 by 1. 559 Calculate 5 divided by 224. 5/224 Calculate -17 divided by -2. 17/2 Calculate -12453 divided by -2. 12453/2 -158 divided by -5 158/5 -2913 divided by -3 971 -7440 divided by -3 2480 Divide 15 by 1. 15 What is 138 divided by -16? -69/8 Divide 17 by -1. -17 Divide 328 by -4. -82 196 divided by 14 14 -1 divided by 66 -1/66 770 divided by -55 -14 What is 7439 divided by -173? -43 Calculate 1344 divided by 84. 16 What is 20 divided by -157? -20/157 Divide 1307 by 2. 1307/2 1 divided by 3412 1/3412 1224 divided by 9 136 -1160 divided by 580 -2 Divide -6456 by 3228. -2 -1 divided by 23 -1/23 Calculate 14994 divided by 4998. 3 Divide -1234 by -2. 617 What is -56 divided by 1? -56 What is 1 divided by -68? -1/68 Calculate 707 divided by 1. 707 -2 divided by 47 -2/47 Divide 1548 by 387. 4 Calculate -210 divided by 14. -15 Divide -531 by -1. 531 1 divided by -2 -1/2 What is -144 divided by 48? -3 Divide -304 by 152. -2 -10 divided by -61 10/61 Divide 406 by 1. 406 Divide -370 by -5. 74 Divide -156 by -12. 13 What is 5 divided by 61? 5/61 Calculate 2931 divided by -3. -977 43095 divided by -5 -8619 What is -7505 divided by -1501? 5 Divide -1800 by 10. -180 What is 301 divided by 4? 301/4 Divide 2312 by -578. -4 What is 1823 divided by -2? -1823/2 Calculate 9129 divided by -3. -3043 Divide 0 by 25. 0 -17249 divided by -1 17249 What is 160 divided by -32? -5 -63 divided by 9 -7 Divide 26 by 13. 2 What is 0 divided by -2950? 0 Divide -1325 by -5. 265 What is 5100 divided by -850? -6 -5110 divided by -10 511 Calculate 300 divided by 12. 25 What is 1 divided by -53? -1/53 What is -220 divided by -110? 2 -7 divided by 191 -7/191 Calculate 388 divided by -194. -2 Calculate 11 divided by -29. -11/29 Calculate -298 divided by 298. -1 Divide 3 by -1269. -1/423 5 divided by 187 5/187 What is -23 divided by 1? -23 -1000 divided by -4 250 -12896 divided by -416 31 Divide -528 by -176. 3 Calculate -2 divided by 52. -1/26 -4 divided by -108 1/27 Calculate 5 divided by 9. 5/9 Divide 3 by -118. -3/118 Divide -12 by 14. -6/7 Divide 238 by -238. -1 What is 1067 divided by -6? -1067/6 Divide -210 by -105. 2 Calculate 4302 divided by 5. 4302/5 What is 3383 divided by 199? 17 0 divided by 128 0 Divide 488 by 488. 1 Divide -11626 by -5813. 2 Divide 78 by 9. 26/3 What is -12928 divided by -202? 64 Divide -51 by -13. 51/13 Divide -410 by 82. -5 What is -2254 divided by -14? 161 Calculate 4 divided by -29. -4/29 -28 divided by 1 -28 What is 6 divided by 8? 3/4 Divide 5 by 264. 5/264 Divide -1 by 265. -1/265 -6 divided by 6 -1 What is 2828 divided by 707? 4 Divide 4 by -17. -4/17 Divide -1246 by 14. -89 Divide -1248 by -208. 6 What is -333 divided by -9? 37 Calculate -234 divided by -5. 234/5 Calculate 3675 divided by 1225. 3 What is -5179 divided by -2? 5179/2 Divide 65 by -5. -13 -32065 divided by -6413 5 595 divided by -7 -85 Divide 3930 by 5. 786 What is -3 divided by 867? -1/289 171 divided by -26 -171/26 -435 divided by 3 -145 -37 divided by -8 37/8 What is 10818 divided by -1202? -9 Divide 774 by -1. -774 Divide 5 by 22. 5/22 What is 906 divided by -6? -151 Calculate -4 divided by -2. 2 Divide 2709 by 129. 21 What is -248 divided by 248? -1 Divide -16 by 9. -16/9 Divide 3 by -32. -3/32 Calculate 28 divided by -4. -7 Calculate -266 divided by 14. -19 227 divided by -3 -227/3 Calculate 84 divided by -1. -84 What is 34 divided by -8? -17/4 What is 5 divided by 1273? 5/1273 Divide -3 by -40. 3/40 What is 322 divided by 46? 7 Calculate -1880 divided by 4. -470 3 divided by 28 3/28 What is 1180 divided by -236? -5 Divide 6302 by -274. -23 What is -152 divided by -38? 4 Calculate -120 divided by -6. 20 Calculate -5 divided by 1544. -5/1544 -22 divided by -23 22/23 What is 2 divided by -32? -1/16 Calculate -836 divided by 4. -209 Calculate 7672 divided by 1918. 4 Calculate 4 divided by -437. -4/437 Divide -21125 by -5. 4225 What is -432 divided by -432? 1 Divide -3910 by 2. -1955 0 divided by -86 0 -66 divided by -13 66/13 -1029 divided by -343 3 -4 divided by -59 4/59 Calculate 24 divided by -6. -4 What is 295 divided by -59? -5 Calculate -473 divided by -11. 43 -12243 divided by 77 -159 Divide -110 by 5. -22 What is 4 divided by -16? -1/4 Divide 19845 by -3969. -5 Divide 462 by -66. -7 -3 divided by -33 1/11 Divide 1120 by 280. 4 Divide -2 by 5. -2/5 Divide 10 by 4. 5/2 What is 76 divided by -38? -2 Calculate 315 divided by -45. -7 Calculate 27 divided by -9. -3 Divide 9205 by -5. -1841 2646 divided by -378 -7 Calculate -100 divided by -10. 10 What is -7326 divided by -66? 111 Calculate -3 divided by 22. -3/22 Calculate 6160 divided by 44. 140 Divide -81 by 140. -81/140 Calculate -24 divid	{ "pile_set_name": "DM Mathematics" }
t is the second smallest value in 1, -2, -9, 3/20? -2 What is the fourth smallest value in 1/8, 4, -0.025, -19, 3, -0.2? 1/8 Which is the second biggest value? (a) 2 (b) -0.097 (c) -192 b Which is the third biggest value? (a) -163 (b) -11 (c) 25 (d) -2/17 b Which is the fifth smallest value? (a) 1/10 (b) 1/25 (c) 4 (d) -0.1 (e) -2245 c What is the fifth biggest value in -2/5, 0.5, -5, 2, -110/7? -110/7 What is the fifth smallest value in 35, -2/7, -0.23, -2, -0.3? 35 What is the second smallest value in 2/13, 645, 0.06, 5, 8, 0.3? 2/13 Which is the third biggest value? (a) -0.1 (b) 0.3 (c) -5 (d) -6 c What is the third biggest value in -77, 1, -2, 5? -2 What is the smallest value in 0, 0.5, 7, -47, -10/9, 2/9? -47 What is the fourth smallest value in -2, 2/83, -24, 4/9? 4/9 What is the fourth smallest value in 4, 8, -33, 6? 8 What is the biggest value in -2/31, -3/4, 5, -8/15, -4? 5 What is the fifth smallest value in -481, 1/4, -2, 1, 19? 19 Which is the biggest value? (a) 2/9 (b) 7 (c) 5 (d) -1 b What is the fifth biggest value in 0, 0.2, 10387/5, -1/10, 1/2? -1/10 What is the third biggest value in -58/49, 2.2, 4? -58/49 What is the second smallest value in -3, -603, -214? -214 Which is the third biggest value? (a) -40 (b) -4 (c) 0 (d) 2/39 b Which is the third biggest value? (a) 0.7 (b) 1/8 (c) -2 (d) -4 (e) -151 c What is the third biggest value in -2/7, -5/2, -1/4, 324? -2/7 Which is the third biggest value? (a) 2 (b) 0 (c) 12 (d) 8 (e) -0.5 a Which is the third smallest value? (a) 4 (b) -1/65 (c) 31 c What is the third biggest value in 8, -2/5, 0, 3/11? 0 Which is the third biggest value? (a) -1 (b) -0.69 (c) -42 c What is the second biggest value in -242, -11, 3, 5, -1/7, 10? 5 Which is the fifth smallest value? (a) 0.1 (b) -2/7 (c) -4 (d) 0.959 (e) -14 (f) -3 a What is the third smallest value in 0.04, -66, -256? 0.04 Which is the second smallest value? (a) -0.5 (b) 30 (c) -13 (d) -179 c What is the biggest value in 9, 0, -2/5, -4, -29? 9 Which is the biggest value? (a) -2/25 (b) 221 (c) 3/8 (d) -3 (e) 2/25 b Which is the third biggest value? (a) 11 (b) 2/41613 (c) -3 c Which is the second smallest value? (a) -2/15 (b) -141 (c) -7/3 c What is the fifth biggest value in 12, -1/104, 0.2, 0.3, 5? -1/104 Which is the sixth biggest value? (a) -1/7 (b) 1 (c) 3/4 (d) 0.5 (e) -21 (f) 1/12 e Which is the second biggest value? (a) -4/31 (b) -30.2 (c) 4 a Which is the third biggest value? (a) 23 (b) -1/7 (c) 5 (d) -3 (e) -0.2 b Which is the second biggest value? (a) 1 (b) -2/9 (c) -7 (d) 5 (e) 0.17 (f) 1/6 a What is the smallest value in -31/6, 3, -50? -50 What is the fourth biggest value in 0.02, -179, 0.1, 0.4? -179 Which is the third biggest value? (a) -4 (b) 898.1 (c) -0.02 a What is the second biggest value in -3/8, -0.2, -4, -1765, 2/11, -0.1? -0.1 Which is the second smallest value? (a) 0.3 (b) 2/11 (c) -4 (d) -0.5 (e) -3 (f) 9 e Which is the fourth smallest value? (a) 137 (b) 7 (c) 3/4 (d) 2/11 (e) -2/9 b Which is the fifth biggest value? (a) 0.116 (b) -18 (c) 0.4 (d) -0.3 (e) -0.06 b What is the third smallest value in 0.014, -2.6, 2, -2, -5.1? -2 Which is the fifth biggest value? (a) 2 (b) 3 (c) -0.1 (d) -0.5 (e) -0.154 (f) 7 e Which is the third smallest value? (a) -2/3 (b) -45 (c) 241 c What is the second smallest value in -1/26, 2, -2, 5, 1? -1/26 Which is the third smallest value? (a) -15 (b) 6291 (c) -3/4 b Which is the third smallest value? (a) -4 (b) 5 (c) 13/135 (d) -1 c Which is the third smallest value? (a) 7 (b) 6116 (c) 2 b What is the third biggest value in 4.8, 0.054, 24/7? 0.054 What is the fourth biggest value in 4/7, -0.2, -241, 0, -4? -4 Which is the second biggest value? (a) -2 (b) 0.2 (c) -3 (d) 7025 b Which is the fifth smallest value? (a) -2/43 (b) -5 (c) 3 (d) -2/13 (e) -49/5 (f) -1/5 a What is the second biggest value in 865, -0.5, 5/7, -2, -4? 5/7 Which is the smallest value? (a) 2/3 (b) -1.6504 (c) 2 b Which is the third smallest value? (a) 2 (b) -4 (c) 116.9 (d) 24 d Which is the second smallest value? (a) 0.1 (b) 0.5 (c) 0.022 (d) 2880 (e) -0.4 c Which is the third smallest value? (a) 23.5 (b) -1 (c) -2/3 a Which is the sixth biggest value? (a) -5/3 (b) 4 (c) -0.5 (d) 40 (e) -2 (f) -1 e Which is the fifth biggest value? (a) 0 (b) 4 (c) 7.2 (d) -0.3 (e) -2 (f) 1 d What is the fourth biggest value in -0.5, 383656, 0.5, 4? -0.5 Which is the biggest value? (a) 4/25 (b) 29/2 (c) 0.3 (d) -3 b What is the third smallest value in -5, -2/7, 44, -53.6, 0.04? -2/7 Which is the second smallest value? (a) 2/9 (b) 5 (c) -2.5 (d) -1/4 (e) -60 c What is the third biggest value in -0.033, 11.2, -5/2, 0? -0.033 What is the second smallest value in 233, -8, 0.1? 0.1 Which is the third biggest value? (a) -2/7 (b) -0.19 (c) -455.85 c Which is the second smallest value? (a) -3 (b) -35.7 (c) -13 c What is the smallest value in -3, 2/7, 69, 9? -3 Which is the smallest value? (a) -0.46 (b) -14 (c) -0.13 (d) -15 d Which is the third biggest value? (a) -71.88 (b) -2 (c) -16/3 a What is the second smallest value in -11, -7, -2, 2/9, 0.5? -7 Which is the fifth biggest value? (a) -10/3 (b) 2/7 (c) 1.6 (d) 2/11 (e) 3/22 (f) -5 a Which is the sixth biggest value? (a) -24 (b) -5 (c) -0.2 (d) -1 (e) -0.16 (f) -4 a What is the biggest value in -2.44, -12.3, -2/11? -2/11 What is the third smallest value in 2/23, -2/845, -1/3, -4, -3/11? -3/11 What is the third biggest value in -3/8, -12.3, 25? -12.3 What is the third smallest value in 1, -2/37043, 2/11, -2/11? 2/11 Which is the biggest value? (a) 1/28320 (b) 3/2 (c) -1/4 b What is the smallest value in -1/2, 0, -3, -527, -4, 61? -527 Which is the second smallest value? (a) 0 (b) -0.37 (c) 63/8 a Which is the sixth biggest value? (a) 1 (b) -3/2 (c) -14 (d) -3/10 (e) -1 (f) -3 c Which is the smallest value? (a) 2/5 (b) -5/92 (c) -1.79 c Which is the biggest value? (a) 4 (b) 3249 (c) 2/35 b Which is the third smallest value? (a) 2/5 (b) -13 (c) -56 (d) -5 (e) 39 d What is the second biggest value in 0, 219, 5, -0.28? 5 What is the fourth biggest value in 0.09, -2, 0.1, -305? -305 Which is the fourth biggest value? (a) 4/5 (b) -0.4 (c) -0.07 (d) 1.3 (e) 1/10 c Which is the third smallest value? (a) 3/4 (b) 0 (c) 0.2 (d) 9887 a Which is the third biggest value? (a) 0 (b) -0.29 (c) -4.4 (d) -1/11 b What is the second biggest value in 4, -1/24, -2/15, 28? 4 What is the second biggest value in -2, -47, 0, 332? 0 Which is the fourth smallest value? (a) 15 (b) 6 (c) 1111 (d) 0.2 c What is the fourth biggest value in -5, -11, 1/4, -0.062? -11 Which is the third biggest value? (a) 4696 (b) -0.3 (c) 5 b Which is the second smallest value? (a) 5 (b) 11/5 (c) -245.24 b Which is the smallest value? (a) -0.3 (b) 0.2 (c) -215018 (d) -1 c Which is the second biggest value? (a) -5 (b) 0.4 (c) -568 a What is the fourth biggest value in -2, 0, 5, 0.5, -26, -61? -2 What is the second smallest value in 0.4, -3/4, 1/2, -4, 0.162, -1/2? -3/4 Which is the third smallest value? (a) -3 (b) 46/5 (c) -2 (d) -1/55 d Which is the fourth biggest value? (a) -1870 (b) 3 (c) 17 (d) -4 a What is the third smallest value in 1/9, 1/11, -5, 158, 14/3, -1? 1/11 Which is the second biggest value? (a) 1/15 (b) -24 (c) -0.1 (d) -0.3 (e) -2/29 e What is the second biggest value in -3, 1/1359, -0.23, 0? 0 What is the fourth biggest value in -1/26, 1, 3, -85? -85 What is the fourth biggest value in -2, -0.5, 0.3, 1, 148? -0.5 What is the third biggest value in 0.01, 225, 1/5, 4/3, -2? 1/5 Which is the fourth smallest value? (a) -135/4 (b) -1 (c) -3 (d) -2 (e) -4 d Which is the third smallest value? (a) 72 (b) -947 (c) 2/29 a Which is the second smallest value? (a) -71811 (b) -3/7 (c) -3 c Which is the third smallest value? (a) -33 (b) 1 (c) -0.1 (d) -0.03 (e) 8 d Which is the fifth smallest value? (a) 1 (b) -3/14 (c) -0.3 (d) 0.021 (e) 2/11 (f) 0.5 f What is the fifth biggest value in 30, 1/6, -0.2, -1, 0? -1 What is the biggest value in 0, -5, 5, -6/83, -2/19? 5	{ "pile_set_name": "DM Mathematics" }
value? (a) -5 (b) -1/8 (c) 0.3 (d) o c Let m = 4831/19388 - -4/4847. Let w = 223/1173 + -5/69. What is the second smallest value in w, 4, m? m Let y = 27.988 + -27.8. Let j = 1.012 + y. Which is the second smallest value? (a) 0.4 (b) 0.2 (c) j a Let l = 111/209 - 1195/1463. Let w = -16 - -26. Which is the second smallest value? (a) -5 (b) w (c) l (d) 2 c Let j be (-3)/(-2)40/15. Suppose 5i + 23 - 8 = -2k, 3i = -3. Which is the third smallest value? (a) j (b) k (c) 3 (d) 2 c Let r = -42224/302815 + -6/4265. Which is the second smallest value? (a) 0.1 (b) 1/7 (c) r a Let l = -227 + 2045/9. Let b(w) = 2w3 + 4w*2 + 3w + 1. Let x be b(-2). Let n be x/(-3 - -23)-6. What is the second biggest value in 29, l, n? n Suppose -2f + 311 = 5z - 880, -2f + 6 = 0. Let r = 473/2 - z. What is the fourth biggest value in -1.6, r, 0.5, 3? -1.6 Let l be 22 + -2 + 7888/(-406). Which is the second biggest value? (a) -1/53 (b) 0.5 (c) l b Let p be 25/10(-24)/(-15). What is the second biggest value in p, -0.4, -19? -0.4 Let s = -2117.02994 + 0.26994. Let g = -2186 - s. Let y = -69 - g. What is the biggest value in -1, y, 0.4? 0.4 Let s = -5029 + 5031. Which is the third smallest value? (a) 0.164 (b) s (c) -6 b Let s(v) = -v + 7. Let n be s(5). Let a be 48/(-170) - (72/(-918))/((-2)/3). What is the fourth biggest value in a, n, 1/7, 3/5? a Let a be (-184)/320-16 - ((-33)/(-3) - 2). What is the third biggest value in 2, a, -0.3, 25, 4? 2 Let d = 480004 - 480010. Let q = 1.2 + -2. Which is the third smallest value? (a) d (b) q (c) -3/5 c Let z = -0.0746 + 306.0746. Let m = z + -306.3. Which is the second biggest value? (a) m (b) -27 (c) 2 a Let z = 107.7 + -0.2. Let g = z - 108. What is the biggest value in 4, 1, g, 0.23? 4 Let l = -147 - -47. Let t = 62 + l. Which is the second biggest value? (a) -0.5 (b) 1/9 (c) t a Suppose 2v - 464o + 463o + 32 = 0, -4o + 80 = -5v. Which is the fourth biggest value? (a) 4/5 (b) 17 (c) v (d) 1/4 c Let w be 9 + (-2 - (28 - -2)). Let l be (-81 - -80)(3/w)/3. What is the third biggest value in -4, l, 0.1? -4 Let p = -43 - -46.4. Let r = p + 30.6. Let y = -35 + r. What is the second biggest value in 0, -2, y? y Let v = 11800 - 247802/21. What is the fourth biggest value in 5, -3, -1/13, v, 4? v Let q = -250 - -251.01. Let k = -618 + 617.49. Let m = k + q. Which is the fourth smallest value? (a) -0.3 (b) -2/23 (c) m (d) 1 d Let o = -20372 + 20413.954. Let p = 0.046 + o. Let w = p - 41.96. Which is the biggest value? (a) w (b) 5 (c) 2/5 b Let s = -12.3 - -8.3. Let z = 0.446 - -0.064. Let v = z - 0.41. What is the third biggest value in 0, v, s? s Let m = 140 - 137. Let o be (1/1)/m - (-4)/6. Let g be -2 - (-3)/((-3)/(-4)). What is the third biggest value in o, -1, g? -1 Suppose -4d + 231 = 4m + d, -m + d = -51. Let y be (0 + (-4)/10)/(m/(-540)). What is the fourth smallest value in y, -3, 2/17, -5? y Let a = -482.1 + 482. Let f be -1 - 2/(-44)-2. Let w = -14/11 - f. What is the fourth biggest value in w, 0.5, a, -1? -1 Let w = 37571/3 - 12524. What is the third smallest value in 1/4, -7, -1, w, 3? w Let n = -5/817 + 2476/4085. Which is the smallest value? (a) 22 (b) 0 (c) n b Let k = -9164 + 9169. What is the smallest value in 0.1, 6, k, -25, 0.5? -25 Let p = 135 - 139. Suppose 3j - 5o - 18 = 0, -2j + 19 = 2j - 5o. What is the fourth smallest value in -5, p, j, -10/9? j Let v = 86 + -60. Let n = -71 + 92. Suppose -m - 5q = -0m - n, 0 = m - 4q + 24. What is the third smallest value in m, -3, v? v Let o = -3732/178265 - -2/1765. Which is the biggest value? (a) -3/5 (b) -3 (c) o (d) 2/5 d Suppose -25q = -20q - 20. Suppose 7n - 9 = qn. Which is the fourth smallest value? (a) -5 (b) -1 (c) -0.14 (d) n d Let p = 30.90936 - 0.03936. Let z = -31 + p. Let s = -1/764 + 2299/5348. Which is the third smallest value? (a) z (b) -1/3 (c) -3/5 (d) s a Let k = 218249 + -218252. Suppose -r + 85 = -6r. Which is the biggest value? (a) k (b) r (c) 5 (d) 2 c Let t = 20/549 + 1487/4392. Which is the fourth smallest value? (a) 8 (b) -54 (c) t (d) -0.2 (e) -0.4 c Let u = -17434.1 - -17434. Let z = 0.3 + -0.24. Let d = 0.04 + z. What is the biggest value in d, -6, u? d Suppose 2c + 24 = -5z, 2c - 18 = 60z - 58z. Let v = -0.052 + 2.052. What is the second smallest value in -0.03, z, v? -0.03 Let r = -1451/9854 + -5/758. Which is the fifth biggest value? (a) 244 (b) 2/11 (c) 4 (d) r (e) 0.2 d Let h be 5 - (16254/48 + 1) - -1. Let t = h + 334. What is the biggest value in t, -3, 5/13? 5/13 Let y = -36 + 36.064. Let o = 3.936 + y. Let v = 0.13 + 0.07. What is the smallest value in o, 0.3, v? v Let z = -437 + 434. Which is the third biggest value? (a) 0.4 (b) z (c) 2/11 (d) -11 (e) 1 c Let b = 1189.363 - 1190. Let m = 0.237 + b. What is the biggest value in 3/2, m, 46, -3? 46 Let t = -1177.7 - -1178.7. What is the third biggest value in -1063, 1/7, t, -3? -3 Suppose 0 = -232i + 2419 - 563. Let u = 0 + -0.2. What is the third biggest value in 0.2, u, i? u Let d = -2596 - -2595.7. What is the smallest value in 0.5, d, -678? -678 Let n = -38/5 - -656/85. Let t = 101.4 - 101. Which is the third biggest value? (a) 3 (b) 2 (c) t (d) n c Let s = 567 - 1026. Let w = -459.258 - s. What is the biggest value in 4, w, 2, 0.2? 4 Let f be 110/(-30) + 15/(315/14). What is the biggest value in 1.3, -1, -2/19, f, -2? 1.3 Suppose d = -d - 6, 3d - 21 = -5y. Suppose -yv + 5v - 3 = 0. Let g = -0.06 - 0.04. What is the third smallest value in v, -0.3, g? g Let i = 8269.3 + -8269. Which is the second biggest value? (a) 0 (b) 0.4 (c) -1 (d) i (e) 3/5 b Let q be (-24 - -13 - -15)(-2)/60. What is the second biggest value in q, -1047, -0.4, 3? q Let o be 130/(-300) + (-60)/(-72). What is the second biggest value in -0.4, o, -2? -0.4 Let k = -2.01333 + 0.01333. What is the second biggest value in 15, 1/5, k, -5? 1/5 Let h = 1700 + -1703. Let z = -12 + 11.92. Let a = z + -0.12. What is the third biggest value in a, -2, h, 1/4? -2 Let w = 18426 + -18426.24. Let g = 0 - -0.1. Which is the third biggest value? (a) 0 (b) w (c) g b Let t(j) = -75j. Let q be t(0). Let g = 0.034 + -0.134. Which is the fourth smallest value? (a) 2 (b) g (c) -0.3 (d) q a Suppose 2q - 14 + 22 = 0. Let u be 6/(-8)4q/32. Let s = 1 - 1.4. Which is the second biggest value? (a) u (b) -0.2 (c) s (d) -2 b Suppose -3u = 3p - 3, -4p + 6p = 5u - 40. Let i be (-2)/u((-12)/4 - -24). Which is the smallest value? (a) 5 (b) -1/2 (c) 4 (d) i d Let t = -20.5 + 20. Let l(f) = -f + 15. Let u be l(11). Suppose -2z + uz - 8 = 0. Which is the fourth biggest value? (a) -2 (b) 3 (c) t (d) z a Let k = -3.51518 - -5.51518. Let d = -1.3 - -0.3. Let x = d + 1.07. What is the third biggest value in x, k, -1/4? -1/4 Let m = 3196 - 3183. What is the smallest value in -0.14, -0.3, m? -0.3 Let g = -2.44 + 1.14. Let k = g - -0.9. Which is the fourth smallest value? (a) -3/2 (b) -0.2 (c) 0.11 (d) k c Suppose -4g + 20 = 4h, -4h = -15g + 18g - 16. What is the second biggest value in 0.3, 1.5, g, 2/13? 1.5 Let d be (-150)/(-1440) - 20/(-320). Let g be -5 - (1 - 2/2). What is the fourth smallest value in -1/5, 5, g, d? 5 Let h = 8844 + -8636.99. Let o = h - 206. Let j = o - 0.51. What is the second smallest value in 1/6, j, 2/13, 3/4? 1/6 Suppose -5q - 2046 = -2006, -28 = -3s + 2q. What is the second biggest value in -3/19, s, -4, -33? -3/19 Let z = -61 + 28. Let q = -44.81 + 45. Let v = q - -0.11. Which is the biggest value? (a) z (b) v (c) -0.1 b Let m = -105.8 + 100.8. Let k = -36 + 36.29. Let d = k + -0.09. Which is the third biggest value? (a) d (b) -1 (c) m c Let l be 399/(-198) + 2 - (13 + 4060/(-308)). What is the third smallest value in -14/3, -5, l, -0.3, 16? -0.3 Let m = 227.01 + -225.01. Which is the fourth biggest value? (a) 5 (b) -2/5 (c) -1/2 (d) -15/2 (e) m c Let i = -3881 - -3880.6. What is the second biggest value in i, 1/92, -3? i Let g = -71.1 - -71. Suppose -14 - 7 = 7l. Let r be 6/45 + 40/825. Which is the fourth smallest value? (a) r (b) g (c) 0.2 (d) l c Suppose 0 = 676x - 608x - 340. Let s be (-3)/(-9) + (-16)/21. Which is the smallest valu	{ "pile_set_name": "DM Mathematics" }
432 = 0. What is m? -1/2, -12/9261625 Find w such that -2w3/9 - 617920w*2/9 - 617918w/9 = 0. -308959, -1, 0 Find k, given that -4k2 - 212305912k - 2817112516884484 = 0. -26538239 Factor 4q2/9 + 110360q/9 - 6553012/3. 4(q - 177)(q + 27767)/9 Let -o*2/3 - 66649129o/3 = 0. Calculate o. -66649129, 0 Determine h so that h*2/3 - 31793h - 190762/3 = 0. -2, 95381 Let -3b3/2 + 57381b*2 - 344205b/2 - 1032777 = 0. Calculate b. -3, 6, 38251 Solve -2x4/3 - 2044x*3 + 364462x*2/3 + 2588031040x - 3206322291200/3 = 0. -2128, 595 Suppose 2d2 + 18438d + 40258368 = 0. What is d? -5667, -3552 Solve d*2 + 2907868d - 14539365 = 0. -2907873, 5 Let 40c3 + 348025c*2 - 2220195c + 783630 = 0. Calculate c. -8707, 3/8, 6 Factor k*3/2 + 1984047k*2/2 + 492054816264k - 492055808288. (k - 1)(k + 992024)2/2 Factor -4275y*3 - 1067430y*2 - 66180259y + 56490256. -(15y + 1879)2(19y - 16) Factor k5/4 - 1608k*4 - 242091k*3 - 9008020k2. k2(k - 6580)(k + 74)*2/4 Determine c, given that 53c*2/6 + 63137843c/6 + 595640 = 0. -1191280, -3/53 Suppose -r*2/7 + 22178r/7 + 1022304/7 = 0. What is r? -46, 22224 Factor z*3/7 + 19z*2 - 44430z/7 - 147312. (z - 168)(z + 22)(z + 279)/7 Suppose 5m3/3 + 2340695m*2/3 + 7802185m + 16384515 = 0. Calculate m. -468129, -7, -3 Solve -4b4 + 10624b*3 - 284652b*2 + 1894176b - 3407184 = 0 for b. 3, 6, 18, 2629 Factor 2g5/13 + 92g*4/13 - 94g*3/13. 2g*3(g - 1)(g + 47)/13 Let 4f*3 - 220f*2 - 3704f - 11040 = 0. Calculate f. -10, -4, 69 What is d in -13d2/5 - 18169d/5 + 164574/5 = 0? -18286/13, 9 Let -5d2 - 57815d - 49055010 = 0. What is d? -10641, -922 Solve p*4/4 - 3467p*3/2 - 97247p*2/4 - 43422p - 20844 = 0. -12, -1, 6948 Suppose -14s4/13 + 505480s*3/13 - 4964092672s*2/13 + 7079344270304s/13 + 2023075035360/13 = 0. What is s? -2/7, 1710, 17198 Factor 4r5 - 406004r*4 + 6089460r*3 - 30446300r*2 + 50743000r. 4r(r - 101486)(r - 5)3 Suppose -28t*3/3 + 89t*2/2 + 401t/6 + 13 = 0. Calculate t. -1, -13/56, 6 Solve d*3/3 - 9366563d*2/3 + 18733123d/3 - 3122187 = 0. 1, 9366561 Find x such that 10x5 + 1541x*4 - 7836x*3 - 6959x*2 + 31184x + 3180 = 0. -159, -2, -1/10, 2, 5 Solve -3x3 + 12288x*2 - 5669940x = 0 for x. 0, 530, 3566 Solve 5u3 - 58625u*2 - 5425240u - 125023860 = 0. -46, 11817 Find o, given that 4o4 + 95944o*3 + 572825328o*2 - 30052019144o - 30624748532 = 0. -12019, -1, 53 Factor c*4/3 + 3776311c*3/3 - 3776313c*2 + 11328941c/3 - 3776314/3. (c - 1)*3(c + 3776314)/3 Factor s*2/3 + 44935398s + 1514392495063803. (s + 67403097)2/3 Solve y4 - 40759y3 - 122283y*2 - 122285y - 40762 = 0. -1, 40762 Let -5w5 + 1365w*4 + 1199225w*3 + 3589435w*2 + 3586680w + 1195100 = 0. Calculate w. -370, -1, 646 Find j such that -4j3/5 - 170296j*2 + 851483j/5 - 212871/5 = 0. -212871, 1/2 Factor 18p3/7 - 62761280p*2/7 + 54708024515946p/7 + 12157341880644/7. 2(p - 1743369)2(9p + 2)/7 Find i, given that -2i*5 - 629076i*4 - 49465189426i*3 + 296818187424i*2 + 346282747776i = 0. -157272, -1, 0, 7 What is g in -2g2/13 - 55800632g/13 - 389213816449928/13 = 0? -13950158 Find k, given that 2k5 - 1322k*4 + 51542k*3 + 280282k*2 + 460160k + 232744 = 0. -2, -1, 47, 619 Factor 2v4 - 302v*3 + 1764v*2 - 3496v + 2320. 2(v - 145)(v - 2)3 Solve o3/12 + 403329553o2/12 + 40668681879130175o/12 - 40668682282459729/12 = 0. -201664777, 1 Factor -2s4/3 + 1454s*3/3 + 351588s*2 + 193388008s/3 + 11207025200/3. -2(s - 1225)(s + 166)*3/3 Factor 39050p*2 + 857565p - 33770. 5(p + 22)(7810p - 307) Suppose -l5/4 + 152076l*4 - 61669555125l*3/2 + 2083639463355346l*2 + 225122988227528691l/4 = 0. Calculate l. -27, 0, 202777 Suppose -3x5 + 55062x*4 - 165126x*3 - 605592x*2 + 165129x + 550530 = 0. Calculate x. -2, -1, 1, 5, 18351 Suppose -g*3 + 191g*2 + 12510g - 1444032 = 0. What is g? -96, 69, 218 Factor 2q3 + 3854q*2 + 2475030q + 529710858. 2(q + 633)2(q + 661) Solve 5i2 - 508037760i + 12905118279290880 = 0. 50803776 Factor k*3/5 + 81152k*2/5 + 172412368k/5 + 92810623104/5. (k + 1084)*2(k + 78984)/5 Solve -2r4/7 + 10786r*3/7 - 123474r*2 + 20066654r/7 - 14544256 = 0 for r. 7, 37, 5312 Factor 35z2 + 138688315z + 39625230. 5(z + 3962523)(7z + 2) Suppose -3g*3 - 684g*2 + 45120g + 403200 = 0. What is g? -280, -8, 60 Factor 3j2/5 + 206058j/5 - 99807981/5. 3(j - 481)(j + 69167)/5 Let 114h5/7 + 5692h*4/7 + 33800h*3/7 - 1028400h*2/7 + 72000h/7 = 0. What is h? -30, 0, 4/57, 10 Factor x*3/5 + 16271x*2/5 - 81394x/5 - 227864/5. (x - 7)(x + 2)(x + 16276)/5 Suppose -2v5/11 + 37900v*4/11 - 2869616v*3/11 + 14403072v*2/11 + 1739427840v/11 = 0. What is v? -20, 0, 48, 18874 Find y, given that -3y3/2 + 4023y*2/2 - 118077y/2 + 114057/2 = 0. 1, 29, 1311 Determine i so that 18i5 + 80072i*4 + 89066590i*3 + 38848760i*2 - 801600768i - 356124672 = 0. -2224, -3, -4/9, 3 Suppose -4r3 - 2164r*2 + 2837940r + 1674924228 = 0. Calculate r. -699, 857 Suppose -2j2/13 + 1023336j/13 + 48101210/13 = 0. What is j? -47, 511715 Factor 972v4 + 16452v*3 + 272569v*2/3 + 487204v/3. v(v + 4)(54v + 349)2/3 Let 2j*5 + 754j*4 - 207576j*3 + 205304j*2 + 413632j = 0. Calculate j. -562, -1, 0, 2, 184 Determine g so that 4g3/3 + 49594g*2/9 - 206822g/9 + 38612/3 = 0. -4137, 2/3, 7/2 Factor 2i2/11 - 566i/11 - 2876068/11. 2(i - 1349)(i + 1066)/11 Factor 5l3 + 676740l*2 + 22899528105l + 45796349290. 5(l + 2)(l + 67673)*2 What is x in 3x*5 - 77374x*4 + 7118430x*3 + 4960560x*2 - 16781633x + 4780014 = 0? -2, 1/3, 1, 93, 25699 What is x in x*5 - 380x*4 - 137364x*3 - 2827440x*2 = 0? -210, -22, 0, 612 Let -2q*3/7 + 90010q*2/7 - 424068q + 14570928/7 = 0. What is q? 6, 27, 44972 Solve -6078740h4 + 5470826h*3 + 12765390h*2 + 1215832h + 8 = 0. -1, -1/10, -2/303937, 2 Find y, given that -6y2/11 + 28115616y/11 + 112462560/11 = 0. -4, 4685940 Suppose 2u5 + 7838u*4/5 - 105638u*3/5 - 346126u*2/5 - 181652u/5 + 51008/5 = 0. Calculate u. -797, -2, -1, 1/5, 16 Determine b, given that 5b4 + 7190b*3 - 496655b*2 - 503840b = 0. -1504, -1, 0, 67 Factor -5o3 - 2307175o*2 + 32301430o. -5o(o - 14)(o + 461449) Let -4v*3 + 603180v*2 - 497376288v + 102814975728 = 0. What is v? 414, 149967 Let -21w4 + 395625w*3 + 82052847w*2 + 4219540539w - 1212290430 = 0. Calculate w. -103, 2/7, 19045 Factor -2c2 - 24662c + 5726904. -2(c - 228)(c + 12559) Solve r*5 + 49r*4 - 335r*3 - 8405r*2 + 48034r + 56056 = 0 for r. -52, -14, -1, 7, 11 Determine s so that 4s5 + 1636s*4 + 183616s*3 + 3348064s*2 + 18220480s + 15054400 = 0. -194, -10, -1 Let -2h3/11 - 4582h*2/11 - 2234088h/11 + 819072 = 0. What is h? -1584, -711, 4 Determine t so that t*5 - 40t*4 - 1354t*3 - 6560t*2 + 33225t + 189000 = 0. -15, -8, -5, 5, 63 Solve 4j2 + 25573656j + 76720932 = 0. -6393411, -3 Determine a so that a*5 - 67056a*4 + 1122986180a*3 + 38244654682a*2 + 241920199995a + 204798598550 = 0. -26, -7, -1, 33545 Determine r, given that -3r2/5 + 2303649r/5 + 2303652/5 = 0. -1, 767884 Suppose 4r2 + 27708r - 4564672 = 0. What is r? -7088, 161 Solve -2h2 + 13585366h - 13585364 = 0. 1, 6792682 Solve -12w4 - 4959w*3 + 306369w*2 - 518394w - 148824 = 0. -468, -1/4, 2, 53 What is d in 5d2 + 57652605d + 403567990 = 0? -11530514, -7 What is n in -n*2/8 + 13771185n/4 - 189645536304225/8 = 0? 13771185 Factor 2s3 - 81936s*2 + 759472416s + 1670013600768. 2(s - 21396)2(s + 1824) Solve 3p5 + 792p*4 - 58485p*3 + 321846p*2 + 25920p - 1716000 = 0. -325, -2, 4, 55 Factor o*3/2 - 142622o*2 + 2567135o/2 - 2852350. (o - 285235)(o - 5)(o - 4)/2 Factor -2s3/7 + 81692s*2/7 + 14095400s/7 + 606738256/7. -2(s - 41018)(s + 86)*2/7 Solve 2q*3 + 741018q*2 + 68641794000q + 617716125000 = 0. -185250, -9 Let 2r4/9 + 217282r*3/9 + 1964425592r*2/3 - 443235349432r/9 - 449128408928/9 = 0. What is r? -54358, -1, 76 Solve -4x3 - 15952x*2 + 20503340x - 5790904	{ "pile_set_name": "DM Mathematics" }
(a) 0.08 (b) 2 (c) -1/8 (d) 1/5 a What is the second biggest value in -533, -1.2, 2, -0.3? -0.3 Which is the biggest value? (a) 5/4 (b) 80 (c) -2/9 (d) -30 b What is the biggest value in 3/7, -17/6, -3? 3/7 What is the third biggest value in 5, -3/7, -5, 11? -3/7 Which is the third smallest value? (a) -11 (b) -3/4 (c) 1 (d) -3 b Which is the fourth smallest value? (a) -2/21 (b) 14 (c) -0.3 (d) -2/11 b What is the third biggest value in -3, -3/8, -0.1, -5? -3 Which is the third biggest value? (a) -5 (b) 9/4 (c) 19 a What is the second smallest value in -6, -4/9, 8? -4/9 Which is the fourth biggest value? (a) -6 (b) -2 (c) 5 (d) -0.3 (e) -1/65 b What is the third smallest value in -0.167, -5, -2? -0.167 Which is the second biggest value? (a) -1 (b) 7 (c) 3 c Which is the biggest value? (a) 7/6 (b) 4 (c) 5 c What is the smallest value in 0.4, -11/2, 0.3? -11/2 What is the second smallest value in -0.2, 5, 613? 5 What is the third biggest value in 2, 3590, 0? 0 What is the biggest value in 8, -0.16, 0.1? 8 Which is the second biggest value? (a) 5 (b) 1/7 (c) 1/2 (d) 66 a What is the fourth smallest value in 1, 6/7, 5/4, -3/4, 2? 5/4 What is the fourth biggest value in 4, -1.3, -2/11, 0.24? -1.3 What is the second biggest value in 4, -1/6, 1, -0.1? 1 What is the fourth smallest value in 0.2, 5, 2/3, 3? 5 Which is the third smallest value? (a) -0.6 (b) 1115 (c) 5 b Which is the second smallest value? (a) -0.3 (b) -3823/2 (c) -3/8 c What is the second smallest value in -7, -3, 2.6, -5? -5 Which is the biggest value? (a) 3 (b) 11/8 (c) 0.5 a What is the biggest value in -2, -1/4, -3, 52, 5? 52 What is the third biggest value in 0.4, -1/5, -1/16, -0.1, 1/6? -1/16 What is the biggest value in 4, 3, 0.006, 2/7? 4 What is the fourth smallest value in 0, 0.011, 7, -1? 7 What is the fourth biggest value in -1/20, -3/8, 3, 0.3? -3/8 Which is the fourth biggest value? (a) 0.1 (b) -1/5 (c) 14 (d) 396 b What is the biggest value in 1, 2, -14, -2/5? 2 What is the second biggest value in 0, -2/19, -5? -2/19 What is the smallest value in -7, -4/7, -0.1, -0.4? -7 What is the second biggest value in 1/3, -2/7, -8/23, 0.4, 0? 1/3 Which is the biggest value? (a) -1/5 (b) 0 (c) 46 c What is the third biggest value in 2, 2/19, -2, 5? 2/19 What is the third biggest value in 0.4, -4/5, -2/89? -4/5 What is the second smallest value in 0.1, 32, -2? 0.1 Which is the third biggest value? (a) 51 (b) -1/27 (c) 0.5 b Which is the smallest value? (a) 71 (b) 1 (c) 5 b What is the smallest value in 0.1, -2162, 0.5? -2162 What is the third biggest value in 6, 5, -12, -10/9, -5? -10/9 What is the smallest value in -2/5, 6, -34? -34 Which is the second smallest value? (a) -6 (b) 1/14 (c) 0.4 (d) 3/4 b Which is the third smallest value? (a) 2.6 (b) -1 (c) -3/4 (d) -4 (e) 10 c What is the third smallest value in -3/2, -0.4, -2/11, -1.8? -0.4 Which is the second smallest value? (a) 40 (b) 4 (c) 76 a Which is the biggest value? (a) -0.05 (b) 2/9 (c) 1.5 c What is the third biggest value in -1, -227, -2/7? -227 What is the third biggest value in -0.3, -4, 48, 2, 3? 2 Which is the smallest value? (a) 2 (b) -2 (c) -12 (d) -3 (e) 0.3 c Which is the fourth smallest value? (a) 1/5 (b) 0.28 (c) 3 (d) 0 c Which is the third biggest value? (a) -26/9 (b) 0.5 (c) 1/33 (d) 5 (e) 0.3 e Which is the third smallest value? (a) 0.1 (b) 3/13 (c) 0 b Which is the biggest value? (a) -304 (b) 4/7 (c) -5 b Which is the third biggest value? (a) 4/5 (b) -2 (c) 70 (d) 20 a What is the fourth smallest value in -3/8, -3, 83, -2/3? 83 What is the second smallest value in -2/7, 0, 0.141? 0 Which is the third smallest value? (a) -0.06 (b) 2.18 (c) -0.2 b What is the second biggest value in 4, 7, 1, -4? 4 Which is the third biggest value? (a) 0.5 (b) 6/7 (c) -1/3 c What is the second smallest value in 0, -3, 9, -2/3? -2/3 Which is the third smallest value? (a) -0.2 (b) 1 (c) -4 (d) -3 a Which is the third biggest value? (a) 0.1 (b) 2/15 (c) -2/15 (d) -2 (e) 6/11 a What is the fourth biggest value in -1, -0.18, 3, 1? -1 Which is the smallest value? (a) -1/3 (b) -0.1 (c) 3/2 a What is the third smallest value in -0.3, -0.8, -116, 2/7? -0.3 Which is the biggest value? (a) 3/2 (b) 0.3 (c) -60 a What is the second smallest value in -3/2, 2/13, 0.4, -34? -3/2 Which is the smallest value? (a) -0.4 (b) 0.5 (c) 2 (d) -138 d Which is the fourth smallest value? (a) -2/3 (b) -3 (c) 2 (d) 0.16 c Which is the fourth biggest value? (a) 106 (b) -2 (c) -4/5 (d) 1 (e) -0.3 c What is the second smallest value in -0.01, 4/25, -0.5? -0.01 Which is the second smallest value? (a) 3 (b) -0.19 (c) -2/3 (d) -1 c Which is the second biggest value? (a) 0.2 (b) -0.43 (c) 2/11 c Which is the second smallest value? (a) -5 (b) 0.4 (c) -6 (d) 0.08 a What is the second biggest value in -6, 0, 3, 4.7? 3 What is the second biggest value in -1, -0.2, -0.46? -0.46 Which is the third biggest value? (a) -0.4 (b) 115 (c) -0.27 a Which is the third biggest value? (a) 16 (b) -4 (c) 0.01 b What is the fifth biggest value in 4, 0, -3/8, -16/5, 0.4? -16/5 Which is the third smallest value? (a) 3/59 (b) -5 (c) -13 a Which is the fifth smallest value? (a) -0.3 (b) -15/14 (c) 12 (d) 0.4 (e) 2/7 c Which is the third smallest value? (a) -3 (b) 4 (c) -8/7 (d) 0 d What is the third smallest value in 5, 4, -3, 4/7, 0.5? 4/7 What is the smallest value in -149, -0.4, 0.5, 4? -149 Which is the biggest value? (a) -8 (b) 3/7 (c) 0.35 b What is the fourth smallest value in 5, 0, -4/9, 3/23? 5 Which is the third smallest value? (a) 0 (b) 0.3 (c) 2/15 (d) -1 c What is the second smallest value in 6/5, 3, -3, -4, -5? -4 What is the third smallest value in 3, 16, 1, -0.4? 3 What is the fifth smallest value in -0.2, 0.1, 5, -3/29, -0.4? 5 Which is the second biggest value? (a) 1/9 (b) -2 (c) -240 (d) -0.3 d Which is the third biggest value? (a) 1/8 (b) -3 (c) 86 (d) -5 b Which is the fourth biggest value? (a) -2/15 (b) -5/6 (c) -3 (d) -0.57 c What is the third biggest value in 41/4, 2/9, 0? 0 Which is the biggest value? (a) 5/4 (b) 0.09 (c) -31 a Which is the fourth smallest value? (a) -5 (b) -0.06 (c) 26 (d) 2 c Which is the second smallest value? (a) 2 (b) -0.34 (c) 0.03 c What is the biggest value in -2, 17, 3? 17 Which is the third smallest value? (a) 4 (b) -15 (c) 68 c Which is the biggest value? (a) -0.5 (b) 709 (c) -0.3 b Which is the biggest value? (a) 2 (b) -2/17 (c) -0.19 a What is the biggest value in -3/2, -13, 32? 32 What is the second smallest value in -4, -2/15, 4, 1? -2/15 What is the second smallest value in -0.04, 0.14, -4? -0.04 What is the fourth biggest value in 1/6, 2/5, 1, 4/7, -10? 1/6 What is the second biggest value in 8, 21, 5, -3? 8 Which is the smallest value? (a) -2/13 (b) -6 (c) -1 (d) 0.08 b What is the third biggest value in -0.7, 1/33, -2? -2 What is the second smallest value in -1, 1, -1/4, 23, 3? -1/4 What is the biggest value in 94/9, -0.3, -2/5? 94/9 Which is the second biggest value? (a) 1.7 (b) -5/18 (c) 0.5 c What is the smallest value in 13, 3, -1? -1 Which is the second smallest value? (a) -40 (b) 6/11 (c) 5/2 b Which is the fourth smallest value? (a) 5 (b) -0.21 (c) -8 (d) 4 a Which is the third biggest value? (a) -6 (b) 0.1 (c) -0.04 (d) 2/7 c What is the third smallest value in 0, 1/5, -0.53? 1/5 What is the biggest value in -1/3, -1/21, 1, 2/3? 1 Which is the third biggest value? (a) 4 (b) 2/3 (c) 0.09 (d) -0.5 c Which is the biggest value? (a) -5 (b) -0.5 (c) -0.09 (d) 0.07 d Which is the smallest value? (a) -3 (b) -4/7 (c) -1/4 (d) -5 (e) 26 d What is the biggest value in 3, -2/13, -8, -41, 1? 3 Which is the second biggest value? (a) -3 (b) 0.5 (c) 0 (d) -6/23 c What is the third smallest value in -1/5, -39, 0.4, -1? -1/5 Which is the fourth smallest value? (a) 15 (b) -1/5 (c) 1 (d) 3/5 a Which is the second biggest value? (a) 3 (b) -20 (c) 4 (d) 2/9 a Which is the biggest value? (a) -43 (b) -1 (c) 3 c What is the third biggest value in 4/23, 0, -3? -3 Which is the second smallest value? (a)	{ "pile_set_name": "DM Mathematics" }
w4 + 18w*3 + 12w*2 - 72w - 96 = 0? -4, -2, 2 Factor d*2 - 3d - 4. (d - 4)(d + 1) Suppose l2/2 + 130l + 8450 = 0. Calculate l. -130 Suppose -5r5 + 19r*4 + 54r*3 - 130r*2 + 47r + 15 = 0. What is r? -3, -1/5, 1, 5 Factor -2w3 - 12w*2 + 74w - 60. -2(w - 3)(w - 1)(w + 10) Let 4f*2/7 - 80f/7 + 204/7 = 0. What is f? 3, 17 Let -2q2/9 + 1018q/9 - 1016/9 = 0. Calculate q. 1, 508 Solve 4t5 + 16t*4 - 144t*3 + 296t*2 - 244t + 72 = 0 for t. -9, 1, 2 Factor 2z3/3 + 1762z*2/3. 2z*2(z + 881)/3 Determine f, given that -2f4/9 - 4f*3/3 + 2f*2/3 + 32f/9 - 8/3 = 0. -6, -2, 1 Factor 2w2/9 + 8w/9 - 10. 2(w - 5)(w + 9)/9 Find z, given that z*3/3 + 5z*2/3 + z - 3 = 0. -3, 1 Factor 2n*2 + 4268n + 2276978. 2(n + 1067)2 Factor 2j*3 - 2j*2 - 20j - 16. 2(j - 4)(j + 1)(j + 2) Solve -z4/2 - 6z*3 - 10z2 = 0. -10, -2, 0 Factor -s5 - 11s4/5 - 7s3/5 - s2/5. -s*2(s + 1)*2(5s + 1)/5 Suppose -4m*2/7 + 5688m/7 - 11360/7 = 0. What is m? 2, 1420 Find s such that 6s2/5 - 68s/5 + 32 = 0. 10/3, 8 What is x in -4x4 + 4x*3 + 120x*2 + 304x + 224 = 0? -2, 7 Solve 4r2 - 468r + 920 = 0. 2, 115 Let 3j3 + 921j*2 - 924j = 0. What is j? -308, 0, 1 Factor -17l3/4 + 184l*2 - 1925l - 1452. -(l - 22)*2(17l + 12)/4 Let 242u*3 - 9482u*2 - 17840u - 8200 = 0. Calculate u. -10/11, 41 Factor 5f3 + 20f*2 - 85f - 300. 5(f - 4)(f + 3)(f + 5) Determine p so that 5p*4/3 - 5p*3/3 - 35p*2/3 + 5p/3 + 10 = 0. -2, -1, 1, 3 Factor y*5 - 27y*3 + 50y*2 - 24y. y(y - 4)(y - 1)*2(y + 6) Factor -5c4 + 205c*3 - 355c*2 - 1345c - 780. -5(c - 39)(c - 4)(c + 1)2 Factor -r3/3 - r2 + 35r - 325/3. -(r - 5)*2(r + 13)/3 What is p in -p*5/4 - 25p*4/2 + 110p*3 - 340p*2 + 460p - 232 = 0? -58, 2 Let 4j5/5 - 33j*4/5 + 28j*3/5 + 51j*2/5 - 14j/5 = 0. What is j? -1, 0, 1/4, 2, 7 Solve i*4/6 + 73i*3/2 + 144i*2 + 430i/3 = 0. -215, -2, 0 Factor -5a2/4 - 285a - 7735/4. -5(a + 7)(a + 221)/4 Factor -4b3 - 1464b*2. -4b*2(b + 366) Factor -q*3 - 30q*2 + 31q. -q(q - 1)(q + 31) Determine o, given that 384o2/17 - 250o/17 - 4/17 = 0. -1/64, 2/3 Factor -w*5 + 309w*4 - 24330w*3 + 71146w*2 - 70533w + 23409. -(w - 153)*2(w - 1)3 Let z3/5 - 21z2 + 1439z/5 - 267 = 0. What is z? 1, 15, 89 Find t such that -2t4 + 1520t*3 - 384048t*2 + 31999936t + 65548256 = 0. -2, 254 Let h*2/6 + 2498h/3 + 1665/2 = 0. What is h? -4995, -1 Determine j, given that -j*4/3 + 832j*3/3 - 57962j*2 + 345280j/3 - 172225/3 = 0. 1, 415 Factor d*4 - 139d*3 + 677d*2 - 941d + 402. (d - 134)(d - 3)(d - 1)*2 What is x in -7x*2 - 67x/2 + 15/2 = 0? -5, 3/14 Determine j so that -j*5 - 19j*4 - 58j*3 + 298j*2 - 341j + 121 = 0. -11, 1 Suppose -h*3/4 + 211h*2/4 - 415h/4 - 627/4 = 0. Calculate h. -1, 3, 209 Factor 3l3/4 - 9l*2/2 - 39l/4 + 63/2. 3(l - 7)(l - 2)(l + 3)/4 Factor -7p*3/3 - 55p*2/3 - 41p/3 + 7/3. -(p + 1)(p + 7)(7p - 1)/3 Solve 90k*3 + 355k*2 + 250k - 15 = 0 for k. -3, -1, 1/18 What is n in n*3 + 136n*2 = 0? -136, 0 Determine h so that 2h*4 - 120h*3 + 1798h*2 + 120h - 1800 = 0. -1, 1, 30 Find f such that -3f5 + 165f*4 - 774f*3 + 1212f*2 - 600f = 0. 0, 1, 2, 50 Determine c, given that -2c4/21 - 44c*3/3 - 4968c*2/7 - 58320c/7 + 839808/7 = 0. -54, 8 Factor 5w3 + 25w*2 - 65w + 35. 5(w - 1)2(w + 7) Find q, given that 4q2/9 - 112q/9 = 0. 0, 28 Suppose -i*5 - 5i*4/2 - 3i3/2 + i2/2 + i/2 = 0. Calculate i. -1, 0, 1/2 Determine u so that -5u5 - 25u*4 - 10u*3 + 70u*2 + 15u - 45 = 0. -3, -1, 1 Factor -22f3 - 526f*2 - 3120f + 288. -2(f + 12)2(11f - 1) Determine l so that -57l*5 + 450l*4 - 807l*3 - 318l*2 + 1116l + 120 = 0. -1, -2/19, 2, 5 Factor 2t3/7 - 180t*2/7 + 4050t/7. 2t(t - 45)*2/7 Find y, given that -2y*5 + 50y*4 - 178y*3 + 214y*2 - 84y = 0. 0, 1, 2, 21 Factor -2g4/9 - 8g*3/9 + 10g*2/9. -2g*2(g - 1)(g + 5)/9 Suppose 5n*5 + 2290n*4 - 11530n*3 + 20800n*2 - 16195n + 4630 = 0. What is n? -463, 1, 2 Determine n so that -n*2 + 9n + 52 = 0. -4, 13 Solve 3g3 - 126g*2 + 465g - 342 = 0 for g. 1, 3, 38 Factor -2s2/5 + 14s + 1012/5. -2(s - 46)(s + 11)/5 Solve 2l5/5 - 4l*4 + 48l*3/5 = 0 for l. 0, 4, 6 Let 2l*2/9 - 10l/3 - 32/9 = 0. What is l? -1, 16 Let -2y4/5 - 4y*3 - 14y*2 - 20y - 48/5 = 0. Calculate y. -4, -3, -2, -1 Determine t, given that t4/4 - t3/2 - 11t2/4 + 3t = 0. -3, 0, 1, 4 Suppose i*3/6 - 443i*2/3 - 889i/6 + 887/3 = 0. Calculate i. -2, 1, 887 Suppose -2g5 - 136g*4 - 3584g*3 - 45056g*2 - 262144g - 524288 = 0. Calculate g. -16, -4 Find w such that 3w5/4 - 219w*4/8 + 2049w*3/8 - 108w*2 - 243w/2 = 0. -1/2, 0, 1, 18 Factor 3k2 + 4215k - 4218. 3(k - 1)(k + 1406) Find s such that s*2/7 + 387s + 2708/7 = 0. -2708, -1 Factor j*3/3 - 76j*2/3 - j/3 + 76/3. (j - 76)(j - 1)(j + 1)/3 Let g3/2 - 323g*2/2 + 1911g/2 - 2853/2 = 0. What is g? 3, 317 Let 15v4 + 565v*3 + 285v*2 - 3085v + 2220 = 0. What is v? -37, -3, 1, 4/3 Factor p*4/7 - 24p*3/7 + 12p*2/7 + 1664p/7 + 3072/7. (p - 16)*2(p + 2)(p + 6)/7 Find u, given that 6u*5 + 57u*4 - 54u*3 - 237u*2 + 48u + 180 = 0. -10, -3/2, -1, 1, 2 Factor 3c2/2 - 36c + 66. 3(c - 22)(c - 2)/2 Suppose -25p5 - 755p*4 - 5750p*3 - 370p*2 + 5775p + 1125 = 0. Calculate p. -15, -1, -1/5, 1 Factor -90k3 - 39k*2 + 45k - 6. -3(k + 1)(5k - 2)(6k - 1) Factor -2d*2 + 158d + 324. -2(d - 81)(d + 2) Solve -o*2/2 - 3o + 7/2 = 0 for o. -7, 1 Factor 2d2/3 - 596d - 1790/3. 2(d - 895)(d + 1)/3 Factor -2i3 - 176i*2 - 3690i + 8100. -2(i - 2)(i + 45)*2 Factor -2r*4 - 10r*3 + 4r*2 + 48r. -2r(r - 2)(r + 3)(r + 4) Factor 2c2 + 94c - 96. 2(c - 1)(c + 48) Suppose -72a4/5 + 48a*3/5 + 502a*2/5 - 154a + 60 = 0. Calculate a. -3, 5/6, 2 Let 3g3 + 13g*2 - 28g + 12 = 0. Calculate g. -6, 2/3, 1 Factor -2v3/13 + 50v*2/13 - 272v/13 + 360/13. -2(v - 18)(v - 5)(v - 2)/13 Factor -2v*4 - 320v*3. -2v*3(v + 160) Factor -2v2/3 - 10v + 32/3. -2(v - 1)(v + 16)/3 Find m such that m*3/5 - 22m*2/5 + 67m/5 + 18 = 0. -1, 5, 18 What is s in 2s2 + 48s + 46 = 0? -23, -1 Find v, given that 3v5/2 + 9v*4/2 - 315v*3/2 + 975v2/2 = 0. -13, 0, 5 Find m such that -m3/3 + 107m2/3 - 936m - 972 = 0. -1, 54 Factor 5o4 - 60o*3 + 90o*2 + 700o - 735. 5(o - 7)2(o - 1)(o + 3) Let 62b*4 - 306b*3 + 476b*2 - 216b - 16 = 0. Calculate b. -2/31, 1, 2 Find s such that -2s2/7 - 256s/7 - 8192/7 = 0. -64 Suppose 3n4/7 - 66n*3/7 + 96n*2/7 + 480n/7 = 0. What is n? -2, 0, 4, 20 Factor -2p3 - 2422p*2 - 732048p + 734472. -2(p - 1)(p + 606)*2 Suppose 3t*2/2 + 471t/2 = 0. What is t? -157, 0 Factor 4r4 + 12r*3 - 16r. 4r(r - 1)(r + 2)2 Factor 5o*3 + 420o*2 + 820o. 5o(o + 2)(o + 82) Suppose b3/10 - 4b*2/5 - 19b/10 - 1 = 0. Calculate b. -1, 10 Determine g so that -38g3/3 + 34g*2/3 + 80g/3 + 8/3 = 0. -1, -2/19, 2 Factor -l*2/2 - 432l + 865/2. -(l - 1)(l + 865)/2 Suppose -4a*2 - 296a - 5476 = 0. Calculate a. -37 Factor -n*2/8 + 2029n/8 + 1015/4. -(n - 2030)(n + 1)/8 Let -4s*4 - 12s*3 + 8s*2 + 48s + 32 = 0. What is s? -2, -1, 2 Determine d so that 4d4 - 64d*3 + 248d*2 + 448d - 2940 = 0. -3, 5, 7 Factor 2o3/17 + 14o*2/17 - 60o/17. 2o(o - 3)(o + 10)/17 Let -5s*4 + 100s*3 - 90s*2 - 100s + 95 = 0. What is s? -1, 1, 19 Factor 2c3/21 + 22c*2/7 + 20c/7 - 128/21. 2(c - 1)(c + 2)(c + 32)/21 Factor -2n*3/9 - 148n*2 - 74368n/3 - 440896/9. -2(n + 2)(n + 332)*2/9 Factor 3q*3/2 + 11q*2/6 + q/3. q(q + 1)(9q + 2)/6 Factor -5o4 + 45o*3 - 100o*2 + 60o. -5o(o - 6)(o - 2)(o - 1) Let 3w5 + 57w*4 - 630w*3 + 606w*2 + 3315w + 2025 = 0. Calculate w. -27, -1, 5 Let 5v2 + 40v - 2800 = 0. Calculate v. -28, 20 Factor -h*2/6 + 673h/2. -h(h - 2019)/6 Factor 3a*3 + 225a*2. 3a*2(a + 75) Factor d*4 - 12d*3 + 17d*2 + 30d. d(d - 10)(d - 3)(d + 1) Factor n*2/2 - 4	{ "pile_set_name": "DM Mathematics" }
) = 9c3 + 3c*2 - 2c - 5. Calculate -5i(w) + 7s(w). -7w3 - 4w2 + w Let k(y) = y3 - 3y2. Let t(l) = 2l*2. Suppose -46h = -95 + 3. Let a = 6 + -3. Give at(s) + hk(s). 2s3 Let b(z) = -1. Let f be ((-13)/(-52))/(1/(-4)). Let d(h) = -2h*2 - 5h - 6. Calculate fd(a) + 5b(a). 2a2 + 5a + 1 Let d(o) = 509o2 - 12o + 3. Let f(y) = -508y2 + 16y - 4. Determine -4d(k) - 3f(k). -512k2 Let m(j) = 2j3 + j2 - j + 2. Let l(n) = 2n3 + 2n*2 - n + 3. Suppose 3y - 8y = 10. Let z = 673 - 670. Give yl(c) + zm(c). 2c3 - c2 - c Let u(l) = -53l2 - 6l - 30. Let j(a) = 107a2 + 13a + 65. Calculate -6j(z) - 13u(z). 47z2 Let q(y) = -y2 + 7y - 5. Let j be q(2). Let s(m) = -16 + 10 + 9 - 6m2 + 7 + 5m. Let p(i) = -5i2 + 4i + 9. Determine jp(k) - 4s(k). -k*2 + 5 Let c(r) = 31r*2 + 8r + 5. Let w(k) = 16k2 + 5k + 3. Calculate -3c(a) + 5w(a). -13a2 + a Let r = 16079 + -16083. Let j(m) be the first derivative of -m2 - 2m - 1. Let s(x) = 0x + 3x + 5 + x. Calculate rs(p) - 9j(p). 2p - 2 Let u(x) = -3x*3 + 4. Let s be -3(2 - (-10)/(-15)). Suppose -o + v = -5, -v + 15 = 5o - 2o. Let z(q) = o + 5q3 - 2q*3 - 10. Calculate sz(i) - 5u(i). 3i3 Let i(z) = -z3 - 3z2 - 3. Let y(c) = -2c*2 + c - 2. Let j = -31 - -33. Suppose n - 6n - 29 = 3v, -v - 19 = 4n. Calculate ji(a) + vy(a). -2a3 - 3a Let y(c) = 12c3 - 43c*2 - 3c - 11. Let a(l) = 5l3 - 14l*2 - l - 4. Give 11a(r) - 4y(r). 7r*3 + 18r*2 + r Let b(o) = -2o*2 + 8o - 7. Let u(k) = -3k2 + 14k - 12. Let s(d) = 5b(d) - 3u(d). Let x(l) = -l*2 + l. What is s(p) - 2x(p)? p*2 - 4p + 1 Let o = 1484 + -1476. Let t(q) = q*3 + 3q - 4. Let x(h) = 3h3 + 9h - 11. Determine ot(a) - 3x(a). -a*3 - 3a + 1 Let p(s) = -2s + 3. Suppose 0 = -4i - i - 5x - 15, 4i = -2x - 16. Let m(y) = -3y + 3. What is ip(g) + 4m(g)? -2g - 3 Let x(l) = 7l + 3. Let v be (((-12)/10)/(-2))/((-3)/(-1965)). Let k(d) = -4d + d - v + 392. Give -5k(t) - 2x(t). t - 1 Let m(c) = c. Let n(j) = -3j + 2. Let s = 786 - 785. Give sn(q) - m(q). -4q + 2 Let l(f) = 2f - 6. Let k(m) = 2m - 5. Suppose 5b + 20 = 0, -4j - 1 = -b - 29. Determine jk(n) - 5l(n). 2n Let z(l) = -1413l + 4. Let d(v) = -7062v + 22. Determine 2d(s) - 11z(s). 1419s Let h(w) = -6w3 - 3w*2 - w + 3. Suppose -12x + 78 = -25x. Let n(v) = -v3 - v2 + 1. Calculate xn(g) + 2h(g). -6g*3 - 2g Let w(z) = -1. Let j(p) = 2p - 2. Let a(b) = 5b*2 + 75b + 6. Let i be a(-15). Give iw(s) + j(s). 2s - 8 Let p(z) = 3z2 + 3z + 3. Let f = -69 - -73. Let w(t) = 4 - 6 - 3t2 - 2 + 0 - ft. Determine 4p(j) + 3w(j). 3j2 Let d = -714 - -718. Let u(b) = -36b*3 - 21b*2 + 21b - 21. Let x(h) = 7h3 + 4h*2 - 4h + 4. Give du(m) + 21x(m). 3m3 Let r(l) = -l2. Let m(f) be the first derivative of 4/3f*3 - 12 + 0f*2 + 0f. What is m(s) + 2r(s)? 2s*2 Let o(q) = -2q + 1. Let b be o(3). Let w(c) = -c*3 - 5c*2 - 3c - 5. Let u(x) = 269 - 799 + 262 + 269 + 3x2 - 2x*2. Determine bu(j) - w(j). j*3 + 3j Let p(t) be the first derivative of t - 22. Let h = -4 + 3. Let b(n) = -n + 2. Give hb(z) - p(z). z - 3 Let t(m) = 108m*3 - 15m*2 + 15m - 45. Let f(r) = -r3 + r2 - r + 3. Calculate -90f(j) - 6t(j). -558j3 Let y(z) = -7z3 + z2 - 6z + 5. Let v(i) = -6i3 + i2 - 5i + 4. Let b = -608 + 613. What is by(x) - 6v(x)? x3 - x2 + 1 Let j(k) = -11k*3 + 8k + 8. Let b(l) = -7l3 + 5l + 5. Let p be (-1 - -1)/(18/6). Let c be (2 + p)4/1. Calculate cb(m) - 5j(m). -m3 Let h(w) = 23w*3 + 5w*2 + 239. Let n(l) = -56l*3 - 12l*2 - 598. Give 12h(a) + 5n(a). -4a*3 - 122 Let l(t) = 14t*2 + 21t - 33. Let k(q) = 3q2 + 5q - 8. What is 9k(y) - 2l(y)? -y*2 + 3y - 6 Let o(c) be the second derivative of -5c4/12 + c3 - c2/2 + c. Let t(b) = 7 - 17b - 153b2 + 167b*2 - 3 - 1. Calculate -17o(n) - 6t(n). n2 - 1 Let k(r) = -r3 + 1. Let c(x) = 5x*3 + 17x*2 - 4. Calculate c(a) + 4k(a). a*3 + 17a2 Let f(o) = o. Let d(r) = -r3 + 7r2 - 5r + 1. Let z = -150 - -151. What is zd(l) + 5f(l)? -l*3 + 7l2 + 1 Let v(q) = -q3 - 11q2 - 11q. Let a be (-2 - -5) + 2 - 2. Let g(w) = -11w3 - 15w*3 + 37w*a - 10w*3 + 6w + 6w2. Calculate 11g(h) + 6v(h). 5h3 Let i(r) = -r2 + r. Let v(a) = 8a2 - 2a - 8. What is 2i(x) + v(x)? 6x*2 - 8 Let s(x) = x - x + 4 + 68x*3 - 36x*3 - 33x3. Let h(g) = g3 - g + 1. Calculate -2h(t) + s(t). -3t*3 + 2t + 2 Let s(r) = 1 + 0 - r + 7r + 1. Let c(t) = -11t - 3. Let q be (-14)/(-6) + 50/75. What is qc(x) + 5s(x)? -3x + 1 Let n(m) = -m. Let a(g) = -4g. Let z = 59 - 6. Let y = -54 + z. What is ya(t) + 3n(t)? t Suppose 0h = 19h - 38. Let g(d) = 23d + 2. Let q(c) = -92c - 9. Calculate hq(a) + 9g(a). 23a Let o(t) = 11t*3 + 5t*2 - 4t - 7. Let w(j) = -13j3 - 5j*2 + 5j + 8. What is 6o(m) + 5w(m)? m*3 + 5m*2 + m - 2 Let m(u) = -8u*2 + 16 + 25 - 57 + 18 - 3u + u. Let y(b) = -41b2 - 11b + 11. Determine 11m(d) - 2y(d). -6d2 Suppose -2f + 4 = -8. Let x(y) = -2y + 128y*3 + y - 127y*3. Let o(k) = 4k*3 - 7k. Suppose d = 2 - 3. What is do(r) + fx(r)? 2r3 + r Let c be (-3 - (-22)/4)2. Suppose -t = -4t + 15, -ct + 31 = -3z. Let y(h) = 4h*2 - 4h + 5. Let u(s) = 2s2 - 2s + 2. What is zy(x) + 5u(x)? 2x2 - 2x Let a(t) = 5706t2 - 36t. Let c(y) = 1141y2 - 7y. Calculate 7a(d) - 36c(d). -1134d2 Let a(o) = o3 + o2 + 45o - 5. Let n(h) = -h3 - h2 - 44h + 6. Give -6a(v) - 5n(v). -v3 - v2 - 50v Let b(p) = 12p - 24. Let g(n) = n - 5. Determine -b(l) + 3g(l). -9l + 9 Let v(x) = 12x*2 - 3x - 138. Let i(t) = -14t2 + 4t + 139. What is 5i(a) + 6v(a)? 2a2 + 2a - 133 Let y(o) = 9o3 + 17o*2. Let l(b) = 3b*3 + 6b*2. Let k(j) = -3j + 2. Let r be k(-6). Let h be ((12/9)/1)/(r/(-90)). Give hy(a) + 17l(a). -3a3 Let q(z) be the first derivative of z4/4 + z3 + 3z*2/2 - z + 2. Let f = -32 + 27. Let r(i) = -2i*3 - 5i*2 - 5i + 2. What is fq(a) - 3r(a)? a*3 - 1 Let v be (-100)/(-60) + 46/(-6). Let w(n) = n - 1. Let o(b) = -7b + 5. Calculate vw(u) - o(u). u + 1 Let t(c) = 3c*2 + 5c. Let f(j) = -2j - 4j2 + j2 + j*2 - 2j. Suppose -8 = -2n + 2. What is nf(k) + 4t(k)? 2k*2 Let m(n) = 2n*2 - 2. Let c(q) = 2q*2 - 1. Let j be 18/(-4) - 1/(-2). Let l = -10 - 8. Let u(v) = 2v*2 + 38v + 39. Let z be u(l). Give jc(b) + zm(b). -2b2 - 2 Let y(i) = -5i + 20. Let n(q) = 1. Let h(s) = 8s + 196. Let k be h(-22). Give kn(d) - y(d). 5d Let r(j) = -8. Let h(b) = b + 8. Give 5h(l) + 6r(l). 5l - 8 Let u(z) = 11z2 + 2. Let b(k) = -8k + 1. Let s(h) = h*2 - h - 1. Let p be s(2). Let q be b(p). Let o(d) = 5d*2 + 1. Determine qo(r) + 3u(r). -2r*2 - 1 Let t(z) be the second derivative of -5z3/6 + z2 + 11z. Let k be (4 - 4) + (-8)/4. Let f(a) = 6a - 3. Give kf(h) - 3t(h). 3h Let j(v) = 237v*3 - 8v*2 + 4v + 4. Let c(l) = -13747l3 + 466l*2 - 233l - 233. Calculate -4c(b) - 233j(b). -233b3 Suppose 2c + 1 = -l, -3c - 5 = -18l + 23l. Let j(s) = -s + 1. Let v(g) = -15g + 9. Calculate lv(i) + 9j(i). 6i Let x(c) be the first derivative of c - 398. Let z(s) = -9s*2 + 2s - 3. Give 3x(h) + z(h). -9h*2 + 2h Let l(b) = -67b2 - 2b - 2. Let d(c) = -10855c2 - 325c - 325. Determine 4d(r) - 650l(r). 130r2 Let q(p) = 241p*2 + 7p + 3. Let b(l) = -242l2 - 5l - 2. Calculate -4b(w) - 3q(w). 245w2 - w - 1 Let a(r) = -r2 + 2. Let m(p) be the second derivative of p4/12 - p2/2 + 3p + 12. What is a(s) + 2m(s)? s2 Let a(t) = -18t*3 + 6t*2 - 1. Let x(s) = 55s*3 - 17s*2 + 3. Calculate 8a(h) + 3x(h). 21h*3 - 3h*2 + 1 Let z(g) = -21g*2 + 25g - 23. Let d(f) = 7f2 - 10f + 8. What is 8d(h) + 3z(h)? -7h2 - 5h - 5 Let a(w) = -5w3 - 15w*2 - 11w + 8. Let n(t) = -2t3 - 6t*2 - 4t + 3. Determine -3a(q) + 8n(q). -q*3 - 3q*2 + q Let m(c) = -14c - 21. Let o(y) = -16y - 22. What is -7m(j) + 6o(j)? 2j + 15 Let q(l) = 8l - 99. Let w(u) = 6u - 97. Calculate 5q(t) - 6w(t). 4t + 87 Let q(o) = -4o*	{ "pile_set_name": "DM Mathematics" }
Let a = 111 - 51. Suppose -8l + a = -2l. Solve 3m - l = 5m for m. -5 Let h(c) be the second derivative of -c4/3 + c2/2 + 4c. Let r be h(1). Let l be r + 16/4 - -1. Solve 0k = -2k - l for k. -1 Let w(c) = -6c + 10. Let p be w(-9). Suppose 0 = 14x - 10x - p. Let u = 17 - x. Solve -11 = -5l - u for l. 2 Suppose 5u = -3h + 30 - 4, h - 5u = -18. Let t be 2/(-4) - h/(-4). Suppose t = 2f - 1 - 1. Solve 0o - f = -o for o. 1 Suppose -16 = -2r - 5l, -3l - 11 = -17. Solve y - 3y = ry for y. 0 Let l be 286/44 + (-3)/(-6)-3. Solve lg = -6 - 19 for g. -5 Suppose 4n = 5o - 3 + 10, 0 = n + 3o - 6. Let r be n - -8 - 4 - 3. Solve -3v = v - r for v. 1 Let n = 15 + -11. Suppose 71 = -0o + 3o + 2y, -5o + 133 = -ny. Suppose -4 = q - o. Solve -5 + q = 4t for t. 4 Let i be (-435)/(-39) - (-6)/(-39). Suppose 4s - i - 5 = 0. Solve -sw = 8 + 4 for w. -3 Suppose w + 3w = -l - 9, -5l = 2w - 9. Let u be (-2)/(-14) + 246/42. Solve -ld + u = -d for d. 3 Let x = 439 - 439. Solve n + 0n - 1 = x for n. 1 Suppose -2574x + 24 = -2568x. Solve -16i + 14i - x = 0 for i. -2 Suppose 17w = 179 + 8. Solve -wc = -10c + 1 for c. -1 Let k = -8 - -12. Suppose 178 = kw + 14. Suppose 11 - w = -3n. Solve n = -3a + a for a. -5 Let u be (-6)/(-51) + 1944/(-51). Let j = u + 41. Solve -4o - j = -o for o. -1 Suppose -12p = -15p + 2b + 37, -2p + 3 = 3b. Solve -7q = -pq + 2 for q. 1 Suppose -4o = 2 - 6. Suppose -4z - 31 = -5b, 0 = -5b - 3z - z - o. Let s be b/(-6) - (-10)/4. Solve -1 = 3h - sh for h. -1 Let w(s) = 2s*3 + 2s*2 - 11s + 13. Let k be w(2). Solve -4q = -kq + 55 for q. 5 Let j = -59 + 61. Let q be (3/(3 + 0))/(-1). Let c = q + j. Solve -3g - c - 8 = 0 for g. -3 Let n = -31 + 39. Solve -4h - 4 = -nh for h. 1 Suppose -608j - 5192 = -619j. Solve -j = -5f - 447 for f. 5 Let p be 0 - (0 + -24) - 0. Let g(j) = j*2 + 17j - 16. Let f be g(-17). Let n = 24 + f. Solve -4t - p + n = 0 for t. -4 Suppose 2f = -3p - 6, 0 = -f - 2p - 2 - 2. Solve -4z + f = -8 for z. 2 Let d(h) = 4 + 2 + 0h - 2h + h. Let u be d(-3). Let r = -9 + u. Solve -2g = 4 - r for g. -2 Suppose 144 = 134h - 126h. Solve 10 - h = -8i for i. 1 Let k(m) = -m2 - 6m + 27. Suppose 2f + 5o = 7, 0 = -0f + 2f - o + 23. Let z be k(f). Solve 0 = 4n - zn - 4 for n. 1 Let l = -7 + -5. Let m be (-201)/(-21) - l/(-21). Solve -3a - m = 3 for a. -4 Suppose 4 = 5q - 4q. Suppose -qs = -5s + 2. Solve sz = 1 + 1 for z. 1 Let h(r) = -r - 6. Let x be h(-6). Suppose x = -5i - 3w + 22, -3i + 4w + 14 = 5w. Suppose im - 9m = -32. Solve -p + m = -3p for p. -4 Suppose 19w - 18w = 6. Solve wu + 13 + 11 = 0 for u. -4 Suppose -5s + 62 = -4j, 3j + 24 = 4s - 25. Let r = s + 2. Suppose -15x + 19x - r = 0. Solve h - xh = -10 for h. 5 Suppose 58 = -8t + 6t. Let p = 4 + t. Let c be ((-20)/p)/(1/5). Solve -c = z + 1 for z. -5 Suppose 0 = -c - 0c + 4. Suppose 4n = 4q - 16, q + n = -3q + 16. Let h be 6/(-3) + q + -2. Solve 0i - ci + 4 = h for i. 1 Let m be (4/3)/((-1)/9). Let c be ((-4)/(-3))/((-8)/m). Let d be (2 - 3)-4 + (14 - 14). Solve 6 = -ch + dh for h. 3 Let g(p) be the second derivative of p4/12 - p3 - p2 + 22p. Let d be g(9). Solve -7r - d = -2r for r. -5 Suppose 136r + 308 = 143r. Solve -3p - 32 + r = 0 for p. 4 Let m(u) = 76u - 489. Let z be m(7). Solve 5a - z = -38 for a. 1 Suppose 13 + 2 = 3u. Suppose 0q + q - 5 = -5b, 0 = -ub. Suppose -2v = -d, 0 = 3v + 4d + d - 13. Solve qf = 24 + v for f. 5 Let t = 279 - 276. Solve -tj - j = 4 for j. -1 Let u = -165 + 37. Let y = u - -133. Solve -5w - y = -0w for w. -1 Suppose -h - 6 = -k, -3k - 2h + 4h + 19 = 0. Solve -ki + 1 = -34 for i. 5 Let t be 2 - (0 - -3) - -8. Solve -tq + 9q = 4 for q. 2 Let s(y) = 4y. Let g be s(1). Suppose -3n + n - 5c = 15, 4c = -4. Let p be (-5)/n(1 + -1). Solve p = gm - 4 for m. 1 Let o(i) = 16i + 18 + 16 - 12 + i2. Let u be o(-15). Let r = -2 + u. Solve ry = -21 - 4 for y. -5 Let s be (-28)/(-44) - (-12)/33. Let d be 6 + 0 + -2 + -2. Solve -u = s + d for u. -3 Let v be ((-896)/256)/((-14)/88). Solve -v = 7n - 22 for n. 0 Suppose -3f + 17 = j, -2f + 9 + 14 = 3j. Solve -j = -3r - 8 for r. -1 Suppose 4f - 5m = 52, -3f + m + 17 + 11 = 0. Solve -fd + 5d - 12 = 0 for d. -4 Let m(u) = u*3 + 13u*2 - 15u + 16. Let f be m(-14). Let g = -30 + f. Solve g = -2p - p for p. 0 Suppose -10n = -6n - 8. Suppose nl - l + 3r = 14, 4l + 2r = 76. Solve -l = w + 4w for w. -4 Suppose -437c + 431c + 18 = 0. Solve -cu = 13u - 48 for u. 3 Let y(j) be the second derivative of j*3/6 + 5j*2 - 9j. Let z be y(-7). Solve 0 = zq + 2q for q. 0 Suppose 2d + 3d + 4j = -143, 164 = -5d + 3j. Let k = d - -31. Solve k = -0x - 3x for x. 0 Suppose 132 = 6k + 2p, 8k + 2p = 4k + 88. Solve -8f - 18 - k = 0 for f. -5 Let x = 48 + -30. Let p = -18 + x. Solve p = -4w + 3w for w. 0 Let v(m) = 9m*2 + 4m + 4. Let x be v(-2). Suppose 4l - x = -4t, -3t = 4l - 0t - 27. Solve -ly = 1 + 2 for y. -1 Suppose 4v - 30 + 6 = 0. Let b(d) = d3 - 5d*2 - 7d + 7. Let p be b(v). Let s be (-1)/(3/6 - p). Solve s = 5m - 3 for m. 1 Let p(f) = f2 - f + 3. Let l = -1 - -1. Let c be p(l). Let q = -3 + c. Solve -5o + 7 - 2 = q for o. 1 Suppose 3w - 2w - 4 = 0. Let b be (-3 - -4)1-1. Let u be (4 - (2 + -3)) + b. Solve -w = um - 0 for m. -1 Suppose 3r + 61 = 4j + 7, -3r + 21 = j. Suppose 11u + j = 6u. Let g be u/120/(-10). Solve 4l + g + 14 = 0 for l. -5 Suppose 0 = -5w - 4k + 21, w - 8 + 5 = -2k. Suppose -5v + b + 54 = -0v, 0 = 2v - 4b - 18. Let l be 46/v + 2/(-11). Solve -z + l = w for z. -1 Let s = -331 - -337. Solve -4k + sk = -2 for k. -1 Let m be (-1 - 4) + (15 - 5). Solve 2b - 1 = m for b. 3 Let p be ((-1)/(-3))/((-2)/18). Let o be (-1)/(1/(p2)). Solve 0 = om - 2m for m. 0 Let a = -62 + 144. Suppose -6s + a = 28. Solve -13o - 20 = -so for o. -5 Let m be (0 - -1) + -3 + 155 + -4. Solve -m = 4z - 161 for z. 3 Let j = 18 - 18. Suppose -2c - 1 = v, -5c + jc - 2v = 0. Solve co = o for o. 0 Let n be (2 + (3 - 5))(-18)/18. Solve nt = -0t + 3t for t. 0 Let o be 4/5 - (-207)/(-15). Let u = o - -19. Solve -uk + 5k = 0 for k. 0 Let d(k) = -2k2 + 11k - 1. Let g be d(4). Solve -g = -2v - 13 for v. -1 Let b = 99 - 69. Let c be (24/(-18))/((-4)/b). Solve 3k - c + 7 = 0 for k. 1 Let a be (4 - 4)/(-1 + 2). Suppose -j + 2 = -a. Let k be 1 + -4 - (-12)/j. Solve o = ko for o. 0 Let f = -13 - -20. Suppose -3b = -k - f, 5b + 3k = 13 + 22. Solve -1 = -bw + 7 for w. 2 Let q(h) = h2 - 8h + 8. Let v be q(9). Let t(b) = b*3 - 18b*2 + 16b + 16. Let y be t(v). Let g be (4 + -3)(-1 - y). Solve g = -f + 2f for f. 0 Suppose -c + 3j - 19 = 0, -4c + 5j - 158 = -47. Let z = c + 22. Let w = z + 38. Solve -w + 11 = 3x for x. -5 Suppose -30 = -5h - 10, 13 = k + 2h. Suppose -b - 1 = -k. Solve 16 = -bs - 0s for s. -4 Suppose -13m - 2 = -15m. Suppose 7y - 1 = -m. Solve y = 4g + 11 + 5 for g. -4 Let n = -4 + 22. Suppose -nc = -2c. Solve -t + 5 - 10 = c for t. -5 Let d be (138/115)/(2/10). Suppose 1 = -2a + 17. Solve 2s = ds + a for s. -2 Let z(r) = -r - 5. Let m be z(-7). Suppose 4g + 11 = -5t, -2t + g = 3t - 9. Let j be t + (-3 - 6/(-3)). Solve jv - 4 = mv for v. -2 Let u(n) = -n + 35. Let b be u(28). Solve -2k + b = -1 for k. 4 Let d(a) = -4a2 - 14a - 33. Let p(q) = 7q2 + 27q + 65. Let j(x) = 5d(x) + 3p(x). Let f be j(-6). Solve o + 4o = f for o. 0 Let p(k) = -9k + 1. Let n be p(-2). Suppose 5 = -3q - 1, -3q + n = 5g. Let d be (-2)/g(1 + -51). Solve 0m + d = 4m for m. 5 Suppose -4h + 2h = 0. Solve s + 17 - 18 = h for s. 1 Let f = 343 + -337. Solve fn + 7 = -23 for n. -5 Let a = 2 + -2. Let k be 2 + -3 + 1 + a. Suppose l + 3l = 24. Solve -2b = -kb + l for b. -3 Let b = -44 + 80. Let w be ((-12)/b)/((-2)/12). Let i = 7 + w. Solve -2s + 3 = i for s. -3 Suppose 145y - 149y + 56 = 0. Solve 9j - yj = 5 for j. -1 Suppose 0k = 4k + 2m + 4, 5k - 5m = -20. Let b(z) = z*3 + 3z*2 - 1. Let l be b(k). Solve ld = d - 2 for d. -1 Let f(o) = -5o2 - 177o - 61. Let w be f(-35). Solve k + 6 - w = 0 for k. 3 Let j(i) = -i*2 + 15i - 5. Let u be j(18).	{ "pile_set_name": "DM Mathematics" }
Express (-1 - k + 1)(0k - 2k + 3k) + 2 - 2 + 3k2 - 6k*2 + 2k2 + k2 + (-3 + 3 - 6k)(-1 + 1 - k) as ik2 + sk + d and give i. 5 Rearrange (3l2 + 0l*2 + 3l*2)(251l2 - 9 + 237l*2 - 489l*2) to the form gl*4 + ml*3 + i + jl*2 + ol and give j. -54 Rearrange -c*2 + 0c2 - c2 + ((3c + 3c + 3c)(-4 - 1 + 4) + c - 2c + 2c)(-102 + 179 - 162)(c + 0c + 0c) to the form gc2 + o + yc and give g. 678 Rearrange 474y2 + 3y - 466y2 + 312y*3 - 5y to the form g + zy + ry*3 + uy*2 and give u. 8 Express 2o*2 - 22o - o*3 - 7 - 23o - 5o3 + 40o + 4o3 as l + go*3 + qo + so2 and give l. -7 Express (267 - 511 + 280)(3k - k - 4k + (k - 5k + 5k)(0 - 2 + 1) - 1 + 2k + 1) in the form mk + b and give m. -36 Express 3h*2 - 11h + 0h2 - 9025099 + 9025102 in the form dh*2 + x + uh and give d. 3 Rearrange 3f2 + 286f*3 + 13f*4 + 0f*2 + 1 + 287f*3 - 577f3 + f - f2 to the form jf + a + qf*2 + wf*4 + hf*3 and give j. 1 Rearrange -193 - 24r + 193 + (-5 + 6 - 2)(r + 0r + r) + (5 - 3 + 0)(-2r - 1 + 1) to the form br + t and give b. -30 Express (-213 + 325 + 227 + 2 - 26v)(1 + 4 - 3) in the form xv + t and give t. 682 Rearrange 569 + 540 - 4z - 137 to the form nz + t and give t. 972 Rearrange -4871c2 + 41c + 2 + 59c + 36c - 136c to the form y + xc*2 + sc and give y. 2 Rearrange (2n - 2n - 2n)(8836 + 6899 + 9270 + 14534 + 6581 - 1837) to l + mn and give m. -88566 Rearrange -2a*3 - 3379 - 1034847a + 1034847a + a2 to the form c + ga*2 + ba*3 + wa and give g. 1 Rearrange (1553d2 + 273466 - 273466)(-12d2 + 2d*2 + 9d*2) to wd*2 + kd*4 + vd*3 + p + bd and give k. -1553 Express -10k4 - 76 - 5k + 188 - 112 + k*2 - 2k*3 as rk*2 + qk*4 + m + tk*3 + vk and give q. -10 Express 9k - 3909 + 3909 + 6k - 114k2 in the form d + ok*2 + sk and give o. -114 Express (j - 2j - j)(53944 + 55692 - 107303) in the form pj + s and give p. -4666 Rearrange -2i - i*2 - 2i + 6i + (10 - 34 + 5)(-i + 2i + 0i)(-236i - 20623 + 20623) to the form g + oi2 + ki and give o. 4483 Rearrange n*2 - 1 - 818n - 56n2 - 820n - 813n + 2450n to the form bn2 + w + zn and give b. -55 Rearrange (3916 - 3916 + 124r)(5 - 5 - 3r2) + 4 - 4r3 - 4 + (-r2 + r2 + r2)(6r - 4r + 6r) to the form br3 + wr + g + zr2 and give b. -368 Rearrange 4a*2 + 11a + 37 + 31 - 82 - 2a3 - 17a to f + va + qa*2 + la*3 and give l. -2 Rearrange 1 + 110z + 191z - z3 + 5z*2 - 5z*2 + 7z to the form yz + kz*3 + wz*2 + r and give y. 308 Express (-1266 - 910 - 1369)(5r2 - 5r2 - r4) as jr + d + xr*3 + zr*4 + br*2 and give z. 3545 Express 5y4 - y4 + 3y4 + (0y - 6y + 4y)(y2 - y2 - y3) - 1169y*2 + 1169y*2 + 135y*4 as ly + f + cy3 + jy*4 + gy*2 and give j. 144 Express 346d - 346d - 3442d*2 + 14097d*2 in the form ud + cd2 + y and give u. 0 Rearrange -1916v + 479v - 34v*2 + 478v + 476v - 3v*3 - 1 + 482v to cv3 + lv + av2 + r and give a. -34 Express 0r*2 + 40r*2 + 4r - 19r2 - 26r*2 - 415 in the form hr + cr2 + d and give c. -5 Rearrange -138f + 530f + 510f - 134f to bf + l and give b. 768 Express 0u + 4u*2 - 26u*2 - 44 + 48u + u*2 + 45 as a + ou*2 + ru and give a. 1 Express -6x2 + 78x*2 + 45x*2 - 2 - 1 - 9 as zx*2 + o + ux and give z. 117 Rearrange -166k + 12k*3 - 15k*4 + 43k + 42k + 43k + 46k to the form vk*2 + lk*3 + ok + wk4 + q and give l. 12 Express -16 - 12 - 16 - 2s - 11s2 + 4s + 41 as zs2 + a + ts and give z. -11 Rearrange -5q + 5126 + 30q - 8q - 7q - 11q to the form bq + k and give b. -1 Express -333x - 310x + 264x + 1258 + 9x*2 - 436x - 1259 as ox2 + vx + a and give v. -815 Express (w - w - w)(-w + 2 - 2) + (-853 - 2133 - 1200)(-2w2 - 5w*2 + 5w*2) in the form b + cw*2 + yw and give y. 0 Rearrange -2s4 + 55s*3 - 1538 + 2s*2 + 1538 - 958s*3 to the form i + gs*2 + ls + hs4 + ps*3 and give p. -903 Express -4417 + 1142j - 2246j + 1103j + (-5 + 2 + 2)(4j + j - 3j) as b + wj and give b. -4417 Express (-2 + 3 + 0)(-24 + 8 - 40)(-2 + 1 - 2)((-1 + 3 - 1)(4v - v - 5v) + (4v + 3v - 5v)(9 - 12 + 8)) in the form xv + d and give x. 1344 Rearrange 17254z*2 + 5219z*2 + 1196z*2 - 2943z*2 to oz*2 + d + uz and give o. 20726 Rearrange (3 - 3 - 3l)(6359 - 6359 - 306l)(1 - 1 - 1) to wl2 + ol + f and give o. 0 Rearrange -138x + 92x + 288x + 364x + 303x to the form ix + r and give i. 909 Rearrange -185i + 12i*2 - 297 + 371i - 9i2 - 153i - 2i2 to the form k + li + di2 and give l. 33 Rearrange -3 + 1353m*3 + 6m - 45m - 33m*2 + 1393m*3 - 2747m*3 to the form um + vm2 + dm*3 + p and give d. -1 Express -20 + 2b*3 - 3098b*2 + 4b + 6191b2 - 3092b*2 - 30 in the form o + ib*3 + ab + xb2 and give o. -50 Rearrange -151q - 120q - 4019 + 2012 + 2008 to uq + k and give u. -271 Rearrange 79i - 8i - 17i - 26i - 103i2 - 18i to j + oi2 + bi and give j. 0 Express (99g - 184g + 106g)(-8g3 + 3g*3 + 12g3) - g2 - 11 - 58g4 + 60g*4 - 12 in the form og*4 + xg*2 + j + sg + hg3 and give j. -23 Express -h4 + 1 - 677204h*3 - 36 + 677207h*3 - 20h*2 in the form mh*3 + g + oh*2 + bh*4 + ah and give o. -20 Rearrange 209 + 3085i + 208 - 624 + 207 to the form ni + h and give n. 3085 Express (-118 + 118 - 4b4 + 5b*4 + 4406b*2 - 775b*2)(7 + 10 - 2) in the form yb + db*4 + vb*2 + nb*3 + l and give d. 15 Rearrange (-147 + 149 - 39034b + 110904b)(2b2 - 4b*2 + 0b*2) to the form i + xb + kb3 + lb*2 and give l. -4 Rearrange (-4 - 84874f - 75813f + 251052f + 4 - 72916f)(-1 + 0 + 0) to the form v + if and give i. -17449 Rearrange -30y*3 + 0 - 69y*3 - 5 + 0 + 2y to the form s + wy3 + uy*2 + ty and give s. -5 Rearrange (4 + 3 - 5)(53562131k*2 - 9785k*3 - 53562131k*2) to ok*3 + mk*2 + c + yk and give c. 0 Express (-11 - 3 + 3)(24v - 6440 + 2092 + 2132 + 2139) as w + uv and give u. -264 Express n - 6n*4 + 24n + 4n3 - 2n*3 + 3 - 10n + 7n4 + 3n*2 in the form in*2 + ln + rn4 + xn*3 + d and give x. 2 Express 123 + 281 - 3r - 283 in the form yr + n and give y. -3 Express (-31f - 44f - 38f)(-2f + 0f + 0f) + 3 - 3 - 2f2 + 6 - 5f*2 + 0f*2 + 3f*2 in the form yf*2 + qf + x and give x. 6 Rearrange (3 - 1 + 1)(-1 + 5 - 3)(p*2 - 43p*3 - 98p*3 - 10p*3) to the form xp + zp2 + hp*3 + c and give h. -453 Rearrange (81 - 81 - 34f - 5f + f + 5f + (-f + f + 2f)(-1 + 1 - 1))(20f*3 - 14f*3 - 4 + 3) to the form kf*2 + nf*3 + mf*4 + g + hf and give m. -210 Express (-2b - 4 + 4)(-6 + 4 - 6)(257b*3 + 594b*3 + 222b*3) as gb*4 + j + nb*2 + mb + ub3 and give g. 17168 Rearrange (14z - 5 - 2z - 22z)((0z2 + z2 - 2z2)(4z - 3z - 3z) + 6 - 6 - 4z*3) to the form wz*3 + x + iz + tz4 + qz*2 and give q. 0 Rearrange -70o*2 + 128o*2 + 49 - 59o*2 - o + 4 - 3o*3 to the form ro*3 + ko*2 + io + z and give i. -1 Rearrange 6q - 80q*2 + 153q*2 - 2 + 2q*3 - 71q*2 + 12q to gq2 + mq + d + vq3 and give v. 2 Rearrange -5s*2 + 208s - 108s + 1 - 2s*2 - 99s to the form z + ns + gs*2 and give g. -7 Rearrange 90 - 5q - 5q3 - 88119q2 + q3 + 88119q2 to the form t + yq*2 + jq + fq3 and give j. -5 Rearrange 801g + 722g - 967g + 3g2 + 1648g + 2 + 2822g to the form j + sg*2 + wg and give j. 2 Express 47 - 3a - 21 + 6a*2 - 10 - 15 - 87a*2 in the form x + wa + ta2 and give t. -81 Express -240g + 93g + 63 + 131g + 254 as og + t and give t. 317 Express (14227v - 7105v - 7117v - 382)(2v*2 - 4v2 + v2) as wv2 + dv + t + zv3 and give z. -5 Express (-2s + 4s - 17s)(81s - 456s - 47 + 47) in the form ps*2 + c + fs and give p. 5625 Rearrange 3967h - 1082h + 1053h to the form g + bh and give b. 3938 Express -7154o3 + 7156o*3 + 8o*2 + 40o*2 in the form uo*3 + go + lo2 + p and give u. 2 Rearrange -2 + 674m +	{ "pile_set_name": "DM Mathematics" }
17 for i. 5 Let i(z) = 103z + z3 - 207z + 106z + 2 + 3z*2 + 0z*3. Let m be i(-2). Solve -30 = 5h + 5c, m + 2 = -2c for h. -4 Suppose -4a = 5x - 74, -3x = 5a - 10a - 74. Solve -3q - 4w = -w, -q + x = -5w for q. 3 Let r be ((-8)/(-20))/((-3)/45) - -8. Solve i + 7 = ro, -3i + 0i + 4o = 13 for i. 1 Let h(x) = -x*2 + 2x - 4. Let g be h(0). Let f be g/(5 + -1)-2. Solve 3p = 4v + 3, -p + fv + 3v + 12 = 0 for p. -3 Suppose -56w + 207 = -17. Solve -ws - 5b = -27, -s = -12b + 11b for s. 3 Suppose 0 = -j + 5o + 11, -5o + 85 = 5j - 0o. Let v(p) = -3p + 4. Let q be v(5). Let x = q - -19. Solve -2f - 2w - x = 0, f + j = 3f - 4w for f. 0 Let t = -475 + 478. Solve tk + r + 25 = -2k, 5k + 5r + 25 = 0 for k. -5 Let z(q) = -q3 + 9q2 + q + 3. Let v be z(9). Let c(o) = -o2 + 8o - 2. Let u be c(6). Suppose u = n + 5. Solve -nw = -3d - v, d - 2d = w + 4 for d. -4 Suppose -29g = -36g + 84. Solve 2i = 4z - g, -3i + 2 = 2z + 4 for i. -2 Let z = 508 - 490. Solve 4b - 3c + 17 = -z, 5 = 3b + 4c for b. -5 Let h be -1 + 2/4 - (-220)/40. Suppose 5f = 2j - 3j + 30, -f - h = -2j. Solve 5w + 0z - 3z + 40 = 0, -4w - 5z = -j for w. -5 Suppose 2n - 4j - 6 = 0, -5n + j + 30 = 6j. Suppose 0 = 3l - 5z - n - 25, -4z = l + 7. Solve 3x + 4w + 5 = 4x, lx - 4w = 25 for x. 5 Suppose 4h + 4 = -40. Suppose -5n = 54 - 44. Let j = n - h. Solve -3x - 4s = 10, -5s - 17 = -3x + j for x. 2 Suppose 8b - 52 = 36. Solve -4q + 0q + 9 = w, -3w + 4q + b = 0 for w. 5 Suppose 16s + 5s = 8s. Solve i - 1 = 3v, 4v - 2i + 3 - 5 = s for v. -2 Suppose -12 - 13 = -5b. Let w(m) = m + 2. Let l be w(b). Suppose 0 = -lr + 10r. Solve rg = -3g + 12, 0 = -d + 3g - 14 for d. -2 Suppose -17x = -135 + 50. Solve 0 = -xk + 4a - 8 - 0, -k + 4a = 8 for k. 0 Suppose v + 75 = 4v. Suppose -v = -g - 4g. Let m = g + -2. Solve 3w - 2w = 5y + 5, -my = 3w + 3 for w. 0 Let q be (-9)/9 - (-3 + 0 - 0). Let y(t) = t - 1. Let v be y(6). Solve 0p + vp = -c + 4, c - 4 = -qp for p. 0 Let j be (7 - 138/18)-27. Solve i + j = -3a - a, -a = -2i for a. -4 Suppose -3m = 2n, 3n + 14m = 15m. Solve ni = -i - 5, 0 = -3u - 4i - 35 for u. -5 Let o = -41 - -44. Suppose 0 = -5b - 20, 0 = ou - u + 3b + 4. Solve -4 = -3t + uy, -2t + 3y + y = -4 for t. 0 Suppose -76 = -3q - 5c, -5c + 103 = -q + 5q. Let u be 2 - -1 - q/(-3). Solve 2p + 3n - u = n, 0 = -n + 4 for p. 2 Let h be (-4)/(-7)(-546)/(-12). Let p be h/8 + (-17)/4 + 4. Solve 1 = pr + 3k - 2, 2r - 2k = -2 for r. 0 Suppose -2a + 5x - 79 = -5a, -x = -5a + 85. Suppose -w + 8 = -2. Solve 4j + w = -3p, -5j + 4p - 10 = a for j. -4 Let v(d) = -d3 + 4d*2 + 17d - 25. Let w be v(6). Solve -2g - 2k + 3 = w, 4k - 8 = -g for g. -4 Let y be (68/(-340))/((-1)/15). Solve 3g - 15 = yl, -12 = 4l - g + 5g for l. -4 Suppose 0 = -8y + y + 14. Solve 3u + 13q = 8q, -yq - 31 = -5u for u. 5 Suppose 3y + 4w - 56 = 0, 2y + 0w - 9 = 3w. Let z be 1/4 - (-45)/y. Suppose -20 = -8f + zf. Solve -4u + m = 5m - 16, -fu + 5m = 10 for u. 1 Suppose -l + 4u = -15, 0l + u = 2l - 9. Suppose -92 = -5d - 2a, -5d = -2d + 4a - 44. Solve 0 = 2v + lv + d, 2i - 2v - 6 = 0 for i. -1 Let q be 4/(-22) + (-92)/(-22). Suppose -2n - 1 = -11. Suppose -42 = -nu + 48. Solve 2z + qh - u = 0, 5z - 3h + 30 = 2h for z. -1 Suppose -66t - 100 = -86t. Solve to + 2y = 18, 3 = y - 1 for o. 2 Suppose 3p + 3r = 22 - 7, 3r = 5p - 9. Solve -m = p, -6m = z - 9m - 8 for z. -1 Let n = -4 - -8. Suppose -t - 2k = 0, k - 28 = nt + 2k. Let g = t - -9. Solve -g = -2p + v - 5, 0 = p - v for p. -4 Let y = -404 + 414. Solve 0 = 5n - 2m - y, 4m = n + 1 - 3 for n. 2 Let i be 2 - (-5 + 2 + 9)/(-2). Suppose 4g + ih = -0h + 32, -2h = 4g - 44. Solve 2r = r + 5c + 21, 4c + g = -3r for r. 1 Let o(l) = -5l + 34. Let z be o(6). Solve zr = 2u - 4, 2r - 2 = 7r - 4u for r. -2 Suppose 0 = -6v + 2v. Suppose v = 3u + f - 31, 0u + 2f = 2u - 34. Solve -u = 4g - 2s, 2s = -4g - 3s - 12 for g. -3 Let b be (4 + -6)/(-3 + 2). Let k(n) = 46n2 - 47nb - n3 + 4 - 3. Let m be k(-1). Solve 0 = 2g + x - m, -5x + 17 = -3g - 14 for g. -2 Suppose -2u = -7u + 5, b + 2u = 10. Solve -3i - b = -g + 3g, 0 = -3g + 4i + 22 for g. 2 Let z(t) = t*2 - 13t + 44. Let u be z(8). Solve h = -uc - 19, 0 = -3h + 4c - 0 + 7 for h. -3 Let f(p) be the second derivative of p4/12 - 7p*3/6 + 4p*2 - 21p. Let o be f(8). Solve -2w = 4t - 1 + 13, 4t = -o for w. 2 Let k be -1 + (-7 - (-4)/1). Let l be ((-3)/(-2))/(10/k - -3). Solve 4c + 3 = lg, 6g = 2c + 4g + 4 for c. 3 Let k = -16 - 0. Let m = -14 - k. Suppose -2y + 20 = 3y. Solve -3a + ya - 2r = 0, -ma = -r for a. 0 Suppose 10o = -3p + 7o + 15, 5o = -p + 17. Solve pa = 3b + 6 - 2, 2a - 8 = b for a. 5 Let t = -115 - -112. Let q be 0/(1 + (0 - t) + -2). Solve -5v - 2x - 19 = q, 3v + 0v = 4x - 1 for v. -3 Suppose q + 5u = 2u + 14, -u = 4q - 12. Let w be ((-2)/(-4))/(q/4). Suppose -c + 4d = -0d + 6, c + 4d = 10. Solve t + w = 0, -3 = cy + 2t - 1 for y. 0 Suppose 2t + 17 = -3u, -1 = 4t - u - 2. Let h be -1 - -3 - 3 - t. Solve h = -d - r, 5d + 8 = r - 4 for d. -2 Suppose -4j + 4m + 102 = 2m, -3j = -2m - 74. Let b = j + -26. Solve -2v = 2l + 4, -bv + 6v = -2l for v. 2 Let y(w) = -5w3 - 2w*2 + w + 2. Suppose -j - i + 4 = -0i, 3i - 15 = 0. Let z be y(j). Solve -2m - 4t = -6m - z, -3m - 4t - 3 = 0 for m. -1 Let o = -15 + -6. Let l = 21 + o. Suppose l = -14a + 12a. Solve 2s - s = 5k - 12, -4s - 4k = a for s. -2 Let k(f) = -f*3 + 6f*2 - 4f - 3. Let z be k(5). Suppose -42 = -2t + 3i, -zt = t - 4i - 63. Solve a - 4v = -t, a + 5v = 12 + 3 for a. -5 Suppose 4m - 33 = 7j - 2j, -5 = 5m + 3j. Suppose 3s = -4w + 35, 2w + ms = -0w + 20. Solve -i - 2b - 3 = 0, wi - 2b - b + 15 = 0 for i. -3 Let g = 30 + -26. Let y = -12 + 32. Solve gr = 0, -5o - y = -3r + r for o. -4 Suppose -8 = -4i - 28, 5q + 3i + 30 = 0. Let p be 0 - q/(7 - 4). Solve 3k + p + 5 = t, -2k = 2 for t. 3 Suppose -10n + 9 = -7n. Solve -3 = -5i - c, -4i + c + 12 = -nc for i. 1 Suppose 4k - 9k = -45. Let a be (-1)/(-1) - (k + -11). Suppose -10 = -0c - 2c. Solve -ab - 9 = n + 11, -2n - 35 = cb for b. -5 Suppose -h - 4h + 3n = -22, 3n = h - 2. Let m = -1 + h. Solve -4r - 6 = mj - 26, -3r - 1 = -j for r. 1 Let h = -2169 - -2174. Solve -5b = 2y - 2 - 22, -4b + 6 = -hy for b. 4 Suppose -31p + 26 = -36. Solve 9 = 5a - 4a + 2f, -f = -pa + 8 for a. 5 Suppose -100i + 52i = -192. Solve 0j - 3j + 2l - 9 = 0, -4l = ij + 32 for j. -5 Suppose -x + 0x = 3b - 14, -x - 2b + 9 = 0. Let n be -45/(-20) - 14x. Solve 5l + 25 = 0, -5h - 2l - 5 - n = 0 for h. -2 Let s(q) = q2 - q. Let m be 18/48(7 + 1). Let b be s(m). Let g be 4/b + (-6)/9. Solve 5a + f = g, f - 6f = 0 for a. 0 Let o(u) = -u*2 + u + 3. Let s be o(2). Let m be (0 + s)/((-2)/(-4)). Let f be 1 + (-2)/m + 4. Solve 4y - 4 = -fc, c = -c + y - 1 for c. 0 Let z(s) = s3 - 3s*2 - 2s. Let w be z(3). Let u be (-4)/w18/6. Let p be 16/24 - 40/(-12). Solve -v = -pv - o + 17, -uv + o = -3 for v. 4 Suppose -25 = -4m - 5o, -3m + 4o = 22 - 2. Suppose 2a + 3a - 30 = m. Suppose 0 = -2i + a. Solve -s = -iu + 12 + 4, -5u = -25 for s. -1 Suppose -8b - 2b + 30 = 0. Let n(k) = -k*2 + 7k - 5. Suppose -4r - 3 = -19. Let y be n(r). Solve bd - 18 = 3x, -y = -d - 5x - 19 for d. 3 Let a = 3 - 1. Let x = -393 - -395. Solve -xm = -4h + 16, -am - 2m - 20 = -2h for m. -4 Let t be -1 + (-2 - -2) - 0. Let g be 3t - (3 - 11). Solve 9 = 2i + 3y, -gi = 4y + 2 - 21 for i. 3 Suppose 0 = -3s + 13 - 1. Solve -5r = -2u + 31, 5u - 2u - s = -r for u. 3 Let s be (-12)/10300/(-120). Solve a - sg = 8 - 7, -4g = 4 for a. -2 Let t be -5(-6)/(-75) - 364/(-35). Solve -2j + 6p = p - 23, 2p = -t for j. -1 Let p = 122 - 174. Let u = p - -58. Solve -3l + 3 = -5j, uj = 2j - 5l + 5 for j. 0 Let c = -84 - -85. Suppose -5 = -f - c. Solve -m = -3y + 3, -3y - 8 = fm + 4 for m. -3 Let c(l) = l*2 + 6 - 2 - 4l - 4. Let i be c(4). Solve 2 = -2b + 3z, i = -3b + z - 0z - 10 for b. -4 Let	{ "pile_set_name": "DM Mathematics" }
). Suppose -op + p - 6 = 0. What is the tens digit of 0 + (p - 2-9)? 1 Let n(p) = -5p - 6. Let b be (12/(-14))/((-5)/(-35)). What is the units digit of n(b)? 4 Let f(p) = -2p - 3. Let k be f(4). Let a(x) = -x - 4. Let n(r) = 1. Let o(u) = a(u) + 6n(u). What is the units digit of o(k)? 3 Let j(a) be the third derivative of 1/60a*5 - 1/6a*3 + 0a + 0 + 1/24a4 - a2. What is the units digit of j(-2)? 1 Let c = 11 + -6. Suppose 3q = 7 + c. Let i = q - 3. What is the units digit of i? 1 Suppose 2m = -6, -3h - 4m + 51 = m. Suppose -u - h = -2u. What is the tens digit of u? 2 Suppose 2 = 2r - 2. Let j be -5 - 12/r. Let v(a) = -a*2 - 6a + 7. What is the units digit of v(j)? 7 Suppose -5y - 15 = -10y. Let f = y + 6. What is the units digit of f? 9 Suppose 3b - o = -85, b + 2o + 2 + 24 = 0. Let y = b + 63. What is the units digit of y? 5 Let k = 6 + 1. Let y be 6/4 - k/(-14). Suppose 24 = 3n - 3v, 0 = -4n - yv + 7 + 1. What is the units digit of n? 4 Suppose 0 = -4c + c - 18. Let j = -4 - c. Suppose 5w = w + 4n + 32, -5w = -jn - 34. What is the units digit of w? 6 Suppose 5i - 17 = 4i. Let j(p) = p2 + 5p - 4. Let q be j(-3). Let h = q + i. What is the units digit of h? 7 Suppose 312 = v + 2v. Let i = -49 + v. What is the units digit of i? 5 Let x(h) = -h3 + 2h*2 - 3h + 4. Let c(n) = 6n3 - 11n*2 + 15n - 21. Let q(d) = 2c(d) + 11x(d). What is the units digit of q(2)? 4 Suppose 0 = 2x - 5b - 94, 0x + 2b = x - 46. Let g = -20 + x. What is the tens digit of g? 2 Suppose -275 + 80 = -5u + 5t, 180 = 4u + 4t. What is the units digit of u? 2 Let y = -5 - -1. Let f(w) = -w*3 - 9w*2 - 2w - 10. Let l be f(-9). Let m = y + l. What is the units digit of m? 4 Let o = -5 + 51. What is the tens digit of o? 4 Suppose 6k - 51 = 453. What is the tens digit of k? 8 Let v = -3 - 7. Let j = v - -21. What is the tens digit of j? 1 Let b be (-1 + 2)(-3 - 22). Let z = -6 - b. What is the tens digit of z? 1 Suppose 820 = 3t + 4y, -2t - 4y + 232 = -316. What is the tens digit of t? 7 Let n = -7 + 14. Suppose -2m + nm - 35 = 0. What is the units digit of m? 7 Suppose -17 = -4g + 99. Suppose 5w - 4 = 3m + 1, -w - 5m + g = 0. What is the units digit of w? 4 Suppose -2v + 32 = 3r - v, 2r + 3v - 12 = 0. Suppose -3b + 19 + 19 = -4q, -2b - 4q = -r. Suppose k + 4 = b. What is the units digit of k? 6 Suppose d - 2 = 9. What is the units digit of d? 1 What is the hundreds digit of (-11)/(3/(4-27))? 3 Suppose 18 = 2c - 2h - 0h, 38 = 5c + 2h. Let z = 37 - 24. Let n = z - c. What is the units digit of n? 5 Let i be 203/35 + 2/10. Let w = i + -4. What is the units digit of w? 2 Let f = -2 - -6. Let t = f + -10. What is the units digit of 2 + (t + 0)/(-2)? 5 Let f(s) = -s*2 - 7s - 6. Suppose 4r + 28 + 7 = 5g, 5r + 28 = g. What is the units digit of f(r)? 4 Let h(u) = -u2 + 4. Let p be h(0). Let l(f) = pf - 4f + 3f - 3. What is the units digit of l(2)? 3 Let v(c) = c*2 + c - 38. What is the units digit of v(12)? 8 Let m = 7 + -4. What is the units digit of m/(-9) + (-19)/(-3)? 6 Suppose 3p = 2f + 110, 6 = 2p + f - 72. What is the units digit of p? 8 Let s(r) be the second derivative of r5/20 + r4/3 + r*3/6 + 2r. Let c be s(-3). What is the units digit of c/(-21) - 18/(-14)? 1 Suppose 3s = 4t + 56, -2s = -3s + 3t + 22. Let u = -12 + s. What is the units digit of u? 4 Let u(r) be the first derivative of r4/4 - 8r*3/3 + 9r*2/2 - 8r + 1. Let q be (-14)/49 - 102/(-14). What is the units digit of u(q)? 6 Let o(q) = -4q2 + q + 4. Let a be o(3). Let w = -17 - a. What is the units digit of w? 2 Let m(t) = 3t + 2. Let a be m(1). Suppose -au + u = -56. What is the units digit of u? 4 Let g(k) = 46k*2 - k. What is the units digit of g(1)? 5 What is the units digit of (54/24)/((-6)/(-16))? 6 What is the hundreds digit of 2 + 1342(-3 - -4)? 2 Let g(f) be the third derivative of f4/24 + f3/2 - 3f*2. Let m be g(-2). Let k = m - 0. What is the units digit of k? 1 Let s(x) = -2x + 3x + 4x*2 + 3 - 2x + 2x. What is the units digit of s(-3)? 6 Suppose 0n = 4n - 32. Let k(y) = 9y*2 - 6y + 3 - y*3 - 6 - 5. What is the units digit of k(n)? 8 Suppose 0 = -5z + 2u + 26, 3z - 22 = -z + 2u. What is the units digit of 3/z - 39/(-12)? 4 Let c = 178 - 113. What is the units digit of c? 5 What is the units digit of (1 + 2)(-56)/(-24)? 7 Suppose 0 = -4g - 3f, -5g + f = -2f - 27. What is the units digit of g? 3 Suppose 4 = 3v - f, -3v - 1 = -2v + 2f. Let w be -2 + (-5v - 0). Let k = w - -11. What is the units digit of k? 4 Let g(y) = -y + 8. Let p be g(8). Suppose -3h + p - 6 = 0. What is the units digit of 7 + -4 + 1h? 1 Let t(z) = 36z*2 - 1. What is the tens digit of t(1)? 3 Suppose r + 9 = -2r + 4t, 0 = -2r - t - 6. Let m = 31 + r. Let s = 40 - m. What is the tens digit of s? 1 Suppose 0 = -3f - 18 + 96. Suppose 4y + f = -5d + 155, 0 = 2d + 6. Suppose 4r - y + 0 = 0. What is the units digit of r? 9 Let f = -13 + 29. Let y(n) = -n2 + 17n + 3. What is the tens digit of y(f)? 1 Suppose -5r + r = -40. Let j = r + -9. Suppose -3 + j = -v, -3m + 5v + 29 = 0. What is the units digit of m? 3 Suppose -t - 4s = -4t - 8, -19 = -t - 3s. What is the units digit of t? 4 Let v = 49 + -18. Let p = -19 + v. What is the tens digit of p? 1 Let y(v) be the first derivative of -v*2/2 - 2v - 3. Let f be y(-10). Suppose 2t - f = t. What is the units digit of t? 8 Let d be ((-5)/(-10))/(2/(-16)). Let j = -3 - d. What is the units digit of j? 1 Suppose -2y + h + 69 = -4h, -3 = h. What is the units digit of 183/y - (-2)/9? 7 Suppose 2d - d - 3o - 116 = 0, 113 = d - 2o. What is the hundreds digit of d? 1 Suppose 0 = -4h + t - 2t + 11, 4h + 3t - 17 = 0. Suppose -w = hd - 18, -6w = -3w - d - 82. What is the units digit of w? 6 Suppose -2p - 186 = -2b, 5p - 3 + 189 = 2b. What is the tens digit of b? 9 Let k be (-12)/14(-21)/3. Let q be 1 + (k - (2 - 0)). Suppose 10 = 3o - q. What is the units digit of o? 5 Let p = 118 + -63. What is the units digit of p? 5 Let y(k) = -89k. What is the units digit of y(-1)? 9 Suppose 0t + 2w = -5t - 14, -2t - 5 = w. Let s = t - -37. What is the tens digit of s? 3 Let n be (-1)/(-2)2 + 15. Let r = 14 - 9. Suppose rb - 32 = m, n = b - 0m + 3m. What is the units digit of b? 7 Let b = 14 - 9. Suppose -7k + 2k = v - 53, -bk + 63 = -4v. What is the units digit of k? 1 Let v = -10 + 11. Let m(q) = 17q3 - 1. What is the units digit of m(v)? 6 Let z(o) = -18o + 5. What is the units digit of z(-2)? 1 Suppose 4j - 5j = 3t - 15, 0 = -2j - 4t + 32. Suppose -5l = 3x, l = 4x - 5 - j. Let q = x + 6. What is the units digit of q? 1 Let m(b) = 28b3 + 1. Suppose -c - 1 = -y + 1, -5y + c = -6. Let t be m(y). Let h = t + -19. What is the units digit of h? 0 What is the tens digit of (-1 - (-21)/14)/(2/472)? 1 Let t(o) = o - 4. Let p be t(8). Suppose -2i = pi - 30. What is the units digit of i? 5 What is the units digit of (-195)/(-52)(0 + (-240)/(-9))? 0 Let c be 2/((-57)/63 + 1). Let b be (-28)/c3/(-2). Suppose 4p + b = 54. What is the tens digit of p? 1 Let n = 129 + -92. What is the tens digit of n? 3 Let v(s) = -s2 + 10s - 11. Let h(p) = p*3 + 4p2 - p - 4. Let x be h(-3). Let g be v(x). What is the units digit of 19 + -1 + -3 + g? 0 Let h(j) = j3 + 6j2 + 2j - 2. Let u be h(-5). Suppose -4n - n - 5 = 0. Let o = n + u. What is the units digit of o? 2 Suppose 0 = d + 3i + 7 + 4, 2d - i - 13 = 0. Suppose 0 = -5q - 4t + 34, -4q - t + dt = -21. What is the units digit of q? 6 Let w(t) be the second derivative of t4/12 + t3/3 + t2/2 + 5t. What is the units digit of w(-2)? 1 Suppose -3g + 24 = 2z + g, -2z + 2g - 6 = 0. Let q(j) = 4j2 + j + 2. What is the units digit of q(z)? 0 Let f(d) = d2 - 7d + 6. Suppose 4g - 4 = u, -3u = -3g - 0 + 12. Suppose g = -4t + 2t + 14. What is the units digit of f(t)? 6 Let b(d) = d3 - 5d*2 + 4d + 4. Let h be b(4). Let r = -15 + 25. Suppose r = -hl + 5l. What is the tens digit of l? 1 Let k be 1240/28 - 2/7. Suppose 5t + a = k, -t = a + 2a - 20. What is the units digit of t? 8 Suppose -2d - 14 = -2j, -4j - 4d - 4 + 16 = 0.	{ "pile_set_name": "DM Mathematics" }
pose r = -3w + 18 + 3. Solve -2m = -5j + w, 3m + 2j - 4j = -c for m. -1 Suppose -3m - 14 = u - 3, 11 = -m - 4u. Suppose 5o = 5t + 9 + 11, -5t + 2o - 11 = 0. Let g = t - m. Solve 3a + 15 = -4y, 0 = gy + 2y - 4a - 20 for y. 0 Let h = -143 - -145. Solve -2v - z - 1 = 0, 0 = -3v + hz + 2 - 14 for v. -2 Let h be 2/(12/3 + -8 - -5). Solve hf + 3 = 11, 3i + 3 = 3f for i. 3 Suppose 7 = -3h + l + 26, 3h - 34 = -2l. Solve -5s + 19 = 2i, h = -5i + 2s - 17 for i. -3 Let r be (-1)/(2/10-1). Let l be (-2)/(-3) + (-26)/(-6). Solve -lz + 15 = -5g, z - 2g = r + 2 for z. -1 Suppose 2t - 4j = -3j + 5, 0 = 5t + j - 2. Solve 0 = -4f + w - 3, -5w - 11 = 5f - t for f. -1 Let u be (-51)/((-6)/(-8)(-28)/7). Solve 0 = -g + 5g - 16, -5r + u = -2g for r. 5 Let u be (3 + 6/(-4))2. Suppose v = -0v + u. Solve vr = 4s - r + 28, 10 = 2r for s. -2 Suppose -1 = 4g - 13. Suppose 6x = x - 2b, 3x = -gb. Solve 5v - 28 = -i - xi, -4v - 3i = -29 for v. 5 Suppose -4t - t = -10. Solve 0 = 5u - 5j - 30, 0u = -2u - tj for u. 3 Let m be (-6)/3 + (-2 - -29). Suppose 3f - 4v = -2 - 12, -m = 4f + v. Let a be (20/f)/((-4)/6). Solve -ad - 4s = 9, -36 = 5d - d - 4s for d. -5 Let c(o) = -o + 9. Let h be c(7). Suppose -2t = -hk - 6t + 4, 3k - 3t - 15 = 0. Solve 4p = 3p + j + 1, -4j = kp + 36 for p. -4 Let j be 1/4 + (-66)/(-24). Suppose -jh + 3 = 0, -s + 7 = h + h. Suppose p = 4p - 15. Solve 29 = -sf - n, -pf - 3n - 37 = -0f for f. -5 Let m = -4 + 19. Let a = -10 - -16. Let u = -10 - -15. Solve -c + 15 = -4o, -uc = o + m - a for c. -1 Let s be (-2)/(-4) + (-250)/(-20). Solve y + s = 3p, -23 = -p - 4p + 2y for p. 3 Suppose 1 = -3s + 7. Let l(a) = a2 + 5a. Let f be l(-6). Suppose 5o + 3 = fo. Solve st = 2i + 14, -o - 12 = i - 3t for i. -3 Let l = -103 + 107. Solve -4s = o - 8, ls + 0 = 4o - 12 for s. 1 Suppose -3l + 50 = k, -11 - 5 = -2l - 5k. Suppose -h - l = -3h. Solve -4z + x - 19 = -0x, -3z = x + h for z. -4 Let x = -129 + 133. Solve -3u - 10 = -4p, -p + 3u + 6 = xu for p. 4 Let b(v) = -v3 - 7v*2 - 8v - 8. Let h be b(-6). Let n be (24/(-8))/((-3)/h). Solve 5j - 21 = 2p - 0, np + 4j = 0 for p. -3 Let n be (-24)/16 - (1 + 18/(-4)). Let o(v) = 2v2 + 3v + 1. Let y be o(-2). Solve nc - 5 = -yq + 10, -3q - 3c = -18 for q. 3 Let y(a) = -4a + 16. Let l be y(7). Let r(k) = -k - 2. Let q be r(l). Solve 5j - 11 - q = -p, p + j = 5 for p. 1 Suppose -2r = 11 - 21. Solve 8c - 4c + f = -9, -5f = -rc - 5 for c. -2 Suppose -j - 2 = -4f, -5j - 8 = -j + f. Let d be 0 + 0 + (-4)/j. Solve -3 = 2l + dn + 1, -4l + 5n = -10 for l. 0 Suppose -2f + 14 = 4d, -3d = f + 2f - 6. Solve -s + 4 = -3s - 4k, -4s - 21 = -dk for s. -4 Let j = -21 + 42. Let q = j + -7. Suppose -4v + 2 = -q. Solve v = -3d - 8, 5d = 2i - 18 for i. -1 Suppose 4q + 92 = 4s, -4q = 15 + 1. Solve -t - y = 8, 8 = t + 2y + s for t. -5 Let f = -7 - -11. Suppose 4b - 4c + 8 = 0, -b + 4 = 3c - c. Let d = b + 2. Solve 4s - 6s = -fj + 24, -dj = -4s - 18 for s. -2 Let r be (-36)/10(-10)/3. Suppose x = 3n - 2x, 0 = -n - 5x + r. Solve 5b - 3z + 3 - 29 = 0, z - n = -b for b. 4 Let g = 19 - 17. Solve 2t = -2b - g, 0t = 2b - 4t + 26 for b. -5 Let m be -5 - (-138)/18 - 1/(-3). Solve -2n - 4s = 13 + m, 3s + 12 = -2n for n. 0 Let j(n) = 4n3 + 2n - 1. Let m be j(1). Suppose my - 2z = 51, -2z - 3 - 15 = -2y. Solve -5r = 5g - y - 14, 2g - 13 = -5r for r. 1 Suppose 0 = -16q + 7q + 45. Solve m + t = -1 + q, -t = 3m - 8 for m. 2 Let b = 5 - 12. Let o = b + 11. Suppose r = or. Solve -5a + 2c - 8 = r, -2a = -4a + 2c - 8 for a. 0 Let j(q) = -q + 12. Let o be j(14). Let r = 2 - o. Let v(l) = l3 + 5l*2 - l. Let s be v(-5). Solve 0 = 2a - ra + sk + 25, 0 = -3a + 5k + 30 for a. 5 Let s = 18 - 16. Solve -20 = -4n - 4g, -sn + 3g = -9 - 1 for n. 5 Suppose 2 = -4g + 5c, 2c = 4 - 0. Suppose -gy - 4k + 0k = 16, -16 = -y + 4k. Solve -4o - 5l + 4 + 16 = y, l = -3o + 4 for o. 0 Let w = 34 - 33. Solve -23 = 3l + 4f, 0 = -3f - w - 5 for l. -5 Let u = -9 - -15. Let z be u/(-9) - 16/(-6). Suppose -4r - 2 = -10. Solve -d + 3j + rj - 9 = 0, zd - 2j + 10 = 0 for d. -4 Suppose -13 = -i + 6. Solve 0z + 2z = -5g + i, -3z = -5g + 34 for g. 5 Suppose 3f - 15 = 3. Solve 0 = -5k + i - 3i - f, 0 = -2k + 2i + 6 for k. 0 Let q = 1 + 4. Solve 14 = 2p - 4k, qp - 23 = 3k + k for p. 3 Let x be (-4 + 1 - -1) + 1. Let a be 5/(-4)(x + -3). Let f(w) = -w2 + 4w + 4. Let g be f(4). Solve al - g = 2s + 1, -4l - 13 = -5s for l. 3 Let g(z) = -z*2 - 14z - 8. Let u be g(-13). Solve -4c + 21 = -8c - uv, 5v = 2c + 3 for c. -4 Suppose -20 = -5w - 0w. Solve 0 = -2g + 3g + 3n + 2, 0 = 2g + n + w for g. -2 Suppose -19 = 2v - o, 2o + 2 = -4v - 32. Let s = v + 14. Suppose -2t + 14 = -w - w, 0 = 2t - 4w - 24. Solve sj + 2r + 0r + 6 = 0, t = -5j - 4r for j. -2 Let o be (-1 - -4) + (1 - 3). Let q be (-6)/(-6 + 3)o. Solve 0 = 2d + p + qp - 13, 0 = -2d + 4p + 6 for d. 5 Suppose -4u - 8 = 5n - 28, 3n = 2u + 12. Suppose 0 = -0v - nv. Solve 5k + 2j + 14 = -j, -2k - 4j = v for k. -4 Suppose 0 = -2w - 0w + 8. Let f(k) = 2k*2 + 31k + 80. Let v be f(-3). Solve -z = -3l - 2z + v, -wl = 3z - 10 for l. 1 Suppose 29 + 61 = 5o. Solve 0 = -2t - 3d - d + 24, 2d - o = -4t for t. 2 Suppose 7 = k + 2. Solve 2h - 5 = k, 2m = -h + 15 for m. 5 Let b = -15 + 30. Suppose -4g - 92 = -4o, -5g = -0o - o + 111. Let x be (-20)/(-15) + g/(-6). Solve -5u - 2 = -3w - 23, xu = b for w. -2 Let b be (1/(-2))/(4/(-32)). Suppose 2i + 4y = -y - 5, -bi + 3y + 29 = 0. Solve ih = -4s - 3, -2h + 6h + 3s = -2 for h. 1 Suppose 15 = 2n + 3. Suppose nh = 4h + 4. Suppose d + 3 = hd. Solve w - r - 3 = d, -2r = -4w + 22 for w. 5 Suppose -5a - 120 = -0a. Let b be 6/15 + a/(-15). Solve 0 = -5x - 3t + 24, -3x = -bx + 2t - 9 for x. 3 Suppose o = -4j + 6o + 36, 3j = 4o + 26. Let b = 16 - j. Suppose -2h - h = -9. Solve -3x - 5v = -21, 4v = -bx + hv + 7 for x. 2 Suppose 0 = -2y + 3y. Suppose j - 11 + 1 = y. Solve 5a = d - 3d + 10, -5d + j = 5a for a. 2 Let u = -8 + 17. Suppose -2k + 7k = 0, -2k = -2t. Suppose 5q = -3f + u, -3f = -q - t - 9. Solve -fn + 21 = -3i, n + 15 + 3 = -4i for i. -5 Let o = -14 - -20. Suppose -u = u - o. Solve j = -3b - 6, uj - 5j + 18 = -4b for b. -3 Let u be -21(-2)/9 + (-3)/(-9). Solve -3g = ub - 15, b - 25 = -5g - 2b for g. 5 Let k be -11 + 0 + 3. Solve -4o - 2t = -7t - 36, 2o = -kt for o. 4 Let d(t) = t2 - 12t - 18. Let u be d(13). Let f(h) = -h*3 - 6h*2 - 5h + 2. Let x be f(u). Solve 0 = -b - 5w - 21 + 2, -20 = xb + 4w for b. -4 Let w(c) be the first derivative of -c3/3 - 4c*2 + 12c + 2. Let u be w(-9). Solve 0i - 17 = 4d + ui, -5 = d + i for d. -2 Let n be (-2 - (-1 + 1 + -1)) + 1. Solve nd = -3y - 3d, -4d = -12 for y. -3 Let b = 0 - -3. Suppose 4q - 5 = b. Solve -m - 10 = -2f - 3m, 3f - 14 = -qm for f. 4 Suppose 5i - 6 - 4 = 0. Suppose -ig - 3g = -2s + 18, 0 = 4s - 3g - 22. Solve 0 = -sc + 4 + 4, -5h = -c + 12 for h. -2 Let f = 13 - 9. Suppose -4s = -fl + 12 + 12, -5s = 15. Let v(y) = -y. Let g be v(0). Solve 0d - 2w = ld, -4d + w = g for d. 0 Let y = -14 - -67. Let k = y + -21. Let h = k + -14. Solve 3a - 12 = 3q, 4a + 4q - h + 2 = 0 for a. 4 Suppose 44 = -5l + l. Let o = l - -11. Solve 4d - 4z + 9 = 25, o = -5z - 25 for d. -1 Let o = 7 + -2. Solve -om = -4p - 20, -4m - 4 = -5m + 5p for m. 4 Suppose -y = 2y - 15. Solve 0z - 2z = -3v - 12, 0 = -5v - 5z + y for v. -2 Suppose 2d - 2h - 8 = 0, 5h + 13 = d + 1. Let u = 5 - 3. Suppose 0 = r + ua - 3, -5a - 1 - 8 = -3r. Solve dz - 5z + 31 = -4x, rx = -12 for z. 5 Suppose 3t - 10 = -4. Solve -7 = o + 4j, -2j - t - 4 = -2o for o. 1 Let f be (5 - 5)/(3 + -2) + 3. Let c = 21 + -10. Suppose 5h + 5n = 5, -3n - c = -4h - 0n. Solve ht + r - 2 = f, 4t + r - 7 = 0 for t. 1 Suppose 12 = -37z + 40z. Solve -5t - 24 - z = -2y, 2t = 5y - 28 for t. -4 Let f(r) = -2r*2 - 6r. Suppose 2 + 2 = -l. Let v be f(l). Let d = v - -8. Solve 1 = j + 4a - 4, 2j - 3*a - 10	{ "pile_set_name": "DM Mathematics" }
g + 3g + 0g). -4g Expand -l*2 + 2l*2 - 3l*2 + 2l*4 + (4 - 1 - 1)(l*4 + 2l - 2l) + 5l4 - l4 - 5l4 + 2l*4 - 4l*4 + 0l4. l4 - 2l2 Expand (2d*4 - 2d*4 + 2d*4)(-80d - 100d + 150d). -60d*5 Expand 0a*3 - 2a3 + a3 - 2a3 + 0a*3 + 3a3 + (a2 - 2a2 + 2a*2)(-2a - a + a) + 0a3 + a3 - 2a3. -3a*3 Expand (16 + 0t - 6 + 2t)(4 + 2 - 3). 6t + 30 Expand -6 + 4t*5 + 6 + (-3t5 + t5 + 0t5)(7 - 2 - 2). -2t5 Expand 3 - 3 + q3 + (q2 + 1 - 1)(4q - q - 2q) + (-q*2 + 3q*2 + 0q*2)(-2q + 5q - q). 6q3 Expand 3f4 - f4 - f*4 + (3f*2 - 4f*2 - 9f*2)(2 + 2f2 - 2). -19f*4 Expand (418 + 57d - 418)(0 + 1 + 1). 114d Expand (0x4 - 2x*4 + 0x*4)(2x + 2x - 5x + (-1 + 8 - 3)(x + x + x)). -22x5 Expand 116k - 142k - 88k - k - 4k + 4k + (-k + 3k - 3k)(1 - 1 + 2) + 4k - 5k + 2k - 2k + 4k - k. -115k Expand -2n*3 + 0n*3 + 3n*3 + (0 - 2n*3 + 0)(-5 + 1 + 3) + n3 - n3 + 2n3 + (-6n + 2n + 0n)(-2n*2 + 0n*2 + 4n*2). -3n*3 Expand (2a*2 + 2a2 - a2)(-2a*2 + 5a2 - a2) + (3a2 - 4a*2 + 0a*2)(3a - 3a*2 - 3a). 9a4 Expand 1 + 5 - 5 + 8x*2 - 2x*2 + 6x*2 - 3x*2 + (-x + x + x)(x + 2x - x). 11x*2 + 1 Expand -4m + 2m + 0m - 2m - 3m + 3m + m + 0m - 3m + (-m + 2m - 2m)(2 - 2 - 1) - 5m + 0m - 2m. -12m Expand k*4 + 2k*2 - 2k*2 + (3k*2 + 3k*2 - 5k*2)(-2k2 + 5k2 - k2) + (-k + 5k - 2k)(0k + 2k3 + 0k). 7k4 Expand (-4n*2 + 5n*2 + 0n*2)(-6 + 1 + 3) - 706 + 706 - 55n2. -57n*2 Expand (-20l - 95l2 - 9l + 30l)(-l + 2l - 2l). 95l3 - l2 Expand (7975 - 7975 + 222r)(r - r2 - r). -222r*3 Expand (29n*2 + 9 + 31n*2 - 57n*2)(-4n2 + 6n*2 - 3n*2). -3n*4 - 9n*2 Expand 0s*2 + 4s*2 - 2s*2 + (-s + 2 - 2)(5s - 2s - s) + 3s2 + 2s - 2s. 3s*2 Expand (0 + 1 + 0)(-31 - 19l3 + 31) + (-2l*2 - 2l*2 + 3l*2)(0l + l + 0l)(3 - 4 + 2). -20l*3 Expand (-f - 4 + 4)(3f - f + 0f) + (f + 2 - 2)(-2 + 2 + f). -f2 Expand (-8u - 6u - 5u)(3u - 4u + 1 + 1 + 2u - 2u - 2u + 4u - 5u + 3u + (0 + 2u + 0)(0 + 0 + 1)). -19u*2 - 38u Expand (2 + 3 - 1)(3o + o - 5o + 6o - 3o - 5o + (-o + 0o - 2o)(1 - 1 + 2)). -36o Expand (0 + 1 - 5)(6 - 1 - 3)(0 - 1 - 1)(f + 0f + 0f). 16f Expand (-1 + 4 - 5 + 2l2)(5l2 - 4l*2 - 3l*2). -4l*4 + 4l*2 Expand 4u - 2u - u + 3 - 2u - 3 + (4u - 3u - 2u)(1 + 0 - 3) + 0u + 0u - u - u + 0 + 0. -u Expand (0l - l - l + (-2l + l + 2l)(-5 + 3 - 3))(0 + 0 + l2). -7l*3 Expand (227 - 3s - 227)(-2s*4 + 4s*4 + 4s*4) + 3s*2 + 2s*5 - 3s*2. -16s*5 Expand (x - 5 + 5)(1 - 2 - 1)(2 + 2x - 2). -4x2 Expand (-5c3 + c3 + 0c3)(0c2 + c2 - 2c*2) - 10c*3 + 10c*3 - 2c*5. 2c*5 Expand (12s - 2s - 3s)(s + 0s + 0s). 7s*2 Expand 0h + 2h - h + (h - 3 + 3)(-1 + 2 + 0) + 2h + 4 + 1 - 6. 4h - 1 Expand (3u2 + 4u*2 - 5u*2)((0 + u + 0)(6 - 3 + 1) + 4u + 1 - 1)(3u - 5u + 3u). 16u4 Expand (16 + 7 + 46 + n)(1 + 2n - 1). 2n*2 + 138n Expand -16x + 16x + 5x5 + (x4 + 0x*2 + 0x*2)(4x + 3x - 6x) - 2x*3 - 4x*5 + 2x*3 + 7x*3 - 7x*3 + 4x*5. 6x*5 Expand (0 + 0 + z)(z*2 + 4z*2 - 6z*2) - 32z3 + z3 + 4z3. -28z*3 Expand -5z*2 - 2z*5 + 3z*3 + 5z*2 + (-4 + 2 + 1)(2z5 + z5 - z5) - 4z*4 + 4z4 - z5. -5z5 + 3z*3 Expand (-2z + 4z2 + 2z)(0 + 2z + 0)(4z + 0z - 2z). 16z4 Expand (1 + 0t + 5t + t)(-2t2 + 1 - 1). -12t*3 - 2t2 Expand (z4 + 0z4 - 2z*4)(1 - 20 + 2). 17z4 Expand (4m*3 + 5m*3 - 6m*3)(4m - m - 2m)(0 + 5 - 4). 3m*4 Expand (2 - 2 - 2w)(0 - 1 - 2)(0 - 3 - 13). -96w Expand 13q*3 + 10q*4 - 13q*3 + (0 + 2q*2 + 0)(-1 + 1 - q*2) + 2q*4 - 3q*4 + 2q*4. 9q*4 Expand (2 + 1 - 2)(4j + 0j - 6j)(-4 + 2 - 3j + 0j). 6j2 + 4j Expand (-z + 6z - z)(5 - 5 + z*2). 4z*3 Expand (-r + 4 - 4)(29r2 - 25r*2 + 2 - 1 - 3r*2 + 3r2 - r2 + (0r + r - 3r)(-2r + 4r - r) + 0r + 2r2 + 0r). -3r3 - r Expand 0t + 2t4 + 0t + (2t2 + t3 - 2t*2)(2t + 3 - 3) + 5 - t4 - 5 - 2t4 + t4 - t*4 + (2t*2 - 1 + 1)(-t*2 + 0t*2 + 0t2). -t4 Expand ((-129 + 129 - m)(-3 + 2 - 1) - 3m + 6m - 2m + (-3 + 3 + 1)(-4m - 3m + 5m))(1 + 1 - 1). m Expand (0 - 4 + 3)(-1 - 4 + 6)(1 + 4 - 6)(-h5 + h - h). -h5 Expand (11y + 26 - 50 + 25)(2y - 2y + y). 11y2 + y Expand (-g - 1 + 1)(-1 - g*2 + 1 + (-1 + 2 - 3)(-g2 + g2 - 2g2) - g2 + 0g*2 + 3g*2). -5g3 Expand (4 - 4 + f2 + (-f*2 - 3f*2 + 3f*2)(3 - 3 - 2))(-2f - 5f + 0f). -21f3 Expand (5c - 3c + 0c)(2c - 2c - c) - 7c*2 + 4c2 + c2. -4c2 Expand (-2r + 5 - 5)(-2r*4 - 4 + 4) + (-3r*2 - 4r + 4r)(-2r3 - 49r + 49r). 10r*5 Expand 0n - 8n + 3n + n - 6n + 2n + (-1 + 5 - 2)(-2n - 2n + 2n). -12n Expand (1 - 4 + 2)(67q2 - 32q*2 - 16q*2 + (-3q + 3q - q)(7q - 4q - q) + 3q2 - 6q*2 + 2q*2 - 3q*2 - 3q*2 + 4q*2 + 3 - 2q*2 - 3). -12q2 Expand (-c2 + c2 + c2)(43c - 40c - 3 + 0)(c + 4 - 4). 3c4 - 3c*3 Expand (-2b - b - b)(-b2 + 4b*2 - 2b*2) + (-23b + 23b - 16b*2)(4b + 0b - 2b). -36b*3 Expand (2h*5 - 2h + 2h)(-3 - 1 + 2) - 4h5 + 2h*5 + 3h*5 + 0h2 - h5 + 0h2 - 6h*5 + 0h*5 + 4h*5 - 5h*5 - 5h*5 + 4h*5. -12h*5 Expand (0 + 0 - 5v + (1 - 2v - 1)(3 - 1 - 1))(-v - v4 + v). 7v*5 Expand (-1 - 3 + 2)(-2s + 2s*3 + 2s) + 2s2 - 2s2 - s3 + (2s + 0 + 0)(s*2 + 0 + 0) - 22 + 22 + 2s3. -s3 Expand (2w - 2w - 4w)(-49w + 5w*2 + 49w). -20w3 Expand (0 + 10u*2 + 0 + (0 + u + 0)(u + u - u))(7 - 4u - 7). -44u3 Expand (-2u*2 - 3u + 3u)(3 - 1 - 18). 32u2 Expand (5z + 5 - 10 + 3)(2 - 2 - 6z). -30z2 + 12z Expand (-3 + 4 - 2)(-2z + 0z - z)(0z - 2z + z)(-2z + 5z - 5z). 6z3 Expand -5a + 5a - a3 + (2a*3 - 2a3 - a3)(-1 + 5 - 6) + 4 + 12a*3 - 4. 13a*3 Expand (0 + 2 - 5)(3 + 3 - 4)(0v*2 + 2v*2 + 0v*2). -12v*2 Expand (-7 - 351f - 19f + 7)(0 + 2 - 3). 370f Expand (1 - 1 + b)((-8 + 2 - 5)(-1 + 4 - 1) - 1 + 2 + 1). -20b Expand (41 - 41 + 6o)((-3 + 3 + o)(2o + 1 - o - 3) - 2o2 - 2o*2 + 6o*2). 18o*3 - 12o*2 Expand ((-2l + 0 + 0)(-2l + 3 - 3) - 14l2 - 2 + 2)(0 + 1 + 0). -10l2 Expand (-6q - 12 + 12)(-1 - 3 + 2)(1 + 2q - 5 + 3). 24q*2 - 12q Expand (1 + 3 - 5)(2q + 3q - 3q) + (-3 + 2 - 2)(q - 3q + 0q) + 11q - 4q - 17q. -6q Expand (-2 - 4l + 1 + 3l)(3 - 2 + 0) - 3l - 2l + 3l. -3l - 1 Expand (0v2 + v2 + v2)(30v - 30v - 6v2) + 1 - 1 + 4v*4 + 1 - 1 + 2v*4 + (2v2 + v3 - 2v2)(-2v + v + 2v). -5v4 Expand (8 + 17 + 7)(-y*2 - 3 + 3). -32y*2 Expand (0q + 3q - 4q)(0q + 0q + 2q*3) - q - 3q4 + q4 - q. -4q4 - 2q Expand -1 + 1 + u + (1 + 0 - 3)(0u + 3u - 2u) - 3u + 2u + 2 - 3u. -5u + 2 Expand (2b2 - 9 + 9)(-3b2 + 0b*2 + 0b*2). -6b*4 Expand (-3j + 2j - j)(11 + 6 - 7)(-4j*2 + 4j*2 - 2j*3). 40j*4 Expand 3q*3 + 2q*3 - 3q*3 + (2q*2 + 2q - 2q)(q - 4 + 4) + (2q3 + 0q*2 + 0q*2)(-4 + 5 + 1) - 7q3 + 9q*3 + 3q*3. 13q*3 Expand (3 - 1 - 1)(0i - i + 2i)(i2 - 2i*2 + 0i2). -i3 Expand (2 - 6 + 3)(u2 + 3u*2 - 2u*2) - 2 + 0u2 - u + u2 - 3u2. -4u*2 - u - 2 Expand -j + 4 - 4 - j + 4j - j + (0j + 3j - 5j)(-1 + 0 - 1). 5j Expand -755s + s*2 + 755s + 27s4 + s4 + 0s + 0s + (s2 + s2 - 3s*2)(0 - s*2 + 0). 29s4 + s2 Expand (-2s2 - 5 + 5)(-2s - 3s + 4s) + 5s*3 - 2s*3 - 4s*3 + 3s3 - s3 - s*3 - 4s*3 + 3s*3 - 11s*3. -10s*3 Expand (-2d - 23d - 20d)(0 - 2 + 4). -90d Expand (0c + c + c)(-6 + 14 + 13)(1 + 0 - 3). -84c Expand (-u - u + 4u)(-24 + 12 + 10 - u). -2u2 - 4u Expand ((3 + 0 - 2)(6y - y - y) + 3y + 4y - 4y)(1 + 1 + 0). 14y Expand (f + 0f - 3f)(-4f - f + 6f) + 0f + 0f - 2f2 - f2 - 2 + 2 + (2 + 0 - 3)(-4f2 + 3f*2 + 2f2) + f2 - 2f2 + 3f*	{ "pile_set_name": "DM Mathematics" }
