Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
Let f(r) = -4r2. Let t(c) = -7c*2 + 2325c + 2. What is t(f(g))? -112g4 - 9300g*2 + 2 Let d(y) = 22556y. Let t(g) = 10g. Calculate t(d(v)). 225560v Let z(s) = -234s2 - 1. Let n(x) = 228x. Determine n(z(h)). -53352h2 - 228 Let m(t) = -76t - 6. Let n(d) = -141d - 10. Let p(l) = 5m(l) - 3n(l). Let a(o) = -7o*2. What is a(p(q))? -12943q*2 Let n(y) = -188y. Let q(p) = -7p - 29. Determine q(n(u)). 1316u - 29 Let k(m) be the first derivative of m*3/3 + 525. Let v(u) be the third derivative of -19/24u*4 + 0u*3 + 2u*2 + 0u + 0. Give v(k(p)). -19p2 Suppose -6j + 5j = -4. Let o(g) = 400 - 400 - jg2. Let h(k) be the second derivative of k4/6 + k. What is h(o(r))? 32r4 Let w(z) be the second derivative of -155z*3/3 - 5z + 24. Let x(u) = -2u2. What is x(w(m))? -192200m*2 Let b(n) = 2n*2. Let t(m) = 13m*2 + 3m. Let w(c) = -14c2 - 2c. Let z(u) = -2t(u) - 3w(u). Calculate b(z(i)). 512i4 Let c(z) = 11z*2. Let d(t) = -2t*2 - 4t - 4. Let p(m) = 4m2 + 6m + 6. Let i(s) = 3d(s) + 2p(s). Give i(c(a)). 242a4 Let g(h) be the second derivative of -1/3h*3 + 0h*2 + 0 - 11h. Let q(s) = 10s. Give q(g(f)). -20f Let i(d) = -1850d2. Let o(j) = -5j*2. Determine i(o(u)). -46250u*4 Let h(d) = 2d*2 + 15 - 4d*2 - 47d - 42d + 89d. Let x(c) = -c*2. Give h(x(y)). -2y*4 + 15 Let p(z) = -2z + 426. Let x(o) = -3o. Give x(p(h)). 6h - 1278 Let j(k) = 4k. Let x(z) be the first derivative of -7z*2/2 + 86. Give x(j(i)). -28i Let z(s) be the first derivative of -68s + s2 + 68s - 19. Let v(l) = 46l. Calculate z(v(y)). 92y Let w(p) = -p + 282. Let d(o) = 20o. Determine d(w(g)). -20g + 5640 Let k(t) = -2t. Let x(l) = 735 + 27l - 35l - 714. Give x(k(q)). 16q + 21 Let z be (-4)/(-18) + 1/(9/394). Let t(u) = 16u + 21u - zu. Let c(y) = -2y. Determine t(c(x)). 14x Let y(l) = 2l*2. Let z(g) = -9g*2 - 2g - 4. Let t(f) = 343f2 + 77f + 154. Let p(b) = 2t(b) + 77z(b). Calculate p(y(n)). -28n4 Let r(i) = -582631i*2. Let w(h) = h. Give r(w(l)). -582631l*2 Let c(j) = -20j - 165. Let m(q) = q. Give m(c(g)). -20g - 165 Let o(j) = 3. Let g(y) = -4y - 13. Let v(a) = 6g(a) + 26o(a). Let u(p) = -7p. Determine u(v(h)). 168h Let i(r) = 4r. Let f(s) = 214s + 164s - 378s + 106s2. Calculate f(i(c)). 1696c*2 Let i(l) = -34l*2 - 35l*2 - 40l*2 + 119l*2. Let c(m) = -46m. What is i(c(y))? 21160y2 Suppose 3h - 2 = -4m + 1, -5m = -3h + 3. Suppose -4p + mp = 0. Let b(f) = 0f - 3f2 + pf + 4f2. Let q(c) = 8c*2. Calculate q(b(o)). 8o*4 Let d(o) = -24o2. Let n(u) be the third derivative of u4/12 - 2u2. What is n(d(x))? -48x*2 Let h(m) = -34m*2. Let u(q) = 51q + 16q - 101q. Determine u(h(c)). 1156c2 Let z(c) = 31c*2 + 2c + 3. Let q(s) = -5s - 49. Determine z(q(a)). 775a*2 + 15180a + 74336 Let x(k) = -626k. Let b(o) = 5o - 5. Calculate b(x(z)). -3130z - 5 Let d(f) = -678f. Let x(g) = 3g + 6. Calculate d(x(l)). -2034l - 4068 Let q(r) = -21r - 18r - 19r - 20r + 76r. Let j(d) = 467d*2. What is q(j(v))? -934v2 Let n(j) = j3 - 4j2 + 4j - 1. Let v be n(4). Suppose 2 + 28 = 3b - 3x, 0 = -3x - v. Let w(p) = -p2 + 5p - bp + 0p. Let c(t) = -3t. Give c(w(q)). 3q2 Let o(x) = -x. Let j(q) = -q2 - q + 2. Let n be j(1). Let u be (n - -1) + 16/8. Let m(z) = -uz - 7z + z + 0z. Determine m(o(r)). 9r Let b(t) be the third derivative of t*8/4032 - 7t*5/20 - 3t2. Let c(o) be the third derivative of b(o). Let f(w) = -w2 + w*2 + 3w*2. Give c(f(s)). 45s*4 Let f(c) = 87500c - 87500c - 37c*2. Let p(h) = -6h*2. Give f(p(t)). -1332t*4 Let y(g) = -127g. Let m(p) = -2358p2. Determine y(m(r)). 299466r*2 Let d(x) = -10x. Let u(q) = -54402q. What is u(d(g))? 544020g Let c(f) = -3f2. Let b(h) be the second derivative of -5h*3/6 - 2h*2 + 159h. Give c(b(z)). -75z2 - 120z - 48 Suppose 16d = 13d - 3. Let w be (0 + d)(2 - 7). Let c(g) = 2g - wg + 0g + 2g. Let z(f) = 15f. Determine c(z(j)). -15j Let o(s) = 153s. Let c(b) = -392b2 + 780b*2 - 389b*2. What is c(o(r))? -23409r*2 Let d(r) = 2r. Let o(p) = -172266p. Determine o(d(y)). -344532y Let q(h) = h2 - h - 12841. Let g(j) = -j2. Give q(g(v)). v4 + v2 - 12841 Let o(j) = -4j2. Let a(r) = -2r*2 - r - 474. Give a(o(x)). -32x*4 + 4x*2 - 474 Let c(p) = 7p. Let o(i) = -257i2 + i + 154. Determine o(c(q)). -12593q*2 + 7q + 154 Let j(s) = 7480s2. Let k(d) = -277d*2. Let c(x) = 3j(x) + 80k(x). Let v(q) = -2q*2. Calculate c(v(m)). 1120m*4 Let n(c) = -127c - 108c + 249c. Let x(h) = -5h2. Calculate n(x(b)). -70b*2 Let w(n) = 65n. Let x(f) = 337f2 + 4. What is w(x(u))? 21905u*2 + 260 Suppose -10y + 0y + 210 = 0. Let d(v) = 14v - yv + 4v. Let g(p) = -19p. Calculate d(g(k)). 57k Let m(i) = 3i. Let c(g) = -g. Let u(o) = -7c(o) - 2m(o). Suppose 5r - 14 = -3t, -8r + 22 = -3r - t. Let l(y) = 150 - 150 - ry. Give l(u(f)). -4f Let j(n) = 42n*2. Let p(h) = 20h - 9. Let f be p(2). Let u(r) = 65r2 - 32r*2 - fr*2. Calculate u(j(d)). 3528d*4 Let c be (-67)/(-13) - (-2)/(-13). Let j(g) = 45g - 45g - 9g*2 - cg*2. Let w(r) = 2r*2. Determine w(j(s)). 392s*4 Let z be (2/(-4) - -1)4. Let n(d) = 2dz - 8d2 + d2 - 2d2. Let c(r) = 7r + 6. Let i(m) = 6m + 5. Let j(o) = 5c(o) - 6i(o). What is j(n(l))? 7l*2 Let v(f) = 234f*2. Let g(t) = 49375t*2. Let o(b) = -3g(b) + 632v(b). Let s(q) = q. Determine s(o(u)). -237u*2 Let i(k) be the first derivative of 3/2k*2 + 8 + 0k. Let y(j) = 30j2. Determine y(i(w)). 270w*2 Let j(p) be the third derivative of -35p*4/24 - 103p*2 + 2. Let c(w) = -w + 3w - 3w. Calculate c(j(k)). 35k Let v(t) be the third derivative of -t4/4 - t2. Let x(o) = o*2 + 226 - 226. Determine x(v(z)). 36z*2 Let i(c) = -2463 + 4950 + 3c*2 - 2449. Let f(b) = 2b. Give f(i(u)). 6u2 + 76 Let l(f) = -3768905f. Let u(h) = -2h2. Calculate l(u(b)). 7537810b*2 Let g(h) = -5h. Let n = -71 - -67. Let t(x) = 4x. Let s(b) = nt(b) - 3g(b). Let v(u) be the first derivative of -u3 - 1. Determine s(v(m)). 3m*2 Let h(s) = 24s*2 - 49s*2 + 29s*2. Let u(d) = 6d + 2. Give h(u(v)). 144v2 + 96v + 16 Let r(n) be the first derivative of 17n2/2 + 150. Let u(s) = 4s*2 - 6s*2 + 2s2 + s2. Determine r(u(d)). 17d2 Let c(a) = -2504a - 2508a + 5010a. Let n(q) = 2q + 7q - 2q. Give c(n(s)). -14s Let k(d) = -5d2. Let a(j) = -8j*2. Let i(q) = 4a(q) - 6k(q). Let r(l) = -72l. What is i(r(z))? -10368z2 Suppose 2j + y + 4 = 6, -4j + 8 = y. Let o(i) be the third derivative of -5i*2 + 0i*j + 0i + 0i4 + 0 + 1/6i*5. Let l(v) = -v. Determine o(l(b)). 10b*2 Let n(w) = -195w*2 + 20w. Let c(d) = 2d2. Determine n(c(k)). -780k*4 + 40k*2 Let n(q) = -10q*2. Let i(j) = -4j*2 - 2j - 4. Let d(k) = 7k2 + 5k + 10. Let m(c) = -2d(c) - 5i(c). Determine n(m(a)). -360a4 Let w be ((-1)/2)/((-3)/18). Let j(x) = -2x + wx - 6x. Let m(r) = -8r2 - 6. Let c(t) = -7t*2 - 5. Let u(o) = 6c(o) - 5m(o). Give j(u(d)). 10d*2 Let p(o) = -3o. Let a(z) = 3 + 5 - 9. Let d(f) = 2f2 - 8. Let j = 94 + -97. Let n(t) = jd(t) + 24a(t). What is p(n(b))? 18b2 Let x(a) be the third derivative of a5/20 + 238a2. Let q(h) = 2h + 133. Calculate x(q(n)). 12n2 + 1596n + 53067 Let d(h) = -21h2. Suppose 4b = -5r - 16, 4r + 3 = 2b + 11. Let k(f) = -4f + 6f + rf + 0f. Calculate d(k(t)). -84t*2 Let v = -8 + 10. Let l(s) = 20 + vs - s - 20. Let t(n) be the first derivative of 2n3/3 - 3. Calculate l(t(m)). 2m*2 Let x(o) = 8o. Let u(p) = -5113p + 1. Give u(x(g)). -40904g + 1 Let f(u) = 2u. Let j(i) be the third derivative of 0i + 0 + 1/15i5 + 0i*4 + 0i*3 - 10i*2. Calculate f(j(z)). 8z*2 Let z(h) = -h. Let c(b) be the third derivative of -16b*4/3 - 3b*2 - 4. Determine c(z(x)). 128x Let k be (-1)/(4/156-3). Let d(o) = 13o + o - ko. Let a(m) = 0m2 - m2 - m*2. What is d(a(w))? -2w2 Let p(d) = -d2 - 4 + 0d2 + 7 + d2 + 21d*2. Let z(i) = -3i*2. Determine z(p(n)). -1323n*4 - 378n*2 - 27 Let l(f) = 165f - 2. L	{ "pile_set_name": "DM Mathematics" }
Let z = -119 - t. Suppose -2u - 18 = -4r - z, 5r = -10. What is the units digit of u? 6 Let x(d) = 35d*2 + 3d - 9. Suppose -19s = -9s - 30. What is the hundreds digit of x(s)? 3 Let i = 158 - 183. What is the thousands digit of ((-14)/(-20) + 5/i)2292? 1 Let s = -86213 - -159237. What is the tens digit of s? 2 Suppose 2j = -4, -5j = -a - a - 102. What is the tens digit of 14/(-3)(-5 - (-4184)/a)? 7 Suppose -3i + l - 4l - 6 = 0, l + 4 = i. Let y be -89 - (i/3)/((-1)/(-3)). What is the tens digit of (-4)/18 - (-160)/y - -71? 6 What is the units digit of 13/(-5) - (-8677099)/215? 6 Let k = -134 + 239. Let v be (-2163)/k - (1 + (-8)/5). Let l(h) = 2h3 + 40h*2 - 4h + 9. What is the units digit of l(v)? 9 Suppose 5o - 34920 = -k + 64130, -o + 19791 = 4k. What is the thousands digit of o? 9 Let p = 624 + -628. What is the units digit of p - 5526/(-2 + -4)? 7 Suppose -1 = -9l + 10l. Let p(j) = -18j + 12. What is the tens digit of p(l)? 3 Let o(a) = -13a*2 + 6a - 9. Let b be o(6). Suppose 5w - 18x + 15x = 15, 0 = -x - 4x. What is the hundreds digit of b/(-4) - w/12? 1 Suppose -100r = -82845 - 152355. What is the thousands digit of r? 2 Let z = 88676 + -52540. What is the units digit of z? 6 Let p be ((-5)/(-2))/(30/72). Suppose -4c + pc = 2f - 1734, -4f + 5c = -3463. What is the tens digit of f? 7 Suppose 7k = 9f + 8k - 248427, -3f - 5k + 82809 = 0. What is the thousands digit of f? 7 Let v = 58 - 100. Let o be 1184/(-28) + (-3)/(v/4). What is the units digit of (6/4 - 1)(o - -162)? 0 Let j = 1126 + 2719. Suppose 0 = 2o + 4z - 1522, 16z = 5o + 18z - j. What is the units digit of o? 1 Let w = -4063 - -4060. Let h(o) = o3 - 3o*2 + 2o - 2. Let s be h(2). What is the hundreds digit of s(w - 282/4)? 1 Let r = 745 + -360. Suppose 113 = -8v + r. What is the units digit of v? 4 Let t = 8701 - -3610. What is the thousands digit of t? 2 Let l(y) = -2y3 + 9y2 - y + 42. Let g(f) = f3 + f*2 + 2f - 1. Let m(x) = g(x) + l(x). What is the hundreds digit of m(9)? 1 Let p(y) = -3y3 + y2 + 3y - 1. Let n be p(-3). Let j be ((-804)/15)/(8/(-20)). Let z = j - n. What is the tens digit of z? 5 Let i(d) = d*3 + 71d*2 - 110d - 120. What is the units digit of i(-48)? 2 Let d(a) be the third derivative of a6/120 - a5/12 + a*4/6 + 7a*3/6 + 8a*2. Let k be d(4). Suppose -7c = -84 - k. What is the units digit of c? 3 Let r(j) = -j*3 + 30j*2 + 5j + 17. What is the units digit of r(-11)? 3 What is the hundreds digit of 20/100 - 270538/(-10)? 0 Suppose 13i = 22862 + 15384. What is the thousands digit of i? 2 Let b(w) be the third derivative of w5/60 - 3w*4/4 + 2w*3 - 29w*2. Let q be b(16). What is the tens digit of (118/q - (-22)/55)-20? 1 What is the tens digit of ((-14)/(-6))/((-732)/(-458964))? 6 Suppose 0 = 17t - 15t - 212. Suppose 4u = h - t, 101 = 2h - 4u - 131. Suppose 2p - 4g - h = 0, -260 = -4p - 3g - 41. What is the units digit of p? 7 What is the hundreds digit of ((-303234)/(-10) - 2) + (-14)/((-1260)/54)? 3 Let k(x) = 28x - 19. Let c = -62 - -102. Suppose -w - 6a = -9a - 10, -5a - c = -5w. What is the hundreds digit of k(w)? 1 Suppose -43q = -30q - 26. Suppose -4s - 4 = 0, -qs = 3b + 3s - 343. What is the tens digit of b? 1 Let b(j) = 41j3 + 26j*2 - 12j - 47. What is the hundreds digit of b(10)? 4 Let n(b) be the first derivative of -2b4 - 4b + 24. What is the tens digit of n(-3)? 1 Let j = -23 - -28. Suppose -360 = 2z - jv + 252, 5z + 1468 = -3v. Let c = z - -450. What is the tens digit of c? 5 Let x(f) = f + 7. Let u be x(-4). Suppose 5a + 25 = 0, ui = 2i - 3a - 3. What is the units digit of 4/(-6) + 560/i? 6 Let c be (-4 + 2)4 + 89. Let f = 44 + -21. Suppose f - c = -2m. What is the tens digit of m? 2 Let v = 8166 - 7997. Let g = 150 + -79. Let w = v + g. What is the tens digit of w? 4 Let x(b) = 217b - 114. Let h be x(8). Suppose -3c - 3n + h = -c, 2c - 5n - 1590 = 0. What is the tens digit of c? 0 Let m(v) = 15v*3 - 9v*2 - 66v - 125. What is the ten thousands digit of m(13)? 3 Suppose 0 = u - 2n, 5u - 5n - 1 = -6. Let i(p) = -3p - 2. Let b be i(u). Suppose 3q + 2l - 90 = 0, -39 = bq + 2l - 157. What is the tens digit of q? 2 Suppose 0 = -4k + 4m - 1172 - 180, 0 = -k + 4m - 326. Let i = k - -623. What is the units digit of i? 1 What is the units digit of (2 + (-14)/8)9/9130556? 9 Let b(t) = -t. Let x(y) = 7y + 2. Let u(v) = -4b(v) - x(v). Let l be u(-2). Suppose i = -lo + 173, -2o - o = -4i + 597. What is the tens digit of i? 5 Let s(z) = z*3 - 10z*2 + 17z - 11. Let x = -175 - -185. What is the hundreds digit of s(x)? 1 Let j = -51 - -57. Let u(l) be the first derivative of 2l2 + 52l + 85. What is the units digit of u(j)? 6 Let x(u) = -11u3 + 3u*2 + 10u + 17. Let f be (-6)/20-2 - 138/30. What is the units digit of x(f)? 9 Let f(d) = 9d - 44. Let y be f(6). What is the units digit of y/213/((-455)/(-2478))? 4 Let q(s) = 31s - 78. Let d be q(3). Suppose 34h + 1066 = 2k + 30h, 3h - d = 0. What is the tens digit of k? 4 Let g(m) = 72m2 + 45m - 150. What is the hundreds digit of g(7)? 6 Let c be ((-5196)/2)/(23/(-6)). Suppose -7w + 727 = -c. Suppose 5a - k - 440 = 2k, -5a + w = 4k. What is the tens digit of a? 9 Let x(s) = -24s3 + 2s*2 + 5s - 5. Let p be x(2). Let u = p + 297. Let d = u + -5. What is the units digit of d? 3 Suppose -3s - 20 - 22 = 0. What is the thousands digit of ((2 + -4)/(-2))/(s/(-20790))? 1 Let r(w) = 19w - 3. Let h be r(-7). Let u = 109 - h. Let k = u - 169. What is the units digit of k? 6 Suppose 5x + 12f = 11f + 71011, 2x - 4f = 28422. What is the ten thousands digit of x? 1 Let b = -2462 - -4039. Let f = 2547 - b. What is the hundreds digit of f? 9 Suppose 0j + 108 = -4j. Let t = -34 - j. Let h = 21 + t. What is the tens digit of h? 1 Let q be 4/((-16)/(-12)) - (-8 - -1). Let a(j) = 12j - 32 - 9 + q. What is the tens digit of a(15)? 4 Suppose 9335 = 298j - 290j - 4161. What is the units digit of j? 7 Suppose -2u + 40w - 36w = -2532, 5u - 6382 = -3w. What is the tens digit of u? 7 Suppose 0 = 4m + v - 100, 6m - m - 125 = -5v. Suppose -3i + 2 + m = 0. Suppose -iq = -q - 368. What is the tens digit of q? 4 Let w = 97783 + -29455. What is the ten thousands digit of w? 6 Suppose -33t + 32t = -187. Suppose 2q - t = -y - 0q, 3y - q - 547 = 0. What is the units digit of y? 3 Let i = -122 - -369. Let n be (-13)/1044 + (-358)/4. Let d = i + n. What is the tens digit of d? 5 Let a(j) = -17 - 5 - 5 - 13j. Let h be a(-3). Suppose -2p - hp = -3052. What is the hundreds digit of p? 2 Suppose 3f + 37396 = 3p - 7p, -5p - 46740 = 5f. What is the units digit of (-24)/9 + p/(-24)? 7 Suppose 5k = 2b - 3118, b = 4k - k + 1557. Suppose -14s + 6859 = -b. What is the tens digit of s? 0 Suppose -3h + 143355 + 79413 = 39h. What is the thousands digit of h? 5 Suppose -188t = -185t - 8724. Suppose 8f - 12f = -t. What is the hundreds digit of f? 7 Let l(p) = -5p3 - p2 + 4p + 26. Let i(a) = -11a3 - a2 + 7a + 54. Let b(d) = -2i(d) + 5l(d). What is the hundreds digit of b(-7)? 8 Let h = 671 + -716. What is the units digit of h/2-86(-5)/(-15)? 5 Let x = 10486 - 7386. What is the thousands digit of x? 3 Let w = -6850 - -12539. What is the thousands digit of w? 5 Let y(k) = 8k - 168. Let t be y(21). Suppose 5f - 2j - 6173 = -4j, -5f + 4j + 6149 = t. What is the hundreds digit of f? 2 What is the thousands digit of (42/(-6))/((-7)/(-4 - -8453))? 8 Let z = -4792 - -13215. What is the units digit of z? 3 What is the thousands digit of (-2506)/539-4207 + (-4)/(-22)? 9 Suppose -3j + 16a = 18a - 31369, -j + 8a + 10465 = 0. What is the hundreds digit of j? 4 Suppose -1133c - 615712 = -1165c. What is the hundreds digit of c? 2 Suppose 8 - 32 = -4x. Suppose -xh = -1454 - 592. What is the tens digit of h? 4 Let b = -6386 + 13736. What is the units digit of b? 0 Let u be (-1)/(5766/5769 - 1). Suppose -9597 = -5c + u. Suppose 8n + n - c = 0. What is the tens digit of n? 5 Let k = 10771 + -5108. What is the hundreds digit of k? 6 What is the tens digit of ((-276)/414)/(4/(-4482))? 4 Let r(c) = -2c*3 - 5c**2 -	{ "pile_set_name": "DM Mathematics" }
k*3 + 4k*2 + 3k + 1. Let s be t(-2). Factor -5f2 + 2f + 2f3 - 2f*4 + 4fs - f2. -2f(f - 1)3 Let y(h) be the second derivative of h5/75 - h*4/40 - 7h*2/2 + h. Let d(m) be the first derivative of y(m). Factor d(v). v(4v - 3)/5 Let n(l) be the first derivative of -l2 - 2l - 2. Let v be n(-2). Let 0 + v + 0 - 4u2 + 3u*3 - u = 0. Calculate u. -2/3, 1 Let c(o) be the second derivative of -2o5/5 - o4/3 + 10o3/3 - 4o*2 + 5o. Suppose c(z) = 0. Calculate z. -2, 1/2, 1 Let i(r) be the second derivative of r4/12 - r3/3 - 3r2/2 + 5r. Let n(g) = -g*2 + g + 2. Let s(j) = 2i(j) + 3n(j). Let s(b) = 0. What is b? -1, 0 Factor -1/3t - 1/6t5 + 7/6t*2 - 3/2t*3 + 0 + 5/6t*4. -t(t - 2)(t - 1)3/6 Let x(v) be the third derivative of v7/840 + v6/480 - v5/240 - v4/96 - 7v*2. Factor x(j). j(j - 1)(j + 1)2/4 Let f = -10 - -15. Factor 16 - 7p*4 + 2p*4 - 7p*4 - 4p*2 + 2p*f - 24p + 22p3. 2(p - 2)*3(p - 1)(p + 1) Let f(g) be the first derivative of -44g*3/3 - 26g*2 - 8g + 3. Suppose f(r) = 0. What is r? -1, -2/11 Suppose -14 + 4 = -2f. Suppose -5k - b + 3 = -f, -4b - 16 = -4k. Factor -2/9h5 + 0 - 2/3h*4 + 0h - 2/3h3 - 2/9h*k. -2h*2(h + 1)*3/9 Suppose 3u*2 - 6 - 2u - u + 0u2 = 0. Calculate u. -1, 2 Suppose 7t - 2t = 10. Let g = -2/83 + 184/747. Factor 2/9l*t - 2/9l + 2/9l3 - gl*4 + 0. -2l(l - 1)2(l + 1)/9 Let b be 0 - 4 - 2(-18)/8. Solve -1 - 1/2h + bh2 = 0 for h. -1, 2 Let g(t) = -5t*3 - 9t*2 - 4t. Let i(a) = -9a3 - 17a*2 - 9a - 1. Let n(f) = -7g(f) + 4i(f). Solve n(b) = 0. -2, -1 Let i(s) = s*2 + 19s - 65. Let u be i(3). Factor -u + 1/2z2 + 1/2z. (z - 1)(z + 2)/2 Let g = -1001843/13 - -76996. Let w = g + 69. Suppose 2/13q*2 - 2/13q - wq4 + 2/13q*3 + 0 = 0. Calculate q. -1, 0, 1 Let p(h) = 2h - 12. Let i(x) = 9x2 - 1. Let m be i(1). Let w be p(m). Factor wt*3 - 3t*3 + 6t + 2 + 6t2 + 0t2 + t3. 2(t + 1)3 Let y = 5 + -1. Factor 4m - 5m2 + 2m*2 - 4m3 - m2 + y. -4(m - 1)(m + 1)2 Let n(s) = s3 - s*2 + s + 1. Let u(b) = 2b*3 - 2b*2 + 4b + 4. Suppose -m = -5 + 2. Let q = m + -2. Let h(x) = qu(x) - 4n(x). Factor h(f). -2f2(f - 1) Let r(j) be the third derivative of 0 + 1/5j3 - j2 + 1/150j*5 + 1/15j*4 + 0j. Solve r(o) = 0 for o. -3, -1 Let w = 294 + -292. Determine f, given that 0f3 + 6/7f*5 + 0 + 0f + 0fw + 2/7f*4 = 0. -1/3, 0 Let z(o) be the second derivative of 2o*6/25 + 39o5/100 - o4/20 - 13o3/10 - 9o*2/10 + 10o. Find j, given that z(j) = 0. -3, -1, -1/4, 1 Let l(u) be the second derivative of u4/48 + u3/24 - u. What is h in l(h) = 0? -1, 0 Let g(k) = -2k. Let d be g(-1). Let t(j) be the first derivative of 0j*3 - 1/2j*4 + 0j*d + 2/5j*5 + 0j - 2. Let t(i) = 0. What is i? 0, 1 Let x(q) be the second derivative of -1/6q4 + 2/3q*3 + 2q - q*2 + 0. Factor x(r). -2(r - 1)*2 Let h(w) be the first derivative of 5/7w*2 - 2/7w*3 - 2/7w - 5/14w4 + 1 + 8/35w*5. What is a in h(a) = 0? -1, 1/4, 1 What is h in 11/2h*2 - 3/2h*4 + 1/2h*5 - 1/2h*3 + 2 - 6h = 0? -2, 1, 2 Factor -7303m + 5m*2 + 7295m + 8 - 3m2. 2(m - 2)*2 Let p be -76/18 + 5. Suppose -2/3o2 + 8/3o - p = 0. Calculate o. 2 Let b(f) be the third derivative of -f9/15120 - f8/6720 + f7/560 - f6/360 + f*5/60 - 3f*2. Let k(i) be the third derivative of b(i). Factor k(d). -(d - 1)(d + 2)(4d - 1) Factor -2/7d2 + 0d + 0 - 2/7d5 - 6/7d*4 - 6/7d*3. -2d*2(d + 1)*3/7 Let h(u) be the second derivative of -2u + 1/7u2 + 0 + 0u*3 - 1/42u*4. Factor h(s). -2(s - 1)(s + 1)/7 Factor 4/5 + 2/5o*2 + 6/5o. 2(o + 1)(o + 2)/5 Let c be 16/15 - 4/10. Let x = 14 + -10. Factor -2/3r + 0 + cr*x - 2/3r*2 + 2/3r*3. 2r(r - 1)(r + 1)*2/3 Let p be (-4)/6 - 100/(-6). Suppose 2i - p = -2i. Solve -iv*2 - 2v*3 - 1 + 0v - 2v2 + 0v + 7v4 + 5v - 3v5 = 0 for v. -1, 1/3, 1 Let k(g) be the second derivative of g5/60 - g4/18 + 12g. Factor k(z). z*2(z - 2)/3 Let c = -27 - -32. Let p(g) be the third derivative of 1/240g6 + 0g*c + 0g*7 + 0 - 1/672g8 + g2 + 0g3 + 0g*4 + 0g. Factor p(q). -q*3(q - 1)(q + 1)/2 Factor -2a*2 + 18 - 10 - 14 + 4a*3 - 10a - 2a3. 2(a - 3)(a + 1)2 Let g be -6(-1)/(3 + 1)2. Let p(y) be the third derivative of -1/360y*6 - gy*2 - 1/18y*3 + 0 - 1/60y*5 + 0y - 1/24y4. Factor p(u). -(u + 1)3/3 Suppose 0 = 2r - 4i - 24, -4r - 3i - 2i = 4. Factor 0 + 2/7w - 6/7w*2 - 2/7w*r + 6/7w*3. -2w(w - 1)3/7 Factor -1/3y*3 + 0 + 1/3y + 0y2. -y(y - 1)(y + 1)/3 Let t = -64 + 194/3. Let x = 58/3 + -18. Solve -ty*2 + 0 + xy = 0 for y. 0, 2 Let s(o) be the third derivative of o*6/360 - 11o5/180 - o4/72 + 11o3/18 - 5o*2 + 2o. Factor s(g). (g - 11)(g - 1)(g + 1)/3 Let c(z) be the third derivative of 6z2 + 1/240z*5 - 1/24z*3 - 1/480z*6 + 0z + 0 + 1/96z4. Solve c(x) = 0 for x. -1, 1 Let y be 2-1 + (-9)/3. Let w = y + 6. Solve -4j2 + w - 1 - 2j + 0j3 - 2j3 = 0. -1, 0 Let r be 1 - ((-26)/(-6) + -4). Determine s so that -r + s2 - 1/3s = 0. -2/3, 1 Let d(j) be the third derivative of j10/453600 - j9/90720 + j8/60480 - 7j*5/60 + 4j2. Let c(o) be the third derivative of d(o). Factor c(q). q2(q - 1)2/3 Suppose -2a - a = 0. Suppose -4 = -6n + 8. Factor 0 - 4/5q*4 + aq + 2/5qn + 2/5q*3. -2q*2(q - 1)(2q + 1)/5 Let d be -4(3/6 + -1). Suppose di = 5i - 9. Suppose 2v*3 - 2v + 3vi - 3v*3 = 0. Calculate v. -1, 0, 1 Let g(i) be the first derivative of 3i*4/28 + 5i*3/7 + 3i*2/2 + 9i/7 - 7. Factor g(q). 3(q + 1)2(q + 3)/7 What is j in 3j3 - 6j*2 - 2/3 + 11/3j = 0? 1/3, 2/3, 1 Let q(t) be the first derivative of -75t4/4 + 5t*3/3 + 7t*2/2 - t - 1. Determine u so that q(u) = 0. -1/3, 1/5 Factor 0k*2 + 1/4k*3 - 1/4k*4 + 0 + 0k. -k*3(k - 1)/4 Suppose -600w - 18 = -609w. Solve 0 + 0u + 4/3u*w + 4/3u*4 - 8/3u*3 = 0 for u. 0, 1 Suppose -15z + 2z = 0. Solve 1/5n*4 + zn*3 - 2/5n + 0 - 3/5n2 = 0 for n. -1, 0, 2 Let d(c) = c. Let o(s) = 3s*2 - 11s - 18. Let b(p) = -4d(p) + o(p). Find x such that b(x) = 0. -1, 6 Let x(l) be the first derivative of l3 - 3l*2/2 + 1. Factor x(r). 3r(r - 1) Let t = 17 + -13. Let a(s) = -s3 - 9s*2 - 6s + 19. Let w be a(-8). Factor 3yw + 16/3y*5 + 1/3y*2 + 0y + 0 + 8yt. y2(y + 1)(4y + 1)*2/3 Factor -27j*3 - 6j*3 - 3 + 12j*4 + 39j*2 - 3j*3 - 18j + 6. 3(j - 1)2(2j - 1)2 Solve -5/9a*2 + 1/9a*3 + 2/3a + 0 = 0 for a. 0, 2, 3 Factor -72/5 - 156/5u - 12/5u*3 - 16u*2. -4(u + 3)*2(3u + 2)/5 Find o, given that -2027o - 4 + 5o2 - 3o*2 + 2029o = 0. -2, 1 Let h(r) = 7r2 - 6r - 1. Let x(s) = -s*2 + s. Let a(g) = 3h(g) + 24x(g). Solve a(i) = 0 for i. 1 Let c be ((-12811)/(-24))/23 + 1/8. Factor ct*2 + 52/3t + 8/3 - 49/3t3. -(t - 2)(7t + 2)2/3 Let o = 749/5 - 149. Suppose 2/5x*5 - 4/5x*3 - 16/5x*2 + ox*4 - 14/5x - 4/5 = 0. Calculate x. -1, 2 Let s(m) be the third derivative of 7/240m5 - 3m*2 + 0 + 1/48m*4 + 1/280m*7 + 0m + 1/60m6 + 0m3. Solve s(i) = 0. -1, -2/3, 0 Let c(f) be the second derivative of -f5/40 + f*4/24 - 25f. Factor c(x). -x*2(x - 1)/2 Let y = -20/31 + 286/155. Factor -6/5j3 + yj*4 + 2/5j*2 - 2/5j*5 + 0j + 0. -2j2(j - 1)*3/5 Let t = 51 - 49. Let l(q) be the third derivative of 0q*4 + 0q*3 + 0q + 0q5 + 0 + 3q*t - 1/420q*6. Factor l(o). -2o*3/7 Factor -4/3u + 2/3u2 + 2/3. 2(u - 1)*2/3 Let l(m) be the second derivative of -1/12m*3 + 1/48m*4 - 3/8m*2 + 0 - 3m. Let l(n) = 0. What is n? -1, 3 Let r(q) be the second derivative of -q6/15 + q4/3 - q*2 + 2q. Find p, given that r(p) = 0. -1, 1 Factor 0a2 + 0a*3 - 6/7a*4 + 3/7a*5 + 0 + 0a. 3a4(a - 2)/7 Suppose 5g = -3y - 14, -7 = -y + 3g + 7. Suppose -2/7q + 0 - 2/7qy = 0. Calculate q. -1, 0 Let p = -119 + 479/4. Let 3/4l*2 - pl + 0 = 0. What is l? 0, 1 Let z(w) = w2 - 1. Let k(q) = q4 - 5q3 + 16q*2 - 4q - 8. Suppose 5o + 46 = 166. Let j(v) = oz(v) - 3	{ "pile_set_name": "DM Mathematics" }
- 5y(i)? -3i + 14 Let l(h) = -9h. Let g(u) = 26u. Let z be (4/4)/((45/(-153))/(-5)). Calculate zl(q) + 6g(q). 3q Let v(k) = 273k*2 + 5k + 213. Let r(u) = -u*2 + u + 56. Give 4r(g) - v(g). -277g2 - g + 11 Suppose 2y - 44d + 4 = -40d, 4y + 4d = -32. Let z(q) = 9q2 - 8q - 3. Let a(v) = 26v2 - 23v - 8. What is ya(p) + 17z(p)? -3p2 + 2p - 3 Let y(b) = -17b + 75. Let u(i) = -24i + 113. What is -5u(m) + 7y(m)? m - 40 Let r(c) = -5c2 - 13c + 9. Let g(h) = -3h2 - 15h + 10. Determine 5g(n) - 6r(n). 15n2 + 3n - 4 Let m(n) = 8n + 144. Let c(h) = -3h - 72. Calculate 7c(s) + 4m(s). 11s + 72 Let p(h) = -h + 5. Let g = -10932 - -10933. Let n(j) = j - 1. Calculate gp(u) + 4n(u). 3u + 1 Let u(d) = -4d2 + 123d - 8. Let c(i) = 5i + 2. What is 5c(z) + u(z)? -4z2 + 148z + 2 Let s be (-20)/40 + (-6)/4 - (-34 - -26). Let r(x) = 5x2 - 19x - 17. Let f(d) = -3d2 + 10d + 9. Calculate sr(v) + 11f(v). -3v2 - 4v - 3 Let a be 40/3 - 8/24. Let n(y) be the first derivative of -5y3/3 - 9y*2/2 - 5y - 2419. Let s(d) = 11d2 + 19d + 11. Give an(b) + 6s(b). b*2 - 3b + 1 Let j(v) = -20v2 - 3v - 6. Let r(u) = -19u2 - 2u - 5. Suppose -2y + 5i + 25 = 0, -5y + 24i = 23i - 28. Calculate yr(w) - 4j(w). -15w*2 + 2w - 1 Let x(l) = 77l. Let o(b) = -b. Let y(s) = -s2 - 46s - 274. Let a be y(-7). What is ax(n) - 66o(n)? -11n Let b(s) = -145s - 111. Let g(a) = -47a - 1. Give -b(f) + 3g(f). 4f + 108 Let i(h) = 107h*2 + 12h + 22. Let s(r) = -56r2 - 7r - 11. Determine -3i(c) - 5s(c). -41c2 - c - 11 Let n(j) = 3j*2 - j + 13. Let r(x) = -366 - 8x*2 + 3x + 138 + 190. Calculate 11n(d) + 4r(d). d*2 + d - 9 Let h(m) be the second derivative of 3m + 2/3m4 - 1/3m*3 + 0 - 6m2. Let w(u) = -u2 + 1. Let z be 5/((-15)/(-6) - 2). Give zw(q) + h(q). -2q*2 - 2q - 2 Let h(s) = -262s2 - 62s + 30s + 3 - 3 + 261s*2 + 31s. Let g(o) = 7o2 + 5o - 2. Let n = 8 - 13. Calculate nh(u) - g(u). -2u*2 + 2 Let i(j) = -5j - 7. Let k(p) be the second derivative of -p*3 - 4p*2 + 901p - 1. Suppose -7o = -11o + 16. What is ok(c) - 5i(c)? c + 3 Let n(o) = 10o3 - 36o*2 + 11o + 6. Let a(v) be the second derivative of v*5/10 - 7v4/12 + v3/3 + v*2/2 + 19v + 8. Determine -11a(q) + 2n(q). -2q3 + 5q*2 + 1 Let h(p) = -33p*2 - 7p - 10. Let q(s) = -64s2 - 17s - 22. Calculate 7h(b) - 3q(b). -39b2 + 2b - 4 Let l(p) = 588p. Let k(h) be the first derivative of -31h*2/2 + 4610. Calculate -56k(g) - 3l(g). -28g Let n(v) = v3 - v2 + v + 1. Let j(b) = 5b3 - b2 - b2 + 4 + 3b + 0b + 0b*2 + 4b*2. Calculate j(h) - 3n(h). 2h3 + 5h*2 + 1 Let x(l) = -6l + 16. Let z = 37 - 19. Suppose 2v + 34 = 4s, 3s - v - z = 2v. Let r(q) = -q + 25 - 22 + 0. What is sr(o) - 2x(o)? o + 1 Let t(l) = -10l - 2. Suppose -2h - 4 = 2z, 0 = 52h - 53h - 5. Let i(s) = -29s - 7. What is zi(w) - 8t(w)? -7w - 5 Let f(k) = 11k*2 - 13k - 7. Let d(a) = -3a2 - 1. Give 2d(s) - f(s). -17s2 + 13s + 5 Let i(p) = p*2 + 10p + 17. Let q be i(-6). Let z(u) = 4u3 - 9u*2 + 5u - 10. Let m(g) = -4g3 + 8g*2 - 4g + 9. Calculate qm(v) - 6z(v). 4v3 - 2v*2 - 2v - 3 Let q(o) be the third derivative of -o*5/4 + 3o*3/2 - 10o*2 + 65o + 1. Let r(n) = -7n2 + 4. Give 6q(y) - 13r(y). y2 + 2 Let o(a) = -59a - 9. Let l(v) = 58v + 11. Calculate 4l(r) + 5o(r). -63r - 1 Let x(v) = -54v3 - 100v*2 + 14245v. Let k(d) = -13d3 - 24d*2 + 3561d. Determine 25k(h) - 6x(h). -h*3 + 3555h Let x(w) = -7w3 + 10w*2 - 1271w + 5. Let n(p) = -8p3 + 12p*2 - 1271p + 6. What is -5n(r) + 6x(r)? -2r3 - 1271r Suppose q = -3, 4v - 2q = -700 + 722. Let p(b) = 10b. Let h(c) = 10c. Let m(l) = l*2 - 6l + 2. Let j be m(5). What is jp(t) + vh(t)? 10t Let k(j) = j + 14. Let l(s) = -11s - 67. Let c(n) = -5k(n) - l(n). Let y(i) = i. Determine 2c(t) - 10y(t). 2t - 6 Let t(n) = -443n2 - 6n - 18. Let h(p) = -1329p2 - 17p - 51. Calculate 6h(g) - 17t(g). -443g2 Let z(s) = -56s*2 - 14s - 91. Let x(t) = 19t2 + 5t + 33. Let n(m) = 11x(m) + 4z(m). Let q(d) = 30d2 + 2d + 2. Determine -5n(f) - 2q(f). 15f2 + f + 1 Let d(k) = 2k + 26. Let m be d(-10). Let y(a) = -ma + 7 + 4 + 4a + 3a. Let z(x) = -19 - 8 + 26. Give 2y(v) + 22z(v). 2v Let z(j) = -2j3 + 2j*2 + 2j. Let m(w) = -15w3 + 8w*2 + 8w - 5. Calculate -m(b) + 4z(b). 7b3 + 5 Let j(w) = -w3 - 3w2 + 3w - 1. Let k(l) = 9l3 + 15l*2 - 38l + 9. Give 5j(q) + k(q). 4q*3 - 23q + 4 Let r(t) = 21t2 - 2t + 5. Suppose 0 = 256c - 261c - 5u - 30, 2u = -2. Let y(d) = 11d2 - d + 2. Calculate cy(s) + 2r(s). -13s*2 + s Let p(c) = -68c*2 - 11. Let a(w) be the third derivative of -17w5/60 - w3/2 - 2w2 + 131. Determine -22a(r) + 6p(r). -34r2 Let y(i) = -i3 - 2i + 5. Let x(j) = -17j*3 - 2j*2 + j - 25. Calculate -x(q) - 5y(q). 22q3 + 2q*2 + 9q Suppose -7 + 2 = 2a + o, -2a + 4o = 10. Suppose -3l + 6l + 21 = -3r, l - 5r - 11 = 0. Let k(h) = -8h. Let m(p) = 7p. What is ak(n) + lm(n)? -4n Let l(g) = g*2 + 16g - 67. Let y(c) = 3c. Determine -l(m) + 6y(m). -m*2 + 2m + 67 Let i(d) be the third derivative of -5d4/8 + d3/3 - 11d*2. Let o(k) = 8k + 105 - 25 - 26 - 25 - 30. Determine 6i(v) + 11o(v). -2v + 1 Let n(c) = -70c*2 - 12c - 12. Let p(x) = -2x2 + 5x - 1. Let t(j) = -36j2 + 15j - 9. Let a(g) = 4p(g) - t(g). Give 12a(v) + 5n(v). -14v*2 Let l(f) = -3f*2 + 4f - 1. Let p(z) = -11z2 - 9z + 4. Let d(c) = 13c2 + 11c - 5. Let g(a) = -5d(a) - 6p(a). What is 6g(s) + l(s)? 3s*2 - 2s + 5 Let d(b) = -4b - 1. Let n(s) = -2164s - 2140s + 4315s + 2. Suppose 0 = -5l - 3k, -3l + 2k - 7 = 12. Calculate ln(w) - 8d(w). -w + 2 Let n(w) = -481w + 8. Let f(v) = -490v + 8. Calculate -6f(i) + 7n(i). -427i + 8 Let s(r) = r3 - r2 - 3r - 1. Let k be (47 - 103 - -55)/(1(1 + -2)). Let n(m) be the first derivative of -m3/3 - m2/2 - m + 1. Determine ks(i) - n(i). i*3 - 2i Let t(y) = y + 3. Let m(n) = -275 - 284 + 839 - 281. Calculate 6m(f) - 3t(f). -3f - 15 Let t(h) = -2h + 10. Let f(g) = 18g - 37. Let b(k) = -f(k) - 4t(k). Let v(x) = -21x - 7. Give -5b(o) + 2v(o). 8o + 1 Let a(o) = -3o2 + 7o - 5. Let p(u) = -u*2 + u - 1. Let w = 54445 - 54446. Let y be 1-2(-5 - -3). Calculate wa(t) + yp(t). -t2 - 3t + 1 Let y(p) = -14p3 + 5p*2 + 13p + 14. Let i(b) = -13b3 + 6b*2 + 11b + 12. Give -7i(l) + 6y(l). 7l3 - 12l*2 + l Let x(s) = 28s*2 - 5763s + 32. Let o(g) = -5g2 + 1153g - 6. Calculate 11o(j) + 2x(j). j*2 + 1157j - 2 Let m(o) = 2 + 14o + 0 + 28o - 5o - 13o. Let t(b) = 71b + 5. Give 8m(a) - 3t(a). -21a + 1 Let q(t) = -t*2. Let a(u) = -41 + 2774u*2 + 42 - 2782u*2 + 6u. Determine -a(f) + 6q(f). 2f*2 - 6f - 1 Let x(b) = 14053 - b2 - b - 14053. Let f(s) = -s3 + s*2 - s - 1. Let m(c) = 5c*3 + 3c*2 + 8c + 3. Let o(q) = -3f(q) - m(q). Give -o(k) + 6x(k). 2k3 - k Let s(x) = 2x*3 + 15x + 5. Let z(v) = -11v - 12v + 743v2 + 589v*2 - 3v*3 - 8 - 1332v*2. What is -8s(c) - 5z(c)? -c3 - 5c Suppose 0 = b + 5v - 21, -5b - 20v + 1 = -21v. Let u(h) = -1. Let j(f) = -10f + 11. Let n(o) = 1. Let a(x) = j(x) - 4n(x). Calculate ba(z) + 6u(z). -10z + 1 Let s(g) = 3. Let w(u) = u2 - 21. Let p = -5 + -170. Let q = p + 178. Calculate qw(j) + 21s(j). 3j*2 Let o(n) = n + 23. Let y(r) = -1. Suppose -4k + 9k = 5h + 40, 0 = -4k + 3h + 23. Determine ko(p) + 3y(p). -p - 26 Let h(o) = 3957o2 + 14o - 12. Let g(n) = 1977n2 + 6n - 5. Calculate 7g(x) - 3h(x). 1968x2 + 1 Let k(g) = -39g*2 - 4g - 585. Let z(h) = 48h2 + 5h + 586. What is 5k(r) + 4z(r)? -3r2 - 581 Let d(r) = -2r*2 - 2. Let f(t) = 12t*2 + 28t + 1. Calculate d(i) + f(i). 10i2 + 28i - 1 Let b(d) = 73d - 131. Let k(c) = -86c + 132. Determine -5b(h) - 4k(h). -21h + 127 Let q(c) = c + 6. Suppose 5a - 162l = -164l - 26, 2l = 5a + 14. Let n(y) = y + 7. Determine an(z) + 5q(z). z + 2 Let x(i) be the first derivative of -10i2 + 16i -	{ "pile_set_name": "DM Mathematics" }
k - 2 + 6 = 0. Solve b = -4t + 19, kt - 5 = -6b + b for b. -1 Let h(r) = r*3 - 7r*2 + 2. Let k be h(7). Suppose 5i - 5 = -p, -i - 1 = p - k. Solve n - 14 = -n + c, -5c - 20 = p for n. 5 Suppose -2 = 2d - 3c - 8, d + c + 7 = 0. Let w = d + 5. Suppose 0 = 5p - 3x - 18, -wp + 5p + x = 8. Solve -2n = q - 6, -pn = 3q - 6n - 9 for q. 4 Let o(q) = 2q*3 + 9q*2 - 7q - 7. Let r be o(-5). Solve 0 = -p + rv + 8, -p + v + 3 + 1 = 0 for p. 2 Let c = 8 - 4. Suppose -q + 0a = -a - 9, 0 = -a - c. Solve -qp + 24 = 4d, 2p = -d - p + 13 for d. 1 Suppose 0 = -d - 5d + 12. Solve 5y + 35 = -0i - 5i, -di + 2y - 6 = 0 for i. -5 Suppose -i - 2i - 6 = 0. Suppose 5c + 72 - 27 = 0. Let h be 1ci/6. Solve hb - 16 = -2s - b, -3s - 2b = -8 for s. 0 Suppose -5l - 16 = -4n, -2l - 2n = -n - 4. Suppose 4g + l = 12. Suppose ga - 6 = 0, h + h + 4a = 18. Solve 2p + 5 = -hr, 3r + 3 = p + p for r. -1 Let t be (-17)/(-85) - 69/(-5). Let h be t/35 + 2/(-5). Solve -2d = -11 + 1, 3q + 3d - 24 = h for q. 3 Let z(s) = s - 5. Let u be 1(-3 - (1 - 11)). Let t be z(u). Let i be t-31/(-6). Solve 4n = -2a + 16, -n = 2n - 5a + i for n. 3 Let o(b) = b2 + b - 3. Let v be 2/1 - (-5 + 1). Let d = v - 3. Let p be o(d). Solve -3s = 3k - 0 - p, 5s - 5k + 5 = 0 for s. 1 Let s(y) = -y2 + 7y - 3. Let r be s(6). Let w = r + -3. Suppose w = 3z + z. Solve n + 5l - 23 = 0, 3l = -zn - 2n + 11 for n. -2 Suppose 5r = -5r. Solve r = 4u + 5w - 6, 5 = -3u - 0u + w for u. -1 Let w be 1 + 3 + (-6)/(-3). Let h = w + -4. Suppose hc - 40 - 34 = 0. Solve 5v - c = -4b - 0v, 3b = v + 4 for b. 3 Suppose 26 = 5f - 109. Solve 6 = 3u + 5m, 3u + u - 5m = -f for u. -3 Let y(k) = k2 + 12k + 35. Let j be y(-5). Let i(u) = 2u2 - 3u - 3. Let b be i(3). Suppose -b = -0c - 2c. Solve -l = j, -7x + 16 = -cx + 2l for x. 4 Let n(v) = v2 - v + 6. Let l be n(0). Let c = -2 + -2. Let h = 7 + c. Solve 4d + 4q = 2d - 4, -hd + 4q = l for d. -2 Let j = -9 + 19. Suppose 5 = 4d - 5d + 3n, 0 = d + 2n - 10. Suppose 3k + 2 = x - 0, -2k + d = 2x. Solve 3m + q + j = xm, -5 = -m + 2q for m. -5 Let p be ((-2)/3)/(14/(-147)). Solve m - p = -3s - 0s, 4m = -3s + 19 for s. 1 Suppose 0p - o = -2p + 13, 0 = -2o - 2. Suppose 4 = g - p. Solve 4j = -2k, -2j + 3j + 3k = -g for j. 2 Suppose -2t + 0t = -j - 27, -4j = -2t + 36. Let f be 2/(-9) - (-237)/(-27). Let y = f - -14. Solve yu + 9 + 1 = 0, -u = -5x + t for x. 2 Suppose 3d - 9 = -3q, -q - 2q + 5 = d. Solve 0 = dn - 0n - b - 1, 2b = 3n for n. 2 Let x(r) = -r - 5. Let o be x(-7). Suppose 3q - o = q. Let g = 4 - q. Solve 4b = -a, 0b = gb - 3a + 15 for b. -1 Let h be 2/(1/(9/6)). Solve -4z = -ha + 27, -2z = -3a + 4 + 17 for z. -3 Let i = 24 - 17. Suppose 5 = 4z - i. Solve 8t - 20 = 5o + 3t, -zo + 2t = 10 for o. -2 Let i(u) be the third derivative of 1/24u4 + 0u + 0 + 1/6u3 + 2u*2. Let q be i(-1). Solve 0 = 4n, q = z + z + 5n for z. 0 Suppose -t + 2z + 9 = -2, -5t + z = -37. Suppose -tq = -3q. Suppose q = 5l - 16 - 4. Solve 5s + 25 = 0, s = -lo + 6s + 13 for o. -3 Let y be (6 - (4 + -4)) + -4. Solve 0 = yd + m + 7, -2d + 2m = d + 21 for d. -5 Let m(f) = -f*2 - 10f - 10. Let c be m(-10). Let z(t) = t*3 + 9t*2 - 9t + 14. Let p be z(c). Solve ps - 12 = 0, -4w + s + 3s = -4 for w. 4 Let t = 11 - 7. Solve 0 = 2x - r - 7 + 2, tr = 5x - 17 for x. 1 Let t be 8/(-6) - (-5)/15. Let f = t + 1. Suppose f = 5w + 3g - 18, 0 = 4w - 4g - 3 - 5. Solve -wd = -5q - 25, -d = -3d + 10 for q. -2 Suppose 0r = -2r - 4. Let g(l) = l2 + 2l + 1. Let d be g(r). Solve 5q + x = -6, x + d = -3q - 3 for q. -1 Let o = -5 - -6. Solve -2 = w - 5j - o, 5w - 4j = 16 for w. 4 Suppose 0 = 5r - 4p - 18, r - 5p = -0r + 12. Suppose -5v - j = -25, -rv + 2j = -6v + 20. Let y = -5 + v. Solve -t = 0, -4f + yt - 4t = 16 for f. -4 Let a(c) = c - 1. Let r be a(3). Solve 0o + 4o = -3l, o = rl - 11 for l. 4 Let w(u) = 2u + 35u*3 + 6u*2 + 2 - 34u*3 + 3u. Let t be w(-5). Solve 3b + 2q = -tq + 5, 4b = -5q + 7 for b. 3 Suppose f - 1 = 1. Let y be (f - 8)/((-2)/1). Let a be y3(-10)/(-18). Solve -as + 3c - 5 = 8, -2s - 22 = 3c for s. -5 Let h(c) = c2 + 9c + 4. Let v be h(-9). Suppose -4a + 1 = 13, -5a - 15 = 2l. Solve 2k = 3u - 23, -12 = -2k - lk - vu for k. -4 Suppose -2a = -a + 2n - 8, 0 = -a + 4n - 16. Solve t = 3z, 3z + az + 12 = -3t for z. -1 Suppose -j - 19 = -o, -o + 4j = o - 44. Solve -5i = -3i + 2x - o, 2i + 5x - 28 = 0 for i. 4 Suppose -5m + 65 = 2n, -m - 2m = -n + 38. Solve 3i + i + n = 3x, -3i + x - 20 = 0 for i. -5 Suppose t + 3h + 17 = -62, -2t + 2h - 182 = 0. Let z be t/(-16) - 2/4. Solve -k - 2a + z = -4k, 4a - 16 = 0 for k. 1 Let d(s) = -8s + 1. Suppose -4p - v - 17 = 2, -3v - 21 = 3p. Let i be d(p). Let n = -19 + i. Solve -3c = -c + 2r + n, -2c + 4 = -4r for c. -4 Let j(b) = b2 - 27b - 26. Let o be j(28). Let l be (2 - 2)/(1 - -1). Suppose 3 = i - l. Solve -or - 5 - 1 = -y, ir + y + 14 = 0 for r. -4 Suppose u - 5t - 20 = 0, 0 = -4t - 16. Solve 5f - 2z = -uz - 29, -3z = -6 for f. -5 Let q = 27 - 15. Let n be (-4)/(-3) + (-104)/24. Let m = 3 - n. Solve -m = -4d - 5l, -6l = -d - 2l + q for d. 4 Suppose -4h - 2 + 5 = 3f, 4h = -4f + 4. Let v be (2 - (2 - 2)) + h. Suppose 3 - 1 = 2j. Solve -5k - 4s - 6 = 0, 3k = vk - s - j for k. -2 Suppose 0 = 4t - 5w - 96, 3t - 4w - 94 = -22. Solve 4m = 2q - 26, 4q - 2m + m = t for q. 5 Let p be 0/(4 + -4 - 2). Suppose 5a - 5n = -4n + 18, -2n - 8 = -3a. Let s = -5 - -15. Solve p = 5y - 0j + aj - s, 2y - 3j = -19 for y. -2 Suppose -32o + 25o + 49 = 0. Solve -3b + 5b = -5i - o, 2 = -2b for i. -1 Let z = -1 + 3. Let v be (z - 0)(-6)/(-4). Let h be 8 - v/6-2. Solve h - 4 = 2p + 3r, 0 = -p + 3r + 7 for p. 4 Suppose -5b = -k - 7, 19 - 5 = 4k + b. Let u be (0 + 9)1/k. Solve 4m = -4q - 24, -uq + 2q - 10 = 3m for m. -2 Let a(j) = j*3 + 8j*2 + 8j + 11. Let d be a(-7). Solve ds = 2c + 20, 3c = -0c for s. 5 Let t(r) = r*2 + r + 2. Let w be t(0). Let d = w + 2. Suppose -2l = 2n + n - 47, -n - 92 = -5l. Solve -s - v + 15 = -4v, -dv = -s + l for s. 3 Suppose -5b - 7 = -4v, -3v = b - 16 + 6. Suppose -2g + 5w = -35, 3g - 6 = -w + 4. Solve -m = -2m - p + 1, gp - 29 = vm for m. -3 Let d = 12 + -10. Solve -du + 10 = 0, -m - 5u + 34 = -4m for m. -3 Let g = 55 - 53. Solve a - gx = 8, -x = 4x + 15 for a. 2 Let n = 7 + -15. Let m = -4 + -1. Let s = m - n. Solve -2t - 3q = 4, -t + st = -4q - 6 for t. 1 Suppose -4m + 2h + 117 = -h, 4m + 2h - 102 = 0. Suppose 3u - m = -3c, 2 = -0c - c. Solve 44 = -4d + 5f + 4, d = -4f + u for d. -5 Suppose 4c = y + 29 - 112, -5c - 3y = 91. Let z be 2/((c/(-8))/5). Let h be 1 + (1 - 2) + 2. Solve -35 = zs + 5k, s - hs - 14 = 3k for s. -5 Let j be (-72)/4214/(-4). Suppose 2v - 26 + j = 0. Suppose 0 = -4l - x + 3, 2x + 8 = -l - 0x. Solve -2z - 3s - 9 = 0, -4s - v = lz - 0s for z. -3 Let j(a) be the third derivative of a6/120 - a5/6 + 5a4/12 - a3 + 8a2. Let q be j(9). Solve -u + 7 = qv - 3u, 11 = 2v + 5u for v. 3 Let h(a) = -5a - 5a + 0 + 3a - 2. Let c be h(-1). Solve -4x + ct + 12 = t, -2x - 4t = 6 for x. 1 Let q(r) = r*3 - 5r*2 + r - 1. Let j be q(5). Solve -3p - 2x = -3, jx + 6 = -p - p for p. 3 Suppose -2i = 3i - 5. Suppose 2j + 12 = 2h, -4j + 0j - 20 = -3h. Let l = h + i. Solve 5z + 0 = -q + 4, q - 4z + l = 0 for q. -1 Let z(c) = c3 - 10c*2 + 12c - 22. Let k be z(9). Solve -4r - 3m - 1 = 7, 10 = -5r - km for r. -2 Let i be ((-18)/15)/((-3)/10). Solve -ih - 12 = 0, -5b + 5h + 9 = -6 for b. 0 Let y be 20/30 + (-10)/(-3). Solve 0 = 3j - 2m + 2, -5j = -0j - ym + 4 for j. 0 Let x = -3 + 7. Suppose xq - q - 12 = 0. Let s be 1/(q + -2)10. Solve -sb + 5z + 25 = 0, 0 = -0b - 4b + 2z + 10 for b. 0 Let s(b) = -b3 - 5b*2 + 4. Let m be s(-5). Solve l + 2a = ml - 1, 0 = 4l - 2a for l. -1 Suppose 2n + 2n = 264. Suppose n = -4f + 6f. Solve -2j = 5u - 16, 2j - 5u - 9 + f = 0 for j. -2 Let c(i) = 2i**2 - i - 4. Let j be c(3). Let l = j - 1. Suppose	{ "pile_set_name": "DM Mathematics" }
est value? (a) -7841 (b) -3335 (c) -0.9 b What is the second smallest value in -0.5, 4, 12, -2556, 0, 2, 5? -0.5 Which is the second smallest value? (a) -538.2 (b) 0 (c) 5 (d) -527 d Which is the smallest value? (a) 0.67 (b) -1/7 (c) -1436 (d) -1 c Which is the biggest value? (a) -0.5 (b) 0.23 (c) -1325.69 (d) -2/9 b What is the smallest value in 0.06, -0.2, -0.7, 0.5, 5/7, -0.6, -11? -11 What is the smallest value in 1/4, 294, 504.43, 1/5? 1/5 Which is the fourth smallest value? (a) -0.037 (b) 0.2 (c) 3/7 (d) -9/7 (e) 3.1 (f) 5 (g) 1 c Which is the biggest value? (a) 3/2 (b) -5 (c) 5009406 c Which is the smallest value? (a) -1/4 (b) -7900 (c) -0.07 (d) 5 (e) -2/243 (f) -5 b What is the fourth biggest value in -40, -4.6937, -0.3, 2/7, 0? -4.6937 Which is the smallest value? (a) 0.51 (b) 7 (c) 46 a Which is the fourth smallest value? (a) -1/9 (b) -3.0266 (c) 0 (d) 1/2 d What is the third biggest value in 0.1173, 815, -16? -16 Which is the third biggest value? (a) -0.2 (b) -0.02174574 (c) 10 a Which is the second smallest value? (a) -6305 (b) 2/23 (c) 375 b Which is the third smallest value? (a) 2/655 (b) 5 (c) 33 (d) 7/2 (e) -4 (f) -0.5 (g) 5/4 a Which is the biggest value? (a) -0.3 (b) -1889 (c) -0.017 (d) -59 (e) -0.4 c What is the second smallest value in -0.4133, 2/3, -3/5, 42, 7, 4? -0.4133 What is the smallest value in 9/8, -0.3, 2/3, 145635? -0.3 Which is the biggest value? (a) 6.15 (b) -4 (c) 0.4 (d) -74/9 (e) -1 a What is the third biggest value in -1/2, 7154/53, -598? -598 Which is the second smallest value? (a) -6 (b) 2/7 (c) -1/3 (d) -30/1309 (e) 0.12 c Which is the smallest value? (a) -0.031 (b) -4 (c) -38/3 (d) 0.04 (e) -2/51 c Which is the second smallest value? (a) -4 (b) 0 (c) -61 (d) 55 (e) -3/2 (f) -2/13 (g) 11 a What is the fifth smallest value in -0.036, -2/5, -4, 41.303, 3/5? 41.303 What is the second smallest value in 1, -0.09, -5, 2885? -0.09 What is the seventh smallest value in 13, -2009, -0.17, -5, 0, 4, -1? 13 Which is the second biggest value? (a) 2 (b) 1/10 (c) 4 (d) -81580 a What is the second biggest value in -16/265, 3845, 23? 23 Which is the second smallest value? (a) -5/3 (b) -1 (c) 1481 (d) -30.6 a What is the fifth smallest value in -72, 3.3, -2, -6, 3/7, 0.02? 3/7 What is the fourth biggest value in -3, -87, 29, -229? -229 Which is the fourth smallest value? (a) 237 (b) -15 (c) 5 (d) -189 (e) 0.3 c Which is the fourth biggest value? (a) 2.7 (b) 2 (c) 1 (d) 93/65 c Which is the third smallest value? (a) -4/9 (b) -2/41 (c) -2.6 (d) 5 (e) -151 a What is the third smallest value in -1.4, -3/29, 24.98? 24.98 What is the third biggest value in 3/4, 86, -0.10382, -0.3? -0.10382 What is the smallest value in 2, -0.1, 6, 1, 3/41, -51? -51 What is the biggest value in 24, -323543, -0.5? 24 Which is the second smallest value? (a) 3 (b) -188104 (c) -8 c What is the sixth biggest value in -1, -4, -2/23, -5, -3.934, -0.4, 2/9? -4 Which is the fourth biggest value? (a) 58 (b) 2/7 (c) 0.2 (d) 2/187 (e) 1/4 c Which is the sixth biggest value? (a) -81 (b) 0 (c) 28 (d) -0.4 (e) -0.3 (f) -0.2 a Which is the second biggest value? (a) 5 (b) -78.12139 (c) -6 c What is the third smallest value in -6, 3330, -199/2? 3330 Which is the third biggest value? (a) 422481 (b) -75 (c) -0.3 b What is the third smallest value in 6, 19, 1/1434? 19 What is the third smallest value in 11, -0.2, 1, -10.4677? 1 What is the sixth smallest value in 2/3, 649, -126, -4, 0.5, 1, 0.1? 1 Which is the third biggest value? (a) -2/15 (b) 3/113992 (c) -0.03 (d) 0.1 c What is the third smallest value in 12/5, -2, 1/5, -1, 438? 1/5 Which is the sixth smallest value? (a) -2 (b) 3 (c) 4 (d) -0.07 (e) -0.16 (f) -1/391 c What is the second biggest value in -0.05, 2, 0, -0.5, 241, 255/8? 255/8 Which is the second biggest value? (a) 9 (b) 0.4 (c) 4 (d) 19863.92 (e) 0.04 a What is the third biggest value in 0.4, -0.3, 1/510111, 14? 1/510111 Which is the second biggest value? (a) -20 (b) -3 (c) -19084 (d) -5 d Which is the fifth smallest value? (a) 26 (b) 14 (c) -2 (d) 3/2 (e) -120/11 (f) -0.3 (g) 0.01 d Which is the third smallest value? (a) 3/2 (b) 3/169 (c) 202 (d) -37 a What is the fourth smallest value in 495/7, 4, -2213, -14/5? 495/7 Which is the fifth biggest value? (a) 5 (b) -18.6 (c) -2/19 (d) 2 (e) -3/11 (f) 0.13 (g) 2/37 c What is the biggest value in -2/9, 0.08, -10.84, 2/7? 2/7 What is the biggest value in -2.4, 2/13, 1/7, 0.1, 0.05, 15/32? 15/32 What is the second smallest value in 1/127, -1269/8, -48? -48 What is the biggest value in -232, -17, -35, -2, 3/5, 2/3? 2/3 What is the third biggest value in -4/1987, -23/3, 0.4, 23.3? -4/1987 Which is the second biggest value? (a) -5587 (b) -0.03 (c) 5 (d) 2/3 (e) 1/10 (f) -2/3 d What is the smallest value in -2, -0.3, 2.3, -18, -4, -37/2? -37/2 Which is the fourth smallest value? (a) 34 (b) 3 (c) 1.22 (d) 1/52 (e) -1/4 b What is the third smallest value in -443, -28, -41? -28 What is the smallest value in -2927.7, -1/37, 0.2? -2927.7 What is the second biggest value in -696, -2, -75/17? -75/17 What is the second biggest value in -126, -38, -213/4, -1? -38 Which is the biggest value? (a) 0.032 (b) -2 (c) 137 (d) 290 d What is the second biggest value in 2/5, 0.14, 390, -17, -5? 2/5 What is the biggest value in -8284, 0.17, -19, -10? 0.17 Which is the biggest value? (a) -4/9 (b) -9608525 (c) -2/5 c Which is the third biggest value? (a) -5 (b) 0.494 (c) -11 (d) -0.23 (e) -46 a Which is the smallest value? (a) 581 (b) -1365 (c) 0.3 b Which is the smallest value? (a) -3.2 (b) -3/2 (c) -7/6 (d) -3 (e) 2/285 a Which is the sixth smallest value? (a) 2/3 (b) 3/7 (c) 0.1 (d) 14/3 (e) -3 (f) -16/1053 d Which is the smallest value? (a) 2/953 (b) -4 (c) 9/50 (d) -24 d What is the biggest value in -4/81, 0.0367, 9? 9 What is the smallest value in -0.1, -2/21, 0.02765, 4/5, -17? -17 Which is the smallest value? (a) -3 (b) -4/195 (c) -5 (d) 61 (e) 1230 (f) -0.3 c What is the smallest value in -3, -0.4, 0.76, -1, -3/8, 50, -1/16? -3 What is the fifth biggest value in 12, 22/5, 1, 5, -36416, 2? 1 Which is the smallest value? (a) 298/3 (b) -11 (c) 0.3 (d) 18 (e) 6 (f) 2 b What is the fourth smallest value in 69/5, -0.2, 0.4, 5, 24/5, -1/3? 24/5 Which is the second smallest value? (a) 4 (b) -120 (c) 3/11 (d) 3 (e) -1623 b Which is the second biggest value? (a) 24.477 (b) -191 (c) -2/3 (d) -0.4 d What is the smallest value in 2/27, 126, 0.06, -0.5, -1, 10/71? -1 Which is the third smallest value? (a) 0.3 (b) 0.5 (c) 1/40 (d) -33/1370 (e) -2 c Which is the second smallest value? (a) -2 (b) 1/5 (c) 18 (d) -5 (e) -1 (f) -1.97 (g) -2/7 a What is the fourth biggest value in 0, -724, -2/257, -4/3? -724 Which is the sixth smallest value? (a) 39 (b) -1/3 (c) 5 (d) -70 (e) 4 (f) -147 a Which is the third biggest value? (a) 3/11 (b) -5 (c) 9537956 b What is the second biggest value in -0.14, 4, 7/4, 109, -4, -11, -2? 4 What is the sixth biggest value in 0.4, 0, 22673, -2/57, 1, -1/2? -1/2 Which is the fourth biggest value? (a) 231 (b) -1/2 (c) -2 (d) 0.133056 c Which is the third biggest value? (a) 5 (b) 19441813 (c) -4 c Which is the third biggest value? (a) -74/13 (b) -0.7 (c) -0.5 (d) 1.88 b What is the fourth smallest value in -1, 3, -25/676, -5, 5/19, 1/9, 0? 0 Which is the third biggest value? (a) 36.332 (b) 21 (c) 9/53 c Which is the smallest value? (a) 4 (b) -23456 (c) 23/3 b Which is the biggest value? (a) 64.3 (b) -9.45 (c) 0.2 (d) 5 (e) -0.4 (f) -4 a What is the biggest value in -2, 15.1, 1.99, 4, 0.5, 2, -1? 15.1 Which is the third smallest value? (a) -418802 (b) 4/7 (c) 1.54 c What is the smallest value in 1/173, 1, 121964? 1/173 What is the biggest value in 5, 0.3, 1, 4, 0, -2302392? 5 What is the second smallest value in 41/5, 162, 0, -0.2, 1? 0 Which is the third smallest value? (a) -3/2 (b) -6 (c) 0.253 (d) 5 c Which is the smallest value? (a) -6 (b) 3985 (c) 0.3 (d) -4 (e) -0.3 a Which is the second biggest value? (a) -0.2 (b) 12.134 (c) 8.1 c	{ "pile_set_name": "DM Mathematics" }
30 Suppose -3j + 0 = -9. Let t(l) = -l3 + 10l*2 + l - 14. Let d be t(10). Let c = 7 - d. What is the lowest common multiple of c and j? 33 Suppose 5i - 20 = i, -4l = 2i - 18. Let b(t) = t*2 + 3t - 30. What is the least common multiple of l and b(-8)? 10 Calculate the common denominator of (-17 + 1900/80)2/(-120) and 37/8. 80 Suppose 5r + 45 = 2b, 2b - 54 = 4r - 12. Suppose bd + 80 = 19d. Calculate the smallest common multiple of d and 20. 20 What is the common denominator of (5280/1872)/(-6(-4)/9) and 48/13? 52 Let w(m) = -m*3 + 943241. Let t be w(0). Let c = t - 7560919/8. Let d = c - -1880. Calculate the common denominator of d and -13/9. 72 Let x = 11 - 14. Let i = x - -19. Calculate the least common multiple of i and 6. 48 Let o be (-3)/(-4)(-208)/378. Let a = -13/42 + o. Find the common denominator of ((-9)/30)/(161/(-79) + 2) and a. 90 Suppose 3b - 39b + 2520 = 0. What is the smallest common multiple of b and 7? 70 Let c = -17 - -22. Suppose cx - 24 = -9. Suppose 0 = -d - x, -k - 2d = -5d - 17. What is the smallest common multiple of 7 and k? 56 Suppose 16f - 844 = -2v + 14f, -f = 3v - 1276. Calculate the least common multiple of v and 7. 427 Suppose -18p = -81p + 1008. What is the lowest common multiple of p and 386? 3088 Let n = -65/16 - 299/16. Suppose -t + 220 = 5y, -4 - 11 = -3t. Suppose -r = 5, -3s + r - 2r = -y. Find the common denominator of n and s. 4 Let r be (-7 + 17)(-2)/(-5). Let v(q) = q*2 + 3q - 8. Calculate the smallest common multiple of 6 and v(r). 60 Let z = 244 + -239. Let s(d) = d*3 - 11d*2 - 11d - 8. Let f = 16 - 4. Calculate the least common multiple of z and s(f). 20 Let y be (-2 + 26)/((-6)/15). Find the common denominator of 67/2 and (-6)/12 + (-333)/y. 20 Let c be (-18)/(-45) + 613/(-55). Let v = c + 114/11. What is the common denominator of -49/20 and v? 220 Suppose -2r + 37 = -251. What is the lowest common multiple of r and 40? 720 Let a(q) = -5q + 26. Let b be a(5). Let p = -24 + 40. Calculate the lowest common multiple of (66/3 - 0)/b and p. 176 Let c(f) = f*3 - 6f*2 + 3f + 2. Let q be c(4). Let r = q + 37. Calculate the smallest common multiple of r and 2. 38 Suppose 0 = 2y, 10 + 10 = 2f + 5y. Let k(p) = -5 - p + 5p + 0p. Calculate the smallest common multiple of k(4) and f. 110 Suppose -53h = -68h + 5400. What is the least common multiple of 40 and h? 360 Suppose -w = -3m + 274, 14m - 4w - 459 = 9m. What is the least common multiple of m and 52? 364 Let p = 400 - 145. Find the common denominator of p/(-50)1/(-6) and ((-4)/(-28))/(4/(-150)). 140 Let m = 2909/238 - 260/17. Calculate the common denominator of -113/50 and m. 350 Let l = -319/30 + 54/5. Calculate the common denominator of l and 53/66. 66 Let u(b) = 2b2 - b - 5. Let t be 336/(-105) + 1/5. Let s = 43 - 25. What is the least common multiple of s and u(t)? 144 Let y(u) = 4u + 2. Let x be y(2). Let b be ((-92)/x)/((-12)/30). Find the common denominator of -89/20 and (b/32)/(9/36). 40 Let n = -1204 + 1224. Calculate the lowest common multiple of 88 and n. 440 Calculate the lowest common multiple of 8 and (-3199)/(-23) + (-60)/690. 1112 Let o = -38 - -53. Let k = 484 + -455. Let w = k - o. What is the smallest common multiple of 10 and w? 70 Suppose p = 2i + 437, 2p + 2i - 5i - 874 = 0. Let l = p + -967/2. Calculate the common denominator of l and -7/8. 8 Suppose 40 = -3t + 82. What is the lowest common multiple of 56 and t? 56 Find the common denominator of 51/6(-10)/45 and -113/10. 90 Let n = -24 - -29. Find the common denominator of 63/2 and ((-78)/(-195))/((-9)/n). 18 Let z(t) = 2t3 - 3t*2 + 2t - 3. Let a be z(2). Suppose ar - 126 + 46 = 0. What is the smallest common multiple of r and 4? 16 Suppose -18z + 12z + 15324 = 0. Let x = 10133/4 - z. Find the common denominator of -12 and x. 4 Suppose -2o = -3d + 2o - 257919, 0 = 4d - 5o + 343892. Let a = 39289642/457 + d. Let y = -36521/10054 - a. What is the common denominator of y and -3/10? 110 Let n = 4215 + -25201/6. What is the common denominator of n and -79/20? 60 Let q = -6 - -8. Suppose 3t + 20 = -qw + 3w, -2t = 8. Suppose 5j = 45 - 0. Calculate the lowest common multiple of w and j. 72 What is the lowest common multiple of 10 and (-1 - -6 - 4)-3 + 13? 10 Let o(z) = z3 - z - 22. Let p be o(0). Let c = p + 24. Calculate the lowest common multiple of 3 and c. 6 Let d = -2/3951 + -125111/7902. Find the common denominator of 3/4 and d. 12 Find the common denominator of ((-13)/(-30))/((-209)/(-836)) and 37/30. 30 Let w(a) = -a2 - 12a + 1. Let x = -261 - -276. Calculate the lowest common multiple of w(-11) and x. 60 Let a(l) = -10l*2 - l - 5. Let t be a(-8). Find the common denominator of 67/8 and ((-2)/(-4))/(28/t). 8 Suppose 45 = 4w + 9. Calculate the common denominator of -101/44 and 553/(-6)w/(-330). 44 Let y = 23 - 6. Let f = 19 - y. What is the common denominator of -1/4 and (-315)/120 + 8/f? 8 Calculate the common denominator of -55/87 and ((-2)/(-324)9)/(29/417). 174 Suppose 6i - 85 = 23. Let t = 20 - 18. What is the smallest common multiple of i and (-13)/26(-8)/t? 18 Let p = 5560 - 1039749/187. Find the common denominator of 39/22 and p. 374 Let q(i) = i2 - 9i + 44. What is the least common multiple of 110 and q(0)? 220 Let v = 4094 + -24487/6. Find the common denominator of v and 69/62. 186 What is the common denominator of -41/85 and (43/43)/(9/(-29))? 765 Suppose -6 + 2 = 5s + 4t, -5s - 2t = 2. Suppose b - 7 - 4 = s. Let k(m) = m*2 - 10m - 5. Calculate the least common multiple of k(b) and 2. 6 Let j = -407 - -411. What is the lowest common multiple of 18 and j? 36 Suppose 2d + 2k - 28 = 34, -4d - 3k + 129 = 0. Let l(u) = 11u2 - 88u + 3. What is the least common multiple of l(8) and d? 36 What is the lowest common multiple of (-85)/51 + 17/3 and 20? 20 Suppose 4v - 4d = d + 34, 0 = v - 5d - 16. Let i(c) = c + 46. What is the smallest common multiple of i(-4) and v? 42 Suppose 28s + 8 = 29s. What is the least common multiple of 66/15 + 2/(-5) and s? 8 Find the common denominator of -3 + 80/24 - (-386)/(-402) and -41/6. 402 Suppose 5n - 2n + 2o = 23, -3n - 5o = -26. Suppose -5d - 99 = -4x + 161, -4x - 2d + 288 = 0. Calculate the smallest common multiple of n and x. 70 Let n(z) = 9z + 2. Let k be n(-3). What is the common denominator of (-25 + -2)(-10)/k and 31/8? 40 What is the smallest common multiple of ((-11)/(572/39))/((-3)/24) and (-2)/(0 + 1)-11? 66 Let o = 162/739 + -8927/226134. Calculate the common denominator of o and 73/136. 1224 Let i = -49133/37620 + 1/2090. Calculate the common denominator of i and 113/6. 36 Let z = -181 - -295. Let o = 156 - 148. Calculate the common denominator of -12/5 and -9 - -13 - z/o. 20 Let p be (-2)/7 + (-1920)/315. Let f = 209/28 + p. Calculate the common denominator of 85/4 and f. 12 Calculate the common denominator of 23/70 and ((-214)/20)/(21/5). 210 Let m = 49781/8 + -6214. Calculate the common denominator of 33/791 and m. 6328 Let l = -2 - 6. Find the common denominator of 119/20 and (10/(-12))/(3l/36). 20 Let f = -46051/12 + 3842. Calculate the common denominator of f and -145/402. 804 Let m = 40 - 28. Suppose 1 = -4u + 9. What is the smallest common multiple of u and m? 12 Let f(g) = g2 - 5g*2 - 3 + 7g*2 - 6g - 2g2. Calculate the least common multiple of f(8) and 10. 130 Let x = 323/26 - 3637/208. Let b be (-1)/(-1) - (-167897)/(-22). Let i = b - -7628. Calculate the common denominator of i and x. 176 Find the common denominator of 0 - 0 - 77/(-6) and (-474)/(-8)66/(-2277). 138 Let j = -7429/732 - 57/61. Calculate the common denominator of -63/20 and j. 60 Let g be 16/16 - 1(-63)/(-3). Suppose -72 = -3v + 6v. Let j = g - v. What is the lowest common multiple of 14 and j? 28 Let v be 617/(-1)3/(3/(-2)). Let l = -22289/18 + v. Find the common denominator of l and 115/14. 126 Let y be (-13 + 4)/(6/(-66)). Let o = 119 - y. Calculate the least common multiple of (46 + 0)/((-2)/(-4)) and o. 460 Let k = 5147/2 - 2541. Let d = -2683/2388 - -8/199. What is the common denominator of k and d? 12 Let i be 1515/8658 + (-4)/24. Let t = i + -19777/6734. Calculate the common denominator of t and -6	{ "pile_set_name": "DM Mathematics" }
be the first derivative of f*2 - 3f - 2. Suppose 2d - 3d = 0. Suppose 2c + 0c - 10 = d. Determine ca(h) + 4s(h). -2h + 1 Let m(r) = r. Let u(y) = -8y + 8. What is 6m(b) + u(b)? -2b + 8 Let a(p) = -p*3 - 2p*2 - 3p + 1. Let q(i) = 4i3 + 6i*2 + 10i - 3. What is -7a(z) - 2q(z)? -z*3 + 2z*2 + z - 1 Let z(f) = -2f*3 + 7f*2 + 5f - 4. Let b(h) = -2h3 + 8h*2 + 6h - 5. Give 4b(q) - 5z(q). 2q3 - 3q*2 - q Let l(k) = -k. Let d(i) = 2i*2 - 5i - 7. Let u(t) = -t*2 + 3t + 4. Let j(b) = -6d(b) - 11u(b). Calculate -j(m) + 3l(m). m2 + 2 Let q(p) = 44p*2 + 5p. Let v(a) = -770a2 - 88a. Determine -88q(s) - 5v(s). -22s2 Let u be ((0/(-2))/2)/(-1). Let b = -4 + u. Let o(n) = -2n + 5. Let f(q) be the second derivative of q3/6 - q2/2 + 9q. Give bf(v) - o(v). -2v - 1 Let q(h) = h. Let u(w) = 5w. Calculate 6q(b) - 2u(b). -4b Let r(l) = -8l*3 + 2l*2 - 2. Let w(k) = 129k*3 - 33k*2 + 33. Give 33r(o) + 2w(o). -6o*3 Let u = 8 + -6. Suppose 3r - 2 = -4y, ur = r + 3y - 21. Let f(t) = 9t - 6. Let d(p) = -8p + 5. Calculate rd(x) - 5f(x). 3x Let w(a) = -a*2 - 4a + 2. Let t(l) = 6l + 3l*2 - 4l*2 + 0l*2 - 9l + 1. What is -4t(v) + 3w(v)? v*2 + 2 Let z(f) = -1 - 11115f - 1 + 11113f + 3f*2. Let w(p) = 7p*2 - 3p*3 - 5p - 4 - p*3 + 3p*3. Give 2w(v) - 5z(v). -2v3 - v2 + 2 Let b(v) = -v + 1. Let s(a) = -a - 1. Let t be 2/((-2)/1) - -6. Suppose x + 13 = 5x - y, -ty - 21 = 2x. Let u be -1(-1)/(-2)x. Calculate ub(l) - s(l). 2l Suppose 3p = -2p - 2y + 9, 4p - 4y = -4. Let f(a) = a*2 - 15a - 6. Let w be f(15). Let o(b) = -2b - 7. Let j(h) = -1. Calculate po(t) + wj(t). -2t - 1 Let f(p) = -p - 6. Let g be f(-12). Let h be 6(-4)/18g. Let t(d) = 11d3 + 5d*2 - 5. Let v(q) = -17q*3 - 8q*2 + 8. Determine ht(k) - 5v(k). -3k*3 Let y(i) = -3i*3 - 5i*2 + 5i + 5. Let q(b) be the second derivative of -b5/20 - b4/6 + b3/3 + b2 - 2b - 1. Determine -5q(w) + 2y(w). -w3 Let i(l) = -l3 + l2 + l. Let z(y) = -8y*3 + 6y*2 + 6y. Let b(u) = -u*2 - 17u - 58. Let d be b(-13). What is di(o) + z(o)? -2o*3 Let i(q) = -21q - 4q + 4 + 17q. Let t(k) = 2k - 1. Let o = 6 - 4. What is oi(r) + 9t(r)? 2r - 1 Let l be ((-8)/(-6))/(4/6). Suppose 3h = 4y + 35, -7 = ly - 3h + 12. Let r(s) = -2s3 - s2. Let w(z) = 6z*3 + 2z*2. Determine yr(q) - 3w(q). -2q*3 + 2q*2 Let n = 3 + 7. Let f be -5((-12)/n)/(-1). Let q(i) = -1 + 2i + 0i - 2i - i. Let j(g) = -g2 - 6g - 4. Calculate fq(r) + j(r). -r2 + 2 Let h(l) = -l2 - 1. Let r(n) = 0n + 5n2 + 4 - 2n*2 - n - n + 2n*3. What is -3h(s) - r(s)? -2s3 + 2s - 1 Let o(b) = 6b2 + b + 5. Let d(i) = -10i*2 - 3i - 10. Let u(m) = -7m2 - 2m - 7. Let y(v) = -5d(v) + 7u(v). What is o(n) - 5y(n)? n2 - 4n Let c = -4 - -7. Suppose -5v = -cv + 2. Let b(u) = -u2 - 1. Let x(p) = -p3 + 6p2 + 3. Give vx(o) - 5b(o). o3 - o2 + 2 Let d(p) = 3p + 270p2 + p3 - 4p - 268p2. Let l(t) = 4t*3 + 11t*2 - 5t. Determine 11d(k) - 2l(k). 3k3 - k Let w(r) = -3r + 4. Let c be (3/6)/((-1)/8). Let j(m) = 3m - 8. Let d(x) = 3x - 7. Let h(u) = cj(u) + 5d(u). Determine 4h(f) + 3w(f). 3f Let b(c) = -4 - 8c + 4 + 8 + 2c2. Let f(a) = a2 - 5a + 5. Suppose -2m = 5s - 9, -m - 2s = -4m - 15. Let v = m + 8. Calculate vb(x) - 8f(x). 2x2 Let d(m) be the first derivative of 2m*3/3 + 3m - 1. Let u = -24 + 26. Let g(p) = -3 + 17p - 1 - 17p - up2. What is 5d(x) + 4g(x)? 2x*2 - 1 Let k(x) = -x - 1. Let g be k(5). Suppose 0 = -3s + 16 + 35. Let m(c) = 23c2 + 11c - 6. Let z(p) = 8p2 + 4p - 2. Determine gm(a) + sz(a). -2a2 + 2a + 2 Suppose 5k + 1 = -3v - 0, -k - 5v = 9. Let w(r) = 1 + 0 + 5r + k. Let j(t) = -14t - 6. Give -3j(b) - 8w(b). 2b + 2 Let g(y) = 2y2 + 3. Let h(p) = 3p*2 + 5. Let f = 0 - -3. Let c = 36 - 41. Give cg(k) + fh(k). -k2 Let i(b) be the third derivative of -b5/15 - 5b4/24 - b3/6 - 27b2. Let g(f) = f2 + f. Give 6g(k) + i(k). 2k2 + k - 1 Let b(h) = 2h. Let w(r) = -r. Let q(y) = b(y) + 3w(y). Suppose 0 = -12c + 4c - 8. Let x(f) = f2 - 1. What is cx(m) + 2q(m)? -m2 - 2m + 1 Let u(k) = k. Let f(h) = -1. Let y(q) = 5q + 3. Let c(a) = -4f(a) - y(a). Suppose 2b - 7b = -10. Give bc(x) + 11u(x). x + 2 Let j(n) = -n*2 + 2n. Let y(l) = l*3 + 3l*2 - 5l. Calculate -15j(b) - 6y(b). -6b3 - 3b*2 Let t(i) = -6i*2 + 23i + 20. Let s = 2 - 5. Let f be 34(s/6)/(-1). Let a(o) = -2o2 - 7 - o2 - 8o + 5o*2. Calculate fa(l) + 6t(l). -2l*2 + 2l + 1 Suppose -4p + 13 = g, -5p = -2p - 5g + 19. Let t(i) = -3. Let d(x) = x*2 - 4. What is pd(m) - 3t(m)? 2m*2 + 1 Let p(l) = -3l*2 - 7l + 2. Let i(m) = -m*2 + m - 1. Let a(n) = -6n*2 + 3n - 4. Let b(r) = -a(r) + 5i(r). Calculate 7b(h) + 2p(h). h2 - 3 Let j(p) = p + 1. Let i(q) = -2q*2 + q - 1. Let t be 6/(-9) + (-3)/9. Give tj(b) + i(b). -2b2 - 2 Let q(k) = 134k*2 - 8k - 2. Let h(m) = 89m2 - 5m - 1. Give -8h(u) + 5q(u). -42u2 - 2 Let m(g) = -g2 + g. Let w be m(3). Let z(s) be the second derivative of 7s4/12 + s3 + 3s2 + 2s. Let k(a) = -a*2 - a - 1. Give wk(i) - z(i). -i*2 Let w(m) = 4m + 5. Suppose 2n = -3n + 10. Let h(v) = 9v + 11. Give nh(g) - 5w(g). -2g - 3 Let l(k) = -k*3 + k - 1. Let z(o) = 7o*3 - 4o + 4. Let c(d) = d*2 - 5d - 15. Let j be c(7). Give jz(w) - 6l(w). -w*3 - 2w + 2 Let b(i) be the second derivative of 5i3/6 + i2 + 36i. Let z(v) = v + 1. Calculate -b(o) + 4z(o). -o + 2 Let t(a) = a2 + 2a - 1. Suppose y + 11 = 3. Let b(x) = -2x2 - 5x + 2. Determine yt(f) - 3b(f). -2f2 - f + 2 Let j(n) = -n2 - 4n - 4. Let l(w) = -3w - 2. Let r be l(-2). Suppose rc - 8 + 0 = 0. Let g(x) = -1 + x*c + 2x + 4 + x. Give -4g(i) - 3j(i). -i*2 Let v(n) = 40n*2 + 10n - 10. Let l(w) = 13w2 + 3w - 3. Calculate 10l(x) - 3v(x). 10x2 Let x(i) = i3 + i2 - i. Let k(f) = -12f*3 - 7f*2 + 13f + 1. Let s(w) = -11w3 - 7w*2 + 12w + 1. Let u(v) = -6k(v) + 7s(v). Give -u(m) - 6x(m). -m3 + m2 - 1 Let a(z) = -z - 2. Let r(c) = 4c + 8. Suppose 8 = -3v + 2. Let h(p) = -p3 + 5p*2 + 11p - 6. Let f be h(7). Let s be 1/(6/f)2. Determine sa(m) + vr(m). m + 2 Let a(u) = -u - 4. Let t be 8/(-6)(-3 - -6). Let x be a(t). Let d(s) = x + 3 - 6s + 4s. Let y(n) = n - 2. Give -4d(w) - 6y(w). 2w Let s(g) = -6g + 7. Let t(z) = 5z - 6. Suppose -6m + 2m = -8. Let k(r) = ms(r) + 3t(r). Let j(b) = 7b - 9. Give 4j(n) - 9k(n). n Let t(z) = -36z2 + 9z - 9. Let x(p) = 9p2 - 2p + 2. Give 2t(l) + 9x(l). 9l2 Let c(i) = 2i + 3. Let g(j) = 7j + 11. Give -22c(z) + 6g(z). -2z Let a(o) = o + 36. Let p(u) = -11. Let i(m) = 4a(m) + 13p(m). Let v(l) = 2l. Let g(s) = -s. Let d(z) = 3g(z) + v(z). Determine 6d(f) + i(f). -2f + 1 Let j be (-2)/(-3) - (-26)/6. Suppose -4v + jv + 9 = 0. Let n(q) = -5q3 - 2q*2. Let a(p) = -21p*3 - 9p*2. Give vn(g) + 2a(g). 3g*3 Let g(q) = 4q + 3. Let b(i) be the third derivative of -i4/24 - i3/6 + 23i2. Calculate 6b(r) + 2g(r). 2r Let o(g) = -3g3 - g2 - 4. Let r(j) = 5j*3 + 2j*2 - j + 7. What is -7o(v) - 4r(v)? v3 - v2 + 4v Let g(a) = -2a2 + 2a + 9. Let m(l) = 3l2 - 5l - 19. Calculate -5g(u) - 2m(u). 4u2 - 7 Let j(y) = 9y*3 - 13y*2 + 13. Let p(z) = -9z3 + z2 - 6. Let o(f) = 5f3 + 3. Let u(g) = -5o(g) - 3p(g). What is -6j(v) + 26u(v)? -2v*3 Let f(m) = -9m3 + m2 - 2m + 5. Let o(r) = 10r3 - r2 + 2r - 6. What is -6f(u) - 5o(u)? 4u3 - u2 + 2u Let x(f) = 19. Let d(c) = -c + 1. Let k(n) = -6d(n) + x(n). Let s(j) = -3j - 6. Give -6k(p) - 13s(p). 3p Let f(b) = b2 - 7. Let x(j) be the second derivative of j2/2 + 16j + 1. Determine -6f(i) - 42x(i). -6i*2 Let k(m) = -2m*2 - 5m - 9. Let b(w) = -w. Determine 6b(l) - k(l). 2l*2 - l + 9 Let v(d) = -2d - 4. Let w(k) = -k - 5. Let c be (32/28)/((-4)/(-14)). Determine cw(b) - 5v(b). 6b Let k(j) be the first derivative of 13j*2/2 - 13j + 61. Let w be -1 + 1 - 0 - 7. Let m(d) = 9d - 9. Determine wm(i) + 5*k	{ "pile_set_name": "DM Mathematics" }
Is h(5) a multiple of 13? True Let b(m) = m*2 + m - 4. Let s be b(-4). Suppose 0 = 3g - sg + 80. Suppose -g - 12 = -2t. Is t a multiple of 7? True Let f(l) = -l*3 - 5l*2 - l - 2. Let c be f(-5). Suppose 0 = -30z + 28z + 6. Suppose 2x = 5i + 85, zi - 58 = -cx + 38. Does 19 divide x? False Let q be (1-43)/(-1 + 2). Let f be -4 + 3 + -3 + 77. Let p = f + q. Is p a multiple of 13? False Is (-5)/(20/(-52)) - 3 a multiple of 3? False Let v = -5 + 4. Is 12 a factor of (-3)/((-3)/(-12)v)? True Let r = -4 - -8. Let d be r/(-6) + 164/3. Suppose d = 5v - 46. Is v a multiple of 10? True Let s = 25 - 18. Is 2 a factor of s? False Suppose 2w = t + 8, -4w + 0w - 2t = -16. Let k be 88/(-14) - w/(-14). Is 10 a factor of ((-15)/10)/(k/64)? False Suppose -3b + n = 84 - 272, 0 = 2b - 5n - 108. Suppose -76 = -4x + 2x + 5u, b = 2x - 2u. Does 14 divide x? True Suppose -3 + 2 = -w. Let m = 2 + w. Is 3 a factor of m? True Let o(i) = i*3 - 2i*2 + 2i - 1. Let h be o(2). Suppose 0 = -hk - k + 68. Is 17 a factor of k? True Suppose -3l + 14 = -31. Is 5 a factor of l? True Let g(i) = 4i + 3. Let d be g(-6). Is 12/16 - d/4 a multiple of 6? True Let x(c) = c2 - 6c - 5. Let p be 4/16 - 27/(-4). Let h be x(p). Suppose 2i - 42 = h. Does 11 divide i? True Let j = -197 + 401. Suppose -y - j = -4y. Does 29 divide y? False Is 16 a factor of ((-4)/(-6))/((-8)/(-228))? False Let f(y) = -y*3 + 4y*2 + 4y - 4. Let x(p) = -p*2 + 5p + 2. Let s be x(5). Let m be ((-3)/(-9))/(s/24). Does 5 divide f(m)? False Suppose -4g - 6 = -3o + 5o, -3o - 25 = -2g. Let k(v) = 7 + v + 4 - 1. Is 3 a factor of k(o)? True Let s = 16 - 11. Suppose -m - 3 = -2, -5u - sm + 70 = 0. Does 11 divide u? False Suppose 67 = 2f + 5c, 0 = 5f + c - 19 - 206. Suppose -f - 71 = -3y. Is 17 a factor of y? False Let w = -4 + 3. Let j(x) = -6x*2 - x. Let i be j(w). Is 19 a factor of i/30 - 290/(-12)? False Let s be -1(-6)/(-3) + 1. Let h be (-2 - 0)(0 + s). Suppose 0 = hd - 11 - 39. Is 7 a factor of d? False Let f(n) = n*3 + 15n*2 + 14n + 10. Is f(-14) a multiple of 7? False Suppose 0 = 4x + 5y - 245, -3x - y = -106 - 64. Is 11 a factor of x? True Let c be 1 + 27 + (-1 - 1). Suppose -5j = -a + 4a - c, 4a - 3j - 54 = 0. Is 10 a factor of a? False Let s(k) = -k3 + 0k*2 + 8k*2 - 2 + 10k + 7 + 1. Is 6 a factor of s(9)? False Suppose 2l = 4z + 22, 5z - 3l + 34 = -7l. Is z/420/(-3) a multiple of 5? True Let p = 91 + -71. Is p a multiple of 5? True Suppose 2u = 3h - 51, 5h - 9 = -2u + 76. Does 17 divide h? True Let d = -10 - -40. Does 12 divide d? False Suppose -18 = 3c + 12. Let l be (-526)/c + 21/(-35). Suppose 4u - l = -0u. Is 13 a factor of u? True Let y(t) = 19t3 - t2. Is 5 a factor of y(1)? False Suppose 20 = a - 4v, 4v = 2a - 4a + 4. Is a a multiple of 8? True Let z be (-6)/(-21) - 23/7. Let p(j) = j - 2. Let s be p(2). Let i = s - z. Does 3 divide i? True Suppose -3x + 4 + 2 = 0. Let r(b) = -b2 - b + 2. Let d be r(-2). Suppose d = -2z - 2, 5k + xz - 35 = -3z. Is k a multiple of 8? True Let j(y) = -35y + 1. Let a(o) = -o*3 - 2o*2 + o. Let p be a(-2). Let n be j(p). Let w = n - 41. Is w a multiple of 12? False Is 16 a factor of 211/((-4)/30 + (-153)/(-135))? False Suppose 6j - j = 20. Let a(k) = -k*2 + 4k + 4. Is a(j) a multiple of 2? True Let q(w) = 71w. Let s be q(2). Let h = -88 + s. Suppose 4u = 50 + h. Is u a multiple of 9? False Suppose 0h - 5p = h - 36, -4h = -3p - 98. Is h a multiple of 4? False Let q be 6/3 - 1 - -8. Suppose -p + q = -6. Does 4 divide p? False Suppose w + 5g = 4g + 8, -20 = -4g. Let h(o) be the third derivative of o6/120 - o5/30 - o4/12 + 2o*2. Is h(w) a multiple of 2? False Let m be (6/(-3))/(6/9). Let r(t) = -3t3 - t2 + 4t - 1. Is 24 a factor of r(m)? False Let u(o) = -o3 + 8o*2 - 1. Is 12 a factor of u(7)? True Suppose -2i + 3g - 12 = 0, -3i + 5i - 4 = -5g. Let l(t) = 3t2 + 2t - 2. Does 11 divide l(i)? False Let g = -19 + 11. Suppose 0 = -10c - 11 - 149. Let n = g - c. Is 8 a factor of n? True Let h(v) = v3 + 6v*2 + 3v - 1. Let q be ((-8)/6)/((-2)/(-12)). Let s(u) = u + 4. Let f be s(q). Is 9 a factor of h(f)? False Let g = -22 - -24. Suppose -4u + g + 74 = 0. Is u a multiple of 4? False Let j(k) be the second derivative of -k5/20 - k4/2 - k3/3 - 9k*2/2 - 2k. Let i be j(-6). Suppose 37 = 3h - 4v, -iv = -9 - 6. Is h a multiple of 6? False Suppose -4 = -2h - 2. Let j(m) = 30m - 1. Let b be j(h). Let n = 46 - b. Is 11 a factor of n? False Let h be 1 + -1 - (1 - 3). Suppose -hz = -0z - 144. Let b = -38 + z. Does 13 divide b? False Is (0 - 3)/(3/(-18)) a multiple of 9? True Suppose 4q = -5f - 79 + 241, -q + 3f = -32. Suppose q = 5h - 17. Let u = h - 5. Is u a multiple of 5? False Let v = 55 - 32. Does 20 divide v? False Let w = -16 + 38. Is 8 a factor of w? False Let o(v) be the third derivative of -v6/120 - v4/24 + 5v*3/3 - 3v*2. Is o(0) a multiple of 9? False Suppose 0b + b - 2 = -y, 4y - 17 = -b. Suppose yl = 4l + 6. Is 6 a factor of l? True Let j(v) be the first derivative of v5/30 + v4/12 - v3/3 - 2. Let k(f) be the third derivative of j(f). Is k(5) a multiple of 11? True Suppose 3r - 7 = -1. Suppose 4v - 20 = -4q - 0q, rv = 3q. Suppose 14 = 2j - 2f, 5 = j - qj + 5f. Is 5 a factor of j? True Let k(u) = -u2 - 10u + 9. Does 4 divide k(-10)? False Suppose -9 - 20 = -b. Is b a multiple of 10? False Let x(a) = -31a + 2. Let c be x(-2). Suppose -2h = -0h - c. Is 11 a factor of h? False Let s = -61 - -74. Is s a multiple of 7? False Let u(v) = v3 - 3v + 2. Does 18 divide u(4)? True Is 2 + 29 + 0 + -1 a multiple of 10? True Let s = 10 - 2. Let g(x) = 4x - 9. Does 20 divide g(s)? False Let m = -54 - -114. Suppose -6y + m = -y. Does 8 divide y? False Let i(v) = 0v2 + v3 - 5v*2 - 2 + 0 - v. Let q be i(4). Let o = q + 31. Does 6 divide o? False Let h(t) = -6t - 1 - 1 + 4. Is 14 a factor of h(-5)? False Let n = 36 + -5. Is n a multiple of 31? True Let l be ((-87)/(-12))/(1/(-4)). Let p be l + -7 + -1 + 1. Does 2 divide (4/(-6))/(8/p)? False Let y = 11 - 11. Suppose 3h + 3 - 45 = y. Does 8 divide h? False Is ((-84)/(-49))/((-2)/(-7)) a multiple of 6? True Let n = 19 + 6. Let g = n + -13. Is (-15)/(-4) - (-3)/g even? True Let a = 22 + -22. Suppose -4m + 54 - 6 = a. Does 12 divide m? True Let r = 104 - 316. Let o be 1/2 - r/8. Suppose 3w - 177 = -o. Is w a multiple of 17? False Let n be ((-2)/(-4))/((-2)/(-312)). Does 17 divide 12/n + (-1322)/(-26)? True Let j(m) = m2 - 8m + 19. Let r be j(9). Suppose 6u - 20 = 4u - 5y, 0 = 4u - 4y + 16. Suppose -4q + r = -uq. Is q a multiple of 2? False Does 11 divide (-4)/12 - (-597)/9? True Let p = -23 + 25. Suppose -ph = -0h - 12. Does 3 divide h? True Let m = 12 + -23. Let b(c) = c2 + 10c + 4. Is 10 a factor of b(m)? False Let k(v) = v*3 - 2v*2 - 5v + 4. Let h be k(3). Let i = h + 7. Is 5 a factor of i? True Let q = 47 - 41. Does 2 divide q? True Let p(k) = k*3 - 8k*2 - k - 10. Let u be p(8). Let z be ((-63)/u)/((-1)/6). Let h = 65 + z. Is 17 a factor of h? False Let w = -6 + 15. Is 3 a factor of w? True Suppose 0 = -0w + 4w - 8. Let p(y) = -y + 0y + 0y + 19y*3 + wy*2. Is p(1) a multiple of 15? False Suppose 5q - 2q = -36. Does 23 divide ((-77)/3)/(4/q)? False Suppose 0 = 4t - 5v + 17, -2t + 2v = t + 11. Let p = t + 7. Suppose w - k = pk + 33, 2k + 132 = 4w. Is w a multiple of 12? False Let b(y) = -6y. Let a be 1-3 + (-2)/(-1). Is b(a) even? True Let r = -15 - -43. Suppose s - r = 7. Is 8 a factor of s? False Does 10 divide (-2 - (-65)/30) + 190/12? False Let c(m) = m*2 + 3. Let w be c(0). Suppose u - w = -0u. Suppose 0 = -2r - ur + 95. Is r a multiple of 7? False Let b(k) = 10k3 - 4k2 + k + 2. Does 17 divide b(2)? True Let c(i) = -i3 + 10i2 + i + 6. Let w be 1 + -1 - 10-1. Is c(w) a multiple of 12? False Let z(s) = 5s2 - s + 3. Is z(2) a multiple of 11? False Let q(z) = -3z2 - 2. Let l(u) = u2 + 1. Let a(t) = 17l(t) + 6q(t). Let n be a(0). Suppose -nv = 2w - 43, w + 9 = 3v + 3. Is w a multiple of 4? False Let w(c) = c3 - 11c*2 + 9c + 13. Let q be w(10). Suppose 0 = -3*l + q	{ "pile_set_name": "DM Mathematics" }
at is 719 minutes after 11:17 AM? 11:16 PM How many minutes are there between 8:22 AM and 9:02 AM? 40 How many minutes are there between 1:46 AM and 3:24 AM? 98 How many minutes are there between 2:39 AM and 8:04 AM? 325 How many minutes are there between 4:02 PM and 2:41 AM? 639 What is 581 minutes before 5:19 PM? 7:38 AM How many minutes are there between 1:13 AM and 3:45 AM? 152 What is 231 minutes after 8:46 AM? 12:37 PM How many minutes are there between 5:24 PM and 9:54 PM? 270 What is 432 minutes before 4:43 PM? 9:31 AM What is 345 minutes before 2:36 PM? 8:51 AM How many minutes are there between 9:47 AM and 1:45 PM? 238 What is 337 minutes before 7:23 PM? 1:46 PM What is 39 minutes before 2:40 PM? 2:01 PM What is 170 minutes before 6:50 PM? 4:00 PM How many minutes are there between 5:37 AM and 2:29 PM? 532 How many minutes are there between 9:44 AM and 4:44 PM? 420 What is 679 minutes before 7:47 PM? 8:28 AM What is 295 minutes after 1:06 PM? 6:01 PM How many minutes are there between 4:12 PM and 2:11 AM? 599 What is 573 minutes after 5:30 PM? 3:03 AM How many minutes are there between 8:46 PM and 4:33 AM? 467 How many minutes are there between 7:37 AM and 10:16 AM? 159 What is 463 minutes after 11:54 AM? 7:37 PM How many minutes are there between 7:43 PM and 11:52 PM? 249 How many minutes are there between 5:30 PM and 10:48 PM? 318 How many minutes are there between 3:08 PM and 10:02 PM? 414 How many minutes are there between 5:48 PM and 6:59 PM? 71 What is 185 minutes after 7:55 PM? 11:00 PM How many minutes are there between 9:45 AM and 4:12 PM? 387 What is 251 minutes after 11:10 PM? 3:21 AM What is 655 minutes after 5:44 AM? 4:39 PM What is 4 minutes after 11:51 PM? 11:55 PM How many minutes are there between 8:40 PM and 7:45 AM? 665 How many minutes are there between 2:44 AM and 1:08 PM? 624 What is 373 minutes after 7:51 PM? 2:04 AM How many minutes are there between 7:02 AM and 4:50 PM? 588 How many minutes are there between 4:21 AM and 2:57 PM? 636 How many minutes are there between 12:37 PM and 1:39 PM? 62 What is 303 minutes before 3:03 PM? 10:00 AM What is 120 minutes after 2:40 AM? 4:40 AM What is 128 minutes after 6:02 PM? 8:10 PM What is 82 minutes before 7:50 AM? 6:28 AM What is 652 minutes after 3:21 PM? 2:13 AM What is 313 minutes before 6:28 PM? 1:15 PM What is 103 minutes after 1:03 AM? 2:46 AM How many minutes are there between 6:26 AM and 3:24 PM? 538 What is 104 minutes after 1:45 PM? 3:29 PM What is 203 minutes after 2:57 PM? 6:20 PM How many minutes are there between 9:27 PM and 6:07 AM? 520 What is 652 minutes before 8:02 PM? 9:10 AM What is 36 minutes before 4:20 PM? 3:44 PM What is 36 minutes after 12:26 PM? 1:02 PM How many minutes are there between 5:21 PM and 12:07 AM? 406 How many minutes are there between 1:00 PM and 11:05 PM? 605 What is 322 minutes after 12:37 AM? 5:59 AM What is 76 minutes before 4:36 PM? 3:20 PM What is 462 minutes after 10:59 AM? 6:41 PM How many minutes are there between 6:18 PM and 4:00 AM? 582 How many minutes are there between 10:21 AM and 5:49 PM? 448 How many minutes are there between 9:08 PM and 1:05 AM? 237 How many minutes are there between 5:30 PM and 5:13 AM? 703 What is 532 minutes before 9:44 PM? 12:52 PM What is 556 minutes before 5:02 PM? 7:46 AM How many minutes are there between 3:09 AM and 5:48 AM? 159 How many minutes are there between 10:23 AM and 9:30 PM? 667 What is 88 minutes before 4:49 PM? 3:21 PM What is 175 minutes before 7:58 PM? 5:03 PM How many minutes are there between 9:52 AM and 8:03 PM? 611 How many minutes are there between 7:17 AM and 5:03 PM? 586 What is 353 minutes before 12:18 AM? 6:25 PM How many minutes are there between 5:46 PM and 4:50 AM? 664 How many minutes are there between 1:15 AM and 5:58 AM? 283 What is 466 minutes after 10:23 PM? 6:09 AM How many minutes are there between 4:58 PM and 6:00 PM? 62 What is 325 minutes before 12:28 PM? 7:03 AM How many minutes are there between 6:02 PM and 7:49 PM? 107 How many minutes are there between 9:15 AM and 11:50 AM? 155 What is 313 minutes before 3:02 PM? 9:49 AM How many minutes are there between 3:50 AM and 5:26 AM? 96 How many minutes are there between 8:47 PM and 9:37 PM? 50 How many minutes are there between 11:59 PM and 2:54 AM? 175 What is 591 minutes before 4:18 AM? 6:27 PM How many minutes are there between 1:17 AM and 12:34 PM? 677 How many minutes are there between 5:33 PM and 12:34 AM? 421 What is 253 minutes after 2:53 AM? 7:06 AM What is 688 minutes before 5:10 AM? 5:42 PM What is 355 minutes after 8:54 PM? 2:49 AM How many minutes are there between 5:11 PM and 2:23 AM? 552 What is 51 minutes after 6:01 PM? 6:52 PM What is 675 minutes after 11:51 PM? 11:06 AM How many minutes are there between 7:09 PM and 7:21 PM? 12 How many minutes are there between 1:49 PM and 11:25 PM? 576 How many minutes are there between 11:47 PM and 9:23 AM? 576 What is 155 minutes before 2:47 AM? 12:12 AM How many minutes are there between 4:11 PM and 4:23 PM? 12 What is 237 minutes before 4:55 PM? 12:58 PM How many minutes are there between 9:24 PM and 12:03 AM? 159 How many minutes are there between 9:30 PM and 9:09 AM? 699 How many minutes are there between 5:46 AM and 3:58 PM? 612 What is 53 minutes after 5:19 PM? 6:12 PM What is 207 minutes after 12:34 AM? 4:01 AM What is 231 minutes before 5:19 PM? 1:28 PM How many minutes are there between 7:24 AM and 12:56 PM? 332 What is 103 minutes before 1:06 AM? 11:23 PM How many minutes are there between 5:53 AM and 2:06 PM? 493 How many minutes are there between 9:22 PM and 10:11 PM? 49 How many minutes are there between 4:33 AM and 6:55 AM? 142 What is 620 minutes before 1:15 AM? 2:55 PM How many minutes are there between 9:59 PM and 8:45 AM? 646 What is 663 minutes before 9:15 AM? 10:12 PM What is 491 minutes after 6:40 AM? 2:51 PM What is 130 minutes after 3:56 PM? 6:06 PM How many minutes are there between 4:42 PM and 8:04 PM? 202 What is 690 minutes after 9:25 PM? 8:55 AM How many minutes are there between 7:43 AM and 12:26 PM? 283 How many minutes are there between 1:59 PM and 4:14 PM? 135 What is 98 minutes before 10:06 AM? 8:28 AM What is 186 minutes after 7:42 PM? 10:48 PM What is 570 minutes after 12:27 AM? 9:57 AM How many minutes are there between 1:49 PM and 3:31 PM? 102 What is 663 minutes before 3:55 PM? 4:52 AM How many minutes are there between 2:59 PM and 5:35 PM? 156 How many minutes are there between 1:56 AM and 4:51 AM? 175 What is 424 minutes before 3:23 AM? 8:19 PM How many minutes are there between 5:08 PM and 12:16 AM? 428 How many minutes are there between 12:03 PM and 9:50 PM? 587 How many minutes are there between 4:39 PM and 8:54 PM? 255 How many minutes are there between 7:05 PM and 5:16 AM? 611 What is 144 minutes after 10:55 AM? 1:19 PM How many minutes are there between 11:53 PM and 12:12 AM? 19 What is 556 minutes after 6:31 PM? 3:47 AM What is 277 minutes after 6:11 AM? 10:48 AM How many minutes are there between 5:57 PM and 3:09 AM? 552 What is 103 minutes before 7:40 PM? 5:57 PM How many minutes are there between 10:22 PM and 11:10 PM? 48 What is 557 minutes before 1:38 PM? 4:21 AM How many minutes are there between 9:27 AM and 2:23 PM? 296 What is 71 minutes before 10:43 AM? 9:32 AM How many minutes are there between 2:18 PM and 4:58 PM? 160 How many minutes are there between 3:34 PM and 11:39 PM? 485 How many minutes are there between 4:20 PM and 4:59 PM? 39 What is 699 minutes after 8:22 AM? 8:01 PM How many minutes are there between 8:29 AM and 7:46 PM? 677 How many minutes are there between 12:48 PM and 12:09 AM? 681 How many minutes are there between 1:07 PM and 11:34 PM? 627 What is 217 minutes before 5:20 PM? 1:43 PM What is 592 minutes before 9:13 PM? 11:21 AM How many minutes are there between 8:22 AM and 5:06 PM? 524 What is 705 minutes after 4:34 AM? 4:19 PM What is 332 minutes before 12:48 AM? 7:16 PM What is 130 minutes before 5:39 PM? 3:29 PM How many minutes are there between 2:01 PM and 5:57 PM? 236 How many minutes are there between 9:25 AM and 3:53 PM? 388 How many minutes are there between 8:17 PM and 7:03 AM? 646 How many minutes are there between 10:16 PM and 11:04 PM? 48 How many minutes are	{ "pile_set_name": "DM Mathematics" }
347 + 175. Give q(z(v)). -700v4 Let p(u) = -272970u. Let t(o) = o. Give p(t(m)). -272970m Suppose 24r - 532 = 5r. Let y(o) = -25o + ro - 4o. Let v(x) = 4x - 2. Determine y(v(b)). -4b + 2 Let l(r) = -2r2. Suppose 0 = 7u + u. Let z(d) = 14d - d - d2 + ud. Calculate z(l(k)). -4k4 - 26k*2 Let z(b) = 6286b*2. Let x(o) = -75o. What is z(x(k))? 35358750k2 Let l(i) = i. Let s(w) = -14352390w. What is s(l(k))? -14352390k Let x(n) = -n. Let c(j) = -50828j. Determine c(x(l)). 50828l Let h(l) = 2l*2. Let v(o) = 15o*2 - 4. Let i(n) = 29n*2 - 7. Let c(d) = 4i(d) - 7v(d). Give h(c(q)). 242q*4 Let h(z) = 78z*2. Let w(a) = 11a*2 - 2. Give w(h(x)). 66924x*4 - 2 Let u(h) = 10h + 2. Let j(m) = 136m2 - 24. Calculate u(j(k)). 1360k*2 - 238 Let c(v) = -10v. Suppose -5p + 8 = -2. Let q(t) = 93 - 93 - 3t - pt. Calculate c(q(n)). 50n Let s(f) = f. Let c(v) = -6v2 + 103. Calculate c(s(d)). -6d*2 + 103 Suppose 9y - 60 = 57. Let c(s) = -9s + 29s - 5s - ys. Let m(t) = 3t. What is m(c(d))? 6d Let a(o) = 20o2 + 16o + 16. Let v = -7 + 23. Let f(u) = -4u2 - 3u - 3. Let d(g) = vf(g) + 3a(g). Let b(k) = -3k2. Calculate b(d(h)). -48h*4 Let b(x) = -15653x. Let f(j) = -j*2 - 67. Calculate b(f(i)). 15653i*2 + 1048751 Let q(g) = 15g - 7g - 7g. Let d(k) be the second derivative of 0k2 + 5/6k*3 + 0 + 4k. Determine q(d(c)). 5c Suppose 2j - 8 = -2. Let m(b) = 0b - jb + 7b. Let c(h) = 9h. Let q(s) = -2s. Let y(l) = -5c(l) - 21q(l). Calculate y(m(o)). -12o Let z(d) = -33d2 - 4d - 8. Let g(c) = -5973c2 - 726c - 1452. Let y(v) = 2g(v) - 363z(v). Let x(q) = 4q. Calculate x(y(n)). 132n*2 Let b(t) = -88t*2 + 5t*2 - 56t*2 - 22t*2. Let k(a) = -a. What is k(b(c))? 161c*2 Suppose 0 = 4i - 6 - 2. Let u(c) = 23ci + 25c*2 - 56c*2. Let g(t) = 3t - 4. Let l(x) = 4x - 5. Let w(o) = -5g(o) + 4l(o). Determine u(w(m)). -8m*2 Let a(d) be the first derivative of -d + d - 138d*2 + 10 + 148d2. Let h(x) = -x2. Determine a(h(y)). -20y2 Let h(m) = -72m. Let a(c) = 355c2. Give a(h(z)). 1840320z2 Let c(y) be the second derivative of -y4/12 - 3y - 28. Suppose 6 = 2w - 0. Let x(b) = -2 + 5b + w - 1. Determine x(c(o)). -5o*2 Let m(u) = -10u*2. Let a(c) be the second derivative of 3c*4 - 4c - 36. Calculate m(a(r)). -12960r4 Let o(w) = 15w*2 - 6w*2 - 7w*2 - 3 + 3. Let c(r) = 69r. Determine o(c(f)). 9522f2 Let h(a) = 6a. Suppose -2c = -0c + 2. Let r = c - -3. Let v(o) = -ro2 + 4o2 - o2. What is h(v(q))? 6q2 Let l = 217 + -215. Let w = 3 - 1. Let h(n) = 0n*2 - ln*w + 11n - 11n. Let q(g) = -10g*2. Give q(h(t)). -40t4 Let q(a) = -a3 - 6a2 - 6a + 2. Let i be (-1)/(3/302). Let k be q(i). Let s(p) = 39 - kp*2 - 39. Let n(y) = 2y*2. Calculate s(n(t)). -28t*4 Let z = -12 - 4. Let c be (-4)/z - (-102)/8. Let x(d) = 13 - d - c. Let v(a) = a. Give x(v(u)). -u Let z(w) = -676w*2. Let q(i) = 9i. Determine q(z(p)). -6084p2 Let m(r) = -2r + 3r + 593 - 593. Suppose -3c + 5d = 13, -35 = 2c - 7c - 3d. Let q(t) = -5t2 - c + 4. Determine q(m(f)). -5f*2 Let l(h) = -3h*2 + 5. Let j(c) = -4c*2 + 6. Let b(n) = -5j(n) + 6l(n). Let r(f) = -45f*2 + 316 - 316. Give b(r(m)). 4050m*4 Let q(v) = -v - 1. Let l(h) = -9h + 3. Suppose -42 = 5n - 37. Let w(j) = nl(j) + 6q(j). Let z(a) = -2a*2. What is z(w(r))? -18r*2 + 108r - 162 Let v(o) = 30 + 77o - 11 - 58o - 18. Let n(m) = 5m. What is n(v(s))? 95s + 5 Let u(l) = -2l. Let k(z) = -11710173z*2. Calculate k(u(i)). -46840692i*2 Let m(u) = 50u - 41u + 21u*2 - 9u. Let c(z) = -z*2 + z. Let o(t) = 3t*2 - 2t. Let i(n) = -2c(n) - o(n). Give i(m(j)). -441j4 Let i(g) be the third derivative of -g5/15 + 385g2 + 2. Let d be 6/15 + 3/5. Let l(q) = 1 - d - 2q. Determine l(i(s)). 8s2 Let o(h) = 2h. Let j(l) = 6l2 + 55l + 17. Give o(j(a)). 12a2 + 110a + 34 Let w(c) = 4c. Let u be (-364)/(-195) + (-4)/(-30). Let a(d) be the first derivative of 1/2d*u - 6 + 0d. Give a(w(b)). 4b Let y(q) = q2 - 9100. Let g(t) = -5t. Determine g(y(k)). -5k2 + 45500 Let a(y) = -6y*2. Let l(v) = 9v2 + v2 + 8v2 - 21v*2. Determine a(l(o)). -54o*4 Let z(r) = -r. Suppose 2k + 4g = g + 18, 38 = 5k + 4g. Let i(w) = kw*2 + 5w2 - w2. Determine z(i(j)). -10j2 Let p(w) be the third derivative of 11w*4/12 - 5w*3/6 + 65w*2 + 2w. Let c(o) = -o*2. Calculate c(p(k)). -484k*2 + 220k - 25 Let c(d) = -6d2 - 10. Let w(j) = 29j - 8. Let t(y) = -36y + 10. Let n(h) = -4t(h) - 5w(h). Calculate c(n(x)). -6x*2 - 10 Suppose 17r - 27 = -27. Let t(u) be the second derivative of r + 0u2 + 1/6u*3 + 2u. Let k(f) = -3f2. Calculate t(k(h)). -3h*2 Let i(s) = -5s - 150. Let n(b) = 18b + 2. Determine i(n(y)). -90y - 160 Let p(n) = -39n. Let t(v) = -4025v. Let z(f) = 207p(f) - 2t(f). Let r(i) = 4i + i - 3i. Determine r(z(j)). -46j Let v(d) = 461d*2. Let z(s) = -14s*2. Give z(v(j)). -2975294j4 Let o(u) be the second derivative of u4/6 - u + 2. Let s(b) = -9b - 40 + 40 - 2b. Calculate s(o(g)). -22g2 Let q(c) = -2c*2. Let y(o) = -16o + 26o + 36 - 12o. What is q(y(w))? -8w2 + 288w - 2592 Let k(v) = -6734v2. Let h(g) = 17g. Give h(k(c)). -114478c2 Let n(f) = -f + 2. Let q(w) = -6w + 11. Let z(j) = 22n(j) - 4q(j). Suppose 0 = 4d - 8 - 40. Let l(c) = 12 - d + 2c*2. Determine l(z(i)). 8i2 Let j(y) be the third derivative of -y6/90 - y*3/6 - 10y*2. Let d(r) be the first derivative of j(r). Let z(c) = c. Give d(z(u)). -4u*2 Let u(r) = 3r. Let f(n) = n. Let z(m) = 2f(m) + u(m). Let i(q) = -q + 12. Let k be i(9). Let a(t) = t + t - kt. Give a(z(b)). -5b Let n(s) = -4s. Let i(g) = g2 - 3. Let r(x) = -x2 + 1. Let z be 158/10 - (-1)/5. Let m = 13 - z. Let b(y) = mr(y) - i(y). Calculate n(b(u)). -8u*2 Let y(w) = w. Let h(x) = 13x - 11 - 15x + 9. Let l(b) = -3b - 5. Let m be 4(2 - 1)1. Let i(v) = ml(v) - 10h(v). What is y(i(k))? 8k Let g(j) = -12801j. Let s(q) = -157q. Let o(f) = -5g(f) + 408s(f). Let y(k) = 5k. Give o(y(r)). -255r Let j(t) = 4t - 4t + t2. Let y be (-2)/8 - 198/(-24). Let u(d) = -9d*2 - 6d*2 + yd*2. Calculate u(j(f)). -7f*4 Let v(x) = -2x. Suppose -5q + 10 = 5p, 0 = -p - p + 8. Let h be (-3)/(-6)-2q. Let z(f) = 6f + fh - 6f. Determine v(z(c)). -2c2 Let j(t) = t2 + 0t*2 + 0t*2 + 6. Let x(v) = -15790 + 4v + 15790 - v. Determine x(j(n)). 3n2 + 18 Let j(d) = -81d - 179. Let s(g) = 2g. Determine j(s(z)). -162z - 179 Let n(m) = 4m2. Let f be (-2)/(1/((-154)/4)). Let c(u) = 39u + 35u - fu. Determine c(n(l)). -12l2 Let w(t) = 16279t*2. Let b(o) = -3o*2. What is w(b(l))? 146511l*4 Let d(h) = 11h + 8. Let z(n) = 4n + 3. Let b = -36 + 28. Let o(q) = bz(q) + 3d(q). Let k(t) = t2. Give o(k(f)). f2 Let u(w) = 11w*2 + 10w. Let s(g) = -5g + 3. Let r(y) = 7y - 4. Let b(h) = 3r(h) + 4s(h). Give b(u(l)). 11l2 + 10l Let u(a) be the second derivative of -5a3/6 - a. Let p(q) be the first derivative of 4q*3/3 - 673. Determine u(p(b)). -20b*2 Let j(o) = -4556o*2. Let k(i) = 233i*2. Determine j(k(c)). -247340684c*4 Let y(r) be the second derivative of 5r*6/72 - 13r*3/3 - 12r. Let f(j) be the second derivative of y(j). Let s(h) = -2h2. Determine s(f(g)). -1250g*4 Let m(c) be the second derivative of 7/6c*3 + 0c*2 - 8c + 0. Let l(u) be the second derivative of u*3/6 + u. Give m(l(z)). 7z Let k(n) = -2349 - 4n + 2349. Let m(i) = i + 5. Let q(d) = 4 + 1 - 1. Let a(h) = -4m(h) + 5q(h). Calculate k(a(u)). 16u Let d(u) = -7u2. Let x(k) = 648k - 676k + 26 - 24. Calculate d(x(o)). -5488o*2 + 784o - 28 Let q(u) = -359u + 8. Let b(c) = 290072c - 6462. Let v(n) = -4b(n) - 3231q(n). Let k(g) = 2g2. What is k(v(p))? 257762p*2 Let y(x) = -18x - 36. Let z be y(-2). Let c(v) be the first derivative of -5 - 1/3v3 + 0v*2 + zv. Let r(q) = 9q. Calculate r(c(n)). -9n*2 Let i(s) = -2s*2 - 213s. Let o(y) = -6y - 1. Give o(i(c)). 12c*2 + 1278c - 1 Let w(u) = 7u2 + 5u. Let d(b) = -3b2 - 2b. Let p(q) = 5d(q) + 2w(q). Let r(m) be	{ "pile_set_name": "DM Mathematics" }
