Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
closest to 4 in 1/7, -1/4, u? u Let s = 9.304 - -0.096. Let m = -9.5 + s. Let l = 31 - 30.9. Which is the nearest to m? (a) l (b) -3 (c) 1/2 a Let k = 1/557 + 1105/5013. What is the closest to 2 in 5, -0.1, -0.02, k? k Let q = 0.01384 - 0.11384. Let o = 5 + -13. Let k = -10 - o. What is the nearest to -1 in q, -3, k? q Let y = 9738 + -9737. What is the nearest to -62 in -2, -0.2, y, 3/8? -2 Let r be (-5)/((-15)/6)-3(0 - -1). Which is the nearest to -1/4? (a) -2/11 (b) -0.3 (c) 4 (d) r b Let f = -3 + 5. Let p = -210 - -209.922. Let s = p - -2.078. Which is the closest to f? (a) s (b) -3 (c) 0.5 a Let u = -6.08 - -6. Let s = -3160 + 3156. What is the closest to u in -2, s, -0.4? -0.4 Let f = -40.041 - -39.8. Let c = f + 0.141. Suppose -6 = -4a - 2n, 4n - 5 + 3 = -3a. What is the nearest to c in 0.3, a, 1/9? 1/9 Let f = -1 - -7. Let r = 34757 + -34752. Let x = -0.2 - 0.2. Which is the nearest to f? (a) r (b) 2/13 (c) x a Let g = -3.93589 + -0.06411. Let q = -1 - -5. Let i be ((-87)/290)/((-12)/(-10)). What is the nearest to i in q, g, 0.5? 0.5 Let x = 285 + -281. Let u(v) = -v*2 - 4v + 8. Let m be u(-6). Which is the nearest to 1/2? (a) x (b) m (c) 3 c Let b = 980 + -1799. Let u = -845 - b. What is the nearest to 2/5 in u, 0.1, 2? 0.1 Let g = 227 + -1521. Let r = g - -1190.2. Let c = r + 104. What is the nearest to -1/4 in c, -2/13, 0.1? -2/13 Let u = -45.773 - 0.227. Let b = 52 + u. What is the closest to 1/3 in -5/4, 0.2, b? 0.2 Let p = 4359 - 4354. Which is the nearest to -0.2? (a) -18 (b) -2/9 (c) p b Let j = -654.7 - -649.7. Let n = 2.96 - -0.04. Which is the closest to 4? (a) n (b) -5/4 (c) 0.09 (d) j a Let u = 17 - 13. Let q = 62 + -59. Let k = u - q. Which is the closest to -0.3? (a) -3/4 (b) -0.5 (c) k b Let k = 651.9 - 652. What is the nearest to k in 1, -5, -134, 4? 1 Let f = -9723.9085 + 9726. Let z = 0.0915 - f. Which is the nearest to -1/18? (a) 3 (b) z (c) -0.2 c Let q = -70 - -71. Suppose -q = -6l + 41. Suppose 4r = -5n + l, -2r - 5 = -2n + 5. What is the closest to 1 in 1, n, -0.3? 1 Suppose -p = -2, -90f + 91f = 2p - 5. Which is the closest to f? (a) 0 (b) 2 (c) -3/5 (d) 43 c Let x = 0.022 - -0.008. Let u be 0/2 - (-17)/(-68). Let v = -4185/8 + 523. Which is the closest to u? (a) v (b) 0 (c) x a Let h = 95863/6 + -15977. Let g be (-164)/90 + (-4)/(-18). Which is the closest to 0.1? (a) -0.3 (b) g (c) h c Let g = 147.4 - 147.36. Let z be 2 + 0 + 9/(-5). Which is the nearest to -0.1? (a) z (b) g (c) 2/5 b Let u = -3102 + 15513/5. Which is the closest to 0.4? (a) 26 (b) -1 (c) -2 (d) u d Let l be 1/20(-12)/(-15). Let o = 11/25 - l. What is the nearest to o in -0.5, 3/8, 1? 3/8 Let k be (1 + 35/(-20))/((-63)/(-714)). Which is the nearest to k? (a) -2 (b) -0.1 (c) -2/9 (d) -11/5 d Let z = -13877 - -263783/19. Let x = z - 221/38. What is the nearest to -2 in 1, x, -2/7, -4? -2/7 Suppose -22s + 89 + 49 = 28. What is the nearest to 2/3 in 2/17, 1/11, s, 4/3? 2/17 Let f = -3.1 - -3. Let o be (-8 + 473/55)/(399/190). What is the closest to o in 2/39, 0.1, f? 0.1 Let g be 3/(-8)1/(-3). Let x = -22.5 - -22.423. Let h = x - 4.923. What is the closest to -2/3 in g, h, 0.3? g Let p(r) = -5r*2 - 207r + 123. Let q be p(-42). What is the closest to 1 in q, 3, 0.017, -4? 0.017 Let l = -2773 - -2771. What is the nearest to 0 in 5, -0.8, -0.14, l? -0.14 Let r(v) = -47v2 + 5v - 1. Let u be r(-2). Let w = 201 + u. Let d be 18/(-4)(-1)/(-6). Which is the closest to 0.1? (a) 5 (b) w (c) d c Let x = 1946.5 + -1946. What is the nearest to 23/19 in 2, -3/2, x? x Suppose -n - 4n + 47 = -4l, 4n + l = 46. Let d be (n + -2)/((-3)/(-6)-2). Let f = -2.9 + 3. Which is the nearest to f? (a) 4/3 (b) d (c) -0.5 c Suppose -2w + 0w = 8. Let u be 2/w + 2/8. Let v = 29054 + -29054.4. What is the closest to 2 in v, u, -4? u Let v = 41.3 + -35.3. Let i = -5 + 1. What is the nearest to 2/7 in -3/7, i, v? -3/7 Let y = 184.4944 + 0.4056. Let h = 185 - y. What is the closest to h in 5, 4, 0.3? 0.3 Let y = -41.212 - -40.6. Let k = -0.112 - y. Let t = 0.1 - 0.6. Which is the closest to -1? (a) -0.3 (b) t (c) k b Let y = 1.1 + -0.8. Let w = 92.78 + -89.78. Which is the nearest to w? (a) 0.07 (b) y (c) 0 b Let t = 164 + -166. Let r = 7772/21 + -370. What is the closest to -3 in t, -0.4, r, 4? t Suppose -364 + 1354 = 15a. Let l be a/(-21) + (-6)/(-42). What is the closest to 0.1 in l, 2, -2, -2/13? -2/13 Let r = 9/10 - 13/20. Let i = -57.3 + 56.9. Which is the closest to r? (a) i (b) 5 (c) 36 a Let z(p) = 8 + 2p + p - 3. Suppose 12 = 56u - 62u. Let v be z(u). Which is the closest to -1? (a) 0.3 (b) v (c) -5 b Let s = 451.54 + -451.34. Let j = -5 + 4.6. Which is the closest to -2/9? (a) 0.3 (b) s (c) j (d) 0.01 c Let v = -0.052 - 51.948. Let w = v + 50.7. Let j = w - -0.8. Which is the closest to -2/7? (a) -0.4 (b) 0.3 (c) j a Let t = 57/301 + -2/43. Let h = -0.059 - -0.275. Let p = -0.146 + h. Which is the closest to 2? (a) -2/13 (b) t (c) p b Let j = 61.7 + -65. Let g = 2.3 + j. What is the nearest to 0 in g, -0.5, 5/4? -0.5 Let l = 13.04 + -19.04. Let u be (9/153)/((-2)/(-4)). Which is the closest to l? (a) 0.3 (b) 5 (c) u c Suppose 0 = 4v + m - 1, -5v - 5m + 2m = 4. Which is the closest to -0.1? (a) -3 (b) 297 (c) 0.3 (d) v c Let v be (-1 - -1) + (-4)/(-22). Let o be 63 + (-1252)/20 + 8/30. Which is the nearest to o? (a) 0.4 (b) v (c) -0.07 (d) 1 a Suppose 0 = w - 4w - 27. Let k = 12527.5 + -12526.5. What is the nearest to k in 0.1, 4, w? 0.1 Suppose -47 = 4m - 23, 19 = -5g - 4m. Which is the closest to -1/3? (a) g (b) -0.192 (c) 1/4 b Let i be -2 + 2 + ((-44)/374 - 42/(-68)). What is the nearest to 1 in -1, i, 11, 0.2? i Let y be (14/21 + -3)/7. Which is the nearest to y? (a) 1 (b) 4.96 (c) -0.1 c Let k be (9/(-8))/((-6)/4). Let g = 3/31 - -29/341. Let w = 2/8319 - 8327/33276. Which is the closest to k? (a) -5 (b) g (c) w b Let w = -3 - 1. Suppose -4p - 3g = -5g + 8, 4 = -2g. Let s be 44/90 + p/5. What is the nearest to -9 in s, w, -0.1? w Let t(m) = 46m + 368. Let a be t(-8). What is the nearest to -1 in 2/3, 35/12, a? a Suppose 2u - 5094 = 20u. Let y = 848/3 + u. Let h = -1.6 - -2. Which is the closest to 1? (a) y (b) h (c) -1/5 b Let o = -0.621 + -0.379. Let b = 0.0154 - -0.8846. What is the closest to 0.1 in 0, -2, o, b? 0 Let z = -961.9727 - 0.0273. Let p = z + 961.082. Let x = p - 0.082. What is the closest to x in -5, -11, 2/9? 2/9 Suppose -12 = 4i - 4n, -58 = 2i - n - 52. What is the closest to -1/2 in 6.6, -0.5, -2/5, i? -0.5 Let m be 6(-84)/648 + (0 - -1). Let h = -0.19 - -3.19. Let n = 2.8 - h. What is the nearest to -1 in n, -4, m? n Let l = -384.5 - -385. Let q = -82 - -736/9. What is the nearest to -2/17 in l, -3/2, q? q Let o = -155.02 + 154.98. Which is the closest to o? (a) -5 (b) -0.2 (c) -3 (d) 2/7 b Let s be (-44)/506 - (-8)/92. Which is the closest to -46/9? (a) -1 (b) -2/11 (c) s a Let i = 0.3 - 0.2. Let k = -67.2 - -65.9. Let n = 5 + -9. What is the closest to i in 2, k, n? k Let w = 333.2 + 1.8. Let t = w + -339. Which is the nearest to -0.3? (a) 2/7 (b) t (c) -6 (d) -1 a Let r = -12985.8 + 12986. Which is the closest to 0.1? (a) r (b) 14 (c) -1/3 (d) -5 a Let d = 134 + -95. Let l = d + -36. Let z = 15 + -13. What is the nearest to 1/3 in -3, z, l? z Suppose -3r - 18 = u, -58r + 59r + 6 = -4u. What is the nearest to 1/2 in 4, r, 0.5? 0.5 Let j = -3099 - -15491/5. What is the closest to -0.1 in j, 224, 4? j Suppose 0 = -4j - 4d - 0d + 116, 4j - 4*d = 100. Let s = j - 80/3. Let o = -223 - -214. What is the nearest to -0.1 in -3, s, o? s Let r = 849.2 + -849. Which is the closest to -12? (a) -3 (b) 4 (c) 2 (d) r a Let h = 0.094 + 0.206. Let d = 18.2 - 46.6. Let t = 28 + d. Which is the closest to -1/8? (a) -2/7 (b) t (c) h a Let y = -1.04 - -0.04. Let l = 4385 - 4390. Which is the nearest to 0.4? (a) l (b) 0 (c) y b Let h = -10064 - -10063.5. Which is the closest to -0.3? (a) 2/27 (b) h (c) 4/9 b Let u = -204 + 186. Let s be (-4)/u + 90/(-405). Which is the nearest to s? (a) -4 (b) -0.12 (c) 0.1 (d) 5 c Let w = 10728 - 182377/17. What is the closest to 8 in	{ "pile_set_name": "DM Mathematics" }
3/3 - 91936w2/3 - 91928w/3 = 0. -11491, -2, 0 Suppose -2t4/7 + 1137204t*3/7 - 161681407794t*2/7 + 1108391799456t - 13299578780544 = 0. Calculate t. 24, 284277 Determine q, given that 2q3/9 - 3197898q*2 + 34514616508960q/3 - 103543820745800/9 = 0. 1, 7195270 Let k*4 + 551k*3 - 23907k*2 - 158211k - 244674 = 0. What is k? -591, -3, 46 Let -3y2 - 897135y + 897138 = 0. Calculate y. -299046, 1 What is j in -3j4/5 + 4866j*3/5 - 241896j*2 + 13870974j/5 - 12666357/5 = 0? 1, 11, 291, 1319 Determine k so that 3k2 + 84416838k + 593850211493187 = 0. -14069473 Factor 12a3/7 + 11381312a*2/7 - 13549300a. 4a(a + 948451)(3a - 25)/7 Factor 5f3 + 28879f*2 + 6080230f + 4845704. (f + 218)(f + 5557)(5f + 4) Factor -160c*3 + 106310040c*2 + 53155035c/2 + 1661095. -5(c - 664438)(8c + 1)2/2 Factor -c5 + 28c*4 - 201c*3 + 614c*2 - 860c + 456. -(c - 19)(c - 3)(c - 2)*3 Factor 2z*3 + 1125886z*2 + 2251758z - 3377646. 2(z - 1)(z + 3)(z + 562941) Find w such that 2w*4/9 + 6396w*3 + 418826344w*2/9 + 7375959120w + 28759665600 = 0. -14310, -158, -4 Factor -4i2 + 1352400i - 1352396. -4(i - 338099)(i - 1) Solve -30w5 - 485w*4 + 13880w*3 + 222370w*2 - 340290w - 2615445 = 0. -19, -3, 23/6, 21 Solve -3d3 + 2036619d*2 - 345646320993d - 1728282520815 = 0 for d. -5, 339439 Solve -2t3 - 134178t*2 - 2250668214t - 6750797094 = 0 for t. -33543, -3 Suppose -t*3 + 236502t*2 + 1419039t + 2128572 = 0. Calculate t. -3, 236508 Factor -r*2/5 - 68254r/5 - 136504/5. -(r + 2)(r + 68252)/5 Find u such that -2u*3 + 84898u*2 + 339616u + 339624 = 0. -2, 42453 Solve -a*4 - 1821a*3 - 514583a*2 + 5312361a - 4795956 = 0 for a. -1468, -363, 1, 9 Find q, given that q*3/8 - 15471q*2/2 + 956974029q/8 + 6704884207/4 = 0. -14, 30949 Factor 12737t2/6 + 184690t/3 + 203/6. (t + 29)(12737t + 7)/6 Factor -326n3 + 1087532n*2 - 906991680n - 11128896. -2(n - 1668)2(163n + 2) What is h in 591980805h*5 - 108810h*4 - 4143865630h*3 - 3551123160h*2 + 652825h - 30 = 0? -2, -1, 1/10881, 3 Factor 2h3/3 - 13064h*2 - 196110h. 2h(h - 19611)(h + 15)/3 What is k in -5k*5 + 130k*4 + 19330k*3 - 191720k*2 - 5757365k - 5546450 = 0? -53, -13, -1, 23, 70 What is x in -2x2/7 + 8032404x/7 - 8064939252402/7 = 0? 2008101 Suppose -3x3 - 2169x*2 + 90360x + 212439372 = 0. Calculate x. -502, 281 Factor t*2/3 + 15905332t/3 + 63244896507556/3. (t + 7952666)2/3 Factor k2/2 - 362481k - 2174895/2. (k - 724965)(k + 3)/2 Factor -3w3/8 - 53649w*2/4 - 235419093w/2 + 39811704681. -3(w - 326)(w + 18046)*2/8 Let -5k*4 - 701565k*3 - 4910790k*2 - 11224540k - 8418360 = 0. Calculate k. -140306, -3, -2 Determine r, given that 5r2 + 252035r + 1008060 = 0. -50403, -4 Let -4b4 + 391700b*3 - 783388b*2 + 391692b = 0. What is b? 0, 1, 97923 Solve 4y5 + 1320y*4 + 66516y*3 - 7197904y*2 + 72026112y - 177537024 = 0. -192, 4, 7, 43 Factor 2g3 + 100152g*2 + 1249082490g - 118300358300. 2(g - 94)(g + 25085)*2 Find s such that -3s*2 + 29226s - 13258215 = 0. 477, 9265 Let -1110578a5/13 + 1427760a*4/13 + 793432a*3/13 - 1427796a*2/13 + 317146a/13 + 36/13 = 0. What is a? -1, -9/79327, 2/7, 1 Factor -258j2 - 80019736j - 1240616. -2(j + 310154)(129j + 2) Solve -g2/3 + 22303g + 3481972/3 = 0. -52, 66961 Let 5s4 + 14714530s*3 - 44143625s*2 + 29429090s = 0. Calculate s. -2942909, 0, 1, 2 Let -3a2 + 537537a - 2150100 = 0. Calculate a. 4, 179175 Find w such that -1089w5 + 17727w*4 - 20437w*3 - 7351w*2 + 10550w + 600 = 0. -2/3, -20/363, 1, 15 What is d in -d*5 + 247909d*4 - 247904d*3 - 991636d*2 + 991632d = 0? -2, 0, 1, 2, 247908 Solve -f*3/7 - 12860f*2/7 - 128525f/7 - 321250/7 = 0 for f. -12850, -5 Solve 2l4/3 + 12171l*3/2 - 83804l*2 - 63994l/3 = 0. -9142, -1/4, 0, 14 Determine j, given that -j*5 - 2513j*4 - 1485504j*3 + 119282908j*2 + 494877344j + 500779200 = 0. -1292, -2, 75 Let -2n4/9 + 180956n*3/3 + 134724022n*2/9 + 2739481000n/3 - 16980125000/9 = 0. What is n? -125, 2, 271682 Solve 4m3 - 477524m*2 - 955064m = 0. -2, 0, 119383 Find d, given that 3d4/7 + 146494968d*3 + 87631501593525618d*2/7 + 25037571444379560d + 87631499542596075/7 = 0. -170910795, -1 Determine p, given that -4p5/5 + 972p*4/5 - 1916p*3/5 - 2924p*2/5 + 7728p/5 - 3856/5 = 0. -2, 1, 2, 241 Suppose 2o4 + 2784o*3 + 948430o*2 = 0. What is o? -797, -595, 0 Factor -4t*3/5 + 125792t*2/5 - 987087124t/5 - 5945186904. -4(t - 15739)2(t + 30)/5 Factor -2z3/5 + 1766z*2 + 1339696z/5 + 49973976/5. -2(z - 4563)(z + 74)2/5 Determine q so that q4/4 - 1819q3/4 + 668947q*2/4 + 144982455q/4 + 1302857172 = 0. -111, -48, 989 Factor 3j3 - 423714j*2 + 15673311j. 3j(j - 141201)(j - 37) Find n, given that 16n*3/3 + 88154n*2/3 + 6348794n/3 - 6436964/3 = 0. -43493/8, -74, 1 Let -2r2/5 + 311960r + 32756682/5 = 0. What is r? -21, 779921 Solve -2p2/15 + 50243968p/15 - 315557040048128/15 = 0 for p. 12560992 Suppose -5x5 - 10235x*4 + 3140905x*3 + 30715x*2 - 9402200x - 6281780 = 0. What is x? -2318, -1, 2, 271 What is h in h*4 + 172h*3 + 1259h*2 - 8752h - 9840 = 0? -164, -12, -1, 5 Factor -t*2/2 + 438t + 1393237/2. -(t - 1697)(t + 821)/2 Find x, given that -5x*2 - 8705x + 11725560 = 0. -2632, 891 Suppose -4v5 - 124520v*4 - 8448012v*3 + 26464808v*2 - 498128v - 35286432 = 0. What is v? -31062, -71, -1, 2 Let 3i3/4 - 350973i*2/4 - 526479i/2 + 350982 = 0. What is i? -4, 1, 116994 Determine r, given that -14r3/3 - 1362776r*2 + 2141514r - 2336200/3 = 0. -292025, 4/7, 1 Factor d*3/3 + 3694d*2/3 - 271081d/3 + 267386/3. (d - 71)(d - 1)(d + 3766)/3 Factor -4c2/5 + 278996736c/5 - 4864948668665856/5. -4(c - 34874592)2/5 Let 2o*5 - 93950o*4 - 469788o*3 - 563760o2 = 0. What is o? -3, -2, 0, 46980 Factor r2 + 4657r + 1009812. (r + 228)(r + 4429) Factor q*3/7 - 5277q*2/7 - 4800580q/7 + 4805856/7. (q - 6068)(q - 1)(q + 792)/7 Factor 3l2/7 - 400098l - 14003505/7. 3(l - 933567)(l + 5)/7 Let y*2/10 + 25706278y/5 + 330406364306642/5 = 0. What is y? -25706278 Find f such that -1403836f2 - 1404028f - 192 = 0. -1, -48/350959 Factor 2w2/3 - 32912w/3 + 2669082. 2(w - 16209)(w - 247)/3 Determine q so that 3q4/8 + 101369q*3/8 + 33789q*2/4 = 0. -33789, -2/3, 0 What is f in -5f*2 + 283890f - 61650400 = 0? 218, 56560 What is w in -w*3/3 + 6983402w2/3 = 0? 0, 6983402 Factor -j3/4 - 11467j2/4 + 9j/4 + 103203/4. -(j - 3)(j + 3)(j + 11467)/4 Find s, given that -2s3/13 - 11628s*2/13 + 177128s - 1681680 = 0. -6006, 10, 182 Factor -4k3/5 + 56764k*2/5 - 91780416k/5 - 172955430144. -4(k - 8568)2(k + 2945)/5 Find g such that 2g4/11 + 14218g*3/11 - 71428g*2/11 - 2047392g/11 + 10244160/11 = 0. -7114, -12, 5, 12 Determine w, given that 2w5/9 - 88324w*4/9 + 1305762044w*3/9 - 6543616242928w*2/9 + 1202316880397042w/9 + 2430818673275396/9 = 0. -2, 193, 14657 Factor g*2/2 - 18463g + 479869/2. (g - 36913)(g - 13)/2 Factor -3w*3/4 + 895959w*2/4 - 66894762825w/4 - 66895658787/4. -3(w - 149327)2(w + 1)/4 What is p in 4p4/7 - 1412p*3/7 + 95544p*2/7 + 965312p/7 + 868352/7 = 0? -8, -1, 106, 256 Factor -4k2 + 55409672k. -4k(k - 13852418) Determine j, given that -5j4 + 3986450j*3 - 794613098465j*2 + 9534926649300j - 28604349417780 = 0. 6, 398639 Factor 196y3 + 1589476y*2 - 14999556y + 35366364. 4(y + 8119)(7y - 33)2 Determine q, given that 2q*3/5 + 2676q*2/5 - 21954q/5 - 562628/5 = 0. -1346, -11, 19 What is z in 5z2 - 957234355z = 0? 0, 191446871 Factor 6x2 - 6077894x - 16207760. 2(x - 1012985)(3x + 8) Suppose -21z*4/8 + 1469859z*3/8 - 25539272829z*2/8 - 6338258893239z/8 + 906507958335/4 = 0. What is z? -245, 2/7, 35119 Find u, given that 4u2 + 887369960u = 0. -221842490, 0 What is m in -10m2 + 534628244m - 213851296 = 0? 2/5, 53462824 Determine p, given that 6p2/5 + 355296062p/5 + 23686404 = 0. -59216010, -1/3 Suppose l*4 + 554l*3 - 261675l*2 + 3297832l + 3560060 = 0.	{ "pile_set_name": "DM Mathematics" }
kilograms are there in 1/20 of a tonne? 50 How many millilitres are there in 17273.52 litres? 17273520 What is 3/7 of a week in minutes? 4320 How many litres are there in 33.09094 millilitres? 0.03309094 Convert 41.70661 micrograms to nanograms. 41706.61 What is 9/10 of a kilometer in meters? 900 How many litres are there in 0.0905579 millilitres? 0.0000905579 What is thirteen fifths of a litre in millilitres? 2600 What is eleven halves of a litre in millilitres? 5500 How many litres are there in 5.909022 millilitres? 0.005909022 Convert 374.6648ng to tonnes. 0.0000000000003746648 What is 59.58791 micrograms in grams? 0.00005958791 How many millimeters are there in 42/5 of a centimeter? 84 What is 3/10 of a microgram in nanograms? 300 How many litres are there in 0.0021331 millilitres? 0.0000021331 How many litres are there in 40.46813 millilitres? 0.04046813 What is three tenths of a microgram in nanograms? 300 What is thirty-one halves of a tonne in kilograms? 15500 What is 7/8 of a kilogram in grams? 875 What is 51.93535 kilometers in centimeters? 5193535 What is 6/25 of a millennium in decades? 24 How many months are there in thirteen fifths of a millennium? 31200 How many meters are there in 77.84649 centimeters? 0.7784649 What is 7/4 of a meter in millimeters? 1750 How many months are there in twenty-three sixths of a year? 46 How many millilitres are there in 5/4 of a litre? 1250 How many meters are there in 611979.3 nanometers? 0.0006119793 What is 90786.09 millennia in decades? 9078609 Convert 0.2437849 kilometers to millimeters. 243784.9 What is seventeen quarters of a microsecond in nanoseconds? 4250 Convert 68222.08 years to decades. 6822.208 What is three tenths of a litre in millilitres? 300 How many months are there in 1/4 of a millennium? 3000 What is 243.3607 milligrams in tonnes? 0.0000002433607 What is 1/10 of a centimeter in micrometers? 1000 Convert 259.0954 kilograms to grams. 259095.4 What is 26/5 of a meter in millimeters? 5200 What is twenty-six fifths of a kilometer in meters? 5200 How many days are there in 13/7 of a week? 13 What is 179.25168 months in decades? 1.493764 What is 0.8862535 litres in millilitres? 886.2535 What is seven halves of a litre in millilitres? 3500 What is 92554.65ng in grams? 0.00009255465 What is 40.39541 litres in millilitres? 40395.41 What is 0.9649183nm in meters? 0.0000000009649183 What is 3/5 of a gram in milligrams? 600 How many seconds are there in two fifteenths of a week? 80640 What is 7/2 of a decade in months? 420 What is 9971.828ug in milligrams? 9.971828 What is fifteen quarters of a litre in millilitres? 3750 What is 0.1547967ml in litres? 0.0001547967 How many minutes are there in 9/10 of a day? 1296 Convert 25.80459 years to millennia. 0.02580459 How many seconds are there in five sixths of a minute? 50 How many micrometers are there in 3/16 of a centimeter? 1875 What is 667.8484ml in litres? 0.6678484 How many millilitres are there in 1/4 of a litre? 250 Convert 558594.5 millilitres to litres. 558.5945 How many micrometers are there in twenty-nine fifths of a millimeter? 5800 Convert 11.860191 hours to days. 0.494174625 What is 123.07086 seconds in days? 0.00142443125 Convert 6.242038 millilitres to litres. 0.006242038 How many millilitres are there in 29/2 of a litre? 14500 How many kilograms are there in 21/4 of a tonne? 5250 What is 152.17068 months in centuries? 0.1268089 Convert 114554.8 nanometers to meters. 0.0001145548 Convert 0.3781585 milliseconds to microseconds. 378.1585 What is 3/32 of a tonne in grams? 93750 Convert 1.623605ml to litres. 0.001623605 How many millilitres are there in 85/4 of a litre? 21250 How many millennia are there in 171.09966 months? 0.014258305 What is 35.58006 months in centuries? 0.02965005 What is one quarter of a meter in millimeters? 250 How many nanoseconds are there in 5/4 of a microsecond? 1250 Convert 109698.93us to hours. 0.000030471925 What is 20.95369l in millilitres? 20953.69 What is 753227.9km in micrometers? 753227900000000 How many micrometers are there in three tenths of a centimeter? 3000 How many millilitres are there in seven halves of a litre? 3500 How many millilitres are there in 1/10 of a litre? 100 How many microseconds are there in 15613.8 milliseconds? 15613800 What is 7/4 of a meter in millimeters? 1750 What is three eighths of a litre in millilitres? 375 Convert 0.8582361mg to kilograms. 0.0000008582361 How many milliseconds are there in two fifteenths of a minute? 8000 What is 7/25 of a meter in centimeters? 28 How many days are there in 0.9218117 weeks? 6.4526819 Convert 4927115.7 microseconds to hours. 0.00136864325 What is one-hundred-and-one halves of a tonne in kilograms? 50500 What is 34/5 of a kilogram in grams? 6800 What is thirteen fifths of a hour in seconds? 9360 What is 4982.99ng in milligrams? 0.00498299 How many months are there in two fifteenths of a century? 160 Convert 185.4178 millennia to decades. 18541.78 How many minutes are there in 13/5 of a week? 26208 What is 0.2204915mm in centimeters? 0.02204915 What is seven halves of a kilogram in grams? 3500 How many millilitres are there in 824.5387l? 824538.7 How many minutes are there in two fifteenths of a hour? 8 How many millilitres are there in 18/5 of a litre? 3600 What is 3/10 of a centimeter in millimeters? 3 How many millilitres are there in 31/2 of a litre? 15500 What is twenty-one halves of a tonne in kilograms? 10500 How many decades are there in 9/10 of a millennium? 90 How many micrometers are there in 0.4399764 meters? 439976.4 Convert 9.106646m to micrometers. 9106646 What is 33.92844 years in millennia? 0.03392844 What is 194834.7 days in seconds? 16833718080 How many litres are there in 148.2117 millilitres? 0.1482117 Convert 758469.6ng to kilograms. 0.0000007584696 How many nanograms are there in twenty-nine halves of a microgram? 14500 Convert 9.993109 weeks to days. 69.951763 How many hours are there in 11/8 of a week? 231 How many grams are there in 11/2 of a kilogram? 5500 Convert 244148.6 years to months. 2929783.2 Convert 0.1106509 microseconds to seconds. 0.0000001106509 Convert 0.5775502 years to millennia. 0.0005775502 How many decades are there in eleven halves of a century? 55 What is 3/16 of a week in minutes? 1890 What is three fifths of a kilometer in meters? 600 Convert 747.8942 years to decades. 74.78942 Convert 0.5846732 minutes to microseconds. 35080392 Convert 722901.6 weeks to milliseconds. 437210887680000 How many nanograms are there in 1/10 of a milligram? 100000 What is 2184.85512ms in weeks? 0.000003612525 How many millilitres are there in 59/5 of a litre? 11800 Convert 6.025842 nanoseconds to microseconds. 0.006025842 Convert 2161.0134us to hours. 0.0000006002815 What is 1/20 of a kilogram in milligrams? 50000 What is 157.1479 days in minutes? 226292.976 What is 13/4 of a meter in millimeters? 3250 How many months are there in twenty-three sixths of a millennium? 46000 How many millilitres are there in 217.8839 litres? 217883.9 How many millilitres are there in 41/2 of a litre? 20500 What is 72/5 of a microgram in nanograms? 14400 Convert 70069.33ml to litres. 70.06933 Convert 280.6896nm to meters. 0.0000002806896 How many millilitres are there in 27/2 of a litre? 13500 How many nanograms are there in seventeen quarters of a microgram? 4250 What is 691.8399 years in months? 8302.0788 How many micrograms are there in one fifth of a milligram? 200 Convert 0.32302g to kilograms. 0.00032302 What is 75/8 of a milligram in micrograms? 9375 Convert 488941.6um to kilometers. 0.0004889416 What is 0.908256um in meters? 0.000000908256 How many grams are there in 32/5 of a kilogram? 6400 What is 0.8049478 tonnes in milligrams? 804947800 How many years are there in five quarters of a century? 125 How many millilitres are there in 67/4 of a litre? 16750 How many micrometers are there in 21877.55km? 21877550000000 Convert 223.2209kg to milligrams. 223220900 How many decades are there in three fifths of a millennium? 60 How many micrograms are there in 3.797655kg? 3797655000 How many kilograms are there in fourty-eight fifths of a tonne? 9600 What is 69269.47 nanograms in milligrams? 0.06926947 What is 7.662755	{ "pile_set_name": "DM Mathematics" }
the value of (31 - 4) + 25 + -38? 14 (0 - 7 - 0) + (-4 + 7 - -42) 38 What is (6 - 15) + 7 - -4? 2 13 + -8 + 1 + 1 + (8 - 7) 8 Evaluate 36 + 2 + -142 + 117. 13 What is (-12 - -10) + -2 + 2? -2 -6 - (14 + -12 - (11 + 1)) 4 What is -12 - -21 - (-3 - (-6 + 4))? 10 What is the value of 17 + -12 - (4 + (-2 - (3 + 1)))? 7 Evaluate -2 + 7 + (-16 - (-31 + 30)). -10 What is (-11 + 7 - -3 - (1 - 6)) + -4? 0 Evaluate (14 - (23 - (10 + 2))) + 10. 13 Evaluate 13 + 0 + -310 + 307. 10 What is the value of -1 + 27 + 14 + -14 + -7 + 1? 20 What is 149 - 142 - (-3 + -2)? 12 Calculate 12 + (11 - (20 + 11)). -8 What is the value of -7 + (3 + -2 - 11) - (-4 - -12)? -25 What is the value of -25 + 3 - (13 + -8 + (-4 - -7))? -30 What is the value of -23 + 26 + -17 + -4? -18 What is the value of (26 - 0 - (0 - -3)) + 4 + -8? 19 Calculate 34 + -25 - (29 + 2) - -9. -13 What is 7 + 0 - (55 - 78)? 30 29 - (20 + 6 + 12) -9 Evaluate 18 + 1 + (3 - 8). 14 What is 30 + 17 + -11 + 11 + -33? 14 Calculate 115 + -124 + -2 + 6 + -19. -24 8 + 0 + 2 + -7 3 What is (66 + -36 - 28) + (-2 - 2)? -2 Evaluate -3 - 9 - ((16 - 11 - -3) + -3). -17 (13 + -2 - (39 + -12 + -33)) + -11 6 15 - (-4 - (6 - (18 - 0))) 7 -4 + 0 + 13 - 5 4 What is the value of -28 - (1 - 3) - (5 - 30 - -22)? -23 Calculate 34 + -13 + (-43 - -20). -2 Evaluate -6 + (-14 - -1) + 14. -5 Calculate (-13 - 11) + 8 + 22. 6 (8 - 2 - 0) + -3 - (2 + 1) 0 What is -2 - -15 - (1 + 4)? 8 What is the value of (-1 - 9) + (-13 + 7 - (-30 + 3))? 11 Evaluate (3 + -1 - 12) + -56 + -1 + 50. -17 -1 - (-19 + 21 - -12) -15 Calculate (0 + 3 - 3) + (-1 - 4) + 18. 13 What is the value of (1 - -13) + -29 - (10 + -30)? 5 What is -15 + (17 + 5 - 19)? -12 Evaluate 37 - (-17 + 18 + 63). -27 Evaluate (3 - -30) + (-7 + 8 - 8) + 7. 33 Calculate (-619 - -626) + (0 - 12). -5 -1 + 1 + -6 + -14 + 16 -4 What is (14 - 14 - -1) + 3 + -1 + 3? 6 What is (33 - 2) + -39 - 7? -15 What is -18 + (7 - -2 - 8)? -17 -2 - (5 - (-1 + -6) - (-7 + 2)) -19 Calculate -7 - (-6 + -6) - (9 + 0) - -3. -1 Calculate (-4 - 3) + 59 + -71. -19 Calculate -14 - (-2 + -8 - -7) - -1. -10 (15 - 3) + (-16 - -21) 17 -2 - ((4 - 23) + 28) -11 Calculate (12 - 5 - -2) + 4 - 0. 13 6 - (12 - ((-5 - 3) + 1)) -13 -7 + -3 - -4 - (-7 + 5 - 0) -4 What is the value of -20 + (-87 - -79 - (1 - -1))? -30 What is the value of -13 + (13 - -3) + 3 + 0 - 4? 2 Evaluate -14 + 1 - (-133 - -124). -4 Evaluate (-2 - (2 - 2)) + -12 - (-81 + 85). -18 What is the value of (28 + -16 - (2 - -20)) + 20 + -1? 9 What is the value of 9 + -8 + (-3 - -2) - -10? 10 -3 - (-2 - (8 - 6) - 3) 4 Evaluate -20 - (-25 - -12) - (4 - (2 - -2)). -7 What is 28 + -19 + 2 + -4 + 3? 10 Evaluate 18 - (-1 + 4 + (-237 - -235)). 17 2 - -24 - (16 - 8 - (-5 + 4)) 17 Evaluate 3 - -14 - 17 - -5. 5 1 - 5 - 2 - (-21 - (4 + 0)) 19 What is the value of 1 + 10 - (2215 - 2221)? 17 What is -9 + (-3 - 0 - -2) + 2 + -2? -10 Calculate -1 + (-1 - 0 - -4) - 12. -10 4 + -9 + (-1 - (0 + -11)) 5 What is 0 + -4 + 20 - 8 - 14? -6 -20 - (27 + -81) - 5 29 What is (16 + -9 - 9) + 6 + -4? 0 What is the value of (1 - -3) + -20 + (-15 - -36) + -5? 0 Evaluate -8 + (11 - ((-11 - -3) + 16)). -5 What is 0 + -13 - ((-1 - 11) + (-112 - -117))? -6 What is the value of -16 + (15 - (10 - 6) - (2 - 0))? -7 0 - (13 + -29) - 26 -10 Calculate -1 + (30 - 23) + 0. 6 Evaluate (-1 + 11 - (-79 + 94)) + -4. -9 What is 0 + 0 + (-26 - -18) + 10 + 3? 5 Evaluate (48 - (-24 + 47)) + -22. 3 What is the value of 9 - 29 - (7 + 0 - 9)? -18 Evaluate (10 - -1) + -5 + 13 + -25. -6 What is the value of 26 + -8 + (-4 - -18 - -1) + -5? 28 Calculate (-90 + 85 - (-6 - 0)) + 5 - 8. -2 What is the value of (-2 - (12 + -6)) + -75 + 85? 2 What is the value of 4 + (-6 - -5) + -8 + 4 + -6? -7 What is -19 + (12 + -23 - -5)? -25 What is -29 + 39 - -11 - 19? 2 -4 + -5 - (-9 - 0 - (33 + -12)) 21 What is (8 - 14) + 2 + (1 + 2 - -18)? 17 Calculate -78 + 30 - (-9 - (-6 + 7)). -38 What is 2 + -5 + (1 - (6 - 3))? -5 Calculate -8 + (6 - -2) - (-3 - (3 - -8)). 14 What is the value of (-1 - (13 - 11) - 0) + (-2 - -44)? 39 What is the value of 17 + -17 - ((2 - 3) + -1)? 2 What is -14 + (12 - -4) - -12? 14 Evaluate -16 - (-47 + (-26 + 11 - -11)). 35 Calculate 19 - -8 - (-13 - -24). 16 -3 + -6 + 3 + (19 - 6) + -5 2 Calculate 231 + -214 + 0 + -7. 10 What is the value of 11 + -2 + (2 - 1) + -4? 6 Calculate (0 + -14 - 2) + (243 - 238). -11 Calculate -71 + 121 + -59 - (-35 + -1). 27 Evaluate -7 - ((-9 - 8) + (0 - -1)). 9 Evaluate -9 + (11 - 10) + 7. -1 Evaluate 7 + (4 + (-6 - (0 - 6)) - 12). -1 What is (-6 - -14) + 11 - 11? 8 Evaluate (-28 - -7) + -17 + 2. -36 (4 - -21 - 32) + 31 24 Calculate -17 - (1 + (8 - 9)). -17 Evaluate (-184 - -178) + 9 + -1. 2 Calculate 6 + (-5 - (-1 + (1 - 2) + 3)). 0 Evaluate 5 + -2 + (2 - (-4 + 4)). 5 What is -21 - (8 - (51 + -41))? -19 7 - (3 + 21) - (-8 + 0 + 2) -11 51 + (25 - 64) + 3 15 What is the value of 23 + -22 - ((-10 - -7) + -9)? 13 What is the value of -17 + 2 - (-22 + -3)? 10 What is -2 + -8 + (-16 - -21) + (1 - 6)? -10 Calculate -22 - (-7 + -17 + 19). -17 What is the value of 4 + (-6 + 4 + 7 - (3 + -4))? 10 -1 + -7 + 11 + 2 + -9 + -11 -15 Calculate 6 - (5 - 13 - (1 - (0 - -5))). 10 What is -60 + 63 - (1 - (-3 - -14))? 13 Calculate -19 + 31 + (-11 - -2). 3 Evaluate 0 + -4 - (0 - (-1 + -4 + 8)). -1 What is the value of -18 + 30 + -17 + 18 + 1? 14 -5 + 15 + 1 + (-12 - -19) 18 Calculate (-7 - -36) + (-2 - 15). 12 Calculate (0 - (-1 - 9)) + 12 + -2 + -5. 15 Calculate (-2 - -47) + (-128 - -61 - -50). 28 What is the value of 0 - 4 - (-9 + (9 - (-7 - -26)))? 15 Calculate (1 + 6 - (16 + -6)) + 5. 2 (-10 - -3) + (-12 - -11) - 11 -19 What is 2 - (-1 - -10) - (-24 + 17 - -9)? -9 What is (-4 + 15 - (-7 - -9)) + -23 + 17? 3 What is -33 + (-24 - -8) - -64? 15 What is the value of (12 - 4) + -6 - (-2 + -6)? 10 Calculate -4 + (1 + -2 - (27 - (64 - 19))). 13 What is 7 + -3 + (-8 - ((-8 - -14) + 7))? -17 What is the value of 6 + (6 - 0) + 2? 14 What is 48 + -60 - (-8 - (0 + -1)) - -15? 10 Calculate -152 - -139 - (-22 + 0). 9 6 - (0 - 2 - -10) - (2 - 17) 13 2 + (-17 - -10) + 19 + 1 15 Calculate ((-1 - -11) + -3 - 2) + -2. 3 What is -26 + 10 + -2 - -34? 16 What is the value of -20 + -7 + (-7 - (-12 + -3) - 1)? -20 What is 8 + -3 + (1 - -6 - (20 - 16))? 8 Calculate 6 - 6 - (-1 - 4 - (17 - -7)). 29 0 + -16 - (-147 + 149) -18 -2 + 0 - (-47 + 2 - (37 - 47)) 33 What is the value of 16 + 1 + -21 + 18? 14 Calculate -4 + (4 - (-22 + 10)) - (1 + 6). 5 What is the value of 3 + (-4 - 4 - -2) - -5? 2 What is (43 - -13) + -68 - (-2 + -9)? -1 Evaluate 63 - (-16 + 43) - 54. -18 What is the value of -18 - (18 + -18 + -19)? 1 Calculate -13 + 29 + 1 + (4 + -1 - 5). 15 What is (-19 - 1) + (13 + -40 - (-25 + -5))? -17 What is (-52 - (-13 - 7)) + 11? -21 4 + (-2 - 2 - -5) - (2 - -17) -14 Evaluate -1 + (-5 - (5 + -3 - 3) - 2). -7 Calculate (16 + -11 + (6 - 2) - 8) + -2. -1 Evaluate -4 - ((-1 - 1) + (15 - 9) + 4). -12 Evaluate 10 - (8 + 9 + -4). -3 Calculate -2 + 6 + 8 - (5 + -2). 9 -28 - (-15 + -13) - 6 -6 What is the value of 5 + -19 + 5 + 2 + 5 + -6? -8 What is the value of -1 - -15 - 4 - 7? 3 What is the value of -7 + (-4 + 3 - -2) + (6 - 12)? -12 Evaluate (5 - (8 + -12)) + -8 - 4. -3 What is the value of (-16 + -1 + 8 - -15) + (1 - -5)? 12 What is -13 - (2 + (-3 - 3) + (1 - -1))? -11 Evaluate (-7 - (-14 + 14) - -20) + -2. 11 Evaluate -2 + 12 + (159 - 155) + (0 - 2). 12 What is the value of 4 - 3 - (8 + (8 - 7) + -10)? 2 What is the value of 66 - 61 - (-5 + -2 - -2)? 10 Calculate 30 - (-1 - -33) - ((0 - 1) + 8). -9 Calculate 6 + 2 + -6 + 3 + 0 + -15. -10 -6 + (4 - (-12 + 7 + 7 + -4)) 0 7 - (-13 + 8 - (-20 - -1)) -7 What is the value of (2 - 7) + 170 + -178? -13 Calculate 0 - (-7 - (-15 + -2 + (6 - 4))). -8 What is -12 - -11 - 5 - -7? 1 Calculate 7 - -1 - (3 + 24 + -33). 14 (-5 - -16) + (2 - 6) + -3 + 5 9 3 + 2 + -249 + 246 2 (-69 - -69) + (19 - (1 + 0)) 18 What is the value of -1 - (3 - 3) - (14 + -6)? -9 Calculate (895 - 887) + (-19 - (2 - 2)). -11 What is the value of 7 + 2 - (9 - -6)? -6 What is the value of 4 + -2 + -5 + 7 + -2 + -29? -27 What is the value of 9 + -14 + -2 - -6? -1 6 + (9 + -4 - (-5 - -7)) 9 Calculate 23 + 16 + 30 + -60. 9 Evaluate -4 + (-21 - (-14 - -7)) - -3. -15 Evaluate (-5 - 9 - -24) + (-5 - 2). 3 What is	{ "pile_set_name": "DM Mathematics" }
0a2 - 8a*2 + 5a*2 + 0. Let b(f) = -2f*2. Give b(k(t)). -1352t*2 Let u(k) = -2k. Let q(m) = -m2 - 5. Let b(c) = -c2 - 6. Suppose 10y + 13 = -37. Let d(l) = yb(l) + 6q(l). Calculate u(d(f)). 2f*2 Let n(l) = -l. Let m(r) = 34984r. Calculate n(m(u)). -34984u Suppose 3o + 364 = -4k, -5o = -2k - 0o - 182. Let y = 161 + k. Let x(v) = y - 6v - 70. Let q(p) = 2p*2. What is q(x(z))? 72z*2 Let v(d) = -6d*2. Let x(m) be the second derivative of 0 + 0m*3 + 0m*2 - 1/12m*4 - 29m. Calculate v(x(o)). -6o4 Let p(r) = 21r + 12. Let j(i) = 26i + 14. Let v(n) = 6j(n) - 7p(n). Let a(o) = -o. Give a(v(t)). -9t Let j(i) = -i*2. Let c(w) be the first derivative of -50w*3 + 217. Determine j(c(o)). -22500o*4 Let w(f) = -8f*2 + 24. Let s(y) = 3y - 5. Give w(s(v)). -72v2 + 240v - 176 Let f(i) = 2i2. Let m(z) = -32z*2 - 153z*2 - 57z*2. Determine m(f(a)). -968a*4 Let h(w) = -81w - 135. Let u(v) = -v - 1. Let l(f) = h(f) - 135u(f). Let i(m) = -m. Determine l(i(s)). -54s Let b(i) = 7053i - 13. Let n(d) = d. Determine n(b(m)). 7053m - 13 Let j(o) = -2o2. Let f(q) = 43601q. Calculate j(f(u)). -3802094402u2 Let k(p) be the third derivative of 23p*5/60 - 68p*2. Let v(d) = -6d*2. Give k(v(u)). 828u*4 Let v(a) = -a. Let o(w) be the third derivative of 15w*2 + 0w + 0 + 0w3 + 0w*4 - 1/20w*5. Calculate o(v(l)). -3l*2 Let g(x) = -78x2 - 5. Let s(t) be the third derivative of t4/24 + 507t2. Determine g(s(p)). -78p*2 - 5 Let u(b) = -5b*2 + 152b. Let m(q) = -8q2. Calculate u(m(h)). -320h*4 - 1216h*2 Let o(w) = -2w*2. Let j be (8/(-5))/((-4)/(-30)). Let b = 17 + j. Let r(z) = -26z + 26z - bz*2. Determine r(o(c)). -20c*4 Let c(n) = 6n. Let t(b) = -35b2 - 3b + 9. Let r(d) = 36d2 + 2d - 6. Let a(z) = -6r(z) - 4t(z). What is a(c(h))? -2736h2 Let z(p) = -6p. Let v(n) be the third derivative of n*5/12 - 28n*2 + n. What is z(v(a))? -30a*2 Let u(q) = 246q*2 - 5q - 3. Let v(n) = 247n2 - 3n - 2. Let l(o) = 2u(o) - 3v(o). Let s(m) = m. Give s(l(x)). -249x2 - x Let y(n) = 7n. Let x(a) be the second derivative of -83a4/12 + 5a - 29. Calculate y(x(v)). -581v2 Let d(h) = -h2. Let b(w) = -w3 + 10w*2 + 12w - 6. Let s be b(11). Let r(v) = sv + 2v + 7v - v. Calculate d(r(f)). -169f*2 Let r(q) be the first derivative of 0q*3 + 0q - 11 + 1/24q4 - 6q*2. Let i(y) be the second derivative of r(y). Let n(z) = 2z*2. Calculate n(i(x)). 2x*2 Let v(g) be the second derivative of 3g*4/4 - 18g - 1. Let a(f) be the first derivative of -2f3/3 - 2. Give a(v(i)). -162i*4 Let a(z) = -10z*2 - 40. Let b(u) = -14u*2. Calculate a(b(c)). -1960c*4 - 40 Let f(j) = -155j + 294j - 147j. Let l(v) = -93v. Determine f(l(w)). 744w Let k(i) be the second derivative of -11i4/6 + i3/2 + 429i. Let a(g) = 2g. Calculate k(a(q)). -88q*2 + 6q Let z(b) = 2b. Let l(f) = -187f*2 - 84f + 4. Determine l(z(q)). -748q2 - 168q + 4 Let s(b) = 12b2 + 13b - 13. Let i(m) = m*2 + m - 1. Let r(z) = 78i(z) - 6s(z). Suppose 13 = 5y - 7. Let u(l) = -yl - 4l + 7l. Give u(r(v)). -6v*2 Let q(s) = 7s. Let d(i) be the third derivative of -i + 5/24i4 + 0i*3 + 0 + 12i*2. What is d(q(a))? 35a Let i(s) = -16s + 4. Let c(a) = 16a - 5. Let b(t) = 3c(t) + 4i(t). Let o(u) = -u. Determine o(b(n)). 16n - 1 Let v(o) = 91o*2 + 346o - 5. Let k(q) = -4q. What is k(v(i))? -364i*2 - 1384i + 20 Let s(b) = -15b. Let a(p) = -10p*2 - 8p*2 + 23p*2. Calculate a(s(c)). 1125c*2 Let o(d) = 12d*2 - 60. Let s(t) = 3. Let y(x) = o(x) + 20s(x). Let f(b) = -b - 4. Give f(y(k)). -12k2 - 4 Let u(j) = 134j. Let v(a) = -140a + 2. Calculate v(u(k)). -18760k + 2 Let t(r) = 19 + 7r - 11 - 4r + 0r + 9. Let o(q) = 12q*2. What is t(o(g))? 36g2 + 17 Let k(f) = -f2. Let m = 14 + -21. Let h = 9 + m. Let t(l) = 8l2 - 8l*2 + 5l*h. Calculate k(t(j)). -25j*4 Let k(z) = 818z. Let w(h) = 25h. Determine w(k(d)). 20450d Let p(q) = -321q2 - 1. Let t(m) = 4m*2 + 7m. Calculate t(p(k)). 412164k4 + 321k*2 - 3 Let y(t) = -t. Let h(s) = 15320s. Give h(y(b)). -15320b Let f(q) = 2q. Let p(l) = l - 1. Let w(t) be the second derivative of -4t3 + 15t*2 + 9t. Let r(c) = 120p(c) + 4w(c). Determine f(r(y)). 48y Let o(l) = -3l*2 - 126. Let z(a) = 3a + 26 + 7 + 13 - 46. What is o(z(m))? -27m2 - 126 Let t(v) = -v. Let y(f) = 1. Let n(x) = -3x3 + x2 + 3x + 2. Let c be n(2). Let g = -9 - c. Let q(k) = k + 5. Let o(d) = gq(d) - 15y(d). What is o(t(m))? -3m Let m(b) = 6b2. Let n(v) be the second derivative of 107v4/12 + v3/6 + 255v. What is n(m(d))? 3852d*4 + 6d2 Let h(m) = m2. Let g(n) = 186n + 1 - 2 + 1 + 1 + 0. Determine g(h(b)). 186b*2 + 1 Let y(p) = -8p. Let z(o) = 6o2 - 8o. Let t(m) = -7m2 + 12m. Let x(f) = 2t(f) + 3z(f). Determine y(x(h)). -32h2 Let r(q) = -2q*2 - 607q. Let z(g) = 2g2. Determine r(z(f)). -8f*4 - 1214f*2 Let d(p) = -2p*2. Let r(j) = -j - 1. Let x(m) = 38m + 57. Let k(o) = -57r(o) - x(o). Let t(z) = 96z. Let q(b) = 16k(b) - 3t(b). Determine d(q(g)). -512g2 Let w(z) = -10z*2. Let k(r) = 3r*2 + 6r. Let o(y) = 3y2 + 5y. Let l(n) = 5k(n) - 6o(n). Calculate l(w(q)). -300q4 Let a(x) = x3 - 4x*2 + 6x - 6. Let j be a(3). Let k = 7 - j. Let d(v) = -v - kv + 0v + 2v. Let l(q) = -q. Calculate l(d(g)). 3g Let p(o) be the first derivative of -3o2/2 + 1. Let w(x) = 17 + 21 - 53 - 7x*2 + 15. What is p(w(j))? 21j2 Let z(v) = -v - 2098 + 2098. Let l(r) = r2. Determine z(l(i)). -i*2 Let x(u) = -402u. Let r(f) = -276f2 + f. Determine r(x(p)). -44602704p*2 - 402p Let d(i) = -i*2. Let r be 2 + (-30)/21 + 9/(-126). Let b(f) be the first derivative of 0f - rf2 - 7. Calculate b(d(h)). h2 Let o(w) = 16w*2 + 2w. Let n(s) = 162s + 8. Calculate n(o(d)). 2592d*2 + 324d + 8 Let t(i) = i*2 + 2i. Let c(a) = -144a2 - 224a. Let f(b) = 5c(b) + 560t(b). Let h(j) = 2j. What is f(h(u))? -640u*2 Let o(a) = 3a. Let h(y) = -y. Let p be (5/(-25))/(3/15). Let j(g) = 9g. Let f(d) = pj(d) - 3h(d). Calculate f(o(z)). -18z Suppose 4x - 6x = -6. Let c(p) = 96 - 96 + xp. Let s(j) = -8j*2. Calculate s(c(d)). -72d*2 Let c(m) = 18m. Let r(b) = -b*2 - 8845b. Calculate r(c(q)). -324q2 - 159210q Let a(w) = w*2 + 2w - 2. Let q(h) = h*2 + h - 1. Let f(t) = 2a(t) - 4q(t). Let l(i) = 17i*2. Determine f(l(c)). -578c*4 Let h(i) = -3578i*2. Let x(r) = 23r. Determine h(x(m)). -1892762m2 Let p(w) = 6w - w - 2w. Let n(l) = l2 - l. Let c(y) = -8y*2 + y. Let r(a) = c(a) + n(a). Give r(p(q)). -63q*2 Let i(g) = 2g*2 + 2g - 1. Let q(m) = 5m2 + 10m - 5. Let w(z) = -5i(z) + q(z). Let v(a) = 32a*2. Give v(w(p)). 800p4 Let t(n) = n. Let r(p) = p2 + p - 1. Let g(q) be the second derivative of 5q4/6 + 7q*3/3 - 7q*2 + 12q. Let w(l) = -5g(l) + 70r(l). What is w(t(j))? 20j2 Let z be 1 - ((-3)/6)/(2/(-4)). Let d(b) = -6b + 2b + 5b + zb. Let i(g) = 3g. Determine d(i(p)). 3p Let k(l) = 13l2. Let a(n) = n2 - 9n + 9. Let w be a(7). Let o be (-2)/(1/w1). Let s(q) = 10 + q - o. Give s(k(v)). 13v2 Let z(p) = -p + 3. Let m(u) be the first derivative of u2 - 8u - 9. Let s(o) = 3m(o) + 8z(o). Let j(x) = -23x. Calculate j(s(y)). 46y Let b be 1/3 - (-20)/12. Suppose -5 = -bt + 3. Let h(g) = -tg + 3g - g + 3g. Let a(r) = -3r2. Calculate h(a(l)). -3l*2 Let z(t) = -7t*2 + 6t - 6. Let n(i) = i*2 - i + 1. Let m(g) = -6n(g) - z(g). Let w(y) = y*2 - 16y + 4y2 + 16y. Determine w(m(d)). 5d4 Let g(y) be the second derivative of -y4/6 + 4y - 7. Let n(l) = -27l2. Give g(n(m)). -1458m*4 Let k = 28 + -8. Let f(h) = 20h - kh - 5h2. Let d(c) = -c2. What is d(f(w))? -25w4 Let p(x) = 651x*2. Let b(n) = 2n - 90. Determine b(p(i)). 1302i2 - 90 Let k(p) = 2p. Let x(s) = -243787s2. What is k(x(o))? -487574o*2 Let n(l) = -2l. Suppose 0 = -4q + 23 - 15. Let g(p) be the third derivative of -1/24p*4 + 0p + 0p3 + 5p*q + 0. What is n(g(a))? 2a Let w(l) = 103l2 + 2l. Let r(v) = 25v. Calculate w(r(y)). 64375y**2 + 5	{ "pile_set_name": "DM Mathematics" }
4, 3d = -0d + q + 10. Solve -du - f = 5x - 4, u + 2 = -4x for u. 2 Let n = 4475 - 4471. Solve 2i + nc = -2, -15i - 2c = -13i for i. 1 Let f(u) = -2u3 - 79u*2 - 41u - 76. Let g be f(-39). Solve 2x - z = -13, 16x + gz + 2 = 13x for x. -4 Let v(n) = n*3 + 4n*2 + 3n + 1. Let l be v(-2). Suppose -2k = -508h + 507h - 27, -12 = k + h. Solve -kj - d = 17, 3d = -lj - 2d - 19 for j. -3 Let t(u) = u3 - 45u*2 - 104u + 582. Let g be t(47). Solve 3d = -4n - 14, 2n + 117d = gd for n. -5 Let l = -5452 + 5458. Solve 3r = -5d - 28, ld + 2 = 5d + 3r for d. -5 Let x = -69 - -65. Let z be (x/810)/((-10)/8). Solve 0 = -r + zo, 3o = 3r + r for r. 0 Suppose -337 = -4o + w, -w - 80 = -o + 2. Let n = o - 82. Solve -nh = 2z + 10, 4z - 2h + 7h = -18 for z. -2 Let d = 1022 + -997. Solve 8m = -2v + 11m + 17, -d = -5v + 4m for v. 1 Suppose -16 = -2j + 2m, -4 = -2j - 0j - m. Suppose -jd - 5t = -52, t + 4 + 32 = 5d. Solve -r = 5l - 17, 3r = l - d - 5 for r. -3 Let p be (-40)/(-25)120/96. Solve 2 = 3n - py, -11y = -3n - 16y + 16 for n. 2 Suppose 184h - 147h = 65 + 9. Let v = -165 + 168. Solve 6 = hl - 2y, -y + 0y + 1 = vl for l. 1 Let q be ((-8)/3 + 2)/(8410/(-261) + 32). Solve 5o - 13 = 4c, -11 = qc + o - 5o for c. 3 Suppose 5 = 5u + f + 4f, 3u = 5f + 35. Suppose -5c + 4v - 16 = 0, 4c - 1 = v - u. Suppose 7 - 35 = -2g. Solve c = h + 4w + g, -3h + 0h = -2w for h. -2 Let g(n) = n*3 + 14n*2 + 3n - 241. Let h be g(-12). Solve 0 = 2u - 3m, -hu + 3m = -12u + 9 for u. 3 Suppose 4j + j + h - 33 = 0, 0 = -4j - 5h + 39. Suppose r - j = s, 2 = 2r + 5s - 3. Solve -6p = -rp + 3x - 14, p + 10 = 3x for p. 2 Let r = -267 + 267. Suppose 8f + 23f = r. Solve -3k + 3z = f, 2k - 4z = -2 - 6 for k. 4 Let o(s) = -s*3 + 11s*2 + 28s - 21. Suppose -3t + 2h - 5h = -39, 4t + 5h = 52. Let k be o(t). Solve 0 = c + 1, 0 = 2d + 5c + k for d. 0 Suppose 25j + 125j + 86j + 38j - 2466 = 0. Suppose 13 = 2u + 5q, -3u + 5 = -q - 6. Solve w + 0w + 3o = -j, 2w + u = o for w. -3 Let k = 6111 + -6107. Solve 0 = n + u + 3, 0 = 2n + 3n - ku - 21 for n. 1 Let p(x) = 10x2 + 72x + 82. Let d be p(-6). Solve 5u = d, 0 = 84m - 86m - 5u + 4 for m. -3 Suppose -t = 5x - 2, 10 = 4t + t - 5x. Let v(q) = -8q*2 - 529q - 1571. Let j be v(-63). Solve -5y + 19 = -ts + 3, js = 2y for y. 4 Suppose 112 = 4w + 52. Let n be (0 + -1)/((-3)/w). Let l be 48/(-18)3/(-4). Solve 0z = -lz + b - 11, -4b - 21 = nz for z. -5 Let t(r) be the second derivative of 29r3/6 + 117r*2 + 220r. Let d be t(-8). Solve m + 5 = -f, 2f + dm = 6m - 10 for f. -5 Let c = -335 - -685. Suppose -c = 55x - 69x. Solve -x = -a + 5l, 0 = -4a + a - 2l - 10 for a. 0 Let z be 24(-8)/(-24) - ((4 - 5) + 5). Solve 5h - zi = -2i - 8, -3h - 10 = 4i for h. -2 Suppose -22 = -11f - 0. Suppose 0 = 3k + k - t - 14, 0 = -t - f. Let c be 19/k - 28/(-42). Solve 3h + 5r - 22 = 0, -ch + 15 = -2h + 4r for h. -1 Suppose -73u = -39u - 2448. Suppose 4i = 2l + 298, -i = -0i + 3l - 57. Let b = u - i. Solve 13 = -2w + f, -2w + bf + 2 = 2f for w. -4 Let q(x) = -3x - 1 + 7 - 42. Let j be 31/6156/(-6). Let o be q(j). Solve 4u + 15 = -4n + 3, ou - 4n + 9 = 0 for u. -3 Suppose 14 = 3v + 5. Suppose vu - 47 = 1. Suppose -5r = -4 - u. Solve j - 2 = 4f, -r = -5j + 3f + 6 for j. 2 Let t = -432 - -462. Suppose -130 = -10x - t. Solve -3h + 2g = x, 2h + 3g - 15 = 7h for h. 0 Suppose -15g = -11g - 8. Suppose r - 4n = -2r + 11, -4r - n = -21. Solve s + 11 = 3t + gs, 0 = -s + r for t. 2 Let h = 70 + -70. Let r(w) = w + 20 - 27 + hw. Let p be r(9). Solve -5i + 5q + p - 7 = 0, q = 1 for i. 0 Let h(v) = v*2 - 9v - 12. Let k be h(11). Suppose 6 = -5n - 0n + 3b, 4n = -5b + k. Solve 3f + w = -3w + 26, n = 3f - 3w + 9 for f. 2 Let w be (1/7 + (-39)/(-21))274. Let h = 552 - w. Solve 0 = -2i - 2y + 7y - 2, hy = 8 for i. 4 Let x(w) = 16w + 37. Suppose -11 + 7 = 2n. Let g be x(n). Solve -b = gs - 5, 0 = 3s - b + 4 + 1 for s. 0 Let z be 4/(-6) + (-20)/(-3). Let a be (2/(-2) + 1)/(-1). Let j(t) = 143t + 2291. Let s be j(-16). Solve sl - z + 0 = a, 5l - 8 = -2x for x. -1 Suppose -33w - 414 = -102w. Solve 35b - l + 7 = 38b, 3l = -w for b. 3 Suppose 18o = 22o + 28. Let r be (((-245)/25)/o)/((-2)/(-10)). Let l be ((-6)/(-2))/(r + (-201)/30). Solve 2a + 3c + 15 = 0, -a = -5c + 7c + l for a. 0 Let a(d) = 2d*3 - 118d*2 - 240d - 240. Let m be a(61). Let x = -16 - -22. Let n be x/1510/1. Solve -4 = f + v - 0, mv = -f - n for f. -4 Let g be 26 - 4(-2)/8. Suppose -21n - 42 = -gn. Solve 2j - 3b + b + 4 = 0, -4j - n = -5b for j. -3 Suppose 877o - 430o = 428o + 247. Solve -g - 8 = 3n, -3g - o = 6n - 8n for g. -5 Let p be (-4)/14 + (-149)/(-7). Let g be (5 + -14)11/(-3). Solve -2 - 17 = -b - gk, 4b + k = p for b. 4 Let a be 8/(-14) + 874/(-161) - -87. Let i = a - 54. Solve -i = -b + 4b - 4g, -29 = 4b - 3g for b. -5 Let k(z) = 2z - 8. Let i be k(7). Suppose -4x - 5 = 4f - 37, i = f + 2x. Solve -2 = 2s + 2o + f, 4s - 3o = -10 for s. -4 Let g(o) = -o - 5. Let c be g(-7). Suppose 0 = 286h - 358h + 288. Solve y + z = -3z - 8, cy - h = 2z for y. 0 Suppose 37y = -808 + 919. Let d(l) = -l - 1. Let s be d(-3). Solve -st - 1 = -r + 2t, -y = -3r - t for r. 1 Suppose -3h - 5w + 89 - 62 = 0, w = 3. Solve 7f + 8 = -2p + 3f, -hp = f + 16 for p. -4 Let j(i) = -i2 + 15i - 42. Let k be j(11). Solve 2b + 4a + 18 = 0, 2a - k = -4b - 20 for b. -3 Let a(l) = l*3 - 2l*2 + 22l - 116. Let k be a(4). Solve kp - 3f + 5 = -22, 13 = -p + 2f for p. -3 Let d = -1581 + 1585. Suppose -16 = -6x + 8. Solve -xm = -df, -5m - 14 = 4f + 13 for f. -3 Let q be -2 - (-13)/(2 + (-4 - -3)). Let x be 78/27 + q/99. Solve 0 = a, -t + a - 2a + x = 0 for t. 3 Suppose -u = 4 - 8. Suppose -3p - 35 = u. Let x = -3 - p. Solve -2o + 12 = o + 2v, -o - x = -4v for o. 2 Suppose -4 = 2w - 16n + 12n, 3w = 5n - 4. Solve b - 8 = -2u - b, -wu - 4b = -8 for u. 4 Let v = -226 - -228. Suppose f + 0g + 3g - 14 = 0, -5f + g = -22. Suppose 0 = -fp + 17 - 2. Solve -po + o = -5z - 4, vo - 4 = -4z for z. 0 Let j(l) = -91 - 7l + 8l + 126. Let v be j(-17). Solve -w + 2 = -4w - q, 5w + v = 2q for w. -2 Let s(o) = -o*2 + 3o + 42. Suppose 4c + 5r + 25 = 0, 2c - 19r = -17r - 8. Let z be s(c). Solve 0 = -zy + 5y + 2h + 11, -h = -2 for y. -5 Suppose -3x = 2x - 5k - 175, 3k - 70 = -2x. Let a = x - 25. Let c be (-4)/31905/(-508). Solve -cz + 5 = -r, -z - 2r = z + a for z. 0 Suppose 2s + 2s = 0. Let o be -9 - (3 + -8) - -296. Let i = o - 292. Solve -2 = -4r - h - s, -4h + 8 = i for r. 0 Suppose -5c + 40 + 0 = 0. Let h be 1/(-2) - 54/(-12). Suppose j - 2l - h = 0, 2 + 2 = -4l. Solve 2t - c = 4y, 4t - 6 = -4y + jy for y. -1 Let r(l) = 3l2 - 90l + 4. Let v be r(30). Solve 30 = -5h, vt - 28h + 4 = -26h for t. -4 Suppose -3u = -6z + 5z + 19, 10 = 5z + 2u. Suppose -3j = zl + 3, l - 1 = 4l + 2j. Solve 5h = -v + 15, 12 = v + 3h + l for v. 0 Let j be ((-15)/10)/(7 + 365/(-50)). Solve 4c + jz = -1, 82c + 7 = 87c - 2z for c. 1 Suppose 12j + 50j - 8j - 108 = 0. Solve 6 = 5q + 4k, -q - jk + 5k + 5 = 0 for q. 2 Suppose 3u = -3b - 288, u + 4b = 6u + 471. Let x be 57/u + 7/(-5). Let k be (-860)/(-80) + x/(-8). Solve 0 = -3j + l - 0 - k, 4l - 30 = 5j for j. -2 Let y = -193 - -230. Let j(l) = -l*3 - 5l*2 + 6l + 5. Let c be j(-6). Let o = c + 20. Solve 5n + f + y = 13, 5f - o = 4n for n. -5 Suppose 9s - 95 = 157. Let v(w) = w*2 - 32w + 112. Let o be v(s). Solve 4d - 3c = 7, 5d + 30 = -oc - 4c for d. -2 Let j(m) = -m - 5. Let g be j(-10). Suppose -gi = -i + 284. Let o = i - -87. Solve 7 = 2z + 5h - 1, -4z = 4h - o for z. 4 Suppose -983 = 6t - 2015. Suppose -tf + 163f = -45. Solve -4m - 13 = -5l, -fm - 5 = 2l + 3l for m. -2 Suppose 51u - 252 = -7u - 5u. Solve 16 = ua + 4m, -1 = 4a - 5m + 1 for a. 2 Suppose -4y + 13 = -3. Let c = 53675 + -53667. Solve yr = -2n + c, -2n - 4 = -2r - n for r. 2 Let l(r) = -28r2 + 4r - r - 206r2 - 5r + 2. Let a be l(1). Let f be ((-4)/	{ "pile_set_name": "DM Mathematics" }
*2. 14760sqrt(17) + 1029672 Simplify (3sqrt(2592) - sqrt(90)/(sqrt(5) + sqrt(45)))/(-2(sqrt(66)-3 - sqrt(66))/sqrt(11)-3). -143sqrt(3)/96 Simplify ((3sqrt(143)5 - sqrt(143)) + (5sqrt(143)2 - sqrt(143)))/(1(-1sqrt(66)-6)/sqrt(6)). 23sqrt(13)/6 Simplify 3(1 + -4(-3sqrt(76)-6 + (-5 + sqrt(76) + 3 + sqrt(76) - sqrt(76))2))4. -1344sqrt(19) - 3828 Simplify (5-2(-2 + sqrt(12) + -4 - (sqrt(12)25 - sqrt(12)))4)*2. 307200sqrt(3) + 1286400 Simplify (1 + -6-2(2 + (-1sqrt(363) + sqrt(363))5 - ((sqrt(363) + 0)2 + 5)))2. 18480sqrt(3) + 210313 Simplify (-4-4-2sqrt(143)5)/(2sqrt(275)-2-6). -4sqrt(13)/3 Simplify (3-2sqrt(187))/(2(sqrt(11) + (sqrt(99) + sqrt(11) - sqrt(11)))) - ((0 + sqrt(2448))-1)*25. -12240 - 3sqrt(17)/4 Simplify 5(1 + (sqrt(684) - (1 + sqrt(684)))*2 + -2 - 2((0 + sqrt(1900))4 + sqrt(1900))2). -475000 Simplify 0 + -3 + -1sqrt(605) + -3 + (5 + sqrt(35)/(-2sqrt(567))2)*2. -109sqrt(5)/9 + 1544/81 Simplify ((((sqrt(1331) + (sqrt(1331) + -1)-3 - (sqrt(1331) + -1 - sqrt(1331))-4) + 4)-2)2 + -2)5. -2640sqrt(11) + 106650 Simplify (-5 + ((sqrt(351)/sqrt(9) + sqrt(39))5)/(-5(sqrt(3) + (sqrt(3)-4 - sqrt(3)) + sqrt(3)))1-2)*2. 40sqrt(13)/3 + 433/9 Simplify 0 + (4 + sqrt(468) + 0)2 + (3 + sqrt(468) + 5)2 + 2 + 5. 144sqrt(13) + 1023 Simplify 4 + (-2 + sqrt(1573)-2 + 3 + -4 - (-2sqrt(1573) + 5 + sqrt(1573) - (sqrt(1573) - 4-2sqrt(1573)))5)*2. -29568sqrt(13) + 3624980 Simplify -3(-3 + ((1 + 5 + 1(sqrt(605) + -3))4)2 + 0). -29463 - 3168sqrt(5) Simplify -2(6sqrt(52)/sqrt(4) + sqrt(78)/sqrt(6) + 0 + -6(sqrt(52)2 - (sqrt(13) - (-1 + 1sqrt(13) + sqrt(13)))))2. -13826 + 552sqrt(13) Simplify 5(2(sqrt(2736) + -2 + sqrt(2736) + -4 - sqrt(2736))3 + -2 + 4)2. -24480sqrt(19) + 498260 Simplify (2sqrt(272) + sqrt(272) - (sqrt(204) + sqrt(204) + sqrt(204)1)/sqrt(12))*23 + 6(-2sqrt(17))*2 + (-1sqrt(1377))*2. 5916 Simplify (5(sqrt(99) - sqrt(99)-3) - sqrt(99)35)/(32sqrt(1296) - (sqrt(1296) + (1sqrt(1296) + sqrt(1296))1 + sqrt(1296))). 5sqrt(11)/24 Simplify (4(sqrt(16) + -2sqrt(1024))3)/((1sqrt(128))/(2sqrt(144) + sqrt(144))). -1620sqrt(2) Simplify (sqrt(12)/sqrt(3)-2)/(sqrt(2) + sqrt(16)/sqrt(2)) + -1sqrt(400)/(sqrt(16)/sqrt(2)). -17sqrt(2)/3 Simplify -4 + (3(1sqrt(104) + sqrt(104)))/sqrt(8) + (-1 + sqrt(208) + 5 - ((sqrt(208) - (sqrt(208)2 + sqrt(208))) + -1))*2. 126sqrt(13) + 1893 Simplify sqrt(605)-1 + -3 + sqrt(605) - (1 + sqrt(605) + 3)2 - 2sqrt(40)/(sqrt(24)/sqrt(192)). -624 - 104sqrt(5) Simplify ((sqrt(704) + 4)2 + -3)-5 + (((-5sqrt(132))/sqrt(12) + -3)1)*2. -3301 - 290sqrt(11) Simplify ((-5(sqrt(22) + sqrt(352)))/((sqrt(44) - sqrt(11))4) + (sqrt(50) + 1)6-2 + 0)*2. 1590sqrt(2) + 71377/8 Simplify -5(-5sqrt(104))/sqrt(8)-4 - (-3 + sqrt(1053) + -23sqrt(1053)). -55sqrt(13) + 3 Simplify -5 + -5 + (sqrt(720) - (sqrt(720) + 2))2 - ((2 + sqrt(180))2 + 1)1. -191 - 24sqrt(5) Simplify -55(-21sqrt(200) + (0 + -4sqrt(2) + -4)2)-6. 1800sqrt(2) + 7200 Simplify 4(-61-2-2sqrt(448)2)2 + -4. 4128764 Simplify (-5 + -5 + 6((-2 + sqrt(1100))-6 + 1sqrt(1100)-1) + -4)2. -48720sqrt(11) + 1943764 Simplify (4(sqrt(686) + sqrt(686)-3))/(((sqrt(32) + sqrt(32)-2 + sqrt(32))/sqrt(8) - sqrt(4))/sqrt(2)). 56sqrt(7) Simplify 4(-5(sqrt(5) + sqrt(20)) + sqrt(25)/sqrt(180)) - (((3 + sqrt(245))-2)2 - ((sqrt(245) - (sqrt(245) + -2)) + 5 + sqrt(245))2). -722 - 388sqrt(5)/3 Simplify (sqrt(252)2-3 - sqrt(252) - (-22sqrt(252) - sqrt(252)))/((sqrt(108)/(sqrt(8)/sqrt(2)))/(sqrt(96)/sqrt(2))). -16sqrt(7) Simplify (2(-2 + sqrt(637)46 - (-4(sqrt(13) + (sqrt(13) + sqrt(1053) - sqrt(13))) + -1sqrt(13) + -2)))*2. 2271412 Simplify (((sqrt(105) - (sqrt(105) - sqrt(105)-2)) + sqrt(105))/sqrt(5))/(-1sqrt(175)) - (-61sqrt(3)-1 + 3). -29sqrt(3)/5 - 3 Simplify ((-31sqrt(100))/(sqrt(35)/sqrt(112)))/(-6(sqrt(1440) + sqrt(1440) + sqrt(1440) + (-5-1sqrt(1440) - sqrt(1440) - sqrt(1440)))). sqrt(2)/36 Simplify -5 + 2 + sqrt(200) + 1 - ((4 + -2(3 + sqrt(2)))2 + 2). -16 + 2sqrt(2) Simplify 3(-2 + -4((sqrt(52)-1 - sqrt(52)) + sqrt(52))/sqrt(4) + (1 + sqrt(26)/sqrt(2) - sqrt(52)/sqrt(4)-4) + 1)*2. 3159 Simplify (-4 + -3 + (sqrt(171) + 0 + sqrt(171))-1 - (2sqrt(171) + 1 + -5(2 + sqrt(171))))*2. 12sqrt(19) + 175 Simplify ((5(sqrt(70) + 2sqrt(70)) + 43sqrt(70))4)/((5(sqrt(360)-1 - sqrt(360)))/(-1sqrt(9)6)). 162sqrt(7)/5 Simplify (-6(-4sqrt(130) + sqrt(130)) - -4sqrt(130)-3)/((2sqrt(640) + sqrt(640))4 + (sqrt(640) - sqrt(640)-23)). 3sqrt(13)/76 Simplify (-4 + (3sqrt(448)1 - sqrt(448) - sqrt(448) - sqrt(448)) + sqrt(448))2 + sqrt(448) + -1 + -3 + 3 + sqrt(448)2 + sqrt(448) + -2. -32sqrt(7) + 461 Simplify ((sqrt(120)24)/(-3sqrt(48)/sqrt(4)))/(-4-2sqrt(288)2). -sqrt(5)/72 Simplify (sqrt(704) + -2 + -4 + -4 + -1 + (-1sqrt(396) - (-1 + sqrt(11) + -4)))*2. -12sqrt(11) + 47 Simplify ((sqrt(190)/sqrt(40) + 0 + -2sqrt(19) - (4(sqrt(152) + -2sqrt(152)))/sqrt(8))-6)*2 + -1. 4274 Simplify ((6(1 + sqrt(720)) - (2 + -1 + sqrt(720)) - (4 + 51sqrt(720)))1)2. 1 Simplify -1(-2 + 5((sqrt(405) - (-5 + sqrt(405) + 2)) + (sqrt(405) - (sqrt(405) + 1))-5))*2. -1444 Simplify (sqrt(91) + -1sqrt(91)2 + -3sqrt(91)2)/(-4sqrt(28)/sqrt(4) + 2sqrt(700) + sqrt(7))-6. 42sqrt(13)/17 Simplify (((sqrt(176) + -1(sqrt(176)-1 - sqrt(176)) - sqrt(176))/sqrt(11))/((3sqrt(392) + sqrt(392) - sqrt(392))5))2 + -4 + -4. -88192/11025 Simplify ((1(sqrt(68) - sqrt(68)-1))/((sqrt(72)/sqrt(3))/sqrt(6)) - -2(-3 + sqrt(17) + -4 + sqrt(17)2))2. -224sqrt(17) + 1284 Simplify (-2 + 0 + (sqrt(133) + 2(sqrt(133) - sqrt(133)-2) + sqrt(133) + -5sqrt(133)-2)/(sqrt(700)1-5))-4. 36sqrt(19)/25 + 8 Simplify (sqrt(36) - (sqrt(432)/sqrt(12) + sqrt(36)))/sqrt(12) + sqrt(3) + sqrt(3) + (1 + sqrt(3))5 - (sqrt(54)/sqrt(2) - sqrt(75)3)*2. -427 + 6sqrt(3) Simplify (((sqrt(99) - (1sqrt(99) + sqrt(99)))3)/(-4(sqrt(9) - (sqrt(9) + sqrt(36)/sqrt(4)))))2 - (5 + ((-3 + sqrt(176))-6)*2). -106541/16 + 864sqrt(11) Simplify (2 + (52sqrt(156)6)/(52sqrt(1728)))2 + -4. 13/4 + 2sqrt(13) Simplify 2((((sqrt(882) + 1 + sqrt(882))3)*2 + sqrt(882) - sqrt(882)) + 6(sqrt(242) - 2sqrt(242)-4)*2). 1512sqrt(2) + 298746 Simplify (sqrt(154)/(sqrt(88)/(sqrt(24)/sqrt(3)) + sqrt(11)))/(sqrt(72)2 + sqrt(2) + sqrt(16)/(sqrt(8) - sqrt(8)-2)) + -3. -3 + 3sqrt(7)/80 Simplify (1sqrt(6776)2 - sqrt(6776)-1-2)/((3sqrt(48))/sqrt(6) + sqrt(8) - (sqrt(392) - 2sqrt(392) - sqrt(392))). 0 Simplify 2 + ((5 + 4 + -3sqrt(425) + 3)41)*22. -11520sqrt(17) + 127010 Simplify (((5(sqrt(456) + sqrt(456)1) - sqrt(456)) + sqrt(456))/(sqrt(144)/sqrt(48)))/((sqrt(4) + sqrt(4)-12)/(sqrt(32)-3)). 240sqrt(19) Simplify ((1sqrt(330))/sqrt(11) + 2sqrt(30)1)/(5(1sqrt(490) + -1sqrt(50)/sqrt(5))). sqrt(3)/10 Simplify -2 + (5(sqrt(13) + -3) + -2 - ((sqrt(78) + -1sqrt(78) - sqrt(78))/sqrt(6) + sqrt(52)/sqrt(16)))2-4. -2731 + 748sqrt(13) Simplify (3(sqrt(76) + 0 + sqrt(76)))*2 + 0 + sqrt(76) + -3 + (5(sqrt(76) + 2 + sqrt(76)) + (1 + sqrt(76))-4)2 + -5. 146sqrt(19) + 5500 Simplify (2((sqrt(80) + sqrt(80) + sqrt(80) + 5sqrt(80) + 4 - sqrt(80)) + sqrt(80)-2-2)5)2. 35200sqrt(5) + 969600 Simplify 3 + (2 + 0 + sqrt(468)4 + -1 + 3 + 5 + 1)2. 480sqrt(13) + 7591 Simplify (-5 + -3 + (1sqrt(156)4)/(-2sqrt(36)/sqrt(3)) + -2)-5. 10sqrt(13) + 50 Simplify 1 + 0 + (1sqrt(325)1 + 1 - (-3(0 + sqrt(325)) + 0))*22. 80sqrt(13) + 10403 Simplify -4((sqrt(150) + (sqrt(150) - (sqrt(150) + (1sqrt(150) - sqrt(150)))-3))/(sqrt(20)-1))/((sqrt(160)-2 - sqrt(160)) + 2sqrt(1000)). 5sqrt(3)/4 Simplify (((sqrt(462) + (sqrt(462) - -2sqrt(462))4)/(2sqrt(99)))/(2sqrt(96)4 + (sqrt(96) - 3sqrt(96)2)))2. 1183/5184 Simplify ((3-4sqrt(152)1-5)/((1sqrt(288) - sqrt(288))5 + (sqrt(288) - -2sqrt(288))1))2. 1900/9 Simplify 1 + 3(4 + -6(1 + sqrt(704)) + (-6(sqrt(704) + 1))*2 + 1 + sqrt(704) + 2) + 1. 1608sqrt(11) + 76145 Simplify 54(-2 + sqrt(52)) - (-1 + sqrt(1872) + -3 + -5). -31 + 28sqrt(13) Simplify ((sqrt(2940)-1 + sqrt(2940))/(sqrt(27)/(sqrt(36)/sqrt(4))))/((4sqrt(40)1)/(sqrt	{ "pile_set_name": "DM Mathematics" }
8a2 - 1381a + 78. (a - 6)(228a - 13) Factor -2w3 + 896w*2 - 113152w + 2768896. -2(w - 208)2(w - 32) Find x, given that 3x2 - 2784x + 254925 = 0. 103, 825 Determine r, given that 35r3/3 - 1860r*2 + 47035r/3 + 17550 = 0. -1, 10, 1053/7 Determine r, given that -2r5/9 - 4r*4/3 + 452r*3/9 - 824r*2/9 - 50r + 836/9 = 0. -19, -1, 1, 2, 11 Solve -867l3/4 + 213l*2 + 441l = 0 for l. -294/289, 0, 2 What is g in 5g2 - 5855g + 1320650 = 0? 305, 866 Determine l so that -2l2/9 + 94l/9 + 2740 = 0. -90, 137 Let 2b2/7 + 1166b/7 + 2592 = 0. Calculate b. -567, -16 Determine v, given that 2v2/5 + 28652v + 513085690 = 0. -35815 Factor -3c3 + 690c*2 + 1401c - 2088. -3(c - 232)(c - 1)(c + 3) Factor 27m*3 + 82368m*2 - 605121m + 1110054. 3(m + 3058)(3m - 11)2 Find h, given that -4h*4 + 17349h*3 + 13015h*2 - 4338h = 0. -1, 0, 1/4, 4338 Solve a*3/6 + 23a*2/6 - 311a/2 + 855/2 = 0 for a. -45, 3, 19 Solve 3t3 - 312t*2 + 8100t = 0. 0, 50, 54 Factor -16b2 + 171460b - 42864. -4(b - 10716)(4b - 1) Factor 5p*2 + 72880p - 291600. 5(p - 4)(p + 14580) Find a such that -3a4 - 89655a*3 - 448161a*2 + 1165299a - 627480 = 0. -29880, -7, 1 Factor 4j4 + 1152j*3 - 16j*2 - 4608j. 4j(j - 2)(j + 2)(j + 288) Factor -4p2 - 396p - 8120. -4(p + 29)(p + 70) Let 2o2/3 - 39832o + 594970584 = 0. Calculate o. 29874 Let -2o5/5 - 3092o*4/5 - 1232o*3 + 24704o*2/5 = 0. Calculate o. -1544, -4, 0, 2 Solve 28b*4 + 8352b*3 - 14500b*2 - 30024b - 7200 = 0. -300, -1, -2/7, 3 Factor j*2/5 - 12468j/5 + 38862756/5. (j - 6234)2/5 Find r, given that -r4 - 7904r3 - 78952r*2 - 94656r + 568368 = 0. -7894, -6, 2 Solve -b*2/3 - 1366b - 56784 = 0. -4056, -42 Solve 2x2/13 - 1606x/13 + 233784/13 = 0. 191, 612 Factor -3d3/7 + 612d*2/7 - 25740d/7 + 308256/7. -3(d - 152)(d - 26)*2/7 Determine x so that -4x*4/5 - 44x*3/5 - 24x*2/5 + 576x/5 = 0. -8, -6, 0, 3 What is m in -2m3 - 4m*2 + 217800m + 435600 = 0? -330, -2, 330 Find c such that -c*4/4 - 50c*3 + 1039c*2/4 + 1435c/2 = 0. -205, -2, 0, 7 Determine q so that 5q5/3 + 2184q*4 + 9157q*3/3 - 2618q2 = 0. -1309, -2, 0, 3/5 Let -p3/6 + 70p2/3 + 55144p/3 - 3453088 = 0. What is p? -348, 244 Factor 4h3/3 + 1260h*2 - 2524h + 3788/3. 4(h - 1)2(h + 947)/3 Factor 3y2 + 1101y + 34860. 3(y + 35)(y + 332) Determine l so that -l*5/6 + 25l*4/3 + 943l*3/6 - 26896l*2/3 = 0. -32, 0, 41 Factor 2s*4 + 962s*3 - 5820s*2 + 11672s - 7792. 2(s - 2)3(s + 487) Factor -1426j2/13 - 4258j/13 + 60/13. -2(j + 3)(713j - 10)/13 Factor l2 - 512l - 3108. (l - 518)(l + 6) Determine g, given that 5g*4 - 5120g*3 - 591840g*2 + 1969994240g - 510156435200 = 0. -620, 548 Find d, given that -2d2/11 + 724d - 509210/11 = 0. 65, 3917 Factor 3u2/7 + 83376u/7 + 83355. 3(u + 7)(u + 27785)/7 Factor 3w3 - 3144w*2 - 3147w. 3w(w - 1049)(w + 1) Factor l2/2 + 966576l + 467134581888. (l + 966576)*2/2 Factor -62t*4 - 16491t*3 - 1096452t*2 + 17689t. -t(t + 133)2(62t - 1) Factor 2y*3 - 564y*2 + 20160y + 3048192. 2(y - 168)2(y + 54) Suppose 2t5/5 + 172t*4/5 + 504t*3/5 + 100t*2 + 166t/5 = 0. What is t? -83, -1, 0 Factor u*2/5 + 441u/5 + 18864/5. (u + 48)(u + 393)/5 Factor -12m*2/5 + 11637m/5 + 49674/5. -3(m - 974)(4m + 17)/5 Factor s2/6 + 6865s/6 - 3433/3. (s - 1)(s + 6866)/6 Factor 4l*2/5 + 21264l/5 - 21284. 4(l - 5)(l + 5321)/5 What is t in -2t2/7 - 20t/7 + 145750/7 = 0? -275, 265 Determine n, given that 22n5/21 + 3132n*4/7 - 18044n*3/21 - 3704n*2/7 + 18022n/21 + 572/7 = 0. -429, -1, -1/11, 1, 2 Suppose -10n5 - 218n*4 + 258n*3 + 674n*2 - 248n - 456 = 0. What is n? -114/5, -1, 1, 2 Let -535y2 - 3220y - 60 = 0. What is y? -6, -2/107 Find b such that -3b2 - 1692b + 6816 = 0. -568, 4 Find p such that p*4/3 - 19p*3/3 + 4p*2 + 36p = 0. -2, 0, 3, 18 Factor -m*2/8 - 17403m/8 - 8701/4. -(m + 1)(m + 17402)/8 Factor 5m*2 + 29350m - 58720. 5(m - 2)(m + 5872) Factor -392w2 - 4156w. -4w(98w + 1039) Factor -6483584z*4/5 + 329392352z*3 - 33382584z*2/5 + 225554z/5 - 508/5. -2(z - 254)(148z - 1)3/5 Solve -2a*2/19 - 106a/19 + 580/19 = 0 for a. -58, 5 Factor -w*2 + 307w - 12432. -(w - 259)(w - 48) Factor 2t*2 + 572t - 44800. 2(t - 64)(t + 350) Let 4m5 + 768m*4 - 35816m*3 - 438528m*2 + 473572m = 0. Calculate m. -229, -11, 0, 1, 47 Determine q so that -2q4/19 + 1590q*3/19 + 7988q*2/19 + 9600q/19 = 0. -3, -2, 0, 800 Solve 3a4/7 + 417a*3/7 + 13326a*2/7 + 125808a/7 + 16128 = 0 for a. -98, -24, -16, -1 Let 2c2/11 + 5184c/11 = 0. Calculate c. -2592, 0 Find o such that 10o4/7 + 42o*3 + 1656o*2/7 + 88o = 0. -22, -7, -2/5, 0 Find t, given that -4t2 + 3740t = 0. 0, 935 Determine q so that 2q2/7 - 2730q - 421388/7 = 0. -22, 9577 Factor -j*2/8 - 31221j/8 - 62410. -(j + 16)(j + 31205)/8 Let -2s*5/15 - 328s*4/15 - 3008s*3/15 + 11012s*2/15 - 11678s/15 + 4004/15 = 0. What is s? -154, -13, 1 Solve -9g2 - 20g + 4796 = 0 for g. -218/9, 22 Factor -5g2 + 752920g - 28344426320. -5(g - 75292)2 Factor 5z*5 + 2290z*4 + 339120z*3 + 14542910z*2 - 251543045z. 5z(z - 13)(z + 157)3 What is j in -3j*4 - 204j*3 - 1455j*2 - 858j + 2520 = 0? -60, -7, -2, 1 What is k in k*4/4 - 11k*3 - 3099k*2 + 70840k + 10368400 = 0? -70, 92 Solve -15f4 + 16242f*3 - 77643f*2 + 28944f + 174636 = 0 for f. -6/5, 3, 1078 Let 3d3 - 15564d*2 + 15561d = 0. What is d? 0, 1, 5187 Factor -5h3 - 19955h*2 + 5h + 19955. -5(h - 1)(h + 1)(h + 3991) What is a in -19a*5 + 135a*4 + 518a*3 + 324a*2 - 40a = 0? -2, -1, 0, 2/19, 10 Solve -2o4 - 1326o*3 - 10520o*2 - 26232o - 20960 = 0 for o. -655, -4, -2 Factor -b*3/9 + 148b*2/9 + 2395b/9 + 8150/9. -(b - 163)(b + 5)(b + 10)/9 Factor 3j2/7 + 8580j/7 + 17148/7. 3(j + 2)(j + 2858)/7 Factor 30x3 + 294531x*2 + 722860068x - 216884529. 3(x + 4909)2(10x - 3) Determine w, given that 3w*3 + 78915w*2 + 1104222w = 0. -26291, -14, 0 Suppose -2n3/3 - 19910n*2/3 + 19912n/3 = 0. What is n? -9956, 0, 1 What is d in 4d2 + 5040d - 234900 = 0? -1305, 45 Suppose -2s2/7 + 2535520s/7 - 803607708800/7 = 0. Calculate s. 633880 Determine n, given that -190n5/3 - 2684n*4/3 + 2894n*3/3 + 2036n*2 + 240n = 0. -15, -1, -12/95, 0, 2 Factor -x*2/4 + 32815x/2 - 1076824225/4. -(x - 32815)*2/4 Find v, given that -3v*3/5 - 279v*2/5 + 3123v/5 + 3399/5 = 0. -103, -1, 11 Factor y*2/3 - 6605y/3 - 13214/3. (y - 6607)(y + 2)/3 Factor r2/8 - 13263r/8 + 6631/4. (r - 13262)(r - 1)/8 Determine i, given that -2i*4/5 - 28i*3 + 4976i*2/5 + 21644i/5 + 3306 = 0. -95, -3, -1, 29 Determine b, given that -4b3 - 3956b*2 - 58496b - 54544 = 0. -974, -14, -1 Let -5q3 - 10685q*2 + 20q + 42740 = 0. What is q? -2137, -2, 2 Factor -3x2/7 + 1494x/7 - 8856/7. -3(x - 492)(x - 6)/7 Determine b, given that -15b4/2 + 8105b*3/4 - 93285b*2 + 4785885b/4 - 196830 = 0. 1/6, 27, 216 Suppose -c*3/4 + 81c*2/4 - 75c/2 - 158 = 0. What is c? -2, 4, 79 Factor -5n3 + 1645n*2 + 385525n - 387165. -5(n - 487)(n - 1)(n + 159) Determine b so that -3b*4 - 687b*3 - 672b*2 + 2748b + 2736 = 0. -228, -2, -1, 2 Factor -4d2 + 1908d - 55304. -4(d - 446)(d - 31) Let 9b3/5 - b2 - 36b/5 + 4 = 0. What is b? -2, 5/9, 2 What is p in 2p2/5 - 134p + 38628/5 = 0? 74, 261 Factor -16k2 + 2386k + 109740. -2(k - 186)(8k + 295) Let -v2/3 + 8672v/3 - 18800896/3 = 0. Calculate v. 4336 Factor 94k2 - 454k - 80. 2(k - 5)(47k + 8) Let -4n*3 + 61464n*2 - 236113956n = 0. Calculate n. 0, 7683 Find l such that -2l4 + 16l*3 + 154l*2 - 1248l + 1080 = 0. -9, 1, 6, 10 Suppose 14d4 + 76984d*3/11 + 874272d*2 - 1004000d/11 - 500000/11 = 0. Calculate d. -250, -2/11, 2/7 Determine c, given that -573c2 - 561c + 12 = 0. -1, 4/191 Factor 2l2 + 727718l. 2l(l + 363859) Let 4u2 - 4904u - 29568 = 0. What is u? -6, 1232 What is b in -b*5/2 + 24b*4 - 330b*3 + 968b**2 = 0? 0, 4, 22 D	{ "pile_set_name": "DM Mathematics" }
? 2 What is the thousands digit of 18022? 8 What is the ten millions digit of 35568118? 3 What is the ten millions digit of 34485727? 3 What is the tens digit of 197870? 7 What is the hundred thousands digit of 401635? 4 What is the units digit of 4107797? 7 What is the hundreds digit of 1777140? 1 What is the hundred thousands digit of 400232? 4 What is the thousands digit of 3686567? 6 What is the millions digit of 19869197? 9 What is the tens digit of 3147895? 9 What is the units digit of 1204576? 6 What is the millions digit of 20645649? 0 What is the hundreds digit of 123010? 0 What is the tens digit of 316579? 7 What is the ten thousands digit of 1576622? 7 What is the ten thousands digit of 6966811? 6 What is the tens digit of 25094136? 3 What is the hundred thousands digit of 2422471? 4 What is the tens digit of 239527? 2 What is the tens digit of 7998923? 2 What is the tens digit of 6195828? 2 What is the ten thousands digit of 808353? 0 What is the ten thousands digit of 126491? 2 What is the tens digit of 7350341? 4 What is the units digit of 1189828? 8 What is the tens digit of 4031027? 2 What is the hundreds digit of 310371? 3 What is the ten thousands digit of 596499? 9 What is the millions digit of 13413693? 3 What is the tens digit of 244195? 9 What is the ten thousands digit of 3064021? 6 What is the millions digit of 2282403? 2 What is the hundreds digit of 189975? 9 What is the millions digit of 1173866? 1 What is the tens digit of 1687374? 7 What is the units digit of 794834? 4 What is the units digit of 237958? 8 What is the tens digit of 4281896? 9 What is the hundred thousands digit of 676944? 6 What is the tens digit of 962198? 9 What is the hundred thousands digit of 785361? 7 What is the units digit of 14231949? 9 What is the tens digit of 91482? 8 What is the tens digit of 14021032? 3 What is the millions digit of 3143277? 3 What is the tens digit of 3829020? 2 What is the hundreds digit of 27987851? 8 What is the hundreds digit of 328452? 4 What is the ten thousands digit of 2981944? 8 What is the tens digit of 2171222? 2 What is the hundreds digit of 12782846? 8 What is the ten thousands digit of 6935093? 3 What is the hundred thousands digit of 753723? 7 What is the ten thousands digit of 482774? 8 What is the millions digit of 1124582? 1 What is the hundred thousands digit of 352893? 3 What is the tens digit of 2716789? 8 What is the tens digit of 2399497? 9 What is the tens digit of 480768? 6 What is the tens digit of 147803? 0 What is the hundreds digit of 3132799? 7 What is the millions digit of 3597340? 3 What is the units digit of 703130? 0 What is the ten thousands digit of 1129379? 2 What is the millions digit of 15560144? 5 What is the hundreds digit of 6543642? 6 What is the hundred thousands digit of 4028343? 0 What is the hundreds digit of 1647058? 0 What is the tens digit of 13655033? 3 What is the ten thousands digit of 17207345? 0 What is the thousands digit of 2116285? 6 What is the units digit of 12677237? 7 What is the ten thousands digit of 959078? 5 What is the thousands digit of 19316067? 6 What is the thousands digit of 166422? 6 What is the hundred thousands digit of 1017580? 0 What is the hundreds digit of 138870? 8 What is the millions digit of 18254895? 8 What is the units digit of 735001? 1 What is the hundred thousands digit of 1093974? 0 What is the hundred thousands digit of 2702388? 7 What is the hundreds digit of 602468? 4 What is the hundred thousands digit of 832983? 8 What is the tens digit of 2444239? 3 What is the tens digit of 3295657? 5 What is the ten thousands digit of 487548? 8 What is the tens digit of 1685530? 3 What is the ten thousands digit of 1737605? 3 What is the hundred thousands digit of 300883? 3 What is the ten thousands digit of 615860? 1 What is the hundred thousands digit of 1574175? 5 What is the tens digit of 1151820? 2 What is the ten thousands digit of 1137582? 3 What is the hundred thousands digit of 2522250? 5 What is the ten thousands digit of 1275167? 7 What is the hundred thousands digit of 284950? 2 What is the hundred thousands digit of 950121? 9 What is the ten thousands digit of 8730882? 3 What is the millions digit of 4428564? 4 What is the hundreds digit of 151564? 5 What is the hundreds digit of 1033961? 9 What is the units digit of 18609602? 2 What is the hundreds digit of 18314326? 3 What is the ten thousands digit of 101127? 0 What is the tens digit of 687728? 2 What is the thousands digit of 23833282? 3 What is the units digit of 17706932? 2 What is the ten thousands digit of 297868? 9 What is the ten millions digit of 17784521? 1 What is the ten thousands digit of 2631101? 3 What is the tens digit of 177735? 3 What is the hundred thousands digit of 310191? 3 What is the hundred thousands digit of 847345? 8 What is the ten thousands digit of 737968? 3 What is the tens digit of 15374478? 7 What is the hundred thousands digit of 1362234? 3 What is the ten millions digit of 26351661? 2 What is the hundreds digit of 11984130? 1 What is the millions digit of 2223262? 2 What is the hundreds digit of 25681899? 8 What is the millions digit of 3198501? 3 What is the units digit of 1853658? 8 What is the units digit of 6504984? 4 What is the thousands digit of 460480? 0 What is the hundreds digit of 510497? 4 What is the ten thousands digit of 11688465? 8 What is the thousands digit of 492837? 2 What is the hundred thousands digit of 154467? 1 What is the ten thousands digit of 2710664? 1 What is the hundred thousands digit of 739471? 7 What is the hundreds digit of 2203040? 0 What is the units digit of 1499010? 0 What is the tens digit of 54394? 9 What is the thousands digit of 1575558? 5 What is the hundreds digit of 317967? 9 What is the units digit of 390102? 2 What is the tens digit of 54743? 4 What is the ten thousands digit of 18850? 1 What is the thousands digit of 5705971? 5 What is the units digit of 65635? 5 What is the thousands digit of 357284? 7 What is the ten thousands digit of 524434? 2 What is the units digit of 8900049? 9 What is the units digit of 403228? 8 What is the ten thousands digit of 372400? 7 What is the units digit of 6246123? 3 What is the hundred thousands digit of 1956340? 9 What is the ten thousands digit of 4258208? 5 What is the units digit of 403261? 1 What is the hundreds digit of 39328? 3 What is the hundred thousands digit of 2068235? 0 What is the millions digit of 4764584? 4 What is the hundred thousands digit of 484869? 4 What is the units digit of 13789760? 0 What is the tens digit of 51861? 6 What is the units digit of 442774? 4 What is the tens digit of 36883? 8 What is the hundred thousands digit of 30895281? 8 What is the hundreds digit of 1277777? 7 What is the hundreds digit of 6603341? 3 What is the units digit of 524418? 8 What is the hundred thousands digit of 878600? 8 What is the thousands digit of 10720? 0 What is the tens digit of 1229984? 8 What is the tens digit of 3428698? 9 What is the ten thousands digit of 498586? 9 What is the ten thousands digit of 14660839? 6 What is the units digit of 433431? 1 What is the hundred thousands digit of 662664? 6 What is the millions digit of 5175739? 5 What is the thousands digit of 1684604? 4 What is the ten thousands digit of 19608? 1 What is the tens digit of 334700? 0 What is the millions digit of 3300678? 3 What is the ten thousands digit of 334451? 3 What is the hundreds digit of 1656156? 1 What is the thousands digit of 950581? 0 What is the units digit of 2162678? 8 What is the thousands digit of 1528676? 8 What is the ten thousands digit of 2522336? 2 What is the units digit of 1446391? 1 What is the ten thousands digit of 89589? 8 What is the hundred thousands digit of 202495? 2 What is the units digit of 574189? 9 What is the thousands digit of 268004? 8 What is the units digit of 4862878? 8 What is the thousands digit of 6517901? 7 What is the hundreds digit of 186618? 6 What is the units digit of 389022? 2 What is the thousands digit of 9398146? 8 What is the millions digit of 34553993? 4 What is the thousands digit of 17995372? 5 What is the hundred thousands digit of 1788632? 7 What is the units digit of 4150566? 6 What is the units	{ "pile_set_name": "DM Mathematics" }
are root of 45 to the nearest integer? 7 What is the cube root of 7010 to the nearest integer? 19 What is 8573 to the power of 1/3, to the nearest integer? 20 What is the sixth root of 783 to the nearest integer? 3 What is the cube root of 239 to the nearest integer? 6 What is 3017 to the power of 1/7, to the nearest integer? 3 What is the ninth root of 940 to the nearest integer? 2 What is 131028 to the power of 1/3, to the nearest integer? 51 What is the cube root of 19303 to the nearest integer? 27 What is the square root of 842 to the nearest integer? 29 What is 3584 to the power of 1/3, to the nearest integer? 15 What is the cube root of 79989 to the nearest integer? 43 What is the tenth root of 2878 to the nearest integer? 2 What is the third root of 13189 to the nearest integer? 24 What is the fourth root of 1656 to the nearest integer? 6 What is 23434 to the power of 1/2, to the nearest integer? 153 What is 30227 to the power of 1/2, to the nearest integer? 174 What is the seventh root of 3315 to the nearest integer? 3 What is 64958 to the power of 1/3, to the nearest integer? 40 What is the cube root of 3422 to the nearest integer? 15 What is the fourth root of 527 to the nearest integer? 5 What is 18387 to the power of 1/2, to the nearest integer? 136 What is the square root of 10402 to the nearest integer? 102 What is 898 to the power of 1/10, to the nearest integer? 2 What is 7150 to the power of 1/3, to the nearest integer? 19 What is 1837 to the power of 1/6, to the nearest integer? 3 What is 6721 to the power of 1/2, to the nearest integer? 82 What is 12381 to the power of 1/2, to the nearest integer? 111 What is 19343 to the power of 1/3, to the nearest integer? 27 What is 1125 to the power of 1/3, to the nearest integer? 10 What is 2797 to the power of 1/2, to the nearest integer? 53 What is 12556 to the power of 1/9, to the nearest integer? 3 What is the third root of 55241 to the nearest integer? 38 What is 10992 to the power of 1/7, to the nearest integer? 4 What is the fifth root of 12130 to the nearest integer? 7 What is 509 to the power of 1/3, to the nearest integer? 8 What is the square root of 2212 to the nearest integer? 47 What is the square root of 28744 to the nearest integer? 170 What is 17566 to the power of 1/3, to the nearest integer? 26 What is the ninth root of 10296 to the nearest integer? 3 What is 98736 to the power of 1/2, to the nearest integer? 314 What is the square root of 288 to the nearest integer? 17 What is the cube root of 69123 to the nearest integer? 41 What is 3644 to the power of 1/5, to the nearest integer? 5 What is 1857 to the power of 1/2, to the nearest integer? 43 What is 144288 to the power of 1/3, to the nearest integer? 52 What is the cube root of 2852 to the nearest integer? 14 What is 1114 to the power of 1/5, to the nearest integer? 4 What is the square root of 10688 to the nearest integer? 103 What is 16985 to the power of 1/3, to the nearest integer? 26 What is 5452 to the power of 1/7, to the nearest integer? 3 What is 21385 to the power of 1/3, to the nearest integer? 28 What is 3267 to the power of 1/8, to the nearest integer? 3 What is 17382 to the power of 1/2, to the nearest integer? 132 What is 68776 to the power of 1/2, to the nearest integer? 262 What is the square root of 9373 to the nearest integer? 97 What is 112667 to the power of 1/3, to the nearest integer? 48 What is the cube root of 1823 to the nearest integer? 12 What is the sixth root of 7349 to the nearest integer? 4 What is the square root of 19962 to the nearest integer? 141 What is the cube root of 97936 to the nearest integer? 46 What is 75440 to the power of 1/2, to the nearest integer? 275 What is the square root of 1268 to the nearest integer? 36 What is the square root of 2449 to the nearest integer? 49 What is the square root of 731 to the nearest integer? 27 What is the sixth root of 16966 to the nearest integer? 5 What is 3692 to the power of 1/9, to the nearest integer? 2 What is the sixth root of 1009 to the nearest integer? 3 What is the square root of 16452 to the nearest integer? 128 What is the cube root of 17134 to the nearest integer? 26 What is the ninth root of 38 to the nearest integer? 1 What is 128 to the power of 1/3, to the nearest integer? 5 What is the fourth root of 9426 to the nearest integer? 10 What is the eighth root of 270 to the nearest integer? 2 What is the sixth root of 106545 to the nearest integer? 7 What is 4351 to the power of 1/2, to the nearest integer? 66 What is 6308 to the power of 1/4, to the nearest integer? 9 What is 2297 to the power of 1/6, to the nearest integer? 4 What is 17165 to the power of 1/10, to the nearest integer? 3 What is the cube root of 66486 to the nearest integer? 41 What is the tenth root of 479 to the nearest integer? 2 What is 1115 to the power of 1/3, to the nearest integer? 10 What is the tenth root of 4833 to the nearest integer? 2 What is the cube root of 184724 to the nearest integer? 57 What is 1079 to the power of 1/3, to the nearest integer? 10 What is the tenth root of 16879 to the nearest integer? 3 What is 88972 to the power of 1/5, to the nearest integer? 10 What is 23723 to the power of 1/10, to the nearest integer? 3 What is 8060 to the power of 1/2, to the nearest integer? 90 What is the third root of 182461 to the nearest integer? 57 What is the cube root of 105842 to the nearest integer? 47 What is the ninth root of 4782 to the nearest integer? 3 What is 26364 to the power of 1/7, to the nearest integer? 4 What is 1859 to the power of 1/2, to the nearest integer? 43 What is the square root of 8712 to the nearest integer? 93 What is 1272 to the power of 1/10, to the nearest integer? 2 What is the cube root of 1982 to the nearest integer? 13 What is the square root of 601 to the nearest integer? 25 What is 8332 to the power of 1/3, to the nearest integer? 20 What is 1587 to the power of 1/3, to the nearest integer? 12 What is the ninth root of 6626 to the nearest integer? 3 What is the third root of 1144 to the nearest integer? 10 What is the fourth root of 90147 to the nearest integer? 17 What is 9651 to the power of 1/2, to the nearest integer? 98 What is the fourth root of 29045 to the nearest integer? 13 What is the cube root of 18215 to the nearest integer? 26 What is 6481 to the power of 1/6, to the nearest integer? 4 What is 71 to the power of 1/2, to the nearest integer? 8 What is the tenth root of 22652 to the nearest integer? 3 What is the square root of 84262 to the nearest integer? 290 What is the cube root of 1932 to the nearest integer? 12 What is the sixth root of 18652 to the nearest integer? 5 What is 13105 to the power of 1/9, to the nearest integer? 3 What is the cube root of 4487 to the nearest integer? 16 What is the ninth root of 50655 to the nearest integer? 3 What is 5627 to the power of 1/3, to the nearest integer? 18 What is the seventh root of 4815 to the nearest integer? 3 What is 664 to the power of 1/3, to the nearest integer? 9 What is 17128 to the power of 1/3, to the nearest integer? 26 What is the square root of 2356 to the nearest integer? 49 What is the tenth root of 5255 to the nearest integer? 2 What is 16 to the power of 1/2, to the nearest integer? 4 What is the cube root of 2707 to the nearest integer? 14 What is the eighth root of 71692 to the nearest integer? 4 What is the third root of 200 to the nearest integer? 6 What is 7754 to the power of 1/2, to the nearest integer? 88 What is 18848 to the power of 1/3, to the nearest integer? 27 What is 1494 to the power of 1/5, to the nearest integer? 4 What is 43431 to the power of 1/3, to the nearest integer? 35 What is 17749 to the power of 1/4, to the nearest integer? 12 What is 28761 to the power of 1/3, to the nearest integer? 31 What is the square root of 32749 to the nearest integer? 181 What is 43470 to the power of 1/2, to the nearest integer? 208 What is 3568 to the power of 1/8, to the nearest integer? 3 What is the cube root of 625 to the nearest integer? 9 What is the cube root of 1482 to the nearest integer? 11 What is the eighth root of 637 to the nearest integer? 2 What is the sixth root of 1628 to the nearest intege	{ "pile_set_name": "DM Mathematics" }
w + 18 = 3a + 59. What is the lowest common multiple of 8 and w? 16 Let h = 49 - 30. What is the smallest common multiple of h + -4 + 2 + 1 and 8? 72 Let k(d) = 2d*2 - 35d + 20. What is the least common multiple of k(17) and 9? 9 Let w = 8189/78 - 1562/13. Let v = 125/9 + w. Find the common denominator of v and 67/27. 54 Suppose 0 = 4u - 109 + 5. Let h be 2 + -1(0 - 0). What is the least common multiple of u and 14/(4 - (1 + h))? 182 Let f be 2555769771563/1189453372198 + (-12)/(-8). Let g = f - -74055/17687302. Let c = g + 5/5173. What is the common denominator of c and -79/2? 26 Let q = 9 - -15. Calculate the smallest common multiple of q and 4. 24 Let s(g) = -g - 2. Let v(c) = -3c - 15. Let j(a) = a + 7. Let z(l) = -13j(l) - 6v(l). Let k be z(-1). What is the least common multiple of 8 and s(k)? 8 Let j = 5431/6 + -895. Let d = 79433/12 + -6608. Calculate the common denominator of j and d. 12 Let h = 76576/9 - 8500. Suppose 3l = -14 - 61. Find the common denominator of 55/l45/(-6) and h. 18 Let o(f) be the first derivative of -f4/4 + 3f*3 + 3f*2/2 - 22f + 1. Calculate the lowest common multiple of o(9) and 2. 10 Let s(t) = -t - 3. Let x be s(-5). Suppose -2 = -xl + 3h + 2, 2l + 3h - 28 = 0. What is the least common multiple of l and 2? 8 Let t(h) = h3 + h2 + 87. Let f be t(0). What is the least common multiple of ((-116)/f)/((-1)/3) and 50? 100 Suppose -7r - 18 = -2r - 3u, 2r + 2u = -20. Calculate the common denominator of -35/12 and -2r/(-324)20/(-1). 108 Let z be (-3)/(-6) - (-2756)/(-44) - 0. Let g = z - -62. Let p = -4542 + 99987/22. Find the common denominator of p and g. 22 Suppose 3p - 4a + 68 = -0a, 3a - 6 = 0. What is the lowest common multiple of 10 and (-176)/p - 1/(-5)? 90 Let s = 348977/61360 + 1/7670. Find the common denominator of -17/64 and s. 64 Let j = 2/1861 - -91149/37220. Let t = -85/564 - 4721/1316. What is the common denominator of j and t? 420 Let j be ((-16)/10)/(-4) - 180323/11220. Let w = j + -4/51. Calculate the common denominator of (-1)/4 + (-12)/(-2) and w. 4 Let a(m) = 4m - 1 - 8m - 9m. Let i(w) = w*3 + w + 1. Let l be i(-1). What is the lowest common multiple of a(l) and 12? 12 Calculate the common denominator of 206/52 - (-5)/(40/(-16)) and 97/16. 208 Suppose -19 = z - 22. Calculate the smallest common multiple of 50 and z/5 - (-376)/40. 50 Let s = -247/83 - -62878/22161. Calculate the common denominator of -41/24 and s. 2136 Let m = 485179/210 + -84759/35. Let y = 335/3 + m. Calculate the common denominator of (-15)/18(-49 - -20) and y. 42 Let p(b) = -b*2 - 8b + 54. Let v(x) = x*3 + 7x*2 + x - 8. What is the least common multiple of v(-6) and p(-12)? 66 Let i = -888/187 - -456887/561. Let a = i - 48709/60. What is the common denominator of 111/10 and a? 20 Let d(c) = c + 2 - 20c*2 + 20c2 - c3. Let n be d(-2). Suppose 3t + n = m - 9, t = -m + 5. Calculate the smallest common multiple of 16 and m. 16 Suppose 0 = -4q + 7q - 108. Let v(i) = -i3 - 2i2 - 30. Calculate the smallest common multiple of q and v(-4). 36 Let t(k) = k2 - 34k - 70. What is the least common multiple of t(-2) and 432? 432 Suppose 46 = 5s + 16. Suppose -s = -2l - 0l. Suppose -lq + 28 = 2t, 0 = 5t - 2q - 0q - 32. Calculate the lowest common multiple of 6 and t. 24 Let d be ((-6102)/15)/((-1)/5) - 4. Let l = d - 10183/5. Find the common denominator of l and 46/21. 105 Let c = -488/19 - -26. Let h(r) = 15r + 2. Find the common denominator of c and h(-3). 19 Let u(d) = -5d - 30. Let a(w) = w + 1. Let y(f) = -2a(f) - u(f). Calculate the least common multiple of 6 + (-1)/(-1)-1 and y(-6). 10 Let o be (-249)/27 - (-2)/9. Let g be o/(-3)1 - 5. What is the smallest common multiple of (-8)/g4/8 and 11? 22 Let j be 22393069262/8684/(-64520). Let p = j + 92/50003. Let x = p + 11220/7. What is the common denominator of x and -73/32? 160 Let m = -31 - -7. Let f be (-3)/(-2683)16/m. Let t = f - 96578/13415. Find the common denominator of -4/9 and t. 45 Let x = -99/4 - -1641/64. Find the common denominator of -25/16 and x. 64 Let c = 17285 - 691283/40. Calculate the common denominator of c and -51/56. 280 Let c(r) = 4r - 22. Let w be c(10). Calculate the common denominator of (-1)/4 - 294/(-40) and w/(-32)(5 - 33). 20 Let b = 22717 + -43012. Let a = b - -608989/30. What is the common denominator of -44/3 and a? 30 Let y(j) = -j3 + j2 + j + 1. Let t be y(3). Let g = -6 - t. What is the lowest common multiple of 24 and g? 24 Suppose 339j - 9 = -m + 344j, 2m = -3j + 18. Suppose -5w + 5b = -65, w - 4b + b - 23 = 0. Calculate the smallest common multiple of m and w. 72 Find the common denominator of 23/18 and (279/4)/(-1 - (-24 + -1)). 288 Let q be (-1400799)/(-5544) + 10/(-70). Let o = -2825/11 + q. Calculate the common denominator of o and 37/7. 168 Let w(o) = 21o - 84. What is the smallest common multiple of w(5) and 78? 546 Let d = -34/435 + 28153/9570. Calculate the common denominator of d and (34/10 - 3)/((-12)/(-5)). 66 What is the common denominator of 6085/(-260) + 5 + (-6)/(-39) and (-308)/(-32)8/(-10)? 20 Suppose 5d - 2b + 2 = d, 4b - 18 = d. Suppose l + d = 2l. Calculate the least common multiple of l and 41/3 - 3/(-9). 14 Let j(i) = 2i2 + 15i + 25. What is the smallest common multiple of j(-6) and 9? 63 Let d be 2/9 - (-120)/(-54). What is the least common multiple of 14/d - -4 and 12? 12 Find the common denominator of -7 - ((-210)/9)/10 and -19/24. 24 Let z = -1028488/69 + 14905. What is the common denominator of 43/5 and z? 345 Let o(f) = -f3 - 7f*2 - 8f + 4. Let u be (-2)/7 - (-120)/(-21). What is the least common multiple of (0 + (-3)/2)(-180)/27 and o(u)? 80 Let v = -15639/10 - -1562. Let j = -1663 + 847. Let x = -17977/22 - j. Calculate the common denominator of v and x. 110 Suppose -13q = -20q + 56. Suppose -36 = 10y - 13y. Calculate the smallest common multiple of q and y. 24 Let s = 2/24159 + 1424765/7440972. What is the common denominator of s and 59/440? 3080 Calculate the common denominator of 3 + -23126/1200 and 49/18. 1800 Let x be 358/6 + 1/3. Suppose 0 = -2t - 0t - x. Let a = 252/11 - 23. Find the common denominator of a and t. 11 Let y(d) = -d*2 + 18d - 18. Let s be y(14). Let b = s + -8. What is the lowest common multiple of b and 21? 210 Let n = -49 - -47. Calculate the smallest common multiple of n - (-6 - -1) - -31 and 20. 60 Suppose d = -3g + 6d - 57, 0 = -4g + 2d - 62. Suppose -2c + 5 - 13 = 0. Let x = c - g. What is the least common multiple of x and 12? 60 Let u(j) = -10j. Let i be u(-11). What is the common denominator of (6/32)/((-15)/i) and -39/11? 88 Let h = -92 - 24. Let i = 227/2 + h. Find the common denominator of 75/14 and i. 14 Let n be 4/20 - (-189732)/(-951585). Let g = -2869282921/634390 + n. Let v = -4527 - g. Calculate the common denominator of -51/4 and v. 20 Let m(x) = -4x + 159. Calculate the smallest common multiple of 36 and m(38). 252 Let u be 0 + -1 - (-11 - -1). Let f be -124(4 + (-8)/(-12)). Calculate the lowest common multiple of (-2)/u - f/18 and 18. 18 Let i be -3 - ((-391)/144 - 10/45). Let d = -19/48 - i. What is the common denominator of d and -59/21? 21 Let f be (15/(-2555))/(9/6). Let a = -2573/4599 - f. Calculate the common denominator of a and 83/10. 90 Let a = 149812/1353 + -1218/11. Let x = -1129/246 + a. What is the common denominator of -35/46 and x? 506 What is the common denominator of -101/18 and 2009/1848 - 6/((-288)/6)? 198 Suppose 0 = 3v + 70 + 74. Find the common denominator of 3/4 - (-1308)/v and -52/7. 14 Let w be -3 + (4/(-10))/((-2)/(-5)). What is the least common multiple of ((-6)/w)/((-17)/(-102)) and 51? 153 Calculate the least common multiple of (23 + 5)/(10/5) and 49. 98 Suppose -3y = -3m - 477, -4y + 10m = 8m - 640. Calculate the smallest common multiple of y and 92. 644 Calculate the common denominator of 81/10 and 4/8 + (-453)/312. 520 Suppose 4g - 2i - 37 = -3i, 2i = -2g + 20. Calculate the lowest common multiple of ((-145)/87)/(50/(-84)2/5) and g. 63 Let u = 22/2717625 + 13948965003/25364500. Let z = -3912/7 + u. Let c = -139223/7628 - -3/1907. Calculate the common denominator of c and z. 12 Let c = 1201489/71 - 16922. Wh	{ "pile_set_name": "DM Mathematics" }
nvert 0.9159208t to nanograms. 915920800000000 How many months are there in 55/2 of a year? 330 How many nanograms are there in 967427.8 kilograms? 967427800000000000 Convert 2222614.8 months to years. 185217.9 What is 0.5464462 millennia in months? 6557.3544 What is seventy-three quarters of a litre in millilitres? 18250 Convert 6819.396 micrometers to kilometers. 0.000006819396 What is 8156.922 minutes in hours? 135.9487 Convert 2478.764 decades to millennia. 24.78764 How many hours are there in five fourteenths of a week? 60 How many millimeters are there in 1/5 of a meter? 200 What is one quarter of a year in months? 3 Convert 0.1367222 micrograms to milligrams. 0.0001367222 What is 2/125 of a microgram in nanograms? 16 What is 6.719558 micrograms in nanograms? 6719.558 How many tonnes are there in 95.94493 grams? 0.00009594493 What is four thirds of a decade in months? 160 What is 0.2065863 micrograms in kilograms? 0.0000000002065863 How many millilitres are there in twenty-seven quarters of a litre? 6750 What is 4.486876 centuries in millennia? 0.4486876 What is 0.0226819 milligrams in nanograms? 22681.9 How many milligrams are there in seventy-one quarters of a gram? 17750 Convert 7955.964ml to litres. 7.955964 Convert 0.8474094t to grams. 847409.4 Convert 2590865.4 months to millennia. 215.90545 How many nanograms are there in 1/64 of a milligram? 15625 What is 3/10 of a millennium in months? 3600 What is 639.7 kilometers in nanometers? 639700000000000 What is 5/4 of a century in years? 125 What is 66062.19ml in litres? 66.06219 How many millilitres are there in one fifth of a litre? 200 How many years are there in 0.2795204 decades? 2.795204 What is 3/25 of a tonne in kilograms? 120 How many months are there in 59/4 of a century? 17700 How many millilitres are there in 5/8 of a litre? 625 How many millilitres are there in seven halves of a litre? 3500 What is 85/4 of a litre in millilitres? 21250 What is 53/5 of a century in years? 1060 How many nanometers are there in 17/4 of a micrometer? 4250 What is 4981.78 millilitres in litres? 4.98178 How many kilometers are there in 6.58183cm? 0.0000658183 How many millilitres are there in 6/5 of a litre? 1200 How many micrometers are there in six fifths of a centimeter? 12000 What is fourty-five quarters of a gram in milligrams? 11250 Convert 69.28915 decades to years. 692.8915 What is 1/4 of a centimeter in micrometers? 2500 Convert 304524.2 decades to years. 3045242 How many millilitres are there in 3/50 of a litre? 60 What is 81.27821 kilograms in micrograms? 81278210000 What is 929688.8 decades in centuries? 92968.88 What is 0.5912344 millilitres in litres? 0.0005912344 What is 1/24 of a day in hours? 1 How many seconds are there in 5690.708ns? 0.000005690708 What is 7254.109 nanometers in millimeters? 0.007254109 What is 0.0913812um in centimeters? 0.00000913812 What is 5886.499ms in microseconds? 5886499 What is 31/5 of a meter in millimeters? 6200 How many nanograms are there in three tenths of a microgram? 300 Convert 43674.6km to micrometers. 43674600000000 Convert 68.26737 kilometers to micrometers. 68267370000 What is sixty-eight thirds of a week in hours? 3808 What is 3/10 of a millennium in decades? 30 What is 5/8 of a second in milliseconds? 625 How many nanoseconds are there in 2771.294 minutes? 166277640000000 How many years are there in six fifths of a decade? 12 How many micrograms are there in 41/2 of a milligram? 20500 What is 33/5 of a millisecond in microseconds? 6600 What is three tenths of a microgram in nanograms? 300 What is five quarters of a tonne in kilograms? 1250 How many millilitres are there in 8/25 of a litre? 320 Convert 262870.2l to millilitres. 262870200 How many months are there in seventy-one quarters of a year? 213 How many nanoseconds are there in 242548.1 weeks? 146693090880000000000 How many centimeters are there in 86.26593 millimeters? 8.626593 How many months are there in 3/25 of a millennium? 1440 What is 2035620.6 minutes in hours? 33927.01 What is 977334.6 decades in months? 117280152 How many weeks are there in 1456587.846ns? 0.000000002408379375 What is eight thirds of a minute in seconds? 160 Convert 55.6672 millennia to years. 55667.2 How many nanograms are there in 6/5 of a microgram? 1200 Convert 7126889.4ms to hours. 1.9796915 What is three eighths of a litre in millilitres? 375 What is one twentieth of a litre in millilitres? 50 How many millilitres are there in 0.8193232l? 819.3232 How many months are there in thirty-seven halves of a century? 22200 How many litres are there in 9352.171ml? 9.352171 What is three tenths of a millimeter in micrometers? 300 How many milliseconds are there in 17/2 of a second? 8500 How many millilitres are there in three eighths of a litre? 375 Convert 63261.33 centuries to decades. 632613.3 How many millilitres are there in eleven halves of a litre? 5500 How many months are there in four thirds of a century? 1600 How many micrometers are there in 3/5 of a millimeter? 600 What is 7/4 of a tonne in kilograms? 1750 How many nanometers are there in seventy-two fifths of a micrometer? 14400 Convert 16522.8 millennia to months. 198273600 How many litres are there in 6.361738ml? 0.006361738 How many milligrams are there in 41.24545ng? 0.00004124545 Convert 35.54407 millimeters to centimeters. 3.554407 What is 31/5 of a litre in millilitres? 6200 Convert 63.30332 weeks to seconds. 38285847.936 How many years are there in 65.93002 millennia? 65930.02 What is 35287.19 seconds in microseconds? 35287190000 How many kilograms are there in 34291.62ug? 0.00003429162 Convert 243.0326kg to grams. 243032.6 How many millilitres are there in 11/8 of a litre? 1375 What is 53/5 of a litre in millilitres? 10600 How many millimeters are there in 971.4162 nanometers? 0.0009714162 How many weeks are there in 489.35187 minutes? 0.0485468125 How many micrograms are there in 176.003t? 176003000000000 What is 17/2 of a millennium in decades? 850 How many hours are there in 3/8 of a day? 9 How many seconds are there in 1/6 of a day? 14400 What is twenty-seven fifths of a century in months? 6480 What is 13.30646 millennia in months? 159677.52 What is 4264.658ml in litres? 4.264658 How many micrograms are there in 1/5 of a milligram? 200 What is seven sixths of a decade in months? 140 How many years are there in 2.1906942 months? 0.18255785 How many nanograms are there in 38022.24 milligrams? 38022240000 How many litres are there in 0.998043 millilitres? 0.000998043 What is one tenth of a day in minutes? 144 How many millimeters are there in six fifths of a meter? 1200 How many litres are there in 809.206ml? 0.809206 What is seventy-three fifths of a kilogram in grams? 14600 What is seven quarters of a millennium in decades? 175 What is 8174.734 hours in nanoseconds? 29429042400000000 How many millimeters are there in one tenth of a kilometer? 100000 How many seconds are there in 6.278108 hours? 22601.1888 What is 20065.74 centuries in years? 2006574 What is 3/32 of a meter in micrometers? 93750 What is 1/4 of a year in months? 3 Convert 78350.67 millilitres to litres. 78.35067 What is 37/5 of a millimeter in micrometers? 7400 How many milligrams are there in 93010.32 tonnes? 93010320000000 What is 901842.2 centuries in months? 1082210640 What is 6/5 of a millennium in decades? 120 What is twenty-one fifths of a litre in millilitres? 4200 How many micrometers are there in three fifths of a millimeter? 600 What is 7.93487ml in litres? 0.00793487 How many months are there in 2/15 of a millennium? 1600 How many decades are there in one fifth of a century? 2 How many millilitres are there in 6/25 of a litre? 240 How many centuries are there in thirteen fifths of a millennium? 26 How many micrometers are there in 0.4706593 millimeters? 470.6593 Convert 9478.831 millennia to months. 113745972 How many nanograms are there in 58.75769ug? 58757.69 What is 257937.9 decades in centuries? 25793.79 How many tonnes are there in 8204.841 nanograms? 0.000000000008204841 How many minutes are there in 138.80034 milliseconds? 0.002313339 Convert 0.009015nm to centimeters. 0.0000000009015 How many millilitres are there in twenty-one quarters of a litre	{ "pile_set_name": "DM Mathematics" }