6, 2023, 3048, 4081, 5122? 4d2 + 1005d - 3 What is the m'th term of 1, -2602, -5205, -7808? -2603m + 2604 What is the l'th term of -453, -3672, -12417, -29454, -57549, -99468? -461l*3 + 3l*2 - l + 6 What is the d'th term of -76, -155, -272, -415, -572, -731, -880, -1007? 2d*3 - 31d2 - 47 What is the v'th term of -316, -639, -974, -1327, -1704? -v3 - 316v + 1 What is the i'th term of 620, 4915, 16576, 39287, 76732? 614i3 - i2 + 7 What is the f'th term of -46, -441, -1528, -3655, -7170, -12421, -19756, -29523? -58f3 + 2f*2 + 5f + 5 What is the u'th term of 1149, 4608, 10371, 18438, 28809? 1152u2 + 3u - 6 What is the m'th term of 5899, 5924, 5971, 6046, 6155? m*3 + 5m*2 + 3m + 5890 What is the w'th term of 8904, 8902, 8900, 8898, 8896? -2w + 8906 What is the v'th term of 143, 1312, 3261, 5990, 9499, 13788, 18857? 390v*2 - v - 246 What is the n'th term of 117248, 117250, 117252? 2n + 117246 What is the g'th term of 2395, 4781, 7167, 9553, 11939, 14325? 2386g + 9 What is the o'th term of -13148, -26269, -39356, -52409, -65428, -78413? 17o*2 - 13172o + 7 What is the f'th term of 3493, 6908, 10349, 13828, 17357, 20948? 2f3 + f2 + 3398f + 92 What is the x'th term of -94182, -94184, -94186? -2x - 94180 What is the t'th term of 240, 499, 770, 1059, 1372? t3 + 252t - 13 What is the n'th term of -14479, -28885, -43291? -14406n - 73 What is the z'th term of -273439, -273440, -273441? -z - 273438 What is the a'th term of -569479, -569480, -569481, -569482, -569483? -a - 569478 What is the a'th term of 6377450, 6377452, 6377454, 6377456, 6377458, 6377460? 2a + 6377448 What is the l'th term of 3993, 7960, 11925, 15888, 19849, 23808? -l*2 + 3970l + 24 What is the b'th term of -655, -1226, -1769, -2272, -2723? 2b3 + 2b*2 - 591b - 68 What is the n'th term of 7843, 7833, 7807, 7759, 7683, 7573, 7423? -n*3 - 2n*2 + 3n + 7843 What is the q'th term of 17458, 34896, 52334, 69772, 87210, 104648? 17438q + 20 What is the z'th term of 1429, 5426, 12111, 21490, 33569, 48354, 65851, 86066? z3 + 1338z*2 - 24z + 114 What is the z'th term of 28108, 112375, 252826, 449467, 702304, 1011343, 1376590? z*3 + 28086z*2 + 2z + 19 What is the x'th term of -440, -895, -1336, -1739, -2080, -2335? 4x3 - 17x*2 - 432x + 5 What is the c'th term of -814, -3281, -7394, -13153, -20558, -29609? -823c2 + 2c + 7 What is the u'th term of 3573, 3571, 3575, 3591, 3625, 3683, 3771? u*3 - 3u2 + 3575 What is the l'th term of 99, 136, 161, 168, 151, 104? -l3 + 44l + 56 What is the i'th term of -24992, -24993, -24996, -25001? -i2 + 2i - 24993 What is the k'th term of 202, 1196, 3914, 9220, 17978? 144k3 - 2k*2 - 8k + 68 What is the c'th term of 4695, 9371, 14047? 4676c + 19 What is the x'th term of -58, -100, -162, -238, -322, -408? x3 - 16x2 - x - 42 What is the i'th term of 10912, 21823, 32732, 43639? -i2 + 10914i - 1 What is the u'th term of -681, -636, -603, -588, -597, -636, -711? -u3 + 52u - 732 What is the h'th term of 5103, 5105, 5107, 5109, 5111? 2h + 5101 What is the r'th term of -2008, -2005, -1996, -1981, -1960, -1933? 3r*2 - 6r - 2005 What is the y'th term of -518, -510, -506, -506? -2y2 + 14y - 530 What is the j'th term of -765, -1414, -2063, -2712, -3361, -4010? -649j - 116 What is the h'th term of 28, 275, 590, 973, 1424? 34h*2 + 145h - 151 What is the z'th term of -7523, -15052, -22581, -30110? -7529z + 6 What is the s'th term of -12908, -12940, -12982, -13034? -5s*2 - 17s - 12886 What is the m'th term of 138303, 138294, 138287, 138288, 138303, 138338? m*3 - 5m2 - m + 138308 What is the d'th term of 3178, 6137, 9094, 12049, 15002, 17953? -d2 + 2962d + 217 What is the l'th term of 5741, 5479, 5217, 4955? -262l + 6003 What is the h'th term of -202399, -404803, -607207, -809611, -1012015, -1214419? -202404h + 5 What is the i'th term of -26278, -26279, -26280? -i - 26277 What is the v'th term of 30793, 30794, 30795? v + 30792 What is the h'th term of -858, -1737, -2674, -3699, -4842? -5h3 + h2 - 847h - 7 What is the z'th term of -503, -992, -1479, -1964, -2447, -2928, -3407? z2 - 492z - 12 What is the x'th term of 1204, 5326, 12196, 21814? 1374x2 - 170 What is the q'th term of -32, -127, -284, -503, -784? -31q*2 - 2q + 1 What is the w'th term of 29, -1107, -2243? -1136w + 1165 What is the p'th term of -4073, -4062, -4029, -3962, -3849? 2p3 - p2 - 4074 What is the v'th term of -88, -521, -1238, -2239? -142v2 - 7v + 61 What is the h'th term of -1981, -1800, -1561, -1234, -789, -196, 575, 1554? 5h3 - h2 + 149h - 2134 What is the s'th term of 784, 6131, 20598, 48745, 95132, 164319? 760s3 + 27s - 3 What is the j'th term of -74, -139, -200, -257? 2j2 - 71j - 5 What is the q'th term of -3301, -3307, -3319, -3337, -3361, -3391, -3427? -3q2 + 3q - 3301 What is the z'th term of -266, -307, -342, -371, -394, -411? 3z2 - 50z - 219 What is the v'th term of -8140, -8154, -8176, -8206, -8244? -4v2 - 2v - 8134 What is the y'th term of 7447, 7384, 7321? -63y + 7510 What is the n'th term of 83970, 83967, 83962, 83955, 83946, 83935, 83922? -n2 + 83971 What is the l'th term of 249, 295, 353, 429, 529, 659, 825? l3 + 39l + 209 What is the g'th term of 2489, 5025, 7561? 2536g - 47 What is the l'th term of 63, 202, 411, 672, 967? -3l*3 + 53l*2 + l + 12 What is the c'th term of 15571, 15566, 15561, 15556, 15551, 15546? -5c + 15576 What is the v'th term of 1341, 1406, 1501, 1614, 1733? -2v3 + 27v*2 - 2v + 1318 What is the o'th term of -85, 146, 541, 1100? 82o2 - 15o - 152 What is the y'th term of -770, -1597, -2448, -3335, -4270? -2y3 - 813y + 45 What is the r'th term of -836, -819, -792, -755? 5r2 + 2r - 843 What is the d'th term of 1660, 1720, 1820, 1960, 2140, 2360, 2620? 20d2 + 1640 What is the p'th term of 2142, 4309, 6464, 8607, 10738, 12857, 14964? -6p*2 + 2185p - 37 What is the h'th term of -3705, -3707, -3717, -3741, -3785, -3855? -h*3 + 2h*2 - h - 3705 What is the c'th term of -26450, -26446, -26438, -26426, -26410, -26390? 2c*2 - 2c - 26450 What is the s'th term of -44, -25, 6, 49, 104, 171, 250? 6s2 + s - 51 What is the i'th term of -10270, -10305, -10338, -10369, -10398, -10425? i2 - 38i - 10233 What is the r'th term of 651, 1200, 1591, 1818, 1875, 1756, 1455, 966? -r*3 - 73r*2 + 775r - 50 What is the g'th term of 65532, 131061, 196590, 262119, 327648? 65529g + 3 What is the q'th term of 3589, 7164, 10729, 14278, 17805, 21304, 24769, 28194? -q3 + q2 + 3579q + 10 What is the z'th term of -3240410, -6480819, -9721228, -12961637, -16202046? -3240409z - 1 What is the a'th term of 10013, 20053, 30093, 40133? 10040a - 27 What is the p'th term of -159697, -159698, -159699, -159700, -159701, -159702? -p - 159696 What is the n'th term of 4519, 4438, 4223, 3808, 3127, 2114, 703? -11n3 - n2 - n + 4532 What is the n'th term of -31479, -62957, -94435, -125913? -31478n - 1 What is the m'th term of -78, -43, 10, 81, 170? 9m2 + 8m - 95 What is the h'th term of -7464690, -7464687, -7464682, -7464675? h*2 - 7464691 What is the p'th term of 201, 307, 413? 106p + 95 What is the f'th term of 1165, 2265, 3365? 1100f + 65 What is the i'th term of -73971, -73969, -73967? 2i - 73973 What is the y'th term of 3556, 3501, 3446? -55y + 3611 What is the i'th term of -2579, -2672, -2827, -3044? -31i*2 - 2548 What is the w'th term of -19174, -38359, -57544, -76729, -95914? -19185w + 11 What is the b'th term of -38, -178, -462, -938, -1654, -2658? -8b3 - 24b*2 - 12b + 6 What is the h'th term of -1538, -699, 700, 2659, 5178, 8257, 11896? 280h2 - h - 1817 What is the n'th term of -1095, -4292, -9619, -17076, -26663, -38380, -52227? -1065n*2 - 2n - 28 What is the v'th term of -150, -1012, -3254, -7536, -14518, -24860, -39222? -110v3 - 30v*2 - 2v - 8 What is the x'th term of -209, 338, 885? 547x - 756 What is the h'th term of -226, -920, -2094, -3760, -5930? -2h*3 - 228h*2 + 4h What is the r'th term of -8645, -8564, -8483, -8402, -8321? 81r - 8726 What is the b'th term of -52, 508, 2264, 5810, 11740, 20648? 99b*3 + 4b*2 - 145b - 10 What is t	{ "pile_set_name": "DM Mathematics" }
of 1/8, to the nearest integer? 3 What is 1227 to the power of 1/2, to the nearest integer? 35 What is the fifth root of 1196 to the nearest integer? 4 What is the seventh root of 14388 to the nearest integer? 4 What is 6161 to the power of 1/2, to the nearest integer? 78 What is 2665 to the power of 1/9, to the nearest integer? 2 What is 73521 to the power of 1/4, to the nearest integer? 16 What is the third root of 78806 to the nearest integer? 43 What is 8897 to the power of 1/2, to the nearest integer? 94 What is the seventh root of 11228 to the nearest integer? 4 What is the third root of 10273 to the nearest integer? 22 What is the third root of 53190 to the nearest integer? 38 What is 56889 to the power of 1/2, to the nearest integer? 239 What is 1263 to the power of 1/3, to the nearest integer? 11 What is 1028 to the power of 1/2, to the nearest integer? 32 What is 1715 to the power of 1/4, to the nearest integer? 6 What is the seventh root of 53322 to the nearest integer? 5 What is 32284 to the power of 1/9, to the nearest integer? 3 What is the square root of 787 to the nearest integer? 28 What is the fourth root of 244 to the nearest integer? 4 What is 16510 to the power of 1/2, to the nearest integer? 128 What is the ninth root of 416 to the nearest integer? 2 What is 23265 to the power of 1/2, to the nearest integer? 153 What is the cube root of 65067 to the nearest integer? 40 What is 1526 to the power of 1/6, to the nearest integer? 3 What is 1 to the power of 1/2, to the nearest integer? 1 What is the square root of 19264 to the nearest integer? 139 What is 26036 to the power of 1/3, to the nearest integer? 30 What is 25302 to the power of 1/6, to the nearest integer? 5 What is the seventh root of 273 to the nearest integer? 2 What is the third root of 4710 to the nearest integer? 17 What is 9283 to the power of 1/3, to the nearest integer? 21 What is 8326 to the power of 1/2, to the nearest integer? 91 What is the square root of 26651 to the nearest integer? 163 What is the seventh root of 1145 to the nearest integer? 3 What is 499 to the power of 1/2, to the nearest integer? 22 What is 791 to the power of 1/9, to the nearest integer? 2 What is 3065 to the power of 1/3, to the nearest integer? 15 What is the cube root of 1454 to the nearest integer? 11 What is 1948 to the power of 1/7, to the nearest integer? 3 What is 6032 to the power of 1/3, to the nearest integer? 18 What is 21589 to the power of 1/7, to the nearest integer? 4 What is the tenth root of 112776 to the nearest integer? 3 What is the square root of 7 to the nearest integer? 3 What is the seventh root of 73218 to the nearest integer? 5 What is the third root of 10990 to the nearest integer? 22 What is 17635 to the power of 1/9, to the nearest integer? 3 What is the square root of 366 to the nearest integer? 19 What is 12278 to the power of 1/3, to the nearest integer? 23 What is 11213 to the power of 1/2, to the nearest integer? 106 What is 7777 to the power of 1/9, to the nearest integer? 3 What is 892 to the power of 1/2, to the nearest integer? 30 What is 12092 to the power of 1/3, to the nearest integer? 23 What is the square root of 3472 to the nearest integer? 59 What is 58181 to the power of 1/3, to the nearest integer? 39 What is 827 to the power of 1/5, to the nearest integer? 4 What is 507 to the power of 1/2, to the nearest integer? 23 What is 35242 to the power of 1/3, to the nearest integer? 33 What is 487 to the power of 1/2, to the nearest integer? 22 What is 426 to the power of 1/2, to the nearest integer? 21 What is 140 to the power of 1/10, to the nearest integer? 2 What is the ninth root of 720 to the nearest integer? 2 What is the tenth root of 63736 to the nearest integer? 3 What is 14039 to the power of 1/2, to the nearest integer? 118 What is 36460 to the power of 1/2, to the nearest integer? 191 What is the cube root of 830 to the nearest integer? 9 What is the tenth root of 3193 to the nearest integer? 2 What is 297 to the power of 1/6, to the nearest integer? 3 What is the fourth root of 12763 to the nearest integer? 11 What is 5237 to the power of 1/8, to the nearest integer? 3 What is 151490 to the power of 1/2, to the nearest integer? 389 What is the fifth root of 15096 to the nearest integer? 7 What is 35731 to the power of 1/9, to the nearest integer? 3 What is 2831 to the power of 1/3, to the nearest integer? 14 What is the square root of 4636 to the nearest integer? 68 What is 57651 to the power of 1/6, to the nearest integer? 6 What is 1731 to the power of 1/2, to the nearest integer? 42 What is 6279 to the power of 1/8, to the nearest integer? 3 What is the fourth root of 28484 to the nearest integer? 13 What is 28731 to the power of 1/2, to the nearest integer? 170 What is 1547 to the power of 1/5, to the nearest integer? 4 What is 10272 to the power of 1/2, to the nearest integer? 101 What is the fourth root of 1802 to the nearest integer? 7 What is 819 to the power of 1/6, to the nearest integer? 3 What is the cube root of 11384 to the nearest integer? 22 What is 5751 to the power of 1/3, to the nearest integer? 18 What is the square root of 8217 to the nearest integer? 91 What is the cube root of 2877 to the nearest integer? 14 What is 469 to the power of 1/8, to the nearest integer? 2 What is the square root of 1088 to the nearest integer? 33 What is the third root of 2846 to the nearest integer? 14 What is the cube root of 13385 to the nearest integer? 24 What is 26479 to the power of 1/3, to the nearest integer? 30 What is 12502 to the power of 1/3, to the nearest integer? 23 What is the cube root of 1015 to the nearest integer? 10 What is the fifth root of 98274 to the nearest integer? 10 What is 46318 to the power of 1/2, to the nearest integer? 215 What is the square root of 45934 to the nearest integer? 214 What is 78158 to the power of 1/2, to the nearest integer? 280 What is the eighth root of 19186 to the nearest integer? 3 What is 10554 to the power of 1/8, to the nearest integer? 3 What is the third root of 842 to the nearest integer? 9 What is the cube root of 43114 to the nearest integer? 35 What is the third root of 8625 to the nearest integer? 21 What is the ninth root of 10980 to the nearest integer? 3 What is the square root of 8671 to the nearest integer? 93 What is 1394 to the power of 1/2, to the nearest integer? 37 What is the sixth root of 1066 to the nearest integer? 3 What is the square root of 125225 to the nearest integer? 354 What is the cube root of 179277 to the nearest integer? 56 What is 3983 to the power of 1/9, to the nearest integer? 3 What is 42743 to the power of 1/2, to the nearest integer? 207 What is 31 to the power of 1/3, to the nearest integer? 3 What is the third root of 870 to the nearest integer? 10 What is the cube root of 22654 to the nearest integer? 28 What is the third root of 750 to the nearest integer? 9 What is 2671 to the power of 1/6, to the nearest integer? 4 What is 3789 to the power of 1/3, to the nearest integer? 16 What is 8230 to the power of 1/2, to the nearest integer? 91 What is 32870 to the power of 1/4, to the nearest integer? 13 What is 18674 to the power of 1/5, to the nearest integer? 7 What is 9288 to the power of 1/3, to the nearest integer? 21 What is 1455 to the power of 1/10, to the nearest integer? 2 What is the ninth root of 17248 to the nearest integer? 3 What is the sixth root of 61578 to the nearest integer? 6 What is 540 to the power of 1/3, to the nearest integer? 8 What is 821 to the power of 1/6, to the nearest integer? 3 What is the third root of 582 to the nearest integer? 8 What is 773 to the power of 1/4, to the nearest integer? 5 What is the third root of 2210 to the nearest integer? 13 What is the square root of 5120 to the nearest integer? 72 What is 5892 to the power of 1/2, to the nearest integer? 77 What is the third root of 21219 to the nearest integer? 28 What is the cube root of 1752 to the nearest integer? 12 What is the fourth root of 41497 to the nearest integer? 14 What is the eighth root of 7409 to the nearest integer? 3 What is the square root of 14246 to the nearest integer? 119 What is the third root of 77863 to t	{ "pile_set_name": "DM Mathematics" }
assuming g is positive. g(-15) Simplify (t/t(2/5)t)(-11)(tt0)(-7) assuming t is positive. t(-123/5) Simplify h(-1/13)((h0/h)/h)/h assuming h is positive. h(-40/13) Simplify (tt(-3/8))/(t/t(-1/2))t*(-9)tt(1/3) assuming t is positive. t(-205/24) Simplify ((oo*(2/15))/oo(-1/7))(-3/14) assuming o is positive. o(1/490) Simplify (y2/y1)(-2/5) assuming y is positive. y(-2/5) Simplify i(-2/69)/(ii/i(26/7)i) assuming i is positive. i(331/483) Simplify j(-2)/(j*(-5/6)j)(((j/(j(j/j*(-2))/j)j)/j)/j)36 assuming j is positive. j(-661/6) Simplify ((q*(-1/3)/q)/(q/(q/(qq*(3/14)q))))(-3/26) assuming q is positive. q(149/364) Simplify ((oo/o(-1/6))/o(-2/3))(-2/43) assuming o is positive. o(-17/129) Simplify ((t(-1/8)t)/t)/t(-22/5) assuming t is positive. t(171/40) Simplify (h*(2/19)hh3h)/((h/h*(-1/4))/(hh/(h/(hh(-1)))h)) assuming h is positive. h*(445/76) Simplify (yyyyyyy/y(6/17)yyyy)31 assuming y is positive. y(5611/17) Simplify (j(-1/6)jj)/j(2/3) assuming j is positive. j(7/6) Simplify ((u/(u/((u/u8)/u)))/u(u/u*(1/7))/uu)(-5/4) assuming u is positive. u(285/28) Simplify b(((b/(b(2/45)b))/b)/b)/bb(3/5) assuming b is positive. b(-13/9) Simplify ((u/u(-4/7))/u)/(uu*(1/4))(uu0u)(3/20) assuming u is positive. u(-53/140) Simplify (m(-4))(3/17) assuming m is positive. m(-12/17) Simplify w(-2/27)ww*1(w/(w/(w*(-9)/w)w))/(w*(2/17)/ww) assuming w is positive. w(-4219/459) Simplify ((j(1/4))(-14))22 assuming j is positive. j(-77) Simplify (((m(-5)m)/mm)/(mm0m))(21/8) assuming m is positive. m(-63/4) Simplify (i(ii*1)/i)/iiii*7/i(i/i(-2))(-45) assuming i is positive. i*(-126) Simplify (x(xx/x(-9/4)x)/xx/(x(-7/5)xx))(-35) assuming x is positive. x(-791/4) Simplify (n0)(-1/43) assuming n is positive. 1 Simplify c(((cc5/c)/c)/cc)/cc((cc(-6))/c)/c(c/(c(cc*(1/3))/c)c)(-1/2) assuming c is positive. c(-7/3) Simplify (rr/(r(2/15)rr)r)/rr/(r/((r/(r(1/3)r))/r)r) assuming r is positive. r(-37/15) Simplify p(6/11)pp/p(-16) assuming p is positive. p(204/11) Simplify (n6/((n(n*(-1/5)/n)/n)/nn))/(((n*(1/2)/n)/n)/(nn/n*(-4)n)) assuming n is positive. n(157/10) Simplify (l(-4)l(-11))(1/29) assuming l is positive. l(-15/29) Simplify (j/((j/(j(j*(-4/15)j)/j))/j))/j(-2) assuming j is positive. j(56/15) Simplify (p*(-5)p(-1/7))(12/11) assuming p is positive. p(-432/77) Simplify ((r/((r/r(-2/3))/r))/r(-5))/(r/((r2/r)/rrr)(r/(r(-1/5)/r))/r) assuming r is positive. r(77/15) Simplify (yy/y*(-1/2)y)47/(y(-5/2)yy(1/5)) assuming y is positive. y(829/5) Simplify (r*(-6)r)/(r*(-5)/r)(rr(-2/3)r)(-24) assuming r is positive. r(-31) Simplify ((o*(-2/13)o)/o)/(o*(4/3)o)(oo*7)/(o/((o/(oo/((o*(-4)/o)/o))o)/o)) assuming o is positive. o(-97/39) Simplify ((n/n9)/n(-6))37 assuming n is positive. n(-74) Simplify (t(1/6)/(t*(3/5)t))(-3/16) assuming t is positive. t(43/160) Simplify k/(k/((k*(1/4)/k)/k))k3 assuming k is positive. k(5/4) Simplify d*23/dd1 assuming d is positive. d23 Simplify (b*9b*10b)(-17/5) assuming b is positive. b(-68) Simplify (y*(-5)/yy*3/yyy)(1/6) assuming y is positive. y(-1/3) Simplify x/((x(-21)/x)/x)((xx(-9/4))/x)/x assuming x is positive. x(83/4) Simplify (j/((((jjj(-1/12))/j)/j)/j))/j(-4)j(-5/4)/(j/j(-9/5)) assuming j is positive. j*(61/30) Simplify (ss*(-9))/ss*12/ss assuming s is positive. s3 Simplify (t/(t(5/7)t)(t*0t)/t)/(t*(-2)ttt)(12/5) assuming t is positive. t(-109/35) Simplify (k/k*(-1/25)k)/k7 assuming k is positive. k(-124/25) Simplify ((u*(-4/5)/uu)/(u2/u))/(((u(-3/5)u)/u)/(u/(uu(-2/17)))) assuming u is positive. u(-92/85) Simplify (n/(n/n(-1/4)))41n(-2/17)/n1 assuming n is positive. n(-773/68) Simplify (y(-4/3)/y(-9))(-7/2) assuming y is positive. y(-161/6) Simplify (g/g(-9))26 assuming g is positive. g260 Simplify (m/((m6m)/mm))/(m2m)mm/m*(4/7)m(-3/2) assuming m is positive. m(-127/14) Simplify j*(2/7)/(jj/(j/(j(j/j(-2/7))/jj)))(j((jj(3/11))/j)/j)/j0 assuming j is positive. j(-30/11) Simplify ((ff(-5))/(f(-2)f))/((f/f(-1/3))/(ff0)) assuming f is positive. f(-10/3) Simplify (hh(-27))/h(1/7) assuming h is positive. h(-183/7) Simplify (v(-1))40/(v(-2/9)v/(v((((((v(-2/13)v)/v)/v)/vv)/v)/v)/v)) assuming v is positive. v(-5140/117) Simplify c13/c(-14/9) assuming c is positive. c(131/9) Simplify ((r/r(-1))/r)5(r*(-1)r)(-1/57) assuming r is positive. r5 Simplify yy(5/6)(y*(-6)y)/yyy assuming y is positive. y(-13/6) Simplify (s1s)(-8)s((ss*(3/7))/ss)/ss(2/9) assuming s is positive. s(-904/63) Simplify (ll/(l/((((l((l/l(-1))/l)/l)/ll)/ll)/l)l))*(-1/64)l(-2/5)/(l/(l(-2)/l)) assuming l is positive. l(-22/5) Simplify (q/(q(-8/5)/q)q(-1/5)qqqq)(-15) assuming q is positive. q(-111) Simplify (nn*(-2/7)n)/nn8(n/(n/(nn(2/7))))/(n/(n/n(-10))n) assuming n is positive. n19 Simplify r8/r(6/7) assuming r is positive. r(50/7) Simplify ((yy(-12)y)/y(4/9))(9/7) assuming y is positive. y*(-94/7) Simplify ((nn/(nn(-4)))/n)/n(5/2)(nn/n1)(-5/4) assuming n is positive. n(1/4) Simplify xx*(1/10)x((x/(x/(xx(-5))))/x)/x assuming x is positive. x(-39/10) Simplify aaa*(-2/9)aa(-18)a assuming a is positive. a(-128/9) Simplify (p(9/4)p)/(ppp/(p(-5/2)p)p) assuming p is positive. p(-9/4) Simplify (a(-1))(-2/25)(a/(a/(a/a1)))(-1/25) assuming a is positive. a(2/25) Simplify (k/k(-12))(-20/3) assuming k is positive. k(-260/3) Simplify (ggg/(ggg*(-4/15)g)g)(-32) assuming g is positive. g(-608/15) Simplify (u0u)(5/2)/(u0u)(-1/2) assuming u is positive. u3 Simplify ccc(cc14)/ccc(-4) assuming c is positive. c14 Simplify (w(4/3)w)/w(-8) assuming w is positive. w(31/3) Simplify (x(-5)/x)(-35) assuming x is positive. x210 Simplify (y/(y/(((y9y)/y)/y)))/(yy/((yy/(y(-2/37)yyyy))/y))yy(2/11)(y*7y)/y assuming y is positive. y*(4573/407) Simplify rr/(rr(-14/9)r)r(2/35) assuming r is positive. r(508/315) Simplify (q(1/7)(qq/q(1/3)qq)/q)26 assuming q is positive. q(1534/21) Simplify (l/(ll*2/l)ll)(-4/27)/((ll/(l/(l/(l/(l*2/l))l))l)/l)(7/3) assuming l is positive. l(-193/27) Simplify (o/o(2/9)o(-2))7 assuming o is positive. o(-77/9) Simplify r(-1/16)/rrr*(-2/13)/rr assuming r is positive. r(-45/208) Simplify (p(-6/11)/pp)/((p/(p/(p(-11/6)/ppp)))/p) assuming p is positive. p(85/66) Simplify ((s(1/4))(-39))(-35) assuming s is positive. s(1365/4) Simplify s(-3)ss(-16) assuming s is positive. s(-18) Simplify (w(-40)/w)(9/11) assuming w is positive. w(-369/11) Simplify (q6)(27/7) assuming q is positive. q(162/7) Simplify (l/(l/l2))(-29) assuming l is positive. l(-58) Simplify a(-4/3)(aa(-12))/a assuming a is positive. a(-40/3) Simplify (z/(zz*(-1/5)))/(((z(z*(-1/7)/z)/zz)/z)/z)(zz*(-2/15)z)/((z(2/23)/z)/z) assuming z is positive. z(14786/2415) Simplify bb(1/2)b/b10 assuming b is positive. b(-15/2) Simplify ((k((kk/(k/(k/(k*(-4)/k))))/k)/k)/(kk/(kk(1/4)k)))/(k*(-5/4)k(3/4)) assuming k is positive. k(27/4) Simplify x37/x(-3/17) assuming x is positive. x*(632/17) Simplify (k/(k/((kk/(k/(k/k*(-6)))k)/k)))/((k/(kk(-4)k))/k) assuming k is positive. k*6 Simplify (x/(xx(-6)))(2/5) assuming x is positive. x(12/5) Simplify y(-13)/(yy/(y/(yy*(5/3)))y) assuming y is positive. y*(-53/3) Simplify ((ss/(s*(-6)s)s)12)(4/7) assuming s is positive. s(384/7) Simplify (i(-2/5))(-37)/(i(-1)/(i/(i0/i)i)) assuming i is positive. i(94/5) Simplify (y(1/13)/(y*(-2/13)y))37 assuming y is positive. y(-370/13) Simplify (nn31n)(3/7) assuming n is positive. n(99/7) Simplify (v/(v*(-2/11)/v)v)	{ "pile_set_name": "DM Mathematics" }
5402? 146 Calculate the highest common divisor of 6132 and 4332. 12 Calculate the greatest common divisor of 56 and 207004. 28 Calculate the highest common divisor of 1287535 and 95. 95 What is the greatest common factor of 1848 and 7161? 231 Calculate the highest common divisor of 49456 and 1967. 281 What is the highest common divisor of 135900 and 360? 180 Calculate the highest common factor of 3969 and 13440. 21 What is the highest common divisor of 154 and 37807? 77 What is the highest common factor of 40 and 512? 8 What is the greatest common factor of 96 and 91488? 96 Calculate the greatest common factor of 26538 and 30. 6 What is the highest common factor of 2874 and 408? 6 What is the highest common divisor of 39 and 205890? 3 Calculate the highest common divisor of 160178 and 566. 566 What is the highest common divisor of 2745 and 3309555? 915 What is the greatest common factor of 78067 and 8272? 517 Calculate the highest common divisor of 1406 and 247. 19 What is the greatest common factor of 85168 and 80? 16 What is the greatest common divisor of 13688 and 32? 8 What is the greatest common factor of 13054 and 1342? 122 Calculate the greatest common factor of 136134 and 270. 54 Calculate the greatest common divisor of 5079255 and 2385. 795 What is the highest common divisor of 702 and 789399? 351 What is the highest common divisor of 448 and 639856? 112 Calculate the greatest common divisor of 24026 and 738. 82 What is the highest common factor of 4410050 and 2895? 965 Calculate the highest common factor of 495 and 37565. 55 Calculate the highest common factor of 498953 and 819. 91 Calculate the greatest common factor of 1358 and 142008. 194 What is the highest common factor of 130872 and 336? 168 Calculate the greatest common factor of 154 and 95326. 154 Calculate the highest common divisor of 1064 and 552. 8 What is the highest common factor of 3980 and 215716? 796 What is the highest common divisor of 10 and 100910? 10 What is the greatest common divisor of 614499 and 34? 17 What is the highest common factor of 28378 and 70? 14 Calculate the greatest common divisor of 120860 and 80. 20 Calculate the greatest common factor of 5516 and 2185124. 788 Calculate the greatest common divisor of 4303 and 144978. 331 Calculate the greatest common factor of 37618 and 22. 2 Calculate the highest common factor of 81258 and 18966. 174 Calculate the greatest common divisor of 91954 and 189905. 1999 What is the highest common divisor of 279676 and 116? 116 Calculate the greatest common divisor of 314 and 375230. 314 Calculate the highest common factor of 26 and 131833. 13 What is the highest common factor of 828 and 1556433? 207 Calculate the highest common divisor of 266 and 41344. 38 Calculate the highest common factor of 7642705 and 70. 35 Calculate the highest common divisor of 27781 and 182. 13 Calculate the greatest common divisor of 1484 and 43513. 53 What is the highest common factor of 2409 and 2739? 33 What is the highest common divisor of 2871 and 792? 99 What is the greatest common divisor of 100431 and 9? 9 What is the highest common factor of 36620 and 30? 10 Calculate the greatest common divisor of 1152526 and 1038. 346 Calculate the highest common divisor of 17171 and 4455. 11 What is the greatest common factor of 6820 and 70060? 620 Calculate the highest common factor of 5 and 286435. 5 What is the highest common factor of 321 and 155792? 107 What is the greatest common factor of 73850 and 211? 211 Calculate the greatest common divisor of 154031 and 3404. 851 Calculate the greatest common divisor of 510 and 531250. 170 What is the highest common divisor of 4049280 and 74? 74 What is the greatest common divisor of 1505904 and 5754? 822 What is the highest common divisor of 7987 and 14? 7 What is the highest common factor of 9264 and 128? 16 Calculate the highest common divisor of 192 and 324. 12 Calculate the greatest common factor of 3125 and 475. 25 Calculate the highest common factor of 65900 and 175. 25 Calculate the greatest common factor of 3354 and 234. 78 What is the highest common factor of 9686 and 83834? 334 Calculate the highest common factor of 12740 and 52. 52 Calculate the highest common factor of 345 and 71875. 115 Calculate the highest common factor of 7028 and 1368703. 1757 Calculate the greatest common factor of 621 and 3241827. 207 What is the highest common divisor of 15400 and 15120? 280 What is the greatest common divisor of 736 and 61536? 32 Calculate the highest common factor of 42862 and 1943. 29 What is the highest common factor of 384 and 584832? 384 Calculate the highest common divisor of 20 and 477. 1 What is the highest common factor of 32028 and 108644? 628 What is the highest common divisor of 46676 and 476? 28 Calculate the highest common factor of 90056 and 8. 8 What is the greatest common factor of 16744 and 616? 56 What is the highest common factor of 397 and 3074368? 397 What is the greatest common divisor of 740586 and 8085? 1617 Calculate the highest common divisor of 1759886 and 178. 178 Calculate the highest common factor of 1820 and 493584. 364 What is the highest common divisor of 720171 and 204? 51 Calculate the greatest common divisor of 9517236 and 12. 12 What is the highest common divisor of 400939 and 164? 41 What is the highest common divisor of 32130 and 1316? 14 Calculate the greatest common divisor of 15231786 and 174. 174 Calculate the highest common factor of 49221 and 234. 9 What is the highest common factor of 172 and 2731618? 86 What is the greatest common factor of 390 and 405? 15 Calculate the highest common factor of 40 and 33080. 40 Calculate the highest common divisor of 141496 and 368. 184 Calculate the highest common divisor of 256964 and 1135. 227 What is the highest common divisor of 1050 and 19550? 50 What is the greatest common divisor of 111450 and 240? 30 Calculate the greatest common divisor of 3 and 820305. 3 What is the highest common factor of 8286282 and 54? 18 Calculate the highest common factor of 981 and 58969. 109 Calculate the highest common divisor of 90 and 42765. 15 What is the greatest common divisor of 3116 and 83353? 779 What is the greatest common divisor of 3861 and 1226511? 1287 Calculate the greatest common divisor of 504240 and 352. 176 What is the greatest common divisor of 4656 and 28518? 582 What is the greatest common factor of 2155 and 1248607? 431 Calculate the highest common divisor of 3525 and 3750. 75 What is the greatest common divisor of 6969 and 298152? 303 Calculate the greatest common factor of 98 and 42938. 14 Calculate the greatest common divisor of 121840 and 56. 8 Calculate the greatest common factor of 6 and 14426. 2 Calculate the greatest common factor of 144874 and 918. 34 Calculate the highest common divisor of 1275 and 1428. 51 Calculate the greatest common divisor of 986 and 29754. 58 Calculate the highest common factor of 2385 and 1060. 265 Calculate the highest common divisor of 246710 and 70. 10 What is the highest common divisor of 4646 and 8686? 202 What is the highest common factor of 23062 and 13858? 26 Calculate the greatest common factor of 918 and 210239. 17 Calculate the greatest common divisor of 13771 and 470. 47 What is the greatest common factor of 4248 and 107852? 236 What is the greatest common factor of 183 and 7790249? 61 What is the greatest common factor of 1421 and 95746? 49 Calculate the highest common factor of 80 and 53980. 20 Calculate the highest common divisor of 126476 and 532. 28 What is the greatest common factor of 5121 and 9? 9 Calculate the highest common divisor of 3782 and 46848. 122 What is the greatest common divisor of 554886 and 1392? 174 What is the highest common factor of 11264 and 21736? 88 What is the highest common factor of 79825 and 62? 31 Calculate the highest common divisor of 150 and 64725. 75 Calculate the greatest common factor of 7576 and 24. 8 Calculate the highest common divisor of 4 and 25876. 4 Calculate the greatest common divisor of 1560 and 12600. 120 Calculate the greatest common factor of 207 and 2587845. 69 What is the highest common divisor of 2873 and 247? 13 Calculate the highest common factor of 284 and 2221306. 142 What is the highest common di	{ "pile_set_name": "DM Mathematics" }
inutes after 9:25 AM? 12:03 PM How many minutes are there between 2:38 AM and 11:58 AM? 560 What is 680 minutes after 12:50 AM? 12:10 PM What is 260 minutes after 12:09 AM? 4:29 AM How many minutes are there between 1:27 PM and 12:19 AM? 652 What is 126 minutes after 1:28 AM? 3:34 AM What is 249 minutes after 2:02 AM? 6:11 AM What is 367 minutes after 2:24 AM? 8:31 AM What is 101 minutes after 2:20 AM? 4:01 AM What is 126 minutes before 11:46 AM? 9:40 AM How many minutes are there between 1:25 AM and 1:13 PM? 708 What is 9 minutes before 7:34 AM? 7:25 AM How many minutes are there between 7:40 PM and 3:27 AM? 467 How many minutes are there between 4:32 AM and 11:35 AM? 423 What is 472 minutes after 11:41 AM? 7:33 PM What is 48 minutes after 1:03 PM? 1:51 PM How many minutes are there between 1:34 PM and 10:54 PM? 560 How many minutes are there between 11:14 AM and 1:47 PM? 153 How many minutes are there between 12:13 AM and 8:41 AM? 508 How many minutes are there between 1:30 PM and 6:51 PM? 321 How many minutes are there between 5:18 PM and 10:49 PM? 331 What is 677 minutes before 11:18 AM? 12:01 AM What is 374 minutes after 2:04 PM? 8:18 PM What is 376 minutes before 1:55 PM? 7:39 AM What is 501 minutes before 2:03 PM? 5:42 AM What is 468 minutes after 3:30 PM? 11:18 PM What is 643 minutes before 12:52 PM? 2:09 AM How many minutes are there between 5:13 AM and 11:13 AM? 360 What is 400 minutes before 8:11 PM? 1:31 PM What is 44 minutes after 1:02 AM? 1:46 AM How many minutes are there between 9:49 PM and 4:27 AM? 398 What is 665 minutes before 6:13 PM? 7:08 AM What is 418 minutes after 6:18 AM? 1:16 PM What is 557 minutes before 1:02 AM? 3:45 PM What is 552 minutes after 5:36 AM? 2:48 PM What is 553 minutes after 12:24 PM? 9:37 PM What is 6 minutes after 5:45 PM? 5:51 PM What is 120 minutes after 4:30 PM? 6:30 PM How many minutes are there between 4:31 AM and 7:32 AM? 181 How many minutes are there between 6:52 PM and 5:16 AM? 624 How many minutes are there between 9:47 PM and 10:56 PM? 69 How many minutes are there between 2:43 PM and 3:21 PM? 38 How many minutes are there between 11:36 PM and 3:00 AM? 204 What is 552 minutes after 11:50 PM? 9:02 AM How many minutes are there between 9:30 AM and 6:15 PM? 525 How many minutes are there between 5:20 PM and 1:13 AM? 473 What is 493 minutes before 5:18 PM? 9:05 AM What is 141 minutes before 9:02 AM? 6:41 AM How many minutes are there between 1:14 PM and 6:38 PM? 324 How many minutes are there between 7:04 AM and 8:59 AM? 115 What is 324 minutes after 8:14 AM? 1:38 PM How many minutes are there between 8:20 PM and 8:47 PM? 27 How many minutes are there between 10:28 AM and 4:53 PM? 385 How many minutes are there between 9:59 AM and 7:55 PM? 596 What is 430 minutes after 1:53 PM? 9:03 PM What is 117 minutes after 10:48 AM? 12:45 PM How many minutes are there between 9:03 AM and 3:16 PM? 373 How many minutes are there between 8:29 AM and 3:52 PM? 443 How many minutes are there between 1:56 PM and 5:02 PM? 186 How many minutes are there between 2:03 AM and 6:29 AM? 266 What is 559 minutes before 1:14 PM? 3:55 AM How many minutes are there between 5:21 AM and 3:09 PM? 588 What is 552 minutes after 4:19 AM? 1:31 PM How many minutes are there between 12:50 PM and 10:20 PM? 570 How many minutes are there between 2:58 AM and 3:04 AM? 6 How many minutes are there between 1:17 PM and 2:28 PM? 71 What is 186 minutes after 12:49 PM? 3:55 PM What is 51 minutes after 12:14 PM? 1:05 PM How many minutes are there between 3:10 PM and 11:11 PM? 481 What is 249 minutes before 2:58 AM? 10:49 PM How many minutes are there between 12:51 PM and 5:06 PM? 255 What is 630 minutes after 12:39 AM? 11:09 AM How many minutes are there between 12:30 AM and 11:27 AM? 657 What is 699 minutes after 1:47 AM? 1:26 PM What is 207 minutes after 7:50 AM? 11:17 AM What is 586 minutes before 8:40 AM? 10:54 PM What is 482 minutes after 9:50 PM? 5:52 AM How many minutes are there between 7:11 PM and 4:41 AM? 570 What is 466 minutes after 2:19 PM? 10:05 PM How many minutes are there between 9:05 PM and 3:39 AM? 394 How many minutes are there between 2:18 AM and 3:27 AM? 69 What is 596 minutes before 12:52 PM? 2:56 AM How many minutes are there between 12:53 AM and 10:10 AM? 557 What is 564 minutes before 11:29 PM? 2:05 PM How many minutes are there between 4:10 AM and 7:37 AM? 207 What is 493 minutes before 4:29 PM? 8:16 AM What is 142 minutes before 5:10 AM? 2:48 AM How many minutes are there between 3:38 AM and 10:12 AM? 394 What is 372 minutes before 9:42 PM? 3:30 PM What is 371 minutes before 9:58 PM? 3:47 PM What is 459 minutes before 11:27 PM? 3:48 PM How many minutes are there between 12:09 PM and 7:10 PM? 421 What is 504 minutes before 8:26 PM? 12:02 PM What is 530 minutes before 7:25 PM? 10:35 AM How many minutes are there between 5:48 AM and 3:35 PM? 587 How many minutes are there between 10:42 AM and 3:07 PM? 265 What is 386 minutes before 8:17 PM? 1:51 PM How many minutes are there between 4:42 AM and 10:58 AM? 376 What is 283 minutes before 7:39 PM? 2:56 PM How many minutes are there between 10:56 PM and 6:20 AM? 444 How many minutes are there between 4:53 AM and 12:31 PM? 458 What is 394 minutes after 6:40 PM? 1:14 AM What is 655 minutes after 1:46 PM? 12:41 AM What is 456 minutes before 3:45 PM? 8:09 AM How many minutes are there between 2:26 AM and 8:33 AM? 367 What is 445 minutes before 12:54 PM? 5:29 AM What is 96 minutes before 3:56 AM? 2:20 AM How many minutes are there between 2:30 AM and 2:17 PM? 707 What is 292 minutes before 1:52 PM? 9:00 AM What is 610 minutes after 7:29 PM? 5:39 AM How many minutes are there between 12:08 AM and 8:36 AM? 508 What is 664 minutes before 5:59 PM? 6:55 AM How many minutes are there between 4:44 AM and 4:55 AM? 11 How many minutes are there between 10:14 PM and 3:59 AM? 345 How many minutes are there between 5:07 AM and 5:13 AM? 6 How many minutes are there between 9:31 AM and 12:17 PM? 166 What is 107 minutes after 1:13 PM? 3:00 PM How many minutes are there between 12:13 AM and 2:49 AM? 156 What is 184 minutes after 10:46 PM? 1:50 AM What is 530 minutes before 2:59 AM? 6:09 PM What is 49 minutes before 12:28 PM? 11:39 AM What is 398 minutes before 2:27 PM? 7:49 AM How many minutes are there between 12:55 AM and 3:35 AM? 160 How many minutes are there between 6:38 AM and 8:08 AM? 90 What is 223 minutes after 1:53 AM? 5:36 AM What is 59 minutes after 12:04 AM? 1:03 AM What is 706 minutes after 11:57 AM? 11:43 PM How many minutes are there between 9:50 PM and 7:46 AM? 596 What is 682 minutes before 7:26 AM? 8:04 PM How many minutes are there between 12:20 PM and 10:09 PM? 589 What is 408 minutes before 9:56 PM? 3:08 PM How many minutes are there between 5:22 PM and 4:31 AM? 669 How many minutes are there between 8:09 AM and 11:20 AM? 191 How many minutes are there between 3:28 PM and 1:59 AM? 631 How many minutes are there between 10:46 AM and 2:15 PM? 209 How many minutes are there between 3:45 AM and 7:48 AM? 243 What is 40 minutes after 6:02 PM? 6:42 PM How many minutes are there between 5:59 PM and 9:03 PM? 184 What is 204 minutes after 3:50 PM? 7:14 PM How many minutes are there between 4:30 PM and 1:04 AM? 514 How many minutes are there between 7:31 PM and 4:50 AM? 559 How many minutes are there between 6:42 PM and 6:13 AM? 691 How many minutes are there between 9:01 PM and 3:07 AM? 366 How many minutes are there between 11:40 PM and 11:39 AM? 719 How many minutes are there between 1:58 PM and 3:40 PM? 102 What is 355 minutes after 11:41 PM? 5:36 AM What is 610 minutes before 12:59 AM? 2:49 PM How many minutes are there between 1:37 AM and 10:01 AM? 504 How many minutes are there between 11:38 AM and 2:10 PM? 152 How many minutes are there between 10:31 PM and 6:17 AM? 466 How many minutes are there between 8:46 PM and 5:02 AM? 496 What is 360 minutes before 11:55 AM? 5:55 AM How many minutes are there between 2:02 PM and 8:48 PM? 406 How many minutes are there between 3:48 AM and 1:45 PM? 597 How many minutes are there between 7:27 AM and 12:30 PM? 303 What is 54 minutes after 1:09 AM? 2:03 AM How many minutes are there between 12:27 PM and 11:46 PM? 679 How many minutes ar	{ "pile_set_name": "DM Mathematics" }
te (-30)/12((-20)/(-25) - -4). -12 Evaluate (-30)/(-4)8/(-6)57/(-38). 15 ((-19)/1 + 33768/1764)/(33/7) 1/33 What is the value of (3 + 2600/(-870))-9? -3/29 What is the value of (6/(-44))/((21/(-49))/((-32)/56))? -2/11 Evaluate ((240/25)/(-8))/((-46)/(-1035)) + 1. -26 Evaluate -2(-3)/60-130. -13 148/(-1924) + 63/3185 -2/35 What is the value of 72/(-60) + -8 + -1 + 9? -6/5 Evaluate (0 + (-6)/(-140) - 1) + (-42)/(-49). -1/10 What is the value of 0/((-108)/12) + 1 + -7? -6 Evaluate (11/55)/(1 + (-21)/18)-20. 24 What is the value of (1 + (-25)/10)/(30/460)? -23 What is the value of (15 - 3)1/(-2)? -6 What is the value of 44 + 25 + -86 - (-1 + -14)? -2 ((-103)/(-1030))/(((-332)/112 + 3)2) 7/5 Calculate 6 + -30 + (16/(-24))/(3/36). -32 ((-714)/85)/((-51)/(-85)) -14 What is the value of 418/(-12)(-34)/357? 4/7 Evaluate ((-56)/70)/((-24)/9). 3/10 Evaluate (-6)/17 - 13717/(-54230). -1/10 What is the value of 1 + 2(-197)/234 - 38/(-171)? -6/13 ((-63)/(-108))/(420/160) 2/9 Evaluate (1860/496)/(-1 - 2/((-32)/28)). 5 What is ((-114829)/(-7524) - 15)-3 - (-3)/4? -2/57 Calculate 312/(-16380)(-7)/(-3). -2/45 Evaluate (-30 - 2) + (299 - 285). -18 (-22449)/4276 + (5 - -1) 3/4 -9 + (-6)/12-20 1 (-4)/(-14) - (70490/(-2646) - -18) - 9 -2/27 What is 2/15 + (-7 + 11 + -4)/1? 2/15 Evaluate (4/(-70))/(51/(-510)). 4/7 (-6 - 9)(-2 - (-288)/150) 6/5 (26325/1170)/(-2 + (-26)/(-8)) 18 What is (-6)/21 + 7 + ((-108)/14 - 2)? -3 What is 14/(-4) + 3/(-39)(-3042)/36? 3 What is 70/28(2 - (-2 - -2)) - -6? 11 What is 14/((-2)/(3/(-3)1)) + -8? -1 What is the value of (-1035)/690136/12? -17 What is the value of 4/(3 - 6/(-108)-42)? 6 (2/(-3))/((-1)/6) + 106/(-53) 2 Evaluate (-15)/(-14)(-23448)/9770. -18/7 What is the value of 9(-91)/(-840) + 6/(-10)1? 3/8 Evaluate (16/24)/(19/228 + (2 - 2)). 8 Evaluate ((-19)/5643-22)/((-1)/6). -4/9 What is ((-602)/28)/(-43)(-102)/(-3 + 6)? -17 Calculate (-1)/(-3 + 26/4) - (-13325)/38675. 1/17 4(1926/(-300) + (-1188)/(-150) + -8) -26 Calculate 22/187 - 65024/2159. -30 What is ((-35)/(6370/(-28)) - (-342)/(-26)) + 8? -5 What is (-128)/(-1496) + 10/110? 3/17 What is (((-16)/(-10))/(-2))/(((-876)/40)/73)? 8/3 Evaluate (0 - (-10)/(-7))/((-252)/294). 5/3 Evaluate 143(-55)/(-121) - 36. 29 Calculate ((-1)/1)/(1877/48802). -26 What is the value of -3342/532 + (-5)/(-2)? -2/19 Evaluate 3782/(-488) - (-1 + (-5)/(-4)). -8 What is (-6 - (-9693)/1620)-3? 1/20 What is 14/4 - ((-405)/36)/(6/4)? 11 (-3 - 63/(-18))3/(-18)4 -1/3 ((-174)/319)/((-4)/(-6)) + 4 + -3 2/11 What is the value of 45/128780/(-1317)? -25 What is ((-22)/12 - -2)(-3)/1? -1/2 Calculate (2 - 1) + 0 + 17 + -74 + 63. 7 What is (-2 - 3)/((-645)/86)-6? -4 Evaluate 2(2 - -2) - (-2 - -3 - 0). 7 Evaluate (((-966)/8)/7)/((-3)/4). 23 Calculate 4/10 + (121/(-165)-9 - 11). -4 -7 - (-4 + (-154)/49) 1/7 Evaluate 2/(-15 - (-618)/42). -7 Calculate (7/6)/(161/(-92)) + 142/6. 23 6/(4(-9)/(-30)(-450)/(-60)) 2/3 (11 + 0 - (-4472)/(-520))/(-2) -6/5 What is 85((-48)/12)/20? -17 What is (-8(-17)/408)/(39/(-9))? -1/13 Calculate 5/(-5) + 16 - (30 + -20). 5 Evaluate ((-4)/11)/((-222)/(-333)). -6/11 Calculate (-7350)/15750(1 + 57/(-42)). 1/6 What is the value of (10/30)/(((-6)/81)/2)? -9 What is ((-3)/(-1))/(-30 + (-5247)/(-176))? -16 What is (-36)/(-10) - (-126)/(-210)? 3 What is (-850)/(-20)(-3)/(-10)(-16)/24? -17/2 What is the value of (-159)/(-57) - (42 + -26 + -131)? -4/19 What is (74/(-111))/((-3)/(-9))? -2 Calculate ((-2)/6)/(3/(-3(-42)/140)). -1/10 Evaluate 16/(-28) - (-16)/56. -2/7 Evaluate (-140)/56 - (-9 + 3 + 1). 5/2 ((294/44 - 142/781) + -4)-2 -5 What is (-17)/(-612)12 + (260/12 - 2)? 20 ((-1248)/65)/(-24) - (117/(-735) - -1) -2/49 Calculate -2(18/(-315)-56)/((-2)/5). 16 What is ((-16)/2 + 4)/(151 + 99)? -2/125 What is the value of 12 + (-2930)/100 - -17? -3/10 What is 79/(-1264)48/(-14)? 3/14 Evaluate 82 + 72 + -14 + -44. 30 What is the value of 22/5560/40? 3/5 What is the value of (56/(-49))/((29/(-203))/(2 + -1))? 8 Calculate (70(-74)/(-1295))/(20/3). 3/5 Evaluate (620/48)/(10/72). 18 What is 16896/(-6912)(2 - (-75)/(-33))? 2/3 What is the value of 498/(-12)2/27 + (-2)/(-27)? -3 What is (-24)/96 + (-136)/(-160) + (-132)/270? 1/9 (-269)/2690 - 321/(-3810) -2/127 What is the value of (-1(-3)/(-3))/(1/(-8 - 2))? 10 Evaluate (-22)/(8/((-48)/(-18)) + (-50)/10). 11 Evaluate 798/(-72) + 9/108. -11 Calculate (-15)/(-10 + (-560)/(-64)). 12 Evaluate (-137)/822 - (508/(-24) - -4). 17 What is the value of (81/(-270))/((-6)/10)? 1/2 What is (-3)/(19 - 4)-32 + (-30 - -24)? 2/5 What is the value of (3/2)/((-77)/(-154))? 3 Evaluate (-162830)/(-3325) - (54 - 5). -1/35 What is the value of (-34)/6 - (1 - 4)6/27? -5 What is the value of (-20 + 1104/24)/(-1(2 - 0))? -13 What is the value of 9 + 59/(-59) + (-117)/15? 1/5 What is the value of 5 + 44/30 + (-14)/(-42) + -7? -1/5 What is (6/(-9))/((-2525)/303)? 2/25 What is the value of (-5 - 3) + 12/16(-2120)/(-195)? 2/13 Evaluate ((-9)/(-12))/((-4)/(-30) + 5882/(-2040)). -3/11 Evaluate 12/22(-53)/(3816/48). -4/11 What is (140/98)/((-21)/245) - (-8)/(-6)? -18 Calculate -6 - -1 - ((-203)/476)/(17/204). 2/17 Evaluate (-25 - (-31 + 4))15/(-2). -15 2/(-16) - ((-32504)/64)/(-17) -30 What is the value of (-1 - 8) + -1 + (-5 - -3 - -22)? 10 Calculate ((-45)/35 + 1)(15 + -22). 2 What is the value of (-12065)/36575 + (-6)/(-105)? -3/11 What is the value of 3/(-63)-3 - (-59 + (-24190)/(-413))? 4/7 Calculate 84/64(-10 + 13 + -9). -3 What is ((-30)/12)/((-2)/(-12))? -15 What is the value of ((-3)/(-18))/((-886)/15948)? -3 (198/(-4))/(-3)44/(-24) -11 What is the value of 5 + -2 - (3 - ((-58)/16 - -4))? 3/8 ((-4 - 47)/(-3))/(21/(-57 - -15)) -34 6/4(940/15)/47 + -7 -5 Evaluate 2/3 - 17080/31110. 2/17 Calculate -4 + 9((-279)/(-216) + (-9)/(-24)). 11 ((-528)/12)/(8/(-12)(-36)/(-6)) 11 -33(-28)/(-147) + (-138)/(-23) -2/7 Evaluate (-64)/(-24) + (3515/(-75))/19. 1/5 Calculate 3/(-6) + (-54)/(-12) + -2 + -1. 1 (-728)/520 - (-3)/(-5) -2 Evaluate -12 + 3 + (1 - -9). 1 What is (-7)/(-22)((-288)/126 - (-16 - -12))? 6/11 Calculate 9(-24)/164/6. -9 What is the value of 13 - 203/14 - 66/(-4)? 15 Evaluate (-21)/(-28) - 3/((-60)/(-395)). -19 What is the value of 4/((-36)/(-756) + (-2 - 15/(-9)))? -14 What is 14/(0 + (480/220 - (-2)/(-11)))? 7 What is the value of ((-8)/4)/(10 + (-793)/78)? 12 Evaluate (-3119/21)/(-18 - -17). 17 4/22 + (-12)/((-1848)/49) 1/2 What is -32/12(-26 + 48)? -11 Evaluate (-3)/(6/(-4)) + -11 + (-1600)/(-180). -1/9 Evaluate (9/15 + (-57)/(-30))/(350/525). 15/4 8/(19/((-494)/(-52))) 4 What is the value of 17/((-680)/(-16))-5? -2 Evaluate (0/1 - 56/(-10))328/1312. 7/5 -4(-6)/(-6) - (-45)/(-18)-4 6 What is (0 - 2/14)(-1206)/(-402)? -3/7 Calculate 610/(-40) - (-840)/(-224). -19 What is (-12)/1380/1203/12? -2/13 Evaluate 3/(-4)(220/36)/((-85)/(-204)). -11 What is 1280/(-6384) - (-3 + (3 - 14/133))? -2/21 Evaluate 6/(-12) + 3/2. 1 Evaluate (8/10 - (-2)/(-5)) + 448/(-770). -2/11 What is ((-21)/(-28) + (-1443)/740)/((-54)/(-40))? -8/9 Evaluate 24/(-168) - (72/616 + 4/(-14)). 2/77 Calculate (32/(-110))/8-5 + 72/(-33). -2 Evaluate 170/425 - ((-308)/(-135))/7. 2/27 Evaluate 2/14 + -1487/(-980). 6/5 (-87)/((-2001)/(-322)) - 27 -41 Evaluate 699/(-1631)(-14)/(-20). -3/10 Evaluate (-384)/(-399) + 492/(-574). 2/19 (3/(-4)1)/(192/1024) -4 Calculate (1 + 2)/(24/(-2400)165). -20/11 Evaluate (6 + 1 - (-297)/(-231) - 1) + -5. -2/7 Evaluate ((-14)/147)/((-1269)/(-329)). -2/81 (6/(-11))/(6(-49)/308) 4/7 What is (5 - (-940)/(-195)) + (-1)/((-12)/(-4))? -2/13 ((-880)/(-385))/(3/(-21)) -16 Calculate 16/(-2)((-3893)/(-136) + -29). 3 Calculate 1 - 165/231(-7)/(-3). -2/3 Evaluate (-56 + (-34970)/(-624))/((-1)/(-4)). 1/6 Evaluate ((7 + -3)/372)/(9/27). 1/31 What is the value of (-12)/6 - ((-183)/21 - -6)? 5/7 Calculate (123/41 - (-3)/(-1))/6. 0 What is 770/(-220) + (-72)/(-21) - 0? -1/14 (-3 - -8) + 299/(-52) -3/4 What is -7 + (-78)/(-11) + (0 - 6/429)? 1/13 What is the value of 2 + 88/(-3 + 11) + -4? 9 Calculate (-323536)/10512 + (-2)/(-18)-2. -31 What is -1 + 6/7 + 227810/8393? 27 (0 - (-6 + (-120)/(-16)))(0 + -2) 3 Calculate (-19)/72 + 0 - 2/18. -3/8 Calculate (-37)/((-481)/(-364))2/(-24)-9. -21 What is (-1998)/(	{ "pile_set_name": "DM Mathematics" }
-3i - 1. Calculate -2s(y) - 5x(y). 3y + 3 Let l(v) = -11v2 - 3. Let h = 274 - 266. Let f(o) = -32o*2 - 8. Give hl(y) - 3f(y). 8y*2 Let o(r) = r - 2. Let i(t) = -2t + 4. Let j be (-1)/(4/(3-12)). Suppose 5a - ja = -24. Give ai(x) + 13o(x). x - 2 Let r(y) = 16y. Let d(m) = -m. Let l(q) = -12d(q) - r(q). Let u = -5 + 11. Let w(i) = i. Let c = 82 - 81. Calculate cl(h) + uw(h). 2h Let g(v) = -5v + 4. Let b(d) = -2 - 4 + 5 + 2. Suppose -18n - 18 = -0. What is ng(f) + 6b(f)? 5f + 2 Let t(k) = 26k - 1. Let j(m) = 26m - 2. Determine 5j(g) - 6t(g). -26g - 4 Let q(h) = -65 + 64 - 13h + 9h. Let i(b) = 7b + 3. Give -6i(d) - 11q(d). 2d - 7 Let z(g) be the first derivative of -65g2/2 - 3. Let m(q) be the second derivative of -q3/2 + 75q + 2. Give -45m(b) + 2z(b). 5b Let y(s) = -1696s*3 + 32s*2 + 32. Let h(j) = 261j*3 - 5j*2 - 5. Determine 32h(k) + 5y(k). -128k*3 Let h(y) = -46y*2 - 17y + 7. Let x(g) = 31g2 + 11g - 5. Give -5h(v) - 7x(v). 13v2 + 8v Let r(z) = -2z3 - 6z*2 + 6z + 6. Suppose -3k + 9 + 6 = 0. Suppose -kf + 9 = -1. Let l(o) = 3 - 8 + 5 - o - 1 + o*f. Give -6l(d) - r(d). 2d3 Let j(o) = 4o*3 + 14o2. Let p = -135 - -121. Let c(k) = -k3 - 3k2. Give pc(t) - 3j(t). 2t*3 Let u(x) = -7798x + 6684. Let f(d) = -2d + 2. Determine 3342f(j) - u(j). 1114j Let n(f) = -7f + 13. Let o(k) = 9k - 51. Let s(t) = -t + 6. Let j(m) = 4o(m) + 33s(m). Give 10j(a) + 4n(a). 2a - 8 Let o(m) be the first derivative of -m*3/3 - 7. Let b(l) = 2l*2. What is -2b(p) - 3o(p)? -p2 Let a(c) = c - 1. Let t be ((-16)/(-24))/((-4)/(-78)). Suppose 18 = -5f + t. Let g(k) = k + 2. Calculate fg(x) - a(x). -2x - 1 Let a(k) = -k + 8. Let h(r) = 2r. Let m(z) = -9z - 9. Let b(p) = 5h(p) + m(p). Let q be (-8)/(-14) + 583/(-77). Give qa(y) - 6b(y). y - 2 Let a(v) = -5v - 2. Suppose t + 8 = 3x, 4x + 4t - 17 = -t. Suppose -xf + 0f + 9 = 0. Let q(o) = -16o - 6. Determine fq(z) - 10a(z). 2z + 2 Let h(z) = 463z*2 - 8z + 8. Let j(f) = -f*2 - 2f + 2. Give h(c) - 4j(c). 467c*2 Let y(h) = 2h2 + 5 - 11 + 7. Let o(x) = x2 + 1. Give -5o(i) + 5y(i). 5i2 Suppose -35 = -8o + 3o. Let v(d) = -13d*3 + 7d*2 + 3d + 1. Let m(a) = 2a + 2a*2 - 9a*3 + 0a + 1 + 3a2. What is om(r) - 5v(r)? 2r*3 - r + 2 Let q(d) = 16d*2 - 1. Let k(x) = -1061x*2 + 2123x*2 - 1065x*2. Determine 11k(i) + 2q(i). -i2 - 2 Let f(b) be the second derivative of -b4 + b3/6 - 2b*2 - 21b + 1. Let x(z) = -23z2 + 2z - 7. Give 7f(w) - 4x(w). 8w2 - w Let i(o) = o2 + o. Let f(k) be the first derivative of 2k*3 + 5k*2/2 + 896. Let m = 2 + -1. Give mf(h) - 3i(h). 3h*2 + 2h Suppose 0 = 28a + 190 + 6. Let t(i) = -9i*2 - 17. Let m(o) = -13o*2 - 25. Determine at(q) + 5m(q). -2q*2 - 6 Let n(l) = 19l*3 + 13l - 13. Suppose 4 = 4u - 4. Let d(j) = -41 + 3j*3 + 15 + 24 + uj. Determine -39d(b) + 6n(b). -3b3 Suppose 37d + 815 = 556. Let c(q) = 3q + 10. Let u(p) = -4p - 15. Give dc(h) - 5u(h). -h + 5 Let c(h) = -15h - 2h + 0h + 6 + 4h. Let s(v) = -7v + 3. What is 6c(a) - 11s(a)? -a + 3 Let s = 7 + -1. Let x(b) be the third derivative of -1/4b*4 - 13/6b*3 - 8b*2 + 0b + 0. Let m(p) = -3p - 6. Give sx(f) - 13m(f). 3f Let x(o) = -o*3 + 7o*2 + 6o + 6. Let b(i) be the second derivative of -i4/12 - i3/6 - i*2/2 - 109i. What is 6b(k) + x(k)? -k3 + k2 Let h(c) = -8c - 2 + 6c + 4. Let w(r) = 10r - 11. Suppose 0 = 4q + 2 - 14. Suppose z = -qz - 8. Calculate zw(d) - 11h(d). 2d Let r(a) = -a + 4. Suppose -8j - 24 = -56. Let b(f) = f - 3. Give jb(i) + 3r(i). i Let q(n) = n*2 - n. Suppose 0k + 6 = 2k. Let r(y) = 4y*2 - y - 1374862 - 2y + 1374862. Determine kq(w) - r(w). -w2 Let l(x) = -2x + 1. Let b(r) = -111r - 1. Determine -b(c) + 4l(c). 103c + 5 Let j(h) = 1. Let q(o) = 13o + 791. Let k be q(-61). Let v(x) = -x + 8. Calculate kj(n) - v(n). n - 10 Let u(b) = -443b + 4. Let l(d) = -534702d + 4829. Calculate -4l(g) + 4829u(g). -439g Let g(x) = -19x2 + 5x + 8. Let y(a) = -20a2 + 5a + 9. What is 7g(c) - 6y(c)? -13c2 + 5c + 2 Let i be (-2)/4 - 6/(-4). Let u(b) be the second derivative of b4/12 + b2/2 + b. Let c(d) = 5 + 7 + 9 + d*2 - 8 - 11. Determine ic(o) - 2u(o). -o2 Let y(s) be the third derivative of -24s*2 + 0 + 0s + 0s3 - 1/24s*4. Suppose -d = -6d + 5. Let a(h) = 3h + 1. What is da(f) + 4y(f)? -f + 1 Let z(r) = -2r + 1. Let w(l) = -12l + 22. Let s(h) = -w(h) + 8z(h). Let c(v) = 2. What is -14c(d) - 2s(d)? 8d Let l(b) = -b3 + b2. Let m(v) = 6v*3 - 3v*2 - 2v + 1. Let j = 1480 - 1479. Calculate jm(k) + 3l(k). 3k3 - 2k + 1 Suppose -15u - 55 - 5 = 0. Let w(p) = -5p2 + 1. Let b(q) = q2. Calculate ub(h) + w(h). -9h2 + 1 Let z(s) = -s2 - s + 1. Let m(i) = -2i2 + i - 1. Let j be 14 - 16 - (-2 + -3). What is jz(y) + 3m(y)? -9y2 Let o(r) = r2 + 111r + 4. Let z(y) = 4y*2 + 333y + 13. What is 7o(l) - 2z(l)? -l*2 + 111l + 2 Let r(z) = -8z - 7. Let g(d) = -4 - 6 - 4 - 15d + 1. Let q(y) = 4g(y) - 7r(y). Let w(o) = -3o - 2. Let s = 39 + -34. Give sq(l) - 7w(l). l - 1 Let q(n) = -46n*3 + 11n*2. Let g(z) = -11z*3 + 6z*2 - 4. Let b(t) = -23t*3 + 14t*2 - 10. Let s(r) = 2b(r) - 5g(r). Give 2q(y) + 11s(y). 7y*3 Let u(q) = -21q*3 - 7q - 2. Let i(l) = -20l3 - 7l - 1. Determine 4i(x) - 3u(x). -17x3 - 7x + 2 Suppose 0d + 2d + 6 = 0. Let j(n) = 32. Let w(r) = -19. Let i(g) = -3j(g) - 5w(g). Let a(f) = 2f + 2. What is di(s) - a(s)? -2s + 1 Let o(g) = -g2 + 3. Let c = 313 - 316. Let k(y) = -4. Suppose 2t - 2 = -10. What is ck(u) + to(u)? 4u2 Let r(w) = -w - 1. Let z(y) = 3y - 34. What is 6r(k) + 3z(k)? 3k - 108 Let p(r) = -r3 - 23r*2. Let k(f) = -2f*3 - 22f*2. Give 2k(c) - 3p(c). -c3 + 25c*2 Let c(i) = 2i - 29. Let o(y) = y - 10. Suppose -2k + 4w - 14 = 0, 5k - 23w + 21w + 19 = 0. Calculate kc(x) + 8o(x). 2x + 7 Let u(f) = -4f2 + 20f + 5. Let z(w) = -5w2 + 21w + 6. What is 4u(v) - 3z(v)? -v*2 + 17v + 2 Let h(i) = -i*3 - 1. Let a(p) = 5p*3 - 2p + 8. Suppose -4q - 181 = 4f - 17, -q + 5 = 0. Let d be f/(-8) + 2/8. Calculate dh(v) + a(v). -v3 - 2v + 2 Let s(c) = 28c2 + 43 + 160c - 47 - 151c. Let b(i) = -7i*2 - 2i + 1. What is 9b(y) + 2s(y)? -7y2 + 1 Let l(m) = m2 + 10m - 25. Let f be l(-12). Let y(p) = -p - 1. Let b(x) be the first derivative of 7x2/2 + 3x + 22. What is fb(n) - 4y(n)? -3n + 1 Let b(r) = 6r*2 - 7r - 8. Let x(t) = -t*2 + t + 3. Calculate b(g) + 5x(g). g*2 - 2g + 7 Let v be (-55)/(-11) - (3 + 1 + -4). Let r(a) = -1. Let w(y) = -7y - 7. What is vr(z) - w(z)? 7z + 2 Suppose -3c - c = -28. Let l(y) = 8 - 3y + 5y + 6y. Let g(p) = 1 + 45p - 2 + 8 - 38p. Calculate cg(t) - 6l(t). t + 1 Let s(x) = -2x*3 + 6x + 9. Suppose 5 = -4f - 19. Let h(c) = -2c*3 + 5c + 8. What is fh(m) + 5s(m)? 2m3 - 3 Let w(m) = 21m - 9. Let t(z) = -39z + 20. Give 4t(d) + 7w(d). -9d + 17 Suppose 0 = a + 4l - 35, 12a = 10a - 3l + 60. Let r(f) = 63f. Let x(w) = -9w. What is ax(i) + 4r(i)? 9i Let c(l) = l - 2. Let t(u) = -38u + 5. What is -5c(m) - t(m)? 33m + 5 Let v = -29 + 32. Suppose 26 = -vl + 29. Let k(i) = i - 3i + 3i + 0i. Let j(n) = n*2 - 5n - 2. Give lj(w) + 5k(w). w*2 - 2 Suppose -37 = 5o + 3u + u, 2o = u - 7. Let q(y) = -y*2 - 3y - 3. Let f(g) = 5 - g3 + 4 + g2 - 5 + 5g + 1. Give oq(m) - 3f(m). 3m*3 + 2m*2 Let y(q) = 8q*2 - q + 69. Let r(d) = 2d*2. Determine -5r(i) + y(i). -2i2 - i + 69 Let s(r) = -3. Let w(j) = -100j - 225. Calculate 75s(k) - w(k). 100k Let c(r) = -47r + 28. Let x(m) = 94m - 52. Calculate 11c(w) + 6x(w). 47w - 4 Let c = 1349 - 1348. Let h(l) = -l3. Let o(x) = -4x*3 - 6x. Calculate co(z) - 2h(z). -2z3 - 6z Let f(w) = -502w3 - 26w*2 - 9. Let r(k) = 251k*3 + 12k*2 + 4. What is 6f(z) + 13r(z)? 251z*3 - 2 Let a(l) = l + 20. Let x(h) = -2h - 62. Determine 11a(o) + 4x(o). 3o - 28 Let h(q) = 5q - 91. Let g(y) = -y + 18. What is 11g(l) + 2h(l)? -l + 16 Let w(c) = -c - 14. Let a = 37 + -48. Let	{ "pile_set_name": "DM Mathematics" }
erivative of 12 - 5r2 + 4r*2 + 45r*2 + 10 + 2r wrt r? 88 Let u(o) be the third derivative of -3o5/5 + o4/12 + 7o3/6 - o2 + 14. Find the second derivative of u(q) wrt q. -72 Find the first derivative of -146 - 70 - 221 + 37n4 - 338n*4 wrt n. -1204n*3 Let h(j) = 168j*5 + 6j*4 + 2j + 90. Let w(a) = -2a5 + 2a*4 + a - 1. Let b(z) = h(z) - 3w(z). What is the second derivative of b(s) wrt s? 3480s3 Let c(t) be the first derivative of t7/210 - t6/40 - 5t*3/3 - 8. Let l(y) be the third derivative of c(y). What is the third derivative of l(z) wrt z? 24 Let x(f) be the third derivative of 317f*5/60 - 87f*4/8 - 797f*2. What is the second derivative of x(y) wrt y? 634 Let j(n) be the third derivative of 0n + 0n3 + 0 + 1/12n*4 + 7n*2 + 0n*5 + 0n*6 - 3/70n*7. Find the second derivative of j(f) wrt f. -108f2 Let a(y) = -y4 + y*3 + 2y*2 + 1. Let u(t) = 88t*4 - 6t*3 - 12t*2 + 38. Let v(c) = -6a(c) - u(c). Differentiate v(m) wrt m. -328m3 Find the third derivative of -56 - 21h + 23 - 4h2 + 124h*4 + 33 - 3h*5 + 44h wrt h. -180h2 + 2976h Let z = -36 + 57. Let a(s) = -17s2 + 4s + 36. Let y(m) = -171m2 + 42m + 360. Let d(b) = za(b) - 2y(b). Differentiate d(w) wrt w. -30w Let x(b) be the second derivative of -10/21b*7 + 0b*2 + 0b*5 + 0 + 0b*6 + 3b + 0b4 + 14/3b*3. What is the second derivative of x(z) wrt z? -400z*3 Let l(y) be the second derivative of 13y5/120 - y4/4 - 11y3/6 + 7y. Let s(t) be the second derivative of l(t). Find the first derivative of s(i) wrt i. 13 Let x(k) = 2k + 16. Let h be x(-8). Suppose 5j - 5 = 5l, h = -2j + 4j - 5l + 1. What is the first derivative of 4z4 + 2z*2 + 28 - 31 - jz*2 wrt z? 16z*3 Let k be (-3)/(-6)0/(-1). Suppose k = -3z + 15, -5n - 2z - z + 35 = 0. Differentiate -1 + 2 + 3t*n + 2 - 2 with respect to t. 12t3 Let v(q) = q2 + 9q + 10. Let o be v(-8). Suppose 2w - 6 = 4h, 2w + w + 4h = 9. What is the third derivative of -zo - z2 - wz*2 - 2z*6 wrt z? -240z*3 Let u(p) be the third derivative of -11p*5/60 + 131p*3/6 - 94p*2. Differentiate u(q) wrt q. -22q Suppose -24 = -0t - 2t + 2u, 5t - 20 = -5u. Suppose 0 = 5j - j - t. Find the third derivative of -6d6 - d6 - 44d*j + 47d*2 wrt d. -840d*3 Find the second derivative of 5841l*4 - 96 + l + 26 - 5837l*4 wrt l. 48l*2 Let f = 657 + -339. Find the second derivative of -5y*4 + 2y - f - 3y4 + 318 wrt y. -96y*2 What is the derivative of 174 - 53j*2 + 20j*2 + 23j*2 - 275j*2 wrt j? -570j Let a be ((-2)/(-4))/((-4)/(-24)). Let k(r) = 2r2 - 7r + 4. Let v be k(4). Find the second derivative of -am - v + 8 + m4 wrt m. 12m*2 Let b(i) be the first derivative of 7i4/2 - i3 + 28i2 + 28. Find the second derivative of b(r) wrt r. 84r - 6 Suppose 3b = -2q + 74, -2b + 40 = -q - 0q. Differentiate -3 + b - 2l2 + 4l*2 with respect to l. 4l Let m(t) be the second derivative of 0t2 + 0t*3 + 1/3t*4 + 0 + 0t*5 + 3/10t*6 - 9t. What is the third derivative of m(n) wrt n? 216n Suppose 17x - 12 = 14x. Differentiate 11m*4 + 12m*4 - xm*4 - 12 wrt m. 76m3 Let x(q) be the third derivative of q10/6300 + 13q6/720 + q5/60 + 3q*2. Let s(a) be the third derivative of x(a). Differentiate s(c) wrt c. 96c*3 Find the second derivative of -3 + 59d*3 + 70d - 148d + 64d wrt d. 354d Let a(m) = -213m - 55. Let x(u) = 215u + 57. Let v(s) = 2a(s) + 3x(s). What is the first derivative of v(b) wrt b? 219 Find the third derivative of -93m*2 + 85m*5 + 183m*2 + 20m - 89m2 wrt m. 5100m*2 Suppose 3j + 5j = 72. Find the second derivative of 0i - 4i + 11i*3 + 15i*3 - ji*3 wrt i. 102i Let r(s) = s4 - s2. Suppose -10j + 16j = 6. Let f(c) = -9c4 + 6c*2 + 4c. Let h(y) = jf(y) + 6r(y). Find the second derivative of h(a) wrt a. -36a2 Let t(u) = 2u*2 + 8u + 1339. Let m(f) = -f*2 - 4f - 670. Let p(a) = -5m(a) - 3t(a). Differentiate p(z) with respect to z. -2z - 4 Let s(x) be the third derivative of 47x*6/60 - 35x*3/2 + 2x*2 - 21. Find the first derivative of s(c) wrt c. 282c*2 Find the third derivative of -65s*2 - 53s*2 - 952s*3 + 928s*3 wrt s. -144 Suppose 4w = -x - 10, 5w - 5 + 43 = 3x. What is the second derivative of -12i3 + 5i - xi2 + 6i*2 wrt i? -72i What is the first derivative of 50 - 153 - 49k2 + 33k*2 + 32 - 170 + 4k wrt k? -32k + 4 Let s(q) = -185q*2 - q - 200. Let u(m) = -62m*2 - 67. Let n(z) = 2s(z) - 7u(z). What is the second derivative of n(r) wrt r? 128 Let k be (-2 - -2) + 2 + 3. What is the third derivative of -d2 - 2d*2 - 8d*k - 4d*5 + 0d*5 wrt d? -720d2 Let u(i) = i2 - 9i - 9. Let r be u(9). Let p = r - -14. What is the first derivative of po*3 + 31o*2 - 5 - 31o*2 wrt o? 15o*2 Let c(n) be the second derivative of -3n6/40 + n5/6 + 19n2 - 7n. Let q(h) be the first derivative of c(h). Find the third derivative of q(a) wrt a. -54 Let m(r) be the third derivative of 311r7/210 - r5/10 + r4/2 + r2 - 55. What is the third derivative of m(h) wrt h? 7464h Let d(x) be the first derivative of 54x4 - 340x - 256. Differentiate d(r) with respect to r. 648r2 Let n(s) be the third derivative of -139s*5/60 - 17s4/12 - s3/6 - s*2 + 16s. Find the second derivative of n(y) wrt y. -278 Let c(g) be the first derivative of 21g4 - 2g*3/3 - 76g + 131. Differentiate c(z) wrt z. 252z2 - 4z Let g(m) = m*2 - 2m - 1. Let r(v) = 14v2 - 15v - 117. Let y(k) = -5g(k) + r(k). What is the first derivative of y(s) wrt s? 18s - 5 Suppose 8p - 114 = 30. Find the first derivative of -pa*4 - a - 2 + a + 2a*4 wrt a. -64a3 Let t(b) be the second derivative of b9/2520 - b5/20 + b4/12 - 13b. Let m(r) be the third derivative of t(r). Differentiate m(n) wrt n. 24n*3 Let z(f) be the third derivative of -47f8/168 - f6/60 + f*4/12 - 13f*3 - 350f*2. What is the second derivative of z(r) wrt r? -1880r*3 - 12r What is the derivative of -35r2 - 5r*2 + 42r*2 + 14r + 347 + 72 wrt r? 4r + 14 Let x(z) be the second derivative of 3z*5/20 + 17z*4/24 - 7z*3/2 - 6z. Let b(t) be the second derivative of x(t). What is the derivative of b(j) wrt j? 18 Let b(o) = -2o4 + o3 - o2 - o - 1. Let j(t) = -7t*4 + 4t*3 + 3t*2 - 4t + 110. Let q(u) = 4b(u) - j(u). Find the first derivative of q(m) wrt m. -4m*3 - 14m What is the third derivative of 8h2 + 3h*4 + 50h*3 + 59h*3 - 18 - 3h*4 + 3h*4 - 7h*3 wrt h? 72h + 612 Let w(y) be the third derivative of y7/420 - y4/6 + 19y3/6 + 15y*2. Let u(q) be the first derivative of w(q). Differentiate u(s) with respect to s. 6s*2 Let r(q) be the first derivative of 2q*3/3 - 24q*2 - 110q + 82. Find the first derivative of r(a) wrt a. 4a - 48 Let u(i) be the second derivative of -5/3i*4 + 0 + 0i*5 - 7/6i*6 + 0i*2 + 10i + 0i3. What is the third derivative of u(h) wrt h? -840h Let y be 7/(182/48) - 6/(-39). Let c(m) = 4m + 14. Let k(u) = -7u - 28. Let h(z) = yk(z) + 5c(z). What is the first derivative of h(q) wrt q? 6 Find the third derivative of -24n5 + 23n*5 - 60n*3 + 28n*2 - 8n*3 wrt n. -60n*2 - 408 Let t be 3/(12/(-2))0. Suppose t = -2v + 4v. Differentiate -2g + 5 + 3g - 5g + vg wrt g. -4 Let z(a) be the third derivative of -11/60a6 - 5/12a*4 + 0a + 0 - 22a2 + 0a*3 + 0a*5. What is the second derivative of z(q) wrt q? -132q What is the first derivative of 123 + 5j4 - 17j - 3j + 5j + 5j wrt j? 20j*3 - 10 Let o(p) be the third derivative of 8p7/105 - p6/40 - 15p5/4 + 3p*2 + 41p. Find the third derivative of o(q) wrt q. 384q - 18 Let x(o) be the second derivative of o7/28 - o4/3 + 4o*3/3 - 11o. Let j(y) be the second derivative of x(y). Differentiate j(t) wrt t. 90t2 Let h(g) = -g3 - 4g*2 - 6g - 5. Let w be h(-3). Suppose 1 = -2v - n, -4n - 7 = wv - n. What is the derivative of 22 - 2k - 23 + vk + 11k*3 wrt k? 33k*2 Let a = -432 + 436. Let u(r) be the first derivative of 0r*5 + 0r*3 - 3 - 3/2r*2 - 1/2r*6 + 0r + 0r*a. What	{ "pile_set_name": "DM Mathematics" }
5) - sqrt(15)/sqrt(243)) - (sqrt(200)/(-1sqrt(8)))/(6sqrt(80)). -61sqrt(5)/72 + 3920 Simplify (-1(sqrt(20) + sqrt(220)/(sqrt(44)/sqrt(4)) - sqrt(20) - 3sqrt(45)4))*2. 5780 Simplify -51(4 + 3 + (sqrt(833) - (sqrt(833) + (0 + sqrt(833) + 3)2)) + (sqrt(833) - (-1 + sqrt(833)))4)-6. -24930 - 1260sqrt(17) Simplify (1((-1sqrt(252)-2 - sqrt(252) - sqrt(252))/sqrt(9) - (sqrt(224)/sqrt(64))/(-1sqrt(8)2 + sqrt(8)))5)*2. 175/16 Simplify (sqrt(405)-3)*24 + (sqrt(405) + sqrt(405) + -3sqrt(405) + -2)2 - (-2 + (1sqrt(125) + 2 + sqrt(125))*2 + -3). -4sqrt(5) + 14490 Simplify ((sqrt(448) + -2)-2-4)*22 + -1 + -4 + (sqrt(7) - (1 + sqrt(7) + 1) - sqrt(252)). -4102sqrt(7) + 57849 Simplify (21sqrt(91) - -4(5sqrt(91) - sqrt(91) - sqrt(91)))/(sqrt(567) + 21sqrt(567) + (sqrt(567) - (1sqrt(567)1 + sqrt(567))) + sqrt(567)). 14sqrt(13)/27 Simplify (-5(sqrt(170) - -3sqrt(170)) + sqrt(170) - sqrt(170) - (sqrt(170)3 - sqrt(170))3)/(sqrt(120)/((sqrt(72) - (sqrt(72) - 4sqrt(72)))/sqrt(6)))-4. 416sqrt(17) Simplify -2(0 + (sqrt(2) + -4 + sqrt(4)/sqrt(2) - (sqrt(40)/sqrt(4))/sqrt(5))*2 + (sqrt(96)/sqrt(3))/(-2sqrt(576))). -36 + 97sqrt(2)/6 Simplify sqrt(5) - sqrt(60)/sqrt(192) - (sqrt(15)-1)/sqrt(3) - (sqrt(225)/sqrt(5)-5)/(1sqrt(1089)). 97sqrt(5)/44 Simplify ((-1-1sqrt(252))/(-1sqrt(196)))/((sqrt(90) - (sqrt(90) + (sqrt(90) - 2sqrt(90))4))/((sqrt(10) + 1sqrt(10))4)). -2sqrt(7)/7 Simplify 4 + (-3 + ((sqrt(95)-42)/(sqrt(20) + sqrt(40)/sqrt(2)))2)-4. -288 Simplify -26(-4(sqrt(1872) + 2 + (sqrt(1872) - (sqrt(1872) + 2)) - (sqrt(1872) + (-1sqrt(1872) + sqrt(1872))5 + sqrt(1872)))-4)*2. -5750784 Simplify (-2sqrt(1134) + sqrt(14) - sqrt(70)/(sqrt(15)/sqrt(3)))/(5(sqrt(4)/sqrt(2) - sqrt(2)) + (sqrt(12)2)/sqrt(6)). -9sqrt(7) Simplify ((sqrt(16) + -1sqrt(1024) + sqrt(16) + sqrt(16))/(sqrt(968) - (1sqrt(968) - sqrt(968))))2 - sqrt(18)/(sqrt(36)2)-4. 50/121 + sqrt(2) Simplify 4(-3 + 3(-5(0 + sqrt(475) + -2sqrt(475))1)*2). 142488 Simplify 5(-5 + (2 + sqrt(1100) + 1)3). 20 + 150sqrt(11) Simplify 5 + (1 + ((1sqrt(80) + 1)5 - (sqrt(80) + 0)1-6))*2. 528sqrt(5) + 9721 Simplify (-2(-5(sqrt(171) - -3sqrt(171) - sqrt(171)) + sqrt(171) - sqrt(171))1)/((sqrt(900) - ((-3sqrt(900) - sqrt(900) - sqrt(900))-3 - sqrt(900)))-1). 3sqrt(19)/13 Simplify ((2(2(1sqrt(153) + -2) - 41sqrt(153)2) + -4)2)2. 3456sqrt(17) + 88704 Simplify ((sqrt(75)/(sqrt(5)5) - sqrt(15))-6)/(sqrt(35)/(sqrt(28)/sqrt(4)) + 1sqrt(405)) + -4. -4 + 12sqrt(3)/25 Simplify (-5(-3 + 1 + -2sqrt(500) + -1 + -3sqrt(500)-1))*2. -1500sqrt(5) + 12725 Simplify (sqrt(180)24 - -6(sqrt(180) + -1) - (-5 + (sqrt(245) - (sqrt(245) + -2 + sqrt(245) - sqrt(245))) + 2))2. -840sqrt(5) + 35305 Simplify sqrt(32)-4 + (sqrt(2) + -4)2-5 - -2(sqrt(2) + (sqrt(72)1)*2)-2. -378 + 20sqrt(2) Simplify 4(6((0 + sqrt(567) + -3)2 + sqrt(567) + sqrt(567)) - (((sqrt(28)6)/sqrt(4) + sqrt(7) - sqrt(7))2 + (5 + sqrt(7))2-4)). -704sqrt(7) + 13328 Simplify (2(-1sqrt(2112) + sqrt(2112))-1)/(-6(sqrt(147)-2 + -1sqrt(3)2)). 0 Simplify 3 + (((sqrt(637) - (sqrt(637) + -2) - sqrt(637))2 + 3 - sqrt(637))-5 - (-6(1 + 3 + sqrt(637) + sqrt(637) - sqrt(637)))2) + 2. -26723 - 1841sqrt(13) Simplify (-1 + sqrt(637))-4 + sqrt(637) + 4 - (sqrt(13) + 4(sqrt(13)5)2 - sqrt(65)/((sqrt(5) - sqrt(5)-1) + sqrt(5))). -1292 - 65sqrt(13)/3 Simplify (2 + 1 + sqrt(612) + sqrt(612) + 5)3 + ((-5 + sqrt(612) + -5)36)*2. -38844sqrt(17) + 230712 Simplify (sqrt(152) + (1sqrt(152) - sqrt(152))1)/(sqrt(56)/(sqrt(7)1)) - ((-3 + sqrt(304))2 - 3sqrt(1900))5. -1565 + 271sqrt(19) Simplify ((sqrt(68) + sqrt(68) + 1sqrt(68) + sqrt(68))-1 + ((sqrt(68) + sqrt(68)1)-3 - sqrt(68)))/((1sqrt(196) + sqrt(196))-6)3 + 2. 11sqrt(17)/28 + 2 Simplify (4 + (-6(sqrt(80) + sqrt(80) + sqrt(80)2 + 2) + ((sqrt(80) + 2 - sqrt(80)) + -4)-6 + 2)-1)*2. 384sqrt(5) + 46084 Simplify (sqrt(125) + sqrt(125) + -2 + -5)*2 + sqrt(125) + -2sqrt(125) + 5 - (5 + (sqrt(125)12 + 5)*2). -245sqrt(5) + 24 Simplify (sqrt(132) + (sqrt(132) + (sqrt(132)-2 - sqrt(132)))-6 + sqrt(132))/(2sqrt(192)) + (sqrt(11)2 - sqrt(11)) + -1 + (-5sqrt(88))/sqrt(8). -9sqrt(11)/4 - 1 Simplify ((-5(sqrt(140) - (sqrt(140)-2 - sqrt(140))))/(sqrt(12)/(2sqrt(3) + sqrt(3))))/(-1(sqrt(720) - (sqrt(720) + sqrt(720)-2) - sqrt(720))3). 5sqrt(7)/3 Simplify ((((-1sqrt(140) + sqrt(140))3)/(sqrt(4) - -6sqrt(36) - sqrt(4))2)/(((sqrt(250)-2)/sqrt(5))/sqrt(10) - -6sqrt(80)4))*2. 0 Simplify -2(6(sqrt(7)3)2 + (sqrt(308)/sqrt(11))2 - (-5 + 5sqrt(4032))). -822 + 240sqrt(7) Simplify ((sqrt(1331) + 1 + -2 - (0 + sqrt(1331) + -1 + sqrt(1331))*2) + -2((sqrt(1331) + 3)-4)2)-4. 8228sqrt(11) + 192824 Simplify 2 + ((sqrt(96)-1)/(sqrt(48)5) - 4((1 + sqrt(2))4 + -4)). -81sqrt(2)/5 + 2 Simplify 3 + (55-3sqrt(1536))/(sqrt(12) - -4(sqrt(84)/sqrt(7) - sqrt(12)) - (sqrt(12) + sqrt(120)/sqrt(40))). 3 + 1200sqrt(2) Simplify 5((sqrt(2057)1-6)*26 + (2sqrt(17)1 - (1 + sqrt(612) - sqrt(612)))*26). -120sqrt(17) + 2223630 Simplify (-6-1-3(-2sqrt(180)22 + -4))2. 124416sqrt(5) + 3737664 Simplify (((0 + sqrt(1331))*2-4 - (sqrt(1331) + 1-5sqrt(1331))) + 2)-5. -220sqrt(11) + 26610 Simplify (sqrt(91)16)/(sqrt(448)1 + sqrt(7)) + (5 + 0 + (sqrt(13) - sqrt(13)2) + sqrt(832) + 0)*2. 212sqrt(13)/3 + 662 Simplify 3 + 4 + (-2 + (sqrt(176)4)2 + sqrt(176) + (5 + sqrt(176))2-3)1. -116sqrt(11) + 2218 Simplify ((-3-1sqrt(88) - sqrt(88))/(sqrt(200)2 + sqrt(8)))2 + ((-4 + sqrt(11))1 - sqrt(77)/(sqrt(7)4)). -40/11 + 3sqrt(11)/4 Simplify (-1sqrt(1225) + sqrt(25) + 6-2sqrt(25))/(-4sqrt(5)1 - -2sqrt(500)). -9sqrt(5)/8 Simplify (4 + (-5(3 + (sqrt(243) + sqrt(243)1 - sqrt(243))) - ((sqrt(243)-1 - sqrt(243))-1 + -3)))2. 1008sqrt(3) + 11971 Simplify (-32sqrt(204)56)/((sqrt(1200) + sqrt(1200)-1 - sqrt(48))/(4sqrt(100))). 3600sqrt(17) Simplify (1 + (sqrt(19) - (sqrt(133)2 + sqrt(133))/sqrt(7)) + sqrt(76)-4 + -6(-4(sqrt(57)/sqrt(3) - sqrt(19)) - (sqrt(171) + -2)))2. -176sqrt(19) + 1337 Simplify 3 + 0 + -1sqrt(704) + (2sqrt(121)-2)/(sqrt(121)/(sqrt(22)/sqrt(2))) + 3. -12sqrt(11) + 6 Simplify 3 + (((sqrt(252) + sqrt(252) + 3sqrt(252)4 + sqrt(252))/sqrt(6))/((1sqrt(54) + sqrt(54))-2))*2. 223/16 Simplify (sqrt(7) + 0 + 4)4 + 5 + 0 + (sqrt(7) - (-1 + sqrt(7))2) + (-4 + sqrt(112) + 1 + -2 + 3)2. -9sqrt(7) + 129 Simplify (-3sqrt(10)-2)/(2sqrt(4)/sqrt(2)) + (4sqrt(5)-2 + (sqrt(5) + 1)-2)2 + 4. 43sqrt(5) + 508 Simplify (sqrt(384)-4 - ((sqrt(72)-4)/sqrt(12) - sqrt(6)))/(-1sqrt(2)-3 + -3sqrt(72)). 9sqrt(3)/5 Simplify (1(2 + -1 + sqrt(4400) - (-1 + sqrt(4400) + 1) - sqrt(4400)23-4))*2. 960sqrt(11) + 2534401 Simplify -1(((sqrt(6480)-4 - sqrt(6480)) + sqrt(6480))-1)/(sqrt(18)/((sqrt(128) + 4sqrt(128) - sqrt(128)) + sqrt(128))) + 1. -1920sqrt(5) + 1 Simplify ((sqrt(1053) + 0 + 1 - 2(sqrt(1053) - (0 + sqrt(1053)))) + ((sqrt(1053) + 1)1 - ((sqrt(1053) - (sqrt(1053) - 1sqrt(1053))) + 3)) + -2 + 3)*2 + -2. 1051 Simplify ((-4 + 6(2 + sqrt(200))6 + -2 + -4sqrt(200)-14)-4)2. 1098240sqrt(2) + 8722496 Simplify (-1(sqrt(119) + 6(sqrt(119)-1 + sqrt(119)))1)/(sqrt(7) + (sqrt(7) - sqrt(175)-1) + sqrt(567)-2). sqrt(17)/11 Simplify -3 + (5 + (2sqrt(4200)-1)/(sqrt(48)/(sqrt(8)14)))*2. -800sqrt(7) + 44822 Simplify 4 + 2 + 2 + sqrt(68) + 5 - ((sqrt(1377) + (sqrt(1377) + 1)-2 + -2)2)*2. -5559 - 286sqrt(17) Simplify (((sqrt(128) + sqrt(128)-1)2)/(4(sqrt(8) - -1sqrt(8))))/(-4sqrt(32)/(sqrt(64)-2 - sqrt(64)))-1. 0 Simplify (-5 + (sqrt(612) - (sqrt(612) + 2))-23)2 - (5(sqrt(68)-11 - sqrt(68))/(-1sqrt(36)))2. -1259/9 Simplify (sqrt(495)-4-6)/(3sqrt(5)3-2). -4sqrt(11) Simplify (-6(3sqrt(132) - sqrt(132))5)/((sqrt(288)/(sqrt(12)-4))/sqrt(2)). 240sqrt(11) Simplify -1 + ((-2-3(sqrt(112) + -1 - sqrt(112)) - (sqrt(112) - (4 + 1 + sqrt(112)))2) + 5)2. 80 Simplify -4((sqrt(2448) - (sqrt(2448)2-6)*2)1 - (sqrt(2448) + -2 + 2)*2-4) + 4. -48sqrt(17) + 1370884 Simplify ((5-5(sqrt(228)1 + sqrt(228) - sqrt(228))-4)/(-6(sqrt(12) + -3sqrt(12)) - 3sqrt(12)-1))	{ "pile_set_name": "DM Mathematics" }
Let d = -14 + 29. Calculate the remainder when l(m) is divided by d. 13 Suppose x + 2 = 4. Calculate the remainder when 3 is divided by x. 1 Let s(q) = -q3 + q + 4. Let v(m) = m2 - 7m - 6. What is the remainder when v(-5) is divided by s(-3)? 26 Suppose 6z - 12 = 4z. Suppose 0 = -j - 2j + 33. Calculate the remainder when j is divided by z. 5 Suppose a + 1 = 2h - 4a, 5h - 20 = -5a. Let z(u) = 2u3 - 5u*2 + u + 3. Let s be z(3). Let g = s + -8. Calculate the remainder when g is divided by h. 1 Let s(n) = n - 1. Let j be s(1). Suppose -3r + jr = -222. Suppose 12 = -4t, 4p - p - 2t - 81 = 0. What is the remainder when r is divided by p? 24 Let a(k) = 2k + 2. Let c = 0 + 2. Let s(j) = j3 + j2 + 17. Calculate the remainder when s(0) is divided by a(c). 5 Let m(t) = -t - 2. Let z be m(-6). Suppose -zi + 6i + 42 = 4k, 54 = 5k - i. Calculate the remainder when 2/(-8) + (-258)/(-8) is divided by k. 10 Suppose 0 = f - 7 - 32. Suppose -3t = -s - 31, -2t + 4s + 7 = -17. What is the remainder when f is divided by t? 9 Let q(g) = g*2 - g + 2. Let p be q(-5). Suppose -5h = -2f - 26, 2f + f = 4h - 25. Suppose hu - 12 = p. Calculate the remainder when u is divided by 7. 4 Let a = 60 + -40. What is the remainder when 198 is divided by a? 18 Let f = 56 - 53. What is the remainder when 12 is divided by f? 0 What is the remainder when (38 + -4)9/2 is divided by 39? 36 Let a = 11 + -7. Let s = 16 + a. Suppose s = 3m - 40. Calculate the remainder when m is divided by 7. 6 Let j = 90 + -43. Suppose 2f - f = -5k + 19, 3f = -5k + j. What is the remainder when 40 is divided by f? 12 Suppose 5y + 16 = 4m - 0y, -5m + 25 = -5y. What is the remainder when 24 is divided by m? 6 Let c = 73 + -43. Let p = 19 + -8. Calculate the remainder when c is divided by p. 8 Let y(s) = -s3 + 4s*2 - 4s + 2. Let d be y(2). Let h = 35 - 24. Calculate the remainder when 332/8 - 1/d is divided by h. 8 Let u(a) = 10a3 + 1. Let o be u(1). Let t(p) = -7p - 7p - p2 + o + p. Calculate the remainder when t(-12) is divided by 13. 10 Suppose -3g = -8g + 20, y - 3g + 2 = 0. Let j be 20/(2/191). Suppose 6h = h + j. What is the remainder when h is divided by y? 8 Let m = -203 + 212. Calculate the remainder when 54/3 - 2 - -1 is divided by m. 8 Let k(j) = j*2 + 9j + 1. Let y be k(-9). Let b(q) = -q*3 + 1. Let z be b(y). Suppose -2h + 4h - 18 = z. Calculate the remainder when h is divided by 5. 4 Let n(z) = -4z - 4. Let r(g) = g*2 - 10g + 28. What is the remainder when n(-6) is divided by r(7)? 6 Suppose -4d - 3l + 9 = -21, -2d + 26 = -4l. Suppose -5w + 136 = -w. Suppose w = 2z - 0. What is the remainder when z is divided by d? 8 Let f(n) = -2n2 + 14n - 7. Let j be f(6). Suppose -s - j = -4v, -4s + 0s - v = -14. Calculate the remainder when 4 is divided by s. 1 Let r = 2 + 1. Let a(w) = w2 + w - 1. Let h be a(2). Suppose -rb - 2b + 215 = ht, -5t = -3b + 105. What is the remainder when b is divided by 14? 12 Let n = 33 - 19. Let r(t) = t3 - t2 - 7t + 6. Suppose -4p - 2u + 22 = 0, 5p + 3u - 8u = 5. Calculate the remainder when r(p) is divided by n. 12 Calculate the remainder when ((-4)/(-18) - 49/(-63)) + 27 is divided by 6. 4 Let p(v) be the first derivative of v*3/3 + 4v - 2. What is the remainder when p(-5) is divided by 10? 9 Suppose -3d + 23 = 2d - x, -17 = -2d + 3x. Suppose 0y + 3y = 30. Calculate the remainder when y is divided by d. 2 Let p = 21 + -13. Let d(t) = -2t - 5. What is the remainder when p is divided by d(-4)? 2 Let p = -3 + 19. Let z(o) = o3 - o2 + 4o - 2. Let u be 90/25 + (-2)/(-5). What is the remainder when z(u) is divided by p? 14 Suppose 18 + 18 = 3s. Suppose 2j = 5z - 12 - 147, 2z - 4j - 54 = 0. Calculate the remainder when z is divided by s. 9 Let n(v) = v3 - 6v*2 - 6v + 4. Let f be n(7). Let s = -6 + f. Suppose sz - 2q = 64, -3z + q + 53 = 14. What is the remainder when 27 is divided by z? 13 Let y = 2 - -14. Suppose 5s - 4q + 13 = 116, 0 = s + 2q - 15. Let p = y + s. What is the remainder when p is divided by 12? 11 What is the remainder when 93/(-2)(-4)/3 is divided by 16? 14 Suppose 4x + 13 = n + 2x, 3n - 4x = 35. Calculate the remainder when 58 is divided by n. 4 Suppose 0 = -5k + 3k + 5i + 69, 5k - 2i - 120 = 0. Calculate the remainder when k is divided by 7. 1 Suppose 0 = -x - 2 - 1, -2j = 5x - 67. Suppose -15 = q - j. Let t = 24 + -15. What is the remainder when q is divided by t? 8 Suppose 6u - 13 = 3u + 5x, -4x + 4 = 0. What is the remainder when 9 is divided by u? 3 Suppose -11 = -3l + 13. Suppose 0 = o - 21 - l. What is the remainder when o is divided by 15? 14 Suppose 3q + 4u - 80 = 0, -4u + 0u = 4. Suppose 0c - 10 = -5c, 0 = -2t + 5c + 208. What is the remainder when t is divided by q? 25 Suppose -f + 6f + 5k = -790, 3f + 5k = -474. Let w = 21 + f. Calculate the remainder when 6/(-12) + w/(-2) is divided by 23. 22 Let z = -50 + 54. Calculate the remainder when 17 is divided by z. 1 Suppose 3l = 6l - 3j + 12, 2j = -3l - 17. Let n = 62 + -31. What is the remainder when n is divided by (-53)/l - (-4)/10? 9 Let c(r) = 23r2 - 5r + 2. Let g(o) = -15o2 + 3o - 1. Let w(j) = -5c(j) - 8g(j). Calculate the remainder when 77 is divided by w(2). 17 Suppose 6k - k - 5 = 0. Calculate the remainder when 3 is divided by (1/k)/(10/30). 0 Let x(g) = -2g*2 - 3g - 1. Let w be x(-2). Let a be ((-2)/w)/(6/153). Suppose 2o + a = 3o. What is the remainder when o is divided by 10? 7 Suppose -13 = -0z - z. Suppose 0 = 2g - 7g + 5, -2v - 3g = -z. What is the remainder when 4/(-12) - 52/(-3) is divided by v? 2 Suppose -2d - 14 = -140. What is the remainder when d is divided by 13? 11 Let k = 21 + 0. What is the remainder when 60 is divided by k? 18 Let r(c) = -2c3 + 2c*2 + c + 1. Let z be r(2). Calculate the remainder when 562/10 + (-4)/z is divided by 29. 28 Suppose -2u + 54 = u + 3m, 99 = 4u - 5m. What is the remainder when 81 is divided by u? 18 Let q(u) = u3 + 5u*2 - u. What is the remainder when 8 is divided by q(-5)? 3 Suppose b - 5 = -r, 5r + 3b = 4r + 15. Suppose r = 3z - 0z - 15. What is the remainder when 8 is divided by z? 3 Suppose -6f = -0f - 198. Calculate the remainder when f is divided by 9. 6 Let u(r) = r*3 - 9r*2 + 12r - 3. Let i be u(8). Let c = -21 + i. Let v(q) = q*2 - 6q - 4. What is the remainder when 23 is divided by v(c)? 11 Let t(a) = a*3 - 25a*2 + 25a - 8. What is the remainder when 94 is divided by t(24)? 14 Let g be ((-16)/(-10))/((-2)/(-60)). Suppose 27 = 2a + 5o, -2o - g = -3a - 7o. Let r = -1 - -13. Calculate the remainder when a is divided by r. 9 Let i be (-2 - -6) + (2 - 3). What is the remainder when 26 is divided by (12 - i)/(1 + 0)? 8 Suppose -21z = -23z + 72. Let o be (-60)/8(-4)/6. Suppose 0 = -og - z + 116. Calculate the remainder when 31 is divided by g. 15 Let j be (-2)/4(0 - -22). Let s = -9 - j. Suppose -sm + 157 = 5g, 5g = 5m + g - 442. Calculate the remainder when m is divided by 22. 20 Let u(q) = q*2 - q - 11. Let i be 5/2(-18)/(-5). Let n be u(i). Suppose -4c = 2o - 44, 3o + n = 7o - c. Calculate the remainder when o is divided by 6. 4 Let r = -11 + 35. Suppose s = v - 1 - 3, -12 = 5s + 3v. Let f = r + s. Calculate the remainder when f is divided by 11. 10 Let p(w) = -20w - 12. Calculate the remainder when p(-3) is divided by 10. 8 Let t = 18 - 4. Calculate the remainder when 40 is divided by t. 12 Suppose 0 = 5q - 2q + 4m - 19, -4q = -3m - 17. Let u be 160/6(-3)/(-2). Suppose y = qy - u. Calculate the remainder when y is divided by 6. 4 What is the remainder when 117 is divided by 28 + (2 - (-1 - -1))? 27 Suppose 3l + 0z - 17 = -2z, -3z = 2l - 18. What is the remainder when 48 is divided by l? 0 Let s = 2 - -3. Calculate the remainder when 13 is divided by s. 3 Let z(c) = -33c + 2. Calculate the remainder when z(-2) is divided by 14. 12 Suppose -4 = 3w + 4p, 0p - 5 = 5p. Suppose o + wo - 11 = 0. What is the remainder when 43 is divided by o? 10 Suppose g - 25 + 0 = 0. Let k = g - 14. What is the remainder when k is divided by (1 - 0)/(3/18)? 5 Suppose -51 = -4a + a. Let m = -5 - -9. Su	{ "pile_set_name": "DM Mathematics" }
ist the prime factors of 2138336. 2, 19, 3517 What are the prime factors of 236165? 5, 149, 317 List the prime factors of 15795180. 2, 3, 5, 87751 List the prime factors of 17374024. 2, 2171753 What are the prime factors of 4932080? 2, 5, 61651 What are the prime factors of 3070022? 2, 1535011 List the prime factors of 1154430. 2, 3, 5, 101, 127 What are the prime factors of 2548118? 2, 181, 7039 What are the prime factors of 282191? 7, 13, 443 What are the prime factors of 1718703? 3, 7, 27281 List the prime factors of 17593366. 2, 7, 947, 1327 List the prime factors of 3853. 3853 What are the prime factors of 517030? 2, 5, 149, 347 List the prime factors of 1454476. 2, 363619 List the prime factors of 3095058. 2, 3, 515843 List the prime factors of 224545. 5, 44909 What are the prime factors of 8187499? 19, 430921 What are the prime factors of 26218771? 26218771 What are the prime factors of 4267102? 2, 7, 17, 17929 List the prime factors of 214204. 2, 53551 List the prime factors of 3603558. 2, 3, 7, 17, 103 List the prime factors of 382231. 382231 List the prime factors of 24259931. 24259931 What are the prime factors of 1242696? 2, 3, 7, 13, 569 List the prime factors of 384698. 2, 23, 8363 What are the prime factors of 292480? 2, 5, 457 What are the prime factors of 20918? 2, 10459 List the prime factors of 1020342. 2, 3, 170057 List the prime factors of 27752816. 2, 7, 13, 389 What are the prime factors of 10225099? 43, 401, 593 What are the prime factors of 25850753? 37, 698669 What are the prime factors of 420375? 3, 5, 19, 59 List the prime factors of 91070. 2, 5, 7, 1301 List the prime factors of 136450. 2, 5, 2729 List the prime factors of 18034850. 2, 5, 107, 3371 What are the prime factors of 23151544? 2, 13, 31, 43, 167 List the prime factors of 1196535. 3, 5, 79769 What are the prime factors of 196176? 2, 3, 61, 67 List the prime factors of 3498387. 3, 37, 31517 What are the prime factors of 3436? 2, 859 List the prime factors of 1037422. 2, 53, 9787 List the prime factors of 210307. 17, 89, 139 List the prime factors of 544971. 3, 7, 25951 List the prime factors of 269887. 269887 List the prime factors of 436433. 607, 719 What are the prime factors of 195476? 2, 48869 What are the prime factors of 4455731? 7, 636533 What are the prime factors of 208113? 3, 69371 List the prime factors of 368391. 3, 19, 23, 281 List the prime factors of 2822230. 2, 5, 367, 769 What are the prime factors of 906141? 3, 41, 53, 139 List the prime factors of 1064624. 2, 11, 23, 263 What are the prime factors of 1782480? 2, 3, 5, 7, 1061 What are the prime factors of 697136? 2, 11, 17, 233 What are the prime factors of 1858454? 2, 13, 71479 List the prime factors of 1687212. 2, 3, 46867 What are the prime factors of 17313721? 439, 39439 What are the prime factors of 300047? 11, 27277 List the prime factors of 6894887. 6894887 List the prime factors of 3388637. 7, 484091 List the prime factors of 6408944. 2, 400559 What are the prime factors of 1746988? 2, 17, 23, 1117 What are the prime factors of 9295234? 2, 13, 357509 What are the prime factors of 44703? 3, 4967 What are the prime factors of 5202866? 2, 37, 70309 What are the prime factors of 25164? 2, 3, 233 What are the prime factors of 649809? 3, 41, 587 What are the prime factors of 1842261? 3, 61, 10067 List the prime factors of 7495878. 2, 3, 13, 17, 5653 List the prime factors of 20157345. 3, 5, 13, 34457 What are the prime factors of 7121323? 11, 61, 10613 List the prime factors of 2658091. 67, 97, 409 List the prime factors of 14437671. 3, 113, 42589 What are the prime factors of 1768833? 3, 11, 17, 1051 List the prime factors of 31607339. 2677, 11807 List the prime factors of 301678. 2, 13, 41, 283 List the prime factors of 17056. 2, 13, 41 List the prime factors of 2462925. 3, 5, 32839 What are the prime factors of 60073? 13, 4621 What are the prime factors of 210006? 2, 3, 3889 List the prime factors of 712277. 67, 10631 What are the prime factors of 137221? 7, 19603 List the prime factors of 906388. 2, 7, 32371 What are the prime factors of 14957822? 2, 11, 229, 2969 List the prime factors of 386115. 3, 5, 25741 What are the prime factors of 28341? 3, 47, 67 What are the prime factors of 7305674? 2, 23, 241, 659 What are the prime factors of 1905293? 13, 113, 1297 What are the prime factors of 529118? 2, 264559 What are the prime factors of 5670794? 2, 2835397 What are the prime factors of 944729? 944729 What are the prime factors of 23355254? 2, 13, 898279 List the prime factors of 3574264. 2, 163, 2741 List the prime factors of 220575. 3, 5, 17, 173 What are the prime factors of 595558? 2, 297779 What are the prime factors of 6241455? 3, 5, 11, 467 What are the prime factors of 12504716? 2, 7, 446597 What are the prime factors of 17919556? 2, 4479889 List the prime factors of 4249. 7, 607 What are the prime factors of 1753359? 3, 23, 25411 What are the prime factors of 29318395? 5, 5863679 List the prime factors of 14393007. 3, 67, 23869 List the prime factors of 13357625. 5, 106861 List the prime factors of 2815378. 2, 29, 48541 What are the prime factors of 2326820? 2, 5, 116341 List the prime factors of 2196970. 2, 5, 19, 31, 373 List the prime factors of 6975456. 2, 3, 72661 List the prime factors of 335137. 11, 30467 List the prime factors of 513675. 3, 5, 761 What are the prime factors of 10901770? 2, 5, 11, 23, 31, 139 List the prime factors of 1332099. 3, 103, 479 What are the prime factors of 12350655? 3, 5, 23, 11933 List the prime factors of 1300846. 2, 37, 17579 What are the prime factors of 23729625? 3, 5, 79, 89 What are the prime factors of 23274954? 2, 3, 43, 30071 List the prime factors of 118516. 2, 29629 What are the prime factors of 195898? 2, 41, 2389 List the prime factors of 2730292. 2, 29, 23537 What are the prime factors of 94043? 157, 599 List the prime factors of 391655. 5, 11, 7121 What are the prime factors of 1699245? 3, 5, 41, 307 List the prime factors of 298716. 2, 3, 11, 31, 73 List the prime factors of 9731496. 2, 3, 19, 21341 List the prime factors of 320874. 2, 3, 53479 List the prime factors of 905534. 2, 7, 71, 911 What are the prime factors of 311891? 31, 10061 List the prime factors of 680789. 19, 35831 What are the prime factors of 106537? 106537 List the prime factors of 193527. 3, 21503 List the prime factors of 2977503. 3, 173, 5737 What are the prime factors of 8924648? 2, 1115581 List the prime factors of 10768193. 19, 29, 19543 List the prime factors of 448930. 2, 5, 44893 List the prime factors of 177400. 2, 5, 887 What are the prime factors of 19642153? 37, 530869 What are the prime factors of 1101835? 5, 7, 31481 List the prime factors of 852397. 7, 13, 17, 19, 29 What are the prime factors of 16790601? 3, 2333, 2399 List the prime factors of 341742. 2, 3, 56957 What are the prime factors of 20333723? 1549, 13127 List the prime factors of 393769. 103, 3823 List the prime factors of 6994833. 3, 103, 22637 What are the prime factors of 1003399? 619, 1621 What are the prime factors of 855955? 5, 193, 887 List the prime factors of 4649698. 2, 797, 2917 What are the prime factors of 1398403? 17, 43, 1913 What are the prime factors of 25473? 3, 7, 1213 What are the prime factors of 7419343? 373, 19891 What are the prime factors of 538246? 2, 23, 11701 List the prime factors of 678777. 3, 11, 67, 307 List the prime factors of 10968663. 3, 97, 37693 List the prime factors of 1219562. 2, 609781 What are the prime factors of 2044244? 2, 511061 List the prime factors of 1994916. 2, 3, 7, 11, 17, 127 List the prime factors of 198762. 2, 3, 157, 211 What are the prime factors of 6386240? 2, 5, 7, 2851 List the prime factors of 8276946. 2, 3, 1379491 List the prime factors of 10613178. 2, 3, 41, 73, 197 List the prime factors of 772292. 2, 193073 What are the prime factors of 197230? 2, 5, 11, 163 List the prime factors of 888888. 2, 3, 7, 11, 13, 37 List the prime factors of 59935. 5, 11987 What are the prime factors of 8696641? 823, 10567 What are the prime factors of 167488? 2, 2617 List the prime factors of 10899204. 2, 3, 911, 997 What are the prime factors of 2029174? 2, 7, 144941 What are the prime factors of 3029671? 37, 81883 List t	{ "pile_set_name": "DM Mathematics" }
e closest to 0? (a) -0.13 (b) 2 (c) -0.2 (d) 0.5 a What is the nearest to 0 in 18, 1/5, -3, 4? 1/5 What is the nearest to -3/4 in 0.3, 1, -0.05, -10? -0.05 What is the nearest to -2/3 in 1/6, -27, -2/5? -2/5 Which is the closest to 1? (a) 5 (b) -2/11 (c) -2 b What is the closest to -0.2 in -0.1, 0.2, 0.3, -13? -0.1 Which is the closest to -2? (a) 5/4 (b) 1 (c) -3 (d) 3/7 c Which is the closest to 1? (a) 1 (b) 3 (c) 0.4 (d) 4 a Which is the closest to 1? (a) 3/2 (b) 2/3 (c) 5 (d) -13 b Which is the closest to 1? (a) -2 (b) 0.067 (c) 1 c What is the closest to 36 in -5, 0, 2, -4? 2 Which is the nearest to 1/3? (a) 1 (b) 0 (c) -1.9 b What is the closest to 18 in 12, -1, 2? 12 What is the nearest to 1/4 in -192, 0, -4? 0 What is the closest to 0.1 in 0.11, 0.5, 0.4? 0.11 What is the nearest to 1 in -1372, 2, 3? 2 What is the nearest to 0.2 in -88, -1/3, -0.3? -0.3 Which is the nearest to -8? (a) -1 (b) 1/5 (c) 4 (d) -2 d What is the nearest to -2/5 in -0.2, -0.02063, 4? -0.2 What is the closest to 0.1 in 2/23, 2, 0.1, -1/3? 0.1 What is the nearest to -17 in 2.5, 3/7, 5? 3/7 Which is the nearest to -1/4? (a) 1.7 (b) 0.07 (c) -0.2 (d) 2 c Which is the closest to 0.1? (a) -3 (b) 2/9 (c) 0 c What is the nearest to 0 in -0.02, -0.01, 2, -1/3? -0.01 What is the nearest to 0.1 in -2/7, 2/7, -3/7? 2/7 Which is the closest to 0.1? (a) 1/5 (b) 4 (c) 0.097 (d) 4/9 c Which is the closest to 0? (a) -3/2 (b) 0.1 (c) -5 (d) -1 b Which is the nearest to -1? (a) -2/9 (b) 3/7 (c) 292 a Which is the closest to -0.2? (a) 3 (b) 0.2 (c) -2/13 c Which is the nearest to -3? (a) 3/11 (b) -4 (c) 5 (d) -1/5 b Which is the closest to 6/13? (a) -1/7 (b) 3 (c) 2 a Which is the nearest to 0.06? (a) 0.1 (b) 4/3 (c) -1/10 a What is the nearest to -0.4 in 2/11, 3, 21/5? 2/11 Which is the closest to -0.1? (a) 3 (b) -4/3 (c) -2 (d) -14 b Which is the closest to -1/4? (a) -3 (b) 1.2 (c) 0.4 c What is the closest to -0.1 in 30, 2/9, 1/3, -0.4? -0.4 What is the nearest to -4 in 0.1, 0.6, -1/5? -1/5 What is the nearest to 1/4 in 5, -1, 1.34, -0.3? -0.3 Which is the closest to 4? (a) 4 (b) -0.1 (c) -5 (d) 0 a What is the closest to 0 in -6, 2, -0.4, 1? -0.4 What is the closest to -2.43 in 0.5, -0.02, -2, -5/3? -2 Which is the closest to -6? (a) -1 (b) -0.2 (c) -2 c What is the closest to -0.1 in -0.3, 1.8, 4/15? -0.3 What is the closest to 3 in 2, 1, 3? 3 What is the closest to -4 in -0.04, 2/13, 0? -0.04 Which is the closest to -89? (a) -0.4 (b) 3 (c) -10 c What is the nearest to -0.3 in -1/4, -0.8, 1/4? -1/4 What is the closest to 1/4 in -2/115, -2/19, -4? -2/115 What is the closest to -2/7 in -3, -2, -0.3, 3/53? -0.3 What is the nearest to 0.1 in 5, -44.5, -19? 5 What is the nearest to -0.3 in -5, -1, 5, 1? -1 What is the closest to 0.2 in -0.2, -2/17, -0.06, 2/9? 2/9 Which is the nearest to 0.1? (a) 0.19 (b) 4 (c) -27 (d) 8 a What is the closest to -3 in -0.04, 5, 1/2? -0.04 What is the closest to -1 in -0.4, 0.15, 0.2, -2? -0.4 Which is the closest to 0? (a) 0.035 (b) -4 (c) -0.21 (d) -2 a What is the closest to -1 in 1, 4, 6? 1 What is the nearest to -3/5 in -11, 1, 3/7, -1? -1 Which is the closest to -1/2? (a) -5 (b) -4 (c) 5 b What is the closest to -2 in -1, 0.5, -17? -1 What is the nearest to -1/9 in 0.03, -8, -3/7, 0.2? 0.03 What is the closest to 205 in -0.2, 19, 5? 19 Which is the closest to 2/7? (a) 0.3 (b) 5 (c) -0.034 (d) -5 a What is the nearest to 1 in 0.2, 1/2, -104? 1/2 What is the nearest to -1/3 in 0, 3, -2, 1.9? 0 What is the closest to 0.2 in -2/15, 1.3, 0.4, -2? 0.4 Which is the nearest to 3/19? (a) -0.5 (b) -2/21 (c) -2 b What is the closest to -2/3 in 6, 0, 4/7, -2/7? -2/7 What is the closest to 0 in -3, 23, -37? -3 What is the nearest to 0 in -2/5, 4, 22, 1? -2/5 What is the nearest to -1/3 in 4, 1, 5.3, -2/7? -2/7 Which is the closest to 15? (a) 3/4 (b) 6/19 (c) -4/3 a What is the nearest to -1481 in -4, 0.3, 1? -4 Which is the closest to 2? (a) -0.1 (b) -5 (c) 39 a What is the closest to -1 in 0.3, -7/2, 5? 0.3 Which is the closest to -0.1? (a) 1/5 (b) -0.5 (c) 0.61 a What is the closest to -0.1 in 1/6, -0.3, -4/7, -0.12? -0.12 What is the nearest to 0.11 in 0.2, 3/61, 1? 3/61 What is the closest to -0.1 in 2, 5, -1/3, 2/519? 2/519 Which is the closest to 0.2? (a) -20/13 (b) -4/3 (c) 2/23 c Which is the closest to 0? (a) 4 (b) -21 (c) -17/3 a Which is the nearest to -1? (a) 24 (b) 3 (c) -3/5 c Which is the closest to 51? (a) -0.7 (b) 2/3 (c) 0.1 b Which is the nearest to -1? (a) -1 (b) 0.11 (c) -1/6 a What is the nearest to 0.1 in 2/3, -1, 1/8? 1/8 What is the nearest to -2/3 in 0.05, 1, -0.5, 2? -0.5 Which is the closest to -1? (a) -3/8 (b) -22 (c) 3 a Which is the nearest to 1? (a) -1/3 (b) 0.2 (c) 4 b Which is the nearest to 1/5? (a) -16 (b) -5 (c) 9.9 b What is the nearest to 0.3 in -156, 1/8, 0.2? 0.2 Which is the nearest to -4? (a) -17 (b) 2/21 (c) 1.8 b Which is the nearest to 0.2? (a) 0 (b) 0.2 (c) -0.7 b What is the nearest to 2 in 9/2, -3/4, 0.5? 0.5 Which is the closest to 3? (a) 2 (b) -40 (c) -0.1 a Which is the nearest to 3/4? (a) 0.01 (b) -56 (c) 0.2 c What is the nearest to 1 in 0.055, -1, -3/2, -0.5? 0.055 What is the nearest to -0.1 in -2/5, 17/2, 0.8, 5? -2/5 Which is the nearest to 2? (a) -3 (b) -6 (c) -175/2 a What is the nearest to -39/4 in -5, 2, 4/7, 0.5? -5 What is the closest to 8 in 87, -0.04, -0.4? -0.04 What is the closest to -1 in -3, 2/7, 64? 2/7 Which is the closest to -0.6? (a) -6 (b) 2/9 (c) 4 (d) -1 d What is the nearest to 1/4 in 0, 3, 0.2, 5/4? 0.2 What is the closest to 1/3 in 0.5, -4, 2/7, 2? 2/7 What is the closest to 0.027 in -4, -1/2, 1/2? 1/2 What is the closest to 1/3 in 0.2, 925, -2/3? 0.2 Which is the closest to 0.1? (a) 1217 (b) 3 (c) 2 (d) 0.5 d What is the closest to -3 in 0.3, 2/13, -0.19, -2? -2 Which is the closest to -61? (a) -7 (b) 0.09 (c) -5 (d) 0.2 a Which is the nearest to -0.1? (a) 4/3 (b) 0.5 (c) 14 b Which is the nearest to -0.05? (a) -5 (b) -0.13 (c) 2 (d) 1/8 b What is the closest to -1/2 in -0.234, -0.7, 3? -0.7 What is the nearest to 0.2 in 5/6, 2/67, 5, -2? 2/67 Which is the closest to -0.03? (a) 5 (b) 0.1 (c) 5/3 (d) 2/3 b Which is the closest to -1? (a) -4/543 (b) 0.5 (c) -1/4 c Which is the closest to 3? (a) -75 (b) 2/3 (c) 0.5 (d) -5/4 b What is the closest to -5/6 in -3, -0.2, 1.5? -0.2 What is the closest to -2 in -1/6, 1/3, 0, -2? -2 What is the closest to 0.1 in 0.1, -0.5, 2, -4/21? 0.1 What is the nearest to -1/21 in 2, -4, -0.05, -2/7? -0.05 Which is the closest to 5/4? (a) -0.4 (b) 0.5 (c) 2/9 b Which is the nearest to 0? (a) -2 (b) 4 (c) 740 (d) -0.5 d What is the nearest to -0.01 in 1/4, -0.2, 5? -0.2 What is the closest to 0 in -1, 2/3, -6/7, -0.2? -0.2 What is the nearest to -0.1 in -4, -1, 35.5? -1 Which is the nearest to -1? (a) 0.2 (b) 0.1 (c) -0.5 c What is the nearest to -1/7 in -3/2, 1, -5/4, -2? -5/4 Which is the closest to 1? (a) 1 (b) 0.2 (c) 2 (d) -5.7 a Which is the closest to -16.1? (a) -2/31 (b) 0 (c) 0.4 (d) -3 d What is the nearest to -38 in -21, -3, 0.4? -21 Which is the closest to 0.1? (a) -0.09 (b) 2/11 (c) 3 (d) 5 b What is the nearest to -2/5 in 4, 38, -3, -3/2? -3/2 Which is the nearest to -5? (a) 4 (b) 0 (c) -9 c What is the closest to 1/2 in -1, 0.3, -2/9, -3? 0.3 What is the nearest to 0 in -188/5, -1, 0? 0 What is the nearest to -0.1 in -35, 0.1, 2, 9? 0.1 What is the nearest to 3 in 15, -2/41, -2? -2/41 Which is the nearest to 20? (a) 0.1 (b) -4 (c) -2/5 a What is the nearest to 0.1 in 6, -5, -1/2, -0.9? -1/2 Which is the closest to -1? (a) 5 (b) 2/3 (c) -3 (d) 56 b Which is the closest to 10? (a) 0.02 (b) -17 (c) 0.3 c Which is the closest to -1? (a) -0.011 (b) -3 (c) -0.1 c Which is the nearest to 0? (a) 4 (b) -175 (c) 2 (d) -1 d Which is the nearest to 1/4? (a) -5/3 (b) -0.91 (c) -0.4 c Which is the closest to 0.1? (a) 0.2 (b) -54 (c) -2/13 (d) -1/5 a What is the nearest to -1 in 2/5, 36/11, 4/7? 2/5 What is the nearest to 1 in 5, -1, 0.4, 5/11? 5/11 Which is the closest to -3? (a) 4 (b) 2 (c) -0.4 (d) 1 c What is the closes	{ "pile_set_name": "DM Mathematics" }