? (a) d (b) -2 (c) r a Let h = -896 + 899. Which is the closest to 2? (a) 7 (b) h (c) -12 b Let p = -0.82 + 1.49. Let b = p + -0.17. Let f = 57 - 56.6. What is the closest to -1/2 in f, b, -1? -1 Let o = -3 + 4. Let y = o - -7. Let g = -328 - -327. What is the closest to g in -3/8, y, -0.5? -0.5 Let o = 15121/28 + -540. Let c = o + -5/28. What is the nearest to -14 in -1/2, c, 8? -1/2 Let n = -878 - -875. Let m = -1.1 + 2.1. Which is the closest to 0.1? (a) -1.1 (b) m (c) n b Let t = 2395 + -2395.02. What is the closest to 2 in -5, t, 5, 0.04? 0.04 Let o = -0.9 + 0.93. Let y = -2.037 + -0.088. Let r = -0.125 - y. Which is the nearest to 1/3? (a) o (b) r (c) 0 a Let q be (-575)/(-75) - (-16)/(-6). Suppose -3i - qs - 3 = 0, -6i + 2s + 26 = -i. Which is the nearest to -1/2? (a) -4 (b) i (c) 3/2 c Suppose 4 + 8 = -4f. Let j = 4.21 - -192.79. Let w = -197.1 + j. Which is the nearest to w? (a) -13 (b) f (c) 3 b Let j be 70/(-25) + (-4437)/(-1740). What is the closest to -1 in 5, j, 0.5, -15/2? j Let w = -3.960181 + -0.039819. Let s = -10 - -14. Which is the nearest to 1/3? (a) 3 (b) 3/2 (c) s (d) w b Suppose -2q + 354 = -w, 3q + 0q + 3w = 540. Let p be -1(q/8)/((-5)/(-20)). Let y = p - -535/6. What is the nearest to -0.2 in y, 2/21, 2/9? 2/21 Let p = -51.41 + 50. Let j = p + 2.41. Let m(g) = g*3 + 5g*2 - 2g - 3. Let a be m(-5). What is the closest to j in 1, a, -0.4? 1 Suppose -w + 2 + 3 = 0. Suppose l + w = 2l. Let m = 0.63663 + 0.36337. What is the nearest to 0.2 in m, -1, l? m Let w = 218.6 + -17.6. Let m = w + -206. Which is the nearest to -1/3? (a) 2/21 (b) 4 (c) m a Let m = 5973 - 5974. Which is the nearest to m? (a) -0.06 (b) -10/7 (c) 0.3 (d) -3 b Let v = 0.045 + -1.855. Let u = -3.55 + v. Let h = u - -0.36. Which is the closest to 1? (a) -3 (b) 2/21 (c) h b Let l(m) = -2m*3 - 4m*2 - m + 2. Let y be l(-2). Let p = 0.946 - -0.054. Suppose 0 = h + 4h + 25. Which is the nearest to y? (a) h (b) 5 (c) p b Suppose o - 13 = -39m + 43m, -2o = m - 8. Let z = 0.75 - 0.45. What is the nearest to m in z, 1, 0.2? 0.2 Let n(w) = -66w*2 - 5w + 2. Let m be n(1). Let z = m - -65. Let x = 107/4 + -741/28. Which is the nearest to x? (a) 4 (b) z (c) 1/3 c Let h = 1.234 + -5.234. Which is the closest to 0? (a) -5 (b) h (c) -1882 b Let l(r) = -106r - 211. Let u be l(-2). Let f = 150/133 + -16/19. What is the nearest to u in -1, 4, f? f Let i = 3526610635808 - 12166764374210685805/3449988. Let w = i - 1/18351. Let s = w - 2/47. Which is the closest to s? (a) -1/2 (b) -4 (c) -5 a Let w = 562.77 - 562.67. Suppose -4t - 2 + 4 = 5y, -3y + t - 9 = 0. Let d be (-2)/(-3)3/y. Which is the closest to w? (a) 3 (b) d (c) -2.9 b Let y = -3467.3 - -3467. Suppose 0 = 5b + 65 + 20. Let q = b - -18. What is the nearest to q in y, -0.4, 3/5? 3/5 Let h = -6 - -11. Suppose k + i = -3, -4k = i + 4i + 10. Suppose 0 = 2f - o + 12, 4f - 5o = -31 - 17. Which is the nearest to -2? (a) k (b) f (c) h b Suppose -22 = 4w + d, 2w - 3d + 2 + 2 = 0. Let z = -30 - -35. Let k = 0.122 + -0.022. Which is the closest to k? (a) 0 (b) w (c) z a Let v = 0.131826 + 4.868174. Let k(x) = -x*3 - 6x*2 + 12x + 1. Let s be k(-8). Let l = s + -67/2. What is the nearest to l in v, 0, 3? 0 Let k = -1661 + 1664. What is the nearest to -2 in k, -6/7, -1, 5? -1 Suppose 0 = -z - 2v + 8, -5z - 9 - 26 = -5v. Let s = 10.8 - 4.4. Let l = -6.2 + s. What is the nearest to -0.2 in z, l, -0.2? -0.2 Let h = 402 - 151. Let p = 1758/7 - h. What is the nearest to 7 in p, 2, -4? 2 Let i = -2192 - -2196. What is the closest to -7 in -5, i, -14, 2/3? -5 Let k = 1917.5 - 1395. Let y = -522 + k. Which is the nearest to -1? (a) -0.4 (b) -2 (c) y (d) -7 a Let m be (2334/(-15))/(12/(-10)). Let x = m - 128. Let k be 5/(-60)(3 + -11)2/6. Which is the closest to 12? (a) -1/4 (b) k (c) x c Suppose 0r - 6 = 3h + 3r, -1641 = 4r - 1629. Let f = -14/13 - -68/39. Which is the nearest to 1? (a) -4/7 (b) h (c) f b Let w = -2726 + 2722.3. Which is the nearest to -1? (a) 1/2 (b) w (c) 4 a Let l be ((-400)/32 + -4 + 16)/(1-2). Suppose -7 = -3t + 29. What is the nearest to 2/11 in t, l, -5? l Suppose v - 4v = -6. Suppose 0x + 1050 = 143x + 7x. What is the nearest to x in -4, v, 5? 5 Let z = 2489 + -2488.8. Which is the nearest to z? (a) -21 (b) -3/8 (c) -3/5 (d) -3 b Let k = -98/15 + 746/105. Which is the nearest to 0.1? (a) -5/9 (b) k (c) -1/7 (d) 7 c Let h(p) = 2p + 36. Let g be h(-17). Suppose 5l - gv - 25 = -4v, -3l + 34 = 5v. Let u(m) = m + 2. Let q be u(l). What is the nearest to 0 in -1/2, 1, q? -1/2 Suppose 2k - 8 = 878i - 880i, -4i - 5 = -3k. Which is the nearest to -1/4? (a) 14 (b) -1/6 (c) i b Let t = 5314 - 4657.1. Let r = 656 - t. Let z = -0.2 + 0.1. Which is the nearest to -1? (a) -1/2 (b) r (c) z b Let u = 3.15 + -0.15. Let m = -36.861 + -0.139. Let l = m - -37.5. What is the nearest to -1 in u, l, 5? l Let o be (-1)/2 - (4/(-3) + 266/(-84)). What is the closest to o in -0.3, 10, -0.1, -4? -0.1 Let l = 200 + -197. Suppose -4k = 5g - 21 + 9, lg = -4k + 4. Let y = 215/3 + -71. Which is the closest to -1? (a) g (b) y (c) -5 b Let s = 1935.8 + -1930. What is the closest to s in 3, 0.3, -5? 3 Let f be 1/(6/11 + 1799/(-3157)). What is the nearest to 1/4 in 0, f, 3/2? 0 Let w = -3.2 - -3. Let f be -149/98(3 - (3 - 2)). Which is the nearest to -8? (a) -0.4 (b) w (c) -4 (d) f c Let h = -131 + -11.6. Let j = -143 - h. Which is the nearest to -1/7? (a) j (b) 5 (c) -6/5 (d) -2/19 d Let j = -4 - -3. Suppose -4h = 20, -s + 37h - 38h = -2. Let n = 461.6 - 462. What is the nearest to j in -0.2, s, n? n Let n = -159 + 292. Let j = 132 - n. Let s be 3/(-9)(-72)/4. Which is the nearest to j? (a) 0 (b) 1/3 (c) s a Let a = 27 - 27.54. Let v = -6206.34 - -6206. Let u = a - v. What is the closest to 2 in -2/11, -0.4, u? -2/11 Let g = 1 - -3. Suppose g = 2y - 4. Let i be -6 + 1 + ((-98)/(-36) - (-16)/(-72)). What is the closest to -4/13 in -0.2, y, i? -0.2 Let k be 8/1 - (-2442)/(-297). Which is the closest to -324? (a) 4 (b) k (c) -5 c Suppose 874 = 306r - 350. Let x = 128/3 - 42. Let t be -2 - (5/(-4) - 1). What is the nearest to 0.2 in r, t, x? t Suppose 4l - 4 = 2o, -4l - 2o - 15 - 5 = 0. What is the nearest to -37.9 in l, 0.2, 2? l Let a be ((-4)/(-2)3/(-60))/((-394)/4925). Let p be (3/(-2))/(6/8). What is the nearest to 0 in 1.1, a, p? 1.1 Let p = -6.13 - -0.13. Let v = 9 + p. Let f = 167 + -167. What is the nearest to f in -5, v, 1/7? 1/7 Let u = -785.58549 - 0.11451. Let z = 786 + u. Let w = 0.4 + -0.3. Which is the nearest to w? (a) -0.3 (b) -1 (c) z c Let n = -31664/9 - -3518. Let q = -3.7 - -3.6. Which is the closest to q? (a) n (b) -0.3 (c) 0 c Let u = 401/3 - 133. Let n = 4.3 + 0.7. Let y = 0 + n. Which is the nearest to y? (a) -5 (b) -3 (c) u c Let o = -10385 - -10380. What is the closest to -4 in o, -5/3, 1/2, -1/4? o Suppose u - 4u - 3 = 0. Let j be 14 + 24/(-4) - 5. Which is the nearest to 3? (a) -2/5 (b) u (c) j c Let n = 7620 - 7621. Let x = 0.077 + -4.077. Which is the nearest to n? (a) x (b) 3 (c) 0.01 c Suppose -169d + 8 = -w - 170d, 3d = 3w. What is the closest to -2 in w, -5, -0.3, 1.6? -0.3 Let f = -4772 + 4776. Let r = 35 - 177/5. Which is the nearest to r? (a) -37 (b) 3 (c) f b Let y = -1831 - -1830. Let o = -15.2 + 15. What is the nearest to o in y, 5, 1/6? 1/6 Let s be 1(1 + 16/(-20)). Which is the closest to 0.3? (a) -0.1 (b) -15/14 (c) 2 (d) s d Let n be 1-4 - (3 + (-492)/(-1)). Let t = -500 - n. Which is the closest to t? (a) -3 (b) -5 (c) 0.14 c Let h = -452.3 - -397. Let o = h + 54.3. What is the closest to o in -0.3, 2, -0.4? -0.4 Let q = -1214/1965 - 32/655. Let m be (2/(-4))/((-4)/6). Which is the nearest to 5/4? (a) m (b) q (c) -0.3 a Let v = 11056/7 + -1579. Which is the nearest to 0.82? (a) 0.3 (b) v (c) 0.4 (d) -0.3 b Let l = 5339 + -5339. Let h = 19 - 22. Which is the nearest to -0.56? (a) l (b) -5 (c) h (d) 4 a Let r be 2/(-4 + 3 - (-18)/45*5). Let g be (-23)/(-7) - (3 + 0). Let h = 0.07 + 0.03. Which is the closest to g? (a) r (b) 0.4 (c) h b Let f = 0.09197 + -5.09197. What is the clos	{ "pile_set_name": "DM Mathematics" }
? 3:28 AM What is 576 minutes after 6:50 PM? 4:26 AM How many minutes are there between 3:22 PM and 12:31 AM? 549 How many minutes are there between 9:02 PM and 8:30 AM? 688 What is 592 minutes before 4:14 AM? 6:22 PM What is 126 minutes after 8:20 PM? 10:26 PM What is 685 minutes before 12:16 PM? 12:51 AM How many minutes are there between 9:47 AM and 2:50 PM? 303 What is 153 minutes before 3:51 AM? 1:18 AM What is 556 minutes after 7:56 AM? 5:12 PM What is 304 minutes before 7:16 AM? 2:12 AM How many minutes are there between 9:26 AM and 4:25 PM? 419 What is 691 minutes before 2:38 AM? 3:07 PM How many minutes are there between 10:52 PM and 6:52 AM? 480 What is 526 minutes after 7:30 AM? 4:16 PM What is 502 minutes before 8:48 AM? 12:26 AM What is 707 minutes before 9:30 AM? 9:43 PM How many minutes are there between 2:49 AM and 2:14 PM? 685 How many minutes are there between 7:45 PM and 1:02 AM? 317 How many minutes are there between 9:34 PM and 2:17 AM? 283 How many minutes are there between 4:42 AM and 5:58 AM? 76 How many minutes are there between 1:38 AM and 2:03 AM? 25 How many minutes are there between 5:09 PM and 9:24 PM? 255 What is 611 minutes after 8:33 AM? 6:44 PM How many minutes are there between 3:25 AM and 10:49 AM? 444 What is 323 minutes after 3:45 PM? 9:08 PM What is 328 minutes before 7:30 PM? 2:02 PM How many minutes are there between 12:01 AM and 11:10 AM? 669 What is 59 minutes before 10:32 AM? 9:33 AM What is 583 minutes after 1:30 AM? 11:13 AM What is 51 minutes after 4:34 AM? 5:25 AM What is 101 minutes after 2:43 PM? 4:24 PM What is 387 minutes after 11:15 AM? 5:42 PM What is 98 minutes before 11:16 PM? 9:38 PM What is 697 minutes after 1:03 PM? 12:40 AM What is 360 minutes before 4:44 AM? 10:44 PM What is 502 minutes after 11:12 AM? 7:34 PM What is 454 minutes after 10:05 AM? 5:39 PM What is 482 minutes after 4:38 AM? 12:40 PM What is 444 minutes after 9:01 AM? 4:25 PM What is 274 minutes before 9:54 AM? 5:20 AM What is 309 minutes before 8:51 AM? 3:42 AM What is 50 minutes after 8:25 PM? 9:15 PM How many minutes are there between 1:03 PM and 7:45 PM? 402 What is 360 minutes after 5:02 PM? 11:02 PM What is 616 minutes after 7:36 AM? 5:52 PM What is 607 minutes before 1:22 PM? 3:15 AM How many minutes are there between 12:08 AM and 1:44 AM? 96 How many minutes are there between 1:26 PM and 2:20 PM? 54 What is 2 minutes after 7:03 PM? 7:05 PM What is 160 minutes before 9:31 PM? 6:51 PM How many minutes are there between 9:01 AM and 12:52 PM? 231 What is 137 minutes after 2:11 AM? 4:28 AM How many minutes are there between 5:14 AM and 6:30 AM? 76 How many minutes are there between 11:14 PM and 1:43 AM? 149 What is 181 minutes after 12:03 PM? 3:04 PM How many minutes are there between 6:36 PM and 3:43 AM? 547 What is 609 minutes after 2:04 PM? 12:13 AM How many minutes are there between 3:10 PM and 8:05 PM? 295 What is 404 minutes after 7:44 AM? 2:28 PM How many minutes are there between 3:07 PM and 9:48 PM? 401 How many minutes are there between 5:08 AM and 7:09 AM? 121 How many minutes are there between 6:27 AM and 7:38 AM? 71 What is 115 minutes after 8:17 PM? 10:12 PM What is 283 minutes before 9:49 PM? 5:06 PM What is 102 minutes after 2:39 PM? 4:21 PM How many minutes are there between 2:29 PM and 4:41 PM? 132 How many minutes are there between 5:48 AM and 5:09 PM? 681 How many minutes are there between 7:08 PM and 2:04 AM? 416 How many minutes are there between 12:04 PM and 6:46 PM? 402 How many minutes are there between 10:03 PM and 12:49 AM? 166 How many minutes are there between 4:46 PM and 8:49 PM? 243 What is 688 minutes after 6:32 AM? 6:00 PM How many minutes are there between 5:36 PM and 4:28 AM? 652 What is 607 minutes before 9:36 AM? 11:29 PM How many minutes are there between 8:47 AM and 3:32 PM? 405 What is 154 minutes before 1:37 PM? 11:03 AM What is 677 minutes after 4:48 PM? 4:05 AM What is 77 minutes before 9:44 PM? 8:27 PM How many minutes are there between 4:04 AM and 10:42 AM? 398 What is 664 minutes before 2:03 AM? 2:59 PM What is 359 minutes after 1:18 AM? 7:17 AM How many minutes are there between 3:09 PM and 8:53 PM? 344 How many minutes are there between 7:29 AM and 6:57 PM? 688 What is 591 minutes before 1:39 PM? 3:48 AM What is 36 minutes before 1:40 AM? 1:04 AM How many minutes are there between 10:36 PM and 7:43 AM? 547 How many minutes are there between 10:49 AM and 3:23 PM? 274 What is 148 minutes after 2:40 PM? 5:08 PM What is 60 minutes before 9:10 PM? 8:10 PM How many minutes are there between 4:05 PM and 7:09 PM? 184 What is 283 minutes after 3:35 AM? 8:18 AM How many minutes are there between 6:02 AM and 1:12 PM? 430 What is 714 minutes before 1:24 PM? 1:30 AM What is 704 minutes after 10:36 PM? 10:20 AM How many minutes are there between 9:04 AM and 11:55 AM? 171 How many minutes are there between 9:10 AM and 7:34 PM? 624 What is 582 minutes before 8:30 PM? 10:48 AM What is 52 minutes before 6:44 PM? 5:52 PM How many minutes are there between 10:57 AM and 6:50 PM? 473 How many minutes are there between 2:58 PM and 8:53 PM? 355 How many minutes are there between 10:03 PM and 6:24 AM? 501 What is 313 minutes after 12:53 PM? 6:06 PM How many minutes are there between 11:32 AM and 10:11 PM? 639 How many minutes are there between 6:35 PM and 10:32 PM? 237 How many minutes are there between 2:44 AM and 2:00 PM? 676 What is 50 minutes after 11:59 PM? 12:49 AM How many minutes are there between 9:01 AM and 9:34 AM? 33 How many minutes are there between 1:30 AM and 4:10 AM? 160 What is 641 minutes before 4:51 AM? 6:10 PM How many minutes are there between 9:41 PM and 9:31 AM? 710 How many minutes are there between 4:14 AM and 7:05 AM? 171 What is 321 minutes after 3:51 AM? 9:12 AM How many minutes are there between 7:41 PM and 5:14 AM? 573 How many minutes are there between 1:55 PM and 9:31 PM? 456 What is 217 minutes after 2:56 AM? 6:33 AM What is 41 minutes after 5:36 PM? 6:17 PM How many minutes are there between 2:59 AM and 5:52 AM? 173 How many minutes are there between 9:07 AM and 8:51 PM? 704 How many minutes are there between 4:07 PM and 1:55 AM? 588 How many minutes are there between 11:19 PM and 1:58 AM? 159 What is 576 minutes before 1:48 AM? 4:12 PM What is 644 minutes after 5:46 PM? 4:30 AM What is 623 minutes after 10:57 PM? 9:20 AM What is 508 minutes after 6:20 PM? 2:48 AM What is 398 minutes before 2:03 AM? 7:25 PM How many minutes are there between 6:25 AM and 3:45 PM? 560 How many minutes are there between 9:24 PM and 2:55 AM? 331 What is 386 minutes before 3:45 PM? 9:19 AM How many minutes are there between 10:10 AM and 5:56 PM? 466 How many minutes are there between 10:44 PM and 9:36 AM? 652 How many minutes are there between 3:32 PM and 6:05 PM? 153 What is 145 minutes before 7:32 PM? 5:07 PM How many minutes are there between 11:33 AM and 4:36 PM? 303 What is 328 minutes after 9:27 AM? 2:55 PM How many minutes are there between 7:06 AM and 2:54 PM? 468 What is 120 minutes before 7:24 AM? 5:24 AM What is 520 minutes before 11:11 PM? 2:31 PM How many minutes are there between 9:28 AM and 1:24 PM? 236 How many minutes are there between 1:34 AM and 10:51 AM? 557 What is 610 minutes after 3:55 AM? 2:05 PM What is 71 minutes before 1:46 AM? 12:35 AM What is 41 minutes after 5:29 AM? 6:10 AM What is 331 minutes before 11:00 AM? 5:29 AM How many minutes are there between 4:48 PM and 4:00 AM? 672 How many minutes are there between 3:11 PM and 5:51 PM? 160 What is 237 minutes after 1:55 PM? 5:52 PM How many minutes are there between 2:54 AM and 12:18 PM? 564 What is 526 minutes after 12:41 AM? 9:27 AM What is 345 minutes before 1:47 PM? 8:02 AM What is 599 minutes before 7:57 PM? 9:58 AM What is 700 minutes after 4:00 AM? 3:40 PM How many minutes are there between 7:25 PM and 5:03 AM? 578 How many minutes are there between 11:17 PM and 9:45 AM? 628 What is 421 minutes after 12:16 AM? 7:17 AM How many minutes are there between 4:31 AM and 1:43 PM? 552 How many minutes are there between 5:27 PM and 6:56 PM? 89 How many minutes are there between 8:19 AM and 7:44 PM? 685 What is 553 minutes before 7:51 AM? 10:38 PM How many minutes are there between 5:44 AM and 8:40 AM? 1	{ "pile_set_name": "DM Mathematics" }
f 11/1272978 and 107/3276. 33097428 Calculate the least common multiple of 4150590 and 1383530. 4150590 Calculate the lowest common multiple of 2851400 and 1140560. 5702800 What is the common denominator of -145/18 and 53/10175606? 91580454 Calculate the smallest common multiple of 3112527 and 1542. 6225054 Calculate the least common multiple of 33703306 and 728. 134813224 Calculate the smallest common multiple of 1205550 and 190. 1205550 Calculate the common denominator of -151/1486030 and 81/13064. 5944120 Calculate the lowest common multiple of 77781375 and 22876875. 388906875 Calculate the least common multiple of 4027792 and 18125064. 36250128 Calculate the common denominator of -139/66 and -43/19330806. 19330806 What is the smallest common multiple of 1037 and 10795? 658495 What is the common denominator of 65/31136 and 69/57975232? 57975232 Find the common denominator of -137/23818872 and 67/3969812. 23818872 Calculate the common denominator of -23/4515255 and -86/1197. 31606785 Calculate the common denominator of 55/669312 and 67/64512. 5354496 Calculate the common denominator of 199/41340 and 71/583000. 22737000 Calculate the smallest common multiple of 38026835 and 33. 114080505 Find the common denominator of -133/15600 and 21/76208. 74302800 Calculate the lowest common multiple of 1287 and 26244. 3752892 What is the lowest common multiple of 4680 and 250460? 58607640 Calculate the least common multiple of 9390 and 984. 1539960 What is the lowest common multiple of 58338 and 3283596? 22985172 Calculate the common denominator of -21/270560 and 191/9740160. 9740160 Calculate the lowest common multiple of 11 and 940229. 10342519 Calculate the smallest common multiple of 10196940 and 2902206. 377286780 Calculate the common denominator of -41/2960 and -67/202240. 7482880 Find the common denominator of -32/989961 and -74/1551. 10889571 What is the common denominator of 97/2240 and 49/2395? 1072960 Calculate the least common multiple of 714340 and 9350. 3571700 Calculate the smallest common multiple of 278230 and 92. 12798580 What is the smallest common multiple of 1559792 and 779896? 1559792 What is the smallest common multiple of 12429573 and 2909049? 136725303 Find the common denominator of -34/192687733 and 131/24598434. 1156126398 What is the common denominator of -109/14566084 and 155/828? 131094756 Calculate the common denominator of -139/252 and 151/20271000. 425691000 Calculate the least common multiple of 4095960 and 40194. 86015160 Calculate the common denominator of -43/1756408 and 8/4579. 33371752 What is the lowest common multiple of 8060 and 35167795? 140671180 What is the lowest common multiple of 1917171 and 33? 21088881 What is the smallest common multiple of 8236 and 338812? 9825548 What is the common denominator of 59/912164 and -89/2695030? 59290660 Calculate the lowest common multiple of 182817 and 330742. 991233774 What is the common denominator of -91/8010204 and 145/1515444? 56071428 Calculate the smallest common multiple of 5 and 43486101. 217430505 Calculate the smallest common multiple of 12 and 26244. 26244 Calculate the lowest common multiple of 22804560 and 13680. 22804560 What is the least common multiple of 10242936 and 12672? 163886976 Find the common denominator of -85/207815952 and 12/224237. 2701607376 What is the smallest common multiple of 344118 and 3222? 184791366 Calculate the common denominator of 133/95040 and 1/15. 95040 Calculate the lowest common multiple of 598176 and 57888. 1794528 Calculate the lowest common multiple of 733278 and 192. 23464896 Find the common denominator of 53/2808876 and -109/816. 11235504 Find the common denominator of -111/212300 and -1/2644. 140330300 What is the common denominator of 61/174465 and -41/14130? 54782010 Calculate the lowest common multiple of 19573295 and 12524. 2427088580 What is the least common multiple of 6891858 and 23? 6891858 Calculate the smallest common multiple of 1495 and 48198800. 48198800 What is the common denominator of 67/7698957 and 23/12098361? 84688527 Find the common denominator of 52/1648339 and 109/2354770. 16483390 Find the common denominator of 127/4916210 and -13/4. 9832420 Calculate the common denominator of -155/5040852 and -17/154763. 35285964 Find the common denominator of -79/389475 and -73/43621200. 43621200 Calculate the common denominator of 5/13534116 and -73/2126. 13534116 Calculate the lowest common multiple of 112952 and 1036738. 29028664 What is the common denominator of -29/590 and -55/17111652? 85558260 Calculate the least common multiple of 2190 and 1536. 560640 Calculate the common denominator of -64/69 and -68/2106879. 48458217 What is the least common multiple of 2735 and 7914990? 4329499530 Calculate the least common multiple of 423 and 284538. 853614 What is the common denominator of 37/11122510 and 61/28941225? 2836240050 What is the common denominator of -44/8035163 and -23/5447? 104457119 Calculate the smallest common multiple of 4114992 and 24494. 4114992 What is the least common multiple of 20 and 8106916? 40534580 What is the smallest common multiple of 2437966 and 3? 7313898 What is the lowest common multiple of 28942732 and 33077408? 231541856 Calculate the common denominator of -79/32292 and -79/24419928. 219779352 Calculate the least common multiple of 265237 and 4879. 184870189 Find the common denominator of -145/147882 and 137/258. 6358926 What is the lowest common multiple of 29960 and 50889200? 356224400 What is the common denominator of 149/171057456 and -37/432? 513172368 What is the common denominator of 19/1114856 and 89/1702? 41249672 Calculate the common denominator of -87/36980 and -103/3191374. 31913740 What is the common denominator of -25/483164 and -31/24641364? 24641364 Calculate the lowest common multiple of 8442 and 2626869. 15761214 Calculate the smallest common multiple of 1130787 and 217. 1130787 Calculate the least common multiple of 42 and 4048722. 28341054 Find the common denominator of 12/8485555 and 48/1697111. 8485555 Calculate the smallest common multiple of 15120996 and 1374636. 15120996 What is the common denominator of 31/512 and 47/3874368? 30994944 Calculate the common denominator of -20/27 and 17/201627726. 1814649534 Calculate the common denominator of 11/2618080 and -19/14000. 458164000 What is the smallest common multiple of 834464 and 11392? 3337856 What is the least common multiple of 185346 and 283? 52452918 What is the smallest common multiple of 1397000 and 2619375? 20955000 What is the lowest common multiple of 1110098 and 5? 5550490 What is the common denominator of -89/55120 and -7/21911578? 876463120 Calculate the least common multiple of 3472994 and 10. 17364970 Calculate the least common multiple of 68121 and 6885. 5790285 What is the common denominator of 4/608493 and 5/1638? 332237178 What is the common denominator of 143/58824 and -77/176472? 176472 What is the common denominator of -23/12138 and -53/1544994? 10814958 Calculate the least common multiple of 72658446 and 150276. 145316892 Find the common denominator of -41/1249052 and -79/6944. 9992416 Calculate the least common multiple of 363194 and 10532626. 10532626 Calculate the common denominator of 1/6850600 and 123/1100. 75356600 What is the least common multiple of 75 and 31456980? 157284900 Calculate the smallest common multiple of 166472 and 144. 2996496 Calculate the common denominator of 27/1775060 and -2/1508801. 30176020 Calculate the common denominator of 1/540 and 107/3940380. 3940380 Calculate the smallest common multiple of 39043480 and 18040. 429478280 What is the common denominator of 97/217430794 and 79/34331178? 652292382 Calculate the smallest common multiple of 4622 and 1. 4622 What is the smallest common multiple of 952 and 6889794? 192914232 Calculate the smallest common multiple of 6 and 21968832. 21968832 Calculate the least common multiple of 12146112 and 1760. 60730560 Calculate the lowest common multiple of 68154 and 1398. 15879882 Calculate the common denominator of -105/82336 and 151/245495076. 1963960608 Find the common denominator of 46/27 and -77/1402950. 12626550 What is the common denominator of -43/4781 and -23/14186593? 99306151 Calculate the common denomin	{ "pile_set_name": "DM Mathematics" }
q2 + 17q*2 + 46q*2. 57q*2 - 58 Collect the terms in 292373 - 8o*3 - 292380 + 4o*2 - 4o*2. -8o*3 - 7 Collect the terms in 7254786n - 3627412n - 3627424n. -50n Collect the terms in -364 + 95o - 19o - 7o. 69o - 364 Collect the terms in 320 - 591 + 270 + 1233r. 1233r - 1 Collect the terms in -5o + 2o + 300 - 2o + 2o. -3o + 300 Collect the terms in 2 + m*3 + 2934916m*2 + 0m*3 + 0m3. m3 + 2934916m2 + 2 Collect the terms in -3k*3 + 13k*3 + 2326k - 25k3 + 4k*3 + 6k*3. -5k*3 + 2326k Collect the terms in 744d + 46 + 771d - 2280d + 48 + 767d - 94. 2d Collect the terms in 13302v + 465v - 54 + 49. 13767v - 5 Collect the terms in -8w + 8323 - 11w + 20w. w + 8323 Collect the terms in 24i + 5759 - 11524 + 5767. 24i + 2 Collect the terms in 47b - 17b + 6b + 8b + 4b + 10b. 58b Collect the terms in 5j - 8j + 28j2 - 36j + 39j - 180j*2 - 5j. -152j2 - 5j Collect the terms in -1147w3 - 83w*2 - 48w*2 + 280w*3 + 175w*2 - 44w*2. -867w*3 Collect the terms in -1674l - 94l2 - 394l + 2068l. -94l*2 Collect the terms in 313l*2 + 0l*3 - 5l*3 + 15l*3 - 8l*3 + 0l*3 - 252l*2. 2l*3 + 61l*2 Collect the terms in -7767 - 176p + 169p - 1101. -7p - 8868 Collect the terms in -20i - 1 + 19317i*2 + 3i*3 + 3 + 4i*3. 7i*3 + 19317i*2 - 20i + 2 Collect the terms in -4959 + 10059 - 18q - 5101. -18q - 1 Collect the terms in -193s - 208s - 516s + 907s. -10s Collect the terms in -244939z*2 - 4361z + 3z3 + 244939z*2. 3z*3 - 4361z Collect the terms in -2159f - 995f + 1690f - 6422f - 5092f. -12978f Collect the terms in 1027479u3 - 1314u*2 - 1027482u*3 + 1314u*2. -3u*3 Collect the terms in -1024s + 5610s2 - 41307s*2 + 1024s. -35697s2 Collect the terms in 1996p*2 + 1998p*2 - 3p*3 + 6p*3 - 3994p*2. 3p*3 Collect the terms in 18415v*2 + 19075v*2 - 37493v*2. -3v*2 Collect the terms in -7 + 9y + 5 - 63262y2 + 63374y*2. 112y*2 + 9y - 2 Collect the terms in 150i3 + i2 - 8853 + 4418 + 4435. 150i3 + i2 Collect the terms in -1477i2 - 1016i*2 + 0i + 0i + 552i*3 + 2493i*2. 552i*3 Collect the terms in -2a + 23 - 2a2 - 24 - 17a*3 + a. -17a*3 - 2a*2 - a - 1 Collect the terms in -75s + 41s - 19s - 70s - 82s. -205s Collect the terms in 339h - 552147h3 + 3h*2 - 2h*2 + 552185h*3. 38h3 + h2 + 339h Collect the terms in 20r - 2082 + 704 + 690 + 688 + 247r. 267r Collect the terms in 1421o - 1531o + 6100o + 1025o. 7015o Collect the terms in 510760718540q*3 - 510760718264q*3 + 1 - 1. 276q*3 Collect the terms in 8979s*2 - 2s - 391s2 + 11950s*2. 20538s*2 - 2s Collect the terms in 6580j - 4 - 18 - 10 - 7351j. -771j - 32 Collect the terms in 6v*2 + 72v*3 + 197v*3 - 5v*2 - 321v. 269v3 + v2 - 321v Collect the terms in -6t2 + 55847t + 48 - 22 - 2t3 - 25. -2t*3 - 6t*2 + 55847t + 1 Collect the terms in -1983055p + 3966103p - 1983054p + 9p*2. 9p*2 - 6p Collect the terms in 104 + 109 - 213 + 406603t. 406603t Collect the terms in 3895v2 + 76896v - 153809v + 76877v - 3894v2. v2 - 36v Collect the terms in 51 + 9 - 21 + 2588k - 15 - 2585k - 24. 3k Collect the terms in 943y*2 - 1746y*2 - 98y*3 + 803y*2 + 99y3. y3 Collect the terms in -294k + 73k*2 + 148k - 124k2 + 76k*2 + 143k. 25k2 - 3k Collect the terms in 8251 - t3 - 3065 - 2124 - 3062. -t3 Collect the terms in 427 + 1322r3 - 414 - 1325r*3. -3r*3 + 13 Collect the terms in 24910b*2 - 24910b*2 - 1667b*3 + 858b*3 + 859b*3. 50b*3 Collect the terms in 72p + 17p3 + 61p*3 + 75p + 155p3 - 147p. 233p3 Collect the terms in 808b - 33 - 412b - 452b. -56b - 33 Collect the terms in -36r*3 - 65r*3 - 44r*3 - 40r*3 - 42r*3 + 265r*3 - 40r*3. -2r*3 Collect the terms in 18330x + 32154x + 1903x. 52387x Collect the terms in 3h + 629h2 + 287h*2 + 3h - 227h2. 689h*2 + 6h Collect the terms in -667n3 + 227n*3 - 1168n*3. -1608n*3 Collect the terms in -45062d*3 + 15052d*3 + 15055d*3 + 15089d*3. 134d*3 Collect the terms in -2d*3 + 0d*3 - 4317 - 11738 + 16055. -2d*3 Collect the terms in 407 - 1781689g + 1781652g - 407. -37g Collect the terms in 7211u2 - 2u - 3564u2 + 2u - 3655u2. -8u*2 Collect the terms in -86312k - 2922k2 - 1147k*2 + 86312k. -4069k2 Collect the terms in 1477969206h*3 - 1477969205h3 - 14 + 5. h3 - 9 Collect the terms in -y - 35 - 2988y3 + 5986y*3 - 2991y*3. 7y*3 - y - 35 Collect the terms in -2h - 11037772813 + 11037772813. -2h Collect the terms in 15837u*2 - 14u - 7900u2 + 14u - 7923u2. 14u*2 Collect the terms in -49o - 89o - 144o - 6o - 37o + 29o. -296o Collect the terms in -27d2 + 3d*2 - 50d*2 + 9d - 85d2 - 1 + 149d. -159d2 + 158d - 1 Collect the terms in -2f2 + 10195f*3 + 2f*2 + 10458f*3 - 25283f*3 - 6f. -4630f3 - 6f Collect the terms in 23034y3 + 25390y*3 - 48415y*3. 9y*3 Collect the terms in -4 + 9 - 58w*2 - 5 + 751w*2 + 166w*2. 859w*2 Collect the terms in 104q*2 + 1 - 6 - 5 - 5. 104q2 - 15 Collect the terms in -j2 - 2j2 - 19j - 5j2 - j2 - 6623j*3. -6623j*3 - 9j*2 - 19j Collect the terms in -10z - 37z + 68 + 72 - 140 - 29z + 28z. -48z Collect the terms in -4x*2 + 3x*2 - 75159x + 27741x. -x2 - 47418x Collect the terms in 699738373 - 699738373 - 4s. -4s Collect the terms in -246470317847k2 + 20k*3 + 246470317847k*2. 20k*3 Collect the terms in 318607870 - 498k*2 - 318607870. -498k*2 Collect the terms in 915g*3 - 98g*3 - 6878g*3 - 1863g*3. -7924g3 Collect the terms in v2 - 100 + 148 + 343v3 - 347v*3 + 4v*2. -4v*3 + 5v*2 + 48 Collect the terms in 23492y - 3216y - 4537y. 15739y Collect the terms in 4075t*3 + 4093t*3 - 5t*2 + 2t*2 + 3t*2 - 8221t*3. -53t*3 Collect the terms in -25j + 62 + 30j + 190 + 62 - 4. 5j + 310 Collect the terms in 44 - 44 - 58479466187p3 + 58479466186p3. -p3 Collect the terms in 16424x2 - 32840x*2 + 17315x*2. 899x*2 Collect the terms in 8591u - 7596u - 40180u - 74935u. -114120u Collect the terms in -5j - 36j*2 + 12j - 106j. -36j*2 - 99j Collect the terms in 139n3 + 8105736027n*2 - 689n*3 - 8105736027n*2. -550n*3 Collect the terms in -372 + 1400 - m - 348 - 343 - 337 + 2m. m Collect the terms in -49287 + 49287 + 2049r3. 2049r*3 Collect the terms in 5365814 + 78y - 5365814. 78y Collect the terms in 612 + 428 - 1551 + 511 + 6o. 6o Collect the terms in -59693z*3 - 404 + 401 + 2151z*3 - 89529z*3. -147071z*3 - 3 Collect the terms in -70688k - 70776k + 141473k + k2 + 0 + 0. k2 + 9k Collect the terms in l2 + 31056 - 15344 - 183l - 15712. l*2 - 183l Collect the terms in -8488 + 8488 - 386541w. -386541w Collect the terms in 66q - 12q*3 - 13q*3 + 4q*3 + 5q*3 - 93q. -16q3 - 27q Collect the terms in -2q + 200764 - 100368 - 100260. -2q + 136 Collect the terms in 524l2 + 27l*2 + 226l*2 - 311l*2 + 79l - 40l - 40l. 466l2 - l Collect the terms in -508u*3 - 515u*3 - 8u*2 + 3 - 3 + 1020u*3 + 10u*2. -3u*3 + 2u*2 Collect the terms in -1171p + 31875p2 - 31875p2 + p3. p*3 - 1171p Collect the terms in 0y - 125y*3 + 182y*3 + y - y. 57y*3 Collect the terms in 1043v - 2317v + 1145v. -129v Collect the terms in -38280 - 2s + 0s + 2s + 2s. 2s - 38280 Collect the terms in -3621 + 3470 - 40p + 216p. 176p - 151 Collect the terms in -15k*2 + 433392k + 4k2 - 433343k - 1. -11k2 + 49k - 1 Collect the terms in -8201o + 16586o - 8185o. 200o Collect the terms in 3 - 2260b2 - 1005b*2 + 713b*2 + 0. -2552b*2 + 3 Collect the terms in 2158z*2 + 195z - 188z + 579z*2. 2737z*2 + 7z Collect the terms in -29 + 8y2 - 120 - 17y*2 + 207 - 30 - 28. -9y*2 Collect the terms in -51f*2 - 7f*2 + 16f*2 - 171f*2 - 94f*2. -307f*2 Collect the terms in -77t - 21572454t2 + 77t. -21572454t2 Collect the terms in 2i*2 + 96 + 0i*2 - 98 + 2i*2 + 241i.	{ "pile_set_name": "DM Mathematics" }
= v - 121, ov = -5j - 143 + 441. Does 31 divide j? True Suppose -5y = -2g - 125, 3y - 75 = -7g + 4g. Suppose -y = 3b - 8b, -5u - 4b + 20 = 0. Let n = 49 + u. Is 13 a factor of n? False Let n = 47 + -50. Let g(y) = -21y - 3. Is g(n) a multiple of 10? True Suppose 5 = -3i + 2i. Let b = -2 - i. Suppose 2y + bn = 23, -5y + 2n + n + 47 = 0. Is y a multiple of 5? True Let h(n) = -20n - 6. Let i(m) = 39m + 12. Let w(r) = 5h(r) + 2i(r). Is 25 a factor of w(-3)? False Suppose 2h - 4h = 6, 2h - 150 = -4c. Let w = 3 + c. Does 20 divide w? False Suppose 2o - 3 = o + p, 4p + 7 = 3o. Suppose 0 = -c + on + 5, n - 15 = -3c + 2n. Suppose -3l + cj - 4j + 1 = 0, -3 = -4l + j. Is l a multiple of 2? True Let a be (-4)/(-7) + 647/7. Let o be 2/5 + a/5. Let s = 19 + o. Is 8 a factor of s? False Does 29 divide (-1)/(-5) - ((-3657)/15 + 12)? True Let q = 850 - 562. Does 8 divide q? True Let z = -329 - -364. Is z a multiple of 2? False Suppose -99l = -95l - 1236. Is l a multiple of 21? False Suppose 0 = 34f - 36f - 32. Let p(q) = -4q - 46. Does 10 divide p(f)? False Let q(o) = -o - 10. Let c be q(-12). Suppose 0d = -cd + 10. Does 18 divide 75/d - (1 - 4)? True Let n(h) = h2 + 11h + 16. Let b be n(-13). Suppose 3u = -5t + 32, 0u - 3u - 3t = -b. Let p = 21 + u. Is 10 a factor of p? True Suppose -2 = -s + 3. Suppose -33 = -6g + sg. Is g a multiple of 11? True Does 12 divide (-2997)/(-21) + 1 + 10/35? True Let a(z) = -z3 + 4z*2 - z. Let b be a(3). Suppose m = bm - 30. Suppose j - mj = -60. Is j a multiple of 11? False Let p(w) = 6 - 4w + 9w - 4w. Let d be p(-3). Suppose 2c - y + 18 = dc, -3c = 5y - 60. Does 5 divide c? True Let g be -2 + 7/((-21)/(-12)). Suppose -3b = 3u - 192, 3b + 46 = -gu + 176. Is u a multiple of 9? False Suppose -39 = 2b + 3r - 12, -19 = -b + 5r. Let m(y) = -y3 - 5y*2 - 12. Is m(b) a multiple of 10? False Let v = 667 - 981. Let y = -162 - v. Does 8 divide y? True Let h(w) = -6w*2 - w + 6w2 + w3 - 6w3. Let l be h(2). Let v = -12 - l. Is 5 a factor of v? True Let y(g) be the second derivative of -g4/12 - g3 + g2 - 2g. Let w be y(-6). Suppose -i + 50 = 2i + wb, 0 = 5i + b - 81. Does 10 divide i? False Is (3/5)/((-33)/(-24585)) a multiple of 25? False Suppose 2p = 4 + 138. Suppose -d = -p - 6. Is d a multiple of 7? True Let o be (0 + 2/(-6))0. Suppose o = 5r + 25, -4t - 2r + 4r = 194. Let u = -36 - t. Does 15 divide u? True Let d = 243 + -62. Does 7 divide d? False Let j be 10/44/5. Suppose -g - j = -2g. Is 2 a factor of g/((-4)/(-10))1? False Let h(n) = -n*3 - 5n*2 + 7n + 5. Suppose -2l = l + 18. Let i be h(l). Let v = i + 35. Is v a multiple of 14? False Let i = 13 - 14. Is (i + -55 - 0)/(-2) a multiple of 14? True Suppose 2m = -6, 2m + 818 = 21t - 25t. Suppose -5j - 2o + 6o = 419, -5j + 5o - 420 = 0. Let z = j - t. Is z a multiple of 24? True Let v = 41 + -38. Is 6 a factor of 161 - (-2 + -1)/v? True Let x = -15 - -13. Let b be (-21)/(-7) - 2/x. Is 26(-3 - (-14)/b) a multiple of 13? True Let l be (2/6)/(0 + (-2)/(-12)). Suppose 2d + 3d - 28 = -ls, -2s + 5d = -68. Is s a multiple of 9? False Let s(u) = -6u + 276. Is s(32) a multiple of 4? True Let z(m) = 24m*3 + 2m*2 - 68m + 203. Is 19 a factor of z(3)? True Let r(i) = -6i + 46. Let c be r(7). Suppose -5z + cx + 112 = -123, 3z + 3x - 141 = 0. Is z a multiple of 4? False Let q(l) = 2l + 2l - 4l - l. Let n be q(-3). Let i(j) = 11j - 2. Is 9 a factor of i(n)? False Is 8 a factor of ((-155)/15)/(4(-2)/384)? True Suppose 16f + 6f = 35068. Is 18 a factor of f? False Let b = 2872 - 1734. Does 16 divide b? False Let q = -22 - -22. Suppose -5d + 20 - 10 = q. Suppose 0 = df - 6f + 32. Is f a multiple of 4? True Suppose 2n - 110 = 4k, 117 = -4k - 0n - 5n. Let f = k - -59. Is f a multiple of 3? False Suppose 8m - 9m - 4x = -3914, 2m + 3x = 7803. Is 11 a factor of m? True Let f = 763 + 1457. Does 30 divide f? True Let j(g) = -14g + 6. Let r(w) = -w + 1. Let c(n) = -j(n) - 5r(n). Is 29 a factor of c(5)? False Let w = 72 - 67. Suppose 0 = -wf + 231 - 36. Is 37 a factor of f? False Suppose -5b - 5o = -5, -o + 8 = 5b - 1. Suppose -bt - 4w = 2t - 124, -13 = -t + 5w. Is t a multiple of 14? True Suppose 5 = -i, i = -4c - c - 5. Let u be (-18)/(-63) + 26/7. Suppose 0w - uw - 3t + 124 = c, 0 = 3w - 3t - 114. Is w a multiple of 6? False Suppose -c = -u + 1324, 5c - 1300 = 9u - 10u. Does 60 divide u? True Suppose 3i - 76 - 155 = 0. Is i a multiple of 11? True Let m be 16/6351/6. Let y = 221 - m. Does 13 divide y? True Let v be (-3 + 6)/(4/(-76)). Let b = 23 - v. Is 20 a factor of b? True Does 4 divide -2(110/(-4) - 7)? False Suppose r = 4t - 2519, -3r = 45 - 48. Is t a multiple of 105? True Is 734/6 - (14 + 369/(-27)) a multiple of 12? False Let w(y) = -55y - 3. Let o(v) = -167v - 12. Let f(u) = 2o(u) - 7w(u). Let d be 2/3(-3)/(-2). Is 12 a factor of f(d)? True Let s be (-366)/(-5)(3 + (-33)/(-9)). Suppose 120 = -2k + s. Is k a multiple of 23? True Let o = 224 + 76. Suppose 2k - o = -3k. Suppose -3n + k = -27. Is n a multiple of 13? False Let k(m) = 66m3 + m2 - 2m + 1. Let y be k(1). Suppose -2w = -y - 54. Does 19 divide w? False Suppose -3r + 174 = m - 4r, 5r = -2m + 362. Is 44 a factor of m? True Suppose 0 = r + v + 46, 163 = -4r + 3v - 0v. Let x = 76 + r. Does 15 divide x? False Let t = 2079 + -2022. Is t a multiple of 19? True Let o(r) = 7r + 9. Let m(d) = -35d - 44. Let j(v) = 2m(v) + 11o(v). Let n(h) = 6h + 11. Let z(p) = 3j(p) - 4n(p). Is 4 a factor of z(-5)? True Let a = -40 - -69. Suppose a = 4k + 1. Is k a multiple of 6? False Let a(q) = q3 - 2q*2 - 507. Let s be a(0). Let u = 773 + s. Is 19 a factor of u? True Let y = 910 + -316. Does 99 divide y? True Suppose 0 = 28i - 29i - 21. Let u = 8 - i. Is u a multiple of 10? False Suppose a + 108 = 5a. Suppose -3v + a = -36. Suppose 2w - z = z + 78, w + 5z - v = 0. Is 15 a factor of w? False Suppose 0 = -5k - 3i + 204, -k + 5i + 28 + 24 = 0. Is k a multiple of 5? False Let x = -4016 - -8016. Is 125 a factor of x? True Let u(o) = 17o. Let p be u(2). Suppose 3g + 4k = 5g - 32, 2g - 5k - p = 0. Suppose -b = -20 - g. Is 8 a factor of b? True Let h be 613 + 1 + -4 + 0. Suppose 0 = -22b + 12b + h. Is b a multiple of 5? False Let m be (1/(-3))/((-1 + -2)/27). Suppose 0 = b - 3q - 46, 250 - m = 5b + 2q. Is b a multiple of 7? True Let w(j) = 2j*2 + 9j + 5. Let q be w(-6). Let o = q + -19. Suppose -p + o = -68. Is p a multiple of 18? True Let d be ((-2)/(-3))/(18/81). Suppose 4o - df - 104 = 46, -4f - 80 = -2o. Does 9 divide o? True Suppose 5t - h = 11, 0 = -3t + t - h + 3. Let m(c) = -3c - 2. Let y be m(-5). Let v = t + y. Does 10 divide v? False Suppose r + 5 = t, 3t = 4t + 4r + 20. Let f be 1270/14 - 4/(-14). Suppose -3s + 3b + 57 = 0, tb - b + f = 4s. Is 17 a factor of s? False Suppose -3z + 40 = 2j + 2z, -j = -5z - 35. Does 5 divide j? True Let s(v) = -2v2 - 11v - 9. Let d(t) = t*3 - 4t*2 - 3. Let g be d(2). Let o be s(g). Let q = -61 - o. Does 23 divide q? True Let i = 14 - 9. Suppose -is + 0s = -395. Does 19 divide s? False Suppose 977 = -7g + 4694. Does 27 divide g? False Suppose -3x - 3r - 166 = -40, x - 3r + 62 = 0. Let c = x + 83. Is 18 a factor of c? True Let h = -33 - -169. Suppose v = 5v - h. Is v a multiple of 13? False Let k be (99/(-6))/(-3) - (-3)/(-2). Is -982/k-5 a multiple of 23? False Let d(o) = -o*2 - 4o - 2. Let s be d(-2). Suppose 3 = 2n - 1, -sa + 22 = 5n. Let g(p) = p3 - 4p2 - 6. Is g(a) a multiple of 12? False Let r(j) = j2 + 6j - 22. Let q be r(12). Let p = 338 - q. Is 12 a factor of p? True Let j be (3 - 1)/((-4)/(-10)). Suppose -s - 152 = -jw, 2w = -0w - 3s + 54. Suppose -4z + 3d + 57 = 0, 5z - 2z - w = -2d. Is z a multiple of 8? False Suppose 2j = -0j + 536. Suppose j = u - 4b, -4u - u + 1265 = 5b. Suppose 224 = 5d - u. Is 24 a factor of d? True Let o = 1099 + -248. Is o a multiple of 10? False Let q(y) = y*3 - 16y*2 - 33y + 44. Does 4 divide q(18)? False Suppose -4u = 3n - 242, -3u + 4u = -3n + 56. Suppose k + 4z - 38 = 0, z = -2*k + u + 7.	{ "pile_set_name": "DM Mathematics" }
or n(x). -4(x - 176)2 Suppose 10 = -565c + 566c. Let b(x) = -39x + 392. Let s be b(c). Suppose 1/12 + 1/6g - 5/4g*s - 3g*3 = 0. What is g? -1/3, 1/4 Suppose -4x + 4q + 32 = 0, 2x - 21 = 74q - 71q. Suppose 0 + 1/5tx + 0t + 1/5t2 = 0. What is t? -1, 0 Suppose 37c*2 - 20c*2 + 1257c - 417c - 13c*2 + 1196c = 0. What is c? -509, 0 Let r(p) be the third derivative of -p*6/1260 + 19p*5/630 + 13p*4/252 - 169p*3/9 - 1305p*2. Factor r(j). -2(j - 13)*2(j + 7)/21 Let 222514 - 4u3 - 222514 - 80u*2 + 896u = 0. What is u? -28, 0, 8 Let k be 30/32108/810. Let r(y) be the first derivative of 5 - 1/8y*2 + 3/40y*5 + 0y + 1/48y6 - ky*3 + 1/32y*4. Factor r(h). h(h - 1)(h + 1)2(h + 2)/8 Let s be (2/5)/((-3)/((-30)/4)). Let b(u) = -7u2 + 4u - 9. Let c(a) = a*2 + 4a - 1. Let q(v) = sb(v) - 5c(v). Let q(z) = 0. What is z? -1, -1/3 Let y(j) be the second derivative of -j*6/30 + 19j*5/10 + 55j*4/4 + 21j*3 + 3144j - 1. Suppose y(c) = 0. What is c? -3, -1, 0, 42 Let k(s) be the second derivative of s*5/90 - 2s*4/9 - 148s*3/27 - 80s*2/3 - 140s + 3. Factor k(y). 2(y - 20)(y + 2)(y + 6)/9 Let h(d) be the third derivative of d7/1260 - d6/180 + d5/90 + 17d*3/3 - 34d*2 + 2d. Let m(p) be the first derivative of h(p). Factor m(s). 2s(s - 2)(s - 1)/3 Let a = -4573/132 - -382/11. Let f(n) be the third derivative of 1/60n*6 + 0 - an*4 - 1/12n*3 + 0n + 12n2 + 1/120n*5. What is x in f(x) = 0? -1, -1/4, 1 Suppose 0 = 4q + 5c + 16, -2q = -4q - 2c - 6. Let l(a) = a*3 + 10a*2 - 24a + 6. Let j be l(-12). Factor 5s2 - js*2 + q + 8s - 8s. -(s - 1)(s + 1) Solve -806y2 + 810y*2 - 304y - 688y = 0. 0, 248 Suppose -3k = -k - 40. Find h such that h*2 + k + 93 + 28h + 83 = 0. -14 Let z(a) be the second derivative of -a6/60 - a5/20 + 11a4/24 + a3 - 1051a. Solve z(b) = 0. -4, -1, 0, 3 Let m(l) be the third derivative of -17/240l6 + 1/420l*7 - 7/12l*4 + 0l*3 + 0l - 131l2 + 0 + 11/30l*5. Solve m(d) = 0 for d. 0, 1, 2, 14 Factor 0 - 2/7w*3 + 512/7w*2 - 32768/7w. -2w(w - 128)*2/7 Let f(t) be the first derivative of -6t*3 - 1/10t*5 - 11/2t - 67 - 17/2t2 - 7/4t4. Factor f(y). -(y + 1)3(y + 11)/2 Let n(y) be the first derivative of 5y9/3024 - y7/21 + 2y5/3 + 20y*3/3 + 7. Let w(f) be the third derivative of n(f). Factor w(z). 5z(z - 2)2(z + 2)*2 Let g = 133 + -97. Factor 2j*4 + 61j - 17j5 - 10j*5 + 26j*5 + 18 + gj*3 + 74j*2 + 2j*4. -(j - 9)(j + 1)*3(j + 2) Suppose -35 = 2b - 7b. Find p, given that -63p2 + 25p*2 - bp*2 - 30 - 145p = 0. -3, -2/9 Let j(y) = y*3 - 19y*2 - 39y - 86. Let l be j(22). Let k = l - 506. Factor 2/3s3 + 1/3 - 5/6s + 1/3sk - 2/3s*4 + 1/6s*5. (s - 2)(s - 1)*3(s + 1)/6 Let v(q) be the third derivative of 0q3 - 1/420q*8 + 0q - 6/175q7 + 0q*4 + 1/15q*6 - 116q*2 + 0 + 0q*5. Factor v(x). -4x*3(x - 1)(x + 10)/5 Suppose u + 2o - 4o = -501, 2u + 4o = -1026. Let b = u - -510. Let 6/7s*2 + 0 + 2/7s*b - 6/7s*4 + 2/7s*5 - 4/7s = 0. Calculate s. -1, 0, 1, 2 Let z(h) be the third derivative of 1/50h5 - 1/175h*7 - 55h*2 + 0h + 0h3 + 1/90h*4 + 0 - 1/450h6. Let z(k) = 0. Calculate k. -1, -2/9, 0, 1 Let a(p) be the third derivative of -p5/12 + 15p4/2 - 175p*3/6 + 1672p*2. Let a(o) = 0. What is o? 1, 35 Factor 1/3f*2 + 14/3f - 95/3. (f - 5)(f + 19)/3 Let g(o) = o3 - 2o*2 - 1. Let z(d) = 67d*2 + 1088d + 1025. Let v(r) = g(r) + z(r). Factor v(c). (c + 1)(c + 32)2 Let r(j) be the third derivative of j6/24 + 59j*5/30 - 2j*4 + 287j*2 + 8j. Determine d so that r(d) = 0. -24, 0, 2/5 Suppose -2o - 3 = 5g, 6o + 69 = -0o - 3g. Let h be o/(-42) - 24/(-9). Let -2/9f*h + 2/9f + 2/9f2 + 0 - 2/9f*4 = 0. Calculate f. -1, 0, 1 Let j(l) be the second derivative of 2 + 2/5l*2 - 1/5l*3 + 8l + 0l4 + 1/50l*5. Find p such that j(p) = 0. -2, 1 Let c(b) be the third derivative of -1/10b*5 - 16 + 0b - 5/6b3 - 11/24b*4 + 3b2. Solve c(w) = 0 for w. -1, -5/6 Let z(r) be the first derivative of r4/14 + 34r3/21 + 79r*2/7 + 18r + 3278. Factor z(i). 2(i + 1)(i + 7)(i + 9)/7 Let s(c) be the third derivative of 0 + 0c*3 - c + 7/15c*6 + 0c*4 - 49c*2 - 1/7c*7 + 2/15c*5. Solve s(h) = 0 for h. -2/15, 0, 2 Let n(f) = 257f - 161f - 168f + 66 + 9f2. Let z(b) = b2 - 9b + 8. Let w(s) = 4n(s) - 33z(s). Find t, given that w(t) = 0. -3, 0 Let b be (-5 - -3) + -11 - -1. Let p = -10 - b. Find h, given that h*3 + 3h*3 - 7h*p + 16 - 16h + 4h3 - 5h*2 + 4h*4 = 0. -2, 1 Factor 0v - 344/7v3 - 92/7v*4 - 2/7v*5 + 0 - 48v*2. -2v*2(v + 2)*2(v + 42)/7 Let j = -14856 - -74292/5. Let a(l) be the first derivative of jl5 + 0l*3 + 7l*4 - 8l*2 + 0l + 18. Factor a(o). 4o(o + 1)(o + 2)(3o - 2) Factor -307y*2 + 238y + 412y - 105625 - 309y*2 + 615y2. -(y - 325)2 Let v(s) be the second derivative of -s*6/270 + 11s*5/180 + 25s*4/108 + 13s*3/54 - 309s + 2. Factor v(i). -i(i - 13)(i + 1)*2/9 Let q = -18198 + 18203. Let x(a) be the second derivative of -5/6a*3 + 0a*2 + 0 - 3/2a*q + 2/3a*6 + 5/3a*4 - 12a - 5/42a7. What is i in x(i) = 0? 0, 1 Let n be ((-21)/(-42))/((-5)/(-20)). Suppose 5p = 4y - 28, -ny + 2 = 3y + 2p. Let 0 + 2/3g3 - 1/3g*5 + 0g*y + 0g*4 - 1/3g = 0. What is g? -1, 0, 1 Find a, given that -3/5a2 - 348 + 204/5a = 0. 10, 58 Determine u, given that -2u5 - 246u*3 + 360u*2 + 7u*4 + 38u + 610u + 5u*4 + 6u*4 + 22u4 = 0. -1, 0, 6, 9 Let t(i) be the third derivative of i5/20 - 21i4/8 - 176i*3 + 811i*2 + i. Factor t(h). 3(h - 32)(h + 11) Let n(g) be the second derivative of g6/150 - 14g*5/25 + 53g*4/60 + 11g*3/3 - 3741g. Factor n(m). m(m - 55)(m - 2)(m + 1)/5 Let u be (-12)/(-13)20384/16464. Factor -u + 6/7p4 - 2/7p*3 + 2/7p*5 - 22/7p*2 - 24/7p. 2(p - 2)(p + 1)*3(p + 2)/7 Let r(i) be the first derivative of -i*4/18 - 352i3/27 + i2/9 + 352i/9 + 6898. Factor r(k). -2(k - 1)(k + 1)(k + 176)/9 Factor 2/7s2 + 4s + 0. 2s(s + 14)/7 Suppose -5p + 4p - 3b = -3, 5b = 4p + 73. Let k be (-7)/((-105)/4)p/(-8). Suppose 2/5i3 - ki*4 - 2/5i + 0 + 2/5i2 = 0. Calculate i. -1, 0, 1 Let s be ((-2)/206)/((-2)/10). Let r(c) = 6c2 + 22c*4 + 3c*5 - 11c*4 + 17c3 - cs. Let n(j) = j4 - j3. Let y(v) = -n(v) - r(v). Factor y(a). -3a2(a + 1)*2(a + 2) Solve 32/9 - 2/9s4 + 14/9s*3 - 8/3s*2 - 8/9s = 0. -1, 2, 4 Let o(h) be the first derivative of 2h3/27 + 11h*2/3 + 60h - 1650. Factor o(m). 2(m + 15)(m + 18)/9 Find o, given that -360 - 3/7o3 + 2526/7o - 3/7o2 = 0. -30, 1, 28 Let g(q) be the third derivative of -121q*5/570 + 2387q*4/57 - 188356q*3/57 - 3q*2 + 6q - 79. Find f such that g(f) = 0. 434/11 Let r(n) be the first derivative of -n*5/5 - 5n4/4 + n3 + 17n2/2 + 10n - 6565. Factor r(d). -(d - 2)(d + 1)2(d + 5) Let w(u) be the second derivative of 3u + 0u*2 - 1/48u*5 + 5/24u*4 + 29/6u*3 - 1/144u*6 + 0. Let m(n) be the second derivative of w(n). Factor m(q). -5(q - 1)(q + 2)/2 Let x(a) = 5a3 - a2 - a + 2. Let p be x(2). Let q be (4(-5 + 184/p))/2. Factor 10/9w*4 + 16/9w + 0 - qw5 - 4/3w*3 - 8/9w*2. -2w(w - 2)3(w + 1)/9 Let y = -3912 + 3924. Let h(w) be the second derivative of -23w - 7/10w*6 - yw*2 - 14w*3 + 3/2w*4 + 0 + 57/20w*5. Suppose h(c) = 0. Calculate c. -1, -2/7, 2 Let a = -566866/3 + 189157. Determine f, given that -440f + af2 + 240 = 0. 12/11 Let q = 78116/321 + -25468/107. What is z in qz*2 + 61/6z + 1/6z3 + 5 = 0? -30, -1 Let t = -38 - -19. Let m = 24 + t. Suppose 10 + g2 + mg*2 + 4 + 16g - 4g2 = 0. Calculate g. -7, -1 Let p(g) be the second derivative of 1/3g*4 + 1/21g7 - g2 - 50g - 1/5g*5 - 1/15g*6 + 1/3g*3 + 2. Factor p(o). 2(o - 1)*3(o + 1)*2 Suppose -11120k + 10881k + 1195 = 0. Let 86/11l*3 + 0 + 14/11l*k - 60/11l*4 + 8/11l - 48/11l2 = 0. What is l? 0, 2/7, 1, 2 Suppose 0 = -5v + 1 - 6. Let i be v/(5/10 - (-3)/(-4)). Let 0b3 - 1/6b**i + 0	{ "pile_set_name": "DM Mathematics" }
= 4z - 5u, 0z + 3z - 11 = -4u. Let b(j) = -zj + 4j3 + j + 5 - 6j*2 - 3j*3 - 2j3. What is b(i)? 0 Let l(u) = -u + 11. Let d be l(7). Let g(b) = b2 - 2b - 4. Let r be g(d). Let a(z) = -3 - z2 + 4z - rz - z - 2z. What is a(-3)? -3 Let c = -32 + 36. Let u(s) = -s*2 + 4s - 6. What is u(c)? -6 Let w(g) = 15g - 4g - 5g - 1 - 3g. Determine w(3). 8 Suppose 5 = -5z + 25. Let o(c) = c3 - 6c*2 + 5c + 4. What is o(z)? -8 Suppose h - 4h = -15. Suppose hq = q + 20. Suppose qf + 0f - 5 = 0. Let r(b) = -4b + 1. Calculate r(f). -3 Let r(d) be the second derivative of d8/6720 - d7/1260 - d5/120 - d4/4 + 2d. Let m(z) be the third derivative of r(z). Calculate m(3). 8 Let p = 27 - 22. Let w(h) be the second derivative of 0 + 1/6h3 + h - ph2. Determine w(5). -5 Suppose -b + 3 = 1. Let d = 2 - b. Let p(l) be the second derivative of -l5/20 - l4/12 - l2/2 + l. What is p(d)? -1 Let o(c) = 3c2 - 2c. Suppose -4s + 4 = -5s. Let z(a) = -3a2 + 3a. Let y(r) = sz(r) - 6o(r). Give y(1). -6 Let n(w) be the first derivative of w4/12 - w3/6 - w*2 - 2w - 8. Let j(z) be the first derivative of n(z). Give j(-3). 10 Let z(s) be the third derivative of -1/6s3 + 0s - 1/120s6 + 1/30s*5 + 0 + 0s4 - s2. Calculate z(2). -1 Let m(t) = 2t3 + 2t*2 + 5t + 4. Let h(z) = z*3 + 2z*2 + 4z + 4. Let k(q) = -3h(q) + 2m(q). Let n be 2/((24/(-9))/(-4)). What is k(n)? -1 Let d(j) = j*2 + 6j. Let r be (-10)/(-4 - (-3 - -1)). Suppose 2v = -v + 6. Suppose -rp - v = 23. Give d(p). -5 Suppose 22 = -12i + 10. Let j(q) = 1 + 4q - 3q + 0. What is j(i)? 0 Suppose -4n = z + 3z - 36, 2z + 3n - 20 = 0. Let f(d) = -d2 + 6d - 6. Determine f(z). -13 Let u(p) = -4 + p2 - p + 1 + 4 - 2. Let s(t) = -t3 - 2t2 + 2t + 3. Let q(a) = -s(a) - 2u(a). Determine q(1). 0 Let g be -10(-1)/312/8. Let c(n) be the second derivative of n5/20 - n4/2 + 2n3/3 + n2/2 - n. Determine c(g). -4 Suppose -5v - 26 = -u, -5u + 5v - 2v = -42. Let d(f) = -3 - 2f2 + f2 + uf + 0f2. What is d(2)? 5 Let t(h) be the third derivative of h6/120 - h5/60 + h4/24 - h3/6 + 28h*2. Calculate t(1). 0 Let s(u) = 2u - 1. Let l = 41 - 44. Determine s(l). -7 Let q(r) be the first derivative of r*6/360 + 7r5/120 + r4/4 - 2r3/3 + 2. Let x(s) be the third derivative of q(s). Calculate x(-5). -4 Let l(y) = y2 - 5y - 1. Let o(r) = 3r2 - 10r - 2. Let d(j) = -5l(j) + 2o(j). What is d(-5)? 1 Let q be (-80)/14 - 26/91. Let y(h) = h*2 + 8h - 1. Give y(q). -13 Let i = 8 + -4. Let l = 1 - i. Let b be (-10)/(-15) - (-17)/l. Let s(c) = c - 6. Determine s(b). -11 Let j(b) be the second derivative of 0 + 3b + 0b*2 - 2/3b*3 + 1/12b4. What is j(5)? 5 Let i = 8 - 3. Let z(o) = -o2 + 3o + 3. Let g be z(2). Let k(w) = -gw*2 - 10w*3 + 12w3 - w - w3 + 1. Determine k(i). -4 Suppose i = -4v + 6i + 25, i + 5 = v. Let b(c) be the third derivative of 2c2 + v + 0c + 1/6c3 + 1/24c*4. Calculate b(5). 6 Let p(y) = -47y*2 + 9y - 14. Let r(g) = -24g2 + 5g - 8. Let u(z) = -4p(z) + 7r(z). Calculate u(1). 19 Let h(k) = -k*2 - 3k - 4. Let b(g) = -g*2 + 2g + 4. Let p be b(3). Suppose -f + p = -1. Let q(w) = -w*3 + 2w + 1. Let n be q(f). Determine h(n). -4 Let a(c) = 6c2 + c + 2. Let y(f) = 5f*2 + 1. Let q(b) = -2a(b) + 3y(b). Suppose 25 = -4d + 21. Determine q(d). 4 Let d(c) = -c*3 - 6c*2 + 2c - 3. Suppose -5g + v - 25 - 2 = 0, -4g = -3v + 15. Calculate d(g). -15 Let o = -39 + 39. Let a(x) = x + 2. Give a(o). 2 Suppose 2f = 11f. Let j(b) be the second derivative of f + 1/2b*2 + b + 1/6b*3. Determine j(-4). -3 Suppose -3l + 1 = 7. Let a(c) = -3c2 - 2c. Calculate a(l). -8 Let j(x) = x2. Let b(v) be the third derivative of v4/24 + 2v2. Let w be b(6). Let q be (-4)/(-6)(w + -3). What is j(q)? 4 Let y(x) = x*2 - 1 - 14x + 11x + 0 + 2x. What is y(3)? 5 Let v(f) be the third derivative of -f*5/60 - 2f*3/3 - 3f*2. Let k(s) be the first derivative of v(s). Determine k(-2). 4 Let c(x) = 2x - 3. Suppose -2 = d - 4. Let j be c(d). Let f(r) = r + 3. Let a(v) = -3v - 13. Let g(p) = 2a(p) + 9f(p). Calculate g(j). 4 Let b be -2 - (-13 + (-4)/(-2)). Suppose 4q = -1 + b. Let h(g) = g*q - 4 - 7 + g + 4. Calculate h(0). -7 Let d be (-1 - -2)-1-3. Suppose 0r + 3 = dr. Let o(p) = 16p2 + p - 1. Calculate o(r). 16 Let n(u) = -u2 + 8u - 3. Let a be n(7). Suppose 0 = -f + a + 1. Let h(p) = -p2 + 7p - 3. What is h(f)? 7 Let u(j) = 5j - 1. Let k = -3 - -5. Let l be k - (-1 - -1)/(-3). Calculate u(l). 9 Let y(n) = -n3 - 8. Let p(o) = o + 3. Suppose 0 = -3w - 8 - 1. Let r be p(w). Calculate y(r). -8 Suppose 4l - 1 - 3 = 0. Let c(y) = -2 + 2y - 3 + 4 + 8y2. Calculate c(l). 9 Let m(i) = -1. Let d(o) = o3 + 4o*2 - 8. Let j(p) = d(p) - 3m(p). Let x = 1 - 5. Give j(x). -5 Let l(u) = 5u + 1. Let w be (-19)/7 + -6 + 160/28. Determine l(w). -14 Let t be (-2 - -3)(6 + -6). Let p(a) = -1 - 5a - 2a + 0a + ta. What is p(-1)? 6 Let p(r) be the second derivative of -r*5/20 + 2r*2 - 6r. Suppose -7w = -4w. Give p(w). 4 Let k(z) = -z*3 - 6z*2 - 3z - 4. Let s be (-16)/3 - (-16)/48. Determine k(s). -14 Let m(a) = -52a3 - 1 + 9a*2 - 8 + 51a*3. What is m(9)? -9 Let w(l) = 6l*2 - 3l + 2. Let t be w(1). Let y(s) be the second derivative of 0 + 1/20st - 1/12s*4 + s + 0s*2 + 0s*3. What is y(0)? 0 Let m(l) = 2l*2 + 18l - 22. Let x be m(-10). Let v(h) = -3h3 - 4h*2 - 4h - 3. Give v(x). 13 Let r = -29 + 41. Let z be (-45)/(-6)r/(-15). Let v(g) = g3 + 7g*2 + 6g + 6. Give v(z). 6 Let g(p) = p + 2. Let a(z) = -1. Let f(b) = 2a(b) + g(b). Calculate f(-4). -4 Suppose -3 = -4c + c. Suppose 3k - 10 = 2x, 4x + c = k + 11. Let y(r) = -r - 4r - 6r2 + kr. Determine y(1). -5 Let x(v) = 6v - 4. Let j(z) = -23z + 15. Let y(t) = 6j(t) + 22x(t). Calculate y(2). -10 Let m(i) = 10i + 1. Let p(z) = -3z*2 - z. Let b be p(-1). Calculate m(b). -19 Suppose 0 = -5a - 3z + 23, 0 = a + 6z - 3z - 7. Let k(f) = f3 - 5f2 + 1. Give k(a). -15 Let b(n) = -n2 - 6n + 3. Let q be (2/1 + -17)/(-1). Let h be (-1)/31q. Determine b(h). 8 Let m(f) = f. Let z(s) = 7. Let u(t) = m(t) + z(t). Calculate u(5). 12 Let r be 3 + 1/(-1) - -18. Let m = r + -25. Let w(q) = q3 + 5q*2 - 2q - 5. Give w(m). 5 Let p(j) = -3j2 - 2j + 4. Let q(u) = -u*2 + 1. Let z(y) = -p(y) + 2q(y). Let o be (-2 - (-2 - -1)) + -3. What is z(o)? 6 Let z(b) be the second derivative of b5/20 + b4/2 + 7b3/6 + 7b*2/2 + 2b. Suppose -8 = -3l - 23. What is z(l)? -3 Suppose 5f + 1 = 6. Let y(g) = 17g3 + g2. Calculate y(f). 18 Let x(n) = 3n + 2. Let s(v) = -4v - 1. Let g(t) = -5s(t) - 6x(t). Determine g(6). 5 Let k(s) = 2s*2 - 5s - 4. Let i(n) = -9n + 7. Let y be i(6). Let r = -31 - y. Suppose -3b = -7b + r. Give k(b). 8 Let f(j) = -6j - 3. Suppose 0 = -r + 3r. Let w = -2 + r. Calculate f(w). 9 Let u(q) = -2q - 1. Let j = -19 + 14. Determine u(j). 9 Let m(n) = n3 + n2 - 6n + 4. Let w(h) = -h3 - 3h*2 + 11h - 7. Let p(a) = 5m(a) + 3w(a). Suppose -3q + 7q = 4. Let r be 1 + q/22. Calculate p(r). 5 Let x(n) = -3n*3 - 6n*2 + 4n - 1. Let m(v) = 16v3 + 31v*2 - 20v + 5. Let k(w) = 2w - 6. Let c be k(4). Let f(z) = cm(z) + 11x(z). Determine f(-5). 4 Let p(r) be the third derivative of -r7/840 - r6/360 + r4/8 - r3/6 + r2. Let v(a) be the first derivative of p(a). Suppose m = -3m. Calculate v(m). 3 Let p(o) be the second derivative of 0 + 0o2 - 1/360o*6 - o - 1/24o*5 + 0o*4 - 1/3o*3. Let w(u) be the second derivative of p(u). What is w(-5)? 0 Suppose -a = 2a - 3. Let d(p) = -8p + 3p*2 + 3p*2 - a + 4p - p3. Give d(5). 4 Let i(s) = s2 - 6s + 6. Let w be i(6). Let j(g) = g2 + 0g + g - 2 - wg - 2g. What is j(7)? -2 Suppose 7j - 33 = -4j. Let d(q) = -q3 + q2 + q. Determine d(j). -15 Let w(u) = 3u3 + u2 + u + 2. Let p be w(-2). Let v be p/6 + 1/3. Let q(d) = -d3 - 4d*2 - 3d + 3. What is q(v)? 3 Let h(u) = -u*3 + 4u*2 + 4u + 7. Let f be h(5). Suppose 1 = -fs + 9. Suppose 5b = -2n + 4, -n + s = b + 2. Let p(t) = 3t. Determine p(n). 6 Let t(l) = -l*	{ "pile_set_name": "DM Mathematics" }
est common multiple of 80 and 80. 80 Find the common denominator of 11/40 and -47/53. 2120 What is the common denominator of -131/30 and 28/57? 570 What is the common denominator of 169/1470 and 23/294? 1470 Find the common denominator of 79/33 and 73/255. 2805 What is the common denominator of 107/1116 and -73/372? 1116 Calculate the lowest common multiple of 210 and 5460. 5460 Calculate the common denominator of 117/100 and 19/20. 100 What is the common denominator of 49/48 and -75/196? 2352 What is the lowest common multiple of 78 and 273? 546 What is the common denominator of -161/1800 and -53/10? 1800 What is the common denominator of 163/84 and -73/70? 420 What is the lowest common multiple of 1932 and 252? 5796 What is the lowest common multiple of 720 and 130? 9360 Calculate the common denominator of -53/1946 and -49/1529. 21406 Calculate the common denominator of 97/10 and 125/6. 30 Calculate the common denominator of -28/2365 and 59/2580. 28380 What is the smallest common multiple of 32 and 48? 96 Find the common denominator of 67/15 and 95/12. 60 What is the lowest common multiple of 130 and 95? 2470 Calculate the smallest common multiple of 4 and 4. 4 What is the common denominator of 47/12 and 29/528? 528 Calculate the least common multiple of 7 and 907. 6349 Find the common denominator of -67/10 and -95/258. 1290 What is the smallest common multiple of 210 and 795? 11130 What is the common denominator of -31/144 and -109/24? 144 What is the common denominator of -37/858 and 93/44? 1716 Find the common denominator of -131/18 and 43/582. 1746 Calculate the common denominator of -19/8168 and -21/88. 89848 What is the common denominator of -26/21 and 73/4923? 34461 What is the common denominator of 41/20142 and -43/10? 100710 What is the smallest common multiple of 160 and 160? 160 Find the common denominator of -55/546 and -97/156. 1092 Calculate the lowest common multiple of 610 and 10. 610 Calculate the common denominator of -89/350 and -71/110. 3850 What is the smallest common multiple of 416 and 72? 3744 Calculate the common denominator of -67/15758 and 81/20. 157580 Calculate the smallest common multiple of 8 and 616. 616 Calculate the smallest common multiple of 936 and 2. 936 Find the common denominator of -43/326 and 15/14. 2282 Find the common denominator of -77/15 and -71/1185. 1185 Calculate the lowest common multiple of 10 and 106. 530 Find the common denominator of -29/8 and 15/58. 232 Find the common denominator of -31/44 and 63/236. 2596 Calculate the least common multiple of 38 and 10. 190 What is the smallest common multiple of 104 and 104? 104 Calculate the common denominator of 25/7 and 37/180. 1260 What is the least common multiple of 64 and 1128? 9024 Calculate the least common multiple of 4 and 36. 36 Calculate the common denominator of -87/112 and -77/60. 1680 Find the common denominator of 103/80 and 39/1216. 6080 Calculate the common denominator of 1/14 and -83/1662. 11634 Calculate the common denominator of 137/8940 and -51/2. 8940 Find the common denominator of -73/88 and 143/13128. 144408 What is the common denominator of -59/3902 and -52/9? 35118 Find the common denominator of -79/364 and -23/5824. 5824 What is the common denominator of -16/21 and -41/126? 126 What is the least common multiple of 136 and 36? 1224 Calculate the common denominator of -157/84 and -107/56. 168 Calculate the least common multiple of 34 and 2. 34 Calculate the common denominator of 115/12 and 67/444. 444 What is the lowest common multiple of 14 and 14? 14 Calculate the lowest common multiple of 9 and 406. 3654 Calculate the common denominator of -69/4 and -31/4. 4 What is the least common multiple of 1200 and 450? 3600 Calculate the common denominator of -19/2416 and -89/20. 12080 What is the least common multiple of 5087 and 3? 15261 Find the common denominator of 32/5037 and -87/146. 10074 What is the smallest common multiple of 20 and 10? 20 What is the smallest common multiple of 264 and 198? 792 Find the common denominator of 42 and 26/4405. 4405 Calculate the common denominator of -19/21 and 52/121. 2541 Calculate the smallest common multiple of 16 and 250. 2000 What is the lowest common multiple of 13 and 42? 546 Find the common denominator of 40/9 and 1/111. 333 Calculate the smallest common multiple of 3 and 1057. 3171 What is the smallest common multiple of 12 and 30? 60 Find the common denominator of -101/30 and 25/123. 1230 Find the common denominator of -49/185 and 65/2. 370 Find the common denominator of 49 and -9/73. 73 Calculate the common denominator of 29/2 and 37/182. 182 What is the common denominator of -24/649 and 51/649? 649 What is the smallest common multiple of 28 and 2? 28 Calculate the common denominator of 107/114 and -151/18. 342 What is the common denominator of 101/336 and 11/6? 336 Find the common denominator of -18/7 and 91/3736. 26152 Calculate the least common multiple of 366 and 1525. 9150 What is the smallest common multiple of 22 and 2? 22 What is the least common multiple of 5 and 10? 10 Calculate the least common multiple of 400 and 14. 2800 Calculate the common denominator of -121/100 and -97/200. 200 Calculate the lowest common multiple of 8 and 396. 792 Calculate the smallest common multiple of 3370 and 90. 30330 Calculate the common denominator of 18/7 and 45/119. 119 Find the common denominator of 19/165 and 101/770. 2310 What is the lowest common multiple of 9 and 157? 1413 Calculate the least common multiple of 3 and 2634. 2634 What is the least common multiple of 24 and 8? 24 Calculate the common denominator of -13/2120 and -25/3392. 16960 Find the common denominator of -22/4223 and 71/369. 38007 What is the common denominator of -49/60 and -109/9666? 96660 What is the common denominator of -145/36 and 173/180? 180 What is the least common multiple of 3 and 16? 48 What is the smallest common multiple of 6390 and 3550? 31950 Find the common denominator of 139/96 and -1/192. 192 Calculate the least common multiple of 48 and 10. 240 What is the common denominator of -23/36 and -157/270? 540 What is the least common multiple of 42 and 231? 462 What is the smallest common multiple of 36 and 108? 108 What is the common denominator of -95/126 and -137/12? 252 Find the common denominator of 70/111 and -61/105. 3885 What is the common denominator of 101/12 and -29/284? 852 What is the lowest common multiple of 6 and 15? 30 What is the lowest common multiple of 264 and 198? 792 Calculate the common denominator of 151/1194 and -16/2985. 5970 Calculate the lowest common multiple of 4 and 5338. 10676 Calculate the least common multiple of 668 and 16. 2672 What is the common denominator of 121/48 and 1/12? 48 Find the common denominator of -41/40 and -46/55. 440 Find the common denominator of -41/135 and -113/30. 270 Find the common denominator of -29/1452 and 64/6171. 24684 Calculate the common denominator of 41/6 and -107/6450. 6450 What is the common denominator of 145/708 and 113/108? 6372 What is the common denominator of 63/500 and 121/500? 500 What is the smallest common multiple of 26 and 234? 234 What is the least common multiple of 90 and 2940? 8820 What is the common denominator of -161/60 and -7/3480? 3480 Calculate the common denominator of 9/117892 and -73/14. 825244 What is the smallest common multiple of 4698 and 6? 4698 Calculate the lowest common multiple of 20 and 76. 380 Find the common denominator of 95/1422 and 89/1896. 5688 Calculate the common denominator of -143/60 and -13/6. 60 Calculate the smallest common multiple of 97 and 1. 97 Find the common denominator of 40/19 and 143/114. 114 Calculate the common denominator of 131/1360 and -41/20. 1360 Calculate the common denominator of 69/20 and 13/4. 20 Calculate the smallest common multiple of 860 and 258. 2580 Calculate the common denominator of 151/294 and 50/343. 2058 What is the smallest common multiple of 812 and 22? 8932 What is the smallest common multiple of 243 and 108? 972 Find the common denominator of 50/3 and -82/63. 63 Calculate the common denominator of 35/2 and 85/326. 326 What is the common denominator of -18/7 and -41/2704? 18928 What is the lowest common multiple of 1800 and 84? 12600 What is the	{ "pile_set_name": "DM Mathematics" }
468 divided by -6 13234/3 What is -868295 divided by 173659? -5 What is -126000 divided by 140? -900 -4 divided by -584898 2/292449 Divide -908807 by -2. 908807/2 Calculate 411186 divided by -3. -137062 Calculate -221547 divided by -73849. 3 Divide 2490 by -149. -2490/149 Divide -26896 by -1681. 16 What is 22018 divided by 61? 22018/61 What is -249422 divided by 124711? -2 Divide -6 by 3249. -2/1083 What is 80997 divided by -2793? -29 What is -1695 divided by -1069? 1695/1069 -126 divided by 1402 -63/701 1690 divided by 845 2 What is -1464 divided by 732? -2 Calculate 0 divided by -27983. 0 -14636 divided by -5 14636/5 Calculate 5330 divided by 5330. 1 Calculate 29624 divided by -23. -1288 Divide 16175 by -3. -16175/3 Divide 61100 by -2350. -26 Calculate -33570 divided by 11190. -3 1805 divided by 27 1805/27 What is 5 divided by 12836? 5/12836 Calculate -93984 divided by -66. 1424 What is 29160 divided by -3? -9720 What is 24 divided by 2150? 12/1075 Calculate -693667 divided by 13. -53359 13078 divided by 213 13078/213 -26840 divided by 4 -6710 What is 6837570 divided by 4905? 1394 Calculate -5640 divided by -19. 5640/19 What is -30 divided by -625? 6/125 Divide -1 by 22064. -1/22064 Divide -48920 by 48920. -1 -1829286 divided by -3 609762 88905 divided by -29635 -3 What is -1075536 divided by 16? -67221 Calculate -102406 divided by 2. -51203 Divide -25773 by 71. -363 What is 5233483 divided by -4? -5233483/4 -286404 divided by 6 -47734 Calculate 3240 divided by -108. -30 -2282258 divided by 2 -1141129 Divide -442680 by -3689. 120 What is 5066 divided by -298? -17 -572102 divided by 24874 -23 What is 767141 divided by -3? -767141/3 What is -2 divided by -2316? 1/1158 -220 divided by -3039 220/3039 What is 5 divided by 350665? 1/70133 Divide -101 by -83. 101/83 Divide 1819 by -2. -1819/2 Calculate -8970750 divided by 1794150. -5 Divide 135344 by 2. 67672 Calculate 117336 divided by -4889. -24 -5 divided by -35417 5/35417 -459559 divided by -5 459559/5 Calculate -3 divided by -23982. 1/7994 Divide 29026 by -14513. -2 What is -77454 divided by -2? 38727 Divide 1106 by 6. 553/3 What is -1 divided by -255877? 1/255877 Calculate 40 divided by 2709. 40/2709 4159932 divided by 346661 12 Divide -66 by -557. 66/557 What is 22212 divided by -7404? -3 Divide 136680 by -6. -22780 What is -2632 divided by 169? -2632/169 -36936 divided by -2052 18 What is -27612 divided by -12? 2301 Divide 234324 by -78108. -3 What is 102 divided by -260? -51/130 What is -30530 divided by -142? 215 What is -20058 divided by 6? -3343 Divide -131 by 25. -131/25 What is 113152 divided by -14144? -8 Divide 42998 by 3. 42998/3 Divide 37200 by -200. -186 Calculate -77740 divided by 5. -15548 What is 208092 divided by 12? 17341 -1017726 divided by -339242 3 What is -5 divided by -2133? 5/2133 What is -1809108 divided by -129222? 14 33206 divided by -16603 -2 Divide -302367 by -9. 100789/3 1474580 divided by 85 17348 3754132 divided by 938533 4 Calculate 1 divided by -6251. -1/6251 Divide -70548 by -4. 17637 Divide -25 by 5583. -25/5583 -11654 divided by 167 -11654/167 What is -54519 divided by 6? -18173/2 12256 divided by 3 12256/3 Calculate -6577 divided by -14. 6577/14 Divide -65268 by -444. 147 Divide -3883 by -20. 3883/20 811764 divided by -6 -135294 Calculate -172598 divided by 4. -86299/2 134876 divided by 28 4817 -3 divided by 30499 -3/30499 What is 69186 divided by 55? 69186/55 Calculate -249 divided by 108. -83/36 Divide 192809 by -23. -8383 What is 3 divided by 22031? 3/22031 Divide -98351 by 1. -98351 What is -593591 divided by -3? 593591/3 214632 divided by 53658 4 Divide 10710 by -4. -5355/2 What is 15066 divided by 15066? 1 35 divided by 1182 35/1182 What is 18 divided by -11? -18/11 Calculate 188616 divided by 2. 94308 Calculate -4486 divided by -19. 4486/19 11110 divided by -12 -5555/6 What is 5 divided by -117491? -5/117491 What is -71 divided by -3104? 71/3104 -374178 divided by 6 -62363 What is -7004 divided by -34? 206 What is 71460 divided by 1? 71460 Calculate 144 divided by 71. 144/71 Divide -9258 by 5. -9258/5 Calculate 2127265 divided by 7. 303895 Calculate 0 divided by 286142. 0 What is -27948 divided by 68? -411 0 divided by -5999 0 What is -3678 divided by -6? 613 What is -6 divided by -821? 6/821 What is 0 divided by -1042422? 0 -9 divided by 124088 -9/124088 Calculate 200 divided by 18. 100/9 Calculate 231 divided by -27. -77/9 Calculate -297315 divided by 5. -59463 What is 98010 divided by -19602? -5 Divide -328149 by 3249. -101 Calculate -768732 divided by 116. -6627 Divide -1872902 by 1. -1872902 Divide 3040706 by -101. -30106 Calculate -212 divided by 143. -212/143 What is 99866 divided by 2171? 46 Calculate 9269 divided by -153. -9269/153 Divide 214 by -85. -214/85 Calculate 5079404 divided by -75812. -67 Divide -3426 by -6. 571 Calculate -689935 divided by 2. -689935/2 What is 149759 divided by 3? 149759/3 Divide -54688 by 4. -13672 Calculate 82688 divided by -64. -1292 -841 divided by 5 -841/5 Calculate -4 divided by 33740. -1/8435 Divide -5839503 by -1946501. 3 -1163962 divided by 4 -581981/2 Calculate 14287 divided by 7. 2041 -87702 divided by -3 29234 Divide -6 by 1677296. -3/838648 Divide -90190 by 29. -3110 Divide 331788 by -172. -1929 Calculate 883424 divided by -23248. -38 12 divided by -426 -2/71 What is -256848 divided by -256848? 1 Divide 392742 by -189. -2078 Calculate 4 divided by 4214. 2/2107 Calculate 21301 divided by -1253. -17 Divide -32887 by 15. -32887/15 Calculate 308535 divided by -1535. -201 What is -188132 divided by -6719? 28 -214989 divided by 15 -71663/5 What is -701932 divided by 154? -4558 What is 212165 divided by 1? 212165 What is -5336 divided by 2? -2668 Divide -87475 by 3499. -25 What is -3 divided by 1158679? -3/1158679 What is 1594 divided by 797? 2 Calculate -899360 divided by 55. -16352 What is -2 divided by -273333? 2/273333 0 divided by 591 0 Calculate 539996 divided by -4. -134999 Divide 894593 by 49. 18257 Calculate -1691811 divided by -207. 8173 Calculate 1 divided by 3707. 1/3707 Divide -47076 by 4. -11769 Divide -461880 by 30. -15396 What is -8880 divided by -6? 1480 What is -281878 divided by 1? -281878 Divide -28984 by -7246. 4 What is -1472 divided by 493? -1472/493 Divide 152274 by -25379. -6 What is 69549 divided by -4? -69549/4 9 divided by 144 1/16 Calculate -2 divided by 182892. -1/91446 12876 divided by -3219 -4 Calculate -129 divided by -2310. 43/770 What is 0 divided by -35856? 0 What is 19293 divided by -34? -19293/34 What is -256450 divided by 1115? -230 Divide -6548 by 79. -6548/79 -886 divided by -1238 443/619 47 divided by 1103 47/1103 92 divided by -404 -23/101 1926 divided by 642 3 Divide -421316 by 1. -421316 Calculate -150012 divided by 81. -1852 Divide 71131 by -5. -71131/5 7 divided by -94282 -7/94282 Calculate -402824 divided by 50353. -8 What is -192814 divided by 2? -96407 What is 194475 divided by 7779? 25 Calculate -1 divided by -31400. 1/31400 127 divided by -2957 -127/2957 What is 1850373 divided by -1? -1850373 Divide 241844 by 1174. 206 Divide -17764 by -35. 17764/35 11814 divided by 3938 3 Divide -328 by -67. 328/67 Divide 113146 by 4. 56573/2 Divide 11670 by -277. -11670/277 Calculate 5 divided by -89758. -5/89758 -19040 divided by -560 34 Calculate 4230 divided by -2115. -2 -70542 divided by -3919 18 -8 divided by -192 1/24 Divide 96351 by -5. -96351/5 What is -1152 divided by 702? -64/39 Calculate 108700 divided by 1. 108700 What is 360760 divided by 20? 18038 644366 divided by 10393 62 -2649097 divided by 240827 -11 614978 divided by 3379 182 3998505 divided by 38081 105 -57237 divided by 3 -19079 -13054 divided by 2 -6527 9360 divided by -936 -10 What is 294560 divided by -294560? -1 Divide -166573 by -166573. 1 Divide -145065 by 285. -509 Calculate 11408 divided by 26. 5704/13 -1109134 divided by 1109134 -1 Divide 11545 by 1. 11545 Divide -464576 by -33184. 14 -3053 divided by -1 3053 Calculate 147810 divided by 10. 14781 Divide -131 by -3273. 131/3273 Calculate 4 divided by -415577. -4/415577 Divide 227473 by -2. -227473/2 509469 divided by 169823 3 Divide 6164718 by -2054906. -3 What is -531622 divided by 37973? -14 What is -57568 divided by -4? 14392 Calcul	{ "pile_set_name": "DM Mathematics" }
vided by s(-9)? 20 Let k = -269 + 673. What is the remainder when k is divided by 141? 122 Suppose 0 = 4c + 52 - 60, 42 = 4z + 3c. Calculate the remainder when 42 is divided by z. 6 Let b(r) = 35r + 86. Calculate the remainder when b(5) is divided by 44. 41 Suppose -66 = -23l + 49. Calculate the remainder when 50 is divided by l. 0 Let o(c) = 6c. Let s(f) = f - 1. Let q(l) = 2o(l) - 4s(l). What is the remainder when 79 is divided by q(2)? 19 Let d(r) = r*3 + 7r*2 - 3r - 5. Suppose -3u + 4b + 98 = 0, 9u = 7u - 4b + 52. Calculate the remainder when u is divided by d(-7). 14 Suppose -x + 2h = 3h - 16, -x + 3h = -36. What is the remainder when 95 is divided by x? 11 Let y(l) = -l - 6. Suppose -5b = 53 + 17. Suppose -2c - 2j + 26 = 0, j = -c - 4c + 65. What is the remainder when c is divided by y(b)? 5 Suppose -8 = -2i, -382 = 16o - 21o - 3i. What is the remainder when o is divided by 7? 4 Suppose 0 = -52w - 206 + 2078. Calculate the remainder when 1078 is divided by w. 34 Let n(f) = -f + 16. Let o be 252/(-27) - 1/(-3). What is the remainder when 49 is divided by n(o)? 24 Suppose 14f - 385 = -119. Calculate the remainder when 377 is divided by f. 16 Let m(i) = i*3 + 5i*2 - 4i - 5. Let s(f) = 10f - 121. Calculate the remainder when m(-5) is divided by s(13). 6 Suppose -8i + 1938 = 9i. Calculate the remainder when i is divided by 24. 18 Let x = 19 + -13. Suppose 5t - 36i + 40i - 48 = 0, -5i = 5t - 55. Calculate the remainder when x is divided by t. 2 Let k(p) = p*3 + 3p*2 - 2p - 3. Let x be k(3). Let s = -34 + x. What is the remainder when 53 is divided by s? 9 Let o(y) = -y + 17. Let f = 9 - 6. Let p = f - -26. Calculate the remainder when p is divided by o(7). 9 Let i = -14 - -14. Suppose 2t + t - 15 = i. Suppose -2q - tm + 41 = 0, -2m - 41 = -3q - 8. What is the remainder when q is divided by 8? 5 Suppose m - 3r + 3 = 0, -m = -14r + 16r - 12. Suppose -2a + 162 = 3x + a, 4x + 3a = 211. What is the remainder when x is divided by m? 1 Let u(b) = -26 + 30b - 14 + 23. What is the remainder when u(6) is divided by 33? 31 Suppose -7m + 2m = -15. Suppose -mu - 560 = -7u. What is the remainder when u is divided by 11? 8 Calculate the remainder when 5((-378)/(-35) - -4) is divided by 4. 2 Let r = -19 + -53. Let l = 197 + r. Calculate the remainder when l is divided by 32. 29 Suppose 2z = -0z + 4, -5y = -5z - 2350. Calculate the remainder when (-12)/28 + y/7 is divided by 23. 21 Let p(q) = -q*3 + 10q*2 - 16q + 185. Calculate the remainder when 157 is divided by p(10). 7 Suppose 12b = 3b + 27. What is the remainder when 73 is divided by b? 1 Suppose 6p = 2p - 24. Calculate the remainder when 206 is divided by (10/4)/(p/(-84)). 31 Let v(t) = 115t2 + 9t - 6. Let x(j) = -115j2 - 8j + 5. Let y(q) = -6v(q) - 7x(q). What is the remainder when y(-1) is divided by 29? 27 Suppose 0 = -2q + 9 + 51. Calculate the remainder when 97 is divided by q/9(-60)/16-2. 22 Suppose -2k = 5o - 121, o + 34 = 4k - 197. Let t = -32 + 52. What is the remainder when k is divided by t? 18 Suppose 0 = -6g + 58 + 14. Calculate the remainder when 19 is divided by g. 7 Let s(b) = 7b*2 + 2b - 2. Let t = -6431 - -6438. What is the remainder when s(-2) is divided by t? 1 Let y = 5 + -2. Suppose 3j + 4l = -l - 27, yj = l - 9. Let k(b) = 2b*2 - 5b - 1. What is the remainder when k(j) is divided by 26? 25 Suppose -206 + 305 = 3r. Calculate the remainder when r is divided by 9. 6 Suppose p = 5p - 596. Let r = -12 + p. Let k = r - 92. Calculate the remainder when k is divided by 12. 9 Calculate the remainder when 8/(216/(-117))-51 is divided by 24. 5 Let f = 1344 - 1336. What is the remainder when f is divided by 6? 2 Suppose 912 = 4v + 4j, -12j = 3v - 7j - 684. What is the remainder when v is divided by 74? 6 Suppose -s + 1 = -2g - 46, -4g = s + 97. Let d = 52 - g. Suppose 0 = -4a + 36 + d. What is the remainder when 83 is divided by a? 27 Calculate the remainder when 224 is divided by 4/8 + (-1017)/(-18). 53 Suppose -3v + 5s = -4v - 2, -43 = -4v - 3s. Let b(g) = 3g3 - 2g*2 - 5g + 3. What is the remainder when b(3) is divided by v? 12 Let o(p) = -8p - 19. Let k(n) = 3n + 6. Let l(a) = -7k(a) - 2o(a). What is the remainder when 44 is divided by l(-4)? 12 Let d(r) = -3r2 - r + 3. Let y(g) = -g. Let o(z) = -d(z) - 2y(z). Suppose 0s - 2s + 86 = 0. Calculate the remainder when s is divided by o(-3). 13 Suppose p - 24 = -p. Suppose 17c + 55 = 28c. Suppose -c = -40i + 39i. What is the remainder when p is divided by i? 2 Suppose 3r = -5i + 5, -i = 4r - 5i - 28. Suppose 5g - 172 - 38 = -5v, -g = rv - 34. What is the remainder when g is divided by 13? 5 Let k(x) = x2 + 30x + 193. What is the remainder when 381 is divided by k(-23)? 29 Let x = -7 + 10. Let d = x + 27. Let q(h) = -h*2 - 7h + 5. What is the remainder when d is divided by q(-6)? 8 Suppose -142n - 5x = -145n + 5, -5n - x = -55. What is the remainder when 297 is divided by n? 7 Suppose -2j = s - 106, -9j + 12j = 2s + 152. What is the remainder when j is divided by 38? 14 Let s(x) = 3x2 - 39x + 38. What is the remainder when 71 is divided by s(12)? 1 Suppose 21r + 700 = 49r. Calculate the remainder when r is divided by 20. 5 Suppose -11z - 29z + 442 = -6z. Let s be (-9)/6-12. Suppose sh - 144 = -h. What is the remainder when h is divided by z? 10 Let x(d) = -3d + 7. Let b be x(-1). What is the remainder when 186/b + (-24)/40 is divided by 5? 3 Let y(j) = j. Let n(r) = -r2 + 7r + 31. What is the remainder when y(2) is divided by n(10)? 0 Suppose 4x = 2x. Suppose -5s - b = -2b - 20, -2s + 4b - 10 = x. Let n = 14 - s. What is the remainder when 25 is divided by n? 7 Suppose -75 = -2m - 2m - 3c, -4c + 80 = 4m. Calculate the remainder when ((-13 - 4) + 15)59/(-2) is divided by m. 14 Suppose -g + 150 = b, -17 = 3g - 2. Suppose 0 = 4c - 8, -5u + 2c + 150 = -41. Calculate the remainder when b is divided by u. 38 Suppose 15 = -5h, -3c + 70 = 3h - 14. Let q(d) = -8d + 59. What is the remainder when c is divided by q(6)? 9 Suppose -5i - 8191 = 214. Let m = i + 1145. What is the remainder when 33 is divided by m/(-44) - 2/11? 9 Let l = -132 + 300. What is the remainder when l is divided by 34? 32 Suppose -4t + 5t + 5 = 0, v = 4t + 75. Calculate the remainder when v is divided by 28. 27 Let s = -309 + 156. Let x = s + 176. What is the remainder when 159 is divided by x? 21 Let d = -21 + 9. Let k = 26 + d. Calculate the remainder when k is divided by 4. 2 What is the remainder when 28 is divided by (-3)/(-2)392/147? 0 Let m(f) = 3f3 + f2 + 3f - 2. Let c(h) = -h - 6. Let b be c(-8). Suppose q - 5g = 32, q + 5g - 4 = -b. What is the remainder when m(2) is divided by q? 15 Let m(p) = -p - 6. Let j be m(0). Let q = -2 - j. Let h = 2 + 4. What is the remainder when h is divided by q? 2 Suppose 34r - 190 = 91r - 874. Suppose 2x = 5h + 14, -h + 2x + 8 = -2x. What is the remainder when (6/h)/(2/(-60)) is divided by r? 9 Let f = -14 + 37. Suppose -1 - f = -4c. Calculate the remainder when 19 is divided by c. 1 Let z = 2776 + -2752. What is the remainder when z is divided by 28/((3 - 2)2)? 10 Let l(v) = 21v*2 + 11v + 3. Calculate the remainder when 155 is divided by l(-1). 12 Let d = -1 - -4. Suppose -di + 793 = 10i. Calculate the remainder when i is divided by 19. 4 Suppose 0 = 5u - 17u + 60. Calculate the remainder when 131 is divided by u. 1 Suppose 0 = 5s - 5f - 160, 19 + 16 = s - 4f. Calculate the remainder when 154 is divided by s. 30 Suppose 61 = -3z + 4v - 63, -z + v = 41. Let c = z + 49. What is the remainder when c is divided by 2? 1 Suppose -r + 6r + 104 = 4g, 70 = 2g + 2r. Calculate the remainder when 56 is divided by g. 25 Let p(n) = 2n - 499. Let f be p(0). Let t = f - -248. What is the remainder when 68 is divided by (-6)/(-33) + t/(-11)? 22 What is the remainder when 548 is divided by 3 + 31 - 5 - 4? 23 Let q(y) be the first derivative of -7y4/2 - y3/3 + y2/2 - y - 6. Calculate the remainder when q(-2) is divided by 18. 15 Let b(j) = 16j*2 - j - 1. Suppose -3p + p - 2f + 6 = 0, 3p - 4*f + 19 = 0. Let c be b(p).	{ "pile_set_name": "DM Mathematics" }