te (16/14)/(18(-8)/(-168)). 4/3 Calculate 182/(-168)(-4)/26. 1/6 What is (-8)/(-36)6/4-2? -2/3 Calculate ((-3)/(-8))/(-1)912/114. -3 Evaluate 19/(-36)-4. 1 Calculate ((-7)/(-9)-3)/((-4)/(-12)). -7 Calculate 4/4-12/(-2). 1 What is the value of (8/(-12))/(4/(-6))? 1 What is ((16/(-4))/8)/(18/12)? -1/3 Evaluate (-4)/18(-1305)/(-290). -1 (2/(-24))/((17/10)/17) -5/6 Calculate ((-92)/(-23))/((-2)/(-4)). 8 Evaluate (-3)/153/(27/(-15)). 1/3 What is the value of 27/(-135)5/22? -1 What is (10/(-4))/(12/24)? -5 What is the value of 35/14(-60)/25? -6 What is the value of ((-6)/((-72)/15))/((-5)/(-20))? 5 Calculate (6/(-8))/((-45)/40). 2/3 What is (-10)/(-6)3(-8)/10? -4 What is (33/253010)/(6/(-4))? -2/23 What is ((-8)/(-20))/(2/(-20))? -4 Calculate ((-15)/(-30))/((-7)/4). -2/7 What is 4/(-16)2-2? 1 What is (2/4)/(6/(-48))? -4 What is the value of (2/4)/(5/((-10)/(-3)))? 1/3 What is 2/(-30-721/(-245))? -1/9 Calculate ((-30)/525)/((-4)/20). 2/7 10/180(-9)/(-2) 1/4 Calculate (2/(-6))/((-42)/(-630)). -5 Evaluate (-10)/101/6-2. 1/3 What is (-34)/(-51)1/(2/(-6))? -2 What is the value of (-286)/(-52)(-4)/(-11)? 2 What is the value of (-3(-1)/(-4))/(3/(-20))? 5 What is ((-2)/(-12))/((126/24)/7)? 2/9 (27/144-12)/(6/(-8)) 3 What is the value of ((-1)/((-1)/(-4)))/((-32)/32)? 4 Calculate ((-3)/(-14))/((-261)/348). -2/7 ((-54)/(-36))/((-1)/(-2)) 3 Calculate (3(-6)/18)/5. -1/5 What is the value of (26/(-39))/((-1)/9)? 6 (-2)/((1/4)/((-5)/(-40))) -1 (-2)/13(-5)/(-30) -1 What is the value of 4/(2/(-1))(-1)/11? 2/11 (-2)/4-7(-96)/(-112) 3 Evaluate 10/(-15)(-12)/(-8). -1 What is the value of 4/(-12)3/2? -1/2 Evaluate 18/(-60)(-1)/((-9)/(-12)). 2/5 Evaluate (7/((-35)/10))/2. -1 Evaluate (35/15)/((-91)/(-156)). 4 Evaluate (-12)/(-180)(-10)/(-3). 2/9 What is (-18)/(-21)((-32)/12)/4? -4/7 What is the value of (-1)/((2/(-1))/12)? 6 6/(-12)-10 0 What is ((-2)/(-3))/((32/(-18))/(-2))? 3/4 Evaluate (-24)/41(-4)/4. 6 What is (-9)/((-54)/8)-3? -4 What is the value of 14(-4)/88? -2/11 Evaluate (-4)/1415/10. -3/7 Calculate 4/((-14)/(-63)9). 2 0/((-5)/2(-24)/20) 0 2(3/(-9))/(-1) 2/3 ((-9)/15)/(12/(-80)) 4 What is 2/3(-12)/(-4)? 2 Calculate (1/12)/(428/107). 1/2 What is ((-456)/(-342))/(4/18)? 6 4/40/2 0 What is (-5)/((1265/(-66))/(-23))? -6 0/((2/(-5))/(3/15)) 0 What is the value of 7/(-9)(-200)/700? 2/9 What is ((-4)/(-16))/(1/(-6))? -3/2 What is the value of ((-6)/(-10))/((-42)/(-30))? 3/7 What is the value of -1(-17)/(85/50)? 10 ((-455)/364)/(9/(-6)) 5/6 Evaluate 5/3(96/60)/(-8). -1/3 What is the value of 217/62(-10)/(-7)? 5 Calculate 36/(-198)(-11)/4. 1/2 What is ((-2)/6)/(3/45)-1? 5 Calculate ((-10)/(-150))/(((-27)/30)/3). -2/9 What is the value of 190/(-665)(-14)/30? 2/15 ((-12)/(6/(-2)))/(304/(-8)) -2/19 What is (-10)/28(-144)/(-90)? -4/7 What is 50/(-15)6/5? -4 What is the value of ((-299)/115)/(-13)(-20)/(-42)? 2/21 ((-40)/(-104))/(-5)2 -2/13 Calculate 36/(-6)(15/(-18))/5. 1 What is 5/5-5(-2)/2? 5 Calculate ((-24)/9)/((-20)/30). 4 Evaluate (14/42-1)/(14/(-12)). 2/7 80/10(-2)/(-56) 2/7 Calculate -1(1/(-2))/(6/(-12)). -1 3/(-1)(150/18)/(-5) 5 What is the value of ((-9)/(198/(-8)))/(-2)? -2/11 Evaluate 2(-3)/18810/45. -6 Calculate 8/(-6)37/(-222). 2/9 What is the value of ((-6)/((-108)/6))/(52/12)? 1/13 What is the value of ((-112)/(-70))/(4/10)? 4 What is (22/(-44))/((-2)/4)? 1 What is 3((-1)/(-3))/(16/48)? 3 What is 4/821? 1 Calculate 48/602/8. 1/5 What is the value of (77/42)/112? 1/3 Calculate ((-12)/(-30))/1-1. -2/5 What is (12/(-2))/(90/(-12))? 4/5 What is the value of 1(-3)/(-18)72/4? 3 What is the value of (-40)/(-90)9/(-2)? -2 Calculate (2/2)/(10/(-80)-8). 1 What is (-2)/(-4)-4(-1)/(-2)? -1 What is ((-3)/(-5))/(23/115)? 3 Calculate 2/(20/909). 1 Evaluate ((-9)/6)/((-33)/(-4)). -2/11 What is the value of (2/24)/((54/(-4))/27)? -1/6 Evaluate (8/4)/24-9. -3/4 Evaluate (6/(-4))/((-8)/((-64)/6)). -2 (32/60)/((-4)/24) -3/5 What is the value of 2/(-40)6(-2)/(-1)? -3/5 (10/(-9))/(340/765) -5/2 What is ((-230)/69)/(40/(-12))? 1 What is the value of (-8)/33/(-2)? 4 Calculate ((-8)/40)/(18/(-135)). 3/2 Evaluate 1(3/(-45))/((-5)/(-30)). -2/5 Evaluate 20/4(-5)/((-50)/(-4)). -2 Calculate -8(-12)/1201/(-4). -1/5 Evaluate 3/((-3)/12(-16)/(-8)). -6 Evaluate (-3)/(-423/(-12)). -2/7 ((-10)/5)/(65/75) -5 What is the value of (-9)/(-2)(56/(-3))/14? -6 Evaluate ((-1)/1)/((-114)/(-76)). -2/3 ((8/(-2))/4)/(3/3) -1 ((-8)/4)/(1-2) 1 (5/(50/4))/(4/(-20)) -2 Calculate 2((-12)/(-1))/6. 4 What is (4/(4/(-1)))/((-6)/(-6))? -1 Evaluate (6/(-44))/(412/64). -2/11 Evaluate (44/(-77))/(6/21). -2 Calculate 2/(-2)8/20-1. 2/5 Calculate (-3)/(189/24)6/(-24). 2/21 Evaluate (((-6)/26)/3)/(10/(-20)). 2/13 What is the value of (5/9)/((-30)/36)? -2/3 What is the value of (-2)/(((-2)/(-14))/((-17)/(-34)))? -7 (38/(-57))/((-34)/(-6)) -2/17 28/(-63)(-81)/6 6 What is the value of -2(1/(-2))/(32/64)? 2 What is the value of (2/(-4))/(5/(-2))? 1/5 Evaluate 4/(-3)(-7)/(14/(-6)). -4 Calculate (12/9)/((-5)/(-6)4). 2/5 What is the value of ((-96)/(-128))/((-6)/40)? -5 What is the value of 2/(((-44)/6)/11)? -3 Evaluate 4-11/4. -1 (130/104)/(-2(-2)/16) 5 What is the value of (1/1)/(325/130)? 2/5 Calculate 4/2(-6)/(-30). 2/5 Evaluate 270/(-144)4/(-10). 3/4 Evaluate (-192)/(-360)5/(-4)-2. 4/3 Calculate (-2)/96(-3)/6. 2/3 What is the value of (((-8)/6)/1)/((-13)/(-39))? -4 What is the value of ((-1)/(1/3))/((-12)/20)? 5 Evaluate (8/44)/((-15)/165). -2 What is the value of (-1)/((-1)/(-5)160/224)? -7 What is the value of (4/2)/(-12)144/(-96)? 1/4 What is the value of (-8)/25(-915)/366? 4/5 2/24(-2)/4 -2 Evaluate (-6)/226/(-48). 3/4 (2/10)/((-197)/(-788)) 4/5 What is the value of 2/4-12(-12)/(-36)? -2 Calculate (16/(-28))/(6/(-14)1). 4/3 Evaluate (-1)/(-3)156/(-338). -2/13 (15/15)/(7/(-70)) -10 (3/2)/(1(-6)/(-16)) 4 What is ((-6)/72-4)/((-17)/561)? -11 Calculate (-8)/(-12)54/(-48). -3/4 (75/(-120))/(20/(-12)) 3/8 What is (12/140-7)/((-2)/(-10))? -3 10-153/30 -5 (11/1)/(7/2) 2/7 What is the value of -3(1/(-6))/((-77)/(-154))? 1 -14(-8)/256(-42)/(-49) 3/8 What is the value of ((-16)/(-120))/((-64)/80)? -1/6 (4/9)/(26/(-39)) -2/3 Calculate ((-27)/18)/(32/12). -3 What is 3/(-36)-34-1? -1 (-5)/2(-2)/15 1/3 What is ((-5)/(-30))/(4/(-9))? -3/8 What is (12(-2)/(-16))/(3/(-6))? -3 (1/3)/(113/(-3051)) -9 What is the value of 1/((10/15)/(-2))? -3 (8/5)/((-74)/(-185)) 4 What is (-33)/224/(-18)-21? -7 18/273/(-18)-2 2/9 8((-3)/(-54))/(12/36) 4/3 Evaluate -18/32(-80)/(-25). -4/5 What is the value of ((-45)/(-4))/360/25? 9 Calculate 1/((-6)/(20/10)). -1/3 -103/(-15)1/(-8) -1/4 Calculate -8(-16)/(-32)1/(-1). 4 What is 39/(-162)2? -1/3 Evaluate (((-12)/(-9))/4)/(4/(-9)). -3/4 What is the value of ((-2)/(-6))/((32/24)/4)? 1 (35/(-700))/(2/(-8)) 1/5 What is the value of (8/((-896)/40))/(-51)? 1/14 Evaluate -3(-5)/304/(-2). -1 Calculate (-220)/(-60)(-3)/(-33). 1/3 What is the value of ((-72)/9)/160? 0 What is the value of (-4)/(-5)13/26? 2/5 What is (-3(-6)/378)/((-5)/(-30))? 2/7 What is the value of (1/10)/((-18)/135)? -3/4 What is the value of ((-3)/(-8))/((-27)/(-12))? 1/6 What is the value of (4/((-120)/(-3)))/((-6)/(-10))? 1/6 What is the value of ((1-24)/(-4))/(20/(-10))? -3 Evaluate (44/440/(-2))/(-1). 0 Calculate 66/99(-3)/14. -1/7 What is the value of (((-16)/3)/8)/((-5)/30)? 4 ((-7)/350)/5 0 What is ((-2)/(-45))/(1/(-3))? -2/15 Evaluate ((-164)/410)/(((-18)/10)/3). 2/3 Calculate 2/7(-3)/(-6). 1/7 What is the value of 3/((-12)/(-8))7/(-49)? -2/7 (52/(-312))/((-1)/(-33)) -11/2 What is 34/(-170)5/(-2)-10? -5 1/(-1(-2)/4) 2 (-1)/(-1)110/10 1 What is -31/364? -1/3 Evaluate 1/(11/((-1)/3)). -1/3 What is (-3)/(9/2)(-42)/7? 4 What is the value of ((-6)/180-6)/(3/(-45))? -3 Calculate ((-1)/(-3))/((-9)/(-9)1). 1/3 What is ((-4)/90)/(29/145)? -2/9 Calculate (-1)/(10/((-18)/(-9))). -1/5 Calculate (16/120)/((4/(-6))/(-1)). 1/5 Evaluate (((-4)/2)/(-10)5)/(-1). -1 What is the value of 6(-2)/5418/(-2)? 2 Calculate 21/144/(-3). -2 Evaluate 296/74(-10)/8. -5 Calculate 9/(-6)(490/15)/(-7). 7 Calculate 54/(-22)1. -5 Calculate 2(-4)/((-16)/4)*-1. -2 What is the val	{ "pile_set_name": "DM Mathematics" }
f 1/2, to the nearest integer? 14 What is the fifth root of 2463 to the nearest integer? 5 What is the third root of 1488 to the nearest integer? 11 What is the cube root of 5389 to the nearest integer? 18 What is 72878 to the power of 1/6, to the nearest integer? 6 What is the fifth root of 42041 to the nearest integer? 8 What is 414 to the power of 1/2, to the nearest integer? 20 What is the seventh root of 13368 to the nearest integer? 4 What is 46515 to the power of 1/3, to the nearest integer? 36 What is the square root of 10559 to the nearest integer? 103 What is the square root of 162 to the nearest integer? 13 What is the cube root of 8982 to the nearest integer? 21 What is 2888 to the power of 1/3, to the nearest integer? 14 What is the sixth root of 598 to the nearest integer? 3 What is 15142 to the power of 1/7, to the nearest integer? 4 What is 20524 to the power of 1/3, to the nearest integer? 27 What is the third root of 443 to the nearest integer? 8 What is 145007 to the power of 1/3, to the nearest integer? 53 What is the third root of 578 to the nearest integer? 8 What is the cube root of 1347 to the nearest integer? 11 What is 7742 to the power of 1/5, to the nearest integer? 6 What is 2040 to the power of 1/5, to the nearest integer? 5 What is the square root of 5416 to the nearest integer? 74 What is 50032 to the power of 1/4, to the nearest integer? 15 What is 129910 to the power of 1/2, to the nearest integer? 360 What is the tenth root of 2243 to the nearest integer? 2 What is 24654 to the power of 1/3, to the nearest integer? 29 What is the sixth root of 942 to the nearest integer? 3 What is the fourth root of 1293 to the nearest integer? 6 What is 957 to the power of 1/3, to the nearest integer? 10 What is 1920 to the power of 1/2, to the nearest integer? 44 What is the third root of 48059 to the nearest integer? 36 What is 43570 to the power of 1/2, to the nearest integer? 209 What is the third root of 1029 to the nearest integer? 10 What is the square root of 19064 to the nearest integer? 138 What is 7265 to the power of 1/4, to the nearest integer? 9 What is the fifth root of 951 to the nearest integer? 4 What is the cube root of 115770 to the nearest integer? 49 What is the fifth root of 2774 to the nearest integer? 5 What is the square root of 46780 to the nearest integer? 216 What is the third root of 4218 to the nearest integer? 16 What is the square root of 47 to the nearest integer? 7 What is the square root of 1407 to the nearest integer? 38 What is the fifth root of 585 to the nearest integer? 4 What is the square root of 281 to the nearest integer? 17 What is the third root of 19455 to the nearest integer? 27 What is the cube root of 156 to the nearest integer? 5 What is the cube root of 563 to the nearest integer? 8 What is 15572 to the power of 1/3, to the nearest integer? 25 What is the fifth root of 280 to the nearest integer? 3 What is 37402 to the power of 1/6, to the nearest integer? 6 What is 1363 to the power of 1/4, to the nearest integer? 6 What is 687 to the power of 1/2, to the nearest integer? 26 What is the cube root of 1365 to the nearest integer? 11 What is 54822 to the power of 1/9, to the nearest integer? 3 What is the third root of 14650 to the nearest integer? 24 What is 631 to the power of 1/5, to the nearest integer? 4 What is the ninth root of 443 to the nearest integer? 2 What is the cube root of 154551 to the nearest integer? 54 What is the fifth root of 19831 to the nearest integer? 7 What is the square root of 7761 to the nearest integer? 88 What is the fifth root of 7937 to the nearest integer? 6 What is the square root of 36256 to the nearest integer? 190 What is the ninth root of 17422 to the nearest integer? 3 What is 4947 to the power of 1/3, to the nearest integer? 17 What is 18969 to the power of 1/2, to the nearest integer? 138 What is the third root of 2201 to the nearest integer? 13 What is the fifth root of 102954 to the nearest integer? 10 What is the square root of 8682 to the nearest integer? 93 What is 1700 to the power of 1/9, to the nearest integer? 2 What is 2105 to the power of 1/5, to the nearest integer? 5 What is the square root of 7277 to the nearest integer? 85 What is the third root of 2397 to the nearest integer? 13 What is the third root of 41656 to the nearest integer? 35 What is 14158 to the power of 1/3, to the nearest integer? 24 What is the fifth root of 21061 to the nearest integer? 7 What is the third root of 25692 to the nearest integer? 30 What is the square root of 3062 to the nearest integer? 55 What is the seventh root of 12185 to the nearest integer? 4 What is the square root of 18823 to the nearest integer? 137 What is 2052 to the power of 1/3, to the nearest integer? 13 What is the fifth root of 95449 to the nearest integer? 10 What is 435 to the power of 1/2, to the nearest integer? 21 What is the cube root of 1222 to the nearest integer? 11 What is the tenth root of 1873 to the nearest integer? 2 What is the fourth root of 11402 to the nearest integer? 10 What is 11668 to the power of 1/2, to the nearest integer? 108 What is the square root of 5676 to the nearest integer? 75 What is the eighth root of 3540 to the nearest integer? 3 What is 18837 to the power of 1/2, to the nearest integer? 137 What is the square root of 3760 to the nearest integer? 61 What is the sixth root of 4028 to the nearest integer? 4 What is the third root of 289 to the nearest integer? 7 What is the cube root of 4696 to the nearest integer? 17 What is 29372 to the power of 1/3, to the nearest integer? 31 What is the eighth root of 42504 to the nearest integer? 4 What is the cube root of 1970 to the nearest integer? 13 What is the seventh root of 10411 to the nearest integer? 4 What is 11113 to the power of 1/5, to the nearest integer? 6 What is 4507 to the power of 1/4, to the nearest integer? 8 What is the cube root of 2317 to the nearest integer? 13 What is 454 to the power of 1/3, to the nearest integer? 8 What is 1212 to the power of 1/10, to the nearest integer? 2 What is the square root of 47865 to the nearest integer? 219 What is 4013 to the power of 1/2, to the nearest integer? 63 What is 1253 to the power of 1/2, to the nearest integer? 35 What is 9810 to the power of 1/3, to the nearest integer? 21 What is the square root of 111 to the nearest integer? 11 What is the cube root of 886 to the nearest integer? 10 What is the tenth root of 2483 to the nearest integer? 2 What is 269 to the power of 1/3, to the nearest integer? 6 What is 15758 to the power of 1/8, to the nearest integer? 3 What is the third root of 883 to the nearest integer? 10 What is 7420 to the power of 1/10, to the nearest integer? 2 What is the third root of 2418 to the nearest integer? 13 What is the third root of 1089 to the nearest integer? 10 What is the square root of 107824 to the nearest integer? 328 What is the third root of 15048 to the nearest integer? 25 What is the square root of 47130 to the nearest integer? 217 What is 1922 to the power of 1/10, to the nearest integer? 2 What is 1488 to the power of 1/4, to the nearest integer? 6 What is 30311 to the power of 1/3, to the nearest integer? 31 What is the third root of 38110 to the nearest integer? 34 What is the eighth root of 3512 to the nearest integer? 3 What is 30042 to the power of 1/6, to the nearest integer? 6 What is 292 to the power of 1/2, to the nearest integer? 17 What is the third root of 121530 to the nearest integer? 50 What is the third root of 6919 to the nearest integer? 19 What is the cube root of 2821 to the nearest integer? 14 What is 1210 to the power of 1/3, to the nearest integer? 11 What is the third root of 75622 to the nearest integer? 42 What is the eighth root of 18852 to the nearest integer? 3 What is 47419 to the power of 1/5, to the nearest integer? 9 What is the square root of 244 to the nearest integer? 16 What is the tenth root of 4109 to the nearest integer? 2 What is the eighth root of 2729 to the nearest integer? 3 What is 26864 to the power of 1/3, to the nearest integer? 30 What is the square root of 1452 to the nearest integer? 38 What is the square root of 43802 to the nearest	{ "pile_set_name": "DM Mathematics" }
the third derivative of 0h + 0h*3 + 0h*4 + 1/30h*n - 10h*2 + 0. What is c(w(t))? 8t*4 Let p(u) = -46u + 167u - 48u - 42u - 42u. Let n(o) = 14o. What is n(p(q))? -154q Let n(q) be the third derivative of q5/30 - q2 + 21. Let x(m) = -m - 1. Let t(h) = -49h - 42. Let d(w) = -t(w) + 42x(w). What is d(n(p))? 14p2 Let f(x) = -154x. Let d(u) = 41u. Calculate d(f(m)). -6314m Let v(c) = 4c2. Let g = -132 - -398/3. Let t(o) be the first derivative of -2 + 0o + 0o2 + go*3. Determine t(v(p)). 32p*4 Let c(k) = -2k. Let w(n) = 108n2 + 1827. Calculate w(c(z)). 432z*2 + 1827 Suppose -c + 3y = 0, 57 = 4c + y + 18. Let b(a) = ca*2 + 9a*2 + 6a*2 - 25a*2. Let g(l) = 2l - 9. Give b(g(f)). -4f2 + 36f - 81 Let i(f) = 1181f2 - 3 + 1 + 2 - 1071f*2. Let d(z) = 4z. What is i(d(w))? 1760w2 Let z(c) = -598c*2. Let s(y) = -11y*2 - 26y. Give s(z(m)). -3933644m4 + 15548m2 Let w(f) be the second derivative of f6/180 - f*4/4 - 2f. Let o(v) be the third derivative of w(v). Let y(t) = -4t + t + 5t. What is y(o(x))? 8x Let l(g) = -3g. Let p(h) = 18h2 + 7h + 61. Let y(s) = -8s2 - 3s - 30. Let i(f) = -3p(f) - 7y(f). Give l(i(a)). -6a2 - 81 Let s(z) = z2 + z. Let r(c) = -15926c*2. Calculate s(r(k)). 253637476k*4 - 15926k*2 Let a(u) = -26u + 23u + 12u. Let d(v) = -v*2 - 6v*2 + 2v*2 - 4v*2. Calculate a(d(l)). -81l*2 Let g(s) = -1 + 1 + 32s. Let f(b) = -296374b + 296374b - 3b2. Give g(f(h)). -96h*2 Let w(b) = 20b. Let g(i) = -12i + i + 6i + 3i. Calculate g(w(k)). -40k Let m(p) = 2p - 16. Let x(v) = 11v - 32v + 19v. Determine m(x(f)). -4f - 16 Let h(o) be the first derivative of -49o*2/2 + 4o + 295. Let t(m) = -2m2. Calculate h(t(u)). 98u*2 + 4 Let z(c) = 3c + 109. Let y(p) = 66p. What is z(y(r))? 198r + 109 Let p(k) = 8k. Let b(o) = -6o + 9. Let s(r) = -r - 1. Let j(x) = -b(x) - 9s(x). Calculate j(p(z)). 120z Let v(x) be the first derivative of 3/4x4 + 0x*2 + 4 - 9x + 0x3. Let q(u) be the first derivative of v(u). Let a(g) = 2g. Give q(a(c)). 36c2 Let t(n) = -2n. Let i = -450 - -452. Let p(o) be the third derivative of 0 + o*i + 1/12o*4 + 0o + 0o3. Determine p(t(a)). -4a Let a(n) = 478023n2. Let f(y) = -2y*2. What is f(a(l))? -457011977058l*4 Let r(b) = 10b. Let s(i) = 170i. Let w(h) = 35r(h) - 2s(h). Suppose g = -3u + 29, -2g + 5u = -3g + 37. Let z(v) = -9v - 9v + gv. Determine z(w(l)). -10l Let z(y) = -31y. Let s(i) = -13983i2. What is s(z(g))? -13437663g*2 Let p(v) = 2v*2. Suppose 2t = -4j + 788, -2j = j - 3t - 573. Suppose 0 = 2f + f - j. Let k(r) = 65 - r*2 - f. Give p(k(x)). 2x*4 Let w(x) = -880x - 143. Let n(p) = 37p + 6. Let r(i) = 143n(i) + 6w(i). Let k(o) = -6o - 4. Give r(k(z)). -66z - 44 Let f(p) = -2265p. Let l(n) = -9n2. Determine l(f(x)). -46172025x*2 Let o(n) = 20n + 30n - 4n*2 - 112n + 26n + 27n. Let j(w) = -2w. Determine j(o(g)). 8g*2 + 18g Let j(k) be the first derivative of 0k + 1/3k*3 - 7 + 0k*2. Let m(c) = -2c. Give m(j(x)). -2x2 Let y(h) = 169h + 42. Let x(s) = -23s. What is y(x(v))? -3887v + 42 Let w(p) be the third derivative of -p*5/15 - 13p*3/6 - 8p*2 - 8p. Let k(s) = s*2. Give w(k(h)). -4h*4 - 13 Let h(b) = 28b*2 - 11b - 474. Let i(r) = -10r2 + 4r + 158. Let g(y) = 4h(y) + 11i(y). Let a(j) = 2j2. Give a(g(k)). 8k*4 - 1264k*2 + 49928 Let f(q) = -10q + 14. Let s(p) = -2p + 3. Let i = 42 + -56. Let y(t) = is(t) + 3f(t). Let u(a) = 13a*2. Give y(u(l)). -26l*2 Let z(t) = -400t. Let y(n) = 1058n2 - 3. What is z(y(a))? -423200a*2 + 1200 Suppose u + 3u + 24 = 0. Let i(c) = 15c2 - 13c + 13. Let f(h) = 7h2 - 6h + 6. Let o(k) = ui(k) + 13f(k). Let q(r) = -r2. Give o(q(d)). d4 Let z(t) = 2t2. Let k(d) be the second derivative of -d5/30 - 4d*3/3 + 11d. Let r(x) be the second derivative of k(x). Calculate z(r(i)). 32i2 Let b(r) = r + 12r + 11r + 3r*2. Let l(c) = c. Give b(l(s)). 3s*2 + 24s Let y(g) be the first derivative of -2g3/3 + 6. Let h(l) = 9l + 8l - 29l + 11l. Determine y(h(u)). -2u*2 Let z(n) = -20n - 47. Let j(q) = 9q + 20. Let u(b) = -9j(b) - 4z(b). Let s(m) = -4m*2. Give u(s(r)). 4r*2 + 8 Let y(k) = -3 + 3 + 11k*2. Let i(d) = 3d*2 + 0d2 + d2 - 2d2. Calculate i(y(w)). 242w*4 Let x(q) = 4q*2 - 2q - 2. Let t = 3 + 1. Let a(n) = n*2 - n - 1. Let c(u) = ta(u) - 2x(u). Let i(s) = 626 - 626 - s. Determine c(i(p)). -4p*2 Let u(y) = 4y. Let n(k) be the third derivative of k*8/20160 + 7k*5/30 - 8k*2. Let r(m) be the third derivative of n(m). Calculate u(r(v)). 4v*2 Let p = 5 + -3. Suppose -g + 1 = 2a, 3a + g + 1 = 2. Let w(i) = 2i - pi - 2i*2 + ai. Let r(l) = -4l2. Give r(w(k)). -16k*4 Let u(w) = -1395w - 1. Let q(o) = -67o - 2. What is q(u(v))? 93465v + 65 Let a(y) = -6y. Let l(m) = -7m + 49. Let z(r) = 6r - 48. Let o(d) = -5l(d) - 6z(d). Give a(o(b)). 6b - 258 Let q(v) = -v - 2197 + 2197. Let a(p) = 18p + 20. Give a(q(t)). -18t + 20 Let m(j) = 8j + 6. Let b(x) = 66x. What is b(m(r))? 528r + 396 Let k(d) be the third derivative of 2d*7/315 + 13d*5/60 - 10d2. Let v(m) be the third derivative of k(m). Let u(g) = -g2. What is v(u(o))? -32o2 Let u(g) be the first derivative of -5g*3 + 94. Let k(i) = i. Determine u(k(d)). -15d*2 Let w(d) = 2d + 287. Let y(n) be the third derivative of -n*5/30 + 57n*2. Determine y(w(o)). -8o*2 - 2296o - 164738 Let p(o) = 1062o + 306. Let m(r) = -14r - 4. Let x(u) = 459m(u) + 6p(u). Let c(g) = -g*2. What is x(c(z))? 54z*2 Let o(s) = -3s. Suppose 8x = 2x. Let z(i) = i*2 + xi*2 - 5i*2 + 17i*2. Determine o(z(g)). -39g*2 Let b(g) = 1920g*2. Let z(a) = -3a*2 + 6a + 4. Let h(c) = -10c2 + 21c + 14. Let i(w) = -2h(w) + 7z(w). What is i(b(o))? -3686400o4 Let q(i) = -949i. Let m(r) = -60r2. Give m(q(t)). -54036060t2 Let s(c) = -c2 - 14c. Let n(f) = 1. Let k(i) = 2i + 3. Let o(t) = k(t) - 3n(t). Give o(s(j)). -2j*2 - 28j Let p(a) = -4090a. Let z(o) = -4o*2. Determine p(z(q)). 16360q*2 Let v(x) = 39754x*2 + 4x. Let i(a) = -2a. Determine i(v(q)). -79508q*2 - 8q Let h = -463 - -466. Let b(p) be the third derivative of 0 + 0p - 1/24p*4 - hp*2 + 0p*3. Let w(n) = -n. What is b(w(d))? d Let a(b) = 7b - 2 + 2. Let o(i) = 5i2 - 188 + 157 + 31. Calculate o(a(x)). 245x*2 Let f(j) = -9j*2 - 2j*2 + 4j*2 - 3j*2. Let h(a) = 10a. Let n(o) = -3o. Let m(i) = -2h(i) - 7n(i). What is f(m(r))? -10r*2 Let s(j) = 13j. Let m(v) = -v*2 - v. Let l(u) be the second derivative of 5u4/12 + u3/2 - 8u. Let z(c) = -l(c) - 3m(c). Determine z(s(g)). -338g2 Let h(i) = i. Let g(s) be the third derivative of -2s*5/3 + 2s*3/3 - 189s*2. Give h(g(l)). -40l*2 + 4 Let o(a) = -3a*2 + 2218a. Let p(r) = -r. Calculate p(o(s)). 3s2 - 2218s Let k(t) = -t. Let d(o) be the first derivative of 2 - 7/2o2 + 0o. Determine d(k(j)). 7j Let h(i) = -15i. Let a(w) be the first derivative of -12w2 - 130. Give h(a(p)). 360p Suppose 3v + 24 = 5h - 2h, -v - 12 = -2h. Let x(f) = hf - f - 6f. Let u(n) = -3n. Determine x(u(b)). 9b Let k(q) = -12q2. Suppose 40 = 4r - 4j, -6r = -r + 5j - 30. Let b(f) = 2f*2 - 12f + 6. Let s be b(6). Let y(v) = -s + r - v - 2. Give y(k(h)). 12h2 Let v(p) = -12p. Let o(x) = -56x2 - 68x. Let j(i) = -5i2 - 6i. Let u(d) = 68j(d) - 6o(d). Give v(u(w)). 48w2 Let k(s) be the second derivative of 7s*4/12 + 25s*2/2 + 314s. Let t(i) = -2i2. Determine t(k(j)). -98j*4 - 700j2 - 1250 Let r(w) be the first derivative of w6/120 - 2w3/3 - 8. Let g(n) be the third derivative of r(n). Let m(c) = 8c*2. What is g(m(j))? 192j*4 Let a(c) = 3c*2 + 8c + 8. Let d be a(-6). Let r(v) = -v*2 + 2v*2 - d + 68. Let n(y) = -55y*2. Calculate r(n(x)). 3025x4 Let s(x) be the first derivative of x2/2 - 7x + 76. Let v(d) = -9d*2. Determine v(s(l)). -9l*2 + 126l - 441 Let f(g) = -1025g2. Let j(q) = 1376q*2. Determine f(j(b)). -1940710400b*4 Let j(v) be the third derivative of 2/5v*5 + 0 + 0v + 0v*3 - 44	{ "pile_set_name": "DM Mathematics" }
inder when (-76)/(-18) + (-2)/l is divided by 2. 0 Let j = -17 + 32. Let t(p) = p*2 - 2p + 1. Let y be t(11). Suppose -y = -2d + 12. Calculate the remainder when d is divided by j. 11 What is the remainder when ((-78)/(-4))/(60/80) is divided by 8? 2 What is the remainder when (-28)/(-16) - (-6760)/32 is divided by 116? 97 Suppose 18 = -0g + 2g. Calculate the remainder when (-1764)/(-52) - (-16)/208 is divided by g. 7 Suppose 25 = 4d - 31. What is the remainder when (46/(-8))/(3/(-36)) is divided by d? 13 Suppose 8f - k - k - 9006 = 0, 5f - 5615 = 4k. Calculate the remainder when f is divided by 24. 23 What is the remainder when 10 + 54396/18 is divided by 32? 31 Suppose 3201 = -26x + 9987. What is the remainder when x is divided by 24? 21 Suppose 291u = 294u - 246. What is the remainder when 316 is divided by u? 70 Calculate the remainder when -543/(-12)16/24 is divided by 7. 2 Let k be ((-2)/6)/(5/(-30)). Let f be 1 - (65 + (-4)/k). Let j = -38 - f. Calculate the remainder when j is divided by 9. 6 Suppose 253 = l + 3w, -2w - 998 = 2l - 6l. What is the remainder when l is divided by -7 + 29 - (-1)/1? 20 Suppose -3g + 44 = -g. Suppose 5c - 7 = 3. Suppose -207 = -5i - 0i + cj, -2i = 5j - 77. What is the remainder when i is divided by g? 19 Suppose -4125 + 1428 = -31o. What is the remainder when o is divided by 10? 7 Let r be (-2 - -1)/(4 + -5). Suppose j = -r + 5. Calculate the remainder when j is divided by 2. 0 Let d(o) = -o3 + 4o*2 + 7o - 4. Let x be d(5). Suppose -5q = -4j + 41, q = -3j - x + 13. Calculate the remainder when 4 is divided by j. 0 Suppose 0 = -58f + 53f + 85. Calculate the remainder when 236 is divided by f. 15 Let f be 215/20 - 6 - (-1)/4. Suppose -d + fo = -111, d - 91 = o + 28. What is the remainder when d is divided by 30 - -21/2? 28 Let t be (-1 + 2 - 2 - 0) + 58. Let k = t - 49. What is the remainder when 21 is divided by k? 5 Let r be 0/(-5) - 1-3. Suppose 3c - 6 = rj, 5 = -j + 2j. Calculate the remainder when 12 is divided by c. 5 Suppose 5x = -2w + 4w - 2, 0 = -3w - 2x + 22. Let k(d) = -1 - 23 + 3 + 8d. Calculate the remainder when k(6) is divided by w. 3 Let m(g) = -g3 + 25g*2 - 3g + 83. What is the remainder when 67 is divided by m(25)? 3 Suppose -3b - 5w = -3w - 271, 0 = 4b - 2w - 352. Suppose 2f + 2f = 92. Calculate the remainder when b is divided by f. 20 Let y be (-6)/(-8) + (-15)/(-12). Suppose -u - 4 = -y. What is the remainder when u/7 - 233/(-7) is divided by 12? 9 Let l = 861 + -789. Calculate the remainder when 574 is divided by l. 70 Let k = 12622 + -12527. What is the remainder when k is divided by ((-2)/(-3))/((-1)/(-48))? 31 Let l(f) = f3 + 14f*2 - 3f - 35. Let d be l(-14). Suppose 0 = da - 20a + 312. Calculate the remainder when 94 is divided by a. 22 Let t = 2 + 18. Suppose 2z + 8z + 506 = 1896. What is the remainder when z is divided by t? 19 Suppose -3x + 553 = 38w - 43w, 3x - 562 = -4w. Calculate the remainder when x is divided by 64. 58 Let q(l) = l3 + 11l*2 - 16l - 12. Let p(z) = -z*2 + 7z + 6. Let t be p(9). Calculate the remainder when q(t) is divided by 14. 8 Let d be (-201)/12 - 5/20 - -3. Let l(i) = -i*2 - 15i - 6. What is the remainder when l(d) is divided by 5? 3 What is the remainder when 163 is divided by (36 - -19)(-1)/(-5)? 9 Suppose 0 = -d - 58 - 102. Let u = -147 - d. Let q = -43 + 81. Calculate the remainder when q is divided by u. 12 Let n(s) = s3 - 7s*2 - 8s + 16. Let d(i) = 9i - 4. What is the remainder when d(7) is divided by n(8)? 11 Suppose -9i + 25 + 74 = 0. Suppose a - 3 = i. What is the remainder when a is divided by 8? 6 Let l be (20 - -1) + 3 + -3. Calculate the remainder when 31 is divided by 245/l + 2/6. 7 Suppose -5j + 3v + 422 = 0, -8v = 5j - 6v - 427. Calculate the remainder when j is divided by 75. 10 Suppose 3m - 3u = 7m - 505, 4m = 4u + 484. Let s be -1m/8-2. Suppose 2 = 3b - s. What is the remainder when 21 is divided by b? 10 Let z(i) = -15i - 133. Calculate the remainder when 308 is divided by z(-13). 60 Suppose -5p + 54 = -4n - 35, p = -n + 25. Suppose -5j - p = b, -4b + 1 - 9 = j. Calculate the remainder when 26 is divided by (-2)/j-2 - -8. 5 Suppose -4r - 2g = -18, 2g = -r - g + 7. Suppose ra = -v - 0a + 39, 5v - 5a = 95. Suppose y - 267 = -2y. Calculate the remainder when y is divided by v. 20 Let t be 70((-6)/8 - 10/(-8)). Suppose -5q - 2k + 107 = 0, -3q + t + 24 = -4k. Calculate the remainder when q is divided by 9. 3 Suppose -196 + 556 = 15i. What is the remainder when 90 is divided by i? 18 Suppose 4d + 56 - 68 = 0. Suppose dh = 2h + 4n + 146, 2h - 2n - 274 = 0. What is the remainder when h is divided by 34? 32 Let v = -860 - -876. Calculate the remainder when 287 is divided by v. 15 Let p = -323 + 383. Calculate the remainder when p is divided by 7. 4 Let j(y) = -2y*3 + 64y*2 + 3y - 20. Calculate the remainder when j(32) is divided by 16. 12 Let v = 0 + 521. What is the remainder when v is divided by 75? 71 Suppose -7f = -3f - 8, -2b = -4f + 2. Suppose 3 + 0 = bl. What is the remainder when 1 + (4/1)/l is divided by 4? 1 Suppose 0 = -3u + 5d + 20, 4d + 42 = -4u + 9u. Calculate the remainder when 29 is divided by u. 9 Suppose 2r - 7r - 4j = -16, 2j = -3r + 10. Suppose 2g = -3b - 3g + 128, -5g + 164 = rb. What is the remainder when 106 is divided by b? 34 Let y(g) = 3g + 47. Let a be y(-15). Suppose x - 4 = 0, -3o + 4x + 17 = -138. Calculate the remainder when o is divided by (8 + -2)/a + 24 - -2. 28 Suppose -36c = 107c - 90233. Calculate the remainder when c is divided by 161. 148 Let r = 334 - 274. What is the remainder when r is divided by 16? 12 Let u = 93 - 67. What is the remainder when 335 is divided by u? 23 Let g = -1386 - -1411. Calculate the remainder when 271 is divided by g. 21 Let i(o) = -o + 39. Calculate the remainder when i(26) is divided by 4 + (-2 - 1) + 2. 1 Suppose -27v - 5b = -22v - 2150, v = -2b + 429. What is the remainder when v is divided by 20? 11 Suppose 0 = -4l - 3l + 742. Suppose 0 = g + o - 13, 4o - l + 43 = -5g. Calculate the remainder when g is divided by 4. 3 Let a = -15319 + 15322. Suppose k + 1 = 0, z - k - 7 = -0z. Calculate the remainder when z is divided by a. 0 Let i(y) be the first derivative of y*4/4 + 10y3/3 - y2 - 15y + 15. What is the remainder when i(-10) is divided by 3? 2 Suppose -2w - b = -160, -b - 152 = -2w + 2b. Suppose -21 = -5d + w. What is the remainder when 38 is divided by d? 18 Let n be (-4)/(-2)18/12. Suppose 15 = 2c + nc. What is the remainder when 211(-2 + c) is divided by 8? 5 Let g = -9 - -16. Let c(s) = 3s2 - 29s - 32. Calculate the remainder when c(11) is divided by g. 5 Suppose 3d = 22 + 44. Suppose -5f + 5 = -10f, 86 = 3m + 4f. What is the remainder when m is divided by d? 8 Let y = -24 - -36. Suppose 97 = 15l - 8. What is the remainder when y is divided by l? 5 Suppose 0x - 4x + 380 = 0. Suppose x = 4b - 197. What is the remainder when b is divided by 26? 21 Let n(o) = o3 + 3o*2 - 3o + 3. Let f be n(-3). Let m be (-2)/(-3)(-4)/8-48. Let a = m - f. What is the remainder when a is divided by 1? 0 Let t be (-27)/(-6)8/12. Suppose tp = 3o - 0p - 45, -3p = -o + 11. What is the remainder when (2 - 142/6)-3 is divided by o? 14 What is the remainder when 6/(72/(-474))-4 is divided by 10? 8 Suppose -o - 6o = -63. Suppose -5z + 0 + 10 = 0. What is the remainder when (-51)/(-6)z - 0 is divided by o? 8 Suppose 3g + 11 - 47 = 0. Suppose 5o + 0t - t + 15 = 0, -2t + 10 = 0. Calculate the remainder when -514/(0 + o) is divided by g. 11 Suppose 0 = -x - 3f - 2f + 18, 2x + 5f - 21 = 0. Suppose xs - 137 = -35. Calculate the remainder when s is divided by (9/5)/((-14)/(-140)). 16 Let q(u) = -u*2 - 4u + 7. Let x(o) = -4o2 + 8o. Let a be x(4). Let v = a + 64. Calculate the remainder when v is divided by q(-4). 4 Let c = 59 - -52. Let s(w) = -7w + 72. Calculate the remainder when c is divided by s(8). 15 Let a be 2/((-5)/((-15)/(-2))). Let l(p) = -4p + 1. Let s be l(a). Suppose -2*o = s - 237. What is the remainder when o is divided by 38? 36 Let m = -133 - -252. Calculate	{ "pile_set_name": "DM Mathematics" }
6 Find the common denominator of 61/228 and 33/2. 228 What is the common denominator of 71/585 and 59/325? 2925 What is the least common multiple of 1233 and 822? 2466 What is the smallest common multiple of 63 and 6? 126 Find the common denominator of 1/7 and -37/161. 161 Calculate the common denominator of -53/6 and -5/8. 24 Calculate the least common multiple of 1324 and 14. 9268 What is the least common multiple of 822 and 12? 1644 Calculate the smallest common multiple of 648 and 60. 3240 Find the common denominator of 23/114 and 17/90. 1710 Calculate the least common multiple of 2400 and 160. 2400 Calculate the common denominator of 59/6 and 53/132. 132 Calculate the least common multiple of 8 and 422. 1688 Calculate the least common multiple of 10 and 58. 290 Calculate the smallest common multiple of 583 and 583. 583 Calculate the lowest common multiple of 52 and 91. 364 What is the common denominator of -79/144 and 67/36? 144 Calculate the smallest common multiple of 252 and 42. 252 Calculate the smallest common multiple of 110 and 627. 6270 Calculate the least common multiple of 290 and 580. 580 What is the common denominator of -131/276 and -71/874? 5244 What is the common denominator of 61/847 and -59/4? 3388 Calculate the common denominator of 11/13 and -27/1456. 1456 What is the smallest common multiple of 108 and 36? 108 What is the common denominator of -41/48 and 77/156? 624 What is the common denominator of -83/2726 and 13/58? 2726 Calculate the least common multiple of 4198 and 1. 4198 Calculate the common denominator of -53/35 and 6/3085. 21595 Calculate the lowest common multiple of 5829 and 15. 29145 Calculate the least common multiple of 30 and 1420. 4260 Calculate the common denominator of -39/28 and -31/448. 448 What is the smallest common multiple of 123 and 168? 6888 What is the common denominator of 43/534 and -28? 534 What is the common denominator of 101/140 and 6/5? 140 Calculate the least common multiple of 231 and 42. 462 What is the common denominator of -97/4236 and 83/2? 4236 Calculate the lowest common multiple of 16 and 48. 48 Calculate the common denominator of 33/4052 and 9/88. 89144 Calculate the least common multiple of 12 and 62. 372 What is the common denominator of 109/3714 and -95/22? 40854 What is the common denominator of 31/15 and 1/190? 570 Calculate the common denominator of -58/385 and 57/1595. 11165 Calculate the smallest common multiple of 140 and 70. 140 Calculate the common denominator of 35/328 and -71/524. 42968 Find the common denominator of -20/133 and 1/266. 266 What is the common denominator of 139/13182 and 121/18? 39546 What is the least common multiple of 92 and 115? 460 Calculate the least common multiple of 91 and 7. 91 What is the least common multiple of 210 and 1470? 1470 Calculate the smallest common multiple of 663 and 102. 1326 Calculate the least common multiple of 508 and 6. 1524 What is the smallest common multiple of 13 and 2421? 31473 Calculate the smallest common multiple of 104 and 3484. 6968 Find the common denominator of 7/2015 and -167/30. 12090 Find the common denominator of -7/6 and 37/2. 6 What is the common denominator of 29/39 and -2/65? 195 What is the smallest common multiple of 790 and 711? 7110 Find the common denominator of -101/34 and -99/340. 340 What is the smallest common multiple of 51 and 9? 153 What is the least common multiple of 25 and 200? 200 Calculate the common denominator of 35/66 and -79/10. 330 Find the common denominator of -49/3 and 5/162. 162 Find the common denominator of -121/12 and 7/3. 12 Calculate the common denominator of 77/4168 and 3/2605. 20840 What is the smallest common multiple of 6 and 9550? 28650 Calculate the least common multiple of 261 and 986. 8874 What is the least common multiple of 45 and 50? 450 Calculate the common denominator of -19/474 and 125/246. 19434 What is the lowest common multiple of 40 and 330? 1320 Calculate the least common multiple of 5 and 285. 285 Calculate the common denominator of -101/12 and 20/9. 36 What is the common denominator of -43/14 and -9/2? 14 What is the smallest common multiple of 50 and 70? 350 What is the common denominator of 59/4458 and 127/30? 22290 Calculate the least common multiple of 60 and 180. 180 Calculate the common denominator of 105/176 and 5/48. 528 What is the common denominator of -59/117 and 19/3? 117 Calculate the lowest common multiple of 160 and 1940. 15520 What is the least common multiple of 110 and 24? 1320 What is the common denominator of -7/12 and 121/230? 1380 Find the common denominator of -85/138 and 40/161. 966 What is the common denominator of 103/576 and 123/80? 2880 Calculate the least common multiple of 18 and 2512. 22608 Calculate the common denominator of 76/8625 and 21/10. 17250 Find the common denominator of 89/246 and 74/123. 246 Calculate the lowest common multiple of 3380 and 2704. 13520 Calculate the common denominator of -12/5 and -127/90. 90 Calculate the common denominator of 43/429 and -89/273. 3003 Find the common denominator of -47/60 and -103/6. 60 What is the lowest common multiple of 32 and 638? 10208 Calculate the lowest common multiple of 630 and 84. 1260 Calculate the common denominator of 28/27 and -50/423. 1269 What is the smallest common multiple of 1230 and 12? 2460 Calculate the common denominator of 91/1224 and -33/152. 23256 Calculate the common denominator of 81/130 and 43/5226. 26130 Calculate the lowest common multiple of 2564 and 4. 2564 Calculate the common denominator of -5/3164 and -52/8701. 34804 What is the common denominator of 71/156 and 62/429? 1716 What is the lowest common multiple of 35 and 45? 315 What is the common denominator of -67/20 and -11/8? 40 Find the common denominator of -113/72 and 115/1224. 1224 Calculate the least common multiple of 140 and 1360. 9520 What is the smallest common multiple of 1358 and 388? 2716 What is the common denominator of -5/28 and -91/7184? 50288 What is the common denominator of -23/44 and -29/57? 2508 Calculate the common denominator of -31/1936 and 71/1936. 1936 Calculate the least common multiple of 3912 and 2608. 7824 What is the least common multiple of 878 and 4? 1756 Calculate the smallest common multiple of 30 and 11070. 11070 Calculate the common denominator of 29/75 and -26/25. 75 What is the common denominator of 79/75 and 70/3? 75 Find the common denominator of -71/36 and 91/264. 792 Calculate the smallest common multiple of 6372 and 3. 6372 What is the smallest common multiple of 114 and 133? 798 What is the smallest common multiple of 120 and 110? 1320 Find the common denominator of -101/364 and 111/308. 4004 Calculate the common denominator of 56/57 and -29/3724. 11172 Calculate the smallest common multiple of 156 and 104. 312 What is the lowest common multiple of 1306 and 11? 14366 Calculate the common denominator of -25/2 and 85/2076. 2076 What is the smallest common multiple of 1173 and 13? 15249 What is the common denominator of 15/1688 and -6/1055? 8440 Calculate the lowest common multiple of 4320 and 18. 4320 What is the common denominator of 101/120 and -151/300? 600 What is the lowest common multiple of 72 and 1686? 20232 What is the least common multiple of 674 and 14? 4718 Find the common denominator of 103/294 and -87/20. 2940 Calculate the common denominator of 8/2391 and 31/21. 16737 Calculate the common denominator of -33/1561 and -49/1338. 9366 Calculate the common denominator of -8/7 and 53/10. 70 Find the common denominator of 197/390 and -23/285. 7410 Find the common denominator of -113/60 and 37/3018. 30180 Calculate the common denominator of 25/9 and -64/8433. 8433 Find the common denominator of 16/639 and -101/4. 2556 Calculate the common denominator of 137/126 and 53/13086. 91602 What is the least common multiple of 10 and 1562? 7810 Calculate the lowest common multiple of 44 and 210. 4620 Calculate the smallest common multiple of 126 and 198. 1386 Calculate the common denominator of -125/558 and 32/39. 7254 What is the smallest common multiple of 836 and 220? 4180 Calculate the common denominator of 67/45 and -151/84. 1260 Calculate the lowest common multiple of 375 and 200. 3000 Calculate the lowest common multiple of 132 an	{ "pile_set_name": "DM Mathematics" }
same value? False Which is bigger: 386 or 387? 387 Is 618 less than 618? False Which is greater: 0 or 2/459? 2/459 Is 644 bigger than 645? False Which is bigger: -259 or -258? -258 Which is smaller: -33 or 0? -33 Which is greater: 15 or 8? 15 Which is greater: 2.07 or -0.5? 2.07 Are -2/643 and -1 nonequal? True Which is greater: -2 or 17? 17 Which is greater: -54/1463 or 1? 1 Which is greater: 37 or 24? 37 Are -1 and 28/75 unequal? True Is -1 smaller than -1067.1? False Is -4213 < -4213? False Is -407 equal to -0.16? False Is 1 at least as big as -18/5701? True Is -177 less than -171? True Which is smaller: -1457 or -1456? -1457 Which is smaller: -194 or -190? -194 Which is smaller: -0.5 or -30? -30 Do 0.167 and 0.8 have the same value? False Is -629 greater than 0? False Is -1.5 greater than or equal to -7.8? True Is 1 > -3/1415? True Is -1 smaller than -31/110? True Which is smaller: 0.34 or 7? 0.34 Which is smaller: -734 or -733? -734 Which is smaller: 44 or 607/14? 607/14 Which is smaller: -109 or -114? -114 Which is greater: -232 or -233? -232 Which is smaller: 2.8 or 0.07? 0.07 Which is smaller: 1/23 or -0.88? -0.88 Which is greater: 12/437 or 1? 1 Which is smaller: 1 or 12/17? 12/17 Is 59 > 65? False Which is bigger: -42/2327 or -1? -42/2327 Which is bigger: 57 or 3? 57 Which is smaller: 17 or 13? 13 Are -1/4084 and 0 equal? False Is -1144 less than or equal to -1144? True Is -300 at most -305? False Which is smaller: 4 or 29? 4 Is 2/731 at least -3? True Is -259 less than or equal to 1/3? True Is -3/2362 bigger than 0? False Is -62 != -62? False Which is smaller: 109 or 34? 34 Does -34487/5 = -6897? False Is 0 != 2/5023? True Which is smaller: 0 or -1/14? -1/14 Is 240 != 2? True Which is smaller: 22 or 2/969? 2/969 Which is smaller: 243 or 975/4? 243 Which is smaller: -3765 or -0.2? -3765 Which is greater: 5 or 12? 12 Which is smaller: -1399 or -1416? -1416 Are -48/43 and -1 equal? False Which is smaller: 260 or 262? 260 Which is bigger: 1 or 7/419? 1 Is 2/157 > -7/2? True Which is greater: -6/307 or 1.2? 1.2 Which is smaller: 4360 or 4358? 4358 Is 4.4 >= -7? True Which is smaller: 5 or -21? -21 Which is bigger: 21 or -0.26? 21 Which is bigger: 0.185 or 0.3? 0.3 Which is bigger: 283 or -4? 283 Is 1 <= 2/189? False Which is greater: 25794 or 25795? 25795 Which is smaller: -193 or -2? -193 Is 294 smaller than 278? False Which is bigger: -31 or -70? -31 Is -141 at most as big as 1/5? True Which is smaller: -0.03 or 15? -0.03 Which is greater: -8 or 77? 77 Does -2682 = -2684? False Which is smaller: 25 or 28/5? 28/5 Is 49 at most 48? False Which is smaller: 2396/7 or 342? 342 Is 70.8 <= -2/5? False Which is smaller: 766 or 4591/6? 4591/6 Is -0.4 smaller than 3/1412? True Are -134 and -47 equal? False Which is smaller: -3.9 or 28? -3.9 Which is smaller: 12/149 or 1? 12/149 Is -5.4 < 0.5? True Is 0.05508 > -1? True Is 229 < 229? False Is -815/24 >= -33? False Does -13 = 4? False Is 302 != 305? True Is -7 bigger than -150/23? False Is -13 not equal to -60? True Does -120 = -123? False Which is greater: -20 or -16? -16 Which is smaller: -978 or -979? -979 Are -15 and -17 equal? False Which is bigger: -46 or -136/3? -136/3 Is 15 greater than -8? True Is -4/17 greater than 16? False Is 1057 at least 1048? True Which is bigger: 54 or 114? 114 Which is greater: -3756 or -3759? -3756 Are -3 and -96/29 non-equal? True Is 1283 at most 1282? False Is -718/5 greater than -145? True Are 76 and 77 equal? False Is 14 smaller than -3/274? False Is -9883 greater than or equal to -9884? True Which is smaller: 1 or -467.15? -467.15 Which is greater: -485 or -481? -481 Is 1 < 1/722? False Which is greater: -4 or 4283? 4283 Is 419/3 bigger than 139? True Which is smaller: 0.817 or 0.1? 0.1 Which is greater: -31 or -0.4? -0.4 Which is smaller: -1 or 109? -1 Is -202 equal to -204? False Which is smaller: -85 or -766/9? -766/9 Are -1/7616 and 1 unequal? True Is -1 equal to -4/1333? False Which is smaller: 288 or -17? -17 Which is bigger: -1 or 2/403? 2/403 Which is smaller: 1 or -1/70? -1/70 Which is greater: 127 or 126? 127 Is 1 at least 11/6? False Which is greater: 1 or -83? 1 Which is bigger: 37 or 47? 47 Is 5 at least 59/13? True Which is smaller: 1 or -2/1311? -2/1311 Which is bigger: -20 or -8? -8 Is 1 bigger than -1/1449? True Is -8 at least -969? True Which is greater: -6284 or -6282? -6282 Which is bigger: -2222 or -2221? -2221 Which is greater: -54 or -429/8? -429/8 Is 560 at least 560? True Which is smaller: 66 or 79? 66 Is 1739 < 1739? False Which is smaller: 5524 or 5523? 5523 Is 9195 less than 9194? False Is -141 less than or equal to -137? True Which is smaller: 211/51 or 5? 211/51 Which is bigger: 1/1253 or 1? 1 Is 1 >= 23/20? False Is 8096 greater than or equal to 8096? True Is -24985 < -24985? False Is 185 less than or equal to 186? True Which is smaller: 2649 or 2652? 2649 Which is bigger: -33/19 or -3? -33/19 Is -71 less than -73? False Which is smaller: -1808/3 or -603? -603 Is 2/525 < 1? True Is -695 bigger than -694? False Which is greater: 1619/5 or 2? 1619/5 Which is bigger: -1 or 3/214? 3/214 Which is bigger: -1 or 1/1745? 1/1745 Which is smaller: -2/11 or -23? -23 Which is smaller: -1/2438 or 0? -1/2438 Which is greater: 65 or 66? 66 Which is smaller: 1 or -150/49? -150/49 Is -988 at least -997? True Which is smaller: 1928 or 1/2? 1/2 Does -4/3 = -32? False Which is smaller: -39 or -41? -41 Which is bigger: 2 or 46/83? 2 Which is bigger: 8 or 144? 144 Are 1 and -2/225 unequal? True Which is smaller: 18/37 or 1? 18/37 Is 34 <= -44? False Is -5 < -50.9? False Is 109/4 less than or equal to -1? False Is 0.1 > 518? False Is -1358 < -1359? False Which is bigger: 38913 or -1? 38913 Is -22571 at least as big as -22570? False Which is smaller: 4/9 or -18? -18 Which is smaller: 0 or 4111? 0 Which is smaller: -1.7 or 77/3? -1.7 Which is bigger: 12 or 79? 79 Which is smaller: 1 or 16/577? 16/577 Is 669 at most as big as 4691/7? True Which is smaller: -7612 or -7610? -7612 Is -3/11 less than -0.201? True Is -89 bigger than -89? False Is 0.1504 smaller than 1/3? True Is 0 less than -4110? False Is 42 less than -1/49? False Which is greater: 182/5 or 35? 182/5 Is 3 > 1? True Which is bigger: -50 or -33? -33 Which is greater: 27/8 or -1/2? 27/8 Is -94 <= -2/7? True Is 37 less than 82? True Are -29/18 and -2 non-equal? True Which is greater: -62.7 or 6? 6 Which is greater: 160 or 159? 160 Is 1/4 bigger than -2594? True Are -289 and -290 equal? False Which is smaller: -7183 or -7184? -7184 Does 0.4 = 9.7? False Is 7089 not equal to 7090? True Is 0 bigger than -21/26? True Are 396 and 395 nonequal? True Is 82 <= 69? False Which is greater: 280/13 or -1/9? 280/13 Is 1152 > 1151? True Is 14/19 at least 0? True Which is greater: 1346 or 1345? 1346 Which is bigger: 2082/7 or 296? 2082/7 Does -2 = -41/18? False Which is bigger: -289/3 or -96? -96 Is 0 greater than or equal to -3/103? True Is 190/3 < 62? False Is 1 at least as big as -1285? True Which is smaller: 2/24213 or 1? 2/24213 Is 1.1 at most -0.25? False Is -297 >= -295? False Which is greater: -73/14 or -4? -4 Which is bigger: 1271 or 1258? 1271 Which is greater: 1 or 4/11175? 1 Which is bigger: -979 or -976? -976 Are -10 and 5/7 equal? False Which is smaller: 632 or 634? 632 Which is bigger: 71 or 70? 71 Is 0.2753 > 1? False Which is bigger: 4.4 or 253? 253 Which is smaller: 190 or 239? 190 Which is smaller: 856 or 2/13? 2/13 Is 22.8 at most -2? False Is 14/8639 less than 1? True Is 9119 <= 9118? False Are 1/4 and -17.65 nonequal? True Which is smaller: -819 or -816? -819 Which is smaller: 3288 or 3287? 3287 Is 159 at most as big as 161? True Is 29 at least as big as 14? True Is 55 at least as big as 56? False Which is smaller: 0.002887 or 0? 0 Which is bigger: -5563 or -5562? -5562 Which is greater: 24 or 73/3? 73/3 Which is greater: 140 or 185? 185 Which is smaller: -0.1 or 1174? -0.1 Are -35 and -20 equal? False Which is greater: 11/150 or 1? 1 Is -92/15 bigger than -6? False Which is bigger: -1/31370 or -1? -1/31370 Is -5 at least as big as -2.54? False Do -1/425 and -10 have different values? True Which is smaller: -2/269 or 8? -2/269 Which is greater: 2601 or 2599? 2601 Which is smaller: -	{ "pile_set_name": "DM Mathematics" }
from {u: 3, n: 1, w: 3, r: 2, i: 2, f: 4}. What is prob of picking 1 r, 1 u, and 1 w? 18/455 Four letters picked without replacement from {z: 2, w: 4, t: 7}. What is prob of picking 3 w and 1 t? 28/715 Calculate prob of picking 2 c when two letters picked without replacement from {v: 1, r: 1, g: 2, c: 2, m: 1, a: 1}. 1/28 Three letters picked without replacement from {g: 1, t: 2, z: 3, c: 2, q: 3, l: 4}. Give prob of picking 1 c and 2 z. 6/455 Two letters picked without replacement from {z: 7, t: 4, h: 5}. What is prob of picking 2 z? 7/40 Three letters picked without replacement from qqwd. What is prob of picking 1 w, 1 d, and 1 q? 1/2 What is prob of picking 4 v when four letters picked without replacement from {l: 3, v: 15}? 91/204 What is prob of picking 1 t, 2 c, and 1 m when four letters picked without replacement from {t: 4, c: 3, m: 4, r: 3}? 48/1001 Three letters picked without replacement from ucululuuonoluuuouuu. Give prob of picking 1 n, 1 u, and 1 l. 11/323 Four letters picked without replacement from yyyyyyyyy. What is prob of picking 4 y? 1 Calculate prob of picking 2 h when two letters picked without replacement from hhhihihhhhhhhhhhhhh. 136/171 Four letters picked without replacement from {p: 10, g: 2, j: 4}. Give prob of picking 1 p and 3 j. 2/91 Calculate prob of picking 1 t and 1 k when two letters picked without replacement from vkskkytksqykskkkyk. 1/17 What is prob of picking 1 y, 2 p, and 1 t when four letters picked without replacement from {p: 4, y: 5, i: 4, t: 2, j: 1}? 3/91 What is prob of picking 2 m when two letters picked without replacement from {d: 1, m: 4, p: 4, a: 2}? 6/55 Calculate prob of picking 1 v, 2 f, and 1 m when four letters picked without replacement from {f: 3, m: 5, v: 3}. 3/22 Two letters picked without replacement from ekkk. What is prob of picking 2 k? 1/2 Calculate prob of picking 3 c when three letters picked without replacement from kcxkkccxk. 1/84 Three letters picked without replacement from naiwnece. What is prob of picking 2 n and 1 e? 1/28 Three letters picked without replacement from huyxp. Give prob of picking 2 x and 1 y. 0 Two letters picked without replacement from {j: 5, m: 1, u: 1, p: 5}. Give prob of picking 1 j and 1 p. 25/66 Two letters picked without replacement from {v: 4, d: 14}. Give prob of picking 1 d and 1 v. 56/153 Calculate prob of picking 1 i, 1 u, and 1 s when three letters picked without replacement from swjiu. 1/10 Calculate prob of picking 1 r and 2 j when three letters picked without replacement from {j: 3, y: 3, r: 2}. 3/28 Two letters picked without replacement from {y: 2, i: 1, h: 1, v: 2, k: 1}. Give prob of picking 1 k and 1 v. 2/21 What is prob of picking 4 o when four letters picked without replacement from oonoronoorrorrrooo? 7/102 Two letters picked without replacement from hhhjhjjjjhjjjj. What is prob of picking 1 j and 1 h? 45/91 What is prob of picking 2 i and 1 w when three letters picked without replacement from woiooooudowociodiod? 2/323 Two letters picked without replacement from ezzzzzezzzz. Give prob of picking 2 z. 36/55 Two letters picked without replacement from {a: 17, d: 1}. What is prob of picking 2 a? 8/9 Two letters picked without replacement from mbsostsbsm. Give prob of picking 1 s and 1 t. 4/45 Four letters picked without replacement from {b: 2, k: 1, f: 2, v: 1, j: 1}. What is prob of picking 2 f, 1 k, and 1 j? 1/35 Three letters picked without replacement from vvvjooovwvlllvvo. What is prob of picking 1 v, 1 j, and 1 w? 1/80 Four letters picked without replacement from {g: 2, h: 8, u: 4, c: 3, f: 2}. Give prob of picking 1 g, 2 c, and 1 h. 4/323 Calculate prob of picking 2 c when two letters picked without replacement from ncccg. 3/10 Calculate prob of picking 1 k and 2 p when three letters picked without replacement from {p: 2, k: 1, q: 2}. 1/10 Four letters picked without replacement from lmlamzameaaammelm. What is prob of picking 1 e, 1 m, and 2 l? 9/595 What is prob of picking 2 j when two letters picked without replacement from {j: 3, f: 7}? 1/15 Three letters picked without replacement from wytwrryrryryr. What is prob of picking 3 r? 10/143 Calculate prob of picking 2 u when two letters picked without replacement from ppupupupppuppppppu. 10/153 What is prob of picking 2 t when two letters picked without replacement from {h: 2, z: 9, t: 3, g: 2}? 1/40 Two letters picked without replacement from {o: 6, g: 2, j: 1, b: 2}. What is prob of picking 2 o? 3/11 Three letters picked without replacement from wwyxnbwnwbxwwynby. Give prob of picking 1 x and 2 w. 3/68 Two letters picked without replacement from nhpnpd. Give prob of picking 1 h and 1 d. 1/15 Four letters picked without replacement from {i: 2, j: 4, g: 1, q: 1}. What is prob of picking 1 g, 2 j, and 1 q? 3/35 What is prob of picking 2 c and 2 o when four letters picked without replacement from cococoo? 18/35 Calculate prob of picking 2 z when two letters picked without replacement from {z: 2, r: 1, g: 2, x: 2, c: 1, t: 4}. 1/66 Two letters picked without replacement from {x: 1, j: 1, r: 2, s: 1, f: 1, b: 2}. Give prob of picking 2 b. 1/28 What is prob of picking 1 q and 3 i when four letters picked without replacement from {q: 2, i: 11}? 6/13 Three letters picked without replacement from kkkkk. Give prob of picking 3 k. 1 Three letters picked without replacement from {j: 9, z: 10}. Give prob of picking 1 z and 2 j. 120/323 What is prob of picking 1 w and 3 i when four letters picked without replacement from whxiwxiih? 1/63 Two letters picked without replacement from rvffrfvrr. Give prob of picking 1 f and 1 v. 1/6 Four letters picked without replacement from {i: 1, s: 1, y: 4, f: 4}. What is prob of picking 1 s, 1 y, 1 f, and 1 i? 8/105 Two letters picked without replacement from eeieiiee. Give prob of picking 2 i. 3/28 Two letters picked without replacement from hkkhdhuukdwk. What is prob of picking 1 k and 1 u? 4/33 Two letters picked without replacement from ewmbi. What is prob of picking 2 e? 0 Three letters picked without replacement from {b: 7, g: 1, x: 4, a: 1, v: 3}. What is prob of picking 2 v and 1 a? 3/560 Two letters picked without replacement from {a: 7, j: 2}. Give prob of picking 1 j and 1 a. 7/18 Two letters picked without replacement from hahhhaha. What is prob of picking 2 a? 3/28 Two letters picked without replacement from {q: 8, d: 2}. What is prob of picking 1 d and 1 q? 16/45 Two letters picked without replacement from wcangcugcann. What is prob of picking 1 c and 1 g? 1/11 Three letters picked without replacement from hhtmhththhhmhhmhht. Give prob of picking 2 h and 1 m. 55/272 What is prob of picking 4 w when four letters picked without replacement from {r: 5, t: 1, w: 5}? 1/66 What is prob of picking 4 l when four letters picked without replacement from {s: 7, l: 7}? 5/143 Calculate prob of picking 1 o and 2 k when three letters picked without replacement from eeffefkxkko. 1/55 Two letters picked without replacement from lllllllll. Give prob of picking 2 l. 1 Four letters picked without replacement from ipxjrfp. What is prob of picking 2 i, 1 r, and 1 p? 0 What is prob of picking 1 q, 1 u, and 1 f when three letters picked without replacement from iuqffquqfffuff? 9/52 Calculate prob of picking 2 e when two letters picked without replacement from execccexe. 1/6 What is prob of picking 2 e when two letters picked without replacement from eeeeeeeeceeeeeceeeee? 153/190 Two letters picked without replacement from {h: 1, t: 5, w: 3, v: 2, q: 7}. Give prob of picking 2 t. 10/153 Calculate prob of picking 2 u and 1 p when three letters picked without replacement from xxpxuuxpxppxx. 2/143 Calculate prob of picking 1 g, 1 c, 1 v, and 1 f when four letters picked without replacement from {g: 1, f: 1, u: 1, v: 1, c: 1}. 1/5 Calculate prob of picking 1 r and 1 k when two letters picked without replacement from zzszkrj. 1/21 Four letters picked without replacement from {p: 14, t: 5}. Give prob of picking 4 t. 5/3876 Calculate prob of picking 1 s and 1 d when two letters picked without replacement from jjdsbdsjjd. 2/15 Two letters picked without replacement from {g: 3, j: 8, z: 2, p: 5, d: 1}. What is prob of picking 2 p? 10/171 Three letters picked without re	{ "pile_set_name": "DM Mathematics" }
biggest value? (a) 5 (b) -177 (c) -229 (d) 0 b What is the third smallest value in 1.37, -6/11, 0.2, 1/3, -0.3, 6? 0.2 Which is the second biggest value? (a) 1917 (b) -0.1 (c) 1/3 c Which is the smallest value? (a) -1/3 (b) 1 (c) -1/2 (d) 5 (e) -59/11 e What is the third biggest value in 5/6, -8, 1/512? -8 What is the second smallest value in -2/3, 0.3, -212372/3? -2/3 Which is the third biggest value? (a) 3602 (b) -0.4 (c) -2/13 b Which is the third smallest value? (a) 1 (b) 3/10 (c) -4/17 (d) 3/5 (e) 0.4 e What is the fourth smallest value in 0.09, 1/2, 3/2, 5, 3? 3 Which is the biggest value? (a) 1.9 (b) -1/28 (c) -11 a Which is the fourth biggest value? (a) 5 (b) -3749/5 (c) -1/4 (d) -1/2 (e) -3/2 e What is the fifth biggest value in -2.78, -0.7, 2, -0.1, -1, 0? -1 What is the second biggest value in -2, -2/9, 0.08, -8, 2/173? 2/173 Which is the fifth biggest value? (a) 2 (b) -20 (c) 0.4 (d) -13 (e) -7 (f) 5/4 d What is the fourth smallest value in -1/3, 0.4, -5, 4, 1, 0.27? 0.4 What is the smallest value in 4, 0.8, 2669, 3, -3, 0.3? -3 Which is the third smallest value? (a) 5/4 (b) -3/5 (c) 0.0427 (d) -2 (e) -50 b What is the biggest value in 202.6, -6, 0, 0.1? 202.6 What is the fifth smallest value in 8, 2, 1/5, 0.4, -0.1? 8 Which is the third smallest value? (a) -22 (b) -0.7 (c) -56 b Which is the biggest value? (a) 1 (b) 97 (c) 1.5 (d) -0.05 b Which is the third smallest value? (a) 14 (b) 2/5 (c) -1090 (d) -0.2 b What is the third smallest value in 117/5, 0.12, 4, 9, -0.4, 1/2? 1/2 Which is the second biggest value? (a) 1 (b) 7 (c) 0.18 (d) 6 (e) -2/31 d Which is the second smallest value? (a) -5 (b) -12/5 (c) 0.01 (d) 6 (e) -1/69 b Which is the third biggest value? (a) 2/11 (b) -9/2 (c) -1/5 (d) 1 c What is the biggest value in 62/79, 3, -2? 3 Which is the smallest value? (a) -0.2 (b) -32.68 (c) 0 (d) 1/2 b Which is the second biggest value? (a) -24/11 (b) 0.01 (c) 0.3 (d) -12 b Which is the third smallest value? (a) -7.1 (b) 54.4 (c) 1 b Which is the third smallest value? (a) -1 (b) -1/5 (c) 3485/3 (d) -5 b Which is the second smallest value? (a) -0.4 (b) -2 (c) 2/7 (d) -0.000939 a What is the third biggest value in -137, 221, 3, 1? 1 What is the second biggest value in -1/6, 1, -22, 1/2, 0.3, -53? 1/2 What is the second smallest value in 5, -0.2, -2/24455? -2/24455 What is the third smallest value in -1, -6, -341, -2? -2 What is the biggest value in 1, 8/3, -144.68, -5? 8/3 Which is the third biggest value? (a) 205 (b) -2/13 (c) 14 (d) -8 b What is the fourth biggest value in -25, 2/2735, -2, -0.4? -25 What is the smallest value in 2/1187, 22, 12? 2/1187 Which is the second smallest value? (a) 1.3 (b) 0.25 (c) 13 a Which is the third smallest value? (a) 56346 (b) 1 (c) 0.5 a Which is the smallest value? (a) -0.1 (b) 2/7 (c) -97 (d) -453 d What is the biggest value in -1/45, 2/71, 25, 2? 25 Which is the smallest value? (a) -3.8 (b) -1653 (c) 0 b What is the fourth biggest value in 0, 2/2087, 1/5, -2/19, -0.02? -0.02 Which is the biggest value? (a) 638 (b) 5 (c) -1047 a Which is the second smallest value? (a) -6.6 (b) 0 (c) 0.4 (d) -0.5 (e) 8 d What is the third biggest value in 29/2, -54, -0.5? -54 What is the third smallest value in 3, 4/23, 1, -566, 5? 1 What is the biggest value in -736, 6, -2.2? 6 What is the smallest value in 0, -0.4, -39248? -39248 Which is the fifth smallest value? (a) 10 (b) 1 (c) 0.02 (d) 0.2 (e) -1/4 a Which is the fifth biggest value? (a) 5 (b) 2/13 (c) -2/1563 (d) 8 (e) -0.3 e What is the fourth biggest value in -1/2, 11, 0, -4, -123? -4 What is the fourth smallest value in -2, -5, -0.4, -826? -0.4 What is the fourth biggest value in -4, -1/4, -5/3, -170.17, 0.4, 1? -5/3 What is the third biggest value in -23, 0.05, 13? -23 What is the biggest value in -4, -0.02, -5, 1, 0.3, -43? 1 What is the smallest value in 1/25, -0.1, 0, 3/20, -0.3? -0.3 What is the third biggest value in -21.9, -3, 2, 12? -3 What is the second smallest value in 2/5, 0.38, -3/13? 0.38 Which is the fifth biggest value? (a) -0.4 (b) -0.1 (c) -1/3 (d) -3 (e) -0.3 (f) -5390 d Which is the fourth smallest value? (a) 5/39 (b) 5/3 (c) -2/9 (d) 2/7 b Which is the second smallest value? (a) 5 (b) -3/55 (c) 0.2 (d) -4 (e) -2/3 (f) 532 e Which is the third smallest value? (a) 3 (b) -10 (c) 19259 c What is the biggest value in -0.3, -1/2, 2003? 2003 Which is the biggest value? (a) 0.5 (b) -0.4 (c) -0.5 (d) 0.07 (e) -0.1 (f) 108 f Which is the second biggest value? (a) 1/9 (b) 2/19 (c) 6 (d) -32 (e) 4/7 e Which is the third smallest value? (a) 0.3 (b) -4 (c) -2 (d) -21 (e) 0.206 c Which is the sixth biggest value? (a) 51 (b) 5 (c) 0.1 (d) 10 (e) -6 (f) -1 e Which is the fourth biggest value? (a) -9 (b) 2.76 (c) 0 (d) 3/4 a Which is the third smallest value? (a) 5 (b) -5 (c) -4/5 (d) 0.037607 d What is the fourth biggest value in 2/29, -13, -2/5, 6, 178? -2/5 Which is the third biggest value? (a) -5 (b) 359 (c) 0.07 a What is the biggest value in -4, -2, 0.6, 8/117? 0.6 What is the second biggest value in -17/116, 0.23, -0.5, -4? -17/116 What is the smallest value in -1/4, 30363, 3? -1/4 Which is the second smallest value? (a) 0.1 (b) 2 (c) 231 b What is the biggest value in -19, 108, -1/14, -2? 108 Which is the fourth biggest value? (a) 21/22 (b) -0.2 (c) -1 (d) -1/67 c What is the biggest value in -6/101, -2/5, -1/6, -18, 0, -1/2? 0 What is the smallest value in -27/5, 3, -2, -2/3, 13/3? -27/5 What is the sixth smallest value in -16/3, -3/4, 5, -11, 1/4, 0.3? 5 What is the fourth biggest value in 149, -1/2, -5, 1/2, 4/19, 0? 0 Which is the fourth smallest value? (a) 8/57 (b) -2/7 (c) -5 (d) -8 a What is the second biggest value in -0.2, -19, 0.31, -1/3, 2, 170? 2 What is the second biggest value in -0.8, 2/119, -3/7, -3, 3/4? 2/119 Which is the fifth biggest value? (a) 1 (b) 2/7 (c) -0.1 (d) 259 (e) 3 (f) -1/2 c Which is the smallest value? (a) 4 (b) -0.064 (c) 2/9 (d) -5 (e) 0.65 (f) 5 d What is the smallest value in -1, -10/71, 3/7, -0.03? -1 Which is the third smallest value? (a) -6/53 (b) 483 (c) 1/4 b Which is the biggest value? (a) -791/2 (b) 0.3 (c) -16 b What is the sixth smallest value in 0.003, -1, -0.4, 5, -5, -0.02? 5 What is the second smallest value in -2/3, -8/3, 3/4, -333/5, -3/5? -8/3 What is the fourth biggest value in -1/3, -412, 3, 0.02, -0.4? -0.4 Which is the fourth biggest value? (a) 0 (b) -0.07 (c) -34 (d) -0.5 (e) 28 d What is the third smallest value in 0.1, -3, 3, 1, -0.143? 0.1 Which is the fifth smallest value? (a) 2 (b) -93 (c) 5/2 (d) 1/6 (e) -2 c What is the third biggest value in -2, 0.53, 846? -2 Which is the second smallest value? (a) 3.5 (b) -5/6 (c) -1/5 (d) 3 (e) 4 c Which is the third biggest value? (a) -4 (b) 0.4719 (c) 0 a What is the second smallest value in 0.06, 1/3, -5/8? 0.06 Which is the biggest value? (a) 2 (b) -21 (c) -0.01 (d) 2/79 a What is the third biggest value in -1/3, -6/7, 1, -18, 0.4, -4? -1/3 Which is the fifth biggest value? (a) -13 (b) 0 (c) 2 (d) -1717 (e) -1 d Which is the sixth biggest value? (a) -0.3 (b) -0.2 (c) -2/7 (d) 14 (e) 0.1 (f) -4 f What is the second biggest value in 131, -105, 0.4? 0.4 Which is the fourth biggest value? (a) -5.4 (b) -2.9 (c) 7/6 (d) 5 (e) -1 b What is the fourth smallest value in 1, -11, -1/6, 2.44, -2/5? 1 Which is the second biggest value? (a) -163 (b) 2 (c) -0.4 (d) -35.9 (e) -2 c Which is the second biggest value? (a) -2800 (b) 0.4 (c) 0 (d) -2 (e) -1/9 c Which is the second smallest value? (a) -71 (b) 2/13 (c) -3.95 c What is the second biggest value in -29400, -2/9, -0.2, 2/7? -0.2 Which is the second smallest value? (a) -1 (b) 2/13 (c) 1.041 (d) -1/8 (e) 1 d What is the biggest value in -3, -53, 0.167? 0.167 Which is the fourth biggest value? (a) 0.5 (b) 4 (c) -1/3 (d) 2/45787 c What is the biggest value in -0.2, 2, 0.3, 1/1533, 0.1? 2 What is the biggest value in 165, -1/2, -2/3, -2/7, 0.1, 15/7? 165 Which is the third biggest value? (a) 0.3 (b) -3 (c) 1 (d) -1148 b Which is the bigg	{ "pile_set_name": "DM Mathematics" }
e greatest common divisor of 20 and 148. 4 What is the highest common factor of 5 and 7? 1 Calculate the greatest common divisor of 45 and 1065. 15 Calculate the highest common divisor of 36 and 8604. 36 Calculate the highest common divisor of 3 and 717. 3 What is the greatest common divisor of 41 and 1271? 41 Calculate the greatest common factor of 8192 and 384. 128 Calculate the greatest common divisor of 40 and 140. 20 Calculate the greatest common factor of 74823 and 147. 147 Calculate the greatest common divisor of 80 and 260. 20 What is the greatest common divisor of 91 and 494? 13 Calculate the highest common factor of 3075 and 75. 75 What is the greatest common divisor of 88 and 1672? 88 Calculate the greatest common divisor of 124 and 16. 4 Calculate the greatest common divisor of 207 and 22563. 207 What is the greatest common factor of 6 and 42? 6 Calculate the highest common factor of 1771 and 55. 11 What is the greatest common divisor of 43 and 43? 43 What is the greatest common factor of 65 and 830? 5 Calculate the highest common factor of 360 and 384. 24 Calculate the highest common divisor of 79 and 553. 79 Calculate the greatest common divisor of 80 and 220. 20 What is the greatest common factor of 1771 and 451? 11 Calculate the highest common factor of 115 and 19435. 115 What is the highest common divisor of 3 and 461? 1 Calculate the greatest common divisor of 78 and 3198. 78 Calculate the greatest common factor of 712 and 534. 178 What is the greatest common factor of 24 and 2520? 24 What is the greatest common factor of 161 and 46? 23 What is the greatest common factor of 2317 and 7? 7 Calculate the greatest common divisor of 259 and 8991. 37 What is the highest common divisor of 131872 and 416? 416 What is the highest common divisor of 12 and 87432? 12 What is the greatest common divisor of 3493 and 14? 7 Calculate the highest common factor of 2313 and 18. 9 Calculate the greatest common divisor of 46 and 14. 2 What is the highest common factor of 304 and 48? 16 Calculate the greatest common divisor of 759 and 46. 23 Calculate the greatest common factor of 14 and 49. 7 What is the greatest common factor of 5776 and 16? 16 Calculate the greatest common factor of 46 and 2. 2 Calculate the highest common factor of 520 and 24. 8 Calculate the greatest common factor of 14 and 1617. 7 Calculate the highest common divisor of 5887 and 87. 29 Calculate the highest common factor of 24 and 1388. 4 Calculate the greatest common factor of 15 and 720. 15 Calculate the highest common factor of 87 and 2291. 29 What is the greatest common divisor of 84 and 60? 12 Calculate the greatest common divisor of 19 and 1691. 19 What is the highest common factor of 196 and 63? 7 What is the highest common factor of 169 and 40729? 169 Calculate the greatest common factor of 16 and 4. 4 What is the greatest common factor of 30213 and 373? 373 What is the highest common divisor of 165 and 1353? 33 Calculate the greatest common factor of 86 and 2236. 86 What is the highest common factor of 61 and 61? 61 Calculate the highest common factor of 45 and 27. 9 What is the greatest common factor of 11 and 12903? 11 Calculate the highest common divisor of 5175 and 1449. 207 What is the highest common factor of 192 and 1104? 48 Calculate the highest common divisor of 178 and 2403. 89 What is the greatest common factor of 243 and 234? 9 What is the greatest common divisor of 50 and 130? 10 Calculate the highest common divisor of 118 and 4. 2 Calculate the highest common factor of 48 and 11584. 16 Calculate the highest common factor of 740 and 7. 1 Calculate the highest common factor of 820 and 50. 10 What is the greatest common divisor of 24 and 24? 24 What is the greatest common divisor of 6060 and 120? 60 Calculate the greatest common divisor of 747 and 7055. 83 What is the greatest common factor of 22 and 418? 22 What is the greatest common divisor of 240 and 1500? 60 Calculate the greatest common divisor of 280 and 70. 70 What is the greatest common factor of 10 and 350? 10 Calculate the highest common divisor of 16 and 1240. 8 What is the greatest common divisor of 176 and 242? 22 Calculate the greatest common factor of 712 and 267. 89 Calculate the highest common divisor of 2368 and 1216. 64 Calculate the greatest common factor of 2662 and 44. 22 Calculate the greatest common factor of 182 and 7. 7 Calculate the highest common divisor of 11583 and 234. 117 What is the greatest common factor of 4293 and 81? 81 Calculate the greatest common divisor of 102 and 6. 6 What is the greatest common factor of 6028 and 137? 137 Calculate the highest common divisor of 80 and 48. 16 Calculate the highest common factor of 30 and 480. 30 Calculate the highest common divisor of 4 and 452. 4 What is the highest common divisor of 64 and 44? 4 What is the highest common factor of 92330 and 70? 70 Calculate the greatest common divisor of 11830 and 1014. 338 Calculate the greatest common factor of 180 and 140. 20 What is the highest common factor of 178 and 4? 2 What is the greatest common factor of 21 and 336? 21 Calculate the greatest common divisor of 22 and 121. 11 Calculate the greatest common divisor of 2021 and 43. 43 Calculate the greatest common divisor of 15 and 960. 15 What is the greatest common factor of 35 and 140? 35 Calculate the greatest common divisor of 117 and 207. 9 Calculate the highest common factor of 32 and 8. 8 What is the highest common divisor of 3 and 24? 3 What is the highest common divisor of 80 and 5760? 80 Calculate the highest common divisor of 126 and 189. 63 Calculate the greatest common divisor of 3162 and 459. 51 Calculate the highest common divisor of 166 and 1245. 83 Calculate the greatest common divisor of 241 and 1. 1 What is the greatest common factor of 120 and 4890? 30 Calculate the highest common divisor of 2586 and 30. 6 What is the highest common factor of 440 and 40? 40 What is the greatest common divisor of 87 and 6148? 29 What is the highest common factor of 36 and 228? 12 Calculate the highest common divisor of 435 and 348. 87 Calculate the highest common factor of 42 and 1029. 21 What is the greatest common factor of 2641 and 417? 139 Calculate the greatest common divisor of 17 and 164. 1 Calculate the greatest common factor of 195 and 1965. 15 What is the greatest common divisor of 11 and 110? 11 Calculate the highest common divisor of 156 and 6318. 78 What is the highest common divisor of 60325 and 190? 95 What is the highest common divisor of 24 and 1408? 8 Calculate the highest common factor of 3159 and 234. 117 What is the highest common divisor of 608 and 684? 76 Calculate the greatest common factor of 4472 and 1352. 104 Calculate the highest common divisor of 73 and 1825. 73 What is the greatest common factor of 38 and 21261? 19 Calculate the highest common divisor of 39 and 923. 13 What is the highest common factor of 1599 and 205? 41 Calculate the highest common divisor of 567 and 4212. 81 What is the highest common factor of 96 and 912? 48 Calculate the highest common factor of 1296 and 2976. 48 What is the greatest common factor of 72 and 738? 18 What is the highest common factor of 2528 and 32? 32 Calculate the greatest common divisor of 66 and 18260. 22 What is the highest common factor of 3757 and 119? 17 Calculate the greatest common divisor of 54 and 14. 2 Calculate the greatest common divisor of 369 and 82. 41 Calculate the greatest common divisor of 28 and 28. 28 What is the highest common divisor of 192 and 448? 64 Calculate the highest common factor of 1479 and 221. 17 Calculate the highest common divisor of 65 and 2990. 65 What is the greatest common factor of 280 and 595? 35 Calculate the greatest common factor of 27 and 108. 27 What is the highest common factor of 74 and 16? 2 Calculate the greatest common divisor of 6118 and 57. 19 What is the highest common divisor of 10088 and 728? 104 Calculate the highest common factor of 640 and 96. 32 Calculate the highest common divisor of 14 and 70. 14 Calculate the greatest common factor of 6 and 162. 6 What is the greatest common divisor of 65 and 169? 13 What is the highest common divisor of 1875 and 135? 15 Calculate the highest common divisor of 1 and	{ "pile_set_name": "DM Mathematics" }
u. Is -0.1 greater than or equal to i? False Suppose -4a = a + 1400. Let g = 5201 - 5480. Which is greater: a or g? g Let t = -2380 - -2344. Which is bigger: t or -35? -35 Let s(k) = k3 - 5k*2 + 7k - 2. Let w be s(4). Suppose c = 4, 0c = -i + c + w. Let o(f) = f + 5. Let n be o(i). Does n = 18? False Suppose -3a + 2j = -32, -3a = -5j + j - 40. Let d(p) = 7p - 39. Let m be d(6). Let c be (35/(-14) + m)(1 + 3). Is c not equal to a? True Let x(t) = -t - 129. Let y(u) = -259. Let w(a) = -5x(a) + 2y(a). Let j be w(-32). Is -33 != j? False Let j(v) = -2v + 7. Let k be j(-1). Let f(u) = -u*3 + 11u*2 - 15u - 6. Let l be f(k). Is l at most as big as 99/5? False Suppose -942 = -p + 1338. Suppose -p = 10c + 210. Are 1 and c equal? False Let g = -195 - -363. Let f = -169 + g. Which is greater: -13/11 or f? f Let k = 10 + -19. Let r(p) = -p2 - 198 + 111 - 7p + 96. Let j be r(k). Which is bigger: j or -8? -8 Let n = 60055 - 184214/3. Is n less than or equal to -1350? False Let b(v) = -111v + 25. Let t(g) = -22g + 5. Let c(w) = -2b(w) + 11t(w). Let q be c(-4). Let z = 80 - q. Is z at least -5? True Let h = -88.9 + 1.9. Let f = h - -95.4. Let i = -8.5 + f. Is i at least as big as -41? True Let d = -43 - -39. Let a be (120/35)/d-70. Let b be 412/a - 6/(-45). Is b bigger than 31/5? True Let i be (-14)/29 + 5/10. Suppose 5w - 17w = 30w + 42. Is w > i? False Let v = -489 - -482. Let z be 1(-7 - -8 - v). Is z > -0.24? True Let k = -630 + 781. Let p = k - 152. Is 4/61 equal to p? False Let j = 381 + -384. Let w be (78/52533)/(1/j). Is w greater than or equal to 1? False Let j(u) = -6u + 32. Let o be j(5). Suppose 52 = -of - 178. Is f smaller than -114? True Suppose 0 = -27j - 10j - 2590. Let r be -5 - ((-86)/20 + (-21)/j). Is r at least as big as -4/113? False Let y = 2748 + -96182/35. Which is smaller: 410 or y? y Let u(s) = s3 - 6s*2 + 6s + 8. Suppose 0 = -12d + 20d - 32. Let r be u(d). Do r and -3/43 have the same value? False Let t(l) = -3l2 + 38l + 25. Let m be t(11). Suppose -126i - m = -131i. Let q be 2/(-3) + (-47)/(-3). Is i at most as big as q? False Let s be (-8)/(-14) + (-45)/(-7). Let f(g) = 9g3 - 3g - 10g3 + 7g*2 - s - 2g2. Let n be f(4). Which is smaller: n or -0.8? n Let o(x) = x2 - 2x - 1. Let s be o(-1). Let y be (1 + s)/((-60)/2200). Let b be (-1 + 3)/(20/y). Is b at most as big as 3? True Let h(p) = 15p3 + p2. Let w be h(1). Suppose -5c + 41 = z - 43, -4c - w = 0. Let s be -2 - (-9)/4 - (-118)/z. Is s equal to 1? False Let w(i) = -3i2 + 24i + 83. Let o be w(-4). Let s = o - 59. Are s and -121 non-equal? True Let t be 13/(-7) + (3 - (-189)/49) + -7. Which is bigger: t or 210? 210 Let p = 5910 + -5911. Is p > 279/8? False Let u = 16432893/29 + -566707. Which is bigger: u or -1? -1 Let o = 3195 - 1959. Suppose z = -3b + 638, -5z + 3z + o = -4b. Which is greater: 625 or z? z Let k be 2/10-12100/(-6). Let v = -35 + k. Suppose vc + 11 = -2h + h, 4h + 4c = 36. Which is smaller: 46/3 or h? h Let w = 12199.2 - 12199. Which is smaller: w or -69? -69 Suppose 2d + k = -1, -d - 11 = d + 3k. Suppose -4l + 441 = -3o, -243 = -dl - 3o - 0o. Let z = 109 - l. Is 5 at most as big as z? False Let l = -390 + 416. Suppose -3k + 15 = 0, 17k - l = g + 12k. Which is smaller: -9/10 or g? g Let l be 3 + 1938/(-702) + (-13)/((-117)/(-2)). Let p be (1(1 - 0))/1. Which is smaller: l or p? l Suppose 0 = -3u - 2b + 82 + 32, -3u + 114 = 5b. Which is smaller: u or 11? 11 Let h be (-23)/(-138) - (-15)/18. Is 26/35 bigger than h? False Suppose 30 = 28x - 23x. Suppose 11o - xo = 780. Is o less than 156? False Let n be (-60)/7014/(-3). Suppose -nu = 36b - 33b + 392, -516 = 4b + 4u. Which is greater: b or -125? b Let c be ((-56)/392)/(3/7)0. Which is smaller: c or 4/1519? c Let y be 1/1 + -64 + 66. Suppose -3a + o = 2, -20a - yo - 6 = -17a. Which is smaller: 3/46 or a? a Let n(b) = 3b - 3. Let y be n(0). Let l(h) = -3h*2 - 11h - 4. Let w be l(y). Suppose -2x - 10 = 2j + wx, -5j + 3 = -4x. Which is greater: j or -1/54? -1/54 Let d(p) = -313p - 4024. Let y be d(14). Is y > -8408? True Let l(h) = h*2 - 63h + 547. Let t be l(53). Which is bigger: t or 13? t Suppose 0f = -9f + 18. Suppose 2m - 5 = -fb - m, 0 = -4m + 4. Let l be ((-26)/(-48))/((-8)/(-32)). Which is smaller: b or l? b Let m = -493373/39220 + 2274/185. Which is smaller: m or 1? m Let o be 4/(-2) + 2958/1478. Let n = -23361 + 23362. Which is greater: o or n? n Suppose -g + 3n - 9 = -4g, -15 = 3g - 3n. Let j be 4 + 2 - (17 - -21). Let f be (j/(-6))/(g/3). Is -14 at least as big as f? True Let k be (6182/(-440) - 1/5)/((-39)/24). Is k > 9? False Let a = 938/5 + -897/5. Suppose 6i + 40 = 94. Is i < a? False Suppose 3c - 15c = 24. Let y(s) = -19s + 6. Let i be y(c). Which is bigger: i or 41? i Let f be 4/10 + (-34)/85. Suppose f = 5i - 2u - u - 166, -2i = 3u - 58. Let c = -15 + i. Which is bigger: 19 or c? 19 Let a(g) = -287g + 3. Let x be a(19). Let i be (52/130)/((-34)/x). Let u = i - 64. Is -0.3 less than or equal to u? True Suppose 7g - 4g + 2x = 56, g + 5x - 23 = 0. Let u be 6/(g/(-6)) - -33. Is u greater than 34? False Let t(d) = d*3 - 3d*2 - 7d - 15. Let h be t(5). Let y be (12/40)/((-5)/6). Is y equal to h? False Let p be (-12)/(6 + -2) + 15. Let q be p/(-30) + (-17)/(-5). Suppose k + 5d - 2d - 33 = 0, 75 = 3k + qd. Is 0 != k? True Let o = 166 - 170. Let d be 28/(-35) + (-3)/o. Which is bigger: -0.2 or d? d Suppose -2b + 37 = -b + 38. Is b != -2/22731? True Let s = 305/11 - 904/33. Are s and -165.6 nonequal? True Let o = 143.05 - 134. Let y = o - 9. Let a be (-7)/12 - (2 + 8 - 615/60). Is a != y? True Let p be (45/(-10) + 4)/(2/(-8)). Let y be 10/p - 6/6 - 10. Is y > -3? False Suppose -54f = -59f - 30, 5b + 5f = 2130. Is b >= 419? True Let m = 63 + -62.7. Let r be (5/(-50))/((-48)/420). Is r greater than or equal to m? True Let d be -10 - 5016/(-2519) - 456/(-57). Let c be 1 - (1 - 0 - 1). Is d < c? True Let d be ((-13)/(-3) + (-2)/(-3))34. Let j be (4/16)/(d/16). Let o(u) = u*3 - 9u*2 + 10u - 17. Let h be o(8). Which is smaller: j or h? h Let c = 157177/466256 + -3/20272. Are c and 1 equal? False Suppose -571 = 96a - 42a + 1481. Is a at least as big as -39? True Let k = 7 - 21. Let n be 2 - (5 + 15/(-3)). Suppose -3v + 2 - 1 = r, -4v = nr + 6. Is r at least as big as k? True Let n(m) = -m2 + 9m - 12. Let a be n(7). Suppose 2q - 3l - 113 = 0, -2l = 4q + al - 196. Suppose -s + q = s. Which is smaller: s or 27? s Let w be 6/(570/(-485)) - (-10)/2. Is w at least as big as -38? True Suppose -6r + 280 = 8r. Suppose 13u = -r + 20. Which is smaller: 9/7 or u? u Suppose -2u + 3o + 3 = 0, 2u = -o - 0o + 7. Let h = 18720 - 149733/8. Is u at least h? False Let m = 20 - 34. Let a = 18 + m. Let q be (-5)/((-70)/a) - (-28)/(-147). Is 0 > q? False Let d = -15248/9 - -1694. Which is greater: d or 1303? 1303 Let r = -6 + 7. Let n be 0(0 - 1) + (-138)/89631. Let t = -2500/63651 + n. Is r at least t? True Let w = 8735 - 8448. Is 23 equal to w? False Let j be 1/7 + (-3904)/(-14). Let m = j - 253. Does 24 = m? False Suppose -28f - 4 + 4 = 25f. Let p = 1/3125 - 1269/59375. Is f smaller than p? False Let q = -917 - -952. Let n be (-3138)/(-30) - (-4)/10. Suppose 3y - j - n = 0, -35 = y - 2y + 4j. Is q >= y? True Let c be ((-40)/((-1600)/210))/(75/66). Which is smaller: c or 1? 1 Suppose 26t = 44t - 3744. Suppose 3z = -2g + 431, -2g - 98 = -4z - 494. Is t smaller than g? False Let k = 26/25 + -333/200. Let o = k - -7/24. Are o and 1 unequal? True Let l = 54887/541229 - 1/6851. Let w = -7 - -6. Which is greater: w or l? l Suppose 4u - u - 10 = -k, -k + 8 = 2u. Suppose -3g + 12 = -5f, 18 = -kf + 3g + 6. Which is smaller: f or 1/318? f Let i be (-172198)/(-260) + 3/(-10). Which is bigger: i or 4638/7? 4638/7 Suppose 0 = 5p - 2p + 210. Let x be -12(p/(-15) - 1). Let t = x + 62. Is 18 at least as big as t? True Let k = -1226 + 1228. Suppose -y = -2x - 6y - 146, -154 = kx + 3y. Suppose m - 24 + 439 = -5b, 5m = 0. Is x < b? False Suppose 9q + 681 = -246. Which is bigger: q or -116? q Let o = 11771 + -2030. Is o at most as big as 9740? F	{ "pile_set_name": "DM Mathematics" }
Let f be o(-4). Suppose f = -2z + 7z. What is the tens digit of z? 2 Suppose 33p + 64 = 34p. What is the units digit of p? 4 Let u(z) = -3z + 8. What is the units digit of u(-7)? 9 Let p(c) = 13c - 27. Let i(x) = -7x + 14. Let z(o) = 11i(o) + 6p(o). Let s be z(4). What is the units digit of 1/(-2)(s - 2)? 3 Let t(j) = -j - 5. Let p be t(-8). Suppose 0 = 3s + 5q - 18, -s = pq + 2q - 6. What is the units digit of s? 6 Suppose 3q - 46 = -13. What is the units digit of q? 1 What is the units digit of (-8 + 5)/(3/(-2))? 2 Let c(j) = -7j - 1. Let d be c(-1). What is the units digit of (d + -7)/((-2)/4)? 2 Let c(p) = 6p - 21. Let d(m) = -m + 1. Let f(r) = -c(r) - 9d(r). What is the tens digit of f(7)? 3 Let l = 28 - 45. Let u = l - -28. What is the tens digit of u? 1 Let j(d) = d*2 - 8d + 1. Let c be j(9). Suppose c = w + 4. Let k(f) = f*3 - 7f*2 + 7f. What is the units digit of k(w)? 6 Let t(z) = z + 2. Let u be t(-2). Suppose -3g + 3 = u, -23 - 31 = -2c + 4g. Let h = c + -16. What is the units digit of h? 3 Let f be (-20)/3 + 3/(-9). Let o = 11 + f. Suppose -v + 56 = 3v + 2z, 2v - 38 = oz. What is the tens digit of v? 1 Let g = -8 - -19. Suppose 2q + 10 + 29 = 5w, 0 = w - 2q - g. What is the units digit of w? 7 Let k(u) = u - 4. Suppose -5j - 5 = 5. Let c be -2 + (j + -6)-1. What is the units digit of k(c)? 2 Let l be 45/102/3. Let f(i) = 8i - 8. Let z be f(7). Suppose -7q = -lq - z. What is the tens digit of q? 1 Let f = -164 + 115. Let w = f + 76. What is the units digit of w? 7 Let z = 11 + -15. Let m be (-32)/(-6) - z/(-12). Let p = 8 - m. What is the units digit of p? 3 Let l be (-6)/((-1)/31). Suppose 5w = 2w - l. What is the units digit of (-10)/15 - 64/w? 0 Suppose -3x - x + 24 = 0. What is the units digit of x? 6 Let g be 2/(-7) - 346/14. What is the units digit of 10/2(-20)/g? 4 Suppose 5j - 2j = 12. Let b(s) = s2 - 5s + 1. Let k be b(j). What is the units digit of (-1 - -1) + (-9)/k? 3 Let l(m) = m*2 - 9m - 9. Let i be l(10). Let y be 1/2(1 + -1). Let d = i - y. What is the units digit of d? 1 Let d(s) = -s - 2. Let t be d(0). What is the units digit of 40/7 - t/7? 6 Suppose 0 = 2j - 2t - 100, -3j + j = -t - 97. What is the units digit of j? 7 Let p = 3 - -75. What is the tens digit of p? 7 Let a = 20 + -12. What is the units digit of a? 8 Let m(n) = 13n2 - 3n - 3. What is the tens digit of m(-2)? 5 Let n = -5 - -8. Suppose 0 = -ni + 4h + 94, -3i = -0i + 5h - 112. What is the units digit of 2/6 + i/6? 6 Let v(x) = x3 + 7x*2 + 2x - 7. Suppose -8 - 16 = 4t. What is the units digit of v(t)? 7 Let c(l) = l3 + 7l*2 - 6l - 6. What is the tens digit of c(-5)? 7 Suppose 0 = -3b + 6, b + 2b = -5y + 616. What is the units digit of y? 2 What is the units digit of 2 - -4(-4)/16? 1 Let i(z) = -z*2 - 5z - 4. Let r = -2 + -1. What is the units digit of i(r)? 2 Let w(s) = 2s2 + 2s + 2. Let u be (3/(-2))/(12/16). What is the units digit of w(u)? 6 Let v = 23 - 13. Suppose 5z - 30 - v = 0. What is the units digit of z? 8 Suppose -l + t = 4t - 53, 2t + 316 = 5l. What is the tens digit of l? 6 Let p be 0(3 - 15/6). Suppose -5x + 15 + 5 = p. Suppose x = 2c + 4j, 9c - 5j - 85 = 4c. What is the units digit of c? 2 Let l(b) = 3b3 - b2 - b + 5. Let q(a) = a*3. Let y(j) = l(j) - 2q(j). What is the units digit of y(0)? 5 Let l(o) = o*2 + 2o - 5. Let j(y) = -y*2 + 5y + 2. Let a be j(4). Let h = a - 10. What is the units digit of l(h)? 3 Let h(p) = -p*2 - p + 47. What is the tens digit of h(0)? 4 Suppose 0 = 2f + 4n - 466, -2 - 2 = -n. What is the tens digit of f? 2 Let c(r) = -r2 + 6r + 11. Let y be c(6). Suppose 3w + y - 86 = 0. What is the units digit of w? 5 Suppose -2t = 2t + 16. Let j = t + 6. Let o = 5 - j. What is the units digit of o? 3 Suppose -2h = -5l + 10 + 5, 3l + 4h = 9. Suppose lc + 0c - 9 = 3m, 0 = 3c + 3m + 21. What is the units digit of -1 - -1 - 2/c? 1 Suppose -4h = -22 - 2. Suppose 4v - 10 = -5a, 2v - 5a - 30 = -2v. Suppose -2l + 2 + h = x, -3l - 40 = -vx. What is the units digit of x? 8 Let n be 4/(-8)0 + -20. Let j = -3 - n. What is the tens digit of j? 1 Suppose -3p + 2p + 4 = 0. Suppose -28 = -pq + 12. What is the tens digit of q? 1 Let b = -11 - -7. What is the units digit of 0 - b/(8/6)? 3 Suppose 20 = -4m - p, 2m = -0p + p - 16. Suppose -5j = -3j - 5c + 8, -2c - 4 = -2j. Let r = j - m. What is the tens digit of r? 1 Suppose -4 + 1 = -v. Let k(w) = w3 - w - 2. What is the units digit of k(v)? 2 Let i be ((-2)/(-3))/((-7)/(-630)). Suppose -7k + i = -2k. What is the units digit of k? 2 Suppose d = 3y - 8, 0d - 2d + 20 = 3y. Suppose 3p + 4s = 2s + 17, -yp + 4s = -56. What is the units digit of p? 9 Suppose 4o - 107 - 93 = 0. What is the tens digit of o? 5 Suppose 2k = -4r + 100, 2r - 30 = 2k + 32. Suppose l = 4l + r. Let y = -5 - l. What is the units digit of y? 4 Let i be (0(-3)/9)/(-3). Let g(f) = f3 + f + 10. What is the tens digit of g(i)? 1 What is the hundreds digit of 730/6 - 36/54? 1 Suppose -2x = -38 - 54. What is the units digit of x? 6 Suppose 4w + 10 = 5p, 4p = 3p + w + 2. Suppose -pm + 4m = 6. What is the units digit of 1/m - 15/(-9)? 2 Let m be 6/3(0 - -1). Suppose -2o + m = -0o. What is the tens digit of 0/1 + o - -10? 1 Suppose 5r - 20 - 145 = 0. What is the tens digit of r? 3 Let n be 1 - 2 - (-51)/3. Suppose n = -2x + 4x. What is the units digit of x? 8 Let c(x) = -x*2 + 10x + 3. Let a be c(9). What is the tens digit of ((-7)/2)/((-2)/a)? 2 Suppose -4t = 5k - 124, 2t + 7 = 2k - 39. Suppose 0 = -2s + 6s - k. What is the units digit of s? 6 Let k(g) be the second derivative of g4/12 + g3/2 + 2g2 - g. Suppose 3x = 12, -3h + 2x + 4 = 24. What is the units digit of k(h)? 8 Suppose 0h = 5h. Suppose 8 = -ha + a. What is the units digit of a? 8 Suppose 4k = -0k + n + 57, 3n = -3. What is the tens digit of k? 1 Let i(g) = -69g - 1. Let k be i(-1). Suppose -5z + 2l + 57 = 0, -4z + k = -0z + 4l. What is the tens digit of z? 1 Let w(o) be the first derivative of -o*2 - 3o - 2. Let z = -11 - -5. What is the units digit of w(z)? 9 Suppose 0 = -5c + 12 - 2. Suppose -5d = -3r + 42, -cr - 2d = -42 + 14. What is the units digit of r? 4 Let l = -10 + 30. What is the units digit of l? 0 Let j be (1/2)/((-6)/12). Let m(d) = -16d*3 + d + 1. What is the tens digit of m(j)? 1 Let k(s) = -3s*3 - 6s*2 + 3s + 2. Let m(w) = 4w3 + 5w*2 - 4w - 1. Let d(y) = -5k(y) - 4m(y). What is the units digit of d(10)? 4 Suppose -192 = -11u + 8u. What is the tens digit of u? 6 Suppose 4 = -3l + l. Let y = 11 - l. What is the tens digit of y? 1 Let h = 4 - 1. Let v(x) = 5 - hx - x + 4x + x. What is the units digit of v(6)? 1 Let d(n) = -17n - 6. What is the tens digit of d(-2)? 2 Let s(o) = o - 3. Let u be s(5). Let z(l) = -5 - 4l + 8l - ul. What is the units digit of z(6)? 7 Let b(y) = y2 - 15y + 13. Let v be b(14). What is the tens digit of 39 - (v - (-1)/1)? 3 Suppose -c + 4 = -6. Let f = 17 - c. What is the units digit of f? 7 Suppose 5w - 3w = 5j - 25, 2w = -3j - 17. Let f = 2 - w. What is the tens digit of f? 1 Suppose 5t = -3r + 46, 4r = t + 1 + 45. What is the units digit of (-32)/(-12) - (-4)/r? 3 Let p(l) = l*3 + 5l*2 + l + 7. Let c be p(-5). Suppose 2x = -cx. Let i(d) = d3 + d + 6. What is the units digit of i(x)? 6 Suppose 4 = 2p - 26. Suppose 2j + p = 59. What is the units digit of j? 2 Suppose 2i - 10 = -3i. Suppose -6 = it - 0. What is the units digit of 13 - (-1)/3t? 2 Let h(l) = -l2 - 16l - 11. What is the units digit of h(-14)? 7 Let o = 4 - -14. Suppose 2a + o = 48. Suppose 3g = a, 0r + 5r = -2g + 35. What is the units digit of r? 5 Let j = -44 + 64. What is the units digit of j? 0 Let l(m) = m2 - 5m - 10. Let a be l(7). Let s(d) = d + 9. Let o be s(0). Suppose -ak + 29 - o = 0. What is the units digit of k? 5 Suppose 0 = 3g - 5g + 66. What is the tens digit of g? 3 Let i be 16/93. Suppose -10 = -5c + 2k + k, 3c - 5 = ik. What is the units digit of c? 5 Let p(c) = 11c - 50. What is the tens digit of p(12)? 8 Suppose -3*w - 24 = -w. Let d = w + 29. What is the t	{ "pile_set_name": "DM Mathematics" }
t f = -683 + 684. Let n(z) = z*2 - 6z. Let w(q) = fb(q) - 2n(q). Let o(j) = 4j2. Give w(o(m)). 16m*4 Let w(b) = -29b*2. Let z(u) = -13420u - 13426u + 26838u. Give w(z(p)). -1856p2 Let b(o) = o + 7. Let t(n) = -n + 4. Let d(s) = 2s - 6. Let q(m) = 15m - 133. Let x be q(9). Let j(p) = xd(p) + 3t(p). What is b(j(f))? f + 7 Let v(y) = 1170y. Let k(s) = -1268s2 - 19s. What is k(v(w))? -1735765200w2 - 22230w Let r(o) = -o. Let l(k) = -4k - 93. Let v be l(-28). Let p(j) be the first derivative of 0j*2 + 0j - v - 35/3j3. Calculate r(p(u)). 35u*2 Let w(d) = -6d. Let u(i) = -106042i + 2. Give w(u(j)). 636252j - 12 Let k(z) be the third derivative of z*4/6 - 5z*2 + 406z. Let c(l) = -359l. Determine c(k(j)). -1436j Let f(r) = 2r. Let w(u) = 54u*2 - 546u + 13. Let x(c) = 26c2 - 252c + 6. Let t(g) = 6w(g) - 13x(g). Give f(t(h)). -28h2 Let l(y) = -804y - 1. Let g(q) = -28q + 3. Let b(o) = 150o - 16. Let k(i) = 3b(i) + 16g(i). Determine k(l(r)). -1608r - 2 Let u(g) = 2g + 1328. Let m(s) = 427s. Determine u(m(f)). 854f + 1328 Let h(m) = -3m. Let z(x) = -21x*2 - 29021x + 1. Calculate z(h(g)). -189g2 + 87063g + 1 Let d(a) = 9a2 - 11a. Let n(c) = -4c2 - 14c - 7. Let r = -88 + 90. Let u(q) = -q*2 - 4q - 2. Let g(v) = rn(v) - 7u(v). Determine d(g(p)). 9p4 + 11p*2 Let x(j) = 4j + 8j3 - 2j*2 - 2j*3 - 3 + 0j*3 - 5j*3. Let c be x(2). Let n(t) = -6 + 2t - c + 11. Let q(v) = 14v. Calculate n(q(r)). 28r Let s(q) = 6 + 13 - 33 - 10q + 2. Let l(r) = 21r + 28. Let x(c) = -3l(c) - 7s(c). Let g(y) = 35y. Give x(g(w)). 245w Let o(t) be the second derivative of -23t4/6 - 5t + 35. Let g(b) be the second derivative of -b*3/6 + 13b. What is g(o(k))? 46k2 Let d(n) be the second derivative of n7/1260 - n4/12 + 6n. Let k(g) be the third derivative of d(g). Let y(h) = -7 + 2h2 + 1 - 14 + 6. What is k(y(p))? 8p*4 - 112p2 + 392 Let z(p) be the third derivative of -p4/12 + 729p3/2 + 1640p*2. Let o(i) = 2i. Calculate o(z(l)). -4l + 4374 Let c(i) = -6i*2. Let u(v) be the first derivative of -19v*3/3 + 150v + 167. Let r(m) be the first derivative of u(m). Give r(c(l)). 228l2 Let w(f) = -12f. Let o(q) = 694q2 + 3659. Give w(o(l)). -8328l2 - 43908 Let o(k) be the third derivative of k5/6 - 13464k2. Let r(h) = 4h - 4h + 4h*2. Calculate r(o(g)). 400g*4 Let c(l) = 7l + 0l - 4l. Let p(y) be the third derivative of -y*6/72 - 7y*3/6 - 6y*2. Let t(g) be the first derivative of p(g). Calculate c(t(w)). -15w2 Let o(l) be the first derivative of -l4/8 + 3l2/2 - 113. Let f(g) be the second derivative of o(g). Let s(d) = 103d. Determine s(f(b)). -309b Let p be ((-176)/(-28) - 1) + (-2)/7. Suppose 3t - 81 = 3d, 2t - 17 = -pd + 16. Let y(k) = -13k - 9k + tk. Let i(r) = -18r. What is y(i(u))? -36u Let h(y) be the third derivative of -1/12y4 + y2 + 0y*3 + 0 + 0y. Let c(j) = 11j2 - 24 + 24 - 2j*2 - 7j*2. Calculate h(c(m)). -4m*2 Let d(p) = -648p. Let b(g) = 21703g. Determine d(b(j)). -14063544j Let d(r) = -14r + 12. Let y(m) = 5m*2 - 4m - 16. Let h(a) = -14a2 + 11a + 44. Let o(u) = -4h(u) - 11y(u). Determine d(o(p)). -14p2 + 12 Let n(r) = r2. Let m(i) = 724759i*2. Calculate n(m(d)). 525275608081d*4 Let r(v) = -261v. Let u(a) = -93180a2. What is r(u(n))? 24319980n2 Let z(u) be the second derivative of -u5/60 - 38u2 - u - 46. Let v(c) be the first derivative of z(c). Let h(s) = -23s - 3. Give v(h(l)). -529l2 - 138l - 9 Let k(b) = 1052b2. Let l(s) = 44s. Let x(v) = 19v. Let r(g) = -3l(g) + 7x(g). Determine r(k(o)). 1052o*2 Let f(r) = 158r*2 - 11901r. Let a(k) = -10k. Calculate f(a(d)). 15800d*2 + 119010d Let r(j) = -j2. Let a(v) be the first derivative of v2/2 - 4v - 17. Let s be a(6). Let l(d) = 15d*s + 2d*2 + 19d*2 + 0d*2. Determine l(r(q)). 36q*4 Let s(d) = -513164d + 2. Let i(q) = 4q. Give i(s(w)). -2052656w + 8 Let w(b) = 23b - 13b - 10b - 6387b*2 + 6386b*2. Let r(l) = 406l + 3. Give w(r(y)). -164836y2 - 2436y - 9 Let m(r) be the first derivative of -r*3 + 9019. Let y(u) = 1163u - 2. What is y(m(s))? -3489s2 - 2 Let x(g) = -16g*2. Let s(j) be the third derivative of 0j + 1/30j5 + 0j*3 + 0 - 52j*2 + 0j*4. Calculate x(s(r)). -64r*4 Let o be (48/(-15) + 0)/((-14)/31640). Let i(r) = o - 7232 - r. Let b(l) = 7l - 5. Give b(i(j)). -7j - 5 Let d be 3275/60 + 1/4. Suppose 0 = -dr + 9r + 55. Let x(f) = -24f + rf + 48f. Let m(k) = -2k. Calculate m(x(l)). -70l Suppose -7h - 38h = -24h. Let f(w) be the third derivative of -9/10w5 + 2w*2 + 0w + 0w3 + h + 0w*4. Let n(s) = -2s*2. Give f(n(a)). -216a*4 Let r(s) = -s + 41. Let z(y) = 38y - 1149. Determine z(r(w)). -38w + 409 Let n(q) = 218q. Let u(a) = -646145a - 5a*2 + 646145a. What is u(n(j))? -237620j2 Let o = 607 + -74. Let b(t) = o - 6t - 533. Let k(y) = -17y. Calculate b(k(q)). 102q Let k(v) = 61v2. Let y(x) = 2x*2 + 2x + 4. Let a(j) = 15j2 + 14j + 39. Let q(b) = -2a(b) + 14y(b). Determine q(k(s)). -7442s4 - 22 Let s(f) = f - 96. Let w(d) = 18694d*2 - d. Determine s(w(h)). 18694h*2 - h - 96 Let a(f) = -2f. Let n(q) = 18 + 8 - 47 - 40 + 2q2. Give a(n(l)). -4l2 + 122 Let g(k) = k2. Let m(f) be the first derivative of -1425f3 + 2846. Calculate g(m(y)). 18275625y*4 Let r(f) = f. Let n = 42 + -17. Let w be ((-20)/4)/n + (-11)/(-5). Let y(g) = 2 - w - 89g + 92g. Calculate y(r(a)). 3a Let x(u) = -13u2. Let l(z) be the first derivative of 39z*2/2 + 2z - 2391. Determine l(x(k)). -507k2 + 2 Let n(h) = -7788592h*2. Let i(g) = -9g. Calculate i(n(j)). 70097328j2 Let l(j) = -1279j*2. Let m(q) = -79263q. Give l(m(x)). -8035475033151x2 Let f(n) = -80n. Let z(c) = 16c + 115. Let o(d) = -45d - 325. Let m(b) = 6o(b) + 17z(b). Determine m(f(r)). -160r + 5 Let y(p) = -1838p - 112. Let t(v) = -8v + 26. Calculate y(t(h)). 14704h - 47900 Let d(l) = -74l. Suppose 1513 = -197j + 2301. Let r(b) be the second derivative of 0b3 + 18b + 0 - 1/12bj + 0b*2. What is r(d(p))? -5476p*2 Let c be 354 - (-5 - 0 - -4)-4. Let w(g) = -cg + 177g + 171g. Let y(n) = -93n*2. Calculate y(w(s)). -372s*2 Let v(x) = 3x. Let i(o) = 59o2 - 32o + 8. Let u(p) = 1887p2 - 1020p + 255. Let k(m) = 255i(m) - 8u(m). Calculate k(v(g)). -459g2 Let g(i) = -4i - 868035. Let w(t) = 3t2. Give g(w(x)). -12x*2 - 868035 Let p(d) = 278d. Let l(o) = -40o - 943. Calculate l(p(x)). -11120x - 943 Let o(v) be the third derivative of -23v5/15 - 2000v*2. Let a(f) = 6f*2. What is o(a(w))? -3312w*4 Let r(h) = -h + 121. Let m(p) = 2p + 3678. Determine m(r(k)). -2k + 3920 Let x(l) = -l2. Let w(a) = -2a*2 + 8a + 11344. Determine w(x(d)). -2d4 - 8d2 + 11344 Let x(l) be the second derivative of -l4/6 + 130l - 5. Let i(b) = -1 - 9b*2 + b - 14b*2 - b. What is i(x(p))? -92p*4 - 1 Let h(y) = 3y*2. Let z(g) = 26140774g. What is z(h(d))? 78422322d2 Let c(o) = -62 + 2o*2 - 52 + 114 + 6o*2. Let t(m) = -96m. What is c(t(y))? 73728y2 Let j(d) be the first derivative of 67d*2 + 1. Let i(b) = 4b - 15. Let s(z) = -5z + 18. Let n(h) = 6i(h) + 5s(h). Determine j(n(m)). -134m Let u(r) be the first derivative of r*3/3 - 66r - 89. Let w(o) be the first derivative of u(o). Let a(k) = -87k. What is a(w(q))? -174q Let m(f) = 4f - 359. Let t(q) = 8628q. Give m(t(y)). 34512y - 359 Let v(p) = 2222631p + 6. Let i(t) = -8t. What is v(i(g))? -17781048g + 6 Let g(p) = 5p. Let n(f) = -f + 473923. What is n(g(v))? -5v + 473923 Let q(k) = -400k2. Let v(g) = 66046g - 2. Calculate v(q(b)). -26418400b2 - 2 Let k(s) = 3928s + 75 - 1964s - 1962s. Let i be (-2)/(-4) + 31/2. Let m(u) = -38u + iu + 20u. What is m(k(c))? -4c - 150 Let p(k) = -2k2. Let m(w) be the first derivative of 2/3w*4 + 11w + 14 + 0w3 + 0w*2. Let b(j) be the first derivative of m(j). Calculate b(p(n)). 32n4 Let v(q) be the third derivative of -q5/60 - 230q2. Let i(r) = 51r - 6. Calculate i(v(z)). -51z2 - 6 Let k(m) = -54m**2. Let o(n) be the second d	{ "pile_set_name": "DM Mathematics" }
((w/w*5)/ww))45 assuming w is positive. w288 Simplify ((hh0)/(h/(h/(h(7/5)/h))))/(hh*(-1/4)(h/((h/h*(4/5))/h)h)/h) assuming h is positive. h*(-39/20) Simplify (((b/(bb*(-6)b))/b)/(b*(2/7)/bb))/(b/(b/b*(2/9)b)b/(b/b(-1/8))) assuming b is positive. b(2327/504) Simplify (j(1/6)j)(4/17) assuming j is positive. j(14/51) Simplify ((r(-11)/r)/r)(13/4) assuming r is positive. r(-169/4) Simplify s(-1/10)/(sssss*(-1/10)s) assuming s is positive. s(-5) Simplify (i(-1/6)/i)/((i/(iii*(3/11)))/ii) assuming i is positive. i(7/66) Simplify (u(3/8)u(-6)/u)(-40) assuming u is positive. u265 Simplify (s/(ss(-1)))38ss*(-4/9)s*(-6)s assuming s is positive. s*(302/9) Simplify (dd(dd9/d)/d)(21/8) assuming d is positive. d*(105/4) Simplify (z/(z/(z(z/z5)/z)))/(((z(-3/5)z)/z)/z) assuming z is positive. z(-12/5) Simplify c(-23)/(c(-2/21)/c) assuming c is positive. c(-460/21) Simplify (((d(2/13)/d)/d)/d)(-1/30) assuming d is positive. d(37/390) Simplify (j/(j/j(1/2)))(4/13)/(((((j/((j(-2/5)/j)/j))/j)/j)/j)/jj)(-3/7) assuming j is positive. j(148/455) Simplify (p*(-4)ppp(-1/4)/p)/(p(-1)pp/(p/p0)) assuming p is positive. p(-13/4) Simplify g*(-1)g*(-2/23)/g(g0)(4/29) assuming g is positive. g(-48/23) Simplify (x(2/3))*0/((xx*(1/9))/xx/x0) assuming x is positive. x(-10/9) Simplify (m/m*(2/3)m/(m/(m/(mmmm(-6)))))/(m5/m(-3)) assuming m is positive. m(-11/3) Simplify ((z/(z/z(6/5)z))/zz)/(z/z(-2/21)z)(z((z/(z*(-2/5)z)z)/zz)/z)(-11) assuming z is positive. z(-1816/105) Simplify (i1/i)/(i/((i7ii)/ii))(ii(-2/5))/(i/((ii3)/i)) assuming i is positive. i(53/5) Simplify (j(j(7/3)/jj)/jjj)18 assuming j is positive. j78 Simplify (ccc8)(-25) assuming c is positive. c*(-250) Simplify z/(zz*17)z/z(-8) assuming z is positive. z(-8) Simplify (g(-1/3))(5/3) assuming g is positive. g*(-5/9) Simplify (((h/(hh*1h))/h)/(h/h0))33 assuming h is positive. h*(-132) Simplify (q/(q/(q/(q(qq(1/34))/q))))(-2/27) assuming q is positive. q(1/459) Simplify d(-3/32)/(dd(-11/2)) assuming d is positive. d(141/32) Simplify y*(-3/4)(y/(y/(yy(5/4))))/yyy assuming y is positive. y(5/2) Simplify v3v/(vv5v)v(-1/2)(v/(vv/(v/((v/(v(1/4)/v))/v))))/vv assuming v is positive. v*(-17/4) Simplify (gg/(g/g(-1/4)))(-13/3)/(g(1/4))(1/3) assuming g is positive. g(-10/3) Simplify (u/(u/(u(2/23)uu)u))/(u/u(-33)) assuming u is positive. u(-757/23) Simplify (o(3/7)o)/ooo/(o*(-1/2)ooo)o/(o(o/(oo(-2/27)))/o)((oo(3/4))/o)/o assuming o is positive. o(457/756) Simplify (j(16/5)/j)(-1) assuming j is positive. j(-11/5) Simplify ((p/(p3/p)p)/(p/(pp(2/11)p)))/((pp1)/(p/p(1/2))) assuming p is positive. p(-7/22) Simplify (h(((h*(-1/11)h)/h)/h)/h)(-5/8) assuming h is positive. h(15/22) Simplify ((o*(-8)/oo)/ooo/(oo(o/(o/o(-3/2)))/o))/(o0o)(2/23) assuming o is positive. o(-303/46) Simplify ((((w/w(2/45))/w)/w)/(w(-1/5)w))(10/7) assuming w is positive. w(-166/63) Simplify (a(-1/3)/a)(2/23)(a/a(-1/5)a)/(a2/a) assuming a is positive. a(374/345) Simplify ((h*(2/9)h)/h)(-41) assuming h is positive. h(-82/9) Simplify ((s*(-3/2)s)(-3/5))(-3/5) assuming s is positive. s*(-9/50) Simplify (vv*(-2)v*(-6)/v)/((vvv/(v(-4/3)v)v)/((vvv(1/3))/vv)) assuming v is positive. v*(-10) Simplify ((tt*(1/6)t)/(t*4t))/(tt(2/3)t6) assuming t is positive. t(-21/2) Simplify (k/(kkk*(-1/4)k))(13/2) assuming k is positive. k(-91/8) Simplify ((dd(d/(dddd/(((d2d)/d)/d)d))/d)(-31))18 assuming d is positive. d1116 Simplify (c(1/12)/c)/(c30/cc) assuming c is positive. c*(-371/12) Simplify (ww(2/3))(-35)(www/(((w5ww)/w)/w)w)/(ww(w*(1/2)ww)/w) assuming w is positive. w(-377/6) Simplify aa*(1/7)a*(-1)a assuming a is positive. a*(8/7) Simplify ((oo*6)/oo*(3/11)o)25 assuming o is positive. o(2000/11) Simplify (v/(v((v/(v0/v))/v)/vvv)v*3v)(-4/7) assuming v is positive. v(-8/7) Simplify l*7l*(7/10)l assuming l is positive. l(87/10) Simplify c(-5)c5 assuming c is positive. 1 Simplify ((u/u2)33)(3/11) assuming u is positive. u(-9) Simplify ((r(8/7)/r)/(r(-2/23)/rr))(1/36) assuming r is positive. r(37/5796) Simplify (hh/h(3/2)hh)/h(-7)(h/(h(-1/3)/h))(7/2) assuming h is positive. h*(53/3) Simplify (tt*(-2/25)t)/((t/(t*(2/17)t))/t) assuming t is positive. t(1291/425) Simplify o(-1/21)/o11 assuming o is positive. o(-232/21) Simplify (a(-1))(-20)/((aa(a*(-3/5)a)/aaaa)/aa*(-1/4)a) assuming a is positive. a(317/20) Simplify a(-17)a(-25)a assuming a is positive. a(-41) Simplify ((q/(q/(q(-1/6)q)))/(q(-2/3)q))/(q(-2))(13/4) assuming q is positive. q7 Simplify b/(b/(b(-20)b))b11/b assuming b is positive. b(-9) Simplify (n/(n/(n*1/n))(nnnn5)/n)/(n(-7)/(n(-2/5)/n)) assuming n is positive. n(63/5) Simplify s/(s/(s(-50)s))(ss*(-5)s)/s assuming s is positive. s(-53) Simplify y24y21 assuming y is positive. y45 Simplify ((l(2/9))(3/5))(5/9) assuming l is positive. l(2/27) Simplify ((b(1/4))(28/5))(2/45) assuming b is positive. b(14/225) Simplify (l(ll9l)/l)/((l/(ll(2/13)))/l) assuming l is positive. l(158/13) Simplify f(-5)/(ff(-10)) assuming f is positive. f4 Simplify l*20ll/(l/l(-2/9)l) assuming l is positive. l(178/9) Simplify ((g/(g/(g(2/19)g)))/g(2/5))/(g(-5)g*(2/7)g) assuming g is positive. g(2939/665) Simplify (h/h(1/3)h)(-16)/(h(-1/2))(-9) assuming h is positive. h(-187/6) Simplify b(-4)/(b/(b(-14)/b)b) assuming b is positive. b(-21) Simplify (x/x(-9)x(2/5))(-2/93) assuming x is positive. x(-104/465) Simplify ((ll/l*4l)/(l(l/l(2/11)ll)/ll))49 assuming l is positive. l(-2597/11) Simplify ((n/(n/(n(n/(nn/(n*6n)))/n)))/(nn0))/(nn*(2/5)n)(1/12) assuming n is positive. n(24/5) Simplify (jjjj/(j(-1)j))*(24/7)(jj(2/9)jj)/(j/(((jjj(-2/3))/jj)/j)) assuming j is positive. j(1025/63) Simplify (i/((i/(i(-24)/i))/i))/(i/(((ii/i(6/13)ii)/ii)/i)) assuming i is positive. i(-292/13) Simplify x(-18)/x(-19) assuming x is positive. x Simplify (q/q(2/9)q)/q(2/5)q2/((q5q)/q) assuming q is positive. q(-73/45) Simplify (h(-1)/h)(5/8)/(h(-6)h8) assuming h is positive. h(-13/4) Simplify ((p(-3))(1/5))(23/4) assuming p is positive. p(-69/20) Simplify (zz/z(-1/3)z)/z*(-1/3)z(-2)/z(-2) assuming z is positive. z(11/3) Simplify (c/c(-2/5))(-21) assuming c is positive. c(-147/5) Simplify yy29y*35y assuming y is positive. y*66 Simplify ((i/(i/(ii*1)ii))/(i/i3))40 assuming i is positive. i80 Simplify ((l/(((l/l(-1/7))/l)/l))/ll(-2))(-17) assuming l is positive. l*(136/7) Simplify ((y((y*(1/6)y)/y)/y)/y)/(y/y*(1/6))y*(-1/9)yyy/(y/y(-5)) assuming y is positive. y(-43/9) Simplify (uu(7/9)u)/u(-1) assuming u is positive. u(34/9) Simplify (z1/(z5/zzz))(9/2) assuming z is positive. z(-45/2) Simplify (a/(a/(a/a*(-4)))a/(a/a7))/(a(-1/2)a/(aaa/(a(3/4)/a)a)) assuming a is positive. a(63/4) Simplify (r/(r/((r(-1/5)rr)/r))r(-5))3 assuming r is positive. r(-63/5) Simplify (d(6/5)d(-2/27))/(d(2/9)d)(-1/34) assuming d is positive. d(5333/4590) Simplify l(5/4)/(l/((l0/l)/l))l*(-1/2)(l*(-1)l)/ll assuming l is positive. l(-9/4) Simplify (b(2/5)bb/((b/(b/(bb*(2/3)b)))/b))6 assuming b is positive. b(22/5) Simplify (u/((u*(-20)/u)/uu))(-2/9) assuming u is positive. u(-44/9) Simplify (b*(1/10)b)(3/26) assuming b is positive. b(33/260) Simplify (u*34u)/(u*22u) assuming u is positive. u12 Simplify ((g(4/9))(-50))14 assuming g is positive. g(-2800/9) Simplify (t(-2/3))(-1/39)/(t5t/t(-2/13)t) assuming t is positive. t(-835/117) Simplify z(-2/9)z3(z/((z/(z/(zz((z/(z/z*(-2/15)))/z)/zzzz))	{ "pile_set_name": "DM Mathematics" }