((w/(ww(6/5)))/(w/(ww(-5)/w)))(5/6)(w(4/3)(w/((w/((w/(w*5/w))/w))/w))/w)/((ww/(ww(-1/4)/ww))/w)(-1/42) assuming w is positive. w(-485/56) Simplify ((k*6kk/(k/(k/(k/k3)))k)/(k*(2/15)k(1/4)/k))/(k(-6)/(k*(1/11)/k)k/(k(((k(3/5)k)/k)/kk)/k)kk(2/9)k) assuming k is positive. k(27889/1980) Simplify ((p(-9)/p)/(p*(-1/3)pp))(-5/13)/((p(p/((pp(-1/2))/p))/p)(1/41)(pp(-4))/pp(-2/13)) assuming p is positive. p(27517/3198) Simplify ((((t*(1/10)t)/t)/(t*2t)(t(-1/3))(-2/127))(-3/29))(20/11) assuming t is positive. t(22058/40513) Simplify ((l(-6/5)ll)(-8/3)/(l/(ll(2/19)))(-11))(4/7) assuming l is positive. l(-536/285) Simplify m/(mm/(mm/((m*(-7)/m)/m)))(m/m*(-2/3))/m(mm(1/6)/mm)/m*(-4)(m*(-1/11)m/(m*(-7/3)m))(9/7) assuming m is positive. m(8647/462) Simplify ((p(-4/11)/p)3(p(-26))(11/3))31 assuming p is positive. p(-101711/33) Simplify ((nn/(nn/(n/n(-2/7)))n)/n)*(-45)n*6(n*1n)/n((nn*(5/2))/(nn*5nn))(-38) assuming n is positive. n(841/7) Simplify (n/n1)45/((n/n0)/nn*(-1/11)/n)(nn/n(-3/4)n(3/4))/(n/n(-5)n/n(7/3)) assuming n is positive. n(-5/66) Simplify (n/((nnnn*(2/3)n)/n)nn*(1/2)n)*(-15)(nnn/(n*(3/4)/nn)n4n)7 assuming n is positive. n(213/4) Simplify (n*(1/4)/((n((n/(n/(((n*(-1/7)/n)/n)/n)))/n)/n)/n)(n*(2/3)nn)(2/61))/((n(1/2)/n)10)(-3) assuming n is positive. n(-48779/5124) Simplify ((q2)5q*2qq/q(3/11))/((q/(qq/((q*(-2/3)q)/q)))(-19/5))(-11/5) assuming q is positive. q*(4564/165) Simplify ((v/(v/(vv*4vv)))/(v/(v/v(-8))))/((vv(-8))/v(-7))(v(-1/3)/v)42v*(2/9)/vv5 assuming v is positive. v(-331/9) Simplify ((j*(-2/9)j)/(j(jj*6jj)/j))(-41)(j*1j)*(34/7)j(-4)/(j4/j) assuming j is positive. j*(21409/63) Simplify (((vv0)(5/6)v(-3/10)/(v(2/9)/v))32)(11/4) assuming v is positive. v(5192/45) Simplify (z(-1/10)/(zz*(12/11)z))*(-50)((zz(-5)z)/zz(-2))/(z(1/4))(1/9) assuming z is positive. z(60793/396) Simplify ((w(-14)/w)/ww/w(1/22))(1/6)/(w7/w(1/2))(-38) assuming w is positive. w(32273/132) Simplify ((mmmmm*(2/3)m)31)(2/99)/(((m/(mm6)mm)/(m/(m8/m)))/(m(1/14)/((mm*(-6/11))/mm))) assuming m is positive. m*(4847/4158) Simplify ((aa12)(1/44)/(a(-1/13)/(a/(a(-5)a)a)))(-2/7) assuming a is positive. a(-3645/2002) Simplify (c(10/7)/c(-2/23)(cc/(c*2/c)c)(1/31))0 assuming c is positive. 1 Simplify (((iii/(i*3i)i)/iiii*(-8/9))/((ii(ii/(i/i*(-24)))/i)/(i/(i/((ii*(-1/4))/i))i)))(-8/3) assuming i is positive. i(-1646/27) Simplify ((r/(rr/r7)r*2)/((r/(((rr*(1/24)r)/r)/rrr))/r10))(-4/3) assuming r is positive. r(-457/18) Simplify (a1a)(2/29)(a/a*(-6))/(aa/(a*(2/3)/a))(aa(a*(-6)/a)/aaaaa(-2/5))(-49) assuming a is positive. a(74561/435) Simplify ((k(-1))(17/4)(k(k/k(-2/5))/k)(20/3))/(k/(k/k(4/9))k/(kk0)k(k(-1)k)(-8/5)) assuming k is positive. k(131/36) Simplify (z*(-3)zz3/zzz)(-1/54)/((z(-2/7)/z(-8))/(z1/(zz(-4)))) assuming z is positive. z(-709/189) Simplify p*(-1)p/p*(-3)((p/p*(-2))/p)/pp*(-2/9)p/(((p/(pp/((p(-6/11)/p)/pp)p))/p)/p)p*(-2/11)p*6(pp6)/p assuming p is positive. p(2192/99) Simplify ((m/(m(-2/3)/m))23(m(-2))(12/11))/((m(-3))29)(-23) assuming m is positive. m(-64081/33) Simplify ((g/g*(-2/9)g)/g)*6/(g/(g/(gg*(-1/5)g)))*(2/81)(g/g1)5(gg/(gg1))(2/153) assuming g is positive. g(328/45) Simplify ((ww*(-27)w5)/(w2ww/w*(-25)ww))(9/2) assuming w is positive. w(-234) Simplify o/(oo*(1/3)o)(((((oo/o*0)/o)/o)/oo)/oo)/oo(-2)/(o1/o)(o4o/(o/o5))/(o(-1)o(-3/7)) assuming o is positive. o(128/21) Simplify ((s(2/7))(2/9))(-6)/(((s/(s(sss*2s)/s))/s)*21/(ss*(-2)ss)(1/9)) assuming s is positive. s(6598/63) Simplify (k(-2)/(((k/(k(-7)/k))/kk)/k)(k1k)(-48))/(k(1/2)k(-2/7))(-22) assuming k is positive. k(-709/7) Simplify (((ttt/(t/t(-2)t))/(t(-16)/t))/(t(-13)t3))(-19) assuming t is positive. t(-494) Simplify (v5/(v(-5)/v))0/((vvv(-4))/(v(2/7)v)(v1)1) assuming v is positive. v(16/7) Simplify s22s*(-1/10)(s*(-4/7)s)/sss/s(-1/41) assuming s is positive. s(67023/2870) Simplify ((q/(q*(-1)q))*(-15/2)(qq(-9))/(q/q(-7)))/((qq1)(-33)/(q*(2/23)q4)) assuming q is positive. q(2143/46) Simplify ((n(nnn0n)/n)*(37/3)(n(1/3))(2/33))/(((n/(n/n(-4)))/n5)/((((n/n(-1/3))/n)/n)/(n/n2))) assuming n is positive. n*(4589/99) Simplify ((g/(g(g*(-3/8)g)/g)ggg(-1/2))/(g/g(-5/2)g(-2/19)))/((g(-7)gg(-7))/(g(1/3))(-5)) assuming g is positive. g(4475/456) Simplify (k/(k(2/3)/k))9/((k*(-1/11)/k)/(k/(kk*(-5))))((k(2/7))(2/13))(-16) assuming k is positive. k(17405/1001) Simplify ((tt23)/(tt/(tt(4/3)))t*(-4)t4/t)1 assuming t is positive. t(70/3) Simplify ((h(-1/2))(-26))(-7/6)/((((h1/h)/h)/h)(-4/13)(h/((hhh(1/11)h)/hh))/h(1/10)) assuming h is positive. h(-29153/2145) Simplify (t(-7/6)/t)12(t*(-10/7)/tt)18 assuming t is positive. t(-362/7) Simplify ((u(-7))22(u/u16)/u(12/7))(-34/5) assuming u is positive. u(8126/7) Simplify ((z1/((zz((z(zz/z(-5))/z)/z)/zz)/z))/(z*5z*(-2/3)z))/((z(-1/3)/z)44/(z*(-1/2)z0)) assuming z is positive. z(281/6) Simplify ((h1)(1/4)/((h*(-1/3)h)/h5))/((h/h(-2/19))/(hh(-1))h*3(h/h(-6))/h) assuming h is positive. h(-1259/228) Simplify (((h*(-2/25)h)/(h*4/hh))/(h/((h*(-5/13)h)/hh)h/(h(-13)/h)))(-3/4) assuming h is positive. h(18003/1300) Simplify ((i(-1/4)i)/i(-17)i(11/4)/(i/(i/i(-16/3))i))(-6/35) assuming i is positive. i(-149/35) Simplify (uu*(1/3)uu(2/13))/(u(1/4)uu)(12/5)(u(2/3))(-1/3)/((uu1u)/u)(-39) assuming u is positive. u(43796/585) Simplify ((b/(bb(3/4)))(-17))(-2/125)/((bb(-1/8))/b(-3)b(2/3)b/(b/(bb1)bbb)) assuming b is positive. b(-11237/3000) Simplify ((i/(i/i(-4)))/(i/i(-8)))(-2/11)((ii/((ii/(ii*(-3/7)))/i)i)/i(2/31))(2/27) assuming i is positive. i(164302/64449) Simplify (r(1/8)r/r(-2))/(r/(r/r0))(-6/13)((r(2/7))(3/4))(8/3) assuming r is positive. r(207/56) Simplify ((aa(-1)aaaa/a(-4/7))/(a6((a/(a/((a/(a*(2/49)/a))/a)))/a)/aa))(-38) assuming a is positive. a(2584/49) Simplify ((zz(-10/9))/((z/(zz/(z/(z/(zz/(zzz(-2/97)))))))/z)z(-30)/z(-32))(-40) assuming z is positive. z(-135080/873) Simplify ((ww/(ww(-40)))(-43)/((ww(4/5))/(w(1/47)w)))(-24/5) assuming w is positive. w(9947712/1175) Simplify (z(-2))12(z1)(8/9)((zz(-1))29)(-2/3) assuming z is positive. z(-208/9) Simplify ((ww*(-4/5)/w)/wwww(-7))/(w2)*(2/67)(((w*(-1)w)/w)40)28 assuming w is positive. w*(-377498/335) Simplify (((ff*(-8))/f)/(ff/(ff(f/(fff*(-7)ff))/f))(f/(f/(((f/(ff((f/f*9)/f)/f))/f)/f)f)f)(1/14))(-38) assuming f is positive. f171 Simplify ((j(5/2))(-16/5)/(jjj(-9)/jj)(-32))(-26) assuming j is positive. j6032 Simplify ((o/o(1/3)o)(-4/7)/((o(-4/11)o)/(oo(-2)o)))/(o(o(o/(o/o*(-4/7)))/o)/ooo(-6)o*(1/6)o/(o/o*(3/10))o) assuming o is positive. o(2906/1155) Simplify ((u/(u/(u(3/8)/u)))/u(-8/3))/(u40u/(u/u7)u) assuming u is positive. u*(-1103/24) Simplify (ff*3/ff4)(-37)/((f/(f*(-2)f))10)12 assuming f is positive. f(-499) Simplify (k3/(kk(2/5))(k*(-2/15)/k)/kk(-1))/((k(1/4))(3/13)/(k1/k)(-36)) assuming k is positive. k(-1241/780) Simplify (f(2/7)/f(2/7))*(-36)(f/(f/(((f/(ff0))/f)/f)))(-39)f*(-1)f/(f(ff*0)/ffff) assuming f is positive. f74 Simplify (s(-11/5)ss*(2/15)s/(ss(-6))s/(s/s19))(-3/28) assuming s is positive. s(-359/140) Simplify ((x(3/2)/((x*(-2/13)/xxxx)/x)(x/(x/(xx2/x)))/x(-11))7)(-5) assuming x is positive. x**(-12425/26) Si	{ "pile_set_name": "DM Mathematics" }
ctor of 858? True Does 30 divide 3788? False Does 62 divide 23214? False Is 3099 a multiple of 4? False Does 34 divide 1000? False Is 56658 a multiple of 266? True Is 24 a factor of 168? True Is 13 a factor of 10482? False Is 60603 a multiple of 11? False Is 12 a factor of 3127? False Does 31 divide 15577? False Is 643 a multiple of 68? False Is 907 a multiple of 23? False Is 91 a multiple of 11? False Is 33 a factor of 91897? False Is 650 a multiple of 45? False Is 41358 a multiple of 21? False Is 6 a factor of 50424? True Is 2 a factor of 614? True Is 14960 a multiple of 88? True Is 67111 a multiple of 26? False Is 65 a factor of 51597? False Is 9 a factor of 1089? True Does 31 divide 19480? False Is 19 a factor of 399? True Is 45 a factor of 10440? True Does 17 divide 4120? False Does 6 divide 6319? False Is 21 a factor of 1512? True Is 35 a factor of 85190? True Is 21 a factor of 1050? True Is 13226 a multiple of 101? False Does 17 divide 7349? False Does 10 divide 2504? False Is 21 a factor of 1796? False Is 35 a factor of 3080? True Is 27603 a multiple of 26? False Does 17 divide 2930? False Does 56 divide 19529? False Is 81 a multiple of 3? True Is 3795 a multiple of 55? True Does 19 divide 35361? False Is 22 a factor of 26752? True Does 52 divide 5564? True Does 165 divide 46860? True Is 168 a multiple of 8? True Is 13 a factor of 780? True Is 8418 a multiple of 11? False Is 26 a factor of 55139? False Is 44926 a multiple of 14? True Is 12 a factor of 7320? True Is 7 a factor of 301? True Does 36 divide 1141? False Is 13 a factor of 525? False Is 13 a factor of 1417? True Does 6 divide 34584? True Does 12 divide 13567? False Is 16 a factor of 2880? True Is 784 a multiple of 31? False Does 2 divide 9576? True Is 14808 a multiple of 12? True Is 114 a factor of 4104? True Does 10 divide 1919? False Is 10753 a multiple of 14? False Does 27 divide 10103? False Is 8 a factor of 4728? True Is 186 a factor of 72656? False Does 42 divide 756? True Is 30550 a multiple of 10? True Does 267 divide 25632? True Does 28 divide 1204? True Is 117 a factor of 2808? True Does 71 divide 1065? True Is 56189 a multiple of 98? False Does 51 divide 8005? False Is 28 a factor of 140? True Is 1540 a multiple of 7? True Does 4 divide 440? True Does 28 divide 672? True Does 16 divide 10613? False Is 479 a multiple of 11? False Is 145 even? False Is 104 a multiple of 4? True Is 1494 a multiple of 15? False Does 14 divide 185? False Does 8 divide 960? True Does 12 divide 14232? True Is 44780 a multiple of 172? False Is 74 a multiple of 37? True Is 37 a factor of 699? False Does 20 divide 1400? True Is 7045 a multiple of 11? False Is 1077 a multiple of 45? False Is 15799 a multiple of 61? True Does 10 divide 34850? True Is 2281 a multiple of 23? False Is 9 a factor of 10347? False Is 65 a factor of 130? True Is 6068 a multiple of 164? True Is 273 a multiple of 5? False Does 56 divide 1747? False Does 15 divide 27? False Does 29 divide 116? True Does 44 divide 8785? False Is 5 a factor of 8695? True Is 5809 a multiple of 5? False Is 4046 a multiple of 7? True Is 58487 a multiple of 41? False Does 19 divide 656? False Is 52 a factor of 5616? True Is 196 a multiple of 4? True Is 21 a factor of 6121? False Does 18 divide 198360? True Does 42 divide 6055? False Is 130 a factor of 32890? True Does 48 divide 5388? False Does 40 divide 6928? False Is 220 a multiple of 4? True Does 19 divide 361? True Is 8211 a multiple of 5? False Is 459 a multiple of 9? True Does 12 divide 3948? True Is 28 a factor of 2856? True Is 10220 a multiple of 35? True Is 121471 a multiple of 49? True Is 4 a factor of 31148? True Does 5 divide 525? True Is 1622 a multiple of 26? False Is 10545 a multiple of 37? True Is 2 a factor of 52? True Is 62 a factor of 51708? True Is 28 a factor of 2240? True Does 28 divide 143136? True Is 662 a multiple of 32? False Is 36 a factor of 24609? False Is 19 a factor of 26847? True Is 25 a factor of 7875? True Does 36 divide 10352? False Does 114 divide 3707? False Is 24 a factor of 4490? False Is 29767 a multiple of 39? False Does 62 divide 648? False Does 4 divide 353? False Is 38 a factor of 33884? False Does 7 divide 184? False Does 262 divide 9007? False Is 867 a multiple of 13? False Does 27 divide 519? False Does 8 divide 15296? True Is 16 a factor of 62844? False Does 8 divide 8? True Is 17677 a multiple of 42? False Is 199 a factor of 43390? False Is 41370 a multiple of 43? False Is 3650 a multiple of 2? True Is 6600 a multiple of 80? False Is 313 a multiple of 10? False Is 8 a factor of 982? False Is 13 a factor of 36127? True Is 58 a factor of 1979? False Is 57 a factor of 1140? True Does 34 divide 816? True Is 34 a factor of 1083? False Does 104 divide 1456? True Does 11 divide 15763? True Is 1599 a multiple of 74? False Does 19 divide 4085? True Is 156 a multiple of 26? True Is 857 a multiple of 59? False Is 7534 a multiple of 2? True Is 28 a factor of 4713? False Is 44 a factor of 26861? False Does 30 divide 920? False Does 6 divide 186? True Is 98 a factor of 2557? False Is 42 a multiple of 7? True Does 78 divide 15366? True Is 19 a factor of 42? False Is 49 a factor of 2842? True Is 32 a factor of 6315? False Does 8 divide 23132? False Is 16 a factor of 624? True Is 510 a multiple of 10? True Is 25 a factor of 750? True Is 11050 a multiple of 50? True Is 5 a factor of 32? False Is 4 a factor of 2709? False Is 5 a factor of 2368? False Is 19624 a multiple of 8? True Is 10 a factor of 73? False Is 17 a factor of 204? True Is 27 a factor of 378? True Does 49 divide 2387? False Does 20 divide 9060? True Is 570 a multiple of 15? True Is 108 a factor of 18630? False Is 250 a multiple of 14? False Is 25606 a multiple of 31? True Is 1060 a multiple of 20? True Does 8 divide 240? True Does 29 divide 1508? True Is 3208 a multiple of 14? False Is 39765 a multiple of 13? False Is 19 a factor of 475? True Is 7 a factor of 453? False Is 612 a multiple of 34? True Is 47619 a multiple of 99? True Does 18 divide 16775? False Does 20 divide 3238? False Is 8901 a multiple of 9? True Is 4 a factor of 1442? False Is 18 a factor of 6060? False Does 42 divide 1302? True Is 8 a factor of 5336? True Is 8116 a multiple of 18? False Is 6 a factor of 169? False Is 21 a factor of 564? False Is 288 a multiple of 32? True Is 162 a factor of 9516? False Does 3 divide 360? True Does 12 divide 5900? False Is 50 a factor of 5350? True Is 7 a factor of 37128? True Does 23 divide 1998? False Is 3 a factor of 307? False Does 15 divide 40? False Is 6 a factor of 42? True Does 16 divide 8988? False Does 3 divide 132? True Is 12450 a multiple of 30? True Is 12 a factor of 5196? True Does 12 divide 3684? True Does 8 divide 3474? False Is 25 a factor of 722? False Does 34 divide 534? False Is 124 a multiple of 124? True Does 15 divide 405? True Is 171 a factor of 19836? True Is 17 a factor of 2080? False Is 154 a factor of 5520? False Is 1652 a multiple of 14? True Is 8 a factor of 5612? False Is 26050 a multiple of 25? True Is 1296 a multiple of 16? True Does 323 divide 37570? False Is 1041 a multiple of 14? False Is 133 a factor of 140378? False Is 3984 a multiple of 31? False Is 114 a factor of 3405? False Is 1023 a multiple of 69? False Is 19687 a multiple of 16? False Does 26 divide 988? True Is 105 a factor of 3990? True Is 650 a multiple of 25? True Does 15 divide 29655? True Is 526 a multiple of 59? False Is 3509 a multiple of 7? False Is 2430 a multiple of 45? True Is 1846 a multiple of 13? True Does 69 divide 8241? False Is 1071 a multiple of 90? False Does 21 divide 22638? True Is 13 a factor of 165268? False Is 4414 a multiple of 67? False Does 26 divide 76303? False Is 12426 a multiple of 12? False Is 39 a multiple of 13? True Does 18 divide 2611? False Does 28 divide 4312? True Is 11587 a multiple of 40? False Is 2080 a multiple of 52? True Is 27 a factor of 138620? False Does 16 divide 156? False Does 46 divide 4554? True Is 833 a multiple of 2? False Is 21777 a multiple of 63? False Does 56 divide 1624? True Is 779 a multiple of 25? False Does 21 divide 1478? False Is 137 a factor of 9249? False Does 33 divide 759? True Does 4 divide 1672? True Does 19 divide 1411? Fal	{ "pile_set_name": "DM Mathematics" }
)/3). Let q be a(c). Suppose -3b - 3 = -48. Solve 5m = 4m + qr + b, 9 = -3r for m. 0 Suppose -2w + 8 = -5j, -5j - 889w = -890w + 4. Solve -5r - 15 = 5s, 6r + jr = 4s + 22 for s. -4 Let y be (-3 + 14 + 1)/(15/10). Solve 4w + 0n - 9 = -n, -2w - 4n + y = 0 for w. 2 Let y = -26 + 24. Let a(k) = k2 - 2k - 3. Let l be a(y). Suppose -lo + 1 = -19. Solve 3s = -u - u + 4, -2u - os + 2 = 0 for u. 5 Let g = 21770 - 21613. Solve 3h = 2t - 19, 154h - 9 = gh + 3t for h. -5 Suppose -40n - 11070 = 2130. Let s = -315 - n. Solve -4l + 3c + 20 = -c, 3l - s = c for l. 5 Let i(z) = 2z*3 + 18z*2 - 102z + 28. Let n be i(-13). Solve 2v + 3x = -4, 2x = -5v - nx - 3 for v. 1 Let j(u) = -u3 - 28u*2 - 28u - 23. Let r be ((-522)/(-58))/((-2)/6). Let f be j(r). Solve -4y = 2x + 12, 4x + 8 = -4y - f for x. 0 Suppose -456 = 16t + 2392. Let k = -167 - t. Solve -3o = -5m - k, -4m - 13 = -0o - o for m. -4 Let q = -3979 - -3992. Solve 4h - 17 = -v, 0 = -v + 4h - 7h + q for v. 1 Suppose 23o = -o - 2136. Let r = -89 - o. Solve u - 12 = -5k, -4u + 6 = -k - rk for k. 2 Let v(h) = h + 8. Let t be v(7). Suppose -16x + 134 = -tx. Suppose -6a + x = 32. Solve -3u + g - a = 0, -12 = 4u - 0u + 4g for u. -5 Suppose 5t = 5p, 3p + 153 - 161 = t. Let q = 15 + -4. Suppose -9 = -5s + q. Solve 9 = r - sg, 0 = -0r + pr + g + 15 for r. -3 Let o(w) = 36w2 + 10. Let z be o(-2). Suppose 174 = 4h + z. Solve 3c + 5l + 2 = 0, 6c + hl + 3 = 4c for c. 1 Let y = 1082 + -1078. Solve 3 = 3p + 6, -yp - 2 = l for l. 2 Suppose 5v + 4w + 70 - 122 = 0, -3v - w + 27 = 0. Solve q = 17p - 19p - 1, -4q - 4p - v = 0 for q. -3 Let h(p) = p*3 + 5p*2 - p + 1. Let q be ((-2)/(-2) + 2/(-4))-10. Let z be h(q). Suppose -u + 21 = zu. Solve 2r + 7 = uk, -2k - 7 = -r + 2r for k. -1 Suppose -g + 5p = 16, -p - 4 = 36g - 38g. Solve 31j = 30j - gt - 21, 4j + 19 = -3t for j. -1 Suppose -12h - 9 = -33 - 48. Solve -2z = -4w - 6, -7w + hw - 14 = -3z for w. 1 Suppose -3h = -3p - 12 - 6, -4h + 16 = 4p. Let l be (p - 0)/(1 + -2) - -1. Solve -3d = 3a + d + 1, 0 = 3a + 5d + l for a. 1 Let c = -138 - -162. Suppose 13h = 7h + c. Solve 5s - 4 = -2b, 0s = -2b - hs + 4 for b. 2 Let a(x) = x*3 - 7x*2 + 3x + 23. Suppose -q - u = -5, 3q - 118 = 3u - 97. Let l be a(q). Let r = 0 + 15. Solve -10 = j + 5m, r = 5j - 5m + l for j. 0 Let z = 24109 - 24107. Suppose -3p + 12 = p - 4g, 0 = -2g + 2. Solve 0 = -3i + ph + 9 + 2, 2i - 8 = zh for i. 5 Suppose 10 + 10 = 4h. Suppose -174c + 764 + 3682 = -78. Solve 3s + 12 = -3d, hd + c = 2s - 1 for s. 1 Let f(l) = -46l - 3770. Let x be f(-82). Solve 3v - xa = -7 + 23, 5v + 5 = -3a for v. 2 Let m(g) = -3g*2 - 15g - 56. Let s(y) = -2y2 - 7y - 29. Let z(b) = -3m(b) + 5s(b). Let x be z(11). Solve -2h = 3i + 11, 4h + 3 = i - x for i. -1 Let w = 5347 - 5331. Solve -2j - 2j + 4 = 4x, 2x + w = 4j for j. 3 Suppose -t = 2281 - 2287. Solve 6l - 5l = b + t, -5b + 3l - 24 = 0 for b. -3 Let h = 6 + -2. Let x(a) = a*2 - 2a - 5. Let d be x(h). Let j = -2261 + 2271. Solve 4 = 3q - 2y - 12, -dq - y + j = 0 for q. 4 Let z be 42/(-2)116/(-174). Solve -15p + 4u + 12 = -11p, 5p = 4u + z for p. 2 Let h be (10/4)/(1/(-4)2). Let r be -1 + (-6)/h - (-1)/(-5). Solve -4p - 9 = 3, -3w + p + 3 = r for w. 0 Let r(z) = z3 - z2 - 3z + 4. Let w be r(2). Let a = 86 + -49. Suppose -5x + a = -3. Solve -wb = -3k + 17, -4b = -5k - x + 39 for k. 3 Suppose t + 3b = -16, -4t - 2 = -b - 3. Let q be (28 - 30)(0 + t). Solve -2u = 3k, -qk = 2k for u. 0 Let t(f) = -3f + 53. Let w be t(19). Let x be (-9 - -8) + (-2)/2w. Solve j = 2d, -2j + x = -d - 0j for d. 1 Let v = -121 - -124. Suppose 2t + 3y = 4, -3t = -vy + 5y - 11. Solve -tm + 9 = 2h, 0m = 2m - h - 9 for m. 3 Let f be 0 - 5-11. Let k = -838 + 863. Suppose 5l - 21 = -3r, 26l - 4r = kl - 5. Solve fc + 3a - 8 = -0, 2c = -la + 5 for c. 1 Suppose 0 = 86a - 59a - 135. Solve 0 = 4q + 2h + 2, aq = 2h - h + 15 for q. 2 Let n = -239 - -230. Let y(p) = p*3 + 11p*2 + 18p + 6. Let s be y(n). Solve 2m = -4i - 14, -m + 2i - 13 = si for m. -1 Suppose -11s - 11 = 0, 5p - 7s + 6s = 26. Solve -pd + 12 = -q, -5q + 16d = 18d + 6 for q. -2 Let k = 558 + -786. Let y = k - -228. Solve y = 4r + c - 1, -r + 3c = -10 for r. 1 Suppose 5v + 30 = -11h + 16h, 3v = 4h - 24. Solve -5j + 9j = -2l + 8, v = l - 5j + 24 for l. -4 Let i = -4975 + 4980. Solve 42 = -in - 3c + 27, 5n = 4c + 20 for n. 0 Suppose -11f + 14f + 261 = 0. Let p = -84 - f. Suppose -12 + 57 = pl. Solve -3z - 4b + l = 0, 2z + 10 = 4z + 4b for z. 5 Suppose -o = 3, 0 = k - 4o - 11. Let p be 7 - 1(4 + k). Suppose -8w = -13w + 25. Solve 0 = -wy, 0d = 4d - 2y + p for d. -1 Let x = 3558 + -3553. Solve 0 = o - xt - 4 + 18, 0 = 5o - t - 2 for o. 1 Let j(c) = -377c - 8c2 - 14c*2 + 464c - 3c3 - 7 + 4c*3. Let v be j(5). Solve -vd + o - 6 = 0, -3d = -4d - 2o - 2 for d. -2 Let m = 79 + -73. Let g(s) = -3 - 3s + s2 - 5 + s3 + m. Let c be g(2). Solve -2i = -5u - 2 + c, 0 = 2u for i. -1 Let r = -49 - -409. Suppose -420 = 15x + r. Let j = x + 56. Solve 28 = -6v + v + 3a, -v - 9 = -ja for v. -5 Let i(a) = a3 + 17a*2 + 68a - 26. Let d be i(-8). Suppose -6f - 8 = -2f. Let b = f - -2. Solve -3m + 12 = -3r - 0m, -4r + 2m - d = b for r. 1 Suppose -72 = -8d + 3 + 13. Solve 4u - 4 = 5k, 5u + dk - 5 = 14k for u. 1 Let o(x) = -6x - 11 + 2x - 8x + 0x. Let k be o(-2). Let h(f) = -f + 17. Let d be h(k). Solve 11 = -5y - dz, z + 8 = 4y - 0z for y. 1 Let x be 2/20 + (-646)/(-340). Solve 65q - 4n = 63q + 14, 0 = -4q + xn + 4 for q. -1 Suppose 6t + 4 = 5l + 4t, 0 = 4l - 2t. Solve 7 = -3d + 3b + l, 0 = -d + 5b + 7 for d. -3 Let c(z) = 12z + 136. Let i(p) = p2 - 4p - 7. Let k be i(3). Let r be c(k). Solve 0 = -4x - r, x - 2x = -2v + 2 for v. -1 Suppose 0 = 4h + 2i - 2, 5i + 13 = 35h - 39h. Solve -2r = 5v + 8, -4r - hv - 21 = -5 for r. -4 Let y be -2(15/6)/(-5). Suppose o + 3i = -2o + 21, y = o - i. Suppose 11h + 13h - 87 = -5h. Solve -3g - 5a + ha = -23, oa - 11 = g for g. 5 Suppose 407 + 496 = 2v + w, -1371 = -3v + 4w. Let y = v - 448. Solve -ya - 16 = -0b - b, 4b + 3a + 28 = 0 for b. -4 Let o = 1269 + -1264. Solve 29g = 25g, -5 = s - og for s. -5 Suppose -f + 3f = 4. Suppose -19l = 2l + 436 - 520. Solve -3x - 12 - 1 = -q, -lq + fx = -22 for q. 4 Suppose 17i - 3x = 14i + 1716, 5i - x - 2856 = 0. Let w = i + -566. Solve wh + 3n - 8n + 10 = 0, 3h + 1 = 2n for h. 3 Suppose -f - 47 = -2r - 4f, 2r = 3f + 53. Let x = r + -17. Suppose 4m = -0w - 3w + x, 0 = -4m + 5w + 8. Solve 5l - d + 5 = d, 1 = 3l - md for l. -3 Let s(u) = u3 - 27u*2 + 23u - 621. Let h be s(27). Solve -3t - 5 = -w, 2w + hw - 10 = 0 for t. 0 Suppose -4j = 24 - 160. Let a(h) be the second derivative of -h*3/2 + 51h*2/2 - h - 113. Let f be a(11). Solve 3y + 1 = -2c - f, -3y - j = 5c for c. -5 Let x be (-1)/1(-10 - (-18 - -9)) + -1. Solve -2o - 16 = 2l, xo + 12 = -o - 2l for o. -4 Let q(v) = 4v2 + 222v + 1190. Let w be q(-6). Solve -4i - 5h = 19, h + w = i - 0h for i. -1 Let k = 6 - 4. Let b(c) = 3c*2 - 182c + 124. Let j be b(60). Solve jp - 4s + 18 = s, 2p - ks + 8 = 0 for p. -2 Suppose 0 = -2b + b - 3. Let s be (b - -2)/(2/(-10)). Let k(o) = 107o + 2035. Let r be k(-19). Solve -5c - sg + 5 = 0, 5c - rg - 33 = -0 for c. 5 Let b be (-352 - -352)/(1-4). Solve 3c + 14f - 11f - 6 = b, 14 = -3c + f for c. -3 Let i(m) = 146m*2 + 9m + 19. Let d be i(-2). Suppose -39j = 6j - d. Solve 4b + 2h - j = 1, -4b + 4h = -20 for b. 4 Let t = 1513 - 1488. Solve -5a + 4a - 20 = 4j, -a = 5j + t for a. 0 Suppose -4y + y + 4r = -44, -4y = -5r - 57. Suppose 0c + 2c - y = 0, -28 = -3a - 4c. Solve an + 2h = 10, -2n - 2h = n - 8 for n. 2 Let t = 335 - 479. Let a = t - -154. Solve -2m - 5u = a, 1 = -u - 1 for m. 0 Suppose -9r + 726 = 2r. Suppose 5w = 16 - r. Let y be 8/w((-18)/4 - -2). Solve d + 11 = 3l, 7 - y = l + d for l. 4 Suppose 642 = -4i + 38. Let k = -136 - i. Solve -	{ "pile_set_name": "DM Mathematics" }
(-33823/1638) Simplify (k(-2/9))(-41)/(k(4/3)k(-1/5)k) assuming k is positive. k(314/45) Simplify (a5)(-47)/(a(-6/5)a/((((aa*(1/4))/a)/a)/a)a) assuming a is positive. a(-4751/20) Simplify (n/((n/n(2/31))/n)nn(-9/4))39 assuming n is positive. n*(-897/124) Simplify (ss(2/5))50(s(-1/4))41 assuming s is positive. s(239/4) Simplify (o/((o/(o/(o/(o/(o(3/11)oo)))o))/o)o)(-32)(o/o(-3/2))(24/11) assuming o is positive. o(-548/11) Simplify (u9)*(-1/26)u*9u(1/17) assuming u is positive. u(3851/442) Simplify (xx/(xx*(-2/7))x)*(-24)(x/(xx11)x)/(((x/(((xx2)/x)/x))/xxxx)/x) assuming x is positive. x(-461/7) Simplify (u/u(-26)u/(((u/(u/u(-2/13))u)/uu)/u))/(uu*(4/3)(uu(-14/3))/u) assuming u is positive. u(1189/39) Simplify (w(w(ww*(-11)/w)/w)/w(ww/(w(-4/9)/w)w)/w)/(w*(-2)(ww/(w/(w/(w(-3/10)ww))w))/w) assuming w is positive. w*(-347/90) Simplify (qq*(6/11)qqq(1/6))/(q(-10))10 assuming q is positive. q(6845/66) Simplify (n*(-20)n(-31))(-28) assuming n is positive. n1428 Simplify (k(1/2)/(k/(k*(-1/7)/k)kkk)(k(2/5))(-45))16 assuming k is positive. k(-2536/7) Simplify ((y/(yy*(-16)/yyyy))/(y*2y))17 assuming y is positive. y187 Simplify (k(kk*(-5)kk)/k)(-1)(k((k(-1)k)/k)/k)(1/3) assuming k is positive. k(5/3) Simplify ((ppp*1p)(-37)/((p(-1)pp)/((p*(-6)/pp)/p)))47 assuming p is positive. p(-7332) Simplify o*(-1/2)/(o/(oo/(oo13)))(o/o*(3/5))/oo(-1/10) assuming o is positive. o(-71/5) Simplify ((ss10s/((ss(5/2))/s)s)(-30))(-2/139) assuming s is positive. s*(630/139) Simplify ((qq/(q12/q))(-4))(-49) assuming q is positive. q(-1764) Simplify ((t1)(-1/5)/(t*(2/15)t(-1/5)))(-1/4) assuming t is positive. t(1/30) Simplify ((m/((m(2/11)/mm)/m))/((m(1/3)m)/m)m0/(m/m8))(1/13) assuming m is positive. m(280/429) Simplify (z(-1/16))(-13/4)/(z(-2/5)/z)(-19) assuming z is positive. z(-8447/320) Simplify (((a/(a8/a))(-33/5))31)(-22/7) assuming a is positive. a(-135036/35) Simplify (u/(uu/u(-2/11)))(-2/75)/(u/(u/u*8)u(-1/15)) assuming u is positive. u(-2173/275) Simplify (((a(-6)/a)/a(-2/11))/(a(1/4)/((a/a(-1/2))/a)))(1/31) assuming a is positive. a(-289/1364) Simplify ((yy/(yy*6y)y(-2/3))/(y0((y/y*6y)/y)/y))(-5/6) assuming y is positive. y(5/9) Simplify (p*(-7)p)/(p/p*(-1/9))p/(pp(-1/9)/p)(((pp/(pp*3)p)/p)/p)/p assuming p is positive. p(-10) Simplify (((d/(d(-1/2)d))/dd(-1))/(d(-2/7)/(dd(2/9)d)))(-15) assuming d is positive. d(-635/42) Simplify (rr(-2)r)*(6/19)r(-9)/r(-1/16) assuming r is positive. r(-143/16) Simplify (o(-2/9)/o)*(-44)o*(-8)o(-1) assuming o is positive. o(403/9) Simplify h*(2/3)h/(hh/(h(h*(-3/14)/hhh)/hh)h)(h/(h/(h/(hh/h0))))(3/23) assuming h is positive. h(311/966) Simplify ((u/(u(-5)/u))/(u/(u/(u(-3/16)/u))u))/(u*(2/9)u/(u/(u/u*(-2/31)u))) assuming u is positive. u*(21877/4464) Simplify ss/((s/((s*(-24)ss)/s)s)/sss)s/(s/((s(ss/(sss(-23)))/s)/s))s*(14/11)(((s/(s*(15/4)s))/ss)/ss)/s assuming s is positive. s*(-241/44) Simplify (nn(-4/3))(-9/8)(n/n(-4))/n(3/7) assuming n is positive. n(277/56) Simplify (((w(-23)w)/w)/w(-13))(4/21) assuming w is positive. w*(-40/21) Simplify ((q/(qq*(-3/13))(q(q/q(3/4))/qq)/q)/(q*1q10))(1/17) assuming q is positive. q*(-547/884) Simplify c/(((c/((cc/c*(-2/5))/c))/c)/c)c/c*9c*(1/16)cc(2/13) assuming c is positive. c(-3519/1040) Simplify (s(-1/19))(11/4)/(((s((ss/(ss/(s/(sss*26ss))s))/s)/ss)/s)/(s/(sss/s(-1/18)s))) assuming s is positive. s*(19015/684) Simplify (((y/(y/(y(y/((yy(-2/5)/y)/y)y)/y)))/((yy/((y(2/9)y)/y))/y))46)(-17) assuming y is positive. y(-92276/45) Simplify (k(-6))11/(k/k(-10)kk*(1/35)k) assuming k is positive. k(-2766/35) Simplify (((k/k(-2/27))/k)/kk25)(-19/2) assuming k is positive. k(-6175/27) Simplify (z/z(-2/7))(3/11)(z(1/4))(3/20) assuming z is positive. z*(2391/6160) Simplify (yy*(-1/8)y/(((((((y*7y)/y)/y)/yy)/y)/y)/y))/((y(y5/y)/y)/y)(-50) assuming y is positive. y*(1191/8) Simplify ((j/(j/(jj/(j(j(6/11)/j)/jj)))j(-1/29))(-30))(7/6) assuming j is positive. j(-15855/319) Simplify ((z/((zz*(-2/29)z)/z))(7/3))(-1/7) assuming z is positive. z*(-2/87) Simplify ((mm/(m/(mmm(mm*(-18/7)m)/mmm)))/mm(-4/9))/(m(-1/20)m/(mm/(((m/m(-1/7))/m)/mmm)m)) assuming m is positive. m*(4903/1260) Simplify b/(bb*(4/3)bbb)b(2/5)(b*10/b)/(bb(-2/21)) assuming b is positive. b(437/105) Simplify (x/((x/(x/(xxx*(-3)x)))/x))*(-22)(x/(x*(-3/4)x))/xx(2/51)x assuming x is positive. x*(-8815/204) Simplify (((i(i*2/i)/ii)/(i/(ii/(ii/(ii/(i(2/13)/i))))))(-1))43 assuming i is positive. i(-2150/13) Simplify (((k(-2/5)/k)/k)(-29)(k((k7kk)/k)/k)/(kk(-4)))(-5) assuming k is positive. k(-403) Simplify (n(2/13)/(nnnn/(n/(nn/((n/(n/n*(-6/5)))/n)n))n))/(n(-1/3))(-2/71) assuming n is positive. n(-125374/13845) Simplify ((i/((i/(i(1/26)/i))/i))/(i(16/5)i))/(i*(3/17)/(ii27)) assuming i is positive. i(52293/2210) Simplify (y/(y/y5))0/(y*(2/3)y(2/15)) assuming y is positive. y(-4/5) Simplify ((l/(ll(-1/5)/l))/l)(1/3)(ll11ll)/(l/(l/l(-6))) assuming l is positive. l(301/15) Simplify q(-12/5)q*(7/6)/qqq27/q(-11) assuming q is positive. q(1103/30) Simplify ((b6b(-1/6))/(b8(b/(bbb(-8)b))/bb))46 assuming b is positive. b(-1127/3) Simplify ((vv*(-2)vv)/v)(1/11)(v(-3))(8/7) assuming v is positive. v(-24/7) Simplify b11/bb(-2/13)(b(-1/4))(1/11) assuming b is positive. b*(5619/572) Simplify (((rrr(rr/(rr(r(r/(r/r*12r))/r)/r)rrrr)/r)/(r/(rrr*(-4/11)r)))/(r0)(-12))(-1/42) assuming r is positive. r(13/231) Simplify ((i*(2/13)i(2/13))/(i(-2/7)i(-3/10)/ii))(-1/53) assuming i is positive. i(-813/48230) Simplify (b/b(-4/3))11/(bb(3/5)b)8 assuming b is positive. b(73/15) Simplify (q/q(-3))(-35)qq/(qqqq(-29))qqq((q/(q(-19/3)q))/q)/q assuming q is positive. q(-314/3) Simplify (c(-2/9)c)/cc*26(cc(8/3))/(cc16) assuming c is positive. c(112/9) Simplify (((s/s*(-10))/s)/s)/ss*(-9)/s(s/(s/s(-2)))/s(2/27) assuming s is positive. s(-110/27) Simplify x(-7)x9x(xxx/((x/(x(-15)/x))/x)xx)/x(-4/3) assuming x is positive. x(-20/3) Simplify (h(-1/5)h*(-4))/(hh(h/(hh*(1/2)h))/hh)(-2/11) assuming h is positive. h(-226/55) Simplify ((uu1)/(u(3/2)u)u*0u2/u)38 assuming u is positive. u*19 Simplify (r/(r/(rr/(r/(r/((r/(rr/r(-2)))/r))))))(1/14)/((rr/(r/(r*(-3)/rr)))/((r/(r/(rr3)))/r)) assuming r is positive. r(38/7) Simplify q4q*19qqq/(q*(1/22)q)(q/((q(qq/q(-17))/q)/q))/q assuming q is positive. q(153/22) Simplify ((w(-3/10)/w)/w)/(w/(w(-11)w))ww*(-10/3)ww8/w assuming w is positive. w(-229/30) Simplify ((s/((ss*(-7))/s))/s)/ss*(-1/18)/ss*(-1/5)s*13ss assuming s is positive. s(1777/90) Simplify ((i/(i/(i((iii*(-1/4))/ii)/i)))(-2/77)/(i/i(-5)i(2/7)))13 assuming i is positive. i(-12675/154) Simplify nn*(-13)nn/(nnn(-24))(n(-2/11))30 assuming n is positive. n(72/11) Simplify (((f/(f/(f/(((f/(f/f4f)f)/f)/f))))/f)/f*(-4/3)f/(f(ff*(-2/7)ff)/ff)f(-1))(1/10) assuming f is positive. f(-46/105) Simplify (n/n(-4/9))(1/25)/(n(2/9)/n9) assuming n is positive. n(1988/225) Simplify ((q(2/17)/(qq*(19/2)q))(-27/2))(1/7) assuming q is positive. q(10449/476) Simplify (p(-3))*(-28/3)(p(1/5))(-2/23) assuming p is positive. p(3218/115) Simplify (l(1/4)/(llll(1/4)/l))/(((ll/(l*(1/2)/l)l)/ll)/(((l/(l0/l))/l)/lll)) assuming l is positive. l(-7/2) Simplify ((k/k(6/11))/k)/(k/(k(3/7)/kk))k5k/k*(-2)k assuming k is positive. k*(607/77) Simplify (ii4)(-5)/(i/((i*(4/3)i)/i)iii*(	{ "pile_set_name": "DM Mathematics" }
ower of 1/3, to the nearest integer? 44 What is the sixth root of 396033 to the nearest integer? 9 What is the square root of 2455874 to the nearest integer? 1567 What is 4695662 to the power of 1/9, to the nearest integer? 6 What is the square root of 153362 to the nearest integer? 392 What is 302711 to the power of 1/2, to the nearest integer? 550 What is the cube root of 5424216 to the nearest integer? 176 What is the cube root of 311782 to the nearest integer? 68 What is the fifth root of 4300159 to the nearest integer? 21 What is the seventh root of 533191 to the nearest integer? 7 What is the tenth root of 1324329 to the nearest integer? 4 What is 891143 to the power of 1/10, to the nearest integer? 4 What is the square root of 2869400 to the nearest integer? 1694 What is 1409232 to the power of 1/3, to the nearest integer? 112 What is the square root of 3396993 to the nearest integer? 1843 What is the cube root of 2058633 to the nearest integer? 127 What is 68166 to the power of 1/8, to the nearest integer? 4 What is the eighth root of 5573695 to the nearest integer? 7 What is 41325 to the power of 1/3, to the nearest integer? 35 What is the seventh root of 1752241 to the nearest integer? 8 What is the seventh root of 3434177 to the nearest integer? 9 What is the square root of 4614187 to the nearest integer? 2148 What is 806833 to the power of 1/7, to the nearest integer? 7 What is the square root of 1931829 to the nearest integer? 1390 What is the square root of 209202 to the nearest integer? 457 What is the fourth root of 218538 to the nearest integer? 22 What is 18459040 to the power of 1/3, to the nearest integer? 264 What is the third root of 358934 to the nearest integer? 71 What is the seventh root of 11624473 to the nearest integer? 10 What is the seventh root of 5995727 to the nearest integer? 9 What is 149546 to the power of 1/3, to the nearest integer? 53 What is 15488161 to the power of 1/8, to the nearest integer? 8 What is the fifth root of 1137568 to the nearest integer? 16 What is the third root of 3991137 to the nearest integer? 159 What is 3763528 to the power of 1/2, to the nearest integer? 1940 What is the third root of 2266893 to the nearest integer? 131 What is 154183 to the power of 1/7, to the nearest integer? 6 What is the fourth root of 780251 to the nearest integer? 30 What is the third root of 404928 to the nearest integer? 74 What is the cube root of 98838 to the nearest integer? 46 What is 750540 to the power of 1/3, to the nearest integer? 91 What is 215647 to the power of 1/3, to the nearest integer? 60 What is the square root of 68694 to the nearest integer? 262 What is the cube root of 13416112 to the nearest integer? 238 What is the cube root of 457196 to the nearest integer? 77 What is the square root of 6245623 to the nearest integer? 2499 What is the seventh root of 335011 to the nearest integer? 6 What is 4466275 to the power of 1/2, to the nearest integer? 2113 What is the fifth root of 32662 to the nearest integer? 8 What is the cube root of 249161 to the nearest integer? 63 What is 1707284 to the power of 1/7, to the nearest integer? 8 What is the square root of 306541 to the nearest integer? 554 What is the square root of 5905205 to the nearest integer? 2430 What is the cube root of 1448817 to the nearest integer? 113 What is 61698 to the power of 1/2, to the nearest integer? 248 What is 1795135 to the power of 1/3, to the nearest integer? 122 What is 3331127 to the power of 1/3, to the nearest integer? 149 What is the tenth root of 2295639 to the nearest integer? 4 What is the cube root of 608081 to the nearest integer? 85 What is the tenth root of 7709364 to the nearest integer? 5 What is 86120 to the power of 1/5, to the nearest integer? 10 What is 25785555 to the power of 1/7, to the nearest integer? 11 What is 5168546 to the power of 1/5, to the nearest integer? 22 What is 988684 to the power of 1/2, to the nearest integer? 994 What is 294270 to the power of 1/2, to the nearest integer? 542 What is the tenth root of 13472649 to the nearest integer? 5 What is the square root of 1190310 to the nearest integer? 1091 What is the ninth root of 221980 to the nearest integer? 4 What is 3187676 to the power of 1/2, to the nearest integer? 1785 What is the fourth root of 363849 to the nearest integer? 25 What is the cube root of 308152 to the nearest integer? 68 What is the fifth root of 273352 to the nearest integer? 12 What is the square root of 13064893 to the nearest integer? 3615 What is the cube root of 307102 to the nearest integer? 67 What is 1906026 to the power of 1/6, to the nearest integer? 11 What is 4203595 to the power of 1/2, to the nearest integer? 2050 What is 322723 to the power of 1/4, to the nearest integer? 24 What is the fifth root of 825381 to the nearest integer? 15 What is the seventh root of 1459923 to the nearest integer? 8 What is 2615441 to the power of 1/5, to the nearest integer? 19 What is 14197417 to the power of 1/2, to the nearest integer? 3768 What is 2334454 to the power of 1/3, to the nearest integer? 133 What is 130183 to the power of 1/3, to the nearest integer? 51 What is the cube root of 682400 to the nearest integer? 88 What is the fourth root of 655712 to the nearest integer? 28 What is 1553215 to the power of 1/2, to the nearest integer? 1246 What is 1454198 to the power of 1/3, to the nearest integer? 113 What is the square root of 2161365 to the nearest integer? 1470 What is 55375 to the power of 1/2, to the nearest integer? 235 What is the square root of 1951291 to the nearest integer? 1397 What is the square root of 4815731 to the nearest integer? 2194 What is the cube root of 588164 to the nearest integer? 84 What is 7380664 to the power of 1/8, to the nearest integer? 7 What is the third root of 65064 to the nearest integer? 40 What is the square root of 254729 to the nearest integer? 505 What is 252932 to the power of 1/2, to the nearest integer? 503 What is the tenth root of 26687051 to the nearest integer? 6 What is 8230173 to the power of 1/3, to the nearest integer? 202 What is 9932306 to the power of 1/3, to the nearest integer? 215 What is 90382 to the power of 1/2, to the nearest integer? 301 What is 7789035 to the power of 1/2, to the nearest integer? 2791 What is the third root of 312360 to the nearest integer? 68 What is 621841 to the power of 1/2, to the nearest integer? 789 What is 7603 to the power of 1/8, to the nearest integer? 3 What is the cube root of 844111 to the nearest integer? 95 What is the ninth root of 1045245 to the nearest integer? 5 What is the eighth root of 5616031 to the nearest integer? 7 What is the square root of 1442902 to the nearest integer? 1201 What is the sixth root of 274360 to the nearest integer? 8 What is 362075 to the power of 1/3, to the nearest integer? 71 What is 74132 to the power of 1/8, to the nearest integer? 4 What is the third root of 844578 to the nearest integer? 95 What is the cube root of 90174 to the nearest integer? 45 What is the cube root of 5407235 to the nearest integer? 176 What is 707804 to the power of 1/5, to the nearest integer? 15 What is 19931160 to the power of 1/3, to the nearest integer? 271 What is the square root of 99625 to the nearest integer? 316 What is the square root of 219846 to the nearest integer? 469 What is the ninth root of 460707 to the nearest integer? 4 What is the third root of 634880 to the nearest integer? 86 What is 438224 to the power of 1/9, to the nearest integer? 4 What is 2810885 to the power of 1/2, to the nearest integer? 1677 What is the eighth root of 1046781 to the nearest integer? 6 What is 541421 to the power of 1/8, to the nearest integer? 5 What is the cube root of 193357 to the nearest integer? 58 What is 230935 to the power of 1/2, to the nearest integer? 481 What is 1277559 to the power of 1/3, to the nearest integer? 109 What is 48028 to the power of 1/3, to the nearest integer? 36 What is 365923 to the power of 1/4, to the nearest integer? 25 What is the cube root of 1819760 to the nearest integer? 122 What is the tenth root of 32440559 to the nearest integer? 6 What is the tenth root of 1596034 to the nearest integer? 4 What i	{ "pile_set_name": "DM Mathematics" }
7051 a prime number? False Is 6241238321 a composite number? False Is 1099289903 prime? True Is 99709451 composite? False Is 98538633427 prime? False Is 26584817551 a composite number? False Is 3394094771 prime? False Is 17780044531 a prime number? True Is 2778129881 prime? False Is 77307384461 composite? False Is 11662080082 prime? False Is 3958582399 a prime number? True Is 110797283741 a composite number? False Is 2153065063 a composite number? False Is 839854195 a composite number? True Is 11442736787 composite? True Is 25061250053 prime? False Is 2240728883 prime? True Is 130696373 composite? True Is 25521190087 a composite number? False Is 18592821629 prime? True Is 48941393803 a prime number? True Is 14355644561 prime? True Is 113682165533 a composite number? False Is 3178525289 a prime number? True Is 46540125559 composite? True Is 1852758959 a composite number? False Is 99338417 prime? True Is 3210222293 a composite number? True Is 877342183 composite? True Is 4835616689 composite? False Is 21611599531 prime? True Is 15997465951 composite? True Is 95566392307 a composite number? True Is 1529154169 a composite number? False Is 1889044063 a prime number? False Is 3679281077 prime? False Is 8072532469 prime? False Is 28138478582 a prime number? False Is 2596431283 prime? True Is 1365582499 a composite number? False Is 32104601447 a prime number? False Is 177383142247 composite? False Is 2108871521 composite? False Is 40607053777 prime? True Is 723589661 a prime number? False Is 2481374437 a prime number? False Is 519437591 composite? True Is 2476693721 composite? True Is 6305144969 composite? False Is 36876836561 composite? True Is 2273632421 composite? False Is 2142539369 composite? True Is 147745601 a composite number? False Is 766240051 a prime number? False Is 10366310005 a composite number? True Is 809793001 prime? True Is 458722811003 a prime number? True Is 15108769983 a composite number? True Is 40035707 prime? True Is 821911117 a prime number? True Is 80125187 composite? True Is 3125460859 prime? True Is 2270421169 prime? False Is 13364825543 prime? True Is 747449749 a composite number? True Is 128842476733 a composite number? True Is 3459441983 prime? False Is 20512869791 a prime number? True Is 5795526739 composite? True Is 1267489127 prime? True Is 1197025717 a prime number? True Is 11751049691 a prime number? True Is 6803901289 composite? True Is 242056249 a prime number? True Is 1323672011 a composite number? True Is 10696441831 a composite number? False Is 1260375797 prime? True Is 7193454601 a prime number? False Is 1418979083 a composite number? False Is 4057819921 a prime number? False Is 2761902613 prime? False Is 7971660259 a composite number? True Is 795237455 a prime number? False Is 52795898866 a prime number? False Is 625507079 a prime number? False Is 1254282059 a prime number? True Is 35094629 prime? False Is 1438325081 prime? True Is 665974657 composite? False Is 163912498307 composite? False Is 3406223567 a prime number? True Is 2095189 prime? True Is 2244546427 prime? True Is 22874601299 composite? True Is 2676911407 composite? False Is 2052147443 a prime number? True Is 30430016971 prime? True Is 801328447 a prime number? False Is 176156031049 a composite number? False Is 2455419466 composite? True Is 10996186291 composite? False Is 4855728389 composite? False Is 33288115541 composite? True Is 90208753963 a prime number? True Is 624684037 prime? True Is 139548736829 a prime number? False Is 3042571846 composite? True Is 82974169807 prime? True Is 228767019853 composite? False Is 5576907779 composite? False Is 142068601 composite? True Is 46991362667 composite? False Is 20795679617 prime? True Is 17505557687 a composite number? False Is 118703876831 a prime number? True Is 74963168173 prime? True Is 208401799 composite? False Is 4182543571 composite? True Is 131120641 composite? True Is 13633790179 composite? True Is 11685868919 prime? True Is 44665133449 a prime number? False Is 22108563439 prime? True Is 157012819331 a prime number? False Is 1963465177 a prime number? True Is 59741057102 composite? True Is 27012464887 prime? False Is 4446651493 prime? False Is 28395951673 a prime number? False Is 15932060659 a prime number? True Is 642817517 a prime number? False Is 250298105 a prime number? False Is 66671382791 a composite number? True Is 26210523751 composite? True Is 23413036561 a composite number? False Is 6262656133 prime? True Is 48120858827 a composite number? False Is 16249733833 a composite number? False Is 529592399 a composite number? True Is 9335082761 a prime number? False Is 14040166429 a prime number? True Is 15518269939 composite? True Is 6219411217 composite? True Is 11545574353 a prime number? False Is 2634383989 a composite number? False Is 9384236567 composite? False Is 1190888711 prime? True Is 10259297753 prime? False Is 171256159 a prime number? True Is 48671735159 prime? True Is 16300601461 a prime number? True Is 1101372959 prime? True Is 274787831 prime? False Is 20910262553 composite? False Is 1144685537 a composite number? True Is 347454773 a composite number? True Is 14990757653 prime? False Is 2661535451 composite? False Is 901007951 a composite number? True Is 17983292927 a composite number? False Is 18189768811 composite? False Is 7173461209 a prime number? True Is 777413489 prime? True Is 901487173 composite? False Is 2335641019 prime? False Is 79195175411 a composite number? True Is 63249397 a composite number? False Is 2583927499 composite? False Is 132887549 a composite number? False Is 81066101759 composite? False Is 11959498 composite? True Is 5644740819 a composite number? True Is 885849001 composite? True Is 5531099885 a prime number? False Is 11219757329 composite? True Is 18828304717 a prime number? True Is 1339284649 composite? False Is 6989568239 a prime number? False Is 142319347 composite? False Is 18204730601 a prime number? True Is 2125016417 composite? False Is 753891647 a composite number? False Is 109442051 prime? True Is 15972432809 prime? True Is 833621909 composite? True Is 53426417987 composite? False Is 4040515021 prime? False Is 146934127 composite? True Is 8137620301 a composite number? True Is 16579187971 prime? True Is 12420682517 composite? False Is 8464931 prime? False Is 30135083507 a composite number? True Is 33742806733 composite? False Is 42378547 a composite number? False Is 15904391093 a prime number? True Is 7431494753 a composite number? True Is 5249678333 composite? False Is 839540638 composite? True Is 283324087 prime? False Is 2067716821 a prime number? False Is 147370394761 composite? False Is 943194983 a prime number? False Is 394511779 a composite number? False Is 3298357631 prime? True Is 332558711 a composite number? True Is 158192799 a prime number? False Is 523558619 composite? False Is 30903919 composite? False Is 102187441 prime? True Is 42413457451 composite? True Is 2041554869 composite? False Is 5421697849 a prime number? False Is 150521029 a prime number? False Is 373312239 a prime number? False Is 1393907191 composite? True Is 104452992745 prime? False Is 1634348741 prime? False Is 2143790267 a prime number? True Is 7538147231 a prime number? True Is 4967535923 composite? True Is 2239089613 a prime number? False Is 10291422211 a composite number? True Is 210132977 a composite number? False Is 24213571883 a composite number? False Is 104792438573 a prime number? False Is 297333653 a composite number? False Is 585644273 a composite number? False Is 1873890901 a prime number? False Is 2852900303 composite? True Is 6480730471 a composite number? False Is 3876840091 a prime number? False Is 2953728373 a composite number? True Is 330714689 prime? False Is 83788064863 a composite number? False Is 5190701959 composite? True Is 2470948153 a composite number? False Is 1833038629 a prime number? True Is 13606610887 composite? False Is 50166217223 a prime number? False Is 10371263093 a prime number? True Is 56747477687 a prime number? True Is 10415006209 a composite number? True Is 1029973421 a prime number? False Is 3739529663 prime? True Is 453495641 a prime number? True Is 7816096493 composite? False Is 9402569849 prime? True	{ "pile_set_name": "DM Mathematics" }
- 4 = -6w. Calculate the least common multiple of (-42)/(-4) + w/2 and 11. 11 Suppose 3s + 2 = 4s. Let k be s(1 - 27/6). Let t(z) = z*2 + 11z + 6. Calculate the common denominator of 57/7 and t(k). 7 Let s = -1 - -1. Suppose 8 = 4w - 4m, -4m - 9 = -2w - 3. What is the common denominator of 91/6 and (s - w) + (-572)/(-72)? 18 What is the common denominator of 113/18 and (-6)/(-16) + (-17 - -17)? 72 Let n(t) = -t*2 - t + 2. Let o be n(0). Suppose oi + 2c = 36, i + 80 = 5i + 2c. Let v = i + -14. Calculate the lowest common multiple of v and 9. 72 Let g(n) = n3 + 10n*2 - n - 14. Let b be g(-10). Suppose u = 2w + 2u - 20, 3u = 5w - 50. Calculate the smallest common multiple of b(-4)/16 + 9 and w. 10 Let j = -10317 + 226935/22. Find the common denominator of j and 83/2. 22 What is the common denominator of 2/(-8) + (-2)/3 and (-5)/(-1) - (-1035)/(-126)? 84 Let d = -20 - -23. Suppose 0 = -do - 2o + 90. What is the smallest common multiple of o and 18? 18 Calculate the least common multiple of (4(-5)/30)/(2/(-12)) and 16. 16 Let x = -1079 + 5427/5. Calculate the common denominator of 6/7 and x. 35 Let a = -4 - -8. Calculate the smallest common multiple of 1 - a(-4)/8 and 2. 6 Let l = 10 - -8. What is the least common multiple of l and (10/3 - 2)/((-2)/(-9))? 18 Let m be (-332)/(-3)(-3)/(-2). Find the common denominator of (m/8)/((-81)/(-18)) and 107/12. 36 Calculate the least common multiple of (3 - 8)(-14)/5 and 2. 14 Let y = 4814/3 - 1620. Calculate the common denominator of y and 47/10. 30 Suppose 39z - 72 = 3z. Let l = 30 - 19. What is the lowest common multiple of z and l? 22 What is the smallest common multiple of (2/4)/(1/52) and 10? 130 Let f(m) = m*2 + 2m - 4. Let r be f(-4). Let h be (1/(-60))/((-706)/r). Let y = h - -238267/84720. Calculate the common denominator of 83/22 and y. 176 Suppose n - 3b = 15, -2n = -3n - 2b - 10. Let x = 50 - 9. Find the common denominator of 27/16 and 2 + (x/2 - n). 16 Let m(a) = -316a - 12 - 137a + 2a + 5. Let k be m(6). Let s = -27193/10 - k. What is the common denominator of s and 52/3? 30 Let l = -1/19 - -483/152. Let k be (-6)/(-27) + 34/9. Calculate the common denominator of (k - 2) + (-242)/12 and l. 24 Suppose 68 = -p - 4. What is the common denominator of 1/14 and ((-284)/p - 4)-67? 126 Suppose 2y + 4a + 2 + 0 = 0, 8 = 2y - a. Let b = 5 + 1. What is the least common multiple of b and y? 6 Let o = -7 - -15. Calculate the least common multiple of o and 13. 104 Let v(u) = -u3 - u2 + 6u + 8. Let m be v(-6). Let x = -15943/1122 - -982/51. What is the common denominator of (36/10)/(m/(-665)) and x? 44 Let t be 148/10 + (-6)/3. Let q = t - 644/55. Find the common denominator of q and -8/5. 55 Suppose 3m = 12, l + 3l - 4m = 0. Suppose -lg = -g - 48. What is the smallest common multiple of g and 9/3 + 33? 48 Let h = -10 - -22. Calculate the least common multiple of h and 26. 156 Suppose -2z = -i - 3, 7 = -2z + 5i - 10. Find the common denominator of (-10)/z88/(-50) and -17/5. 5 Let m = 24 - 12. Calculate the lowest common multiple of m and 20. 60 Let x = -2/62899 + -137937503/125798. Let n = -3/32108 + 175245479/160540. Let y = n + x. Calculate the common denominator of -71/4 and y. 20 Let c(y) = -y2 + 6y - 3. Let w be c(5). Let f(i) = -i*2 - i + 2. Let u be f(w). What is the least common multiple of 4 and u(-5 + (0 - -2))? 12 Let w = -10 + 18. Calculate the lowest common multiple of w and 18. 72 Suppose -7f - 7 = -8f. Let g(v) = -v + 2. What is the least common multiple of g(-7) and f? 63 Suppose 3s - 4l = 15, -2s + 4s = 5l + 17. Let t = s - -5. Suppose 3p - 4 = -p. What is the least common multiple of p and t? 6 Let p = 60 - 44. Calculate the least common multiple of 2 and p. 16 Let q(c) = c + 2. Let b be q(6). Let p be (0/b)/((-2)/2). Suppose 0 = -2u - 4n - pn + 20, 5n - 19 = -2u. What is the lowest common multiple of u and 14? 84 Let b = -101/2 + 833/18. What is the common denominator of 53/3 and b? 9 Suppose 8f = 4f + 84. What is the lowest common multiple of f and 6? 42 Suppose 3i + 661969 = -h + 37387, 2i - 3122927 = 5h. Let a = h - -6887888/11. Let k = a - 1590. Calculate the common denominator of k and -11. 11 Let t be (-6)/(-9)(1 - -59). Suppose t = -y + 5y. Calculate the lowest common multiple of y and 18. 90 Let v be (1 - 2 - -13)-1. Let r = v + 32. Calculate the least common multiple of r and (-1)/(((-5)/(-6))/(-5)). 60 Let g = 9487/33 + -288. Calculate the common denominator of 10/3 and g. 33 Let v = 4 + -7. Find the common denominator of -51/2 and ((-1)/(-12))/(v/870). 6 Let r = -392953/27 + 14552. What is the common denominator of r and 71/(-3) + 4/(-4)? 27 Let v(p) = 2p*2 - 5p - 2. Calculate the least common multiple of 1 and v(4). 10 Let q = -8593/186 - 28/93. Let y = -190/3 - q. What is the common denominator of y and 39/4? 12 Let s be (-1010)/(-1149)(-412)/32. Let k = s + -38/383. Calculate the common denominator of 93/16 and k. 48 Suppose -7k = -2k - 10, 5u - 17 = -k. Calculate the smallest common multiple of 4 and (2/(-3))/(u/(-9)). 4 Let w be 3/(-12)-14-2. Let g = w - -13. What is the least common multiple of 2 and g? 6 Let i = 23/35 + -3881/420. Find the common denominator of 1726/(-252) + 4/(-18) and i. 84 Suppose -3x = -6x + 72. Suppose 7i - x = 3i. What is the lowest common multiple of 10 and i? 30 Suppose -q = -3t + 8t - 18, -5t + 5q = 0. Suppose 0 = tf + f - 32. Calculate the least common multiple of f and 4. 8 Let d = 24/95 + 7267/190. Calculate the common denominator of d and (43/(-2))/(5 + -4). 2 Suppose 5n + 3 = 33. Calculate the least common multiple of n and (14 - 0) + -1 - 1. 12 Let x(r) = -r*2 + 7r - 1. What is the lowest common multiple of x(4) and 5? 55 Let a = -2996 + 59977/20. Calculate the common denominator of 97/28 and a. 140 Let j(c) = -8c2 + c3 - 18 + 4c*2 + 2c - 10c2. What is the least common multiple of 1 and j(14)? 10 Let p = 25 - 21. Calculate the lowest common multiple of p and (-2)/(-8) - (-142)/8. 36 Suppose 2j - 14 = 2i, -2j - 14 = -i + 6i. Suppose 0m - s = 4m - 42, -jm + 24 = -3s. What is the smallest common multiple of 16 and m? 80 Suppose 0 = 4u - 0u - 16860. Suppose 0 = 4w - u - 877. Let l = w - 11515/9. Find the common denominator of l and -27/5. 45 Let f = 18619/8 - 2340. Find the common denominator of f and 22/(-33) - 33/18. 8 Let j = 1/99 + 659/99. What is the common denominator of -97/10 and j? 30 Let f = 14 + -7. Calculate the smallest common multiple of 9 and f. 63 Let l(o) = -2o3 + 2o*2 - 2o + 3. Let d be l(2). Let v(h) = h + 10. Calculate the common denominator of 34/9 and v(d). 9 Let d = -245665/69372 + 26/1927. What is the common denominator of 49/8 and d? 72 Let x(r) = -r*3 - 14r*2 - 11r + 31. Suppose 3y + 6 = 5y. Calculate the least common multiple of 2y/(-4)-2 and x(-13). 15 Let w = -40 + 58. Calculate the smallest common multiple of w and 20. 180 Suppose 2 = -4g + 14. Suppose 0 = -2m + gm - 3t - 5, -3 = 3t. Calculate the lowest common multiple of 10 and m. 10 Calculate the smallest common multiple of ((-352)/(-40) - 0) + 2/10 and 10. 90 Let w(n) = n3 - 2n*2 + n. Let v be w(1). Suppose v = -3k + 7k - 40. What is the least common multiple of k and 2? 10 What is the smallest common multiple of (-26)/(-169) + 193/13 and 3? 15 Let s = -2120 - -29651/14. Find the common denominator of (-4)/(-14) + (-230)/28 and s. 14 Let t = -204076228284 + 7448374180742779/36498. Let d = -4/6083 - t. What is the common denominator of (-975)/36(-2)/15 and d? 18 Let h be (-19)/(-6) - 2/12. Let r be ((-3)/9)/(h/(-45)). Suppose 0 = 5m + u - 92, u = -3m + ru + 46. Calculate the smallest common multiple of 10 and m. 90 Let h = -89248427/1027257 - -48/31129. Let v = h - -262/3. What is the common denominator of v and 8/7? 77 Let p = -2515 - -25117/10. Find the common denominator of p and ((-245)/(-200))/(-7)-6. 20 Suppose 3s = 2s + 2. What is the smallest common multiple of 228/14 - s/7 and 10? 80 Suppose 8a = -0 + 48. Calculate the least common multiple of 51 and a. 102 Let i(w) = 3w. What is the lowest common multiple of 14 and i(4)? 84 Let b = 74 - 52. What is the least common multiple of ((-12)/(-14))	{ "pile_set_name": "DM Mathematics" }
-1 - a. What is the units digit of b(m)? 5 Suppose i + 20 = 2i. What is the tens digit of (i - 6) + (-1 - -2)? 1 Let h(v) = -v + 5. Let a be h(5). Suppose a = -5i - r + 73, 4i + 0r - 62 = -2r. What is the units digit of i? 4 Suppose 3n + 3 = 0, 3y - 4y - 3n = -129. What is the hundreds digit of y? 1 Let h(t) = t - 3. Let i be h(5). Let p be (-1)/(i/(-22)1). Let f = 17 - p. What is the units digit of f? 6 Let b = 5 - 6. What is the tens digit of b - (2 - 1 - 12)? 1 Let y be (2/5)/((-2)/10). Let i(d) = -d*2 - d + 17. Let a be i(-9). What is the tens digit of a/(-5) + 2/y? 1 Let k be 0(-2 - (-2 - 1)). Suppose k = -5f - 17 + 47. Let o(v) = -v2 + 8v - 5. What is the units digit of o(f)? 7 Let b be -4((-1)/4 + -1). Suppose 0j = -2j + bh + 64, 0 = -3j + h + 70. What is the units digit of j? 2 Let p(u) = 2u*2 + u. Let m be p(1). Suppose -w + 21 = 5a - 13, 0 = ma + 3w - 30. What is the units digit of a? 6 Let h(o) = o*3 + 10o*2 - 15o - 14. What is the tens digit of h(-11)? 3 Let a(c) = 2c - 10. What is the tens digit of a(14)? 1 Suppose 2d + 0w = w - 4, d = 4w + 12. Let s(p) = -6p3 - 1. Let i be s(1). Let t = d - i. What is the units digit of t? 3 Suppose 12w - 1000 - 488 = 0. What is the tens digit of w? 2 Let t = -5 + 1. Let y be (-5)/(-1)t/(-4). Suppose -b = -3b - 5c + 33, 0 = -yb + 5c + 30. What is the units digit of b? 9 Suppose 5u = 2d - 5d - 1, u + 5 = 0. What is the units digit of d/4 - (2 - 7)? 7 Suppose 11n = 15n - 48. What is the tens digit of n? 1 Suppose 0 = -6v - 265 + 1105. What is the hundreds digit of v? 1 Suppose 5k + 4a - 7 = 0, -k - 5a - 4 - 3 = 0. Suppose 0 = -ku - y + 4y + 42, 2u - y - 27 = 0. What is the units digit of u? 3 Suppose 3y + 4q - 3 = 0, -2y = y + 5q - 6. Suppose -3x + x + 4 = m, -3m - 2x = -20. Let c = m + y. What is the units digit of c? 5 Suppose 3u - 118 + 40 = 0. What is the units digit of u? 6 What is the tens digit of 255/1030/9? 8 Let y = 12 + -12. Suppose -4h - 15 = -j, y = -5j - 3h + 50 + 94. What is the tens digit of j? 2 Suppose 2a + 5p = 153 - 0, 3a = 4p + 195. What is the units digit of a? 9 Let x = -60 - -85. What is the units digit of x? 5 Let p = -68 - -105. What is the units digit of p? 7 Let l(g) = 21g*2 + 3g + 1. What is the units digit of l(-2)? 9 Let f(y) = 38y3 + y2 - y. Suppose z + 0z = -l - 2, 4l + 12 = 0. What is the units digit of f(z)? 8 Suppose -4n + 2j - 10 = 0, -3j + 15 = -2n + 3n. Let d(r) = -2r - r2 + r3 - 2r3 + r + 10. What is the units digit of d(n)? 0 Let m(a) = a2 - 4a - 3. What is the units digit of m(-2)? 9 Suppose -4p + d + 7 = 0, p = d - 2d + 3. Suppose 0u + 10 = 5u. Let o = u + p. What is the units digit of o? 4 Let r(d) = 4d - 3. Let z(q) = 2q - 2. Let b(l) = -3r(l) + 5z(l). What is the units digit of b(-1)? 1 Suppose 8f - 74 = 6f. What is the units digit of f? 7 Let x(k) = k3 + 7k*2 - 3. Let h be x(-7). Let c = h - -7. Suppose 0 = -3q + 3, -cq - 14 = -b - q. What is the units digit of b? 7 Suppose w + 3s + 3 = 5w, -w - 3s = -12. Suppose -q = -wq + 6. What is the units digit of q/(-12) - 50/(-8)? 6 Suppose -2j - 40 = -4i, 2j + i = -2i - 33. Let y be (-255)/(-9) - 4/(-6). Let z = j + y. What is the tens digit of z? 1 Suppose -12m = -948 - 708. What is the tens digit of m? 3 Let y = -33 + 88. Let i = y - 28. What is the tens digit of i? 2 Suppose 13 = p - 17. What is the tens digit of p? 3 Suppose -9k + 8k = -7. What is the units digit of k? 7 Suppose 5n + 15 = -f, -6f = 5n - 2f. What is the units digit of -2(-1)/(-4)n? 2 Let o(c) = -59c + 6. What is the tens digit of o(-3)? 8 Suppose j + 3i + 19 = -0i, -j - 2i = 15. Let f(q) = -q*3 - 8q*2 - 10q - 7. What is the tens digit of f(j)? 1 Let m be 20/(-8)22. Let x be (-4)/m - (-90)/25. Suppose r + 3r = x. What is the units digit of r? 1 Let h(p) = -p3 + 3p + 3. Let z be h(-2). Suppose -9 = -2g - z. What is the units digit of g? 2 Suppose -4p - 6 = -66. What is the units digit of (24/(-9))/((-10)/p)? 4 What is the tens digit of (-85)/(-3) + 1/(-3)? 2 Let g(z) = z*3 - 9z2 + z - 10. Let p be g(9). What is the units digit of (-105)/(-10) + p/(-2)? 1 Let d(x) = x3 - 4x2 + 4x - 1. Let g be d(3). Suppose -2n - 3r - 15 = 0, 8 = 5n - 3r - 7. Suppose ny = -gy + 26. What is the units digit of y? 3 Let i(y) = -y*2 + 5y. Let m be i(5). Suppose m = -2q - 2b, -5q + 3 + 21 = -b. What is the units digit of q? 4 Let m be -1 + (-3)/((-6)/22). Suppose -3u = -5u - 6. Let z = m + u. What is the units digit of z? 7 Suppose 2k - 2l = -10, k - 3l + 21 = 6. Suppose k = z + 4z - 130. What is the tens digit of z? 2 Let g be 2 - (-4)/(-10)5. Suppose 3x + 126 = 5r, g = -4r + 5x + 134 - 28. What is the units digit of r? 4 Let g = 31 - -5. What is the tens digit of g? 3 Suppose 25 = 2u + 3u. Let j(s) = s*3 - 6s*2 + 5s + 7. What is the units digit of j(u)? 7 Suppose 0 = -j - 20 + 24. Suppose 0 = g + 4h - 24, -3g + 0h + 112 = jh. What is the units digit of g? 4 Let z be (-1)/5 + 571/5. Suppose 5i = -2r + 227, 3i = i + 5r + z. What is the units digit of i? 7 Let d be (16/20)/(6/15). What is the units digit of 5d + (3 - 2)? 1 Suppose 549 = 16n - 299. What is the units digit of n? 3 Let m(a) = -a*3 + 7a*2 + 14a - 11. What is the tens digit of m(8)? 3 Let k(r) = -9 + 0 + r*2 + r - 2 - 1. Let g be k(0). Let i = 27 + g. What is the units digit of i? 5 Let g = -8 - -11. Let q(m) = m + 10. Let x be q(-9). Suppose 4a = -4, gk - 5a = -x + 21. What is the units digit of k? 5 Let q(z) = 16z - 2. Let p be q(-1). Let x = p + 35. What is the units digit of x? 7 Let r be (-5)/5 - (-5)/1. Let p = r - -17. What is the tens digit of p? 2 Let i = -8 - -4. Suppose -2 = -p, -3a + 0p + 20 = p. Let h = a + i. What is the units digit of h? 2 Let o = 53 - 22. Let a = o - 18. Suppose -n + 0 + 3 = -p, -a = p - 3n. What is the units digit of p? 2 Let k(m) = -m*3 - 3m*2 - 2m + 5. What is the tens digit of k(-4)? 2 Let c(n) = n*2 - 5n + 2. Let o(g) = g*2 - 6g + 3. Let i(w) = 3c(w) - 2o(w). Let f be i(2). Let b(a) = 3a2 + a + 2. What is the units digit of b(f)? 2 Let c(s) = -8 + 0s*2 + 5s - s*2 + 3s. Let k be c(6). Suppose -5m + 1 = -km. What is the units digit of m? 1 Let t(d) = 5d2 - 5d - 4. What is the units digit of t(-5)? 6 Let i(n) be the first derivative of -n*4/4 + 8n*3/3 + 11n + 5. What is the units digit of i(8)? 1 What is the units digit of 2 - (-4 + 6 + -4)? 4 What is the tens digit of (36/42)/6 - (-2966)/14? 1 Let j(i) be the third derivative of 0 + 7/24i4 - 1/60i*5 + 0i - 2i2 - i3. What is the units digit of j(5)? 4 Let p(i) = -i2 - 6i. Let j be p(-5). Suppose 2k - 17 = -0k + 5h, -jk + 52 = -3h. What is the units digit of k? 1 Let o(z) = z3 - 3z*2 - 5z + 5. Let s be (2 - 1)72/2. Suppose -12 = -3k, 5y - s = 4k - 8k. What is the units digit of o(y)? 1 Suppose 2a = a + 17. Suppose -2h + 0q - q + a = 0, 4q + 12 = 0. What is the tens digit of h? 1 Suppose -4 - 2 = -i. Suppose -5h = -4n - 100, ih - 2h - n = 69. What is the units digit of h? 6 Let j = -16 - -24. Suppose j = 3a - 4. What is the units digit of a? 4 Let n = 156 + -92. What is the units digit of n? 4 Let f be 2/(-3) - 3/9. Let t(p) = 19p2 + 1. What is the tens digit of t(f)? 2 Suppose 52 = -6a + 8a. What is the tens digit of a? 2 Let g = 26 + -46. Let s be (g/8)/((-2)/4). Suppose -i = -3 - s. What is the units digit of i? 8 Let u(o) = -o + 5. Suppose 3 = 2r - 5. What is the units digit of u(r)? 1 Let g = 40 - 27. Let i be (4/6)/((-1)/12). Let x = i + g. What is the units digit of x? 5 What is the units digit of 332/3(-21)/(-6)? 7 Let j be -3(4/6 - 1). Let l(h) = -31h*2 + 1. Let z be l(j). What is the units digit of -2 + z/(-5 + 2)? 8 Let v(h) = -4 - 2 - 5 + 4h. What is the tens digit of v(10)? 2 Let c be (-10)/3(-9)/6. Suppose -7 = cl + 43. What is the units digit of 0 + (-1 - -1) - l? 0 Suppose -4v - 5g + 3 = 0, 2v - g = g + 6. Suppose -vw + 7 + 3 = 0. What is the units digit of w? 5 Let o be -5 + 3 + 4/2. Suppose o = -r + 7 + 8. What is the tens digit of r? 1 Suppose 2 = j + o, -5*j - o + 14 + 4 = 0. What is the tens digit of ((-44)/16)/	{ "pile_set_name": "DM Mathematics" }
e first derivative of 91g3n*2 + 42g3 - g2 + gn2 wrt n. 182g*3n + 2gn What is the derivative of 333g3 - 571 wrt g? 999g*2 Find the second derivative of -2dv4 - 2982dv2 + 4d - 247v wrt v. -24dv2 - 5964d What is the second derivative of 211p4w*2x + p*2w*2x + 5pw*2x + 3px - 12p wrt p? 2532p*2w*2x + 2w2x What is the second derivative of 9o5 + 85o*3 - 14o - 136? 180o3 + 510o What is the second derivative of -6944p2 - 3p + 47? -13888 What is the first derivative of 1071mr + 1290m wrt r? 1071m What is the second derivative of 1160c3 + 107c wrt c? 6960c What is the second derivative of 216l*2x + l*2 - l - 253x wrt l? 432x + 2 What is the second derivative of 10198j*3 - 9982j wrt j? 61188j What is the second derivative of -20977i*3 - 68i + 1 wrt i? -125862i What is the first derivative of -2c*2l - c*2t + 444c2 - 47cl2t + 2cl*2 wrt l? -2c*2 - 94clt + 4cl Find the first derivative of -30d3 - 25d*2 - 10854. -90d*2 - 50d Find the third derivative of 4482x3 - 3x*2 - 90. 26892 What is the third derivative of -7qy5 + 88qy2 - qy + 2y6 + y3 wrt y? -420qy2 + 240y*3 + 6 What is the third derivative of -16a*6t + 524a3t + 11a2t - 40at wrt a? -1920a3t + 3144t Find the first derivative of -134j*3 + 3 wrt j. -402j*2 What is the first derivative of -7980o + 9303? -7980 What is the second derivative of f*2t*3 + 2f*2t - 2ft + 54t4 - 10 wrt t? 6f*2t + 648t2 What is the derivative of -5759y + 4557? -5759 Differentiate -2b2t*2v + 30btv2 - 151t*2v2 + t2 + t wrt b. -4bt*2v + 30tv*2 Find the second derivative of 37c*3 - 31c*2 + 1890c + 5. 222c - 62 Differentiate 18f*2h + fh - 4fm2 - 580hm2 with respect to f. 36fh + h - 4m*2 Find the second derivative of 9g*5 - 10g*2 - 461g wrt g. 180g3 - 20 Find the first derivative of -16nu2 - 30n - u*2 - 30 wrt u. -32nu - 2u What is the second derivative of 2pv*3 + 57pv + 2v*3 + 9v*2 - v wrt v? 12pv + 12v + 18 Find the third derivative of -42j6 + 4j5 + j2 - 308 wrt j. -5040j3 + 240j*2 What is the first derivative of -8ar2y*3 - ar*2y - 4ay + 7r2y3 + r2y wrt a? -8r*2y3 - r2y - 4y Find the first derivative of -89y2 + 77 wrt y. -178y What is the derivative of b*3v + 3b3 + 17bv - 333v + 1 wrt b? 3b2v + 9b2 + 17v Find the third derivative of -5fj*3 + 6fj2 + 231j5 + j3 - 397j wrt j. -30f + 13860j2 + 6 What is the first derivative of -2fg3h*2 - 46fh2 - 3f + 12g3h*2 + 17gh2 wrt f? -2g*3h*2 - 46h*2 - 3 Find the second derivative of 11q*5 + 18q*2 + 1196q wrt q. 220q3 + 36 Differentiate -248gr2 - 611r*2 with respect to g. -248r*2 Find the first derivative of 5371h*2 + 1676 wrt h. 10742h What is the second derivative of -3j3l3 - j3l + 23j*2l - 40l5 wrt l? -18j*3l - 800l3 Find the second derivative of -1494f*3l + 2fl - 88f wrt f. -8964fl What is the third derivative of 2n*5 - 126n*4 + 2440n*2 wrt n? 120n*2 - 3024n What is the third derivative of -ap6v - 2ap*3v + 2ap*2v - 12ap*2 + 2av + 1788p*3 wrt p? -120ap3v - 12av + 10728 What is the derivative of -21a3u*2 - 2347a*3 + 5au2 + 4u*2 wrt u? -42a*3u + 10au + 8u What is the third derivative of 18b*3h*3 + 54b*3u + b*2h*3u + b*2h - 15491u wrt b? 108h*3 + 324u What is the second derivative of 582u4 + u - 79? 6984u*2 Find the first derivative of -9v*4 - 5v*3 - 209. -36v*3 - 15v*2 Differentiate -18o*2t2 + o2 - ot2 + 7o - 1661t2 wrt o. -36ot2 + 2o - t*2 + 7 What is the third derivative of 72uz4 + uz*3 - 102u - 50z4 - z3 + 2z*2 + z - 1 wrt z? 1728uz + 6u - 1200z - 6 What is the third derivative of -430i*3 + 679i*2? -2580 Find the third derivative of 56p*6 - 2p*5 - 170p*2 wrt p. 6720p*3 - 120p*2 Find the second derivative of 124h*4 + 14h + 7 wrt h. 1488h2 Find the second derivative of -31409d*2 - 8239d wrt d. -62818 Find the second derivative of -519k2n*2s*2 - 79k*2s - 3ks*2 + k + 2n*2s*2 - 2ns wrt n. -1038k*2s*2 + 4s*2 What is the third derivative of 3162t*3 - 40t*2 + 44t? 18972 What is the derivative of 3c3x*2 - 36c*2 - 2cqx*3 + 5qx3 - 4qx + 8q wrt c? 9c2x*2 - 72c - 2qx*3 Find the first derivative of -2d*3j - 310d3 + 2d*2j*2 - 10d*2j wrt j. -2d3 + 4d*2j - 10d2 Differentiate uy*2 + 32uy - u - 2y*2 + 3y - 2519 with respect to y. 2uy + 32u - 4y + 3 Find the third derivative of 169z5 + 6z*2 + 1 wrt z. 10140z*2 What is the first derivative of -184m + 321 wrt m? -184 Differentiate -h*3v*2 - 6h*3 - 16h*2v*3 - 1 with respect to v. -2h*3v - 48h2v*2 Find the first derivative of -47f*2u + 51f2 wrt u. -47f*2 What is the derivative of 97l*2 + 185? 194l What is the third derivative of -1078p3 + 3p*2 - 948? -6468 What is the third derivative of -1131b4 - b3y + 2071b*2y + b wrt b? -27144b - 6y Differentiate mu4 - mu*3 + 18mu2 - 547m with respect to u. 4mu*3 - 3mu2 + 36mu Find the third derivative of 422z*3 - 456z*2. 2532 What is the third derivative of 17a*3pr2s - 30a3pr2 - 192a*2pr2s + 8a2p - 2a2s + 2ars wrt a? 102pr2s - 180pr*2 Find the second derivative of 3437n*3 + 18n + 42 wrt n. 20622n Differentiate 2y*4 - 8y*3 - 34y + 1506 wrt y. 8y3 - 24y*2 - 34 What is the third derivative of 25721o*3 + 661o*2 - 8o? 154326 Find the third derivative of -2832u3 + 44u*2 - 15u wrt u. -16992 What is the second derivative of d*5 + 31d*3 - 132d + 1? 20d3 + 186d What is the third derivative of -f*3k*5s*3 + 3f*3ks + f2k*2s*3 + 2fk2s3 + k4s3 + 7s wrt k? -60f3k*2s*3 + 24ks3 Find the second derivative of -8l*2y*2 + 2l*2y - 4ly*2 + 4y*2 - 5 wrt l. -16y*2 + 4y Find the third derivative of -2x5 - 1040x*4 + 38x*2 + 103. -120x*2 - 24960x Find the second derivative of -7314s2 - 179s - 7. -14628 What is the third derivative of 142k3 + 14k*2 - 1? 852 Find the second derivative of 318p*5 - 262p. 6360p3 What is the second derivative of 2a*2bw - 65a*2b + 3a2w + abw + 3ab + 2aw + 107w wrt a? 4bw - 130b + 6w What is the third derivative of -33699x*3 + 26855x*2? -202194 Find the third derivative of -150f*4 - 142f*2 wrt f. -3600f What is the derivative of -7a3 - 42a*2 + 16004 wrt a? -21a*2 - 84a Differentiate -894a3 + 932. -2682a*2 What is the third derivative of -2l*5 - 125l*4 - 421l*2 wrt l? -120l*2 - 3000l Find the second derivative of 5845a5 + 18a + 75. 116900a3 Find the first derivative of 9106d + 24829. 9106 What is the third derivative of -360ct*2v*3 - ct*2v*2 + ct*2 + 480ctv*2 + cv3 - t2v3 wrt v? -2160ct2 + 6c - 6t2 Differentiate -2m*4 - 25m*2 - 50m + 1916 wrt m. -8m3 - 50m - 50 What is the third derivative of -5b6 + 71b*5u*2 + 259b*2u + bu2 wrt b? -600b*3 + 4260b*2u*2 Find the second derivative of 4im3w*2 + im*2w*3 + imw2 - 2m*3 + 8mw3 + 15m wrt m. 24imw2 + 2iw3 - 12m What is the derivative of 4745z4 - 6577? 18980z*3 Differentiate -89n*2 - 125. -178n Find the third derivative of -n*2o*5 - 20n*2 + n + 1854o5 + o2 wrt o. -60n2o*2 + 111240o*2 What is the third derivative of 13012o*3 + 5o*2 - 2o + 149 wrt o? 78072 Find the second derivative of 662b3z*3 - 5b*3z + 2b2z - 11b wrt z. 3972b*3z What is the second derivative of -56a2c*3l*2 + 11a*2c*3 + 2ac3l + 3ac*3 + 4c*2l*2 + 2cl2 wrt a? -112c*3l*2 + 22c*3 What is the third derivative of -158a*3hk + 2a*3h + 5a2k + ahk + 2ah + 5a wrt a? -948hk + 12h Find the second derivative of 1387k2v*3 + kv*3 + 10kv2 + v3 wrt k. 2774v*3 What is the second derivative of -331h*2s*4 + 16h*2s	{ "pile_set_name": "DM Mathematics" }
u be (-3 - 0) + (-12)/(-2). Calculate the common denominator of -34/9 and -5 + u + (-66)/(-5). 45 Suppose -60 = -13u + u. Calculate the lowest common multiple of u and 11. 55 Let b be ((-7394)/(-7))/(99/21). Let j = -661/3 + b. Find the common denominator of j and 4/14 - 2325/126. 66 Suppose -7w + 3w - 14 = -5f, f + 2w = 0. Suppose 4y + 8 = -5c - 2, fc = -y - 1. Calculate the lowest common multiple of ((-28)/(-3))/(10/15) and c. 14 Let a(g) = 2 - 2g2 + 3 - 4 + 9g*3. Suppose 14 = x - 5w, -3x + 6 = 5w + 4. Calculate the least common multiple of a(1) and x. 8 Let i = 1125852030/889 - 2532855/2. Let o = i - -7/127. Calculate the common denominator of 71/22 and o. 154 Suppose 7r - 17 - 11 = 0. Calculate the least common multiple of 5 and r. 20 Let p be 0 - (-5 - -2) - 1. Let d be 41/p - 1712. Let h = -6917/4 - d. Calculate the common denominator of h and 24/7. 28 Let n = 199/12 + -113/12. Let a = 26143/16 - 1633. Find the common denominator of n and a. 48 Suppose 0 = 8q - 10q - 10. Let u(d) = d*3 + 4d*2 - 7d - 2. Suppose 2x + 11 = 3x. Calculate the least common multiple of x and u(q). 88 Let b(z) = 17z3 + 3z*2 - 3z - 1. Let h(s) = -16s3 - 2s*2 + 2s + 1. Let f(k) = -4b(k) - 5h(k). What is the lowest common multiple of 3 and f(1)? 33 Let d = 123 - 77. What is the common denominator of 16/9 and d? 9 Calculate the common denominator of 73/12 and 310/(-36) - (-4 - -3). 36 Calculate the smallest common multiple of 20 and 32/24 - ((-32)/3 + -2). 140 Let g(w) = w*3 - 9w*2 + 14w + 6. Calculate the smallest common multiple of 9 and g(7). 18 Calculate the common denominator of -35/16 and (-11)/(-88) + (-401)/40. 80 What is the lowest common multiple of ((2 - -1) + 1)/((-5)/(-15)) and 14? 84 Suppose c - 3 = v - 2c, 0 = 2v + 2c - 2. Suppose -5o = -vo + 575. Calculate the common denominator of (-4)/4 - o/6 and 75/16. 48 Let o(t) = -t3 - 10t*2 - 9t + 7. What is the smallest common multiple of 9 and o(-9)? 63 Let h(n) = -81n2 + 7n - 8. Let k be h(-11). Let o = k - -177893/18. Find the common denominator of 1 - 190/(-36) - -1 and o. 18 Calculate the least common multiple of (2 - 3) + 1 + 16 and 10. 80 Let z = -2625/136 + 207/17. Calculate the common denominator of -49/16 and z. 16 Find the common denominator of -1 - 53/(-4) - 0 and (-3)/12462/7. 4 Let x = 11/124 + 5507/124. What is the common denominator of x and ((-9)/36)/((15/(-546))/1)? 10 Let p(o) = o3 + 4o*2 - 15o - 4. What is the smallest common multiple of p(-6) and 10? 70 Let n(a) = a*3 - 6a*2 - 7a + 2. Let u be n(7). Suppose -ud = -3j - 28, -j + 30 - 100 = -5d. Calculate the smallest common multiple of 6 and d. 42 Find the common denominator of -121/20 and ((-118)/28)/(4/(-4)). 140 Suppose 5r - 2r = 15. Let s = r - -1. What is the smallest common multiple of (1 + -4)10/(-3) and s? 30 Let c be 6/4 - (-65)/(-10). Let x(i) = i*3 + 5i2 - 2. Let t be x(c). Let s = 8 - t. What is the least common multiple of 16 and s? 80 Let u(c) = -c3 + 6c2 - 7. Let k be u(5). Let d be 6/k - (-25)/(-3). What is the least common multiple of ((-60)/16)/(3/d) and 14? 70 Let d = -2342 - -46961/20. Find the common denominator of d and -23/6. 60 Let o = -19 + 39. Calculate the smallest common multiple of o and (-3)/6 + 13/2. 60 Let b be -4(0 - (-3)/(-8682)). Let i = b + -18843/23152. What is the common denominator of i and -133/18? 144 Let t(h) = h*3 - 19h + 17 + 3 + 5h - 13h*2. What is the least common multiple of 2 and t(14)? 20 Let n(i) = i + 19. What is the least common multiple of 6 and n(-7)? 12 Let r be (-25)/2(-1 - 15). Suppose -a = 3a + r. Calculate the common denominator of a and (-303)/42 + 1/(-2). 7 Let k = -15 - -13. Find the common denominator of (-80)/(-18) - 2/k and (0 - 2) + (-58)/(-16). 72 Suppose 32 = 5p + 12. Suppose -4s + p = -0. Calculate the common denominator of 1 - ((-18)/20 + s) and 47/14. 70 Let i = 11773/6 + -1938. What is the common denominator of i and -53/34? 102 Let x(g) = 2g - 7. Let a(w) = -3w + 10. Let l(n) = 5a(n) + 7x(n). Calculate the lowest common multiple of l(-7) and 10/218/15. 24 Suppose 2q - 20 = -0q - 4u, 0 = 3q + 5u - 26. Let l(b) = -3 + b2 - 4b*2 + 5b + 2bq + 3b. What is the smallest common multiple of l(7) and 6? 12 Let q = 373/10 + 16/5. What is the common denominator of -51/4 and q? 4 Let d = 3326573773/1538168010 + -918/497789. Let i = d + 3/515. What is the common denominator of -67/6 and i? 6 Let j(c) = 2c2 + 16c - 22. Calculate the lowest common multiple of j(-10) and 14. 126 Let r(j) = 2j + 28. Calculate the least common multiple of 1 and r(-12). 4 Let l = 17 - 7. Let z(j) = -j + 11. Suppose -2 + 20 = 3f. Calculate the lowest common multiple of z(f) and l. 10 Suppose 0 = 5s - 4z - 2 - 7, -3s = 4z - 31. Let g = 38 - 27. Calculate the smallest common multiple of s and g. 55 Let s be (-18)/(-14) - (-4)/(-14). What is the common denominator of ((-388)/(-8))/(s + 0) and 799/(-70) + 4/(-14)? 10 Let t(p) = -978p + 1. Let q be (-2)/7 - (-18)/14. Let l be t(q). Let s = 21565/22 + l. Calculate the common denominator of s and -37/2. 22 Let r = 13 - -10. Let i = -16 + r. Let x(b) = 5b - 2. What is the lowest common multiple of i and x(2)? 56 Suppose -13g = -9g - 120. What is the lowest common multiple of 10 and g? 30 Suppose 5v = a + 2a - 20, 5v - 10 = a. Calculate the least common multiple of a and 30. 30 What is the common denominator of 29/14 and (-29)/(-8) - -9(-4)/12? 56 Suppose -8m + 5m = 3t - 3, -5t = -2m + 9. Suppose -m = 5z + 3. Find the common denominator of z/4 + (-118)/24 and 47/2. 6 Let d be (1 - 2)/((-3)/21). Let m(w) = -18 - 6w + d + 31w*2 - 22w2 - w3. Calculate the least common multiple of 7 and m(8). 35 Let n(p) = -p - 5. Let c be n(-12). Let j = 8 - c. Find the common denominator of -121/6 and (j/(-3))/((-10)/(-555)). 6 What is the lowest common multiple of ((-64)/6)/((-13)/39) and 8? 32 Suppose -2d + 2 + 2 = 0. What is the common denominator of (282/600)/(d/4) and -97/2? 50 Let r = 92585/12 - 7721. What is the common denominator of r and -51/28? 84 Calculate the common denominator of (-139)/(-42) + 24/(-16) and -109/30. 210 What is the lowest common multiple of (-6)/(-4)8/3 and 0(-1)/3 + 2? 4 Let d(z) = z3 - 6z*2 + z + 6. Let h be d(7). Suppose o + 7i - 3i - 24 = 0, 2i - h = -3o. Calculate the lowest common multiple of 12 and o. 60 Let l be (12 + -3)(-1 + 2). What is the common denominator of (0 - -2) + (-50)/l and 2/(-2) - (-52)/14? 63 Suppose 4h = h + 36. Let u(t) = t3 - 6t*2 + 7t + 2. Calculate the least common multiple of u(5) and h. 12 Let d be (-26)/14 - (3 - 0). Let y = -25/28 + d. Calculate the common denominator of y and 89/20. 20 Let y be (2/58116)/(32/(-7090024)). Let r = 2/14529 - y. Calculate the common denominator of r and 61/16. 16 Let y(q) be the third derivative of q*5/60 - 5q*4/24 + 2q3/3 - q2. Let b = -63 + 69. Calculate the lowest common multiple of y(b) and 4. 20 Suppose 0 = q - 7q + 12. What is the least common multiple of 13 and q? 26 Let o = 465041/18 + -25843. What is the common denominator of o and 31/2? 18 Suppose 0c = -2i + 2c + 6, -i + 5c = -19. Let d = i - -11. What is the lowest common multiple of (10/2 - -2)/1 and d? 70 Let x = -122374 + 2691483/22. Let h = x + 15/11. Find the common denominator of (-67)/(-12) + -2 - -1 and h. 12 Let m = 27407/260 - 1449/13. What is the common denominator of -31/2 and m? 20 Let n(x) = x3 + 4x*2 - 5x. Let o be n(-5). What is the common denominator of -2 - 2/(32/3) and 3 - o - 57/2? 16 Let d be ((-160)/15)/(2/6). Find the common denominator of -61/20 and -16 - -17 - 54/d. 80 Let y = -16317/20 + 4096/5. Calculate the common denominator of y and (-9)/(-12) - 53/(-12). 60 Calculate the lowest common multiple of 56/16(38/14 - 1) and 5. 30 Suppose -2 = 5j + 3. Let d = 4 + j. Suppose 2s - 90 = -ds. Calculate the least common multiple of 14 and s. 126 Let u = 20717 - 373043/18. Let w = -859/180 - -31/18. What is the common denominator of w and u? 180 Let t = -55/7 + 628/63. Find the common denominator of 24/7 and t. 63 Let l = 590 - 390. Find the common denominator of l/256 - -2*1 and 79/20. 160 Let g = 28581 - 13347332/467. Let m =	{ "pile_set_name": "DM Mathematics" }
(d). -1 Suppose 2m = -c - 2c + 31, 0 = 5m - 5c - 15. Let b(v) = 6v + 5v + m - 10v - 2v. What is b(0)? 8 Let c(v) = -3v2 - 4 + 19v - 3 - 1 + 4v2. What is c(-19)? -8 Let j(n) = -5n. Let k be j(1). Let o(a) = 13474 + 5a2 + 0a3 - 13467 + a3 + a. Determine o(k). 2 Let c(f) = f*3 - 11f*2 + 2f - 9. Let i = -752 + 763. Give c(i). 13 Let c(y) be the second derivative of -y*3/6 - 3y*2 - 53y. Give c(-12). 6 Let j(s) = 3s2 - 2s + 8. Let a(y) = -2y2 + 2y - 7. Let m(h) = -6a(h) - 5j(h). Let o be m(-2). Let b(l) = l*2 + 5l. Give b(o). 6 Let x(n) = n*3 - 11n*2 + 6n. Suppose 8p - 67 = 13. Give x(p). -40 Let h be ((-4)/(-12))/(1/(-15)). Let n(x) = -x3 + 5x*2 + 7x - 7. Let u be n(6). Let y = u - h. Let q(r) = -3r + 6. Determine q(y). -6 Let p(k) = -2k*2 + 13k + 26. Let f(w) = w*2 - 6w - 13. Let j(h) = 5f(h) + 3p(h). Give j(10). 3 Suppose 2z = -3d - 3z + 34, 4z - 20 = 0. Let s(y) = 9y3 - 16y + 5 - d - 1 + 18y. Determine s(-1). -10 Let r(v) = v + 0 + 2v - v*2 + 2v - 2. Suppose 5 = -3p + 14. Give r(p). 4 Let g = -286 - -290. Let q(n) = -n2 + 3n - 5. Give q(g). -9 Let q be (6 + 4/(-4))(5 - 3). Suppose -qo - 36 - 24 = 0. Let s(m) = -m - 12. Calculate s(o). -6 Let b(a) = 25a - 8 + 6a2 - a3 - 13a - 18a*2 + 7. Determine b(-13). 12 Let w(j) = 4j. Let t(h) = -h. Let f(d) = -5t(d) - w(d). Let k be (-4)/10 - 34/(-10). Calculate f(k). 3 Let w(x) be the second derivative of x3/6 - 159x. Give w(0). 0 Let p = 145 + -165. Let a = p + 25. Let j(i) = -i*2 + 7i - 1. What is j(a)? 9 Let u(p) = -29p2 - 11p - 2. Let h(s) = 14s2 + 5s + 1. Let z(g) = 7h(g) + 3u(g). Suppose 3 = -3l - 0. Let v be l + 02/(-4). What is z(v)? 10 Suppose 7 = -3m - 3h + 5h, 4m - 5h = 0. Let t(c) = -7c - 9. Calculate t(m). 26 Let m(j) = -j + 4. Let p be m(2). Let v(w) = 2 - 6 + 2w + p - 3. Determine v(6). 7 Suppose 3b = -12, -5b + 7b = y - 38. Suppose -2v - 5c - 1 = 16, y = 5v - 2c. Let r(u) = u*2 - 5u - 4. Calculate r(v). -8 Let u(k) = 5k - 2. Let m = -87 + 73. Let h = -12 - m. Calculate u(h). 8 Suppose -4b = -3c - 21, b - 9 = -0b + 2c. Suppose -z + bz = 4. Let r(u) = u*3 - 3u + 2. What is r(z)? 4 Let d(t) = 4t + 4. Let o = -10 + 38. Let v be -9(o/12 + -2). What is d(v)? -8 Let k(j) = 2j3 + 5 + 1 - j3 - 5 - j2. Let n(f) = 5f*2 - 2f + 1. Let t be n(1). Let c be (-3)/6 + 2/t. Calculate k(c). 1 Suppose 25x - 29x + 8 = 0. Let m(b) = 4b2 - 7b + 1. Let p be m(x). Suppose -pi - i = -24. Let k(q) = 2q - 3. What is k(i)? 9 Let y(l) = l*2 + 7l - 5. Let d(b) = -b*3 + 20b*2 + 17b + 77. Let v be d(21). Give y(v). -5 Let a(n) = n*3 + 13n*2 - 15n - 18. Let i be a(-14). Let g(c) be the first derivative of -2c - 1 - 4/3c*3 - 1/4c*4 + 1/2c2. Give g(i). -6 Let w(b) be the first derivative of -b4/2 - b*3/3 + 2b*2 - 5b - 826. Give w(2). -17 Let f(n) = -n + 31. Let d be f(27). Let s be d/(-1) + -271/(-3). Let q(j) = 5j*3 + 6 - 6j*3 + 4j - 1 + 4j2. What is q(s)? 0 Let s be ((-3)/(-21)0)/1. Let b(c) = c + 25. Determine b(s). 25 Let u(s) = -4s2 - 2s - 2. Suppose -10j = 18 + 12. Calculate u(j). -32 Let c(f) = -7f + 21. Suppose 116g - 112g = -3o + 12, -5o - 2g + 20 = 0. Determine c(o). -7 Let q(w) be the second derivative of w5/40 + w4/24 - w3/6 + w. Let p(r) be the second derivative of q(r). Suppose 33l - 44 = 44l. Determine p(l). -11 Let s(b) = -4b. Let d be s(-1). Let u be (25/20)/(2/8). Let n(l) = 4 + u - l - d + 0l. Determine n(5). 0 Let c(q) be the second derivative of q3/6 - 2q*2 - q. Let t(g) = -g + 8. Let m(j) = 5c(j) + 3t(j). Give m(-4). -4 Let a be (-4)/(1413/182). Let m(k) be the third derivative of -k*5/60 - 5k4/24 - k3 - k2. Give m(a). -2 Let b(i) = -i3 + 5i2 + i - 2. Suppose -15 = -l - 5o, 4l - 3o - 10 = 4. Give b(l). 3 Let a(z) = 5z - 3. Let p(l) = 3l + l*2 - 12 - 4l + 6l. Let w be (7 - 5) + 0 + -9. Let o be p(w). Determine a(o). 7 Let i(k) be the third derivative of -k7/2520 + k5/60 - 11k*4/24 - 5k*2. Let c(h) be the second derivative of i(h). What is c(3)? -7 Let f(t) = 6t - 13. Let m(y) = 3y - 7. Let l(q) = -6f(q) + 11m(q). Calculate l(3). -8 Let t(f) = f2 - 2f + 5. Suppose -93s = -90s - 6. Suppose sc = 3v - 4, 2c - 14 + 2 = -v. Give t(v). 13 Let a(f) = f2 + f + 17. Let d be 0/(24/4 + -3). Determine a(d). 17 Let l = -97 + 91. Let m be ((-18)/15)/l - (-42)/(-10). Let c(i) = -6i - 4. Determine c(m). 20 Let m(o) = -o*2 - 2o + 1. Let c be 4 - (-3 + (4 - 0)). Suppose 0 = 3j + 3u, 0 = -cj - u - 4 - 4. Calculate m(j). -7 Suppose 0f - 3041 = -5d + f, -5d + 4f = -3044. Let m be d/20 - (-4)/(-10). Let h(w) = m - 4w*3 - 19 + 3w3 + w2. What is h(0)? 11 Let a(g) = -11g - g - 2 + 15g - 2g. Suppose c - 25 = 3x + 2x, 3c + 1 = -4x. Determine a(c). 3 Let t(d) be the first derivative of -d3/3 - 3d*2 - 3d + 1. Let i = 56 + -60. Calculate t(i). 5 Let p(f) be the second derivative of -f*4/6 - 5f*3/3 - 5f*2/2 + 2f - 92. Calculate p(-4). 3 Let w(g) be the third derivative of g6/15 + g4/12 + g*3/6 + 9g2 - 5. Calculate w(-1). -9 Let t(m) = m2 + m - 1. Let w be t(2). Let b(j) = -4j2 + 13 + wj*2 + 3j - 15. Determine b(-6). 16 Let k(g) = 2g - 1 + g2 + 6g - 11. Let h(y) be the first derivative of -5y2/2 - 104y - 61. Let q be h(-19). What is k(q)? -3 Let i = 216 - 210. Let s(d) be the third derivative of 5d2 - 1/120d*i - 1/6d*3 + 0 - 1/8d*4 - 1/10d*5 + 0d. Calculate s(-5). -11 Let y = -97 - -91. Let q(z) be the second derivative of z*4/12 + 2z*3/3 - 2z*2 + 3z. Determine q(y). 8 Let m(f) be the first derivative of -f*4/4 - 19f*3/3 - 17f*2/2 + 18f + 134. What is m(-18)? 0 Suppose 5y + 0y = -2y. Let b(t) = -4t + 6t - 1 + t2 + 2 + yt*2. Determine b(-4). 9 Suppose -t + 3 + 24 = 0. Let v(o) = to + 1 - 49o + 28o. Give v(1). 7 Let r = 207 + -205. Let z = -6 - -8. Let l(i) = -1 - i*3 + 1 + i + 2 + zir. Calculate l(3). -4 Let s(n) = 1. Let l(y) = y3 - 3y2 - 7y + 4. Let p(i) = l(i) + 2s(i). Suppose 0 = 5v - 20 + 45, 32 = 3k - 4v. Determine p(k). -6 Let y(a) = -a*2 - a - 6. Let d(g) = -4g*2 + 12g - 39. Let f(r) = -d(r) + 5y(r). Give f(-14). 51 Let y be (-4 + 1)(10 - 9). Suppose -j + 36 = -4j. Let s be (-90)/j2/y. Let z(g) = g*3 + 6g*2 + 7g + 1. Determine z(s). -9 Let w(i) = -i + 5. Let t be 2 + 0 - -4 - 0. Let x be -2t(-2)/8. Calculate w(x). 2 Let c = -2903 + 2904. Let m(y) = -y + 2y3 + 5y*3 + 0y + y*2. What is m(c)? 7 Suppose -166 = -4w - 66. Let y(j) = 42j - wj - 18j. What is y(-6)? 6 Let a(r) = -r3 - 9r*2 - 9r + 9. Let w(t) = t*3 + 7t*2 - 6t + 8. Let i be w(-8). What is a(i)? 17 Suppose -10 = 2k + 2. Let i(n) be the third derivative of -n4/24 - 4n3/3 + n2 - 3. Give i(k). -2 Suppose 0 = -d - 3d + 12. Let u(y) = -16y - 10. Suppose 0 = -3k + 6k - 6. Let g(r) = 3r + 2. Let o(s) = ku(s) + 11g(s). Determine o(d). 5 Suppose 3b + z = -19, -5b - 42 - 1 = -4z. Let v(c) = c*2 + 6c + 3. Give v(b). 10 Let m(w) be the second derivative of 1/2w2 - 1/2w*3 + 0 + 4w. Let t = 1 - 3. What is m(t)? 7 Let b(g) = -g*3 - 8g*2 - 12g - 2. Let n be b(-4). Let r(a) = a + 29. What is r(n)? 11 Let k(a) = -3a - 11. Let n be k(-5). Let t(i) = 1 + 1 - 3 - 298i + 300i. Give t(n). 7 Suppose 0d + 115 = 3f + 5d, f = -d + 41. Let q = f - 25. Suppose 22 = -6h - q. Let l(s) = -s3 - 6s*2 + 7s + 2. Determine l(h). 2 Let y(u) = u*2 + 2u - 1. Suppose 15 + 40 = -5m + 5d, 2d = -5m - 20. Determine y(m). 23 Let x(d) = -6d - 1 + 4d + d*2 + 6d. Let r(w) = w*3 - 10w*2 + 10w - 13. Suppose -v + 12 = 3. Let o be r(v). Calculate x(o). -1 Let i(w) = w. Suppose 5p = 10p + 20. Let m = 4 - p. Suppose 2c + 0g + 5g = -m, g - 8 = 2c. Determine i(c). -4 Let v(b) be the first derivative of -1/2b2 - 5 + b. Let q = -2 - 1. Calculate v(q). 4 Let u(r) = -8r. Let j(n) = -n*2 - 11n + 1. Let z be j(-11). Determine u(z). -8 Let z = -2 + -5. Let d(t) = -2t - 10. What is d(z)? 4 Let v(j) = -j2 - j3 - 2 - j + 2. Let x be ((-20)/6)/((-2)/(-3)). Let b be 15/(-10)(-1 - x). Calculate v(b). 6 Let i be (10 + -11)/(2/14). Let g(s) = s2 + 10s + 17. Give g(i). -4 Le	{ "pile_set_name": "DM Mathematics" }
5 in descending order. 90, 0.2, -4/5, -3, -5, -6 Sort 1, 5, 156, -5, -4. -5, -4, 1, 5, 156 Put -1, 2954, 2, 3, 0, 5 in decreasing order. 2954, 5, 3, 2, 0, -1 Sort 0, 35, 3, 2, 30 in increasing order. 0, 2, 3, 30, 35 Put 1040, -11, 5 in increasing order. -11, 5, 1040 Sort -274, 31, 0.4 in increasing order. -274, 0.4, 31 Sort 38, -0.02, 170, 0.1 in decreasing order. 170, 38, 0.1, -0.02 Sort -30447, 1, -4 in decreasing order. 1, -4, -30447 Sort -2, 2/27, -9, 320, -3 in ascending order. -9, -3, -2, 2/27, 320 Sort 10, 21/2, 0.3, 4, -3 in ascending order. -3, 0.3, 4, 10, 21/2 Sort -0.02, 14, 1, 7.24, 0.02 in descending order. 14, 7.24, 1, 0.02, -0.02 Put -2, -5, 4, 7, 27, 3 in descending order. 27, 7, 4, 3, -2, -5 Sort -5, -16020, -3 in decreasing order. -3, -5, -16020 Sort 1/21, 1, 0.31 in ascending order. 1/21, 0.31, 1 Put 1/63, -0.02, -4.4 in increasing order. -4.4, -0.02, 1/63 Sort 12, -36, 3/4, -1/3 in decreasing order. 12, 3/4, -1/3, -36 Sort 1/3, -0.05, 9, 1, 4, 1/7 in ascending order. -0.05, 1/7, 1/3, 1, 4, 9 Put 2, -0.2, 2/3, 32.3 in increasing order. -0.2, 2/3, 2, 32.3 Put -1/7, -2/321, 39078 in ascending order. -1/7, -2/321, 39078 Sort -18, 1/4, 1/37, 1.23, -5 in descending order. 1.23, 1/4, 1/37, -5, -18 Sort 1, -4, -20, -47. -47, -20, -4, 1 Sort 10.8, -2, 2/9, 1.3, 0.04, 3. -2, 0.04, 2/9, 1.3, 3, 10.8 Sort -41348, -5, -2/5. -41348, -5, -2/5 Sort 2, 80, 4, 7. 2, 4, 7, 80 Sort 1/251, -2, 815 in descending order. 815, 1/251, -2 Put -1/155, -3/2, -0.209 in decreasing order. -1/155, -0.209, -3/2 Sort 1, 834, -4, 4, -3 in decreasing order. 834, 4, 1, -3, -4 Put -2, 2.81, -1, -4, -5/2, -7/2 in increasing order. -4, -7/2, -5/2, -2, -1, 2.81 Put 0.09, -2/7, 5318, 3, 4 in ascending order. -2/7, 0.09, 3, 4, 5318 Sort -5, -1961, 3, 1, -3 in increasing order. -1961, -5, -3, 1, 3 Sort 2, 1, -6, 733, 18. -6, 1, 2, 18, 733 Sort 8, 5, 3, -92, -1 in decreasing order. 8, 5, 3, -1, -92 Put -1413, -5, 4, 3, -8 in decreasing order. 4, 3, -5, -8, -1413 Put -0.5, -1/4, -8, -520, -5 in descending order. -1/4, -0.5, -5, -8, -520 Sort -5, 5, 707. -5, 5, 707 Sort -2192, -3, -11 in descending order. -3, -11, -2192 Put 2, -4, -0.04, 2/15, -5/2, -76 in decreasing order. 2, 2/15, -0.04, -5/2, -4, -76 Put 0, -167, -1178 in decreasing order. 0, -167, -1178 Put -1, -13, 4, 2 in ascending order. -13, -1, 2, 4 Sort 5, 8, 26, 34, -2, 2 in ascending order. -2, 2, 5, 8, 26, 34 Sort 4, -33, 3, -8 in decreasing order. 4, 3, -8, -33 Put 4, 0.5, -3, -0.5, 48643 in ascending order. -3, -0.5, 0.5, 4, 48643 Sort 341, 8, 1, 14/9 in ascending order. 1, 14/9, 8, 341 Sort -2/9, 119933, -2, 5 in increasing order. -2, -2/9, 5, 119933 Sort 5, -2, 17, 3, 7/4. -2, 7/4, 3, 5, 17 Sort 6, 113, 1, -1, -3, 0 in descending order. 113, 6, 1, 0, -1, -3 Put -1266, 4, 0, 3, 21 in decreasing order. 21, 4, 3, 0, -1266 Put 14, 1, 0, -490 in decreasing order. 14, 1, 0, -490 Sort -3662, 3, 5, -5, 0.5, -4. -3662, -5, -4, 0.5, 3, 5 Put -0.3, -237/8, -0.2 in increasing order. -237/8, -0.3, -0.2 Put 8, 2, -2, 86, 5 in ascending order. -2, 2, 5, 8, 86 Put -10, 394, 1, 2, -5 in decreasing order. 394, 2, 1, -5, -10 Put -179, -4, -2, 193 in decreasing order. 193, -2, -4, -179 Sort 3/29, 13, -13, -2 in ascending order. -13, -2, 3/29, 13 Sort 0, -135, -0.033, -0.2 in decreasing order. 0, -0.033, -0.2, -135 Sort 7, -12, -1173, 2. -1173, -12, 2, 7 Sort 11/5, -1, -6, 0.5. -6, -1, 0.5, 11/5 Put 33, -3, 16, -8, 5 in increasing order. -8, -3, 5, 16, 33 Put 70, 36, 2.16, 0.1 in descending order. 70, 36, 2.16, 0.1 Sort -3, 7220, 42 in ascending order. -3, 42, 7220 Sort -2/5, -4/7, 0.39, 1/43 in descending order. 0.39, 1/43, -2/5, -4/7 Put 361, 0.9, 9, 0.2 in descending order. 361, 9, 0.9, 0.2 Sort 4, 1, -2, -11, -1, -54. -54, -11, -2, -1, 1, 4 Sort -19, 2, 9, 5, -4, 3. -19, -4, 2, 3, 5, 9 Sort 1344, 1/3, -6, 23 in increasing order. -6, 1/3, 23, 1344 Sort -2, 4, 12, 0.001, -0.2 in increasing order. -2, -0.2, 0.001, 4, 12 Sort 1951, -3, -5, -2. -5, -3, -2, 1951 Put -33, -0.1, -2, 2/73, 3/7 in ascending order. -33, -2, -0.1, 2/73, 3/7 Sort 5, -5, 13, -1, 0. -5, -1, 0, 5, 13 Sort 0, 5, -2, -66. -66, -2, 0, 5 Sort 5, -52, 307 in descending order. 307, 5, -52 Sort -1, 22, 2, -5, 33, -2. -5, -2, -1, 2, 22, 33 Sort -1174, 3, -4, -5 in increasing order. -1174, -5, -4, 3 Put 4924, 8, 2 in descending order. 4924, 8, 2 Sort 2, 0, -491, 7 in decreasing order. 7, 2, 0, -491 Sort -14, 4, -4, -15, 5, -5 in descending order. 5, 4, -4, -5, -14, -15 Sort -4, 1/58, -98 in decreasing order. 1/58, -4, -98 Put 4, -1/5, -0.06, 3/8, -6 in decreasing order. 4, 3/8, -0.06, -1/5, -6 Sort -393, -0.2, -1.51, 3/10, 2 in increasing order. -393, -1.51, -0.2, 3/10, 2 Sort 4, 3, -336, 1/4, -0.3, -7 in decreasing order. 4, 3, 1/4, -0.3, -7, -336 Sort 0, 9, 21 in decreasing order. 21, 9, 0 Sort 382, -5, 2, 17, -1 in descending order. 382, 17, 2, -1, -5 Sort -2, -5, -14, 17, -6. -14, -6, -5, -2, 17 Put -2, 9, -0.2, -3.6, 0.3, -3 in descending order. 9, 0.3, -0.2, -2, -3, -3.6 Sort -15, -13, -1, 3, 0, 7. -15, -13, -1, 0, 3, 7 Sort -1, 1908, 8. -1, 8, 1908 Sort 2.6, -73, 5/4. -73, 5/4, 2.6 Put 3, 1, 10538, 4, 2 in decreasing order. 10538, 4, 3, 2, 1 Sort 0, 2/84749, -4. -4, 0, 2/84749 Sort 8.8, 20747, -2 in ascending order. -2, 8.8, 20747 Sort 5, -17, 4, 1, 2, -3 in decreasing order. 5, 4, 2, 1, -3, -17 Put -1, -4, 198, 4, -42, 1 in ascending order. -42, -4, -1, 1, 4, 198 Sort 1, 4907, -0.06 in increasing order. -0.06, 1, 4907 Put -2, -3990, 0, 2 in descending order. 2, 0, -2, -3990 Sort -0.01, -3, -30, 1/6. -30, -3, -0.01, 1/6 Put 0, 0.23, -762, -0.3 in increasing order. -762, -0.3, 0, 0.23 Sort 1/7, -1.049, -1/3. -1.049, -1/3, 1/7 Put 6, -502, 0.5, 1/3, 2/5 in decreasing order. 6, 0.5, 2/5, 1/3, -502 Sort -4/139, 1, -4/9 in descending order. 1, -4/139, -4/9 Put 3, 5, 4, 2546, -1 in ascending order. -1, 3, 4, 5, 2546 Put -695, 3, 12, -3, -2 in increasing order. -695, -3, -2, 3, 12 Sort -3, 5, -2/17, 142, 0.2, 10 in ascending order. -3, -2/17, 0.2, 5, 10, 142 Put -1, -24, 2, -49 in ascending order. -49, -24, -1, 2 Put 4, 348, 2, 3 in ascending order. 2, 3, 4, 348 Sort 37/9, -1/5, 2/15 in ascending order. -1/5, 2/15, 37/9 Put 5, 1726, 75 in ascending order. 5, 75, 1726 Sort 1, -3, -8, 0, 56. -8, -3, 0, 1, 56 Sort 2, 5, 4, 40 in increasing order. 2, 4, 5, 40 Sort 2/3, 16, 23, 3/10, 0.2 in descending order. 23, 16, 2/3, 3/10, 0.2 Put -3, -0.128, -1/4, -4.7, 5 in decreasing order. 5, -0.128, -1/4, -3, -4.7 Sort 0, 516, -19 in descending order. 516, 0, -19 Sort 0, -11, -4, 2, -5, 984 in descending order. 984, 2, 0, -4, -5, -11 Sort -2, 6, 2, 2/9, -12 in decreasing order. 6, 2, 2/9, -2, -12 Put 0.5, 0.844, 0, 15, 2 in descending order. 15, 2, 0.844, 0.5, 0 Put -0.74, 0.5, -4/5, -3 in ascending order. -3, -4/5, -0.74, 0.5 Put -0.2, 4, -2206, -100 in ascending order. -2206, -100, -0.2, 4 Sort 5, -0.5, -3/2, 2.16, -1/3 in descending order. 5, 2.16, -1/3, -0.5, -3/2 Sort 0.019, 0, -2, 1, 29, 0.1. -2, 0, 0.019, 0.1, 1, 29 Sort -11/17, -56, 0.2, 2 in decreasing order. 2, 0.2, -11/17, -56 Sort 56, -7635, 2 in decreasing order. 56, 2, -7635 Sort 15, 40, 0, 1 in ascending order. 0, 1, 15, 40 Sort 22, -6, 3/2, -3, 211 in increasing order. -6, -3, 3/2, 22, 211 Put -2, -5, -111.03, -37/5, 0, -3 in decreasing order. 0, -2, -3, -5, -37/5, -111.03 Put -5, 7252, 19, 1 in increasing order. -5, 1, 19, 7252 Sort -5057, 0, -9, -1. -5057, -9, -1, 0 Sort -5, -0.015811, -0.13 in descending order. -0.015811, -0.13, -5 Sort 7, 70, -1/3, -1.3 in descending order. 70, 7, -1/3, -1.3 Sort 7933, 0.5, 1, 0.3, -1. -1, 0.3, 0.5, 1, 7933 Sort 1, 15, 3, 5, -574 in descending order. 15, 5, 3, 1, -574 Put -2, 3, -7758, 5 in descending order. 5, 3, -2, -7758 Sort 7, 3, 0, 13, 1, 5. 0, 1, 3, 5, 7, 13 Sort 0.6, -4, 5772 in decreasing order. 5772, 0.6, -4 Put -40, -4, 0.2, 1/9, 1, 18 in ascending order. -40, -4, 1/9, 0.2, 1, 18 Sort -39/8, -0.4, -8, 1 in descending order. 1, -0.4, -39/8, -8 Sort -40, 50, 2 in decreasing order. 50, 2, -40 Put 3, -3, 1, -1, -151 in ascending order. -151, -3, -1, 1, 3 Sort -1, -2, -4/3, 0.01, 2/7, -2/21 in descending order. 2/7, 0.01, -2/21, -1, -4/3, -2 Sort 1.4, -182, 1/3, 0, 1, -2 in increasing order. -182, -2, 0, 1/3, 1, 1.4 Put -0.2, -1.855, -0.4, -2.6 in descending or	{ "pile_set_name": "DM Mathematics" }