)/109 + 848/18. 48 What is 384/14 - (-7444)/13027? 28 What is (25 - (740 + 8)/17) + -48? -67 What is the value of -7 + ((-1 + 0 + 3)7785/(-346))/1? -52 What is the value of (5600/(-49))/10 - 656/1148? -12 Calculate (-12792)/287 - (-1 + -44). 3/7 ((-10)/(-13680)-6)/(8/122417) -3/76 What is the value of 39/(-9)(-1066 + 1075)? -39 Calculate 8 - (-2780)/(-360) - (-50)/(-60). -5/9 What is the value of (-38)/(-10) - 1091307/278040? -1/8 6/4(-8 - -10) - (2 + 32) -31 11648/840 - 2/(-15) 14 26/(-2691) + (-865985)/32085 -27 What is ((-54)/(-585))/((-12)/(-52))? 2/5 Evaluate -81 - (-480)/(2340/39)(-2)/4. -85 What is the value of 1/(-14)-316(-63)/(-18) + 280/(-56)? 74 418557/(-3654) - -112 - (-5)/6 -12/7 What is ((-2176)/(-102) + -23)/((-45)/(-252))? -28/3 Calculate (-4)/7 - (-44 - 8856/(-378)). 20 What is the value of 14208/(-25840) + (-738)/(-31365)? -10/19 What is the value of (14/(-588)-4764)/(-2) - 10/(-14)? -56 What is 12/(-4) + (1215/(-4830))/27(-11640)/36? 2/161 -30 + (-8)/(-14) + (-14784)/1176 -42 Evaluate (680/96 - 7)/((-12)/342) + (-9 - -17). 45/8 What is 64/(6784/(-159))88/42? -22/7 Calculate ((-6)/(-7) + 516/(-63))((-9680)/418 - -23). 22/19 Evaluate (4767/(-147) + 25)(57/(-304))/((-3)/4). -13/7 Calculate -5 + 7084/224 + -27. -3/8 Evaluate (-1079)/7553 + -1 + (-412)/7. -60 What is ((-3 - -1) + -5)-323102/(-6783)? -34 Calculate ((-34)/12)/((-2)/6)(-25044)/12522. -17 Calculate (5/(-2))/(715/(-572))4370/(-92). -95 Calculate 841804/(-330840) - 26/(-10). 1/18 (-46)/((-4232)/1702)4(-8 - -7) -74 (-12 + (-33)/17628)-1212/(-54) -46 Evaluate ((35/(-255))/(63/(-81)))/(6/(-72)-6). 6/17 What is the value of 159/2(3535/4242 + (1 - 14/12))? 53 Calculate 416/572 + ((-1508)/(-44) - 0). 35 Evaluate (2 + -61 + 4/2)17052/(-25578). 38 What is (506/66 + 5)(-3 + 0)? -38 Evaluate (-5)/(-32) + (-582625)/1342368. -5/18 Evaluate (63 + -38 + 24)/1. 49 What is the value of -10 - 40 - (-13904)/(-869)? -66 What is the value of 2 + (-627)/385 + (-4)/(-30)6/4? 4/7 Evaluate (-233)/100 - (64242/(-344))/83. -2/25 Evaluate 86/(-559) + (1 + (-5)/4 - (-147193)/3172). 46 (-20)/501560/(-9672) 2/31 Calculate (-20)/5 - (2 + (-63)/7)1. 3 Evaluate 9/2115(-8)/84077/(-6). 11/14 Calculate (-4)/(-6) + -2 + (-19050)/(-100)4/558. 1/31 What is (-3450)/750 - (-1452)/(-55)? -31 -66 + (-75)/(2100/(-616)) + (-6)/(-2) -41 What is (38 - 42240/1089)(8 - 14)? 52/11 What is 13 - 784/64 - ((-486)/(-504) - 8/(-28))? -1/2 What is (-3027)/9081 + 0 + 10/4? 13/6 Evaluate ((-2)/(-39))/((-102)/(-37791)). 19 (86/6 + 23530/(-1560))/(270/32) -4/45 What is (-13670)/(-2055) + 8/(-12) + (-12192)/2032? -2/137 Calculate (-11)/((24/(-1728)8)/((-3)/9)). -33 Calculate (98/42 - 8/6)(7 + 1668/(-236)). -4/59 What is 502228/(-13596) + (8/330)/(10/(-25))? -37 Calculate (-53)/(-742) - (-330)/84. 4 What is (-29 - -71)/((-15)/45) - -19? -107 What is the value of 440496/25920 + 5/900? 17 Calculate (-16)/(-24) - (-34816)/(-54528). 2/71 What is the value of 51/((66/495 + 65/75)/1)? 51 ((-165)/(-12) - 3)(-22)/(-33)(44 + -47) -43/2 -35330/(-379086) + (16/46)/(-4) -3/67 What is (-328)/(-28) - 24/(-84) - (-2035)/(-110)? -13/2 What is (-20)/8 + 146/131427/(-6)? -3 What is (1182/(-72) + 10 + (-12)/(-72))1? -25/4 What is 34 + 21229/(-621) + (-12)/(-54)? 1/27 Evaluate -2(164/80)/((-336)/(-6510)). -31 What is the value of ((-572)/(-70))/(-11) + (-20)/(-6650)-19? -4/5 What is the value of 16/(-10) - -9(-148)/(-810)? 2/45 4 + 44/(-594) + (-8432)/2160 1/45 What is the value of (3/(-810))/(38 + (-3696)/99)? -1/180 Evaluate (-3960)/(-42) + -2 - (-43 - (-24543)/567). 92 -1(-3)/(-24) + (1659/3081)/((-32)/(-44)) 8/13 Evaluate ((-2)/(-8) - (-164)/(-16)) + 276298/7271. 28 Evaluate (101016/966 - 90)/((-33)/42 + 1). 68 What is 33 - 42 - ((-7)/((-14)/(-78)) - 11)? 41 Evaluate -1 - (-2 - (-231)/(-18)) - 350/25. -1/6 Calculate (((-1)/4)/(-1))/((-39330)/(-552) + -57). 1/57 Calculate 21/119 - (1492/(-408) + -2). 35/6 What is ((-72)/15 - (5 - (9 + 0)))195/(-3)? 52 Calculate (6 - 2717/455) + 720/280. 13/5 What is (((-156)/5)/13)/(1456/(-280))? 6/13 What is the value of (-377)/(1679535/18216) + (-2)/(-10)? -35/9 (-85536)/(-3564) - (-114)/62-13 3/31 Calculate (-1)/((-5066)/(-7599) - (214/12)/(261)). 52 Evaluate ((-140)/21)/((-240)/36 - -5). 4 What is 23 - (252/48 - 6)/(3/(-36))? 14 What is the value of 24/((-50(-18)/(-2160))/(10/18))? -32 What is the value of ((-3)/((-18)/(-15)))/(1550/(-3720)) - (-114)/(-20)? 3/10 Evaluate 13 + ((-520)/80 - 21/14). 5 What is (-2 - ((-12)/(-14))/((-32)/56))(-840)/(-1330)? -6/19 Calculate ((-171)/(7182/(-28)))/((-14)/3). -1/7 What is the value of ((-723)/190 - -4) + ((-10)/(-35) - 288/1596)? 3/10 Calculate -17 + ((-12)/40 - (-201178)/28060). -3/23 Calculate (85/((-3315)/(-117)))/(-6). -1/2 (117/6 + 0)/(6 - (-414)/(-92))-1 -13 Evaluate (-42)/(-4)(-84)/(-144) - ((-104)/(-64))/13. 6 What is the value of (-13 - 2449/(-155))/(1/((-25)/30))? -7/3 What is 672/(-64680)12/602/((-12)/75)? 2/77 Calculate (440/1800 - (-8 - -15)/(-35)) + (-190)/(-18). 11 Evaluate (-64)/(-6) - ((-5654)/308 + 29). 1/42 Evaluate (40/2240-14)/((-5)/(-2) + 3). -1/22 What is (90 - 12336/80) + (-42)/15? -67 (2 + 5559/255 - 25)/(3/140) -56 What is the value of (-6704 - -6722)/(21/6(-3)/28)? -48 (-5985)/(-95) + 64/(4 + -6) 51 What is the value of 4(-2)/4 + 18 + 41/((-697)/1173)? -53 What is 1683/765 - ((-14)/(-2) - 941724/195930)? 2/311 Evaluate (-465)/6(4 + (-544)/170). -62 What is the value of ((-810)/2430(8 + -3))/((-34)/(-12))? -10/17 Calculate ((4/(-52))/(-2 + 12))/(((-40)/16)/(-5)). -1/65 Calculate (19/(361/(-38)))/(8/(-164)). 41 (1/7 + 0)/(12105/135 + -88) 3/35 What is the value of (-100)/12 - (-14744)/1632 - (1 - 45/51)? 7/12 What is 49 + (37/(-148))/(4/(-48) - 0)? 52 42313/(-3553) + 12(-1)/(-1) + 2471/(-77) -32 Calculate ((2/(-12))/1)/(23320/34980). -1/4 Calculate 3087/(-882)48/14. -12 What is (-224)/12(108/90)/(9 - 30)? 16/15 What is 80 + 52 + -107 - -23? 48 Evaluate -10043 + 10014 - (3/2)/((-6)/8). -27 What is (2 + -1)2 - (73168/(-13719))/((-1)/6)? -30 Evaluate 51 - 2461/46 - 366/12. -33 Evaluate 1 + (-1 - -68) - ((-3)/(-6) + (-2052)/(-216)). 58 What is -7(16/(-1584)-27)/(-3)? 7/11 What is (-2)/(4 - -6)((-15)/9)/(55/(-594))? -18/5 Calculate 348/23 - (-18 + (-526)/(-16) + 119/952). 3/23 What is the value of (340/255)/((-4162)/66 - (-9)/(-33))? -2/95 Evaluate (-31 - 42) + -92(-3)/12. -50 Evaluate (7 + (-3672)/684)19. 31 ((-1)/((-6)/9))/((-18095)/(-282) - 64) 9 (-1 - 0)/((-100)/(-75) - ((-431)/(-6) - -4)) 2/149 Calculate ((-19960)/240 - -46) + 38. 5/6 (291/(-338724))/(53/180) -1/97 Evaluate (-1744)/(-40) - 14(-7)/245. 44 What is the value of (-35)/(-108) - (24/810 - (-10)/225)? 1/4 What is (20/(-30))/(26 + (-106112)/4080)? 85 Calculate (-2428 + 2424)(4 + 23/2). -62 Evaluate 9/6(-2 + 1608/(-144) + (14 - 2)). -7/4 (29609/(-319) - -91)(10 + 1) -20 (-16)/(-560)(-2450)/(-5810) 1/83 What is (-4)/14(-38 + -3 - -43)? -4/7 (46/2)/(-114 + 66 + 47) -23 (-2 - (1120/(-5880))/(6/(-147)))/((-4)/(-6)) -10 (25500/625)/34(-2 + 17/8 - 2) -9/4 Calculate 52/((-624)/(-45)) - 99/4. -21 Evaluate 5548/(-118) + 612/36108 - 15. -62 What is (-141)/(8319/1534) + 39? 13 What is the value of ((-6901)/(-67))/((-1(17 - 5))/(-12))? 103 14 - (-61398)/(-37521) 26/11 What is (-87 - -30) + 175 - 17? 101 Evaluate (216/(-84))/(7 + 2388/(-336)) - 2. 22 Evaluate (8 + -11 + 4)(1/(-34) + (-193311)/1598). -121 What is the value of (28/84 - (-154)/6)/(-14 + 13)? -26 What is (-14)/(-8) + -2 + -18 + (258951/(-76))/59? -76 What is (10/4)/(((-2324)/112 - -19)(-4)/(-98))? -35 What is (-48)/(-15) - (20/8)/(3900/312)? 3 Evaluate 104/(-2) - (36 + -40). -48 ((-20)/13026)/(4(-1)/993) 33 2080/7800(388/(-136) + 3) 2/51 312/(-20) + 36/(1260/91) -13 Evaluate (-68064)/709 - (-130 - -3). 31 What is the value of (24082 + -24083)(1/(-1) + 17/19)? 2/19 Calculate (55488/(-1275) + 44)(-15)/8. -9/10 What is the value of 39/24 - (-3 - (-4)/1)? 5/8 Evaluate (-33)/9234/(-33). 26 Calculate ((-5698)/(-21))/(-11) - (-10132)/(-7599). -26 Calculate -20 + 1/(-2)(-10140)/169. 10 120513/5202 + 2/(-9)(-225)/60 24 What is ((-20516)/(-184) - 111)/(30/2092) - (-2)/15? 35 What is the value of (-2)/(-9) - (-5265)/8019*-11? -7 (-2)/13 + 14 + (-33402	{ "pile_set_name": "DM Mathematics" }
c and l have the same value? False Let u = -12/167 + -345/2171. Suppose 4l = -0l + 2b + 14, 4l - 5b = 29. Which is smaller: l or u? u Let f be (10/8 - 2)-1. Let v = 428 + -198. Let j = -228.9 + v. Is j >= f? True Let l be 1524/(-344) - (-27)/6. Are l and 0.32 non-equal? True Suppose 194 = -2v - 16s + 21s, 2s = 3v + 302. Let y be (-12)/(-16)-10 - v/17. Let o(u) = -3u3. Let x be o(1). Which is bigger: y or x? y Suppose -180h + 170h = 1170. Let x be h/(-135) + 1/(-5). Which is smaller: x or 0? 0 Let y(u) = -41u - 30. Let s be y(-26). Let t = 111887/108 - s. Which is smaller: -1 or t? -1 Let m = 2.004 + -2. Let i = 75.996 + -76. Let j = i + m. Is j less than 21? True Let x = -15778 - -15778. Let o = 0.219 + 103.781. Is o < x? False Suppose 8z = 3z - 260. Let h be z/(-72)21/2. Let v = h - 33/4. Is 0.6 <= v? False Let k(v) = -v3 - 14v*2 - 48v + 23. Let g(c) = -c*3 - 14c*2 - 47c + 22. Let h(y) = 5g(y) - 4k(y). Let t be h(-9). Which is smaller: t or 2/199? t Let s = -873.9 - -873.2. Is s greater than 0.296? False Let s be -759(16/(-3) - -4 - -1)-1. Do s and -240 have different values? True Let w be (-15)/(-515)67/5762. Is w at most as big as -1? False Let u be (-2)/(-3) - (-1940)/60. Which is smaller: u or -1/7? -1/7 Suppose 2b = -4f - 4860, 5b + 238f = 242f - 12192. Which is smaller: b or -2435? b Let n be (2(-52)/16)/(11/374). Is -193 smaller than n? False Let d be (-1)/((4/2)/2). Let k be ((-3216)/160)/((-36)/76). Let a = k - 130/3. Is a at most as big as d? False Let h be (-8)/(3920/2538) + 5. Let p = h + -1/49. Let n = -1.1 - -1.03. Is n bigger than p? True Suppose 5u - 4q + 308 = 0, -q = -223 + 226. Which is smaller: -24 or u? u Let l = 0.25 + -0.26. Let c(n) = 3n + 29. Let j be c(-7). Let v be j/(-30) - (-10)/(-25). Which is smaller: v or l? v Suppose -15 = -2h + 1. Suppose 0 = -3a + ha - 10. Suppose -5x - 43 = 3m, 3x + 18 + 9 = -am. Which is bigger: m or 0.08? 0.08 Let c = 27737 + -27743. Which is smaller: c or 2/261? c Let y be (4 + (-5372)/14)224/(-48). Is y at least as big as 1772? True Let i = 172 + -294. Let a = i + 1. Let o = 120 + a. Which is greater: -5 or o? o Let m be 404/(-12) + (-3)/9. Let t be (-10)/10 + m1/(-30). Which is greater: 1 or t? 1 Let q = -322 + 604. Suppose -291b - 9 = -qb. Which is greater: b or -5/3? b Let v = -3162937124 - -686356162844/217. Let b = v - -5498. Is 0 < b? True Let j(d) = -4d + 0d + 2d + 32 - 5d. Let b be j(8). Let p = b + 22. Are p and 1.7 non-equal? True Suppose 5 = -2u + 15. Let c(x) = 2x + 3 + 10 + 1 - 17. Let a be c(u). Is a at most 7? True Let u(d) = d3 + 8d*2 - 13d - 104. Let m be u(-8). Are 6/143 and m equal? False Let r = 51 - 39. Suppose 2v + r = 4. Let g be (16/(-6))/(37/9 + v). Is g bigger than -24? False Let m = -0.04 + 22.04. Let r = 21 - m. Let k = -38 + 47. Which is greater: r or k? k Let g = -203 - -202. Let h = 6.2 - -17.8. Is g > h? False Let o(i) = i2 + i - 1. Let n be 0/(0 - 1) + -1. Let g be o(n). Let d = -10214.01 - -10214. Is d smaller than g? False Suppose 2g - 4j = 6802, -4g = -4j - 4549 - 9019. Is g > 10148/3? True Suppose -25l + 72l = 27025. Which is greater: 563 or l? l Let f = 1 - 2. Let d = -645 + -195. Let n be 730/d + 6/21. Which is bigger: n or f? n Let n = 0.25 + -0.15. Let s = -33.02 - -33. Which is smaller: s or n? s Suppose 3j - 11 + 5 = 0. Let x be (1 - 3 - 2) + -26 + 25. Let s = x - j. Which is bigger: s or -6? -6 Let c = -934783/5 - -185381. Which is smaller: c or -1577? -1577 Suppose -21d + 16d + 115 = 0. Let o be d/7 - 3 - 2/7. Are o and -2/277 equal? False Let d(z) be the third derivative of -z5/60 - z4/8 + z*3 - 2z*2. Let a be d(-5). Suppose -19f = 15956 - 15956. Is a <= f? True Let s = 12 + -9. Suppose -2m = -sm + 13. Which is smaller: 1.4 or m? 1.4 Suppose 456 = -11k + 3k. Let v = 159 + k. Suppose -h + 2l = -3l - 35, -2l = -2h + v. Is 1/4 > h? False Let p = -176.626 + 174.5. Let k = 0.126 + p. Do k and 6 have the same value? False Let k(a) = 2a2 + 66a + 319. Let c be k(-7). Suppose i = -4i - 235. Is i at most c? True Let z = 19.5 - 1.5. Let u be ((-22)/20)/(885/(-8850)). Which is bigger: u or z? z Let f be 12(-2)/(-64 + 8). Which is smaller: f or -2/4911? -2/4911 Suppose 2b - 5m - 29 = 3b, 5m = b - 11. Let t = -31 + 10. Let v = t - -20. Which is bigger: b or v? v Suppose -2s + 182 = v, -5s + 355 = -2v + 656. Do 168 and v have the same value? True Let a(z) be the second derivative of -z3 - 81z*2/2 + 158z. Let p be a(-18). Which is smaller: 25 or p? 25 Let c(i) = -5i + 45. Suppose 0 = -14o + 28 + 98. Let z be c(o). Is z greater than 1/156? False Let o = -328.4 + 383. Let c = -54.9 + o. Which is greater: 1 or c? 1 Let w = -879 - -2195. Which is bigger: 1317 or w? 1317 Let y(r) be the second derivative of -r4/12 - r3/2 - r*2 + r. Let q be y(-3). Let l = 130.384 + -131.684. Which is smaller: q or l? q Let l = 5.7582 + 2.6418. Which is bigger: -3 or l? l Let i = -0.16117 - -7168.16117. Is -1 < i? True Let f be (-4)/14 - (-14920)/35. Let a be (426 - 10) + (19 - (19 + -13 - -2)). Which is smaller: a or f? f Suppose b + 18674 = 12b - j, 2j = -4b + 6800. Which is bigger: b or 1701? 1701 Let p = -65 + 105. Suppose 3c - 84 = -3w, -3906 + 3974 = w - 4c. Is w greater than p? False Suppose -3x + l + 4l - 69 = 0, -2x - 68 = 4l. Let r = 35 + x. Which is smaller: r or 8? r Let y = 3.582 + -822.582. Which is smaller: y or 2/7? y Let k = 229 - -90. Suppose 8268 = 6s + 20s. Which is smaller: s or k? s Let o be 0 - ((-9901)/(-117) - (-12)/78). Is -2/7 <= o? False Let l(d) = d3 + 16d*2 + 19d + 34. Let w be l(-15). Let c = -13 - -13. Suppose -3o + 2h - 78 = c, o + 2 = h - 24. Is o <= w? True Let c = 1 - 1.053. Let k = 260.277 - 260. Let f = c - k. Which is smaller: f or -1/3? -1/3 Let j = 711 + -554. Is j greater than 0? True Suppose -6s + 16s = -270. Let i be (12/(-75))/(s/15 + -1). Which is bigger: i or 4? 4 Suppose -57d - 1696 = -61d + 8688. Are 2597 and d nonequal? True Let y = -5 + 10. Let p = y + -68. Let d = 913/1995 - 23/399. Is d bigger than p? True Let x(t) = -t3 - t2 + 4t + 3. Let w be x(0). Let q be (400/(-6))/(w - 24/9). Is q less than -200? False Suppose -p + 2 = -1. Suppose 7 = pn - 5h + 2, -1 = -3n + h. Let v be -3 - 1600/(-266) - (-25)/((-400)/48). Which is smaller: n or v? n Let h = 12 + -148. Let y = h + 180. Let k = 99 - 55. Is y < k? False Suppose 5m + 23 - 58 = 0. Let x(k) = -k2 + 5k + 15. Let z be x(m). Let y be 0 - 15/(-48)3/(-5). Which is smaller: z or y? y Let z = -0.8 + 3.8. Let q = -570.7425 + 570. Let x = -0.0575 + q. Which is greater: z or x? z Let s(q) = -4q + 13q - 5q + 6. Let n be s(8). Let k(z) = -7z - 60. Let v be k(-14). Is n < v? False Let s(o) = o + 5. Let v be s(-6). Let y be (56 + -41 - (-34)/(-38)) + -15. Which is greater: v or y? y Let h = -602/46719 - -629597156/8175825. Let q = 77 - h. Is -1 less than q? True Let c = -6559 - -6825. Which is smaller: c or 11? 11 Suppose -2q - 3q + 5885 = 5l, -3q + 3515 = -l. Suppose -75 = -9h - q. Is h less than -2/7? True Let h be (17/(-5))/(1428/(-285) + -7 - -12). Which is smaller: 270 or h? 270 Let d be ((-35)/10 - -3)/((-4)/16). Let r = 6903 - 55101/8. Let t = -1289/88 + r. Is d at least as big as t? True Suppose -5m = -9 - 6. Let d be 5 + 69/92-1(3 + -1). Is d at most m? False Let w(x) = -x2 + 4x + 125. Let j be w(0). Let o = 127 - j. Suppose -oh + 2t - 2 = -h, 0 = -h - 4t - 20. Are -9 and h nonequal? True Suppose -47q + 46q - 303 = -2y, 0 = y - q - 150. Is 194 at least as big as y? True Suppose -4z + 12 = 4w, -171 = -5z - 161. Is w greater than 5/1707? True Suppose -24l + 18l + 12 = 0. Suppose -w + 4j - 7 = 0, -w - 5j - 1 = -3. Let i be 76/84w - -4. Which is smaller: i or l? i Let v be 3/((-68)/238 - 9/(-7)). Suppose vz - 9 = 0, 14 = 2l - 5z + 425. Which is smaller: l or -199? -199 Let p = -16 + 24. Suppose -pt + 21 = -5t. Let o be (1 + t/((-28)/16))-3. Is 11 equal to o? False Let h = 29.74 + -30. Let u = -11.74 + h. Let g = 455.2 + -455. Is g less than or equal to u? False Suppose 0 = -2p - 2p + 3t - 167, 0 = -p + 2t - 38. Let c = -43 - p. Let k be (-36)/42c2. Is k less than or equal to -2? False Le	{ "pile_set_name": "DM Mathematics" }
30? 0 What is the tens digit of 1447904? 0 What is the units digit of 2461428? 8 What is the thousands digit of 18052257? 2 What is the hundreds digit of 28565378? 3 What is the ten thousands digit of 5197747? 9 What is the hundred thousands digit of 19339298? 3 What is the tens digit of 420763? 6 What is the hundreds digit of 388325? 3 What is the ten millions digit of 14379271? 1 What is the tens digit of 4957051? 5 What is the hundred thousands digit of 773413? 7 What is the ten thousands digit of 2790367? 9 What is the hundreds digit of 1406741? 7 What is the ten thousands digit of 875803? 7 What is the thousands digit of 869916? 9 What is the ten thousands digit of 131780? 3 What is the hundred thousands digit of 174144? 1 What is the thousands digit of 89755? 9 What is the hundred thousands digit of 12613988? 6 What is the ten thousands digit of 246072? 4 What is the ten thousands digit of 329592? 2 What is the hundred thousands digit of 1114009? 1 What is the units digit of 4926424? 4 What is the units digit of 307347? 7 What is the units digit of 13797194? 4 What is the ten thousands digit of 180748? 8 What is the hundreds digit of 315961? 9 What is the hundreds digit of 659920? 9 What is the thousands digit of 7016542? 6 What is the ten thousands digit of 516291? 1 What is the thousands digit of 6553832? 3 What is the tens digit of 107684? 8 What is the ten thousands digit of 509980? 0 What is the tens digit of 14567549? 4 What is the hundred thousands digit of 705597? 7 What is the ten thousands digit of 181977? 8 What is the thousands digit of 172295? 2 What is the ten thousands digit of 4208325? 0 What is the hundred thousands digit of 343533? 3 What is the ten thousands digit of 66022? 6 What is the hundreds digit of 288678? 6 What is the ten millions digit of 12244590? 1 What is the thousands digit of 591825? 1 What is the thousands digit of 2063800? 3 What is the hundreds digit of 439466? 4 What is the thousands digit of 99283? 9 What is the units digit of 16256268? 8 What is the hundred thousands digit of 12504307? 5 What is the tens digit of 2173039? 3 What is the thousands digit of 3046645? 6 What is the thousands digit of 1080029? 0 What is the hundreds digit of 153317? 3 What is the thousands digit of 36254930? 4 What is the thousands digit of 39397101? 7 What is the thousands digit of 166831? 6 What is the millions digit of 7133386? 7 What is the hundreds digit of 27347896? 8 What is the hundred thousands digit of 2020233? 0 What is the ten thousands digit of 7674673? 7 What is the millions digit of 2005761? 2 What is the thousands digit of 2016008? 6 What is the millions digit of 4166065? 4 What is the millions digit of 11462766? 1 What is the hundreds digit of 6362288? 2 What is the thousands digit of 25211333? 1 What is the hundreds digit of 1755236? 2 What is the hundred thousands digit of 11026992? 0 What is the hundreds digit of 95976? 9 What is the hundred thousands digit of 853386? 8 What is the thousands digit of 185791? 5 What is the ten thousands digit of 930257? 3 What is the tens digit of 471920? 2 What is the ten millions digit of 16134543? 1 What is the tens digit of 32598277? 7 What is the hundreds digit of 138533? 5 What is the hundred thousands digit of 278234? 2 What is the units digit of 883479? 9 What is the hundreds digit of 55130? 1 What is the tens digit of 8747? 4 What is the hundred thousands digit of 1064558? 0 What is the ten thousands digit of 523225? 2 What is the thousands digit of 6954797? 4 What is the hundreds digit of 13768181? 1 What is the thousands digit of 1995149? 5 What is the ten thousands digit of 10244683? 4 What is the hundreds digit of 442630? 6 What is the hundreds digit of 4833098? 0 What is the hundred thousands digit of 2550599? 5 What is the tens digit of 605970? 7 What is the units digit of 8412? 2 What is the thousands digit of 46181? 6 What is the thousands digit of 81480? 1 What is the hundreds digit of 173703? 7 What is the thousands digit of 122718? 2 What is the units digit of 223856? 6 What is the thousands digit of 1471802? 1 What is the hundred thousands digit of 190644? 1 What is the hundreds digit of 4192954? 9 What is the millions digit of 1348042? 1 What is the ten thousands digit of 4366862? 6 What is the hundreds digit of 2959515? 5 What is the units digit of 31769078? 8 What is the hundreds digit of 544488? 4 What is the units digit of 241134? 4 What is the hundreds digit of 24083048? 0 What is the hundred thousands digit of 1348532? 3 What is the units digit of 1299069? 9 What is the units digit of 883520? 0 What is the units digit of 740315? 5 What is the ten thousands digit of 2544630? 4 What is the hundred thousands digit of 24726967? 7 What is the thousands digit of 1660685? 0 What is the ten thousands digit of 211324? 1 What is the ten thousands digit of 36114? 3 What is the ten thousands digit of 24550490? 5 What is the hundreds digit of 339524? 5 What is the hundreds digit of 8577458? 4 What is the units digit of 277655? 5 What is the units digit of 451093? 3 What is the thousands digit of 919203? 9 What is the hundred thousands digit of 4437212? 4 What is the tens digit of 512783? 8 What is the units digit of 272085? 5 What is the tens digit of 4480151? 5 What is the units digit of 6421455? 5 What is the thousands digit of 794341? 4 What is the thousands digit of 88597? 8 What is the tens digit of 139298? 9 What is the hundreds digit of 196507? 5 What is the thousands digit of 673782? 3 What is the hundred thousands digit of 716257? 7 What is the hundred thousands digit of 7842944? 8 What is the thousands digit of 2090491? 0 What is the hundred thousands digit of 589942? 5 What is the units digit of 6524965? 5 What is the tens digit of 24795652? 5 What is the units digit of 46907? 7 What is the tens digit of 1244573? 7 What is the thousands digit of 1365744? 5 What is the ten thousands digit of 1353660? 5 What is the units digit of 3034515? 5 What is the hundred thousands digit of 670575? 6 What is the units digit of 4541563? 3 What is the millions digit of 7156212? 7 What is the tens digit of 133543? 4 What is the hundred thousands digit of 2177785? 1 What is the ten thousands digit of 24575? 2 What is the tens digit of 2847530? 3 What is the units digit of 16098936? 6 What is the ten thousands digit of 28619? 2 What is the tens digit of 8437781? 8 What is the hundred thousands digit of 4489737? 4 What is the millions digit of 15840787? 5 What is the tens digit of 362766? 6 What is the tens digit of 455977? 7 What is the tens digit of 247413? 1 What is the ten thousands digit of 1612914? 1 What is the tens digit of 9809336? 3 What is the tens digit of 5133116? 1 What is the hundred thousands digit of 1167257? 1 What is the tens digit of 1239375? 7 What is the hundreds digit of 7119457? 4 What is the tens digit of 171307? 0 What is the hundreds digit of 421937? 9 What is the millions digit of 7357105? 7 What is the thousands digit of 774669? 4 What is the hundred thousands digit of 897643? 8 What is the millions digit of 6923362? 6 What is the hundreds digit of 3279550? 5 What is the thousands digit of 804079? 4 What is the thousands digit of 144062? 4 What is the tens digit of 3871892? 9 What is the units digit of 159707? 7 What is the ten thousands digit of 6685135? 8 What is the ten thousands digit of 915640? 1 What is the hundred thousands digit of 7389065? 3 What is the thousands digit of 169281? 9 What is the hundred thousands digit of 259877? 2 What is the units digit of 1919? 9 What is the thousands digit of 348386? 8 What is the thousands digit of 21164507? 4 What is the ten thousands digit of 769846? 6 What is the units digit of 2616105? 5 What is the hundreds digit of 384406? 4 What is the tens digit of 146901? 0 What is the units digit of 962221? 1 What is the units digit of 911970? 0 What is the units digit of 351824? 4 What is the tens digit of 196320? 2 What is the units digit of 1100094? 4 What is the millions digit of 18326719? 8 What is the hundred thousands digit of 1990204? 9 What is the hundred thousands digit of 1111945? 1 What is the units digit of 609771? 1 What is the thousands digit of 1001695? 1 What is the hundreds	{ "pile_set_name": "DM Mathematics" }
4? 347 In base 8, what is -14537 - 0? -14537 In base 3, what is -1002 - 11? -1020 In base 11, what is 2 - 38a? -388 In base 8, what is -35 + 20? -15 In base 4, what is -123 - 0? -123 In base 8, what is -13 + 334? 321 In base 9, what is 1 - 7102? -7101 In base 8, what is -3 + 73? 70 In base 13, what is -b + -2? -10 In base 12, what is -a - 1b? -29 In base 5, what is -1411 + -34? -2000 In base 8, what is 1102 - -5? 1107 In base 6, what is -13122 + -2? -13124 In base 10, what is 17305 + -1? 17304 In base 11, what is -22 - -5? -18 In base 2, what is -110011001 - 11? -110011100 In base 9, what is -5 + 1801? 1785 In base 2, what is -100100 + -110? -101010 In base 9, what is 5 - -222? 227 In base 13, what is -9 + 304? 2c8 In base 7, what is -300 - 4? -304 In base 13, what is 3 + -1a? -17 In base 10, what is 35 - -229? 264 In base 3, what is 21 - -1010? 1101 In base 8, what is 10 - -1? 11 In base 8, what is 2 + -122? -120 In base 6, what is 25 - 32? -3 In base 2, what is -100 - 100100110011? -100100110111 In base 14, what is 4 + 1? 5 In base 2, what is -10 + -11101101101? -11101101111 In base 13, what is -7 - -8a6? 89c In base 7, what is 106 + 30? 136 In base 11, what is -32 - 9? -40 In base 4, what is 0 - 2121? -2121 In base 7, what is 654 - -15? 1002 In base 6, what is -5 - -2? -3 In base 12, what is 12 - -a? 20 In base 6, what is -52 + 2011? 1515 In base 5, what is -3 + 21? 13 In base 6, what is -24 + 301? 233 In base 8, what is -646 - -6? -640 In base 15, what is -6 - -1b0? 1a9 In base 3, what is 10 + -11202? -11122 In base 13, what is 0 + -9a? -9a In base 13, what is 32 - 2? 30 In base 11, what is 39 + 250? 289 In base 2, what is 1101 + -10100110011? -10100100110 In base 15, what is -5 - 792? -797 In base 4, what is -2023 - -1? -2022 In base 14, what is -63 - -6? -5b In base 14, what is 2 - 4d? -4b In base 6, what is -102241 - -3? -102234 In base 4, what is -331221 - 10? -331231 In base 6, what is -23034 - 1? -23035 In base 3, what is -11 - 2200221? -2201002 In base 8, what is 735 + 1? 736 In base 16, what is -3 - f? -12 In base 10, what is 299 - -1? 300 In base 9, what is -2 - -42? 40 In base 7, what is 2 + -623? -621 In base 6, what is -4 - -143? 135 In base 7, what is 15 - 14? 1 In base 14, what is -5 + 15? 10 In base 8, what is 356 + -23? 333 In base 11, what is 19 + -35? -17 In base 3, what is 20000102 + -11? 20000021 In base 2, what is 1000 + 10100011111? 10100100111 In base 8, what is 0 - 55? -55 In base 10, what is 25 - -58? 83 In base 8, what is -507 - 5? -514 In base 4, what is -10 - 32312? -32322 In base 2, what is 100 - 11000? -10100 In base 2, what is 111 - 10010000? -10001001 In base 15, what is 620 - 0? 620 In base 5, what is -10041 - 0? -10041 In base 9, what is 1 - 2318? -2317 In base 5, what is 222331 - -2? 222333 In base 11, what is 8a8 + -1? 8a7 In base 4, what is 2032123 + -11? 2032112 In base 16, what is -1 - 82? -83 In base 4, what is -1212222 + 3? -1212213 In base 2, what is 10 - 10000110100101? -10000110100011 In base 16, what is 7 + -17? -10 In base 12, what is 1 + 17? 18 In base 7, what is 50016 - 1? 50015 In base 3, what is -11 - 220212? -221000 In base 6, what is 1 - -2410? 2411 In base 13, what is 5 + 25cb? 2603 In base 8, what is 5 - 270? -263 In base 3, what is 12 - 20022? -20010 In base 6, what is 200 + -5? 151 In base 10, what is -27 - 113? -140 In base 7, what is -21 - -660? 636 In base 13, what is -1 - -1c9? 1c8 In base 15, what is -3 - 1d? -21 In base 16, what is 24 + -23? 1 In base 7, what is 65 + 153? 251 In base 5, what is 2 + -14201? -14144 In base 16, what is 34 - 2? 32 In base 16, what is -4 - 623? -627 In base 14, what is 1 - c40? -c3d In base 5, what is 10 - 1124? -1114 In base 11, what is 96 + -7? 8a In base 9, what is 0 + -2624? -2624 In base 10, what is 76 - -75? 151 In base 13, what is -3482 - -1? -3481 In base 8, what is 116 - -10? 126 In base 12, what is 4 + -2b? -27 In base 7, what is -245 + -10? -255 In base 13, what is 2 - 3c? -3a In base 9, what is -3 - 105? -108 In base 4, what is -10 + 12102? 12032 In base 14, what is -3a5 - 3? -3a8 In base 8, what is 6 - -61? 67 In base 6, what is -214 - -5? -205 In base 16, what is b20 + -4? b1c In base 5, what is -4040 + 4? -4031 In base 7, what is -102 + -4? -106 In base 10, what is -5 - -1423? 1418 In base 13, what is -1c6 + -5? -1cb In base 10, what is -3 + 29? 26 In base 12, what is 55 - -2? 57 In base 12, what is 3 - -2444? 2447 In base 16, what is -18 - 7? -1f In base 6, what is -5 + -55? -104 In base 4, what is -12 - 32? -110 In base 3, what is -11 - 1100? -1111 In base 3, what is -1110221 + 1? -1110220 In base 16, what is -4 - -1c2? 1be In base 13, what is 131 - 0? 131 In base 8, what is -3 + -110? -113 In base 6, what is 1324 - 1? 1323 In base 7, what is 261 + -50? 211 In base 5, what is 2 - -20330? 20332 In base 6, what is -144 + 0? -144 In base 11, what is -2 + 53? 51 In base 14, what is -5 - 82? -87 In base 7, what is 2 - 335? -333 In base 7, what is 3 - 535? -532 In base 12, what is 3 + 28? 2b In base 2, what is -1010 - -10110? 1100 In base 4, what is -211 + 312? 101 In base 5, what is -1002 + 3? -444 In base 4, what is -22 + -2100? -2122 In base 7, what is -36 + -4? -43 In base 13, what is 1764 - -5? 1769 In base 7, what is -1 + -665? -666 In base 14, what is -c + 2c? 20 In base 13, what is 3 + -46a? -467 In base 12, what is -22 - -215? 1b3 In base 9, what is -63 + 231? 157 In base 5, what is -122 - 201? -323 In base 4, what is 11 - 123? -112 In base 12, what is -2 + 66? 64 In base 6, what is 524 + -5? 515 In base 10, what is 0 - -541? 541 In base 13, what is 38 + -6? 32 In base 8, what is 2 - 624? -622 In base 13, what is 44 + -1? 43 In base 9, what is 27 + -64? -36 In base 2, what is 100111 + -110? 100001 In base 11, what is 1 - 52? -51 In base 14, what is 154 - -2? 156 In base 8, what is -101 + 106? 5 In base 14, what is -5a7 + 2? -5a5 In base 15, what is -81 + -4? -85 In base 12, what is 17 + 4? 1b In base 16, what is -26 - f? -35 In base 6, what is -4 + 1001? 553 In base 15, what is -141 + 5? -13b In base 4, what is 22301 + -10? 22231 In base 3, what is -1101 + 102011? 100210 In base 15, what is 3 - -2e? 32 In base 10, what is 1336 + 3? 1339 In base 3, what is -2112 + 11? -2101 In base 5, what is -200 + -3? -203 In base 3, what is 1 - 1120000? -1112222 In base 4, what is -2231 + -10? -2301 In base 3, what is -2 - 12121? -12200 In base 12, what is -50 + 5? -47 In base 4, what is 10211 - 13? 10132 In base 15, what is -5 + -136d? -1373 In base 3, what is 12211 + -211? 12000 In base 9, what is 68 + 2? 71 In base 16, what is 0 - -28d? 28d In base 3, what is 101021 + 2? 101100 In base 10, what is 2 + 1021? 1023 In base 14, what is -22 + -1? -23 In base 15, what is -4e4 + 8? -4db In base 13, what is 4 + -49? -45 In base 8, what is 13 - -3160? 3173 In base 4, what is -10 + -2312? -2322 In base 15, what is 4 + -7e? -7a In base 14, what is -bbd + -2? -bc1 In base 7, what is -10043 - 0? -10043 In base 6, what is 1243 - -34? 1321 In base 5, what is 204 + -10? 144 In base 2, what is -1001 - -11001100? 11000011 In base 2, what is -111 - -1000101100? 1000100101 In base 9, what is 22 + 2? 24 In base 6, what is -315 - 15? -334 In base 4, what is 23 - -1122? 1211 In base 10, what is -3 + 60? 57 In base 10, what is -3 - -34? 31 In base 11, what is 4 - -4? 8 In base 15, what is 4a88 - -5? 4a8d In base 2, what is -110000 + 11? -101101 In base 5, what is 2 - 314? -312 In base 14, what is -5 - 68? -6d In base 2, what is 101001 + -1000? 100001 In base 4, what is -23 + 122? 33 In base 7, what is 55 + 10? 65 In base 7, what is -362 + -1? -363 In base 11, what is -3 - -549? 546 In base 6, what is 32154 - -5? 32203 In base 12, what is a6 - -4? aa In base 13, what is 1226 - -2? 1228 In base 16, what is -10f8 + 4? -10f4 In base 2, what is -101 + 1001001? 1000100 In base 6, what is 44143 + 3? 44150 In base 7, what is 5665 - -3? 6001 In base 5, what is -11 - 20113? -20124 In base 14, what is -5 + 22? 1b In base 9, what is 317 + -45? 262 In base 16, what is 76f - 5? 76a In base 13, what is 5 + 705? 70a In base 2, what is 100 - 100010100? -100010000 In base 2, what is -10100000001 + 100? -10011111101 In base 2, what is -100 + -11110011? -11110111 In base 6, what i	{ "pile_set_name": "DM Mathematics" }
nearest integer? 29527 What is the cube root of 2123381254 to the nearest integer? 1285 What is 18380716 to the power of 1/2, to the nearest integer? 4287 What is the fifth root of 3560126447 to the nearest integer? 81 What is the square root of 340467131 to the nearest integer? 18452 What is the square root of 633014676 to the nearest integer? 25160 What is the ninth root of 573581435 to the nearest integer? 9 What is 21865246 to the power of 1/9, to the nearest integer? 7 What is the seventh root of 836435770 to the nearest integer? 19 What is 27257609 to the power of 1/3, to the nearest integer? 301 What is 78053952 to the power of 1/8, to the nearest integer? 10 What is 1377839523 to the power of 1/8, to the nearest integer? 14 What is 15128015 to the power of 1/4, to the nearest integer? 62 What is 986190607 to the power of 1/3, to the nearest integer? 995 What is 600435740 to the power of 1/3, to the nearest integer? 844 What is the square root of 127800175 to the nearest integer? 11305 What is 42274955 to the power of 1/2, to the nearest integer? 6502 What is the cube root of 112770412 to the nearest integer? 483 What is 98736027 to the power of 1/6, to the nearest integer? 21 What is 480016995 to the power of 1/5, to the nearest integer? 54 What is the cube root of 35167021 to the nearest integer? 328 What is 4408828865 to the power of 1/2, to the nearest integer? 66399 What is 68907280 to the power of 1/5, to the nearest integer? 37 What is the cube root of 8351721305 to the nearest integer? 2029 What is the cube root of 6131217652 to the nearest integer? 1830 What is the third root of 511678826 to the nearest integer? 800 What is the square root of 30676511 to the nearest integer? 5539 What is 1911463035 to the power of 1/5, to the nearest integer? 72 What is the tenth root of 961751764 to the nearest integer? 8 What is 225017317 to the power of 1/3, to the nearest integer? 608 What is 427026096 to the power of 1/2, to the nearest integer? 20665 What is 4330442870 to the power of 1/2, to the nearest integer? 65806 What is 88551364 to the power of 1/3, to the nearest integer? 446 What is 17689369 to the power of 1/2, to the nearest integer? 4206 What is the square root of 5119632567 to the nearest integer? 71552 What is 4013068392 to the power of 1/2, to the nearest integer? 63349 What is 186542209 to the power of 1/2, to the nearest integer? 13658 What is 62819763 to the power of 1/5, to the nearest integer? 36 What is 2201487584 to the power of 1/2, to the nearest integer? 46920 What is 196828211 to the power of 1/6, to the nearest integer? 24 What is 1067813196 to the power of 1/5, to the nearest integer? 64 What is the square root of 2720143286 to the nearest integer? 52155 What is the ninth root of 103976340 to the nearest integer? 8 What is the fifth root of 625622662 to the nearest integer? 57 What is 745956434 to the power of 1/2, to the nearest integer? 27312 What is 9247923663 to the power of 1/7, to the nearest integer? 27 What is 15708170 to the power of 1/3, to the nearest integer? 250 What is 104206026 to the power of 1/2, to the nearest integer? 10208 What is 340259547 to the power of 1/2, to the nearest integer? 18446 What is 604557661 to the power of 1/2, to the nearest integer? 24588 What is the tenth root of 1396902468 to the nearest integer? 8 What is the tenth root of 113567190 to the nearest integer? 6 What is 89209935 to the power of 1/2, to the nearest integer? 9445 What is the seventh root of 34368302 to the nearest integer? 12 What is the third root of 1482003844 to the nearest integer? 1140 What is the square root of 525140727 to the nearest integer? 22916 What is the fifth root of 146276992 to the nearest integer? 43 What is the fourth root of 68706214 to the nearest integer? 91 What is 61355335 to the power of 1/4, to the nearest integer? 89 What is 43285829 to the power of 1/9, to the nearest integer? 7 What is 5971998632 to the power of 1/3, to the nearest integer? 1814 What is the seventh root of 182137774 to the nearest integer? 15 What is 214613630 to the power of 1/5, to the nearest integer? 46 What is 102231219 to the power of 1/2, to the nearest integer? 10111 What is the tenth root of 1656070656 to the nearest integer? 8 What is the square root of 265753457 to the nearest integer? 16302 What is 4692649817 to the power of 1/2, to the nearest integer? 68503 What is 35063939 to the power of 1/2, to the nearest integer? 5921 What is the square root of 1252406764 to the nearest integer? 35389 What is the third root of 171529335 to the nearest integer? 556 What is 1964370652 to the power of 1/8, to the nearest integer? 15 What is the square root of 362074565 to the nearest integer? 19028 What is the square root of 2452620 to the nearest integer? 1566 What is the square root of 2631195333 to the nearest integer? 51295 What is 478722213 to the power of 1/9, to the nearest integer? 9 What is 60294768 to the power of 1/3, to the nearest integer? 392 What is 2484428011 to the power of 1/2, to the nearest integer? 49844 What is 8300112027 to the power of 1/3, to the nearest integer? 2025 What is 1667444127 to the power of 1/4, to the nearest integer? 202 What is 49167090 to the power of 1/8, to the nearest integer? 9 What is the cube root of 11500859 to the nearest integer? 226 What is 142245993 to the power of 1/6, to the nearest integer? 23 What is the eighth root of 474464368 to the nearest integer? 12 What is the third root of 4597929987 to the nearest integer? 1663 What is the tenth root of 5363510008 to the nearest integer? 9 What is 989355866 to the power of 1/2, to the nearest integer? 31454 What is the square root of 310720993 to the nearest integer? 17627 What is the third root of 41488229 to the nearest integer? 346 What is the cube root of 275225587 to the nearest integer? 650 What is the third root of 190289866 to the nearest integer? 575 What is the tenth root of 71892254 to the nearest integer? 6 What is the cube root of 695186710 to the nearest integer? 886 What is the cube root of 34843485 to the nearest integer? 327 What is 1802004486 to the power of 1/3, to the nearest integer? 1217 What is the fifth root of 45499601 to the nearest integer? 34 What is the square root of 185909072 to the nearest integer? 13635 What is 203527487 to the power of 1/4, to the nearest integer? 119 What is the tenth root of 24686951 to the nearest integer? 5 What is 4240295901 to the power of 1/2, to the nearest integer? 65118 What is the square root of 1922686014 to the nearest integer? 43848 What is 3280446553 to the power of 1/2, to the nearest integer? 57275 What is 834135721 to the power of 1/4, to the nearest integer? 170 What is the third root of 40891269 to the nearest integer? 345 What is 980735441 to the power of 1/2, to the nearest integer? 31317 What is 48797872 to the power of 1/2, to the nearest integer? 6986 What is the square root of 181544410 to the nearest integer? 13474 What is the cube root of 35240441 to the nearest integer? 328 What is the fourth root of 1805525250 to the nearest integer? 206 What is 3919198596 to the power of 1/4, to the nearest integer? 250 What is the square root of 84444573 to the nearest integer? 9189 What is the seventh root of 5766385662 to the nearest integer? 25 What is the sixth root of 4907142716 to the nearest integer? 41 What is the square root of 2683824329 to the nearest integer? 51806 What is 4570263767 to the power of 1/4, to the nearest integer? 260 What is 63036660 to the power of 1/10, to the nearest integer? 6 What is 6725728026 to the power of 1/3, to the nearest integer? 1888 What is 124653360 to the power of 1/8, to the nearest integer? 10 What is the square root of 1186839174 to the nearest integer? 34451 What is 16847573 to the power of 1/3, to the nearest integer? 256 What is 424906951 to the power of 1/4, to the nearest integer? 144 What is the ninth root of 621158873 to the nearest integer? 9 What is 2041035116 to the power of 1/9, to the nearest integer? 11 What is the third root of 352533996 to the nearest integer? 706 What is the cube root of 937595743 to the nearest integer? 979 What is the cube root of 2289334 to the nearest integer? 13	{ "pile_set_name": "DM Mathematics" }
k(9). 3 Let x(k) = 83k - 16. What is x(3)? 233 Let x(f) = 7f*2 + 162f + 3. Give x(-23). -20 Let h(t) = -t*3 + 7t*2 - t + 8. Determine h(7). 1 Let f(y) = -5y + 105. Give f(13). 40 Let z(n) = -n + 4. Give z(-3). 7 Let y(r) = 7r + 9. What is y(12)? 93 Let f(a) = -51a + 4. Calculate f(-1). 55 Let g(k) = 4k - 2. Calculate g(5). 18 Let f(y) = y2 - 6y - 12. Determine f(5). -17 Let v(q) = q - 17. What is v(-29)? -46 Let t(w) = -2w3 + 3w*2 + 13w - 18. Determine t(3). -6 Let v(d) = -d*2 - 3d + 4. What is v(-5)? -6 Let v(c) = -2c - 11. What is v(-9)? 7 Let u(y) = y2 - 12y + 16. What is u(11)? 5 Let d(h) = -h*3 + 6h*2 + 4h + 6. Calculate d(8). -90 Let p(d) = 34d2 - 1. What is p(-1)? 33 Let r(w) = w3 + 12w*2 - 10w - 116. What is r(-12)? 4 Let y(c) = 2c3 + 11c*2 + 3c - 8. Calculate y(-4). 28 Let m(j) = -j*3 + 3j*2 + 3j + 6. Calculate m(5). -29 Let k(p) = 4p + 2. Determine k(3). 14 Let i(a) = 4a*2 - 3a + 2. Give i(0). 2 Let x(s) = -s*2 + 6s + 8. What is x(6)? 8 Let q(j) = 26j3 + 4j2 - j - 3. What is q(1)? 26 Let z(i) = -i3 + 5i2 + 3i + 3. What is z(5)? 18 Let b(i) = -12i3 + 2i*2 - i. Calculate b(1). -11 Let d(h) = 4h + 8. Give d(-5). -12 Let b(k) = -k + 1. Give b(-6). 7 Let b(i) = i*3 + 28i*2 + 29i + 54. What is b(-27)? 0 Let z(y) = -y - 11. Determine z(8). -19 Let c(i) = -i*3 - 11i*2 - 11i - 26. Determine c(-10). -16 Let o(m) = m*2 + 13m + 13. Determine o(-11). -9 Let t(r) = r*2 + 10r - 5. Calculate t(-11). 6 Let w(o) = -o - 18. Calculate w(-10). -8 Let t(w) = w*2 + 3w + 7. Calculate t(-5). 17 Let b(x) = 2x2 - 4x - 2. Give b(4). 14 Let u(f) = -f*3 + 19f*2 - 18f - 15. Give u(18). -15 Let u(b) = -11b3 - 1. Determine u(1). -12 Let b(a) = a - 22. Determine b(17). -5 Let p(j) = -45j3 + j2. What is p(1)? -44 Let u(h) = -h*3 + 4h*2 + 2h - 20. What is u(3)? -5 Let f(i) = 67i - 591. Calculate f(9). 12 Let w(r) = -2r*2 - 45r - 3. What is w(-21)? 60 Let d(p) = -p*2 + 4. Calculate d(4). -12 Let d(j) = -77j + 313. Give d(4). 5 Let o(m) = m*2 - m + 2. Determine o(3). 8 Let d(o) = -2o + 4. Give d(-3). 10 Let u(b) = b*3 + 2b*2 - 4b - 11. Determine u(0). -11 Let m(o) = -4o3 - 9o*2 - 4o + 7. Determine m(-3). 46 Let y(d) = 15d + 238. Calculate y(-16). -2 Let y(j) = -6j*3 + 3j*2 + 2j. What is y(-1)? 7 Let a(l) = -l*2 + 7l + 6. Give a(-5). -54 Let a(n) = -n*2 + 20n - 14. What is a(19)? 5 Let a(z) = 33z - 3. What is a(2)? 63 Let d(w) = -w3 - 3w*2 + 8w + 5. Calculate d(-5). 15 Let u(o) = -o*3 + 14o*2 - 15o + 20. Give u(13). -6 Let o(h) = -20h + 14. What is o(6)? -106 Let p(l) = 118l3 - l2 - 2l - 1. Determine p(-1). -118 Let g(l) = 10l3 + l2 - 4l - 1. Give g(-2). -69 Let c(l) = 2l - 5. Determine c(13). 21 Let d(o) = o*3 - 23o*2 + 46o - 66. Calculate d(21). 18 Let u(y) = y*3 + 9y*2 - 4y - 13. Calculate u(-9). 23 Let a(m) = m*2 - m - 4. Give a(4). 8 Let b(i) = -8i - 37. Determine b(-5). 3 Let b(r) = r*3 + 10r*2 + 8r - 6. Give b(-9). 3 Let n(m) = -32m - 264. Determine n(-8). -8 Let a(m) = -m + 14. What is a(13)? 1 Let k(a) = a3 + 5a2 - a - 6. What is k(-5)? -1 Let w(h) = -h3 + 4h2 + 2h + 3. Calculate w(5). -12 Let l(x) = 4x + 2. Calculate l(7). 30 Let h(d) = -d3 - 5d*2 + 4d - 7. Give h(-6). 5 Let s(g) = g*2 + 8g + 6. Determine s(-6). -6 Let x(l) = l*3 + 3l*2 + 6l - 2. Give x(-3). -20 Let m(l) = 8l + 80. Determine m(-8). 16 Let t(d) = -11d*3 - 5d*2 + 4d + 12. Give t(-2). 72 Let a(k) = k*2 + 16k + 1. Calculate a(-16). 1 Let x(b) = -b*2 - 16b + 11. Give x(-17). -6 Let i(t) = t*3 - 7t*2 + 9t - 7. What is i(6)? 11 Let j(l) = l*3 - 3l*2 - 10l + 6. Calculate j(5). 6 Let m(z) = -6z - 2. Determine m(-3). 16 Let y(g) = -g3 - 10g*2 - 18g - 15. Give y(-7). -36 Let p(q) = 7q + 10. What is p(-10)? -60 Let k(d) = -d3 + 4d*2 + 2d + 12. Give k(5). -3 Let t(y) = y*3 - 11y*2 - y + 32. Give t(11). 21 Let x(v) = -16v + 1. Calculate x(1). -15 Let h(a) = 2a + 29. Give h(-21). -13 Let c(b) = -8b*3 - 4b*2 - 3b + 5. Give c(1). -10 Let l(y) = 8y + 55. Calculate l(4). 87 Let p(l) = 7l*2 - 5l + 5. What is p(2)? 23 Let d(h) = 5h2 + 4h + 1. What is d(-4)? 65 Let b(j) = 12j3 - 57j*2 - 11j - 13. Calculate b(5). 7 Let r(a) = -4a - 23. Give r(-11). 21 Let b(j) = 20j*3 + 1. Determine b(-1). -19 Let c(g) = -11g - 59. What is c(-5)? -4 Let t(y) = -5y2 - 35y - 5. Calculate t(-7). -5 Let p(g) = g*2 + 5g + 9. Give p(-13). 113 Let h(y) = y*2 - 10y + 8. Give h(11). 19 Let z(q) = -13q2 - 3q + 1. What is z(-2)? -45 Let i(u) = -3u2 - u + 1. Calculate i(-2). -9 Let m(j) = j2 - 16j + 31. Determine m(14). 3 Let y(h) = h*2 + 5h - 10. Determine y(-7). 4 Let g(o) = -80o + 5. Determine g(1). -75 Let v(z) = 3z + 3. What is v(-6)? -15 Let r(y) = -4y2 - y - 7. Calculate r(-4). -67 Let w(q) = -q3 + 7q*2 - 14q - 4. Calculate w(4). -12 Let u(z) = z*3 - 43z*2 + 157z - 44. Determine u(39). -5 Let k(w) = -w*2 - 9w. What is k(-5)? 20 Let x(v) = -v*2 - 16v + 10. Give x(-14). 38 Let r(w) = -4w + 2. What is r(-2)? 10 Let t(r) = r2 + 9r. What is t(-8)? -8 Let c(v) = -31v3 - 4v + 4. Determine c(1). -31 Let f(c) = c*2 - 15c - 3. Calculate f(17). 31 Let u(k) = k*3 - 8k*2 + 7k - 11. Give u(8). 45 Let s(t) = -t*2 - 13t - 30. Calculate s(-8). 10 Let r(q) = -q - 37. What is r(0)? -37 Let v(w) = w*2 - 17w + 61. Give v(13). 9 Let v(r) = -r*3 + 8r*2 - 3r + 8. Calculate v(7). 36 Let k(v) = 2v2 - v - 6. What is k(5)? 39 Let m(x) = 2x*2 - 9x - 2. Determine m(10). 108 Let y(p) = p*3 - 7p*2 + 5p - 11. What is y(6)? -17 Let k(l) = -2l2 + 12l + 3. Give k(6). 3 Let y(f) = -2f2 - 10f - 6. Calculate y(-7). -34 Let p(v) = -3v2 - 8v - 9. Give p(-4). -25 Let z(t) = 2t2 - 12t - 703. What is z(22)? 1 Let d(o) = o - 8. Calculate d(0). -8 Let u(z) = z*2 + 18z + 22. Give u(-11). -55 Let l(a) = 6a + 32. Give l(-5). 2 Let t(y) = y3 + 6y*2 + 3y - 9. Calculate t(-5). 1 Let f(u) = 10u - 490. Calculate f(49). 0 Let j(r) = -r2 + 17r - 27. What is j(15)? 3 Let m(n) = 5n2 - 30n + 51. What is m(4)? 11 Let c(i) = -i*3 + 20i*2 - 2i + 78. Calculate c(20). 38 Let k(n) = -n*2 + 3n - 3. Give k(0). -3 Let y(g) = 6g - 6. Calculate y(3). 12 Let j(r) = -r2 + 17r - 29. Give j(15). 1 Let d(j) = -9j2 - 2j + 6. What is d(-3)? -69 Let v(y) = y*2 - y + 17. Calculate v(0). 17 Let f(h) = -10h + 26. Determine f(-7). 96 Let v(f) = -f*2 - 2f + 3. Determine v(-3). 0 Let j(u) = u*2 + 2u - 21. Determine j(5). 14 Let w(x) = -9x - 67. Calculate w(-6). -13 Let d(n) = 4n + 80. Calculate d(-15). 20 Let r(i) = -17i - 363. Determine r(-22). 11 Let i(j) = 31j - 255. Calculate i(7). -38 Let q(t) = -t*3 - 2t - 48. Calculate q(0). -48 Let r(v) = -4v2 - 67v - 158. What is r(-14)? -4 Let z(r) = -13r3 - 4r*2 + 11r - 8. What is z(2)? -106 Let q(m) = 4m2 + 6m + 10. What is q(-4)? 50 Let p(q) = -q3 + q + 62. Give p(0). 62 Let w(d) = d3 - 10d2 - 2d + 4. Determine w(10). -16 Let p(q) = 8q + 156. Give p(-21). -12 Let v(o) = 28o + 2. Give v(1). 30 Let d(k) = k + 7. What is d(2)? 9 Let p(x) = x - 1. Calculate p(6). 5 Let v(c) = -2c - 9. Give v(-3). -3 Let p(j) = -161j*2 - 7j - 1. What is p(-1)? -155 Let h(s) = -s*2 - 3s + 127. Determine h(-13). -3 Let n(z) = -z*2 - 18z + 4. Calculate n(-17). 21 Let r(s) = -s*2 + 16s + 94. What is r(21)? -11 Let l(q) = -17q - 18. Calculate l(-3). 33 Let f(q) = -14q + 176. What is f(12)? 8 Let q(c) = 2c2 - 10c - 10. Calculate q(8). 38 Let w(c) = c*3 - 9c*2 + 10c + 3. Determine w(9). 93 Let m(j) = j - 14. Determine m(0). -14 Let u(h) = -h*3 + 18h*2 - 16h - 18. What is u(17)? -1 Let x(i) = 9i2 + 2i + 3. Determine x(-1). 10 Let j(w) = -w*3 + 12w*2 - 33w - 1. Calculate j(8). -9 Let r(m) = 3m - 59. What is r(19)? -2 Let l(p) = -19p - 120. Calculate l(-8). 32 Let g(z) = z*3 + 6z*2 + 3z + 1. Give g(-5). 11 Let u(l) = 44l - 831. Calculate u(19). 5 Let t(g) = -g2 - 5g + 1. Calculate t(-6). -5 Let l(f) = f*2 - 67f - 3. Calculate l(67). -3 Let a(z) = -3z - 26. Give a(0). -26 Let k(q) = q3 + 2q - 9. Determine k(0). -9 Let f(g) = -2g2 + 10g + 2. Calculate f(7	{ "pile_set_name": "DM Mathematics" }
: 1}. What is prob of sequence fes? 1/105 What is prob of sequence yys when three letters picked without replacement from {n: 2, y: 2, s: 3, g: 6}? 1/286 Three letters picked without replacement from {p: 2, m: 4, i: 5}. What is prob of sequence mpp? 4/495 What is prob of sequence jn when two letters picked without replacement from nnjnnnnnnnnnn? 1/13 Two letters picked without replacement from tgbtbjotgoeb. Give prob of sequence te. 1/44 What is prob of sequence dzk when three letters picked without replacement from rrzdrkk? 1/105 Three letters picked without replacement from {d: 4, o: 1, g: 5, t: 1, x: 4}. Give prob of sequence ggx. 8/273 Three letters picked without replacement from {o: 14, k: 2, c: 1}. Give prob of sequence okk. 7/1020 What is prob of sequence lg when two letters picked without replacement from zlghh? 1/20 Two letters picked without replacement from stbsazzstztsaabz. What is prob of sequence st? 1/20 Calculate prob of sequence nnnn when four letters picked without replacement from {n: 10}. 1 Calculate prob of sequence rc when two letters picked without replacement from {c: 1, f: 2, r: 2}. 1/10 Calculate prob of sequence ivz when three letters picked without replacement from zeicv. 1/60 Two letters picked without replacement from {s: 1, g: 1, f: 1, o: 2, q: 2, i: 1}. What is prob of sequence os? 1/28 Calculate prob of sequence kt when two letters picked without replacement from tktuuuu. 1/21 Two letters picked without replacement from {x: 2, z: 1, i: 1, f: 1}. Give prob of sequence fz. 1/20 Four letters picked without replacement from pyyxtyyvy. Give prob of sequence ptyv. 5/3024 What is prob of sequence nn when two letters picked without replacement from hnhnnhhemtnnnnn? 4/15 What is prob of sequence vy when two letters picked without replacement from {y: 3, v: 4}? 2/7 Three letters picked without replacement from vvavavuauvavaaa. Give prob of sequence vua. 2/65 What is prob of sequence dm when two letters picked without replacement from {f: 1, m: 2, d: 3, y: 1}? 1/7 What is prob of sequence sssa when four letters picked without replacement from {s: 9, a: 9}? 21/340 What is prob of sequence ek when two letters picked without replacement from {m: 3, n: 5, k: 1, e: 3}? 1/44 What is prob of sequence ow when two letters picked without replacement from {m: 6, w: 1, q: 1, o: 3, v: 3}? 3/182 Two letters picked without replacement from {b: 1, u: 1, h: 1}. What is prob of sequence hu? 1/6 Four letters picked without replacement from deeddoodoodoofeddee. Give prob of sequence oodo. 35/3876 Calculate prob of sequence tpp when three letters picked without replacement from {t: 3, p: 3}. 3/20 Calculate prob of sequence jkkk when four letters picked without replacement from {k: 3, j: 1}. 1/4 Four letters picked without replacement from {h: 4, g: 2, d: 1}. Give prob of sequence dhhg. 1/35 Calculate prob of sequence qqqq when four letters picked without replacement from {b: 3, q: 7}. 1/6 What is prob of sequence rji when three letters picked without replacement from {j: 1, i: 2, r: 1}? 1/12 Three letters picked without replacement from {u: 2, a: 5, v: 8}. What is prob of sequence uau? 1/273 What is prob of sequence qttq when four letters picked without replacement from qqttttqqqqqqtqtt? 9/130 What is prob of sequence ri when two letters picked without replacement from {d: 1, i: 2, r: 1}? 1/6 Three letters picked without replacement from diimidi. Give prob of sequence mdd. 1/105 Four letters picked without replacement from uuaauuuuuuuuuuuauu. Give prob of sequence uuaa. 7/408 Three letters picked without replacement from hpijiwhipqww. What is prob of sequence jhw? 1/220 Two letters picked without replacement from {r: 1, m: 1, y: 1, p: 2}. What is prob of sequence mp? 1/10 Calculate prob of sequence di when two letters picked without replacement from {d: 2, i: 2}. 1/3 Two letters picked without replacement from aftaafaakaaakaaaah. What is prob of sequence fh? 1/153 Calculate prob of sequence ur when two letters picked without replacement from {i: 2, u: 1, q: 1, r: 1}. 1/20 Calculate prob of sequence uu when two letters picked without replacement from {u: 5, k: 8, m: 4}. 5/68 Two letters picked without replacement from {m: 1, i: 4, z: 1, k: 7, d: 1, y: 5}. What is prob of sequence yk? 35/342 Two letters picked without replacement from {q: 1, o: 3, s: 1, x: 2}. What is prob of sequence so? 1/14 What is prob of sequence ee when two letters picked without replacement from {e: 5}? 1 Two letters picked without replacement from xxxxwxtqwxxtxx. What is prob of sequence wx? 9/91 Calculate prob of sequence ua when two letters picked without replacement from {b: 7, y: 3, w: 2, u: 1, a: 4}. 1/68 Three letters picked without replacement from kkkpakaakapk. What is prob of sequence aak? 3/55 Calculate prob of sequence mgzi when four letters picked without replacement from {c: 4, i: 5, m: 1, z: 5, g: 3}. 5/4896 What is prob of sequence rr when two letters picked without replacement from rcrrrrrr? 3/4 Two letters picked without replacement from {c: 1, k: 1, f: 2, i: 2, y: 1, o: 1}. What is prob of sequence ko? 1/56 Calculate prob of sequence uzq when three letters picked without replacement from {q: 2, z: 1, u: 2}. 1/15 Four letters picked without replacement from {h: 3, l: 2, o: 1, n: 1, x: 3}. What is prob of sequence nhho? 1/840 Two letters picked without replacement from qzzzzzqpppzpzz. Give prob of sequence zz. 4/13 What is prob of sequence qw when two letters picked without replacement from {b: 3, c: 1, z: 1, q: 4, w: 1, y: 2}? 1/33 Calculate prob of sequence wn when two letters picked without replacement from {w: 2, y: 9, n: 6}. 3/68 Calculate prob of sequence tjh when three letters picked without replacement from {u: 7, t: 5, j: 1, h: 3}. 1/224 Calculate prob of sequence yiyt when four letters picked without replacement from yyyyyyyyttyiyyyt. 33/3640 What is prob of sequence iiii when four letters picked without replacement from {i: 9}? 1 Two letters picked without replacement from hmmiffhmiynmmimyhi. What is prob of sequence if? 4/153 Four letters picked without replacement from kykykciukckk. What is prob of sequence uyyc? 1/2970 Two letters picked without replacement from {n: 1, q: 9, t: 3, x: 2, c: 4}. Give prob of sequence qc. 2/19 Calculate prob of sequence ftf when three letters picked without replacement from fftft. 1/5 Two letters picked without replacement from {u: 2, m: 1, f: 2, l: 1, a: 1}. Give prob of sequence au. 1/21 What is prob of sequence hh when two letters picked without replacement from gghffggf? 0 What is prob of sequence uas when three letters picked without replacement from ausyasassayquasasu? 3/136 Calculate prob of sequence lolx when four letters picked without replacement from jlllxbklbllojkj. 1/1092 Two letters picked without replacement from {i: 1, z: 2}. Give prob of sequence iz. 1/3 Calculate prob of sequence kij when three letters picked without replacement from oikiooojoojoooyyj. 1/680 Two letters picked without replacement from {s: 1, t: 1, z: 6, b: 2, f: 5, w: 1}. Give prob of sequence fw. 1/48 Calculate prob of sequence jqyq when four letters picked without replacement from lllrydlddljdlyqrlllq. 1/29070 Four letters picked without replacement from kbbpfbfbfkkffqbpff. What is prob of sequence pbkk? 1/1224 Calculate prob of sequence kk when two letters picked without replacement from pklpklpkkkp. 2/11 Two letters picked without replacement from {h: 4, k: 4, t: 2, w: 1, m: 6}. Give prob of sequence tt. 1/136 Two letters picked without replacement from lllmlslklkrkn. Give prob of sequence lr. 1/26 Four letters picked without replacement from {g: 1, q: 3}. Give prob of sequence qgqq. 1/4 What is prob of sequence zbw when three letters picked without replacement from {b: 1, d: 1, c: 1, w: 1, j: 1, z: 2}? 1/105 Two letters picked without replacement from vvvvvvvvvvvb. Give prob of sequence bv. 1/12 Three letters picked without replacement from {w: 2, q: 1, a: 1, k: 2, s: 1, y: 1}. Give prob of sequence sqa. 1/336 Two letters picked without replacement from {x: 3, u: 2, g: 5, b: 1, v: 1, s: 3}. What is prob of sequence gb? 1/42 Four letters picked without replacement from rjyjhmhryhhrhrrhhjmh. Give prob of sequence ymj	{ "pile_set_name": "DM Mathematics" }
- 4? -4432785262680 Subtract 0.5 from -42798467.1793. -42798467.6793 What is the difference between 1.1 and 6491295.165? 6491294.065 What is 18633204.08 less than -31? -18633235.08 What is the distance between 380223460721 and -2.4? 380223460723.4 Work out -24841 + 9645677.97. 9620836.97 What is -11182456 + 185.61? -11182270.39 What is 1 + -7749880131.47? -7749880130.47 323 + 176410618 176410941 105+-653.0326518 -548.0326518 What is -20496778263 plus 6? -20496778257 Work out 48184 - 7.747191524. 48176.252808476 Put together 118761874 and -13.6552. 118761860.3448 33429920879+-2 33429920877 Work out -1150964814032253 - -3. -1150964814032250 Add together 35 and 130292.47409838. 130327.47409838 What is 545279679 + -252965? 545026714 Work out -0.873593776 - -0.728. -0.145593776 Add -540865898 and -3.86833. -540865901.86833 Subtract 7469 from -0.01541520706. -7469.01541520706 What is the distance between -8 and -1357.39971602? 1349.39971602 Calculate -0.27 - 0.1298518744. -0.3998518744 What is 0.491883343711 less than 225? 224.508116656289 What is 5.383 - -9008.5105? 9013.8935 -9596 - 43240000 -43249596 -7.37150274 - 51.8 -59.17150274 Work out 7180599570738 - -26. 7180599570764 Sum -2456033 and 355275449. 352819416 What is -1816 + -4036311844? -4036313660 What is the distance between -14054846138738 and 0? 14054846138738 What is -2.01922 take away -129228194? 129228191.98078 Total of -5715813432358 and 84. -5715813432274 Work out 0.314 - 56262531920. -56262531919.686 What is 0.7461141963 minus 26.4? -25.6538858037 What is the distance between -10797146090 and -0.068? 10797146089.932 What is -1990333.6 less than -1807113? 183220.6 Total of -5 and 125.34774387. 120.34774387 Work out 4064884195663 - 3.1. 4064884195659.9 Work out 1455051555 - -317. 1455051872 Put together -98.7912967326 and 0.59. -98.2012967326 Add 444827734303 and -0.3. 444827734302.7 What is -173.325319229 + -0.051? -173.376319229 -8446539640 - -45 -8446539595 Total of 7 and -250307334579. -250307334572 Put together 0.09 and 902382177.2841. 902382177.3741 8 - 5042128110 -5042128102 Calculate 11582125689498 - -0.2. 11582125689498.2 What is 48456543.8603 + -0.6? 48456543.2603 What is 2189519566 less than -3305? -2189522871 What is 73894.977 plus 2464.53? 76359.507 Sum 0.02105217 and -17818874. -17818873.97894783 What is 569903.5 take away -9300359? 9870262.5 What is -0.13574276735 minus 15026? -15026.13574276735 What is -20681266.337 take away 178? -20681444.337 What is 0.05 minus -560523009.9047? 560523009.9547 Add together -556181408806 and -144. -556181408950 Work out -36696125577 - -2.5402. -36696125574.4598 What is the difference between -0.596 and -0.0991963514? 0.4968036486 What is 17194438245575 less than -5? -17194438245580 What is the distance between -664649.592263 and -1.6? 664647.992263 Subtract 221595 from -6803805. -7025400 What is -14886105 + 170.008? -14885934.992 -690399288+-0.23 -690399288.23 Calculate 295 + -2348670850139. -2348670849844 What is -676874621638 take away -0.1? -676874621637.9 What is 0.1 less than 12.42686146068? 12.32686146068 -23+1296876234147 1296876234124 Add together -682.33 and 7787577. 7786894.67 2239612.4 - 287.703 2239324.697 Add together -168.665905 and -11.13. -179.795905 Total of 381 and 598154701818. 598154702199 What is 9688699 + 28508.3? 9717207.3 -140.5284991+-9585 -9725.5284991 Add -5575381 and -4563488. -10138869 What is the distance between 0.022 and 2.826889482? 2.804889482 What is the difference between 7877525453734 and -8? 7877525453742 Total of 3968001747958 and -5. 3968001747953 -161294029 - 633 -161294662 What is -3.360275635 - 201? -204.360275635 Work out -4 + 33616.46305. 33612.46305 Work out 0.0795385195 + -515. -514.9204614805 Work out 531.2934 - -1285256. 1285787.2934 Calculate -0.84 + -443562600. -443562600.84 -0.147984314 + -337.162 -337.309984314 What is 46876594265068 - -5? 46876594265073 What is -913415599 less than -18? 913415581 Add together 0.33 and -400431059. -400431058.67 Total of -2235369 and 1321. -2234048 What is -8423 minus -67636.071? 59213.071 Add -0.413 and -3058616343. -3058616343.413 Add together -0.5 and -6.5418389235. -7.0418389235 What is 1 + -80106076.57? -80106075.57 Add 16 and -1.35586121369. 14.64413878631 Work out -130675779.55 - -525.9. -130675253.65 Calculate -742 - 1072799950. -1072800692 What is 2950266 take away 0.77714? 2950265.22286 Subtract -71599 from -211581762. -211510163 Put together 43 and 5648977887. 5648977930 Calculate -1818736701 - 2. -1818736703 Add -4.45602249165 and 1. -3.45602249165 Sum 856916896341 and -4. 856916896337 Subtract -0.03 from 4808986804478. 4808986804478.03 Sum 3.6385502 and 311. 314.6385502 Subtract -3005629.380251 from 174. 3005803.380251 What is 1614803.59 less than 398? -1614405.59 Total of 45454488 and 1922.918. 45456410.918 What is 12861.56918842 take away 0.5? 12861.06918842 What is -3062404 minus 42236593.8? -45298997.8 Put together 0.6738341 and 16020.67. 16021.3438341 What is -12010 take away -3818.452708? -8191.547292 What is 90664195 minus 0.24584? 90664194.75416 Subtract -6.29 from 16.33024717. 22.62024717 Calculate 0.8 - -91914715664. 91914715664.8 What is the difference between 930552315893 and 0.4? 930552315892.6 Calculate -14 + -2665181931089. -2665181931103 What is -30931.96 less than 685? 31616.96 Calculate 103 + -20.18088797814. 82.81911202186 Sum -45085748220 and 1.035. -45085748218.965 40089+1726108894 1726148983 Add 286.97 and 62592138. 62592424.97 What is -12237875336 - 116.24? -12237875452.24 What is -1750 take away 138811634161? -138811635911 What is 5 less than -0.16112683243349? -5.16112683243349 Total of 0.042 and -263165305. -263165304.958 What is the distance between 40 and -32209224886? 32209224926 What is 0.06095133298 minus -441? 441.06095133298 What is 68918547 less than -2767? -68921314 Subtract 125220381 from 0.43. -125220380.57 What is 4 plus 40.67797506194? 44.67797506194 Total of 1.92733477 and -0.1803. 1.74703477 What is 542 less than 77519409? 77518867 Subtract -1512545547 from -0.7458. 1512545546.2542 -90 - -600306484 600306394 Sum -4 and 100105206292339. 100105206292335 Calculate 1.047981406486 - 4. -2.952018593514 Calculate 132.77067 + -299484. -299351.22933 Work out -451962069 - -835. -451961234 Work out -15374 - 14.205603. -15388.205603 Add together -305419109219 and 109. -305419109110 Calculate -17.5153693 - 74854. -74871.5153693 What is the distance between -0.1 and 253627.37992299? 253627.47992299 What is -24936763 take away -288.7? -24936474.3 5+42033.8534728 42038.8534728 0.2747507+-116562 -116561.7252493 Total of -148960449758 and 80. -148960449678 Calculate -0.2798055 + -1060743. -1060743.2798055 Work out -5 - 0.55924394177147. -5.55924394177147 What is -77.483778 - 48385? -48462.483778 Add 0.03 and 391281333162. 391281333162.03 What is 526699747271 plus 11? 526699747282 1.990744 + 221544702 221544703.990744 What is 47071529234 minus -0.5? 47071529234.5 Sum -779897 and -95233328. -96013225 What is -5 + -138.27831976? -143.27831976 Work out 45862929022629 - -10. 45862929022639 Sum 693445.246836 and -0.2. 693445.046836 Add together -13 and -0.898046379. -13.898046379 What is -395859 minus 60071632? -60467491 80610 + 14807067 14887677 -60420.6+973583 913162.4 What is -19.1344149 - -373? 353.8655851 Add -0.07 and 34.451696432833. 34.381696432833 20039.8175152 + 0 20039.8175152 8473841225691 + -2 8473841225689 What is -9.377 minus 51170764? -51170773.377 Calculate -137585.1373209 - 21.1. -137606.2373209 Calculate 30115051 - -9198. 30124249 Add together 505992507 and 0.1731. 505992507.1731 What is -590683 minus 7737.92732? -598420.92732 -5028+64896.37924 59868.37924 What is -3356817215 plus -16.4? -3356817231.4 What is the distance between -3 and -104345198970? 104345198967 What is the difference between -0.53 and 2188303776776? 2188303776776.53 What is 3291322989785 less than 0.4? -3291322989784.6 What is 58.3 minus 58067477722? -58067477663.7 What is the difference between 208.93185154818 and 4? 204.93185154818 What is 0.26257367235 + 0.08? 0.34257367235 Work out 173.6836 + 80240103. 80240276.6836 Work out -222 - -1186480564. 1186480342 What is the difference between -55.9777 and 205237? 205292.9777 Work	{ "pile_set_name": "DM Mathematics" }
4v - 324. Let m = 109 - r. Calculate the remainder when m is divided by 11. 8 Let r = 26 - 15. Calculate the remainder when 43 is divided by r. 10 Suppose 2t = 4t - 10. What is the remainder when 6 is divided by t? 1 Let x = -14 + 21. What is the remainder when 11 is divided by x? 4 Suppose 0 = 4r - 2k + 84, 38 = -5r + 4k - 67. Let b = -16 - r. Calculate the remainder when b is divided by 3. 2 Let d be (-21)/(-4) - 15/(-20). Let h = 13 - d. What is the remainder when 19 is divided by h? 5 Suppose 0 = a, -v - 9 = -a + 2a. Let y(m) = -m*3 - 9m2 - m + 5. Let q = -6 + 11. What is the remainder when y(v) is divided by q? 4 Let i(o) = o3 + 9o2 + 3o + 4. Let h be i(-6). Suppose h + 41 = 5q. Calculate the remainder when q is divided by 14. 13 Let c = -24 - -37. Let g(x) = -3x3 - 1. Let t(l) = l3 - l*2 - 1. Let w(r) = -g(r) - 4t(r). What is the remainder when c is divided by w(4)? 3 Let l = -6 + 6. Let c = l - -16. What is the remainder when 29 is divided by c? 13 Suppose -4c + 5i = -319, i = 3i - 10. What is the remainder when c is divided by 29? 28 Suppose 18 = -6m + 8m. Calculate the remainder when 53 is divided by m. 8 Let p be (-10)/(-6) - 2/(-6). Suppose -m - pm = -9. What is the remainder when 2 + m/((-6)/(-22)) is divided by 5? 3 Let r be (17 + 0)(-2 - 0). Let i = r - -48. Let c = 8 + -3. What is the remainder when i is divided by c? 4 Suppose 0m = 4m. Suppose m = t + t. Suppose -3b + 6 = -tb. What is the remainder when 2 is divided by b? 0 Let t = 12 + 18. What is the remainder when 21 is divided by ((-36)/t)/((-1)/5)? 3 Let u = 24 + -17. Let q(b) = 2b*2 - 11b + 9. Calculate the remainder when q(u) is divided by (16/(-3))/(3/(-9)). 14 Suppose v + 30 = 2v. What is the remainder when ((-10)/(-4))/(5/v) is divided by 8? 7 Suppose 0 = -2p - 5y + 12, -3y = 4p - 2y + 12. Calculate the remainder when 14 is divided by ((-2)/p)/((-1)/(-10)). 4 Let k = 14 - 10. Suppose 3o - 24 = l + 20, ko + 5l = 27. What is the remainder when o is divided by 7? 6 Suppose 3u + 3n = 48, -5n + 45 = 3u - 3. Let i(v) = -v2 + 2v + 1. Let y be i(2). Calculate the remainder when y/1 + 128 is divided by u. 13 Let f = -4 - -12. Suppose -2i + 148 = 2i. Let w = i - 14. What is the remainder when w is divided by f? 7 Suppose -10 = 4o + o. Let v be -2 + (-48 - 2) + o. Let b = -37 - v. What is the remainder when b is divided by 6? 5 Let d = 2 - -55. Calculate the remainder when d is divided by 21. 15 Let a(n) = -2n - 6. Suppose 0 = s - 1. What is the remainder when a(-4) is divided by s? 0 Let i(r) = 1. Let u(z) = -z + 9. Let a(q) = 6i(q) - u(q). What is the remainder when 11 is divided by a(7)? 3 Suppose 0j + 5j = -3y + 139, 4j = -2y + 112. Calculate the remainder when j is divided by 9. 2 Suppose 37 = -4b - 11. What is the remainder when 9 is divided by (-70)/b + (-1)/(-6)? 3 What is the remainder when ((-152)/16)/((-2)/4) is divided by 7? 5 Let o(w) = -11w - 1. Let q = 133 + -116. Calculate the remainder when o(-6) is divided by q. 14 Suppose 2h + 5x = 36, 4x - 73 = -4h - h. Suppose 2u = -m - 3u + 58, -3u + 50 = m. Calculate the remainder when m is divided by h. 12 Let z(x) = x*2 + 3x - 8. Suppose -79 + 21 = -2l. Calculate the remainder when l is divided by z(-6). 9 Suppose 0 = -4d + 4, 4o = 5d + 38 + 21. What is the remainder when 92 is divided by o? 12 Let h(s) = s*3 - 2s2 + s + 1. What is the remainder when 37 is divided by h(3)? 11 Let q(c) = c3 + 6c2 + 5c + 4. Calculate the remainder when 18 is divided by q(-2). 8 Suppose -x + 5b + 13 = 0, 0 = -3x + b + b + 65. Calculate the remainder when 66 is divided by x. 20 Suppose -3a = 4x - 152, 0 = 5x + 5a - 144 - 46. Calculate the remainder when x is divided by ((-20)/(-3))/(1/3). 18 Suppose 55 = 5x - 4i, -4i = 2x - 2i - 4. What is the remainder when x is divided by (-1)/(-2 - (-10)/6)? 1 Let r(a) = a2 - 2a - 6. Calculate the remainder when 1(-1 + (-36)/(-2)) is divided by r(5). 8 Suppose -24l + 19l + 190 = 0. Calculate the remainder when 187 is divided by l. 35 Suppose x = 3g + 6, -x + g + 2 = -4g. Suppose t + x = 3t. Calculate the remainder when 11 is divided by t. 5 Suppose 0 = 2m - 8, -q - 2m + 0m = -9. What is the remainder when q is divided by 1? 0 Let f = 31 + -29. Let o(w) = 15w3 + w2. Let a be o(1). Suppose -fm - 5n + a = 0, 2n - 8 = -m + 3n. What is the remainder when 23 is divided by m? 7 Suppose 0 = -5l - 1 + 146. Suppose -j = -5j - 56. Let o = -6 - j. What is the remainder when l is divided by o? 5 Suppose -14 = 4h - 126. Suppose -p = -0 - 10. What is the remainder when h is divided by p? 8 Suppose 0 = -2o + 20 + 14. What is the remainder when 66 is divided by o? 15 Suppose 7 + 5 = 3m. Calculate the remainder when 15 is divided by m. 3 Let o(c) = 4c*2 - 27c - 6. What is the remainder when o(9) is divided by 39? 36 Let o(x) = -x + 7. Let m = 0 + 6. Calculate the remainder when o(-9) is divided by m. 4 Let w(h) = h*3 - 2h*2 - h + 2. Let m be w(2). Suppose -y = -my - 17. Calculate the remainder when y is divided by 10. 7 Let c = -20 + 14. Let k be (-4)/(-12) + (-100)/c. Suppose w = -0w + k. Calculate the remainder when w is divided by 6. 5 Let c(l) = -5l + 5. Suppose i = 4q - 7, 4q - 36 = -2i + 2q. What is the remainder when c(-4) is divided by i? 12 Suppose -5k - 2g = g - 65, 0 = -5g. Let y be (-1)/5 + 708/15. Let s = y + -22. What is the remainder when s is divided by k? 12 Suppose 0 = -g + 3, 3n - 24 = -g + 5g. Suppose 0 = -5z - 10, 3b - z - n = -4. Let p = b - 0. What is the remainder when p is divided by 1? 0 Suppose -o = -2o + 13. Let a be (-4)/6 - 4/(-6). Suppose j = 4j - 2d - 147, a = -3d + 9. Calculate the remainder when j is divided by o. 12 Let a be (3 + 1 + -4)/(-1). Suppose 3k = -ak + 3. Suppose k = -x + 24. What is the remainder when 67 is divided by x? 21 Let o(q) = q2 + 9q + 22. What is the remainder when o(-9) is divided by 4? 2 Suppose 6t - 3t = -5m + 9, -4t + 47 = -5m. Calculate the remainder when 13 is divided by t. 5 Suppose -4v - 2g + 32 = 0, -7g - 4 = -2v - 2g. Calculate the remainder when 17 is divided by v. 3 Calculate the remainder when 70 is divided by (-4)/12 + (-110)/(-6). 16 Let i be (-26)/(-3) + 12/(-18). Let z = i + -3. Calculate the remainder when 12 is divided by z. 2 Let q(r) = 6r + 6. What is the remainder when 69 is divided by q(5)? 33 Suppose -2y + 15 = -21. Suppose -2n - 5l + 65 = -19, 0 = n + 3l - 40. What is the remainder when n is divided by y? 16 Let f be 3 - ((-6)/2 + 2). Let v = -5 + f. Calculate the remainder when 64 is divided by (0 - v)-1 + 23. 20 Let k = 31 + -12. What is the remainder when 75 is divided by k? 18 Let q = 140 - 134. Let l(r) = -r*3 + 5r*2 - 3r - 2. Let w be l(4). Suppose -30 = wi - 5i. What is the remainder when i is divided by q? 4 Suppose -37 = -2u + 13. What is the remainder when 197 is divided by u? 22 Let n be 42/(-9) + (-8)/(-12). Let x be (-3 + 0)(-44)/3. What is the remainder when 31 is divided by ((-2)/n)/(2/x)? 9 Let k be (-17)/5 + (-4)/(-10). Let t(n) = -n*3 - 5n*2 - 5n - 2. Let j be t(k). Calculate the remainder when 4 - 2 - 85/j is divided by 5. 4 Let w(r) = -10r - 3. Suppose 0 = -5d - 57 + 17. Let s = d - -17. What is the remainder when w(-2) is divided by s? 8 Suppose -2z - 3z + 245 = -4f, f = z - 48. What is the remainder when z is divided by 14? 11 Suppose -8 = -4f + 2i + 28, -3i + 46 = 4f. Let l = 28 + -9. Calculate the remainder when l is divided by f. 9 Calculate the remainder when 37 is divided by -4 + 2 + 20 + 3. 16 Let y(n) = 2n*3 - 4n*2 - 7n + 6. What is the remainder when 292 is divided by y(4)? 40 Let j(p) be the first derivative of -3p2 - p + 1. What is the remainder when 10 + -22/4 is divided by j(-1)? 4 Suppose -y - 4y = -4v - 14, 2y - 2 = -2v. Calculate the remainder when 2/4 + (-18)/(-4) is divided by y. 1 Let q(s) = -s - 9. Let m be q(-10). Suppose -m = r - 6. Calculate the remainder when 14 is divided by r. 4 Let h = -28 - -9. Let l = -8 - h. What is the remainder when 43 is divided by l? 10 Let k be -43 + (-12)/(-1 + 5). Let q = k + 87. Suppose l - 6l - 3a + 76 = 0, l + 5*a - 24 = 0. Calculate the remainder when q	{ "pile_set_name": "DM Mathematics" }
/(-10))/((-27)/(-45)). -1/3 Calculate (30/(-12))/(-5)0. 0 What is -2 - 4(-1)/(-2)? -4 What is the value of 1/4-421/(-6)? 7/4 What is the value of -28 + 28 + -5 + 1? -4 What is the value of 22/35 + 45/(-105)? 1/5 Evaluate (-2)/4(-140)/(-56). -5/4 Calculate (2 - 7/4)2. 1/2 What is the value of (-42)/18 + (-4)/(-12)? -2 (-76)/(-95) + -1 + 8/(-10) -1 Evaluate 4/(-44) - (-2 - -2). -1/11 Calculate ((12/22)/2)/(58/116). 6/11 Calculate 72/(-32) - (7/4 + -2). -2 (-15)/(-399) - (-47)/(-329) -2/19 Calculate 387/234 + (42/4)/(-7). 2/13 ((-18)/12)/(165/44) -2/5 What is (15/4)/(16/((-448)/(-21)))? 5 -12(-3 + (-598)/(-195)) -4/5 What is the value of ((-2 - 2) + 3)(-6)/21? 2/7 Calculate (-8 - (-200)/30)36/(-8). 6 What is the value of (27/(-36))/((-1)/(-4))? -3 5 - (-6)/(-6 + 5) -1 Calculate 11/(-12)120/(-45). 2/9 (-14)/82 - -4 1/2 Evaluate (3/(-24)-4)/((-1)/(-4)). 2 What is (-7)/(14/(-3))4/10? 3/5 What is 6/(-18) + 44/(-12)? -4 Evaluate ((-2)/(-6))/(18/(-1 + -107)). -2 34/85 - (-27)/(-5) -5 4/(-18)26 + 33 + -27 2/9 What is 9/1622/(-1)? -1/9 Evaluate (-6)/3 - ((-6 - 0) + 4). 0 Calculate 45/7 - 348/58. 3/7 What is the value of -6 + ((-16)/(-2) - 3)? -1 What is (-153)/(-144)4 - 4? 1/4 Evaluate 96/(-44) - 2/(-11). -2 What is (-32)/12 + (-1)/3? -3 16/116/(-64) -4 Evaluate -1 + 0 + 690/750. -2/25 What is ((6 - 7)15)/(-1 - 2)? 5 Evaluate (-101)/303 - (0 + (-40)/(-6)). -7 Evaluate (-1976)/(-420) + (-4)/(-42) - 5. -1/5 Evaluate -2 + (40/(-11))/(-2). -2/11 What is the value of -3 + (4 - 3) + 12/(-6)? -4 What is (-76)/(-12) - (-108)/(-81)? 5 17/5 + 6/(-15) 3 What is 7/70-12? -1/5 What is the value of -2 - ((-66)/(-30) + -4)? -1/5 Evaluate 22/5510/(-9). -4/9 Evaluate ((-1)/(1/(-3)))/((-45)/(-6)). 2/5 What is ((-1)/4512)/(2/(-6))? 4/5 What is the value of -1 - -27/14? 0 (-2)/(-5)5/(-6) -1/3 Calculate ((-1)/4)/(12/60). -5/4 Evaluate 448/231 + 100/(-60). 3/11 Calculate (126/12 + -6)4/12. 3/2 Calculate 2/(-2 + 0) - (-18)/30. -2/5 Evaluate 2/(-4) + 75/110. 2/11 What is 7 + -3 + 04/(-8)? 4 ((1 - -1) + -8)(-4)/6 4 Evaluate (-1512)/(-4830) - (-2)/23. 2/5 (-31)/(-18) + 54/(-243) 3/2 What is the value of 3/(6/(-39) + (-124)/208)? -4 What is 4/9 + (280/(-90))/(-14)? 2/3 Evaluate 0 + -2 - (-3 - -1)/(-2). -3 Calculate 2/2 - (-3 - -3). 1 What is the value of 2/(-14) - (15/(-21))/5? 0 (65/(-39))/(1/(-3)) 5 Evaluate (-63)/105 + (-44)/10. -5 What is the value of 92/24 + -6 + 2? -1/6 What is the value of -30 + 24 + 12/2 + -4? -4 -3 + 4/1 - 4 -3 What is ((-168)/196)/(1/7)? -6 What is (2/(-7) - 174/(-21)) + -3? 5 Calculate -2 + (12/(-48) - (-11)/(-4)). -5 (-294)/(-56) - 2/8 5 What is the value of ((-2)/3)/(20/6)? -1/5 ((-4 - 3) + 9)/((-24)/15) -5/4 Calculate -30 + 32 + 6/(-1). -4 What is the value of ((-33)/22)/(3/2)? -1 Calculate -5 + 240/(-36)3/(-2). 5 What is the value of (-9)/9 + 0 - 2? -3 What is (1 + -10)(-10)/(-30)? -3 Calculate 38/(-840)-5. 1/7 What is (1/5)/(10/(-350))? -7 What is the value of (-11 + (-468)/(-48))/(-5)? 1/4 Evaluate (-15)/40 - 30/(-80). 0 Calculate 25/((-875)/410) - -12. 2/7 Evaluate 44/(-28) + 52/91. -1 What is the value of (-11 - (-55)/11) + 148/25? -2/25 What is (-7)/21(-5 + 4)? 1/3 Evaluate (16 - 2) + 80/(-10). 6 Evaluate (1 + 18/(-24))8. 2 Evaluate 351/(-130) - (-6)/(-20). -3 Evaluate (-22)/(-154) + (-11)/(-21) - 1. -1/3 Calculate (-1)/(-3) - (-4)/6. 1 29/583/6 1/4 (-7)/((-84)/156) - 11 2 What is the value of (9/33)/(6/(-4))? -2/11 6/(-12)2-1 1 What is the value of 8/14 + 22/(-77)? 2/7 Evaluate (14/(-7))/(-2) - (1 - -1). -1 Calculate ((-3)/(-12))/((-3)/(-36)) + 4. 7 Calculate (4/(-18))/((-3)/(-9)). -2/3 What is (-4(-3)/16)/(1 - 4)? -1/4 What is the value of 156/(-16) + 9 + 1/1? 1/4 What is 12/9 + (15/9 - 2)? 1 5/(10/(-3)) - 14/(-4) 2 What is 5 + -14 - 255/(-25)? 6/5 (99/(-6))/(-11) + 9/(-4) -3/4 Evaluate 75/15 + (-76)/14. -3/7 Calculate 1(0 + -1)/(3/(-15)). 5 (-7 - -1) + 5 + 5 4 What is (-18)/(-2 - -3)(-12)/(-36)? -6 What is the value of 4(-2)/8 + (-44)/(-36)? 2/9 What is the value of ((-24)/40)/((-9)/(-2))? -2/15 Calculate 52/(-806) - (-305)/2325. 1/15 What is (((-36)/(-87))/4)/(180/120)? 2/29 (0 - -2)/(25/(-50)) -4 Evaluate (21/350-5)/((-18)/(-15)). -1/4 What is the value of (10/(-4) - -3)/(-2)? -1/4 22/(33/21 - 108/(-252)) 11 What is the value of 7(-2)/4 - (-154 - -150)? 1/2 What is ((-100)/75)/(((-35)/15)/(-7))? -4 Evaluate (9/(-2))/(75/(-50)). 3 Calculate (6/(-24))/(-7(-9)/168). -2/3 Calculate 104/(-39) + 49/21. -1/3 10/(-45) - (-130)/(-225) -4/5 66/7 + -6 + (-1 - 2) 3/7 What is the value of 3(-6)/7 + (-8)/(-14)? -2 (-3)/(-4) - 319/(-44) 8 What is 6-1 + 3 + -1 - 0? -4 What is the value of 4/(-4 + 4 + -1)? -4 Calculate (-17 - -17)/(2/1). 0 Calculate (12/(-5) - -2)(-4)/(-8). -1/5 What is the value of -3((-5)/(-3) - 0)? -5 What is ((-63)/(-2))/9 - (-2)/(-4)? 3 ((-16)/48)/(1/((-9)/(-12))) -1/4 Calculate (2 + (-12)/9)(-2)/(-4). 1/3 Evaluate (62/(-9)3)/(-14). 2/7 (2/18)/(19/(-57)) -1/3 Calculate (-55)/30 + (-23)/(-23). -5/6 What is the value of 1/(6 + -7 - (-8)/7)? 7 Evaluate (-3 - (-51)/9)/(5 + -3). 4/3 What is 20/6 - (-220)/(-165)? 2 What is the value of (-3)/(-1)-34/(-90)? 2/5 Calculate (12/(-24))/(1 + 2/(-4)). -1 Evaluate 39/13 + 3 + -4. 2 0/((-4)/(-6)3) 0 (-2)/(-4)(14/(-4) + 5) 3/4 Evaluate 2/(-1)(-6)/108-1. -1/9 What is the value of 0/(((-48)/6)/((-2)/(-1)))? 0 ((-1125)/(-12))/(-15) - (-4)/16 -6 What is the value of (2 + 8 - 8)/(30/(-25))? -5/3 Evaluate (-140)/(-14)((-18)/(-4) + -5). -5 Calculate (-26)/(-8) - 4/((-16)/(-12)). 1/4 Evaluate (-44)/(-48) + (-22)/6 + 3. 1/4 Calculate -10 + 1/(-1 - 28/(-21)). -7 Calculate 5/(-15) - (-8)/(-3). -3 6/(-10) - (-28)/55 -1/11 (-9)/5 + (8/(-20))/2 -2 Evaluate -2(4 - (-165)/(-40)). 1/4 What is the value of 14/84 + 26/(-48)? -3/8 4/12 - 44/(-12) 4 Evaluate 42/(-38) + (-9)/(-9). -2/19 Evaluate ((-3237)/325 + 10)/(2/(-10)). -1/5 Evaluate (-3 + 22/6)-3. -2 What is ((-6)/(-192))/(1 + 6/(-8))? 1/8 What is the value of 9(-5)/105-7? 3 Calculate 5 - (-190)/193/(-4). -5/2 Evaluate -5 + -1 - 90/(-12). 3/2 What is ((-6)/(-8))/(34 - 32)? 3/8 Calculate 1/(1 - (-25)/10). 2/7 Calculate 0 + 11/((-385)/14). -2/5 What is 13/(-156)6 - (-5)/2? 2 Evaluate (-4173)/819 + (-20)/(-4). -2/21 (2/(-10))/(80/100) -1/4 What is the value of 4/22 + (3 - (-3464)/(-1144))? 2/13 What is (-1 - (11 + -9))(-3)/(-33)? -3/11 What is 20/3033/77? 2/7 What is (-1)/(-2) - (-10 - (-1001)/98)? 2/7 Calculate (-2)/12 + 1 + (-102)/36. -2 Evaluate (-55)/15 + (-2)/6. -4 What is the value of (416/(-260))/(18/(-15))? 4/3 What is -22/42 - (-1245)/3150? 3/10 Evaluate ((8/10)/(-2))/(44/(-550)). 5 What is (-116)/176 - (-3)/(-33)? -3/4 1/1(380/(-55) + 7) 1/11 Calculate (5/(-4))/(148/(-592)). 5 What is the value of (3/(10 - 4))/((-3)/2)? -1/3 Calculate -1 - (2/3)/((-15)/20). -1/9 Evaluate 714/833(-7)/(-4). 3/2 121(-7)/(-56) 3/2 Evaluate (-4 + -4)/(-4) - (-3)/(-1). -1 What is (-20)/80 + ((-41)/28 - -2)? 2/7 7 - -17(-10)/30 4/3 ((-4)/8 + (-1)/2)/1 -1 Calculate ((-45)/105)/(18/(-14)). 1/3 0/4 + 5/(-15) -1/3 What is 108/(-100) + (-32)/(-400)? -1 Evaluate 1 + (1 - 2) - (-2 - -5). -3 What is the value of (32/(-90))/(-1) + (-12)/90? 2/9 What is 18 - (19 + -9 - 0)? 8 Calculate (-9 + 6)/((-3)/(-3)). -3 Evaluate (05/(-10))/(0 - -1). 0 Evaluate (-2)/8 - (-121)/(-44). -3 4/((-264)/(-78)) - 1 2/11 Calculate 6 - (-21)/(-2) - 4/(-1). -1/2 (-4290)/1040(-8)/3 11 Evaluate (-8)/(-28)49/(-63). -2/9 Calculate ((-249)/(-63) - 4)3. -1/7 (-8)/30(-3)/((-36)/10) -2/9 What is (123/(-42) - -3)-2 + 0? -1/7 (108/18)/(101) 3/5 Calculate 1/(-7) + (-23)/(-63). 2/9 Evaluate 2/(2/3) + (10 - 14). -1 (-16)/12(-27)/12 3 What is (-40)/(-105) - (0 + 6/9)? -2/7 ((-4)/8)/((-4)/(-6)-3) 1/4 What is the value of (8/(-16))/(1/(-6)) + -3? 0 Calculate (-75)/27 + 26/(-117). -3 What is ((-20)/6 - -3)/(3/27)? -3 Evaluate ((-10)/(-6))/(28/84). 5 Calculate 1/(4 - (-21)/(-9)). 3/5 What is 7/(504/(-88)) + 1? -2/9 Evaluate 3/33(-3 - (-3 + 1)). -1/11 Evaluate (-8)/(-8) + 0 - 2/6. 2/3 Evaluate (3/(-42))/((75/(-36))/(-25)). -6/7 Evaluate 1(-1 - 2 - -6). 3 Calculate (44/4 + -1)/2. 5 Calculate -3((-15)/12 - (-10)/(-24)). 5 Evaluate 3/12 + (-4)/(-32). 3/8 Evaluate (3 + -1)/(12/2 + -4). 1 Calculate 19/(95/2)*1/2. 1/5 ((-5 - -3) + 0)/(0 - -2) -1 (-4)/10	{ "pile_set_name": "DM Mathematics" }