integer? 39 What is the square root of 25090431 to the nearest integer? 5009 What is the cube root of 3940994 to the nearest integer? 158 What is 3952252 to the power of 1/2, to the nearest integer? 1988 What is the cube root of 888387 to the nearest integer? 96 What is the cube root of 324792 to the nearest integer? 69 What is the ninth root of 8883329 to the nearest integer? 6 What is the third root of 9455111 to the nearest integer? 211 What is the square root of 716206 to the nearest integer? 846 What is 24436833 to the power of 1/2, to the nearest integer? 4943 What is 612338 to the power of 1/5, to the nearest integer? 14 What is 2451126 to the power of 1/6, to the nearest integer? 12 What is 2919584 to the power of 1/4, to the nearest integer? 41 What is the eighth root of 34615690 to the nearest integer? 9 What is the fourth root of 5209705 to the nearest integer? 48 What is 344568 to the power of 1/2, to the nearest integer? 587 What is 1891977 to the power of 1/10, to the nearest integer? 4 What is the fifth root of 2973164 to the nearest integer? 20 What is 80784 to the power of 1/2, to the nearest integer? 284 What is 759548 to the power of 1/7, to the nearest integer? 7 What is 6854374 to the power of 1/3, to the nearest integer? 190 What is 1289115 to the power of 1/2, to the nearest integer? 1135 What is the third root of 21396249 to the nearest integer? 278 What is 14052819 to the power of 1/8, to the nearest integer? 8 What is the ninth root of 312895 to the nearest integer? 4 What is 10872257 to the power of 1/8, to the nearest integer? 8 What is the ninth root of 625556 to the nearest integer? 4 What is the cube root of 6090981 to the nearest integer? 183 What is 5117007 to the power of 1/2, to the nearest integer? 2262 What is 183924 to the power of 1/4, to the nearest integer? 21 What is 1610173 to the power of 1/8, to the nearest integer? 6 What is 218721 to the power of 1/2, to the nearest integer? 468 What is the seventh root of 611042 to the nearest integer? 7 What is 67581 to the power of 1/2, to the nearest integer? 260 What is the third root of 10461311 to the nearest integer? 219 What is the cube root of 384668 to the nearest integer? 73 What is the third root of 376482 to the nearest integer? 72 What is the third root of 9900430 to the nearest integer? 215 What is the cube root of 4607 to the nearest integer? 17 What is the square root of 8088169 to the nearest integer? 2844 What is 165213 to the power of 1/3, to the nearest integer? 55 What is the third root of 36069824 to the nearest integer? 330 What is the eighth root of 746970 to the nearest integer? 5 What is the cube root of 140364 to the nearest integer? 52 What is the ninth root of 2667556 to the nearest integer? 5 What is 417644 to the power of 1/2, to the nearest integer? 646 What is the fourth root of 241992 to the nearest integer? 22 What is the square root of 3304604 to the nearest integer? 1818 What is the third root of 4172609 to the nearest integer? 161 What is 306995 to the power of 1/5, to the nearest integer? 13 What is the square root of 2717160 to the nearest integer? 1648 What is the square root of 5581428 to the nearest integer? 2363 What is the square root of 212107 to the nearest integer? 461 What is the third root of 15903092 to the nearest integer? 251 What is the fifth root of 18424346 to the nearest integer? 28 What is 2153449 to the power of 1/3, to the nearest integer? 129 What is 208739 to the power of 1/5, to the nearest integer? 12 What is the third root of 8694801 to the nearest integer? 206 What is the tenth root of 219986 to the nearest integer? 3 What is the square root of 337991 to the nearest integer? 581 What is 9018153 to the power of 1/7, to the nearest integer? 10 What is the square root of 169358 to the nearest integer? 412 What is the fifth root of 363589 to the nearest integer? 13 What is the ninth root of 287615 to the nearest integer? 4 What is 1484314 to the power of 1/10, to the nearest integer? 4 What is the cube root of 1515741 to the nearest integer? 115 What is 3139470 to the power of 1/2, to the nearest integer? 1772 What is the seventh root of 1493152 to the nearest integer? 8 What is the seventh root of 1996878 to the nearest integer? 8 What is the square root of 5316163 to the nearest integer? 2306 What is 751484 to the power of 1/2, to the nearest integer? 867 What is the ninth root of 2179656 to the nearest integer? 5 What is the third root of 9061099 to the nearest integer? 208 What is 529726 to the power of 1/2, to the nearest integer? 728 What is 160914 to the power of 1/2, to the nearest integer? 401 What is 1618146 to the power of 1/3, to the nearest integer? 117 What is the cube root of 32962389 to the nearest integer? 321 What is the square root of 100434 to the nearest integer? 317 What is the fourth root of 11126378 to the nearest integer? 58 What is 3037839 to the power of 1/4, to the nearest integer? 42 What is the cube root of 1650743 to the nearest integer? 118 What is 1322068 to the power of 1/4, to the nearest integer? 34 What is the square root of 34839409 to the nearest integer? 5902 What is 3997651 to the power of 1/3, to the nearest integer? 159 What is the square root of 5636634 to the nearest integer? 2374 What is the fifth root of 501856 to the nearest integer? 14 What is the cube root of 1255467 to the nearest integer? 108 What is the square root of 186575 to the nearest integer? 432 What is 498768 to the power of 1/7, to the nearest integer? 7 What is the square root of 1396453 to the nearest integer? 1182 What is the seventh root of 953538 to the nearest integer? 7 What is 700321 to the power of 1/6, to the nearest integer? 9 What is 1586812 to the power of 1/7, to the nearest integer? 8 What is the square root of 3674429 to the nearest integer? 1917 What is 6215769 to the power of 1/3, to the nearest integer? 184 What is 29530826 to the power of 1/2, to the nearest integer? 5434 What is the square root of 179342 to the nearest integer? 423 What is the fifth root of 111432 to the nearest integer? 10 What is the seventh root of 63391 to the nearest integer? 5 What is 2633141 to the power of 1/3, to the nearest integer? 138 What is the square root of 141850 to the nearest integer? 377 What is 7022278 to the power of 1/6, to the nearest integer? 14 What is the ninth root of 1046573 to the nearest integer? 5 What is the square root of 216381 to the nearest integer? 465 What is the seventh root of 3384020 to the nearest integer? 9 What is 1032650 to the power of 1/8, to the nearest integer? 6 What is the cube root of 143538 to the nearest integer? 52 What is 183360 to the power of 1/3, to the nearest integer? 57 What is 4458285 to the power of 1/2, to the nearest integer? 2111 What is the square root of 853827 to the nearest integer? 924 What is the square root of 7450494 to the nearest integer? 2730 What is 816714 to the power of 1/4, to the nearest integer? 30 What is the cube root of 468797 to the nearest integer? 78 What is the fifth root of 117176 to the nearest integer? 10 What is the cube root of 195702 to the nearest integer? 58 What is the fifth root of 608493 to the nearest integer? 14 What is 2453842 to the power of 1/2, to the nearest integer? 1566 What is the fifth root of 750756 to the nearest integer? 15 What is the sixth root of 2456518 to the nearest integer? 12 What is the ninth root of 1797042 to the nearest integer? 5 What is the eighth root of 2907178 to the nearest integer? 6 What is the square root of 14212731 to the nearest integer? 3770 What is the cube root of 145084 to the nearest integer? 53 What is the fourth root of 142079 to the nearest integer? 19 What is the square root of 303874 to the nearest integer? 551 What is 186838 to the power of 1/10, to the nearest integer? 3 What is 9589621 to the power of 1/3, to the nearest integer? 212 What is the cube root of 944443 to the nearest integer? 98 What is 23026492 to the power of 1/3, to the nearest integer? 284 What is the square root of 113073 to the nearest integer? 336 What is 9602346 to the power of 1/2, to the nearest integer? 3099 What is the cube root of 249645 to the nearest integer? 63 What is	{ "pile_set_name": "DM Mathematics" }
)/sqrt(7)) - (3sqrt(2592) + sqrt(2592) + sqrt(2592) + sqrt(2592)))/(-3sqrt(36)/(2sqrt(4)3)). 144sqrt(2) Simplify (5(sqrt(1815) - 5sqrt(1815)-1)/(sqrt(35)/(sqrt(63)/sqrt(144)))6)2-3. -2205225 Simplify (3 + 1(-1 + sqrt(275) + 5 - -51sqrt(275)) + 2 + -4)2. 300sqrt(11) + 9925 Simplify -2(6sqrt(850))/sqrt(2) - (2sqrt(170)-4)/(sqrt(40) - (sqrt(360) - sqrt(40))). -64sqrt(17) Simplify 0 + -6(sqrt(196)/sqrt(7) + (sqrt(14)1)/sqrt(2))2 + ((0 + sqrt(7))-4 + (2sqrt(77))/sqrt(11))2. -350 Simplify (sqrt(170) + (sqrt(170)14 - sqrt(170)))/(42sqrt(10)) - (-2 + (1(sqrt(17) + -2) - 5(sqrt(17) + -1))2). -279 + 49sqrt(17)/2 Simplify -5(-3(0 + sqrt(243) + 3 + (1 + sqrt(243))3 + (1 + (sqrt(243)-2 - sqrt(243)))-2))2. -1094220 - 32400sqrt(3) Simplify (((2(sqrt(99)-2 - sqrt(99)) - sqrt(99) - sqrt(99)) + (sqrt(99) - (-2sqrt(99) - sqrt(99))2 - sqrt(99)))-2)/(-4sqrt(900)3-2). sqrt(11)/60 Simplify (sqrt(96)2-4 + sqrt(96) + (-1sqrt(96)-1 + sqrt(96) - sqrt(96)))/(sqrt(48) - 5(sqrt(48) - sqrt(288)/sqrt(6))). -6sqrt(2) Simplify -2 + (5(sqrt(168)/sqrt(4) - sqrt(42))-6)/(sqrt(864)-11 - sqrt(864) - sqrt(864))3. -2 Simplify (sqrt(18) + sqrt(882)-2 + 2 + sqrt(162))*2 + 0 + 1 + sqrt(2) + (sqrt(20)-2)/sqrt(10) + sqrt(2) + -4. -120sqrt(2) + 1801 Simplify (((sqrt(1300)2 + -3)6 + -4 - (sqrt(1300) + (sqrt(1300)4 + 4 - sqrt(1300)) + 4 + (1sqrt(1300) - sqrt(1300)) + sqrt(1300))) + -1)2. -4340sqrt(13) + 64661 Simplify (62sqrt(735))/(-6sqrt(48) - sqrt(6)/sqrt(2)-4) + 5. -21sqrt(5)/5 + 5 Simplify (3(-3sqrt(648)/sqrt(12))/sqrt(2)6 + 0)1. -162sqrt(3) Simplify 4 + (0 + sqrt(108))2 - ((sqrt(1089) - 1sqrt(1089)) + sqrt(1089))/(sqrt(3) + sqrt(135)/sqrt(5)). 4 + 37sqrt(3)/4 Simplify -5 + (-2(sqrt(152) - (sqrt(152) - -1sqrt(152))) - sqrt(152))/(sqrt(968)-5)4. -5 - 4sqrt(19)/55 Simplify -4 + (4(sqrt(65) + sqrt(65)1))/(sqrt(125)1) - sqrt(65)/(sqrt(5) + sqrt(605)-1)6-4. -4 - 4sqrt(13)/5 Simplify (3(sqrt(396)-11 + -2 + 1 + (sqrt(396) - ((sqrt(396) + sqrt(396)2 - sqrt(396)) + -2))))2. -216sqrt(11) + 14265 Simplify ((-3sqrt(88)-3)/(sqrt(11) + -3sqrt(176)) + -5)-2. 36sqrt(2)/11 + 10 Simplify (sqrt(44) - (4 + sqrt(44)))2 - (sqrt(11) + -1 + -4) - (5sqrt(891)41)*2. -356379 - sqrt(11) Simplify -2 + (-1 + (sqrt(396) - (2 + sqrt(396)) - sqrt(11)) - (4sqrt(33)/sqrt(3) + 4(sqrt(22)/sqrt(2))2)). -49 - 5sqrt(11) Simplify (-22(3 + (1sqrt(1377) + 3 - (-1sqrt(1377) + -4)) + 5))*2-4. -366912 - 34560sqrt(17) Simplify 5(-5((sqrt(30)-2 - sqrt(30))-64)/(sqrt(12)/sqrt(2)-1 + sqrt(60)/(2sqrt(10))) + -1). -5 + 3600sqrt(5) Simplify 2(3(6(3 + -2 + sqrt(7) + sqrt(567)/sqrt(9) + sqrt(7)) + -5)2)2. 4320sqrt(7) + 453672 Simplify -3((sqrt(1008)3 - sqrt(1008) - sqrt(1008)) + 2 + (sqrt(77) + (sqrt(77) - -61sqrt(77)) - sqrt(77))/sqrt(11) + -4). -57sqrt(7) + 6 Simplify (-4 + (sqrt(847)-2 + sqrt(847))3)2 + -4 + -3sqrt(112) + sqrt(21)/(sqrt(3)-1 - sqrt(3)). 503sqrt(7)/2 + 7635 Simplify -1 + 1(-1sqrt(245))*2 + 2 + sqrt(60)/(sqrt(12)2) + -2. sqrt(5)/2 + 244 Simplify (sqrt(252)/(sqrt(48)/sqrt(4)))/(-2sqrt(75)) - (4 + (sqrt(1008)2 - sqrt(1008)) + -5). -121sqrt(7)/10 + 1 Simplify -4(((sqrt(475) + -3 - sqrt(475))-6)2 - (4 + sqrt(38)/sqrt(2) - (sqrt(19) + ((sqrt(95)-2 - sqrt(95)) + sqrt(95))/sqrt(5)))*2) + 4. -924 + 64sqrt(19) Simplify -2(((sqrt(80) + 1 + sqrt(80) + -4)2 - (sqrt(80) + -5 + sqrt(80)2)) + (1(sqrt(80) + -2))22). -1004 + 184sqrt(5) Simplify (3(4 + -2sqrt(588)-1) + -3)-4. -336sqrt(3) - 36 Simplify (-4 + (5sqrt(133)/(-2sqrt(7)) + -4)-23 + -2)*2. 540sqrt(19) + 4599 Simplify 0 + -6(sqrt(448) + -4 + 1 + sqrt(448))2 + 5 + 4 + 4. -10793 + 576sqrt(7) Simplify 2 + sqrt(153) + -6((sqrt(153) - (-3 + sqrt(153))) + sqrt(153) - sqrt(153)) - (-5 + ((sqrt(153) - (-3 + sqrt(153))) + -2)2). -12 + 3sqrt(17) Simplify (sqrt(50)5)2-33 - (-1-2sqrt(2) - sqrt(882)/sqrt(9)). -11250 + 5sqrt(2) Simplify 2((2 + (sqrt(2299) - (sqrt(2299)-3 + 4)) + -2 + 6sqrt(2299)-3)-2)2. 9856sqrt(19) + 3604960 Simplify (sqrt(1872)3 - (sqrt(143)-2 + sqrt(143) - sqrt(143) - sqrt(143))/sqrt(11))-1 - (-4 + (sqrt(65)/(4sqrt(20)))*2-2). -39sqrt(13) + 141/32 Simplify -6(-1 + (5 + sqrt(108)1)6-3)25-3. 1769040sqrt(3) + 3894570 Simplify 2 + (-5 + 6(sqrt(3) + ((sqrt(3) + -1 - sqrt(3))-6 - sqrt(3)) - sqrt(3) - (sqrt(3) + (sqrt(3) - (-2 + sqrt(3) + 1)))) + 3)*2 + -3. -672sqrt(3) + 1215 Simplify ((sqrt(245) + (-2sqrt(245) + -5 - sqrt(245) - sqrt(245)))-6 + sqrt(245) + 0 + sqrt(245)1 + sqrt(245) + -3 + 2)2. 8526sqrt(5) + 108886 Simplify (5(-6((sqrt(2448) - (sqrt(2448) + -1)) + 2 + sqrt(2448)) + -5 + (1 + sqrt(2448)3 - sqrt(2448))))25. 264000sqrt(17) + 4956500 Simplify (sqrt(605)4)*225 + 2((-2 + sqrt(605) + -1)*2 + sqrt(605)) + -5. -110sqrt(5) + 98023 Simplify 2 + (-1 + ((6((sqrt(1216) - (sqrt(1216)3 - sqrt(1216))) + sqrt(1216)) + sqrt(1216))*2 - (sqrt(171) + 4)6))4. -72sqrt(19) + 4766 Simplify -4 + (-3(sqrt(35) + (sqrt(35) - (sqrt(1260) - 2sqrt(1260))) - sqrt(35)))/(sqrt(35)/(sqrt(20)/sqrt(4))-1) + -5. -9 + 21sqrt(5) Simplify -6(-3 + ((2sqrt(171)1 - 6(sqrt(171) + -2sqrt(171)))/(-3(-3(sqrt(9) - sqrt(36)) - sqrt(9))))2). -554/3 Simplify (sqrt(833) + 0 + -3 + -1(sqrt(833) + 1))*2 + 2 + ((sqrt(17) + sqrt(272))-3)*2 + (sqrt(17) - (1 + sqrt(17)))6. 3837 Simplify (-6sqrt(110)-2)/((sqrt(70)-2)/sqrt(7)) - 6(0 + ((sqrt(110)1)/sqrt(10))2). -66 - 6sqrt(11) Simplify (sqrt(144)/sqrt(4))/(sqrt(84)/sqrt(7) - sqrt(3)) - (((sqrt(144)/sqrt(6))/sqrt(8))*2 - (sqrt(3) + (sqrt(3) + (-4sqrt(432) - sqrt(432)))*2)). 3sqrt(3) + 10440 Simplify 2 + 1 + -4 + (2(-2sqrt(825) + sqrt(825)))/((6sqrt(162))/sqrt(6)). -5sqrt(11)/9 - 1 Simplify 2(-3((3 + -1 + sqrt(343) - sqrt(343)) + -6(sqrt(343) - (0 + sqrt(343))))-6-4)2 + 1. 41473 Simplify ((0 + (sqrt(1215)1)/sqrt(3))*2 - (-5sqrt(540))/(sqrt(12) - (sqrt(12) + -5sqrt(108))))-2. -810 - 2sqrt(5) Simplify (32(sqrt(56)6)/sqrt(4))/(-2(sqrt(2) + sqrt(2) + sqrt(18)/(sqrt(9)-4) + sqrt(2))-4). 18sqrt(7)/11 Simplify 0 + 4 + ((sqrt(133) + sqrt(133) + sqrt(133)-2-3 + sqrt(133))4)/(sqrt(56)/(2sqrt(8)) + -1sqrt(175)). -8sqrt(19) + 4 Simplify ((sqrt(91)/(sqrt(14)/sqrt(2)) - -2sqrt(13)1) + -6((sqrt(325))2 + 1))3-4-3. -70416 + 108sqrt(13) Simplify 1((sqrt(196) - -11sqrt(196) - (sqrt(196) + sqrt(196) + sqrt(196) + 6-2sqrt(196)))/(sqrt(21)/(sqrt(3)2)-33))2. 13552/81 Simplify (-1((sqrt(180)5 + sqrt(180) + 2 + (-6sqrt(180)-2 - sqrt(180)))-5 + -5)2)2. 61200sqrt(5) + 5202900 Simplify ((1 + sqrt(405) + 5 - sqrt(405)) + -5 - (5 + sqrt(40)/sqrt(128)6)) + 3. -3sqrt(5)/2 - 1 Simplify (-5 + (sqrt(363) + 0 + sqrt(363) + -3 + sqrt(363))*2 - (-1 + 62(2 + sqrt(3))2)) + -4. -246sqrt(3) + 3184 Simplify ((sqrt(119) - (sqrt(119) - -32sqrt(119)) - sqrt(119)) + (sqrt(119) - sqrt(119)-2)-1)/(-2(sqrt(175) + sqrt(175)-3))-2. sqrt(17) Simplify 2 + ((sqrt(38) - (sqrt(152) + (sqrt(152) - sqrt(152)-3 - sqrt(152)))/sqrt(4) - sqrt(304)/(sqrt(8)4))/(3-2-6sqrt(8)/sqrt(4)))*2. 44683/20736 Simplify (6(((1sqrt(98) + 2)1 - (sqrt(98)1-2 + sqrt(98)-2 + 1)) + 3))2. 10080sqrt(2) + 88776 Simplify (-6(sqrt(176) + 2 + -2 - sqrt(176))2 + (sqrt(176))2 + -3 + (sqrt(11) - (sqrt(11) - (sqrt(11) + (2sqrt(176) - sqrt(11))))*2))1. -366 + sqrt(11) Simplify (1(-1 + sqrt(605) + -5))2 - (sqrt(45)/(sqrt(18)/sqrt(2)) - sqrt(5) - (sqrt(5) - (sqrt(45)-4)/sqrt(9)))*2. -132sqrt(5) + 516 Simplify ((2 + -3(sqrt(612) - (5 + 2sqrt(612) + sqrt(612)) - sqrt(612))5)-5)*2. 1039500sqrt(17) + 31130725 Simplify -1((((sqrt(152) - (sqrt(152) + 3sqrt(152)))6)/(sqrt(288)1)5)2 + -3). -4272 Simplify 1(3-1-3(sqrt(175) + -1 + sqrt(175))-3 + 4 + -1)*2. -16200sqrt(7) + 511200 Simplify -5 + (21-1sqrt(153)3)/(-6(2sqrt(441) + (sqrt(90)/(sqrt(10) + sqrt(10) + sqrt(40)/sqrt(4)) - sqrt(9)))). -5 + 3sqrt(17)/40 Simplify -2(-1-2sqrt(20)-6)2 + (sqrt(100)/(-1sqrt(10)))/(sqrt(2)-21) + 3. -5757 + sqrt(5)/2 Simplify 1 + ((sqrt(50) - (sqrt(1800)-1 + sqrt(50)) - sqrt(50))/sqrt(2))/((sqrt(125) + sqrt(125)3)3). sqrt(5)/12 + 1 Simplify (((6sqrt(320)2)/sqrt(8))/(-4	{ "pile_set_name": "DM Mathematics" }
-39.6653375 to 3 decimal places. -39.665 What is 46628229.3 rounded to the nearest 1000? 46628000 Round 855858.4477 to the nearest one hundred. 855900 What is -7509.032 rounded to the nearest 100000? 0 What is -0.000001131202816 rounded to 7 decimal places? -0.0000011 Round 44482850.2 to the nearest 1000000. 44000000 What is 1.265444152 rounded to four decimal places? 1.2654 Round -1021958344 to the nearest one million. -1022000000 Round 18247529 to the nearest one million. 18000000 Round 17.9081546 to three decimal places. 17.908 Round 105929803 to the nearest ten thousand. 105930000 What is -41291036400 rounded to the nearest one million? -41291000000 Round -0.0098369928 to four dps. -0.0098 What is 93.741765 rounded to one decimal place? 93.7 Round 0.065327318 to 5 decimal places. 0.06533 Round -12795.443663 to 1 dp. -12795.4 Round -912.96911 to the nearest integer. -913 Round -0.096421684 to 2 dps. -0.1 Round 15168.9661 to the nearest one thousand. 15000 What is -475108.72 rounded to the nearest 100000? -500000 Round 50952.77489 to the nearest one thousand. 51000 Round -1385912.62 to the nearest ten thousand. -1390000 What is -2.789645 rounded to zero decimal places? -3 Round -0.00002486895176 to 7 decimal places. -0.0000249 What is -0.00001200471651 rounded to six dps? -0.000012 What is -4168755940 rounded to the nearest one million? -4169000000 Round -0.171800478 to three dps. -0.172 What is 8392762.37 rounded to the nearest 1000000? 8000000 What is -8630.26727 rounded to the nearest integer? -8630 Round -0.02410135434 to 4 dps. -0.0241 Round -59.2170175 to three decimal places. -59.217 Round -2.09531 to 1 decimal place. -2.1 What is -8.055738344 rounded to 3 decimal places? -8.056 Round 1056.22253 to 1 dp. 1056.2 Round 2.505908673 to 1 decimal place. 2.5 What is 20.9646782 rounded to 0 dps? 21 Round -1.7300687 to 2 decimal places. -1.73 What is 0.00164143051 rounded to 7 dps? 0.0016414 Round -0.0000031002016 to 5 dps. 0 What is 59.0307111 rounded to the nearest ten? 60 Round -0.0120269514 to 6 dps. -0.012027 Round -55477055 to the nearest one million. -55000000 Round 5.33206351 to three decimal places. 5.332 Round -190142.73 to the nearest one hundred. -190100 What is 0.0000089321503 rounded to seven dps? 0.0000089 Round 119703773800 to the nearest one million. 119704000000 What is 9723.09295 rounded to 0 dps? 9723 Round -215282814.5 to the nearest 1000. -215283000 What is -23336272.68 rounded to the nearest 100000? -23300000 Round -12584770260 to the nearest one million. -12585000000 Round 0.007218336615 to 4 dps. 0.0072 Round 0.273845807 to one dp. 0.3 Round -70189.9698 to the nearest ten thousand. -70000 Round 115.95766 to the nearest 100. 100 What is -0.61032463 rounded to 3 dps? -0.61 Round -61450.247 to the nearest one thousand. -61000 Round -8532.4763 to the nearest 1000. -9000 What is -0.5876528249 rounded to 3 dps? -0.588 Round 109288.6964 to the nearest ten thousand. 110000 Round 0.038004078 to 5 dps. 0.038 Round 25130530.31 to the nearest one thousand. 25131000 What is 0.000003792899 rounded to seven dps? 0.0000038 Round 91852989 to the nearest one hundred thousand. 91900000 Round 0.00088830657 to 4 decimal places. 0.0009 What is 151544.337 rounded to the nearest ten thousand? 150000 Round 0.0000639794488 to seven decimal places. 0.000064 Round -0.0018053084 to six dps. -0.001805 Round -1.91330789 to one dp. -1.9 What is 359.75405 rounded to the nearest 10? 360 Round -0.00004996555818 to 6 dps. -0.00005 What is 0.0000003159752491 rounded to 7 decimal places? 0.0000003 Round -0.184292604 to 5 dps. -0.18429 Round 498.78256 to the nearest 100. 500 Round 2099.92706 to the nearest 10. 2100 What is -24037137.1 rounded to the nearest 1000? -24037000 Round 130.598858 to one dp. 130.6 Round -0.260668915 to 5 decimal places. -0.26067 What is 0.497934002 rounded to five decimal places? 0.49793 Round -186319.449 to the nearest ten thousand. -190000 What is -327384.791 rounded to the nearest ten thousand? -330000 Round -0.92044933 to 3 decimal places. -0.92 What is 13.60621858 rounded to 4 decimal places? 13.6062 What is -0.0001073649648 rounded to 5 dps? -0.00011 What is -3.72285509 rounded to 1 dp? -3.7 What is -963808.068 rounded to the nearest one thousand? -964000 Round 762668.067 to the nearest 1000. 763000 What is -0.23624959 rounded to 1 decimal place? -0.2 Round 0.000363327553 to three decimal places. 0 What is 1549072.539 rounded to the nearest 1000? 1549000 What is -160170.337 rounded to the nearest ten thousand? -160000 What is -147602050 rounded to the nearest 1000000? -148000000 What is 18.1152113 rounded to the nearest ten? 20 Round 23327.775 to the nearest 10. 23330 Round -0.21328702 to two decimal places. -0.21 What is -0.0007333467764 rounded to 4 dps? -0.0007 Round -7995.5258 to the nearest 10. -8000 What is -33.76290097 rounded to one dp? -33.8 What is -70737.1507 rounded to the nearest integer? -70737 Round 2898261.409 to the nearest 100000. 2900000 Round -1.235220648 to 4 decimal places. -1.2352 Round 4219.344515 to the nearest 10. 4220 What is 19846.43678 rounded to the nearest integer? 19846 What is -19.61166975 rounded to one decimal place? -19.6 Round -0.000362420499 to 5 dps. -0.00036 Round 894339.639 to the nearest 10000. 890000 What is 11061234.4 rounded to the nearest 1000? 11061000 What is -2019752.505 rounded to the nearest one thousand? -2020000 What is -0.0002052689817 rounded to 7 decimal places? -0.0002053 What is -98950860.9 rounded to the nearest one thousand? -98951000 What is -43749.9531 rounded to the nearest 10? -43750 What is -0.991092788 rounded to 4 decimal places? -0.9911 What is 0.06705390176 rounded to five dps? 0.06705 What is -61360.6213 rounded to the nearest one hundred? -61400 Round 0.2598606503 to three decimal places. 0.26 Round 7995391.7 to the nearest one million. 8000000 What is 370.32745 rounded to 0 dps? 370 What is 0.00759020248 rounded to six dps? 0.00759 Round -0.029530492 to 5 dps. -0.02953 Round -42557841 to the nearest 100000. -42600000 What is 0.00964425954 rounded to 4 dps? 0.0096 What is -0.000460286498 rounded to five dps? -0.00046 What is -51.3782814 rounded to 1 decimal place? -51.4 What is -3350.04114 rounded to the nearest 1000? -3000 Round 55241442.4 to the nearest one million. 55000000 Round -5373405.7 to the nearest 100000. -5400000 Round 0.0000656059782 to 5 decimal places. 0.00007 Round -79851.944 to the nearest 100000. -100000 What is -2.937625892 rounded to 1 dp? -2.9 What is 0.014651304548 rounded to four dps? 0.0147 What is -0.0379647381 rounded to six dps? -0.037965 Round 0.00713396068 to three dps. 0.007 Round 0.040926761 to 3 dps. 0.041 What is -0.00331022205 rounded to 6 dps? -0.00331 What is 1023.372963 rounded to one dp? 1023.4 What is -37046173 rounded to the nearest one thousand? -37046000 Round -0.0050773243 to six dps. -0.005077 What is 0.000126723502 rounded to 5 dps? 0.00013 What is -0.14270473 rounded to one decimal place? -0.1 Round 2041519481.9 to the nearest one hundred thousand. 2041500000 What is -0.000004345203945 rounded to six dps? -0.000004 Round -38869382 to the nearest 10000. -38870000 What is -0.010465411 rounded to 4 dps? -0.0105 Round -0.01050262185 to four decimal places. -0.0105 Round 31.9388608 to one decimal place. 31.9 Round 1424.6653 to the nearest one thousand. 1000 Round -0.0000274293975 to five decimal places. -0.00003 What is -71.803409 rounded to the nearest 10? -70 What is -0.000006385737048 rounded to 6 decimal places? -0.000006 Round 5035624.138 to the nearest one million. 5000000 Round -107515.0711 to the nearest one hundred. -107500 What is 328670890 rounded to the nearest ten thousand? 328670000 Round 5.100511344 to the nearest integer. 5 What is -21434.86117 rounded to the nearest one hundred? -21400 What is 29850932 rounded to the nearest 1000000? 30000000 What is -0.0000406765583 rounded to 7 decimal places? -0.0000407 What is 1.122744543 rounded to 4 dps? 1.1227 Round -0.000183313623 to 4 decimal places. -0.0002 Round 2681.5026 to the nearest 10. 2680 Round 4496966493 to the nearest 1000000. 4497000000 Round 11369026.16 to the nearest 1000000. 11000000 What is 0.114731298 rounded to two dps? 0.11 Round 3	{ "pile_set_name": "DM Mathematics" }
d derivative of 512560n2 - 2502324n wrt n. 1025120 Find the third derivative of 9303m6t + 303m3t*2 + 4m*2t*2 - 3mt + 3t*2 - 24t + 167 wrt m. 1116360m3t + 1818t2 Find the second derivative of -335359387o*4 - 87o - 366375. -4024312644o2 Differentiate -48481623ru - 13284r + 1911 wrt u. -48481623r Differentiate -9385h*3s + 51257h3 - 1156172415s wrt h. -28155h2s + 153771h2 Find the third derivative of 114dg3nr - 387516dg3n - dg2n + 8dnr + 3942g*2nr + 2gnr - 4gr - 9r wrt g. 684dnr - 2325096dn Differentiate 92702at - 98033227a + 30t with respect to t. 92702a + 30 Find the second derivative of 164q*3 + 49009q*2 + 2002530q + 1. 984q + 98018 Find the second derivative of -2n*3 + 1795590n*2 - 39628285n wrt n. -12n + 3591180 What is the second derivative of a4 - 10325a*3 - 17a*2 - 415a - 3545 wrt a? 12a2 - 61950a - 34 What is the second derivative of 2df*3 + 128df2 - 138df - 2d + 13881f3 - 20f + 561 wrt f? 12df + 256d + 83286f Find the second derivative of 838095081b2v*2 - 36151b*2v - 57b2 - bv + 16b + 1 wrt v. 1676190162b*2 What is the second derivative of 385c*5 + 3c*4 - 21846c*2 + 76184c - 786? 7700c3 + 36c*2 - 43692 Differentiate 2478oq3 - 47o - 486q3 + q2 + 313242 with respect to q. 7434oq2 - 1458q*2 + 2q What is the second derivative of -360556120n4q - 5nq - 363n - 2q + 1669 wrt n? -4326673440n2q Differentiate -j*4 - 228190j*3 + 25j*2 + 16479444 wrt j. -4j*3 - 684570j*2 + 50j What is the derivative of -300777t4 - 79t*2 - 230728539 wrt t? -1203108t*3 - 158t Differentiate -1518882o4 - 2o*3 + 27o - 88885729. -6075528o3 - 6o*2 + 27 What is the second derivative of 768498865k*2 - 142455k - 316 wrt k? 1536997730 What is the derivative of -111kn*3q - 433721knq2 - 6n*3q*2 - 21n*3 - 58901nq2 wrt k? -111n*3q - 433721nq*2 Differentiate -61h*2w*2 + 2920h*2 + 19878hw3 - 1009h wrt w. -122h2w + 59634hw*2 Find the second derivative of -170j*4l - 15975j2l - 87jl + 23586l + 2 wrt j. -2040j*2l - 31950l Find the second derivative of 52578195w*5 - 223880321w. 1051563900w3 Find the third derivative of 2194o*4t*3 - 13215o*4t - 29o2t*2 + 11o*2 - 6ot2 - 62t*3 + t + 1 wrt o. 52656ot3 - 317160ot What is the third derivative of 86c*3t*2 - 28539c*3t + c*3 + 1065c*2 + 2ct2 + 161ct - 2t wrt c? 516t2 - 171234t + 6 What is the second derivative of 819062561i3 + 5924670i + 53? 4914375366i What is the third derivative of 151459762y*3 + 2y*2 + 48457960? 908758572 Find the third derivative of -294082p*4 - 41p*3 - 1187943p*2. -7057968p - 246 Differentiate 2b2z - 841000b2 + 4bz - 2b + 139345618z wrt b. 4bz - 1682000b + 4z - 2 What is the second derivative of -6332185q*4u3 + q3u + 2qu3 - 49qu2 + 2qu - 3u*3 - 17u*2 wrt q? -75986220q*2u*3 + 6qu Find the first derivative of 427761841f*4 - 467798523. 1711047364f*3 What is the third derivative of -4297711v*6 + 40280566v*2 + 2 wrt v? -515725320v*3 What is the second derivative of 129568562w*2 - 1888295w - 3? 259137124 Find the third derivative of -907a2m*3 + 33a*2m*2 + 5a*2m - 190388am*4 - 439a + m*2 + 587 wrt m. -5442a*2 - 4569312am What is the derivative of 15430i4 - i3 + 182i - 102351701? 61720i*3 - 3i2 + 182 What is the third derivative of -g5 + 250871g4 - 7g*3 + 181569420g*2? -60g*2 + 6020904g - 42 What is the second derivative of 5806436y3 + 6359457y - 1? 34838616y Find the first derivative of 144843006v*3 - 544703780 wrt v. 434529018v*2 What is the first derivative of 2406712g*3 + 92g*2 + 290874610 wrt g? 7220136g*2 + 184g Find the second derivative of 238881873u4 - 216660371u wrt u. 2866582476u2 What is the second derivative of 2w*5 - 4w*4 - 56w*3 + 23w*2 + 3910697w + 2 wrt w? 40w3 - 48w*2 - 336w + 46 Find the first derivative of -22484k3 + 2k*2 + 590k - 376157370 wrt k. -67452k2 + 4k + 590 Find the second derivative of 60787072mt*2 + 7mt - 2m + t*5 - 118t + 1298 wrt t. 121574144m + 20t*3 Find the third derivative of -430593443j*4 - 1869j*2 - 2405j. -10334242632j Find the first derivative of -20517794g + 6917782. -20517794 What is the third derivative of -83685171a5 + 580a*2 + 18587a - 2? -5021110260a2 What is the first derivative of -34g*3 + 1574g*2 + 50g + 67050575 wrt g? -102g2 + 3148g + 50 What is the derivative of 2mp*2 + 28500m - 27596p2 + 1160p - 1179 wrt p? 4mp - 55192p + 1160 What is the third derivative of 159022y*4 + 6y*3 + 3309357y*2? 3816528y + 36 What is the second derivative of -5y2z*3 - 406y*2z*2 - 8479y*2z + 95yz*3 + y + 14553z wrt y? -10z3 - 812z*2 - 16958z Find the second derivative of -38033244z5 + 227699z + 21 wrt z. -760664880z3 Find the third derivative of -73261g*3l*3n*3 + 4g*3l*2n + 4g3l*2 - 1468g*2l*2n3 + g2l - 6gl3n*2 wrt l. -439566g*3n*3 - 36gn2 Find the first derivative of 27657779k*4 - 4717387 wrt k. 110631116k*3 What is the third derivative of -8995166l6 + l4 + 213091492l2 wrt l? -1079419920l*3 + 24l What is the third derivative of 90641924w3 - 100930712w*2 wrt w? 543851544 Find the first derivative of 227929802i - 383238204. 227929802 What is the third derivative of 4o5 + 1864835o*3 + 150673o*2 - 12? 240o*2 + 11189010 Find the second derivative of 9c*5 - 237715c*4u*2 - 30cu2 - 5494cu + 2c - 10u2 wrt c. 180c*3 - 2852580c*2u*2 Find the third derivative of -750886i*6 - 380i*5 + 680203i*2 - 373 wrt i. -90106320i*3 - 22800i*2 Find the third derivative of -106269r*6 - 248r*3 - 2313978r*2 + 10r wrt r. -12752280r3 - 1488 Find the first derivative of 139752985n - 35531407. 139752985 What is the derivative of 84x2 + 116861x - 19071260? 168x + 116861 Differentiate 12689117du3 + 2u*3 + 137u*2 + 4040u wrt d. 12689117u3 What is the derivative of -1996306ay + a - 14718231y wrt a? -1996306y + 1 What is the second derivative of -719566s*5 + 534223s? -14391320s3 What is the derivative of 7qr - 2195922qx - 12974805q - 184rx wrt x? -2195922q - 184r What is the third derivative of -21092b2d*3 - 17525359b*2d*2 + 286d*4 wrt d? -126552b*2 + 6864d Differentiate 68253050f - 290065734. 68253050 What is the second derivative of -125309323k*2 - 293168058k wrt k? -250618646 Find the first derivative of 8a4 - a3 + a2 + 12a - 126306564. 32a3 - 3a*2 + 2a + 12 What is the derivative of 2s3 - 53011270s*2 + 637238247 wrt s? 6s*2 - 106022540s What is the second derivative of 651683333p2 - 1996p - 15801 wrt p? 1303366666 Differentiate -5kz*3 + 962kz2 + 45kz + k - 20105z*3 + 68z*2 - 2 wrt k. -5z*3 + 962z*2 + 45z + 1 Find the second derivative of -11841791r3 - 79748r + 37. -71050746r Find the first derivative of 364l*3o - 856l3s + 97471l3 + 18321los + l wrt o. 364l3 + 18321ls What is the first derivative of 239i*2 + io*3 + 141io - 9i - o*3 + 3o*2 - 155640o wrt i? 478i + o3 + 141o - 9 What is the third derivative of a*2g*4 - 51a*2g*2 - 16a*2g + a*2 - 3ag2 - a + 5107994g*4 - 95 wrt g? 24a*2g + 122591856g What is the third derivative of -80012k*6 - 2k*4 + 457k*3 - 28k*2 - 195184k + 4 wrt k? -9601440k3 - 48k + 2742 What is the third derivative of 27138376b2j*3 + 228b*2j*2 - 53b*2 + bj*3 - bj*2 - 14bj - 5j*2 + 1 wrt j? 162830256b*2 + 6b Find the third derivative of -70967974t3 + 28t*2 - t - 119999 wrt t. -425807844 Find the third derivative of 9d*2gz4 - 179d*2 + dgz + 3dg + dz*2 - 3dz - 183533gz4 + 540z*2 wrt z. 216d*2gz - 4404792gz What is the third derivative of 2f*3p*2 + 71039753f*3p - 2f2p*2 - 3f*2 + 332fp2 + 29fp + f + 10 wrt f? 12p*2 + 426238518p Find the third derivative of -2r2s*3 - 40r*2s*2 - 4r*2 + 3r*s	{ "pile_set_name": "DM Mathematics" }
t j. 66 Let p(b) = -187b4 - 5b*2 - 103b. Let o(g) = 1029g4 + 28g*2 + 567g. Let x(f) = 5o(f) + 28p(f). What is the second derivative of x(r) wrt r? -1092r2 Find the second derivative of 62f + 60f - 50f*4 + 54f*4 - 26f*3 wrt f. 48f*2 - 156f Suppose 0i = -w - 3i + 15, 5i = 20. Suppose -y + 8 = wy. What is the first derivative of -5 - 4hy + 4h*2 - 7h*2 wrt h? -14h Find the second derivative of -21h3 - 5h*2 + 41h*3 + 3h*2 + 86h - 2h2 wrt h. 120h - 8 Let u be ((-22)/3)/((-4)/(-6)-1). What is the first derivative of -6g + 10 + u + 4 wrt g? -6 Let g(b) = -49b2 + 9b - 172. Let k(r) = 50r2 - 13r + 172. Let q(v) = 4g(v) + 3k(v). Differentiate q(h) wrt h. -92h - 3 Let d(x) = 470x*3 + 3x*2 + 2x - 45. Let f(q) = -472q3 - 4q*2 - 3q + 44. Let r(h) = 3d(h) + 2f(h). What is the third derivative of r(n) wrt n? 2796 Let j(o) = 19o3 + 5o + 1. Let v be (-2)/7 - (-74)/14. Let a(y) = 56y3 + 14y + 4. Let t(h) = va(h) - 14j(h). Differentiate t(x) with respect to x. 42x2 Suppose 4w - 4u = 12, 3w = 5u + 5 + 6. What is the second derivative of -1 + 9 - 8 - 6f + 14fw wrt f? 28 What is the first derivative of 559g - 110g - 166 + 14g*3 - 6g*3 - 5g*3 - 5g*3 wrt g? -6g2 + 449 Let n(z) be the first derivative of z7/140 - z*6/72 - 2z*3 + 5. Let r(i) be the third derivative of n(i). What is the third derivative of r(y) wrt y? 36 Let g(i) = -52i*4 - 2i*3 + 75i*2 + 3i - 3. Let t(a) = a - 1. Let o(w) = g(w) - 3t(w). Find the third derivative of o(u) wrt u. -1248u - 12 Let b(w) = -12w4 - 4w*3 - 4w*2 + 6w + 1. Let h(f) = 2f4 + f3 + f2 - f + 1. Let u(l) = -b(l) - 4h(l). Find the second derivative of u(t) wrt t. 48t2 Let d(t) be the first derivative of -t4/4 - 83t*3/3 + 31t + 487. Differentiate d(y) with respect to y. -3y2 - 166y Let u(k) = -129k2 + 5k - 81. Let b(m) = -67m2 + 3m - 41. Let a(r) = -10b(r) + 6u(r). What is the derivative of a(j) wrt j? -208j Let g(u) = u - 9. Let v be g(13). Find the third derivative of 6z*2 + vz*4 - 5 + 2z*2 + 5 wrt z. 96z Let n(a) be the third derivative of 0a6 + 0a + 0a3 - 36a*2 - 3/14a*7 - 43/60a*5 + 0 + 0a*4. What is the third derivative of n(v) wrt v? -1080v What is the third derivative of 29o3 - 59o*4 + 2o*2 - 15o + o*2 + 60o*4 - 67o*3 wrt o? 24o - 228 Let c(n) = 78n2 + 162n + 7. Let u(s) = 39s2 + 80s + 4. Let w(t) = -4c(t) + 7u(t). Find the second derivative of w(j) wrt j. -78 Let j(l) be the third derivative of -143l4/24 + 100l*3/3 + 5l*2 - 24l. What is the first derivative of j(n) wrt n? -143 Let j(r) = -2r2 - 2r. Let m(c) = -3c2 - 2c. Suppose 32 - 5 = -d. Let t = d - -31. Let h(b) = tj(b) - 5m(b). Find the second derivative of h(g) wrt g. 14 Let f = -10 + 16. Let t be (-7 + 1/(-1))(-7)/14. Find the first derivative of -12h*2 - t + 6h*2 - fh*2 - 3 wrt h. -24h What is the second derivative of 2i2 + 111i + 62i3 + 3i*2 + 427i*3 - 5i*2 wrt i? 2934i Let l(t) be the first derivative of 0t3 + 0t*2 - 11/5t*5 + 0t*4 + 2t + 5. Find the first derivative of l(r) wrt r. -44r3 What is the third derivative of 11 + 127j*6 + 177j*2 - 4 - 5 - 8j*6 wrt j? 14280j*3 Let j be 3 + -2 - -3 - 4. Find the second derivative of jk*3 + 9k3 - k3 + 29k wrt k. 48k Let x(f) = 12f3 + 260f*2 - 161f - 3. Let v(i) = 17i3 + 261i*2 - 159i - 4. Let s(h) = 2v(h) - 3x(h). What is the second derivative of s(c) wrt c? -12c - 516 Let x(p) be the third derivative of 4p*2 + 0p*5 + 0p*6 + 0 + 0p*4 + 0p - 8/3p3 + 11/210p*7. What is the first derivative of x(o) wrt o? 44o*3 Let u(l) = -1566l + 1853. Let t(a) = 313a - 370. Let v(p) = -11t(p) - 2u(p). Find the first derivative of v(y) wrt y. -311 What is the derivative of -12792a*2 - 12789a*2 + 283 + 10a*4 + 25584a*2 wrt a? 40a*3 + 6a Suppose 5y + 15 = b, -3b = -0y - 4y - 12. Find the third derivative of 12g2 + bg*5 - 4g2 + g5 - 5g5 wrt g. -240g*2 What is the second derivative of -43g*4 + 24g*4 - 53g*4 + 51g wrt g? -864g2 Let r(z) = -12z*2 - z - 37. Let g(o) = 61o*2 + 5o + 185. Let x = -84 - -73. Let i(l) = xr(l) - 2g(l). What is the derivative of i(v) wrt v? 20v + 1 Suppose 0x + 25 = -5x. Let i(q) = 42q*2 + 22q - 5. Let y(f) = -41f2 - 21f + 4. Let h(b) = xy(b) - 4i(b). What is the second derivative of h(v) wrt v? 74 Let u(m) = 379m3 - 729m*2 + 3m - 3. Let w(v) = -379v3 + 729v*2 - 2v + 2. Let d(f) = -2u(f) - 3w(f). What is the third derivative of d(l) wrt l? 2274 Let x(q) be the third derivative of 173q4/24 - 97q*3/2 + 11q*2 + 10. Differentiate x(p) with respect to p. 173 Let r(p) be the first derivative of -81p*4/4 - 2p*3/3 - 5p*2 - 156. What is the third derivative of r(g) wrt g? -486 Let q(h) be the second derivative of 11h6/720 + h5/30 + 3h4/4 + h. Let n(o) be the third derivative of q(o). What is the first derivative of n(y) wrt y? 11 What is the third derivative of -24546x*3 - 67x*2 + 24215x*3 - 420x*2 wrt x? -1986 Let f be 6/(-8) + (-9 - -12). Let b(t) be the first derivative of 0t - ft4 + 1 + 0t*3 + 2t*2. What is the second derivative of b(w) wrt w? -54w Let q(z) be the first derivative of 53z4/2 - 13z*2/2 - 3z - 86. What is the second derivative of q(l) wrt l? 636l What is the second derivative of -5k*2 - 14 + 90 + 16k - 18k + 49k*3 + 105 wrt k? 294k - 10 Let k(z) be the second derivative of 113z4/6 - 143z*2/2 - 50z + 2. Differentiate k(d) with respect to d. 452d Let d = 37 + -31. Suppose dz - 17 = 19. What is the derivative of 0k3 + 11 - 7k*3 - 3k*3 + zk*3 wrt k? -12k*2 Let h(g) be the third derivative of 2g*7/105 + 7g*6/120 - 7g5/60 + g4/8 + 109g2. What is the third derivative of h(d) wrt d? 96d + 42 Let d(i) be the first derivative of -i*7/35 - 4i3/3 + i2 + 2. Let w(c) be the second derivative of d(c). What is the derivative of w(y) wrt y? -24y3 Let g(j) be the first derivative of 76j*4 + 6j*2 - 13j + 216. What is the second derivative of g(a) wrt a? 1824a Let z(u) be the first derivative of -u5/5 + 56u3/3 + u2 + 27u + 6. Find the second derivative of z(c) wrt c. -12c*2 + 112 Let v be 40/50 - (-12)/10. What is the third derivative of 8p*v + 10p*4 + 370p - 370p wrt p? 240p Let h(d) be the second derivative of -365d4/12 + 123d*2/2 + 6d + 17. What is the derivative of h(r) wrt r? -730r Let p(u) = 1740u*2 + 1790. Let l(o) = 1161o*2 + 1194. Let y(z) = -8l(z) + 5p(z). Differentiate y(g) with respect to g. -1176g Let d = -31 + 30. Let f(i) = i*2 + i + 1. Let z(p) = 4p*4 + 2p*2 + 4p + 2. Let w(m) = dz(m) + 2f(m). Find the second derivative of w(c) wrt c. -48c2 Let l = -376 - -226. Let h be 2/(-7) + l/(-35). Differentiate 0 - 17n*h + 8n*4 - 2 + 5n*4 wrt n. -16n*3 Find the first derivative of -298s - 48s - 221 + 125s wrt s. -221 What is the first derivative of -168 + 25c2 - 212c*2 + 75 + 195 + 343 wrt c? -374c Let b(i) be the third derivative of -i8/168 - i7/7 + i*5/30 + 7i*3/3 - 18i*2 - 4. Find the third derivative of b(h) wrt h. -120h*2 - 720h Let k(a) be the second derivative of -19a3/3 + 93a*2/2 + 144a. What is the first derivative of k(d) wrt d? -38 Let p(m) = 18m2 + 31. Let o(f) = -30 + 423f - 423f - 17f*2. Let h(i) = 4o(i) + 3p(i). Differentiate h(d) with respect to d. -28d Let t(b) be the second derivative of -67b3/6 + 16b*2 + 2b + 3. What is the derivative of t(c) wrt c? -67 Let x(o) be the third derivative of -o*6/24 - 2o*5/3 - 2o*2 + 18. Find the third derivative of x(a) wrt a. -30 Let g(m) = m + 1. Let z(y) = -29y - 55. Let i(l) = 6g(l) + z(l). What is the first derivative of i(x) wrt x? -23 Let l(o) = -6o*2 - 3o + 7o2 - 1 + 3o. Let t(y) = 5y2 + 8. Let u(c) = -6l(c) - t(c). What is the derivative of u(j) wrt j? -22j Find the second derivative of 492d*2 - 5d*3 - 21d*3 - 7d*3 - 977d*2 + d + 57 + 486d*2 wrt d. -198d + 2 Let p(f) = 28f2 - 68f - 10. Let g(s) = -28s2 + 67s + 12. Let h(l) = -5g(l) - 6p(l). What is the se	{ "pile_set_name": "DM Mathematics" }
he prime factors of 92264387? 113, 816499 List the prime factors of 194564042. 2, 2221, 43801 List the prime factors of 29603229. 3, 29, 340267 List the prime factors of 71398262. 2, 13, 157, 17491 List the prime factors of 36239890. 2, 5, 199, 18211 What are the prime factors of 2450436322? 2, 1225218161 What are the prime factors of 1335098745? 3, 5, 19, 1561519 List the prime factors of 238406911. 79, 3017809 List the prime factors of 142181559. 3, 13, 93479 List the prime factors of 1920176519. 137, 14015887 What are the prime factors of 2448059122? 2, 109, 11229629 What are the prime factors of 482791606? 2, 11, 21945073 What are the prime factors of 1273375404? 2, 3, 7, 23, 79, 103 What are the prime factors of 386674109? 386674109 List the prime factors of 1557517695. 3, 5, 59, 457, 3851 List the prime factors of 1063381318. 2, 97, 433, 12659 List the prime factors of 327578918. 2, 89, 1840331 What are the prime factors of 251910012? 2, 3, 17, 1234853 What are the prime factors of 50461565? 5, 7, 11, 53, 2473 What are the prime factors of 62883608? 2, 7860451 What are the prime factors of 148104668? 2, 37026167 List the prime factors of 424744182. 2, 3, 97, 131, 619 List the prime factors of 53984732. 2, 223, 60521 What are the prime factors of 2930344034? 2, 29, 701, 72073 List the prime factors of 239577502. 2, 6659, 17989 List the prime factors of 800319849. 3, 7, 79, 467, 1033 What are the prime factors of 361976864? 2, 41, 275897 What are the prime factors of 8006755324? 2, 61, 367, 89413 List the prime factors of 17313691. 61, 283831 What are the prime factors of 2643670721? 107, 24707203 What are the prime factors of 45983419? 17, 2704907 What are the prime factors of 133976560? 2, 5, 211, 7937 List the prime factors of 60898665. 3, 5, 1213, 3347 What are the prime factors of 84187007? 84187007 List the prime factors of 107560897. 107560897 What are the prime factors of 46503262? 2, 13, 17, 105211 What are the prime factors of 173184222? 2, 3, 28864037 List the prime factors of 11147465. 5, 7, 73, 4363 List the prime factors of 1273114. 2, 19, 33503 List the prime factors of 894204531. 3, 11, 29, 59, 5279 List the prime factors of 259250175. 3, 5, 41, 157, 179 List the prime factors of 288049196. 2, 19, 3790121 List the prime factors of 7541522. 2, 3770761 List the prime factors of 5523646398. 2, 3, 920607733 What are the prime factors of 701472538? 2, 13, 23, 1039, 1129 List the prime factors of 65650431. 3, 7, 11, 284201 List the prime factors of 384024158. 2, 7, 61, 449677 What are the prime factors of 750091703? 5431, 138113 What are the prime factors of 90013382? 2, 349, 128959 List the prime factors of 169429933. 43, 3940231 List the prime factors of 2808432360. 2, 3, 5, 47, 165983 What are the prime factors of 194722741? 194722741 What are the prime factors of 7690262? 2, 929, 4139 List the prime factors of 1064288806. 2, 7, 29, 139, 18859 What are the prime factors of 524897774? 2, 601, 436687 What are the prime factors of 229975901? 269, 854929 List the prime factors of 97453872. 2, 3, 676763 What are the prime factors of 2768721644? 2, 13, 109, 193, 2531 List the prime factors of 965562983. 7, 11, 31, 57787 List the prime factors of 344367404. 2, 67, 439, 2927 What are the prime factors of 182237740? 2, 5, 19, 23, 29, 719 What are the prime factors of 44593689? 3, 7, 839, 2531 List the prime factors of 26590626. 2, 3, 47, 10477 List the prime factors of 152484866. 2, 17, 4484849 List the prime factors of 2762842265. 5, 59, 337, 27791 List the prime factors of 35455446. 2, 3, 13, 277, 547 What are the prime factors of 29156797? 59, 331, 1493 List the prime factors of 16402349. 71, 231019 List the prime factors of 392545813. 11, 541, 65963 What are the prime factors of 968148396? 2, 3, 8964337 What are the prime factors of 236229306? 2, 3, 39371551 List the prime factors of 988218000. 2, 3, 5, 7, 11, 23, 31 List the prime factors of 1062784901. 1087, 977723 List the prime factors of 94828355. 5, 1951, 9721 List the prime factors of 12385155. 3, 5, 23, 35899 What are the prime factors of 2196937523? 11, 17, 281, 41809 List the prime factors of 8248424. 2, 1031053 List the prime factors of 298528592. 2, 23, 157, 5167 List the prime factors of 51852342. 2, 3, 8642057 What are the prime factors of 93039415? 5, 7, 937, 2837 What are the prime factors of 152260964? 2, 31, 1227911 What are the prime factors of 78219406? 2, 37, 1057019 What are the prime factors of 28964995? 5, 521, 11119 What are the prime factors of 873541239? 3, 16519, 17627 What are the prime factors of 210850977? 3, 47, 307, 4871 List the prime factors of 1237641682. 2, 227, 1361, 2003 What are the prime factors of 1335595418? 2, 23, 41, 708163 List the prime factors of 126417994. 2, 63208997 List the prime factors of 1570810. 2, 5, 157081 List the prime factors of 920599. 283, 3253 What are the prime factors of 433919666? 2, 79, 2746327 What are the prime factors of 17742344? 2, 181, 12253 What are the prime factors of 630822111? 3, 17, 521, 23741 What are the prime factors of 6360619? 6360619 What are the prime factors of 3446156444? 2, 1307, 659173 What are the prime factors of 2457221785? 5, 2659, 184823 What are the prime factors of 88846296? 2, 3, 7, 11, 131, 367 What are the prime factors of 18263437? 173, 229, 461 What are the prime factors of 2565326625? 3, 5, 6840871 List the prime factors of 91034173. 67, 269, 5051 List the prime factors of 473264522. 2, 2539, 93199 List the prime factors of 1600187273. 1600187273 What are the prime factors of 6261475064? 2, 13, 41, 59, 24889 What are the prime factors of 109541714? 2, 54770857 What are the prime factors of 8892651438? 2, 3, 11, 233, 192757 List the prime factors of 1460830268. 2, 365207567 What are the prime factors of 228973246? 2, 1889, 60607 What are the prime factors of 73038061? 2797, 26113 What are the prime factors of 3834041? 151, 25391 What are the prime factors of 859644818? 2, 31, 61, 227299 List the prime factors of 22993161. 3, 1499, 5113 List the prime factors of 493616050. 2, 5, 9872321 What are the prime factors of 1692408269? 1692408269 List the prime factors of 1445233349. 7, 67, 1621, 1901 List the prime factors of 4508706848. 2, 269, 359, 1459 List the prime factors of 281555200. 2, 5, 29, 37, 41 What are the prime factors of 99052101? 3, 467, 23567 List the prime factors of 6617150649. 3, 17827, 41243 What are the prime factors of 184661232? 2, 3, 7, 549587 List the prime factors of 1733694321. 3, 577898107 List the prime factors of 315112118. 2, 701, 224759 What are the prime factors of 390284068? 2, 1093, 89269 List the prime factors of 1640356135. 5, 11, 1423, 20959 What are the prime factors of 5229090995? 5, 3061, 341659 What are the prime factors of 3961911025? 5, 158476441 List the prime factors of 38338352. 2, 13, 19, 89, 109 List the prime factors of 106963414. 2, 2131, 25097 What are the prime factors of 1932872687? 157, 619, 19889 List the prime factors of 116356568. 2, 17, 227, 3769 What are the prime factors of 188773327? 419, 450533 List the prime factors of 862844187. 3, 53, 5426693 List the prime factors of 183075871. 11, 1069, 15569 List the prime factors of 60170505. 3, 5, 29, 138323 What are the prime factors of 4621657629? 3, 14431, 106753 What are the prime factors of 151424965? 5, 19, 1593947 What are the prime factors of 166544431? 31, 5372401 What are the prime factors of 1119756413? 15859, 70607 List the prime factors of 182542643. 182542643 List the prime factors of 37153455. 3, 5, 19, 130363 List the prime factors of 123152926. 2, 13, 613, 7727 What are the prime factors of 2505010814? 2, 359, 727, 4799 What are the prime factors of 1610508017? 2237, 719941 List the prime factors of 66378525. 3, 5, 53, 16699 List the prime factors of 130622783. 6379, 20477 List the prime factors of 4452053443. 23, 109, 569, 3121 What are the prime factors of 3073919105? 5, 449, 1369229 What are the prime factors of 7179997173? 3, 2393332391 List the prime factors of 542677. 29, 18713 What are the prime factors of 272161935? 3, 5, 317, 19079 List the prime factors of 17948621. 17948621 What are the prime factors of 632619533? 7, 13, 73, 95231 What are the prime	{ "pile_set_name": "DM Mathematics" }
diuts. Give prob of sequence si. 1/20 Calculate prob of sequence rvw when three letters picked without replacement from {w: 5, v: 3, r: 4}. 1/22 What is prob of sequence kez when three letters picked without replacement from {n: 1, h: 5, e: 2, k: 6, z: 1}? 2/455 Two letters picked without replacement from djrdi. Give prob of sequence rd. 1/10 What is prob of sequence ooy when three letters picked without replacement from {o: 3, y: 2, x: 5}? 1/60 What is prob of sequence qc when two letters picked without replacement from {q: 5, u: 7, c: 2, t: 3, k: 3}? 1/38 Calculate prob of sequence hbh when three letters picked without replacement from hhhhbhhhbhhbbhhhhhh. 140/969 Three letters picked without replacement from hkmmokkkameohkm. What is prob of sequence khe? 1/273 Two letters picked without replacement from {c: 2, h: 2, e: 3, z: 4, u: 1, i: 2}. Give prob of sequence zh. 4/91 Two letters picked without replacement from {m: 2, u: 1, a: 2, b: 1, w: 1, o: 2}. Give prob of sequence ua. 1/36 What is prob of sequence jc when two letters picked without replacement from {i: 1, j: 1, g: 1, c: 2, r: 2}? 1/21 Three letters picked without replacement from iixsgccssi. Give prob of sequence sis. 1/40 Two letters picked without replacement from {s: 2, c: 3}. Give prob of sequence cs. 3/10 What is prob of sequence fg when two letters picked without replacement from ffgfutgf? 1/7 Calculate prob of sequence zcv when three letters picked without replacement from zczv. 1/12 Two letters picked without replacement from llohqmd. What is prob of sequence ol? 1/21 Two letters picked without replacement from {p: 6, j: 3, w: 1, t: 3, s: 2}. What is prob of sequence tp? 3/35 Two letters picked without replacement from {q: 7, m: 1, w: 6, i: 6}. What is prob of sequence ww? 3/38 Four letters picked without replacement from {d: 1, g: 1, c: 1, s: 1, u: 1}. Give prob of sequence uscd. 1/120 What is prob of sequence bbb when three letters picked without replacement from bbihhhb? 1/35 Calculate prob of sequence fde when three letters picked without replacement from {q: 3, p: 2, e: 6, f: 3, d: 6}. 3/190 Two letters picked without replacement from kkkook. What is prob of sequence ok? 4/15 Calculate prob of sequence rng when three letters picked without replacement from rnrnrrrgrngr. 7/220 Two letters picked without replacement from nninnnnnnnnninnnnnnn. Give prob of sequence nn. 153/190 What is prob of sequence oko when three letters picked without replacement from kokwoononnwonwkoonw? 7/323 Three letters picked without replacement from {r: 1, c: 11, k: 1, s: 4, n: 1, z: 2}. Give prob of sequence nzr. 1/3420 Calculate prob of sequence soob when four letters picked without replacement from osbbbobs. 1/105 Calculate prob of sequence nn when two letters picked without replacement from {w: 1, j: 3, m: 1, n: 6, g: 6}. 15/136 Three letters picked without replacement from {k: 3, y: 11}. What is prob of sequence yky? 55/364 What is prob of sequence uu when two letters picked without replacement from jjuufjijuj? 1/15 What is prob of sequence sr when two letters picked without replacement from {s: 2, r: 3}? 3/10 Two letters picked without replacement from {u: 3, b: 1}. What is prob of sequence bu? 1/4 Two letters picked without replacement from ffteseftcf. What is prob of sequence fc? 2/45 Calculate prob of sequence ehh when three letters picked without replacement from {h: 5, e: 3}. 5/28 Calculate prob of sequence wwy when three letters picked without replacement from {w: 2, o: 11, y: 6}. 2/969 Two letters picked without replacement from {o: 1, v: 6, j: 2, h: 5, p: 3}. Give prob of sequence pv. 9/136 Two letters picked without replacement from fyyfzfzfyfzffjyfyyyz. What is prob of sequence zz? 3/95 Calculate prob of sequence xppx when four letters picked without replacement from pxccccckcxccxopcccp. 1/2584 Three letters picked without replacement from {q: 5, v: 1, g: 2, l: 1}. Give prob of sequence qvl. 5/504 Calculate prob of sequence zz when two letters picked without replacement from {z: 10}. 1 What is prob of sequence occ when three letters picked without replacement from ecokokcg? 1/84 Calculate prob of sequence su when two letters picked without replacement from {u: 4, s: 14}. 28/153 Three letters picked without replacement from sdtsdtsdststt. Give prob of sequence sdd. 5/286 Four letters picked without replacement from {y: 1, d: 2, a: 1, q: 2}. Give prob of sequence dayq. 1/90 What is prob of sequence bbbo when four letters picked without replacement from bbbbobbb? 1/8 What is prob of sequence ce when two letters picked without replacement from {c: 1, z: 9, e: 1, x: 7}? 1/306 Four letters picked without replacement from {a: 6, k: 1, x: 2, v: 2}. What is prob of sequence xavv? 1/330 What is prob of sequence rrr when three letters picked without replacement from {w: 1, c: 1, r: 12, o: 1}? 44/91 Three letters picked without replacement from lodbb. Give prob of sequence dlb. 1/30 Three letters picked without replacement from {x: 2, u: 3, o: 2, g: 6}. What is prob of sequence goo? 1/143 Four letters picked without replacement from gggggegeeageegggae. Give prob of sequence aaee. 1/1224 Four letters picked without replacement from dddvdldlll. What is prob of sequence ldll? 1/42 What is prob of sequence tj when two letters picked without replacement from sjsssdssjttvddsdjj? 4/153 Two letters picked without replacement from {g: 3, r: 1, u: 2, d: 3, a: 3, t: 1}. Give prob of sequence du. 1/26 What is prob of sequence kks when three letters picked without replacement from {s: 1, k: 3}? 1/4 Two letters picked without replacement from kzm. Give prob of sequence zm. 1/6 What is prob of sequence rvr when three letters picked without replacement from {t: 3, p: 1, w: 1, r: 4, v: 2}? 4/165 What is prob of sequence jrw when three letters picked without replacement from {w: 6, j: 4, r: 7, i: 1}? 7/204 Two letters picked without replacement from {s: 1, r: 1, n: 4, f: 1, a: 2}. What is prob of sequence ns? 1/18 Two letters picked without replacement from prdrpdrdrdrrr. Give prob of sequence pp. 1/78 Four letters picked without replacement from {f: 10, o: 1, g: 2, d: 1}. What is prob of sequence offf? 30/1001 Three letters picked without replacement from lnqnlnnllnnnnqnnnnl. What is prob of sequence nqn? 44/969 Calculate prob of sequence oym when three letters picked without replacement from {o: 6, m: 3, y: 8}. 3/85 Two letters picked without replacement from dmdmumcmmuddmm. Give prob of sequence cu. 1/91 Three letters picked without replacement from {h: 11, u: 2, a: 5, z: 2}. Give prob of sequence zaa. 1/171 What is prob of sequence kl when two letters picked without replacement from lhkhcqhhhhkhlvq? 2/105 Three letters picked without replacement from qqqhqqcdpqt. Give prob of sequence dph. 1/990 Four letters picked without replacement from tytyg. Give prob of sequence ygty. 1/30 Two letters picked without replacement from pnnnppnnpnnnnn. What is prob of sequence np? 20/91 Calculate prob of sequence rgz when three letters picked without replacement from gfzrzkmk. 1/168 What is prob of sequence xcck when four letters picked without replacement from xxccxkkc? 3/140 What is prob of sequence vd when two letters picked without replacement from {e: 1, v: 2, d: 8, k: 2, l: 2}? 8/105 Three letters picked without replacement from {y: 1, n: 2, v: 1, j: 1, r: 2, s: 1}. Give prob of sequence rjr. 1/168 Calculate prob of sequence fb when two letters picked without replacement from nbgnfngfnff. 2/55 Four letters picked without replacement from {t: 6, x: 2}. Give prob of sequence txtx. 1/28 Three letters picked without replacement from trh. Give prob of sequence hrt. 1/6 Two letters picked without replacement from {i: 2, w: 2, o: 5, n: 1, y: 1, l: 2}. Give prob of sequence ll. 1/78 Two letters picked without replacement from jil. What is prob of sequence ji? 1/6 Two letters picked without replacement from puuufuuuphuuuzfzuuuf. Give prob of sequence hz. 1/190 Two letters picked without replacement from wxx. Give prob of sequence wx. 1/3 Four letters picked without replacement from xxtdttqxqdxt. What is prob of sequence dxxx? 2/495 Three letters picked without replacement from fddfffffffd. What is prob of sequence f	{ "pile_set_name": "DM Mathematics" }
Let z(f) = 59f + 1. What is k(z(i))? -41772i*2 - 531i + 3 Let v(t) be the third derivative of 0t3 + 0t + 8t2 - 1/12t*4 + 0. Let q(r) = 6r. What is v(q(k))? -12k Let l(r) = -142470r + 1 + 142470r + 101r*2. Let t(w) = -3w. What is t(l(b))? -303b2 - 3 Let b(z) = -2z2. Let y(m) = m2. Let h(l) = 4l2 + 11l + 8. Let t(k) = h(k) - 3y(k). Let d be t(-11). Let x(g) = -13g + dg + 7g. Give b(x(j)). -8j2 Let b(m) = -231m*2. Let v(l) = -2l*2. What is b(v(z))? -924z*4 Let n(v) = 121v*2. Let a(l) = 752l*2. What is a(n(x))? 11010032x*4 Let y(x) = -19x*2. Let a(n) = -6n*2 - 6n - 3. Let p(c) = 5c2 + 8c + 4. Let s(m) = 4a(m) + 3p(m). What is s(y(w))? -3249w4 Let t(f) = 5 - 3 + 3f*2 - 2. Let b(u) = 7u. Let o(k) = -6k. Let h(z) = -5b(z) - 6o(z). Give t(h(c)). 3c*2 Let a be (-18)/(-45) + (-804)/(-15). Let y(m) = -am*2 + 36m*2 + 30m*2. Let r(z) = 3z*2. Calculate y(r(x)). 108x*4 Let s(l) = -2l. Let q(y) = 25480y. Calculate q(s(a)). -50960a Let d(f) = -5f2. Let s(h) = -3h. Suppose -2i = -5u + 102, -i + 76 = 4u - 4i. Let z(p) = 16p. Let y(n) = us(n) + 4z(n). Give y(d(a)). 10a*2 Let b(f) = 3f + 8. Let r(m) = 4m + 12. Let g(y) = 3b(y) - 2r(y). Let x(a) = -4a. Calculate x(g(w)). -4w Let h be 1/(-2)0/2. Let q(j) = 5j2 + hj*2 - 3j*2. Let p(a) be the first derivative of 4a*3/3 - 86. Give q(p(f)). 32f*4 Let j(p) = -11p2. Let m(t) be the third derivative of t6/360 + 11t3/6 - 15t*2. Let f(r) be the first derivative of m(r). Give f(j(c)). 121c*4 Let b(h) = 5h - 70. Let x(o) = -o + 10. Let z(s) = -3b(s) - 21x(s). Let p(d) be the first derivative of 11d2/2 + 1. Calculate z(p(j)). 66j Let d(v) = v. Let a(l) = -4l - 3. Let r(b) = a(b) + 3d(b). Let w be r(-4). Let k(s) = 3 + w + s - 4. Let g(i) = 14i. Calculate k(g(t)). 14t Let s(d) = d. Let j(y) = -63y + 30. What is s(j(c))? -63c + 30 Let v(q) = 2q - 7. Let y(j) = j - 2. Let c(r) = -2v(r) + 7y(r). Let l(s) = -5s + 3. Let m(n) = -6n + 4. Let a(t) = -4l(t) + 3m(t). Determine c(a(u)). 6u Let n(u) = -4u2. Let k(b) = -850717b. What is k(n(o))? 3402868o2 Let v(r) = -5r + 2282. Let i(o) = 53o. What is v(i(h))? -265h + 2282 Let c(r) = 5r - 100. Let y(p) = -15p. Give y(c(k)). -75k + 1500 Let z(b) = b. Let p(r) = -36498r. Determine z(p(a)). -36498a Let i(g) = -2g. Let j = -5 + -2. Let b = j - -7. Let q(v) = 4v + 2v + bv - 3v. Give i(q(w)). -6w Let i(r) = -6r*2. Let b(q) = 432q - 42. Let p(f) = -288f + 27. Let m(l) = 9b(l) + 14p(l). What is m(i(u))? 864u*2 Let b(n) = -3n. Let m(c) be the second derivative of -8c - 5/12c*4 + 0c*3 + 0c*2 + 0. What is b(m(f))? 15f*2 Let l(n) = -2n*2. Let w(m) = -148m*2 + 4m - 6. Give w(l(r)). -592r4 - 8r*2 - 6 Let n(t) = -2t. Suppose r = -2x - 4, x = 5r + 4x - 1. Suppose -f + 6 = rf. Let m(w) = -115w + 5w*2 - 3w*f + 115w. What is n(m(c))? -4c2 Let p(v) = 2v. Let l = -16 + 23. Let k(w) = -2w2 - 17w + 32. Let r be k(-10). Let u(t) = t + lt - rt. Give p(u(z)). 12z Let b(m) = -1081m*2 - 253m - 506. Let r(w) = 4w2 + w + 2. Let k(s) = 6b(s) + 1518r(s). Let a(u) = u2. Determine k(a(o)). -414o*4 Let r(u) be the first derivative of -7/2u*2 + 0u + 0u3 + 1/24u4 - 12. Let h(t) be the second derivative of r(t). Let x(q) = q2. Determine x(h(d)). d*2 Let o(k) = -89321k + 89321k + k2. Let h(g) = 331g. What is h(o(u))? 331u2 Let w(c) = c2. Let j(k) be the first derivative of -81k*2/2 + k - 169. Calculate w(j(q)). 6561q*2 - 162q + 1 Let k(i) be the first derivative of 7 - 1/2i2 + 0i. Let j(f) = -4f2. Calculate j(k(u)). -4u*2 Let u(m) = -10 + 8 - 9 - m. Let q(j) = j + 20 + 40 - 60. What is q(u(i))? -i - 11 Let o(n) = -2n*2. Suppose -5m + 9 + 1 = -5l, -2m - 5l = -25. Let q(t) = -9t - 21. Let f(u) = 2u + 5. Let v(s) = mq(s) + 21f(s). Give v(o(j)). 6j*2 Let h(w) be the third derivative of 1/20w*5 + 0w*3 + 28w*2 + 0w + 0 + 0w4. Let r(u) be the second derivative of u3/6 - 2u. What is h(r(x))? 3x2 Let w(q) = -203858q*2. Let d(a) = a. Determine w(d(g)). -203858g*2 Let x(m) = m - 124. Let p(o) = -11o*2. What is x(p(u))? -11u*2 - 124 Let j(y) = 2y*2. Let p(i) = -i - 408440. What is p(j(x))? -2x*2 - 408440 Let h = 14 - 12. Let y(w) = -50w*2 - 47w*h + 92w*2. Let o(z) = -z. Let k(d) = -2d. Let s(r) = 5k(r) - 8o(r). Determine y(s(m)). -20m2 Let p(t) = -17656t. Let g(n) = 4n. What is p(g(u))? -70624u Let r(l) = -l*2 - 2l + 4. Let q(h) = 4h2 + 9h - 18. Let t(u) = 2q(u) + 9r(u). Let o(p) = -6p2 - 1. Give o(t(z)). -6z*4 - 1 Suppose 0 = -d + 11 - 8. Let f(c) = -3c + 4. Let z(l) = l + 3 - 3l + 0l. Let u(g) = df(g) - 4z(g). Let r(a) = a. Determine r(u(m)). -m Let h(g) be the third derivative of -g*5/30 - 8g*3 + 893g*2. Let f(q) = -q - 1. Let p(v) = -2v*2 - 2v - 2. Let n(m) = 2f(m) - p(m). Determine h(n(t)). -8t*4 - 48 Let t(w) = -6w*2. Let b(m) = 18475m. What is t(b(s))? -2047953750s2 Let i(r) = 23r*2 - 9r. Let z(n) = 1242n2 - 483n. Let f(y) = -161i(y) + 3z(y). Let d(p) = 2p. Determine d(f(v)). 46v2 Let x(d) be the third derivative of d5/6 + 358d2. Let f(w) = -w + 0w + 0w. Give f(x(a)). -10a*2 Let i(z) = 33z - 21. Let a(n) = 91n. What is i(a(c))? 3003c - 21 Let i(j) = 84j. Let x(c) = c + 1. Let l(q) = q2 + q + 1. Let n(m) = 2l(m) - 2x(m). Give n(i(r)). 14112r*2 Let s(p) = -4p + 8. Let y(h) = -16h2 - 15h + 10. Let j(o) = 30o2 + 27o - 18. Let a(u) = 5j(u) + 9y(u). Give s(a(t)). -24t2 + 8 Let p = 44 + -31. Let t(n) = -4n*2 - p + 13. Let h(w) = -2w + 18. Let o(g) = 2g - 21. Let r(q) = 7h(q) + 6o(q). What is r(t(d))? 8d*2 Let f(a) = -a - 7775. Let c(u) = 3u*2. Give f(c(x)). -3x*2 - 7775 Let h(i) = i. Let y(m) = -14m. Let c(d) = -12h(d) - y(d). Let s(u) be the second derivative of -25u*4/12 - 790u. Calculate s(c(g)). -100g2 Let b(c) = -125c*2 - 4c - 6. Let p(j) = 6j. Determine b(p(s)). -4500s*2 - 24s - 6 Let p(j) be the third derivative of -j*5/60 + 89j*2 - 8. Let z(g) = -2g*2 - 5 + 5g*2 + 0. What is z(p(u))? 3u*4 - 5 Let i(h) = 2h. Let a(g) = -629g2 - 74g. Let w(o) = 35o2 + 4o. Let q(f) = -2a(f) - 37w(f). Determine i(q(u)). -74u2 Let s(v) = -v. Let a(x) = -x3 + 9x*2 - 8x + 2. Suppose -4m + 19 + 13 = 0. Let j be a(m). Let k(d) = 2d*j - 12d*2 + 3d*2. Give k(s(b)). -7b2 Let a(h) be the third derivative of h4/24 - 3h2. Let r(x) = -x3 - 8x*2 + 10x + 11. Let j be r(-9). Let w(i) = -9i - ji + 2i - 2i. Give a(w(d)). -11d Let h(x) = x + 43. Let s(u) = 4u + 129. Let d(g) = 14h(g) - 4s(g). Let y(l) = -l*2. Determine y(d(t)). -4t*2 + 344t - 7396 Let o = -11 - -17. Let a(t) = -ot2 - t2 + 2t*2. Let h(i) = -10 + 28 - i - 18. Calculate a(h(z)). -5z*2 Let u = 15 + -12. Let h(b) = -u + 4 - 1 + 7b. Let n(x) be the second derivative of -x*4/6 - 2x. Determine h(n(c)). -14c2 Let c(a) be the third derivative of -a6/144 + a4/12 - 2a*3/3 + 2a*2 + 2a. Let j(r) be the second derivative of c(r). Let w(l) = l. Give j(w(s)). -5s Let h(g) be the third derivative of -g7/5040 + 11g*5/60 + 16g*2. Let m(b) be the third derivative of h(b). Let l(i) = 5i*2. Give l(m(o)). 5o*2 Let c(p) = 167256p*2. Let b(u) = -5u*2. Calculate c(b(q)). 4181400q*4 Let l(t) = 6164t - 158t2 - 6164t. Let s(a) = -a*2. Determine s(l(v)). -24964v*4 Let u(n) = 317454n. Let d(h) = -h*2. What is d(u(a))? -100777042116a*2 Let g(a) be the third derivative of 1/12a*5 + 0a*3 + 0a*4 + 0a - 6a2 + 0. Let h(l) = -6l*2. Determine h(g(c)). -150c*4 Let q(g) = 4g. Let n(k) = -1925k. What is n(q(y))? -7700y Let y(t) = 1. Let p(g) = g + 3. Let d(f) = p(f) - 3y(f). Let o(x) = -22x*2 - x + 32x*2 + x. Calculate o(d(z)). 10z*2 Let a(j) = -6j + 1. Suppose 4x - 2x + 3i = 10, -4i = x - 5. Let q(r) = r*2 - xr*2 + 5r*2. Give q(a(m)). 36m*2 - 12m + 1 Let w(i) be the first derivative of -7i3/3 - 285. Let q(l) = -15l*2 - 2. Determine q(w(o)). -735o*4 - 2 Let i(a) = 202a - 1. Let u(n) = -n*2. Calculate i(u(q)). -202q*2 - 1 Suppose -4a = -p - 26, 5*a - 13 = -p	{ "pile_set_name": "DM Mathematics" }
is the third derivative of -b*4 - 180b*3 - 251b*2? -24b - 1080 Find the first derivative of 66g2 + 132. 132g Find the third derivative of -107j6 - j2 + 104j wrt j. -12840j3 What is the second derivative of -8s*3w*2 + 111s*2w*2 - 160sw2 wrt s? -48sw2 + 222w*2 Differentiate 1043g + 6686. 1043 Find the third derivative of 2h5 + 327h4 + h2 - 211h wrt h. 120h*2 + 7848h Find the second derivative of 549h3u*2 - 1901h3 - h2u2 - 2h*2u - 2u wrt u. 1098h*3 - 2h*2 Find the second derivative of -23b*2h*3 - 24b*2h + 3bh*3 - 551bh wrt b. -46h*3 - 48h What is the third derivative of -1028r6 + r2 + 98r? -123360r3 Differentiate -12j*2m*2 - 51j*2 - 233m*2 - 2m with respect to j. -24jm*2 - 102j What is the third derivative of -53w4z*2 - 9w*2 + 2z*2 - z wrt w? -1272wz2 What is the second derivative of -2h*2jz - 2h*2j + 286h2z + h*2 - 153hjz + 3hz + h + 3jz wrt h? -4jz - 4j + 572z + 2 Find the second derivative of 1029j2x*3 - 79j*2x + 15j2 + x3 wrt x. 6174j*2x + 6x Find the second derivative of -3r*3v*2 + 2r*3v - r*2v*4 + 23v*3 - 141v wrt v. -6r3 - 12r*2v*2 + 138v What is the third derivative of 2o4u + 2o4 + 276o*3u + 2o2 + 13u + 5 wrt o? 48ou + 48o + 1656u Find the third derivative of -1891v5 - 1167v*2. -113460v*2 Find the second derivative of -14h*2lm2 + 3h*2l + 5h2 + hl + 118lm*2 - 2lm + m2 + 1 wrt h. -28lm2 + 6l + 10 Find the first derivative of 4dv + 28d + 3v wrt v. 4d + 3 What is the second derivative of -83kw2 - 39kw + w wrt w? -166k What is the third derivative of -13gl*4 - 473gl3 - 2gl2 - 29gl + 2l*4 - 71l*2 wrt l? -312gl - 2838g + 48l Find the second derivative of -r4 + 507r*3 + 34r - 1 wrt r. -12r2 + 3042r Find the second derivative of 46n4 - 11n + 2 wrt n. 552n2 Find the second derivative of 11l*2ru2 + 12l*2r - 27l2 + 2lru - 673lu*2 + 2r wrt l. 22ru*2 + 24r - 54 Find the second derivative of -13a3gk2 + 4a*3g + a*3k + 83a2gk2 - a2 - 5 wrt k. -26a*3g + 166a2g Find the second derivative of 3176s3 + 298s. 19056s What is the third derivative of 10692n*3 - 15n*2 + 54n - 2? 64152 What is the second derivative of -xz2 - xz - 1682z4 + 2824z wrt z? -2x - 20184z*2 What is the third derivative of -695c*4 + 2c*2 wrt c? -16680c What is the third derivative of 539b5 + 3b*4 - 342b*2 + 3 wrt b? 32340b*2 + 72b Find the first derivative of -4d3p + 111d3 - 2dp wrt p. -4d*3 - 2d What is the derivative of 858k - 585? 858 What is the second derivative of 28d*3 + 132d*2 + 4160d wrt d? 168d + 264 Find the third derivative of n4 + 10n*3 + 331n*2 wrt n. 24n + 60 Differentiate -271w - 285. -271 What is the second derivative of 12h*2n*3 - 54h*2n2 - h2n + 14h*2 - 1 wrt n? 72h*2n - 108h2 Find the third derivative of j5v - j*5 - 5j*3v - 26j2v - 5v wrt j. 60j*2v - 60j2 - 30v Find the third derivative of -x*6 - 7x*4 - 17x*2. -120x*3 - 168x What is the derivative of 3w3 + 215w*2x + 14x - 1 wrt w? 9w*2 + 430wx What is the first derivative of 153a*4 - 52 wrt a? 612a*3 Find the second derivative of -62h*2l*2 - 2h*2l - 3h2 + 6hl2 + 1687 wrt l. -124h*2 + 12h Differentiate -7k2 + 45k - 3273. -14k + 45 Find the third derivative of -23h*4 - 6h3 + h2 + 175h wrt h. -552h - 36 Find the second derivative of -1466g2y*4 - 10g*2y + 2g2 - 18gy wrt y. -17592g*2y*2 Differentiate -6p*2t*2v - p*2t2 + p2v + 5t*2 - 3tv - 36 wrt v. -6p*2t2 + p2 - 3t What is the second derivative of 12b*2u*2 - 145b*2u + 2bu*3 + 18bu2 + 3u wrt u? 24b2 + 12bu + 36b Find the first derivative of -b*2lx - 2b*2lz + 633b*2 - blxz - bl - 2bx - 31lz + 4xz wrt z. -2b*2l - blx - 31l + 4x Find the first derivative of -570j2 - 419 wrt j. -1140j Differentiate 650k4 + 244 wrt k. 2600k*3 What is the third derivative of 88o*4 + 264o*2 wrt o? 2112o What is the second derivative of a*5 - 135a*3 - 9a - 20 wrt a? 20a3 - 810a Find the second derivative of -1940i2 + 154i - 3. -3880 What is the second derivative of 2214g2y*2 + 5g*2y - 288gy wrt y? 4428g2 Find the first derivative of 14056p*3 + 3028. 42168p*2 Find the first derivative of -13l*2 + 611l + 14427 wrt l. -26l + 611 Find the first derivative of -16k*3 - 9k*2 - 77 wrt k. -48k*2 - 18k What is the first derivative of 1659dx*2z*2 + 2dz2 + 6x*2 + 374xz2 wrt d? 1659x*2z*2 + 2z*2 Differentiate -3p*3 + 85p*2 + 1766 with respect to p. -9p*2 + 170p What is the second derivative of 1048v2 - 24020v wrt v? 2096 What is the second derivative of 10o3z*3 + 25o*3z + 8o3 - 7o*2z*3 + 9oz3 + 2o - 2z wrt z? 60o*3z - 42o2z + 54oz Find the second derivative of gv2y + 2gy + 56v2y - 6vy + 1 wrt v. 2gy + 112y Differentiate 3v*4 - 3677v + 24729. 12v3 - 3677 Find the first derivative of 2p*4 + 1494 wrt p. 8p3 Find the first derivative of -j2k - 4858j*2 - 511k wrt k. -j*2 - 511 Find the first derivative of -4lw3 - 37lw - 471l wrt w. -12lw*2 - 37l What is the first derivative of -47ho*2 + 3ho + 3h + 252o2 wrt h? -47o*2 + 3o + 3 What is the derivative of 4it*4 + 596i - 1449t4 + 3 wrt t? 16it3 - 5796t*3 What is the first derivative of 8dk2q - dkqw + dqw + 3k*2qw + 2k*2q + kqw + 2w wrt d? 8k*2q - kqw + qw Find the second derivative of -42b*4 + 6b*3 + 608b. -504b2 + 36b What is the first derivative of 39m3 - m2 + 7m + 1148? 117m2 - 2m + 7 What is the first derivative of 145m - 4 wrt m? 145 Find the second derivative of -30t*3 + 58t*2x*3 + 37tx3 + 23tx2 + tx wrt t. -180t + 116x*3 What is the derivative of 41dit*3 - dt*3 - 295it3 + t3 wrt d? 41it3 - t3 What is the third derivative of -2t*5 + 19t*3 + 88t*2? -120t*2 + 114 Find the third derivative of 3m*5x + 7m5 - 38m*2 - mx wrt m. 180m2x + 420m2 Find the third derivative of -52m*6 - 15m*5 + 17m*2 - 23m wrt m. -6240m3 - 900m*2 Find the second derivative of 454x*2 + 175x - 2. 908 What is the third derivative of 2ct*3 + 10ct2 - 9409t*3 + 13t*2 + 13 wrt t? 12c - 56454 Find the second derivative of 80u3 + 36u*2 - 8104u. 480u + 72 Find the third derivative of -4p*4u - 7p4 - 2p*3u*2 + 8p*2u - 12u2 wrt p. -96pu - 168p - 12u2 What is the third derivative of 469m*5 - 67m*2 - 13? 28140m*2 What is the derivative of 4i*3n*2oz + i3n + 3i2n*2 - 2in + 2no + 401oz + 425z wrt o? 4i3n*2z + 2n + 401z Find the third derivative of 2g4 + 184g*3 - 25g*2 + 17g - 1 wrt g. 48g + 1104 What is the second derivative of 9r*2u*2z - 2r2uz + 2ru2z - 43rz + 19u2 - 2uz wrt u? 18r*2z + 4rz + 38 What is the second derivative of 354f3 + f2 - 1196f? 2124f + 2 Find the third derivative of 2p*6 - 36p*4 + 199p*2. 240p*3 - 864p Differentiate -11q3r*3 - 150q3 - q - r3 wrt r. -33q3r*2 - 3r*2 Find the second derivative of -71d*3 + 13d - 9 wrt d. -426d Differentiate -418k*4m + 2k2m*3 + 2m*3 + 7m - 29 wrt k. -1672k3m + 4km*3 Find the third derivative of 3rvx*3 + 2rvx*2 + 69rx - 57vx3 - 2x*2 wrt x. 18rv - 342v What is the second derivative of 369af*2lp2 + 7af2lp + 3aflp - ap + f*2l + f*2 + 3flp*2 wrt p? 738af2l + 6fl What is the third derivative of -8425q6 - 41q*2 + 49q - 1 wrt q? -1011000q3 What is the derivative of -420m - 245? -420 What is the third derivative of 113a4p*3 - 14a*4p - 36a2p*3 + 9ap2 wrt a? 2712ap3 - 336ap Find the first derivative of -4l*4 - 8l + 812. -16l3 - 8 Find the second derivative of -2c*2qv3 + 765c*2q - 22cqv3 - cv + 31v3 wrt c. -4qv3 + 1530q Differentiate	{ "pile_set_name": "DM Mathematics" }
567, -71315, -95053, -118781, -142499? 5s2 - 23773s - 41 What is the i'th term of -2077877, -4155756, -6233647, -8311556, -10389489, -12467452, -14545451, -16623492? -i*3 - 2077872i - 4 What is the x'th term of 18875, 19060, 19245? 185x + 18690 What is the c'th term of -4862535, -4862531, -4862525, -4862517, -4862507, -4862495, -4862481? c2 + c - 4862537 What is the q'th term of 3218, 7076, 10940, 14810? 3q*2 + 3849q - 634 What is the k'th term of 6930922, 13861832, 20792742, 27723652, 34654562, 41585472? 6930910k + 12 What is the t'th term of -171615120, -171615119, -171615118, -171615117? t - 171615121 What is the b'th term of 13108, 15867, 18628, 21391, 24156, 26923? b2 + 2756b + 10351 What is the k'th term of 2288030, 2288080, 2288130, 2288180, 2288230, 2288280? 50k + 2287980 What is the c'th term of 28, 1483, 5742, 14209, 28288, 49383, 78898, 118237? 234c*3 - 2c*2 - 177c - 27 What is the j'th term of 3606, 9435, 15262, 21087? -j*2 + 5832j - 2225 What is the v'th term of 485, 4129, 14095, 33545, 65641, 113545, 180419, 269425? 527v3 - v2 - 42v + 1 What is the w'th term of 10266, 41155, 92646, 164739, 257434, 370731, 504630? 10301w2 - 14w - 21 What is the u'th term of -1494, -3028, -4562, -6096, -7630? -1534u + 40 What is the a'th term of -323, -1707, -4035, -7199, -11091, -15603, -20627, -26055? 18a*3 - 580a*2 + 230a + 9 What is the r'th term of 2887403, 2887379, 2887355, 2887331, 2887307, 2887283? -24r + 2887427 What is the p'th term of -6675, -5937, -4707, -2985, -771? 246p*2 - 6921 What is the s'th term of 263707037, 527414072, 791121107, 1054828142, 1318535177? 263707035s + 2 What is the c'th term of -64142475, -64142474, -64142473, -64142472, -64142471? c - 64142476 What is the u'th term of -14357, -57844, -130323, -231794, -362257? -14496u2 + u + 138 What is the c'th term of -1040865, -1040858, -1040851, -1040844? 7c - 1040872 What is the g'th term of -1429348, -2858684, -4288020, -5717356, -7146692, -8576028? -1429336g - 12 What is the j'th term of 2209, 9015, 20417, 36463, 57201, 82679, 112945, 148047? 8j*3 + 2250j2 - 49 What is the p'th term of -1662, -3180, -4696, -6210, -7722, -9232? p2 - 1521p - 142 What is the k'th term of 6676, 13415, 20260, 27205, 34244, 41371? -k3 + 59k*2 + 6569k + 49 What is the t'th term of 93638, 374573, 842800, 1498313, 2341106, 3371173, 4588508, 5993105? -t*3 + 93652t*2 - 14t + 1 What is the n'th term of 27897, 111509, 250877, 446013, 696929, 1003637? 2n3 + 27866n2 + 29 What is the c'th term of 4216, 8376, 12462, 16468, 20388, 24216? -c3 - 31c2 + 4260c - 12 What is the v'th term of -8682157, -8682155, -8682151, -8682145, -8682137, -8682127, -8682115? v2 - v - 8682157 What is the z'th term of -81545, -94257, -106967, -119675, -132381, -145085, -157787? z2 - 12715z - 68831 What is the s'th term of 21516, 20808, 19628, 17976, 15852, 13256? -236s*2 + 21752 What is the i'th term of -3754753, -7509516, -11264279, -15019042? -3754763i + 10 What is the f'th term of 7504, 15263, 23348, 31765, 40520, 49619, 59068, 68873? f*3 + 157f*2 + 7281f + 65 What is the l'th term of 34885, 69767, 104657, 139555, 174461? 4l2 + 34870l + 11 What is the d'th term of 102, 255, 422, 561, 630, 587? -7d3 + 49d*2 + 55d + 5 What is the d'th term of 219279538, 438559075, 657838612? 219279537d + 1 What is the a'th term of 248113, 496227, 744345, 992473, 1240617, 1488783? a3 - 4a*2 + 248119a - 3 What is the d'th term of 827, 2639, 5469, 9317, 14183, 20067? 509d2 + 285d + 33 What is the v'th term of -79242, -77381, -75520, -73659? 1861v - 81103 What is the l'th term of -51039655, -51039654, -51039653, -51039652? l - 51039656 What is the t'th term of -61301133, -61301150, -61301167, -61301184, -61301201? -17t - 61301116 What is the c'th term of -611, -2568, -5857, -10472, -16407? c*3 - 672c*2 + 52c + 8 What is the s'th term of 229507, 459023, 688545, 918073, 1147607, 1377147, 1606693? 3s2 + 229507s - 3 What is the a'th term of -11818, -12050, -12276, -12496? 3a2 - 241a - 11580 What is the y'th term of -209516474, -209516476, -209516478? -2y - 209516472 What is the u'th term of -2237757, -2237800, -2237843? -43u - 2237714 What is the h'th term of 36198159, 72396321, 108594483? 36198162h - 3 What is the h'th term of -141, -846, -2797, -6618, -12933? -104h3 + h2 + 20h - 58 What is the a'th term of -6824, -27302, -61420, -109178, -170576, -245614, -334292? -6820a*2 - 18a + 14 What is the k'th term of -41099, -82351, -123755, -165311, -207019, -248879? -76k2 - 41024k + 1 What is the l'th term of 122681924, 122681923, 122681922, 122681921? -l + 122681925 What is the n'th term of -285, -1325, -3057, -5481, -8597, -12405? -346n2 - 2n + 63 What is the k'th term of 43178, 172998, 389366, 692282, 1081746, 1557758? 43274k2 - 2k - 94 What is the k'th term of 435, 881, 1329, 1779, 2231? k*2 + 443k - 9 What is the l'th term of -594919, -594937, -594955, -594973, -594991? -18l - 594901 What is the k'th term of -14089, -32462, -50835? -18373k + 4284 What is the c'th term of 34416, 34400, 34384? -16c + 34432 What is the c'th term of 208, -1021, -3056, -5903, -9568? -c3 - 397c*2 - 31c + 637 What is the o'th term of 25263, 34595, 43927, 53259, 62591, 71923? 9332o + 15931 What is the y'th term of -30612, -30590, -30576, -30576, -30596, -30642, -30720? -y3 + 2y*2 + 23y - 30636 What is the n'th term of -744480, -744897, -745314, -745731, -746148, -746565? -417n - 744063 What is the l'th term of -573, -1919, -4063, -6993, -10697, -15163, -20379, -26333? 2l*3 - 411l*2 - 127l - 37 What is the k'th term of -8687267, -8687266, -8687265, -8687264? k - 8687268 What is the c'th term of -255240, -509369, -763498, -1017627, -1271756, -1525885? -254129c - 1111 What is the x'th term of 13855, 27707, 41557, 55405, 69251, 83095? -x2 + 13855x + 1 What is the v'th term of 3137, 5123, 7109, 9095, 11081? 1986v + 1151 What is the o'th term of 6337, 3640, -17107, -64928, -148847, -277888, -461075, -707432? -1504o3 - o2 + 7834o + 8 What is the y'th term of 64377, 259672, 585163, 1040850, 1626733, 2342812? 65098y2 + y - 722 What is the z'th term of -331006, -331104, -331210, -331330, -331470, -331636, -331834? -z3 + 2z2 - 97z - 330910 What is the b'th term of 890, 2738, 5642, 9602, 14618, 20690, 27818? 528b2 + 264b + 98 What is the y'th term of 19729, 39612, 59655, 79864, 100245, 120804, 141547? y*3 + 74y*2 + 19654y What is the i'th term of 12525, 25089, 37653, 50217, 62781? 12564i - 39 What is the s'th term of -3283, -3418, -3555, -3700, -3859, -4038, -4243, -4480? -s3 + 5s*2 - 143s - 3144 What is the o'th term of 95656777, 95656775, 95656773? -2o + 95656779 What is the v'th term of -4399, -8639, -12765, -16771, -20651, -24399, -28009? v3 + 51v*2 - 4400v - 51 What is the z'th term of 2340, 10835, 24992, 44811, 70292, 101435, 138240? 2831z2 + 2z - 493 What is the t'th term of -3641, -14455, -32453, -57635, -90001, -129551, -176285? -3592t2 - 38t - 11 What is the u'th term of -460780, -460750, -460704, -460642, -460564, -460470? 8u2 + 6u - 460794 What is the u'th term of 469, 2890, 9399, 22018, 42769? 337u3 + 22u*2 - 4u + 114 What is the r'th term of -294815, -294809, -294801, -294791? r*2 + 3r - 294819 What is the i'th term of -3477, -13114, -29175, -51660, -80569, -115902? -3212i2 - i - 264 What is the y'th term of -124641377, -124641386, -124641395, -124641404? -9y - 124641368 What is the f'th term of 65435238, 65435236, 65435232, 65435226, 65435218, 65435208? -f*2 + f + 65435238 What is the l'th term of 1454574, 2909154, 4363742, 5818338, 7272942, 8727554, 10182174? 4l*2 + 1454568l + 2 What is the m'th term of -10643, -42520, -95627, -169952, -265483? 2m3 - 10627m*2 - 10m - 8 What is the x'th term of -26139, -26145, -26155, -26169, -26187, -26209, -26235? -2x2 - 26137 What is the u'th term of -3087, -4866, -9691, -19086, -34575? -254u3 + u2 - 4u - 2830 What is the q'th term of 966, 5077, 12316, 22677, 36154, 52741? -q3 + 1570q*2 - 592q - 11 What is the b'th term of 305, 420, 515, 584, 621, 620? -b*3 - 4b*2 + 134b + 176	{ "pile_set_name": "DM Mathematics" }
closest to m? (a) 1/4 (b) u (c) -5 a Let y = -48 + 619. Let w = 13135/23 - y. Which is the closest to -1/2? (a) 1 (b) -1 (c) w b Let k = 0.8 + -0.9. Let a = 11 + 3. Let c be 10/a - (-2)/(-7). What is the closest to -1 in -4, c, k? k Let y = 138 - 1240/9. Let z(g) = -g*3 + 7g*2 - 9g + 21. Let p be z(6). Which is the closest to -1/2? (a) p (b) -0.2 (c) y b Let c = -6 + 5.8. What is the closest to 1 in -4, c, 1? 1 Let l = 2.4 - 4.4. Let i = 8 - 13. Which is the nearest to l? (a) i (b) 0.4 (c) -2/17 c Let r be (0/5)/(2 + -1). Which is the nearest to 1? (a) -1 (b) -0.2 (c) r c Let l = 147.1 - 147. Let p be (-2)/11/3. Which is the nearest to l? (a) p (b) 0.3 (c) 2 b Let d = -0.2 + 0. Let q = d + 1.2. What is the nearest to q in -4, 1, -1/7? 1 Let v = -0.3 + -3.8. Let n = -4 - v. Which is the nearest to -1? (a) -1/4 (b) 5 (c) n a Suppose -b - 6 = -3b, 3b = n + 3. Suppose ng - 27 = g + d, 9 = g - 2d. Suppose gk = -0k + 10. What is the closest to -2/3 in -0.5, 0.4, k? -0.5 Let v = -21.3 + 24. Let j = -1.7 + v. Let b = 0.8 - 1. What is the nearest to j in b, 1, 0? 1 Let x = -49.8 + 50. Which is the closest to 0? (a) x (b) 2 (c) -1 a Let r = 3 - 2. Let s = -3 + 2. Let v = -1.3 - -4.3. What is the closest to s in 3/5, r, v? 3/5 Let k be (-18)/4(1 + 5/(-3)). What is the nearest to 2 in 2/5, k, -0.5? k Let k = 0.02 + 0.98. Let i = -2 - -1. Let x = k + i. Which is the closest to 1? (a) 4 (b) x (c) -0.3 b Suppose 3d = 2d + 2o + 5, 0 = 3d + 5o + 29. Let v be (-15)/(-6)d/10. Which is the nearest to -1? (a) 2 (b) v (c) -1/7 b Let g = 0.08 + 2.32. Let b = g - -0.5. Let a = -3 + b. What is the closest to -2 in 5, a, -0.2? -0.2 Let p be (1/1)/(-17 - -12). Suppose 0 = -0z + 3z. Which is the closest to z? (a) -5 (b) p (c) -0.1 c Let n be 13044/(-10) - (-10)/25. Let d = n - -66502/51. Let r = 5/17 - d. Which is the nearest to r? (a) -1/3 (b) 3 (c) 3/8 c Let m = 8/7 + -9/14. Which is the closest to m? (a) -5 (b) 5 (c) 0 c Let o = -141 - -142. What is the nearest to 0.3 in o, 0, 0.3? 0.3 Let g = 3 + -4. Let d = 2.18 - 0.18. What is the closest to g in 1/2, d, -1/3? -1/3 Let m = -18/7 + 20/7. What is the closest to 1 in 2, m, -2? m Let j = 0.3 + -0.1. Let v = -152.7 + 153. What is the closest to j in v, -1, -4? v Let t = -0.13 + 0.23. Which is the closest to 0? (a) -0.4 (b) 2/11 (c) t c Let m = 15.5 + -16. Which is the closest to -0.4? (a) m (b) -0.2 (c) -2 a Let d = -23 - -24. Which is the closest to d? (a) 2/7 (b) 0 (c) 3 a Let i = 0.5 - 1. Let p = 0.6 - 0.9. Let o = p - -3.3. Which is the nearest to 0.1? (a) -2 (b) i (c) o b Let j = -6 + 4. Let x = -3.89 + -0.11. What is the nearest to 0 in j, x, -0.1? -0.1 Let x = -50 + 51. Let d = 4 - 8. Let l be (-10)/12 + d/6. What is the nearest to x in 2, -2/5, l? 2 Let o be ((-4)/(-10))/(3/(-5)). Let l(y) = 2y - 1. Let p be l(-1). Let x(w) = -20w + 105. Let k be x(5). What is the closest to o in k, p, 0.1? 0.1 Let w = -2.5 - 0.3. Let p = 3 + w. Let r = 0.2 + -0.3. What is the closest to 2/3 in p, -0.4, r? p Let w = 0.152 - -0.048. Let y = 3 + -2. Which is the nearest to y? (a) w (b) 3 (c) 2/11 a Let d = -5 + 4. Let y = -0.8 - d. Which is the closest to 1? (a) -5/2 (b) -3 (c) y c Let z be (-2)/31/(-2). Let j(w) = 3w - 2. Let g be j(2). Suppose -1 = gx - u + 24, u = x + 10. Which is the closest to -2/5? (a) z (b) 0.5 (c) x a Let m = 17.3 + 0.7. Let x = -18.5 + m. What is the nearest to 0.2 in 5, 3, x? x Let d = -80 - -78. What is the nearest to 1 in d, -0.5, -2/9? -2/9 Let w = 5.13 - 0.13. Let j = 5 - w. What is the closest to j in 1, 4, 0.4? 0.4 Let i = -0.05 + 0.05. Let r = 5.98 + 0.02. Let l = r - 5.6. Which is the closest to i? (a) l (b) -2 (c) -5 a Let g = -117 - -108.9. Let p = -8 - g. Which is the closest to p? (a) 2 (b) -0.5 (c) 3 b Let w be (44/90)/((-3)/2). Let h = w - 2/27. Let l = -1042/9 - -116. What is the nearest to l in -4, -4/5, h? h Let o = 23 - 25. Let t = -2/81 - 148/567. Which is the nearest to t? (a) o (b) 3 (c) -1/4 c Suppose 10 - 18 = -2h. What is the closest to -1/3 in -3, h, 0.4? 0.4 Suppose -5t = 4l - 12, 2t + 0l = -l + 6. Which is the closest to 0.05? (a) 5 (b) -4 (c) t c Let p = -10.5 + 10.4. Which is the nearest to -0.1? (a) p (b) 3/11 (c) -3/5 a Let z be (-2)/(-51/(-2)). Suppose 10 + 0 = -2y. Which is the nearest to -1? (a) y (b) z (c) -2 b Suppose -2b = 14i - 15i, 0 = -2b + 2i + 4. What is the closest to -1 in 0.2, -1/4, b? -1/4 Let i = -0.5 - -0.4. Let z = -2.9 + 3. What is the closest to z in i, 3, 0? 0 Let p(q) = 2q - 5. Let v be p(4). Let u be (-1)/(2 + (0 - 3)). Which is the nearest to 1/3? (a) u (b) v (c) -4 a Let o = 0.05 - 0.05. What is the closest to 0.1 in o, -0.08, -3? o Suppose u = -0u - 3b + 21, -4u + 2b = -28. Let c = 14 - u. Suppose 4m + 3 = 3t + 8m, -2m + 6 = 0. What is the nearest to 2/9 in c, t, -4? t Let n = 19 - 18. Which is the closest to n? (a) 0.06 (b) 1 (c) -0.3 b Let j = 0.13 - 0.23. What is the nearest to 0.2 in -0.2, j, -5? j Let k = -6 - 0. Which is the nearest to 0? (a) k (b) -2/7 (c) -0.4 b Suppose 5g + 41 + 19 = 0. Let w be (9/6)/(g/20). Which is the closest to 2? (a) 2/7 (b) -5 (c) w a Let n = 1.5 + 0.5. Let o = 2/17 + 8/221. What is the closest to 0 in -0.3, n, o? o Let l = 12377/23 - 538. Let w be (-7)/(-805)85/2. Let u = l + w. Which is the closest to -1? (a) -5 (b) -0.1 (c) u b Let x = -63/2 - -815/26. Let m = -0.2 + -0.2. Let t = 0.4 - -0.1. Which is the nearest to 0? (a) x (b) m (c) t a Let i = -1 - 1. Which is the closest to -2? (a) 1 (b) i (c) -0.3 b Suppose -b = 3b - 4z - 8, -3b - z = 10. What is the nearest to 0.3 in 1/3, b, 2? 1/3 Let f = -54 - -272/5. Let l be ((-2)/(-3))/((-2)/(-1)). What is the closest to 2/5 in l, -2/3, f? f Let m = 0.2 - 0.1. Let z = 0.04 - 0.14. What is the closest to z in 0.3, 0, m? 0 Suppose 3c = 4h - 32, 2h = 2c + 7 + 11. Let n = 5 - 6. Let d = -0.4 - -3.4. What is the closest to 0.1 in d, c, n? n Let t = -26 + 26. What is the nearest to 1 in 2/9, -1, t? 2/9 Let d = -8 - -4. Let h = 177 - 177. Which is the nearest to h? (a) 3/2 (b) d (c) -0.5 c Let a = -0.099 - 0.201. What is the closest to 2 in -5, a, 0? 0 Let x be (17/221)/((-2)/(-4)). What is the closest to -0.03 in -0.3, 0, x? 0 Suppose 23v + 20 = 18v. Which is the closest to 2/3? (a) -1/3 (b) -0.2 (c) v b Suppose 0 = -4u - t + 10, -t = 3u - 2t - 11. What is the nearest to u in 1/4, 2, -3? 2 Let n = -1.18 - -1.38. Suppose -2w + 5w + 3 = 0. Which is the closest to 1? (a) w (b) n (c) -4 b Let x = 28 - 32. Which is the closest to 1/4? (a) x (b) -2 (c) 1/10 c Let v(f) = f*3 - 20f*2 - f + 20. Let q be v(20). Which is the nearest to q? (a) -1/4 (b) -1 (c) 4 a Let k = 3.3 + -7.3. Which is the nearest to 1? (a) 0.4 (b) k (c) -0.1 a Let p = -61/105 + 13/15. Which is the nearest to -8? (a) -0.3 (b) -5 (c) p b Let o be ((-2)/(-10))/(36/(-54)). Let j = -287 + 199. Let g = -527/6 - j. Which is the nearest to -0.2? (a) -3 (b) o (c) g c Let y be 2/5(-1)/2. Let z(r) = -1. Let c(n) = n + 9. Let d(u) = -c(u) + 4z(u). Let m be d(-17). What is the closest to 0 in -0.4, y, m? y Let t = 10 + -11. Let v = -0.2 + 0.1. What is the closest to 1 in v, t, 0.2? 0.2 Let q = 117/100 - -2/25. Let p be (-2)/(34/6). What is the closest to p in 0.3, -1, q? -1 Let a = 0.13 + -3.13. What is the closest to -5/6 in a, 0.2, -1? -1 Let g be (-21)/(-14)4/6. Let w = g + -6. Which is the nearest to 2? (a) w (b) -1/5 (c) 2/3 c Let z = -0.02 - -0.02. Let k = z + 1. Let f be 2/(-5) - (0 + 0). Which is the closest to f? (a) k (b) -4/7 (c) 0 b Let y = -107/133 - -18/19. Which is the nearest to 1/3? (a) 5 (b) 4 (c) y c Let u(j) = j - 3. Let x be u(5). Which is the nearest to -1? (a) -0.2 (b) x (c) 1/4 a Let a = 147 + -147.5. What is the closest to -1 in -2/7, a, 1/4? a Suppose -6d = -11d - 10. Let g = -65/2 - -32. Which is the closest to g? (a) 3/8 (b) -5/3 (c) d a Let q = 15 - 11. Which is the closest to q? (a) 4 (b) -4 (c) 3 a Let j be ((-4)/(-8))/((-6)/4). Let h = 4 - 3. What is the closest to 0 in 0.5, h, j? j Let r = 12.2 - 11.17. Let q = r - 0.03. What is the nearest to -0.1 in 4, 2/21, q? 2/21 Suppose v	{ "pile_set_name": "DM Mathematics" }
/81 Simplify sqrt(52)/sqrt(4) + -1 + -5. -6 + sqrt(13) Simplify (sqrt(1088) + (sqrt(1088) - (sqrt(1088) + sqrt(1088) + -1))-3)2. -192sqrt(17) + 17417 Simplify (-3(sqrt(60) - -1sqrt(60))/sqrt(12)1)2. 180 Simplify sqrt(1300) + (sqrt(1300) - (sqrt(1300) + -2 + -5)2) + (sqrt(1300) - ((sqrt(1300) + -2)4)*2). -22213 + 810sqrt(13) Simplify sqrt(175) + -2 + (sqrt(7)-13)*2. 5sqrt(7) + 61 Simplify 6((-2sqrt(117)-4)/sqrt(9))2. 4992 Simplify (sqrt(36)/sqrt(2) + sqrt(18) - sqrt(18))/sqrt(6) + (sqrt(243)1)*2 + sqrt(243) + sqrt(243). 19sqrt(3) + 243 Simplify (sqrt(117) - (sqrt(117) + (sqrt(117) - (sqrt(117) - (sqrt(117) + ((sqrt(117) + 1sqrt(117))6 - sqrt(117)))))))/(sqrt(441)-1). 12sqrt(13)/7 Simplify (1sqrt(1377) + 3)2 + (-5-2sqrt(1377))2. 54sqrt(17) + 139086 Simplify -1(sqrt(200) - sqrt(50)). -5sqrt(2) Simplify (sqrt(76)/(sqrt(192)/sqrt(12)))*2. 19/4 Simplify (sqrt(76) - (sqrt(76)1-1 + sqrt(76)))/sqrt(4). sqrt(19) Simplify ((sqrt(2835)-2)/sqrt(5)-5)2. 56700 Simplify sqrt(26)/(sqrt(16)/sqrt(8))-2 + 2. -2sqrt(13) + 2 Simplify 2(sqrt(170) + (sqrt(170) - sqrt(170)-3))/sqrt(10) + -1. -1 + 10sqrt(17) Simplify -5 + (sqrt(80) - sqrt(5))2 + 3. 43 Simplify (4 + 4 + -1 + sqrt(19) + -4)2. 6sqrt(19) + 28 Simplify sqrt(325)1 + 2. 2 + 5sqrt(13) Simplify (5sqrt(20)/(sqrt(100) + sqrt(100) + sqrt(100)4 + sqrt(100) - sqrt(100)))2. 5/36 Simplify -3 + sqrt(15)/sqrt(3)-1-3. -3 + 3sqrt(5) Simplify (sqrt(425))*23-4. -5100 Simplify -1 + (-5(sqrt(1872) + (sqrt(1872)3 - sqrt(1872))))2. 421199 Simplify (sqrt(117)/sqrt(729))2-6 + -1. -53/27 Simplify (sqrt(6292) + 3)*2-1. -6301 - 132sqrt(13) Simplify (-2sqrt(432) + 5)*2 - (0 + sqrt(432) + (sqrt(432)1)*2 + sqrt(432)). -264sqrt(3) + 1321 Simplify (5sqrt(2448)-3 - (3 + sqrt(2448) + 3sqrt(2448)))2. 1368sqrt(17) + 883737 Simplify -6sqrt(22)/((sqrt(56)/sqrt(7))/sqrt(4)). -6sqrt(11) Simplify sqrt(45)/sqrt(324). sqrt(5)/6 Simplify sqrt(320)/(sqrt(10) - (sqrt(20)/(sqrt(6)/sqrt(3)) - sqrt(10))). 4sqrt(2) Simplify sqrt(20)/(sqrt(10)-2) + sqrt(14)/(sqrt(14)/sqrt(2)). sqrt(2)/2 Simplify ((sqrt(1088) - (sqrt(1088)5 + -2)) + sqrt(1088))2. -96sqrt(17) + 9796 Simplify (1sqrt(180) + 1)2. 12sqrt(5) + 181 Simplify sqrt(27)/(sqrt(81)3)2. 2sqrt(3)/9 Simplify sqrt(192)/(sqrt(432)/sqrt(8)). 4sqrt(2)/3 Simplify (sqrt(45) + -2)6. -12 + 18sqrt(5) Simplify (2(sqrt(19) + 0 + sqrt(19) + 2))2. 32sqrt(19) + 320 Simplify (2(sqrt(108)/sqrt(4)-5)/sqrt(9))2. 300 Simplify (sqrt(2299) + -1 + sqrt(2299) + sqrt(2299) + (1 + sqrt(304) - sqrt(19)))2. 24624 Simplify ((sqrt(560)/sqrt(40) - sqrt(56)) + sqrt(56))/(1sqrt(8)-1). -sqrt(7)/2 Simplify ((1sqrt(1029))/sqrt(3))2. 343 Simplify -2 + (sqrt(12)-5 + -3)*2. 60sqrt(3) + 307 Simplify (-2 + 2 + -2 + sqrt(108) + sqrt(108) + -3)*2. -120sqrt(3) + 457 Simplify sqrt(5) - -5sqrt(405) - (sqrt(405)-4 - sqrt(5) - sqrt(5)). 84sqrt(5) Simplify (-4 + sqrt(500) + 2 + sqrt(500) + -5)2. -280sqrt(5) + 2049 Simplify -1 + sqrt(11) + -1 + (sqrt(44)/sqrt(4))*2. sqrt(11) + 9 Simplify (sqrt(15)32)/(sqrt(45) + sqrt(45) + sqrt(90)/sqrt(2)). 2sqrt(3)/3 Simplify -4(1 + -1 + sqrt(1008) + sqrt(1008) + sqrt(1008)). -144sqrt(7) Simplify (-6(-1 + sqrt(1539)))2. -648sqrt(19) + 55440 Simplify (sqrt(931) + -2 + sqrt(931))*2 + -5. -56sqrt(19) + 3723 Simplify -1 + (-4(sqrt(304) + -3))2. -384sqrt(19) + 5007 Simplify -3 + ((sqrt(1100) - (1 + sqrt(1100))) + -2)-5. 12 Simplify ((sqrt(52) - (-1 + sqrt(52))) + 4)-2. -10 Simplify (1 + sqrt(1088))1. 1 + 8sqrt(17) Simplify sqrt(24)/((1sqrt(72) + sqrt(72))/sqrt(6)). sqrt(2)/2 Simplify (-12sqrt(33) - sqrt(33))/(-6sqrt(176)). sqrt(3)/8 Simplify (sqrt(18)/(sqrt(3) + sqrt(3)-2))/sqrt(3). -sqrt(2) Simplify (sqrt(720) + -1 + -3 + 5)2. 24sqrt(5) + 721 Simplify (0 + 4 + sqrt(1100) + -1)*2. 60sqrt(11) + 1109 Simplify ((-1sqrt(170))/sqrt(10) + sqrt(17))-5. 0 Simplify (-6(sqrt(48) + (sqrt(48) - (sqrt(336)/sqrt(28) - sqrt(48)))))2. 10800 Simplify (sqrt(567) + sqrt(567) + -1 + -1)2 + ((sqrt(567) + 2)5)*2. 828sqrt(7) + 16547 Simplify sqrt(68)2-4 + 3. -16sqrt(17) + 3 Simplify 61sqrt(12). 12sqrt(3) Simplify (2(sqrt(720) - (sqrt(720) + 1 + (sqrt(720) - (sqrt(720) + 1)))))2. 0 Simplify (sqrt(91)/(((sqrt(112) - sqrt(7))6 - sqrt(7)) + sqrt(7)))*2. 13/324 Simplify (sqrt(35)-2)/sqrt(7) - 1sqrt(245). -9sqrt(5) Simplify ((sqrt(91) + sqrt(91)-1-1)/(sqrt(42)/(sqrt(6) + sqrt(24) - sqrt(6))))*2. 208 Simplify (-41(sqrt(2448) + 4sqrt(2448)))*2. 979200 Simplify (sqrt(57) + 2sqrt(912))/((sqrt(3) + 2sqrt(3))6) + 5. sqrt(19)/2 + 5 Simplify (6(-1(sqrt(1584) + 1sqrt(1584) + sqrt(1584)) + sqrt(1584)))2. 228096 Simplify (sqrt(1568) + (sqrt(1568) - (sqrt(1568) - (sqrt(1568)-2 + -5))) + sqrt(1568) + 0)*2. 25 Simplify ((sqrt(153) + sqrt(17))6)*2 - (4 + 0 + sqrt(17)). -sqrt(17) + 9788 Simplify 1(sqrt(324)/sqrt(3))*2 + 2. 110 Simplify (-3 + sqrt(11))-3 + 1. -3sqrt(11) + 10 Simplify 2sqrt(605) + (sqrt(135)/sqrt(3) - sqrt(45))/sqrt(9). 22sqrt(5) Simplify -1 + 3 + sqrt(5) + 2 + (sqrt(20))2. sqrt(5) + 24 Simplify ((sqrt(220)-2 + sqrt(220))/sqrt(11))/(-61sqrt(4)). sqrt(5)/6 Simplify 3 + (-2 + sqrt(5) + 1)*2 - (sqrt(10)/(sqrt(8)/sqrt(4) + sqrt(2)) + -1sqrt(5)5). 5sqrt(5)/2 + 9 Simplify (sqrt(60)/sqrt(90))/(sqrt(33)/sqrt(176)). 4sqrt(2)/3 Simplify sqrt(1584) + sqrt(1584) + sqrt(1584) + ((sqrt(1584) + sqrt(1584)-2)3)2 + (sqrt(1584) - (-1 + sqrt(1584))2)-3. -72sqrt(11) + 19011 Simplify -2sqrt(75)-3. 30sqrt(3) Simplify ((sqrt(14)-3)/sqrt(2) + sqrt(7))2 + sqrt(28)/(-3sqrt(4)). -sqrt(7)/3 + 28 Simplify (2(sqrt(88) + 1sqrt(88) + sqrt(88) + sqrt(88)))/(-12sqrt(8))-3. 12sqrt(11) Simplify -2(-2sqrt(475) - sqrt(19)). 22sqrt(19) Simplify (-52sqrt(432)2)*2. 172800 Simplify (sqrt(133) + 4sqrt(133)1)/((sqrt(49)-3)/sqrt(7)). -5sqrt(19)/3 Simplify (sqrt(700) - sqrt(700)-2)*2 + sqrt(7) + sqrt(7) + (sqrt(7) - sqrt(252)) + 1. -3sqrt(7) + 6301 Simplify ((sqrt(160)/sqrt(4))/sqrt(8) + 3sqrt(80))2. 845 Simplify ((sqrt(121)-13 + sqrt(121))/(3sqrt(11)2 - sqrt(11)))2. 44/25 Simplify (-2-2sqrt(95))/(sqrt(60)/(sqrt(36)/sqrt(3))). 4sqrt(19) Simplify (-62sqrt(88))/((1sqrt(24))/sqrt(3)). -12sqrt(11) Simplify 4 + 5(2 + sqrt(539))2. 140sqrt(11) + 2719 Simplify -2 + sqrt(425) + -4. -6 + 5sqrt(17) Simplify (0 + sqrt(425) + -3)-4. -20sqrt(17) + 12 Simplify (sqrt(24)/(-2-1sqrt(12)))2. 1/2 Simplify (1sqrt(90)/sqrt(2))/((sqrt(90)1 + sqrt(90))/sqrt(10)). sqrt(5)/2 Simplify -4 + sqrt(81)/sqrt(3). -4 + 3sqrt(3) Simplify sqrt(121)/(sqrt(44)/sqrt(4)) + 4. sqrt(11) + 4 Simplify 3(sqrt(704) + sqrt(704) + 0 - sqrt(704)). 24sqrt(11) Simplify (sqrt(95)14 - sqrt(95))/sqrt(5) + -6(sqrt(19) - (sqrt(19) - (sqrt(171)1)/sqrt(9)))*2. -114 + 3sqrt(19) Simplify ((-5sqrt(17)-3 + sqrt(17) - sqrt(17)) + -1)*2. -30sqrt(17) + 3826 Simplify sqrt(68)/(sqrt(196) + 1sqrt(196)). sqrt(17)/14 Simplify 5 + sqrt(405)5. 5 + 45sqrt(5) Simplify (sqrt(176) + 1 + -4 + 3sqrt(176)1)2. -96sqrt(11) + 2825 Simplify 2(sqrt(7) + -2) - (sqrt(7) - (-5 + sqrt(7) + -2)). -11 + 2sqrt(7) Simplify (5(sqrt(75) - -2sqrt(75)))*2. 16875 Simplify (sqrt(2) + 1)-2 + sqrt(2) + 4. -sqrt(2) + 2 Simplify -3(sqrt(1100) - 6(sqrt(1100) + 0 - sqrt(1100) - sqrt(1100))*2)-2. -39600 + 60sqrt(11) Simplify (-1 + (sqrt(140) + (sqrt(140)1 - sqrt(140) - sqrt(140)))/sqrt(5) + -1 + sqrt(4032))*2. -96sqrt(7) + 4036 Simplify sqrt(3)2-43. -24sqrt(3) Simplify 2sqrt(187)/(sqrt(33)/sqrt(3)) + -1. -1 + 2sqrt(17) Simplify 0 + (sqrt(190)/sqrt(10) - sqrt(19) - sqrt(19))3-3. 9sqrt(19) Simplify (sqrt(24) - (sqrt(1944) - (sqrt(1944) + (sqrt(1944) - (sqrt(1944) - sqrt(1944)2))) - sqrt(24)))/sqrt(12). 20sqrt(2) Simplify ((sqrt(75)/(sqrt(3)-3))/(6sqrt(5)2))*2. 5/1296 Simplify (1(5(sqrt(68) + -1) + sqrt(68) + -4))2. -216sqrt(17) + 2529 Simplify (3 + (sqrt(684) - (sqrt(684) + -3 + sqrt(684)) - sqrt(684) - sqrt(684)) + 4)*2. -360sqrt(19) + 6256 Simplify (sqrt(38)25)/(sqrt(1078)/sqrt(11)). 10sqrt(19)/7 Simplify (-2 + sqrt(11) + 0)-2. -2sqrt(11) + 4 Simplify -3(0 + sqrt(2) + -3sqrt(2) + 5). -15 + 6sqrt(2) Simplify ((sqrt(304) - sqrt(304)2 - 4sqrt(2299)) +	{ "pile_set_name": "DM Mathematics" }