(-3(-1)/2)/((-24)/(3024/45)) -21/5 Calculate (54649/(-888) + 34 + (-5)/40)/((-4)/3). 83/4 Evaluate (-8)/32(2 - 14) - (-1560)/1179. 123 What is 81928/6468 - 2119/168? 3/56 What is (-10 + 129/66/(-25 - -28))/(-5)? -33/5 What is the value of (736/3496)/((-30)/1425)? -10 Calculate ((-226)/(-565))/(1230/(-300)). -4/41 Calculate 7/2 - (123 - 125118/1134). -55/6 Calculate 2/20 + (-46)/(-16)(-18)/(-45). 5/4 (-2310)/(-2695)(435/9 - -3) 44 Calculate (((-756)/516)/21)/(4/(40/(-15))). 2/43 ((-8)/(-36)-2 - 1998/(-3402)) + 97/7 14 What is 2156/(-538) + (295 - 282) + 7 + -16? -2/269 What is the value of (4 + 309/15)(2856 + -2851)? 123 Evaluate (-2)/(-29 - 1) + ((-20420)/300 - -150). 82 Evaluate (18/6 - 0)/(-302 + 233). -1/23 What is (22/22)/((10/(-4))/((-285)/3534))? 1/31 Evaluate 1(16 - (-285)/(-20)) + (-210)/24. -7 Calculate 5(-2)/(-30)141/(-376)-568. 71 2/(-108) + (-27193)/765234 -2/37 What is the value of 54 + (-151 + 167 - -52)? 122 What is the value of (-159)/189 - ((73 + -21)/520 - (-54)/(-140))? -5/9 4-3 - 60606/(-5291) -6/11 Evaluate ((-42)/(-168))/(-1508/(-768)). 4/25 (-12374364)/217415 + 57 + ((-8)/(-8))/(-1 + -10) -2/295 Calculate (0 + 4)/(((-14)/(-595))/(66/(-660))). -17 Calculate (-3090824)/67053 + (-4)/(-42) + 0. -46 Calculate 10 + 1230/(-90) - 517/(-231). -10/7 What is the value of 1(((-12)/(-7))/4)/(438/(-2555))20? -50 What is -411/(50468/(-111))? 3/31 Calculate (-1222)/(-94) - (2 + (-3 - 3)). 17 Calculate (5/(-490))/(1016/672 + 10/(-120)). -1/140 What is the value of (1/2)/(6/(-120)) - (-97 - 23)/15? -2 Calculate ((-1480)/5183/(-6))/((-4)/70). -25 Calculate (-1104)/(-20) + 32/(-60) + (-3)/(-9). 55 What is (-21 - -21)(-91)/(-1183) + 2/(-494)? -1/247 Calculate (155/40 + -4)/(174/1392). -1 Calculate ((-212)/42612)/(90/(-1005)). 1/18 What is 24 + (-3)/120 + (-382 - -289)? -69 ((-1673)/(-28441))/((-7)/84) -12/17 Evaluate ((-18)/8)/(1495/3588)5. -27 What is the value of ((-6527)/1708 - 250/(-70))/(2/928)? -116 What is the value of ((-2)/12)/((-444)/(-48285)) - (-2)/16? -18 What is the value of (66/(-42))/(79/(51982/(-611)))? 22/13 What is ((-66)/(-240) - (-1)/8)/((-1440)/(-1350))? 3/8 What is the value of (-810)/(-12)(-1092)/4095? -18 Calculate (-32 - 5670/(-175)) + -3 + (-3028)/(-1180). -2/59 Evaluate 2553/21793 - ((-6)/62)/((-18)/726). 1/19 381/(-20574) + (-19864)/432 -46 Calculate 90(-13)/(-130)((-6)/4 + (-400)/(-96)). 24 Calculate 4165/(-476)(-132)/(-55). -21 Evaluate 4400/(-22)(-22)/(-176). -25 What is -4300/26 - ((-1938)/(-247) - 8)? -46 What is 0 + (55/(-80))/(-11) + (-1593)/(-2160)? 4/5 Calculate ((-2)/28)/((-27589)/(-8218)). -1/47 What is the value of (-118 - -109) + (5 - (-53 - 55/(-11)))? 44 Evaluate (-5733)/(-351) - 464/24. -3 What is the value of (-130 + (-43662)/(-399))/(3/(-7))? 48 16452/825342(-35)/10 -3/43 Evaluate (-15114)/1452 + -1 + 10 + 18/12. 1/11 151 - (-147 + (-115 - -517)) -104 Evaluate -13782/(-198) - 56/63 - 13. 1/33 Calculate ((-498)/27)/2 + (-19)/(1881/1661) + 17. -9 (-278 - -266 - 46/(-4))/(4/(204 - -4)) -26 50/1545/(-675) + 274/18 15 Evaluate -4 + -29 + ((-2555)/(-73) - -105). 107 Calculate -21 - 11/((-264)/32)357/68. -14 ((-372771)/315)/97(-5)/(-1) -61 32/28(-17)/((-2176)/5600) 50 What is the value of (-1)/((1904/170)/56)? -5 Calculate ((-14)/90)/(-1 - 754/(-348)). -2/15 What is the value of (-184)/201392510/(-152513)? 84 What is the value of (-21)/36(22196/434)/179? -1/6 What is -8 + ((-690)/(-18) - -5 - 6)/(28/42)? 48 Evaluate (-17 + 1539/54)2. 23 Calculate 323/(-418) - -1437/11396. -8/11 Calculate 24/33 - ((-14406)/(-539) + 11). -37 What is the value of (35256/(-40320))/(1 + 130/(-138))? -23/6 Evaluate ((-12260)/160 - -29) + 48. 3/8 What is the value of ((-125)/(-18) - (-140)/(-315))/(-1 - 4/(-8))? -13 Calculate ((-4152)/(-22144))/(12/2368). 37 What is 63/268 - (2(-27)/54)/(-4)? -1/67 Evaluate (11011/2128)/11 - (-3450)/(-11040). 3/19 Calculate ((-316)/(-2686))/((-2)/34)3/(-34). 3/17 Calculate (-7992)/(-5328) - (-218)/4. 56 Calculate (15/(-25))/(876/49640). -34 Evaluate ((-220)/(-2090) - 72/(-38))-20. -40 Evaluate 4/(-102)(-2415)/322. 5/17 What is the value of 37 + ((-2351514)/(-1927))/(-33)? 1/47 Calculate (1394/(-116))/(-456 + 455) - (11 - -1). 1/58 What is the value of ((-18560)/(-256))/145(1 - 33)? -16 What is the value of (9/(-408))/(5/(-4)3546/7880)? 2/51 Evaluate 102850/2090 - (-56)/(-266). 49 (2 - 19/(-3))/((-1010)/(-606)) + 11 16 Calculate (465/6)/(((9/(-4))/(-9))/((-153)/765)). -62 Calculate ((-7344)/5100)/(-18/20). 18/5 Evaluate (-112)/(-64) + (-1552)/(-24)6/16 + -1. 25 (251620/114870)/((-46)/(-14)) 2/3 Evaluate ((-2)/9 - 7809/1512) + (1885/1560)/(-29). -38/7 What is 1(2 + -15) - (54 + (-24)/(-4))? -73 Evaluate -103 + 0 - (-215810)/6166. -68 Calculate (-6)/(-4)-2 + (-8 - (-28 + 42)). -25 What is the value of ((-1813)/(-777))/((-3)/(-18))-4? -56 What is 1240/70(-21)/(-6) - 2(-1 + -5)? 74 6 - ((-6188)/910)/(8/5) 41/4 Calculate (((-105)/(-14))/(75/(-165)))/((-2)/32-6). -44 (3/(-99))/((-12)/((-3420)/3971) - 14) 5/11 What is the value of -38/(-3) + (731/(-2))/43? -1/2 What is the value of (72/90)/(196/(-8330))? -34 What is 13/130(84 - 86) + (-122)/(-10)? 12 Calculate 1 + 7 + (627/(-33) - 31). -42 Evaluate (8/(-52))/((-160)/(-80)). -1/13 Evaluate (48 + -27)(-30)/(-168)-2. -15/2 Evaluate 10(-6 + (-12)/12026 + 5). -36 (-3)/(63/30) + (-868797)/18263 -49 (383022/(-205))/54 - 6/15 -35 What is the value of (-2)/((327 - 290) + 12 + -21)? -1/9 Calculate (-30 + (-29072)/(-966))339/(-2) + 9. -50/7 (160 + (-121284)/756)/(3/(-511)) 73 What is the value of (8 + 274)/(-47) + 25? 19 Evaluate 7/231 - 11(-126468)/19602. 71 What is ((-62565)/582 + 106)((-326)/(-6) + -2 + -1)? -77 ((-28)/98)/((-20094)/(-1379)) -1/51 Calculate (-81)/9 - 750/(-100)3/(600/242). 3/40 What is (-24)/1836 - (-267610)/(-10710)? -25 What is ((-190 - -196)70/(-12))/((-5)/(-5))? -35 What is -20((-25470)/600 + 41)? 29 What is ((-225)/(-36)4)/(10/30 + (-352)/660)? -125 (-8)/(-430)-58/128-4 1/43 Evaluate (-3 + -22 + 54)/(-3). -29/3 What is the value of (278/4)/(5390/308 + -18)? -139 What is the value of (1015983/62715)/((-3)/5)? -27 Calculate ((52/12)/((-360)/(-240)))/((-6)/(-216)). 104 Evaluate 2/(188/987 - 2/(-21)). 7 158/395 - 1030/200 -19/4 (-9 + 20)/(-11)(1003/102 - 8) -11/6 What is the value of (-191)/343801650(1 + (-8)/10)? -11/6 What is the value of 1368/1710 + 39 + ((-6)/9 - (-4)/(-30))? 39 Calculate ((-1314)/876 - (-21)/12)52. 13 What is (39/4)/(80 + (-99014)/1240)? 65 Evaluate (-400)/(-190) - 8 - -6 - (-23646)/266. 89 Evaluate 1/(-6)(-14040)/720. 13/4 Evaluate (((-105)/(-14))/(-5))/(65903/1534 + -43). 39 What is the value of (-6 - -2) + ((-960)/1440)/(2/(-6))? -2 What is (6 - 27/4)(-2)/(-5)452/4746? -1/35 What is (11 + -3 + 624/(52/(-4)))(-1)/1? 40 Evaluate ((-2151/119)/(3 - 0))/(486/4). -2/81 (12 - (-20 - -21)) + 128/(-12)45/6 -69 Evaluate (3 - 7 - (-2480)/100)/((-560)/(-1400)). 52 What is ((-23)/(-24) - (-22)/429-26)/((-7)/154)? 33/4 Calculate (-2(-10)/(-126))/(1320/(-23760)). 20/7 ((-4)/(-30))/((1400/84)/(-25)) + (-2080)/(-25) 83 -38 + (13 + (-924)/70 - (-426)/30) -24 (20700/(-405) - -56)/4 11/9 Calculate -7 + 6 + -3 + (-47 - (0/9 + -5)). -46 0 - (-19 + 8) - 13 -2 142((-104)/(-48))/((-1261)/291) -71 ((-8)/6((-47430)/(-992))/85)/(2/32) -12 What is the value of 4 + -8814/(-112) + -14 - -89? 90 1(3 + (6 - 0)) + 6027/(-533) -30/13 Evaluate 18820/(-950410) - (-7674)/(-101). -76 Calculate (-1)/(-3) + 302/21 + (-16)/(-56). 15 Calculate (-128)/(-576)(54/(-84) + (-8 - (-186)/21)). 1/21 What is the value of 4/(-72)(807/2152)/((-1)/(-40))? -5/6 Calculate (-10)/24((-16)/50)/((-42)/(-420)). 4/3 Calculate 20/(-520) + (-2745)/(-390) - 226/32. -1/16 1 + (-15 - -2) + (-66 - 1898/73) -104 What is the value of -63 + 170 + -109 - 62? -64 1740/(-976) + (-812)/(-464) -2/61 (2/(-8) - 6/8)(-96 - 51 - -148) -1 Evaluate ((13412/(-234710))/((-1)/4062))/((-1)/(-10)). 116 Calculate (3(19 - 225/18) + -13)/((-10)/4). -13/5 What is (-634/255)/((-24)/600)? 20 What is the value of -19 - (37 + 26952/(-480))? 3/20 What is the value of ((-297)/22 - (41 + -53))/(-8 + 2252/280)? -35 Evaluate ((-10)/(-45))/(130/(-27) + (-128 - -133)). 6/5 What is (-16)/(-18)(-18613)/(-26590)*10/(-252)	{ "pile_set_name": "DM Mathematics" }
ext: -7331314, -14662630, -21993948, -29325268, -36656590? -43987914 What is next in -26041, -51981, -77849, -103651, -129393, -155081? -180721 What is the next term in -631935, -631927, -631919, -631911, -631903, -631895? -631887 What comes next: -80430, -80410, -80392, -80376, -80362? -80350 What is the next term in -3670890, -7341666, -11012442, -14683218, -18353994, -22024770? -25695546 What is next in -1432470, -1432067, -1431664, -1431261, -1430858? -1430455 What is next in -22351, -35161, -47971, -60781, -73591, -86401? -99211 What is next in -7168, -14545, -21924, -29311, -36712, -44133, -51580? -59059 What is next in -50001, -100197, -150375, -200529, -250653, -300741, -350787? -400785 What comes next: 450631, 450644, 450677, 450736, 450827, 450956, 451129, 451352? 451631 What comes next: -185, -1302, -3125, -5624, -8769, -12530? -16877 What comes next: -93, -598, -1527, -2886, -4681? -6918 What is next in -624821, -4998620, -16870345, -39988958, -78103421, -134962696, -214315745? -319911530 What is next in -22468761, -22468760, -22468759, -22468758? -22468757 What comes next: 109593, 438354, 986281, 1753374? 2739633 What is next in 88512, 177065, 265612, 354153, 442688, 531217, 619740? 708257 What comes next: -376089, -376108, -376161, -376266, -376441, -376704, -377073, -377566? -378201 What is next in 1852023, 1852014, 1852003, 1851990, 1851975, 1851958, 1851939? 1851918 What is next in 1467693, 2935383, 4403073, 5870763, 7338453, 8806143? 10273833 What is next in 1998, 2334, 2600, 2556, 1962, 578, -1836? -5520 What comes next: -5205786, -10411569, -15617352? -20823135 What comes next: -48794, -188674, -421808, -748196? -1167838 What is the next term in 4055, 4102, 4241, 4520, 4987? 5690 What is next in 21822, 21981, 22152, 22341, 22554, 22797, 23076, 23397? 23766 What is the next term in -8722531, -8722537, -8722543, -8722549? -8722555 What is the next term in -876, -3005, -5134, -7263? -9392 What is the next term in 10809, 10793, 10775, 10755, 10733, 10709? 10683 What comes next: 656521, 1313281, 1970041? 2626801 What is the next term in -1972620, -3945124, -5917628, -7890132, -9862636, -11835140? -13807644 What comes next: -228799, -229049, -229459, -230023, -230735, -231589, -232579, -233699? -234943 What comes next: 36049, 72455, 108859, 145261, 181661, 218059, 254455? 290849 What is the next term in 4654, 18126, 40584, 72028, 112458, 161874, 220276? 287664 What comes next: -126187, -126319, -126451? -126583 What comes next: -6429, -50381, -169715, -402129, -785321, -1356989, -2154831? -3216545 What is next in -1021, -3086, -6527, -11344? -17537 What comes next: 5637151, 22548597, 50734341, 90194383, 140928723, 202937361, 276220297? 360777531 What is next in 198091, 198110, 198125, 198136? 198143 What comes next: 36761871, 73523756, 110285647, 147047550, 183809471? 220571416 What is the next term in -751020, -751018, -751018, -751020, -751024? -751030 What is next in -2761390, -2761382, -2761376, -2761372, -2761370, -2761370? -2761372 What comes next: -12729, -101702, -343093, -813078, -1587833, -2743534? -4356357 What comes next: 3588, 14312, 32190, 57222, 89408, 128748? 175242 What is next in 14876051, 14876055, 14876059, 14876063, 14876067, 14876071? 14876075 What comes next: -14923, -15893, -16827, -17719, -18563, -19353, -20083, -20747? -21339 What is the next term in -354455, -355104, -356185, -357698, -359643, -362020? -364829 What is next in 26601, 27339, 28079, 28821, 29565, 30311, 31059? 31809 What comes next: 1216331, 1216310, 1216289, 1216268, 1216247? 1216226 What is the next term in 60759, 121453, 182147, 242841? 303535 What comes next: -788, -157, 3266, 10873, 24056, 44207? 72718 What is next in 1738, 13527, 45494, 107719, 210282, 363263, 576742? 860799 What is next in -987941, -1975875, -2963809, -3951743? -4939677 What comes next: -17085, -16776, -16467? -16158 What comes next: -1679, -1578, -1605, -1826, -2307, -3114, -4313, -5970? -8151 What is next in -2321, -18476, -62299, -147620, -288269, -498076? -790871 What is next in 16212, 14649, 13098, 11565, 10056, 8577? 7134 What is next in 6021, 5881, 5647, 5319? 4897 What is the next term in 5069, 20273, 45657, 81227, 126989, 182949, 249113, 325487? 412077 What is the next term in -75064425, -150128848, -225193271, -300257694? -375322117 What comes next: -4546, -4572, -4636, -4744, -4902, -5116, -5392? -5736 What is next in 9521, 18837, 28153, 37469, 46785? 56101 What is the next term in 1179358, 2358680, 3538002? 4717324 What is next in -1054021, -2108046, -3162085, -4216144, -5270229, -6324346? -7378501 What is next in -51248, -204995, -461236, -819971, -1281200, -1844923? -2511140 What is next in -20568, -41168, -61834, -82566? -103364 What comes next: -93070, -93049, -93012, -92959? -92890 What comes next: -1781, -7164, -16159, -28778, -45033, -64936, -88499? -115734 What is next in -923614, -923535, -923472, -923431, -923418, -923439, -923500, -923607? -923766 What is next in 539038, 1077974, 1616908, 2155840, 2694770? 3233698 What is the next term in -874, -3122, -6750, -11758, -18146, -25914, -35062? -45590 What comes next: 240, 292, -36, -924, -2552, -5100, -8748? -13676 What comes next: -6155805, -12311498, -18467201, -24622920, -30778661, -36934430, -43090233? -49246076 What is the next term in 27041, 27203, 27473, 27851? 28337 What is the next term in 15329, 121759, 410597, 973037, 1900273? 3283499 What is next in -36, -1921, -5708, -11391, -18964, -28421? -39756 What comes next: -1117, 1016, 3147, 5276, 7403? 9528 What is the next term in 294953, 294934, 294915, 294896, 294877? 294858 What comes next: 78789, 151957, 225125, 298293? 371461 What is next in 14461688, 28923376, 43385064, 57846758, 72308464? 86770188 What comes next: -69186952, -69186951, -69186950? -69186949 What is next in -1307480, -2614936, -3922400, -5229872, -6537352, -7844840, -9152336? -10459840 What is the next term in 11184, 44138, 99058, 175944, 274796, 395614, 538398? 703148 What is the next term in 608, 4310, 13926, 32276, 62180, 106458? 167930 What is the next term in -1431, -2992, -4633, -6354, -8155, -10036, -11997? -14038 What is the next term in 11743, 46864, 105335, 187132, 292231? 420608 What comes next: -18, -28, -14, 36, 134, 292? 522 What is the next term in -123698, -247452, -371206? -494960 What comes next: -16743, -16839, -17073, -17511, -18219, -19263? -20709 What comes next: -4359, -8607, -12807, -16935, -20967? -24879 What comes next: -581, -1214, -1895, -2642, -3473, -4406? -5459 What is next in -1886, -7842, -17864, -31952, -50106, -72326, -98612? -128964 What comes next: 361782, 361739, 361634, 361437, 361118, 360647, 359994? 359129 What is next in -20878, -21185, -21492, -21799? -22106 What is next in -34090, -68254, -102414, -136570, -170722? -204870 What comes next: -3197, -5075, -5583, -4721, -2489, 1113, 6085? 12427 What is the next term in 55524867, 55524857, 55524847, 55524837, 55524827, 55524817? 55524807 What is the next term in -10773770, -10773731, -10773694, -10773659, -10773626, -10773595? -10773566 What comes next: 4756, 19941, 45560, 81613, 128100, 185021? 252376 What is the next term in 2991, 5911, 8829, 11745, 14659, 17571, 20481? 23389 What is the next term in -18835478, -18835481, -18835484, -18835487, -18835490? -18835493 What comes next: 175907, 175918, 175929? 175940 What is next in 2353, 2946, 3775, 4840, 6141, 7678, 9451? 11460 What is next in -29954, -59962, -89966, -119966? -149962 What is the next term in -11202, -12441, -14508, -17403, -21126, -25677? -31056 What is next in -19221332, -38442668, -57664004, -76885340, -96106676? -115328012 What is next in 215742, 433388, 651034, 868680, 1086326, 1303972? 1521618 What is the next term in 30896, 61122, 91348, 121574? 151800 What is next in 131, -111, -555, -1201, -2049, -3099, -4351? -5805 What is next in -413023, -826123, -1239223, -1652323, -2065423? -2478523 What is next in 6006327, 6006352, 6006375, 6006396, 6006415, 6006432? 6006447 What is the next term in -304490, -1217919, -2740276, -4871543, -7611702, -10960735, -14918624? -19485351 What is next in 81058, 162424, 243788, 325150, 406510, 487868? 569224 What is the next term in 1943, 3797, 5547, 7199, 8759, 10233, 11627	{ "pile_set_name": "DM Mathematics" }
+ 11, 4v + y - 17 = 0. Is v a multiple of 4? True Suppose -42u = -38u - 20. Suppose -5p + 162 = -2p. Suppose uw = 2w + p. Does 11 divide w? False Suppose 3n - 257 + 16 = 4h, 0 = -n + 4h + 83. Does 11 divide n? False Let z = -1 + 1. Suppose 5m - 38 - 12 = z. Suppose -4n = -2n - m. Is n a multiple of 5? True Let d = 8 - 5. Suppose 2b + 36 = di, i - 2b + 3 = 11. Is i a multiple of 7? True Let i(k) = k*3 + 8k*2 - 11. Let x be i(-8). Is ((-1)/1)/(1/x) a multiple of 5? False Let a = -63 + 167. Does 13 divide a? True Let w = -8 + 0. Let y(b) = 10b*2 + 11b + 4b3 - 4b3 + b3. Is 10 a factor of y(w)? True Let r(w) = -6 + w - 6 + 12w + 10. Let b be 16/6 - 4/6. Does 13 divide r(b)? False Suppose -2b = -118 - 68. Let c = -63 + b. Does 15 divide c? True Let n(r) = r*2 - 2r. Does 11 divide n(5)? False Suppose -4j = 5f + 3 - 11, -3f + 27 = -5j. Suppose 3s = fs - 50. Is 15 a factor of s? False Let g(k) = 16k3 - k2 + k + 2. Does 25 divide g(2)? False Let u = 3 + 1. Suppose 4p - 5x - 167 = 0, -ux + 137 = 4p + x. Is p a multiple of 25? False Suppose 2l = 5l - 270. Is 17 a factor of l? False Let x(u) = 2u - 2. Let r(z) = -z + 2. Let p(c) = -3r(c) - 2x(c). Let m be p(-7). Suppose -mj + 8 = -7. Is j a multiple of 3? True Does 43 divide 7/(476/(-8)) - (-2348)/17? False Let z(r) = 3r*2 - 2r - 3. Let n(w) = -w*3 + 8w*2 - 6w - 2. Let o be n(7). Suppose 0 = oa + 10. Is z(a) a multiple of 13? True Let r be -2 + 2 + 3 - 1. Let m(a) = a + 6a*r + 3a + 0a. Is 12 a factor of m(-3)? False Let w(z) be the third derivative of z6/120 - 7z5/60 - z4/3 + 11z3/6 - 3z*2. Is 5 a factor of w(8)? False Let o = 5 + 1. Suppose 4r = or - 26. Is r a multiple of 13? True Suppose 2k + 26 = 3k. Suppose -k - 38 = -2u. Is u a multiple of 11? False Let d(z) = 3z2 + z - 34. Is 33 a factor of d(8)? False Suppose t = -3s + 40, 0t + 2t + s = 65. Suppose -25d + 24d = -t. Is 17 a factor of d? False Let u(g) = -6g + 3. Let j(t) = -t + 1. Let h(k) = 3j(k) - u(k). Is 5 a factor of h(5)? True Suppose -14i = -15i + 16. Is 4 a factor of i? True Suppose 244 = 2w + 2w. Suppose 0k - 47 = -3q - 2k, 0 = -4q - k + w. Is q a multiple of 15? True Let v be 4/(-6) - 267/(-9). Suppose k - 43 = -2c, c = 2k - 0k + v. Is 9 a factor of c? False Let v = -2 + 4. Suppose v = n - 0. Suppose 5a + nb = -0a + 47, -28 = -4a - 4b. Is a a multiple of 11? True Suppose 4p = 7p - 12. Let a(v) = -v + 7. Let i be a(p). Suppose -43 = -ib + h, -2h = 5b + h - 81. Is b a multiple of 7? False Let b be (-21)/(-14) - 19/2. Is 17 a factor of (-270)/b - (-1)/4? True Suppose -4i - 8 + 28 = 0. Suppose -3s + 535 = -0s + 2g, ig = 2s - 325. Suppose h + 4h - s = 0. Is h a multiple of 12? False Let l be (-50)/(-8) - 3/12. Let r = l + -2. Is 2 a factor of r? True Suppose -340 = -2y - 0y. Does 14 divide y? False Suppose -j - 31 + 10 = 0. Let g be -1 - -1 - (-61)/1. Let z = j + g. Does 20 divide z? True Let h(n) = 2n3 - 4n*2 + 4n + 6. Let q(d) = 3d3 - 7d*2 + 8d + 11. Let s(y) = -5h(y) + 3q(y). Is 4 a factor of s(-3)? False Suppose 5u - 16 = -4v, 3u - 9 = -5v + 11. Suppose 0 = 4m - 2m - 10, vw - 19 = m. Is w a multiple of 3? True Let b = -119 - -203. Is b a multiple of 28? True Let u be 9 + (4/(-2) - -4). Let z(i) = i3 - 9i*2 - 9i + 13. Let q be z(u). Suppose -q = -5l + l. Does 10 divide l? False Let o(i) = i3 + 3i*2 - 4i - 2. Let a be o(-4). Is 4 a factor of 5 - (a - -4 - 1)? True Suppose 1 = 3d - 26. Is 3 a factor of d? True Suppose -3z = -5z + 50. Suppose 0 = 4s + j - 2j - 7, 0 = -5j + z. Does 16 divide 4(s - 1)4? True Let i(q) = 9q + 5. Let h be i(4). Suppose 0 = 2r + 5x - h, -2r = 3x + 4 - 51. Is 10 a factor of r? False Let k(m) = -37m - 7. Let w(p) = -18p - 4. Let v(h) = 3k(h) - 5w(h). Does 18 divide v(-3)? False Suppose 0c + 5c - 620 = 0. Does 41 divide c? False Is 50 - ((-24)/(-3))/(-4) a multiple of 13? True Let b(l) be the third derivative of l5/60 + l4/12 + 5l*3/6 + 3l*2. Does 11 divide b(4)? False Suppose -111 = 4k - 415. Let l = -49 + k. Let r = 69 - l. Is r a multiple of 21? True Let k be (-41)/2 - 15/10. Let f = k - -34. Is f a multiple of 12? True Let f(b) = 3b2 + 4b*2 - 8b*2 - 13b - 4. Is f(-7) a multiple of 20? False Suppose 4q = 8, -384 = -3j - j + 4q. Is 14 a factor of j? True Is 21-1 + 138 + -6 a multiple of 26? True Let i be (258/24)/((-1)/(-8)). Suppose 3n + 0c - 68 = 2c, -4n - 2c + i = 0. Is n a multiple of 5? False Let w = -22 + 43. Does 7 divide w? True Suppose 5s - 18 = 3x - 2, 5x = -2s + 25. Suppose 181 + 34 = sb. Is 20 a factor of b? False Suppose -4u + 2h + 4 + 16 = 0, u - 3h = 5. Suppose -317 = -ur - 57. Suppose -6p + 101 = 4l - p, r = 2l + 4p. Is l a multiple of 12? True Suppose -w = w - 2, 5x - 2w + 42 = 0. Let o be -60(-2 + (-8)/(-5)). Let u = x + o. Does 8 divide u? True Suppose 6g - y = 3g + 73, 0 = -4g + 5y + 101. Is g a multiple of 8? True Is 17 a factor of (-66)/297 + 1120/18? False Suppose 0p = -4p - 16. Is 164/14 - p/14 a multiple of 12? True Let g(r) be the first derivative of -3r2 - 3r + 1. Does 5 divide g(-2)? False Does 43 divide (4/8)/((-4)/(-688))? True Let j(w) = -w*3 - 3w*2 - 5w - 5. Let x be j(-4). Let o = -20 + x. Let l = -3 + o. Is 8 a factor of l? True Suppose -2d + 705 = -3d. Let l be (d/10)/((-2)/4). Suppose 9 = 5h - l. Is 15 a factor of h? True Let b(y) = 5y2 + 1. Let i be b(1). Let r(u) = u3 - 3u2 - 3u - 4. Let d be r(4). Suppose d = -c + 3l - il + 26, -4l = 3c - 58. Is 7 a factor of c? True Let u = 106 - 66. Suppose -18 = -3a - a - i, 2i + 4 = 0. Suppose -5j + 3r + u = 0, 4r = -2j + 11 + a. Does 3 divide j? False Is 26/(-6)((5 - 6) + -5) a multiple of 26? True Let q = -10 + 46. Let m be (2/(-2))/(3/(-15)). Suppose q = f + m. Is 11 a factor of f? False Let f be (-2(-2)/(-2))/2. Does 8 divide -4(f + -3 - -2)? True Suppose -3q + 8q - 74 = -v, -5v = -5q - 430. Does 14 divide v? True Suppose 247 = t + g + 44, -4t = -3g - 833. Is 19 a factor of t? False Does 12 divide (-1)/4 + (-9222)/(-24)? True Let h be ((-4)/(-8))/((-2)/(-72)). Suppose m - n - h - 18 = 0, 2m - 5n - 84 = 0. Is 16 a factor of m? True Suppose -3j + 355 = 2j. Is j a multiple of 17? False Let p = 30 - -20. Is 25 a factor of p? True Let a(v) = -v3 - 8v*2 + 9v + 9. Let i be a(-9). Let x = i + -5. Does 2 divide x? True Let i = -44 + 66. Is 11 a factor of i? True Suppose -p + 3p + 4j = 4, 3j - 4 = -2p. Suppose pl = -2l. Let v = l + 4. Is v even? True Let h be 18/4 + (-8)/16. Suppose 0 = -3s - ho + 352, -s + 3o + 26 = -74. Suppose -3b + s = 40. Is b a multiple of 12? True Let f = -17 - -38. Does 16 divide f? False Let m(i) be the first derivative of -i*4/4 + 11i*3/3 + 6i*2 + 3i - 7. Is m(12) even? False Let q(w) be the second derivative of w5/20 + w4/2 + w3/2 - w2 + w. Does 18 divide q(-4)? True Let g(m) = m*3 - 8m*2 + 8m - 4. Let c be g(7). Let d = 4 + c. Suppose 4x - 41 = ds - 2s, -24 = -3x - 3s. Does 9 divide x? True Suppose 0f + 4 = f. Suppose 153 = fq + 53. Suppose 3t - w = q, 5w + 4 = -2t + 15. Does 8 divide t? True Let k(l) be the second derivative of l6/360 + l5/120 - l4/6 + l3/6 + 3l. Let s(v) be the second derivative of k(v). Does 8 divide s(3)? True Is -24(-1 - 0) + 0 a multiple of 12? True Suppose 5h = 5 + 10, 5o = -h + 8. Let n(t) = -4t2 + 60t*3 - 2t*2 + 1 + 4t*2. Is 23 a factor of n(o)? False Let v = -31 + 50. Does 19 divide v? True Suppose 2b = -0b + 4. Suppose -4c + 122 = -2h, -23 = -3c + bc - 2h. Suppose 11 = 5z - c. Does 6 divide z? False Suppose 7v = 17v - 310. Is 31 a factor of v? True Let q(i) = -33i - 4. Does 8 divide q(-2)? False Is 14 a factor of (-1685)/(-30) - 3/18? True Suppose 35 = -2w - 151. Does 12 divide (8/12)/((-2)/w)? False Let p = 16 - 12. Let u(n) = 13n. Is u(p) a multiple of 11? False Suppose -4f + 2n + 147 = -741, 2f - 5n - 428 = 0. Is 32 a factor of f? True Let u(v) = -4v + 8. Let f be (-3)/(-7) - 511/49. Is 12 a factor of u(f)? True Let o = -19 + 32. Suppose 2v - o - 25 = -m, -m + 2v + 46 = 0. Does 21 divide m? True Suppose 2r - 3*r + 2 = 0. Is (35 + r)/(6 -	{ "pile_set_name": "DM Mathematics" }
-584000000 What is 1539.0568719 rounded to zero dps? 1539 What is 0.00028553582 rounded to 5 dps? 0.00029 Round -199073818.62 to the nearest one hundred thousand. -199100000 Round 3607975582 to the nearest 1000000. 3608000000 What is 1536572.3 rounded to the nearest ten thousand? 1540000 What is 1076789.91 rounded to the nearest ten thousand? 1080000 What is 9243306.1 rounded to the nearest 100000? 9200000 What is -27.76800107 rounded to 3 decimal places? -27.768 What is -0.016539236 rounded to 5 dps? -0.01654 Round -501896509 to the nearest one million. -502000000 What is -8511321.682 rounded to the nearest one hundred? -8511300 Round -0.00035463137 to 4 decimal places. -0.0004 What is 0.014886103 rounded to two dps? 0.01 What is 0.00577650021 rounded to 4 decimal places? 0.0058 Round 36.89718 to the nearest integer. 37 Round 0.00009976167168 to 6 dps. 0.0001 Round 238290424 to the nearest 100000. 238300000 What is 1647443451 rounded to the nearest 100000? 1647400000 Round 8349681.46 to the nearest one million. 8000000 Round -0.00003396556039 to 7 decimal places. -0.000034 What is 1344.733494 rounded to zero decimal places? 1345 What is 0.000147439992 rounded to five dps? 0.00015 What is 0.220682149 rounded to two decimal places? 0.22 What is 230.87566 rounded to the nearest ten? 230 What is -19309157.86 rounded to the nearest one thousand? -19309000 Round -4562.4301 to the nearest integer. -4562 What is 0.01022055567 rounded to six decimal places? 0.010221 What is -0.00391321325 rounded to 6 dps? -0.003913 Round 0.00076440608 to five dps. 0.00076 What is -0.09643329214 rounded to four dps? -0.0964 Round -11.94435297 to three decimal places. -11.944 What is -121.83410876 rounded to 3 dps? -121.834 Round -837.0479771 to the nearest 10. -840 What is -0.00010937759 rounded to 5 dps? -0.00011 Round 0.000261696 to 3 decimal places. 0 Round 824398.146 to the nearest 10000. 820000 What is 0.407178346 rounded to 2 dps? 0.41 What is 2365294600 rounded to the nearest 1000000? 2365000000 Round 32.993642 to two dps. 32.99 What is 13190614.1 rounded to the nearest ten thousand? 13190000 What is -19.839434 rounded to 3 dps? -19.839 What is -0.0000018076289 rounded to seven decimal places? -0.0000018 Round 1280283.7 to the nearest one hundred thousand. 1300000 Round 1763373.275 to the nearest one million. 2000000 What is -0.0058998804 rounded to 3 decimal places? -0.006 Round -1242115164.7 to the nearest 100000. -1242100000 Round -842719.143 to the nearest 1000. -843000 What is -3955.36346 rounded to the nearest ten? -3960 What is -5289751.461 rounded to the nearest one million? -5000000 Round 169813.99 to the nearest one hundred. 169800 What is -16936729.02 rounded to the nearest 100000? -16900000 What is 0.120748464 rounded to 4 dps? 0.1207 Round 0.300387056 to 1 dp. 0.3 What is 52965.9031 rounded to the nearest one hundred? 53000 Round 0.001371504735 to six decimal places. 0.001372 Round 21954776.02 to the nearest one thousand. 21955000 What is -175.9901 rounded to one decimal place? -176 Round 50.7185556 to the nearest integer. 51 What is -272762381.5 rounded to the nearest 100000? -272800000 Round -40965.108 to the nearest ten. -40970 What is 333992661.3 rounded to the nearest 100000? 334000000 Round 31018228.2 to the nearest one thousand. 31018000 What is 0.0003146155911 rounded to five dps? 0.00031 Round -0.0038074236 to 4 dps. -0.0038 Round 0.046049859 to 4 decimal places. 0.046 What is 4.2810842 rounded to 2 dps? 4.28 Round -31964.25905 to the nearest 10. -31960 What is 11.738111663 rounded to 3 decimal places? 11.738 What is -0.106389987 rounded to 4 dps? -0.1064 Round -5743.1766 to the nearest integer. -5743 Round 0.000020296498 to 6 decimal places. 0.00002 Round -5061238.91 to the nearest 10000. -5060000 What is 4413842.958 rounded to the nearest 100000? 4400000 What is 0.04531714363 rounded to 5 decimal places? 0.04532 What is 182.7983 rounded to one dp? 182.8 Round 50077.147 to the nearest 10000. 50000 Round -290609.991 to the nearest 1000. -291000 Round -2172107.73 to the nearest one hundred. -2172100 What is 0.0613945182 rounded to two dps? 0.06 What is 24784425.92 rounded to the nearest one thousand? 24784000 Round -0.001155271699 to five decimal places. -0.00116 Round 113244.175 to the nearest 1000. 113000 What is 0.4159934149 rounded to 3 decimal places? 0.416 Round 0.000628255652 to seven dps. 0.0006283 What is -0.00103327335 rounded to four decimal places? -0.001 Round -282513882 to the nearest one million. -283000000 What is -0.0098337641 rounded to three dps? -0.01 What is 25355542.3 rounded to the nearest 1000000? 25000000 What is -3.958635704 rounded to one dp? -4 What is 9325.6914 rounded to the nearest 10? 9330 Round -2.425015 to two dps. -2.43 What is 10953.7 rounded to the nearest 1000? 11000 What is -265662.732 rounded to the nearest ten thousand? -270000 What is 11.95191958 rounded to one decimal place? 12 What is 935925.9689 rounded to the nearest 100000? 900000 Round -0.1032916381 to 5 decimal places. -0.10329 Round -8356065.2 to the nearest one thousand. -8356000 What is -7715.98647 rounded to the nearest 1000? -8000 Round 0.000001097783478 to seven dps. 0.0000011 What is -12.79538655 rounded to one dp? -12.8 What is -17039.3561 rounded to the nearest one hundred? -17000 Round -4408.58719 to the nearest ten. -4410 Round -0.068741598 to five decimal places. -0.06874 What is -0.459997516 rounded to 3 dps? -0.46 What is 270982115 rounded to the nearest one hundred thousand? 271000000 Round -1507.203843 to 2 dps. -1507.2 What is -2643749.16 rounded to the nearest 10000? -2640000 Round -3.077778195 to one decimal place. -3.1 Round 0.00001004928679 to seven dps. 0.00001 What is -3.237877776 rounded to three dps? -3.238 Round -65610.626 to the nearest 10. -65610 Round -0.000650616936 to six decimal places. -0.000651 What is 10935429700 rounded to the nearest 1000000? 10935000000 Round -178.1965618 to 1 dp. -178.2 Round -1847660.549 to the nearest one hundred. -1847700 What is -4.2817579 rounded to one decimal place? -4.3 Round 883.9531185 to 1 dp. 884 Round -1.3493231926 to four decimal places. -1.3493 Round 0.0000557161846 to 6 dps. 0.000056 What is 992.528953 rounded to one decimal place? 992.5 What is 1579144.349 rounded to the nearest 10000? 1580000 Round -0.000087854959 to 7 decimal places. -0.0000879 Round 0.0002597382163 to 6 decimal places. 0.00026 What is -4.17714128 rounded to two decimal places? -4.18 What is 0.000067186887 rounded to 7 dps? 0.0000672 Round 0.00000132997879 to seven decimal places. 0.0000013 Round -0.0097401848 to 3 dps. -0.01 Round 167.336182 to the nearest integer. 167 Round -145.5319815 to 2 dps. -145.53 What is -4129.6032 rounded to the nearest integer? -4130 Round 0.0084414734 to 6 dps. 0.008441 Round -0.04956713847 to four decimal places. -0.0496 Round 13.2774598 to 3 dps. 13.277 Round -92034307 to the nearest 1000000. -92000000 Round -486425.221 to the nearest 10. -486430 Round 0.0003481900878 to 4 dps. 0.0003 Round 398.227222 to the nearest ten. 400 What is -4.739535498 rounded to 4 dps? -4.7395 Round -0.00000011820066 to 7 dps. -0.0000001 What is -0.0000032801092 rounded to seven decimal places? -0.0000033 Round -0.1147261373 to 3 decimal places. -0.115 What is 0.0000087894719 rounded to 6 dps? 0.000009 What is 1630.39772 rounded to the nearest one thousand? 2000 What is -5943.2638 rounded to the nearest 100? -5900 What is 15870.14174 rounded to the nearest 100? 15900 Round 0.0043506048 to 5 decimal places. 0.00435 Round -9345560.752 to the nearest 100. -9345600 Round -29.3256882 to 2 decimal places. -29.33 What is 0.069947936 rounded to 4 dps? 0.0699 What is -0.042923122 rounded to 5 dps? -0.04292 What is -7783864.4 rounded to the nearest one hundred thousand? -7800000 What is 141196106.11 rounded to the nearest one million? 141000000 What is -178.0098842 rounded to the nearest ten? -180 Round -0.334467764 to 1 dp. -0.3 What is 1.662658644 rounded to three decimal places? 1.663 Round 89.1322457 to 3 dps. 89.132 Round 4651209682 to the nearest 1000000. 4651000000 What is -2967.20166 rounded to the nearest ten? -2970 What is 0.00104465859 rounded to 6 decimal places? 0.001045 Round -0.00402	{ "pile_set_name": "DM Mathematics" }
scending order. -2, p, d Let q(t) = -2t + 9. Let k be q(-6). Let v = k + -23. Let d = 1 + -4. Put 3, v, d in decreasing order. 3, v, d Let n be 1 - (6 - (-1 + 3)). Sort 1, 3, n, -1 in increasing order. n, -1, 1, 3 Suppose 5k + 0 - 5 = 0. Let l(p) = -p*3 + 25. Let n be l(0). Let f = -20 + n. Put -11, f, k in descending order. f, k, -11 Suppose 0 = -y + 6y - 20. Let m(o) = 17o + 3. Let u(a) = -12a - 2. Let c(k) = -5m(k) - 7u(k). Let z be c(y). Sort z, -3, 1 in increasing order. z, -3, 1 Let s = -0.4 + 0.8. Suppose -130p + 129p - 5 = 0. Put p, 0.5, s in descending order. 0.5, s, p Let w = -23 - -38. Let q be (-1)/(-3) - 95/w. Suppose -4y + 0y - 16 = 0. Put q, y, 5 in descending order. 5, y, q Suppose 3s + 2s - 20 = 0. Suppose 0 = -sp - 0p + 16. Let o be 2/(-2)(-2 + -1). Sort o, -1, p in decreasing order. p, o, -1 Suppose 27i - 816 = 39i. Sort -1, 2, 1, i in increasing order. i, -1, 1, 2 Let t = 0 + -0.4. Let c be 93/(-60) - 738/(-410). Sort c, t, -4, -1/3 in descending order. c, -1/3, t, -4 Let l = -4.9 + -2.1. Sort 0.2, l, -18 in ascending order. -18, l, 0.2 Let g(s) = 2s*2 - 4. Let r be g(2). Suppose 0 = rj + 5v - 11, -3j + 4v + 10 + 6 = 0. Sort 2, j, -3. -3, 2, j Let i = -3.9855 + -0.0145. Sort i, -0.01, 1, 3 in ascending order. i, -0.01, 1, 3 Let z be -1(4/(-2) - 0). Let q be (z/4)/(2/(-8)). Let o be -5(0 + (-2)/q). Put o, -1, 1 in decreasing order. 1, -1, o Let r(o) = o2 + 7o. Let n be r(-7). Suppose 40 - 20 = -4g. Sort g, -4, n, 4 in ascending order. g, -4, n, 4 Let y be (16 - (-598)/(-39))/((-2)/6). Put 5, 7, y in decreasing order. 7, 5, y Let d = 0.3 - 0.4. Let l(w) = -w2 + 1. Let s be l(-2). Let q be s/(2 - (-28)/(-8)). Put q, d, -3/4 in descending order. q, d, -3/4 Let r = 1.7 + -2.7. Sort 38, r, -3 in descending order. 38, r, -3 Let n = 2380 - 59509/25. Let i = -37/75 - n. Let f = 1.6 + -2. Sort -5/2, f, i. -5/2, f, i Suppose 3h + 2x + 2 = -0h, -h - 24 = -4x. Let o(i) = i2 - 7i + 12. Let n be o(4). Suppose 2p = p - 1. Sort n, p, h in descending order. n, p, h Let q = 322 - 329. Put -4, 4, q, 3 in descending order. 4, 3, -4, q Let y(p) = -2p + 42. Let n be y(22). Sort n, -3, 42 in ascending order. -3, n, 42 Let w = 0.255 - -3.805. Let b = 4 - w. Let k = -0.6 + -2.4. Put 1/5, k, b in ascending order. k, b, 1/5 Let x be 1 + 30/(-27) - (-1708)/549. Sort 14, 4, x, -1 in descending order. 14, 4, x, -1 Suppose 3s - x - 11 = 0, 5s = -3x + 10 - 1. Suppose 5n = sn + 10. Suppose -25 = g + 4g. Sort 0, n, g in descending order. n, 0, g Let h = -3499/70 - 14/5. Let q = 105/2 + h. Let m = -475/7 - -68. Put m, -4, q in descending order. m, q, -4 Let q be 0/2 - 22/(-10). Sort q, 0.2, 0.1, -4/11 in decreasing order. q, 0.2, 0.1, -4/11 Let b = 1101 - 1092. Put -38, b, -1 in descending order. b, -1, -38 Let l = 0.49 - 0.47. Sort 4, -2, l, 2. -2, l, 2, 4 Let a(y) = y - 2. Let w be a(-5). Let k(b) = 2b - 4. Let d(f) = f - 2. Let u(m) = wd(m) + 4k(m). Let i be u(-1). Put -5, i, -4 in descending order. i, -4, -5 Let b = -3/40 - -113/440. Sort 0.2, b, 1 in decreasing order. 1, 0.2, b Let p(k) = -58k2 + k + 2. Let t be p(-1). Let d = 115/2 + t. Let w = 3 + -1. Sort 0.1, d, w in increasing order. 0.1, d, w Suppose -55 = -4y - d - 2d, -3d = 3y - 39. Suppose yt - 14t = -18. Let i = -13 - t. Sort -1, i, -0.1. i, -1, -0.1 Let v = -20 - -19.64. Let d = v + -0.14. Sort -3, d, -0.3 in descending order. -0.3, d, -3 Let a = -429.7 - -430. Sort 8, -2, a, 4/7. -2, a, 4/7, 8 Suppose 0 = -2l + 8, r + 5l - 22 = -0r. Suppose 5h = -3f + 1 - 2, rh = -3f + 5. Put 7, 1, f, 2 in decreasing order. 7, f, 2, 1 Let i = -23.69 - 3.31. Sort 3, 0, i in ascending order. i, 0, 3 Let m = 6 + -7. Suppose 0 = 13a - 3a + 50. Sort m, a, -1/9. a, m, -1/9 Let d = -14 + 10. Let t be (1 + d)(-4)/6. Suppose 0 = 5n + 4u - 3, -3n - n - 5u = 3. Sort n, t, -11. -11, t, n Suppose -13m + 9m = -3z - 25, 4m = -z + 13. Put z, -2, 97, 2 in increasing order. z, -2, 2, 97 Let o = 0.7 - -19.3. Let i = -24 + o. Let x be -1(-2 - (-14)/6). Put -4/5, x, i in descending order. x, -4/5, i Let n be (-1 - -1) + 27/9. Let m(k) = -k + 3. Suppose 4j = -a - 3a + 24, -4j - 3a = -21. Let v be m(j). Sort 1, v, n in increasing order. v, 1, n Let y be 12/(-15) + (-456)/5 + 3. Let m = y - -88. Put m, 3, 1 in decreasing order. 3, 1, m Let j be 15/3(2 + -3). Let h = 1 - 0.5. Let v = 709/2 - 355. Sort v, h, j. j, v, h Let f = 5 + -9. Let p(q) = -q3 + 28q*2 + 30q - 34. Let z be p(29). Sort -1, f, z in ascending order. z, f, -1 Let z = 80 - 79.8. Let x = -4 + 7. Sort z, 0, x. 0, z, x Suppose 0 = -2t + 3 + 1. Suppose ty - 7 + 43 = 0. Let q be 12/(-42) + y/(-14). Sort q, -2, -1 in descending order. q, -1, -2 Let x = 0.116 - 0.016. Let i = -3.96 - 0.04. Sort i, -2, x in decreasing order. x, -2, i Let y = 18 - 10. Let v be (-53 - -50)4/(-3). Sort v, -2/5, y in descending order. y, v, -2/5 Suppose 3j = 7j - 32. Suppose 11 = -z + j. Sort 1, z, 3 in increasing order. z, 1, 3 Let r = 1.6 + -18.6. Suppose 3u = 2g - 11 + 1, u + 1 = 3g. Let w = 749 - 749.5. Put u, r, w in decreasing order. w, u, r Let k be (60/50)/(27/90). Sort 32, k, 3, 1 in descending order. 32, k, 3, 1 Let x = -21 - -1. Let w be (1 + 1)/(x/50). Let v be 6/w(-30)/(-9). Sort v, 7, 2 in increasing order. v, 2, 7 Let j be 24/(-20)30/27. Let g be 0/(-4) - 5/(-3). Sort g, -0.3, j. j, -0.3, g Suppose 5l = -4a - 18, -3a + 43l - 45l - 10 = 0. Put 98, a, 4, -4 in ascending order. -4, a, 4, 98 Suppose -5f + c = 27, 0 = 4f - 3c - 20 + 46. Put -3, f, 123 in decreasing order. 123, -3, f Let g(o) = -o*3 - 7o*2 - 7o - 3. Let a(j) = -3j + 30. Let s be a(12). Let b be g(s). Put 0.2, b, 0 in ascending order. 0, 0.2, b Let x = 269 + -268. Sort 5, x, 1/8, 0.2. 1/8, 0.2, x, 5 Suppose 4v = 5s + 841, -v - 2v = 2s - 602. Suppose 0 = -39z + 43z - v. Put 1/4, 0.2, z in increasing order. 0.2, 1/4, z Let t = -43 + 25. Let v = -55 + 32. Let r = v - t. Sort 5, r, 1 in increasing order. r, 1, 5 Let w = 8.7 - 8.5. Put 8, 0.5, w in decreasing order. 8, 0.5, w Suppose 0 = 3328k - 3323k + 15. Put 138, 4, k in decreasing order. 138, 4, k Suppose -19 = -5m - 4. Suppose 2z + x - 2 = -mz, -3x = -z + 10. Sort z, -15, -2. -15, -2, z Let w = -7 + 1. Let t(h) = -h2 - 5h + 3. Let f be t(w). Suppose 0y + 5y + 25 = 0. Put y, -6, f in decreasing order. f, y, -6 Let f be 4/6 + -2 - -1. Let j(l) = l*3 + 13l*2 - 11l + 39. Let r be j(-14). Let g = 0.9 + -0.6. Put r, g, f in increasing order. r, f, g Let y(x) be the second derivative of -x*5/20 + 5x*4/6 - 4x*3/3 - 3x*2 + 8x. Let d be y(9). Put d, -2, 2 in descending order. d, 2, -2 Let f = -0.406 - -3.406. Sort f, -4, 0.046 in descending order. f, 0.046, -4 Suppose 15c + 20 - 5 = 0. Let p be (-44)/(-10) - (-4)/(-10). Sort -2, p, -7, c. -7, -2, c, p Let m(a) be the first derivative of a2/2 - 5a - 13. Let p be m(6). Suppose 3z - n + 8 = 0, p = -4z - n - 5. Sort z, -5, -11 in ascending order. -11, -5, z Let y(l) = -5l + 76. Let n be y(16). Sort n, -12, 1 in descending order. 1, n, -12 Let a(f) = 31f + 94. Let m be a(-7). Sort 3, m, 1. m, 1, 3 Suppose 4j + 2 = -5t - 2, 3j = -3t. Suppose 2i = -ji - 12. Put i, 4, -5 in ascending order. -5, i, 4 Let p = 56.973 + -57. Let x = p + 0.427. Let g(j) = j*2 + 4j - 3. Let t be g(-4). Put t, x, 1/6 in decreasing order. x, 1/6, t Let q be (-78)/(-390) + (-42)/10. Let k = -2 + 7. Sort q, k, 0, -6 in descending order. k, 0, q, -6 Let i = 2.52 + -2.89. Sort -0.4, i, -0.1, -2 in ascending order. -2, -0.4, i, -0.1 Let y(w) = -w*2 + w - 2. Let z be y(2). Suppose 8p = 76 - 12. Put z, -5, p in descending order. p, z, -5 Let p = -32 - -42. Let o = 1 - p. Sort 1/7, -3, o in decreasing order. 1/7, -3, o Let d = 0.4127 + 0.1573. Sort d, -2, 3/4, -1. -2, -1, d, 3/4 Let b be ((-3)/(-6(-2)/(-32)))/6. Put b, 2/15, 1/2 in ascending order. 2/15, 1/2, b Let l = 3.8 - -1.2. Let q be -199/24 + 4. Sort l, q, -1/4 in descending order. l, q, -1/4 Let x be (-12)/(-18) - 129/(-9). Suppose 0 = xu - 5u. Let v(o) = o*2 + 3o - 1. Let q be v(-4). Put u, -4, q in descending order. q, u, -4 Let h be -10*(3/2)/3. Put 3, h, 1 in ascending order. h, 1, 3 Let d = 298 - 297.7. Put -65, -1, -1/6, d in increasing ord	{ "pile_set_name": "DM Mathematics" }
ctor of 6 and 48? 6 Calculate the highest common divisor of 18 and 22. 2 What is the highest common divisor of 8 and 22? 2 What is the highest common divisor of 18 and 1200? 6 What is the highest common divisor of 218 and 6? 2 Calculate the greatest common divisor of 22 and 352. 22 What is the greatest common divisor of 320 and 56? 8 Calculate the greatest common divisor of 48 and 4848. 48 Calculate the highest common factor of 1387 and 95. 19 What is the greatest common factor of 5018 and 26? 26 What is the highest common factor of 45 and 17505? 45 What is the highest common factor of 1 and 47? 1 What is the highest common divisor of 7533 and 31? 31 Calculate the greatest common divisor of 36 and 900. 36 Calculate the highest common factor of 108 and 720. 36 What is the greatest common factor of 12 and 8? 4 Calculate the highest common divisor of 84 and 1932. 84 What is the greatest common factor of 5778 and 54? 54 Calculate the greatest common divisor of 16 and 216. 8 What is the highest common factor of 87 and 29? 29 What is the greatest common divisor of 17 and 391? 17 What is the greatest common factor of 74 and 11174? 74 What is the greatest common divisor of 250 and 50? 50 Calculate the highest common factor of 52 and 3068. 52 Calculate the greatest common divisor of 413 and 472. 59 Calculate the highest common factor of 105 and 777. 21 Calculate the greatest common factor of 485 and 3589. 97 What is the highest common divisor of 1196 and 26? 26 Calculate the highest common divisor of 342 and 38. 38 What is the highest common factor of 67 and 67? 67 What is the greatest common factor of 306 and 162? 18 What is the highest common factor of 75 and 495? 15 Calculate the highest common factor of 36 and 1926. 18 Calculate the highest common factor of 2680 and 134. 134 What is the greatest common factor of 1125 and 315? 45 Calculate the highest common factor of 20 and 4340. 20 Calculate the greatest common divisor of 44 and 8. 4 Calculate the highest common factor of 1666 and 170. 34 What is the greatest common factor of 20 and 45? 5 What is the greatest common divisor of 234 and 54? 18 Calculate the greatest common divisor of 272 and 120. 8 What is the highest common factor of 1734 and 340? 34 What is the greatest common factor of 296 and 3996? 148 Calculate the highest common factor of 468 and 1092. 156 Calculate the highest common divisor of 2408 and 84. 28 Calculate the greatest common divisor of 57 and 912. 57 Calculate the highest common divisor of 208 and 3408. 16 What is the highest common factor of 24365 and 55? 55 Calculate the highest common divisor of 2121 and 91. 7 Calculate the highest common factor of 104 and 51532. 52 Calculate the greatest common divisor of 44 and 748. 44 Calculate the highest common factor of 300 and 12. 12 What is the greatest common factor of 20803 and 71? 71 Calculate the highest common divisor of 92 and 8234. 46 Calculate the highest common factor of 207 and 24. 3 Calculate the greatest common factor of 301 and 28. 7 What is the highest common factor of 63 and 126? 63 Calculate the greatest common divisor of 1624 and 29. 29 Calculate the highest common factor of 41 and 11275. 41 Calculate the greatest common divisor of 425 and 6035. 85 What is the highest common divisor of 490 and 560? 70 What is the greatest common divisor of 12446 and 127? 127 What is the highest common factor of 263 and 1? 1 Calculate the greatest common factor of 710 and 160. 10 Calculate the greatest common factor of 70 and 238. 14 Calculate the greatest common divisor of 495 and 285. 15 What is the highest common factor of 369 and 82? 41 What is the greatest common factor of 43 and 129? 43 Calculate the greatest common divisor of 25 and 8075. 25 What is the greatest common factor of 5805 and 135? 135 Calculate the highest common factor of 2587 and 26. 13 What is the highest common factor of 187 and 221? 17 Calculate the greatest common divisor of 819 and 1456. 91 Calculate the highest common divisor of 3283 and 67. 67 Calculate the greatest common factor of 22 and 6. 2 What is the greatest common divisor of 528 and 348? 12 What is the highest common divisor of 82 and 8? 2 Calculate the highest common factor of 456 and 437. 19 Calculate the greatest common divisor of 198 and 684. 18 What is the highest common factor of 408 and 360? 24 Calculate the highest common divisor of 477 and 424. 53 What is the greatest common factor of 14 and 10654? 14 What is the highest common factor of 13 and 26? 13 What is the highest common divisor of 207 and 9? 9 Calculate the greatest common divisor of 3 and 1461. 3 Calculate the greatest common divisor of 77 and 1463. 77 What is the greatest common factor of 11 and 352? 11 What is the highest common factor of 440 and 154? 22 What is the highest common divisor of 168 and 792? 24 Calculate the greatest common factor of 6 and 981. 3 What is the greatest common divisor of 43 and 1075? 43 What is the greatest common divisor of 1472 and 23? 23 Calculate the greatest common factor of 198 and 451. 11 What is the highest common factor of 165 and 231? 33 Calculate the highest common divisor of 2265 and 570. 15 Calculate the highest common divisor of 20 and 620. 20 Calculate the greatest common factor of 28 and 98. 14 Calculate the greatest common divisor of 162 and 36. 18 Calculate the greatest common divisor of 96 and 216. 24 Calculate the highest common factor of 304 and 38. 38 Calculate the highest common factor of 172 and 1118. 86 What is the greatest common divisor of 9563 and 262? 131 Calculate the greatest common divisor of 470 and 3666. 94 What is the greatest common factor of 247 and 52? 13 What is the greatest common divisor of 33 and 5346? 33 Calculate the highest common divisor of 2989 and 61. 61 Calculate the highest common divisor of 120 and 1240. 40 What is the highest common factor of 1975 and 790? 395 Calculate the greatest common divisor of 60 and 24. 12 What is the greatest common factor of 7173 and 9? 9 Calculate the greatest common divisor of 46 and 36202. 46 Calculate the greatest common divisor of 726 and 6. 6 Calculate the greatest common divisor of 57 and 102. 3 Calculate the highest common factor of 444 and 204. 12 What is the greatest common divisor of 760 and 80? 40 What is the highest common factor of 203 and 928? 29 What is the highest common factor of 1557 and 9? 9 What is the greatest common divisor of 139 and 5143? 139 What is the highest common divisor of 56 and 144? 8 What is the greatest common divisor of 15 and 55? 5 What is the greatest common divisor of 103 and 3? 1 Calculate the greatest common divisor of 288 and 45. 9 Calculate the greatest common factor of 581 and 7. 7 Calculate the highest common factor of 1512 and 702. 54 What is the highest common divisor of 142 and 781? 71 What is the greatest common divisor of 144 and 160? 16 Calculate the highest common factor of 2216 and 24. 8 What is the greatest common factor of 34 and 374? 34 What is the highest common divisor of 15833 and 213? 71 What is the greatest common factor of 420 and 7910? 70 What is the greatest common divisor of 476 and 204? 68 What is the highest common divisor of 20 and 500? 20 What is the highest common factor of 1807 and 143? 13 Calculate the highest common factor of 845 and 481. 13 What is the highest common divisor of 320 and 3980? 20 What is the highest common divisor of 48 and 12? 12 What is the highest common factor of 220 and 60? 20 Calculate the highest common divisor of 47 and 423. 47 What is the highest common factor of 3 and 669? 3 What is the highest common divisor of 319 and 580? 29 What is the greatest common divisor of 2538 and 94? 94 Calculate the greatest common factor of 793 and 39. 13 What is the highest common factor of 15 and 183? 3 What is the highest common factor of 860 and 140? 20 Calculate the highest common factor of 15 and 4525. 5 What is the highest common divisor of 852 and 12? 12 What is the greatest common factor of 36 and 252? 36 Calculate the greatest common factor of 42 and 10. 2 What is the greatest common factor of 98 and 1344? 14 What is the greatest common factor of 39 and 117? 39 Calculate the greatest common factor of 50 and 980. 10 What is the great	{ "pile_set_name": "DM Mathematics" }
Let q(u) = 1202u + 4. Let h be q(2). Suppose 7r - h = -r. Suppose 14m + r = 1477. What are the prime factors of m? 2, 3, 7 Let y(c) = 37c*2 + 48c - 901. What are the prime factors of y(24)? 21563 Let i(x) = -7x - 199. Let z be i(-31). Let r(n) = 4n - 25. What are the prime factors of r(z)? 47 List the prime factors of (((-19204)/(-16))/1 - 2)/((-3)/(-84)). 7, 4793 Let c be ((-1)/3)/((-4)/(-36)). Let v be -2 + (-288 - c)/(-5). Suppose -v = 12p - 343. What are the prime factors of p? 2, 3 Let v = -373 + 375. Suppose 266 = vy - 1234. List the prime factors of y. 2, 3, 5 Let q(s) = -2s3 - 5s*2 + 3s + 6. Let p be q(-6). Let j(a) = a*3 + 41a*2 + 4. Let d be j(-41). Suppose dz + z = p. What are the prime factors of z? 2, 3 Suppose 5f + 6x - 7x - 41977 = 0, 41963 = 5f + x. What are the prime factors of f? 2, 3, 1399 List the prime factors of 1340(-26)/(-12)(-2268)/(-315). 2, 3, 13, 67 Let j = 56717 - 27475. What are the prime factors of j? 2, 14621 Let q(w) = -w*3 + 6w*2 - 3w - 36. Let h be ((-10 - -1) + -1)(-7)/(-14). List the prime factors of q(h). 2, 127 Let c be 353052/441 + (1 - (-11)/(-7)). Suppose 5l - 5a - 3970 = 0, -l + 0l = 5a - c. What are the prime factors of l? 3, 5, 53 Suppose 0 = 135x - 136x + 9. Suppose xj = 11j, 2z - 5j = 1824. What are the prime factors of z? 2, 3, 19 Suppose 0 = 3a, -6h = -2h + 4a - 2248. Let b = 1019 - h. What are the prime factors of b? 457 Let m(x) = -x3 + 51x*2 + 29x - 243. What are the prime factors of m(29)? 2, 5, 191 Let q(i) = i*2 - 18i + 26. Let d(b) = -b*3 + 11b*2 - 9b - 21. Let l be d(10). What are the prime factors of q(l)? 3, 5, 23 Let d(o) be the second derivative of 7o2 + 2o*3 - 5o*2 - 13o3 + o2 - 8o. List the prime factors of d(-3). 2, 3, 17 Let q be ((-4)/(-28) - 1)/(12/(-42)). What are the prime factors of (-9459)/(-6)2/q? 1051 Suppose 8 + 48 = 8b. Suppose -bv - 5 = -8v. What are the prime factors of (-1561)/(-35) + (-3)/v? 2, 11 Let d(l) = -7l*3 - 7l - 14. Suppose -5c = 3c - 16. Let r(j) = j*3 - 2j*2 - j - 1. Let b be r(c). What are the prime factors of d(b)? 2, 7 Suppose -972c + 968c + 8 = 0. Suppose 4k + 2109 = cp + 5301, 3k + 2p = 2394. List the prime factors of k. 2, 3, 7, 19 Let f(c) = 16c*2 + 13c - 8. Let q be f(1). Let g(h) = 2h2 - h - 4. Let b be g(3). Let o = b + q. List the prime factors of o. 2 Suppose -12t + 16t + 36 = 0. List the prime factors of 5(-7)/(21/t). 3, 5 Let m be 10/30(0 + 0). Suppose 3j + m = -4i + 5, 3i = -j. What are the prime factors of j + 5 + -4 - -108? 2, 7 Suppose 54s = 45s. Suppose 72f - 65f - 3500 = s. What are the prime factors of f? 2, 5 Suppose -10h + 30 = 5h. Suppose 0 = -3x, 4x = 3i + hx - 1539. List the prime factors of i. 3, 19 Let h(k) = -43k2 - k + 48k*2 + 3 + 6k. Let j be h(-5). Let r = 15 + j. What are the prime factors of r? 2, 59 Suppose -w + 16204 = 5p, p = -4w - 704 + 3960. List the prime factors of p. 2, 3, 5 Let n(b) = 119b3 + b2 + 3b + 13. Let c be n(-2). Let p = -485 - c. List the prime factors of p. 2, 3, 19 Let k be (-3 + -3)((-66)/4)/3. Suppose 2q + k = 209. Suppose 0 = -4n - 0n + q. What are the prime factors of n? 2, 11 Suppose -416449 = -88f + 226127. What are the prime factors of f? 2, 3, 1217 Let l(m) = 6m - 87. Let g be l(17). What are the prime factors of g - (50/20 + (-2)/(-4))? 2, 3 Let d(t) = -t3 + t2 + 19 - 27 + 32 + 8t. List the prime factors of d(-7). 2, 3, 5 Suppose 4l - 5 - 21 = -3q, 5l = 2q - 2. List the prime factors of (424/q)/((-20)/(-60)). 2, 53 Let x = -109 + 119. Let v(f) = 15f - x - 32f + 22f. What are the prime factors of v(3)? 5 Let n(d) = 19d - 1. Let l be n(18). Suppose -10k = -819 - l. Suppose k = w - g, 0 = 3w - 4w - 3g + 128. What are the prime factors of w? 7, 17 Let s(p) = 46p + 33. Let c(g) = -46g - 31. Let r(k) = 3c(k) + 2s(k). Let d be ((-2)/6)/((-1)/(-12)). List the prime factors of r(d). 157 Let k = -11186 + 17791. List the prime factors of k. 5, 1321 Let l = 9632 - -371. What are the prime factors of l? 7, 1429 Let f be ((-33)/(-2))/(1/12). What are the prime factors of f2/(-43/(-18))? 2, 3, 11 Let v(s) = -s + 8. Let u be v(6). Suppose -uw = 4w + 24. Let r(f) = -f2 - 2f + 15. List the prime factors of r(w). 7 Suppose 0 = -76x + 93x - 34. Suppose -3d + 4023 + 1394 = -xv, 4d - 7215 = -5v. List the prime factors of d. 5, 19 Let v = -204 - -196. What are the prime factors of (-65 - v)20/(-5)? 2, 3, 19 Let i be 25((-143)/260 + 6/8). Suppose -4k = iv - 2k - 1485, -3k = -3v + 891. List the prime factors of v. 3, 11 Let f(w) = -17w*2 + w - 2. Let c be f(1). List the prime factors of 156/c + 1899. 2, 947 Let h be 0 + 1 + -5 + (11 - 10). Let l = 14 - h. Suppose -276 = lq - 20q. What are the prime factors of q? 2, 23 Let r(a) = -a*3 + 18a*2 + 21a - 38. Let t be r(19). Suppose t = 7s - 2611 - 343. What are the prime factors of s? 2, 211 Suppose -11y = -2y - 333. Suppose -f + 1 = 0, -3f + 94 = 3x + y. What are the prime factors of x? 2, 3 Suppose 111173 - 39773 = 12b. List the prime factors of b. 2, 5, 7, 17 Suppose -q - 10q = 0. Suppose 4n = -3u - qu - 12, 5n + 5u = -10. What are the prime factors of (-80)/24(-1)/(n/(-99))? 5, 11 Let m be -1 - (12/15)/(1/(-5)). What are the prime factors of (-6 + 95 + -1)/(1/m)? 2, 3, 11 Suppose -18l + 23l + 360 = 0. Let j be 1329/(-27)1 + (-16)/l. List the prime factors of j/(1/(-10)2). 5, 7 Let p(z) = -z3 + 13z*2 + 17z - 2. Let h be p(-7). Suppose -2d + 504 = 4a, 3d + 2a - h = -115. List the prime factors of d. 2, 3, 41 Let s be (6 + 0)/(-1 + 3). What are the prime factors of (8/s - 2)/(14/4893)? 233 Let k(p) = -p*3 + 8p*2 + 3p - 5. Let x be k(9). Suppose -2n + 19 = -m, -238m + 233m - 60 = -5n. What are the prime factors of x/(-4) + n/28? 3, 5 Suppose -48j + 126 = -45j. Suppose jh - 38h - 176 = 0. Suppose 0 = -hr + 43r + 138. What are the prime factors of r? 2, 3, 23 List the prime factors of (-9683 + -4)/((63/28)/(-3)). 2, 3229 Suppose -40o = -31o - 153. Suppose 13g - og + 1184 = 0. List the prime factors of g. 2, 37 Let q be (4 - 11)19. Let f(l) = l*3 + 19l*2 - 54. Let p be f(-19). What are the prime factors of (p/5)/(q/420)? 2, 3 Suppose 0 = -2c + 2h - 10, 9h - 14h + 25 = -c. Suppose -19u + cu = -2850. List the prime factors of u. 2, 3, 5 Let n = 11258 - 5144. List the prime factors of n. 2, 3, 1019 Suppose f + 8 = 18. Suppose 15h = fh + 3400. What are the prime factors of h? 2, 5, 17 Suppose -87k + 85k = 4i - 7824, -2k - 2i = -7836. What are the prime factors of k? 2, 3, 109 Let x be 8 - (3/12 + 22/8). Suppose 0 = xb - 1235 - 870. Suppose -b = -4p + 2p - 3i, 648 = 3p - i. List the prime factors of p. 5, 43 Let k = 38 - 62. What are the prime factors of (-584)/(-6)k/(-16)? 2, 73 Suppose -10s = 6s + 1248. Let k = 80 + s. Suppose 5u - kn - 455 = n, 4u + 4n - 332 = 0. What are the prime factors of u? 2, 11 Let w(v) = -7v - 42. Let j be 7 - (-375)/(-55) - (-112)/(-11). Let p be 43/(-5) - (-4)/j. List the prime factors of w(p). 3, 7 Let m(v) = -2v*2 + 104v + 478. What are the prime factors of m(48)? 2, 431 Let d(s) = -50s2 + 28s - 26. Let a be d(1). List the prime factors of 1017 - (a/(-120) + 34/(-10)). 2, 3, 5, 17 Let s(d) = 2d2 + 39d + 235. Let j be -4 + 120/(-5 - 0) - 5. What are the prime factors of s(j)? 2, 563 What are the prime factors of (-74620)/(-246)336/10? 2, 7, 13 Let j(q) = -q3 + q2 + 2q + 31. Let a(p) be the second derivative of -p*4/12 + 3p*3/2 - 4p*2 - 9p. Let c be a(8). What are the prime factors of j(c)? 31 Suppose 87c - 112c + 50650 = 0. List the prime factors of c. 2, 1013 Suppose 0 = -3o - 4h - 1186, 59o - 55o + 2h = -1598. Let q = 467 - o. What are the prime factors of q? 11, 79 Suppose 1 = -2z + 4j - 151, 4j = 12. List the prime factors of (864/(-60))/(3/z). 2, 3, 7 Suppose -o + 31446 = -2n, 4o - 2n + 3n - 125802 = 0. What are the prime factors of o? 2, 5, 17, 37 Let c(o) = 37 - 17 - 15o - 26o2 + 79 - o3. List the prime factors of c(-26). 3, 163 Suppose -4n + 4v - 6260 = 0, 3n - 2n - 5*v + 1545 = 0. List the prime factors of 98/21 - 5 - n/3. 523 Let g(q) = 9	{ "pile_set_name": "DM Mathematics" }
osite? True Let z = 4191 - 2161. Suppose -z = -2b - 4o, -o - 1054 = 5b - 6102. Is b a composite number? False Let p = -341938 - -663857. Is p a prime number? False Suppose 5r + 18 - 63 = 0. Suppose 3c = -3, 5f - 7c = -11c - r. Is 10954/10 + f - 10/25 a prime number? False Let o = 779929 - 413772. Is o a prime number? False Is ((-11430471)/(-15))/23 - (1 + 33/(-15)) prime? False Suppose 4923l = 4919l + 234404. Is l a prime number? True Let j(y) = 2066y2 + 253y - 20. Is j(-11) composite? False Let p(d) = 866 + 208 - 7d + 6983. Is p(0) prime? False Is ((-875762)/18)/(123/(-1107)) a composite number? False Suppose -4123 + 12096 = 7s. Suppose 3l = 2w + 1756, -2l - 6w + w + s = 0. Let k = l + -91. Is k prime? True Let f(o) = o*3 + 10o*2 + 2o - 5. Let z be f(-11). Suppose 14p = b + 15p - 278, 4p = -2b + 562. Let t = z + b. Is t composite? False Let f(g) = 511g3 + 4g*2 + 44g - 53. Is f(10) a prime number? True Let z(v) = 23v3 + v2 + 8v - 7. Suppose 4b - 10 = m, 5b + 0m - 5m = 5. Is z(b) a prime number? True Is (3437562/(-15))/(7 + (-6)/(150/185)) composite? False Let s = 83066 - -456927. Is s composite? False Let y = 126436 + -39513. Is y a prime number? True Suppose 0h = -6h - 6h + 211764. Is h a composite number? True Suppose -3q + 8q - 140 = -5g, 0 = 3g + 12. Suppose -5w - 3p = q, p = -2w - 2w - 20. Let b(s) = 24s*2 - 10s - 5. Is b(w) composite? False Suppose -2d - 16585 - 24613 = 0. Let h = 38328 + d. Is h prime? True Suppose 5r = 4g - 2800170, 208g - 5r + 3500235 = 213g. Is g a prime number? False Suppose -74h + 79h = 80605. Suppose -h = -3n - 0k + 2k, 5k = -2n + 10722. Is n a composite number? True Let d(k) = k2 - 5k - 24. Let m(g) = 3g - 10. Let y be m(6). Let h be d(y). Suppose -3x + 2u + 1087 = h, 4x = -x - 3u + 1837. Is x a composite number? True Suppose 2i = 166g - 164g - 272794, 3i + 136385 = g. Is g a prime number? True Let g(j) = 599j + 6181. Is g(14) a composite number? True Let k(c) = -c*3 - 15c*2 - 27c - 7. Let p be k(-13). Is -10p/12 + 1764 composite? False Let u be 6/(10/((-120)/(-18))). Suppose 0 = uh + 3d - 3464, 6h + 3d = 12h - 5226. Is h prime? False Suppose -134u + 34920 = -129u. Is (22/3)/(48/u) prime? False Let j = -68 - -72. Let p(r) = -jr - 11 - 24 + 9 + 3r*2. Is p(11) a prime number? True Suppose 0 = -3f - 22 - 53. Is (3 + -2)/(f/(-77725)) prime? True Let j(t) = -6639t + 1789. Is j(-30) a composite number? True Suppose 19 = -m + k, -3k + 53 = -3m - 2k. Let c(y) = -2y3 - 4y*2 - 8y - 27. Is c(m) composite? False Let v = 214 - 209. Suppose -vd + 3910 = -8145. Is d composite? False Let y(u) = 6u + 44. Let x be y(-7). Suppose -xq + 3q = 133. Is q a prime number? False Let w(b) be the second derivative of b*5/20 + 19b*4/12 - 7b*3/2 + 17b*2 + 42b. Is w(-15) a composite number? False Suppose -4 = 4g - g + 4a, 2g = -5a - 12. Suppose gl - 268 = 3y, 3y - 23 = -l + 44. Suppose -72b = -lb - 14695. Is b prime? True Suppose -3m - 54126 = -3w, 2m - 4m = -5w + 90207. Is w composite? False Let o = 182 + -38. Suppose 7m + 83 + 470 = 0. Let x = o + m. Is x composite? True Suppose -3l = w - 3, -3l - 9 = 4w - w. Let z(x) = x*3 + 3x*2 + 4x + 5. Let q be z(w). Let v = 418 + q. Is v a prime number? False Let q = 7112 + -4003. Is q a composite number? False Suppose -14t + 28t = 0. Suppose 0 = -5i + 3h + 24536, -3i - 5h + 3278 + 11464 = t. Is i a composite number? False Suppose -6627f + 6613f = -2977114. Is f prime? True Let v(s) = 8218s2 + 31s + 18. Is v(3) prime? False Let o = 2183180 + 1373391. Is o a prime number? True Suppose -1074 = -28q - 3986. Let r(z) = 8z*2 + 3z + 1. Let p be r(6). Let k = p + q. Is k a prime number? False Let u = 390219 - 210710. Is u a prime number? False Suppose 5217 = 3w - 2j, 2j - 1739 = -w - 2j. Suppose 0 = 5q - 2n - 2226, n + 260 = -5q + 2477. Let d = q + w. Is d a composite number? True Suppose 129 = -x + 3b, 6x - 10x - 5b - 482 = 0. Let p = x + 131. Suppose 0 = 7n + pn - 15855. Is n a prime number? False Let q(s) = 818s*3 + 14s*2 - 20s + 101. Is q(7) prime? False Suppose -11z + 13z - 175258 = -4h, -z + 4h = -87611. Is z a composite number? False Let j = -218 + 223. Let p(w) = 87w - 4. Is p(j) composite? False Let n(z) = -411z*2 - 10z + 29. Let s(c) = -1234c2 - 28c + 86. Let k(t) = -7n(t) + 2s(t). Is k(6) a prime number? False Suppose 4c - 718544 = 4l, 898177 = 5c - 15l + 11l. Is c prime? True Let a(r) be the third derivative of 27r5/20 + r4/12 + 2r3/3 - 129r*2. Let t(i) = 2i*2 - 2i - 1. Let z be t(2). Is a(z) a prime number? True Suppose 8a - 1482 = -5a. Suppose -119d = -ad - 8795. Is d a prime number? True Let g(j) = j3 + j2 + 2j + 4. Let m = 6 - 6. Let z be g(m). Is (-1)/z + 5706/72 a prime number? True Let f = 910 + -1456. Let b = -1436 + 317. Let a = f - b. Is a prime? False Let x(d) be the first derivative of -d2 - 39 - 1/3d*3 + 781d. Is x(0) prime? False Let n be 20(-18)/4 - (65 - 60). Let l = 5652 + n. Is l a prime number? True Let g(a) = a2 - 10a + 17. Suppose 6c = c + 45. Let t be g(c). Suppose p = i + i - 1006, t = 2p. Is i prime? False Suppose 5v + u - 933959 = 856867, 4u + 1074491 = 3v. Is v a prime number? False Let x(w) = 15802w*2 + 1150w - 15. Is x(-8) prime? False Let n(a) = -a*3 + 9a*2 - 2a + 118. Let p be n(10). Is ((-402381)/(-315))/(p/(-10)) a prime number? False Let y = -899009 + 2280440. Is y a prime number? False Let k(a) = -159a - 3. Let s be k(-6). Let y(g) = 19g + 211. Let c be y(-11). Suppose -cr + s = r. Is r a prime number? True Let o(c) = -31 + 47c + 11c - 7 + 5. Let y(n) = -115n + 66. Let d(u) = 11o(u) + 6y(u). Is d(-10) composite? True Let g(j) = 3j. Let d be g(-2). Let r(n) = 21n*2 - 3n + 41. Let w(t) = t*2 - t + 1. Let q(a) = r(a) - 6w(a). Is q(d) prime? True Suppose 5 + 4 = 3i. Let r be (2289 - (0 + 0))i. Suppose -l + 17526 = n + r, -4n = -l + 10679. Is l a composite number? False Let d(p) = 99p*3 + 9p*2 - 39p + 134. Is d(5) a prime number? True Suppose -226a + 44886377 = -101040125 - 21819060. Is a a composite number? True Let u(q) = 32q*2 + 8q - 33. Let f(w) = 7w + 32. Let r be f(-7). Is u(r) prime? False Is ((-1491)/1988)/(1(-6)/142616) a composite number? False Let d = 469 + -497. Is (-239055)/(-21) + 16/d composite? False Let h be -3 + 10 - (0 + 1). Suppose 0 = -3l - 3m + 3645, -hm + 11m + 2402 = 2l. Is l composite? True Let c(s) be the first derivative of 97s*3/3 - 11s*2 - 53s + 60. Is c(-6) a prime number? True Let f = 245953 - 151384. Suppose -21o - 8o + f = 0. Is o a prime number? False Suppose 0 = -0n + 9n - 45. Let v be (n/(-3) - -1)(7 - 13). Suppose 0 = vz - 270 - 310. Is z a prime number? False Suppose 0i = -10i. Suppose 3w + 17c - 18c - 27773 = i, -2c - 27775 = -3w. Is w a composite number? False Let g(l) = 4l*2 - 4l + 4. Let q be g(1). Suppose 5x - q = 4x. Suppose -xa - 2m + 530 = -8, 2a - 263 = 5m. Is a a prime number? False Suppose 13g + 82 = 17. Is (((-163010)/3)/g)/(36/54) prime? True Let p be 52620/9 + (15/(-9) - -1). Suppose p = y + 1143. Is y a composite number? False Suppose -343a + 30909808 = -39a. Is a a prime number? False Suppose -2t - o - 2o = -7, 8 = 4t + 4o. Let b be -1(-3)/t - -306. Let w = 796 - b. Is w composite? True Let j(h) = 22h2 + 4h. Let v be j(-4). Let w(s) = v - 21s - 367 - 199s. Is w(-5) a composite number? False Suppose 0 = 5n - 3x - 13, n + n + 1 = -5x. Suppose -i + 5g + 1419 = 0, ni - g = 2106 + 750. Suppose 5w + 324 = i. Is w prime? False Suppose 0 = -3a + 2y + 27149 + 137862, -2y - 55009 = -a. Is a prime? True Let r = -362128 + 558150. Is r a prime number? False Suppose 107p - 12949311 - 5631174 = 35029618. Is p composite? False Is (-12598)/(-13 + 12) - 19 a prime number? True Suppose -106v + 79090 = -104v - 4b, -4b = 3v - 118675. Is v composite? True Let b be 5(-2 + 64/20). Suppose -bj - 48 = -14j. Suppose -jz = z - 7511. Is z composite? True Is (837827 - 1)/(-188 - -190) a composite number? True Suppose -5q + 19 = -3s, 4s + 17 = -0s + 5q. Suppose 4z = 3a + 10393, 0 = -sz - z + 5*a + 7792. Is	{ "pile_set_name": "DM Mathematics" }
k(d) wrt d? -6 Suppose -4j - 2l = -177 + 51, -4j - 5l = -117. Let a = 35 - j. What is the second derivative of -13w2 - 9w*2 + 4w*a + 33w wrt w? -36 Let h(i) be the second derivative of -1/3i3 + 0 - 13/4i*4 + 0i*2 - 1/10i*5 - 103/30i*6 - 90i. What is the third derivative of h(j) wrt j? -2472j - 12 Find the first derivative of 2407b*3 + 28b - 260 - 28b + 401 wrt b. 7221b*2 Let f(h) = -8835h*2 + 40h - 688. Let g(n) = -2209n2 + 10n - 172. Let m(q) = 2f(q) - 9g(q). Find the second derivative of m(v) wrt v. 4422 Let l(r) be the first derivative of -r*9/12 - 8r*5/5 - 62r*2 - 32. Let w(j) be the second derivative of l(j). Find the third derivative of w(a) wrt a. -5040a3 Let f(g) = -g2 - 5 + 2g2 + 14 - 8g + 5. Let c be f(6). Find the first derivative of 27 + w*c - 14 + 4w*2 wrt w. 10w What is the third derivative of -102g3 + 811g*2 + 1938g*2 - 2g*4 - 558g*2 + 4g*4 wrt g? 48g - 612 Let o be 1/(-2 + (-10)/(-4)) + 3. Suppose -5d + o = -5. Find the third derivative of 8 + 9a*d + 12a*3 - 8 wrt a. 72 What is the first derivative of 780j*3 - 25j*3 + 579j*3 - 450 wrt j? 4002j*2 Let f(v) = 2v4 + v3 + 2v2 - 1. Let i(u) = -33u*4 - 9u*3 - 13u*2 - 23. Let x(a) = 6f(a) + i(a). Find the third derivative of x(b) wrt b. -504b - 18 Let j(i) be the first derivative of 1/2i*2 + 30i + 1/4i4 - 65/3i*3 + 82. Find the second derivative of j(p) wrt p. 6p - 130 Let h(c) be the third derivative of -17/3c3 + 0c + 7/120c5 + 0 + 9c*2 + 5/4c*4. Let j(m) be the first derivative of h(m). Differentiate j(s) wrt s. 7 Let w(y) be the third derivative of 0 - 11/5y*5 + 0y + 26y2 + 0y*4 - 11/6y*3. Find the first derivative of w(u) wrt u. -264u Suppose -5i - 56 = -12i. Let o = 18 - i. Find the third derivative of -ob5 - b2 + 7b*2 - 11b*2 wrt b. -600b*2 Let p(a) be the first derivative of -44a - 95 - 47/2a2. Find the first derivative of p(f) wrt f. -47 Let h(j) be the first derivative of 9029j*3/3 - 3263j*2 + 2952. Find the second derivative of h(t) wrt t. 18058 Find the first derivative of -960 + 27107w*2 + 21w - 27107w2 - 19w*3 wrt w. -57w*2 + 21 Let v(a) = 167a3 - a2 + 4a - 2. Let m be v(1). Find the second derivative of y3 + 8y*3 - 183y + 9y3 + y2 - 3 + my wrt y. 108y + 2 Find the second derivative of -2 - 13l*5 + 0 + 65532l*4 + 13708l - 65940l4 + 2 wrt l. -260l*3 - 4896l2 Let x(r) = r2 - 6r - 24. Let d be x(9). Let i = -21 + 26. What is the second derivative of 9n*i - 17n + 3 - d wrt n? 180n3 What is the third derivative of 6v + v*3 + 43v*6 - 44v + 19v + 82v - 3v2 wrt v? 5160v3 + 6 Let v(a) be the second derivative of -a6/15 - 139a5/20 + 157a3/3 + a2 + 1566a. What is the second derivative of v(n) wrt n? -24n*2 - 834n Suppose 18t = -4y + 17t + 1038, 0 = -y - t + 261. Find the first derivative of 142 - 144 + 67c*2 - y + 0c + c wrt c. 134c + 1 Let p(t) be the first derivative of 1992t*5 + 95t*3 - 9t*2/2 - 2t + 2265. What is the third derivative of p(q) wrt q? 239040q Let j(s) be the second derivative of 351s*6/10 + 265s*3/2 - 60s + 10. What is the second derivative of j(t) wrt t? 12636t2 Let t = -50 + 51. Let b be (0/t - -51)/3. Differentiate -2 - ba*4 + 10a*4 - 17 - 16a*4 wrt a. -92a*3 Let j(f) be the second derivative of -1516f*6/5 - 7f*4/6 - 44f3/3 - f2/2 - f + 3498. Find the third derivative of j(q) wrt q. -218304q Let g(x) = -1549x*2 - 20x + 250. Let a(r) = -2r2 + 4r + 7. Let h(t) = -6a(t) - g(t). Find the first derivative of h(z) wrt z. 3122z - 4 What is the derivative of 670m - 165m + 577m - 113 - 28 - 30 wrt m? 1082 Let g be (2 - (-44)/(-12))72/(-40). Find the third derivative of 29p2 + 75p*2 + 2 - 819p + 151pg + 819p wrt p. 906 Let i(h) be the third derivative of -h*7/105 + 13h*6/3 - 236h*5/15 - 2032h*2. What is the third derivative of i(g) wrt g? -48g + 3120 Let q(d) be the second derivative of 0d2 - 16d*3 - 6/5d*5 + 0d*4 - 120d - 2. What is the second derivative of q(h) wrt h? -144h Let x(k) = -k3 + k. Let m(t) = 274t3 - t2 + 3t. Let b(h) = -m(h) + 5x(h). Let y be b(-1). Differentiate 8q2 + 16 + yq - 278q wrt q. 16q Let d = -44 - -74. Suppose -w + 36 = d. Find the third derivative of -1 + 21n3 + 7 - w + 13n*2 wrt n. 126 Let m(x) be the second derivative of -791x*5/20 - 239x*4/4 + 2636x. Find the third derivative of m(c) wrt c. -4746 Let x(k) = k*2 + k + 4. Let q be x(0). Let i be 9/(-27)-21 + -2. What is the second derivative of 0r4 + ir + r*q + 2 - 2 wrt r? 12r*2 Let a(n) = -69n*3 + 41n + 4. Suppose -6o = -8o - 2. Let w(j) = 1. Let m(d) = oa(d) + 4w(d). Find the second derivative of m(t) wrt t. 414t Let f(a) = -978a - 1316. Let x(n) = -24. Let g(p) = -2f(p) - 6x(p). Differentiate g(c) with respect to c. 1956 Let r(l) = l*2 - 5l + 15. Let j be r(3). What is the derivative of jm + 5m - m*2 + 1699 - 1671 wrt m? -2m + 14 Suppose 0 = 2n + 7 - 17. Let b(g) be the second derivative of 0g*3 - 3/2g*2 + 0g*4 + 3/2g*n + 19g + 0. Differentiate b(m) with respect to m. 90m2 Differentiate -42a*4 + 8a*4 + 5a*4 + 656a*2 - 4436 + 27a*4 wrt a. -8a*3 + 1312a Let f(v) be the first derivative of -2967v7/7 - 2v*3/3 - 192v + 246. What is the third derivative of f(u) wrt u? -356040u3 Let w be 15/9 - (-3 + 2 - (-48)/72). Let l(s) be the first derivative of 0s - 7/4s4 + 6s*3 + 0s*w - 10. What is the third derivative of l(v) wrt v? -42 Let o be (-205915)/(-3)18/15. Differentiate 149 + 99 - oy + 82531y with respect to y. 165 Let o(g) = -g + 23. Let c be o(20). Suppose -n + c = 1. Find the third derivative of 0w2 - 9w*n - 8w*4 + 2w*4 wrt w. -144w What is the first derivative of 3576r2 - 1582r*2 + 866 + 102 - 1363r*2 wrt r? 1262r Find the second derivative of 7f2 + 2246f*5 + 4962f + 478f5 - 7f*2 - 1965f wrt f. 54480f3 Let m(j) = -5043j*2 + 3000j - 12. Let a(g) = 5035g2 - 3001g + 18. Let r(k) = -2a(k) - 3m(k). Find the second derivative of r(n) wrt n. 10118 Let y(p) be the second derivative of 52p7/21 - 436p*3/3 - 186p + 3. What is the second derivative of y(o) wrt o? 2080o3 Let l(c) = 12 + 13 - 28. Let b(h) = -74h + 14. Let v(g) = -b(g) - 3l(g). What is the first derivative of v(k) wrt k? 74 Let b(w) be the third derivative of 0w + 12w2 - 13/10w*5 + 0w*3 + 1 + 17/24w*4. What is the second derivative of b(v) wrt v? -156 Find the third derivative of -71v*2 + 2023884v*3 - 2390v*2 - 549v*6 - 2023884v*3 wrt v. -65880v*3 Let o(k) be the third derivative of 0 + 0k*5 + 0k - 1/112k8 + 0k*7 + 0k*6 - 7k*2 - 29/24k*4 - 1/3k*3. Find the second derivative of o(m) wrt m. -60m*3 Let j(f) = f + 1. Let g be j(2). Suppose gu = 2l + 2l + 22, 0 = u + 2l + 6. What is the third derivative of 7x5 - x5 + 193xu - 185x*2 wrt x? 360x*2 Suppose 3q = 4w - 24, 3q - 2w - 7 = -37. Let y = q + 33. Find the first derivative of -yz*2 + 58z*2 - 23z*2 + 18 wrt z. 28z Let f = 241 - 238. What is the third derivative of -y*3 + 11y*4 + 2006y*2 + 2y*f - 2127y*2 + 12y*4 wrt y? 552y + 6 What is the derivative of -2654 + 21h4 - 93h*3 - 20h*4 - 406h*3 wrt h? 4h*3 - 1497h*2 Let s(d) be the first derivative of 109d*4 + 1012d + 438. Differentiate s(z) with respect to z. 1308z2 What is the third derivative of -1 + 1 + 253205c*2 - 534c*5 - 51c - 253207c2 wrt c? -32040c*2 Find the second derivative of 1934w + 5833w + 1627689w*2 - 1621948w*2 wrt w. 11482 Let z(s) be the third derivative of -2293s*6/40 - 445s4/24 + s3/2 - 2374s2. Find the second derivative of z(x) wrt x. -41274x Let q = -5105 - -5109. Let m(w) be the first derivative of qw2 + 0w + 0w3 + 19/2w*4 + 21. Find the second derivative of m(a) wrt a. 228a Differentiate -1127p3 + 4p - 240679 - 10p2 + 3p*2 + 242372 + 7p*2 with respect to p. -3381p*2 + 4 Let b(l) = 56l*2 + l - 60. Let j(p) = -55p*2 - p + 61. Let v = 614 + -619. Let w(n) = vb(n) - 6*j(n). What is the first derivative of w(a) wrt a? 1	{ "pile_set_name": "DM Mathematics" }
2i + 4, 2w = i + 3 for w. 3 Solve -1 = 3o + 4g, -o + g + 16 = 7 for o. 5 Solve 3a = 2l - 5l + 12, -4 = -a for l. 0 Solve -5i = 3x + 16, -7i - 3x = -9i - 19 for i. -5 Solve 0 = 4c + 5a + 19, 8c - 5a = 7c + 14 for c. -1 Solve -5 = o, -20 = -m + 3o - 7 for m. -2 Solve 5 = -3v - 4, -3z - 2v = -3 for z. 3 Solve 0 = 3u + 3z - 21, -4u = u - 4z + 1 for u. 3 Solve 5f - 11 = -u + 7, 5f - u = 12 for f. 3 Solve -4v - 5b + 25 = 0, 8v + 3b - 15 = 6v for v. 0 Solve -3t + 3f + 3 = 0, 0 = -5t - 3f - 2 - 1 for t. 0 Solve -8d = -5d + 2f - 1, 0 = 3d + 4f + 7 for d. 3 Solve -5p + 2c + 4 = c, -2c = 2p - 4 for p. 1 Solve -2s - 4r + 4 = 0, -s + 3r + r - 4 = 0 for s. 0 Solve 5h - 3 = -2s + 3, 4s - 2 = -5h for s. -2 Solve 0a - 4a + 4m = -12, 4m + 11 = 5a for a. -1 Solve -2k + 19 = -5d, d = 2d + 5k - 7 for d. -3 Solve 3q = b + 33 - 24, -14 = 2b - 5q for b. 3 Solve r = 5u - 15 - 5, 0 = -4u - 5r + 45 for u. 5 Solve 8 = -5x + 28, 2s + x - 4 = 0 for s. 0 Solve 4w + 26 = -2j, -250w + 5j = -251w - 29 for w. -4 Solve 0 = 2h + 4j + 6 + 18, -2j - 8 = -h for h. -2 Solve -4m = -d - 1, -5d - 6m - 27 = -4m for d. -5 Solve 5w - 45 = 5g, 6 = -3w - g + 13 for w. 4 Solve 0 = 2l - 5w - 15, 4w = 9l - 37 - 12 for l. 5 Solve 15 = -5u, 0q - 5q = 5u - 5 for q. 4 Solve 2c + 4o = -12, 4c + 16o - 9 = 19o for c. 0 Solve -4k = -2k + a + 3, 5a = 3k + 37 for k. -4 Solve -7w - p = -4w - 14, -2p + 16 = 2w for w. 3 Solve -2z + 5 = m + 2m, -2m - z = -3 for m. 1 Solve 45 = -3p - 9z, -10z + 20 = -15z for p. -3 Solve -5j - 9 = m + 13, 0 = 2j + 2m + 4 for j. -5 Solve -3y = -4v + 42 - 47, 0 = 5y - 2v + 1 for y. -1 Solve 0p - 4 = -p + i, 4i = -20 for p. -1 Solve 2t - 4c = -14, -4t - c = -0t + 19 for t. -5 Solve -w - z - 3 = 0, 18w + 5z = 20w - 22 for w. 1 Solve -3g - 19 = -0g + k, 3g = -5k - 35 for g. -5 Solve 12 = -3q + g - 3g, -3q - 12 = -2g for q. -4 Solve -13h + 8h = z + 21, z = -4h - 16 for h. -5 Solve 2a + 2 = 2y, 3y - 5 = -4a - 2y for a. 0 Solve 0 = -2h + 3z + 3, -z - 10 = 5h + 8 for h. -3 Solve 0 = -0i + 3i - 5n + 32, -20 = -5n for i. -4 Solve 4i = -8, -2q - q = -2i - 19 for q. 5 Solve -6 = -2o - 2g + 8, 0 = -o - 2g + 11 for o. 3 Solve 5v = -2s + 29, s = 6s + 4v - 30 for s. 2 Solve 3 = -z + 5u + 13, -4z + 6 = -3u for z. 0 Solve 5z - 13 = -14l + 11l, 3l - 22 = 4z for z. -1 Solve 0 = 5r + 10x - 8x - 11, 3x = 4r - 18 for r. 3 Solve -5h + 4h - 5l - 1 = 0, -4l - 4 = 0 for h. 4 Solve 9 + 0 = -5x + 4z, -7 = 5x - 2z for x. -1 Solve 0 = -5s - 4c + 23, -2s = 4c - 7 - 7 for s. 3 Solve 5l = 2k + 26, -4l + k = -1 - 18 for l. 4 Solve -5j = -10j - 4r, -4j = -2r for j. 0 Solve 0 = 3j - 5x + 31 - 6, -5x = -j - 15 for j. -5 Solve 4q + 16 = 5v, -32q = -27q + 2v + 20 for q. -4 Solve -5t - 9 = -2m, 0m + 3m - 2 = -4t for m. 2 Solve 4j + 28t = 32t + 16, -3t = -2j + 9 for j. 3 Solve -5a = 0, -5b + 8a = 3a + 5 for b. -1 Solve 0 = 3l - 3r - 12, l = -l - 2r for l. 2 Solve 0 = -s + 2o + 17, 0 = 12o - 10o + 8 for s. 9 Solve 2d + 2 = -2o - 2o, 0 = 3o - d - 1 for o. 0 Solve 4q + 2x = -3x + 15, 0 = -3q + 5x - 50 for q. -5 Solve -29 = 2z + 105q - 100q, -3z - 3q = 21 for z. -2 Solve 46m - 4x - 4 = 44m, -4m + 2x + 2 = 0 for m. 0 Solve l = -a - 4l - 18, -l + 6 = -3a for a. -3 Solve -5k - 28 = -7p + 8p, -p + 3k + 12 = 0 for p. -3 Solve -4d - 2c + 31 = 1, c - 10 = -d for d. 5 Solve -6b + 3 = -8b + 5t, -8 = 3b - 4t for b. -4 Solve -3o + o + 3b = 8, 4b - 20 = -2o for o. 2 Solve -2 = -2s + 4n + 2, -4s + 2n = 10 for s. -4 Solve 0 = d + 3g + 3 - 1, -5g - 8 = 4d for d. -2 Solve 2w = -5a + 24, -w + 2 = -5a + 20 for a. 4 Solve 15 = 5r - 0, -2g - 3r - 1 = 0 for g. -5 Solve -2x - 5c - 26 = 0, -13 = 5x + c + 6 for x. -3 Solve -6c + 3c + 3h = -3, -h + 29 = 5c for c. 5 Solve -5f = g - 5g + 15, 3f = -3g + 18 for f. 1 Solve -p - 4 = n, 6n + 16 = -p + 2n for p. 0 Solve 0j - j + 11 = -3n, 0 = j + 4n + 3 for j. 5 Solve 5f + 5v - 15 = -0v, 2v - 2 = -f for f. 4 Solve 5l - 4j - 2 = 0, 3j = -2j - 15 for l. -2 Solve 5q = -4z + 16, 4q + 23 - 43 = -5z for z. 4 Solve 32 = 5n + 3a, -8 = 2n - 0a - 4a for n. 4 Solve -2j - y = -1, 3j + 2y - 16 = 6j for j. -2 Solve 3u - 4b = -20, 0b = -3u + 3b - 15 for u. 0 Solve 5s - 16k - 7 = -13k, 3s - 45 = -5k for s. 5 Solve -m = 2r - 4r + 8, -4r + 4m + 16 = 0 for r. 4 Solve 2w - 38 = -r - 35, 21 = 4w - r for w. 4 Solve 3f = 47m - 48m + 9, 3m + 2f - 6 = 0 for m. 0 Solve -5p = 0, -2c + 1 - 3 = -4p for c. -1 Solve -h + 17 = 3i, -h + 2h + i - 7 = 0 for h. 2 Solve -d + 5w = 14 + 13, -5w + 31 = -3d for d. -2 Solve 2h + 2 = z + 5, -3h - 4z = -21 for h. 3 Solve 21 = -3c - 2d, 3d + 2 = -c - 12 for c. -5 Solve 22y + 3k = 17y + 10, -2y + 13 = 3k for y. -1 Solve 2i = z, -4i + 5z + 2 - 8 = 0 for i. 1 Solve -12x = 2q - 7x - 12, 8 = 4x for q. 1 Solve 0 = y + 2m + 7, 5y + m - 21 = 5m for y. 1 Solve 5c = 5d - 1 + 11, c + d + 4 = 0 for c. -1 Solve -3p - 2o = 2o + 9, -3o - 3 = p for p. -3 Solve -20 = -4c + 4i, 0 = 3c - i + 3i + 10 for c. 0 Solve 1 = -k, -3b = -0b + 5k + 5 for b. 0 Solve -11s - 3k = -6s + 3, 23 = -s + 5k for s. -3 Solve 5r = -j - 3, 5r + 1 = j - 3j for j. 2 Solve -y = -2y - 5n - 29, -3n = 4y + 31 for y. -4 Solve -4x + 223u - 18 = 221u, 0 = u - 1 for x. -4 Solve -5a - z - 8 = 0, -3a - 8 = -4a - 5z for a. -2 Solve 0y = 5y + 3s - 6, 2 = 5y + s for y. 0 Solve -b = -3s + 1, -18s + 20s - b - 1 = 0 for s. 0 Solve -4y + 24 = -4a - 7y, 3a + 4y = -25 for a. -3 Solve 0f + f + 3a = -4, -5f + 4a = 20 for f. -4 Solve -7 = 2r - 3t, 2t - 40 + 38 = 2r for r. 4 Solve -6q - 14 = -h, -q - 11 = 4h + 8 for q. -3 Solve 6 = -3t + 5y + 1, -5t + y = 1 for t. 0 Solve -3a + 5g = 35, -g - 21 = 6a - a for a. -5 Solve -2d - 2 = w, -4w = -d + 4 + 4 for w. -2 Solve 2u + 21 + 8 = -5a, 2u + 19 = -3a for a. -5 Solve 117 = j + 4n + 122, -2j - 3n - 10 = 0 for j. -5 Solve s - 4 = x, 0 = -5s - 5x + 34 - 24 for s. 3 Solve 5m - 5g = 35, 8m - 4m + 2g - 4 = 0 for m. 3 Solve 3x - 36 = -3v - 60, 2x + 8 = 0 for v. -4 Solve p = -4m - m + 4, 5m + 5p - 20 = 0 for m. 0 Solve 0 = 5f + 5, 5u - 28 = -3f - 6 for u. 5 Solve -13 - 22 = 5o - 5l, -4l + 12 = 4o for o. -2 Solve 0 = 4b + 2g + 22, 3b - 26g = -29g - 21 for b. -4 Solve -9 = -m + 4m, -2k - 4m - 2 = 0 for k. 5 Solve y - 31 = -4m - 45, 8 = -2m for y. 2 Solve 2x + 5o - 10 = 20, -4o + 21 = x for x. 5 Solve -19g = -16g + 5z + 5, -2g + 2z = -18 for g. 5 Solve 4f + 9 = -u - 0, 0 = 5f + 2u + 15 for f. -1 Solve 2l + 3l + 2g = 0, 0 = -4l + 3g for l. 0 Solve -4s + 15 = -h, 0s = 4h + 4s for h. -3 Solve 2l - l = -4n - 19, 4l + 8 = n for l. -3 Solve 2u + 25 - 13 = 4q, -5q + 5u = -15 for q. 3 Solve -30 = 3h - 3n, 3 = -3h - 2n - 2 for h. -5 Solve 8j + o = 5j + 10, 2j = 4o + 30 for j. 5 Solve -5g = -63p + 62p - 20, -5p + 30 = g for p. 5 Solve -x - 4u = -3, 7x + 5u + 12 = 11x for x. 3 Solve 0 = -3x + 4q + 15 + 6, q + 3 = 0 for x. 3 Solve -5t = -25, 0 = -i + 3i + t - 3 for i. -1 Solve 0 = -4l + 4q - 8, 9 = -l + 2q + 3 for l. 2 Solve -5a + 2z + 3 = 16, 4z - 5 = 3a for a. -3 Solve -2l + 4d + 8 = 0, l = 5d + 5 + 2 for l. 2 Solve 8 = 2r, -3c = -5r + 29 - 9 for c. 0 Solve 2n = -4c - 4, -4c = -4n + 2n + 20 for c. -3 Solve 5s - 17 = -5t + 3, -4s - t + 7 = 0 for s. 1 Solve 5s - 3o = 14, 0 = 2s + 3o - 19 + 5 for s. 4 Solve 3w = -3l - 0l, 0 = -3w + 5l - 8 for w. -1 Solve 4r = 3q + 20, -3q + q - 16 = -4r for r. 2 Solve -4v + 6 = -7s + 37, 3s = -4v + 19 for s. 5 Solve 4h - 15 = 5u, -4u - 6 - 6 = 4h for h. 0 Solve -5m + 2v + 22 = 0, 27 = -2v + 15 for m. 2 Solve t - 5k - 13 = -27, -5k = -10 for t. -4 Solve -m - 17 = 38w - 42w, 0 = 2m + 5w - 31 for m. 3 Solve 0 = -3d + 3k + 6, 0d + d + k - 4 = 0 for d. 3 Solve -2u + 40 = 3u + 3s, 0 = s - 5 for u. 5 Solve 0 = m, -5m - 62 + 82 = -5s for s. -4 Solve -5a - 4o = -56 + 16, a + 1 = o for a. 4 Solve -10t = -2d - 11t + 1, 0 = -4d + t - 1 for d. 0 Solve -4*l + 4	{ "pile_set_name": "DM Mathematics" }
(-6)? 26 What is the remainder when 7/21 - (-1200)/72 is divided by 12? 5 Let x be 129/(-15) - (0 - 21/35). Calculate the remainder when (-4)/(x2/300) is divided by 36. 3 Calculate the remainder when (-5 + 873/27)3 is divided by 43. 39 Let f = 24 - 21. Suppose -15a + 2024 = -7a. Suppose 3p = -8p + a. What is the remainder when p is divided by f? 2 What is the remainder when 550 is divided by 1156/36 + (-260)/234? 23 Suppose -32w + 53 - 21 = 0. Calculate the remainder when 6 is divided by w. 0 Let w = -158 - -227. Let s = -63 + w. Let o = 17 - 7. What is the remainder when o is divided by s? 4 Let p(o) be the second derivative of o4/6 - 5o*3/3 - 19o*2/2 + o - 127. What is the remainder when 111 is divided by p(-3)? 24 Calculate the remainder when 85 is divided by ((-480)/140)/(4 + (-59)/14). 5 Let q = 50 - 52. Let z(l) = 6l*2 + 5l + 12. Calculate the remainder when z(q) is divided by ((-45)/(-1))/3 - -1. 10 Let k = 12 - 5. Let c(u) = -8u + 266. Suppose -32 = -q - 2l, -5q + 2l = -96 - 52. What is the remainder when c(q) is divided by k? 5 Let j = 4 + -4. Let l(f) = -f + 57 + 0f - 3f + 3f. Calculate the remainder when l(j) is divided by 10. 7 Suppose -44a + 12465 = -21315 - 17172. What is the remainder when a is divided by 92? 54 Let r be 20/(-35) + (-9)/((-126)/8). Suppose -2c + 5o + 47 = r, 2o - 17 = -2c - 3o. What is the remainder when 206 is divided by c? 14 Suppose 8 = -5v + c + c, -2v - 8 = -2c. Suppose vn + 277 = 5d - 3n, 5d + n = 281. Calculate the remainder when d is divided by 15. 11 Let t(z) = z*2 + 13z + 5. Let r be t(9). Let d = r - 187. What is the remainder when 58 is divided by d? 10 Suppose 3w = 6, -2k - 3w = -5k + 27. Suppose 0s - 132 = -3m - 3s, 0 = 2m - s - 94. What is the remainder when m is divided by k? 2 Let b(v) = 5v3 - 2v*2 + 22v - 49. Calculate the remainder when 352 is divided by b(3). 84 Let f = -13589 + 13630. Calculate the remainder when (-5394)/(-27) - (-4)/18 is divided by f. 36 Let u(a) = 2a2 + 53a - 53. What is the remainder when u(-30) is divided by 63? 31 Suppose -337 = -5x + 168. Suppose -d + 3v - 26 + 61 = 0, d + 5v = 59. What is the remainder when x is divided by d? 13 Suppose 0 = -2s - 2, -u + 1553s = 1551s - 65. Calculate the remainder when u is divided by 39. 24 Let h(b) = -4b - 43. Let q = -69 + 85. Suppose -4z = q, 4x + 51 = -5z - 49. Calculate the remainder when 73 is divided by h(x). 36 Let s(b) = -95b3 + b2 - b - 1. Calculate the remainder when s(-1) is divided by 90/53/18 - -18. 12 Suppose 0 = l - 3m - 986, 3l - 4m + m - 2940 = 0. Calculate the remainder when l is divided by 20. 17 Let x(r) = -11r*2 - r + 2. Let t be x(2). Let a = -42 - t. Suppose 2l - 12 = 5z - 1, -al + 31 = -z. Calculate the remainder when l is divided by 5. 3 Let c(v) = 15v2 + 18v - 64. Let t be 2/13 + (-1221)/(-429). What is the remainder when c(t) is divided by 56? 13 Let k(j) = 2j2 + 8j - 5. Suppose a + 2c + 4 = 0, 5a = -2c + 5 + 7. What is the remainder when 128 is divided by k(a)? 10 Let z = 47 + -22. Let w = 240 - 70. Let l = w + -121. Calculate the remainder when l is divided by z. 24 Let u(z) = -3z. Let c be u(2). Let n = -331 - -340. What is the remainder when 18 is divided by c/n-3 + 2? 2 Suppose v - 3d - 207 = -71, -d + 568 = 5v. What is the remainder when v is divided by 53? 9 Suppose -5z + 27 = -s, 4z - 6 = -2s + 2z. Let x(w) = 57w*2 + 7w + 4. Let i be x(s). Let h = -21 + i. What is the remainder when h is divided by 33? 32 Suppose 46v - 54v = -28v + 307820. What is the remainder when v is divided by 74? 73 Suppose 2c = -2u + 18, -2c + 2u + 6 = -0u. Let f be ((-9)/6 + 1)c + 246. Let t = f + -114. Calculate the remainder when t is divided by 26. 25 Suppose -c + 63 = -0c + 3f + 15, 5f - 35 = 0. Let s(m) = 17m2 + 1. What is the remainder when c is divided by s(1)? 9 Let r(x) be the third derivative of x5/60 + x4/24 - 5x*3/6 + 40x*2. What is the remainder when r(-6) is divided by 10? 5 Suppose -118q + 9q + 4796 = 0. Suppose -12 + 33 = -p - 5d, -33 = -2p + 5d. Suppose 53 = pv - 7. What is the remainder when q is divided by v? 14 Let y(x) = -116x - 345. What is the remainder when 946 is divided by y(-3)? 1 Let r = 7720 + -7527. What is the remainder when r is divided by 23? 9 Suppose -119 = -l - z, 9z - 5z - 597 = -5l. What is the remainder when 1200 is divided by l? 111 Suppose -4q + 5n = -900 - 55, 0 = q - 3n - 244. Calculate the remainder when q is divided by 56. 11 Let n(j) = -j*3 - 3j*2 - j + 3. Let c be n(-2). Let s = 28 - c. Suppose s = a + 8. Calculate the remainder when a is divided by 11. 8 Let h = 4236 + -4029. What is the remainder when h is divided by 105? 102 Calculate the remainder when ((-20)/6)/5249345/(-90) is divided by 232. 223 Suppose 4o + 5f - 63 = 0, -3f - 54 = -5o + 2o. Suppose -1143d + 457896 = -102174. Calculate the remainder when d is divided by o. 14 Let f = -3386 + 3443. What is the remainder when 82 is divided by f? 25 Suppose -x + 1087 + 135 = -3z, -4z = 4x - 4936. Calculate the remainder when x is divided by 11. 10 Let p(i) = 53i*2 + 165i - 1191. What is the remainder when p(7) is divided by 57? 53 Let s(r) = r*2 - 23r + 2. Let t be s(5). Let c = -61 - -36. Let o = c - t. Calculate the remainder when o is divided by 13. 11 Suppose 3j = 3d - 42, 14d - 15d - 3j = 2. Calculate the remainder when 569 is divided by 1221/110 - 1/d. 8 Suppose w + 1 = -2s, -12w + 10w - s + 4 = 0. What is the remainder when (-10)/((-140)/(-147))(-16)/w is divided by 4? 0 Suppose -t = -5s - 4, -5t + 3s = 4s - 20. Suppose -m - t = 46. Let v = m + 65. What is the remainder when 59 is divided by v? 14 Let z(j) = j3. Let r be z(0). Suppose r = 5c - t - 35, -4c - 1 = 2t - 43. Calculate the remainder when 21 is divided by c. 5 Let u be -16 - -13 - (-2 + 1)187. Let j = u + -40. What is the remainder when j is divided by 17? 8 Calculate the remainder when 29/(2175/(-30)) + (2944/10 - 3) is divided by 6. 3 Let r = -34 - -34. Suppose 2p = -3i - 11, i + ri = -3p + 1. Let b(y) = -y2 - 10y + 5. Calculate the remainder when b(i) is divided by 16. 14 Suppose 45w - 40w - 545 = 0. Suppose 0 = -u - 2b + w - 32, 0 = -2b. What is the remainder when u is divided by 23? 8 Calculate the remainder when 381 is divided by 1/(4/24) - 945/(-9). 48 Let a(h) = 7h + 4. Let s be -6 + (-9 - -5) + 5. What is the remainder when 119 + 5/5(s + 0) is divided by a(5)? 36 Let s(n) = -2n + 30. Let f be s(13). Suppose -b = -o + 2o + f, -2b + 17 = -3o. Calculate the remainder when 38 is divided by o + 150/8 + 6/(-8). 12 Let t = 32700 + -31273. Calculate the remainder when 4290 is divided by t. 9 Suppose 40y - 3y - 423660 = -55y. Calculate the remainder when y is divided by 94. 93 Suppose -16 + 114 = -i. Let t = 114 + i. Calculate the remainder when t is divided by 12. 4 Let n(j) = 664j + 7480. What is the remainder when n(-7) is divided by 218? 216 Suppose 130m = 135m - 10. Calculate the remainder when (-8)/(2 - 6)11/m is divided by 8. 3 Let s = 70 - 67. Suppose 0 = 3q - 2m + 3 - 47, -2m = sq - 64. Calculate the remainder when 11 is divided by (1 + 4)/(15/q). 5 Suppose -2x + 29 = -35. Calculate the remainder when ((-34)/187)/((24/(-7744))/3) is divided by x. 16 Suppose 147d + 2698 = -150d + 42199. Let v = -56 - -83. Calculate the remainder when d is divided by v. 25 Let u be -6 - 1(-2 + 2). Suppose -1197r - 260r + 50995 = 0. Calculate the remainder when u/21 - (-1950)/14 is divided by r. 34 Let w(k) be the first derivative of k3/3 + 5k*2 - 19k + 10. What is the remainder when 227 is divided by w(2)? 2 Let i(x) = -355x - 6964. Suppose 2n = 3n - 42. What is the remainder when i(-20) is divided by n? 10 Suppose 0 = 4c - 0c + 5r, 3c - 4r = 31. Suppose 3h - 75 = -5a, h + 14 = 2a - 5. Suppose -cy = -a + 2. What is the remainder when y is divided by 2? 0 Suppose 589y - 2079 = 526y. Suppose -5u + 2065 = -285. Suppose 3h - u = -2h. What is the remainder when h is divided by y? 28 Let y(t) = 17t*2 - t - 7. Let k be (80/(-60))/(((-32)/12)/(-4)). What is the remainder when y(k) is divided by 22? 19 Let y(c) be the third derivative of -c	{ "pile_set_name": "DM Mathematics" }
+ 4n + 136, -5s - 2n - 204 + 774 = 0. What is the units digit of s? 6 Suppose -3x = x + 60. What is the tens digit of 10/x + 113/3? 3 What is the units digit of 2 + (-1062)/(-26) - 2/(-13)? 3 Let l(p) = 27 + 12p2 - 9p - 21 - p2 - p3. What is the tens digit of l(10)? 1 Suppose 340 = 5a - 150. What is the units digit of a? 8 What is the tens digit of (-4 + 1 + -1)/((-6)/111)? 7 Let x(l) = -3l - 9. Let n be x(-9). Let c = 1 + n. What is the units digit of c? 9 Let z be ((-4)/6 + -1)-3. Let p(o) = 6 + 2o - 6o + 2o*2 + 0o + 4o2 - o3. What is the tens digit of p(z)? 1 Suppose -3q - 5j - 34 = 0, -4q - j + 2j = 7. Let d = -1 - q. Let i = d + 1. What is the units digit of i? 3 Let a(o) = -6o - 3. Let j be a(-3). Let y = -8 + 10. Suppose -ym = -2q, -m + q + j = 3m. What is the units digit of m? 5 Suppose l = -2p + 51, p = 4l + 1 + 47. What is the tens digit of p? 2 Suppose 0 = -4h + i - 2i + 334, 158 = 2h + 5i. What is the units digit of h? 4 Let v = 3 + -1. Suppose 0r + 13 = -2r + 3j, 4j = -vr + 22. What is the units digit of r? 1 Let w(j) = 6j2 - 9j + 19. What is the tens digit of w(6)? 8 Let g(t) = 2t2 + 5t - 11. Let a(y) = -5y2 + 0 + 6 - 3y + 4y2. Let x(m) = 7a(m) + 4g(m). What is the units digit of x(-2)? 4 What is the units digit of (-4 - -43) + (-2)/2? 8 Suppose -6d + a = -d - 457, -2a = 5d - 451. What is the units digit of d? 1 Let w(v) = -v*2 - 5v - 4. Let u be w(-3). Suppose 0 = -ug + b + 74, 0 = g + 3g + 3b - 128. What is the tens digit of g? 3 Let r(c) = 12c*2 - 5c. What is the units digit of r(2)? 8 Let w be (-2)/(2 + -3) + 2. Let p(r) = w + r - 3r - 3 + 6r*2. What is the units digit of p(1)? 5 Suppose 2a - 9 = -101. Let p be 2/(-7) + a/(-14). Let l = 6 - p. What is the units digit of l? 3 Let i(g) = 2g2 - 10g - 11. What is the units digit of i(8)? 7 Let d = 108 - 57. What is the tens digit of d? 5 Let j = -97 - -254. What is the tens digit of j? 5 Suppose -6b = -12b + 204. What is the units digit of b? 4 What is the hundreds digit of (-19280)/(-90) + (-4)/18? 2 Let k(y) = -y*2 + 15y. Let u be k(7). Suppose 4f + 0f = q + 36, 0 = 4f + 4q - u. What is the tens digit of f? 1 Let i(g) be the second derivative of -2g + 1/12g*4 - 2g*2 + 0 - 2/3g*3. What is the units digit of i(5)? 1 Suppose 6h = 179 + 49. What is the units digit of h? 8 Let r(z) = -z. Let k(b) = -b*3. Let o be k(1). What is the units digit of r(o)? 1 Suppose -n = -5s - 90, 0 = -3n + 6n - 4s - 325. What is the units digit of n? 5 Suppose 5w - 3 - 18 = -3i, -w - 7 = -5i. Let g = 10 - w. What is the units digit of g? 7 Suppose -3z - 2z = 10. Let g(k) = -21k. What is the tens digit of g(z)? 4 Let z = -51 - -82. What is the units digit of z? 1 Let n = -1 + 10. Suppose -2p + 7 + n = 0. What is the units digit of p? 8 Let b be -7 + 3 - (-4 - 0). Suppose -3p + p - 9 = 5u, u = p + 8. Let t = b - p. What is the units digit of t? 7 Let w = 28 + -25. Suppose 2q = wu - 128, -u - 2u + 108 = 3q. What is the units digit of u? 0 Let c be (-2)/((-3)/(2 + 25)). Suppose 0 = f + 2f - c. What is the units digit of f? 6 Suppose 3 = -m + 2, 3m = 2j - 9. Suppose 10 = 2k + jk. What is the units digit of -7(40/(-14) + k)? 6 What is the units digit of (-3234)/14(-1)/3? 7 Let a(f) = f3 - 4f*2 + 5f - 26. What is the units digit of a(6)? 6 Let k(s) = -s*2 + 9s + 3. Let o(y) = y*2 - 2y - 6. Let l be o(5). Let b be k(l). Let h = b + 10. What is the tens digit of h? 1 Let a be 79/216/8. Let b = a + -50. What is the tens digit of b? 2 Let d = -3 + 6. Let r = d + -5. What is the units digit of (-1 + 2)11 + r? 9 Let a be 2 + 1 + 0 + 0. Let h = 5 + a. Suppose 0 = -4y - 0y + h. What is the units digit of y? 2 Let f be 18/(-15)(6 - 1). Let y = 28 - f. What is the tens digit of y? 3 What is the tens digit of (1155/(-14))/((-6)/8)? 1 Let x be (2 - 14/6)-15. Let k = x + 15. Suppose -k = -i - 2i + 4g, i - 13 = -5g. What is the units digit of i? 8 Suppose 0 = 2n - 4z - 224, -2n - 4z + 180 = -12. What is the units digit of n? 4 Let t be (-1)/(-21/4). Let m = 8 - t. What is the units digit of m? 6 Suppose -3z + 2 = 2y - 2, -5y = -5z - 10. Suppose -3j + 4j - 34 = z. What is the tens digit of j? 3 Let l = 118 - 65. What is the tens digit of l? 5 Let y = 7 + -1. What is the units digit of ((-32)/(-24))/(4/y)? 2 Suppose 2h - 181 = -3r + 118, 0 = 3h - 5r - 458. What is the hundreds digit of h? 1 Let w be ((-1)/2)/((-1)/(-14)). Let i = -5 - w. Suppose 2 - 4 = -ia. What is the units digit of a? 1 Let p be (-14)/18 - (-4)/(-18). Let g = 4 + p. Suppose -4b = -5b + g. What is the units digit of b? 3 Let i(x) = -5x*3 - 4x*2 - 4x - 9. What is the tens digit of i(-3)? 0 Suppose 594 = -193k + 195k. What is the tens digit of k? 9 Let z be (-245)/(-20) + 2/(-8). Let w = z + 15. What is the tens digit of w? 2 Suppose 0 = 2o - 5 + 55. Let t = 37 + o. What is the units digit of t? 2 Let y = -6 - -1. What is the units digit of ((-20)/(-6))/y-24? 6 Let x(g) = g + 7. Let t be x(7). Let o = 1 + t. Suppose o = 2q + 3q. What is the units digit of q? 3 Let h = -11 - -6. Suppose 14 = -z - 5u, -z = 3z - 4u + 8. What is the units digit of (16/h)/(z/10)? 8 Let k(d) = d + 3. Let o = 20 + -5. What is the tens digit of k(o)? 1 Suppose 2y + 3d = 333, 4y - 5d - 696 = -d. What is the hundreds digit of y? 1 Let o be -1 + 1 + 1 + 1. Suppose -ou = u - 18. Let l = 7 - u. What is the units digit of l? 1 Suppose -k = k - 8. Let h be (-4976)/(-28) - k/(-14). What is the tens digit of (-2)/11 + h/11? 1 What is the hundreds digit of (-472)/(-4) + (-1 - 0)? 1 Suppose -3a + 64 = -a. What is the tens digit of a? 3 Let w be (-14)/(-49) + 19/7. Suppose 2l - 48 = -2h - 0l, 0 = -3l + w. What is the tens digit of h? 2 Let t(f) = 2f - 6. Let y be t(4). Suppose 84 = 5i - yi. Suppose -2g + 46 = 4x - i, 0 = 2x - 5g - 7. What is the units digit of x? 6 Let q(x) = 3x - 3. Let z(b) be the second derivative of -b5/20 - 5b4/12 - b3 - 5b2/2 + b. Let p be z(-4). What is the units digit of q(p)? 6 Suppose -81 - 9 = -3h. Suppose -4k - 5f + 63 = 0, -3k + 4f = 6 - h. What is the units digit of k? 2 Suppose -r + 4d = 19, 57 = -3r + d + d. Let m be (-1)/(-2 - -3) - r. Suppose -4y + 2 = -5l + m, -13 = 3y - 4l. What is the units digit of y? 1 Let t(s) = -3s + 5s*2 - 3s*2 - 2 + 0s + 2s2. What is the tens digit of t(3)? 2 Suppose x + 5x = 318. What is the tens digit of x? 5 Let l(o) = o*2 + 2o - 3. Suppose 0 = 6p - p. Suppose -4 = t - pt. What is the units digit of l(t)? 5 Suppose l - 7y - 41 = -3y, 89 = 2l - y. What is the units digit of l? 5 Let a(w) = -7w - 7. Let c(b) = 18b + 18. Let m(f) = 12a(f) + 5c(f). What is the tens digit of m(3)? 2 What is the units digit of (-310 + 1)/(4 + -7)? 3 Suppose 2j - 11 - 1 = -4v, 4j - 3v = -20. What is the tens digit of 14 - 0/(-3 - j)? 1 Let p be -2 + 1 + 1 + 1. Suppose o + 0o = p. Let r(q) = 17q. What is the units digit of r(o)? 7 Let w(m) = -m2 + 9m - 4. Let u be w(8). Suppose -uo + 53 - 5 = 0. What is the tens digit of o? 1 Suppose 5k + 25 = 5i, i - 32 = -4i - 2k. Let n(z) = -z + 6. Let j be n(i). Suppose 0 = -js + 5s - 65. What is the units digit of s? 3 Let j = -250 - -364. What is the units digit of j? 4 What is the tens digit of (-5 - -5) + (-38)/(-1)? 3 Suppose -2r - 2r = 5o - 190, -4r = o - 198. What is the units digit of r? 0 What is the tens digit of (-2)/(1/(172/(-8)))? 4 Suppose -l - 124 = -4i + 2l, 2i + l - 72 = 0. What is the units digit of i? 4 What is the tens digit of ((-4)/5)/(20/(-2350))? 9 Let k(o) = -o*2 + 4o - 3. Let h be k(-6). What is the units digit of (-14)/h + 176/18? 0 Let i(d) = -6d2 + 2 + d - 5 - 2d*3 - 2d + d3. What is the units digit of i(-6)? 3 Let w = -13 + 6. Let m = 19 + w. What is the units digit of m? 2 Let v(d) = d2 - 6 - 5d + d - d. Let q be v(7). Let z(w) = -w2 + 8w + 1. What is the units digit of z(q)? 1 Let m = -11 - -14. Suppose -i = i - 4s - 82, mi = -2s + 107. What is the units digit of i? 7 Suppose 4r - 3 - 5 = 0. Suppose -rc = 4w + 16 - 4, 0 = -w + c. Let s = w + 9. What is the units digit of s? 7 Let n(s) be the third derivative of	{ "pile_set_name": "DM Mathematics" }