2 + 6 + 8 - x. Let a(k) = -k3 - 13k*2 - k - 16. Let c be a(-13). Give u(c). 3 Let m(t) = 16t + 13t + 15t + 0 - 3 - 45t. Suppose 0 = 4g + 4v + 32, 3g + 34 = -0g - 5v. What is m(g)? 0 Let z be ((-3)/(-6))/(3/(-12)). Let u be ((-3)/z)/(9/12). Suppose 0 = 3g + 4s + 9, u + 0 = 5g + s. Let t(y) = -4y3 - y2 - y + 1. Determine t(g). -5 Let f(p) = 2p - 7. Let b(j) = -2j + 7. Let d(i) = -5b(i) - 6f(i). Give d(6). -5 Let n(x) be the first derivative of -x4/4 - x3/3 - x*2/2 - x - 2. Let u(v) = -2v*3 - 5v*2 - 4v - 5. Let i(z) = n(z) - u(z). Calculate i(-4). -8 Suppose 4q + 0q = 196. Let z(t) = q - 51 + t - 3t. What is z(3)? -8 Let a(c) = -2 + 9c*3 + 5c*2 + 0c*3 + 2c*2 - 10c*3 - 6c. Let l be (10/8)/((-3)/(-12)). Determine a(l). 18 Let v(i) = -3i - 8. Let g(b) = b + 3. Let j(q) = -8g(q) - 3v(q). Let l(y) = y + 3. Let n(p) = -j(p) - l(p). Calculate n(-3). 3 Let z(k) = -8k. Suppose 0 = -2y + 2, -5b + 4y = -0b - 21. Suppose -52 + 47 = bx. Give z(x). 8 Let l(m) = -m2 + 15m - 13. Suppose 18d + 117 = 27d. Give l(d). 13 Let p(v) = -12v2 - 40v - 31. Let q(w) = -7w2 - 20w - 15. Let s(n) = -3p(n) + 5q(n). Determine s(-18). -18 Let r(g) = 5g3 - 4g*2 + 6g + 8. Let j(s) = 13s - 10s*2 + 17 - 9s*2 + 10s*2 + 11s*3. Let b(o) = -6j(o) + 13r(o). What is b(3)? -7 Let r(b) = b3 + 9b*2 + 2b - 7. Let l(j) = j. Suppose 3x - 30 + 18 = 0. Let g(t) = xl(t) + r(t). Give g(-8). 9 Let u(r) = -22r - 14. Let c(m) = 8m + 4. Let b(s) = 8c(s) + 3u(s). Determine b(-6). 2 Let j(c) = -c*3 - 8c*2 - 8c - 7. Let x be j(-7). Suppose 9 + 7 = 4q. Let p(l) = 3l + 7. Let z(r) = r + 2. Let u(d) = qp(d) - 11z(d). What is u(x)? 6 Let i(f) = 6 + 4 - 3 - 3 - 5 + 2f. Give i(-7). -15 Let q be (84/70)/(6/10). Let u(w) = -3w*2 - 3 + 4w*q + 0w*2 + 6w - 2w2. Give u(4). 5 Let q(d) be the first derivative of 1/12d*4 - 3 + 0d + d*2 + 1/3d*3. Let j(b) be the second derivative of q(b). What is j(3)? 8 Let t(h) = -7h3 + h2 - 1. Let l = -43 - -40. Let z be (-2)/(-8)(7 + l). What is t(z)? -7 Let k(p) = -p + 4. Let t = -146 + 139. What is k(t)? 11 Let b(f) = -f - 7. Let k = -596 - -592. What is b(k)? -3 Let a = -24 - -31. Let p(q) = -q3 + 7q*2 + 3q + 8. Determine p(a). 29 Let v be -1 - -2 - 4/(-2). Let s(p) = -p2 + pv + 2p2 + p - 5p*2. Let y be (-1)/(-2) + (-9)/(-6). Calculate s(y). -6 Let f(b) = 2b - 3. Suppose -2v + 17 = -4v - 3w, 2w = 4v - 6. Let j be -3 + 3 + v + 4. Give f(j). 3 Let i be -3 + -20 + -2 + 1. Let a be (7/2)/(12/i). Let w(m) = -m3 - 8m*2 - 5m + 4. What is w(a)? -10 Let r be -21/(-4) - (-76)/8. Suppose -3q - r = 11. Let h(b) = b*2 + 8b + 8. Give h(q). 1 Let v(l) = -l*3 - 4l*2 + 5l + 1. Let w = -26 + 32. Suppose -p + w = 11. Determine v(p). 1 Let v(g) be the first derivative of -g*2/2 - 5g - 263. Calculate v(-9). 4 Let r(x) = -12x2 + 1. Let n = 1809 + -1810. Give r(n). -11 Let b(g) = -4g + 4g + 5g. Suppose 2s - 2k = 74, 2k + 25 = s - 12. Let y = s - 36. Calculate b(y). 5 Suppose -5y + 12 = 4k, -4k + 4y + y + 12 = 0. Let l(t) = -kt*2 + 5 + 6t - t - 2t + 2t2. Determine l(5). -5 Let s(i) = -i3 + 8i2 - 6i + 12. Suppose -97u + 88u = -72. Determine s(u). -36 Let y be -2(-76)/32 - (-1)/4. Let o(w) = -w2 + 11w - 9. Let b be o(10). Let g(n) = -3n2 + b - n3 + y + 25n - 18n. Calculate g(-4). -6 Let o(h) = -5h*3 - 11h*2 - 16h - 13. Let s(d) = 9d3 + 22d*2 + 31d + 26. Let l(x) = -11o(x) - 6s(x). Calculate l(12). 11 Let n(l) = -5l2 + 7l - 11. Let i be ((-26)/4 - -2)-2. Let t(p) = 11p*2 - 14p + 23. Suppose 15 = 13c - 37. Let v(w) = ct(w) + in(w). Give v(7). -7 Let r be ((-385)/(-1176) - 0) + (-6)/21. Let p(o) be the third derivative of -3o*2 - 1/6o*3 + 1/60o*5 + ro*4 + 0 + 0o. What is p(0)? -1 Let o(k) = -2k2 - 6k + 4. Let c = 348 + -352. Give o(c). -4 Let n(s) = -13s + 3s*2 + 18s + 114s3 + 6 - 115s3. Give n(5). -19 Let s(p) = -p2. Let g(i) = -7i2 + 7i - 3. Let v(w) = g(w) - 6s(w). Suppose 3c - 84 = -5k + 2k, -5k = 4c - 142. Let x be (2/4)/(3/k). Calculate v(x). 7 Suppose -13p + 28p - 45 = 0. Let c(x) = x*2 + 4x - 10. Give c(p). 11 Let d(c) = 2c - 5. Let b = 78 + -54. Let h = 74 - b. Let a be 9/6h/15. Determine d(a). 5 Let p(f) be the third derivative of f*5/60 + 3f*4/8 + 4f*3/3 + 3f*2. Let z be p(-8). Let k(c) = -5c + 2c - 1 + zc - 3. Determine k(-3). 5 Let j(c) = -2c - 3. Suppose -126i + 124i - 4 = 0. Calculate j(i). 1 Let q be (-3)/(-1) - (2 - 10/(-5)). Let l(h) be the second derivative of -h3/3 - h2/2 + 2h. Give l(q). 1 Suppose 72f - 70 = 62f. Let n(h) = 3h - 17. Give n(f). 4 Suppose -3j - 1 = -7. Let n(z) = zj - 5 - z + 1 + 3. Let q = 63 + -63. Give n(q). -1 Let f(b) be the first derivative of -b3/3 - 3b - 7. Determine f(5). -28 Suppose 3f = s - 25, 3f + 0s = 5s - 29. Let k(b) = -7b + b3 + b3 + 3 + 7b2 - b3. Calculate k(f). -5 Let j(z) = 25z - 10z - 8z - 5z. Give j(1). 2 Let r = 234 + -237. Let f(h) = -2h. Give f(r). 6 Let c(w) = -10w + 1. Let b(l) = -l3 - 6l*2 + 5l - 8. Let i be b(-7). Let v be 0 - i - (-13 + 8). Determine c(v). 11 Let f(q) = -q*3 + 3q. Let i be f(-2). Let s(w) be the first derivative of -2w3/3 + 2w*2 - 3w - 3. Give s(i). -3 Let u(b) = b*2 + 7b + 5. Let j(d) = -3d2 - 20d - 14. Let n(l) = -4j(l) - 11u(l). Suppose 0 = -338c + 309c - 58. Give n(c). -1 Let s(o) = o*2 + 2o - 4. Let y(p) = -p*3 - 4p*2 + p - 5. Let d be y(-5). Suppose 11j - 16 = dj. Calculate s(j). 4 Suppose 0 = -8j + 5j - b - 50, -5j = -4b + 55. Let k be j(1 - 12/10). Let i(v) = v*2 - 4v - 3v2 - 1 + 3v*2. Calculate i(k). -4 Let a(m) = -19 + 8 + 19 - 10 + m. Suppose 4b - 5 = -4d + 15, -4d + 2b = -8. What is a(d)? 1 Suppose z - 2z - 3 = 3v, 0 = 5z + 3v - 21. Let n be (-20)/30 - (-22)/z. Let l(d) = 2d*2 - 4d + 1. What is l(n)? 7 Suppose 2 = -d - 3b - 2, -2d + 2b = -8. Let k(r) = -d + 13 - 12 - 4r. Suppose -6q = -5q, -i = q - 2. Calculate k(i). -9 Let b(h) be the first derivative of -1/2h2 - 1/3h*3 - 10 - 2h. Determine b(3). -14 Let g(w) = w3 + w2 + w - 2. Let d be 28/(-7) - (-7 + 1). Determine g(d). 12 Let b(c) be the second derivative of c6/360 - c5/20 + c*4/6 - 31c*3/6 + 41c. Let y(p) be the second derivative of b(p). Determine y(5). -1 Let u(v) = -16v2 + 5v + 12. Let l(b) = 7b2 - 2b - 5. Let p(k) = -7l(k) - 3u(k). Suppose -5i + 3 = 18. Calculate p(i). -7 Let q(j) = -j2 + 6j - 6. Suppose 0 = -3p - 4u + 4, 0u = 5u + 10. Let g be q(p). Let v(w) = 6w + gw - 6w. Calculate v(-3). -6 Suppose -400d - 95 = -381d. Let k(v) = -5v3 - v2 - 7v + 7. Let i(o) = -11o*3 - 3o*2 - 15o + 15. Let p(b) = -6i(b) + 13k(b). Give p(d). 6 Suppose 57x - 61x = -8. Let f(j) = -5j2 + 149 - 151 - j - xj - j. Let r be (-3)/(((-6)/4)/(-1)). What is f(r)? -14 Let f = 31 - 27. Let s be 2/1 - f - 1. Let x(c) = -c*3 - 2c*2 + 2c - 1. What is x(s)? 2 Let s(b) = 2b2 + 22b - 2. Let l be s(-11). Let j(n) = 3n2 + 2n + 1. Let w be j(l). Let o(a) = a*3 - 8a*2 - 8a - 7. Calculate o(w). 2 Let n = -35 + 16. Let i = 22 + n. Suppose s + o = -i, -3o - 2o = -5s - 15. Let b(y) = y2 + 3y - 2. What is b(s)? -2 Suppose n - 4i = 8, -3n + 18 - 45 = 5i. Let f = n - -9. Let w(r) = -r2 + 8r - 4. Give w(f). 11 Let o(y) = 114y - 226y + 2 - 6 + 117y. Calculate o(6). 26 Let v(h) be the third derivative of -h5/60 - h4/24 + h3/6 + 31h*2. Calculate v(2). -5 Suppose -32n + 25 = -71. Let i(r) = -2r - 6. Let q be i(-4). Let s(b) = 0b*2 - 8b + 4 - 2bq + 3b*2. What is s(n)? -11 Let u(h) = -6h - 18. Suppose o - 2t = 6, -2o + 5t + 21 = -o. Give u(o). 6 Let o(w) = -286 - 293 + 851 + 2w - 295. Determine o(10). -3 Let x(z) = z + 20. Suppose -5q - 60 = -q + 5y, 3q + 76 = 4y. Give x(q). 0 Let q(s) = 2 + 3s3 - 4 + 1. Let t be -1(3/(-6))/((-2)/260). Let i = 66 + t. Give q(i). 2 Let h be 234/12 + (-3)/(-6). Let j be 3-1(h/12 + -1). Let c(a) = -10a + 7. Let n(w) = -3w + 2. Let s(g) = 2c(g) - 7n(g). What is s(j)? -2 Let j(r) = -r*2 - 2r + 4. Let m(o) = 5o2 - 23o + 9. Let l be m(4). Let p(g) = 2g2 + 3g - 7. Let x(f)	{ "pile_set_name": "DM Mathematics" }
1.0667 -3767.5844 -0.4 * -191159724 76463889.6 -0.04 times 16285597 -651423.88 Multiply 0.2872574 and -0.1. -0.02872574 3-11125438 -33376314 Work out 8540570 0.2. 1708114 Calculate 42563711.2. 5107645.2 What is the product of -1.2026 and -1063? 1278.3638 -0.4 -2.5187786 1.00751144 What is the product of 0.54474 and 55? 29.9607 What is the product of -186 and 67.5223? -12559.1478 -0.2456778-4 0.9827112 Multiply 8.535 and 21.53. 183.75855 Product of -2293 and -749. 1717457 What is 42.672069 times -0.1? -4.2672069 What is -1480512 times 19? -28129728 -168.588 -1 168.588 Work out -12772782 * 5. -63863910 Product of -77578 and -166. 12877948 13 * -3327.343 -43255.459 -0.0038453-1 0.0038453 Multiply 0.320208 and -0.094. -0.030099552 What is the product of -50 and 3981908? -199095400 Multiply 0.4 and 20338307. 8135322.8 0.4 69.8643 27.94572 Work out 2035.1 * -28.5. -58000.35 -53904.99 * -6 323429.94 Work out -0.6 * -0.0438593. 0.02631558 Work out -0.1 * -23252201. 2325220.1 Multiply 0.02 and -8.318811. -0.16637622 0.3261963 times 0.005 0.0016309815 Product of 0.16106 and 2.2. 0.354332 Work out -2180.96187 * -2. 4361.92374 Multiply 160.0747 and -23. -3681.7181 Product of 0.3 and -121453794. -36436138.2 What is the product of 0.1 and -42855.44? -4285.544 -0.3 * -16.054092 4.8162276 What is 0.9 times -7053.387? -6348.0483 Multiply 33790994 and -20. -675819880 Calculate 57.9522690.5. 28.9761345 -5889 0.216 -1272.024 Calculate -0.183-141516. 25897.428 What is the product of -6473940 and 55? -356066700 Product of -0.02601839 and -77. 2.00341603 0.040.693854 0.02775416 Product of 536.69144 and 0.03. 16.1007432 -535719836 -447861084 14.4 times -0.325844 -4.6921536 Calculate -0.0067627613. -4205.0071 -0.5 * -100060.29 50030.145 Multiply 0.041 and -654.452. -26.832532 35 times -310699 -10874465 Calculate -18678419. -15718273 What is 378 times -9.6876? -3661.9128 8469 times -62333 -527898177 What is -0.081 times -197095? 15964.695 Work out 4221027.9 -5. -21105139.5 What is the product of -0.0641 and -56.581? 3.6268421 -0.5 * -0.10554821 0.052774105 What is the product of 0.237 and -850281? -201516.597 Calculate 1.62631004. 1632.8052 0.110158 1156 127.342648 Work out 19 * 16.44383. 312.43277 What is the product of 1254057.69 and -0.2? -250811.538 Product of 488.21 and -15637. -7634139.77 What is the product of -1 and -117699045? 117699045 124.72 times 3.21 400.3512 630-4631 -2917530 7725263 0.1 772526.3 What is 16 times -202295? -3236720 2 * -73194572 -146389144 1-207572 -207572 Multiply 5 and -25431991. -127159955 What is 0.9 times -872.08049? -784.872441 What is 10.6 times -0.0562? -0.59572 Work out 0.01 -1.705994. -0.01705994 20756642 13325352 Multiply -5 and 1269.5685. -6347.8425 Calculate 1.215113-0.4. -0.4860452 Work out 6561725 * 0. 0 Calculate -316200.2131. -6738.222 What is the product of -3411903 and -5? 17059515 Multiply -33.631 and -1281. 43081.311 Work out -0.054595437 -0.5. 0.0272977185 What is the product of -64 and -399200? 25548800 -348501 times -413 143930913 -8.5 * 0.1593938 -1.3548473 -12030 times -2829 34032870 Calculate 0.33-108.8041. -35.905353 Work out -0.29 14.77456. -4.2846224 Work out 394 * -28582. -11261308 Multiply -1921392 and -2. 3842784 0.42.97528 1.190112 Calculate 6480.620.32. 2073.7984 Multiply -5 and -611013.7. 3055068.5 What is the product of 9.797 and -3542? -34700.974 0 times -112521115 0 Product of -35893968 and 9. -323045712 Multiply -2077 and 22.2. -46109.4 2-42283.9 -84567.8 Work out 38946.488 2. 77892.976 What is 0 times 0.04411354? 0 Multiply -2423 and 2235. -5415405 Work out 3 * -95623175. -286869525 -550637 times -14 7708918 Calculate 51.79442-13. -673.32746 Product of 0.019 and 622.172. 11.821268 Calculate -1394509-41. 57174869 -236 times -9914.5 2339822 Work out -111.14 * 6241. -693624.74 0.185388 * -56 -10.381728 167329 times 1687 282284023 -127 * 46853 -5950331 What is -4366.5 times -3814? 16653831 Work out 0.0518 * -10. -0.518 Calculate -0.6721473-3. 2.0164419 Calculate 34583.64. 13750.92 Product of 0.01873 and -97444. -1825.12612 44 times -63552 -2796288 -1953.5858 times -0.5 976.7929 Multiply 5386525 and 3. 16159575 -358474 times -0.93 333380.82 -1.4 times 2.614852 -3.6607928 Multiply -39753 and -2769. 110076057 -1.826 times 15558 -28408.908 -5 times 6346.07 -31730.35 -0.9695562 times 1.7 -1.64824554 Multiply -2898965 and -0.71. 2058265.15 What is the product of -9555 and 1.3551? -12947.9805 Calculate 1121611360.4. 44864454.4 -35333 -8.91 314817.03 Product of 51.42156 and -5. -257.1078 What is the product of -946 and 0.37999? -359.47054 Multiply 0.19331 and -106.5. -20.587515 Work out 0.02 * -1238851.9. -24777.038 -9227.867 * 9 -83050.803 Work out 51.563 * 712. 36712.856 -0.25509407 -1101881.4 166.4991 166.499 -4819686 * 12 -57836232 Product of -47586 and -2. 95172 What is the product of -29.7342 and -21? 624.4182 What is -8.0269 times -13? 104.3497 What is the product of -22242 and -23905? 531695010 What is -0.5 times 32.93584? -16.46792 -17631 * 0.00236 -41.60916 -246.833387 times 0.1 -24.6833387 Multiply 194872457 and 0.5. 97436228.5 -1.702 * 555965 -946252.43 What is the product of 228 and -422.6143? -96356.0604 Product of -199.0799 and 39. -7764.1161 -4.5 times 561034 -2524653 What is the product of 2.95 and 0.016364? 0.0482738 -17 * -8387651 142590067 Multiply 2941479 and -5. -14707395 -0.05 * -7562484.5 378124.225 What is -99579 times -0.399? 39732.021 What is 0.05 times -0.006392? -0.0003196 Calculate 0.0238510.266. 0.006344366 Calculate -0.43.6831344. -1.47325376 -0.2 times -3.544145 0.708829 2.63846 times 224 591.01504 0.39452234 176371.26 -0.1261882904 -366.449952 Product of 2 and -810442. -1620884 Multiply -0.5 and -2.565. 1.2825 -63825 * 32 -2042400 -8050353.4 -2737119 Multiply 446 and -36.13. -16113.98 Product of 7 and -279.5733. -1957.0131 Work out -53 -79.81761. 4230.33333 -0.2 * 125.068 -25.0136 Product of -188.83 and -13. 2454.79 0.1604387 * 14 2.2461418 Calculate 1-12380805. -12380805 What is 4.627312 times -0.21? -0.97173552 What is 570.306 times -5? -2851.53 Multiply 0 and -83788.85. 0 -0.4-3891734 1556693.6 Work out 2298832 * -2.9. -6666612.8 -11960423211 -1196042321 -185 times -24454.5 4524082.5 What is -2.2785 times -0.4? 0.9114 Work out -55974.67 -0.3. 16792.401 Calculate 112995143. 16158285 Work out -36.06005 0.03. -1.0818015 Work out -150631 * -2.15. 323856.65 0.59079041 times -0.3 -0.177237123 Calculate -0.308163924. -50488.592 What is -3218 times -0.029126? 93.727468 -0.150457 times 79.5 -11.9613315 -283460.04209 -1193.08314 -673062 times 3.2 -2153798.4 -466799 * -0.17 79355.83 Multiply -1007 and 164. -165148 What is 621 times -75.927? -47150.667 Multiply 4 and -94290274. -377161096 What is the product of 14271 and -15569? -222185199 Work out 0.4 * -12299608. -4919843.2 -572068 * 0.68 -389006.24 -29 times 1934409 -56097861 Product of -425.447 and 52. -22123.244 What is the product of 0.2287138 and 5? 1.143569 Calculate 0.547149.045. 23574.5225 What is 50871 times 23.3? 1185294.3 608.4 0.20174 122.738616 Work out 59 * 1116288. 65860992 -0.83 * -152.3563 126.455729 -0.3 times 2704491.9 -811347.57 -3 * 2600.755 -7802.265 What is -0.258941 times 0.3? -0.0776823 Calculate 72791115. 8370965 What is the product of -238 and -1492.48? 355210.24 -7489020.299 -223921.698 What is the product of 523526 and -6? -3141156 1.9 times -66.4336 -126.22384 Product of 0.232 and -44922.5. -10422.02 Calculate -67953.9-5. 339769.5 0.4-32686252 -13074500.8 0.31807 * 4608 1465.66656 0.4 * 28.726498 11.4905992 Multiply -0.1532 and -113.62. 17.406584 Work out 0.256269 * -0.0399. -0.0102251331 What is the product of -0.3 and -213860? 64158 Calculate 4.1148.994. 610.8754 Calculate -0.0119649649. -196496.49 -890.27354 -24.34506 44 1765984 77703296 What is 0.05 times 4135.91? 206.7955 Product of 2248839 and -12. -26986068 What is the product of 0.6663835 and -0.05? -0.033319175 3 times -689643 -2068929 -4-19330841 77323364 Work out -11288 62.03. -700194.64 Multiply 227 and 0.0380565. 8.6388255 What is the product of 0.06368443 and 2? 0.12736886 -211683 times 54 -11430882 14 * -542185 -7590590 Work out 47534 * -109. -5181206	{ "pile_set_name": "DM Mathematics" }
+ 3b, 0 = -4b - 4. Let q be 1/(-4) - 9/(-4). Let o(k) = -k. Let z be o(-3). Solve -p = -zg + qg, fp = g for p. 0 Let b be 1/(-2)(-23 - -17). Solve 4u - bh = -15, -u - h = h - 10 for u. 0 Suppose 2d - 3i + i - 12 = 0, 24 = 4d + 4i. Solve -3m = 3h + 9, 0 = -h + 2m - 0 - d for h. -4 Let o(w) = -w2 - 10w - 13. Let v be o(-8). Solve vx - 7 = 2u - 0u, 4u + x = -7 for u. -2 Let r(w) = -5w3 - 3w*2 - w - 1. Let o be r(-1). Solve g + k = 0, -g - 7 = 2k - o for g. 5 Suppose 0 = -5w + 4w + 3. Let l = -8 - -15. Suppose l = 5s - w. Solve 0 = -a + u - 1, -2a + su = -u for a. -3 Let c be (-124)/(-7) + 2/7. Let i = 10 + -5. Solve -6d = 3o - 2d + 22, -o + c = -id for o. -2 Let k(y) = -2y - 15. Let t be k(-10). Let m = t - 2. Solve -mo = -4x - 13, x - 5 = 3x - o for x. -1 Suppose 3l = -2l + 35. Suppose -9 = -3f, -i + 0i = f - l. Let j = 4 + -2. Solve -4d = -5u + 16, -jd = iu - 4 + 12 for u. 0 Let s = -33 - 2. Let k = -23 - s. Solve 2b + 3y - 2y = 12, 0 = -5b + 2y + k for b. 4 Let g be 35/(-14)(-6)/5. Solve 2c = -f - gf - 10, -3c = f for c. 1 Suppose 9 = -3p, 3u - 2p + 4 = 10. Suppose u = -w + 5a + 9, 2w - 7 - 11 = -3a. Let h = w - 5. Solve 2n = -3i - 2, 5n - h = 2i + 10 for i. -2 Let l be (180/(-42))/(2/(-14)). Solve 23 = -2q - 3g + 7, -5g = 5q + l for q. -2 Let d be ((-56)/(-12))/((-8)/(-36) - 0). Solve -3f - 15 = 0, 0 = -5c + c - f - d for c. -4 Let r(l) = l*2 - 2l - 4. Let y be r(4). Suppose ys - 38 = -14. Solve -3d + s + 3 = 0, -4k = -3d + 13 for k. -1 Suppose p + 0i - 2i = 21, -p - 3i + 46 = 0. Solve -2h - p = 5x, -2x - x - h - 18 = 0 for x. -5 Let k be 2/5 + (-28)/(-5). Suppose -20 = -4d - d. Suppose 0 = db - b - 3x - 15, 4x = -5b + 7. Solve -n - 9 = -bn + o, 3o = -n - k for n. 3 Let t(p) = -2p - 9. Let w be t(-6). Solve 0 = -4o + 4, -5d + 2o = w - 1 for d. 0 Let k = -5 + 5. Suppose w = 5 - k. Solve 2y = -x + w, 8y + 2x = 5y + 6 for y. 4 Suppose -a = -3a + 10. Suppose 5n - 5 = ay, -4n - 3y = -2y - 29. Solve -5l - 29 = -2g, -l - 3g - 11 = -ng for l. -5 Suppose -u - 1 + 2 = 0. Let i be (-14 + (0 - u))-1. Suppose -h + 2f - 8 = 0, 3f - 1 = 5h + 4. Solve 2n - 5z + 1 = i, z = -hn - 10 for n. -3 Suppose 0 = 3v + 2x - 8, -3v + 5x + 23 = 1. Suppose -3w + 17 + 52 = 0. Let n be (-11)/((-6)/18). Solve -3z + 16 = -5z + nh, 3z + w = vh for z. -5 Suppose 0u + 2u - 12 = 0. Suppose 3r = 12 + u. Solve -a = q - 7, rq - 15 = 3q - a for q. 4 Let q(b) = -b*2 - 5b - 4. Let p be q(-3). Suppose pl = 5l - 12. Suppose -9 = -lm + 11. Solve -mt = 4z + 13, 5t + 15 = -6z + z for t. -1 Let u be 5(0 + 2 + -1). Let k be 3/32/1. Solve -kr - uc - 14 = r, -4c = r + 14 for r. 2 Suppose -5j = -0j - 10. Let y = -1 - -1. Solve -5k + 5 = -5i, 5k - ji - 8 = -y for k. 2 Suppose 0 = -10f + 5f + 35. Solve -14 = -2k + 4u, -3u = 3k - 2u - f for k. 3 Let k(v) = -v3 + 2v*2 + 1. Let t be k(-4). Suppose -m - i = 4i - 37, -5m = 3i - t. Solve 3p = 3s + 2 - m, 5p - 4s = -23 for p. -3 Suppose -7l + 90 = -2l. Solve 3c + 3q = -l, 0 = 4c - 6c + 3q - 2 for c. -4 Let v(x) be the third derivative of -x5/60 - 5x*4/12 + 2x*3 - 5x*2. Let c be v(-10). Solve -2u - 2o - 14 = o, -4o = -4u + c for u. -1 Let s be (-132)/(-48) - (-3)/(-4). Suppose -sf = f - 57. Solve 0 = -3t - 2q - f, -2t - t - 24 = 3q for t. -3 Suppose -a = -15a. Solve a = 2w + 10, 5w = -0v + 3v - 31 for v. 2 Suppose 4v - o + 89 = 0, 2o + 27 = -2v - o. Let p be (1/(-2))/((-2)/(-4)). Let k be ((-3)/(-9))/(p/v). Solve 3q - kw = -2w - 10, -q + 3w = 6 for q. 0 Let h(s) = -3s + 15. Let b be h(-5). Solve -30 = -g + 5z, g + b = 5g - 2z for g. 5 Let g be 25/(2/42). Let w(x) = -2x - 2. Let l be w(3). Let n(z) = -z - 6. Let q be n(l). Solve qp + v = -0p - 8, 3p - 5v = -g for p. -5 Suppose -4 = -2o + 2. Let w = o - 3. Solve -s + 1 = -w, -3k + s = -2 for k. 1 Let k(q) = q*2 + 11q + 14. Let p = -14 - -4. Let z be k(p). Solve 15 = 3h - zw, 0 = 5h - 0w + w - 25 for h. 5 Suppose 15 = 5h - 2h, -4v = -h + 5. Solve k + w = -vw, -k = 2w for k. 0 Let x be (-264)/15 - (-8)/(-20). Let r = x + 20. Solve -m - 2 = 3v, 0m - rm - 4 = v for m. -2 Let z = -1 - -1. Let q be z/(0 - -2) - 15. Let o be ((-20)/q)/(2/6). Solve 5l + 45 = ot, 6l + 3t = l - 10 for l. -5 Let o(f) = f*3 - 9f*2 - 23f + 12. Let r be o(11). Solve l - 4a - r = -20, 4a - 25 = -5l for l. 1 Suppose -5r = -6o + 4o - 92, -3o = -3r + 48. Suppose -t = -p + 4, p + 4p + 3t = r. Solve -4k - a = 12, pa = -3k + 5a - 9 for k. -3 Let g be 10/(-1 + 2). Suppose 4a + 4 = -ga. Let i be a/(-2)(-2 - -2). Solve -5t + 0 = -3z + 1, i = 5t + 5z + 25 for t. -2 Suppose -4f + 12 = -4w, -4f - 2 = 3w - 21. Solve fy - 2h - 7 = 9, -5y = -4h - 17 for y. 5 Let a = 29 - 24. Solve f - 5c - 18 = 0, 5c + 5 = af - 25 for f. 3 Let w be (-8 + 10)/((-4)/(-6)). Let n = 21 - 8. Solve -u + wu = 4m + 16, 5m + u = -n for m. -3 Let w be 0/(1 + -2 + 0). Suppose f = -wf + 3. Solve -4j = fo, 0 = -j - j + 2o + 14 for j. 3 Suppose -2q + 1 = 7. Let m = q - 1. Let f(b) = -b - 1. Let i be f(m). Solve k - 1 = 0, 3z + ik - 5k + 11 = 0 for z. -3 Let v(t) be the first derivative of 3t2/2 - 2t - 2. Let b be v(6). Solve -3f + b = f, 5f = 5s - 5 for s. 5 Suppose 2 = q - 5f - 25, 3f + 91 = 5q. Suppose -2b - 1 = -4a - q, 5b + 4a + 2 = 0. Solve 2k = 4n, k + 5 = n - bk for n. -1 Let c = -6 + 7. Let i be 1/((-2)/(-6)) - c. Solve -3 = 5l + 3k, -2l + 3k + ik = -5 for l. 0 Let r(v) = -v*2 - 7v - 11. Let k be r(-4). Let i = -7 + 10. Solve 0 = -j + 2y - y + k, -ij + 17 = 4y for j. 3 Let f(w) = -w2 - 15w - 10. Let n be f(-14). Solve 16 = -no, 3p - 2o + 7o + 14 = 0 for p. 2 Let f = -10 + 19. Let t(x) = 2x2 + x - 1. Let u be t(1). Let i be (1 + -1)/(2/u). Solve -5y - f - 1 = -2q, i = 4q for y. -2 Let l(a) = -3a - 4. Let o be l(-8). Suppose -t - 84 = 2t. Let p = t - -46. Solve -o = 4i, -3w + 3i = -6 - p for w. 3 Suppose -2 - 2 = -2z. Solve 3m + zk = -13, -25 = 5m + 3k + k for m. -1 Let s(n) = -5n3 + n2 + n. Let o be s(-1). Solve -c - 2 = 3h, -2h - 3h - oc - 20 = 0 for h. 1 Let g = 22 - -13. Let a(f) = f - 10. Suppose -63 = -5v - 13. Let w be a(v). Solve -4o + 3x + wx = g, -5o + 3x - 40 = 0 for o. -5 Let j(i) = i2 - 5i - 2. Let l be j(5). Let o(p) = p*3 + 3p*2. Let q be o(l). Let t = q - -7. Solve -g + 3 = -3z + 2g, -z + 4g = -t for z. -5 Suppose -p - 14 = -0p - 5m, 0 = -p - 3m + 18. Solve -3r + 2z + p = 0, 4r + 3z + 6 = -3 for r. 0 Suppose 4i + 14 - 26 = 0. Solve -l - u = 3, 0l - 19 = 4l - iu for l. -4 Let j(d) = -d - 7. Suppose -3t = -a + 24, -3a = -0t - 5t - 44. Let h be j(t). Solve 21 = -y + 5x, -5y + h = -3x - 5 for y. 4 Let b be (-2)/(-9) - 16/(-9). Solve 12 = -3k - g + bg, 0 = k - 2g - 1 for k. -5 Suppose -2u + 5r + 8 = 0, 3u - 3r = -0r + 12. Let h = -5 + 3. Let v be -2 + h(-2 + 1). Solve v = y - 4y + i, 5i = uy for y. 0 Let g(x) = x*2 + 7x. Let n be g(-8). Suppose 3 - n = -m. Solve -2b + 3c - 15 = -b, -mb - 4c = -20 for b. 0 Let n(d) = 3d - 7. Let h be n(3). Solve 5i - hc - 3 = 0, -2i = 3i + 4c - 9 for i. 1 Suppose 0 = 3t - t - 5x - 40, 2x = -2t + 12. Let w(f) = -f - 5. Let v be w(0). Let z = v + 7. Solve b + 25 = -5q - 3b, 0 = 2q + zb + t for q. -5 Let m(k) = k + 1. Let t(r) = r + 2. Let c(l) = -3m(l) + 2t(l). Let d be c(-3). Solve -p - 2p - da = 16, -5p - 2a - 8 = 0 for p. 0 Suppose 3g + 0g - 6 = 0. Suppose -b + 11 = 4u, -4u + 5u = -gb + 1. Solve -uf - 4w = 21, -f + 0f + 3w = -6 for f. -3 Let t(n) = n*3 + 11n*2 - n - 2. Let i(b) = 65b + 2. Let u be i(-2). Let k be u/12 + (-2)/6. Let v be t(k). Solve 5q + 5w + v = 2w, 10 = 5w for q. -3 Let t(y) = -y*2 + 17y - 14. Let p be t(16). Solve -p = 3o - 3m + 4m, 12 = 2o + 4m for o. -2 Suppose -3d + 4m = 2m - 54, -4d = -m - 77. Let g(a) = -4a. Let o be g(-1). Suppose d = op + 4. Solve 0c - p = -3b - c, -6 = -b - 5c for b. 1 Suppose 2i = -5d + 31, i - 28 = -0d - 5d. Solve -3l + 18 = 2g + i, 3l - 15 = 5g for g. 0 Let r(b) = -b*2 - 5b + 1. Let d be r(-4). Suppose -dq - 28 = -2t - q, t = 5*q	{ "pile_set_name": "DM Mathematics" }
426x2 + 0 + (-6x + x - x)(-2 + 2 - 2x). -105x2 + 2 Expand 468 + 16p + 12p - 444 + (3 + 0 - 2)(2p - 3p + 0p) + 4p - 5p + 3p + p - 1 + 1. 30p + 24 Expand (1097 + 2377 - 2025)(1 - 2f - 1)(-f - 3 + 3). 2898f2 Expand (-3i + 2i - 2i)(4 - 3 - 4772i - 597i - 1). 16107i*2 Expand (4l - 92l - 114l)(-5 + 4 + 0)(l*2 + 2l*2 - 2l*2 + 7l*4). 1414l*5 + 202l3 Expand ((n2 + 3n - 3n)(-4 - 1 + 0) + 5 + n2 - 3 - 3)(1 + 4 - 7)(-5 - 3 + 3). -40n*2 - 10 Expand 8206o*5 - 4019o*5 - 4883o*5 + (-2o*3 + 4o*3 - 3o*3)(0o2 - o2 + 0o*2 + 5o). -695o5 - 5o*4 Expand (-2 + 7 + 2)(-3n2 + 6n*2 - 4n*2) + 24n*2 + 5n*2 + 8n*2. 30n*2 Expand 117o + 5o2 - o2 - 159o + 3 + o*2 - 3 + (-2 - 1 + 4)(2o2 + o - o) + 0o + 0o + o2 + 2o2 + o2 - o*2. 10o*2 - 42o Expand (-q + q + 2q)(-9613q2 + 18832q*2 - 8389q*2). 1660q*3 Expand (n - 2n + 3n + (-28 - 173 - 120)(2n + 0n + n) + (3n + 1 - 1)(-4 - 1 + 6))(-3n2 - n2 + 5n2). -958n*3 Expand (-3k*4 + 3k*4 - 4k*4)(60k + 30k + 24k) + 4k*3 + 45k4 - k5 - 45k4. -457k*5 + 4k*3 Expand (x + 3x + 41x)(-23x + 12x + 22x). 495x*2 Expand (37192 - 37192 + 318m)(1 + 5 - 4 + (-6 + 3 + 1)(-3 + 5 + 0)). -636m Expand 0 - 2r + 0 + (-3 + 6 - 5)(2 - r - 2) + (7 + 12 - 15)(-1 - 6 + 2r + 6). 8r - 4 Expand (2t - 2t*4 - 2t)(t + t - 8t) - 307t5 + 2t*3 + 73t*2 - 300t*5 + 605t*5. 10t*5 + 2t*3 + 73t*2 Expand q - q - 5q + (7q + 10q - q)(-1 - 7 - 2). -165q Expand t + 3t - 63316t*3 - 4t - 2471t4 + 63319t*3 + (3 - 3 - t)(-2t3 + 3t - 3t) - 2t*4 + 4t4 - t4. -2468t4 + 3t*3 Expand -17d + 8d - 28d + (d - 3 + 3)(0 + 0 + 1)(-8 + 23 - 6). -28d Expand (-18i - 46i + 92i)(0i + 3i - 6i) - 4i2 + 3i*2 + 9i*2. -76i*2 Expand (4u + 5 - 5)(155u + 3u + 32u)(2 - 2 + 5u*2). 3800u*4 Expand (2 + 3i - 2)(-13 - 18 - 6)(21i3 - 240 + 240). -2331i*4 Expand (2600g*3 - 3628g*3 + 1879g*3 + 3708g*3)(4g - g - 4g). -4559g4 Expand (-16m + 11m + 38m)(-2 + 0 + 0) + 42m - 29m + 41m + 1. -12m + 1 Expand 2t - 3 + 3 + (-13 - 14t + 13)(1 - 1 - 2) + 2t - 6 + 6 + (6 - 1 + 1)(3t + 2t - 7t). 20t Expand 7 + 6n2 - 7 + 15n*2 + 82n*2 - 8n*2 + (-2 + 4n + 2)(2n + 1 - 1). 103n2 Expand 4g - 7g + 0g + (2g + 0g - g)(-1 + 3 - 4) + (-2g + 2g - 3g + (3 - 3 + 2)(-4g + 3g + 3g) + 1 - 1 + 2g)(-12 + 14 + 9) + 0g - 4g + 3g. 27g Expand -3 + 2o5 + 3 + (0o + o + 0o)(-69o4 - 56o*4 - 29o*4) - 6o*5 + 4o5 - o5 + (o3 + o3 - o*3)(0o2 - o2 + 3o*2). -153o*5 Expand 2o*3 + 139495o - 139495o - 3o*2 + (-4o*2 - 3o*2 + 5o*2)(o + o - 4o) - 2o*3 + 6o*3 + 2o*3. 12o*3 - 3o*2 Expand -44b + 44b + b3 + (3b*2 - 3b*2 + 2b*3)(2 - 2 + 4) + 6b3 + 20b3 + b3 + 6b3 + 17 - 17. 42b*3 Expand (-2 - 2 + 2)(-5129 + 2565 + 11o + 2566 + 6o - 2o - 2o - 2 + 2 - 2o + (6o - 4o + 0o)(-2 + 2 - 1) - o - 3o + 7o). -24o - 4 Expand (0f2 - 2f*2 - 4f*2 + (-5f + 3f + 3f)(3f + 0f - f))(0 - 1 + 3)(3 + 76 - 71 - 487). 3832f2 Expand -r3 - 1 + 1 + (0r + 0r - r*2)(4r + 3r - 5r) - 1 - r3 + 1 + 11r - 11r - 2r*3 - 8 + 20r*3 + 8. 14r*3 Expand (-37y*3 - 13y*3 - 11y*3)(0 + 7 - 3)(3 + 2 - 3)(6y + 25 - 25). -2928y*4 Expand (-11 - 14r + 11)(3r - 47r - 96r). 1960r2 Expand ((0 - 3 + 1)(978 - 307s - 978) - 1 - 2s + 1)(4s - s + 3s). 3672s*2 Expand (-1 - 2 + 2)((4f + 0f - f)(0 - 2 + 0) + (0f - f - f)(-15 + 12 - 58) + 0 + 2f + 0 - 2f - 2f - f). -113f Expand 126m*2 - 126m*2 + 39m*4 + (-m + m + m)(-3m3 + 3m3 - m3) - 5m4 + 6m*4 - 3m*4 + (1 + 2 - 5)(m4 + m4 - 4m4). 40m*4 Expand (-3y2 + y2 + y*2)(-47 - 39 + 136 + 1729y - 50). -1729y*3 Expand (-4f + 0f + 6f)(-2f + 0f + 5f)(-35f + 139 - 139) + (-6f - 3f + 0f)(2f2 + f2 - f2). -228f*3 Expand (5 - 1 + 6)(0 - 1 - 3)(29a - 32a + 15a). -480a Expand (4 - 2 - 1)((-4 - 1 + 3)(-2y5 + y5 + 0y5) - 3y*2 + 2y*5 + 3y*2 - 2y + 2y5 + 2y - 2y5 + 0y*5 + 3y*5). 7y*5 Expand (2a + 0a - 4a)((-14 + 8 + 1)(-5a - a + 3a) + 928a - 129a - 374a + 1). -880a*2 - 2a Expand -4i + 4i + 5i2 + (-2i + 2i - 2i)(0i + 3i - i) + (-18 + 45i + 18)(-3i - 7i + 4i). -269i2 Expand (2j + 0 + 0)(j - 3 + 3) + j - j2 - j - 420j*2 - 423j*2 + 872j*2 + 1 + 9j - 2j2 - 9j. 28j2 + 1 Expand (2n + 0n - n)(-3n + n2 - 205 + 136 - 30)(-n - n + 0n). -2n*4 + 6n*3 + 198n2 Expand (-4 + 4 + z3)(17z*2 - 170z*2 - 261z*2). -414z*5 Expand (492l*2 - 4 - 1112l*2 + 540l*2)(3l - 5l + 0l)(3 - 2 - 2). -160l3 - 8l Expand (5 - 8d - 14 + 10)(-15 - 21 + 0)(d4 - 6d4 + d3 + 3d4). -576d*5 + 360d*4 - 36d*3 Expand -4j + 4j - j + 3 - 3 + 2j - 3j + 3j - j + (0j + 0j + j)(3 - 4 - 1) + 2 - 2 - 2j + 6 - 6 + 10j + (1 - 5 + 3)(-2 + 2 - 7)(-2j + j + 8 + 1). -j + 63 Expand (0z + 2z + 0z)((-7 + 3 + 3)(-2 + 3 + 0) - 4 + 5 + 1)(-1 + 1 + z) + 43z - 21z*2 - 43z. -19z2 Expand (5447 - 5447 + 67m*3)(32m2 - 7m*2 + 18m*2). 2881m*5 Expand -2210v2 - v3 + 80 + 2210v2 + (-4v + 48v + 0v)(4v*2 - 5v*2 + 3v*2). 87v*3 + 80 Expand (0f + 2f + 0f)(-159f - 102f - 52f)(6f - 2f - 5f). 626f3 Expand (0n*3 + 3n3 - n3)((-40 - 35 - 7)(1 + n*2 - 1) + (1 - 2 - 3)(n*2 + 0n + 0n)). -172n5 Expand (-o4 + 4o4 + 0o*4)((0 + 4 - 2)(-1 + 3 + 7) + (-1 - 3 + 3)(-2 + 2 - 1) + 31 - 7 + 80). 369o4 Expand (2 + 10n - 2)((3 - 4 - 2)(-3 + 3 - 1) + 0 + 3 + 2)(-5 - 2 - 4)(-4 + 1 + 2). 880n Expand (4a*4 - 2a4 - a4)(-403a - 770a - 442a)(2 + 0 - 4). 3230a*5 Expand -119x*4 - 7x*4 + 1088x*4 + (3x*3 - 2x*3 - 2x*3)(x + x - x) - 2x4 + 5 - 5 - 3x*4 + 2x4 - x4 - 3x4 + 4x*4 - 2x*4. 956x*4 Expand (u + 2u - u)(0 - 1 - 2)(77u - 77u + 11u2) - 3u*3 + 3u*3 - 2u*3. -68u*3 Expand (-110 - 68 + 366 + (8 + 7 + 0)(1 + 0 + 1))(-4m + 0m + 2m). -436m Expand ((-1 - 1 + 1)(2 - 2 - y) + y - 3y - 2y)(1 - 1 - 1)(-85y + 412 - 87y + 173y). 3y*2 + 1236y Expand (t*3 + 2t*3 - 10t + 8t)(-12 - 12t + 12) + (-t2 - 2t*2 + 0t*2)(t - t + t*2). -39t*4 + 24t*2 Expand (-120 + 583 - 63 + 199 + 141)(-3n + n + 5n). 2220n Expand (-679x - 4325354 + 4325354)(0 + 4 + 2). -4074x Expand (-2h - 3 + 3)(4h - h2 - 4h)(8 + 21 - 14) + (2h*2 - 3h*2 + 0h*2)(-10h + 3h - 18h). 55h*3 Expand (0q*2 - 3q*2 + 2q*2)(2 + 0 - 4) + 51797q - 51797q - 1985q2. -1983q*2 Expand 149j*3 + 172j*3 + 35j3 + 0 + j3 + 0 + (3j - 3j + 2j)(j*2 + 3j*2 - 5j*2) + 6j*3 - 4j*3 + 0j*3 + 4 - 4 - 2j*3. 355j*3 Expand (-1 + 2 + 2)(-2331 + 871 + 813)(-7l + 12 - 12 - l). 15528l Expand (-163 - 53 - 88)(-t + 0t + 2t + (2t - 2t + t)(1 - 2 - 1) + 2t + 0t - 4t). 912t Expand -q5 - q4 + 2q*5 - 5q*5 + (-2q*3 - q + q)(0q2 - 2q*2 + 3q*2) - 16q*2 + 17q2 - q5 - 12q5. -19q5 - q4 + q*2 Expand (6 - 4 - 1)(-6 - 4 - 13)(1 + 265h - 262h + 0). -69h - 23 Expand (4p + p + 2p)((5 + 0 - 2)(-4 + 3 - 1) + 24 + 24 - 15)(4p*2 - 4p*2 - 2p*2). -378p*3 Expand 82v*4 + 28v*5 + 28 - 26v*5 - 3v*5 + (-v + 2 - 2)(4v4 + 4v*4 - 6v*4). -3v*5 + 82v*4 + 28 Expand (-3z + z + 5z)(16 + 67 - 149). -198z Expand (8q + 0q - 17q)(-11 - 3 + 29)(-3 + 5 - 4). 270q Expand (-49p*4 - 48p*4 + 81p*4)(p - 2 + 2) + 5p5 - 16 + 16 + 18p*2 - 5p*2 - 8p*2 + 2p*5 + 0p + 0p - p5 + (1 - p4 - 1)(2p - 2p + p). -11p5 + 5p*2 Expand (7 - 5 - 9)(-3 - 1 + 6)(-53k*5 - 105k*5 + 63k*5). 1330k*5 Expand (-5q*2 + 3q*2 - 6q*2)(-3q3 + 7q*3 - 2q*3 + (-2q - 1 + 1)(-3q*2 + 5q*2 - 3q*2) + 5q*3 - 2q*3 + 0q*3 + 1 - 3q*3 - 1). -32q*5 Expand (0p - 3p + 2p)(-1 + 3p - 1 - 5p)(3p - 4p*3 - 3p) - 37p4 + 373 - 373 - 3p*5. -11p*5 - 45p*4 Expand (7 - 1 + 11)(2d - 3d + 3d)(115 - 117 + 55). 1802d Expand (7491y - 11936y - 10935y)*(y	{ "pile_set_name": "DM Mathematics" }
/(sqrt(24)/sqrt(4)-6))2 - (-1sqrt(66)/sqrt(3))/(sqrt(528)/sqrt(3)). 1/18 + sqrt(2)/4 Simplify ((sqrt(120)/sqrt(3))/sqrt(4))/(2sqrt(20)) + ((-6-3sqrt(200))/sqrt(4))2. sqrt(2)/4 + 16200 Simplify ((1 + -3 + 5 + 4-1sqrt(1331))-3)*2-4. -766980 + 9504sqrt(11) Simplify (-25(sqrt(975)-1 + sqrt(975)))/(-6sqrt(30)/(1sqrt(10))5). 0 Simplify -1(2 + (sqrt(175) - 6(0 + sqrt(175)))) + (1 + (sqrt(175) + 0 - sqrt(175)) + 2 + (sqrt(175) + -1)2)-1. -181 + 35sqrt(7) Simplify ((-5sqrt(374)-6)/sqrt(11))/(sqrt(200)-3-5). sqrt(17)/5 Simplify (((2 + sqrt(208))-3 - 5(sqrt(13) + -2(-2sqrt(13))2)) + 2 + 4)4 + 2. -68sqrt(13) + 2082 Simplify 1(5 + (sqrt(15)/(sqrt(12)/(sqrt(16) + sqrt(4))) + 2)13 + 5). 16 + 9sqrt(5) Simplify (((sqrt(300) - sqrt(300)-2)-2 - sqrt(300))/(sqrt(120)/sqrt(90)))/(sqrt(45)/(sqrt(72)/(sqrt(24)/sqrt(3)))4). -21sqrt(5)/4 Simplify -1 + -3 + (2 + 2 + (sqrt(363) - (0 + sqrt(363)) - sqrt(363)) - (-3 + (sqrt(363) + (sqrt(363) + 1sqrt(363) - sqrt(363)) + -1)*2)). -1450 + 33sqrt(3) Simplify (0 + (2 + (sqrt(11) - sqrt(77)/sqrt(7)) - sqrt(11)) - (-4sqrt(88)-3)/sqrt(8)) + 3. -13sqrt(11) + 5 Simplify ((sqrt(297)2)/sqrt(9) - (sqrt(396)/(sqrt(12) + (sqrt(96)/sqrt(8) - sqrt(12))) - sqrt(33)))/(3sqrt(3)3 + 6-4sqrt(3)). -2sqrt(11)/15 Simplify -1 + (-3 + sqrt(117) + -5)-3 + (1 + sqrt(468) + (sqrt(1053) - (sqrt(1053) + (sqrt(1053) - (1 + sqrt(1053))))))*26 + -1. 135sqrt(13) + 2854 Simplify ((sqrt(539) + -1 - sqrt(539)-3)6)2 + -5 + (4-5(-1 + sqrt(1331)))2. -10816sqrt(11) + 843295 Simplify (((sqrt(320) + 2 - sqrt(320)) + -3 - sqrt(320))*2 + (-1sqrt(10))/sqrt(2)-2 + 5)-4. -1304 - 72sqrt(5) Simplify 6((2sqrt(38)-3)/(sqrt(2) + 2sqrt(98)) + 445(sqrt(95)/sqrt(5) + sqrt(19)))*2. 72595656/25 Simplify -3(-3(sqrt(5) + 1 + 2 + -5) - ((sqrt(50) + sqrt(200) + sqrt(50))1)/((sqrt(250)2 - sqrt(250)) + sqrt(250) - sqrt(250)))22. -3246/5 + 1368sqrt(5)/5 Simplify (sqrt(63) - -1sqrt(2268))/(-2sqrt(1296) - sqrt(1296)) + 4 + ((sqrt(308)/(sqrt(11)-2))/(sqrt(100)-1))2. -7sqrt(7)/36 + 407/100 Simplify (-1 + -4 + (sqrt(833) - sqrt(833)3))2 + (-2(sqrt(833) - ((6-1sqrt(833) + sqrt(833) - sqrt(833)) + sqrt(833))))*2 + 5. 140sqrt(17) + 123314 Simplify (14(1sqrt(400) + sqrt(400)))/(-6(sqrt(800) + -1sqrt(800) - sqrt(50))). 8sqrt(2)/3 Simplify (-1(-1 + sqrt(396)) + (sqrt(396) - (-1 + -4sqrt(396) - sqrt(396) - sqrt(396) - sqrt(396)))*2 - -4(-2 + 4 + -2sqrt(396)))-2. -50708 - 84sqrt(11) Simplify -6((3 + sqrt(304)-2)2 - (1sqrt(304) + -3)3)*24 + 2. -362902 + 20160sqrt(19) Simplify -64((1sqrt(891)-3)2 - sqrt(891)) - (2 + 2sqrt(275)1)25. -197976 + 16sqrt(11) Simplify 4 + (1sqrt(119)-1 + 5-1sqrt(119))/((sqrt(28) - sqrt(112)/(sqrt(4)4))/sqrt(4)). -8sqrt(17) + 4 Simplify (-5((2sqrt(65)2)/(sqrt(45)-2 - sqrt(5)) + (sqrt(26)/sqrt(2) + 1 + 1)1))*2. 300sqrt(13)/7 + 7825/49 Simplify -3 + -1((-1 + -2 + -1sqrt(13))*2 + (sqrt(1872) + 4)-3). -13 + 30sqrt(13) Simplify ((0 + -13(0 + sqrt(32)2) + 5)-6)2. -8640sqrt(2) + 42372 Simplify (12sqrt(567)23 + (2 + sqrt(567) + 0)-15)*2 + -3. -1260sqrt(7) + 27880 Simplify 5(-5 + (2 + -3 + -4 + sqrt(200)-1 - (-4(1 + sqrt(200))4 + 3)))*2. 4500sqrt(2) + 225045 Simplify (0 + sqrt(26)/(sqrt(20)/(sqrt(10) + sqrt(50)/sqrt(5))) + (sqrt(325) - (-5 + (sqrt(325) - sqrt(325)-4))) + -1)2. -144sqrt(13) + 4228 Simplify (sqrt(76) + 2sqrt(76)2 - (1sqrt(76) - sqrt(76))-5)/(sqrt(8)/(2-5sqrt(2))). -50sqrt(19) Simplify 4-1(-4(sqrt(343) - -1sqrt(343)-3))*24. -351232 Simplify 6((sqrt(1275) + 3sqrt(1275))-1)/(((2sqrt(108))/sqrt(12))/sqrt(3)). -60sqrt(17) Simplify (2 + -1sqrt(468)-55 + 0 + -6sqrt(468)-2 + -4 + -1)*2. -1332sqrt(13) + 640701 Simplify (-6sqrt(208) + -5)2-1 + (sqrt(104)/sqrt(968) - sqrt(13) - (sqrt(13) + sqrt(52)/(sqrt(4) + sqrt(24)/sqrt(6)))). -7513 - 5333sqrt(13)/22 Simplify (sqrt(91)/(sqrt(77)/sqrt(99)) + (sqrt(1872)2 - sqrt(1053)-2) + 3 + (-5sqrt(91)1)/((-2sqrt(56))/sqrt(8)))*2. 285sqrt(13) + 117361/4 Simplify (-2 + -2(sqrt(1539) + 0) + 2 + (-2sqrt(1539) - sqrt(1539) - sqrt(1539)) + -4(-2 + sqrt(1539)) + 1)262. -19440sqrt(19) + 1847772 Simplify ((6(sqrt(72) - -2sqrt(72)))/((sqrt(726)-1 + sqrt(726) - sqrt(726)) + sqrt(726) + sqrt(726)))/((sqrt(100) + sqrt(100)24)4). sqrt(3)/110 Simplify (54((sqrt(130) - 5sqrt(130))-5 - sqrt(130) - sqrt(130)))/(sqrt(640)-1 + sqrt(10) + (sqrt(60)5)/sqrt(6) + sqrt(10)). -360sqrt(13) Simplify (4 + ((sqrt(1584) - (-1 + 0 + sqrt(1584))) + -2sqrt(1584)2 - (0 + sqrt(1584)2 + sqrt(1584) + -4)))*2. -1512sqrt(11) + 77697 Simplify 5 + -3((sqrt(77) + sqrt(77) + 2sqrt(77) + sqrt(77))-4 - sqrt(77))/sqrt(7) + (sqrt(99)/sqrt(3)-1)/(sqrt(3) - 2sqrt(3)-1)-3. 5 + 64sqrt(11) Simplify ((-3 + sqrt(605)2)-6-2)2 + (1sqrt(125) + -1 - (sqrt(125) - (sqrt(125) + -1 + -1))*2)2. -18998sqrt(5) + 349766 Simplify 4 + (41sqrt(156) - sqrt(156) - (sqrt(156) + 1sqrt(156))-2)/(sqrt(48)/(3sqrt(4)2)) + 2. 6 + 42sqrt(13) Simplify ((sqrt(2736) + 2 + 0)2 + sqrt(2736) - (-4 + sqrt(2736) + (sqrt(2736) + 2 - sqrt(2736)))2) + 2(sqrt(2736) - -6(sqrt(2736)4 + sqrt(2736)))2. 108sqrt(19) + 5258592 Simplify 3(6-2sqrt(76))/sqrt(4) - (1(sqrt(304) + -1 - sqrt(304)))*2-6. -36sqrt(19) + 6 Simplify -1((sqrt(847) + 1(-1 + sqrt(847)) + sqrt(847))1 + (sqrt(847) + (sqrt(847) - (1 + sqrt(847) - sqrt(847))) + sqrt(847))5-3)*22. -2988608 + 25872sqrt(7) Simplify (-2 + 5(-1 + -11(sqrt(45) + 1)-6 + -3))2. 1440sqrt(5) + 40564 Simplify -1 + 1(((sqrt(405) - (sqrt(405) + (sqrt(405) + sqrt(405) + 0)-1)) + 2)*2 - ((-2sqrt(405)1)2 + 3)) + -1. -1 + 72sqrt(5) Simplify (1 + -4 + sqrt(243) + 1 + 4 + sqrt(243) + (sqrt(243) + -2sqrt(243) - sqrt(243)) + 0 + ((1 + sqrt(243))5 - sqrt(243))*2)3. 1080sqrt(3) + 11745 Simplify -2((-1(sqrt(65)2 + sqrt(65)) - sqrt(65))/sqrt(5) - (2 + sqrt(1573) + 3 + sqrt(1573)))-5. -260sqrt(13) - 50 Simplify ((5sqrt(78)2 - (-3sqrt(78)2 - sqrt(78)))/(sqrt(12)/sqrt(2)-1 - sqrt(54)1))*2. 3757/16 Simplify 6((-6(sqrt(110) - sqrt(110)-22))/(sqrt(1440)2 - sqrt(80)/(sqrt(8) + sqrt(128))) + -4 + -2). -36 - 900sqrt(11)/119 Simplify (sqrt(256) - ((sqrt(256) - sqrt(256)3) + sqrt(256)) - sqrt(576)2)/(-3-1sqrt(72)-3)-4. -16sqrt(2)/27 Simplify ((sqrt(132) + sqrt(132) + 2sqrt(132)4)/(6sqrt(11)-1))/(((sqrt(40) - (sqrt(40) + sqrt(2560)2)) + sqrt(40) + sqrt(40))/(sqrt(40)-2)). -10sqrt(3)/21 Simplify (2(sqrt(931) - (sqrt(931) + -2))-3)2 - ((-2 + sqrt(1216) - (2 + sqrt(475))) + 1). -3sqrt(19) + 147 Simplify -5(2 + (1sqrt(3) - sqrt(3))) - -2(sqrt(3) - (-5 + sqrt(12)/sqrt(4))) - (1sqrt(36))/(-5sqrt(6)/sqrt(2)). 2sqrt(3)/5 Simplify (sqrt(294) - ((34sqrt(294) - sqrt(294) - sqrt(294)) + sqrt(294) + sqrt(294) - sqrt(294)))/((sqrt(10) - sqrt(50)/sqrt(605))/sqrt(5)). -77sqrt(3) Simplify (-5 + sqrt(50)-3 + -4 + sqrt(50)-1 - (-6-1sqrt(450) + 5))2. 3080sqrt(2) + 24396 Simplify (sqrt(1088) + -2)1 + 4 + 4(sqrt(1088) - (sqrt(1088) + 2 + sqrt(1088))*2) + (-5(0 + sqrt(1088)) - sqrt(1088)). -17422 - 264sqrt(17) Simplify (-1sqrt(104)145)/(12(-1sqrt(968) + sqrt(8))). sqrt(13) Simplify (((sqrt(198) + (sqrt(198) - sqrt(198)2) + sqrt(198) - sqrt(198))-6)/(sqrt(9)2-6))/(sqrt(98)-2 - sqrt(2) - sqrt(98)3) + 2. 2 Simplify (3 + sqrt(1331) + -3 + sqrt(1331))*2-3 + -4 - -6((-2 + sqrt(1331))6 + 5)*2. -5544sqrt(11) + 271814 Simplify 1((-1 + 5 + 2sqrt(108) + (0 + sqrt(108) + 0 - sqrt(108)) + sqrt(108) + (sqrt(108) - (1 + sqrt(108)))6)2 + 0). -72sqrt(3) + 976 Simplify (-5-1sqrt(153))/(sqrt(729)-1 - sqrt(9)) - (-1(sqrt(153) - (sqrt(153) + 0 + sqrt(153))*2-3) + 1). 5sqrt(17)/2 + 1835 Simplify (1 + (0 + (sqrt(704) - (sqrt(704) - sqrt(704)3) - sqrt(11)) + sqrt(11) - (-3 + sqrt(11) + -1 - sqrt(132)/(sqrt(36)/sqrt(3))))*2)-6. -38118 - 1152sqrt(11) Simplify (4(sqrt(363) + 3) + (4 + sqrt(363) + 5)*2)3-5 + -2. -6842 - 3630sqrt(3) Simplify -66((sqrt(7)-1)2 + -1 + (sqrt(63))25 - (sqrt(7) + -2 + 1 - (-1 + sqrt(7) + 5))). -11736 Simplify (-4 + 2sqrt(2448) + -1)-6 - (3 + sqrt(17)-1 + 2 + sqrt(17)-2 + -5 + -2). -141sqrt(17) + 32 Simplify -3 + (-1((-5*(sqrt	{ "pile_set_name": "DM Mathematics" }
(-2) a composite number? True Let j = -74 - 90. Is ((-45)/(-18))/((-2)/j) a composite number? True Let j = 3421 - 2424. Is j composite? False Is (4/16)/(3/1236) a prime number? True Let j(h) be the first derivative of 39h2 + 7h + 1. Let a(t) = -78t - 6. Let n(u) = -6a(u) - 5j(u). Is n(1) a prime number? True Suppose -3h + 1751 = -4m, -5h + 5m = -h - 2334. Is h a composite number? True Let u(t) = -36t*2 - 3t - 3. Let v be u(-3). Let r = 875 + v. Is r composite? False Let t = 287 + -102. Is t a composite number? True Let k = 13 + -8. Suppose -4f + 3f + 4z - k = 0, z - 14 = -4f. Suppose -14 = 2c - 5i, 0 = fc - 6c + 2i + 1. Is c a prime number? True Let u(d) = 4d - 7. Let w(h) = 9h + 9h - 20 - 6h. Let g(s) = 11u(s) - 4w(s). Is g(-3) prime? False Suppose 4l + 2x - 622 = 0, 4 = -4x - 0. Let q = 641 - l. Is q a composite number? True Let k(q) = -2q + 3. Let b be k(-3). Let v = b - -5. Is v composite? True Let a(w) = 10w - 3. Suppose -2i - 4 = -4f, 16 = 3i + 2f + 6. Let j be (i - -5)(-3)/(-3). Is a(j) composite? False Is 1(3 + 33) + 2 a composite number? True Is 412 + ((-26)/8 - (-17)/68) composite? False Suppose 1063 = 5q - 2f, -6q + 4q + 4f = -438. Is q a prime number? True Let x(p) = 4p*2 + 7p + 9. Is x(-6) a composite number? True Suppose -19 = -5c + 6. Suppose -3l - 209 = cw, -171 = 5w + 2l + 40. Let b = w - -64. Is b a composite number? True Let p(x) = -351x - 13. Let q(g) = 88g + 3. Let t(z) = -2p(z) - 9q(z). Is t(-1) a composite number? False Let d = 497 - 306. Is d a composite number? False Let p = -45 - 1. Let k = p + 7. Is k/(-2)(-10)/(-3) prime? False Suppose 0 = 2c + 2c + s - 1471, 2s - 1107 = -3c. Is c a prime number? True Suppose -216 = -4c + 488. Suppose -133 = -d - 4a, -31 = d + a - c. Is d a composite number? False Let c be 3/(-2) - (-62)/(-4). Let d = c - -24. Is d prime? True Let h be (-9624)/(-66) + (-2)/(-11). Let y = 273 + h. Is y a prime number? True Let c be (-45)/5 + 21. Let t = -2 - c. Suppose -319 = -tq + 4v + 438, -v = q - 146. Is q a prime number? True Is (-3 + 2/4)-74 a composite number? True Let r(s) = -s*3 + 2s - 3. Suppose 3m = -m - 16, -b - 2m = 13. Let q be r(b). Let p = -61 + q. Is p a prime number? False Let k(i) = -10i. Let u be k(-1). Suppose 4h - u = 2z, -1 = 5z + h + 24. Let q(o) = o*3 + 6o*2 - 4o + 1. Is q(z) a prime number? False Let j(i) = -i2 + i + 145. Is j(0) a prime number? False Let h(a) = a2 - a - 8. Let j be h(0). Is j(-3 - 1) - 1 a composite number? False Suppose -2h + 2 = 3w + 4, -4w - 4 = 2h. Let m = w - -2. Suppose m = -4u + 3u + 77. Is u prime? False Let o(q) = -8q*3 + 2q*2 - 6q - 1. Is o(-3) a composite number? False Is (-19)/(-38)(2 + 64) prime? False Let d(n) = 1 + 4n*3 + 2n*2 + 4n*2 - 4n*2 + 4n. Is d(3) prime? True Suppose -23686 - 12258 = -8r. Is r a composite number? False Let g be (-48)/(-18) + 2/(-3). Let c(v) = -v3 - 6v*2 - 6v - 2. Let p be c(-5). Suppose gy - 2s + 52 = 6y, py + 4s = 34. Is y a prime number? False Let t = -5 - -13. Suppose -3p + 10 = -tp. Is (14/(-6))/(p/30) a composite number? True Suppose -g = 2w - w - 10, 4g - 4w = 0. Suppose -657 - 958 = -gy. Is y a composite number? True Suppose -3g + 9 = 3. Suppose -gx = -15 - 65. Let q = -9 + x. Is q a composite number? False Let g = 5 - 5. Suppose gu - 24 = 3u. Is (1 + -20)/(4/u) composite? True Let a(r) = -6r*2 - 4r + 4r + 97r*2. Is a(1) a prime number? False Let l = -9 + 9. Suppose -3c + lc = -5x + 883, 0 = -3x + 2c + 529. Is x a composite number? False Suppose -2i - 3i + 10 = 0. Suppose 3r + 24 = -il + 3l, -4l + 5r = -75. Is l composite? True Let l be 8/36 - 637/(-9). Let d = 129 - l. Let q = d - 21. Is q a prime number? True Suppose 0 = -4t + 9 + 3. Suppose 0i = -2i, tk - 381 = -3i. Is k a prime number? True Is (-67551)/(-77) - 4/14 a composite number? False Suppose 4d + d = 25. Let n(x) = 19x - 11. Let u(h) = -28h + 17. Let k(g) = du(g) + 7n(g). Is k(-9) composite? False Let f(t) = 28t*3 - 2t*2 + 1. Suppose 3 = l + 2. Let p be f(l). Suppose 3x = q + p, -5x + 25 = -q - 22. Is x a composite number? True Let f(j) = -j3 - 5j + 1. Is f(-6) a composite number? True Let u(q) = 5q2 - 32q - 23. Let c(a) = -3a2 + 21a + 15. Let i(v) = -8c(v) - 5u(v). Let b be i(-6). Let p(t) = 18t - 7. Is p(b) a prime number? False Let j(t) = -t3 - 4t*2 + 10t - 3. Let i be j(-7). Suppose 0 = -c + 3c - i. Is c composite? False Suppose -6p - 1714 - 2294 = 0. Let r = p - -1183. Is r a prime number? False Let l(h) = -221h + 2. Is l(-1) a composite number? False Let p(u) = -u2 + u + 17. Let o be p(0). Let h = o - 2. Is h a prime number? False Suppose 0 = 4d + 4b - 1228, -5d + 0b + 1535 = -3b. Is d prime? True Let j(p) = -293p + 2. Let d = 12 - 13. Is j(d) prime? False Suppose 2h + 2i = 3i + 219, 4i = h - 113. Let u be (-370)/6 + (-1)/3. Let v = u + h. Is v composite? False Suppose -9o + 4336 = -5051. Is o composite? True Let g(c) = -9c - 39. Let p(y) = -5y - 19. Let o(m) = -4g(m) + 9p(m). Let d be o(12). Let w = d + 286. Is w a prime number? True Suppose -5q = -15 - 5. Suppose -qf - 4 = 8, 4x + f = 121. Is x a composite number? False Let x(t) = t3 - 5t*2 - 9t - 6. Let r be x(7). Let a(y) = y*3 - y + 44. Let m be a(0). Let c = m - r. Is c composite? True Let b be ((-4)/8)/((-2)/28). Is b3/(3/29) composite? True Is (-1 - (-1454)/8)88/33 a prime number? False Suppose 0 = z - 0z - 2705. Is z prime? False Suppose -3t = -3m - 657, 2t + t - 657 = 5m. Let z(j) = -11j - 13. Let c be z(12). Let r = t + c. Is r a composite number? True Suppose -5l = -l. Let n = l + 2. Is -2 - (n - 63)1 composite? False Suppose -4y + 275 = 3i, -5i + 324 + 81 = -4y. Is i a prime number? False Let v = -2 + 4. Suppose -vl + l = -211. Is l a prime number? True Suppose -3u - 5d + 16 = -7, -4u - 3d = -16. Is 0 - (-48 + (2 - u)) composite? False Let p(k) be the first derivative of -k*4/4 - 4k*3/3 - k + 2. Let r be p(-4). Is (r/3)/((-1)/201) a prime number? True Let k be (1 - 0)/((-2)/(-12)). Suppose -3g = -k - 3, -2l = -g - 1. Suppose -207 = lu - 5u. Is u composite? True Suppose -1 - 14 = -3m. Suppose mp + 4y - 772 = p, -3p + 5y = -563. Is p prime? True Let s(v) = -v3 + v2 + 133. Let l = -13 + 13. Is s(l) prime? False Let j(t) = -1 + 0t - 2 + 2t + 6. Let g be j(6). Suppose 0 = -3d - g, 0l = -l - 2d + 121. Is l a prime number? True Let v = 21 + 3. Suppose -3r + 6 = -v. Is r prime? False Let h = 526 + -135. Is h prime? False Let x be ((-2)/(-6))/(6/5634). Let c = x + -108. Is c prime? False Is (2 + 1)790 + 4/4 composite? False Let h = 12 + -5. Is (-108 - -1)(-10 + h) a prime number? False Suppose -7s - 4 = -9s. Suppose -s = h - 0. Is ((-2)/4)/(h/276) composite? True Suppose 0 = 3p + 2p - 4b - 8659, 0 = -2b + 8. Is p composite? True Suppose -845 = -3d - 4t - 207, 5d - 1067 = -3t. Is d prime? False Let g = -5 - -5. Suppose g = -5f + 2y, -3f + 4y - 24 = -5f. Is (f/(-6))/(2/(-222)) a prime number? True Suppose -i = 2m - 28, -i - 2m - 32 = -3i. Let k be (-4)/(-2) - i/(-5). Suppose -2h + kh = 124. Is h prime? True Suppose -2n - 4b - 2 - 14 = 0, 5n + 34 = -4b. Is (1/2)/(n/(-228)) prime? True Suppose -f + 5f - 80 = 0. Suppose -2q + f = 3q. Suppose 0 = -qx + 3v + 358, -2x + 178 = -6v + 4v. Is x prime? False Let p = 795 - -266. Is p a composite number? False Suppose 6o - 3s - 460 = 2o, 5o - s = 586. Suppose -2u + 180 = -o. Is u a composite number? False Let t(x) = -66x - 19. Is t(-5) composite? False Let o be 1 - (1062 + -3)/(-1). Suppose o = 2n + 2h, 3h + 1040 = -0n + 2n. Is (n/(-4))/(4/(-8)) a prime number? True Let s(h) = 4h*3 - 3h*2. Let p be s(2). Suppose -4g + 81 = 5x, -4x = 2g - x - 41. Suppose p = m - g. Is m prime? False Suppose -a - 3l + 3 = 0, 0 = -a + 5l - l + 31. Suppose -k + a = 2k. Let x(i) = i*3 - 3i*2 - 5i - 4. Is x(k) a prime number? False Is (2/1)/((-1)/(5644/(-8))) a prime number? False Let m = 74 - 36. Let h = 84 - m. Is h a composite number? True Suppose -4k - l + 1063 = 0, 5l - 4 = -29. Is k a prime number? False Suppose 0 = -4x - 5a + 28943, 5a + 28950 = 4x + 3*a.	{ "pile_set_name": "DM Mathematics" }
Let t(j) = -11j3 + 1 + 2j*2 + 16j*3 - 2j + 2j2 - 2j2. Determine t(1). 6 Let u(n) = n2 + 8n + 3. Suppose 0 = g + 5w - 3, 0w = -3g + 5w - 31. Give u(g). -4 Suppose 3q - 4 = 8. Suppose -qa + 2a = -16. Suppose -l = -5g - 10, -4l + a = -5g - 2. Let f(r) = -2r*3 - 4r*2 - 3r - 2. Give f(g). 4 Let r(g) be the first derivative of -g*4/4 - 4g*3/3 + 3g*2 + 6g - 15. Calculate r(-5). 1 Let h(z) = z*3 + 3z*2 - 8z - 4. Let f(v) = 7 - 2v - 1 - 3. Let y be f(4). What is h(y)? -14 Let z(x) = x. Let w(n) = n - 6. Let i be w(5). Let v(c) = -3c + 3. Let b(j) = iv(j) - 2z(j). Let q = -5 - -5. Determine b(q). -3 Let d(s) = s*3 + 2s2 + s - 5. Let q(x) = -x2 - 1. Let u(v) = d(v) + q(v). Determine u(0). -6 Let i(u) = -5u2 + u - 1. Let w be i(-1). Let o(d) = d2 + 4d - 7. Give o(w). 14 Suppose 0 = j + 3o - 4, j - 5j + 16 = 4o. Let p(g) = g2 - 2g - 3. Let c be p(j). Let r(d) = -d*2 + 7d - 5. Give r(c). 5 Suppose 3a = 5a + 2d - 8, 4a = -d + 10. Let c(n) = n2 - 1 + n2 + an2 + n. Suppose -5j = -1 - 4. Give c(j). 4 Let a(v) = v*3 + 2v2 + 1. Let z(x) be the first derivative of -x4 - 3x3 - x2/2 - 4x + 8. Let f(c) = 9a(c) + 2z(c). Give f(-2). -3 Let v(w) be the second derivative of w*5/20 + 5w*4/12 - 4w*3/3 - 4w*2 - 8w. Let x = -11 + 5. Determine v(x). 4 Let v be 3/(6(-4)/40). Let m(l) = l3 + 4l*2 - 2l + 6. Calculate m(v). -9 Let g(s) = s + 4. Let y be ((-117)/(-13))/(6/(-4)). Give g(y). -2 Let q be (0 - -2)(-1 + 2). Suppose 0 = -a, s - 3a = -qs. Let b(u) = -u + 1. Give b(s). 1 Let k(x) = -3x*3 + 23x*2 - 4x. Let q(h) = 2h3 - 15h*2 + 3h. Let y be -24(2 + 21/(-9)). Let b(w) = yq(w) + 5k(w). Determine b(3). -6 Let x(h) = 6h3 + h2 - 2h + 1. Suppose 0o + 2i - 3 = o, 6 = 2o - i. Suppose -oq + 3 + 2 = 0. Calculate x(q). 6 Let t(q) = -2q + 18. Let g be t(8). Let h(j) be the first derivative of -j4/4 - j2 + 2j - 1. What is h(g)? -10 Let x(w) = 3w*3 + 10w*2 - 10w + 8. Let m(i) = -4i3 - 11i*2 + 11i - 9. Let l(j) = -2m(j) - 3x(j). Give l(-9). 3 Suppose -14o + 6 = -13o - q, 0 = o - 5q - 6. Let p(h) = -h2 + 6h + 7. Determine p(o). 7 Let k(j) = j*2 + j + 4. Let w = 1 + -3. Suppose 5 = -0r + 3r + q, -4q = 3r - 11. Let p be w + (-1 - (-1 + r)). Calculate k(p). 10 Let h(o) be the first derivative of o4/4 - 5o*3/3 - 5o*2/2 - 3o + 2. Suppose -2 = b + 4z, 0z + z + 14 = 2b. Give h(b). 3 Let r(x) be the third derivative of -x6/120 - x5/15 + 2x*3/3 - 2x2. Let j = 5 + -4. Let t be (-3 - 2) + (j - 0). Calculate r(t). 4 Let k = -56 + 56. Let f(w) be the third derivative of -w6/120 - w*5/60 + 2w*3/3 + 2w2. Calculate f(k). 4 Let s(n) = n3 - 3n2 - 3n + 3. Let c(m) = m2 + m - 1. Let l be c(-3). Let d(b) = b3 - 6b2 + 5b + 3. Let x be d(l). Determine s(x). -6 Suppose -2m + 1 + 5 = 0. Suppose -i - b = 3b + 18, -mi + b = 2. Let p(a) = -5a + 1. Calculate p(i). 11 Let d(o) = -3o + 0 + 10o + o*2 + 3. Let u = 40 + -19. Suppose -m = 4i + 18, -i = -4m - 8 + u. What is d(i)? -7 Let r(s) = 10 - 7 + 0 - 2s. What is r(2)? -1 Let v(y) = -y*2 - 4y + 3. Let j be v(2). Let k(h) = -2h - 31. Let u(b) = -b - 15. Let d(x) = ju(x) + 4k(x). Let n be 2/(-4) - (-3)/6. Determine d(n). 11 Let y(o) = -o2 + 3o + 4. Let i(a) = a*3 - 3a*2 - 5a + 10. Let v be i(4). Let b be -10(21/v + -4). Give y(b). -6 Let t(m) = -4m + 1. Suppose -c = -3c - 2. What is t(c)? 5 Suppose -52n + 56n - 14 = -5s, -5n = 20. Let h(i) = 5i + 2. Let z(t) = -2t - 1. Let p(u) = 3h(u) + 8z(u). Determine p(s). -8 Suppose -2i + 4i - 4 = 0. Let v(u) = -4u - 1 + iu2 - 1 + 5u. What is v(2)? 8 Let t(d) = d*2 + 3d - 3. Let f(q) = -q*3 + 2q*2 - 2. Let b be f(2). Let l be (b/4)/(2/(-4)). Suppose -2m - 7 - l = 0. Determine t(m). 1 Let t(j) = j2 - j + 8. Let b(c) be the second derivative of c5/20 - c4/12 - c3/3 - 3c. Let i be b(2). Give t(i). 8 Let y(t) = 0 + 0t*2 - 5t - 3t2 + 2t + 3. Determine y(-3). -15 Let c(y) = -4y3 - 7y*2 + 10y - 26. Let r(g) = g*3 + 2g*2 - 3g + 9. Let p(f) = 2c(f) + 7r(f). What is p(0)? 11 Let u(g) = -g*2 + g + 3. Let q be u(0). Let a(z) = -qz + 5z2 - 9z + 7 - 2z2. Let l(o) = o2 - 4o + 2. Let c(p) = 2a(p) - 7l(p). Calculate c(4). 0 Suppose l = -2o + 10, -4o - 3l = -4l - 14. Let y(m) be the third derivative of 1/2m3 - 1/60m5 + m2 + 0m + 0 + 1/6m4. Determine y(o). 3 Let x(m) = -m2 - 8m - 6. Suppose 3h = 5 + 1. Suppose -6i = 5q - hi + 29, 0 = -q + 3i - 2. Determine x(q). 9 Suppose 0 = -4k - 3 + 19. Let m(p) = 3 + p3 - 22 - kp*2 + 8 + 8. What is m(4)? -3 Let p be 0/32/4. Let q(w) = w*2 + 2 - 1 - 1. Give q(p). 0 Let z(y) = -3 - 1 + y + 0. Give z(7). 3 Let f(m) = 4m*2 - 1 - 11m + 5m3 - 6m*3 + 9m. Let o(k) = -k*3 - 7k*2 - 7k. Let r be o(-6). Suppose -5b + r + 14 = 0. Determine f(b). -9 Let t be 6/1(-4)/6. Suppose 4w + 5n = 36, -2n = -w - n. Let p(z) = 3z + z + w - 3z + 3. What is p(t)? 3 Let s(g) = -7g*3 + 2g*2 - 2g + 1. Let r(f) = -f*2 - 7f + 1. Let j be r(-7). Give s(j). -6 Let v(y) be the first derivative of -5y3/3 - y2 + y + 1. Calculate v(1). -6 Let d be -27/((-14)/8). Let g(p) = -8p2 - dp + 21p - 12p. Determine g(1). -7 Let i(f) = -f*2 - 4f - 1. Let b be -2 + 1/(1/4). Let k be 6/b + (-3 - 0). Suppose -n + k = 3. Give i(n). 2 Let l(x) be the first derivative of -3x - 1/2x*2 - 4. Determine l(-3). 0 Let p(r) = 2r + 102r3 + 12 + 98r*3 - 199r3 + r2 + 7r2. What is p(-8)? -4 Suppose 2z - 10 = -5k, -9 - 1 = 5k - 2z. Let v = 1 + 1. Suppose -s + k = v. Let q(g) = g2 + 2g + 1. What is q(s)? 1 Let i be ((-1)/(-2)0)/(-3). Let l(u) = u3 - 7 + 15 - 3. Determine l(i). 5 Let g(p) = -p3 - 3p*2. Suppose -m - 66 = 4d + m, -2m + 9 = -d. Let x = -10 - d. Let y = -8 + x. Give g(y). 0 Let x(z) be the first derivative of -z4/4 - 2z3 + z2/2 + 3z + 3. Let s(h) = 3h. Let r be s(-2). Determine x(r). -3 Let r(f) = -f*2 - 2f2 - f - 1 + f3 + 0f2. Let j(n) = n3 + 4n*2 + 3n + 4. Let m(l) = l - 3. Let h be m(0). Let c be j(h). Determine r(c). 11 Let l(j) = -3j3 + 1. Let w be 6/(-4)(-8)/6. Let t be ((-1)/w)/(4/8). Determine l(t). 4 Let o be (-2)/7 + (-38)/14. Let h(l) = -2l + 3 + 0l + 4l. What is h(o)? -3 Suppose -3h + u + 9 = 0, 0 = -6h + 3h + 4u. Let c = -5 + 8. Let x(d) = -3d - 1 + 1 + c. What is x(h)? -9 Let a(c) = c. Let q be a(4). Let d = 1 + q. Suppose -s - d = 4s. Let x(m) = -8m*2 - 2m - 1. Calculate x(s). -7 Suppose -2d = w + 4, 3w - 2d + 3 = d. Let y(r) = 5r*2 + 4r + 3. Calculate y(w). 15 Let f(v) = 2v + 4. Let a be f(0). Let q(z) = -2z + 2. Give q(a). -6 Let p(h) = -h*3 - 4h*2 + 2h - 1. Let q be 18/(-4) + (-10)/4 + 2. Determine p(q). 14 Let c be (5/(-2) + 2)-2. Let b(v) be the first derivative of -4v*2 + 11. Determine b(c). -8 Let s(k) = -4k*3. Let w be s(-1). Suppose -wp + 6p + 2 = 0. Let o(l) be the second derivative of l3 - 2l. Calculate o(p). -6 Suppose -20 - 5 = 5k. Let d(x) = -4x - 5x2 + 3x2 + x2 + 7. Determine d(k). 2 Let n(r) = r*2 - 4r + 6. Suppose 0 = -5l + 11 + 4, 2i + 9 = l. Let d = -7 - i. Let y be d/(-14) + (-104)/(-28). Give n(y). 6 Let b = 10 + -7. Let y(d) = 2d2 + 3d + 4. Let a be y(-2). Let g(n) = 4n - n + 5n - an - n2. Calculate g(b). -3 Let a(m) be the second derivative of -m5/20 - m4/2 + m3/6 + 7m*2/2 + 2m. Suppose 7 = 3o + 25. Give a(o). 1 Let z(j) = 3j - 22. Let n(h) = 7h - 45. Let t(d) = 2n(d) - 5z(d). Calculate t(0). 20 Let b = 31 + -16. Suppose -2x = x - b. Let z(t) = -4t + 54t*2 + 48t*2 + 56t*2 - 157t2 + 3. Determine z(x). 8 Let j(t) be the second derivative of -t4/12 + 5t3/6 - 2t*2 + 2t. Let h be j(4). Let q(g) = g2 + g + 5. Give q(h). 5 Let l(h) = -h3 + 2h2 + 5h - 6h + 2h. Calculate l(-2). 14 Let a(z) be the second derivative of -z6/120 - z4/3 + z. Let g(q) be the third derivative of a(q). Calculate g(-1). 6 Let s(g) = -g*3 - 11g*2 - 11g - 4. Let l(w) = -w*3 - 10w*2 - 10w - 5. Let u(f) = 4l(f) - 3s(f). Let a = 0 - 6. Determine u(a). -2 Let l(r) = r*3 - 8r*2 + 7r + 1. Let z be l(7). Let q be z + -1 + (-1 - -4). Let n(d)	{ "pile_set_name": "DM Mathematics" }
w(r) be the third derivative of r8/1344 + r7/315 + r*4/4 + 3r*2. Let c(q) be the second derivative of w(q). Find the third derivative of c(d) wrt d. 30 Let z(b) be the second derivative of 0b*2 + 0 + 0b*5 + 0b*3 + 11b + 0b6 + b4 + 1/8b*8 + 0b*7. Find the third derivative of z(y) wrt y. 840y3 Let c(r) = -r3 - 15r2 - 13r + 18. Let q be c(-14). What is the third derivative of 869o4 + 9o*6 - 869o*q - 9o*2 wrt o? 1080o*3 Let j(y) = 6y*3 + 22y + 42. Let z(q) = q*3 - q - 1. Let o(i) = 2j(i) + 44z(i). What is the derivative of o(b) wrt b? 168b*2 Let q(k) be the first derivative of 21k*4/4 - 25k*3/3 + 75. What is the third derivative of q(s) wrt s? 126 Let h be (2/8)/(6/24)5. Differentiate -2g2 - 18 - h - 25g*2 wrt g. -54g Let o(q) = -q*3 - 14q2 + 8. Let b be o(-14). What is the second derivative of -t4 - 16t4 + 2t - bt wrt t? -204t*2 Suppose -5p - 7 = 5w - 6w, p = 1. Differentiate -11 + 14 + w - 26k wrt k. -26 Let v(g) = g2 - 47g + 538. Let d be v(19). Let l(r) be the first derivative of -8/3r3 + 0r - d - 3r2. What is the second derivative of l(i) wrt i? -16 Let u(t) be the third derivative of 0t*3 + 0t + 0 + 7/60t5 - 1/2t*4 + 22t*2. Find the second derivative of u(j) wrt j. 14 Let n = 344 - 342. Let s(d) be the first derivative of 9/2dn - d - 7. What is the first derivative of s(x) wrt x? 9 Let w(y) = -y3 - 12y2 - 14y + 3. Let c be w(-11). Find the third derivative of -u*2 - u + cu*4 + u - 25u*4 wrt u. 264u Let g(x) be the third derivative of -43x7/35 + x4/12 + 7x*3/2 + 273x*2 - 2x. Find the second derivative of g(w) wrt w. -3096w2 Let l(c) be the first derivative of 4c5/5 + c4/2 + 70c3/3 - c + 51. Find the third derivative of l(d) wrt d. 96d + 12 What is the first derivative of 15f2 + 10f - 9775 + 5231 + 5143 wrt f? 30f + 10 Let u(x) be the third derivative of -457x6/120 + x4/4 + 21x3/2 + 57x*2. Find the second derivative of u(k) wrt k. -2742k Let q(z) = 3z4 - 8z*2 + 5z + 5. Let f(o) = 31o + 4o*2 - 20o - 14o - 2o*4 - 3. Let l(y) = 10f(y) + 6q(y). Find the third derivative of l(d) wrt d. -48d Suppose 4q - g = 197, -3g - 18 = -15. Differentiate -13h3 + 70 - q + 32h*3 wrt h. 57h*2 Let g(p) be the first derivative of 0p - 1/3p3 + 0p*6 - 5 + 18/7p*7 + 0p*4 + 0p*2 + 0p*5. Find the third derivative of g(z) wrt z. 2160z3 Let o(t) = -t4 + 29t2 - 6t - 2. Let h(b) = b. Let z(q) = -6h(q) - o(q). Find the third derivative of z(a) wrt a. 24a Let k(i) = -i*2 - 7i + 17. Let y be k(-9). Let f(w) = w*4 - w. Let d(u) = 3u*4 + 3u*3 + u + 20. Let p(b) = yf(b) - d(b). Differentiate p(c) wrt c. -16c3 - 9c*2 Find the third derivative of -16618t*3 + 53t*2 + 16961t*3 + 94t2 wrt t. 2058 Let m(w) = w3 - 51w2 + 51w - 8. Let x be m(50). Suppose 119 = 4r - 101. What is the third derivative of rj*2 + 6j*4 + 3j*4 - xj*2 wrt j? 216j What is the third derivative of 0s2 - 2s*3 - 17s*4 - 2s*2 - 12978 + 12894 wrt s? -408s - 12 Let k(d) = -2d + 12. Let l(f) = f3 + 6f*2 + 4f. Let s be l(-5). Let r be k(s). Find the third derivative of 3g2 - 6g*4 + 0g2 + gr + g*2 wrt g. -144g Let n(p) = 2p + 5. Let g be n(-1). Find the second derivative of -2w - 18w4 - gw*3 + 3w*3 - 20w wrt w. -216w2 Let a = 13 + -9. Suppose -5o = -19 + a. Find the second derivative of 0u - 3u - 2u3 + uo + 5u wrt u. -6u Suppose 0 = r - 4z + 11, 0 = -5r + z - 2z - 76. Let d be (r/6)/((-1)/2). Find the third derivative of -dw2 - 2w*3 - 4w*2 + 0w*2 + 5w*2 wrt w. -12 Let y(i) = 101i*3 - 111i*2 - 11i - 11. Let j(x) = 51x3 - 55x*2 - 6x - 6. Let b(q) = 11j(q) - 6y(q). Find the third derivative of b(m) wrt m. -270 Let u(b) be the second derivative of b3/6 - b2 + 2b. Let g be u(4). What is the third derivative of gx*2 - 18x*4 + 3x + 23x4 - 3x wrt x? 120x Let l = 10 + -10. Let r be 2/4(0 - l). What is the third derivative of 2v5 + 36v*4 + 7v*2 - 36v*4 + rv*5 wrt v? 120v*2 Let a(x) be the third derivative of 2x + 5/3x3 + 1/24x*4 + 0 + 29x*2 - 11/15x*5. Find the second derivative of a(d) wrt d. -88 Suppose 0 = -x + 7. What is the third derivative of -7b*2 - 15b3 + b2 + 3b2 - xb*2 wrt b? -90 Let d = -62 + 66. What is the second derivative of 2k*2 + 15k*2 + 5k*2 - 6k - dk wrt k? 44 Suppose 5u = 8u - 36. What is the second derivative of 4b*4 - 41 + 0b*4 + 41 + ub wrt b? 48b2 Let d(u) be the third derivative of 39u*9/28 - 103u*5/15 + 801u*2. What is the third derivative of d(b) wrt b? 84240b*3 Let b(w) = -25w*2 + 8w + 321. Let q(u) = 2u2 - u - 1. Let v(h) = b(h) + 5q(h). Differentiate v(n) wrt n. -30n + 3 Find the second derivative of 111 + 126 - 2948s*2 + 2876s*2 + s wrt s. -144 Let g(m) be the first derivative of -735m*4/4 - 194m*2 + 737. Find the second derivative of g(p) wrt p. -4410p Suppose 5q - 20 = 3v, 2v - 3q - 8 = -5q. Suppose -4j + 8 = -vj. Find the third derivative of -x2 - 2x*j - 6x*2 - 7x*6 wrt x. -840x*3 Let a(t) be the third derivative of 5t5/4 - t4/8 - 160t3/3 - 178t*2. What is the first derivative of a(g) wrt g? 150g - 3 Let q be 28/(-3)(-39)/26. Suppose -g = -5o + 21, -q = -5o + 11. Differentiate g + 4 - 5b*4 - 5 with respect to b. -20b3 Let u(w) = -w4 - w*2 + w - 1. Let y(k) = 20 + 18k - 4k + 15k*4 - 39k + 20k2. Let s(x) = -20u(x) - y(x). What is the second derivative of s(h) wrt h? 60h2 Let w be (-2 + 0 + 12)/(-2). Let r = w + 7. What is the third derivative of -sr + 43s3 + s2 - 37s3 + 3s*2 wrt s? 36 Let w be ((-1)/(-1))/(2/(-4)). Let k be (-2 - w - 4)/(-1). Differentiate -6 + 4c*3 + 1 + kc*3 - 6c*3 wrt c. 6c*2 Let y = -3 + 15. Let r = y - 10. What is the third derivative of -5v*3 + 4v*2 - 2v + 2v - rv*2 wrt v? -30 Let y be (-4)/(-22) + (-6)/33. Let r(f) = f + 2. Let o be r(y). What is the third derivative of 3u5 - u2 - 8uo - 4u*5 + 3u*2 wrt u? -60u*2 Let y(c) be the first derivative of 35c*3/3 + 136c + 162. What is the derivative of y(f) wrt f? 70f Let w = 20 + -1. What is the first derivative of -10 + l + 11 - w wrt l? 1 Suppose -6 - 12 = -3w. Let d = 3 + w. Find the third derivative of -x*5 + dx*5 - 35x*2 + 28x*2 wrt x. 480x*2 Let h(f) be the third derivative of -9/20f*5 + 4f*3 - 19f*2 + 0f*4 + 0f + 0. Differentiate h(p) wrt p. -54p Let r(j) be the first derivative of 0j*2 + 36/5j*5 + 0j + 0j4 + 5 - 38/3j*3. What is the third derivative of r(i) wrt i? 864i Let k(q) be the second derivative of 7q6/30 - q4 + 121q*2/2 - 12q + 2. Differentiate k(a) wrt a. 28a3 - 24a Let i(j) = 268j2 + 61j - 11. Let g(n) = 269n2 + 59n - 9. Let m(a) = 6g(a) - 5i(a). Find the second derivative of m(o) wrt o. 548 Let c(v) be the first derivative of -5 + 0v2 + 0v*6 + 0v*4 + 0v*5 + 4v*3 + 2/7v*7 + 0v. What is the third derivative of c(w) wrt w? 240w3 Let q(t) be the second derivative of t8/14 - 2t*7/21 - 145t*4/12 + 7t - 4. Find the third derivative of q(z) wrt z. 480z3 - 240z*2 Let v(b) = 3b + 8. Let y(c) = -c*2 - 8c - 15. Let n(u) = -5v(u) - 3y(u). What is the second derivative of n(p) wrt p? 6 Let k(b) be the second derivative of b*8/28 + 7b*5/10 - 271b*4/12 + 407b. What is the third derivative of k(y) wrt y? 240y3 + 84 Let l(r) = r2 + 10r + 2. Let g be l(-9). Let i = g - -10. Find the first derivative of -5 - 2q3 - 3q*2 + iq*2 wrt q. -6q*2 Let i(u) be the second derivative of -12u + 0 + 11/30u6 + 0u*5 - 31/2u*2 + 0u*3 + 0u*4. What is the first derivative of i(t) wrt t? 44t*3 Let q(a) be the third derivative of 0a*6 - 1/24a*4 - 13/105a*7 + 0a*3 - 1/20a*5 + 0 + 0a + 24a2. What is the third derivative of q(j) wrt j? -624j Let l(v) be the second derivative of -v*7/42 - 3v5/20 - v4/6 - 11v2/2 + v + 1. What is the third derivative of l(p) wrt p? -60p*2 - 18 Let p(i) = 7i*2 + 23i + 5. Let q be p(-4). Find the third derivative of 9z2 + qz*6 - 20z*2 + 16z*2 wrt z. 3000z**3 Let x(m) be	{ "pile_set_name": "DM Mathematics" }
/1. Let b = -10 + p. Solve -7 = -u + 2f, -5u = -f - b - 5 for u. 5 Suppose 6l = 4l - 10. Let u be 3 - l - (3 + 0). Solve 3z - 4 = 4z, -uz - 18 = x for x. 2 Suppose 2w = 5w - 21. Let a(b) = -7b2 + b - b3 - b*2 + 18 - w. Let r be a(-8). Solve -2c + 5v = r - 2, c + 4v = -7 for c. -3 Suppose 0 = -o - 0f + 2f + 4, 2o + 5f = -10. Solve -c - k - 3 = 0, -6 = 2c - ok - 4k for c. -3 Let m(d) = d2 - 11d + 28. Let f be m(7). Let g = 55 - 23. Solve -3r - g = 4j, f = 4j - 3j + 5 for r. -4 Let i be (2/(-3))/((-4)/18). Solve m + m - 13 = -f, 3f - 27 = -im for f. 5 Let v(o) = -o + 7. Let m be v(3). Solve -m = 3l - 7l - 3z, -5l = -z - 5 for l. 1 Let j = -6 - -17. Let t = -6 + j. Suppose 8 + 3 = -3r - td, -5r - d + 11 = 0. Solve -3q + 22 = 4s, 8s = 5q + rs + 10 for q. 2 Suppose t + 2 = 20. Let o be (-15)/6(-8)/10. Suppose 0 = -m + x, 2 = m - 3m + 3x. Solve -oa - t = 4y, 5y - a - ma = 5 for y. -2 Let z = -3 - -6. Suppose 34 + 2 = zm. Suppose 4r + 0u = 2u + 20, -2r + 4u + 16 = 0. Solve -6b + b - m = -3l, -r = 5b - l for b. 0 Suppose 0 = -2z + z. Let o = 0 - z. Let q(u) = 2u*2 - 2u + 1. Let x be q(-2). Solve -x = k - 2l, -k - 5l + 31 - 9 = o for k. -3 Let y = -18 + 11. Let p = y - -9. Solve -pt - n = 0, -t = -5t - 4n for t. 0 Suppose -6 = -5l - 1. Suppose g = l, 4a = -4g + 2g + 10. Let k be ((-2)/5)/(a/(-60)). Solve -2m = -4u + 16, m + k = 4u - u for m. 0 Let t(a) = -7 + 4a2 - 2a - 4a2 - 4a + 2a2. Let v be t(6). Solve g = -o - 7, -o - 3g + 12 - v = 0 for o. -2 Let n = -4 + 6. Suppose 12 = -4d - 8. Let r = -3 - d. Solve 8 = -nw - 2a, ra - 3a - 6 = -w for w. 1 Let t be 36/(-10) + 2/(-5). Let w be 0/(t - (-2 - 1)). Solve -4i + 20 = 0, -4l + wl = -4i + 28 for l. -2 Suppose -4l + 9 + 63 = 0. Let a be ((-27)/l)/((-3)/10). Suppose 0f - 2k - a = f, k + 5 = 0. Solve 2d - 5u = -5, -5d + fu = -d - 5 for d. 5 Let n be 3 - ((-3 - -5) + 1). Suppose 2f + 0f = n. Solve -5i - 3o - 9 = 0, 3i + fo - 6 = 2o for i. 0 Let h = -38 - -143. Suppose 4d - 147 = -5z + h, -2z + 90 = -2d. Let w be 2/(-6) - z/(-9). Solve -2y = 3l - y - 9, 2l = wy - 11 for l. 2 Let y = 21 + -9. Solve -3x + 2j - j - 6 = 0, -y = -4j for x. -1 Suppose 0 = -0w - w + 3. Suppose ws - 45 = -2c, -5s + c + 88 = -0s. Solve 1 = 3t - 5n + s, t = -4n + 23 for t. 3 Suppose 0 = -5v + 5a + 50, -2a = 2v - 0a. Solve -4u + 3h + 20 = -0h, vh = 0 for u. 5 Let o(i) = i3 - 6i*2 + 6i - 5. Let w be o(5). Solve 2u = 5v - 15, 4u + wu + 15 = -5v for v. 1 Let k(m) = 2m. Let f be k(1). Suppose 0z - fz = -4. Solve -2v - zq = -2 - 0, 4v + 2q = 4 for v. 1 Suppose -p + 7 - 3 = 0. Solve pr - 8 = r - y, -8 = 2y for r. 4 Suppose -2q + z + 124 = 3q, 2z = -3q + 77. Solve -4t - 2d - 26 = d, 5d = -3t - q for t. -5 Let r(j) = j*3 - 10j*2. Let t be r(10). Let l be (t + -1)/((-1)/9). Solve a = -g + 2g - l, -2a - 2g = 2 for a. -5 Suppose 3v - 7v = -444. Suppose -2h = h - v. Solve 3m - 5w = 34, 5w = m - h + 9 for m. 3 Suppose 8 = 11w - 7w. Solve 4o = 4, h - o + 7 = wo for h. -4 Let u(t) = 2t - 6. Let o be u(5). Let h(w) = -w + 7. Let f be h(o). Suppose 14 = fy - 1. Solve 5a - 10 = -l, 5a + yl + 0l = 10 for a. 2 Let k be (-2)/((-1 + 2)/2). Let u = 0 - k. Solve -3d + 8d + 3y + 3 = 0, 5d - 4 = uy for d. 0 Let o = 10 - 10. Solve o = 4k - 16, -4k + 17 = 4y - 7 for y. 2 Let m = -42 + 46. Solve -2q - o = -5, 5q - mo = 8 - 28 for q. 0 Let a = 30 - 21. Suppose -210 = 4p - ap. Let r be (-8)/6p/(-4). Solve -4n + 9n = f - 12, -5f + r = -2n for f. 2 Suppose -k = -3 - 1. Suppose 2q + 2q + 2v - k = 0, -15 = -q + 3v. Solve -3x = -d - 1 - 0, q = 3d - 3x for d. 2 Let w(m) = m3 - 5m*2 - 5m - 4. Let z be w(6). Let f = z - -2. Solve -l + 4 = 4n + 7, -4n - 28 = -fl for n. -2 Suppose 11 - 1 = -5k - b, -6 = k + b. Let x(r) = -6r3 - r - 1. Let f be x(k). Solve 3c - 1 = -4y + 2c, 0 = 2c + f for y. 1 Let l = -130 - -132. Solve 3 = -3x - 6d + 2d, lx - 3 = -d for x. 3 Suppose 6 + 4 = p. Let b(i) = -2i2 + i3 - 10i2 + i2 + 11 + 10i. Let z be b(p). Solve 4d + 2o = -d + z, -2d - 2 = 4o for d. 3 Let b(j) = -4j2 - 4j + j*2 + 2j*2. Let a = -9 + 6. Let w be b(a). Solve 4s + 2f - 2 = -0, 4f = -ws - 6 for s. 2 Let s = -22 - -32. Solve 0 = -g - 2f - 3, -3g + 2g + 5f = s for g. -5 Let b = 5 + -3. Let x(o) = 2o - 4. Let v be x(3). Solve 2j + bj - d + v = 0, -4j = d + 6 for j. -1 Let f(y) = y - 1. Let t(h) = 7h - 9. Let o(b) = 6f(b) - t(b). Let j be o(3). Let v be 2 - 4 - 4/(-1). Solve p + vk = 12, j = -p - 2p - k + 16 for p. 4 Let q(i) be the first derivative of i2/2 - i - 9. Let m be q(4). Solve -ms - 6 = -v - s, -2v - s = -7 for v. 4 Let x = 84 + -52. Solve 3t = 4v + x, 3t = -5v - 8 - 5 for v. -5 Let r be (-3 + (-3)/(-2))-2. Let p(c) = -c*2 + 5c - 2. Let d be p(r). Solve -3q = -w + 4, q = dq + 3w + 12 for q. -2 Suppose 0 = 3v + 1 - 7. Solve 4t = 2z - 8, -3t - vz - 6 = -0 for t. -2 Suppose 0 = g - 2g + k, -k + 4 = 0. Solve -j - b + 3 = -6j, -3j - gb = -12 for j. 0 Let f(r) = r*3 - 5r*2 - 6r + 4. Let s be f(6). Solve 0 = 2l - 3l + 2v - 2, 16 = -3l - sv for l. -4 Let n be 75/(-4)8/(-3). Let f be -44/((-16)/3). Solve s + n = -5j - 4s, 10 = -fj + s for j. -5 Suppose -b + 3b = 5l + 16, 0 = 4l - b + 14. Let x be ((-2)/5)/(3/(-180)). Let n = l + x. Solve u = r - 7, -5u - n = 3r - 1 for r. 2 Suppose -2u = -32 - 0. Suppose l + u = -4y, -1 + 11 = -2y. Let c(k) = k*3 - 3k*2 - 4k + 5. Let x be c(l). Solve -a - 4h = 7, h - 16 = -xa - 2h for a. 5 Let g = 90 - 62. Suppose x + 2r - 13 = 5r, 2x - 4r = g. Solve -3h + 21 = 4m, 4h - 11 - x = -5m for h. 3 Suppose -t - 14 = -4o, 0 = 3t - 6o + 3o + 6. Let f(p) = 1 + p - 4p - 7 + p*t. Let z be f(7). Solve 0l + x = 4l + z, 5x - 10 = 0 for l. -5 Suppose -3m + 1 = 2v, 3m - 17 = 3v - 41. Let w = -23 - -15. Let c = m - w. Solve 3n = i - 4i, -ci = -3n - 8 for n. -1 Let v = 1 - -2. Suppose 31 = -4z - vq, 5z + 0q = 4q. Let j = z - -8. Solve 4y - 32 = jt, 4y + 3t = y + 6 for y. 5 Let b = 8 - 6. Let l be ((6 - b) + -1)1. Solve 6 = -3t + ly, 3t + 0t + 5y - 2 = 0 for t. -1 Suppose -3c = -3b - 15, 13 = 2c + 3. Let l(s) = s + 3. Let v be l(b). Solve -r - 5 = -5x - 15, -vr = -2x - 17 for x. -1 Let a(g) = -2g*2 - 20g + 22. Let x be a(-11). Solve x = -4h + 3i - 6, -h + 4 + 3 = -5i for h. -3 Let y be 21/2(-2)/3. Let v(d) = -d*3 - 8d*2 - 9d - 9. Let o be v(y). Solve -4x + 3q = -q + 32, 0 = ox - 2q + 25 for x. -3 Let x(s) = -s*2 - 15s - 8. Let h be x(-12). Solve -3t - t - 2o + 26 = 0, 4o = -2t + h for t. 4 Let c(z) = -z + 4. Suppose -3d - 15 = -8d. Let f be c(d). Let o be -11/f-5. Solve -5h + 2v - 32 = -2v, o = -2h - v for h. -4 Suppose 4n - 28 = 3b, 2b + 13 = 3n - 9. Solve 2j - 2w - 4 = 0, 5j + nw - 5w = 30 for j. 4 Let n be 1/(-2)(-6 - 2). Solve c + np + 8 = 0, 2c - 2p + 5 = p for c. -4 Let s be ((-84)/(-70))/((-3)/(-10)). Solve -3p - 2 = 2c + 2p, 3c - sp = 20 for c. 4 Let j(c) = c*3 - 2c*2 - 5c - 8. Let m be j(4). Solve 2s - 5u = -m, 3 = -s + 4u - 2 for s. 3 Suppose -19 = -i - 3z - 11, -4z = -3i + 50. Let g = -2 - -4. Solve 0u = gs - u - 7, s - i = -3u for s. 5 Suppose j = 3j - 2. Suppose j - 2 = s + c, -5s + 5c = -5. Suppose -4w + 11 + 17 = 0. Solve -r - 2 = 3t, -5t - 2r + 4 - w = s for t. -1 Let s(b) = -2b - 4. Let f be s(-4). Let w = -9 - -24. Let x = 25 - w. Solve 4d + fv - 5v - x = 0, 2d + 4v = 14 for d. 3 Let t = -2 + 4. Suppose t = 5b - 4b. Solve 0 = -f - 5c - 25, bc + 23 = f - 4f for f. -5 Let d(h) = -h3 + 5h*2 + 9h - 14. Let i be d(6). Solve iv + 4y + 20 = 0, 0 = 4v - 4y + 13 + 7 for v. -5 Let h be ((-2)/4-8)/2. Let a be (4 - (5 - 2))h. Solve -14 = 3n - b, -n - 18 = -b - ab for n. -3 Let b = -1 + -1. Let x be (2 + -4 - -2)/b. Let d(s) = -s*2 - 11s - 7. Let w be d(-9). Solve -4u = 16, x = 2f - 5f + 2u + w for f. 1 Let a be 6745/(-15) + 1/(-3). Let r be (a/24)/(3/(-8)). Suppose -10 = 2x + 4q, -5x - q + r = -6q. Solve c - 5 = -4k, xk - 4 = -4c + 2c for c. -3 Let f be (60/50)/(3/10). Suppose q = -f + 7. Solve 0*	{ "pile_set_name": "DM Mathematics" }
15. Determine h(13). 236 Let a(k) = -4k3 + 105k*2 - 24k - 42. What is a(26)? 10 Let f(t) = t*3 - 19t*2 + 29t + 58. Determine f(17). -27 Let t(i) = -i*3 - 15i*2 - 20i - 520. Calculate t(-17). 398 Let u(v) = -514v - 2043. What is u(-4)? 13 Let l(f) = -193f + 2268. Calculate l(12). -48 Let f(c) = -c*2 - c + 1037. Calculate f(35). -223 Let h(t) = 2t*3 - 13t*2 + 30t - 152. Give h(6). -8 Let y(s) = -s*3 - 16s*2 + 149s + 2213. What is y(-17)? -31 Let f(k) = -k*3 - 9k*2 - 15k - 8. Give f(0). -8 Let x(r) = -12217r + 85518. Give x(7). -1 Let x(i) = -5i + 7. Calculate x(3). -8 Let k(q) = -382q - 40496. Determine k(-106). -4 Let t(g) = 15g*2 - 1814g - 191. What is t(121)? -70 Let q(s) = -s*2 - 94s + 310. What is q(3)? 19 Let v(d) = d*3 - 104d*2 + 2328d - 768. What is v(32)? 0 Let t(h) = -8h2 - 614h - 8. Give t(-77). -162 Let g(h) = -h*3 - 8h*2 + 43h + 98. Calculate g(-11). -12 Let q(i) = 2i3 + 28i*2 + 46i - 7. What is q(-12)? 17 Let s(b) = 929b - 6111. Determine s(6). -537 Let d(w) = -w2 - 66w - 1090. Determine d(-30). -10 Let o(x) = -22x - 888. Determine o(-43). 58 Let l(o) = 8o*2 + 205o - 77. Give l(-26). 1 Let y(v) = v*3 - 68v*2 - 140v + 96. What is y(70)? 96 Let o(d) = -2d2 - 12d + 922. What is o(-24)? 58 Let l(u) = -85u3 + 3u2 - u. Give l(-1). 89 Let g(t) = t2 - 60t + 598. What is g(47)? -13 Let c(o) = o3 - 13o*2 - 11o + 358. Determine c(11). -5 Let d(r) = -r*3 - 15r*2 - 2r + 158. Calculate d(-14). -10 Let y(v) = -2v2 + 11v + 491. What is y(23)? -314 Let u(i) = 29i - 99. Give u(3). -12 Let n(q) = 4q*3 - 52q*2 - 26q - 6. Calculate n(13). -344 Let m(l) = 115l + 4268. What is m(-40)? -332 Let v(k) = -37k + 648. Calculate v(18). -18 Let s(b) = -28b2 - 3386b + 241. Give s(-121). -1 Let a(m) = 14m - 217. What is a(20)? 63 Let d(w) = -4w*2 - 101w + 2288. What is d(15)? -127 Let z(l) = -328l + 4264. What is z(13)? 0 Let i(l) = -l2 - 9l + 103. Give i(-16). -9 Let d(x) = 270x - 4320. What is d(16)? 0 Let y(h) = 356h - 3215. Determine y(9). -11 Let y(a) = -26a2 + 7480a + 2305. What is y(288)? 1 Let r(b) = -b*2 - 246b + 3634. What is r(14)? -6 Let w(h) = 356h3 - 11h + 12. Give w(1). 357 Let x(h) = -1053h - 23147. Give x(-22). 19 Let f(h) = h3 - 4h*2 - 39h + 3. Determine f(5). -167 Let x(c) = -c*2 - 25c + 299. Give x(0). 299 Let h(u) = -27098u - 162570. Calculate h(-6). 18 Let n(v) = 22v*3 + 4v2 - v - 4. Determine n(1). 21 Let v(p) = p2 - 49p - 786. Determine v(-19). 506 Let x(a) = 7a*3 + 109a*2 - 46a + 4. What is x(-16)? -28 Let g(n) = n*3 - 13n*2 - 59n + 189. What is g(16)? 13 Let h(o) = -2o2 + 91o - 660. Determine h(35). 75 Let k(v) = -20v - 158. Give k(-9). 22 Let h(j) = -9j*3 + 11j*2 - 128j + 119. Determine h(1). -7 Let t(o) = -11o2 - 135o - 267. Calculate t(-10). -17 Let x(u) = u*3 - 44u*2 + 167u - 138. What is x(40)? 142 Let x(a) = -a*2 - 27a - 101. Determine x(-19). 51 Let b(o) = 10o2 + 1301o + 127. Give b(-130). -3 Let f(k) = 2k3 - 73k*2 + 41k - 169. What is f(36)? 11 Let y(q) = 22q - 1428. Give y(65). 2 Let h(o) = 3o*2 + 264o - 4332. Calculate h(14). -48 Let y(l) = 45l - 298. Calculate y(7). 17 Let k(c) = 20c + 232. Calculate k(-6). 112 Let n(r) = 18r3 - 2r*2 + 2r + 5. What is n(-1)? -17 Let a(s) = 4s2 + 74s - 148. What is a(2)? 16 Let t(x) = x*3 + 40x*2 + 37x - 120. Determine t(-39). -42 Let b(v) = 187v - 1947. Give b(11). 110 Let g(b) = b2 + 12b - 159. Calculate g(-20). 1 Let i(f) = -2f + 295. Calculate i(-57). 409 Let j(u) = -2u*2 + 160u - 1509. Give j(69). 9 Let f(t) = t*3 + 19t*2 + 55t - 17. Give f(-13). 282 Let t(b) = 1844b + 1823. Give t(-1). -21 Let y(s) = 97s + 32. Calculate y(-1). -65 Let x(h) = 3h3 + 13h*2 + 14h + 19. What is x(-5)? -101 Let x(j) = -2j3 - 28j*2 - 2j - 28. What is x(-14)? 0 Let b(z) = -320z + 1311. Determine b(5). -289 Let d(x) = 578x - 3996. What is d(7)? 50 Let j(d) = 12d - 279. Determine j(22). -15 Let v(h) = 4h*2 + 3h - 9. Calculate v(7). 208 Let y(o) = 2o2 + 72o + 235. Calculate y(-31). -75 Let a(l) = -3l3 - 7l*2 - 4l - 11. Determine a(-3). 19 Let h(l) = 10756l + 75288. Calculate h(-7). -4 Let d(b) = 4b*2 + 10b - 198. What is d(6)? 6 Let t(r) = 4r2 - 19r + 9. What is t(4)? -3 Let a(s) = -61s + 799. Give a(10). 189 Let g(m) = -34m + 2760. What is g(81)? 6 Let z(d) = 17d3 + 3d*2 - 2d - 2. What is z(1)? 16 Let m(n) = n*3 - 6n*2 - 16n + 3. Determine m(8). 3 Let a(w) = -w*3 + 14w*2 - 102w + 77. Give a(7). -294 Let c(v) = -59v - 1049. Give c(-25). 426 Let t(f) = -1687f - 30365. Determine t(-18). 1 Let m(a) = -381a + 31599. What is m(83)? -24 Let z(k) = k3 + 38k*2 - 18k + 815. Give z(-39). -4 Let x(s) = -2s2 - 1500s + 12123. Determine x(8). -5 Let y(l) = -l*3 - 21l*2 - 19l + 45. Determine y(-20). 25 Let t(h) = -14h2 + 305h - 453. What is t(20)? 47 Let l(g) = -156g - 2. What is l(0)? -2 Let b(h) = -3h*2 - 99h - 107. Determine b(-32). -11 Let d(u) = -u*3 + 93u*2 + 179u + 1142. Determine d(95). 97 Let p(m) = m*3 + 2m*2 - 18m + 5. Give p(-7). -114 Let c(h) = -h*3 + 24h*2 - 160h + 3153. Give c(23). 2 Let m(v) = 78v + 880. What is m(-7)? 334 Let u(n) = 44n - 689. Calculate u(19). 147 Let h(q) = q*3 + 3q2 - 43. Give h(0). -43 Let f(d) = d3 - 16d2 + 39d + 92. Determine f(14). 246 Let u(n) = -n*3 + 8n*2 + 26n - 45. Determine u(3). 78 Let p(r) = -2r2 + 62r - 5. Calculate p(0). -5 Let y(f) = 5f2 + 21f - 1125. Calculate y(13). -7 Let z(m) = -14m - 101. Give z(8). -213 Let r(g) = -g2 - g + 303. What is r(-18)? -3 Let x(j) = 2j*3 + 90j*2 - 10j - 365. What is x(-45)? 85 Let y(k) = -8k2 - 40k - 75. Calculate y(-2). -27 Let r(p) = 1740p - 60909. Give r(35). -9 Let a(u) = 2u*3 + 40u*2 + 143u - 38. Give a(-16). -278 Let v(h) = -15h + 366. Calculate v(23). 21 Let l(c) = -31c*2 - 67c + 6. What is l(-5)? -434 Let q(r) = -5r - 2. Determine q(-11). 53 Let a(o) = o3 + 27o*2 - 42o + 353. What is a(-29)? -111 Let r(u) = 2u3 - 4u*2 - 104u + 521. What is r(6)? 185 Let c(h) = 13h2 - 13h - 30. Calculate c(-4). 230 Let i(n) = 182n + 972. Determine i(-7). -302 Let g(k) = 34k - 89. Give g(5). 81 Let j(o) = -o*2 - 59o + 2917. What is j(32)? 5 Let x(q) = q*2 + 189q + 1615. Calculate x(-9). -5 Let s(c) = 4c3 + 3c*2 + 5c + 8. Give s(-3). -88 Let z(w) = 289w + 5786. What is z(-20)? 6 Let w(u) = -u3 + 74u*2 - 390u - 1228. What is w(68)? -4 Let s(u) = -180u + 44843. Give s(249). 23 Let n(z) = -z3 + z2 + 69z + 212. What is n(10)? 2 Let u(x) = 4x3 - 42x*2 + 53x + 18. Determine u(9). 9 Let d(g) = 2g3 - 52g*2 + 174g + 39. Give d(22). -5 Let z(y) = y*2 + 497y + 2471. What is z(-5)? 11 Let n(j) = -19j3 + 224j*2 + 14j + 12. What is n(12)? -396 Let i(l) = 2l3 - 15l - 41. What is i(-6)? -383 Let s(r) = r*3 - 112r*2 + 106r + 559. What is s(111)? 4 Let l(n) = n*2 - 20n + 461. Calculate l(24). 557 Let z(p) = -p*3 - 12p*2 + 167p + 1904. What is z(-12)? -100 Let f(t) = 41t + 2759. What is f(-68)? -29 Let p(a) = 2a*2 - 111a - 230. What is p(-2)? 0 Let o(d) = 2d3 - 67d*2 - 105d - 90. Give o(35). -90 Let o(b) = 9715b + 68010. Determine o(-7). 5 Let q(p) = 15p*2 - 5p. Give q(-1). 20 Let n(j) = -27j3 - 100j*2 + 20j + 10. Determine n(-4). 58 Let x(s) = -4s3 - 85s*2 - 18s - 139. Give x(-21). -202 Let t(f) = -2f2 + 61f - 61. Calculate t(30). -31 Let q(u) = u*2 - 10u - 6. Calculate q(11). 5 Let h(g) = g*2 + 294g - 3074. Give h(10). -34 Let c(o) = 169o - 698. What is c(4)? -22 Let t(d) = -d3 + 21d*2 + 17d - 363. Give t(21). -6 Let z(v) = -v*2 - 26v - 34. What is z(-24)? 14 Let n(h) = -5h2 - 164h + 1212. Determine n(-39). 3 Let h(j) = 19j2 - 27j - 3. Determine h(2). 19 Let x(l) = 7l3 - 1294l*2 - 185l - 6. What is x(185)? -6 Let p(z) = -1289z - 1294. Calculate p(-1). -5 Let n(r) = -10r3 + r2 - 15r + 26. Calculate n(2). -80 Let w(s) = -s3 + 21s*2 - 745s + 2078. What is w(3)? 5 Let u(d) = -3d3 - 115d*2 - 35d + 120. Give u(-38). 6 Let s(n) = -222n + 1305. Give s(6). -27 Let h(b) = 4b*3 - 9b**2 - b -	{ "pile_set_name": "DM Mathematics" }
rounded to 3 decimal places? -0.002 What is -1117520 rounded to the nearest one hundred thousand? -1100000 What is 1941000 rounded to the nearest one hundred thousand? 1900000 Round -15.2514 to zero decimal places. -15 Round 0.014169 to four decimal places. 0.0142 Round -0.10546 to 2 decimal places. -0.11 What is -752000 rounded to the nearest one million? -1000000 What is -1.2816 rounded to 1 dp? -1.3 What is -0.000029769 rounded to five decimal places? -0.00003 Round 27.83 to zero dps. 28 Round -0.000033705 to seven decimal places. -0.0000337 What is -87875 rounded to the nearest ten thousand? -90000 Round -0.9812 to one decimal place. -1 What is -0.0065436 rounded to 4 dps? -0.0065 Round -0.00011713 to six decimal places. -0.000117 Round 2320000 to the nearest one hundred thousand. 2300000 Round 0.00039377 to six dps. 0.000394 Round -43.13 to the nearest 10. -40 What is 0.010736 rounded to three dps? 0.011 Round 0.37433 to 1 decimal place. 0.4 What is -0.066868 rounded to 2 decimal places? -0.07 Round 12561000 to the nearest 1000000. 13000000 Round 1.819 to 1 decimal place. 1.8 Round 0.0047246 to four dps. 0.0047 What is 72800 rounded to the nearest 1000? 73000 Round -0.0000001909 to 7 dps. -0.0000002 Round 0.0028899 to five dps. 0.00289 Round 0.0003754 to 4 decimal places. 0.0004 Round 0.010596 to four dps. 0.0106 Round -7538 to the nearest one thousand. -8000 Round -0.0000536 to 5 dps. -0.00005 What is 0.00074603 rounded to 4 decimal places? 0.0007 Round -0.0000007996 to 7 dps. -0.0000008 Round 35226000 to the nearest one million. 35000000 What is 1176000 rounded to the nearest one hundred thousand? 1200000 What is -2.0816 rounded to one decimal place? -2.1 Round -8506300 to the nearest one hundred thousand. -8500000 What is 4190 rounded to the nearest 100? 4200 Round -13690000 to the nearest 1000000. -14000000 What is -0.0822 rounded to two decimal places? -0.08 What is 2.0732 rounded to 1 decimal place? 2.1 Round -35.4 to the nearest integer. -35 Round -529553000 to the nearest one million. -530000000 Round 0.0008534 to 4 decimal places. 0.0009 What is -0.000315 rounded to 5 dps? -0.00032 Round 0.00000041689 to seven decimal places. 0.0000004 Round 0.00113891 to 4 decimal places. 0.0011 Round -181.75 to 0 dps. -182 What is 133.7 rounded to the nearest 10? 130 What is -928800 rounded to the nearest one hundred thousand? -900000 What is -433.9 rounded to the nearest 100? -400 What is -0.00000332 rounded to 6 decimal places? -0.000003 What is 0.005238 rounded to four decimal places? 0.0052 Round 549300 to the nearest 10000. 550000 Round -973.8 to the nearest 100. -1000 Round -0.00053442 to five decimal places. -0.00053 Round -0.00003474 to 6 dps. -0.000035 Round 9180 to the nearest 1000. 9000 What is 3481900 rounded to the nearest 1000000? 3000000 Round 23182 to the nearest 1000. 23000 Round 580.7 to the nearest 100. 600 What is 0.03025 rounded to 3 dps? 0.03 What is -0.001764 rounded to four decimal places? -0.0018 What is 13.463 rounded to one dp? 13.5 Round -49837 to the nearest 100. -49800 What is 268250 rounded to the nearest 1000? 268000 What is 22100 rounded to the nearest ten thousand? 20000 Round 45.508 to zero decimal places. 46 Round 9230000 to the nearest one million. 9000000 Round 0.9576 to one dp. 1 Round -56700 to the nearest 1000. -57000 Round -0.03992 to three dps. -0.04 Round -5941 to the nearest one thousand. -6000 Round 5810500 to the nearest one hundred thousand. 5800000 Round -966.8 to the nearest ten. -970 Round -25.003 to the nearest integer. -25 What is -7327000 rounded to the nearest ten thousand? -7330000 What is 3748410 rounded to the nearest 10000? 3750000 What is 0.022444 rounded to three dps? 0.022 What is 0.071939 rounded to three decimal places? 0.072 What is 135700 rounded to the nearest one hundred thousand? 100000 Round -2.808 to one decimal place. -2.8 What is 0.0000048899 rounded to seven decimal places? 0.0000049 What is -15421 rounded to the nearest one thousand? -15000 Round 10371000 to the nearest one million. 10000000 What is 0.0000005618 rounded to 7 decimal places? 0.0000006 Round -0.24 to the nearest integer. 0 Round 11692800 to the nearest one million. 12000000 Round -54.74 to zero decimal places. -55 Round -463.3 to the nearest 10. -460 Round -12.7905 to the nearest integer. -13 Round -540 to the nearest 100. -500 What is 0.000003414 rounded to six decimal places? 0.000003 What is -0.0032742 rounded to 4 dps? -0.0033 What is 159 rounded to the nearest one hundred? 200 What is -175930000 rounded to the nearest one million? -176000000 What is 0.003831 rounded to 4 dps? 0.0038 What is 12.928 rounded to zero dps? 13 Round 3428000 to the nearest one million. 3000000 Round 0.0000139198 to seven dps. 0.0000139 Round 0.0000001131 to seven decimal places. 0.0000001 What is 0.056043 rounded to 3 dps? 0.056 Round -1422.29 to the nearest 10. -1420 Round 45.526 to 1 decimal place. 45.5 Round -5295 to the nearest 1000. -5000 Round 199 to the nearest 100. 200 Round 334000 to the nearest one hundred thousand. 300000 Round 8.7836 to 1 dp. 8.8 What is 0.00138728 rounded to four dps? 0.0014 What is -0.00120574 rounded to 4 decimal places? -0.0012 What is -0.196689 rounded to two decimal places? -0.2 What is 0.91205 rounded to two decimal places? 0.91 What is -2300400 rounded to the nearest 100000? -2300000 Round -40400 to the nearest 10000. -40000 Round -0.00014691 to six decimal places. -0.000147 Round -0.07715 to 2 dps. -0.08 What is -0.0000014249 rounded to seven decimal places? -0.0000014 What is -78810 rounded to the nearest ten thousand? -80000 Round 735 to the nearest ten. 740 Round -0.00000139741 to 7 dps. -0.0000014 Round -16.61 to the nearest integer. -17 What is 2019600 rounded to the nearest 10000? 2020000 Round 0.0024855 to 3 dps. 0.002 What is -32.5124 rounded to the nearest integer? -33 What is -80700 rounded to the nearest 1000? -81000 Round -4086200 to the nearest 1000000. -4000000 What is -0.000042554 rounded to 7 decimal places? -0.0000426 Round 0.0053389 to three decimal places. 0.005 What is -0.000003568 rounded to 6 dps? -0.000004 Round -287600 to the nearest ten thousand. -290000 Round -47.65 to 0 decimal places. -48 What is 61.49 rounded to the nearest 10? 60 Round 0.0358 to two decimal places. 0.04 Round 5950 to the nearest 1000. 6000 What is -0.01714 rounded to 3 decimal places? -0.017 What is -0.00013891 rounded to 6 decimal places? -0.000139 What is 0.0002094 rounded to 5 decimal places? 0.00021 What is -27.595 rounded to 1 dp? -27.6 What is 0.0204 rounded to the nearest integer? 0 What is -34638000 rounded to the nearest 1000000? -35000000 Round -408.9 to zero decimal places. -409 Round 0.0346 to 2 dps. 0.03 What is 3002000 rounded to the nearest one hundred thousand? 3000000 Round -1243900 to the nearest one million. -1000000 What is 57693000 rounded to the nearest one million? 58000000 Round 0.000984 to 5 dps. 0.00098 Round 0.072191 to 2 dps. 0.07 Round -4.1944 to one dp. -4.2 Round 0.000083673 to 6 dps. 0.000084 Round 1744 to the nearest 100. 1700 What is 11.237 rounded to the nearest integer? 11 What is -187.448 rounded to the nearest ten? -190 What is -270.1 rounded to the nearest 10? -270 What is -172.18 rounded to the nearest ten? -170 Round -0.126 to 2 dps. -0.13 Round 16913 to the nearest one thousand. 17000 What is -1551 rounded to the nearest 100? -1600 Round 0.0816 to 3 dps. 0.082 Round -0.00233455 to 4 decimal places. -0.0023 Round 15.923 to the nearest integer. 16 What is 0.000006563 rounded to six dps? 0.000007 Round -89.04 to the nearest integer. -89 What is -3442.4 rounded to the nearest 1000? -3000 Round 80300 to the nearest ten thousand. 80000 What is 0.000468 rounded to four dps? 0.0005 What is 0.0002006 rounded to three dps? 0 What is -209700 rounded to the nearest one hundred thousand? -200000 What is -26047 rounded to the nearest 100? -26000 What is 0.00023039 rounded to six decimal places? 0.00023 What is 0.000001919 rounded to six decimal places? 0.000002 Round -83.7 to the nearest 100. -100 What is -87.957 rounded to the nearest ten? -90 Round -0.000021161 to 6 dps. -0.000021 Round -10.12 to 1 decimal place. -10.1 Round -350.2 to the nearest 10. -350	{ "pile_set_name": "DM Mathematics" }