ded by 13. 11 Let f(a) = 8a2 + a. Let n(b) = b - 5. What is the remainder when f(-1) is divided by n(9)? 3 Let w(i) = -i3 + 5i*2 + 3i - 7. Let f = -3 + 8. Calculate the remainder when 3/12 + (-110)/(-8) is divided by w(f). 6 Suppose 3x - 2s + 12 = 3s, -x - 12 = s. Let q = x + 22. Calculate the remainder when (-91)/((-3)/12) is divided by q. 10 Let o(p) = -p*2 - 9p + 9. Let n be (-6)/(-4)12/(-2). Calculate the remainder when 33 is divided by o(n). 6 Let g(i) = -i2 + 17i + 2. What is the remainder when g(6) is divided by 14? 12 Let u(y) = 3y2 + 9y - 76. What is the remainder when u(6) is divided by 18? 14 Suppose -z + 6 = -o, -z + 8 = -2o - 2. Suppose f = z - 4. Let d(y) = 8y*2 + 4y + 3. Calculate the remainder when d(f) is divided by 10. 7 Let s(a) = a*3 + 4a*2 + 2a - 2. Suppose 3p + 0p - 117 = -3v, v - 42 = -2p. What is the remainder when (-8)/v + (-141)/(-27) is divided by s(-2)? 1 Let d(x) = -x*2 - 10x + 12. Calculate the remainder when 59 is divided by d(-10). 11 Suppose 3c + 15 = -4v + 1, -4c + 5v = -33. Suppose -ct + 56 = 5d, -5d + 2t - 5t = -54. What is the remainder when d is divided by 7? 5 Let x(c) = c2 + 3c + 2. Let v be x(-3). What is the remainder when 16 is divided by (-4)/(-8)v + 9? 6 Let l(q) = q2 - 2q + 4. Suppose 2d + 5i - 2 = 0, d - 6 = -3i - 2i. What is the remainder when 110 is divided by l(d)? 26 Let a be ((-140)/(-3))/(2/9). Suppose 5i = -25, a = -o + 6o - 2i. Calculate the remainder when o is divided by 14. 12 Let q(i) = 3i*2 - 3i + 1. Calculate the remainder when q(3) is divided by 2 - 8/(-4)4. 9 Suppose -13f + 36 = -9f. What is the remainder when 56 is divided by f? 2 Suppose 2r + 2q - 136 = 0, 2q = -2r + 7q + 164. Suppose -6l = -2l - r. What is the remainder when l is divided by 10? 8 What is the remainder when 10 is divided by (-8)/(-16) + 30/4? 2 Let z(d) = -98d3 - d. Let i be z(-1). Let p = i - 41. What is the remainder when p is divided by 15? 13 Suppose -3l + 4 = -2l, -4x = -5l + 836. What is the remainder when (-4)/(38/x) is divided by 12? 10 Let k(b) = b*2 - 3. Let a = -3 + -1. Let y be k(a). Suppose 0 = 3s - 11 - y. What is the remainder when 14 is divided by s? 6 Let x = -53 + 74. What is the remainder when 81 is divided by x? 18 Let t = -18 - -41. What is the remainder when t is divided by 8? 7 Let d = -20 - -32. Calculate the remainder when 45 is divided by d. 9 Let a be ((-1)/3)/((-6)/36). Suppose -2f + 28 = af. Calculate the remainder when 19 is divided by (0 - -2)/(2/f). 5 Let p be 18(2 + (-15)/9). Suppose 3m + 36 = pm. What is the remainder when 33 is divided by m? 9 Let l = 7 + -7. Suppose 2t - z = -2t - 15, l = t - 2z + 9. What is the remainder when 1 - (t - 11) - -1 is divided by 9? 7 Suppose 13 = 3v + 5t, 0 = -v - 4t + 6t - 3. Suppose -5 = 5m - 2w, 0w - 16 = 4m - 4w. Calculate the remainder when 5 - 2/m - 0 is divided by v. 0 Suppose -32s + 26s = -198. Calculate the remainder when 97 is divided by s. 31 Suppose -d - x = -0x - 5, 3x = 5d - 1. Let w be 2 - 1d/(-2). Suppose -4p + 62 = wn, 0 = 3n + 5 + 1. What is the remainder when p is divided by 9? 8 Let o = 4 + -2. Suppose oy - 1 = 3. Suppose -yf + 27 + 49 = 0. Calculate the remainder when f is divided by 13. 12 Suppose -2w = -0w - 64. Let y = w - 4. What is the remainder when y is divided by 15? 13 What is the remainder when 6 is divided by 2/(-4) - (-7)/2? 0 Let v = -5 - -16. Suppose -2p + 39 = 13. Suppose 5n + p - 113 = 0. What is the remainder when n is divided by v? 9 Let r(n) = -n*3 - 8n*2 + 7n + 2. What is the remainder when 57 is divided by r(-9)? 17 Let g = -33 - -9. Calculate the remainder when 23 is divided by g/(-15)5/1. 7 Suppose 3i + 78 = 3q, 3q + i = q + 67. What is the remainder when q is divided by (64/2)/(-3 + 5)? 15 Suppose 2z = 5t - 94, z - 85 = -5t + 6z. Suppose -3f - r + t = f, 0 = 5f - 5r. What is the remainder when f is divided by 2? 0 Suppose 0 = -w - w. Suppose w = 3n + 2n - 210. Suppose -n - 30 = -4q. What is the remainder when q is divided by 10? 8 Calculate the remainder when -3 + 29 + 4/(-4) is divided by 14. 11 Let z be (-2)/(-14) - (-2)/(-14). Suppose 3m + 4p - 75 = z, 49 + 29 = 4m - 2p. Let g = -15 - -27. What is the remainder when m is divided by g? 9 Let j = -34 - -47. What is the remainder when 35 is divided by j? 9 Suppose 2b + 22 - 4 = 0. Calculate the remainder when 61 is divided by (b/6)/(3/(-42)). 19 Let n(f) = -4f - 2. Let o be n(-3). Suppose 5d = -t - o + 110, 2t - 29 = -d. Calculate the remainder when 35 is divided by d. 16 Suppose 5y - 5t - 345 = 0, -9 + 5 = 4t. Calculate the remainder when y is divided by 27. 14 Let l(n) = -5n + 4 - 3n + 2n + 4n. What is the remainder when 47 is divided by l(-6)? 15 Calculate the remainder when ((-3)/(-3))/(1/2) is divided by 1. 0 Let l = 22 - -23. What is the remainder when l is divided by 16? 13 Let f(h) = h3 - 3h*2 + 3h + 3. Let p be f(3). Let r(j) = 7j - 8j*2 + 7j*2 + 13 + 2j*2 - 19j. Calculate the remainder when r(p) is divided by 7. 6 Let j(r) = -r*3 + 8r*2 - 5r - 8. Let l be j(7). Suppose -43 = 2h - lh + 5z, -3z - 9 = 0. Calculate the remainder when 19 is divided by h. 5 Let v(x) = -11x. Let n be v(-1). What is the remainder when 63 is divided by (-2)/n + 178/11? 15 What is the remainder when (4/3)/((-6)/(-333)) is divided by 25? 24 Suppose 4a - 96 = a. Suppose 22 = -7x + 141. Calculate the remainder when a is divided by x. 15 Let o(v) = -v3 - v2 + 23. What is the remainder when o(0) is divided by 12? 11 What is the remainder when 8 is divided by 3 - 7 - -9 - 0? 3 Suppose -5 = -2f + 17. What is the remainder when 19 is divided by f? 8 Suppose 0 = 6a - 3a - 342. Calculate the remainder when a is divided by 39. 36 Calculate the remainder when 387 is divided by (-4)/56-2021. 27 Let b be 17/4 - 9/(-12). Suppose bl = 31 + 19. Suppose 0 = -2a + l + 8. Calculate the remainder when a is divided by 5. 4 Suppose -4w - 5i = -6w + 61, w + 5i + 7 = 0. Let u(c) = c*2 - 3c + 6. Let m be u(6). Suppose m = 3j - 6. Calculate the remainder when w is divided by j. 8 Let d(w) = -12w*3 - 8w + 0w3 + 7w - w2. Let g(u) = -u2 + 9u + 2. Calculate the remainder when g(5) is divided by d(-1). 10 Let p(q) = -q2 - 4q + 1. Let w be p(-2). Suppose 4h - 34 + 9 = -5a, -15 = -3a + wh. Let z(u) = u. What is the remainder when 13 is divided by z(a)? 3 Suppose -s = -3 - 7. Let c = -18 + 22. Calculate the remainder when s is divided by c. 2 Suppose c - 5c + 2u + 82 = 0, c + 2u = 28. Calculate the remainder when 87 is divided by c. 21 Suppose -3k = -4f + 365, 328 = 4f + k - 57. Calculate the remainder when f is divided by 24. 23 Suppose 0 = 2p + 5 - 13. Suppose -4f = -18 - 2, 60 = 4h + pf. What is the remainder when 37 is divided by h? 7 Suppose -n + 20 = 6. Calculate the remainder when 29 is divided by 138/n - (-10)/70. 9 Suppose -69 = -2h - h. Suppose l - 25 + h = 0. Calculate the remainder when 6 is divided by l. 0 Let s = 3 - 6. Let n = 194 + -180. What is the remainder when (0 + (-40)/3)s is divided by n? 12 Let z(c) = -2c + 4. Let i be z(-3). Let f be (4/i)/(1/110). Suppose 0r - 52 = -4a + 2r, 4a - f = 4r. What is the remainder when 43 is divided by a? 13 Let d be 3 - 3/(-3)-3. Suppose d = -4y + 3k + 24, -2y = -3y - k + 6. What is the remainder when y is divided by 5? 1 Suppose 5j = -2x + 18, -5j + 0j + 2x + 2 = 0. Suppose -3y - 2 = -5s, -y - 2 = -js - 1. What is the remainder when (y + -2)/((-1)/9) is divided by 5? 4 Let f(w) = 2w3 + w2 - 3w + 1. What is the remainder when 27 is divided by f(2)? 12 What is the remainder when 17 is divided by 22(-3)/(-12) + 2/(-4)? 2 Let c be 1 + -3 - 1/1. Let u = c + 8. Suppose -53 = -uf - 13. Calculate the remainder when 22 is divided by f. 6 Suppose 0 = -x - 2d + 9, -2x + 8 + 10 = -4d. What is the remainder when x is divided by 6? 3 Suppose -5 - 13 = -2v + 2u, -u = 5v - 21. Calculate the remainder when 8 is divided by v. 3 Let g = -21 - -15. Let b(c) = c2 + c - 1. Let h(q) = -4q*2 - 10q + 4. Let l(d) = 3b(d) + h(d). What is the remainder when 12 is divided by l(g)? 5 Let o = -17 + 19. Suppose 0r + o*r =	{ "pile_set_name": "DM Mathematics" }
4 to the power of 1/2, to the nearest integer? 302 What is the sixth root of 396536 to the nearest integer? 9 What is the square root of 176224 to the nearest integer? 420 What is the sixth root of 5193328 to the nearest integer? 13 What is the cube root of 1499035 to the nearest integer? 114 What is the cube root of 3307188 to the nearest integer? 149 What is 345784 to the power of 1/10, to the nearest integer? 4 What is the square root of 201522 to the nearest integer? 449 What is 678002 to the power of 1/2, to the nearest integer? 823 What is the ninth root of 293863 to the nearest integer? 4 What is 2170 to the power of 1/2, to the nearest integer? 47 What is the square root of 639223 to the nearest integer? 800 What is 14762728 to the power of 1/8, to the nearest integer? 8 What is the third root of 83638 to the nearest integer? 44 What is 8156740 to the power of 1/3, to the nearest integer? 201 What is 943411 to the power of 1/2, to the nearest integer? 971 What is the square root of 1141418 to the nearest integer? 1068 What is 122268 to the power of 1/9, to the nearest integer? 4 What is the cube root of 41779208 to the nearest integer? 347 What is 1840895 to the power of 1/6, to the nearest integer? 11 What is the square root of 13351477 to the nearest integer? 3654 What is the square root of 753240 to the nearest integer? 868 What is 4623527 to the power of 1/2, to the nearest integer? 2150 What is the fifth root of 1525914 to the nearest integer? 17 What is 3405652 to the power of 1/2, to the nearest integer? 1845 What is the cube root of 3890715 to the nearest integer? 157 What is the square root of 14026 to the nearest integer? 118 What is 2513120 to the power of 1/6, to the nearest integer? 12 What is 370388 to the power of 1/2, to the nearest integer? 609 What is 1987039 to the power of 1/2, to the nearest integer? 1410 What is the third root of 11024321 to the nearest integer? 223 What is 309051 to the power of 1/8, to the nearest integer? 5 What is 2278544 to the power of 1/5, to the nearest integer? 19 What is the square root of 3655720 to the nearest integer? 1912 What is the square root of 9735347 to the nearest integer? 3120 What is 3959378 to the power of 1/7, to the nearest integer? 9 What is the square root of 5598540 to the nearest integer? 2366 What is the third root of 567192 to the nearest integer? 83 What is the square root of 11234378 to the nearest integer? 3352 What is the square root of 4143203 to the nearest integer? 2035 What is 727345 to the power of 1/2, to the nearest integer? 853 What is the third root of 231105 to the nearest integer? 61 What is the square root of 2845757 to the nearest integer? 1687 What is the cube root of 1059950 to the nearest integer? 102 What is the tenth root of 93917 to the nearest integer? 3 What is 179110 to the power of 1/10, to the nearest integer? 3 What is the third root of 1170771 to the nearest integer? 105 What is 339570 to the power of 1/3, to the nearest integer? 70 What is the cube root of 396342 to the nearest integer? 73 What is 19414671 to the power of 1/2, to the nearest integer? 4406 What is the ninth root of 786452 to the nearest integer? 5 What is the cube root of 304654 to the nearest integer? 67 What is the tenth root of 606253 to the nearest integer? 4 What is 9165076 to the power of 1/5, to the nearest integer? 25 What is 1497471 to the power of 1/3, to the nearest integer? 114 What is 34183964 to the power of 1/2, to the nearest integer? 5847 What is the square root of 363778 to the nearest integer? 603 What is 84001 to the power of 1/3, to the nearest integer? 44 What is the third root of 147380 to the nearest integer? 53 What is the fourth root of 1284090 to the nearest integer? 34 What is the fourth root of 1096991 to the nearest integer? 32 What is 13130713 to the power of 1/3, to the nearest integer? 236 What is 1958527 to the power of 1/5, to the nearest integer? 18 What is 10047660 to the power of 1/3, to the nearest integer? 216 What is the square root of 412644 to the nearest integer? 642 What is 263692 to the power of 1/2, to the nearest integer? 514 What is the fifth root of 1347678 to the nearest integer? 17 What is 222261 to the power of 1/3, to the nearest integer? 61 What is the third root of 670401 to the nearest integer? 88 What is the tenth root of 273906 to the nearest integer? 3 What is 2085210 to the power of 1/2, to the nearest integer? 1444 What is 119305 to the power of 1/4, to the nearest integer? 19 What is the third root of 2231855 to the nearest integer? 131 What is the square root of 18217825 to the nearest integer? 4268 What is the ninth root of 9691095 to the nearest integer? 6 What is the eighth root of 878861 to the nearest integer? 6 What is the third root of 1411183 to the nearest integer? 112 What is 6445950 to the power of 1/2, to the nearest integer? 2539 What is the sixth root of 62473 to the nearest integer? 6 What is 178363 to the power of 1/2, to the nearest integer? 422 What is the seventh root of 169750 to the nearest integer? 6 What is 6256262 to the power of 1/2, to the nearest integer? 2501 What is 497814 to the power of 1/3, to the nearest integer? 79 What is the eighth root of 1933238 to the nearest integer? 6 What is 1079337 to the power of 1/2, to the nearest integer? 1039 What is the square root of 252530 to the nearest integer? 503 What is the square root of 1318488 to the nearest integer? 1148 What is 204729 to the power of 1/2, to the nearest integer? 452 What is the third root of 1803543 to the nearest integer? 122 What is the fourth root of 13125780 to the nearest integer? 60 What is the third root of 3984763 to the nearest integer? 159 What is the square root of 486540 to the nearest integer? 698 What is the square root of 24031 to the nearest integer? 155 What is the cube root of 546473 to the nearest integer? 82 What is 42809 to the power of 1/3, to the nearest integer? 35 What is the fourth root of 21714480 to the nearest integer? 68 What is 27293720 to the power of 1/2, to the nearest integer? 5224 What is the cube root of 1007894 to the nearest integer? 100 What is the sixth root of 18418105 to the nearest integer? 16 What is the cube root of 2208547 to the nearest integer? 130 What is 191079 to the power of 1/6, to the nearest integer? 8 What is 3386785 to the power of 1/2, to the nearest integer? 1840 What is the square root of 167595 to the nearest integer? 409 What is 37789 to the power of 1/3, to the nearest integer? 34 What is the ninth root of 981141 to the nearest integer? 5 What is 1859161 to the power of 1/2, to the nearest integer? 1364 What is 9938429 to the power of 1/3, to the nearest integer? 215 What is 2870778 to the power of 1/3, to the nearest integer? 142 What is the sixth root of 77526 to the nearest integer? 7 What is 13731980 to the power of 1/2, to the nearest integer? 3706 What is the square root of 22147693 to the nearest integer? 4706 What is 42027 to the power of 1/3, to the nearest integer? 35 What is 481138 to the power of 1/2, to the nearest integer? 694 What is the square root of 72119 to the nearest integer? 269 What is the seventh root of 18292260 to the nearest integer? 11 What is 1601674 to the power of 1/2, to the nearest integer? 1266 What is 972912 to the power of 1/8, to the nearest integer? 6 What is the seventh root of 403340 to the nearest integer? 6 What is the fifth root of 417922 to the nearest integer? 13 What is 8879782 to the power of 1/8, to the nearest integer? 7 What is the tenth root of 2072260 to the nearest integer? 4 What is the third root of 2826998 to the nearest integer? 141 What is 12944364 to the power of 1/2, to the nearest integer? 3598 What is the fourth root of 3048233 to the nearest integer? 42 What is 48260 to the power of 1/9, to the nearest integer? 3 What is 34128506 to the power of 1/4, to the nearest integer? 76 What is the third root of 1638291 to the nearest integer? 118 What is the third root of 3598014 to the nearest integer? 153 What is 1353248 to the power of 1/2, to the nearest integer? 1163 What is the fifth root of 70555 to the nearest integer? 9 What is the square root of 81602 to the nearest integer? 286 What	{ "pile_set_name": "DM Mathematics" }
0 in increasing order. -10, -8, -4, 2, 3 Sort 8, -2, 121 in decreasing order. 121, 8, -2 Sort 0, 21, -9 in ascending order. -9, 0, 21 Sort 40, -25, -2. -25, -2, 40 Sort -7, 12, 0. -7, 0, 12 Put -9, 0, -2, -4 in decreasing order. 0, -2, -4, -9 Sort -0.3, 27, -0.4, 15. -0.4, -0.3, 15, 27 Sort 2, 0.1, -3/2, -3/5 in ascending order. -3/2, -3/5, 0.1, 2 Sort -6, 0.3, -4 in decreasing order. 0.3, -4, -6 Sort 139, -2, 87 in descending order. 139, 87, -2 Sort 3, -0.5, 2/13, -0.1 in ascending order. -0.5, -0.1, 2/13, 3 Sort 3, -1/3, -0.05, 10 in decreasing order. 10, 3, -0.05, -1/3 Sort -9, -0.4, 2 in descending order. 2, -0.4, -9 Sort 0.4, -3/2, 0, -1.7, 2 in decreasing order. 2, 0.4, 0, -3/2, -1.7 Sort -1, 4, 144. -1, 4, 144 Sort -2420, -2/9, -0.1, 1/3. -2420, -2/9, -0.1, 1/3 Put -8, -15, 4 in ascending order. -15, -8, 4 Put -5, 0.3, 1/3, 8.5 in descending order. 8.5, 1/3, 0.3, -5 Sort 3, 6, 8. 3, 6, 8 Sort -1, -2, 5, 2, -9. -9, -2, -1, 2, 5 Sort 3, 28, -0.6 in decreasing order. 28, 3, -0.6 Put 2, -6, 6 in decreasing order. 6, 2, -6 Sort -5, -3, -877, -7. -877, -7, -5, -3 Sort -2, -5, 4, -4, 61 in decreasing order. 61, 4, -2, -4, -5 Sort -3.4, -6, 3, 2. -6, -3.4, 2, 3 Sort -1, 1, -75, 2. -75, -1, 1, 2 Sort 3, 5, -10, -5 in decreasing order. 5, 3, -5, -10 Sort 0.01, 0.5, 4, 38. 0.01, 0.5, 4, 38 Sort -0.3, -137, -3, -3/4, -1/2. -137, -3, -3/4, -1/2, -0.3 Sort 3/8, 0.5, -1/5, -5 in decreasing order. 0.5, 3/8, -1/5, -5 Sort 2, 7, -4 in ascending order. -4, 2, 7 Put 9/5, 0.4, -0.4, 3 in ascending order. -0.4, 0.4, 9/5, 3 Put -1, 1, 19 in decreasing order. 19, 1, -1 Put -1, 2530, 4 in ascending order. -1, 4, 2530 Sort 3, 16, 0. 0, 3, 16 Sort -13, -16, 4, -4, 1. -16, -13, -4, 1, 4 Put 3, -1650, -0.1, -1 in increasing order. -1650, -1, -0.1, 3 Sort -2/3, -2/5, -3, -0.1. -3, -2/3, -2/5, -0.1 Sort -0.1, 7, 0.4, -2, -1/8. -2, -1/8, -0.1, 0.4, 7 Sort -2/7, -2, 0.3, 3/31. -2, -2/7, 3/31, 0.3 Sort 0, -3, 4. -3, 0, 4 Put 2, 6/13, -1 in descending order. 2, 6/13, -1 Put 0, -10, -1, -5 in descending order. 0, -1, -5, -10 Sort 28, -358, -3 in decreasing order. 28, -3, -358 Sort 0.3, -2/11, 0.8 in decreasing order. 0.8, 0.3, -2/11 Put 9, -2, -1/4, 2, -4/3 in ascending order. -2, -4/3, -1/4, 2, 9 Sort -2/387, -3/7, 0.3. -3/7, -2/387, 0.3 Sort -4, 4, -16. -16, -4, 4 Sort 0.04, -2/25, -2/3, 3/4 in decreasing order. 3/4, 0.04, -2/25, -2/3 Put 9, 1/8, -1/27 in descending order. 9, 1/8, -1/27 Put -2, 5, 296, -7 in decreasing order. 296, 5, -2, -7 Put -2, -1, -5, 3, -44 in decreasing order. 3, -1, -2, -5, -44 Sort -3, 3, -1, 10 in decreasing order. 10, 3, -1, -3 Sort -0.9, 0.3, 0.7, 0.5 in descending order. 0.7, 0.5, 0.3, -0.9 Put 93, 1, -4 in descending order. 93, 1, -4 Sort -9, 0, 4, 1, -51 in descending order. 4, 1, 0, -9, -51 Sort 2, 1, 30, 21, 3 in increasing order. 1, 2, 3, 21, 30 Sort -1, -13, 3, 0.2 in descending order. 3, 0.2, -1, -13 Sort 0, -3, 2, 50 in descending order. 50, 2, 0, -3 Sort 5.1, 2, 0, 0.5 in increasing order. 0, 0.5, 2, 5.1 Put -16, -0.2, -0.5 in descending order. -0.2, -0.5, -16 Sort 3, -58, -4, -5. -58, -5, -4, 3 Sort -4, -29, 11/3 in increasing order. -29, -4, 11/3 Sort -3, -6, -1, 4 in descending order. 4, -1, -3, -6 Put 2/13, 3, 2/3, 1, 2/9 in descending order. 3, 1, 2/3, 2/9, 2/13 Sort -45, 3, -2/29 in descending order. 3, -2/29, -45 Put -8, 0, -2, -4 in ascending order. -8, -4, -2, 0 Put 4/7, 5, 0.03526 in increasing order. 0.03526, 4/7, 5 Sort -4, -24, -5, 2 in increasing order. -24, -5, -4, 2 Put 4, 38, -1, 3, -3 in ascending order. -3, -1, 3, 4, 38 Sort -190, -2, 24. -190, -2, 24 Sort -5, -31, 5, -0.1 in decreasing order. 5, -0.1, -5, -31 Sort 1.6, 9/8, -7. -7, 9/8, 1.6 Sort -2, -1, 2 in descending order. 2, -1, -2 Sort 2, 3, 4, -37. -37, 2, 3, 4 Put -1, -9, 2 in increasing order. -9, -1, 2 Sort 7, -9/11, 17 in decreasing order. 17, 7, -9/11 Put 4/13, 1, 1/44 in descending order. 1, 4/13, 1/44 Sort 1/6, -0.2, -18, -1, 0 in descending order. 1/6, 0, -0.2, -1, -18 Sort -4, -21, 3, 5. -21, -4, 3, 5 Sort 3, 5, 4 in ascending order. 3, 4, 5 Sort -5, 0.5, 9 in descending order. 9, 0.5, -5 Sort -3, 7, -2, -4 in ascending order. -4, -3, -2, 7 Put 3/5, -8.7, -5 in decreasing order. 3/5, -5, -8.7 Sort 0.036, 4, 3, -3, 2. -3, 0.036, 2, 3, 4 Sort -1, -4, -115, -5, -3. -115, -5, -4, -3, -1 Sort -0.5, -1/28, -1, -1.6, -2. -2, -1.6, -1, -0.5, -1/28 Put 1, 5, 10, -5, -3 in decreasing order. 10, 5, 1, -3, -5 Put 5, 2, -26 in descending order. 5, 2, -26 Sort 2/3, 4, 2/53 in decreasing order. 4, 2/3, 2/53 Sort 3, -1, 48. -1, 3, 48 Put 4, -8/17, 2, -2/7 in descending order. 4, 2, -2/7, -8/17 Sort 5, -3, 6, -1 in decreasing order. 6, 5, -1, -3 Sort 4, 7/2, 0 in decreasing order. 4, 7/2, 0 Put -2, 4, -7, 21 in ascending order. -7, -2, 4, 21 Sort 4, -0.4, -2/3, 2/45. -2/3, -0.4, 2/45, 4 Sort 1, -4, -148 in decreasing order. 1, -4, -148 Put -4, -5, -2, -106, -1 in increasing order. -106, -5, -4, -2, -1 Sort -18, -2, 5, 27, 2 in increasing order. -18, -2, 2, 5, 27 Sort 4, 114, 13, -1, 0 in increasing order. -1, 0, 4, 13, 114 Sort -3, 1, -5, 11 in descending order. 11, 1, -3, -5 Sort -2/9, 58, -4/7, -0.4 in increasing order. -4/7, -0.4, -2/9, 58 Put -20, -4, 3, -1 in decreasing order. 3, -1, -4, -20 Sort -2, 4, 0, -5, 30 in descending order. 30, 4, 0, -2, -5 Put -30, -2, 2, 7, 5 in descending order. 7, 5, 2, -2, -30 Put 0.5, -24, -2/15, -2 in decreasing order. 0.5, -2/15, -2, -24 Sort -1, -5, -4, 363 in descending order. 363, -1, -4, -5 Put -0.4, 4, 0, 231 in descending order. 231, 4, 0, -0.4 Put -3097, -2, 2 in ascending order. -3097, -2, 2 Sort 3, -5, -1, 4 in decreasing order. 4, 3, -1, -5 Sort 5, 4, 40, 3 in ascending order. 3, 4, 5, 40 Sort 0, 4, 57, 10 in descending order. 57, 10, 4, 0 Put 5/6, 104, 1/10 in increasing order. 1/10, 5/6, 104 Sort 22/17, -0.1, 0.2, 4, -2 in decreasing order. 4, 22/17, 0.2, -0.1, -2 Put 2, -5, 5, 4, 1/3 in decreasing order. 5, 4, 2, 1/3, -5 Sort 6, 3, -1, 15, 5 in ascending order. -1, 3, 5, 6, 15 Sort -3, 3, -619. -619, -3, 3 Sort 2, 5, 3, -0.069 in increasing order. -0.069, 2, 3, 5 Put 4/7, -2, 63 in ascending order. -2, 4/7, 63 Sort -3, -7, -0.2, 3. -7, -3, -0.2, 3 Sort 2, 3, 7, -2 in increasing order. -2, 2, 3, 7 Put 0.3, 1/6, -0.2, -5 in increasing order. -5, -0.2, 1/6, 0.3 Sort -2/35, 5, 27, -2 in increasing order. -2, -2/35, 5, 27 Put 2, -2, 3, -10 in descending order. 3, 2, -2, -10 Sort -2, -3, -0.21, 3 in decreasing order. 3, -0.21, -2, -3 Put 5, -7, -3, 12, -1 in descending order. 12, 5, -1, -3, -7 Sort 2, 1, -1, -8. -8, -1, 1, 2 Sort 0.02, 244, 1/7, 2 in increasing order. 0.02, 1/7, 2, 244 Put -18, 3, -1/3, 4, -1/4 in decreasing order. 4, 3, -1/4, -1/3, -18 Put 0.5, -0.3, 0.2, -1/22, -2/7 in ascending order. -0.3, -2/7, -1/22, 0.2, 0.5 Sort -0.2, 0.03, 0 in decreasing order. 0.03, 0, -0.2 Sort 19, -5, -4 in ascending order. -5, -4, 19 Sort 2.71, 0.9, -5. -5, 0.9, 2.71 Put -5/2, 1.3, 2/11, 3 in decreasing order. 3, 1.3, 2/11, -5/2 Sort 0, 75, 2 in increasing order. 0, 2, 75 Sort 4, -5, -1, 2803 in decreasing order. 2803, 4, -1, -5 Put 3, 0, 9, 2/17 in decreasing order. 9, 3, 2/17, 0 Sort -22, -3, -4, -1 in decreasing order. -1, -3, -4, -22 Sort 0.2, 0.349, 3/5, -9, -0.1 in descending order. 3/5, 0.349, 0.2, -0.1, -9 Sort 1, -9, -0.3, -105, -4 in descending order. 1, -0.3, -4, -9, -105 Put 0, -5, 5, -1 in decreasing order. 5, 0, -1, -5 Sort -2/11, -7, 0.3 in ascending order. -7, -2/11, 0.3 Put 114, 1, 3 in descending order. 114, 3, 1 Sort 0, -5, 2, -2, 3 in ascending order. -5, -2, 0, 2, 3 Sort -2, 3, -55, -5. -55, -5, -2, 3 Sort 0.3, -2/11, -2, 1/2 in descending order. 1/2, 0.3, -2/11, -2 Put -7, 160, -5 in descending order. 160, -5, -7 Put -0.4, -8, 1/2, -4, -0.5 in decreasing order. 1/2, -0.4, -0.5, -4, -8 Sort 0.5, -0.007, 19 in descending order. 19, 0.5, -0.007 Put 6, 2, 5, 74 in descending order. 74, 6, 5, 2 Sort 8, 4, -7, -1 in decreasing order. 8, 4, -1, -7 Sort -1, 5, 1/65, 0.1 in descending order. 5, 0.1, 1/65, -1 Put -10, -4, 0, 5, 2 in decreasing order. 5, 2, 0, -4, -10 Put 2, 1, -47 in ascending order. -47, 1, 2 Put 10, -2, 1, 68 in decreasing order. 68, 10, 1, -2 Sort -5, -13, -3, 3 in decreasing order. 3, -3, -5, -13 Put -5, 16, 4 in decreasing order. 16, 4, -5 Put -5, 4, -0.5, -0.2 in ascending order. -	{ "pile_set_name": "DM Mathematics" }
Let s(o) be the second derivative of -1/20o5 + 2/3o*3 + 0 - 1/2o*4 - 2o*2 + 9o. What is the units digit of s(-7)? 7 Suppose 2a = -15 - 1. Let x(p) = -9p - 8. Let v be x(a). Let h = -33 + v. What is the units digit of h? 1 Let u(s) = -3 + 2 - s - 4 + 4. What is the units digit of u(-8)? 7 Let d(o) be the first derivative of 3 + 23o + 1/2o*2. What is the units digit of d(-10)? 3 Let c(i) = -557i*3 - 3i - 2. What is the units digit of c(-1)? 8 What is the thousands digit of 224/(-28) + 6322? 1 Let h = -411 - -913. What is the tens digit of h? 0 Let h be (-392)/6(3 + 27/(-6)). Suppose -m + h = -0m. What is the units digit of m? 8 Let u(x) = 41x*2 - 4x + 5. What is the tens digit of u(-2)? 7 Let q(w) = -72w + 32. Let y(o) = 216o - 97. Let r(z) = -7q(z) - 2y(z). What is the hundreds digit of r(3)? 1 Let g = 684 - 356. What is the units digit of g? 8 Suppose 171n = 184n - 23946. What is the units digit of n? 2 Let o(d) = d*3 - 8d*2 - 8d - 7. Let i be o(9). Suppose -2x + iu + 62 = u, 0 = -2x - 3u + 54. Suppose -c - c = -x. What is the units digit of c? 5 Let j(y) = y*3 - 16y*2 + y - 1. Let s be j(16). Let t be ((-18)/10)/(s/(-50)). Suppose -i = -ti + 125. What is the tens digit of i? 2 Let l be ((-144)/54)/(2/(-3)). Suppose -115 - 81 = -lq. Suppose -5k = 3s - 106, s + k + q = 3s. What is the tens digit of s? 2 Let j(c) = -c*2 + 3c + 85. Let t(l) = 2l3 + 3l*2 - 4l - 4. Let v be t(-2). What is the tens digit of j(v)? 8 Suppose -66395 = -20x - 7935. What is the tens digit of x? 2 Let i = 9 - 7. Let r be i/(-10) - (-4)/20. Suppose 5d - 5 = r, 5d + 88 = t + 2t. What is the tens digit of t? 3 Let d be (-180)/22 + (-4)/(-22). Let h(l) = 2l + 9. Let a be h(d). Let i = a + 17. What is the units digit of i? 0 Suppose -2 + 210 = 4f. Let q = 62 - f. What is the tens digit of q? 1 Let k be (-18)/(-4) - (-6)/12. Suppose km - 7a + 3a = 63, 4a = -m + 3. Suppose -16v + 40 = -mv. What is the units digit of v? 8 Suppose -2a - 3820 = -7a. What is the units digit of a? 4 Let w(j) = -52j - 45. What is the units digit of w(-22)? 9 Let v(i) be the first derivative of 31i*3 + i + 18. What is the units digit of v(-1)? 4 Suppose 4g + 4 = -3w, 0g - 5g - 2 = 3w. Let l be -6(-3)/12g. Suppose -x + 41 = 3u - 2, -u + 25 = lx. What is the tens digit of u? 1 Suppose 0t - t + 5 = m, -2m + 3t = 0. Suppose -mz - 2s + 44 = -7, 0 = -s. Let k = 18 - z. What is the units digit of k? 1 Let k be 3/(4/(-16)-3). Suppose -h + 17 = 2b, kh - 21 = -4b + 23. What is the units digit of b? 6 Suppose 5n + 5x = 55, 3n - 31 = 2n - 5x. Suppose -n = 2r, -5m + 51 = -3r - 28. What is the units digit of m + 6/2 - -2? 9 Let f be (1/(-7) - -1)/((-4)/(-14)). Suppose r - 131 - 107 = 2g, 0 = -fr + g + 689. What is the hundreds digit of r? 2 Suppose 3j - 9j + 288 = 0. Suppose 4x - j = x. Suppose 4r - 8 = -2l, -4r = -l - 3r + x. What is the tens digit of l? 1 Let k = 3316 - 2339. What is the units digit of k? 7 Let v = 793 - 344. Let m = v + -313. What is the units digit of m? 6 Let n(f) be the third derivative of f5/12 - f4/4 + f*3/3 - 2f*2 - 5. Let m = -6 + 8. What is the units digit of n(m)? 0 Suppose 12b = 379 + 905. What is the tens digit of b? 0 Suppose 12 = 2q - 3w, 0w - 2w - 13 = -3q. Suppose 50 = qg + 197. What is the units digit of (2/7)/((-7)/g)? 2 Let j(l) = 535l3 + 3l*2 - 9l + 5. What is the thousands digit of j(2)? 4 Suppose 64t + 1329 = 65t - 4a, -5244 = -4t - 2a. What is the thousands digit of t? 1 Let c(k) = 20k*2 - k + 1. Suppose 28 = u + 3u. Let o(f) = f - 6. Let w be o(u). What is the tens digit of c(w)? 2 What is the hundreds digit of -93(10 - 11)(0 - -5)? 4 Let q = -131 + 128. What is the units digit of 3/((-8)/(-428)q/(-2))? 7 Let d(t) = 6t*2 - 4t - 25. What is the hundreds digit of d(10)? 5 Let c be (-3 - -4 - -1)295/10. Let u(h) = 2h*2 + 3h - 2. Let z be u(4). Let t = c - z. What is the tens digit of t? 1 Suppose -5v = -2b - b, 0 = -3v + b. Suppose x - 5 + 1 = v. Suppose 0 = -xj - 2f + 68, 5j - 84 - 1 = -3f. What is the tens digit of j? 1 Suppose 11j = 6j + 30. Suppose h + 5f = 98, -jh + 2f + 326 = -2h. What is the tens digit of h? 8 Suppose -7v + 238 = -14. What is the tens digit of 20/v36? 1 What is the units digit of (6 + (-182)/28)/(3/(-11262))? 7 Suppose 0 = -x - 5q + 1362, 11x - 6x - 6831 = -4q. What is the units digit of x? 7 Suppose -4l - 3l + 7 = 0. Let u = l + 90. What is the tens digit of u? 9 Suppose 4r = 2r + 6. Suppose 7n = rn. Suppose n = 5k + 4d - 37, 0k - 4d + 17 = k. What is the units digit of k? 5 Let o(k) = 30k2 - 1. Let g be o(1). Suppose 1520 = ga - 10a. What is the units digit of a? 0 Let p = -35 - -38. Suppose 0 = -6l + pl. Suppose 2t - 2i - 24 = -li, i = 4t - 48. What is the tens digit of t? 1 Let w = -9 + 13. Suppose -q + 2q = -c + 3, -3c + 44 = -wq. Suppose -3i - 35 = -ci. What is the units digit of i? 7 Let j = -40 - -41. Let c(k) = 140k2 + 3k - 2. What is the hundreds digit of c(j)? 1 What is the units digit of (0 + -1 + 11)338? 0 Suppose -5n + 4957 + 2588 = 0. What is the hundreds digit of n? 5 Suppose -218s + 222s - 21756 = 0. What is the units digit of s? 9 Suppose -5a + a - 12 = 0. Let x = a + 6. Let u = x - -7. What is the tens digit of u? 1 Let u(h) = -h2 + 11h - 8. Suppose -3b - 20 = -5b. Let x be u(b). Suppose -4w + 132 = w + g, -30 = -w - xg. What is the tens digit of w? 2 Suppose -14 - 14 = -4c. Let z = 10 - c. What is the units digit of z? 3 Suppose 8b = 113 - 1073. Let c = -51 - b. What is the tens digit of c? 6 What is the units digit of (-50)/(-2)(-2 + (1 - -13))? 0 Let q = -14 - -23. Suppose -5m = 5l, -m = 4m + 2l - q. Suppose -mc + 24 = -4w, c - w = -2w + 1. What is the units digit of c? 4 Suppose 0 = 3g + 15 - 285. Suppose 0b = 5b - g. What is the tens digit of b? 1 Suppose 0 = 17x - 3433 - 2092. What is the tens digit of x? 2 Let d = 1527 - 775. What is the hundreds digit of d? 7 Let f(n) = n*3 - 15n*2 + 14n + 19. Suppose 5a - 62 = 8. What is the units digit of f(a)? 9 Let l be (-1)/3 - 16/(-12). Let i = 34 + l. Let q = 58 - i. What is the tens digit of q? 2 Let l(o) be the first derivative of o5/60 + o4/8 - o3/6 + 9o*2/2 - 8. Let y(s) be the second derivative of l(s). What is the tens digit of y(6)? 5 Suppose -5u = -u - 864. Let p = 365 - u. What is the hundreds digit of p? 1 Let f(c) = -3c2 + 95c + 24. What is the tens digit of f(16)? 7 Suppose -623d - 850 = -628d. What is the tens digit of d? 7 Suppose j = p - 3j + 4, 2p = -3j + 3. Let r be (-1)/(-2)(p - 0). What is the units digit of (-26 + 0 - r)-1? 6 Suppose 19 = -5p + 19. Suppose p = -2t + 88. What is the units digit of t? 4 Let i(m) = -125m + 33. What is the hundreds digit of i(-6)? 7 Suppose 0 = 2a + 5m + 6 - 20, -5a + 5m = 0. Suppose 4 = 2z, 7g - 4z = ag + 187. What is the tens digit of g? 3 Suppose -5t = o - 3543, 2t + 4o + 381 = 1791. What is the tens digit of t? 0 Let h(p) = -54p - 12. Let r be h(7). What is the units digit of ((-20)/(-50))/((-2)/r)? 8 Suppose -3214 = -10j + 3096. What is the hundreds digit of j? 6 Let z be (-3 - 1/3)3. Let j be (-484)/(-55) + (-2)/z. What is the units digit of 226/5 + j/(-45)? 5 Suppose 0c + 8 = 2c. Suppose -cl = -0l. Suppose l = 8a - 6a - 54. What is the tens digit of a? 2 Suppose -4d + 14d = 190. Suppose d = x - 37. What is the units digit of x? 6 Let d = 523 - 183. What is the hundreds digit of 24/2d/30? 1 Let o(a) = 0a3 - a2 + 9a2 + 1 - 7a2 + a3. Let m(l) = 4l3 + 10l*2 + 10. Let f(q) = -m(q) + 5o(q). What is the tens digit of f(6)? 3 Suppose -85p = -76p - 2232. What is the tens digit of p? 4 Suppose 36x = 42x - 2466. What is the tens digit of x? 1 Let s = -112 - -94. Let o(z) = -8z + 42. What is the tens digit of o(s)? 8 Let z(t) = -15t*3 + 3t*2 + 2t + 3. Let i be z(-2). What is the units digit of i - (-8 - -2)/(2 + 0)? 4 Let r(f) = 2f - 16. Let p be r(9). Suppose -pw - 45 = -5w. Suppose -14k + wk = 16. What is the tens digit of k? 1 Let j(v) = v2 - v - 4. Let p be j(3). Suppose 0 = pn - 7n + 15. Suppose -5t + 100 = -5c, 0 = -3t - n*c	{ "pile_set_name": "DM Mathematics" }
8. 506345 Convert 123755 (base 13) to base 4. 1222200203 What is -17655 (base 11) in base 16? -60a8 212310322 (base 4) to base 2 100110110100111010 What is 26b40 (base 13) in base 5? 4302330 What is 1161414 (base 8) in base 12? 135410 -2678719 (base 10) to base 4 -22031332333 What is b01a (base 14) in base 7? 154033 13043043 (base 9) to base 14 bca666 What is 31202431 (base 6) in base 10? 902611 What is 100000110010111000111 (base 2) in base 11? 674428 What is 12020111210202 (base 3) in base 5? 1203112432 What is -a77388 (base 12) in base 4? -22012001120 120343113 (base 5) to base 2 10001000100000110110 -132425123 (base 7) to base 9 -17062812 -104637c (base 13) to base 9 -10281683 -1221201121 (base 4) to base 15 -880e7 What is -2a64377 (base 11) in base 10? -5247249 Convert 20441204 (base 5) to base 9. 281136 Convert -5065632 (base 8) to base 6. -44403402 -2210103143 (base 5) to base 16 -48c595 Convert -7051881 (base 10) to base 15. -9446a6 Convert 203002133 (base 4) to base 3. 21021212112 5203499 (base 10) to base 11 2a34514 1111040222 (base 5) to base 16 253b7e -4311044 (base 7) to base 15 -a52e8 Convert -253b6 (base 16) to base 2. -100101001110110110 1258072 (base 9) to base 6 22430145 What is 380ad (base 14) in base 13? 4a698 What is 143571 (base 9) in base 4? 111132031 What is 465bc (base 13) in base 11? 88541 Convert -42c915 (base 13) to base 14. -2cc32d Convert 49735 (base 12) to base 6. 2044505 What is -10100223231 (base 4) in base 15? -170e09 What is 711156 (base 8) in base 15? 49564 Convert -14b054 (base 12) to base 2. -1010101101010000000 11640224 (base 7) to base 6 34313122 -2e700 (base 15) to base 3 -21121212100 What is 7ab398 (base 14) in base 13? b34699 Convert -421840 (base 13) to base 12. -626747 4773774 (base 9) to base 10 2587855 Convert -830a7 (base 12) to base 7. -1312060 Convert 5120680 (base 10) to base 7. 61345045 What is 1010111010101 (base 2) in base 12? 3299 What is 1430688 (base 10) in base 4? 11131102200 -101012010201 (base 3) to base 16 -30f7f What is 178eee (base 16) in base 13? 42097c Convert -234423423 (base 5) to base 13. -2c328c Convert 21c496 (base 16) to base 11. 1281741 -13312023101 (base 4) to base 12 -832415 dc1d00 (base 14) to base 2 11100011100110011001100 What is -1142204044 (base 5) in base 4? -22101302002 Convert -1000022111020 (base 3) to base 10. -537630 Convert -9c1e (base 15) to base 3. -1200102002 -513678 (base 14) to base 3 -12011001112020 What is -45043133 (base 6) in base 14? -275333 What is 598540 (base 11) in base 14? 1a9853 -17304883 (base 9) to base 13 -1a5078b What is -47076272 (base 8) in base 14? -150d630 -31201816 (base 9) to base 15 -14b45e3 What is -192dab (base 16) in base 2? -110010010110110101011 What is -b0609 (base 14) in base 8? -1473521 What is 13113443 (base 5) in base 15? 28468 What is 4575471 (base 8) in base 5? 304301321 What is -41100422 (base 5) in base 11? -206a59 -2344683 (base 9) to base 5 -311113000 Convert 18b19 (base 12) to base 5. 2124130 Convert -62501 (base 10) to base 11. -42a5a -3a8b01 (base 12) to base 13 -27c23b Convert -1573479 (base 10) to base 9. -2857360 Convert -3445325 (base 6) to base 16. -2b535 Convert 1102123320 (base 4) to base 14. 8b0a4 What is -32903 (base 10) in base 4? -20002013 Convert 2a0374 (base 14) to base 8. 5444422 Convert -515466 (base 7) to base 9. -144226 -20031235 (base 7) to base 14 -31108c What is -193416 (base 10) in base 4? -233032020 Convert -a1b5 (base 14) to base 12. -14103 Convert -2776674 (base 9) to base 7. -15660061 -796fd (base 16) to base 4 -1321123331 -1430552 (base 8) to base 14 -a7ca6 What is -31aa53a (base 11) in base 12? -1a79772 Convert -101111101000001110111 (base 2) to base 5. -344420240 Convert 20020011000 (base 3) to base 2. 11101111011010100 What is -134950 (base 10) in base 7? -1101304 Convert -4ba51 (base 16) to base 13. -ab04c What is -10840 (base 10) in base 14? -3d44 What is 200122123 (base 4) in base 10? 132763 -3123130221 (base 4) to base 11 -564363 -1130063 (base 7) to base 12 -6a008 What is 123274 (base 9) in base 4? 102031123 What is -10708b (base 16) in base 5? -233434022 What is 100000110102010 (base 3) in base 14? 8ca50d What is 120501200 (base 6) in base 5? 1040404111 What is 11102022213 (base 4) in base 2? 101010010001010100111 What is 260642 (base 8) in base 7? 524636 What is 2a349a (base 15) in base 16? 1f11ca 2a6b933 (base 13) to base 14 1b3103a What is 344317 (base 9) in base 7? 1520143 What is 22612654 (base 7) in base 14? 399dd4 -11220122221 (base 3) to base 2 -10111100111001000 What is 8a4211 (base 14) in base 7? 54635121 276007 (base 9) to base 16 291d6 68d73 (base 14) to base 7 2111503 What is -a4c5 (base 14) in base 2? -110111011101101 Convert -1276272 (base 11) to base 10. -2204457 -41544203 (base 6) to base 10 -1211403 Convert -14cdb (base 14) to base 5. -3130222 What is 13304251 (base 6) in base 16? 6c727 Convert -45511532 (base 7) to base 13. -a8c9c5 Convert -f099 (base 16) to base 4. -33002121 Convert -11230000123 (base 4) to base 12. -5ba9b7 -12211100101201 (base 3) to base 14 -5a8961 123514 (base 10) to base 14 33026 What is 14353530 (base 6) in base 16? 7963e Convert -76a05a (base 14) to base 7. -46123143 Convert 27056511 (base 9) to base 11. 7580261 -214884 (base 11) to base 6 -11204315 1b7ba3 (base 15) to base 4 11013300213 What is 1746d (base 16) in base 10? 95341 What is -10011102110122 (base 3) in base 13? -46b428 Convert -aa08a (base 14) to base 10. -411722 Convert 11373767 (base 8) to base 10. 2488311 What is 42809a (base 12) in base 15? 15b4e7 18a750 (base 11) to base 4 1013120213 -110002230200 (base 4) to base 6 -304335412 1304503 (base 6) to base 10 71031 What is 111201213 (base 4) in base 6? 1520103 What is 1000212221022 (base 3) in base 11? 345432 -34615770 (base 9) to base 2 -1000000001111010001111001 What is 4668a6 (base 12) in base 8? 4241576 Convert 11ac95 (base 16) to base 2. 100011010110010010101 4228945 (base 10) to base 13 b50b46 -3009140 (base 12) to base 7 -136163244 What is 33202010 (base 5) in base 13? a0c90 Convert 2788700 (base 13) to base 2. 101111101011101111001100 Convert -1244411014 (base 5) to base 10. -3122634 12002102000011 (base 3) to base 16 2944d2 -2e61cb (base 15) to base 12 -905032 1b3358 (base 12) to base 16 75d34 What is 71036 (base 9) in base 5? 2443224 3c072 (base 13) to base 12 54a90 Convert 1100100111101000010011 (base 2) to base 11. 195a42a Convert 828a9a (base 11) to base 16. 1449f9 573117 (base 8) to base 12 94413 Convert 1370451 (base 9) to base 8. 2702305 -3031165 (base 12) to base 16 -89aa9d Convert cca11 (base 16) to base 3. 1120120202000 What is -213214001 (base 5) in base 15? -130a86 What is 2c83 (base 13) in base 15? 1e04 What is 1450843 (base 9) in base 12? 327749 Convert 16099aa (base 12) to base 13. c15538 -11110010001110 (base 2) to base 5 -444002 Convert 133002202302 (base 4) to base 5. 4040340012 What is -2202100122020 (base 3) in base 11? -90a667 What is -5a45a (base 14) in base 15? -45474 What is 447327 (base 8) in base 14? 3d19d -69a66 (base 14) to base 5 -31212432 Convert 2900965 (base 13) to base 10. 12996859 Convert 14c5a (base 16) to base 10. 85082 What is -3312101 (base 4) in base 10? -15761 a76681 (base 15) to base 4 132121300312 What is 973717 (base 12) in base 11? 1393311 What is a617 (base 14) in base 8? 67735 What is -3645580 (base 9) in base 7? -22551426 What is -4126159 (base 11) in base 8? -33624014 35405336 (base 8) to base 5 3440023110 -3417361 (base 10) to base 6 -201125041 4466452 (base 7) to base 10 554521 Convert -12436 (base 10) to base 11. -9386 What is -1011010000100011110 (base 2) in base 5? -43301201 -214084 (base 10) to base 2 -110100010001000100 Convert -708e1 (base 15) to base 5. -42401021 Convert 12242000 (base 5) to base 13. 41b5a Convert 5922a (base 11) to base 3. 11100020010 What is -341343241 (base 5) in base 15? -1ed166 What is 24676 (base 11) in base 4? 20221113 213a4b (base 14) to base 15 1731ed Convert 5212566 (base 7) to base 4. 2120221113 Convert -224323005 (base 6) to base 2. -1111110000110111001101 What is 249b8a5 (base 12) in base 3? 111111111011022 Convert 632c8c (base 13) to base 8. 10663153 Convert 1110000011110101001 (base 2) to base 15. 91793 Convert 259803 (base	{ "pile_set_name": "DM Mathematics" }
90184. 2, 6911273 What are the prime factors of 1054047972? 2, 3, 87837331 List the prime factors of 81684098. 2, 857, 47657 List the prime factors of 221079248. 2, 13, 1062881 What are the prime factors of 1325275544? 2, 31, 47, 67, 1697 What are the prime factors of 4168613953? 7, 19073, 31223 List the prime factors of 339627793. 19, 1997, 8951 List the prime factors of 1038890292. 2, 3, 11, 37, 5749 What are the prime factors of 24100676? 2, 2087, 2887 List the prime factors of 131332538. 2, 3019, 21751 What are the prime factors of 4840873? 271, 17863 List the prime factors of 1628224643. 1628224643 List the prime factors of 112573031. 17, 6621943 List the prime factors of 1498330687. 7, 313, 683857 What are the prime factors of 1204701382? 2, 602350691 List the prime factors of 382115822. 2, 11, 127, 12433 What are the prime factors of 89556094? 2, 101, 443347 List the prime factors of 24560318. 2, 541, 22699 List the prime factors of 2498746266. 2, 3, 23, 1229, 1637 List the prime factors of 67249705. 5, 17, 401, 1973 What are the prime factors of 3481947717? 3, 59, 661, 29761 List the prime factors of 368583803. 7, 52654829 What are the prime factors of 377731353? 3, 125910451 List the prime factors of 225290664. 2, 3, 17, 103, 1787 List the prime factors of 150291654. 2, 3, 79, 317071 List the prime factors of 77704238. 2, 38852119 List the prime factors of 2578432909. 13, 198340993 List the prime factors of 4276238246. 2, 7, 23, 1831, 7253 What are the prime factors of 89241582? 2, 3, 523, 28439 What are the prime factors of 18919597? 167, 193, 587 What are the prime factors of 39366328? 2, 19, 43, 317 What are the prime factors of 121969975? 5, 4878799 List the prime factors of 131752769. 109, 1208741 List the prime factors of 1250063447. 19, 65792813 What are the prime factors of 2439210830? 2, 5, 7, 17, 131, 15647 List the prime factors of 8778225. 3, 5, 117043 What are the prime factors of 864090658? 2, 223, 1109, 1747 List the prime factors of 6961783781. 17, 8807, 46499 List the prime factors of 1480808670. 2, 3, 5, 11, 4487299 What are the prime factors of 2132705332? 2, 59, 9036887 List the prime factors of 48988645. 5, 17, 41, 14057 List the prime factors of 48325865. 5, 7, 191, 7229 What are the prime factors of 843317101? 11, 83, 167, 5531 What are the prime factors of 7775244? 2, 3, 71993 List the prime factors of 171403573. 11, 37, 151, 2789 What are the prime factors of 428291855? 5, 23, 3724277 What are the prime factors of 161568406? 2, 193, 223, 1877 What are the prime factors of 40171615? 5, 11, 53, 13781 List the prime factors of 99381791. 293, 339187 What are the prime factors of 81002772? 2, 3, 367, 6131 List the prime factors of 206278939. 97, 2126587 What are the prime factors of 672614400? 2, 3, 5, 29, 151 What are the prime factors of 181821108? 2, 3, 7, 19, 37, 3079 What are the prime factors of 53197121? 53197121 What are the prime factors of 260401484? 2, 7, 189797 List the prime factors of 198270087. 3, 37, 1786217 List the prime factors of 1105998308. 2, 17, 3733, 4357 What are the prime factors of 712173666? 2, 3, 157, 756023 List the prime factors of 1477659802. 2, 738829901 List the prime factors of 375174117. 3, 37, 1126649 What are the prime factors of 113905580? 2, 5, 5695279 What are the prime factors of 3403303282? 2, 83, 1627, 12601 List the prime factors of 33165443. 31, 1069853 What are the prime factors of 3675691976? 2, 11, 59, 707953 List the prime factors of 1415009761. 11, 691, 186161 What are the prime factors of 35391223? 7, 29, 313, 557 List the prime factors of 8181533. 19, 491, 877 List the prime factors of 76010884. 2, 31, 41, 14951 List the prime factors of 635017840. 2, 5, 41, 193603 List the prime factors of 136403794. 2, 1217, 56041 What are the prime factors of 1653141692? 2, 503, 821641 List the prime factors of 1053393254. 2, 526696627 List the prime factors of 1400852341. 7, 199, 1005637 List the prime factors of 1036732471. 17, 7069, 8627 What are the prime factors of 835894760? 2, 5, 17, 1229257 What are the prime factors of 2647217856? 2, 3, 13787593 What are the prime factors of 1472526994? 2, 383, 641, 2999 What are the prime factors of 780774948? 2, 3, 3989, 5437 List the prime factors of 25898348. 2, 7, 127, 7283 List the prime factors of 430914996. 2, 3, 59, 202879 What are the prime factors of 2008536? 2, 3, 83689 List the prime factors of 863997547. 7, 83, 109, 1949 List the prime factors of 42348900. 2, 3, 5, 11, 41, 313 List the prime factors of 488809041. 3, 7, 17, 23, 59, 1009 What are the prime factors of 45448825? 5, 53, 34301 What are the prime factors of 4150240148? 2, 19, 163, 335021 What are the prime factors of 16667654? 2, 131, 63617 List the prime factors of 700859787. 3, 73, 113, 127, 223 List the prime factors of 755337828. 2, 3, 7, 29, 43, 7211 List the prime factors of 155512233. 3, 2531, 6827 What are the prime factors of 109010156? 2, 23, 1184893 List the prime factors of 1247865479. 7, 178266497 List the prime factors of 40559048. 2, 5069881 What are the prime factors of 49659266? 2, 1103, 22511 What are the prime factors of 87211352? 2, 29, 199, 1889 What are the prime factors of 5126842205? 5, 113, 9074057 What are the prime factors of 3417805976? 2, 13, 2527963 List the prime factors of 2005366053. 3, 17, 229, 171707 List the prime factors of 477869220. 2, 3, 5, 98327 What are the prime factors of 3008826? 2, 3, 41, 151 List the prime factors of 93308864. 2, 11, 132541 List the prime factors of 42545541. 3, 19, 746413 What are the prime factors of 72466132? 2, 18116533 List the prime factors of 2365989701. 167, 14167603 List the prime factors of 4566307971. 3, 16759, 90823 What are the prime factors of 64936348? 2, 16234087 List the prime factors of 891057619. 3167, 281357 List the prime factors of 4977105. 3, 5, 7, 107, 443 What are the prime factors of 1141888683? 3, 13, 293, 99929 List the prime factors of 34208889. 3, 11, 13, 23, 3467 What are the prime factors of 102456715? 5, 20491343 What are the prime factors of 97756? 2, 24439 List the prime factors of 69452585. 5, 241, 57637 What are the prime factors of 5426398513? 5426398513 List the prime factors of 7023887075. 5, 280955483 List the prime factors of 952895231. 952895231 List the prime factors of 116657442. 2, 3, 11, 277, 709 What are the prime factors of 86439796? 2, 23, 173, 5431 What are the prime factors of 257778178? 2, 7, 1109, 16603 List the prime factors of 3098712870. 2, 3, 5, 11, 43, 83, 877 What are the prime factors of 1472485051? 1472485051 List the prime factors of 136221218. 2, 7, 9730087 List the prime factors of 284122217. 8713, 32609 List the prime factors of 177503694. 2, 3, 29583949 What are the prime factors of 452202742? 2, 29, 7796599 List the prime factors of 196289142. 2, 3, 7, 4673551 List the prime factors of 54854342. 2, 17, 1613363 What are the prime factors of 147532470? 2, 3, 5, 593, 8293 List the prime factors of 96798038. 2, 48399019 List the prime factors of 1074414303. 3, 119379367 What are the prime factors of 347385677? 347385677 List the prime factors of 52025246. 2, 7, 13, 29, 9857 What are the prime factors of 91251398? 2, 7, 37, 176161 List the prime factors of 578093680. 2, 5, 103, 70157 What are the prime factors of 4337755792? 2, 71, 3818447 What are the prime factors of 268144454? 2, 19, 163, 43291 List the prime factors of 2325963961. 2325963961 List the prime factors of 7288495563. 3, 211, 11514211 What are the prime factors of 6510605605? 5, 7, 186017303 What are the prime factors of 73991064? 2, 3, 7, 29, 15187 List the prime factors of 1555611907. 251, 673, 9209 What are the prime factors of 4852376144? 2, 7, 11, 103, 38239 List the prime factors of 509070346. 2, 37, 6879329 What are the prime factors of 2414809491? 3, 23, 107, 379, 863 List the prime factors of 230428536. 2, 3, 13, 23, 163, 197 What are the prime factors of 1351514899? 7, 991, 194827 What are the prime factors of 1186603261? 13901, 85361 List the prime factors of 536048272. 2, 1459, 22963 What are the prime factors of 4936892558? 2, 13, 71, 205721 What are the prime factors of 197121474? 2, 3, 11, 977, 1019 What are the prime factors of 6677165? 5, 11, 121403	{ "pile_set_name": "DM Mathematics" }
-0.3 (b) -4 (c) -3 (d) 0.4 d Let f = -8 - -8.1. What is the nearest to 1 in -0.5, 4, -0.1, f? f Let n = -835.5 + 835. Which is the closest to -1/2? (a) n (b) -5 (c) -1/4 (d) -1/88 a Let p = 1470 + -1469. Which is the closest to p? (a) -4 (b) 1/5 (c) 0.12 (d) -3 b Let m be 1 - (1 + (-2)/14). Let u = -58 + 64.5. Let q = u + -6.8. What is the nearest to 2 in m, q, -1/7? m Let t = -79 - -79. Which is the closest to t? (a) 2/7 (b) 2/3 (c) 4 a Let m = -82 + 54. Let d = -23 - m. Let s = -11 - -15. Which is the nearest to -2? (a) d (b) s (c) 1/3 c Let q = 9 + -8.5. Suppose -106 = 3s - 5s. Let u = s + -319/6. Which is the closest to -0.3? (a) u (b) q (c) 3 a Let k = 13 + -16. Suppose q + 1 = -3, q = -2p - 2. Which is the closest to -2? (a) 3/5 (b) p (c) k c Let a = -2.02 - 7.15. Let w = 0.17 + a. Let s = -9 - w. What is the nearest to s in -0.2, 0.3, 1? -0.2 Let i = -481.9 + 482. What is the nearest to i in -1/4, 0.5, -5, 0.4? 0.4 Let i = -0.4 + 0.3. Let n = -72 - -66. Let l = n - -5. Which is the closest to l? (a) i (b) 4 (c) -2 a Let h = 8 + -8.04. Let d = 0.06 - h. What is the closest to d in -4, 1/5, 7? 1/5 Let q(p) = 4p + 25. Let r be q(18). Let f = r - 487/5. Which is the nearest to -2? (a) f (b) -0.3 (c) -4 a Let m = 53 + -56. Let n = -1018/5 + 203. What is the closest to -0.2 in m, n, 2/5? n Let i = 0.237 - 1.237. Which is the closest to -0.1? (a) -25 (b) 1 (c) i c Let h = 3354 - 3350. Which is the closest to -1/10? (a) -2 (b) 0.5 (c) h (d) 3 b Let i be (-5 - -1)2/60. Let k be 21(-63 - -65). What is the closest to -0.1 in i, k, 3? i Let v = -8 - -13. Let l = v + -2. Let k be -7 + (3 - 200/(-52)). Which is the closest to -7? (a) -3 (b) k (c) l a Let o = 7 - 9. Let w = 1 + o. Suppose -5u = 14 + 11. What is the closest to u in w, 0.5, -0.4? w Let q = 1.41 - 77.41. Let o = 80 + q. What is the nearest to -0.2 in o, 0, -0.03? -0.03 Let m = 0.28 + 0.72. Let p(r) be the third derivative of -r*4/12 - 5r*3/2 + 3r*2. Let v be p(-10). Which is the closest to -2? (a) v (b) m (c) -3 c Let b = -9.2 + 8.47. Let z = 0.33 + b. What is the closest to 1 in z, -2, -5? z Suppose 6f = 8f + 6. Which is the nearest to -2? (a) 2/7 (b) -4/7 (c) f c Let s be 2 - 3(-2)/(-12). Let z = -2 + s. Let y = -26 + 25.8. Which is the nearest to z? (a) -3 (b) y (c) -5 b Let p = 7 + -11. Let o = 2 - 41. Let q = -44 - o. Which is the closest to -2/11? (a) 5 (b) p (c) q b Let h = -0.7 + 2.7. Let q = 2 + h. Let j = -5.119 - -0.119. Which is the closest to -1? (a) q (b) -0.2 (c) j b Let h = -7.36 + 9.36. Suppose 0 = 5f + 1 - 16. What is the nearest to h in 5, 0, f? f Let w = 0.168 + -0.668. What is the closest to w in 0, 11/3, -4? 0 Let h = 26.7 + -26.2. What is the closest to -22 in 0.1, 1, h? 0.1 Let q = 1 + -0.9. Suppose 0 = -4v - p + 6p + 21, 3v = -3p + 9. Let w be (28/8 + -4)/((-2)/v). Which is the closest to q? (a) 3 (b) w (c) -1/6 c Let w = -337/3 - -111. Let l = -281 + 285. What is the closest to w in 4/7, -5, l? 4/7 Let k = -3 + 2. Let i = 198 + -198.1. Which is the closest to -1? (a) k (b) i (c) 2/9 a Suppose -170 = 42g - 395 - 195. Suppose p + 4p - 25 = 0. Which is the closest to 1? (a) g (b) p (c) 0.2 c Let r = 0.475 + -0.175. Which is the nearest to -5? (a) 1/3 (b) r (c) -2 c Let i = 7 - 9. Let j be (-3 + 2)/(3 + -14)2. Let h = -3/29 - -79/203. Which is the closest to i? (a) j (b) h (c) 2 a Let k be (1/3)/((-117)/351). Which is the closest to -2/3? (a) k (b) 0.4 (c) -0.1 (d) 4 a Let m = 0.47 - 0.4. Let y = m + -5.07. Let i = -5 - -2. Which is the nearest to 1? (a) 1/4 (b) i (c) y a Let s = -554 - -542. What is the closest to -0.2 in s, 2, 5, -0.1? -0.1 Let i = -4 - -4. Let h = -3 - -5. Let d = 6 + -6. What is the nearest to d in -4, h, i? i Let w = -597/7 - -3589/42. Which is the closest to -1? (a) 4 (b) 3/41 (c) w b Suppose 0 = -3l + l, q - 2l + 5 = 0. Let x = 4726 - 14381/3. Let a = 67 + x. What is the nearest to a in 2, 2/3, q? 2/3 Let v = -0.34 + 15.34. Let i = -60 - -47. Let j = i + v. What is the nearest to -1 in 3, -2/3, j? -2/3 Let j = -26/31 - -172/279. What is the closest to 1 in -20, 2, j, 0.1? 0.1 Let l = 49 + -49.23. Let z = l + -0.07. Let h = -116 + 115.5. What is the nearest to 4 in 0.1, h, z? 0.1 Let l = -243.4 + 243. Let f = -17 - -18. What is the closest to -0.1 in -5, l, f? l Let t = -1683 - -11782/7. Which is the closest to 1? (a) -3/2 (b) t (c) -1/4 (d) 1 d Let j = -447 - -437. What is the nearest to -1 in j, -1/3, 2/33, 1/4? -1/3 Let q(o) = 2o2 - 50o - 93. Let n be q(-2). What is the closest to 6 in n, -2/7, 2? 2 Let o = -1258/55 - -234/11. Which is the nearest to 0? (a) 4 (b) o (c) -0.1 c Let x = -9 + 13. Suppose -3w = 2u - 9, 2w = xu - 10 - 0. Let r be w/(-9) - 4/18. Which is the nearest to 0.1? (a) r (b) 0.4 (c) 0.5 b Let i = -2.7 + 2.35. Let r = i + 0.35. Which is the closest to -2? (a) -0.4 (b) -1/2 (c) r b Let h be (3 - (-28)/(-7))(-4 - -2). What is the nearest to h in -0.5, -4/3, 104? -0.5 Let t = -2.2 - 3.8. Let q = t - -8. What is the closest to -1/2 in q, -0.4, 1/7? -0.4 Let w be 30/(-40)1(-3)/(-6). Which is the closest to 9? (a) 0.3 (b) -7 (c) w a Let p = -1501 + 1500.9. Let r be 14/40 + 3/(-12). Which is the nearest to -1? (a) r (b) -0.4 (c) p b Let g be 22/(-77) + 212/7. Let r = g + -32. What is the closest to 4 in -4, 3/5, r? 3/5 Suppose -2g + 1 = -7. Let i be (-33)/45 + g/10. Let d = -58 + 293/5. What is the nearest to 0.1 in 4, i, d? i Let j = 492 - 481. Which is the closest to 0? (a) -0.4 (b) -2/11 (c) -1/2 (d) j b Let g be (-4)/(-6)(-6 + 0)-1. Let v(i) = 3i2 - 11i - 9. Let y be v(g). Which is the closest to -2? (a) y (b) -1/2 (c) 0.5 b Suppose 2i - 5 = -5u + 2, 2i - 4u + 20 = 0. Let n = 5 + -2. Let y be (-2(-2)/(-10))/(16/10). Which is the nearest to 0.2? (a) y (b) i (c) n a Let y = 527/6 + -88. Let w = 0.1135 - 0.9135. Which is the nearest to y? (a) 0.2 (b) -4 (c) w a Let h = 21.53 + -0.53. Let v = h - 21.4. Which is the closest to -0.08? (a) 1 (b) v (c) -5 b Let t = -0.12 - 0.28. What is the nearest to 9 in 2, t, 0? 2 Let i be 4/(-5 + 17) - 64/120. Which is the closest to 0.1? (a) -26 (b) -0.1 (c) 5 (d) i b Let p = 1 + -6. Let k be 22/(-55)(-838)/(-4). Let v = 83 + k. Which is the nearest to -0.3? (a) 5/6 (b) p (c) v c Let f be (-3)/5 + 476/560. Which is the closest to 2/9? (a) -5 (b) f (c) -0.04 b Let l = 4/17 - -9/34. What is the nearest to -2 in -0.08, -0.1, l? -0.1 Let r = -2.26 + 2.76. Which is the closest to -9? (a) r (b) -1/3 (c) -2/5 c Let w = 3.1 + -3. Let u = 276 - 275.7. Let s = u + w. Which is the nearest to 1/3? (a) 0 (b) 2 (c) s c Let t = 0.19 - 2.19. Suppose p + 17 = 4v - 0v, 0 = -2v + 10. Let w = -174 + 175. Which is the nearest to p? (a) w (b) -1/4 (c) t a Let u = 7.46 + -6.46. What is the closest to -0.3 in u, 0.4, 2/3? 0.4 Let p = -0.88 - -1.31. Let s = p - 3.43. Which is the closest to 2/7? (a) s (b) -0.4 (c) -5 b Let s = 3 - 3. Let x be ((-44)/715)/(2/(-70)). Let t = -222/91 + x. Which is the closest to s? (a) 0.4 (b) 1 (c) t c Let w = -577 - -590. What is the closest to -1 in w, 4, -5, 2/19? 2/19 Let c = -3.8 - 4.1. Let h = 5.9 + c. Let s = -1.99 + -0.01. What is the closest to s in h, 1, 0? h Let s = -0.12 + 0.12. Let m = -8/3 + 29/12. Which is the closest to m? (a) -0.3 (b) s (c) -4/3 a Let b = 301 - 304. What is the nearest to -1/2 in b, -5/3, 0? 0 Let t = -42 - -45.1. Let u = -4.1 + t. Which is the nearest to u? (a) 2/5 (b) -1 (c) -2 b Let a = -0.1392 + 0.0392. What is the nearest to -1/2 in 154, a, 0? a Let u = -0.2236 - 1.7764. What is the closest to u in -2/7, 16, -3? -3 Let l = 1.44 + 0.46. Let d = -2.3 + l. Let t = 5 + -3. What is the nearest to d in -3/7, 0.2, t? -3/7 Let p = -28.2 - -36. Let q = -8 + p. Suppose 0 = 2k + 2k + 4. Which is the nearest to k? (a) q (b) 0.2 (c) -1 c Let p = 988 - 985. Let r = 1.4 + -0.4. What is the closest to r in 3/4, 0.01, p? 3/4 Let t = 0.04 + -0.44. Let v = 0.00814 + -1.00814. Which is the closest to v? (a) t (b) -1/2 (c) 0.4 b Let w(a) = -a3 - 2a. Let n be w(0). Suppose 3 = -2i - k + 1, -5i + 3*k - 16 = n. What is the closest to 0.1 in 0.2, i, 2? 0.2 Let z	{ "pile_set_name": "DM Mathematics" }
5023, 5045, 5091, 5167, 5279, 5433? 5635 What is next in 1725, 11188, 26967, 49068, 77497, 112260, 153363? 200812 What comes next: -10, -922, -2444, -4576, -7318? -10670 What is the next term in -783, -661, -537, -405, -259, -93, 99, 323? 585 What is next in 728, 775, 848, 947? 1072 What comes next: 5295, 10576, 15891, 21258, 26695, 32220, 37851, 43606? 49503 What comes next: -3389, -6786, -10181, -13574? -16965 What is the next term in 2266, 9203, 20808, 37081, 58022, 83631? 113908 What is next in -3096, -3043, -2966, -2865, -2740, -2591? -2418 What is the next term in 49, 434, 1399, 3208, 6125, 10414? 16339 What comes next: -946, -1806, -2654, -3490, -4314, -5126, -5926? -6714 What is next in 84, 294, 712, 1440, 2580, 4234, 6504? 9492 What is next in -71160, -71159, -71156, -71151? -71144 What is next in 178934, 178961, 178988, 179015? 179042 What comes next: -342, -557, -768, -975, -1178, -1377? -1572 What is the next term in 897, 1687, 2357, 2901, 3313, 3587, 3717? 3697 What is the next term in -59, -90, -135, -194? -267 What is the next term in 4, 5, 18, 55, 128? 249 What is next in -5662, -5772, -6080, -6688, -7698, -9212, -11332? -14160 What comes next: -374, -851, -1326, -1799? -2270 What is the next term in 30078, 30082, 30088, 30096, 30106? 30118 What is next in -243, -991, -2233, -3963, -6175, -8863? -12021 What comes next: -8940, -17862, -26784, -35706? -44628 What is next in -2798, -2590, -2244, -1760, -1138, -378? 520 What is the next term in 229, 490, 763, 1030, 1273, 1474, 1615? 1678 What is next in 32, -254, -1044, -2590, -5144, -8958? -14284 What is next in -51, -128, -261, -450, -695, -996? -1353 What is the next term in -80, -441, -1346, -3053, -5820, -9905, -15566? -23061 What is next in 226, 338, 532, 814, 1190, 1666, 2248, 2942? 3754 What is the next term in 160, 1042, 3390, 7936, 15412, 26550, 42082, 62740? 89256 What is the next term in 36, -9, -80, -177? -300 What is next in -252, -2645, -9154, -21837, -42752, -73957, -117510, -175469? -249892 What comes next: -1220, -1204, -1192, -1184? -1180 What comes next: 8774, 17549, 26324, 35099? 43874 What is the next term in -1538, -5704, -12646, -22364, -34858? -50128 What is next in 845389, 845385, 845379, 845371, 845361, 845349? 845335 What is next in 41052, 41050, 41048, 41046, 41044? 41042 What is next in 28423, 56863, 85317, 113785, 142267, 170763, 199273? 227797 What is next in -147563, -147552, -147541? -147530 What is the next term in -2432, -2735, -3034, -3329, -3620, -3907? -4190 What is next in -707506, -1415012, -2122518, -2830024, -3537530, -4245036? -4952542 What is the next term in 21763, 43522, 65277, 87028, 108775? 130518 What is next in 90927, 181866, 272805, 363744? 454683 What is next in -23138, -46295, -69454, -92615, -115778, -138943? -162110 What is next in 107724, 215451, 323182, 430917, 538656? 646399 What is next in 29161, 29150, 29129, 29092, 29033, 28946, 28825, 28664? 28457 What is the next term in 494, 720, 938, 1142, 1326, 1484, 1610, 1698? 1742 What is next in 4310, 7539, 10768, 13997, 17226, 20455? 23684 What is the next term in 1588518, 1588516, 1588514? 1588512 What is the next term in -227, -220, -213, -206, -199? -192 What is the next term in -87, -321, -711, -1257, -1959, -2817, -3831? -5001 What is next in -137, -415, -673, -899, -1081, -1207, -1265, -1243? -1129 What is next in 1611269, 3222540, 4833811, 6445082? 8056353 What is next in -288, -579, -868, -1155, -1440, -1723, -2004? -2283 What is the next term in -253, -291, -347, -421, -513, -623, -751? -897 What comes next: 1486700, 1486707, 1486716, 1486727? 1486740 What comes next: 11, 16, 17, 14? 7 What comes next: -3175, -3149, -3077, -2935, -2699, -2345? -1849 What is the next term in -3552, -3626, -3702, -3780, -3860, -3942, -4026? -4112 What is the next term in -5778, -5716, -5558, -5256, -4762, -4028, -3006, -1648? 94 What comes next: -48, 51, 208, 423, 696, 1027, 1416? 1863 What comes next: 381, 706, 1237, 1974, 2917, 4066? 5421 What comes next: -266, -465, -654, -827, -978, -1101, -1190, -1239? -1242 What comes next: 41849, 83758, 125669, 167582, 209497? 251414 What comes next: -65027, -65024, -65019, -65012, -65003, -64992, -64979? -64964 What is the next term in 93736, 187476, 281216, 374956, 468696, 562436? 656176 What is the next term in 7, -51, -183, -425, -813, -1383, -2171? -3213 What is next in 451, 1496, 3141, 5386? 8231 What comes next: 3181, 12732, 28649, 50932, 79581, 114596, 155977? 203724 What is the next term in -1273, -4745, -10533, -18637? -29057 What is next in 87409, 174817, 262223, 349627, 437029, 524429? 611827 What comes next: -1067, -1057, -1027, -965, -859, -697, -467? -157 What comes next: 4280, 8574, 12894, 17252, 21660? 26130 What is the next term in -477642, -955279, -1432914, -1910547, -2388178, -2865807? -3343434 What is next in -767, -634, -501? -368 What comes next: -232, -431, -650, -895, -1172, -1487, -1846, -2255? -2720 What comes next: -48, -60, -80, -108, -144? -188 What comes next: 105, 393, 835, 1425, 2157, 3025? 4023 What is next in 46249, 46252, 46255, 46258? 46261 What comes next: -7528, -7532, -7542, -7558, -7580, -7608? -7642 What is next in -6752, -13518, -20300, -27098, -33912, -40742? -47588 What is next in -24381, -97527, -219437, -390111? -609549 What comes next: -105, 128, 515, 1056? 1751 What is the next term in -297767, -297768, -297769, -297770? -297771 What comes next: -135005, -135007, -135009, -135011, -135013, -135015? -135017 What comes next: 977811, 977812, 977813, 977814? 977815 What comes next: 56499, 56502, 56507, 56514? 56523 What comes next: -319446, -638885, -958326, -1277769? -1597214 What is the next term in 2465, 4942, 7417, 9884, 12337? 14770 What is the next term in 879, 7903, 26965, 64083, 125275, 216559, 343953, 513475? 731143 What is the next term in 159703, 159705, 159707, 159709? 159711 What comes next: -511, -379, -247, -115, 17? 149 What is the next term in 754257, 754260, 754263, 754266, 754269, 754272? 754275 What is the next term in 44, -4, -236, -742, -1612, -2936, -4804, -7306? -10532 What comes next: -233, -1405, -4593, -10805, -21049, -36333, -57665, -86053? -122505 What is the next term in -1261, -4913, -10955, -19387? -30209 What comes next: 468, 938, 1414, 1896, 2384, 2878? 3378 What is next in 120, 227, 346, 465, 572? 655 What is next in 41591, 41592, 41593? 41594 What comes next: 927, 1824, 2687, 3516, 4311? 5072 What is the next term in 312, 622, 942, 1278, 1636, 2022, 2442? 2902 What comes next: 1197, 2098, 2999, 3900, 4801? 5702 What is the next term in 413, 646, 989, 1436, 1981, 2618, 3341? 4144 What comes next: -14313, -28632, -42951, -57270, -71589, -85908? -100227 What is next in -22709, -45384, -68059, -90734, -113409? -136084 What is next in 5582, 5580, 5578, 5576, 5574? 5572 What comes next: 922, 917, 910, 901, 890, 877, 862? 845 What is the next term in 117503, 117505, 117503, 117497, 117487? 117473 What is next in -135, -539, -1215, -2163? -3383 What is next in -2955, -2926, -2899, -2874, -2851, -2830, -2811? -2794 What is the next term in -291941, -291947, -291963, -291995, -292049, -292131? -292247 What comes next: -16278, -32457, -48638, -64821, -81006? -97193 What is the next term in 18351, 18313, 18253, 18171, 18067? 17941 What comes next: 93821, 187640, 281459, 375278? 469097 What comes next: 3447518, 3447517, 3447516? 3447515 What is next in 291, 684, 1077? 1470 What is the next term in 201, 1037, 2533, 4689, 7505, 10981? 15117 What is the next term in 11160, 22318, 33478, 44640? 55804 What is next in 316, 733, 1150? 1567 What is the next term in -21, -131, -309, -549, -845, -1191? -1581 What is next in -127648, -127635, -127610, -127567, -127500, -127403? -127270 What is next in 0, -23, -56, -99, -152, -215? -288 What comes next: -5709, -11420, -17135, -22854, -28577, -34304? -40035 What is the next term in 145, 616, 1417, 2548, 4009, 5800, 7921? 10372 What is the next term in -820, -734, -656, -592, -548, -530, -544, -596? -692 What is next in 208, 345, 410, 403, 324, 173? -50 What comes next: 42997, 42992, 42987, 42982, 42977? 42972 What is next in -100943, -100947, -100955, -100967, -100983? -101003 What is next in -36857, -73713, -110569? -147425 What is next	{ "pile_set_name": "DM Mathematics" }
(30/(-675)-15)? 6 What is the value of 12/78/(((-78)/7)/(-13))? 16 What is the value of (-328)/(-1804)2/(-1)? -4/11 Evaluate 3/54255/17. 5/6 Calculate ((-35)/4)/(30/1728-18). 28 ((-32)/36)/8-6 2/3 Evaluate (-34)/(-17)(-1)/10-5. 1 Evaluate (81/(60/(-25)))/((-25)/30). 4 What is the value of 9/44(-2)/(-6)? 3 Calculate (27/399)/((-390)/(-2470)). 3/7 Evaluate ((-1)/(-11))/((-20)/(600/15)). -2/11 What is the value of 922/(-1089)4/2? -4/11 (85/90-3)/(6/81) -18 Evaluate (7/((-70)/24))/((2961/(-210))/(-47)). -8 (2/56)/(581/23240) 10/7 What is (45/25)/(12/1024/240)? 15 Calculate 4/(-12)20/5-6. 8 What is (((-8)/10)/(-1))/((-21828)/3210)? -2/17 What is the value of ((-3)/(-4))/((-2548)/2912)? -6/7 What is the value of 1/2(-2990)/(-897)? 5/3 What is (((-4)/2)/(-20))/(((-15)/(-3))/(-20))? -2/5 Evaluate (12/(-62))/2(-19)/(285/(-10)). -2/31 Calculate (-180)/2((-24)/1)/120. 18 What is 88/(-44)1/128/32? -7/4 What is ((-68)/(-1105)(-60)/(-24))/(8/26)? 1/2 What is ((4/(-2))/(-24))/(35(-21)/588)? -1/15 41/((-10455)/30)2/(-4) 1/17 What is the value of (18/30)/(20/(-8)(-16)/(-100))? -3/2 What is ((-8)/(-15))/((-14)/63-1)? 12/5 What is 9/(-56)(-672)/252? 3/7 2/41(-3)/(-6) 1/4 1/(-5)140/35 -4/5 Evaluate ((-44)/(-18))/(((-5301)/(-93))/(-513)). -22 What is the value of ((8/28)/(135/(-63)))/((-21)/(-140))? -8/9 What is the value of (1/31)/((-759)/2761/11)? -4/31 Evaluate (1836/(-648))/((-10)/(-60)). -17 ((-1035)/(-230))/((-35)/(-14)-1) -9/5 Calculate (28/112030)/((-1)/2). -3/2 What is the value of -7(252/(-49))/36? 1 Evaluate (-2142)/(-918)(-60)/(-196). 5/7 (-896)/168(-30)/6320 2/79 Evaluate 69/276(-104)/2. -13 (-215/(-27))/(4180/(-5016)) -4/3 What is (1644/10960)/(8/301/(-2))? -9/8 (24/(-160))/((2142/(-48))/(-17)) -2/35 (((-10)/(-4))/5)/((-412)/(-824)) 1 Evaluate ((-5)/(-4))/((10570/840)/151). 15 What is (-20)/56(3/(-5))/((-51)/68)? -2/7 Calculate -1((132/4)/3)/(-1). 11 ((-56)/4)/(-14)15/(-5) -3 Evaluate (-56)/(-336)(-6)/2. -1/2 What is the value of 4/652520/(-1008)? -2/13 What is the value of (25/(-1))/((-1)/(4/10))? 10 What is the value of (-114)/(-8)(-66)/1485-30? 19 What is ((2-1)/(24/(-60)))/(-6)? -5/6 What is the value of (5107/25535)/(((-6)/260)/(-3))? 26 What is the value of (-9)/2(-528)/(-594)? -4 -4412/(-3168)9/(-8) -3/16 What is (-7)/210/61? 0 (-9)/((-9)/(-10))((-10780)/56)/(-55) -35 Calculate (46/12)/(33(-35)/(-6930)). 23 What is the value of (3834/(-284))/((-3)/8)(-4)/(-18)? 8 -4(4/(-2))/(-10)(-3445)/73034 2/53 Calculate (18/10660/(-198))/4. -3/2 What is the value of (82/205)/((-7)/(-10))? 4/7 What is 1/((-12)/(-88)8/6)? 11/2 ((-11)/4-10)/((-7085)/(-2834)) 11 What is the value of ((-140)/(-9135))/(7(-22)/693)? -2/29 Evaluate (-291/(-2))/((-27)/36). -12 What is 11/(220/(-8))80/64? -1/2 Evaluate 23/((-3450)/120)(-10)/8. 1 Calculate (((-654)/(-436))/(6/(-4)))/8. -1/8 Evaluate 32934/(-31437)(-21)/63. 11 What is the value of (-1)/(-159)(-774)/(-2322)-118? -2/53 19/(-1)18/(-171)-8 -16 (143/33)/(3/9)7/7 13 What is ((-4)/(-2)(-38)/76)/((-2)/(-2))? -1 What is (-6750)/1485(-22)/4? 25 ((2/40)/((-198)/(-110)))/(6/(-16)) -2/27 Evaluate (-70)/(-8)44/(-9240)30. -5/4 What is 510/40-4? -5 Calculate 14(-13)/(-468)-9. -7/2 What is the value of (-98)/(-42)(-6)/56? -1/4 Calculate ((-210)/1365)/(6/(-507)). 13 What is the value of 415/660-1? -1/11 Evaluate -3(-14)/(-630)18130/12. -13 (17/((-544)/32))/(-119) 1/19 Evaluate 275/20(-688)/(-946). 10 Evaluate (-9)/(243/225)(-39)/(-13). -25 Calculate 16(-26)/3744(-2)/4. 1/18 Calculate 716/(-537)189/12. -21 What is the value of ((-3)/20)/((-39)/65)? 1/4 What is the value of 1/(-10)(-900)/(-720)? -1/8 ((8/4)/((-205)/82))/(2/40) -16 What is the value of 392/234162/8? 27/4 Evaluate (-450)/18020/301-3. 5 What is the value of ((52/(-39))/(-2))/((-2)/9)? -3 What is the value of (433/528)/((-5)/4)? -1/5 Evaluate 10/15(-15)/236/(-20). 9 Calculate (7/(-14))/((-19)/(1444/(-57))). -2/3 What is the value of (-18249)/(-97881)(-4)/22? -2/59 What is the value of ((2/(-16))/(121/(-121)))/((-7)/63)? -9/8 Calculate ((-4)/18)/((-110)/99). 1/5 Evaluate (-1674)/(-1488)(-4)/(-18). 1/4 (201/335)/((-594)/90) -1/11 Evaluate ((-81)/189)/((-24)/140). 5/2 What is 110((-16)/4)/(1350/(-15))? 4/9 Evaluate 133/(21/(-7)). -13 What is (12/(-399))/(372/1302)? -2/19 What is ((-32)/(-22))/((-220)/(-1210))? 8 What is ((-3)/3)/((-20)/((-17000)/(-25)))? 34 What is the value of 81/(18711/(-420))(-2)/(-4)? -10/11 What is 18/(-27)9/(-60)27/(-27)? -1/10 What is the value of ((-18)/8)/((-354)/(-1062))? -27/4 Evaluate (1/(((-28)/(-3))/(-4)))/((-26)/91). 3/2 Evaluate ((-2)/(-4))/(830/960)15. 30 What is the value of (-324)/(-243)6/3? 8/3 What is (-6)/402116/36? -2/15 What is the value of 492/574(-28)/44? -6/11 What is ((5/(-5))/((-42)/(-28)))/(1/(-33))? 22 What is 1/(16/(-40))(-72)/(-15)? -12 What is the value of ((-1)/(6/(-18)))/((-2)/2)1? -3 ((-611)/(-611))/(((-2)/18)/((-4)/(-3))) -12 Evaluate 12/21(-42)/60. -2/5 Evaluate ((-57)/(-190))/(3/(-4)). -2/5 (220/(-99))/(-20)27/2 3/2 Calculate ((-8856)/(-36531))/(2/33). 4 Calculate 15/613(-22)/(-2145). 1/3 What is the value of (5/(-2))/((-20)/(-18)14/(-28))? 9/2 What is the value of (-1(-12)/39)/((-168)/(-126))? 3/13 What is (-168)/(-266)(-19)/(-2)? 6 Calculate (1602/7476)/(3/(-4)). -2/7 (-36)/(-45)13/(-52)(-40)/(-6) -4/3 What is the value of (-810)/(-90)(-50)/(-45)? 10 What is the value of (2/1)/((-202)/909)? -9 What is (-2)/6754/(-567)? 2/9 Evaluate ((-48)/(-216))/(4/((-2)/(-23)9)). 1/23 What is the value of 2910/(-2328)(4/2)/100? -1/40 What is (((-27)/24)/3)/(453/(-10872))? 9 Evaluate (((-9)/33)/(150/(-2200)))/(229). 2/29 Evaluate (-6)/9-18((-184)/23)/8. -12 What is the value of (5/2)/((-150)/(-100))(-9)/2? -15/2 What is the value of 6/(-12)((-896)/(-42))/16? -2/3 Evaluate -111/22(-5)/((-70)/(-8)). 2/7 Calculate 516/(-301)56/60. -8/5 Evaluate (4(-3)/3)/((-80)/220). 11 Calculate (-8)/(-20)55/(-4). -11/2 Calculate (2(-10)/100)/(54/(-15)). 1/18 What is 15/((-450)/(-280))27/21? 12 Evaluate (8/(-5))/228(-180)/68544. 1/17 What is the value of ((-15)/18)/(5/(-90)-2)? -15/2 What is the value of (-107/(-280))/((-3)/156)? -13 What is the value of ((-3429)/4953)/(2/(-26))? 9 What is the value of (-2)/(-8)(-720)/135? -4/3 What is ((-130)/651/1)/((-6)/(-57))? -19 Evaluate ((-90)/4)/((-1971)/876). 10 Evaluate (-5)/201026/(-65). 1 What is 4/(-162)(-3474)/1930-31? -2/15 Evaluate (-15)/(-6)12012/1430. 21 Calculate (-2185)/233/15. -19 Calculate 20/(((-42)/(-210))/(4/(-40))). -10 78/(-10)1110/666 -13 Calculate (4/(-2))/((-14)/(-672)12). -8 Calculate (-6(-247)/(-117))/(3(-22)/99). 19 Evaluate ((-94)/235)/(((-88)/90)/(-11)). -9/2 Evaluate 8569/(-2337)(-6)/121. 2/11 Calculate ((6/(-16))/(2130/(-3976)))/(6/(-45)). -21/4 What is the value of 1/(216/723/117)? 13 Evaluate ((-198)/(-220))/(3/((-24)/4)). -9/5 Evaluate (610/(-61))/(25/(-70)). 28 Calculate (590/413)/((-25)/(-35)). 2 What is the value of ((-1)/((-2)/(-1)))/(((-81)/144)/9)? 8 Calculate 3/(-24)368/9234. -17 What is (-6)/4(-650)/(-455)70/(-6)? 25 What is (-162)/30240/28840/(-18)? 10 (0/(-1))/(131/(-131)) 0 What is the value of (644/575-1)/(4/(-10))? 14/5 What is ((80/24)/(-5))/((-256)/(-24))? -1/16 What is the value of (2/16)/(50718/7584)? 2/107 12/(-44)165/(-135) 1/3 Evaluate ((-4)/(-56))/(43/86). 1/7 (-8)/(-2)(-765)/612 -5 What is (-316(-2)/(-12))/(94/(-188))? 16 What is ((-42)/((-4452)/(-901)))/((-3)/6)? 17 What is ((-446)/1115)/(1-18(-1)/5)? -1/9 What is (110/165)/(20/72)? 12/5 What is (-9)/5(-1390)/(-556)? -9/2 What is ((-6)/4)/((-4)/(-2))6400/3000? -8/5 Calculate 6/(8/4)(-1825)/219. -25 Calculate (5/10)/(-1)-218/(-2). -9 What is the value of (4/16)/((-68)/102)? -3/8 Calculate ((-40)/(-90)3/2)/((-4)/(-1)). 1/6 Evaluate ((-644)/138)/(1/(-3)). 14 What is (25/10)/(14/(-28))? -5 560/40-3(-2)/6 14 Evaluate 90/(-9)(-1)/185. 2/37 Evaluate ((-543)/(-1267))/(15/665). 19 Evaluate (9/((-1440)/(-680)))/(2/8). 17 (-304)/(-456)15/2 5 2/(-10)1185/47440 -20 Evaluate 26/((-2262)/551)3. -19 Evaluate 3-5((-54)/(-81))/((-15)/18). 12 Calculate (234/(-117))/(2/8). -8 Evaluate 31/((-1209)/(-130))1/(-85). -2/51 What is ((-2)/5	{ "pile_set_name": "DM Mathematics" }
nd 11:39 PM? 44 How many minutes are there between 2:05 PM and 2:58 PM? 53 How many minutes are there between 5:29 PM and 6:19 PM? 50 How many minutes are there between 8:21 AM and 3:15 PM? 414 How many minutes are there between 11:49 PM and 9:19 AM? 570 What is 315 minutes before 2:19 PM? 9:04 AM What is 508 minutes before 3:21 PM? 6:53 AM What is 209 minutes after 9:25 AM? 12:54 PM How many minutes are there between 8:39 PM and 10:55 PM? 136 What is 249 minutes before 11:54 AM? 7:45 AM What is 663 minutes before 7:03 AM? 8:00 PM What is 503 minutes before 7:43 PM? 11:20 AM How many minutes are there between 4:43 AM and 7:54 AM? 191 How many minutes are there between 4:28 PM and 8:11 PM? 223 What is 685 minutes before 8:25 PM? 9:00 AM What is 202 minutes before 7:20 AM? 3:58 AM How many minutes are there between 8:11 PM and 6:27 AM? 616 What is 250 minutes before 4:47 PM? 12:37 PM How many minutes are there between 4:19 AM and 5:00 AM? 41 How many minutes are there between 9:49 AM and 4:47 PM? 418 How many minutes are there between 6:20 PM and 6:02 AM? 702 What is 298 minutes after 12:45 AM? 5:43 AM What is 11 minutes after 12:27 AM? 12:38 AM What is 254 minutes before 4:46 AM? 12:32 AM What is 704 minutes after 5:51 PM? 5:35 AM How many minutes are there between 10:38 PM and 5:50 AM? 432 What is 665 minutes before 4:17 PM? 5:12 AM How many minutes are there between 4:17 PM and 12:57 AM? 520 How many minutes are there between 5:40 PM and 7:57 PM? 137 What is 405 minutes after 7:35 AM? 2:20 PM How many minutes are there between 8:21 PM and 5:41 AM? 560 How many minutes are there between 12:17 AM and 11:42 AM? 685 What is 62 minutes before 2:43 AM? 1:41 AM What is 547 minutes before 7:30 PM? 10:23 AM How many minutes are there between 5:17 PM and 7:36 PM? 139 How many minutes are there between 6:50 AM and 5:07 PM? 617 What is 97 minutes after 1:12 AM? 2:49 AM What is 235 minutes after 12:56 PM? 4:51 PM What is 568 minutes after 3:35 AM? 1:03 PM What is 209 minutes before 7:24 AM? 3:55 AM How many minutes are there between 7:06 AM and 4:19 PM? 553 What is 624 minutes before 3:49 AM? 5:25 PM What is 324 minutes after 5:21 PM? 10:45 PM What is 155 minutes before 7:37 PM? 5:02 PM What is 687 minutes before 11:15 PM? 11:48 AM What is 676 minutes after 4:08 AM? 3:24 PM How many minutes are there between 8:53 PM and 6:45 AM? 592 How many minutes are there between 5:56 PM and 7:56 PM? 120 How many minutes are there between 5:33 PM and 5:06 AM? 693 What is 14 minutes before 1:57 AM? 1:43 AM What is 691 minutes before 10:58 AM? 11:27 PM What is 265 minutes after 12:56 AM? 5:21 AM What is 41 minutes before 8:02 PM? 7:21 PM How many minutes are there between 2:13 PM and 10:01 PM? 468 How many minutes are there between 5:43 AM and 9:43 AM? 240 What is 416 minutes after 2:41 AM? 9:37 AM How many minutes are there between 6:39 PM and 6:24 AM? 705 How many minutes are there between 2:26 PM and 1:55 AM? 689 What is 595 minutes before 2:54 PM? 4:59 AM What is 467 minutes before 1:17 AM? 5:30 PM How many minutes are there between 9:38 PM and 8:24 AM? 646 How many minutes are there between 6:15 PM and 4:45 AM? 630 What is 456 minutes after 6:35 PM? 2:11 AM How many minutes are there between 4:15 PM and 7:42 PM? 207 What is 53 minutes before 11:28 PM? 10:35 PM What is 715 minutes after 5:28 PM? 5:23 AM What is 152 minutes before 5:15 AM? 2:43 AM How many minutes are there between 10:49 AM and 11:14 AM? 25 What is 33 minutes before 7:20 AM? 6:47 AM How many minutes are there between 2:02 PM and 12:22 AM? 620 How many minutes are there between 8:15 PM and 4:09 AM? 474 What is 394 minutes after 2:29 AM? 9:03 AM What is 315 minutes after 3:57 AM? 9:12 AM What is 385 minutes after 4:31 AM? 10:56 AM What is 559 minutes after 5:14 PM? 2:33 AM What is 91 minutes after 4:43 AM? 6:14 AM What is 321 minutes after 1:34 AM? 6:55 AM How many minutes are there between 11:42 PM and 12:38 AM? 56 What is 291 minutes after 12:15 AM? 5:06 AM What is 530 minutes before 8:03 PM? 11:13 AM What is 252 minutes before 9:43 AM? 5:31 AM How many minutes are there between 6:35 PM and 2:01 AM? 446 What is 655 minutes after 5:59 AM? 4:54 PM What is 439 minutes before 3:11 AM? 7:52 PM How many minutes are there between 2:30 PM and 5:41 PM? 191 How many minutes are there between 9:58 AM and 1:04 PM? 186 How many minutes are there between 4:14 AM and 5:42 AM? 88 What is 48 minutes before 2:11 AM? 1:23 AM What is 662 minutes after 2:07 AM? 1:09 PM How many minutes are there between 2:20 PM and 3:56 PM? 96 How many minutes are there between 11:15 PM and 6:14 AM? 419 How many minutes are there between 6:53 PM and 7:31 PM? 38 What is 672 minutes after 2:12 PM? 1:24 AM What is 266 minutes before 12:52 PM? 8:26 AM What is 505 minutes before 8:08 PM? 11:43 AM How many minutes are there between 8:18 AM and 8:57 AM? 39 What is 62 minutes after 2:44 AM? 3:46 AM What is 33 minutes before 1:51 AM? 1:18 AM What is 313 minutes after 2:53 PM? 8:06 PM What is 12 minutes before 1:48 PM? 1:36 PM What is 59 minutes after 2:00 AM? 2:59 AM What is 610 minutes after 5:48 AM? 3:58 PM How many minutes are there between 9:51 AM and 8:34 PM? 643 How many minutes are there between 8:59 PM and 6:29 AM? 570 How many minutes are there between 8:18 PM and 3:41 AM? 443 What is 304 minutes after 4:32 AM? 9:36 AM How many minutes are there between 9:22 AM and 3:50 PM? 388 How many minutes are there between 10:52 AM and 9:55 PM? 663 What is 618 minutes after 12:01 AM? 10:19 AM How many minutes are there between 4:30 AM and 5:58 AM? 88 What is 501 minutes before 10:39 AM? 2:18 AM How many minutes are there between 2:20 PM and 6:15 PM? 235 What is 444 minutes after 9:39 AM? 5:03 PM How many minutes are there between 5:46 PM and 8:02 PM? 136 How many minutes are there between 7:59 PM and 1:58 AM? 359 What is 353 minutes after 2:22 PM? 8:15 PM What is 646 minutes before 1:30 PM? 2:44 AM What is 559 minutes after 11:16 AM? 8:35 PM How many minutes are there between 2:22 AM and 9:56 AM? 454 How many minutes are there between 12:50 PM and 12:32 AM? 702 What is 631 minutes after 8:46 AM? 7:17 PM How many minutes are there between 1:56 AM and 4:25 AM? 149 How many minutes are there between 7:24 AM and 5:54 PM? 630 What is 481 minutes after 11:30 AM? 7:31 PM What is 254 minutes before 3:03 PM? 10:49 AM How many minutes are there between 6:40 AM and 4:25 PM? 585 How many minutes are there between 4:47 PM and 3:28 AM? 641 How many minutes are there between 11:08 AM and 10:17 PM? 669 What is 504 minutes before 10:28 PM? 2:04 PM What is 341 minutes after 6:58 AM? 12:39 PM What is 691 minutes before 2:56 AM? 3:25 PM How many minutes are there between 5:36 PM and 7:08 PM? 92 How many minutes are there between 8:47 PM and 3:46 AM? 419 What is 625 minutes before 1:05 AM? 2:40 PM What is 144 minutes before 3:45 AM? 1:21 AM How many minutes are there between 9:33 AM and 8:55 PM? 682 How many minutes are there between 11:07 PM and 9:54 AM? 647 How many minutes are there between 4:28 PM and 4:23 AM? 715 What is 6 minutes before 12:46 PM? 12:40 PM What is 665 minutes before 6:10 PM? 7:05 AM How many minutes are there between 1:04 PM and 1:03 AM? 719 How many minutes are there between 6:42 AM and 7:44 AM? 62 How many minutes are there between 5:56 PM and 5:51 AM? 715 What is 474 minutes after 5:37 AM? 1:31 PM How many minutes are there between 4:29 PM and 12:37 AM? 488 How many minutes are there between 1:44 PM and 9:44 PM? 480 How many minutes are there between 2:56 AM and 3:23 AM? 27 What is 474 minutes after 11:32 AM? 7:26 PM How many minutes are there between 4:20 PM and 9:45 PM? 325 What is 318 minutes before 2:44 AM? 9:26 PM How many minutes are there between 12:28 PM and 11:57 PM? 689 How many minutes are there between 3:00 AM and 3:35 AM? 35 What is 173 minutes after 9:03 AM? 11:56 AM How many minutes are there between 12:11 PM and 11:42 PM? 691 What is 708 minutes after 6:53 PM? 6:41 AM How many minutes are there between 3:56 AM and 10:02 AM? 366 How many minutes are there between 6:05 PM and 6:14 PM? 9 How many minutes are there between 9:19 AM and 10:51 AM? 92 How many minutes are there between 2:54 AM and 12:30 PM? 576 How many minutes are	{ "pile_set_name": "DM Mathematics" }
+ 3 = -12 for w. -3 Suppose -17s = 114 - 964. Solve 2a - s + 42 = 0 for a. 4 Let j(v) = 4v3 - v2 + 2v - 1. Let z be 2/5 - 9/(-15). Let g be j(z). Solve -gq = -3q - 1 for q. 1 Suppose -6 - 178 = -92f. Solve fn + 6n - 16 = 0 for n. 2 Let d = 27 - 12. Suppose 5p - 2w - d = 0, 2p - 4 = -2w + 2. Solve -3j + p = -6 for j. 3 Suppose 10k - 12k + 70 = 0. Let a = k + -11. Let t = a + -24. Solve -2u + 4 = -tu for u. 2 Let o = 554 + -515. Solve -31m - o = -44m for m. 3 Let f = 44 + -38. Solve -4 = 2g - f for g. 1 Let m be 404/(-7) - 4/14. Let g = m - -74. Solve 4 = -3y + g for y. 4 Let t(m) = 4m + 30. Let q be t(-7). Solve -3b + 5 = -qb for b. 5 Suppose -3y - 23 = -4j, 0y = 3y - 2j + 25. Let n be ((-15)/9)/(3/y). Solve -o = -no - 16 for o. -4 Let m = 46 - 44. Let l be 33/((-9)/(-8)). Suppose r - 4 = 4p - 20, -5r - mp + l = 0. Solve 0 = -i - r - 1 for i. -1 Suppose -5j = -15 - 10, 19 = 2r + 3j. Let u be 14/(-18) + 1 + 133/9. Solve -u = -rl - 3l for l. 3 Let f = -178 - -181. Let k be -1 - (-5)/((-15)/(-6)). Let u(m) = 4m2 - 1. Let c be u(k). Solve -cd + f = -6d for d. -1 Suppose 2x - 29 = 23. Solve 5j + 11 = x for j. 3 Suppose 60 = 487f - 482f. Solve 16i = fi + 12 for i. 3 Let g be -2 + 8/4 - -3. Let o be (-42)/(-10) - g/15. Suppose 0 = 2s + 3f + o, 3s + 4f + 1 + 3 = 0. Solve su = -7 - 5 for u. -3 Let d be (-21)/(-6)(-24)/(-14). Solve m + 25 = dm for m. 5 Let k(d) = -9d3 - d2 - d. Let i be k(-1). Let s be 24/i15/2. Suppose 2q = -2q + s. Solve 2u + 3 = qu for u. 1 Suppose -5g - 41 = o + 2, -3o + 2g - 78 = 0. Let t = 31 + o. Solve m - t = 2m for m. -3 Suppose 4f + 2p - 24 = 0, -6 = -5p + 14. Let a = 6 - f. Solve 10 = -3h - ah for h. -2 Let d(w) = 15w*2 - 6w + 2. Let c be d(1). Solve cv - 18 = 5v for v. 3 Suppose 0 = -5s - 0s - 5. Let o be 3s + 16/2. Suppose -ov = -3v - 4. Solve vi + i + 6 = 0 for i. -2 Let r = -307 + 310. Solve -1 = -rh - 13 for h. -4 Let l be ((-4)/2)/(6/(-15)). Suppose -x - l = 0, -5k + 79 = x - 16. Solve -2s - k = -6s for s. 5 Suppose 0 = -4o + 5o + 2. Let p(i) = -3i - 2. Let s be p(o). Solve -4z - 4 = s for z. -2 Suppose 15 = -4r + 9r. Let z = 3 + r. Solve p = z - 4 for p. 2 Suppose -5z + z = -12. Suppose 5k - 17 = j, j + 2k = zk - 1. Solve jw - 7 - 2 = 0 for w. 3 Suppose -9h + 5h - 5x + 88 = 0, -3h = -4x - 35. Solve 90 = hb + b for b. 5 Let t(q) be the first derivative of -q2/2 - 5q - 19. Let g be t(-8). Solve -2s = -3s + g for s. 3 Suppose -2z + 12 = 4z. Suppose -5d - 7 = 4r, r + zr + 12 = 3d. Let q be (-28)/(-8) - r/(-6). Solve t = -0t + q for t. 3 Let s(a) = -3a*3 - 4a*2 + a - 24. Let t(l) = 2l*3 + 3l*2 + 23. Let r(y) = 3s(y) + 4t(y). Let f be r(0). Solve k - f = -4k for k. 4 Let z = 2 - 27. Let h be 9 + 2/(10/z). Solve 3j - 1 = hj for j. -1 Let f = 173 + -166. Let g be -15f/14(-2)/3. Let p be (-1)/((-6)/(-10))-3. Solve -px = -4x + g for x. -5 Suppose 61c - 1214 = -116. Solve -16 + c = f for f. 2 Suppose 18 = 3m + 3b, m + 4 = 5b - 2. Suppose -x - x = m. Let u(q) = -q2 - 4q. Let s be u(x). Solve -4f + s = -2f for f. 2 Let d = -134 + 136. Suppose 0 = -4j - 3j + 77. Solve -j + 1 = di for i. -5 Let b = 27 - 18. Let i(c) = 6c + 2 + 2 - 7c + 8. Let a be i(b). Solve ak - k = 0 for k. 0 Suppose -13m + 32 + 7 = 0. Solve 3 = mk - 6 for k. 3 Suppose 0 = 17b + 13 - 47. Solve -bn + 31 = 23 for n. 4 Suppose 15y - 544 - 1781 = 0. Solve 8 = -ys + 157s for s. 4 Let t be (-48)/(-14) - (-4 - 186/(-42)). Let l = 1 + -4. Let p(w) = -w2 - 5w - 2. Let f be p(l). Solve ty - y = f for y. 2 Let d be (-4)/(-4)(-5)/(-1). Suppose 3a = 6a + 12, -dr + 5a = 45. Let h = 15 + r. Solve 0 = -u + hu for u. 0 Suppose -5 + 36 = 2p + 5f, -2p + 4f - 14 = 0. Solve pn + 7 = 7 for n. 0 Let m = -230 + 235. Solve -m + 2 = -3t for t. 1 Let f = 10 - 4. Let u(a) = -7a - 102. Let g(h) = 5h + 103. Let w(q) = 5g(q) + 6u(q). Let s be w(-6). Solve sv + f - 1 = 0 for v. -1 Let q = 108 - 101. Solve m = q - 9 for m. -2 Let z be 6/27 - (-10)/(-45). Suppose z = 5v - 2v + 36. Let m be ((-3)/(-6))/((-1)/v). Solve -m = 4j + 2 for j. -2 Let w(f) = f3 + 24f*2 + 34f - 181. Let t be w(-22). Solve -30j = -tj + 9 for j. 1 Suppose -44a - 16 = -60. Solve -15b + a = -14 for b. 1 Let h = 684 + -680. Solve h = -w - 0 for w. -4 Let g(q) = 2q2 - q - 1. Suppose 5k + 10 = 10k. Let s be g(k). Solve 2f + 1 = -s for f. -3 Let z be ((-2)/4)/((3 - 13)/120). Suppose -4p - 2b + 17 = -7b, 0 = -3p + 2b + 11. Solve pm - zm = 12 for m. -4 Let j = -16 - 1. Let q = j - -22. Suppose 0 = -3k - n, -4n = 3k - 5n. Solve -qy + 10 = -ky for y. 2 Let m(w) = -w - 11. Let b be m(-12). Suppose -15 = -4y + 3o, 2o = -y - 0o + b. Let u = y - 3. Solve u = -2p - 2p + 20 for p. 5 Let z be -5((3 - -1) + -9). Suppose -2v + z = 5p, -2p + v = -5p + 14. Solve 1 = pf + 13 for f. -4 Let k(i) = -i3 + 7i*2 + 11i + 3. Let x be k(8). Suppose 0 = 2m - 25 - x. Suppose m = 5j - 49. Solve -4o - j = o for o. -3 Suppose 0 = j + 3q - 42, -2q - 5 + 105 = 2j. Solve 18r = -9r - j for r. -2 Let p = 13 + -2. Let o = -18 - -22. Suppose p = ox - 21. Solve -3s - 5 = -xs for s. 1 Suppose 0 = -g + u + 14, 4g - 13 - 18 = -u. Solve gi - 7i = 4 for i. 2 Suppose 0 = 4m + r + 2, 5r - 8 = -m - m. Let w = 0 - m. Solve -w + 13 = 3k for k. 4 Suppose 5 = -3h + 5c - 9, 4h = 4c - 8. Solve -26j = -28j - h for j. -1 Let c be 13/2 + (-4)/8. Suppose 4y + 4 = cy. Solve y = 2v - 0 for v. 1 Let r(s) = -s*2 + 2s. Suppose 3l = 0, 6 = 3t - l + 2l. Suppose a - t = -g - 6, 8 = -g - 2a. Let f be r(g). Solve 4 = -2v - fv for v. -2 Let a(x) = -2x + 17. Suppose -8q = -7q + 5. Let j be a(q). Suppose -j = -3i + 18. Solve 4u = -u + i for u. 3 Let g = 5 + -1. Let h be (-18 + 0)/(-3)1. Let s(v) = -v + 7. Let t be s(h). Solve -5 + t = ga for a. -1 Let p be (-16)/(-10)300/24. Solve -x - p = 4x for x. -4 Suppose 1 = -2y + y - 2u, -3u - 6 = 0. Let f(m) = -m*y + 4m2 - m2 + 4m2 - 9m. Let i be f(5). Solve iq + 1 = 6 for q. 1 Suppose 2g = -4m + 10, -3g + 5m - 2 - 5 = 0. Suppose 3s - s = 0. Solve s = -l - g for l. -1 Let w(c) = -c*2 + 22c - 83. Let f be w(5). Solve -2m + 4m = -f for m. -1 Let m(k) = -k*3 - 8k*2 + 9k + 7. Let f be m(-9). Let n(u) be the third derivative of u*4/12 - 13u3/6 - u2. Let x be n(f). Solve x = -0w + w for w. 1 Let l(s) = -s3 + 6s*2 + 2s - 11. Suppose -6 = -2j + 6. Let z be l(j). Solve 2c = z - 11 for c. -5 Let u(z) = -14 + 6 - 41 - 17z + 45z*2 - 46z*2. Let p be u(-13). Solve 0 = -pa + 1 - 7 for a. -2 Let i(d) = d*3 + 23d*2 - 48d + 56. Let y be i(-25). Solve -9o = y + 12 for o. -2 Let v(m) = -m2 - 5m. Let o = -7 - -2. Let p be v(o). Let f(l) = -l3 - l2 + 3l + 2. Let q be f(-2). Solve q = 4i - pi + 16 for i. -4 Let q = -3 - -1. Let o be (0/(2/(-1)))/(q + 3). Solve j + 5 - 1 = o for j. -4 Let v = 66 - 64. Let q be ((v - 6)/4)/((-2)/4). Solve 5 - 15 = -qm for m. 5 Suppose 2x - 4q - q + 12 = 0, -16 = -x - 3q. Suppose 0 = -u - xu + 3u. Solve 0 = 3g - 3 - u for g. 1 Suppose -3q - 36 = -2m - 3m, 4m = 0. Let y be (-4)/q - 118/(-6). Solve -3c - y = -5 for c. -5 Let c(r) = 13r - 36. Let n be c(3). Solve p = np + 8 for p. -4 Let i be ((-111)/(-9) - -1) + (-80)/60. Let g be 0/(-3 + (2 - 0)). Suppose -3z + 4o + 12 = 0, gz - 2z = -3o - 9. Solve zv = 3v - i for v. 4 Suppose -x = -5x + 56. Let c = x - 10. Solve -7 = cd + 5 for d. -3 Let j be (-5)/((-10)/16) + -3. Suppose jo = 122 - 17. Let q be -7(36/o + -2). Solve 4s = qs for s. 0 Let b(u) = -2u2 - 27u + 37. Let q(v) = v*2 + 13v - 18. Let o(i) = -6b(i) - 13q(i). Let t be o(-8). Solve tf + 9 = f for f. -3 Let n(p) be the third derivative of p4/24 + 11p*3/6 - 2p*2. Let a be n(-8). Suppose 4g = 5u - 0 + 2, 9 = g + au. Solve g + 1 = c for c. 4 Let r(p) = -p - 1. Let z be r(-1). Suppose -2g = 4, -4u + u + 4g + 14 = z. Solve u = -n + 6 for n. 4 Let i = 21 + -13. Let w(j) = j3 + 2j*2 - 20j + 15. Let d be w(3). Solve d = 7f - 3f - i for f. 2 Let d(z) = z*3 - 14z*2 + 12z + 13. Let w be d(13). Suppose -5s - j = -5j, w = 2s - j. Solve 0 = -sy - 3*y - 3 for y.	{ "pile_set_name": "DM Mathematics" }
t d = 12763 + -5438. What is the thousands digit of d? 7 Suppose 4o = 2w + 8, -10w = -14w + 4o. What is the tens digit of -6((-10)/w - -2) - -409? 1 What is the tens digit of (115/46)/(3/17946)? 5 Let z(v) = 3v3 - 7v*2 - 41v - 111. What is the units digit of z(23)? 4 Let s be -2410/(-4) + 1 + 1. Let x = 55 - s. What is the units digit of (-3 - x/2)246? 3 What is the tens digit of ((-63)/252)/((-4)/((-1400032)/700014) - 2)? 5 Let q(m) = -m*3 - 3m*2 - 5m - 4. Let o be q(-2). Suppose -4n + 166 = 2h, on = -4h + 106 - 8. What is the tens digit of n? 3 Let j = -28 - -9. Let i = 49 + j. Suppose -33m + im = -432. What is the units digit of m? 4 What is the thousands digit of (-3 + -5 - 2240/16)1138/(-8)? 1 Let n(a) = -2a + 1. Let f be n(6). What is the units digit of (7 + f - 2) + 75? 9 Let q = -35 - -30. Let k be 14 - q/(-20)4. What is the tens digit of 15 + (-2)/k3? 1 Suppose -3w = 2l - 168814, 3l = 10w - 6w - 225040. What is the units digit of w? 6 What is the units digit of (29/3 - 11)/((-16)/73452)? 1 Suppose -3j + 4l + 308 = 0, 2l + 3l = -25. Suppose -2w + 44 = -x, x = 5w + 2x - j. Suppose -w = -5z - 5. What is the units digit of z? 3 Suppose 2h + 583587 = 21h - 625060. What is the ten thousands digit of h? 6 Let b be (-182)/(-26) + (-1688)/2. Let m = -578 - b. What is the units digit of m? 9 Suppose -513r + 514r - 4318 = -n, 0 = 5n - 2r - 21653. What is the units digit of n? 7 Suppose -2f - 32970 = -6f + 2x, 3f = -3x + 24741. Suppose -5u = -17u + f. What is the hundreds digit of u? 6 Let y(c) = 880c*2 - 28c - 76. What is the hundreds digit of y(-5)? 0 Let c = -4507 - -6227. What is the hundreds digit of c? 7 Let d = -17342 + 21692. What is the thousands digit of d? 4 Let s be 8 - 2/((-2)/(-3)). Suppose sn + 969 = 2589. Suppose 5u + 2c = n + 120, -5c = -4u + 375. What is the units digit of u? 0 Let j(d) = 293d + 105. Let r be j(12). Suppose 0 = -4k - 12, -r = -9p + 6p + 2k. What is the hundreds digit of p? 2 Let o(d) = -40d3 + 3d*2 + 5d + 15. Let y be (-1 - 0/(-10)) + (-4 - -2). What is the thousands digit of o(y)? 1 Let p = -15263 - -25508. What is the ten thousands digit of p? 1 Let n(b) = -2b + 34. Let f be n(19). What is the tens digit of ((-14)/f)/((-2)/(-744)3)? 3 Let f = 28523 + -7116. What is the hundreds digit of f? 4 Suppose 21i + 15 = 24i. Suppose 4n - 6 = in. What is the tens digit of (4 - 7)/(n/106)? 5 Suppose 0 = 7g + 30g - 284012. What is the tens digit of g? 7 Let d(q) = q*3 - 9q*2 + 3q + 43. Let v be d(8). What is the units digit of 8/(-12)(v - 201)? 2 Let l(b) = -3b. Let t(y) = 77y + 91. Let g(z) = 42l(z) + 3t(z). What is the hundreds digit of g(12)? 5 Let i(o) = 4903o*3 - 120o + 238. What is the ten thousands digit of i(2)? 3 Suppose 2l + 4r + 26 = 24, -1 = 2l + 3r. What is the tens digit of 4418/8 + (-17)/68 + l? 5 Let a be (-16)/(-48) + 2/3. Let x be -4 + (762 - a) + -1. Suppose y = -5y + x. What is the tens digit of y? 2 Let x(q) = 229q*2 + 161q - 820. What is the tens digit of x(5)? 1 Let s = 28 - 26. Let z be (2/1)/(s(-5)/40). What is the hundreds digit of 223/2 + (-4)/z? 1 Let q = -4380 - -9397. What is the units digit of q? 7 Let p = -1873 - -3311. Let b = p - 762. What is the hundreds digit of b? 6 Let c = 20 - -19. Let y = 29 - c. What is the tens digit of (-548)/(-20) - (-4)/y? 2 Suppose -16c + 39c = 10c + 79859. What is the tens digit of c? 4 Let z = -7586 - -35217. What is the thousands digit of z? 7 Let q be (-6)/(-150)5-410. Let d = 42 - 86. Let r = d - q. What is the tens digit of r? 3 Let w(z) = -z*2 + 238z - 52. What is the hundreds digit of w(80)? 5 Let m(b) = -b*3 + 3b*2 + 3b + 7. Let h be m(4). Let q be 481/78 + h/(-18). Suppose 11 + 61 = qd. What is the units digit of d? 2 Let b = -2966 - -9938. What is the tens digit of b? 7 Let q(s) = s2 - 9s + 8. Let b be ((-4)/(-4) - -3)/((-2)/(-4)). Let h be q(b). Suppose 3f + 3j - 423 + 72 = h, 4f = 4j + 476. What is the tens digit of f? 1 Let r(h) = 77h2 - 798h - 24. What is the units digit of r(11)? 5 Let o be 21/(-35) - (36/15 - 4). Let b(h) = 121h - 12. What is the tens digit of b(o)? 0 Let x(r) = -1127r - 3943. What is the thousands digit of x(-17)? 5 Suppose -u = u + 6, 0 = -2b - 2u - 2. Suppose -7o = -bo - 20. Suppose -n + 100 = -oh, 2h + 41 = -5n + 519. What is the tens digit of n? 9 Let w = 22 - 18. Suppose -5r - 2a + wa + 12 = 0, -4a - 6 = -r. Suppose p - 793 = -4i + rp, -5p = 25. What is the tens digit of i? 9 Let m(a) = -3a - 2 - 218a*3 - 4a*2 + 4a*2. Let g be 11 + -7 + 9 - 14. What is the units digit of m(g)? 9 What is the tens digit of 9729 - ((-12)/(-8)-6 - -17)? 2 Let j(a) = 11a2 + 4a + 3. Let l(n) = -n*3 - 8n*2 + 6n - 29. Suppose -3b = b + 36. Let r be l(b). What is the tens digit of j(r)? 3 Let i(c) = -20c + 63. Let k be i(17). Let j = 625 + k. What is the tens digit of j? 4 What is the thousands digit of (715245/(-10))/(-5 - 1) + 1/4? 1 What is the tens digit of (2312/1445)/(2/4840)? 7 Let d be (-4(-6)/8)/((-6)/(-10)). Suppose 2g = 4m - 1718, -dm + 6g + 2146 = 5g. What is the tens digit of m? 2 Let m = 4769 - 4178. What is the units digit of m? 1 Suppose -2s - 5i - 593 + 25336 = 0, -61808 = -5s + 4i. What is the thousands digit of s? 2 Suppose -11h - 136937 = -48h. What is the hundreds digit of h? 7 Let q(n) = -1052n + 1913. What is the hundreds digit of q(-11)? 4 Let u(c) be the third derivative of -c6/120 - c5/30 + c4/24 - c3/3 + 2c*2. Let j = -14 + 9. What is the tens digit of u(j)? 6 Let z be (-1662)/6(-3 + 4). Let l = -98 - z. What is the hundreds digit of l? 1 Let d(b) = 3184b3 + b2 + 7b - 6. What is the thousands digit of d(1)? 3 What is the units digit of (9736/(-12))/(((-2)/18)/(31 + -29))? 4 Suppose 0h = -7h + 22792. Suppose t - 12t = -h. Suppose -g = -4x + t, -63 = -x - 0g + 3g. What is the units digit of x? 5 Let h be 5366/(-30) + 164/(-1230). Let o = h + 1203. What is the hundreds digit of o? 0 Suppose 3t + 5q + 13 = 0, t + 5q - 14 = 7q. Suppose -tr - 597 = -3c, 499 = -4r + 4c - 93. Let j = -73 - r. What is the tens digit of j? 8 Suppose -5f + 8915 = -41005. What is the tens digit of f? 8 Let t = 116 + -114. What is the hundreds digit of t/((108/7281)/6)? 8 What is the hundreds digit of -32/(-16) + (-6141794)/(-464)? 2 Let l(y) = 2y - 1. Let a(x) = -17x - 226. Let t(j) = a(j) - 5l(j). What is the units digit of t(-24)? 7 Let w = 209 - 209. Suppose -d - 3m + 1355 = w, 0 = 7m - 10m - 15. What is the hundreds digit of d? 3 Suppose 2k = -10k + 3120. Let r = k - 104. What is the units digit of r? 6 Let a = 4014 + -2543. Let r = -1044 + a. What is the hundreds digit of r? 4 Suppose 5j + 54 - 4 = 0. Let u = 13 + j. Suppose 4i - 241 - 111 = -4s, -s - ui + 98 = 0. What is the units digit of s? 3 Let m(k) = 2k + 9. Let a be m(-10). Let x(u) = -31u + 287. What is the units digit of x(a)? 8 Let b = -66 - -67. Suppose 4q - q + 210 = 0. What is the units digit of (q/7)/(-2b/12)? 0 Suppose 0 = -277b + 140b - 336b + 6510372. What is the thousands digit of b? 3 Suppose 52k = 233125 + 72687. What is the hundreds digit of k? 8 Let f = -29 - -53. Let m be (-13)/1226 - (-4)/f. What is the units digit of ((-31)/(-4))/(-1 - 35/m)? 1 Let z = 921 + -896. Suppose -zm + 39332 + 5918 = 0. What is the tens digit of m? 1 Suppose 0 = 8t - 53824 - 11640. What is the hundreds digit of t? 1 Suppose 0 = -4d + 7 - 23, 2d + 96 = 4i. Let m be 3 - (1 + 2)/(6/i). What is the hundreds digit of 2/m + 1636/16? 1 Let s be (-1)/((-6)/(-2))(-3 - -3). Suppose 0 = -sb + 17b - 2975. What is the units digit of b? 5 Let a(t) = -25 - 13t - 23t3 + 45t*3 - 21t*3 - 17t*2. What is the hundreds digit of a(19)? 4 Let p be 16/(-9) + 20/(-90). Let t be 842 - (1 - 2/p). Suppose x + t = 7x. What is the units digit of x? 0 Let k(y) = 19y2 - 49y + 641. What is the thousands digit of k(23)? 9 Let k = -10285 + 12523. What is the hundreds digit of k? 2 Let i be 0 - ((-4)/6)/(4/(-24)). Let c(m) = -8m2 - 7m - 18. Let k be c(i). Let j = 199 + k. What is the tens digit of j? 8 Suppose -21h + 22097 = s - 18h, -5*s = -h - 110405. What is the thousands	{ "pile_set_name": "DM Mathematics" }
ich is the second biggest value? (a) -1 (b) -42 (c) 2/3621 a What is the biggest value in -3, 3192, -4/7, -3/7, 4? 3192 What is the second biggest value in -17, -2/7, -0.01, 0.03, -0.5, 0.04? 0.03 What is the third biggest value in 3, -6/7, -69.5237? -69.5237 Which is the second smallest value? (a) 5 (b) -1 (c) 1/3 (d) 7/4 c Which is the second smallest value? (a) -2 (b) 0.1 (c) -0.1 (d) 1 (e) -29 a Which is the sixth smallest value? (a) -2 (b) 1 (c) 2 (d) -0.019 (e) -3/5 (f) -0.1 c Which is the sixth biggest value? (a) -0.02 (b) 3/13 (c) 0.1 (d) -1/10 (e) -2/13 (f) -2 f What is the fourth smallest value in -0.1, -1, 2/14467, 4? 4 What is the biggest value in 1/22, 4, 109? 109 Which is the fourth biggest value? (a) -1/9 (b) -0.07 (c) 4 (d) 3/2 (e) 3 b What is the smallest value in 2018/43, 5/13, -2? -2 What is the fifth smallest value in -1/6, 2/1725, -0.02, -2, 0.3, -4? 2/1725 What is the biggest value in -2405/9, -111, -2/9? -2/9 What is the fifth smallest value in 0.01, 19, -2, -8/11, -0.4, 4? 4 Which is the biggest value? (a) 599 (b) -3 (c) 2/25 (d) 6/25 a What is the third biggest value in -1016, -5, -1, -0.01? -5 Which is the third smallest value? (a) 5 (b) 0 (c) 1 (d) -7 (e) -3 b Which is the biggest value? (a) -2/3 (b) -0.9 (c) -85 a Which is the fourth biggest value? (a) 0.5 (b) -1556 (c) 0.1 (d) -1 b Which is the fourth biggest value? (a) 322 (b) 1 (c) -3 (d) -4 d What is the fifth smallest value in -3, -0.45, -1, -1/15, 0.2, -0.14? -1/15 What is the biggest value in -440, 4, -5? 4 Which is the third smallest value? (a) 0.5 (b) 12 (c) 2/7 (d) 14 (e) -5 a Which is the second smallest value? (a) -2 (b) 10 (c) 3.4 (d) -0.14 d Which is the sixth smallest value? (a) -4/15 (b) -4 (c) -318 (d) 5 (e) -3 (f) -1/8 d Which is the second biggest value? (a) -4/9 (b) -2 (c) -2/15 a Which is the third smallest value? (a) -11 (b) 11 (c) -2 (d) 1.35 d What is the second smallest value in 5, 0.5, -12, -5, 0.2, -0.097? -5 Which is the third smallest value? (a) 5 (b) 0.01 (c) -2 (d) 2 (e) -4 (f) -4/7 f Which is the biggest value? (a) 0.230059 (b) -0.1 (c) -0.5 (d) -2 a What is the fifth biggest value in 0.2, 1, -2, -1/10, 1/119? -2 What is the second smallest value in -36/7, -10, 0.2644? -36/7 What is the fourth biggest value in -2, 21, -39/31, -4? -4 What is the second smallest value in -356, 0.04, -15? -15 What is the biggest value in -1/3, -2.17, -19? -1/3 What is the third smallest value in 2, 583, 1/5? 583 Which is the biggest value? (a) 1/4 (b) -14 (c) -2/5 (d) -4 (e) -201/5 a What is the fourth biggest value in 2.61, -1/4, 1, -4, 0.4, -3? -1/4 What is the second biggest value in -683, -13/8, -1? -13/8 Which is the third smallest value? (a) 0 (b) 128674 (c) 3 (d) -1/3 c Which is the third biggest value? (a) 14 (b) -3 (c) -3.91 c Which is the smallest value? (a) -0.3 (b) -1 (c) -4 (d) 8 (e) -1/5 (f) 2.3 c What is the biggest value in 2/9, 24/7, -1499? 24/7 What is the third biggest value in 4/3, 2/3, 264, -3? 2/3 What is the fourth biggest value in -45, 26, 98, 4, -4? -4 Which is the smallest value? (a) -11 (b) 4/353 (c) 2 a What is the second biggest value in -2/141, 2/5, -1/20, 0.03? 0.03 Which is the fifth biggest value? (a) 0.3 (b) -0.2 (c) 0.05 (d) -0.5 (e) -13.3 e Which is the second smallest value? (a) -38 (b) 3/28 (c) 2/3 (d) 2/7 b What is the third biggest value in 5/6, -2, 0.05, 10, 16? 5/6 Which is the third smallest value? (a) 2135 (b) -5 (c) 7.6 a Which is the third biggest value? (a) 2 (b) 3 (c) -43/190 c Which is the fourth smallest value? (a) 6 (b) -49 (c) -5 (d) -3 a Which is the third smallest value? (a) -140 (b) -2 (c) -0.4 (d) -14 (e) 1/4 b Which is the third smallest value? (a) 2 (b) -0.5 (c) 5 (d) 0.11 (e) 761 (f) 0 d What is the fifth biggest value in 0.5, 2/13, -4/5, 0, 4548? -4/5 Which is the fifth smallest value? (a) 5/6 (b) -5 (c) 63.4 (d) -1/2 (e) -228 c Which is the third biggest value? (a) 3/4 (b) -0.063 (c) -1/4 (d) 0.4 (e) -24/17 b Which is the third smallest value? (a) -188/3 (b) 16 (c) 3/25 b What is the biggest value in -10, 4, 2, -90.2? 4 What is the smallest value in 2800, 86, -11? -11 What is the smallest value in 1.4, -2.85, 2, 0.007? -2.85 What is the fourth biggest value in -5, 14, -0.02, 20? -5 What is the third smallest value in 1/2, 10/1367, -1/3? 1/2 Which is the fifth smallest value? (a) -16 (b) -3/5 (c) -4/3 (d) 0.02 (e) -14/3 d What is the smallest value in -4/7, -105, 2/2075? -105 Which is the second biggest value? (a) -0.5 (b) -3028 (c) 1.95 a What is the second smallest value in 0.03, 16, -12, 15? 0.03 What is the fifth biggest value in 4, -2, 0.5, -0.009, -8/15? -2 Which is the third smallest value? (a) 3 (b) -10820/3 (c) -2/5 (d) 5 a Which is the biggest value? (a) -9 (b) 3 (c) 5/4 (d) 5/7 (e) -0.3 b Which is the smallest value? (a) -0.5 (b) -0.4 (c) -4 (d) 1727 (e) -6 e Which is the third biggest value? (a) -0.2 (b) 2 (c) -5 (d) -1/8 (e) 0.239 (f) 0.4 e What is the sixth smallest value in -30.4, 7, -3, -1, -1/3, 11? 11 Which is the second smallest value? (a) 5237 (b) 2/9 (c) -1/7 (d) 1 (e) -2/7 (f) -0.5 e What is the second smallest value in 39, -80/9, 4, 0.05, 0? 0 What is the second smallest value in -2/19, 1.2, 4? 1.2 What is the fourth smallest value in 3/8, 4/3, 443, 2/15, 9/4, -1/8? 4/3 Which is the fourth smallest value? (a) -4 (b) -0.5 (c) -2/3 (d) 0.212 (e) -1/13 e What is the smallest value in 2/343, 2/7, 4, -5/11, -2/3? -2/3 What is the second smallest value in -89, -5, -0.01, -1/11, -0.07? -5 Which is the third smallest value? (a) 18 (b) 5 (c) 1/17131 a What is the fourth biggest value in -18, -0.4, -1, -10, -12? -12 What is the second smallest value in -0.4, -8, -3.73, -2? -3.73 What is the third smallest value in -7, -54, 4, -8/7? -8/7 Which is the smallest value? (a) -70601 (b) -1 (c) -0.1 a Which is the second smallest value? (a) 0.5 (b) -3 (c) 17869 (d) -0.2 d What is the fifth biggest value in -3, 2530, 2/17, 0.06, 22? -3 What is the second biggest value in 86, -2, -0.28? -0.28 Which is the sixth smallest value? (a) -4 (b) -0.08 (c) 12 (d) -0.7 (e) -1 (f) -2/11 c Which is the second smallest value? (a) -0.1 (b) -8/9 (c) 1 (d) 0 (e) -4/49 a What is the second smallest value in 0.07, -0.2, 2/13, -4/11, 25? -0.2 What is the fourth smallest value in 0.6, 65, -1, -2/15, 23? 23 Which is the smallest value? (a) -0.25 (b) -1 (c) -261 (d) 1/4 c Which is the biggest value? (a) -2577 (b) 15 (c) 2 b What is the fourth biggest value in 90, 12, -1/3, 0.1? -1/3 Which is the third biggest value? (a) -0.4 (b) 3/8 (c) -9 (d) 1.8592 (e) 1/6 e Which is the second smallest value? (a) 0.53 (b) 2 (c) 2/73 (d) 5 a Which is the fourth biggest value? (a) 21 (b) -1/10 (c) 2/173 (d) -2 d What is the smallest value in 1, -3352, -1/18? -3352 What is the fifth smallest value in -236, 0.3, -5, -1/9, 7? 7 What is the fifth smallest value in 15, -5, 973, 3, 4, -1/2? 15 What is the third smallest value in -11/5, 18, -1, 5? 5 Which is the biggest value? (a) 4 (b) 12/7 (c) -29/5 (d) -1 (e) 38 e What is the second smallest value in 4, 5/7, -0.07, -9? -0.07 What is the third biggest value in -7, -0.5, -2/15, 2/9, -0.08, 0.1? -0.08 What is the second biggest value in -1, -0.4, 0.1, 1.6, -137? 0.1 What is the fifth smallest value in 0.3, -0.2, -8, 9/5, 1/5? 9/5 What is the second smallest value in 0.5, -27, -2.62, 2/9? -2.62 What is the third biggest value in 3/70, 1, 0, -1? 0 Which is the sixth biggest value? (a) 2/15 (b) 21078 (c) -1 (d) -0.2 (e) 5 (f) -0.5 c Which is the second biggest value? (a) -0.03 (b) 1 (c) -1/2 (d) 3/5 d Which is the third biggest value? (a) 26 (b) -55 (c) -0.9 b What is the second smallest value in -2/3, -2/53, -0.23, -4, -3, 2/17? -3 What is the smallest value in 1/5, -0.07, 53386? -0.07 What is the biggest value in 2.5, -0.06, 124/7, -0.3? 124/7 What is the smallest value in 9676, -6/5, -2/13? -6/5 What is the fourth biggest value in 0.2, -1/7, 4, -2/73, 24, -1/3? -2/73 Which is the third smallest value? (a) -1/501 (b) 1/7 (c) 0.03 (d) 0.5 b	{ "pile_set_name": "DM Mathematics" }