j*3 + 7j*2 + 39j - 268. Let o be k(6). Solve -a - oa = 2q + 2, -2a = 5q + 16 for a. 2 Let d(p) = p*2 - 11p + 23. Let c be d(11). Let r = 5 + c. Let f = -26 + r. Solve 0 = 2h - w - fw + 3, 0 = -5h + 4w + 3 for h. 3 Let h(i) = -12i2 - 629i - 260. Let u be h(-52). Let w(k) = k*3 + 5k*2 - 6k + 5. Let g be w(-6). Solve -2r = 3o + 8, r - 22 = go - ur for o. -4 Let i(b) = 596b - 6552. Let p be i(11). Solve t - pt - 5o - 17 = 0, -2o = t + 6 for t. -4 Suppose -u = 4y, 5u - 3y - 15 = 8. Let v be 129/(-6) + 6/(-4) + 1. Let o = v + 35. Solve -3p - o = -ub + 5b, 4p = -16 for b. -1 Suppose -271a + 291a = 18000. Let b = a + -897. Solve b = v + 5c - 7c, 3v - 19 = -4c for v. 5 Let i(r) = -7r*2 - 3r + 4. Let z be i(1). Let f be (10/z)/((5/(-15))/1). Solve fo - k = 22, -8 - 1 = -3k for o. 5 Let t be (-860)/100 + 4/(-10). Let h(n) = 26n + 238. Let i be h(t). Solve -ij = -5v - 25, 9 = -4v + j - 0j for v. -1 Suppose 0 = 20b - 28b + 32. Suppose -2f - 34 = 12. Let u = 25 + f. Solve k + q + b = uq, -4k - 2q = 16 for k. -4 Suppose 3f = 5p - 10p - 6, 4p + 12 = 0. Let d(z) = -3z. Let a be d(-4). Solve 4h - o = fh - 6, 0 = -4h - 5o + a for h. -2 Suppose 0 = 5h + 1026 - 1091. Solve -23 = -5z - h, -z = -2i for i. 1 Suppose 121k = 51k + 210. Solve -5l + h + h - k = 0, 4h = l + 15 for l. 1 Let s be (-20)/(-55) - (-88)/(-242). Solve -2n - 2 = -4n + 2o, -3o + 6 = s for n. 3 Let v(a) = -a3 + 5a*2 - 41a + 73. Let b be v(2). Solve 40 = -2f + 6f + 5k, -bk + 7 = -f for f. 5 Let u be ((-5)/((-100)/32))/((-284)/(-1065)). Solve -3w - 3l + u = 0, 3w - 5l + 16 = 6w for w. -3 Let f = 27 + -25. Suppose 0 = u - 2b, fu - 1 = 3b - 0b. Suppose o = i - 7, 5o + 18 = ui + 2o. Solve -4r + 7 = z, -2z - 4r = iz - 3 for z. -1 Suppose -63k - 208 = -523. Solve -2 = -4c + 3h, -kc + 14 = -2h + 15 for c. -1 Suppose -4z - 4l + 20 = -12, 28 = 2z + 5l. Let i(k) = -9k + 23. Let x be i(2). Suppose -7w + 37 = -x. Solve -4h + 20 = -4s, -2s - w = z for h. 0 Let s(g) = -g*3 + 3g*2 + 4g - 1. Let o(f) = -f*2 - 36f - 65. Let j be o(-34). Let n be s(j). Solve -2c + 2 = -2r, -n = -0r - 3r - 4c for r. 1 Let b be 877/(-21) + 8. Let m be b/28 - 282/(-24). Solve 4h - 3o = 2o + 14, 3o = 5h - m for h. 1 Let d = 8144 + -8129. Solve -d = o - 2b - 20, 0 = o - 4b - 7 for o. 3 Let v(n) = -5n + 14. Let j be v(0). Suppose 2m + 24 = jm. Solve -16 = -5s + mw + w, 5s - 5w - 20 = 0 for s. 2 Suppose -5d - 9 = -g + 4, 4d + 11 = g. Solve 2o - 3o - 14 = 4b, 14 = -5b - go for b. -4 Suppose 16r = 55 - 7. Suppose -a - 17 = 3h - 6h, 4h - ra - 26 = 0. Solve -2o - 3z + 6 = 2o, o - hz + 10 = 0 for o. 0 Suppose 0 = 4m + z - 24, 2m - z + 14 = 4m. Let w be -87m/(-135) + 2/(-9). Solve -wf = 2j - 0f, -5j - 13 = f for j. -3 Suppose 0 = 5k + 3x - 2x - 23, 2k - 3x = 16. Let q(m) = -57m + 860. Let v be q(15). Solve -y = i - 0y + k, vi - 5y = -25 for i. -5 Suppose -5k - 5m = -6m - 410, -k - 4m + 103 = 0. Let b = -80 + k. Solve r + 7 = -3f, -bf - 3r = -0r + 15 for f. -1 Let g be (-296)/(-518)(-21)/(-4). Solve -19p + 14p - 21 = gb, 5b + 7 = p for b. -2 Let q(x) = -4x2 + 28x + 123. Let z be q(-3). Solve -10b = v - 14b - 1, 0 = -zv - b + 16 for v. 5 Let g(a) be the third derivative of a6/120 + a5/20 - a4/2 - 29a*3/6 - 200a*2. Let d be g(-4). Solve 0 = -5h, dr - 15 = 8r - 4h for r. -3 Let a = 121 + -115. Suppose 4v - a = b, -3v + 0v + 12 = 3b. Solve vg + 3 = -5f, -g + 0f + f = -2 for g. 1 Suppose 6n + 0 - 6 = 0. Suppose 2t - 5v - 19 = n, 0 = -3v. Solve t = -5u + 3r, 0 = -r + 3r for u. -2 Let v = -71 + 61. Let n be 178/v(-5)/1. Let p = 92 - n. Solve 4c = 2i - 20, 0 = -6c + pc - i - 10 for c. -4 Let h(z) = z*3 + 23z*2 + 36z - 126. Let n be h(-21). Solve n = -4x - s + 3, -x = -3s - 14 - 3 for x. 2 Suppose 181t + 4l - 11 = 184t, 0 = 2t - 3l + 9. Solve 0 = tb - 11g + 7g - 29, 3g + 9 = -2b for b. 3 Let s(z) = -65z - 127. Let o be s(-2). Solve 4f - j - 13 = 2f, -4j = -of + 27 for f. 5 Suppose -4i + 18 = -2j, 5i - j = -4j + 28. Suppose 10r + 10300 - 10330 = 0. Solve ru + 2z = -0z - 11, -4z = -iu + 11 for u. -1 Let x(y) = y2 - 7y. Let q be x(7). Let p = -10646 + 10649. Solve -pz + 3o + 2o - 9 = q, 3z = -2o + 12 for z. 2 Let t = 225 - 0. Let s = 226 - t. Solve s = o, o - 5o - 8 = 4i for i. -3 Let z = 109 + -108. Let w be (-112)/(-64) - 1z/(-4). Solve -5i - 29 = c, -3c + 8c + 30 = -wi for i. -5 Suppose -28w - 3 + 171 = 0. Suppose 7v - 10 = wv. Solve -n = 2q - v, -3n = -5q + 2n - 5 for q. 3 Let s be (-6 + 4)-1(-5)/(-2). Suppose -y + 3l + 10 = 0, sy + 12 = 6y - 5l. Solve 3h + 5u + 5 = 0, 0 = -h - 4u - 4 + y for h. -5 Suppose 3t + 2k + 199 = 205, -t - 4k + 2 = 0. Solve tz = -z - 18, 3g + 3z + 33 = 0 for g. -5 Let v be (-264)/(30 - 18) - -29. Solve q = 3t - 9, 0 = -t + 4q - vq + 13 for t. 4 Suppose 611 - 161 = 225v. Solve -4x + 8 = 6u - 5u, -x + 2 = -vu for u. 0 Let a be (0 + 32/6)3. Suppose -59w - 9797 + 46200 = 0. Let r = w + -613. Solve -3o = -h - rh - a, 3h + 15 = 0 for o. -3 Suppose -5b = -7n + 2n + 110, -12 = 3b. Let g be 1((n - 2) + -6). Solve g = h - 4w - 2, w = 5h + 16 for h. -4 Suppose 9 = -2w + 45. Suppose -wx = -27x. Let c be (77/66)/((-1)/(-6)). Solve 0 = -t + 2a - c, -2a = -2t - xt - 12 for t. -5 Let l(q) = -4q - q + 1 + 0 + 3q + 2q*2 + 83q*3. Let c be l(1). Suppose r - 6r + 104 = 4f, 4r + 4f = c. Solve -2w + 4 = y, 5w - r = 2y - 7y for y. 4 Let f(c) = 15c*2 + 13c - 52. Let x be f(4). Let o = x + -236. Solve 0 = 2m - o, m - 3 - 2 = -3a for a. 1 Suppose 0 = -2v + 177 - 1533. Let b = v + 681. Solve -o - x = -b, -3o - 3x - 2x + 13 = 0 for o. 1 Let m = -163 + 180. Suppose -13u - m = -82. Solve -2r + 3b + 22 = 0, 4r = -2b + ub + 32 for r. 5 Let v(r) = 5r3 + 14r*2 + 10r + 39. Let o be v(-3). Solve 0 = 2n - 2i - 4, -5n - 5i + i - 17 = o for n. -1 Suppose -4n = 12p - 7p - 175, 5p + 3n - 170 = 0. Suppose -63 = -8a - p. Suppose -6t = -9t + 9. Solve -z + 3z = -tg + 8, ag - 3z = 22 for g. 4 Let u be (14550/2625 + (-4)/10)7/2. Solve 0 = -uq + 16q - 10, o = -2q - 7 for o. 3 Let o(f) = 7f3 + f2 - 2f + 2. Let s be o(1). Suppose -17 = 3w - s. Let x be -3 - -5 - (w + 0). Solve xk = 2a - 26, 4a - 42 = 5k - 10 for a. 3 Suppose 10v - 5k - 15 = 15v, 4k = 4. Let z be -1(-6 - (v - 0)). Let u = 1 - -1. Solve 4o = -t - 6, uo + 3o + 9 = -zt for t. -2 Let h be ((1404 - -16)/(-10))/(1/(-1)). Suppose 3t - h = -127. Solve 3y - s - 11 = 0, -y + 2y = ts + 13 for y. 3 Suppose -o = 3p + 3o - 3, p + 3o = 6. Let u be ((-8)/12)/(p/36). Suppose 3j - 12 = -4t, -t + 16 = j + 3j. Solve -jn - 2h = n - u, 2h - 8 = 2n for n. 0 Let q = 126 - 117. Let i(n) = -3n2 + 27n + 4. Let f be i(q). Solve -m = -2m + fr - 17, -11 = 3m - 4r for m. 3 Let d = 133 - 128. Let m = -98 + 101. Solve -mv - 5q = -8v + d, 0 = 4q - 8 for v. 3 Suppose 3n + 2g = 105, 4g + 34 = -4n + 170. Suppose 39v = nv + 6. Solve v = -r + 4y, 2r + 5y = -3r - 15 for r. -3 Suppose h + 3 = 0, -15b + 4h + 3 = -16b. Solve 4j + 4o - 23 = j, 2o = -j + b for j. 5 Let g(x) = x*3 + 10x*2 - 2x + 14. Let d be g(-10). Let i(h) = 5h - 160. Let v be i(d). Solve -b = -n - 2n + v, -3b = -2n + 16 for n. 2 Suppose 0 = -31v - 38 + 69. Let w be (45/9 - 5)v/3. Solve w = -3j - 12, -5b = 5j for b. 4 Let l = -225 - -88. Let y = -132 - l. Solve -2h + 3n = 12 + 2, yh + n = -1 for h. -1 Let f(a) = -a + 9. Let c be f(2). Suppose 10 = 5k - t, -4k - ct + 3t + 8 = 0. Let d be 1/1 - k - (-11 + 9). Solve -o - 17 = -4i + 2o, -o = -d for i. 5 Suppose 0m + 4m + 15165 = 5x, 5m = 4x - 12141. Let d be -10 - x/(-65) - (-6)/(-10). Solve -4 = -3g - 2k, -4g + 6k + d = k for g. 4 Suppose 3m = -2q + 9, -4q - 14 - 3 = -m. Let w be (-1 + (-4)/(-6))/(m/(-435)). Solve 5u + w = 2b, u - b = 6u + 23 for u. -5 Suppose 243c - 32 = 2o + 247c, 3c + 24 = 2o. Let h(u) = u*2 - u - 2. Let y be h(-2). Solve -3f + y = g - o, -g = -3f - 4 for f. 0 Suppose 0 = 2b + 9 - 21. Suppose q - 831 + 827 = 0, -4u + 28 = 5q. Solve u*l -	{ "pile_set_name": "DM Mathematics" }
e product of -0.49 and 1458635? -714731.15 -3.976-118800 472348.8 Work out 11.43 -21221.5. -242561.745 Work out -2450 * 1276. -3126200 -5921 times 317254 -1878460934 0.04-90432910 -3617316.4 What is -1.09017 times 0.0751? -0.081871767 What is -0.5 times -15.7057749? 7.85288745 Product of 0.081 and 3767565. 305172.765 Multiply -3442892 and 98. -337403416 Product of -3691039.99 and 0.4. -1476415.996 -0.1 157789894 -15778989.4 14 * 21.61521 302.61294 1573.55 times -0.06 -94.413 Multiply 1686.804 and -1.22. -2057.90088 265 times -23252 -6161780 14420.125313 180.701346 Product of 2.6 and -1685067. -4381174.2 What is the product of 7 and -73680936? -515766552 Calculate 11.011-16662. -183465.282 -167623621 -35200956 Multiply 157 and 1.509. 236.913 What is 512 times 11870? 6077440 What is the product of 0 and 361.1712? 0 What is the product of -257.88 and 6.49? -1673.6412 -5 -0.0834235 0.4171175 32.96752 * -0.5 -16.48376 Multiply -1.332 and 5574. -7424.568 8615 times 0.00683 58.84045 35648591 times -0.21 -7486204.11 Calculate 1.180559-0.12. -0.14166708 Work out -2.29 0.8468. -1.939172 What is the product of 18 and -379? -6822 What is -870 times -1065? 926550 What is -162058 times 0.481? -77949.898 Product of 0.1 and -2247.69. -224.769 Calculate -7109.56.722. -47790.059 What is -112 times 104730? -11729760 Work out 0.03393 -3712. -125.94816 Product of 552 and -6017. -3321384 -0.118372 times 0.22 -0.02604184 Calculate -7.3210641.36. -9.95664704 Multiply 4 and -119.66154. -478.64616 What is 42 times 1.95071? 81.92982 What is -1103.2 times 53805? -59357676 What is 48.6 times -5.9632? -289.81152 -71 -42.24891 2999.67261 Work out 0.46 * -1710528. -786842.88 -805 * 13544 -10902920 Product of 8405 and 14.4. 121032 Multiply -19728.776 and -0.2. 3945.7552 Product of -190 and -903789. 171719910 -0.51 * -2487326 1268536.26 0.0350.05875569 0.00205644915 What is the product of -3 and -55.5128? 166.5384 Multiply 0.279 and -63557. -17732.403 -396.404594 times 4 -1585.618376 -388.024 -26 10088.624 Product of -116914 and -21. 2455194 Work out -1 * 1633322. -1633322 Work out 2313227 * 5. 11566135 Multiply -2599 and -202.2. 525517.8 Calculate 8161998-4. -32647992 What is 16.926 times 377? 6381.102 4.5059297 -0.3 -1.35177891 Calculate -2421434101. -244564834 Work out 331459 -51. -16904409 -5765081 times 10.5 -60533350.5 Work out 65.3604 * 21.2. 1385.64048 What is 3938 times 12.5? 49225 What is 68310 times 9.9? 676269 -0.19-0.03652481 0.0069397139 -0.02 times 0.3973261 -0.007946522 -4680206.38 -965858.4 -4095 times 9.04 -37018.8 Work out 2593351 * -1. -2593351 Multiply 0.24908 and 70.9. 17.659772 Multiply -1.42 and 12.28766. -17.4484772 Calculate -12176725-0.07. 852370.75 Calculate -0.02-0.026994. 0.00053988 What is 74.7 times 61345? 4582471.5 3.82-2367.4 -9043.468 Calculate -2920-1494. 4362480 -0.3 * -1174333 352299.9 Work out 22.1 * 1415004. 31271588.4 Calculate 8.375-37.03. -310.12625 Calculate 7-63127612. -441893284 134076-35 -4692660 -11345597.29 times 3 -34036791.87 Work out -18120589 0.1. -1812058.9 What is 3 times -32009286? -96027858 What is -47 times -382569? 17980743 Work out 2815022 * -93. -261797046 -0.21 * -0.53660785 0.1126876485 What is -98466 times -1621? 159613386 -1.516 times 2384.33 -3614.64428 5 * 19103907.6 95519538 Multiply 0 and -13948568. 0 What is the product of 105770 and -3642? -385214340 Work out -5 * 24449749. -122248745 Calculate -529661.11. -529661.1 Calculate 1362211640.3. 40866349.2 -764820-0.19 145315.8 What is the product of 42551 and 22.08? 939526.08 Multiply -0.02 and -16579.15. 331.583 Product of -0.2 and 4812.4685. -962.4937 Work out -385114 -1281. 493331034 Calculate -0.12564323.2. -67718.784 239.93293 0.5 119.966465 What is the product of 129 and 236847? 30553263 23468335-0.5 -11734167.5 What is the product of 11770 and -1138? -13394260 Calculate 152514.7464. 610058.984 -53759693 * 0.5 -26879846.5 Work out 12334 * -4813.1. -59364775.4 153.8 * -630.9 -97032.42 Multiply 0.5 and 1033757.9. 516878.95 -0.2 * 18082898 -3616579.6 Multiply -0.7 and -606084.3. 424259.01 Product of 0.2 and 19706051. 3941210.2 0.2 * 62121407 12424281.4 What is 0.039 times -1753978? -68405.142 -127.56915 times 3 -382.70745 Work out -1474.306 * 0.3. -442.2918 -93.6-12181 1140141.6 What is -232382323 times -4? 929529292 Multiply 4351 and 58073. 252675623 0.11518 0.0441 0.005079438 Product of 0.45211 and 0.33. 0.1491963 What is the product of 37545 and 380.8? 14297136 4-6252603.4 -25010413.6 What is the product of 317 and -1.28968? -408.82856 Calculate -0.219.169667. -3.8339334 Multiply -6 and -1.393499. 8.360994 What is the product of -0.5 and -6.141721? 3.0708605 0.3-6340648 -1902194.4 0.1 -16953062 -1695306.2 -0.6424 * 140 -89.936 -19893-2.4 47743.2 -0.1 -270.8876 27.08876 Product of 2.6256 and -141. -370.2096 -2979 * 82.818 -246714.822 -46 * 303.03 -13939.38 Multiply 588504 and -0.064. -37664.256 Work out 364.95944 * 0.5. 182.47972 0.2363700.35 72740.07 What is -1404206 times -27? 37913562 Multiply 139241104 and -2. -278482208 Multiply -0.253681 and 107.2. -27.1946032 1078 times -86.7 -93462.6 -0.2 1.2369967 -0.24739934 What is -7219837 times 1? -7219837 Multiply -349.04315 and 2. -698.0863 2.52096624 60.503184 Calculate -0.8968004-0.4. 0.35872016 Product of -2.378 and 8932. -21240.296 Calculate -0.69009820.4. -0.27603928 -17.6148.17 -2607.792 -6123063 times 52 -318399276 Product of 0.266 and 222.0728. 59.0713648 Work out 4033814 * 0.1. 403381.4 Product of 169 and -0.051194. -8.651786 0.4501843 * 0 0 644-0.1317586 -84.8525384 10110083 2.1 21231174.3 -2559053 times -11 28149583 -6 * 1889120 -11334720 Multiply -20.15055 and 3. -60.45165 -135 * 1.049297 -141.655095 Calculate 111856-0.00509. -569.34704 Work out -2 76864459. -153728918 -12841737 * -0.18 2311512.66 0.2 * 0.05657797 0.011315594 Calculate -95.16293-53. 5043.63529 Multiply -2.1 and -0.42648. 0.895608 610743 times 10.77 6577702.11 2703720.872 564316.264 0.4-3321088 -1328435.2 -15355053-0.5 7677526.5 -4 times 0.013122529 -0.052490116 10 times -0.57844 -5.7844 -7.320855 * -7 51.245985 What is the product of 1.739 and 5068? 8813.252 954952 times 1 954952 Multiply 28227715 and 2.7. 76214830.5 Multiply -7693252 and -156. 1200147312 What is 5 times 439072? 2195360 What is 0.3 times -3.8215175? -1.14645525 Product of -0.1462 and -0.02062. 0.003014644 1 times 52255508 52255508 Calculate -3-0.7017976. 2.1053928 243460.0678 1650.6588 Product of 0.02 and 134649. 2692.98 Product of 0.79985 and -0.07. -0.0559895 What is the product of 265 and -2.51638? -666.8407 Product of 0.5 and 0.002061534. 0.001030767 1213.236 * -54 -65514.744 What is the product of 2352170 and 0.15? 352825.5 -3 * 1617744 -4853232 What is -0.13119 times -1.21? 0.1587399 Multiply -0.761391 and 374. -284.760234 Multiply -3.24028 and -2381. 7715.10668 1354.45 times 10547 14285384.15 Product of 34746796 and -0.2. -6949359.2 120432053 times 4 481728212 Work out -7112799 * 5. -35563995 Product of 471126.63 and -4. -1884506.52 Product of -0.1 and -5142373. 514237.3 Work out -747 * -0.279904. 209.088288 What is 14260 times 2099? 29931740 0.673 * -2.884 -1.940932 Work out -45 * 26936. -1212120 Multiply -0.051 and 512297. -26127.147 Calculate -0.0247762-0.161. 0.0039889682 Work out 1.47 45643.6. 67096.092 What is -46.063 times 0.861? -39.660243 What is the product of 0.2 and -4.80637? -0.961274 Calculate 23.5488.36. 11476.46 -23829026 -4 95316104 Calculate -141029-0.13. 18333.77 Product of -58321.5 and 0.295. -17204.8425 0.4489 times 2088 937.3032 What is -11 times -247575? 2723325 Work out 1277391 -0.61. -779208.51 120731.48 20731.48 Multiply 12428903 and -0.4. -4971561.2 What is the product of -13.03 and -0.14549? 1.8957347 -10 times -37.3176 373.176 Product of -1282726 and 10. -12827260 Multiply 200699450 and -0.06. -12041967 What is the product of 1129 and -73669? -83172301 Product of 0.3 and -685.88633. -205.765899 Product of -0.0127 and -162533. 2064.1691 Product of -8.75 and 2297. -20098.75 0.06 -0.0954917 -0.005729502 -70.8336-0.182 12.8917152 -3 -0.4226142 1.2678426 Work out 142595 * 235.8. 33623901 2693*-348 -937164 Product of 1894.41 and 58. 109	{ "pile_set_name": "DM Mathematics" }
-2i - 2. Let z(u) = 6u + 6. Give cz(p) - 10f(p). 2p + 2 Let a(r) be the third derivative of 1/60r*5 - 1/6r*3 + 0r + 0r4 + 0 - 9r*2. Let w(x) = -4x*2 + 2x - 1. Calculate -2a(u) - w(u). 2u*2 - 2u + 3 Let g(k) = k3 - k2 + k - 1. Let h(a) = 4a3 - 3a*2 + 3a - 8. Calculate 6g(y) - 2h(y). -2y3 + 10 Suppose 2a + 0a = 8. Let v(o) = 2o + 2o2 + a - 3o2 - 5 - o - o3. Let s(u) = -6u3 - 2u*2 + 5u - 4. Determine s(w) - 4v(w). -2w*3 + 2w*2 + w Let r(w) = -5w + 3. Let t(o) = 12o - 10. Let j(f) = 13f - 11. Let c(h) = 6j(h) - 7t(h). What is 3c(d) - 4r(d)? 2d Let z(n) = 3n*3 + 2n. Suppose 0 = 3k - 3t - 3, -4t = -5k - 0k + 2. Let u(c) = 35c*3 + 2c - 11c3 + 5c - 14c3. Calculate ku(w) + 7z(w). w3 Let w(z) = 5z*2 - 2z + 5. Let t = -46 + 50. Let f(b) = -9b2 + 3b - 9. What is tf(v) + 7w(v)? -v*2 - 2v - 1 Let c(o) = 2o3 - 3o*2 - 5o + 4. Let z(r) = -4r3 + 5r*2 + 9r - 7. What is 5c(v) + 3z(v)? -2v3 + 2v - 1 Let k(a) = a*3 + 1. Let y = -34 + 32. Let q(o) = -2o*2 - 4. What is yk(l) - q(l)? -2l3 + 2l*2 + 2 Let y(n) = 10n - 801 + 801. Let h(w) = -w. What is 65h(i) + 6y(i)? -5i Let r(f) = 3f + 4f - f2 + 8f*2. Let q = -6 - -8. Let u(s) = -3s*2 - 2s*2 - 6s - s*q. Calculate -4r(i) - 5u(i). 2i*2 + 2i Let b(q) = 11q + 3. Let d(c) = 18c + 2. Let j(f) = f. Let h(p) = d(p) - 12j(p). Determine -4b(y) + 7h(y). -2y + 2 Let s(j) = -4j3 + j2 + 3j. Let v(h) = -8h3 + 2h*2 + 5h + 1. Determine -5s(o) + 3v(o). -4o3 + o2 + 3 Suppose -10c + 15c - m + 4 = 0, 4c + 3m + 7 = 0. Let t(o) = -10o2 - 2. Let x(y) = y2. What is ct(r) - 12x(r)? -2r2 + 2 Let v(y) = 6y - 4. Let h(z) be the first derivative of 11z2/2 - 7z + 1. Let d = 18 + -25. What is dv(a) + 4h(a)? 2a Let i(g) = g2 - 1. Let r(h) = -5 + 6h*2 + 4h + 10h - 12h. What is -5i(s) + r(s)? s2 + 2s Let p(t) be the first derivative of -t*4/4 + 3t + 50. Let u(c) = -c*3 + 1. What is -p(w) + 3u(w)? -2w3 Let v(t) = t3 + t2. Suppose 4j + l + 8 = 0, 2j + 4 = -5l - 18. Let w(f) = 2f3 + f2 - 4. Determine jv(n) + w(n). n*3 - 4 Let u(l) = -4l + 1 - 3l - l + 0l. Let d(z) = -7z + 1. What is 7d(s) - 6u(s)? -s + 1 Let y(o) = 7o. Let h(g) = 20g. Let t be (0 + -5)(9 + -10). Let q(i) = -i*2 + 5i - 8. Let x be q(6). Give th(v) + xy(v). 2v Let x(d) = -9d - 1. Let k be x(-1). Let n be k/28 + 46/(-14). Let t(z) = -5z + 14. Let w(v) = -2v + 5. Give nt(p) + 8w(p). -p - 2 Let r(z) = 6z + 9. Let v(x) = 1. Let n(b) = r(b) + v(b). Let i(q) = 2q + 3. Suppose m = -3 + 1. What is mn(j) + 7i(j)? 2j + 1 Let o(q) be the first derivative of -3q - 4/3q3 + 1 + 1/2q*2. Let x(g) = -17g*2 + 4g - 13. What is 9o(r) - 2x(r)? -2r2 + r - 1 Let a(p) = 3p*2 - 2p. Let w = -7 + 5. Let k(i) be the first derivative of 4i3/3 - 3i*2/2 + 3. Determine wk(x) + 3a(x). x2 Let g(o) be the first derivative of 3o*2 + 7o - 2. Let l(c) = 7c + 8. Let k be 5/(-1 - 2/(-1)). Suppose -2z + 18 = -kz. Determine zg(p) + 5l(p). -p - 2 Let f(t) = 2 + 3t + 6 + 1. Let j(g) = -5g - 14. Suppose -10x + x = -72. Calculate xf(l) + 5j(l). -l + 2 Let u(d) = -4d + 3. Let n be 1 - (3 + (-2 - -3)). Let m be (6/(-9))/((-1)/n). Let f(j) be the first derivative of -j2/2 + j + 4. What is mf(g) + u(g)? -2g + 1 Let y(p) = 0p*3 - 10p*2 + 3p + 15p2 - 4 - 2p3. Let v(s) = -s2 - s + 1. Determine -5v(f) - y(f). 2f*3 + 2f - 1 Let p(v) = -19. Let t(m) = m + 95. What is 11p(d) + 2t(d)? 2d - 19 Let w(v) = -2v*2 + v + 2. Let c(x) = -4x*2 + 3x + 4. Give -4c(q) + 9w(q). -2q2 - 3q + 2 Let x(v) = -v. Let z(t) = 10t. What is 66x(p) + 6z(p)? -6p Let g(h) = -8h2 - 10h + 2. Let k(c) = -7c2 - 9c + 2. Determine -5g(s) + 6k(s). -2s2 - 4s + 2 Let w(d) = -7d2 - 6. Let h(s) be the third derivative of -s5/60 - s3/6 + 3s*2. Calculate -6h(p) + w(p). -p*2 Let s = -42 + 46. Let q(m) = -5m*2 - 7m + 4. Let x(b) = -b*2 - b + 1. Give sx(h) - q(h). h*2 + 3h Let t(c) = 6c2 + 11c - 11. Let l(a) = -4a - 1. Let z be l(-3). Let y(s) be the second derivative of s4/12 + s3/3 - s2 + s. Calculate zy(o) - 2t(o). -o2 Let l(t) = -7t + 2. Let z(s) = s. Let v = -12 - -17. Determine vz(y) + l(y). -2y + 2 Let o be (-1)/9 + (-26)/9. Let k be 1 + (-1)/(2/(-8)). Let m(i) = 2i2 + 4i + 9. Let l(t) = t*2 + 2t + 5. Determine kl(g) + om(g). -g*2 - 2g - 2 Let z(f) = f*2 + f + 1. Let l(t) = -11 + 9 - 7t - 1 - 8t2 - 4. Suppose 5i - 53 = -5s + 37, 60 = 4s + i. What is sz(w) + 2l(w)? -2w2 Let p(l) = 2l. Let b(i) = 2i + 1. Let k(w) = -2b(w) + p(w). Let o(t) = 2t + 1. Let z(q) = q2 - 4q. Let s be z(3). Determine sk(f) - 4o(f). -2f + 2 Suppose 0 = -7r + 2r - 3n - 25, 6 = 2r - 2n. Let f(w) = -w + 3. Let j(z) be the second derivative of -z*2 - z. Determine rf(g) - 3j(g). 2g Let o(h) = 4h3 + 5h*2 - 2h - 3. Let b(q) = -7q3 + 6q + 3q + 5 - 9q*2 + 0q - 6q. Give 3b(m) + 5o(m). -m3 - 2m*2 - m Let r(l) = -8l*3 - 2l*2 - 2l. Let c(t) = -8t3 - 3t*2 - 3t. Calculate 2c(m) - 3r(m). 8m3 Let n(q) = q + 1. Let d(u) = u + 1. Give 3d(z) - n(z). 2z + 2 Let j(l) = -20l*3 + 3l. Let q(s) = -459s3 + 68s. Give -68j(i) + 3q(i). -17i3 Let p(g) = 6g. Let d(x) = -3x. Calculate 5d(v) + 3p(v). 3v Let s(k) = k. Let d(y) = -3y - 7. Let m be d(-3). Let n(a) = -2a. Determine ms(f) + 3n(f). -4f Let c(n) = -3n*2 + 2n + 3. Let m(p) = -4p2 + 2p + 2. Calculate -5c(r) + 4m(r). -r*2 - 2r - 7 Let j(k) = 6k2 + k + 4. Let i(n) = 7n2 + n + 5. Let w(s) = -s2 + s + 5. Let p be w(0). What is pi(t) - 6j(t)? -t*2 - t + 1 Let u(k) = 3k*2 - 4k + 5. Let b(w) = -w*2 - w - 1. Determine b(x) + u(x). 2x*2 - 5x + 4 Let b(a) be the third derivative of -a*4/4 - 2a*3/3 - 2a*2. Suppose -2h = -4n + 24, 20 = 2n - 5h - 8. Let d(m) = 5m + 3. What is nb(x) + 5d(x)? x - 1 Let a(j) = -30 + 13 + 16. Let s(f) = 4f - 4. What is -5a(b) + s(b)? 4b + 1 Let m(w) = -6w*2 - 3w - 2. Let k(b) = -8b2 - 5b - 5. Let j(n) = -17n2 - 11n - 11. Let y(t) = -3j(t) + 7k(t). Calculate 4m(x) - 5y(x). x*2 - 2x + 2 Let o(x) = 3x + 5. Let j(a) = -1. Let t(q) = -6j(q) - 3o(q). Let n(v) be the third derivative of -v4/3 - 4v*3/3 + 21v*2. Calculate 7n(b) - 6t(b). -2b - 2 Let y(h) = 541h + 1 - 6 - 540h. Let d(a) = a - 4. Calculate -4d(i) + 3y(i). -i + 1 Let t(a) = a*2 - a - 1. Let n(j) = 6j*2 - 4j - 7. Determine -n(g) + 5t(g). -g2 - g + 2 Let c be (-2)/(-2) + 4 + -1. Suppose 5m - m = -c. Let i = 8 + m. Let o(d) = -9d2 - 4d + 11. Let r(u) = 5u2 + 2u - 6. Give ir(s) + 4o(s). -s*2 - 2s + 2 Suppose 15 = -3x, 5d + 4x + 15 = -0x. Let z(m) = -m*2 - 5m. Let o = -11 + 16. Let c(u) = u. Give dz(q) + oc(q). -q2 Let a(t) = t + 1. Let x(c) = c2 + 2c + 1. Let j be x(-2). Let k(o) = -4o - 5. Determine jk(i) + 6a(i). 2i + 1 Let u(l) be the second derivative of 5l3/6 + l2 + 22l. Let a(y) = y. Give 3a(f) - u(f). -2f - 2 Let i(b) = -4b*2 + 7b - 7. Let k(t) = -3t2 + 5t - 5. Let p(v) = 3v2 - 5v + 5. Let r(l) = 5k(l) + 6p(l). What is 5i(z) + 7r(z)? z*2 Let k(a) = 2a*3 + 4a*2 + 2a + 3. Let d(m) = m*2 + 1. Give 2d(z) - k(z). -2z3 - 2z*2 - 2z - 1 Let d(o) = -4o. Let y(q) = 12q + 1. Calculate 8d(x) + 3y(x). 4x + 3 Let p(t) = 11t*3 + 7t*2. Let u(o) = 10o*3 + 6o*2. Determine 6p(w) - 7u(w). -4w*3 Let z(p) be the third derivative of 7/24p*4 + 5/3p*3 + 0p + 5p2 + 0 + 1/6p*5. Let w(r) = 3r*2 + 2r + 3. Calculate 7w(s) - 2z(s). s*2 + 1 Let x(u) = 6u*2 - 125u + 14. Let j(r) = 2r2 - 42r + 5. Calculate -11j(w) + 4x(w). 2w2 - 38w + 1 Let x(f) = 5f + 2. Let h(g) be the second derivative of -11g*3/6 - 2g*2 + 3g. What is -3h(y) - 7x(y)? -2y - 2 Suppose z = 0, -3b - 8 = 5z - 2. Let x(f) = -2f*2 - 2f + 2. Let p(m) = 2m2 + 3m - 3. Calculate bp(d) - 3x(d). 2d2 Suppose 4q + 0q + 4 = 0. Let u(i) be the first derivative of 5i3/3 - i2 - 5i + 2. Let y(p) = p2 + p - 1 + 4p - 5p. Give qu(o) + 4y(o). -o2 + 2o + 1 Let x(w) = 13w3 + 4w**2 - 4. S	{ "pile_set_name": "DM Mathematics" }
from dpssspppdpddpp. What is prob of picking 1 s and 1 d? 12/91 Three letters picked without replacement from dddzddddzddddaadda. What is prob of picking 1 z and 2 d? 13/68 What is prob of picking 2 g when two letters picked without replacement from orrglclrlrrlllugl? 1/136 Four letters picked without replacement from nqyqqhhsythqnqh. Give prob of picking 1 q, 1 n, 1 s, and 1 h. 8/273 Four letters picked without replacement from scucccuctuhuc. Give prob of picking 1 c, 1 h, 1 u, and 1 t. 24/715 What is prob of picking 3 w when three letters picked without replacement from wwwhhwwwwwwww? 15/26 Two letters picked without replacement from yeblz. Give prob of picking 1 b and 1 e. 1/10 Four letters picked without replacement from pspsjjjjsspjsp. Give prob of picking 1 s and 3 j. 50/1001 Calculate prob of picking 1 o and 2 g when three letters picked without replacement from {a: 3, e: 4, o: 2, g: 8, v: 2}. 56/969 Three letters picked without replacement from {r: 2, o: 2, y: 1, x: 5, l: 2, w: 2}. Give prob of picking 1 x and 2 l. 5/364 Two letters picked without replacement from {n: 7, w: 6, r: 1}. Give prob of picking 2 n. 3/13 What is prob of picking 1 f and 2 p when three letters picked without replacement from fefkpekpff? 1/30 Calculate prob of picking 3 g when three letters picked without replacement from qgggqqg. 4/35 What is prob of picking 1 f, 1 l, and 1 n when three letters picked without replacement from {l: 3, n: 4, f: 4}? 16/55 Four letters picked without replacement from nniinfininninigngf. Give prob of picking 2 f and 2 n. 7/765 What is prob of picking 4 v when four letters picked without replacement from vvvvvvv? 1 What is prob of picking 3 z when three letters picked without replacement from {u: 1, e: 1, o: 10, j: 5, z: 3}? 1/1140 What is prob of picking 2 i and 1 w when three letters picked without replacement from {w: 4, i: 7}? 28/55 Four letters picked without replacement from sxzuzazszrzrsxzzs. Give prob of picking 2 z and 2 r. 3/340 Four letters picked without replacement from {l: 2, x: 17}. Give prob of picking 3 x and 1 l. 20/57 Four letters picked without replacement from obtsstbsovvvvys. Give prob of picking 1 o and 3 v. 8/1365 Two letters picked without replacement from ppspppsprrppp. Give prob of picking 1 p and 1 s. 3/13 Two letters picked without replacement from ykxfxkfykoxoyfkf. What is prob of picking 1 o and 1 f? 1/15 What is prob of picking 1 k and 1 g when two letters picked without replacement from ggckceg? 1/7 Two letters picked without replacement from geqgegitedddedq. Give prob of picking 1 g and 1 e. 4/35 Two letters picked without replacement from {v: 1, h: 1, k: 2, q: 1}. Give prob of picking 1 h and 1 q. 1/10 Three letters picked without replacement from nzilzilddinindg. What is prob of picking 1 l and 2 n? 6/455 Calculate prob of picking 1 r, 2 m, and 1 t when four letters picked without replacement from qtmmrmwmw. 1/21 Four letters picked without replacement from {b: 7, h: 1, n: 2}. What is prob of picking 1 n and 3 b? 1/3 Two letters picked without replacement from {f: 3, b: 1, l: 5, c: 1, x: 1}. What is prob of picking 1 c and 1 l? 1/11 Two letters picked without replacement from nnnnnn. What is prob of picking 2 n? 1 Three letters picked without replacement from {w: 1, z: 2, h: 1, r: 1}. Give prob of picking 1 h and 2 z. 1/10 Four letters picked without replacement from rqqnqrnqkqqqnqnqqkk. What is prob of picking 2 k and 2 r? 1/1292 Two letters picked without replacement from {p: 2, d: 2, k: 3, s: 2}. Give prob of picking 1 k and 1 d. 1/6 Two letters picked without replacement from meemme. Give prob of picking 2 e. 1/5 Four letters picked without replacement from gncjcngnn. Give prob of picking 3 n and 1 g. 4/63 Two letters picked without replacement from hhhhhhuhhhfsh. What is prob of picking 1 h and 1 s? 5/39 What is prob of picking 3 j and 1 k when four letters picked without replacement from kckkkkkcckkkkkkcjkkc? 0 Two letters picked without replacement from {b: 2, q: 7}. Give prob of picking 2 b. 1/36 What is prob of picking 1 x, 1 o, and 1 m when three letters picked without replacement from {y: 2, m: 2, o: 1, x: 4, w: 2, h: 3}? 2/91 Three letters picked without replacement from {s: 1, p: 1, w: 1, u: 2, a: 2}. What is prob of picking 2 a and 1 p? 1/35 What is prob of picking 1 m, 1 s, and 2 d when four letters picked without replacement from sdddbsddsbdddddmq? 27/476 Calculate prob of picking 2 q when two letters picked without replacement from {f: 1, q: 2, v: 2, i: 1}. 1/15 Calculate prob of picking 4 u when four letters picked without replacement from zzzzuzuzuzz. 0 Three letters picked without replacement from ninnw. What is prob of picking 1 n, 1 w, and 1 i? 3/10 Two letters picked without replacement from {z: 2, h: 12, i: 3, u: 2, x: 1}. Give prob of picking 1 u and 1 x. 1/95 Three letters picked without replacement from jszssqsozoozsojzsoz. What is prob of picking 1 z, 1 j, and 1 s? 20/323 Four letters picked without replacement from {u: 11, w: 5}. Give prob of picking 4 w. 1/364 Three letters picked without replacement from gzhihtvz. Give prob of picking 1 h, 1 z, and 1 t. 1/14 Calculate prob of picking 2 p and 1 o when three letters picked without replacement from {p: 3, g: 1, c: 2, o: 3, l: 6}. 9/455 Two letters picked without replacement from pxfzf. What is prob of picking 1 x and 1 z? 1/10 Two letters picked without replacement from pclclclpccclcp. Give prob of picking 1 c and 1 l. 4/13 Four letters picked without replacement from {f: 1, y: 1, w: 4, r: 2, j: 2, a: 2}. Give prob of picking 1 f, 1 r, and 2 a. 2/495 Three letters picked without replacement from {l: 2, x: 1, g: 2, m: 1}. Give prob of picking 1 x, 1 l, and 1 m. 1/10 Calculate prob of picking 3 k and 1 v when four letters picked without replacement from vvvkvvvvkvvvkvvvvvkv. 64/4845 Three letters picked without replacement from {s: 12, z: 3}. Give prob of picking 3 s. 44/91 Four letters picked without replacement from {t: 4, f: 2, q: 3}. What is prob of picking 3 q and 1 f? 1/63 Two letters picked without replacement from {d: 1, t: 3, c: 1, x: 6, l: 1}. What is prob of picking 1 d and 1 l? 1/66 Calculate prob of picking 1 c and 1 l when two letters picked without replacement from {o: 1, c: 5, w: 1, y: 7, l: 1}. 1/21 Calculate prob of picking 1 a and 1 k when two letters picked without replacement from {a: 7, k: 9}. 21/40 What is prob of picking 4 h when four letters picked without replacement from shhshshhsshhhhlsshs? 35/646 Three letters picked without replacement from ffff. Give prob of picking 3 f. 1 Two letters picked without replacement from zpzpzzzzzzzpzp. Give prob of picking 2 p. 6/91 Three letters picked without replacement from {a: 7, c: 4, g: 7}. What is prob of picking 3 g? 35/816 Calculate prob of picking 3 f when three letters picked without replacement from fftnfnntnnfttnfnntc. 10/969 Two letters picked without replacement from aawddwoawwxoaoawdo. What is prob of picking 1 a and 1 x? 5/153 What is prob of picking 2 v and 2 l when four letters picked without replacement from villzvllllvlvvivla? 7/51 Two letters picked without replacement from fumui. Give prob of picking 1 f and 1 u. 1/5 Calculate prob of picking 1 t and 1 m when two letters picked without replacement from {m: 2, t: 10}. 10/33 Four letters picked without replacement from qmiimgyggmmihmgggm. Give prob of picking 1 y, 1 q, 1 m, and 1 h. 1/510 What is prob of picking 1 b and 2 d when three letters picked without replacement from bbdkbdwbkwbd? 3/44 What is prob of picking 2 n, 1 q, and 1 j when four letters picked without replacement from {q: 2, l: 2, n: 2, w: 1, j: 1, m: 1}? 1/63 Two letters picked without replacement from {u: 4, a: 4, e: 5, x: 1, r: 1, m: 3}. Give prob of picking 1 m and 1 u. 4/51 What is prob of picking 2 x, 1 q, and 1 s when four letters picked without replacement from {s: 2, x: 2, q: 5}? 5/63 Calculate prob of picking 1 f, 1 b, and 2 k when four letters picked without replacement from sssbkkssef. 1/210 Two letters picked without replacement from vzvvzzvzzz. Give prob of picking 1 v and 1 z. 8/15 What is prob of picking 1 f and 1 j when two letters picked without replacement from kjffsk? 2/15 What is prob of picking 2 l w	{ "pile_set_name": "DM Mathematics" }
plify (-5(-2sqrt(68) + sqrt(17))46)*2. 2203200 Simplify 3 + 6(6sqrt(9)2)/(sqrt(12)/sqrt(4)-6). -12sqrt(3) + 3 Simplify (sqrt(720) + sqrt(720) + sqrt(720) + -5sqrt(720) + -2)2 + (sqrt(25) - sqrt(25)5)/sqrt(5)1. 92sqrt(5) + 2884 Simplify -3 + 52(sqrt(80) - ((-1 + sqrt(80))3 - sqrt(80)))2. -240sqrt(5) + 887 Simplify ((4sqrt(6)/sqrt(3))2 - (sqrt(22)/(sqrt(11)-3) - sqrt(2))) + -5. 4sqrt(2)/3 + 27 Simplify 3(2 + ((1sqrt(2057))2-3 - (sqrt(2057) - (4 + sqrt(2057) + 1) - sqrt(2057) - sqrt(2057)))). -18492 + 66sqrt(17) Simplify 1(1 + ((sqrt(176) - sqrt(176)3) + 5)2)-3. -2190 + 240sqrt(11) Simplify -5(((sqrt(76) + -3sqrt(76) + sqrt(76) - sqrt(76) - sqrt(76))-2 - sqrt(76))/(sqrt(40)/(sqrt(10) - (sqrt(90) + sqrt(10) + sqrt(10)))))*2. -38000 Simplify (-5(sqrt(68)/sqrt(36) + 2sqrt(17) + -4 + sqrt(17) + (sqrt(51)/sqrt(3) + -5 - (sqrt(1700) + 0))))2. 2550sqrt(17) + 141050/9 Simplify (((5sqrt(170)2 - sqrt(170)) + sqrt(170))/(sqrt(30)/sqrt(12)))*2. 6800 Simplify (((sqrt(68) + -1sqrt(68)5 - sqrt(68)) + sqrt(68))4)/((-1sqrt(1536))/sqrt(6)). 2sqrt(17) Simplify 0 + (-6(2sqrt(425))*2 - 2sqrt(425)4 - ((2sqrt(425)1)2 + 1)). -11901 - 40sqrt(17) Simplify 5 + ((sqrt(57)/sqrt(3) + -5 - (sqrt(19) + sqrt(152)/(sqrt(8)-2))) + (sqrt(19) + -1 + sqrt(19) + 3 - (sqrt(19) + 0 + 4)))2. -21sqrt(19) + 387/4 Simplify -6((sqrt(21) - 3sqrt(336))/(sqrt(63)-4 - sqrt(7)) + -4)2. -18402/169 + 528sqrt(3)/13 Simplify ((3sqrt(176)-11 + 3)2)*2. -288sqrt(11) + 6372 Simplify -1 + ((0 + sqrt(605) + 3)-5 + (sqrt(605) + 1sqrt(605)6 - ((sqrt(605) - (sqrt(605) + -1)) + 2)))2. -792sqrt(5) + 2743 Simplify -2(5(sqrt(432)-1 - sqrt(432)) + -5 + (sqrt(432) - (-1 + sqrt(432))))2 + -3. -86435 - 1920sqrt(3) Simplify (-2 + -1(sqrt(275) - -1sqrt(275)1)2)4. -4408 Simplify (sqrt(91) + 6(sqrt(91) - (sqrt(91)3 - sqrt(91))))/(sqrt(77)/(sqrt(33)/sqrt(3) + sqrt(11))) + 3. -10sqrt(13) + 3 Simplify (6sqrt(27)/(sqrt(9)2)-4)*2 + -4. 428 Simplify (sqrt(1216) + 0 + -5 - -1(sqrt(1216)-2)2) + 3 + 1. 8sqrt(19) + 4863 Simplify (sqrt(5) + sqrt(25)/sqrt(5) + 2)-11 + (sqrt(135)/(sqrt(9)/sqrt(3)))/sqrt(9)5. -2 + 3sqrt(5) Simplify (-5((sqrt(6)/sqrt(2) - sqrt(3)) + 0 + -2 + (sqrt(3) - (1 + sqrt(3) + sqrt(3))) + -4)4)*2. 5600sqrt(3) + 20800 Simplify (54sqrt(104))/(sqrt(48)/(sqrt(12)/sqrt(2))). 20sqrt(13) Simplify (sqrt(40) - (sqrt(40) + (sqrt(280) - 2sqrt(280))/sqrt(7)))/(sqrt(80)3)2. sqrt(2)/3 Simplify -3 + -5((0 + sqrt(28))-1 - 1sqrt(28)-4). -30sqrt(7) - 3 Simplify 5((sqrt(468)-5 + sqrt(13))2 + sqrt(143)/(sqrt(77)/sqrt(7))). 5sqrt(13) + 54665 Simplify 6(-3 + sqrt(1573) + 42sqrt(1573) + 2)2. -1188sqrt(13) + 764484 Simplify (3 + (sqrt(352) - -3sqrt(352) - sqrt(352))/sqrt(32))2. 18sqrt(11) + 108 Simplify (-2(-5(sqrt(77)1 + sqrt(77)) + sqrt(77) + sqrt(77)))/(sqrt(77)/(sqrt(7) + 2sqrt(7)) + (sqrt(110)/sqrt(2) - sqrt(55))/sqrt(5) + sqrt(11)). 12sqrt(7) Simplify sqrt(2) + (sqrt(50)-2)2 + -5 + ((sqrt(18)/(sqrt(18)/sqrt(2)))2 - 2sqrt(50)). -9sqrt(2) + 197 Simplify 4 + 2 + (4 + (-5 + sqrt(75) + -2sqrt(75) - sqrt(75)26))2. 130sqrt(3) + 12682 Simplify (2 + -1(-2 + -32sqrt(343)))2. 336sqrt(7) + 12364 Simplify (-5 + sqrt(176) + -1 - (sqrt(176) + sqrt(176) + -2)-6)46. -432 + 1248sqrt(11) Simplify (2sqrt(156)-3 - -3(sqrt(156) + -2sqrt(156)))/(1(sqrt(768)-1 + sqrt(768)) - sqrt(768)). 9sqrt(13)/8 Simplify -4 + sqrt(171) + 0 + (((sqrt(228) - 1sqrt(228)) + sqrt(228))-3 + sqrt(228) - sqrt(228))/sqrt(12). -4 Simplify (sqrt(36)/sqrt(3))/sqrt(6)-2 + sqrt(2) + sqrt(20)/(1sqrt(10) + sqrt(10)) + sqrt(2)2 + 4. 3sqrt(2)/2 + 4 Simplify 4-4((sqrt(1539) - (sqrt(1539) + 6(sqrt(1539) + 0 + sqrt(1539)))*2) + -2). -144sqrt(19) + 4161488 Simplify ((sqrt(119) - sqrt(119)2)-2)/(sqrt(7) + sqrt(7) + (sqrt(7) - (sqrt(112)-1 - sqrt(112))))5. 10sqrt(17)/11 Simplify (-3sqrt(800))/sqrt(10) - ((sqrt(200)/(sqrt(80)/sqrt(8)) - sqrt(20))/sqrt(4))*2. -12sqrt(5) Simplify -5 + (-1sqrt(6480) - (sqrt(45) - (sqrt(3645) + 2sqrt(3645))))/(sqrt(72)/sqrt(2)-5). -5 - 7sqrt(5)/5 Simplify ((sqrt(2) + sqrt(6)/(sqrt(3) - (sqrt(27)/sqrt(9) - sqrt(3))))1)2 - 4(-1 + sqrt(50)). -20sqrt(2) + 12 Simplify (-62sqrt(190))/(4sqrt(10)4). -3sqrt(19)/4 Simplify (sqrt(425) - (-2(0 + sqrt(425)) - sqrt(425))2) + (sqrt(425) - (-2 + sqrt(425) + sqrt(425)2) - sqrt(425)) + -2. -3825 - 10sqrt(17) Simplify ((sqrt(12)/(sqrt(64)2) + (sqrt(2592)2 - sqrt(2592))/sqrt(6))3)*22. 254043/32 Simplify 1((sqrt(99) - 4sqrt(99))/sqrt(9) - (sqrt(11) - ((1sqrt(77))/sqrt(7) - sqrt(11)))) + -1. -4sqrt(11) - 1 Simplify (-4 + (sqrt(20) - sqrt(500)))1 + -1(sqrt(20) - -5(3 + sqrt(20))). -20sqrt(5) - 19 Simplify 3 + ((((sqrt(567) - (1 + sqrt(567))) + -2 - sqrt(567)) + sqrt(567) + -1sqrt(567) + sqrt(567) + -3)2 - ((2sqrt(567)2)2 + sqrt(567) + -1 + 2)). -9034 - 9sqrt(7) Simplify (-4(sqrt(22) - (sqrt(110)/sqrt(5) + sqrt(22))) + sqrt(22) + sqrt(22))/(sqrt(11) - (sqrt(704) + 2sqrt(704)))-2 + -2. -2 + 12sqrt(2)/23 Simplify (24(-1sqrt(125)2 - (3 + sqrt(125) + sqrt(125)-1)))2. 3840sqrt(5) + 32576 Simplify 4((-3sqrt(1700))*2 - (sqrt(204)-6 + sqrt(204))/sqrt(12)) + -3. 20sqrt(17) + 61197 Simplify (sqrt(300) + 5 + sqrt(300)-2 - sqrt(300) - sqrt(300) - (sqrt(300) + 1(2 + sqrt(300))))2. -300sqrt(3) + 7509 Simplify 0 + (sqrt(68)/(sqrt(4)-2))2 + (-4sqrt(102)-1)/sqrt(6). 17/4 + 4sqrt(17) Simplify -4((sqrt(1100) - (1 + sqrt(1100) + -2) - (sqrt(1100) - (sqrt(1100) - (sqrt(1100) + 1 + 3)))) + 3)2. -4400 Simplify sqrt(4800)1 + -2 + sqrt(2352) + (sqrt(240)/(sqrt(5) + sqrt(5) + (sqrt(5) - ((sqrt(5) - (sqrt(5) - sqrt(180))) + sqrt(5))1)))2. 1 + 68sqrt(3) Simplify -2(-5 + sqrt(160)/(sqrt(35)/sqrt(7)) + -5). -8sqrt(2) + 20 Simplify 1-5(sqrt(108) - (sqrt(108) - (0 + sqrt(108)))*2)-5-4. -600sqrt(3) Simplify (1(sqrt(300) + 0 + 2) - 5(sqrt(300) + (2sqrt(300) - sqrt(300) - sqrt(300)) + 2))2. 640sqrt(3) + 4864 Simplify (-6(sqrt(209) - sqrt(209)-1))/((sqrt(110) - sqrt(110)2 - sqrt(110))/sqrt(10)) + 4. 4 + 6sqrt(19) Simplify (sqrt(22)/(sqrt(176)6) - (-3 + sqrt(6)/sqrt(3) + (sqrt(2) - (sqrt(2) + sqrt(54)/sqrt(3)))))2. 49sqrt(2)/4 + 4993/288 Simplify (-5(-3 + 1 + sqrt(245)))2 - (((sqrt(245) - -1sqrt(245))-5 - sqrt(245)) + 5). -623sqrt(5) + 6220 Simplify 3((0 + sqrt(1100) + -4 - sqrt(1100))2 - (sqrt(44) + sqrt(44) + (-5sqrt(88)/sqrt(2))*2)). -3252 - 12sqrt(11) Simplify (3(sqrt(110)1 + sqrt(110)) + -5(sqrt(110) + 2sqrt(110)))/((sqrt(480)6)/sqrt(3)). -3sqrt(11)/8 Simplify 1(5 + (sqrt(640)/sqrt(8))2)-6. -510 Simplify ((sqrt(209)-43)/((sqrt(77) + -3sqrt(77))/sqrt(7)))2 + 2. 686 Simplify 3 + (-4(sqrt(7488) + 0) + 3)*2. -576sqrt(13) + 119820 Simplify (sqrt(63) + sqrt(189)/sqrt(3))/sqrt(9) + -5 - (sqrt(21)/sqrt(27) + (sqrt(847) - -2sqrt(847))). -94sqrt(7)/3 - 5 Simplify ((((sqrt(187) - (sqrt(187) - -1sqrt(187)))1 + sqrt(187) - sqrt(187)) + sqrt(187)1-4)/(-61sqrt(99)))*2 + 5. 2045/324 Simplify (sqrt(17) - ((1 + sqrt(17))-1)2) + (sqrt(17) - (sqrt(153) + 2 + sqrt(153)) - sqrt(17))2 + -4. 23sqrt(17) + 594 Simplify (sqrt(180)-12 - -2(sqrt(180) + -2 + sqrt(180) + sqrt(180)))*2-2. -5792 + 384sqrt(5) Simplify 4(4 + (sqrt(252) - (-4 + (sqrt(252) - -1sqrt(252))2))). -4000 + 24sqrt(7) Simplify (sqrt(78) - (sqrt(78)2 - sqrt(78))6)/(sqrt(6) + (sqrt(96)-2 - sqrt(6))) + -2(sqrt(325) + 2sqrt(325)-5). 725sqrt(13)/8 Simplify (((sqrt(147)2 - (sqrt(243) + -2))2 + -3)-6)*2 + 3. 720sqrt(3) + 10839 Simplify ((sqrt(2448) + (sqrt(2448) + 1 - sqrt(2448)))5 + -2sqrt(2448)-2)2-4. -793252 - 4320sqrt(17) Simplify 1((-3 + sqrt(1900))-1 - (0 + sqrt(1900))-4)*2. 180sqrt(19) + 17109 Simplify (0 + sqrt(300)-3)-5 - (sqrt(300) - ((sqrt(300) + (sqrt(300) - (sqrt(300) + 0)))*2 + -1) - (sqrt(300) - sqrt(300)-2)1). 170sqrt(3) + 299 Simplify (sqrt(81)/(-2sqrt(9)))/(sqrt(36)/(sqrt(12)-2)). sqrt(3) Simplify (sqrt(171) - (sqrt(171)-1-6 + sqrt(171)))/(4sqrt(324)). -sqrt(19)/4 Simplify (sqrt(17) - (sqrt(136)/sqrt(8) + 2 - sqrt(17)))2 + 2 + (-2(sqrt(153) + sqrt(153)1))/sqrt(9). -8sqrt(17) + 23 Simplify -3(-45(sqrt(252) - 1sqrt(252))**2	{ "pile_set_name": "DM Mathematics" }
3 What is the j'th term of 129, 269, 417, 573, 737, 909, 1089? 4j2 + 128j - 3 What is the a'th term of -216, -231, -246, -261, -276, -291? -15a - 201 What is the v'th term of -94, -72, -14, 98, 282, 556? 3v3 + v - 98 What is the i'th term of 85, 54, 21, -14? -i2 - 28i + 114 What is the a'th term of 67, 54, 33, 4, -33? -4a2 - a + 72 What is the j'th term of -520, -2087, -4706, -8383, -13124, -18935, -25822? -j3 - 520j2 + 1 What is the b'th term of -9, -7, 3, 21, 47? 4b*2 - 10b - 3 What is the a'th term of 96, 73, 4, -135, -368? -4a3 + a2 + 2a + 97 What is the i'th term of -8, -10, -12, -14, -16, -18? -2i - 6 What is the g'th term of 30375, 30372, 30367, 30360? -g2 + 30376 What is the c'th term of 403, 416, 437, 466, 503, 548, 601? 4c*2 + c + 398 What is the f'th term of -953, -950, -947, -944, -941? 3f - 956 What is the s'th term of 13, 22, 31? 9s + 4 What is the h'th term of 7, -2, -37, -110, -233, -418, -677, -1022? -2h3 - h2 + 8h + 2 What is the d'th term of 30, 32, 34, 36, 38, 40? 2d + 28 What is the t'th term of -59, -87, -119, -155, -195, -239, -287? -2t2 - 22t - 35 What is the r'th term of 4085, 4094, 4103, 4112, 4121, 4130? 9r + 4076 What is the l'th term of 27, 71, 127, 201, 299, 427? l3 + 37l - 11 What is the i'th term of 1682, 1678, 1674, 1670, 1666, 1662? -4i + 1686 What is the g'th term of 146, 290, 434, 578, 722? 144g + 2 What is the a'th term of 172, 341, 506, 667, 824, 977, 1126? -2a2 + 175a - 1 What is the z'th term of -26, -23, -12, 13, 58, 129? z*3 - 2z*2 + 2z - 27 What is the b'th term of 48, 178, 394, 696, 1084, 1558, 2118? 43b2 + b + 4 What is the s'th term of 1134, 1135, 1136, 1137? s + 1133 What is the v'th term of -487, -497, -527, -589, -695? -2v*3 + 2v*2 - 2v - 485 What is the h'th term of 1491, 1494, 1499, 1506, 1515, 1526? h*2 + 1490 What is the n'th term of 81, 170, 259, 348, 437, 526? 89n - 8 What is the v'th term of -51, -82, -113, -144, -175, -206? -31v - 20 What is the h'th term of 14, 27, 40, 47, 42, 19, -28? -h3 + 6h*2 + 2h + 7 What is the x'th term of 19, 5, -15, -35, -49, -51, -35, 5? x*3 - 9x*2 + 6x + 21 What is the c'th term of 6495, 6498, 6503, 6510, 6519, 6530? c*2 + 6494 What is the m'th term of 3, 10, 21, 36? 2m2 + m What is the y'th term of 15, 30, 59, 108, 183, 290? y3 + y*2 + 5y + 8 What is the u'th term of 115, 51, -113, -425, -933, -1685, -2729, -4113? -8u3 - 2u*2 - 2u + 127 What is the h'th term of -215, -205, -181, -137, -67, 35, 175, 359? h3 + h2 - 217 What is the l'th term of -19, -71, -195, -427, -803? -6l3 - 10l - 3 What is the j'th term of -4395, -8788, -13181, -17574? -4393j - 2 What is the c'th term of 1905, 1899, 1889, 1875, 1857? -2c*2 + 1907 What is the s'th term of 184, 739, 1662, 2953, 4612, 6639? 184s*2 + 3s - 3 What is the s'th term of -2736, -2738, -2740, -2742, -2744, -2746? -2s - 2734 What is the m'th term of -120, -126, -136, -150, -168? -2m*2 - 118 What is the p'th term of 55, 56, 57, 58, 59, 60? p + 54 What is the k'th term of 140, 573, 1294, 2303, 3600, 5185, 7058? 144k*2 + k - 5 What is the s'th term of 7942, 7945, 7948, 7951? 3s + 7939 What is the y'th term of -40, -36, -30, -22, -12, 0? y2 + y - 42 What is the m'th term of 4511, 4512, 4513, 4514, 4515? m + 4510 What is the p'th term of -237, -470, -701, -930, -1157, -1382? p2 - 236p - 2 What is the a'th term of -71, -138, -205? -67a - 4 What is the i'th term of -1344, -2686, -4028, -5370? -1342i - 2 What is the k'th term of -380, -758, -1134, -1508, -1880? k2 - 381k What is the i'th term of -73, -84, -105, -136, -177, -228, -289? -5i2 + 4i - 72 What is the p'th term of 3024, 3027, 3030, 3033? 3p + 3021 What is the c'th term of 2, 7, 10, 11? -c2 + 8c - 5 What is the g'th term of -7, -1, 5, 11? 6g - 13 What is the y'th term of -729, -2907, -6537, -11619? -726y*2 - 3 What is the l'th term of 1411, 5643, 12695, 22567, 35259? 1410l*2 + 2l - 1 What is the v'th term of -3, -10, -31, -72, -139, -238, -375, -556? -v3 - v2 + 3v - 4 What is the o'th term of -405, -400, -385, -354, -301? o3 - o2 + o - 406 What is the b'th term of -36, -69, -126, -213, -336, -501, -714? -b3 - 6b*2 - 8b - 21 What is the x'th term of 120, 119, 118? -x + 121 What is the m'th term of 251, 502, 753? 251m What is the f'th term of 21509, 43017, 64525? 21508f + 1 What is the h'th term of 0, 7, 18, 33? 2h2 + h - 3 What is the q'th term of -63, -95, -153, -249, -395, -603, -885, -1253? -2q3 - q2 - 15q - 45 What is the q'th term of -51, -53, -55, -57? -2q - 49 What is the a'th term of -6, -20, -44, -84, -146, -236, -360, -524? -a3 + a2 - 10a + 4 What is the w'th term of 4, 10, 34, 88, 184, 334? 2w*3 - 3w2 + w + 4 What is the o'th term of -8, -11, -10, 1, 28, 77, 154, 265? o3 - 4o2 + 2o - 7 What is the m'th term of 178, 176, 174, 172, 170? -2m + 180 What is the i'th term of -20, -30, -16, 28, 108, 230, 400? i3 + 6i*2 - 35i + 8 What is the i'th term of -36, -3, 60, 159, 300, 489, 732, 1035? i*3 + 9i*2 - i - 45 What is the c'th term of -1498, -2998, -4498? -1500c + 2 What is the m'th term of -23, -39, -57, -71, -75, -63? m*3 - 7m*2 - 2m - 15 What is the g'th term of -197, -184, -165, -140, -109, -72? 3g2 + 4g - 204 What is the o'th term of -1728, -3459, -5188, -6915, -8640? o*2 - 1734o + 5 What is the p'th term of -32, -72, -118, -170? -3p2 - 31p + 2 What is the b'th term of -9915, -19829, -29743? -9914b - 1 What is the x'th term of 15, 10, 11, 18, 31? 3x*2 - 14x + 26 What is the i'th term of 843, 852, 867, 888, 915? 3i2 + 840 What is the g'th term of 42, 92, 134, 162, 170, 152? -g3 + 2g*2 + 51g - 10 What is the h'th term of 182, 716, 1596, 2816, 4370, 6252? -h*3 + 179h*2 + 4h What is the u'th term of -99, -120, -159, -222, -315, -444, -615, -834? -u*3 - 3u*2 - 5u - 90 What is the r'th term of 428, 427, 426, 425, 424? -r + 429 What is the k'th term of -36, -12, 26, 78, 144? 7k2 + 3k - 46 What is the h'th term of -36, -71, -106, -141, -176? -35h - 1 What is the w'th term of 343, 686, 1029, 1372? 343w What is the g'th term of 15, 16, -5, -60, -161, -320? -2g3 + g2 + 12g + 4 What is the g'th term of 5, -15, -69, -175, -351, -615? -3g3 + g2 - 2g + 9 What is the q'th term of 536, 1071, 1606, 2141, 2676, 3211? 535q + 1 What is the d'th term of 129, 222, 287, 330, 357? d3 - 20d*2 + 146d + 2 What is the u'th term of 43, 50, 61, 76, 95? 2u2 + u + 40 What is the a'th term of 766, 767, 768, 769, 770? a + 765 What is the k'th term of 841, 844, 847, 850? 3k + 838 What is the r'th term of 608, 597, 584, 569? -r*2 - 8r + 617 What is the d'th term of -208, -208, -218, -244, -292, -368, -478? -d3 + d2 + 4d - 212 What is the h'th term of 7, 4, -7, -32, -77, -148, -251, -392? -h3 + 2h*2 - 2h + 8 What is the h'th term of -5, -6, -11, -20, -33? -2h2 + 5h - 8 What is the n'th term of -111, -401, -889, -1581, -2483? -n*3 - 93n*2 - 4n - 13 What is the w'th term of 10, -25, -102, -239, -454, -765, -1190? -3w3 - 3w*2 - 5w + 21 What is the c'th term of 484, 485, 484, 481, 476? -c*2 + 4c + 481 What is the g'th term of -49, -185, -419, -757, -1205, -1769, -2455, -3269? -g*3 - 43g2 - 5 What is the o'th term of 205, 218, 229, 238, 245, 250? -o2 + 16o + 190 What is the o'th term of 2555, 2565, 2575, 2585, 2595? 10o + 2545 What is the q'th term of -1562, -1601, -1650, -1715, -1802, -1917? -q3 + q2 - 35q - 1527 What is the k'th term of 829, 806, 797, 808, 845, 914, 1021, 1172? k3 + k2 - 33k + 860 What is the r'th term of 3504, 14021, 31558, 56121, 87716? r*3 + 3504r*2 - 2r + 1 What is the p'th term of -2, -15, -40, -77? -6p2 + 5p - 1 What is the n'th term of -1662, -3330, -4998, -6666? -1668n + 6 What is the o'th term of 62, 64, 32, -52, -206, -448? -3o3 + o2 + 20o + 44 What is the k'th term of 565, 1132, 1701, 2272? k2 + 564k What is the y'th term of -886, -890, -896, -904, -914, -926? -y*2 - y - 884 What is the f'th term of 46, 46, 52, 64, 82, 106, 136? 3f*2 - 9f + 52 What is the s'th term of -145, -267, -375, -463, -525, -555? s3 + s2 - 132*s - 15 What is the n'th term of	{ "pile_set_name": "DM Mathematics" }
44000000 What is 0.117422 rounded to three dps? 0.117 Round 11723.5 to the nearest one thousand. 12000 What is 32888750 rounded to the nearest one hundred thousand? 32900000 Round 965.38 to the nearest one hundred. 1000 Round -0.00219682 to three dps. -0.002 What is 0.0000270546 rounded to 7 dps? 0.0000271 What is -22445300 rounded to the nearest 100000? -22400000 What is 0.000001335211 rounded to 7 decimal places? 0.0000013 What is -125.06394 rounded to the nearest 10? -130 What is 0.02755548 rounded to 3 dps? 0.028 What is 0.000020660704 rounded to 6 decimal places? 0.000021 What is 370285.8 rounded to the nearest 10000? 370000 Round -102815.81 to the nearest one hundred. -102800 Round 0.03424213 to three dps. 0.034 Round -0.0014456685 to 5 dps. -0.00145 Round -423790 to the nearest one hundred thousand. -400000 What is -0.9207382 rounded to two decimal places? -0.92 Round -0.0626599 to 4 dps. -0.0627 What is -0.0030036 rounded to four decimal places? -0.003 Round 0.0027080793 to four decimal places. 0.0027 Round -6103220 to the nearest 100000. -6100000 What is 51.65705 rounded to the nearest 10? 50 Round -205.90269 to 0 decimal places. -206 What is -1.07349 rounded to 2 decimal places? -1.07 What is 0.0000841738 rounded to 5 dps? 0.00008 Round -0.03441913 to four dps. -0.0344 Round 37631.37 to the nearest one thousand. 38000 Round 0.05816268 to four decimal places. 0.0582 Round 51937.8 to the nearest ten thousand. 50000 Round -155341 to the nearest 1000000. 0 What is 1611897700 rounded to the nearest 100000? 1611900000 What is -0.00026787 rounded to five dps? -0.00027 What is 410781.8 rounded to the nearest 100000? 400000 What is 0.00000304186 rounded to 6 decimal places? 0.000003 What is -0.07083748 rounded to two decimal places? -0.07 Round 50.3871 to zero decimal places. 50 Round 0.00126798 to 4 dps. 0.0013 Round 17552.1 to the nearest 1000. 18000 What is 43.195917 rounded to 2 dps? 43.2 What is 0.000014659729 rounded to 6 dps? 0.000015 Round -0.00005347718 to six decimal places. -0.000053 What is 0.0339269 rounded to five dps? 0.03393 What is -3857460 rounded to the nearest 10000? -3860000 Round 1704368 to the nearest 10000. 1700000 What is -4262310 rounded to the nearest 10000? -4260000 What is 2177.279 rounded to the nearest one thousand? 2000 Round 0.048394327 to three dps. 0.048 Round 2.307629 to 3 dps. 2.308 Round -24.715 to the nearest integer. -25 Round 10009.9377 to 0 decimal places. 10010 Round -0.0149017 to two dps. -0.01 Round 0.00133999 to four decimal places. 0.0013 What is -0.000000942962 rounded to 7 decimal places? -0.0000009 What is 7198690 rounded to the nearest one hundred thousand? 7200000 Round -14848430 to the nearest ten thousand. -14850000 Round -1.0704 to one dp. -1.1 What is 0.000288768 rounded to six dps? 0.000289 Round -876495.94 to the nearest one hundred. -876500 What is 92306.9 rounded to the nearest 10000? 90000 What is -0.00003608213 rounded to 6 dps? -0.000036 What is -678.7492 rounded to the nearest 10? -680 What is 0.0015115 rounded to 4 dps? 0.0015 Round -13851.87 to the nearest ten. -13850 What is -5.071991 rounded to three decimal places? -5.072 What is 27744600 rounded to the nearest one hundred thousand? 27700000 What is -582.853 rounded to the nearest one hundred? -600 Round 17141100 to the nearest 1000000. 17000000 Round 79957.06 to the nearest 100. 80000 What is 0.002296555 rounded to 4 dps? 0.0023 Round -0.0004191657 to seven dps. -0.0004192 Round 46119400 to the nearest 1000000. 46000000 Round 0.0000365385 to 7 dps. 0.0000365 Round -0.3270343 to two dps. -0.33 Round 0.00001276175 to seven decimal places. 0.0000128 What is -349225 rounded to the nearest 1000? -349000 Round -95460.5 to the nearest ten thousand. -100000 What is -13070817 rounded to the nearest one hundred thousand? -13100000 What is 41640400 rounded to the nearest 100000? 41600000 What is 102285.46 rounded to the nearest 100? 102300 What is -3943164 rounded to the nearest ten thousand? -3940000 Round 556.49 to one dp. 556.5 What is 885790000 rounded to the nearest 1000000? 886000000 What is -177.655 rounded to the nearest 100? -200 What is -2814372 rounded to the nearest 1000000? -3000000 What is 370.392 rounded to the nearest ten? 370 What is -0.15925805 rounded to 2 dps? -0.16 What is 0.000003330093 rounded to 7 dps? 0.0000033 Round -3174.405 to the nearest integer. -3174 What is 0.00000100132494 rounded to 7 decimal places? 0.000001 Round -0.80681 to 1 decimal place. -0.8 Round -90.08848 to 1 decimal place. -90.1 Round 9297.94 to the nearest 100. 9300 What is 4.30882 rounded to the nearest integer? 4 What is -234910 rounded to the nearest one million? 0 Round -6.082677 to three decimal places. -6.083 What is 41468251 rounded to the nearest ten thousand? 41470000 What is 0.0000000586647 rounded to 7 dps? 0.0000001 Round -0.00506482 to 3 dps. -0.005 Round 0.0237104 to 5 dps. 0.02371 Round 0.0000747586 to seven dps. 0.0000748 What is 0.0002235135 rounded to 7 decimal places? 0.0002235 Round -123983.8 to the nearest one hundred. -124000 Round -20399.75 to the nearest integer. -20400 Round -2646427.7 to the nearest 10000. -2650000 What is -19925400 rounded to the nearest one million? -20000000 Round 6567260 to the nearest one hundred thousand. 6600000 What is -0.00000860742 rounded to seven dps? -0.0000086 Round 0.000976966 to 5 decimal places. 0.00098 Round 121.11 to the nearest 10. 120 What is 1.033835 rounded to 2 decimal places? 1.03 Round 0.00531914 to 4 dps. 0.0053 Round -0.00993704 to three dps. -0.01 Round 2230.085 to the nearest 10. 2230 Round 2179.76 to the nearest one hundred. 2200 What is -34.315637 rounded to the nearest integer? -34 What is -0.1231866 rounded to 2 decimal places? -0.12 What is -11811.8 rounded to the nearest one hundred? -11800 Round -922448 to the nearest one hundred thousand. -900000 What is -17436790 rounded to the nearest 10000? -17440000 Round -0.2016113 to two decimal places. -0.2 Round 11512310 to the nearest one hundred thousand. 11500000 Round 2.488576 to two dps. 2.49 Round -8.90305 to 1 decimal place. -8.9 What is -0.1457151 rounded to three decimal places? -0.146 Round 35623.9 to the nearest ten thousand. 40000 What is -0.2508586 rounded to four decimal places? -0.2509 Round -56709 to the nearest one thousand. -57000 What is 3652071.4 rounded to the nearest 1000? 3652000 What is 0.0008277984 rounded to 5 decimal places? 0.00083 What is 316.87 rounded to the nearest 100? 300 What is -13616.7 rounded to the nearest one hundred? -13600 Round 0.08627864 to 2 dps. 0.09 What is -2.1668076 rounded to 2 decimal places? -2.17 Round -99.591 to the nearest ten. -100 What is -0.1434028 rounded to 3 decimal places? -0.143 Round -0.000016713298 to seven dps. -0.0000167 Round 37.4712 to 2 dps. 37.47 What is -0.0000011770389 rounded to seven dps? -0.0000012 Round 0.006844231 to 5 dps. 0.00684 Round -3334510.9 to the nearest 100000. -3300000 Round 9826700 to the nearest 100000. 9800000 What is 0.00001588612 rounded to 7 decimal places? 0.0000159 Round 2980.217 to the nearest ten. 2980 What is -141331 rounded to the nearest 1000? -141000 Round 68255700 to the nearest 1000000. 68000000 Round -265.79562 to 1 dp. -265.8 What is 0.0000385459 rounded to 6 decimal places? 0.000039 What is -0.00000781845 rounded to 6 decimal places? -0.000008 What is 0.0015357121 rounded to 5 decimal places? 0.00154 Round -77.8769 to the nearest 10. -80 Round 13845600 to the nearest 10000. 13850000 What is 570.932 rounded to the nearest integer? 571 Round -2440700 to the nearest one thousand. -2441000 What is -0.00001531096 rounded to six dps? -0.000015 What is 1343.554 rounded to the nearest 10? 1340 Round 29.499697 to 2 dps. 29.5 Round -0.0297474 to 4 dps. -0.0297 What is 0.0000044684 rounded to 6 decimal places? 0.000004 Round -0.001187169 to four decimal places. -0.0012 What is -40.137 rounded to the nearest 10? -40 Round -52498890 to the nearest 1000000. -52000000 What is -0.175858 rounded to 3 decimal places? -0.176 What is 0.24929818 rounded to 3 decimal places? 0.249 What is 4157326000 rounded to the nearest 1000000? 4157000000 What is 0.05004762 rounded to 5 decimal places? 0.05005 What is 133.16562 rounded to the	{ "pile_set_name": "DM Mathematics" }
closest to -5 in 24885, -5, -3/4? -5 Which is the nearest to 2/5? (a) 0.2 (b) -1/2 (c) -1.82 (d) 1/2 d What is the closest to -0.6 in 5, 0.3, 2/15, -292? 2/15 What is the nearest to 4 in 28, -34, -3? -3 What is the closest to -1 in 70, 803, -0.5? -0.5 What is the closest to 128 in -4, 210, -0.2? 210 What is the nearest to 1/5 in -164, -2, -0.08? -0.08 What is the nearest to 0 in -3/8, 0, -395/6, 1/5? 0 What is the closest to 0.065 in 7.4, -1/5, 3/13, 0? 0 Which is the closest to 0.273? (a) 11/5 (b) 0.1 (c) -0.2 b Which is the nearest to -4/7? (a) -0.0402 (b) 2 (c) 3 (d) 0.3 a What is the closest to 93/17 in 1, 2/15, 3, 3/4, -0.4? 3 What is the nearest to 0.5 in -3, 5, 0.6, 1220? 0.6 What is the closest to 5 in -0.4, -2/51, -67? -2/51 Which is the nearest to -2/5? (a) 0 (b) -7 (c) 0.15 (d) -18 (e) -0.5 e What is the nearest to 3.5 in -4, -2, 34, -5? -2 What is the nearest to 1741 in 1/6, 0, 3, -3? 3 Which is the closest to -1/3? (a) -0.7 (b) -7/2 (c) 17 (d) -0.3 d Which is the closest to -2/7? (a) -10/11 (b) -0.3 (c) 1.418 (d) 3 b What is the closest to 1 in 0.1, 3/2, -0.4, -18, 3? 3/2 What is the nearest to 0 in -5, -0.3, -0.4, 1/2? -0.3 Which is the closest to 1/55? (a) -114 (b) 24/7 (c) 0.3 c What is the nearest to 2/35 in 5, 0.023, 6, 2? 0.023 Which is the nearest to 0.2? (a) 335 (b) 1 (c) 2/13 (d) 168 c Which is the closest to -1? (a) 2 (b) -0.4 (c) -1 (d) 252 c What is the nearest to -1 in -1, -228, 2, 6/7? -1 Which is the closest to -90? (a) -0.02 (b) -1 (c) -2/11 b What is the nearest to 3 in 0.4, -3, -1, 1405? 0.4 Which is the nearest to 1221/5? (a) 0.5 (b) -1 (c) 4 (d) -11/2 (e) -3/4 c What is the nearest to 28 in 7, -0.02, 1, -5? 7 Which is the nearest to -2? (a) -0.19 (b) -1/6 (c) 984 a Which is the closest to 3? (a) 1.1 (b) 307 (c) -0.1 (d) 1/5 a What is the nearest to 0.07 in -2/23, 338, 0.04? 0.04 What is the closest to -0.066 in 0, -1, -2/39, 2/27? -2/39 Which is the closest to 0? (a) -16.7 (b) 1/4 (c) -1 (d) 2 (e) -36 b Which is the closest to 3/7? (a) -0.19 (b) 2/19 (c) -1.7 b What is the nearest to 0 in 3.1, 3, -1/13259? -1/13259 What is the closest to -0.2 in -0.4, -0.3, 2? -0.3 Which is the closest to 334? (a) -32 (b) 3/4 (c) -5 (d) 2 (e) 3 e Which is the closest to 3/10? (a) 0.2 (b) 2 (c) 777 a Which is the nearest to -1? (a) -6 (b) -11 (c) -47 (d) 2/5 d Which is the closest to 2/5? (a) -1 (b) -48 (c) 4/13 (d) 3 (e) 5 c What is the closest to -11.58 in -4, 11, -2? -4 What is the nearest to 12 in -3/89, 0, -27? 0 What is the nearest to -0.9 in 2, -187, 0.1? 0.1 What is the closest to 61/217 in 4, -1/9, 2/19, -0.1? 2/19 Which is the closest to -1/2? (a) -0.05 (b) 2 (c) 1/4 (d) -95 (e) 2/19 a Which is the nearest to 3? (a) 2/127 (b) -3/19 (c) -2 (d) 5/6 (e) -5 d Which is the closest to -10? (a) -4 (b) 3/8 (c) -0.2 (d) -2/3 a Which is the nearest to -0.1? (a) 7 (b) -21/113 (c) -4 (d) 3 b Which is the nearest to 1/160? (a) -0.2 (b) -1 (c) 4 (d) -2/15 d What is the nearest to -808/7 in 12, 4, -3/4? -3/4 Which is the closest to -3? (a) -6/11 (b) -2888 (c) -1 c What is the nearest to 18 in 3/8, -20, 2? 2 Which is the nearest to -37? (a) -3 (b) -0.3 (c) -31 c What is the nearest to -514 in -0.1, 3/4, -1/2? -1/2 What is the closest to 6835/4 in -4, -2/11, -0.4? -2/11 What is the closest to -0.2 in 5, -4, -818? -4 What is the nearest to 33 in 1/5, 13/11, 2/9? 13/11 Which is the nearest to 1? (a) 11.31 (b) -0.35 (c) 3/4 c Which is the closest to 2/7? (a) 32 (b) -2/5 (c) -232 b What is the closest to -39 in 0.4, 1, 1411/6? 0.4 Which is the nearest to -2? (a) -239/3 (b) 2/3 (c) -2/9 (d) 1/4 (e) -1/7 c What is the nearest to -10 in 3/32, -1, 12? -1 What is the nearest to 1 in 2, -5, -4/235, -628? 2 Which is the closest to -0.16? (a) -356/5 (b) -4/7 (c) 0.4 (d) -1 b Which is the nearest to -7.1? (a) -2 (b) -5 (c) 0.5 (d) 11.1 (e) 0 b What is the closest to 2 in 2.6, 0.01, -2, 3/5, -0.26? 2.6 What is the nearest to -3 in -1, 3, -17, 2? -1 Which is the nearest to -3/5? (a) 0.39 (b) -2/3 (c) -13 b Which is the closest to -9? (a) 1/126 (b) -36.3 (c) -1 c Which is the closest to -17? (a) 26 (b) -2/7 (c) -1 c Which is the nearest to -0.1? (a) 15 (b) 0 (c) -1/4 (d) -0.4 b Which is the closest to -1? (a) 0.53 (b) -2/9 (c) -1 c Which is the nearest to 27? (a) -1/182 (b) -7 (c) -0.3 (d) 1 (e) 2/3 d What is the nearest to -2/3 in -0.1, -189, -1.9, -2/15, 8/7? -2/15 What is the nearest to 2/3 in -0.4, -2, 0.57, -0.0771? 0.57 Which is the closest to -0.5? (a) -2 (b) -1 (c) -9 (d) 25 b Which is the closest to -115/4? (a) 11 (b) -2/5 (c) -7 c What is the nearest to -0.3 in 0.14, -1/3, -13666? -1/3 What is the closest to -1/3 in 5, -0.2, 0.13569? -0.2 What is the nearest to -1/46 in -1/11, 645, 4? -1/11 Which is the closest to 1/2? (a) -9 (b) -5/17 (c) 3 (d) 0.4 d What is the nearest to 0 in -1.3, 37, -0.07? -0.07 Which is the closest to 4? (a) -0.2 (b) -1/6 (c) -0.11 c What is the closest to -1226 in -2/11, 0.09, -3, -1/4? -3 Which is the closest to -1? (a) 3/5 (b) 1929 (c) 0 (d) -7 c Which is the closest to -1/2? (a) 0 (b) -1/11 (c) 4 (d) 165/4 b What is the closest to -13/28 in 0.25, -4/11, 4/3? -4/11 What is the closest to -845.16 in -3, -5, -2/9? -5 Which is the closest to 4? (a) -198 (b) 11 (c) -2 c Which is the closest to -0.195? (a) 2 (b) -0.02 (c) -0.1 c Which is the closest to 1/3? (a) 0.01 (b) 465 (c) 2/11 (d) -3 c What is the closest to -5.6 in -2/9, 0, -1, 5? -1 What is the closest to 0.2424 in -0.5, 3, -2/5? -2/5 Which is the nearest to 0.7? (a) 7 (b) 3/5 (c) 1.5 (d) -2/3 (e) 4 b Which is the closest to -8.7? (a) -3/4 (b) 0.3 (c) 10 a What is the nearest to -0.1 in -0.05, -5/3, 2/5, 4? -0.05 What is the closest to -1/3 in 0.1, 90, -0.17? -0.17 What is the closest to 1 in 0, -270, -5, -6? 0 Which is the closest to -0.0477? (a) -4/7 (b) -4 (c) -0.5 c Which is the closest to -1/9? (a) -0.09 (b) -1 (c) -488 a What is the closest to -0.1 in 5, -3, -2054/9, -5? -3 What is the nearest to -2/7 in 0.6, 164, 7? 0.6 Which is the nearest to 1? (a) -2/577 (b) 2/41 (c) 2/3 (d) -0.6 c Which is the nearest to 1? (a) 1/109 (b) -3 (c) 4 (d) 2 (e) -1/3 a What is the closest to 1 in 0.05, 1.65, -0.7, -2, -0.2? 1.65 What is the closest to 1/2 in -2/7, -2/15, -5/22, -0.19? -2/15 Which is the closest to -0.4? (a) -2/129 (b) -3/11 (c) -2/3 b What is the nearest to -1 in -2/5, 0.4, 2.3, 36? -2/5 What is the nearest to -9 in 0.4, 20, -2/11, -0.01? -2/11 Which is the closest to 0.04? (a) 2/43 (b) -1/4 (c) -4 (d) 1 a What is the closest to 4/9 in -2874, 4, -3/5? -3/5 What is the nearest to 10/13 in 1, -0.3, -0.03? 1 What is the closest to 3 in 2/25, -4/99, -0.4? 2/25 What is the closest to 169.06 in 0, 79, 2? 79 What is the closest to 0.017 in -3, -0.5, -4, -5, -0.04? -0.04 What is the nearest to 0.04 in 1/2, -0.5, -17? 1/2 What is the closest to -40 in -33, 56, 1/3? -33 What is the nearest to 173 in -0.05, -2, 0.6, -3? 0.6 What is the nearest to -2 in 50/7, 5, -2/13? -2/13 Which is the closest to 0.1? (a) -3 (b) 6 (c) 25 (d) 0.1 d Which is the closest to -2/5? (a) 5 (b) 5644 (c) 14 a What is the closest to -811 in 0.1, -3/4, -6? -6 What is the closest to -4 in 20, -6, -0.1, -1/6? -6 What is the nearest to 2/7 in 14, 50, -46, -3? -3 Which is the nearest to 601? (a) -1/4 (b) -1 (c) -0.2 (d) -0.09 (e) -21 d Which is the closest to -11? (a) -0.3 (b) 674 (c) 3 a Which is the closest to 0.46? (a) -8 (b) 69 (c) 5 (d) -5 c What is the nearest to -0.1 in 0, 13/2, -2, -350? 0 What is the nearest to 1.7 in 5, 3, 144.1? 3 What is the nearest to -40 in 3, -2, 0.2, 1836? -2 Which is the closest to -1/7? (a) -11 (b) -1 (c) 3 (d) -4/9 (e) -115 d What is the nearest to 0.1 in 372, 3/4, 10, -0.1, 0.4? -0.1 Which is the closest to -2? (a) 4 (b) 2 (c) -0.3 (d) -2/41 c Which is the closest to -40? (a) 0.3 (b) -2/9 (c) 0.1 (d) 7/2 b Which is the nearest to 2/5? (a) 165.4 (b) 7/6 (c) 0.5 c Which is the closest to 0? (a) 0.2 (b) 2/411 (c) -1/9 (d) 0 (e) -6/17 d Which is the closest to -2? (a) -0.5 (b) -2/7 (c) 25 (d) 0.82 a What is the clos	{ "pile_set_name": "DM Mathematics" }
nder when m is divided by r(2)? 18 Suppose -117j = -110j - 175. Let p(n) = n*3 + 16n*2 + 1 + 6 - 43n*2 + 55n. What is the remainder when p(j) is divided by 34? 30 Let z = -153 + 209. Suppose 2r = 4r - 40. Calculate the remainder when (z/(-6))/(1/3-1) is divided by r. 8 Let k(f) = -f2 - 1. Let c(i) = -17i*2 + 2i + 5. Let n(u) = -c(u) + 2k(u). What is the remainder when n(2) is divided by (13 - 0)/(2/2)? 10 Suppose 7j = -13j + 1140. What is the remainder when (1 + j/1)(-5)/(-2) is divided by 37? 34 Let v = 153 + -143. Suppose -2l + 4z = v, -l + 3z = -0l + 10. Calculate the remainder when 7 is divided by l. 2 What is the remainder when 351 is divided by (4/5 - (1 - -1)) + (-252106)/(-2330)? 30 Suppose -4y = -i + 138, -8i + 9i = -5y + 183. Calculate the remainder when 636 is divided by i. 4 Let j(n) be the first derivative of -n*4/4 + 5n*3 + 25n*2/2 - 53n - 26. Suppose -6u + 66 = -78. What is the remainder when j(16) is divided by u? 19 Let a(k) = -2k + 24. Let c be a(9). Suppose -cw + 2w - 3n - 221 = 0, -w = n + 54. Let v = 71 + w. Calculate the remainder when 80 is divided by v. 8 Suppose 47f + 1059 = 9093 + 7006. Calculate the remainder when f is divided by 159. 2 Let m(w) = 7w3 + 3w - 3. Suppose 5x = 2r + 67, 4x - r - 56 = 3r. Suppose 0 = -xb + 15b - 2. Calculate the remainder when 95 is divided by m(b). 4 Let d(w) = w*3 + 37w*2 + 37w + 47. Let r(u) = u*2 - 2u - 9. Let f be r(4). What is the remainder when 256/5 + f - 2/10 is divided by d(-36)? 6 What is the remainder when 12500 is divided by ((4864/(-112))/8)/(3 + 148/(-49))? 264 Let h(g) = 27g3 - 3g*2 + 6. Let l be h(2). Suppose 7m - l = -3m. Calculate the remainder when (80/25 + -4)-260 is divided by m. 19 Let l = -327 - 20. Let x = 393 + l. What is the remainder when 186 is divided by x? 2 Let q(d) = -2 + d + 10d2 + 13d*2 + 6d*3 + 16d*2 - 37d*2. Let c(y) = y - 2. Let a be c(3). Calculate the remainder when 19 is divided by q(a). 5 Let j = -1603 - -6590. What is the remainder when j is divided by 208? 203 Let b = 7054 - 7050. What is the remainder when 358 is divided by b? 2 Suppose -8v + 114 + 269 = -281. Calculate the remainder when 95 is divided by v. 12 Suppose -5m - 2463 = -3p - 8m, -3259 = -4p + m. What is the remainder when 825 is divided by p? 9 Let o(d) = -d*3 - 3d*2 + 9d + 5. Let c be o(-6). Let n = c - 15. Let h = n + -30. Calculate the remainder when h is divided by 3. 2 Suppose -477 = 4c - 633. Calculate the remainder when 205 is divided by c. 10 Suppose -c - 4b = -82, 3c - 202 = -3b + 2b. Suppose -762 = 403768n - 403774n. Calculate the remainder when n is divided by c. 61 Let u be 6/4 - (-5 + (-3)/(-2)). Let h(t) = -8 + 13t + 3 - u - 3t. What is the remainder when 58 is divided by h(4)? 28 Let o(g) = g2 - 11g - 35. Let n be o(14). Suppose 11p - np - 44 = 0. Calculate the remainder when 54 is divided by p. 10 Suppose -2l + 3y = -17, -7 - 6 = -4l - y. Suppose 2a - 358 = -d - d, -ld - a + 701 = 0. What is the remainder when d is divided by 44? 42 Let o(s) = 5s + 18. Let i = -6 - -3. Let q be o(i). Let h(x) = 2x3 + x2 + 5x. What is the remainder when h(q) is divided by 20? 18 Let v = -490 - -529. Suppose -37l - 5j - 29 = -vl, 4l = -5j + 43. What is the remainder when (-46 + -2 + 1)-1 is divided by l? 11 Let h(a) = -367a + 1927. Calculate the remainder when 735 is divided by h(5). 91 Let u be (64/(-4) - -3) + 6. Suppose ub - 5n = -2b + 10, -4b - 4n + 48 = 0. What is the remainder when b is divided by 6? 1 Let c = 3830 + -3818. Calculate the remainder when 432 is divided by c. 0 Let n(j) = 9j*2 + 148j + 87. What is the remainder when 5081 is divided by n(-16)? 21 Let d(y) = -y*2 + y - 10. Let b be d(0). What is the remainder when (-56)/(-72)183 - 1/3 is divided by (-84)/b + (1 - (-6)/(-15))? 7 Let n(u) = u*2 + 19u + 5. Let d be n(-16). Let k = d - -92. What is the remainder when 142 is divided by k? 44 Let b be (0 + 0)/(-2)17/34. Suppose b = 9c - 95 - 202. What is the remainder when 61 is divided by c? 28 Let j = -12 - -17. Suppose -n - 260 = -jn. What is the remainder when n is divided by (50/(-35))/(1/(-14)) + 4? 17 Let k = -471 + 480. Suppose -1 = 4n - b, 6 = 2n + b - 1. Calculate the remainder when 5 + k - (-2 - n-3) is divided by 9. 4 Let h(l) = 175l2 - 15l - 14. Let m be h(-1). Suppose -mt - 624 = -180t. Calculate the remainder when t is divided by 79. 77 Suppose 29h = 33h - 68. Suppose -8p = -hp + 459. Calculate the remainder when 251 is divided by p. 47 Let t = -245 + 383. Suppose 0 = -3a - 5w + 209, -3w + 1 = 2a - t. What is the remainder when a is divided by (-2)/(-3) + (-58)/(-3)? 8 Suppose 0 = -57o + 1211 + 1842 + 595. What is the remainder when 2108 is divided by o? 60 Let b = -51 - 10. What is the remainder when b/(-3) - (7 - (-207)/(-27)) is divided by 4? 1 Let d = -45 - -63. What is the remainder when 120 is divided by ((-30)/d)/((-30)/378)? 15 Suppose 2 = a + 4z, -4a - 3z + 92 = 19. Let b = -738773 - -738970. Calculate the remainder when b is divided by a. 21 Calculate the remainder when 4323 is divided by (((-96)/(-40))/(-1))/(8/(-20)). 3 Let s(d) = 14d3 + 8d*2 - 10d - 11. Let j be s(-4). Let i = -725 - j. Calculate the remainder when 41 is divided by i. 13 What is the remainder when (14 + 6)/((-2)/(-19)) is divided by 64? 62 Let h = -569 + 816. Suppose 13 = 10l - h. Calculate the remainder when 105 is divided by l. 1 Suppose 0 = -5w - 20, -35x - 4w = -40x + 146. What is the remainder when 768 is divided by x? 14 Let l = 36232 + -31306. What is the remainder when l is divided by 53? 50 Let y = -6 + 19. Calculate the remainder when (-117 - -46) + 36 + 136 is divided by y. 10 Let h(o) = -o3 - 10o*2 - 7o + 2. Let c be h(-10). What is the remainder when (-48)/c - 35/(-3) is divided by 6? 5 Let n = 4059 - 3986. Let r = -18 - -29. Calculate the remainder when n is divided by r. 7 Suppose -118d + 10063 = -79d - 8462. What is the remainder when d is divided by 24? 19 Suppose 4v - 3451 = -10k + 13k, -8k = v - 819. Calculate the remainder when v is divided by 43. 42 Suppose -4b + 448 = 5q, -357b + 360b - 5q = 301. What is the remainder when 217 is divided by b? 3 Let z(y) = -38y + 793. What is the remainder when 822 is divided by z(20)? 30 Let i(d) = -2d3 + 64d*2 - 61d + 105. Calculate the remainder when 1492 is divided by i(31). 132 Suppose -278 + 53 = -5v. Suppose -v = a - 2a. Suppose -112h + 128h - 368 = 0. What is the remainder when a is divided by h? 22 Suppose -1778c = -1775c - 111. Calculate the remainder when c is divided by 28. 9 Calculate the remainder when 813 is divided by 2/1((-7)/2 - -2) + 54. 48 Let j(m) = -m3 + 3m*2 - 22m + 111. Let b be j(8). Calculate the remainder when (7/5)/(4 + 1529/b) is divided by 7. 0 Let o be 16 - (7 - 7)2/(-2). Suppose 4a - oa - 204 = 0. What is the remainder when 118 is divided by (10/2)/(a/(-34))? 8 Suppose 318r = 324r - 24. Suppose 5z - rb = 114, z + 4b - 146 = -4z. What is the remainder when 127 is divided by z? 23 Let n(s) = 109s - 1181. Calculate the remainder when n(15) is divided by 35. 34 Suppose -5o + d = -0d - 9, -4o - 4d + 12 = 0. Suppose -ox = -x - 71. Suppose -189r + 4455 = 1053. Calculate the remainder when x is divided by r. 17 Suppose 4w = 5w + 2o - 1, 2w = 5o + 11. Suppose -wa = a + 5b - 124, 0 = -2a + 2b + 62. Calculate the remainder when a is divided by (-1)/3 + 50/6. 7 Let b = 122 - -4. Suppose -3d + 2j = 3j - b, -3 = -j. What is the remainder when (9/(3 - 0))/(-4 + 218/54) is divided by d? 40 Let k be 70 + 21/14 + (-3)/(-2). Let r = -67 + k. What is the remainder when (-13)/(-3)(3 + 0) is divided by r? 1 Let y(r) = -r2 + 16r + 3. Let g be y(16). Let k(j) = 6j2 + j + 8. What is the remainder when k(g) is divided by (14/8)/((-6)/(-48))? 9 Let a be 1/(428/280 - 3/2). Suppose 40z = az, 3z = -5m + 900. Calculate the remainder when m is divided by 13. 11 Let d(p) be the third derivative of p5/60 + 3p*4/8 + 5p*3/2 - 5p2. What is the remainder when 141 is divided by d(-11)? 30 Let w be (12 + 3)/((-2)/(-2)). Let v(z) be the second derivative of z3/6 - 5z2 - 6z - 2.	{ "pile_set_name": "DM Mathematics" }
any kilograms are there in 7.466467 grams? 0.007466467 How many nanometers are there in 13/4 of a micrometer? 3250 How many centimeters are there in 7687.679m? 768767.9 Convert 0.1242721 meters to micrometers. 124272.1 What is 7/18 of a week in minutes? 3920 How many millilitres are there in 5/8 of a litre? 625 What is 23697.1um in millimeters? 23.6971 How many centuries are there in 31/5 of a millennium? 62 How many millimeters are there in 0.1576566 centimeters? 1.576566 What is 8/25 of a litre in millilitres? 320 What is 6.068834 centuries in millennia? 0.6068834 What is three tenths of a millennium in centuries? 3 Convert 7.94916ml to litres. 0.00794916 What is 9.831806 litres in millilitres? 9831.806 How many kilograms are there in 19/10 of a tonne? 1900 What is three tenths of a millisecond in microseconds? 300 Convert 474315.5ug to grams. 0.4743155 How many nanometers are there in 13/4 of a micrometer? 3250 How many months are there in 4/15 of a century? 320 What is 0.3704386ng in milligrams? 0.0000003704386 How many tonnes are there in 0.931397g? 0.000000931397 How many seconds are there in five sixths of a day? 72000 How many millennia are there in 16277.55 decades? 162.7755 What is 1/4 of a minute in milliseconds? 15000 What is 26/5 of a day in minutes? 7488 Convert 26810090.1 nanoseconds to days. 0.00000031030196875 What is 55291.06mg in grams? 55.29106 What is 1/54 of a week in seconds? 11200 What is 576034.2m in nanometers? 576034200000000 How many millilitres are there in 7/2 of a litre? 3500 How many milligrams are there in one quarter of a gram? 250 What is 50.84452 millilitres in litres? 0.05084452 How many kilograms are there in 9/10 of a tonne? 900 How many minutes are there in 43/3 of a hour? 860 How many litres are there in 15457.19 millilitres? 15.45719 How many grams are there in 7.874391ug? 0.000007874391 Convert 119.4314us to milliseconds. 0.1194314 How many days are there in 155.676006 milliseconds? 0.000001801805625 Convert 4.746806t to kilograms. 4746.806 How many nanometers are there in 7002.567um? 7002567 How many weeks are there in 11531995.65 microseconds? 0.000019067453125 What is 10/3 of a century in months? 4000 How many micrograms are there in 58.38911t? 58389110000000 What is seven halves of a meter in millimeters? 3500 Convert 47794.25g to nanograms. 47794250000000 What is 1/10 of a decade in months? 12 What is sixty-one quarters of a kilogram in grams? 15250 What is 11.65426km in nanometers? 11654260000000 How many millennia are there in 2434.3761 months? 0.202864675 How many tonnes are there in 433625.9kg? 433.6259 What is 757.6938 centuries in decades? 7576.938 How many months are there in 1/6 of a decade? 20 How many milligrams are there in 27/4 of a gram? 6750 What is thirty-three fifths of a microgram in nanograms? 6600 Convert 43071.84g to milligrams. 43071840 What is 6602.894 centuries in millennia? 660.2894 How many days are there in 1540828.71ns? 0.000000017833665625 Convert 0.1930174 millilitres to litres. 0.0001930174 How many milligrams are there in one tenth of a kilogram? 100000 Convert 8602.247 litres to millilitres. 8602247 What is 4.142764 millimeters in meters? 0.004142764 How many seconds are there in 7/6 of a minute? 70 What is 21/5 of a decade in months? 504 What is five quarters of a kilometer in meters? 1250 Convert 202171.6 milligrams to kilograms. 0.2021716 How many millilitres are there in 633449.5 litres? 633449500 What is 52/5 of a tonne in kilograms? 10400 Convert 1740.262kg to nanograms. 1740262000000000 How many milligrams are there in three tenths of a gram? 300 Convert 3.945728 grams to nanograms. 3945728000 How many months are there in 21/4 of a millennium? 63000 How many milligrams are there in 3/8 of a gram? 375 How many nanograms are there in 23683.75 kilograms? 23683750000000000 What is 0.6174356 decades in months? 74.092272 What is 13/5 of a litre in millilitres? 2600 Convert 3.323762 milligrams to kilograms. 0.000003323762 What is 122.4392ml in litres? 0.1224392 How many minutes are there in eight thirds of a hour? 160 How many hours are there in 54.26742 weeks? 9116.92656 How many meters are there in 7.150413 micrometers? 0.000007150413 How many decades are there in 121.78194 months? 1.0148495 What is three eighths of a centimeter in micrometers? 3750 How many months are there in 15/4 of a millennium? 45000 What is 612023.9 milliseconds in nanoseconds? 612023900000 What is 11/4 of a millisecond in microseconds? 2750 What is 5037.167 minutes in milliseconds? 302230020 How many micrograms are there in 19/4 of a milligram? 4750 How many millilitres are there in 74.6764 litres? 74676.4 What is 70666.66 millimeters in kilometers? 0.07066666 How many millimeters are there in 0.1928425 nanometers? 0.0000001928425 What is 5/8 of a gram in milligrams? 625 Convert 9794.222 millilitres to litres. 9.794222 How many micrometers are there in 67/5 of a millimeter? 13400 How many millilitres are there in 12/25 of a litre? 480 What is fourty-three quarters of a millisecond in microseconds? 10750 How many millimeters are there in 3/10 of a meter? 300 How many millilitres are there in nine tenths of a litre? 900 What is 5/8 of a litre in millilitres? 625 How many micrometers are there in 1/10 of a meter? 100000 How many milligrams are there in fourty-four fifths of a gram? 8800 How many kilograms are there in 903.3202 micrograms? 0.0000009033202 What is 9/10 of a litre in millilitres? 900 What is 1/20 of a litre in millilitres? 50 Convert 4955.998mg to grams. 4.955998 How many centimeters are there in 54/5 of a meter? 1080 What is twenty-nine fifths of a kilogram in grams? 5800 What is 3/5 of a microgram in nanograms? 600 Convert 955.3821 decades to millennia. 9.553821 What is 25/2 of a decade in months? 1500 How many months are there in twenty-seven fifths of a millennium? 64800 What is 1/4 of a century in months? 300 How many kilograms are there in 27/4 of a tonne? 6750 How many minutes are there in four thirds of a day? 1920 How many years are there in seven quarters of a millennium? 1750 How many millilitres are there in 1/10 of a litre? 100 What is 12/25 of a micrometer in nanometers? 480 Convert 77.75823ng to kilograms. 0.00000000007775823 How many weeks are there in 169614704.7 microseconds? 0.00028044759375 What is fifty-four fifths of a tonne in kilograms? 10800 How many months are there in 12/25 of a century? 576 How many milligrams are there in 8768.625g? 8768625 What is 7554.293 millimeters in nanometers? 7554293000 How many micrometers are there in 193.1582 millimeters? 193158.2 How many litres are there in 0.648909ml? 0.000648909 How many decades are there in 717.1033 centuries? 7171.033 What is 0.8427681nm in kilometers? 0.0000000000008427681 How many nanograms are there in 55600.66kg? 55600660000000000 How many grams are there in one quarter of a kilogram? 250 What is eight thirds of a hour in seconds? 9600 What is 11/4 of a litre in millilitres? 2750 How many months are there in fourty-seven quarters of a decade? 1410 How many grams are there in fifteen quarters of a kilogram? 3750 How many nanograms are there in one tenth of a microgram? 100 How many centimeters are there in 1/16 of a kilometer? 6250 What is 0.7160583 microseconds in minutes? 0.000000011934305 How many micrograms are there in 3/50 of a gram? 60000 What is 2319.184 years in centuries? 23.19184 How many tonnes are there in 5.082364 micrograms? 0.000000000005082364 What is 3/25 of a day in seconds? 10368 What is 21/4 of a milligram in micrograms? 5250 What is 651.24kg in nanograms? 651240000000000 What is 3/10 of a kilometer in centimeters? 30000 What is three eighths of a decade in months? 45 How many millilitres are there in 3/5 of a litre? 600 What is 11/10 of a gram in milligrams? 1100 What is 7283.7 months in years? 606.975 How many grams are there in 1/20 of a tonne? 50000 Convert 0.779165kg to milligrams. 779165 How many hours are there in five quarters of a day? 30 What is 421030.1l in millilitres? 421030100 How many millilitres are there in 37/2 of a litre? 18500 How many centimeters are there in 12/25 of a meter? 48 How many micrometers are there in 7/2 of a centimeter? 35000 How many mi	{ "pile_set_name": "DM Mathematics" }
iple of 25? True Does 91 divide 40967108? True Is 327 a factor of 1295247? True Does 33 divide 9574059? True Is 38979013 a multiple of 27? False Is 77 a factor of 128276379? True Is 431924491 a multiple of 38? False Does 6377 divide 863541762? False Is 1386106668 a multiple of 21? False Does 22 divide 44089870? True Does 1002 divide 960064296? True Is 114 a factor of 11702041? False Does 19 divide 114487756? False Does 18 divide 29891126? False Does 216 divide 458734? False Does 15 divide 122743547? False Is 25 a factor of 85757? False Is 403308 a multiple of 34? True Is 1387 a factor of 441142285? True Is 769965196 a multiple of 1463? True Is 78070357 a multiple of 321? False Is 351644424 a multiple of 3336? True Is 76 a factor of 64322828? True Does 51 divide 12581904? True Does 13 divide 338229130? False Is 1213080 a multiple of 40? True Does 4 divide 76309642? False Is 121328 a multiple of 4? True Is 27 a factor of 225024896? False Does 53 divide 1214653663? False Is 185 a factor of 883995490? True Is 158 a factor of 37845938? False Is 1040680179 a multiple of 3773? True Is 3175 a factor of 4044009215? False Does 2553 divide 9666602? False Is 1830991312 a multiple of 910? False Is 80978216 a multiple of 69? False Is 13064256 a multiple of 74? True Does 2779 divide 46898404? True Is 337848472 a multiple of 38? False Is 12 a factor of 32701595? False Does 70 divide 19951820? True Does 1097 divide 371417898? False Does 7 divide 4766934? False Is 65 a factor of 1018364534? False Does 2002 divide 27989962? True Is 1459 a factor of 229720272? False Is 36 a factor of 6075732? False Is 585 a factor of 901119041? False Is 128 a factor of 1409272349? False Is 130 a factor of 985628047? False Is 88722544 a multiple of 15? False Does 5 divide 96023525? True Does 136 divide 143493222? False Does 125 divide 250222826? False Is 1512359086 a multiple of 9512? False Does 1437 divide 8590386? True Is 3087 a factor of 89186517? True Is 54 a factor of 130560836? False Is 7694188 a multiple of 5? False Is 1377 a factor of 396558099? True Does 1343 divide 305872972? False Is 349329834 a multiple of 54? True Is 3739131 a multiple of 26? False Is 72108455 a multiple of 640? False Is 654 a factor of 184339710? True Does 661 divide 143089975? True Is 81 a factor of 81625201? False Is 609141811 a multiple of 10? False Does 30 divide 104228567? False Does 150 divide 88825452? False Is 501482877 a multiple of 651? True Is 27 a factor of 55720486? False Is 19 a factor of 385546345? False Is 25 a factor of 523566750? True Does 37 divide 23686068? True Does 4 divide 79863594? False Is 115813936 a multiple of 3248? True Is 629 a factor of 204842656? True Is 1590513793 a multiple of 11? True Is 2990 a factor of 324516660? True Does 32 divide 14847200? True Is 59 a factor of 367501088? True Is 248 a factor of 119744568? True Does 6801 divide 2779133436? True Is 22 a factor of 6640436? True Is 451554123 a multiple of 3921? True Is 16544631 a multiple of 2922? False Is 26689314 a multiple of 6? True Does 3 divide 228246031? False Does 1043 divide 94805571? True Is 58785938 a multiple of 2773? False Is 40885154 a multiple of 2? True Is 2064489876 a multiple of 166? True Is 23691192 a multiple of 651? True Does 954 divide 21326670? True Does 1506 divide 36622908? True Is 3264 a factor of 645788305? False Is 5708 a factor of 279315948? False Does 33 divide 4710882? True Is 10 a factor of 359435836? False Is 949325260 a multiple of 26? True Does 2412 divide 478343016? True Is 9 a factor of 274796631? True Does 2553 divide 1571319940? False Is 40 a factor of 45043160? True Is 1378 a factor of 117759384? False Does 38 divide 199202498? True Is 12 a factor of 8544594? False Is 363 a factor of 661202? False Does 11 divide 20852431? False Is 7411 a factor of 460438019? True Does 39 divide 113582235? True Does 121 divide 448604717? True Is 19 a factor of 6502351? True Is 62 a factor of 378713626? False Is 15716297 a multiple of 37? False Does 562 divide 29265588? True Does 44 divide 1135915861? False Does 311 divide 242264166? False Is 428109207 a multiple of 12? False Does 15 divide 51846420? True Is 1155450 a multiple of 50? True Is 13546650 a multiple of 15? True Is 11301532 a multiple of 29? True Is 17 a factor of 2350359935? False Is 199 a factor of 146140824? True Is 909 a factor of 39450137? False Is 1741448464 a multiple of 56? True Is 52 a factor of 325223668? False Is 6500867265 a multiple of 292? False Is 8 a factor of 1728631628? False Does 157 divide 30533290? False Is 71074283 a multiple of 577? True Is 2583880304 a multiple of 6824? True Is 263354607 a multiple of 32? False Is 54 a factor of 917764390? False Is 37 a factor of 164474733? False Does 331 divide 14410085? True Is 29 a factor of 18437098? True Is 33975197 a multiple of 24? False Does 2762 divide 171227428? True Is 29 a factor of 1527326222? False Is 1864 a factor of 352804401? False Is 2746147136 a multiple of 10835? False Does 48 divide 184373183? False Is 65 a factor of 7165795? True Is 2673156 a multiple of 10? False Does 1638 divide 2716849044? True Does 180 divide 1850583600? True Is 7 a factor of 405863592? False Does 257 divide 164480? True Does 5 divide 5459295? True Is 32 a factor of 247820502? False Is 209060274 a multiple of 121? False Is 34493352 a multiple of 25? False Is 876 a factor of 9720972? True Is 40010257 a multiple of 311? False Is 21 a factor of 1760104080? True Is 7 a factor of 16394330? False Is 115608930 a multiple of 630? False Does 75 divide 12908505? False Does 205 divide 522491700? True Is 170539056 a multiple of 24? True Is 56332863 a multiple of 4? False Is 4158 a factor of 57840675? False Does 1349 divide 12814362? False Does 208 divide 24091143? False Is 32 a factor of 8604736? True Is 1133860748 a multiple of 28? False Does 17 divide 149464204? True Is 8407632 a multiple of 48? True Is 11 a factor of 89442915? False Is 249 a factor of 9423969? False Is 856607348 a multiple of 25? False Does 8 divide 62617058? False Does 75 divide 37629610? False Is 144717288 a multiple of 409? True Is 75678032 a multiple of 10? False Is 1134080 a multiple of 5? True Is 22835718 a multiple of 1962? True Is 1068 a factor of 10861178? False Is 595 a factor of 485852010? True Does 4114 divide 2757790699? False Is 17055500 a multiple of 109? False Does 727 divide 27347559? True Is 243 a factor of 1000980423? True Does 15 divide 568385250? True Does 13 divide 869678264? True Does 6 divide 6613921? False Does 1170 divide 11210940? True Is 117750 a multiple of 5? True Does 31 divide 7008604? True Does 42 divide 414338662? False Does 3 divide 158115945? True Is 6 a factor of 13148754? True Is 30868423 a multiple of 310? False Does 47 divide 364162533? True Does 27 divide 3769302978? True Does 1874 divide 17220468? False Does 218 divide 1061454862? True Does 192 divide 2029774848? True Does 10 divide 23658490? True Does 419 divide 37918243? True Is 311 a factor of 18243551? False Is 3092 a factor of 1287924370? False Does 574 divide 32938990? True Is 341139777 a multiple of 121? True Is 1024040850 a multiple of 175? True Does 42 divide 1768075? False Does 60 divide 922380060? True Does 151 divide 43419501? False Is 5056412793 a multiple of 868? False Does 101 divide 183438892? False Does 944 divide 683309919? False Does 8948 divide 289452757? False Is 1040653212 a multiple of 158? False Does 45 divide 6307380? True Is 801304392 a multiple of 84? True Does 3727 divide 973179180? False Is 173 a factor of 4693287? False Does 20 divide 877030480? True Does 9 divide 15457361? False Is 318 a factor of 1201808537? False Does 155 divide 86371250? False Is 1384062919 a multiple of 2828? False Does 267 divide 3093445713? True Does 475 divide 213729100? True Is 3 a factor of 1249869? True Does 390 divide 449140048? False Is 85900499 a multiple of 7? False Does 1153 divide 11205691? False Is 2299805 a multiple of 36? False Is 32 a factor of 209465312? True Is 53282454 a multiple of 102? True Is 364393662 a multiple of 5767? True Is 11 a factor of 1029669905? True Is 4810501 a multiple of 25? False Is 2577460028 a multiple of 1276? True Does 7370 divide 1386775290? False Does 138 divide 2317547501? False Is 1	{ "pile_set_name": "DM Mathematics" }
2v - 863 = 5n. Let j = -2605/6 - v. Put h, -0.3, j, -2/3 in decreasing order. j, -0.3, h, -2/3 Let z = 36660 - 36665. Sort 0.5, 5/6, -73, z in descending order. 5/6, 0.5, z, -73 Let j = -5.02 + 3.71. Let i = -2.31 - j. Let v = 10 - 15. Sort i, 0.5, v, -2/5 in decreasing order. 0.5, -2/5, i, v Let k = -12 - -4. Let n = 8.3 + k. Let y = 1123 + -1128. Sort 1, n, y in ascending order. y, n, 1 Suppose -3x = n - 520, -5x + 6n + 870 = 7n. Suppose 215 = -5y + x. Let f = -1.5 - -2. Put f, -3, y in ascending order. y, -3, f Let d be (-102)/4(-1760)/288. Let o = 155 - d. Sort o, -1/2, 19 in increasing order. o, -1/2, 19 Suppose -9 = 3j - 15. Suppose jl - 28 = -5l. Suppose -la - 12 = -32. Put 1, a, -4 in ascending order. -4, 1, a Let q be ((-2)/(-6))/(2/(-30)). Let w(i) = i*2 + 120i + 1739. Let b be w(-17). Sort 4, q, b in increasing order. b, q, 4 Let s = 1094 - 1090. Let j = 39 + -28.5. Let g = j - 10. Sort -3, -1, s, g. -3, -1, g, s Let n = 63 + -21. Let f = 84 - n. Let m = f + -40. Sort 5, -2/7, -1, m in decreasing order. 5, m, -2/7, -1 Let h be (3 - 0)(-2)/(-15). Let p = -0.7706 - 27.2294. Sort p, h, 0.5, 3 in decreasing order. 3, 0.5, h, p Let p be (-26)/52 + 9/2. Suppose 0 = -6f + 2f. Let c = f - 7. Sort -4, p, c. c, -4, p Let d be ((-136)/(-17) + -8)/(-1). Sort 2, 4, -5, 9, d in increasing order. -5, d, 2, 4, 9 Let m(l) = -l3 + 4l*2 - 3l + 1. Let i be m(2). Suppose 0 = 2h - 0h - 4. Suppose 5z = 4c + 38 + 12, z + 5c = -19. Put z, h, i in ascending order. h, i, z Let d be 6/(-5)-20(-4)/(-16). Let i be 8 - 5 - (-18)/d. Sort i, -9, -3 in ascending order. -9, -3, i Let v = 0.65 - -5.25. Let m = 0.12 - -5.88. Let w = m - v. Sort 1/4, -3, w. -3, w, 1/4 Let p = 795 - 796. Sort p, -5, -24. -24, -5, p Let g = 13.818 + -18.818. Put -2/9, g, -10 in descending order. -2/9, g, -10 Let t = -3226 + 3295. Let f = -2 - -4. Let r be (-46)/t-2f/(-8). Put r, -6, -0.3 in decreasing order. -0.3, r, -6 Let z(b) = -2b*3 - 4b*2 + 6b + 4. Let t be z(-4). Suppose -4x + 4a = t, -3a + 1 = 3x + 46. Sort -1, x, -4 in ascending order. x, -4, -1 Let q = 9 + -9. Let c = -169 + 168.989. Sort -1/4, 2/9, c, q in decreasing order. 2/9, q, c, -1/4 Let v be (-2)/(-12) - (30/(-36) + 15/15). Sort v, 50, -0.6. -0.6, v, 50 Suppose -17 = -o + 6o - 4s, -3s + 13 = -4o. Suppose -3k = -3r + 3, 0 = r + r - 6. Put k, o, 0 in descending order. k, 0, o Suppose 5p + 3h = 44, 0 = 242p - 239p + 5h - 52. Sort -22, -0.3, 8, p in descending order. 8, p, -0.3, -22 Let l(d) = d2 - d. Let y(s) = 2s*2 - 19s - 19. Let i(k) = -3l(k) + y(k). Let w be i(-15). Suppose 12q - 38 - 22 = 0. Sort w, -3, 3, q. w, -3, 3, q Let d(b) = -12b - 49. Let s be d(-5). Let h = -50 + s. Let n = h + 309/8. Put -1/5, -4, n in descending order. -1/5, n, -4 Let h = 1006/7 + -144. Let z = 210.799 - 211. Let t = z - 0.099. Sort h, 2/5, t, -4 in increasing order. -4, t, h, 2/5 Let s = -23778 - -23781. Put s, -1, -10, -11, 4 in increasing order. -11, -10, -1, s, 4 Let w = -1.204 - -1.104. Put -1, w, 0.04, 3 in increasing order. -1, w, 0.04, 3 Let p = -5.90814 - -1.90814. Let s = -3.344 + 0.324. Let x = s - -3. Put 1, p, x in decreasing order. 1, x, p Let s = -61 - -62. Suppose -s = -8h + 39. Suppose 0 = hc + 7c - 72. Sort c, -5, -1 in ascending order. -5, -1, c Let o(k) = 198k + 199. Let u be o(-1). Put u, -4, 5, 4 in increasing order. -4, u, 4, 5 Let c = -70.3 - -70.59. Sort 4, 2/5, c in decreasing order. 4, 2/5, c Let l = -525.9 - -526. Let g = 23 + -21. Sort 5, l, -4, g in increasing order. -4, l, g, 5 Let p = 4941/8185 - 6/1637. Put -2, p, -21 in descending order. p, -2, -21 Let b(f) = f3 - 6f*2 - 58f + 44. Let l be b(11). Sort l, -2, 4, 15 in increasing order. -2, 4, l, 15 Suppose -s - 4c + 15 = 0, -3s - 6c + 31 = -c. Suppose 2z - 2f = 0, 4z - sz + 4f = -5. Let v be 9/(-12) + 7/4. Put z, -4, v in ascending order. z, -4, v Let j(x) = -64x - 628. Let p be j(-10). Sort -3, 5, 1, -1, p in descending order. p, 5, 1, -1, -3 Let f = -1/936 - 1247/936. Sort -2/13, -1/11, f, -1. f, -1, -2/13, -1/11 Let s be (-28)/(-6)(-900)/175. Let r be (s/10)/(219/(-365)). Suppose -32 = 3u - 2. Put r, 5, -4, u in ascending order. u, -4, r, 5 Let n(h) = h3 + 18h*2 + 17h + 17. Let i be n(-17). Let t be (i - 1)/4 - 6. Sort 4, t, 14, -3 in decreasing order. 14, 4, t, -3 Let a be (16 - 14) + -10 - -7. Put 3, -3, -14, a, 1 in decreasing order. 3, 1, a, -3, -14 Suppose 0 = -5i + 22l - 26l - 47, 0 = 6i + l + 26. Put 0, 1969, 2, i in descending order. 1969, 2, 0, i Let p = 0.08 - 4.08. Let d = 17309 + -17309.1. Sort d, -23, p. -23, p, d Let j = 17.7 + -18. Let c = -557.4 + 557. Let k = 43 - 39. Sort k, j, c in ascending order. c, j, k Suppose -2y + 4w = -8, 0 = -4y + 18w - 23w - 36. Let g be -1 + (-2 - -1 - 1). Sort 1, g, y. y, g, 1 Let b = -109 + 107. Let h be (8 - 6)/2b/(-6). Put 4, -13, -5, h in descending order. 4, h, -5, -13 Let k = 16079 + -16076.7. Put -0.4, -26, k, 1 in increasing order. -26, -0.4, 1, k Let h = 17 + -12. Let r be 2/h + (-24)/10. Suppose 3f - 5z + 23 = 0, -2f - 4z - 3 = -17. Put 8, f, r in ascending order. r, f, 8 Suppose 40 = 5y - 4f, -3y - f - 2f - 3 = 0. Suppose 9965 = -4q - u, -3 = u - 2. Let s be (-4)/18 + q/(-477). Sort 1, s, y in ascending order. 1, y, s Suppose h + 4h + 20 = -4p, h = -2p - 4. Let n = -232530 - -232996. Put -0.1, p, n in decreasing order. n, p, -0.1 Let d = 31.8 + -31.7307. Let m = -39.9307 - d. Put m, -0.1, -0.4, 1/3 in ascending order. m, -0.4, -0.1, 1/3 Suppose -5h - 6 = 4r, 385h + 8 = -2r + 380h. Suppose -2a + 20 = 3a. Put a, r, -11, -3 in ascending order. -11, -3, r, a Suppose -7u = u. Suppose uv + 2v + 8 = 0. Let r = -41 - -46. Sort -7, v, r in increasing order. -7, v, r Let q be (630/56)/(-118/240). Sort 4, q, 2 in decreasing order. 4, 2, q Suppose -5u = m + 106 + 9, 4m + 524 = -4u. Let f = 138 + m. Sort f, 0, 5, -7 in descending order. 5, f, 0, -7 Let l be ((-78)/(-14) - (576/42)/24) + -1009. Put 5, 2, l, -2 in increasing order. l, -2, 2, 5 Let j be (86/8 - -3)20. Let t = j + -258. Sort -5, t, -3. -5, -3, t Suppose -10d = -52 - 68. Suppose 2m - 3u + 5u + 8 = 0, -3m + 5u = d. Put 13, m, -5 in ascending order. -5, m, 13 Let o = 0.8143 + -76.7783. Let h = o - -76. Let n = -5.964 - h. Put n, 3/5, -2/3 in descending order. 3/5, -2/3, n Let d be (-1 + -4)-1 - 31. Let b = -8/7 + 39/28. Put b, d, -5/6 in descending order. d, b, -5/6 Suppose 36 = 5u + 4r + 15, 4u + 2r - 12 = 0. Suppose 30m = 31m + u. Put 0, 8, m in ascending order. m, 0, 8 Let t(l) = -l3 + 11l*2 - 11l + 14. Let r be t(10). Let o = -9 - -5. Let f = 1636 + -1625. Put o, 1, f, r in descending order. f, r, 1, o Let d(c) = c*2 - 6c - 11. Let q be d(7). Suppose -5t + 220 = 5v, -3v = -t + 12 + 16. Let m be 2/((-4)/(t/25)). Put 5, 2/3, m, q in descending order. 5, 2/3, m, q Let t be 5 + (-2 + 8 - 15). Let n be 0 - (-9 + (5 - 4)). Sort t, -3, 0, n. t, -3, 0, n Suppose 12i = -332 - 928. Let l = i + 100. Put -65, l, -2 in decreasing order. -2, l, -65 Let f(h) be the first derivative of h*4/4 - 9h*3 - 31h*2/2 + 87h - 285. Let l be f(28). Suppose -3q + j - 19 = -6, -j - 2 = 2q. Sort q, -4, l. -4, q, l Let y = 3 + -4. Suppose 0 = -2k + m - 2m + 6, 2k = 3m - 2. Let j be (9 - 30/4)/(3/k). Sort y, 0, j in increasing order. y, 0, j Let y = 7.77 + -0.17. Let l = y + -111.6. Let a = l - -102. Sort -0.19, -0.4, a. a, -0.4, -0.19 Let v = -1.15 - 18.85. Let n = 79 + v. Let d = -59 + n. Sort d, -2/17, 4. -2/17, d, 4 Let x(q) = q*3 + 13q - 67. Let d be x(3). Sort d, 84, 0 in ascending order. d, 0, 84 Let l = 137.09 - 3.09. Let c = 133.6 - l. Put -14, -0.2, c, 0.4 in decreasing order. 0.4, -0.2, c, -14 Let j be ((-120)/(-816))/(20/8). Sort j, 1/2, -0.2 in increasing order. -0.2, j, 1/2 Let s(n) = n*3 - 40n*2 - 2. Let f be s(0). Let g = -0.1 + 5.1. Sort f, -1, g, -1/4. f, -1, -1/4, g Suppose -165a + 188a - 95 = -26. Let m(o) = o - 7. Let d be (-6 - 0)/(-1 - 0). Let z be m(d). Put 1, z, a in descending order. a, 1, z Suppose 0 = 4g + 7 + 1. Let j = 48/13 + -694/195. Put 4/3, j, g in ascending order. g, j, 4/3 Let z = -535.33 - -533. Let j = z + 1.33. Let q be 2/(-2) + (-20)/(-14). Put q, j, 1/2, 2 in decreasing or	{ "pile_set_name": "DM Mathematics" }