and give u. 77 Rearrange 12 - 3h2 + 8 - 25 + 2h to the form f + ph2 + sh and give s. 2 Express 28 - 7b2 - 28 as n + xb*2 + mb and give x. -7 Express (8l - 29l - 10l)(2l2 - 2l2 - l3) in the form ul + gl*2 + b + jl*4 + cl*3 and give j. 31 Express -4 + m + 4 - 5m + m + 3m + (-2 + 0 - 1)(-7m + 13m + 13m) in the form vm + k and give v. -57 Express -12k - 25 + 56 - 31 as ck + y and give c. -12 Rearrange 8t - 7t - 6t - 3t2 + t3 to jt3 + yt*2 + c + at and give a. -5 Express (3 - 3 + 2w)(-60w2 - 158 + 158)((-7 + 4 + 1)(0 + w + 0) - w - 1 + 1) as pw + l + kw2 + fw*3 + cw4 and give c. 360 Rearrange (-z3 + 0z3 - 3z*3)(z + 0 + 19 - 45) to n + pz3 + yz + mz4 + wz*2 and give p. 104 Express -2 + 5u + 11u + 2 in the form p + mu and give m. 16 Rearrange 2x4 - 76x*2 + 3 + 75x*2 + 0x*4 + 3x to the form gx3 + cx*2 + y + wx + px4 and give w. 3 Express 0p*2 + 6p*2 - 5p*2 + 6 - 5 - 3p in the form m + kp2 + wp and give m. 1 Express 14 - 3 - 11p2 - 11 as c + jp*2 + vp and give v. 0 Rearrange -n - 55n2 - n - 2 + 53n*2 + 2n*3 to the form s + wn*3 + on + zn2 and give z. -2 Rearrange -88 + p + 46 + 55 to mp + q and give m. 1 Express (r*2 + 3r*2 - 6r*2)(4r - 10r + 4r) as lr*3 + x + gr + ar2 and give g. 0 Rearrange 58 - 58 + 152i + 20i to the form yi + t and give y. 172 Express 0 - n + 0 + (2n - 2n - 3n)(1 + 1 + 1) + (-3n + 5n - n)(-1 + 3 + 0) in the form m + qn and give q. -8 Express (-2y - 2y + 3y)(-3 - 1 + 2) - y - y + 5y + 6y - 5y + 4y + (-2y + 2y - y)(6 - 1 - 3) in the form gy + w and give g. 8 Express m*2 - 51m + 1 + 0m2 + 0 + 44m in the form xm2 + rm + j and give r. -7 Rearrange 9b + 27b - b + 0b to the form u + nb and give u. 0 Express 10 - 88p + 19 - 29 in the form ap + g and give a. -88 Express (2i3 - 517i + 25i2 + 517i)(0 - 3 + 5) in the form ui*2 + ni + ji3 + l and give u. 50 Rearrange n4 + 61n*2 + 56n*2 - 118n2 + 2 - n3 + n to w + kn3 + mn + ln4 + bn*2 and give w. 2 Rearrange (2g*2 + 3g*2 - 3g*2)(-108 - 6g + 108)(-2 + 2 - 1) to the form mg + zg*3 + qg*2 + n and give z. 12 Express -3l*2 + 241 - 2l + 2l2 - 240 as vl + t + nl2 and give v. -2 Rearrange -3m*3 - 1 - 4m - 439m2 - 446m*2 + 893m*2 to the form am + u + cm3 + qm*2 and give a. -4 Rearrange (1 + 0 + 3)(-14 - 6r2 + 14) to the form jr*2 + qr + p and give j. -24 Express 121l2 + 41l*2 - 38l*2 as cl*2 + d + al and give c. 124 Express 4g + 15g*3 - 3 + 49g*4 - 48g*4 - 3g in the form dg2 + v + lg*4 + og*3 + hg and give h. 1 Express (-1 - 1 + 3 + (0 - 3 + 4)(-3 + 0 + 1) - 3 - 4 + 6 + 5 - 2 - 2)(w + w - 3w) as vw + u and give v. 1 Rearrange (-3x2 + 1 - x + x2 + 2x)(1223x - 1223x - 4x*2 - 2) to rx + fx2 + lx*4 + ix*3 + k and give k. -2 Rearrange 0v + 9v + 0v to cv + a and give a. 0 Rearrange (-113f + 113f + 12f*2)(-1 + 6 - 3) to af + qf*2 + t and give q. 24 Express (5 - 2 + 0)(-2d + d + 0d) as gd + y and give g. -3 Rearrange 2 + 37z - 2z2 - 12z*4 + 2z*3 + 13z*4 - 5 to mz*3 + jz*2 + pz*4 + yz + t and give t. -3 Express -2b2 + 14b*3 - 4 + 4b*2 - 27b*3 - b + 16b3 + b4 in the form cb + ab*3 + n + mb*4 + wb*2 and give m. 1 Rearrange (-3x - x + 3x)(-5x - 5x - 4x) to the form wx*2 + ux + z and give w. 14 Rearrange (-2 + 5 - 5)(-5k - 6k - 2k)(-6k*3 - 2 + 2) to jk + vk4 + z + xk*2 + uk*3 and give v. -156 Express (0 - 2m + 0)(3 - 5 + 4)(-3 - 6 - 1) as i + sm and give s. 40 Express (-f + 0 + 0 + (2 - 3 - 1)(1 - 2f - 1))(39f + 41f + 14f) in the form b + qf + uf2 and give q. 0 Express -207 - 32b*2 + 207 as ib*2 + fb + s and give i. -32 Express z*3 + 0z - 3z - 2z in the form xz3 + uz*2 + m + fz and give f. -5 Express -3 + p + 3 + 0 + p + 3 - 1 + (4p - 3p - 3p)(26 + 25 - 15) in the form m + dp and give d. -70 Rearrange (0g + 2g - g)(7 - 2g + 3g - 3g) to the form d + ig + jg2 and give j. -2 Rearrange (1 + 0 - 2)(-9 + 9 + 46x3) to the form p + bx + tx2 + jx3 and give j. -46 Express 5 - 7 - w3 + w*2 - 3w*3 in the form pw*2 + aw*3 + fw + i and give f. 0 Express 125q + 718 - 718 in the form jq + g and give j. 125 Rearrange (u + 2u - 2u)((-2 + 4 + 0)(-5u + u + 3u) - 12u + 1 + 6u - 4u) to l + nu*2 + au and give a. 1 Express -4j2 - 8j*2 - 2 - 4j*2 + 0j2 + j3 in the form aj3 + f + vj*2 + pj and give f. -2 Rearrange -5k2 - 5k*3 + 5k*2 + (0k + 0k - k2)(0 + 0 - k) - 3k3 + 4k*3 - 3k*3 to the form ak + w + hk3 + lk*2 and give h. -6 Rearrange 2s*2 + 39 + 0s*4 - 40 + 4s*4 to the form ys + is4 + g + zs*3 + os*2 and give i. 4 Rearrange -39l + 48l + 59l to the form vl + u and give v. 68 Rearrange s3 + 0s2 + s3 + 1 + 2s + 0s*2 to the form zs*2 + ns + q + ys3 and give y. 2 Express -2f + 2156 + 2f2 - 9f*3 - 2156 in the form x + nf*3 + bf + jf2 and give b. -2 Rearrange -19y*2 + 6736y*3 + 2 - 3 - 6737y3 + y4 to ty + oy*3 + vy*2 + iy*4 + x and give x. -1 Rearrange 0m*4 + 15m*4 + 9m4 + (-m2 + 2 - 2)(0m*2 - 4m*2 + 3m*2) to the form b + ym*3 + qm + am2 + im*4 and give i. 25 Rearrange -2a + 0a - 2a + 8a to the form v + pa and give p. 4 Express 0r2 - 5r*2 + 3r*2 + (r - r + 2r)(-4r - 6r + 44 - 47) as q + tr + ur2 and give u. -22 Rearrange -14063p + 14063p - 36p*2 + 2 to sp + r + ap2 and give a. -36 Express -2d*3 - 45d*2 + 45d*2 - 1 as pd*3 + b + yd*2 + md and give b. -1 Rearrange (-3 - 4c + 5 + 2c)(-69 + 24c + 69) to xc2 + vc + f and give x. -48 Rearrange (0 + 0 + 2s)(0s + 0s + 5s) + 2s*2 - 2s2 + s2 to cs + ys*2 + o and give y. 11 Express 1 - 45k*2 + 59k*2 + 1 - 52k*2 in the form qk + sk2 + c and give s. -38 Express (-2a + 10a + 0a)(-1 + 1 - a)(2a2 - 2a*2 + 2a*2) as ka*2 + la*4 + qa + ha3 + u and give u. 0 Express 114c4 + c3 - 2c - 52c*4 - 60c*4 in the form rc*2 + wc*4 + pc*3 + s + vc and give p. 1 Express 0j3 + 3j - j*4 + 6j*3 - 5j*3 as oj*4 + i + aj*2 + pj*3 + lj and give o. -1 Rearrange h3 - h2 - 3h3 + 2 + 0 to the form xh*3 + th*2 + nh + v and give t. -1 Express 2f4 - 6f4 + f2 + 2f3 + f + f2 - 3f*4 in the form zf + of4 + mf*2 + pf*3 + h and give o. -7 Express -67 + 3v + 67 in the form h + xv and give x. 3 Rearrange -4l*4 + 7l*4 + 2 + 8l*4 + 3l*2 to the form rl + m + tl2 + kl*3 + vl*4 and give v. 11 Express (0 + 0 + w)(-11 + 28 + 5) as i + aw and give a. 22 Rearrange 0c*2 - 4c*2 + 3c2 + c2 - c + c + (2c - 2c - c*2)(1 + 3 - 5) to a + gc2 + uc and give g. 1 Express (0 + 0 - 13y)(4 - 5 + 0)(1 + 3 - 2)(2 - 5 + 4) in the form r + hy and give h. 26 Rearrange 3 - 2 - 32j - 1 to the form wj + t and give w. -32 Rearrange -4y*4 - 2y*3 + 7y*3 + y - 4y*3 to iy*4 + d + jy*3 + py + ly2 and give p. 1 Express 2n + 4n3 - 4n4 + n2 + 3n2 - 6n*2 - 3n in the form qn4 + z + tn*2 + ln + vn3 and give t. -2 Express 0 + 4 - 4 + 2d*2 - 17d in the form vd + r + td*2 and give t. 2 Express -4 - 16b*2 + 4 as wb + vb2 + z and give v. -16 Express -25 - 2q*2 + 25 + 2q*2 - 3q + 3q + (2q - 1 + 1)(-4q + q + q) - 7q2 + 5q - 5q in the form u + hq*2 + nq and give h. -11 Rearrange 3t2 + 12t*3 - 3t2 + (2 - 2 - t2)(-2 - 2t + 2) to st3 + ct*2 + ht + b and give s. 14 Express -2 + 4 - 4 + 25g2 in the form dg*2 + cg + j and give d. 25 Rearrange (-19x4 + x4 + 8x*4)(4 - 2 + 0 + (0 + 4 - 3)(0 + 0 + 1) - 1 + 2 + 2) to the form j + ax + lx4 + tx*3 + dx*2 and give l. -60 Express 11 + 88j + 4 + 2j2 - 89j + 5 as v + kj + dj*2 and give d. 2 Rearrange (233v*2 - 521v*2 + 210v*2 + 1)(5 - 3 - 1) to the form zv + s + jv*2 and give z. 0 Rearrange 0q*4 + 2q4 - 7 + 9 - q4 - 4q3 to xq*4 + lq*2 + wq + fq3 + n and give x. 1 Express -7z*3 - 2z - 2z + 6z in the form pz*2	{ "pile_set_name": "DM Mathematics" }
4 - 1 - 2) to oy + b and give o. 2750 Rearrange -2x + 5x - x + x - 2x + 0x + (7 - 3 - 2)(x + 2 - 2) + (-6x - 8 + 8)(0 + 3 - 1) + 1 - 1 + x to sx + v and give s. -8 Rearrange 2p*3 - 3p + 525p2 + 289p*2 + 2p + p to rp + qp*2 + bp*3 + j and give b. 2 Express 1084c + 250c + 561c as i + bc and give i. 0 Rearrange 48b - 1 - 4 + 11 - 42b to yb + a and give a. 6 Express -u*2 + 2u*2 - 3u*2 + (-12 + 12 + 7u*2)(0 - 3 + 4)(46 + 3 + 30) in the form x + ru + au2 and give a. 551 Rearrange 66a*2 + 106a - 24a2 - 40a*2 + 73a to x + ra2 + qa and give r. 2 Rearrange -3n2 + 159013n*4 - 159012n*4 - 44n*3 + 32 - 33 + 2n to a + yn3 + mn*4 + kn + ln2 and give a. -1 Rearrange -27x*2 + 9x*3 + 27x*2 - 63x*2 + 63x*2 + 12x*3 + (2x - 4x + 3x)(-x2 + 4x*2 + 6x*2) to u + jx*3 + sx*2 + ax and give j. 30 Express -2t + 2 + 0 - 70069t*2 + 70949t*2 as bt*2 + a + ht and give h. -2 Rearrange 3655s - 1063s + 4125s - 1682s to the form g + cs and give c. 5035 Rearrange 378k*3 + 381k*3 - 3k*4 + 391k*3 + 376k*3 - 2k*2 - 1392k*3 to the form hk*2 + fk*4 + w + dk + ok3 and give f. -3 Rearrange 11r*3 + 4r2 - r2 + 296 + 297 - 6r3 - 3r*3 to nr*2 + zr*3 + yr + v and give y. 0 Express -2j2 + 3923j + 3j2 + j4 - 10j3 - 6 + j4 - 3925j as t + sj*4 + xj + bj2 + wj*3 and give t. -6 Express -14a + 99 + 7a + 17a - 29 in the form ma + c and give c. 70 Rearrange 3v + 1418v4 - 1429v*4 + 2v3 - v3 - 3v + 15 - v - v2 to tv*4 + av + p + ov3 + cv*2 and give a. -1 Express (7m - 5m + 3m)(840 + 153 - 86) in the form wm + f and give f. 0 Rearrange -18a2 - 1 + 34a + 3 + 9a2 + 7a*2 to the form m + ia*2 + ja and give j. 34 Rearrange (-27g2 - 11g*2 + 56g*2)(4 + 2 - 4) - 2g2 + 3 - 3 + (g2 + 0 + 0)(0 - 3 + 4) - 211g + 211g + 20g2 to og*2 + y + mg and give o. 55 Express (2 - 2 + r)(-2 + 237r - 255r - 618r + (0 + 2r + 0)(1 - 7 + 1)) as tr + f + pr*2 and give f. 0 Express (3 - 2r - 3)((-4 - 3 + 3)(3 + 2 - 3) + (3 - 5 - 1)(57 - 41 + 130)) in the form k + tr and give t. 892 Rearrange 514g + 1185g + 949g - 174g to the form fg + h and give h. 0 Express 53407 - 53402 - 2d + 7d as x + sd and give s. 5 Express 92 - c - 143 - 143 - 696 as m + uc and give u. -1 Rearrange (-2 + 1 + 0)(-34q4 + 166q*4 + 29q*4) + 4q*4 - 6q*4 + 3q*4 to nq*3 + iq*4 + sq + lq2 + c and give i. -160 Rearrange -486v + 5 + 6 + 2 + 9 - 23 to rv + p and give p. -1 Rearrange -42 + 409t*2 + 165 - 26 - 50 - 50 to c + ft*2 + at and give a. 0 Rearrange (0g + 0g - 2g)(13 + 64 - 4 - 2g) to y + qg + kg2 and give k. 4 Rearrange 701 - 26d + 638 - 1403 - 27d to n + ud and give n. -64 Express 2 + 4v3 + 3v*3 + 13v*4 + 101v*2 + 20v*3 - 104v2 + v3 as o + wv4 + iv*2 + sv*3 + fv and give s. 28 Rearrange -152 - 4q2 - 4q*2 - 727 + 10q*2 to the form rq + wq2 + y and give w. 2 Express 1100h + 2471h - 707h - 897h as gh + n and give g. 1967 Express (0a2 - 2a*2 + 3a*2)(1035a + 93a*2 - 1035a) + 10a4 - 10a*4 - 16a*4 in the form ia*2 + ba*3 + va + ha4 + w and give v. 0 Rearrange -2998k + 1 + 36042k3 - 36043k*3 + 0 - 86k to the form dk + r + uk*2 + fk*3 and give r. 1 Express 191y*4 - 1889y*4 - 1578y4 + (-1 + y4 + 1)(0 - 3 + 1) as h + ky*2 + zy*4 + vy + xy3 and give z. -3278 Rearrange -482s*2 + 9s*2 - 3s*3 - 8s*3 + 8s*3 + 4s*3 - 2 to the form us*3 + hs + a + ks2 and give k. -473 Express (8u - 3u - u)(-1 + 1 + u)(15u - 16u + 10u)(106 + 78 - 100) as du*3 + xu + ju2 + t and give d. 3024 Express (-1 - 4 + 3 - 3 + 5 - 1 + (1 + 1 - 1)(2 + 2 - 3) - 2 + 2 - 1 + (-1 + 2 - 2)(-1 + 1 - 6))(-6 - 4 - 1)(u - 3u + 0u) in the form vu + i and give v. 110 Express c + 0c4 + 2c*4 - 2698 - 291c*3 + 2696 as lc + vc2 + xc*4 + y + zc*3 and give x. 2 Express 14o - 16o + 1 + 0 + 17o*2 + 67o*2 in the form z + io*2 + yo and give i. 84 Rearrange 2655214 - 2655214 - 1810v - 9v*2 to cv*2 + uv + l and give u. -1810 Rearrange (-2 - 1 + 5)(1 + 2 + 1)(3361t - 24t + 3176t - 1540t) to x + dt and give d. 39784 Express 6192 - 28u - 63u - 6204 in the form c + ku and give c. -12 Express -j*3 + 3j3 + j3 + (2 - 2 - 3j)(-4195j + 340j*2 + 4195j) in the form uj2 + a + fj*3 + kj and give f. -1017 Express (-3 + 3 + 2)(4 + 2 - 5)(0 + 2 - 4)((1 + 3 + 5)(-4t - 4t - 3t) + (-2t - 5t + 5t)(2 - 5 + 4)) in the form ht + x and give x. 0 Rearrange -34o2 + 82o*2 + 17o*2 + (-4 + 4 + 2o)(3o - o - o) to the form mo2 + g + xo and give m. 67 Express -2 + 571h + 558h + 3h3 - 1147h - h*2 in the form wh*3 + uh + mh2 + p and give u. -18 Rearrange (-9 + 38i + 15 + 4 + 184i - 2050i)(-2i*2 + 2i2 - i2) to the form yi2 + z + bi*3 + oi and give y. -10 Express -13v - v3 - 4 + 11v + 2664v4 + 2v*2 - 2584v*4 in the form b + av*3 + jv*4 + qv + zv2 and give q. -2 Rearrange (20 - 10m - 20 + (2 + 11 - 1)(-578m + 175m + 259m))(-1 + 1 - 2m) to rm2 + xm + l and give r. 3476 Express (6810 + 348 + 424 + 619 + 898 + 229)(-4x*2 + 3x2 - x2) as ix + c + gx*2 and give g. -18656 Rearrange 4945d*2 - 12d*3 + 4991d*2 + 5 - 9923d*2 + 2d to p + td2 + md*3 + ad and give t. 13 Express 5885f2 + 2226f*2 - 2181f*2 + 2672f*2 as mf*2 + v + lf and give m. 8602 Rearrange (j*2 - 4j*2 + 2j*2)(-8340j + 2128097 - 2128097 - 1580j) to the form o + gj3 + ij*2 + qj and give g. 9920 Rearrange (13j + 18j - 22j + j2 + 16j)(7 - 9 - 3) to tj*2 + fj + a and give t. -5 Rearrange -5109 + 3l2 + 2583 + 2644 to the form t + dl + bl2 and give t. 118 Rearrange (-5k + 5k + k)(-124930k + 207k*2 - 164k*2 + 120 + 124930k) to q + zk3 + dk + lk2 and give d. 120 Rearrange -23723o + 23721o - 2708 - 12038 to yo + z and give y. -2 Rearrange 2 - 69x - 3458x - 913x - 69853x*2 + 69851x*2 + 678x to px2 + ux + g and give g. 2 Express 165j + 2j3 + 1 - j2 + 36 + 11 - 10 - 181j as nj + mj2 + f + yj*3 and give y. 2 Express 3969w + 2879w - 2776w + 1702w in the form m + fw and give f. 5774 Rearrange -150v2 + 5831v*2 + 5446v*2 + 2555v*2 to the form n + cv + tv2 and give t. 13682 Express -5352 - 4263x*2 + 5352 as gx*2 + tx + m and give g. -4263 Rearrange (855 - 250 + 1779 - 10096 + 2069)((0 + 0 - 2)(2o2 - 3o*2 + 2o2) + o2 + o*2 - 4o*2) to the form s + do + ao2 and give a. 22572 Rearrange (-16 - 2 - 24)(-3 - 3 + 5)(-15a + 2a - 11a) to the form da + p and give d. -1008 Rearrange -57i - 134i2 + 56i - 348i2 + 35i*2 - 67i*2 to the form oi + xi2 + j and give o. -1 Rearrange (-62t*2 - 190t*2 + 66t*2)(-8t2 + 5t*2 - 2 + 0) to the form zt*4 + st*3 + wt + rt2 + y and give s. 0 Express (320r - 2 + 1 - 309r)(-16r + 7r + 17r) in the form n + zr + vr2 and give v. 88 Express 23 + 18 + 14 - 59 - 68k*3 as tk*2 + o + yk + jk3 and give o. -4 Rearrange (14j*3 + 6j*3 + 6j*3)(-13j + 193 - 192 + 54j) to f + bj3 + nj + uj4 + gj*2 and give n. 0 Express (-3 - 1 - 2)(-2h - 2h + 6h) + 28 - 2 - 20 - 8 - 869h + (0h + 0h - h)(-2 - 2 + 6) - 2h - 5h + 5h as q + mh and give q. -2 Express 2615 - 1306 + 7318r - 1309 in the form j + or and give o. 7318 Express -2 + 44d*2 - 2 - 46d*2 - 10d + 33d as r + pd + td2 and give t. -2 Rearrange 112 + 144 - 9j - 255 + 68j3 - j2 to the form hj + sj3 + gj*2 + l and give h. -9 Express 4129k*2 + 2k*3 - 9k*3 + 4 - 4127k*2 - 4 as mk*2 + l + jk + nk3 and give j. 0 Express (j2 + 2j*2 - 4j*2)(3 - 3 - 2) + 33431j2 + 567j*2 + 70549j*2 + 1 - 1 + 6193j*2 in the form a + rj*2 + ij and give i. 0 Rearrange (-2 + 1 - 1)(-88 + 88 - 19v*3) - 3v*3 - 3v*3 + 4v*3 + (2v*2 - 3v + 3v)(4v - 7v - 2v) to uv*3 + lv + b + dv2 and give u. 26 Express -532c - c*3 - 7c*3 + 599c - 1 + 2c3 - c2 as dc*3 + hc*2 + z + gc and give d. -6 Rearrange (0 + 0 - l*2)(0	{ "pile_set_name": "DM Mathematics" }
n'th term of 935, 2466, 4571, 7250, 10503, 14330? 287n2 + 670n - 22 What is the f'th term of 136597, 136462, 136171, 135670, 134905, 133822, 132367? -9f3 - 24f*2 + 136630 What is the p'th term of -3297, -3371, -3439, -3501, -3557, -3607? 3p*2 - 83p - 3217 What is the i'th term of 365, 410, 507, 698, 1025? 7i3 - 16i*2 + 44i + 330 What is the l'th term of 2858709, 5717520, 8576331, 11435142? 2858811l - 102 What is the d'th term of 4023, 4530, 5011, 5460, 5871? -d3 - 7d*2 + 535d + 3496 What is the y'th term of 51669, 101598, 151527? 49929y + 1740 What is the q'th term of 81448, 81136, 80824, 80512, 80200? -312q + 81760 What is the y'th term of 4817868, 4817880, 4817898, 4817922, 4817952, 4817988? 3y2 + 3y + 4817862 What is the x'th term of -251747, -251836, -251925, -252014, -252103, -252192? -89x - 251658 What is the l'th term of 6418, 14739, 23064, 31393, 39726, 48063? 2l*2 + 8315l - 1899 What is the q'th term of -37059, -74572, -112539, -150966, -189859? -q*3 - 221q*2 - 36843q + 6 What is the b'th term of 1834, 7428, 16774, 29890, 46794, 67504, 92038? 3b3 + 1858b*2 - b - 26 What is the b'th term of -408, -959, -1660, -2523, -3560, -4783, -6204, -7835? -2b*3 - 63b*2 - 348b + 5 What is the w'th term of 1040, 1475, 2068, 2819, 3728? 79w2 + 198w + 763 What is the i'th term of -22768, -22823, -22918, -23053, -23228, -23443? -20i2 + 5i - 22753 What is the y'th term of 1485, 11146, 37355, 88386, 172513, 298010, 473151, 706210? 1379y3 + 8y + 98 What is the m'th term of 326457, 1305823, 2938097, 5223279, 8161369, 11752367? 326454m2 + 4m - 1 What is the l'th term of -218927, -437867, -656811, -875759, -1094711? -2l2 - 218934l + 9 What is the g'th term of 2148, 9723, 22728, 41163? 2715g2 - 570g + 3 What is the z'th term of 13448545, 13448548, 13448551? 3z + 13448542 What is the o'th term of -107286347, -214572714, -321859079, -429145442? o2 - 107286370o + 22 What is the f'th term of 130360, 130665, 130972, 131281, 131592, 131905? f*2 + 302f + 130057 What is the j'th term of -17623, -35116, -52503, -69784, -86959, -104028? 53j2 - 17652j - 24 What is the s'th term of 119, -55, -333, -727, -1249, -1911, -2725? -2s3 - 40s*2 - 40s + 201 What is the l'th term of 5586, 44735, 151062, 358179, 699698, 1209231, 1920390, 2866787? 5602l3 - 23l*2 + 4l + 3 What is the x'th term of 749, 2707, 5895, 10313, 15961? 615x2 + 113x + 21 What is the i'th term of -17987, -34360, -50733, -67106, -83479, -99852? -16373i - 1614 What is the s'th term of 284127, 568471, 853029, 1137801? 107s*2 + 284023s - 3 What is the h'th term of 302123551, 302123552, 302123553? h + 302123550 What is the o'th term of -7409589, -7409588, -7409587? o - 7409590 What is the h'th term of -8432, -69592, -235598, -558872, -1091836, -1886912, -2996522? -8737h3 - h2 + 2h + 304 What is the j'th term of -17085946, -17085959, -17085988, -17086039, -17086118, -17086231, -17086384, -17086583? -j*3 - 2j*2 - 17085943 What is the r'th term of -77527, -77604, -77701, -77818, -77955, -78112? -10r*2 - 47r - 77470 What is the b'th term of -205012, -409935, -614858, -819781, -1024704? -204923b - 89 What is the v'th term of -9212, -17759, -26282, -34769, -43208, -51587? 2v*3 - 8561v - 653 What is the m'th term of 7569, 59835, 201719, 478029, 933573, 1613159? 7468m3 + m2 - 13m + 113 What is the h'th term of -16070719, -16070722, -16070727, -16070734, -16070743, -16070754? -h*2 - 16070718 What is the i'th term of -5871688, -5871665, -5871642, -5871619, -5871596, -5871573? 23i - 5871711 What is the k'th term of -1023559, -1023519, -1023479, -1023439? 40k - 1023599 What is the q'th term of -33053, -34484, -36867, -40202? -476q*2 - 3q - 32574 What is the m'th term of -7058, -28584, -64534, -114908? -7212m2 + 110m + 44 What is the v'th term of 60, 2505, 4894, 7233, 9528? v*3 - 34v*2 + 2540v - 2447 What is the n'th term of -3067677, -12270703, -27609079, -49082805, -76691881, -110436307? -3067675n2 - n - 1 What is the c'th term of 922, 10429, 36078, 85939, 168082? 1345c3 + c2 + 89c - 513 What is the z'th term of -3596, -7523, -11452, -15383, -19316? -z2 - 3924z + 329 What is the y'th term of 877, 943, 1007, 1069, 1129? -y*2 + 69y + 809 What is the w'th term of 103937, 208029, 312123, 416219, 520317, 624417? w*2 + 104089w - 153 What is the p'th term of -56380, -112924, -169626, -226486, -283504, -340680, -398014? -79p2 - 56307p + 6 What is the w'th term of -6157, -2350, 7961, 28028, 61103, 110438, 179285? 542w3 + 13w - 6712 What is the h'th term of 3311, 3279, 3273, 3293, 3339? 13h2 - 71h + 3369 What is the l'th term of -4474, -17922, -40320, -71638, -111846, -160914? 5l3 - 4505l*2 + 32l - 6 What is the i'th term of -3856, -5120, -6384? -1264i - 2592 What is the o'th term of 6305407, 12610732, 18916057, 25221382, 31526707? 6305325o + 82 What is the i'th term of -4253, 4533, 19179, 39685, 66051, 98277? 2930i2 - 4i - 7179 What is the y'th term of 2721, 3875, 5043, 6231, 7445, 8691, 9975, 11303? y3 + y2 + 1144y + 1575 What is the k'th term of 442887, 885777, 1328667, 1771557, 2214447, 2657337? 442890k - 3 What is the u'th term of 13380082, 26760166, 40140250, 53520334, 66900418, 80280502? 13380084u - 2 What is the y'th term of -43597, -85913, -128231, -170551, -212873? -y2 - 42313y - 1283 What is the r'th term of 4171019, 4171018, 4171017, 4171016, 4171015, 4171014? -r + 4171020 What is the a'th term of 75334, 75952, 76570, 77188, 77806, 78424? 618a + 74716 What is the o'th term of 235, 425, 731, 1141, 1643, 2225, 2875? -2o*3 + 70o*2 - 6o + 173 What is the k'th term of 161494, 645945, 1453366, 2583763, 4037142? k*3 + 161479k*2 + 7k + 7 What is the x'th term of -97548103, -97548107, -97548111, -97548115, -97548119? -4x - 97548099 What is the g'th term of 224, 954, 2258, 4136? 287g*2 - 131g + 68 What is the o'th term of -15672409, -31344814, -47017221, -62689630? -o*2 - 15672402o - 6 What is the c'th term of -99958, -199836, -299710, -399574, -499422, -599248? c*3 - 4c*2 - 99873c - 82 What is the r'th term of 12454863, 12454864, 12454865? r + 12454862 What is the u'th term of 8435515, 8435489, 8435463, 8435437, 8435411? -26u + 8435541 What is the d'th term of -27692, -27739, -27794, -27857, -27928, -28007? -4d*2 - 35d - 27653 What is the o'th term of -68396, -272648, -613070, -1089662, -1702424, -2451356? -68085o2 + 3o - 314 What is the t'th term of -88, 1113, 3218, 6311, 10476? 14t3 + 368t2 - t - 469 What is the s'th term of -55015, -110049, -165107, -220195, -275319, -330485, -385699? -s3 - 6s2 - 55009s + 1 What is the j'th term of -2465444, -2465471, -2465498, -2465525? -27j - 2465417 What is the h'th term of 776044, 1552272, 2328500, 3104728, 3880956, 4657184? 776228h - 184 What is the w'th term of 185831, 185837, 185849, 185867, 185891, 185921, 185957? 3w2 - 3w + 185831 What is the d'th term of 55269, 55303, 55341, 55383, 55429? 2d2 + 28d + 55239 What is the i'th term of -1701, -6689, -14955, -26487, -41273, -59301, -80559, -105035? 2i3 - 1651i*2 - 49i - 3 What is the m'th term of -507, -1962, -4389, -7788, -12159, -17502, -23817? -486m2 + 3m - 24 What is the x'th term of 690, 311, -272, -1041, -1978? 3x3 - 120x*2 - 40x + 847 What is the n'th term of 5082381, 20329497, 45741357, 81317961, 127059309, 182965401? 5082372n2 + 9 What is the o'th term of 334163, 334179, 334195, 334211, 334227? 16o + 334147 What is the g'th term of 2835873, 11343465, 25522773, 45373791, 70896513, 102090933, 138957045, 181494843? -g*3 + 2835864g*2 + 7g + 3 What is the a'th term of 4866, 1659, -1548, -4755? -3207a + 8073 What is the i'th term of 25269205, 50538494, 75807783? 25269289i - 84 What is the j'th term of 57040, 59197, 65050, 76447, 95236, 123265, 162382, 214435? 308j3 + j + 56731 What is the d'th term of 1518, 1444, 1274, 960, 454, -292? -8d*3 - 18d + 1544 What is the m'th term of 303, 2091, 6947, 16443, 32151, 55643? 262m3 - 38m*2 + 68m + 11 What is the k'th term of -761643, -1523285, -2284927, -3046569, -3808211, -4569853? -761642*k - 1 What is the i'th term of 7181	{ "pile_set_name": "DM Mathematics" }
d - 3 + 3d). 4d + 6 Expand -4 + 4 - r + (0r + 0r + 2r)(3 - 2 - 3) + ((4 - 2 - 4)(1 - r - 1) + 2r + 11r - r)(-6 + 3 + 2). -19r Expand (3k2 - 13k*2 + 5k*2)(-2k - k + 0k). 15k3 Expand (-w + 5 - 5)(18 - 18 + 5w2) + 0w - w*3 + 0w. -6w3 Expand ((-1 - 1 + 1)(2h - 3h - h) + h - h - 3h)(3h + 4h - 2h) - h + h2 + h + (3h + 2h - 4h)(2h - 3h - h). -6h*2 Expand ((-5x + 4x + 3x)(-1 + 6 - 3) - x + x - x + 2x + 2x - 2x)(1 - 1 - 2). -10x Expand -2b3 - 2 + 2 + (2 - 3b*3 - 2)(3 + 1 - 2) + 1 - 2b3 - 1 + (-1 - 2b*3 + 1)(0 + 1 - 3). -6b3 Expand (3t*3 - 4t*3 + 0t*3)(6 + 3 - 4). -5t3 Expand -3z*4 + 2 - 2 + (2z2 - z2 - 2z2)(2z2 - 2z2 - z2). -2z4 Expand 2k + 0 + 0 + (3 - 5 + 1)(-2k - k + 5k) + 4k - 23k - 4k. -23k Expand (-7u*3 - 1 - 12u*3 + 13u*3)(u*2 + 0u*2 - 2u*2). 6u5 + u2 Expand -3i5 + 0 + 0 - i5 - 2i*5 + 0i*5 + (5i - 5i + i)(3i4 + i4 - 3i*4) + (-2i + 2i + 3i)(-3i4 + i4 + 0i4). -11i*5 Expand (-3 + 4 - 2)(-5 + 1 - 3h + 2 + 3h + h - 2h + (0 - 2 - 9)(-4h + 5h - 3h)). -21h + 2 Expand -1 + 4b + 0b - 7b4 + 5b*4 + (-2b + 4b - 3b)(-4b*3 + 3b*3 + 0b3). -b4 + 4b - 1 Expand 2z*3 - 2z*4 - 2z*3 + (-18z*2 - 95z + 95z)(-3z2 + 3z2 - z2). 16z4 Expand (-2u*2 + 4u - 4u)(1 + 2u - 4u + 0u). 4u*3 - 2u*2 Expand (-4h - 3h + 5h)(5 - 12 + 5). 4h Expand -2 - 4q3 + 2 + (q2 + 2q*2 + 0q*2)(6q + 0q - 3q). 5q*3 Expand -8l*2 - 5l*4 + 8l*2 + (3l + 0l - l)(-l + 2l3 + l). -l4 Expand (23s + 36s3 - 23s)(2s - s + s). 72s4 Expand (-2 + 0 + 0)(-4m - m + 4m)(-1 - 2 + 4). 2m Expand (-142 + 142 + 18n)(-5n3 + 5n*3 - 2n*3). -36n*4 Expand 0x4 - x4 - 3x4 - 5 + 2x*4 + 5 + (-2x*2 - 3x*2 + 3x*2)(-2x2 + 0x + 0x) + 5x*4 - 2x4 - x4. 4x4 Expand (2d2 + d2 - 5d2)(-5040d + 5040d - d*2 + 27). 2d*4 - 54d*2 Expand (-6h - h + h)(h - 3h + 0h)(2h - 3h*2 + 2h + 2h2). -12h*4 + 48h*3 Expand (8s - 9s - 2s - 2)(0s - 4s - 3s). 21s2 + 14s Expand (-3866 + 3866 + 162k2)(-2k3 - 3 + 3). -324k*5 Expand (-10 + 8 + w + 0w)(4w - 4w + 3w*2). 3w*3 - 6w*2 Expand 7j*3 - 48j*2 + 48j*2 + 3j*3 - 2j3 + j3 + (-5j + 2j + j)(1 + 2j2 - 1) + j3 - 2j3 - j3. 3j3 Expand (f2 - 7f2 + 3f*2)(3 + 5 - 3). -15f2 Expand (-i2 + 19i*4 - 45i*4 + 13i*4)(3i + 3i - 5i). -13i5 - i3 Expand 3a - 2a*3 - 3a + (-3a - 2a + 4a)(3a - 3a - a*2) + 4a*3 - 2a*3 + 0a*3 + (-2 - 2a + 2)(-2a*2 + 1 - 1). 5a*3 Expand -14b*2 - 26b2 - b2 + (-2b + 4 - 4)(-b + 4b - 5b). -37b2 Expand -1 + 1 + l + (-l + l + 2l)(3 - 4 + 0) + (-3l + l + 3l)(-1 + 0 - 1). -3l Expand (1 - 3 + 0)(12g - 3 - 5g + 4). -14g - 2 Expand 2u*5 + 4u*4 - 4u*4 + (-3u + 3u - u4)(u + 4u - 7u). 4u5 Expand (-1 - j2 + 1)(184 - 184 + 24j) + (-3 - j2 + 3)(j - j + j). -25j3 Expand (-6j + 4j + 3j)((0 - 9 + 11)(0 + 4 - 3) + 1 + 1 - 3 + (5 - 4 + 0)(-1 + 0 + 3) + 1 + 3 - 2). 5j Expand (-121 - 124 + 235 - 2n)(0n + 3n - 4n). 2n*2 + 10n Expand (0o + 3o - o)(-3o + o + 3o)(2o2 + 4o*3 - 10o*3 - 12o*3). -36o*5 + 4o*4 Expand (22p*2 - 1530p + 1530p)(-3p3 - 4p*3 + 6p*3). -22p*5 Expand (4b + 2b - 2b)(7 - 3 - 2b + 0b). -8b*2 + 16b Expand (1 - 2 - 2)(3y - 2y + y - y + 1 - 1 + 0 + 0 + 2y + (3 - 3 - 3y)(-5 + 0 + 3)). -27y Expand 0u*2 + 0u*2 - 3u*3 + (-2u - 12 + 12)(4u*2 - 2u2 - u2). -5u3 Expand (3s - s + s)(4s2 - s2 - 2s2). 3s*3 Expand (123 + 125 + 279k*2 - 248)(-2k3 + 2k3 - k3). -279k5 Expand (2 - 5 + 2)(-3v2 - 2v*2 + 4v*2 - v + v - 2v*2 + (3v + 5v - 2v)(0v - v + 0v)). 9v2 Expand (j3 - 2j + 7j - 6j)(0 + 0 + 2). 2j3 - 2j Expand 0l2 + 0l2 - l2 + (-3l + 3l + 2l)(-4l + 2l + 0l) + l2 - 2l*2 + 2l*2 - 17 + 21l*2 - 8l*2 - 15l*2. -6l*2 - 17 Expand -2b*3 - 3b*3 + 3b*3 + (-b + 2b + 0b)(-2b2 + 4b2 - b2) + 11b3 + 0b*3 - 13b*3. -3b*3 Expand (0m + 0m - 2m)(-m - m - m)(-3 + 5 - 1) - 6m2 - 5m*2 + 4m2. -m2 Expand 2d4 - 2d4 + d4 + (0d2 + 6d*2 - 5d*2)(d*2 - 3 + 3). 2d*4 Expand -7s - 1 - 29s5 + 31s*5 + 0s + (-6s3 + 3s3 + s3)(0s*2 + 0s2 - s2). 4s5 - 7s - 1 Expand 3i3 + i3 - 6i3 + i3 - i*3 - 2i*3 - 5i*3 + 4i*3 + 0i3 + i3 + 4 - 4 + (2 - 2 + i)(5i*2 - 3i2 - i2). -3i3 Expand (-2 + 6 - 3)((3s + 0s - 2s)(3s3 - s3 - s3) - 3s*2 + 2s*4 + 3s2 + 6 + s4 - 6)(0 + s + 0). 4s*5 Expand 3p*3 - 3p3 + p3 + (5 - 9 + 8)(3p3 - p3 - p*3). 5p*3 Expand 3c3 + c3 - 2c3 - 2c*2 + (-1 - c + 1)(c2 - c2 - 2c2) + 3c*3 + 3c*3 - 4c*3. 6c*3 - 2c*2 Expand (-8r*5 - 4 + 9r*5 + 6 + 4r*4)(-1 + 5 - 2). 2r5 + 8r*4 + 4 Expand -7k4 - k4 - 57k4 + (0k*3 + 0k*3 + 2k*3)(-1 - 2k + 1) - 4k4 + k4 + 4k4. -68k*4 Expand (-w + 8w - 6w)(3 + w + 2w - 1)(-w + 2w + 0w). 3w3 + 2w*2 Expand (-8z - 6z + 5z)(5z - z*2 - 5z). 9z3 Expand (-4b + 0b + b)(2 - 2 - 5) + (-3 + 1 - 2)(-2b - b + 2b). 19b Expand 7d4 + 6d*4 - 5d*4 + (3d3 - d3 - 4d3)(-3d + d + 0d). 12d4 Expand (-4m - 3m + 5m)(m2 - 3m*2 + 0m*2) + (-2m2 + m2 + 2m2)(-2m + 0m - 9m) - 2m*3 - 2m*3 + 2m*3. -9m*3 Expand (-4x*2 + 5x2 + x2)(5 + x2 - 10 - 2x + 7). 2x4 - 4x*3 + 4x*2 Expand 20k - 15k + 29k + (-4k + k + 2k)(0 + 0 - 1). 35k Expand 0j5 - 3j*5 + 2j5 + j5 + 3 - 3 - 2j5 - 1 + 1 + (2j*4 + 0j*4 + 0j*4)(2 - j - 2) - 2j4 + j5 + 2j*4 + 0j*5 + 5j5 + j5. 3j5 Expand 3v - 3v + v2 + (-v - 2 + 2)(v + 2v - 4v) - 7v2 + 6v*2 + 18v*2. 19v*2 Expand (0a*5 + 2a5 - a5)(5 + 8 - 10). 3a*5 Expand -9a*2 - 5a*2 + 10a*2 + (-3 + 5 - 3)(-4a + 4a - 2a2). -2a2 Expand (r4 + 5r4 - 5r*4)(-4r + r + r) - r5 + 21r*3 + 22r*3 - 33r*3 - 2r*4 - 2r*5 + 2r*4. -5r*5 + 10r*3 Expand (886f*2 - 886f*2 - 29f*3)(-3f - 2f + 3f)(1 + 1 - 4). -116f4 Expand 0i3 - i3 - i3 + (3 - 3 + i2)(i - 2i - i) - i*3 - 5i*3 + 4i*3. -6i*3 Expand (s - 2 + 2)(21 - 10s + 4s + 5s). -s2 + 21s Expand -14j - 2j + 6j - 1 - 2j + 1 + (4 - 1 - 1)(4 - 2j - 4). -16j Expand (y + 2y + y)(-y - y + 4y). 8y2 Expand (-2 - 2 + 5)(3 - 3 + 3j) + 0 - 2j + 0 + 4j - 5j + 3j + (j + 3j - 2j)(0 - 1 + 2) + 4 - 4 + 2j + j - 3j + j. 6j Expand (-3 + 2n + 3)(3n + 0n - n) - 479 - 39n*2 + 479. -35n*2 Expand -2c*2 + 4c*2 + 6 - 4 + (6 - 6 - 8c)(-1 + c + 1) - 2c*2 - 1 + 1. -8c*2 + 2 Expand (0z - z*2 + 0z)(228z - 10 + 10 + 159z). -387z*3 Expand 31n + 2n5 - 31n + (2 - n*2 - 2)(2n - 4n*3 - 2n). 6n5 Expand (-3 + 0 + 6)(-a*4 + 0a*4 + 3a*4 + (-a + 0 + 0)(-3a3 + 3a3 + a3)). 3a4 Expand -21x*2 + 21x*2 - 23x*5 - 18x5 + (0 + 0 - x2)(4x*3 - 3x*3 - 2x*3). -40x*5 Expand (-2 - 1 + 2)(l - 1 + 1)(95l + 55l - 120l). -30l2 Expand 3s - 3s + 3s + (-3 - 2 + 2)(5s - 2s - s). -3s Expand (-11 - 4b + 9 + 4)(-3 - 2b2 + 3). 8b*3 - 4b*2 Expand 7l + l - 5l + (2l - 3l + 0l)(-2 + 5 - 2) + l - 4l + 2l + (-3 - 2 + 2)(-5l + 3l + l). 4l Expand (3 - 6 + 2)(9b - 9b + 3b3 + (-b + 3 - 3)(b - b - b*2) - 4b*3 + 5b*3 - 3b*3). -2b*3 Expand (2y - 2y - y)(0y2 + 4y*2 - 2y*2) + 11y*3 - 61y*3 - 28y*3 + (0 + 0 + y)(-3y2 + y - y). -83y*3 Expand (-o - 2o*3 + o)(-o - 2o + 2o) - 4o4 + o4 + 5o*4 - 3o*4 + 6o*4 - 4o4 + (o2 + 3o2 - 2o*2)(o*2 + 0o2 + o2). 7o4 Expand (0r - r + 6r)(-2r + 2r*2 + 2r). 10r3 Expand (-6v2 + v2 - 20v2)(-7 + 4 + 2). 25v2 Expand (-1 - j + 1 + (-4 + 4 + 2)(-3j + 4j - 2j) + 6j - 5j - 2j)(-228j + 228j + 17j*2). -68j*3 Expand (-20k + 0k + 4k)(-2k*4 + 2k*4 + 2k4) + k5 + 0k4 + 0k*4 + (-4k + 2k + 3k)(0k2 + k4 + 0k2). -30k*	{ "pile_set_name": "DM Mathematics" }
= -3s - 4h, 4s - 187 = 3h. Calculate the remainder when s is divided by -11(-1 - 4/1 - -3). 21 Let c = 87 + -62. Suppose -5 = 5s, -4s = 4p + c - 105. Calculate the remainder when 62 is divided by p. 20 Let c = -32 + 39. Calculate the remainder when 31 is divided by c. 3 Let m(t) = t3 + t2 + t - 12. Let n be m(0). Let v = -20 - n. Let w = -1 - v. Calculate the remainder when 13 is divided by w. 6 Suppose 2m = -3s + 10, -1 = -m - 2s + 4. Suppose -4d + 0d + 25 = 3b, -mb - d = -19. Calculate the remainder when b is divided by 3. 0 Let y(s) = -s2 - 6s + 10. Let n be y(-7). Suppose -l + n = -3. What is the remainder when 21 is divided by l? 3 Suppose k + 14 = 2k. Suppose -3m - m = -184. Suppose 2z - 6 = m. Calculate the remainder when z is divided by k. 12 Let w = 128 + -27. Calculate the remainder when w is divided by 28. 17 Let s(i) = -i2 - 9i + 7. What is the remainder when s(-7) is divided by 12? 9 Suppose 0 = -2r + 3g + 39, -3r + 4r - 2g - 20 = 0. Suppose 2x = 5x - 159. Calculate the remainder when x is divided by r. 17 Calculate the remainder when 2 + -2 - (-47 - 6) is divided by 14. 11 Suppose -12 = 2h + 2s, -3s + 6s - 31 = 4h. Let m(g) = -5g - 2. What is the remainder when 129 is divided by m(h)? 30 Calculate the remainder when 93 is divided by (24/15-2)/((-4)/30). 21 Let l = -18 - -28. Calculate the remainder when 69 is divided by l. 9 What is the remainder when 1616/5 - 46/(-30) is divided by 65? 64 Let q = 21 + -17. What is the remainder when 9 is divided by (-10)/3(-6)/q? 4 Calculate the remainder when 25 is divided by -2(-3)/(6/14). 11 Let l = 5 - 4. Let b(c) = -c + 1. Let y be b(l). Suppose -5o + 50 = -yo. What is the remainder when o is divided by 4? 2 Let a(l) = -l + 28. Calculate the remainder when a(7) is divided by 11. 10 Let o(s) = s2 + 3s. Let f be o(4). Let x = f - 12. What is the remainder when (-2)/5 + (-237)/(-5) is divided by x? 15 Let s be 5 + (2-1)/(-2). Suppose 0 = st - 2t - 48. What is the remainder when 45 is divided by t? 9 Suppose 2o - 28 = 4c, -5o - 2c = -4c - 46. Let b(i) = 3i2 + 3i + 4. Calculate the remainder when b(-3) is divided by o. 6 Let w(t) be the second derivative of -t*5/20 - 7t*4/6 - 7t3/3 - t2 - 3t. Calculate the remainder when 32 is divided by w(-13). 10 Suppose 0 = -0n + n - 1. Let t = 18 + n. Calculate the remainder when t is divided by 7. 5 Suppose -8g + 3a = -3g + 35, 5g + 5a = -75. Let c = g - -16. Suppose -2q = -29 - 3. Calculate the remainder when q is divided by c. 4 Calculate the remainder when 49 is divided by (-128)/(-10) + (-5)/(-25). 10 Suppose -2r - 10 = -38. What is the remainder when 53 is divided by r? 11 Let v be 3(-9)/6-4. Let i = 29 - v. Suppose 0 = c - 2c + 5w + 11, 2c - w = 40. What is the remainder when c is divided by i? 10 Let x(i) = i*3 - 5i2 + i + 5. Let l(r) = -r2 - 6r. Let j be l(-5). Let s = -35 + 62. What is the remainder when s is divided by x(j)? 7 Suppose -19 = -5m + 76. Calculate the remainder when m is divided by 8. 3 Suppose -2 = -4p + 26. Let j(d) = -d3 + 7d*2 + d + 9. What is the remainder when j(p) is divided by 9? 7 Suppose 5a - 3a = 40. What is the remainder when a is divided by 6? 2 Let g(k) = k2 + 3k - 8. Suppose -21 = 5p + a + 2a, -5p - 18 = 4a. Let q = p - -17. What is the remainder when g(-7) is divided by q? 9 Suppose -t + 4t = 3. Let j be t3/(-6)-2. What is the remainder when 18 is divided by ((-10)/3)/j-3? 8 Suppose 4u = -2n + 12, 0 = 4n - 0u + u - 59. Calculate the remainder when 45 is divided by n. 13 Let z(i) = i*2 - 10i - 16. Let p = 29 + -14. Calculate the remainder when p is divided by z(12). 7 Let v = 4 - 2. Suppose vr = -5y + 1102, 2y - 134 - 309 = -3r. Suppose y = 8n - 3n. What is the remainder when n is divided by 15? 14 Calculate the remainder when 60 is divided by -1 + 302/14 + 21/49. 18 Let w(z) = z*3 + 11z*2 - 14z - 18. What is the remainder when w(-12) is divided by 3? 0 Let y = 120 + -83. What is the remainder when y is divided by 8? 5 Suppose 0g + 3g = -4z + 729, -5 = 5g. What is the remainder when z is divided by 37? 35 Let m = -41 - -71. What is the remainder when m is divided by 22? 8 Let b = 3 + -3. Let i be -3 + 0 + b + 14. Let r = 6 + i. What is the remainder when r is divided by 9? 8 Let d = -5 - -9. Let v = 2 + -2. Suppose v = -dj + 71 + 5. What is the remainder when j is divided by 10? 9 Let l(a) = a3 - 6a*2 + 10a + 2. Suppose -10 = -x - 3. Calculate the remainder when l(x) is divided by 31. 28 Let q = 9 + 23. Calculate the remainder when 127 is divided by q. 31 Let o = 53 - 23. Let w = o + -18. What is the remainder when w is divided by 5? 2 Let k(s) = -21s3 + 2s + 1. Suppose -3l = -3r - 2 - 1, -r + 4l = 1. Calculate the remainder when k(r) is divided by 7. 6 Let s(k) = k2 + k + 5. Let d(b) = 2b + 6. Let j be d(-5). What is the remainder when 65 is divided by s(j)? 14 Suppose 19 + 81 = 5l. Calculate the remainder when l is divided by 11. 9 Let u(m) = m3 - m2 + m - 7. Let l be u(0). Let b = 14 + l. Suppose -p + 24 = 4q, -q = -0q - 3p + b. What is the remainder when 8 is divided by q? 3 Let o(f) be the second derivative of -8f3/3 + 2f*2 - f. Suppose 17 = 5z + 32. What is the remainder when o(z) is divided by 27? 25 Suppose -6 - 4 = -q. Let p(h) = 7h2 - 22h*3 + 3 - 2h*2 + 21h*3 + 5h*2. Calculate the remainder when 4 is divided by p(q). 1 Suppose 0 = -6g + 11g - 250. Calculate the remainder when g is divided by 13. 11 Calculate the remainder when (-80)/(-25)(-10)/(-4) is divided by 4. 0 Let s = -13 - -27. What is the remainder when 431 - (5 + -1) is divided by s? 11 Suppose i - 7 = 14. Let o = -8 + i. Calculate the remainder when o is divided by 4. 1 Suppose -3h + 101 = 47. Calculate the remainder when h is divided by 10. 8 Suppose 2a + 3 = 11. Let y = 14 - a. Calculate the remainder when 37 is divided by y. 7 Let x(m) = m3 - 6m*2 - 7m - 7. Let d be x(7). Suppose -3h + 65 = 2h. Let y = h + d. Calculate the remainder when 16 is divided by y. 4 Let k(y) = y*2 + 2y + 21. What is the remainder when k(0) is divided by 11? 10 Let s = 131 - 105. What is the remainder when 155 is divided by s? 25 Suppose 0 = -5n - 3r + 122, 5n - 5r - 14 = 76. What is the remainder when 81 is divided by n? 15 Let a = 33 + -30. Let k(p) = p*3 + 4p*2 - p - 2. What is the remainder when k(-3) is divided by a? 1 Suppose 3j + 0n = -3n, -3j = 4n. Suppose -k + 3k + f - 9 = j, -2k - 5f = -29. Suppose b + kb - 21 = 0. Calculate the remainder when 13 is divided by b. 6 Suppose -4g + g = -12. Calculate the remainder when 14 is divided by -4 + g + 10 + -2. 6 Suppose 4r - 156 = 4c, -3c + 7c = 12. What is the remainder when r is divided by 15? 12 Suppose 2w + 9 = 15. Let z(j) = j2 - 2. What is the remainder when 19 is divided by z(w)? 5 Let i(y) = y3 - 21y2 - y + 25. What is the remainder when 21 is divided by i(21)? 1 Calculate the remainder when (4 + 2)-3(-3 - 2) is divided by 221 + (0 - -1). 21 Let a = 47 - 27. Let n(d) = -6d - 1 - d2 + 2 + d + 2. Calculate the remainder when a is divided by n(-4). 6 Let b = -10 + 2. Let j = b + 11. Suppose 5q = jq + 20. Calculate the remainder when 19 is divided by q. 9 Let p = 69 - 37. Suppose -5d + p = k, -d - 23 = -7k + 3k. Suppose 4c = j - 4, -3j - 5c + 58 = j. Calculate the remainder when j is divided by k. 5 Let f(s) = s2 - 10s - 9. Let g(q) = 5q - 16. Let n be g(6). Calculate the remainder when f(n) is divided by 10. 7 Let f be -3 - -1 - (-67 + -1). Suppose f = 2w + w. Calculate the remainder when w is divided by 8. 6 Suppose -6l = -l - 680. Suppose 76 = 2f - l. What is the remainder when f is divided by 36? 34 Suppose -t = 2c + 3t + 24, -5c + t - 60 = 0. Let k = 31 + c. What is the remainder when 36 is divided by k? 17 Let f(j) = -j2 - 2j. Let q be f(5). Let m = 81 + q. Calculate the remainder when m is divided by 16. 14 Let f(c) = -26c + 4. Let k be f(-2). Suppose -2r - d = -25, -k = -4r - d - 3d. What is the remainder when 32 is divided by r? 10 Let v(o) = -o*2 + 18o - 45. What is the remainder when 174 is divided by v(10)? 34 Suppose -4u + 3q = -110, -2q = u - 3u + 56.	{ "pile_set_name": "DM Mathematics" }
nt from {h: 6, e: 2}. 15/28 Calculate prob of picking 1 o, 1 q, and 1 f when three letters picked without replacement from fofqqoqf. 9/28 Calculate prob of picking 2 c when two letters picked without replacement from ccccuccccccccccccc. 8/9 What is prob of picking 2 r when two letters picked without replacement from riirrrrr? 15/28 Calculate prob of picking 1 l, 1 f, and 1 k when three letters picked without replacement from {l: 1, f: 9, k: 10}. 3/38 What is prob of picking 2 n, 1 s, and 1 y when four letters picked without replacement from nnhnhnnaysyhnysy? 6/91 What is prob of picking 2 m and 1 f when three letters picked without replacement from {b: 7, f: 2, m: 11}? 11/114 Four letters picked without replacement from {q: 3, b: 6, f: 2, s: 1, v: 5}. Give prob of picking 1 b, 1 s, and 2 v. 3/119 Calculate prob of picking 2 s when two letters picked without replacement from {s: 3, j: 1, f: 5}. 1/12 Two letters picked without replacement from bhhhhhhhhbbhhhhh. Give prob of picking 2 b. 1/40 Calculate prob of picking 1 m and 3 b when four letters picked without replacement from {m: 15, b: 4}. 5/323 Three letters picked without replacement from {g: 3, t: 4, d: 2, m: 3, e: 1, q: 6}. What is prob of picking 1 t and 2 g? 4/323 What is prob of picking 1 e, 1 p, and 1 a when three letters picked without replacement from {e: 3, a: 3, p: 3, k: 3, m: 4}? 27/560 What is prob of picking 1 s and 1 w when two letters picked without replacement from {w: 3, v: 1, s: 3, d: 2, p: 1, b: 1}? 9/55 Two letters picked without replacement from {r: 7, x: 5}. What is prob of picking 2 x? 5/33 Four letters picked without replacement from owdbb. Give prob of picking 1 d, 1 b, 1 w, and 1 o. 2/5 Calculate prob of picking 4 h when four letters picked without replacement from whwhhhhqhwhwhhwhhhhq. 143/969 Two letters picked without replacement from {s: 1, o: 7}. What is prob of picking 2 o? 3/4 Three letters picked without replacement from {a: 2, q: 3}. Give prob of picking 3 a. 0 Calculate prob of picking 3 w and 1 m when four letters picked without replacement from mmwmmwmmmmmmwmm. 4/455 Three letters picked without replacement from arr. Give prob of picking 3 a. 0 Three letters picked without replacement from {k: 1, d: 1, i: 1}. What is prob of picking 1 i and 2 k? 0 Four letters picked without replacement from {p: 4, s: 5, u: 2}. Give prob of picking 4 p. 1/330 Three letters picked without replacement from {f: 1, q: 1, y: 1, j: 5, k: 3, d: 1}. Give prob of picking 1 q, 1 d, and 1 f. 1/220 Calculate prob of picking 1 u and 1 y when two letters picked without replacement from {u: 2, y: 1}. 2/3 Calculate prob of picking 2 g when two letters picked without replacement from qgqqggg. 2/7 Two letters picked without replacement from {n: 5, a: 5, e: 2}. What is prob of picking 1 n and 1 e? 5/33 Calculate prob of picking 2 n when two letters picked without replacement from unnn. 1/2 What is prob of picking 1 w and 2 k when three letters picked without replacement from {f: 1, k: 3, b: 1, w: 5}? 1/8 Two letters picked without replacement from {k: 7, c: 4}. Give prob of picking 1 k and 1 c. 28/55 What is prob of picking 4 i when four letters picked without replacement from {i: 7, n: 1}? 1/2 Three letters picked without replacement from tpyppystyttyjtpyjyp. What is prob of picking 3 p? 10/969 Calculate prob of picking 2 r and 2 b when four letters picked without replacement from {r: 6, b: 13}. 195/646 Three letters picked without replacement from {d: 8, a: 6, z: 3}. Give prob of picking 3 d. 7/85 Three letters picked without replacement from lyyy. Give prob of picking 2 y and 1 l. 3/4 What is prob of picking 1 w and 2 v when three letters picked without replacement from wwwwwfmwvwwwmwwmwwv? 13/969 Three letters picked without replacement from qqifqiqfqhqqqfqqqfiq. Give prob of picking 2 f and 1 i. 3/190 Three letters picked without replacement from {k: 1, z: 2, t: 1}. Give prob of picking 1 k, 1 t, and 1 z. 1/2 Two letters picked without replacement from kwwwqke. Give prob of picking 1 e and 1 k. 2/21 Two letters picked without replacement from {r: 3, j: 8}. Give prob of picking 2 j. 28/55 What is prob of picking 2 w when two letters picked without replacement from kwkwuwuuuukuwk? 6/91 What is prob of picking 1 f and 1 h when two letters picked without replacement from jjjhfjfjhfhhfjfjjfjj? 12/95 Two letters picked without replacement from cyycycyyyyyyyycyycy. Give prob of picking 2 c. 10/171 Four letters picked without replacement from phpupuphhvuuuvh. What is prob of picking 3 p and 1 v? 8/1365 Calculate prob of picking 2 j and 1 i when three letters picked without replacement from llhiiihjihjjvjjilj. 25/272 Calculate prob of picking 1 w, 1 k, and 1 d when three letters picked without replacement from dwkkk. 3/10 Calculate prob of picking 1 d and 1 m when two letters picked without replacement from {s: 2, r: 6, m: 7, d: 3, y: 1}. 7/57 Three letters picked without replacement from vkkoovhkddydhvkkddd. Give prob of picking 1 y and 2 h. 1/969 What is prob of picking 1 v and 2 p when three letters picked without replacement from pvppppvvppppppvpppp? 140/323 Two letters picked without replacement from {z: 6, y: 6}. What is prob of picking 1 y and 1 z? 6/11 What is prob of picking 2 s and 2 q when four letters picked without replacement from {r: 1, y: 1, s: 2, q: 1}? 0 Two letters picked without replacement from grrlllclurlrrluc. What is prob of picking 1 l and 1 u? 1/10 Three letters picked without replacement from {s: 1, b: 3, o: 1, f: 4, t: 2}. What is prob of picking 2 t and 1 b? 1/55 Three letters picked without replacement from {i: 1, y: 3, x: 2, j: 1}. What is prob of picking 1 y and 2 x? 3/35 What is prob of picking 1 g and 1 c when two letters picked without replacement from {c: 9, s: 1, g: 1}? 9/55 Two letters picked without replacement from gllkgkakjlz. What is prob of picking 1 z and 1 g? 2/55 Two letters picked without replacement from xvbsctvc. Give prob of picking 1 b and 1 c. 1/14 Three letters picked without replacement from xmmcfhfmmfmmxmcmm. What is prob of picking 2 m and 1 c? 9/85 Three letters picked without replacement from ggvf. What is prob of picking 1 f and 2 g? 1/4 Three letters picked without replacement from {o: 2, z: 4, s: 3, w: 1, r: 3, n: 2}. Give prob of picking 2 z and 1 o. 12/455 Two letters picked without replacement from {o: 3, h: 17}. What is prob of picking 1 o and 1 h? 51/190 What is prob of picking 1 o, 1 l, and 1 a when three letters picked without replacement from {s: 1, a: 1, y: 1, l: 1, o: 1}? 1/10 What is prob of picking 1 m, 1 r, and 2 p when four letters picked without replacement from jrprrprmrrjtjjrjhrrr? 2/969 What is prob of picking 2 d and 1 r when three letters picked without replacement from ddriq? 1/10 Calculate prob of picking 1 o and 2 j when three letters picked without replacement from {j: 3, o: 15, m: 2}. 3/76 Calculate prob of picking 2 m when two letters picked without replacement from mmbbmbbbbmb. 6/55 Two letters picked without replacement from izoozdoizzzidzoood. Give prob of picking 1 z and 1 i. 2/17 Two letters picked without replacement from {f: 2, z: 1, g: 2, o: 7}. What is prob of picking 2 f? 1/66 What is prob of picking 2 w and 2 s when four letters picked without replacement from nxmwswysy? 1/126 Three letters picked without replacement from {c: 2, s: 2, w: 2, r: 5, f: 1, u: 1}. Give prob of picking 2 s and 1 c. 1/143 What is prob of picking 3 n and 1 l when four letters picked without replacement from lnnlnnnnnjlnnmtnmnnn? 286/1615 What is prob of picking 1 c, 1 j, 1 p, and 1 q when four letters picked without replacement from {q: 1, p: 2, c: 3, g: 2, o: 1, j: 3}? 2/55 Calculate prob of picking 2 m, 1 i, and 1 c when four letters picked without replacement from mmcccccicc. 1/30 Calculate prob of picking 3 s when three letters picked without replacement from {m: 1, s: 4, d: 3}. 1/14 What is prob of picking 1 h and 1 a when two letters picked without replacement from {q: 2, a: 2, h: 1, m: 1, j: 1, v: 2}? 1/18 Four letters picked without replacement from xtttttcxtayacttttta. Give prob of picking 1 y, 2 t, and 1 a. 55/1292 Two letters picked without replacement from {r: 1, a: 3, g: 1}. Give prob of picking 1 a and	{ "pile_set_name": "DM Mathematics" }
*4/2 + 25q*3 - 55q*2 + 55q + 1. Let b(h) = 5f(h) - 2n(h). Factor b(j). -5(j - 5)(j - 1)*2 Let d be 3/(-8) + (0 - (3 - (-2105)/(-600))). Factor -8/15 - dg*2 - 8/15g. -2(g + 2)2/15 Solve -6a*2 - 208a + 11532 + 6a2 + 117a + 3a2 - 281a = 0 for a. 62 Let k(c) = 1 - 121c + 119c + 0 - 5c2 - 3c3. Let x be k(-4). Let -122 - j3 - 2j2 + x - 3j - j*2 = 0. Calculate j. -1 Solve 0p - 6/7p3 + 0 - 6/7p*2 = 0. -1, 0 Let y = 111 - 107. Let s(m) be the second derivative of -8/3m*y + 0 + m + 0m3 + m2. Suppose s(c) = 0. Calculate c. -1/4, 1/4 Let s(r) be the first derivative of -3/14r2 - 2 + 1/7r*3 - 1/28r*4 + 1/7r. Let s(k) = 0. Calculate k. 1 Suppose -16f + 32 = -0. Let v(b) be the second derivative of fb + 0 + 0b2 + 1/4b*4 - 1/2b*3. Find p, given that v(p) = 0. 0, 1 Let k be (-91)/(-39)9/42. Let 1/2b2 + b + k = 0. What is b? -1 Let f = 44 - 45. Let g be (-6 + 96/18)/(f/3). Find p, given that -1/5p*g - 3/5p - 2/5 = 0. -2, -1 Let t = 484 + -482. Let h(d) be the first derivative of -5 - 3d3 + 3/4d*4 - 3d + 9/2dt. Let h(z) = 0. What is z? 1 Let v be (-4 - (-24)/9)/((-1)/3). Suppose 80i*4 - 5i*3 - 23i*3 + 8i - 16i3 - 64i*v + 20i*2 = 0. Calculate i. -1/4, 0, 1, 2 Let f = 1732/2595 + -2/2595. Suppose 2 + 10/3l*2 - 14/3l - fl3 = 0. What is l? 1, 3 Let i be (-16)/12((-546)/260 - (-6)/10). Factor 2f + 10/3f*i + 0. 2f(5f + 3)/3 Suppose 1134 - 1146 = -2i + z, i - 4z = 27. Factor -36/5r2 - 4/5r*4 - 28/5r - 8/5 - 4ri. -4(r + 1)*3(r + 2)/5 Let w(f) be the third derivative of -f*5/480 + 11f*4/8 - 363f*3 + 11f2 - 2. Factor w(q). -(q - 132)2/8 Find v such that 1/5v5 - 3/5v*3 + 0 - 1/5v*4 + 1/5v*2 + 2/5v = 0. -1, 0, 1, 2 Let o(b) be the second derivative of b7/11340 + b6/3240 - b*4/4 + 11b. Let q(p) be the third derivative of o(p). Suppose q(a) = 0. What is a? -1, 0 Let z = 30 - 30. Suppose 4n - 2x = -x + 3, 5n - x - 5 = z. Factor 4/9y*n + 2/9y + 2/9y3 + 0. 2y(y + 1)2/9 Let g(r) be the first derivative of r6/24 - 7r*5/20 + 15r*4/16 - 3r3/4 + 193. Factor g(v). v2(v - 3)2(v - 1)/4 Let m(d) be the first derivative of -10 + 25/8d3 + 1/8d + 125/32d4 + 15/16d2. Determine t so that m(t) = 0. -1/5 Let i(p) be the first derivative of p5 + 55p4/4 + 40p*3 - 90p*2 + 97. Factor i(d). 5d(d - 1)(d + 6)2 Let c(k) be the third derivative of k8/896 + k7/70 + k6/80 - 13k5/80 - 37k*4/64 - 7k*3/8 - 4k*2 + 52k. Find b such that c(b) = 0. -7, -1, 2 Let f(l) = -2l2 - 110l - 1676. Let i(g) = 2g2 + 108g + 1674. Let v(q) = 4f(q) + 3i(q). Factor v(a). -2(a + 29)2 Let n be (2 + 20)/(4/5)(-1250)/(-375). Solve -125/3f5 - 8/3f + 0 + 68/3f2 + nf*4 - 70f*3 = 0 for f. 0, 2/5, 1 Let a = 46 + -46. Let p(g) be the third derivative of 1/15g*5 - 2g*2 + ag*4 + 1/60g*6 + 0g*3 + 0 - 1/105g*7 + 0g. Factor p(o). -2o2(o - 2)(o + 1) Let m(x) be the first derivative of -x4 + 68x*3/3 + 36x2 + 109. Let m(h) = 0. What is h? -1, 0, 18 Let p(y) = y3 - 15y2 + 26y + 2. Let k be p(2). Solve 0 + 7lk - 7/4l*4 - 2l + 9/2l3 - l5 = 0 for l. -2, 0, 1/4, 2 Let w(t) = -5 + 20t*2 - 51t*2 + 21t2. Let j(y) = -y2 - y - 1. Let g(x) = 5j(x) - w(x). What is z in g(z) = 0? 0, 1 Let x = -4117 - -24703/6. Factor 1/6j + xj2 + 0. j(j + 1)/6 Let l(y) be the first derivative of 1/5y3 - 3/5y + 0y2 + 15. Factor l(g). 3(g - 1)(g + 1)/5 Let g(q) be the second derivative of -q7/6300 - q6/450 - q5/100 - q4/3 - 15q. Let x(l) be the third derivative of g(l). Suppose x(t) = 0. What is t? -3, -1 Factor -19s - 138s*3 - 11s*4 - 389s*5 + 125s*4 + 70s*2 + 7s + 355s5. -2s(s - 1)3(17s - 6) Let v(d) be the first derivative of d6/2 + 6d*5 + 24d*4 + 32d*3 - 132. Find j such that v(j) = 0. -4, -2, 0 Let d(m) be the first derivative of 10m*6/3 + 3m*5 - 75m*4 + 380m*3/3 + 499. Find j, given that d(j) = 0. -19/4, 0, 2 Let n(y) = -4y*3 + 2y*2 + 6y + 4. Let q(u) = u4 + u3 + u*2 - u + 2. Let o(x) = n(x) - 2q(x). Factor o(h). -2h(h - 1)(h + 2)2 Let x(k) be the third derivative of k8/20160 - k7/560 + k5/60 - k3/3 - 3k*2 + 2. Let u(w) be the third derivative of x(w). Solve u(q) = 0 for q. 0, 9 Find g, given that 17/3 - 1/3g - 17/3g2 + 1/3g*3 = 0. -1, 1, 17 Find f such that -20 - 750f + 351f + 375f - 4f2 = 0. -5, -1 Factor 5a*2 - 15a*2 - 16a - 2a2 + 3a*2 + 7a*2. -2a(a + 8) Let k(s) be the first derivative of -2s*6/15 - 12s5/25 + s4 + 36s3/5 + 64s*2/5 + 48s/5 - 101. Let k(p) = 0. Calculate p. -2, -1, 3 Let h be (-2)/4(-8 + 2). Factor -12f + 4f3 - f3 + 15f*2 - 11f*h + 5f*3. -3f(f - 4)(f - 1) Let l(j) be the first derivative of 0j + 32/5j*5 - 4j*2 - 28j*4 - 62/3j*3 - 33. Factor l(u). 2u(u - 4)(4u + 1)2 Let j(s) be the first derivative of s5/80 + 11s*4/16 + 121s*3/8 - 14s*2 - s - 19. Let r(d) be the second derivative of j(d). Factor r(b). 3(b + 11)*2/4 Factor -295/4 - 5/4s*3 - 285/4s*2 + 585/4s. -5(s - 1)2(s + 59)/4 Suppose 11/2z2 - 450 + 7z*3 - 210z - 1/2z4 = 0. What is z? -3, 10 Let v be (-4)/7 - (1 + 430/(-140)). Factor vi - 3/2i3 - 3/2i*2 + 0 + 3/2i*4. 3i(i - 1)2(i + 1)/2 Let q(t) be the third derivative of 13/18t4 + 0 + 1/20t*6 - 8/9t*3 - 29t*2 + 43/90t*5 + 0t. Suppose q(z) = 0. What is z? -4, -1, 2/9 Let k(w) be the second derivative of 5w4/12 - 25w*3 + 140w*2 - 115w. Suppose k(c) = 0. What is c? 2, 28 Let u(n) = 90n - 5. Let i(q) = -q2 + 90q - 6. Let o(p) = 5i(p) - 6u(p). What is m in o(m) = 0? -18, 0 Let u(o) be the third derivative of -o7/735 - o6/28 - 9o5/35 - 10o*4/21 - 144o*2. Solve u(j) = 0. -10, -4, -1, 0 Let n(x) = -4x*2 - 52x - 95. Let d(m) = -m*2 - 17m - 32. Let k(p) = 21d(p) - 6n(p). Factor k(w). 3(w - 17)(w + 2) Let t = -184 + 185. Let v be ((-58)/10 - -6)t. Suppose 3/5h*3 - vh*4 - 3/5h*2 + 0 + 1/5h = 0. What is h? 0, 1 Let c = 5 - 1. Suppose -4y = cn - 20, -1 - 1 = -2n + 2y. Determine q, given that 2q4 + 4q*2 - 7q*3 - nq*3 + 3q3 + q3 = 0. 0, 1, 2 Let a(m) be the third derivative of -5m8/56 - 11m*7/70 + 11m*6/40 + 13m5/20 - m4/8 - m*3 + 215m*2. Solve a(t) = 0. -1, -1/2, 2/5, 1 Let t be 46/6 + (2/(-6))/((-83)/(-1743)). Factor -1/3g - 15g2 + t. -(5g - 1)(9g + 2)/3 Suppose 36 = 22429w - 22411w. Let -2/5cw + 0 - 2/5c = 0. Calculate c. -1, 0 Factor -43904/17 - 168/17v2 - 2/17v*3 - 4704/17v. -2(v + 28)3/17 Find s, given that -16s*4 - 68s*2 - 12 - 76s - 2s5 - 48s*3 + 89s - 59s = 0. -3, -2, -1 Let z be 10/48(-160 - -7). Let i = z - -32. Suppose -il2 + 0 + 1/8l*4 - 1/8l*5 + 1/8l*3 + 0l = 0. What is l? -1, 0, 1 Let q = 5 + -3. Let h = 81 - 71. Factor 2 + qo + 19o - h + 12o2 + 2. 3(o + 2)(4o - 1) Let t(k) = -2k4 + 7k*3 + 20k*2 - 11k + 7. Let x(r) = 2r4 - 8r*3 - 22r*2 + 12r - 8. Let d(i) = 8t(i) + 7x(i). Factor d(u). -2u(u - 1)*2(u + 2) Let l = -7 + 18. Let h(t) = 20t3 - 9t*2 - 80t + 91. Let x(f) = 4f3 - 2f*2 - 16f + 18. Let j(m) = lx(m) - 2h(m). Factor j(o). 4(o - 2)(o - 1)(o + 2) Let o = 1/162 + 2585/1134. Factor ou + 0 - 48/7u2 + 20/7u*3. 4u(u - 2)(5u - 2)/7 Let w(s) = -11s*3 - 78s*2 - 183s - 92. Let y(c) = 12c3 + 76c*2 + 186c + 94. Let k(v) = 7w(v) + 6y(v). Determine u, given that k(u) = 0. -16, -1 Suppose 0 = 2h - 10 - 14. Suppose -2s - h = -6s. Factor ps + 3 - 3p*4 - 2p + 5p3 - 3p - p. -3(p - 1)3(p + 1) Let x(n) be the second derivative of -n10/6048 + n9/1008 - n*7/126 + 5n*4/4 - 11n. Let m(g) be the third derivative of x(g). Factor m(u). -5u2(u - 2)*2(u + 1) Factor 1/2v5 + 0v*2 + 0 + 0v - 2v4 + 2v3. v3(v - 2)2/2 Determine o, given that -7 - 1 + 1 - 12o + 3 - 9o2 = 0. -2/3 Let v(z) be the second derivative of 0 - 1/10z*6 + 0z*2 - z + 1/2z*3 - 3/20z*5 + 1/4z*4. What is q in v(q) = 0? -1, 0, 1 Let l = 78 + -73. Factor y + 14y*2 - 6y*l - 9y*4 - y - 11y*2. -3y*2(y + 1)*2(2y - 1) Suppose 0o - 4 = 4i - 3o, 8 = 2*o.	{ "pile_set_name": "DM Mathematics" }
e the smallest common multiple of g and p(2). 70 Let k be 100/(-15)(-1 + -26). What is the common denominator of 37/18 and (-6)/15 + 1317/k? 36 Suppose 0v + 5v = 70. Calculate the least common multiple of v and 22. 154 Suppose 0 = -3j + 13 + 8. Calculate the least common multiple of j and 11. 77 What is the smallest common multiple of (-4)/16(0 + -28) and 6? 42 Let k = 412 - 782. Let o = k - -3373/9. Suppose -79 = 5h + 21. What is the common denominator of h and o? 9 Let z(q) = -q*3 - 5q*2 - 4q + 4. Let g be z(-4). Suppose r - 5 = gd, -3d = 2r + 3r - 2. Calculate the lowest common multiple of 20 and 24/d(-6)/9. 80 Let f = -72 + 75. Calculate the least common multiple of f and 30. 30 Let f(y) be the second derivative of y3/3 - 9y*2/2 - y. Let c be f(7). Suppose -cq + 18 = -22. Calculate the smallest common multiple of q and 10. 40 Suppose -3f - 3t = 84, 0 = -t + 1 - 4. Calculate the smallest common multiple of ((-8)/5)/(10/f) and 11. 44 Let m = 12 + -5. Calculate the least common multiple of m and ((-11)/(-4))/((-2)/(-8)). 77 Let s = -3 + 7. Let y(a) = -7a. Let t be y(s). What is the common denominator of -125/18 and (-113)/(-4)8/t? 126 Suppose 14 + 11 = 5a. Calculate the lowest common multiple of 11 and a. 55 Suppose 3m - 7 = 5p, 2p + 2p - 12 = -2m. Suppose 5j - mo = j + 8, 2o = 0. Calculate the lowest common multiple of (-41 - -2) + 14 and j. 12 Let w(i) = i*3 - 8i*2 + 11i - 7. Let l be w(10). What is the common denominator of -17/18 and l/12 + 2/8? 18 Let y(v) = v*2 + 2v - 7. Calculate the lowest common multiple of y(-5) and 5. 40 Let s be (0 + 0/(-1))/1. Calculate the smallest common multiple of (-10)/(-1) - (-1 + s) and -8 - 112/(-6) - (-2)/(-3). 110 Let k be (0 + 2)/(-2)-12. Suppose -3f = -k - 0. Suppose f = a - 2s, 2s - s + 5 = 2a. What is the least common multiple of a and 5? 10 What is the lowest common multiple of (-4 + 3)-2 + 10 and 18? 36 Suppose -18k + 16k = -22. Suppose 5t = 4t + k. What is the least common multiple of 3 and t? 33 Let s be (-1)/(-2) - 15/(-10). Suppose 5z = -sc - 3c, -4z - 3c + 4 = 0. What is the lowest common multiple of z and 10? 20 Suppose -3f = 2y - y - 18, 0 = 3f - 2y - 9. Let a = f + -14. Find the common denominator of (-2)/(2 - 30/a) and -7. 8 Let n(y) be the first derivative of -y4/4 - 2y3 - y2/2 - 4. What is the lowest common multiple of n(-6) and (-48)/(-9)3/2? 24 Suppose -5o = -3k - 7, 2o - 16 - 12 = -3k. What is the common denominator of 83/22 and 1/(-3) - (-83)/k? 22 Let m = -1016 + 5116/5. Calculate the common denominator of -131/6 and m. 30 Let g(c) = -2c - 2. Let j be g(-3). Suppose d - 70 = -jd. What is the lowest common multiple of 18 and d? 126 Calculate the lowest common multiple of 17 and 6/466/9. 187 Let g(n) be the second derivative of -n5/20 - n3/6 + 4n2 + n. Calculate the least common multiple of g(0) and 20. 40 Let i = -18/283 + 9784/2547. Let f = 2150 + -19375/9. What is the common denominator of i and f? 9 Let t = -267 - -2411/9. Calculate the common denominator of -34/9 and t. 9 Let d(n) = 2n2 - n2 - 3n + 0n*2 + 3 - 3n*2. Let o be d(-3). Let m = o + 10. Calculate the lowest common multiple of m and 2. 4 What is the common denominator of -76/39 and (-1102)/(-420) + ((-48)/(-20) - 3)? 546 Suppose k + 4o = 18, 5k + o + 7 - 2 = 0. Calculate the common denominator of 65/2 and k + 2 - 28/22. 22 Suppose a + 10 = 42. Suppose -a = -2t + 12. Let u(j) = j*3 + 8j*2 + 9j + 4. What is the least common multiple of t and u(-6)? 22 Let p = 1709/60 - 331/15. Find the common denominator of p and 46/(-18) + (-2)/2. 36 Let h = -20 + 37. Suppose -4c - h = -3l + 2, 5l - 29 = 4c. Suppose -2t - 7 = 5s + 2, t + 5s + 17 = 0. What is the least common multiple of t and l? 40 Let w = 15 + -4. What is the lowest common multiple of 60/24(-28)/(-10) and w? 77 Let z = -14 - -45. Suppose -s + 3 = -5n - z, n + 74 = 5s. What is the lowest common multiple of s and 14? 14 Let u be ((-30)/63)/(-5)6. Let q = -154463/35 - -4416. Let n = q - u. Find the common denominator of 109/10 and n. 10 Let c(t) = -2t + 1. Let u be c(-1). Let s(j) = -j*3 + 3j*2 + 3j - 2. Calculate the smallest common multiple of 11 and s(u). 77 Suppose w + 52 = 14w. What is the least common multiple of 7 and w? 28 Let z = 2 - 0. Find the common denominator of 469/281/z and 49/10. 40 Let g be ((-173)/10)/((-18)/(-15)). Let x = g + 63/4. Find the common denominator of 114/27 + (-1 - -1) and x. 9 Find the common denominator of 28/(-792)-3(1 - 9) and 83/12. 132 Let i = -2/1271 - 73712/3813. Calculate the common denominator of i and -15. 3 Suppose 0r - 6 = -v - r, -3v - r + 26 = 0. Suppose 21 = 3o + 2b, 4b + 2 = -2o + 8. What is the least common multiple of o and v? 90 Let k(b) = b*3 + 13b*2 - 20b - 60. What is the least common multiple of 15 and k(-14)? 120 Let q(g) = 17g3 - 1 + 0 + 0 + 2g - 2g2. What is the lowest common multiple of 10 and q(1)? 80 Suppose -h - j = -18566 + 67524, 0 = 4j + 8. Let x be (h/(-318))/((-440)/(-6)). Let s = -2/2915 - x. Find the common denominator of 109/20 and s. 20 Let h be -1 - 0 - (-24476)/(-4). Let a = h + 49041/8. Calculate the common denominator of -37/10 and a. 40 Let f = -1849/30 - -202/3. Let u be (8/10)/(2/(-15)). What is the common denominator of f and ((-83)/(-3))/(20/u)? 10 Let h(k) = k2 - 12. Let z(n) = n3 - 4n2 + n. Let t be z(3). Calculate the least common multiple of h(t) and 2. 24 Let x(k) = k3 - 5k*2 - 6k + 5. Suppose 2d = 5 + 7. What is the least common multiple of 5 and x(d)? 5 Find the common denominator of 109/44 and 33/11 - (-41)/(-14). 308 Let j be -2 + -15 + 0 + 2. Suppose 3f - 2b = 4f - 578, -3f - 4b = -1736. What is the common denominator of 17/2 and (2/j)/(48/f)? 18 Let m be (4 - -8)(-1)/(-2). Calculate the least common multiple of (-2)/10 + 41/5 and (2/(-4))/((-3)/m). 8 Let l(i) be the first derivative of -i3/3 + 7i*2/2 + 2. Calculate the smallest common multiple of l(4) and 22. 132 Let z = -5863/90 - -577/10. Find the common denominator of 32/21 and z. 63 Let r = 1 - -1. Let w = 42 + -34. What is the least common multiple of r and w? 8 Suppose -5g = z + 631, 0 = 3g - 0z - 5z + 401. Let a = 61 + g. Calculate the common denominator of (3/4)/(a/(-28)) and 9/16. 176 Suppose 0x - 5 = -x. Suppose -8 = 6h - 74. What is the smallest common multiple of h and x? 55 Let g be (12/(-15))/(2/(-185)). Let k = g - 47. What is the common denominator of -37/9 and (k/(-30))/(12/170)? 36 Suppose 3u + 11 = -2j, -9 + 25 = -4j. Let h = 9 - u. Let a = 4 - 2. What is the lowest common multiple of a and h? 10 Let p = -8 - -16. Let w = -1 + 2. Let r(m) = 11m2 - m. Calculate the least common multiple of p and r(w). 40 Suppose 0m - j = -4m + 91, 104 = 5m + 2j. Let l = 28 + -8. Calculate the lowest common multiple of m and l. 220 Let h be -1 - -1 - 1 - 1. What is the common denominator of 27/8 and h + (0 - (-42)/4)? 8 Let q be (4/(-3))/(18/27). Find the common denominator of 65/2 and (q/(-6))/(140/1911). 20 Let n = 14067 - 281447/20. What is the common denominator of 45/(-16) + (-33)/44 and n? 80 Let j be ((-44)/5)/(-2)-5. What is the smallest common multiple of 9 and (j/8)/((-7)/28)? 99 Let q be (-2 + 15)/(4/(-509)). Let l = 1671 + q. Calculate the common denominator of (-4)/(-30)410 and l. 12 Let u(k) = -k*2 + 6k - 7. Let c be u(5). Let r = c - -4. Suppose -5f = -2f - 18. What is the smallest common multiple of f and r? 6 Let n = 27 - 19. Calculate the lowest common multiple of n and 6. 24 Suppose -3d = 2g + 60729, 5d + 3g + 101210 = -2g. Let j = d + 364525/18. What is the common denominator of j and -43/4? 36 Let s be (45/12)/((-2)/16). What is the lowest common multiple of 10 and s/(-50) + (-134)/(-10)? 70 Let a = -5 - -11. Let m = -14002 - -280121/20. What is the common denominator of m and ((-1)/2)/(a/231)? 20 Let c be 102/8 + (-9)/(-36). Let f = c + -6. Let l = 24 + -14. Calculate the least common multiple of f and l. 70 Suppose 4n = -3a + 39, -3a - 57 = -0n - 4n. Calculate the smallest common multiple of n and 12. 12 Calculate the least common multiple of (-21)/(-14)12/9 and 4. 4 Suppose b - 14032 = 4v + 3b, v = 3b - 3494. L	{ "pile_set_name": "DM Mathematics" }
tive of 0y5 + 1/36y*4 + 0 - 1/540y*6 + 6y*2 - 7/6y*3 + 0y. Let h(o) be the first derivative of a(o). Factor h(n). -2(n - 1)(n + 1)/3 Suppose -14l + 24 = -8l. Suppose 0 = -4k - 2u + 2, lk - 4u - 11 = -3u. Factor -8/13 - 24/13w - 10/13wk. -2(w + 2)(5w + 2)/13 Find d, given that -115 - 107d2 + 111 + 23d*2 + 38d = 0. 1/6, 2/7 Suppose 0 = 3f - 4f - 3, 0 = 5z - 2f - 16. Let -28d2 - 4d*z + 11d*2 - 6d = 0. Calculate d. -2/7, 0 Factor 52 - 151 + 2t2 + 47 + t + 51. (t + 1)(2t - 1) Find i, given that -5/2i*3 - 19 - 55/2i + 49i2 = 0. -2/5, 1, 19 Let g(u) = u4 - u2 + u + 1. Let y(j) = -j + 0j - 2j + 6j*3 - 22j*2 - 8j*4 - 3 + 32j*2. Let l(h) = -4g(h) + 4y(h). Factor l(s). -4(s - 1)*2(3s + 2)2 Let l(m) be the third derivative of m7/2520 - m6/360 + m5/120 + 3m*4/8 - 10m2. Let k(g) be the second derivative of l(g). Factor k(p). (p - 1)2 Let t(v) = 24v + 1. Let s be t(1). Let l be 5/240/s. Determine x, given that 9xl - 3x4 - x2 + 2x5 - 7x2 = 0. -2, 0, 1 Let p(a) be the second derivative of -a7/147 + a*6/35 + 2a*5/35 + 42a. Solve p(s) = 0 for s. -1, 0, 4 Let i be (4/(-7))/(342/(-399)). Solve -10/3b + 4/3 + 2/3b*3 - ib*4 + 2b*2 = 0. -2, 1 Suppose 1 = 5g - 3q, -22q + 27q - 23 = -4g. Let x(f) be the first derivative of 6fg + 18f + 2/3f3 + 2. Factor x(k). 2(k + 3)*2 Let m(y) = -y. Let q(j) = 4j*2 + 3j - 1. Let w(u) = -6m(u) - q(u). Suppose w(x) = 0. Calculate x. -1/4, 1 Let x(m) be the first derivative of 5m*4/4 - 25m*3/3 + 10m2 + 82. Solve x(t) = 0 for t. 0, 1, 4 Let b(x) be the third derivative of x8/42 - 29x7/105 + 67x*6/60 - 67x*5/30 + 29x*4/12 - 4x*3/3 + 8x*2 + 5x. Factor b(w). 2(w - 4)(w - 1)*3(4w - 1) Suppose 4v + 5b = 15, -3b = -3v - 5 - 4. Find a such that a - 6a*2 + va*2 - 3a*3 - 5a + a*3 = 0. -2, -1, 0 Let w be 68/519/(-678). Let p = w + 462/565. Factor 1/5 + 6/5d2 + 1/5d*4 - 4/5d*3 - pd. (d - 1)*4/5 Let f be (-124)/(5 + -3) + 3. Let j = -31 - f. Determine d so that -13d*2 + jd3 + d2 + d*2 + 8 + 16d*4 - 28d - 13d2 = 0. -2, -1, 1/4, 1 Let c(v) be the first derivative of -12/7v*2 + 7 - 8/7v - 2/7v3 + 5/14v*4. Factor c(i). 2(i - 2)(i + 1)(5i + 2)/7 Suppose -151 = -48n - 55. Factor -1/2t4 + 0 + 2t - 4tn + 5/2t*3. -t(t - 2)*2(t - 1)/2 Let a(u) be the first derivative of -2/5u6 - 7/15u*3 + 11/20u*4 + 7/25u*5 + 0u - 14 + 1/10u2. Solve a(o) = 0 for o. -1, 0, 1/4, 1/3, 1 Let y = 129 - 125. Suppose 6f = yf. Determine z so that 0 - 1/2z*5 - 1/2z*2 + 1/2z*3 + fz + 1/2z4 = 0. -1, 0, 1 Factor 4/3 - 1/9t*2 - 4/9t. -(t - 2)(t + 6)/9 Let k = -308604/7 + 44088. Solve 90/7r*4 + 0r + 0 - 78/7r5 - kr*3 + 0r*2 = 0 for r. 0, 2/13, 1 Solve 10w + 3w2 - 13 - 11 - 16w = 0 for w. -2, 4 Let k(i) be the third derivative of -i*5/30 - 3i*4/4 + 52i*3/3 - 356i*2. Determine y so that k(y) = 0. -13, 4 Let v = 795 - 760. Factor -49/5m*5 - 8m + 4/5 + 29m2 + vm*4 - 47m3. -(m - 1)3(7m - 2)2/5 Let g(n) be the first derivative of n6/6 - 5n4/4 + 2n*2 - 115. Solve g(o) = 0. -2, -1, 0, 1, 2 Find n, given that 36/11n*4 - 120/11 - 138/11n*3 + 90/11n*2 + 144/11n = 0. -1, 5/6, 2 Let l(w) be the second derivative of -1/30w5 + 0 + 1/9w*4 + 0w*3 - 9w + 0w2. Factor l(h). -2h*2(h - 2)/3 Let w be -3 + 5 - (-4)/(-14). Suppose -6v = 5 - 17. Factor -2/7g*v - wg - 18/7. -2(g + 3)2/7 Let j(p) = -2p - 2p + 3 + 5p - 2. Let h(k) = -4k2 + 3k - 9. Let i(s) = h(s) + 5j(s). Suppose i(t) = 0. What is t? 1 Factor -456 - 197s*2 + 376s*2 + 593s*2 - 68s*2 - 1132s - 12s3. -4(s - 57)(s - 2)(3s + 1) Let n be -2 - 6(-2 + 1). Suppose -3i - 2q + 3q + 4 = 0, 2i + 20 = -5q. Factor -n + 4 + 2s + s*2 + i. s(s + 2) Let f(k) be the second derivative of 0 - 3k + 0k*2 - 1/15k*3 - 1/60k*4. Factor f(r). -r(r + 2)/5 Solve -43b2 + 80 + 11233b - 11273b - 32b*2 + 40b*3 - 5b*4 = 0. -1, 1, 4 Let z(l) = 6l + 0l + 4l*2 + 1 - 4l - 4l. Let f be z(2). Factor 4s*2 + fs + 2s2 - 10s + 3s3. 3s(s + 1)2 Let y be (5/10)/((-3 + (-172)/(-60))/(-2)). Factor -15/2k*2 - yk*3 + 0 - 5/2k*4 - 5/2k. -5k(k + 1)3/2 Let w(d) be the first derivative of d4/4 + 4d3/3 - 109. Let w(i) = 0. Calculate i. -4, 0 Let o(i) be the first derivative of -1/2i + 7 + 1/12i3 - 1/8i*2. Let o(y) = 0. Calculate y. -1, 2 Determine i, given that 48/7 + 8/7i - 2/7i3 - 20/7i*2 + 2/7i4 = 0. -2, 2, 3 Let u(z) be the third derivative of -z5/12 + 5z4/6 + 25z*3/6 - 15z*2 + 10. Solve u(q) = 0. -1, 5 Factor -4p*3 + 1/2p*4 - 16p - 15p2 - 11/2. (p - 11)(p + 1)3/2 Factor -x + x3 + 1/2x4 - 1/2 + 0x*2. (x - 1)(x + 1)*3/2 Let m be ((-4)/130)/(345/(-17940)). Factor 2/5x*5 - 22/5x*2 - 24/5x - 2/5x3 + 6/5x*4 - m. 2(x - 2)(x + 1)3(x + 2)/5 Let c(l) = 5l4 - 5l*2 - 4. Let n(z) = 48 - 37 - 3z*3 + 3z*3 - 14z*4 + 14z*2. Let v(q) = 11c(q) + 4n(q). Factor v(t). -t2(t - 1)(t + 1) Suppose -3w + 5 = -1. Let k(y) = 3y - 4. Let z be k(w). Solve -20x*4 - 2x*5 + 4x*2 + 12x*4 - 12x*2 - zx - 12x3 = 0 for x. -1, 0 Let u be (-13 - (-330)/24)1. Factor -15/8p - 3/8p*2 - 3/4 + up*3. 3(p - 2)(p + 1)(2p + 1)/8 Let -488601/7y + 2097/7y2 + 37948011/7 - 3/7y*3 = 0. What is y? 233 Determine g so that 5256/5g*2 + 17328/5 - 48g*3 - 3648g + 3/5g4 = 0. 2, 38 Factor -18 - 3t*3 - 3t*2 + 3t*4 - 18t*2 + 30t - 2t3 + 2t*3 + 9t. 3(t - 2)(t - 1)*2(t + 3) Let l(k) = 10k2 - 252k - 8706. Let t(u) = 2u2 + 2u + 1. Let a(v) = l(v) - 6t(v). Factor a(m). -2(m + 66)*2 Factor -18/5 - 36a*2 - 111/5a - 27/5a3. -3(a + 6)(3a + 1)*2/5 Suppose -r = -9h + 4h + 11, 5h - 27 = -3r. Suppose -m = 5j - 6m - 20, rm = -j - 6. Factor 1/2aj + 0 + 1/2a. a(a + 1)/2 Let j(c) = -7c*4 - 72c*3 - 66c*2 + 52c + 73. Let f(t) = 6t4 + 72t*3 + 66t*2 - 57t - 72. Let n(x) = -4f(x) - 3j(x). What is y in n(y) = 0? -23, -1, 1 Solve 373h - 546 + 4h*2 + 210 - 41h = 0. -84, 1 Factor 440l2 - 857l*2 + 385l + 422l2 + 750. 5(l + 2)(l + 75) Suppose -6u = -10u + 16. Factor 8 - ui*3 + 7i + 0i + 4i*4 - i - 12i*2 - 2i. 4(i - 2)(i - 1)(i + 1)2 Let m be 5232/9592(-88)/(-10). Determine o so that -mo - 3/5o*2 + 0 = 0. -8, 0 Suppose -3k = 226 - 259. Suppose 2o - 3p - k - 4 = 0, -3p - 15 = 5o. Suppose 2/9z4 + 2/9z*5 + 0 + 0z*3 + oz + 0z2 = 0. What is z? -1, 0 Suppose 4m = 9m - 15. Let z(j) be the second derivative of 0j*6 + 1/21j*7 + 0 + 0j*2 - 2j + 0j4 + 0j*m + 0j5. Let z(u) = 0. Calculate u. 0 Let t(a) = a2 + 4a + 3. Let f be t(4). Let -40n - fn2 - 6 + 9 + 14 + 3 + 25n*3 = 0. What is n? -1, 2/5, 2 Suppose -r = 5d - 15, 10r + 4d - 12 = 5r. Let t(h) be the first derivative of 0h*2 + 2 - 1/9h*3 + 1/12h*4 + rh. Factor t(f). f*2(f - 1)/3 Let n(i) = -6i4 + 7i*3 - 4i*2 - 12i. Let v(b) = 2b4 + b3. Let q(w) = -n(w) - 5v(w). What is k in q(k) = 0? -3, -1, 0, 1 Let x = 27 + -34. Let j(c) = -c*2 - 4c + 21. Let h be j(x). Solve -2/7v + 2/7v*5 + h + 0v*3 + 4/7v*4 - 4/7v*2 = 0 for v. -1, 0, 1 Let x be (-1)/9 - (-1496)/6336. Let w(k) be the first derivative of xk*4 - 1/3k*2 + 0k*3 - 1/30k*5 + 0k + 6. Factor w(p). -p(p - 2)2(p + 1)/6 Let i(s) be the first derivative of 4s3/15 - 18s*2/5 + 72s/5 + 742. Find r, given that i(r) = 0. 3, 6 Let g(r) = 135r3 + 15r*2 - 185r - 40. Let q(a) = 2a2 + 5a*3 - 23a + 132 + 12a3 - 137. Let w(x) = -3g(x) + 25q(x). What is f in w(f) = 0? -1, -1/4, 1 Let j be -3 + (5 - (-9)/(-3)). Let d be 10 - 7 - 1/j. Factor 21 + 28g + 3g2 + 27 - dg. 3(g + 4)2 Let c(h) be the third derivative of h7/210 + h6/60 - h5/5 + 7h*4/12 - 5h3/6 + h2 - 34. Let c(m) = 0. What is m? -5, 1 Let u(h) = 36h + 975. Let t be u(-27). Let f(n) be the first derivative of -4 - 1/4n*2 + 1/12n*t + 0n. Factor f(y). y(y - 2)/4 Let n(j) be the first derivative of 0j + 5/12j4 + 5/36j*6 + 0j*2 + 8 + 0j*3 - 1/2j*5. Factor n(c). 5c*3(c - 2)*(c - 1)/6 Le	{ "pile_set_name": "DM Mathematics" }
2, -1, 2 Suppose -2y - 10y = 684. Let w be 6 - (-4 + (-450)/y - -2). Factor 0s - ws*5 + 2/19s*3 + 2/19s*2 + 0 - 2/19s*4. -2s*2(s - 1)(s + 1)2/19 Factor -121/5i + 1/5i3 - 38/5i*2 - 82/5. (i - 41)(i + 1)(i + 2)/5 Let u(c) be the first derivative of -c4/4 - c3 + 2c*2 + 12c - 213. Find w, given that u(w) = 0. -3, -2, 2 Solve 50/17y3 + 0y + 0 + 28/17y4 + 2/17y*5 + 24/17y2 = 0 for y. -12, -1, 0 Let l(g) = -g3 - g*2 - 3g - 5. Let y be l(-2). Factor -yz2 + 6z*3 + 61z*2 + 112z*2 - 106z*3 - 32z - 8z3. -4z(3z - 4)(9z - 2) Let h(k) be the first derivative of 2k5/5 + 107k*4 - 862k*3/3 + 216k2 + 1054. Suppose h(g) = 0. Calculate g. -216, 0, 1 Let z(f) be the second derivative of f7/42 - f*6/30 - 27f*5/20 - 9f*4/4 + 9f*3 + 190f + 2. Solve z(x) = 0 for x. -3, 0, 1, 6 Let c(v) be the third derivative of -v*6/72 + 7v5/120 - v4/12 - 35v3/6 - 145v*2. Let b(x) be the first derivative of c(x). Factor b(u). -(u - 1)(5u - 2) Let z be -9 + -8 + 9 - (2 - 0). Let k be 15z/9(-3)/8. Suppose -kf*3 + 4f - 1 - 11/4f4 + 9/4f*5 + 15/4f*2 = 0. What is f? -1, 2/9, 1, 2 Suppose -n + 6k + 134 - 128 = 0, -5k - 5 = 0. Let a(i) be the second derivative of -35i + 11/36i4 + n - 7/18i3 - i2 + 1/30i5. Factor a(j). (j - 1)(j + 6)(2j + 1)/3 Let y(f) = f*3 - 3f*2. Let d be y(3). Let z be (-47 + 32)(-9 + (-156)/(-18)) + -2. Let 3/5i4 + 0i + diz - 6/5i2 + 3/5 = 0. Calculate i. -1, 1 Let i(l) = l5 + l*4 - 6l*3 + 2l2 + l + 1. Let t(g) = -g3 - 2056 + 2056 + g*2. Let h(y) = 3i(y) - 12t(y). Factor h(x). 3(x - 1)*2(x + 1)*3 Let -19q*2 - 15/4q*4 + 0q - 18q3 + 1/4q*5 + 0 = 0. Calculate q. -2, 0, 19 Let w(h) = -19h*4 - 167h*3 + 586h*2 - 711h + 289. Let j(c) = -3c4 - 34c*3 + 117c*2 - 142c + 58. Let o(r) = 11j(r) - 2w(r). Factor o(k). 5(k - 3)(k - 2)*2(k - 1) Let p(g) be the third derivative of g10/75600 - g9/30240 + 7g5/5 - 3g*2 - 15g. Let j(n) be the third derivative of p(n). Solve j(y) = 0. 0, 1 What is j in -804/5j + 156/5j*3 + 174/5j*2 + 477/5 - 3/5j*4 = 0? -3, 1, 53 Let v(d) = -d + 1. Let l be v(-2). Let g be 4/((-132)/(-93)) + 8/44. Suppose 16 + 0m*g - 6 + 15m - 5ml = 0. What is m? -1, 2 Suppose -4t + 93 = s + 4s, -4t + 2s = -114. Let m = -23 + t. Suppose -2 - 2h*m - 1 + 1 + 4h*2 = 0. What is h? -1, 1 Factor 3/2y + 5/2y3 + 0 - 1/2y*4 - 7/2y*2. -y(y - 3)(y - 1)2/2 Let d(l) be the first derivative of -296 + 13/5l*3 - 4/5l + 38/5l2. Factor d(f). (f + 2)(39f - 2)/5 Let m be (-8)/(((-2)/(-7))/((-86)/3010)). Factor -m + 3/5y + 1/5y2. (y - 1)(y + 4)/5 Let w(a) = -3a2 + 22a - 53. Let y(h) = -h*2 + 1. Let v(r) = w(r) - 2y(r). Let l be v(19). Let -1/4zl - 9 - 3z = 0. What is z? -6 Let w(k) be the third derivative of 2 - 9k2 + 11/56k*4 + 0k - 13/140k5 - 1/7k*3 + 1/70k*6. Suppose w(g) = 0. Calculate g. 1/4, 1, 2 Let m(o) = 7o*2 - 9o + 11. Let d be 0 + 10 + -7 + -23. Let z(w) = -48w2 + 64w - 76. Let k(q) = dm(q) - 3z(q). Factor k(i). 4(i - 2)(i - 1) Factor 2/3w2 + 24w + 0. 2w(w + 36)/3 Let x be (((-51075)/(-10))/(-15))/((-6)/(-10)). Let y = 569 + x. Suppose yb2 + 3b + 0 = 0. What is b? -2, 0 Let a(l) = -l*2 + 5l + 11. Let b be (-3)/(-9)(14 - 2). Let n(w) = w2 - 6w - 11. Let x(q) = ba(q) + 5n(q). Solve x(z) = 0. -1, 11 Suppose 7b - 13 = 29. Let f be ((-4)/b)/(((-120)/9)/4). Solve 0 - fu*2 - 2/5u = 0. -2, 0 Let r(g) be the third derivative of g*5/15 - 84g*4 - 2024g*3/3 - 13421g*2. Find s such that r(s) = 0. -2, 506 Suppose 4u = 39 - 31. Factor -2v + 2v + 1620v2 - 1625v*u + 20. -5(v - 2)(v + 2) Factor 62q*2 + 704 - 193q + 5q3 - 3q3 - 1103 - q3 + 529. (q - 2)(q - 1)(q + 65) Factor 528 + 110f2 + 778f + 248 - 213f2 + 105f*2. 2(f + 1)(f + 388) Suppose 45n + 9n = 216. Solve 3t*n + 9 + 754t - 760t - 12t*2 - 4t*3 + 10t*3 = 0. -3, -1, 1 Solve 0 + 46/5q + 2/5q2 = 0. -23, 0 Suppose 0 = -2w - 79 + 85. Let a = 5 - 3. What is l in -l*3 - 8l*a + wl*3 + 4l*3 - 4l*3 = 0? 0, 4 Solve -55 - 430002w*4 + 430000w*4 + 38w*3 - 5 + 154w - 130w2 = 0. 1, 2, 15 Let h(x) = -x3 - 2x*2 + 8x + 3. Let o be h(-4). Suppose -26d2 - 5d*5 - 16d*2 - 80d + 47do + 17d*2 + 5d*4 + 60 - 2d*3 = 0. What is d? -2, 1, 3 Let u(f) be the second derivative of -2/5f*4 - 1/25f*5 - 22/15f*3 - 173 - 2f - 12/5f2. Factor u(r). -4(r + 1)(r + 2)(r + 3)/5 Let r(w) be the second derivative of w*5/5 - 38w*4/3 + 48w*3 - 3038w. Factor r(u). 4u(u - 36)(u - 2) Let q(w) be the second derivative of 1/18w*4 - 2/3w*2 + 0 - 56w + 1/9w3. Factor q(k). 2(k - 1)(k + 2)/3 Let t(b) = 6b*3 - 1668b*2 - 3304b - 1655. Let p(k) = -16k3 + 5004k*2 + 9916k + 4966. Let j(r) = -5p(r) - 14t(r). Suppose j(w) = 0. Calculate w. -415, -1 Let z be -3 + 3 - -9 - (-4488)/(-544). Let 25/4t4 - t5 + z - 11/2t - 27/2t3 + 13t*2 = 0. What is t? 1/4, 1, 3 Let u(v) be the first derivative of 5v*3/18 - 675v*2/2 + 273375v/2 + 1225. Factor u(q). 5(q - 405)2/6 Suppose -i - 12 = -n, -3n + 21i + 24 = 24i. Let b(r) be the first derivative of -2r + n - 2r*3 + 1/2r*4 + 3r*2. Solve b(x) = 0 for x. 1 Factor 5 + 164f*2 + 2 - 2f - 329f2 + 160f*2. -(f - 1)(5f + 7) Let a(r) = -2r*2 - 24r + 2. Let f be a(-12). Solve 2d2 + 22d + 2d - 2d - 22 - fd = 0 for d. -11, 1 Let p = 533 - 526. Let r(s) be the third derivative of 1/72s*4 - 1/630s*p - 1/360s*6 + 0 + 3s*2 + 0s + 0s3 + 1/180s*5. Factor r(a). -a(a - 1)(a + 1)2/3 Suppose -37 = -4o + 4t + 19, 42 = 3o - 5t. Suppose -4d + 2r = -8, -4r = -3d + 5d - o. Factor 3/4w4 - 3/4w*d + 3/4w - 3/4w2 + 0. 3w(w - 1)2(w + 1)/4 Let u(g) be the second derivative of -g*7/70 + 3g6/40 + g5/4 - 3g4/8 + 43g*3/6 + 2g - 19. Let m(d) be the second derivative of u(d). Factor m(k). -3(k - 3)(k + 1)(4k - 1) Let o = -446024/3 + 148675. Find a such that -25 - 13/3a2 - 55/3a - oa3 = 0. -5, -3 Let m = 404/1743 + 2501/1743. Factor -70/3z - mz4 + 25/3 + 20z*2 - 10/3z*3. -5(z - 1)*3(z + 5)/3 Let g(p) be the first derivative of p*4/3 - 8p*3 + 120p - 16. Let j(w) be the first derivative of g(w). Factor j(t). 4t(t - 12) Let h be -5 + ((0 - 1)-129 - 3). Let t = -116 + h. Find m such that 0m*2 + 0m + 4/7m4 + 0m*3 + 0 + 4/7m*t = 0. -1, 0 Suppose -6/7r*2 - 4/7r*3 + 72/7r - 88/7 = 0. What is r? -11/2, 2 Suppose 9s2 + 1/10s*3 + 966/5s - 2116/5 = 0. What is s? -46, 2 Let n = 0 - 3. Let k(l) = -l*3 - 3l*2 - l - 1. Let p be k(n). Factor 22 + 30y + 2y3 - 18y*2 + p + 0 + 26. 2(y - 5)*2(y + 1) Let t(i) be the first derivative of 4i3/21 - 365i*2/2 - 639i/7 + 6373. Factor t(z). (z - 639)(4z + 1)/7 Factor 1/5w4 - 4/5w*3 + 0 - 1/5w*2 + 4/5w. w(w - 4)(w - 1)(w + 1)/5 Let q(x) = -6x5 - x4 - 29x3 + 5x*2 + 69x - 31. Let i(k) = -5k5 - k4 - 27k*3 + 5k*2 + 64k - 30. Let g(d) = -7i(d) + 6q(d). Solve g(r) = 0. -3, -2, 1, 4 Let x = -60 + 81. Suppose -17o + xo = 12. Factor -12/5b2 - 3/5 - 2b - 6/5bo - 1/5b4. -(b + 1)3(b + 3)/5 Let l be (-17)/(-5) + (-204)/(-340). Factor 2/7o*l - 2/7o*2 + 2/7o*3 + 0o - 2/7o5 + 0. -2o*2(o - 1)*2(o + 1)/7 Let z be (-6)/(-10) + 63/45. Suppose zi = -6i + 168. Factor 5n2 - i + 15n + 34 - 13. 5n(n + 3) Let s be (24 + -24)2(-1)/(-10). Factor -39 - 36v2 + 3v*4 + 69v + 3 - 9v3 + 9v*2 + s. 3(v - 4)(v - 1)2(v + 3) Let k be (-18)/(2430/351)5/3 - -6. Suppose 20c*2 - 120c + 50/3c3 + kc4 + 0 = 0. What is c? -6, 0, 2 Let x(z) be the second derivative of -z7/42 - z6/10 + z5/2 + 13z4/3 + 12z*3 + 16z*2 - 2100z. Determine c, given that x(c) = 0. -2, -1, 4 Let a = -1881/59 - -5938/177. Find l such that 25/6l - al*2 - 5/3 = 0. 1/2, 2 Let i be (-63/(-243))/(9/(90/20)). Let a(c) be the second derivative of 15c + 0 + 0c*2 + 1/9c*3 - 1/90c*5 + ic*4. Factor a(x). -2x(x - 3)(x + 1)/9 Let x(d) be the second derivative of d9/8064 - d8/1120 + d7/448 - d6/480 + 43d3/6 + 163d. Let o(v) be the se	{ "pile_set_name": "DM Mathematics" }
6105 - 13920 = -93v + 411v for v. -93 Solve 2802f + 52818 = -81678 for f. -48 Solve 163y + 328 = 90y + 99y - 140 for y. 18 Solve 222i - 11042 - 1390 = 0 for i. 56 Solve 119o - 296o - 308o - 37345 = 0 for o. -77 Solve -55z - 433191 + 429451 = 0 for z. -68 Solve -19464s = -18362s - 3042 - 264 for s. 3 Solve -1265a = -1473a + 5824 for a. 28 Solve 2f - 2548 = 110f + 800 for f. -31 Solve 1463p - 1430p = 1320 for p. 40 Solve -136453 + 32908 = -1593u for u. 65 Solve -155q = 212q + 142q + 18085 - 6378 for q. -23 Solve 0 = 6100n - 1522n - 114450 for n. 25 Solve -83056 + 570736 = -3613c - 1905c - 69638 for c. -101 Solve -39607 + 249988 = 3049k for k. 69 Solve 0 = 254x + 26566 - 18184 for x. -33 Solve -2086036p = -2085910p - 1890 for p. 15 Solve -371 - 309 = -102k - 170 for k. 5 Solve -44892 + 333 - 8118 - 13011 = -2856n for n. 23 Solve 552u + 534u + 153u - 1239 = 0 for u. 1 Solve 145d - 4048 + 2423 = 3160 for d. 33 Solve 2035h = 2736h - 3061 - 6052 for h. 13 Solve -5542 = -107w - 1904 for w. 34 Solve 1142z - 84851 = 931z + 1004z for z. -107 Solve 100768 + 247475 = -5047x for x. -69 Solve -38o + 338 = 870 for o. -14 Solve -28833 - 15267 = -329z - 346z - 375z for z. 42 Solve 498815x + 650 = 498750x for x. -10 Solve -400n - 14911 = 3n for n. -37 Solve -23782g + 23575g + 13869 = 0 for g. 67 Solve 0 = 69m - 3412 + 9346 for m. -86 Solve 29176 = 1097c + 3863 - 36119 for c. 56 Solve 4666l = 5409l - 17832 for l. 24 Solve 0 = -20772t + 20458t + 16642 for t. 53 Solve 3765 = -27x + 3819 for x. 2 Solve 44b + 889b - 58830 = 344b - 1372b for b. 30 Solve -103302 = 1307d + 96141 - 49688 - 7292 for d. -109 Solve 145n = -1184 - 113 - 1313 for n. -18 Solve 10120820 = -76q + 10125304 for q. 59 Solve -4329g + 54g + 36812 + 339388 = 0 for g. 88 Solve 16s + 1199921 = 1200513 for s. 37 Solve 565x + 162x + 666x = 118x + 173400 for x. 136 Solve 80b - 85b = -92b + 1305 for b. 15 Solve 7807 + 616 = 496p - 13482 + 5041 for p. 34 Solve 0 = 12930x + 163876 + 249884 for x. -32 Solve -70z - 152z = -14z - 7488 for z. 36 Solve -12033 - 12044 = 295n - 941 - 3371 for n. -67 Solve -2326w = 901w - 209755 for w. 65 Solve -1268o + 38180 = -806o - 794o for o. -115 Solve -188p = -11p - 34p + 858 for p. -6 Solve 48847s + 154 + 65 = 48774s for s. -3 Solve -91z + 332z = -31z - 42z - 13188 for z. -42 Solve 0 = -2884u + 636u - 745u + 90684 + 41008 for u. 44 Solve 8o + 2o - 6o + 7o - 11 = 0 for o. 1 Solve 0 = 10196s - 10591s - 26070 for s. -66 Solve 1283h - 886h + 13420 = 702h for h. 44 Solve -1863 - 8785 = 451a + 2882 for a. -30 Solve 0 = -375q - 17q + 6534 + 2874 for q. 24 Solve 320v - 2305v + 116775 = -1604v + 7404v for v. 15 Solve -280y - 1438 = 3469 - 147 for y. -17 Solve -5348m + 111872 = -604760 for m. 134 Solve 8578a = -4510a - 235584 for a. -18 Solve 29x - 232x - 72x = x + 30636 for x. -111 Solve 11363i + 3328 = -11408i + 22835i for i. 52 Solve -1202h - 61688 = -4006h for h. 22 Solve 280r + 542r - 18824 = 98r for r. 26 Solve 1030784w - 1030772w + 384 = 0 for w. -32 Solve -28w + 5 = 83 - 190 for w. 4 Solve -740l = 82l + 1030 + 1436 for l. -3 Solve 3263b - 2180b = -1924b - 276644 for b. -92 Solve 2120 = -4923z + 1744z + 6036 + 2442 for z. 2 Solve -1100j - 8j + 44948 = 386j - 23776 for j. 46 Solve 0 = -12b + 68b - 14996 + 13876 for b. 20 Solve -1943s = 2799s + 3839s - 2722s - 626913 for s. 107 Solve -45502u + 89556 = -46819u for u. -68 Solve -64942 + 286263 = -5147j for j. -43 Solve -11983 - 9993 = -328r for r. 67 Solve -81861 + 225756 = 7226v + 57500 - 224323 for v. 43 Solve 319 = 245s + 28 - 474 - 460 for s. 5 Solve -59k = 37k + 33k + 3096 for k. -24 Solve 0 = 429u + 5757 + 1034 + 73 for u. -16 Solve 0 = 867334s - 867754s + 13860 for s. 33 Solve -240c - 17942 = -18509 - 7833 for c. 35 Solve 311k - 4438 = 3486 + 2115 - 1953 for k. 26 Solve -1765 + 4771 - 1550 = 20w - 404 for w. 93 Solve -5115 - 15406 + 6348 = 1509d + 9971 for d. -16 Solve 3940l - 26783 = -24321 + 119678 for l. 31 Solve 158f + 10147 = 6671 for f. -22 Solve 2726 = 306p - 510p - 130 for p. -14 Solve -62r - 530 = 643 + 21 + 2464 for r. -59 Solve -696 - 4425 = -175o + 304 for o. 31 Solve -621n - 711n = -1164n + 8904 for n. -53 Solve 35r - 20542 + 22992 = 0 for r. -70 Solve -374c = 725c + 2001 + 6791 for c. -8 Solve 607w + 24927 = 5838 - 22794 for w. -69 Solve 0 = -3492w + 3452w + 3320 for w. 83 Solve 0 = 164v - 21338 + 15270 for v. 37 Solve 17c + 5760 = -147c + 44c for c. -48 Solve 248s + 628s = -31740 + 8619 - 18051 for s. -47 Solve 22v - 6652 = -8126 for v. -67 Solve 142m + 36m + 45m - 5798 = 2230 for m. 36 Solve 116o = 937 + 3618 - 150 - 693 for o. 32 Solve -551613 - 27762 = 8320t + 11345 for t. -71 Solve 397l = -532l - 274l - 5l - 14496 for l. -12 Solve 1698y + 2593y + 159120 = 243y - 372y for y. -36 Solve 23p + 325 - 600 = -528 for p. -11 Solve 115y + 331y = 217y + 7099 for y. 31 Solve -1817o + 265285 = 1304o for o. 85 Solve 4057 = -25v - 4011 + 9693 for v. 65 Solve 319k = -1002k - 2964 - 36666 for k. -30 Solve -177 = 313x + 449 for x. -2 Solve 57z + 150z + 7z = -4430 - 10550 for z. -70 Solve -73k + 306 = -40k - 24k for k. 34 Solve 103c + 16417 = 16932 for c. 5 Solve -117p - 615 - 2531 = -572 for p. -22 Solve 577v + v - 15573 = 41v for v. 29 Solve 1104z = 3793z - 26890 for z. 10 Solve 4833l - 298227 - 84260 - 42817 = 0 for l. 88 Solve -1938 = 85b - 145b + 111b for b. -38 Solve 157z = -120z - 17451 for z. -63 Solve -8a - 17 = 291 + 84 for a. -49 Solve 41o - 258 = -90o + 7864 for o. 62 Solve 0 = -509z - 745z + 26746 + 7112 for z. 27 Solve -20l - 18981 - 56202 = -1339l for l. 57 Solve 25017 = 2707g - 3514g for g. -31 Solve -1011m - 56801 + 65217 = 1694m - 170114 for m. 66 Solve 86800 = 4262z - 5998z for z. -50 Solve 528t + 9767 = 1220 - 429 for t. -17 Solve -882b - 33b + 11272 - 1882 = -9825 for b. 21 Solve 214h = 452 - 54 + 2384 for h. 13 Solve 767h = -6901 - 6905 for h. -18 Solve 145a - 465 + 305 = -15a for a. 1 Solve 16q - 24q + 2862 - 7686 = 28q for q. -134 Solve 112t + 89 - 61 = -t - 85 for t. -1 Solve -723a = -883a + 6501 - 1221 for a. 33 Solve -15652 = 29b - 16261 for b. 21 Solve 157q - 1360 = -1525 - 12081 for q. -78 Solve 1421a + 1554a - 20151 = 736a for a. 9 Solve -6870y = -73y + 1129y - 340y + 462746 for y. -61 Solve -3983b + 6753b - 3477b - 17675 = 0 for b. -25 Solve -6826z + 334198 + 110330 = -1338z for z. 81 Solve 1547i + 40788 = 1135i for i. -99 Solve 2676642z = 2676677z + 1540 for z. -44 Solve 1895086 = 188o + 1910314 for o. -81 Solve -4019u - 5359u = -262584 for u. 28 Solve -12842x + 11478x + 83204 = 0 for x. 61 Solve -l + 88l = -181l - 53l - 37236 for l. -116 Solve 4115a = 25231 + 110564 for a. 33 Solve 6511 + 4203 = -1701c + 508 for c. -6 Solve -2176c + 29484 = -16212 for c. 21 Solve -120u - 672u - 369u + 346u + 70905 = 0 for u. 87 Solve -540j - 1378j + 27862 + 59778 = 273j for j. 40 Solve -749292r - 3060 = -749241r for r. -60 Solve -1041y - 2156y - 1021 + 31927 = -154520 for y. 58 Solve 1699o - 126384 = 4239o - 236605 - 270779 for o. 150 Solve -211m - 46697 + 69335 = 51545 for m. -137 Solve 2659 = -129u - 1469 for u. -32 Solve -2155c - 34774 - 6346 - 6290 = 0 for c. -22 Solve -1706 - 810 + 767 = -53q for q. 33 Solve 715q - 338q - 355q = 352 for q. 16 Solve 45p = p - 332 - 613 - 639 for p. -36 Solve 250l - 11076 + 5076 = 0 for l. 24 Solve 4451w + 80443 = 11921w - 54017 for w. 18 Solve 224x - 2536 + 1132 - 3556 = 69x for x. 32 Solve -76c - 547 + 444 = 79c + 16792 for c. -109 Solve -675v - 12960 + 3393 = 27407 + 10951 for v. -71 Solve 6031908y - 6031957y = -3479 for y. 71 Solve -110y = 668y - 22947 + 6609 for y. 21 Solve -136s = -1006s - 1907s + 147181 for s. 53 Solve 23151q + 73342 = -135017 for q. -9 Solve 55x + 8018 = -113x - 76x + 33x for x. -38 Solve -6662y - 19 = -6663y for y. 19 Solve 70077 = 292b + 1902b - 13295 for b. 38 Solve 1346921 - 984483 = -13849y - 1396385 for y. -127 Solve -834g + 32639 = 284g - 95931 for g. 115 Solve 674 + 161 = -74s + 105 - 232 for s. -13 Solve 1	{ "pile_set_name": "DM Mathematics" }