to base 16. 2 What is -3 (base 8) in base 7? -3 What is 0 (base 15) in base 3? 0 What is -2a (base 14) in base 5? -123 Convert -76 (base 8) to base 14. -46 1001 (base 2) to base 9 10 What is -28 (base 9) in base 5? -101 What is -4a (base 12) in base 15? -3d What is 18 (base 11) in base 2? 10011 110 (base 2) to base 7 6 Convert 1121 (base 3) to base 7. 61 Convert -1011100 (base 2) to base 10. -92 -3 (base 12) to base 14 -3 Convert -11000 (base 2) to base 14. -1a 0 (base 3) to base 12 0 1 (base 14) to base 2 1 Convert -2 (base 12) to base 14. -2 What is -13 (base 7) in base 13? -a What is -124 (base 5) in base 16? -27 Convert 13 (base 7) to base 11. a Convert 1 (base 7) to base 8. 1 -8 (base 13) to base 15 -8 133 (base 6) to base 10 57 What is 3 (base 9) in base 13? 3 Convert a (base 13) to base 15. a What is -2 (base 5) in base 6? -2 20 (base 13) to base 7 35 3 (base 7) to base 12 3 Convert -3 (base 7) to base 6. -3 Convert 37 (base 16) to base 2. 110111 Convert -82 (base 11) to base 14. -66 What is -21 (base 11) in base 16? -17 Convert -1012 (base 5) to base 11. -110 Convert 100 (base 2) to base 3. 11 What is 36 (base 10) in base 6? 100 What is -8 (base 13) in base 4? -20 45 (base 6) to base 15 1e Convert 48 (base 13) to base 8. 74 -2 (base 16) to base 15 -2 Convert -7 (base 11) to base 12. -7 6 (base 10) to base 7 6 Convert -2 (base 8) to base 7. -2 -1011 (base 2) to base 16 -b -cc (base 13) to base 8 -250 40 (base 9) to base 6 100 Convert -3 (base 11) to base 10. -3 What is -31 (base 4) in base 9? -14 What is -20 (base 5) in base 8? -12 What is -4 (base 7) in base 8? -4 What is 6 (base 11) in base 2? 110 Convert -10000 (base 2) to base 6. -24 Convert 8a (base 11) to base 13. 77 Convert 12 (base 7) to base 13. 9 What is -4 (base 5) in base 6? -4 18 (base 16) to base 11 22 What is -5 (base 10) in base 3? -12 -11 (base 3) to base 15 -4 a2 (base 11) to base 5 422 What is -32 (base 4) in base 6? -22 Convert -133 (base 7) to base 9. -81 100001111 (base 2) to base 11 227 What is 56 (base 10) in base 8? 70 Convert 6 (base 12) to base 13. 6 Convert 141 (base 7) to base 9. 86 Convert -a (base 12) to base 4. -22 What is 5 (base 10) in base 13? 5 Convert -14 (base 11) to base 6. -23 0 (base 16) to base 8 0 Convert -140 (base 8) to base 3. -10120 Convert 53 (base 15) to base 4. 1032 What is 210 (base 4) in base 16? 24 Convert -2 (base 3) to base 2. -10 Convert 2a (base 15) to base 2. 101000 Convert 2 (base 9) to base 4. 2 Convert 1 (base 13) to base 12. 1 53 (base 9) to base 2 110000 What is 11 (base 5) in base 3? 20 What is -79 (base 10) in base 5? -304 What is -4 (base 11) in base 2? -100 2 (base 3) to base 6 2 2 (base 15) to base 4 2 Convert -210 (base 5) to base 4. -313 c (base 14) to base 3 110 Convert 1 (base 6) to base 9. 1 Convert 2 (base 3) to base 6. 2 -28 (base 12) to base 5 -112 What is 2121 (base 5) in base 4? 10132 -1121 (base 3) to base 2 -101011 What is 6 (base 16) in base 12? 6 Convert 11 (base 5) to base 9. 6 What is -1000 (base 2) in base 5? -13 -7 (base 13) to base 12 -7 -1 (base 4) to base 6 -1 Convert 4 (base 15) to base 11. 4 Convert -d (base 14) to base 15. -d What is 162 (base 9) in base 15? 92 Convert -320 (base 6) to base 16. -78 3b (base 16) to base 15 3e What is 21020 (base 3) in base 4? 3003 Convert 102 (base 12) to base 14. a6 Convert -353 (base 9) to base 2. -100100011 Convert -1c6 (base 13) to base 2. -101001011 9c (base 16) to base 5 1111 Convert 0 (base 9) to base 4. 0 What is -350 (base 6) in base 13? -a8 Convert 9b (base 12) to base 11. a9 Convert -22 (base 15) to base 6. -52 Convert 56 (base 9) to base 6. 123 -111 (base 2) to base 11 -7 -b (base 15) to base 11 -10 What is -4 (base 13) in base 16? -4 What is 23 (base 6) in base 7? 21 What is 2d (base 16) in base 7? 63 What is 2 (base 9) in base 2? 10 Convert 121 (base 10) to base 2. 1111001 What is -1 (base 7) in base 13? -1 -14 (base 8) to base 7 -15 -29 (base 13) to base 11 -32 Convert 51 (base 12) to base 8. 75 -125 (base 7) to base 3 -2112 What is 2 (base 3) in base 7? 2 10 (base 3) to base 9 3 What is -17 (base 9) in base 14? -12 56 (base 13) to base 12 5b What is 135 (base 14) in base 4? 3303 What is -10 (base 6) in base 10? -6 1c9 (base 13) to base 3 110101 Convert 8b (base 13) to base 5. 430 What is 13 (base 9) in base 2? 1100 -2a (base 16) to base 11 -39 What is 19 (base 11) in base 3? 202 What is -7 (base 11) in base 5? -12 -11100 (base 2) to base 8 -34 What is -c (base 14) in base 3? -110 Convert -100 (base 2) to base 11. -4 Convert 102220 (base 3) to base 11. 272 What is 0 (base 12) in base 6? 0 What is -57 (base 12) in base 6? -151 Convert -22 (base 6) to base 14. -10 Convert -4 (base 13) to base 5. -4 1 (base 15) to base 2 1 -20 (base 3) to base 16 -6 4 (base 10) to base 8 4 What is -17 (base 8) in base 9? -16 What is 15 (base 15) in base 10? 20 -a (base 11) to base 12 -a -112 (base 8) to base 14 -54 What is -2 (base 5) in base 6? -2 What is 3 (base 6) in base 8? 3 What is 33 (base 14) in base 9? 50 20 (base 9) to base 4 102 What is -3 (base 9) in base 13? -3 66 (base 14) to base 16 5a Convert 2 (base 15) to base 5. 2 c (base 16) to base 4 30 Convert 32 (base 16) to base 10. 50 Convert 113 (base 6) to base 8. 55 What is 25 (base 6) in base 3? 122 Convert 123 (base 4) to base 13. 21 What is a3 (base 12) in base 7? 234 16 (base 16) to base 7 31 43 (base 8) to base 6 55 11 (base 9) to base 10 10 Convert -12 (base 4) to base 3. -20 -75 (base 12) to base 2 -1011001 Convert 4b (base 16) to base 11. 69 Convert 3 (base 15) to base 12. 3 -32 (base 6) to base 3 -202 Convert 0 (base 9) to base 6. 0 2 (base 14) to base 9 2 What is -c (base 14) in base 2? -1100 Convert -2 (base 9) to base 10. -2 Convert 10 (base 6) to base 8. 6 -99 (base 13) to base 11 -105 What is 30 (base 8) in base 2? 11000 56 (base 12) to base 14 4a 1110101 (base 2) to base 8 165 What is 1110 (base 4) in base 7? 150 Convert -26 (base 9) to base 13. -1b What is 11 (base 9) in base 2? 1010 What is -10 (base 3) in base 4? -3 What is 98 (base 12) in base 4? 1310 Convert 6 (base 9) to base 5. 11 10 (base 7) to base 5 12 What is -13 (base 14) in base 8? -21 1 (base 8) to base 4 1 Convert -1 (base 6) to base 8. -1 Convert -4 (base 7) to base 14. -4 5 (base 9) to base 7 5 What is -4 (base 10) in base 14? -4 What is -210 (base 5) in base 3? -2001 What is -31 (base 9) in base 6? -44 Convert -10 (base 4) to base 6. -4 21 (base 15) to base 11 29 What is -3 (base 9) in base 15? -3 a (base 12) to base 10 10 1 (base 6) to base 10 1 11 (base 15) to base 3 121 Convert -2a (base 12) to base 10. -34 -8 (base 16) to base 2 -1000 Convert 33 (base 14) to base 10. 45 Convert -4f (base 16) to base 2. -1001111 -52 (base 6) to base 16 -20 2 (base 10) to base 6 2 Convert -7 (base 15) to base 2. -111 2 (base 8) to base 6 2 What is 3 (base 14) in base 2? 11 Convert 2 (base 15) to base 11. 2 What is -58 (base 11) in base 10? -63 What is -30 (base 7) in base 6? -33 222 (base 4) to base 16 2a Convert -3 (base 7) to base 10. -3 Convert -3 (base 13) to base 11. -3 24 (base 7) to base 11 17 Convert -13 (base 7) to base 16. -a Convert -165 (base 15) to base 13. -1b8 11 (base 10) to base 8 13 1101001 (base 2) to base 3 10220 2d (base 14) to base 5 131 -6 (base 16) to base 9 -6 What is -31 (base 10) in base 4? -133 -41 (base 7) to base 5 -104 What is 72 (base 10) in base 6? 200 Convert -8 (base 16) to base 14. -8 Convert 49 (base 16) to base 11. 67 Convert -5 (base 13) to base 7. -5 What is 11 (base 3) in base 13? 4 -14 (base 14) to base 9 -20 134 (base 9) to base 5 422 243 (base 7) to base 4 2001 What is -c (base 13) in base 12? -10 2 (base 5) to base 14 2 -2 (base 10) to base 5 -2 5 (base 10) to base 2 101 What is -134 (base 10) in base 15? -8e 1 (base 2) to base 9 1 What is 200 (base 4) in base 3? 1012 57 (base 12) to base 3 2111 1011 (base 2) to base 12 b Convert 13 (base 9) to base 16. c What is 3 (base 12) in base 4? 3 221 (base 4) to base 5 131 What is 310 (base 9) in base 12? 190 2 (base 7) to base 10 2 6a (base 11) to base 14 56 Convert 10011 (base 2) to base 10. 19 What is -22 (base 14) in base 11? -28 Convert 7d (base 16) to base 5. 1000 Convert -2e (base 16) to base 7. -64 Convert -75 (base 14) to base 13. -7c What i	{ "pile_set_name": "DM Mathematics" }
6a In base 15, what is -1 - -2a? 29 In base 8, what is -42 - 12? -54 In base 9, what is -107 + 222? 114 In base 5, what is 3002 - 0? 3002 In base 16, what is 3 - -da? dd In base 9, what is 3 + 2280? 2283 In base 15, what is 17 - c4? -ac In base 12, what is -10357 + -3? -1035a In base 11, what is -5 + -90? -95 In base 6, what is -3 - 3213? -3220 In base 10, what is 33 - -20? 53 In base 13, what is cb + -2? c9 In base 7, what is 143 + -1? 142 In base 10, what is -4 - 3869? -3873 In base 13, what is 1 - 103b? -103a In base 16, what is -185 + -a? -18f In base 4, what is -123 + 12020? 11231 In base 3, what is 110210 + -11? 110122 In base 16, what is -3 - -200? 1fd In base 3, what is 2 + 10010? 10012 In base 5, what is 11243 - 102? 11141 In base 7, what is -13354 + -2? -13356 In base 16, what is ba + -4? b6 In base 10, what is 100 - 207? -107 In base 5, what is 40 + 4? 44 In base 14, what is -269 + 1? -268 In base 11, what is 5 + 1101? 1106 In base 2, what is -101 - -1010110? 1010001 In base 6, what is 5 + 13453? 13502 In base 13, what is -1a - -3? -17 In base 12, what is 2a3 + -1? 2a2 In base 7, what is 542 - -1? 543 In base 8, what is -42335 + 5? -42330 In base 10, what is -59 + -175? -234 In base 8, what is -4 - 133? -137 In base 2, what is -1010010001011 + -11? -1010010001110 In base 15, what is 83c - 5? 837 In base 13, what is -6488 + -2? -648a In base 5, what is -11 + 24030? 24014 In base 16, what is 2a + b7? e1 In base 16, what is -5 - cc? -d1 In base 13, what is 2 + 5a? 5c In base 5, what is -10 - -402? 342 In base 11, what is 2 + -50? -49 In base 11, what is 126 - -2? 128 In base 8, what is -251 + 237? -12 In base 15, what is 0 - -91? 91 In base 11, what is -503 - 5? -508 In base 14, what is -23d + -20? -25d In base 10, what is 327 - -36? 363 In base 8, what is -2145 + -1? -2146 In base 3, what is -21112 - -1? -21111 In base 13, what is -520 + -4? -524 In base 10, what is 14841 - -4? 14845 In base 13, what is -2 + -156? -158 In base 15, what is 0 + 49? 49 In base 12, what is -14 - -60a? 5b6 In base 13, what is -46 - -5? -41 In base 14, what is -ca - -4? -c6 In base 2, what is -1011 - 1111? -11010 In base 12, what is 15 + -11? 4 In base 7, what is -2 - 156? -161 In base 2, what is 10 + 100011100? 100011110 In base 13, what is -7 - 43? -4a In base 2, what is 0 + -1111101100? -1111101100 In base 12, what is -11 - 6? -17 In base 13, what is -2 - 37? -39 In base 10, what is 0 - 30? -30 In base 13, what is -3 + -3b? -41 In base 5, what is 10 - -1? 11 In base 2, what is 0 - -111011001? 111011001 In base 15, what is b + 6? 12 In base 7, what is 16 + -606? -560 In base 6, what is -11 + 122? 111 In base 11, what is -265 + 1? -264 In base 9, what is 33200 + -5? 33184 In base 15, what is -3137 + -3? -313a In base 4, what is 1211 + -10? 1201 In base 9, what is 4 + -1744? -1740 In base 10, what is 2 + -1386? -1384 In base 8, what is 214 - 57? 135 In base 2, what is -1110110111 + 101? -1110110010 In base 10, what is -37 + 4? -33 In base 14, what is 1a7 - 3? 1a4 In base 12, what is -4 - -85? 81 In base 13, what is 2 + -1338? -1336 In base 4, what is 1 + -100021? -100020 In base 8, what is -70 + -10? -100 In base 9, what is 5 + -280? -274 In base 14, what is -1 - 3? -4 In base 15, what is -2 + 69? 67 In base 5, what is -421 + 11? -410 In base 11, what is -16 + -3? -19 In base 6, what is 0 + -200? -200 In base 15, what is -34 - -3? -31 In base 10, what is -692 + -19? -711 In base 2, what is 101000 - 0? 101000 In base 10, what is 1 - -411? 412 In base 13, what is -229 + 2? -227 In base 15, what is -9d + -6? -a4 In base 13, what is 4 + 1329? 1330 In base 4, what is -21 + -202? -223 In base 6, what is -24 - -100? 32 In base 13, what is -2 + 5b? 59 In base 10, what is -19 - -51? 32 In base 3, what is 12 - 20021020? -20021001 In base 11, what is 3 + 539? 541 In base 9, what is 86 + -1? 85 In base 10, what is -31 + -79? -110 In base 8, what is -14 - -51? 35 In base 2, what is -100000 + 101011100? 100111100 In base 14, what is 4 + -10? -a In base 15, what is -25a + -1? -25b In base 11, what is 10 + -1? a In base 6, what is 3 - 245? -242 In base 14, what is 2 + -4b? -49 In base 13, what is 18c + -7? 185 In base 8, what is 7 + -266? -257 In base 3, what is -2102220 - 20? -2110010 In base 11, what is 112 - 3? 10a In base 5, what is 22 + -20433? -20411 In base 16, what is 750 - -1? 751 In base 14, what is 1aa0 - 5? 1a99 In base 12, what is 1 + -96? -95 In base 7, what is -603 - -4? -566 In base 13, what is -3757 + -2? -3759 In base 8, what is -2024 + -1? -2025 In base 13, what is -67 - 20? -87 In base 13, what is 1 - -35b8? 35b9 In base 9, what is -6 - 404? -411 In base 7, what is 52 + -5? 44 In base 2, what is 10001 + -100100? -10011 In base 7, what is 213 + 110? 323 In base 2, what is 100011 - -111010? 1011101 In base 16, what is 22 + f? 31 In base 5, what is -11423 + -131? -12104 In base 3, what is -122 - -212? 20 In base 10, what is -250 + 2? -248 In base 2, what is -10101 - 110? -11011 In base 14, what is 891 + -2? 88d In base 7, what is -3 + 61? 55 In base 12, what is 3077 - 3? 3074 In base 4, what is 233 + -3? 230 In base 3, what is 201120 + 211? 202101 In base 8, what is 10271 + 3? 10274 In base 13, what is 410 + 3? 413 In base 2, what is 1110011 - 0? 1110011 In base 7, what is 4 + -244? -240 In base 12, what is -271 + 5? -268 In base 16, what is -2 + 220c? 220a In base 7, what is 2241 - -11? 2252 In base 2, what is 11100010 - -1101? 11101111 In base 3, what is 20 - 10100? -10010 In base 3, what is 111 - 20? 21 In base 12, what is 3a - 2? 38 In base 11, what is 50 - -103? 153 In base 14, what is 0 - 14? -14 In base 2, what is -10 - -10011001000? 10011000110 In base 11, what is -20 + 5? -16 In base 4, what is 12 + 111? 123 In base 5, what is 31423 - -10? 31433 In base 12, what is 4 - 100? -b8 In base 14, what is -21 + 27? 6 In base 15, what is 2e - 4? 2a In base 6, what is -20 + -5231? -5251 In base 4, what is 0 - -31? 31 In base 8, what is 14122 - -3? 14125 In base 9, what is 23 + -15? 7 In base 14, what is -3 - a? -d In base 5, what is -243 - -3? -240 In base 15, what is 0 - -9b8? 9b8 In base 11, what is -195 - 3? -198 In base 5, what is 10 + 440? 1000 In base 3, what is -1 + 12222? 12221 In base 15, what is 121 + 3? 124 In base 3, what is 21010 + -12? 20221 In base 12, what is 1 + 1023? 1024 In base 2, what is -11110100 - -100? -11110000 In base 2, what is -10111000011 + -10? -10111000101 In base 9, what is -27 + -281? -318 In base 2, what is 10010 - 100? 1110 In base 14, what is d + -33? -24 In base 5, what is -1313 - -10? -1303 In base 4, what is 12011 - -310? 12321 In base 16, what is 39f - -4? 3a3 In base 13, what is 38 + 6b? a6 In base 9, what is -271 + 11? -260 In base 11, what is 21 - 10a? -99 In base 10, what is -147 - 3? -150 In base 9, what is 1056 - -5? 1062 In base 7, what is -30 + -1302? -1332 In base 7, what is 61 + 4? 65 In base 3, what is 110120 + 2? 110122 In base 15, what is -4 - 5b? -60 In base 13, what is -23 - -1? -22 In base 4, what is 0 - -11? 11 In base 12, what is -6 - a? -14 In base 15, what is 57 - 1? 56 In base 7, what is 5 - 101? -63 In base 10, what is 1 - 457? -456 In base 16, what is 3 + 173? 176 In base 9, what is -4 - 160? -164 In base 2, what is -10 - -101101110? 101101100 In base 2, what is -111100000 + -10? -111100010 In base 6, what is -2 - -20312? 20310 In base 5, what is 12310 + 4? 12314 In base 13, what is -1311 - -3? -130b In base 7, what is -206 - -4? -202 In base 3, what is -110022 - 10? -110102 In base 4, what is -1 + -13111? -13112 In base 14, what is -d + b2? a3 In base 12, what is 5 - -79? 82 In base 6, what is -303 + 231? -32 In base 2, what is -1010010011 - -100? -1010001111 In base 11, what is 140 + 62? 1a2 In base 13, what is -1 + 218? 217 In base 11, what is -30 + 1? -2a In base 9, what is 2 - 52? -50 In base 11, what is -4 + 105? 101 In base 9, what is 5 + -623? -617 In base 7, what is -3 + 525? 522 In base 7, what is 1 + -2463? -2462 In base 8, what is -66 + -611? -677 In base 14, what is 237 + -24? 213 In base 3, what is -210112 + 2? -210110 In base 11, what is 15 + -a? 6 In base 16, what is 35 - 68? -33 In base 7, what is 36 + -5? 31 In base 9, what is 304 - 12? 282 In base 7, what is 100 - -12? 1	{ "pile_set_name": "DM Mathematics" }
posite number? True Suppose -c = -1632 - 269. Is c a composite number? False Let g(k) = 2k3 - 3k*2 + 5k + 1. Let w be g(4). Let p = 896 + -637. Suppose 4j - 3o - p = 0, 0 = 5j - 3o - 225 - w. Is j a composite number? False Suppose -5d + 9178 = -4k, 4d - 2k = k + 7343. Is d a composite number? True Suppose 2b + 1158 = -624. Let f = -448 - b. Is f a composite number? False Let b = -42 - -61. Suppose 0 = y - 4t - 141, 4t = 1 + b. Is y a composite number? True Suppose 0 = -4x - 2j + 1318 + 3706, -j + 6277 = 5x. Is x prime? False Let c = -2 - -2. Let f = 8 + -4. Suppose c = 3z - 53 - f. Is z composite? False Let r = 1 - -1. Suppose 3f + 2g - 3 = 20, -54 = -4f + rg. Is f composite? False Let r be 9/(-2)(-4)/(-2). Let f = -30 + r. Let c = -1 - f. Is c prime? False Let u(k) = -11k - 7. Is u(-4) a composite number? False Let h be (-6 - -8) + (0 - 1). Let b be 23/(-6) + h. Let n(m) = m*2 - m + 22. Is n(b) composite? True Let w(p) = -104p - 57. Is w(-22) a composite number? True Let u(b) = 2b + 1. Suppose -3 + 4 = v. Let r be u(v). Suppose -15 = 3d, -3c + d + rd = -221. Is c a prime number? True Suppose -5y + 0y + 5s = -25, 2s = -4y + 14. Suppose yo - 164 = 4q, o = -o - q + 82. Suppose 11 = 4m - o. Is m a prime number? True Let i = 232 + -141. Is i a prime number? False Let j be (-3 + -2)(-9)/(-1). Let r = -26 - j. Is r prime? True Suppose 3b = 5 + 7. Suppose 2f - 202 = -bv, 0v = -5f - 3v + 491. Is f prime? True Let c = 13 - 19. Is c - -3 - 28/(-2) prime? True Let k = 227 - 114. Is k a composite number? False Let z(o) be the second derivative of o5/15 - 5o*4/24 + 2o*3/3 + 3o. Let c(u) be the second derivative of z(u). Is c(5) a composite number? True Let o = -52 - -137. Is o a composite number? True Suppose -4o - 5h = -4 - 41, 5o + 4h = 45. Let s(z) = -z*2 - 3z + 10. Let p(c) = -c*2 - 3c + 9. Let y(a) = -5p(a) + 4s(a). Is y(o) prime? False Suppose -4r - 3n + 321 = -1246, -3r = 4n - 1177. Is r a prime number? False Suppose 6y = 5y + 1. Let g = y - -6. Suppose 5 = -w + g. Is w prime? True Is (1 - 0)(4 + 259) prime? True Suppose -1455 = -13z + 8z. Is z prime? False Suppose 4o - 8881 = -2637. Is o composite? True Suppose o - 6o = -445. Let q = -36 + o. Is q composite? False Let u = 3 - 3. Suppose 0 = -5d - b - ub - 31, -15 = 3d - 3b. Let g(o) = -o2 - 9o - 3. Is g(d) a prime number? False Let t = -282 + 409. Is t prime? True Let d = 7 + -1. Suppose 4a = y - 43, -3a + 3 = -d. Is y prime? False Let f = 15 + -15. Suppose 148 = 4m - fm. Is m composite? False Suppose -147 - 439 = -2a. Is a a prime number? True Suppose 21 = 2q - 53. Suppose -147 = -4m + 3j, -5m + 238 - q = 2j. Let b = 166 - m. Is b prime? True Let p = -3 + 3. Suppose -2r - 4 = p, 0i - 2r + 49 = i. Is i a prime number? True Is ((-17455)/(-10))/((-3)/(-6)) a composite number? False Let l(j) = -3j*2 - 5j + 7. Let v be l(6). Is (-1 + (-3 - -3))v a composite number? False Let w = 420 + -199. Is w a prime number? False Suppose 44 = -3o + 335. Is o a composite number? False Let o(n) = -n3 + n2 - n + 19. Let m be 4/14 + (-4)/14. Is o(m) prime? True Suppose 0 = -5g - 16 + 6. Is g/(-7) + (-1858)/(-14) a prime number? False Let a = -166 - -645. Is a a prime number? True Suppose -5i = -3u - 6, 2i + 5 = 4u - 1. Suppose u = -5v - 4c + 29, -4c + 10 = -3v. Suppose -vz = -0 - 6. Is z a prime number? True Suppose -2u = 2u - 140. Is u a composite number? True Suppose -z = z + 2. Is -2 - (z - 0) - -66 composite? True Suppose 0 = -5s + 3x + 5210, -s + 3x = x - 1049. Is s a prime number? True Let d be 40/126/2. Is (d + 1)18/6 composite? True Let b be 263/(-2) + 1/2. Let j = 454 - 270. Let o = j + b. Is o composite? False Let s(p) = 2p - 10. Let k be s(7). Suppose 0q = -2t - q + 25, 2t - 30 = kq. Is t composite? False Suppose -2r - 3o = -38, 5o - 74 = -4r - 0o. Let v = -9 + r. Let u(p) = 2p*2 - 9p - 10. Is u(v) a prime number? False Is -9073/(-6)(3 + -1) a composite number? False Suppose 1521 = 9g - 612. Is g prime? False Let n(v) = 234v*2 + v + 3. Suppose 2y = 5f + 10, f = y + y - 2. Is n(f) prime? True Let h(k) = 21k + 53. Is h(24) composite? False Suppose -3u + l + 0l + 6 = 0, 5l + 2 = u. Let z(b) = -b - 4. Let c be z(-6). Is (2/u)/(c/38) prime? True Let i = 226 + -60. Suppose 3p = -i - 1097. Is p/(-9) + 6/27 a composite number? False Let d(w) = w + 10. Let t be d(-7). Suppose -60 = -7z + tz. Let g = 50 - z. Is g composite? True Suppose -5g = 4l + 10, -2g + 5l = -g - 27. Let t(m) = 0m3 + 11m + 7m2 - 2m*3 - gm*3 - 2 + 3m*3. Is t(8) composite? True Let j(o) = -6o*2 + o - 1. Let z be j(1). Let l = 9 + z. Suppose 0 = f - l - 20. Is f a composite number? False Let h = -29 + 8. Let z = h + 44. Is z a composite number? False Suppose -g - 4u + 4654 = g, -u = -3g + 7002. Is g prime? True Let z(p) = -5p + p - 7p2 + p3 + 3 - 5p*3. Let b be z(-4). Suppose -5a = 2k - b, -4k - 3a - a = -344. Is k a composite number? False Let q(b) = -7b*3 + 2b + 1. Let k be q(-2). Suppose k - 341 = -3d. Suppose 5m + 5l - 120 = -0l, 5m = 3l + d. Is m composite? True Let n be 2 + 1-2 + 29. Let s(z) = -z2 - 5z - 2. Let j be s(-4). Suppose -n = jv - 103. Is v a prime number? True Is (-502 + -1)/(-1) + -4 a composite number? False Let q be (-10)/(-3)(-1 - -4). Suppose -r = r - q. Suppose -rd + 220 = -d. Is d a composite number? True Let g be 3/1(3 + -2). Suppose -d = gd - 316. Is d a prime number? True Let p(r) be the first derivative of 3r*2 + 7r - 6. Is p(5) a composite number? False Suppose 6o = -158 + 446. Let z = 103 - o. Is z a prime number? False Let q(u) = -u2 + 12u - 1. Suppose 2t = 3t - 11. Is q(t) a prime number? False Let a = -124 - -203. Suppose 0 = -4b + 5b - a. Is b composite? False Suppose 3r - w = 14, -10 - 7 = -3r - 2w. Suppose 3 = 2k + l, 0 = rk + 6l - 2l - 12. Is (k + -1)/((-1)/37) prime? True Let d(n) = 35n*3 + 3n*2 - 2. Let o(y) = 69y*3 + 5y*2 - 3. Let i(g) = -5d(g) + 3o(g). Is i(2) a prime number? True Suppose 0 = -2h - h - 4g + 70, h + 5g = 27. Let x = h + -3. Is x prime? True Suppose -2s = -2i - 3i + 14412, 3i = -2s + 8660. Suppose 7v - i = 3v. Is v a composite number? True Suppose -926 = -8l - 150. Is l prime? True Suppose -3y + n = -226, -200 = -5y + 5n + 170. Let p = -45 + y. Is p composite? False Suppose 2r + 3j + 2j = 25, 0 = 5r - 5j + 25. Suppose r = v - 4v - 6. Is -1 + 64/(v - -4) a prime number? True Suppose 0k - 2k + 12 = 0. Suppose -n + 47 = -k. Is n a prime number? True Let w(v) = v2 - 9v + 4. Let j be w(9). Suppose 3a - ja + 37 = 0. Is a a composite number? False Let a(c) be the first derivative of -5c - c3 + 1/4c*4 + 0c*2 + 3. Is a(4) prime? True Let b(v) = -142v3 - v2. Is b(-1) prime? False Let b(s) = 7s3 - 6s*2 - 9s + 11. Is b(5) a composite number? False Suppose 5 = 3l - 1. Let f = -5 - l. Let c = f + 17. Is c prime? False Let o(r) = -337r*3 - r - 1. Is o(-1) a composite number? False Suppose 2r - 3h - 639 = -59, 0 = -4r - 5h + 1182. Is r composite? False Let p(h) = h3 - 8h*2 + 8h - 4. Let j be p(7). Suppose -jy - 15 = -4m + 10, 19 = 4m - y. Is m prime? False Let q(h) = -h2 - h + 4. Let t be q(0). Suppose 3l + 5 = 4c, tc - 5l = c + 1. Suppose 2a = 2y + 114 + 26, -ca = 3y - 125. Is a composite? False Suppose 0 = 4i - 3b - 25, -b - 2 = i + b. Suppose -5q - 178 = -k, -5k - iq + 618 = -185. Is k a composite number? False Suppose -77 = 6c - 449. Is c a composite number? True Let b(k) = -7k + 1049. Let d(c) = 8c - 1050. Let z(j) = 7b(j) + 6d(j). Is z(0) a prime number? False Suppose -s + 5a + 6 - 23 = 0, s + a + 17 = 0. Let r = 24 + s. Is r composite? False Suppose 0 = -31d + 29d + 178. Is d a prime number? True Suppose -o = -0o - 8. Suppose 12w = ow + 212. Is w prime? True Let n(i) = 9i*2 - 3i + 27. Is n(8) composite? True Let i(n) = -11n3 + n. Let u(m) = -m2 - 5m - 5. Let j be u(-4). Let y be i(j). Suppose -2a = -a - y. Is a composite? True Let h = 421 - 294. Is h a composite number? False Suppose 4z - 9 - 7 = 0. Let p be (-3)/(-12) + 2/(-8). Suppose -zw + 5o + 91 = 0, po = -4w - o + 73.	{ "pile_set_name": "DM Mathematics" }
'th term of -12268, -24528, -36772, -49000, -61212, -73408, -85588? 8s2 - 12284s + 8 What is the x'th term of -526, -5333, -18954, -45979, -90998? -765x3 + 183x*2 - x + 57 What is the v'th term of 3550436, 3550401, 3550366, 3550331, 3550296, 3550261? -35v + 3550471 What is the x'th term of 1902583, 1902577, 1902571? -6x + 1902589 What is the x'th term of -8481, -8478, -8475? 3x - 8484 What is the l'th term of 358825, 359020, 359215, 359410? 195l + 358630 What is the o'th term of -14344, -57311, -128910, -229141? -14316o*2 - 19o - 9 What is the n'th term of 3038, 12091, 27158, 48221, 75262? -3n3 + 3025n*2 - n + 17 What is the o'th term of -949, -3947, -8969, -15997, -25013, -35999, -48937? 3o*3 - 1030o*2 + 71o + 7 What is the x'th term of -323589, -1294405, -2912431, -5177667, -8090113? -323605x2 - x + 17 What is the v'th term of 719, 986, 1747, 3242, 5711, 9394, 14531? 40v*3 + 7v*2 - 34v + 706 What is the j'th term of -1675607, -1675595, -1675585, -1675577, -1675571? -j*2 + 15j - 1675621 What is the a'th term of -3391, -7094, -10777, -14440, -18083? 10a2 - 3733a + 332 What is the i'th term of -768, -728, -702, -678, -644? 2i3 - 19i*2 + 83i - 834 What is the j'th term of 96500, 772034, 2605618, 6176276, 12063032? 96504j3 + j2 + 3j - 8 What is the l'th term of 83802, 167638, 251482, 335334, 419194, 503062? 4l2 + 83824l - 26 What is the v'th term of 5974, 25822, 59538, 107122, 168574, 243894? 6934v2 - 954v - 6 What is the p'th term of 1015886, 4063606, 9143140, 16254488? 1015907p2 - p - 20 What is the r'th term of -395099, -395115, -395131, -395147, -395163, -395179? -16r - 395083 What is the i'th term of -25847, -25492, -25139, -24788, -24439, -24092? -i*2 + 358i - 26204 What is the c'th term of -3893, -12421, -20945, -29465, -37981? 2c2 - 8534c + 4639 What is the o'th term of -386501, -386480, -386459, -386438, -386417, -386396? 21o - 386522 What is the c'th term of -9476384, -18952765, -28429146, -37905527? -9476381c - 3 What is the p'th term of 3664, 3512, 3368, 3232, 3104? 4p2 - 164p + 3824 What is the d'th term of 3311, 6631, 9939, 13229, 16495? -d*3 + 3327d - 15 What is the z'th term of 1016174, 4064695, 9145562, 16258775, 25404334, 36582239? 1016173z2 + 2z - 1 What is the v'th term of 26171, 104493, 235031, 417785? 26108v2 - 2v + 65 What is the p'th term of 4706006, 18824007, 42354006, 75296003, 117649998, 169415991, 230593982? 4705999p2 + 4p + 3 What is the l'th term of 6646, 190, -10570, -25634, -45002, -68674? -2152l2 + 8798 What is the g'th term of -528050932, -1056101865, -1584152798, -2112203731? -528050933g + 1 What is the l'th term of 481, 2153, 4917, 8773, 13721, 19761? 546l2 + 34l - 99 What is the d'th term of 325373, 650752, 976133, 1301516, 1626901? d*2 + 325376d - 4 What is the q'th term of -2135178, -2135195, -2135212? -17q - 2135161 What is the h'th term of 8013024, 16026048, 24039072? 8013024h What is the b'th term of -8615, -8652, -8717, -8810, -8931, -9080? -14b2 + 5b - 8606 What is the q'th term of 3376, 9251, 19024, 32701, 50288, 71791, 97216, 126569? q*3 + 1943q*2 + 39q + 1393 What is the t'th term of -739, -2247, -4761, -8281, -12807, -18339? -503t2 + t - 237 What is the y'th term of -126987, -126942, -126897, -126852, -126807, -126762? 45y - 127032 What is the s'th term of -107774579, -215549156, -323323733, -431098310, -538872887, -646647464? -107774577s - 2 What is the q'th term of -7688, -8973, -10258, -11543? -1285q - 6403 What is the w'th term of 2873541, 5746924, 8620307, 11493690, 14367073? 2873383w + 158 What is the u'th term of 3670, 13682, 30044, 52750, 81794? -u3 + 3181u*2 + 476u + 14 What is the l'th term of 1147, 214, -689, -1562, -2405? 15l2 - 978l + 2110 What is the t'th term of -237758, -237771, -237784? -13t - 237745 What is the v'th term of -26278, -50595, -72950, -93337, -111750, -128183, -142630? v3 + 975v*2 - 27249v - 5 What is the b'th term of 467909, 467912, 467929, 467966, 468029? b3 + b2 - 7b + 467914 What is the s'th term of -3077, -3848, -4619, -5390? -771s - 2306 What is the j'th term of 28603, 35788, 42969, 50146? -2j2 + 7191j + 21414 What is the d'th term of -4884, -10877, -16884, -22911, -28964, -35049? -d3 - d2 - 5983d + 1101 What is the t'th term of -96160, -97647, -99134? -1487t - 94673 What is the w'th term of -6759, -26959, -60617, -107727, -168283, -242279, -329709? w*3 - 6735w*2 - 2w - 23 What is the u'th term of -298718, -1194477, -2687408, -4777511? -298586u2 - u - 131 What is the l'th term of -10032, -10117, -10190, -10251? 6l*2 - 103l - 9935 What is the y'th term of -579934, -1160112, -1740290, -2320468, -2900646, -3480824? -580178y + 244 What is the d'th term of 159235, 317877, 476519, 635161, 793803? 158642d + 593 What is the y'th term of -196, -323, -508, -751, -1052, -1411? -29y2 - 40y - 127 What is the s'th term of -9926949, -19853898, -29780847, -39707796, -49634745? -9926949s What is the d'th term of -12725133, -12725132, -12725131, -12725130? d - 12725134 What is the h'th term of 197, 847, 1679, 2489, 3073, 3227, 2747? -34h*3 + 295h*2 + 3h - 67 What is the p'th term of -54147, -54045, -53883, -53667, -53403? -p*3 + 36p*2 + p - 54183 What is the h'th term of -97812, -391252, -880288, -1564896, -2445052, -3520732? 4h*3 - 97822h*2 - 2h + 8 What is the h'th term of -1455971, -5823859, -13103663, -23295377, -36398995, -52414511, -71341919, -93181213? h*3 - 1455964h*2 - 3h - 5 What is the k'th term of 6656, 53098, 179178, 424724, 829564, 1433526, 2276438? 6638k3 - 9k*2 + 3k + 24 What is the t'th term of 2275, 4595, 6945, 9325, 11735, 14175? 15t2 + 2275t - 15 What is the v'th term of -16550, -16539, -16498, -16403, -16230, -15955? 4v3 - 9v*2 + 10v - 16555 What is the h'th term of -436199, -872391, -1308577, -1744757? 3h2 - 436201h - 1 What is the l'th term of 1010, 12404, 34198, 66398, 109010? l*3 + 5194l*2 - 4195l + 10 What is the g'th term of 14606934, 58427721, 131462364, 233710863, 365173218, 525849429, 715739496? 14606928g2 + 3g + 3 What is the l'th term of 906770, 906760, 906750, 906740, 906730, 906720? -10l + 906780 What is the u'th term of 30368, 121470, 273304, 485870, 759168, 1093198? 30366u*2 + 4u - 2 What is the h'th term of 15003, 30323, 45641, 60957? -h*2 + 15323h - 319 What is the b'th term of 5716, 11594, 21392, 35110? 1960b2 - 2b + 3758 What is the i'th term of 19844, 19885, 19926, 19967, 20008, 20049? 41i + 19803 What is the a'th term of 1840, 1856, 2018, 2398, 3068, 4100? 12a3 + a2 - 71a + 1898 What is the c'th term of 68017, 544063, 1836189, 4352437, 8500849? 68007c*3 - 2c*2 + 3c + 9 What is the x'th term of 1200874, 2401755, 3602636, 4803517? 1200881x - 7 What is the s'th term of 43342, 173174, 389566, 692518, 1082030, 1558102, 2120734? 43280s*2 - 8s + 70 What is the v'th term of -1747843, -1747832, -1747809, -1747768, -1747703, -1747608? v*3 + 4v - 1747848 What is the k'th term of -122978, -122945, -122912, -122879? 33k - 123011 What is the l'th term of 1266543, 2533115, 3799685, 5066253, 6332819, 7599383? -l2 + 1266575l - 31 What is the l'th term of 13173, 33700, 54227, 74754, 95281? 20527l - 7354 What is the b'th term of 813, 6468, 21919, 52116, 102009? 825b*3 - 52b*2 + 36b + 4 What is the j'th term of -9589803, -9589805, -9589807? -2j - 9589801 What is the v'th term of 157540, 314961, 472260, 629437? -61v*2 + 157604v - 3 What is the w'th term of -86474, -173187, -259898, -346607, -433314, -520019, -606722? w*2 - 86716w + 241 What is the f'th term of 429, 2764, 6691, 12210, 19321? 796f2 - 53f - 314 What is the a'th term of 1553515, 3107284, 4661053, 6214822? 1553769a - 254 What is the f'th term of -2277, -4654, -7031, -9408? -2377f + 100 What is the z'th term of -96, -1179, -3292, -6441, -10632, -15871? -z*3 - 509z*2 + 451z - 37 What is the s'th term of -129639841, -259279691, -388919541, -518559391, -648199241, -777839091? -129639850s + 9 What is the s'th term of 44853, 89695, 134531, 179361, 224185? -3s*2 + 44851s + 5 What is the c'th term of 5603, 4868, 4133, 3398? -735*c + 6338	{ "pile_set_name": "DM Mathematics" }
s + 7 for s. 2 Let g be 21/(-6)((-144)/(-21))/(-4). Suppose k + 220 = gk. Suppose k = 5l - 16. Solve 0 = 5m - h - 18, 0 = 2m + h + h - l for m. 4 Suppose 0 = 10h - 37 - 13. Suppose 5 - 50 = ha. Let g(t) = t3 + 10t*2 + 8t - 4. Let b be g(a). Solve 4u = -4f + 28, -5f = u - 14 - b for f. 3 Let o be (-2)/(-5) - (-13)/5. Let a(w) = 2w*2 - 66w - 70. Let q be a(34). Let c be (q + 2)/(4(-15)/20). Solve -b + 11 = -os, cs + 4b - 9 = 5s for s. -5 Let y = 1216 - 1201. Solve l + y = 4q, 0 = 40l - 43l - 2q - 3 for l. -3 Let z be 16/(-2) - (-173 - -165). Suppose 4u - 12 = 4. Solve -5b = 3t + 15, z = 2b + t + 1 + u for b. 0 Let j = 7277 + -7275. Solve -t - 10 = -jw, -48w + 45w = 4t - 37 for w. 7 Suppose 0 - 3 = -l + 2. Solve -ld = -2y + 12, 31 = -5y + 3d + 23 for y. -4 Let x = 522 - 955. Let n = x + 436. Solve -nb = 5s + 3, 0 = 3s - b - 2 + 1 for s. 0 Let a be ((-60)/(-36))/(-5)(-28 + 1). Suppose -z + 3k = -11, -3k + 0k = a. Solve g - 2 = -5o - 19, zo + 5 = -g for g. 3 Let l = 2089 - 2072. Solve -16 = 4m, -lm - 13 = -n - 13m for n. -3 Let d be 27/5 - 2/((-55)/(-11) - 0). Solve -9 + 15 = 3z - 3p, 3z - 14 = -dp for z. 3 Let f = 15917 - 15912. Solve -fd = -4n + 63 - 68, -16 = 5n - 3d for n. -5 Suppose 63k - 6 = 62k. Let b be k(-6 - -5) + 10. Solve -bg + 7 = -3m, m - 2 = 3m for g. 1 Suppose -4m + 212 = 5j - 271, 0 = 3j + 3. Suppose -134g + mg = -60. Let h be (-1 + -1)/2 - -9. Solve w + h = -2k - 3, -gw - 10 = -5k for k. -3 Let q be (0 - 0) + -3 + 5. Suppose qf = -7f + 18. Solve -6 = -fk + x, 4k - 2x = -3x + 24 for k. 5 Let f be 3/(-21) + 144/126. Let y(a) = -42a + 43. Let i be y(f). Solve 0 = d + 3k - 2k + 1, -d - 5k = i for d. -1 Suppose 0 = -12n - 25 + 49. Let d(y) = -6y - 1. Let c be d(-1). Solve nv - 10 = -2a - v, 2a = -cv + 18 for a. -1 Let i = -3 - -30. Let h = -21 + i. Suppose 0 = -z - 3v + 2, -4z + h = v - 2. Solve 5c = -zo - 19, -4o - 2c - 2c - 20 = 0 for o. -2 Let c(a) = -a*2 + 6a + 179. Let m be c(16). Solve -3o + 2j = 5, -3o - 2j - 3j - m = 0 for o. -3 Let m(i) = 971i*2 + 62 - 970i*2 + 23i + 0. Let a be m(-20). Solve an - 1 = -5j, 0 = 3j + n + 5 - 6 for j. 1 Let y be (-22)/6 + 4/6. Let t(j) = -2j - 1349 - 3j2 + 2j*2 - 2j + 673 + 673. Let h be t(y). Solve -5l = -4z - 7, -l + 9 = 3z - h for z. 2 Suppose -6450 = 522b + 523b - 1060b. Solve p + bu - 11 = 432u, 3p = -u + 5 for p. 3 Suppose 0 = -3h + 3w, -2h = -6h + 2w. Suppose hu - p + 8 = 3u, 4u - 17 = 5p. Solve -4 = a - s, -4 = -5a - 0s - us for a. -1 Let s be -15(-10)/25 + (-3 - 0 - -3). Solve -m - s = -z, -3z + 38 - 25 = 2m for z. 5 Let q(t) = -t*2 + 21t - 43. Let z be q(5). Suppose 3s - 24 = -4n, 2n - 13 + z = 3s. Solve -2v + 2i = 4i + s, -5i = 3v + 18 for v. -1 Suppose -3y = -3h + 15, 77h - 80h - 5y = -15. Suppose 0 = -5t - 0t. Solve -l + r + 8 = t, r - 12 = l + hr for l. 4 Suppose 3g + 2z = 3z + 284, 0 = 2g + 2z - 192. Let m = g + -87. Solve s - 5 = -2p + p, -s + m = 4p for s. 4 Let j = -134 + 119. Let t be (6/(-30))/(1/j). Solve 3 = 3w, 3d + 13 - 1 = tw for d. -3 Let f = -14991 + 15061. Solve -3r + 4v = -11, 73r + 24 = fr - 3v for r. -3 Let n(m) = -m*3 + 49m*2 + 157m - 62. Let o be n(52). Let l be (-1)/(-10) - (-2684)/(-440) - o. Solve 5c + 25 = -d, -3c + c = ld + 28 for d. -5 Let u be 5/((2 + -7)/5). Let y be 2/(u/(-75)6). Let g be (-4)/(-12) - (-208)/6. Solve -5v + z + g = yz, -4v + 17 = z for v. 3 Let s be ((-278)/(-6))/((-8)/(-6) - 1). Suppose 137j + 6 = sj. Solve -7q + jq - w = -13, w = 5q - 23 for q. 4 Suppose -12791f + 12799f - 48 = 0. Solve 2i = 2v + 2, fi = 9i + 5v - 3 for i. 1 Let s be -17 - (2 + (-40)/4) - -13. Solve -2o = 4, -so - 14 = -4l + 10 for l. 4 Let u = 43 - 71. Let x = u + 30. Suppose 24 - 17 = 3v - d, 2d - 6 = v. Solve 0 = 3o, vo - x + 18 = 4w for w. 4 Suppose 6 = -4d + 3x, -3d + x - 4 = -x. Suppose d = 5g + 5, -2i + g + 11 = 0. Solve 4y = ip, 5y - 45 = -7p + 2p for p. 4 Suppose -14q - 5r = -19q, q - 18 = -5r. Let b(j) = 3j + 2. Let f be b(4). Let s = f - 9. Solve 3z + 20 = -sk, 3k + 6 + 12 = -qz for k. -1 Suppose 519w - 262 = 408w + 848. Suppose 5t + 0t = 15. Solve -w = -5j, tu - 2u = -j + 1 for u. -1 Suppose 0 = u + 3, -3u + 4 = 5y - 2. Solve -2f + 9 = -k - 3f, -yf = 12 for k. -5 Let y(q) = -q*3 + 15q*2 + q - 13. Let n be ((-216)/32 - -3)-41. Let a be y(n). Solve ad + 7p - 2p = 21, -4d + 4p = 0 for d. 3 Let w = -378 - -384. Suppose -ws + 42 = 8s. Solve -si - 5 = -0i + o, -1 = i + o for i. -2 Let v = -56 - -444. Let k = -383 + v. Solve y = -u - y + 1, -ku - 5y - 10 = 0 for u. -5 Let n(g) = 2g2 + 2g. Let c be n(-2). Suppose 0q + 52 = cq. Solve 4l + 4a - 28 = 0, -4l + 2a + q = a for l. 4 Let h(n) = n*2 - 10n - 9. Let j be h(11). Let o be (2/(-3))/(3j/(-72)). Let m(g) = -3g + 27. Let y be m(o). Solve 1 = -5l + ya, 4l - 4a - 2 = -6 for l. 1 Let r(i) = -i*3 + 5i*2 - 3i - 1. Let d be r(4). Suppose 8g = 2g - 600. Let q = 116 + g. Solve 2y = 6y + 5v + 11, q = -dy + 4v for y. -4 Let y be (-271)/(-271) + ((-58)/(-5) - (-2)/5). Solve 8 - y = -w, -4s - 12 = -4w for s. 2 Let o be (0/1)/(-1 - 12). Suppose -10r - 10 = -15r. Solve ru + 15 = -u + s, o = 3u - 5s + 27 for u. -4 Suppose -3x + 5f + 11 = -18, -3 = 3f. Solve -40 = -xd + 4d - 5c, 0 = 2d + 4c - 26 for d. 5 Let w(z) = -z - 38. Let d be w(-14). Let q = d - -29. Suppose qy - 43 = 17. Solve 3r = -3x, 2r = x - r + y for x. -3 Suppose -4y + 5d + 3 = 0, 0d + 11 = 4y + 3d. Suppose -3i = -i + y. Let r(w) = w + 4. Let m be r(i). Solve 4q - 16 = -3l, 2q = mq - 3l - 4 for q. 4 Let g(p) = p2 + 112p - 1217. Let v be g(-122). Solve -23 = 15t - 11t - m, m + 12 = -vt for t. -5 Let q(a) = 3a*2 + 2a. Let h be q(2). Suppose 0 = hi - 21i + 90. Suppose 16m - im = -8. Solve 3c - 20 = -mr, -r = 2c + 2c - 18 for r. 2 Suppose 57f - 37f - 100 = 0. Let y be (f + -6)(1 - 0)-5. Solve -4o - 16 = -4j, j = yo - 0o for j. 5 Let z(d) = -d - 1. Let g be z(-3). Let r = 54 + -122. Let o be 3/((-12)/r) - -1. Solve 5i - o = -f + g, -8 = -2i - f for i. 4 Let m = -510 - -540. Let u be 2/12 + -10 + 295/m. Solve 3i - q - 14 = u, 5i - 26 = -0i - q for i. 5 Let w be 3/(-2)(16/24 + -4). Solve 3t - n - 7 = 0, 4t + 3n = -0t + w for t. 2 Suppose -8c + 9 + 17 = 2. Solve o - cq = 8, -q - 13 = o - 5 for o. -4 Let q = -535 - -539. Suppose 24z - qz = 0. Solve z = -5r, s + 5r = -2s + 15 for s. 5 Suppose -169z + 35z = -670. Solve -zi - 4s - 32 = 0, 4s + 32 = -36i + 32i for i. 0 Let v be (-414)/(-184)8/6. Solve y - v = 0, 5u - 7y + 6y + 18 = 0 for u. -3 Suppose -3v - 5r = -27, -4v + 22 = 22r - 20r. Solve y = 3t - 9, -1 = y - v for t. 4 Let b = 13 - 26. Let j = b - -25. Suppose -5c + 9c = 20. Solve -4z - j = -3y - 39, 5 = -cz - 4y for z. 3 Suppose 0 = -360k - 73k + 1732. Solve -z = -0p - 3p - k, -3p + 2z - 8 = 0 for p. 0 Let b = -229 + 233. Let l = -13 + 23. Let g be 3/1 + l + 3. Solve 4f = -2t - 24, -3t + g = -bf - t for f. -5 Let a be (18 - 901/51)21. Solve -20 = 5j - 3r, aj = 2j - 4r - 20 for j. -4 Suppose -18 = 3r - 6, 4r = 5i + 1719. Let v = i + 350. Solve -3o = -vf + 1 - 10, 0 = -2o for f. -3 Suppose f - 10 = -6. Suppose z + 0z = f. Let p be 9 - 7/2828. Solve -i + 3d = 2i - 9, -pi - zd + 6 = 0 for i. 3 Let b = 119 - 117. Suppose -4i = z + 5, -5z + bi + 11 = 4i. Solve -6l + zl + 20 = 2v, 0 = -2v + 8 for l. 4 Let k be 42/(-15)1900/(-266). Solve 4j + 2v = 24, -2j = 18v - 13v - k for j. 5 Suppose -21 - 5 = -26o. Solve 1 = -3t + d - 10, 0 = -t - d - o for t. -3 Let b = 846 + -844. Suppose 0 = 2n - 5w + 2w - 10, -5n = 4w - 2. Let h = n - -2. Solve 2k = bu - u + h, -25 = -5k - 5u for k. 3 Let c = 6 - 3. Suppose -161 = -4l - 3o - 34, 0 = -l + co + 13. Suppose -7h + l = -14. Solve 3i - 4k = 1, h = -2i + 2k + 4 for i. -5 Let s(u) = 3u - 16. Suppose 30 = 5p - 0p. Let l be s(p). Let q be (6 + -9)/(3 + (-72)/20). Solve 5f - qx + 30 = -lx, -4x + 29 = -3f for f. -3 Suppose -361x + 969 + 411 = -85x. Solve 5r + 0f - 35 = xf, 0 = -3r - 4f + 7 for r. 5 Le	{ "pile_set_name": "DM Mathematics" }
+ 7d2 + 5d - 3. What is the units digit of f(j)? 3 Let t = 39 - 87. Let w = -26 - t. What is the tens digit of w? 2 Let n = -36 + 51. What is the units digit of n? 5 Suppose 2t = -26 - 2. Let d = -8 - t. What is the units digit of (-9)/d(-1 + -1)? 3 Let c = -11 + 16. Let h(a) = a*3 - 5a*2 + 4. What is the units digit of h(c)? 4 Let r = -1 + 4. Suppose -m - ra + 10 = -2a, -a = -2m + 14. What is the units digit of (-2)/(6/m - 1)? 8 What is the tens digit of (-5 - 2856/(-10)) + (-2)/(-5)? 8 Suppose 13c = 11c + 702. What is the tens digit of c? 5 Suppose 3r + 6 + 7 = 2a, -a = 4r - 1. Let l(o) = 2o*2 - 4o + 1. What is the units digit of l(a)? 1 Let v be (-11 - -13) + (-1 - -3). Let u = 0 - -2. What is the units digit of ((-2)/(-4))/(u/v)? 1 Let s(m) = -4m2 - 4m - 5. Let u(r) = -r*2 + r + 1. Let q(x) = -s(x) + 3u(x). Let w(l) = l2 + l - 6. Let c be w(0). What is the units digit of q(c)? 2 Let n(v) = v2 - 2v - 7. Let r be n(-5). Suppose 3z = -z + r. What is the units digit of z? 7 Let o = 199 + -108. What is the tens digit of o? 9 Suppose -c + 5j + 12 = 0, 0 = 2c - 4c - 3j - 2. Suppose 5t + 50 = -4g, 3t - 13 = t + 5g. What is the units digit of 8/3 - c/t? 3 Let d(i) = -i*2 + 9i. Let l be d(10). Let g be l/(3/6-1). Suppose 0o - 2o = -g. What is the units digit of o? 0 Let z be 2/(-4)-10 + -3. Suppose -v - q = z + 3, v + 4q - 1 = 0. Let f = -5 - v. What is the units digit of f? 2 Let n be 6(-5)/((-30)/4). Let w = n + 1. What is the units digit of w? 5 Let v(c) = c*3 - 10c*2 + 8c + 4. Let l be v(9). Let r = -3 - l. Suppose 0 = -4b + rn + 32, -4b + 4n + 21 = -7. What is the units digit of b? 9 Let i(a) be the third derivative of a6/120 + a5/10 - a*4/24 + 5a*3/6 + 2a*2. What is the units digit of i(-6)? 1 Let r(k) = 3k3 + k2 + 2k - 7. What is the units digit of r(2)? 5 Let l = 8 - 35. What is the units digit of (l/(-12) + -2)52? 3 Let s be 4/10 + (-66)/15. Let d = s - -5. What is the units digit of d? 1 What is the tens digit of 2/(-3) + 226/6? 3 Suppose 4i - 3 = 9. Suppose 0 = 2o - 7o + 30. Let s = o - i. What is the units digit of s? 3 Let y(l) = -l2 - 8l - 7. Let m be 20/4(-6)/5. What is the units digit of y(m)? 5 Let g = -21 + 35. Let h be -9(2 + -2 + -1). Let j = g - h. What is the units digit of j? 5 Let p be 3/6(-2)/(-1). Suppose -q + 2 = p. What is the units digit of q? 1 Suppose 0 = 2y + 1 + 3. Let s be (-1)/y(4 + -4). What is the units digit of 0 + 0 + s - -1? 1 Suppose -24p + 3216 = -8p. What is the tens digit of p? 0 Let l = 49 + -31. What is the tens digit of l? 1 Suppose f - 3f + 10 = 0. Suppose -5i + 150 = fx, -49 = -2i + 5x + 25. What is the tens digit of i? 3 Let g = -4 - -4. Let x be (-1 + g - -7) + 1. Suppose -8 = -xp + 3p - d, 5p - 10 = -4d. What is the units digit of p? 2 Suppose -j - 3p - 36 = 0, -4j - 4p - 144 = -p. Let k = 72 + j. What is the tens digit of k? 3 Let a be 1/22 + 4. Suppose -2y - 123 = -ay. What is the tens digit of y? 4 Let f(d) = d*3 - 6d*2 + 3d + 2. Let u(q) = 2q3 - 12q*2 + 7q + 3. Let i(c) = -5f(c) + 2u(c). What is the units digit of i(5)? 6 Suppose -5x + i + 286 = 0, -5i = x - i - 53. What is the tens digit of x? 5 Let x(i) = i*3 - 9i*2 + 12i - 27. What is the units digit of x(11)? 7 Let t be 4/14 - (-1005)/35. Let o = t + -13. What is the tens digit of o? 1 Let a(p) = -3p2 + 6p - 4. Let f(m) = -7m2 + 13m - 7. Let z(n) = -5a(n) + 2f(n). What is the tens digit of z(5)? 1 Suppose 3k - 60 = -3q - 2k, 3k + 51 = 4q. What is the tens digit of q? 1 Let k = -9 - -13. What is the units digit of k? 4 Let a be 2/5 + 6/(-15). Suppose a = -5d - 0d. Suppose 0 = -dp - 5p + 4j + 23, 0 = -p - 4j + 19. What is the units digit of p? 7 Suppose i + 5z = 27, -5i + 4z - 15 = -z. Let b(y) = 1 + iy + y2 + 0y*2 - y - 2y*3. What is the units digit of b(-1)? 3 Suppose -3o - 3 = -d - 0o, d = -4o + 17. What is the units digit of d? 9 Let r(z) = -34z - 5. What is the tens digit of r(-2)? 6 Let s be -2 - (-4 - 6/(-3)). Suppose s = y + 6 - 29. Suppose -4q + 33 = -4z - y, -5z - 25 = 0. What is the units digit of q? 9 Let s = -25 - -43. Suppose h - s = -h. What is the units digit of h? 9 Let r be (4 - 2) + (-12)/(-4). Suppose r = 5b, 3c - 5c = -4b - 52. What is the units digit of c? 8 Let f(g) = -g*3 - 11g*2 - g + 3. Suppose 5k = -9 - 46. What is the units digit of f(k)? 4 Let h(c) be the second derivative of -c*4/12 + 3c*3/2 - 3c*2 - 2c. Let x be -22/(-1)2. What is the units digit of h(x)? 2 Let s(f) = -4f - 1. Let z be s(-1). Let d(j) = 2j*2 - 6j + 1. Let n be d(4). What is the tens digit of 111/n + 2/z? 1 Suppose z - 4d - 151 = 0, -3z + 5z = -4d + 290. Suppose 0 = 2b + 49 - z. What is the units digit of b? 9 Suppose 5k = 2i + 218, -3k = -2i + 3i - 133. Suppose n + k = 3n. What is the tens digit of n? 2 Let p(n) = n + 2. What is the units digit of p(5)? 7 Suppose -638 = -2p - 124. What is the tens digit of p? 5 Let a = -11 + 13. What is the units digit of a(-14)/(-4)1? 7 Suppose 0f - 4f + 84 = 4d, 3f - 4d = 77. Let g = f + -18. What is the units digit of g? 5 Let k be 4-42/(-4). Suppose 0 = 2f - 6f - k. What is the units digit of (-9)/(-2)(-4)/f? 9 Suppose h + 2 = -0h + r, -h - 2r - 11 = 0. Let t = 10 + h. What is the units digit of t? 5 Let q(f) = f*2 + 2f + 2. Let s be q(-2). Suppose 3r + 7 = h, 6h = sh + r + 83. What is the tens digit of h? 2 Let s(l) = 2l - 3. Let o(h) = 5h - 6. Let r(g) = -6o(g) + 14s(g). Let n be (1 - 3)/(-2) - 7. What is the units digit of r(n)? 6 Suppose -3k = -5l - 3, -2 = 4k + 5l - 6. What is the tens digit of (1 - 2)/(k/(-11))? 1 Let c = 10 + -6. Let a be (-6)/c2/(-3). Let x(u) = 8u. What is the units digit of x(a)? 8 Suppose 3i - 40 = -i - 4u, 5u - 20 = i. Suppose -110 = -2p + 4b, -b + 278 = ip + 47. What is the tens digit of p? 4 Let g(c) be the third derivative of -c6/120 + c5/60 - c4/24 + 5c*3/3 - 2c*2. Let o be 1/(-4) - (-4)/16. What is the tens digit of g(o)? 1 Suppose -2p - 2p - r - 9 = 0, 0 = -3p - 3r. What is the units digit of (-1)/(-3)(36 + p)? 1 Let g(s) = -s + 11. What is the tens digit of g(-10)? 2 Let r(j) = 3j2 - 2j - 13. What is the units digit of r(-5)? 2 Let j be (-2)/(-4)4 + 0. Suppose -k = -x - 8 - 3, 2k + jx - 2 = 0. Suppose -kq = a - 3q - 19, -4q + 22 = a. What is the tens digit of a? 1 Let m = 3 - 0. Suppose -f - md + 7 + 1 = 0, 0 = f - 3d + 4. Suppose p = -2t - t + 8, -fp = -10. What is the units digit of t? 1 Let u be (-2)/(5/((-45)/6)). Suppose -l - 27 = -5v, uv + 5 + 10 = -2l. What is the units digit of 2/6 - 8/l? 1 Suppose 5t - 14 - 6 = 0. Suppose -3c - 44 = -3n + 1, -tc = -2n + 38. What is the units digit of n? 1 Suppose 0 = 4t - 540 - 136. What is the units digit of t? 9 Suppose -4n - 26 - 12 = 2a, -2n = -3a - 57. Let q = -32 + a. What is the units digit of (-3)/15 + q/(-5)? 0 Let o(a) = -a3 + 4a*2 + 5a + 7. Let q(r) = -r*3 + 5r*2 - 2r - 3. Let f be q(4). What is the units digit of o(f)? 7 Let p = -92 + 60. Let s = p - -59. What is the tens digit of s? 2 Suppose -o + 4o = -3. Let q be 3/((-7)/2 - -2). What is the tens digit of (8 - q) + 0/o? 1 Let h(t) = t3 - 4t*2 - 5t. Let g be h(5). Let k(b) = -b + 2. Let j be k(g). Suppose 4o + j = 22. What is the units digit of o? 5 Let v be (-26)/(-6) + (-4)/12. Suppose 0 = -vd - 34 + 126. What is the units digit of d? 3 Let t be ((-6)/9)/((-2)/6). Suppose tn = n + 13. What is the tens digit of n? 1 Let j(o) = -o3 + 2o*2 + 2o + 3. Let n be j(3). Suppose u + 3u - 8 = n. Suppose 0 = -ub - 10, -2t + 2b = -38. What is the tens digit of t? 1 Let i(l) = 103l3 - l2 - 2l + 3. What is the hundreds digit of i(1)? 1 Suppose 2c - 181 = -3d, c + 0c - 4d - 85 = 0. What is the tens digit of c? 8 Let u(i) = -i - 5. Let o(n) = 4. Let s(a) = 5o(a) + 4u(a). Let w be s(-1). What is the units digit of (w/(-8))/((-2)/8)? 2 Let z(b) = 2b2 - 3b + 8. What is the units digit of z(6)? 2 Let v(z) be the third derivative of z4/12 - z3 - 2z*2. Let s be (32/(-12))/(4/(-6)). What is the units digit of v(s)? 2 What is the units digit of 1/(-3) + (-68)/(-6)? 1 Let v(z)	{ "pile_set_name": "DM Mathematics" }
40f + 6. Let l(d) = 3k(d) + 8m(d). Find the second derivative of l(p) wrt p. 2700p + 2 Find the first derivative of 753u4 - 2845344u*2 + 2845344u*2 - 2u*3 + 2709 wrt u. 3012u*3 - 6u*2 Let i(s) be the third derivative of -13s*8/168 - 4s*7/105 - 53s*5/5 + 45s*2 - 13. What is the third derivative of i(l) wrt l? -1560l*2 - 192l Let z(i) be the first derivative of -2i6/3 - 3i5/5 + i3 - i*2/2 - 2746i + 4691. Find the second derivative of z(u) wrt u. -80u3 - 36u*2 + 6 Suppose -3p = 2p + 2i - 16, -28 = -5p + 4i. Let r(x) = -2x2 + 15x - 8. Let f be r(p). Differentiate 3u + f - 4u - 27u with respect to u. -28 Let j(m) be the first derivative of 760m*3/3 + 1151m + 1036. Find the first derivative of j(g) wrt g. 1520g What is the derivative of -928 - 95g + 15g - 61g + 11g - 36 wrt g? -130 Let a = 1 - -1. Let h = -698 + 1992. Find the third derivative of 1294m - 19ma - 11m*5 - hm wrt m. -660m2 Let c(h) be the first derivative of -h6/6 - 1095h*4/4 - 551h3/3 - h2/2 + 3h + 10443. Find the third derivative of c(w) wrt w. -60w*2 - 6570 What is the third derivative of -293g*4 + 3293g*2 - 9004g*6 - 85g*2 + 8752g*2 + 293g*4 wrt g? -1080480g*3 Let k(c) = 3c - 13. Let m be k(5). What is the third derivative of 20 + 95262p - 95262p - 185p3 - 2p*m wrt p? -1110 Let z(u) be the second derivative of -1388u*6/5 - 19u*4/12 - 28u*3/3 - 149u - 11. Find the third derivative of z(g) wrt g. -199872g Suppose -352 - 412 = -5o - 2k, -448 = -3o + 4k. What is the derivative of -60c*3 - 3 - 152c + oc + 0 wrt c? -180c*2 Let y be -11(-5 + (-424)/(-88)). Find the third derivative of 0b3 - b3 + 9b2 - b2 + 116b5 - 6 + 6b*2 - 2b*y wrt b. 6960b*2 - 6 What is the third derivative of 2 - 299g*6 - 3g*3 + 4406499g*4 + 4882g*2 - 4406499g*4 wrt g? -35880g*3 - 18 Let f(m) = -2589m*3 - 12m*2 - 18m + 15088. Let x(s) = 2583s3 + 14s*2 + 21s - 15089. Let v(r) = 7f(r) + 6x(r). What is the derivative of v(o) wrt o? -7875o2 Let o(a) = 22a3 + a2 + a - 1. Let l(b) = 999b3 - 6b*2 - 6b + 1627. Let i(r) = l(r) + 6o(r). Differentiate i(x) with respect to x. 3393x*2 Differentiate -2392 + 34z - 30z - 783 - 58z - 99z with respect to z. -153 Let c(k) be the second derivative of -k5 + 0 + 0k*4 + 0k*3 + 43/2k*2 + 24k. What is the first derivative of c(g) wrt g? -60g2 What is the third derivative of -20n3 - n3 + 264n4 - 6n*3 - 491n*2 - 267n*4 wrt n? -72n - 162 Let u(l) be the first derivative of 53l5/120 - 35l*4/24 + 8l*3 + 49. Let p(w) be the third derivative of u(w). What is the derivative of p(n) wrt n? 53 Let g(l) be the third derivative of 0l*4 + 86/3l*3 - 78l*2 - l + 0 + 23/15l*5. Differentiate g(v) with respect to v. 184v Let n(v) = 9621v + 6452. Let h(j) = -19242j - 12903. Let l(a) = 2h(a) + 5n(a). Find the first derivative of l(q) wrt q. 9621 Let r(g) be the second derivative of 485g7/21 + 41g*4/2 + 2g - 558. What is the third derivative of r(m) wrt m? 58200m2 Let y(r) be the third derivative of -131r8/1680 - r4/2 - 14r3 - 61r*2. Let z(f) be the first derivative of y(f). What is the derivative of z(m) wrt m? -524m*3 What is the second derivative of -172h*5 + 430h - 252h5 + 226h + 64h5 + 54h*5 wrt h? -6120h*3 Suppose f - 72 + 80 = 0. Let h = -5 - f. Find the first derivative of 2 + 1 + 14k*4 + 46k*3 - 46k*h wrt k. 56k3 What is the third derivative of -a4 - 196a2 - 349a*3 - 3742a*2 + 798a*2 wrt a? -24a - 2094 Suppose -222l + 95 = -217l. What is the derivative of 31o2 + 57o*3 + lo*3 - 272 - 29o*2 wrt o? 228o*2 + 4o Let y(h) = 22h2 - 5h - 284. Let d(p) = 3p2 - p + 5. Let z(q) = -12d(q) + 3y(q). What is the first derivative of z(m) wrt m? 60m - 3 Let z(i) be the first derivative of -78i5/5 + i4/4 - 3177i*2 + 5708. What is the second derivative of z(u) wrt u? -936u*2 + 6u Let x(y) be the third derivative of -7/5y5 - y2 + 0y + 8 + 0y3 + 0y*4 + 13/60y*6. Find the third derivative of x(k) wrt k. 156 Let t be 4 + (7/14 - (-1)/2). What is the third derivative of -9i*5 - 20i*2 + 12i*t + 2 + 10i*5 wrt i? 780i*2 What is the second derivative of -1844f*4 - 1 - 2f*3 + 1844f*4 - 2f*3 + 345f - 48f5 wrt f? -960f*3 - 24f Let d(b) be the first derivative of 586b2 - 875b + 567. What is the derivative of d(k) wrt k? 1172 Differentiate 2306 - z + 491z4 - 3z + 7516 - 4z3 + z wrt z. 1964z*3 - 12z*2 - 3 Let c = 263 - 209. Find the second derivative of 0z - 97z2 + 146z*2 + cz wrt z. 98 Let b(a) be the second derivative of -944a6/15 - 715a*2/2 - 4a + 8. Differentiate b(d) wrt d. -7552d3 Let t(u) be the first derivative of -4175u*4/2 - 11957u + 3032. What is the derivative of t(l) wrt l? -25050l2 Let n be (-1(-2)/(-2))/(5/(-175)). Suppose b = -5y + n, y - 2y = -4b - 7. What is the second derivative of -2i - 4i + 8i*4 + 7i*4 + yi wrt i? 180i2 Let h(u) be the third derivative of 0 + 17/2u*3 + 0u + 2/15u5 + 63u*2 - 1/12u*4. Find the first derivative of h(z) wrt z. 16z - 2 Let c = 815 - 782. Differentiate -74m - 190 - 2m*4 + 26m + cm - 5m*4 with respect to m. -28m*3 - 15 Suppose 0 = -3w - 2w - t + 280, 3w + 2t = 168. What is the second derivative of -2n + 3n + 74n*2 + 73 - w wrt n? 148 Let b(p) be the third derivative of -11063p*5/60 - 2239p*4/12 - 7p*2 + 246p + 3. What is the second derivative of b(h) wrt h? -22126 Suppose 21r - 29r = -240. What is the third derivative of 26p - r - 9p + 81p6 - 17p - 2p2 wrt p? 9720p*3 Let n(g) = -4g*2 + 141g - 5952. Let h(z) = z + 26. Let l(y) = 4h(y) - n(y). Differentiate l(m) with respect to m. 8m - 137 Let c(k) = 5k3 + 3k*2 - 16k*3 + 10k*3 + 6k + 55. Let d(i) = -6i2 - 11i - 109. Let b(y) = 11c(y) + 6d(y). Differentiate b(o) with respect to o. -33o2 - 6o Let f(x) be the second derivative of 17 + 187/2x2 - 239/12x*4 + 0x*3 - 2x. Differentiate f(j) wrt j. -478j Let y = -498 - -501. Let t(d) be the second derivative of -7/12d*4 + 0d*y + 0 + 4d - 4d2. Differentiate t(h) wrt h. -14h Let u(d) = 3d3 - 8d*2 - 3d + 7. Let r be u(7). Differentiate 34f + 72f + r - 41f - 851 + 84f with respect to f. 149 Let r be (51/34)/(6/16). Suppose -rx + 42 = 10. What is the third derivative of -xo4 - o4 + 0o4 - 6o*2 wrt o? -216o What is the third derivative of -5d2 - 41d*4 + 85d*5 + 50 + 41d*4 - 15d*5 wrt d? 4200d*2 Let p = 831 - 707. Find the third derivative of -253v + pv + 10 + 129v - 11v2 - 38v*4 wrt v. -912v Let t(x) = -11x3 - 189x + 100. Let y(h) = -9h3 - 192h + 98. Let v(m) = -4t(m) + 5y(m). Differentiate v(l) with respect to l. -3l2 - 204 Let a = -7 - -11. Let q be (a/(-4))/((-5)/20). What is the second derivative of -9w*q - 11w*4 - 5w + 5w4 + 3w wrt w? -180w2 Suppose 2l + 11 = 9. Let d be (-20)/((0 - -2)l). What is the third derivative of -du*2 - 4u*6 + 21u*2 - 5u*6 wrt u? -1080u*3 Find the first derivative of 736 - 732 - 11r*4 - 779 - 639 - 5r wrt r. -44r3 - 5 Find the second derivative of 4916j + 16389j2 - 10269j*2 - 11521j*2 wrt j. -10802 What is the second derivative of 1201b*4 + 1213b*4 - 2011b - 599b4 wrt b? 21780b*2 Let k(t) be the first derivative of 0t*5 + 0t*6 + 0t*4 - 46/3t*3 + 70 - 7t*7 + 0t*2 + 0t. Find the third derivative of k(q) wrt q. -5880q3 Let n(o) be the first derivative of -169o*5 - 1555o*2/2 + 1958. Find the second derivative of n(d) wrt d. -10140d*2 Let t(s) be the second derivative of -133/2s*2 - 7 - 5/3s*4 - 1/3s*3 + 5s. Differentiate t(a) with respect to a. -40a - 2 Let j(o) = o3 - o. Let a(s) = -8s*2 - 9s + 6. Let k = 88 - 89. Let b(z) = ka(z) + 4j(z). Find the second derivative of b(r) wrt r. 24r + 16 What is the derivative of -4338 + 1837y*2 - 2225 + 4771 + 2692y*2 wrt y? 9058y What is the third derivative of 363458z3 - 3z*5 - 364094z*3 + 105z2 + 3 + z5 wrt z? -120z2 - 3816 Find the first derivative of 993 - 146y*2 + 849 + 3y	{ "pile_set_name": "DM Mathematics" }
-569)/(-6) a composite number? True Suppose 3o = 2r + 7287, r - o = -3r - 14549. Is (0 - -1)/((-18)/r) a prime number? False Let y(i) = 54i*2 - 2i - 1. Suppose 0 = 2h + 2 - 0. Is y(h) composite? True Let l = 4 - -64. Let c = -37 + l. Is c a prime number? True Let s(o) = 3o*2 + 2o - 2. Suppose 6 = -4y - 6. Is s(y) a prime number? True Let y = 224 - 135. Suppose 0l + l = y. Is l a composite number? False Let l = 441 - -132. Suppose 0t - 3t + l = 0. Is t a composite number? False Let w be 0/1 - (-1 + 5). Let i be 0 - (-2 + w/(-2)). Suppose i = r + 2 + 3, -5r + 149 = 3z. Is z composite? True Suppose -4q = -5o + 937 + 1330, -4o = -q - 1807. Is o a composite number? True Suppose 198 = 4j - 6j. Let d be j/(-21) - (-4)/14. Suppose 130 = 4i - 2h, i = 5i - dh - 139. Is i a prime number? True Let q = 4 + -5. Let t be (-196)/8 + q/(-2). Let b = t - -71. Is b a prime number? True Let y = 107 - -524. Is y a prime number? True Suppose 5u = -4a + 444, -a + 2u = -0u - 111. Is a a composite number? True Let u = 790 + -353. Suppose -3p + 1142 = 3v + u, 10 = 5p. Is v a composite number? False Let c(d) = -3d2 - 4d - 51. Let g(s) = s*2 + s + 1. Let y(i) = -c(i) - 4g(i). Is y(0) a composite number? False Suppose o - 309 = 104. Is o a composite number? True Is (-7)/(7/(-222)) + 1 composite? False Let k be (-2)/6 - (-14)/6. Suppose 0 = f + kf - 57. Is f a prime number? True Let s = 11 - 8. Suppose 1 - 16 = -5a. Suppose o + sl = 6o - 79, 39 = ao + l. Is o prime? False Let j = 5 - 1. Suppose -49 = -jt - 4g + 3g, -3g = t - 15. Suppose -t = u - 95. Is u a prime number? True Let j(k) be the third derivative of 5k4/8 - k3/6 + k*2. Is j(6) composite? False Suppose -5y = 5s + 24 - 79, -5s + 2y + 76 = 0. Suppose 0 = 3p - s - 49. Let t = p + 188. Is t a composite number? True Let h be (-34)/2(-35)/7. Let q = h - 51. Is q a composite number? True Let s be 3/2 + (-1)/(-2). Let j(i) = -i2 + 6i - 3. Let p be j(s). Suppose -4a + 175 = a - 4q, -5a + 180 = -pq. Is a a composite number? False Suppose -59 = -4v + 141. Is -3 + (5v - 0) a composite number? True Let i be 414/12 + 2/4. Suppose 4p - i = -p. Is p a composite number? False Suppose o = 56 - 13. Is o a composite number? False Suppose 123 = 2f - 1007. Is f prime? False Let g(k) = -336k3 + k2. Let x = -5 - -4. Is g(x) composite? False Let u = -168 + 391. Is u a prime number? True Let x(g) = 17g*2 - 18g + 26. Is x(-9) a composite number? True Let v(l) = -4l2 + 9l + 2. Let c(t) = 11t2 - 27t - 5. Let h(r) = 3c(r) + 8v(r). Let x be h(4). Let k = 34 - x. Is k prime? True Suppose 5o - 4 - 1 = 0. Let l = o + 2. Is l a prime number? True Let c = -5 - -9. Let l = c + 1. Suppose 0 = y - 4, 4y = -ls + 7y + 43. Is s a composite number? False Let l(n) = -4n3 - 2n*2 - 2n - 3. Is l(-2) prime? False Suppose 0 = 11b - 12b + 6. Suppose -bd = -7d + 633. Is d a composite number? True Let d(q) = -8q + 1 + 4q + 4q - q2. Let u be d(0). Is (-3)/(-2)(35 - u) a prime number? False Suppose a - 5259 = -2a. Is a a prime number? True Is (1 + 1)(5 - -302) prime? False Let a(k) = k*2 - 4k - 6. Let g = 15 + -10. Let m be a(g). Is (m/2)/((-5)/1270) a prime number? True Let f(u) = -19u3 + 6u*2 + 2u - 4. Let j be f(-4). Suppose x + 4x = j. Let n = x + -141. Is n composite? True Let w(o) = 54o + 5 - 4 + 13o + 7o. Is w(2) a prime number? True Let s = 3 + 23. Is s a composite number? True Suppose -5t = 2 + 18. Let v(j) = 5j2 - j + 1. Is v(t) composite? True Let n(j) be the third derivative of j4/24 - j*3 - 2j*2. Let b be n(0). Is 114/4b/(-9) prime? True Let o be 9/(-12 - -3). Suppose o = b - 6. Is b prime? False Let l(m) be the first derivative of -m4/4 + 11m3/3 + m2 - 1. Suppose 33 = 3u - 0u. Is l(u) a prime number? False Suppose 4q - 989 - 1095 = 0. Is q a composite number? False Is -4 - 1 - (-96 - 6) composite? False Let h(n) = n + 7. Let u be h(-3). Let j(l) = l3 - l + 1. Let t(f) = -5f*3 - 4f*2 + 3f + 3. Let b(k) = uj(k) + t(k). Is b(-5) a prime number? True Let r(q) = -q2 + q + 1. Let m be r(-2). Let f(c) = c2 + 3c - 7. Let h be f(m). Suppose 2g + 7 = hg. Is g a prime number? True Suppose -5m - 3n - 2n = 60, -3n + 20 = -4m. Is -2-26(-2)/m composite? False Let m be -1 + -3 - (-4 - -1). Let h(t) = -t3 + 6t*2 + 6. Let f be h(6). Is 49 - (m + f + -3) prime? True Suppose -4i + 5732 = -4p, 2881 = 2i + p - 0p. Let a = -467 + i. Is a a prime number? True Suppose 25 = 4w + 5d, 2d - d = 2w + 5. Let c(r) = r + 161. Is c(w) a composite number? True Suppose 0 = 4y - 4. Suppose -4f + 5 = y. Is ((-1)/(-2))/(f/14) a composite number? False Let d be 23 + -1 + (2 - 1). Suppose -4 = -3y + 2. Suppose -3z + 401 = yv, 3v - d = -z + 113. Is z a composite number? True Suppose 2m - 620 - 366 = 0. Is m composite? True Let b = 1158 + -583. Suppose 0y - 5y + b = 0. Is y a prime number? False Let c = 1619 - 664. Suppose 83 = -z + c. Suppose 4x - 804 = z. Is x a composite number? False Let q be 1(6/(-2) + -3). Let l(s) = -21s + 1. Is l(q) a prime number? True Let v = 6226 - 1961. Is v a composite number? True Let f(h) = 3h*2 + 9h - 19. Is f(6) prime? False Suppose 0 = -7w + 2w - f + 6, 0 = -2w - 5f - 16. Suppose -2n - 112 = -wi - 5n, -4i - n + 214 = 0. Is i a prime number? True Suppose 2y + 8 = -0y. Let i be y/(-6) + (-10)/(-3). Let q = i + 3. Is q composite? False Suppose -i + 34 = -33. Is i prime? True Let m = -8 - -5. Let r(t) = t*2 - t + 1. Let v(y) = -2y*2 + 2y - 2. Let a(w) = -5r(w) - 3v(w). Is a(m) a composite number? False Suppose 2o - 10 = -4w, -w = -3w - 3o - 1. Suppose 2x - 18 = -0x + 2m, wm + 20 = 0. Is 11/4 - (-1)/x prime? True Suppose 34 = 4d - 26. Let x = 14 + -10. Suppose -13 - d = -xu. Is u a prime number? True Let c = -87 - -264. Suppose -n - 2n = x - 67, -n = 3x - c. Is x composite? True Suppose 4f = -0f. Suppose -4w - 4n + 16 = f, 2w + 6n - 2n - 12 = 0. Suppose -4l = -3m - wl + 17, 5m - 37 = -l. Is m prime? True Suppose 3d - 37 = -2t, 2t - 23 = -2d + t. Is d prime? False Suppose f = 5o + 27, 8o + 37 = 3f + 4o. Let j = -6 + f. Suppose 48 = w + j. Is w prime? True Suppose 75 = -k + 4k. Is k a prime number? False Suppose 55 + 15 = 5m. Let x be 35/m(-16)/(-10). Suppose -4n - 3w + 49 + 108 = 0, -xw = -12. Is n a prime number? True Let i = -5 - -8. Suppose -3b - 4v = -2v - 74, -iv - 76 = -4b. Suppose 2f - 5d - 86 + b = 0, -3f - 3d + 54 = 0. Is f composite? True Suppose 0 = 5f + 3n + 632 - 3285, 0 = -4f - 3n + 2120. Is f composite? True Suppose 3r - 2r - 5t - 4 = 0, -4r + 5t = -31. Suppose 0 = 3c - 120 + r. Is c composite? False Let y(j) be the second derivative of 0 + j + 1/2j3 + 1/4j*4 + 1/2j*2 - 1/5j*5. Is y(-2) a composite number? True Suppose -23f + 3785 = -18f. Is f prime? True Let r(x) = -x3 - 12x*2 - 12x - 7. Let m be r(-11). Let i be 615 - m - 1/1. Suppose 6h = h + i. Is h a composite number? True Let x be -10((-4)/10 - 0). Suppose -x = -g - 1. Is 1/(g/8013) a prime number? True Suppose 6d - z = d - 32, 2z - 16 = 2d. Is (-6444)/(-24)(-4)/d a composite number? False Let h(g) be the second derivative of g4/6 - g3/6 - 3g*2/2 + 9g. Suppose 3x = -x - 16. Is h(x) a composite number? True Suppose 5g = -0g + 25, 3h = 5g + 14. Let u = h - 23. Is (-1)/(-5) - 68/u a composite number? False Suppose 2r = -3r + 2050. Suppose c = 6c - r. Is c a composite number? True Let f be ((-1)/3)/(5/(-75)). Suppose -c - 16 = -fc. Suppose cz - 4 = 0, -z + 5z = -5n + 34. Is n composite? True Suppose u - s + 2 = 2s, 4u + 5s = 43. Let n = 3 + u. Suppose 2r - n - 8 = 0. Is r prime? False Let l(d) = -132d - 7. Is l(-3) composite? False Is 1263/3 + 4/(-2) a composite number? False Let a be (0 + -10)2/(-5). Suppose 0 = -3z + 2k - 40 + 123, -az + 111 = -3k. Suppose 0 = -b + 104 - z. Is b a composite number? True Let j(d) = -342d + 41. Is j(-5) composite? True Let r = 13 - 18. Let i = r - -7. Suppose -2 - 13 = 3t, 0 = 4a - it - 66. Is a a composite number? True Let x(t) = 185t + 5. Is x(4) prime? False Let q(n) be the first derivative of n3/3 + 4n*2 + 4n + 1. Let i be q(-8). Suppose	{ "pile_set_name": "DM Mathematics" }
ultiple of 12 and 20. 60 Calculate the lowest common multiple of 165 and 1008. 55440 Calculate the lowest common multiple of 76 and 60. 1140 Find the common denominator of -32/2261 and 31/95. 11305 What is the lowest common multiple of 65 and 225? 2925 What is the common denominator of -8/33 and 14/15? 165 Calculate the lowest common multiple of 298 and 298. 298 Calculate the common denominator of 7/968 and -22/5. 4840 Calculate the lowest common multiple of 10 and 35. 70 What is the common denominator of 37/6652 and -14/9? 59868 What is the common denominator of 68/33 and -10/9? 99 Calculate the common denominator of 73/330 and -97/2970. 2970 Calculate the common denominator of 161/90 and -63/20. 180 What is the smallest common multiple of 240 and 2310? 18480 Calculate the least common multiple of 98 and 18. 882 Find the common denominator of -139/90 and 91/396. 1980 Find the common denominator of 76/9 and -18/2461. 22149 What is the smallest common multiple of 94 and 14? 658 What is the smallest common multiple of 224 and 176? 2464 Find the common denominator of 83/12 and -119/6. 12 Calculate the smallest common multiple of 40 and 7316. 73160 Find the common denominator of -119/18 and 83/54. 54 Calculate the smallest common multiple of 5 and 7201. 36005 What is the lowest common multiple of 149 and 14? 2086 What is the lowest common multiple of 408 and 68? 408 Calculate the lowest common multiple of 130 and 39. 390 What is the common denominator of 31/24 and -57/80? 240 What is the least common multiple of 560 and 40? 560 Calculate the lowest common multiple of 142 and 6. 426 What is the common denominator of -75/22 and 47/8? 88 Find the common denominator of 53/512 and 3/2560. 2560 What is the lowest common multiple of 48 and 1436? 17232 Find the common denominator of -103/10 and 45/7. 70 What is the lowest common multiple of 130 and 20? 260 Calculate the lowest common multiple of 910 and 8. 3640 Find the common denominator of -22/103 and -40/23. 2369 What is the lowest common multiple of 1685 and 5? 1685 What is the common denominator of 91/54 and 55/336? 3024 What is the lowest common multiple of 246 and 7? 1722 What is the common denominator of -137/6 and -73/6? 6 What is the least common multiple of 4 and 4990? 9980 Calculate the smallest common multiple of 84 and 2408. 7224 What is the common denominator of -23/156 and 53/30? 780 What is the lowest common multiple of 6 and 11? 66 What is the lowest common multiple of 4544 and 2272? 4544 Calculate the smallest common multiple of 18 and 698. 6282 What is the smallest common multiple of 3 and 203? 609 Calculate the lowest common multiple of 100 and 20. 100 Calculate the common denominator of 113/336 and -65/77. 3696 Calculate the common denominator of -23/84 and 91/12. 84 What is the lowest common multiple of 329 and 1645? 1645 Calculate the common denominator of 151/84 and 29/20. 420 What is the least common multiple of 815 and 1630? 1630 Calculate the smallest common multiple of 26 and 74. 962 Calculate the common denominator of 53/766 and 11/6. 2298 Find the common denominator of 113/12 and -20/69. 276 Calculate the common denominator of 143/1416 and 131/84. 9912 Calculate the common denominator of 19/132 and -101/198. 396 What is the lowest common multiple of 24 and 56? 168 What is the least common multiple of 258 and 60? 2580 What is the least common multiple of 21 and 654? 4578 Calculate the common denominator of -4/63 and 83/42. 126 Find the common denominator of 97/162 and 85/378. 1134 Calculate the lowest common multiple of 12 and 780. 780 What is the smallest common multiple of 5 and 158? 790 Calculate the lowest common multiple of 363 and 7062. 77682 What is the common denominator of 151/144 and -47/33? 1584 What is the common denominator of 43/11 and 145/708? 7788 Calculate the smallest common multiple of 11 and 49. 539 Find the common denominator of 29/64 and -49/248. 1984 Calculate the common denominator of 151/18 and 89/150. 450 Calculate the lowest common multiple of 1334 and 638. 14674 What is the common denominator of 37/18 and 1/2142? 2142 What is the common denominator of -115/1106 and -51/632? 4424 Find the common denominator of -169/2520 and 59/12. 2520 Calculate the smallest common multiple of 19 and 17. 323 What is the smallest common multiple of 3720 and 33? 40920 What is the lowest common multiple of 7702 and 4? 15404 Calculate the common denominator of 5/2248 and -137/6. 6744 Calculate the common denominator of 59/462 and -8/7007. 42042 Calculate the common denominator of -173/546 and 47/819. 1638 Find the common denominator of -85/1626 and -85/8. 6504 Calculate the least common multiple of 500 and 96. 12000 What is the common denominator of 49/2 and -89/25274? 25274 Calculate the smallest common multiple of 128 and 36. 1152 Calculate the lowest common multiple of 6 and 210. 210 Find the common denominator of 133/54 and -113/78. 702 What is the common denominator of -25/1683 and -87/374? 3366 Find the common denominator of -7/783 and 23/243. 7047 Calculate the lowest common multiple of 6 and 5. 30 What is the least common multiple of 3276 and 2? 3276 Calculate the smallest common multiple of 1210 and 220. 2420 What is the common denominator of 17/1245 and -151/48? 19920 What is the smallest common multiple of 96 and 3648? 3648 Calculate the lowest common multiple of 100 and 46. 2300 What is the common denominator of 73/14 and -15/14? 14 What is the common denominator of 3/380 and 55/2? 380 What is the smallest common multiple of 160 and 180? 1440 What is the common denominator of 67/2112 and 37/432? 19008 Find the common denominator of 21/17 and 37/435. 7395 What is the lowest common multiple of 82 and 1? 82 What is the least common multiple of 176 and 4? 176 Calculate the common denominator of -28/85 and -7/680. 680 Find the common denominator of -97/2680 and 75/4. 2680 Find the common denominator of 31/2493 and -37/4155. 12465 Calculate the lowest common multiple of 10 and 177. 1770 What is the smallest common multiple of 42 and 126? 126 Calculate the lowest common multiple of 36 and 12390. 74340 Calculate the smallest common multiple of 98 and 1. 98 Find the common denominator of -25/124 and 145/372. 372 What is the smallest common multiple of 27 and 54? 54 What is the common denominator of 1/10 and -67/40? 40 Find the common denominator of 43/24 and -137/42. 168 What is the common denominator of 1/8 and -33/668? 1336 What is the common denominator of 10/3399 and -107/1236? 13596 What is the common denominator of 87/52 and 17/2462? 64012 What is the lowest common multiple of 1080 and 54? 1080 Calculate the smallest common multiple of 248 and 403. 3224 Calculate the common denominator of 69/64 and -29/12. 192 Calculate the least common multiple of 16 and 3688. 7376 What is the lowest common multiple of 26 and 754? 754 Calculate the common denominator of 32/77 and 50/77. 77 Calculate the least common multiple of 26 and 406. 5278 Calculate the least common multiple of 406 and 116. 812 Calculate the least common multiple of 276 and 368. 1104 Calculate the common denominator of -93/148 and 67/148. 148 Calculate the common denominator of -95/3924 and 83/6. 3924 Calculate the common denominator of 93/44 and 109/24. 264 Calculate the least common multiple of 1260 and 52. 16380 Calculate the least common multiple of 45 and 40. 360 What is the common denominator of 5/4 and 19/36? 36 Calculate the common denominator of -27/10 and -91/1808. 9040 Calculate the common denominator of -46/9 and -19/1610. 14490 What is the common denominator of 101/6052 and 1/12? 18156 Calculate the common denominator of -95/2 and -11/30. 30 Calculate the least common multiple of 288 and 528. 3168 Find the common denominator of 23/13 and 41/871. 871 Calculate the lowest common multiple of 750 and 75. 750 Calculate the common denominator of -127/6 and 101/14. 42 Find the common denominator of -21/2050 and 1/25. 2050 What is the smallest common multiple of 8250 and 4? 16500 What is the smallest common multiple of 1155 and 9? 3465 Calculate the smallest common multiple of 16 and 136. 272 What is the smallest common multiple of 36 and 36? 36 Find the common denominator of 3/16 and -13/124. 4	{ "pile_set_name": "DM Mathematics" }
2/9? (a) -4 (b) g (c) k b Let n = 26 - 23. Let t = -7 + 8. What is the closest to n in 2/15, 0, t? t Let f = -8 + 5. Let i = 3 + f. Let h = 0.1 - 0.2. Which is the nearest to i? (a) -4 (b) 2/17 (c) h c Let m = 0.2 - 0.4. Let n = -14 + 13. Let d = 3.3 + 0.7. What is the nearest to -1/3 in n, d, m? m Let t be (3/3)/(2/8). Suppose 3f = 3g + 3, -g - tg + f = -15. Suppose o + 1 = -g. Which is the nearest to -1? (a) 0 (b) 4 (c) o a Let j = 1.6 - 2. What is the nearest to j in 5, 0, -0.3? -0.3 Let y = -772 + 731.7. Let f = y - -45. Let v = f + -0.7. Which is the closest to -1? (a) -0.5 (b) v (c) -2/5 a Let u = -0.1 - 0.8. Let n = u + 0.9. Which is the closest to 1/3? (a) n (b) 2 (c) 4 a Let q be 2/(-4 + 1 + -2). What is the nearest to q in -0.4, 2, 2/3? -0.4 Let t be 22(-5)/4. Let q be 184/186. Let o = q + -49/2. What is the nearest to 1 in t, o, 4? o Let l = 17/24 + -3/8. What is the closest to l in 0.1, -1/3, -3? 0.1 Let d = 1/20 - -11/20. What is the closest to -1/4 in -5, d, 0? 0 Let l = -2.1 + 2. Let j = 150 + -146. What is the nearest to l in j, 3/7, -2? 3/7 Suppose 9k - 20 = 13k. Let q be 1(3/4)/(-3). What is the nearest to q in k, 5, -0.3? -0.3 Let u = -64 + 67. Let m = 3/7744 + 2191537/38720. Let p = m + -57. Which is the closest to p? (a) u (b) -2 (c) 5 b Let w = -125 + 127.04. Let u = 0.04 - w. What is the nearest to 1 in 1/3, u, -2/3? 1/3 Let i(r) = 9r2 - 2r + 1. Let h be i(1). Let u = h - 14. Let f be ((-1)/(-3))/(1/u). Which is the nearest to f? (a) -1 (b) 0.4 (c) 5 a Suppose -7i + 28 = -7. Let o = -0.02 + -1.98. Let w = -3 - o. What is the nearest to w in i, 4, 2? 2 Let i = 0.156 - 0.556. What is the nearest to 13 in 2/5, -1, i? 2/5 Let k = -0.104 - 0.896. Let z = -4 + 6. Which is the closest to 2/3? (a) z (b) k (c) 5 a Let q be (0 - 1/(-2))2. Let s(g) = g*3 + 3g*2 - 4g. Let m be s(1). What is the nearest to 1/4 in -0.2, q, m? m Let d = 4.04 + -4. Let o = d - 0.34. Which is the closest to 0? (a) o (b) -2 (c) 0.5 a Let x be -2 - (60/9)/(-4). What is the closest to 2 in x, 4, 0.3? 0.3 Let j = 0.5 + 0.5. What is the closest to j in -0.03, 0.2, 3/7? 3/7 Let d = 5.6 - 1.6. Which is the closest to 0.3? (a) -5 (b) d (c) 0.1 c Let l = -27.4 + 27. Let y = -3 + 2.9. Which is the closest to y? (a) l (b) 2/9 (c) -1 a Let k be 4/((-16)/6)-2. Let w be 2(-3)/(-2) - k. What is the closest to w in -1, -0.3, -5? -0.3 Suppose -3z + 5z + 4 = 0. What is the closest to 1 in z, 2/11, 7? 2/11 Suppose 3u + 0 = -3. Let k = -58 + 57.71. Let q = -5.29 - k. What is the closest to u in 4, -4, q? -4 Let h = 1.3 - -1.7. Let v = 0.09 + -5.09. Let x = 4 + v. Which is the nearest to x? (a) 5 (b) h (c) -2/13 c Let k be -41/(-2)2. Let v = 11/2 - 4. What is the closest to 0 in 3/5, k, v? 3/5 Let d = 0.2 + -1.2. Let i = -4.1 - -1.6. Let f = i + 0.5. Which is the closest to 0? (a) 5 (b) d (c) f b Let f = -0.7 + 1. Let x be ((-6)/100)/((-2)/(-5)). Let c = -11/60 + x. What is the closest to 1 in c, f, -3? f Let h = -200 - -1798/9. What is the closest to 0 in h, 0, 1? 0 Let k = -2 + 3. Suppose -10 = f + 4f - 5d, -4f = -d + 11. Let z = -1.1 - -1. Which is the nearest to 2? (a) f (b) z (c) k c Let h be 48/70 + (-20)/70. Which is the closest to 0.1? (a) 0.3 (b) 1 (c) h a Let t = -30 - -29.3. Which is the nearest to 4? (a) t (b) 2/3 (c) 1 c Let h = 0 + 0. Let y = 32 - 94/3. Let k = -6 - -1. Which is the nearest to y? (a) k (b) h (c) 0.4 c Let u(j) = -j - 5. Let z be u(-3). What is the closest to -0.2 in 1/3, z, 0.4? 1/3 Let h = 7 - 6.5. Let q = 8/11 + -43/44. Which is the closest to 1? (a) q (b) h (c) -1 b Let n = -7 - -8. Let g = 5 - n. What is the nearest to 1/4 in 0.5, g, -0.4? 0.5 Let w be (-2 - 0)(-4)/(-24). What is the nearest to w in 2, -3, -7? 2 Let q = -76/325 - -2/25. What is the closest to 0.1 in q, 1/3, 0? 0 Let h = -4.06 + 0.06. Let c = 4 - 3. Let d = -3 - -3.1. What is the nearest to d in h, c, 0.4? 0.4 Let r = -5 + 0. Let j = r - -10. Let u = 18 + -17.8. Which is the nearest to -1/4? (a) 2/5 (b) u (c) j b Let f be 20/110 - (-2)/110. Which is the closest to -1? (a) -1 (b) 0.1 (c) f a Suppose 2a = -8, -a + 11 = o - 2a. Let y = 5 - o. Let w be y/(-8)(-3 - -1). What is the nearest to -0.2 in 5, -2/3, w? w Let n(f) = f*2 + 7f + 3. Let z be n(-7). Let x be (4/(-4))/((-15)/z). Which is the nearest to 0? (a) -1 (b) -5 (c) x c Let m = 0.4 + -5.4. Let o = 0.07 + 0.03. Let d = -2.1 + o. What is the nearest to 0 in 1/2, d, m? 1/2 Suppose 0 = -2f + 5c + 27, 0 = -4f + 2c + 8 + 6. What is the nearest to f in 4, 0.5, -4? 0.5 Let q = -0.018 - -1.088. Let v = q + -0.07. Which is the closest to v? (a) -5/4 (b) 1/5 (c) -1/5 b Let k be (2/(-5))/((-51)/15). What is the nearest to 0.1 in k, 4, 3? k Let o = 107 + -106.9. Which is the nearest to o? (a) -4 (b) 2/7 (c) -1/4 b Let f = -14 - -15. What is the nearest to f in -0.4, 1/8, -3? 1/8 Let p = 3 + -5. Let r = p + 2.2. What is the closest to r in 0.5, -3, 0.4? 0.4 Let r = 2.4 - 2.5. Which is the closest to 0.1? (a) -1 (b) r (c) 5 b Let y = -0.05 - 0.75. Let l = 1.3 + -0.3. Let r = y + l. Which is the nearest to -1/4? (a) 1 (b) r (c) -5 b Let v = -12.93 - -13. Let j = -0.13 - v. Let u = -0.5 - -1. Which is the closest to 0? (a) j (b) u (c) 5 a Let x = -0.2 + 1.2. Let a = -0.15 - -0.05. Let t = 401/56 + -55/8. What is the closest to t in 2, a, x? a Let d = 12 + -12.3. Let m = -6.4 - -4.41. Let w = -0.01 + m. Which is the closest to w? (a) 0.2 (b) d (c) -2/13 b Let u = -19 + 16. Which is the nearest to -0.2? (a) 4 (b) 3 (c) u c Suppose 4l + 18 = -2z + l, -4z - 5l = 34. Let g = -30 + 31. Which is the nearest to z? (a) -0.2 (b) 3 (c) g a Let f = 4.9 + 0.1. Let u = -4.1 + -0.9. Let y = 2 + -6. Which is the nearest to -0.1? (a) y (b) u (c) f a Suppose 6t + 2 = 5t. Which is the nearest to 1? (a) t (b) -4 (c) 0 c Let n(k) = -k*3 + 5k2. Let u be n(5). Let q = -2.17 - -0.17. Which is the nearest to q? (a) -5/3 (b) u (c) 0.1 a Let b = -10 - -9. What is the closest to b in 2/13, -2/23, 0? -2/23 Let g be 1/1 + 36/(-45). Let l = 0.5 + -2.5. Which is the closest to 1? (a) l (b) g (c) 0 b Let g = 3.7 + -3.7. Which is the closest to -1? (a) -3 (b) g (c) -0.2 c Let n(b) = b3 + b*2 - 4. Let o be n(0). Let x be (6/(-8))/(18/o). Let t = -7.5 - -2.5. What is the nearest to 0.2 in x, t, 1/5? 1/5 Let z = 231/4 + -58. Which is the nearest to z? (a) -4 (b) -3/2 (c) -1 c Let k = 23 - 26. Which is the closest to -1/3? (a) 0.3 (b) 1/3 (c) k a Let h = -2 + 1.9. Let d = 58 + -56. What is the closest to h in -0.5, d, 0? 0 Let z = 2.38 - 1.38. Which is the nearest to 1/5? (a) -4 (b) -2 (c) z c Let q = 8.8 - -0.8. Let g = -10 + q. Let l = 1153/7 + -165. Which is the nearest to l? (a) g (b) 3 (c) 5 a Let t be 1/(-2) + 8/12. What is the closest to t in 0, 4, -2/7? 0 Let t = -1/2 + 1/3. Which is the nearest to 18? (a) t (b) 2 (c) 3 c Suppose 13 + 9 = 5g + 2k, 0 = 2k - 2. Suppose -b + 10 = 5w, gw - 5b = -w - 20. Let o = 0.11 - -3.89. What is the closest to w in 0.3, o, -0.5? 0.3 Let z = 10 - 10.4. What is the nearest to 1/4 in 3, 7, z? z Let q be ((-4)/10)/(18/10). Let i = -139 - -971/7. What is the nearest to i in 3/2, -2, q? q Let g = -1 + 2. Let z(k) = 2k - 10. Let u be z(6). Which is the nearest to g? (a) u (b) 5 (c) -3/2 a Let j be 5/(-30)9/(-1). Which is the nearest to 2/7? (a) -1/5 (b) j (c) 5/3 a Suppose 3d + 3 = 2d. Let g = 6 + -4. What is the nearest to 0.1 in g, d, -2? g Let q = -13 + 12. Which is the closest to q? (a) 5 (b) -0.05 (c) -2/9 c Let r = 0.13 + -2.63. Let k = r + -0.5. Let v be 1/(-4) + 6/(-8). Which is the nearest to v? (a) -0.2 (b) k (c) -0.5 c Let n = 17.5 + -2.5. Let h = n - 9. Let j = -5.7 + h. Which is the closest to 0.1? (a) 0 (b) j (c) -4 a Let c be 50/(-40)4/10-1. Let d(a) = a3 + 1 - 2a*2 + 0a + 3a2 - a. Let m be d(-2). What is the closest to -2/5 in 2, c, m? m Let v be 2/(-4)3(-4)/18. What is the nearest to v in -3/5, 0.3, 0? 0.3 Let u be 16/(-60) - 4/10. Let x = -3.44 + 3.1. Let k = x - -0.14. Which is the closest to 0.2? (a) u (b) k (c) -2/7 b Let j(l) = 2l*2 - 17l - 9. Let f be j(9). Which is the closest to 3? (a) -1/4 (b) 2	{ "pile_set_name": "DM Mathematics" }
on denominator of c and (-2)/3 + (-67)/(-33). 22 Let l(v) = 25v2 - 6. Let c be l(-4). Suppose 2o = -c + 802. Calculate the lowest common multiple of o and 6. 204 Let h(a) = -a*2 - 7a + 24. Let v be h(-9). Suppose -vt = -4t + 104. Let f = t + 56. Calculate the smallest common multiple of 2 and f. 4 Let q = -4100 + 4749. Calculate the least common multiple of q and 8. 5192 Find the common denominator of 151/48 and ((-2641)/(-95))/((-582)/(-5) - 6). 1104 Suppose -26l + 171 = -63. Calculate the least common multiple of -1 - 8/(-12) - 76/(-12) and l. 18 Suppose -k + 2b + 568 = 0, 20k - 596 = 19k - 5b. What is the least common multiple of 24 and k? 576 Suppose 31i - 21i - 9010 = -7i. Calculate the smallest common multiple of 848 and i. 4240 Let o = -933 + 525. Let i be (0 - -1)/((-34)/o). What is the common denominator of -81/26 and (1100/i)/(-11)2/(-4)? 78 Suppose 24a + 364 = -19a + 56a. Calculate the least common multiple of 252 and a. 252 Let z(r) = -6r - 10. Suppose -13q = -8q + 45. Let i = -692 + 694. What is the least common multiple of z(q) and i? 44 Let z = 64980913 - 240797365010321/3705663. Let s = z - -5962411907/259396410. Let b = -135/7 + s. Calculate the common denominator of b and 17/7. 70 Suppose -32v = -55v + 3220. Calculate the lowest common multiple of 2 and v. 140 Suppose -3o + 5j - 3 - 5 = 0, 0 = 2o + 5j - 3. What is the smallest common multiple of (-10 - -12) + 24(0 - o) and 20? 260 Suppose 3i = 2o + i - 142, 4i = -2o + 130. Let a = 79 - o. Suppose 0 = 3j - j - 28. Calculate the smallest common multiple of a and j. 70 Let c be -43 + (3 - (-4)/(-1)). Let q be ((-402)/8)/((-5)/c). Let n = -440 - q. What is the common denominator of 27/5 and n? 5 Let v(s) = -1602s*3 - 3s*2 - 66s - 63. What is the least common multiple of 801 and v(-1)? 1602 Suppose -5y - 974a + 977a + 1873 = 0, -2a = -3y + 1125. Calculate the smallest common multiple of 203 and y. 10759 What is the common denominator of 122/48 + (-12)/32 and -43/427? 2562 Find the common denominator of -179/2280 and ((-141)/(-24) - 46/46)1/(-114). 4560 Calculate the common denominator of 2/(-3)(52/195 - (-6519)/(-14490)) and 62/21. 483 Let t be (125/20)/(4/(-10)). Let a = 15 + t. Find the common denominator of 54/66(-1)/((-9)/6) and a. 88 What is the common denominator of -31/8 and 4/2 + (-615)/(-9240)-20? 616 Let z = -12037 - -13878. What is the lowest common multiple of z and 2104? 14728 Let t = 6169 - 135679/22. What is the common denominator of (35/33)/((-4)/6) and t? 22 Suppose 3a - 4504 = -1228. Suppose -15c + c = -a. Find the common denominator of 0 + (-4)/26 + 506/c and -25/12. 12 Suppose 0 = p + 26. What is the common denominator of -67/45 and (p/780)/((-8)/10)? 360 Suppose -427 = -53w + 1693. Calculate the least common multiple of 2625 and w. 21000 Suppose q + 5 = c, -17 + 1 = -4c + 3q. Let i be (0 - (c + 3)) + 5756/(-1). Let r = 161223/28 + i. What is the common denominator of r and 53/16? 112 Suppose -4006 = -5a - 4m, -3m + 742 + 1664 = 3a. Calculate the smallest common multiple of 10 and a. 3990 Let z = 80561/18069 + -250/57. Let o be 4/14 - 187307/35504. Let r = o - z. Find the common denominator of r and 45/11. 176 Calculate the least common multiple of 72 and 12 - 7 - ((-416)/8 + 4). 3816 Suppose 0 = -3j + r - 182 + 320, 216 = 5j - 4r. Let p = 44 + -8. Calculate the smallest common multiple of p and j. 144 Suppose 352 = -2t + 382. Suppose 3v - 12 = -3q, -18v + tv - 51 = -4q. Calculate the lowest common multiple of 2 and q. 18 Suppose 2b - 96 = -3q, -52 - 64 = -2b + 2q. What is the least common multiple of b and 672? 6048 Let j be (-1 + 4)/(-6)0. Suppose j = 6k + k - 42. What is the common denominator of (1/28)/(-1)(-119)/k and -109/36? 72 Let u(y) = -y*2 - 5y + 2. Let f be u(-7). Calculate the common denominator of (545/(-10) - -6)/(28) and (1/(-8))/(f/1212). 32 Let k(d) = 5d - 153. Let t be k(30). Calculate the smallest common multiple of 8 and (t + 0)60/54-6. 40 Let z be 2/(-7) + 10081/20. Let w = z - 2504/5. Find the common denominator of w and -61/16. 112 Let h(g) = -g3 - g2 + 24g + 88. Calculate the least common multiple of 335 and h(-4). 2680 Let o = -5955 - -6055. Calculate the smallest common multiple of 10 and o. 100 What is the common denominator of 49/(-122)(-28)/56 and 67/20? 1220 Suppose -642 = -19a - 566. What is the lowest common multiple of 100 and a? 100 Calculate the smallest common multiple of 8 and (-4)/(-14)13/26 - (-37038)/42. 3528 Let p = -105 + 80. Suppose -3g - 140 = 2g. Let k = p - g. What is the smallest common multiple of 6 and k? 6 Suppose -t - 7 = -4z + 2t, -5z = -5t - 5. Suppose 0 = -11f + 15077 - 14813. What is the smallest common multiple of f and z? 24 Let a(o) = -7o - 18. Let t be a(-3). Suppose -3x = -t, -5q + 12 = -6x + 3x. Suppose -qz = -9z + 198. What is the lowest common multiple of z and 18? 198 Suppose -5v + 7 + 113 = 2o, 4v - 5o = 162. Suppose -4p + 32 = -2p. Calculate the smallest common multiple of p and v. 112 Suppose -3l - 80 = -8l. Suppose -4s + b + 128 = -l, -4b + 36 = s. Let h = 6842/7 - 975. What is the common denominator of s and h? 7 Suppose 27p = 25p + 80. What is the least common multiple of p and 24? 120 Suppose -6 = m - 3m + 3y, y = -5m + 15. Suppose -p - mt = 3p - 63, 5t = 25. Calculate the lowest common multiple of 8 and p. 24 Let k = 176 - 166. Calculate the common denominator of k/(-35) + 2 + (-283)/112 and ((-66)/28)/(10/7). 80 Suppose 13r - 20288 = 6310. What is the least common multiple of 88 and r? 8184 Let a = 898 + -619. Calculate the lowest common multiple of a and 10. 2790 Let z = -392/169 - -78301/28730. Calculate the common denominator of -43/2176 and z. 10880 Calculate the common denominator of 65/21 and 1 + 3 + 71535/(-18225). 8505 Let s = 1642 + -490936/299. Calculate the common denominator of 3/874 and s. 11362 Suppose n + 2u - 12 = 9, -2n + 2u = -48. Suppose -ni - 485 = -28i. Calculate the smallest common multiple of 10 and i. 970 Suppose -4x + 1280 = -3b, 10x - 8 = 6x. What is the common denominator of -40/71 and b/(-12)2/(-6 - -10)? 213 Let u = 2 + 6. Let f(b) = -514b3 + b2 - 4b + 4. Let m be f(1). Let g = 557 + m. What is the lowest common multiple of u and g? 88 Suppose 0 = 60l - 178l + 3186. What is the lowest common multiple of l and 16455? 148095 Let r = 375642367/81455 - 812/7405. Let p = r - 4615. What is the common denominator of -64/9 and p? 99 Calculate the common denominator of 9 + (-1036)/96 + 3 and -83/366. 1464 Let y(b) = -11 + 29 - 10 - 11b + b*2. Let c be -2 + (-9)/(-6) - 69/(-6). Calculate the least common multiple of 11 and y(c). 88 Suppose -3d + 432 = 4s, -2d + 78s = 75s - 305. Let k = 22 + -21. Calculate the least common multiple of k and d. 148 Suppose 5p + 37 = -m + 18, -2p - 2m = 14. Let z(o) = -o2 + 21. What is the lowest common multiple of z(p) and 9? 36 Suppose -192 + 370 = -17i + 382. Suppose -q = -3x + 37, -x + 2x - q = 11. Calculate the least common multiple of i and x. 156 Let h = -37356062233/67694658460 - 730/3457337. Let r = h + 2/979. Find the common denominator of (10/12)/((-22)/(-18)) and r. 220 Let t = -149483/16 + 9337. Let u = 3225/2 - 1660. Calculate the common denominator of t and u. 16 Suppose 3g - 10792 = 2w, -3w = -2g + 20378 - 4185. Let u = w - -86283/16. Calculate the common denominator of u and 35/8. 16 Suppose -23w + 785 = -1354 - 2047. Calculate the lowest common multiple of w and 9. 1638 Let n = 130663 - 33972421/260. Calculate the common denominator of -79/56 and n. 3640 Let z(m) = -12m - 9. Suppose 1284 = 38f - 1224. What is the lowest common multiple of z(-3) and f? 594 Let i be 1(-128)/12 + 4/6. Let z be i/(-35)(55/2 - 2). Let r = -821/105 + z. Find the common denominator of r and -56/33. 165 Suppose 5a = 2o + 282813, 5a + 4o - 3179 = 279640. Let j = -3733241/66 + a. What is the common denominator of j and 7/24? 264 Suppose -2p - 3m = 43, 2p - 2m - 14 = -52. Find the common denominator of 1/(-3) - (-41)/12 and (-4)/((-480)/455) - p/(-15). 24 Suppose 7z + 0z - 35 = 0. Let m(a) = -a2 + 5a + 15. Let x be m(z). Suppose 3*q - x = 3. What is the smallest common mu	{ "pile_set_name": "DM Mathematics" }
*3 + 87922s*2 + 163? 113072802 Find the second derivative of 5s*3u - 23695s2u - 28s2 + 10su - 54s - 128u wrt s. 30su - 47390u - 56 What is the first derivative of 63n4 - 17858n + 789852? 252n3 - 17858 What is the second derivative of -125814f*3 + 81f*2r*2 + 2f*2 + fr*2 - fr + 5f - 192184r*2 - 1 wrt f? -754884f + 162r2 + 4 What is the third derivative of 3930f*3y*3 - 124f*3y - 287037f2y*3 wrt f? 23580y*3 - 744y What is the third derivative of -143528093w5 + 45w*2 - 120882 wrt w? -8611685580w*2 Find the first derivative of -222l*3 + 10l*2 + 12456l - 227313303 wrt l. -666l2 + 20l + 12456 What is the second derivative of 10448l3 + 192l*2 + 15441525l wrt l? 62688l + 384 Differentiate 2611fhm*2t + 16233fhm2 + 59fm2t - 74fm*2 + ft + 791f wrt h. 2611fm2t + 16233fm*2 What is the second derivative of -248088173b*2p + 2bp + 6231475b wrt b? -496176346p What is the third derivative of -102232271g3t - 56552g2t - 1139t wrt g? -613393626t Find the third derivative of 23323057g5 + 17g*3 + 32g*2 - 10067235. 1399383420g*2 + 102 Find the third derivative of 258718856y*4 + 235217314y*2 wrt y. 6209252544y What is the third derivative of 1745583w3z*3 - 3w*3z + 8149w2z*2 - 41wz3 - wz + z wrt w? 10473498z3 - 18z What is the third derivative of -6242133y5 - 3y*3 - 26y*2 + 636762 wrt y? -374527980y*2 - 18 Find the third derivative of -199940sw4 + 219289sw2 + 500sw + 1053w*4 - 1 wrt w. -4798560sw + 25272w Find the second derivative of -19026ou*5 - 14ou - 13o - 405u5 + 965u + 24 wrt u. -380520ou*3 - 8100u*3 What is the second derivative of 222793937j*3 + 659718801j wrt j? 1336763622j What is the derivative of -215ls2 - 3ls + 18141581l - 3415s2 wrt s? -430ls - 3l - 6830s Find the third derivative of -j2k*4 - 28458835j*2k*3 - 2j*2k*2 + 11j*2 + 53j + 23k2 - k - 3 wrt k. -24j*2k - 170753010j2 What is the first derivative of -12a*3t + 213546134a3 + a2t + 72149at - 10t wrt t? -12a3 + a2 + 72149a - 10 What is the first derivative of 10b*2r*2 - 3394b*2 - 2br + 27b - 65678752r2 wrt b? 20br2 - 6788b - 2r + 27 What is the first derivative of 18651827q - 5031392? 18651827 What is the first derivative of -79316306w3 + 70880226? -237948918w*2 What is the second derivative of -5274121i*2ku3 - 2i*2ku - 401iku - 861i + 61u*3 - 2u wrt u? -31644726i2ku + 366u What is the third derivative of 7535c5 - 17697c*4h*2 - 512c*2 - 66519ch2 wrt c? 452100c*2 - 424728ch2 What is the derivative of -225107830a*2w - 392991280a2 wrt w? -225107830a*2 Find the first derivative of -54l*4 + 626609l - 107926564. -216l3 + 626609 What is the third derivative of -54455428h*4 + 496182h*2? -1306930272h What is the derivative of 10093046u + 12704313? 10093046 What is the derivative of -1909973l*3 + 12l*2n - 15646860n wrt l? -5729919l*2 + 24ln What is the first derivative of -2lw3 + 9lw2 + 534925l - 23965w - 31 wrt w? -6lw2 + 18lw - 23965 What is the derivative of 8280x*3 - 205x*2 - x - 6185855 wrt x? 24840x*2 - 410x - 1 Find the first derivative of -761i3y2 + i3 - 3i2 - 5162i - 1634y2 - 6 wrt y. -1522i*3y - 3268y Find the third derivative of 8981337u*3y*2 - 3u*3y - 2u3 + 167131834u*2y - 2y2 wrt u. 53888022y*2 - 18y - 12 What is the third derivative of -1943154v6 - 8705815v*2 wrt v? -233178480v*3 Find the second derivative of 395nsv*2 - ns - 272nv*2 + 2sv2 - 85230804sv - 18v*2 wrt v. 790ns - 544n + 4s - 36 Find the third derivative of -63o*5 + 168126o*4 + 27612123o*2. -3780o*2 + 4035024o Find the third derivative of -104990617q3 + 8142818q*2 wrt q. -629943702 What is the first derivative of 2c*4 - 5041135c*3y*3 - 5y*3 + 45666y*2 + 1 wrt c? 8c*3 - 15123405c*2y*3 What is the second derivative of 45687199x*3 + 3x*2 + 183523342x wrt x? 274123194x + 6 What is the derivative of 120433499q*3t + 111q3 + 2q*2 + 1085q + 27 wrt t? 120433499q3 Find the third derivative of 838k*5 - 8971k*3 + 7787517k*2. 50280k*2 - 53826 What is the second derivative of 517572kw3 + 11681kw + 197k - 8w3 wrt w? 3105432kw - 48w Differentiate -6j4 - 2j*2 + 35768j - 6309505 wrt j. -24j3 - 4j + 35768 Find the third derivative of 79995383u5 + 12578u*2 + u + 1091 wrt u. 4799722980u*2 Find the first derivative of -248px + 36548p + 245x + 30727 wrt p. -248x + 36548 What is the derivative of -1524012m + 8716609? -1524012 What is the derivative of -188474a*3 + 125a*2 + 71967347? -565422a*2 + 250a What is the third derivative of 33237540r6 + 219r*2 + 38r - 1395 wrt r? 3988504800r3 What is the second derivative of 63807241t*5 - 6862t + 330 wrt t? 1276144820t3 What is the derivative of 62081g*2k2 + g2 + 7gk*2 + 292k*2 - 4842k wrt g? 124162gk*2 + 2g + 7k2 Find the first derivative of -388810568q*4 + 429560688. -1555242272q*3 Find the first derivative of -627986070a - 574470985 wrt a. -627986070 What is the third derivative of w*5 - 1772019w*4 + 8w3 - w2 - 7175224? 60w2 - 42528456w + 48 What is the derivative of 22547n2w*2 - nw*2 + 55n - 291w2 - 173715 wrt n? 45094nw2 - w2 + 55 Find the second derivative of 377r*2z*2 - 3591r*2 + 2467rz2 - 248rz wrt z. 754r*2 + 4934r Find the first derivative of -9184281s2 + 16094745 wrt s. -18368562s Find the third derivative of 16040872k3x*3 - 8k*3x*2 - 2k*3x - 41614k2x*2 - 4k*2 - 4x + 1 wrt x. 96245232k3 What is the second derivative of 13220666i*3 + 171496i + 86? 79323996i Find the first derivative of 10591j*2 - 184jq + 184680q - 13 wrt j. 21182j - 184q Find the first derivative of -30150m2 - 44m + 28952287 wrt m. -60300m - 44 Find the second derivative of 13i*4 - 2303i*3 - 5i*2 - 4290081i. 156i2 - 13818i - 10 Find the third derivative of 275618412f3i + 6f2i + 2296097i wrt f. 1653710472i Differentiate -13v3 - 907882v*2 - v - 131474306 with respect to v. -39v*2 - 1815764v - 1 What is the third derivative of -l*6 + 4174659l*5 - 63l*2 + 59752l + 2? -120l3 + 250479540l*2 Differentiate -309911dn3 - dn*2 + 26146836n*3 with respect to d. -309911n3 - n2 Find the second derivative of 354050458k4 - 61k + 91850 wrt k. 4248605496k2 Find the third derivative of 1268q*5 - 2q*4 - 2093q*3 - 313674q*2 + 25 wrt q. 76080q*2 - 48q - 12558 What is the second derivative of 18f5z*3 + 100592f*2z*3 - 356fz3 + 16f - 27z3 wrt f? 360f*3z*3 + 201184z*3 Find the first derivative of 1484h*4n*3 + 77110hn3 + 296047n*3 + 2n*2 - 160n + 1 wrt h. 5936h3n*3 + 77110n*3 What is the third derivative of 8140921b*4 - 5576776b*2 wrt b? 195382104b What is the third derivative of -9984675g6 - g5 + 2g*2 - 3932820g - 2 wrt g? -1198161000g3 - 60g*2 What is the second derivative of -176044209cm2 + 268cm + c - 2m - 2465 wrt m? -352088418c Find the third derivative of -445260k*3r4 - k3r3 - 6k*3r*2 - 3k*3r - k*2 - 805kr2 - 6k + 2r wrt r. -10686240k*3r - 6k3 Find the second derivative of 20726087v*2 - 1159261190v. 41452174 Find the third derivative of 8260854x3 + 65689x*2 + 1029 wrt x. 49565124 Find the third derivative of -184038184r*5 - 90481068r*2. -11042291040r*2 Find the second derivative of 81054088n*2 - 88462334n. 162108176 Find the second derivative of -10t3w*2 + 7t*3w + 7t3 - 1085t*2w2 - t2w - 2tw + 12654t + 88w2 wrt w. -20t*3 - 2170t*2 + 176 What is the third derivative of 420682n*3 + 6962622n*2 wrt n? 2524092 What is the second derivative of 48052i*2t + 4i2 + 3it - 2344228i - 2t wrt i? 96104t + 8 Differentiate 38967it + 75i + 135055435t with respect to i. 38967t + 75 Find the second derivative of -147p*5 - 46397p*2 + 8567613p - 2 wrt p. -2940p*3 - 92794 Find the secon	{ "pile_set_name": "DM Mathematics" }