(x)). 10x2 Let g = 12 - 7. Let z(c) = -c + 7. Let s be z(g). Let y(v) = -8 + 8 - 2v*s. Let j(f) = -2f*2. Determine j(y(h)). -8h4 Let x(y) be the second derivative of y4/12 + 2y - 1. Let l(v) = -14v*2. Calculate l(x(g)). -14g*4 Let h(m) = -12m. Let y(n) = -5n + 4. Suppose 5f - 23 = 2. Let x(z) = -6z + 5. Let i(q) = fy(q) - 4x(q). Determine i(h(a)). 12a Let d(y) = 6 - 3 - 2y2 - 3. Let b(j) = 4j*2 - 2j2 + j2 - 2j2. Give d(b(o)). -2o*4 Let b(c) = -c. Let u(v) be the first derivative of -11v*2/2 + 7. Calculate b(u(s)). 11s Let x(w) = 4w2. Suppose -5h + 0h + 10 = 0. Let j(o) = o2 - 6o2 + oh + 6o2. Calculate x(j(a)). 16a*4 Let a(v) = -2v. Let z(q) = 3q - 2. Let l(u) = -10u + 7. Let o(n) = 2l(n) + 7z(n). Let y(d) = 2a(d) + 3o(d). Let j(b) = 2b. Determine y(j(c)). -2c Let b(j) be the second derivative of -j*3/3 - 350j. Let t(w) = -w. Let p = 11 - 21. Let s(a) = -6a. Let m(r) = pt(r) + s(r). Determine m(b(d)). -8d Let v(h) be the third derivative of h5/60 + 8h*2. Let f(z) = 6z. Calculate f(v(t)). 6t2 Let n be (3/(-9))/((-1)/18). Let q(o) = -3o2 + o2 + no2 - 3o*2. Let h(i) = 2i*2. Determine h(q(y)). 2y*4 Let x(k) = -k. Let w(g) = 83g*2. What is w(x(n))? 83n*2 Let y(u) = u. Let z = 15 - 4. Let s = z - 11. Let j(v) = sv - 3v + 4v. What is j(y(d))? d Let u(s) be the third derivative of 0s3 + 0 - 1/15s*5 + 2s*2 + 0s*4 + 0s. Let t(q) = q*2. Calculate t(u(d)). 16d*4 Suppose -4q - 4b + 12 = 0, -2q + 2b = -5q + 9. Let h(d) be the first derivative of q + 0d - 5/2d*2. Let l(u) = -2u*2. What is l(h(x))? -50x*2 Let z(d) = -63d + 10. Let c(g) = -42g + 7. Let x(n) = -7c(n) + 5z(n). Let p(t) = 2t. Calculate p(x(i)). -42i + 2 Let g(l) = 8l. Let s(h) = -3h. Let f(t) = 4g(t) + 11s(t). Let u(o) = o2. Calculate f(u(m)). -m2 Let k(c) = -40c. Let l(v) = -29v. What is l(k(t))? 1160t Let y(i) be the third derivative of -i5/15 + i2. Let v(a) = a*2 + 5a + 3. Let w be v(-6). Let f(x) = w + 2x - 9. Determine f(y(r)). -8r*2 Let j(h) = 6h. Let z(f) = -1 + 3f + 1 + 0. Give j(z(y)). 18y Let u(a) = a*2. Let n be (2/(-4))/((-1)/12). Let o(h) = -3h + 0h + nh - 4h. What is u(o(d))? d2 Let g(l) = 2l. Suppose 2z = k + k - 6, z = 3k - 7. Suppose 3t = -kt + 25. Let x(j) = -tj - j + 3j. Give x(g(s)). -6s Let c(h) = 2255h*2. Let m(i) = 2i*2. What is m(c(l))? 10170050l*4 Let o(l) = -4l*2 + 58l. Let a(u) = 2u. Determine a(o(n)). -8n*2 + 116n Let i(k) = 2k2. Suppose -3h + 10 = 2h. Let j(y) = 0y + y - y - hy. What is j(i(t))? -4t*2 Let i(v) = 6v*2. Let j(x) = 1 + 2x - 7 + 6. Let n(o) = -o. Let h(t) = 3j(t) + 8n(t). Give i(h(s)). 24s2 Let j(l) = l. Let r(b) = 331b. What is j(r(p))? 331p Let v(g) = g. Let z(o) = o2 + 5o - 2. Let m be z(-6). Let r(s) = 4s - ms + 2s2. Give v(r(u)). 2u*2 Let f(w) = 5w. Let m(x) = 3x. Let b(n) = -n3 - 5n*2 + 3. Let o be b(-5). Let l(a) = -2a. Let u(i) = om(i) + 4l(i). Give f(u(s)). 5s Let m(i) = i2. Suppose 0 = 2g + g + 3. Let d be 3(2 + g/3). Let f(v) = -v + dv - v. Give m(f(a)). 9a2 Let k(z) = -4z + 7. Let r(l) = -5l. Calculate r(k(p)). 20p - 35 Let t(f) be the first derivative of 5f2/2 - 1. Let i(y) = 6y. Let m(d) = d. Let r(p) = i(p) - 5m(p). Calculate t(r(c)). 5c Let c(r) = 2r2. Let o(w) = w - 21. Let k(t) = 3. Suppose -z - 17 = -4p, 2z = -p - p - 44. Let l(v) = zk(v) - 3o(v). Give l(c(g)). -6g*2 Let f(l) be the third derivative of -5l*4/24 - 13l2. Let j(q) = -4 - q2 + 4. Give j(f(x)). -25x2 Let h(v) = 5v. Suppose 0 = -0t + t - 4. Let b(c) = 14c*2 - 11c - 11. Let j(f) = 5f2 - 4f - 4. Let g(w) = tb(w) - 11j(w). Calculate h(g(l)). 5l2 Let s(u) = 2u*2 - 38u. Let o(r) = -2r. Give o(s(q)). -4q*2 + 76q Let z(j) = -j. Let c(t) = -288t2. What is z(c(x))? 288x*2 Let q(c) = -2c. Suppose 0m = -m + 2. Let j = m - 2. Let o(w) = -w - w - w + w + j. Determine o(q(a)). 4a Suppose 7 = 3y - d - 0, 1 = 3y + 5d. Let a(f) = 1 - yf + 5 - 6. Let v(t) = 7t2. Give v(a(b)). 28b*2 Let k(q) = -2q. Let z(b) = -4b2. Determine k(z(c)). 8c2 Let s(h) = h3 - 4h2 + 3h + 3. Let u be s(3). Let m(t) = ut2 + t2 - 2t*2. Let c(q) = -q. What is m(c(z))? 2z*2 Let v(b) = b. Let g(n) = 85n. Calculate v(g(s)). 85s Let s(x) = 7x. Let z(o) = 17o. Give z(s(p)). 119p Let q be (-100)/(-55) + 2/11. Let b(y) = 6y2 - 3y*q + 2y2 + y2. Let o(m) = -2m. Determine o(b(n)). -12n*2 Let i(z) = 22z2. Let g(c) = -c2. Let n(r) = -3g(r) - i(r). Let j(m) = -3m. Calculate j(n(b)). 57b2 Let w(y) = -22y2 + 4. Let f(c) = c2. Give w(f(j)). -22j4 + 4 Let v(m) = 2m - 34. Let f be v(19). Let j(c) be the third derivative of 0c + 5/12c*f + 3c*2 + 0 + 0c*3. Let s(a) = -a. Calculate j(s(w)). -10w Let z(m) be the first derivative of 8m3 + 3. Let p(t) = t2. Give p(z(d)). 576d*4 Let r(k) = -k. Let g(v) = -710v. Determine g(r(d)). 710d Let r(q) = -11q*2. Let s(g) = -57g - 9. What is r(s(x))? -35739x2 - 11286x - 891 Let a(l) = 2l2. Let w(v) = -19v*2 + 29v. Give w(a(q)). -76q4 + 58q*2 Let u(t) = -t. Let r(n) = -8n*2 + 11n - 11. Let o(y) = y*2 - y + 1. Let b(c) = 22o(c) + 2r(c). Determine u(b(l)). -6l*2 Let m(d) = -2d2. Let g(z) be the second derivative of z4/6 + 2z. Let c(w) = -3g(w) - 2m(w). Let j(p) = -9p. What is j(c(l))? 18l2 Let h(f) = 53f*2 - 2f. Let d(m) = 2m. Give h(d(r)). 212r*2 - 4r Let z(n) = -n*2 + 1. Let y(r) = 2. Let u(c) = -3y(c) + 6z(c). Let m(q) = -2q*2. Give m(u(o)). -72o4 Let w(u) be the second derivative of -u4/6 + 11u. Let n(z) = -4z*2. Calculate n(w(g)). -16g*4 Let z(k) = 9k*2 - 3. Let v(u) = 5u*2 + 1. Give v(z(a)). 405a*4 - 270a*2 + 46 Suppose 6j = 3j + 6. Let l(w) = 3w*2 + 2w*j - 5w2 + w2. Let d(r) = -2r. Calculate l(d(m)). 4m*2 Let i be 1/3 + (-132)/(-9). Let o(v) = 2v - i + 15. Let p(s) = 2s. Give p(o(w)). 4w Let f(a) = 3a - 2. Let z(y) = y. Calculate z(f(p)). 3p - 2 Let d = -25 - -25. Let i(a) be the third derivative of 1/6a4 - 2a*2 + 0a + 0 + da3. Let q(n) = n2. Calculate i(q(r)). 4r*2 Let m(a) = -13a*2. Let c(s) = 11s*2 + 10s*2 - 19s*2. What is m(c(x))? -52x4 Let x(o) = -o2 - o + 1. Let s(f) = 8f2 + 5f - 5. Let v(g) = -s(g) - 5x(g). Let k(t) be the third derivative of t4/12 - t2. What is k(v(j))? -6j*2 Let c(b) = -2b*2. Let z(w) = 3w + 79. Give z(c(a)). -6a2 + 79 Let i(f) = 13f. Let u(m) = 582m. Calculate i(u(j)). 7566j Let b(a) be the third derivative of a4 - a2 - 3a. Let k(v) = v. Give k(b(o)). 24o Let w(s) = 2s2. Let l be w(1). Let i(u) = l - 2 - u. Let z(x) be the first derivative of x2/2 + 10. Calculate i(z(h)). -h Let f(q) = 2q*2. Let h(k) = -115k. What is h(f(r))? -230r2 Let z(f) = -f2 - 3. Let m(y) = -2y*2 + 7 + 4y*2 + 0. Let p(g) = 3m(g) + 7z(g). Let l(k) = 3k*2. Give l(p(q)). 3q4 Let q(t) = -t - 4. Let d be q(-5). Let m(h) = -h2 + d - 1 + 5h2. Let w(x) = 2x*2. Give m(w(c)). 16c*4 Let u(t) = 42t. Let r(p) = p. What is u(r(k))? 42k Suppose -3v + 4 = -v. Let n(b) = vb - b + 0b. Let p(g) = -1. Let k(a) = 3a - 6. Let y(f) = k(f) - 6p(f). Calculate y(n(t)). 3t Let s(i) = i. Let c(h) be the first derivative of 5h*4/12 - 3h - 1. Let b(y) be the first derivative of c(y). Determine s(b(v)). 5v2 Let f(b) = 32b*2. Let x(k) = -2k*2 + 3k + 3. Let o(q) = q*2 - 2q - 2. Let t(h) = 3o(h) + 2x(h). Calculate t(f(p)). -1024p4 Let r(q) be the second derivative of q3/2 - 4q. Let p(m) = 3m2. Give r(p(b)). 9b2 Let o(j) = j2 + 2j + 2. Let t(c) = -5c*2 - 11c - 11. Let l(h) = 11o(h) + 2t(h). Suppose -9 = -5k + 1. Let r(z) = -z2 + 2 - k. Calculate r(l(f)). -f4 Let z(x) = x. Let l(c) = 5c + 8. Let y be l(7). Let d(u) = -43 + y + 3u2. What is d(z(h))? 3h*2 Let p(f) = 29f. Let i(k) = 102k. Calculate i(p(o)). 2958o Let b = -5 + 7. Let o(m) = -m2 - mb + m*2. Let c(z) = -3z*2. Determine c(o(i)). -3i4 Let w(y) = y2. Let z(o) be the first derivative of 1 + 0o - 1/2o2. Calculate w(z(d)). d2 Let a(u) = -u*3 - 11u*2 - 11u - 12. Let g	{ "pile_set_name": "DM Mathematics" }
3 - 2h2 - 42h + 15. What is the lowest common multiple of t(-19) and 12? 204 Calculate the smallest common multiple of (-24)/70-15(-70)/(-3) and 120. 120 Suppose -3b - 19 = -61. Suppose q + b = 3q. Let g = 0 + 1. What is the lowest common multiple of g and q? 7 Suppose 107 + 31 = 2g. Suppose -5h - 11 - g = 0. What is the common denominator of 63/4 and (-48 + -3)1/h? 16 Suppose 51 = 8s - 397. What is the least common multiple of s and 6? 168 Let q = -37573 + 10520417/280. Find the common denominator of -53/55 and q. 3080 Let t = 17270/7 + -9863/4. Calculate the common denominator of t and -95/512. 3584 Let z = -27208697/8 + 3406339. Let d = -5259 + z. Calculate the common denominator of d and (-4)/((-400)/(-65)) + (-2)/(-5). 8 Suppose -6 = -3o, -u = u - 4o - 2. What is the smallest common multiple of u and -3((-28)/12 + 0)? 35 Let n(v) = 18v - 68. What is the lowest common multiple of n(4) and 20? 20 Let k = 36/721 + 12409/112476. Calculate the common denominator of -169/30 and k. 780 Let x = 6/1271 + -59917/38130. What is the common denominator of x and 97/18? 90 Suppose 5m - 13 = -3. Suppose 6c - mc = -192. Let a = -26 - c. What is the smallest common multiple of a and 20? 220 Calculate the common denominator of 2 + 2712/(-882) + (-28)/(-21) and -65/28. 588 Let q be 6/4(-2)/(-3). Let i be 0 + (0 - -58q). What is the common denominator of -109/6 and 133/i + (0 - 3)? 174 What is the common denominator of 8/(-18) + 1774/144 and 37/50? 200 Let n = 1/79645 - 2310209/40141080. Calculate the common denominator of n and 53/56. 504 Suppose 0 = l - 2h - 170, -4l + 342 + 273 = 5h. What is the lowest common multiple of 128 and l? 640 Let v = -118741/33 + 3597. Calculate the common denominator of (104/100)/((-12)/(-35)) and v. 330 Find the common denominator of (4/(-10))/(-11 - 24105/(-1975)) and -17/35. 1190 Suppose 4c - 44 - 16 = 0. Let k be (-1)/(-5) + (-228)/c. Calculate the lowest common multiple of 8/20 + (-204)/k and 8. 56 Let y = 108 + -109. Find the common denominator of y/9(0 + (66 - -7)) and 4/(-14) + 424/406. 261 Suppose z - 4x + 1764 = 3z, -5x + 1768 = 2z. Calculate the common denominator of z/(-60) - 2/(-5) and (-32)/80 - 19/(-5). 30 Let a(s) = s*3 - 23s*2 - 26s + 48. Let h be a(24). Suppose h = v + 6r - 4r - 1, 5v = -4r + 5. What is the smallest common multiple of 7 and v? 7 Suppose -3n + 24 + 24 = h, 4h + n - 148 = 0. Suppose -2f = q + 9 + 18, -f = -q - h. Calculate the common denominator of -55/14 and 5/(-2)q/50. 140 Let u = -15 + 21. Calculate the lowest common multiple of (196/(-140))/(3/(-30)) and u. 42 Suppose 0 = 3w - w + 6. Let d(u) = 2u*2 + u - 8. Let c be d(w). Let g = 9 + c. Calculate the least common multiple of g and 18. 144 Suppose 0 = 5u + 5j - 125, 2u + j - 58 = -3j. What is the smallest common multiple of 21 and u? 21 Let x = -1114/21 - -307/6. Calculate the common denominator of -52/7 and x. 42 Let x = -1476 - -1632. What is the smallest common multiple of 104 and x? 312 Let l(q) = -6q*3 - 6q*2 + 5q - 3. Let v be l(-8). Let x = v - 15761/6. Find the common denominator of -31/16 and x. 48 Let p = -9886 + 89099/9. Let z = p + 137/18. Calculate the common denominator of -43/14 and z. 14 Let f(k) = 42k - 2. What is the smallest common multiple of 65 and f(1)? 520 Let h(x) = x3 + 2x + 2. Let c be h(-1). Find the common denominator of 101/4 and (0 - 85/40)/c. 8 Let i(q) = -q*2 - 5q - 4. Let x be i(12). Calculate the common denominator of (-930)/x + (-14)/(-91) and -7/10. 40 Let r be 378/19 - (-6)/57. Suppose -26v + 22v + r = 0. Suppose -4x + 25 = x. Calculate the lowest common multiple of v and x. 5 Find the common denominator of (-59)/((23)/1) and (-42)/231 + 50/1485. 54 Calculate the common denominator of -54/7 and (-8 - 0) + 228492/28080. 5460 Suppose -s = 7s - 72. Let l = -24 - -32. What is the lowest common multiple of l and s? 72 Let j = 42 + -41. What is the common denominator of -59/12 and 8/(-60)j/(-3)10? 36 Suppose -155b + 146b + 405 = 0. What is the smallest common multiple of 345 and b? 1035 What is the common denominator of -3 + (-30)/40412/(-66) and 11/(-4)(-4)/(-18)? 198 Let b(x) = -7x*3 + 3x + 4. Let s be b(-2). Suppose s = 5h + c, -2c + 28 = 2h - 0c. What is the least common multiple of 4 and h? 20 What is the common denominator of ((-612)/(-60))/(27/6) and 67/39? 195 Suppose 2p - 122 = -5f, p - 2f - 45 - 7 = 0. Suppose -25w + 24w - 9 = -3j, 2j + 14 = 4w. Calculate the smallest common multiple of w and p. 168 What is the common denominator of ((-1455)/15)/(-25 - -1) and 143/48? 48 Suppose 24818 = -5k - 3n + 5n, 5k = -4n - 24794. Calculate the common denominator of -91/10 and k/3024-3 - (-2)/7. 120 What is the common denominator of 174/33 - (-3 + 5) and 130/(-9)2/5? 99 Let f = -6007/16 - -375. Let z = -493/48 - f. Find the common denominator of z and -5/2. 6 Let p = 52964 - 3601649/68. What is the common denominator of p and 23/153? 612 Let g(s) = s2 - 8s + 7. Suppose 2y + 21 = 5y. Calculate the lowest common multiple of y and g(8). 7 Let j(n) = n*2 - n - 5 + 60n*3 + 4 + 18n3. Calculate the lowest common multiple of 7 and j(1). 77 Let u(n) = n2 - 13n + 16. Let z be u(12). Suppose 0 = -p - p + z. Calculate the least common multiple of 16 and ((-48)/(-2))/(3/p). 16 Suppose -14d + 2487 + 20599 = 0. What is the lowest common multiple of d and 5? 8245 Let h(b) = 5b - 4. Let i be h(2). Let v(f) = 4f*2 + 6f + 8. Let z be v(i). Find the common denominator of 23/10 and 4 - (-5)/((-240)/z). 60 Let c(u) = u*3 + 5u*2 - 2u - 2. Let y = 1 + -5. Calculate the lowest common multiple of c(y) and (-3)/(-2 + -1) + 15. 176 Let c = 23 + -39. Let a = c - -22. What is the least common multiple of a and 6/9-3 - 8/(-1)? 6 Let g = -34/27 + 581/54. Find the common denominator of g and 27/22. 22 Let j = 67441 - 8902351/132. What is the common denominator of -139/12 and j? 132 Let l = 378937/4398 + 4/733. Let r = -86 + l. What is the common denominator of (43 - 0)5/60 and r? 12 Find the common denominator of -23/21 and ((-981)/(-6))/(-1)15/6885. 2142 Let w be -4 - ((-1145)/(-20))/1. Let h = w - -72. What is the common denominator of h and 33/10? 20 Let h(j) = j2 + j. Suppose k = f + 10, 8f = k + 5f - 16. Calculate the lowest common multiple of h(-3) and k. 42 Let f be 26/(-30) + (-1)/((-60)/(-8)). Calculate the common denominator of (f - 2) + 4 - (-32)/(-52) and 59/9. 117 Let p = -12637/19788 + 69/388. What is the common denominator of p and -43/14? 714 Let o = -4612 - -124544/27. What is the common denominator of o and -59/30? 270 Let v be 35/(-84)(-3814)/540. Let k = v - 73/81. Calculate the common denominator of k and 137/36. 72 Suppose -g - 2h = -4, -3g + h = -2g - 1. What is the common denominator of ((-303)/g)/(-4 + 16) and -39/10? 40 Suppose -2w = 3y + 1, -w = -2y - 2y + 28. Let h = 12 - -10. What is the smallest common multiple of (w/(-2))/(8/12) and h? 66 Let m = 94908 + -186215/2. Let j = m - 1760. What is the common denominator of (-6)/20290/4 and j? 4 What is the common denominator of ((-68)/60)/(72/(-80)) and 1/27? 27 Let a(i) = -i*3 + 7i*2 + i - 3. What is the smallest common multiple of 6 and a(7)? 12 Suppose 210 = -17v + 27v. What is the lowest common multiple of 2(-9)/(1 - 4) and v? 42 Let u(k) = 116k3 + 2k*2 + 2k + 1. Let j be (-3)/2 - (-2)/4. Let t be u(j). Calculate the common denominator of 67/10 and ((-6)/15)/((-9)/t). 90 Suppose 242l = 229l + 156. Let r be (-8)/123/(-1). Suppose 2k = 3j - j + r, -3k = j - 15. Calculate the smallest common multiple of l and k. 12 Suppose -4w + 10 = 3g - 4, 38 = 5g + 3w. What is the smallest common multiple of 110 and g? 110 Suppose 0 = -2m - 5t - 190, -5t - 198 = 5m + 277. What is the common denominator of (-717)/180 - 2/3 and m/(-16) + (-2)/(-8)-1? 80 Let l be (2 - (-1 - -5)) + 30. Suppose 5n = -3q - l, n = q - 3 - 1. Calculate the lowest common multiple of 4n/70-21 and 11. 66 Suppose -6a = -2a + 3v - 15, v + 27 = 4a. Let z(m) = 4m*2 - 7m + 4. Let n be z(a). Calculate the common denominator of (-4 - -2) + n/(-20) and 109/6. 30 Find the common denominator of ((-2)/6 - 4422/(-1656)) + -3 and -16/9. 828 Calculate the	{ "pile_set_name": "DM Mathematics" }
). 7 Let x(r) = 6r. Suppose 0 = -5z + 2d - 5, -3z - 8 = -2d - 5. Let u be z(-14)/49-7. What is x(u)? -12 Let u(s) be the third derivative of -s4/4 - s3/6 + 902s2. What is u(4)? -25 Let x(o) = o3 + 9o2 + 7o - 8. Let m be x(-8). Let i(f) = f + 47. Let d be i(-19). Let n(c) = 12 - 2c - d + c. Determine n(m). -16 Let r be (-1540)/(-175) + ((-6)/(-10))/3. Let y(x) = -12x + 3x2 + rx + 2 + 4x - 3. Give y(1). 3 Let p(q) = 49q - 2. Let f(w) = -106w + 4. Let s(a) = 6f(a) + 13p(a). Let l be -1(-3 - -2)-9. What is s(l)? -11 Suppose 480 - 470 = 12y - 242. Let a(z) be the first derivative of 3/2z2 + 2z + y. Determine a(-5). -13 Let x = 1000 + -1006. Let h(b) = -b*2 + 32. Give h(x). -4 Let y(n) = -2n*3 - 56n*2 - 56n - 56. Let q be y(-27). Let o(d) be the first derivative of -9d2/2 - 2d + 8. Determine o(q). 16 Let k = -2038 - -2044. Let h(g) = -g*3 + 6g*2 - g + 16. Give h(k). 10 Let z(p) = -8p - 2p2 + p2 + 1322 + 1337 - 2659. Determine z(-2). 12 Let k(z) = z2 + 7z - 6. Suppose 9b + 162 = 18b. Let p(i) = b + 19i - 9i + 21 - 7i. Let u be p(-15). Calculate k(u). -12 Let j(f) be the first derivative of f3/3 - 3. Let w = -184 + 194. Let a be (-54)/(-45)w/(-4). Give j(a). 9 Let o(i) = -i + 2. Let u be o(3). Let b(m) = 19m - 19m + m*2 + 5398m*3 - 5408m*3. Calculate b(u). 11 Let v(l) = 19l*3 - 25l*2 - 4l - 91. Let u(d) = 24d3 - 31d*2 - 5d - 114. Let c(n) = 11u(n) - 14v(n). Determine c(5). 0 Let r(f) = f - 8. Let g(j) = 68j2 + 62j - 1. Let h be g(-1). Calculate r(h). -3 Let j be (-2)/4 - 1/(-2). Let l(w) = -6w3 + 9w*2 - 6w - 9. Let g(i) = i*3 - 2i*2 + i. Suppose -5q = q + 30. Let u(d) = qg(d) - l(d). What is u(j)? 9 Let c be (-27 + (9 - -6))(-1)/(-2). Let s(x) = 0x + 7x + x*2 - 4 - 2x - 1. Determine s(c). 1 Let w = -30 - -18. Let t(b) = 4b + 15. Let i(a) = a + 4. Let c(h) = 9i(h) - 2t(h). Give c(w). -6 Let g(w) = -17w*3 - 5w*2 + 40w - 66. Let m(k) = 3k3 + k2 - 8k + 13. Let i(z) = -2g(z) - 11m(z). Determine i(2). 9 Let x(y) = 5y3 - 16y*2 + 8y - 1. Let k(i) = -2i3 + 5i*2 - i + 1. Let n(r) = -2k(r) - x(r). Determine n(5). -6 Suppose -525 = -5w - g + 5g, 2w - 2g = 210. Let a = w + -104. Let h(p) = p*2 - a - p + 5p - 2p - 3p. What is h(2)? 1 Suppose 0 = 2l - 12 + 4. Suppose 4f - d - 4 = 3d, 5f - d = 13. Let a(j) = f + 5j + 6j + 11j2 - 12j*2 - 6j. What is a(l)? 7 Let o(d) = -1027d - 329 + 652 - d3 + 1022d - 328 - 6d2. Let l be 46/(-10) + (-4)/10. Calculate o(l). -5 Let p(k) be the second derivative of k5/30 + k4/24 + 68k*3/3 - 9k - 9. Let h(s) be the second derivative of p(s). Calculate h(-6). -23 Let q(l) be the third derivative of l4/24 + l3/2 - 419l2. Let a(c) = 0c*2 - 6c2 + c2 + c - 1 - c3 + c2. Let s be a(-4). Determine q(s). -2 Suppose 0 = -3o + 194 - 167. Let t be (-6)/o + (-20)/(-12). Let y(r) = -15r*3 - 2r*2 + 1. Give y(t). -16 Suppose -k = -1 - 2. Suppose 1 = 2s + k. Let r(q) be the first derivative of 7q3/3 - q + 941. Calculate r(s). 6 Let k(v) = -43v - 605. Let m be k(-14). Let u(z) = -z*2 + 6z + 33. Determine u(m). 6 Suppose -i = -2o + 350, 1030 = -31i + 28i + o. Let g = -340 - i. Let l(s) be the third derivative of -s4/3 + 3s2. Calculate l(g). -16 Let w(o) = -o3 + 51o2 + 2o - 98. Let l(r) = -r*3 + 25r*2 - 135r - 30. Let z be l(9). Determine w(z). 4 Suppose 5z - 73 = -2m, 6z = 34 - 28. Let g(w) = -15w + 491. Determine g(m). -19 Let u(r) be the first derivative of r4/4 - r3/3 - 5r2 - 7r - 1290. Calculate u(4). 1 Let a(k) be the third derivative of -1/60k5 - 5 + 1/3k*3 - 2k*2 + 0k + 0k4. Give a(3). -7 Let x(c) = -9c - 221. Suppose 2q = 2r - 36, -4q + 5q - 2r = -11. Give x(q). 4 Let n(s) = s3 + 0s*2 + 26025 - 2s*2 - 25991 - 24s - 7s2. Give n(11). 12 Let n be -3 + 19 + 5 + -15. Let a(h) = 2h*3 - 10h*2 - 13h - 4. Calculate a(n). -10 Let c(p) = -13p2 - 2p*3 + 47233p - 36 - 47238p - 40. Calculate c(-7). 8 Suppose 0 = 4f + 5s + 210, 0s - 244 = 5f - 3s. Let u = 52 + f. Let h(m) = m*3 - 4m*2 + 1. Determine h(u). -7 Let a(k) be the first derivative of 9k4/4 + k3/3 + k*2/2 + k + 1. Suppose 0 = 50c - 36c - 462. Suppose cu - 40u = 7. Determine a(u). -8 Suppose 0 = 2o + 6, f + 5o + 31 = -f. Let z(y) be the first derivative of y4/4 + 3y*3 + 4y*2 + 7y + 12354. Calculate z(f). 7 Let v(o) = -o*2 - 3o - 4. Let n(m) = 3m2 + 9m + 11. Let q be -2(-35)/14(-16)/10. Let d(a) = qv(a) - 3n(a). What is d(-3)? -1 Let i(h) = -h*3 + 48h + 7. Suppose 82x + 57x = -199x + 2366. Calculate i(x). 0 Let b(u) = -u3 + 8u*2 + 8u + 11. Let r be b(9). Let c(k) = 16k - 2k*3 - 34k + 17k - r + k3 + 1. Determine c(-2). 9 Let d(o) be the second derivative of o4/12 + 5o*3/6 + 2o*2 + 2863o. Determine d(-8). 28 Let m(d) = 3990d + 323. Let a(p) = 74p + 6. Let k(o) = 323a(o) - 6m(o). Give k(1). -38 Let t(o) = o + 9 + o*2 - o + 4o + o. Suppose 0 = 4s - 10s + 312. Let n = 46 - s. What is t(n)? 15 Suppose 10w + 31 = -5w + 136. Let z(p) = -p*3 + 5p*2 + 13p + 2. What is z(w)? -5 Let q(m) = -m - 5. Let n be (-36)/34/6. Let h be q(n). Let j(c) = 3c*2 - 2c*2 + 2c + 3 - hc - 2. Calculate j(1). 1 Let d(i) be the second derivative of -i5/60 - i4/24 + 7i*3/6 - 56i*2 - 78i - 2. Let j(n) be the first derivative of d(n). What is j(-5)? -13 Let j(f) = f*2 - 7f - 8. Let l be -2 + ((-25)/6 - (-20)/120). Let h be ((-64)/20)/(l/15 + 0). Calculate j(h). 0 Let g be 5/(-25) + (-1)/((-15)/(-6867)). Let a = -457 - g. Let p(f) = 8f3 - f2. Calculate p(a). 7 Let l(y) be the first derivative of -y3/3 - 9y*2/2 - 2y + 6. Let h(g) = -4g - 12. Let i be h(9). Let x = i + 41. Determine l(x). 12 Let v(a) = -a3 - 14a*2 + 17a - 4. Let c be -12(3/2 + ((-29)/4 - -7)). Give v(c). -34 Let h(m) = 11m + 247. Let t be h(-22). Suppose -2g = -14g - tg. Let v(u) = -u2 + 23. Give v(g). 23 Let o(t) be the first derivative of 13t4/4 + t2/2 + 420. Let u be (-2 + 0)(-2 - (-3)/2). Calculate o(u). 14 Suppose g - 4 = k, -k = -g + 4k + 12. Suppose -m + gj + j + 11 = 0, 5m + 4j = -2. Let p(x) = 4x*2 + 2x. Give p(m). 20 Suppose 3v - v = 4w + 92, -137 = -2v - 5w. Let s(d) = -10 - 7d2 - 113d + d*3 + 57d + vd. Determine s(7). -10 Let y(p) = -p2 + 5p + 16. Suppose 2148 = -18v + 2058. Determine y(v). -34 Let d(j) = -j2 + 11j - 15. Let u be (1 - 3 - 7)-5 + 0. Suppose -5h - 3r + u = -2h, 0 = -3r + 15. Give d(h). -5 Let p(b) = -4428b*2 + 8 + 4429b2 + 37 - b3 - b. Calculate p(0). 45 Suppose 2c = 2b - 66 - 8, -b - 5c = -13. Suppose 20o + b = 9o. Let v(p) = p2 + 3p + 3. Determine v(o). 3 Let a(r) = 29r - 4. Suppose -253k + 248k = 5. Determine a(k). -33 Let f(x) = 2x*2 - 5x + 3. Let y(v) = -v - 109. Let c be y(-25). Let m be 312/c - 14/49. Calculate f(m). 55 Let s be 32/(-40)((-90)/(-48) - 1)-20. Let j(c) = 6c - 68. Calculate j(s). 16 Let k(x) = x3 + 11x*2 + 10x + 3. Let q = -448 - -454. Suppose q = n + 4p, -29 = n + p - 23. Determine k(n). 3 Suppose 2l = -2n + 18, 2n + n = 3l - 15. Let f(k) = -53k - 2. What is f(n)? -108 Let n(g) = -30g2 + 3 - 33g*2 + 69g*2 - 3. Suppose -1 = -b - 5. Let u be 14b/(-16). What is n(u)? 6 Let x = -41 - -55. Suppose -m - 18 = -g, g - 5m = -0 + x. Suppose -2 = -7c + g. Let b(s) = -s3 + s2 + 3s + 4. Determine b(c). -5 Let f(o) = o*2 - o - 13. Suppose -5 = -5u, 2t + 4 = 3t - 3u. Let g be (-2)/7 - -21/t. Calculate f(g). -13 Let l(p) be the second derivative of 25p3/6 - 84p*2 + 2p - 627. Determine l(7). 7 Let k be 4/(-8) + 142/(-16) + (-297)/(-792). Let u(q) = q*2 + 10q + 3. Determine u(k). -6 Let i(h) = -3h - 49. Let z be i(-20). Let y(w) be the second derivative of w5/20 - w4 + 13w*3/6 + 2w*2 + 295w. Determine y(z). 26 Let c(v) = -v - 8. Suppose -5x = -25, -80 = -q - 3q - 4x. Suppose 3k - 2h + 0h = 13, 0 = -k - 2h + q. Give c(k). -15 Let c(o) = -3o*2 - 23o + 4. Let l = -8844 - -8836. Give c(l). -4 Suppose 2a + 288 = 7a - 4m, 3m = 3a - 174. Let h = a + -54. Let j(n) = -8nh + n3 - n - 2n2 - 25n*3 + 9n2. Give j(-1). 24 Let h(n) = -n3 + 12*	{ "pile_set_name": "DM Mathematics" }
eplacement from {j: 2, v: 5, r: 2}? 5/126 Two letters picked without replacement from {m: 1, f: 6, o: 1, x: 4, c: 1, a: 2}. What is prob of sequence xa? 4/105 What is prob of sequence bbby when four letters picked without replacement from {y: 6, b: 6}? 2/33 Four letters picked without replacement from tgcgttcaeatggeqectaa. What is prob of sequence cttc? 1/969 Four letters picked without replacement from gdggidiiddgd. Give prob of sequence idii. 1/396 Calculate prob of sequence uq when two letters picked without replacement from {a: 4, u: 3, q: 6}. 3/26 Four letters picked without replacement from {g: 5, f: 1, w: 3, l: 4}. What is prob of sequence llfg? 1/286 Two letters picked without replacement from {j: 1, x: 1, q: 1}. Give prob of sequence qj. 1/6 What is prob of sequence umj when three letters picked without replacement from {u: 1, m: 1, e: 1, b: 1, j: 1}? 1/60 What is prob of sequence bhh when three letters picked without replacement from hbh? 1/3 Three letters picked without replacement from ovsjppi. Give prob of sequence jop. 1/105 Four letters picked without replacement from uddxdrudr. Give prob of sequence xrud. 1/189 Calculate prob of sequence wnww when four letters picked without replacement from wwwnnwwwww. 2/15 Four letters picked without replacement from {w: 2, f: 3}. Give prob of sequence fwfw. 1/10 Calculate prob of sequence nzp when three letters picked without replacement from {p: 2, n: 1, z: 4, m: 3, c: 2, h: 6}. 1/612 Calculate prob of sequence sskk when four letters picked without replacement from kkskkkkkssk. 7/165 Two letters picked without replacement from {e: 4, c: 10}. What is prob of sequence ee? 6/91 Two letters picked without replacement from ssjjjssjjsjsjjjjjj. What is prob of sequence jj? 22/51 Three letters picked without replacement from qyqxqkeytxxx. Give prob of sequence xyt. 1/165 Three letters picked without replacement from fggyaqpggggppaqpyagp. What is prob of sequence ypg? 7/684 Calculate prob of sequence el when two letters picked without replacement from {l: 1, e: 1, r: 1, f: 1, v: 1}. 1/20 What is prob of sequence ab when two letters picked without replacement from bdamw? 1/20 Two letters picked without replacement from {x: 1, z: 2, s: 3, u: 1, h: 6, v: 2}. Give prob of sequence xu. 1/210 Four letters picked without replacement from ajmmjnwa. Give prob of sequence nmwm. 1/840 Calculate prob of sequence giii when four letters picked without replacement from {i: 5, g: 9}. 45/2002 Calculate prob of sequence qz when two letters picked without replacement from {r: 2, a: 3, z: 6, x: 5, q: 1, u: 2}. 1/57 Four letters picked without replacement from {l: 5, d: 3, r: 2, y: 1, f: 3, x: 1}. Give prob of sequence fxff. 1/5460 Calculate prob of sequence lfl when three letters picked without replacement from {p: 7, l: 2, f: 1}. 1/360 What is prob of sequence gkg when three letters picked without replacement from {k: 8, g: 3}? 8/165 Four letters picked without replacement from kbpkbpjkkjpk. What is prob of sequence bkpp? 1/198 Three letters picked without replacement from {k: 9}. Give prob of sequence kkk. 1 Calculate prob of sequence vf when two letters picked without replacement from mfmvmvmvmv. 2/45 Four letters picked without replacement from qquququuuqqqu. What is prob of sequence uqqq? 21/286 Three letters picked without replacement from ynmnnyyynynnnnmmytym. What is prob of sequence yyy? 7/228 Four letters picked without replacement from {g: 6, o: 7}. What is prob of sequence gggo? 7/143 Calculate prob of sequence qh when two letters picked without replacement from {j: 3, h: 1, l: 4, q: 2, n: 2}. 1/66 Calculate prob of sequence mrx when three letters picked without replacement from {e: 3, w: 1, x: 2, m: 1, r: 5}. 1/132 What is prob of sequence ffm when three letters picked without replacement from {f: 3, m: 1}? 1/4 What is prob of sequence qw when two letters picked without replacement from {q: 2, p: 2, w: 6, s: 6, l: 3}? 2/57 Calculate prob of sequence wojk when four letters picked without replacement from wkkkoojk. 1/210 What is prob of sequence sv when two letters picked without replacement from {l: 2, d: 1, s: 11, v: 1}? 11/210 Four letters picked without replacement from ppbppbbbbppppbbp. Give prob of sequence pbpp. 21/260 Two letters picked without replacement from {b: 4, g: 6, n: 3, d: 1}. What is prob of sequence nb? 6/91 Calculate prob of sequence jeee when four letters picked without replacement from ejjejjjejejjje. 45/2002 Two letters picked without replacement from {c: 2, d: 1, f: 1, r: 2, y: 1, e: 1}. What is prob of sequence fy? 1/56 Calculate prob of sequence qk when two letters picked without replacement from {k: 2, p: 3, f: 3, q: 1, d: 1}. 1/45 Calculate prob of sequence fu when two letters picked without replacement from {f: 4, u: 3}. 2/7 Calculate prob of sequence mk when two letters picked without replacement from {m: 1, h: 1, k: 7, e: 6, l: 2, v: 2}. 7/342 What is prob of sequence hsh when three letters picked without replacement from {s: 3, h: 2}? 1/10 Calculate prob of sequence vdv when three letters picked without replacement from {n: 2, v: 5, d: 4}. 8/99 Three letters picked without replacement from lllglgglll. Give prob of sequence ggg. 1/120 What is prob of sequence eeen when four letters picked without replacement from nnneneennnnnnn? 1/364 Calculate prob of sequence aa when two letters picked without replacement from {a: 2, x: 1}. 1/3 Calculate prob of sequence bc when two letters picked without replacement from rbrcorrbe. 1/36 Two letters picked without replacement from llhlhaaccnaalxalx. Give prob of sequence nh. 1/136 Calculate prob of sequence aars when four letters picked without replacement from {s: 3, a: 3, r: 2}. 3/140 Three letters picked without replacement from {a: 1, u: 7}. Give prob of sequence uau. 1/8 Two letters picked without replacement from {z: 1, x: 1, f: 1}. Give prob of sequence xf. 1/6 Calculate prob of sequence wo when two letters picked without replacement from {o: 3, w: 7, m: 1, q: 3}. 3/26 Calculate prob of sequence vv when two letters picked without replacement from plllopovv. 1/36 Two letters picked without replacement from {p: 12, e: 1}. What is prob of sequence pe? 1/13 Calculate prob of sequence vfv when three letters picked without replacement from ifvfitvgtggfftthgttt. 1/855 Three letters picked without replacement from {e: 1, b: 1, y: 1, m: 2, p: 2}. What is prob of sequence pep? 1/105 Calculate prob of sequence zzgg when four letters picked without replacement from {g: 4, z: 3, b: 1}. 3/70 Four letters picked without replacement from jikjjjic. What is prob of sequence kjcj? 1/140 Two letters picked without replacement from {o: 7, u: 2}. Give prob of sequence oo. 7/12 Four letters picked without replacement from {i: 10, v: 3, r: 2, m: 4}. What is prob of sequence rvii? 15/2584 Four letters picked without replacement from jjjjjj. Give prob of sequence jjjj. 1 Calculate prob of sequence cc when two letters picked without replacement from cccm. 1/2 Four letters picked without replacement from dywwmwywym. What is prob of sequence ydmw? 1/210 Two letters picked without replacement from nnnnnnqnnnnnnnnx. Give prob of sequence nx. 7/120 Calculate prob of sequence cc when two letters picked without replacement from {c: 13, o: 6}. 26/57 What is prob of sequence ai when two letters picked without replacement from {i: 2, a: 5, r: 7}? 5/91 Two letters picked without replacement from mzzzzzmmzzmzzz. Give prob of sequence mm. 6/91 What is prob of sequence ll when two letters picked without replacement from {c: 6, x: 3, f: 1, l: 5}? 2/21 Calculate prob of sequence dsns when four letters picked without replacement from ndsndvnrrdsnsnns. 9/1820 Four letters picked without replacement from mhsrzmhtmmhrhmrm. What is prob of sequence tmsh? 1/1820 Four letters picked without replacement from fuvvffvuuufvvfvfv. Give prob of sequence uuvu. 1/340 Two letters picked without replacement from virgakk. Give prob of sequence rv. 1/42 What is prob of sequence on when two letters picked without replacement from ovjnjnvnnnoovnhjjajo? 6/95 Two letters picked without replacement from {c: 1, k: 4, d: 4, p: 2}. Give prob of sequence kk. 6/55 Four letters picked without replacem	{ "pile_set_name": "DM Mathematics" }
6)) 2/7 Evaluate (69/2)/(369/(-246)). -23 Evaluate ((-47)/94)/((-7)/((-84)/(-9))). 2/3 56/14(14/49)/(180/21) 2/15 Calculate 335/33526/4(-2)/1. -13 Evaluate (6/9)/(((-15)/575)/((-243)/270)). 23 What is ((32/22)/(-8))/14/2? -4/11 What is (-88)/(-33)1(54/(-3))/6? -8 ((-152)/(-8))/((((-3)/(-6))/1)/1) 38 (-3)/(-460/(-1040)) -13 (27/15)/331/(163959/430) 2/41 Evaluate 15/(1080/(-36))26. -13 What is the value of (8/6)/((-1968)/108015)? -2/41 Evaluate (25/(-55))/((4/6)/((-562)/843)). 5/11 Evaluate 6/63-310/(-80). 1/28 Evaluate (52/(-12))/(25/((-2250)/30)). 13 What is (-32)/(-144)36/(-16)(-12)/(-2)? -3 16/(-60)(-192)/32 8/5 What is the value of ((-555)/(-24975))/(2/(-20))? -2/9 (-149)/1147321/(-9) 1/33 What is (3(-4)/6)/(3508/(-38588))? 22 Calculate (3/12)/((-450)/(-3240)). 9/5 Calculate -9(-10)/(-4500)18(-10)/6. 3/5 (16/28)/((-8)/(-840)110) 6/11 Calculate (412/320)/(((-315)/24)/7). -2/25 What is the value of (4/38)/2122/61? 2/19 Evaluate (-18)/18(51/102)/(9/(-2)). 1/9 What is (-390)/(-468)((-6)/(-40))/(-1)? -1/8 What is 54/81(2/(-15))/(20/25)? -1/9 ((9504/40)/27)/((-2)/5) -22 What is the value of (-24)/32(-16)/(-18)168/32? -7/2 Evaluate 4/(16/(-18))(-6)/(-27)-3. 3 What is 10/107/(-1)? -7 What is the value of -21(-34)/14281-27? -7 What is (44/(-66))/(((-132)/(-90))/(-11))? 5 What is the value of (3/(-198)2)/((-71)/(-639))? -3/11 Calculate ((-1)/(-5))/((-14)/(-5040)18). 4 What is ((-32)/12)/(-2)30/(-50)-10? 8 Evaluate 96/22(-715)/(-130). 24 Calculate (6/2)/(183/(-793)). -13 8/58-26(-11)/572 2/29 Evaluate ((-189)/(-27))/((64/(-4))/80). -35 What is the value of (-19712)/(-924)34/(24/(-3))? -32 Calculate 95/57(-576)/120. -8 What is 12/12(-135)/(-9)? 15 What is the value of ((108/280)/9)/((-96)/(-112))? 1/20 What is the value of 13/(1456/(-4))8? -2/7 Calculate (-120)/4824/10. -6 Evaluate 6/(-75)(-75)/903. 1/5 Calculate 5(-11)/(-3575)5. 1/13 What is the value of (-1)/(((-3)/(-15))/((-550)/110))? 25 What is the value of ((-12)/(-10))/((-6)/16(-42)/105)? 8 ((-500)/(-2625))/(2/(-14)) -4/3 What is the value of (13/(117/18))/(-18)? -1/9 What is the value of (-1)/((650/(-625))/(-26))? -25 What is the value of ((-5)/9)/(25/6)? -2/15 (-3342)/557(1-2)/(-54) -2/9 Evaluate ((-4)/(48/(-18)))/(60/4812). 1/10 Calculate ((3/(-18))/(174/(-27)))/(381/1016). 2/29 Calculate (-10)/22(-3)/5(-1170)/1755. -2/11 What is (1065/710)/(3/32)? 16 4544/426(-21)/(-14) 16 (-3)/(((-8)/(-20))/((-144)/40)) 27 What is 267/(-267)2/(-3)21? 14 (-14)/(-1)195/(-91)35/(-30) 35 Evaluate 230/6945/(-50). -3 ((-132)/(-8))/((-18)/(-3)) 11/4 What is the value of (36/(-81))/(10/9)? -2/5 What is the value of 66/(-396)2/136? -2/13 Calculate (9/(-3))/((-84)/(-21)1/(-4)). 3 Calculate 10/5(-57)/38. -3 (-56)/7(-1)/2 4 (6/12)/(((-19)/(-95))/(9/45)) 1/2 What is the value of (-1)/(-185)995/(-398)? -1/34 What is the value of 2/((-95)/342((-16)/5)/(-4))? -9 What is the value of (1/(-8))/((-63)/(-84))? -1/6 Calculate 1/((-43)/172(-42)/4). 2 What is the value of 3/21900/150? 19 Evaluate (5/(-2))/(65/(-1664)8). 8 Calculate (5/(-75))/(26/(-3120)). 8 (-324)/36(-4)/4 9 What is 8(-21)/2105/74? -2/37 Evaluate -4(-8)/(-48)15/(-3). 10/3 What is 2/(2/(2/11))(-4004)/(-728)? 1 What is the value of ((-143)/(-39))/11(-7)/((-455)/(-45))? -3/13 What is (2/((-54)/(-21)))/(134/402)? 7/3 ((56/6)/14)/(24(-4)/9) -1/16 Evaluate (22/(-1)68/34)/(-4). 11 Evaluate ((-10)/(-8))/(120/(-1728)). -18 What is (-498)/332(-16)/(-6)? -4 Evaluate 1776/(-740)50/(-8). 15 What is the value of (-33570)/373((-2)/(-3))/(-2)? 30 Evaluate (-6669)/10267/(91/(-46)). 23 Calculate (((-7)/(-105))/((-1)/6))/(38/(-855)). 9 Evaluate (-3)/91-345/(-36). -5/4 Calculate (35/56)/(9/201698). 10/7 (11/33050)/(-11/(-3)) 5 ((52/(-12))/13)/((-5)/225) 15 Calculate (0/23)/82(-2)/20. 0 Evaluate (((-660)/(-6))/(-10))/3(-12)/4. 11 (84/(-70))/(((-7)/210)/(2/(-6))) -12 Calculate 5/(75/(-4))485/388-6. 2 (-24)/14(23506/(-138))/73 4 What is (10338/(-29291))/(2/(-136))? 24 What is the value of (((-80)/68)/(-10))/((-18)/(-90))? 10/17 What is (-71)/184640/10? -2/13 What is (11/5)/((-494)/2470)? -11 Calculate 4/(-14)(-609)/116-14. -21 Evaluate (-3)/6-711/231. 1/6 What is the value of (96/144)/(((-62)/4)/(3/(-2)))? 2/31 What is 42/(18/84-14)? -14 Calculate (-5)/(((-5)/8-28)/(-2)). 4/7 Calculate ((-1040)/13)/40(-10)/(-4). -5 What is the value of (92/506)/((-1)/1)? -2/11 What is (-185/520)/((-48)/128)? 6/13 Evaluate ((-2)/56)/((-191)/4011). 3/4 ((5/(-39))/5)/(13/(-6)) 2/39 (5/(-15)6)/(((-63)/(-99))/7) -22 What is the value of ((-264)/(-154))/(16/(-8))? -6/7 Evaluate (182/35)/262/((-4)/(-6)). 3/5 Evaluate (-343)/(-147)((-72)/(-42))/3. 4/3 What is (-18)/21(-4046)/2601? 4/3 (28/(-98)(-98)/658)/1 2/47 Evaluate 32/(-5)(-1355)/(-1626). -16/3 36/(-20)150/2733/(-715) 6/13 Evaluate -1-912/(-1296). -1/12 What is the value of (-34/42)/(860/(-12040))? 4 (47/((-2303)/(-42)))/((-132)/(-28)) 2/11 What is (-170)/(-102)(-3)/(-12)-2? -5/6 What is (-345)/(-920)48/(-6)? -3 What is (-10)/(-108(-8)/16)60/(-25)? 4/9 Evaluate 22120/284418/5. 28 What is the value of ((-9)/(-3))/(-1)(-276)/(-7038)? -2/17 Calculate (198/108)/11(-39)/26. -1/4 Calculate (-30)/(-975)-135. -2 Evaluate (-16)/(-24)-4-21(-4)/112. -2 Calculate 1011/(-6930)3. -1/21 What is (108/72)/(3/(-40))? -20 Evaluate (-224)/(-14)1(-5)/(-140). 4/7 Calculate ((62)/((-4)/(-2)))/(417/556). 8 What is the value of 333/(-185)80/32? -9/2 Calculate (-11)/(-3)((-6)/(-4))/((-11)/22). -11 Evaluate ((-48)/60)/(98/35). -2/7 Calculate 2604/(-2511)(-12)/(-8). -14/9 Calculate 2/((-29)/(4466/28)). -11 Evaluate (45/20)/(6/(-8))(-52)/(-6). -26 What is ((-8275)/(-74475))/((1/5)/((-2)/(-5)))? 2/9 What is the value of (228/152)/((-324)/48)? -2/9 What is ((-250)/10)/((-40)/8)? 5 (-6)/9(9/(-8))/((-6)/104) -13 84/(-6)38/1332/2 -4 Evaluate 5/(-2)258/215. -3 Evaluate ((-18)/10)/(112/(-1260)(-27)/6). -9/2 What is the value of (-72)/(18/1)(-1)/34? 2/17 What is -16/(-2)89/(15219/1083)? 19 Calculate (-7522/(-198)(-12)/10)/(-8). 5/4 Calculate ((-21)/(-315)12)/((-1340)/50). -2/67 What is the value of (811/1622)/(((-2)/12)/1)? -3 Evaluate 2/36(-71)/((-355)/40). 4/9 What is the value of ((156/12)/(-39))/(-1(-2)/(-42))? 7 What is (-3)/6(-140)/245? 2/7 Calculate 21(-17)/(-119)(-2)/(-18). 1/3 ((-920)/28520)/(((-27)/(-6))/(-3)) 2/93 Evaluate 33/(-18)41/(-451). 1/6 Calculate 27/(-4)-15(-34)/765. -9/2 (-29)/29070/8350/245 -5/4 What is the value of ((-44)/(-264))/(10/(-18))? -3/10 (3/(-4))/((1950/(-1400))/13) 7 What is 2/(-1)(-2135)/(-122)(-2)/(-5)? -14 Calculate -11/((-3)/15). 5 (1/(-3))/(((-1)/3)/(318/(-106))) -3 (-32)/(-2)21/7812-31 -4/3 What is 144/(-20)(-6)/(396/(-110))? -12 What is the value of (2/(-2)1596/(-320))/(-3)? -3/2 What is the value of -3(-40)/(-9)57/76? -10 ((-76)/(-209)-11)/18 -2/9 What is the value of (2/1)/((3/6)/((-3)/6))? -2 What is 504/5046/10? 3/5 What is the value of -184/16(4/(-3))/1? 6 Calculate 2282/48-2. -19 Evaluate (23/((-414)/9))/((-2)/32). 8 Calculate (10/(-11))/(144/132). -5/6 What is the value of ((5/((-10)/(-22)))/1)/(-1)? -11 What is the value of -39/(-6)144/1620? 2/5 Evaluate (-870)/(-609)(-28)/(-44). 10/11 ((-3)/(-6))/((-19)/266) -7 Calculate (3/(-1))/(6120/240). -2/17 Evaluate (-4208)/526075/(-4). 15 Evaluate ((-4)/13)/(526/(-30771)). 18 What is the value of (1/((-8)/2))/(147/84)? -1/7 Evaluate 26/20((-24205)/188)/103. -3/4 (-3)/(4/(88/(-99))) 2/3 What is the value of (20/4680-6)/((-2)/12)? 2/13 Calculate -1878/2574(-198)/4. 27 What is ((-60)/42)/((-190)/2394)? 18 Calculate 4(-3)/18(-108)/(-24). -3 (10/(-18))/(28/42)4/(-5) 2/3 ((-4)/6)/((-1)/((-12)/8)) -1 Calculate -46(7(-12)/(-168))/(5/5). -23 Calculate 1029/98(-5)/(35/(-8)). 12 (((-132)/(-42))/11)/(1/(-14)) -4 Evaluate (37/111)/(51/555). 37 What is the value of 13/((-390)/(-225))4? 30 What is the value of 1/(-12)1284/321? -1/3 What is the value of ((-1)/21)/((-56)/90723)? 27 1/(((-7)/(-11))/7)(-1)/(-1) 11 What is the value of 696/11484(-3)/30-6? 2/55 Calculate 24(-58)/(-4176)(-10)/2. -5/3 What is the value of (-14)/245-3(-30)/(-3)*-7? -12 What is the value of ((3/1)/(5/15))/(26/(-26))? -9 Evaluate ((-6	{ "pile_set_name": "DM Mathematics" }
p + 0p + 33p - 17p. 64p Collect the terms in f*3 + 10f + 0f3 - 10f. f*3 Collect the terms in 14n + 10n + 9n. 33n Collect the terms in 6f*2 + 36f*2 - 4f - 11f2 + 3f. 31f2 - f Collect the terms in 4o*2 - 8o*2 - 2o*2 + 7o*2 - 6o*2. -5o*2 Collect the terms in -80l + 28l + 21l + 30l. -l Collect the terms in 39 + 39 - 104 - i2 + 26. -i2 Collect the terms in -148g*2 + g + 896g*2 - g. 748g*2 Collect the terms in 26154u*3 - 13075u*3 - 13081u*3. -2u*3 Collect the terms in -27f*2 + 3f*2 + 25f2. f2 Collect the terms in 2q - q + 2q. 3q Collect the terms in 3 + 839v*2 - 836v*2 - 3. 3v*2 Collect the terms in -206a*3 + 181a*3 - 5a*2 + 5a*2. -25a*3 Collect the terms in 1886d*2 - 6d*3 - 1886d*2. -6d*3 Collect the terms in -2 + 1887h + 2 - 1888h. -h Collect the terms in -15c*2 + 2 - 2 - 87c*2. -102c*2 Collect the terms in 62g - 119g + 57g + 6g2. 6g*2 Collect the terms in -10 + 6 - 113t + 4 + 109t. -4t Collect the terms in 6s + 692 - 692. 6s Collect the terms in 4v + 4v + 0v - 2v - 3v. 3v Collect the terms in n*2 + 87n*3 + 109n3 - n2. 196n3 Collect the terms in n - 39n*2 - 192n*3 + 39n*2. -192n*3 + n Collect the terms in -82a - 78a + 239a - 78a. a Collect the terms in -16k*2 - 29k*2 + 43k*2. -2k*2 Collect the terms in -4z - 6z + 3z*3 + 11z + 3z3. 6z*3 + z Collect the terms in 2067 - 2067 + 50t*3. 50t*3 Collect the terms in 6y + 11y - 14y. 3y Collect the terms in -5s + 13s + 4s. 12s Collect the terms in -6p*2 + 202p - 202p. -6p*2 Collect the terms in 650o - 62o + 0o. 588o Collect the terms in -521m + 172m + 176m + 178m. 5m Collect the terms in -52382k + 3k2 - k3 + 52382k - 3k2. -k3 Collect the terms in -16f + 22f + 27f. 33f Collect the terms in 5860985 + 2a - 5860985. 2a Collect the terms in -46457w - 6w*2 + 46457w. -6w2 Collect the terms in -13i*2 - 26i*2 + 41i*2. 2i*2 Collect the terms in -9 - 25i*3 + 9. -25i*3 Collect the terms in -23a - 11a - 8a - 36a. -78a Collect the terms in 3n2 + 47 - 97 + 50 - 2n2. n2 Collect the terms in -13q + q - 8q. -20q Collect the terms in -19y*2 + 19y*2 - 13y*2. -13y*2 Collect the terms in -6r*3 - 3r*3 + 6r3 + r3 + 4r3. 2r*3 Collect the terms in 1 + 11p*3 - 1 - 9p*3. 2p*3 Collect the terms in 3g*2 - 3g*2 + 2g*2 + 9g*3 - 4g*3. 5g*3 + 2g*2 Collect the terms in 13800 + 6i - 13800. 6i Collect the terms in 44r + 8583 - 8583. 44r Collect the terms in 8 + 175a*3 + 171a*3 - 348a*3. -2a*3 + 8 Collect the terms in 20r + 60r + 24r. 104r Collect the terms in -6a*2 + 3a*2 + 2a2 - 27078 + 27078. -a2 Collect the terms in -46w + 0 + 0. -46w Collect the terms in -105 + 5f3 - 4f3 + 100. f3 - 5 Collect the terms in 36x2 + 25x*2 - 120x*2 + 40x*2. -19x*2 Collect the terms in 0b*2 + 0b*2 + 11b*3 + 0b*2. 11b*3 Collect the terms in 2m*2 + 486693m*3 - 486691m*3 - 2m*2. 2m3 Collect the terms in y3 + 3y2 + 4y*2 - 7y2. y3 Collect the terms in 102y3 + 101y*3 - 304y*3 + 100y3. -y3 Collect the terms in f + 0f + 2f - 4f. -f Collect the terms in 20g - 7g - 4g - 8g. g Collect the terms in 31a + 27a + 25a - 86a. -3a Collect the terms in 391d + 524d - 353d. 562d Collect the terms in -20q - 19q - 20q + 66q - 16q. -9q Collect the terms in -z3 + 675 - 675. -z3 Collect the terms in -69369p + 69369p + 17p2. 17p*2 Collect the terms in -3 - 5v*2 - 3v*2 + 4 - 2. -8v*2 - 1 Collect the terms in -47267f + 47267f - 2f*2. -2f*2 Collect the terms in 51t + 65t - 119t. -3t Collect the terms in -5a + 9a3 + 6a*3 + 5a. 15a3 Collect the terms in -165k*3 - 162k*3 + 331k*3. 4k*3 Collect the terms in -740w*2 - 928w*2 - 7041w*2. -8709w*2 Collect the terms in 2874 - 10q - 2874. -10q Collect the terms in -5 - 9v - 8 + 13. -9v Collect the terms in 6m + 92 - 92 + 7m. 13m Collect the terms in 13m3 + 829m*2 + 2m*3 - 830m*2. 15m3 - m2 Collect the terms in 7h + 15h*2 - 5h + 3 - 3. 15h2 + 2h Collect the terms in -4x - 3x*2 + 5x - 3x - 8x*2. -11x*2 - 2x Collect the terms in -4z2 + z3 + 4z*2 + 185z - 156z. z3 + 29z Collect the terms in -3i2 - 14i*2 - 36i*2. -53i*2 Collect the terms in -55g + 19g - 10g. -46g Collect the terms in s3 + 430s - 229s - 201s. s*3 Collect the terms in -452h + 144h - 339h. -647h Collect the terms in -113h - 122h + 229h. -6h Collect the terms in -24 + 38 - 5j - 14. -5j Collect the terms in 6g - 6g + 3g. 3g Collect the terms in 80259x*3 - 40133x*3 - 40132x*3. -6x*3 Collect the terms in 14p*2 - 32p*2 + 23p*2. 5p*2 Collect the terms in 2143g2 - g3 - 2143g2. -g3 Collect the terms in 8823l - l*2 + 0l*2 - 4414l - 4409l. -l2 Collect the terms in 16s*2 - 11s*3 - 5s*2 + 3s*3 - 3s*2. -8s*3 + 8s*2 Collect the terms in -56c + 28c + 29c. c Collect the terms in -u + 7u - 7u + 7u - u. 5u Collect the terms in -9t3 + 3t3 - t3. -7t3 Collect the terms in 5m*2 + 13m*2 - 2m*2. 16m*2 Collect the terms in 12l*2 + 3l*2 - 8l*2 + 0l*2. 7l*2 Collect the terms in -1173o*3 + 584o*3 + 587o*3. -2o*3 Collect the terms in -16b + 16b - 8b - 17b. -25b Collect the terms in -111 + 14m3 + 57 + 54. 14m*3 Collect the terms in 11j*2 + 6j*2 - 14j*2. 3j2 Collect the terms in -c2 - 54 + 54 + 0c2. -c2 Collect the terms in 24g - 57g - 39g. -72g Collect the terms in -32d*2 - 42d*2 + 71d*2. -3d*2 Collect the terms in -4g*2 - 128g*3 + 4g*2. -128g*3 Collect the terms in 14c + 18c - 9c. 23c Collect the terms in -85 - v3 - 90 + 175. -v3 Collect the terms in 20h*3 + 4h + 11h - 15h. 20h3 Collect the terms in -13m*2 - 22m*2 + 23m*2. -12m*2 Collect the terms in 14 + 0u3 - 12 + u3. u*3 + 2 Collect the terms in -9q - 2 + 2 + 3q. -6q Collect the terms in -5o3 - 4o*3 + 2o*3 - 8o*3. -15o*3 Collect the terms in -749 + 749 - 14z. -14z Collect the terms in -9780 + 9780 + x2. x2 Collect the terms in -5t*2 + 8t2 + t2 - 7t2. -3t*2 Collect the terms in 0o*2 + 2o*2 + 7o*2. 9o*2 Collect the terms in 2 - 412g + 405g - 2. -7g Collect the terms in 10q - 145q*3 - 10q. -145q3 Collect the terms in 2z*3 - 9z*3 + 5z*3. -2z*3 Collect the terms in 6c*2 + 6c*2 + 0c*2 + 8c*2. 20c*2 Collect the terms in 46r + 32r - 46r + 74r. 106r Collect the terms in -16 + 0o - 2o + 0o + 19. -2o + 3 Collect the terms in -17f2 + f2 - 6f*3 + 16f*2. -6f*3 Collect the terms in 2z + 10z - 12z + 7z3. 7z*3 Collect the terms in -2f + 21f + 13f + 10f - 10f. 32f Collect the terms in 0m + 3m - 5m - 15m2. -15m*2 - 2m Collect the terms in -3g2 + 3g*2 + 2g*3. 2g*3 Collect the terms in 3f + 35 + 0f - 4f. -f + 35 Collect the terms in -20a2 - 21a*2 + 47a*2 - 29a*2. -23a*2 Collect the terms in 10t*2 - 11t*2 - 2t*2 - 13t*2. -16t*2 Collect the terms in -17965q*2 + 35925q*2 - 17966q*2. -6q*2 Collect the terms in 32b + 26b + 24b - 77b. 5b Collect the terms in -22y - 59y + 97y. 16y Collect the terms in 5h2 - 3h*2 - 3h*2 + 2h2. h2 Collect the terms in -6 + 21 - 9t2 - 15. -9t*2 Collect the terms in -142d + 64d + 4 - 4. -78d Collect the terms in 11499 + 3y3 - 11499. 3y*3 Collect the terms in -29j*3 + 308j*2 - 308j*2. -29j*3 Collect the terms in 102t*3 - 23t*3 - 28t*3 - 28t*3 - 25t*3. -2t*3 Collect the terms in a - 3a + a + 6a. 5a Collect the terms in -173a2 + 189 - 92 - 97. -173a*2 Collect the terms in -10 - 363r + 10. -363r Collect the terms in 12i*3 + 19i*3 - 23i*3 - 1 + 1. 8i*3 Collect the terms in 46h*2 - 24h*2 - 19h*2. 3h*2 Collect the terms in 0r*3 + 23r*3 + 14r*3. 37r*3 Collect the terms in -14 + 2 + 29u - 25u. 4u - 12 Collect the terms in -l*3 + 8l*3 - 6l3. l3 Collect the terms in -10v3 + 65v*3 - 33v*3. 22v*3 Collect the terms in 57j - 50*j	{ "pile_set_name": "DM Mathematics" }
(20/8)/(2/(-4))? -5 4/(-5)(-70)/112 1/2 Evaluate (4/16-7)/(10/(-40)). 7 Evaluate (-412/(-168))/(15/(-7)). -2/15 What is (-10)/4456/(-380)? 3 Evaluate ((-10)/6)/(34/(-102)). 5 Evaluate 2(-7)/(-14)-1. -1 Calculate (56/(-42))/(4/(-6)). 2 What is (-46/16)/(15/(-6))? 3/5 What is the value of 6(-1)/(-6)-13? -3 ((-19)/190)/(6/10) -1/6 (-2)/(-15)3/(-2) -1/5 Evaluate 54/72(-2)/(-6)-1. -1/4 Calculate 70/(-40)4/(-14)-2. -1 What is the value of 49/24(-16)/132? -2/11 What is the value of ((50/(-15))/5)/4? -1/6 What is ((-2)/(-12))/((-9)/(-24)4)? 1/9 What is (((-9)/5)/(-3))/(8/(-40))? -3 Evaluate ((-14)/(-4))/((-14)/(-28)). 7 What is ((-2)/(-3))/(260/(-78))? -1/5 What is the value of (-18)/27(-9)/(-21)? -2/7 (4/18)/((-12)/36) -2/3 Evaluate (70/175)/(1/(-10)2). -2 Calculate (50/125)/(2/(-2)). -2/5 What is the value of 4/42(-5)/(15/9)? -2/7 (-54/55)/((-4)/44) 4 Evaluate (-1)/3(-27)/36. 1/4 What is (-24)/(-32)(-6)/45-6? 3/5 What is 1-2(-45)/(-18)? -5 Evaluate (50/60)/(((-5)/2)/(-5)). 5/3 What is (1/3)/((-3)/9)? -1 (9/15)/(84/40) 2/7 What is the value of ((-4)/(-12))/((-6)/(-18)-5)? -1/5 Evaluate (-60)/(-80)(-5)/(30/32). -4 What is -5(-2)/(-5)(-4)/2? 4 ((-52)/13)/(-2(-3)/(-6)) 4 Calculate ((-88)/16)/(-11)0. 0 Evaluate -6(3/(-45))/1-5. -2 What is the value of ((24/21)/2)/2? 2/7 Calculate ((-4)/(-10))/((-3)/(-15)-7). -2/7 Evaluate -203/3636/(-10). 6 (-15)/208/(-3) 2 (-1)/(-31/15) 5 What is 10/(-4)(-2)/(-20)-12? 3 Evaluate ((-48)/(-32))/(63/(-12)). -2/7 Calculate 4(21/(-70)-5)/(-51). -2/17 Evaluate (-4)/(-56)70. 0 Calculate (-25)/(-55)6/(-10). -3/11 What is 1(-18)/(-45)(-10)/2? -2 What is (6/2)/((-40)/40)? -3 ((-3)/18)/(8/32) -2/3 What is the value of (1/5)/(90/(-75))? -1/6 What is 10/612/(-30)? -2/3 What is the value of 16/933/4? 4 What is (-3)/(-10)13/((-156)/(-16))? 2/5 What is the value of (4/3)/((-172)/774)? -6 What is (((-8)/(-2))/8)/((-1)/(-6))? 3 (-852)/284(-2)/(-21) -3 What is ((-4)/(-10))/((-32)/(-40))-6? -3 Evaluate 2/(9/((-27)/(-24))). 1/4 Calculate (-5)/(-2)(-6)/3. -5 (1/((-10)/2))/(8/(-5)) 1/8 Calculate ((-2)/(-6))/((-21)/126). -2 Evaluate 30/(-27)16/10. -2/3 Evaluate (-36)/602/(-18)-3. -1/5 -10(12/(-15))/2 4 (81/486)/(1/(-2)) -1/3 Calculate (0/1)/((-36)/18). 0 What is the value of ((-18)/(-24))/(675/200)? 2/9 Calculate (-1)/(3/(-12)12/(-9)). -3 What is the value of 255/1326(-8)/(-10)? 2/13 What is the value of 2/(-3)(-3)/(-2)? -1 1(-5)/151 -1/3 Evaluate (-3)/((-6)/7)132/154. 3 ((-42)/(-9))/(42/63) 7 What is ((78/(-12))/(-13))/(2/32)? 8 What is the value of (-20)/(-6)54/(-36)? -5 What is the value of (12/(-8))/(-3)4/2? 1 Calculate (-1)/(4/(-6))4/(-2). -3 What is (2/(-3))/(2/(-3))? 1 ((-20)/(-36))/((-125)/(-50)) 2/9 What is the value of ((-22)/55)/(-22(-5)/(-50))? 2/11 Calculate 8/(-14)(-4)/16. 1/7 Calculate ((-6)/(4(-5)/10))/(-5). -3/5 What is the value of 1/(2/(-7)(-70)/80)? 4 Evaluate (1/((-2)/(-3)))/((-243)/(-27)). 1/6 ((-2)/9)/((-2)/(-12)2) -2/3 What is -9(-14)/(-63)-1? 2 What is the value of 14/(-4)(-51)/238? 3/4 What is ((-2)/(-14))/(((-3)/3)/1)? -1/7 Evaluate ((-1)/91)/(8/(-32)). 4/9 What is (-1)/(-9)(-336)/224? -1/6 Evaluate 8/190-53/6. -2/19 ((-10)/(-60))/((-15)/12) -2/15 Evaluate (((-5)/3)/(-5)-6)/(-4). 1/2 What is (-12)/(-45)(-45)/30? -2/5 What is the value of (2/(-32)-4)/2? 1/8 Calculate ((-10)/2)/(840/(-144)). 6/7 What is the value of (44/(-66)3/14)/(-1)? 1/7 Calculate -23/14336/48. -3 What is the value of ((-2)/(-8))/((-16)/64)? -1 What is the value of -3131/93? -1 Calculate (-2)/(-27)3(-3)/3. -2/9 What is the value of 78/1302/(-6)? -1/5 Evaluate (0/1)/((-2)/((-10)/5)). 0 Calculate 2/(-6)-1451/(-3094). -1/13 Calculate (-2)/(-2)-4(-17)/68. 1 Evaluate (-10)/243/5. -1/4 What is the value of (36/45-5)/((-2)/(-2))? -4 Calculate (1/(-14))/(14/(-168)). 6/7 What is the value of (45/45)/(3/27)? 9 Evaluate (-4)/(-42)-6(-2)/(-4). -2/7 What is (-1)/(-3)(-27)/(-3)? 3 270/(-405)42/(-4) 7 Evaluate (18/81)/((-1)/(-9)). 2 What is the value of (-3)/(-6)59/(-118)? -1/4 Evaluate ((114/(-6))/76)/((-1)/12). 3 What is the value of (-10)/(-4)(-6)/60? -1/4 (1/21)/(7/(-21)) -1/7 ((-5)/(-15))/((-10)/15)0 0 Calculate -3(-19)/573/(-5). -3/5 Calculate (-288)/(-256)5/(15/(-2)). -3/4 Calculate -2(504/16)/9. -7 Evaluate (-3)/278/28. -3 What is the value of ((-120)/78)/(-10)-1? -2/13 Evaluate (-322)/(-46)4/(-7). -4 12/32/8 1 Evaluate ((-18)/(26/13))/(-6). 3/2 Evaluate (-9)/4192/(-144). 3 Evaluate 42/(-21)9/(-2). 9 Evaluate ((-164)/(-41))/(-22/2). -2 (-1)/5-512/(-16) -3/4 What is the value of 1((-1)/6)/(17/(-714))? 7 Evaluate (-3)/143(-44)/99. 2/7 8/(-6)48/(-256) 1/4 What is (3/((-120)/16))/(2/(-5))? 1 (-15)/(-3)5/((-450)/(-4)) 2/9 Calculate (4/(-36))/((-6)/12). 2/9 What is ((-408)/68)/(2-1)? 3 Calculate 33/2724/132. 2/9 (8/11405)/((-7)/(-21)) 2/19 What is ((-3)/(-1))/((-4)/(-8))? 6 Calculate ((0/(-14))/4)/(8/(-2)). 0 What is (-1)/(((-4)/14)/((-26)/(-13)))? 7 Evaluate (-2)/(-12)(-6)/(-12)-2. -1/6 ((-4)/6)/((-48)/36-2) -1/4 What is 12/(-108)-9-9? -9 Calculate 2/(-1)(-42)/(-28). -3 What is (-70)/(-45)-118/21? -4/3 What is 5/206/(-90)-20? 1/3 What is the value of 36/(-3)22/(-66)? 4 ((-3)/(-4))/((1125/(-40))/15) -2/5 What is (9/16-2)/3? -3/8 What is the value of (5/(-35))/((-2)/70)? 5 (-9)/(-3)4/(-6) -2 What is the value of (55/(-110))/(5/(10/(-8)))? 1/8 What is the value of 112/7010/(-4)? -4 What is (-2)/21/1? -1 Evaluate 10/(-2)-2(-1)/(-55). 2/11 What is (-9)/(-3)4/(-36)? -1/3 Calculate ((-6)/11)/(((-51)/(-374))/(-1)). 4 Calculate (-3)/12(-4)/(-2). -1/2 What is the value of (16/(-64))/(1/(-4)1)? 1 What is the value of ((-4)/2)/(17)? -2/7 Evaluate (30/(-16))/((-405)/180). 5/6 (4/14)/((-7)/(147/24)) -1/4 What is the value of (45/10)/923? 3 What is (-2)/(5/((-150)/20))? 3 What is the value of 2/(-20)20/(-24)? 1/12 Calculate ((-2)/(-3))/((-40)/(-12)). 1/5 What is ((-8)/(-18))/((-26)/117)? -2 Calculate (-1)/8-4-24. -4 What is the value of ((-8)/(-4)3)/((-136)/(-17))? 3/4 1/(((-616)/16)/(-11)) 2/7 What is the value of -72/82/(-21)? 1/6 What is 3/(-9)-12760/(-115)? -8 What is the value of ((-40)/30)/((-18)/27)? 2 What is ((-7)/154)/(5/(-40))? 4/11 What is the value of (-9)/9050? 0 ((-3)/(-45))/((15/(-6))/(-5)) 2/15 What is the value of 1/5-1(-45)/(-15)? -3/5 What is the value of (-5)/(((-76)/342)/(2/18))? 5/2 Calculate (12/(-24))/((1/6)/(-1)). 3 Evaluate 36/(-4)14/(-126)2. 2 What is (-4)/(-6)((-210)/190)/(-7)? 2/19 Evaluate 205/(-82)1/(2/4). -5 What is 109/(1575/(-10))? -4/7 Evaluate (-16)/(-12)2/(-4). -2/3 What is the value of 0/((-35)/(-5))2/8? 0 What is the value of 25/3756/4? 1/10 What is the value of (33/(1089/44))/(4/21)? 7 What is the value of 2/(-10)(-10)/(-16)? -1/8 Evaluate 3(8/12)/2. 1 Evaluate 8/((-56)/(-7))8. 8 Evaluate ((-24)/(-9))/((-22)/(-33)). 4 What is the value of 3-1108/108? -3 (-90)/14412/10 -3/4 (24/(-66))/(-2)(-1)/1 -2/11 What is (80/(-14))/(-10)14/4? 2 Calculate ((-9)/(-15))/((-6)/(-5)). 1/2 What is the value of -612/(-18)(-3)/(-3)? 4 Evaluate 5/(-20)12/3. -1 What is the value of 7/147-9(-4)/(-6)? -2/7 (-1)/313 -1 ((-8)/20)/(6/90) -6 Calculate 16/67218(-1)/(-1). 3/7 What is the value of (-62/(-33))/(110/605)? 2 Evaluate (-9)/(-3)(-11)/33. -1 1/15/22 5 What is (-566/385)/(2-1)? 3/7 What is the value of 8/(-3)3/(-2)-1? -4 Evaluate 2(-1)/(-42)-34. -4/7 (91/(-156)(-6)/(-21))/(-2) 1/12 Calculate ((-84)/9)/766/(-484). 2/11 (((-6)/(-11))/(-1))/(18/(-18)) 6/11 What is ((-5)/15-12)/(20/(-6))? -6/5 Evaluate ((-6)/95)/(36/(-60)). 2/19 What is the value of 3/(-28)(-52)/(-13)? -3/7 What is the value of (4/2)/(125/(-5))? -2/25 (7/(1911/(-6)))/((-117)/273) 2/39 Evaluate ((-1048)/(-655))/(4/(-10)). -4 ((-20)/350)/(3/15) -2/7 What is (-12/(-28))/((-70)/(-280))? 2/7 -4(-12)/(-16)(-4)/(-42) -2/7 What is (-6)/20248/(-93)? 4/5 What is 5/(-10)(-16)/10-5? -4 4/(3/((-15)/(-4))) 5 What is (4/(-12))/((-4)/(-6))? -1/2 What is 90/(-18)(-2)/4? 5/2 3/(1-12)1 -1/4 What is 1/304(-775)/155? -2/3 What is ((-4)/6)/((-40)/135-3)? -3/4 Calculate (176/(-33))/(-16)36/2. 6 Evaluate (-2)/(-10)(-140)/(-168). 1/6 What is the value of 33/(-44)(-16)/(-150)? -2/25 What is 520/52*	{ "pile_set_name": "DM Mathematics" }
10). 230 Let b(i) = -23i + 1450. What is b(63)? 1 Let v(i) = -870i - 113098. Determine v(-130). 2 Let o(z) = 24z - 114. What is o(11)? 150 Let a(p) = 58898p + 294484. Calculate a(-5). -6 Let d(y) = 11y3 + y2 - y + 2. Calculate d(-3). -283 Let a(x) = 5x*2 + 97x + 468. What is a(-10)? -2 Let m(j) = -687j + 4102. What is m(6)? -20 Let v(n) = 81n + 178. Determine v(-2). 16 Let q(u) = 3u2 + 30u - 122. Determine q(5). 103 Let m(c) = 20c - 308. Determine m(18). 52 Let v(k) = -k2 + 141k - 1193. Determine v(132). -5 Let m(g) = 36g + 188. Calculate m(-6). -28 Let i(r) = r2 - 29r + 81. Determine i(25). -19 Let h(s) = -2s2 - 13s - 38. What is h(-4)? -18 Let k(q) = -62q - 4164. Give k(-64). -196 Let a(k) = k3 + k2 - 78k - 42. Calculate a(-8). 134 Let m(n) = 2n2 - 79n - 318. Give m(43). -17 Let m(x) = -6921x + 200697. Give m(29). -12 Let f(z) = 1113z - 15581. Determine f(14). 1 Let b(g) = g*3 + 7g*2 + 12g + 22. Give b(-7). -62 Let v(i) = i*2 - 8i - 40. Determine v(-8). 88 Let j(z) = -3z3 + 11z*2 + 6z - 2. Give j(4). 6 Let l(c) = 30c2 - 324c - 58. Calculate l(11). 8 Let v(k) = -k*3 + 12k*2 - 31k + 33. Calculate v(9). -3 Let i(q) = 9q3 - 422q*2 - 53q + 288. Calculate i(47). 6 Let t(k) = k*2 + 112k - 2562. Give t(-132). 78 Let q(j) = -55j - 1272. Determine q(-28). 268 Let b(f) = -f3 - 114f*2 + 2082f + 281. Determine b(-130). 21 Let m(r) = 20r2 - 23r. Determine m(-3). 249 Let p(r) = 2r2 + 21r - 13. Calculate p(-10). -23 Let m(b) = 30b + 169. Determine m(-9). -101 Let o(n) = 7n*3 - 50n*2 + 9n - 16. Calculate o(7). -2 Let v(a) = 2a2 - 46a + 243. Give v(5). 63 Let g(f) = -133f - 220. Give g(-2). 46 Let a(x) = -x3 + 138x*2 + 125x + 1952. Determine a(139). 6 Let j(p) = -p*3 - 242p*2 - 5p - 1194. Give j(-242). 16 Let v(l) = 314l - 116486. Determine v(371). 8 Let t(z) = -103z + 368. What is t(3)? 59 Let o(j) = j*3 - 15j*2 - 124j - 32. Calculate o(21). 10 Let f(r) = r*2 - 4849r + 29058. Determine f(6). 0 Let r(a) = a*3 + 95a*2 - 824a + 10. Calculate r(8). 10 Let h(d) = 125d + 3250. Give h(-26). 0 Let l(s) = -561s + 6745. Give l(12). 13 Let b(w) = 3w - 19. Give b(-25). -94 Let k(p) = -9p*3 - 10. Determine k(-2). 62 Let a(y) = 84y + 40. What is a(-2)? -128 Let p(m) = -169m2 + 160m - 161. Give p(1). -170 Let y(u) = -u*3 + 154u*2 - 892u + 597. Determine y(148). 5 Let o(g) = g*2 + 302g - 925. Give o(3). -10 Let v(a) = a*2 + 95a + 839. Calculate v(-86). 65 Let x(n) = -n*2 - 79n - 1051. Determine x(-17). 3 Let q(h) = 102h2 + 4898h + 96. Calculate q(-48). 0 Let z(r) = -3r2 - 16r - 77. What is z(-6)? -89 Let k(u) = -u*3 + 10u*2 + 37u + 10. Determine k(-3). 16 Let x(k) = -80k + 3711. Give x(46). 31 Let y(c) = 31c + 228. Calculate y(-7). 11 Let t(c) = c*2 - 13604c + 81582. Calculate t(6). -6 Let h(m) = 2m3 - 201m*2 + 299m - 203. Determine h(99). -5 Let r(f) = f*2 - 99f + 1140. Calculate r(86). 22 Let z(w) = w*3 - 2w*2 - 71w + 279. What is z(4)? 27 Let l(c) = 2c3 + 6c*2 - 35c - 3. Determine l(-5). 72 Let m(l) = -l*3 + 667l*2 - 8499l - 32. Calculate m(13). 7 Let y(z) = z*3 + 4z*2 - 20z - 15. What is y(-7)? -22 Let h(t) = t*3 + 10t*2 + 61t + 580. What is h(-9)? 112 Let l(b) = -2b3 + 31b*2 - 14b - 31. Give l(15). -16 Let k(a) = a*3 - 159a*2 + 346a - 5036. Determine k(157). -12 Let p(r) = r*2 - 684r + 12635. What is p(19)? 0 Let o(v) = -v*3 + 36v*2 + 3v - 843. Determine o(36). -735 Let g(l) = l*2 - 24l + 153. What is g(16)? 25 Let y(f) = -20f + 60. Give y(7). -80 Let o(v) = -40v - 297. Give o(-9). 63 Let o(i) = -9i2 + 20i + 25. Give o(-3). -116 Let w(m) = 70m - 1238. What is w(19)? 92 Let o(w) = 6w*2 - 172w - 330. Give o(29). -272 Let w(t) = -t*2 - 5t - 75. What is w(-14)? -201 Let q(j) = -7j2 + 11j + 26. Determine q(-2). -24 Let v(w) = 24w + 14. Calculate v(-9). -202 Let f(v) = -510v - 7149. What is f(-14)? -9 Let h(a) = 82a - 430. Calculate h(-5). -840 Let i(x) = x3 - 8x*2 + 2x - 24. Determine i(7). -59 Let m(l) = -2l3 - 54l*2 - 51l + 15. Calculate m(-26). -11 Let r(h) = 8h + 683. Calculate r(-90). -37 Let m(a) = -107a - 808. Calculate m(-7). -59 Let p(y) = -131y + 913. What is p(7)? -4 Let o(f) = 3f*2 + 147f + 1759. Give o(-28). -5 Let b(d) = -d*2 - 35d - 224. Give b(-15). 76 Let h(o) = 35o - 358. Determine h(10). -8 Let k(y) = -24y*2 + 528y - 6. Determine k(22). -6 Let m(q) = -11q - 404. Determine m(-38). 14 Let b(s) = 22s - 1506. Give b(63). -120 Let r(i) = 159i + 3099. Give r(-19). 78 Let r(n) = 2n*3 + 11n*2 + 10n - 8. Determine r(-3). 7 Let h(f) = 37f3 - 8326f*2 + 224f + 253. Determine h(225). 28 Let u(z) = -695z + 4087. What is u(6)? -83 Let n(k) = 62k - 859. Determine n(14). 9 Let p(z) = -z*3 - 5z*2 + 127z + 618. Determine p(-5). -17 Let w(q) = 6q2 + 45q + 122. Determine w(-4). 38 Let v(g) = 15g2 + 23g + 20. Calculate v(-3). 86 Let z(i) = -i*2 + 150i - 1235. Give z(141). 34 Let b(g) = 295g - 10533. What is b(36)? 87 Let s(k) = -2k*3 - 4k*2 + 13k - 15. What is s(-4)? -3 Let t(w) = -2w2 - 3w + 9. What is t(4)? -35 Let n(i) = i*2 + 45i - 1949. Give n(27). -5 Let v(r) = -14r2 - 89r - 120. Calculate v(-4). 12 Let p(n) = -17n2 + 679n - 625. What is p(39)? -1 Let d(w) = -4w2 - 86w + 27. Determine d(-22). -17 Let i(a) = -a*3 - 16a*2 + 380a - 55. What is i(-29)? -142 Let j(l) = -3l2 + 49l - 140. Calculate j(3). -20 Let v(d) = -25d2 + 57d + 133. Determine v(-3). -263 Let b(i) = -4i2 + 10i + 67. What is b(-4)? -37 Let n(v) = v*2 + 69v + 659. What is n(-59)? 69 Let c(s) = 17s2 + 2332s + 440. Determine c(-137). 29 Let j(w) = -w*3 + 15w*2 + 50w + 56. What is j(18)? -16 Let d(w) = -w*3 + 2w*2 - 15w + 36. Calculate d(2). 6 Let u(s) = -14s - 124. Give u(-8). -12 Let h(u) = -u3 - 13u*2 - 35u - 24. Determine h(-10). 26 Let a(n) = -n*2 - 33n + 272. Determine a(-35). 202 Let z(u) = -u*2 - 2u + 144. Give z(-13). 1 Let q(j) = -2j3 - 12j*2 + 34j + 13. Determine q(-8). -3 Let t(h) = 47h + 730. Give t(-4). 542 Let w(i) = -2i*3 - 15i*2 - 16i + 8. What is w(-6)? -4 Let t(l) = -951l + 1899. What is t(2)? -3 Let a(z) = z3 + 75z*2 - 155z - 86. Calculate a(-77). -9 Let u(f) = -f*3 - 3f*2 + 4f - 28. Calculate u(-6). 56 Let n(u) = 2u3 + 109u*2 - 163u + 285. Give n(-56). 5 Let q(v) = 4v3 - 90v*2 + 43v + 12. Calculate q(22). -10 Let t(q) = 13q2 - 11q + 2. What is t(1)? 4 Let r(d) = 2d2 - 384d - 1911. What is r(-5)? 59 Let a(m) = 7m - 87. What is a(19)? 46 Let m(w) = -w2 + 107w - 982. Calculate m(97). -12 Let v(b) = -b*3 - 5b*2 + 15b + 38. Give v(-6). -16 Let f(d) = 2934d - 20500. Determine f(7). 38 Let l(b) = 45b + 246. Determine l(-17). -519 Let w(l) = l*2 + 19l - 44. Give w(2). -2 Let n(w) = 45w3 + w. Determine n(1). 46 Let j(t) = -t3 - 12t*2 - 18t - 27. Determine j(-11). 50 Let d(v) = -v*3 + 121v*2 - 105v - 1808. Determine d(120). -8 Let o(h) = 2676h + 206060. Determine o(-77). 8 Let w(p) = -104p - 14. Calculate w(0). -14 Let m(p) = 2p - 120. Determine m(44). -32 Let a(n) = -n2 - 3n + 3975. Calculate a(62). -55 Let r(v) = v3 + v2 - 20v + 88. Calculate r(4). 88 Let y(r) = r3 + 119r*2 + 115r - 347. What is y(-118)? 7 Let y(c) = -5c3 + 2c*2 - 5c. Calculate y(0). 0 Let n(g) = g*3 - 31g*2 + 88g + 20. Calculate n(4). -60 Let n(c) = -c*3 + 13c*2 + 1217c + 37. Determine n(42). -5 Let o(x) = -2x2 - 39x - 47. What is o(-18)? 7 Let p(b) = 130b + 501. Determine p(-4). -19 Let j(p) = -2p*3 - 4p*2 + 4p + 5. Give j(-3). 11 Let a(f) = -2f2 - 110f - 1154. What is a(-37)? 178 Let d(c) = c*3 - 6c*2 - 13c + 22. Calculate d(6). -56 Let w(u) = 1967u - 2024. Calculate w(1). -57 Let l(p) = -p3 + 16p*2 + 77p - 1365. Give l(15). 15 Let c(y) = 149y - 28308. Determine c(190). 2 Let u(x) = 15888x - 95330. Determine u(6). -2 Let o(w) = w*2 - 633w + 6841. What is o(11)? -1 Let y(r) = -82r - 205. Calculate y(-4). 123 Let a(x) = -x3 - 44x*2 - 84x + 97. Give a(-42). 97 Let q(f) = -6f2 + 151f - 739. Calculate q(7). 24 Let y(w) = 16w2 + 27w - 127. What is y(4)? 237 Let u(p)	{ "pile_set_name": "DM Mathematics" }
/5 Suppose o3/8 + o2/8 - o/8 - 1/8 = 0. Calculate o. -1, 1 Factor x*4 - 21x*3 + 68x2. x2(x - 17)(x - 4) Suppose 25m4 + 320m*3 - 2690m*2 + 4800m - 855 = 0. Calculate m. -19, 1/5, 3 Let 2c5/3 - 2c*4/3 - 18c*3 - 46c*2/3 + 52c/3 + 16 = 0. Calculate c. -4, -1, 1, 6 Find n, given that -4n4/5 + 96n*3/5 + 164n*2 - 3072n/5 + 432 = 0. -9, 1, 2, 30 Factor j*4 + 2j*3 - 3j*2 - 8j - 4. (j - 2)(j + 1)2(j + 2) Factor 50t2/9 - 202t/9 + 8/9. 2(t - 4)(25t - 1)/9 Determine u so that 3u*2 - 21u = 0. 0, 7 Factor s*5/3 - 59s*4/3 + 115s*3/3 - 19s2. s2(s - 57)(s - 1)*2/3 Solve -2y*2/11 + 70y/11 - 248/11 = 0. 4, 31 Factor -a*5/3 - 5a*4/3 - 4a*3/3 + 16a*2/3 + 32a/3 + 16/3. -(a - 2)(a + 1)(a + 2)*3/3 Suppose 2v*4/15 + 26v*3/15 + 36v*2/5 + 184v/15 + 112/15 = 0. What is v? -7, -2 Factor -3p3/4 + 69p*2 - 1632p + 11520. -3(p - 60)(p - 16)*2/4 What is a in 24a*5/7 - 1686a*4/7 - 1284a*3/7 + 426a*2/7 = 0? -1, 0, 1/4, 71 Factor -5s*2 - 10s + 120. -5(s - 4)(s + 6) Find p such that -5p2 + 25p + 120 = 0. -3, 8 Find z such that -2z5 + 46z*4/7 + 16z*3/7 - 176z*2/7 + 160z/7 - 32/7 = 0. -2, 2/7, 1, 2 Suppose -8b3/15 - 14b*2/15 + 28b/15 - 2/5 = 0. Calculate b. -3, 1/4, 1 Factor -2k2/9 + 16k/3 - 238/9. -2(k - 17)(k - 7)/9 Factor -d*5/3 - 2d*4 - 2d*3/3 + 20d*2/3 + 9d + 10/3. -(d - 2)(d + 1)3(d + 5)/3 Determine s, given that s*2/5 + 104s/5 + 2704/5 = 0. -52 Suppose -75r3/4 + 30r*2 + 273r - 588 = 0. Calculate r. -4, 14/5 Factor -3v3 - 9v*2 + 12v. -3v(v - 1)(v + 4) Solve 6y*5 + 1232y*4/5 + 1288y*3/5 + 64y*2 = 0 for y. -40, -2/3, -2/5, 0 Solve -9j*3 - 142j*2 + 185j - 34 = 0 for j. -17, 2/9, 1 Suppose -15x3/2 - 981x*2/2 + 1314x - 816 = 0. Calculate x. -68, 1, 8/5 Factor -2l3 - 44l*2 - 240l. -2l(l + 10)(l + 12) Find x such that 15x*5 - 145x*4 + 310x*3 - 210x*2 - 5x + 35 = 0. -1/3, 1, 7 Determine m, given that -3m5 + 51m*4 - 231m*3 + 381m*2 - 198m = 0. 0, 1, 2, 3, 11 Factor -4v2 - 12440v - 9672100. -4(v + 1555)2 Factor -5v*5 - 14v*4 - 12v*3 - 2v*2 + v. -v(v + 1)*3(5v - 1) Factor c3/9 - 370c*2/9 + 736c/9. c(c - 368)(c - 2)/9 Factor -4h3 - 76h*2 + 1096h + 2464. -4(h - 11)(h + 2)(h + 28) What is h in 2h*2 - 4172h + 2175698 = 0? 1043 Find s such that 6s2/5 + 2s/5 - 12 = 0. -10/3, 3 Solve 40y3/9 + 74y*2/9 + 40y/9 + 2/3 = 0. -1, -3/5, -1/4 Factor -4g3 - 24g*2 - 44g - 24. -4(g + 1)(g + 2)(g + 3) Find h such that -h4 - 7h*3 + 120h*2 - 368h + 256 = 0. -16, 1, 4 Determine w, given that -2w2 - 10w = 0. -5, 0 Solve z*2/7 + 72z + 9072 = 0 for z. -252 What is x in -80x3 - 364840x*2 - 182405x - 22800 = 0? -4560, -1/4 Factor -2g3/9 - 1774g*2/9. -2g*2(g + 887)/9 Let 2h5/11 - 2512h*4/11 + 781202h*3/11 + 4747660h*2/11 + 9535672h/11 + 6370576/11 = 0. What is h? -2, 631 Factor -2d2 + 1352d - 228488. -2(d - 338)2 Find m, given that 4m*3 - 48m*2 + 140m - 96 = 0. 1, 3, 8 Let 5d3/3 - 320d*2/3 + 1595d + 3630 = 0. Calculate d. -2, 33 Solve v*5 + 5v*4 - 6v*3 - 38v*2 - 43v - 15 = 0. -5, -1, 3 What is k in 4k2 - 5040k + 5036 = 0? 1, 1259 Find m, given that 3m3/2 - 36m*2 - 453m/2 + 261 = 0. -6, 1, 29 Factor 2y2/9 - 86y/9 + 560/9. 2(y - 35)(y - 8)/9 Let 5y2 + 15y - 50 = 0. Calculate y. -5, 2 What is w in 9w5 + 201w*4 + 969w*3 - 3609w*2 - 19866w + 14520 = 0? -11, -5, 2/3, 4 Suppose -w*3/6 - 7w*2/2 + 97w/6 - 25/2 = 0. Calculate w. -25, 1, 3 Solve -b*4/4 - 9b3/4 + b2/4 + 9b/4 = 0 for b. -9, -1, 0, 1 What is d in -2d*3/3 - 14d*2/3 - 16d/3 + 32/3 = 0? -4, 1 Suppose 3l5/2 + 3l*4 - 21l*3/2 - 12l*2 + 18l = 0. What is l? -3, -2, 0, 1, 2 Find h such that -4h5 - 20h*4 + 224h*3 + 1392h*2 + 1152h = 0. -6, -1, 0, 8 Factor -2n4 + 102n*3 - 466n*2 + 258n + 828. -2(n - 46)(n - 3)*2(n + 1) Solve -2r5/17 - 224r*4/17 + 228r*3/17 + 224r*2/17 - 226r/17 = 0. -113, -1, 0, 1 What is t in -3t2/2 + 165t/2 - 234 = 0? 3, 52 Factor 4x2 - 800x + 40000. 4(x - 100)2 Suppose w3/8 - 11w*2/4 + 65w/8 + 169/2 = 0. Calculate w. -4, 13 Factor 3t2 + 1272t - 1275. 3(t - 1)(t + 425) Find n, given that -n*3 + 2436n*2 - 1485957n + 2962178 = 0. 2, 1217 Suppose -2r2/11 + 250r/11 - 732/11 = 0. What is r? 3, 122 What is i in 15i2 - 72i + 84 = 0? 2, 14/5 Factor -2y2 + 158y - 156. -2(y - 78)(y - 1) Factor -98h3/3 - 4466h*2/3 - 17680h - 16224. -2(h + 1)(7h + 156)2/3 Factor -i5 - 1122i*4 - 2240i*3 + 2i*2 + 2241i + 1120. -(i - 1)(i + 1)3(i + 1120) Suppose -n*4 - 113n*3/5 - 234n*2/5 + 5012n/5 - 392 = 0. Calculate n. -14, 2/5, 5 Let -2t2/5 + 86t/5 - 504/5 = 0. What is t? 7, 36 Factor -12i4 - 39i*3 + 111i*2 + 30i. -3i(i - 2)(i + 5)(4i + 1) Factor 14a*4 + 38a*3 - 138a*2 + 106a - 20. 2(a - 1)2(a + 5)(7a - 2) Factor -z*3 - 246z*2 - 20172z - 551368. -(z + 82)3 Find j such that j3/4 + 21j2/4 - 31j + 39 = 0. -26, 2, 3 Find j such that -2j2/3 - 1276j/3 - 203522/3 = 0. -319 Factor 2v5/5 + 4v*4/5 - 6v*3/5 - 8v*2/5 + 8v/5. 2v(v - 1)*2(v + 2)*2/5 Suppose 3u*2 - 11316u + 10670988 = 0. Calculate u. 1886 Suppose 2304w5 + 2688w*4 + 208w*3 - 192w*2 - 12w + 4 = 0. What is w? -1, -1/4, 1/6 Let 9t3/5 + 146t*2/5 + 284t/5 + 56/5 = 0. Calculate t. -14, -2, -2/9 Determine d so that d*3/3 - 6d*2 = 0. 0, 18 Factor 3q*3/5 - 39q*2/5 - 12q + 252/5. 3(q - 14)(q - 2)(q + 3)/5 Suppose 2h*2/3 - 86h/3 + 148 = 0. Calculate h. 6, 37 Determine n, given that -2n2/3 + 44n = 0. 0, 66 Factor 3u2/4 - 21u/4 - 6. 3(u - 8)(u + 1)/4 Solve -q*2/4 - 71q/2 - 5041/4 = 0 for q. -71 Let -2l3 + 162l*2 - 3198l - 3362 = 0. Calculate l. -1, 41 Factor -4t3 - 56t*2 - 176t - 160. -4(t + 2)2(t + 10) Factor -4c2 - 32c. -4c(c + 8) Factor -5z2 - 2120z - 224720. -5(z + 212)2 Find j, given that 2j*5/7 + 4j*4/7 - 4j*3/7 - 8j*2/7 + 2j/7 + 4/7 = 0. -2, -1, 1 Factor -r*3/4 - 11r*2/4 - 15r/2. -r(r + 5)(r + 6)/4 Let -6w5/5 - 2w*4 + 2w*3/5 + 2w*2 + 4w/5 = 0. What is w? -1, -2/3, 0, 1 Let 3v5 + 12v*4 - 30v*2 - 3v + 18 = 0. What is v? -3, -2, -1, 1 Factor 15d4 + 27d*3 - 78d*2 - 72d. 3d(d - 2)(d + 3)(5d + 4) Determine m, given that m3/3 + 49m*2/3 + 392m/3 - 5488/3 = 0. -28, 7 Factor v*3 - 36v*2 - 75v - 38. (v - 38)(v + 1)2 Find m such that m5/3 + 5m4/3 - m3/3 - 17m2/3 + 4m = 0. -4, -3, 0, 1 Find i, given that 10i5 + 14i*4 + 4i3 = 0. -1, -2/5, 0 Determine k, given that -k5 - 351k4 + 1418k*3 - 714k*2 - 1417k + 1065 = 0. -355, -1, 1, 3 Suppose -28o5 + 7048o*4 - 590688o*3 + 16426368o*2 + 4741632o = 0. Calculate o. -2/7, 0, 84 Factor -24d2/11 - 222d/11 + 180/11. -6(d + 10)(4d - 3)/11 Suppose 4x*2 + 172x - 5376 = 0. What is x? -64, 21 Factor 2w3 + 22w*2 - 40w - 600. 2(w - 5)(w + 6)(w + 10) Factor 2j*2/11 - 556j/11 - 1686/11. 2(j - 281)(j + 3)/11 Let -5y2/6 - 17y - 248/3 = 0. What is y? -62/5, -8 Solve -2m5/11 - 16m*4/11 - 24m*3/11 + 4m*2 + 58m/11 - 60/11 = 0. -5, -3, -2, 1 Find t such that -29t5/5 + 321t*4/5 + 13t*3 - 181t*2 - 576t/5 + 44/5 = 0. -1, 2/29, 2, 11 Let -20c4 + 188c*3 - 52c*2 - 188c + 72 = 0. What is c? -1, 2/5, 1, 9 Find p, given that -5p5 + 10p*4 + 5p*3 - 10p*2 = 0. -1, 0, 1, 2 Factor 4h*3 - 1000h*2 + 61488h + 127008. 4(h - 126)2(h + 2) Factor -2z3/5 - 8z*2/5 + 8z/5 + 32/5. -2(z - 2)(z + 2)(z + 4)/5 Suppose -z3/3 + 768z2 = 0. What is z? 0, 2304 Factor -g2/9 + 6g - 81. -(g - 27)2/9 Let 2o*4 + 198o*3 - 202o*2 - 198o + 200 = 0. Calculate o. -100, -1, 1 Solve -3o5/2 + 6o*4 + 21o*3/2 - 51o*2 + 36o = 0. -3, 0, 1, 2, 4 Find s such that 4s2/13 + 18s/13 = 0. -9/2, 0 Factor -2x2/9 + 2240x/3 - 627200. -2(x - 1680)2/9 Determine k, given that 12k*3/5 - 192k*2/5 + 195k - 1521/5 = 0. 3, 13/2 Factor -2z2/13 + 70z/13 - 348/13. -2(z - 29)(z - 6)/13 Let -4z4 + 40z*3 - 132z*2 + 144z = 0. Calculate z. 0, 3, 4 Sol	{ "pile_set_name": "DM Mathematics" }
alue in l, n, -2? n Let t = -1 + 0.6. Let p = -72 + 76. Suppose pq = m + 17, q + 2q - m = 12. What is the third biggest value in q, -4, t? -4 Let d = -2/283 - 271/1698. What is the second biggest value in d, -2, 2? d Let n = -1548 - -1547. Which is the third smallest value? (a) -65 (b) -3 (c) n (d) 4 c Let w = -4 + 4.1. Suppose -5 = -2l + 5. Let b = -4.5 - -4. What is the smallest value in l, b, w? b Let o = -5 + 7. Let j = -2.8173 - -0.0473. Let d = 0.23 - j. What is the second biggest value in o, 0.5, d? o Suppose 2u - 1 = 2d + 5, 5u - 35 = -5d. Let g = -18 + 17. Let l be (-200)/96 - 6/(-8). Which is the second smallest value? (a) l (b) g (c) u b Let s = 0.814 - -0.286. What is the second biggest value in 0, s, 1, 4? s Let w = 813/4 - 15439/76. Let m = -280 + 10350/37. Let g = m + 332/407. Which is the second smallest value? (a) w (b) g (c) 0.5 c Let l = 0.062 + -1.062. Let f = -215.01 - -215. Which is the third biggest value? (a) l (b) f (c) 4 a Let a = -84 - -74. Let p = a + 13. What is the third biggest value in 1/3, p, 2/3, -0.02? 1/3 Let a = 0.03 + -0.04. Let t = a + 0.06. What is the smallest value in 1/4, t, 0.1? t Let z be 23315/(-45850) + (-3)/(-6). Let f = z + 1222478/13755. Let j = f + -89. What is the second biggest value in 0.2, -0.3, j? j Let n(y) = y3 - 3y + 2. Let q be n(2). Let v be (10/(-25))/(6/10). Let u be (-20)/(-50)10/(-22). Which is the third smallest value? (a) q (b) v (c) u a Let z = 18/35 - 272/665. Let l = -0.4 - 0.1. What is the biggest value in z, 3/7, l? 3/7 Suppose 14r - 19r = 4f + 35, 3r - f = -4. Which is the smallest value? (a) 3 (b) r (c) 7 (d) -2 b Let h = 2.032 - 0.032. Let p be (0 - -198) + (-26)/(-13). Let i = p - 1403/7. Which is the third smallest value? (a) h (b) -0.04 (c) i a Let i = 4.1 + -1.8. Let k = i + 0.7. Which is the third smallest value? (a) k (b) 6/5 (c) -3 a Let l be -1 + -10 + 3 - -3. What is the third biggest value in l, 32, -3, -0.5? -3 Let t = -3347489 - -30035110/9. Let j = t + 31147/3. Let x = -128 + j. Which is the smallest value? (a) 3 (b) x (c) 3/4 b Let k = -457 + 456. What is the third smallest value in -4, 23, k, 4? 4 Let w = -17 + 24. Let g = w + -7.96. Let l = g + -0.04. What is the smallest value in -0.05, l, -2/9? l Let y be (-6)/(-3) - (-363)/(-9). Let n = y - -39. Which is the smallest value? (a) n (b) 0.6 (c) -2 c Let b = -37 - -20.6. Let k = b - -16. Let r = -0.42 - -0.12. What is the second smallest value in r, 3/5, k? r Let p = 413.6 + -414. Which is the second biggest value? (a) 2 (b) 3 (c) 2/3 (d) p a Let p = -0.492 + 0.362. Which is the smallest value? (a) -1/2 (b) -0.3 (c) p a Let l = 2 - 6. Let p = l - 0. Let z = -2693 + 2682. What is the second biggest value in p, -2, z? p Suppose 2p - 10 = -0. Let o = 0.75 + -0.8. Let v = o - -0.55. Which is the second smallest value? (a) -0.2 (b) v (c) p b Suppose -6 = 6l + 66. Let m be (-4)/(-9) + 8/l. Which is the fourth smallest value? (a) -4 (b) m (c) -1.4 (d) 0.2 d Let w = 40.8 - 39. Let h = -3.2 - w. Let a = -0.4 + 0. What is the smallest value in a, 4, h? h Let s = -1.2 - -1.1. Suppose -f - 6 + 16 = 0. Let k be (39/(-15) - -3)f. Which is the third smallest value? (a) s (b) k (c) 5 c Let k = 542/5 + -108. Which is the third smallest value? (a) 2/7 (b) 1 (c) 9/2 (d) k b Let o be (-22)/(-66) - (1 + 4/(-3)). Which is the smallest value? (a) 12 (b) -5 (c) o b Let n be (-16)/73323/2. Let y = n - 2430/4277. Let i = -2.96 + -0.04. Which is the biggest value? (a) y (b) i (c) 1/5 c Let u = 52.364 - -0.236. Let q = 53 - u. Which is the third smallest value? (a) -0.5 (b) -4 (c) -1/4 (d) q c Let j be (5/4)/((-6)/48). Let r = j - -17. Let d be (-10)/4r/35. Which is the second biggest value? (a) d (b) -4 (c) -5 b Let r = 1.5 - 1. Let u(g) = -39g + 671. Let o be u(17). Which is the biggest value? (a) -3 (b) o (c) r b Let t = 0.31 - -0.19. Suppose j - 2u - u = 4, 2j = -2u - 8. What is the biggest value in t, -6, j, -0.1? t Let f = 3 + -8.5. Let r = 15 + -21. Let p = f - r. What is the second biggest value in p, -2/3, 0.3? 0.3 Let s(b) = -6b2 - 212b - 63. Let z be s(-35). Suppose g = 1 + 1. What is the biggest value in z, -0.1, 0.05, g? z Let x be (-31 - -21)/((1 - -1)-3). Let a = 0.42 - 0.02. What is the second smallest value in 3, x, a? x Let w = -2.5 + 2. Let i = 8419/7 - 1203. Which is the smallest value? (a) 2 (b) i (c) w (d) -2/3 d Let j = 12 + -24. Let p = -6 + j. Let m = p + 17.5. What is the third biggest value in 1/2, m, 3/7? m Let k = 11 + -6. Let y = -26.731 - -21.731. Which is the second biggest value? (a) -0.4 (b) k (c) -24 (d) y a Let q(c) = -c + 4. Let u be q(8). Let i = 0.3747 - 0.8747. What is the second smallest value in i, -2, u? -2 Suppose 0 = 2f, -3f - 145 = 5v + 65. Which is the smallest value? (a) v (b) -0.5 (c) 2/9 a Let w = -43.065 + 43. Let h = w + -11.935. Which is the third biggest value? (a) -1 (b) -4 (c) -2 (d) h b Suppose 2j = -0o + 2o, 5o - 10 = 0. Suppose -13 = 5i + j. What is the third biggest value in -0.4, i, 18, 0.2? -0.4 Suppose 10 = 2g - 2n - 0, 2g = 4n + 14. Let f be -2 + g + 15/(-17). Which is the smallest value? (a) f (b) -1 (c) -0.3 (d) 1 b Let s = -1373 - -1369. Which is the third smallest value? (a) -3 (b) s (c) 0.08 (d) 2/9 c Let q = 8 + -11. Let f = -200 - -201. Let o be f/(-104)-55 - 46/299. Which is the second biggest value? (a) q (b) 5 (c) o c Let d = 20 + -21. Suppose o = -4z - 3o + 8, -2z + 9 = -3o. Suppose 0 = 4v - 9 - 7. What is the second biggest value in z, v, d? z Suppose 5i - 5y + 65 = 0, i + 8 = -3y - 21. Let c = -3.838 + -0.162. What is the smallest value in -1, c, i? i Let w = 27.1 + -27. Which is the fourth smallest value? (a) 5 (b) -0.4 (c) w (d) -1 a Let a = 482 + -481.8. What is the biggest value in -2/5, 37/4, a? 37/4 Suppose -10q + 1143 - 243 = 0. Suppose 0 = 4y - 3 - 573. Let i be y/q + (-1)/1. What is the second smallest value in 1, i, 0? i Let x = 2093 - 2090. Which is the biggest value? (a) x (b) -4/3 (c) -6 a Suppose 5i + 6 = 4b + 3i, 4 = 5b + i. What is the second biggest value in -42, 0.2, b? 0.2 Suppose 0 = -692t + 684t - 40. Which is the second smallest value? (a) t (b) -0.3 (c) 0.3 (d) 2 b Let l = 9/16 - -133/48. Let t = l - 4. Suppose 22 = 2j - 5c, -3 = -2j + c + 3. What is the smallest value in j, -5, t? -5 Let m be (1/5)/(-1 - 0). Let d(r) = r3 + 6r*2 + 5r + 4. Let v be d(-5). Which is the second smallest value? (a) v (b) -14 (c) m c Let r = 129 + -145.8. Let s = r + 17. What is the smallest value in 4, s, 0.3, -0.1? -0.1 Let p = 1 - 0. Let k = 2.917 - 0.917. What is the third biggest value in k, 0.2, p, 2/9? 2/9 Suppose -3 - 1 = -4p. Let o = -8 + 4. Let a = 37.93 - 32.93. What is the third biggest value in o, p, a? o Let z = -618/5 + 124. Let s = 6 - 5.6. Let h = s - 0.5. Which is the second biggest value? (a) h (b) -3/2 (c) z a Let x = -11.6 + 11. Let m = x + 0.9. Let i = 2.11 - 2.1. What is the third biggest value in -0.1, i, m? -0.1 Let n = 0.55 + 1.45. Which is the smallest value? (a) 26 (b) 0.2 (c) n b Let v(r) = r2 + 10r - 1. Let n be v(-7). Let f be (-316)/(-14) + 6/(-21). Let l = f + n. What is the third biggest value in -5, -1/6, l? -5 Let g = 424 + -1274/3. What is the second biggest value in g, 0.06, -4/7, 0.2? 0.06 Suppose 3g = 6g + 30. Let r = 30 - 17. Let i = g + r. Which is the third smallest value? (a) 8 (b) i (c) -0.5 a Let g = -945 - -20797/22. Let h = 3/22 - g. What is the second biggest value in 0.1, -0.3, h? h Let r be (-2)/6(-34 - -13). Suppose 3h + r = -5a, a - 26 = -5h - 1. Let p be h + (1 - 5) - 7. What is the second biggest value in -2, p, -0.02? -2 Let u = -214 - -213.8. What is the third biggest value in -7, -5, u? -7 Let n be 5/75*(3 - -36). Let q be ((-1)/1 - (-115)/(-35)) + 4. What is the third smallest value in n, q, 1/2, 2? 2 Let r = -41/35 - -4/7. Let c = 175/118 + 1/59. Let i = -0.17 - -7.17. What is the second smallest value in i, r, c? c Let q = 42 + -46. Which is the biggest value? (a) -3.1 (b) q (c) -5 a Let o = 27 + -16. Let k = o + -10.9. Let y = -59 - -55. What is the third smallest value in y, k, -1? k Let p = -535	{ "pile_set_name": "DM Mathematics" }
ivisor of 25384 and 4495096? 152 Calculate the greatest common divisor of 288 and 1969568. 32 What is the greatest common divisor of 164177 and 1936389? 2249 What is the greatest common factor of 20232002 and 196? 98 What is the greatest common divisor of 2699576 and 2200? 88 What is the greatest common divisor of 1510572 and 144? 12 Calculate the highest common factor of 12133812 and 4944. 1236 Calculate the highest common factor of 3428193452 and 4. 4 Calculate the greatest common divisor of 2977200 and 1850. 50 Calculate the highest common factor of 1315 and 10930017. 263 What is the greatest common divisor of 2528 and 52509088? 2528 What is the greatest common divisor of 3733742948 and 11276? 11276 What is the highest common factor of 5966802 and 7686? 18 Calculate the highest common divisor of 59073 and 5576627. 679 What is the highest common divisor of 26553269 and 1? 1 Calculate the highest common factor of 140 and 138084212. 28 Calculate the greatest common divisor of 20617815 and 381. 381 Calculate the highest common divisor of 33772979 and 110132. 2503 Calculate the greatest common factor of 6134667 and 297. 33 Calculate the greatest common divisor of 2503479 and 144771. 3531 Calculate the highest common divisor of 75823958 and 14. 14 Calculate the greatest common factor of 24 and 4776897. 3 What is the highest common divisor of 9 and 128916639? 9 Calculate the highest common divisor of 8726 and 82290543. 4363 Calculate the greatest common factor of 3637788 and 1198274. 4774 What is the greatest common factor of 134 and 8385921? 67 Calculate the greatest common divisor of 811068 and 7896. 12 Calculate the highest common factor of 6678430 and 1671. 557 What is the highest common factor of 69328404 and 96? 12 Calculate the greatest common divisor of 25245360 and 78. 6 Calculate the greatest common factor of 1491 and 25920183. 213 What is the greatest common divisor of 715343156 and 3684? 1228 What is the greatest common factor of 43016 and 38168210? 566 Calculate the greatest common factor of 467577511 and 30196. 7549 Calculate the greatest common factor of 36936 and 1767. 57 Calculate the greatest common factor of 21950 and 2990. 10 Calculate the highest common factor of 6486541 and 239809. 5849 What is the highest common factor of 37493886 and 4110? 822 What is the greatest common divisor of 19726601 and 211? 211 Calculate the highest common factor of 423396 and 468540. 684 Calculate the highest common divisor of 313800 and 90600. 600 Calculate the highest common divisor of 5990886 and 661441. 4213 What is the highest common factor of 38016 and 1540296? 216 What is the greatest common divisor of 23462334 and 17052? 1218 Calculate the highest common factor of 112 and 52668798. 14 What is the greatest common divisor of 2872566 and 1044? 522 What is the highest common factor of 380032 and 496? 16 What is the highest common factor of 68808 and 642? 6 Calculate the greatest common factor of 1102673 and 2057. 121 Calculate the highest common factor of 308 and 26924828. 28 What is the greatest common factor of 741395 and 245? 5 Calculate the highest common factor of 432 and 43946496. 432 Calculate the highest common factor of 849123 and 1188. 297 Calculate the highest common divisor of 1408897 and 3528. 49 What is the greatest common factor of 1932 and 757758? 138 What is the greatest common factor of 1207017 and 587673? 3519 Calculate the greatest common divisor of 94658 and 190. 38 What is the greatest common divisor of 2383008925 and 1361? 1361 Calculate the greatest common divisor of 1047029 and 129743. 23 Calculate the highest common factor of 2106 and 5594580. 18 What is the greatest common factor of 3667598730 and 9990? 9990 Calculate the greatest common divisor of 10172130 and 120. 30 Calculate the greatest common divisor of 265251 and 28203. 357 What is the greatest common divisor of 29057 and 79172023? 4151 Calculate the greatest common divisor of 88 and 5329104. 88 What is the greatest common factor of 8484233 and 180881? 277 Calculate the greatest common factor of 423158 and 58474. 346 Calculate the greatest common factor of 8950 and 28550. 50 What is the greatest common factor of 574979 and 479207? 347 Calculate the highest common divisor of 83055534 and 72. 6 Calculate the greatest common divisor of 9 and 15244209. 9 What is the greatest common factor of 251927760 and 480? 240 Calculate the highest common factor of 8 and 46979368. 8 What is the highest common divisor of 636 and 13119? 3 Calculate the highest common divisor of 27360 and 19913672. 152 Calculate the highest common divisor of 10797344 and 12453. 593 What is the highest common factor of 1199222011 and 62? 31 Calculate the greatest common factor of 270 and 9910. 10 Calculate the highest common divisor of 305 and 6139505. 5 What is the highest common factor of 80 and 13532080? 80 Calculate the highest common divisor of 1123818071 and 8518. 4259 Calculate the greatest common divisor of 21438 and 82647. 27 What is the greatest common divisor of 2275 and 190671? 13 What is the highest common factor of 16760979 and 27? 27 What is the highest common divisor of 544008 and 551? 19 What is the highest common divisor of 45579151 and 18015? 1201 What is the highest common divisor of 110712 and 751044? 84 What is the highest common factor of 652782 and 6682? 26 What is the greatest common divisor of 26 and 64086607? 13 What is the highest common factor of 20 and 191110540? 20 What is the highest common factor of 13077 and 50449613? 1453 What is the highest common factor of 121095 and 98215? 65 What is the greatest common factor of 30903497 and 2635? 31 What is the greatest common factor of 126898026 and 348? 174 What is the greatest common factor of 8 and 229676? 4 Calculate the greatest common divisor of 480933 and 9. 9 Calculate the highest common divisor of 749367 and 5891250. 4713 Calculate the highest common factor of 587817 and 594459. 3321 What is the highest common divisor of 1503650 and 15950? 1450 Calculate the greatest common factor of 3921449 and 154. 7 What is the greatest common divisor of 1542 and 4518831? 771 What is the highest common divisor of 9190464 and 1472? 64 Calculate the greatest common divisor of 1143 and 17255490. 381 Calculate the greatest common factor of 11 and 18968917. 11 Calculate the highest common divisor of 30301 and 3134191. 157 What is the highest common divisor of 7448746 and 1466? 1466 Calculate the highest common factor of 212772075 and 150. 75 Calculate the greatest common divisor of 1026 and 3127818. 114 Calculate the greatest common factor of 22011 and 45936. 957 What is the greatest common divisor of 23110353 and 252? 63 What is the greatest common factor of 756 and 888924? 12 What is the greatest common divisor of 2997 and 1408923? 333 What is the highest common factor of 45430 and 2319290? 590 Calculate the highest common factor of 457642398 and 589. 589 What is the highest common divisor of 443409 and 183? 183 What is the highest common divisor of 3232 and 98272? 32 Calculate the highest common factor of 55 and 91632035. 55 What is the greatest common divisor of 17060 and 10427925? 4265 Calculate the highest common factor of 2498350 and 725. 725 What is the greatest common divisor of 7 and 652639806? 7 What is the greatest common divisor of 24604659 and 6? 3 What is the highest common divisor of 48 and 46183376? 16 What is the highest common factor of 775029890 and 1832? 458 Calculate the greatest common divisor of 491975 and 139542. 1789 Calculate the highest common divisor of 756 and 3939714. 18 What is the highest common factor of 4219488 and 49959? 819 Calculate the greatest common factor of 4823529 and 27642. 13821 Calculate the greatest common divisor of 4578 and 6941634. 42 Calculate the greatest common factor of 3560 and 15590. 10 Calculate the highest common factor of 4061 and 12087501. 131 What is the greatest common factor of 131564959 and 7352? 919 Calculate the highest common divisor of 1277 and 22157. 1 What is the greatest common divisor of 23 and 402316? 23 Calculate the highest common divisor of 1555459 and 107. 107 What is the greatest common divisor of 112214639 and 193? 193 Calculate the greatest common d	{ "pile_set_name": "DM Mathematics" }
092o/3 - 43778/3 = 0. -7, 1, 53, 59 Solve z5 + 122z*4 + 3057z*3 + 28404z*2 + 100656z + 119232 = 0. -92, -12, -3 Let -4g2/9 - 6776g/9 - 66560/3 = 0. Calculate g. -1664, -30 Determine k, given that -k*3 - 2287676k*2 - 1308365370244k = 0. -1143838, 0 Factor -18w3 - 4208w*2 + 35784w - 7744. -2(w - 8)(w + 242)(9w - 2) Find k, given that k3/6 + k2/2 - 24k + 70/3 = 0. -14, 1, 10 Factor 3k*2 + 4218k - 38205. 3(k - 9)(k + 1415) Factor -5n4 + 15n*3 + 680n*2 + 1260n. -5n(n - 14)(n + 2)(n + 9) Factor -n*3 - 2205n*2 + 33516n + 479520. -(n - 24)(n + 9)(n + 2220) Determine x, given that x*4 + 1241x*3 - 7473x*2 + 11223x = 0. -1247, 0, 3 Let -25j4 - 17285j*3 - 3396285j*2 - 136189075j - 53933330 = 0. What is j? -319, -53, -2/5 Suppose -30m3 - 33595m*2 - 200760m - 300735 = 0. Calculate m. -6683/6, -3 Factor -4n2/5 - 3276n/5 + 17576. -4(n - 26)(n + 845)/5 Suppose -162j5 + 108j*4 + 9794j*3 + 7396j*2 - 2128j = 0. Calculate j. -7, -1, 0, 2/9, 76/9 Let 32i4 - 4144i*3 - 19230i*2 - 8836i - 1072 = 0. Calculate i. -4, -1/4, 134 Factor -2o3/21 - 4324o*2/21 + 8774o - 92568. -2(o - 21)2(o + 2204)/21 Factor 3k2/5 - 30381k/5 + 485328/5. 3(k - 10111)(k - 16)/5 Find j such that 3j2 - 1768074j = 0. 0, 589358 Factor 5d2 + 53100d + 140980500. 5(d + 5310)2 Determine r so that 2r*3/3 + 134r*2 + 4180r/3 = 0. -190, -11, 0 Suppose -3o4 - 51o*3 + 2772o*2 + 204o - 11040 = 0. What is o? -40, -2, 2, 23 Factor 4j2 - 51020j + 4106376. 4(j - 12674)(j - 81) Let -8b5 + 396b*4 - 4792b*3 - 2896b*2 + 4800b + 2500 = 0. What is b? -1, -1/2, 1, 25 Suppose y*3 + 4353y*2 - 43630y = 0. What is y? -4363, 0, 10 Determine v, given that 5v2 - 5028290v + 1264185016205 = 0. 502829 What is y in -4y5 + 853y*4 - 14701y*3 - 45866y*2 - 21772y + 8536 = 0? -2, -1, 1/4, 22, 194 Find n, given that 2n2/11 - 223100n/11 = 0. 0, 111550 Factor l*2/5 + 452258l/5 + 51134324641/5. (l + 226129)*2/5 Factor -4g*2/5 - 2904832g/5 - 2904828/5. -4(g + 1)(g + 726207)/5 Let -3c2 - 157776c - 2074438848 = 0. What is c? -26296 Factor -2o2 - 3332o - 117360. -2(o + 36)(o + 1630) Factor -q*3/7 + 93q*2/7 + 286q/7 + 192/7. -(q - 96)(q + 1)(q + 2)/7 Factor 9n3/5 + 3594n*2/5 - 3603n/5. 3n(n - 1)(3n + 1201)/5 Factor -o*4/4 - 14325o*3/4 + 128979o*2/4 - 386991o/4 + 193509/2. -(o - 3)*3(o + 14334)/4 Determine d, given that 2d3/7 + 166d*2/7 - 1424d/7 + 416 = 0. -91, 4 Factor s*2 - 101s - 19206. (s - 198)(s + 97) Find h, given that 4h*2/5 - 72896h/5 + 332114176/5 = 0. 9112 Factor -k*3/4 + 8261k*2/2 - 82585k/4. -k(k - 16517)(k - 5)/4 Solve 8x5/17 + 345306x*4/17 - 1985690x*3/17 + 3626156x*2/17 - 1726776x/17 - 690704/17 = 0 for x. -43169, -1/4, 2 Factor c*3/4 - 632c*2 - 2529c/4. c(c - 2529)(c + 1)/4 Let 2w2 + 27282w - 81864 = 0. What is w? -13644, 3 Factor -3y4 - 29811y*3 - 178794y*2 - 357540y - 238344. -3(y + 2)3(y + 9931) Factor -2k3/3 - 1142k*2/3 - 70094k/3 + 9873538. -2(k - 123)(k + 347)*2/3 Find f, given that 2f*2/13 - 41722f/13 - 375660/13 = 0. -9, 20870 Factor o*4/2 - 31o*3/2 + 67o*2 + 200o. o(o - 25)(o - 8)(o + 2)/2 Factor -2k*3 - 254044k*2 - 8067548280k - 16134080400. -2(k + 2)(k + 63510)*2 Solve 11m*5 - 1506m*4 + 2822m*3 + 1776m*2 - 2833m - 270 = 0. -1, -1/11, 1, 2, 135 Suppose i*4 + 169i*3/2 + 4281i*2/2 + 18252i + 22842 = 0. What is i? -47, -18, -3/2 Determine w, given that -6w5/5 + 19336w*4 + 644704w*3/5 + 1547424w*2/5 + 1547488w/5 + 103168 = 0. -2, -2/3, 16120 Determine u, given that 2695u5/4 + 24245u*4/4 - 6760u*3 + 25u2 = 0. -10, 0, 2/539, 1 Factor l2 + 20305l + 60906. (l + 3)(l + 20302) Factor -4c3/3 - 564224c*2/3 - 564220c/3. -4c(c + 1)(c + 141055)/3 What is r in r5/3 - 4r*4/3 - 22r*3/3 + 4r*2/3 + 7r = 0? -3, -1, 0, 1, 7 Factor 2p4/17 - 256684p*3/17 + 10981027080p*2/17 - 156585785647316p/17 - 156596766931082/17. 2(p - 42781)3(p + 1)/17 Let -2t5/5 - 108t*4 - 33788t*3/5 + 141144t*2/5 - 178754t/5 + 14388 = 0. Calculate t. -165, -109, 1, 2 Factor -w*4/4 + 9w*3/2 - 22w2 + 128. -(w - 8)2(w - 4)(w + 2)/4 Factor -4i5 + 8344i*4 - 4334676i*3 - 17438960i*2 - 17472400i. -4i(i - 1045)*2(i + 2)*2 What is o in 8o*4 + 10360o*3 + 10354o*2 + 2588o = 0? -1294, -1/2, 0 Factor c*2/9 + 223c/9 - 11050/3. (c - 102)(c + 325)/9 Factor -w4 + 25w*3 - 26w*2 - 436w - 552. -(w - 23)(w - 6)(w + 2)2 Factor -g3/6 + 425g2/6 - 847g/6 + 141/2. -(g - 423)(g - 1)2/6 Factor -4s*3 + 127624s*2 - 1017992836s. -4s(s - 15953)*2 Factor -2v*3 - 18318v*2 + 18320v. -2v(v - 1)(v + 9160) Solve 2r*2 + 560r - 15912 = 0. -306, 26 Suppose -38f2/15 + 47036f/15 + 9904/15 = 0. What is f? -4/19, 1238 Factor -r*3 + 504r*2 - 66885r + 840350. -(r - 245)*2(r - 14) Determine t so that -5t2 - 12985t + 52020 = 0. -2601, 4 Let -52y2 + 6233924y - 959064 = 0. Calculate y. 2/13, 119883 What is x in 7x2 - 1324x + 2805 = 0? 15/7, 187 Factor 2x2/9 + 1618x/9 + 20696/9. 2(x + 13)(x + 796)/9 Suppose -h*5/5 - 74h*4/5 - 279h*3/5 + 86h*2/5 + 1132h/5 + 168 = 0. Calculate h. -70, -3, -2, -1, 2 Factor 4q4 - 2216q*3 + 8800q*2. 4q*2(q - 550)(q - 4) Factor -b3 + 5414b*2 - 32457b + 48672. -(b - 5408)(b - 3)2 Factor 4t*2 - 25244t + 377760. 4(t - 6296)(t - 15) What is c in 2c2 - 1474c + 13104 = 0? 9, 728 Factor -v*4 + 41v*3 + 542v*2 + 1560v. -v(v - 52)(v + 5)(v + 6) What is v in 6v*5 + 31046v*4/5 + 1584054v*3 - 58059198v*2/5 + 7600348v/5 = 0? -521, 0, 2/15, 7 Suppose -2p5/11 - 4944p*4/11 - 3070194p*3/11 - 18302668p*2/11 - 36526392p/11 - 24324624/11 = 0. Calculate p. -1233, -2 Let -24j5 - 1168j*4 + 88006j*3/3 - 29042j*2/3 + 804j = 0. Calculate j. -67, 0, 1/6, 18 Suppose -12810w3 - 12830w*2 - 6445w/2 - 5 = 0. What is w? -1/2, -2/1281 Factor -2l3/5 - 152l*2 - 62216l/5 + 1958592/5. -2(l - 24)(l + 202)*2/5 Determine m so that 2m*3/7 + 690m*2/7 + 18958m/7 + 2610 = 0. -315, -29, -1 Solve -15h3 - 3820h*2 - 11325h = 0 for h. -755/3, -3, 0 Factor 2i2/5 - 336524i/5 + 14156050322/5. 2(i - 84131)2/5 Let -5y*5 - 2520y*4 - 10030y*3 - 15020y*2 - 10005y - 2500 = 0. What is y? -500, -1 Factor -3g2 - 264108g - 5812752972. -3(g + 44018)2 Factor -3d*3 - 1707d*2 + 63318d - 61608. -3(d - 34)(d - 1)(d + 604) Factor 4x*4/9 + 13864x*3/9 + 4009004x*2/3 + 24012448x/9 + 11999296/9. 4(x + 1)2(x + 1732)*2/9 Find k, given that -3k*3/5 + 519k*2/5 + 39258k/5 + 216216/5 = 0. -52, -6, 231 Factor 5207i3 - 31244i*2/3 + 4i/3. i(i - 2)(15621i - 2)/3 Solve -s5 - 12s*4 + 75s*3 + 182s*2 + 96s = 0. -16, -1, 0, 6 Determine y so that -y*4/2 - 3700y*3 + 14803y*2/2 - 3701y = 0. -7402, 0, 1 Factor 3y2 + 60630y - 60633. 3(y - 1)(y + 20211) Solve 4o5/7 - 152o*4/7 + 968o*3/7 - 16o*2 - 3756o/7 - 360 = 0 for o. -1, 3, 7, 30 Let c*4/4 - 122741c*3/4 - 368229c*2/4 - 368231c/4 - 30686 = 0. What is c? -1, 122744 Find k such that -2k2 - 21784k + 108970 = 0. -10897, 5 Let -34s3 - 2597s*2 - 986s + 152 = 0. What is s? -76, -1/2, 2/17 Factor m*4 - 5228m*3 + 6916132m*2 - 217317504m + 1727898624. (m - 2598)*2(m - 16)*2 Factor -2j*2/9 - 9232j/9 + 46210/9. -2(j - 5)(j + 4621)/9 Suppose u*2 + 5755u - 138696 = 0. Calculate u. -5779, 24 Determine m so that 2991m4/5 - 8967m*3/5 + 5964m*2/5 + 12m/5 = 0. -2/997, 0, 1, 2 Let 2y4/7 + 296y*3/7 + 10470y*2/7 - 34128y/7 = 0. Calculate y. -79, -72, 0, 3 Solve 2o2/3 + 672392o + 169541625624 = 0. -504294 Suppose y*3 + 706y*2 - 709y - 1414 = 0. What is y? -707, -1, 2 Find c, given that 3c5/5 - 48c*4/5 - 10536c*3/5 + 350208c*2/5 - 1715472c/5 = 0. -66, 0, 6, 38 Find o, given that 6084o3 + 182364o*2 - 191840o + 49600 = 0. -31, 20/39 Find g, given that -g*5 - 73g*4 + 1020g*3 = 0. -85, 0, 12 Find k such that 3k*4 + 17973k*3 + 26945988k*2 + 80604468k - 107568432 = 0. -2994, -4, 1 Find q such that -2q4 - 8148q**3 -	{ "pile_set_name": "DM Mathematics" }