2m + 10 = v, -2v + o = 2m - 19. List the prime factors of v. 2, 3 Let f(j) = 2j - 9. Let g be f(-8). Let u = 84 + g. What are the prime factors of u? 59 Let j be (-10)/5 + -6 + 2. What are the prime factors of (-2585)/(-15) + j/(-9)? 173 Let f(o) = o*2 - 7o - 17. Let h be f(8). List the prime factors of (h/2)/((-60)/1840). 2, 3, 23 Let u(b) = b*3 - 11b*2 + 11b + 5. Let f be u(10). Suppose 13g = fg. Suppose 0 = -4j - gj + 16. What are the prime factors of j? 2 Let j(r) = 11r + 1. Let x(t) = 5t. Let z(b) = 6j(b) - 13x(b). Suppose 2g - 7g = -4y - 36, -3g - 4y = -28. What are the prime factors of z(g)? 2, 7 Suppose 8d = 1247 + 1121. What are the prime factors of d? 2, 37 Suppose 12x - 17x + 150 = 0. Let g = 81 - x. What are the prime factors of g? 3, 17 Suppose s = -3s + 56. Suppose 3l + 5w + 56 = 0, 2l + 28 = -w - 0w. What are the prime factors of (l/s)/((-4)/112)? 2, 3 Let n(x) = -8x*3 + 5x*2 + 9x + 9. List the prime factors of n(-4). 5, 113 Let p = -29 + 26. Let f(d) = -d*2 - d + 1. Let m be f(-3). List the prime factors of (m + p)/4-14. 2, 7 Let n(p) = -p*3 + 6p*2 - 6p + 5. Let b be 4(-3)/(-12)4. Let j be n(b). Suppose -3q = -73 + j. What are the prime factors of q? 2, 5 Let n(f) = -f3 - 9f*2 - 60f - 16. List the prime factors of n(-12). 2, 71 Let t be (-166)/(-10) + 6/15. Let p(w) = -2w + t - 2 + 0 + 3w. What are the prime factors of p(0)? 3, 5 Let l be (-12)/66 + (-70)/(-22) + 0. Let k be (-2)/2(-2 - -1). Suppose -3n = -lh, 4h = 5n - k - 3. List the prime factors of h. 2 Suppose -2947 = -4f + 3u, 3f - 7f + 2945 = -u. Suppose -4p - 3a = -a - f, 0 = 5p - 4a - 920. Suppose -p = -0t - 8t. List the prime factors of t. 23 Let u = 20 - 8. Let z be 784/u + 1/(-3). Suppose -4y - 9 = -z. What are the prime factors of y? 2, 7 Suppose -6t = -t + 270. Suppose -4 - 8 = -2n. List the prime factors of t/(-15)45/n. 3 Let f(w) be the third derivative of w6/120 - w5/15 - 6w*2. Let o be f(4). List the prime factors of 13/26(o - -38). 19 Suppose -4i - 468 = 400. Let z = -113 - i. List the prime factors of z. 2, 13 List the prime factors of (6 + (20 - -3) + 3)48. 2, 3 Let b(o) = 2o2 + 18o - 21. Let h(c) = c*2 + 19c - 20. Let p(k) = -2b(k) + 3h(k). What are the prime factors of p(11)? 2, 23 Suppose 3n = 15, -565 = -4a + n + 10. List the prime factors of a. 5, 29 Suppose 0 = -0w + 17w - 10574. List the prime factors of w. 2, 311 Suppose 2k = 5q + 31, -k + 5k + 4q = -8. Suppose -ks - 3l + 111 = 0, -5l + 2l = 3. Suppose 0 = -3y + 82 + s. List the prime factors of y. 2, 5 Let r = 1048 - 372. List the prime factors of r. 2, 13 What are the prime factors of (16 + 20/5)127/2? 2, 5, 127 Let d(a) = -8a + 12. Let p be d(-4). Suppose 3l - p = 2l. List the prime factors of l. 2, 11 Let m = -65 - -185. Suppose 0 = -7u + 2u - 2q + 554, u + 5q = m. What are the prime factors of u? 2, 5, 11 Let y(r) = r3 - 5r*2 + 2r - 7. Let q be y(5). Let c(z) = z*2 + qz*2 - z - 3z2 + 8 + 17 + z3. What are the prime factors of c(0)? 5 Let o be ((-3)/6)/(1/(-4)). Suppose 0y + z = oy - 102, 0 = 2y - 4z - 102. Let r = -28 + y. List the prime factors of r. 23 Let l(h) = -27h + 196. What are the prime factors of l(-8)? 2, 103 Let o(c) = -25c + 17. Suppose -g + 6g + 23 = -2r, -4g = -3r. List the prime factors of o(r). 3, 13 Let v(p) = 2p - 6. Let y be v(3). Suppose y = f - 23 - 12. List the prime factors of f. 5, 7 Suppose f = 2909 + 2271. What are the prime factors of f? 2, 5, 7, 37 Let m be (-1)/((-5)/(-1368)) + (-12)/30. Let p = m + 400. What are the prime factors of p? 2, 3, 7 Let y(i) = -12i - 52. Let n be y(-12). Suppose -nl - 136 = -96l. List the prime factors of l. 2, 17 Let j = -27 - -41. Suppose 4q + 4i + j = 2i, -2q - 4i + 8 = 0. List the prime factors of ((-45)/(-6))/(q/(-16)). 2, 5 What are the prime factors of 31040/12 - (-3)/(-18)-2? 13, 199 Let b be 214 - 1 - (-4 + 2). Suppose d = -2x + 53, -4d + 0d = 5x - b. List the prime factors of d. 5, 11 Suppose -5n - 5 + 25 = 0. Let s(l) be the third derivative of -l5/60 + l4/3 + l3/3 + 18l*2. List the prime factors of s(n). 2, 3 What are the prime factors of -5 + 245 + 4 + 5? 3, 83 Let a be 2 - -1833/3. Let c = -94 + a. Suppose 0 = -3r - h + c, -3r - 2r - h = -153. List the prime factors of r. 31 Suppose 0x - 31 = 2k - 5x, 3k - x = -14. Let o = k - -36. List the prime factors of o. 3, 11 Let n be ((-15)/3)/(-1) - 1. Let s(a) = a3 - 17a*2 + 19a - 33. Let w be s(16). Suppose -4f = f + w, -nj + 234 = 2f. What are the prime factors of j? 2, 3, 5 Let p(n) = 222n*2 - 7n + 1. List the prime factors of p(-3). 2, 5, 101 Let b = -2718 - -5389. What are the prime factors of b? 2671 Let k = -952 + 1539. List the prime factors of k. 587 Let o(u) = -u*3 - 2u*2 - u. Let h be o(-2). Suppose 4d + 4m = 3d + 15, -3d + 15 = hm. What are the prime factors of 21 - (24/d)/2? 17 Let m = -304 + 167. Let r = 218 + m. What are the prime factors of r? 3 List the prime factors of 426 - ((5 - 3) + 1). 3, 47 Suppose -q + 27 = 2p, -4q + 4p - 9p + 120 = 0. Let i = q + -24. Suppose 5 + i = 2b. What are the prime factors of b? 2 Suppose 3039 = 12n - 2289. List the prime factors of n. 2, 3, 37 Let m(t) = 29t - 14. Let z(n) = 3n2 + 1. Let w be z(-1). Let g be m(w). Let j = -53 + g. List the prime factors of j. 7 Let o = 3249 - 1747. List the prime factors of o. 2, 751 Let h(s) be the second derivative of -s5/20 + 7s4/12 + 5s*3/6 + 13s*2/2 - 7s. What are the prime factors of h(6)? 79 Suppose 48588 = -435l + 447l. List the prime factors of l. 4049 Let y(b) = -b*2 + 21b + 13. Let g be y(12). Let v = -57 + g. What are the prime factors of v? 2 Let v(l) = l + 2. Let z be v(0). Suppose w - 147 = -2w - zp, 0 = -3p. Suppose -w = -4m + 59. List the prime factors of m. 3 Let a(s) = -s*3 - 5s*2 + 4s - 8. Let o be a(-6). List the prime factors of -3 + 2 - (-100)/o. 2, 3 Let l(s) = -s*3 + 3s2 + s - 1. Let u be l(2). Let f(i) = i3 - 5i2 + 4. Let r be f(u). List the prime factors of r - 4/(-2)-1. 2 Let b = 147 + -64. List the prime factors of b. 83 Let f(u) = 9u2 + u + 54. List the prime factors of f(-11). 2, 283 Suppose m - 4a - 34 - 17 = 0, 0 = -4m - 3a + 242. Let t = -4 + m. What are the prime factors of t? 5, 11 Suppose -3c - 10 = -8c. Suppose -s + cs = 0. Suppose s = -8f + 3f + 15. List the prime factors of f. 3 What are the prime factors of (-16412)/(-32) + 0 - 3/(-24)? 3, 19 Suppose -2p + 27 = -4r - 35, -r = 2p - 87. Suppose -l + 4z = -25, -19 - p = -4l - 4z. Let g = 3 + l. What are the prime factors of g? 2, 5 Suppose 14m = 9m - 1220. List the prime factors of 16m/(-20) + (-2)/10. 3, 5, 13 Let o(w) = -w*3 - 24w*2 - 13w + 11. List the prime factors of o(-24). 17, 19 Suppose -683 + 78 = -5b. Suppose -b + 7 = -2c. List the prime factors of c. 3, 19 Let h(o) = 4o - 1. Let s be h(1). Suppose -sq + 285 = -225. Suppose -q = -6i + i. List the prime factors of i. 2, 17 Let v = -1052 + 1075. Let o(b) = -3b - 1. Let p be o(-2). Suppose -222 - v = -pl - 2h, h - 250 = -5l. List the prime factors of l. 3, 17 Suppose -3a + 142 = -83. What are the prime factors of 372/10 - 15/a? 37 Let w = 1388 + -440. What are the prime factors of w? 2, 3, 79 Let m(j) = -2j3 - 35j*2 - 24j - 7. What are the prime factors of m(-18)? 7, 107 Suppose 235 = -3u - q, -2u + 3u + q = -81. Let w = -50 - u. List the prime factors of w. 3 Let c(k) = -92k - 17. List the prime factors of c(-4). 3, 13 What are the prime factors of 10/10 + (-5 - -1) + 794? 7, 113 Suppose -3f - 20 + 2 = 0. Let a(m) = m3 + 5m*2 - 7m - 3. Let i be a(f). Suppose 3t + y = t + 131, 287 = 4t - iy. List the prime factors of t. 2, 17 Let m(t) be the first derivative of -t4/4 + t3 + t2/2 - 3t - 7. Let r be m(3). Suppose r = -h + 2h - 19. What are the prime factors of h? 19 Suppose 12u - 2w - 19991 = 7u, u = 4w + 4009. List the prime factors of u. 7, 571 Suppose 0 = 17l - 21l - 3v + 4482, 6 = -3v. What are the prime factors of l? 2, 3, 11, 17 Let j(l) = l. Let i(n) = 3n*3 - n. Let t be i(1). Suppose 3m - tb + 19 = 6m, -25 = -5*b. What are the prime factors of j(m)	{ "pile_set_name": "DM Mathematics" }
m = 6m - 26. Let u be (0/a + 4)/12. Let p = -0.2 + -1.8. Put u, -0.1, p in increasing order. p, -0.1, u Let h be -1 + 14/(-6). Suppose -165 = 1036l - 856l + 15. Put h, -13/3, l, -3/5 in increasing order. -13/3, h, l, -3/5 Let j = 139 - 2639/19. Suppose 3s - 63 = 6s. Let b be (0 - 0) + s/(-28). Sort -1, j, -1/4, b in ascending order. -1, -1/4, j, b Suppose -7u = -5d - 201, -2u + 3u - 23 = -5d. Sort u, -12, -4. -12, -4, u Suppose 4w = -r + 16, -r + 2r - 1 = -w. Let l = 11 + -10. Let n = -37011 - -37010. Put l, 4, n, w in descending order. w, 4, l, n Let n(j) = 11j*2 + 130j - 177. Let q be n(-13). Sort 2, 65, q in descending order. 65, 2, q Let z be (-690)/78 - (4 - (-500)/(-130)). Put z, -5, 6, 1, 4 in decreasing order. 6, 4, 1, -5, z Suppose 5m + 538 = 7m. Let a = m - 1879/7. Let b be ((-2)/28)/(2/8). Put b, a, 5 in decreasing order. 5, a, b Let v(y) = y*2 - 6y - 27. Let b be v(9). Let k = -19 + 20. Suppose f + 3 = k. Sort b, 5, f in decreasing order. 5, b, f Let l be ((-319)/2552)/(1/8). Sort 2, 1, -2, 186, l. -2, l, 1, 2, 186 Let v = 2/121 - -236/363. Let k = 2.153 - 1.953. Put k, -0.1, v in descending order. v, k, -0.1 Let o(c) = 3c - 1. Let n be o(2). Let p(z) = 539z*2 + 4843z + 26. Let t be p(-9). Put t, n, 0 in descending order. t, n, 0 Let b be 2/9 - 16/72. Put b, 2, 5, -557 in ascending order. -557, b, 2, 5 Let n = -6232/299 - -490/23. Sort n, 3/20, -1/2, 2/9 in decreasing order. n, 2/9, 3/20, -1/2 Suppose 0 = -4v - 5d + 39 - 4, -5v = d - 28. Suppose j + 18 = 8. Let s be j/(-6) + ((-16)/4)/4. Sort v, 0.4, 0.5, s in decreasing order. v, s, 0.5, 0.4 Let j = 1343.1 - 1343. Sort -7.7, -22, -0.4, j in decreasing order. j, -0.4, -7.7, -22 Suppose 5o + 67 = 127. Suppose -4v + 0v - 2g - 6 = 0, -2v + 2g = -o. Let p be ((5 - v) + -5)5. Sort p, -1, 16. p, -1, 16 Suppose 0 = 40p - 58p - 72. Sort -96, 6, p, 2 in increasing order. -96, p, 2, 6 Let d = -213266 - -213262. Let k(j) = -j*2 - 2j + 3. Let n be k(2). Sort 49, n, d in increasing order. n, d, 49 Let b = 1831 - 1835. Put -0.1, -257, b in descending order. -0.1, b, -257 Let t = -627 - -626.84. Let y = -5.6 - -6. Let v = 34.6 + -32.6. Sort -4, y, v, t in decreasing order. v, y, t, -4 Suppose -1924 = 5v + 2m, -2m - 11 = 3. Sort -5, -1, v, -3, 1. v, -5, -3, -1, 1 Let q = 71.9 + -72. Let d = -2115 - -2110. Let t = -0.7 - -0.76. Sort q, d, t in increasing order. d, q, t Let z(t) = 113t - 225. Let p be z(2). Let v be 249/(-15) + (-3)/(-5). Sort p, v, -2 in decreasing order. p, -2, v Let u be -2 + 0 + (-2 - -4)(-585)/(-78). Sort 3, -51, u in decreasing order. u, 3, -51 Suppose 3u + 5g + 27 = 0, 0 = -u + g + 3g + 8. Let i = 60319 + -60318. Sort i, u, 4, 5 in descending order. 5, 4, i, u Let u(g) = -2g3 - 40g*2 - 5g - 104. Let j be u(-20). Put -752, j, 4 in decreasing order. 4, j, -752 Let w = 14.947 - 13.347. Put w, -5, -1/4 in descending order. w, -1/4, -5 Let v be 924/(-46) - (-4)/(-276)-6. Let q be v(8 + (-297)/36). Let j(z) = -z*3 + 5z*2 - 2z. Let d be j(4). Sort q, 2, d in descending order. d, q, 2 Let f = 57 + -110. Let q = -51.4 - f. Let z = q + 2.4. Sort 2/19, 0, z. 0, 2/19, z Let p = -34.632 - -39.632. Sort p, 4, 3/5, 0.196. 0.196, 3/5, 4, p Let l = -0.22 + 0.33. Let d = -2.2 + 2.5. Sort 2/7, d, -1/4, l in increasing order. -1/4, l, 2/7, d Suppose f - 2y + 1 = 6, y - 20 = -4f. Suppose -fw + 1133 = 183. Put w, 5, 4 in decreasing order. w, 5, 4 Let q = 1.96 - -0.04. Let c be 2/(-10)7960/(-398). Put q, c, -1/5, -2/3 in decreasing order. c, q, -1/5, -2/3 Let j(k) = k + 12. Let u be j(-16). Sort u, 3, -75.5 in decreasing order. 3, u, -75.5 Let m = -1613 + 1608. Put 2.7, -4, 0.04, m, 2/11 in decreasing order. 2.7, 2/11, 0.04, -4, m Suppose 7 - 55 = -2p. Suppose 3v - 2q - 6 = 0, 5q = -3v + q + p. Let l = 46.9 - 47. Put -0.3, -0.5, v, l in descending order. v, l, -0.3, -0.5 Suppose -10a = -8a + 54. Let x be (1 - 1)(-9)/a. Sort -5, x, -56 in descending order. x, -5, -56 Let m = -2 - -6. Let s be 1729/(-798) + (-3)/(-6). Let q = 125 - 124.8. Sort 0.5, s, q, m. s, q, 0.5, m Suppose -9o - 13 = -u - 7o, -3u - 5 = 5o. Put u, 0, -45, 6 in descending order. 6, u, 0, -45 Let u = 42770.2 + -42767.7. Let m = -0.05 - 2.55. Let r = m + 0.6. Sort r, u, -0.2. r, -0.2, u Let s = 8.26904 + -0.26904. Let g be ((-4)/(-2))/23. Let h = 266 - 1865/7. Sort s, g, h in decreasing order. s, g, h Let c = 67 - 70. Let n be ((-2 + -1)/9)/(14/18). Sort c, -1/3, n, -6. -6, c, n, -1/3 Suppose 0 = 3r - 5s - 2 + 18, -5s - 40 = 5r. Let t be 6(4 - 138/(-12)). Let w = 98 - t. Sort r, -1, w, -5 in increasing order. r, -5, -1, w Suppose 0 = 4a + z - 188, -2a = -4a + 4z + 94. Suppose -15 = -3k - 3t, 5k + t + 7 = 16. Put a, k, 4 in ascending order. k, 4, a Let x(m) = 3m - 17. Let o(l) = -l*3 + 7l*2 + 6l + 20. Let d be o(8). Let r be x(d). Let h = 0.22 - 0.17. Put h, -4, r in increasing order. r, -4, h Suppose -46 + 41 = -h. Let k = -7748 - -7739. Sort h, 15, k in descending order. 15, h, k Let w = -17889 - -17893. Sort 3, 0, -190, -2, w in increasing order. -190, -2, 0, 3, w Let p = 779.107 + -779. Sort p, -2, -5 in increasing order. -5, -2, p Let n = 386/63 - 124/21. Put n, 5, 122/5 in increasing order. n, 5, 122/5 Let a = 468.04 - 468. Let h be (2/(-10))/(18/30). Sort 2, a, h in decreasing order. 2, a, h Let x be (((-4)/(-8))/1)/(17 - 4343/258). Let w = -1232530/9 - -136803. Let u = 145 + w. Sort -4, -0.4, x, u in ascending order. -4, -0.4, u, x Let c(k) = k*2 - 3k + 2. Let d be c(3). Let h = 2 - d. Suppose -5v - 40 = 5b, -236v + 232v - 24 = 2b. Sort 3/7, v, h in increasing order. v, h, 3/7 Let x = 21.2 - 21. Let m = -4.8 - -2.8. Put x, m, -2/11 in decreasing order. x, -2/11, m Let l(y) = -3y*2 - 17y + 206. Let b be l(6). Sort 0, b, -3, 287 in decreasing order. 287, 0, -3, b Let l be ((-30)/25)/((-7)/5). Let b be (-2)/(-3)1029/(-14). Let k be (2/(-24))/(b/98). Put l, -2, k, 5 in ascending order. -2, k, l, 5 Let y = 280.7 - 281. Sort 3/4, y, 33, -1/25 in decreasing order. 33, 3/4, -1/25, y Suppose -4m = 5u - 498, 3u - 100 - 21 = -m. Suppose 121q + 24 = mq. Sort q, 2, -14, 1. -14, 1, 2, q Let q be (-6 + 11)6/20. Let y = 0.58 - 1.48. Put q, y, 0.1 in increasing order. y, 0.1, q Let o be (-2)/(-4)(0 + -4). Let c = -2.74 + -186.26. Let k = c + 195. Sort o, 1/2, k in decreasing order. k, 1/2, o Let s = 3.2476 - 0.0176. Let y = s + -2.83. Sort -5, -0.3, y, -8/7 in decreasing order. y, -0.3, -8/7, -5 Suppose -8y = -13y - r - 58, 0 = 2r - 4. Let j = 16 + y. Sort j, 1, -10 in increasing order. -10, 1, j Suppose -5p = 5z - 610, 65 = 5p - 5z - 525. Suppose -pc = -117c - 9. Let h = -0.54 - -0.5. Sort 5, h, 4/5, c. h, 4/5, c, 5 Let f = 0.0238 + 227.9762. Let a = f - 232. Let l = 0.6 + -1. Sort -3, l, a, 1/5 in ascending order. a, -3, l, 1/5 Let m = 540 - 516. Let p = m - 23.6. Sort -3/2, p, 5, -2 in decreasing order. 5, p, -3/2, -2 Let r = 117.6 + 26.4. Let w = -143 + r. Sort w, -3, -19, 0. -19, -3, 0, w Let q = 76 + -74. Suppose q = 7p - 26. Suppose -4m - 4a = -16, -4m + 3a + 31 = 2a. Sort p, m, 2. 2, p, m Let k = 1/2174 - -5433/4348. Let p be (-14)/21(-12)/(-10). Put k, -4, p, 3 in decreasing order. 3, k, p, -4 Let i be (-4 - (5 - 6)) + -29. Let g be (16/i)/(1 - (-9)/(-10)). Suppose -5p = -10p + 15. Sort p, -6, g in descending order. p, g, -6 Suppose h + 1 = -2v, 4v = 4h + 6 - 2. Suppose -39s + 44s + 1220 = 66s. Put s, v, -4 in increasing order. -4, v, s Let i(x) = 2x + 9. Let f be i(-3). Let y(c) = -5c - 44. Let g be y(-8). Sort g, -32, f in decreasing order. f, g, -32 Let y(x) = x - 1. Let m(z) = 5z. Let d(q) = -m(q) - y(q). Let t be d(1). Let i = 4400 - 4397. Put i, 4, t, -2 in increasing order. t, -2, i, 4 Suppose 213 - 3209 = 30w + 394. Put w, 4, 5 in decreasing order. 5, 4, w Let o = -3318022/65 - -51050. Let s = o + -56/13. Put s, 4, -10.2 in descending order. 4, s, -10.2 Let s be 6 + (-2 - -1) - 4. Let j(g) = 17g2 + 15g - 16. Let d be j(s). Put -2, d, -1 in descending order. d, -1, -2 Let k be (3/12)/(((-12)/(-168))/(4/70)). Put -4, 2/11, k, 3/8, -1/7 in increasing order. -4, -1/7, 2/11, k, 3/8 Suppose -2v + 8 = -2k, 2v - 13 = 4v + 5*k. Let b = -238 - -479/2. Sort b, v, 0.1 in decreasing order.	{ "pile_set_name": "DM Mathematics" }
is divided by 217. 194 What is the remainder when 7211 is divided by 1208? 1171 What is the remainder when 73396 is divided by 5645? 11 What is the remainder when 13262 is divided by 225? 212 Calculate the remainder when 121611 is divided by 40522. 45 What is the remainder when 1048 is divided by 70? 68 Calculate the remainder when 5410 is divided by 5394. 16 What is the remainder when 562912 is divided by 413? 406 Calculate the remainder when 511 is divided by 2. 1 Calculate the remainder when 35818 is divided by 78. 16 What is the remainder when 830875 is divided by 58? 25 Calculate the remainder when 35625 is divided by 91. 44 Calculate the remainder when 23935 is divided by 1867. 1531 Calculate the remainder when 4196 is divided by 524. 4 What is the remainder when 2847 is divided by 42? 33 What is the remainder when 375171 is divided by 1075? 1071 Calculate the remainder when 23726 is divided by 3953. 8 What is the remainder when 7805 is divided by 600? 5 What is the remainder when 1219450 is divided by 39? 37 Calculate the remainder when 22608 is divided by 4513. 43 What is the remainder when 30705 is divided by 7? 3 What is the remainder when 17115 is divided by 535? 530 What is the remainder when 3890 is divided by 1292? 14 What is the remainder when 181145 is divided by 7? 6 What is the remainder when 31996 is divided by 15998? 0 What is the remainder when 77837 is divided by 515? 72 Calculate the remainder when 818 is divided by 415. 403 What is the remainder when 821 is divided by 206? 203 What is the remainder when 4817 is divided by 688? 1 Calculate the remainder when 389593 is divided by 194790. 13 Calculate the remainder when 4565 is divided by 1313. 626 Calculate the remainder when 270900 is divided by 653. 558 What is the remainder when 705 is divided by 334? 37 What is the remainder when 6335 is divided by 1583? 3 Calculate the remainder when 38060 is divided by 1086. 50 What is the remainder when 771962 is divided by 257318? 8 Calculate the remainder when 10729 is divided by 5358. 13 Calculate the remainder when 2819 is divided by 13. 11 What is the remainder when 467199 is divided by 50? 49 Calculate the remainder when 1255 is divided by 91. 72 What is the remainder when 10419 is divided by 104? 19 What is the remainder when 47321 is divided by 388? 373 Calculate the remainder when 82731 is divided by 1561. 1559 Calculate the remainder when 152261 is divided by 49. 18 Calculate the remainder when 3167 is divided by 88. 87 Calculate the remainder when 6218 is divided by 577. 448 What is the remainder when 1205378 is divided by 1007? 1006 Calculate the remainder when 233104 is divided by 38830. 124 Calculate the remainder when 23750 is divided by 567. 503 Calculate the remainder when 66857 is divided by 153. 149 What is the remainder when 129180 is divided by 56? 44 Calculate the remainder when 2921 is divided by 107. 32 Calculate the remainder when 174330 is divided by 87160. 10 What is the remainder when 669200 is divided by 207? 176 What is the remainder when 30409 is divided by 6? 1 What is the remainder when 816 is divided by 330? 156 What is the remainder when 492514 is divided by 138? 130 What is the remainder when 1705 is divided by 43? 28 What is the remainder when 15279 is divided by 4820? 819 What is the remainder when 14596 is divided by 36? 16 Calculate the remainder when 39752 is divided by 19875. 2 Calculate the remainder when 496598 is divided by 260. 258 What is the remainder when 3813 is divided by 868? 341 Calculate the remainder when 6450 is divided by 536. 18 Calculate the remainder when 358908 is divided by 4324. 16 Calculate the remainder when 21493 is divided by 713. 103 Calculate the remainder when 265307 is divided by 1340. 1327 What is the remainder when 7127 is divided by 1424? 7 Calculate the remainder when 3272 is divided by 3123. 149 What is the remainder when 128740 is divided by 113? 33 What is the remainder when 1652 is divided by 1585? 67 Calculate the remainder when 3077 is divided by 805. 662 Calculate the remainder when 934 is divided by 249. 187 Calculate the remainder when 26882 is divided by 29. 28 Calculate the remainder when 14465 is divided by 1644. 1313 What is the remainder when 1584 is divided by 115? 89 Calculate the remainder when 90176 is divided by 204. 8 Calculate the remainder when 13398 is divided by 4463. 9 Calculate the remainder when 334668 is divided by 1725. 18 Calculate the remainder when 38837 is divided by 19. 1 What is the remainder when 20585 is divided by 52? 45 What is the remainder when 7802 is divided by 6? 2 Calculate the remainder when 463 is divided by 140. 43 What is the remainder when 23434 is divided by 7? 5 What is the remainder when 3901 is divided by 42? 37 What is the remainder when 5939 is divided by 1970? 29 What is the remainder when 121331 is divided by 24265? 6 Calculate the remainder when 54543 is divided by 487. 486 Calculate the remainder when 28961 is divided by 14. 9 What is the remainder when 250478 is divided by 124? 122 Calculate the remainder when 551502 is divided by 1027. 3 Calculate the remainder when 91454 is divided by 8. 6 Calculate the remainder when 11836 is divided by 623. 622 Calculate the remainder when 3878 is divided by 42. 14 What is the remainder when 4204 is divided by 71? 15 What is the remainder when 148884 is divided by 13? 8 Calculate the remainder when 128404 is divided by 61. 60 What is the remainder when 1290 is divided by 13? 3 What is the remainder when 12060 is divided by 4012? 24 What is the remainder when 7643 is divided by 187? 163 What is the remainder when 8530 is divided by 2005? 510 Calculate the remainder when 24813 is divided by 264. 261 What is the remainder when 2141 is divided by 304? 13 What is the remainder when 100398 is divided by 20? 18 Calculate the remainder when 195700 is divided by 1165. 1145 What is the remainder when 4948 is divided by 28? 20 Calculate the remainder when 4694 is divided by 78. 14 What is the remainder when 10966 is divided by 65? 46 Calculate the remainder when 15303 is divided by 1410. 1203 What is the remainder when 10398 is divided by 1289? 86 What is the remainder when 1399 is divided by 419? 142 Calculate the remainder when 56641 is divided by 2573. 35 Calculate the remainder when 2291 is divided by 27. 23 What is the remainder when 312017 is divided by 37? 33 What is the remainder when 20100 is divided by 37? 9 What is the remainder when 4087605 is divided by 406? 403 Calculate the remainder when 38444 is divided by 1069. 1029 Calculate the remainder when 19772 is divided by 4835. 432 Calculate the remainder when 3382 is divided by 152. 38 Calculate the remainder when 63559 is divided by 86. 5 Calculate the remainder when 12428 is divided by 24. 20 What is the remainder when 31491 is divided by 100? 91 Calculate the remainder when 41517 is divided by 80. 77 Calculate the remainder when 15460 is divided by 107. 52 Calculate the remainder when 1694 is divided by 468. 290 What is the remainder when 666399 is divided by 833? 832 What is the remainder when 28177 is divided by 2? 1 Calculate the remainder when 68931 is divided by 19. 18 What is the remainder when 7614 is divided by 61? 50 What is the remainder when 367791 is divided by 9? 6 What is the remainder when 17037 is divided by 569? 536 What is the remainder when 1147 is divided by 355? 82 Calculate the remainder when 8878 is divided by 57. 43 Calculate the remainder when 813 is divided by 161. 8 What is the remainder when 45388 is divided by 51? 49 What is the remainder when 16286 is divided by 575? 186 What is the remainder when 4209 is divided by 1401? 6 Calculate the remainder when 4798 is divided by 4786. 12 Calculate the remainder when 437 is divided by 53. 13 What is the remainder when 1396 is divided by 685? 26 Calculate the remainder when 79939 is divided by 19. 6 What is the remainder when 57944 is divided by 425? 144 Calculate the remainder when 332 is divided by 85. 77 What is the remainder when 6277 is divided by 46? 21 Calculate the remainder when 14459 is divided by 241. 240 Calculate the remainder when 551 is divided by 164. 59 What is the remainder when 3209 is divided by 289? 30 Calculate	{ "pile_set_name": "DM Mathematics" }
and -115/264. 792 Find the common denominator of 113/18 and 76/315. 630 Calculate the common denominator of -15/16 and 109/26. 208 What is the common denominator of 20/209 and 17/133? 1463 Find the common denominator of -25/2387 and -79/2772. 85932 What is the common denominator of -41/6 and -76/183? 366 Find the common denominator of -58/2391 and -55/6. 4782 Find the common denominator of 61/2276 and -73/10. 11380 Find the common denominator of -36/11459 and 45/4. 45836 Calculate the common denominator of 115/108 and 37/144. 432 What is the common denominator of 19/9037 and -37/1291? 9037 Calculate the common denominator of 87/104 and -23/536. 6968 What is the common denominator of -33/104 and 29/65? 520 What is the common denominator of 29/55 and -57/5? 55 Calculate the common denominator of -1/8 and 41/5958. 23832 What is the lowest common multiple of 56 and 12? 168 Calculate the least common multiple of 36 and 54. 108 What is the least common multiple of 26 and 18? 234 What is the common denominator of 40/81 and -53/15? 405 What is the smallest common multiple of 566 and 2? 566 What is the least common multiple of 100 and 700? 700 Find the common denominator of -11/846 and 32/11. 9306 Calculate the least common multiple of 106 and 11. 1166 What is the lowest common multiple of 36 and 2997? 11988 What is the common denominator of 87/14 and -53/2? 14 What is the smallest common multiple of 1806 and 462? 19866 Calculate the least common multiple of 54 and 9. 54 Calculate the least common multiple of 224 and 560. 1120 Calculate the least common multiple of 122 and 1340. 81740 Calculate the common denominator of 91/12 and 149/84. 84 What is the common denominator of -59/12 and 5/5088? 5088 What is the common denominator of -11/14 and 43/12? 84 What is the smallest common multiple of 3520 and 1760? 3520 What is the common denominator of -76/1085 and 29/868? 4340 What is the common denominator of 23/452 and -17/12? 1356 What is the common denominator of -157/2508 and -13/1368? 15048 What is the lowest common multiple of 288 and 24? 288 Calculate the common denominator of 32/427 and 91/915. 6405 Calculate the lowest common multiple of 351 and 2106. 2106 What is the lowest common multiple of 9 and 2486? 22374 Calculate the common denominator of 21/80 and -107/208. 1040 What is the least common multiple of 45 and 45? 45 Calculate the common denominator of 29/3150 and -41/10. 3150 What is the least common multiple of 14 and 1066? 7462 Calculate the common denominator of 19/3 and 181/966. 966 Find the common denominator of -19/25 and -32/15. 75 What is the least common multiple of 44 and 72? 792 What is the least common multiple of 210 and 42? 210 What is the smallest common multiple of 426 and 22? 4686 Calculate the common denominator of -4/4125 and -44/175. 28875 What is the common denominator of -51/28 and 73/228? 1596 Calculate the lowest common multiple of 14 and 834. 5838 Calculate the lowest common multiple of 44 and 4. 44 What is the lowest common multiple of 513 and 9? 513 Calculate the common denominator of -22/45 and -163/120. 360 Find the common denominator of 23/528 and -101/594. 4752 What is the smallest common multiple of 440 and 35? 3080 Calculate the least common multiple of 126 and 490. 4410 Calculate the least common multiple of 3234 and 77. 3234 Find the common denominator of 23/102 and 107/22. 1122 Calculate the common denominator of -19/117 and -61/130. 1170 Calculate the lowest common multiple of 92 and 805. 3220 What is the lowest common multiple of 4 and 13130? 26260 What is the smallest common multiple of 35 and 200? 1400 Calculate the least common multiple of 5593 and 952. 44744 Calculate the common denominator of 97/76 and -45/7. 532 What is the smallest common multiple of 27 and 33? 297 Calculate the common denominator of -31/10 and 59/615. 1230 What is the common denominator of 89/48 and 109/20? 240 What is the lowest common multiple of 10 and 980? 980 Calculate the least common multiple of 1320 and 11. 1320 Find the common denominator of 109/22 and 82/99. 198 Find the common denominator of 47/183 and 41/33. 2013 What is the smallest common multiple of 504 and 21? 504 Calculate the least common multiple of 160 and 1125. 36000 What is the lowest common multiple of 138 and 3? 138 Calculate the common denominator of 21/8 and 47/32. 32 Calculate the common denominator of 47/64 and -41/24. 192 Calculate the common denominator of -20/51 and -11/15. 255 Calculate the least common multiple of 12 and 750. 1500 What is the least common multiple of 115 and 230? 230 What is the common denominator of -5/4 and -44/595? 2380 What is the common denominator of 65/112 and -39/56? 112 Calculate the common denominator of -23/43 and -61/4. 172 What is the least common multiple of 63 and 70? 630 Calculate the smallest common multiple of 261 and 8. 2088 What is the smallest common multiple of 18 and 120? 360 What is the common denominator of -49/10 and 139/318? 1590 What is the smallest common multiple of 48 and 1112? 6672 Calculate the common denominator of 17/664 and -79/664. 664 Calculate the smallest common multiple of 390 and 12. 780 What is the smallest common multiple of 78 and 102? 1326 Calculate the common denominator of 109/660 and -43/924. 4620 Calculate the common denominator of 58/561 and 77/51. 561 Calculate the common denominator of -59/65 and 73/650. 650 Calculate the smallest common multiple of 161 and 92. 644 What is the lowest common multiple of 3946 and 10? 19730 Calculate the smallest common multiple of 26 and 38. 494 Calculate the common denominator of 48/143 and -43/12. 1716 What is the common denominator of -73/30 and 4/55? 330 Find the common denominator of -49/120 and -149/3540. 7080 What is the lowest common multiple of 843 and 45? 12645 What is the lowest common multiple of 258 and 344? 1032 Calculate the common denominator of 145/738 and 95/164. 1476 Calculate the lowest common multiple of 120 and 48. 240 What is the common denominator of 70/297 and 34/27? 297 Calculate the smallest common multiple of 1296 and 66. 14256 Calculate the common denominator of -89/144 and -13/144. 144 Calculate the least common multiple of 2840 and 8. 2840 Calculate the smallest common multiple of 1860 and 3255. 13020 Calculate the smallest common multiple of 242 and 605. 1210 Find the common denominator of 53/42 and -107/186. 1302 What is the least common multiple of 4948 and 18? 44532 Calculate the least common multiple of 748 and 595. 26180 Find the common denominator of -59/81 and 68/3. 81 What is the common denominator of 37/10 and -107/6? 30 What is the lowest common multiple of 1976 and 9? 17784 Calculate the smallest common multiple of 399 and 84. 1596 What is the least common multiple of 4994 and 2270? 24970 Calculate the lowest common multiple of 54 and 513. 1026 What is the lowest common multiple of 12 and 162? 324 Calculate the lowest common multiple of 7290 and 648. 29160 Find the common denominator of -145/828 and 2/3. 828 Calculate the lowest common multiple of 30 and 156. 780 What is the common denominator of -23/5 and -11/65? 65 Calculate the common denominator of -58/141 and 13/66. 3102 Calculate the common denominator of 17/210 and -73/238. 3570 Calculate the common denominator of 53/69 and -34. 69 Calculate the least common multiple of 552 and 80. 5520 Calculate the lowest common multiple of 28 and 4. 28 What is the lowest common multiple of 7 and 80? 560 What is the lowest common multiple of 8 and 110? 440 What is the common denominator of 37/92 and 51/152? 3496 Find the common denominator of -65/534 and 23/9. 1602 Find the common denominator of -19/40 and 111/80. 80 What is the lowest common multiple of 1496 and 3? 4488 What is the common denominator of 73/18 and 5/1866? 5598 Calculate the common denominator of -57/2066 and -33/4. 4132 Find the common denominator of -32/81 and -71/81. 81 What is the least common multiple of 9 and 3? 9 Calculate the lowest common multiple of 24 and 3087. 24696 What is the common denominator of 137/43260 and 29/16? 173040 What is the smallest common multiple of 13 and 1? 13 Calculate the common denominator of -53/66 and -63/275. 1650 What is the common denominator of -43/690 and	{ "pile_set_name": "DM Mathematics" }
- 21) as bf2 + xf + j + cf3 + gf*4 and give g. -5530 Rearrange f - 25f*4 - 62f*2 + 27f*4 + 67f*2 - 2f*3 to if + yf2 + g + kf*3 + of*4 and give y. 5 Rearrange 792h*2 - 3h*3 - 1 + 1 - 715h*2 to c + lh*3 + fh + xh2 and give x. 77 Express (0j + j*3 + 0j)(2 - 4 + 0)(-55 - 24 - 11 - 115) as pj3 + qj*2 + i + zj and give p. 410 Express -1462k2 - 637k*2 - 421007k + 421007k as p + jk*2 + rk and give j. -2099 Express 3z2 - 2z*2 - 3z*2 + (4z - 2z + z)(z + z + z) - 4 - 3z2 + 4 in the form i + mz*2 + kz and give m. 4 Express (-2i + i + 0i)(-1941i + 1010i + 2665i)(-4i - 2i + 7i) in the form ri + ti*2 + xi*3 + a and give r. 0 Express 0x + 2 + x*4 + 2x + 339x2 - 340x*2 - 9x*3 as f + ox*3 + nx*4 + hx + rx2 and give o. -9 Rearrange (2l + 0l - 3l)(108 + 181 - 31) to the form jl + w and give j. -258 Rearrange (1 + 1 + 0)(2l - 3l + 0l)(15 + 177 + 200) to the form r + bl and give b. -784 Express -185a2 + 68a*2 - 8 - 3 + 11 as ta + b + va2 and give v. -117 Rearrange -13999l - 1233l4 + 13999l - l*4 - 1 + 1 + (2 - 2 - 2l*2)(-l*2 + 0l*2 + 0l*2) to the form wl*4 + ul + m + xl3 + vl*2 and give w. -1232 Rearrange (s - s - 2s)(10s*3 + 19s*3 - 5s*3) + 1 - 4s*4 - 1 to the form is*3 + c + fs*2 + ps*4 + ns and give f. 0 Express (-332 + 190 + 212)(2 - 1 + 2)(0i - 2i + 3i) in the form gi + m and give g. 210 Express 91 + 129w - 128 + 163w + 37 in the form x + hw and give h. 292 Rearrange 67793t - 67793t - 43t*2 + (t + 1 - 1)(1 - 1 + t) - 4 + t*2 + 4 to xt + ht2 + i and give h. -41 Express 0u + 6u + 8u + 353 - 2u4 - 355 in the form s + ou*4 + xu + tu3 + hu*2 and give x. 14 Express 25n + 5 + 13 - 17 + (-4 + 4 + 3)(-4n + 3n - n) in the form c + vn and give c. 1 Rearrange (-5 + 2 + 1)(8x - 2x + 2x + 10x - x + x + 0 + 0 + 2x + (-x + 2x + x)(-1 + 0 + 2) + 0 + 0 - x) to c + jx and give j. -42 Express -440l + 539l - 459l as c + jl and give j. -360 Rearrange -282y + 88y - 161y - 26y to u + jy and give j. -381 Express (3 - 5 + 4)(-2u*3 + 6u*3 - 3u*3)(0u + 48 - 2u - u) as ru + h + bu*4 + du*3 + vu*2 and give b. -6 Rearrange 19i*2 + 82i*2 + 10i*2 + 72i*2 to oi + v + xi2 and give x. 183 Rearrange (2923 - 81 + 466 + 131)(3c + 3c - 4c) to gc + v and give g. 6878 Rearrange 1539j + 9203 - 18414 + 9211 to the form o + vj and give v. 1539 Express (-6j3 - 3j + 3j)(-38j + 115 - 115) + 2j*4 + 4 - 4 as pj + aj3 + dj*4 + u + mj*2 and give d. 230 Rearrange -23s + 6 + 2s + 12s to t + ps and give t. 6 Rearrange -2a2 + a2 - 124a3 + a4 + 7a - 5a to fa*2 + ba*3 + o + qa + pa4 and give f. -1 Express (2 - 2i - 2)(20 + 1 - 4)(12 - 30 - 4)(6 - 2 - 2)(0i - 3i + 2i) in the form v + ni + zi2 and give v. 0 Express (-b2 + 10b - 17 + 144 - 11b)((2 + 3 - 4)(2b - 2b + b) - 3b + 0b + 4b) in the form pb2 + cb + kb3 + a and give c. 254 Rearrange -486c + 27482 - 27482 to the form yc + d and give y. -486 Express (-2 + 4p + 8 - 6)(11p - 56p + 24p) in the form j + ap + gp*2 and give g. -84 Rearrange (3545 - 188c - 3545)(3 - 7 - 3) to the form tc + s and give t. 1316 Express (312z3 + 52 - 2z - 313z3 - 52z*2 - 49)(-z + 1 - 1) as uz4 + hz*3 + dz*2 + mz + y and give h. 52 Rearrange 3w - 4w + 3w - 168 to gw + h and give h. -168 Rearrange 126r + 3 - 48r - 9r - 24r to c + ir and give c. 3 Express (380n*2 - 126n*2 + 567n*2)(0n2 - 2n*2 + 5n*2) in the form u + xn*3 + zn + qn2 + an*4 and give a. 2463 Express 2 + 43y*2 - 31y*2 + 96y*2 as cy + vy2 + u and give u. 2 Rearrange 95j + 77j + 70j + (-2 + 0 + 0)(-6j + j + 3j) + 2j + 2j - 5j to d + sj and give s. 245 Rearrange -1 + 0 - 5 + 318t*2 + 5 + 108t*2 to lt + ht2 + s and give s. -1 Express l3 + 0l*3 - 2l*3 + (-2l + 0l - 15l)(-4 - 2 + 5)(3 + 0 + 0)(-l2 - 3l*2 + 6l*2) in the form sl*2 + al*3 + i + hl and give a. 101 Rearrange (10 - 34 - 45)(-8c + 4c + c - 11c) to the form lc + j and give l. 966 Rearrange -16 + 2w*3 + 9 + 13w + 6w - 9w to the form xw + iw*2 + hw*3 + r and give r. -7 Rearrange (2t + 2 - 2)(452 - 676 - 430 - 398) to zt + x and give z. -2104 Rearrange 82z2 - 333z*2 - 1360z*2 - 1 to tz + sz2 + j and give t. 0 Express (-10z - 6z + 1 + 13z + (3 - 1 - 1)(5z - 8z - 6z))(0 - 3 + 2) in the form u + rz and give r. 12 Express -4q2 + 21q*2 - 2q*3 - 2q - 145 + 6q3 + 144 + q3 as f + yq + uq3 + pq*2 and give p. 17 Express -67n - 3 - 2 + 3 + 4 in the form r + an and give a. -67 Rearrange (8l - l + 7l)(9 + 6 - 17)(1 + 1 - 1)(-1 - 1 - 1) to the form n + tl and give t. 84 Express (-29y*2 + 79y*2 - 31y - 46y2)(5y - 3y + 3y) in the form gy*3 + a + cy + ny2 and give g. 20 Rearrange -2j*2 + 1 - 1 + (18 + 12 - 24)(-2j + 5j*2 + 2j) to the form ij + n + tj*2 and give t. 28 Rearrange (-3 - 3 + 4)(-9 + 9 + 8j) + (3 - 2 + 1)(-2j - j + 4j) + 7j - 5j + 3j to the form dj + q and give d. -9 Express (-16h - 21 + 21)(-5h2 - 2h - 160 + 160) in the form ih2 + qh + x + nh3 and give n. 80 Rearrange -13f*2 - 5f*2 - 7 + 10 to the form df*2 + k + rf and give k. 3 Rearrange -6129l4 + 1 + 56l + 6132l4 - 3 to the form sl*3 + q + kl + dl4 + ml*2 and give k. 56 Rearrange (-1 - i + 1)(-288 - 445 + 158) to the form ai + z and give a. 575 Rearrange -22966 + 22966 - 475x to the form cx + v and give c. -475 Rearrange -t4 - 110t - 103t + 9t*2 - 3 - 97t + 312t to the form y + mt*3 + bt*4 + gt + dt2 and give d. 9 Rearrange -8 - 5 - 6r*2 - 2r + 12 to the form g + mr + sr*2 and give g. -1 Express -18 - 564067g*4 + 4g3 - g2 + 564066g4 + 0g*3 in the form sg + xg4 + k + yg*2 + fg*3 and give y. -1 Express -7273 + 7273 - 27p*2 - 2 + 2 + 3p*2 + (0p + 0p - 2p)(-p - 4p + 4p) + (0 + 0 + p)(2p - 2 + 2) as up*2 + kp + o and give u. -20 Express 5c - 16c*2 - 4c - 2c - c - 52c*2 as i + uc + dc2 and give i. 0 Express (-5s + 0s + 4s)(4 - 4 - s) + (2 - 13 - 22)(-1 - 2s2 + 1) in the form cs + r + bs2 and give b. 67 Express -33v - 2v3 - 3v*3 - 3v*2 - 2v*4 - 4v + 36v as uv*3 + fv*2 + b + iv*4 + qv and give i. -2 Rearrange (3 - 2 + 0 - 2 - 3 + 4 + (-2 + 5 - 5)(0 - 1 + 3) - 3 + 1 + 3 - 3 + 6 - 2 - 4 + 5 + 0)(-1 + 7r + 6 - 4r) to the form o + kr and give k. -3 Express (-670q*3 - 902q*3 - 646q*3 + 543q*3)(4q - 2q - 4q) in the form d + oq*4 + cq + jq3 + mq*2 and give d. 0 Express -22c - 34c2 + 42c + c*4 - 22c - 1 in the form vc3 + fc*4 + h + nc + pc2 and give h. -1 Rearrange -43t - 86t + 130t + 515 to it + s and give s. 515 Express v - 10 - 45 + 4v as r + kv and give r. -55 Rearrange -144s + 11253 - 11253 - s*2 to n + ps*2 + js and give p. -1 Rearrange (3r2 + 0r + 0r)(54 - 102 - 119)(2r - 2r - 2r) to br2 + kr + jr3 + d and give j. 1002 Rearrange -84 - 121 - 45i*2 + 46i*2 to oi*2 + ci + d and give o. 1 Express (6z + z + 2z)(5 + 3 + 24 + 6 + 0) in the form h + pz and give p. 342 Rearrange (-2 + 2 - 1)(-3l*3 + 2l*3 + 4l*3)(-17l + 32l + 10l) to hl*3 + fl*2 + cl + d + wl4 and give w. -75 Express r3 - 2r*3 + 2r + 12 - 5 - 6 as p + ur + lr*2 + vr*3 and give u. 2 Express (-h - 5h + 5h)(5313h2 - 5312h*2 - 2 + 30) in the form ih + yh2 + xh*3 + w and give x. -1 Express (2f*2 - f + f)(-1297f2 + 632f*2 + 445f*2) as rf*3 + hf*4 + jf*2 + df + a and give h. -440 Express (-6 - 2 - 2)(1 + 0 + 1)(11 + 14g4 - 11) as lg*2 + yg + c + kg3 + wg*4 and give w. -280 Rearrange (-2o2 + o2 + 3o2)(111 - 100 - 857) to jo2 + vo + p and give j. -1692 Rearrange (0 + 0 - 1)(-4 + 4 + c4) + 2c*4 + 314c - 172c - 161c to mc4 + tc*3 + a + qc*2 + fc and give t. 0 Express -123j + 59j + 64j - 36 - 7j*2 as rj*2 + aj + d and give a. 0 Express -205h + 26h + 12 + 10 - 20 in the form m + uh and give u. -179 Express -1800o*2 + 19192o - 191	{ "pile_set_name": "DM Mathematics" }
What is z? -144, -4, 7 Factor -2f2/7 + 49452f/7 - 305687538/7. -2(f - 12363)2/7 Factor -6l*2 + 2996l - 9920. -2(l - 496)(3l - 10) Let 3u*5 - 927u*4 + 102309u*3 - 4727181u*2 + 76102488u + 80932908 = 0. Calculate u. -1, 49, 106 Suppose 3l5 + 123l*4 - 161331l*3 - 808599l*2 - 1294728l - 647580 = 0. Calculate l. -251, -2, -1, 215 Solve -i*3/3 + 3377i*2/3 + 10158i = 0. -9, 0, 3386 Let -2k2 + 132k - 1786 = 0. Calculate k. 19, 47 What is s in -3s5 + 45s*4 - 189s*3 + 255s*2 - 108s = 0? 0, 1, 4, 9 Find r such that -22r2/5 + 12574r/5 - 6852/5 = 0. 6/11, 571 Suppose -2k4/15 + 164k*3/15 + 1334k*2/15 - 7832k/15 = 0. Calculate k. -11, 0, 4, 89 Factor 3m2 - 3261m + 3258. 3(m - 1086)(m - 1) Let -4q3 + 14320q*2 + 57328q + 57344 = 0. What is q? -2, 3584 Suppose u*2/4 + 1771u/4 + 8322 = 0. What is u? -1752, -19 Suppose -4q2/5 - 44q - 1936/5 = 0. What is q? -44, -11 Find f, given that 125f4 + 61700f*3 - 1176695f*2 + 463270f - 46080 = 0. -512, 1/5, 18 Factor 26x3/7 - 17834x*2/7 - 196x. 2x(x - 686)(13x + 1)/7 Determine x, given that 5x4 + 423070x*3 + 8950257340x*2 + 35795529650x + 26845695375 = 0. -42305, -3, -1 Find h, given that -3h2/4 + 2416431h/2 - 1946379592587/4 = 0. 805477 Solve 5t5/2 - 67t*4/2 + 648t*3/5 - 918t*2/5 + 432t/5 = 0 for t. 0, 6/5, 3, 8 Determine x so that 45x4 + 55830x*3 - 751660x*2 + 927720x - 300960 = 0. -1254, 2/3, 12 Suppose 242n4/5 - 32908n*3/5 - 33698n*2/5 - 548n/5 = 0. What is n? -1, -2/121, 0, 137 Find h, given that h*2/6 + 34h - 11726/3 = 0. -286, 82 Determine n, given that 2n2/3 - 3146n/3 + 312800 = 0. 400, 1173 Solve -2g3/7 - 92g*2/7 + 442g/7 + 300 = 0. -50, -3, 7 Determine f, given that -105f4 - 19445f*3 - 35825f*2 - 13735f + 2750 = 0. -550/3, -1, 1/7 Factor 4l2/11 + 146l/11 - 74/11. 2(l + 37)(2l - 1)/11 Factor 3z*2/4 - 15069z/2 - 30141/4. 3(z - 10047)(z + 1)/4 Find p, given that 5p5 + 1995p*4 + 191915p*3 - 1409895p*2 + 3272360p - 2472540 = 0. -203, 2, 3 Factor -a*4/7 + 57a*3/7 + 394a*2/7 - 144a. -a(a - 63)(a - 2)(a + 8)/7 Solve -2d*3 - 430d*2 - 16800d + 720000 = 0. -120, 25 Factor d*2/3 + 341172d + 87298750188. (d + 511758)*2/3 Let -2g*3 - 18g*2 + 114g + 130 = 0. What is g? -13, -1, 5 What is x in -8x5/11 - 1270x*4/11 + 37262x*3/11 - 291092x*2/11 + 496704x/11 - 106560/11 = 0? -185, 1/4, 2, 12 Find p, given that 3p5/7 - 258p*4/7 + 30p*3 + 3756p*2/7 + 5835p/7 + 2550/7 = 0. -2, -1, 5, 85 Factor -i*4/6 - 49i*3/3 - 326i*2/3 - 229i - 273/2. -(i + 1)(i + 3)2(i + 91)/6 Let -6845c5 + 46620c*4 + 861900c*3 + 2312000c*2 = 0. Calculate c. -170/37, 0, 16 Factor -4c*3/5 + 914c*2/5 - 456c/5. -2c(c - 228)(2c - 1)/5 Find m such that 3m3/2 - 1254m*2 - 7563m/2 + 5034 = 0. -4, 1, 839 Determine p so that -14p3/17 - 1954p*2/17 + 848p/17 + 1120/17 = 0. -140, -4/7, 1 Find k such that 9k3 + 177k*2/2 + 69k - 564 = 0. -47/6, -4, 2 Factor -25v3/6 - 89v*2/3 - 206v/3 - 52. -(v + 2)*2(25v + 78)/6 Factor -5f*3 + 11105f*2 + 224205f - 235305. -5(f - 2241)(f - 1)(f + 21) Factor 5u*3 + 1415u*2 + 106175u + 844605. 5(u + 9)(u + 137)*2 Suppose 3x*4 + 348x*3 + 4734x*2 + 19332x + 24543 = 0. Calculate x. -101, -9, -3 What is f in f*3/2 + 663f*2 - 1329f/2 - 1327 = 0? -1327, -1, 2 Factor 15h2 + 7939h + 2116. (h + 529)(15h + 4) Suppose 3f5 - 7167f*4 - 115323f*3 - 281385f2 = 0. Calculate f. -13, -3, 0, 2405 Suppose b2/3 - 518b/3 + 7095 = 0. Calculate b. 45, 473 Factor 2y*2/9 - 414y + 14872/9. 2(y - 1859)(y - 4)/9 Suppose 3v5 + 249v*4 - 768v*3 + 516v*2 = 0. Calculate v. -86, 0, 1, 2 Suppose -3k*3 - 6k*2 + 1080k = 0. What is k? -20, 0, 18 Suppose f*3/5 - 179f*2/5 + 242f - 1032/5 = 0. Calculate f. 1, 6, 172 Factor -k*2 - 657k - 15800. -(k + 25)(k + 632) Factor -2p*3 + 40p*2 - 242p + 420. -2(p - 10)(p - 7)(p - 3) Factor -2k*2/9 - 410k/9 - 2576/3. -2(k + 21)(k + 184)/9 Factor 2d4/3 - 8026d*3/3 + 3604192d*2 - 4990942720d/3 + 135838294016/3. 2(d - 1328)3(d - 29)/3 Solve -5v4 + 815v*3 - 7495v*2 - 24815v + 168300 = 0 for v. -5, 4, 11, 153 Factor 15l2 + 257789l - 17186. (l + 17186)(15l - 1) Factor -4k4 + 52k*3 + 628k*2 - 1396k + 720. -4(k - 20)(k - 1)*2(k + 9) Solve -5o4 + 1530o*3 - 118560o*2 + 231040o = 0 for o. 0, 2, 152 Solve -v*4 - 41v*3 - 3v*2 + 1445v - 1400 = 0. -40, -7, 1, 5 Determine z, given that -z*3/2 + 9175z*2 - 146704z + 586688 = 0. 8, 18334 Solve -3f2 + 1978800f - 326304120000 = 0 for f. 329800 Suppose 3s3 + 2145s*2 + 53661s - 55809 = 0. What is s? -689, -27, 1 Factor -2t3 + 1144t*2 + 14016t. -2t(t - 584)(t + 12) Factor y3/3 + 140y*2 + 2652y - 17600/3. (y - 2)(y + 22)(y + 400)/3 What is u in 2u2 + 1447u/2 - 1815/2 = 0? -363, 5/4 Find r such that -4r3/3 + 224r*2 - 4336r + 23360/3 = 0. 2, 20, 146 Factor -c*2 + 27124c + 27125. -(c - 27125)(c + 1) Factor 5y*2/3 + 562955y/3 + 562940. 5(y + 3)(y + 112588)/3 Find t such that -125t5 + 33100t*4 - 977645t*3 + 385770t*2 = 0. 0, 2/5, 167/5, 231 Let -2v*3/5 + 2226v*2/5 + 29456v/5 - 40536 = 0. Calculate v. -18, 5, 1126 Factor 4z2/7 + 27136z/7 + 54256/7. 4(z + 2)(z + 6782)/7 Find v, given that -20v5 - 48105v*4 - 38604205v*3 - 10365088185v*2 - 23145756075v - 5139224010 = 0. -801, -2, -1/4 Factor t*4/5 - 14t*3/5 - 59t*2 - 1432t/5 - 432. (t - 27)(t + 4)2(t + 5)/5 Factor 98m3/3 + 3836m*2 + 119894m + 1260872/3. 2(m + 4)(7m + 397)2/3 Factor w2 - 27409w. w(w - 27409) Factor 3a*4 + 2712a*3 - 10929a*2 - 29982a - 16344. 3(a - 6)(a + 1)*2(a + 908) Determine h, given that 4h4 - 1144500h*3 - 3433524h*2 - 3433532h - 1144512 = 0. -1, 286128 Suppose n*3/2 + 173n*2/2 + 255n = 0. Calculate n. -170, -3, 0 Suppose -3t2 + 1644t + 28815 = 0. Calculate t. -17, 565 Factor 2k5/3 - 3812k*4/3. 2k*4(k - 1906)/3 Factor 2y2/7 - 78y/7 + 76/7. 2(y - 38)(y - 1)/7 Determine q so that 2q4/5 - 26q*3/5 + 16q*2 = 0. 0, 5, 8 Let 2x*3/3 - 372x*2 - 184280x - 51904400/3 = 0. Calculate x. -170, 898 Suppose 4d4/7 + 1473120d*3/7 + 135633104608d*2/7 + 542514741120d/7 + 542508848704/7 = 0. Calculate d. -184138, -2 What is b in -2b4/17 + 10b*3/17 + 90b*2/17 - 90b/17 - 648/17 = 0? -4, -3, 3, 9 Suppose 4b5/9 + 5b*4/9 - 97b*3/3 - 77b*2/9 + 287b/9 + 8 = 0. Calculate b. -9, -1, -1/4, 1, 8 Suppose -98g5 + 2072g*4 + 168542g*3 + 297580g*2 - 506688g + 160704 = 0. What is g? -31, -3, 4/7, 54 Suppose 11226s4/5 + 37432s*3/5 + 104896s*2/15 + 10016s/5 + 32/15 = 0. Calculate s. -2, -2/3, -2/1871 Determine l, given that 2l2/13 - 208340l/13 + 5425694450/13 = 0. 52085 Factor 2l2 - 1870l - 1872. 2(l - 936)(l + 1) Factor -2u4 - 6952u*3 - 6096648u*2 - 96215680u - 383091200. -2(u + 8)2(u + 1730)*2 Factor -14z*2/13 - 1042486z/13 - 297852/13. -2(z + 74463)(7z + 2)/13 Let -y2/3 + 6691y + 20074/3 = 0. What is y? -1, 20074 Solve 2g3/3 + 94616g*2/3 + 1119118042g/3 + 2237857636/3 = 0 for g. -23653, -2 Factor -2c3/3 + 1094c*2 - 442736c - 15010072/3. -2(c - 826)2(c + 11)/3 Factor 2b3 - 426b*2 - 1304b + 1728. 2(b - 216)(b - 1)(b + 4) Solve -21l*3/8 - 246123l*2/4 - 632859l/8 - 70317/4 = 0. -23439, -1, -2/7 Determine z so that -5z5 + 1310z*4 + 1405z*3 - 23590z*2 - 21200z + 42080 = 0. -4, -2, 1, 4, 263 Solve 26p5/17 - 508p*4/17 - 1956p*3/17 - 2560p*2/17 - 1414p/17 - 276/17 = 0. -1, -6/13, 23 Factor 4f4 + 1820f*3 + 23176f*2 + 85008f + 63648. 4(f + 1)(f + 6)*2(f + 442) Find b such that 3b3 + 177b*2 + 1893b - 7353 = 0. -43, -19, 3 Factor 5v2 - 290v - 117475. 5(v - 185)(v + 127) Factor -y3/5 - y2 + 4712y/5 - 116964/5. -(y - 38)2(y + 81)/5 Solve -v*3/3 - 96v*2 - 8732v - 766640/3 = 0 for v. -140, -74 Factor 26p2/3 - 2594p/3 - 38116/3. 2(p + 13)(13p - 1466)/3 Solve -5z*5/6 - 5z*4/6 + 5z*3/2 + 5z*2/6 - 5z/3 = 0 for z. -2, -1, 0, 1 Factor x*5/2 - 43427x*4/2 + 471497795x*3/2 - 471454369x**	{ "pile_set_name": "DM Mathematics" }
- -9) + -2. Suppose -lv - 21 = -a, 7a - 4a = -5v + 3. What is the remainder when 17 is divided by a? 5 Suppose -7r + 20 = 5t - 6r, -r + 10 = 3t. What is the remainder when 24 is divided by t? 4 Let v = 116 + -83. What is the remainder when v is divided by 18? 15 Let a = 126 - 78. Let q = -33 + a. Suppose q - 5 = 2j. Calculate the remainder when 9 is divided by j. 4 Let m = 103 - 4. Let w = 143 - m. Calculate the remainder when w is divided by 23. 21 Suppose 10 = 2p - 0p. Suppose -pj + 10 = -h - 38, 3j - 4h = 22. Calculate the remainder when 18 is divided by j. 8 Suppose -x + 30 - 19 = 0. What is the remainder when x is divided by 2? 1 Let o = -6 - 1. Let s = o - -16. What is the remainder when 34 is divided by s? 7 Let p = -2 - -3. What is the remainder when (-2)/5 - 304/(-10) is divided by 14/1 - (-2)/p? 14 Let i(w) be the third derivative of w5/20 + w4/12 - w*3/3 + 4w*2. What is the remainder when i(-3) is divided by 10? 9 Let m = -8 - -26. What is the remainder when m is divided by 10? 8 Suppose -7v + 24 + 25 = 0. What is the remainder when 9 is divided by v? 2 Let m(s) = -s*3 + 6s*2 + 4. Let y be m(6). Let f(b) = 2b*2 - 2b + 4. What is the remainder when f(y) is divided by 10? 8 What is the remainder when 20 is divided by (26/(-1) + 0)/(-2)? 7 Suppose 2x + 0x + 55 = 5b, 3b + 4x - 7 = 0. What is the remainder when 39(21/b - 2) is divided by 5? 3 Let z = -58 + 64. Calculate the remainder when z is divided by 1. 0 Suppose 0 = -i + d + 17, 0d + 71 = 5i + 2d. Calculate the remainder when 58 is divided by i. 13 Let k be (-3 + 12)4/(-6). What is the remainder when (-1 - 13)k/7 is divided by 7? 5 Suppose -l - 4 = 1. Let d(n) = n2 + 3n - 7. What is the remainder when 9 is divided by d(l)? 0 Suppose 10x = 12x - 176. What is the remainder when x is divided by 30? 28 Let c(z) be the second derivative of -z4/12 - z3 + 3z2/2 - 3z. Let i be c(-5). What is the remainder when 6/24 - (-270)/i is divided by 12? 10 Suppose 0 = -3v + 2l - 135, 0 = 3v + 2l + 35 + 100. Suppose -4y + 76 = -2y. Calculate the remainder when y is divided by (-910)/v + (-4)/18. 18 Suppose 3s - 19 = -4. Let t = -1 - -3. Calculate the remainder when s is divided by t. 1 Let x = -36 + 53. What is the remainder when x is divided by 11? 6 Suppose 20 = 3h - 67. Suppose -4j + 23 + h = 0. What is the remainder when j is divided by 7? 6 Let y(u) = u3 + 7u*2 - 4. What is the remainder when y(-6) is divided by 8? 0 Suppose 4f - 5u - 139 = -4u, -u = -3f + 104. What is the remainder when f is divided by 9? 8 Let c(j) = j3 - 7j*2 + j - 1. What is the remainder when 9 is divided by c(7)? 3 Suppose 2h - a - 7 = 0, -3a - 28 = -5h - 4a. Calculate the remainder when 11 is divided by h. 1 Let g(w) = -w + 5. Let h be g(-10). Suppose -2i - 2 = -10. Let n = h + i. Calculate the remainder when 55 is divided by n. 17 Suppose l + 4l = -485. Let v be 1 - 3 - -4 - l. Suppose -3t - 53 = -3h - 8t, -4h + v = t. What is the remainder when h is divided by 14? 12 Suppose 2v + v = 45. Calculate the remainder when 72 is divided by v. 12 Let m(b) = 2b + 3. Suppose -5d = -4x + 180, -3x + 4d - 45 = -4x. Calculate the remainder when (-4)/(-6)-3 + x is divided by m(4). 10 Let m = 45 + -41. What is the remainder when 33 is divided by m? 1 Suppose -14 - 30 = -3g + 5v, -5g + 60 = 5v. What is the remainder when 49 is divided by g? 10 Suppose c - 121 = -4r, 4 = -2r - 2c + 60. Calculate the remainder when 121 + -1(2 + -2) is divided by r. 28 Suppose 5i - 7i = -54. What is the remainder when 131 is divided by i? 23 Let x(f) = 4f*2 - 2f - 2. Let g(w) be the second derivative of w*4/12 - 2w*3 + 5w*2/2 - 3w. Calculate the remainder when g(13) is divided by x(2). 8 What is the remainder when 57 is divided by (-559)/(-39) - 4/(-6)? 12 Let v(a) = -a*3 + 3a*2 + a + 3. Let z be v(4). Let q = z + 36. Calculate the remainder when q is divided by 10. 7 Calculate the remainder when (-21)/(-7)19/3 is divided by 7. 5 Let w = 43 - 26. What is the remainder when 32 is divided by w? 15 Let l(m) = -m + 1. Let b be l(-3). Suppose -4x - i = -5i - 400, -bx = -5i - 398. Calculate the remainder when x is divided by 26. 24 Let m be -32/(-9)3. Suppose j = mj + 1. Let b = j - -8. Calculate the remainder when b is divided by 4. 3 Let i(n) = n - 1. Let t be i(5). Suppose 3c = -3x + 5 + 10, -5x + 3c + 17 = 0. Let l = x + t. What is the remainder when 15 is divided by l? 7 Suppose -6a = -2a + 3c - 65, 2c + 30 = a. What is the remainder when 78 is divided by a? 18 Let b(g) = g - 1. Let a be b(3). Let w = 1 + a. Suppose -wp - 4 = -13. What is the remainder when p is divided by 2? 1 Let b(s) = -s*3 + 6s*2 - 2s - 2. What is the remainder when (-1 + -2)/((-14)/238) is divided by b(5)? 12 Let a be (-6)/30 + 6/5. Let p(c) = 3c2 - c - 2. Calculate the remainder when 8 - -4 - (-1 - a) is divided by p(2). 6 Suppose z - 3 = -0z. Suppose -za + r = -374, -3r = -14 + 2. What is the remainder when a is divided by 32? 30 Suppose 0 = -2b + 46 - 10. Calculate the remainder when 31 is divided by b. 13 Let o(f) = -3f*3 + 4f*2 - f - 2. Let j be o(2). Let d be (-3)/j - (-19)/4. Suppose 11 = du - 4. What is the remainder when 10 is divided by u? 1 Let b(v) = v*3 + 5v*2 - 4v + 3. Let f be b(-6). Let w = 3 - f. Calculate the remainder when 59 is divided by w. 11 Suppose 3j + 128 = -j - 4y, 5j - 4y = -124. Let z(k) = 6k + 1. Let f be z(7). Let c = j + f. What is the remainder when c is divided by 8? 7 Let q = 86 - 39. Let p = -38 + 62. Calculate the remainder when q is divided by p. 23 Suppose 47 = -3j - 5i - 12, -4j - i = 56. Let n = j + 26. Calculate the remainder when n is divided by 4. 1 Let n(v) = -2v - 9. Let s = 11 + 0. Suppose 4t - 3b - 59 = 0, 1 = -t - 4b + s. What is the remainder when t is divided by n(-7)? 4 Let z(c) = 2c3 - 4c*2 - c + 5. Let t(r) = -2r*3 + 4r*2 + r - 6. Let w(d) = 3t(d) + 4z(d). Calculate the remainder when w(3) is divided by 4. 1 Suppose -4m + 0q = -2q + 12, -3q = -6. What is the remainder when m/(1/(-25) + 0) is divided by (-6)/2(-52)/6? 24 Suppose 2h = h + 19. Let l = -24 + 98. Calculate the remainder when l is divided by h. 17 Calculate the remainder when (-455)/(-5)32/56 is divided by 5. 2 Let j be (3/3 + 0)3. Suppose -s + 12 = -jm - 6, 46 = 2s - 4m. What is the remainder when s is divided by (-69)/(-4) + 2/(-8)? 16 Let f(j) = j*2 - 7j - 9. Suppose 0r + 2t - 74 = -2r, -5r + 3t = -161. Calculate the remainder when r is divided by f(9). 7 Let b be -3110/(-6). Suppose 0 = 4j - 4, -bq - 4j + 0j = 136. What is the remainder when 2 + -1 + (-2 - q) is divided by 14? 13 Let a(j) = -3j - 4. Let d(w) = w. Let m(z) = -a(z) - 5d(z). Let n be (-1)/4142. What is the remainder when m(n) is divided by 10? 8 Let t be (-4 - (3 - 6)) + 10. Calculate the remainder when (-3)/(-3) - -31 is divided by ((-12)/t)/((-6)/9). 0 Suppose -32y + 108 = -28y. Calculate the remainder when 79 is divided by y. 25 Let q(p) = -p*3 - 3p*2 - p - 3. Calculate the remainder when 63 is divided by q(-4). 12 Let k be (1 - -2)30/(-9). Let w = k - -32. Suppose -2o + w = -m - 2m, -55 = -5o + 5m. What is the remainder when 20 is divided by o? 9 Let y(i) = i + 4. Let z(d) = d*3 - 7d*2 + 7. What is the remainder when z(7) is divided by y(0)? 3 Suppose -4w - 5 = -21, -4f + 3w + 20 = 0. What is the remainder when 7 is divided by -4 + f + (3 - 2)? 2 Let q(b) = 23b2 - b. Let t(x) = -x3 - 3x*2 + 2x - 2. Calculate the remainder when q(1) is divided by t(-4). 4 Let g(k) = k + 1. Let f(h) = h*3 - 3h*2 - h - 5. Let w = -5 + 9. What is the remainder when f(w) is divided by g(3)? 3 Suppose -4z + 261 = m, 8 = -5m + 33. What is the remainder when z is divided by (-2432)/(-112) + 2/7? 20 What is the remainder when (-3)/2122/(-3) is divided by 21? 19 Let w(g) = 5g - 48. Let a = 1 + 1. Calculate the remainder when a is divided by w(10). 0 Let g = -73 + 165. Suppose 5b = 48 + g. Calculate the remainder when b is divided by 10. 8 Suppose -d = 2d. Suppose d = -2o + 5 + 17. What is the remainder when o is divided by 3? 2 What is the remainder when 17*((-6)/16 - 11/(-8)) is divided by	{ "pile_set_name": "DM Mathematics" }
? 10/3 Calculate (-140)/(-1512)54 - (2 + -3 + -3). 9 What is ((-15876)/189)/((-3)/1)? 28 (-15)/12 - (-7 - 2645/(-368))(-9772)/21 86 Calculate ((1957/(-57) - -16) + 22)/((-209)/(-2166)). 38 Calculate (175/(-21560)16)/((-10)/14). 2/11 Evaluate 1/(-1)(-21)/33 + ((-2064)/(-264) - 8). 5/11 (-320)/1204/(-64)1052 35 Calculate -97(7 + 363/(-55))/((84/30)/7). -97 What is 26 + ((-12)/(-15) - (-219000)/(-1875))? -90 What is the value of 12/(-342) - 203149/(-267900)? 1/5 Evaluate ((-5)/25 - (-267)/1785)/((-390)/910). 2/17 Calculate 166 - (5876/(-52) - -221). 58 (-10)/(-4)4/(-15)(-12)/(-50) -4/25 Evaluate ((-472134)/48424)/((-26)/16 + 1 - 3/(-3)). -26 (1351/772 + (-3)/12)20/6 5 Evaluate 120/(-2) + -659 + 720. 1 Calculate (-647218)/(-4433) + (-1 - -1 - -1). 147 What is the value of (-4)/18-3(-72)/(-22272)-16? -1/29 What is (-31470)/(-1850) + (-136)/((-112)/(-14))? 2/185 Calculate (41 - 908)/(-51) + 28. 45 What is the value of (1715/(-10))/498/(-42)75? 50 What is the value of -4 + -16 + 7 + 23/((-115)/(-250))? 37 Evaluate (22700/24970)/(24/(-396)). -15 What is 54/(-279)(-115165)/2229? 10 What is the value of 4769/266 - 18 - 7/((-2744)/46284)? 118 (1 + -10 + (21 - 294))(-1)/3 94 (34/2046)/(-2 + (-4)/8) -2/5 Evaluate (16048/1416)/((-8)/36). -51 What is 797/7970(-6 - 3/(-3)) + (-28)/(-16)? 5/4 Evaluate (90/54 + -113 + (-6)/(-1))237/(-316). 79 Calculate 2736/(-6156)(8 - (-3175)/(-20)). 67 (-7 - (-13)/(572/1356)) + (-80)/(-440) 24 What is (18 + (6 - 53/2))4? -10 What is 144/90((-14)/24 + (-202)/808)? -4/3 Evaluate (-110 - -9) + 78 - 155/(-7). -6/7 What is 6409/(-5916) + ((-28)/24 - -1)? -5/4 (690/2600 - 2/8)/(-4 - 154/(-35)) 1/26 What is the value of 3(9 - 18) + (-8961)/(-618)? -25/2 (-17193)/41684/(4 - (-28)/2) -11/12 Evaluate 964/(-42) - (4/(-122) + (-32033)/(-398391)). -23 Evaluate 200-4242/(-7056). 50 Evaluate ((-6699)/693 - (0 + 3 + 0)) + 7. -17/3 Evaluate 0 + -78 - (-1)/(76/1672). -56 Calculate (61 + 33 + -17)(-40)/140. -22 Calculate -1(-37 + 109 + -60). -12 Calculate 397782/(-50512)(-16)/3. 42 (-32)/(320/(-15))10(-15)/9 -25 What is the value of (213/(-57) - -4)((-1247)/(-215) - 3)? 14/19 Evaluate 30 - (-3 + (1111 - -7)/(-26)). 76 What is ((-3)/78 - 0)(5 + 130/10)? -9/13 What is ((3/(-2))/(-1 - -262))/(22 - (-3655)/(-172))? -2/261 What is ((-94)/(-12))/((-343)/(-1470)) + (-38)/(-7) + -5? 34 What is the value of 0/((((-7)/7)/(14/8))/((-5)/(-35)))? 0 What is the value of (1 - -2)785/210066(-88)/110? -2/223 What is the value of (-2180)/10010/(-8 - -10)? -109 Evaluate 381060/6960 + 47-1. 31/4 3432/(-24882) + (-1745)/(-7395) 5/51 What is the value of 12/(-196)2422/1038? -1/7 (3 + (-1229)/390 + 60/360)/(-1) -1/65 What is the value of ((-194)/(-8) + -25)(-10)/(-20)? -3/8 What is the value of 144/18 + (-56)/532-19? 10 What is the value of (-316)/(-1576050)3525 + (0 - 4/14)? 8/19 What is 6(11/(-22) + 1)195/(-45)? -13 What is (24824/406 - 26) + (44/(-14) - (-32)/8)? 36 (-42)/60(-8 + -6 + -2 - -14) 7/5 What is -2 - 7519/(-627) - 1506/198? -22/3 What is the value of -68(67 - (-3540)/(-59) - 69/10)? -34/5 What is (-145 - -36) + (-300)/6? -159 Calculate 1/(-36)(231177/156222 - 6/(-297)). -1/24 What is the value of 36856/(-272) + (-3139)/(-86)? -99 What is the value of (-1225)/525(-33)/7? 11 What is the value of (8/(-700) - (-25530)/(-63000))/(0 - 3/(-8))? -10/9 Evaluate 3135/(-285) + 118 - -62. 69 (210/175)/((-6720)/70) -1/80 Evaluate ((-1)/2)/(((-27)/2)/(-171 + 147)). -8/9 Evaluate (-2)/7 + (3288/(-16128) - (44/(-8) + 5)). 1/96 What is the value of 7845/(-450) - 6864/(-416)? -14/15 (-55)/38 - ((-666)/1628)/((-6)/(-22)) 1/19 What is 28336/(-345) - 3248/1740? -84 1386/154 - (-24 - -8) 25 What is the value of ((-1639)/44 - -46)/(10/(-56))? -49 What is the value of (0 + (-8)/2)/((-3100)/(-775))? -1 Calculate (-26)/(4/5((-6550)/400 + 17)). -52 What is 46/((-12696)/2254)(4 - 10)? 49 Calculate 77/(-1674)1 + 63120/117180. 1/54 Calculate (-20)/(76 - -24) - (-192)/10. 19 Evaluate (-18)/2 - (-76 - 129062/(-3008) - (-26 - -2)). 3/32 What is 156 + -13 + 2585/(-47)? 88 What is the value of 57/(-10(-351)/5850)? 95 Evaluate 2164/52 - (-192 + 233). 8/13 (-240)/(-105) + 438/(-511) 10/7 What is the value of 1824/(-11704)770/44? -30/11 What is (930/(-12) - 2) + -12 + 39/6? -85 What is the value of -5 + (-280)/(-21)54/67515? 11 Evaluate 6/1263 - ((-11155)/485 - 562/(-14)). -17 What is 4/(616/(-56) - (-2 + 355/(-40)))? -32 What is ((-2)/8 - (-4)/16)439/(-1756)? 0 Evaluate (29330/(-33520))/(2/40). -35/2 What is the value of 26/42499/(-735) + (9/30)/3? -22 Calculate (2/(3 - 20/5))/(86/2021). -47 Evaluate 8/(-6) - ((-1855)/1749 + 60/(-220)). 0 Evaluate ((-932)/(-1864) - 591/6) + (1 - -5). -92 Evaluate ((-511)/814 - (-5)/10) + (-754)/(-4147). 2/37 Calculate 40/18 + -9 + -27 + 8151/297. -19/3 What is 111/((-5217)/(-3760)) - 12? 68 What is the value of ((-144)/594)/((-408)/459)? 3/11 ((-38)/3230)/((-1363)/799) 1/145 What is the value of (-86)/(-29412)(-23 - -17)? -1/57 What is 6(-2 + 5306/2667)(-13 + 1530/120)? 2/127 16749/(-106077)(-418)/6 11 What is the value of (15/(-21))/(7/((-1176)/1980))? 2/33 What is the value of -6 + (-67261/(-221502))/(2/156)? 3/19 Evaluate ((-2376)/1782)/(1 + -7 + (-6496)/(-1080)). -90 Evaluate (-99)/(-1815) - (-3)/30-27/14. -1/22 What is the value of (-78)/(-68) + (-5122)/(-261222)? 7/6 Evaluate (-4)/(-13) - 825192/17082. -48 Calculate ((-225)/525)/((-3091)/(-238) + -13). 34 What is the value of (-86)/(((6/(-5))/((-8)/(-10)))/(138/184))? 43 Evaluate (-20165)/56680 - (-9)/39. -1/8 What is the value of (-43821)/(-1082)1/(-18)? -9/4 Calculate 192/33 + (-15)/(495/(-6)) - 2015/325. -1/5 What is 30/(-306)397698/(-8355)? 14/3 (-29)/(319/1936)(16 + (-3458)/209) 96 Evaluate (-6003)/(-116) + -52 + 5/(440/28). 3/44 What is the value of ((-3979)/92 - -50)/(315/28)? 3/5 What is the value of (-400)/(-1000) - 724/(-40)? 37/2 What is (34/12 - 17/(-102)) + (-12)/((-72)/114)? 22 Calculate (-24)/((-15504)/(-34))(-2)/153. 2/95 Calculate (0 - 0 - 65)45765/(-76275). 39 What is -126/90175/30? -2 Evaluate (-20 + 16 + 16)/(4/4(-5)/(-10)). 24 ((-4)/(-224)2)/((-60)/24063013) - -11 -1/56 What is (247/1001 + (-2)/(-11))/(477/3339)? 3 What is the value of ((62/(-28))/(-31)35)/(25625/500)? 2/41 What is the value of ((-1410)/3384)/((-5 + 3)/36)? 15/2 Evaluate (-335)/((-4831035)/19872) + (-2)/19. 14/11 What is the value of 105/(165/(-11)) + 423/18 + -7? 19/2 (-1232)/336 - (6/(-78) + 150/(-78)) -5/3 (-110)/38563 - 5 -23 618885/7665 + (-26)/(-91) + 16/(-584) 81 What is the value of (-111)/((-28305)/(-2856)) + 16? 24/5 Calculate 6171/267414/6. 2/13 Calculate (-31)/((-640677)/309507) + (-2)/(-4)(-3 - 27). -2/83 Evaluate (660/11)/6(1180/240 + -5). -5/6 3 + 210/(-65) - (-36)/(1689480/9842) -2/95 Calculate (74/33 + 5980/(-6578))(-9)/3. -4 What is 11/(99/34)(6300/(-112))/25? -17/2 What is the value of ((-780)/(-936)1/(-5))/(1 + (-5)/9)? -3/8 Calculate (-5046)/(-4872) - (12/(-70))/((-152)/20 + 7). 3/4 Calculate (2/(-6))/((1/(-5))/(((-24021)/19635)/(-157))). 1/77 Calculate (((-9)/(-36))/((-3)/4))/(8/11138439). -119 26169/3861 + (110/18 + -6)/((-6)/(-12)) 7 What is the value of (-20944)/6358(-34)/(-4)? -28 (-360)/(-800)30 + (-4094)/92 -31 2/(2/(-61)) - ((-16170)/(-8624))/(10/48) -70 Evaluate 70 - ((-414)/(-9) + -25). 49 Evaluate (15/(-234))/((-830)/(-664)). -2/39 Calculate -3(((-396)/3)/12 - -8 - (2 + 3)). 24 Calculate ((-21618)/10557 - -2) + (-8)/(-92). 2/51 Calculate ((-48)/(-36))/(16807/5760 - 22/10). 32 Evaluate (-3 - -5)/(-226(-3)/(-6) + 22). -2/91 (49 - 154/7)34/3519 6/23 Calculate -2 + (-24)/(-144)-12 - 21. -25 (-2312)/119 - (-294)/(-245)40/(-3) -24/7 What is the value of 2428/(-9330) + 10144/(-1577392)? -4/15 2592/1209621/12 3/8 What is 4 - ((-213)/(-2130) - (-61)/(-10))? 10 Calculate (9/(-12))/((-180)/144) - (3108/300 + -10). 6/25 Evaluate 8058/(-32130) - (-29)/1015. -2/9 What is the value of -20 - (-19 + 70 - 0/(-5))? -71 Evaluate 6776/8120 + (-100)/125. 1/29 What is (28/(-70))/(-10 - 1989/(-85))? -2/67 1/6 + -57 + 5805/90 23/3 What is the value of 3(-493)/87 - (-1600)/20? 63 -119 + (-38220)/308 + 144 10/11 ((-648)/3476520)/((-3)/174) 2/185 Calculate 46398/570 + -56 + 1/5*3. 26 What is the value of	{ "pile_set_name": "DM Mathematics" }
ose -2m - m + 3 = 0. Let b = m + -3. Does 9 divide b + 2 + -1 - -19? True Suppose 0o = -3o. Suppose 3g - 3s - 102 = 0, og + 70 = 2g - s. Is 9 a factor of g? True Suppose w + 0w + 4 = 0, 3d + 23 = -2w. Let l(k) = -2 + k + 7 + 7. Is 7 a factor of l(d)? True Let k(l) = 10l - 4. Is k(4) a multiple of 10? False Let g = 3 - -1. Let u = -62 - -98. Suppose u = go + 12. Is 6 a factor of o? True Let w(i) = -3i - 1. Let r be (-38)/8 - (-4)/(-16). Is 7 a factor of w(r)? True Let d(b) be the first derivative of b3/3 - 5b - 1. Let r be 1/(-2) - (-1 + 49/(-14)). Does 5 divide d(r)? False Suppose 0 = 4x - 12, -7x - 47 = -4r - 8x. Is r a multiple of 9? False Let b(l) = 6l2 + l - 5. Let n be b(-4). Let y = n + -37. Suppose 6 = f - 5t, 0 = -5f + t + y + 28. Does 10 divide f? False Suppose -5t = -1 - 9. Let u(l) = -2l2 + l + 1 - 3l3 - l3 + 9l3. Is 15 a factor of u(t)? False Let x(k) = 6k*2 + 5 - 10k + 5 + 3k3 - 2k3. Let t be x(-8). Does 11 divide (3 + -1)/((-4)/t)? False Does 16 divide 68 - 1 - (2 + -1)? False Let x(b) = -b3 - 9b2 + 10b + 11. Let m(u) = -u*3 - 6u*2 - 3u + 2. Let l be m(-6). Let h = 10 - l. Is x(h) a multiple of 4? False Let n be 624/(-10) - 10/(-25). Let f = n + 117. Is f a multiple of 25? False Let w(l) = -l3 + l + 6. Let i(k) = k + 1. Let q be i(-1). Does 4 divide w(q)? False Let d(r) = r3 + 5r2 + r - 1. Let x be d(-5). Let h(w) = -6w + 14. Does 10 divide h(x)? True Suppose -n - 4i + 149 = 0, 3n + 4i + 123 = 546. Is n a multiple of 6? False Suppose 3g - 2w + 16 = 0, 4g - 5w + 52 = -10w. Let z = g + 8. Does 25 divide -31 - (z + -37)? False Let u = 8 - -49. Suppose -u = -3v - 12. Is v a multiple of 5? True Let p = -1 - -1. Suppose p = a + 2a. Suppose a = x - 13 - 13. Is x a multiple of 17? False Suppose v + 4v - 25 = 0. Suppose -96 = -vy + 24. Suppose -c - 5 + y = 0. Is 7 a factor of c? False Suppose 3j - 1 = 32. Let a = j + -3. Is 4 a factor of a? True Suppose 19 = -2w + 2k + 81, -5w = 3k - 147. Does 15 divide w? True Let u be (-6)/27 + (-6)/(-27). Suppose 0 = -t - 4y, 3t - 5y - 104 + 36 = u. Does 8 divide t? True Let l(s) = -s2 - 9s - 6. Let n be l(-9). Let r(u) = u*2 + 8u + 6. Let c be r(n). Is (4/c)/((-6)/549) a multiple of 18? False Is (-2)/3 - (-116)/3 a multiple of 19? True Suppose 0 = -x - 2x + 90. Is 9 a factor of x? False Let q be 29 + 3 + (-2 - 0). Suppose q = -0r - 3r. Does 12 divide (-492)/(-30) + 4/r? False Suppose 0 = 5i + f + 150 - 845, 0 = -2f - 10. Is i a multiple of 28? True Let n(z) = -z. Let t be n(8). Let k = -4 - t. Does 3 divide k? False Let k be 1(-1 + 0)-4. Suppose -4n - z = -3, kn - 5z + 0z = 33. Suppose g = 4i + 31, -ng + 3g = 2i + 21. Does 9 divide g? False Suppose a - 445 = -4c, 2a = -4c + 5a + 457. Does 8 divide c? True Let f(a) = 98a*2 + 1. Does 33 divide f(1)? True Is (70/3)/((-1)/(-18)) a multiple of 63? False Let p = -6 - -16. Suppose -i = -s - 0s - p, s = -2. Does 7 divide i? False Let r be (-3 - (-4 + 0)) + -9. Let w = 1 - r. Does 7 divide w? False Suppose -3h - 1 = -7. Does 10 divide 11/h(4 + 0)? False Let o = 7 - 14. Let x = o + 10. Suppose 0 = 2m + s - 18 + x, -5s - 65 = -4m. Is m a multiple of 10? True Let l(f) = -f3 - f2 + 13f + 6. Is l(-5) a multiple of 16? False Let d(a) be the second derivative of 43a7/840 - a6/180 + a4/24 - a3/6 + 2a. Let w(t) be the second derivative of d(t). Is 18 a factor of w(1)? False Let w = -8 - -32. Does 8 divide w? True Let i(c) = 2c2 + 7c3 + 1 - c3 - 2c + 15c*3. Let q be i(1). Suppose 3h - h = 4p - q, -15 = 5h. Does 2 divide p? True Suppose -4g + 1300 = 5n, 259 = n - 2g + 3g. Is n a multiple of 24? True Suppose -3s + 27 = -3j, 4j + 11 = 3j + 2s. Let r = j + 3. Is r(-2)/(-20)-30 a multiple of 6? True Suppose 2g + 13 = -3t, 0g - 4g - 2t - 6 = 0. Is 80/4 + g-3 a multiple of 17? True Suppose -3 = -j + 2. Suppose -r = jc - 109, -4c + 3r + 72 = -0r. Is 13 a factor of c? False Let m = -51 - -76. Is 5 a factor of m? True Is 14 a factor of (-296)/(-10) - (-6)/15? False Let t = -73 + 31. Let i be -1 - 0(-1)/2. Is i/(-1 + t/(-45)) a multiple of 9? False Let v(x) = x3 - x2 + x + 246. Let k be v(0). Suppose 2b = 5g - 0g - k, -b + 237 = 5g. Does 12 divide g? True Let b = -2 + 7. Suppose -2s = c - b, -5c + 0c = 4s - 19. Is c even? False Suppose -2a = g - 81, 2g = -2a - 19 + 101. Is 33 a factor of a? False Suppose 4m - 3c = -6c + 1001, -4c = 2m - 508. Is 62 a factor of m? True Let g(p) = -p*2 - 17p - 25. Does 13 divide g(-11)? False Is (-1 - 1)/((-20)/340) a multiple of 12? False Let n = 0 + 1. Let y(u) be the first derivative of 7u4/4 + u3/3 - u + 3. Is y(n) a multiple of 4? False Does 23 divide -13/6(0 + -172)? False Suppose -4u + 25 = -5f, 0 = 3u - 5f - 17 - 3. Suppose -uq - 30 = -10. Is 17 a factor of q + 3 - 1-47? False Let d(j) = 6j + j*2 - 2 + 5j*2 - 3j*2 + 7. Is d(-5) a multiple of 24? False Let a(u) = -u + 21. Let c be a(10). Let i(r) = -23r*2 - 1. Let v be i(1). Let t = c - v. Is t a multiple of 10? False Suppose 5z = 4z + 17. Is z a multiple of 17? True Let h = 6 + -3. Suppose 8x + 16 = 4x, 0 = 3y + hx - 30. Does 7 divide y? True Let x be (-9)/12 + 175/4. Let q(s) = s. Let g be q(3). Suppose -x - 68 = -gd. Does 15 divide d? False Let u(j) = j*3 - 2j*2 - j - 2. Let g be u(3). Suppose 5 = f + h - 9, 56 = gf - 2h. Is 9 a factor of f? False Let z(v) = 2v*2 + 15v + 41. Is z(-11) a multiple of 9? False Let v(f) = -6f + 13. Is 8 a factor of v(0)? False Let c = -4 - -1. Suppose 0y - 6 = -3y + 2h, 13 = y + 3h. Let b = y - c. Does 6 divide b? False Let x(q) = 5 - 4q - 1 - 2q2 + 4 + 3q*2. Does 12 divide x(7)? False Suppose -4l + 0l - 4 = 0. Is 9 a factor of (12/7)/(l/(-7))? False Suppose -5 = -b, -b = -3x + 1 + 3. Suppose xq + 5 = 11. Is 8 a factor of 44/q - -2 - -1? False Let y = -9 + 24. Is y a multiple of 15? True Suppose -4j - j - 2w - 44 = 0, 2w + 4 = -j. Let b be (52/j)/(2/10). Let h = 49 + b. Is 18 a factor of h? False Let k(t) = -t*3 + t + 7. Let g be k(0). Let u = g - 4. Suppose 0 = uj - 23 - 1. Is 7 a factor of j? False Suppose o - 25 = 75. Suppose -5r + o = -4n, 4r - 57 = 5n + 14. Is 16 a factor of r? False Suppose -2d + 6d - 12 = 0. Suppose 4p = -dl + 28, 2p - 54 = -2l - 2l. Is l a multiple of 8? True Suppose -i - 35 = -6i. Is (-2)/i - 90/(-21) a multiple of 2? True Suppose 5u - 8z + 6z = 749, -u = -2z - 153. Let o = u + -44. Does 27 divide o? False Suppose 0 = -2y + 160 + 48. Is y a multiple of 12? False Let l be (-4)/10 - (-24)/10. Suppose -a - ld = 2, 0 = -0a - 5a - 2d + 22. Suppose -3b + 4v - a = -4, -2v + 12 = 4b. Does 2 divide b? True Suppose 4f - 10 = 2. Let i(c) = 9c2 + 23c - 11. Let o(h) = 5h2 + 12h - 5. Let j(n) = fi(n) - 5o(n). Is j(-7) a multiple of 11? False Let b = 11 + -6. Suppose 34 = a + 3x - 1, 0 = 4a - bx - 72. Is 9 a factor of a? False Let s = -5 + 3. Let j be -1 + (s + -1 - -8). Suppose jg + 39 = 5l, l - 22 = -2l + g. Is 7 a factor of l? True Does 11 divide ((-10)/4)/(5/(-30))? False Suppose -35 = -8o + 125. Is 10 a factor of o? True Suppose -2g + 52 = -0g. Let z be 2/5 - g/(-10). Is 0 + 12 + z + -2 a multiple of 9? False Let l be (-53)/(-6) - (-1)/6. Let d = -4 + l. Suppose du - 2u - 126 = 0. Is u a multiple of 15? False Let b(g) = 4g3 + g2 - 2g + 1. Let q be b(1). Suppose -i - ql + 48 = 0, i + i + 2l - 72 = 0. Does 32 divide i? True Suppose 3u - 7v + 226 = -2v, -2u - 153 = -v. Let j = 112 + u. Does 12 divide j? False Let o = 18 - 11. Suppose 2v = ov - 10. Suppose vc - 5c = -6. Is 2 a factor of c? True Let o(d) = 3d*2 - 10d + 27. Is o(7) a multiple of 26? True Suppose -i + 1 = 3d - 1, -d = 3i + 10. Suppose -4k - 44 = s - 3s, 45 = ds - 5k. Is s a multiple of 10? True Let a = 93 + -30. Is 8 a factor of a? False Let c(p) = 12p2 - p - 5. Let b(g) = 25g*2 - 2g - 11. Let h(m) = -6b(m) + 13c(m). Let z be h(1). Is (-56)/(-3)9/z a multiple of 14? True Suppose -5q - 16 - 9 = 0. Let v(f) = f*2 - 12f + 12. Let j(w) = 2w2 - 24w + 25. Let a(i) = qv(i) + 2j(i). Does 6 divide a(9)? False Let w be (-2 + (-20)/6)-3. Suppose 0 = -4d + 4 +	{ "pile_set_name": "DM Mathematics" }
et d(w) = 26w - 1. Let f(c) = 13c*2 - 3c. Determine f(d(x)). 8788x2 - 754x + 16 Let k(g) = -2g2. Let h(u) = 20u*2 + 6u. Determine k(h(i)). -800i4 - 480i*3 - 72i*2 Let v(y) = -4y*2. Let s(b) = -11b*2. Determine s(v(l)). -176l*4 Let n(b) = -186b + 1. Let k(z) = 25z2 + 2z. What is n(k(x))? -4650x2 - 372x + 1 Let q(v) = 5v + 216. Let i(l) = -2l*2. Give q(i(n)). -10n2 + 216 Let l be -12 + 5/(15/6). Let g(s) = s2 - 2s - 2. Let b(n) = 3n*2 - 5n - 5. Let r(i) = lg(i) + 4b(i). Let u(c) = 5c. Determine u(r(x)). 10x*2 Let n(q) = -4q + 6. Let d(u) = 3u - 5. Let p(s) = -6d(s) - 5n(s). Let c(t) = -16t. What is p(c(o))? -32o Let a(r) = -16r. Let h(p) = p + 1. Let i(j) = -4j - 5. Let g(n) = 5h(n) + i(n). Calculate a(g(t)). -16t Let u(s) = 17s - 5. Let l(v) = -8v + 2. Let b(w) = -5l(w) - 2u(w). Let i(y) be the third derivative of y4/24 + 3y*2. Determine i(b(q)). 6q Let v(x) = 100x2 - 55x. Let b(t) = 11t2 - 6t. Let w(k) = 55b(k) - 6v(k). Let s(f) be the second derivative of f*4/4 - f. Determine w(s(r)). 45r4 Let k(m) be the first derivative of m2 - 1. Let h(x) = x - 1. Let z(j) = 3j - 2. Let v be (3 - 0)4/6. Let p(l) = vh(l) - z(l). What is k(p(u))? -2u Let m(x) = -x*2. Let w(u) = 15u - 10u - 7u. Give w(m(n)). 2n2 Let o(n) = -2n. Suppose -d = -7d. Let l(f) be the second derivative of 0 + 1/2f*4 - 4f + 0f3 + df*2. Give l(o(t)). 24t*2 Let m be 2(0 - -1) + 2. Let a(z) = z*3 - 6z*2 + 7z - 6. Let l be a(5). Let v(t) = -lt + mt - t. Let s(y) = 2y2. What is v(s(j))? -2j*2 Let k(z) = 2z. Let f(v) = v. Let j(i) = -9i. Let a(g) = -14f(g) - 2j(g). Determine a(k(t)). 8t Let o(p) = -3p - 2. Let i(z) = -5z. Calculate i(o(k)). 15k + 10 Let t(f) = -2f2. Let m(n) be the first derivative of n6/90 - n*3/3 - 3. Let k(o) be the third derivative of m(o). Calculate k(t(u)). 16u*4 Let c be (-2)/8 - (-10)/8. Let b be (6/8)/(c/4). Let r(w) = 2w - 3. Let z(k) = 6k - 10. Let t(l) = bz(l) - 10r(l). Let s(m) = -m. Determine s(t(g)). 2g Let p(d) = 2d + 1. Let a(f) = -5f*2. What is p(a(t))? -10t*2 + 1 Let b(k) = -2k*2 + 81k. Let p(q) = -2q2. Determine b(p(r)). -8r*4 - 162r*2 Suppose -p = 3p - 28. Let m(k) = -2k + 7 - p + 3k. Let t(l) = 2l. What is t(m(y))? 2y Let b be ((-2)/(-6))/((-1)/(-9)). Suppose -w + b = -1. Let k(o) = -wo2 + o2 + 0o*2. Let i(t) = -2t. What is k(i(n))? -12n2 Let t(d) = 4d. Let h(o) = -21 + 10 + 11 + 4o. What is h(t(y))? 16y Let b(r) = -65r2. Let v(g) = 19g*2. Give v(b(z)). 80275z*4 Let b(o) be the second derivative of -5o*3 + 26o - 1. Let z(c) = 4c2. Give b(z(d)). -120d*2 Let d(s) = -2s. Let m(l) be the third derivative of -l8/5040 + l5/30 + 2l2. Let v(z) be the third derivative of m(z). What is v(d(c))? -16c*2 Let z(j) = 3j. Let r = -60 + 60. Let n(c) be the second derivative of -3c + 1/4c*4 + 0c*2 + 0c*3 + r. Calculate n(z(f)). 27f*2 Let r(t) = 3t - 7. Let a(l) = -6l2. Calculate a(r(v)). -54v*2 + 252v - 294 Let i(v) = -2v2. Let a(y) = -y3 - 7y*2 + 7y - 4. Let w be a(-8). Let j(z) = w - 4 + 8z. Determine i(j(r)). -128r*2 Let g(i) = -6i. Let f(n) be the third derivative of n*5/15 + 18n*2. Give g(f(d)). -24d*2 Let d(w) = 89w. Let s(v) = -v*2. Give s(d(l)). -7921l*2 Let q(k) = -2k*2. Let l be 6/27 + 16/9. Let t(r) = -2 - 3r + 0 + l. Give q(t(c)). -18c2 Let a(f) = 5f + 6. Let w(c) = -9c - 11. Let y(t) = -11a(t) - 6w(t). Let o(b) = -2b + 4b + b. Give y(o(s)). -3s Let p(y) = -2y2. Let o(b) = b - 2029. Give o(p(z)). -2z*2 - 2029 Let g(v) = v. Let t be 15(-3)/(-18)2. Let w(y) = -5y + ty - y. Give w(g(a)). -a Let z = 1 - -1. Let p(n) = -2n*2 - 2n*2 - 3n*z + 5n*2. Let d(f) = -f. What is p(d(m))? -2m2 Let z(c) be the third derivative of c4/12 + c*2 - 79c. Suppose 5k + 10 = -5u, 7 + 19 = 3k - 5u. Let o(b) = -2b2 + 2b*k - 3b*2. What is z(o(d))? -6d*2 Let l(y) = -5y. Let z(j) be the first derivative of -j6/360 - j3 - 3. Let f(d) be the third derivative of z(d). Determine f(l(a)). -25a2 Let i(b) = -2b*2. Let u(w) = 622w*2. What is i(u(k))? -773768k*4 Let p(s) = 0s + 17s - 5s - 10s. Let d(t) = 6t*2 - 4t. Determine d(p(v)). 24v2 - 8v Let f(r) = -r*2. Let w(c) = -24c - 24. What is w(f(n))? 24n2 - 24 Let b(w) = 4w. Let t(l) = l. Let p(c) = -2b(c) + 6t(c). Let y(s) = -8s2. Give p(y(o)). 16o*2 Let d(r) = 225r*2 + 2. Let j(w) = 3w*2. Determine d(j(p)). 2025p*4 + 2 Let f(a) = -61a*2. Let y(r) = 5r*2. Calculate y(f(m)). 18605m4 Let x(f) = f2. Let i = -8 + 10. Let j(q) = -3q2 + 0q*2 + 6q*i. What is x(j(s))? 9s*4 Let p(u) = -6u. Let k(s) = s. Calculate p(k(z)). -6z Let h(d) = 39d - 23d - 14d - 19d. Let p(k) = 3k*2. What is p(h(v))? 867v*2 Let i(r) = -3r*2 - 9r. Let k(d) = -6d. Give i(k(n)). -108n*2 + 54n Let n(q) = 7q2. Let m(w) = -149w*2. What is m(n(l))? -7301l*4 Let u(k) = -2k. Let w be 2/3 - 208/(-39). Let b(a) = 2a - 5. Let x(h) = -3h + 6. Let g(r) = wb(r) + 5x(r). Calculate g(u(l)). 6l Let m(y) be the third derivative of y4/8 - 5y*2. Let f(n) = 3n. What is m(f(p))? 9p Let j(x) be the first derivative of -2x3/3 - 7. Let p(f) be the third derivative of f4/24 + f*2. Give j(p(a)). -2a2 Let k be (0/(-3))/(-2 + 1). Let c = 2 - k. Let x(o) = o2 - 3o2 + 4o*c. Let g(s) = -s. Determine x(g(f)). 2f*2 Let z(y) = -1. Let c(m) = m - 3. Let w(o) = c(o) - 3z(o). Let f(h) = -5h2. Give w(f(g)). -5g*2 Let p(i) = 43i*2. Let r(t) = 6t + 2. What is r(p(s))? 258s2 + 2 Let d(c) = 2c*2. Let r(x) = -21x*2 - 4x2 + x2. Calculate d(r(o)). 1152o4 Let n(y) = y3 + 13y*2 + 11y - 12. Let r be n(-12). Let v(j) = j - j - j + r. Let z(b) = b. Determine v(z(x)). -x Let b(p) = p*2. Let c(k) be the first derivative of 0k + 0k2 - 7 - 1/3k3. Give b(c(m)). m4 Let m(k) = -k. Let p(h) = 16h2 - 11h*2 - 6h*2 - 6h*2. Determine p(m(g)). -7g2 Let s(r) = -r2 + 2r. Let k(u) = -15u*2 + 33u. Let z(d) = -2k(d) + 33s(d). Let n(c) be the first derivative of -2c3/3 + 6. What is z(n(p))? -12p*4 Let w(r) = 53r*2. Let z(b) = -2b*2. What is z(w(q))? -5618q4 Let m(o) = -o2 + 9o. Let z be m(8). Let p = -4 + 9. Let k(r) = -5r - pr + zr. Let h(a) = a. What is h(k(v))? -2v Let k(h) = -11h*2 - 3h + 3. Let d(w) = w*2 + w - 1. Let q(j) = 3d(j) + k(j). Let f(z) be the third derivative of z*4/24 + 25z*2. Give f(q(t)). -8t*2 Let h(r) = 2r2. Let g(m) = -m3 - 14m2 - 24m + 3. Let d be g(-12). Let q(t) be the second derivative of 2t + 0 + 0t*2 + 1/6t*d. Give h(q(z)). 2z*2 Let c(j) = 3j. Let g(i) = 25 - 25 + 2i2. Calculate c(g(k)). 6k*2 Suppose m + 4m = 0. Let r(s) = 0 - 6s + m + 4s. Let w(q) = 3q2. Determine r(w(x)). -6x*2 Let g(m) = -39m*2 + 7m - 9. Let i(o) = 19o2 - 3o + 4. Let q(y) = -4g(y) - 9i(y). Let b(d) = 2d2. What is q(b(z))? -60z*4 - 2z*2 Let o(p) = 2p - 3. Let f(b) = -3b + 4. Let k(v) = -3f(v) - 4o(v). Let a(m) = 0m - m + 2m. What is k(a(h))? h Let r(z) = -2z. Let w(q) = 715q2 + q. Give r(w(t)). -1430t*2 - 2t Let u(k) = 3k. Let b(x) = 179 - 179 + x. What is u(b(d))? 3d Let d(u) = -u. Let b(w) = 7w. Let h(p) = -b(p) - 3d(p). Let k(t) = t*2. Give h(k(g)). -4g*2 Let o(m) = 2m*2. Suppose -4v + 9 = -27. Let t(g) = vg - 7g + 8g. Determine o(t(p)). 200p*2 Let g(z) = -18z*2. Let k(h) = 4h + 2. Let w(y) = -9y - 5. Let x(f) = -5k(f) - 2w(f). Calculate x(g(q)). 36q*2 Let f(t) = -5t. Let v(h) be the third derivative of h*4/12 - 14h*2. Calculate v(f(x)). -10x Let o(k) = -2k2. Let x(v) = -286v*2. Give x(o(g)). -1144g*4 Let q(h) = -219h. Let o(c) = 3c. Give q(o(n)). -657n Let m(c) = -29c + 18c + 12c. Let j be 2(1 - 2)/(-2). Let d(o) = 1 - j + o. Give m(d(f)). f Let o(c) = 3c. Suppose 63 = 5m - 2m. Let s(l) = -4l - 21 + m. Determine o(s(v)). -12v Let x(k) be the second derivative of k3/2 + 5k. Let w(n) = -7n2. What is w(x(d))? -63d*2 Let g(d) = d. Let q(o) = -22o*2 - 3o. Calculate q(g(f)). -22f2 - 3f Let u(i) = 2i. Let o(j) = -5j*2 + 2. Suppose 3c = -3*d -	{ "pile_set_name": "DM Mathematics" }