Let k(g) = -369g - 66. Let x(w) = 164k(w) + 3q(w). Let r(t) = -9t*2. Give x(r(p)). -3321p*2 Let q(m) = 536724m - 5. Let p(n) = -7n. Give q(p(c)). -3757068c - 5 Let x(z) = -2z2 - 3z. Let m(c) = 4c2 + 5c. Let n(o) = -3m(o) - 5x(o). Let d(t) = 62t - 32t + 28t2 - 72t*2 - 30t. What is d(n(s))? -176s4 Let j(w) = -37w*2. Suppose -97 = -2a + k, 0 = -5k + 2k + 9. Let o(h) = -115h2. Let n(m) = -14m*2. Let c(g) = an(g) - 6o(g). Determine j(c(p)). -3700p*4 Let w(g) = 28g. Let n(s) = -233927s. Determine n(w(d)). -6549956d Let f(d) = -272d2. Let h(o) be the third derivative of 13o*5/60 - 2178o*2. Calculate h(f(p)). 961792p*4 Let a(p) be the third derivative of 86p + 1/30p5 + 0p*3 + 0p4 - p2 + 0. Let s(q) = 4q2 - q. Determine s(a(r)). 16r*4 - 2r*2 Let c(q) = -3q*2 - 2q + 2. Let i(u) = 0u2 - u - u2 + 3 - 2. Let v(d) = c(d) - 2i(d). Let b(g) = -3225g + 3225g - g2. Calculate v(b(m)). -m4 Let n(m) = -67m. Let u(a) = -289a - 612. Let f(o) = -2o - 4. Let j(p) = -153f(p) + u(p). Determine j(n(x)). -1139x Let q(r) be the second derivative of -13r*4/6 + 4r. Suppose -2k = 5a - 2, -3a = -0k - k + 1. Let d(n) = n + n - n + an. Determine q(d(w)). -26w*2 Let u(n) = 5n + 77. Let m be u(-15). Let k(l) = 20lm - 12l*2 - 4l*2 - 6l*2. Let b(f) = 42f - 2f2 - 2 + 2 - f. Calculate b(k(a)). -8a*4 - 82a*2 Let c(i) = 24i + 5. Let h(f) = 3f + 5. Let m(k) = c(k) - h(k). Let g(z) = 2z*2 - 36. What is m(g(a))? 42a2 - 756 Let j(b) = -b2. Let w(h) = -11h + 3. Let t(u) = -17640u + 1008. Let o(g) = -t(g) + 336w(g). What is o(j(p))? -13944p2 Let l(h) be the first derivative of h3 + 26935. Let n(p) = p - 48p - 11p. Calculate l(n(z)). 10092z2 Let x(p) = 11306p + 11323p - 22602p. Let u(s) = -4s - 5. Calculate x(u(j)). -108j - 135 Let q(k) = k*2 + 34 + 28 - 101 + 39. Let z(d) be the second derivative of 0 - 3d + 1/2d3 + 0d*2. Determine q(z(s)). 9s*2 Let p(j) = -622075j. Let d(r) = 11r2. Give d(p(x)). 4256750361875x*2 Let x(f) be the third derivative of -7f*5/30 - 2335f*2. Let y(a) = 134a*2. Calculate y(x(l)). 26264l*4 Let f(y) = -39y - 25. Let d(v) = 8v + 5. Let x(o) = 5d(o) + f(o). Let n(k) = 1469k2. Give x(n(w)). 1469w*2 Let x(r) = 3r. Let s(c) = c - 15718425. What is x(s(v))? 3v - 47155275 Let v(t) = 13t*2 + 212t - 17. Let x(i) = -6i2 - 92i + 8. Let r(b) = -8v(b) - 17x(b). Let m(j) = -21j2. Give r(m(y)). -882y*4 + 2772y*2 Let m(j) = 3864j. Let y(z) = -437z - 81. What is m(y(x))? -1688568x - 312984 Let p(m) be the second derivative of -m*4/6 + m. Let c(y) = -854729701 + 57y + 77y + 854729699. Give c(p(s)). -268s2 - 2 Let u(q) = -q2. Let o(f) be the third derivative of 26f2 + f + 0 - 13/8f*4 + 0f*3. Give u(o(m)). -1521m*2 Let w(u) = 6u*2 - 463u. Let y(p) = 7165p. What is w(y(g))? 308023350g*2 - 3317395g Let d(t) = t. Let y(m) be the third derivative of 0m4 + 0 + 59m*2 - 91/60m*5 + 0m + 0m3. Calculate d(y(h)). -91h*2 Let b(w) = w + 13328696 - 13328696. Let n(o) = 28o - 1. Calculate b(n(y)). 28y - 1 Let x(h) = -18h. Let g(q) = 12q2 - 9q - 9. Let u(r) = -r*2 + r + 1. Let v(t) = -2g(t) - 18u(t). What is x(v(z))? 108z*2 Suppose 437 = 25o + 312. Let n(h) be the third derivative of -oh2 + 0h + 0h3 + 0 + 2/3h*4. Let z(m) = 2m*2. Determine z(n(u)). 512u*2 Let s(x) = 2x2 - 1 + 2 + 7. Let v(k) = -k2 - 5. Let o(f) = -5s(f) - 8v(f). Let r(l) = -374 + 43l - 45l + 374. Calculate r(o(n)). 4n2 Let l(u) = -6u + 16. Let i(b) = b*3 + 4b*2 + 2b + 12. Let h be i(-4). Let z(w) = -5w + 1359 + hw - w - 1359. Give z(l(r)). 12r - 32 Let v(w) = w2. Let b(m) = -11778m*2 - 6220. Give b(v(i)). -11778i*4 - 6220 Let z(o) = 41o. Let t(i) = 179726i + 1. Calculate z(t(l)). 7368766l + 41 Let m(c) = -86c - 8 + 8 + 90c. Let l(d) = 267d2. What is l(m(q))? 4272q*2 Let d(x) = -15x. Let i(h) = 4h - 40. Let b be i(-7). Let c = 94 + b. Let t(q) = -13q + cq - 12q. Give d(t(l)). -15l Let p(f) = -53f - 1. Let g(a) = 167a2 + 22a. Determine g(p(r)). 469103r2 + 16536r + 145 Let i(p) be the first derivative of 0p - 3/2p*2 + 67. Let r(u) be the first derivative of -7u*3/3 - 1. Determine r(i(f)). -63f*2 Let a(l) = 12l. Suppose 2x = 7x - 10, 4u + 4x = -44. Let m be (2 + u)/(-6 + 5). Let o(y) = -4y. Let d(i) = 2i. Let c(w) = md(w) + 6o(w). Give a(c(g)). -24g Let q = -216 + 222. Let x(w) = -4w - 3w + 4w - qw. Let p(a) = -5a*2. Calculate p(x(m)). -405m*2 Let o(p) be the second derivative of -5p*4/12 - p. Let g(b) be the second derivative of 2b*3/3 + 875b. Determine o(g(a)). -80a2 Suppose -2y + 6542 = 5q, 10y + 4q - 6540 = 8y. Let h(p) = yp - 4 - 3268p + 4. Let m(o) = o*2 + 135o. Calculate h(m(d)). -2d2 - 270d Let s(q) = -q. Let x(i) = 4i - 7167583. Calculate s(x(t)). -4t + 7167583 Let i(t) = 1692801t2. Let y(w) = -82w. Give i(y(k)). 11382393924k2 Let h(k) = 82k. Let p(s) be the first derivative of 2s3/3 - 2019. Calculate p(h(q)). 13448q*2 Let t(k) = -k + 23. Let a = 929 + -946. Let y(b) = -2b + 0b + 69 - b. Let h(p) = at(p) + 6y(p). Let w(l) = -l. Determine h(w(z)). z + 23 Let c(h) = 1126h - 2. Let u(t) = -3799t + 3799t + t*2. Give c(u(s)). 1126s*2 - 2 Let o(b) be the third derivative of 11b8/2880 - b6/720 + 13b5/20 + 2b2 - b. Let a(m) be the third derivative of o(m). Let g(v) = -v2. Give g(a(j)). -5929j4 + 154j2 - 1 Let o(w) = -w2. Let t(z) = -2z2 - 4338z + 22. Calculate t(o(c)). -2c4 + 4338c*2 + 22 Let h(v) = -34166v - 820v2 + 34166v + 41v2. Let u(s) = -3s. Determine u(h(w)). 2337w2 Suppose 0 = -44g + 46g - 110. Let a = g - -115. Let v(j) = 161j*2 + aj*2 - 335j*2. Let r(y) = 6y. What is v(r(f))? -144f2 Let p(t) = -5895t + 485 + 17684t - 5896t - 5891t. Let c(a) = -3a*2. Determine p(c(z)). -6z*2 + 485 Let g(t) = -79487t*2 - 12120. Let k(v) = 105v*2 + 16. Let w(u) = 2g(u) + 1515k(u). Let b(c) = -16c*2. Determine w(b(y)). 25856y*4 Let x(t) = -223632t. Let p(m) = 44m. Give p(x(j)). -9839808j Let w(j) = -3j + j + 3j. Let b(l) = 9l2 - 2l + 35. Let t(v) = -28v2 + 7v - 121. Let p(q) = -7b(q) - 2t(q). What is p(w(r))? -7r2 - 3 Let p(b) be the first derivative of 13 - 4b*2 - 12 + 2b*2 + 17. Let c(q) = -1. Let s(v) = 2v*2 + 5. Let w(y) = 5c(y) + s(y). Determine p(w(g)). -8g2 Let s(k) = 2k*2 - 70k + 71. Let y be s(34). Let v(x) = 23x - 6x + 2x - 1 + yx - 12x. Let f(a) = -3a*2. Calculate v(f(i)). -30i*2 - 1 Let m(g) = 7g*2. Let i(d) = 11026357d. What is i(m(c))? 77184499c2 Let h(w) = -18w - 24. Let a be (-4 + 84/18)/((-1)/18). Let q(y) = y + 2. Let d(f) = aq(f) - h(f). Let b(j) = 3j. What is d(b(g))? 18g Let i(j) be the second derivative of -3169j*3/2 - 3j + 40. Let r(p) = p. Calculate r(i(u)). -9507u Let k(z) = -6z2. Let m(o) = -o2 + 10o. Let u(j) = -726j*2 - 50j. Let y(f) = -5m(f) - u(f). What is y(k(h))? 26316h*4 Let k(z) = 11120z*2 - z + 57. Let y(q) = 7q - 2. What is y(k(l))? 77840l2 - 7l + 397 Let l(q) = 3q - 6. Let b = 162 - 158. Let d(c) = -5c - 4c + 2c + bc. Determine d(l(a)). -9a + 18 Let k(o) be the second derivative of o*4/3 - 3436o - 2. Let b(q) = -2 - 103q + 1 + 3. Give k(b(c)). 42436c*2 - 1648c + 16 Let g(b) = -2b2. Let s(x) be the second derivative of -61x6/720 + x5/60 + 287x4/12 - 213x. Let m(o) be the third derivative of s(o). Give g(m(t)). -7442t2 + 488t - 8 Let n(a) = -19a2. Suppose 441 = 3l + 441. Let w(u) be the third derivative of 0 - 19u2 + 0u*3 + 0u*4 + lu - 1/30u5. Calculate n(w(y)). -76y4 Let y(c) be the third derivative of c5/30 + 33c3 + 2c*2 - 964c. Let n(s) = 2s2. Give n(y(b)). 8b*4 + 1584b*2 + 78408 Let l(q) = 9q + 45. Let z(v) = 15. Let r(c) = l(c) - 3z(c). Let x(k) = -165k. Calculate r(x(d)). -1485d Let r(c) = -17c. Let i(t) = 12t2 - 412t + 2. Give i(r(z)). 3468z2 + 7004z + 2 Let i(x) = -155035504x2. Let k(d) = -2d*2. Determine i(k(t)). -620142016t*4 Let w(o) = -11o*2. Suppose 0n + 14n = 2058. Let a(y) = 80y + 6y*2 - n	{ "pile_set_name": "DM Mathematics" }
What is the highest common divisor of 148 and 4181? 37 What is the greatest common factor of 16 and 2896? 16 Calculate the greatest common factor of 5004 and 96. 12 Calculate the greatest common factor of 5747 and 14. 7 What is the greatest common divisor of 80 and 16? 16 Calculate the greatest common divisor of 3762 and 114. 114 Calculate the greatest common factor of 1744 and 48. 16 Calculate the highest common factor of 581 and 7. 7 What is the highest common divisor of 123 and 1927? 41 What is the greatest common factor of 448 and 21? 7 What is the highest common factor of 77 and 7? 7 Calculate the greatest common divisor of 28 and 44. 4 Calculate the highest common divisor of 58 and 6090. 58 What is the greatest common factor of 595 and 35? 35 What is the greatest common divisor of 73 and 1? 1 Calculate the greatest common divisor of 12 and 42. 6 Calculate the highest common factor of 518 and 14. 14 Calculate the highest common divisor of 20 and 10. 10 Calculate the greatest common factor of 423 and 18. 9 What is the greatest common factor of 14982 and 22? 22 Calculate the greatest common factor of 308 and 20. 4 Calculate the greatest common factor of 873 and 9021. 291 What is the greatest common factor of 55 and 517? 11 Calculate the highest common divisor of 1276 and 464. 116 What is the greatest common factor of 171 and 6612? 57 What is the greatest common divisor of 90 and 522? 18 Calculate the greatest common divisor of 2691 and 13. 13 Calculate the greatest common factor of 99 and 561. 33 Calculate the greatest common factor of 3 and 753. 3 Calculate the highest common divisor of 210 and 560. 70 What is the greatest common factor of 1079 and 498? 83 Calculate the greatest common factor of 2250 and 1150. 50 Calculate the highest common factor of 18 and 24. 6 What is the greatest common factor of 22 and 22? 22 What is the highest common factor of 143 and 26? 13 What is the greatest common factor of 981 and 1199? 109 What is the highest common factor of 3596 and 434? 62 Calculate the highest common factor of 1184 and 64. 32 Calculate the greatest common divisor of 188 and 1222. 94 Calculate the highest common divisor of 1472 and 128. 64 What is the greatest common divisor of 9694 and 74? 74 Calculate the greatest common divisor of 2592 and 576. 288 Calculate the greatest common divisor of 32 and 304. 16 Calculate the greatest common factor of 10 and 310. 10 What is the greatest common divisor of 87 and 464? 29 Calculate the highest common divisor of 1631 and 63. 7 Calculate the highest common factor of 330 and 150. 30 Calculate the highest common divisor of 570 and 30. 30 Calculate the greatest common divisor of 87 and 8439. 87 What is the highest common factor of 3611 and 368? 23 What is the greatest common factor of 1038 and 96? 6 Calculate the highest common divisor of 87 and 30. 3 What is the highest common factor of 64 and 1200? 16 What is the greatest common divisor of 3664 and 80? 16 Calculate the highest common divisor of 1 and 307. 1 What is the highest common divisor of 560 and 1232? 112 Calculate the greatest common factor of 57 and 969. 57 Calculate the greatest common divisor of 25 and 100. 25 Calculate the greatest common factor of 432 and 96. 48 What is the greatest common factor of 18 and 826? 2 What is the greatest common factor of 60 and 330? 30 What is the highest common divisor of 178 and 979? 89 What is the highest common divisor of 7284 and 108? 12 What is the greatest common factor of 34240 and 16? 16 What is the greatest common divisor of 31 and 3937? 31 What is the highest common divisor of 8 and 216? 8 Calculate the highest common factor of 70 and 620. 10 What is the greatest common divisor of 126 and 2814? 42 What is the greatest common factor of 75 and 552? 3 Calculate the highest common factor of 5 and 55. 5 What is the highest common divisor of 44 and 297? 11 What is the highest common divisor of 6 and 2658? 6 What is the greatest common divisor of 29 and 493? 29 Calculate the greatest common factor of 284 and 10. 2 What is the greatest common factor of 5 and 10? 5 What is the highest common factor of 319 and 55? 11 What is the greatest common factor of 16 and 4160? 16 What is the greatest common divisor of 5624 and 152? 152 Calculate the highest common divisor of 14688 and 54. 54 Calculate the greatest common divisor of 58674 and 21. 21 Calculate the highest common factor of 37301 and 11. 11 What is the highest common divisor of 282 and 376? 94 Calculate the greatest common factor of 9 and 261. 9 What is the greatest common divisor of 5532 and 12? 12 Calculate the highest common factor of 99 and 6381. 9 Calculate the highest common factor of 495 and 27. 9 What is the highest common divisor of 15 and 36? 3 Calculate the greatest common factor of 20 and 540. 20 What is the highest common divisor of 74 and 17834? 74 What is the highest common divisor of 232 and 696? 232 What is the highest common factor of 4898 and 632? 158 Calculate the greatest common divisor of 4 and 497. 1 What is the greatest common divisor of 3885 and 231? 21 Calculate the greatest common divisor of 561 and 132. 33 What is the highest common factor of 14406 and 42? 42 Calculate the highest common factor of 196 and 98. 98 Calculate the greatest common divisor of 38 and 1463. 19 What is the greatest common divisor of 1134 and 1917? 27 Calculate the greatest common divisor of 4 and 46. 2 What is the greatest common factor of 245 and 539? 49 What is the highest common factor of 984 and 336? 24 Calculate the highest common factor of 1690 and 10. 10 What is the highest common divisor of 5 and 61? 1 Calculate the highest common factor of 41 and 13489. 41 What is the greatest common factor of 7 and 1701? 7 What is the highest common divisor of 143 and 187? 11 Calculate the greatest common factor of 195 and 26. 13 Calculate the greatest common factor of 12 and 128. 4 What is the highest common factor of 50 and 3860? 10 What is the highest common factor of 55 and 125? 5 What is the greatest common factor of 1955 and 85? 85 Calculate the highest common factor of 7560 and 2205. 315 Calculate the highest common factor of 7357 and 7. 7 Calculate the highest common divisor of 75 and 650. 25 What is the highest common divisor of 42 and 378? 42 What is the greatest common factor of 2480 and 3224? 248 Calculate the highest common divisor of 5820 and 60. 60 What is the greatest common factor of 171 and 216? 9 What is the highest common factor of 11 and 1727? 11 What is the highest common factor of 340 and 20? 20 Calculate the greatest common divisor of 210 and 56. 14 Calculate the highest common divisor of 512 and 216. 8 What is the greatest common divisor of 548 and 16? 4 Calculate the greatest common divisor of 24 and 84. 12 Calculate the greatest common factor of 68 and 918. 34 Calculate the greatest common factor of 28 and 28. 28 What is the greatest common factor of 266 and 38? 38 What is the highest common divisor of 132 and 33? 33 Calculate the highest common factor of 62 and 806. 62 Calculate the greatest common divisor of 84 and 98. 14 Calculate the highest common factor of 253 and 44. 11 Calculate the highest common divisor of 200 and 5900. 100 Calculate the greatest common factor of 52 and 273. 13 What is the greatest common factor of 175 and 14? 7 Calculate the greatest common divisor of 5488 and 16. 16 Calculate the highest common divisor of 12 and 28. 4 Calculate the greatest common divisor of 442 and 52. 26 Calculate the highest common factor of 2 and 2010. 2 Calculate the highest common factor of 12 and 37428. 12 What is the highest common divisor of 837 and 243? 27 What is the highest common divisor of 2793 and 3705? 57 Calculate the highest common divisor of 41 and 1. 1 Calculate the highest common factor of 265 and 5. 5 What is the highest common factor of 18718 and 7? 7 Calculate the greatest common divisor of 9207 and 108. 27 What is the highest common divisor of 6161 and 183? 61 What is the highest common factor of 7252 and 592? 148 Calculate the greatest common factor of 76 and 361. 19 What is the highest common factor of 637 and 104? 13 What is the highest common factor of 33 and 957? 33 What is the greatest common factor of	{ "pile_set_name": "DM Mathematics" }
e hundreds digit of 805356? 3 What is the hundreds digit of 10325106? 1 What is the hundred thousands digit of 452103? 4 What is the thousands digit of 838600? 8 What is the thousands digit of 196577? 6 What is the hundreds digit of 49952? 9 What is the ten thousands digit of 980516? 8 What is the hundred thousands digit of 848118? 8 What is the hundreds digit of 3483900? 9 What is the thousands digit of 2251314? 1 What is the ten thousands digit of 13410158? 1 What is the ten thousands digit of 88890? 8 What is the units digit of 81127? 7 What is the tens digit of 9586226? 2 What is the millions digit of 9470824? 9 What is the units digit of 5027940? 0 What is the hundred thousands digit of 19505853? 5 What is the units digit of 584890? 0 What is the ten thousands digit of 58979? 5 What is the units digit of 1959009? 9 What is the hundred thousands digit of 1158010? 1 What is the units digit of 5352999? 9 What is the hundreds digit of 1340805? 8 What is the hundreds digit of 768716? 7 What is the thousands digit of 20414031? 4 What is the hundreds digit of 1198368? 3 What is the ten thousands digit of 32473887? 7 What is the units digit of 223588? 8 What is the units digit of 234796? 6 What is the hundreds digit of 6763341? 3 What is the units digit of 191028? 8 What is the ten thousands digit of 5791459? 9 What is the millions digit of 7018467? 7 What is the units digit of 10413649? 9 What is the hundreds digit of 1126457? 4 What is the hundred thousands digit of 1349704? 3 What is the thousands digit of 1545403? 5 What is the hundreds digit of 19510399? 3 What is the hundred thousands digit of 3529658? 5 What is the ten thousands digit of 13876178? 7 What is the hundred thousands digit of 1142925? 1 What is the units digit of 10122539? 9 What is the thousands digit of 342817? 2 What is the units digit of 528817? 7 What is the hundreds digit of 1408346? 3 What is the units digit of 4210247? 7 What is the units digit of 2092947? 7 What is the millions digit of 1699497? 1 What is the units digit of 1266398? 8 What is the hundreds digit of 10807? 8 What is the ten millions digit of 29742002? 2 What is the thousands digit of 315403? 5 What is the units digit of 893680? 0 What is the units digit of 8833237? 7 What is the ten thousands digit of 206384? 0 What is the hundreds digit of 249665? 6 What is the hundred thousands digit of 763605? 7 What is the hundreds digit of 740039? 0 What is the thousands digit of 16469? 6 What is the thousands digit of 569310? 9 What is the millions digit of 1854771? 1 What is the millions digit of 1537742? 1 What is the units digit of 250684? 4 What is the tens digit of 2617764? 6 What is the tens digit of 280915? 1 What is the hundreds digit of 12515737? 7 What is the tens digit of 1327341? 4 What is the millions digit of 1288614? 1 What is the hundreds digit of 4300051? 0 What is the tens digit of 6113730? 3 What is the ten millions digit of 12071201? 1 What is the units digit of 26921? 1 What is the hundreds digit of 1646655? 6 What is the hundreds digit of 30695120? 1 What is the ten thousands digit of 43547? 4 What is the tens digit of 610502? 0 What is the tens digit of 7036035? 3 What is the thousands digit of 5266724? 6 What is the thousands digit of 4438673? 8 What is the hundreds digit of 304640? 6 What is the tens digit of 318664? 6 What is the ten thousands digit of 487410? 8 What is the hundreds digit of 2156449? 4 What is the ten thousands digit of 4329680? 2 What is the hundred thousands digit of 4697876? 6 What is the hundred thousands digit of 5718880? 7 What is the millions digit of 6388016? 6 What is the tens digit of 750254? 5 What is the thousands digit of 687099? 7 What is the ten thousands digit of 6553794? 5 What is the millions digit of 1199887? 1 What is the hundreds digit of 81274? 2 What is the tens digit of 9392136? 3 What is the ten thousands digit of 397965? 9 What is the hundreds digit of 18079769? 7 What is the units digit of 7956678? 8 What is the tens digit of 82482? 8 What is the hundred thousands digit of 177369? 1 What is the units digit of 253632? 2 What is the units digit of 246360? 0 What is the thousands digit of 4671308? 1 What is the thousands digit of 349657? 9 What is the thousands digit of 65399? 5 What is the ten millions digit of 21184048? 2 What is the units digit of 1823026? 6 What is the hundreds digit of 2954401? 4 What is the hundred thousands digit of 809879? 8 What is the hundreds digit of 79642? 6 What is the ten millions digit of 25875584? 2 What is the millions digit of 4805852? 4 What is the hundred thousands digit of 7727375? 7 What is the tens digit of 3352904? 0 What is the ten thousands digit of 1525946? 2 What is the hundred thousands digit of 23425862? 4 What is the hundreds digit of 31018313? 3 What is the ten thousands digit of 328594? 2 What is the millions digit of 22117740? 2 What is the ten thousands digit of 4619192? 1 What is the tens digit of 95684? 8 What is the tens digit of 563694? 9 What is the thousands digit of 7653974? 3 What is the millions digit of 3593962? 3 What is the ten thousands digit of 37322? 3 What is the tens digit of 74155? 5 What is the units digit of 687188? 8 What is the hundred thousands digit of 1396340? 3 What is the millions digit of 4463582? 4 What is the tens digit of 1064103? 0 What is the hundreds digit of 161686? 6 What is the ten thousands digit of 617065? 1 What is the tens digit of 265830? 3 What is the millions digit of 7818834? 7 What is the hundreds digit of 1783375? 3 What is the thousands digit of 844309? 4 What is the hundreds digit of 4836713? 7 What is the units digit of 32123867? 7 What is the ten thousands digit of 141001? 4 What is the thousands digit of 2534891? 4 What is the ten thousands digit of 2106614? 0 What is the thousands digit of 2688428? 8 What is the hundred thousands digit of 528838? 5 What is the thousands digit of 6299313? 9 What is the units digit of 1130161? 1 What is the tens digit of 577337? 3 What is the hundred thousands digit of 5674331? 6 What is the millions digit of 4148453? 4 What is the hundreds digit of 350112? 1 What is the thousands digit of 2114158? 4 What is the thousands digit of 584860? 4 What is the hundred thousands digit of 591459? 5 What is the ten thousands digit of 642125? 4 What is the hundred thousands digit of 4908704? 9 What is the tens digit of 1683679? 7 What is the millions digit of 1955631? 1 What is the tens digit of 25171? 7 What is the thousands digit of 212334? 2 What is the ten thousands digit of 1296642? 9 What is the thousands digit of 771420? 1 What is the hundred thousands digit of 727002? 7 What is the hundred thousands digit of 148000? 1 What is the thousands digit of 393517? 3 What is the ten thousands digit of 2418108? 1 What is the hundreds digit of 3400783? 7 What is the units digit of 1062297? 7 What is the ten thousands digit of 3616825? 1 What is the thousands digit of 6052441? 2 What is the ten thousands digit of 72613? 7 What is the ten thousands digit of 956585? 5 What is the millions digit of 6271363? 6 What is the thousands digit of 2268310? 8 What is the millions digit of 2662407? 2 What is the thousands digit of 2072234? 2 What is the units digit of 20644? 4 What is the thousands digit of 2041882? 1 What is the hundred thousands digit of 2610663? 6 What is the hundred thousands digit of 1523703? 5 What is the tens digit of 93076? 7 What is the hundred thousands digit of 18667394? 6 What is the millions digit of 1505011? 1 What is the ten thousands digit of 13090596? 9 What is the units digit of 1325291? 1 What is the hundred thousands digit of 8484363? 4 What is the thousands digit of 128606? 8 What is the units digit of 11713436? 6 What is the millions digit of 1354794? 1 What is the thousands digit of 1478596? 8 What is the units digit of 6226983? 3 What is the thousands digit of 39457? 9 What is the hundred thousands digit of 1011678? 0 What is the units digit of 458882? 2 What is the hundreds digit of 187147? 1 What is the thousands digit of 21814225? 4 What is the thousands digit of 333381? 3 What is the thousands digit of 5970064? 0 What is the hundreds digit of 8909955? 9 What is the units digit of 144371? 1 Wha	{ "pile_set_name": "DM Mathematics" }
(g/(g(g/(g/(gg(-5))))/g))6/(g(-1/2)/g(1/6)))(1/5))(-1/24) assuming g is positive. g(-23/90) Simplify y(1/7)/((y/y*(-7))/y)y(yy(y/(y(-8)y))/y)/yyy*(2/11)(y(-3)/(y(-1/6)/y))/(yy(-2/7))(-10/9) assuming y is positive. y(3167/1386) Simplify ((y(-2/3)y)(-1/43))(2/77)/(y*(2/7)(y*5/y)/yy(-1)/(y5/yy)) assuming y is positive. y(26959/9933) Simplify ((p(-3/17)(p*(23/3)/p)/p)/(pp(-23))(-1/34))15 assuming p is positive. p(1235/17) Simplify ((b*8/(b/(bb/b*(1/10))bb))(-5/8))(16/5) assuming b is positive. b(-69/5) Simplify (i37)(1/12)ii(-30)ii(-3) assuming i is positive. i(-335/12) Simplify (w/(w/w(-2)))(-10/3)w*(-8)ww/w0(www*5w)/(w/(ww(2/7))w)(w/w(-1))(-12/11) assuming w is positive. w(1333/231) Simplify (l5/l(2/9))(-19)l*1ll(-6)l(l/(ll(l/l0)/l))6 assuming l is positive. l(-898/9) Simplify ((z1/z)(1/53))(-25)(z/(z(z(-2/7)z)/z))(1/70)/(z/(z(1/2)/z))(4/7) assuming z is positive. z(-209/245) Simplify ((y(1/6)/y)24)*(-27)(y8/(y(-8)y))36 assuming y is positive. y1080 Simplify n(3/8)/nn*4(n/(nn/n(-2/3)n))*(17/4)(n0)(-9/2)/(n*(1/5)nn3) assuming n is positive. n(-1459/120) Simplify (h(2/5)/h)(-19)/(h0/h(1/9))(h(-1/2))(1/3)(h2)(-7) assuming h is positive. h(-239/90) Simplify (t/(t/t6t)t/(t/t(2/17))tt4tt(-1/4)/tt)/(((tt/(t(-2/17)t))/tt(-2)/t)/(t(-2/5)/t)49) assuming t is positive. t(-1097/20) Simplify ((j(2/21))(16/7)/(j/j4(j*(2/29)/j)/jj))32 assuming j is positive. j(565952/4263) Simplify (((n/(n/(nn42)))(-30/13))(-4))(-6/7) assuming n is positive. n(-30960/91) Simplify (t0t/(t*(-13/2)/t)(t*0t)(-3/17))(-33) assuming t is positive. t(-9339/34) Simplify (((z(-3)z)/z)/((zzz0)/zz))/(((zz/z(1/4)z)/z)/zz8/z)(z(-1))37/(((z/z*(-4/7)z)/z)/zzzz(-2/3)) assuming z is positive. z(-4339/84) Simplify o(1/3)/(o(-2/5)/o)(o/o(2/3))/o(-1/9)((o/(oo/((oo0oo)/o))o)37)(-21) assuming o is positive. o*(-69832/45) Simplify ((iii/(ii*(-4))i)/i*(-1/5)i*(-1/9)/(i/((ii(ii/(i/(i*(-3/10)i)))/i)/i)))/((i(-1))(-50)/(i(-2/5))33) assuming i is positive. i(-4987/90) Simplify ((d/d(-10/13))/dd(2/47))/(d(1/8)d)(-14) assuming d is positive. d(40477/2444) Simplify ((v(-2/33)/v(-2/3))/(v*(9/4)v(-4/3)))19 assuming v is positive. v(-779/132) Simplify (q(-7/3)qq(1/12))/((((q(1/4)/qqqqq)/q)/qq)/((q/q(-8))/q))((q(-3/4))(1/2))47 assuming q is positive. q(-105/8) Simplify ((www(-2/7))16/((w/w(-5/3))/w(-2/3)))/((w(-3)/(w(4/3)/w))/(w*(-3/4)ww(1/5))) assuming w is positive. w(3903/140) Simplify ((cc/(c*(-5)/c)c/(((c/c(-4/3))/c)/c))(-38))(-33) assuming c is positive. c10868 Simplify (h(-6/11))(-2/9)(hh26)/h(1/16) assuming h is positive. h(14287/528) Simplify (r1)22/((r(1/9)r)/(r/r(1/8)))(r/(((rr/r(-2/3))/rrr)/r))(-49)(r*(-1/5)r)/(r/(r/((r*(-8)rr)/r))r) assuming r is positive. r(39683/360) Simplify (b/b(-1/4)b6(b/b0)31)/(((b*(4/5)/b)/b)/(bb*(-4/9)b))40 assuming b is positive. b(5345/36) Simplify ((c*(-12/7)c(cc/(((cc/(ccc11))/c)/c))/c)/(c(-1/7))(-17))(-14) assuming c is positive. c(-152) Simplify ((((((t(-2/9)t)/t)/t)/ttt)/tt)/(t/t(-1/4)tt)t*(1/5)t/t*1)/((tt(-1/4))(12/13)(t/(t1tt))/t4) assuming t is positive. t(4763/2340) Simplify (((s2)(-7/5)(s/(ss(-5/3)))/s(-1))(1/9))(-6) assuming s is positive. s(4/45) Simplify ((u/((u/u(-1/2))/u)u)/u(3/5))/(u/u0)*(2/21)((((u(4/5)/u)/u)/u)/u(-7))/(u/(u/(u*(1/8)/u))uuu(u6uuu)/u) assuming u is positive. u(-3797/840) Simplify ((t/(t(-2/5)t))/(tt(3/7)))(-1/24)/(((ttt/((tt(-1/4))/t)ttt)/tt)0t0/t(1/15)) assuming t is positive. t(23/210) Simplify ((b7)*(-4/15)b*(-11)b1)(-1/3) assuming b is positive. b*(178/45) Simplify (r/((rrr/((((r(-4/13)/r)/r)/r)/r))/r))/r(-22)((r*(20/7)rr)/r)(-2/13) assuming r is positive. r(1465/91) Simplify (((dd*(-5/3)d(1/3)/d)11)1)(-14) assuming d is positive. d*(616/3) Simplify ((kk(1/22))45(k(-2/93)/k)/k(1/7))(-28) assuming k is positive. k(-1314218/1023) Simplify (b(b*(-2/5)/b)/bbbb)*0b*(2/3)/(bb*(1/15)b)(b1)24/((b(b/b*(-2))/b)/(b/((b(b/b*(-5))/b)/bb))) assuming b is positive. b*(73/5) Simplify (ooo(-1/2))(-2/35)(o/o(-1/2))24((oo0)(-19/3))32 assuming o is positive. o(-17509/105) Simplify (((u/((uu(1/3)u)/u))/u)(-43))6/((u1/u)(-1/41)/(uu(2/5)u)(11/5)) assuming u is positive. u(8732/25) Simplify w*3/(ww/(w/w*(2/9))w)w(3/8)/w(-5)((www*(-2/17))/ww)/(w/(w/(w*(2/7)w)))w(4/5)/w7 assuming w is positive. w(23537/42840) Simplify (h/h(-1/6)(h*(2/71)h)/h(h/(h(-23)h))/((h/h*13h)/h))49 assuming h is positive. h(755531/426) Simplify ((p/((p/p(-1/4))/p))/p(2/3))/((p*0/p)/pppp*(-5/4))(pp(-2/7)p(-3))(-29) assuming p is positive. p(1420/21) Simplify (t0/(t/t*(-6)t))*(-13/3)((t/(ttt/(tt(1/2)/tt)t))(-4/39))49 assuming t is positive. t(1646/39) Simplify (((tt(t(tt(2/7)tt)/t)/t)/t)/t)/(tt*(-6/11)tt)tt(3/8)t(t7t)/t((t(-2))(-11))(-2/5) assuming t is positive. t(1251/3080) Simplify ((aa/a*(3/4)a)(-1/53))(8/3)/(a*(-7)aa(-2/13)a2/a(1/5)) assuming a is positive. a(14609/3445) Simplify ((q2)(-13)/(q(1/2)q1))/(q(q*(-1)/q)/qqq(-2/25)(q(-1))(-1/8)) assuming q is positive. q(-5309/200) Simplify (g(-1)g)(-42)/((gg0)/g)(-3/10)((g(gg/((g7/gg)/g))/g)/g(-13))(-23) assuming g is positive. g(-207) Simplify (f(-8/5)f(1/2)f(-2/21)/f(-7/4))45 assuming f is positive. f(699/28) Simplify (((l*(-1/3)/(l/(ll(-2))))(-5))(-1/44))(-8/15) assuming l is positive. l*(14/99) Simplify (m(mm3mm)/m(mm/(m/m(-7/2))mm)/mm)(-8)/((m7/(mmm7))/((m/m(-1))/((mm(2/5)mm)/m))) assuming m is positive. m(-212/5) Simplify ((pp/(pp/(pp*(-3)pp)))/pp*(-10/3)p/p*(-10)(p/(pp/(pp/p9)))/p)(-37) assuming p is positive. p*(259/3) Simplify ((a(a(-2)/a)/a)14/(((a/(a*(-1/3)/a))/a)/aa)(-2/117))(3/5) assuming a is positive. a*(-14734/585) Simplify ((pp/(((p(p/((pp*(1/3))/pp))/pppp)/pp)/p))*32/(p/(pp*3/p)(p/p(-2/7))/p))/(p(-2)pp(3/8)/p)(-6/11) assuming p is positive. p(10621/924) Simplify (n(-8)n(2/15))/(n(9/5)/n)(1/5) assuming n is positive. n(-602/75) Simplify ((g/(g(2/9)g))/g*12g/(g/g*(-20))gg(1/9)g)(1/89) assuming g is positive. g(-271/801) Simplify (u*2/(uu/(u/((u/u*3)/u)))(u*0u)/(u/u*6))/((u/(uuu/u(1/4)))(-3/44)((u*0u)/u)(-2/13)) assuming u is positive. u(1739/176) Simplify (((rr(3/5)r/((r*(-3/11)r)/r))/(r/(r/r*(7/5))r/r0))(-2/95))(1/78) assuming r is positive. r(-2/15675) Simplify (((k*(-1/6)k)/k(k/k(-6/7))/k)/((k/(k/(kk(-4))))/k)(-25))(-50) assuming k is positive. k(104275/21) Simplify ((s/s*(-1/3)ss(-3/7)ss(-2/15)s(-2))37)(-3) assuming s is positive. s(-2997/35) Simplify ((m(m(-28)/m)/m)/m)/m(-3/10)m*(-6/13)/mmm(-1) assuming m is positive. m(-4051/130) Simplify (l7/l((ll(-2/7))/l)/l)/(l(1/3)l*(-2/9))((ll(1/13))/l)/ll*(4/9)((ll(1/2))/l)(-17) assuming l is positive. l(-2389/546) Simplify (((k(4/7)k)/(k/k*(3/5)))/((k/(kk*(-3/7)))/(kkk/k(-3/5))))/((k2)44)(7/5) assuming k is positive. k(-832/7) Simplify (o(-1/18)o*(2/15))/(ooo46o)11 assuming o is positive. o(-48503/90) Simplify ((g/((g/(g(-1)/g))/g))(-2/19))*1(g(1/2))(5/3)g2/gg/(g/(g*(-6)g)) assuming g is positive. g(-349/114) Simplify (t(-2/13)/t(4/3))(-4/11)/(t*(-2)t(t(-2)/tt)/tt(t/(t/(t/((t/(t/t*(-1/2)))/t))t))38) assuming t is positive. t(-22934/429) Simplify ((d*(2/9)d)36)(-25)/((ddd/(d*7/d)ddd)/dd(d*(3/5)/d)/d(d/(dd/d(-1/3)dd))10) assuming d is positive. d(-15979/15) Simplify ((j/j	{ "pile_set_name": "DM Mathematics" }
Let m(s) = -2s + 6. Let q be m(6). Let p be q/(-15) + 52/20 - 51. Let i = -48 - p. Solve -v - 1 + 4 = i for v. 3 Suppose -y = 2s - 72, 5s + 5y = 9s - 130. Suppose 13 = 6b - s. Solve -10v + bv = 8 for v. -4 Let j = -60 + 65. Let o(b) = -b*3 + 6b*2 - 6b + 8. Let r be o(j). Solve r = -2u + u for u. -3 Let d(c) = 2c + 4. Let g(p) = -1. Let t(u) = d(u) + 6g(u). Let r be t(3). Let q = -6870 - -6873. Solve -3 = qx - rx for x. 3 Let t be 8/(-44) + (-1568)/(-154). Let z be (-5)/((-125)/45) + 2/t. Solve 6h = h + zh for h. 0 Let b(a) = -a2 - 2a - 1. Let g be b(-1). Suppose 0 = -49w + 36w. Suppose 8f - 30 + 14 = w. Solve g = -fn + 1 + 1 for n. 1 Let k be (-104)/(-18) - (-8)/36. Let o(i) = 11i - 90. Let b be o(9). Suppose -k = g - b. Solve -5w = 18 - g for w. -3 Suppose 5b = b. Let h(j) = 2j*2 - 29j - 13. Let y be h(15). Suppose yv + v = b. Solve v = -3g + 6 for g. 2 Let r = 486 - 390. Suppose 0 = l + 3c + 87, l = -3l - 5c - 362. Let z = l + r. Solve 0n + 3 = -zn for n. -1 Suppose 2h - 16 = 16l - 17l, 2l - 7 = h. Let q = 12 - 3. Solve qs - l = 39 for s. 5 Suppose 0p = -2p + 36. Suppose 6 = -y - 3m - 0, -5y - m + 26 = 0. Suppose -3i + 3b = -p, -y - 9 = 3b. Solve -5 = -4q - i for q. 1 Suppose 0f - 4r = 4f - 12, 6 = -4f + 2r. Let k be 90(-6)/27-3. Suppose -k = -9z + 4z. Solve -3n - z = -f for n. -4 Suppose 0 = 7f - 3 - 25. Suppose -15 = -fb - b. Suppose -x + 2 = bn - 13, -13 = -4n + x. Solve nl + l = 25 for l. 5 Let r be -2(3 + -4) + 2. Suppose -2p + 9p + 28 = 0. Let v be p/14 + 4/705. Solve rh + 0 + 20 = v for h. -5 Suppose -29r - 228 = -228. Suppose a = 5f + 3a - 14, -2f - 4a - 4 = 0. Suppose -3z = -d - f, 10 = z - 4d + 27. Solve rg - zg + 3 = 0 for g. 1 Let o = 454 - 237. Let w = o - 213. Let p(a) = a + 3. Let q be p(-3). Solve qn = -2n - w for n. -2 Let s be (-15)/(0 + (-1)/5). Let f = s + -73. Solve fn = -2n - 12 for n. -3 Let i = -110 - -88. Let g = i - -69. Let h = 47 - g. Solve k - 6k = h for k. 0 Suppose 4i - 52 - 392 = 0. Suppose i = 7a + 69. Solve 0v = 6v + a for v. -1 Let z(q) = -q*3 - 7q*2 + 12q + 20. Suppose -2f = 2p + 24, -3p + 2f = 2p + 32. Let u be z(p). Let w = -8 - u. Solve 0 = -wy - 7 + 3 for y. -1 Let f(l) = -287l + 1759. Let i be f(6). Solve -ip = 6p - 301 for p. 7 Let i(l) = -9l*3 + 77l*2 + 103. Let a be i(8). Solve 0 = t + 421 - a for t. 2 Suppose -5q = -5u - 330 + 15, 5u + 129 = 2q. Solve -39y + 296 = q for y. 6 Let p(m) = m*3 + 5m*2 - 8m - 8. Let g(j) = -1 + 0 + 2j + 7. Let w be g(-6). Let i be p(w). Solve 2u - 6 = iu for u. -3 Suppose 0 = -3w - 3p, 2w - 2p + 4 = -6p. Suppose wm - 64 = 10m. Let q(c) = c*3 + 8c*2 - 3c + 1. Let d be q(m). Solve 2s - 7s - d = 0 for s. -5 Suppose 6o + 6o - 3380 = -8o. Solve og = 178g - 9 for g. 1 Suppose -33154 = -153t - 5767. Solve -ty = -180y + 2 for y. 2 Suppose 0 = -5s + 9 + 36. Let p = 629402 + -629402. Solve sw - 36 = -pw for w. 4 Let y = 3273 - 2981. Solve yw - 21 = 299w for w. -3 Let j(r) = 78 + 0r - 6r + 3r. Let a be j(25). Solve -5 - a = 2f for f. -4 Let h = 1504 + -1467. Solve h = -4q + 17 for q. -5 Suppose -30p + 31p - 10 = -2m, p - 12 = -3m. Solve -12o = mo for o. 0 Let n be (-4)/(-24) - 59/(-6). Suppose -nq = -15q. Solve 4 = -2v - qv for v. -2 Let z be (6/9)/(6/252). Suppose 36m - 34m - 2r - 16 = 0, -5m + 4r + 37 = 0. Solve -mk = 8 - z for k. 4 Let d = -181 - -224. Let u = d + -37. Let r be (-1)/(0 + 1) + 1. Solve -3p + rp = u for p. -2 Let m = 20 + -17. Suppose -ma = -a. Suppose 0z + 7 = z + 4p, 4z - 2p - 10 = a. Solve 11 = 2x + z for x. 4 Let d(i) = 27i + 5309. Let w be d(-180). Solve 20 = -444y + wy for y. 4 Let l(f) = -f2 + 7f - 10. Let c be l(3). Suppose 13p - 54p = -492. Solve cq - 4 = -p for q. -4 Suppose -5p + 22 = z, 4z + 2p - 33 + 17 = 0. Solve 255 - 261 = zj for j. -3 Let h(z) = -z3 + 2z*2 - 2z + 1. Let s be h(1). Let l be (-2)/5 - (3 + 286/10). Let i = 35 + l. Solve 5y - iy + 10 = s for y. -5 Suppose -2k - 135 = -11k. Suppose z = 6z - k. Suppose 0 = -a + z + 2. Solve -ao + 1 = -14 for o. 3 Suppose -i = 5i. Let j(u) = 2u - 16. Let g be j(6). Let q be (-1)/4 + g + 116/16. Solve i + 15 = -qf for f. -5 Let v = 23375 + -23304. Solve 31d - v + 195 = 0 for d. -4 Suppose 9z = -197 + 377. Solve -290o = -280o + z for o. -2 Suppose n - 3u - 73 - 200 = 0, -4n + 1092 = -5u. Solve 0 = -278m + nm - 15 for m. -3 Suppose 54 = -6f + 15f. Suppose -2k + a - fa = -8, 0 = 3a. Solve 6s - 4s = k for s. 2 Let t = -2853 + 2862. Let y be 2 - (-2)/(-2)-4. Solve -yd = -td - 15 for d. -5 Suppose p = 5v - 8, -v - 5p = 4v - 20. Suppose 4i - vh - 32 = 0, -4i + 5h + 42 = 8h. Let z be i/3(-3)/(-9). Solve 2f + z = 5 for f. 2 Let x(w) = -4w - 16 - 8 + w. Let u be x(-10). Let a = u + 0. Solve a + 2 = -4i for i. -2 Suppose -2s = -2 - 6. Suppose -sr - 75 = -8r + 5i, -48 = -3r + i. Suppose -40w = -8 - 72. Solve r = -3d - wd for d. -3 Suppose 5k - 4k - 4 = 0. Suppose 25 = -5c, 3c + 0c - 9 = -w. Suppose 10 = -wo + 29o. Solve kq + o + 2 = 0 for q. -1 Let l = 53 + -49. Suppose -46 = 9b - 64. Solve o - bo + l = 0 for o. 4 Let m = -2 - -4. Let r = -56569 - -56573. Solve -rw - 6 = -mw for w. -3 Let f(s) = -s*3 + 13s*2 + 5s + 16. Let w be f(13). Suppose -4i - w = c, -3i = -c + 2i - 45. Let v = c + 67. Solve -v = 2o - 4 for o. 1 Let m = 2053 + -1953. Solve 6l - m = -14l for l. 5 Let y be (2/(-4))/(5/15)(-2496)/36. Solve -6 = -102v + yv for v. -3 Let d(v) = -3v*2 - 2v + 1. Let p be d(-1). Let l = -22 - -27. Solve -lq + 0q - 25 = p for q. -5 Let b(h) = h*2 + 3h - 9. Let s be b(-8). Let k(z) = -z*2 - 45z + 906. Let c be k(15). Solve -5l = s - c for l. -5 Let h = 3321 + -3249. Solve 73x - hx = 0 for x. 0 Let l(m) = -178m - 1227. Let a be l(-7). Solve 21 + 93 = -av for v. -6 Let f = 277 + -243. Suppose 40m - fm - 36 = 0. Solve -mq = -q + 5 for q. -1 Let x be (-1)/(11/3 - 4). Suppose -xh - 2f + 1 + 5 = 0, 5h - f = 10. Solve 0 = 2p - h for p. 1 Let u(b) = -1 + 3 - 3b + 8 + 5. Suppose 16 = 4p - 4. Let v be u(p). Solve v = -z + 1 for z. 1 Let k(j) = -j*2 - 90j - 340. Let d be k(-4). Solve 0 = -di - 42 + 14 for i. -7 Let u(b) = -b2 + 12b - 5. Let s be u(11). Suppose -12m + 12 = -sm. Suppose -mj + j + 3 = 0. Solve -1 = jl - 4l for l. 1 Let h be 4 + (-3 - (-4 + -4)). Let j(k) = -k3 + 30k*2 - 29k. Let u be j(29). Solve u = 10b - hb - 5 for b. 5 Let k = -41 + 43. Suppose -d + 153 = -ky, 4d + 69 = -y + 2d. Let w be y/(-27) + (-6)/(-27). Solve 4a - 3 = wa for a. 3 Let c be (-3)/(-9) - 3/6 - (-650)/156. Suppose -5p + 20 = 3l, 3p + 6l = l + 12. Solve cy = -p - 16 for y. -5 Suppose -t + 5t - 2i - 90 = 0, t - 4i - 40 = 0. Let p be (10 + -4 - t)(-8)/14. Solve 4h + 0h = p for h. 2 Let k be (4/(-38) - 0) + (347521/1007 - 67). Solve -206 = -8b - k for b. -9 Let c(v) = 2v*3 - 9v*2 - 16. Let n be c(5). Suppose nq - 5 = 22. Solve 2x + qx = -10 for x. -2 Suppose -4 = -4c - 4. Suppose -112q = -120q + 40. Solve -qv + 6v + 5 = c for v. -5 Let a(v) = 3v - 6. Let d be a(4). Suppose -2p = 2o, p - 4o + do = 0. Solve p = y + 1 + 3 for y. -4 Let j(d) = 26d - 14d - 14d + 2d*2. Let a be j(1). Solve a = -2w + w for w. 0 Let h(u) = -5u + 26. Let s(i) = 5i - 28. Let n(c) = 6h(c) + 5s(c). Let k be n(3). Solve k = -3t - 2 for t. -1 Let b(d) = -286 + 148 + 3d + 168. Let w be b(-9). Solve -18 = -9c + wc for c. 3 Let n = 1062 - 1094. Suppose -2a = 2d - 5d - 101, -4d + 5a - 123 = 0. Let y = n - d. Solve 2g - y = g for g. 5 Let c = 1931 + -1921. Solve -50o = -60o + c for o. 1 Let i be ((-5)/(-15))/((-1)/(-6)). Let s = -22 + 30. Suppose -4z + 2b + 10 = 0, -4b - s = 6z - 2z. Solve z = -ix - 5 for x. -3 Suppose 0 = -2x + i + 3, 5x + 47 = 5i + 57. Suppose 14p = 127 - x. Solve -a - p + 9 = 0 for a. 0 Let w(s) = s + 5. Let b be w(0). Suppose bm = -2t - 5, m + 1 = -3t - 2t. Let r = -63615 - -63616. Solve tc + r = -c for c. -1 Let k = 1641 - 1636. Solve -56f - k = -61f for f. 1 Let r = 85 - 83. Suppose -132 = rj - 162. Solve 0 = t + j - 14 for t. -1 Let d be (19 + -12)/(((-42)/(-36))/1). Solve -d*z = 284	{ "pile_set_name": "DM Mathematics" }
What is the value of (9330/(-20215))/(3/183)? -12/13 What is 400/(-125)(-45)/3(-1)/3? -16 (6/4)/((4/(-10))/(136/(-1020))) 1/2 What is the value of (446/(-24530))/((-12)/22)? 1/30 What is the value of ((-8)/(-192)4)/(4/((-32)/4))? -1/3 Calculate (-25)/((-9350)/408)11/2. 6 What is ((-30)/8)/(20(-72)/(-3840))? -10 Calculate 30/4510/(-70). -2/21 What is the value of (-24)/(-126)(-35)/(-10)? 2/3 Calculate (((-10416)/(-126))/(-62))/(-12/(-9)). -6 What is (((-9)/(9/(-2)))/(-4))/((-417)/(-278))? -1/3 What is the value of (-1)/((-9)/78(-30)/(-45))? 13 What is the value of 26/(-39)(-6)/(-8)1? -1/2 What is the value of 12/(576/(-12))-9? 9/4 Calculate ((-1533)/(-1314))/(6/(-12)). -7/3 Evaluate ((-567)/21)/54-17. 17/2 (23/(966/24))/(-2) -2/7 (60/50-1)/(15/(-125)) 10 (3/5)/((-78)/(-1560)) 12 Calculate 2/(-19)(-11)/(-22)1. -1/19 1(-2)/((-2)/(-1))39/13 -3 Calculate ((-46891)/(-7214))/((-13)/(-54)). 27 ((-12)/3)/(((-132)/(-6))/(-66)) 12 Evaluate ((-10)/(-300)-3)/(5/125-2). 5/4 (118/8)/(234/1560) 15 What is ((525/35)/45)/(6(-1)/(-20))? 10/9 (15/(-8))/(143/4293/(-8)) 15 What is (-28896)/129020/(-14)? 32 What is (5/28)/(5/(-6))-14? 3 What is 2-4((-135)/12)/15? 6 (68/(-22))/(22/((-17182)/(-71))) -34 Evaluate (-140)/9310-17. 2/19 What is ((-6)/(-112))/((-7938)/(-6174))? 1/24 Evaluate (24/(-8))/((-21)/(-7))2. -2 Calculate 10/(((-3)/24)/((-3)/(-20))). -12 (3(-2)/(-9))/((75/135)/(-5)) -6 55/1104/(-2) -1 Calculate (-2)/15/(-4)(-1666)/2380. -7/4 What is (164/1025)/(6/(-15)3)? -2/15 Evaluate 6630/(-255)(3/15)/((-4)/(-10)). -13 21/63-22/(-4) 1/3 What is (91)/(388/(-388))? -9 Calculate (8/20)/(1196/32890). 11 (22/(-11))/(24/6) -1/2 Evaluate (-6)/(-216)(8/(-12))/((-3)/9). 1/18 Evaluate ((16/4)/8)/(((-250)/360)/25). -18 Evaluate (29/(-232))/((-3)/(-48)-2). 1 What is the value of 3/(-1)204/(-918)? 2/3 Evaluate (-1)/7710/(140/(-49)). 1/22 Calculate ((-15)/(-2))/3-8105/700. -3 Evaluate ((-2)/(-5))/(((-54)/(-525))/(12/(-56))). -5/6 What is the value of ((-15)/(-75))/((-74)/20)? -2/37 (12/252)/((-15)/(-35)) 1/9 Evaluate ((-248)/(-310))/(((-30)/(-225))/((-7)/(-18))). 7/3 What is the value of (71/(7455/(-450)))/((-6)/(-21))? -15 What is 1775/3552/2-5? -25 Calculate ((-132)/(-90)5)/(8/6). 11/2 95/((-2375)/(-210))(50/4)/5 21 Evaluate -5((-28)/50)/(22/(-1760)-16). 14 Evaluate (-1836)/10812/(-68). 3 Evaluate (((-8)/(-4))/(-4))/(-2(-18)/(-1008)). 14 (-10)/(-7110/231) 3 What is the value of ((25/5)/(-90))/((-542)/271)? 1/36 15/315/(7350/(-28)) -2/7 What is the value of 48/78414-7? -6 Calculate ((-19)/38)/(((-7)/238)/(-1)). -17 ((-104)/12)/((-86)/(-258)) -26 -1(-48)/56(-14)/(-9)3 4 Evaluate ((-32)/(-24))/((-1)/2)630/1470. -8/7 What is the value of (3/5)/((-51345)/4075)? -1/21 What is the value of 20/(-15)1014/104? -13 What is the value of ((-16)/(-72)-6)/((-13)/((-117)/210))? -2/35 ((-4)/6)/((-1467)/(-36675)(-10)/9) 15 ((-3)/2102)/(790/(-2765)) 1/10 What is (-9)/3(-45)/(-81)96/8? -20 What is the value of (23/(-897))/(((-22)/(-55))/((-24)/(-10)))? -2/13 What is (67284/(-1424))/(18/(-8))? 21 What is the value of ((-20)/75)/(68/34(-3)/20)? 8/9 What is the value of (-280)/1752/4? -4/5 Calculate (-46-1)/((-3898)/(-1949)). 12 Evaluate (6/(-204))/(4/16). -2/17 Evaluate ((-43)/((-9933)/(-66)))/(15/(-7)). 2/15 What is (46/6)/((-50)/(-7500)50)? 23 Evaluate (-622/(-77))/((-10)/5). -6/7 What is 2965/(-1186)(-1)/(-5)? -1/2 What is ((100/(-150))/(4/(-6)))/(1/(-6))? -6 (-4)/(-6)(-369)/12308/12 -2/15 (-176)/(-22)(-11)/(-924) 2/21 Evaluate 14/3306/3574. 16 What is the value of 5(-16)/(960/(-36))2? 6 What is the value of (9/(-108))/(16/160)? -5/6 Calculate ((-3)/(63/30))/(37/44412). -10/7 What is 8/6((-513)/4389)/((-2)/11)? 6/7 Evaluate (-4)/27114/(-76). 2/9 What is 6/191/(-1911)? -2/7 Calculate ((-40)/10)/((-6)/(-63)3). -14 Evaluate ((-45255)/(-4310))/(1/2). 21 What is (((-850)/(-85))/((-3)/3))/(4/10)? -25 What is ((-3)/(-36)4)/(-8(-55)/(-396))? -3/10 Calculate 6831/6072(1/1)/((-1)/(-8)). 9 Evaluate 14(185/(-111))/(15/9). -14 Calculate 6/2(-5)/(-110)11-6. -9 What is the value of (-1111/33)/(-13/(-18))? -22 What is ((-59)/(-236))/(40/(-32))? -1/5 -45((-60)/50)/(6/2) 18 What is the value of (((-13)/6)/(-13))/(((-264)/(-32))/(-11))? -2/9 Evaluate 5(5/(75/(-10)))/5. -2/3 Evaluate (21/49(-26)/39)/(5/40). -16/7 ((-63)/(-9))/715 15 What is the value of (-13)/273-28(9/2)/3? 2 (57/(-38))/((78/(-36))/(-13)) -9 Evaluate (630/4536)/(10/(-6))-10. 5/6 4389/665(-5)/(-3) 11 Calculate ((-1)/(-18))/((-66)/198). -1/6 Evaluate ((-3)/43)/((-1197)/(-798)). -2/43 What is 78/101460/(-876)? -13 Evaluate ((-27)/81)/((-1)/12). 4 What is (-413)/118(96/(-21))/4? 4 Calculate -12(1/((-12)/(-2)))/((-4)/(-24)). -12 What is the value of 117/12(-3)/((-18)/(-8))? -13 Calculate (276/(-552))/((-6)/(-132)). -11 (-14)/(-7)2/7(-1078)/(-770) 4/5 Evaluate 8/4((-46)/108)/(-23). 1/27 What is the value of (-35)/(288/(64/4))(-4)/(-5)? -14/9 Calculate (2/5)/(241/9640). 16 What is (84/(-525))/(4/(-170))55/(-22)? -17 Evaluate (16/(1408/220))/(1/82). 10 (-12)/(-20)925/(-666)12 -10 Calculate 16/(-44)11/(-14). 2/7 4/11(-3)/25(-165)/90 2/25 What is the value of (-27)/((-54)/140)73/146? 35 What is ((-3)/(-2))/(70/210)(-2)/(-42)? 3/14 Calculate (29/(-300)-2)/(18/15). 1/10 Evaluate ((9/4)/(150/(-25)))/((-75)/(-20)). -1/10 What is the value of ((-650)/195)/((-35)/21)? 2 Calculate ((-68)/85)/(44/20). -4/11 Calculate (70/(-100)2)/34/(-14). 2/15 Calculate (5/((-600)/(-32)))/((96/10)/(-8)). -2/9 -5(-98)/(-343)6/3 -20/7 Calculate (3016/(-145))/(-26)(30/4)/(-3). -2 What is the value of 1190/(-3332)7/((-70)/(-12))? -3/7 What is ((-4)/18)/(65/(-234))(-6)/(-12)? 2/5 What is (35/(-75))/(231/(-792))? 8/5 What is the value of (-1)/(-5)((-150)/(-40))/(-15)? -1/20 What is the value of -92/8(-352)/132? 6 What is ((-592)/(-74))/(((-30)/4)/(-3))? 16/5 What is (-8)/(-50)(-25)/10-2? 4/5 What is ((-10)/8)/((-2645)/29624)? 14 What is 2/(-1)21/(252/78)? -13 (252/189)/(16/(-108)) -9 What is (9/(-1))/(9/(-2)22/66)? 6 (8/(-28))/(60/3361/(-5)) 8 Evaluate 11/((-132)/168)(-40)/80. 7 What is the value of ((-3)/((-216)/16))/(-2)? -1/9 What is the value of 12/(-2)(-17)/(-68)? -3/2 What is the value of 0/(2/126)1/(-3)? 0 Calculate 1618/(-1080)(-5)/(-2). -2/3 Evaluate (32/96(-36)/1)/10. -6/5 What is ((-1)/(-1))/(-21(165/(-105))/11)? 1/3 What is the value of 30/(-275)26/(1196/115)? -3/11 What is the value of 6/840428/(-18)? -2/15 (1/(-3))/(7(-7)/(3675/25)) 1 What is 60/1222/(-935)? -2/17 What is the value of (-4)/(35/(3675/(-168)))? 5/2 What is the value of (-3)/6782/(-391)? 1 Calculate (42/112)/((-30)/(-8))45/(-36). -1/8 What is the value of ((-84)/(-182)13)/((-30)/(-25))? 5 (12/5)/(20286/1100) 6/13 What is 36/(-54)-445/(-280)? -3/7 Calculate ((-5)/3)/(((60/18)/(-5))/(-2)). -5 What is 1(5/(-7))/(41/(-164))? 20/7 (0/(-2))/((-50)/75(-9)/(-2)) 0 ((-10)/(-3))/((512/(-60))/64) -25 Evaluate 0/125/((-200)/(-4)). 0 What is -47(-54)/(-71064)(-2)/(-1)? -1/14 ((-12555)/(-124))/(-15)-4 27 Evaluate 1533/(-146)(-24)/(-14). -18 ((-192)/(-144))/(1/((-48)/8)) -8 Evaluate (19/(-1))/(1224/(-288)1). 19 Calculate (-1)/20/((6/1)/6). 0 4/(-38)((-64)/16)/4 2/19 What is 4/(-14)(-1295)/4443/10? 1/4 Evaluate 114/(-18)(-50)/3325. 2/21 What is -3(-4)/(-306)-6(-18)/(-24)? 3/17 Calculate (21/756)/(3(-4)/(-24)). 1/18 What is the value of (-56)/(-350)30/(-4)(-18)/162? 2/15 Calculate 40/(-250)(-1575)/70. 18/5 Calculate (24/30)/((-1)/15(-612)/1734). 34 (-2)/(53/(636/(-84))) 2/7 Calculate 9((-360)/(-918))/10. 6/17 Evaluate ((-17)/((-85)/(-45)))/((-21)/(-56)-2). 12 ((-3)/1)/(9/1238) -2/19 (-378)/((-588)/(-28))21/6 -6 What is the value of ((-6)/(-4))/((-1)/126-9)? 21 (((-90)/(-14))/(-5))/((429/13)/(-693)) 27 Calculate ((-420)/175)/((-3)/(-10)). -8 ((-5)/82016/840)/(3/50) -25 Calculate 2426/(-1248)-24. 12 What is the value of 12/(-171)((-114)/8)/19? 1/19 What is (-3)/((-18)/(-4))2499/392-4? 17 Evaluate ((-41)/(1107/216))/(5/((-15)/4)). 6 -484/288-6 7 (-423/828)/(1(-7)/(-6)) -2/21 68/(-51)45/6 -10 ((-20)/60)/(-31/(-126)) -14 What is ((-16)/360)/(32/(-320))? 4/9 Calculate ((6/(-20)-2)/((-2)/(-50)))/1. 15 Evaluate (8/(-60)*(-95)/152)/(	{ "pile_set_name": "DM Mathematics" }
r(v). Let k(l) = 2l*2. Calculate k(x(t)). 1250t*4 Let j(t) = -66143t2. Let w(b) = b2. Calculate w(j(i)). 4374896449i4 Let o(u) = -9u. Let j(f) = -4f. Calculate o(j(w)). 36w Let f(r) be the first derivative of r*2/2 + 13. Let h(l) = 106l. Determine h(f(p)). 106p Let c(d) = -3d2. Let n(j) = -j3 + 9j2 + 11j - 8. Let a be n(10). Let f(r) = -r*2 - 4r*2 + 4r*a. Determine f(c(z)). -9z*4 Let g(l) = 78l. Let d(o) = 2o. Give g(d(j)). 156j Let l(q) be the first derivative of q3/3 - 3. Let d(n) be the first derivative of n4/12 + 2n + 3. Let p(y) be the first derivative of d(y). Give p(l(r)). r4 Let z(o) = -2o*2. Let u(x) be the first derivative of 2x*2 - 7. Calculate z(u(p)). -32p*2 Let s(u) = 12u. Let p(v) = 14v + 17. Let a(f) = 5f + 6. Let o(z) = 17a(z) - 6p(z). Calculate o(s(n)). 12n Let a(x) = -x + 1. Let d(p) = 18p - 27. Let n(v) = -54a(v) - 2d(v). Let j(t) = 2t2. Give n(j(r)). 36r2 Let v(c) be the first derivative of c3/3 - 2. Let s(n) = n*3 - 3n*2 - 3n - 3. Let t be s(4). Let l(g) = -1 + g + t. What is l(v(u))? u2 Let f(w) = w2. Let q(x) be the second derivative of 2x3 + 7x. Determine f(q(d)). 144d2 Let m(x) = -16x. Let w(g) = 3g. Let i be 26/7 - 2/(-7). Let n(u) = im(u) + 22w(u). Let o(c) = -5c*2. What is o(n(z))? -20z2 Let s(f) = -f3 + 4f2 + 5f + 6. Let z be s(5). Let g(q) = -3q + zq - 5q. Let t(v) = -v. Determine t(g(y)). 2y Let w(h) = 9h - 5. Let i(o) = 8o - 4. Let z(t) = -5i(t) + 4w(t). Let s(n) be the third derivative of 1/24n4 + 0n + 0n3 + 0 - 2n*2. Give z(s(f)). -4f Let z(m) = 7m. Let j(a) = -6a2 - a2 + 4a2 + 2a*2. Give j(z(h)). -49h*2 Let i(x) = 60x + 42. Let u(p) = 12p + 9. Let v(t) = -6i(t) + 28u(t). Let z(a) = -a. Determine z(v(g)). 24g Let s(l) = -143l - 2. Let u(o) = -9o. Calculate s(u(n)). 1287n - 2 Suppose g + 3f = -0g - 7, -2g - 5f - 11 = 0. Let b(w) = 2w + 2w - gw - w. Let l(c) = -3c2. Give l(b(k)). -3k*2 Let n(x) = -4x2. Let a(i) be the second derivative of i3/6 + i. What is n(a(v))? -4v2 Let h(z) be the first derivative of 3 + 2/3z*3 + 0z*2 + 0z. Let w(s) = -s*2. Determine w(h(b)). -4b*4 Let v(s) = 48s*2. Let r(c) = 2c. Let g(t) = -2t. Let h(b) = -3g(b) - 2r(b). Give h(v(q)). 96q*2 Let f(m) = -2m2. Let q(b) be the third derivative of b5/20 - 2b3/3 - b2. Let d(z) be the first derivative of q(z). What is d(f(a))? -12a*2 Let b(q) = -10q2. Let c(n) = n2 + 1177n - 1177n. Calculate c(b(a)). 100a4 Let y(z) be the second derivative of 16z*3/3 + 6z. Let i(o) = -o*2. What is y(i(m))? -32m*2 Let g(h) = -2h. Let t(k) = k. Let d(p) = 3g(p) + 10t(p). Let j(z) = 3z. What is d(j(b))? 12b Let y(g) = -8g. Let s(x) = 7x*2 - 5x + 5. Let w(r) = -8r2 + 6r - 6. Let d(j) = -6s(j) - 5w(j). Determine d(y(p)). -128p2 Let p(z) = -z. Let d(a) = 2a*2 + 115a. What is d(p(t))? 2t2 - 115t Let o(w) = w. Let p(r) be the second derivative of 67r4/12 - 11r. Calculate o(p(d)). 67d2 Let a(z) = -2z + 0z + z. Let k(v) be the first derivative of -2 + 0v + 1/2v2. Give k(a(h)). -h Let b(d) = 9d. Let l(y) = 11y - 5y - 4y - 4y. What is l(b(n))? -18n Let l(r) = 14r. Let a(d) = -2d2. What is a(l(o))? -392o2 Let i(c) = c2. Let l(z) = 3z2 + 7z*2 + 6z*2 - 2z*2. What is i(l(x))? 196x*4 Suppose -2 - 5 = -3s + m, 0 = 2m - 4. Let u(i) = i + si - 6i. Let b(w) = -5w + 0w + 3w. What is u(b(f))? 4f Let u(h) = 15h. Let x(c) = 2c2 - 4c. Let r(a) = a*2 - 3a. Let t(q) = -4r(q) + 3x(q). Calculate t(u(y)). 450y2 Let z(h) = -2h. Let y(x) be the third derivative of -x*4/12 + 7x*2. What is y(z(d))? 4d Let q(a) = 6a. Let u(s) = -s3 - 4s*2 + 3. Let c be u(-4). Let j(b) = 2b*2 - 4b*2 + cb*2. Determine q(j(l)). 6l2 Let j(a) = -a2. Let c(i) be the third derivative of -7/60i5 + 0 + 2i*2 + 0i + 0i4 + 0i*3. Calculate j(c(y)). -49y*4 Let f(x) = -2x. Let m(w) = 853w2. What is f(m(v))? -1706v2 Let j(l) = l2. Let a be 1-1(4 + -4). Suppose ab = -b. Let f(p) = bp - 2p + 5p. Calculate f(j(s)). 3s2 Let f(n) = 6n. Let d(h) = 7h. Let z(a) = 4d(a) - 3f(a). Let w(x) = -2x*2. What is w(z(y))? -200y2 Let d(b) = -b2. Let j(p) = 36p - 1. Determine d(j(k)). -1296k*2 + 72k - 1 Let b be 6/(-4)(-50)/15. Let c(d) = -bd*2 - 2d + 2d. Let a(v) = -2v*2 + 5v. Let q(r) = -r*2 + 2r. Let s(m) = -2a(m) + 5q(m). Calculate s(c(k)). -25k4 Let l(m) = 5m*2. Let c(s) = -2s*2 + 6 - 18 + 12. Give l(c(i)). 20i*4 Let n(h) = -22 + 85h + 22 + 4h. Let o(b) = -2b*2. Determine o(n(g)). -15842g*2 Let d(j) = 2j*2. Let a(s) = 22s - 5. Let p(n) = 11n - 2. Let m(i) = -2a(i) + 5p(i). What is d(m(h))? 242h2 Let u(g) be the second derivative of -g3/2 - 7g. Let p(x) = -3x*2. What is u(p(y))? 9y*2 Let a(h) = 7h + 5. Let o(q) = 8q + 6. Let c(r) = -6a(r) + 5o(r). Let i(v) be the third derivative of v5/10 + v2 - 7. What is i(c(l))? 24l*2 Let v(j) = -2j*2 + 1 - 1. Let k(a) = -5a + 7. Let o(b) = 3b - 5. Let y(x) = 5k(x) + 7o(x). Give v(y(z)). -32z*2 Suppose -5h + 30 = -0h. Let o(b) = -2b - 3. Let w(t) = -9t - 13. Let m(r) = hw(r) - 26o(r). Let q(u) = 2u*2. Calculate q(m(p)). 8p2 Let n(c) be the third derivative of c5/60 + c*2. Let f = 16 + -8. Let g(r) = 8 - 3r - f. Calculate g(n(m)). -3m2 Let x(v) = 5v*2 + 28. Let s(z) = 3z*2. What is s(x(r))? 75r*4 + 840r*2 + 2352 Let j(p) = 2p - 23 + 23. Suppose 5 = 4n - 3. Let h(a) = 0a*2 + na2 - a2. What is h(j(k))? 4k2 Let q(r) = r + 4. Let c(i) = 3i + 7. Let s(a) = 4c(a) - 7q(a). Let f(l) = -2l2. Give s(f(w)). -10w*2 Let s = 19 + -9. Let a(w) = -s + 5w + 10. Let t(m) = -m. What is a(t(i))? -5i Let b(g) = 704g*2. Let o(p) = -p. Calculate b(o(m)). 704m*2 Let r(a) = -3a*2. Let c(s) = -s - 119. Give c(r(q)). 3q*2 - 119 Let b(g) = -3g*2 + 6g - 6. Let u(n) = -7n2 + 13n - 13. Let a(r) = 13b(r) - 6u(r). Let s(t) = -3t2. Calculate s(a(y)). -27y*4 Let j(l) = 6l. Let k(f) = 1368f. Calculate j(k(q)). 8208q Let d(s) = -s*2 + 6s - 6. Let i be d(4). Let f(j) = 2j + 3j - ij - 2j. Let t(u) = -u2. Give f(t(q)). -q2 Let u(h) = 2h. Let y(b) = -38b*2. Calculate y(u(z)). -152z2 Let o(h) = h2. Let y be 3 - (-2 + -4 + 9). Let g(f) be the third derivative of 0f + yf*4 - 1/15f*5 + 0 + 0f*3 - 4f*2. Determine g(o(v)). -4v*4 Let v(p) = -22p*2 - 53p. Let s(h) = -3h. Determine s(v(q)). 66q*2 + 159q Let a(o) = o. Let z(s) = 3146s - 1. Calculate a(z(l)). 3146l - 1 Let d(r) = -1376r2. Let s(p) = -2p*2. What is s(d(b))? -3786752b*4 Let w(m) = -20m. Let h(z) be the second derivative of z*3/3 - 22z. Calculate h(w(k)). -40k Let m(t) = -2t + 7 - 2 - 5. Let a(d) = 6d. Calculate m(a(s)). -12s Let q(v) = -2v2 - 4. Let k(w) = -3w*2 - 7. Let y = -7 - -11. Let o(u) = yk(u) - 7q(u). Let j(x) = 2x*2 - 3x*2 - 3x*2. Give j(o(m)). -16m*4 Let f(n) = 4n*2. Let d(b) = -1400b*2. Calculate f(d(t)). 7840000t*4 Let k(y) = 15y - 2. Let n(q) = 1139q - 153. Let l(b) = -153k(b) + 2n(b). Let a(z) = -z2. Give a(l(h)). -289h*2 Let b(v) = -2v. Let p(i) = -i - 1. Let g = -2 + 7. Let d(c) = 2c - 5. Let n(h) = gp(h) - d(h). Determine b(n(u)). 14u Let t(v) = 4v*2 + 5v + 5. Let z(c) = -2c2 - 3c - 3. Let p(k) = 3t(k) + 5z(k). Let b(d) = 8d2. Determine p(b(y)). 128y*4 Let g(t) = -2t*2. Let i(x) = 3826x. Calculate i(g(u)). -7652u2 Let r(h) = 3h + 1. Let m(j) = j*2 - 4j - 8. Let f be m(6). Let g(z) = -z - 1. Let l(w) = fr(w) + 4g(w). Let k(s) = -2s2. Calculate l(k(y)). -16y*2 Let f(u) = -u + u - 6u + 3u. Let c(j) be the third derivative of 0 + 0j + 0j3 + 2j*2 + 1/24j*4. What is f(c(h))? -3h Let g(r) = r. Let j(q) be the first derivative of 5q2/2 - 15. Determine j(g(u)). 5u Let t(s) = 12s. Let h(z) = -20z*2 - 10z. What is t(h(b))? -240b2 - 120b Let c(k) = -k*2. Let x(b) be the second derivative of -5b*4/3 - 2b. Give c(x(g)). -400g4 Let y(u) be the first derivative of -12u - 2 + u*2 + 12u. Let p(g) be the second derivative of -g*4/6 + g. What is p(y(j))? -8j**2 Let z(	{ "pile_set_name": "DM Mathematics" }
) be the second derivative of w5/20 - w3/3 + w*2 + 2w. Let u(j) = 2j3 - 5j + 5. Determine dy(g) - 2u(g). g*3 Let y(c) = 8 + 7c*2 - 23 + 7. Let r(u) = 6u*2 - 7. Give 6r(j) - 5y(j). j2 - 2 Let u(m) = 23m*2 - 11m - 6. Suppose 1 = i + 6. Let q = i - -11. Let j(l) = -8l2 + 4l + 2. Give qu(t) + 17j(t). 2t2 + 2t - 2 Let a(y) = -y2 + y. Let x(s) = -s3 + 8s2 - 9s + 10. Let j(n) = n. Let i be j(7). Let v be x(i). Let h(k) = -5k2 + 6k. Determine vh(c) + 22a(c). -2c2 - 2c Let v(b) = b*3 - 4b*2 + 5b - 8. Let w(d) = 2d3 - 7d*2 + 9d - 15. Give 7v(q) - 4w(q). -q3 - q + 4 Let i(g) = g2 + 2g + 2. Let c(h) = 3h*2 + 9h + 9. Let m be (12 + -6)/2 + 1 + -2. Calculate mc(f) - 9i(f). -3f2 Let l(a) = 4a*3 + 5a*2 + 5a - 5. Let j = -8 - -13. Let y(t) = 2t3 + 3t*2 + 3t - 3. What is jy(x) - 3l(x)? -2x3 Let b(j) = 10j*3 + 7j + 29. Let o(s) = 3s3 + 2s + 10. What is 2b(u) - 7o(u)? -u3 - 12 Let j(m) = m3 + m2 + 1. Let o(l) = l2 - l - 3. Let h be o(2). Let g(w) = 4w3 + 3w*2 + w + 3. Determine hg(t) + 3j(t). -t3 - t Let d(r) = -r3 - 1. Let u(v) be the second derivative of 3v*5/5 + 5v*2 + 38v. Give 10d(n) + u(n). 2n*3 Let o(f) = -f - 1. Let k(v) = 0 + 2v - 4 - 7v. Let s(r) = 4k(r) - 18o(r). Let w(c) = c - 1. Let m be w(-5). Let b(i) = -2i + 2. Calculate mb(z) + 5s(z). 2z - 2 Let f(m) = -m2 - 4. Let x(q) = q2 + 4. Calculate -5f(j) - 6x(j). -j2 - 4 Let p(n) be the third derivative of -n4/24 + 6n*2. Let g(i) = 2i + 1. Calculate -2g(x) - 5p(x). x - 2 Let w(k) = 7k3 + k2 - k - 1. Let v be w(-1). Let d(x) = 5x*2 - 5x + 2. Let o(f) = -f*2 + f. Determine vo(l) - d(l). l*2 - l - 2 Let q(i) = -3i + 39. Let c(r) = r - 11. Calculate 18c(x) + 5q(x). 3x - 3 Let m be -6 + 5/((-25)/(-20)). Let t(j) = -13j*2 + 10. Let y(a) = -4a*2 + 3. Calculate mt(h) + 7y(h). -2h*2 + 1 Let p(k) = -19k - 7. Let q(y) = y - 1. Let i(g) = -p(g) + q(g). Let h(u) = 7u + 4. Let n(l) = -14l - 9. Let x(j) = -5h(j) - 2n(j). Give 6i(b) + 17x(b). b + 2 Let k(a) = -a*3 - 11a - 11. Let j(q) be the third derivative of 0q - q2 + 1/12q4 + 0 + q3. Let b be j(8). Let o(y) = y + 1. What is bo(v) + 2k(v)? -2v3 Let m(l) = -9l*3 + 13l + 13. Let p(y) be the first derivative of y*4 - 3y*2 - 6y + 2. Calculate 6m(h) + 13p(h). -2h3 Let y = -44 - -38. Let p(m) = 4m*3 - 2m + 5m + 0m + 3. Let h(i) = i*3 + i + 1. What is yh(c) + 2p(c)? 2c*3 Let o(s) = -7s - 6. Suppose z = 2z + 9. Suppose 2b + 2b - 5l + 60 = 0, -4b + 3l - 52 = 0. Let t = b - z. Let h(x) = -x - 1. Calculate to(k) + 6h(k). k Let s(v) = 2v2 + 3v. Let t = 1 - 4. Let y(f) be the first derivative of 1 + 0f - 7/2f*2 - 5/3f*3. Give ty(n) - 7s(n). n2 Let l(v) = -5v. Let n(q) = 6q. Determine 2l(h) + 3n(h). 8h Let v(g) = 5g2 + 2g - 1. Let n(y) = -1 + 0 - 4y2 - 2y - 1 + 3. Suppose -5k - 3 - 12 = 0. Give kn(d) - 2v(d). 2d*2 + 2d - 1 Let l(i) = -i + 4. Let k(n) = -3n - 12. Let b(o) = -2o - 11. Let h(d) = 5b(d) - 4k(d). Determine 3h(y) + 5l(y). y - 1 Let l(a) be the second derivative of 5a3/6 + 4a*2 + 8a. Let c(d) = -11d - 17. Determine 6c(n) + 13l(n). -n + 2 Let r(b) = -8b. Let o be (-7)/(-2 + (-3 - -4)). Let u(j) = 4j - oj + 4j. Give -6r(h) - 51u(h). -3h Suppose -7 + 1 = u. Let n(g) = -5g + 4. Let x(w) be the first derivative of -9w*2/2 + 7w - 6. Suppose 25 = 2q + 3. Determine qn(v) + ux(v). -v + 2 Let s(g) = g3 + g - 1. Let j(w) = -5w - 2w3 + 1 - 3 + 7. Let z(l) = -3l*2 - 20l + 8. Let h be z(-7). Determine hj(f) + 5s(f). 3f3 Let x(w) = -2w2 - 7. Let a(o) = -o2 - 3. Suppose -2m + 4m = 0, 3c + 15 = 3m. What is ca(t) + 2x(t)? t*2 + 1 Let f(c) = c + 1. Let z(t) = 6t + 11. What is 14f(g) - 2z(g)? 2g - 8 Let s(t) = 4t - 5. Let a(q) = -8q + 9. Determine -4a(m) - 7s(m). 4m - 1 Let y(l) = l - 4l + l - 7. Let p be 1 + 1 - (-8)/(-1). Let a(t) = -1. Give pa(h) + y(h). -2h - 1 Let h(x) = 4x*2 - 4x - 5. Let l(n) = 8n2 - 7n - 9. What is -11h(r) + 6l(r)? 4r2 + 2r + 1 Let l(x) = -x + 1. Let j(m) = -m*2 - 4m + 1. Let n(v) = -j(v) + 4l(v). Let k(g) = -2g*2 - 5. Suppose 4u + 30 = u. Determine un(a) - 6k(a). 2a2 Let m(b) = -8b*2 + 8. Let y(o) = 2o*2 - 2. Let q(f) = -2m(f) - 9y(f). Let s(l) = -6 + 2l*2 + 5l2 - l2. Determine -16q(k) - 5s(k). 2k2 - 2 Let d(c) = 4c*2 + 5c + 3. Let w(h) = 5h2 + 6h + 4. Determine -6d(g) + 5w(g). g*2 + 2 Let l(j) = -2j*3 + 3j*2 + 6j - 3. Let w be (-4 - (-28)/8)/((-2)/(-20)). Let h(p) = -3p3 + 5p*2 + 11p - 5. What is wl(y) + 3h(y)? y*3 + 3y Suppose r + 2 = 9. Let o(m) = 4m2 - 3m + 13. Let s be 2 - -1(-2 + 0). Let i(g) = g - g2 + 0g*2 + sg*2 - 4. Determine ri(k) + 2o(k). k2 + k - 2 Let s(v) = v - 8. Let b(w) = 3w - 25. Calculate -2b(n) + 7s(n). n - 6 Let p(g) be the second derivative of 7g6/720 - 3g5/40 - g4/4 - g. Let j(q) be the third derivative of p(q). Let h(a) = -4a + 5. Give 11h(t) + 6j(t). -2t + 1 Let f(i) = i*3 - i - 1. Let s(y) = -2y*3 - 7y - 6. Calculate 6f(l) - s(l). 8l*3 + l Let b(x) = 3x*3 - 8x*2 - 8. Suppose 2i + i = -30. Let t = i + 5. Let h(a) = -2a3 + 5a*2 + 5. Give tb(v) - 8h(v). v3 Let d(v) be the first derivative of 3v*2/2 + v - 4. Let b(x) = x. Determine -5b(y) + 2d(y). y + 2 Let i(k) = -k3 + k2 - k - 1. Let w(f) = -9f*3 - 4f - 8. Let l(r) = -10r3 - r2 - 4r - 9. Let a(n) = -3l(n) + 4w(n). Determine -a(y) + 5i(y). y3 + 2y2 - y Let m(c) = -c - 2. Let h be m(-1). Let i(u) = -u3 - u. Let a(t) = -6t3 - 3t. Give ha(f) + 3i(f). 3f3 Let q(a) = 17a*3 - 88a + 20. Let y(k) = -6k3 + 29k - 7. Calculate -4q(p) - 11y(p). -2p3 + 33p - 3 Let x(k) = -20k3 - 14k*2 - 8k - 14. Let a(r) be the second derivative of -7r5/20 - 5r4/12 - r3/2 - 5r2/2 - 8r. Determine 14a(q) - 5x(q). 2q3 - 2q Let k(s) = 5s3 + 5s*2. Let a(j) = -4j*3 - 4j*2. Give 3a(p) + 2k(p). -2p*3 - 2p2 Let s(n) = -1. Let a(f) = -f2 + 8. Calculate a(t) + 4s(t). -t2 + 4 Let p(v) = -v3 - v2 - v. Let c(k) = 102k*3 - 5k*2 - 5k. What is c(s) - 5p(s)? 107s3 Let a(w) = w + 5. Let k(o) = -o. Let v(r) = -r3 + 3r2 - 5r - 3. Let s(m) = 6k(m) - v(m). Let d be s(3). Let f(l) = d + 0 + 1. Give -a(n) + 5f(n). -n Let t(v) = 2v3 - 4v + 4. Let b(a) = 2 - 7 - 3a3 + 25a - 20a. Calculate 4b(w) + 5t(w). -2w*3 Let l(d) = 161d - 49. Let j(w) = -10w + 3. Calculate 49j(s) + 3l(s). -7s Let c(g) = 3g3 + 4g*2 + g - 5. Let h(p) = -2p2 - p3 + 7 - 18 + 13. Give 2c(u) + 5h(u). u*3 - 2u*2 + 2u Let u(d) be the first derivative of 10d3/3 + 5d*2/2 - 8. Let x(l) = -5l*2 - 3l. Calculate 3u(w) + 5x(w). 5w2 Suppose -25 = -5g + 3a + 2a, 4g = -4a - 4. Let x be 12/(g + -4) + -1. Let r(h) = 6h - 6h - h - 8h2. Let l(j) = 7j*2 + j. Determine xl(s) - 6r(s). -s2 - s Let f(a) = -9a3 - a2 - 4a. Let d(x) = 9x3 + x2 + 3x. Determine 6d(s) + 5f(s). 9s3 + s2 - 2s Let h(l) = -l + 2. Let j(z) = -z. Let x be j(-3). Let y(o) = -2o. Let r(f) = -3f + 1. Let v(k) = xr(k) - 4y(k). Determine 4h(i) - 3v(i). -i - 1 Let a(q) = 2q + 3. Suppose 7n + 44 = 18n. Let h(v) be the third derivative of v*4/6 + 7v*3/6 - 2v*2. Give nh(f) - 9a(f). -2f + 1 Let p(r) be the second derivative of -r5/20 - r4/12 - r*3/2 + 2r*2 + 8r. Let g(n) = -n3 - n2 - 3n + 5. Calculate -4g(y) + 5p(y). -y3 - y2 - 3y Let t(w) be the third derivative of 0w3 + 0w - 1/24w4 - w2 + 0. Suppose 0 = -5q - 2000 + 2045. Let f(l) = -l*2 - 4l - 1. Calculate qt(c) - 2f(c). 2c2 - c + 2 Let d(q) = 7q*2 - 3. Let o(h) = 4h*2 - 2. Let i(s) = -3d(s) + 5o(s). Let p(z) = 8z*2 + z + 7. Determine -14i(x) - 2p(x). -2x*2 - 2x Let h(d) = -2d + 5d + 3d - 7d. Let c(y) = -y*2 - 5y + 1. Determine -c(r) + 6h(r). r2 - r - 1 Let q = -12 + 13. Let u(m) = 0 - q + 1 - m2 - 2m. Let i(g) = 4g2 + 9g. Determine 4i(t) + 18u(t). -2t2 Let a(p) = p - 3. Suppose 0 = 2k - 7 - 1. Suppose 2l + r - 3 = -0r, kr = 3l - 32. Let b(w) = w - 2. What is l	{ "pile_set_name": "DM Mathematics" }
d thousands digit of 5419194? 4 What is the ten millions digit of 28058934? 2 What is the tens digit of 763247? 4 What is the hundreds digit of 13944772? 7 What is the hundred thousands digit of 665295? 6 What is the units digit of 705743? 3 What is the hundreds digit of 415559? 5 What is the hundreds digit of 2231799? 7 What is the tens digit of 257440? 4 What is the ten millions digit of 14626621? 1 What is the units digit of 991754? 4 What is the millions digit of 2315809? 2 What is the millions digit of 21655352? 1 What is the hundreds digit of 1103029? 0 What is the ten thousands digit of 1055801? 5 What is the ten thousands digit of 836275? 3 What is the millions digit of 8455700? 8 What is the ten thousands digit of 7170036? 7 What is the ten thousands digit of 213199? 1 What is the ten thousands digit of 13718463? 1 What is the ten thousands digit of 769327? 6 What is the ten millions digit of 17222742? 1 What is the thousands digit of 597363? 7 What is the hundred thousands digit of 22244819? 2 What is the hundreds digit of 3891804? 8 What is the hundred thousands digit of 1416454? 4 What is the ten thousands digit of 1405952? 0 What is the hundreds digit of 27203? 2 What is the ten thousands digit of 2157406? 5 What is the thousands digit of 1156808? 6 What is the hundred thousands digit of 33595770? 5 What is the units digit of 167208? 8 What is the tens digit of 408132? 3 What is the thousands digit of 4274734? 4 What is the thousands digit of 1955074? 5 What is the units digit of 1037657? 7 What is the thousands digit of 1374024? 4 What is the thousands digit of 6885891? 5 What is the hundreds digit of 110965? 9 What is the tens digit of 4617? 1 What is the hundreds digit of 473651? 6 What is the ten thousands digit of 5463081? 6 What is the tens digit of 3417671? 7 What is the millions digit of 9285635? 9 What is the ten thousands digit of 3571961? 7 What is the thousands digit of 813862? 3 What is the thousands digit of 3132849? 2 What is the thousands digit of 703024? 3 What is the millions digit of 2797930? 2 What is the tens digit of 385817? 1 What is the thousands digit of 6020201? 0 What is the hundreds digit of 4505095? 0 What is the hundred thousands digit of 272900? 2 What is the ten thousands digit of 6752407? 5 What is the hundred thousands digit of 234212? 2 What is the units digit of 390253? 3 What is the millions digit of 4161661? 4 What is the tens digit of 269710? 1 What is the hundred thousands digit of 1904544? 9 What is the units digit of 207615? 5 What is the thousands digit of 3880042? 0 What is the hundred thousands digit of 983435? 9 What is the units digit of 258138? 8 What is the units digit of 144948? 8 What is the tens digit of 184463? 6 What is the thousands digit of 49939? 9 What is the tens digit of 3910803? 0 What is the hundred thousands digit of 262897? 2 What is the millions digit of 26937504? 6 What is the tens digit of 518250? 5 What is the ten thousands digit of 16846769? 4 What is the units digit of 224353? 3 What is the hundreds digit of 4260110? 1 What is the millions digit of 1233741? 1 What is the tens digit of 406879? 7 What is the tens digit of 98071? 7 What is the ten thousands digit of 311364? 1 What is the millions digit of 5496408? 5 What is the tens digit of 151885? 8 What is the hundreds digit of 399072? 0 What is the units digit of 22351390? 0 What is the hundred thousands digit of 18249437? 2 What is the tens digit of 388788? 8 What is the ten thousands digit of 38249? 3 What is the hundred thousands digit of 225459? 2 What is the hundred thousands digit of 445714? 4 What is the hundred thousands digit of 148379? 1 What is the ten thousands digit of 7962924? 6 What is the units digit of 3683436? 6 What is the tens digit of 1120965? 6 What is the units digit of 226548? 8 What is the hundreds digit of 147209? 2 What is the hundreds digit of 20764841? 8 What is the thousands digit of 29079072? 9 What is the hundreds digit of 950? 9 What is the units digit of 3592359? 9 What is the hundreds digit of 504800? 8 What is the thousands digit of 315227? 5 What is the units digit of 2129027? 7 What is the hundreds digit of 176342? 3 What is the hundred thousands digit of 412736? 4 What is the thousands digit of 1921916? 1 What is the hundred thousands digit of 19577976? 5 What is the hundred thousands digit of 318194? 3 What is the hundred thousands digit of 21085308? 0 What is the hundreds digit of 5609652? 6 What is the units digit of 1140309? 9 What is the tens digit of 10012828? 2 What is the ten thousands digit of 2882213? 8 What is the tens digit of 361774? 7 What is the thousands digit of 470754? 0 What is the units digit of 106708? 8 What is the units digit of 29848831? 1 What is the ten thousands digit of 2739252? 3 What is the units digit of 1631484? 4 What is the hundred thousands digit of 324723? 3 What is the tens digit of 12224573? 7 What is the thousands digit of 2017953? 7 What is the hundred thousands digit of 3357472? 3 What is the ten thousands digit of 936036? 3 What is the thousands digit of 654046? 4 What is the thousands digit of 24933391? 3 What is the hundred thousands digit of 494490? 4 What is the hundred thousands digit of 874795? 8 What is the ten thousands digit of 783801? 8 What is the units digit of 220758? 8 What is the hundred thousands digit of 594842? 5 What is the ten thousands digit of 6335042? 3 What is the units digit of 425050? 0 What is the ten thousands digit of 1471291? 7 What is the tens digit of 19559? 5 What is the hundreds digit of 7893694? 6 What is the units digit of 703408? 8 What is the thousands digit of 55963? 5 What is the hundred thousands digit of 378343? 3 What is the units digit of 28798588? 8 What is the hundreds digit of 14095941? 9 What is the thousands digit of 408426? 8 What is the thousands digit of 910401? 0 What is the ten thousands digit of 2124044? 2 What is the thousands digit of 50374? 0 What is the ten thousands digit of 313041? 1 What is the units digit of 4840616? 6 What is the ten thousands digit of 1998082? 9 What is the thousands digit of 598981? 8 What is the hundreds digit of 787455? 4 What is the thousands digit of 856115? 6 What is the ten thousands digit of 418159? 1 What is the hundred thousands digit of 2608421? 6 What is the ten thousands digit of 8691199? 9 What is the thousands digit of 486481? 6 What is the hundreds digit of 835289? 2 What is the ten thousands digit of 202298? 0 What is the ten thousands digit of 2441380? 4 What is the tens digit of 734459? 5 What is the millions digit of 7387674? 7 What is the tens digit of 28774? 7 What is the thousands digit of 225567? 5 What is the millions digit of 1949731? 1 What is the hundred thousands digit of 133488? 1 What is the ten thousands digit of 416904? 1 What is the units digit of 6140726? 6 What is the hundred thousands digit of 4697531? 6 What is the hundreds digit of 2708276? 2 What is the ten thousands digit of 110650? 1 What is the millions digit of 13460322? 3 What is the tens digit of 2655773? 7 What is the thousands digit of 20710? 0 What is the tens digit of 5287547? 4 What is the millions digit of 1063527? 1 What is the ten millions digit of 21154200? 2 What is the tens digit of 35077764? 6 What is the units digit of 138624? 4 What is the tens digit of 965117? 1 What is the thousands digit of 2585804? 5 What is the ten thousands digit of 136311? 3 What is the ten thousands digit of 383203? 8 What is the hundreds digit of 547437? 4 What is the tens digit of 1459226? 2 What is the tens digit of 263782? 8 What is the hundreds digit of 506006? 0 What is the tens digit of 378848? 4 What is the millions digit of 33392711? 3 What is the thousands digit of 679130? 9 What is the ten millions digit of 24990614? 2 What is the thousands digit of 25110? 5 What is the hundreds digit of 1317715? 7 What is the thousands digit of 586572? 6 What is the tens digit of 27007746? 4 What is the thousands digit of 52392? 2 What is the ten thousands digit of 132807? 3 What is the tens digit of 983192? 9 What is the units digit of 283772? 2 What is the ten thousands digit of 8055053? 5 What is the hundred thousands digit of 2137500? 1 What is the thousands digit	{ "pile_set_name": "DM Mathematics" }
= -8818 + 8814. What is the closest to 2/5 in 0.2, -2911, j? 0.2 Suppose -3p = 3j, j = 6 - 8. Let l be 5/(90/(-12))(p - 1). Let c = 6 - 11/2. What is the closest to 0 in l, c, 1/3? 1/3 Suppose -4u - 16 = 16. Let l = 314 - 319. Let v be 2023/(-255) - -6 - 3/l. What is the closest to u in 3, v, -0.3? v Let a = -57/2 - -29. Let i = -466.8 + 258.2. Let r = i + 209. What is the nearest to a in -1, -2, r? r Let k(w) = 2w2 - 3w - 13. Let q be k(-2). Let l be q + ((-4)/(-5) - 2). Let j = 0.2 + -0.3. Which is the closest to j? (a) l (b) -7 (c) 3 a Let k = 0.03 - 6.13. Let x = 0.8 - 1.9. Let a = x - k. What is the closest to 2/3 in -2, -1, a? -1 Let h = 4375.9 - 4376. Which is the closest to 0? (a) h (b) -21 (c) 17 a Let i = -17 + 8. Let u = -192.1 - -479.1. Let x = -292 + u. Which is the nearest to 1? (a) -0.3 (b) i (c) x a Let n = 2017/8148 + 5/2037. Let x = 0.3 + -0.2. What is the closest to x in n, -5, 0.3, 7? n Let z = -5 - -4.6. Suppose 2c - 2n + 24 = 0, -2n + 3 - 6 = c. Let u be (6/c)/(-2)108/234. What is the closest to 0.02 in -4, u, z? u Let t = 1.4205 + 1.5795. Which is the nearest to 2/47? (a) -1/3 (b) t (c) -2/17 (d) 4/3 c Let l = -311 - -306. Let a = l + 14. What is the closest to a in -5, 1/3, 2? 2 Let r = -7 - -23/3. Let m = -0.903 + 29.903. Let z = m - 32. What is the nearest to r in -2/9, 0, z? 0 Let v = 11 - 7. Let w = -20.41 - -21.5. Let z = -1.91 - w. Which is the nearest to 3? (a) -2/5 (b) z (c) v c Let k = 4 + -4. Let w = -32 - -189. Let y = w + -151. What is the closest to k in y, -2/11, -3/7? -2/11 Let i = -1351.7 + 1358.7. Which is the closest to -27? (a) 2/5 (b) i (c) -0.4 c Let v = 166.4 + -166. Let c = 881 + -1759/2. What is the nearest to c in v, 4/3, -2/9, -2/7? 4/3 Let w = 7/2 + -29/6. Let t = 35894 + -35893.7. Let q = -3.1 + 3. Which is the nearest to w? (a) q (b) t (c) -5 a Let v = -1.9 + 0.9. Let r = -19.6269 - -7.6269. What is the closest to 0.1 in r, 0.6, v, -4? 0.6 Let i be (11 + 432/(-40))/((-2)/6). Let p be (-3)/(-9) - (-10)/(-21). What is the closest to -0.05 in p, i, 3/2? p Let m be 39/(-52) - (-5)/28. Suppose 1762o - 1758o = r + 8, -3o = -2r - 1. What is the nearest to 0 in r, -5, m, 2/15? 2/15 Let h(t) = t - 1. Let l be h(7). Suppose -l = 6r + 12. Let c = 14.5 + -14.7. What is the closest to c in -1/2, r, -2/5? -2/5 Let p = -1717 - -1292.5. Let d = 425 + p. Suppose -4u - 7 = 1. Which is the nearest to u? (a) 1/4 (b) d (c) -0.3 c Let o = 5.4 + -0.4. Let q be (-2615)/(-1569) - 17/21. Let a be (-2)/4 + (-1)/(-2). What is the closest to -0.1 in a, o, q? a Let k = 4100 - 28702/7. Which is the nearest to -0.04? (a) k (b) 2/15 (c) 1.2 (d) 0.1 d Let n = 0.4 - -0.6. Let q be (-26)/(-45) - 39/(11934/(-68)). What is the nearest to n in -5, q, -2/5? q Let n(i) = 3i3 - 6i*2 + 8i - 1. Let x be n(2). Let s be -9(-10)/x - (5 - 0). Which is the closest to 2? (a) -5/3 (b) s (c) -1/8 b Let n = 473676 + -473679. Let u = -0.2 - -0.1. Which is the nearest to u? (a) n (b) 1 (c) -2/7 (d) 0 d Let v = 12470.2 - 12470. Which is the nearest to v? (a) 5 (b) 0.4 (c) 17.25 b Let i = -12844 + 12848. Suppose 4z - 4 = -0z. Let y = z + 0. Which is the nearest to -2/3? (a) i (b) -0.5 (c) y b Let q = -564/5 - -557/5. What is the nearest to -1 in 4, q, 2, 0? q Let r = 13.42 - 14. Let i = 0.42 - r. Let u be (1/4)/(7/(-28)). Which is the nearest to u? (a) 3 (b) i (c) 1/3 c Let l = -7519 + 7519. Which is the nearest to l? (a) -5/3 (b) 36/13 (c) -0.2 c Let h(x) = -2x*3 + 3x*2 - x + 4. Let g be h(2). Which is the closest to 2/5? (a) g (b) -2/7 (c) -0.12 (d) 6 c Let f = 491 - 495. Which is the nearest to -1? (a) f (b) 2/17 (c) -1/39 (d) 1/5 c Let u be (-6)/(-20)-26 + 128/16. Let z = 4 + -3.64. Let l = z + 0.04. Which is the nearest to l? (a) u (b) 4 (c) 3/4 a Let g be (-298)/(-84) - (-4)/14. Let i = g + -4/3. Let y be (2/((-36)/(72/6)))/((-8)/3). What is the closest to y in i, -1.4, -0.4? -0.4 Let x be -12 + (-996)/(-84) - 40/(-182). What is the nearest to x in -0.08, 0, 2/5, -3? 0 Let b = 4184/5 - 836. Let h = 0.1 - -3.9. What is the nearest to 0.2 in b, h, -2? b Let q be (1830/2760 - 4/(-46))16/6. What is the closest to -1 in 8, q, 0.4, 2/21? 2/21 Let i = 123.9 - 2.9. Let h = i + -128. What is the nearest to h in -0.3, 0.2, 4? -0.3 Let i be (-4 - 39/(-9))6. Suppose im + 2c = -6, -m = -3c - 11 + 2. Let w = -1273 + 1272. What is the nearest to m in w, 5, 1/7? 1/7 Let u = -11.37 - -11.32. Which is the closest to 0.2? (a) u (b) 1 (c) 3 a Let l be 1144/(-220) - ((-42)/7 - -1). What is the nearest to -1/4 in l, 2/3, -3, 4.4? l Suppose -2 - 1 = -3v. Let u be (-4 + 4)/(2 + -1 + v). Which is the nearest to 1/2? (a) -0.1 (b) u (c) -1/3 b Suppose 32o = -4i + 31o + 19, 5i = -2o + 26. Which is the closest to 0? (a) -1 (b) i (c) 198 (d) -5 a Suppose 2o = 3f, 2f - o = -3o. Let p = 6735.2 - 6735. Which is the nearest to f? (a) p (b) -0.5 (c) -0.4 (d) 4 a Let c = -741 - -729.58. Let i = c + 12.4. Let y = i - 0.28. What is the closest to 0 in -4/5, -4/9, y? -4/9 Let m = -1064 - -1062. Which is the nearest to 0.1? (a) 1/4 (b) 4 (c) m (d) 0 d Let w = 2519.1 + -2519. Let x = 269 + -269. What is the nearest to x in -4, w, -1/3, -2? w Let r = 5.6 + 0.4. Which is the nearest to 2? (a) 1 (b) -30 (c) r a Suppose -55x + 1842 = -2943. Suppose -96w - 18 = -xw. Let q = -0.2 + 0. Which is the closest to w? (a) 1/14 (b) q (c) 5 b Let k be (-1 + 21/15)-1. Let j(d) = -d2 + 14d + 16. Let x be j(17). Let r be x/3513. Which is the nearest to k? (a) 11 (b) 2 (c) r b Let p = -381.2 - -381. Let w(c) = c*3 - 14c*2 + 10c + 36. Let n be w(13). What is the closest to p in -7, n, -5, -1/8? -1/8 Let f = 0.0079 - -222.9921. Let n = -234 + f. What is the nearest to -3 in -1/6, n, -3? -3 Suppose 85 = -i - o - 4, -i = 3o + 99. Let y be (((-2)/15)/2)/(i/(-72)). Let q = 1 + -1.2. Which is the nearest to 1? (a) 0.4 (b) q (c) y a Let o = -6 + 5. Let t = 4 - 8. Let z = -9.6 + 9.7. Which is the closest to z? (a) -5 (b) t (c) o c Let w = 6636 - 6800. What is the nearest to 1 in -1, w, 4/9? 4/9 Let l = 302 - -26. Let k = 327.9 - l. What is the nearest to k in 0.04, -0.2, 25? -0.2 Let t = 36 + -36.2. Let s = -5381 - -43051/8. Which is the closest to 0.09? (a) t (b) 0.5 (c) 1 (d) s d Let k = 337 + -351.3. Let y = -20.3 - k. Let o = 175/6 - 521/18. Which is the nearest to 2/7? (a) -5 (b) o (c) y b Suppose -278t - j - 8 = -274t, 3t = 3j + 9. Suppose 0 = 3s - 4k - 7, 4s = -4k - k - 1. Which is the nearest to t? (a) 3 (b) -9 (c) s (d) -1/5 d Suppose -30r - 59 = 4v - 27r, -4r - 75 = 5v. Let n be (-1)/1(-8)/(-12). Suppose -4 = w - 0. Which is the closest to n? (a) -2 (b) v (c) w a Let i = -57873 + 57875. Let d be 5/(-3) + (1 - -1). Which is the nearest to -2/3? (a) i (b) 1 (c) d c Let b = 28 + -28.1. Let i = 0.715 + -5.205. Let n = i + -0.51. What is the closest to b in 1, n, -0.3? -0.3 Let r = 185324 + -185324. Let o be (0 - -2)/(7/(-2)). What is the nearest to -0.11 in r, o, 1? r Let j = 23651 + -23650.8. What is the closest to j in 1/2, 6/5, -457? 1/2 Let m = -17 - -7. Let f be 9 + -4 - (-94)/(-18). Let u = 1907 + -1906. Which is the closest to 3? (a) m (b) f (c) u c Let o be 1/(-4) + 51/68. Let h = -5 + -3. Let y = 0.456 - 0.656. Which is the closest to o? (a) h (b) 1 (c) y b Let v = -25 - -16. Let j be ((-564)/270 + 2)693/(-154). Let z = -555/7 + 79. Which is the closest to z? (a) v (b) j (c) 4 b Let c(g) = -g*2 - 17g + 997. Let j be c(-41). What is the nearest to j in 2/15, 1, -0.5? 1 Suppose -233 = -28l + 775. Suppose lo + 2s = 32o + 36, -o + 9 = 5s. Which is the closest to o? (a) 3/2 (b) 1/5 (c) 2/7 a Suppose -6l = -2l + 536. Let x = -89 - l. Let n be (-2)/418/x. Which is the closest to -2? (a) 0 (b) -0.4 (c) n b Let y = 2536 - 2531. Let d be ((-2)/(-4))/((-7)/14). What is the closest to d in -1, -8, 1/11, y? -1 Let k = -249591/10 + 24959. Which is the nearest to 28? (a) -2/17 (b) k (c) 2/9 (d) 1 d Let u(z) = -14z2 - 421z - 29. Let w be u(-30). Which is the closest to w? (a) -2/7 (b) 12 (c) 2/17 c Let j = -60.1 + 60. Let f = 0.1 - j. Let m = -152 + 150. Which is the closest to -3? (a) m	{ "pile_set_name": "DM Mathematics" }
he greatest common factor of 50935 and 1220? 305 Calculate the greatest common factor of 20504 and 2024. 88 Calculate the greatest common divisor of 119383 and 99. 11 Calculate the highest common factor of 2205 and 55440. 315 Calculate the highest common factor of 3910 and 245. 5 Calculate the highest common factor of 260 and 554320. 260 Calculate the highest common factor of 1419 and 126093. 33 Calculate the greatest common factor of 38 and 533425. 19 Calculate the greatest common divisor of 3620 and 4980. 20 Calculate the highest common divisor of 416440 and 145. 145 What is the highest common factor of 221683 and 693? 77 Calculate the highest common divisor of 1163943 and 66. 33 Calculate the greatest common factor of 1676 and 34. 2 What is the greatest common divisor of 46979 and 1853? 109 What is the highest common factor of 456460 and 580? 580 What is the highest common factor of 2345 and 45091? 67 What is the greatest common divisor of 810 and 88155? 135 What is the highest common factor of 1971207 and 1005? 201 Calculate the highest common divisor of 45 and 1059327. 9 Calculate the highest common factor of 421788 and 48. 12 What is the greatest common factor of 112 and 213521? 7 What is the greatest common divisor of 15 and 10470? 15 What is the highest common divisor of 1524 and 82804? 508 Calculate the greatest common factor of 72 and 10652. 4 What is the highest common factor of 244 and 142? 2 What is the highest common factor of 3848 and 832? 104 Calculate the greatest common divisor of 201 and 111957. 201 What is the greatest common divisor of 101 and 181497? 101 Calculate the greatest common divisor of 1740 and 20280. 60 Calculate the highest common divisor of 34223 and 14. 7 Calculate the highest common divisor of 13 and 58669. 13 Calculate the greatest common factor of 15519 and 21. 21 What is the highest common divisor of 34 and 170782? 34 What is the greatest common factor of 3225 and 34185? 645 Calculate the highest common factor of 447 and 80907. 447 Calculate the highest common factor of 152100 and 720. 180 What is the greatest common divisor of 91989 and 81? 27 Calculate the highest common divisor of 72641 and 289. 17 Calculate the highest common divisor of 2670 and 21510. 30 What is the highest common factor of 2 and 139206? 2 Calculate the highest common divisor of 12309 and 5968. 373 Calculate the highest common divisor of 7878 and 10908. 606 What is the highest common divisor of 11623 and 13865? 59 What is the highest common factor of 424 and 416? 8 What is the greatest common divisor of 4620 and 9750? 30 What is the greatest common divisor of 99820 and 1540? 140 Calculate the highest common factor of 171443 and 4325. 173 Calculate the highest common divisor of 1584 and 237168. 144 What is the greatest common factor of 126363 and 12? 3 Calculate the highest common divisor of 1606464 and 1728. 576 What is the greatest common divisor of 10 and 9105? 5 Calculate the highest common divisor of 128864 and 32. 32 What is the highest common factor of 6 and 23316? 6 What is the highest common factor of 18 and 235638? 18 What is the greatest common divisor of 35 and 12649? 7 What is the greatest common factor of 84301 and 56? 7 Calculate the greatest common factor of 68 and 240652. 68 What is the greatest common divisor of 415235 and 15? 5 What is the greatest common factor of 8 and 37864? 8 Calculate the greatest common divisor of 215 and 2410. 5 Calculate the highest common divisor of 151657 and 170. 17 What is the greatest common divisor of 3212 and 2288? 44 What is the greatest common factor of 21245 and 1855? 35 Calculate the highest common divisor of 848 and 49502. 106 Calculate the highest common divisor of 109650 and 450. 150 Calculate the highest common divisor of 150 and 6364950. 150 What is the highest common divisor of 95 and 126445? 95 Calculate the highest common divisor of 271692 and 36. 36 What is the highest common divisor of 70 and 1440? 10 Calculate the highest common divisor of 690 and 2700. 30 Calculate the highest common divisor of 274992 and 337. 337 Calculate the highest common factor of 16 and 825112. 8 What is the greatest common factor of 13651 and 105193? 803 What is the greatest common factor of 375176 and 736? 184 What is the greatest common divisor of 835 and 39579? 167 What is the highest common factor of 1087590 and 56? 14 Calculate the greatest common divisor of 8952 and 3000. 24 What is the highest common factor of 29767 and 7633? 17 What is the highest common divisor of 1210 and 474078? 242 What is the highest common divisor of 190119 and 762? 381 What is the highest common divisor of 22 and 8176971? 11 Calculate the highest common factor of 92 and 65458. 46 Calculate the highest common divisor of 390515 and 3764. 941 Calculate the highest common divisor of 2000 and 23920. 80 What is the highest common factor of 500760 and 320? 40 Calculate the highest common divisor of 3745308 and 84. 84 What is the greatest common factor of 10710 and 14790? 510 Calculate the greatest common divisor of 1947 and 4686. 33 Calculate the highest common divisor of 982794 and 23902. 1406 Calculate the highest common divisor of 10 and 26210. 10 What is the highest common divisor of 3694754 and 14? 14 What is the highest common divisor of 992 and 54064? 496 What is the greatest common divisor of 1104 and 3266? 46 What is the greatest common factor of 4366 and 296? 74 What is the highest common factor of 145468 and 2661? 887 Calculate the highest common factor of 50238 and 45. 9 What is the greatest common factor of 497 and 1775? 71 Calculate the highest common divisor of 36 and 417870. 18 Calculate the highest common factor of 40 and 55296. 8 What is the greatest common divisor of 133181 and 97? 97 What is the highest common divisor of 8468 and 61364? 116 Calculate the highest common divisor of 2877 and 8421. 21 What is the highest common divisor of 1639 and 88? 11 Calculate the greatest common factor of 1147652 and 110. 22 Calculate the greatest common factor of 13896 and 744. 24 Calculate the highest common factor of 270 and 313650. 90 What is the greatest common divisor of 19459 and 976? 61 Calculate the highest common divisor of 3751 and 55. 11 What is the highest common divisor of 41076 and 819? 63 What is the greatest common divisor of 1664 and 7552? 128 Calculate the highest common factor of 6915 and 15. 15 What is the greatest common divisor of 10 and 1556465? 5 What is the greatest common divisor of 4 and 766? 2 Calculate the highest common divisor of 7884 and 43508. 292 What is the highest common divisor of 3378 and 125549? 563 Calculate the highest common factor of 926480 and 40. 40 What is the highest common divisor of 2242 and 37406? 118 What is the greatest common factor of 2706 and 607046? 902 Calculate the greatest common divisor of 292 and 24188. 4 What is the highest common divisor of 1920 and 12352? 64 Calculate the greatest common divisor of 963 and 11449. 107 What is the greatest common factor of 47230 and 240? 10 Calculate the highest common divisor of 28 and 2647582. 14 What is the highest common divisor of 560 and 78512? 112 Calculate the highest common factor of 69875 and 1375. 125 Calculate the greatest common divisor of 24139 and 239. 239 Calculate the greatest common divisor of 6584 and 184. 8 What is the greatest common divisor of 20916 and 742? 14 Calculate the highest common factor of 6233 and 1127. 23 Calculate the greatest common divisor of 968 and 593384. 968 Calculate the highest common divisor of 27 and 693657. 27 What is the highest common factor of 143646 and 534? 534 What is the highest common divisor of 367880 and 2720? 680 What is the greatest common factor of 382596 and 16? 4 Calculate the highest common divisor of 7644 and 663. 39 Calculate the highest common factor of 176 and 2486. 22 Calculate the greatest common factor of 3933 and 65132. 19 Calculate the highest common factor of 812320 and 160. 160 What is the highest common divisor of 765 and 54825? 255 Calculate the highest common factor of 527 and 20770. 31 Calculate the greatest common divisor of 510 and 14370. 30 What is the greatest common factor of 8536 and 2904? 88 Calculate the greatest common divisor of 13	{ "pile_set_name": "DM Mathematics" }
out replacement from naavrtvtrvrtvttrxa. 5/306 Calculate prob of sequence lss when three letters picked without replacement from {l: 5, s: 3, w: 1}. 5/84 Calculate prob of sequence svv when three letters picked without replacement from vsvvvsv. 4/21 Two letters picked without replacement from {n: 13, d: 1, z: 1, i: 5}. Give prob of sequence nn. 39/95 What is prob of sequence yyy when three letters picked without replacement from yyyyyyy? 1 Two letters picked without replacement from apaaappgppg. Give prob of sequence pp. 2/11 Two letters picked without replacement from mmmmmm. What is prob of sequence mm? 1 Three letters picked without replacement from {g: 3, b: 1}. Give prob of sequence gbg. 1/4 Two letters picked without replacement from hvhffhhhvvhh. What is prob of sequence vv? 1/22 Calculate prob of sequence cre when three letters picked without replacement from {c: 2, e: 2, f: 1, r: 1, v: 6}. 1/330 What is prob of sequence iyii when four letters picked without replacement from {i: 12, y: 7}? 385/3876 What is prob of sequence ovf when three letters picked without replacement from {x: 2, f: 2, v: 1, i: 1, o: 1, z: 1}? 1/168 What is prob of sequence nnan when four letters picked without replacement from {n: 3, v: 5, a: 9, r: 2}? 3/5168 Calculate prob of sequence uii when three letters picked without replacement from {i: 2, d: 4, y: 2, u: 2, l: 4}. 1/546 Four letters picked without replacement from {t: 1, q: 1, p: 2, z: 1}. What is prob of sequence pqzp? 1/60 Calculate prob of sequence ge when two letters picked without replacement from eegegeoggeegekeo. 1/6 Four letters picked without replacement from {b: 2, o: 2, r: 1, z: 1, l: 1}. What is prob of sequence zorb? 1/210 Four letters picked without replacement from {o: 2, z: 1, c: 1, x: 7, l: 3}. What is prob of sequence cxlo? 1/572 Three letters picked without replacement from {f: 5, e: 3, m: 1, z: 4, p: 1}. What is prob of sequence zpf? 5/546 Calculate prob of sequence jbb when three letters picked without replacement from jjjbjjjjjjjj. 0 Two letters picked without replacement from qqqvannnnnqqnqqavq. What is prob of sequence qq? 28/153 Three letters picked without replacement from kkkpp. What is prob of sequence ppk? 1/10 Two letters picked without replacement from {s: 6, g: 3, h: 1, j: 1, w: 1}. Give prob of sequence gh. 1/44 What is prob of sequence hk when two letters picked without replacement from jhjnrnrhnhnkkjrr? 1/40 Four letters picked without replacement from ghvwk. Give prob of sequence khwg. 1/120 What is prob of sequence ov when two letters picked without replacement from ovvovovovvoovovvoo? 9/34 Calculate prob of sequence cy when two letters picked without replacement from jaajcacaaacaaaycajj. 2/171 What is prob of sequence udd when three letters picked without replacement from {u: 1, d: 2, b: 2, c: 1}? 1/60 Calculate prob of sequence au when two letters picked without replacement from urufaafaaf. 4/45 What is prob of sequence fftf when four letters picked without replacement from tfffftffff? 2/15 Four letters picked without replacement from {j: 1, y: 1, i: 5, b: 9, s: 1}. What is prob of sequence sjiy? 1/11424 What is prob of sequence ucu when three letters picked without replacement from {s: 4, n: 12, u: 2, c: 1}? 1/2907 What is prob of sequence zz when two letters picked without replacement from pzzzpzzzzzzzppzzzz? 91/153 What is prob of sequence xnf when three letters picked without replacement from {n: 5, x: 6, l: 3, f: 1}? 1/91 What is prob of sequence ni when two letters picked without replacement from jjnip? 1/20 What is prob of sequence yj when two letters picked without replacement from {y: 1, u: 2, f: 1, k: 1, j: 5}? 1/18 Three letters picked without replacement from {c: 3}. Give prob of sequence ccc. 1 What is prob of sequence cco when three letters picked without replacement from {c: 3, o: 5}? 5/56 What is prob of sequence ca when two letters picked without replacement from eac? 1/6 Calculate prob of sequence lr when two letters picked without replacement from {r: 1, h: 1, l: 1, t: 1, u: 1}. 1/20 What is prob of sequence rr when two letters picked without replacement from {c: 4, m: 2, t: 1, k: 3, r: 3, j: 2}? 1/35 Three letters picked without replacement from zzatztmtda. Give prob of sequence dma. 1/360 Three letters picked without replacement from hhhhwhwhhhh. Give prob of sequence hwh. 8/55 Two letters picked without replacement from {p: 1, h: 12, l: 3}. What is prob of sequence hh? 11/20 Four letters picked without replacement from mwsnjdwd. Give prob of sequence njss. 0 Four letters picked without replacement from immmxzxmvimzzig. What is prob of sequence miix? 1/546 Calculate prob of sequence bb when two letters picked without replacement from {b: 4}. 1 Calculate prob of sequence qykb when four letters picked without replacement from {k: 1, q: 11, b: 5, y: 2, f: 1}. 11/11628 Calculate prob of sequence hh when two letters picked without replacement from {h: 13, d: 3}. 13/20 Calculate prob of sequence hwh when three letters picked without replacement from {w: 2, h: 2, k: 1}. 1/15 Two letters picked without replacement from {e: 8, g: 2, p: 2, q: 2}. Give prob of sequence gp. 2/91 Two letters picked without replacement from {u: 4, s: 4, i: 1, f: 2, w: 1, z: 3}. What is prob of sequence uu? 2/35 What is prob of sequence qqr when three letters picked without replacement from makqmmmkmkqmraak? 1/1680 Two letters picked without replacement from {d: 7, e: 9}. What is prob of sequence de? 21/80 What is prob of sequence iipi when four letters picked without replacement from {h: 6, p: 3, i: 4}? 3/715 Three letters picked without replacement from hjhjjjjhjjjjjjjjw. Give prob of sequence jjj. 143/340 Three letters picked without replacement from eeeeeeceecee. What is prob of sequence cee? 3/22 Calculate prob of sequence eje when three letters picked without replacement from {g: 3, j: 1, e: 3}. 1/35 What is prob of sequence reww when four letters picked without replacement from wewwwreerw? 1/42 Two letters picked without replacement from mmvvoovywv. What is prob of sequence ov? 4/45 Three letters picked without replacement from {r: 9, f: 1, m: 1, h: 4}. Give prob of sequence rrm. 12/455 Four letters picked without replacement from mzjmmozzzjojoj. What is prob of sequence zzjz? 4/1001 Two letters picked without replacement from {e: 5, c: 3}. What is prob of sequence cc? 3/28 Three letters picked without replacement from lnlapanlzl. What is prob of sequence nal? 1/45 Calculate prob of sequence quiw when four letters picked without replacement from iqwqwqqqqwwquwuiwww. 7/2907 Two letters picked without replacement from uuuuvuvuvuuvuuvu. Give prob of sequence uv. 11/48 Two letters picked without replacement from {m: 4, r: 14}. Give prob of sequence rm. 28/153 What is prob of sequence edu when three letters picked without replacement from {p: 4, e: 3, d: 3, u: 3, h: 4}? 9/1360 Three letters picked without replacement from {t: 1, j: 1, a: 3}. What is prob of sequence ajt? 1/20 Four letters picked without replacement from {a: 4, i: 2, m: 8, l: 2}. What is prob of sequence lail? 1/2730 Four letters picked without replacement from {r: 2, e: 1, h: 1, i: 2, c: 2, d: 1}. What is prob of sequence rdrr? 0 Calculate prob of sequence jnj when three letters picked without replacement from janjjajrjuuj. 1/44 What is prob of sequence ohyl when four letters picked without replacement from {f: 2, l: 3, d: 4, o: 1, y: 1, h: 7}? 7/24480 Calculate prob of sequence hyv when three letters picked without replacement from {y: 1, q: 1, w: 1, v: 6, u: 1, h: 1}. 1/165 Calculate prob of sequence yyy when three letters picked without replacement from {y: 3}. 1 What is prob of sequence bq when two letters picked without replacement from {b: 3, w: 1, k: 2, z: 1, u: 11, q: 1}? 1/114 What is prob of sequence cx when two letters picked without replacement from {e: 3, k: 1, q: 5, c: 4, t: 1, x: 1}? 2/105 What is prob of sequence md when two letters picked without replacement from sdsmmlmmmlllxmc? 1/35 What is prob of sequence ec when two letters picked without replacement from {s: 7, e: 1, c: 1}? 1/72 Four letters picked without replacement from {d: 1, c: 2, v: 1, r: 1, i: 1, w: 1}. Give prob of sequence c	{ "pile_set_name": "DM Mathematics" }
n decreasing order. 5, 4, -1, p Let j = -1 - -0.9. Let s = 0.5 + j. Put 1/3, -5, s in increasing order. -5, 1/3, s Let b = -3.4 + 20.4. Let h = b - 16.1. Let g = h + 3.1. Sort 2, 0.5, g in decreasing order. g, 2, 0.5 Let d = 7 + -8. Put -3, -6, d in decreasing order. d, -3, -6 Let j = -90 + 91. Let n = -0.3 - 0.7. Let q = n + 4. Put q, j, 0 in descending order. q, j, 0 Let w = 1.9 - 1.8. Sort -3/5, -4, w, 3 in descending order. 3, w, -3/5, -4 Let i = -16 + 15.6. Let h = 0.3 - 0.2. Let k(n) = -n + 4. Let w be k(8). Sort h, i, w. w, i, h Suppose 2t - 5b - 12 = 0, 4b = 5t - 10 - 20. Suppose -3z = -tz. Sort 3, z, -3 in decreasing order. 3, z, -3 Let j = -23/15 + 11/5. Sort 3, 1/2, -4, j in decreasing order. 3, j, 1/2, -4 Let g(p) = p*2 - 6p - 5. Let u be g(6). Suppose -4m - d = -0d + 8, -5d = 0. Sort u, m, 0 in increasing order. u, m, 0 Let x be (-763)/252 - 4/18. Let a = x - -203/60. Let r be (-4)/10 + (-68)/(-70). Sort r, a, 0.5. a, 0.5, r Let n be 10/6 + 18/(-27). Let d be n/(3 + -3 + 1). Put -5, 0, d in descending order. d, 0, -5 Let v be 3(3/(-9) - -2). Let l(m) = -m*3 + 4m*2 + 4m + 3. Let o be l(v). Sort -1, o, 1 in decreasing order. 1, -1, o Let z = -2 + -2. Let r = z + 6. Let x = r - 1.8. Put x, -2, -1/4 in increasing order. -2, -1/4, x Let k be 2/6 - (-11)/(-22). Sort k, -3/7, 1/3 in descending order. 1/3, k, -3/7 Suppose -3o = -2 - 4. Sort 0.2, 1/2, o in descending order. o, 1/2, 0.2 Let c = -0.088 + -0.112. Put 1/2, 0.1, -0.1, c in descending order. 1/2, 0.1, -0.1, c Suppose 5c + 10 = 3i, 4c - 14 = -i - i. Suppose 0q = -q + h + 1, -h - 13 = iq. Sort -1/4, q, -4 in descending order. -1/4, q, -4 Let m = -2.88 - 0.12. Put -5, -4, m in ascending order. -5, -4, m Suppose 0 = -4k - 5 - 3. Sort -1, k, 2. k, -1, 2 Let a(x) = -x - 1. Let z be a(4). Suppose -2g + 4 + 0 = 0. Sort z, 1/3, g. z, 1/3, g Let z = 131/2 + -67. Suppose -3y - 2 = -2y. Sort y, -0.4, z. y, z, -0.4 Let m be 66/(-14) - (2 + -7). Let b be 22/(-8) - 1-2. Sort m, -0.5, b in ascending order. b, -0.5, m Suppose -5g = 3m - 4m - 11, -m + 1 = -g. Let z(n) = -6n - 21. Let f be z(-4). Put -2, f, m in increasing order. -2, f, m Let v = -4 + 1. Let u(i) = i2 - 2i - 4. Let p be u(4). Let q be -3 - ((-39)/9 + 1). Sort q, v, p. v, q, p Let b be (-41)/3 + 2/3. Let p = b + 5. Let z be (-4)/p + (1 - 1). Sort z, -5/4, 1/6 in ascending order. -5/4, 1/6, z Let l = 9 + -5. Let x = 4 + -7. Sort -2, x, l in decreasing order. l, -2, x Let i = 0 - -2. Let y be 0/(-3) + 1-1. Let z be ((-20)/6)/(46/69). Put z, y, i in ascending order. z, y, i Let c(p) = p2 - 12p - 6. Let l be c(9). Let t be 3/l20 - -2. Put 4, t, 0.1 in decreasing order. 4, t, 0.1 Suppose -32 = -2o + 4o. Let g = 11 + o. Sort 1, g, 2 in descending order. 2, 1, g Let o = -3 - -2. Let f be 2/1(0 - o). Suppose 0 = -5a - 4j - f, 3a + 5j + 2 - 6 = 0. Sort 4, 0, a in increasing order. a, 0, 4 Suppose 2a - 3 = -7. Put a, 2, 4 in ascending order. a, 2, 4 Let z = -19/63 - 2/63. Sort z, -5, 0.4, -1. -5, -1, z, 0.4 Let j = 57 - 56. Put j, 3, 0 in ascending order. 0, j, 3 Suppose 2u + 3q = -3 + 27, q - 16 = -2u. Let c = -6 + u. Suppose n - 4n = c. Put n, -1, -2 in increasing order. -2, -1, n Let k(n) = 5n - 7. Let i be k(5). Let b be (-2 - 0)/(84/i). Sort 2/5, 3, b. b, 2/5, 3 Let c = -21/16 + 473/336. Let y = 5.7 - 3.7. Put 0.1, c, y in increasing order. c, 0.1, y Let m = 2.99 + -3. Let c = 11.6 - 10.6. Put c, -3/2, m in decreasing order. c, m, -3/2 Suppose -5n - 19 = -3b, -2b - b = -2n - 13. Put 4, 2, n, 1 in descending order. 4, 2, 1, n Let a = -8 - -9. Sort -3, a, 1/5. -3, 1/5, a Let t(l) = l*3 - 7l*2 + 6l - 1. Let c be t(6). Let g be 2/21/1. Sort c, g, -2. -2, c, g Let a = 4 - 1. Suppose ar = -r. Sort r, 1/4, -2. -2, r, 1/4 Suppose -2a - 2a = 0. Suppose 0 = -l - al. Suppose -5x - 6 = -21. Put l, 5, x in increasing order. l, x, 5 Let l = -15/7 - -31/21. Let c = 20 + 1. Suppose c = -5z - 4. Sort -3, z, l. z, -3, l Let u be -5(-2 + 21/15). Suppose 3z + ud = 0, 0d + d + 1 = 0. Put -4, 3, z in descending order. 3, z, -4 Suppose -3b + 4 - 1 = 0. Let j = 7 - 5. Sort j, 3, b in ascending order. b, j, 3 Let f(u) = -u*3 + 3u*2 + u + 1. Suppose 3y - b = 5, 5 = -2y + 3b - 1. Let x be f(y). Sort -1/2, 2/17, x. -1/2, 2/17, x Suppose 5q + 3x = 14, -x = 4q - 7q. Let h = -1 - -0.7. Put h, q, 4 in increasing order. h, q, 4 Let f(t) = t*2 - t + 1. Let h be f(2). Suppose -3 = hn, 5k - 2k - 2n + 13 = 0. Let l be -3 - 210/(-27) - (-4)/18. Sort l, -4, k in decreasing order. l, -4, k Suppose m + 7 = 3y + 2, 0 = -3y + 3. Sort m, -3, 4 in decreasing order. 4, m, -3 Let v = 0.7 + -0.8. Put -2/5, v, 0.2, -2 in decreasing order. 0.2, v, -2/5, -2 Let b = -1 - -1. Let r = 0.2 + b. Let t be ((-24)/(-140))/(9/30). Sort r, t, 5 in increasing order. r, t, 5 Suppose -4q - 7 = 3s, -2 = -2s + s + 3q. Sort -5, s, 1 in ascending order. -5, s, 1 Suppose -1 = 2f + 5, 0 = -3m - 2f + 69. Suppose 6g - g = m. Suppose 2y + 3 = -2c - g, 5c - 8 = 2y. Put -2, c, 5 in ascending order. -2, c, 5 Let f be (-2 - 54/(-28))-4. Suppose 0 = 3a - 3i - 36, 2i + 0i = -10. Let r be (-4)/(-2) - a/4. Sort f, 3, r. r, f, 3 Suppose 3b + 19 = -f, -2b = -3f + 4f + 14. Put f, -2, -0.4 in decreasing order. -0.4, -2, f Suppose 0 = 2q - 4q - 5b + 17, 4q = -4b + 16. Let m be (-2)/6 + (-28)/6. Suppose -j - 2j = 9. Put j, q, m in descending order. q, j, m Let c = -19 + 19. Sort -5, c, 3. -5, c, 3 Let h(d) = 2d3 - 2d2 + 4. Let u(a) = -a2 + 1. Let y(z) = h(z) - 4u(z). Let q be y(-2). Let g = -3 - q. Put 2, -4, g in increasing order. -4, 2, g Let l = 58 - 61. Sort 16, l, 3, 5. l, 3, 5, 16 Suppose f - 2 = -f. Suppose o + 0 = -2. Let s be (-5)/6 + f/o. Put 2/7, 3, s in descending order. 3, 2/7, s Let d = -2 - -3. Let k = d - 0. Let v(w) = w3 + 6w*2 - 8w - 3. Let s be v(-7). Sort -3, k, s in increasing order. -3, k, s Let u = -3 - -5. Suppose 0 = -115y + 114y + 3. Put u, -3, y in decreasing order. y, u, -3 Let i be (3 - 2)/((-6)/4). Suppose 0 = -0o - 6o - 18. Put o, i, -4 in descending order. i, o, -4 Let b(n) = n + 7. Let z be b(-7). Let j(s) = 2s - 2. Let x be j(3). Suppose -xv - 1 - 15 = 0. Sort 3, v, z. v, z, 3 Let p(f) = -f + 5. Let v be p(10). Suppose 0 = -2b - 0b. Sort -2, b, v in ascending order. v, -2, b Let p(f) be the third derivative of -f*4/24 + 2f*3 + 2f*2. Let h be p(7). Let j = 227 - 2045/9. Put 2/11, h, j in decreasing order. h, 2/11, j Let i be 16/(-64)41. Sort i, 1, 2. i, 1, 2 Let f = 111 - 111. Sort -5/7, -1/3, f, 4 in descending order. 4, f, -1/3, -5/7 Let v = 0 + 3. Suppose vk - 4i = 11 - 35, -2i + 6 = 0. Put -1, k, -5 in decreasing order. -1, k, -5 Let c = 0.3 - 0. Let n = -2.6 - -2.1. Put -2/3, n, c in descending order. c, n, -2/3 Let v be (-2)/(-5) - (-8)/(-20). Let z = 0.26 - 11.26. Let s = z - -6. Put v, 1/4, s in descending order. 1/4, v, s Suppose 0 = -3s + s. Suppose -p - 3x + 5 = s, 2x = -p + 7x - 11. Sort p, -2, 4. -2, p, 4 Let p = 193.2 - 175.13. Let u = p + -18. Let g = u + 0.13. Put -4/7, g, -3 in ascending order. -3, -4/7, g Let i = -5.05 - -0.05. Sort -0.11, i, 3/4. i, -0.11, 3/4 Let h be 23 - (3 - 6)-1. Let a = h - 25. Put a, 5, 2 in ascending order. a, 2, 5 Suppose n - u = -62, -n + 14 = -2u + 75. Let t be (9/(-6))/(n/(-4)). Sort 1, -0.2, t. -0.2, t, 1 Let i(f) = f + 3. Let p be i(-7). Put -6, 0, p in increasing order. -6, p, 0 Let w = -4 - -9. Let f = -4.25 + -1.05. Let z = w + f. Put -3, z, 4 in increasing order. -3, z, 4 Let d = -10 - -5. Let s = -0.04 + 2.04. Let u = d + s. Put -1/4, 0.4, u in descending order. 0.4, -1/4, u Suppose 2 = -f - 3. Let x(j) = j2 - 2. Let a be x(-2). Put -1, a, f in increasing order. f, -1, a Let x be (-10)/(-3) - 1/3. Let u(q) = q2 + q - 1. Let h be u(-3). Suppose -hi + 0 = 5. Sort x, i, 5 in ascending order. i, x, 5 Let u be (-2)/7 + (-16)/(-7). Suppose 7v - 2v - 25 = 0. Sort u, -4, v in increasing order. -4, u, v Let t = -1 + 1. Let d = -8.8 - -9. Let r = d + t. Put -0.3, 0.3, r in descending order. 0.3, r, -0.3 Suppose 5g + 147 = 407. Let p be (-1)/3 - g/(-12). Sort 3, -4, p. -4, 3, p Let w be 6 + (-2 - -1) + -1. Let p be -42/(-8)-2. Put 0, w, p in ascending order. p, 0, w Suppose 5*p =	{ "pile_set_name": "DM Mathematics" }