f 9/18 - 1326/(-4)? 2, 83 Let h(z) be the first derivative of -z4/2 + z3/3 + z*2 - 10z - 8. List the prime factors of h(-4). 2, 3, 7 Let r = -139 + 611. What are the prime factors of r? 2, 59 Suppose -v - 16 = 23. Let p = -37 - v. Suppose 2a - k - 48 = 0, -3a - 3k = -pk - 67. What are the prime factors of a? 23 Let m = 1081 - 27. List the prime factors of m. 2, 17, 31 Let z(k) = -4k + 1. Let q(t) = -t. Let y(u) = -u + 9. Let r be y(8). Let v(h) = rz(h) + q(h). What are the prime factors of v(-1)? 2, 3 Let q(l) = 2l - 45. Let r be q(24). Suppose 0 = rn + 9, 0 = -4b - 5n + 329. What are the prime factors of b? 2, 43 Suppose -7p = 2p - 117. Suppose -pm = -6m - 1806. List the prime factors of m. 2, 3, 43 Suppose 2w - 4w = 3v - 3699, -4v + 4932 = -4w. What are the prime factors of v? 3, 137 Let o = 6172 - 2283. List the prime factors of o. 3889 Suppose 6 = 11g - 14g. Let y be (-1035)/(-25) - g/(-5). Let p = y - 23. List the prime factors of p. 2, 3 Let t = 864 + -589. Suppose t = 8h - 4h + l, -4h + 290 = -2l. What are the prime factors of h? 2, 5, 7 Suppose 3u + 2x = 584, -4u + 556 = -u - 5x. List the prime factors of u. 2, 3 Let q be 3 - 04/12. What are the prime factors of (-5)/(115/(-38) + q)? 2, 5, 19 Suppose 0 = -3b - 0j - 2j + 11, j = 3b - 17. Suppose -2 - 18 = -bu. Suppose 0 = -ur + 3r + 14. List the prime factors of r. 2, 7 Let h = 1173 + -602. List the prime factors of h. 571 Suppose 190 + 2802 = 4g. What are the prime factors of g? 2, 11, 17 Suppose 2q - 14 = -2x, -30 = -2q - 4x - 10. Suppose 3g + qh - 210 = 0, -g + h - 21 = -91. List the prime factors of g. 2, 5, 7 Let x(h) = -h*3 + 9h*2 - 5h - 7. Let z be x(7). Suppose 5k - 4r + r - 140 = 0, 5r = 2k - z. Suppose -k = -2i - 8. What are the prime factors of i? 2, 5 Suppose 13u = 7u + 18. Suppose ug + 0g - 395 = 5r, 3r = g - 129. List the prime factors of g. 3, 5 Suppose 0 = 4k + 5c - 6 - 4, -4 = -2k - 3c. Let y(u) = -u2 + 15u - 5. What are the prime factors of y(k)? 3, 5 Let p = 1692 + -706. What are the prime factors of p? 2, 17, 29 Let r be (45/20 - 2)8. Suppose -ro = -5o + 96. List the prime factors of o. 2 Let t = -33 + 48. Let g = t + -7. Let l(i) = i3 - 8i*2 + 4i + 1. What are the prime factors of l(g)? 3, 11 Let m = 670 - -525. What are the prime factors of m? 5, 239 Let s be 2/(-7) + (-256)/(-14). Let k(v) = v*3 - 14v*2 + 4v - 35. Let t be k(14). Suppose tg - 39 = sg. List the prime factors of g. 13 Let m = -310 - 152. List the prime factors of (m/(-9))/(12/18). 7, 11 Let r(t) be the first derivative of 2t3/3 - 4t*2 - 2t - 7. List the prime factors of r(6). 2, 11 Suppose -39l = -121771 - 17420. List the prime factors of l. 43, 83 Suppose 9b = 10b - 291. List the prime factors of b. 3, 97 Suppose 5f = 5437 + 5683. What are the prime factors of f? 2, 139 Suppose -2f - 1 = -w + 7, -5w = -2f - 32. Let l = w - 1. What are the prime factors of l? 5 What are the prime factors of (2 - 5)/(-3)(7 - -1814)? 3, 607 Suppose -x - o = 0, 10 + 5 = 3x - 2o. Suppose xs + 33 = 5w - 2w, 4s + 20 = w. Suppose 5d - w - 91 = t, -5d + 98 = -2t. List the prime factors of d. 2, 5 Let v = 237 + -416. Let l = v + 275. What are the prime factors of l? 2, 3 Let y(l) = -21l - 12. Let k be y(-11). Let j = 133 - k. What are the prime factors of j(-1)/2 - -2? 3, 5 What are the prime factors of -1 - (-5170)/26 - 36/(-234)? 2, 3, 11 Suppose -4c - 2193 = -5o, 3o + 4c - 1554 = -219. List the prime factors of o. 3, 7 Suppose 2b - 4 + 0 = 0. Let y(d) = -db + 22 + d3 - d + 0d3 + 0d*3. List the prime factors of y(0). 2, 11 Suppose -10y + 9 = -y. Suppose -y = h, -55 + 12 = -4c - h. What are the prime factors of c? 11 Suppose 3w - 673 = -4h + 4476, -2w + 6438 = 5h. What are the prime factors of h? 2, 7, 23 Let h(j) = j3 - 4j*2 - 5j - 6. Let v be h(5). Let s(r) = 3r2 + 6r - 6. What are the prime factors of s(v)? 2, 3, 11 Let o(a) = -4a + 5. Let i be o(-2). Let c be -22/(-8)22. Let z = i + c. What are the prime factors of z? 2, 3 Suppose s = 3s - 12. Suppose -2n + sn - 332 = 0. Let z = -52 + n. List the prime factors of z. 31 Let p(m) be the third derivative of -m*4/12 - 11m*3/6 - 3m*2. Let f be p(-8). Suppose 8 = -fj + 9j. What are the prime factors of j? 2 What are the prime factors of 675/54(1 - -39)? 2, 5 Let b(f) = 10f - 60. What are the prime factors of b(9)? 2, 3, 5 Let p = 74 + -1. Suppose -6n + 29 = -p. List the prime factors of n. 17 Let k(p) = p*3 + 3p*2 + 2p + 179. What are the prime factors of k(0)? 179 Let y be 1953/33 + (-6)/33. Let o = y + -43. List the prime factors of o. 2 Let p(m) = 3m2 - 2m - 3. Suppose -5j = -20, -3z - 2j + 5j = -3. Suppose -13 + 3 = zs. What are the prime factors of p(s)? 13 Let h(v) = v3 + 5v*2 + 4v - 1. Let j be h(-4). What are the prime factors of (1 - (-1 - j))/((-7)/(-329))? 47 List the prime factors of ((-9)/(-2) + -5)-114. 3, 19 Let z = 3 + -3. Suppose -2p + 54 + 36 = z. Suppose -5 = 2d - p. What are the prime factors of d? 2, 5 Suppose 6 = -3k, -4o + 36 + 104 = -2k. List the prime factors of o. 2, 17 Let h = -66 + 386. Let s = 478 - h. List the prime factors of s. 2, 79 Let p be 1/(-5) + (-63)/(-15). Suppose 10 = 2a + 4d - 118, -3d - 300 = -pa. What are the prime factors of (a/30)/(3/10)? 2 Let w(n) = n*2 - n. Let i(g) = 4g*2 - 13g + 4. Let r(m) = -i(m) + 3w(m). Suppose c - 6c + 40 = 0. What are the prime factors of r(c)? 2, 3 Suppose -13m - 3910 = -2c - 9m, -4c - 4m = -7844. What are the prime factors of c? 3, 653 Let x(a) be the second derivative of a5/20 + 2a*4/3 + 2a3/3 + a2 + 8a. List the prime factors of x(-7). 23 Let j(q) = -2q + 4. Let r be j(-1). Suppose -rg - 4 = -700. List the prime factors of g. 2, 29 Suppose 0 = -5q + 5f + 5445, 4q - 3f - 4350 = -5f. List the prime factors of q. 2, 17 Let g(d) = d*2 + 7d + 11. Let z be g(-9). Let y be (-6)/(-12)148 + -5. Let l = y - z. List the prime factors of l. 2, 5 Suppose 25l - 145 = 20l. Let n = 115 - l. What are the prime factors of n? 2, 43 Suppose -4h + 19 = l, -h = h - 5l - 15. Suppose -hv + 2j = 17 - 165, 3v = -j + 91. List the prime factors of v. 2, 3, 5 Let n(q) = q*3 + 11q*2 - 8q - 32. Suppose -k - 20 = -9. List the prime factors of n(k). 2, 7 Let r(h) = h*2 - 11h + 22. Let d be r(9). Suppose -2c = db - 254, -2c = 5b + 2c - 319. List the prime factors of b. 3, 7 Let u(m) = m - 12. Let a be u(3). Let x be (-1)/(-2) - a/2. Suppose xf - 81 = h, -3h - 5 = -2f + f. What are the prime factors of f? 17 Suppose -25 = -18z + 23z. Suppose -7p + 15 = -2p. List the prime factors of 3(3 - z/p). 2, 7 Suppose -7p + 9p - 4c - 3312 = 0, -3p + 4943 = -c. What are the prime factors of p? 2, 823 Let d(z) be the first derivative of -3z*2/2 + 9z - 9. Let b be d(4). What are the prime factors of (-665)/(-20) - b/4? 2, 17 List the prime factors of (54/12)/((-30)/(-2720)). 2, 3, 17 Suppose 2i - 808 = -w, -2w - 7i + 9i = -1604. List the prime factors of w. 2, 3, 67 Let v = 30 - 46. Let f = 6 - v. What are the prime factors of 429/f(-4)/(-6)? 13 Let t(q) = 55q + 8. Let x be t(1). Suppose -510 = -xc + 60c. List the prime factors of c. 2, 5, 17 Suppose j - 6 = 4h, -2h - 1 = 1. Let t(i) = 8 + i*2 - 3i2 + ij - 8i. What are the prime factors of t(-6)? 2, 5 Let f = 31 - 27. Suppose -h + 46 = 4s - 2s, -fs - 4h = -100. Let x = s - 8. List the prime factors of x. 13 Let n(g) = 21g - 140. Let b be n(8). Let r = 0 - -1. Let t = b - r. List the prime factors of t. 3 Suppose 0 = 62j - 68j + 4422. What are the prime factors of j? 11, 67 Let w(y) be the third derivative of -31y4/12 - y3/3 + 2y*2 + 21y. Let l be 3/(-5) - 4/10. List the prime factors of w(l). 2, 3, 5 Let c(u) = -10u + 12. Let f(y) = -8y + 12. Let w(z) = 6c(z) - 4f(z). List the prime factors of w(-5). 2, 41 Let n = 34 - 65. Let i = n + 36. What are the prime factors of i? 5 Let u be 4/(-14) + 612/84. Let q = u - -58. List the prime factors of q. 5, 13 Suppose 0 = 3h + 1 - 10, -y - 86 = h. Let a = y + 193. What are the prime factors of a? 2, 13 Suppose -3h - 279 = -6*h. List the prime factors of h. 3, 31 Let h(w)	{ "pile_set_name": "DM Mathematics" }
, -144? 3 Which is the closest to 0? (a) -1/8 (b) 2.1 (c) -0.2 (d) 1/3 a Which is the closest to 2/13? (a) 0.3 (b) -12/13 (c) 3/2 (d) -3/2 a What is the nearest to 1/3 in 0.4, 2/49, 2, -1/4? 0.4 Which is the closest to 2? (a) 1 (b) 0.8 (c) 2/3 (d) -0.4 a What is the closest to -1 in -1, -1/5, 2, -0.6? -1 What is the closest to 3 in 0.4, -0.2, 2, -1/6? 2 Which is the closest to 1/7? (a) -6/13 (b) -0.1 (c) -0.2 b What is the nearest to -7/4 in 1/2, 12, 16? 1/2 What is the closest to -11 in -2/7, -13, 0.4, -3? -13 Which is the nearest to 0.1? (a) 7 (b) -2 (c) 2/9 c What is the closest to -9 in 0.5, 0.4, 11, 2? 0.4 What is the closest to 3 in -0.1, 0, -116, -1? 0 What is the nearest to 0.1 in -1/62, -2, -0.1, 0.1? 0.1 Which is the closest to -2/3? (a) 1/7 (b) -30 (c) -1 (d) -14 c What is the closest to -5/6 in -2, 3, -1? -1 What is the nearest to 21.8 in 0.4, 0.5, -0.4? 0.5 What is the nearest to -50 in 2, -0.29, -1, -4? -4 What is the nearest to 0 in 1/3958, -1/2, 3/7? 1/3958 Which is the nearest to 2/9? (a) -0.4 (b) -12 (c) -0.5 (d) 5 a Which is the nearest to -1? (a) -0.3 (b) 2/15 (c) -2 (d) 0.1 a Which is the closest to 0? (a) -0.11 (b) 3 (c) -0.2 (d) -7/5 a Which is the nearest to 1/4? (a) 0.03 (b) -5 (c) 2 a Which is the closest to -90? (a) -0.5 (b) 1 (c) -1/4 a Which is the nearest to -20? (a) 2 (b) -4 (c) -0.5 (d) -3/4 b What is the closest to -1 in -7/2, 0.2, -3? 0.2 Which is the closest to -0.1? (a) 164/3 (b) 3 (c) 1 c What is the nearest to -256 in -4/7, -0.5, 2/3? -4/7 What is the nearest to -1/4 in 8, 2/17, 1/7? 2/17 What is the nearest to 10 in 2, 1/3, -3? 2 Which is the closest to -1? (a) 0.4 (b) -1/11 (c) 0.21 b Which is the nearest to 1/4? (a) -3 (b) 5 (c) 1 (d) -4 c Which is the nearest to 1? (a) 5 (b) 6.3 (c) -15 (d) 0 d Which is the closest to -2/9? (a) 20 (b) 1 (c) -2/5 (d) 2 c What is the closest to -2 in 2/5, 0, -2, -1/2? -2 What is the closest to 0.1 in 2, 0, -2, -0.2? 0 Which is the closest to -3? (a) 3 (b) -6 (c) -0.04 c Which is the nearest to 2/3? (a) 2/5 (b) 0.53 (c) 0 (d) 4 b Which is the nearest to -0.4? (a) 0.2 (b) 5 (c) -1/4 c Which is the nearest to -2/9? (a) 1/5 (b) 3 (c) -0.7 a Which is the closest to 0? (a) 4 (b) -1.4 (c) -3 (d) 2/11 d Which is the closest to -1? (a) -1 (b) -0.78 (c) -35 a Which is the closest to 77? (a) -2/7 (b) -5 (c) 5/4 c What is the closest to -1/4 in 2, -1/51, -0.5? -1/51 What is the nearest to -2/5 in -3, 0, -1/5, 4? -1/5 What is the nearest to 0 in -1, -3, -2, -44? -1 What is the nearest to 0.4 in 2, 27, 0.5, 8? 0.5 What is the closest to 1 in -0.3, -0.2, 5? -0.2 What is the nearest to -0.3 in -2, 2, 17, 0.3? 0.3 What is the nearest to 0 in 1.9, 0.5, 2/61? 2/61 Which is the nearest to -1? (a) -2/9 (b) 11 (c) 0.3 (d) -3 a Which is the nearest to 0.2? (a) -4/7 (b) 0.5 (c) 5 (d) 1/3 d What is the nearest to -17 in 4, 0, -1/6? -1/6 Which is the nearest to -1? (a) 2/295 (b) -2/3 (c) -3 b Which is the closest to 1/2? (a) 1.4 (b) 0 (c) -10/9 b What is the closest to 1 in -1/7, 1, 17, 2/3? 1 What is the nearest to 1/4 in -1/6, 0.3, -2/7, -4? 0.3 What is the nearest to -3/7 in -14, 4, 7? 4 What is the nearest to 10 in -0.2, 7, 1.3? 7 Which is the nearest to 3? (a) -0.21 (b) 1/4 (c) 0.2 (d) 0.4 d What is the closest to -9/8 in -3, -2/3, 4? -2/3 Which is the nearest to -13? (a) -2/3 (b) 2/3 (c) -0.1 (d) 0.5 a What is the nearest to -6 in 3/7, 1/5, 5? 1/5 What is the closest to -2 in -55, -5, -0.4? -0.4 What is the closest to 59/3 in -2/13, -2, 6? 6 What is the nearest to 0 in 2/3, -1/5, 1, 1.2? -1/5 What is the nearest to -1/4 in 7/3, 5, -0.5? -0.5 Which is the closest to -6? (a) 1/6 (b) -1 (c) -1/9 (d) 0.4 b Which is the closest to -1/5? (a) -0.2 (b) -2/7 (c) 11 (d) 8 a Which is the nearest to 0.1? (a) 4 (b) 3 (c) 5 (d) 0.5 d What is the nearest to -0.09 in 1/5, 1/4, 3, 9? 1/5 What is the closest to -1 in 0.5, 18, 3? 0.5 What is the closest to 47 in 1, 2, -0.5? 2 Which is the closest to 0.2? (a) 4 (b) -1 (c) 8 (d) 2/11 d Which is the closest to -8? (a) 1 (b) 5 (c) -0.4 c What is the nearest to 0.1 in -187, -4, 5, -0.1? -0.1 Which is the nearest to -0.4? (a) 0.2 (b) 19 (c) 0 c Which is the nearest to 0.3? (a) -5 (b) 1/7 (c) -6/5 (d) 1 b What is the nearest to 11 in 5, 0.4, -5, -4/9? 5 Which is the closest to -1023? (a) -5 (b) -0.4 (c) -1 a What is the closest to -2 in 5, 9/4, -10? 9/4 What is the nearest to 425 in -2, 0.5, -2/13? 0.5 What is the closest to -426 in 2/5, -1/4, -1, -6? -6 What is the nearest to 2/5 in 7, 1/6, 0, 0.2? 0.2 Which is the closest to -1? (a) 4/31 (b) 12 (c) 0.07 c Which is the closest to -2? (a) 3 (b) 1 (c) 5 b What is the nearest to -9 in 0.04, -1/3, -3, 2/5? -3 Which is the nearest to 0? (a) 0.2 (b) -2 (c) 5/8 a Which is the closest to -2/7? (a) -5 (b) 3 (c) -67 b Which is the nearest to -1? (a) -3/4 (b) 2/5 (c) 0 (d) 8 a Which is the closest to -3? (a) 0.4 (b) -4 (c) -4/7 (d) 0.2 b What is the closest to 0 in 3, -0.2, -2/7, -11? -0.2 Which is the nearest to 0.1? (a) -0.07 (b) 4/3 (c) 0 c What is the closest to 0.3 in -2, 1/5, -0.5, 3/5? 1/5 What is the closest to -8 in 218, -5, -1/3? -5 What is the nearest to 0 in 0.3, 0.7, 2, 3/4? 0.3 Which is the closest to -263? (a) -4 (b) 1/5 (c) 5 (d) 3 a Which is the nearest to -2? (a) 0 (b) -5/3 (c) 297 (d) -3 b Which is the nearest to -2? (a) 4/5 (b) 0 (c) -1/11 c Which is the closest to 0? (a) 4 (b) -5 (c) 3 (d) -32 c Which is the closest to 0? (a) 1 (b) -0.17 (c) -3/22 (d) 3 c What is the nearest to 64 in 4, 1/3, 2? 4 Which is the nearest to -2/5? (a) 2 (b) -3 (c) -0.5 (d) -5 c Which is the nearest to 1/3? (a) -5 (b) -4/27 (c) 2/7 (d) -2/7 c What is the nearest to -11 in -3, -5, -1/7, -25? -5 Which is the nearest to -11? (a) -10 (b) -0.5 (c) -3 a Which is the nearest to 1? (a) -3 (b) 32 (c) 4 (d) -6 c Which is the closest to -1.39? (a) -3 (b) 2 (c) -2 c Which is the closest to -0.05? (a) 3.5 (b) -2 (c) -0.2 (d) -2/15 d Which is the closest to -174? (a) 2.4 (b) -0.3 (c) 0.1 b What is the closest to 355 in -0.5, -5, -1/3? -1/3 What is the nearest to 17 in 2, -2/5, -5? 2 Which is the nearest to -4/15? (a) 0.4 (b) 0.2 (c) 3 b Which is the nearest to -2/13? (a) -1 (b) 360 (c) 4 a What is the closest to 3 in 0.2, -1/3, 5, 32? 5 Which is the closest to 2/9? (a) -3 (b) 0.3 (c) 1.4 (d) 1 b What is the closest to -6 in -0.5, 20, 2/5, 18? -0.5 What is the closest to 4 in -0.2, 2, -4/85? 2 What is the closest to 2/5 in -0.1, -7, -1/7, 3? -0.1 What is the nearest to 2/5 in 370, 3/2, -2/9? -2/9 Which is the closest to -1/4? (a) -2/43 (b) -3 (c) 43 a Which is the nearest to 19? (a) 2/13 (b) 1/3 (c) 2/3 c Which is the closest to -1? (a) 13 (b) 2/5 (c) 0.3 (d) 4 c Which is the nearest to -8/25? (a) -0.3 (b) 0.4 (c) -0.4 (d) 0 a What is the nearest to 1 in 2/5, 1/7, -0.1, -0.45? 2/5 Which is the closest to -0.1? (a) 1/10 (b) 4.4 (c) 1 (d) 1/3 a Which is the closest to -2? (a) -7 (b) -6/11 (c) -0.5 (d) -4 b What is the nearest to 1 in -0.5, 13, -7, -14? -0.5 Which is the nearest to 1? (a) -0.2 (b) -3 (c) 16/5 (d) -4 a Which is the nearest to 1.2? (a) 3/2 (b) -1/2 (c) 120 a What is the nearest to 0.07 in 0.3, -4/7, 0.1, -0.2? 0.1 Which is the closest to -1? (a) -2/3 (b) -3/2 (c) 78/37 a Which is the closest to -6? (a) 2 (b) -3.9 (c) -0.9 b Which is the nearest to 1/4? (a) 0.5 (b) -3 (c) 1/14 c What is the closest to -2/9 in -0.3, -0.4, -0.2, -22? -0.2 What is the closest to -0.1 in 6/25, -5/3, -1/13, -1/5? -1/13 Which is the closest to 4? (a) 0 (b) 2 (c) -4/3 (d) -5 b Which is the closest to -2/9? (a) 1.2 (b) 1.3 (c) -3 (d) 2/5 d What is the nearest to -0.1 in 1/2, -0.2, 0.2, 1.9? -0.2 Which is the nearest to 9? (a) 4 (b) 3 (c) 1 a Which is the closest to 3? (a) 0.1 (b) -2/9 (c) 0.3 c Which is the nearest to -0.32? (a) -2 (b) 0.4 (c) -7 b What is the closest to 1 in 1, -1.53, 2/11? 1 Which is the closest to 0.1? (a) -2/15 (b) -2/9 (c) -0.3 (d) 3 a What is the nearest to -2/13 in -5, 3, 39/11? 3 Which is the nearest to -2/9? (a) 3 (b) 2/13 (c) -0.5 (d) 5 c Which is the ne	{ "pile_set_name": "DM Mathematics" }
(nn1)/n)(1/35)/((nn(-1/4)/n)/n)(4/3))(5/6) assuming n is positive. n(89/63) Simplify v*(5/4)/(vv/v*(2/3)vv)(v/(v/(vv/v(-1/8))))9 assuming v is positive. v(409/24) Simplify (h(-34)/(hh*(-3/13)))/((hh(h/(hh*(-30)h)h)/h)/hh(5/9)) assuming h is positive. h(-7643/117) Simplify (x(-1/28)/((x(-10/3)x)/x))/((x/(x(-14)x))/x)(39/5) assuming x is positive. x(-41203/420) Simplify (q/((q/(q/(qq/(qq*(2/5)))q))/q))*18(q/q(-4))(20/7) assuming q is positive. q(2012/35) Simplify (h/(h1/h))(-39)/((h/h(-3))/(h/h(-5))) assuming h is positive. h(-37) Simplify (zz/(z(1/15)z)(zz*(-26/5))/zz)/(z/z*(-14/3)zzzz(2/7)) assuming z is positive. z(-1283/105) Simplify ((lll(-7)l)/l)(-4/9)/((l(3/25)l)/(ll/(l(l(-2/5)/ll)/ll))) assuming l is positive. l(563/225) Simplify (p/(p(-12)/p))/p5(p/((p/p1)/p))/p(-1/4) assuming p is positive. p(45/4) Simplify (((u(-1))(3/5))(-12/13))(10/7) assuming u is positive. u(72/91) Simplify (mm/m(-9)mm/(m/(m(-1/15)/mm)m)(mm2)(-11))(-7/10) assuming m is positive. m(2317/150) Simplify (w/(ww/w*(-2/23)w)w(-1/8))/((w/(ww*(-2/29)w))/(w/w0)) assuming w is positive. w(-1499/5336) Simplify ((d(-6/7)/d)/d)40/(d(-5/4)/d(-9)) assuming d is positive. d*(-3417/28) Simplify ((mm/(m/(m/((m/m*9m)/m)))m)/m(-5/2))/(m(-2)/mmm)(-41) assuming m is positive. m(-55/2) Simplify (l(-8/11)lll/l1)/(l38l/(ll17)) assuming l is positive. l(-217/11) Simplify (y*(-15)/yy/(y/(y(y4/y)/yy)))/(y/y(-8/7))49 assuming y is positive. y(-117) Simplify b(-3)/((bb(-14))/bb)((b(-9/2)b)/b)(-26) assuming b is positive. b127 Simplify d/d*(-13/5)((dd(-5/3)d)/d)/dddd3/(d(d/d(-1/9))/d) assuming d is positive. d(262/45) Simplify d*8d*(-14/9)/dd*6dd/(dd*(-9))dd assuming d is positive. d(211/9) Simplify ((yy/(y*(-7/8)/y)y)(-29))(-4/19) assuming y is positive. y*(1131/38) Simplify (zz*0/zz)*9(zzzz(-3)z)/(zz9) assuming z is positive. 1 Simplify (j/(j(-2/3)/j))/(j/j(-31))j*5jj28 assuming j is positive. j(14/3) Simplify (m(mm/(m(-2)m))/m)*10m4/(m/(m6m)) assuming m is positive. m40 Simplify aaaa*15aa(4/17)a*10a(-21) assuming a is positive. a(140/17) Simplify ((w10)(-5/9))50 assuming w is positive. w(-2500/9) Simplify (((u/(uu/(u(-14)/u)u))/uu)/uu*(3/4))/(u/(u(u/u*(-10))/u)uu(-7)) assuming u is positive. u(-5/4) Simplify p(2/3)/((p(pp(-2/13))/p)/p)((ppp*(6/11)/p)/ppp)/(p(7/3)p) assuming p is positive. p(14/429) Simplify (d(-3/4)d)(-10)(d/(d*0d))(-37) assuming d is positive. d(-5/2) Simplify (b10/b)/(b(-8)b)(b(3/2))42 assuming b is positive. b*79 Simplify ((h/(hh15))/h(-2/29))/((h(-1/8)/h)/h(-3/4)) assuming h is positive. h(-3377/232) Simplify ((((n32/nn)/nn)/nn)/nnn(-32))/(n(-2/13))50 assuming n is positive. n(100/13) Simplify n(-2)n*(-12/5)(nn1/n)40 assuming n is positive. n(178/5) Simplify ((((z/z(-18))/zz)/(z/(((zz/(zz20))/z)/z)))33)(4/7) assuming z is positive. z(-396/7) Simplify ((((aa/(((aa/a*(-5))/a)/aa))/aa)/a)/a)(-24/7)/(a(-3/4)/a(-5)) assuming a is positive. a(457/28) Simplify ((x0/x7)/((xx*(-3/8)x)/((x/x3)/x)))(-48) assuming x is positive. x*558 Simplify (m/(mmm(-2/9)mmm))/mm(-27)m*8/mmm(-5/4) assuming m is positive. m(-901/36) Simplify ((g/((g/(g/g(-3)))/g)g4)35)(-28) assuming g is positive. g(-8820) Simplify (vv16)(-7/5)/(v20)34 assuming v is positive. v(-3519/5) Simplify (((k(k/((kk(2/3))/kk))/k)22)(-15/7))(-32) assuming k is positive. k(-7040/7) Simplify ((vv28v)/v(-4/5))/(v(-3))(-1/4) assuming v is positive. v(601/20) Simplify ((j/(j/((j/j*(-11))/jj)))/j*(-29))/((jj*(-1/40)j)/((j*(-15)/j)/jj)) assuming j is positive. j(921/40) Simplify (x(1/4))*(-3)(x10)2 assuming x is positive. x*(77/4) Simplify (((y/(yy(2/5)))(-41))(-35))(-48) assuming y is positive. y27552 Simplify ((((r(4/5)r)/rr)/r)/rr)(-7)/(r(-4/13)rrr*(-6)r) assuming r is positive. r(-149/65) Simplify t/t2tt*(-4)(ttt(1/8))(-40) assuming t is positive. t(-89) Simplify (d/(d(-2/3)/d)d(2/27))(36/7) assuming d is positive. d(296/21) Simplify (r4rrrr(7/3)r)/(r/((rr(7/5)r)/rr)r4) assuming r is positive. r(131/15) Simplify (x(-6)/x)41(x(-11)x)(-6/17) assuming x is positive. x(-4819/17) Simplify ((j1)33j3/jj(2/9))(1/4) assuming j is positive. j(317/36) Simplify (k(-4/3)k(-9/4))/(kkk(-5))(-1/15) assuming k is positive. k(-227/60) Simplify (t(3/10)/(ttt36tt))/(t(9/8)t(2/5)) assuming t is positive. t(-1649/40) Simplify ((f/f*4ff/(f(ff(2/7)/f)/f))/(f(1/7)/f(2/5)))(1/94) assuming f is positive. f(-18/1645) Simplify (p(-1/33)/((p/p(13/2))/p))/(p13(p(-20)/p)/p) assuming p is positive. p(1021/66) Simplify (k/(k*(3/4)k)k/(k(2/7)/k))/((k/(k/k(-7/2)))/(k/(k/(kk/(kk(-16)))))) assuming k is positive. k(601/28) Simplify (h/(h/(hh*(1/17))))/hhhh/((h/h*(-1/44))/h)hh(h*(-5/8)h)(3/19) assuming h is positive. h(144829/28424) Simplify ((m(2/3))1/(m(mm*(-2/7))/mmm)(-47))(-2/11) assuming m is positive. m(-5386/231) Simplify ((hh(h/h(-12)h)/hhh)/h(-3/10))/(h(2/3)h(1/9)/h) assuming h is positive. h(1577/90) Simplify ((z/(z/(z(-3/2)z))zz)/z(8/9))(1/47) assuming z is positive. z*(11/846) Simplify ((oo/(o(o(-2/5)o)/oo)o)(-2/105)/(o(1/11)/o(-2)))(24/7) assuming o is positive. o(-13976/1925) Simplify (o2)*22((o/o*(-1/3)o)/o)/(o/o(-1/4)) assuming o is positive. o(529/12) Simplify (i/((i*(-3/10)/i)/i)i/(i/(ii(3/10)))(i/(i6/i))/i(-5/4))(-2/89) assuming i is positive. i(-37/890) Simplify ((m*(-3/5)m)/m*(2/9)m/(m/(mmm*(-2)/m))m(2/7)/m)(38/7) assuming m is positive. m(-18392/2205) Simplify (i1/(i*(-4/7)i))/(i(2/5)/i)(-50) assuming i is positive. i*(-206/7) Simplify p/((p/(pp/((pp12)/p)))/pp)p(-6)p/p*(-8)p/p(-2/21) assuming p is positive. p(-124/21) Simplify ((z/z*(1/6))/(zz(-5/6)))/((z/(((z(1/18)z)/z)/z))/(z(6/11)z)) assuming z is positive. z(53/198) Simplify (j12jjj(-1/5))/(j1/j)(-21/8) assuming j is positive. j(69/5) Simplify (k(-1/11)k(k/k(3/8))/kk(k/((k(4/9)/k)/k))/k(-1))(2/29) assuming k is positive. k(139/396) Simplify ((q0q)*(-24/7)q/((q/(q/((q/q*(-1/7))/q)))/q)((q/q*1)/qq)/qq)(2/185) assuming q is positive. q(-22/1295) Simplify (h(-4/5))(-3/10)(h/h(-5))(-8/11) assuming h is positive. h(-1134/275) Simplify x/((x/(((x/(x/(x/x1)))/x)/x)x)/x)x*(2/9)x/x*(2/37)xxxx(-10) assuming x is positive. x(-2608/333) Simplify (h(-13))(3/4)/((hh*0h)/h)36 assuming h is positive. h(-183/4) Simplify (c*(1/4)c(c/c(-2/13))/cc(c/(cc/c*(4/7)c)c)/((c(-5)c)/c))(3/7) assuming c is positive. c(7617/2548) Simplify (y(1/5)/y)(6/11)y(-37)/(y/((y/(y14/y))/y)yy) assuming y is positive. y(-2939/55) Simplify (h11)17h(1/3)/h(-11) assuming h is positive. h(595/3) Simplify f(-20)/f(ff*(-2/75)f)/f(f(-2))(-3/20) assuming f is positive. f(-2959/150) Simplify (p2p(-11/2)/p)/(p(-6)pp(1/4)) assuming p is positive. p(1/4) Simplify (j/j*(-1/6)(jj(-3))/j(jj(-1))(-1))22 assuming j is positive. j(-121/3) Simplify ((p(1/7)p/(pp/(p/(p/p(-1/2)))p))26)(-50) assuming p is positive. p*(21450/7) Simplify (((q/(qq14))/q)/(q/(q/(q/q(7/6)))qq))/(q*(-8)qq/(qq*(3/11)q)) assuming q is positive. q*(-565/66) Simplify ((mmm(2/35))/m)/(m/m8)(m/m*(-2/27))/(mmm(-2/21)) assuming m is positive. m(6829/945) Simplify (w(-3/8))(-5/2)ww(-17)w(-9/4) assuming w is positive. w(-277/16) Simplify (((v/v(-3))/v)/v18)/((vv/v(-3/7)v)/(vv(-8/5)v)) assuming v is positive. v*(-631/35) Simplify ((qq*(-3)q)/q)(-7)/(q/(((q(3/4)/q)/q)/q))(-11) assuming q is positive. q(199/4) Sim	{ "pile_set_name": "DM Mathematics" }
a + 4 = -0a - 0a + o - 5 for a. -5 Solve -6x - 30 = -2g + g, 17x - 32x - 75 = 3g for x. -5 Solve -4f - 3 = -b - 61, b - 36f = -538 for b. 2 Solve -10 = -3m - 4r, m - 4r = -m - 558 + 598 for m. 10 Solve 252i - 4 = -r + 254i, 13i = -3r + 69 for r. 10 Solve 3h - 2n + 54 = -8h, 38h - 20 = 35h - n + 7 for h. 0 Solve 4r - 32343 = -4q + 2r - 32357, -5r + 21 = -4q for q. -4 Solve 2m + 14u - 14 = 635u, 2m = 3u + 14 for m. 7 Solve -14d + 30 = -3q, 3d - 6q - 404 + 413 = -2d for d. 3 Solve -136076p + 3f = -136094p + 219, 2f = 4p + 66 for p. 5 Solve -a = -2l - 435 + 448, 0 = -a - 6l + 43 for a. 1 Solve 4n + 96 = 5x - x, 0 = -2x + 251n - 710 + 6485 for x. 1 Solve -149z + 430 = 176p - 175p, 0 = 3p - z + 54 for p. -17 Solve -11528y + 11532y + 75 = 3a, 3a = -y - 15 for a. 1 Solve 5w + 4a - 5a = -19, 114w - 99w + 3a + 63 = 0 for w. -4 Solve 4a - 4y - 4 = 0, -4y - 153 + 121 = -184a + 187a for a. -4 Solve -7t - 11 = -2c, 27c = -2t + 34c - 16 for t. -1 Solve 4s - 621516m + 621519m + 30 = 0, -5m = -7s + 50 for s. 0 Solve 71 = 12k - i, 29199i = 29194i - 55 for k. 5 Solve -186 = g + 67n - 14n, 10n + 57 = 5g + 4n - 97 for g. 26 Solve 4q + 13w + 13w + 28 = 30w, -10q = w + 15 for q. -2 Solve 5u = 11h + 209, -112 + 169 = 4u - 0u - 3h for u. 0 Solve 29014j + 5 = 29009j, -q = -7j - 37 for q. 30 Solve -10f = -4j + 134, 607f = 605f + 2j - 22 for f. -15 Solve -4w + 35 = -222r + 223r, -2176w = 2r - 13078 for w. 6 Solve 28g - 10g = 16g + 5g + 15g - 3t - 129, 0 = t - 5 for g. 8 Solve 4n = 1100c - 1099c - 15, 15c + 6n - 5n + 80 = 0 for c. -5 Solve 4z + 3a = 63, -13a + 17 = 22z - 11a - 69 - 188 for z. 12 Solve 13z = -3r + 102, -839z + 859z - 185 = r for z. 9 Solve 0z - z = -0d + d + 7 + 21, 82d + 2z = -2456 for d. -30 Solve -2a + 68x = 80, -40a = -35a - 2x + 200 for a. -40 Solve m = -0m - 7i + 12i + 19, 2m - 3i - 17 = 0 for m. 4 Solve -2g - 20 = -2h - 3 - 3, 301g + 6h + 2 = 296g for g. -4 Solve 0 = -33g + 36g + 261j - 6267, -j - 2j + 5j - 47 = g for g. 1 Solve -36 = -4j - 5c, -7j = 18575c - 18580c - 8 for j. 4 Solve 4i = -18k + 65 - 52 + 155, -2k + 26 = -2i for k. 10 Solve -c - 2c = 4s + 16, -75870c - 2s + 2 = -75871c for c. -4 Solve -4p + 2212 = z + 2195, 2z = 3p - 10 for z. 1 Solve 2u + 4117 - 4125 = 0, 34 = -3w + 4u for w. -6 Solve 0 = -4s - 4m + 8, 4s + 92m = 97m - 37 for s. -3 Solve -2x - 2r + 8r + 24 = 2x + 10r, 0 = -2x + 2r for x. 3 Solve -2m = 10329j - 10326j + 76, 114 = -3m + 3j for m. -38 Solve -3p + 97 = -2s, -26p - 1243 = -4s - 1537 for s. -41 Solve 5k = 2z + 28, -4z + 3329k = -6z + 3333k - 28 for z. -14 Solve 3p + 211 - 217 = 0, -3l = -5p - 32 for l. 14 Solve -5r + r + 32 = 3c, -43c = -44c + 16 for r. -4 Solve -3f + 48 = g, 3f = -3f + g - 2g - 44444 + 44540 for f. 16 Solve -3r + 3 = 11x - 12x, 0 = 3r + 6x + 39 for r. -1 Solve 0 = 4m - h - 86, -16m + 5h + 4h + 14 = 10h for m. 5 Solve 0o + o = -9p - 204, 251p - 54 = 254p + 5o for p. -23 Solve 0 = 12068t - 12065t - 5a + 78, 5a = 4t + 79 for t. -1 Solve 3 = -10a - i, -3780a + 5i + 235 = -3775a for a. 4 Solve -d + 2z = -0z - 19, 169d - 523 = -176d + 344d + 74z for d. 5 Solve 0 = 13c - 12c - 2, -15v - c = -2c - 51 + 17 - 14 - 70 for v. 8 Solve 74u - 4z - 958 = 0, 3u + 28 = 2z + 65 for u. 13 Solve 0 = 2o - 2i + i + 2i, 0 = o - 0o + 5i + 18 for o. 2 Solve -3801g + 6l + 360 - 284 = -3799g, 0 = -4g + 3l + 35 for g. -1 Solve -210x + 201x + 3u - 54 = 0, 5u = -x + 90 for x. 0 Solve 4c = -c + 3u + 20, -4u - 8 = -6c + 19 + 1 for c. -2 Solve 2q + 12 = 5o - 5o - 4o, 23 = -5q - 3o for q. -4 Solve 864p + 4c - 4 = 863p + 1, 0 = -7p + 3c + 35 for p. 5 Solve 2d = -10, 0 = 1460q - 1461q - d + 19 + 10 for q. 34 Solve o = -3q - 2o - 45, 4q + 6983o + 50 = 6989o for q. -14 Solve 14a + 130 = -2v, 0 = -2v + 3021238a - 3021251a - 120 for v. 5 Solve -155 = -3i + 7q - 3q, -2q - 845 = -8i + 10q + 11q for i. 5 Solve 269m - 535m + 261m - 4i + 29 = 0, 9m - i = i - 3 for m. 1 Solve -17p - 1339h + 1344h = 179, 3p + 12 = 8h - 5h - 9 for p. -12 Solve 2a + 14270 - 14210 = -8v, 0 = -0a - 3a - 6 for v. -7 Solve -1 = -y + 16, 5n + 13y + 105 = 2n + 320 for n. -2 Solve 3l + 30 = 941d - 937d, 6l + 9 = 2d + 3 for l. 2 Solve m - 2179951 + 2179959 = -2f, 0 = -3f - 5m - 12 for f. -4 Solve -5w + 7967 - 8277 = 5n, -6n + w = -69 for n. 1 Solve -13a + 7a - 9 = 5f - 8a, 38a - 4 = -2f + 35a for f. -1 Solve 0t = -5b - t + 76, -2t = 141b - 145b - 4t + 122 for b. 5 Solve 79i - 81i - 26 = v, 2i = 5v - 38 for i. -14 Solve 2m - 2o - 32 = 0, o - 26446 + 27743 = 62m for m. 21 Solve 14p - 32p + 13g - 92 = -13p, -5p + 4g - 127 = -116 for p. 5 Solve 0 = 44o - 49o + 9x + 3 + 5, -3x = -26o - x - 48 for o. -2 Solve 4n - 31 = -o, -7o + 7o + n - 12 = -7 for o. 11 Solve -5d - 2g - 94 = -143, -15d = g - 162 for d. 11 Solve -13y + z - 52 = 0, 11y + 16y + 4z - 31 = 28y + 6z for y. -5 Solve 2t = -18615c + 18610c - 44, -10c = 100 for t. 3 Solve 0 = -2g + 3g - 3t + 170 - 161, -19g - 407 = 2t for g. -21 Solve -5p = -l + 217, 11l = 396p - 389p + 323 for l. 2 Solve -2l - 2h + 4 = 0, 14l + 3h + 53 - 112 + 47 = 13l for l. -3 Solve 25 = 5c, 11p + 3p + 7p - 78 = 25p + 2c for p. -22 Solve 3t = -2q - 2, -904126q + t - 2t = -904125q + 3 for q. -7 Solve -2l - 20 = 0, 0 = -p - 17l + 14373 - 14546 for p. -3 Solve h = 10m + 18, 0 = -2h - 4m + 144207 - 144195 for h. 8 Solve -184y + 181y + 4g = 52, -7y - 4g - 3g - 168 = 7g for y. -20 Solve -351i + 29 = 46v - 45v - 347i, -2v - 2i = -64 for v. 33 Solve 66 = -2j + 4d, 33j = 5j + 5d + 5278 - 5947 for j. -23 Solve -38 = -4c - z, 16c - 63 = z - 42 + 1 for c. 3 Solve a + 38n - 36n = 14 - 12, -8a - 3 = -3n for a. 0 Solve -3t = -11q - 6q + 13q + 31, -4q - 53t - 5 - 20 = 0 for q. 7 Solve -y + j - 5j + 1 = 0, 11j - 9j = -4y + 4 for y. 1 Solve -6z + 2z = 2u + 20, -6u + 0u + 24z = -9u - 138 for u. 2 Solve -4g + v = -13, g - 233v - 4 = -232v for g. 3 Solve 114 = -4l + 3l + l + 3l - 120q, 0 = 3q + 3 - 0 for l. -2 Solve 135b = 133b + 88, -4h + 0h = 2b - 68 for h. -5 Solve 2u - 116f - 112f = 114f - 352f - 14, -2u + 5f - 14 = 0 for u. -7 Solve 0 = -2x + 14103p - 14102p + 14, -x + 88 = -5p for x. -2 Solve 0 = -3w + 135m - 134m + 28, 3m + 0m = 1412w - 12711 for w. 9 Solve -3d + 5d - 85 = -k, -26d + 29d - 130 = -2k for k. 5 Solve -4s - 4 = -u - u, 5u - u + 21 = -4s + 17 for s. -1 Solve 561x = -4f + 557x - 20, 340 = -68f + 4x for f. -5 Solve -a - l + 3 = 0, 92l - 330 = -56a - 80l + 170l for a. 6 Solve -14728l + 14725l - k - 13 - 1 = 0, -3l - 2k - 10 = -3k for l. -4 Solve 0t - 10t = 0, -10k + 151 - 27 + 14 = t - 91 - 41 for k. 27 Solve -3q + 6 = 3d, -725 + 674 + 419 = q - 60d for q. 8 Solve -160 = -2a + 70n - 146n, -3a = -2n - 8 for a. 4 Solve 5w - 5 = 0, -4c + 943 = 6w - 11w + 896 for c. 13 Solve -11o + 73 = 4i - 57, -6o + 5i - i + 41 - 1 = 0 for o. 10 Solve 4n + 10 = -13o + 12o + 10 - 6, 75 = 3n - 8n + 10o for n. -3 Solve -6 = -i + 16397p - 16399p, -4 = 3i - 5p for i. 2 Solve -724 = -7l - 13j, 43j - 40j = -l + 164 for l. 5 Solve -2l - 21m = -86, 6l - 14m + 215 = 9l + 2l for l. 43 Solve -5y + 270 = 5x, 2x + 81 = 4x + y - 27 for x. 54 Solve -45x = -4u + 209, -453x + 459x = 3u - 18 for x. -5 Solve -2 = -2g + 4l, -2l = -5g - 34104 + 34093 for g. -3 Solve -2i = -5k + 255, -1566 = 14i + 12k + 78 for i. -120 Solve 0 = -v + 2t + 10, 5t = -2v + 454 - 434 for v. 10 Solve -5y + 2r - 5 = 0, -34661y = -34667y - 5r + 31 for y. 1 Solve -5t = 11652g - 11657g + 60, -6g = 2t + 8 for t. -10 Solve 2r + 2i = 10 - 4, 4r = 21i - 75 - 38 for r. -2 Solve -6o + 22 + 19 - 1 = -4m - 3o, -4m + 5o - 56 = 0 for m. -4 Solve 310h - 309h - 93 = 8l, -18 = 3l + 3h for l. -11 Solve 17s + 44 = -2h, -3s - 3811 = 2h - 3823 for h. 12 Solve 5o + 93 = -p, -144p + 43 + 44 = -5o - 148p for o. -19 Solve 27 = -3n - 44a - 5, 4a + 12 = 2*n for n.	{ "pile_set_name": "DM Mathematics" }
y 249 111408 -3 divided by 1241076 -1/413692 -184120199 divided by 641 -287239 Calculate -6 divided by 1048071. -2/349357 Calculate -118054221 divided by -4. 118054221/4 Divide 53068570 by -10613714. -5 Divide 66162972 by -7. -66162972/7 Divide 111 by 78225. 37/26075 Divide -5300 by 14386. -2650/7193 Calculate -88594694 divided by 1671598. -53 What is -2 divided by 44063087? -2/44063087 What is 80385030 divided by 6? 13397505 Calculate -2 divided by -3433652. 1/1716826 What is 41 divided by -139099? -41/139099 -321992772 divided by -26832731 12 What is 18 divided by -260845? -18/260845 51253 divided by 4 51253/4 What is 11 divided by 577426? 11/577426 Calculate -1102918 divided by -14. 551459/7 Calculate -1004 divided by 33542. -502/16771 Divide 8465319 by 477. 17747 Divide 13193610 by -2. -6596805 What is -772191 divided by -42? 36771/2 What is -95516300 divided by -2446? 39050 967412642 divided by 342811 2822 What is 41 divided by -2427? -41/2427 Calculate 5742 divided by 1040. 2871/520 What is -8115072 divided by -579648? 14 385560 divided by 126 3060 What is 5253689 divided by -5? -5253689/5 Divide 34329432 by 11443144. 3 18627 divided by 402 6209/134 Calculate 164043 divided by -184. -164043/184 Calculate 60207120 divided by -360. -167242 What is 150997 divided by -20? -150997/20 -115874 divided by -568 57937/284 Calculate 99171445 divided by 88943. 1115 What is -89 divided by -9912? 89/9912 -520 divided by 391317 -520/391317 Divide 78139040 by 11162720. 7 What is 247446 divided by -6? -41241 Calculate -10947456 divided by -1824576. 6 What is -1 divided by 17913322? -1/17913322 Divide -424486 by -2. 212243 What is -81250743 divided by -1? 81250743 Calculate -80 divided by -2235780. 4/111789 Calculate -442 divided by 587263. -442/587263 -20068152 divided by 1964 -10218 What is -96645204 divided by -108? 894863 Calculate 117 divided by 909214. 117/909214 -124145190 divided by -3183210 39 Divide 25575375 by -5115075. -5 432187 divided by -1 -432187 What is 914 divided by -2950? -457/1475 What is 0 divided by -12626803? 0 Calculate 1438131 divided by -479377. -3 Divide 10049100 by -6. -1674850 374503353 divided by 22029609 17 What is -14276514 divided by -6? 2379419 -33 divided by 3813319 -33/3813319 Calculate -14 divided by -465742. 7/232871 Divide 425635740 by -5. -85127148 621 divided by -30855 -207/10285 What is -7894389 divided by -1? 7894389 What is 131503872 divided by -15936? -8252 Divide -5806704 by -4. 1451676 Calculate 41982134 divided by -361. -116294 Divide -4 by 2345869. -4/2345869 Divide -12756319 by -1. 12756319 Calculate 181446408 divided by -33. -5498376 Divide 579523415 by -5. -115904683 -627551226 divided by -683607 918 Calculate 21227700 divided by -10. -2122770 -8 divided by -1173538 4/586769 What is 638834040 divided by -9? -70981560 16007880 divided by 472 33915 Calculate 8643432 divided by -6. -1440572 What is -21987966 divided by -95186? 231 Calculate 3 divided by -13958030. -3/13958030 Calculate -220694436 divided by 73564812. -3 What is 51055664 divided by 46288? 1103 Calculate -487 divided by -244534. 487/244534 Calculate -3 divided by 3789361. -3/3789361 Divide -54111582 by -184053. 294 Calculate 437189090 divided by 113. 3868930 What is 1 divided by 259233? 1/259233 Calculate 786 divided by -14112. -131/2352 What is -114126 divided by -1049? 114126/1049 Divide -77347712 by 8944. -8648 Calculate 4761 divided by 1639. 4761/1639 Divide -3 by 136081. -3/136081 What is 1177815830 divided by 2? 588907915 Calculate -2798750 divided by -1250. 2239 Divide 31614684 by -3. -10538228 Divide 80478185 by 3. 80478185/3 Calculate 123200600 divided by -50. -2464012 What is -9318630 divided by 107? -87090 Divide 84883500 by -29250. -2902 Calculate -876 divided by 15838. -438/7919 Divide -190733 by 1093. -190733/1093 Calculate 4166502 divided by 82. 50811 What is -642045 divided by 112? -642045/112 -23730322 divided by 34342 -691 Divide -16889652 by -1876628. 9 What is 1 divided by -741724? -1/741724 What is -13728 divided by -4376? 1716/547 Calculate 1247362495 divided by 249472499. 5 -704 divided by 4353 -704/4353 Calculate -3424225 divided by 5755. -595 Calculate 0 divided by -634716. 0 Divide 535000 by -267500. -2 138469365 divided by 3 46156455 Calculate 984 divided by -1156. -246/289 Calculate 6118879 divided by 470683. 13 -424281669 divided by -6 141427223/2 Divide 57078827 by -1542671. -37 Divide -2115558 by 2. -1057779 7004358 divided by 82 85419 What is -181761876 divided by 90880938? -2 What is -6 divided by -129570089? 6/129570089 What is -96 divided by -57812? 24/14453 Calculate -708 divided by 24526. -354/12263 Calculate 9 divided by -5399058. -3/1799686 What is -148980 divided by 1910? -78 What is -274 divided by 2769688? -137/1384844 What is 72327654 divided by 382686? 189 Divide 12138938 by 14. 867067 0 divided by -3832670 0 Divide 523005736 by 201466. 2596 74956196 divided by -118 -635222 Calculate -252385980 divided by -22. 11472090 What is -485 divided by -13757? 485/13757 What is -2439136 divided by -16? 152446 Divide 5 by -3157580. -1/631516 Calculate -9222436 divided by -2305609. 4 What is -130415824 divided by -3? 130415824/3 Divide 79218 by -41. -79218/41 106967875 divided by 122249 875 What is -1649518 divided by -111? 1649518/111 -958124 divided by -4 239531 Divide 130839 by 190. 130839/190 Calculate 75840 divided by 120. 632 Calculate 277 divided by -481275. -277/481275 Calculate 1041181057 divided by -7. -148740151 693206146 divided by 565421 1226 2 divided by -2380638 -1/1190319 Divide -22906248 by -263. 87096 What is -24992876 divided by 6248219? -4 Calculate -2747 divided by 12851. -2747/12851 1 divided by 14391462 1/14391462 Divide -17 by -4746939. 17/4746939 What is -1933 divided by 2917? -1933/2917 Calculate -119997131 divided by -119997131. 1 Calculate 30387507 divided by 3. 10129169 2 divided by 318384 1/159192 -13071981 divided by -3 4357327 Calculate -255 divided by -1054595. 3/12407 -1 divided by 13739517 -1/13739517 Divide -6470 by -9746. 3235/4873 What is -40796 divided by -408? 10199/102 Calculate -280894 divided by -2275. 280894/2275 -61 divided by 14119 -61/14119 5245050678 divided by 6 874175113 Divide 5 by -5651063. -5/5651063 Divide -481 by 28003. -481/28003 Divide 50427546 by 2. 25213773 3 divided by 1260290 3/1260290 16 divided by 1452132 4/363033 Calculate 0 divided by 1120615. 0 11 divided by -4552242 -11/4552242 What is 98 divided by -14808865? -98/14808865 Divide -35780072 by -4. 8945018 Calculate -1928 divided by 115459. -1928/115459 Calculate -6271 divided by 63. -6271/63 Divide -2794895535 by -5. 558979107 -754500 divided by 10 -75450 -4 divided by 160505952 -1/40126488 What is -66029247 divided by 3? -22009749 What is 14460170 divided by 1030? 14039 973138 divided by -973138 -1 What is -54 divided by -74119? 54/74119 Divide -876 by -10281. 292/3427 Calculate -106263295 divided by -395. 269021 117132836 divided by 49444 2369 Calculate 9386339 divided by -27. -9386339/27 Divide -15330509 by -46. 15330509/46 -67424484 divided by -6 11237414 What is -30562540 divided by 20? -1528127 Calculate 4 divided by 5231427. 4/5231427 -19 divided by 3293946 -19/3293946 Divide 595 by 30271. 595/30271 Calculate -1438465 divided by -2. 1438465/2 What is -37039 divided by 69? -37039/69 -2067871 divided by 28327 -73 Calculate -66475392 divided by -22158464. 3 Calculate -66392330 divided by 13278466. -5 Calculate 51123818 divided by 2. 25561909 Calculate 92702 divided by -16. -46351/8 Divide -176914 by 9. -176914/9 Divide -130460736 by -194138. 672 Calculate -133945932 divided by -65244. 2053 Divide 491570112 by 3. 163856704 What is -187331 divided by -1105? 187331/1105 1 divided by 39410944 1/39410944 What is -48026 divided by -74? 649 Calculate 17975858 divided by 842. 21349 -40537157 divided by 40537157 -1 -48911016 divided by -234024 209 Calculate 11056 divided by 51732. 2764/12933 Divide 83673 by -13061. -83673/13061 What is -2 divided by 12979579? -2/12979579 18284 divided by -59 -18284/59 What is 191620 divided by 26? 7370 Calculate 207407325 divided by -69135775. -3 Divide -5 by -326054717. 5/326054717 Divide 126401682 by -42133894. -3 Divide -33426624 by -374. 89376 What is -13098	{ "pile_set_name": "DM Mathematics" }
tance between -2299352.0824 and 0.06? 2299352.1424 Work out 149182.33878 - 5. 149177.33878 -440692+30003988 29563296 Work out -2459750.25904 - 11. -2459761.25904 Sum 281941943598 and 15.24. 281941943613.24 Put together 13178523.5 and 757.26. 13179280.76 Work out -0.019101 - 11933155900. -11933155900.019101 What is the distance between 93545028790.3 and 786? 93545028004.3 What is 17 - 6571400238? -6571400221 Total of 11358852.9 and -8.5. 11358844.4 What is 2336.26282553 - -0.4? 2336.66282553 What is -0.476 plus -11.7819866171? -12.2579866171 Subtract -2.51662651 from -1369. -1366.48337349 What is the distance between -117557393 and 83616? 117641009 108+7838229596 7838229704 What is 87505186781 - 0.044? 87505186780.956 What is the distance between 2804653500532 and -0.009? 2804653500532.009 What is -274303 take away -141720? -132583 What is the difference between -83114.1 and -4641631? 4558516.9 Work out -53313525647972 - 1. -53313525647973 Calculate 1811053 - 1993827. -182774 Work out -1536.124 - 20017. -21553.124 -1184190607495 - -0.912 -1184190607494.088 What is -10826 take away 37618750? -37629576 What is the distance between 2031625 and -2159074? 4190699 Add -20.382387 and 16108. 16087.617613 Add 1.58 and 51140757156. 51140757157.58 -147868 - 3.798656 -147871.798656 Put together 3 and 53983190152. 53983190155 Total of 4 and 7540673916. 7540673920 Work out 14347 + -30980720. -30966373 What is 169970745 less than -466? -169971211 Total of 29355 and 1668106.1387. 1697461.1387 -420093699+0.024693 -420093698.975307 Work out -469123487 - 1.825. -469123488.825 Add -33159.8909 and 1115. -32044.8909 What is 1.12 take away 10.00310897297? -8.88310897297 What is -43546 - 347360.9? -390906.9 Subtract 0.2318 from -533950777. -533950777.2318 Sum 2261204656.4 and 0. 2261204656.4 Subtract -33716 from -10.20126. 33705.79874 What is 41997340161.62 - -0.7? 41997340162.32 What is 28.4115 take away 3119.5034? -3091.0919 What is -766.85 take away 2415543? -2416309.85 What is -2264938794618 take away -0.6? -2264938794617.4 What is the difference between 1 and -2.5534331723? 3.5534331723 Add 0.2 and 3.353868616675. 3.553868616675 Put together -0.09 and -6.095085847259. -6.185085847259 What is -455968694461 plus -0.2? -455968694461.2 What is 4734212909005 + -0.77? 4734212909004.23 What is 7.8718036155 take away -4? 11.8718036155 Total of -352.654485 and 2498. 2145.345515 What is the difference between 4515793160468 and 94? 4515793160374 What is 0.136453 minus 170231129? -170231128.863547 -2001341709+-0.93 -2001341709.93 Put together -0.014761276 and -49609.2. -49609.214761276 Total of 59330308.6 and -0.00225. 59330308.59775 Total of -49829118 and 15325. -49813793 -0.4 + -180538.53443 -180538.93443 Calculate 342502561 - 0.68944. 342502560.31056 49684.138 + -0.0267195 49684.1112805 What is 1 minus -1123241808.20906? 1123241809.20906 Add together -12.769 and -0.02606203. -12.79506203 Put together -1577670 and 5019.54. -1572650.46 Work out 0.0362848 - -1.10174. 1.1380248 What is the difference between 765.86247 and -242? 1007.86247 Sum -159135.2232597 and 0.18. -159135.0432597 What is -266444478 - 40? -266444518 Add -10665 and 23431274. 23420609 What is -524.915756 plus 7? -517.915756 What is -56282273 less than -7745? 56274528 What is -216036 less than 1169812286? 1170028322 Subtract -18831.3 from -14846.99. 3984.31 -868.98228659 - -0.17 -868.81228659 Calculate -107 - 2.84067942189. -109.84067942189 What is the difference between 12821571378 and -113? 12821571491 18 + 24.9245493049 42.9245493049 Put together 0.010616 and -2448.553. -2448.542384 What is 22388 less than 575641926.9? 575619538.9 Calculate 59.8481893547 - 0.9. 58.9481893547 Subtract 0.7194307058 from -31. -31.7194307058 What is 0.68019471 less than -1288106? -1288106.68019471 What is 9 less than -308642.819? -308651.819 Calculate 4533315233.783 - 0. 4533315233.783 Calculate -0.4 + 44004139.217. 44004138.817 0.04369749+131504712 131504712.04369749 -62270+-0.0379854704 -62270.0379854704 Sum -36164 and 5846650483. 5846614319 Work out 4321850 - -15120. 4336970 -0.07 - 1028.627421425 -1028.697421425 Calculate -98 + 6737.1874516. 6639.1874516 What is -0.178899 + -44600788? -44600788.178899 -422729 - 10071566 -10494295 What is the distance between -1.7 and 257808719615? 257808719616.7 What is -6002095938 + -130? -6002096068 What is 6274396.6106 less than 1.1? -6274395.5106 Put together -0.1961 and 97.6090939. 97.4129939 Add -37 and -924.61506956. -961.61506956 -1033957102 + 26.939 -1033957075.061 What is -66275939 less than 493.526? 66276432.526 What is 58 + 0.5277745087? 58.5277745087 Sum 1.89 and 71985603542. 71985603543.89 Subtract 3 from 4582687971959. 4582687971956 Put together 0.38 and 1923.64011468. 1924.02011468 What is 2 take away -42473017264765? 42473017264767 Sum -706393 and -216.7634. -706609.7634 What is 10328 less than -764.81548? -11092.81548 What is the difference between 0.85535 and 0.1926914868? 0.6626585132 Subtract -298780 from 36486.4. 335266.4 Calculate -0.1 - 106627.060579. -106627.160579 Subtract 0.02686075185 from 19.9. 19.87313924815 -116076630 - 79468.3 -116156098.3 Subtract -631667945.8 from -0.6988. 631667945.1012 Put together 43830106 and 0.05713. 43830106.05713 What is the distance between -11755597671 and 31? 11755597702 What is the difference between 19 and -95424.56962? 95443.56962 What is -522418533 plus -2.8? -522418535.8 What is 0.9 take away -28.5674267863? 29.4674267863 Subtract -17965.84875 from -25446. -7480.15125 1169 - 45000569317 -45000568148 Put together 19437 and -23.526838. 19413.473162 320807251 - 8177 320799074 What is the distance between -0.596593032648 and 0.3? 0.896593032648 Add together -338 and -5505744100. -5505744438 Put together -15875010 and -852162. -16727172 What is the difference between -4.64 and -50.80529? 46.16529 -3829147.35+295.03 -3828852.32 What is -2632096325 take away 37053? -2632133378 What is 3.2245372227058 less than -0.07? -3.2945372227058 What is -62 plus -0.3476917953? -62.3476917953 -470742336 + -13207 -470755543 What is -98155561130.55 minus -2? -98155561128.55 Work out 0.034514636 + -66963. -66962.965485364 Calculate 2.22143463 - 1198.04. -1195.81856537 Calculate 12.7 - -1129673272. 1129673284.7 What is the distance between -1764384002 and -32? 1764383970 What is the difference between -0.102 and 254621898087? 254621898087.102 Add together 6681.0177 and -12.856. 6668.1617 What is -0.0945585297 + 175.91? 175.8154414703 5.3972462248 - -0.02541 5.4226562248 What is -692974677.942 + 4? -692974673.942 What is -0.34521959251 less than -0.1568? 0.18841959251 Add together 37831444349530 and -0.9. 37831444349529.1 Work out 266630.317 + -0.0997. 266630.2173 What is 284867485716 + 4? 284867485720 Total of -98 and 218898066. 218897968 What is 16641059798231 - -1? 16641059798232 Work out 17.82521 - 357786. -357768.17479 Subtract -2405161440 from -134516. 2405026924 1049044644182+-56 1049044644126 Sum 10006675 and -37233. 9969442 Put together 136.5351 and 974194. 974330.5351 Add together 0.035111615 and -4.092. -4.056888385 What is 648825 plus -174826? 473999 What is the distance between -514935457.7 and -1071? 514934386.7 Work out 15379 - -310732207. 310747586 What is 16 + 2213428571? 2213428587 What is 26648737790 take away 0.58? 26648737789.42 114592234.19748 + -3 114592231.19748 Add together 10348752768122 and -17.7. 10348752768104.3 What is 3039777 less than -3979.374? -3043756.374 Calculate 155.06414681558 + 6. 161.06414681558 Calculate 1.3437 + 0.111901111. 1.455601111 What is 8.459051409 less than 765.9? 757.440948591 Add together -321744699321 and -4. -321744699325 What is 42250665033 + -1939? 42250663094 Work out -10.214445 - -1478723. 1478712.785555 Calculate 0.08 + 458232603905. 458232603905.08 What is -0.3688 take away 1541698.488? -1541698.8568 What is 4.6796 plus -7512127.589? -7512122.9094 Subtract 7939120 from 9194. -7929926 What is -0.3 + 1492.64162727? 1492.34162727 What is -21194273 minus -591? -21193682 What is the distance between 167343908 and 972? 167342936 Work out -0.1034 + 930970662. 930970661.8966 Calculate 9731356.466 + 1. 9731357.466 Add together -531347 and -0.024009567. -531347.024009567 Put together -1206.86	{ "pile_set_name": "DM Mathematics" }
)/(19(30/4)/5) -1/38 (((-2379)/1508)/61)/(427/32) -2/261 ((-3)/5)/(6(-102)/408) 2/5 ((-46/48)/((-110)/(-836)))/(4/20) -19 Calculate (99/9)/((-66)/330). -55 ((-771)/(-1799))/(((-153)/3)/13/(-63)) 3/17 Evaluate (-18)/1107752/34884. -2/55 What is ((-90)/(-8))/(((-5181)/(-396))/(-157))? -135 What is the value of 11934/5304(-16)/(-30)? 6/5 Calculate (((-6)/(-8))/(243/162)0)/(-2). 0 Calculate (19474/455)/(356/(-890)). -107 Evaluate 261/(-2436)228/24. -1/4 What is the value of 946/12(-10868)/(-39468)? 19/2 6(-11)/11(-40)/20 12 Evaluate (((-1)/2)/((-2)/(-22)))/(64545/774540). -66 Evaluate (287/(565390/591))/(3/5-7). -1/14 Evaluate (255/12)/(2405/481). 17/4 What is 28(9/(-3))/((-2583)/(-984))? -32 ((-5)/4)/(60/1((-98674)/(-824))/(-479)) 1/12 (-9)/((-2052)/32)112/((-17472)/702) -12/19 (19504/1166)/(-46)8-22 64 Evaluate (108/144)/((-493)/(-464)). 12/17 Evaluate (-156447/50362)/(15/(-13)). 6/5 Evaluate (50/245)/(((-2499)/49)/357). -10/7 What is the value of (1212/31815)/((-16)/(-28))? 1/15 (11/((-99)/27))/((-114)/1140) 30 What is the value of 10((-1330)/(-252))/(-19)(-8)/(-20)3? -10/3 Evaluate (-13(-174)/(-12441))/(-3(-6)/(-99)). 1 What is the value of (21/1575-5-9)/(2/(-140))? -42 Calculate ((-570)/(-38))/((-12)/8). -10 What is ((-56)/(-3696))/((-115)/(-1242))10/3? 6/11 Evaluate ((-36)/((-3492)/2425))/(2/(-4)). -50 (((-12)/13)/6)/((-180)/(-36)) -2/65 What is 3280/(-41)(-2)/205? 40 What is 154/(-33)2805/595? -22 What is ((-2)/(-1))/1-3(-1)/((-21)/1)? -2/7 Calculate (-5)/(-25)(-190)/(-76)-38. -19 What is 68/119(-63)/(-864)-10? -5/12 What is ((-30)/(-4))/((-1694)/3388)? -15 8/(-261)(-13266)/5896 2/29 Calculate 3248/558(-693)/12. -77 Calculate (8/1144)/(2/6(-294)/196). -2/143 What is (2(-68)/(-32))/(-3(-19)/684)? 51 Evaluate ((-31)/(651/(-42)))/(2/(-13)). -13 ((-320)/65)/(-4)((-29)/29)/((-4)/(-12)) -48/13 ((-50)/200)/((-18)/4082/9-3) -17/2 What is the value of (2915/424)/(48/48075/6)? 11/2 What is the value of 15144/283955/4-35/4? -5/2 What is the value of ((-750)/(-100))/(13/(1040/30))? 20 What is ((525/21)/62520/2)/(6/1740)? 116 Evaluate (60/(-48)(-3627)/(-65))/(66/(-88)). 93 Calculate 12(36/(-168))/((-14)/343). 63 (3/405)/((-108)/367217) -2/135 What is ((-308)/(-6248))/(-1)(-16)/28? 2/71 What is -12(-4140/2688)/2? 5/4 38/(28842/(-33))-23 1 ((-2115)/5312880)/((-1)/(-32)) -2/157 What is ((-11)/(14190/12))/((-5)/((-25)/3))? -2/129 What is (-185)/(-3)(-1068)/(-3560)3(-2)/(-3)? 37 What is the value of (-1647)/(-27)(-13)/13? -61 Evaluate 36/(-8)(-3)/(-90)(-480)/1440. 1/20 (15/((-1815)/77))/(217/(-14322)) 42 ((6/(-4))/((6237/72)/33))/46 -2/161 Evaluate (9/(-48)(-6)/45-5)/((-7)/602). 43/4 What is (-30)/180(-27)/18? 1/4 What is ((-5)/15(-282)/2)/((7656/87)/88)? 47 Calculate (20(-3)/((-33)/(-11)))/((-342)/(-19))2. -20/9 (-910)/105218/16 -91 40380/14806154/(-10) -42 What is the value of (((-3416)/(-61))/(-56))/24? -1/24 What is ((-423)/(-22607)-37)/((-7)/(7/6))? 3/26 Evaluate ((-324)/(-122094)-19)/(((-6)/28)/(-1)). -4/17 Calculate ((-1312)/(-336))/(61/1281). 82 (3(-45)/2070)/((-6)/(-16)) -4/23 Evaluate (-154)/(-693)1944/(-1800). -6/25 What is the value of ((-5)/24)/(30/18)(-4)/(40/(-2))? -1/40 Calculate ((-213)/(-6))/(((-3318)/(-42))/(-158)). -71 What is (1175724/(-237520))/((-36)/10)? 11/8 What is the value of (-38)/4(-58320)/18468? 30 Evaluate -4(-130)/(-8)(-8)/884. 10/17 What is the value of (14(-54)/1323)/((-3)/(-14)(-40)/10)? 2/3 What is the value of 1476/(-1271)129115/1190? -126 What is 223/(-2093)-13? 2/7 Evaluate (1244/622)/((-4)/62). -31 Evaluate ((-2)/7)/(((-4510)/(-385))/(-41))(-37)/(-1). 37 Evaluate 49/((-245)/20)9/138. -6/23 What is the value of 415(6/21)/(180/(-126))? -83 Calculate (-29(-2)/1015)/((-3)/3). -2/35 What is (((-5472)/1463)/24)/(((-1053)/(-63))/(-13))? 4/33 Evaluate 40/(-4)(-32889)/(-17310). -19 What is the value of 27/(-78)(-11840/3234)/((-12)/(-14))? 15/13 Calculate (-9899/(-53361))/((-4)/14). -7/11 What is the value of (-220)/135(-61857)/(-59566)? -22/13 Evaluate (-2)/((16/(-180))/((-8556)/2790)). -69 Calculate -629(10/(-100))/((-925)/(-500)). 34 What is the value of 132/(-154)((-572)/495)/13(-15)/(-20)? 2/35 101520/(-2820)196/63 -112 What is 20((2/50)/(-1))/((-228)/(-39520)52)? -8/3 Calculate ((-13584)/1698)/((-3)/(-9)-2). 12 Evaluate ((-3)/((-18)/110))/(-28(-35)/(-2940)). -55 What is ((-3)/((-7)/7))/((198/(-231))/(8/7))? -4 (96/(-352))/(99/(-6)) 2/99 -142/10(-2490)/36603 4/21 Evaluate ((33/33)/((-2)/(-4)))/(100/1000). 20 What is the value of (66/(-11))/((-156)/(-6))? -3/13 (2/(-14))/(110/2695)(-23)/(483/324) 54 Calculate -18195/(-1014)17/85. 9/13 Evaluate (((-270)/4)/(594/396))/(7/(252/(-30))). 54 What is the value of 15(-18)/(-169920)-32? -3/59 Calculate 236/10764-23. -2/13 Evaluate (((-2736)/(-19))/48)/(((-2)/(-84))/(9/(-9))). -126 Evaluate ((4070/(-55))/444)/((4/(-54))/(-2)). -9/2 Evaluate (((-8)/(-8))/((16/4)/44))/(5/5). 11 (((-1617)/14)/11)/((-137)/(-822)) -63 What is the value of (324/4852/702)/(-17)? -1/34 Evaluate ((6/(-15))/((-8)/20))/((-15487)/2733). -3/17 Calculate ((2/32)/((-5873)/(-120816)))/(1/(-1)). -9/7 What is the value of (2/(-52)(-3562)/137)/(1/80)? 80 Calculate 2/((144/(-16))/(7/14-414)). 46 What is the value of (38/(10944/(-3792)))/(1/6)? -79 3/((-116)/((-22968)/(-2706))13) -3/41 What is the value of ((14/(308/(-33)))/(168/20))/(2/4)? -5/14 (2(-18)/12)/(((-6603)/1736)/(-71)) -56 Calculate (1872/(-24))/((-1008)/(-72)). -39/7 Evaluate ((-40)/31)/((-366335)/(-439602)). -16 ((-8)/(-56))/(45(-13)/14742) -18/5 What is (13095/(-873))/((-1)/(-3))? -45 What is the value of (130/(-40))/((-2574)/6072)? 23/3 Calculate 50(-42)/1454/(-675)(-10)/6. -20 Evaluate 562/4215106/(-371). -4/105 4/(-7)1554/(-2072)(-8)/(-18) 4/21 141825/(-1220)(-24)/10(-10)/(-45) 62 Calculate (30/(-9))/(70/21)97. -97 Evaluate (37/(-148))/((33/588)/(-11)). 49 What is the value of 5(-211)/((-52750)/(-4400))? -88 3780/312(-1140)/(-5985) 30/13 What is the value of 160/100(-20)/(-16)(-261)/362? -29 6/(-156)35/63018 -1/26 Evaluate ((-585)/(-60))/3952/26. 1/2 Calculate 6/(-9)((-225)/4)/((-423)/282). -25 (11/11)/((-91)/((-3276)/144)) 1/4 12444/7932834/(-436) -102 Calculate -18((-780)/(-4290))/((-9)/(-154)). -56 What is 1/((-36)/6)-699/1287? 1/13 What is (-1299)/(-69713)-8(-21)/72? 1/23 Calculate (71/((-1988)/120))/(((-177)/(-295))/((-14)/(-2))). -50 What is the value of ((-60)/(-280)(-144)/162(-9)/(-6))/2? -1/7 Calculate 3((-17)/((-918)/(-12)))/((-8)/8). 2/3 What is the value of (-15)/(-45)((-6)/(-30))/((-77)/35)? -1/33 ((-109440)/64)/(-30)-16/27-3 38 What is the value of 4743/2108(-21)/((-378)/480)(-1)/(-4)? 15 What is ((-1)/(-144)(-208)/(-52))/1? 1/36 Evaluate (-5(-67)/(-15))/((-15)/(-135)-3). 67 Evaluate (-26)/11745927/189. -54 What is ((-69)/((-69)/14))/(484/480)? 20 What is the value of ((-489540)/(-59700))/(82/34)? 17/5 (16/(-224)-12)/(21/(-588)) -24 Evaluate 48/144(-17)/(170/30)2/(-26). 1/13 (-1305)/(-15)170/(-510) -29 (168/7)/4(-1117/(-9))/7 74 What is the value of (-43)/2451-3613? 19 ((-59)/(-4307)73)/((-1)/((-368)/4)) 92 What is the value of ((-279140)/(-12315))/((-2)/(-3))? 34 Evaluate ((-37332)/(-315))/122-7. -34/5 Evaluate 3(-4334/(-1462))/(1/(-35)). -105 77/28(-264)/(-484) 3/2 Evaluate (((-5187)/(-28))/19)/(1164/(-3104)). -26 What is the value of ((((-418)/(-99))/19)/((-40)/(-36)))/((-24)/750)? -25/4 What is the value of (68/((-3264)/96))/394? -1/197 (10(-57)/10260)/((-8)/(-18)) -1/8 What is the value of 441/((-227556)/(-344))27/(-8)? -9/4 What is the value of (858/121)/(-13)1881/(-57)? 18 Evaluate ((-39)/(-7))/((-81)/(-17577)93). 13 Evaluate ((-6)/594)/((-311)/6842). 2/9 What is the value of 4/(-14)((511056/81)/104)/(2/(-6))? 52 Calculate (-92)/69-66111/(-22). -44 (2/(-1))/(-18)-2125/(-210) 5/18 What is the value of ((-483)/(-92)(16/28)/(-2)2)/1? -3 (((-2)/(-3))/(10/126))/(((-748)/330)/(-34)) 126 (1568/1862)/((-55)/55) -16/19 (2-2)/((-483)/7-1)144/(-128) 3/46 What is 10/5-182/72? -1 (-63)/7938-672-15(-6)/(-4) -120 What is the value of 4(-1)/29/((-99)/220)? 40 Evaluate (1672/(-88))/24713/(-4). 1/4 (194/(-4))/((14/(-756)*-99)/((-121)/(-33))) -97 Evaluat	{ "pile_set_name": "DM Mathematics" }
3)(h/(h/(h/(h/(hh(1/3))))))/h assuming h is positive. h(-13/3) Simplify nn3n(4/3) assuming n is positive. n(16/3) Simplify (z/((zz1z)/z))/(z/(((zzz/z*2z)/z)/z)) assuming z is positive. z(-2) Simplify ((i(1/2))(-4))9 assuming i is positive. i*(-18) Simplify ((r(r/(rrr*8))/rr)/r)(-6/5) assuming r is positive. r(54/5) Simplify (c/((c/(c(c(2/7)/c)/c))/c)c)3/(c(-1/2)/c(-2)) assuming c is positive. c(33/14) Simplify u/u*(2/5)u/u(2/39) assuming u is positive. u(302/195) Simplify (p*(-15/7)/p)/(pp(-37)) assuming p is positive. p(230/7) Simplify (c(c/(c/(c((c/(((c*3c)/c)/c))/c)/c)))/c)*0((ccc0/c)/c)/c(1/3) assuming c is positive. c(-1/3) Simplify k31/k(-11) assuming k is positive. k42 Simplify (l1)(-49)/(ll1)(2/37) assuming l is positive. l(-1817/37) Simplify (ii(-33))29 assuming i is positive. i*(-928) Simplify (b/((((b(b/(b(b(-18/7)/b)/b))/b)/b)/b)/b))/b(2/21) assuming b is positive. b(-2/3) Simplify (i1)34/(i(-3)iii(1/5)) assuming i is positive. i(174/5) Simplify (bb(-1/18))(-2/29) assuming b is positive. b(-17/261) Simplify (n(-1/3)(nn(-2/9)n)/n)(-19) assuming n is positive. n(-76/9) Simplify (f(-1))(-37)/((fff(1/2))/(f(-5)/f)) assuming f is positive. f(57/2) Simplify ((l(1/3)/ll)/(l(-2)l))(3/31) assuming l is positive. l(4/31) Simplify (yy/y0)/(yy*(-3))yyy*1yyy0 assuming y is positive. y9 Simplify (y*(-4/3)/(y/(yyy/(y/y(-15))y)))(2/17) assuming y is positive. y(-86/51) Simplify (g/g*10g13)45 assuming g is positive. g180 Simplify ((y(-1))39)(-47) assuming y is positive. y1833 Simplify t(-1/24)/(t/(t/t*(-19)tt)) assuming t is positive. t(503/24) Simplify t(-7)/tt((ttt(1/12))/t)/tttt/t*9t(-11)/t assuming t is positive. t(-299/12) Simplify b(-4/17)/(b(-1/19)b) assuming b is positive. b(-382/323) Simplify (cc*(-1/10)c)/(c(-9/2)/c) assuming c is positive. c(37/5) Simplify uuu*(2/3)uu(-2/35) assuming u is positive. u(379/105) Simplify (z26)(-10) assuming z is positive. z(-260) Simplify (((pp(-4/3))/p)/((p(1/4)/p)/p))(-24) assuming p is positive. p(-10) Simplify b/(bb/b(-23)bb)bb(-2/5) assuming b is positive. b(-127/5) Simplify (u(3/2)/u)(1/6) assuming u is positive. u(1/12) Simplify (s/s(-27))/(ss*18s) assuming s is positive. s8 Simplify v4/vv(-1/2)v assuming v is positive. v(7/2) Simplify (u3/u)/(((u*0uu)/u)/u)(u(-1/2))(-27) assuming u is positive. u(31/2) Simplify ((k(5/6)kk)/k*(2/11))/((kk/(k*(-7)kk))/k(-5)) assuming k is positive. k(-617/66) Simplify (k(1/3)/k)/(k(kk1)/k)(k/(k/(k*1/kk))kk)(-48) assuming k is positive. k(-440/3) Simplify (g(-7)/g7)(-21) assuming g is positive. g294 Simplify (b/b*(9/8)b)/(b/(b/(b/(b/(b/((((b/(b*(-3/4)/b))/bb)/b)/b)))))) assuming b is positive. b*(5/8) Simplify rr*(1/2)rr(r(rr*7r)/r)/rrr(r(-2/3))(-30) assuming r is positive. r(67/2) Simplify (y1)21y*(2/13)yy/(yy*(7/2)y) assuming y is positive. y(459/26) Simplify (a(-1))*22a*(1/2)a(-6/11) assuming a is positive. a(-485/22) Simplify (q/q0)/(q/q(-4/5))q(q*4qq)/qq2 assuming q is positive. q(36/5) Simplify (c(-24))(-1) assuming c is positive. c*24 Simplify (zz*(-13)zz)(8/13) assuming z is positive. z(-80/13) Simplify p(2/19)/p(5/3) assuming p is positive. p(-89/57) Simplify (ii*5i(-1/8))/(i(-1))(-24) assuming i is positive. i(-145/8) Simplify ((b/b(11/2))/b)/(b/b34) assuming b is positive. b(55/2) Simplify ((d/(d/d(2/19)))/dd(-1/4))/(d(-7)/(d/(d(-6)d))) assuming d is positive. d(901/76) Simplify (y(1/3)/yy)(-2/11)/(y/y8yyyy(-4/3)yy) assuming y is positive. y(36/11) Simplify (n/(nn/(n*(-1/4)/n))n)/(nn10) assuming n is positive. n(-49/4) Simplify (qq/q*(3/5))/((qqqq(q/q19)/q)/q) assuming q is positive. q(87/5) Simplify (w(-2)w(-2/5))(-7/5) assuming w is positive. w*(84/25) Simplify (zz/(zz(-8)/zz)zzz/z(-1/16))(-43) assuming z is positive. z(-8299/16) Simplify (g/g1)(24/5)g*(-2/3)g(-2/3) assuming g is positive. g(-4/3) Simplify ((r(4/7))(-36))(-2) assuming r is positive. r(288/7) Simplify ((j(-1/3))44)(9/11) assuming j is positive. j(-12) Simplify ((k/(kkk/(k*(-18)k)k))/k(-2/27))(7/5) assuming k is positive. k(-3766/135) Simplify ((p(-6))(-18))1 assuming p is positive. p108 Simplify (z1)(2/21)/(z(-1)zz)(-12) assuming z is positive. z(254/21) Simplify ((w(-17)/ww)/w19)(-3/13) assuming w is positive. w(108/13) Simplify (p4p)/(pp*(4/5))(p0)(-1/4) assuming p is positive. p(16/5) Simplify (f(-1/2)ff)2 assuming f is positive. f3 Simplify d*(1/33)/d(dd18)/d assuming d is positive. d(562/33) Simplify (www/(w/w(-17))w)(-33) assuming w is positive. w462 Simplify (((b/(bb(-2/5)))/b)/b)(12/11)/(b(-1/5)bb2) assuming b is positive. b(-50/11) Simplify (v(-2))(-38/5) assuming v is positive. v(76/5) Simplify m(-4/21)/((m/(m(5/6)/m))/m) assuming m is positive. m(-5/14) Simplify (tt/t(-5/7))(17/4) assuming t is positive. t*(323/28) Simplify (n/(n/(nn(-2/3))))(14/3)((n(-1/5)/n)/n)27 assuming n is positive. n(-2603/45) Simplify (i(1/3)/i)20/(ii/i1)(-31) assuming i is positive. i(53/3) Simplify f(-1/9)(ff*(-1/6)/ff)/ff(3/4)ff(-3)ffff assuming f is positive. f(89/36) Simplify rr/r*(-6/11)r(-11) assuming r is positive. r(-93/11) Simplify (b21)47 assuming b is positive. b*987 Simplify (qq*(-4/9)q/((q(-1/9)/q)/q))(1/24) assuming q is positive. q(11/72) Simplify m(-2/15)mmm/(m/m(-23)) assuming m is positive. m(-317/15) Simplify x/(x(-18)xx)xx(-2) assuming x is positive. x16 Simplify b(2/11)/b(5/3) assuming b is positive. b(-49/33) Simplify (mm(-2))3(m(1/3))(-12/11) assuming m is positive. m(-37/11) Simplify ll*(-3/8)ll(3/2)l*(-1/4)l/(l*0l) assuming l is positive. l(23/8) Simplify (i(-1))*1/(iiii*6iii/(ii(-1/10))) assuming i is positive. i(-121/10) Simplify ((vv/(v/(v/((vv(3/4))/v)))vv)/(v(-2/5)/vv))/(v*2/vv/(v/v*1vv)) assuming v is positive. v(73/20) Simplify (k0/k2)/(k(-5)kk(3/4)/k) assuming k is positive. k(9/4) Simplify ((t/(t6/t))/t8)/(t/((t/(t(-1/4)t))/t))(-1) assuming t is positive. t(-41/4) Simplify ((s/(((s(s(1/5)/s)/ss)/s)/s))/s)/(s*5/s)ss/((ss/s*5)/s)s(2/9) assuming s is positive. s(181/45) Simplify (uuu*(-2/15)uu)/(u/(u/u(-4/5))) assuming u is positive. u(14/3) Simplify ((hh*(-7))/hh)(-18) assuming h is positive. h108 Simplify g*(-15)ggg/(gg(-14))g assuming g is positive. g2 Simplify (j(-2)j(-2/7))/(j3/jjjj1) assuming j is positive. j(-51/7) Simplify (d(-1))18/(d(1/3)/(d4/d)) assuming d is positive. d(-46/3) Simplify m(3/8)/m*(-6)((m/m0)/m)/(m3/m) assuming m is positive. m*(35/8) Simplify ((rr*(2/13))/r)/rrr(-13) assuming r is positive. r(-167/13) Simplify (c/c(-12)c/(c*(1/6)c)c)(10/3) assuming c is positive. c(415/9) Simplify (zz*(1/6)zz(z*(1/18)z)/z)/(zz(2/5))(-5/6) assuming z is positive. z(79/18) Simplify (oo*(-1/4)o)(-2/7)/((o/o(2/33)oo)/oooo(o(o/o(-2/11))/o)/oo) assuming o is positive. o*(-437/66) Simplify ((mm/((m*(18/11)m)/mm))/m)/m43 assuming m is positive. m(-491/11) Simplify (b(-5))(-29) assuming b is positive. b145 Simplify ((p(-2))38)11 assuming p is positive. p(-836) Simplify (c/(c/((cc(2/9))/c)))/c3(c/(c/(c/(ccc(-2/3))))c)(-14) assuming c is positive. c(-109/9) Simplify (i*(5/2)i)/i*(-3/5)(i1)49 assuming i is positive. i(531/10) Simplify (d(-4/9)/d*(-6))/(((d/(dd/((d*1dd)/d)))/ddd)/d)(-1/18) assuming d is positive. d(101/18) Simplify (z4)9 assuming z is positive. z36 Simplify ((l/l(-2/11)l)/l)/l(1/2) assuming l is positive. l(15/22) Simplify y*(1/6)/(y/((yy/((y*(-4/3)/y)/y))/y)y)*(	{ "pile_set_name": "DM Mathematics" }
in the form mw + s + zw*2 and give s. -2 Rearrange -277p + 163 - 163 to c + hp and give h. -277 Rearrange (6o*3 + 2o*3 + 5o*3)(-8 - 19 + 19) to lo3 + p + no + uo2 and give l. -104 Express (-4p2 + p2 + 5p2)(-p - p + 0p) + 593p*3 + 2p*2 + 3 - 2 - 594p*3 - 6p in the form dp + jp*3 + q + bp*2 and give j. -5 Rearrange (3v2 - v2 + 0v2)(-4v + 26 - 2v + 49 - 33) to pv2 + iv*3 + ov + x and give i. -12 Express (-151m2 - 24m*2 - 5m*2)(-2m + 4 - 4 + (3 + 3 - 4)(-2m + 2m - m) - 3m - m + 2m) in the form hm + pm*3 + v + qm*2 and give p. 1080 Rearrange -815r*2 - 829r*2 + 1040r*2 + (-3 + 2 + 2)(0 + 2r2 + 0) + 0r*2 + 3r*2 - 2r2 - r2 + 5r2 - 3r*2 to ar*2 + w + ur and give a. -600 Express (1869 + 30x2 - 1869)(-2x - 11 + x2 + 11) - 3x4 + x3 - x*3 - 2x*4 + 2 - 2 as ax + p + ux4 + zx*2 + wx*3 and give w. -60 Express -j + 27j + 54j in the form k + gj and give g. 80 Rearrange (-8 - 12v + 8)(-3 + 3 - 1)(3 - 2 - 2 - 3 - 3 + 2 + 2 - 3 - 1 + (2 + 1 - 4)(3 + 1 - 2) + 0 + 2 - 4) to the form s + lv and give l. -132 Rearrange (7s - 23 + 23)(-s + 3s + 0s)(3s - 4 + 1 + 4)(4 - 4 + 1) to the form t + us2 + xs*3 + zs and give x. 42 Express 29j - 180j + 31j as bj + n and give b. -120 Express (-16j3 + 15j*3 + 21j*3)(4 - 7j - 4 + (2j + 2 - 2)(-2 + 3 - 3)) in the form yj*2 + h + rj*4 + cj + fj3 and give r. -220 Rearrange -130 + 397n*2 - 136 + 266 - 2n to the form zn2 + un + b and give z. 397 Express 8 + 232t - 22 + 14 in the form v + kt and give k. 232 Express -202k - 877k + 2 + 1 - 3 as w + ak and give a. -1079 Express (-36v - 1 - 107v - 58v)(2v + 2v - 2v)(v + v + 0v) in the form kv + tv*2 + nv*3 + g and give t. -4 Rearrange (-3 + 0 + 4)(-6c + 25c + 2c)(23 - 1 + 6) to m + kc and give k. 588 Express 7568n - 5047n - 2 + 2 in the form z + tn and give t. 2521 Express -5 + 5 - 5u + (-2u - 3u + u)(2 - 2 - 3) in the form q + zu and give z. 7 Rearrange (23z - 23z + 4z*3)(4 + z + 19 - 13) + z*4 - 2z*2 + 2z*2 to pz*2 + s + bz*3 + jz*4 + kz and give j. 5 Express 5 - 7 + 22g + 2 in the form yg + r and give y. 22 Rearrange (-5 + 3 + 1)(3a - 3a - 2a) + 156a + 26a - 50a to the form za + p and give z. 134 Rearrange (-1 - 4d2 + 1)(35 - 12 + 18) to the form i + gd2 + xd and give g. -164 Rearrange -4 + 2q + 12q*3 - 2q*2 - 3 - 153q*4 + 5 + 155q*4 to zq*3 + r + uq*4 + xq*2 + kq and give u. 2 Express 25a2 - 94a + 94a - 269a*2 in the form da + wa2 + l and give w. -244 Express (29 - 27 - 70)(-2 + 2 + 5)(4b*3 - 6b*3 + 3b*3) as ub + qb3 + o + wb*2 and give q. -340 Express (31 - 76 - 20)(-14j3 + 8j*3 + 5j + 3j3) in the form ij*3 + xj + oj2 + g and give i. 195 Rearrange 36 + 39 + 2024o - 590o + 38 - 112 to jo + d and give j. 1434 Express -y + y + y + (3 + 2y - 3)(1 + 4 - 4) + (7 + 3 - 6)(-2 + 3 + 1)(10 + 11 - 60)(-1 + 2y + 1) as ly + s and give l. -621 Rearrange -3354b + 6220b - 3386b to g + mb and give m. -520 Express 2g2 - 2 - g3 + 5g4 - 7g*2 - 7g + 5g3 - 11g*4 + 4g*4 as ng*2 + rg*3 + bg*4 + p + xg and give n. -5 Express 52p2 + 2p*3 + 6883p + 3 - 6883p as o + rp*3 + xp + dp2 and give o. 3 Rearrange (-89b + 53b + 11b*2 + 31b)(-3 - 1 + 3) - 5b*2 + 4b*2 + 3b*2 to nb + qb2 + r and give n. 5 Rearrange -153t - 154t + 316t - 2t3 - t4 to the form jt + mt2 + q + yt*3 + dt*4 and give y. -2 Express (2 - 4 + 4)(15b4 + 18b*4 - 18b*4) - 3b*4 + 0b*4 - 4b*4 in the form lb + sb4 + ub*3 + yb*2 + x and give s. 23 Rearrange 832c + 2 - 832c - 24c*2 to the form qc*2 + nc + h and give q. -24 Rearrange -10l3 + 11l*3 + 0l + l*2 - 2l - 4l2 to f + bl + wl3 + nl*2 and give w. 1 Rearrange 17a + 26a - 373 + 15a + 748 - 369 to the form x + ca and give x. 6 Express -519n - 272 - n*4 + 257n + 260n - 4n*2 + 6n*2 in the form l + fn*4 + kn + hn3 + dn*2 and give f. -1 Express 48k + 175k2 + 180k*2 + 178k*2 - 526k*2 as ck + xk2 + g and give c. 48 Express -5 - q3 - 2q*2 + 2q*3 - 7q + 0q as cq + zq2 + v + kq*3 and give k. 1 Rearrange (-h - 3h + 2h)(7 + 4 - 3) + 6h + 3h + 86h to the form xh + b and give x. 79 Rearrange -7 + 483z - 3 - 9 + 19 to l + kz and give k. 483 Rearrange -3f2 - 4f4 + f2 + 7f4 - f4 + f - 1 + 5f*3 + 3f*2 to the form qf*3 + tf + o + sf4 + yf*2 and give y. 1 Rearrange (316w + 25 - 630w + 320w)(0w - 3w + 4w) to dw + o + xw*2 and give d. 25 Rearrange (-49l*2 + 49l*2 + 14l*3)(1 + 4 - 3 - 2 - 3 + 3 + (4 + 4 - 5)(2 + 0 + 0)) to ol*2 + bl*3 + cl + q and give b. 84 Express (23543g2 - 11406g*2 - 13849g*2)(3g + 2g - 4g) in the form t + ng*3 + pg*2 + ig and give n. -1712 Rearrange ((-50 + 6 - 25)(1 - 3 + 0) - 2 - 1 + 0)(-4p3 + 4p*3 + 2p*3) to yp + up2 + s + bp*3 and give b. 270 Rearrange 182p*2 - 3p - 366p2 - 51 + 183p*2 to the form mp*2 + b + kp and give k. -3 Rearrange -b*2 + 2b*2 - 6708b + 0 + 6708b - 12 to the form y + pb + ib2 and give y. -12 Rearrange 225r*2 + 126r*2 - 111r*2 to pr + nr2 + s and give n. 240 Rearrange 2 - 5 + s2 + 0s*2 + 1 - 10s to ds + is*2 + t and give i. 1 Rearrange 2d*3 + 9d*2 - 577d*4 + 1158d*4 + 6d - 2 - 582d4 to hd*3 + qd*2 + s + ud*4 + jd and give s. -2 Rearrange -7r2 - r2 - 45r*3 + 3 - 4 + 2r*2 + 2r*2 to the form dr*3 + sr*2 + xr + f and give s. -4 Rearrange 457q2 + 781q*3 - 227q*2 - 230q*2 + (-2q*2 - 2q*2 + 2q*2)(-4q - 3q + 5q) to the form xq + gq3 + hq*2 + c and give g. 785 Rearrange 6n - 598n4 + 3 + 600n4 + n3 - 19n to the form qn*2 + ln*3 + xn + s + zn4 and give z. 2 Express 1283u + 50u2 - 1283u + 0u2 as w + ku + gu2 and give g. 50 Rearrange 66k*2 - 365k - 67k2 + 402 + 364k to the form ck2 + pk + o and give o. 402 Rearrange -t*3 + 0t*3 + 3t*3 + (-480 + 2t*3 - 16t + 480)(-3 - 5 + 4) to dt*2 + ft + nt3 + g and give n. -6 Rearrange -24r*4 + 2r - 3 + 5 - r*3 + 14r*4 to the form mr*4 + ar*2 + z + hr + ir3 and give z. 2 Rearrange 43i*2 - 66i*2 - 234i*2 - 5i + 2i2 + 5i + (3i - 4i + 0i)(-2i + 3 - 3) + i - i2 - i to k + ai*2 + ni and give a. -254 Rearrange (1 + 5 - 3)(-3z2 + z2 + 7z2) + 18z - 45z + 17z + 8z2 to the form w + az + cz2 and give w. 0 Rearrange 29 - 101 + 916a*2 - 917a*2 to the form ia + r + ua2 and give r. -72 Rearrange -139k*2 + 3k*4 - 1 - k + 128k2 - k4 to the form zk3 + vk*4 + wk + pk2 + x and give x. -1 Express (1 + 3 - 3)(1 + 3 - 6)(2b - 3b - b)(48b - 15b - 2b)(2b2 + b2 - 4b*2) as c + mb + kb2 + ib*3 + vb4 and give v. -124 Rearrange 37 - 11 - f3 + 7f3 - 10f*3 to the form af + zf2 + h + yf*3 and give h. 26 Rearrange -17z - 2 + 4z + 7z + 8z to the form a + nz and give a. -2 Rearrange (-2 - l*2 + 2)(0l + 11l - 2l) + (4l*3 + 11l3 - l3)(2 - 1 + 0) to the form il*2 + ql*3 + xl + u and give q. 5 Express n + 7 - 10 + 4 + (29 - 4n - 29)(0 - 2 + 5) as on + p and give o. -11 Express 2s*2 - 4s + 14 - 3s4 + 5s - 2s4 - s3 - 33 + 20 in the form ts*4 + r + is + ms3 + js2 and give t. -5 Rearrange -z2 - 15z4 - 62 + 14z*4 + 68 - 8z*3 to the form fz + tz3 + yz*4 + sz*2 + n and give y. -1 Express -33x*2 - 5x + 29x2 + 4x - 3x3 - 16x*4 + 0x in the form hx2 + fx + ox3 + s + cx*4 and give c. -16 Rearrange 43485 - 43485 - 860t*2 to the form lt*2 + u + zt and give l. -860 Rearrange -1330c2 - 782c*2 + 3185c*2 to o + dc*2 + mc and give d. 1073 Rearrange (-137 + 3p + 137)((3 - 2 - 2)(-5 + 0 + 2) - 2 + 1 + 0 + (0 + 3 - 1)(1 + 0 + 0) + 1 - 2 + 0) + p - p + 2p to the form q + dp and give q. 0 Express -57113m + 57119m - m*2 - 12m*2 in the form cm*2 + vm + w and give c. -13 Rearrange ((51 - 76 - 70)(-5s + 2s + s) + 3s + 2s - 4s)(s - 4s + s) to x + gs + js**2 and give j. -382 Rearr	{ "pile_set_name": "DM Mathematics" }
hat is 0 + -42? -42 In base 7, what is 34 - -11? 45 In base 10, what is -1 - 15? -16 In base 16, what is 1 - -4f? 50 In base 13, what is -4a - -1? -49 In base 13, what is 2 - -3c7? 3c9 In base 2, what is -10011 - -11011? 1000 In base 7, what is 6 + -2004? -1665 In base 5, what is -1100 + 412? -133 In base 11, what is 899 + 2? 8a0 In base 5, what is -4 + -13113? -13122 In base 8, what is 2 - 14? -12 In base 14, what is -2b04 - -3? -2b01 In base 13, what is -13 + 22? c In base 16, what is 8 - 22? -1a In base 13, what is -3 - 4? -7 In base 11, what is -62 - 25? -87 In base 12, what is 2 - -722? 724 In base 8, what is 30 - -163? 213 In base 6, what is 115053 - 2? 115051 In base 15, what is 3318 - -1? 3319 In base 7, what is -1231 + -5? -1236 In base 13, what is 100 + 5? 105 In base 3, what is 2111 - -10122? 20010 In base 6, what is -3 + -2502? -2505 In base 4, what is 31 + -11? 20 In base 9, what is 306 + 5? 312 In base 12, what is 0 - 144? -144 In base 3, what is 0 + 122? 122 In base 10, what is 9 + -15? -6 In base 13, what is 12b - 5? 126 In base 8, what is -1200 - -1? -1177 In base 4, what is 3003 - -3? 3012 In base 8, what is 452 - -5? 457 In base 10, what is 91 + 194? 285 In base 8, what is -35 - -76? 41 In base 9, what is 6 - -772? 778 In base 9, what is -3 - 22? -25 In base 15, what is -3 + 6a? 67 In base 10, what is 242 - -29? 271 In base 6, what is -20 + 20502? 20442 In base 10, what is 19621 + 1? 19622 In base 12, what is -197 + -3? -19a In base 13, what is -c6 - -4? -c2 In base 9, what is -31 + 145? 114 In base 6, what is 20451 + -4? 20443 In base 16, what is -5 + 4e? 49 In base 14, what is -3 - -30? 2b In base 9, what is 10 - 1053? -1043 In base 15, what is 4 + 3? 7 In base 10, what is -24 + 16? -8 In base 14, what is -1c - 3? -21 In base 2, what is -1111000110 - 10? -1111001000 In base 6, what is -25 + 15? -10 In base 4, what is -2 - -20? 12 In base 3, what is 100212 + 1? 100220 In base 13, what is 2a4c - -5? 2a54 In base 4, what is 3203 - 10? 3133 In base 10, what is 0 + 9? 9 In base 10, what is -49 + -103? -152 In base 7, what is -3 - 563? -566 In base 16, what is -2 - b? -d In base 4, what is 2321 - -22? 3003 In base 8, what is -4 - 4102? -4106 In base 2, what is -11101 + -1111101? -10011010 In base 5, what is -1040 + 10? -1030 In base 7, what is 5 - -2634? 2642 In base 9, what is -6 + -76? -83 In base 2, what is -111111100001 - 10? -111111100011 In base 9, what is -4413 - 11? -4424 In base 2, what is -10011101 - -1011? -10010010 In base 3, what is 110211 - 12? 110122 In base 14, what is 5c4 + -5? 5bd In base 4, what is -30012 + -3? -30021 In base 11, what is 379 - -58? 426 In base 9, what is -22 - -36? 14 In base 16, what is -2 - -58? 56 In base 5, what is -21023 - -13? -21010 In base 3, what is 0 + -210000? -210000 In base 4, what is 0 - -2032? 2032 In base 9, what is -58134 + 0? -58134 In base 11, what is 38251 - 4? 38248 In base 3, what is 0 - -1220? 1220 In base 10, what is 877 - 1? 876 In base 6, what is 134 - 11? 123 In base 9, what is 3 - -877? 881 In base 2, what is 1010101 - -110? 1011011 In base 15, what is 1937 - 5? 1932 In base 6, what is -1433 + -1? -1434 In base 8, what is -70 - -7? -61 In base 3, what is 12 - -1100202? 1100221 In base 3, what is 12 - -100101? 100120 In base 9, what is 236 - -1? 237 In base 10, what is 2 + -557? -555 In base 4, what is 21 + 11? 32 In base 16, what is 3de - -1a? 3f8 In base 8, what is 73 + -4? 67 In base 13, what is 3 + 169? 16c In base 12, what is 6 - 409? -403 In base 15, what is -4a - 3? -4d In base 15, what is -4 + -545? -549 In base 13, what is 10 + 2? 12 In base 11, what is -36 - 15? -50 In base 13, what is a - a3? -96 In base 3, what is 1100201 - 2? 1100122 In base 8, what is 3 + -15305? -15302 In base 4, what is 3032100 + 10? 3032110 In base 5, what is -444 - -30? -414 In base 2, what is 0 - 100100? -100100 In base 9, what is 3 - -44? 47 In base 7, what is 123643 - -4? 123650 In base 4, what is -10 + 1203102? 1203032 In base 12, what is -259 + 1? -258 In base 12, what is -9 + -9? -16 In base 11, what is -135a - 1? -1360 In base 4, what is 12 - 3? 3 In base 16, what is -1 - 208d? -208e In base 10, what is 270 + 1? 271 In base 16, what is -1ee + -5? -1f3 In base 7, what is -5 - -42? 34 In base 12, what is 72 + -3? 6b In base 6, what is -1505 - 20? -1525 In base 5, what is 2 - 123443? -123441 In base 7, what is -1562 + 1? -1561 In base 12, what is 9 - 21a? -211 In base 16, what is 110 + 7? 117 In base 10, what is -43 + 4? -39 In base 16, what is 33 + -2e? 5 In base 11, what is 11 - -52? 63 In base 13, what is -5 + 1073? 106b In base 3, what is 11011102 - 11? 11011021 In base 8, what is -1076 + -3? -1101 In base 2, what is 100 - -1111000100? 1111001000 In base 4, what is -111 - -10? -101 In base 12, what is a - 91? -83 In base 12, what is 3 - -351? 354 In base 8, what is 15 - 12? 3 In base 3, what is -21 - -10020? 2222 In base 5, what is 44 + -4? 40 In base 16, what is -14ef + -4? -14f3 In base 7, what is 4 + 22? 26 In base 2, what is -10 - -110001? 101111 In base 3, what is 110200 + 100? 111000 In base 16, what is 3 - -391? 394 In base 11, what is 86a8 + 2? 86aa In base 15, what is 1d - a? 13 In base 16, what is 2 + 31? 33 In base 6, what is 33 + 1? 34 In base 5, what is -412 + -102? -1014 In base 9, what is -5 - 448? -454 In base 3, what is -102222120 - 12? -102222202 In base 5, what is -10 + 1403? 1343 In base 6, what is 14144 + -4? 14140 In base 2, what is 101 + -11011001? -11010100 In base 12, what is 3 + -b7a? -b77 In base 4, what is 2330 - 12? 2312 In base 8, what is 5 + 11124? 11131 In base 6, what is 3 - -123? 130 In base 7, what is 0 + 623? 623 In base 4, what is 20 - -101? 121 In base 3, what is -11100 - 12? -11112 In base 13, what is 4 - 481? -47a In base 5, what is 0 + 234? 234 In base 7, what is 121 + 0? 121 In base 5, what is 11 + 3423? 3434 In base 5, what is 144 + 10? 204 In base 5, what is 0 + -34? -34 In base 4, what is 133 + 0? 133 In base 14, what is -42 - a7? -109 In base 10, what is -1580 + 1? -1579 In base 13, what is -30 - -4? -29 In base 12, what is -27 + -13? -3a In base 14, what is 258 - -5? 25d In base 2, what is -110 - -10101? 1111 In base 10, what is -6 + -3427? -3433 In base 2, what is 10 - -11000010? 11000100 In base 10, what is 486 + 5? 491 In base 10, what is 6 + -83? -77 In base 15, what is -1b - c? -28 In base 5, what is 321 + 1? 322 In base 16, what is -1c - -114? f8 In base 5, what is 2444 + 4? 3003 In base 15, what is -1 + -26e? -270 In base 6, what is -2 + 135? 133 In base 6, what is -3 + 4301? 4254 In base 16, what is -d + 1? -c In base 12, what is 5 + 60? 65 In base 10, what is 5 + -15? -10 In base 5, what is -10242 + 3? -10234 In base 2, what is -1101111 - 10? -1110001 In base 8, what is 1731 + -2? 1727 In base 7, what is -3 + 222? 216 In base 6, what is -1402 + 3? -1355 In base 4, what is -31 - -1032? 1001 In base 8, what is -20 - -3? -15 In base 12, what is 14 + -6? a In base 11, what is 9 - 107? -a9 In base 16, what is c4f + -5? c4a In base 11, what is -4 - 4553? -4557 In base 16, what is e - -58? 66 In base 9, what is 511 - 4? 506 In base 11, what is 8 + -6? 2 In base 7, what is 343 + 3? 346 In base 6, what is 5314 - 3? 5311 In base 16, what is 3b - -8? 43 In base 13, what is 2140 + -4? 2139 In base 11, what is -23 + 3? -20 In base 7, what is 14 + 1201? 1215 In base 9, what is 3 + 370? 373 In base 8, what is 1 - -2241? 2242 In base 5, what is 13241 + 0? 13241 In base 3, what is 11 + -12? -1 In base 7, what is -3 + -430? -433 In base 3, what is -2121212 + -1? -2121220 In base 16, what is -13d + 1? -13c In base 6, what is -4 + 5345? 5341 In base 15, what is -14 - -a5? 91 In base 4, what is -10310 - -13? -10231 In base 16, what is -18 + -3? -1b In base 6, what is -3 - 4? -11 In base 2, what is 10000101 + 0? 10000101 In base 2, what is 101101001 - -1? 101101010 In base 3, what is -100 + 22222? 22122 In base 6, what is 2134 - 3? 2131 In base 3, what is 2 + 1112? 1121 In base 2, what is 0 - -1010001? 1010001 In base 6, what is 101001 + 5? 101010 In base 7, what is -223 - -3? -220 In base 15, what is c30a + 2? c30c In base 7, what is -3 + 60? 54 In base 14, what is 41 + -5? 3a In base 3, what is -101011 - 12? -101100 In base 14, what i	{ "pile_set_name": "DM Mathematics" }
= -3k + 12 for k. -4 Solve c - 5x = 25, -21x + 18x = 12c - 48 for c. 5 Solve -9o = -12o - 15, -5o - 23 = 2r for r. 1 Solve -3f + 4x + 7 = 0, -7f = -2f + 5x + 35 for f. -3 Solve i - 4j + 3 - 1 = 0, -5j = 5i + 10 for i. -2 Solve 0 = 2n - 5h - 25, 10h = -2n + 12h + 16 for n. 5 Solve 3q + 5l - 17 = 2q, 0 = 2q - 2l + 14 for q. -3 Solve -5c + 4l - 41 = 0, 2l + 3 = -4c - 9 for c. -5 Solve 3m + 12 = o, 24 = -m + 19 for o. -3 Solve 10 = -5b - 0b, -3b - 26 = -4v for v. 5 Solve 4g = 16, -5z + 2g + 3g - 20 = 0 for z. 0 Solve 354y - 3t + 11 = 355y, 5t = 2y for y. 5 Solve -5n + 4w + 11 = 0, 3w - 1 = -4n - 17 for n. -1 Solve 0 = -h + 5j - 15, 0 = -3j + 4j - 4 for h. 5 Solve -s - 7 = -3v, 3v + 2s - 4 = 9 for v. 3 Solve -4 - 11 = 5r - s, 35 = -5r + 5s for r. -2 Solve 0 = -6m + 2m + 5g - 4, -5m - 5 = -2g for m. -1 Solve 5m + 4r - 11 = 0, 4m - 5r = 8 - 32 for m. -1 Solve 0 = -4x - c + 5, 179 = 4x - 2c + 189 for x. 0 Solve -115b + 116b = -5o - 11, 3b = -5o - 13 for o. -2 Solve 0 = -2f + 3w - 12, -5f + 1 + 7 = 2w for f. 0 Solve 20 = -3l + 2x, 12 = 214l - 213l + 4x for l. -4 Solve -3t + 25 = -5d, -4t - 2d - 5 = -d for t. 0 Solve 5g - 7g = -5u + 27, 0 = -4g - 3u + 11 for g. -1 Solve 65w - 2t = 62w - 25, -4t = 5w + 5 for w. -5 Solve -5x + 6 - 22 = 2f, x = -4f + 4 for f. 2 Solve 4f + 0f + 15 = 3j, -4j - 3f + 20 = 0 for j. 5 Solve -4x - 5 = u, -x - 1 + 6 = -u for x. 0 Solve 3k + 4x = 4, -13 = -k - 4x - 1 for k. -4 Solve 0 = 5w - 2o - 5, -w + 5o - 3 + 27 = 0 for w. -1 Solve -3g - 22 = -4w, 5w - 23g + 25g = 16 for w. 4 Solve 2s + 20 = 2d + 6, 5d + 2s = 0 for d. 2 Solve 4c + 6 = 2m, -4c + 10m + 6 = 12m for c. 0 Solve -2y - 20 = 5n, -21 = 3y + 4n - 12 for y. 5 Solve -5n = -3u - 9n + 14, 4u + 2n = 2 for u. -2 Solve -5r - 2o + 34 = 0, 7 = 2r - o - 3 for r. 6 Solve -5i + 6 = 3p - 26, p - 20 = -4i for i. 4 Solve 2c - 4b = 14, 0 + 5 = 3c - 2b for c. -1 Solve 3m + 15 = -3i, 4m = -5i - 15 - 10 for i. -5 Solve -3v + 71u - 73u - 16 = 0, -2u = -5v - 16 for v. -4 Solve 2o - 10 = 0, 4l + 2o - 17 = -3o for l. -2 Solve -3z - 4i - 27 = -0z, 5i = 2z - 5 for z. -5 Solve 24 = -3t - 12q + 7q, 2t + 5q = -21 for t. -3 Solve 9 = 3j - 0c + 3c, 7 = 3j + 4c for j. 5 Solve 9 = -5z - 4y, 0 = -0z - 4z + 4y for z. -1 Solve 0 = 5a + 2x - 10, -136x - 40 = -5a - 132x for a. 4 Solve -a - 4w - 1 = -0w, a - 3w + 8 = 0 for a. -5 Solve -2s + 5s + 5f = 11, 0 = -2s + 5f - 1 for s. 2 Solve 2w = 2m - 8 + 14, 5 = -4m - 3w for m. -2 Solve -w = -3w + 3v + 8, w + 4v - 4 = 0 for w. 4 Solve 4h = 4u + 24, 5u - 5h + 6h = 0 for u. -1 Solve -2j + 6 = 4u, 18u - 9 = 4j + 19u for j. -3 Solve 0 = -3d + 2x - 8, 4x - 8 - 2 = 3d for d. -2 Solve 2f - 4b + 8 = 0, f + 9b - 5 = 8b for f. 2 Solve 0 = u + n, -4n = -8u + 9u - 6 for u. -2 Solve -5o - 4v + 0 - 15 = 0, 5o = 3v - 15 for o. -3 Solve 0 = -23x + 28x - 2j - 5, x + 22 = 5j for x. 3 Solve 3z = -0z - 4a + 31, -5z = -3a - 13 for z. 5 Solve 0 = 5l - b, b + 2b - 20 = -5l for l. 1 Solve 0 = 5j + h + 9, 3j + 0j = -h - 5 for j. -2 Solve 4p - 18 = 5s, 4p = -0s + 2s + 12 for s. -2 Solve 5n = -2l - 21, -l + 2l - 6 = 3n for l. -3 Solve 2s = -5j + 14, 2s = 4s - 3j + 18 for s. -3 Solve -3f - 2a - 2a = -3, 5a = -5f for f. -3 Solve 10k - 14k = -2n - 20, -2n = 2k + 2 for n. -4 Solve -340l + 338l + 13 = 3q, 2l = -5q + 15 for q. 1 Solve 3v + 2 = -3i + v, -13 = -3i - 5v for i. -4 Solve -2z + 3u = -13, 9 = z + 6u - 10u for z. 5 Solve -2u + 0u = 2s, 5u + 4s = -5 for u. -5 Solve -12 = 2l - 2b, -5l - 4b - 14 - 7 = 0 for l. -5 Solve 4 = -w, -13p - 12 = -12p + 2w for p. -4 Solve 5r - 8 = 2x, 2r = x + 12 - 9 for x. 1 Solve -4t + 24 = 2h, 0h + 4h - 23 = -3t for h. 2 Solve -34 + 11 = 5c + r, -3c + r - 17 = 0 for c. -5 Solve 4a - 3a - 3n = -2, a + 4n = 12 for a. 4 Solve 3p - 29 = -4u, p + 21 = 3p + 3u for p. 3 Solve -4j + 3v = 14, 0 = -2v - 0 + 4 for j. -2 Solve 4 = -5f - 2k, -k - 4 = k for f. 0 Solve 2y + 3i + 19 = 0, y + 2i + 12 = -0i for y. -2 Solve 2b = 3i - 0b + 9, -5i - 3b + 4 = 0 for i. -1 Solve -3h = 3j, -5h + h = -2j - 30 for h. 5 Solve 0 = 3q + 24l - 27l, -3q = 3l + 24 for q. -4 Solve -w - 69 + 68 = 2o, 0 = 5o + 3w + 2 for o. -1 Solve -j - 14 = -3m, 5j = -7m + 4m + 2 for j. -2 Solve 3g = 4o - 2g - 29, 15 = -3g for o. 1 Solve -2n + 26 = 4i, -3n + 2 = 4i - 29 for n. 5 Solve -u = -0l + 3l, -l = -2u + 7 for u. 3 Solve 3s - 7s - 8 = 5m, -2m = 0 for s. -2 Solve 0 = 3f + 3c, -22f = -18f - 4c + 32 for f. -4 Solve -s + 5 = -16k + 15k, -2k = 10 for s. 0 Solve 0r = 3r + 12, -20 = 4t + 4r for t. -1 Solve 4s + 3v - 20 = 0, 2v + 20 = 4s - v for s. 5 Solve -5f + t + 12 = 0, f + 2f + 5t - 24 = 0 for f. 3 Solve -2y = -2, -8 = -4z + 2z - 2y for z. 3 Solve -v - 10 = -5l, 4v + 5l = 2v - 5 for v. -5 Solve 12u - 14u = 3a - 18, 0 = -4a - 2u + 20 for a. 2 Solve 3c + 19 = 4r, 0r + r = 1 for c. -5 Solve 0 = m + 2j - 10, -1 - 24 = -3m - 5j for m. 0 Solve -q - 4q + 22 = -b, -2q = 3b - 2 for q. 4 Solve -27 = -3q + 3x, -8 = -44q + 40q - 3x for q. 5 Solve -2v - 24 = 3c + v, c = 2v + 1 for c. -5 Solve 2g - 8 = -2u, 0 = -4g + g + 3u for g. 2 Solve 3 = 3y - 3, 5v = 2y - 19 for v. -3 Solve -7b - 5t + 22 = -8b, 8 = -4b + 4t for b. 3 Solve 2b = -u - 1, -3 = -3b - 3u - 0u for b. -2 Solve 0 = 5y - 3a + 4, -y = -2a + 54 - 56 for y. -2 Solve -4i + 24 = -3u, 2 = -2u - 5i + 3i for u. -4 Solve 0 = -5t + 2c - 1, -2 = -2t - 35c + 37c for t. -1 Solve 4j = -g - 2, 2g - 4 + 0 = 0 for j. -1 Solve -2o = -8, 5o = 5p - 15 + 50 for p. -3 Solve -4d = 3m - 2, -m + 5m = 8 for d. -1 Solve 4y - 5 = -17, 6 = -3m + 2y for m. -4 Solve 5h = -u - 9, -10u = -13u - 12 for h. -1 Solve -5w + 4c = -18 - 28, 0 = -4w - c + 20 for w. 6 Solve -s + 3 = 3j, 0 = s - 7 + 10 for j. 2 Solve 0 = -5l - 3x + 29, -l - 4x = l - 20 for l. 4 Solve 3 + 1 = -3v - z, -8 = -2v + 2z for v. 0 Solve -3c = -25t + 28t + 3, 0 = c - 4t - 4 for c. 0 Solve 10 = -27m + 23m + 3x, 0 = -4m + x - 6 for m. -1 Solve -4s + 12 = 3d + s, 5d - 20 = -2s for d. 4 Solve 5b + 4 = -3z, -3z - 7b - 8 = -6b for z. -3 Solve 5z = -2d - 19, -43 + 30 = 2d + 3z for d. -2 Solve -16 = -z + 5y, 2 = -z - 2y - 3 for z. 1 Solve d = -3m, 3m + 5d = 6d for m. 0 Solve -1 = 3c + a, 4c + 3a = -10 + 2 for c. 1 Solve -3t + 2u + 7 + 3 = 0, 2u = -t - 2 for t. 2 Solve -3c + 9 = x, 2x - 3c + 12 = -6 for x. -3 Solve -2j = -0j, -4p - 8 = -3j for p. -2 Solve -4b = -m - 4, 4m = 5m + b + 4 for m. -4 Solve j + 1 = -3s + 7, 2s + 9 = -5j for s. 3 Solve 3h + 4a - 9 = 0, 3a - 7 = 4h + 6 for h. -1 Solve -20 = -5r - o, -3r - o + 4o = 6 for r. 3 Solve -32v = -31v - 3f + 15, -15 = 2v - 3f for v. 0 Solve 3l + 2b - 12 = 3, 0 = 4b for l. 5 Solve 0 = -2q - 5r + 33, -3q + 4r = -2 + 33 for q. -1 Solve i - 7 = -p, -2i - 8p = -4p - 24 for i. 2 Solve 2i = -3 - 7, l - 18 = 3i for l. 3 Solve 3r = 5x + 22, -r = 3x - 2 + 4 for x. -2 Solve -2u - u = 18, -5s + 2u - 8 = 0 for s. -4 Solve m + 5l - 8 = 0, -2m - 6 = -3m - 4l for m. -2 Solve 0 = v + 3w - 14, -5v - 4w + 12 = -14 for v. 2 Solve -6a + 3n = 18, -5a - 7 = -6a - 2n for a. -1 Solve -4s - 3r = -14, -22s = -25s + 3r for s. 2 Solve 4t + 4u + 26 = 2, 5u + 30 = 0 for t. 0 Solve -11 = -2q + 3y, -10y = 5q - 9y - 19 for q. 4 Solve 21 = c + 4p, -5c - 25 = -0c - 6p for c. 1 Solve 0 = -2n - 4, 4n - 7n = 3u + 24 for u. -6 Solve 4r - 2 + 0 = -2q, -5q + 3r = 21 for q. -3 Solve -25 = 3k + 5m, -3k - 2k = -m - 5 for k. 0 Solve -2h - 7 = -c, 3h - 3c = -7c - 5 for h. -3 Solve 4z + 20 = -5w, -5w + 0w - 20 = z for w. -4 Solve -s + 2z = -0s - 8, 2s = -4z for s. 4 Solve 5v - 6a + a = 0, 0 = -4v + 3a + 5 for v. 5 Solve 0 = -l - 4b + 18, -98l + 2b - 16 = -95l for l. -2 Solve -k = -5z + 28, 4k - 2z + 7 = 5k for k. -3 Solve -o + 12 = 8p - 4p, -28 = 2o - 5p for o. -4 Solve -n + 1 = 2f, -2f - 9n = -10n - 11 for f. 3 Solve 4v = -4b - 24, 7*b	{ "pile_set_name": "DM Mathematics" }
inder when 1/(-2) - s/4 is divided by 13. 11 Calculate the remainder when 143614/18 is divided by 33. 31 Let i(r) = -r3 - 5r*2 - 5r - 2. Let n be i(-4). Let v be 2/(1/n + -1). Calculate the remainder when (2/v)/(2/(-48)) is divided by 7. 5 Let n(t) = t - 7. Let i be n(11). Suppose -4 = -ij + 8. What is the remainder when 5 is divided by j? 2 Calculate the remainder when ((-2)/4)/((-8)/464) is divided by 17. 12 Let w(u) = -3u - 4. Let j be w(-3). Suppose jn - 49 + 19 = 0. Calculate the remainder when 17 is divided by n. 5 Suppose 16 = 4k - 0. Suppose 0 = -5r - kv - 3 + 30, 3v = -6. Suppose 2c - 5 = -1, -2z + 3c = -20. What is the remainder when z is divided by r? 6 Let w be ((-9)/(-6))/((-2)/12). Let u(x) = 2x2 + 10x + 6. Let g(p) = p2 - p - 1. Let d(y) = g(y) - u(y). What is the remainder when 31 is divided by d(w)? 9 Let y(d) = d2 - 3d + 2. Let o(r) = -54r - 3. Let h be o(-2). Suppose i - h = -2i. What is the remainder when i is divided by y(5)? 11 Suppose -68 = -2k - 0k + 3j, -2k + 88 = 2j. Calculate the remainder when 338/10 - (-8)/k is divided by 9. 7 Suppose p = -3q - q + 18, 5p + 5q = 75. Calculate the remainder when p is divided by 7. 0 Suppose -22 = -5p + d, 3d = -2p - 2d - 2. What is the remainder when 10 is divided by p? 2 Let k = 199 + -55. Suppose 3l - k + 3 = 0. What is the remainder when l is divided by 16? 15 Calculate the remainder when 9(-1)/((-9)/84) is divided by 17. 16 Let c = 7 - 4. Suppose 3o - 30 = cp, 4o - 3o = -2p - 5. Let a = 37 - 23. Calculate the remainder when a is divided by o. 4 Suppose -2x + 45 = -5b, -4x + 2b + 75 = -3b. Let q(c) = c2 + 4c - 6. What is the remainder when x is divided by q(-6)? 3 Suppose -3i - 3d + 468 = 0, -341 = -5i - 3d + 445. Suppose i = 5a + 24. Calculate the remainder when a is divided by 14. 13 Let h(m) = m3 - 2m*2 + m - 3. Let s be h(3). What is the remainder when 3/(-1)(-246)/s is divided by 21? 19 Suppose 3f + 5b + 16 = 0, 0 = 5f - b - 0b - 20. Suppose 7m = fm + 316. Suppose 5i - 246 = m. Calculate the remainder when i is divided by 22. 21 Let h(x) = 23x*2 + 4x - 3. Let i be h(2). Suppose -4a + 4w + 96 = 0, a + 3w + i = 5a. What is the remainder when a is divided by 13? 12 Let n(c) = -22c + 8. Let m(j) = 15j - 5. Let w(f) = -7m(f) - 5n(f). Let y be w(4). Suppose 4u - 13 = y. Calculate the remainder when u is divided by 4. 3 Let w = 32 - 1. Suppose 5k - 2b - 35 = 40, -2k = -b - w. Let n(x) = 24x2 - x - 1. What is the remainder when n(-1) is divided by k? 11 Suppose 3a = 5q - 13, 21 = 4a + q - 0. Let n be ((-6)/(-15))/(2/20). What is the remainder when 02/n - -7 is divided by a? 3 Let y(k) = -k - 2. Let f be y(-2). Let b = 7 + f. What is the remainder when 20 is divided by b? 6 Let y = -1 + 3. Suppose -s = -6r + r + 45, 0 = -4r - 3s + 17. What is the remainder when (1/3)/(y/138) is divided by r? 7 What is the remainder when 15 is divided by (-19)/(-2) + (-2)/(-4)? 5 Suppose 0 = 4j - 5p - 2 + 5, 4j = 3p - 5. Suppose -g + 0d - d + 24 = 0, 48 = g - 5d. Calculate the remainder when g is divided by (0 - (4 + j)) + 12. 8 Let f(n) = -n*3 + 3n - 3. Let p be f(-3). Suppose -4z + v = -91, -2v - 52 = -3z + p. Calculate the remainder when 67 is divided by z. 21 Suppose -3s + 64 = 3z - 20, 2s - z - 44 = 0. Calculate the remainder when 93 is divided by s. 21 Let s(m) = -5m + 0 - 3m*2 - 5m - 3 + 2m2. What is the remainder when s(-8) is divided by (15/3)/((-3)/(-3))? 3 Let q(z) = -z + 7. Suppose -3v = l - 37, -l + 37 = -3v - 12. Calculate the remainder when (-5)/(5/3) + l is divided by q(-14). 19 What is the remainder when 762/18 + 2/(-6) is divided by 15? 12 Let a(y) = -y3 + 3y*2 - 4y. Let z be a(3). Suppose -6 = 3m - 6m. Calculate the remainder when m is divided by (-18)/z - (-2)/(-4). 0 Suppose -2p + 39 = -17. Calculate the remainder when 109 is divided by p. 25 Suppose 2v = -h - 3v + 250, 9 = 3v. Calculate the remainder when h is divided by 34. 31 Let c = -5 + 9. Suppose cd = 3j + 69, 4d + 0j + 3j - 51 = 0. Calculate the remainder when d is divided by 8. 7 Suppose -3t + 4t = -27. Let v be 3/(-5) + t/(-45). Suppose vn - 60 = -5n. What is the remainder when 34 is divided by n? 10 Let t be 29/((-2 - -1) + 2). Suppose -s - 5 = -0s, 0 = k - s - t. What is the remainder when k is divided by 9? 6 Suppose 5h = -5v - 5, -4h = -v - 4 - 12. Suppose y + 2p - 28 = 23, 0 = -hp + 9. Suppose y - 1 = 2f. Calculate the remainder when 43 is divided by f. 21 Let i(j) = -5j + 14. Let c(b) = 9b - 27. Let k(t) = -3c(t) - 5i(t). Calculate the remainder when k(-8) is divided by 14. 13 Let o be 1/(-4) - 119/(-28). Suppose 4 + 32 = ob. What is the remainder when 25 is divided by b? 7 Let t(u) = -u. Let v be (14/4 + -3)4. Suppose -3b - 2q + 30 = -b, 0 = 2q - v. What is the remainder when b is divided by t(-5)? 4 Let t = 4 + -3. What is the remainder when t is divided by 4/3 - (-3)/(-9)? 0 Suppose -8 - 18 = -2t. What is the remainder when t is divided by 5? 3 Suppose 3r = 5b + 29, 2b + 6 + 17 = 5r. Let a(g) = 3g - 3. Let k be a(r). Suppose z + k = 23. What is the remainder when 50 is divided by z? 16 Let u be (4 + 0)/(2 - 1). Suppose 0 = 4j - ud - 72, -4j + 8d = 3d - 71. What is the remainder when j is divided by 10? 9 Suppose -o = -q - 149, -5q = 5o - 608 - 167. What is the remainder when o is divided by 7? 5 Suppose -2n = -3n + 1. Let r(k) = -1 + 1 + n + k + k. Calculate the remainder when 24 is divided by r(6). 11 Suppose -k + 2k - 25 = 0. Calculate the remainder when k is divided by 15. 10 Let m(z) = 21z*3 + 2z*2 - 1. Suppose 6 = t - 4t, -2t - 4 = i. Suppose 4y = -i + 4. Calculate the remainder when m(y) is divided by 12. 10 Suppose 0 = 5p + 3l - 52, 5p - 3l - 8 = 20. What is the remainder when 32 is divided by ((-17)/4)/((-2)/p)? 15 Let z(k) = 2k2 + 3k + 6. Let l(o) = 2o2 + 2o + 6. Let h(y) = -4l(y) + 5z(y). Let d = -43 - -36. Calculate the remainder when h(d) is divided by 14. 13 Let c = -388 + 395. Suppose -2o = 0, -g - 4o = -0g - 12. Calculate the remainder when g is divided by c. 5 Suppose -f + 57 = 2f. Suppose 5o - f - 21 = 0. Calculate the remainder when 31 is divided by o. 7 Let k(j) = -4j - 2. Calculate the remainder when 26 is divided by k(-4). 12 Suppose 0 = -n - b + 19, -4n + 2b + 35 = -11. Calculate the remainder when -411(-16 + 15) is divided by n. 13 Let y(g) = 10 + 0g - 9g + g*2 - 2 + g. Calculate the remainder when 14 is divided by y(8). 6 Let h(p) = p + 1. Let u be h(0). What is the remainder when 71 - -1 - (u + 0) is divided by 24? 23 Suppose 11x - 110 = 6x. What is the remainder when 65 is divided by x? 21 Let l = -21 + 37. Calculate the remainder when 63 is divided by l. 15 Let n be 6/1 - (-2 - -1). Suppose 0c + n = -c. Let j(g) = -g*3 - 7g*2 - 5g - 9. Calculate the remainder when j(c) is divided by 9. 8 What is the remainder when (-16)/48 + (-206)/(-6) is divided by 24? 10 Let b(i) = -i - 4. Let l(z) = -4z + 3. Let k be l(2). Suppose -2w = -3 + 1. Calculate the remainder when b(k) is divided by w. 0 Let d = 15 + -8. Let k = -1 - -2. Let v = 5 - k. Calculate the remainder when d is divided by v. 3 Suppose -4x = 35 - 11. Let c = 8 - 5. What is the remainder when 3/2(-16)/x is divided by c? 1 Suppose 2c - 5o - 76 = 0, -4c + 5o + 45 = -117. What is the remainder when c is divided by 11? 10 Suppose -2k - k = -30. What is the remainder when 25 is divided by (k - 0) + (0 - -3)? 12 Suppose -4k = q - 78, -q - k + 89 = -4. What is the remainder when q is divided by 20? 18 Let q(x) = 12x + 2. Suppose 4o - 3r - 6 = -6r, -r + 2 = -5o. Suppose of - 60 = -3f. Calculate the remainder when q(3) is divided by f. 18 Let d = 52 + -29. What is the remainder when d is divided by 14? 9 Suppose 0a + 6 = 3a. Suppose 0 = 4k - ao - 10 - 22, 5k + 3o - 18 = 0. Calculate the remainder when 11 is divided by k. 5 Suppose -11k - 32 + 274 = 0. Calculate the remainder when k is divided by 5. 2 Let z = -25 - -56. Suppose 1 = -l + 2. Let i = 10 + l. Calculate the remainder when z is divided by i. 9 Let f(a) = 7a2 - 2a + 1. Calculate the remainder when f(1) is divided by (-15)/(-20) - (-39)/12. 2	{ "pile_set_name": "DM Mathematics" }