derivative of 7d3/6 - d2/2 + 383d - 1. Let j(h) = h*2. Calculate j(r(a)). 49a*2 - 14a + 1 Let r(b) = b - 5. Let v(f) = -3f2 + 221f. Give r(v(u)). -3u2 + 221u - 5 Let c(v) = -v - 499. Let i(l) = 3l2. Give c(i(f)). -3f2 - 499 Let a(i) = i - 1. Let l(b) = b3 + 10b2 - b - 11. Let f be l(-10). Let d(q) = q2 + 3q - 6. Let n(p) = fd(p) + 6a(p). Let y(x) = -x. Calculate y(n(v)). v*2 - 3v Let r(v) = 3v - 3. Let z be r(3). Let j(p) = -zp - 4p + 9p. Let q(c) = 2c. Give j(q(m)). -2m Let f(i) = 18 - 3i2 - 18. Let h(q) = 3q - 10. What is f(h(g))? -27g2 + 180g - 300 Let h(j) = -j*2. Let n(o) = 14720o*2. What is n(h(f))? 14720f*4 Let t(v) = 2v*2. Let z(o) = -1338o + 61. Determine t(z(s)). 3580488s2 - 326472s + 7442 Let s(a) = a. Let v(g) = -59799g2 + 5. Calculate v(s(r)). -59799r*2 + 5 Let c(q) = 3q. Let f(u) = -7u - 103 + 103. Determine f(c(s)). -21s Let h(y) = -11y. Let t(n) = -7n*2 + 10 + 13 - 23. Calculate t(h(b)). -847b*2 Let r(a) = -4a - a - 4a. Let v(p) = -18p*2 - 5p - 10. Let u(g) = -88g2 - 24g - 48. Let j(k) = 5u(k) - 24v(k). Give r(j(d)). 72d2 Let b(u) = -12u*2. Let d(g) be the third derivative of 0g - 24g2 + 0g*3 + 0g*4 - 1/15g*5 + 0. Give d(b(p)). -576p*4 Let h(w) = 652w - 5. Let x(t) = -70t2. Give h(x(u)). -45640u*2 - 5 Let j(v) = -4214v. Let x(t) = 25t2. Determine x(j(i)). 443944900i*2 Let s = 31 - 16. Let i(c) = -sc*2 + 8c*2 + 3c*2 + 7c*2. Let b(k) = 2k*2. What is i(b(m))? 12m*4 Let z(h) = 4h. Let m be 8 + (2 - 10 - 0). Let q(t) be the third derivative of 0 + 0t + mt*3 + 6t*2 + 1/6t*4. Determine z(q(w)). 16w Let h(n) = -14n. Let j(u) be the first derivative of -u2/2 + 59. What is h(j(c))? 14c Let s(v) = 37v2 + 5v*2 + 842v - 842v. Let r(l) = -l. Determine r(s(t)). -42t2 Let j(r) = r2 + 173r. Let s(q) = -233q. Calculate j(s(h)). 54289h2 - 40309h Suppose x - 13 = -0x - 3z, 5x = -z + 79. Let v(f) = 7f + f - x + 16. Let m(c) be the third derivative of c*5/60 + 2c*2. Give v(m(d)). 8d*2 Let m(h) = -101h. Let g(b) = 26b + 48. Let p(f) = 5f + 9. Let u(s) = -3g(s) + 16p(s). Determine m(u(j)). -202j Let u(v) = v. Let i(m) = 53m + 59m - 99m. Determine i(u(z)). 13z Let b(a) = a2 + a2 - 1 + 1. Let d = 68 + -27. Let p(n) = 2 + dn*2 - 2 - 43n*2. Determine p(b(i)). -8i*4 Let x(w) be the third derivative of 7w*4/24 + 5w*2. Let u(l) = 3l*2 + 4. Let v(t) = -1. Let b(a) = -u(a) - 4v(a). Give b(x(n)). -147n2 Let r(g) = 16g*2 - 2g. Let l(c) = 46c - 139c + 49c + 48c. What is l(r(j))? 64j2 - 8j Let j(a) = -10a + 4. Let r(h) be the third derivative of h5/5 + 560h*2. Give r(j(l)). 1200l*2 - 960l + 192 Let y(s) = -5s + 3. Let n = 14 + -23. Let r be (-36)/1612/n. Let d(v) = -16v + 10. Let x(i) = rd(i) - 10y(i). Let o(m) = 6m. Calculate o(x(t)). 12t Let m(n) be the first derivative of -20 + 4/3n*3 + 0n + 5n2. Let r(d) = d2. What is r(m(s))? 16s*4 + 80s*3 + 100s*2 Suppose -4u + 4 = 2s, -1 = 5s + 9. Let v(p) = 311p - 311p + up2. Let j(i) be the second derivative of -17i*4/12 - 4i. Calculate j(v(c)). -68c4 Let b(k) = -k - 2. Let c be b(-4). Let u(l) be the third derivative of 0l*3 + 0 + 1/12l*5 + 0l + 0l4 + 4l*c. Let g(i) = 2i. Calculate g(u(f)). 10f2 Let g(n) = -4n*2 + 2n. Let f(o) be the second derivative of -5o3/6 - 152o. Determine f(g(m)). 20m2 - 10m Let f(g) = 4g2 - 21g. Let j(n) be the third derivative of -n*5/60 + 2n*2 - 10n. Give j(f(z)). -16z4 + 168z*3 - 441z2 Let k(h) = -h2 + 1. Let j(q) = -6q2 + 5. Let d(y) = -j(y) + 5k(y). Let o(b) = -13b - 33. Let p(t) = -t - 3. Let x(u) = 2o(u) - 22p(u). Give d(x(n)). 16n*2 Let w(q) = 8323 - 16q*2 - 16q*2 - 8323. Let c(i) = -3i. Calculate w(c(j)). -288j2 Let p be (4/(-22) + 90/11)/2. Let r(a) = -20a + pa2 + 42a - 22a. Let o(n) = -5n. Calculate o(r(y)). -20y2 Let x(y) = -3012y. Let n(p) = 15p. Calculate x(n(h)). -45180h Let t(k) = -3k2. Let b(j) be the second derivative of 0 + 5/24j*4 + 0j*3 + 5j + 7/2j2. Let n(r) be the first derivative of b(r). Determine t(n(p)). -75p*2 Let p(y) = -2y. Let k(s) be the second derivative of -40s + 0 + 7/6s*3 + 0s*2. Determine p(k(g)). -14g Let k(n) = -2n + 4. Let h(x) = 1127x. What is k(h(z))? -2254z + 4 Let z(n) = 2n. Let p = -104 - -114. Let f(u) = -p + 9 - 6u + 20u. What is z(f(b))? 28b - 2 Let h(y) = 3y. Let j(d) = -12d3 + 1. Let u = 24 + -23. Let f be j(u). Let s(k) = -8k. Let a(r) = fh(r) - 4s(r). Let n(o) = 2o2. Determine n(a(v)). 2v*2 Suppose 0 = 3p + 2p + 3p. Let c(s) = 2s + ps - 12 + 3. Let y(t) = t*2. Give y(c(n)). 4n*2 - 36n + 81 Let a(b) = -b. Let l(g) = -2954178g2. Determine a(l(i)). 2954178i*2 Let j(a) = -25a*2. Let t(p) = 2978p. Determine t(j(q)). -74450q2 Let d(n) = 210n. Let h(t) = 450t. Determine d(h(q)). 94500q Let t(s) = -9s2 - 8s. Let f(z) = 6z2 + 5z. Let v(k) = -8f(k) - 5t(k). Let q be 1/((-9)/6 + 2). Let r(d) = d + qd - 4d. Calculate r(v(c)). 3c2 Let d(q) = 2q. Let j(n) = -29n - 154. Let f(h) = 5h + 27. Let o(r) = 34f(r) + 6j(r). Determine d(o(v)). -8v - 12 Let v(o) be the first derivative of 0o*2 + 0o + 27 - 1/3o3. Let y(u) = -11u. Calculate v(y(f)). -121f2 Let n(g) = -g. Let u be -1 + 7 - (-8 - -8). Let m(h) = 9h*2 + 6h. Let k(z) = 9z2 + 5z. Let q(f) = uk(f) - 5m(f). What is n(q(c))? -9c2 Let l(f) = f2 + 5f + 6. Let j be l(-4). Let a(s) = -6 - 3s2 + 4s*j + 6. Let p(i) = 2i + 5i - 4i - 2i. Give a(p(o)). o2 Let n(z) be the third derivative of -z5/30 - 9z*2 + 21z - 1. Let a(j) = 2j + 4j + 9j. Determine a(n(s)). -30s*2 Suppose -j = -2 - 1. Let n(d) = 3d + 0d - jd - 2d. Let g(c) be the second derivative of c3 - 2c. Give g(n(o)). -12o Let r(v) be the first derivative of -v2/2 + 14. Let y(z) = 37z - 803 + 803. Calculate y(r(s)). -37s Let x(h) = 245h - 482h + 234h. Let a(f) = -3f2 - 5. What is x(a(j))? 9j*2 + 15 Let n(v) = 2v*3 + 2v*2 - 2v + 1. Suppose w + 9 = -3q - 2w, -5q + 5w + 25 = 0. Let l be n(q). Let i(y) = l - y - 3. Let o(s) = -s2. What is o(i(u))? -u2 Let h(c) = 2c2. Let p(a) = 30a*2 + 7a. Let n(s) = -30s2 - 10s. Let r(z) = -4n(z) - 6p(z). Calculate r(h(t)). -240t4 - 4t*2 Let g(t) be the second derivative of 25t4/12 - t + 164. Let z(o) be the second derivative of -o4/6 + 4o. What is g(z(n))? 100n*4 Let p(s) = -16s2. Let k(m) be the third derivative of -m4/24 + 2m2 - 2m. Determine k(p(j)). 16j2 Let g(b) = -20b*2. Let h(m) = 3m + 563. Determine g(h(x)). -180x2 - 67560x - 6339380 Let i(d) = 18d2. Let p(r) be the first derivative of 3r*3 + 143. Determine p(i(y)). 2916y*4 Let s(q) = q. Let z(v) = -2582749v. Give z(s(a)). -2582749a Let r(w) = 17w*2. Let d(k) = -18k*2 + 28k*2 - 8k*2. Determine d(r(v)). 578v*4 Let t(n) = -n. Let u(v) = 3v + 2. Let c(a) = -7a - 5. Let h(z) = -2c(z) - 5u(z). Let y(w) = -27w. Let i(m) = 45h(m) - y(m). Give t(i(q)). 18q Let o(w) = -297232w. Let q(i) = -6i*2. Calculate q(o(y)). -530081170944y*2 Let m(s) = 1414s. Let k(i) = 16i2. Determine k(m(w)). 31990336w*2 Let s(v) = -4v*2. Let f(a) = 19a*2 + 1785. Determine f(s(z)). 304z*4 + 1785 Let h(o) = 19o. Let j(n) be the third derivative of n*5/20 + 80n*2. What is h(j(v))? 57v*2 Let u(f) = -3f*2 + 4. Let d(s) = 4s*2 - 5. Let r(o) = 4d(o) + 5u(o). Let l(h) be the first derivative of 13h*3 - 572. Calculate l(r(b)). 39b*4 Let c(x) = -8x - 9. Let s(g) = -852g2. Calculate c(s(h)). 6816h*2 - 9 Suppose 29q = 28q + 7. Let s(i) = -qi - 2i + 7i + 4i. Let u(l) = -8l*2. Calculate s(u(y)). -16y*2 Let c(y) = -25y. Let l(n) = 3n - n + 0n - n. Determine c(l(d)). -25d Let h(p) be the second derivative of p4/6 + 355p. Let s(x) = 9x2. What is h(s(q))? 162q*4 Suppose -687 = 2d - 691. Let y(n) be the second derivative of 0 - 1/6n3 + 10n + 0nd. Let p(v) = -6v. What is p(y(t))? 6t Let s(r) = r3 - 4r*2 + 2r - 5. Let t be s(4). Let q(f) = -f + 2f - tf + f. Let o(g) = 25g. Determine o(q(h)). -25h Let	{ "pile_set_name": "DM Mathematics" }
/5, d, -4 Suppose -w - 2 = -0w. Let r(n) = n3 - 6n*2 - 7n + 2. Let v be r(7). Sort w, 1, v in decreasing order. v, 1, w Let d be 0/(2/(-3 + 2)). Let o = 5 - 6. Let h = -7 + 5. Put d, h, o in decreasing order. d, o, h Suppose w - 5 + 1 = 0. Let y = 16 + -14. Put w, y, 3 in descending order. w, 3, y Suppose -2 + 12 = -5x. Let h be (1 + -7)x/4. Suppose -21w - 16 + 100 = 0. Sort 0, w, h in descending order. w, h, 0 Let q = -128.3 + 128. Sort q, -2, -6. -6, -2, q Suppose 14 + 1 = -3i. Put -2, i, 3 in ascending order. i, -2, 3 Let i(c) = 10c3 - 11c*2 - 10c - 4. Let o(g) = -3g3 + 4g*2 + 3g + 1. Let z(x) = 2i(x) + 7o(x). Let f be z(6). Sort f, 3, 1 in increasing order. 1, 3, f Let w = 99 + -106. Put 0.2, -2, w in ascending order. w, -2, 0.2 Suppose 0 = 5r + 3 + 7. Let k be r/6 - (-4)/(-6). Let a be (k/(-12))/(1/3). Put -5, a, -1 in decreasing order. a, -1, -5 Let x(a) = -2a*2 + a. Let p be x(-1). Let d = 28 - 8. Suppose 2h - 7 = -i, 8h = 4h - 4i + d. Put p, h, 5 in descending order. 5, h, p Let p be (3 + 33/(-12))-1. Put p, 0, -1, 1/8 in ascending order. -1, p, 0, 1/8 Let q = 0 - -5. Let j = 8 + -7. Sort -2, q, j in ascending order. -2, j, q Suppose 4d - 110 = 10. Suppose -4k = 2 - d. Let b be (48/k)/3 + -2. Put b, -5, 2 in decreasing order. 2, b, -5 Suppose -5m + 15 = 0, 3f + 2m - 12 = -0m. Suppose fo = -2o - 12. Let p(q) = -q*3 - 9q*2 - 9q - 4. Let x be p(-8). Sort x, 5, o in descending order. 5, x, o Suppose 2a + 16 = -0a - 5j, 2a - 4j + 34 = 0. Put 5, a, 1 in increasing order. a, 1, 5 Let y be ((3 + -6)(-1)/(-3))/1. Let w = -1 + 1. Sort w, 3, y in decreasing order. 3, w, y Let h = -8.3 - -8. Suppose n + 27 - 1 = 3k, -2n + 38 = 4k. Let s = 13 - k. Sort s, -4, h in decreasing order. s, h, -4 Let t be 6(-3 + 2 - 0). Let z = -10 - t. Let o = -61 - -917/15. Sort 5, z, o in decreasing order. 5, o, z Let u = -30 - -30. Let p = -4.01 - -4. Let m = p - 1.99. Put m, u, -3 in decreasing order. u, m, -3 Let r(q) = 5q + 22. Let k be r(-6). Put 0.1, 3, 2/7, k in decreasing order. 3, 2/7, 0.1, k Let s(f) = -2f*2 - 13f + 3. Let m be s(-7). Put 0.4, 4.2, m in descending order. 4.2, 0.4, m Suppose 0 = -2o + 4 - 2. Let p be (-30)/2(-11)/(-33). Sort 5, o, p. p, o, 5 Suppose -2 = -0f - 2f, 5x - 4f + 29 = 0. Put -2, 22, x, -4 in ascending order. x, -4, -2, 22 Suppose 0 = 14j - 13j - 4. Sort j, -2/17, -0.1, 0.1. -2/17, -0.1, 0.1, j Suppose 9 = -q + 4q. Let b be (-16)/40 + (-214)/(-10). Let d = b - 14. Sort q, -2, d in decreasing order. d, q, -2 Let i = -93/5 + 19. Suppose -4y + 16 = 2f, -4y - 4f + 26 = y. Suppose -2x = yn - 4, 4x + 5 + 5 = 2n. Sort i, -0.2, n in ascending order. -0.2, i, n Let u be 18/5 - (-15)/(-25). Suppose -a = ua - 8. Suppose -5l - 4t + t - 25 = 0, -4l + t - 20 = 0. Sort a, -1, l. l, -1, a Suppose -5x = 4o, 3x = 5o - 2o. Suppose 2c + c = o. Put -2, c, 1 in decreasing order. 1, c, -2 Suppose 0 = -3w - 7c + 10c + 3, c = 4w + 11. Sort 1, -5, w. -5, w, 1 Let v be -1 - -3 - (2 - -2). Suppose 0 = 5c - 3u - 1, c + 6u - 4u = -5. Let s = 2 + c. Put v, 0, s in increasing order. v, 0, s Let k be (6 - 47)/(2/14). Let v = k - -3159/11. Put v, -4, -3 in decreasing order. v, -3, -4 Let s be (10/(-18))/(4/6). Suppose 4 = q + 2. Suppose -4v + 6 = 3c + 29, 16 = -3v - qc. Sort v, s, 4. v, s, 4 Let o(s) = s3 - 23s*2 + 22s - 2. Let a be o(22). Put a, 3, 1 in descending order. 3, 1, a Suppose 0 = a - 3. Let r be a/(-12) - 10/(-8). Sort r, -2, -1. -2, -1, r Let s = -1747/4109 - 2/587. Let i = 9.2 - 9. Sort 2/13, s, i in increasing order. s, 2/13, i Let j = 0.04 - -1.96. Let u = 8 - 8.6. Let l = u + 0.2. Sort j, -3/7, l in descending order. j, l, -3/7 Let o = -23 - -24. Let t be 3 - o - (-6)/2. Sort -4, t, 2 in decreasing order. t, 2, -4 Let q = 19 + -15. Put q, 1, 2/9 in decreasing order. q, 1, 2/9 Let r be (-395)/(-15) + -3 - (-4)/6. Put 5, r, 3/5, -5 in ascending order. -5, 3/5, 5, r Suppose u = -2t + 3, -u = 4t - 0t - 1. Put -4, 1, u in decreasing order. u, 1, -4 Suppose 7x + 5 = 12x. Sort -4, -1, -30, x. -30, -4, -1, x Let j(v) = -v + 13. Let l be j(10). Put 2, -5, l in decreasing order. l, 2, -5 Let h(d) = 3d. Let g be h(-1). Let o be (-10)/6 + (-2)/g. Sort 4, o, -4. -4, o, 4 Let n(s) = -s*3 + 6s*2 - s + 5. Let l be n(6). Suppose 5c - 5d - 40 = 0, c - 3d = d + 23. Put -2, c, l in decreasing order. c, l, -2 Let n = -4.6 + 5. Let v = 60 - 62. Put -3, v, n in decreasing order. n, v, -3 Let f = -0.02 - 0.08. Let y be (-221)/6 - (-6)/(-3). Let w = y + 39. Put f, w, -3 in descending order. w, f, -3 Suppose 0 = 3h - 8h - k + 51, -3k - 56 = -4h. Sort h, 4, -2 in increasing order. -2, 4, h Let j = -7.7 - -8. Let v = 0.5 - j. Sort -2, v, -0.1 in descending order. v, -0.1, -2 Let b = -15 - -15.1. Put b, 1/4, -1/2 in descending order. 1/4, b, -1/2 Let s be (-24)/(-84) - 103/(-7). Let p be -2(s/(-18) - -1). Let b = 3.8 + -0.8. Sort p, b, 0. p, 0, b Suppose 5 = -2h - 5v, 5h - 19 - 15 = 3v. Suppose 3c - 22 = hc. Let n = c - -6. Sort n, 5, -1. n, -1, 5 Let j = -170 - -248.3. Let s = -85 + j. Let b = -7 - s. Sort b, -0.1, -3/5 in increasing order. -3/5, b, -0.1 Suppose -3c - 2i - 1 = 0, -1 = -c - 3i - 13. Put c, 1, 1/4 in descending order. c, 1, 1/4 Let v = 1 - 3. Let p be (v/2 - -2) + 4. Suppose -3g = 2j - 23, -pg = j + j - 33. Sort 0, -3, j. -3, 0, j Let m = -20 + 13. Let r = -7.6 - m. Let u = r - -0.2. Put 3, 0, u in ascending order. u, 0, 3 Let b = 26 + -30. Let k be ((-2)/b)/(2/(-4)). Let o be 20/(-6) - 2/3. Sort k, o, 4 in ascending order. o, k, 4 Let u = 0.5 - -0.1. Let h = -21 - -21.4. Sort h, u, -1/5 in increasing order. -1/5, h, u Let i = -21 - -16. Put -2, -3, i, 4 in decreasing order. 4, -2, -3, i Let w be (-32)/(-6) - (5 - 1). Let k = -0.7 + 1. Sort 3/5, w, k. k, 3/5, w Let h = 4 - 6. Let j be (h - 0)(-1)/14. Let s = j + -17/21. Sort -0.4, 2, s in decreasing order. 2, -0.4, s Let k = -3 + 3. Suppose -3y + 1 - 13 = k. Let p(n) = n2 + 11n + 10. Let b be p(-10). Sort y, 1, b. y, b, 1 Suppose 4g = g. Sort -3, g, 13 in descending order. 13, g, -3 Let b be 3 + (-4)/2 + 2. Let h = b - 3. Suppose 10 + h = -5r. Put -5, 1, r in descending order. 1, r, -5 Suppose -11q = -6q - 20. Put -1, q, -10 in increasing order. -10, -1, q Let c = 5.7 + -1.7. Put c, 0, 1/3, 10 in ascending order. 0, 1/3, c, 10 Let u be -1(-1 + 0 + 5). Let a be 2/(-4)u/(-6). Let z = -7.8 + 8. Sort 2, z, a in increasing order. a, z, 2 Let g = -3 - -3.4. Let l = 0.76 + -0.26. Put -2/7, g, l in increasing order. -2/7, g, l Let n = 133/156 - 4/39. Put n, 0.2, 4 in descending order. 4, n, 0.2 Suppose k - 96 = -3k. Suppose -h = h + 4j + 6, 4h = 4j - k. Sort h, -1, 0.1. h, -1, 0.1 Let h be 6/(-4)(-8)/3. Let s = 2 - 3. Put 5, s, h in decreasing order. 5, h, s Let f = 18 - 27. Let i = -11 - f. Sort 4, i, -3 in descending order. 4, i, -3 Let y(c) = -c3 + 9c*2 + 21c + 10. Let s be y(11). Let a = 2/49 - -37/294. Put s, a, 3 in decreasing order. 3, a, s Let p be 10/(-4)(-24)/15. Let c = -6 + p. Suppose 0 = -0v + v. Sort -1, c, v. c, -1, v Suppose 12 = -4b - 8. Put 5, b, -2, -4 in increasing order. b, -4, -2, 5 Let y = -2.562 + -0.348. Let o = 0.09 - y. Sort o, -0.1, 1/12 in descending order. o, 1/12, -0.1 Let k = -2 - -2.5. Let m be 1/6 + (-42)/36. Let c = m - 0. Put c, -3, k in decreasing order. k, c, -3 Suppose 0 = 6s - 3s + 54. Let r be 13/s - (-6)/12. Sort 0, r, 1 in decreasing order. 1, 0, r Let z(n) = 4n - 4. Let g be z(10). Let i = g + -75/2. Sort -1, 2, i in descending order. 2, -1, i Let c = 12 - 8. Put -5, -1, c in increasing order. -5, -1, c Let l = 38 - 42. Put 4, l, -1.8 in descending order. 4, -1.8, l Let k = -10 + 4. Let p = k - 0. Let a = p + 5.8. Sort a, -3, 0 in decreasing order. 0, a, -3 Let p(s) = 5s - 19. Let l be p(3). Sort l, -2, 1/2, -1/6. l, -2, -1/6, 1/2 Let l = -7 - -6.94. Let b = 24 - 23.5. Put b, l, -3 in descending order. b, l, -3 Let i = 26 - 21. Sort i, -2, -5 in decreasing order. i, -2, -5 Let y be (3 - 3) + 2/2. Sort -5, 3, y in decreasing order. 3, y, -5 Let d be -2 + (-50)/(-8)8/20. Sort d, 3/5, -4. -4, d, 3/5 Let h be (-2)/(-10) - (-4)/(-5). Sort h, -4, -0.4 in descending order. -0.4, h, -4 Suppose 2j + 2j = -8, a - 10 = 2*j.	{ "pile_set_name": "DM Mathematics" }
5/hh))/(h/(((h*10h)/h)/h)hhhh*(1/13)/hh) assuming h is positive. h(-100/117) Simplify ((k/k(3/8))/(k/k*(-9)k))/(k*(1/18)k/k(-3/7)) assuming k is positive. k(-5977/504) Simplify ((y*4y)/((y/(y/y(-2/9)))/y))/((y/(y/y(-11)))/((y(1/4)/y)/y)) assuming y is positive. y(557/36) Simplify (r2/(r(-1/19)/r))/(r*(-1/19)/(rr(-18/7))) assuming r is positive. r(204/133) Simplify ((z*(-3/10)/zz(zz/(((z/(z*(-5)/zz))/z)/z))/z)/((z/z*(1/7))/zz1))(6/25) assuming z is positive. z(-873/875) Simplify i/((i(-6/17)/i)/ii)ii((i(ii/(i*(-1/43)ii)i)/i)/iii)/ii(i/(ii(1/4)i))/((ii/(i/i(3/23)))/i) assuming i is positive. i(335975/67252) Simplify (uu6)(11/4)/(((uu(3/10)uu)/u)/u)(-31) assuming u is positive. u(1191/20) Simplify yy/(((yy2)/y)/y)yy/(yy/(y/y*17y)yy)y(-2/5)y((((yy(-1/12)/y)/y)/y)/y)/y assuming y is positive. y(-1169/60) Simplify (s3)6/(ss/(ss/s*(1/2)s)s)(-4/11) assuming s is positive. s(200/11) Simplify c/(c/(cc(ccc/(c3c)cc)/c))c(-2)/ccc/((c/(c(1/19)c))/c)ccc/(c/((c/(ccccc17c))/cc)) assuming c is positive. c(-322/19) Simplify (((uu*30)/u)/(u/(u/(((u/(uu*(11/8)))/u)/u)u)u))(-3/8) assuming u is positive. u(-801/64) Simplify ((z(-4)zz/(z(-7)/z))/(z(-11)/(z/(z/((z/z(-4))/zz)))))(1/16) assuming z is positive. z(11/8) Simplify o*(5/7)oo/(oo/(o*(2/17)o)o)(oo/(oo/(ooo*(-1/28)))o)(-4/9) assuming o is positive. o(-520/1071) Simplify ((b*(-3)b(-10))(-37))(2/131) assuming b is positive. b(962/131) Simplify q*11qq7qqq/q*1(q*(-1/5)q)/q assuming q is positive. q(104/5) Simplify (a10)(-4)/(a9)(-40) assuming a is positive. a320 Simplify (w(-2/13))48(w(1/10)www)/w(2/25) assuming w is positive. w(-2837/650) Simplify ((f/(f/(f/f3)))/f5)/(f*8f7) assuming f is positive. f(-22) Simplify (z(-2/3))31/(z(-2/7)/((z/z(-2/9)z)/z)) assuming z is positive. z(-1207/63) Simplify (((q/(q/((q2/q)/qqq)))(-1/39))(-10/11))(-33) assuming q is positive. q(-20/13) Simplify ii/i*(1/6)iii/i*(-2/11)ii((i/i*(1/4)ii)/i)/(i/i(-11)i) assuming i is positive. i*(-559/132) Simplify (q/(q(q/(q/((qq(1/8)q)/qq)))/q))(9/10)/(qq*(-4/3)qqq4) assuming q is positive. q(-1603/240) Simplify s(-1/10)/s(-2/43)(ss(-2))(-6/17) assuming s is positive. s(2189/7310) Simplify (s(-3)s/(s/(s6s)s)ss/s(2/13)s(5/3))(-7) assuming s is positive. s*(-1778/39) Simplify ((ll/l*(2/29))/l(l*4l)/l)/(l*(-12)/ll/(l/(l(-9/7)/l))) assuming l is positive. l(4104/203) Simplify (s0/s)/s(1/3)s(-2)s/s(1/10) assuming s is positive. s(-73/30) Simplify (k*(3/11)k(4/11))/(k(2/7))(-2/5) assuming k is positive. k(289/385) Simplify (jj(-11))21j*(-1/14)j(1/42)/j assuming j is positive. j(-4432/21) Simplify (j/(j*(-3/4)/j)j*(-22))/(jj(4/9))(-1/19) assuming j is positive. j*(-13115/684) Simplify (x/(xx*(6/5))xxx*(1/13)x)/(x/x*(-8/7)xxx*15xx) assuming x is positive. x(-8766/455) Simplify (vv*(6/7)v)*(-3/13)((v/v*(-5/9))/v)/(vv*(-2/17)v) assuming v is positive. v*(-27653/13923) Simplify (l/(l/(ll/(lll*8/ll))l)lll*(-7/4)l)/((l*(-5/3)l)/(ll(-8)l)) assuming l is positive. l*(-157/12) Simplify ((gg(ggg(-3/17))/g)22)(-49) assuming g is positive. g(-51744/17) Simplify (qq(4/11))(4/3)/(q/q(-7/3))(1/36) assuming q is positive. q(1025/594) Simplify ((o/(((o(1/19)o)/o)/o))/(o/(oo5)))/(o(-14)(oo*(7/3)o)/o) assuming o is positive. o*(1004/57) Simplify (y(y/y(17/2))/y)(1/19)/(y1)(29/2) assuming y is positive. y*(-283/19) Simplify (((n/(nn*(-1)))/((nn/n*1)/n))/((nn*(-4)/n)/(n/(nnnnn1nn))))(-3/13) assuming n is positive. n(3/13) Simplify (pp/((pp/p0p)/p)pp)*19((pp15)/pp)/(p/(p*(-2)/p)p) assuming p is positive. p49 Simplify ((a(1/14)a)/aaa10)/(a(-1/18)(a(-1/2)/a)/a) assuming a is positive. a(1717/126) Simplify ((x5/x)/(x20x))/(x(-2/15)/(x(-1/42)/x)) assuming x is positive. x(-3757/210) Simplify (a(-1/2))(-28)/(a(1/6)/(((a(5/4)a)/a)/a)) assuming a is positive. a(169/12) Simplify (((b/b(2/3))/(b/b(-3)))/((b(-5)/b)/b(-8)))46 assuming b is positive. b(-782/3) Simplify (r/r(2/9))/r*(-1)(((rr/(r(r*(-2/5)r)/rr))/r)/r)(2/19) assuming r is positive. r(1376/855) Simplify (t/t(-16))/t(-2)(t/(tt(-1/4)))(-1/24) assuming t is positive. t(1823/96) Simplify (a14a)*(-21)a*(-33)/aa/((aa/a(2/7))/aa) assuming a is positive. a*(-2448/7) Simplify ((((oo/o6)/o)/o4)/(oo(2/3)ooo)28)(-1/45) assuming o is positive. o(419/135) Simplify (c/c(-2)c)/(c(9/2)/c)(c/(c*3/c))/ccc/(c/c(4/11)c) assuming c is positive. c*(-25/22) Simplify (ss*(-3)s*(4/7))/(ss/(ss/(s(-15)s)s)s0) assuming s is positive. s(95/7) Simplify b(-2/19)/(b/b(5/2))(b/b(-5))(-1/34) assuming b is positive. b(787/646) Simplify (k3)(-4)((k/k(-2/3))/k)(-2/49) assuming k is positive. k*(-1768/147) Simplify gg/(g/(g*9g))gg/(gg(1/15))g*(-5)g(-4/5) assuming g is positive. g(92/15) Simplify (n5)(-11/3)((n/n(-6/13))/n)/(n/(nnn(-6)nn)) assuming n is positive. n(-814/39) Simplify l(-1)l(l(-25)l)/ll(-1/20)/(l/l(-5/2)) assuming l is positive. l(-571/20) Simplify (i(-1)i*(2/5)i(i(i/(i/i*0))/iii)(-26))(2/15) assuming i is positive. i(-172/25) Simplify (((zz/((z6/z)/z))/z12)(21/8))(41/5) assuming z is positive. z(-6027/20) Simplify (b(-2/11)b)35/((b(-9)/b)/(b/b(-13))) assuming b is positive. b(579/11) Simplify (s11s*(-7)(s(-1/6))(-40))(-9) assuming s is positive. s(-96) Simplify (u/(u/(uu/((u/(u/u(-2/33)u))/u)u)))/(u(-3)u)uu*(-2/25)/uuu/(u(-13)/u)uu assuming u is positive. u(20609/825) Simplify h(1/2)/hh*(-13)/hh*(-2)hh/(h(-4/11)/h) assuming h is positive. h(-289/22) Simplify ((((c21c)/c)/c)/(c(ccc/(((cc(c/(cc*(-27)))/cc)/c)/ccc))/cc))/(c(-2/23)ccc(-2/13)/c) assuming c is positive. c(13228/299) Simplify ((g*(1/6)/g)/gg*(3/8)/g)/(g/(gg(-2/7)/g))(-2/15) assuming g is positive. g*(-1921/840) Simplify (((dd*(-3)/dd)/(dd(d(3/2)/d)/d))43)(16/7) assuming d is positive. d(-344) Simplify xx1xx(-23)x*11x/(x(x(-22)x)/x)x assuming x is positive. x14 Simplify ((r/((r(-2/9)r)/r))/r)*19r/(rr/(rr/(rrr/(r/(r/r*(-3/5))r))))rr(-1/5) assuming r is positive. r(154/45) Simplify ((q*(1/2)/(q(qq/(q/(q/(q/q(-1/4)))q))/q))(-13))(-41) assuming q is positive. q(1599/4) Simplify (((j/j(-11))/(jjj/j*(-2/3)j))/((j*(-3)j)/jj)(-33))(-6/7) assuming j is positive. j(352/7) Simplify (((fff(-2/45)f)/f)/f)*(-12/13)(f31)17 assuming f is positive. f(102593/195) Simplify (z(-20/7)/z(-28))27 assuming z is positive. z(4752/7) Simplify (t(-7)/(tt3t))/(t(-4/5)/t)(4/9) assuming t is positive. t(-56/5) Simplify (l(2/29))*7l/((ll/(lll5l)llll)/l)lll15 assuming l is positive. l(623/29) Simplify ((y(-4/13)y)/((y(1/3)/y)/y))9 assuming y is positive. y(276/13) Simplify (n(-11)/n(-6))/(n(-1/6)/((n/n*(2/15))/nn)) assuming n is positive. n(-119/30) Simplify k(2/5)/(k/(k/(k*5/k)))(k/(k*(-26)k))/k(-8/11) assuming k is positive. k(1272/55) Simplify (g4/g(-2/11)(g/g(1/5)g)/ggg(1/5))42 assuming g is positive. g*(2856/11) Simplify (((kk/(kk/(k(19/4)k)))/k)/((k/(((kkk*27kk)/k)/kkk))/k))/(k(5/8)/(kk*(-1/7)k)) assuming k is positive. k(2071/56) Simplify (c(-2/21)cc*(-6)c(ccc(2/15))/c(-2/9))(-5/17) assuming c is positive. c(548/1071) Simplify (((o10oo)/oooo(-1/6))/((o/(o(-2/13)/oo)o)/o(1/9)))12 assuming o is positive. o(5050/39) Simplify (((t/(t0t))(2/69))(-1/52))(-15) assuming t is positive. 1 Simplify (q(2/11)q)*21(q(-3))(1/5) assuming q is positive. q(1332/55) Simplify q8q/(q15q)q(1/11)/(qq(5/9)) assuming q is positive. q(-838/99) Simplify (p*32p	{ "pile_set_name": "DM Mathematics" }
-1 + 2)/(g/(-16)) a multiple of 8? True Suppose -i + 2i = 0. Suppose 5m + j - 73 = i, 5j = 10 + 5. Is m a multiple of 10? False Let w be (-4)/18 - 332/(-36). Let j be ((-6)/4)/(w/48). Let h(f) = -f + 6. Is 14 a factor of h(j)? True Let o(w) = -w3 + 9w*2 + 3w - 12. Does 7 divide o(9)? False Suppose 0 = -2g - 18 + 142. Suppose -f - f + 58 = 0. Let t = g - f. Does 13 divide t? False Suppose 1 - 10 = -3x. Suppose 0 = xo - 0v - 5v - 31, 0 = -5o + 3v + 25. Is 15 a factor of 32/2 + (o - 3)? True Let q(t) = 1 + 6t - 6 + 2. Suppose -9 = -3s + n + 9, 5n + 30 = 3s. Does 21 divide q(s)? False Suppose -4b = -11b + 1358. Is 42 a factor of b? False Suppose -6z = -81 - 261. Let w be (2/4 - 1)-6. Is 25 a factor of ((-6)/(-2))/w + z? False Suppose 2 = 5g - 3. Let l = g - -26. Is l a multiple of 9? True Let x(i) = 4i2 + 3i + 1. Let j be x(-5). Let r = j - 26. Is r a multiple of 20? True Suppose 14 = -2a + 44. Is a a multiple of 3? True Suppose -5z - 7 = 2r - 0z, -2z + 6 = 3r. Suppose -5c + 37 = 3l, rc + l - 12 = 3l. Is c a multiple of 4? False Let x(w) = 4w2 + 2w - 3. Let k = 5 - 3. Is 8 a factor of x(k)? False Let f(s) = -74s3 + 2s*2 + s. Is 5 a factor of f(-1)? True Let u(k) = -2k - 7. Let i be u(-4). Let y = i - -8. Is y a multiple of 3? True Let c(a) = -a. Let d be c(-3). Suppose -2i = 2i - 16, dj = 2i + 70. Does 9 divide j? False Suppose -20 = -4v, -2g = 3g - 3v + 20. Let h(m) = m + 1. Let p be h(-4). Is 10 a factor of (-320)/(-15) - g/p? False Suppose -v + 13 = -4. Does 4 divide v? False Let g = 1 - -4. Suppose 0k - 25 = -gk. Is k a multiple of 3? False Let p(w) = -2w - 1. Let m(u) = 2u. Let k(c) = 4m(c) + 5p(c). Is 7 a factor of k(-7)? False Suppose 3r + 200 = 8r. Let w = 90 - r. Suppose -w = -4s + 2s. Is 14 a factor of s? False Let w(h) = 3h2 + 2h - 5. Is 15 a factor of w(-4)? False Let f = 108 + -41. Suppose 0 = -3t + 95 + f. Suppose -2k + t = -2i, 0k - 2k = 2i - 74. Is k a multiple of 23? False Suppose -3b = -4b + 4. Let f(d) = d*2 + 6d - 2. Is f(b) a multiple of 19? True Let y(g) be the first derivative of -4g2 - 2g + 3. Is y(-5) a multiple of 14? False Let k = -208 - -417. Suppose 4v - 11 = k. Does 21 divide v? False Suppose -4p = -9p + 1795. Is 53 a factor of p? False Let q = 152 - 74. Does 14 divide (q/(-21))/((-2)/14)? False Let t(q) be the first derivative of q4/4 + 11q*3/3 - 15q*2/2 - 6q + 3. Let j be t(-12). Let x = -15 + j. Is 15 a factor of x? True Let r = -1 - -3. Let i(n) = 2 - n2 - 3 - nr - n3. Is i(-3) a multiple of 5? False Let x(w) = w2 - 7w - 2. Let n be x(7). Let m be (2 - n) + -2 - 0. Suppose 2d = 5y - 32 + 7, 4y - md - 20 = 0. Is 3 a factor of y? False Suppose n + 2q = q + 88, 0 = -q - 2. Suppose m - n = -m. Is m a multiple of 15? True Suppose 0 = -a + 3a - 16. Is 8 a factor of a? True Let o = -15 + 11. Let a be 10/5o/(-2). Suppose x + 4c + 0c = 16, -ax = 2c - 106. Is x a multiple of 11? False Suppose -6 = 4z - 2. Does 3 divide (12/(-30))/(z/25)? False Let v = 4 - -2. Let x(l) = l - 2. Let w be x(v). Suppose 3z = d + 4d + 81, -z + 10 = wd. Is 11 a factor of z? True Let d be (-6)/(-8) + 7/(-4). Let y(m) = -5m. Let c be y(d). Let l = 21 + c. Does 12 divide l? False Let p(n) = n3 + 10n*2 - 5n - 8. Is p(-5) a multiple of 4? False Let u = 16 - 13. Suppose -w = uw - 184. Is 23 a factor of w? True Suppose -647 - 331 = -6y. Does 18 divide y? False Let n(r) = -r*2 - 4r + 4. Let f be n(-4). Suppose 2g - 2x = -f + 18, -4g = 5x - 10. Does 5 divide g? True Let b(f) = f*3 + 9f*2 + 2f - 11. Is b(-5) a multiple of 16? False Suppose 0 = 5o - 5 + 35. Let i(h) = -h2 - 9h. Let k be i(o). Suppose 0 = j + a - 10, 2j = -4a + k + 6. Does 5 divide j? False Does 46 divide (10 + -5 + -12)-46? True Suppose -2b = -z - 0b + 17, 42 = 2z - 2b. Suppose z = 2h - 59. Is 19 a factor of h? False Let q = 4 - 1. Suppose 3p - 3 = r, -qr + 2p - 2 = -2r. Suppose 5g - 48 - 2 = r. Does 6 divide g? False Suppose -138 = -6u + 282. Does 9 divide u? False Let u = -6 + 10. Suppose -uc - 2l = c - 34, -5c + 38 = 4l. Does 5 divide c? False Let d(v) be the third derivative of 2v2 - 1/12v*4 + 0 + 5/6v*3 + 0v. Does 13 divide d(-5)? False Let s(a) = 70a - 1. Suppose -u + 2 = u. Is 20 a factor of s(u)? False Suppose -2n - 48 - 24 = -5s, s - 17 = 3n. Let t(o) = -o*2 - 6o - 5. Let b be t(-5). Suppose g + 4 - s = b. Does 5 divide g? True Suppose 37 = g + 2f, 3f = -0f + 6. Is 20 a factor of 2/11 + 1974/g? True Let i be -3((-12)/(-9))/(-1). Suppose 4 + i = 2v. Suppose -2y - 7w + 59 = -4w, -vy - 3w + 133 = 0. Does 17 divide y? False Let y(j) = -2j - 7j*2 + 19j*2 + j. Is 18 a factor of y(2)? False Let d be (-9)/(-3) - 5 - -3522. Suppose 3g + b = -2650, -g - 4b - d = 3g. Does 13 divide g/(-35) - (-4)/(-14)? False Suppose 5c = -0c. Suppose -k + 0k + 25 = c. Suppose -5m + k = -3z - 6, -1 = -m - 2z. Is 3 a factor of m? False Let j = -5 - -15. Suppose -5t = -j - 40. Is 5 a factor of t? True Suppose 11 = 3f - 4n + 4, 5n = 10. Is f even? False Suppose k = -2k + 96. Let y be k/12 + 4/(-6). Does 8 divide 22 + 0 + -4 + y? False Suppose -5d - 3q = -279, 0q + 238 = 4d - 5q. Is 14 a factor of 1/(-4) + d/4? True Let v = -42 + 89. Suppose 5l - 4g - v = 0, 2l + 7g = 3g + 30. Let o = 19 - l. Is 5 a factor of o? False Let z(v) = -2v*2 - 46v - 28. Does 4 divide z(-22)? True Suppose 2l + 43 + 128 = -3w, -4l = -2w + 302. Let d = -51 - l. Is d a multiple of 8? False Suppose 3z = 18 + 30. Is z a multiple of 8? True Let g(k) = -k + 1. Let z be g(4). Let v = -4 - -6. Let b = v - z. Does 5 divide b? True Does 9 divide 5((-9)/(-15))/(15/530)? False Suppose 2o = 6, -4o + 68 = 3y + y. Is 14 a factor of y? True Let o(l) = l + 10. Let v be o(-17). Let z(a) = -a2 - 8a + 9. Does 8 divide z(v)? True Let g = 45 + -25. Does 4 divide g? True Let v = -74 + 115. Let q = v - 24. Let k = q + -5. Does 12 divide k? True Suppose -3y = -2a + 187, -4a + 489 = y + 80. Is a a multiple of 11? False Let j = 964 - 664. Suppose -3v - j = -5v. Suppose 0 = 7x - 2x - v. Is x a multiple of 15? True Let s be 0 - (-5 - (-2)/1). Suppose -3o = -h - 84, -o + 28 = 2h + sh. Let r = o - 16. Is r a multiple of 6? True Let a(u) = u*3 - 6u*2 + 2u. Let i be a(6). Let r = -7 + i. Suppose -h - 2k = -29, -rh - 4k = -k - 131. Is h a multiple of 9? False Does 12 divide (15 - 0) + 2 + -3? False Suppose -64 = -5g - 24. Suppose 0 = -3y - g - 4. Is 3 a factor of (y - 1)(-8)/10? False Suppose -2 - 8 = -5y. Suppose -3t - t = -4u - 40, yt + 2u - 4 = 0. Does 6 divide t? True Let j = -42 + 75. Is j a multiple of 26? False Let p(s) = s3 - 4s*2 - 7s - 3. Let k be p(6). Suppose -43 = -5d + k. Does 14 divide d? True Suppose 4f = -0f + 80. Is f a multiple of 4? True Let z(j) = -8 + 3j*2 - 9j - 4j2 - 1. Let a be z(-6). Suppose -a = -3g, 3k + g + g = 54. Is 11 a factor of k? False Let a(j) = j2 - j. Let c be a(2). Suppose -33 - 11 = -cp. Is p a multiple of 11? True Let y = -2 - 7. Let d be (-1 - -2) + y/(-3). Does 2 divide ((-6)/d)/((-6)/12)? False Let a(y) = -7y2 + 4y + y3 + y2 + 0y2 + 4. Does 8 divide a(6)? False Let o(p) = 3p*2 - p + 5. Does 3 divide o(-3)? False Suppose -4y + 25 = y. Suppose -3b + 0p + 210 = 2p, -yp - 231 = -3b. Is 17 a factor of b? False Let n(u) = -4u*2 - 11u. Let f(p) = 5p2 + 11p. Let z(l) = -5f(l) - 6n(l). Is z(6) a multiple of 15? True Let l be ((-68)/(-6))/((-3)/9). Let r = l + 59. Is 25 a factor of r? True Suppose 6a - 395 = a. Let o = 56 - a. Does 9 divide o(2 + -1 + -2)? False Does 33 divide (26/(-8))/(3/(204-1))? False Suppose -4x + d + 11 = 0, x - 3 + 7 = -2d. Suppose -xy + 103 = -17. Suppose m - y = -m. Is 15 a factor of m? True Let o(f) = -f*2 + 7f - 5. Suppose -5i + 1 = -14. Suppose -il - 2z = -0z - 11, 3z = -6. Does 4 divide o(l)? False Let u(p) = -16p*3 - 61p*2 + 66p - 26. Let v(m) = 3m3 + 12m*2 - 13m + 5. Let r(j) = 2u(j) + 11v(j). Does 3 divide r(-11)? True Let x = -122 - -1. Does 15 divide (-22)/x - 493/(-11)? True Suppose 0 = 3b - b. Suppose bq - 2q - 6 = 0, 4u - 4q = 16. Does 16 divide 14 - u-2*1? True Suppose f	{ "pile_set_name": "DM Mathematics" }
u))(u/(u(-4)/u)uuuuu/(uu(3/5))u)4 assuming u is positive. u(846/35) Simplify (v(vv*(-1/3)v)/vv(-2/5))/(v(-2/7))3v(1/2)/v(-1/7)(v1/vv)9 assuming v is positive. v(353/30) Simplify (r/(r*20r)r/(r(-27)rr))/(r(-13/2)/(rr/(r/((r/r*(-1/25)r)/rr)))) assuming r is positive. r(777/50) Simplify ((mm(-1/5))(2/35)/(m(-4))(1/23))43 assuming m is positive. m(38012/4025) Simplify (l*(-1/5)lll/((l/(ll(-8)l))/l))/(l(ll/l2)/l)(29/5)((ll/(l(1/7)/l))/(l(-2/3)/l))(-2/53) assuming l is positive. l(-18758/5565) Simplify (((bbb*(4/13)b)/b)/(b/(bb12))bb/b(-1/7)bbb(-8/7))(6/13) assuming b is positive. b(1350/169) Simplify (k(-1/3))*(-38)/(kk0/k)(-29)(k1)(-2/51)/(k(1/2))(27/5) assuming k is positive. k(5063/510) Simplify (m10m(-1/2))(-39)/(m(2/13)/((m/(m/(m/m(1/5)m)))/m)m/m*(-6)m/(mmm(2/3))) assuming m is positive. m(-146323/390) Simplify ((y/y(-2/25))/y(-3))/((yy/y0)/y)(-29/5)(yy/(yyy(-7)/yy)yy/y(2/7))20 assuming y is positive. y(32229/175) Simplify (n(-25)n(-4/13))/(nn(n/n11)/n)(-4/23) assuming n is positive. n(-8035/299) Simplify (v18v*(-4/3)(v(4/13)/v)/(v/v(-16)v))39 assuming v is positive. v(-79) Simplify (g(-2/77)/gg(2/17))/(((g/g(14/5))/g)/g(-8/5)) assuming g is positive. g(1909/6545) Simplify (((y*(-6)/(yyy(-1/8)))(-3/20))14)26 assuming y is positive. y(17199/40) Simplify ((v(-1/3)/vvv(1/3)v)/((v/(v/v*19)v)/(v(-9/7)/v)))(-41) assuming v is positive. v*(6109/7) Simplify (nn*(-2/19)n*(-2/7)nnn*(-3/7)nn(-2/3))/(n6nn0nnn*(-1/4)nn/n7) assuming n is positive. n(-1973/1596) Simplify ((g/g(-1))(-8)/(gg*(-1/4)g)*(4/21))/((g/(gg*(-4)))/((gg/g*(-3))/g)(ggg(-2/5)/g)(-3/17)) assuming g is positive. g(-4138/255) Simplify ((w(5/4)w)/w)6w*44/((ww*(-23/4)ww)/w) assuming w is positive. w(221/4) Simplify (a17aa(3/17)(a*4a)14)(7/9) assuming a is positive. a(10493/153) Simplify ((b(-15)/(bb(-2/23)))/((b/(b/(b/b(-6/13))))/bbb(-3/11)))(-18) assuming b is positive. b(1012464/3289) Simplify ((l/(l/(l(3/13)l)))/l(-14))(4/13)((l/(l4/l))(-2))(2/31) assuming l is positive. l(25904/5239) Simplify (w(w/w*(4/7))/wwww(-16))/((((w/w20ww)/w)/w)/(w/w*(1/37)www)) assuming w is positive. w(2435/259) Simplify i/i(1/7)ii*(-1)((i/i*(-3))/ii)/i(ii/(ii/(i/(i(ii4)/i))))/ii(2/13)/i(-3/5)i(-5)ii/(ii*0i) assuming i is positive. i*(-2452/455) Simplify uu*(1/5)uu/u3(u(-2/3))(-14)(u/(u(-1/5)/u)u/((uu(-6))/u))(19/3) assuming u is positive. u(339/5) Simplify m35/(m/m(1/7))(mm(3/22))/((m/(m(-22)m))/m) assuming m is positive. m*(2199/154) Simplify ((hhh/h(3/11)h)/h(-4))/(h0)*(-9)h/h*(-8)h/h*7h(h(-2/7)/h)5 assuming h is positive. h(408/77) Simplify (b/b(-2/13))/(bb*(-4/7)b)(bb/b(-1/5))/b(1/2)(b/b(4/9))/b(b(b(2/5)b)/b)/b(b(2/7))(-5/4) assuming b is positive. b(4192/4095) Simplify (((p/p(-1))/p)(-1/59)/((p(-1)p)/(p/(p/p(-2/11)))))/((p/p(-7))/(pp/p4))(8/19) assuming p is positive. p(-54371/12331) Simplify (w7/(((w/(w/w3)w)/w)/w))/(w/w*(1/2)w(w/w(-4))/w)(w*(5/4)w/(ww(-1/14))ww)/(w(-2)/w(6/7)) assuming w is positive. w(159/28) Simplify ((v/(v/(v/(v(3/7)/v)))v(-5))/(v(-1/3)/((v*(-5)v)/v)))/(v/((v/(v/(v/v*2)))/v)v*15v)(4/25) assuming v is positive. v(-5846/525) Simplify ((ff/((f(f/(f/f*(-11/5)ff))/f)/f)fff((f/((f(-3)f)/ff))/f)/f)/(ff*(-7)f13))14 assuming f is positive. f(294/5) Simplify ((w/(w2w))22w(w/(w/((w/(w(1/5)/w))/ww)))/ww/(wwww(-1/4)))/(w0www(-6)ww(-6)ww4w) assuming w is positive. w*(-819/20) Simplify ((fff12/f)(-46)f(-21)/(f(-12)f))(-49) assuming f is positive. f29792 Simplify (p(-4)/p)/(p/p(-5))(p/(p/(p2/p)))/p(1/3)((ppp0)(1/4))(1/23) assuming p is positive. p(-1423/138) Simplify ((o/(o/((o/((oo*(-2/9)oo)/o)o)/o)))/o((oo*(-9)o)/o)/o)34/(((o/(o(-1/6)/o)o)/((oo2)/o))/(o(-1))12) assuming o is positive. o(-6833/18) Simplify (g(-1))(1/7)/((g/g5)/(g/(g/(g(-2/19)/g))gg))(g3g(-1/10))/(g/g(2/3))(6/35) assuming g is positive. g(1443/190) Simplify ((w*(-33)w)/w(-2/75))/(w/(w/w(-11/3))w(4/3)/w) assuming w is positive. w(-716/25) Simplify (x(-1))(-21/4)/(x1/x(2/7))((xxxxx/x*(-1/2))/x(xxx(x/(xx*(-6)x))/xx)/x)(-12) assuming x is positive. x(-3737/28) Simplify (i(-2/19)i/(i6/i))(2/81)/(((i/(i/i*0))/ii)(4/5))24 assuming i is positive. i*(-52/513) Simplify (z/(zz*(1/6)/z)z*(-1/7)(zz/(z(-7)z))/z*6)/((zz/(z/z*(1/3))z)*(2/27)/(zzzz/z(-2/7))(-2/35)) assuming z is positive. z(18041/7938) Simplify (b0(bb*(1/4))/b)/((bb*(1/2)b)/bbb*(-3/7))((b/(b*(-2)b))/b((b(-3)/b)/b)/b)/(b(1/4))(2/31) assuming b is positive. b(-5935/868) Simplify ((u(1/2))(-3/25)u/(u/u*(-5))u(-1)/u)/((u(-2/7))*(-46)(u/(((uu/u(2/5))/u)/u)u)/((u/(u/u*(-2/3)))/uuuu)) assuming u is positive. u(-22333/1050) Simplify c(-44/3)ccc(c/(c*(1/60)c))/c(cc*(-30)c)/((c/c6)/c) assuming c is positive. c(-2081/60) Simplify ((v*1vv)36/((vv*(-1)v)/(v/(v*(1/2)v))))/((v/((v/(((v/v(-1))/v)/v))/v))(-25)(v(1/11)v)/(v*(-2/3)vv)) assuming v is positive. v(8695/66) Simplify (b/(b/(b/(b/b(4/3))b))b(1/5)/b)(-37)((b/(b/b(1/2)))(-1/2))(-7) assuming b is positive. b(-3299/60) Simplify ((x*(-2/33)x*(-20)/xx)/((x*(-1/15)x)/x(1/6)))(-24/7) assuming x is positive. x(27492/385) Simplify (((b(-1))*(-4)(b/((b/(b*(-1/2)b))/b)b)(-1/14))(-7/6))43 assuming b is positive. b(-4601/24) Simplify (h(2/3))(-8/15)h(hh/(hhh*5h)h)/hhh/(hhh(h*(-1/13)/h)/h)hhh*(1/3)hh5/hh*7h/(h*(-9)h) assuming h is positive. h(11147/585) Simplify (a(-2/17)aa/a*(4/3)a)*44((aa/a7)/aa(-3))/(a(2/9))(-1/5) assuming a is positive. a(45289/765) Simplify (f*(-1)/f)/(ff*8f)((ff*(-1)ff)/f)(2/95)(f/(f(ff/f(-1))/f))(-45)(f(-1/4))(3/8) assuming f is positive. f(236899/3040) Simplify ((yy*(-37)y)/yyy*(3/16)(y/(y/y*(-21)))/(yy(-5/4)))(2/5) assuming y is positive. y(-889/40) Simplify (v19(vv*6)/vvv((v/v*7)/v)/vvvvv21v)(-2/49) assuming v is positive. v(-88/49) Simplify ((g*6gg)/(gg(-2/3)/g))(-40)/((g/g(-1/4))/g(2/15))(-25/3) assuming g is positive. g(-12145/36) Simplify (((vvv(-1/4))/(v2v))/(vv/v(-1/5))(11/6))24 assuming v is positive. v(-634/5) Simplify ((xx(-2/3))(-1/6))(-21)(x/(x/(xx0/x)))(-7/9)(x*(-2)/x)/((xx/((x(-2/5)/x)/x))/x) assuming x is positive. x(-157/30) Simplify ((f(2/5))(-2/11))45/((f0)(1/10))(-5/3) assuming f is positive. f*(-36/11) Simplify ((a/((a(aa/a(3/4)a)/a)/a)aaaa(-1/2))/(a(-1))20)/((a1)*(-47)(aa/a(-7)a)/(a/(a/(a*0a)))) assuming a is positive. a*(241/4) Simplify ((hh*(4/3)h*(4/3)(hhh(-2/5))(-28))(13/5))(4/23) assuming h is positive. h*(-32084/1725) Simplify ((ii*(-1))/ii)(-2/31)/(i(1/4)/((i/i*(-3/8)i)/ii))((i/(ii(-1/2)))/i)(-2)(i2)(22/3) assuming i is positive. i*(427/24) Simplify qqq/q(-1/3)qq(q*(-42)/q)/qq(3/19)/(q21qq) assuming q is positive. q*(-3506/57) Simplify (ll0)(-1/63)/(l*(-32)ll/(l/((((l(-11)/l)/l)/l)/l))) assuming l is positive. l(2897/63) Simplify ((zz/(z*(-1/11)z)z)/(zz(-10)))(-40)/((z2)(-32))(9/8) assuming z is positive. z(-4088/11) Simplify ((t(-5/4)/t)/t(-2/9))*(-47)(t0)48(t(-6)tt)/((t/(t/(tt*(3/5)t)t))/t) assuming t is positive. t(16327/180) Simplify ((g1)(2/59)((g/((ggg*(1/3))/g))/g)/(gg(1/6)))(-46) assuming g is positive. g(6693/59) Simplify b(2/15)/b*(2/3)(b/b*(-1))/bbb(-1/15)(b*(-4)/bb*(-1)bb)(-2/3) assuming b is positive. b(61/15) Simplify (((s/(ss1))/s1)/((s*0s)/(s*(6/5)s)))/((s/(s/(s(-1/4)/s)))(1/2)	{ "pile_set_name": "DM Mathematics" }
t(242)-1)) + 5. 275sqrt(3) Simplify -6(((-3(sqrt(200) + sqrt(200) + 2 - sqrt(200)))2 + (sqrt(200) - ((sqrt(200) + -1)2 - sqrt(200))3))-4 + -4)1. 11040sqrt(2) + 29616 Simplify 1 + (5((1 + sqrt(700) - sqrt(700))-1 - (-1(sqrt(700) + -2 + sqrt(700)) + sqrt(700)))-2)*2. -6000sqrt(7) + 70901 Simplify 1 + sqrt(104)/((-3sqrt(88))/sqrt(11) - sqrt(8)) + (sqrt(117)/sqrt(9) + -3 + sqrt(13) - (sqrt(1300) + (-2sqrt(1300) - sqrt(1300))*2 - sqrt(13))). -11702 - 29sqrt(13)/4 Simplify ((5(sqrt(187) - sqrt(187)-3)-5)/(sqrt(99)/(sqrt(9) + sqrt(9) + -6sqrt(36))))*2. 17000000 Simplify ((-4((-6(sqrt(95) - -2sqrt(95) - sqrt(95)) - sqrt(95)) + sqrt(95) - sqrt(95) - sqrt(95))-1)/(sqrt(225)/(sqrt(500)-3)))*2. 5958400 Simplify -1 + 2 + (((sqrt(288)-4)/sqrt(8))/(sqrt(12) + sqrt(528)/sqrt(11)))*2 + 0. 19/3 Simplify -5 + -541(sqrt(396) - (sqrt(396) - (2(-5 + sqrt(396)) + sqrt(396))))2. -720sqrt(11) + 395 Simplify ((-3(sqrt(252) + 1) + sqrt(252) + 3 + 2sqrt(252) - (sqrt(252) + -6(-1 + sqrt(252) - sqrt(252)) + 2))2)2. 384sqrt(7) + 1264 Simplify -2 + -5(sqrt(441)/sqrt(225))/(sqrt(7) + (sqrt(567) - sqrt(63))) + -3 + 3. -2 - sqrt(7)/7 Simplify 5((-4(sqrt(121)3 + sqrt(121)))/sqrt(11))*2 - ((sqrt(22) - sqrt(66)/sqrt(3) - sqrt(22))-6 + sqrt(22))/(sqrt(24)/(-2sqrt(12))). 14sqrt(11) + 14080 Simplify ((-14(-1 + sqrt(98)))*2 + (sqrt(8) + 1 + 2)-2)5. -1140sqrt(2) + 7890 Simplify (-2(sqrt(35) + (-2sqrt(5040) - sqrt(35)))/sqrt(5) - 2-2sqrt(63)6)21. 100800 Simplify ((-4(sqrt(130)-2 - sqrt(130))-1)/((61sqrt(80))/sqrt(8)) + 0)-2-2 + 0. -8sqrt(13) Simplify (((sqrt(140) - 2sqrt(140))1 - 2(sqrt(140) - (sqrt(140) + sqrt(140)-2)))/(24(sqrt(1008) - sqrt(1008)-2)))2. 125/20736 Simplify (-44(sqrt(20) - (-2sqrt(100) + sqrt(100) - sqrt(100) - sqrt(100))/sqrt(5)))/(-2sqrt(160)-46). -sqrt(2)/3 Simplify ((sqrt(625) + sqrt(625)1 + sqrt(625))-1-5)/((sqrt(540)6)/((sqrt(108) - (sqrt(108) - 3sqrt(108)))/sqrt(9))). 25sqrt(5)/2 Simplify ((1 + (sqrt(180) - (sqrt(180) - (-1 + sqrt(180) + 5) - sqrt(180)) - (3 + -1sqrt(180))))2-2)*2. 1152sqrt(5) + 25984 Simplify 5 + ((-2 + sqrt(343) + sqrt(343) + (-1sqrt(343) + sqrt(343) - sqrt(343)) + sqrt(343))-1 - (sqrt(252)/sqrt(3))/(sqrt(363) + -2sqrt(363)))2. -608sqrt(7)/11 + 162817/121 Simplify (sqrt(400)/(sqrt(20)/sqrt(2)) + (2sqrt(160) - sqrt(40)))/((sqrt(288) - 12sqrt(288) - sqrt(288))/sqrt(9)) + -1. -sqrt(5) - 1 Simplify (0 + -5(0 + (sqrt(833) - 5((sqrt(833) - (sqrt(833) + -1sqrt(833) + sqrt(833) + sqrt(833))) + sqrt(833))) + 0)-3)2. 187425 Simplify (-1((0 + 64sqrt(882))-6 + -2) + 1)2. 18144sqrt(2) + 18289161 Simplify ((sqrt(143)3)/sqrt(11) + ((sqrt(91)3)/sqrt(7) - sqrt(13)))*2 + -3((-2 + sqrt(13) + 4)*2 + -3). -12sqrt(13) + 283 Simplify ((sqrt(468) + -1)4 + -5 + ((sqrt(104) + sqrt(104)2)-6 + sqrt(104))/(sqrt(24)/sqrt(12)))26. 1080sqrt(13) + 8286 Simplify 4 + -4 + -2(3 + (2sqrt(931) + 4)2)-3. 672sqrt(19) + 22458 Simplify (-4 + (sqrt(6)/sqrt(3))2 - ((sqrt(288) + -2)2 + sqrt(288)) - (-4 + 3 + sqrt(162)))61. -1758 + 162sqrt(2) Simplify ((sqrt(1400)3 + (sqrt(14) - sqrt(896)-3))/((sqrt(288) + (sqrt(288) + sqrt(288)-2 - sqrt(288))-5)-1))2. 175/144 Simplify (((sqrt(84)1 - sqrt(84))/sqrt(3) - sqrt(280)/(sqrt(40)/sqrt(4)))-3)/(((sqrt(128) + sqrt(8))/sqrt(2) - (sqrt(36)-2)/sqrt(9))-4). -3sqrt(7)/28 Simplify (4(1 + (4sqrt(400)-1)/(sqrt(8) - (sqrt(80) - -1sqrt(80))/sqrt(10))))*2. 640sqrt(2) + 12816 Simplify (6(sqrt(275) - (sqrt(275) + 2)))2 + 1 + (sqrt(275)-1 + sqrt(275) + sqrt(275))*2 + -2 + -3(sqrt(275)-5 + 2 + -3)2. -20210 - 150sqrt(11) Simplify (-2 + sqrt(684)226)2 + sqrt(209)/((sqrt(121) + (sqrt(121) - (sqrt(121) + sqrt(121)-1)))/sqrt(11)) + -6(sqrt(171) + 1)2. -1223sqrt(19)/2 + 392956 Simplify (1 + 2(6(sqrt(117) + 4 + sqrt(117)) + 2sqrt(117)-5 + sqrt(117)))*2. 1764sqrt(13) + 6613 Simplify -5((sqrt(76) - sqrt(76)1 - sqrt(76))*2-3 + 1 - -3(sqrt(76) + -1 + sqrt(76) + -4 + sqrt(76))). -90sqrt(19) + 1210 Simplify ((-4 + (sqrt(1053) - (sqrt(1053) - ((-2sqrt(1053) - sqrt(1053)) + -5))) + -5 + 5 + sqrt(1053)-1 + -1)5 + 2)2. 17280sqrt(13) + 423504 Simplify (5sqrt(250)/(sqrt(40)/sqrt(2)))/(-3(sqrt(160) - -2sqrt(160) - (sqrt(810) + sqrt(810)1))). 5sqrt(5)/36 Simplify -4 + ((0 + 1 + sqrt(500) - -4((sqrt(500) - (-1 + sqrt(500))) + sqrt(500)))3)2 + -1 + 5. 4500sqrt(5) + 112725 Simplify (sqrt(210)/(sqrt(35)/sqrt(7)) + sqrt(168)/(sqrt(4)-1) + sqrt(42))/(sqrt(36)/(-2sqrt(54))6). -sqrt(7) Simplify ((53sqrt(228) - (sqrt(228) - sqrt(228)2-6 - sqrt(228)))/(4(-6sqrt(48) - sqrt(108)2)))*2. 19/576 Simplify ((-3sqrt(825) + sqrt(825) + sqrt(33))/((-1sqrt(88))/sqrt(8)) - 5((sqrt(432) + -1 - sqrt(432) - sqrt(432) - sqrt(432) - sqrt(432)) + -1 + -3))*2. 9450sqrt(3) + 107788 Simplify (((sqrt(153) - (sqrt(153) - -1sqrt(153)))-2 - -4(sqrt(153)2 - sqrt(153)))/((sqrt(108)13)/(-5sqrt(24)/sqrt(2))))2. 1700 Simplify (3 + (sqrt(147) - (-1 + sqrt(147) + 4) - ((sqrt(147) - (sqrt(147) - (sqrt(147) + 0))) + -5)) + 1 + 3)2 + -2. -126sqrt(3) + 226 Simplify -1 + (3((sqrt(2000) - (sqrt(2000) - (1 + sqrt(2000) + -1 + sqrt(2000)))) + -2 + -1(3 + sqrt(2000)-1 - sqrt(2000))))2. -7200sqrt(5) + 288224 Simplify (-5 + sqrt(242) + 2)*2 + -2 + -1 + sqrt(242) + -6-4-2(sqrt(2) + sqrt(8))3. -487sqrt(2) + 248 Simplify ((sqrt(9) - -5sqrt(63)/sqrt(7))/(sqrt(3) + sqrt(48)) + (sqrt(432) + sqrt(3))-1 + sqrt(30)/(sqrt(1210) + 2sqrt(1210)))2. 3771364/9075 Simplify (-1 + (-3sqrt(1216)3 - sqrt(1216)) + -5 + (sqrt(1216) + -2 + -3)-6)*2. -6144sqrt(19) + 311872 Simplify (1(3 + -3 + sqrt(25)/(sqrt(5)-2) + 2(4 + sqrt(5)1 + sqrt(5))2))2. 240sqrt(5) + 2149/4 Simplify 1 + 5(-1 + sqrt(192) + -1 - (sqrt(192)3 + -2 - sqrt(192)))*2. 961 Simplify (sqrt(22) - (sqrt(352)-2 - sqrt(352)))/(sqrt(22)/(sqrt(33)/sqrt(3))) - (sqrt(110)/(1sqrt(10)) - (2sqrt(44))/sqrt(4)). 14sqrt(11) Simplify ((((sqrt(160) + (sqrt(160) - 3sqrt(160)) + sqrt(160) + sqrt(160) - sqrt(160))-1)/sqrt(5))/(sqrt(36) + 1sqrt(324)))*2. 0 Simplify -3(-1(sqrt(480) - 1sqrt(480)) - (sqrt(480) - (sqrt(480) - -1sqrt(480)))5)/((sqrt(810) - sqrt(810)-3)-2). 5sqrt(3)/6 Simplify (-2(3 + sqrt(11) + -1 + -3 + (sqrt(33) + sqrt(132)/sqrt(4))/sqrt(3) + sqrt(110)/sqrt(40)) + 3)*24-6. -13536 + 1680sqrt(11) Simplify (-5(-1sqrt(187)1 - (sqrt(187) - -6sqrt(187)1)))/(sqrt(44)/sqrt(4)6 + sqrt(33)/(sqrt(3) - (sqrt(3) + sqrt(75)) - sqrt(3))). 48sqrt(17)/7 Simplify (4sqrt(153))/sqrt(9) + sqrt(2057)-3 + sqrt(17) - ((sqrt(170)2)/sqrt(5))/(3sqrt(10)/sqrt(5)). -86sqrt(17)/3 Simplify ((5 + sqrt(252) + 2 + sqrt(252))-3)2 + (2 + sqrt(7) + 1 + -2sqrt(7))*2 + -2. 1506sqrt(7) + 9527 Simplify ((25(sqrt(1500) - -1sqrt(1500) - sqrt(1500)))/((sqrt(72) - (-3(-1sqrt(72) - sqrt(72)) + sqrt(72)))/(sqrt(96)1)))*2. 50000/9 Simplify (-2 + -5 + (2 + sqrt(5) + -5 - 2(0 + sqrt(5))) + (2-2sqrt(405) - (sqrt(405) - (sqrt(405) - (5 + sqrt(405)-2)))))2. 570sqrt(5) + 2030 Simplify (2((sqrt(84) - 5-1sqrt(84)) + (sqrt(84) - ((sqrt(84)-1 + sqrt(84))1 + sqrt(84)))))/((2sqrt(84)1)/(-5sqrt(7)1)) + -4. -30sqrt(7) - 4 Simplify ((4sqrt(50) + sqrt(128)1 + 0 + sqrt(24)/(sqrt(132)/sqrt(11)))-2)2 + 4. 6732 Simplify ((((sqrt(98) + -1)5 - sqrt(98))-2 + 3 + (sqrt(98) - (1 + sqrt(98))) + sqrt(98) + (1 + sqrt(98))-2)*2 + 4)6. -7560sqrt(2) + 48252 Simplify -2(((sqrt(4) - (sqrt(4) + sqrt(484)1))-4)/(sqrt(16)/(sqrt(640)/sqrt(5))) + -1). -352sqrt(2) + 2 Simplify (2sqrt(252) + 2 + -3)*2-21 + 1 + -5. -2022 + 48sqrt(7) Simplify (sqrt(152)/(2sqrt(200)) - (sqrt(38)/(sqrt(18)-6))*2) + sqrt(76)/(1sqrt(576) + sqrt(576) + sqrt(576)) + (((sqrt(76)2)/sqrt(4))2 - -6sqrt(304)). 24605/324 + 4343sqrt(19)/180 Simplify (((-4 + 1 + sqrt(1008) - (sqrt(1008)2 + -5)) + 5)1)2-2. -2114 + 336sqrt(7) Simplify 4 + 4 + (sqrt(540)1)/((-2sqrt(12))/sqrt(4) + sqrt(3)) + -1 + -4. -6sqrt(5) + 3 Simplify ((sqrt(176)-1)/sqrt(11))/sqrt(8)4 + 242-1sqrt(2). -20sqrt(2) Simplify -5(2sqrt(1539)-2 + -4(sqrt(1539) + 3) + -5 + 2)2. -493605 - 10800sqrt(19) Simplify (-1sqrt(792)2)/(sqrt(14)/((2sqrt(14))/sqrt(2))). -24sqr	{ "pile_set_name": "DM Mathematics" }
u*3. -3u*2(u - 2)(3u - 2)/4 Suppose -2x - a = -9, x + a + 33 = 6x. Let n(m) = m*2 - 5m - 4. Let b be n(x). Determine u so that 0 - 2u3 - 4/3u*b + 2/3u = 0. -1, 0, 1/3 Let y(w) = w*2 + 2w - 3. Let j be y(-3). Let z(b) be the first derivative of jb + 2/7b*3 + 3/14b*4 + 2/35b*5 + 1/7b*2 + 2. Factor z(v). 2v(v + 1)3/7 Let r(m) be the second derivative of m9/30240 + m8/13440 - m4/6 - 3m. Let q(y) be the third derivative of r(y). Factor q(x). x*3(x + 1)/2 Solve -1/4f5 - 9/4f*4 - 7/4f*2 + 6f - 23/4f3 + 4 = 0. -4, -1, 1 Let l = 491/3 + -163. Factor lk*2 + 4/3 + 2k. 2(k + 1)(k + 2)/3 Let c(j) be the first derivative of -8j - 22j*2 + 4 + 52/3j*3. Suppose c(l) = 0. What is l? -2/13, 1 Let u = 6 + -2. Suppose x + 2x + 8 = -ug, 9 = x - g. Solve j3 - 4j*2 + 2j - 3j3 - 4j*3 + x + 4j*3 = 0 for j. -2, -1, 1 Suppose -12 = -3o - h, -5h = 2o - 1 - 7. Let 4 - 8t3 + 2t - 4to + 10t - 4t = 0. What is t? -1, 1 Suppose y = 3t - 6, -4t + 10 = y + t. Let v = 2 - y. Suppose w2 - 3w*2 - 5w - 1 - 7w2 - vw*4 - 7w*3 = 0. What is w? -1, -1/2 Suppose -2y + 2i - 2 = 4, -33 = -4y - 5i. Find c, given that -2/5c + 1/5cy + 0 = 0. 0, 2 Let u(m) be the third derivative of 0m - 1/3m4 - 1/60m*7 - 4m*2 - 1/3m*3 + 0 - 19/240m*6 - 1/672m*8 - 5/24m5. Factor u(q). -(q + 1)3(q + 2)2/2 Let b = 974/45 - 193/9. Let 1/5l*2 - bl*4 - 1/5l*5 + 0 + 0l + 1/5l3 = 0. Calculate l. -1, 0, 1 Let k(u) = u3 - 3u*2 - 3u + 4. Let j be k(3). Let p = j + 8. Factor -a*3 - 6a*p - 4 + 2 + 6a - a*3. -2(a + 1)(2a - 1)2 Let d(c) be the third derivative of -c6/240 - 11c5/480 + 19c4/192 - c3/12 - c2. Suppose d(u) = 0. Calculate u. -4, 1/4, 1 Let c(n) = n4 - n*2 - 1. Let f(o) = 4o*4 - 4o*4 - 4 - 5o*2 + 3o*4 + 2o*2. Let j be (-12)/10 - 1/(-5). Let h(g) = jf(g) + 4c(g). Factor h(p). p2(p - 1)(p + 1) Let c(i) be the third derivative of 1/210i*6 - 1/42i*4 + 0 + 2i*2 + 0i*5 + 0i - 1/21i3 + 1/735i*7. Factor c(b). 2(b - 1)(b + 1)3/7 Suppose -2i + 32 = 2i. What is m in 24m*4 - 14m*2 - 6m + 4 - im3 + 14m*5 - 6m*2 - 8m*2 = 0? -1, 2/7, 1 Let h(j) be the first derivative of 48j5/25 - j4 - 8j3/5 - 2j*2/5 - 10. Let h(u) = 0. Calculate u. -1/3, -1/4, 0, 1 Factor -6l*2 + 0l + 3l3 - l + l + 9l*4. 3l*2(l + 1)(3l - 2) Let a be 2/(-15) + 31/210. Let t(s) be the third derivative of as7 + 0s*4 + 0s*6 + 2s*2 - 1/20s*5 + 0s + 0 + 0s3. Solve t(g) = 0 for g. -1, 0, 1 Let a(p) = 5p*2 - 7p - 6. Suppose -10 = -4t + 2. Suppose 44 = -tg - g. Let d(n) = -9n2 + 13n + 11. Let h(f) = ga(f) - 6d(f). Factor h(j). -j(j + 1) Suppose 3m - 2s - 5 - 1 = 0, -m + 2 = 3s. Let b(a) be the first derivative of 2/7a + 2 + 0a*m - 2/21a*3. Factor b(q). -2(q - 1)(q + 1)/7 Let x be 35/(-14)(3 + 42/(-10)). Let r(l) be the first derivative of -1/7l2 - 1/14l*4 + 0l + 4/21lx + 4. Factor r(q). -2q(q - 1)2/7 Let r(m) = -2. Let j(g) = 0g*2 + 0g2 + g2 - 2 - g + 1. Let w(s) = -2j(s) - r(s). Factor w(p). -2(p - 2)(p + 1) Let j(h) be the second derivative of h6/480 - h5/240 - h2/2 + 5h. Let f(k) be the first derivative of j(k). Factor f(g). g*2(g - 1)/4 Factor 5 - 9j2 - 5 + 3j. -3j(3j - 1) Suppose 19s - 30 = 46. Let 11/4ys - 1/2y*5 + 2y - 9/2y3 + y2 + 0 = 0. Calculate y. -1/2, 0, 2 Let s = -7/16 - -9/16. Let r(c) be the third derivative of -sc*6 + 0c*3 - 1/5c*5 + 0 + 0c - 1/8c4 - c2 - 1/35c*7. Factor r(g). -3g(g + 1)2(2g + 1) Let r(q) be the third derivative of 1/100q*5 + 4q*2 + 1/120q*6 + 0 - 1/350q*7 - 1/420q*8 - 1/120q*4 + 0q*3 + 0q. Suppose r(n) = 0. Calculate n. -1, 0, 1/4, 1 Let j(f) be the second derivative of f10/45360 - f9/22680 - f8/10080 + f7/3780 + f*4/6 + 2f. Let y(x) be the third derivative of j(x). Factor y(w). 2w2(w - 1)*2(w + 1)/3 Let q(i) = -i + 2. Let y be q(0). Suppose 2/3xy + 2x + 4/3 = 0. What is x? -2, -1 Let k(m) be the third derivative of m8/80640 - m7/20160 + m*5/60 + 4m*2. Let t(h) be the third derivative of k(h). What is p in t(p) = 0? 0, 1 Let s(n) be the second derivative of -3n5/70 - n4/14 + n*3/7 + 3n*2/7 + 19n. Suppose s(v) = 0. What is v? -1, 1 Let y = 139 - 139. Let r(d) be the second derivative of -1/147d7 - 1/105d*6 + 1/42d*4 + yd*3 + 0 + 0d*2 + 1/70d*5 - 4d. Solve r(c) = 0. -1, 0, 1 Let w = -18 - -20. Factor -5rw - 21r - 3 - 3r - 43r*2. -3(4r + 1)2 Let b(o) be the third derivative of 2o7/105 + o6/10 + 2o5/15 + 21o*2. Let b(y) = 0. What is y? -2, -1, 0 Let a(f) = 2f3 + f2 - 3f. Let l(n) = -n3 + n. Suppose 2 + 10 = -4m. Let j(b) = ml(b) - a(b). Suppose j(c) = 0. What is c? 0, 1 Let v = 481 + -9623/20. Let z = 1/4 - v. Let 0f - zf2 + 2/5 = 0. What is f? -1, 1 Let y(k) be the third derivative of -1/90k5 - k2 - 1/180k6 + 1/36k*4 + 1/9k*3 + 0 + 0k. Factor y(z). -2(z - 1)(z + 1)*2/3 Let m(a) = -4a + 12a2 - 2 - 10a*2 + a. Let v(q) = -3q*2 + 4q + 3. Let x = 5 + -2. Let f(l) = xv(l) + 4m(l). Factor f(n). -(n - 1)(n + 1) Let -2/3h*3 - 4/3h*2 - 2/3h + 0 = 0. Calculate h. -1, 0 Let i = -2789/15 + 186. Let p(r) be the second derivative of 0r3 - r + 0r*2 - 3/20r*5 + 0 + ir*6 + 1/14r*7 - 1/6r*4. Find u such that p(u) = 0. -1, -2/3, 0, 1 Factor 1/5v*3 + 8/5 + 12/5v + 6/5v2. (v + 2)3/5 Let n(t) = -t3 + 7t*2 - 17t - 1. Let w(b) = b*3 - 7b*2 + 18b + 2. Let p(j) = 7n(j) + 6w(j). Factor p(g). -(g - 5)(g - 1)2 Let k(i) be the third derivative of -i5/60 + i3/6 + 16i2. Suppose k(b) = 0. Calculate b. -1, 1 Let i(d) be the second derivative of -d4/78 + 5d3/39 - 4d*2/13 + 33d. Suppose i(q) = 0. What is q? 1, 4 Let y = 0 + 10. Let b be 2/(-10) + 22/y. Determine g so that 5 - 2g + g2 - 6 + b = 0. 1 Let q(b) = b2 - 6b + 3. Let o be q(6). Determine t so that -7t5 + t5 + 24t*2 + 2t + 3t3 - 4 + 28t*4 - 47t*o = 0. -1/3, 1, 2 Let n be ((-2)/(-7))/(3/7). Find y such that -2/3y*3 + ny*2 + 4/3y + 0 = 0. -1, 0, 2 Let g(c) be the second derivative of c8/2520 - c7/420 + c6/180 - c5/180 - c*3/2 - 5c. Let x(o) be the second derivative of g(o). Factor x(r). 2r(r - 1)*3/3 Let -3j*4 + 52j + 3j3 + 9j*3 - 3 - 40j - 18j2 = 0. What is j? 1 Find o such that -1/2o*2 + 1/2 + 1/2o*3 - 1/2o = 0. -1, 1 Let l(u) = 39u3 + 60u*2 + 60u + 24. Let a(y) = -8y3 - 12y*2 - 12y - 5. Let d(v) = -24a(v) - 5l(v). Let d(h) = 0. What is h? -2, 0 Suppose -27m + 8 = -23m. Find f such that f*m + 0 - 1/2f*3 - 1/2f = 0. 0, 1 Suppose -2 = -2l, 2m - 5l + 9l = 8. Factor 2/3tm + 4/3t + 2/3. 2(t + 1)2/3 Let u(m) = 4m*2 + 2m + 2. Let h(z) = -z + 1. Let p(a) = 2h(a) - u(a). Let p(x) = 0. What is x? -1, 0 Let d(c) = c2 + 5c - 3. Let f = 7 + -13. Let i be d(f). What is a in 0a2 + 0 + 1/3a*5 + 0a + 0ai - 1/3a*4 = 0? 0, 1 Let j(z) = -4z*4 - 4z*3 + 24z*2 - 20z + 10. Let r(i) = i4 - i3 - i*2 + i - 1. Let b(w) = j(w) + 6r(w). Suppose b(x) = 0. Calculate x. 1, 2 Solve -7u3 + 10u*3 - 4u - 150u4 + 149u*4 = 0. -1, 0, 2 Let k(z) be the first derivative of 8z*5/55 + 5z*4/22 + 2z*3/33 - 1. Solve k(i) = 0 for i. -1, -1/4, 0 Suppose -3j + 33 + 27 = 0. Let w be 17/j + 6/(-10). Factor 1/4n2 - 1/4 + 1/4n*3 - wn. (n - 1)(n + 1)2/4 Let j(v) = 4v*4 - 20v*3 + 19v*2 - 3v + 3. Let x(t) = -12t4 + 60t*3 - 56t*2 + 8t - 8. Let q(r) = 8j(r) + 3x(r). Let q(o) = 0. Calculate o. 0, 1, 4 Let j(u) be the second derivative of 2u5/5 - 7u*4/6 - 2u*3/3 - 8u. Find p such that j(p) = 0. -1/4, 0, 2 Let x be 1/((-2)/6) + -1. Let n = 6 + x. Solve -tn + t2 + t*2 - t = 0 for t. 0, 1 Let x = 44 + -130/3. Let -xl*4 - 8/9l*3 + 2/9l*2 + 0 + 4/9l = 0. Calculate l. -1, 0, 2/3 Let g be (3 - (-39)/(-6))(-16)/28. Factor -125/2y*3 - 2 - 125/2y*g - 20y. -(5y + 1)(5y + 2)2/2 Suppose 5i - 13 - 2 = 0. Let l be 6/1 - 0/1. Factor 3 - ih2 + lh - 4h - 2h. -3(h - 1)(h + 1) Let k(a) = a*2 - a. Let i(m) = m. Let u = -3 + 2. Let p(v) = ui(v) - k(v). Determine s, giv	{ "pile_set_name": "DM Mathematics" }
x + 0n + 2/3n*3 + 0n*4 - 2. What is the third derivative of j(i) wrt i? -24i Let i(d) be the first derivative of d*4 - 2d*3 - 4d + 1. Let m(t) = -3t3 + 5t*2 + 3. Let w(b) = 5i(b) + 6m(b). Differentiate w(o) with respect to o. 6o2 Let y(f) = f3 + f2 - f + 7. Let x(l) = -l2 + l + 1. Suppose 0 = -2d + 9 - 7. Let z(b) = dy(b) + x(b). Find the first derivative of z(v) wrt v. 3v2 Let a(z) = -z3 + z. Let s(x) = x3 + 5x - 5. Let c(h) = 5a(h) - s(h). Find the first derivative of c(p) wrt p. -18p*2 Let w be 2/(-4) - 45/(-6). Let b = -4 + w. Find the second derivative of 4j + j3 + jb - 5j wrt j. 12j Suppose 0 = -4o + 3 + 5. Let n(z) be the first derivative of 1/2z*2 + o + z. What is the first derivative of n(d) wrt d? 1 Let p(q) = 28q*3 + 9q*2 + 34q. Let c(d) = -42d3 - 14d*2 - 51d. Let k(w) = 5c(w) + 8p(w). Find the second derivative of k(o) wrt o. 84o + 4 What is the second derivative of 14d*3 - 12d - 6d3 + 34 - 34 wrt d? 48d What is the derivative of -40 - 36u4 - 438u + 438u wrt u? -144u3 Let c(z) = z4 + 6z2 + 0z*2 - 5z*2. Let p(f) = -10f*4 - 8f*2 - 4. Let d(q) = -8c(q) - p(q). Differentiate d(k) with respect to k. 8k3 Suppose -4q = b - q - 23, 4b + 4q = 60. Let s be 42/b + (-6)/(-33). What is the second derivative of -2 + j - 3j5 - sj + 2 wrt j? -60j3 Suppose -3 - 6 = -3q. What is the third derivative of 8g3 + 11g2 + gq - g*3 - 19g2 wrt g? 48 Let f(d) = d3 + 8d2 + 8d + 10. Let y be f(-7). Find the third derivative of -9 + yj3 + 9 + j2 wrt j. 18 Let t(d) be the first derivative of 3d*4/2 + 19d*2/2 + 16. Find the second derivative of t(g) wrt g. 36g What is the first derivative of -162n2 + 2n*3 + 1 + 162n*2 wrt n? 6n*2 What is the third derivative of -8z - 10z2 - 16z*5 + 3z + 5z wrt z? -960z*2 Let z = 27 - 23. Find the first derivative of -3i*z - 2 - 4i*4 - 2i*4 wrt i. -36i3 Let d(g) = -g3 + 5g2 - g + 7. Let c be d(5). What is the third derivative of 10a*3 - a + a - 4a*c wrt a? 60 Find the first derivative of -5d*2 + 1 - 3d*2 + 3 + 5 wrt d. -16d Let v(z) be the first derivative of 0z - 1 + 2/3z*3 - 3/2z2. Find the second derivative of v(t) wrt t. 4 Let z(h) = -h4 - 3h2 + 13. Let j(f) = 3f*4 + 5f*2 - 26. Let m(k) = -3j(k) - 5z(k). What is the first derivative of m(l) wrt l? -16l*3 Let u = -8 - -27. What is the derivative of -3t + 7 - u + 9 wrt t? -3 Let q(o) = 55o - 25. Let n(d) = 1. Let i(x) = 4n(x) - q(x). Find the first derivative of i(u) wrt u. -55 Let j(g) = -26g3 - 24g*2 - 3g - 5. Let u(w) = -13w3 - 12w*2 - w - 2. Let d(b) = 2j(b) - 5u(b). What is the third derivative of d(y) wrt y? 78 Let d(x) be the second derivative of 0 + 0x*2 + 0x*5 + 0x*3 - 2x + 1/3x4 + 1/30x*6. Find the third derivative of d(o) wrt o. 24o Find the third derivative of -v3 + v3 - 3v5 - v5 - 3v*2 wrt v. -240v*2 Let d = -7 - -9. What is the first derivative of -d - 3v*3 - 2 + 2v*3 wrt v? -3v*2 Let b(u) be the first derivative of -2u - 1 + u*5 + 0u*5 - 1. What is the derivative of b(i) wrt i? 20i*3 Suppose v = 5x - 2v - 9, x - v = 1. Find the second derivative of 3s*3 - 5s*3 - xs*3 - 4s + 2s3 wrt s. -18s Let d = -11 + 14. Let i(l) be the third derivative of -1/24l4 + 0l*d + 3l*2 + 0 + 0l + 0l5 + 1/40l*6. What is the second derivative of i(k) wrt k? 18k Differentiate -52k3 + 20 + 5 + 52k*3 - 25k*4 with respect to k. -100k3 Let r(u) be the second derivative of -u6/60 + u4/12 - u2/2 + 2u. Let k(m) be the first derivative of r(m). Find the second derivative of k(n) wrt n. -12n Let k(t) be the third derivative of t6/8 - t5/15 + 4t2. Find the third derivative of k(a) wrt a. 90 Let s(y) be the first derivative of -y6 - 4y*3/3 + 7. What is the third derivative of s(w) wrt w? -360w*2 Let y = -17/6 - -3. Let x(t) be the first derivative of 0t*5 + 0t - yt6 + 1/2t*2 + 0t*3 + 2 + 0t*4. What is the second derivative of x(g) wrt g? -20g*3 Let r(g) = g - 1. Let z be r(4). What is the derivative of 2j + zj + 28 - 24 wrt j? 5 Suppose -8 = -4b + 4r, -2b - 2b + 13 = r. Let g = -1 + b. Differentiate 6 - 3 - 4q*4 + gq*4 wrt q. -8q*3 What is the derivative of 12n - 5 + 5 - 3n + 6 wrt n? 9 Suppose -2i = 4, -2i + 10 = -2n + 4. Let d be n(2 + (-14)/5). Find the second derivative of s + sd - 4 + 4 wrt s. 12s*2 Suppose -3w - l = 2w - 7, l = 3w - 1. Let y be -2(-1 - (-1 + w)). Find the third derivative of -u5 + u2 + yu2 - u2 wrt u. -60u2 Let l(y) = -16y*4 + 12y*2 - 3. Let z(b) = -17b*4 + 13b*2 - 4. Let d(f) = 4l(f) - 3z(f). Find the third derivative of d(p) wrt p. -312p Let v(s) be the first derivative of -4/3s3 - 4 + 0s*4 + 0s*6 + 0s*5 + 0s + 6/7s7 + 0s*2. Find the third derivative of v(x) wrt x. 720x*3 Let u(z) be the third derivative of 0z*4 + 0z + 1/30z5 - 2/105z*7 + 0z*3 + 0 - 3z*2 + 0z*6. Find the third derivative of u(g) wrt g. -96g Let x(h) be the third derivative of -1/112h8 - h2 + 0h*6 + 0h*4 - 1/60h*5 + 0 + 0h*7 + 0h + 0h3. What is the third derivative of x(k) wrt k? -180k2 Let r(p) be the third derivative of -p7/2520 + p6/240 - p5/60 + 3p2. Let v(h) be the third derivative of r(h). Differentiate v(k) with respect to k. -2 Differentiate -5 + 20 - 7m*3 - 12 - 16 with respect to m. -21m*2 Find the third derivative of 4j + 6j2 + 186j*5 - 4j - 179j5 wrt j. 420j2 Let z(p) be the second derivative of p8/3360 - p*7/504 - 5p*4/12 + 8p. Let x(l) be the third derivative of z(l). Find the third derivative of x(j) wrt j. 12 Let p(y) be the first derivative of -11y4/4 + 37y*2/2 + 9. Find the second derivative of p(t) wrt t. -66t Let g = -8 + 11. What is the second derivative of 0p + p3 + gp*3 - p + 0p wrt p? 24p Let m(n) = -12n*3 - 2n*2 + 2n + 1. Let k(i) = -36i3 - 7i*2 + 7i + 4. Let z(r) = 2k(r) - 7m(r). Find the first derivative of z(f) wrt f. 36f2 Let i = 26 + -26. Let t(q) be the second derivative of -q + 0q*4 + 0q*5 + 1/10q*6 + i + 1/2q*3 + 0q*2. Find the second derivative of t(u) wrt u. 36u2 Let m(c) be the second derivative of c5/10 - 4c2 + 7c. Find the first derivative of m(s) wrt s. 6s2 Let d = 11 - -1. What is the first derivative of 7 - d - 8m + 6 wrt m? -8 Suppose 5m - 31 = 4d - 6, -3d = -3m + 15. Find the second derivative of -ml5 + 4l + 3l5 + l5 wrt l. -20l*3 Let r(f) = 11f*2 + 11f. Let g(y) = -33y2 - 33y. Let b(x) = 4g(x) + 11r(x). Find the second derivative of b(l) wrt l. -22 Let b(x) = 8x2 + 19. Let u(n) = -3n*2 - 6. Let f(c) = 2b(c) + 7u(c). Differentiate f(j) wrt j. -10j Find the third derivative of 0s2 + 3s*4 - 14s*4 + 6s*2 wrt s. -264s Let o(q) be the first derivative of -2q3/3 - 8q + 11. Differentiate o(l) wrt l. -4l Let s be 0/(3 - 1) - -6. Find the third derivative of bs - 7b*5 + 7b*5 - 5b*2 wrt b. 120b*3 Find the second derivative of -8i*3 + i - 32i + 3i + 6i wrt i. -48i What is the third derivative of 13u*2 + 31u*3 + 2 - 36u3 - 2 wrt u? -30 Let l = -5 + 9. What is the derivative of ml - 2 - 3m + 3m - 2m4 wrt m? -4m*3 Let q(c) be the second derivative of 0c*3 + 3/2c*2 + 5c + 0c4 + 0c*5 - 7/30c*6 + 0. Differentiate q(p) wrt p. -28p*3 Let x(s) be the second derivative of -1/3s*4 + 1/20s*5 + 0 - 4s + 0s2 + 0s*3. Find the third derivative of x(a) wrt a. 6 Let v = 22 + -65/3. Let n(i) be the first derivative of -i + 0i*2 + vi*3 - 2. Differentiate n(y) with respect to y. 2y Suppose 0 = 5j - z - 48, 3j - 32 = -4z + 3z. Suppose -5k + 5 = -j. Find the second derivative of o - 3o - o*3 - 2o*k wrt o. -18o Let t(j) = -4j2 - 9j. Let l(z) = z4 + z2 + z. Let k(b) = -4l(b) - t(b). Find the second derivative of k(s) wrt s. -48s*2 Let g be (-1)/(-6) + (-2)/(-6). Let v(m) be the first derivative of -gm*2 + 0m - 3/4m4 + 0m*3 - 2. What is the second derivative of v(h) wrt h? -18h What is the third derivative of 3u2 + 5u4 - u4 + 0u4 wrt u? 96u Suppose 3*t + 2	{ "pile_set_name": "DM Mathematics" }
: -75659995, -151319989, -226979983, -302639977, -378299971? -453959965 What comes next: 19216, 38440, 57648, 76834, 95992, 115116, 134200, 153238? 172224 What is the next term in 171281, 342576, 513873, 685172, 856473, 1027776? 1199081 What is the next term in -2787081, -5574112, -8361143, -11148174? -13935205 What is next in -1628244, -1628242, -1628240, -1628238, -1628236? -1628234 What is the next term in 332365831, 332365829, 332365827, 332365825? 332365823 What is next in 417662, 417697, 417758, 417845? 417958 What is next in -172817979, -345635959, -518453939, -691271919, -864089899? -1036907879 What is the next term in -4541, -3836, -2709, -1160, 811, 3204? 6019 What is next in 37350423, 37350424, 37350425, 37350426? 37350427 What comes next: -24623, -196909, -664539, -1575185, -3076519, -5316213, -8441939, -12601369? -17942175 What is next in 17038, 37779, 58524, 79273, 100026? 120783 What is next in 1060642, 2121286, 3181930, 4242574? 5303218 What is next in 122235, 488917, 1100053, 1955643? 3055687 What is the next term in -7181, -11885, -16589, -21293, -25997, -30701? -35405 What comes next: -3917, -7144, -10361, -13574, -16789, -20012, -23249? -26506 What comes next: -243435, -486822, -730209? -973596 What is the next term in 2356, 4775, 7200, 9631, 12068, 14511, 16960? 19415 What comes next: -69841, -139514, -209177, -278824, -348449? -418046 What is next in -174563, -349042, -523521, -698000? -872479 What is next in -24254, -14998, 428, 22024, 49790, 83726? 123832 What comes next: 1354, 6570, 15644, 28576, 45366? 66014 What is the next term in -11078, -22151, -33222, -44291, -55358? -66423 What comes next: 1737, 3333, 4959, 6627, 8349, 10137, 12003? 13959 What is the next term in -14263, -15253, -16243, -17233? -18223 What is next in -54354, -109134, -163904, -218658, -273390? -328094 What is next in 968593067, 968593069, 968593071, 968593073, 968593075? 968593077 What is the next term in 19254, 19164, 19020, 18822, 18570? 18264 What is next in 93047, 184485, 274315, 362531, 449127? 534097 What is next in -1084958, -1084954, -1084950, -1084946? -1084942 What is the next term in -41725, -41913, -42099, -42283? -42465 What is next in -11940549, -11940548, -11940547, -11940546? -11940545 What comes next: 12364753, 12364755, 12364757, 12364759, 12364761, 12364763? 12364765 What comes next: -3589, -8002, -13987, -22330, -33817, -49234, -69367, -95002? -126925 What is the next term in 4404405, 8808812, 13213219? 17617626 What is the next term in 1284943, 2570091, 3855253, 5140435, 6425643? 7710883 What is the next term in 54243, 108442, 162537, 216474, 270199? 323658 What comes next: 4990016, 9980033, 14970050? 19960067 What is the next term in 486850, 486856, 486872, 486904, 486958? 487040 What is the next term in -9184, -8660, -8136, -7612, -7088, -6564? -6040 What is next in -19692421, -39384839, -59077257? -78769675 What is the next term in 53611, 214570, 482835, 858406? 1341283 What is next in -5251140, -10502261, -15753382, -21004503? -26255624 What comes next: 2545, 16074, 52807, 124348, 242301, 418270? 663859 What is the next term in 398324, 398695, 399314, 400181, 401296? 402659 What is the next term in -262490, -1056688, -2380352, -4233482? -6616078 What comes next: 2774, 12100, 28180, 51014, 80602, 116944? 160040 What is next in 20790894, 20790896, 20790898, 20790900, 20790902? 20790904 What is next in 259, 1123, 2703, 5083, 8347? 12579 What comes next: -13498, -21650, -35240, -54274, -78758, -108698? -144100 What is the next term in -45896, -45033, -44170? -43307 What is the next term in -12033, -23995, -35957? -47919 What comes next: -17446282, -17446208, -17446084, -17445910? -17445686 What is next in -4161, -9839, -15517, -21195, -26873, -32551? -38229 What is next in 674, -10732, -22138, -33544? -44950 What is the next term in 2113367, 4226738, 6340123, 8453522? 10566935 What comes next: -53507, -106523, -159539, -212555, -265571, -318587? -371603 What is the next term in -39510, -39948, -40388, -40830, -41274, -41720, -42168? -42618 What comes next: 79435, 78489, 77543? 76597 What is next in 7109, 16066, 25023, 33980, 42937? 51894 What is the next term in 1844, 5598, 11260, 18830? 28308 What comes next: 92546, 92916, 93306, 93710, 94122, 94536, 94946, 95346? 95730 What is next in 80529, 162085, 243637, 325185, 406729? 488269 What is the next term in -8828, -6163, -3498? -833 What comes next: -10474, -10094, -9456, -8560, -7406, -5994? -4324 What is next in -369, 2958, 6285, 9612, 12939? 16266 What comes next: -33012758, -33012757, -33012756, -33012755, -33012754? -33012753 What is the next term in 8564, 17113, 25664, 34229, 42820, 51449, 60128, 68869? 77684 What comes next: -33457577, -33457576, -33457575, -33457574? -33457573 What is the next term in -9152, -13649, -18142, -22631, -27116, -31597, -36074? -40547 What is the next term in 6062, 12199, 18406, 24683, 31030, 37447, 43934? 50491 What comes next: -94860305, -379441212, -853742725, -1517764844? -2371507569 What is next in -7937, -30944, -69019, -122168, -190397, -273712? -372119 What is the next term in -20165, -20859, -21551, -22241, -22929, -23615, -24299? -24981 What is next in 471689, 943434, 1415179? 1886924 What is the next term in -31658, -29848, -28048, -26264, -24502, -22768, -21068? -19408 What is the next term in -667, -2216, -4623, -7882, -11987, -16932, -22711, -29318? -36747 What comes next: 668604, 666908, 665212, 663516, 661820? 660124 What comes next: -18418123, -36836258, -55254393, -73672528, -92090663, -110508798? -128926933 What is next in 44196, 87921, 131642, 175359, 219072, 262781, 306486? 350187 What is next in 48877, 97662, 146349, 194938, 243429, 291822, 340117? 388314 What is next in -290032, -579995, -869884, -1159699, -1449440, -1739107, -2028700? -2318219 What is next in 24400, 24359, 24282, 24163, 23996, 23775? 23494 What is the next term in 360555449, 360555447, 360555445, 360555443, 360555441, 360555439? 360555437 What is next in -130195, -130120, -129915, -129514, -128851, -127860, -126475, -124630? -122259 What is next in -31017, -61168, -91319, -121470? -151621 What is next in 43283, 87441, 131609, 175787, 219975, 264173, 308381? 352599 What comes next: -5786458, -5786473, -5786492, -5786515, -5786542? -5786573 What comes next: 1249, -532, -5283, -14462, -29527, -51936? -83147 What comes next: -1143, -2798, -4449, -6096, -7739, -9378? -11013 What is next in -39783717, -79567419, -119351121? -159134823 What is next in 140099, 280995, 421891, 562787? 703683 What is next in 85, -170, -783, -1754, -3083, -4770? -6815 What is next in 1434, 3327, 5208, 7071, 8910, 10719, 12492, 14223? 15906 What comes next: 782396, 782456, 782560, 782708, 782900, 783136? 783416 What is next in -28602, -57049, -85496? -113943 What is the next term in -281, -8596, -31169, -75128, -147601, -255716, -406601? -607384 What comes next: 173018285, 346036566, 519054847, 692073128, 865091409? 1038109690 What is the next term in -115973, -463909, -1043799, -1855643, -2899441? -4175193 What is next in 175829, 351597, 527361, 703121, 878877? 1054629 What comes next: -400703, -400686, -400651, -400592, -400503, -400378, -400211? -399996 What comes next: 65560, 131198, 196836? 262474 What is next in 8709, 8549, 8279, 7899, 7409? 6809 What is next in 114946, 221652, 328358, 435064, 541770, 648476? 755182 What is next in 1830, 2172, 2548, 2976, 3474, 4060? 4752 What is next in 12165, 97065, 327549, 776409, 1516437? 2620425 What is next in -11214, -10208, -9202, -8196, -7190, -6184? -5178 What comes next: -27518, -110045, -247612, -440237, -687938, -990733, -1348640, -1761677? -2229862 What is the next term in -5200, -10503, -15912, -21427, -27048? -32775 What comes next: 170665, 341283, 511901? 682519 What is next in -400630, -1602347, -3605150, -6409045, -10014038, -14420135, -19627342, -25635665? -32445110 What is next in 78, 202, 560, 1260, 2410? 4118 What comes next: -10895, -76071, -184705, -336803, -532371, -771415? -1053941 What is next in -60, -1200, -4510, -11076, -21984, -38320, -61170, -91620? -130756 What is next in 1060, 1888, 2580, 3136? 3556 What is the next term in 1571, 4984, 10703, 18728? 29059 What is next in 65662, 262492, 590540, 104980	{ "pile_set_name": "DM Mathematics" }
5k - 3 + 4. Let z(i) = bc(i) + 66s(i). Differentiate z(r) wrt r. -12 Let l(s) be the second derivative of 29s7/3 - s4/12 + 41s3/2 + s2/2 - s + 514. Find the second derivative of l(h) wrt h. 8120h*3 - 2 Let o be (-2)/8 - (205/(-20) + 4). Let g be (-24)/(-14) + o/21. Differentiate -5p + 0p + 9 - 11p + gp wrt p. -14 Differentiate -38r - 11r2 + 6r*2 + 695 - 6518 + 450r*4 - 447r*4 with respect to r. 12r*3 - 10r - 38 Let f(w) be the second derivative of -431w4/12 - 593w3/6 + w2/2 + 1041w. Find the second derivative of f(n) wrt n. -862 Suppose -6g = -31 + 7. Find the first derivative of 5h4 + 20h*g - 33 + 117 + 28 wrt h. 100h*3 Let s(i) be the second derivative of 0i*4 + i + 1/3i*3 + 3i*2 + 0i*5 + 61 - 41/15i*6. What is the second derivative of s(y) wrt y? -984y*2 Let m(r) be the second derivative of -1217r*6/15 + 740r*2 - 17r - 38. Differentiate m(y) wrt y. -9736y3 What is the third derivative of 2 - 2k*3 - 540k*5 + 110844k*2 - 108293k*2 - 2 wrt k? -32400k*2 - 12 Let w = -376 - -405. Differentiate 10o*3 + 4o*3 - wo*3 + 42 + 13o*3 - 2o wrt o. -6o2 - 2 Let j(n) be the second derivative of -119/12n*4 + 0n*3 + n - 3 + 27n*2. What is the derivative of j(m) wrt m? -238m Suppose 0 = 3h + 15f - 20f - 33, f + 29 = 2h. Find the second derivative of -hc5 - 32c*5 + 28c*4 + 50c*5 + 48c wrt c. 40c3 + 336c*2 Let o = 13 - 3. Let r = -194 + 199. What is the third derivative of oz*5 + 8z*r - 12z*5 + 9z*2 wrt z? 360z*2 Suppose 39t = 282 - 165. Let f(q) be the third derivative of -q*t + 0q - 9/20q5 - 10q*2 + 0 + 0q*4. What is the derivative of f(h) wrt h? -54h Let c(y) = -y*3 - 3y + 4y + 229y*4 + 1 - 230y*4. Let a(k) = -64k4 - k3 + k - 39. Let l(d) = a(d) - c(d). Find the first derivative of l(z) wrt z. -252z3 Find the second derivative of -586z2 - z5 + 1015z3 + 3725z - 1015z3 - 917z*2 wrt z. -20z*3 - 3006 Let z(p) be the first derivative of 1331p4/4 + p3 - 195p + 582. What is the third derivative of z(y) wrt y? 7986 Let l(z) be the third derivative of -2z*7/105 - 4z*6/5 + 3911z5/60 + z4/24 - 839z2 - 2. What is the third derivative of l(p) wrt p? -96p - 576 Let v(c) = 934c - 3668. Let x(d) = 931d - 3657. Let z(k) = -7v(k) + 6x(k). Differentiate z(h) with respect to h. -952 Let u(o) be the second derivative of -1665o3/2 - 3387o*2/2 + o - 2227. Differentiate u(t) wrt t. -4995 Let l(m) be the third derivative of -61m8/336 - m7/70 - m*6/40 + 752m5/15 - m4/12 - 67m2 + 2m + 6. Find the third derivative of l(s) wrt s. -3660s2 - 72s - 18 Let y(r) be the second derivative of -1153r4/2 - 6689r*3/6 + 451r + 1. What is the second derivative of y(f) wrt f? -13836 Let a(z) be the third derivative of -5z9/504 - 41z7/105 - z5/60 - z*4/2 + 13z3/3 - z2 - 5z + 45. Find the third derivative of a(v) wrt v. -600v*3 - 1968v Let z(x) be the first derivative of 35x3/2 - 133x*2/2 - 176x - 221. Let l(k) be the first derivative of z(k). Differentiate l(v) with respect to v. 105 Suppose 2v = -2v + 3i + 29, -2v = i - 17. Suppose -35 = -vy + 77. What is the second derivative of -3t - 8t - yt - 41t2 + 11t*2 wrt t? -60 Let x(z) = 3z*3 - 4z*2 + 13z + 4. Let m be x(7). What is the third derivative of -79y2 - 99y*3 - my - 194y3 + 928y wrt y? -1758 Let v(u) be the third derivative of -23u7/105 - 1111u*3/6 + 255u*2 + u. What is the first derivative of v(l) wrt l? -184l*3 Find the third derivative of 397560f - 198777f - 2959f*3 + 2978f*2 - 198783f wrt f. -17754 Let u be (-3 - -2) + 0 - -3. Let j be (u - 12)/(2 - 3). What is the second derivative of -jc - 6c + 83c5 - 82c*5 wrt c? 20c*3 Let a(h) = 4h*2 + 23h - 1. Let y be a(-6). What is the third derivative of -41w2 - 28w*2 - 30w*y - 51w*5 + 14w*2 wrt w? -4860w*2 Let k(w) be the second derivative of 1181w5/20 - w4/6 + 871w3/2 + 4148w. Find the second derivative of k(s) wrt s. 7086s - 4 Let p(c) be the second derivative of c5/20 - 83c*4/12 - 422c*3/3 - 997c. Find the second derivative of p(z) wrt z. 6z - 166 Suppose 100x - 172x = 106x. Let k(y) be the second derivative of x - 12y + 0y*3 + 13/2y*2 - 4/3y*4. Find the first derivative of k(h) wrt h. -32h Let f(i) = -2366i2 - 8i - 2687. Let l(k) = k*2 + 2k - 1. Let r(a) = -f(a) - 4l(a). Find the first derivative of r(q) wrt q. 4724q Let b(w) = -1428w3 + 5w*2 + 5w + 645. Let g(r) = 2143r3 - 8r*2 - 8r - 968. Let h(a) = 8b(a) + 5g(a). Differentiate h(v) wrt v. -2127v2 Let a(p) be the second derivative of 109p*5/20 - 17p*3/6 - 3035p*2/2 + 3842p. Differentiate a(x) with respect to x. 327x2 - 17 Let r(h) = 2h - 1. Let k be r(4). Find the second derivative of 2 + 5n5 + 7n*3 + kn - 30n + 3n*3 wrt n. 100n*3 + 60n Let q(b) be the third derivative of -316b7/105 + 1607b*3/3 - 830b*2. What is the derivative of q(y) wrt y? -2528y*3 Suppose 0 = 2k - 22 + 10. What is the third derivative of h*2 + 103h*k - 248h*4 + 3h + 248h4 wrt h? 12360h*3 Suppose 2i = -4, -8i = q - 5i. Find the third derivative of 39oq - 46o*6 - 5o*2 - 21o*2 wrt o. -840o*3 Let k(z) be the third derivative of -3/2z*5 - 186z*2 + 1/2z*3 + 0 - 1/4z*4 + 1/120z*6 + 0z. What is the second derivative of k(a) wrt a? 6a - 180 Let p(b) = -b3 - 524b*2 + 406b + 5. Let f(s) = 2s3 + 524s*2 - 406s - 8. Let y(g) = -2f(g) - 3p(g). Find the second derivative of y(n) wrt n. -6n + 1048 Let q(d) be the first derivative of -40d*4/3 - 19d*3/6 - 203d - 22. Let k(n) be the first derivative of q(n). Find the second derivative of k(z) wrt z. -320 Let p = -223 + 136. Let x = p - -142. Find the first derivative of 76b3 - xb*3 + 9 - 51b*3 wrt b. -90b*2 Let n(r) = -4r + 14. Let t(p) = -3342p + 7383. Let h(c) = -15n(c) + t(c). Differentiate h(v) wrt v. -3282 Let w = 36 - 34. Let k be (-68)/(w/7 + 32/(-14)). What is the derivative of 3 - 36j - 11 + kj wrt j? -2 Differentiate -861l - 823l + 68l - 875l + 1377 + 3l with respect to l. -2488 Let n(l) be the first derivative of -19l*5/5 + 51l*4/2 + 8641l*3/3 - 10337. Find the third derivative of n(w) wrt w. -456w + 612 Suppose -5q + 30 = 4p, q - 3p = p - 18. What is the third derivative of 4 - 7 + 0a*2 - 188a*4 - 3a*q + 5a*2 wrt a? -4512a Suppose c = -d + 16, 0 = -3d - 21c + 25c + 83. What is the second derivative of -d - i + 40 + 29 + 18 - 34i*2 + 4 + 3i*4 wrt i? 36i*2 - 68 Find the second derivative of -258i*3 + 120i*3 + 0i*2 - 790i - 29i3 + i2 - 4 - 3i*4 - 27i*3 wrt i. -36i*2 - 1164i + 2 Suppose 13r + 28 = 20r. Let n be r/(-22) + 192/88. What is the second derivative of 818h - 807h + 7h2 + hn wrt h? 16 Let u be (-7 + (-18)/(-2))/((-1)/(-3)). Let l(x) = -218x + 69. Let p(v) = 219v - 68. Let r(o) = ul(o) + 5p(o). Differentiate r(h) with respect to h. -213 Suppose -164 = -5b + y, 2b - 70 = -0b - 4y. Differentiate 1 + 117l*2 + 1 - 15 - b with respect to l. 234l Let p be 6 - 64/(-6) - 1/(-3). What is the third derivative of 19s4 + ps*4 + s + 194s*2 - 200s*2 wrt s? 864s Let q(h) = -5h3 + 635h*2 - 8h - 3427. Let l(a) = -4a3 + 635a*2 - 6a - 3388. Let f(g) = -8l(g) + 6q(g). What is the derivative of f(u) wrt u? 6u2 - 2540u Let g(a) = -5a. Let i(p) = 633p + 211. Let s(b) = g(b) - i(b). What is the derivative of s(x) wrt x? -638 Let i(s) be the first derivative of -3s + 1/2s*2 + 0s*4 + 78 + 19/3s*6 + 0s*3 + 0s*5. What is the second derivative of i(t) wrt t? 760t*3 What is the third derivative of 5178z*2 + 1956z*3 + 5z*4 + 745z*2 - 1995z*3 - 5z*6 wrt z? -600z*3 + 120z - 234 Suppose 4q = 3o + 7, 2q + 3o + 3 = 20. What is the third derivative of 3555i4 + 37i2 + i6 - 13i3 - 12i*2 - 3555i*q wrt i? 120i*3 - 78 Let p(t) = 2t*2 + 2. Let z(o) = -1059o*2 + 3o - 57. Let v(i) = 5p(i) + z(i). What is the second derivative of v(x) wrt x? -2098 Let i(c) be the third derivative of 0c*3 - 15/2c*4 - 2c*2 - 4/5c*6 + 0 + 0c*5 - 5c. What is the	{ "pile_set_name": "DM Mathematics" }
- 57 + 6j. -2(j + 1)(4j + 1)(5j - 2) Suppose -k + 16 = 2x, -5k = -x - 4x - 80. Let l = k - 16. Determine m so that l - 3/2m*3 + 0m*2 + 3/4m + 0m4 + 3/4m*5 = 0. -1, 0, 1 Let x = -386/3 + 277/2. Let g = x + -19/2. Factor 5/3t - 10/3t2 + 1/3t*5 + 10/3t*3 - g - 5/3t4. (t - 1)5/3 Let t(z) be the first derivative of 1/4z4 + 6z*2 - 2 - 2z*3 - 8z. Factor t(n). (n - 2)3 Let s(w) be the first derivative of w5/210 - w*3/21 + 3w*2/2 + 3. Let g(i) be the second derivative of s(i). Suppose g(x) = 0. What is x? -1, 1 Let j(w) = 7w - 31. Let m be j(5). Let t(f) be the second derivative of 0f3 - 1/50f*5 + mf - 4/5f2 + 0 + 1/10f4. What is v in t(v) = 0? -1, 2 Let w(f) be the second derivative of -f6/75 - f*5/50 + 7f4/30 + f3/15 - 6f2/5 - 33f. Solve w(j) = 0 for j. -3, -1, 1, 2 Let s be (-5)/2(-36)/15. Let g(b) be the second derivative of 1/90b*s + 0b*3 + 0 + 0b*5 - 1/18b*4 + 2b + 1/6b2. Factor g(v). (v - 1)2(v + 1)*2/3 Suppose -2r - 14 = -4r. Suppose 3x*3 - 2x*5 - rx4 + x4 + 6x2 - x5 = 0. What is x? -2, -1, 0, 1 Suppose -34 - 11 = -5k. Suppose -m = 5, -t + 3m + k = -4t. What is o in 2o - 7o*2 - 2o*3 + to*4 + 6o2 - o2 = 0? -1, 0, 1 Let t = -946 - -948. Factor 2o + 2 + 1/2ot. (o + 2)2/2 Let b(l) be the first derivative of 2l3/39 - 40. Determine c, given that b(c) = 0. 0 Let a(v) = v - 6. Let w be a(4). Let t(r) = 1. Let n(p) = 1 - 16 + 7p*2 - 12p + 0. Let c(j) = wn(j) - 22t(j). Solve c(s) = 0 for s. -2/7, 2 Let l(m) be the first derivative of 117m4/10 - 86m*3/5 + 16m*2/5 + 24m/5 - 18. Factor l(h). 2(3h - 2)*2(13h + 3)/5 Let v(d) be the second derivative of -2/3d*3 + 0d*2 - 5d - 1/6d4 + 0. Let v(c) = 0. What is c? -2, 0 Suppose -4d + 16 + 4 = 0. Solve -4m3 - dm*2 - 4 - 8m + 3m3 + 0 = 0 for m. -2, -1 Determine f, given that 0f + 0 + 1/6f4 + 1/3f*2 - 1/2f*3 = 0. 0, 1, 2 Let v(f) = -f - 5. Let h be v(-6). Let r(d) = 4d*2 + 3d + 3. Let c be r(-1). Factor 6u2 + 1 - h - cu. 2u(3u - 2) Let z = -17 + 17. Let f be -4((-3)/20 - z). Solve 0h2 + 0 + fh*3 + 0h = 0 for h. 0 Let n be 1/7(-22917)/3. Let r = n - -1093. Solve 0j + 6/7j4 - 2/7 + 16/7j*3 + rj2 = 0 for j. -1, 1/3 Let q(o) be the second derivative of -o5/40 + o*3/3 + 7o. What is g in q(g) = 0? -2, 0, 2 Solve -3l5 + 5l - 16l2 + 4l*5 + 26l*2 - 6l*5 - 10l*4 = 0. -1, 0, 1 Suppose -4i + 4v + 4 = 0, -6v - 4 = 4i - 2v. Solve 0 + 2/5k4 - 2/5k*2 + ik + 0k3 = 0 for k. -1, 0, 1 Let g(c) = -c3 - 3c*2 - 2c - 3. Let q be g(-3). Suppose -f2 + fq + f*2 - 5f + 4f = 0. What is f? -1, 0, 1 Let r(c) be the first derivative of -c6/3 + 4c5/5 - 9. Find q such that r(q) = 0. 0, 2 Let w(x) be the second derivative of -x4/30 + 2x3/5 - 9x*2/5 - 11x. Find r such that w(r) = 0. 3 Let w(x) = 11x2 - 38x - 32. Let y(a) = 4a2 - 13a - 11. Let k(b) = 3w(b) - 8y(b). Let n be k(11). Factor 0 + 0p2 - 1/4p*n + 1/4p. -p(p - 1)(p + 1)/4 Let r(t) be the first derivative of -t4/18 - t3/9 + 3t - 1. Let m(a) be the first derivative of r(a). Suppose m(p) = 0. What is p? -1, 0 Let k(l) be the second derivative of 0l*2 + 0 - 1/40l*5 + 3l - 1/12l4 + 1/4l*3. Factor k(h). -h(h - 1)(h + 3)/2 Let d(h) be the first derivative of 0h + 4 + 1/10h4 + 0h*2 + 0h*3 - 2/25h*5. Factor d(y). -2y*3(y - 1)/5 Let g(a) be the third derivative of -a6/24 + a5/6 + 5a4/24 - 5a*3/3 - 34a*2. Factor g(c). -5(c - 2)(c - 1)(c + 1) Suppose f + 2 + 5 = 3u, 3u - 17 = -f. Suppose q + uq - 15 = 0. Determine p so that -45p*2 + 38p*3 - q + 21p + 2p2 - 2p*2 - 11p*3 = 0. 1/3, 1 Let h = -21 + 23. Let l(w) be the second derivative of 0w*4 + 0w*3 - 1/60w*6 + 0 + w - 1/84w*7 + 0w*5 + 0wh. Factor l(t). -t4(t + 1)/2 Let k(f) be the third derivative of 0f + 1/100f6 + 4/525f*7 + 1/840f8 + f2 - 2/75f5 + 0 - 1/15f*4 + 0f*3. Suppose k(d) = 0. What is d? -2, -1, 0, 1 Let y(t) be the first derivative of 17t*4 + 10/3t*6 + 0t*3 - 8t*2 + 0t - 72/5t5 + 4. Determine f so that y(f) = 0. -2/5, 0, 1, 2 Let m = -26/5 + 88/15. Determine w so that mw - 2/3w3 - 2/3w*2 + 2/3 = 0. -1, 1 Let f(i) = -677i*3 + 403i*2 - 72i + 2. Let d(l) = -678l3 + 402l*2 - 72l + 1. Let r(j) = 2d(j) - 3f(j). Find v, given that r(v) = 0. 2/15, 1/3 Let k be (3 - (1 + 1))/105. Let b(l) be the second derivative of 0 - kl6 + 2l - 1/21l3 - 3/70l*5 - 1/14l*4 + 0l2. Suppose b(g) = 0. Calculate g. -1, 0 Let q(h) = -h3 + 5h2 + 6h + 2. Let t be q(6). Find y, given that -ty2 + 2y + 8y3 - 2y - 9y3 - y = 0. -1, 0 Let g = 1511/5 - 301. Let d(o) be the first derivative of -7/15o*6 + 2/5o*2 + 0o - go3 + 1/2o*4 + 18/25o*5 + 3. Find x, given that d(x) = 0. -1, 0, 2/7, 1 Suppose 4m - 3/4m2 + 7/4m*4 - 4m*3 - 1 = 0. What is m? -1, 2/7, 1, 2 Let p(v) be the third derivative of 0v*5 + 1/30v*6 + 3v*2 + 0v*3 + 0v*4 - 1/105v*7 + 0 + 0v. Factor p(k). -2k3(k - 2) Let u be -3 - (0/2)/4. Let d = u + 3. Determine k, given that -1/4 - 1/4k4 + dk + 1/2k2 + 0k*3 = 0. -1, 1 Let i(m) be the third derivative of 0m + 1/20m4 + 1/150m*5 - 4m*2 + 0m*3 + 0. Factor i(y). 2y(y + 3)/5 Let w(c) be the third derivative of -c8/1344 - c7/840 + c6/480 + c5/240 - 17c2. Factor w(u). -u2(u - 1)(u + 1)*2/4 Suppose -5v - 8 = 2. Let a be (4 - 6)v/2. Factor s + 1/2s*3 + 0 + 3/2s*a. s(s + 1)(s + 2)/2 Let j(h) be the first derivative of -1/10h*2 - 1/60h*4 + 1/15h3 + h + 2. Let b(n) be the first derivative of j(n). Factor b(w). -(w - 1)2/5 Let t(u) be the third derivative of -5u2 + 0u + 0u3 - 1/15u*4 - 1/300u*6 + 2/75u*5 + 0. Find f, given that t(f) = 0. 0, 2 Let a(o) = 14o*2 + 11o + 4. Let i = 2 + 5. Let t(x) be the first derivative of -7x3/3 - 5x*2/2 - 2x - 1. Let v(k) = it(k) + 4a(k). Factor v(m). (m + 1)(7m + 2) Let u(b) = -b*3 + 5b*2 + 6b + 5. Let z be u(6). Find c, given that -2c4 + 2c*z - 21c*2 - 16c*4 - 6c - 27c3 - 5c*5 + 3c*4 = 0. -2, -1, 0 Let h be (-22)/77 - 38/(-168)2. Let n(s) be the second derivative of -1/12s4 + 0 + 0s*2 + s + hs*3. Suppose n(d) = 0. What is d? 0, 1 Let u(t) be the first derivative of -1/9t*3 - 2 + 2/3t + 1/6t2. Find s, given that u(s) = 0. -1, 2 Suppose 3z = 4z + 24. Let x be 28/3z/(-42). Solve 0 + 14/3q3 - 98/9q*4 + xq*2 + 8/9q = 0. -2/7, 0, 1 Determine m so that -4m + 2m*2 + 24m - 15 - 7m2 = 0. 1, 3 Let i be (-53)/(-17) + (-2 - 1). Let q = 28/51 + i. Let qw5 + w4 + 1/3w3 + 0w + 0 + 0w2 = 0. Calculate w. -1, -1/2, 0 Factor 15f*2 + 33 - 3f*3 - 40f + 47 - 2f3 - 50f*2. -5(f - 1)(f + 4)2 Let z(s) be the third derivative of s6/15 + s5/10 - s4/12 - 8s*2. Factor z(k). 2k(k + 1)(4k - 1) Let p(q) be the second derivative of q6/60 + q5/30 - q4/12 - q3/3 - 3q*2/2 + q. Let d(n) be the first derivative of p(n). Factor d(c). 2(c - 1)(c + 1)2 Let y(p) = 6p*3 + 12p*2 - 21p - 21. Let g(z) = 11z3 + 23z*2 - 41z - 43. Let r(v) = -3g(v) + 5y(v). Find c, given that r(c) = 0. -4, -1, 2 Let c(f) = f3 - 1. Let d(u) be the first derivative of u4/2 + 2u2 - 6u + 6. Let i(p) = 6c(p) - d(p). Factor i(l). 4l(l - 1)(l + 1) Let u(k) be the second derivative of 7k4/12 + k3/6 + 7k*2/2 - 2k. Let a(s) = 8s2 + 2s + 8. Let r(d) = 5a(d) - 6u(d). Factor r(x). -2(x - 1)2 Let x be (-8 - (-234)/30)-5. Factor -9/4a2 - x + 1/2a*3 + 3a. (a - 2)*2(2a - 1)/4 Let w be 610/210 + (-16)/(-168). What is y in -1/5y + 1/5yw + 2/5y*2 - 2/5 = 0? -2, -1, 1 Let r(o) = 8o*4 + 12o*3 + 12o*2 + 4o - 12. Let g(k) = k + 1 + 34k4 - 35k*4 - 2k - k*3. Let w(z) = 12g(z) + r(z). Factor w(l). -4l(l - 1)*2(l + 2) Find x such that -9x - 4x*2 + 0x*2 - 4x*3 + 17x = 0. -2, 0, 1 Let t(d) be the second derivative of 0 - 3d - 1/12d*4 - 1/168d*7 - 1/30d*6 - 1/24d*3 - 3/40d*5 + 0d*2. Find l such that t(l) = 0. -1, 0 Let g be (-18)/(-5) + 3/(-5). Suppose 3r*2 - 7r*g - 6r*3 + 9r*4 - 2r*3 + 3r = 0. Calculate	{ "pile_set_name": "DM Mathematics" }