5). Solve -12 = -4g, -4g = ad + d - 7 for d. -1 Suppose -4a = -3a - 1. Let q be a/((-2)/10-1). Solve -5 = 3z - 3v + 1, 3v - 30 = -qz for z. 3 Let l(p) = 4p + 4. Let c be l(4). Let f be c + (-2)/(-4)-6. Solve 5n + f = 3t, 5 = 4n - 9n for t. 4 Let u be (-4)/6 + 34/6. Suppose -x - 3n = -0x - 4, -ux + 20 = 4n. Solve o = -2o + 4z - 5, -z - 13 = xo for o. -3 Suppose -o = 3o - 2d + 24, 5o - 2d = -29. Let r(u) = -u3 - 4u*2 + 6u + 5. Let j be r(o). Solve 5k + 5y = -15, -3k = -jk - 5y + 25 for k. -5 Let v be (-16)/(-9) - 2/(-9). Let p = 6 - v. Solve -3d + 4x = -8, x - 1 = -d + p for d. 4 Let q(o) = -o + 13. Let j be q(9). Suppose 2h = -0h - 5s - 7, -3h - js = 0. Solve -f = -5z + 4f + 30, hf = 3z - 20 for z. 4 Let p be (-20)/5 + 6 + 1. Suppose -pl = -2w - 2l + 3, -3w - 5l = -37. Solve 5v = -wy - 5, y + 3v = -4y - 16 for y. -5 Suppose 4g - 5t = 11, 0 = -g - 4t - t + 34. Solve 8 = 3v - 0a + 4a, -v + a - g = 0 for v. -4 Let l(i) = i. Let n be l(2). Solve nv - 6 - 13 = 3m, 3m = -4v + 11 for m. -3 Suppose 12y - 16y + 8 = 0. Solve -v - 7 = -yr, -3r - 16 = -4r + 3v for r. 1 Suppose -20 = -6w + w. Suppose -2q = -5y + 15, 2y + 3 = -wq + 3y. Solve 0 = s - 2d + 11, -5s + d = 10 - q for s. -1 Suppose 0 = 3r + 5t - 36, -4r - 4t + 39 = -r. Solve 3a + 2o = -r, 5a = -9o + 4o - 30 for a. -5 Let j = -1 - -1. Let q be j(-3 + -3 + 5). Solve -5t + m + 1 - 4 = q, 4t - 3m + 9 = 0 for t. 0 Let g = 35 - 35. Solve g = 4o + j - 17, -6o + 4o = -5j - 25 for o. 5 Let b(f) be the second derivative of 5f3/6 - 3f*2/2 + 7f. Let v be b(2). Solve 3u + 2a + v = 0, 3u - a + 11 = a for u. -3 Suppose -2o = 4n - 12, -n - 3n + 4 = -2o. Solve -3u + 8 = -5j, -2j - 4u + 0 = -n for j. -1 Let v = 14 - 4. Suppose 0 = -2g - g + 48. Suppose -9c + 25 = -4c. Solve 0 = -5i + ct + v, -4i = 5t - 3t + g for i. -2 Let k = -4 - -7. Suppose 0o = ko. Suppose u + oz = -z + 4, 0 = 3u - 3z - 6. Solve 3w + 3h - u = 0, -w + 2 = -5w + 2h for w. 0 Let x(v) = v - 5. Let b be x(8). Suppose 4g = -0u - bu + 34, g + u - 8 = 0. Solve 3a = -4z + 27 - g, 0 = 3z - 4a - 19 for z. 5 Let l be 1 + (0/2 - 11). Let k = -6 - l. Solve -2z + 0i + k = -i, -5z + 25 = 5i for z. 3 Suppose 3n + 0n = 78. Suppose -5y - 6 = -n. Solve -5h - c - 7 = 0, -yh + 0h - 5 = c for h. -2 Suppose -4j - 3w = w - 28, 3j - 2w + 4 = 0. Solve -5f - 5 = -5o, -4o - 3f = 1 + j for o. 0 Suppose 3n = 8n - 25. Solve 0 = 5b - 2r + n, -2b - 5r - 12 - 19 = 0 for b. -3 Suppose 17 = 2k - 7. Let j(l) = -l*2 + 12l + 5. Let w be j(k). Suppose 0 = h - 2h. Solve 2i - p - 12 = -5, h = i + wp + 13 for i. 2 Let r = -12 + 36. Solve 3 = y, -4d - 6y = -2y - r for d. 3 Let u be (-1)/2 + (-15)/(-2). Let v(n) = 2n - 10. Let g be v(u). Solve 2c = -3c + 25, gf = 4c for f. 5 Suppose 0 = 3b - 13 + 1. Suppose 0t - 16 = -3t + bh, 4h = 2t - 12. Solve -4y + 2k = 2, ty + 3k = 2y + 19 for y. 2 Suppose 8 = n - 2h, -2n + 5h + 7 = 4h. Solve -17 = nt + 5p, 7 = 3t - 2p + 3p for t. 4 Let x = 10 - 9. Let l = 1 + x. Solve 3w = -lo + 13, -7 = -o - 2w + 2 for o. -1 Let j(z) = 17z + 1. Let t(o) = -4o. Let g(a) = -2j(a) - 9t(a). Let c be g(2). Solve -10 = -cl - 0l - 4h, 10 = l + 3h for l. -5 Let o = 12 + -18. Let h be 5 + 03/o. Suppose -20 = 4z + 5l, 4z = 5l + h + 15. Solve -4y + 2t = 12, -y = -t + 4 - z for y. -2 Let n(m) = -m + 4. Let b be n(-4). Suppose -a + b + 7 = 0. Solve k + 4k - 45 = -4o, -5o + 2k = -a for o. 5 Let r = 17 + -13. Solve -3t = 2c - 9, rc - c = -t + 3 for c. 0 Suppose 2j - 2 = x, -4x + x + 3j = -3. Suppose -3b + 4m - 10 = -4b, -3b = -m - x. Solve -q - 3t = -2t, bt = -q - 5 for q. 5 Suppose 3p + 2 = -7. Let r(k) = -k3 - 3k*2 + k + 3. Let c be r(p). Suppose -s - x = -6s + 23, 3x = -s + 11. Solve q - u + cu = -s, 2u - 10 = -q for q. 0 Let t = 119 - 175. Let s be (-1)/(-2(-1)/t). Suppose -2m + s = 2m. Solve 5q - 3x = -x + m, 2q = -2x for q. 1 Suppose 0 = -3u + 11 + 1. Solve 3x = w - 3, 5 - 13 = ux for w. -3 Suppose 5 + 5 = -2w. Let c be w(2 - 24/10). Solve 0 = -3z + z - g + c, 5z + 10 = 5g for z. 0 Let t(p) = p*2 + 8p + 5. Let j = -10 + 3. Let l be t(j). Let w = 28 + l. Solve -v - 14 = 4f + 2v, -3v = -4f - w for f. -5 Let v be 3 + 18/12 - (-6)/(-4). Solve -5w = vm, -2m + 2w + w + 19 = 0 for m. 5 Suppose -3d + 5f - 6 = 0, -2d - 3d + 2f = -9. Solve dn + m - 8 = -m, -12 = 2n - 3m for n. 0 Let j(c) = -c + 15. Let h be j(6). Let y be (2/(-4))/(1/(-4)). Solve 0 = -4f + 8u - 3u - 33, -h = yf - u for f. -2 Let h(m) = 11m2 - 17m - 6. Let d(u) = 4u2 - 6u - 2. Let r(f) = 8d(f) - 3h(f). Let t be r(3). Solve 2y - 2 = 0, -ty = n + y - 4 for n. 1 Suppose 17 = 3z + 5. Solve -p - 23 = -s + 3p, zp = 4s - 32 for s. 3 Let j(t) = t*2 + 15t + 7. Let l(k) = 6k2 + 75k + 36. Let r(g) = 11j(g) - 2l(g). Let f be r(15). Solve 2b - 9 - 9 = 4n, 5b = 2n + f for b. -1 Let m(j) = -j*2 + j + 4. Let c be m(0). Suppose s = -3s + 5a + 1, -5s + 14 = -2a. Let y(p) = p + 19. Let u be y(-7). Solve -b = b + c, h + u = -sb for h. -4 Suppose 3h = -3o + 45, -5h + 60 = -h - 2o. Solve -2k + 17 = -5d, 2d - 3k = -2d - h for d. -3 Let n(p) = p3 - p2 - 2p + 1. Let w be n(2). Let b = 3 - 6. Let t be 1/b(w + -10). Solve 0f - tf + 8 = -2c, 2 = 2f + 2c for f. 2 Let a = 160 - 155. Solve -2m + a = 3m, r + 3 = -m for r. -4 Let c = -3 - -5. Let g = -4 - -4. Solve 3f - d + 2 = g, -3f + 0f = -5d - c for f. -1 Suppose -2w - 3r = -17 + 2, 2r = 3w - 3. Suppose wx = -x. Solve -3p - 11 = 5g - xp, p + 2 = 0 for g. -1 Suppose 3i = -4i + 35. Solve 2w - 35 = -iv, -8w + 3w + 5 = -4v for w. 5 Let x(h) = -h2 - 2h. Let y be x(-1). Let m be 1/y(1 - -6). Suppose mg - 95 = 2g. Solve 5l = -0l - 2o - g, 5o = -10 for l. -3 Let w be 4/((-4)/3) - 6. Let b = 9 + w. Solve 3p + p = 4r - 20, -4r + p + 11 = b for r. 2 Let b be (12/(-16))/((-4)/16). Solve -2x = -3g + 4, 4x - bx + g = -7 for x. -5 Let n = -23 + 28. Solve 3x - 9 = -4s + s, 0 = -ns - 4x + 17 for s. 5 Let y be -1(-1 - 1) + -1. Let h be y/(-3) + 100/12. Suppose k - h = -k. Solve 3n = -3r, -kr - 2n = 1 - 3 for r. 1 Suppose -4q = 2m + 2m + 4, 5q - 4 = -2m. Suppose 3z = -2v + 8, -1 = -qz - 2v + 5. Solve 4l - 5o = z, -l + 2 = -6l + 4o for l. -2 Suppose -5d + 2d + 6 = 0. Solve 5q = -4n + 12, -5n + 2q = -10n - d for n. -2 Let c be -1(-1)/(-2) + (-119)/(-34). Let d(a) = 2a + 0 + 1 - 2a3 + a3. Let z be d(-1). Solve -5g - 35 = -i - 4i, z = -cg - i - 13 for g. -5 Suppose -2j - k - 2 = -0, -4j - 4k = -4. Let m be (-5)/((-1)/j-1). Solve -m = -0w + 5w + 5b, -3w + 4b - 9 = 0 for w. -3 Suppose -11s + 10s + 12 = 0. Solve 4a + 0h - 4h - s = 0, -h = 0 for a. 3 Let s(z) = -z - 1. Let t be s(4). Let m(u) = -5u + 2 - u*2 - 2. Let i be m(t). Solve id + 8 = d - j, 0 = -2d + j + 12 for d. 4 Suppose -7 - 1 = -2t. Let x be (3 - 5) + (2 - -11). Let b = x + -7. Solve 0f - f - g - 4 = 0, -g = -tf + b for f. 0 Let x(w) = -2w. Suppose 4z - 6 = -5s + 23, 4s + 4z = 24. Let l = 2 - s. Let m be x(l). Solve 4t = 5f - 15, 2f = -t - 2t + m for f. 3 Suppose 0 = -2f - 3f + 45. Let j(h) = -h3 + 10h*2 - 6h - 3. Let c be j(f). Solve 5g - 4q = g - c, 4g - 5q + 27 = 0 for g. -3 Let b = -39 + 78. Let n = b + -24. Let h = n - 9. Solve -v + hv - 2o = 10, -5o = -2v + 25 for v. 0 Let l(m) = -m*3 - m + 7 - 5m + 6m2 + 0m. Let t be l(5). Suppose 3n = 5 + 1. Solve 2r - 2k + 12 = 0, tr + 16 = k + nk for r. -2 Let q(z) = z3 - 3z*2 - z. Let y be q(5). Solve 5b - 20 = d, d - y = -4d - 4b for d. 5 Let m(b) = b - 8. Suppose 3t = 6, 2u - 5t = -2u + 30. Let s be m(u). Suppose -sj - 60 = -6j. Solve -5i = -z + 27, -2i + j = -5z - 7i for z. 2 Suppose -3v = -2v. Let t = v - -4. Solve -4m = 12, -3m = -5y - tm - 3 for y. 0 Let g(t) = -5t. Let s be g(-1). Let x = s + -3. Solve n - 8 = 4z - n, 0 = -5z - xn - 28 for z. -4 Let o(h) = h + 10. Let q be o(-8). Suppose -qd - m + 8 = 0, 5d + 2 = -0m + 3m. Solve -5y = -dn + 10 + 25, 4y = -2n - 10 for n. 5 Let y be (32/10)/((-11)/(-55)). Solve -2 +	{ "pile_set_name": "DM Mathematics" }
ide 27208038? True Is 29 a factor of 246063426? False Is 733244738 a multiple of 278? True Does 64 divide 751479516? False Is 76 a factor of 862777156? True Is 175 a factor of 1045399075? True Is 28 a factor of 12692789? False Is 508 a factor of 43500266? False Does 37 divide 976423673? True Is 298 a factor of 39411990? True Is 151467204 a multiple of 383? False Is 53366804 a multiple of 4? True Is 1234 a factor of 832643968? True Is 76 a factor of 10243052? True Does 23 divide 389345198? False Is 50 a factor of 25978400? True Does 102 divide 562635470? False Is 410 a factor of 892270290? True Does 832 divide 1536136576? True Is 71239518 a multiple of 24? False Is 22 a factor of 43457290? False Is 61362753 a multiple of 60? False Does 17 divide 51933372? False Is 3267013089 a multiple of 343? False Does 3648 divide 292168864? False Is 18 a factor of 1865459899? False Is 10 a factor of 7701050? True Is 219428657 a multiple of 1965? False Does 12 divide 1042905144? True Is 6 a factor of 433277556? True Is 59476020 a multiple of 73? True Is 608479664 a multiple of 52? True Is 342 a factor of 17658486? True Is 862920 a multiple of 72? True Is 78 a factor of 31190551? False Does 7 divide 47139140? False Is 1294 a factor of 380592043? False Is 47 a factor of 15797123? True Does 65 divide 27094145? True Is 517 a factor of 49558586? True Does 35 divide 36954603? False Does 202 divide 135130930? True Is 375 a factor of 943126676? False Does 104 divide 1757288? True Is 1565 a factor of 421460358? False Is 23 a factor of 52365802? True Does 574 divide 17768744? True Is 3 a factor of 268819359? True Is 280 a factor of 101549750? False Does 580 divide 319752496? False Is 696 a factor of 85640712? True Is 729 a factor of 209506581? True Is 62 a factor of 18761944? True Does 39 divide 794723524? False Does 118 divide 163329082? False Is 4702022 a multiple of 115? False Does 4953 divide 770289719? False Is 883558973 a multiple of 29? False Does 97 divide 2412407169? True Does 10 divide 34847045? False Does 57 divide 43269992? False Is 26565350 a multiple of 14? True Is 226 a factor of 139771498? False Is 61 a factor of 139845870? False Is 16 a factor of 34272209? False Does 143 divide 201046560? True Is 13757775 a multiple of 233? False Does 163 divide 181625358? True Is 26515315 a multiple of 613? True Does 495 divide 230765345? False Is 40 a factor of 5358000? True Is 53 a factor of 53677711? True Does 36 divide 11408364? True Does 72 divide 6722857? False Does 22 divide 44016666? False Does 2780 divide 1779084303? False Is 576090631 a multiple of 748? False Is 27746130 a multiple of 15? True Does 985 divide 1800848905? True Is 242447490 a multiple of 13686? True Is 219 a factor of 242260433? False Is 19 a factor of 1033362928? False Is 1885 a factor of 1412567471? False Is 16 a factor of 163648496? True Is 49 a factor of 3890845? True Is 1113 a factor of 52255350? True Is 171 a factor of 50595993? True Does 22 divide 19401011? False Is 522314554 a multiple of 2579? True Is 2005499493 a multiple of 3307? False Is 1470535 a multiple of 55? True Does 854 divide 1588491365? False Is 2038977268 a multiple of 43? True Is 77 a factor of 2370564774? False Is 46457824 a multiple of 112? True Does 8 divide 30211957? False Does 10 divide 629356350? True Is 330111683 a multiple of 259? False Is 66799425 a multiple of 473? True Is 666660330 a multiple of 35? True Is 7734812 a multiple of 154? False Is 28615212 a multiple of 285? False Does 4752 divide 427680000? True Is 2484614990 a multiple of 4693? True Does 139 divide 29546300? False Is 1426 a factor of 40442786? True Does 84 divide 112722919? False Does 19 divide 25790106? True Does 83 divide 104279955? True Does 99 divide 1161049824? True Is 301 a factor of 77004959? False Is 1491 a factor of 80206253? False Is 23 a factor of 60220647? True Does 914 divide 3642883588? False Is 5831915 a multiple of 12? False Does 220 divide 7515188? False Is 8494827 a multiple of 208? False Is 1706712453 a multiple of 287? False Does 23 divide 157786532? True Is 475380 a multiple of 12? True Is 20595473 a multiple of 701? False Is 1781675 a multiple of 710? False Is 478846476 a multiple of 23? True Is 10656516 a multiple of 116? False Is 7142 a factor of 1958763108? False Does 21 divide 100997106? True Is 1390504122 a multiple of 476? False Does 53 divide 109705316? False Is 316317436 a multiple of 54? False Is 10 a factor of 17728517? False Is 18 a factor of 6353689? False Is 28094939 a multiple of 807? False Is 965 a factor of 30782400? False Does 1188 divide 332202270? False Does 267 divide 2725536? True Does 124 divide 83648163? False Is 1580406171 a multiple of 77? False Is 4225 a factor of 12332775? True Is 15855657 a multiple of 351? False Is 56774994 a multiple of 23? True Does 3264 divide 781017686? False Is 9 a factor of 9639279? True Is 12 a factor of 47748595? False Is 380016322 a multiple of 52? False Is 53394864 a multiple of 1016? True Is 984946732 a multiple of 154? True Does 244 divide 63848482? False Is 1710089781 a multiple of 386? False Does 42 divide 23163210? True Is 2646 a factor of 114517993? False Is 28 a factor of 4090184? True Does 914 divide 14980460? True Is 3057 a factor of 391676856? False Is 25404834 a multiple of 6? True Does 551 divide 25250525? False Is 1761 a factor of 277905077? False Is 483 a factor of 170142694? False Is 204 a factor of 399421127? False Does 11 divide 142908843? True Is 6704129 a multiple of 161? False Is 76547482 a multiple of 4877? False Is 49 a factor of 180697584? False Does 28 divide 392419328? True Does 19 divide 872285053? False Is 3842 a factor of 170889155? False Does 347 divide 646871501? True Is 68 a factor of 399458248? True Does 3318 divide 25432058? False Is 529689292 a multiple of 727? True Is 13 a factor of 184340667? False Is 1116 a factor of 28752373? False Is 165603072 a multiple of 768? True Is 10 a factor of 130515992? False Does 785 divide 13046119? False Is 102 a factor of 23926966? False Is 852 a factor of 446896152? True Does 763 divide 1777564915? True Is 183189400 a multiple of 2610? False Is 181 a factor of 4201146118? False Is 1794562652 a multiple of 251? True Is 358 a factor of 32885887? False Is 687127248 a multiple of 24? True Does 368 divide 1983568208? True Is 25 a factor of 183312725? True Does 106 divide 3680721710? False Is 14 a factor of 1336230? True Is 5465185 a multiple of 11? True Is 32 a factor of 12018368? True Is 347790714 a multiple of 1268? False Does 563 divide 37167704? False Does 688 divide 120796573? False Does 105 divide 602833560? True Is 20265792 a multiple of 48? True Is 35 a factor of 141781713? False Does 237 divide 95580634? False Does 7428 divide 510192430? False Is 121520848 a multiple of 53? False Is 1640 a factor of 1423494909? False Is 9 a factor of 153829809? True Is 22194447 a multiple of 3? True Does 11069 divide 91241767? True Does 61 divide 5086241? True Is 759277289 a multiple of 9? False Is 1245316 a multiple of 99? False Is 824 a factor of 556267568? True Does 3172 divide 76556220? True Does 961 divide 650182922? False Is 141 a factor of 11943969? True Is 554633976 a multiple of 1110? False Is 546375471 a multiple of 178? False Is 926 a factor of 3079667533? False Is 6 a factor of 3555687? False Is 463 a factor of 119729635? False Is 2 a factor of 14333349? False Is 11 a factor of 1227080382? True Is 279145316 a multiple of 268? True Is 11 a factor of 2880845? True Is 155 a factor of 3538437650? True Is 1619697960 a multiple of 8392? True Is 1682200852 a multiple of 508? True Is 326 a factor of 30407324? True Is 614 a factor of 180891768? True Does 350 divide 25554200? True Is 21 a factor of 147148575? True Is 902605572 a multiple of 2? True Is 330169 a multiple of 4? False Is 8 a factor of 101704492? False Is 276234497 a multiple of 250? False Does 437 divide 8238803? False Is 5 a factor of 356678586? False Is 9 a factor of 146359962? True Does 1155 divide 89714625? True Is 608 a factor of 48664320? True Is 56 a factor of 1907618? False Is 79 a factor of 8964367? True Is 11984625 a multiple of 27? True Does 10 divide 74298457? False Is 97156980 a multiple of 60? True Does 108 divide 4837044924? True	{ "pile_set_name": "DM Mathematics" }
ivide -1082361 by -529. 1082361/529 Calculate 578924 divided by 159. 578924/159 What is 193 divided by -817224? -193/817224 Divide -47 by -4630927. 47/4630927 Calculate 271282560 divided by 4. 67820640 Calculate -131537034 divided by -6. 21922839 249692 divided by 5 249692/5 Calculate -2 divided by 3916076. -1/1958038 Calculate 12646506 divided by -5. -12646506/5 Divide -15950477 by 4. -15950477/4 Divide -117463749 by -54457. 2157 Calculate 9048 divided by 5933. 9048/5933 What is 811214134 divided by 2? 405607067 Calculate -5082256 divided by 89. -57104 Divide -7450229 by -4. 7450229/4 4 divided by 24392337 4/24392337 What is 95 divided by 4013? 95/4013 What is 69 divided by -751? -69/751 18157726 divided by 2 9078863 What is 474579860 divided by -118644965? -4 What is 53432125 divided by 10686425? 5 Calculate -75905461 divided by -579431. 131 34545550 divided by 2 17272775 Divide -287020608 by -1. 287020608 What is 777065400 divided by -27? -28780200 Divide 11 by -17574368. -11/17574368 Calculate 2245274 divided by -3946. -569 Divide 5784333 by -4. -5784333/4 Calculate 19195166 divided by 4622. 4153 Divide 29 by 5104076. 29/5104076 1121480175 divided by -37 -30310275 Divide 34027 by 673. 34027/673 What is -103399836 divided by -4? 25849959 Calculate 4 divided by 130354416. 1/32588604 6126663 divided by 2042221 3 What is -5377043 divided by 497? -10819 Calculate 13962 divided by -51951. -4654/17317 Divide 27 by -35793. -3/3977 Divide 6626855 by 1325371. 5 Calculate -31 divided by -551723. 31/551723 Calculate -27676441 divided by 40169. -689 -586177250 divided by -10 58617725 Divide 4843 by -19855. -4843/19855 Calculate 3099320 divided by 20. 154966 What is 320132978 divided by -2? -160066489 What is -2058213 divided by 1? -2058213 What is 74000844 divided by -268119? -276 What is -2 divided by -2089267? 2/2089267 What is -98076284 divided by -2? 49038142 5490 divided by 366 15 -559645255 divided by 111929051 -5 2194269 divided by 1 2194269 7530180 divided by 3765090 2 Divide 469 by -1037681. -469/1037681 Divide -7176 by -22647. 2392/7549 What is 188 divided by -14083? -188/14083 Divide -1866380 by -10. 186638 -2306706 divided by 6 -384451 Divide -6252475 by -29. 6252475/29 17161686 divided by 1906854 9 What is -1171399 divided by 51? -1171399/51 Calculate -29 divided by 8061181. -29/8061181 Calculate 1949 divided by 16475. 1949/16475 Divide 36 by -3444331. -36/3444331 Divide -42481296 by 36. -1180036 378605224 divided by 189302612 2 What is 4 divided by -37093348? -1/9273337 Divide 915336 by 762. 152556/127 Divide 17930940 by 5. 3586188 Divide -497671026 by 894. -556679 Divide 234 by 15113. 234/15113 What is 5 divided by 405886? 5/405886 Divide -5 by 307616962. -5/307616962 Calculate 38017574 divided by -1652938. -23 Calculate -2 divided by -2258757. 2/2258757 Calculate -3985 divided by 55616. -3985/55616 Divide 59012928 by 23643. 2496 Divide 63 by -21823. -63/21823 What is -13234463 divided by -4? 13234463/4 402 divided by 25179 134/8393 Calculate -2 divided by -156414217. 2/156414217 -43499808 divided by 42984 -1012 What is 78633 divided by 591? 26211/197 Divide -514320 by -8. 64290 What is 42858930 divided by 1428631? 30 9311166 divided by 538 17307 Calculate 15536708 divided by 34. 456962 What is 73025346 divided by -1517? -48138 14 divided by 712707 14/712707 What is -1715 divided by 4227? -1715/4227 Calculate 29 divided by -27200701. -29/27200701 -54479661 divided by -1878609 29 Calculate 22463 divided by 10023. 22463/10023 Calculate -318 divided by 27025. -318/27025 Calculate -27011776 divided by 3904. -6919 Divide 28830735 by -5. -5766147 Calculate 921936 divided by -230484. -4 What is -4 divided by 42081488? -1/10520372 Calculate 88960256 divided by -7. -12708608 Divide 410135460 by 82027092. 5 Divide -56408544 by -6267616. 9 49172 divided by 22 24586/11 Calculate -11691812 divided by 25. -11691812/25 143 divided by -218 -143/218 -85941675 divided by -225 381963 Divide 10989930 by -1774. -6195 Calculate -25523540 divided by -5. 5104708 What is 43521960 divided by -11640? -3739 Calculate 26267720 divided by 8. 3283465 What is -6437 divided by 2494? -6437/2494 What is -3001 divided by 1057? -3001/1057 Divide 617106 by -31. -617106/31 Divide 82027424 by 2. 41013712 Calculate 23789650 divided by -951586. -25 What is 283702 divided by 31? 283702/31 What is 2 divided by -21440135? -2/21440135 Divide -438198082 by 1358. -322679 Calculate 52 divided by 1215596. 13/303899 What is 5849718 divided by -139279? -42 Calculate -90313674 divided by 15609. -5786 -1 divided by 25952169 -1/25952169 Divide -93411200 by 934112. -100 -75615977 divided by -3 75615977/3 Calculate 402167026 divided by 2. 201083513 64531488 divided by 21 3072928 Divide -183160120 by -1573. 116440 Divide 1 by -7376632. -1/7376632 Calculate 1249678825 divided by 7495. 166735 Calculate -445681673 divided by 20621. -21613 35768342 divided by 19 35768342/19 Divide 2 by -948864. -1/474432 Calculate -2571532 divided by 642883. -4 Divide 166620115 by -4. -166620115/4 1737896 divided by 4 434474 Calculate 339887613 divided by -26145201. -13 Divide 0 by 3040692. 0 Calculate 22202433 divided by 2466937. 9 What is -5912710 divided by -2956355? 2 What is -11018982 divided by 39? -282538 3814 divided by -107 -3814/107 Divide 1568842 by 45. 1568842/45 What is -357 divided by -9150? 119/3050 Divide 2791569 by -83. -2791569/83 135619 divided by 4102 135619/4102 -3085240 divided by -11260 274 4497 divided by 4371 1499/1457 What is -25082478 divided by -9? 2786942 Calculate 4059 divided by -514. -4059/514 What is -8638542 divided by 9? -959838 Calculate 59891565 divided by -3. -19963855 Divide -187367656 by 46841914. -4 Divide -31850085 by -10616695. 3 What is -2891995 divided by -2? 2891995/2 What is 11 divided by -241454? -11/241454 Calculate -53 divided by -94278. 53/94278 What is -1839 divided by 4130? -1839/4130 What is -30486 divided by -852? 5081/142 Divide -13 by -3471642. 13/3471642 What is -18719 divided by 13703? -18719/13703 -102730575 divided by -16745 6135 Calculate 39210654 divided by 127722. 307 10933 divided by -65 -841/5 Calculate 3561583 divided by 5. 3561583/5 Calculate 114 divided by -1737416. -57/868708 Calculate 13744284 divided by 2. 6872142 Divide 372953600 by 25. 14918144 Calculate -5 divided by -124570633. 5/124570633 1259071 divided by -120 -1259071/120 167928 divided by -1564 -41982/391 What is 2476931 divided by -79901? -31 Calculate -314437544 divided by -6697. 46952 Divide 0 by -9598217. 0 1001526756 divided by -333842252 -3 3617020 divided by 17 3617020/17 -1391019 divided by -21 66239 What is 43633415 divided by -8726683? -5 What is 3 divided by 178247961? 1/59415987 Calculate 3486745 divided by -201. -3486745/201 What is 0 divided by 25011209? 0 Divide 1030449725 by 6. 1030449725/6 What is 40683063 divided by 13561021? 3 233 divided by 20014 233/20014 Divide -8933486 by -4. 4466743/2 What is 3 divided by 15110180? 3/15110180 Calculate -1044 divided by -3764. 261/941 Divide -1 by -7706565. 1/7706565 What is -14281980 divided by 714099? -20 What is -6440040 divided by -20? 322002 Calculate 5 divided by -280203610. -1/56040722 Calculate 66881 divided by 410. 66881/410 Divide 4025736 by 792. 5083 Divide -182 by -65644. 91/32822 Divide 66080 by -84. -2360/3 What is -18712030 divided by 17167? -1090 Divide -67804941 by -1. 67804941 Calculate 37602264 divided by 21. 1790584 What is 13 divided by 617654? 13/617654 -2490 divided by 44812 -1245/22406 5678 divided by 950 2839/475 What is 7193 divided by -2096? -7193/2096 5654 divided by -3835 -5654/3835 Calculate -17267520 divided by 32. -539610 Calculate 3 divided by 1066673. 3/1066673 Calculate 3016 divided by -6. -1508/3 -37 divided by 70773 -37/70773 What is -4489 divided by 67? -67 Divide 2916804 by -2508. -1163 Divide 638649853 by -1. -638649853 40123 divided by 2270 40123/2270 -11011662 divided by -381 28902 -82917 divided by 9 -9213 What is 54376956 divided by 12? 4531413 Calculate -531 divided by 1194184. -531/1194184 Calculate -3790989 divided by 2. -3790989/2 What is -667 divided by 2042556? -667/2042556 -12 divided by -388071 4/129357 Divide -1178594 by -37. 1178594/37 Divide 1672486053 by -4. -1672486053	{ "pile_set_name": "DM Mathematics" }
positive. k(70212/793) Simplify (o8o/(o/(o/o(-5/12)))(o12/o)(-29))(-13/3) assuming o is positive. o(48295/36) Simplify (u*4u*(-4/3)u(u/(u/((uu/(u*0/u))/u)u))*(1/19))/(((u(uuu*(-1))/u)/uuu(-2/13))/(u0)48) assuming u is positive. u(2129/741) Simplify ((ff*0f/f*(-1/2)f(f/(f(1/13)/f))/(ff*(1/7)f))(-2))(-19/4) assuming f is positive. f*(11343/364) Simplify ((a/(a/(a(aaa/(aa(-2/25))a)/a))a)/a(-10/7))(25/6)/((a(2/9))(-32))16 assuming a is positive. a(8614/63) Simplify (((l/(l/l(-20)))/l)/l)/l(-28)(l*(3/5)l)/l(-3/17) assuming l is positive. l(661/85) Simplify ((r/(rr/r0))(-33)r/r*4rr1r)/((((r/(r(rr*(-5/3))/r))/r)/(r/((r/(rr*6))/rr)))/(rr/(r(-1)/r)r)(-1/35)) assuming r is positive. r(823/21) Simplify t(-2/17)/t(-4)t1/tt/(t/t*(3/2))t(t0)(-3/4)/(t(-4)/tt*(-2/7)t) assuming t is positive. t*(2539/238) Simplify ((s/(ss*26s))/s(-22))/(s(1/3)s(5/3)) assuming s is positive. s(-7) Simplify (g4/(g(g3/g)/g))(9/7)(g(-2/7))(-13/3)(g/g(-1))(-15) assuming g is positive. g(-550/21) Simplify (g0/g)*12(g(-2/5))(-11)(g/(g/(gg*(-1)/gg)))38/(g(-1/3)/g(-1)) assuming g is positive. g(-124/15) Simplify ((ff/(f/(ffff*(-5)))f*(-1/2)/f)/((ff*(-7)f)/ff(-1/2)f))/(f*5fff*(-6)fffff)(-2/75) assuming f is positive. f(79/25) Simplify (x*(-2/13)(xxx7)/x)/(x(-2/9)x(-3)x)(((xx/x*(-1/6))/xx)/(x/x(-3)))/(x(-2))(5/7) assuming x is positive. x(15829/1638) Simplify (hh/(hh/h*(1/9)h)((h/h1)/h)/hh)*(-48)(h/(h(hh(hhh/h1)/h)/h))(-7/13)/(h(-4)/(h/(hh(-1)))) assuming h is positive. h(3773/39) Simplify (k*(-10/11)/(kk*(-10))(k*(2/7)/k)/kkk/(k/((k/(kk(k/(k/(k/(k/(k/(k(2/37)k))))))/kk))/k)))36 assuming k is positive. k(556992/2849) Simplify ((j(-2/7))(-39))(1/44)/((j2j)/(j/(jj(4/7)jjj))j(-3/2)(jj(1/6))/j) assuming j is positive. j(-329/66) Simplify (q0)40q*(1/9)qq(-3/4)/q(q*(-1/11)/(((qq/(q/q(3/2)))/q)/q))(14/5) assuming q is positive. q(-4541/1980) Simplify (v/((v/v1)/v))*(-12)v2/v1((v(-7/4)v)/v6)(-14) assuming v is positive. v*(143/2) Simplify (((q(q/(qqq*(6/5)q))/qq0)(-6/11))21)(-29) assuming q is positive. q(-58464/55) Simplify (g(-1))(-5/17)(g1)(-2/109)(((g/((g(g/g*(2/11))/g)/g))/g)/(gg/g*(-1)g))(-11) assuming g is positive. g(78337/1853) Simplify (v*(2/9)/vvv/v(-2)v(-5)/(v/v(-5)))/(((vv/((v/(v(-3/5)/v))/v))/v(-1/5))/((vv(-2/5))/v)1) assuming v is positive. v(-79/9) Simplify ((g/g(-3)g)40g(1/4)/g(1/3))(-39/5) assuming g is positive. g(-31187/20) Simplify ((w*3(w/w(-18))/w)/((w/(w/(w(-4/13)w)))/w(6/7)))(-31) assuming w is positive. w(-59706/91) Simplify ((b/(bb/(b/(b/(b*(-2)/bb)))))*33(b/b(10/11))/b16)(-1/28) assuming b is positive. b(316/77) Simplify (((ii0)/i)(-39)(i(i/i(-1))/i)/i6)/((i(i/i*(-1/2)i)/i)*(37/2)/((ii/(i/i*(-1/4))ii)/i6)) assuming i is positive. i(-107/2) Simplify (v0/v)(-36/7)/((vv/(v/(vv/(v6/v)vv)))/v1)(v(v0v)/vvv)(-2/23)/(v(1/4))34 assuming v is positive. v(-843/322) Simplify ((i*(-2/5)i)/(iii*(-8))(i*(-8)i)/i11)9 assuming i is positive. i(-513/5) Simplify j(-3)jj*(-4)jj(1/6)/((j/j(-2/7))/j)j/j*(-6)j*0j*3j(2/7) assuming j is positive. j(31/6) Simplify (z0)4((z(zz0z)/zz)/z)(-2)((z/(zz(-1)))/z(1/2))(-34/3) assuming z is positive. z(-29/3) Simplify ((((c(-3)/c)/c)/c)/c(-4))(3/14)((cc3c)/(c/((c/((cc/(c/(c6c)))/c))/c)))/(c/c*(-4)cc/(((c(1/3)/c)/c)/c)) assuming c is positive. c(-275/21) Simplify (((nn*(-1)/nn)/n)*(-9)(nn(-6))/nn(n/(nnn(-21)/nn))/n)40 assuming n is positive. n920 Simplify (x(-10)/(x/x10)(x/x(-1))50)(2/5) assuming x is positive. x(198/5) Simplify ((v(-3)v)/((v/(vv(1/3)))/v))/((v/v(1/6))/v(-2/7))(v*(-6)v(-6))/((v(-1/4)/v)/(vvv(5/2))) assuming v is positive. v(-225/28) Simplify ((w/(w/(ww/(ww*13)ww)))(6/23)/(ww11)(-36))48 assuming w is positive. w(474048/23) Simplify (y*(-8)y*(2/3)(yy(-1/7)/yyyy)/(yy(-3)))/(y(-2/3)/yy*9(y(-3)/y)/y(-1/3)) assuming y is positive. y(-43/7) Simplify (((j(-3)/(j/(((j/((jj/j(-1/4)j)/j))/j)/j)))/(j*(4/5)j/j*(-2/3)j))40)(-13) assuming j is positive. j*(16718/3) Simplify (u/(u/((uuu/(u/(u(-2)u)))/u)))*(16/7)(u0)(3/8)(u(-1/11)/uu(-1/2))/(u(1/2)/uu(-8)) assuming u is positive. u(76/11) Simplify (j/j(5/3)j0)/(j1)*(-2/13)(j*(1/9)j(j/(j/(((jjj/(j/j4))/j)/j)))/j)/((j/j(-2))/(j/(j/(j/(jj/j*(-2/9))j)))) assuming j is positive. j(44/117) Simplify (p(1/47)p)(-35)(pp/p(1/33))/(p(p/p(-4/3))/p) assuming p is positive. p(-18668/517) Simplify (z(2/3)/((z/z(4/5))/z))/(z/((z*(-3/2)/zz)/z)zzz(-1/2))(z(-2/3)/z2)/((z(2/7)/z)/z)(1/10) assuming z is positive. z(-211/35) Simplify (i(-18)/(iii*(2/45))ii3iii/(i/(i/(i/(i*(1/7)i)))))17 assuming i is positive. i(-69088/315) Simplify ((y/(y(-2/3)/y))22y/(y/(y(-3)y)y)y4)/(y(-6)y(y/y*(-3))/y(y/((yyy*(1/3)y)/yy))/y(5/6)) assuming y is positive. y(389/6) Simplify (((iii/(i/(i/(i25/ii))))/i)/(i/(i*(-1/2)ii)i))/(ii(3/17)/iii(-40)i) assuming i is positive. i*(487/34) Simplify ((ii*6/iii)/(ii*(-3)i))*(-1/13)(i/(((iii*1)/iii)/ii))*(-21/2)/(((iii(-4)i)/iii)/(i/i(-1))) assuming i is positive. i(853/26) Simplify (l*(-3/2)ll(-2/13)l)/(((l/(l/((l/(l/(ll5)))/l)l))/l)/(l/l*(6/5)))l*(-5)/(ll*(-1/7)lll)l(-3)/l(4/5) assuming l is positive. l(-2823/182) Simplify (f(-42)/((ff40)/f))/(f25/(f/(f/(f/(((f*45f)/f)/f))))) assuming f is positive. f(-150) Simplify ((u(-1/17)(u(-1/3)u)/u)(-4/5))(-1/21) assuming u is positive. u(-16/1071) Simplify ((m(-16))*(-34)(m25)(-3/8))(-5) assuming m is positive. m(-21385/8) Simplify ((((i/i*(-1/7))/ii*(-12)i)(-33))(1/7))(-28/9) assuming i is positive. i(-3344/21) Simplify ((s(2/7))20(s1sss)(-6/11))/((s(2/3)/s)*(-29/2)(ss1)(1/4)) assuming s is positive. s(-416/231) Simplify (c/(c/c3))/c0c*(1/5)c*(1/5)c(cc((c/((cc*5c)/c))/c)/cccc)/ccc0ccc*(1/7)/cc3 assuming c is positive. c(229/35) Simplify ((m*10m)(-34)/(m(-1/19))(-16/9))(2/45) assuming m is positive. m*(-25588/1539) Simplify ((bb/(bb(-1/10)/b))/(b/(b(2/3)/b))b/b*(2/21)b(3/5))/((b/b(-2)b)(-28))38 assuming b is positive. b(298079/70) Simplify ((vvv(-5)v)/(v/(v*3/vv)))/(v(2/3))23v(-6/7)/vvv(-2)(vv(-1/4))9 assuming v is positive. v(-961/84) Simplify (j(-2/5)/j)(-22/9)/(((jj/((j*(-3/4)/j)/j))/jj)/(j*6j))(j/(j(5/7)j)j/(j/j0j))(3/2) assuming j is positive. j(3907/1260) Simplify ((l/((l*(1/3)/l)/l)l)(-38))(1/3)(l/(l(-2/3)/ll))*(8/5)((l*(-1/3)l)/l)36 assuming l is positive. l(-502/9) Simplify ((hh(-25))(22/9)/(hhh(-1/37)h(hhhh*(1/24)/hh)/h))3 assuming h is positive. h(-56549/296) Simplify (((h*0/(hh/(h/(hh/(hh*(-3))))h))/(hh(-2/11))(7/10))(-30))(-2/65) assuming h is positive. h(-4338/715) Simplify ((l(-2/3))(-1/42))(-2/51)((l*(-2/3)l)/(ll/l(-1/2)ll))/(l(-1))(-20) assuming l is positive. l(-155299/6426) Simplify ((a2)(-21))(-10)/((a(1/2))(-13)/((a(-7)a)/((aa(-1/3))/a))) assuming a is positive. a(2525/6) Simplify (((jj25)/(j/j(1/15)))(34/5))(43/5) assuming j is positive. j(549712/375) Simplify (((o/(o(-1)/oo)o)/(o8/o))/(o(-1/3)o(-2/7)))/(o/o3o/o(-3/16))(-31) assuming o is positive. o(-9599/336) Simplify (s/(s/s(-2/19))s)/s(1/4)(s/s*(3/2))/(((ss*7/s)/s)/ss)(s(1/4)/(ss/((s(ss/(s*(-5)/s))/ss)/s)s))(-6/11) assuming s is positive. s(-7289/836) Simplify (((i(-6/23)/i)/(i(18/11)/i))/(i(-8)/i(21/4)))(-12) assuming i is positive. i(-34467/253) Simplify (((i(-1/12)i)/(i/i(3/2)))/(i(5/2)*	{ "pile_set_name": "DM Mathematics" }
-4 Let o(f) = -80f + 1039. Determine o(13). -1 Let b(q) = -2q*2 - 239q + 720. Calculate b(3). -15 Let i(q) = -19q + 110. Determine i(-12). 338 Let o(b) = 39b + 276. Calculate o(-14). -270 Let k(o) = -o*3 - 12o*2 - 24o + 8. What is k(-3)? -1 Let g(f) = -35f2 + 184f + 160. Give g(6). 4 Let i(w) = w*3 + 23w*2 - 27w - 1083. What is i(-22)? -5 Let f(q) = 12q3 - 199q*2 + 112q - 21. Determine f(16). -21 Let k(f) = -f*3 + 11f*2 + 59f - 292. Determine k(4). 56 Let h(s) = 52s + 74. Give h(-3). -82 Let q(p) = p2 + 43p - 1228. Determine q(19). -50 Let c(v) = 26v + 28. Give c(-3). -50 Let x(i) = 2i*3 + 36i*2 - 35i + 36. What is x(-19)? -21 Let o(f) = 2428f - 7288. What is o(3)? -4 Let u(c) = 2c*3 + 86c*2 + 94c + 160. Determine u(-42). -260 Let k(d) = 4d2 + 38d - 154. Determine k(5). 136 Let g(c) = -378c3 - 2c2 + 1. What is g(1)? -379 Let o(h) = h2 - 10h - 440. Give o(28). 64 Let m(r) = -r3 + 16r*2 - 113r + 1422. Determine m(15). -48 Let z(u) = -1422u - 5670. Calculate z(-4). 18 Let y(n) = -9n*3 - 116n*2 + 5n - 26. Determine y(-13). 78 Let z(j) = -13j3 - j2 - 3j + 4. Determine z(-3). 355 Let u(z) = 23z - 27. Determine u(6). 111 Let b(c) = 495c - 3457. Calculate b(7). 8 Let u(h) = h*2 - 60h - 183. Determine u(64). 73 Let z(f) = -2f2 + 10f + 117. Calculate z(-7). -51 Let z(j) = 37j - 2452. Determine z(54). -454 Let k(w) = w2 + 44w + 15. Give k(0). 15 Let b(q) = -3q3 + 35q*2 + 50q + 39. Determine b(13). 13 Let h(n) = 4n3 + 130n*2 - 70n - 132. Give h(-33). 0 Let q(z) = z*2 + 50z + 242. Calculate q(-45). 17 Let f(x) = -5x2 - 1430x - 2848. Determine f(-2). -8 Let r(y) = 2y3 - 64y*2 - 51y + 1618. Determine r(32). -14 Let p(w) = 9w2 + 553w + 252. What is p(-61)? 8 Let j(r) = 4r2 - 77r + 39. Calculate j(19). 20 Let t(x) = 2019x + 10088. Calculate t(-5). -7 Let c(z) = -2z*3 - 10z*2 + 30z - 16. Calculate c(4). -184 Let a(f) = 14f + 93. Give a(-6). 9 Let h(c) = c3 + 5c*2 - 378c - 2267. Determine h(-6). -35 Let i(m) = 5m2 + 428m + 1462. Give i(-82). -14 Let p(d) = -d*3 + 20d*2 - 41d - 23. Determine p(17). 147 Let t(u) = -26u - 843. Determine t(-30). -63 Let x(v) = 3v*2 - 163v - 4925. Give x(76). 15 Let c(w) = -20w + 762. What is c(57)? -378 Let h(a) = -2a*3 + 18a*2 + 48a - 12. Determine h(11). 32 Let i(v) = -v*3 + 10v - 10. Give i(-3). -13 Let s(d) = 52d + 1292. Give s(-16). 460 Let l(u) = -46u - 670. Determine l(-11). -164 Let l(a) = a*2 + a + 5. What is l(0)? 5 Let l(g) = -63g - 4863. What is l(-77)? -12 Let t(c) = 16c2 + 78c + 3. What is t(-7)? 241 Let j(l) = l*3 + 21l*2 - 234l - 9. Determine j(-29). 49 Let h(s) = -25s + 938. Give h(37). 13 Let a(d) = -d2 + 49d + 365. Determine a(54). 95 Let v(y) = -18y + 182. Determine v(5). 92 Let b(w) = -21w + 809. Determine b(36). 53 Let v(m) = 5m2 + 18m + 733. Calculate v(0). 733 Let s(p) = p*3 - 57p*2 - 182p + 105. Determine s(60). -15 Let n(v) = 244v - 40510. What is n(166)? -6 Let w(p) = -5p*3 - 2p*2 + 4p + 7. Determine w(-1). 6 Let n(k) = -k*2 + 5k + 18. What is n(8)? -6 Let k(g) = 2g3 + 5g*2 - 30g - 7. Determine k(-5). 18 Let t(h) = h3 - h2 - 238h + 354. Calculate t(15). -66 Let i(y) = -5y*2 + 228y - 96. Calculate i(45). 39 Let l(b) = -3b3 - 72b*2 - 56b - 32. Determine l(-23). -331 Let c(t) = t*3 - 9t*2 + 9t - 53. Give c(9). 28 Let p(u) = u*3 - 5u*2 - 18u - 155. Calculate p(9). 7 Let d(v) = -40v - 717. What is d(-18)? 3 Let s(a) = 3a + 25. Give s(-5). 10 Let b(t) = 3t2 - 37t + 55. Calculate b(11). 11 Let b(r) = 265r - 6472. Calculate b(24). -112 Let z(w) = 2w*2 + 5w - 32. Determine z(8). 136 Let x(c) = 160c + 483. Determine x(-3). 3 Let s(w) = w3 + w2 + 4w + 1. What is s(-2)? -11 Let f(s) = s*3 - 55s*2 + 246s + 202. Give f(50). 2 Let m(j) = -j*2 - 30j + 1219. Determine m(23). 0 Let z(l) = l*3 + 42l*2 - 2l - 195. What is z(-42)? -111 Let l(a) = 5a2 + 272a + 3612. Determine l(-23). 1 Let r(b) = b*2 + 54b - 13. Give r(-52). -117 Let q(l) = 9l3 - l2 + 2l - 3. Calculate q(-2). -83 Let m(d) = -5d3 + 59d*2 + 8d + 25. What is m(12)? -23 Let s(t) = -3t3 + 127t*2 + 87t + 61. Give s(43). 104 Let l(f) = -2f3 - 7f*2 + 2f. What is l(-3)? -15 Let p(g) = 2g3 - 33g*2 - 77g + 1018. Determine p(17). -2 Let s(k) = 41k2 + 2951k - 131. Calculate s(-72). -59 Let i(g) = -4g3 - g. Give i(1). -5 Let x(s) = s3 - 3s*2 - 5s - 25. Calculate x(5). 0 Let p(f) = -f*2 - 138f - 4349. Calculate p(-51). 88 Let f(v) = -2v3 - 39v*2 + 91v + 553. What is f(-21)? -35 Let f(g) = -g*3 + 21g*2 - 1069g + 24013. Determine f(22). 11 Let u(g) = -g*2 - 342g - 5842. What is u(-18)? -10 Let h(a) = -131a - 16. Determine h(0). -16 Let r(s) = -30s + 70. Calculate r(2). 10 Let h(q) = -4q3 + 365q*2 - 88q - 284. Determine h(91). -11 Let x(w) = -11w2 - 43w - 117. What is x(-3)? -87 Let w(v) = -v*3 + 19v*2 + 83v - 67. Give w(22). 307 Let c(a) = 39a + 331. What is c(-8)? 19 Let m(u) = 142u + 1965. Calculate m(-14). -23 Let l(b) = 76b + 573. Determine l(-7). 41 Let q(m) = -m2 + 49m - 545. Determine q(19). 25 Let a(f) = 4f3 - 23f*2 + 7f - 10. What is a(5)? -50 Let j(o) = -2o3 - 29o*2 - 353o - 6415. Calculate j(-16). 1 Let r(k) = k*2 + 94k - 1270. Give r(-106). 2 Let j(k) = -123k + 311. Determine j(2). 65 Let a(h) = 2h*2 - 204h - 822. Give a(-4). 26 Let l(z) = -2z3 + z2 + 2z + 126. What is l(0)? 126 Let k(i) = i*2 - 26i + 582. What is k(19)? 449 Let t(d) = -16751d + 100496. Determine t(6). -10 Let t(g) = -4g*3 - 370g*2 + 183g - 254. Determine t(-93). 25 Let b(u) = -45u - 119. Give b(-3). 16 Let j(i) = 150i - 4765. Calculate j(32). 35 Let l(k) = 6k3 - 17k*2 - 14k - 1. Give l(-1). -10 Let d(w) = 63w + 139. What is d(-2)? 13 Let o(j) = j3 + 37j*2 - 4j - 227. What is o(-37)? -79 Let l(x) = 99x - 1624. Give l(17). 59 Let k(t) = -5t - 20. Give k(-1). -15 Let z(b) = -b*3 + 23b*2 + 25b + 4. Give z(24). 28 Let b(x) = x*3 + 42x*2 + 445x + 87. Determine b(-21). 3 Let a(c) = 48c + 1554. What is a(-32)? 18 Let g(c) = -c3 + c2 + 141c - 220. Determine g(-12). -40 Let h(m) = 3m2 - 63m - 80. Calculate h(22). -14 Let i(u) = -u*2 + 197u - 8764. Calculate i(68). 8 Let i(g) = -368g - 2201. Give i(-6). 7 Let w(o) = -2o*2 - 69o - 204. What is w(-29)? 115 Let a(v) = 2v2 - 16v - 60. Give a(-11). 358 Let q(w) = 70w - 2881. Calculate q(42). 59 Let j(k) = 23k - 298. Give j(15). 47 Let y(l) = -l*3 - 87l*2 + 175l - 438. What is y(-89)? -171 Let q(s) = s*2 + 435s - 6270. Determine q(14). 16 Let a(q) = -2122q - 6365. What is a(-3)? 1 Let c(l) = -l3 + 15l*2 + 10l + 73. Calculate c(-5). 523 Let n(l) = 918l + 24776. Calculate n(-27). -10 Let h(w) = w2 - 5818w + 17444. Give h(3). -1 Let q(m) = m*3 - 19m*2 - 70m + 987. Give q(20). -13 Let y(h) = 1415h - 22642. What is y(16)? -2 Let v(y) = -y3 - 6y*2 + 269y - 962. Determine v(-21). 4 Let k(p) = p*3 - 38p*2 + 165p + 12. What is k(33)? 12 Let l(d) = -599d - 1202. Calculate l(-2). -4 Let n(u) = 137u + 12351. Determine n(-90). 21 Let q(r) = -6r2 - 703r - 124. Give q(-117). -7 Let b(a) = 10a2 + 650a + 21. Give b(-65). 21 Let w(u) = -u*3 - 85u*2 + 261u - 250. What is w(-88)? 14 Let o(t) = 339t + 3787. Give o(-11). 58 Let h(b) = -7b*3 - 4b*2 + 5b - 3. Calculate h(2). -65 Let l(i) = 2i2 + 13i + 61. Determine l(-10). 131 Let l(w) = -w*3 + 8w*2 - 74w + 469. Determine l(7). 0 Let g(k) = k*3 - 5k*2 + 5k + 2. Calculate g(7). 135 Let y(g) = 2g3 - 83g*2 - 234g + 760. Determine y(44). 144 Let x(m) = -62m2 + 54m + 2. Give x(1). -6 Let y(d) = d*3 - 11d*2 + 35d - 453. What is y(11)? -68 Let k(h) = 35h + 172. Calculate k(-5). -3 Let g(h) = -h2 - 30h - 30. What is g(-27)? 51 Let g(y) = -2y3 + 152y*2 - 168y + 1388. Calculate g(75). 38 Let k(y) = -4y2 - 273y - 2179. Give k(-59). 4 Let m(d) = 2d3 + 147d*2 + 89d + 1042. What is m(-73)? -126 Let r(u) = u*3 - 37u*2 - 35u - 51. Give r(38). 63 Let u(x) = -1332x + 39938. What is u(30)? -22 Let f(h) = -6917h + 20750. Determine f(3). -1 Let g(q) = q**2 + 23	{ "pile_set_name": "DM Mathematics" }
Solve -70l = 26l + 43l + 1390 for l. -10 Solve -66d - 3808 = -138d - 152d for d. 17 Solve -15 = -294h + 235 + 926 for h. 4 Solve 0 = -11g - 1406 + 1461 for g. 5 Solve 42f - 998 = -452 for f. 13 Solve -35 - 100 = 119h - 74h for h. -3 Solve -106g = -33g + 803 for g. -11 Solve -36r - 127 = -199 for r. 2 Solve -683z + 782z - 990 = 0 for z. 10 Solve 0 = 159d - 301d - 216d + 2506 for d. 7 Solve 54f + 5f - 2100 = -46f for f. 20 Solve -177p - 2403 = -987 for p. -8 Solve -12984n + 13018n + 102 = 0 for n. -3 Solve 592 = 13n + 475 for n. 9 Solve -13z - 5z - 252 = 10z for z. -9 Solve 6829 = -333z + 1168 for z. -17 Solve 0 = 278c - 1578 - 90 for c. 6 Solve -32o + 51 + 137 + 132 = 0 for o. 10 Solve -57n = -569 - 58 for n. 11 Solve -10i + 70 = -120 for i. 19 Solve 211f = -113f + 47f - 1662 for f. -6 Solve -82n = -222 + 1124 for n. -11 Solve 0 = -13181o + 13176o - 45 for o. -9 Solve 14542p - 14532p + 92 + 228 = 0 for p. -32 Solve -3c + 0c + 3855 = 3831 for c. 8 Solve -24b + 900 = 76b for b. 9 Solve -600d = -650d - 1150 for d. -23 Solve 515c - 1407 - 4081 = 4812 for c. 20 Solve -17m + 128 + 119 = 26 for m. 13 Solve 262h - 420 + 114 = 244h for h. 17 Solve -60c - 75c = -122c - 65 for c. 5 Solve 545m + 4031 = 674 + 87 for m. -6 Solve 82a - 2640 = 50a - 144a for a. 15 Solve l = 20l + 86 - 29 for l. -3 Solve -83v + 7883 = 5227 for v. 32 Solve 620x + 1810 = 464x - 998 for x. -18 Solve -291y - 1171 - 1283 = 456 for y. -10 Solve 41u - 13u - 351 = -15 for u. 12 Solve 12 = -6q - 129 - 27 for q. -28 Solve 6u - 72 - 1072 = 110u for u. -11 Solve -2123h + 2503h + 3040 = 0 for h. -8 Solve -u - 6u - 94 = -94 for u. 0 Solve -316d - 1500 = -216d for d. -15 Solve 2418 - 917 = 79p for p. 19 Solve 319 - 535 = -12x for x. 18 Solve 0 = 2427t - 2439t + 156 for t. 13 Solve -230u = 3172 + 48 for u. -14 Solve -1558y + 43181 = -187y + 118y for y. 29 Solve 64v + 537 = -22v - 93v for v. -3 Solve -93570p + 93731p - 1932 = 0 for p. 12 Solve 18w - 76w - 335 = 71 for w. -7 Solve -152y - 3 = -200y + 333 for y. 7 Solve 0 = 150t - 3431 + 3731 for t. -2 Solve 45r - 220 = -17r + 18r for r. 5 Solve -34y = -118y - 2604 for y. -31 Solve -11g + 39 - 33 = -71 for g. 7 Solve -105v + 175 = -120 - 125 for v. 4 Solve -16p + 22 = -10 + 32 for p. 0 Solve -124g - 234 = -150g for g. 9 Solve -45r + 291r + 68 = -178 for r. -1 Solve -5x + 62x - 154 = -1807 for x. -29 Solve -929g + 441 = -1076g for g. -3 Solve 12114m - 12107m + 140 = 0 for m. -20 Solve 0 = -409v + 421v - 132 for v. 11 Solve y = 7y + 11y - 170 for y. 10 Solve 3902 = -683l + 196l - 9734 for l. -28 Solve 19395z = 19427z - 320 for z. 10 Solve 31u + 28 = 29u for u. -14 Solve 512m - 180m = 4648 for m. 14 Solve 0 = -44785n + 44774n - 143 for n. -13 Solve -197y - 709 = 532 + 1714 for y. -15 Solve 5567 = -321a - 4946 + 3451 for a. -22 Solve -10y - 11y + 1083 = 36y for y. 19 Solve -62u + 448 = 14 for u. 7 Solve -8y - 8y - 16 = 0 for y. -1 Solve 54 + 8 = -22o - 202 for o. -12 Solve 18o + 130 = 25o + 3o for o. 13 Solve 162z - 1344 = -86z + 56z for z. 7 Solve -77 = 16k - 382 + 145 for k. 10 Solve 0 = 300c + 1588 + 2312 for c. -13 Solve 49 - 11 = 43q - 48 for q. 2 Solve 2544 - 3110 = 29k - 1581 for k. 35 Solve -166y - 158y + 321y = -42 for y. 14 Solve -1283 = -g - 602 - 646 for g. 35 Solve -22c - 1064 = 38c - 4c for c. -19 Solve 0 = -57b - 33b - 11 + 11 for b. 0 Solve 1627 = 86a - 26a + 367 for a. 21 Solve 2l + 496 + 171 = -27l for l. -23 Solve -16v = 4958 - 4942 for v. -1 Solve -39b + 114 = 889 + 83 for b. -22 Solve 0 = -3i - 24201 + 24240 for i. 13 Solve -220w - 1164 = -317w for w. 12 Solve 478p + 1607 + 403 + 380 = 0 for p. -5 Solve 5 - 107 = -34k for k. 3 Solve 360c - 549 = 4131 for c. 13 Solve -52r + 2357 = 81r - 2165 for r. 34 Solve 14l + 17l - 17l + 182 = 0 for l. -13 Solve -202c + 60c = -26c + 928 for c. -8 Solve -2v - 168v - 199 = -29 for v. -1 Solve -239 = 17c - 341 for c. 6 Solve 343i = 5029 + 1488 for i. 19 Solve 0 = 18t - 6t + 19t - 186 for t. 6 Solve -219 - 236 = -21l + 70 for l. 25 Solve 0 = -326x + 105x + 4862 for x. 22 Solve 53y + 46y - 1339 + 4309 = 0 for y. -30 Solve 0 = 47k - 36k + 41k - 104 for k. 2 Solve -11442z + 154 = -11428z for z. 11 Solve 80r + 35r + 2750 = -10r for r. -22 Solve 0 = -83x - 84x + 1169 for x. 7 Solve -529 = 41f - 3f - 301 for f. -6 Solve -58 = -13q - 293 + 118 for q. -9 Solve 193m = -75m + 4288 for m. 16 Solve -422o - 14384 = 74o for o. -29 Solve 439 + 17471 = -819z + 2349 for z. -19 Solve -545a - 2229 = 5885 + 1151 for a. -17 Solve 0 = -479v - 355v - 10121 + 35141 for v. 30 Solve -99k - 212 = 53k + 3892 for k. -27 Solve 274191f - 104 = 274178f for f. 8 Solve 456m - 122m = -2338 for m. -7 Solve -d - 6d + 0d + 8d = 0 for d. 0 Solve -504f + 80f = -2968 for f. 7 Solve 9d + 17d - 37d - 187 = 0 for d. -17 Solve -170 = -6v + 29v + 11v for v. -5 Solve 3o - 55 = -64 for o. -3 Solve 767l = -284l + 27326 for l. 26 Solve 0 = 567z - 506z - 116 - 6 for z. 2 Solve 799 - 309 = 7m + 28m for m. 14 Solve 109w + 430 = -182w - 152 for w. -2 Solve -45s = 321 - 186 for s. -3 Solve 0 = -55g - 59g + 1864 + 644 for g. 22 Solve -1492j + 2998 + 8107 = -21719 for j. 22 Solve -117p - 1074 = 208p + 876 for p. -6 Solve -2j + 461 - 437 = -8j for j. -4 Solve 6x + 43x = 196 for x. 4 Solve -8022h = -8024h + 14 for h. 7 Solve -28 + 23 = 6v - 35 for v. 5 Solve -159h + 5773 = -600h - 10103 for h. -36 Solve 0 = -891o + 899o + 40 for o. -5 Solve -95l - 365l = 7820 for l. -17 Solve -204g + 20923 - 427 = -936g for g. -28 Solve 67g + 488 = -584 for g. -16 Solve -9880w = -9865w - 19 + 109 for w. -6 Solve 1075j - 4 = 1074j - 0 for j. 4 Solve 1229 = -19p + 1115 for p. -6 Solve -37p - 273 = 35p + 159 for p. -6 Solve 334k + 25k = 1795 for k. 5 Solve -9c + 15c + 25 = c for c. -5 Solve 0 = 7u - 16u - 68 - 31 for u. -11 Solve -470u + 384u = -1032 for u. 12 Solve 0 = -267s - 4844 + 1106 for s. -14 Solve 3633 = 35f + 3738 for f. -3 Solve -52c - 121c = -3287 for c. 19 Solve 0 = -76k + 37k - 31 - 86 for k. -3 Solve 44m + m + 45 = 0 for m. -1 Solve -317l = -231l - 344 for l. 4 Solve -581 = -2n - 621 for n. -20 Solve 0 = -1448946m + 1448976m - 60 for m. 2 Solve 0 = -111i + 7840 - 5065 for i. 25 Solve 220u - 320u = -178u - 156 for u. -2 Solve -54f - 22f - 117 = 41f for f. -1 Solve -69c = 47c + 651 - 3551 for c. 25 Solve -103q = 155q + 69q + 3597 for q. -11 Solve -152s = -298 - 158 for s. 3 Solve -93v + 82 = -104 for v. 2 Solve -21181 = -2t - 21149 for t. 16 Solve 154w + 1503 + 345 = 0 for w. -12 Solve 0 = 6m - 87 + 63 for m. 4 Solve 0 = -229p - 133p + 26p - 6720 for p. -20 Solve 10j + 6 + 35 = -31j for j. -1 Solve -3q = -237 + 207 for q. 10 Solve 756l - 1615 = 433l for l. 5 Solve -169 = 1458m - 1471m for m. 13 Solve 12207c - 12220c = -273 for c. 21 Solve -18554a + 9 = -18551a for a. 3 Solve -943l + 784l = 0 for l. 0 Solve -30g - 315 = -43g + 34g for g. -15 Solve 41a - 959 = 800 - 242 for a. 37 Solve 254r + 462 - 378 + 424 = 0 for r. -2 Solve -37s = 586 + 228 for s. -22 Solve r + 4r = -65 - 15 for r. -16 Solve 493k + 8 = 495k + 72 for k. -32 Solve 0 = -1016l + 389l + 379l - 4712 for l. -19 Solve 32c - 796 = -956 for c. -5 Solve -85m + 390 + 51 = -69 for m. 6 Solve -181h = -116h - 1820 for h. 28 Solve -p + 9 = 7 for p. 2 Solve 89g - 1845 = 14g - 130g for g. 9 Solve -71w + 38w = 49w + 410 for w. -5 Solve 361 = -96d - 48 - 263 for d. -7 Solve -203m + 233 = -235 - 750 for m. 6 Solve -103s + 659 = 38s - 2584 for s. 23 Solve 70 - 126 = 36c + 124 for c. -5 Solve -334w - 1609 = 2814 + 2257 for w. -20 Solve 662 = 21s + 96s - 40 for s. 6 Solve -417h - 1680 = -137h for h. -6 Solve 10g - 18g + 16 = 0 for g. 2 Solve -86z + 542 = -399z - 1649 for z. -7 Solve -2138 = -24c - 2618 for c. -20 Solve 411u - 4561 + 40 = 0 for u. 11 Solve -141q + 144 = -79q - 104 for q. 4 Solve -2246040f = -2246072f - 960 for f. -30 Solve -2348y + 2361y = -65 for y. -5 Solve -83q - 532 - 28 = 104 for q. -8 Solve -838o - 2112 = -934o for o. 22 Solve -31b - 36*	{ "pile_set_name": "DM Mathematics" }
. -2m2 + 1965m Collect the terms in -355809s + 1440642s - 161 + 161. 1084833s Collect the terms in -11273q - 11275q - 11299q + 45093q - 11253q. -7q Collect the terms in 4370 - 1620p + 812p - 5p*2 + 810p. -5p2 + 2p + 4370 Collect the terms in -4411805z - 33 - 5z*2 + 4411805z. -5z2 - 33 Collect the terms in -6470 - 6461 - 78h*3 + 12931 - 95h*3. -173h*3 Collect the terms in -4230188k + 4230192k - 7k*2 + 4k*2. -3k*2 + 4k Collect the terms in 1071m + 1060m - 2325m. -194m Collect the terms in -4z - 5322 + 2302 + 2633. -4z - 387 Collect the terms in -217m - 234m + 11264 - 229m + 652m. -28m + 11264 Collect the terms in -f2 + 491 - 119040f + 119040f. -f2 + 491 Collect the terms in 12388390343472c - c*3 - 12388390343472c. -c*3 Collect the terms in -2514800l*3 - 710828l*3 - 1488811l*3. -4714439l*3 Collect the terms in 8729493a*2 - 17458981a*2 - 343a*3 + 8729488a*2. -343a*3 Collect the terms in -253b*2 - 444b*2 + 1191b*2. 494b*2 Collect the terms in 148719950d + 6d2 + 135 - 148719950d. 6d2 + 135 Collect the terms in 2418926q*2 - 1613 + 1613 - 2418962q*2. -36q*2 Collect the terms in 22 - 38 + 16 + 5983773y. 5983773y Collect the terms in -29f - 31f - 60f - 14 - 37f + 159f. 2f - 14 Collect the terms in 301u*2 + 125u*2 - 685u*2 - 20u + 258u2. -u2 - 20u Collect the terms in 2l3 - 2907783 + 2907492 - l3. l3 - 291 Collect the terms in -11 + 5 - 33311a*2 + 6 + 33305a*2. -6a*2 Collect the terms in -10391 + 229x*3 - 415x*3 + 192x*3 + 10391. 6x*3 Collect the terms in 11p*3 - 14p*3 + 40p*3 - 4469p*2 + 4470p*2. 37p3 + p2 Collect the terms in 2612 - 1359 - 1255 + 6533o. 6533o - 2 Collect the terms in -2909z + 963z + 965z + 983z. 2z Collect the terms in 4202467n*2 - 8405052n*2 + 4202539n*2. -46n*2 Collect the terms in 716 - 312 - 188 + u + 2u - 216. 3u Collect the terms in -5 - 2416k + 5 + 39 - 13. -2416k + 26 Collect the terms in 57823s*2 - 13s*3 + 3s + 8s3 - 3s - 57823s2. -5s*3 Collect the terms in -1801c + 871c + 321c + 318c + 298c. 7c Collect the terms in 57013x - 28522x - 28488x. 3x Collect the terms in 9k - 33k - 30k - 10k - 3k*2 - 33k - 13. -3k2 - 97k - 13 Collect the terms in -12p3 + 95694099979p - 95694099979p. -12p*3 Collect the terms in -74958539 + 37478969 + 37479570 + p. p Collect the terms in -21124j + 10552j + 10561j - 2 - 15. -11j - 17 Collect the terms in 11161074m - 5581362m - 5579706m. 6m Collect the terms in 11686r*2 - 5525r*2 + 22861r*2 + 6634r*2. 35656r*2 Collect the terms in 33 - 41 + 1307a + 6. 1307a - 2 Collect the terms in 174y*3 - 103y*3 - 118y*3 - 81y*3 - 192y*3. -320y*3 Collect the terms in 14 - 402k + 398k - 15k*3 + 148k*2 - 148k*2. -15k*3 - 4k + 14 Collect the terms in -2117q - 60q*2 - 3 + 1 + 1 + 2083q. -60q2 - 34q - 1 Collect the terms in 15235t + 3071t + 2133 - 2133. 18306t Collect the terms in -38601h + h*2 + 80360h - 39296h. h2 + 2463h Collect the terms in 5320s2 + 3025s*2 + 3058s*2 - 3107s*2. 8296s*2 Collect the terms in -82d*3 + 5d + 1222 + 1215 - 2d2 + 4d*2 - 2437. -82d*3 + 2d*2 + 5d Collect the terms in -97d2 + 97d*2 - 11225d*3 - 13164d*3. -24389d*3 Collect the terms in -4a*3 - 63a*3 - 19a*3 + 74606a*2 + 74601a*2 - 149207a*2. -86a*3 Collect the terms in -15t + t*2 - 12t - 1 - 5t2 + 0t + 6t. -4t*2 - 21t - 1 Collect the terms in 115d2 + 23d*2 + 55d*2 + 45d*2 - 49d*2 + 2d*2. 191d*2 Collect the terms in -498f + 9f3 - 485f - 273f2 + 983f. 9f3 - 273f*2 Collect the terms in 1106k - 221k - 203k - 205k - 201k - 200k - 86k. -10k Collect the terms in -11386t + 2883 - 2883. -11386t Collect the terms in -k3 - 7457k*2 + 14913k*2 + 1320 - 7458k2. -k3 - 2k2 + 1320 Collect the terms in 2618 + 2623 - 13066 - 11i + 2604 + 2607 + 2614. -11i Collect the terms in 102y - 113y + 92y - 42y. 39y Collect the terms in -236m + 90m - 183m - 329m + 40m. -618m Collect the terms in -101385 - 8g + 50693 + 0g + 7g + 50689. -g - 3 Collect the terms in -46 + 20 + 464488c + 26. 464488c Collect the terms in -9 + 1542n*2 + 9 + 1502n*2 - 3041n*2. 3n*2 Collect the terms in -3w*3 - 2w*2 + 9769 + 5w*3 + 5288 - 2172. 2w*3 - 2w*2 + 12885 Collect the terms in -5301l + 10375l - 5294l. -220l Collect the terms in -602o*2 + 602o*2 + 20o*3 - 1345885 + 1345885. 20o*3 Collect the terms in 5699a*3 - 2583a*3 - 3087a*3. 29a*3 Collect the terms in -292f + 102f + 9 + 104f - 239f2 + 86f. -239f2 + 9 Collect the terms in 441t + 417t - 858t + 1091t2 - 542t*2. 549t*2 Collect the terms in -7f + 1136f2 - 12f - f + 13f3 + 20f. 13f3 + 1136f*2 Collect the terms in 3i + 246825 - 2i - 246825 + 32i*3 + i. 32i*3 + 2i Collect the terms in -3n - 4190 - 4524 + 8714. -3n Collect the terms in 855g2 - 1405g*2 + 1002g*2. 452g*2 Collect the terms in 317 - 4757658w - 317. -4757658w Collect the terms in -2806 + 22y - 2825 + 8450 - 20y - 2819. 2y Collect the terms in 25584 - 51160 + 2w + 25579. 2w + 3 Collect the terms in -2630y3 + 2672y*3 + 1370y*3. 1412y*3 Collect the terms in 27c2 + 362 - 1158 + 439 - c3 + 357. -c*3 + 27c*2 Collect the terms in -1213h*2 - 1182h*2 - 1187h*2 + 5915h*2 - 1100h*2 - 1184h*2. 49h*2 Collect the terms in 42212v*2 - 42197v*2 - 2581275 + 2581275. 15v*2 Collect the terms in 20 - 13 - 5 + 5317h*2. 5317h*2 + 2 Collect the terms in -20 - 22639a*2 + 23 + 22425a*2. -214a*2 + 3 Collect the terms in -2959w*2 + 5912w*2 - 2955w*2 + 1901. -2w*2 + 1901 Collect the terms in -123n + 33 - 11n + 73n - 33. -61n Collect the terms in 275x + 1716 + 268x - 6x*3 - 813x + 270x. -6x*3 + 1716 Collect the terms in 1 - 11195563854223i + 11195563854223i - 49i*2. -49i*2 + 1 Collect the terms in -111117c*3 - 111117c*3 - 111122c*3 + 333350c*3 + 3c*2 - 3c*2. -6c*3 Collect the terms in 50v*3 - 2179686673 + 2179686672 + 33v*3. 83v*3 - 1 Collect the terms in 3088g - 819 - 2g2 - 3088g. -2g2 - 819 Collect the terms in -27 - 19g*2 + 3g + 27 - 15g2 - 29g*2. -63g*2 + 3g Collect the terms in -1051 + 175i2 - 1053 - 1045 + 3149. 175i*2 Collect the terms in 18860z - 6287z - 6286z - 6285z - 2z*3. -2z*3 + 2z Collect the terms in -142s2 - 179s*2 - 4s*2 - 183s*2. -508s*2 Collect the terms in 11f + 198 - 6 + 103 - 25f. -14f + 295 Collect the terms in 40028k - 19137k + 51676k. 72567k Collect the terms in -5272t2 + 1303t*2 + 1314t*2 + 1317t*2 + 1300t*2. -38t*2 Collect the terms in 84y + 107y + 74y + 78y + 76y - 429y. -10y Collect the terms in 1495f - 2 + 2 + 1563f + 1502f + 1506f + 0 - 6064f. 2f Collect the terms in -9630s - 3700s - 4698s - 27674s. -45702s Collect the terms in 4b + 2657b3 - 2660b*3 - 10b - 3b. -3b*3 - 9b Collect the terms in -26j3 + 79j*3 + 20j*3 + 6j*3 - 76j*3. 3j*3 Collect the terms in 497265f*2 + 497005f*2 - 1491283f*2 + 497010f*2. -3f*2 Collect the terms in 392z*2 + 137z*2 + 68 - 9z - 19. 529z2 - 9z + 49 Collect the terms in -9998 - 10007 + 19994 + 81j. 81j - 11 Collect the terms in 9l - 32 + 22 + 9 + l + 28. 10l + 27 Collect the terms in -553z + 2216z - 553z - 1 - 545z - 566z + 1. -z Collect the terms in 1050c + 1689c + 743 - 743. 2739c Collect the terms in 324 - 77 - 86 - 86 + 963p - 75. 963p Collect the terms in 10 - 6 - 2 + 1608u - 1631u. -23u + 2 Collect the terms in -81412l*2 - 81230l*2 + 162647l*2. 5l*2 Collect the terms in 43217 - 2978936h*2 - 43217. -2978936h*2 Collect the terms in 2584u*2 - 2878u + 993u2 + 2878u + 104u2. 3681u*2 Collect the terms in 70688a*3 - 70679a*3 + 2a - 2a + a - 4a + 2a. 9a*3 - a Collect the terms in 8c + 21473 + 2c - 10672 - 10792. 10c + 9 Collect the terms in 81l + 643l + 1048l - 1767l. 5l Collect the terms in 198s - 59s - 8567s*3 - 58s - 54s. -8567s*3 + 27s Collect the terms in 84j*3 + 44972	{ "pile_set_name": "DM Mathematics" }
). 21sqrt(2) + 2450 Simplify (4 + 1sqrt(243)-3 + (3 + sqrt(243))-2)*2. 180sqrt(3) + 6079 Simplify 5(3 + (-6(sqrt(200) + 0) + -2)*2). 1200sqrt(2) + 36035 Simplify (-6sqrt(1300)-1)/(sqrt(36)5 + sqrt(12)/sqrt(3)-3). 5sqrt(13)/2 Simplify -2 + (((sqrt(480)/sqrt(8))/sqrt(4) + sqrt(15))/sqrt(2352))2. -387/196 Simplify (-5(sqrt(171) + (2sqrt(171) - sqrt(171))))2 - (2sqrt(1539) + -3). -18sqrt(19) + 17103 Simplify -3(sqrt(264)/(sqrt(176) - sqrt(11)) + (sqrt(24) - sqrt(288)/(sqrt(36)/sqrt(3))))/(sqrt(40)/(sqrt(45) + sqrt(5)) + sqrt(24)/sqrt(3)-4). 4sqrt(3)/15 Simplify ((sqrt(245) - 1sqrt(245)) + 5)2 - (-1sqrt(5)-6 - -2sqrt(45)). -12sqrt(5) + 25 Simplify -5 + ((2sqrt(11) + sqrt(11))-5 + -4 - (-2 + (1 + sqrt(11))4))*2. 228sqrt(11) + 4002 Simplify ((-6sqrt(121)-1 - sqrt(121)) + sqrt(121))/(sqrt(99)/(-2sqrt(9)))-36. 216sqrt(11) Simplify 3 + -1sqrt(1216)-4 + -1. 2 + 32sqrt(19) Simplify ((sqrt(343) + -1)21 - (-1 + 2 + sqrt(343) - sqrt(343))*2) + 4. -14sqrt(7) + 347 Simplify (sqrt(242)-22)*25 + (sqrt(324)1)/((sqrt(22)-1)/sqrt(11)). -9sqrt(2) + 19360 Simplify sqrt(44)/(-1sqrt(4))-1 - ((sqrt(352)/(-1sqrt(8)))/sqrt(4))*2. -11 + sqrt(11) Simplify (((1sqrt(243) - sqrt(243))*2 - sqrt(3)) + sqrt(48) + 4 + -4)-4. -12sqrt(3) Simplify -1 + ((0 + sqrt(832) + sqrt(832)-2)-43)*2. 119807 Simplify (1 + 2 + 0 + (sqrt(1008) - (sqrt(1008) + sqrt(1008) + (sqrt(1008) + 0 + sqrt(1008) + sqrt(1008))5)))*2. -1152sqrt(7) + 258057 Simplify (((sqrt(390)-2 - sqrt(390))/sqrt(10)-2)/((sqrt(147) - sqrt(147)-3)2))*2. 117/784 Simplify (1sqrt(162))/(sqrt(1350)/sqrt(9)). 3sqrt(3)/5 Simplify (2(-5 + sqrt(448)) - (-1(-3 + sqrt(1008) + sqrt(1008) - sqrt(1008)) + sqrt(1008)))2. -416sqrt(7) + 1961 Simplify (0 + sqrt(13)1 + 5)2 - ((sqrt(832))2 + -5). -789 + 10sqrt(13) Simplify sqrt(2448) + -1 + -4 + (sqrt(2448) - (0 + sqrt(2448) + -2)*2) - ((sqrt(2448)-3 + -1)-4)2. -354985 - 1080sqrt(17) Simplify (-5-4(sqrt(133) + (sqrt(133) - sqrt(133)2) + sqrt(133) - sqrt(133)))/((sqrt(84)1 + sqrt(84))/sqrt(12) + -4sqrt(14)/sqrt(2)). 0 Simplify 5(-1 + (sqrt(130)/sqrt(90))*21-4 + 2). -215/9 Simplify -2 + (sqrt(1300) + 0)2 - ((1sqrt(104) - sqrt(104))-1)/sqrt(8). 1298 Simplify -4 + -2 + (((sqrt(68) - sqrt(68)4) + sqrt(68))*2 - ((sqrt(153) - sqrt(153)-3)*2 - sqrt(17))). -2182 + sqrt(17) Simplify -2(sqrt(19)-3)2 + 3 - (6(sqrt(19) + -1sqrt(19) + -2))2. -483 Simplify (sqrt(768) - (sqrt(768) - -4(sqrt(768) + 0 + sqrt(768))))*2 + (sqrt(72) - 1-2sqrt(72))/sqrt(6). 6sqrt(3) + 49152 Simplify (((5-2sqrt(209) - sqrt(209)) + sqrt(209) - sqrt(209))-6)/(sqrt(99)/((sqrt(45)-3 - sqrt(45))/sqrt(5))). -264sqrt(19) Simplify ((sqrt(1088) - (-4 + -2sqrt(1088)))*2 + ((2sqrt(612))2 - (sqrt(17) - (sqrt(1088) + 1)2)))-4. -53380 - 828sqrt(17) Simplify -2(sqrt(1216) + 0 + 5)-1-1. -16sqrt(19) - 10 Simplify (0 + (sqrt(7) + sqrt(7)-25)2 + (sqrt(28)/sqrt(64))2)3. 27237/16 Simplify 5((sqrt(425) + (sqrt(425) - (sqrt(425) - (sqrt(425) + 1))) + 3 + sqrt(425))*2 + sqrt(425)) + (5(sqrt(425) + 0 - sqrt(425))-6)2. 625sqrt(17) + 19205 Simplify ((1 + 2(sqrt(3388)2 + 0))-3)2. 1584sqrt(7) + 487881 Simplify (-5 + 0 + sqrt(2) + sqrt(2) + -3 - (-1 + 31sqrt(2)))*2. 14sqrt(2) + 51 Simplify (((1sqrt(91) + sqrt(91))-3 + sqrt(91) + -32sqrt(91))/(51sqrt(343)))*2. 1573/1225 Simplify ((sqrt(189)-1)/sqrt(7) + ((2sqrt(189) + sqrt(189))/sqrt(7))2)532. -90sqrt(3) + 7290 Simplify -5 + -3 + (((0 + sqrt(76))5 - sqrt(76))2 - ((sqrt(76) + 1)2 + 1)). -4sqrt(19) + 1130 Simplify ((1 + (sqrt(192) - -2sqrt(192))*2 - sqrt(192)) + sqrt(24)/(sqrt(16)/sqrt(2) + sqrt(8)) + sqrt(3) + (sqrt(3) - (-1sqrt(243) + sqrt(243))))-2. -3458 + 11sqrt(3) Simplify ((66sqrt(156)4)/((-4sqrt(192) - sqrt(12))1))2. 269568/289 Simplify ((sqrt(156) + (sqrt(156) + (sqrt(156) - (sqrt(156) + sqrt(156)4) - sqrt(156)))3 + sqrt(156))/((sqrt(432) + sqrt(12) + sqrt(12))-1))*2. 325/16 Simplify (2sqrt(6300) - (2sqrt(126))/sqrt(2)) + 0 + sqrt(252)/sqrt(4) + -2. -2 + 57sqrt(7) Simplify ((-6(sqrt(420) - (sqrt(420)1 + sqrt(420) + sqrt(420)) - sqrt(420)))/sqrt(7))/(2(sqrt(588) - (sqrt(588) - sqrt(588)3))). 3sqrt(5)/7 Simplify sqrt(5) + -4 + sqrt(20) + -4(-1 + sqrt(5)) + (sqrt(55)/(sqrt(99) - (sqrt(99) - ((sqrt(99) - sqrt(99)-2) + sqrt(99)))))2. -sqrt(5) + 5/144 Simplify (((sqrt(176) + 1)-3 + -3 + -5)3)2 + -2. 2376sqrt(11) + 15343 Simplify (-4 + sqrt(153) + 0)-1 + (-2 + sqrt(612) + sqrt(612) + 1(sqrt(17) + sqrt(85)/sqrt(5)))*2. -59sqrt(17) + 3340 Simplify (4((sqrt(2736) + -3 - sqrt(2736))6 + sqrt(2736)))*2-4. -195840 + 27648sqrt(19) Simplify (-2 + (sqrt(78)2)/sqrt(6) + (sqrt(13) - sqrt(13)-14) + 4sqrt(117) + -3)2. -190sqrt(13) + 4718 Simplify -3 + ((sqrt(272) - (sqrt(272) + -1 + -3))*2 - (sqrt(272)26)2) + -2. -39157 Simplify (sqrt(70) - (sqrt(70) - (sqrt(70) - sqrt(70)46)))/(sqrt(70)/(-3sqrt(7))). 69sqrt(7) Simplify ((sqrt(396)/sqrt(9)-6)*2 - 5sqrt(1584)) + -5. -60sqrt(11) + 1579 Simplify 5(sqrt(4860)-1)/(sqrt(24)/sqrt(2)-6) + 5. 5 + 15sqrt(5)/2 Simplify (((-1sqrt(140))/sqrt(5))/sqrt(2))/(1sqrt(32) - sqrt(64)/sqrt(8)). -sqrt(7)/2 Simplify -2(2 + 0 + sqrt(68)26 + 2). -48sqrt(17) - 8 Simplify 1((0 + sqrt(684) + -5 + (sqrt(684) + 2 + 1sqrt(684) - sqrt(684)))-2)*2. -288sqrt(19) + 10980 Simplify -3(4 + sqrt(450)/(sqrt(36)/sqrt(4))). -15sqrt(2) - 12 Simplify ((sqrt(200)/(-5sqrt(20)/sqrt(2)))/(sqrt(20)/(sqrt(2) + sqrt(2)2 - sqrt(2)) + sqrt(20)/sqrt(2)3))2. 8/1225 Simplify 4 + 3(sqrt(17) + 0) + (sqrt(34) - sqrt(170)/sqrt(5))/sqrt(2). 4 + 3sqrt(17) Simplify (-6sqrt(156)1 - sqrt(156) - (sqrt(156) + sqrt(156)-2)1)/(sqrt(120)/(sqrt(60)/(sqrt(18)/sqrt(3) + sqrt(6)))). -3sqrt(13) Simplify (1(sqrt(204) - 1sqrt(204)) + sqrt(204) + (sqrt(204) - 1sqrt(204)-5) + sqrt(204))/(sqrt(60)/sqrt(5)-4 + -4-2sqrt(12)). 2sqrt(17) Simplify (4(sqrt(24) - sqrt(24)5))/((sqrt(32)-3)/sqrt(4) - sqrt(8) - sqrt(8)). 16sqrt(3)/5 Simplify (sqrt(900) + (sqrt(900) + sqrt(900)-2)-3)/((sqrt(132) + 3sqrt(132)-1 - sqrt(132))/sqrt(11)). -20sqrt(3)/3 Simplify sqrt(56)/(sqrt(72)/sqrt(9)-5) + (sqrt(7) + (2 + sqrt(7))5 - sqrt(70)/sqrt(90))2. 1697sqrt(7)/15 + 2923/9 Simplify (3sqrt(1100) + -2 + 5)-6. -180sqrt(11) - 18 Simplify 2 + (2(-2 + sqrt(68))*2 + 5 + sqrt(68) + 1)-4 + -1. -599 + 56sqrt(17) Simplify (-1-4sqrt(104)1)/(6-1(-4sqrt(8) - sqrt(8))). 2sqrt(13)/15 Simplify (-1-4(-2 + sqrt(1053) + 0)1)2. -576sqrt(13) + 16912 Simplify -5(6-12sqrt(77))/(sqrt(14)/(sqrt(2)-2) + (sqrt(7) - (-3(sqrt(7) + sqrt(28)) - sqrt(7)))). 40sqrt(11)/7 Simplify 32((sqrt(76) + 1)2 + -5 + sqrt(76) - ((sqrt(76)-2)*2 + 1)). -1398 + 36sqrt(19) Simplify (5-2sqrt(13) + sqrt(13))*2 + (sqrt(117) - (sqrt(117) + sqrt(117)-2 - sqrt(117)))/sqrt(9) + ((2sqrt(832) + sqrt(13))3)*2. 3sqrt(13) + 34866 Simplify (-1(sqrt(228) - 1sqrt(228)) - sqrt(228))/(-6sqrt(432)). sqrt(19)/36 Simplify (sqrt(475) + -1 - sqrt(475) - sqrt(475))25 + 4(sqrt(2299) + sqrt(2299)-3). -38sqrt(19) + 2380 Simplify (sqrt(95) - ((sqrt(95) + sqrt(95) + sqrt(95)2)3 - sqrt(95)) - (sqrt(95) - sqrt(95)1)-3)/(6(sqrt(720) + (sqrt(720) - sqrt(720)-3) + sqrt(720))). -5sqrt(19)/216 Simplify (sqrt(50) + (sqrt(1250) - 2sqrt(1250)) - sqrt(350)/(sqrt(14)/sqrt(2)))/(((sqrt(1000)-2 - sqrt(1000) - sqrt(1000)) + sqrt(1000))-5). -sqrt(5)/30 Simplify 6(sqrt(320) + sqrt(320) + (sqrt(320)22)*2 + ((sqrt(180)-2)/sqrt(12))/sqrt(3)). 84sqrt(5) + 30720 Simplify (2 + sqrt(1088)21 + -5)2 + -2 + -3. -96sqrt(17) + 4356 Simplify (-6((1 + sqrt(720))2 + (-2sqrt(160))/sqrt(8) + 0))2. 2880sqrt(5) + 72144 Simplify 4 + ((sqrt(200) + (sqrt(200) - -5(1 + sqrt(200) - sqrt(200) - sqrt(200))))2 - (sqrt(200) - (sqrt(200) + -5 + (1sqrt(200))*2) - sqrt(200)))61. -1740sqrt(2) + 12124 Simplify 25(sqrt(6) + sqrt(216)2 + sqrt(216))/sqrt(2) + 2. 2 + 190sqrt(3) Simplify (sqrt(76) + (-3sqrt(76)-1 - sqrt(76)))/sqrt(4) + (4sqrt(57)/sqrt(3))22 + -1. 3sqrt(19) + 607 Simplify 2 + -6(sqrt(325) - (1 + sqrt(325)))*24. -22 Simplify 5 + 4 + -2 + 4(sqrt(720) + -1). 3 + 48sqrt(5) Simplify (sqrt(24)/sqrt(3)	{ "pile_set_name": "DM Mathematics" }
-k(n) - 6x(n). -2n*3 - 2n*2 - n - 2 Let a(o) = -4o*2 + 9. Suppose 0 = k + 3p - 5p + 9, -k + 5p - 9 = 0. Let y(m) = m*2 - 2. Determine ky(n) - 2a(n). -n2 Let m(q) = -3q*2 + 4q + 3. Let u(n) be the first derivative of n3/3 - n2/2 - n + 25. Give 2m(s) + 7u(s). s*2 + s - 1 Let m(f) = -9f*3 + 4f - 7. Suppose 7p = 8p + 3. Let y(a) = 4a3 - 2a + 3. Determine pm(l) - 7y(l). -l*3 + 2l Let c(h) = -13h - 4. Let t(p) = 493p + 153. What is 153c(r) + 4t(r)? -17r Let j(x) = 0x + 8 + 4x - 5. Let u be 8/56 + 86/(-14). Let l(b) be the third derivative of -7b*4/24 - 5b*3/6 + 2b*2. Calculate ul(g) - 10j(g). 2g Let g(q) = -1. Let o(k) = 5k3 + k2 - k + 1. Let y be o(1). Let i(h) = 3h - 8 - h - h. Let t(b) = 3b - 19. Let x be t(6). Calculate xi(l) + yg(l). -l + 2 Let z(k) = -k2 + k - 1. Let h(c) = -6 + 22c*2 - 16c*2 + 3c - 9c2. Give -h(t) + 4z(t). -t*2 + t + 2 Let s(d) = -4d2 - 2. Let t(w) = -w2 + 8w - 3. Let v be t(6). Let g(a) = -5 + a - a - va*2. Let z = 0 + 5. Determine zs(h) - 2g(h). -2h*2 Let n(g) = 1 + 6 + 7 - 12 - 6g. Let d(i) = 17i - 5. Determine 4d(l) + 11n(l). 2l + 2 Let p(s) = 2s3 - 8s2. Let h = -13 + 5. Let o(z) = z3 + 9z2 - 12z - 14. Let u be o(-10). Let d(l) = ul + l2 - 3l - 3l. What is hd(r) - p(r)? -2r3 Let d be (-12)/20 + (-2)/5. Let j(k) = 4k + 5. Let g(r) be the third derivative of -r4/24 - r3/6 - 5r2. Determine dj(y) - 5g(y). y Let w(y) = -6y*2 - 3y. Let a(n) be the third derivative of -n5/60 - n4/24 + 33n2. Determine -3a(h) + w(h). -3h2 Let r(p) = 2p3 + p2 + 4p - 1. Let i(j) = j3 + j2 + 3j - 1. Calculate -4i(s) + 3r(s). 2s3 - s2 + 1 Let r(x) = x + 1. Let i(l) = -3l*2 - 17l - 6. Calculate -i(y) - 6r(y). 3y*2 + 11y Let g(m) = m - 6. Let b(z) = z*3 + 16z*2 + z + 21. Let u be b(-16). Let i(v) = -v + 7. Give ui(p) + 6g(p). p - 1 Suppose 9 = f - 2m, -m = -0m + 5. Let y(g) = g3 + g + 1. Let r(h) = -4h*3 - 2h*2 - 5h - 6. Determine fr(b) - 6y(b). -2b3 + 2b*2 - b Suppose -2r = 3r - 20. Suppose 3y - ry = 8. Let t(h) = -6h. Let j(m) = -m. Calculate yj(c) + t(c). 2c Let d(f) = -6f - 34. Let z(y) = -13y - 68. Calculate 9d(x) - 4z(x). -2x - 34 Let z(o) = 1. Let f(c) be the third derivative of c4/12 - 5c*3/3 - 4c*2. Calculate 2f(n) + 20z(n). 4n Let m(l) = l*2 + 2l + 5. Let j be -1 - ((6 - 10) + 5). Let o(s) = -s. Give jo(p) - m(p). -p2 - 5 Let w(x) = x2 - 4x + 1. Let p(h) = -3h2 + 11h - 3. Suppose 0 = -4y - 4y + 24. Calculate yp(o) + 8w(o). -o*2 + o - 1 Let x(y) = 5 + 925y*2 - 926y*2 - 2y + 7y. Suppose -h + 18 = 2h. Let k(t) = -t - 1. Give hk(b) + x(b). -b2 - b - 1 Let x(d) = -2d*3 - 3d - 3. Let l be ((-2)/(-1))/(3/3). Let f(j) = j + 1. Calculate lx(i) + 6f(i). -4i3 Let r(a) = a - 1. Let d be r(-4). Let j(t) = -3t*3 + 5t2. Let w(s) be the second derivative of -s5/5 + s*4/2 - 13s + 2. Calculate dw(v) + 6j(v). 2v3 Let x(l) = -5l*3 - 9l*2 + 5l - 7. Let v(a) = -3a3 - 4a*2 + 2a - 3. Give 9v(k) - 4x(k). -7k3 - 2k + 1 Let a(f) be the first derivative of f*3 + 3f*2/2 + 12. Let k(i) = -4i + 2i2 - 5i2 - i2. Let c = 10 + -4. Calculate ca(l) + 4k(l). 2l2 + 2l Let m(j) = 3j2 - 3j + 3. Let a(x) = -x*3 + 5x*2 - 5x + 5. What is 3a(z) - 5m(z)? -3z3 Let v(w) = -11w*2 + 4w - 11. Let a(c) = 5c2 - 2c + 5. What is -13a(t) - 6v(t)? t*2 + 2t + 1 Let q(i) = 1. Let u(r) = -2r - 3. Let p(f) = 2f + 3. Let m(a) = -6p(a) - 7u(a). Determine m(n) - 4q(n). 2n - 1 Let p(q) = -6q2 - 4q - 3. Let k(h) = 11h2 + 7h + 7. Calculate -4k(a) - 7p(a). -2a2 - 7 Let m(x) = -5x - 2. Let a(j) = j + 1. Give -4a(g) - m(g). g - 2 Let a(h) = -h - 4. Let v(w) = -w - 7. Let b(q) = 3q - 1. Let c be b(-2). Calculate ca(z) + 4v(z). 3z Let g(a) = -a + 1. Let f(x) = 2 + 2 - 2x + x*2 - 2x + 0. What is f(m) - 3g(m)? m2 - m + 1 Let j(o) = -o + 2. Let r(p) = 2p - 4. Let v(c) = 2c2 + 11c + 7. Let t be v(-5). Calculate tr(a) + 5j(a). -a + 2 Let u(f) = -13f2 + 4f + 4. Let r(n) = -377n2 + 117n + 117. Determine 4r(y) - 117u(y). 13y2 Let j(q) = 10q*2 + 16q + 16. Let y(k) = 2k2 + 3k + 3. Suppose u = 4l - 10, 4u - 5u = -2l + 6. Determine lj(d) - 11y(d). -2d2 - d - 1 Let o = 6 - 20. Let z = 10 - 6. Let x(r) = 1 - zr + 8r + 1. Let j(t) = 9t + 5. What is ox(a) + 6j(a)? -2a + 2 Let w(c) be the first derivative of c4/4 + c3/3 + c2/2 - c + 10. Let u(n) = 10n*3 + 12n*2 + 12n - 10. Determine -u(h) + 12w(h). 2h*3 - 2 Let n(j) = -4j2 - 4. Let d(c) = c3 - 5c2 - 5. Let b(l) = -2d(l) + 3n(l). Let r(u) = u2 - u + 1. Calculate b(t) + 2r(t). -2t3 - 2t Let s be (-6)/3(1 - 3). Let d(t) = 32t + 57t2 - 4t + 5t. Let b(u) = -7u*2 - 4u. What is sd(y) + 33b(y)? -3y2 Let m(o) = 15o. Let n(r) = 14r. Determine -5m(l) + 6n(l). 9l Let b be (4 - (0 + 1))-1. Let c(g) = g + 1. Let s(f) = -2f - 1. Suppose 4v + 5w = -8, -5v = 4w - 0w + 10. What is bc(p) + vs(p)? p - 1 Let t(i) = 5i - 3. Let z be (4 + -3)/(2/(-22)). Let b(m) = -2m + 1. Give zb(s) - 4t(s). 2s + 1 Let p(a) = a3 + 1. Let h(s) be the third derivative of s6/40 + s*4/24 + 13s*2. Suppose -31 = 3v - 5w, -v - 4v = -2w + 20. What is vp(y) + h(y)? y*3 + y - 2 Let n be 221/122. Let x(p) = p2 - 1. Let z be x(-1). Let s(y) = z - 4 + 5y + n. Let a(i) = -4i - 2. What is -4a(v) - 3s(v)? v - 1 Suppose 23 = -4l + 7. Suppose -4y = 1 + 3. Let x(d) = 2d*2 + 2d + 2. Let m(q) = -1. Give lm(t) + yx(t). -2t2 - 2t + 2 Let z(c) = c*2 + 2c - 1. Let y(l) = 2l2 - 9l + 6. Let u(s) = 3s2 - 10s + 7. Let w(p) = -4u(p) + 5y(p). Calculate -3w(q) - 7z(q). -q*2 + q + 1 Let s(p) = -19p*2 - 4p. Let b(h) = -95h2 - 19h. What is -4b(l) + 19s(l)? 19l2 Let i(c) = c + 1. Let h(q) = -5q - 6. Let y(f) = h(f) + i(f). Let n(z) = 5z + 6. Let p = -24 + 17. Let k = 0 - 6. Calculate kn(g) + py(g). -2g - 1 Let j(v) = -v - 1. Let c(f) = -3 + 0 + 33f - f2 - 36f. Let d be 0 + 3 + (1 - 2). Give dj(p) - c(p). p2 + p + 1 Let z(k) = -2k*3 - 6k*2 - 7k. Let g(w) = 4w3 + 11w*2 + 13w. Calculate 6g(b) + 11z(b). 2b3 + b Let g(n) = 3 + 457n*2 - n - 1 - 454n2. Let j(d) = -d3 + d - 1. What is g(o) + 2j(o)? -2o*3 + 3o*2 + o Let m(y) = -9y*2 + 6y - 3. Let b(n) = 4n2 - 3n + 1. Give -5b(p) - 2m(p). -2p2 + 3p + 1 Let v(z) = 4z2 - 3z + 6. Let p(i) = -i*2. Give -2p(w) - v(w). -2w2 + 3w - 6 Let b(v) = v*2 + 4v + 2. Suppose 2l + 6 + 2 = 0. Let h be b(l). Let d(z) = -z2 + 2. Let c(a) = 2a*2 - 5. Give hc(u) + 5d(u). -u2 Let z = -3 + 1. Let o(q) = q + 1. Let s(t) = 8t + 8. Suppose 34 = j - 2k + 3k, -15 = 5k. Suppose -j = -5f + 53. Determine fo(v) + zs(v). 2v + 2 Let v(w) = 10w. Let y(k) = -19k - 1. Let g(x) = -5v(x) - 3y(x). Let z(r) = -8r - 4. Give -6g(m) - 5z(m). -2m + 2 Let o(f) = 3f - 2. Let y be ((-3)/6)/((-1)/10). Let g(n) be the first derivative of -n*2/2 + 1. Give yg(w) + o(w). -2w - 2 Let v(u) = 3u*3 - 2u2. Let n(z) be the third derivative of -z6/40 + z*5/20 - 7z*2. Calculate 2n(m) + 3v(m). 3m*3 Let q(o) be the first derivative of 3/2o*2 + 2o + 2/3o3 + 1. Let x(f) = -5f*2 - 8f - 6. Determine 11q(g) + 4x(g). 2g2 + g - 2 Suppose d + 4d = i + 30, 3d - i = 20. Let r(j) = -1 - d - 2j*2 + 2j + 4j2 - j2. Let l(c) = -c2 - c + 5. What is -4l(w) - 3r(w)? w2 - 2w - 2 Let b(v) = 4v3 + 6v*2 + 3. Let s(c) = -11c*3 - 17c*2 - 8. Suppose 15 = 4y + y. What is ys(u) + 8b(u)? -u*3 - 3u*2 Let p(q) = 4q + 1. Suppose k + 2k = 0. Suppose 0 = -4a + 4s, 2a + ka + 5s = 14. Let o(d) = -2d - a + 2. Determine -5o(x) - 2p(x). 2x - 2 Let a(g) = 2g + 10. Let z(o) = -4o - 11. Calculate 4a(b) + 3z(b). -4b + 7 Let a(w) = 2w*2 + 5w - 1. Let d(i) = i. Give -a(r) + 3d(r). -2r*2 - 2r + 1 Let t = 1 - -2. Let z(x) be the third derivative of x*5/60 + 29x2. Let p(m) = -m2. Determine tz(c) + 2p(c). c*2 Let x be 285/25 + (-8)/20. Let d(l) = 26l + 11. Let k(g) = -9g - 4. What is xk(h) + 4d(h)? 5h Let u(t) be the third derivati	{ "pile_set_name": "DM Mathematics" }
m be q(-8). Let y = 24 - m. Suppose y = -4l + 313. What is the units digit of l? 4 Let h = 367 + 82538. What is the hundreds digit of h? 9 Let x be ((-72)/(-8) + -10)1-5. Suppose xj - 6028 = j. What is the tens digit of j? 0 Suppose 17g + 20g - 4107 = 0. What is the hundreds digit of (-96)/(-192)114g? 7 Let u(w) = -2317w + 309. What is the ten thousands digit of u(-13)? 3 Let h(i) = 5i + 4i*2 - 3i2 + 14 - i3 - 5i2. Let n be h(-7). Let u = 212 - n. What is the units digit of u? 6 Let q = 24 - 29. What is the units digit of 20/((-380)/(-75) + q)? 0 Let g(a) = 4a*2 - 15a - 2. Let r(n) = -n*2 + 1. Suppose 18 - 30 = 4q. Let p(w) = qr(w) - g(w). What is the tens digit of p(6)? 5 Let m(f) = 10f + 6. Let p be m(-2). Let b be (-7)/((-294)/18) - (-2078)/p. Let t = -61 - b. What is the tens digit of t? 8 Let a = 415 + -4807. Let r = 6226 + a. What is the tens digit of r? 3 Suppose x - 2i = -5i - 7, 0 = -2i - 6. What is the units digit of (5 + (-11)/x)-688? 4 Suppose -22f = -30635 - 32403 - 37304. What is the units digit of f? 1 Suppose 20y - 15y - 40 = 0. Suppose -2h - y = -2b, 8 = 2b + h - 6h. What is the units digit of b? 4 Let v(h) = 48h - 123. Let i be v(21). Suppose 0 = -9u + i + 1599. What is the hundreds digit of u? 2 Let t = -904 - -2385. What is the units digit of t? 1 Suppose 2y + 4o = -24, 5y - 12 - 3 = 5o. Let i be 2(-3)/1212/y. Suppose -ib + 405 = g, -2g + 125 = b - 5g. What is the tens digit of b? 3 Let s(y) = y*3 - y + 148. Let g be s(0). Suppose 4v - 160 - g = 0. Suppose -13 = -3m + v. What is the units digit of m? 0 Let x = 13177 + 8455. What is the ten thousands digit of x? 2 Suppose 51 = -88y + 105y. Suppose b - 1299 = -5u, 3b + yu - 1772 = 2137. What is the tens digit of b? 0 What is the units digit of (7 + (-91)/14)/(6/106512)? 6 Suppose 3729 = -13g + 1038. Let c = g + 313. What is the units digit of c? 6 Let o = -29 - -24. Let i(d) = -87d - 44. What is the units digit of i(o)? 1 Suppose 54 = 3d - d. Let o be 4 + (198/(-15))/((-4)/(-10)). What is the units digit of o/9 - -3 - (-4191)/d? 5 Let b(j) = -2j*2 - 9j - 26. Let k(p) = 6p2 + 26p + 79. Let g(u) = 11b(u) + 4k(u). Let a be g(-6). Let f = -1 + a. What is the tens digit of f? 7 Suppose 80963 - 2646422 = -140j + 151101. What is the thousands digit of j? 9 Let w = 8743 + -1799. What is the units digit of w? 4 Let o(h) = h2 - 3h - 8. Let u be o(0). What is the tens digit of (-2264)/u - (1 + 4)? 7 Suppose 3a + 3i - 2940 = 2607, 5a - i - 9227 = 0. Suppose 0 = -5s + a - 221. What is the units digit of s? 5 Suppose 4d + 24630 = 2k, -4k = 3d + 22303 - 71497. What is the thousands digit of k? 2 Let u = 1179 - -690. Let r = u + -1272. What is the tens digit of r? 9 Suppose 4h = -58w + 62w + 64844, -3h + 48669 = w. What is the hundreds digit of h? 2 Suppose -3u - 4h - 1 = -4u, -4h = u - 9. Suppose -n + 641 = q, -un - 5 = -0. What is the units digit of q? 2 Let v(t) = 5t + 29. Let d be v(-7). Let q(m) = -4m - 20. Let l be q(d). Suppose 8w - 588 = -lw. What is the tens digit of w? 4 Suppose -3r + 2p = -94043, 2r = -p + 98181 - 35481. What is the tens digit of r? 4 Suppose -4a = 989 - 181. Suppose 6l - 5l = 324. Let i = a + l. What is the tens digit of i? 2 Suppose -5f - 4c = -943, 2c - c - 2 = 0. Let z = f + -93. What is the tens digit of z? 9 Let p = -1992 + 4713. What is the units digit of p? 1 Let c(d) = -5051d + 390. What is the hundreds digit of c(-3)? 5 Let z = -1 - -1. Suppose -10i + 1 = -8i - 3f, i + 4f = 17. Suppose ib - 105 - 15 = z. What is the units digit of b? 4 Suppose -2q + 2 = 10. Let x(g) = -8g3 + g2 - 2g + 4. What is the tens digit of x(q)? 4 Let s = -2728 + 12843. What is the thousands digit of s? 0 Let t = 763 - 760. Suppose v - q + 275 = 1300, -4v = -tq - 4102. What is the units digit of v? 7 Let j = 9 + 23. Suppose -4t = 4x + j, -t + 3x = -5 - 3. What is the units digit of 156 + (-4 - (t - -1))? 5 Let w(z) = 293z + 7810. What is the ten thousands digit of w(28)? 1 Let r be ((-222)/148)/((-6)/(-20)). Let b(x) be the first derivative of -3x*2 - 9x + 1. What is the units digit of b(r)? 1 Let y be (28/(-5) - -2)135. What is the tens digit of (-2 + 8)y/(-12)? 4 Let a(y) = 42 + y*3 - 1771y - 55 - 108 + 1746y + 25y*2. What is the tens digit of a(-25)? 0 What is the tens digit of 76/(-95) - (-1241 - -8)/(5/3)? 3 What is the thousands digit of (44/(-10))/((-33)/94875)? 2 Suppose -2619u + 2617u + 1302 = 0. What is the tens digit of u? 5 Let n = 43 + -43. Suppose 3w + nw + 348 = 0. Let q = w - -165. What is the tens digit of q? 4 Let s(o) = -1469o - 7. What is the hundreds digit of s(-4)? 8 Suppose -1155x + 1150x = -12455. What is the units digit of x? 1 Let w(r) = 12r2 + 159r + 475. What is the hundreds digit of w(-46)? 5 Suppose 0p + 3p = 9. Suppose -21x - 22x = 67x - 4x. Suppose 3s - 3q = 4s - 13, -q + p = x. What is the units digit of s? 4 Let p(x) be the first derivative of -55x*2/2 + 13x + 10. What is the hundreds digit of p(-11)? 6 Let r(x) = x*2 - 16x + 24. Let f be r(14). What is the hundreds digit of f/(-4) + (-13 - -1174)? 1 Let o = -34 + 30. Let l(y) = -y*3 - 4y*2 - 2y - 6. Let v be l(o). Suppose 0 = -va - 6, -6q + 101 = -4q - 3a. What is the units digit of q? 6 Let w(n) = 3091n3 - 2n*2 + 3n - 2. Let q be w(1). Let h = q - 1841. What is the thousands digit of h? 1 Let d = -205 - -195. Let u(l) = -13l - 61. What is the tens digit of u(d)? 6 Let o(l) = l3 - 19l*2 + 10l - 68. Let f be o(22). Suppose f = -77j + 79j. What is the units digit of j? 2 Let l(y) = -1421y + 3y*3 + 2y*2 + 9 + 1388y - 4y2. What is the tens digit of l(8)? 5 Suppose -257o + 49o + 19283 + 6925 = 0. What is the hundreds digit of o? 1 Let g = 118 - 114. Suppose -gk = -3i + 635, -3i - 4k + 464 + 155 = 0. What is the units digit of i? 9 What is the tens digit of 721623/12 - ((-142)/(-355) - 46/40)? 3 Suppose 5o = -15 - 65. Let j be (2 + o)/(5/(-20)). Suppose -t + d + 8 = -6, j = 4t + 5d. What is the units digit of t? 4 Let y(m) = 24m2 - 3m - 30. Let h be y(-3). Let f = h + 201. What is the hundreds digit of f? 3 Let z be ((-63)/42)/((-6)/80). Suppose 5n - n - z = 0, 2t = 3n - 23. Let o(k) = -17k - 8. What is the tens digit of o(t)? 6 Suppose -3o - n = -66394, -3n + 20379 = o - 1739. What is the units digit of o? 3 Suppose q - 20 = -3p, -3p + 40 = 2q + 3q. Suppose pi = 9i - y - 461, -3i + 357 = -3y. What is the hundreds digit of i? 1 Let s(t) = 4891t2 + 124t + 358. What is the ten thousands digit of s(-3)? 4 Let z = 35 - 40. Let m(g) = g*3 + 5g*2 + 2. Let k be m(z). What is the tens digit of ((-30)/40)/(k/(-48))? 1 Suppose -5a = 9a - 11927 - 83791. What is the tens digit of a? 3 Suppose 1453 = 3b - 530. Suppose -b = -3l - 4. What is the hundreds digit of l? 2 Suppose 5p = 0, j - 2p + 3 = 20. Let v = 24 + j. What is the units digit of v? 1 Suppose -5p - h + 43606 = 0, 3p - 4h = 18638 + 7544. What is the hundreds digit of p? 7 What is the tens digit of (-1)/(((-13)/(-1))/(-205647))? 1 Let n(z) = 11z - 13z + 65z3 + z2 + 5z + 2. Let i be n(-1). Let u = -20 - i. What is the units digit of u? 5 Let t(f) = 13f + 66. Let r be t(-5). What is the tens digit of r + -5 - -2 - (-326 - 1)? 2 Suppose -120n = -122n + 10. Suppose nr + 4v - 3291 = 0, 16r - 13r - 2v = 1979. What is the hundreds digit of r? 6 Let w = 595 + -404. Suppose 6z - w = 571. What is the hundreds digit of z? 1 Let o(t) = -279t + 386. What is the thousands digit of o(-17)? 5 Suppose -o - 2936 = -4o + 5c, 5o - 2c - 4868 = 0. Suppose 5d - 1208 = o. Suppose d = 4a + 4k, 0a + k - 215 = -2a. What is the units digit of a? 6 What is the tens digit of 10-952896/(-200)? 1 Suppose u = -j + 5166 - 440, u = j + 4724. What is the thousands digit of u? 4 Suppose 5r + 30 = 5b, 3r + 18 = 5b - 10. Let x be (-4(-3)/18)/(r/3). What is the units digit of 0 - 1/(x/126)? 3 Suppose -5o + 2v - 170 = 0, -6o + 3o = -3v + 102. Let c be 7 - 4 - 2 - o. Suppose -t + c = -9. What is the units digit of t? 4 Suppose l - 40 = -32. Let o(c) = -c*2 + 3 - lc + 10c + 6c. What is the units digit of o(8)? 3 Let w(x)	{ "pile_set_name": "DM Mathematics" }
24). What is ra(f) + 14z(f)? 6f - 2 Let o(w) = 2w - 5. Let v(h) = -h + 1. Let m = -38 + 55. Let c = m - 14. Let k be -1 - (c - (6 + -3)). Calculate ko(y) - 3v(y). y + 2 Let h(k) = 3k3 - 8k*2 + 4k + 1. Let j(z) = -21z3 + 54z*2 - 27z - 6. Determine -27h(o) - 4j(o). 3o3 - 3 Let l(q) be the third derivative of -q4/3 - q3/3 + q2 + 34. Let c(p) = -7p - 2. What is 5c(t) - 4l(t)? -3t - 2 Let n(q) = 4q*2 - 4q + 2. Suppose x + 4x - 2z = -21, 2z + 19 = -3x. Let c(a) = 9a2 - 8a + 5. What is xn(v) + 2c(v)? -2v2 + 4v Let z(a) = 9a3 + 6a. Let h = -138 + 132. Let i(g) = g*3 + g. Determine hi(f) + z(f). 3f3 Let g(m) = -m3 - m2. Let z(o) = 5o*3 - 17o*2. What is 3g(q) + z(q)? 2q3 - 20q*2 Let f = 18 - 17. Let b(y) = f - 4 + 3 + 2y. Let i(u) = -3u. Let j(p) = -4b(p) - 3i(p). Let w(l) = 7l - 2. What is -6j(s) + w(s)? s - 2 Let n(q) = -q - 9. Suppose 0 = 5z - 4k + 2 - 26, -4k = -16. Let f(x) = 3x + 26. Determine zn(j) + 3f(j). j + 6 Suppose u = 3u. Let d(a) = ua + a + a. Let i(v) be the third derivative of -v5/60 - v4/8 - 629v*2. Determine 3d(y) + 2i(y). -2y*2 Let r(n) = -1. Suppose 31z - 3a - 132 = 36z, -2z + 4a = 32. Let s(t) = 8t - 24. What is zr(o) + s(o)? 8o Suppose -15 = 4z - 4w + 17, -4w = 4z. Let t(i) = 9i*3 - 6i*2 + 2i + 7. Let o(c) = 5c3 - 3c*2 + c + 4. What is zt(p) + 7o(p)? -p3 + 3p2 - p Let h(y) be the first derivative of -y2/2 + y + 50. Let o(b) = 4b - 4. Determine 6h(s) + o(s). -2s + 2 Let a(z) = -45z*2 + 3z + 8. Let j(i) = -90i2 + 7i + 18. Give 7a(w) - 3j(w). -45w2 + 2 Let y(p) = p3. Let c(m) be the first derivative of -m4 + 2m*3/3 - m - 71. Determine c(n) + 2y(n). -2n3 + 2n*2 - 1 Let d(g) = -116g*3 + 7g*2 - 7g + 2. Let m(b) = -58b3 + 4b*2 - 4b + 1. Give 4d(x) - 7m(x). -58x3 + 1 Let a(s) = s3 - s2 - s. Let g(c) be the third derivative of c6/120 + c5/20 + c4/24 + 2c*2 + 35c. Calculate -3a(d) - g(d). -4d*3 + 2d Suppose -5q = 2h + 206, 6h = q + 8h + 38. Let r(p) = 7p3 - 2p - 2. Let x(k) = -70k3 + 21k + 21. What is qr(d) - 4x(d)? -14d3 Let n(w) = -10w*2 + 6w + 6. Let y(l) = -31l2 + 16l + 18. Calculate -8n(z) + 3y(z). -13z2 + 6 Let k(o) = o3 + 3o*2 - 2o - 2. Let y = -2 + 0. Let u(m) be the first derivative of -m*4/4 - 2m3/3 + m2 + m - 9. Calculate yk(j) - 3u(j). j*3 - 2j + 1 Let v(y) = 2y2 + y + 61. Let j(r) = -3r*2 - r - 60. Determine 3j(c) + 4v(c). -c2 + c + 64 Let c(m) = 4m*2 + m - 1. Let k(x) = 2x*2. Suppose -7s = 16 - 2. What is sc(o) + 5k(o)? 2o2 - 2o + 2 Let l(i) = -7i - 1. Let m(h) = -8h - 1. Let t = -1952 - -1947. Calculate tm(b) + 6l(b). -2b - 1 Suppose -7 = w - 0w - v, -19 = w - 4v. Let x(t) = 4t - 3. Let o(k) = -4k + 13. Let c(g) = -g + 4. Let p(d) = -3c(d) + o(d). Calculate wp(i) - x(i). -i Let c = -86 - -95. Let b(k) = 7k - 11 + c + 4. Let j(l) = -l + 0l + 2l + 1. Determine -b(f) + 5j(f). -2f + 3 Let i(w) = -30w + 1272w*2 + 7w - 1287w2. Let f(q) = -4q*2 - 6q. Give 22f(s) - 6i(s). 2s2 + 6s Let m(h) = h2 - h - 2. Let x(p) be the second derivative of -p4/12 + p*3/2 + 3p*2/2 - 41p + 1. Give -5m(y) - 3x(y). -2y2 - 4y + 1 Let l(u) = -17u2 - 11u + 47. Let b(a) = 8a2 + 5a - 24. Determine -13b(y) - 6l(y). -2y2 + y + 30 Let y(h) = 3h*3 - 17h*2 - 12h + 3. Let r(v) be the third derivative of v6/120 - v5/10 - v4/6 + v3/6 - 73v2. Give -17r(p) + 6y(p). p3 - 4p + 1 Let q(k) = 2k + 9. Suppose 3z - 2 = -4t + 4, 30 = 3z - 4t. Let g(v) = -9v - 4. Let c(p) = 2p. Let a(b) = 4c(b) + g(b). Give zq(h) + 14a(h). -2h - 2 Let v(i) = -2i - 28. Let s(g) = g. What is s(h) + v(h)? -h - 28 Let f(i) be the second derivative of 17i3/6 - 3i*2 + 136i. Let s(g) = 341g - 121. What is -121f(n) + 6s(n)? -11n Let u(n) = 3n2 + 3n - 6. Let p(o) = -o*2 - o + 2. Suppose -45 + 53 = -4q. Calculate qu(i) - 7p(i). i*2 + i - 2 Let d(l) = -l. Let i(o) = -2o - 1. Let m be (-6)/(-4) - 261/(-6). Let a = m - 42. Calculate ad(q) - i(q). -q + 1 Let k(u) = -7u*3 - 6u*2 + 3u + 3. Let i(z) be the second derivative of z5/20 + z4/12 - z3/6 - z2/2 - z + 16. Give -3i(p) - k(p). 4p*3 + 3p*2 Suppose -3c - 2c - 15 = 0. Suppose -w = -2w - 8. Let v(s) = 5s - 2. Let l(q) be the first derivative of -7q*2 + 6q + 383. Calculate cl(b) + wv(b). 2b - 2 Let g(n) = 4n*3 - 16n*2 + 16. Let o(s) be the first derivative of 0s*2 + 5/3s*3 - 22 - 5s - 1/4s4. Calculate -5g(a) - 16o(a). -4a*3 Let y(h) = 3h2 - h2 - 6h2. Let b(l) = -7l2. Let w(n) = n2 + 44n - 6. Let j be w(-44). Determine jb(i) + 10y(i). 2i*2 Let a(d) = 12d - 3. Let j(u) = 23u - 5. Let k(w) = 7a(w) - 4j(w). Let c(n) = 4n - 6. Let z be c(-2). Let y(r) = -r. Determine zy(m) + 2k(m). -2m - 2 Let y(c) = -3c - 2. Let k(v) = -173v - 57. Let f(d) = k(d) - 6y(d). Let j be (8/(-3) - -2)3. Let h(o) = -7o - 2. Give jf(b) + 45h(b). -5b Let q(y) be the second derivative of -y3/6 - 26y - 4. Let t(p) = 2p - 2. Determine -5q(l) - t(l). 3l + 2 Let t(g) = -3. Let u be 30/12(-2 + 0). Let l(a) = a + 5. Suppose -8q - 23 = 1. Calculate ql(c) + ut(c). -3c Let n(o) = 4o - 45. Let u(y) = -y. Determine n(c) + 5u(c). -c - 45 Let g(w) be the second derivative of w*4/12 - 8w - 4. Let k(d) = -7d2 - 2d + 2. What is 6g(u) + k(u)? -u2 - 2u + 2 Let g(s) = 2s + 2. Let p(u) = -544u - 1088. Determine -544g(c) - p(c). -544c Let z(x) = -5x + 4. Let w(s) = -6s + 4. What is -4w(u) + 3z(u)? 9u - 4 Let p be 1/(-5) - ((-30)/25 - 2). Let l(b) = 6b*2 + 2b + 1. Let d(z) = -5z2 - z - 1. What is pl(o) + 4d(o)? -2o*2 + 2o - 1 Let f(m) = -126m3 + 3m*2 - m - 3. Let j(r) = 127r*3 - 2r*2 + r + 2. What is 2f(b) + 3j(b)? 129b*3 + b Let l(i) = -8i*3 - 8i - 6. Suppose w - 18 = -4s, -22 = -2w - 2s + 8. Let z(c) = 1 + 0 + c + 0c3 + c3. What is wz(b) + 2l(b)? -2b3 - 2b + 2 Let x(h) = 2h2 + h - 5. Let b(i) = i2 - 3. Let l(c) = -3c - 13. Let d be l(-10). Suppose -5p - d = -2. What is px(r) + 5b(r)? -r2 - 3r Suppose 4r - 2c - 24 = 0, 4r + 16c = 11c + 10. Let o = -14 - -8. Let i(q) = 2q*2 - 4q - 4. Let d(w) = 2w2 - 3w - 3. Calculate od(p) + ri(p). -2p2 - 2p - 2 Let d(m) = -m*2 - 3m - 5. Suppose 11 - 77 = -6f. Let b = f + -14. Let j(h) = -2h*2 - 4h - 6. Determine bj(t) + 4d(t). 2t2 - 2 Let y(k) = -6k - 10. Let j(g) = -5g - 8. Calculate 4j(t) - 3y(t). -2t - 2 Let y(g) = -192 + 6g - 203 + 393. Let q(l) = -13l + 5. Determine 3q(k) + 7y(k). 3k + 1 Let g(u) be the second derivative of 7u*4/12 + 35u2/2 + u - 115. Let h(y) = -y2 - 6. What is 6g(j) + 35h(j)? 7j2 Let o(l) = 211l - 57l - 51l - 50l - 54l. Let p be 18/(-24) - (-26)/(-8). Let f(u) = 7u - 2. What is po(w) - f(w)? -3w + 2 Let q(b) = 2b*2 + 79b + 11. Let w(r) = 2r2 + 81r + 13. Give 6q(i) - 5w(i). 2i2 + 69i + 1 Let f(b) = -5b3 + b2 - 5b. Suppose -4h + 52 = 9h. Let v(k) be the third derivative of -k6/30 + k5/60 - k4/6 + k2. What is hv(j) - 3f(j)? -j3 + j2 - j Let g(c) = 3c + 9. Let p = -757 - -750. Let y(m) = 2m + 6. Determine py(d) + 5g(d). d + 3 Let l(x) = -3x + 3. Let h(m) be the first derivative of -5m*2/2 + 4m + 74. Calculate 5h(f) - 8l(f). -f - 4 Let k(j) = 3j2 + 19j + 36. Let a be k(-3). Let q(h) = -h*2 + h. Let y(o) = -8o*2 + 4o - 1. Calculate aq(p) - y(p). 2p*2 + 2p + 1 Let n(h) be the second derivative of 10h3/3 - 12h*2 - 81h - 2. Let j(k) = -4k + 5. What is -14j(s) - 3n(s)? -4s + 2 Let x(a) = -1 - 4a + 7 + 5a - 5a + a. Let w(q) = -q + 2. Give 8w(h) - 3x(h). h - 2 Let m(g) be the second derivative of 2g4/3 + g3/3 + g*2/2 - 3g - 19. Let u(s) = -s*2 - s. What is -m(j) - 6u(j)? -2j2 + 4j - 1 Let l(h) = -8h2 + 49h + 14. Let g(i) = -5i2 + 25i + 8. Calculate 5g(t) - 3l(t). -t*2 - 22t - 2 Let u(j) = -j*3 - 3j*2 - 3j - 4. Let n(f) = 2f3 - f2 + 5f + f*2 + 7 + 5f*2. Let p be 12/(-14)112/(-24). Calculate pn(m) + 7u(m). m3 - m2 - m Let n(j) = -2j + 2. Let q(d) = -6d + 5. Let v(c) = 1	{ "pile_set_name": "DM Mathematics" }
at is the highest common factor of 114872 and 1352168? 1384 Calculate the greatest common divisor of 50760 and 26420. 20 What is the highest common factor of 6648 and 1481640? 24 What is the highest common divisor of 48 and 16901076? 12 Calculate the greatest common divisor of 8938 and 41424022. 82 Calculate the greatest common divisor of 2819166 and 2646. 294 Calculate the highest common factor of 82 and 87291091. 41 What is the greatest common divisor of 3678 and 132138? 6 Calculate the greatest common divisor of 53635 and 1454095. 85 What is the greatest common divisor of 57228878 and 14? 14 What is the greatest common divisor of 2699 and 127128298? 2699 What is the greatest common factor of 44861 and 1207744? 113 What is the highest common divisor of 51256751 and 26? 13 Calculate the highest common divisor of 1051016 and 8216. 632 Calculate the highest common divisor of 1470 and 44682659. 49 What is the greatest common factor of 190111 and 555917? 901 Calculate the highest common factor of 34839 and 172700794. 3871 Calculate the greatest common factor of 18 and 95779872. 18 Calculate the greatest common factor of 127929318 and 34. 34 What is the highest common factor of 116368 and 272? 16 What is the greatest common divisor of 4894283 and 3417? 1139 Calculate the greatest common divisor of 16576656 and 86572. 3764 Calculate the greatest common divisor of 53851639 and 1201. 1201 Calculate the greatest common factor of 56251811 and 3388. 847 Calculate the greatest common factor of 13853378 and 44. 22 Calculate the greatest common divisor of 8 and 12111656. 8 Calculate the highest common divisor of 84 and 5064684. 12 What is the highest common factor of 49 and 66345216? 49 What is the greatest common divisor of 44576 and 22038653? 1393 What is the greatest common divisor of 263830 and 154? 14 What is the greatest common divisor of 485415 and 119930? 335 What is the greatest common divisor of 144 and 10203792? 48 Calculate the highest common factor of 26224 and 9658. 22 What is the greatest common divisor of 17710 and 121680350? 2530 Calculate the highest common factor of 306 and 206050166. 34 Calculate the greatest common factor of 4535895 and 255. 15 What is the greatest common factor of 8 and 46848984? 8 Calculate the greatest common divisor of 13814534 and 4039. 577 Calculate the highest common divisor of 15558612 and 12. 12 What is the greatest common divisor of 92046849 and 265? 53 What is the greatest common divisor of 14 and 14194474? 14 What is the highest common factor of 294 and 16200498? 6 Calculate the highest common divisor of 17482338 and 344. 86 Calculate the greatest common factor of 130 and 35985495. 65 What is the highest common factor of 22 and 675508009? 11 What is the greatest common factor of 317292 and 88587? 579 What is the highest common factor of 4553766 and 63677? 1721 Calculate the highest common divisor of 4929 and 363527. 53 Calculate the highest common factor of 39835759 and 337. 337 What is the highest common divisor of 35155 and 319510? 445 Calculate the highest common factor of 94669928 and 2036. 2036 Calculate the greatest common factor of 30664 and 1928. 8 What is the highest common divisor of 1088 and 124873024? 1088 Calculate the highest common factor of 438 and 801400278. 438 What is the highest common factor of 51 and 87157929? 51 Calculate the highest common factor of 4255972 and 97097. 679 What is the highest common factor of 728 and 143024? 56 Calculate the greatest common factor of 632632480 and 80. 80 What is the highest common divisor of 4732236 and 174924? 1548 What is the greatest common factor of 2580 and 7815680? 860 Calculate the highest common divisor of 1477599 and 6718957. 1681 Calculate the greatest common divisor of 6272228 and 4886. 698 What is the highest common factor of 326301 and 69? 69 Calculate the greatest common factor of 646174 and 218. 2 What is the greatest common factor of 64301595 and 465? 465 What is the greatest common factor of 27 and 3808908? 9 What is the highest common divisor of 279916 and 17108? 364 Calculate the highest common factor of 29196624 and 40908. 5844 Calculate the highest common divisor of 4 and 24670222. 2 Calculate the greatest common divisor of 8722294 and 882. 98 What is the highest common factor of 26311 and 1572435? 83 What is the highest common factor of 52632420 and 1860? 1860 What is the greatest common divisor of 56 and 23210040? 56 Calculate the highest common divisor of 4066 and 412718. 38 What is the highest common factor of 31 and 135449? 1 Calculate the highest common factor of 178813572 and 420. 84 What is the highest common factor of 51 and 397167? 3 Calculate the greatest common divisor of 11 and 43441123. 11 Calculate the greatest common divisor of 47152 and 210. 14 Calculate the greatest common divisor of 85899 and 121353. 57 Calculate the highest common divisor of 25368 and 651504. 168 What is the highest common factor of 106094519 and 142? 71 What is the greatest common factor of 31280 and 2532320? 1360 Calculate the highest common factor of 104 and 16334084. 52 What is the greatest common factor of 41 and 193132427? 41 What is the highest common divisor of 42437376 and 10269? 1467 What is the greatest common divisor of 7903894 and 4? 2 Calculate the greatest common divisor of 151296478 and 12173. 1739 Calculate the greatest common factor of 351247 and 941711. 659 Calculate the highest common factor of 9824 and 816927. 307 Calculate the highest common divisor of 25826 and 23664016. 74 Calculate the highest common factor of 745554 and 9. 3 What is the highest common factor of 11 and 9583860? 11 What is the greatest common divisor of 8 and 1934632? 8 What is the greatest common divisor of 6396 and 1971936? 492 What is the greatest common factor of 8626 and 30609? 19 What is the greatest common divisor of 319434 and 24? 6 What is the highest common factor of 32230996 and 212? 212 What is the greatest common factor of 82658972 and 26532? 2948 What is the greatest common factor of 8788 and 2657356? 676 What is the highest common divisor of 14853739 and 517? 47 Calculate the highest common divisor of 15726591 and 36603. 747 What is the highest common factor of 78255650 and 23804? 11902 What is the highest common divisor of 36 and 436096? 4 What is the highest common divisor of 24651 and 251721? 27 What is the greatest common factor of 173217350 and 654? 218 Calculate the greatest common divisor of 3168378 and 36. 18 What is the greatest common factor of 2662543 and 2834? 1417 Calculate the greatest common divisor of 10759 and 16874723. 1537 What is the highest common factor of 26732628 and 3585? 717 What is the greatest common factor of 68440 and 36934? 118 What is the greatest common divisor of 5332 and 3100558? 2666 What is the greatest common divisor of 36036 and 35838? 198 Calculate the greatest common divisor of 4980 and 1346. 2 What is the greatest common factor of 30397713 and 1044? 87 What is the greatest common divisor of 30 and 5019330? 30 Calculate the greatest common divisor of 443548305 and 139. 139 What is the highest common divisor of 75078 and 5564502? 1746 What is the greatest common factor of 167736 and 107727? 723 Calculate the greatest common factor of 30043980 and 900. 180 What is the greatest common divisor of 200184 and 10572? 12 Calculate the greatest common factor of 27 and 1067463. 9 Calculate the highest common factor of 2374249 and 54519. 1069 What is the highest common factor of 301 and 41014561? 301 What is the greatest common factor of 48025562 and 78? 26 What is the highest common factor of 33 and 2357993? 11 Calculate the greatest common divisor of 120 and 7582695. 15 What is the greatest common divisor of 19586 and 333942? 14 Calculate the greatest common factor of 161103 and 4208088. 1941 What is the greatest common factor of 25 and 232638? 1 Calculate the highest common factor of 31589793 and 6773. 521 Calculate the highest common divisor of 31611 and 20242091. 257 What is the highest common divisor of 417 and 33513? 3 Calculate the greatest common divisor of 756 and 7593852. 84 Calculate the highest common divisor of 12263738 and 138. 46 What is the highest common divisor of 22316 and 1271046833?	{ "pile_set_name": "DM Mathematics" }