what is -101101 - 0? -101101 In base 4, what is 13122 - 2? 13120 In base 9, what is 20 - -54? 74 In base 14, what is -9 - 1? -a In base 2, what is -10101110110 - -1011? -10101101011 In base 12, what is 4 + -1b? -17 In base 14, what is 5 + -1cd2? -1ccb In base 12, what is -1 + 2250? 224b In base 16, what is 453 - -4? 457 In base 16, what is 6 + -452? -44c In base 6, what is -3 - -34? 31 In base 15, what is -3 + -8c? -90 In base 16, what is e0c + 3? e0f In base 9, what is 14 - 40? -25 In base 9, what is -5 + 2180? 2174 In base 5, what is 414 + 0? 414 In base 4, what is 23 + 213? 302 In base 8, what is 142 + -65? 55 In base 3, what is 10210 - 10220? -10 In base 3, what is 2 - 101211? -101202 In base 5, what is -33 + 11234? 11201 In base 15, what is 1d - d3? -b5 In base 10, what is -16 + -143? -159 In base 4, what is 130203 + 0? 130203 In base 13, what is 4 + -3ab? -3a7 In base 4, what is 1 + -2112? -2111 In base 11, what is -42 - -23? -1a In base 16, what is -4b + -14? -5f In base 10, what is 6 + -51? -45 In base 10, what is 12 + 2011? 2023 In base 11, what is 3a + -10? 2a In base 15, what is 5 - aa2? -a9c In base 4, what is 0 - -10? 10 In base 3, what is -11 - -22002? 21221 In base 15, what is -85 + 2b? -59 In base 10, what is -2 + -238? -240 In base 3, what is -10 + 12001? 11221 In base 6, what is -2511 + 1? -2510 In base 8, what is 444 - 125? 317 In base 14, what is -4457 + -3? -445a In base 4, what is 1 + 2203? 2210 In base 14, what is 16 - -17c? 194 In base 14, what is 4 - 82? -7c In base 9, what is 27 + -171? -143 In base 6, what is 0 - -1441? 1441 In base 11, what is 3 - -4? 7 In base 9, what is -2062 - 2? -2064 In base 2, what is 1 + -1001010? -1001001 In base 7, what is -2021 - 0? -2021 In base 8, what is 664 + -2? 662 In base 15, what is 1b + 31? 4c In base 3, what is -11101 + 222? -10102 In base 6, what is -1 - 3301? -3302 In base 12, what is -1033 + 3? -1030 In base 12, what is 7 - b5? -aa In base 4, what is -11 + 3102? 3031 In base 2, what is -10010101 - -1? -10010100 In base 15, what is -1ba7 + 4? -1ba3 In base 7, what is 6512 - 3? 6506 In base 15, what is 11e6 + 4? 11ea In base 15, what is 5 + 282? 287 In base 8, what is -24444 + 1? -24443 In base 7, what is -1010 + -1? -1011 In base 4, what is -11 - 1113? -1130 In base 3, what is -102 + -1120? -1222 In base 10, what is 5 - -1039? 1044 In base 9, what is 3652 - -4? 3656 In base 14, what is 296 - 0? 296 In base 12, what is b0 - 1? ab In base 10, what is -4 - 46? -50 In base 9, what is -13020 + -5? -13025 In base 11, what is -332 + -17? -349 In base 16, what is -b - 1? -c In base 6, what is -5522 + 1? -5521 In base 16, what is b10 + -4? b0c In base 16, what is 45 - 1? 44 In base 16, what is 55 - -d? 62 In base 14, what is 127 + -3c? c9 In base 12, what is 103 - 42? 81 In base 3, what is -1 + -201012? -201020 In base 13, what is 18a + 0? 18a In base 16, what is -20ff + 5? -20fa In base 2, what is 1000101101 + -11? 1000101010 In base 8, what is -3 + 1033? 1030 In base 6, what is -1 - -10522? 10521 In base 13, what is 147 + 2? 149 In base 14, what is 0 - -11? 11 In base 10, what is -1611 - -2? -1609 In base 15, what is 6 - 325? -31e In base 9, what is 5 - -80? 85 In base 13, what is 14 + -16? -2 In base 15, what is 27 - -1? 28 In base 15, what is 367 + -2? 365 In base 16, what is 14e - 3? 14b In base 7, what is -1 - -61? 60 In base 16, what is -160 - 4? -164 In base 16, what is ac8 - 4? ac4 In base 5, what is -3 + 433? 430 In base 3, what is 1 - 1011? -1010 In base 11, what is -a90 - -12? -a79 In base 11, what is 7 + -312? -306 In base 11, what is -8 + -989? -996 In base 11, what is 11 - 60? -4a In base 10, what is -10 + 3? -7 In base 15, what is 8 - 27? -1e In base 3, what is 1001 - -1011? 2012 In base 10, what is 0 + -318? -318 In base 3, what is 12 + -1210011? -1202222 In base 16, what is 60 - 4a? 16 In base 14, what is 16 + -1? 15 In base 10, what is 338 + 3? 341 In base 2, what is 10110 - 10? 10100 In base 4, what is -10 - -1102321? 1102311 In base 9, what is 0 + -1740? -1740 In base 11, what is 4 + -541? -538 In base 11, what is -2 + -13? -15 In base 11, what is 1747 - 2? 1745 In base 10, what is 0 + -53? -53 In base 10, what is 4 - -595? 599 In base 10, what is -5 + 945? 940 In base 5, what is -2343 + -12? -2410 In base 12, what is 6 - -215? 21b In base 14, what is -5 + 4c3? 4bc In base 12, what is 2 - 106? -104 In base 12, what is 4 - a7? -a3 In base 13, what is -3494 - -5? -348c In base 6, what is -132414 - 0? -132414 In base 15, what is -360 - -2? -35d In base 2, what is -10010100 + 1111011? -11001 In base 16, what is -2 + f15? f13 In base 15, what is -11 - -e? -2 In base 5, what is -4432 + 1? -4431 In base 4, what is 13 - -132331? 133010 In base 15, what is -2 - 53b? -53d In base 9, what is -10 + 71? 61 In base 9, what is 8 - -1? 10 In base 2, what is -101011011 + 11? -101011000 In base 4, what is -1021111 - 0? -1021111 In base 7, what is -5130 - -2? -5125 In base 4, what is -2 - -3211? 3203 In base 11, what is 196 + 12? 1a8 In base 2, what is -11011110 + -100000? -11111110 In base 2, what is -11001 + -101? -11110 In base 3, what is 2221 + -2? 2212 In base 3, what is 2001 - -222? 10000 In base 11, what is 98 + -1? 97 In base 13, what is -2719 - 5? -2721 In base 3, what is -220020212 + 12? -220020200 In base 14, what is 4 + -2a? -26 In base 6, what is -1120 + 5? -1111 In base 11, what is 26 + -1? 25 In base 13, what is 2 - 186? -184 In base 9, what is -125 + -1? -126 In base 9, what is 1 + -65? -64 In base 8, what is -1 - 1477? -1500 In base 9, what is 4 - 306? -302 In base 11, what is 2557 - 5? 2552 In base 13, what is 151 - -4? 155 In base 16, what is 4 - b80? -b7c In base 16, what is 1 - 1f? -1e In base 10, what is 5 + 303? 308 In base 6, what is 11 + -25510? -25455 In base 2, what is -101111 - -10? -101101 In base 5, what is 1124 - 11? 1113 In base 11, what is -1aa - -14? -196 In base 16, what is -2 + 655? 653 In base 7, what is -116 + -14? -133 In base 12, what is 40b9 - 5? 40b4 In base 8, what is 4 + 102? 106 In base 7, what is 0 + -211? -211 In base 12, what is 5 - 49? -44 In base 4, what is -22201 - -13? -22122 In base 14, what is 3 + -38? -35 In base 11, what is 2119 + -a? 210a In base 13, what is 37 + -6? 31 In base 14, what is -12d - -50? -bd In base 11, what is -547 - -7? -540 In base 2, what is -1010 + -10001101? -10010111 In base 7, what is 262 - -1? 263 In base 10, what is -632 + -5? -637 In base 9, what is -453 + 2? -451 In base 5, what is 121233 + -2? 121231 In base 8, what is -5423 + -1? -5424 In base 11, what is 41 - -84? 115 In base 9, what is -457 - -11? -446 In base 5, what is 10 + -4404? -4344 In base 7, what is 14 + 2213? 2230 In base 5, what is 0 - -1441? 1441 In base 15, what is 21e7 + 4? 21eb In base 6, what is 105453 + 4? 105501 In base 3, what is -10 - 11102? -11112 In base 16, what is 36 - e3? -ad In base 3, what is -1 - -2120? 2112 In base 3, what is -1122 - -2? -1120 In base 12, what is 261 - -54? 2b5 In base 16, what is -686 + -b? -691 In base 3, what is -12 + -120? -202 In base 11, what is 6 - 29? -23 In base 13, what is -47 - 3? -4a In base 6, what is -20 - -220? 200 In base 9, what is -4 + 1001? 886 In base 9, what is 4 - 175? -171 In base 6, what is -130 - 111? -241 In base 5, what is 11432 + 3? 11440 In base 14, what is -2c + -21a? -248 In base 13, what is 1 + -b? -a In base 15, what is e - -1? 10 In base 8, what is -3 - 2424? -2427 In base 11, what is 8417 - 4? 8413 In base 2, what is 10101100100 - 1? 10101100011 In base 2, what is 0 + -1000010? -1000010 In base 10, what is 311 + -1? 310 In base 11, what is -20 + -7? -27 In base 14, what is -1a5 + -4? -1a9 In base 16, what is -303 + 1? -302 In base 15, what is 3 - -30? 33 In base 9, what is 624 - -4? 628 In base 12, what is -72ba + 2? -72b8 In base 3, what is -20211012 - 1? -20211020 In base 4, what is 1102 + 1? 1103 In base 14, what is 4 + aa? b0 In base 16, what is -d1f8 - 2? -d1fa In base 15, what is -5 + 94b? 946 In base 6, what is -32532 + -5? -32541 In base 8, what is -2 - 4205? -4207 In base 5, what is -1002 + 1? -1001 In base 11, what is -14 + 99? 85 In base 13, what is -224 - -1? -223 In base 15, what is -982 - -5? -97c In base 16, what is 1 + -8e? -8d In base 8, what is -14	{ "pile_set_name": "DM Mathematics" }
2. Solve p - d = -2h, -h - p = -2h + 4 for h. 2 Suppose 0 = 4w - 0 + 16. Let j be (w/(-7))/(310/105). Solve -i + 4i + r - 10 = 0, -2r - 4 = -ji for i. 3 Let v be 2 + 0 + (65 - 62). Solve -31 = -4a - 8q + vq, -3a = -2q - 2 for a. 4 Suppose 0 = 154z - 139z - 45. Solve -3f - 17 = -2m - 2, 5f + 25 = -zm for m. 0 Suppose -25p + 13 = -87. Solve 0 = py + b - 1, -2y - 3b = 3y + 4 for y. 1 Suppose 6g + 7g = 65. Solve gi - 20 = 0, -d - 2d = -2i - 4 for d. 4 Suppose 0s + 2s - 6 = 0. Let d be (-259)/35 + 7 - (-2)/1032. Solve 3q - d = -sj, -16 = -3q - 2q - 2j for q. 4 Let g(f) = -2f. Let m be g(-2). Solve w + 5 = 3i, 0 = mi + 3w + 2w - 32 for i. 3 Let u(o) = -2o2 - 25o - 63. Let g be u(-4). Solve 5v + z = -16, -2v + 3z - 2z = g for v. -3 Let m be 4/((-3)/(6/4)). Let j be (0/(-1(m + 4)))/(-1). Solve -1 = -3y - 4d, j = -4y + y + 4d - 31 for y. -5 Let r(f) be the first derivative of -f4/4 - 3f*3 - 4f*2 + 4f + 5. Let n be r(-8). Solve 5w - np = -3 + 12, 3p = -2w - 1 for w. 1 Let x be (44/(-24))/(4/(-66)). Suppose l + 20 = xl. Solve c - ls = 0, -2c = -6c - 5s - 13 for c. -2 Let x be 4/884/7. Let z(b) = b3 - 8b*2 + 4. Let q be z(8). Let f = x - q. Solve 2w + fa + 14 = 0, w - 3a - 2a - 23 = 0 for w. -2 Let k(m) = 4m - 36. Let d be k(15). Suppose 4a - 7a + d = 0. Solve -2j = -f + j - 12, 4f + 2j = a for f. 0 Let l(h) = 6h*2 - 2h - 1. Let o be l(2). Let d = -1409 + 1418. Solve -2s = -3r + o, 2r - 2s - d = r for r. 5 Let l = 295 + -264. Solve -5o + l = 3v - 0, -1 = 2v - o for v. 2 Suppose -408d + 403d = -30. Solve -9 = 3a + d, -4a = -3y + 26 for y. 2 Let v(i) = 26i + 936. Let a be v(-36). Solve 2j - 24 = -4g, -4j + 3g + ag = 7 for j. 2 Suppose 0 = 5t - 3g - 35, g = -5t + 2g + 25. Solve -tf - 2m + 20 = 2m, -5 = -f - 5m for f. 5 Suppose 6h - 20 = h. Suppose 4d + 4o - 15 = 3o, 2d - 2o = 0. Let f be (-5 - -6)/(d/9). Solve -3a - 13 = 3m + 2m, -2a + h = -fm for m. -2 Suppose 18 = 30k - 21k. Solve -2h - 5s = 1, -h - 5s = kh - 1 for h. 2 Let y(h) = 14h - 80. Let k be y(6). Solve 3 = w - 1, -kp + w = 0 for p. 1 Suppose -4f = 3l - 45, 3f - 7 = l + 30. Suppose k = 5p - 6, 0 = 3p - 7p - k + f. Suppose 4z - 6 = p. Solve zy - 3y + 1 = 2i, 12 = 4i for y. -5 Suppose s = 12 - 7. Let j(w) = -2w + 13. Let d be j(s). Solve 5m + 4z + 12 = 0, m + dz - 14 = 3m for m. -4 Suppose -2s = 12 - 24. Suppose sk - 40 = -2k. Solve -4a + 4m - 28 = 0, 3a - km = -a - 30 for a. -5 Let x be (-1)/71 + 11/77. Solve -2y + 7y + 2b + 21 = 0, 3y - 5b - 6 = x for y. -3 Suppose -2f = 4n + 72, 5n + f = -4f - 100. Let g = n - -16. Solve g = 5z - 5, -5z = 2w - 4z + 1 for w. -1 Let z be (0 - 5) + (0 - -2). Let x be z/(-1) + 0/1. Solve -4p - d - 21 = 0, d + 4d + 37 = -xp for p. -4 Let w = -67 - -139. Let j = w + -55. Solve -21 = 4i + 5o, 3i + 8o = 3o - j for i. -4 Let p be (3/6 - 1)2. Let l be 21 - (p - -5)/(-4). Suppose -2q + l = -8. Solve -3s + q = -3u, -3u + s - 6 = 5 for u. -3 Suppose 0 = 2l - 71 + 27. Suppose 7 - l = -n + 2f, -2n + 33 = -5f. Solve -v = -3a - 2, 0 = -3a + 5v + 5 + n for a. -2 Let h(v) = v - 12. Let n be ((-12)/21)/((-4)/98). Let x be h(n). Solve 3a - xd + 6 = 0, -28 = 4a + 3d + d for a. -4 Let r(h) be the second derivative of h4/12 - h3/2 + 3h2 - 9h. Let q be r(2). Solve -2v + 12 = p - 5v, -qp = v + 17 for p. -3 Suppose 5b - 15 - 10 = 0. Let n = 9 + -4. Let x be (n - 3)/(4/6). Solve c + b = 2y, xc = 2c - 3y - 5 for c. -5 Suppose v + 4v = -3n + 12, 0 = 3n - 2v - 12. Let c = 5 - n. Suppose 22 = -0g + 3g - 2s, s + 8 = g. Solve -2f + 5b = -c, g = -5f - 2b - 6 for f. -2 Suppose 13 = o + 2. Let a = o - 1. Suppose 3i - 3 = -w - 2w, -a = -4i + 2w. Solve c - ic - 2j - 2 = 0, 4j - 8 = 4c for c. -2 Let p = -23 - -26. Solve -px + 3 = 0, -y + 5 = 5x + 2 for y. -2 Suppose -b - 5l - 10 + 2 = 0, 2b = l + 28. Solve -g + 4g - 4w - 12 = 0, 3g - 2w - b = 0 for g. 4 Let r(z) = z3 - z2 - 11z - 7. Let s be r(-2). Solve -2n + 15 = sm, -n + 19 = 5m + 1 for n. 3 Let x(j) = -4j*2 + 15j + 4. Let q be -23(-9)/54 - -3. Let t be x(q). Solve -2v + 14 = 4f, -3f + v + 9 + 9 = t for f. 5 Let v be (4 - (-5)/1) + -5. Solve 2r = r + g - v, 2g - 8 = -5r for r. 0 Let l(k) = 2k3 - 8k*2 - 7k - 12. Let c be l(5). Solve 0 = -2b - z - 9, -33 + 11 = 5b + cz for b. -5 Let x = -624 + 624. Solve 3 = h, xh - 11 = -2u - h for u. 4 Let u = -149 + 103. Let r = u - -47. Solve 0 = -k - 3a - r, -4k + 1 = -a + 5 for k. -1 Suppose -z = -5s + 23, 5s - 2z + 0z = 21. Let n be (-1)/(-5) + 21/(-5). Let k be (-1)/n - 21/(-12). Solve 5y = sc, -4c - 28 = ky + 2 for y. -5 Let y = 1473 + -1471. Solve 0r + r = -3g - y, r = 2g + 8 for r. 4 Suppose -m - 30 = -5z, -3z - 5m + 18 = -m. Suppose -5l - 40r + 9 = -42r, -8 = -r. Solve lx + 2t = 12, -32 = -5x + zt - 3t for x. 4 Let g be (-10)/342/(-35). Solve -k + 7 = 3a + 3, 16 = 5a + gk for a. 0 Suppose 4s + 3 = -5, -5a = 3s - 14. Let f be 12/10(-10)/(-4). Solve an - 6n + m = -3, 4n = fm + 9 for n. 0 Let w(l) = 2l*2 + 6l - 2. Let b be w(-4). Suppose -2c = -3f, -4c - 3f + 22 = 2f. Solve 0 = -2p + co + 1, o - 3o = -3p - b for p. -4 Suppose o + 2l - 1 = 0, o + 5l = -2o + 5. Suppose 0 = 7k - 2k. Suppose -17 + k = -x. Solve 4d = -of - x, 4d + 0f = f - 11 for d. -3 Let j(y) = 5y - 23. Let a be (45/27)/(1/3). Let x be j(a). Solve 5o - 27 = 3q, 0 = 5q + 6o - xo + 8 for q. -4 Suppose -3b + 35 = -11m + 7m, 3b - 25 = 2m. Let z be (-140)/618/(-15). Solve -5o = 3i - z, o + 3o = bi + 15 for i. 1 Suppose 0 = -9w + 45 + 18. Let d = w + -3. Solve -4 = df + 4, -5f = 2l + 16 for l. -3 Suppose 2t - 1 = -4x - 5, -5 = -5t - 5x. Solve 4i + t = -4s - 0s, -4 = 4s - i for s. -1 Let l be 2(-3)/(-2) - -2. Let j(s) = s3 + 10s*2 + 9s + 90. Let t be j(-10). Solve 0 = -lf + 5p + 2 - 17, t = -f - 4p - 13 for f. -5 Let u(o) = -o + 25. Let k(q) = 5q*3 - 2q*2 + 2q + 3. Let r be k(-1). Let m be u(r). Solve 5l + 3g = -m, 0g + 5g = -4l - 30 for l. -5 Suppose -5u + 1 = -14. Let w(r) = -7r + 22. Let s be w(0). Let z(f) = -f2 + 21f + 26. Let j be z(s). Solve 4y + 3x = 4, -uy - 2x = -0 - j for y. 4 Suppose -10t + 25 = -5t. Let w be (t - 1) + -3 - 1. Solve -4 = u - 4x, w = 5u - 2x - 2x - 12 for u. 4 Suppose -7a + 160 - 132 = 0. Solve 0 = -2v + 3m + 5, av + 0m + 2m - 18 = 0 for v. 4 Let g(b) = 4b2 + 7b. Let i be g(-3). Let y be (-48)/(-22) - 4/22. Suppose 2d + yd - 12 = 0. Solve 3f + 22 = -k + dk, 3k = i for f. -4 Let f = 7 + -14. Let g be ((-7)/(f/(-30)))/((-5)/5). Solve -r - 11 = -2l, -r - 2r = -5l + g for l. 3 Let w = 26 - 16. Let j = -70 + 106. Let z be -60(j/(-8) - -4). Solve -y + 4h + w = z, -y + 4 = 2h for y. -4 Suppose -8 = -3r - r. Suppose 2h - ri - 6 = 0, -2h + 4h + 3i - 1 = 0. Solve -4q = v + 3, hv + q + 6 = 14 for v. 5 Suppose 0 = -4d + s + 4s + 8, 0 = -s - 4. Let c be d/(-4)(16 + -12). Solve -14 = cg - 5r, -2g + r = 3g - 6 for g. 2 Let c be (-11)/(-1) + -3 + -1. Suppose 1 = 3u - 2n, -4u + 5n - 6 = 2. Let z be 6/8 + (-5)/(-4). Solve -y = uv + c, 4y + 4 + 4 = -zv for y. -1 Let n(r) be the second derivative of -r5/20 - r4/12 - r3/3 - 2r*2 + 11r. Let b be n(-2). Solve -3u - 18 = -3s, 8 = s - bu - 13 for s. 1 Let f(y) = 4y - 172. Let s be f(45). Solve l - w + s = -0w, -2w + 26 = -4l for l. -5 Suppose 0 = -2d - 24 + 48. Solve -4h - d = -5x + 4, 2h - 6 = -x for x. 4 Let b(x) = x3 + 23x*2 - 45x + 150. Let n be b(-25). Solve 3m + 2a = -n, 6m + 30 = 3m - 3a for m. -5 Let n = 145 + -143. Solve 0k = k + nq, 2 = q for k. -4 Suppose -g + 5d = -20, g + 4g - 31 = 2d. Let f be (g + (-17)/3)/(4/(-18)). Solve -5b = 6x - 3x - 18, -fx - 3b = -12 for x. 1 Let g = 0 - 0. Suppose -3b + 3c + 29 = -c, g = 4b + 3c + 3. Solve 4 = -2v - 3d, 0 = v - bd - 6 - 1 for v. 1 Suppose -2j = -4j - 5t + 4, 0 = t. Let v(r) = -r3 - 4r*2 + r + 3. Let x be v(-4). Let m = 9 - x. Solve -ju - 2u + 3o = -7, 0 = u + 2o - m for u. 4 Suppose 0 = 7d - 168 + 98. Solve -4i = -2o - d, 18 = -5o + 2i + 1 for o. -3 Let i	{ "pile_set_name": "DM Mathematics" }
t u be (40/(-50))/((-2)/60). Suppose 0 = -11f + 7f - u. Let x be f + 3 - 54/(-3). Which is greater: 14 or x? x Let y = -2356 + 2355. Is y less than -20/31? True Let b be 4/40 + (5 - (-7115)/(-1400)). Which is smaller: 0 or b? 0 Let x(l) = -l*3 + 4. Let w be x(-3). Are 31 and w non-equal? False Suppose 2z = 3p - 0p + 28, 2z = -p - 20. Let l be 8/(-117) - p/54. Suppose 5j + 9 - 4 = 0. Which is greater: l or j? l Let b = -0.02 + 17.52. Let d = -18 + b. Let l = d - 3.5. Is 0.1 greater than l? True Let l = -2 - -3. Let v = -325.1 + 324. Which is smaller: l or v? v Let d(p) = 16p - 196. Let r be d(15). Which is smaller: 49 or r? r Let c be (3 + 259/(-14))6. Let v = 94 + c. Let s be -1 - 2(-11)/18. Is v at most as big as s? False Suppose 7 - 22 = -5x. Suppose -8 = xs - 11. Are s and 3/4 non-equal? True Let u be (4/(-294))/(-17 - 1526/(-90)). Are u and -1 unequal? True Let z be -7 + 5 + 5922/(-40). Suppose 0 = 4c - 244 - 356. Let o = c + z. Which is greater: 0 or o? 0 Suppose -2h - 10 = 12. Let k = h + 11. Suppose v + 5a - 6 = 0, -5a + k + 2 = -3v. Which is bigger: -1/8 or v? v Let a be (-2)/24 + 15 + (-944)/64. Which is bigger: -2.9 or a? a Let q be (-4)/(-2) + 1 + 101. Let a be 3/(-4(-3)/q). Let o be (-4)/1539/a. Are 2/29 and o nonequal? True Let w be 0/((-2)/(-1) - 1). Let q be -9(-3)/9 + (0 - w). Is q <= 2? False Let p(i) = i - 1. Let j(q) = 7q2 + q - 1. Let y be j(1). Let u be p(y). Is u less than or equal to 7? True Let n(l) = l2 - 10l + 14. Suppose 0 = 4b - 2i + 5i - 26, 0 = 2b + 5i - 6. Let a be n(b). Are a and -2 nonequal? False Let k be 3/1 + 8/4 + -6. Let a = 1 + -1. Which is greater: a or k? a Let i be ((-630)/28)/(2/12). Is i less than -539/4? True Let n = -62 + 59. Let p = 1 + -0.9. Let j = 2.1 - p. Which is smaller: n or j? n Let u(k) = 2k2 + 5k + 6. Let w be u(-2). Let q(t) = 2t. Let s be q(2). Suppose 0 = -v + sv - 12. Is v at least w? True Let f = -43 - -48. Is f greater than 14/23? True Suppose -3b = 2r - 38, -2b + 5 = 4r - 55. Let v be (0 - -1)/(2/28). Is v smaller than r? False Let c = 2753/8 + -345. Which is greater: -1 or c? c Let y(k) = -8k2 - 113k - 9. Let g be y(-14). Is g at least 6/17? True Suppose -19a - 1248 = -3a. Which is greater: a or 0? 0 Let v = 633 + -1877/3. Which is smaller: v or -0.1? -0.1 Let l = 593/5 - 119. Suppose -2o + 7 = o + 2r, -3 = 3o - 3r. Which is bigger: l or o? o Let i be 144 - 147 - 126-1. Is i at most as big as 145/6? True Let h = 1766 - 1732. Is 32 less than h? True Suppose -22k - 13 = -1157. Is 48 greater than or equal to k? False Suppose 2t + t = 4g - 41, 5t - 3g + 61 = 0. Let d = 351 - 364. Which is smaller: d or t? d Let q = 124.48 + -125. Which is greater: 2 or q? 2 Let h(x) = x2 - 29x + 145. Let o be h(7). Let d(i) = -6i + 1. Let u be d(2). Is u at least as big as o? False Suppose -3i + 3b = b - 6, -4i + 10 = -2b. Suppose -iq + 2q + 28 = 0. Let t be (q/8)/((-1)/(-4)). Is 4 at most as big as t? True Let y be (17 + -12)(-9)/5. Is -23/3 smaller than y? False Suppose -2j + 4a = 3a - 3, 2j + 5a - 21 = 0. Suppose jn - 3x - 42 = -3, -x - 5 = 0. Let l = -57 - -63. Is n greater than l? True Suppose 0 = 415h - 407h. Which is smaller: -14/67 or h? -14/67 Let r(j) = -10j - 8. Let q be r(-2). Does 14 = q? False Let x(q) = q*2 - 4q - 4. Suppose 3c - 2a = 6c - 19, c = 3a - 1. Let i be x(c). Is 4 <= i? False Let m = -2 - -5. Suppose -581 = 4n + 3n. Let x = n + 81. Which is bigger: x or m? m Let g(s) = s*2 + 5s + 1. Let k be g(-4). Let b be 1/k + (-68)/12. Let q(j) = -3j2 + 2j + 1. Let v be q(-1). Is v not equal to b? True Suppose -84 = -t + 4u, -92 = 35t - 36t - 4u. Is 88 <= t? True Let r = -32/21 + 125/84. Suppose 5g = v + 3, 4g = 4v + 14 - 2. Which is smaller: r or g? r Suppose 0 = 3t - 0t, 272 = 4i - t. Let s be 3/(-5) + i/(-20). Let w = -1 - s. Do w and 2 have the same value? False Let i = 89.985 + -90. Let d = i + 0.015. Do d and -50 have the same value? False Suppose 0 = -112x + 120x. Is -2/211 bigger than x? False Let x be 5472/248 + -7. Which is greater: x or 3? 3 Let l(k) = -k2 + 1. Let o(d) = -d + 10. Let u be o(8). Suppose ux + 2 = i, -2i - 3i = 5x + 20. Let g be l(i). Is g at most as big as -7/2? False Let c = 179 - 162. Which is smaller: c or -1? -1 Let z be ((-27)/90)/(5/(-330)). Which is smaller: 3 or z? 3 Let l = -66 + 75. Suppose 0 = 3k - lk. Is 1/51 >= k? True Let g = 4 - -4. Suppose l - 4 = g. Suppose t - l = -2. Do -2/5 and t have the same value? False Suppose -5f - 4 = 2c, 0 = -5f - 6c + c - 10. Suppose -2l = -4l + i + 10, f = -l + 5i + 5. Suppose -8w + lw = 21. Is -7 < w? False Let f = -36 + 37. Let j be (-4)/(-21)45/(-30). Which is smaller: f or j? j Let s be 0 + -2 + 1134/(-10). Let a = s + 2882/25. Let v(f) = f + 8. Let i be v(-7). Which is smaller: a or i? a Let m = -10755/405046 + 7/278. Is m not equal to 1? True Let m = -9.32 + -25.68. Is m > -6? False Let c be (14/3)/(2/(-6)). Let n be 2/(-8)c2. Suppose 2a - na = 35. Which is smaller: a or -6? a Suppose p - 4l = -5 - 16, 0 = -2l + 8. Let z be (-21)/(-90) - 0 - 3/p. Is 0 < z? True Let c be (427/(-4))/(-1(-3)/(-12)). Let g be ((-6)/(-8))/1c/(-183). Is g greater than -1? False Let w be (-84)/(-2)(-5)/9. Let i = w + 22. Let h = 2.13 + -1.13. Which is smaller: i or h? i Let i = 521 - 521. Suppose 4y = -2v - 14, 1 + 1 = -2v + 2y. Let o be ((-9)/4)/(v/(-12)). Is i at most o? False Let i = -69.43 + 71. Let f = 1.5 - i. Is f less than 3? True Let s = 0.3 - 1.7. Let m = s + 1.55. Let j = m - 0.15. Which is bigger: j or 3/10? 3/10 Let f = -81 + 86. Let n(g) = g*2 - 6g + 4. Let s be n(f). Which is greater: -0.09 or s? -0.09 Let u = 45 - 82. Which is smaller: u or -3/10? u Suppose 15i - 60 = 17i. Let r be (-2)/10 + 718/(-10). Let n be (4/i)/(16/r). Which is smaller: -0.2 or n? -0.2 Let u = 0.014 + 0.042. Let s = u - -0.024. Which is greater: -1/5 or s? s Let d = -8 + 7. Let i(v) = -v*2 - 20v + 8. Let t be i(-13). Let m be 93/t + (-16)/24. Is m not equal to d? True Let h = 0.51 + 122.49. Let v = h + -122. Which is bigger: v or -111? v Suppose 18v = 21v. Let k be v/(-3)(-1)/(-2). Let b be -5 - -6 - (1 + k). Is 7/6 less than b? False Suppose 5j + 8 = 6j. Suppose 11w = 9w - j. Let i be 44/(-6) - w/4. Which is smaller: i or -7? -7 Let p be 1 + 3 + (28/7 - 8). Is 1/36 smaller than p? False Suppose 14i - 7i = 168. Suppose -i = 33v - 29v. Which is greater: v or -5? -5 Let p(i) = i2 + 5i - 19. Let t be p(-7). Let v be (0 - -5)/t-13. Is 6 bigger than v? False Suppose -68 = 6d - 10d. Let w = -3 - -4. Let l be 3/(w - d/2). Which is smaller: l or 0.2? l Suppose -5122 = -10d + 2288. Let b be (19/d)/(10/(-12) - -1). Is 1 at most b? False Let w = 2.4 + 21.6. Let p = -24.2 + w. Which is greater: p or -2/7? p Suppose 17 = 3u + 5. Suppose 5m = -u + 19. Suppose -1 = mv + 2. Is v at least -2/3? False Let s = 0.22 - 2.32. Let l = s - -1.8. Is l > 0? False Let d = 492 - -1542. Which is bigger: d or 2033? d Let s = -0.38 - -2.38. Which is smaller: -59 or s? -59 Let v = -527 + 339. Is -188 bigger than v? False Let m be -2(7/(-2) - -3). Suppose g = -3 + m. Which is greater: g or -3? g Let u be -4 + 6/3 + 1. Let q be 2/(-3) - (3 + u)/6. Which is smaller: q or 0.14? q Let g(m) = -3m - 18. Let t be g(-6). Does 1/296 = t? False Let n be ((-2)/6)/((-4)/60). Let f = -19.7 - -20. Which is smaller: n or f? f Let u be (23/12558)/(21/(-9)). Is 1 smaller than u? False Let n be 6/328229/12. Let a = n + -22/41. Which is greater: 0 or a? 0 Let k = 175.1 - 185.1. Which is smaller: 30/7 or k? k Suppose 0y - 4f - 13 = y, 0 = 3y + 4f + 7. Suppose -5v = 5g - 130, -3v = -3g - 21 - 87. Suppose -47 = ys + v. Is -26 <= s? True Let x = 11009150/471 - 23374. Which is greater: x or 0? 0 Let f = -29.71 + -7.99. Which is smaller: 0.1 or f? f Let b = 3182 + -385024/121. Let w be (1/(-3))/((-1)/(-3)). Which is bigger: b or w? b Let h be (-1 + 0)/(((-2)/(-22))/1). Is -11 <= h? True Let c(f) = -f3 - 10f*2 - 7f - 1. Let v be c(-9). Let i be -3 + 0 - 59/v. Suppose 0 = -11t - 14 + 3. Is t >= i? False Let u be (-104)/24 + 4 + 190/3. Which is smaller: 70 or u? u Suppose 4 = 2z - 26. Suppose 9m = 4m - z. Suppose -5*u	{ "pile_set_name": "DM Mathematics" }
b + b + 16. Let z = 0 - b. Let c = z + -5. Solve -5t + 37 = 4w, -cw + 4w + 7 = 2t for w. 3 Suppose -3s - 15 = -21. Solve sv - 11 = -0y + 3y, -3v = y for y. -3 Let c(b) = -b3 - b2 + b. Let a be c(-2). Let l(p) = 2p2 - 2p + 1. Let v be l(a). Solve -3w + 12 = 0, -w = vo - 2 - 2 for o. 0 Let x(m) = m + 7. Let c be x(-5). Suppose -cy = -31 - 59. Solve -6k - 5g + y = -k, 0 = 4k + 2g - 28 for k. 5 Suppose 1 = -j + 7. Suppose -8a + 11a = j. Solve 4r - 18 = -ax - 4, -4x = -12 for r. 2 Let w(q) = -1 + 7q - 1 - 1 - q2. Let g be w(6). Solve 5u + 3t + 7 = 0, -5u + 18 = -gt + 1 for u. 1 Let u = -32 - -57. Solve 2y - 2f + 5 = 5y, -4y = -f - u for y. 5 Let c(t) be the first derivative of t4/4 - 7t*3/3 - 7t*2/2 - 4t - 1. Let o be c(8). Let n be 15/1o/5. Solve 11 - 3 = z + 3u, z - 2u = -n for z. -4 Let b(m) = m3 + 2m*2 + 2m. Let h be b(-2). Let t = 6 + h. Solve -2y + 0 - t = n, -4y + n - 10 = 0 for y. -2 Let a = 27 - 22. Solve 5o - 25 = 2l - 4l, 37 = 4o + al for o. 3 Suppose 3d = -d + 2u + 8, -6 = 3u. Suppose -3s - 45 = 3g, 5g + 59 = -3s - 6. Let i be 0 + (-4)/8g. Solve 0 = -2t - ic - d - 4, 28 = -5t + 3c for t. -5 Suppose 2b - 77 = 4z + 5b, z + 14 = b. Let l = 17 + z. Solve -f - 15 = 5m - 3m, l = -4m + 3f - 5 for m. -5 Let k(z) = z - 9. Let h be k(10). Solve 3c - 4 = -s, -2 = -c + h for s. -5 Let b(n) = n2 + 4n + 3. Let u be b(-4). Let o = -12 - -25. Let x = 15 - o. Solve -r - j + u = -0j, -24 = xr - 4j for r. -2 Let q(s) = s3 + 13s*2 + 10s - 15. Let c be q(-12). Solve -2t = 3m - 7, 3m = 4m + 2t - c for m. -1 Let u = 50 - 47. Solve -x = 2x + 4j + 13, -ux = 3j + 12 for x. -3 Suppose 6b + 26 = 2b - 2l, -b = 4l + 24. Let i(u) = u2 + 5u + 6. Let r be i(b). Solve 0 = s + 2, 0 = -rc + 2s + 14 for c. 5 Suppose 10 = 2h + 4. Solve -2 = 2p + 3x, 5p - hx - 20 = 2x for p. 2 Let i(r) = -r + 6r2 + 3r + 0r2 + 1. Let d be i(-1). Let f be (2/(-6))/(2/(-24)). Solve fc = -a + d - 2, -5a - c - 4 = 0 for a. -1 Let o(j) = 2j. Let c be o(1). Let x = 5 + 1. Let l(d) = -d + 12. Let b be l(x). Solve 3y - 2v - 2v - 5 = 0, -cy + b = -4v for y. -1 Let v be (-3)/(6/(-4) - 0). Let t = 3 + v. Solve 0 = -tf - 5n + 35, -3f + 8f + 3n = 31 for f. 5 Let q = 5 - 2. Let b(k) be the second derivative of k5/20 + k4/6 - 5k3/6 - 2k*2 - 2k. Let j be b(-3). Solve -a - 4a + 3 = 4o, qo - 8 = ja for a. -1 Suppose -244 = -b - 3b. Let u(i) = -85i + 1. Let d be u(-1). Let m = d - b. Solve s - 5s = -5a - m, 5 = -5a for s. 5 Suppose -1 + 6 = y. Let r(b) = -b2 + 3b - 2. Let v be r(2). Suppose v = 15g - 12g - 6. Solve l - 21 = -ya + 2, -2l = -a - g for l. 3 Suppose -40 = -4u + 5v - 3, 17 = 4u - v. Solve -5s - um = 12, 1 + 7 = 3s - 2m for s. 0 Suppose 2u + 9y = 6y - 2, 3u - 3y = 27. Solve -4i = -2m + 6, 4 = um - 3i + 3 for m. -1 Suppose -3s + 2 = -1. Let i = 8 + -5. Suppose 3v - 1 - 4 = -a, 2v + ia = 15. Solve v = -z + 3k - 8, 2z - s = 5k - 16 for z. -5 Let n be (-272)/(-85) + 2/(-10). Solve -5r + 40 = -nt - 2t, -4r = -3t - 28 for t. -4 Let t be (-4)/(-3)6/4. Suppose -j - 4y - 5 = 0, -4j - 4y = 6 + t. Let c be j/(-3) + 40/24. Solve 5d = -2a + 25, -1 = -ca + 9 for d. 3 Suppose -4a - 2s + 2 = -5a, -4a - 2 = -5s. Let f be 6/(-9) - 7/3. Let k = f - -11. Solve 2t = m - 2m - k, 0 = -5m + at - 16 for m. -4 Suppose -5n + 2v = -2v - 29, -4n + 16 = 4v. Suppose n - 2 = d. Suppose -2i + 0 + 4 = 0. Solve -ij - 11 = 3b, -2b - 11 = dj - 3b for j. -4 Let x(i) = i - 3. Let j be x(5). Suppose 5q - 32 = -j. Solve -s + 2z - qz + 25 = 0, 5s - 3z = 10 for s. 5 Let o(l) = -2l2 + 4l - 1. Let m be o(1). Let d(g) = g - 3. Let x be d(6). Suppose xv - 21 = 9. Solve -w + v - m = -t, -41 = 5t - 4w for t. -5 Let x = 19 + -11. Let c(v) = -v3 - 5v*2 + 6v + 3. Let a be c(-6). Suppose s - a = -0s. Solve 0 = -5u - 4y + x, su = -0u + 4y + 24 for u. 4 Let q = 5 - 1. Suppose 4u = 5c - 2c + q, 8 = -2u + 4c. Solve -d = n + 3, 20 = -ud - 0 for n. 2 Let d = 0 - -1. Let b be 11(d + 0/3). Let f = b + -7. Solve -5p = -10, 0x = x - p + f for x. -2 Let k = 3 - -1. Solve -2i + 5 = u, -ku - 9 = -i + 16 for i. 5 Let o be (0 - -4) + -1 + -2. Let m be 3/(-3) + 1/o. Solve 5t = 4n - mn + 2, 5n + 5t = -25 for n. -3 Suppose 5c - 2i - 77 = -30, c = -3i + 6. Suppose cg - 5g - 16 = 0. Solve gs - 20 = 4n, -s + 1 = -2n - 4 for s. 5 Let y = 0 - 1. Let w be y - (-9)/62. Solve -3j + 12 = wr, 2r - 20 = -5j + 3r for j. 4 Let y(x) = x*2 + 7x - 15. Let h be y(-9). Solve -5q - h = -5s + 17, 2s = 5q + 11 for q. -1 Let q = -56 - -61. Solve 0 = -5b + 4o + 1 + 24, 0 = b + 5o - q for b. 5 Suppose -4h + 25 - 1 = 0. Solve 5s - 1 + h = 0, 0 = 3p - 5s - 17 for p. 4 Suppose o - 1 = -5x + 2, 0 = -5o + 15. Let y be 14 + -1 + -2 + 1. Suppose 2z = -2z + y. Solve x = -zq + 2g + 23, -29 = -2q + 4g - 3 for q. 5 Suppose -5b + 0b = -35. Let w = 3 + b. Solve 0 = -5j + 5 + w, 5j = 2a + 17 for a. -1 Let a(f) = 2f - 8. Let c be a(8). Suppose -5g + c = -7. Solve -5y = -2m + 2, 0 = -y + m - g + 2 for y. 0 Let w = -70 + 72. Solve 0 = -0h - 4h + wm - 22, 0 = -4m + 20 for h. -3 Let k = -6 + 4. Let y be (4 - k/(-1)) + -16. Let c be 4/y + (-111)/(-21). Solve cx - 20 = -6u + 3u, -4 = -x + 4u for x. 4 Let y be -3 + -5 + 1 + -2. Let x = -5 - y. Solve 0 = -2o - g - 3, -2o - g = -xg + 23 for o. -4 Let c = 4 - -12. Let r = -12 + c. Solve -4j = -4o - 12, ro = 3j - 10 - 0 for j. 2 Let z(s) = 2s*2 - 4s + 2. Let d be -3 + 0/1 - -5. Let t be z(d). Solve 4g - 6p + tp - 28 = 0, 2g - 5p = 26 for g. 3 Suppose -h + 7 = -3. Let a(w) = -w3 + 9w*2 + 12w - 5. Let b be a(h). Solve 2i - 6i + 5k = -8, i = -3k - b for i. -3 Suppose 12 = 4d - 188. Let u = 4 - 0. Suppose -ur = r - d. Solve -5p - n + r = 0, 0 = -4p - 3n + n + 8 for p. 2 Suppose 0 = 2h - 2p - 20, 3h = -4p + 17 + 27. Let w = h + -8. Solve 5c + n + 0n = 24, 0 = 4c - wn for c. 4 Suppose -2m + 32 = a + 4, a + 17 = m. Solve -4i + m = -v, -v - 3v = -i + 15 for i. 3 Let w = -127 + 127. Let c(y) = 16y. Let f be c(1). Solve f = -2q - 3o, 4o + 6 = 5q - wo for q. -2 Let d be 114/22 - 14/77. Solve du - v = -18 + 7, 0 = -u + v + 1 for u. -3 Let x = -10 - -14. Suppose -h = -xh. Solve -r = 2w - w - 2, h = -3w + 3r + 24 for w. 5 Let k be 18(6/(-9) - 0). Let y be k/42 + 667/7. Suppose 0 = 2b - 7b + y. Solve w - 3p = -0w + b, -2w - 4p = 12 for w. 4 Let d(l) = l*3 + 10l*2 - 13l - 14. Let c = 3 + -14. Let x be d(c). Solve j - 2y - x = 0, 3j - y - 14 = 3y for j. -2 Suppose 48 = g - 4g. Let w = -13 - g. Solve 4f + 14 = -x, 5x = 3f + wx + 5 for f. -3 Suppose -4j + 3 = -5. Solve -5y = -0k + 5k + 5, -k - jy + 2 = 0 for k. -4 Let q(a) = -10a*2 + 2a2 - a3 - 4 + 3 + 8a - 4. Let c be q(-9). Solve -9 = -3s + 3p, -2s + 5s - cp = 14 for s. -2 Let w(r) = 23r2. Let b(y) = -y. Let f be b(1). Let x be w(f). Solve 4k + j + x = -0j, j = -2k - 13 for k. -5 Suppose 6q - 252 + 36 = 0. Solve -24 = 4l + 3a + 7, -4l - 4a = q for l. -4 Let q be (-4)/(-6) + 10/3. Let g be 4 + (0 - (q - 2)). Let r be (2/g - -2)/1. Solve n - 4o + r = -2, -4 = 2n - 5o for n. 3 Let y be (-4)/14 - (-4)/14. Suppose 3j + y + 14 = 4l, -2j + 5l = 21. Suppose -jv = -v. Solve -c + h = v, 6 = -4c - 2h - 0h for c. -1 Suppose -3r - 2 = -14. Solve -p = -3p + 5j - 19, 0 = -rp - 2j + 22 for p. 3 Suppose 2z - 6 = 2o, -3o + 0o = -4z + 12. Solve -5x = -5i + 10, -i = x - ox for i. 1 Suppose -41 + 51 = 5l. Solve -y = y + 4j + 10, -6 = lj for y. 1 Let o(m) = m + 6. Let x = -23 + 17. Let v be o(x). Solve 3w = 5s - 17, 4w - s + 16 + 1 = v for w. -4 Let o be -3 + (10 - -1) + -4. Solve om = r - 6, -2m + 16 = -7m - 3r for m. -2 Suppose 0 = -0b - 3b. Solve b = 5h + 2g - 9, -5g + 5 = -3h - 2 for h. 1 Let z(l) = l2 - 5l + 6. Let w be z(6). Let c be (-8)/(-2)9/w. Let x be 50/12 + (-3)/18. Solve -2q - 4i = -cq - 3, 2q = -xi - 6 for q. -3 Suppose -2a - 5 = -2g + g, 3a - 20 = -4g. Solve 6 = -2t, 0 = -ax - x - 2t - 9 for x. -3 Let k(i) = -5 + 5 + 2i. Let t(b) = b*2 - 6b - 3. Let n be t(7). Let r be k(n). S	{ "pile_set_name": "DM Mathematics" }
3. What is v(m(d))? -50d2 + 7255d - 263175 Let q(b) = -b. Suppose 0 = o - 0o - 2h - 9, -2h + 6 = 0. Suppose 10t + 55 = ot. Let l(k) = 9k + 4k - 5k + tk. Give q(l(y)). -19y Let z(f) = 4f + 3. Let a(l) = -5l - 2. Let y(w) = 2a(w) + 3z(w). Let v(x) = 128x. Let i(t) = 15t. Let q(r) = 51i(r) - 6v(r). Calculate q(y(o)). -6o - 15 Let t(q) = -219913766q. Let l(f) = 2f. Calculate l(t(k)). -439827532k Let d(s) = 50s. Let i(x) = 74x - 223. What is i(d(z))? 3700z - 223 Let v(z) = -319z*2. Let r(n) = 4n + 0n + 5n - 5n - n. Determine v(r(m)). -2871m*2 Let f(k) = -53k*2 - 2. Let h(u) = 77u + 8. Let a(m) = 820m + 85. Let t(n) = -8a(n) + 85h(n). Calculate t(f(x)). 795x*2 + 30 Let h(i) = 247i2. Let m(o) be the third derivative of -o5/15 + o*2 - 4446o. What is h(m(q))? 3952q4 Let s(y) be the second derivative of -16y*3/3 + y. Let a(x) = -13x. Let f = -1539 + 1534. Let v(u) = fs(u) + 12a(u). Let c(r) = -2r. Determine c(v(b)). -8b Let f(i) = -2i + 1904. Let j(t) = -124t*2 - 7t - 21. Let h(s) = 18s2 + s + 3. Let y(a) = -7h(a) - j(a). Determine f(y(c)). 4c2 + 1904 Let z(b) be the second derivative of b3/2 + 1189b - 2. Let o(p) be the first derivative of p*2 - 5p - 5. Calculate z(o(w)). 6w - 15 Let o(h) = 40h - 3. Let d(v) = -53v + 4. Let i(b) = -3d(b) - 4o(b). Suppose 5y = 7y - 20. Let s(x) = 2x*2 + yx - x - 9x. Calculate i(s(u)). -2u*2 Let l(h) = -2h + 24. Let c be l(6). Let x(f) = 32f2 + 30f*2 + cf*2. Let z(g) = -g. What is z(x(o))? -74o*2 Let x(y) = 8119y*2. Let p(d) = -111d*2 - d. Calculate p(x(g)). -7316915871g*4 - 8119g*2 Let p(w) = 425w + 29. Let a(j) = -88j - 6. Let n(c) = 29a(c) + 6p(c). Let b(m) = -m2 + 1806m. Calculate n(b(l)). 2l2 - 3612l Let b(j) = -j*2 - 7j - 8. Let m be b(-6). Let x be 6/m - (-123)/3. Let z(a) = 38 - x - 30a. Let k(n) = -2n. Determine z(k(p)). 60p Let q(t) = 24t*2. Let n(j) = -j + 1. Let p(l) = 2l - 3. Suppose -87a = -93a + 36. Let w(x) = an(x) + 2p(x). What is w(q(y))? -48y2 Let r(h) = -h2. Let u(n) be the first derivative of 215 + 5n*2 - 2/3n*3 + 0n. What is u(r(d))? -2d4 - 10d*2 Let q(r) = -94r*2. Let t be 13/((-65)/(-30)) + 5. Let z(o) = 10o + 31 - to - 31. Determine z(q(k)). 94k*2 Suppose 0 = 5n - m - 13, 3n + 4m - 7 = 10. Let f(b) = -2b + 12. Let t(s) = 2s - 9. Let j(c) = nf(c) + 4t(c). Let r(x) = -36x - 3. Calculate j(r(y)). -72y - 6 Let c(m) = -5025m2. Let f(w) be the third derivative of -w4/8 + 4w*2 - w - 448. What is c(f(t))? -45225t*2 Let h(d) be the second derivative of -113d*4/12 + 510d + 4. Let o(j) = -3j - 6. Calculate h(o(y)). -1017y*2 - 4068y - 4068 Let q(s) = 7079s + 7075s - 14150s. Let y(c) = 14c*2 + 3c. What is q(y(k))? 56k2 + 12k Suppose -2t = -5b + 170, -2b - 46 = -2t - 120. Let z(v) = 9v + 4v + 13v + 10v - bv. Let a(i) = 6i + 10i + 7i. Give a(z(q)). 92q Let d(l) = -4l + 523332. Let f(u) = -u. Give f(d(c)). 4c - 523332 Let y(j) = 2j. Let k(d) be the third derivative of -57d2 + 0d + 0 + 0d3 + 9/2d*4. Calculate y(k(c)). 216c Let v(g) = -49 + 126 - 17g + 18g - 77. Let u(h) = 17h2 - h - 9. Give u(v(r)). 17r*2 - r - 9 Let y(i) = 2i*2. Let d(g) = g - 38. Let m(h) = 1990h - 30248. Let b(o) = -796d(o) + m(o). Determine b(y(s)). 2388s2 Let p(v) be the second derivative of -v4/12 - 2v2 + v. Let x(c) be the first derivative of c2/2 - 1432. Calculate p(x(a)). -a2 - 4 Let d(f) = -f2. Let o(p) = 186349863p. Give o(d(h)). -186349863h2 Suppose -70n + 182 = -44n. Let i(g) = -6g*2 - 4g*2 + ng*2 + 2g*2. Let x(p) = -168p*2. What is x(i(u))? -168u4 Let n(z) be the third derivative of -z5/60 + 5z4/2 - 5z*3/2 - 100z*2. Let a(k) be the first derivative of n(k). Let c(j) = -2j*2. What is a(c(p))? 4p*2 + 60 Let o(w) be the first derivative of 26w3/3 - w2/2 - 5221. Let h(u) be the second derivative of 0 - u + 0u2 - 1/6u*3. What is h(o(y))? -26y*2 + y Let a = -19 - -29. Let o(t) = -at - 12 + 12. Let q(w) = -10w2 - 12w - 12. Let x(l) = -4l2 - 5l - 5. Let u(y) = -5q(y) + 12x(y). What is o(u(v))? -20v2 Suppose -3a + 25 - 28 = 0. Let l be (-7 - -7) + 14 + a. Let r(j) = 7j - 13 + l - 13j. Let w(m) = 2m. Calculate w(r(g)). -12g Let o(w) = 25w2. Let c(q) = -11q*2 - 14q*2 + 5q - 5q - 7q*2. Give o(c(z)). 25600z*4 Let l = 152 - 150. Let i(s) = 59s*2 - 44 + 13s*l + 44. Let a(z) = z. Determine a(i(p)). 72p*2 Let y(z) = 63z. Let o(w) = -w*2 - 7w + 46. Let u be o(4). Let m(c) = -3cu + 0 + 0 + c2. Give y(m(b)). -126b*2 Let p(l) = 971l. Let k(z) = -4z2 - 102. Let y(f) = -3f*2 - 85. Let t(r) = 5k(r) - 6y(r). Determine t(p(h)). -1885682h*2 Let v(g) = 1196348g. Let n(u) = 3u + 4. Give v(n(a)). 3589044a + 4785392 Let b(x) = -2x. Suppose 21 = 3q - 13w + 10w, -2w = 4q + 2. Let r(i) = -205i2 + 9 + 209i*q - 13 + 10. Calculate r(b(c)). 16c*2 + 6 Let i(d) = -31d*2. Let m(p) = -107p + 33p + 38p + 31p. Determine m(i(u)). 155u*2 Let x(t) = 350t. Let n(j) be the third derivative of 3j5/10 - 2172j*2. Give x(n(c)). 6300c*2 Let u(b) = 68688b. Let p(f) = -13f. Give p(u(c)). -892944c Let w(s) = -25s. Suppose c - 5f - 4 = 33, 3c = -3f - 15. Let q(a) be the first derivative of 22 + 0a - 3/2a*c. Determine q(w(k)). 75k Let d(j) = 2j. Let r(v) be the first derivative of 46v*3/3 + 2737. Let i(w) = -28w*2 + 11w*2 - 29w*2. Let k(a) = 2i(a) + 3r(a). What is d(k(z))? 92z*2 Let d(z) = -85z*2 - 22z + 7. Let k(b) = -5b + 514. Give k(d(y)). 425y*2 + 110y + 479 Let f(b) = -4938b2. Let w(x) = 20710x*2. Determine w(f(q)). 504989409240q*4 Let u(k) = 37k*2. Let x(d) = 41868d*2. Give x(u(s)). 57317292s4 Let s(b) be the second derivative of b3/6 - 3b2/2 + 3b + 493. Let n(i) = -29i2. Determine n(s(d)). -29d*2 + 174d - 261 Let c(i) = -28i2 + 21i. Let x(s) = 145s + 14. Let u(m) = 124m + 12. Let r(b) = -7u(b) + 6x(b). Calculate r(c(z)). -56z2 + 42z Let f(y) = -497677y. Let l(u) = -12u. What is l(f(r))? 5972124r Let b(g) be the first derivative of -19g*3 + 2g*2 - 3039. Let i(o) = -2o. Give i(b(z)). 114z2 - 8z Let p(b) = -17b2 - 3b. Let n(a) = 32a + 44a - 22a - 73a + 36a. Determine p(n(f)). -4913f*2 - 51f Let d(w) = 52w2 + 10614. Let s(c) = 8c*2 + 4. Calculate d(s(i)). 3328i*4 + 3328i*2 + 11446 Let u(y) = 4y*2. Let d(n) = -19n*2 + 10903n - 10903n. What is d(u(h))? -304h*4 Let s(i) be the second derivative of -389i*3/3 + 1565i. Let a(n) = -3n2. What is s(a(l))? 2334l*2 Let w(x) be the third derivative of -8x5/15 + x4/12 + 9x2 - 2x + 2. Let o(c) be the first derivative of -c*2 + 2. Determine w(o(i)). -128i*2 - 4i Let y(r) = -6r2 - 3 + 15r*2 + 1. Let a(d) = 4d - 20d + 49 - 49 + 18d. Give y(a(v)). 36v2 - 2 Let p(i) = 4i - i + i - 2i. Let h(a) = 2a. Let c(q) = -15q - 25q + 43q. Let b(w) = 2c(w) - 22h(w). Calculate b(p(k)). -76k Let n(s) = -4s. Let v(k) = 111k + 259. Let z(b) = b + 3. Let w(y) = -3v(y) + 259z(y). Give w(n(j)). 296j Let s(i) = 17i - 9. Let d(k) = 44k - 24. Let p(f) = 3d(f) - 8s(f). Let b(x) = -310x*2 - 1. What is b(p(o))? -4960o*2 - 1 Let u(r) = 2r. Let a = -30169 + 30169. Let i(c) be the second derivative of 0c2 + 2c - 7/6c3 + a. What is i(u(t))? -14t Let x(n) = 6n2. Let d(m) be the first derivative of 115m*3/3 - 1378. Determine d(x(a)). 4140a*4 Let h(p) = -89471p*2 + 178944p*2 - 89466p*2. Let s(a) = -5a + 14. Calculate h(s(n)). 175n2 - 980n + 1372 Let j(n) = 10n. Let x(u) = 3994903u. Give j(x(b)). 39949030b Let p = 116 + -228. Let k = p + 114. Let r(u) = 16u*2 - 3u*2 - 5u*k. Let m(w) = w. Determine m(r(s)). 8s*2 Let r(u) = 3u. Let a(z) = 26z - 15. Let m(f) = -54f + 24. Let v(x) = 11a(x) + 6m(x). Determine v(r(s)). -114s - 21 Let g(q) = 20q. Let i(s) = -537s. Let h(d) = 54g(d) + 2i(d). Let m(k) = -1479k*2. Calculate m(h(r)). -53244r*2 Let z(m) = -2m*2 - 66141m - 2. Let n(k) = 15k - 1. Give n(z(h)). -30h*2 - 992115h - 31 Let j(p) = -32p. Let t(o) be the first derivative of -16o3/3 + o2/2 + 13976.	{ "pile_set_name": "DM Mathematics" }
ide 67162855? False Is 680809928 a multiple of 4? True Does 228 divide 2064507? False Does 291 divide 213739791? True Is 66 a factor of 485178403? False Does 22 divide 3602063739? False Does 2243 divide 85155495? True Does 11 divide 54097416? False Is 476303842 a multiple of 373? True Is 45333900 a multiple of 4? True Does 34 divide 11556328? True Does 14 divide 1546103524? True Is 444811891 a multiple of 304? False Is 112493606 a multiple of 21? False Is 12 a factor of 632869908? True Is 564 a factor of 41461811? False Is 78 a factor of 191716566? False Is 9 a factor of 53717904? True Is 153705816 a multiple of 132? True Does 107 divide 64010906? False Is 80 a factor of 11259145? False Does 5 divide 54077029? False Does 23 divide 3468179745? False Is 476018944 a multiple of 3569? True Is 45308729 a multiple of 1957? False Does 94 divide 66740834? False Is 471294805 a multiple of 145? True Does 7 divide 235737457? False Is 6413733 a multiple of 932? False Is 273700484 a multiple of 1161? False Is 231578538 a multiple of 3511? True Is 2346 a factor of 69847458? True Is 176363848 a multiple of 2593? False Is 87 a factor of 514489116? True Is 820059672 a multiple of 636? True Is 618242304 a multiple of 1544? True Is 12388211 a multiple of 13? False Does 2384 divide 966628560? True Is 82736309 a multiple of 127? True Does 142 divide 429681350? True Does 13 divide 649678211? True Does 4451 divide 122580540? True Is 132 a factor of 11856021? False Does 13 divide 1138748039? True Is 161465317 a multiple of 1628? False Does 55 divide 887915111? False Is 95448175 a multiple of 215? True Is 54106464 a multiple of 1578? True Is 161 a factor of 546476717? False Is 177 a factor of 18701720? False Is 171 a factor of 11476836? True Is 528989535 a multiple of 81? True Is 799295371 a multiple of 2777? False Is 21 a factor of 232517355? True Does 173 divide 162188884? True Does 717 divide 526410645? True Does 3641 divide 105680025? True Does 24 divide 2479241688? True Does 220 divide 1135455860? True Does 1585 divide 58158405? True Does 61 divide 15228162? True Is 7 a factor of 19680908? False Does 3433 divide 11668767? True Is 367857922 a multiple of 37? True Does 28 divide 1494636923? False Is 44 a factor of 1215804832? True Is 80 a factor of 18165440? True Is 12 a factor of 325317636? True Is 1203 a factor of 2228675923? False Is 698012588 a multiple of 68? True Is 62 a factor of 1278288224? True Is 662292481 a multiple of 13? False Is 1450551092 a multiple of 470? False Is 338 a factor of 21779495? False Does 482 divide 90143640? True Is 3 a factor of 276118728? True Is 47265079 a multiple of 8? False Does 12 divide 10466511? False Does 156 divide 10955724? True Is 455 a factor of 52750880? True Is 4312 a factor of 1656515396? False Is 665011450 a multiple of 2155? True Is 1060890 a multiple of 10? True Is 2872 a factor of 2961032? True Is 193787040 a multiple of 80? True Does 181 divide 196849455? False Does 53 divide 236847407? True Is 892570434 a multiple of 42? True Is 81092517 a multiple of 25? False Is 12 a factor of 219834336? True Is 9 a factor of 638803899? True Does 3 divide 5250576? True Is 386006992 a multiple of 17? False Does 34 divide 131154314? False Is 84532488 a multiple of 9? False Is 236 a factor of 3023985? False Does 183 divide 48081969? True Does 659 divide 3603412? True Is 312095772 a multiple of 2118? True Is 75322104 a multiple of 1768? True Is 3359734812 a multiple of 6? True Is 803167212 a multiple of 329? False Is 230948816 a multiple of 28? True Is 3666 a factor of 1422158712? True Is 45508968 a multiple of 8? True Is 655 a factor of 46371380? True Does 5 divide 2890358860? True Is 37 a factor of 344337318? True Does 2621 divide 421447113? False Is 322549311 a multiple of 147? True Is 611 a factor of 631503327? True Is 442 a factor of 64501502? True Is 11389253 a multiple of 33? False Is 255 a factor of 3139406745? True Is 11 a factor of 40472135? True Does 19 divide 78596312? True Does 60 divide 1167579300? True Is 672533509 a multiple of 98? False Is 42376728 a multiple of 118? False Is 27694970 a multiple of 10? True Does 4969 divide 1083506416? False Is 128 a factor of 239899308? False Is 20 a factor of 1138560? True Is 185 a factor of 77151344? False Does 177 divide 1346599008? True Does 1078 divide 69487446? False Does 21 divide 349336382? False Is 828969674 a multiple of 13? True Is 12107400 a multiple of 425? True Is 13 a factor of 522048371? True Is 24808098 a multiple of 21? True Is 100 a factor of 731187700? True Is 6 a factor of 30599909? False Does 6783 divide 157704750? True Is 177 a factor of 22994601? True Is 22 a factor of 39359166? True Is 146 a factor of 32475931? False Does 5186 divide 452660441? False Does 2 divide 251320056? True Is 840 a factor of 22706604? False Is 639505651 a multiple of 15? False Does 5 divide 2853695? True Is 42 a factor of 845438209? False Does 2999 divide 4245863483? False Is 20 a factor of 246838180? True Is 45992846 a multiple of 313? True Does 96 divide 168868896? True Does 273 divide 84818643? True Does 12 divide 5476117? False Is 35203955 a multiple of 316? False Does 204 divide 58410096? True Does 1009 divide 357546213? True Is 95 a factor of 2118405? True Is 356310504 a multiple of 6234? True Is 3758 a factor of 1807545388? True Does 1274 divide 387329932? False Does 202 divide 269422146? True Is 875 a factor of 85563227? False Does 5 divide 334064? False Is 15432554 a multiple of 11? False Does 6 divide 2804160? True Is 30150305 a multiple of 71? False Is 12 a factor of 2269305033? False Is 60953418 a multiple of 29? True Is 1213 a factor of 13004573? True Is 157 a factor of 13559678? False Does 11 divide 44620873? True Is 128423476 a multiple of 22? False Is 520871402 a multiple of 23? False Is 7 a factor of 1848532? True Is 955110 a multiple of 1027? True Is 5 a factor of 7205152? False Is 1399 a factor of 960656926? True Does 4 divide 8234938? False Does 1002 divide 2856552049? False Is 127 a factor of 158917608? False Does 390 divide 524152368? False Does 7066 divide 603959284? True Does 48 divide 1621968? True Is 9 a factor of 584464923? True Is 269107144 a multiple of 125? False Is 10 a factor of 100321138? False Is 208664038 a multiple of 9? False Does 153 divide 91566055? False Does 262 divide 13472564? True Does 18 divide 944713103? False Does 6679 divide 1179388961? False Is 9348915 a multiple of 15? True Is 2 a factor of 4452636? True Is 545180830 a multiple of 660? False Is 156 a factor of 150546552? True Is 38465810 a multiple of 54? False Does 1144 divide 2523469148? False Is 86 a factor of 196763421? False Is 1041960673 a multiple of 13? True Is 1341 a factor of 345771529? False Does 46 divide 695850682? False Does 20 divide 9565180? True Does 214 divide 149372163? False Is 200052767 a multiple of 19? True Is 89794166 a multiple of 341? True Is 9 a factor of 3068359578? True Is 40474811 a multiple of 1502? False Is 545819625 a multiple of 3296? False Does 99 divide 86910581? False Is 291 a factor of 8335113? True Is 7 a factor of 105581296? False Does 42 divide 73903536? True Does 14 divide 85800855? False Is 1209 a factor of 1028954242? False Is 9360 a factor of 2999880000? True Is 289 a factor of 183569403? False Is 88 a factor of 29409923? False Is 23698808 a multiple of 56? True Does 78 divide 819025? False Does 29 divide 154417772? False Does 4812 divide 1611370547? False Is 2204086610 a multiple of 14? False Is 355 a factor of 15999242? False Does 5 divide 375343? False Is 1409 a factor of 704545902? False Is 11632269 a multiple of 11? True Does 218 divide 8520748? True Is 91 a factor of 9783137? True Is 588156814 a multiple of 7? True Is 3314 a factor of 183028906? True Is 13 a factor of 2181474282? True Is 32532790 a multiple of 12? False Does 943 divide 71704777? True Is 17206593 a multiple of 123? True Does 13 divide 102192064? True Is 2450 a factor of 68122091? False Is 4204400 a multiple of 80? True Does 3263 divide 65915863? True Does 3 divide 21546876? True Does 322 divide 31967081? False Is 93 a factor of 230825070? True Is 639 a factor of 1805175? True Is 346363789 a multiple of 2701? False Is 215 a factor of 4880633? False Does 48 divide	{ "pile_set_name": "DM Mathematics" }
2d - 11d for d. 4 Let p(y) = -2y2 + 327y + 13443. Let a be p(-34). Let v be 2 - (2 - (2 - 1)). Solve 4i = -2m, -2m + a - v = -2i for m. 4 Suppose 67u = 108 + 294. Solve 9t + u = d + 12t, -t - 14 = -5d for d. 3 Let z be (-576)/(-528) + 24/(-22). Solve 16 = 4l + 3i, z = -4l + 2l - 2i + 8 for l. 4 Suppose -8m - 5a = -9m - 22, 0 = -3m + 4a - 11. Let u = 7 - -4. Solve 0 = -2j - j + 2o + u, 17 = mj + o for j. 5 Let g be (-141/(-42))/((-3)/(-81)). Solve -2j - 8 = -2i, -14j + gj - 20 = -4i for j. -4 Suppose 3g + 0 - 3 = 0, -2g = 5o - 17. Solve oy + 3 = -2z, -5y - 5 = -3z + 19 for y. -3 Let r(d) = d*2 - 151d + 3541. Let b be r(29). Solve -2a = 5f - 2, -b = -3a + 11f - 12f for a. 1 Suppose 0 = -5x + 2l + 38, -3l = 4x + 11 - 23. Solve -3p + 14 = a, -xp - 23 = -11p - 2a for p. 5 Let i(g) = g3 + 2g*2 - g + 4. Let a be i(-4). Let d be (28 - 14) + -15 - -14. Let k be d/15 - a/5. Solve -kt - 4j + 16 = 0, -3t + 11 + 5 = 4j for t. 0 Let y = -198 - -284. Suppose -5d + 25 = 2v, -15d = -4v - 13d + y. Solve 8 = 5b - 2n, 0 = -b + 3b + 5n + v for b. 0 Let l(c) = 100c - 1195. Let k be l(12). Solve 0 = -g + ks + 6, g = 4g - 4s + 4 for g. -4 Let s(b) = b2 + 476b - 3867. Let v be s(8). Solve 51h = z + 55h - 11, -z - vh + 13 = 0 for z. 3 Let x(k) = -844k + 12. Let s be x(0). Solve r = f - 9, -2f - 4r + 0r = s for f. 4 Let c(z) = -2z + 6. Let f be c(-7). Suppose 4m - 28 = -f. Suppose -mq + 2 = -12. Solve qu = 2u - 5b, 4u + 2b = -8 for u. -4 Suppose 3a = -a + 132. Let d = 36 - a. Let l(s) = 2s3 + s2 + s + 3. Let p be l(0). Solve -dt = -4h, -t = 5h - pt for h. 0 Let x(f) = -8f*2 + 138f - 16. Let g be x(17). Suppose gb - 2 = 16b, -l - 3b = -11. Solve 0 = 5n - l - 17, n = 4d - 11 for d. 4 Let l = 46 + -46. Suppose 0j + 7j - 28 = 0. Solve l = -n + 5c + 4, -n - c - 6 = jc for n. -1 Suppose -14 = 5o + 4j + 11, -4o + 5j = -21. Let r be 3 + 0/o - -2. Suppose -6f + 110f = 416. Solve 0 = -3n + fw + 11 + r, 4n = -3w + 13 for n. 4 Let v(o) = 2o*3 + 3o + 9. Let a(h) = h*3 + h. Let y(p) = -3a(p) + v(p). Let c be y(0). Solve -c = 3w - d, 5w - 4d + 15 = d for w. -3 Let k(r) = r + 35. Let f be k(0). Suppose -10 = -fl + 30l. Solve 3z + 3n = 27, 0 = -4z - 0z - ln + 28 for z. 5 Let i = -7 - -11. Let t be (0 + -6 - (-14490)/1794) + 2/(-26). Solve -5r - i = 2q + 1, -tr = -5q + 31 for r. -3 Suppose -14242f + 44 = -14231f. Solve r - 2 = -3d, fr + 4d - 8 = d for r. 2 Suppose 0 = 87c - 56c - 49c + 378. Solve -co + 18o = 4v - 32, o - 9 = -v for o. 4 Let h = 19 + -1. Suppose 20 = -3q - 2l, -1957q + 1959q = 4l + 40. Solve 8n + 5z - 30 = 3n, q = 5n + z - h for n. 3 Let g be 1/5 - (-28)/10. Suppose -2x + 4c = -22, -5c = 5x + 3 - 43. Suppose xn - 2 = 34. Solve y = -t - n, 0 = -2t - gt + y - 2 for t. -1 Let y be 780/50 - 2/206. Let w = 11 + 11. Suppose wl + y = 25l. Solve 0 = -5q + li - 15, -4q - i + 11 = -q for q. 2 Let j(g) = -2985g + 8958. Let k be j(3). Solve -2c + 9s - k = 12s, 4 = -2c - 2s for c. -3 Suppose -4t + 8 = 4j - 4, 4t - 48 = 5j. Suppose 0 = 5z - t - 18. Suppose 1 = -i + z. Solve 2x = im + 30, 20 = m - 5m for x. 5 Suppose 13r - 12r = 2. Suppose -ra = -6a + 24. Solve -2u + 3 = -3n + a, -4n = 2u - 4 for n. 1 Let q(u) = 4u*2 - 19u + 56. Let s be q(12). Let z = s + -401. Solve -15 = -4v - 5b, zb = v + 6 + 3 for v. 0 Let d = 28869 + -28570. Solve -2g - 20 = -4b, -4g - db - 13 = -298b for g. -4 Let u = 822 + -800. Solve -59s = 2y - 62s + u, -8 = 4y + 3s for y. -5 Suppose 2f - f - 12 = 0. Suppose -o = -f - 14. Let l(g) = g*3 + 6g*2 - 6g - 31. Let w be l(-6). Solve wv = -4z + o - 10, -2v - z + 4 = 0 for v. 0 Suppose 11j + j = -60. Let d be (-4 + 4 - -22) + j. Suppose -x + 0x + q = -6, 2q + 8 = 0. Solve 3l = xc - d, 6 = -5l - 3c + 3 for l. -3 Suppose 5b - 12 = -2h + 3b, -b + 3 = 0. Let c be (23/6302/3473)/((-2)/(-6)). Solve 0 = -z - 5y + 12, -2z - hy + 4 = c for z. -3 Let v be (21/4)/((-135)/180)-1. Solve 0d - 4d + 16 = 5t, -3d + t - v = 0 for d. -1 Suppose -10l = 19l - 87. Suppose 0 = ld - 3i, 9i = 3d + 4i + 10. Solve -2k = r - 5k + 5, -dk = 0 for r. -5 Let k be (3 - 2)/(6/12). Suppose -4m + 2t + 150 = 0, -3t + 161 = -2m + 246. Solve r = -2d - k, 0 = -6d + d + 5r - m for d. -3 Let q = -3129 + 3129. Solve 2y + 14 = 11k - 12k, 3y + 2k + 23 = q for y. -5 Let h be (-1)/3 + 15808/192. Suppose -152 = -14n - h. Solve -2x = -6x, 0 = nv + x for v. 0 Let u = 11658 + -11654. Solve -15 = 6g - 3g, -50 = 5j + ug for j. -6 Suppose 79g - 144 - 172 = 0. Solve 5j - j = f + 8, -gj = -2f - 12 for f. -4 Let k = 124 + -118. Suppose z = 0, -4w - 2z - 8 = -kw. Solve -2a - 2 = 0, -3r + a = -0a - w for r. 1 Suppose f = -f + 10, 2j - 4f = -14. Suppose 2 = js - 58. Solve 0 = 5z - 2r + s, -3r = -2z + z - 4 for z. -4 Suppose 11 + 31 = 3f. Suppose 9m = fm - 675. Let h = m + -106. Solve -3x - k = k - 7, -5x + k = -h for x. 5 Let t = -3325 - -3237. Let l = -186 - -122. Let x = l - t. Solve 3p - 1 = 4g - x, -4g - p = -19 for g. 5 Let h be (-33)/(297/24)6/(-8). Solve -hg = 2k + 2k - 2, 2g = -k + 5 for g. 3 Let d(z) = -z*2 + 8z + 35. Let p be d(-5). Let i be p/(-20)1/(-3)-2. Solve 0 = 4o - 4f + 20, -f + i = -5o - 2f for o. -1 Let i = 11552 - 11551. Solve -o - c = -i, 2o + 3c + 6 = 11 for o. -2 Let n = -12227 + 12232. Solve -np + 5m + 7 = 37, 5m - 20 = -5p for p. -1 Suppose -16p + 47 = 6 - 7. Solve -2x - 4y + 11 = 9, 2x = -py + 3 for x. 3 Let r = 17434 - 17434. Solve c + 12f + 9 = 8f, f + 3 = r for c. 3 Suppose -115n + 1582 = 676n. Solve -4 = v - a, -168v + 10 = -172v - na for v. -3 Let x = -6088 + 6114. Solve 3p + 0 = -2z - 1, 2p = 5z - x for p. -3 Let v(g) = -g + 19. Let y be v(12). Suppose 0r = yr - 35. Suppose 2p - 2k - 2k = 14, 3p - 2k = 17. Solve 3z + 16 = z - px, 3z = rx + 1 for z. -3 Let l(d) = d2 - 7d - 16. Let z be l(9). Solve -5t - 5j = 0, -zt - 2 = -0t + 3j for t. 2 Let q be (-15)/(-6) - 150/(-20). Suppose -6 = f - q. Solve 0 = -5p + 4m - 18, fp - p = m - 8 for p. -2 Let t(b) = 49b - 210. Let y be t(5). Solve -3s + 3r = 0, 45s - 49s - 3r = y for s. -5 Let o be 6/(-234)18 + 12/26. Solve -25x - 2d - 19 = -28x, o = d + 5 for x. 3 Suppose 4f = -f + 900. Let a = -160 + f. Solve -4y - a + 6 = -2c, -c - 17 = 4y for c. -1 Let d = 38467 + -38392. Solve 3o = 3v - 9, 63 = v + 4o + d for v. 0 Suppose -10 = -5l + 31 - 16. Solve 0 = -lq + 3t - 30, -3t = 2q - 20 + 11 for q. -3 Let k(c) = -3c + 41. Let s be (16/(-2))/(10/(-5)). Suppose 0 = 5o - sn - 85, n = 4o + 4n - 37. Let q be k(o). Solve -l - l = q, -5y + 9 = -4l for y. 1 Suppose -636v = 2s - 638v - 24, 3 = 3v. Solve -sa = -5o - 16a + 29, -3o + 2a = -6 for o. 4 Let p(j) = -j + 3. Let s be p(1). Solve r = 0, sr = t + 2t - 9 for t. 3 Suppose 7s + 139s = 575 + 1761. Solve 6q - 2q + s = 0, -o + 5q + 24 = 0 for o. 4 Suppose 0c - 3w - 96 = -3c, -c = -2w - 34. Suppose 5l - c = 5d, -5l - 4d = -2l + 3. Solve -3j = -2f - l - 1, -5j - 2 = f for j. 0 Let m = -10999 - -11001. Solve 12 = -7l + 5l - q, -ml - 3q = 16 for l. -5 Suppose -5b + 19 + 17 = -4. Solve 0s - 2s = -4, -s + b = 3i for i. 2 Let n be 7/(42/9)-2. Let w be ((-30)/10n)/((-6)/(-4)). Solve -c - w = 3h + 2, h - 3c - 14 = 0 for h. -1 Let r(j) = -13j - 22. Suppose -114p - 14 = -107p. Let z be r(p). Solve 2g - t - z = 2, 2t = 3g - 8 for g. 4 Suppose -27t - 2133 = -2214. Solve -4v + tp = -8v + 2, 0 = -4v - 5p - 2 for v. 2 Let x be 29/87(-9)/21-259. Solve -u = 4i + 4, 12 = 2i - 40u + xu for i. 0 Let y be 2 + 16/(-7) - (-11)/(154/74). Solve -2v + 1 = -ya, 3v + 9a - 4a - 14 = 0 for v. 3 Suppose -9 = -3z + 3u, -3z - 41u = -37u - 9. Solve 13 = 2i + 11n - 12n, -4n + 3 = zi for i. 5 Suppose 0f = -f + 3. Suppose 5i + 12t - 50 = 14t, 5t + 9 = -2i. Suppose w + fw = i. Solve y - 13 = -5j, -4j = 2y + w - 10 for y. -2 Let w = 395 - 392. Suppose 4h - 15 = -h. Suppose hu = -4 + 19. Solve -5s + 0s - w = d, 0 = us for d. -3 Let z(l) = l2 + 10l - 29. Let r be z(-8). Let o be -6-5(-6)/r	{ "pile_set_name": "DM Mathematics" }
5y + 5k - 35, 0y - 5y + 2k - v = 0. Is 2/y - (12488/(-12) + 1) a composite number? False Is -51 + 45 + (96703 - 0) a composite number? False Let p(y) = 2y*3 + 7y*2 + 9. Let r be p(-4). Is (r - (-2 - 4))16118/(-2) a composite number? False Suppose 13u - 350088 - 4203564 = -603745. Is u a composite number? False Suppose 10 = 4r - 6. Suppose rm + 8945 = -5q + 22890, 2789 = q - 3m. Is q composite? False Let p(o) be the first derivative of 46o*3/3 - 7o*2/2 + 3o + 13. Let y be p(-4). Suppose -2 + 0 = 2b, 3m - 5b = y. Is m prime? False Suppose 25 = 6s - 47. Suppose -5m = r - 3, -2r - 2r + s = 4m. Suppose 4x = z - 93, 4x - 41 - 318 = -rz. Is z a composite number? False Let n = -58322 + 120055. Is n a prime number? False Suppose -7u + 40586 = -5u - 4o, 2o + 81142 = 4u. Let t be (-1 + -1 + u)1. Suppose 5n - 2y - t = 0, -7n = -2n + 2y - 20269. Is n composite? True Is (-6)/9 - 273884/(-12) a prime number? False Suppose -2a + r - 8 = -4a, -2r = 5a - 22. Let d be (a/12)/(3 - 1282/428). Suppose d = g - 147. Is g prime? False Let q be (-921)/2456 + (74/(-16) - -1). Let h be (-108)/(-14) + (-2)/(-7). Is (-1)/((h/194)/q) a composite number? False Let f(l) = -12l3 + 4l*2 + 3l - 4. Let a be 10(2 - 69/15 - -3). Let i be f(a). Is ((-17)/4)/(6/i) composite? True Let u(o) be the third derivative of -119o4/8 - o3/3 + 25o2. Let y be u(-2). Let d = -381 + y. Is d prime? True Let z(y) = -18y - 39. Let x be z(-10). Let j = 144 - x. Suppose -6k + 1599 = -jk. Is k composite? True Let j = -46521 + 77576. Is j prime? False Let h = -5 + 9. Let w(a) = -76a - 1209. Let u be w(-16). Suppose -hj = uj - 979. Is j prime? True Suppose -c - c = -2h, -5h = 4c. Suppose c = -132i + 146i - 240310. Is i a prime number? False Let y(v) = 58v + 857. Let a be y(-15). Let n(i) = -16i*2 - 1 - 9i - 2i3 + 2 - 3i. Is n(a) prime? True Let c be (-3 - (1 + -16))/(-2). Let r(s) = 101s2 + 12s + 31. Is r(c) prime? False Is (5198272/16 - -35) + 52 composite? True Suppose 4c - 1 = u, -c = -6u + 4u - 9. Let k be (4/c)/(-4)-7. Let q(y) = 19y*2 - 14y - 20. Is q(k) prime? True Let d be (-1 + -8)(-35 - 37). Suppose d = 2m - 2954. Is m composite? False Let u = 105 - 105. Suppose 4a = 8, u = g - a - a - 975. Is g prime? False Let y(q) = -45q + 3. Let i be y(-1). Is (-11)/88 + 185718/i a composite number? True Let z = -1432 - -2409. Let m = z + -346. Is m a composite number? False Is 50 + -31 + (-4352274)/(-3) a composite number? True Suppose -2 = 2c - p + 4, 4c + 3p = -32. Let g(f) = -25f + 13 - 17f - 14f. Is g(c) composite? False Let g = 308990 - -54427. Is g composite? True Let x(l) = 2l3 - 6l*2 + l + 6. Let u be x(4). Let i = -43 + u. Is (697/(-51))/(i/69) a prime number? False Suppose -s = -l - 3264, 4l + 1955 = s - 1318. Suppose 4t = a - s, a + 32t = 29t + 3289. Is a composite? True Let q(x) = -81x + 4. Let i(u) = -1. Let k(p) = i(p) - q(p). Let y = 1477 + -1475. Is k(y) a prime number? True Let u = 16542 + -24244. Let m = 9637 - u. Is m a composite number? True Let b = -43 - -39. Let u(n) = -25n3 - 2n*2 - 4n - 5. Let k(g) = -51g3 - 4g*2 - 7g - 9. Let r(c) = bk(c) + 7u(c). Is r(4) a prime number? True Let b(i) = -i*3 + 11i*2 - 18i. Let k be b(9). Suppose 10n - 9n - 1731 = 0. Suppose 9v + n - 4692 = k. Is v composite? True Let b = 60 + -57. Suppose -bx + 2507 = -5n, 2x + 0x - 2n = 1674. Suppose -v = -2v + x. Is v composite? False Suppose -36p + 21p + 839745 = 0. Is p a prime number? False Suppose -1463715 = -51j - 295968. Is j prime? False Suppose 13c = 2a - 76177, 5c - 87212 = -2a - 11089. Is a a prime number? True Let o(x) = x*2 + 6x. Let b be o(-6). Suppose 0 = -bq - 4q - 2a - 2, 15 = 5q - a. Suppose 901 = -qf + 3f. Is f a composite number? True Let j be 48/20 + (-3)/(-5). Let z(b) = 3b3 - 5b*2 + 5 - 8b*2 + jb + 4b2. Is z(7) a prime number? False Let q(h) = h3 - 26h*2 + 24h + 62. Let a be q(29). Suppose p - d - 16 - 3263 = 0, -p + a = -2d. Is p a composite number? True Let b be (2437/1-1)/1. Let m = 6119 + b. Let l = m + -2540. Is l a composite number? True Is 89776 - ((-14)/(-1) - 270/30) a composite number? True Let o be 4(1 + -3) + 454. Suppose 440d + 6108 = od. Is d a prime number? False Let m(i) = -i3 + 2i*2 - 3i + 2. Let d be m(1). Let j be (d - (-44)/(-2))/((-3)/(-18)). Let v = -74 - j. Is v prime? False Let t be 5046/30 + (-7)/35. Let f = t + 419. Is f composite? False Let n be (-56)/30 - (-7)/((-210)/4). Let s(b) = -2b. Let w be s(n). Suppose wg = 3j - 11361, -5j = 2g - 0g - 18935. Is j prime? False Let x(i) = -i*2 - 26i - 20. Suppose -f + 3f + 30 = 0. Is x(f) composite? True Let s = 668329 + -269198. Is s prime? True Let l(b) = 0 - 5 + 161b*2 - 93b*2 + 5b. Is l(8) a prime number? False Let t(b) = 2 + 16 + 64 - 76b. Is t(-6) composite? True Suppose -16 + 24 = 4x, -w - 304 = -2x. Let f = w + 637. Is f a prime number? True Suppose 0 = -4w - 3f + 27727, 4f + 27692 = -w + 5w. Let u be 1517/(168/w). Suppose -4t + u = 558. Is t a composite number? False Is (3 - (-27)/(-5))-11915 + 5 prime? False Suppose n = -403 + 2337. Suppose -6y - 5a + 2421 = -5y, 4y - 9634 = 5a. Suppose -n - y = -5z. Is z a composite number? True Let z(y) = -254y*3 - 28y*2 - 123y - 46. Is z(-15) composite? False Suppose 4m + 68827 = -x + 308678, -2x = -3m - 479647. Is x composite? False Suppose 4u - 37411 = -3g, -3g + 50043 = 3u + 12636. Let a = g - 6268. Is a prime? True Is ((-584392)/918)/((-10)/555) + (-2)/(-18) composite? True Suppose 938w - 688830 = 923w. Is w a prime number? False Let v(p) be the second derivative of 5p*4/4 + 2p3 + p2 + 25p. Suppose 6q + 7q - 91 = 0. Is v(q) a prime number? True Suppose -1135 = -3h - s, -3s + 1505 = -3h + 7h. Let g(u) = 52u - 49u - 1 - 2u*2 - hu*3 + 1081u*3. Is g(1) prime? True Let g(t) = -2t*2 - 7t. Let p be g(-3). Is (-469 - 0)/(p - 4) a composite number? True Let o = 50204 + 7263. Is o a composite number? False Let f(i) = -i*3 - 64i*2 + 397i - 207. Is f(-92) composite? True Suppose 6n - 2n = 276. Suppose -2d - n = r, -3d = 10 - 4. Is (1534/r)/((-8)/(-10) + -1) a composite number? True Suppose -16a - 19950 = -22a. Suppose 1214 = -n + a. Is n a prime number? True Let g(x) = x*3 + 19x*2 + 20x - 27. Is g(-14) a composite number? False Let q = 41925 + -20138. Is q prime? True Let g = -791 - -788. Let m(h) = -11423h - 238. Is m(g) prime? True Let s(r) = r2 - r - 8. Let a be s(19). Let k(t) = 34 - 13 + at - 5 - 13. Is k(1) a prime number? True Let p(f) = f*3 + 3f*2 - 30f - 14. Let x be p(-7). Suppose 0k - 6k + 5910 = x. Is k a prime number? False Suppose 725332 = 7n + 126153. Is n a prime number? True Let v(s) = s + 1172. Let b be v(0). Let y = 1171 + -492. Let q = b - y. Is q a prime number? False Let y(b) = 5b + 25. Let i be y(-7). Let t be 4/(i/(-4) - (-9)/(-18)). Suppose -2h + 4297 = -ts + 3s, h - 2145 = -4s. Is h prime? False Let i be (-8 + 1)2/(-7) + 4683. Let g = i + -2928. Is g composite? True Suppose 2m - 4 = 4. Suppose 0 = q + 2t - 2055, mt + t = -4q + 8226. Suppose 1718 + q = 3p. Is p a prime number? True Let j(p) = -266p + 206. Let o be j(-6). Suppose -31w + o = -585. Is w composite? True Suppose 0 = -4u + 15v - 10v - 20552, 3v = u + 5138. Let s = u - -8971. Is s composite? False Let d be (-21)/(-3) - 12. Let l = -891 + 873. Is 3195/l-14/d prime? False Let r be 0(13/(-2))/13. Suppose 5u + 2t - 49797 = r, 9 + 11 = -5t. Is u prime? False Let g = 3754 + -945. Suppose 0 = d + 2q - g, 2d - 138 = -2q + 5480. Is d a prime number? False Suppose 6g + 2375 = g - 5n, -g + 5n = 499. Is (4/4)/((-1)/g) a composite number? False Suppose 8 = 2n, 0 = s + 11n - 8n - 292181. Is s composite? True Suppose 21s = -4s + 3623021 + 27434204. Is s composite? False Let j be (6/(-9))/((-24)/1836). Suppose -ji + 337001 = -20i. Is i prime? False Suppose 291586 = 5q - 3f, 11f = -3q + 6f + 174972. Is q prime? False Is (-32)/144 + (-15291830)/(-90) prime? True Let w(f) be the first derivative of -f4/4 + 9f3 - f2/2 - 30*f - 240. Is w(25) composite? True Let c = 12091 + 139776. Is c prime? False Su	{ "pile_set_name": "DM Mathematics" }
38 What is the third derivative of -3aq*2t + 318aq - at4 + 23781at3 + 2q*2t*3 + 2t*2 wrt t? -24at + 142686a + 12q2 Find the third derivative of 61hm3 + 2hw2 - 697m*3w*2 - 3m*2w*2 - 7737m*2 wrt m. 366h - 4182w2 What is the first derivative of -1553r*2 - 4r + 171775? -3106r - 4 What is the third derivative of 12780l*6 + 2l3 - l2 - 47l + 59? 1533600l*3 + 12 What is the second derivative of -18d*4 - 2d*3 + 137d*2 - 562841d? -216d2 - 12d + 274 Differentiate 183443t4 - 2t*3 + 1008583 with respect to t. 733772t*3 - 6t2 Find the third derivative of m5 + 1660183m4 - 2190m*2 + 479m. 60m2 + 39844392m What is the third derivative of 9o4 + 26o*3r*2 + 6o3 - o2r + 12288or2 wrt o? 216o + 156r2 + 36 What is the second derivative of -24z*5 + 2580z*2 - z - 50954 wrt z? -480z*3 + 5160 What is the third derivative of 2464m*2t*3 - 233m*2t*2 + 2m*2 - 4mt3 + 12t*2 + 4 wrt t? 14784m*2 - 24m Differentiate -672h2i*2 + 87h*2 - hi - 61h - 2i*2 + i with respect to i. -1344h*2i - h - 4i + 1 Find the third derivative of 25326h*3k - h*2k + 6hk - 140k - 2 wrt h. 151956k What is the derivative of -711080y - 148926 wrt y? -711080 What is the third derivative of -508347m*3 + 2m*2 + 356649m wrt m? -3050082 What is the third derivative of -2075813l4 - 733l*2 + 80l + 3 wrt l? -49819512l Find the first derivative of 430546x*4 + 924036. 1722184x*3 Find the third derivative of 115d*5 - 16d*4 + 3d*3 - 296449d*2. 6900d*2 - 384d + 18 What is the second derivative of 4x3 - 3347x*2 + 1428x + 5? 24x - 6694 What is the second derivative of -2t*5 - 187229t*2 - 72528t - 1? -40t3 - 374458 What is the second derivative of 12o*2q + 434o2 + 6oq - 2o + 2q - 40 wrt o? 24q + 868 What is the second derivative of -323a5w + a*3w - 28a2 - 10aw + 2a - 218w + 1 wrt a? -6460a*3w + 6aw - 56 What is the first derivative of 335q2v*3 - 55q*2 - 97v*3 - 4v*2 + v wrt q? 670qv3 - 110q Find the second derivative of 83786b4 + 121601b. 1005432b2 Find the second derivative of 48904l*3 + 799l + 4. 293424l Find the third derivative of -3a*4c + a*4 + 26520a*3 - 177a*2c - a*2 + 31ac wrt a. -72ac + 24a + 159120 What is the third derivative of -778989k4 + 18121k*2 + 6 wrt k? -18695736k Differentiate -117522c + 109037. -117522 What is the third derivative of -146074p*4 + 7p*2 + 4904 wrt p? -3505776p Find the third derivative of 735d6y*2 - 77d*4x + d*2xy2 - 22d*2y*2 + 2d*2 - 2dx + 4xy wrt d. 88200d*3y*2 - 1848dx Find the second derivative of -9125a*2m*2n + 7a2m*2 - 17a*2n - 2m2n - 8216mn wrt m. -18250a2n + 14a2 - 4n What is the third derivative of 353847b6s + 2b6 + 4b*2s - 63781b2 wrt b? 42461640b*3s + 240b3 What is the second derivative of 536h*5 + 80h*4 + 628832h wrt h? 10720h3 + 960h*2 Find the third derivative of -4ju4 - 7ju3 - ju*2 - 1683j - 193u4 - u3 - u wrt u. -96ju - 42j - 4632u - 6 Differentiate 50r*2 - 48r + 23582. 100r - 48 What is the third derivative of 96963o*3 - 11547o*2 - 3o? 581778 What is the first derivative of -5250j2 + j + 31066 wrt j? -10500j + 1 Find the third derivative of 48053s4 - 8122s*2. 1153272s Differentiate -864234b2g*4 - 745b*2 + 6b + 4 with respect to g. -3456936b2g*3 What is the first derivative of -573089z*2 - 86320 wrt z? -1146178z Find the first derivative of -2460774dg + 29642d + 2 wrt g. -2460774d Find the second derivative of -272098w2 + 48w - 21 wrt w. -544196 Find the first derivative of 47465j2 + 70604 wrt j. 94930j What is the third derivative of 14324h4 - 3h*3 - 7h*2 - 440h? 343776h - 18 Find the third derivative of -34256s*6 + 18649s*2. -4110720s*3 What is the third derivative of -866201l*5m - 2l2m - 24879l2 - 2lm wrt l? -51972060l*2m Differentiate -282439c2 + 248946. -564878c Find the second derivative of -312174o2 - 65o + 2568 wrt o. -624348 What is the second derivative of 443v3w*2 - 3v*3w - 10v2w*2 + 2080vw2 + 5vw + 2v - 1 wrt v? 2658vw*2 - 18vw - 20w*2 Differentiate -1361111f*2 - 81880. -2722222f What is the derivative of -136555d2 - 595629 wrt d? -273110d Find the second derivative of 655728b2 + 15162b. 1311456 What is the derivative of -1575984k3 + 409503 wrt k? -4727952k*2 Find the second derivative of 1491204i*2 + 1056i - 461. 2982408 What is the third derivative of g*2l*4 - 2289g*2l - gl4 + 14gl2 - 4418l*3 - 2l wrt l? 24g2l - 24gl - 26508 What is the second derivative of 78j3s*2 - 3j*3s - 54js*3 - 128j + 7s wrt s? 156j*3 - 324js What is the first derivative of -830936n + 830721 wrt n? -830936 What is the second derivative of -25164g2u2 + g2u - 895g*2 + 3gu + 2u wrt u? -50328g2 Find the third derivative of 9168c*4 + 5c*3j + 12c2j - 2c2 - cj - 94 wrt c. 220032c + 30j What is the first derivative of -317037b + 234840 wrt b? -317037 Find the third derivative of 61i*5 - 868i*4 + 2i*2 + 9441i - 1. 3660i2 - 20832i What is the first derivative of 14w4 + 115w*3 - 13w*2 - 955399? 56w*3 + 345w*2 - 26w Find the first derivative of -5311ci*2 - 3465i*2 + 3i + 1 wrt c. -5311i2 Find the third derivative of -71gu3z*3 - 9gu3z + 185gz*3 + 23gz2 - 3g wrt z. -426gu*3 + 1110g What is the third derivative of -575gl*4 + 123048gl - 154l5 + l2 wrt l? -13800gl - 9240l2 Find the third derivative of 11272p*3 - 191p*2 - p + 206. 67632 What is the first derivative of -3gn3 + 3gn2 + 2gn - 750g - 2n3 + 20n*2 + 63n + 42 wrt g? -3n3 + 3n*2 + 2n - 750 What is the second derivative of -5657c5j + 6c3g*2j + 1213cg*2j + 3cj + 2g2j - 2g - 2j wrt c? -113140c3j + 36cg*2j What is the second derivative of 1250851f5 - 2f*4 - 2654710f wrt f? 25017020f3 - 24f*2 What is the third derivative of 6361877a*3o - a*2o + 2a2 + 13ao - 2a - 113o wrt a? 38171262o What is the first derivative of -89n2 + 22nr3 + 3r*3 + 2801r wrt n? -178n + 22r*3 What is the second derivative of 3i*5 - 184i*3 - 11i*2 - 6021i + 3? 60i3 - 1104i - 22 Find the second derivative of 45033a4 - 108709a. 540396a2 Find the third derivative of -20d*2w*4 - 2d*2w3 - d2w2 + 380dw3 + 3dw2 - 10114w*2 wrt w. -480d*2w - 12d2 + 2280d What is the first derivative of 4752q3 + 129q + 3578839? 14256q2 + 129 Find the third derivative of 1515atz*6 - 7atz*5 + 40az2 - 10a - 7tz - 2z2 wrt z. 181800atz*3 - 420atz*2 Find the second derivative of 981206g*3hr2 + 2g*3hr - 2g*3h - g*2hr - 2772g*2r wrt r. 1962412g3h What is the first derivative of 612097q - 340969? 612097 Find the third derivative of -547f*2r*3 + 4f*2r*2 - 12f*2 + fr*3 - 3fr - 4r*3s - 9rs wrt r. -3282f2 + 6f - 24s Find the second derivative of 192565m*2 - 606546m wrt m. 385130 What is the first derivative of -9cdr2 + 13cr2 + cr + 32541d - 10r*2 - 3r + 4 wrt d? -9cr*2 + 32541 What is the first derivative of 5hj - 536h - 1564j + 8 wrt h? 5j - 536 What is the second derivative of -1030204q2 + 1892077q wrt q? -2060408 Find the second derivative of -110569a2 - 89a - 184 wrt a. -221138 Find the third derivative of -37341w3 - 3w*2 - 4. -224046 Find the third derivative of -58f*3k - 196f3 - 57f*2k + 24f2 + 2fk wrt f. -348k - 1176 What is the third derivative of -2128604z3 - 2880774z*2 wrt z? -12771624 Differentiate 4n*3 + 2028n*2 - 4n + 3891547 wrt n. 12n2 + 4056n - 4 Find the second derivative of 57068c2 + 43910c wrt c. 114136 What is the second derivative of c*5 + 6c4 + c3 + 4187c2 + 2c + 330144 wrt c? 20c3 + 72c*2 + 6c + 8374 What is the first derivative of 4417944n2 + 1971124? 8835888n What is the second derivative of -1171j4 + 1180j*3 - 17741j	{ "pile_set_name": "DM Mathematics" }
+ 2z, 0 = -3p - 5z - 41 for p. -7 Solve -5l = -5y - 807 + 767, -y + 12 = l for l. 10 Solve 0 = 4j - 8, 6x + 5j - 11 = 5x for x. 1 Solve 4o - 12 = -4q, -3o + 218q = 216q + 1 for o. 1 Solve -4c - 27 = -s, -4c - 57 = -29 for s. -1 Solve 69y = 70y + 2u + 3, 5y = 2u + 33 for y. 5 Solve -2t = 8b - 18, -4b + 1096 - 1099 = 5t for b. 3 Solve b + 3g - 53 = -33, 0 = 19b + 4g - 62 for b. 2 Solve 0 = 4g + 4i, 4g + i = -198 + 192 for g. -2 Solve v - 15 = 9l, v - 36l + 39l + 9 = 0 for v. -3 Solve -5s = 20, 2n + 5s = 247 - 275 for n. -4 Solve 5m - 329 = -v - 333, 3v = 2m + 39 for v. 11 Solve -9 = 2r - l, 13r - 5l = -20r + 34r - 12 for r. -3 Solve -18k + 9 = 5y, -222k - 54 = 5y - 225k for y. -9 Solve -7f = 2s + 41, 5f = -3s + s - 31 for s. -3 Solve 0 = n - 5d, -n - 1244d + 1247d + 2 = 0 for n. 5 Solve 5z - 5b = -25, 5z + 8b + 25 = 10b for z. -5 Solve -191 = 2a - 5d - 220, 2d + 14 = 0 for a. -3 Solve 5x - 439 + 431 = l, 4x = -3l + 14 for x. 2 Solve -601u + 4y - 24 = -606u, 5u - 13 = -3y for u. -4 Solve -2p - 5d - 594 + 606 = 0, -5d + 30 = 5p for p. 6 Solve -5g - 2v = 22, -845g = -430g - 412g - 5v + 38 for g. -6 Solve -150k + 148k = 3g + 9, 0 = 4g - 3k + 29 for g. -5 Solve -5b + 122i = 127i + 15, 4b - 4i = 20 for b. 1 Solve 5j + 2g = 25, -64j + 69j + 40 = 11g for j. 3 Solve 39 = -5i + 4v, 138v + 36 = -2i + 143v for i. -3 Solve 3c = -3q - 6, -4q - 34 + 18 = 8c for q. 0 Solve 2q + 8945 = -14h + 8879, -5h - 23 = q for h. -5 Solve 2k - d - 14 = 0, 38 = 3k + 2k - d for k. 8 Solve d + 1 = -r, -113r + 117r = -3d - 1 for d. -3 Solve 4d - 4 = -580r + 576r, -8 = -2r + d for r. 3 Solve 5x + 3k = -16, 2x - 118k + 116k = 0 for x. -2 Solve y - 1 = 507m - 509m, -4 = -4y - 5m for y. 1 Solve 584v - 38 = -3o + 579v, v = 7 for o. 1 Solve 3 = g + 3c, -3g + 194c - 29 = 184c for g. -3 Solve v = 3l - 5, -111v + 14 = -2l - 106v for l. 3 Solve -2f + 25 = 5i + 7, 2i - 13 = 78f - 73f for f. -1 Solve -4f + 178w = 177w + 39, -3w - 18 = 3f for f. -9 Solve 6 = -q - 5, 2n + 43 = -20q + 17q for n. -5 Solve 3q = -2p - 3, 5p = -83q + 79q + 3 for q. -3 Solve 85 - 108 = 15c - 2r, -c - 17 = -4r for c. -1 Solve -23 = l - 2855s + 2851s, 0 = l - 2s + 13 for l. -3 Solve 965p + 4m = 963p - 6, 3p = -5m - 5 for p. 5 Solve 269d - 271d = -4b - 8, 9d = b - 49 for d. -6 Solve -p + 3r - 33 = -9, 47 = -4p + 5r for p. -3 Solve -1383q + 1384q + 6x = 10, 3q - 5x = -16 for q. -2 Solve -5m - 154l = -152l + 30, -2m - 12 = -4l for m. -6 Solve -2c = -5p + 52, -2p + 819c = 822c - 17 for p. 10 Solve 4k = -4v, 4k = -2v + 6 + 4 for v. -5 Solve 5k + 3n + 1499 - 1476 = 0, 0 = 5k + 5n + 25 for k. -4 Solve -3i - 18 = 2r, -38r + 3i + 24 = -42r for r. -3 Solve 3w + 9 = 2b, -w + 180 = 3b + 139 for w. 5 Solve 0 = -5z - 2k + 14, -k - 15 = -26z + 23z for z. 4 Solve 4n = -5444 + 5464, g = n - 10 for g. -5 Solve 15 = 3h, -53n + 32n + 5 = -26n + 4h for n. 3 Solve 3m - 23 = -k, -11m = -5k - 6m - 65 for k. -4 Solve 4w + 5y = -1, 381y - 191y - 188y = -2 for w. 1 Solve 441d = 443d + 2a - 22, -4a + 20 = 0 for d. 6 Solve 49x + j = 54x + 2, 0 = -x + 2j + 5 for x. -1 Solve -5g - 3c + 134 = 168, 0 = 2g - 4c - 28 for g. -2 Solve 4p + 3s - 5 = 0, -3 = -6p + 4p - s for p. 2 Solve -2a + 4l = 6, -4l - 4 = -1739a + 1735a for a. 5 Solve 0 = 5a + 173 - 203, 5l - 5a = -25 for l. 1 Solve -3r - 8 = 5t, -1046r = -1049r - t + 8 for r. 4 Solve -14 = s + 5k - 18, -3s + 5k - 8 = 0 for s. -1 Solve -114s = -3j - 116s + 5, 2j - s - 8 = 0 for j. 3 Solve -2b + 3l = -2, -3b + 20 = 31l - 27l for b. 4 Solve -3q - 4l = 1, -84l + 85l + 9 = q for q. 5 Solve -k + 8 = -15w - 4w + 14w, 4w = k - 7 for k. 3 Solve -2t = -7r - 22, 3t - 57r - 22 = -52r for t. 4 Solve -15h = -2x + 42, -19h + 24h - x = -16 for h. -2 Solve 3t - 5v - 16 = 0, -3t - 68v + 8 = -69v for t. 2 Solve 0 = -2w - 5z - 42, -2w - 4z - 5 - 29 = 0 for w. -1 Solve 4 = r + p, -5r = -4p - 34 - 31 for r. 9 Solve t + 2g + 5 = 0, -t + 14658g = 14659g + 3 for t. -1 Solve -b - 11 = 4i, -339b - 11 = -336b + i for b. -3 Solve 10y + 9a = 10y, 5y + 3a = -2822 + 2822 for y. 0 Solve 3f - 6u = 18, -4u = -f + 377 - 367 for f. 2 Solve -5b = a - 15, -3b + 102 = -3a + 75 for b. 4 Solve -5k = -3n + 18, 376 - 186 = -k + 187 for n. 1 Solve -20y - 10 = 5j, 4j - 3y + 35 - 46 = 0 for j. 2 Solve -5y - 36 = -43n + 57n, 4y - 3n = 28 for y. 4 Solve -1596z + 1594z + 2 = 2l, -9 = 3l for z. 4 Solve -9p + 42 + 41 = x, -5p + 55 = 5x for p. 9 Solve 8 = -2n + 3p, -55n + 60n - 5p + 20 = 0 for n. -4 Solve 113c = z + 116c - 2, -15c - 70 = -5z for z. 8 Solve 0 = -y - 8 + 12, 4z + 32 = 5y for z. -3 Solve -6l = -2n - 3 + 5, n + 2l = 1 for n. 1 Solve -3b = 4g + 15, -2b = 3b - 10g + 25 for b. -5 Solve -2h = -l + 15 - 8, 10 = 5l - 5h for l. -3 Solve -220h + 225h = 3r + 4, 3h + 6 = 3r for r. 7 Solve -o = 5b + 58 - 46, 0 = 3b - 3o for b. -2 Solve 5d + 112l = 101l - 59, 5l + 35 = -5d for d. -3 Solve 4d = 235h - 230h - 67, 2 = h + 3d for h. 11 Solve -836z - 2t = -841z + 27, -2z - 4t + 6 = 0 for z. 5 Solve -5o - 3m + 152 = 154, 10 = -5o + 5m for o. -1 Solve 4v + 4i + i = -37, -27i - 129 = -0v - 2v for v. -3 Solve -14 = 2l - 6u, 83l = 78l + 5u + 15 for l. 8 Solve -242n = -2k - 238n - 10, 0 = 6k + n + 4 for k. -1 Solve -5p = 3d - 575 + 603, -3p + 5d - 10 = 0 for p. -5 Solve 3o + 148 = -5c + 181, 8o = c - 41 for o. -4 Solve -2o + 68 - 31 = -5g + 44, 0 = -3o - 2g - 1 for o. -1 Solve -5m + 28 = 3k, -m - 12 = 1035k - 1030k for k. -4 Solve 4797n - 4800n - 3b = 12, 3n + 12 = -8b for n. -4 Solve -3t + 23g = 18g + 12, 5t - g = 2 for t. 1 Solve -5w = -5v - 5, 71v + 4w = 68v + 32 for v. 4 Solve 3v - 20 = -4j, 1621j - 1624j = -2v + 2 for j. 2 Solve 3m + 2b = -m - 6, -2m - 63b - 38 = -67b for m. -5 Solve -868n = -865n - 3k - 12, 2n + k = -4 for n. 0 Solve -2a = 3929p - 3922p + 26, 5a + 15 = -0p - 5p for p. -4 Solve -4c - 4v = 12, 22v + 6 = 28v for c. -4 Solve -4u + 12 = 0, m - 11 = -9u + 6u for m. 2 Solve -593n = -590n + 5c - 38, 0 = -3n - c + 22 for n. 6 Solve 36 = 12l - 3h, -4h - 9 = 7 for l. 2 Solve -448p + 5x = -447p - 13, 0 = -0p + 3p + 5x + 21 for p. -2 Solve 0 = 2n - 15t + 11t - 34, 0 = 3n - 2t - 19 for n. 1 Solve -6t = 18, 3515k + t - 13 = 3511k for k. 4 Solve -5z + 60 = -2d, -7z = -d - 422 + 338 for d. 0 Solve -3o + 4f = -28, -3o + 2f - 1901 = -1921 for o. 4 Solve -k - 4o - 48 = 0, -3544k + 51 = -3543k - 5o for k. -4 Solve 2u = 3j + 4, -2u + 21256j - 12 = 21257j for u. -4 Solve d = 5z + 3, 5z = 3d + 29 - 18 for d. -7 Solve -1579v + 1577v - r - 7 = 0, 5v = 11r + 50 for v. -1 Solve 478g + 12 = 5x + 481g, -7x = -g + 4 for x. 0 Solve -4d + 97130 - 97138 = 4p, 3d - p = -10 for d. -3 Solve -i - 5y - 27 = 0, -i - 36y = -33y + 17 for i. -2 Solve -i + 2h + h = 1, 4h = 16 for i. 11 Solve -2f = i - 9, 684f - 689f = -4i + 10 for f. 2 Solve -2g - 1 = v, 77v = -g + 76v + 2 for g. -3 Solve 0 = 2a - 2s - 6, 0 = -a + 7s + 36 - 27 for a. 2 Solve 4619h + 4g - 10 = 4616h, -21 = -4h - 13g for h. 2 Solve 0 = z - 8w + 51, -4z + 214 = 4w + 166 for z. 5 Solve 242 = -22r + 42h - 45h, -r + 2h - 11 = 0 for r. -11 Solve 3h = 5v - 52 + 11, 5h + 38 = 4v for v. 7 Solve -4u + 41 = 5c, -14 = -6u + 8c - 6c for u. 4 Solve 8z - 4z = 17r, -2z + r + 2r + r = 0 for z. 0 Solve 3828h - 3829h = 2q, 3h - 2q = -q for h. 0 Solve 2v + 2 = 15l, 0 = v + 12l - 11l + 1 for v. -1 Solve -504y + 507y - 8 = -5i, 4y = -i - 12 for i. 4 Solve -2r = -10, -3u + 1393r + 5 = 1391r for u. 5 Solve -f + m + 1 = 0, -15f + 13f + 5m + 8 = 0 for f. -1 Solve -2c + 4u + 0u + 62 = 0, 4c - 4u - 56 = 0 for c. -3 Solve 19g = 2d - 61, -4d - 7453g - 1 = -7450g for d. 2 Solve -8295j - 2i - 38 = -8299j, 0 = -5j - 2i + 43 for j. 9 Solve -4s - 259 = -267, -2s = 2x - 6 for x. 1 Solve -6 = 4d + g, -23d + 21d - 8 = -2g for d. -2 Solve 5y = 4k - 17, -5y + 524 = -9k + 556 fo	{ "pile_set_name": "DM Mathematics" }
- 4.39. Let f = x + 205.0000214. Round f to six dps. 0.000021 Let w = -114 + 114. Let a(g) = -9g - 4 + 264344g*3 + wg + 477844g3. Let t be a(-4). What is t rounded to the nearest 1000000? -48000000 Let k = 0.038 + -12.538. Let v = -190097.5113 + 190110. Let l = k + v. What is l rounded to 3 decimal places? -0.011 Let i be (335976056/16)/(4/8) + -7. Round i to the nearest 1000000. 42000000 Suppose -47 + 8 = -13j. Suppose -94 = -ju - 34. Suppose 25q - 785 = uq. What is q rounded to the nearest 10? 160 Let g = -1.37 + -7.33. Let r = g - 2.3. Let b = r + 10.9999955. Round b to 6 decimal places. -0.000005 Let p = 0.2184009723 + -0.2184. Round p to 7 decimal places. 0.000001 Let o be -1 - 11/(-1) - (3 + 3). Let l be 01/4 + o - 240804. What is l rounded to the nearest ten thousand? -240000 Let q = 213 + -218.31. Let l = q + -0.39. Let v = 5.69999657 + l. What is v rounded to 7 dps? -0.0000034 Let l = -30.36 - -19.4. Let m = -10.958962 - l. What is m rounded to 4 decimal places? 0.001 Let o be (-5 + (-261)/(-54))6. Let x be (-13 + -797)(o + -10). What is x rounded to the nearest one thousand? 9000 Let x = -259863809 - -259863781.14023981. Let a = x + -14.14023945. Let d = -42 - a. Round d to seven dps. -0.0000004 Let y = 11.087 + -0.087. Let v = y - 132. Let c = 121.0000106 + v. Round c to six decimal places. 0.000011 Let l = 45 + -44.789. Let c = 0.22982 - l. Round c to 3 decimal places. 0.019 Let r be (1-1)/(2/(-10)). Suppose 2134 = rs - 411. Suppose 6m = s - 19109. Round m to the nearest one thousand. -3000 Let y = -0.469215372 - -0.4692. What is y rounded to seven dps? -0.0000154 Let m = -1472855360.74379206 + 1472855385. Let h = -75.85621021 + m. Let x = 51.6 + h. What is x rounded to 7 decimal places? -0.0000023 Let u = -16132.648 + 16188. Round u to 1 dp. 55.4 Let v = 2051.9999999577 - 2052. Round v to 7 decimal places. 0 Let h = -21 - -744. Let o = 723.94 - h. What is o rounded to 2 dps? 0.94 Let x(n) = -3n + 5n - n - 3n. Let y be x(-1). Suppose 0 = 4o - 7o - yw - 3900008, w = -4. Round o to the nearest 1000000. -1000000 Let f be (-130)/(-91) + ((-2239546)/(-14))/1. Round f to the nearest one thousand. 160000 Suppose -4s + 3x + 9 = 0, 5s + 0x + 3x = 18. Suppose -4a = 0, 0 = u - sa - 211 + 4280. Round u to the nearest 100. -4100 Suppose h = -3d + 106, 2h - 4d = -6d + 224. Suppose -5n + 3b = -h, -4b = 3n - 6n + 58. What is n rounded to the nearest 100? 0 Let z = 3.7 + -4. Let i = 0.069076 - -0.231054. Let y = i + z. What is y rounded to 5 dps? 0.00013 Let w = 1735.7258 + -1736. Let v = w + -246.9258. Round v to the nearest ten. -250 Let s = 197.8994098 + -197.9. Round s to four decimal places. -0.0006 Let c = -12323.962326 + 12324. What is c rounded to 3 dps? 0.038 Let n = -4421 + 8925. Let l = 4503.99997957 - n. Round l to 6 decimal places. -0.00002 Let s = -0.23602 - -0.23601995097. What is s rounded to seven dps? 0 Let p = 5153674.620077 + -5153677. Let t = p - -2.38. Round t to five decimal places. 0.00008 Let o = -2.3354 - -71.4444. Let h = o - 0.109. Let f = h - 69.124. Round f to two dps. -0.12 Let u(z) = 194449z - 3 + 5 + 12 - 1. Let h be u(6). Suppose 2j + b + h - 206705 = 0, 2j + 959996 = 2b. What is j rounded to the nearest 100000? -500000 Suppose 0 = 384g - 50g - 377136100. Round g to the nearest one hundred thousand. 1100000 Let u = -51 + -19. Let c = 42 + u. Let b = c - -27.99982. Round b to 4 decimal places. -0.0002 Let w = -337553 + 337552.0100032. Let i = -1.04 + 0.05. Let s = w - i. What is s rounded to 6 decimal places? 0.000003 Let c = 0.248 - 0.072. Let q = c + -0.1760026. What is q rounded to 7 decimal places? -0.0000026 Let c = -53.2223 + 13.61828. Let h = -39.6 - c. Round h to 3 dps. 0.004 Let m = -37 - 104. Let s = m + 206. Let b = s - 64.999951. What is b rounded to five decimal places? 0.00005 Let z be (-3 - -2)/(2/82862). Let c = 62241 + z. Suppose -3a = -c - 9190. What is a rounded to the nearest 1000? 10000 Let t be 2453818/1 + (40 - 18). Round t to the nearest 100000. 2500000 Let b = 65.3341 - -357.629. Let r = b - 423. What is r rounded to 2 dps? -0.04 Let b be (-8)/(-12)3(-4 - 2). Let p be 0 + 2 - (b + -543348). Let s = p + -264362. What is s rounded to the nearest ten thousand? 280000 Let m = -1.572 + 1195.372. What is m rounded to the nearest 100? 1200 Let o = 0.0876 - -0.2919. What is o rounded to one decimal place? 0.4 Let v = -70522 - -62669.4. What is v rounded to the nearest one hundred? -7900 Let c(o) = -o*3 + 14o*2 + 17o - 26. Let x be c(15). Suppose -2756000 = -xw - j, 0j = -4j. What is w rounded to the nearest 100000? 700000 Let t = -35.002 - -35. Let z = 600.998092 - 601. Let f = t - z. What is f rounded to 5 dps? -0.00009 Suppose 1 = -2y + 7. Suppose -4v = yv. Suppose 0 = 5d - 3j + 10999997, -d + 3j - j - 2199998 = v. What is d rounded to the nearest 1000000? -2000000 Let y = -7702.94974 + 7703. Round y to 3 decimal places. 0.05 Let q = -85.5112 - 0.8288. Round q to the nearest integer. -86 Let d = 1096.28 + -1085.1811. Round d to 2 dps. 11.1 Let d = -14820 - -14729.836. Let o = d - -90. Let p = -0.16399769 - o. Round p to 7 decimal places. 0.0000023 Let r be (-4 - (-3912272)/98)14/3. Round r to the nearest 10000. 190000 Let y = -3 + -18. Let c = y + 26.6. Let l = c - 5.60175. Round l to 3 decimal places. -0.002 Let y(w) = 1101w3 - w2 + w - 1. Suppose 0 = -2s, 2v + 0s = -s. Suppose v = -3m - 5 + 8. Let f be y(m). What is f rounded to the nearest one hundred? 1100 Let s be 195714/(-21) + 18/(-63)1. What is s rounded to the nearest ten thousand? -10000 Let z = -0.07774 - -1.84444. What is z rounded to 1 dp? 1.8 Let h = 5602.9999994881 - 5603. What is h rounded to 7 dps? -0.0000005 Suppose 4a = 2c + 4 + 12, c - 27 = -5a. Suppose 4n - an = 2n. Suppose 71b - 75b + 700 = n. Round b to the nearest ten. 180 Let h = 146 + -244. Let c = h - -96.32. Let t = c + 1.68198. Round t to four decimal places. 0.002 Let u = 5556.013397 + -5556. Round u to 3 decimal places. 0.013 Suppose -4f = -6 - 2. Suppose s - 267600003 = -fp, 2p + s + s = 267600006. Suppose 0 = -6d - 0d + p. Round d to the nearest one million. 22000000 Let l = -75.532 - -223.951. Round l to the nearest ten. 150 Let b = -6.535 - -6.5349989922. What is b rounded to 7 decimal places? -0.000001 Let w = 3490229.99654 + -3490180. Let c = w + -50. What is c rounded to four decimal places? -0.0035 Let p = 3142 - 3341. Let m = 1015.1645 + -1214.16597. Let n = p - m. What is n rounded to 4 decimal places? 0.0015 Let c be (-67 - -31)(2106/4)/(-3). Suppose -15v = -15132 - c. What is v rounded to the nearest one hundred? 1400 Let i(y) = 1089y*3 - 25y*2 + 34y - 26. Let q be i(13). Let x = q - 1680724. Round x to the nearest ten thousand. 710000 Let u = -0.044929 - -0.0444. What is u rounded to 4 dps? -0.0005 Suppose -13p - 77619493 - 31284176 = -3187669. Round p to the nearest one hundred thousand. -8100000 Let b = -27.967 + -0.033. Let z = b + 158. Let d = -130.00000377 + z. Round d to 7 decimal places. -0.0000038 Let i = -529.005131 - -529. What is i rounded to 4 decimal places? -0.0051 Let c = 5677.3329 + -4876.397. Let i = 801 - c. What is i rounded to 3 decimal places? 0.064 Let t = 1713.2 + 9.8. Let p = t + -1723.1059. Round p to 2 decimal places. -0.11 Let z(r) = -6r - 10. Let a be z(-7). Suppose ay = 29y + 9. Suppose 7h - yh + 764 = v, 3v + 558 = -3h. Round h to the nearest one hundred. -200 Let l = 2.697 + 142.403. Let s = -67.2 + l. Round s to the nearest 10. 80 Let z = 211431962 - 211432041.00004016. Let g = -79 - z. Round g to 6 decimal places. 0.00004 Let b = -4410.14 - -4410.14198493. What is b rounded to 5 decimal places? 0.00198 Let l(j) = 13653j2 + 146j - 2720. Let i be l(20). Round i to the nearest 100000. 5500000 Let x = -99298 + 99297.5048126. Let d = x - 0.1187565. Let l = -0.614 - d. Round l to 5 dps. -0.00006 Let a = -582.50002712 + 582.5. What is a rounded to six decimal places? -0.000027 Let o = 173.308 + -178. Let s = o - -4.73. Round s to one decimal place. 0 Suppose -20834635 = -257j - 62j + 12657175. Round j to the nearest one thousand. 105000 Suppose -5h = g - 153, -5h - 3*g + 91 = -68. Let i be (-4)/h - 143/165. Let v(d) =	{ "pile_set_name": "DM Mathematics" }
-2 in decreasing order. 1, -2, -4808477 Put -1, 3, 0, -79, 25, -201 in increasing order. -201, -79, -1, 0, 3, 25 Sort -5, -1, -3, 2, -148, 1, -151. -151, -148, -5, -3, -1, 1, 2 Sort -0.4, 1, -67435, -2/57. -67435, -0.4, -2/57, 1 Sort -2/15, -0.974, 7/4 in ascending order. -0.974, -2/15, 7/4 Put -5, -156, 9, -236, 4 in descending order. 9, 4, -5, -156, -236 Put -1, 0.6814409, 2, -47, 1/2, -3 in descending order. 2, 0.6814409, 1/2, -1, -3, -47 Put 14, -841, 1, 2732 in decreasing order. 2732, 14, 1, -841 Put -15, 2, 1476, 4, 10, -1, -2 in decreasing order. 1476, 10, 4, 2, -1, -2, -15 Sort -793, -3, 12446. -793, -3, 12446 Put -1/3, -950, -3, -2/9, 2, -2.1 in descending order. 2, -2/9, -1/3, -2.1, -3, -950 Sort -2, 217, 153, 0, 2, 4 in decreasing order. 217, 153, 4, 2, 0, -2 Sort 1/6, -3.1364, -105, 3. -105, -3.1364, 1/6, 3 Sort 5, -2, -25, -7137, 0, 2. -7137, -25, -2, 0, 2, 5 Sort -0.5, 3, 2/9, 5, -1/7, -4/2811. -0.5, -1/7, -4/2811, 2/9, 3, 5 Put 9501, 4, 2/379 in increasing order. 2/379, 4, 9501 Sort 6923.08, -0.02, 3 in descending order. 6923.08, 3, -0.02 Put 1, -3, 24361, 3, -1, 5, -2 in descending order. 24361, 5, 3, 1, -1, -2, -3 Sort 0, 6/5, -162572. -162572, 0, 6/5 Sort -7, 14, -188, 595, -1. -188, -7, -1, 14, 595 Sort 3, 0.18, 210702 in descending order. 210702, 3, 0.18 Sort -2/993, 0.06, -4, 1, -3 in ascending order. -4, -3, -2/993, 0.06, 1 Put -10/3011, 35, -0.03 in decreasing order. 35, -10/3011, -0.03 Sort 20, -21, -53, 5, -2 in descending order. 20, 5, -2, -21, -53 Put 199212, -197, 4 in decreasing order. 199212, 4, -197 Sort 1784, -4, 1483 in ascending order. -4, 1483, 1784 Sort -2, 0, 8, 63, 1, -3, -5. -5, -3, -2, 0, 1, 8, 63 Put -32, 6, -6, 0, 12, 2, 745 in descending order. 745, 12, 6, 2, 0, -6, -32 Sort -3.3583, -0.015, -1 in descending order. -0.015, -1, -3.3583 Sort -19, 4, -6, 118, 71, 3 in decreasing order. 118, 71, 4, 3, -6, -19 Put -0.024, -1006, -15 in increasing order. -1006, -15, -0.024 Sort 255, 11, -1, 0, -3, 3. -3, -1, 0, 3, 11, 255 Put 13, 7, -0.03, 0.06, 3.5, 2, 0 in descending order. 13, 7, 3.5, 2, 0.06, 0, -0.03 Put 6, 10007, 0, -2, 5 in increasing order. -2, 0, 5, 6, 10007 Sort 19, -4, -5, 9, 46, -3, -9. -9, -5, -4, -3, 9, 19, 46 Sort -6, 7, -5, -3, 1, -1, 5 in ascending order. -6, -5, -3, -1, 1, 5, 7 Put 18, -82.81, -6 in decreasing order. 18, -6, -82.81 Put 5, 16, -4, -2, -75, -5, -592 in decreasing order. 16, 5, -2, -4, -5, -75, -592 Sort 1, -3.8, 0.9, 1/8, -0.8, -6. -6, -3.8, -0.8, 1/8, 0.9, 1 Put -5, 5/9, -4, 0.14, -67, -3/5 in ascending order. -67, -5, -4, -3/5, 0.14, 5/9 Put 751, 2868, 4, 5, 10 in ascending order. 4, 5, 10, 751, 2868 Sort 2732, -10, 3, 696 in ascending order. -10, 3, 696, 2732 Put -51/4, 2, 9, -0.16, 14 in ascending order. -51/4, -0.16, 2, 9, 14 Sort -2315, 13, 2/19, 5, 6.6 in increasing order. -2315, 2/19, 5, 6.6, 13 Put 4, 5, 91762, -4, -5, -3, -2 in increasing order. -5, -4, -3, -2, 4, 5, 91762 Sort -1, -15, -2, 171, 21, 6 in decreasing order. 171, 21, 6, -1, -2, -15 Put 0, -3, -180, -17, 21 in increasing order. -180, -17, -3, 0, 21 Sort 109, -1, -10493 in ascending order. -10493, -1, 109 Sort 3, -51, 158, -14, 5. -51, -14, 3, 5, 158 Sort -2.1, 6/13, -15819 in descending order. 6/13, -2.1, -15819 Sort 6, -2, -15, -1513, -342. -1513, -342, -15, -2, 6 Sort -414, 64, 0, -8/159 in ascending order. -414, -8/159, 0, 64 Put 55619, -2/5, -3, -0.48, -1 in increasing order. -3, -1, -0.48, -2/5, 55619 Sort 1, 0.1, -96564323 in decreasing order. 1, 0.1, -96564323 Put 2, 2627, -1/5, 2/7, -294 in ascending order. -294, -1/5, 2/7, 2, 2627 Sort -179, -4, 2, -2, 468, 10, 0.4 in ascending order. -179, -4, -2, 0.4, 2, 10, 468 Sort -22/5, 0.0521, -3, 23, 2/15 in decreasing order. 23, 2/15, 0.0521, -3, -22/5 Sort 1, -116539, 165 in descending order. 165, 1, -116539 Sort -4, 466, -554 in decreasing order. 466, -4, -554 Sort -31, -2, 1, -209, 5, -5 in descending order. 5, 1, -2, -5, -31, -209 Sort 397/562, 2, 0.5, 0.4, -3, -4. -4, -3, 0.4, 0.5, 397/562, 2 Sort 0, 4, 2, -4, 3108652. -4, 0, 2, 4, 3108652 Sort -4, -82, 5, -2, 3, 9, -236. -236, -82, -4, -2, 3, 5, 9 Sort 69, -2, -1, 6, 13, 3 in descending order. 69, 13, 6, 3, -1, -2 Sort -10, -39, -2, -5, -1, 12 in descending order. 12, -1, -2, -5, -10, -39 Put 3/8, -1665308, -171 in increasing order. -1665308, -171, 3/8 Put -3, -644972, 1 in decreasing order. 1, -3, -644972 Sort -0.124, -2, 507, 1/4, -3, -0.5. -3, -2, -0.5, -0.124, 1/4, 507 Put 1, -2, 54, 85, -81, 3 in increasing order. -81, -2, 1, 3, 54, 85 Put 18, -0.39, 1886 in decreasing order. 1886, 18, -0.39 Sort -86, -650, 1, -1, 3, -4. -650, -86, -4, -1, 1, 3 Sort 1, 0.2, -2036, 4/83 in decreasing order. 1, 0.2, 4/83, -2036 Sort 109, 0.01, -4498. -4498, 0.01, 109 Put 371, 1771, -11 in decreasing order. 1771, 371, -11 Put 3/985, 515.7, 0.2 in descending order. 515.7, 0.2, 3/985 Sort -4, 5, 14, -555, -16, -5 in decreasing order. 14, 5, -4, -5, -16, -555 Put 9, 670, -3, 5, 6, 2 in descending order. 670, 9, 6, 5, 2, -3 Put 0.31, 0.4, 9, 4/5, 6, 263/9 in descending order. 263/9, 9, 6, 4/5, 0.4, 0.31 Sort 558, -1, 3, -2, -46. -46, -2, -1, 3, 558 Sort -871629, 2, 385, -4 in decreasing order. 385, 2, -4, -871629 Sort -5, 19/7, -1/5, 20, -4, 2, -28 in decreasing order. 20, 19/7, 2, -1/5, -4, -5, -28 Put 324, -4, 62, 46 in decreasing order. 324, 62, 46, -4 Sort 2, -4, 82667 in descending order. 82667, 2, -4 Sort 14, 1314, -3.4, 103 in increasing order. -3.4, 14, 103, 1314 Sort 0, -1110/19, 0.2, -26/15 in decreasing order. 0.2, 0, -26/15, -1110/19 Sort -4.1, -3, 57247 in descending order. 57247, -3, -4.1 Sort -2, 61, -3, 4, 30, 0, 369. -3, -2, 0, 4, 30, 61, 369 Put 972, 0, -3/4, 283/5, -0.5 in increasing order. -3/4, -0.5, 0, 283/5, 972 Sort 2, -1, 5, -25, -706 in decreasing order. 5, 2, -1, -25, -706 Sort 1148/169, -0.8, -1.3, 4/7 in increasing order. -1.3, -0.8, 4/7, 1148/169 Put -5, 2, -2, 32, 2723, 93 in decreasing order. 2723, 93, 32, 2, -2, -5 Put -50, 3.76, 2697 in decreasing order. 2697, 3.76, -50 Put -47, 1173, 537 in ascending order. -47, 537, 1173 Sort -3/35, -3/2, 3, -18/103. -3/2, -18/103, -3/35, 3 Sort 154, -16, 0.1, 25, 9 in ascending order. -16, 0.1, 9, 25, 154 Sort 0.5, 0.7, 8/7, -189, -1, 1, -3 in decreasing order. 8/7, 1, 0.7, 0.5, -1, -3, -189 Put 2, -1, 466703 in ascending order. -1, 2, 466703 Sort 1.2, -30, -0.3, -516, 0.4 in descending order. 1.2, 0.4, -0.3, -30, -516 Sort 3, -492652, -18, 4, -4. -492652, -18, -4, 3, 4 Put -1, 0, 5, 42, 3002, -4, 1 in decreasing order. 3002, 42, 5, 1, 0, -1, -4 Put -17, -8, -4, -4004.71 in descending order. -4, -8, -17, -4004.71 Put 1, -2, -43147, -473, -3 in increasing order. -43147, -473, -3, -2, 1 Sort 3107, -4, 172, 3, -3, -1. -4, -3, -1, 3, 172, 3107 Sort -2, 387145, 0, -8, 2 in ascending order. -8, -2, 0, 2, 387145 Put 10, 5, -1, -1895, -14 in decreasing order. 10, 5, -1, -14, -1895 Put 1, 3240, -19, 5, 2, 47 in increasing order. -19, 1, 2, 5, 47, 3240 Put -107, 13/3, -3, -398 in descending order. 13/3, -3, -107, -398 Put 36, -5, -1, -2, -14, 1, 4 in descending order. 36, 4, 1, -1, -2, -5, -14 Put 188/25, -1/3, -4, -0.5 in increasing order. -4, -0.5, -1/3, 188/25 Sort -3, -1588, 3, 6, 183 in descending order. 183, 6, 3, -3, -1588 Sort -16, -24, 3825 in decreasing order. 3825, -16, -24 Sort 0, -5, -124, 5, -10, 4, 9 in descending order. 9, 5, 4, 0, -5, -10, -124 Sort -127282, -4, 106 in increasing order. -127282, -4, 106 Put -4, -5, 4, 1875, -0.06, 3 in descending order. 1875, 4, 3, -0.06, -4, -5 Put -1173, -17.31, 1/9, -2 in descending order. 1/9, -2, -17.31, -1173 Put -0.0341, 0, 235359 in descending order. 235359, 0, -0.0341 Sort 6, -1.85, 1877, -0.21 in ascending order. -1.85, -0.21, 6, 1877 Sort -0.0517, -4, 682823. -4, -0.0517, 682823 Sort -0.3, 0.1, 2, -10.9, 4/11 in decreasing order. 2, 4/11, 0.1, -0.3, -10.9 Sort -5, -1/9, 2/7, 0.1, 479, -0.4 in increasing order. -5, -0.4, -1/9, 0.1, 2/7, 479 Put 2/9, 178, 0, 4/7, -0.35, 2, -1 in descending order. 178, 2, 4/7, 2/9, 0, -0.35, -1 Put -13, -3, 5, -2/7, -15, 36 in increasing order. -15, -13, -3, -2/7, 5, 36 Sort 5.3, -55, -382, -3 in ascending order. -382, -55, -3, 5.3 Put 1, 12, 68, -1, -3, -14, -2 in decreasing order. 68, 12, 1, -1, -2, -3, -14 Sort 8, -1, -16, 2, -2, 981, 13 in ascending orde	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.