603, 815047600, 815047597, 815047594? -3u + 815047609 What is the o'th term of -2096571, -4193138, -6289667, -8386140, -10482539? 3o3 + o2 - 2096591o + 16 What is the w'th term of 9165, 18135, 27117, 36111, 45117? 6w*2 + 8952w + 207 What is the y'th term of 16254, 18513, 20772, 23031? 2259y + 13995 What is the k'th term of -1191920, -1192015, -1192110, -1192205? -95k - 1191825 What is the i'th term of -17012, -67901, -152708, -271433, -424076, -610637, -831116? -16959i2 - 12i - 41 What is the r'th term of -51189512, -51189513, -51189514, -51189515, -51189516? -r - 51189511 What is the i'th term of 4128161, 8256313, 12384465, 16512617, 20640769, 24768921? 4128152i + 9 What is the n'th term of 3592, 14126, 31608, 56038, 87416, 125742, 171016? 3474n*2 + 112n + 6 What is the g'th term of -30143137, -30143132, -30143127, -30143122? 5g - 30143142 What is the g'th term of 829, 847, 853, 829, 757, 619? -3g*3 + 12g*2 + 3g + 817 What is the b'th term of -14003387, -28006765, -42010143, -56013521, -70016899, -84020277? -14003378b - 9 What is the q'th term of -76614, -613396, -2070504, -4908102, -9586354? -76694q3 + q2 + 73q + 6 What is the r'th term of -51723, -103932, -156141? -52209r + 486 What is the i'th term of 29658627, 29658628, 29658629, 29658630, 29658631, 29658632? i + 29658626 What is the i'th term of 111497565, 222995129, 334492693? 111497564i + 1 What is the d'th term of -118140, -117964, -117668, -117252, -116716? 60d*2 - 4d - 118196 What is the b'th term of 6418, 6449, 6516, 6625, 6782, 6993, 7264, 7601? b*3 + 12b*2 - 12b + 6417 What is the c'th term of -902, -1692, -2600, -3632, -4794? -c*3 - 53c*2 - 624c - 224 What is the l'th term of -42827, -42047, -41271, -40499? -2l2 + 786l - 43611 What is the d'th term of 57435502, 57435501, 57435500, 57435499, 57435498, 57435497? -d + 57435503 What is the c'th term of 4155, 8061, 11869, 15579, 19191, 22705? -49c2 + 4053c + 151 What is the b'th term of 177841, 177024, 176207? -817b + 178658 What is the m'th term of -73781, -74435, -76231, -79739, -85529, -94171? -95m3 - m2 + 14m - 73699 What is the s'th term of 2427, 5008, 7623, 10290, 13027, 15852? 3s3 - s2 + 2563s - 138 What is the z'th term of 3537, 4815, 6093, 7371, 8649, 9927? 1278z + 2259 What is the c'th term of -1999, -4387, -6775, -9163, -11551, -13939? -2388c + 389 What is the i'th term of -524625663, -1049251324, -1573876985, -2098502646? -524625661i - 2 What is the v'th term of -261, -1454, -4495, -10302, -19793, -33886, -53499, -79550? -153v3 - 6v*2 - 104v + 2 What is the o'th term of -56277450, -112554900, -168832350, -225109800, -281387250, -337664700? -56277450o What is the l'th term of -21497, -19654, -16583, -12284, -6757? 614l*2 + l - 22112 What is the f'th term of 26750657, 26750665, 26750677, 26750693? 2f*2 + 2f + 26750653 What is the x'th term of 38822, 77894, 117170, 156752, 196742, 237242, 278354, 320180? 17x3 + 38953x - 148 What is the b'th term of 27626209, 27626208, 27626207, 27626206? -b + 27626210 What is the s'th term of -23593403, -47186809, -70780217, -94373627, -117967039? -s*2 - 23593403s + 1 What is the d'th term of 2307, 2332, 2385, 2478, 2623, 2832, 3117, 3490? 2d3 + 2d*2 + 5d + 2298 What is the u'th term of -33821, -67970, -102127, -136292? -4u2 - 34137u + 320 What is the q'th term of 52587, 53206, 53825, 54444, 55063, 55682? 619q + 51968 What is the x'th term of -64, -345, -814, -1477, -2340, -3409? -x3 - 88x*2 - 10x + 35 What is the f'th term of 21520008, 21520004, 21519998, 21519990, 21519980, 21519968, 21519954? -f*2 - f + 21520010 What is the g'th term of -1649511724, -1649511726, -1649511728, -1649511730? -2g - 1649511722 What is the s'th term of 1062, 1642, 2222, 2802? 580s + 482 What is the i'th term of 4195, 4285, 4449, 4723, 5143? 6i3 + i2 + 45i + 4143 What is the m'th term of 2054442, 8217662, 18489694, 32870538, 51360194, 73958662? 2054406m*2 + 2m + 34 What is the x'th term of -196609, -787543, -1772425, -3151249, -4924009, -7090699? x*3 - 196980x*2 - x + 371 What is the s'th term of 106, 875, 2310, 4411, 7178, 10611? 333s*2 - 230s + 3 What is the h'th term of 21995873, 21995875, 21995877, 21995879, 21995881, 21995883? 2h + 21995871 What is the g'th term of 5015, 4298, 3581, 2864? -717g + 5732 What is the s'th term of -175407, -175392, -175377, -175362, -175347, -175332? 15s - 175422 What is the m'th term of -4912402, -9824822, -14737242, -19649662, -24562082, -29474502? -4912420m + 18 What is the m'th term of 1424, 2597, 3782, 4985, 6212, 7469, 8762, 10097? m*3 + 1166m + 257 What is the c'th term of 2300, 11880, 28744, 52892, 84324? 3642c2 - 1346c + 4 What is the a'th term of 3030, 3886, 4742? 856a + 2174 What is the q'th term of 2957, 2848, 2661, 2396, 2053? -39q*2 + 8q + 2988 What is the n'th term of 932364, 1864690, 2797016? 932326n + 38 What is the q'th term of -2176960, -2176936, -2176912, -2176888? 24q - 2176984 What is the p'th term of 2868997, 11475954, 25820883, 45903784? 2868986p2 - p + 12 What is the a'th term of -607143, -607105, -607055, -606987, -606895, -606773, -606615, -606415? a3 + 31a - 607175 What is the b'th term of 845049, 845087, 845137, 845199, 845273? 6b2 + 20b + 845023 What is the c'th term of 104919635, 209839269, 314758903, 419678537, 524598171, 629517805? 104919634c + 1 What is the a'th term of 3252010, 26016006, 87804000, 208127992, 406499982, 702431970, 1115435956? 3252000a3 - a2 - a + 12 What is the w'th term of 6600, 47123, 157112, 371301, 724424, 1251215, 1986408? 5789w3 - w2 + 3w + 809 What is the d'th term of 122162576, 244325157, 366487742, 488650331, 610812924, 732975521, 855138122? 2d2 + 122162575d - 1 What is the z'th term of 4537, 9030, 13513, 17986? -5z2 + 4508z + 34 What is the d'th term of -3417, -6074, -8769, -11502, -14273, -17082? -19d2 - 2600d - 798 What is the t'th term of 4266547, 8533138, 12799725, 17066308? -2t2 + 4266597t - 48 What is the v'th term of -69955, -139940, -209947, -279988, -350075, -420220? -2v3 + v2 - 69974v + 20 What is the q'th term of -7422, -6356, -5290, -4224? 1066q - 8488 What is the r'th term of -8434, -16752, -25070? -8318r - 116 What is the z'th term of 1582811283, 3165622565, 4748433847, 6331245129? 1582811282z + 1 What is the u'th term of 2026, 8206, 18404, 32536, 50518? -14u*3 + 2093u*2 - u - 52 What is the j'th term of -84202, -168481, -252828, -337243, -421726, -506277? -34j*2 - 84177j + 9 What is the r'th term of -22525, -22302, -22067, -21814, -21537, -21230, -20887, -20502? r*3 + 216r - 22742 What is the u'th term of -1893, -3795, -5683, -7563, -9441, -11323, -13215, -15123? -u*3 + 13u*2 - 1934u + 29 What is the x'th term of -812, -3995, -11964, -27113, -51836, -88527, -139580, -207389? -399x3 + x2 - 393x - 21 What is the k'th term of -74585415, -74585413, -74585409, -74585403? k*2 - k - 74585415 What is the f'th term of 76890, 73749, 68514, 61185? -1047f2 + 77937 What is the o'th term of 165417, 165422, 165417, 165396, 165353, 165282, 165177? -o3 + o*2 + 9o + 165408 What is the u'th term of -4918, -16658, -36224, -63616, -98834, -141878? -3913u2 - u - 1004 What is the y'th term of -257606, -256874, -256142, -255410? 732y - 258338 What is the n'th term of -33082, -132326, -297746, -529342, -827114, -1191062? -33088n2 + 20n - 14 What is the d'th term of 645, 2372, 5183, 9102, 14153? 4d3 + 518d*2 + 145d - 22 What is the z'th term of -490, -1993, -4478, -7945, -12394? -491z2 - 30z + 31 What is the y'th term of -94108, -188572, -283036? -94464y + 356 What is the b'th term of 1169296, 2338611, 3507926, 4677241, 5846556? 1169315b - 19 What is the r'th term of 656364, 2625464, 5907298, 10501866, 16409168, 23629204? 656367r2 - r - 2 What is the d'th term of 132841499, 132841501, 132841503, 132841505, 132841507, 132841509? 2d + 132841497 What is the b'th term of -58003, -116153, -174305, -232459, -290615, -348773, -406933? -b*2 - 58147b + 145 What is the g'th term of -1135437, -2270819, -3406147, -4541421, -5676641, -6811807? 27g2 - 1135463g - 1 What is the o'th term of -3556059, -71	{ "pile_set_name": "DM Mathematics" }
2). Let d(o) = -uo - o - 12o + o. Let i(y) = -4y. Determine -4d(r) + 22i(r). -4r Let k(r) = -5r3 + 2r*2 - 6. Let u(d) = 13 + 3d*3 - 3d*2 - 1548d + 6d3 - 2 + 1548d. What is -7k(h) - 4u(h)? -h*3 - 2h*2 - 2 Let u(m) = m + 2. Let f(k) = -756k - 1890. What is -f(a) - 945u(a)? -189a Let r(n) be the second derivative of n5/10 + n4/4 + 2n3/3 + 3n2/2 - n. Let t(u) = u2 + u + 1. Suppose 0 = y + 4. Let m = -7 - y. Give mt(c) + r(c). 2c*3 + c Let w(p) = -p - 1. Let v be w(0). Let z = -15 - -17. Let y(g) = -7g*z - 6g*2 + g + 12g*2 - 1. Let q(c) = 2c*3 + 2c*2. Give vq(l) - 2y(l). -2l*3 - 2l + 2 Let w(z) = -8z2 - 98z + 13. Let j(h) = 13h2 + 146h - 20. Give 5j(q) + 8w(q). q*2 - 54q + 4 Let w(c) = -2c3 - 17c*2 - 60c. Let x(h) = -4h3 - 37h*2 - 119h. What is 13w(j) - 6x(j)? -2j3 + j2 - 66j Let o(z) = 10z + 4. Let m(p) = -13p - 7. Let v(a) = -3m(a) - 4o(a). Let n(f) = f - 5. Determine -5n(u) - 6v(u). u - 5 Let q(w) = -4w2 + 5w + 3. Let s(l) = l*2 - 2l. Let o(p) = 11p2 - 12p - 10. Let f(y) = o(y) + 2s(y). What is 2f(u) + 7q(u)? -2u*2 + 3u + 1 Let r(y) = -y - 4. Let h(v) = -21v + 32. Give -h(u) - 2r(u). 23u - 24 Let y(h) = 0h - 1930h2 + 1949h*2 + 5 - 5h. Let w(o) = -77o2 + 21o - 21. Give -5w(r) - 21y(r). -14r2 Let q(t) = -10t + 6. Let n be 224/(-140) + (-2)/5. Let v(y) be the first derivative of -3y2/2 + 2y - 24. Calculate nq(g) + 7v(g). -g + 2 Suppose -3l - 4 = -5l. Suppose q + l + 3 = 0. Let y(g) = -3g + 9. Let d(b) = 2b - 6. What is qy(i) - 8d(i)? -i + 3 Suppose -b = -0 + 1. Let s(t) = 2 + 0t - t - 9. Let c(a) = 15. Let w(q) = 41. Let m(u) = -11c(u) + 4w(u). Calculate bs(y) + 6m(y). y + 1 Let b(l) = 37l*2 + 295l. Let n(k) = -7k2 - 59k. Give 2b(a) + 11n(a). -3a2 - 59a Let b(m) = 4m2 + 10. Let d be 1 + -111 + 3 - 1. Let k = 118 + d. Let o(n) = -1. Give ko(l) + b(l). 4l2 Let x(f) = 10f*2 + 15f. Let q(k) = 3024k - 1512k - 1515k - 2k*2. Calculate -11q(w) - 2x(w). 2w*2 + 3w Let m(u) = -u3. Let h(x) = x3 + 3x + 27. What is h(k) - m(k)? 2k*3 + 3k + 27 Suppose 2g + 10 = 3q + 23, 0 = -3g - 3q + 12. Suppose 0 = -0s - 2s. Let v(n) = -1 + gn - 4n + sn. Let j(k) = k - 1. Determine -5j(u) + 4v(u). -u + 1 Let z(y) = -15y*2 - 3y. Let j(q) = 10q2 + 2q. Let w be -5 + 13 - (3 + 0). Calculate wz(l) + 7j(l). -5l2 - l Let k(g) = -10g + 8. Let h(c) = c - 1. Let x(m) = 4h(m) + k(m). Let t(d) = 8d + 61. Let r be t(-7). Let f(l) = 5l - 3. Calculate rf(y) + 4x(y). y + 1 Let y be (1 - -5)(-4)/(-8). Let q(j) = -46jy + 3j + 3j + 45j*3. Let a(b) = 5b. What is -6a(l) + 5q(l)? -5l3 Let y(t) = -5t. Suppose 112 = 4d + 3a - 0, 0 = -4d - 4a + 116. Suppose -x - 3u = -6u + 13, 3u - 17 = -x. Let q(b) = 60b. Calculate dy(s) + xq(s). -5s Let y(v) = 2v*2 + 13905v - 13905v - 16 - 3v*2. Let d(p) = -3. Give -11d(k) + 2y(k). -2k2 + 1 Let h = -241 - -240. Let u(x) be the first derivative of x2/2 + 8. Let a(w) = 4w2 + 6w + 1. Calculate ha(p) + 6u(p). -4p2 - 1 Let s(t) be the second derivative of 0 - 12t + 7/2t2 + 5/6t*3 + 1/6t*4. Let v(k) = -k - 1. Determine s(g) + 4v(g). 2g2 + g + 3 Let k(v) be the third derivative of -3v5/20 - v4/8 + 6v2 - 7v. Let m(u) = u*2 - u. Determine k(d) - 3m(d). -12d2 Let x(i) = -62i*2 + 4i. Let g(o) = -186o2 + 11o. What is 4g(u) - 11x(u)? -62u2 Let p(a) = a2 - 4a - 16. Let b be p(7). Suppose x + b - 11 = 0. Let h(z) = 2z2 - 9z + 8. Let o(n) = 4n2 - 17n + 15. Determine xo(y) - 11h(y). 2y2 - 3y + 2 Let b(i) = 52i - 5. Let x(g) = -258g + 24. Calculate -14b(y) - 3x(y). 46y - 2 Let g(u) = 12u*2 + 6u + 19. Let a(z) = 2z2 + z. Calculate -5a(y) + g(y). 2y2 + y + 19 Let q(m) = 12m*3 + 16m. Let i(v) = -7v3 - 5v. Let f(t) = 44t3 - 97t*3 - 5t + 0t + 45t*3. Let b(r) = 3f(r) - 4i(r). Give -16b(p) + 5q(p). -4p*3 Let v(w) = 375w*2 + 2w - 7. Let x(k) = -1500k2 - 9k + 30. What is -9v(l) - 2x(l)? -375l2 + 3 Let c(o) = -17o - 6. Let j(s) = 16s + 5. Calculate -4c(f) - 5j(f). -12f - 1 Suppose -2n + d + 2d - 1 = 0, 4d = 3n. Suppose 0s + s = -np - 13, 3p = -3s - 3. Let j(q) = -q + 3. Let u(r) = -1 - 2 + 1. Calculate su(w) + 2j(w). -2w Let m(f) = 11f + 14. Let z(i) = -20i - 23. Let n(u) = 7m(u) + 4z(u). Let y(a) = -5a + 11. Let x = 16 - 9. Determine xn(h) - 4y(h). -h - 2 Let z(d) = -2d2 - 11. Let a(o) = -5o*2 - o - 34. Determine 2a(g) - 7z(g). 4g*2 - 2g + 9 Let p(n) = -n*2 + 4n - 109. Let w(g) = -g*2 + 3g - 109. Calculate 3p(t) - 4w(t). t2 + 109 Let b(x) be the third derivative of x3/6 + 2x2. Let y(s) = -s - 5. Suppose -964v = -972v + 72. Calculate vb(t) + 2y(t). -2t - 1 Let t(m) = -6m2 - 1. Let v(l) = 9l*2 - 55411l + 4 + 55412l + 9l*2. Give -7t(h) - 2v(h). 6h*2 - 2h - 1 Let a = 15 - 6. Let m(i) = -4i - 5. Let w(g) = -2g - 7. Let v(h) = 3h + 10. Suppose 35 = 17q - 22q. Let l(o) = qw(o) - 5v(o). Calculate al(y) - 2m(y). -y + 1 Let n be -4 + 8 + -6 + -1. Let v(d) = 7d. Let p(u) = 4u. Determine nv(q) + 5p(q). -q Let a(g) be the first derivative of -8g*3/3 + 3g*2 - 6g + 198. Let f(h) = 15h2 - 11h + 11. Suppose 0 = 4z + 28 - 4. Determine zf(q) - 11a(q). -2q*2 Let k(f) = -3f*3 - 6f2 + 11. Let a(w) = w2 - 2. Let d(x) = -10a(x) - 2k(x). Let z(b) = -6b3 - 3b*2 + 3. Give -6d(p) - 4z(p). -12p*3 Let x(u) = 3u + 21. Let y(d) be the second derivative of d*3/6 + 5d*2 - 118d. What is 2x(p) - 5y(p)? p - 8 Suppose -5m + 5 + 10 = -5h, 4h - 5m = -16. Let b(j) = 5j2 - 6. Let r(u) = u2 - 1. Let f = -128 - -122. Determine fr(y) + hb(y). -y2 Suppose -4d - 2z - 4 = -2d, -4d - 2z - 6 = 0. Let g(u) = u*2 - u. Let q(f) = 3 + 664f*2 + f - 667f*2 - 2. What is dq(b) - g(b)? 2b2 - 1 Let f(p) = 71p*2 - 4p + 9. Let k(m) = 2m2 + 2m - 2. Determine f(y) + 4k(y). 79y*2 + 4y + 1 Let o(x) = -6x + 2. Let b(v) = -11v + 3. Let k be (21/28)/(-1(-1)/(-4)). What is kb(r) + 5o(r)? 3r + 1 Let h(p) = p*2 - p. Let i(g) = -3g*2 + 8g - 2. Let l(s) = 2s2 - 9s + 3. Let w(r) = 5i(r) + 4l(r). Let y = 10692 + -10693. Determine yw(t) - 5h(t). 2t2 + t - 2 Let n(o) = -3o. Let w(k) = -20k. Let v(x) = x. Let r(s) = 8v(s) + w(s). Let y = -66 - -62. Let q be (y/14)/((-7)/49). What is qr(g) - 9n(g)? 3g Let i(f) = -52f + 308. Let c be i(6). Let p(g) be the first derivative of -g*2/2 - 2. Let a(r) = 2r. Let d be 1-1(3 - 2). Give cp(s) + da(s). 2s Let y(z) = -1. Suppose 0 = 947d - 946d - 1. Let g = 41 - 29. Let f(c) = 2c + 10. Determine df(a) + gy(a). 2a - 2 Let u(b) = b + 1. Let c(g) = -5g - 38. Let i be c(-12). Let f(o) = -14 + 10o - 2 - io. Calculate f(r) + 16u(r). 4r Let t(s) = 17s + 21. Let q(p) = -6p - 7. Determine 7q(z) + 2t(z). -8z - 7 Suppose 0 = -5u - 0u + 15. Suppose -n - u = 4n - 2y, -2n - 2y - 4 = 0. Let p(r) = r + 1. Let m(o) = 2o - 1. Determine np(h) - m(h). -3h Suppose 0 = 2l - 0l + 12. Suppose -a - 26 = 17. Let u = 38 + a. Let v(d) = 2d2 + 3d - 5. Let o(c) = -2c2 - 3c + 6. Give lv(s) + uo(s). -2s2 - 3s Let t be (10 - 0) + -31 + 27. Let k(v) = 7v3 - 6v*2 + 6v + 2. Let f(s) = -13s3 + 11s*2 - 11s - 4. What is tf(x) + 11k(x)? -x*3 - 2 Let j(l) = -l - 1. Let f(n) = 5n*2 - 7n - 5. Let d be ((-5)/(-10))/((-17)/170). Determine dj(q) + f(q). 5q*2 - 2q Let b(p) = -5p3 - 6p*2 + 6p + 7. Let v(q) = 5q3 + 7q*2 - 7q - 7. Give -7b(t) - 6v(t). 5t3 - 7 Let x(k) = 3k*2 - 7k - 19. Suppose -5y + 4q - 6 = 0, -2q + 18 = y + 2q. Let b(m) = 39m2 + 6 - 17m*y + 2m - 23m2. What is 7b(j) + 2x(j)? -j2 + 4 Let y(o) = 6o*2 - 5o + 10. Let d(b) = 7b2 - 4b + 14. What is 3d(x) - 4y(x)? -3x2 + 8x + 2 Let g(k) = 1. Let a(q) = -q - 5. Let p = -26 - -50. Let r be (16/p)/((-2)/12). What is rg(v) - a(v)? v + 1 Suppose 0 = -954d + 947d + 35. Let u(b) = -4b*2 + b + 5. Let l(p) = -7p*2 + 2p + 9. Let h be 70/(-22) - (-2)/11. Determine du(m) + hl(m). m*2 - m - 2 Suppose -2r - 12 = -5r. Let z(x) = rx**2 + 7 - 7. Let w(q) = -1	{ "pile_set_name": "DM Mathematics" }
2. 1727 Simplify -5 + sqrt(68) + 0 + sqrt(68) + sqrt(68) + -4. -9 + 6sqrt(17) Simplify sqrt(136)/(sqrt(1152)2)-1. -sqrt(17)/24 Simplify ((sqrt(18) + 5)*2 + -2 - sqrt(18)) + 5. 27sqrt(2) + 46 Simplify (5(-4 + (-1 + sqrt(11) - sqrt(11))))2. 625 Simplify (sqrt(5) - (sqrt(5) - (-1 + sqrt(180))))2 + sqrt(320). -4sqrt(5) + 181 Simplify sqrt(33)/sqrt(3) + 4 + -5 - (sqrt(396) - (sqrt(396) + (-1 + sqrt(396))-4))2. -6353 + 193sqrt(11) Simplify ((sqrt(12)/(-2sqrt(6)))2 - ((sqrt(288) + 0 - sqrt(288)) + sqrt(288))2)6. -1725 Simplify 6(sqrt(500)-4 + sqrt(500)). -180sqrt(5) Simplify sqrt(2816)2 - 13sqrt(44). 26sqrt(11) Simplify -3 + -1 + sqrt(304). -4 + 4sqrt(19) Simplify (sqrt(726)-2 + sqrt(726))/(sqrt(36)/sqrt(2)). -11sqrt(3)/3 Simplify -2 + (sqrt(39) - sqrt(975) - sqrt(39))/sqrt(3) + 1sqrt(52). -3sqrt(13) - 2 Simplify (6sqrt(96))/(-1sqrt(648)). -4sqrt(3)/3 Simplify (5sqrt(208) + 4 + -2)*2. 80sqrt(13) + 5204 Simplify ((1 + sqrt(44) + sqrt(11))*2 + 4 + 0)-2. -208 - 12sqrt(11) Simplify (sqrt(144)/sqrt(8))/sqrt(9) + -4. -4 + sqrt(2) Simplify sqrt(39)/(sqrt(3) + sqrt(363)-1). -sqrt(13)/10 Simplify ((-2 + sqrt(176))2 - (4 + sqrt(11) + 0)2)-5. -765 + 120sqrt(11) Simplify 1 + (sqrt(304) + -3)*2 + -2. -24sqrt(19) + 312 Simplify (-1 + 0 + sqrt(117))-3. -9sqrt(13) + 3 Simplify (-5 + sqrt(2736)-3)2 + -5. 360sqrt(19) + 24644 Simplify -3 + (-4(2sqrt(14) + sqrt(14)))/sqrt(7). -12sqrt(2) - 3 Simplify (sqrt(5) - -1sqrt(5))4 - (sqrt(45)/(sqrt(45)/sqrt(5)) - sqrt(5)). 8sqrt(5) Simplify 1 + 1(sqrt(1539)2)*2. 6157 Simplify -4 + -2(1 + sqrt(17)) + 2. -2sqrt(17) - 4 Simplify (sqrt(10)/(sqrt(5) + sqrt(45)) - (1 + sqrt(8) - sqrt(2))) + 4. -3sqrt(2)/4 + 3 Simplify (sqrt(612)-3 - (sqrt(153)-2 - sqrt(153))/sqrt(9))*2. 3825 Simplify (12sqrt(110) + sqrt(110))/(sqrt(10) - 2sqrt(160)). -3sqrt(11)/7 Simplify 5 + sqrt(156)/(sqrt(108)1 - sqrt(108) - sqrt(108))2. -2sqrt(13)/3 + 5 Simplify (-1 + (sqrt(12)/sqrt(4) - sqrt(3))1)26. 6 Simplify (5-5(sqrt(2) + 1))*2. 1250sqrt(2) + 1875 Simplify sqrt(18)/(sqrt(30)/sqrt(5)6). sqrt(3)/6 Simplify 2 + 0 + sqrt(343). 2 + 7sqrt(7) Simplify (6(sqrt(13) + sqrt(468) + sqrt(13)))2 + -5. 29947 Simplify 0 + sqrt(12)2. 4sqrt(3) Simplify (sqrt(1584)-1)/(sqrt(4) + sqrt(40)/(sqrt(40) + sqrt(10)) + sqrt(4)). -18sqrt(11)/7 Simplify (-1 + 5 + 0 + sqrt(2057) + 4)2. 176sqrt(17) + 2121 Simplify (sqrt(110)/sqrt(2))/sqrt(11)2. 2sqrt(5) Simplify (sqrt(90)/sqrt(2)-1 - sqrt(45))/(sqrt(9) + sqrt(180)/sqrt(5)). -2sqrt(5)/3 Simplify (sqrt(700) + -1 + 4)*2. 60sqrt(7) + 709 Simplify (sqrt(11) + (sqrt(11)1)2 + 1)54. 20sqrt(11) + 240 Simplify (sqrt(76) + sqrt(76)16)/(sqrt(20)/((sqrt(5) - (sqrt(5) + sqrt(125))) + sqrt(5))). -28sqrt(19) Simplify sqrt(133)/(sqrt(84)/sqrt(3)). sqrt(19)/2 Simplify (sqrt(32) + -5 + -1)2. -48sqrt(2) + 68 Simplify -4(sqrt(1100) + 2 + sqrt(1100) + sqrt(1100) + 0)2. -39616 - 480sqrt(11) Simplify (sqrt(34)/sqrt(2)-1)2 - ((2 + sqrt(17))-6)*2. -739 - 144sqrt(17) Simplify (sqrt(2057) + -1)5 + 5(sqrt(2057) + 1). 110sqrt(17) Simplify (0 + sqrt(832)-1 + sqrt(832))-5 + -1. -1 Simplify -3(1 + sqrt(2)) + -4sqrt(2)-2. -3 + 5sqrt(2) Simplify (((sqrt(153)-1 - sqrt(153))-5)/(1sqrt(324) + sqrt(9) - sqrt(9)))*2. 425/9 Simplify 5(-2(sqrt(1331) + -2))2. -880sqrt(11) + 26700 Simplify -3sqrt(832) - (sqrt(13) + sqrt(3328)). -41sqrt(13) Simplify -5(0 + sqrt(605)). -55sqrt(5) Simplify sqrt(21)/(sqrt(7) - sqrt(63)) + -1sqrt(192) - ((0 + sqrt(3))-5 + 3). -7sqrt(3)/2 - 3 Simplify sqrt(22)/sqrt(2)-5 + 5 + 5. -5sqrt(11) + 10 Simplify (-2 + sqrt(700)2)*2. -80sqrt(7) + 2804 Simplify sqrt(343) + 2 + 2. 4 + 7sqrt(7) Simplify sqrt(65)/(sqrt(605)3). sqrt(13)/33 Simplify 2 + sqrt(27) + 3 + (sqrt(30)/(sqrt(5)-1))/sqrt(2). 2sqrt(3) + 5 Simplify (-1sqrt(143)-1)/(-4sqrt(22)/sqrt(2) - sqrt(11)). -sqrt(13)/5 Simplify sqrt(308)/(2(sqrt(11) + sqrt(396))). sqrt(7)/7 Simplify (((-1 + sqrt(567))-5 + (-2sqrt(567) + -2 - sqrt(567)))3)2. -3888sqrt(7) + 326673 Simplify (-32sqrt(187) + sqrt(187) + sqrt(187))/(sqrt(11) - 3-2sqrt(11)). -4sqrt(17)/7 Simplify (-1sqrt(832) + sqrt(832) + 2)5. 10 Simplify 4((sqrt(13) + 1)*2 + -5)-3. -108 - 24sqrt(13) Simplify (sqrt(1584) + (sqrt(1584) - (sqrt(1584) + 3))-5 - ((sqrt(1584)2 - sqrt(1584)) + 0))2. 225 Simplify (sqrt(6050)1)/(sqrt(250)-1 - sqrt(10)). -11sqrt(5)/6 Simplify -1 + (4sqrt(448))2. 7167 Simplify ((sqrt(500)-2)/sqrt(10))/(sqrt(640) + -2sqrt(640)). sqrt(5)/4 Simplify (sqrt(40)/(1sqrt(2)) - sqrt(20))/(-6-2sqrt(10)). 0 Simplify sqrt(931) - (sqrt(931) - (-5 + 1 + sqrt(931))*2). -56sqrt(19) + 947 Simplify ((sqrt(475) + -1)-1 - (2 + (sqrt(475) + (sqrt(475) - (3 + sqrt(475))) - sqrt(475)) + sqrt(475)))2. -40sqrt(19) + 1904 Simplify (sqrt(1088) - 3-3sqrt(1088))*2. 108800 Simplify 4((sqrt(833)-2 + 5)-6)*2. -20160sqrt(17) + 483408 Simplify -5 + (5-2sqrt(243) - ((0 + sqrt(243)2)2 - sqrt(243))). -977 - 81sqrt(3) Simplify 4 + (sqrt(52) + 0)*2 - 2sqrt(52)2. -8sqrt(13) + 56 Simplify (-3sqrt(52) - (sqrt(13) + -1)-5)*2. 10sqrt(13) + 38 Simplify sqrt(6)/(sqrt(12)-3 - sqrt(3)) + 1. -sqrt(2)/7 + 1 Simplify ((sqrt(209) - 4sqrt(209))/sqrt(11) - (sqrt(19) + sqrt(57)/sqrt(3) + 1))*2. 10sqrt(19) + 476 Simplify sqrt(336)/sqrt(7) - (-1 + sqrt(192) - sqrt(192)). 1 + 4sqrt(3) Simplify (1 + sqrt(162) + (sqrt(162) - (sqrt(162)3 + 5 + sqrt(162))))*2. 144sqrt(2) + 664 Simplify sqrt(15)/sqrt(12) + -5. -5 + sqrt(5)/2 Simplify 3sqrt(704) + 2. 2 + 24sqrt(11) Simplify ((sqrt(78) + (sqrt(78) - (sqrt(78) + (sqrt(78) - (sqrt(78)-1 + sqrt(78) + sqrt(78)) - sqrt(78)))) - sqrt(78) - sqrt(78))2 + sqrt(78))/sqrt(6). sqrt(13) Simplify ((sqrt(136) - (sqrt(136) - sqrt(136)-1) - sqrt(136) - sqrt(136))5)/sqrt(8). -15sqrt(17) Simplify 3 + sqrt(133)/(sqrt(7) - sqrt(28)). -sqrt(19) + 3 Simplify 0 + (sqrt(208)2 + 3 + sqrt(208))*2. 72sqrt(13) + 1881 Simplify (-3sqrt(102)1)/(sqrt(6) + sqrt(72)/(sqrt(24)/sqrt(2))). -3sqrt(17)/2 Simplify 4(-6-1sqrt(7) + sqrt(7) + sqrt(7)). 32sqrt(7) Simplify (sqrt(180) - ((sqrt(180) - (sqrt(180) + (sqrt(180) - -2sqrt(180)) + sqrt(180))) + -2) - sqrt(180))*2 - sqrt(180)1-3. 114sqrt(5) + 2884 Simplify ((0 + sqrt(99) + sqrt(11) + (sqrt(11) - (sqrt(11) + -1))1 + sqrt(11))4)*2. 160sqrt(11) + 4416 Simplify -3 + 2sqrt(13) + 2. -1 + 2sqrt(13) Simplify sqrt(1216) + 2 + (sqrt(1539) + 2)*2. 44sqrt(19) + 1545 Simplify (sqrt(152)/sqrt(8) + 4)*2-2. -70 - 16sqrt(19) Simplify -2 + 0 + sqrt(432) + 1. -1 + 12sqrt(3) Simplify ((sqrt(396) + 1)*2 - (2sqrt(1331) - sqrt(1331))*2) + -1. -935 + 12sqrt(11) Simplify (sqrt(56)/((sqrt(16)/sqrt(2) - sqrt(8)) + sqrt(8))-3)2. 63 Simplify ((-2 + sqrt(1872)4)-6)2. -6912sqrt(13) + 1078416 Simplify (2sqrt(20))2 + sqrt(5) + sqrt(500)-5 + sqrt(5). -48sqrt(5) + 80 Simplify (sqrt(204) - (sqrt(204) - (sqrt(204)-3 - sqrt(204))) - sqrt(204))/sqrt(3). -10sqrt(17) Simplify 4 + ((sqrt(833) + 3)3 - sqrt(833))*2. 252sqrt(17) + 3417 Simplify -3 + (4 + (sqrt(13)4)2)5. 1057 Simplify sqrt(3) + (sqrt(972))*2 - -3sqrt(48). 13sqrt(3) + 972 Simplify (sqrt(325) + 1 + sqrt(325) + 1)2 + sqrt(325) + -4. 45sqrt(13) + 1300 Simplify -3(3 + sqrt(288) + 0)2. -891 - 216sqrt(2) Simplify (sqrt(833) + 2(sqrt(833) + -2))2. -168sqrt(17) + 7513 Simplify (sqrt(130)1)/sqrt(10) - sqrt(26)/(sqrt(2)-2). 3sqrt(13)/2 Simplify (sqrt(7) + (sqrt(7) - (1 + sqrt(7))))26 - sqrt(42)/(sqrt(6)2). -25sqrt(7)/2 + 48 Simplify (((sqrt(1300) + -2)*2 - sqrt(13)) + 2)2. -82sqrt(13) + 2612 Simplify -3sqrt(12)/(2sqrt(6)). -3sqrt(2)/2 Simplify -1 + sqrt(1008)1 + 0. -1 + 12sqrt(7) Simplify (sqrt(24)/(-3sqrt(300) - sqrt(300)))2. 1/200 Simplify (-4-1sqrt(8))/sqrt(4). 4sqrt(2) Simplify 0 + ((0 + sqrt(448)-1)2 - sqrt(448)). -8sqrt(7) + 448 Simplify (sqrt(108) - 4(sqrt(108) + sqrt(108) + 0))2 + 21sqrt(108). 12sqrt(3) + 5292 Simplify (-3 + sqrt(650)/sqrt(2))*2. -30sqrt(13) + 334 Simplify -3 + sqrt(17) + (sqrt(2057) + 0 - sqrt(2057)) + -6(0 + sqrt(1088)). -47sqrt(17) - 3 Simplify -3 + (-1sqrt(125)-2 + 1(-1 + sqrt(125)))2. -30sqrt(5) + 1123 Simplify (sqrt(2420) + sqrt(2420) + sqrt(2420)*-2 +	{ "pile_set_name": "DM Mathematics" }
Is 595769 a prime number? False Is 11182471 prime? True Is 209584039 prime? False Is 1591006 a prime number? False Is 9371737 a composite number? True Is 261753 prime? False Is 848603 composite? True Is 2120143 a prime number? True Is 4205641 a composite number? True Is 15312413 composite? True Is 7757363 prime? True Is 295973 prime? True Is 933739 a composite number? False Is 2076532487 a composite number? False Is 4771 a prime number? False Is 1111161 a prime number? False Is 4729261 a prime number? True Is 16259587 a prime number? True Is 103332701 prime? True Is 32184223 prime? True Is 12656863 a composite number? True Is 45566057 prime? False Is 3226043 a composite number? False Is 356922629 a composite number? True Is 24737299 composite? False Is 177551131 a composite number? False Is 1547383 prime? True Is 7924831 a prime number? False Is 4961155 composite? True Is 342355555 a prime number? False Is 71058133 prime? True Is 14113103 a composite number? False Is 76129489 a prime number? True Is 7228041 prime? False Is 1591883 a composite number? False Is 31667611 a composite number? False Is 33141827 a composite number? True Is 155392249 a prime number? False Is 277698845 composite? True Is 89205887 composite? True Is 374399303 prime? False Is 2474837 a composite number? False Is 317757091 a prime number? True Is 1069784195 composite? True Is 72839245 a composite number? True Is 83313217 a prime number? False Is 88289 prime? True Is 2326657 prime? False Is 24187391 composite? False Is 13482641 prime? True Is 17584687 composite? False Is 182019517 prime? True Is 14860577 prime? True Is 45182393 a composite number? True Is 405581927 prime? True Is 906388783 a composite number? False Is 40261147 a prime number? False Is 2905549 composite? False Is 5392535 prime? False Is 742261 a prime number? False Is 20900149 a prime number? True Is 82840939 prime? False Is 71913031 a prime number? True Is 12867187 a prime number? True Is 451859 a prime number? True Is 6420133 prime? False Is 36597199 a prime number? False Is 3890201 a composite number? True Is 267989369 composite? True Is 135442477 a prime number? True Is 14177 a prime number? True Is 1591541 composite? True Is 48222431 composite? False Is 37134377 composite? True Is 21221342 a composite number? True Is 27018977 a prime number? False Is 103217 composite? False Is 256938967 a composite number? True Is 252559 a composite number? False Is 123055 a composite number? True Is 43427029 composite? False Is 299339 prime? False Is 36690922 prime? False Is 29149691 a composite number? True Is 382441 a prime number? False Is 9675257 prime? True Is 5479466 composite? True Is 2491323 a prime number? False Is 29430809 composite? False Is 287747 a prime number? True Is 2518739 composite? True Is 10095287 prime? True Is 2332381 composite? False Is 139870943 a prime number? False Is 3273593 prime? True Is 4641379 a prime number? True Is 51635519 prime? False Is 2145437 composite? True Is 30915103 composite? True Is 2408027 prime? False Is 32210761 prime? False Is 109935229 prime? True Is 25519063 a prime number? True Is 31896121 prime? True Is 18012881 a prime number? True Is 377214969 composite? True Is 65640027 a prime number? False Is 1914947 prime? True Is 61351357 composite? False Is 1023719 a prime number? True Is 174593993 prime? False Is 2548142 a composite number? True Is 689083 prime? False Is 2051818 composite? True Is 33384077 prime? False Is 8368099 composite? True Is 3931517 composite? False Is 6195719 composite? True Is 18038399 a composite number? True Is 37948259 composite? False Is 549968605 prime? False Is 85290041 composite? False Is 27198407 a prime number? True Is 3002165 a prime number? False Is 469597033 a composite number? False Is 446231 prime? True Is 7906229 a prime number? True Is 358724567 prime? True Is 4665019 a prime number? True Is 21327638 a composite number? True Is 95080159 a composite number? True Is 32964655 a prime number? False Is 373133903 a composite number? False Is 6643235 composite? True Is 198996983 a composite number? False Is 155219311 a prime number? False Is 1717687 prime? True Is 8625997 composite? False Is 2356127 composite? False Is 4173761 prime? True Is 62643299 a composite number? False Is 83833 composite? False Is 10309709 composite? False Is 4726919 a prime number? True Is 6032617 a composite number? True Is 2838697 a composite number? False Is 3544727 a prime number? True Is 94055285 composite? True Is 6923933 a prime number? False Is 378971 a prime number? False Is 14641139 prime? True Is 2494489 a prime number? True Is 187636859 prime? True Is 46125811 prime? False Is 6444499 composite? True Is 1396817 a prime number? True Is 489044893 a prime number? False Is 36872569 composite? False Is 77049733 prime? True Is 202613 a prime number? True Is 144211029 composite? True Is 45152677 composite? True Is 15466271 composite? False Is 504736297 a composite number? True Is 3221419 composite? False Is 50602649 prime? True Is 4670291 composite? True Is 2416061 composite? False Is 5429089 composite? True Is 218663 composite? True Is 1147200737 a composite number? False Is 16675453 composite? True Is 454697 a composite number? True Is 3924497 a composite number? False Is 24368987 prime? False Is 20488093 prime? True Is 31357837 composite? True Is 3409319 composite? True Is 5373119 a composite number? False Is 16532311 prime? True Is 5048357 composite? True Is 5049313 a prime number? True Is 50574109 composite? False Is 212354971 a composite number? False Is 2501663 a composite number? True Is 366953 prime? True Is 6102631 a prime number? True Is 390917 a prime number? False Is 82864226 prime? False Is 7274699 a prime number? True Is 10405573 prime? False Is 7202219 a prime number? True Is 4121801 a prime number? False Is 13049749 a prime number? True Is 6246847 a composite number? True Is 49392269 prime? False Is 4539641 a composite number? True Is 55037641 prime? False Is 248264221 composite? False Is 6704198 prime? False Is 15020483 a prime number? False Is 66274021 composite? True Is 261115 a composite number? True Is 6960739 prime? True Is 4930693 prime? True Is 5790671 a prime number? False Is 184669 a composite number? False Is 3238537 a composite number? False Is 4318291 a composite number? True Is 2084419 a composite number? False Is 6009107 prime? False Is 5386307 a composite number? False Is 187553629 prime? False Is 96636847 composite? True Is 1263487 a prime number? True Is 6858823 a composite number? False Is 215901106 prime? False Is 250073 composite? False Is 33568883 prime? True Is 276436789 prime? True Is 2250991 a prime number? False Is 20422543 a prime number? False Is 2411351 prime? True Is 145761947 composite? True Is 70500993 composite? True Is 133737281 prime? True Is 58362397 composite? False Is 11542163 composite? True Is 155135269 a prime number? False Is 33001513 a prime number? True Is 82712017 a prime number? True Is 57927643 composite? False Is 1258727 composite? True Is 10922291 a composite number? False Is 184036709 prime? False Is 171404113 composite? False Is 106232171 prime? False Is 9103871 composite? True Is 481363 a prime number? True Is 2209399 a prime number? False Is 205258837 a prime number? False Is 1556707 prime? False Is 2929451 a composite number? True Is 1472017 a composite number? False Is 30682243 prime? True Is 3753487 a prime number? True Is 38969365 prime? False Is 5080529 prime? True Is 6447409 prime? False Is 14295773 prime? False Is 7090691 composite? False Is 63337803 a composite number? True Is 244985047 prime? True Is 493363 a prime number? False Is 56904557 prime? False Is 1098017 prime? True Is 4674967 a composite number? True Is 463316857 a prime number? True Is 3326249 a prime number? True Is 14512759 a prime number? False Is 8035517 a composite number? True Is 86110709 a composite number? True Is 246579557 prime? False Is 17342137 composite? False Is 373942493 a prime number? True Is 9075259 composite? False Is 45186913 a prime number? True Is 7662307 prime? True Is 152277623 a composite number? True Is 49902959 composite? False Is 38558711 a composite number? True Is 99176869 prime? False I	{ "pile_set_name": "DM Mathematics" }
- -210/4. Let p(t) = t2 + 9. Let q(r) = -3. Calculate kq(h) - 4p(h). -4h*2 - 3 Let u(k) = 453k + 6. Let l(a) = -1349a - 17. Determine 3l(n) + 8u(n). -423n - 3 Suppose 4p - 2s - 22 = 0, -p - 2s - 12 = s. Let l(a) = -293a*3 + a + 0a*2 + 292a*p + 0a2. Let k(q) = q3 + 2q. Determine k(z) - 4l(z). 5z3 - 2z Let h(y) = 5y3 - 4y + 7. Let l(g) = 6g3 - 5g + 8. Let t = 1196 + -1192. Calculate tl(d) - 5h(d). -d*3 - 3 Let o = -264 + 260. Let h(p) = 40p*2 + 10p + 7. Let l(t) = -13t2 - 3t - 2. Calculate oh(f) - 14l(f). 22f2 + 2f Let s(c) = 8c3 - 9c*2 - 3c + 11. Let o(r) = -25r3 + 26r*2 + 10r - 37. What is -3o(p) - 10s(p)? -5p3 + 12p*2 + 1 Let d(i) = -74i*3 + 40i*2 + 68i + 72. Let j(s) = -14s3 + 8s*2 + 14s + 14. Determine -3d(c) + 16j(c). -2c3 + 8c*2 + 20c + 8 Let b(s) = 4s - 19. Let c(l) = -5l - 50. Let o(n) = -2n - 2. Let a(h) = c(h) - 6o(h). Calculate -6a(u) + 11b(u). 2u + 19 Let t(v) = -60v*2 - 748v + 5. Let z(k) = -35k2 - 374k + 3. Determine 3t(w) - 5z(w). -5w2 - 374w Let p = 3282 - 3278. Let m(g) = -2g3 - 3g*2 + 3g. Let d(r) = r*3 + 2r*2 - 2r. What is pm(t) + 6d(t)? -2t3 Let f(p) = 2p3 + p2 + 5. Let k(i) = 14i3 + 8i*2 - 28i + 30. What is 6f(q) - k(q)? -2q*3 - 2q*2 + 28q Let q = 1232 - 1237. Let o(k) = 14k - 4. Let a(m) be the third derivative of -5m*4/8 + 5m3/6 - m2. What is qo(y) - 4a(y)? -10y Let d(t) = -t2 - 17t + 3. Suppose -101u - 42u = 38u - 543. Let f(n) = -n2 - 17n + 4. What is ud(w) - 2f(w)? -w*2 - 17w + 1 Let i(c) = -129c3 + 12c*2 - 16c. Let f(s) = -129s3 + 15s*2 - 21s. What is 4f(k) - 5i(k)? 129k3 - 4k Let x = 3089 - 3084. Let m(r) = 2r2 + 8r + 2. Let s(i) = 2i2 + 7i + 2. Give xm(z) - 6s(z). -2z2 - 2z - 2 Let s(u) = -u*3 - 3u*2 - 12u - 779. Let p(b) = -b*3 - 5b*2 - 20b - 1556. Give 3p(d) - 5s(d). 2d3 - 773 Let q(k) be the first derivative of -k2/2 - 25k + 60. Let u be q(-23). Let z(l) = 3l3 + 4l - 2. Let h(t) = 10t3 + 13t - 7. What is uh(p) + 7z(p)? p*3 + 2p Let z(y) = -15y3 + y2 - 5y - 4. Let c(v) = -v3 - v2 - 1. Determine 3c(u) - z(u). 12u*3 - 4u*2 + 5u + 1 Let i(m) = -296m3 + 5m*2 + 15m. Let r(v) = -443v3 + 8v*2 + 20v. Calculate -8i(t) + 5r(t). 153t3 - 20t Let p(x) = 2x + 3005. Let i(v) = -v - 1498. Give 13i(n) + 6p(n). -n - 1444 Let x(j) = -21j*2 - 2j - 4. Let o(n) = -62n2 - 7n - 13. Let y(r) = -91r + 630. Let w be y(7). What is wx(q) + 2o(q)? 23q*2 + 2 Let j(d) = 5. Let s be (-26 - -25) + -1 + (2 - -1). Let g(v) = -1. Let f(r) = sj(r) + 4g(r). Let m(y) = -y. Calculate f(k) + 5m(k). -5k + 1 Let g(w) = w3 - 11w*2 + 2. Let o(k) = -3k*3 + 34k*2 - 7. Let h(n) = -2n*3 - 24n*2 - 6n - 79. Let b be h(-12). Give bg(t) - 2o(t). -t*3 + 9t*2 Let c(z) = -214z*3 + 6z2 - z - 1. Let k(v) = v3 + 8v2 - 1. Give c(l) - k(l). -215l*3 - 2l*2 - l Let x(f) = f - 2. Let k be -2 - (-9)/4 - 5/20. Let c(g) = -1 + k + 13g - 1. Let o(d) = 7d - 1. Let j(q) = -6c(q) + 11o(q). Calculate 3j(b) + x(b). -2b + 1 Let r(j) = -5j2 - 5. Let w = -2326 - -2331. Let g(n) be the first derivative of n4/4 + 4n3/3 + 4n - 21. Calculate wg(b) + 4r(b). 5b3 Let b(t) = 8 + 12t + 367t + 16 - 380t. Let k(d) = 1. Give 2b(u) + 4k(u). -2u + 52 Suppose 5b - 56 = -4w - 30, -3b + 3w - 6 = 0. Let y(l) = l + 1. Let v(h) = 3h*2 - 2h + 1. Calculate by(z) + v(z). 3z2 + 3 Let h(c) be the second derivative of -c3/6 + 3c2/2 + 2c. Let k(m) = 15 - 739430m - 14 + 739431m. What is -h(u) + 3k(u)? 4u Let b(g) = -g*2 + 1. Let v(q) = -2q*2 + 1. Let x(y) = 33 - 27 - 2y*3 + 0y*3 - 20y*2 - 15 + 11y - 3y2. Let z be x(-12). What is zv(n) - 3b(n)? -3n2 Let l(q) = -q3 - 27q2 - 110q + 7. Let y be l(-22). Let f(z) = z - 17. Let s(v) = -8. Calculate ys(t) - 3f(t). -3t - 5 Let s(y) = -y3 - 2y*2 + 3y - 2. Let c(a) = -203a3 + 11a*2 - 6a + 4. Calculate c(i) + 2s(i). -205i*3 + 7i*2 Let v(q) = -74q*3 - 8845q - 42. Let a(l) = 28l3 + 3317l + 16. What is -21a(k) - 8v(k)? 4k3 + 1103k Let t(k) be the second derivative of k4/12 + k3/6 + k*2/2 + 1238k. Let y(q) = 7q2 - q - 1. Calculate t(z) + y(z). 8z2 Let j(r) be the first derivative of r4/4 + 14r3/3 - r2/2 - 10r - 27. Let c be j(-14). Let h(l) = 6l + 4. Let s(w) = -7w - 5. Give cs(p) + 5h(p). 2p Let i(c) = 9c*2 + 5c - 19. Let x(v) = -19v - 14v + 14v2 + 0 - 28 + 63v - 22v. Calculate -8i(r) + 5x(r). -2r*2 + 12 Suppose 2186t = 2191t - 5. Let j(y) = -y3 - y2 + 1. Let m(w) = w3 + 3w*2 + w - 5. Determine tm(z) + 3j(z). -2z*3 + z - 2 Let a(g) = -7g*3 + 7g*2 + 6. Suppose 0 = 5w - 5n - 208 - 67, 3w + 3n - 141 = 0. Let k = 52 - w. Let f(p) = -p3 + p2 + 1. Calculate ka(x) - 6f(x). -x3 + x2 Let j(o) = 36o*3 + 6o*2 - 6. Suppose -133c + 669 = 1467. Let k(m) = m3 - m2 + 1. Calculate ck(z) - j(z). -42z*3 Let g(c) = -19c - 11c - 29 - 32 + 105 - 39. Let h(q) = -q + 1. Give g(t) - 6h(t). -24t - 1 Let n(t) = 4t*2 - 4. Let m = 1396 - 1394. Let k(w) = -9w*2 + 9. Determine mk(o) + 5n(o). 2o*2 - 2 Let w(t) = 974t - 5. Let p(x) = -481x + 2. Determine -7p(s) - 3w(s). 445s + 1 Let u(i) be the first derivative of -i*4/4 - 2i*3 - 5i*2/2 + 3i + 2672. Let q(x) = x*3 + 5x*2 + 4x - 3. Let b = 51 - 45. Determine bq(s) + 5u(s). s*3 - s - 3 Let x(c) = 28c*2 - c + 3. Let q(g) be the second derivative of -55g4/12 + g3/2 - 7g2/2 - 9885g. What is 3q(h) + 7x(h)? 31h2 + 2h Let d(i) = 66i - 12394. Let h(o) = -237o + 43380. Give 18d(p) + 5h(p). 3p - 6192 Let f(r) = -327r + 25. Let q(h) = 490h - 36. Determine -7f(a) - 5q(a). -161a + 5 Let s(l) = -15l2 - 9l + 5. Let c(w) = 49w2 + 35w - 14. Determine 2c(v) + 7s(v). -7v2 + 7v + 7 Let x = 8987 + -8980. Let a(p) = 3p3 - 3p - 6. Let y(q) = -10q3 + 10q + 17. Determine xa(i) + 2y(i). i*3 - i - 8 Let n(a) = 10a*2. Let p be (0 - -4) + -3 - 1 - -8. Let g(o) = -3o*2 + 48 - 48. What is pg(v) + 3n(v)? 6v*2 Let k(i) = -74i - 278. Let w(f) = -47f - 186. Give 5k(h) - 8w(h). 6h + 98 Let j(x) = -25x2 - 104x - 15. Let l(m) = 8m2 + 37m + 5. Let v(i) = -6j(i) - 17l(i). Let y(z) = -13z2 + 6z - 6. Calculate -6v(t) - 5y(t). -19t2 Let q(r) = -8r*2 - 75r + 38. Let d(b) = -3b2 - 26b + 12. Determine 17d(l) - 6q(l). -3l2 + 8l - 24 Let p(x) = x3 + x2 + x. Let r(c) = c*3 - 7c*2 - 11c + 79. Let q be r(7). Let o(w) = -9w3 - 2w*2 - 2w. Determine qp(g) + o(g). -7g*3 Let v(g) = 72g + 126. Let f(x) = -129x - 252. What is 3f(y) + 5v(y)? -27y - 126 Let p = 20747 + -20749. Let q(m) be the first derivative of -m*3/3 + 2m - 2. Let c(t) = 3t2 - t - 8. What is pc(n) - 9q(n)? 3n*2 + 2n - 2 Let u(s) = -1176s2 + 140s + 140. Let c(b) = 25b2 - 3b - 3. Suppose -5w + 3y = -20 + 23, 4w - 5y = -18. What is wu(d) + 140c(d)? -28d2 Let f = -3981 + 3986. Suppose -31 + 3 = 4b. Let h(z) = -6z3 + 3z*2 + 7z + 10. Let c(i) = -4i3 + 2i*2 + 5i + 7. Calculate bc(r) + fh(r). -2r3 + r2 + 1 Let z(v) = 4v + 2v + 0v2 - v2 - 6v2. Let j(o) = -105o*2 + 91o. Let h(t) = -2t2 - 70t - 91. Let y be h(-35). Determine yz(f) + 6j(f). 7f2 Let x(f) = -f2 + f. Let y be (23-1 - -1) + 30/(-10). Let a = y + 27. Suppose 0 = 10h - 11h - a. Let b(o) = -o*3 + 2o*2 - o + 2. Determine hx(n) - b(n). n*3 - n - 2 Suppose -9p = 4p - 1274. Let t = -97 + p. Let m(c) = c2 + c. Let n(w) = 5w*2 + 4w - 1. Give tn(q) - 6m(q). -q*2 - 2q - 1 Let n(k) = -113k3 + 18k*2 - 3k + 28. Let v(l) = 38l3 - 6l*2 + l - 10. Determine 5n(h) + 14v(h). -33h*3 + 6h*2 - h Let z be 12 - (-132)/(-15) - 1/5. Let v(h) = -7h - 4. Let f(n) = -6n - 3. Let o = 9 + -13. Let k(p) = of(p) + 3v(p). Let l(c) = 2c. Give zl(w) - k(w). 3w Let v(i) = 144i + 11. Let w(x) be the second derivative of -29x3/6 - x2 + 20x - 5. What is -2v(n) - 11w(n)? 31n Let b(v) = 66v - 29. Let i(g) = -135g + 63. What is 7b(z) + 4i(z)? -78*z + 49 Let d(u) = 1. Let y be (21	{ "pile_set_name": "DM Mathematics" }
f 343, 1129, 2539, 4579, 7255? f*3 + 306f*2 - 139f + 175 What is the j'th term of 959293337, 959293335, 959293333, 959293331, 959293329, 959293327? -2j + 959293339 What is the o'th term of 2653570, 2653836, 2654102, 2654368? 266o + 2653304 What is the z'th term of -17092, -16053, -15014, -13975, -12936, -11897? 1039z - 18131 What is the m'th term of -44102, -44647, -45554, -46823, -48454, -50447? -181m*2 - 2m - 43919 What is the o'th term of 34999, 29013, 23027? -5986o + 40985 What is the u'th term of -868, -1242, -1792, -2458, -3180, -3898, -4552, -5082? 10u*3 - 148u*2 - 730 What is the q'th term of 564, 1190, 1874, 2616? 29q*2 + 539q - 4 What is the c'th term of 5133782, 10268702, 15403636, 20538590, 25673570? c3 + c2 + 5134910c - 1130 What is the x'th term of -278, -1955, -4730, -8597, -13550, -19583, -26690, -34865? x3 - 555x*2 - 19x + 295 What is the x'th term of 1945, 7619, 17021, 30151, 47009? 1864x2 + 82x - 1 What is the f'th term of -851956763, -851956765, -851956767, -851956769, -851956771? -2f - 851956761 What is the u'th term of -14525, -31976, -49427, -66878, -84329? -17451u + 2926 What is the b'th term of 2157006, 4314086, 6471166, 8628246, 10785326, 12942406? 2157080b - 74 What is the i'th term of 19103178, 19103174, 19103168, 19103160? -i2 - i + 19103180 What is the w'th term of -78112, -625096, -2109772, -5000986, -9767584, -16878412? -78141w*3 + 3w + 26 What is the i'th term of 7569, 7337, 7105, 6873, 6641, 6409? -232i + 7801 What is the o'th term of -5473, -6996, -8521, -10048, -11577? -o2 - 1520o - 3952 What is the d'th term of -664605, -664698, -664833, -665010? -21d2 - 30d - 664554 What is the x'th term of 4416497, 4416488, 4416479, 4416470, 4416461? -9x + 4416506 What is the s'th term of 4837, 38582, 130181, 308560, 602645, 1041362? 4821s3 + s2 - 5s + 20 What is the b'th term of -3412574, -6825152, -10237730, -13650308? -3412578b + 4 What is the n'th term of 258855, 517063, 775271, 1033479, 1291687, 1549895? 258208n + 647 What is the a'th term of -11054, -22201, -33348, -44495, -55642? -11147a + 93 What is the x'th term of 7242, 28673, 64296, 114111, 178118, 256317? 7096x2 + 143x + 3 What is the r'th term of 388, 1635, 3746, 6715, 10536, 15203? -r*3 + 438r*2 - 60r + 11 What is the p'th term of -5457, -21199, -47421, -84111, -131257, -188847, -256869, -335311? 2p3 - 5252p*2 - 207 What is the u'th term of -77119, -154256, -231393? -77137u + 18 What is the z'th term of -1611, -7037, -20107, -44643, -84467, -143401? -637z3 - 967z - 7 What is the z'th term of 1, 129, 477, 1141, 2217, 3801, 5989, 8877? 16z3 + 14z*2 - 26z - 3 What is the u'th term of -58552, -58429, -58306, -58183, -58060, -57937? 123u - 58675 What is the v'th term of -148, -96, -44, 8, 60? 52v - 200 What is the l'th term of -401805027, -401805028, -401805029, -401805030? -l - 401805026 What is the k'th term of -23570, -47143, -70738, -94349, -117970, -141595, -165218, -188833? k*3 - 17k*2 - 23529k - 25 What is the t'th term of 2210514, 8841942, 19894322, 35367654, 55261938, 79577174, 108313362? 2210476t2 + 38 What is the o'th term of -1005, -3925, -8779, -15567, -24289, -34945, -47535? -967o*2 - 19o - 19 What is the g'th term of 560, 4189, 13884, 32633, 63424? 498g3 + 45g*2 + 8g + 9 What is the d'th term of 99069, 198112, 297133, 396126, 495085, 594004, 692877, 791698? -d*3 - 5d*2 + 99065d + 10 What is the k'th term of 30437287, 30437290, 30437293, 30437296, 30437299, 30437302? 3k + 30437284 What is the a'th term of -414718, -414940, -415162? -222a - 414496 What is the f'th term of 872137, 872132, 872125, 872116, 872105, 872092? -f*2 - 2f + 872140 What is the w'th term of 4313545, 4313542, 4313539, 4313536, 4313533? -3w + 4313548 What is the o'th term of -10847, -14202, -19815, -27680, -37791? o3 - 1135o*2 + 43o - 9756 What is the j'th term of -182679, -182660, -182641, -182622, -182603? 19j - 182698 What is the s'th term of -74557682, -74557691, -74557700, -74557709? -9s - 74557673 What is the v'th term of 2200, 21988, 76946, 184660, 362716, 628700, 1000198? 2931v3 - v2 - 726v - 4 What is the u'th term of 4421, 5820, 7219? 1399u + 3022 What is the l'th term of 25086, 25103, 25120, 25137, 25154? 17l + 25069 What is the t'th term of -171085, -168825, -166565, -164305, -162045, -159785? 2260t - 173345 What is the j'th term of 780565, 1561107, 2341649, 3122191, 3902733? 780542j + 23 What is the p'th term of -42356, -84919, -127482, -170045, -212608? -42563p + 207 What is the n'th term of -60027743, -60027742, -60027741, -60027740? n - 60027744 What is the o'th term of -397, -409, -433, -463, -493, -517, -529, -523? o3 - 12o*2 + 17o - 403 What is the u'th term of 144120, 144111, 144100, 144087, 144072, 144055? -u*2 - 6u + 144127 What is the l'th term of 66623, 133250, 199877, 266504, 333131? 66627l - 4 What is the u'th term of 88497, 87996, 87163, 85998, 84501, 82672, 80511? -166u*2 - 3u + 88666 What is the w'th term of 515438, 515406, 515376, 515348, 515322, 515298? w*2 - 35w + 515472 What is the h'th term of -2792, -7424, -12056? -4632h + 1840 What is the c'th term of -11485, -10712, -9429, -7636? 255c*2 + 8c - 11748 What is the v'th term of -951714, -951716, -951718, -951720, -951722, -951724? -2v - 951712 What is the a'th term of -1998, -7559, -13120, -18681, -24242? -5561a + 3563 What is the i'th term of -41837, -84114, -126391, -168668, -210945, -253222? -42277i + 440 What is the m'th term of 2110250, 4220490, 6330730, 8440970, 10551210, 12661450? 2110240m + 10 What is the u'th term of -9928, -19792, -29614, -39394, -49132? 21u2 - 9927u - 22 What is the u'th term of 3530942, 7061886, 10592830? 3530944u - 2 What is the y'th term of -1321412, -5285592, -11892558, -21142310, -33034848? -1321393y*2 - y - 18 What is the g'th term of 2949, 23576, 79561, 188586, 368333? 2947g*3 - 3g*2 + 7g - 2 What is the j'th term of -10988, -22033, -33086, -44153, -55240, -66353, -77498, -88681? -j*3 + 2j*2 - 11044j + 55 What is the s'th term of 9013, 8660, 8413, 8326, 8453, 8848, 9565, 10658? 9s3 - s2 - 413s + 9418 What is the k'th term of -397113, -793407, -1189701, -1585995, -1982289? -396294k - 819 What is the i'th term of 4558865, 9117729, 13676591, 18235451? -i2 + 4558867i - 1 What is the w'th term of -38103501, -38103502, -38103503, -38103504, -38103505? -w - 38103500 What is the y'th term of 8875, 35666, 80321, 142840? 8932y2 - 5y - 52 What is the t'th term of 1105378, 1105252, 1105126, 1105000, 1104874, 1104748? -126t + 1105504 What is the i'th term of -2050, -9221, -21174, -37909, -59426, -85725? -2391i*2 + 2i + 339 What is the u'th term of -114, -253, -302, -111, 470, 1591, 3402, 6053? 25u3 - 105u*2 + u - 35 What is the u'th term of -2916936, -2916937, -2916938, -2916939? -u - 2916935 What is the w'th term of 27913, 55742, 83571? 27829w + 84 What is the l'th term of 33509, 33915, 34321, 34727? 406l + 33103 What is the p'th term of -336475397, -672950794, -1009426191, -1345901588, -1682376985? -336475397p What is the u'th term of -388, -189, 124, 551, 1092? 57u2 + 28u - 473 What is the h'th term of 39170016, 39170015, 39170014, 39170013? -h + 39170017 What is the n'th term of 3330, 3307, 3248, 3135, 2950, 2675, 2292, 1783? -3n3 - 2n + 3335 What is the c'th term of -468368, -468351, -468332, -468311, -468288, -468263, -468236? c*2 + 14c - 468383 What is the d'th term of -666037, -1331571, -1997105, -2662639? -665534d - 503 What is the v'th term of -1885031, -7540127, -16965287, -30160511, -47125799? -1885032v2 + 1 What is the i'th term of 120002, 120206, 120412, 120620, 120830, 121042? i2 + 201i + 119800 What is the c'th term of 10911, 21814, 32659, 43416, 54055? -5c3 + c2 + 10935c - 20 What is the w'th term of -320332, -640642, -960956, -1281274, -1601596? -2w*2 - 320304w - 26 What is the h'th term of 1995988, 1995981, 1995974, 1995967? -7h + 1995995 What is the t'th term of 2110347, 4220694, 6331041, 8441388, 10551735? 2110347t What is the f'th term of -71518, -72033, -72548? -515*f - 71003 What is the k'th term of 8333, 33417, 75239, 133805, 209121,	{ "pile_set_name": "DM Mathematics" }
-2, r Let q = -0.19 + 0.69. Let m = -164 + 161. Sort -2, q, -0.3, m in descending order. q, -0.3, -2, m Let i = 10.6 - 11. Let j = 0.33 + -21.33. Let h = j + 20.96. Put h, i, 1/4 in decreasing order. 1/4, h, i Suppose 10 = -u - 27. Put u, 3, -3 in decreasing order. 3, -3, u Suppose 0 = x + 3, 3x = 4k - 15 - 6. Let t(v) = 2v - 41. Let z be t(12). Put z, k, -4 in descending order. k, -4, z Let k = -1104.5 + 1104. Sort 0.2, -0.014, k in decreasing order. 0.2, -0.014, k Suppose -145 = -9k - 100. Let l(w) = w - 4. Let x be l(5). Sort x, 2, k in ascending order. x, 2, k Let n(i) = -2i2 + 8i + 15. Let f be n(7). Let r = f - -47. Suppose -5v + r = -10v. Sort v, -1/2, -2. v, -2, -1/2 Let i = -1 + 1. Let z(o) = -o*2 - 12o - 18. Let h be z(-10). Suppose 0 = -5k - hk - 28. Sort i, k, -1 in increasing order. k, -1, i Let n = -20 + 12. Let b(a) = -a - 12. Let h be b(n). Let s be 19/h + 1/(-4). Put -3, 1, s in ascending order. s, -3, 1 Let w(h) = -7h - 38. Let v be w(-6). Sort 2, -5, 5, v in decreasing order. 5, v, 2, -5 Suppose -6i = -345 - 639. Suppose i = 3m + 7g - 2g, 3m - g - 194 = 0. Let v = m + -440/7. Sort 2, v, -0.4. -0.4, v, 2 Suppose 0 = 8h + 38h + 92. Put 4/17, h, 1 in descending order. 1, 4/17, h Let c = 0.4584 + -0.1584. Sort c, -1, -0.3, -41. -41, -1, -0.3, c Let p = -77.6 + 75.6. Sort 0.02, p, -3, -4/3. -3, p, -4/3, 0.02 Let x be (-24)/(-132) + (-2)/11. Let s be (2 - 11)/3 - -5. Suppose 3f = -13 - s. Put 2, x, f in descending order. 2, x, f Suppose -7 = -3s + 4y, 1 = -3s - 10y + 6y. Put -1/6, -2/37, -0.3, s in ascending order. -0.3, -1/6, -2/37, s Suppose -5j = -5 - 10. Suppose y = 4y, -4a + jy = -8. Suppose s + 9 = -h, -as - 3s + 5 = -5h. Sort -1, s, -5 in increasing order. -5, s, -1 Suppose 23 = -5r + 8. Let f = r + 2. Suppose 4y = 5g + 6 + 15, -4g - 24 = -5y. Sort f, y, 5. f, y, 5 Let a = 5.6 + -6. Put 1, -63, a in descending order. 1, a, -63 Let k be (2/(-48))/(11/66-2). Sort 4/5, k, -2/5, 0.3 in descending order. 4/5, 0.3, k, -2/5 Let k(h) = -7h*2 - 6h - 5. Let r be k(-4). Let d = r + 91. Sort d, 3, -1. d, -1, 3 Let i = -2.1 + 1.4. Let b = i + 3.7. Suppose 8 = -3x + 5. Put x, b, -2/3 in ascending order. x, -2/3, b Let y(a) = a3 + 9a*2 - 12a - 15. Let x be y(-10). Let m = 0 + 12. Let w = -17 + m. Put -1, w, x in decreasing order. x, -1, w Suppose -3 = -c - 1. Let w be (3 + c + -6)8. Let r be w/24(-12)/22. Sort r, 0, 2 in increasing order. 0, r, 2 Let h = -5 - -14. Suppose 2k = -5x - 3k - 5, 3x - k = h. Let r = x - -1. Put 0, -2, r in ascending order. -2, 0, r Let y = -16 + 26. Let v be y/25 + (-27)/5. Put -3, 3, v in decreasing order. 3, -3, v Let o be 58(78/12 + -7). Put -4, 1, o in descending order. 1, -4, o Let g = 6471/50 + -259/2. Let x = -31/75 - g. Put 0.1, 3/2, 0, x in increasing order. x, 0, 0.1, 3/2 Let f(i) = -i + 0i + 6i2 - 9i*2 + 2 + 4i*2. Let b be f(0). Let y be 4b/40-1. Put -2/17, -5/6, y in descending order. -2/17, y, -5/6 Let u be 4/(-22) + (-861)/(-924). Put 5, -0.4, u, 4 in decreasing order. 5, 4, u, -0.4 Let r = 0.1 + -0.5. Let j = 7205/75873 - -1/3613. Put -0.2, j, r in increasing order. r, -0.2, j Let r = -208 - -213. Put -3.5, -2/5, 2/3, r in descending order. r, 2/3, -2/5, -3.5 Suppose 5y = -v + 24 - 1, 0 = 4v + 2y - 2. Let d be 4/22 - (v - -7 - 5). Sort 1/4, d, 2/9, -0.4 in ascending order. -0.4, d, 2/9, 1/4 Let k = 7 - 5. Let d = 1256 + -1230. Put k, d, -5 in ascending order. -5, k, d Let f be 0 + (2 - 18/12)64. Sort 10, 0, f. 0, 10, f Suppose 4r = -3r - 1008. Let l be (28/r)/7-2. Sort -2/23, l, 5 in descending order. 5, l, -2/23 Suppose -2m = -4p + 26, 5p = -2m + 13 - 3. Suppose a = 4a - 6. Let l(r) = -r2 + 6r - 2. Let g be l(6). Sort g, a, p. g, a, p Suppose 12s - 9s - 105 = 0. Suppose 4o = 3f + s, 3 - 18 = 3f. Suppose ou + 9 = -5w - 11, w = u + 6. Sort -3, -1, u in ascending order. u, -3, -1 Let u be 5 - (5 - 24/(-6)). Sort u, -56, 4, -1 in increasing order. -56, u, -1, 4 Let q = 241 + -240.8. Sort 6, q, 4. q, 4, 6 Let d = -105 + 108. Let f(l) = l3 - 2l*2 - 3l + 1. Let w be f(d). Let j = -15 - -10. Sort j, 0, w in ascending order. j, 0, w Suppose -2j - 4 = -2u, -4 = 5u - 9u. Let f = 0.59 + -0.29. Put f, j, 2 in decreasing order. 2, f, j Let a = -359 - -362. Sort 3/4, a, -1, 14. -1, 3/4, a, 14 Let q(p) = p*3 + 5p2 - p + 3. Let a be q(-5). Let m(w) = w2 - 9w + 7. Let i be m(a). Let v be ((1 + -2)/i)/1. Put 5, v, -4 in descending order. 5, v, -4 Let p(k) = -k3 - 4k*2 - 2k - 3. Let z be p(-4). Let b = -20 - -26. Let v(i) = -i*2 + 7i - 6. Let d be v(b). Sort z, d, 2 in increasing order. d, 2, z Let j = -1/639 + -1915/1278. Sort j, 9, -2/7. j, -2/7, 9 Let k = -217 - -216.5. Let o be (-12)/16(-54)/1. Let b = -39 + o. Put 1, b, k in increasing order. k, 1, b Suppose -66 = -a + 34a. Suppose 0 = -4s - 0s - 12. Sort s, -5, a, 4 in descending order. 4, a, s, -5 Let j(k) = -k*2 - 5k + 2. Let u be j(-6). Let x(p) = 2p2 + 106p - 104. Let b be x(-54). Sort 2, -3, b, u in ascending order. u, -3, 2, b Let l = 2144 + -2143. Suppose 0 = -3n - 4b + 19 - 3, -17 = -3n - 5b. Sort 0.5, l, n in decreasing order. n, l, 0.5 Suppose 153l - 154l + 1 = 0. Put l, 4, -5, -9 in increasing order. -9, -5, l, 4 Suppose 3s = 5o + s - 22, -3o + 2s + 14 = 0. Suppose u = -2u - 24. Let t(z) = z2 + 9z + 9. Let d be t(u). Sort -1, d, o. -1, d, o Let u = -2967 + 50415/17. Let g be 10/(18(-51)/150). Let n = g - u. Sort 5/3, n, 3 in descending order. 3, 5/3, n Let i = -184 + 284. Let v = i - 58. Let o be ((-36)/v)/((-2)/(-14)). Sort 1, o, 3 in descending order. 3, 1, o Let j be (16 + -28)31/2. Put -1, 0, j in decreasing order. 0, -1, j Suppose -u - 2u + 9 = 0. Let x = u - 4. Suppose 0 = v + 5g + 30, 4v - 3g = g. Put v, 2, x in increasing order. v, x, 2 Let i = -5/7 - -37/42. Let k = -2.33 - -2.5. Let h = 0.17 - k. Sort h, -2, i in ascending order. -2, h, i Let n = -1.01 - -0.31. Sort 4, 0, n, 17 in decreasing order. 17, 4, 0, n Suppose 0 = 2o - 15 - 5. Let c be -3 + -2 + 2 + (14 - o). Let b(v) = 2v3 + v2. Let u be b(1). Sort -5, c, u. -5, c, u Let y = 164 + -168. Let a = 10 - 7. Sort a, 2, y in increasing order. y, 2, a Let k = -4 - -15. Let f(d) be the first derivative of d*3/3 - 5d*2 - 13d + 15. Let c be f(k). Sort -1, c, 2 in decreasing order. 2, -1, c Let m = 1.828 - -0.062. Let o = 1.49 - m. Sort o, -5, 0, 8 in descending order. 8, 0, o, -5 Let k(m) be the third derivative of -m*5/60 - 5m*4/12 - 23m*3/6 - 5m*2 - 2. Let v be k(-7). Sort -1, v, 4. v, -1, 4 Let p = -12.9 + 13. Let x = p + 3.9. Sort -4/7, x, 2/3. -4/7, 2/3, x Let p(x) = -3x + 105. Let c be p(40). Put 1, 2, -2, c in descending order. 2, 1, -2, c Let u be (-185)/(-35) + (-6)/21. Let p be -1 - (-87)/12 - u. Put -4, p, 1 in increasing order. -4, 1, p Suppose -7y = -4y - 300. Suppose -5s - y = -60. Sort 5, -4, -3, s in decreasing order. 5, -3, -4, s Let a be -3 + (-3 - (2 + -11)). Suppose 5o + 5 = b, -b + 0o = ao + 11. Put -4, -2, b in descending order. -2, -4, b Let o = 1.419 + -0.419. Sort -0.08, -2/5, o. -2/5, -0.08, o Suppose 6 = -0b - 3b, -3b - 3 = 3x. Put -5, x, -38 in increasing order. -38, -5, x Let i = 5.72 - 0.02. Let j = i + 3.3. Put 4, 1, 0.4, j in decreasing order. j, 4, 1, 0.4 Let j = 194 + -193.5. Sort -3, j, -2/17, 0. -3, -2/17, 0, j Let r = 368 + -369. Sort 7, 2/17, r in descending order. 7, 2/17, r Suppose r - 33 = 5f - 12, -3f - 2r = 10. Let g be (-2)/(-2)(-8 - f). Put -67, 1, g in increasing order. -67, g, 1 Suppose 2a + t = -0a, -5a + t = -14. Suppose 0 = -3q + as - 7s + 53, s = -q + 15. Let h = -10 - -10. Sort 1, h, q. h, 1, q Suppose 0 = 3c - 3x - 9, 0 = 3c + 3x + 2x - 49. Suppose 4s = -15*s - 19. Sort c, 5, -5, s in decreasing order. c, 5, s, -5 Let m = -354 + 349. Sort m, 47, 0 in decreasing order. 47, 0, m Let x = -237 - -248. Put 3, 4, x, -4 in descending order. x, 4, 3, -4 Let b = 1.01 + -0.91. Sort -14/5, -2, b in decreasing order. b, -2, -14/5 Let w = 779 - 774. Sort w, -1/63, -3 in decreasing order. w, -1/63, -3 Let a = 5 - 9. Let u = 44/435 - 1/29. Let v = 2/5 - u. Sort a, v, 4 in increasing order. a, v, 4 Let h be 5/6 + (-25)/(-30). Sort 0.1, h, -2/5, -22. -22, -2/5, 0.1,	{ "pile_set_name": "DM Mathematics" }
*2 - 21t*2 + 4t*2 + 7t2. t2 Collect the terms in 10k - 1 + 2 - 1. 10k Collect the terms in 7v + 7v + 4 + 7v. 21v + 4 Collect the terms in 11 - 11 + 38n. 38n Collect the terms in -6k + 6k - 21k2 + 23k*2. 2k*2 Collect the terms in -91p*3 + 3p - 3p + 81p*3. -10p*3 Collect the terms in -81r + 166r - 85r + 2r3 + 5r*3. 7r*3 Collect the terms in -207 + 2t + 207. 2t Collect the terms in -2a*2 + 6a*2 + 1 - 6. 4a*2 - 5 Collect the terms in -9i*3 + 9i*3 + 14i*3. 14i*3 Collect the terms in 0p*3 + 1 - 8p*3 - 1. -8p*3 Collect the terms in 18h - 11h + 8h + 20h. 35h Collect the terms in -159c - 19c*2 + 320c - 161c. -19c*2 Collect the terms in -35p - 63p + 25p - 71p. -144p Collect the terms in -9a3 + 2201a - 2201a. -9a*3 Collect the terms in 16 - 13 - 9v*2 + 7v*2. -2v*2 + 3 Collect the terms in -11q - q - 3q. -15q Collect the terms in -4 - 20d - 1 + 3 - 68d. -88d - 2 Collect the terms in -336u*2 + 1 - 1 + 174u*2 + 166u*2. 4u*2 Collect the terms in 40v*2 - 45v*2 + 9v*2. 4v*2 Collect the terms in -36 - l + 3l - 33 + 69. 2l Collect the terms in -13r + 15r + r. 3r Collect the terms in 60i3 + 65i*3 - 194i*3 + 67i*3. -2i*3 Collect the terms in 56c*2 - 2c + 20c2 + 5c. 76c2 + 3c Collect the terms in 3y3 + 9y*3 - 21y*3. -9y*3 Collect the terms in -316 + 6n*2 + 153 + 163. 6n*2 Collect the terms in -14p - 2p2 + 27p - 23p. -2p*2 - 10p Collect the terms in -2908 + 2w + 2908. 2w Collect the terms in 16k + 12k - 4k2 - 28k. -4k2 Collect the terms in 7 - 72i - 7. -72i Collect the terms in 1051m*3 + 1080m*3 - 2129m*3. 2m*3 Collect the terms in 592i - 1205i + 609i. -4i Collect the terms in -3 - 57u*3 + 1 + 2 + 59u*3. 2u*3 Collect the terms in -1 - 3 + 4 + 22j. 22j Collect the terms in 1386 - 27a - 1386. -27a Collect the terms in -70s*2 + 113s*2 - 56s*2. -13s2 Collect the terms in -n2 - 9n + 9n. -n2 Collect the terms in 2878 + z3 - 2878. z*3 Collect the terms in 51i*2 - 53i*2 - 7i*2. -9i*2 Collect the terms in 45d*2 - 18d*2 - 25d*2. 2d*2 Collect the terms in 2a*3 + 12 - 9a*3 + 6a3. -a3 + 12 Collect the terms in -32n + 5n + 27n + 2n3 + n3. 3n3 Collect the terms in 16r + 9r + 20r - 18r. 27r Collect the terms in 54j2 + 2j*3 - 113j*2 + 59j*2. 2j*3 Collect the terms in -g - 4g + g + g. -3g Collect the terms in 76k - 152k - 12k*2 + 76k. -12k2 Collect the terms in -8l3 - l3 - 7l3. -16l*3 Collect the terms in 3m - 5m + 2m - m. -m Collect the terms in -c + c - 387c3. -387c*3 Collect the terms in 26483o*3 - 13241o*3 - 13240o*3. 2o*3 Collect the terms in 48 - 21 - 34s*3 - 23. -34s*3 + 4 Collect the terms in 4 - 11r + 9 - 13. -11r Collect the terms in -5v + 5v - 4v*2 + 1 - 9v*2. -13v*2 + 1 Collect the terms in -4 + 234b - 237b + 2 + 2. -3b Collect the terms in -4 - 2672b3 + 4 + 2673b3. b3 Collect the terms in 2k + 0k + 2k - 8k. -4k Collect the terms in 27 - 65 - 9t + 31. -9t - 7 Collect the terms in -4r*2 - 9 + 4 - 2 + 7. -4r*2 Collect the terms in 2802a*2 - 249a*2 + 147a*2. 2700a*2 Collect the terms in -34o + 0o - 33o + 16o. -51o Collect the terms in -8j + 2j + 43j2 + 6j. 43j2 Collect the terms in -14u*2 + 16u*2 - 28u*2 - 17u*2. -43u*2 Collect the terms in -4g*3 + 0g + g*3 + 0g + 15. -3g3 + 15 Collect the terms in -39x*3 - 37x*3 - 40x*3 + 118x*3. 2x*3 Collect the terms in -11u*2 + 15u*2 + 42u*2. 46u*2 Collect the terms in -5 - 80y*2 + 79y2 + 5. -y2 Collect the terms in -21u + 13u - 59u - 33u. -100u Collect the terms in 53g*2 + 53g*2 - 203g*2 + 52g*2 + 50g*2. 5g*2 Collect the terms in 8g*2 - 5g*2 + 3g2 - g2. 5g2 Collect the terms in -4 + 2 - 59k*2 + 56k*2 + 2. -3k*2 Collect the terms in 52l*2 + 14l - 8l - 50l*2 + 28l. 2l2 + 34l Collect the terms in 13z2 + 13z - 9z - 4z. 13z2 Collect the terms in 13f - 7f + 10f - 2f. 14f Collect the terms in -341 + 18y2 + 341. 18y*2 Collect the terms in 43b*2 - 106b*2 + 37b*2. -26b*2 Collect the terms in 2f*2 + 540 - 540. 2f2 Collect the terms in -344 + 344 + h2. h*2 Collect the terms in 36257 - 36257 - 2j. -2j Collect the terms in -n + 524 - 524 - 2n*3 + n. -2n*3 Collect the terms in 6 - 6d*2 - 5 - 1. -6d*2 Collect the terms in -33f*2 - 2f*3 + 5f - f - f*2. -2f*3 - 34f*2 + 4f Collect the terms in -2o - o - 3o - 2o. -8o Collect the terms in 35u2 - 45u*2 + 11u2. u2 Collect the terms in 4l3 - 7l3 - l3. -4l3 Collect the terms in -2m + 40m2 - 31m*2 - 32m*2. -23m*2 - 2m Collect the terms in 89a2 - 62a*3 - 89a*2. -62a*3 Collect the terms in 11a + 118a2 - 117a*2 - 50a. a*2 - 39a Collect the terms in -20p + 50p - 28p. 2p Collect the terms in 2 - 1 + 10z2 + 1. 10z*2 + 2 Collect the terms in -1 + 0 + 25v*2 + 7v*2. 32v*2 - 1 Collect the terms in -2v + 6 + 2 - 8. -2v Collect the terms in 156185 - 156185 - 6i. -6i Collect the terms in 107m - 24 + 23 - 1. 107m - 2 Collect the terms in 1244s - 2491s + 1249s. 2s Collect the terms in 22z + 9z - 4z. 27z Collect the terms in -2235 + 6f*3 + 2235. 6f*3 Collect the terms in -1123 + g + 0g + 1123. g Collect the terms in 0 + 3p3 + 0 - 2p3. p3 Collect the terms in -3i - 2 + 4i + 4i + 2. 5i Collect the terms in 1795m3 - 3586m*3 - 2m + 1800m3 + 2m. 9m3 Collect the terms in 0w*2 + 0 + 60 - 6w*2. -6w*2 + 60 Collect the terms in -x - 6645x*2 + 6642x*2 + x. -3x*2 Collect the terms in 154q + 112q - 264q. 2q Collect the terms in 19 - 19 - 9f*3. -9f*3 Collect the terms in 23 - 9t*3 - 45 + 22. -9t*3 Collect the terms in -2l + 9l + 0l - 12l. -5l Collect the terms in -53x + 9x + 20x + 9x + 17x. 2x Collect the terms in 81v3 - 5v + 5v. 81v*3 Collect the terms in c - 4c*2 + 2c - 3c. -4c*2 Collect the terms in -2 + 2 - 39n + 42n. 3n Collect the terms in 8682 - 8682 - 5m. -5m Collect the terms in -415h3 + 9h*2 + 428h*3 - 9h*2. 13h*3 Collect the terms in -51 + 51 - 6x - 11x + 16x. -x Collect the terms in 24m2 - 22m*2 - 4m*2. -2m*2 Collect the terms in -35 + 65 - 30 - 30h*3. -30h3 Collect the terms in -j3 + 37j3 + 29j*3. 65j*3 Collect the terms in 0x*3 + 3x*3 + 37x - 37x. 3x*3 Collect the terms in -302l*2 + 594l*2 - 295l*2. -3l*2 Collect the terms in 13x*3 - 6x*3 - 1 - 14x*3 + 29x*3. 22x*3 - 1 Collect the terms in 212g*3 + 41g*2 - 23g*2 - 18g*2 - 211g3. g3 Collect the terms in 12m2 + 2m*2 + 5m*2 - 18m*2 + 3m*2. 4m*2 Collect the terms in -2h*2 + 5h*2 + 3h*2 - 4h*2. 2h2 Collect the terms in -613893 - p2 + 613893. -p*2 Collect the terms in -11s*2 - 3s2 + s2. -13s2 Collect the terms in -21l*3 + 40l*3 - 11l*3. 8l*3 Collect the terms in 66z*3 + 0 - 65z3 + 0. z3 Collect the terms in -13l2 + 13l*2 + 29l*3. 29l*3 Collect the terms in -21s*3 - 10s*3 - 4s*3 + 47s*3 - 11s3. s3 Collect the terms in 70a - 149a + 53a. -26a Collect the terms in -2104u2 + 2105u2 - u + u. u2 Collect the terms in -5 + 3 + 2 + 17g. 17g Collect the terms in -6t2 - 73t*2 - 53t*2 + 24t*2. -108t*2 Collect the terms in -n - 2n + 6n - 5n. -2n Collect the terms in d2 + 529 - 165 + 198. d2 + 562 Collect the terms in -427 + 427 + 2p. 2p Collect the terms in 2h*3 + 2h*3 - 821h + 821h. 4h*3 Collect the terms in -5b*3 - 8b*3 + 22b*3 - 4b*3. 5b*3 Collect the terms in 434c - 140c - 142c - 144c. 8c Collect the terms in -210 - 215 + w2 + 425. w2 Collect the terms in -5o2 + 17 - 8 + 10. -5o*2 + 19 Collect the terms in 8c*2 - 4c*3 - 5c*3 + 5c*3 + 2c*3. -2c*3 + 8c*2 Collect the terms in 12q*3 + 0q*3 - 10q*3 - 11q*3. -9q*3 Collect the terms in 13u + 12u + 24u - 50u. -u Collect the terms in 0t + 4t - 4t - 10t2. -10t*2 Collect the terms in -4r*2 + 2r*2 + 115698r - 115698r. -2r**2 Colle	{ "pile_set_name": "DM Mathematics" }
/2)/uu))/uu/u*(-1/12)u)31)(-29) assuming u is positive. u*(-13485/76) Simplify (((dd/d*10)/dddd*(1/16))/(dd*(2/13)ddd(-1/4)))(-10/7) assuming d is positive. d*(10235/728) Simplify ((t/(tt*(-26))tt(-2/5))/(((t17/t)/t)/(tt/t(9/4))))(-37) assuming t is positive. t*(-8399/20) Simplify (kk*9k9)(-9/4)/(((k/k(-1))/k(-1/2))/(k*(-1/5)/((kk*2/kk)/k))) assuming k is positive. k*(-949/20) Simplify ((mm*(-5/4))/((mm(4/3))/m))/(m0)*(2/25)(m*(1/3)m*(-1/4))/(((mmm(2/15))/mm)/mm/(mm/(((m0/m)/m)/m))) assuming m is positive. m(41/30) Simplify ((kk(-2)/k)(-16/7)/(k(1/13)/(kkk(-14))))(-26) assuming k is positive. k(1366/7) Simplify (j(1/3)/j(-2/7)j/(j/(j/(j*9/j)))j(((j/((j2j)/j))/j)/j)/j)(-1/17) assuming j is positive. j(197/357) Simplify (((q/(q/((q*(-2/3)/q)/q)))/qq)*(-2/45)/(qq*(3/2)qq/(qq10)))(-1/21) assuming q is positive. q*(-1787/5670) Simplify ((bbb(bb(-2/3))/b)45/(((bb(1/3))/b)/b1))/((bb(-1)b)*(-1/14)(b(-1)/b)(2/51)) assuming b is positive. b*(75553/714) Simplify (((c/(cc/(((cc(5/3))/ccc)/c)c)c)/(cc/(cc(-3))))/(c(-2/5)/c(2/13)))/((cc/c*(-2/3)c)(-18/7))26 assuming c is positive. c(332191/1365) Simplify (p16/(pp23)(p/(pp(2/9))p)36)(1/12) assuming p is positive. p(5/3) Simplify (x/(x/(x/((x(-2)x)/x)))x/(x(xxxx/(x/x*(-2/3)xx))/xx))*(2/63)(((x/(x/(x*(-2/5)x)))/x)(-18))25 assuming x is positive. x*(34036/189) Simplify ((uu/(uu/u(4/5)u)u)/(u(-5)/u)(u*(-2/5)uuu)23)/((u/u(2/5))/(u/(((u(-4)/u)/u)/u)))45 assuming u is positive. u(1998/5) Simplify ((z(-1/3)/z)*8z/z*(-5)z*(-2))/((((zz/(zz(2/7)))/z)/(zz(1/5)))/(z2(z/(zz/(z/(z*(-1)/z))zz))/z)) assuming z is positive. z(-439/105) Simplify (c(4/21)cc37((c(-18)/c)/c)(-1/20))(5/11) assuming c is positive. c(4115/231) Simplify (o(1/41)/((o/o(-43))/o))/(o*(-5/8)oo(-18)) assuming o is positive. o(-8315/328) Simplify (((u/u(-2/3))/u)7)(-5/13)u*2/(uu*4/u)(u(-2))(11/3) assuming u is positive. u(-434/39) Simplify (((c/(c(-2/9)cc))/(c(-1/3)/c))/(c(-3/10)/cc(-5)))/(((c(-1)c)/ccc)*(20/7)ccc*1cc(1/2)c) assuming c is positive. c(-473/315) Simplify ((u(-2))(1/16)/(u/(u/(u/u3)))(11/4))(-2/31) assuming u is positive. u(-43/124) Simplify (((i(-1/20)/i)/(i/(i/(ii/i25i))))/(i/(i/i*(2/49)i)i(-2/51)))(-7/3) assuming i is positive. i(-1096981/21420) Simplify ((l(-2))(-3/7))17(l*3l/(l5/l))/((l(-6)l)/(l/l(-4))) assuming l is positive. l(172/7) Simplify ((k3/kkkk(-5/6))/((k(-7)k)/(k/(k/k(-2/9)))))/((k(-1/3))42)(8/13) assuming k is positive. k(4109/234) Simplify ((ll/(l(l/(ll0))/l))(1/6)/(lll/l*(-3/2)ll(-1/2)ll))/((l/(l/l0))(-4/5))18 assuming l is positive. l(-20/3) Simplify ((z(-21)/z)(-50)/((zz*(-4)/z)/(zz*0zz)))49 assuming z is positive. z54243 Simplify (((m(-1/4)/m)/m)(-3/26)/(mm/m*(-5)m*(1/5)/mm))/((m/m(2/5))/(m1m))14 assuming m is positive. m(6583/520) Simplify (((l/(l1l))(-10/3))1)(1/6) assuming l is positive. l(5/9) Simplify (((o/(ooo/o*(1/2)o))*(-14)o*(-1/5)o(-5))(-38))(-7/5) assuming o is positive. o(39634/25) Simplify (((f/f4)/(f/(f(2/9)fff)))/((f/f(-1/7))/f(-6)))/(f(1/14)(ff(-5))/f)(1/32) assuming f is positive. f(-31315/4032) Simplify (w(-6)w*(-2/7)(ww(-8))/ww(2/5)/w)/(w10w(-1))(-43) assuming w is positive. w(13024/35) Simplify (u(-3)/(uu(-2)))/(u/(u/(u(1/3)/u)u))(2/141)(u*6u(-4/5))(-1/3) assuming u is positive. u(-7846/2115) Simplify ((((o2/oo)(-50))(-47))(1/17))(-1/15) assuming o is positive. o(-940/51) Simplify o(-2/11)o*5(o(-2/3)/o)45((o/(oo*(-5/3)oo)oo)/o)/(ooo(-6/5)/oo)oo(o/((oo*6)/o)o)/oo(o(2/5)/o)/o assuming o is positive. o(-12196/165) Simplify ((q(4/5)/q1(q(1/3))(2/21))(-20))(-8) assuming q is positive. q(-1696/63) Simplify ((t(-20)/t)/t(11/5)tt/(t/(t(-1/9)t))ttt/(tt/(t/((t/(((ttt*(-5))/tt)/t))/ttt))))(-5/9) assuming t is positive. t(1139/81) Simplify ((f/((f/(ff9))/f)f)/ff(1/15)f(f(-2/3))(-27/4))/(f/(f/(f/((f14/f)/ff)))f(2/3))(-24) assuming f is positive. f(-7663/30) Simplify (((j/(j/(j(j*(1/3)/j)/j)))/j)/jj*(3/17)(j*3/jj)(-2/5))26 assuming j is positive. j(-24466/255) Simplify ((p/p(2/7)pp)4)(-8/9)(p1)(-12)(p/(pp(-1))p)/(pp/(p/p5)) assuming p is positive. p(-1616/63) Simplify (d(d/(d/(d(dd(-2/3))/d)))/d)43/(d3/d(-4))((d5dd)/(d/d(-1)))/((d/(d(2/3)/ddd))/(dd2)) assuming d is positive. d16 Simplify ((j*13j*(-2/39))/(jjjj/(jj(j/j*(-4))/j)j/j10))22 assuming j is positive. j(20548/39) Simplify (b(2/31)b/((b(-8)/b)/b)b((bb/(b6/b))/b)(-2/13))39 assuming b is positive. b(15330/31) Simplify (((k/(kkk1/k))/k)/k)33(k(-6)/kkk)/kkk/(k/(kk*(-2/23)k))(k(k/k*3)/kkkk4/k)/(k(1/4))(-33/5) assuming k is positive. k(-44821/460) Simplify ((y/y(-1/2))(-4/31))10/((y3)(-3/16))(-47) assuming y is positive. y*(-14073/496) Simplify (((rrr9)/r)15/((r(8/7)/r)/(r/r(-22))))(-11) assuming r is positive. r(-13310/7) Simplify (i(-1/3))2i*(-3/2)/(ii*(-5))(i*(-3/8)/(ii/i(4/7)))/(i(-2/3))(-2/37) assuming i is positive. i(-13/2072) Simplify (r*(-2/7)rr/(r3/rrr))(-18)((r/r*(-2/11))/(rr5))(2/17) assuming r is positive. r*(53114/1309) Simplify ((dd(-2/7))(1/19)/(d*(3/4)ddd*7dd))/((d(d*(1/5)d)/d)*(-2)(ddd/d*(-2/5)d)23) assuming d is positive. d(-293963/2660) Simplify ((u/(u*(1/7)/uu))/u*(-3)u*(-5)uuu*(-4/5)u)/(u*(-2/7)u/u*(-5)(u(-1/4))28) assuming u is positive. u(82/35) Simplify (u(-6)u(-5))(-1/51)((uuu/(uuu(-8)))/u(-3/7))(-3/2) assuming u is positive. u(-4972/357) Simplify (((c*(1/2)c)/c)(6/13)/((c(-2/29)c)/c(-3/2)))/((c2)(-2/5)c*(1/3)/(c/(cc1))) assuming c is positive. c(-30917/11310) Simplify ((n/(n*(5/4)/n))/(n(n/n0)/n))/(n(1/2)/n*5)(((n*(1/3)nn)/n)/n0)/(n(1/3))21 assuming n is positive. n(-17/12) Simplify ((j/j7)/(jjjj*(-2/7)j))/(j*(-2/9)/(jj*(-7)jj))((j*4/j)/(jjj(-3/2)j))/(j*6/jj/(jj(-7)/jjj)j) assuming j is positive. j(-3023/126) Simplify (a6/(a/a(-10)))(1/8)/((((a/((a*(-1/5)a)/a)aa)/aaa)/a)*22(a*(-1/12)a)/a(-6)) assuming a is positive. a(-9353/120) Simplify (ss(-2/5)s(ss*2)/sss(-2/17)s(2/9))/(s(-2/5)/((s*(-1)s)/ss))(1/11) assuming s is positive. s(7979/1683) Simplify (q(-8)/((q(-3/5)/qq)/q))*36((q(q(-1/2)qq)/qq)/qqq*(-2/3)q)30 assuming q is positive. q(-727/5) Simplify ((g*(-19)g*(-3/8))/((gg*27gg)/(g/((g(-5)g)/g))))4 assuming g is positive. g(-347/2) Simplify (((g*(-1/19)/g)/g)/(gg*(-18/13)/g)ggg/(g/g*(-7))g*(1/6)g)19 assuming g is positive. g(-6671/78) Simplify (s(-22))(-16/9)ss/((s/s*(2/5))/s)s(2/51)/s assuming s is positive. s(31021/765) Simplify (l*(14/5)ll(-4/5)ll(1/22)l(-6)/l)(-19) assuming l is positive. l*(1235/22) Simplify (rr(2/3))/r(-5)(r/(rr*(-1/2)))/rrr(-5)/r(r*(-6/11)rr(-11))(-22) assuming r is positive. r(1399/6) Simplify (w(-6)/w(-1))/(w0www*(-3)w)(((w/((w(2/7)/w)/w))/w)/(ww/w(1/3)))/(w(2/5)/w)(4/9) assuming w is positive. w(-164/35) Simplify (n*4n)/n*1((n(-1/4)/n)/n)/n3(n(2/9)n(1/4))/((n(-1)/n)/n)31 assuming n is positive. n(830/9) Simplify (((a/a(-3))/(a/a(1/3)))/(a4)(-14/13))(-14/5) assuming a is positive. a(-4172/195) Simplify ((d/(dd/(dd(-1))))(-20)(d/d(-1/2))(-13/3))/(((d(-1/2)d)/d)(1/19))(-1/19) assuming d is positive. d(4873/361) Simplify (g/g(-1))(8/11)/(g(-1))*(35/2)((gg5)/g7)/(g/(g/(g/((g2/g)/g)))g*(-5)g) assuming g is positive. g*(461/22) Simplify (((aa/a*0)/a)/aa)*26(a(a/(a/(aa(-1/10))))/a)/a5a(3/7)a*(-1)(a/(a*(2/15)a)aa)/(a**(1/5)	{ "pile_set_name": "DM Mathematics" }
= 3.79 - -0.21. Let f = -51 + 56. What is the closest to 1 in x, f, 1? 1 Let s = 0.466 + 0.034. What is the closest to 0.5 in 0.1, 2, s? s Let r be (-22)/(-77) - 74/14. Let t = 0 + 0. Let b = 19.5 - 19.6. What is the closest to t in b, -0.5, r? b Let q = 143 - 569/4. Let y = 0.3 - 0.5. What is the nearest to y in 4, -2/13, q? -2/13 Let v = -1792 - -1791.8. Let x be ((-1)/7)/((-6)/(-7)). Which is the closest to v? (a) x (b) 4 (c) 0 a Let l = 0.5 + 1.5. Let h = 1.36 + -0.96. Suppose -j - 2z + 5 = -z, -z = 3j - 11. Which is the closest to l? (a) j (b) 1/3 (c) h a Let f be 8/6 - (-280)/132. Let l = f + -288/77. Which is the closest to 0.1? (a) 1/2 (b) l (c) -0.1 c Let j be (-1)/5 - 0/(-1). Let i = 0.0822 - -0.1178. What is the nearest to 0.4 in 4, i, j? i Let i = -0.52 + -3.48. Which is the nearest to -1? (a) 2/21 (b) i (c) 0.2 a Let r be (-120)/(-16)(-1)/6. Suppose 0 = -4s + 2 + 2. Which is the nearest to s? (a) -2 (b) 2/7 (c) r b Let o = 4.53 - 4.54. Let v = 8 - 7.9. Which is the closest to o? (a) 0.4 (b) -0.5 (c) v c Let u = 2.1 + -2. Let y(q) = -q*3 - 8q*2 - 8q - 1. Let o be y(-7). Let b be (-85)/136(o/(-5))/3. What is the closest to 2 in 1/12, u, b? b Let a = -258 + 245. What is the nearest to -4 in 4, 2, a? 2 Let v = 68.6 + -65.6. Let g = -4.93 + -0.07. Let y = g + 4.7. Which is the nearest to 1? (a) y (b) v (c) -4 a Let d = 1.8 + -3. Let z = d + 1.9. Let f = z - 0.9. What is the nearest to f in -0.3, 1/2, 1? -0.3 Let r = 1715 + -1711. Suppose 5u + 10 = -0. Which is the closest to r? (a) 0.4 (b) u (c) 3 c Let h = -0.5 + 0. Let l = -0.2 + 0.7. Suppose -8u + 4m - 16 = 0, 0 = 4u + m + 2m - 22. What is the closest to -1 in h, l, u? h Let q = -87303/188 - -1857/4. Let n = -124/235 - q. Which is the closest to -2/3? (a) n (b) 3 (c) 5/3 a Let n = 1367 - 1367. Which is the nearest to -16? (a) -2 (b) n (c) -1/3 (d) 1 a Let k = -43.7 - -44.2. Which is the nearest to 1/25? (a) k (b) 0.2 (c) -5 b Let t = 59 - 64. Let x = 9.3 + -9. Which is the nearest to -1? (a) t (b) -2/17 (c) x b Let z be -412/(480/50). What is the closest to -1/4 in 35, 0.05, z? 0.05 Let b be (-2)/(-8) - 0/(-2). Let r = 384/13 + -5552/195. Let t = r - 7/5. What is the nearest to t in b, 1, -3/7? -3/7 Let h = 0.117 + -0.317. Which is the closest to 1? (a) -136 (b) h (c) -4 (d) 1/6 d Let v = -217.4 + 179. Let g = -38 - v. What is the nearest to -2 in g, 0.1, 6/7? 0.1 Let k = 0.05 + 0.15. Let g be (-10)/40(-8)/9 + 0. Let d(z) = -z*2 - 4z - 3. Let x be d(-2). Which is the closest to k? (a) x (b) 1/2 (c) g c Let r(u) = -2u3 + 54u*2 - 51u - 22. Let g be r(26). What is the nearest to -0.065 in -5, g, 2/9? 2/9 Let y = 1063 + -8505/8. Which is the closest to -1/2? (a) y (b) -10 (c) 5 (d) -5 a Let w = -16.4 - -20.4. What is the closest to 0.1 in -47, -1, w, 3? -1 Let i = -91 + 639/7. Let h = -3/7 + i. Which is the closest to 0.1? (a) -2/7 (b) h (c) 4 b Let z = 727 - 725. What is the nearest to z in 0.3, -0.03, 2/27? 0.3 Let i = -0.1 + 0.1. Suppose -6v + 2v = 8. Let d be v/(-44)(3 - 7). What is the closest to i in 0, d, 2/5? 0 Suppose -1 - 2 = -3n. Suppose 6p - 3p = 51. Suppose 5r - 5 = 4d - 18, r + p = -4d. Which is the closest to 1? (a) n (b) 1/3 (c) d a Let h = -34 + 69/2. Let w = 26.32 + -26. Let r = -0.22 + w. What is the closest to h in r, 5, 3? r Let z = -3.958 + -0.042. What is the closest to -0.2 in z, 3, -2? -2 Let t = 56.5 + -57. Let w = 46 - 45. Which is the nearest to -1/2? (a) t (b) 0.04 (c) w a Let n be 0((-130)/16 + 8). Which is the closest to -0.2? (a) 21 (b) -8 (c) n c Let c = 6 + -6.4. Let v = 290 + -1149/4. Let s = v - 23/8. What is the closest to -2 in 3/8, c, s? c Let l = 3.1 - 0.1. Let v be (1 - 7)(-9)/(-6). Let c(z) = -z - 7. Let j be c(v). What is the closest to 0 in j, 1, l? 1 Let s(f) = f3 + f - 5f*2 + 6 - 6 - 7f. Let q be s(6). Suppose 0 = -5i - 10 - 0. Which is the closest to -2? (a) q (b) i (c) 3/8 b Let o be (7/7)/((-6)/(-24)) + -8. Let w = -0.41 + 0.01. Which is the closest to 0.1? (a) 19 (b) o (c) w c Let t = 5/11 - 43/22. Let d = 498 + -500. What is the nearest to -6 in d, 0.3, t? d Let f = -409 + 412. Which is the closest to -0.8? (a) f (b) 1/7 (c) -2 b Let y = -0.1451 - 0.0549. What is the closest to y in 2, 1/10, 0.5? 1/10 Let d = -3.5 - -3. Let x = -7 + 27. Let t = 21 - x. Which is the closest to -4? (a) t (b) -2 (c) d b Suppose 120 = 8u - 2u. Let p = -21 + u. Let f be 2/(-1 - 57/(-9)). Which is the closest to 2/7? (a) p (b) 0 (c) f c Suppose 5q - 10 = 5d, 3q + d = -0q + 14. Let h be 255/(-75) + 4/10. Suppose p = 4x + 22, -6p + 5p = 2x + 8. What is the closest to -2 in h, p, q? h Let g = 1748 + -1747.94. What is the closest to 2 in g, -0.3, -0.5, 4/3? 4/3 Let p = -0.409 - -0.109. Let g = 1 - 0. Let j = 161.9 - 162. Which is the closest to j? (a) p (b) g (c) -2/7 c Let f be (-4)/4 + (3 - 4) + 3. Let d be f - 1/4 - (-145)/(-140). Let q = 529/9 - 59. Which is the nearest to d? (a) -5 (b) 0.3 (c) q c Let a = -159 + 159. What is the closest to a in 0.5, 3, 2/47? 2/47 Let n = -16 + 18. Let g be (-14 + 12)2/12. Which is the closest to -1/4? (a) n (b) g (c) -5/6 b Let z = 11 + -12.6. Let x = -1.1 - z. Let h be 4/(-14) - (-68)/140. What is the nearest to 0 in 5, h, x? h Let u = -0.07 - 3.93. Let v = -0.46 + 0.36. Which is the closest to -0.1? (a) v (b) u (c) 3 a Let z be (17/((-510)/36))/((-22)/11). What is the nearest to -10 in -0.3, -3, z, 2? -3 Let j = 0 - 1. Let y = -1 - j. Let q(r) = -r*3 - 15r*2 + 40r + 99. Let o be q(-17). What is the closest to y in o, -2, 2/11? 2/11 Suppose -48m + 41m = 21. What is the nearest to 0.03 in -4, m, -0.2? -0.2 Let c = -19.8 + 17. Let y = -2.9 - c. What is the closest to -0.1 in 0.1, y, -1/5? y Let b = 0.965 - 0.765. What is the nearest to 2 in 2/9, 11, 1/8, b? 2/9 Let i = -2 + 3/2. Suppose -3y - 7 - 19 = 4x, -x - 11 = 3y. Suppose 0 = 9m - 0m + 36. What is the closest to 1/2 in y, m, i? i Let q(w) = -2w*3 + 6w*2 - 6w - 1. Let k be q(2). Which is the nearest to 2/3? (a) -0.01 (b) k (c) -0.6 a Let s = 4201/13 - 323. Let z = 124.5 - 124. What is the closest to -1 in 0.2, s, z? s Let a(n) = -27 + 34n - 9n - 18n - 9n. Let z be a(-15). What is the closest to 1/2 in 1.1, z, -2/5? 1.1 Let t = 113 - 112.87. Which is the nearest to -0.2? (a) t (b) -0.3 (c) -1 b Let i = -36 + 19.5. Let x = -17 - i. Which is the nearest to 2/9? (a) -0.2 (b) -3 (c) x a Let d = 4.02 + -3.62. Let s = -4.8 - -0.8. Which is the nearest to 3/7? (a) 0.2 (b) s (c) d c Let g = 94/37 - 3/74. Let d = 4 - 5. Let s = -1.3 - d. Which is the nearest to 0? (a) -1 (b) g (c) s c Let g be -19 + 930/21 - 25. Suppose 17 = 2i + 7. Let d be -11 + (3 - 1). Which is the nearest to d? (a) -1/2 (b) i (c) g c Let l(x) = -x*3 - 6x*2 + 7x + 3. Let a be l(-7). Suppose i + i = -5o + 7, 6 = i + 5o. Let r = -10 + 14. What is the closest to i in a, -0.1, r? -0.1 Let i = 0.011 - 0.281. Let c = i - -1.27. What is the nearest to 6 in -3, c, 4? 4 Let u = -5 - -1. Let q = -4 + -9. Let m = -13 - q. Which is the nearest to -0.2? (a) 3 (b) u (c) m c Let h = -102 - -93.6. Let i = h + 8. Let j = 8 - 12. What is the closest to -1 in j, i, -2/3? -2/3 Suppose 2l + 8 = -4x, -4x = 9 + 3. Suppose 0 = -5m + 3g - 14, l = -3g - 4. Which is the nearest to 9? (a) -0.4 (b) m (c) 5/2 c Let i = 0.4 + 0.6. Let d = 101 - 97. Which is the nearest to i? (a) 3 (b) -0.2 (c) d b Let f = -7.97 + -0.13. Let w = f - -8. Let u(q) = -q*2 - 4q + 12. Let p be u(-6). Which is the nearest to w? (a) p (b) 1 (c) 1/2 a Let r = 3 + 2. Suppose 5m + 0p + 3p = -43, -2 = 2p. Let s be (-6)/2114/m. What is the nearest to 1 in -2/11, s, r? s Let b = -18 - -17.1. Let i = -16.3 + 14.2. Let m = i + b. What is the closest to 2/3 in -4, m, 3? 3 Let u be ((-20)/27-3)/((-6)/(-27)). What is the nearest to 0.1 in -4, -0.5, u? -0.5 Let f = -1/46 + 101/414. Let z = -167 - -170. What is the nearest to z in f, -5, -2? f Suppose -7q = -0 - 28. Let p = -0.06 - 1.94. Let b = 2.82 - -0.18. What is the nearest to p in b, q, -3? -3 Suppose -15 = -3b + 2b - 4g, 0 = -3b + 4g - 3. Let s be (-1)/b - (-810)/(-42). Let c = 58/3 + s. What is the clo	{ "pile_set_name": "DM Mathematics" }
tors of 18314? 2, 9157 List the prime factors of 23075. 5, 13, 71 List the prime factors of 699. 3, 233 List the prime factors of 1628. 2, 11, 37 List the prime factors of 15138. 2, 3, 29 List the prime factors of 25623. 3, 13, 73 List the prime factors of 463. 463 What are the prime factors of 1784? 2, 223 What are the prime factors of 4520? 2, 5, 113 List the prime factors of 1371. 3, 457 What are the prime factors of 1706? 2, 853 What are the prime factors of 12924? 2, 3, 359 What are the prime factors of 23696? 2, 1481 List the prime factors of 42665. 5, 7, 23, 53 List the prime factors of 79609. 79609 List the prime factors of 70295. 5, 17, 827 List the prime factors of 366. 2, 3, 61 What are the prime factors of 9965? 5, 1993 List the prime factors of 3058. 2, 11, 139 What are the prime factors of 1120? 2, 5, 7 List the prime factors of 3111. 3, 17, 61 What are the prime factors of 142520? 2, 5, 7, 509 What are the prime factors of 3443? 11, 313 List the prime factors of 17275. 5, 691 What are the prime factors of 4704? 2, 3, 7 What are the prime factors of 48251? 7, 61, 113 List the prime factors of 12285. 3, 5, 7, 13 What are the prime factors of 519? 3, 173 List the prime factors of 806. 2, 13, 31 What are the prime factors of 3754? 2, 1877 What are the prime factors of 10433? 10433 List the prime factors of 482. 2, 241 List the prime factors of 50215. 5, 11, 83 List the prime factors of 3931. 3931 List the prime factors of 7555. 5, 1511 List the prime factors of 37832. 2, 4729 What are the prime factors of 3728? 2, 233 What are the prime factors of 1388? 2, 347 What are the prime factors of 624? 2, 3, 13 What are the prime factors of 24353? 7, 71 What are the prime factors of 70950? 2, 3, 5, 11, 43 What are the prime factors of 61481? 7, 8783 What are the prime factors of 33886? 2, 16943 What are the prime factors of 1646? 2, 823 What are the prime factors of 3827? 43, 89 What are the prime factors of 5381? 5381 What are the prime factors of 65312? 2, 13, 157 List the prime factors of 17938. 2, 8969 What are the prime factors of 8704? 2, 17 What are the prime factors of 46136? 2, 73, 79 What are the prime factors of 4939? 11, 449 What are the prime factors of 5486? 2, 13, 211 What are the prime factors of 65409? 3, 21803 List the prime factors of 13472. 2, 421 List the prime factors of 1089. 3, 11 List the prime factors of 3416. 2, 7, 61 What are the prime factors of 54308? 2, 13577 What are the prime factors of 975? 3, 5, 13 What are the prime factors of 5904? 2, 3, 41 List the prime factors of 670. 2, 5, 67 What are the prime factors of 9904? 2, 619 What are the prime factors of 1014? 2, 3, 13 What are the prime factors of 738? 2, 3, 41 What are the prime factors of 931? 7, 19 What are the prime factors of 13679? 13679 List the prime factors of 20627. 20627 What are the prime factors of 1672? 2, 11, 19 List the prime factors of 17603. 29, 607 List the prime factors of 1805. 5, 19 What are the prime factors of 184946? 2, 19, 31, 157 What are the prime factors of 80409? 3, 7, 547 List the prime factors of 1636. 2, 409 List the prime factors of 192915. 3, 5, 1429 What are the prime factors of 3446? 2, 1723 What are the prime factors of 1811? 1811 What are the prime factors of 8985? 3, 5, 599 List the prime factors of 54037. 54037 What are the prime factors of 52120? 2, 5, 1303 List the prime factors of 47. 47 What are the prime factors of 10335? 3, 5, 13, 53 What are the prime factors of 2121? 3, 7, 101 What are the prime factors of 14473? 41, 353 List the prime factors of 1152. 2, 3 What are the prime factors of 49870? 2, 5, 4987 What are the prime factors of 722? 2, 19 What are the prime factors of 59174? 2, 29587 What are the prime factors of 23369? 23369 What are the prime factors of 466? 2, 233 List the prime factors of 617. 617 What are the prime factors of 1244? 2, 311 List the prime factors of 28614. 2, 3, 19, 251 What are the prime factors of 133394? 2, 66697 What are the prime factors of 2197? 13 What are the prime factors of 5535? 3, 5, 41 List the prime factors of 16553. 16553 List the prime factors of 109210. 2, 5, 67, 163 What are the prime factors of 30246? 2, 3, 71 List the prime factors of 29965. 5, 13, 461 List the prime factors of 1330. 2, 5, 7, 19 What are the prime factors of 8? 2 What are the prime factors of 37341? 3, 461 List the prime factors of 105076. 2, 109, 241 What are the prime factors of 8895? 3, 5, 593 What are the prime factors of 816? 2, 3, 17 What are the prime factors of 18700? 2, 5, 11, 17 What are the prime factors of 2113? 2113 List the prime factors of 2343. 3, 11, 71 List the prime factors of 25262. 2, 17, 743 List the prime factors of 52114. 2, 71, 367 List the prime factors of 1820. 2, 5, 7, 13 List the prime factors of 455. 5, 7, 13 What are the prime factors of 149729? 149729 List the prime factors of 557. 557 List the prime factors of 1571. 1571 What are the prime factors of 47601? 3, 41, 43 List the prime factors of 1138. 2, 569 What are the prime factors of 2400? 2, 3, 5 List the prime factors of 37843. 13, 41, 71 List the prime factors of 290. 2, 5, 29 What are the prime factors of 933? 3, 311 What are the prime factors of 20417? 17, 1201 What are the prime factors of 5322? 2, 3, 887 List the prime factors of 11368. 2, 7, 29 What are the prime factors of 29631? 3, 7, 17, 83 List the prime factors of 22155. 3, 5, 7, 211 List the prime factors of 10970. 2, 5, 1097 What are the prime factors of 14550? 2, 3, 5, 97 What are the prime factors of 5642? 2, 7, 13, 31 List the prime factors of 22151. 17, 1303 What are the prime factors of 16163? 7, 2309 What are the prime factors of 56445? 3, 5, 53, 71 List the prime factors of 44488. 2, 67, 83 What are the prime factors of 2927? 2927 What are the prime factors of 32? 2 What are the prime factors of 434? 2, 7, 31 What are the prime factors of 15543? 3, 11, 157 List the prime factors of 20722. 2, 13, 797 What are the prime factors of 1067? 11, 97 List the prime factors of 144. 2, 3 List the prime factors of 47514. 2, 3, 7919 List the prime factors of 2673. 3, 11 List the prime factors of 7138. 2, 43, 83 What are the prime factors of 65204? 2, 16301 What are the prime factors of 3690? 2, 3, 5, 41 List the prime factors of 14765. 5, 2953 List the prime factors of 33503. 33503 What are the prime factors of 819? 3, 7, 13 What are the prime factors of 8073? 3, 13, 23 What are the prime factors of 100808? 2, 12601 List the prime factors of 145. 5, 29 List the prime factors of 2599. 23, 113 List the prime factors of 40247. 167, 241 List the prime factors of 618. 2, 3, 103 List the prime factors of 9060. 2, 3, 5, 151 List the prime factors of 92339. 13, 7103 List the prime factors of 22241. 23, 967 List the prime factors of 2765. 5, 7, 79 List the prime factors of 342. 2, 3, 19 List the prime factors of 290. 2, 5, 29 What are the prime factors of 8883? 3, 7, 47 List the prime factors of 1434. 2, 3, 239 List the prime factors of 1531. 1531 What are the prime factors of 90? 2, 3, 5 What are the prime factors of 1311? 3, 19, 23 List the prime factors of 43425. 3, 5, 193 What are the prime factors of 856? 2, 107 What are the prime factors of 8030? 2, 5, 11, 73 List the prime factors of 4933. 4933 List the prime factors of 968. 2, 11 What are the prime factors of 7757? 7757 What are the prime factors of 1000? 2, 5 List the prime factors of 130576. 2, 8161 What are the prime factors of 15530? 2, 5, 1553 What are the prime factors of 646? 2, 17, 19 What are the prime factors of 802? 2, 401 List the prime factors of 20207. 11, 167 What are the prime factors of 24301? 19, 1279 List the prime factors of 6355. 5, 31, 41 What are the prime factors of 5670? 2, 3, 5, 7 List the prime factors of 37909. 167, 227 List the prime factors of 1033. 1033 What are the prime factors of 1565? 5, 313 What are the prime factors of 4458? 2, 3, 743 What are the prime factors of 1605? 3, 5, 107 What are the prime factors of 13373? 43, 311 What are the prime factors of 25592? 2, 7, 457 List the prime factors of 1726. 2, 863 List the prime factors of 6867. 3, 7, 109 What are the prime factors of 64418? 2, 31, 1039 What are the prime factors of 15219? 3, 19, 89 List the prime facto	{ "pile_set_name": "DM Mathematics" }
2 + 929u + 19856. -(u - 34)(u + 16)(u + 73)/2 Factor w2/7 - 5500w/7 + 5499/7. (w - 5499)(w - 1)/7 Factor -z2/6 + 218623z - 143388048387/2. -(z - 655869)*2/6 Let -4l*3 - 1688l*2 + 6804l - 5112 = 0. Calculate l. -426, 1, 3 Solve -12c2 - 5625c - 4212 = 0. -468, -3/4 Determine d so that 2d3/7 + 64d*2 - 2742d/7 + 4140/7 = 0. -230, 3 Find f, given that 32f3/5 + 2174f*2/5 + 2008f/5 - 134/5 = 0. -67, -1, 1/16 Determine y, given that 30y2 + 291y + 567 = 0. -7, -27/10 Find v such that -15v4 - 1367v*3 - 24182v*2 + 334300v + 45000 = 0. -50, -2/15, 9 Solve g*2/7 - 437g/7 + 1416 = 0. 24, 413 Solve 44z2/7 - 1808008z/7 + 164364/7 = 0. 1/11, 41091 Factor a*3/5 - 154a*2/5 + 3724a/5 - 24696/5. (a - 126)(a - 14)2/5 Find d such that -2d*4/9 - 16d*3/3 + 50d*2/3 + 2596d/9 + 800/3 = 0. -25, -6, -1, 8 Factor -k*4 - 267k*3 - 3843k*2 - 15925k - 12348. -(k + 1)(k + 7)2(k + 252) What is g in 2g4/13 - 17530g*3/13 + 38386304g*2/13 + 115316736g/13 = 0? -3, 0, 4384 Factor -w*3/5 + 426w*2/5 - 10799w/5 + 10374/5. -(w - 399)(w - 26)(w - 1)/5 Suppose -5i4 + 10120i*3 - 120895i*2 + 352100i = 0. Calculate i. 0, 5, 7, 2012 Let -18j5 - 5880j*4 - 449378j*3 + 5124020j*2 + 1797800j - 20402000 = 0. What is j? -505/3, -2, 2, 10 Factor i*3/2 + 646i2. i2(i + 1292)/2 Let -2b*2/9 + 6554b/9 + 4372/3 = 0. What is b? -2, 3279 Factor 4h2/3 - 3096h - 665280. 4(h - 2520)(h + 198)/3 Determine n, given that n*4 - 151n*3 + 299n*2 - 149n = 0. 0, 1, 149 Determine d so that -46d4/9 + 262d*3/3 - 22d*2/9 - 262d/3 + 68/9 = 0. -1, 2/23, 1, 17 Suppose 3k2 + 12324k - 61695 = 0. What is k? -4113, 5 Factor l*5 - 217l*4 + 2284l*3 - 3708l2. l2(l - 206)(l - 9)(l - 2) Find u such that u3/7 - 1842u*2/7 + 12837u/7 + 14680/7 = 0. -1, 8, 1835 Determine v, given that -2v4 - 616v*3 - 7200v*2 - 28544v - 37888 = 0. -296, -4 Let -j*4 + 613j*3 - 20077j*2 - 88317j - 67626 = 0. Calculate j. -3, -1, 39, 578 What is j in j*2/7 + 178j/7 - 360/7 = 0? -180, 2 Factor -5n2 + 14930n - 44745. -5(n - 2983)(n - 3) What is n in 3850n2 + 11554n/3 + 4/3 = 0? -1, -2/5775 Suppose -y*3 - 105y*2 - 1583y - 1479 = 0. Calculate y. -87, -17, -1 Solve 14i5/11 + 50i*4 - 17498i*3/11 - 5590i*2/11 + 17484i/11 + 5040/11 = 0. -60, -1, -2/7, 1, 21 Suppose 8d5 - 194d*4 - 1592d*3 - 2566d*2 + 744d = 0. What is d? -4, -3, 0, 1/4, 31 Factor -r*2/3 - 572r - 6816. -(r + 12)(r + 1704)/3 Suppose -5o*5 - 1125o*4 + 9240o*3 - 18640o*2 = 0. Calculate o. -233, 0, 4 Suppose 4x*4/7 - 7164x*3/7 + 7156x*2/7 + 7164x/7 - 7160/7 = 0. Calculate x. -1, 1, 1790 Suppose -5n4/4 - 435n*3 + 70545n*2/4 - 65285n + 63525 = 0. What is n? -385, 2, 33 Let -11045i4 + 4902100i*3 - 543507140i*2 - 92618400i - 3942720 = 0. Calculate i. -4/47, 222 Factor -c*4/6 + 8110c*3/3 - 32886050c2/3. -c2(c - 8110)2/6 Determine n so that -8n*3/7 + 286n*2/7 + 3312n/7 + 810/7 = 0. -9, -1/4, 45 Factor 4i3 + 3808i*2 - 34524i + 69192. 4(i - 6)(i - 3)(i + 961) Factor g3/6 + 103g*2/2 + 153g. g(g + 3)(g + 306)/6 What is k in 3k2 - 27567k - 137910 = 0? -5, 9194 Factor 5m2 - 1103660m + 60903269780. 5(m - 110366)2 Suppose 3z*2 - 100308z - 501615 = 0. What is z? -5, 33441 Factor -162z5/11 + 5184z*4/11 + 15120z*3 + 122496z*2 + 313632z. -6z(z - 54)(3z + 22)*3/11 Suppose -3y*4 - 88704y*3 - 655611258y*2 + 1311488640y - 655788675 = 0. What is y? -14785, 1 Find q such that 20q3 - 715q*2 - 5355q + 4410 = 0. -7, 3/4, 42 Suppose -4w3 + 7092w*2 + 1943328w + 124299584 = 0. What is w? -124, 2021 Factor n*3/2 + 3547n*2/4 + 443n - 1773/4. (n + 1)(n + 1773)(2n - 1)/4 Factor -2y*3/5 - 488y*2 - 96370y - 5237100. -2(y + 115)2(y + 990)/5 Suppose 2i4 + 216i*3 - 684i*2 - 2008i - 1110 = 0. Calculate i. -111, -1, 5 Solve -g*4/4 + 3g*3/4 + 10g*2 - 27g - 36 = 0. -6, -1, 4, 6 Factor 4b3/7 - 69708b*2/7 + 303525984b/7 + 1519373120/7. 4(b - 8716)2(b + 5)/7 Factor 3t2 - 1407t - 21780. 3(t - 484)(t + 15) Find o such that -o*3 + 933o*2 + 768345o + 120053411 = 0. -283, 1499 Solve -3w5 + 8w*4 + 63w*3 - 8w*2 - 60w = 0 for w. -10/3, -1, 0, 1, 6 Solve 5v4 - 470v*3 + 7285v*2 + 28220v - 35040 = 0. -4, 1, 24, 73 Determine y so that -y*5/6 + 85y*4/2 - 5109y*3/2 - 120091y*2/6 - 1572y + 102966 = 0. -6, -3, 2, 131 Determine a so that a*4/3 + 22a*3/3 - 440a*2/3 + 736a - 1152 = 0. -36, 4, 6 Factor -r*2/8 + 36r + 145/2. -(r - 290)(r + 2)/8 Find x, given that 14x*4/3 + 1256x*3/3 - 584x*2/3 - 20096x/3 + 1920 = 0. -90, -4, 2/7, 4 Factor -4z4 + 244z*3 - 5244z*2 + 44764z - 109744. -4(z - 19)3(z - 4) Factor -4w3 + 512w*2 - 8204w - 8720. -4(w - 109)(w - 20)(w + 1) Factor -2d*2/5 + 934d/5 - 932/5. -2(d - 466)(d - 1)/5 Factor 6l2/7 - 4434l/7 + 8700. 6(l - 725)(l - 14)/7 Factor -3j3 + 30j*2 + 864j + 3456. -3(j - 24)(j + 6)(j + 8) Factor 45v*3 + 4490v*2 - 14905v + 3090. 5(v - 3)(v + 103)(9v - 2) Factor b*5/5 + 349b*4/5 - 10962b3/5. b3(b - 29)(b + 378)/5 Factor -2k2/3 + 1308k + 15728/3. -2(k - 1966)(k + 4)/3 Suppose 3f4/5 + 504f*3 - 15192f*2/5 + 30432f/5 - 20304/5 = 0. What is f? -846, 2 Factor -42m2/5 - 2104m/5 - 40. -2(m + 50)(21m + 2)/5 Solve -219h*5 - 435h*4 + 663h*3 - 9h*2 = 0 for h. -3, 0, 1/73, 1 Factor -3y*4 - 141y*3 + 2163y*2 + 2301y. -3y(y - 13)(y + 1)(y + 59) Let 420n5 + 552n*4 - 3309n*3/4 - 1479n*2/4 + 252n - 27 = 0. Calculate n. -2, -3/4, 3/20, 2/7, 1 Factor 4n2 + 12668n. 4n(n + 3167) Solve -4f2/7 - 168712f/7 - 1778983684/7 = 0 for f. -21089 Solve 4p2/3 - 62216p/3 + 241926916/3 = 0. 7777 Factor 3z4 + 57z*3 + 288z*2 + 432z. 3z(z + 3)(z + 4)(z + 12) Find h such that 3h4 + 144h*3 + 1269h*2 - 9276h + 12276 = 0. -31, -22, 2, 3 Solve 2a2 + 50926a - 50928 = 0. -25464, 1 Find a, given that 3a3 + 1140a*2 - 424116a - 161173152 = 0. -378, 376 Suppose 10f5 - 285f*4 + 355f*3 + 1410f*2 - 1580f - 1080 = 0. What is f? -2, -1/2, 2, 27 Determine d so that 2d5/5 + 1167d*4/10 + 44708d*3/5 + 612597d*2/10 - 88466d + 90738/5 = 0. -142, -9, 1/4, 1 Solve -y*2/3 + 76y - 452/3 = 0. 2, 226 Determine m so that 2m2/11 - 390m + 12852/11 = 0. 3, 2142 Find y, given that -4y3 - 1224y*2 - 7236y - 10800 = 0. -300, -3 Determine y, given that 36y3 + 225784y*2 - 4580416y + 1006720 = 0. -6292, 2/9, 20 Suppose -n*5 - 157n*4 - 8311n*3 - 153655n*2 - 283000n - 137500 = 0. What is n? -55, -50, -1 Find a such that 4a5 + 1024a*4 - 2080a*3 - 4120a*2 + 2076a + 3096 = 0. -258, -1, 1, 3 Factor -5z2 + 101860z - 101855. -5(z - 20371)(z - 1) Solve -c*3/4 + 1035c*2/4 - 296583c/4 + 14467309/4 = 0. 61, 487 Factor -5p4 + 115p*3 + 1820p*2 + 1700p. -5p(p - 34)(p + 1)(p + 10) Suppose -5n3/3 - 4189n*2/3 - 3347n/3 + 279 = 0. Calculate n. -837, -1, 1/5 Find b, given that -8b3/11 - 195840b*2/11 - 195834b/11 - 48958/11 = 0. -24479, -1/2 Factor 76d4 + 1871036d*3 - 196952d*2. 4d*2(d + 24619)(19d - 2) Factor l*2/3 - 81052l + 4927070028. (l - 121578)*2/3 Solve 5s*5 - 1505s*4 - 3050s*3 + 6050s*2 + 3045s - 4545 = 0 for s. -3, -1, 1, 303 Factor 2v2/3 - 1220v + 7312/3. 2(v - 1828)(v - 2)/3 Factor -3r3/4 + 60r*2 - 4287r/4 + 2025/2. -3(r - 54)(r - 25)(r - 1)/4 Factor -d4/3 + 58d*3/3 - 167d*2/3 + 110d/3. -d(d - 55)(d - 2)(d - 1)/3 Factor 2l*4/7 - 14208l*3/7 + 25176512l*2/7 + 28870656l + 57806336. 2(l - 3556)2(l + 4)*2/7 Let 5m*4 + 10030m*3 + 4917900m*2 - 113101560m = 0. Calculate m. -1014, 0, 22 Solve -a*5 + 389a*4 - 3449a*3 + 11059a*2 - 14838a + 6840 = 0 for a. 1, 2, 3, 380 Find t such that t*2 + 1630t + 664225 = 0. -815 Determine d so that -3d3 - 1032d*2 + 2100d + 8304 = 0. -346, -2, 4 Find i such that -3i4 + 2184i*3 + 9i*2 - 6546i - 4368 = 0. -1, 2, 728 Solve 7f3/3 - 145f*2/3 + 592f/3 - 220 = 0 for f. 2, 3, 110/7 Factor 2l3/5 - 76l*2/5 + 262l/5 + 68. 2(l - 34)(l - 5)*(l + 1)/5 Factor -	{ "pile_set_name": "DM Mathematics" }
3k + 3. Let u(c) be the second derivative of 3c5/20 - c3/3 - c*2 - 28c + 3. Calculate -2s(i) - 3u(i). -5i3 Let t(z) = 3z*3 - 2. Let q(r) = 3r*3 - 1. Let i = 7134 + -7132. What is it(l) - 3q(l)? -3l*3 - 1 Let n(p) = -23p*2 + 9p + 3. Let y be (-136)/(-18) - (-36)/81. Let m(u) = 8u2 - 4u - 1. Let r(h) = ym(h) + 3n(h). Let o(l) = -l. What is 3o(f) - r(f)? 5f*2 + 2f - 1 Let q(a) be the third derivative of a4/24 - a3/3 - a*2. Let t(u) = u - 2. Let x = -3116 + 3112. Calculate xq(m) + 5t(m). m - 2 Let n(z) = z3 - 2z*2. Let i(g) = 127g*3 - 6g*2 - 4g. What is i(o) - 2n(o)? 125o*3 - 2o*2 - 4o Let u(t) = -4 - t*3 + 2 + 4 + 6t - 7t2. Let c(l) be the third derivative of l5/60 - l4/24 - l2. Let a be 11/(-33) - 4/6. Calculate au(r) - 6c(r). r3 + r2 - 2 Let s(y) = -40y*3 - 8y*2 - 5y + 8. Let p(k) = -27k3 - 5k*2 - 3k + 5. Let g = -2456 - -2464. Give gp(h) - 5s(h). -16h3 + h Let z(l) = 4l*2 - l - 9l*2 + 6l*2 - 3l2 - 2 + l2. Let s(r) = 3r2 + r + 3. Give 3s(p) + 5z(p). 4p*2 - 2p - 1 Let g(w) = 2w3 + 3w*2 + 1. Let r(d) = 1320d*3 - 7d*2 + 1. Determine 2g(n) + r(n). 1324n3 - n2 + 3 Let i be 1/1(3 + -4). Let r(v) be the first derivative of -v*2/2 - v - 4263. Let n(y) be the first derivative of 2y*2 + 6y - 1. Determine in(z) - 5r(z). z - 1 Let v(z) = -4610z - 5. Let i(y) = 4607y + 6. Give 6i(w) + 7v(w). -4628w + 1 Let q(x) = -1607x*2 + 5x - 24. Let c(h) = -h*2 + h - 6. What is 4c(n) - q(n)? 1603n2 - n Let v(b) = -6b*2 - 6b + 141. Let j(t) = t*2 + t + 4. Determine 4j(c) + v(c). -2c2 - 2c + 157 Let m(k) = 2k3 - 8k*2 + 12k + 7. Let v(i) = -i*3 + 4i*2 - 7i - 4. Determine -6m(p) - 10v(p). -2p3 + 8p*2 - 2p - 2 Let o(t) = -587t + 20. Let v(h) = -2h*2 + h - 10. Give -o(j) - 2v(j). 4j2 + 585j Let w(u) = 141u2 - 3u - 47. Let v(p) = -2p2 - 2p + 8. What is -6v(x) - w(x)? -129x*2 + 15x - 1 Let c(j) = -5j + 24. Let s(f) = f - 6. Let b(g) = -c(g) - 4s(g). Let z = 82 + -79. Let w(a) = 3a + a - a. Determine zw(i) - 3b(i). 6i Let i(b) = b*2 - 1. Let m(l) be the third derivative of 7l5/60 - l4/24 - l3/2 - l2 + 64. Calculate -4i(n) + m(n). 3n*2 - n + 1 Let m(s) = -9s*3 - 8s*2 + 6s - 8. Let y = 286 - 287. Let r be (y/3)/((-3)/(-117)). Let x(q) = 19q3 + 17q*2 - 13q + 17. Determine rm(k) - 6x(k). 3k3 + 2k*2 + 2 Let g be 130/4(-11 + (12 - 45/25)). Let v(m) = -4m2 + 3m + 9. Let y(s) = -17s2 + 13s + 37. What is gv(l) + 6y(l)? 2l2 - 12 Let k(z) be the first derivative of -2z*2 - 5z + 8250. Let t(x) = 2x + 3. Determine -6k(d) - 11t(d). 2d - 3 Let z(x) = x - 1. Suppose 4h = 2t - h - 4, 3t - 6 = 2h. Suppose -4 = tp - a - 0a, p + 2 = -3a. Let n(d) = -d - 7 + 4 + 3d. Calculate pn(f) + 5z(f). f + 1 Let y(d) = 4d2 + 102d - 40. Let c(u) = -2u2 - 101u + 41. What is -3c(a) - 2y(a)? -2a2 + 99a - 43 Let t(o) = -6o2 + 66o + 8. Let x(c) = -9c2 + 131c + 15. What is 11t(h) - 6x(h)? -12h2 - 60h - 2 Let b(u) = -19u + 10. Let w(t) = 6t - 3. Give -6b(p) - 21w(p). -12p + 3 Let x(h) = -4h*3 + 2h2 - 1. Let c = -18325 + 18326. Let l be (10/(-4))/(2/(-4)). Let m(y) = y3. Give cx(j) + lm(j). j*3 + 2j*2 - 1 Let r(p) = 16p*3 - 192p*2 - 45p - 11. Let n(i) = 6i3 - 64i*2 - 15i - 4. Give 11n(g) - 4r(g). 2g3 + 64g*2 + 15g Let x(v) = -4v + 2. Let i(d) = d2 + 13d + 47. Let c be i(-5). Suppose -co + 3w = -6o - 18, -5o + 3w = -30. Let t(u) = -u. Calculate ot(n) - x(n). n - 2 Suppose -4v + 713 = y, 0 = v - 14y + 13y - 172. Let m(b) = b - 174 - v + 352. Let x(q) = q + 2. What is 6m(k) - 5x(k)? k - 4 Let u(l) = 107l - 1 - 36l - 22l - 23l - 23l. Let j(s) = 2s - 1. What is 4j(i) - 3u(i)? -i - 1 Let t(l) = -8133910l - 17510. Let a(r) = 5575r + 12. Calculate 8755a(s) + 6t(s). 5665s Let v(r) = -44r2 - 1. Let g = -7802 + 7801. Let b(q) = q2 + 1. What is gv(d) - b(d)? 43d2 Let w(x) = 2169x*2 - 10x + 10. Let j(q) = 945686q2 - 4358q + 4358. Calculate 5j(r) - 2179w(r). 2179r2 Let b(s) = 15s - 11. Let x(y) = -23y + 16. Let a be (-2)/(-6) + -13140/(-273). Calculate ab(c) + 5x(c). -10c + 3 Let u(o) = 1044o*2 - 17o + 1. Let y(m) = -1563m2 + 26m - 2. Give 8u(f) + 5y(f). 537f2 - 6f - 2 Let l(o) = -23o3 + 6o*2 + 6o - 6. Let i(s) be the first derivative of 23s4/4 - 7s*3/3 - 7s*2/2 + 7s + 1722. Determine 6i(v) + 7l(v). -23v3 Let v(a) = -205a - 5. Let t(n) = 99n + 2. Give 9t(s) + 4v(s). 71s - 2 Let b(p) = -37p - 1313. Let a(r) = 55r + 1313. Determine -2a(d) - 3b(d). d + 1313 Let r(u) be the third derivative of -1/24u4 + 0u + 0u3 + 0 - 26u*2. Let a be (9/6)/(3/(-20)). Let z(t) = -3t*2 + 5t. Give ar(x) - 2z(x). 6x2 Let o(p) = 2381p*2 - 6p. Let t(m) = 2385m2 - 7m. Give -6o(u) + 5t(u). -2361u2 + u Let d(s) = -4s. Let y(o) = -27o - 7. Let j(g) = 3 + 2 + 14g - 2. Let i(l) = -7j(l) - 3y(l). Suppose -114 = m - 88. What is md(v) + 6i(v)? 2v Let c(p) = -p - 3 - p - 3p. Let z(n) = -11n - 7. Let d be -21(-6 - -4). Suppose 2a = -5o - a + 1, -3o - 6 = da. Give oz(m) - 5c(m). 3m + 1 Let a be (-848)/265(-5)/(-4). Let u(f) = -203f. Let t(m) = -68m. What is au(q) + 11t(q)? 64q Let w(t) = 2t2 - 3t3 - t2 + 2t3. Let n(d) = -28d*3 + 21d2. Let c(u) = u3 - 48u2 + 90u + 71. Let i be c(46). Give iw(a) + n(a). -7a*3 Suppose -193 + 447 + 164 = -19t. Let s(f) = f*2 - 9f - 7. Let k(p) = p + 1. What is tk(h) - 2s(h)? -2h2 - 4h - 8 Let w(b) = -b*2 + 16b + 10 + 5b2 + 2b*2. Let z(h) = -144h*2 + 20h*2 - 3 - 5h + 96h2 + 26h*2. Give -5w(f) - 16z(f). 2f*2 - 2 Let o(n) = -905n*2 + 6n - 6. Let g(q) = 930336q2 - 6167q + 6167. Give 6g(i) + 6167o(i). 881i2 Let u(g) = -249g*2 + 12g + 13. Let f(k) = 4k2 - 2k - 2. Calculate -6f(c) - u(c). 225c*2 - 1 Let k(l) = -5l. Let p(q) = -4q + 4254. Give -k(i) + p(i). i + 4254 Let k(f) = -f + 176. Let j(u) = -4u*2 + 4u + 174. Let l(b) = j(b) - k(b). Let r(i) = -3i2 + 0 + 1 + 4i - 2. Calculate -2l(a) + 3r(a). -a*2 + 2a + 1 Let x(l) = l*3 - 79l - 11. Let o(s) = 4s3 - 397s - 52. Give -3o(z) + 14x(z). 2z3 + 85z + 2 Let t(o) = -75o + 2. Let r(w) = -5 - 7 + 15w + 13 + 10w - 24w. Give -2r(u) + t(u). -77u Suppose -53t - 3 = -i - 55t, 4t + 24 = 4i. Let v(m) = -11m + 2. Let w(o) = -16o + 3. Calculate iw(u) - 7v(u). -3u + 1 Let j = 27576 - 27574. Let p(c) = 3c3 + c2 - 2c + 2. Let o(v) = 5v*3 + 3v*2 - 5v + 4. Calculate jo(r) - 5p(r). -5r3 + r2 - 2 Let x(r) = 13r*3 - 2r*2 + 2r - 2. Let z(a) = -13a3 + 2a*2 - 3a + 3. Suppose 12l + 8 = -16. Determine lz(u) - 3x(u). -13u*3 + 2u*2 Suppose -2m + 5i = -20, 2m + 3i + 12 = -2m. Suppose m = 22c - 16c - 102. Let z = c + -21. Let t(s) = s + 1. Let r(y) = -3y - 4. Calculate zt(v) - r(v). -v Let h(t) = -2t2 + t - 1. Let g(n) = 9n*2 - 2n + 129. Calculate -g(w) - 5h(w). w2 - 3w - 124 Let j(x) be the first derivative of -2x3/3 + 4x*2 + 5x + 1334. Let c(z) = -z*2 + 1. Give -3c(g) + j(g). g*2 + 8g + 2 Let v(x) = -8x + 2. Let t be (-46)/8 - (-1)/(-4). Let j(q) = -124q + 20. Let a be j(-6). Suppose -o - 763 + a = 0. Let p(m) = -m. Calculate ov(w) + tp(w). -2w + 2 Let w(i) = 11i*3 + 7 - 4i + 5978i2 + 5985i*2 - 11960i*2. Let a(g) = -6g*3 - 2g*2 + 2g - 4. Calculate 7a(b) + 4w(b). 2b3 - 2b*2 - 2b Let g(t) = 29t. Let n = -7617 - -7633. Let w(l) = -144l. What is ng(m) + 3w(m)? 32m Let p(y) = 3. Let v(o) = -o - 13. Suppose -4i + 341 = 21. Suppose ik = 78k + 4. Give kv(u) + 9p(u). -2u + 1 Let x(a) = -6a3 - a2 + a. Let f(l) = 75l3 - 43l*2 - 7l. Calculate -f(m) - 7x(m). -33m*3 + 50m2 Let p(d) be the second derivative of -d3/2 - 2d2 + 8090d. Let l(t) be the third derivative of -t*4/6 - 5t3/6 + t2. Calculate -4l(a) + 5p(a). a Let x(a) = -17a2 + a + 4. Let d = -52 + 58. Let s(f) = 33f*2 - 29f*2 - 4 + d - 3. Give 9s(m) + 2x(m). 2m*2 + 2m - 1 Let a(k) = 75k + 51. Suppose 90 = -107v + 81 + 651. Let f(b) = -3b - 2. Give va(r) + 1	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.