18900 How many millennia are there in 4123.895 years? 4.123895 How many nanometers are there in 89803.65m? 89803650000000 What is thirteen fifths of a centimeter in micrometers? 26000 How many nanometers are there in 381.1434m? 381143400000 What is 62532.34l in millilitres? 62532340 How many grams are there in 8/25 of a kilogram? 320 How many millennia are there in 5363.208 years? 5.363208 How many hours are there in twenty-nine halves of a day? 348 What is thirteen fifths of a microgram in nanograms? 2600 Convert 15.68439m to millimeters. 15684.39 How many nanograms are there in 88.89402 grams? 88894020000 How many millilitres are there in 1/4 of a litre? 250 How many microseconds are there in thirty-seven halves of a millisecond? 18500 How many grams are there in three eighths of a kilogram? 375 Convert 0.6924921 litres to millilitres. 692.4921 Convert 2.32285 millimeters to centimeters. 0.232285 What is twenty-one halves of a century in years? 1050 What is 7/2 of a millennium in years? 3500 How many millimeters are there in nineteen quarters of a meter? 4750 Convert 0.6080199 nanometers to kilometers. 0.0000000000006080199 How many centuries are there in 9106.344 millennia? 91063.44 How many nanoseconds are there in 87910.22 hours? 316476792000000000 How many millilitres are there in 34.3266 litres? 34326.6 What is 421542.5 nanoseconds in seconds? 0.0004215425 How many minutes are there in 3/16 of a day? 270 How many millimeters are there in 34/5 of a meter? 6800 How many hours are there in 4/3 of a week? 224 What is 11/2 of a milligram in micrograms? 5500 How many seconds are there in 51/2 of a hour? 91800 What is 1024.21 years in centuries? 10.2421 How many millennia are there in 7960.537 centuries? 796.0537 What is one tenth of a kilometer in meters? 100 What is 27/5 of a millennium in decades? 540 How many minutes are there in 1/10 of a day? 144 How many months are there in 781.952 millennia? 9383424 How many litres are there in 0.8462755ml? 0.0008462755 How many years are there in 15/4 of a millennium? 3750 What is five eighths of a milligram in micrograms? 625 How many minutes are there in 23/3 of a day? 11040 How many millilitres are there in thirteen quarters of a litre? 3250 How many nanometers are there in 2865.699m? 2865699000000 How many microseconds are there in 3.612138ms? 3612.138 How many millilitres are there in 17/4 of a litre? 4250 How many litres are there in 78.13297 millilitres? 0.07813297 How many kilograms are there in 9/10 of a tonne? 900 How many centimeters are there in seventy-one quarters of a meter? 1775 Convert 90802.03 hours to minutes. 5448121.8 How many seconds are there in 19634.1us? 0.0196341 What is 1/20 of a kilogram in grams? 50 What is 8.552218 millilitres in litres? 0.008552218 What is 25.30756ml in litres? 0.02530756 How many meters are there in 18/5 of a kilometer? 3600 What is twenty-one quarters of a litre in millilitres? 5250 How many millilitres are there in 25/2 of a litre? 12500 How many years are there in 1/10 of a decade? 1 What is 0.8737241m in nanometers? 873724100 What is 6/5 of a gram in milligrams? 1200 How many millilitres are there in one fifth of a litre? 200 How many nanograms are there in seven halves of a microgram? 3500 What is 3/25 of a kilogram in grams? 120 What is twenty-one fifths of a kilometer in meters? 4200 How many millilitres are there in 6.89427l? 6894.27 What is fifty-one fifths of a litre in millilitres? 10200 How many micrograms are there in 21/4 of a milligram? 5250 What is 3/10 of a microgram in nanograms? 300 What is fifty-three fifths of a centimeter in millimeters? 106 What is 80.933 years in decades? 8.0933 How many weeks are there in 3.6462384 minutes? 0.00036173 Convert 92135.09 centimeters to meters. 921.3509 What is 3/5 of a century in decades? 6 How many millennia are there in 80.09691 years? 0.08009691 How many nanograms are there in six fifths of a microgram? 1200 What is 7/2 of a litre in millilitres? 3500 Convert 32594.93ug to grams. 0.03259493 Convert 34.712ml to litres. 0.034712 What is 6.657744ns in microseconds? 0.006657744 What is 0.0898853 minutes in seconds? 5.393118 What is one quarter of a millennium in years? 250 What is 17/2 of a decade in years? 85 How many minutes are there in 3/28 of a week? 1080 How many milliseconds are there in 4.865752 minutes? 291945.12 What is fourty-three quarters of a year in months? 129 What is one fifth of a century in years? 20 Convert 74.9977 kilometers to centimeters. 7499770 What is 5/4 of a litre in millilitres? 1250 How many years are there in 887742.2 centuries? 88774220 What is 0.6185174ml in litres? 0.0006185174 What is 9/10 of a milligram in micrograms? 900 How many minutes are there in 1/16 of a week? 630 What is 3/5 of a meter in millimeters? 600 Convert 124.07358 months to decades. 1.0339465 What is three tenths of a kilometer in meters? 300 What is 869.3157 milligrams in grams? 0.8693157 How many milliseconds are there in 21/4 of a second? 5250 What is 0.7106013kg in tonnes? 0.0007106013 What is 5/4 of a meter in centimeters? 125 What is twenty-one quarters of a kilogram in grams? 5250 How many minutes are there in 3/8 of a day? 540 Convert 52.5223 kilograms to micrograms. 52522300000 How many millilitres are there in 74792.5l? 74792500 How many micrograms are there in five quarters of a milligram? 1250 Convert 0.572193 centimeters to nanometers. 5721930 What is three eighths of a gram in milligrams? 375 Convert 57045.15nm to centimeters. 0.005704515 What is 5050.71 months in centuries? 4.208925 Convert 6995.656 micrometers to millimeters. 6.995656 How many milliseconds are there in 6/5 of a minute? 72000 What is 0.556602 decades in millennia? 0.00556602 What is twenty-seven fifths of a milligram in micrograms? 5400 Convert 13.87373 meters to kilometers. 0.01387373 What is 3/10 of a decade in years? 3 How many kilometers are there in 0.8496146um? 0.0000000008496146 Convert 3814.954 millennia to centuries. 38149.54 What is 289.3173s in milliseconds? 289317.3 What is 633.5325 hours in microseconds? 2280717000000 What is 1/10 of a gram in milligrams? 100 What is 139.9506 millilitres in litres? 0.1399506 What is 7/16 of a centimeter in micrometers? 4375 What is 17/2 of a century in months? 10200 What is 1/10 of a centimeter in micrometers? 1000 How many nanoseconds are there in seventy-four fifths of a microsecond? 14800 What is 19/4 of a centimeter in micrometers? 47500 What is 56546.38ml in litres? 56.54638 Convert 1238.253ng to milligrams. 0.001238253 How many hours are there in 145893.5 days? 3501444 What is 35974.5mg in tonnes? 0.0000359745 Convert 0.2485018 litres to millilitres. 248.5018 How many millimeters are there in 91.88649um? 0.09188649 What is 0.2640068 days in hours? 6.3361632 How many millilitres are there in 1/4 of a litre? 250 How many millilitres are there in 3/25 of a litre? 120 How many nanometers are there in 3/25 of a micrometer? 120 How many years are there in fourty-two fifths of a decade? 84 How many seconds are there in 1/6 of a minute? 10 How many micrograms are there in 51/4 of a milligram? 12750 Convert 89517.97 centuries to millennia. 8951.797 What is 3/40 of a tonne in kilograms? 75 How many nanograms are there in 86406.03g? 86406030000000 Convert 521431.8 centuries to months. 625718160 How many minutes are there in three tenths of a hour? 18 What is 516.5349 months in decades? 4.3044575 How many minutes are there in 3/5 of a hour? 36 What is seven quarters of a litre in millilitres? 1750 What is one quarter of a litre in millilitres? 250 Convert 7015.169 milligrams to micrograms. 7015169 What is fifty-nine fifths of a microgram in nanograms? 11800 Convert 785.9078l to millilitres. 785907.8 How many seconds are there in 77.5312us? 0.0000775312 How many years are there in 27/2 of a century? 1350 Convert 4.775559l to millilitres. 4775.559 What is one twentieth of a millennium in years? 50 What is 322.326l in millilitres? 322326 What is sixteen fifteenths of a millennium in months? 12800 How many years are there in 2851.33 millennia? 2851330 How many millilitres are there in 88/5 of a litre? 17600 What is thirty-one fifths of a hour in seconds? 22320 Convert 36.274	{ "pile_set_name": "DM Mathematics" }
b = -113 - -104. Let s(f) = f*3 + 11f*2 + 13f + 18. Let n be s(b). Calculate the highest common divisor of n and 14. 7 Let d be (-1 + (-438)/9)3. Let i = d - -233. Calculate the greatest common divisor of i and 12. 12 Let z = -937 - -963. Calculate the greatest common divisor of z and 182. 26 Suppose 2b - 308 = 2n - 7n, -2b - 2n + 308 = 0. What is the highest common factor of 44 and b? 22 Suppose -4t - 37 + 13 = 0. Let s be (22/t)/((-1)/3). Suppose 0 = 49x - 53x + 440. Calculate the greatest common factor of x and s. 11 Let w be ((-120)/160)/(3/(-92)). Calculate the greatest common factor of w and 23. 23 Suppose -2k - d = -14 + 7, 2d + 10 = 0. Suppose 0 = -b - 3, -3b - 1 = s - 7. Calculate the greatest common divisor of k and s. 3 Let u = 4536 + -2664. What is the highest common factor of 39 and u? 39 Suppose j - 5 = -0. Let b(c) = -12c - 592. Let v be b(-51). What is the greatest common factor of j and v? 5 Let v be 21/1464/3. Let l be (-4)/1-21. What is the highest common divisor of l and v? 8 Let t(f) = 2f3 - 7f*2 + 7f + 5. Let n be t(3). What is the greatest common factor of 3 and n? 1 Let o be (-2 + 2 - -16) + 2. Let d = -43 + 52. Let q be (2/(-6))/(d/(-1215)). Calculate the greatest common divisor of o and q. 9 Let c = 6 - 4. Let r(i) = -i - 2. Let x be r(-7). Suppose 0 = -2h - 5j + 40, xh + 10j - 13j - 100 = 0. What is the greatest common divisor of c and h? 2 Let o be 3 + 71 + -4 - 0. Suppose -7q - 17q + 720 = 0. Calculate the greatest common factor of q and o. 10 Let f be (5/(-50)-36)/((-9)/(-30)). Calculate the highest common divisor of f and 60. 12 Let y be ((-12)/20)/((-27)/(-15) + -2). Suppose 4h - 2 - 10 = 0, yh = -l + 105. Calculate the highest common divisor of 12 and l. 12 Let d(n) = 20n - 375. Let f be d(19). What is the highest common divisor of 605 and f? 5 Suppose u + 14 = 38. Calculate the greatest common factor of 156 and u. 12 Let x be (-84)/9(4 + 23/(-2)). Calculate the highest common divisor of 20 and x. 10 Suppose -27c - 5796 = -31c. Calculate the greatest common factor of 23 and c. 23 Suppose 12r - 568 = 8r + 2z, 0 = r + z - 136. Let s be ((-12)/8)/(6/(-80)). What is the greatest common divisor of r and s? 20 Suppose 2l + 14 = -2. Suppose -5k = -2o + 5o + 16, 0 = o - k. Let h be (-142)/l + o/(-8). Calculate the highest common factor of h and 12. 6 Let p = -44 + 37. Let w(j) = -j3 - 9j*2 - 17j - 1. Let t be w(p). Calculate the greatest common factor of 50 and t. 10 Let j = 2 + -1. Let a(l) = 2l2 + 1. Let s be a(-1). Calculate the highest common divisor of s and j. 1 Let x be (-5 + 1)(2 + (-30)/(-8)). Let j = x - -42. What is the greatest common factor of j and 76? 19 Let l(b) = -b*2 + 4b - 2. Let y be l(1). Let c be y - (0/3 - -2). Let h(r) = -11r. Let g be h(c). Calculate the greatest common factor of 88 and g. 11 Suppose -8h = -8 - 88. Let d be 637/14 + 1/2. Let p = d + -28. What is the highest common factor of h and p? 6 Let x(b) = -26b - 49. Let z be x(-4). Calculate the highest common divisor of z and 44. 11 Let k be -12/(3 + -2). Let o be (143 + -9)k/(-4). Suppose 4b + o = 391. What is the highest common factor of 9 and b? 9 Let n(b) = -210b - 673. Let l be n(-5). What is the highest common divisor of l and 29? 29 Suppose 27 = 2g - 2h - 21, -4h = -4. Suppose g = l + 3. Suppose 96 + 123 = 29j - 100. What is the greatest common factor of l and j? 11 Suppose 2k - 3 = -r - 5, 1 = -k - 5r. Let n be ((-4)/6)/(k/96). Calculate the highest common divisor of 8 and n. 8 Let v(b) = b2 - 2b - 6. Let n be v(-4). Suppose 0 = 5f - 3t + 2 - 6, 2f + 4 = 4t. What is the greatest common factor of f and n? 2 Let t = 330 + -265. Calculate the highest common divisor of t and 10. 5 Let u = 276 - 150. Let o(l) = 9l. Suppose -2v + 8 = 2v. Let a be o(v). Calculate the greatest common divisor of u and a. 18 Suppose 112n - 348 = 110n. What is the highest common factor of 1914 and n? 174 Suppose 8d + 7788 = 19d. What is the greatest common factor of 6 and d? 6 Let i(z) = 2z*2 - 4z - 10. Let s be i(-3). Let j(q) = 5q - 34. Let u be j(s). Calculate the greatest common factor of 44 and u. 22 Suppose -m - 4w = -5w - 83, -403 = -5m - w. Suppose 25y - 1666 = -316. What is the greatest common divisor of m and y? 27 Let h(u) = 3u - 1. Let s be h(3). Let f be (-3)/(3/(-1))17. Suppose -y - 3r - f = -2y, -2r = 5y. What is the highest common divisor of s and y? 2 Suppose 27 = a + 2a. Suppose 257 - 41 = 3c. What is the greatest common divisor of c and a? 9 Let q = 755 + -307. Calculate the highest common factor of q and 128. 64 Let d = 463 + -307. What is the highest common divisor of d and 858? 78 Suppose 0 = -8f + 207 - 39. What is the highest common factor of f and 399? 21 Suppose 2m = 36 + 18. Let z = m - 12. Let d be z - (2 + 0 + 1). What is the greatest common factor of d and 4? 4 Let t = -3 + 19. Let s = 4 + t. What is the highest common factor of 10 and s? 10 Let o(z) = z + 5. Let g be o(-6). Let w be 10/(-10)(-109 - g). Calculate the highest common divisor of w and 18. 18 Suppose 2z = -5u + 2u + 24, 0 = 4z + 2u - 48. Suppose -4b + z = -4t, 6b - 3 = 3b - 3t. What is the greatest common divisor of b and 14? 2 Let n = 243 - 211. What is the highest common divisor of 224 and n? 32 Let k be 3 + ((-2)/5 - 1935/(-25)). What is the greatest common divisor of 40 and k? 40 Let n = 28 - 24. Let t be 5/(5/238) - n. Let o = -94 + t. Calculate the highest common divisor of 20 and o. 20 Let p = -23 + 46. Suppose -2x + x - 8 = h, -3x - 2h - p = 0. Let w(j) = -2j - 2. Let c be w(x). What is the highest common factor of c and 18? 6 Let g be (-20)/6(5 - 2). Let w be g/(-15) - 806/(-6). Let o = 66 - 39. What is the greatest common factor of o and w? 27 Suppose 0 = 4v + 20 - 128. Suppose 0p = 3p + v. Let b = 19 - p. Calculate the highest common factor of b and 70. 14 Let k be ((32/20)/1)/((-18)/(-315)). Let v be ((-140)/(-3))/((-3)/(-9)). Calculate the greatest common factor of k and v. 28 Let l(s) = 2s - 28. Let w = 15 + 3. Let h be l(w). Calculate the greatest common divisor of 48 and h. 8 Let v(c) = -c2 + 11c - 46. Let w(m) = 2m - 9. Let s(h) = -2v(h) + 11w(h). Let p be s(4). Calculate the greatest common factor of p and 25. 25 Let b(l) = l2 + l + 25. Let y be b(-6). Suppose 3p = -d + y, -4p + 3d + 33 = -49. What is the highest common factor of p and 114? 19 Suppose 4d + 2 - 42 = 0. Suppose 14g - 100 = dg. Calculate the highest common factor of g and 25. 25 Let y be 40/(-30) - (0 + (-760)/3). What is the highest common factor of 819 and y? 63 Let j be 117/(4/(-10)(-15)/4). Let n = j - 40. What is the greatest common divisor of n and 380? 38 Let p be 14/(-8) + 2 + (-552)/(-96). Let n be (0 + -2)/(2 - 3). Calculate the highest common factor of p and n. 2 Let p = -61 + 78. Suppose -187 = -2z + 51. Calculate the highest common factor of z and p. 17 Let t be 21/28 - (-677)/4. Suppose 0 = 3m - t - 10. Suppose 3p = 8p - m. Calculate the highest common divisor of p and 36. 12 Let s = 68 - 58. Let h(x) = -34x + 2. Let u be h(-2). Calculate the greatest common factor of s and u. 10 Suppose -35f - 312 = -39f. Suppose f = 5q - 2i, q = -q - 5i + 37. What is the highest common divisor of 128 and q? 16 Suppose 0 = 5y - 9y + 96. Suppose -3n + n = -y. Calculate the greatest common factor of 3 and n. 3 Let t(l) be the first derivative of 6l - 5 - 1/2l2. Let h be t(4). Calculate the greatest common divisor of h and 14. 2 Let f be ((-645)/(-24))/5 - (-12)/(-32). What is the greatest common divisor of 5 and f? 5 Suppose 0 = -2w + 7w. Suppose -c + 66 = 5u, u + 4c = -0u - 2. Suppose -5g + 21 + u = w. What is the highest common factor of 56 and g? 7 Let r = 341 - 176. Suppose 4v + 8 = 0, 3b - 3v = -r + 36. Let s = -17 - b. What is the highest common divisor of 84 and s? 28 Suppose 8f - 4 = 6f. Suppose -fv + 2 = -v. What is the greatest common divisor of 22 and v? 2 Suppose -3b - 10b + 364 = 0. Suppose -2g + 704 = 2g. Let p = g + -92. Calculate the highest common divisor of b and p. 28 Let p(x) = -x3 - 7x*2 - 6x + 2. Let q be p(-6). Suppose qr = 4r - 76. Let b be 38/((48/30)/4). Calculate the greatest comm	{ "pile_set_name": "DM Mathematics" }
126 - 5d6/12 + 1357d*5/60 - 61d*2 + 1. Find the third derivative of k(g) wrt g. 2400g*3 - 300 Suppose w - 4v = -3w + 16, 0 = -3w + 5v + 10. Suppose -wc + 38 = -17. Differentiate 33 + 3f - 4f - c - 6f with respect to f. -7 Let i be (7/21)/(3/4) + (-8)/18. Let n(a) be the first derivative of ia + 4a2 - 8/3a*3 + 1. What is the second derivative of n(b) wrt b? -16 Let v be (126/35)/(3/10). Suppose 7k = 11k - v. What is the third derivative of -8g*2 + 507g + kg6 - 507g - 2g6 wrt g? 120g*3 Suppose 4q + 2r = 14, 5q - 22r - 19 = -25r. Find the first derivative of 50z2 - 154z*q - 74 + 54z*2 wrt z. -100z Let q(t) be the third derivative of 169t9/21 - 157t5/30 - t4/8 + t*3/3 + 39t*2 + 55. Find the third derivative of q(w) wrt w. 486720w*3 What is the second derivative of 8 - 313v + 4 - 14 + 121v5 + 5v*4 + 4v*4 wrt v? 2420v*3 + 108v*2 Suppose -17y - 120 = 7y. Let f(n) = -150n*2 + 4n + 127. Let j(b) = 301b2 - 10b - 255. Let h(r) = yf(r) - 2j(r). Differentiate h(a) with respect to a. 296a Let v(l) = 3l + 8. Let c be v(-2). Find the first derivative of 2 - 7 + 2p + 3 + 6p*c + 27 wrt p. 12p + 2 What is the second derivative of 419n - 7288632n*3 + 33n*4 + 7288632n*3 - 31n*2 wrt n? 396n*2 - 62 Let a(i) = -1935i + 2373. Let o(c) = 1922c - 2373. Let j(b) = 5a(b) + 4o(b). What is the derivative of j(t) wrt t? -1987 What is the third derivative of 4526y2 + y3 + 723 - 4527y2 - 1716 + 4395y*4 + 2753y*4 - 1220 wrt y? 171552y + 6 Let i(h) be the first derivative of 72h2 + 1/3h*3 + 0h*6 + 0h*4 + 0h*5 + 0h + 13h7 - 28. What is the third derivative of i(f) wrt f? 10920f*3 Suppose 118h = -39h. Let o(l) be the third derivative of 25/24l*4 + 0l + 0 + l*2 + hl*3 - 1/12l*5. Find the second derivative of o(n) wrt n. -10 Let g be (5 + -4)/((-136)/(-45) + -3). What is the first derivative of -275 - gu + 131u + 6u + 83u wrt u? 175 Let s(h) be the first derivative of -1626h*2 - 1339h - 881. What is the derivative of s(d) wrt d? -3252 Let x(o) be the first derivative of 5o6/6 - o4/2 + 78o*3 + 23o*2/2 + 57o + 2216. Find the second derivative of x(u) wrt u. 100u3 - 12u + 468 Suppose -c - 3y = 0, 4c - 4y - 3 = 5c. Find the second derivative of cq + 3q*2 - 7q*4 + 42q*4 - 3q*2 wrt q. 420q*2 Let k(d) be the second derivative of 0d*7 + 0d*3 + 139/28d*8 + 0d*2 + 0d*5 - 116d + 0d6 + 0 - 5/6d*4. Find the third derivative of k(f) wrt f. 33360f*3 What is the second derivative of 7a*5 + 247113a*2 - 4a*4 - 247148a*2 + 2a*4 - 7315a wrt a? 140a3 - 24a*2 - 70 What is the second derivative of -292k + 1 - 2k4 - 131k - 3 + 153k2 wrt k? -24k*2 + 306 Find the second derivative of -2v + 9v2 - 223 - 480 + 7997v*4 - 7643v*4 wrt v. 4248v*2 + 18 Suppose 0 = -2d - 9 + 127. Let c = -57 + d. What is the third derivative of 9hc + 0 + 21h3 - h2 + 0 wrt h? 126 Let v be (-20)/(-9) - (-14)/(-63). What is the second derivative of -1 + 0j2 + 40j*v + 301j - 304j wrt j? 80 Let s be (-1939)/(-14) + 30/12. Differentiate -9 - 84c - sc + 64 + 104 with respect to c. -225 Let p(h) be the third derivative of -11h*8/280 - 4h*4 - 23h*3/6 - 39h*2. Let r(q) be the first derivative of p(q). Differentiate r(n) wrt n. -264n*3 What is the derivative of 1751 + 370k - 10469 - 5k + 603k wrt k? 968 Find the second derivative of 2q - 59q*2 + 843 + 572q*2 + 43q*2 - 138q*2 + 417q*2 wrt q. 1670 Differentiate -6503d*2 + 894 + 5092d*2 + 3415d*2 with respect to d. 4008d Find the second derivative of -1208s4 + 6983s - 2822s4 + 2047s wrt s. -48360s2 Let l(m) be the third derivative of -10m*2 - 1/105m*7 + 0m*3 + 5/24m*6 + 1/5m*5 + 0 + 0m - 1/24m4. Find the third derivative of l(z) wrt z. -48z + 150 Let f(g) = 10465g - 18423. Let c(p) = -5231p + 9212. Let u(k) = -13c(k) - 7f(k). What is the derivative of u(h) wrt h? -5252 Suppose -3 - 30 = -3w. Suppose -27 = -wa - 5. What is the third derivative of aj2 + 3j*2 + 103 - 57 - 51 - 39j*3 - 2j*5 wrt j? -120j*2 - 234 Let i(x) = -38x*2 - 230x + 2279. Let y(b) = -5b2 + b - 1. Let j(m) = i(m) - 7y(m). Differentiate j(t) wrt t. -6t - 237 Let d(c) = -198c*3 + 75c*2 - 7c - 7583. Let r(m) = 592m3 - 200m*2 + 21m + 22749. Let j(a) = -8d(a) - 3r(a). Differentiate j(t) wrt t. -576t2 - 7 Let s(z) be the third derivative of 0 - 4z*2 - z + 1/30z*5 + 8/3z*3 + 0z*4 + 1/30z*6. Differentiate s(w) with respect to w. 12w*2 + 4w Let d = -44 - -54. Suppose -7w - 18 = -dw. What is the third derivative of -18v2 - 7v*6 + 22v*w + 134v*4 - 134v*4 wrt v? 1800v*3 What is the derivative of -325u - 1371 + 1447u + 1517u + 1016u + 1952u wrt u? 5607 What is the third derivative of 713l3 - 2045l*3 - 118l*2 + 107l - 107l - 363l*2 wrt l? -7992 Find the second derivative of -1307u*5 + 83u + 67u - 25u + 387u + 197u wrt u. -26140u3 Let a(v) = 1441v*4 - 33v*2 - 33v - 616. Let j(z) = -180z4 + 4z*2 + 4z + 77. Let h = 203 - 207. Let r(f) = ha(f) - 33j(f). Differentiate r(n) wrt n. 704n3 Suppose f = 3, 109 = 5a + 4f + 22. Let d be (150/(-18) + 7)a-1. What is the second derivative of ds + 5s2 - 9s + s wrt s? 10 Suppose -15b - 222 = -21b. Find the third derivative of 84d2 + bd*4 + 13d*3 - 45d*4 + 95d*2 wrt d. -192d + 78 Differentiate 521u - 40 + 159 + 154 - 32 + 129 with respect to u. 521 Let a(o) = 6661o + 2849. Let m(r) = -6647r - 2854. Let k(j) = 5a(j) + 4m(j). Find the first derivative of k(n) wrt n. 6717 What is the third derivative of 2y*2 - 1167y*6 + 1403 + 5y*2 + 7180y*6 + 3800y*6 + 66y - 1401 wrt y? 1177560y3 Find the third derivative of -493n*3 - 286n*3 - 5n*2 - 26n*2 + 4n wrt n. -4674 Let q(d) be the first derivative of -2353d5/5 - 3d*4/4 + 2d3/3 - d2/2 - 671d - 9565. What is the third derivative of q(u) wrt u? -56472u - 18 Let n(q) be the first derivative of 175q4/12 - 209q*3/6 - 76q + 57. Let l(k) be the first derivative of n(k). What is the second derivative of l(m) wrt m? 350 Let w(j) = 2j - 19. Let z be (1/(-2))/(3(-3)/198). Let d be w(z). What is the second derivative of 4q - dq - 26q - 12q*4 wrt q? -144q*2 Let q(b) be the third derivative of -29b7/210 - b4/24 - 199b3/6 - 891b*2. What is the first derivative of q(p) wrt p? -116p*3 - 1 Let u(z) be the first derivative of 4057z*5/5 + 1728z + 3057. What is the first derivative of u(r) wrt r? 16228r3 Let b(m) be the first derivative of 43/4m*4 - 54 - 19m*3 + 0m*2 + 0m. What is the third derivative of b(n) wrt n? 258 Let j(g) = -7g2 + 14g - 1. Let y be j(2). Let t be ((-11)/(-3))/(-11)33/y. Find the second derivative of -tx - x*4 + 13 + 26x - 13x - x2 wrt x. -12x*2 - 2 Let f(x) = -10x - 40. Let b be f(-5). Suppose -58 = -2r - r - 2p, b = 5p. What is the third derivative of -r + 30 - 12 + 27v*4 + 36v*2 wrt v? 648v Let j(m) be the first derivative of 222m7 + 514m*3 + 711. Find the third derivative of j(k) wrt k. 186480k*3 Let d(a) = -642a + 3179. Let o(z) = 608z - 3181. Let w(q) = 5d(q) + 4o(q). Differentiate w(u) wrt u. -778 Let l(n) = -12n + 134. Let y be l(7). What is the second derivative of 115v5 - yv*5 - 6v*5 + 157v*5 - 8v wrt v? 4320v3 Let n(m) be the first derivative of -183m3 + m2/2 - 562m + 541. Find the second derivative of n(f) wrt f. -1098 Let v(a) = -a2 - 9a. Let f(k) = 1493k2 + 408k. Let t(c) = -f(c) - 2v(c). Find the second derivative of t(i) wrt i. -2982 Find the third derivative of -149d*2 - 1848d*4 + 5416460 - 5416460 wrt d. -44352d Let v(s) be the second derivative of -13s5/20 + 23s*4/2 - 1274s*2 + 9098s. What is the derivative of v(m) wrt m? -39m2 + 276m Let z(s) = -68s + 20. Let c be z(-1). What is the first derivative of c - 16w + 1486w3 - 2971w*3 + 1486w*3 wrt w? 3w*2 - 16 Let i(h) be the second derivative of 224h - 93/2h2 + 7/3h*3 + 0. Find the first derivative of i(l) wrt l. 14 Let v(b) be the second derivative of -247b6/10 - b4/4 - 10411b*2/2 + 3	{ "pile_set_name": "DM Mathematics" }
a) 15 (b) 5/3 (c) 0.1 c What is the nearest to 1 in 2, -3, 16/3, 7? 2 What is the nearest to 0.1 in -3/2, -0.4, -3, -5? -0.4 Which is the closest to -0.3? (a) 9/13 (b) 0.3 (c) -2 b What is the nearest to 2/7 in 2/11, 6/5, 3/5, -0.3? 2/11 What is the nearest to 2/5 in -22, 0.4, -4? 0.4 Which is the nearest to 0.1? (a) -0.2 (b) -0.1 (c) -28 b Which is the nearest to -0.1? (a) 2 (b) 0 (c) -15/7 b Which is the nearest to -1? (a) 5 (b) 3 (c) -2 c Which is the closest to 0.1? (a) 0.2 (b) -4 (c) 5 (d) -1 a What is the nearest to -1 in 0.11, 3, 2/9, 2/3? 0.11 Which is the closest to -11? (a) -26 (b) 0.2 (c) -0.4 c Which is the nearest to -1? (a) -2 (b) -0.5 (c) -0.1 (d) 39 b What is the closest to 0 in -4, 0.26, 0, 0.2? 0 What is the nearest to 0.19 in 0, 1, -0.12? 0 What is the nearest to 0.5 in -4, 58, -3? -3 What is the closest to -7 in 4, -0.3, -0.1, -2? -2 Which is the nearest to -15? (a) -2 (b) 0 (c) 1 a What is the closest to 1 in 3, 2/13, 13, 0.2? 0.2 Which is the closest to -4? (a) 1/4 (b) -0.2 (c) 4 b Which is the nearest to -1/3? (a) 5 (b) -53 (c) -31/6 c What is the nearest to -8 in 2, -1/9, 2/7, 2/13? -1/9 Which is the closest to 4? (a) 3 (b) 1/17 (c) 1 a What is the nearest to 0 in 0.02, 0.26, -5, 0? 0 What is the nearest to 0.1 in -2, 23, 0.4, -1/4? 0.4 What is the closest to 0 in -1, 0.5, -286? 0.5 Which is the closest to 1? (a) -2 (b) 0.05 (c) 1/5 c What is the closest to 3 in -2/3, 1, -3/4, -2/21? 1 What is the closest to 0 in 2/7, 33, -0.5, -3? 2/7 What is the closest to 0.2 in -0.2, 0.94, 1? -0.2 What is the nearest to -5.73 in 2/13, -2, -3/4? -2 Which is the nearest to 0.3? (a) -2 (b) -0.3 (c) -1/2 (d) 0.06 d What is the nearest to 0 in -0.4, 4, 0.7? -0.4 Which is the closest to -9? (a) -28 (b) 4/7 (c) -8 c What is the closest to -1/2 in -5, 0, 4/5, -0.01? -0.01 Which is the nearest to -1? (a) 3/4 (b) 9800 (c) -3 a Which is the closest to -5? (a) 1 (b) -165 (c) 0 (d) -5 d What is the closest to -0.1 in 4, -0.3, -5, -1? -0.3 Which is the nearest to -14? (a) -1 (b) 1/2 (c) -0.2 (d) -3 d Which is the closest to 10/9? (a) -2/3 (b) 1/5 (c) -1/18 b What is the closest to 0.1 in -3, 0.3, 7.11? 0.3 What is the closest to 1 in 4, -1/153, 2/15? 2/15 What is the nearest to -2 in 4, -0.2, 3, 1? -0.2 Which is the closest to -0.2? (a) 4 (b) -19 (c) 0.5 c What is the closest to 0 in -166, -4/7, 2, 0.3? 0.3 What is the nearest to 0.1 in 0.031, -6/7, -1/3? 0.031 Which is the nearest to -2/3? (a) 0.5 (b) -1/6 (c) -1 (d) -2/3 d What is the nearest to 9 in 0, -2/5, -2/3? 0 Which is the nearest to 3/2? (a) 2.2 (b) 1 (c) -3/7 (d) 0.4 b What is the nearest to -7 in 1, -0.3, 1/2, -13? -13 What is the nearest to 0.2 in -4, -0.3, 1/4, 12? 1/4 Which is the nearest to 1/2? (a) -0.02 (b) -12 (c) -1/7 a What is the closest to 2 in 1/7, -0.2, 2, 6? 2 Which is the nearest to 1? (a) 2 (b) 0.2 (c) -2/29 b What is the closest to 5/2 in -1, 0.5, 1, -1/2? 1 What is the closest to -1 in -0.4, 13, 3, 1/2? -0.4 What is the nearest to 18 in -3, 0.2, -5/2, -2? 0.2 Which is the nearest to -1? (a) 3 (b) -0.3 (c) 2/19 b Which is the closest to -0.2? (a) 0.5 (b) 0.8 (c) -2 a Which is the nearest to 1/4? (a) -2/15 (b) -1/4 (c) 1 (d) 0.3 d Which is the closest to -5/3? (a) 6 (b) 0.5 (c) -4/5 c Which is the closest to 0? (a) -1/2 (b) -2 (c) -3 (d) 5/7 a Which is the closest to -1? (a) -3 (b) -5 (c) 0.13 (d) -0.1 d Which is the closest to 0.1? (a) 0.2 (b) -3.3 (c) 4 (d) -20 a Which is the nearest to -1? (a) -4 (b) 2/25 (c) 0 (d) 4 c What is the closest to 2/3 in 2/11, -2, -13, 6/11? 6/11 Which is the nearest to 2/7? (a) 1 (b) 9 (c) -5 (d) 43 a What is the closest to -2 in -0.06, -0.4, 1/4, 4? -0.4 Which is the nearest to 0.1? (a) 0 (b) 0.4 (c) 144 a What is the nearest to 2/3 in 2/15, -2/131, -2/3? 2/15 Which is the closest to 0? (a) 2 (b) 3 (c) -0.5 (d) -6 c Which is the closest to -1/2? (a) 4 (b) 3 (c) -0.2 c What is the closest to -1/4 in 0, 3/4, -4, 2? 0 What is the nearest to -0.1 in 2, -2, -7/165? -7/165 Which is the nearest to 1? (a) 14/3 (b) -2 (c) -4/7 c What is the nearest to -1 in -2, -1.2, 0.4, -43? -1.2 Which is the nearest to 0? (a) -1/4 (b) 2 (c) -63 (d) 4 a What is the closest to -2/7 in 0.7, -13, -5/4? -5/4 What is the nearest to -1/5 in 2, 2/3, -2/41? -2/41 What is the closest to -0.1 in -1, 76, 0.1? 0.1 Which is the nearest to -283? (a) -0.4 (b) 1/3 (c) 0.1 a Which is the closest to -1? (a) 2/9 (b) 1/5 (c) -3/2 c What is the nearest to 0.7 in 5, 2/5, -0.08? 2/5 What is the nearest to -2/97 in -2, 4/5, 2, 1/5? 1/5 Which is the nearest to 100? (a) -1 (b) 0.46 (c) -1/5 b What is the closest to 1 in -1.22, -3, -0.1, -5? -0.1 Which is the closest to -2/7? (a) -1 (b) -0.3 (c) -5 (d) -0.1 b What is the closest to 0 in 4, -2, -37, -0.4? -0.4 Which is the closest to -1? (a) 0 (b) -0.1 (c) 0.1 (d) -14 b Which is the closest to 2? (a) -2 (b) -5/7 (c) 0 (d) -1/3 c What is the nearest to 2/825 in 2, 0.3, 0? 0 Which is the closest to -18? (a) 1/3 (b) 4 (c) 2 (d) 3 a Which is the closest to 2/5? (a) -1.5 (b) -0.2 (c) 1/6 c Which is the closest to 8? (a) 0.5 (b) 1/5 (c) -0.2 (d) 0 a What is the closest to -5 in -4/7, -3, -0.16, 0? -3 Which is the closest to 4/13? (a) 7 (b) 3 (c) 2 (d) -23 c What is the nearest to 1/4 in 0.1, 9, -0.1? 0.1 What is the closest to 0.1 in 1, -2, 3? 1 What is the closest to 0.07 in -1.14, -1, -0.1? -0.1 What is the closest to -0.1 in -10/3, -10, 4, 0.3? 0.3 Which is the nearest to 2? (a) -3/4 (b) 2/389 (c) -3 b What is the nearest to -18 in -4/7, -4, 0, -2? -4 Which is the closest to -2? (a) 2 (b) 3 (c) -8/37 c What is the nearest to -4 in 2, -5/6, 2/7, 1/3? -5/6 What is the closest to -21 in -0.4, 3/5, -1? -1 Which is the closest to 3/67? (a) -3 (b) -3/4 (c) -0.02 c Which is the nearest to 1? (a) -0.4 (b) 0.4 (c) 2/7 (d) -2/9 b What is the nearest to 0.1 in -0.4, -15, 2/87? 2/87 What is the closest to 0 in -0.3, 1, 0.24, -5? 0.24 What is the nearest to 0.1 in 31, -2/11, -1, 3/5? -2/11 What is the closest to 1/3 in 51, 5, 0? 0 What is the nearest to 0.1 in -2/19, 0.022, 0.2, 0.3? 0.022 What is the nearest to 3/7 in -1.7, 3, -2/5, -1/4? -1/4 Which is the closest to 39? (a) 0.1 (b) 2/3 (c) -4 b Which is the nearest to 0? (a) -2/7 (b) -15/2 (c) -5/69 c What is the nearest to -0.1 in -22, 0.5, -3? 0.5 Which is the closest to -1? (a) -140 (b) 2/5 (c) 2 b What is the closest to 0.3 in -1/2, -2, -2/15? -2/15 Which is the nearest to -2/3? (a) 1 (b) -33 (c) 15.4 a What is the nearest to -0.3 in -0.5, 2/5, -0.09? -0.5 Which is the nearest to 0.1? (a) -3 (b) -0.28 (c) 2 b What is the closest to -1 in 2/9, -12, -0.04, -1? -1 What is the closest to -2/9 in -2/17, -20, -0.3, -0.1? -0.3 Which is the nearest to -0.4? (a) 9 (b) -2/15 (c) 1 (d) -0.6 d What is the nearest to -2 in 0, -28, -0.4, -1? -1 Which is the closest to -1? (a) 5 (b) -1/3 (c) 3/5 b What is the closest to -2/7 in 0, -10, -2? 0 Which is the closest to 61? (a) -1/4 (b) 0.4 (c) -1/8 (d) -0.3 b What is the closest to -2/7 in 108, -0.3, -1/5, 3? -0.3 What is the nearest to 0 in 5, 0.2, 3? 0.2 Which is the nearest to 5? (a) 0.1 (b) 1/2 (c) 3/5 c What is the closest to 2/7 in -3, -2, 36? -2 What is the nearest to 1/5 in 6/7, -1, -0.8? 6/7 What is the nearest to 2 in -16, 3, 2/13? 3 What is the closest to 0 in 0.1, -1, -2/11, -4/5? 0.1 Which is the nearest to 2/3? (a) 2 (b) 88 (c) 2/7 (d) 0 c What is the nearest to -10 in -2, 3/4, -0.3, 1? -2 Which is the closest to 2? (a) -5 (b) -2 (c) -0.16 (d) 3 d Which is the nearest to -0.1? (a) -18 (b) -0.2 (c) 4 (d) 0.12 b What is the nearest to 0.2 in -5, 0.3, 0.5, 2/5? 0.3 Which is the closest to 3? (a) 0 (b) -0.18 (c) -4 a Which is the closest to -2/5? (a) -0.1 (b) 0 (c) -0.2 (d) -3 c What is the nearest to -1 in -0.2, 4, 2/13, -2/29? -0.2 Which is the closest to -1/2? (a) 2 (b) 3 (c) -1 (d) 2/7 c Which is the nearest to 0.2? (a) 0.12 (b) 7/5 (c) -5 a Which is the closest to 20? (a) -0.02 (b) -5 (c) 3 (d) -0.4 c What is the nearest to -1/10 in 0, -0.3, 0.01, -2? 0 What is the nearest to 0.1 in 5, -0.3, -0.01, 5/3? -0.01 Which	{ "pile_set_name": "DM Mathematics" }
ccx when three letters picked without replacement from yyccpyxycpb? 1/165 Two letters picked without replacement from {p: 2, z: 1, q: 3, u: 3, m: 9, l: 1}. Give prob of sequence pp. 1/171 What is prob of sequence wh when two letters picked without replacement from qqwhhqq? 1/21 Calculate prob of sequence eq when two letters picked without replacement from eesseseqeqseeq. 3/26 Three letters picked without replacement from {v: 1, u: 1, i: 1, e: 1, h: 2, p: 1}. Give prob of sequence hph. 1/105 Two letters picked without replacement from drkejji. What is prob of sequence dk? 1/42 Three letters picked without replacement from {v: 1, c: 1, y: 1, n: 1, p: 3}. What is prob of sequence pyv? 1/70 Two letters picked without replacement from tttrtbttjrrk. Give prob of sequence jt. 1/22 What is prob of sequence viym when four letters picked without replacement from ssmysgmsssssmsismysv? 1/14535 Calculate prob of sequence eo when two letters picked without replacement from {o: 10, e: 10}. 5/19 Two letters picked without replacement from {q: 1, n: 3, e: 5}. Give prob of sequence qe. 5/72 What is prob of sequence jfp when three letters picked without replacement from pppfjffppf? 1/36 What is prob of sequence eo when two letters picked without replacement from {z: 5, o: 1, b: 5, e: 7}? 7/306 Calculate prob of sequence nnn when three letters picked without replacement from {g: 1, f: 7, l: 2, a: 1, n: 6}. 1/34 What is prob of sequence hh when two letters picked without replacement from uuurjjhbbxhx? 1/66 What is prob of sequence mdmd when four letters picked without replacement from {m: 9, d: 3}? 2/55 Four letters picked without replacement from fyjyihhvyvvj. What is prob of sequence vyfi? 1/1320 What is prob of sequence ssq when three letters picked without replacement from qqsssstt? 1/14 Four letters picked without replacement from {n: 1, s: 2, c: 1, p: 14, b: 2}. Give prob of sequence cpbb. 7/29070 What is prob of sequence mhh when three letters picked without replacement from hyymyymmmyyymhy? 1/273 Four letters picked without replacement from aawawaaawaw. Give prob of sequence awaw. 7/110 Four letters picked without replacement from vvvvhvwvvmwvhhvmwmvv. Give prob of sequence whvh. 11/6460 Three letters picked without replacement from {y: 2, q: 2, n: 1, r: 1, t: 1}. What is prob of sequence nqt? 1/105 What is prob of sequence wy when two letters picked without replacement from cllwyxl? 1/42 What is prob of sequence aawv when four letters picked without replacement from {a: 8, v: 5, w: 3}? 1/52 Calculate prob of sequence oyoh when four letters picked without replacement from {h: 2, y: 3, o: 3, p: 1, f: 1, j: 3}. 3/1430 What is prob of sequence qqc when three letters picked without replacement from pqczzpztctqzpd? 1/546 What is prob of sequence jjjd when four letters picked without replacement from {w: 4, d: 7, j: 5}? 1/104 Calculate prob of sequence obhc when four letters picked without replacement from {x: 4, o: 5, b: 2, i: 2, h: 2, c: 4}. 5/5814 Two letters picked without replacement from {l: 2, p: 1}. What is prob of sequence pl? 1/3 What is prob of sequence vv when two letters picked without replacement from lnpvnvvlllvvvplnvlvl? 14/95 Four letters picked without replacement from vvvvevvvvvvvevvvvvvv. Give prob of sequence veev. 1/190 Two letters picked without replacement from {e: 1, y: 3, z: 3, q: 3}. What is prob of sequence zz? 1/15 What is prob of sequence dz when two letters picked without replacement from {d: 5, b: 2, j: 4, z: 5, h: 3}? 25/342 Two letters picked without replacement from bbbb. Give prob of sequence bb. 1 Calculate prob of sequence uuww when four letters picked without replacement from {u: 3, w: 4, q: 1}. 3/70 Two letters picked without replacement from {i: 2, u: 2}. Give prob of sequence ii. 1/6 Three letters picked without replacement from {u: 7, v: 3, o: 1, l: 1, h: 2}. Give prob of sequence hvl. 1/364 Calculate prob of sequence rxx when three letters picked without replacement from gxtrxxxxxxxx. 3/55 What is prob of sequence ki when two letters picked without replacement from kkkikkkki? 7/36 Three letters picked without replacement from oororroooororoorrror. What is prob of sequence rro? 11/95 Calculate prob of sequence fkjk when four letters picked without replacement from wnjnkjjtfwkjntt. 1/4095 Calculate prob of sequence fz when two letters picked without replacement from fzfllm. 1/15 Three letters picked without replacement from xkmmbkzz. What is prob of sequence bzx? 1/168 Calculate prob of sequence aaaz when four letters picked without replacement from aaazaaaaaaaazaaaaaaa. 8/95 Calculate prob of sequence yqnn when four letters picked without replacement from {e: 3, n: 2, y: 1, r: 2, c: 7, q: 3}. 1/12240 Three letters picked without replacement from lnlbbnlnllllln. Give prob of sequence nnn. 1/91 What is prob of sequence jjj when three letters picked without replacement from {w: 4, j: 3}? 1/35 What is prob of sequence ppvp when four letters picked without replacement from vppvpppppvp? 7/55 Calculate prob of sequence nn when two letters picked without replacement from {v: 1, n: 2, b: 4, f: 2, w: 2, i: 4}. 1/105 What is prob of sequence ffyf when four letters picked without replacement from ffpykffyyyfyef? 25/1001 Four letters picked without replacement from pipu. What is prob of sequence ippu? 1/12 Three letters picked without replacement from {p: 2, i: 1, w: 1}. Give prob of sequence pwi. 1/12 What is prob of sequence nsb when three letters picked without replacement from {b: 4, s: 2, z: 1, j: 3, n: 7, u: 1}? 7/612 What is prob of sequence ggp when three letters picked without replacement from gpgop? 1/15 Calculate prob of sequence mm when two letters picked without replacement from mmmmmmmbkmbmmmmb. 11/20 What is prob of sequence zz when two letters picked without replacement from zzuuzz? 2/5 Calculate prob of sequence gg when two letters picked without replacement from gddddgg. 1/7 Four letters picked without replacement from kkrkkkrrkkkrrkrkkkk. What is prob of sequence rkkk? 143/1292 Calculate prob of sequence hwcp when four letters picked without replacement from owchp. 1/120 Two letters picked without replacement from btmtpqn. What is prob of sequence nq? 1/42 Four letters picked without replacement from {k: 3, a: 6, t: 2, c: 3, y: 2, n: 2}. What is prob of sequence ytcn? 1/3060 Calculate prob of sequence avs when three letters picked without replacement from {u: 2, l: 1, v: 2, s: 2, a: 3, o: 2}. 1/110 Three letters picked without replacement from {l: 15, x: 4}. What is prob of sequence llx? 140/969 Four letters picked without replacement from {s: 2, u: 3}. Give prob of sequence uuss. 1/10 Calculate prob of sequence ub when two letters picked without replacement from {h: 1, u: 2, b: 1, m: 1}. 1/10 Three letters picked without replacement from uicccsiscb. What is prob of sequence bcu? 1/180 What is prob of sequence peb when three letters picked without replacement from pbeeepebb? 1/21 Four letters picked without replacement from {l: 3, t: 1, i: 4, y: 3, c: 3, v: 1}. Give prob of sequence cccv. 1/5460 Two letters picked without replacement from llllclclcl. What is prob of sequence cl? 7/30 Two letters picked without replacement from dfm. What is prob of sequence fm? 1/6 What is prob of sequence zff when three letters picked without replacement from fffzfzf? 4/21 What is prob of sequence jhh when three letters picked without replacement from {j: 12, h: 3}? 12/455 Calculate prob of sequence ww when two letters picked without replacement from {w: 5, f: 3, y: 4, m: 1, p: 1, d: 1}. 2/21 Calculate prob of sequence htkj when four letters picked without replacement from tjhtktfktkkjfktjt. 3/1904 Three letters picked without replacement from ojvodosjjsoaddv. What is prob of sequence jaj? 1/455 What is prob of sequence nkb when three letters picked without replacement from {n: 1, b: 2, k: 3, u: 1}? 1/35 Three letters picked without replacement from geg. Give prob of sequence egg. 1/3 What is prob of sequence rgz when three letters picked without replacement from rgraaz? 1/60 What is prob of sequence zgvg when four letters picked without replacement from ozoggovvogoiv? 3/2860 Calculate prob of sequence zl when two letters pic	{ "pile_set_name": "DM Mathematics" }
t v(p) be the first derivative of n(p). Let i(f) = -f. Calculate i(v(h)). -3h2 Let h(c) = 7c. Let x(v) = 1. Let l(j) = -2j + 2. Let o be 9(-2)/(-6) - 4. Let k(y) = ol(y) + 2x(y). Determine h(k(d)). 14d Suppose -k + 1 + 0 = 0. Let u(b) = 2b*2 - 4b*2 - 1 + k. Let g(w) = -5w*2. What is g(u(t))? -20t4 Let x(z) = z2. Let q(l) = 16l. Let h(a) = -17a. Let u(t) = -3h(t) - 2q(t). Give u(x(k)). 19k2 Suppose 0 = -t - 3t. Let g(m) = tm + m + m. Let q(w) = 11w + 9. Let k(j) = 5j + 4. Let o(n) = -9k(n) + 4q(n). Determine o(g(i)). -2i Let j(d) be the third derivative of d*5/20 + 7d*2. Let l(t) = 5t. Calculate l(j(a)). 15a2 Let q(b) = -b. Let m(t) = 5t + 2t - 6t - 9t. Determine m(q(h)). 8h Let s(g) = g. Let a(k) be the second derivative of 35k3/6 - 27k. Calculate s(a(l)). 35l Let o(j) = 4j. Let r(u) be the third derivative of -u*5/20 - 11u*2. What is r(o(s))? -48s*2 Let z(b) = -4b*2. Let o(g) = 2g - 6. What is z(o(h))? -16h2 + 96h - 144 Let f(d) = 7d. Let c(b) = -b. Let l(a) = -10a*2 + 25a. Let h(q) = -25c(q) - l(q). What is h(f(s))? 490s*2 Let h(y) = 2y. Let p(b) = b*2 - 53b + 6. Calculate h(p(k)). 2k2 - 106k + 12 Let j(p) = -p*2 + 5p - 2. Let k be j(4). Let o(u) = 0u2 - 2u*k + 8u - 8u. Let f(q) be the second derivative of q4/12 - q. Give f(o(g)). 4g4 Let c(f) = f2. Let r(v) = 5v - 33v - 21v + 10v. Calculate c(r(x)). 1521x2 Let j = -1 - -3. Let s(f) = 8f + jf2 - 8f. Let g(o) = 2 + 8 + 2o - 10. What is s(g(k))? 8k*2 Let d(m) = 1. Suppose -2w - 1 = -3. Let t(g) = -g - 3. Let v(a) = wt(a) + 3d(a). Let p(q) be the third derivative of q4/24 + q2. Determine p(v(r)). -r Let s(w) = -7w + 7. Let z(x) = -2x*2. Calculate s(z(o)). 14o2 + 7 Let v(n) be the third derivative of n4/8 - 4n2. Let c(i) = -5i. Determine c(v(m)). -15m Let z(s) be the second derivative of s4/6 + s. Let b(r) = -11r*2 - 8r. Let f = 2 + 3. Let p(u) = -7u2 - 5u. Let i(n) = fb(n) - 8p(n). Give z(i(o)). 2o4 Let g(a) = 0a - 6a + 4a. Let i(q) = q*2 - 346 + 346. Give g(i(y)). -2y*2 Let r(f) = 409f2 + 2. Let l(t) = -t2. What is l(r(w))? -167281w4 - 1636w*2 - 4 Let b(h) = 9h - 3. Let w(n) = -2n2. What is b(w(f))? -18f2 - 3 Let u(x) = -x2. Let p(c) be the second derivative of -c3/6 + c. Determine p(u(i)). i2 Let x(n) = -6n. Let w(t) = 22t. Give x(w(g)). -132g Let x(m) = -11m2 - m. Let c(a) = a. Let o(y) = c(y) + x(y). Let f(h) = -h2. Calculate f(o(q)). -121q4 Let u(m) = 8m. Let z(s) = s. Let i(j) = 2u(j) - 6z(j). Let r(o) = o. Determine r(i(g)). 10g Let c = 4 - -3. Let p = c - 5. Let s(n) = 0n + pn - 3n. Let u(x) = 3x2. Give u(s(q)). 3q*2 Suppose w + 2u - 2 + 1 = 0, 2w + u = 2. Let r(f) = 8f*2 - 4f. Let x(n) = -n*2 + n. Let t(z) = wr(z) + 4x(z). Let a(v) = -v2. Determine a(t(k)). -16k*4 Let b(l) = -2l. Let i = -29/2 - -16. Let s(r) be the first derivative of 1 + ir2 + 0r. Determine b(s(n)). -6n Let d(o) = 3o*2. Suppose -3t = -5v - 9 - 11, -t + 2v + 8 = 0. Let l be (-1)/(-4) + 21/28. Let h(c) = -c + t - 1 + l. Give h(d(s)). -3s2 Let f(m) = -m2 - 3m + 3. Let l(g) = -g*2 - 2g + 2. Let p(h) = 4f(h) - 6l(h). Let t be 1 - -1 - (0 + 0). Let r(q) = q*t - q + q. Give p(r(d)). 2d*4 Let k(d) = -7d*2. Let o(c) be the first derivative of 1/3c*3 - 1 + 0c + 0c2. Give o(k(f)). 49f*4 Let a(t) = 4t. Let h(c) = 3c. Suppose 6l - l + z = 85, -5z = -2l + 61. Let n(j) = -13j. Let k(q) = lh(q) + 4n(q). Give a(k(r)). 8r Let s(h) = 252h. Let x(l) = -2l. What is x(s(t))? -504t Let w(j) = 7j. Let f(v) be the second derivative of -v*3/6 - 12v. What is w(f(r))? -7r Let y(x) = -17x + 3880 - 3880. Let j(p) = 3p. Determine y(j(k)). -51k Let a(d) = -4d2 - 2. Let x(m) = 3m*2 + 3. Let q(p) = 3a(p) + 2x(p). Let f(n) = -n2 + 2n. Let v(c) = -c. Let s(w) = -f(w) - 2v(w). Give q(s(b)). -6b*4 Let v(a) = 17a*2 + 9a + 9. Suppose 2 = -3k + 14. Let q(h) = -1 - kh*2 - 2h + 3 - 4. Let p(z) = -9q(z) - 2v(z). Let f(n) = 2n. Determine f(p(j)). 4j*2 Let x(f) = -2f. Let j = -583/60 - -49/5. Let v(s) be the second derivative of 0 + 0s2 - js*4 + 0s*3 + s. What is x(v(z))? 2z*2 Let q(l) = -9148l*2. Let p(u) = -2u. What is q(p(y))? -36592y2 Let o(m) = -2m*2. Let d(f) = -88f*2. What is d(o(v))? -352v*4 Let c(y) = 195y. Let b(k) = -2k. Determine c(b(o)). -390o Let z(w) = 118w - 1. Let g(l) = -l2. Give z(g(t)). -118t*2 - 1 Let a(m) = -m. Let c(f) = -26f*2 - 29f. Give a(c(n)). 26n2 + 29n Let m(s) = s. Let j(u) = -1333u2. Give j(m(p)). -1333p*2 Let g(u) = 4u + 2u - 3u. Let v(h) be the second derivative of h*3/6 + 69h. Give v(g(l)). 3l Let p(b) = -4b - 7. Let n(g) = -3g - 5. Let l(f) = 7n(f) - 5p(f). Let m(j) = -6j. Calculate m(l(y)). 6y Let w(r) = 10r. Let x(f) = 17f + 11f - 25f. What is x(w(y))? 30y Let b(h) = -2h - 1022. Let m(c) = 2c*2. Determine b(m(n)). -4n*2 - 1022 Suppose 5c + 25 = 5w, 5w + 4c + 2 = 3w. Let x(n) be the third derivative of 0nw - 1/24n*4 + 0n + 0 + n*2. Let k(s) = s. Give k(x(f)). -f Let m(u) = 9u*2 + 12270 - 12270. Let s(r) = 9r*2. Calculate s(m(k)). 729k*4 Suppose -2a = 5q - 4, a + q - 7 = -4q. Let u = a + 5. Let r(o) = -6o - 2o*u + 6o. Let h(m) = 2m2. Calculate h(r(b)). 8b*4 Let j(q) = -24q - 32q + 43q. Let l(h) = -2h2. Determine l(j(p)). -338p*2 Let d(s) = -4s*2. Let m be 1/(-31/(-36)). Let h(y) = y*2 - m + 12. Calculate h(d(j)). 16j*4 Let u(x) = 18908x. Let v(p) = 3p2. What is u(v(h))? 56724h2 Let l(q) = -q. Let g(u) = u2 + 11u. Let f(n) = 2g(n) + 22l(n). Let a(w) = 10w*2. Determine a(f(y)). 40y4 Let p(i) = -i2. Let l(o) = -188o + 3o*2 + 188o. What is p(l(m))? -9m4 Let f(a) = 529a*2. Let l(s) = -10s. Calculate f(l(x)). 52900x2 Let z(w) be the second derivative of -w3/6 - w2 - 2w. Let a(s) = 3s + 5. Let t(n) = 2a(n) + 5z(n). Let r(l) = l2. What is r(t(i))? i2 Let s(n) = -4n2 + 7. Let p(y) = -y2 + 2. Let x(h) = -7p(h) + 2s(h). Let w(i) = 14i2. Give w(x(t)). 14t*4 Let j(c) = 3c. Let t(a) = -1630 + 29a2 + 1630. Give t(j(v)). 261v*2 Let h(r) = 2r. Let g(m) = 231m2 + 2. Determine g(h(u)). 924u*2 + 2 Let p(a) = -19a*2 - 15a*2 + 36a*2. Let y(i) = 10i - 1. Calculate p(y(l)). 200l2 - 40l + 2 Let h(w) = w. Let k(q) = 3q - 35. What is k(h(u))? 3u - 35 Let t(w) = -w*2. Let k(h) = -368h*2. Determine t(k(a)). -135424a*4 Let y(c) = 13c. Let z(a) be the first derivative of 5a3/3 - 12. Calculate z(y(w)). 845w*2 Let v(q) = -3q*2 - 79. Let i(r) = 21r*2. Give i(v(c)). 189c*4 + 9954c*2 + 131061 Let a(w) = -2w. Let z(x) = 6x2 - 2x - 2. Let g be 1 + 0 + 2 + 0. Let h(u) = -4u - 1 + 0u + gu + u2. Let i(y) = -2h(y) + z(y). Determine i(a(f)). 16f2 Let l(s) be the first derivative of s2 + 3. Let j(r) be the first derivative of -4r*3/3 - 2. Give l(j(v)). -8v2 Let f(c) = c2 + c. Let s(i) = 4i2 + 3i. Let j(b) = -3f(b) + s(b). Let q(t) = 40t*2. Give q(j(r)). 40r*4 Let t(y) = 19y*2. Let u(j) = 479j. Determine u(t(l)). 9101l2 Let k(c) be the first derivative of -c4/4 - c2/2 - 2. Let s(b) be the second derivative of k(b). Let o(f) = -f2 + 22 - 22. Calculate s(o(h)). 6h*2 Let u(a) = -a. Suppose -5y + 13 = -3n, -n + 22 + 7 = 5y. Let p(x) = 4 - y - 2x + 1. Determine p(u(m)). 2m Let o(i) be the third derivative of 1/20i5 + 2i*2 + 0i + 0i4 + 0i3 + 0. Let w(t) be the second derivative of t4/12 - 14t. What is w(o(l))? 9l*4 Let v(d) = 14658d. Let m(r) = 2r2. Calculate m(v(a)). 429713928a2 Let a(k) be the third derivative of k5/30 - 9k2. Let v(s) = 6s*2. Give v(a(b)). 24b*4 Let b(d) = -2d. Suppose 5q = 0, 5c + 2q + 2q = -20. Let r = c - -6. Let i(g) = rg - g + g. Determine b(i(f)). -4f Let z(y) = -5y. Let m(j) = j. Determine m(z(k)). -5k Let i(y) = 2y2. Let b(z) be the third derivative of 3z*2 + 1/30z*5 + 0z + 0z4 + 0 + 0z*3. What is b(i(c))? 8c4 Let o(p) be the third derivative of p4/12 - p*2. Let x(d) be the second derivative of 0d*2 + 0 - 8d + 1/3d4 + 0d*3. Give x(o(v)). 16v**	{ "pile_set_name": "DM Mathematics" }
n 0.3, -8, -0.049, -2/9? -8 Which is the second smallest value? (a) -1 (b) -69 (c) 0.5 a What is the second biggest value in 0.1, 1/67, -5, 1? 0.1 What is the second biggest value in 1, 3/31, -2/11, -5, -2/5? 3/31 Which is the fifth smallest value? (a) -4/135 (b) 2/11 (c) -0.1 (d) -2/5 (e) -3/8 b What is the fourth biggest value in 1, -3, 4, 4/31, -37? -3 Which is the biggest value? (a) -5 (b) 4 (c) 2971 c Which is the fourth biggest value? (a) 3 (b) -0.011 (c) -0.5 (d) -1 d Which is the second smallest value? (a) -0.6 (b) -0.07 (c) 0.064 b Which is the biggest value? (a) 4 (b) -13/25 (c) 0.4 (d) 2 a What is the second biggest value in -0.01, 156, -5? -0.01 Which is the second smallest value? (a) -23 (b) 3 (c) -0.5 (d) -3 d Which is the second biggest value? (a) 5/3 (b) -66 (c) -2/19 c What is the second smallest value in 5, -0.19, 4, -4? -0.19 Which is the smallest value? (a) 5/2 (b) -8 (c) -60 c Which is the third smallest value? (a) -2/17 (b) -0.1 (c) 4 (d) 2/9 d What is the second smallest value in 240, 1, 0.5, -0.2? 0.5 Which is the third smallest value? (a) 1/3 (b) 0.02 (c) -0.1 (d) -2/9 b Which is the biggest value? (a) 1/3 (b) 20.95 (c) 1 b Which is the biggest value? (a) 4 (b) -3 (c) 0.5 (d) -1 (e) 0.1 a What is the third biggest value in -1/2, -3, 3, -2/5, 57? -2/5 Which is the fourth biggest value? (a) -3 (b) -15 (c) 5 (d) 0.2 b Which is the second smallest value? (a) 5 (b) -63 (c) 0 (d) -1 (e) -0.5 d Which is the second biggest value? (a) 2.7 (b) 0.2 (c) 0.36 c Which is the smallest value? (a) 0.4 (b) 1/2 (c) 24 (d) 0.1 d Which is the third smallest value? (a) 2/15 (b) 3 (c) -3 b Which is the third smallest value? (a) -2/3 (b) -3 (c) -2 (d) -9 c Which is the biggest value? (a) 4 (b) 1/921 (c) 5 (d) 1/6 c Which is the smallest value? (a) 1 (b) 0.8 (c) -0.2 (d) 1/6 c Which is the third smallest value? (a) -0.06 (b) -1 (c) 2 (d) 1/2 d What is the second smallest value in -2, -3, 156? -2 What is the second smallest value in 0.07, -0.2, -3, 4? -0.2 Which is the fourth biggest value? (a) 230 (b) -1/5 (c) 0.04 (d) -2 (e) 5/4 b What is the third smallest value in -2, -2.8, 3/8? 3/8 Which is the biggest value? (a) -1.22 (b) -0.3 (c) -4 (d) 0.9 (e) 4 e Which is the third biggest value? (a) 11/2 (b) 1 (c) -2/5 (d) -2 (e) 0.5 e What is the smallest value in 4, 0.5, -54/5, -3/4, -4? -54/5 Which is the second biggest value? (a) 2/17 (b) -4 (c) 3 (d) 0.7 (e) -3/2 d Which is the fourth biggest value? (a) 919 (b) 0 (c) 5 (d) 0.1 b What is the second biggest value in -0.06, -0.5, -31? -0.5 What is the third biggest value in -1, 210, -3, -4, -0.5? -1 Which is the fifth biggest value? (a) 0.3 (b) 308 (c) 1/4 (d) 5 (e) -0.2 e What is the fourth smallest value in -27, 3, -4, 0.2? 3 Which is the second biggest value? (a) -2/3 (b) 5 (c) 2/35 c Which is the smallest value? (a) -0.7 (b) 4 (c) 3 a Which is the second biggest value? (a) -193 (b) 0 (c) -2 c What is the fifth smallest value in 2, -0.1, -1/3, 1.53, 1/3? 2 What is the third biggest value in -2/117, 0.015, -4? -4 Which is the third smallest value? (a) -4 (b) 77 (c) -1/2 b Which is the third smallest value? (a) 0.3 (b) -24 (c) -2 (d) 0.4 a What is the smallest value in -0.01, 2/13, 17? -0.01 What is the smallest value in -3, 1/6, 22/9? -3 What is the third smallest value in 300, -2, -12? 300 Which is the fourth biggest value? (a) -4/13 (b) 2/9 (c) 0 (d) -0.5 d Which is the smallest value? (a) 0.4 (b) 1/4 (c) -0.2 (d) 0.3 (e) 7 c What is the smallest value in 0.746, 0.03, 0.4? 0.03 Which is the fifth biggest value? (a) -97 (b) 4 (c) 0.4 (d) 0.5 (e) 1/6 a What is the biggest value in -2/7, -116, 5? 5 What is the third biggest value in 5, -1/8, 0.059? -1/8 Which is the second smallest value? (a) 4 (b) -14 (c) 0.35 c What is the fourth biggest value in -5, 20, 0, 0.3? -5 What is the fourth biggest value in 5, 0.16, 1/4, 7? 0.16 What is the third biggest value in -0.4, -2, 0? -2 Which is the third biggest value? (a) -1 (b) -9 (c) 0.6 (d) -0.2 (e) 0.5 d Which is the biggest value? (a) 0.07 (b) 0.4 (c) -5 b What is the second smallest value in 5, -7/6, -11, 0.5? -7/6 Which is the second biggest value? (a) 0 (b) 2 (c) -0.08 a Which is the second smallest value? (a) -4 (b) -12.264 (c) -2 a What is the second biggest value in -1/3, -8, -2, -5, 5? -1/3 What is the third smallest value in -5/6, -5/19, -4? -5/19 What is the second smallest value in 1/4, -0.4, -0.2, 2, -0.9? -0.4 What is the smallest value in 0.13, 0.5, 3, 1/4? 0.13 What is the fourth biggest value in -3, 7, -161, 1/5, 0.3? -3 What is the fifth biggest value in 1/2, 0.2, -5/4, -2/17, -10? -10 What is the fourth smallest value in -1/2, 2/1017, -0.4, 2? 2 Which is the fourth biggest value? (a) 5 (b) -1/8 (c) -0.1 (d) -0.2 (e) 0.16 b Which is the smallest value? (a) 4/3 (b) 1/7 (c) 7 (d) 1 b Which is the second biggest value? (a) 2/87 (b) -13/3 (c) -1 c What is the fourth biggest value in -3/5, 0.3, 1/4, -474/7, 5? -3/5 Which is the second smallest value? (a) 2/439 (b) 0.3 (c) 4 b What is the third biggest value in -3, -14.9, -1? -14.9 What is the third smallest value in 0.5, -0.5, -2/13? 0.5 Which is the biggest value? (a) 3 (b) -16 (c) -2 a Which is the third biggest value? (a) 0 (b) -1 (c) 0.3 (d) 3 a What is the second smallest value in -1, -0.067, 2, -4? -1 What is the fourth biggest value in -25, 4, -4, 0.5? -25 What is the fourth biggest value in -0.4, -4, -4/7, 2/3? -4 What is the third biggest value in -16, 4, -2/7, 5, 0? 0 Which is the smallest value? (a) -1 (b) -16 (c) 1/8 (d) -1/3 b Which is the smallest value? (a) -9 (b) -7 (c) -147 c Which is the second biggest value? (a) -0.07 (b) -33 (c) -2/5 c Which is the smallest value? (a) 1/4 (b) 33 (c) 1/7 (d) -1/2 d Which is the second smallest value? (a) -0.21 (b) 1/8 (c) 0.2 (d) -0.4 a What is the fourth smallest value in 1/4, -57, 2, -4, -2? 1/4 What is the fourth biggest value in -0.03, -1, -0.5, -0.17? -1 Which is the fifth smallest value? (a) 2 (b) -0.05 (c) 1/3 (d) -2 (e) -1/5 a Which is the second smallest value? (a) -5 (b) 0.1 (c) -3/8 (d) -5/4 d What is the second biggest value in 0.5, -1, 0.3, -1/46, 1? 0.5 What is the smallest value in -3, 4, 0.9, 17? -3 Which is the third biggest value? (a) -10/7 (b) -0.4 (c) 4 (d) 3 b Which is the fifth biggest value? (a) -1 (b) 0.05 (c) 5 (d) -0.1 (e) -0.05 a Which is the fifth smallest value? (a) -0.2 (b) -3/7 (c) -0.01 (d) 0.5 (e) 3 e What is the third biggest value in 3/4, 1, -6, 0.4? 0.4 Which is the second biggest value? (a) -0.2 (b) -0.5 (c) -1/216 a What is the biggest value in -1, 0.3, 2.1, 139? 139 What is the third smallest value in -12, 2/11, 5, -3/7? 2/11 Which is the biggest value? (a) 7 (b) -0.5 (c) 2/7 (d) -5 (e) -6 a Which is the third biggest value? (a) -56 (b) -0.9 (c) 2/7 (d) 4 b What is the biggest value in 1/6, 0.4, -2, -1/4? 0.4 What is the smallest value in 0.18, -4, -3/4, 1, -3? -4 What is the biggest value in 2/3, -1/6, -0.02? 2/3 Which is the third biggest value? (a) -1/3 (b) 0.04 (c) -10/11 c Which is the second biggest value? (a) 3/5 (b) 0.14 (c) 0.4 (d) -2/9 c Which is the third biggest value? (a) 0.21 (b) 0.1 (c) 3 b What is the biggest value in -3, -17, 0.2, -0.2? 0.2 What is the fourth smallest value in 3, 0.6, 2, 1/5, 0.3? 2 What is the second biggest value in 5.3, 2, -0.3? 2 What is the second smallest value in -4, 413, 0.1? 0.1 Which is the third smallest value? (a) -1 (b) 2/21 (c) 13/12 c What is the second biggest value in 2, -1/4, 1? 1 What is the biggest value in -112, 5, 1, 2, -3? 5 Which is the second biggest value? (a) 19.4 (b) 1/6 (c) -7 b Which is the biggest value? (a) -0.1 (b) 2/27 (c) -2/7 (d) 0.06 b What is the second smallest value in 4, -0.2, -2/7, -1? -2/7 What is the second biggest value in -4, -1, -40/11? -40/11 Which is the biggest value? (a) -55/2 (b) 3 (c) -15 b Which is the smallest value? (a) 1/4 (b) 3/4 (c) 16 a What is the biggest value in -3/7, 0.08, 1, 0.4? 1 What is the third biggest value in 9, -2, -0.5, 0.1, -10? -0.5 Wh	{ "pile_set_name": "DM Mathematics" }
) as dl + zl*3 + vl2 + c and give z. 9782 Rearrange -b3 + 48b2 - 26b*2 + 2b - 53b2 to the form rb*2 + nb + h + mb3 and give n. 2 Express (-d2 + 2d3 + d2)(d + 2 - 2 + (3 - 1 + 0)(d - 2d + 2d))(-3 + 5 + 1)(0 + 1 - 4) as xd4 + q + cd*2 + kd*3 + wd and give q. 0 Express 2f - 1630 + 780 - 11f + 790 in the form u + hf and give u. -60 Express -157r - 2r2 + 72r - r*3 + 1 + 80r in the form pr3 + ir*2 + gr + o and give g. -5 Rearrange -327d + 270d - 865d + (4 - 4 - 1)(-2d - 2 + 2) to the form jd + z and give j. -920 Rearrange 15s - 2s + 183 - 96 - 87 to r + ks and give k. 13 Rearrange (5n - 3n - n)(0n2 + n2 - 2n*2) + 25n*3 + 6n*3 - 5n*3 to a + jn*2 + pn*3 + mn and give p. 25 Express 51 - 4m - 14 - 2 as q + rm and give r. -4 Express -3503k + 165 - 3493k + 6998k in the form r + vk and give r. 165 Rearrange (-5 + 1 + 9)(-15 - 5 + 3)(-2a + 2a + a) to the form w + za and give z. -85 Rearrange -33r - 2r4 + 34r - 1 - 5r2 + 6r*2 to the form zr*4 + lr*2 + q + nr*3 + yr and give l. 1 Express 4 - 4 - b*3 + (0b + 3b + b)(22b2 - 46b*2 + 13b*2) in the form pb + mb3 + qb*2 + c and give m. -45 Express 20j + 70j + 12j + 25j as w + kj and give k. 127 Rearrange (-2d + d - d)(1 - 1 + 2d) + (-3d + 2d + 3d)(41d + 49d - 12d) to the form id + md*2 + a and give m. 152 Rearrange (82 - 336x + 670x + 94 - 337x)(0x - 3x - 3x) to the form f + ix + hx*2 and give i. -1056 Rearrange (-4n*2 + 3n*2 + 2n*2)(56 + 72 + 8)(1 + 0 + 0) to the form hn*2 + sn + r and give h. 136 Rearrange (-4 - 3 + 4)(4 - 5 + 4)(-10l2 + 7l*2 - 11l*2) to m + ol*2 + zl and give o. 126 Express 12 + 16i3 - 8 + 2i - 3 + 6i3 in the form qi + ti2 + fi*3 + b and give f. 22 Express 665w - 544w + 395w as u + dw and give d. 516 Rearrange 12t + t - t + (2t + 8t - 2t)(-4 - 1 + 3) to the form m + rt and give r. -4 Rearrange 2 + 20d*2 - 11d + 19d2 + 10d - 3d2 + d3 - 2d*2 to y + hd*3 + pd + kd2 and give y. 2 Rearrange -52g3 + g2 + 48g3 + 1 + 0 to m + yg*2 + wg + xg3 and give m. 1 Express -7s - 5s2 - 2s*2 + 5s*2 - 2s*2 in the form c + ys*2 + vs and give v. -7 Express 0 + 0 + 3u4 + 27u*2 - 340u*3 + 342u*3 + u in the form zu*4 + f + xu*3 + ru*2 + iu and give i. 1 Rearrange -21 + 10 + 2i2 - 4i*2 + 12i + 50i + 9 to ki*2 + s + di and give k. -2 Express (0q - 485 + 483 + 3q)(-5 + 2 + 1) as vq + r and give v. -6 Rearrange (w2 + w2 - w*2)(4 - 4 + 1)(25w + 22w + 10w) to yw2 + bw + x + vw3 and give v. 57 Express 1 + 0 + 435m + 0 - 224m + 117m as lm + q and give q. 1 Rearrange (-1 + 1 + 2)(2j2 + 2 - 2)(-240j2 + 124j*2 + 105j*2 - 23j) to xj2 + rj*4 + v + dj + bj3 and give r. -44 Express -4h*3 - 2h*2 + 2h*2 + (-11h*2 + 14h*2 + 4h*2)(3 + h - 3) - 6h3 + 5 - 5 in the form ph + r + yh2 + mh*3 and give m. -3 Rearrange -591f - 18f2 + 11 - 587f + 1178f to the form lf*2 + wf + p and give l. -18 Rearrange (-1 - 4 + 1)(-2l - 17 + 23 - 10)(38l*2 - 6l*2 + 4l*2) to the form il*2 + sl*3 + w + rl and give i. 576 Express 942w - 372w - 20w + 199w + 1292w in the form hw + m and give h. 2041 Express -3 + 7 - 8n2 - 7n*2 + 6n*4 + 4n*2 - 7n*3 + 12n*2 in the form p + mn*4 + qn + jn2 + dn*3 and give q. 0 Express -220w*4 + 1 - 7w*3 - w + 219w*4 - 2w*2 + 7w*3 as bw + qw3 + pw*2 + i + jw*4 and give p. -2 Rearrange -46 + 71a + 18 + 9a + 30 to z + ba and give z. 2 Express (-3z - 3z + 3z)(0z - z - 3z) + (10z - 39 + 39)(0 + 0 + 2z) - z2 + 5z*2 - 2z*2 in the form pz*2 + iz + m and give p. 34 Express (-34c - 36c + 28c)((4 - 3 + 0)(1 + 0 - 3) - 5 + 1 + 0) in the form bc + g and give b. 252 Express (7 - 10q - 7)(2q - q + q) + 78q*2 - 5405 + 5405 as lq + t + cq2 and give c. 58 Rearrange -35 - l2 + 15 - 75 + 2l to jl + nl*2 + a and give n. -1 Rearrange 3a*2 - 116a + 132a - 2 + 2 to the form ka + q + ia2 and give i. 3 Rearrange 2k - 2 - 345k3 - 47k*2 + 47k*2 + 1 + 0k*4 - 2k*4 to the form yk*2 + hk*3 + l + dk*4 + mk and give d. -2 Express (0u - 2u + 3u)(-12 - 5 + 81)(5u + 0u - 3u)(-3u*2 - 1 + 1) as iu*3 + bu*4 + fu*2 + pu + j and give i. 0 Express (20 + 3 + 19 + (-4 + 2 + 0)(2 - 1 + 1))(-2w + w - 4w) as h + vw and give h. 0 Express (-2 - 4 + 2)(-3 - 19 + 5)(-4 + 0 + 5)(2l - l - 3l) as ol + i and give o. -136 Rearrange 40f*2 + 437f*2 + 709f*2 + 143f*2 to the form jf + lf2 + b and give l. 1329 Express (-512 - 322 - 193 - 908)(-y*4 - 3 + 3) in the form wy*3 + ly*4 + hy*2 + by + i and give l. 1935 Rearrange -21x - 5 + x3 - 11x - 7x - 19x to ox + l + qx*3 + sx*2 and give q. 1 Express -8 - 3o - o*3 - 2o2 + o3 - 2o3 + 0o*3 as do*3 + v + xo + fo2 and give x. -3 Rearrange c3 + 7c3 - c3 + (-7c + 6c - 8c)(-1 + 2c2 + 1) to jc*3 + i + lc*2 + xc and give j. -11 Rearrange 6s3 - 22s*4 + 44s*4 - 25s*4 + 1 to the form ls*3 + ks*4 + a + gs + fs2 and give a. 1 Express (426 - 242 - 288)(-2u + u - u) as v + bu and give b. 208 Rearrange (4 + y - 4)(31 + 1685y*2 - 29 + 93y*2) to xy*3 + ny + iy2 + c and give n. 2 Express (-2d - 4077d3 - 1 + 4d + 4036d3 - 3d*4)(-1 + 2 + 2) as hd3 + nd*2 + g + md + kd4 and give k. -9 Express -1074y*3 - 1074y*3 + 2146y*3 - 37y*2 in the form ay*2 + dy*3 + t + my and give a. -37 Rearrange (0y + 4y - 2y - 4y + 4y - 2y + (2 + 4 - 4)(3y + 2y - 3y) + 2y - 2y + 2y)(1 - 4 + 4) + 2y - 115 + 106 - 3y to i + cy and give i. -9 Rearrange 11r*3 - 17r*3 + 5r*2 + 24r*3 to ar*2 + ur*3 + cr + p and give a. 5 Rearrange ((-1278 + 1278 + 164n)(0 - 3 + 5) - n + 3n - 4n)(-n - 3n + 3n) to the form p + xn*2 + fn and give x. -326 Rearrange 2 - 108r - 75r - 2 to g + qr and give q. -183 Express -f3 + 19f*2 - 49f*2 - f + 29f*2 + 31 in the form cf*2 + j + af + xf3 and give a. -1 Rearrange (-2i + 58 - 59 + 19i2 - 1)(i - 6 + 4 + 0i + (2 - 6 + 2)(-i - i + 0i)) to t + ri*3 + hi + ci2 and give h. -6 Express 13r3 - r4 - 3r2 + r + 0r + 16r3 as fr*4 + jr + b + nr3 + pr*2 and give p. -3 Rearrange 7796 + 67y*2 - 7796 + (-y - y + y)(5y - y - 2y) + 0y2 - 2y2 + y2 to the form by + a + qy*2 and give q. 64 Rearrange 27 + m + 9m*3 + 1 - m - 7m3 + m2 to the form hm + km*3 + d + um2 and give u. 1 Rearrange (-a4 + 4a4 - 2a*4)(-312 + 255 - 380 - 615) to the form z + pa3 + ga + qa2 + ra*4 and give r. -1052 Express 206 + 2d*2 - 63d - 3d3 + 17d - 207 + d*3 in the form hd*3 + s + bd + ad2 and give s. -1 Rearrange 16476 + 155s*3 - s - 16476 to ws*3 + qs*2 + ks + z and give k. -1 Express -638m - 26 + 17 + 9 as d + lm and give l. -638 Express 1 - 4d4 + 13d*4 - 11d - 41519d3 + d4 + 41521d*3 in the form zd*4 + f + yd*2 + pd + ld3 and give z. 10 Rearrange (-1 + 2n + 0 + 0)(2n - 3n + 3n + 22n + 20 - 20 + (-n + 4n - 2n)(-4 - 4 + 4)) to u + mn2 + tn and give t. -20 Express -4 + 0q4 + 8q*4 - 95q*3 + 99q*3 as yq*2 + xq*3 + v + nq*4 + hq and give n. 8 Rearrange 33q - 13q - 2q2 + 40 - 21q to the form cq2 + pq + u and give u. 40 Rearrange -2d3 + 4d*3 + 3 + 2d*2 + 8d*4 + 3 + 28d*2 - 7d*4 to the form f + qd*2 + td*4 + rd*3 + jd and give q. 30 Rearrange (87x - 1473 - 1474 + 2949)(6 - 2 - 1) to hx + r and give h. 261 Express 2q*2 + 7q*2 - 9q*2 + 44q - 46q - 2q*3 - 1 in the form sq*3 + tq + iq2 + p and give s. -2 Rearrange (-83c + 37c2 + 1 + 80c - 100c2)(-2c2 - 3c*2 - 6c*2) to the form oc*3 + ac*4 + vc*2 + g + xc and give v. -11 Express -2i + 0i - 15i + 24i - 5i + 262 in the form c + ui and give u. 2 Rearrange 0i2 + 3i*2 + 13i*4 + 11i - 14i4 to the form ji*4 + ti*2 + yi + k + vi3 and give y. 11 Express (-3 + 2 + 0)(5i - 33i - 17i)(4 + 1 + 0) in the form bi + h and give b. 225 Express p + 2p**2 -	{ "pile_set_name": "DM Mathematics" }
derivative of 0h5 + 290h*2 + 0 + 19/12h*6 - h + 1/24h*4 + 19/2h*3. What is the derivative of b(a) wrt a? 570a*2 + 1 Suppose 4s - 2s - 40 = 0. What is the third derivative of -40o*6 + so*6 - 95o*6 - 100o*2 wrt o? -13800o3 Let b(k) = -k3 + 6k2 + k + 1. Let l(r) = 2063r*3 + 16r*2 - 7r + 2. Let f(c) = -b(c) - l(c). Find the third derivative of f(z) wrt z. -12372 Let s = -206 + 223. What is the third derivative of 14v3 + 20v*2 - sv*3 - 6v*3 wrt v? -54 Let x = 795 - 767. Find the third derivative of xv*4 + 128586v - 128586v - 87v*2 wrt v. 672v Suppose a + 3 = 0, -a = -0q + 5q + 28. Let y be (54/q)/((-16)/40). What is the second derivative of 8 + 19 + 20k - y - 14k*2 wrt k? -28 Let o(r) = 30r*4 - 3r*2 - 1365r + 6. Let j(d) = 28d4 - 3d*2 - 1364d + 7. Let z(m) = 6j(m) - 7o(m). Find the second derivative of z(f) wrt f. -504f2 + 6 Let m(g) = -27g + 12g + 8g - 23. Let p = -7 - -3. Let j(q) = -15q - 46. Let a(f) = pj(f) + 7m(f). What is the first derivative of a(n) wrt n? 11 Let a(u) = -u2 - u. Let m(j) = 620j*2 - 3j + 202. Let x(d) = 6a(d) - 2m(d). What is the derivative of x(o) wrt o? -2492o Let l(c) = c2 - 7c + 6. Let s be l(7). Suppose 0 = 2t + 5b - s, -4t + 17 = -b + 5. Differentiate 9n*t - 39 - 10n*3 + 39n*3 + 6n*3 wrt n. 132n2 Let s(n) be the second derivative of n8/28 + 61n6/2 - n4/12 - 489n*2/2 - 5n + 11. What is the third derivative of s(b) wrt b? 240b3 + 21960b Differentiate -3508 - 1592498u + 12162u*2 + 1592498u with respect to u. 24324u Let s = 161 + -159. Let g = 15 + -7. What is the third derivative of 40p*s + gp*5 + 5p*5 + 25p*6 - 13p*5 wrt p? 3000p*3 Find the second derivative of -782a4 + a + a5 + a*3 + 540462 - 540462 wrt a. 20a*3 - 9384a*2 + 6a Let c(h) be the third derivative of -7h2 + 0h*4 - 1/70h*7 - 20h*3 + 0h*5 - 6 - 1/30h*6 + 0h. Differentiate c(j) with respect to j. -12j3 - 12j*2 Let h(n) be the second derivative of -31/10n*6 - 123n + 10n3 + 0 + 0n*2 + 0n*5 + 0n*4. What is the second derivative of h(y) wrt y? -1116y*2 Let h be 1/11 + (-2700)/(-66). Find the second derivative of 32a2 - a3 + ha2 - 6a - 11a2 + 0a wrt a. -6a + 124 Let v(p) be the first derivative of 522p*5/5 + 19p*2 - 63p - 577. What is the second derivative of v(l) wrt l? 6264l2 What is the third derivative of -27v - 779v4 - 1 + 26v - 1093v3 + 704v*2 + 1094v*3 wrt v? -18696v + 6 Let n(m) be the first derivative of 373m3/3 - 1940m*2 + 3834. Find the second derivative of n(j) wrt j. 746 Suppose 5l + 12 = -4r, 2r - 36 + 24 = 2l. What is the first derivative of 2836g*2 + 2836g*2 + 207 + 84g*4 - 5672g*r wrt g? 336g*3 Let g = 37 + 727. Let v = -333 + g. What is the second derivative of 442q*2 - 2q - 19q - vq*2 wrt q? 22 What is the second derivative of -22k - 385 + 27k - 779k*2 + 330 wrt k? -1558 Let u(c) = 7c*2 - 60c - 35. Let n be u(42). What is the second derivative of 12y + 118y*2 + 213y + 9792y5 - ny*5 wrt y? -20y*3 + 236 Find the third derivative of -88c + 5774c2 - 46c*6 - 5773c*2 - 193c*6 wrt c. -28680c*3 Suppose -153h + 386 = -73. Let y(w) be the first derivative of 8 + w + 0wh + 0w*2 - 31/4w*4. Differentiate y(t) wrt t. -93t*2 Let d(l) be the third derivative of 0l*3 + 0l*7 + 0l*6 + 196l*2 + 0l + 0 - 9/56l8 + 15/8l*4 + 0l*5. What is the second derivative of d(p) wrt p? -1080p*3 Let r(b) be the third derivative of 1453b6/60 + b5/20 - 820b4/3 - 8b*2 - 3b - 42. What is the second derivative of r(m) wrt m? 17436m + 6 Let q(c) be the first derivative of 155/2c*2 + 0c - 35/2c4 + 0c*3 - 220. What is the second derivative of q(j) wrt j? -420j Suppose 5x = -3x + 120. Suppose -9h + xh = 30. Find the third derivative of 6sh - 20s*5 - 18s*2 - 15s*2 wrt s. -840s*2 Suppose 5q = -3i + 598 + 299, 2q = 6. Suppose 159 = 3p - i. Differentiate -4u*3 - 2u3 - u3 + p - 114 wrt u. -21u2 What is the second derivative of -7c*3 + 50c*2 + 11c*3 + 14c*3 + c - 29c*3 - 1 wrt c? -66c + 100 Suppose -21 = -5n + 2t, -4t = -5n - 5t + 12. Suppose -5b = nc - 0b - 334, -c + 116 = -3b. Differentiate c - 235 + 11g*3 + 114 with respect to g. 33g*2 Let z = 290 - 123. What is the second derivative of 137k*2 + 187 - 67 - 57 - 61 - zk wrt k? 274 Let j = 4 + 31. Suppose -j + 53 = 2q. Find the third derivative of 10o*3 + 9o*3 + qo*3 - 28o*2 wrt o. 168 What is the first derivative of 20p*2 - 2321p + 2919 + 1362 - 2p2 + 3p*2 - 23p*2 wrt p? -4p - 2321 What is the third derivative of -6f3 - 3f - 27f2 - 6844f*5 + 89 + 6f*3 - 23f*2 + 52f*2 wrt f? -410640f*2 Suppose -5m - 2j + 17 = 0, 4m + 90j - 9 = 93j. Let u(s) be the first derivative of 9/5s5 + 0s*2 - s + 11 + 0s*4 + 0s*m. Differentiate u(r) wrt r. 36r*3 Let w(j) be the first derivative of -355j*6 + 1716j*2 + 4968. Find the second derivative of w(o) wrt o. -42600o*3 Let q = 225 + -170. Differentiate 2g*3 + q + 2g*2 - 5g*3 + 5g*2 with respect to g. -9g*2 + 14g Let k(c) = 1130c2 - 2c + 603. Let d(g) = 13g2 + 2g - 1. Let o(y) = -d(y) - k(y). Find the first derivative of o(i) wrt i. -2286i What is the second derivative of 1820c*5 - 268 + c - 2c*4 + 681c*5 - 936c*5 + 2589c*5 wrt c? 83080c*3 - 24c*2 Find the first derivative of 23a*4 - 43a*3 - 18a*3 - 13a*4 + 1121 - 5a*4 - 6a*4 wrt a. -4a*3 - 183a*2 Suppose 0 = -5h - 5i - 8 + 28, -3h - 12 = -3i. Suppose -2j + 164 = 3q + 128, 0 = -2q - 3j + 24. What is the first derivative of hf - f + q - 3f wrt f? -4 Find the third derivative of -2995s*5 + 1022s*5 + 1003s*5 - 29s*4 + 2425s*2 + 991s*5 wrt s. 1260s*2 - 696s Let i(c) = c*3 - 10c*2 + 12c + 1. Let h be i(9). Let m be -3 + 212/h - 12/21. What is the second derivative of 48z - 137z*4 + 53z*m + 65z*4 wrt z? -228z*2 Let t(f) be the second derivative of 2 - 1/6f*4 + 18f - 19/3f3 + f2 - 1/10f*5. Find the second derivative of t(v) wrt v. -12v - 4 What is the first derivative of 2058w2 - 1624 + 616w*2 + 703w*2 wrt w? 6754w Suppose c - 3c = -6c. Let o be ((-2)/5 + c)10. Let a(w) = 6w*2 - 4w - 25. Let t(g) = -g*2 + g - 1. Let n(i) = ot(i) - a(i). Differentiate n(y) wrt y. -4y Let j(l) = -23l*3 + 303l - 1244. Let f(m) = 4m3 - 2m - 2. Let n(u) = 6f(u) + j(u). Differentiate n(q) wrt q. 3q*2 + 291 Let n(r) = -6r*2 - 33r + 382. Let i(q) = q*2 - 2q - 2. Let x(y) = -3i(y) + n(y). What is the first derivative of x(u) wrt u? -18u - 27 What is the first derivative of 325z + 327z - 2741 - 1291z + 318z + 325z wrt z? 4 Let k(y) = 5682y*3 - 33y*2 + 4y + 6. Let x(r) = 1136r3 - 6r*2 + r + 1. Let t(p) = 2k(p) - 11x(p). Find the second derivative of t(s) wrt s. -6792s Suppose 11j - 525 = 4j. What is the first derivative of j + x*3 - 406x*2 + 803x*2 - 403x*2 + 0x*3 wrt x? 3x*2 - 12x Let f(a) = -1169a2 + 12a - 5480. Let k(o) = -3516o2 + 34o - 16433. Let x(m) = 17f(m) - 6k(m). What is the derivative of x(b) wrt b? 2446b Let p(h) = h2 + 1. Let n be p(-1). Suppose -10 = 2k, i + 2k + 4 = -k. What is the third derivative of -6l*3 + nl*3 + il2 - l3 - 5l3 wrt l? -60 Let q(f) be the first derivative of 0f*4 + 0f*5 + 75/2f*2 + 12 + 0f - 2f3 + 5/6f*6. Find the second derivative of q(v) wrt v. 100v*3 - 12 Suppose -4s - 2n = -0n - 2, n + 20 = 5s. What is the second derivative of 387f*s + 8f*4 + 382f*3 - 769f*3 + 53f - 291f - 3f*2 wrt f? 96f*2 - 6 Let s(p) be the first derivative of -3p5/5 + p4/2 + 376p3 - p2/2 + 1349p - 3395. What is the second derivative of s(a) wrt a? -36a2 + 12a + 2256 Suppose -3n = -23n + 1540. What is the first derivative of 25s - 12 + ns - 14s wrt s? 88 Suppose -4m + 2 = 3q + 6, 2q - 3 = 3m. Suppose q = 2h + 26 - 34. Differentiate hy2 - 1 - 4 + 9 + 8 with respect to y. 8y Find the third derivative of -43f3 - 34f*3 - 15f*4 + 0f*4 - 801f*2 - 2080f*2 - 39f*2 wrt f. -360f - 462 Let m(l) = -5*l + 1. Let o	{ "pile_set_name": "DM Mathematics" }
t = -2/87 - 9/29. What is the biggest value in t, 1/7, -2/7, -0.4? 1/7 Let f = -2972 + 9013/3. Let s = 973/30 - f. What is the third smallest value in s, -3/2, -0.2? s Let h = 4 + -4.4. Let q = -12.5 + 15.5. What is the third smallest value in h, 5, q? 5 Let u(w) = w*2 + 9w + 5. Let z be u(-10). Let h be (-3 - (-73)/z) + -2. What is the third biggest value in h, 0, 1/4? h Let w be (-3)/(-1)(-8)/(-84). Let m be (-3 + 7)/4 - 3. What is the smallest value in w, 2, m? m Suppose -5g + 2h - 79 = 0, -5g - 12h - 97 = -8h. Which is the second biggest value? (a) -1 (b) -5 (c) g (d) -3/8 a Let y = -0.42 - -1.92. Which is the biggest value? (a) 1/3 (b) 1/2 (c) y c Suppose 0 = -d + 89 + 43. Suppose -l - 3l + d = 0. Let k = 67/2 - l. What is the smallest value in k, 2, -0.2? -0.2 Let u = 10.4 + -11. What is the second smallest value in 5, -4, u? u Let h = 0.1 - 0.1. Let m = -41.9 - -40. Let r = m + 0.9. Which is the third biggest value? (a) 5 (b) r (c) h b Let i be (-34)/(-8) - (-5)/(-20). Let x be 17384/(-190) + i/(-10). Let l = -92 - x. What is the third smallest value in -2/7, l, 2? 2 Let r = -18.6 - -1. Let h = r + 18. What is the third smallest value in 1/4, h, 4? 4 Suppose -31 = 5f - 1. Let j = 1 + f. Let z = 4 - 0. What is the second biggest value in z, j, 1? 1 Let y be 4/(-10) - 1/(-15). Let f = 94 + -93.43. Let n = 0.07 - f. Which is the second biggest value? (a) -3 (b) n (c) y b Let w = 4 - 4. Let g = 0.2 + w. Let d = -0.02 - -5.02. What is the third smallest value in 1, g, d? d Let k(i) = -i*3 - 8i*2 - 8i. Let n be k(-7). Let w = n - 11. What is the smallest value in 0.5, w, 0.3? w Let w(q) = q*2 - q - 3. Let x be w(0). Let p be -1 - (36/26 + x). Let z = p + -37/39. What is the second smallest value in -1/5, z, -7? z Let c = -155/6 + 51/2. What is the fourth biggest value in 2/9, c, 8, 1? c Let o(q) = -3q*2 - q. Let i be o(-1). Let r be (-16)/(-42) - i/(-3). Let g be -5(-7)/70 - (0 - -1). Which is the third biggest value? (a) r (b) g (c) 2 b Let r = -5 + 1. Let y = -0.5 - -0.2. Let z = 5 + -2. Which is the second smallest value? (a) r (b) y (c) z b Let b = -3.9 + 4. What is the smallest value in b, -1/9, -3/2? -3/2 Let h be (-7 + 1)/(12/(-6)). Let k = h + -2. Which is the third smallest value? (a) -2 (b) 4 (c) k b Let g = -125.6 + 126. What is the biggest value in 2/19, 6, -1, g? 6 Let n = -0.5 + 0.8. Let m(k) = k*2 - 5k + 9. Let u be m(2). What is the second biggest value in n, u, 1/2? 1/2 Suppose g = 3o - 12 - 4, 5o = g + 26. What is the biggest value in g, -4, 0.4? 0.4 Let x = -15 + 18. Let h = -0.9 - -4.1. Let n = h - x. What is the second biggest value in n, 3, -0.1? n Let s = 74 - 70. Let p = 185 + -919/5. Let j = -88/65 + p. Which is the biggest value? (a) s (b) 1 (c) j a Let q = -16 + 21. What is the second biggest value in -2/11, q, -1/7? -1/7 Let w = 1987/9 - 221. Let u = 169 + -2871/17. What is the biggest value in w, u, -5? u Let d = 0.02 - 5.02. What is the third biggest value in d, 0.3, -1/4? d Let v(h) = h*3 + 6h*2 - 8h - 12. Let q be v(-7). Which is the second smallest value? (a) q (b) -0.1 (c) 2 b Let t = 0.9 + -1. Let w = t + 0. Let o = 0.28 - -0.02. What is the second biggest value in o, -0.5, w? w Let u = 6.9 + -4.9. Let q(p) = p*2 + 5p - 3. Let r be q(-5). Which is the second smallest value? (a) u (b) -0.4 (c) r b Let p(a) = 9 - 1 + a - 10. Let y be p(2). Let u = -0.1 - -0.3. What is the biggest value in 5, y, u? 5 Let x be (2/10)/((-8)/30). Suppose -7 - 41 = -4f. Let k be ((-39)/f - -4) + -1. Which is the second biggest value? (a) k (b) x (c) 1 a Let p = -0.2 - 0. Suppose -3q = -3g - 7 - 2, 0 = q + 2. Which is the third smallest value? (a) p (b) 1/5 (c) g b Let j be ((-1)/21)/(11/(-66)). Which is the smallest value? (a) j (b) -6 (c) -0.1 b Let x = 2.2 + -0.2. Let m = x - 1. Let d = 0.4 - -0.1. Which is the smallest value? (a) 0.2 (b) d (c) m a Let w be 10/8 - (-1)/(-4). Let s be (0 + 0)1 + w. Let v be (-2 - -3)/(-12 + s). Which is the second smallest value? (a) 3 (b) -0.1 (c) v c Let c = -4 + 11. Let v = -7 + c. What is the second biggest value in v, 1, -5? v Let n = 13 + -7. Let i = -8 + n. Let u = i - 1. What is the second biggest value in u, -2, 0.2? -2 Let g = -415/102 + 72/17. Let j = -8 + 8.3. Let i = -0.5 + j. What is the third smallest value in -2, g, i? g Let m = 0.6 - 0.46. Which is the smallest value? (a) m (b) 0.2 (c) 5 (d) 1 a Let o = 3 - 2.5. Which is the third smallest value? (a) o (b) -0.1 (c) -3/4 a Let g be 7/((3 + 2)/20). Let q = -736/9 + 490/9. Let x = g + q. What is the second biggest value in -1, x, 2? x Let i be (-10)/(-5) - 2/2. What is the third biggest value in i, 2/7, -5? -5 Let r = 1 + 2. Let f = 11 + -11.07. Let l = f + 5.07. What is the smallest value in 0.2, l, r? 0.2 Let i = -0.9 - 0.1. Let q = 16 + -11. Let j(n) = -n*2 + 6n - 4. Let k be j(4). Which is the second biggest value? (a) k (b) i (c) q a Let b be 193/4 - 1/4. Let h be (-2)/8 - 4/b. Let i = -20 - -15. What is the third biggest value in 6/7, i, h? i Suppose -75 = -a - 4a. Suppose -5y - a = 15. Let l be (y/16)/((-3)/(-12)). What is the second biggest value in -4/7, -1/4, l? -4/7 Let a = 136.4 + -136. Let j be (-2)/(-4) + 3/(-10). What is the biggest value in 3, a, j? 3 Let h(b) = -b*2 - 4b + 21. Let s be h(-9). Let z be (-1)/4s/(-15). Let u = 0.3 - 0.1. What is the third smallest value in -1/4, u, z? u Let u = -3.4 + 1.2. Let h = 0.82 + -0.02. Let l = h - u. Which is the third smallest value? (a) 0.4 (b) l (c) -0.1 b Let u be ((-12)/10)/((-2)/(-10)). Let x be 2 + (u - -2) + 1. What is the second biggest value in x, -4, -3? -3 Let t = 1/58 - -51/406. Let f(k) = 2k*2 - k - 1. Suppose -2r - 3m + 21 = r, 5 = m. Let w be f(r). Which is the second biggest value? (a) w (b) t (c) -5 b Let c = 0.96 + 0.04. Let u(h) = -h2 - 2h - 3. Let o be u(-2). What is the third biggest value in o, c, -3/2? o Let h = -11 - -10.8. Let q = 5 - 3. Suppose -qw = -w - 2. Which is the third smallest value? (a) h (b) w (c) 0.5 b Let n = 145 - 723/5. Suppose x = 3u + 82, 4x = 5u - 4u + 9. Let o = u - -85/3. Which is the biggest value? (a) -4 (b) o (c) n c Let t = 0.44 + -0.24. What is the second biggest value in -5, 3/7, t? t Let d = 1906/9 - 212. Suppose -2r + r = 0. Let m = 0.5 - 0.1. Which is the second smallest value? (a) d (b) r (c) m b Let y = -32.7 + 33. Which is the second smallest value? (a) y (b) 0.1 (c) 2 (d) -0.3 b Let h = -11 - -5. Let u = 3 + h. Let o = -1.1 + 1.3. Which is the second smallest value? (a) u (b) 0 (c) o b Let z = 10 + -5. What is the second biggest value in -2.8, 0.3, z? 0.3 Let w be (2/7)/(6/9 - 0). Which is the biggest value? (a) 1/4 (b) -0.1 (c) w c Let p be (2 + (-56)/30)-1. Suppose 4q = 2g + 12, 13 = q - 0q + 2g. What is the second biggest value in 2, p, q? 2 Suppose 0 = -26g + 10g + 48. What is the fourth biggest value in 2/9, g, -3, 0.02? -3 Let o = -67 + 338/5. Which is the second biggest value? (a) -1 (b) 4 (c) o (d) -1/5 c Let t(u) = 5u - 10. Let g(x) = -6x + 11. Let i(n) = 6g(n) + 7t(n). Let s be i(-6). Which is the third biggest value? (a) 1/7 (b) s (c) -0.1 c Let u = 0.15 - 0.15. Let m = 4 + u. Which is the second smallest value? (a) -5 (b) -3 (c) m b Let t = 1194/7 + -171. Let y = 0.149 - -1.851. Let v = -157/285 + 13/19. What is the second smallest value in y, v, t? v Let j = 0.65 + -0.35. Let k be 1/(-28) - 1/4. Which is the second biggest value? (a) j (b) -3 (c) k c Let i = 0 - 0.2. Let d = i - 0.3. Let z = d - -1. Which is the smallest value? (a) 1/6 (b) -1/2 (c) z b Let t = -418/5 - -84. Let b be (2/6)/(-6 - -5). What is the third smallest value in b, t, -2/7? t Let q = 2 + -7. Let r = -0.13 - -0.05. Let o = 4.92 - r. What is the biggest value in o, -1/4, q? o Let s = -2.3 - -2. Let w = 0.5 + s. Let i = w - -4.8. Which is the third biggest value? (a) -1/2 (b) -3/5 (c) i b Let d(q) = q2 + 2q - 14. Let v be d(-5). Suppose 0 = 4*a - 2 + 18. What is the biggest value in a, v, 3? 3 Let o = 3 + -2.5. Let r = -32 - -28. What is the smallest value in -0.1, r, o? r Let q = 34.2 + -31.14. Let x = q - 0.06. Let t = -5 - -5. What is the third biggest value in x, -	{ "pile_set_name": "DM Mathematics" }
013. Which is smaller: m or r? m Suppose 5q + 0 = -20. Let j = 5 - q. Is 9 greater than or equal to j? True Let b be 4/(-2) - (-5 + 2). Which is greater: b or 2? 2 Let l be (((-15)/(-414))/(-5))/1. Let z = l - -281/690. Which is smaller: z or -2? -2 Let i = -21 + 10. Let h = 11 + i. Which is greater: -8 or h? h Suppose 0 = -8r - 497 + 201. Are r and -38 equal? False Let l = -2 - -2.4. Let f = 0.3 - l. Let s = -0.1 - f. Is 0 smaller than s? False Suppose 108 = 4m - 4w, w + 1 = 3m - 80. Which is smaller: m or 26? 26 Let r = 5383 + -5380.173. Let s = 0.073 + r. Let l = s + -0.9. Are 1/3 and l unequal? True Suppose k - b - 1 = 2k, 3k + 4b = -7. Let s be 16/k - (-2)/(-6). Which is smaller: 6 or s? s Suppose 9c + 2c = -2c. Let m be (4 + -2)/63. Suppose -15 = 5n, -d + 2d + n + m = 0. Which is bigger: d or c? d Suppose 0u - 18 = 3u. Let h = u + 11. Suppose 3o = -ht + 9, 0t = -t + o - 3. Which is smaller: t or 2? t Let u = 11 + -8. Let x be 12/66 - (-84)/22. Which is bigger: x or u? x Suppose -2o = 5t + 10, -4o + 0t - 20 = 4t. Which is smaller: o or -12? -12 Let f = -187 + 192.88. Let o = -0.12 - f. Let z = o - -4. Is 0.1 at least as big as z? True Let y(j) = j*2 - 7j - 5. Let k be y(8). Suppose -c - k = -5g, 3c - 5g - 3 = -2. Are c and 4 equal? False Suppose -3g - 5l - 32 = 0, -2g - 2l = -3g + 4. Let b be 4(1 + 0) - 1. Suppose 2h - 4 = h, 0 = -5q - bh - 3. Do q and g have the same value? False Let f(c) = c*3 + 4c*2 - 1. Let v be f(-4). Is v at least -2/5? False Suppose -2n = j - 9, n = -1 - 1. Let z be j/(-7) - (-4 + 2). Let i = 19/35 - z. Are 0 and i equal? False Let a(i) = -i*3 - 3i*2 - 4i + 5. Let m(r) = -2r3 - 7r*2 - 9r + 10. Let x(d) = -13a(d) + 6m(d). Let s be x(4). Are 3 and s nonequal? False Suppose 10 = 2q - 3b, b - 8 = -q - 3. Suppose 4 = 3o + r - 1, -qr = -o - 9. Which is smaller: o or -3/10? -3/10 Let n = -1 - -1. Suppose nd + 5d = -10. Let x = -0.1746 + 0.0746. Which is smaller: d or x? d Let q be ((-417)/(-30))/(18/(-15)). Let b = q - -41/4. Which is smaller: 0 or b? b Suppose 3g - 38 - 37 = 0. Suppose 5h - g = 0, -3h = -0x + 3x - 18. Suppose 0 = 5u - 4 - x. Is 2/11 at least as big as u? False Let k(b) = 2b - 1. Let p be k(1). Which is greater: p or -19/4? p Let z = 12 - 13. Let h = -1/3 + 19/39. Is z < h? True Let d be (3/(-30))/((-14)/8). Let n = 32 - 31. Which is smaller: n or d? d Suppose -7 = f + 5d + 6, f - d = -31. Let p be ((-5)/10)/(6/f). Is -2/3 at most p? True Let i = 68 + -85. Is i < -17? False Let k = 129/4 - 1169/36. Let b = -22 + 16. Which is smaller: k or b? b Suppose -2o - 2 = -10. Let y = 62 - 59. Which is smaller: o or y? y Let l(r) = -r3 + 4r*2 + 3r + 2. Let q be l(5). Let x be ((-12)/16)/(12/q). Does 1 = x? False Let f = 27 - 16. Let y be ((-8)/(-6))/(f/33). Suppose -yk - 4 = 5o - 3k, -2k = 4o + 8. Are o and 2 equal? False Let h be 9/68/(-6). Let r be h(-1 - 6/(-4)). Is r < -1/3? True Let n = -49 - -48. Which is smaller: n or -7/4? -7/4 Let x = -0.13 + 1.13. Which is smaller: x or 14? x Let c = 17 - 33/2. Let v = -8778 + 175807/20. Let s = -51/4 + v. Which is smaller: c or s? s Suppose -4o + 2o = z - 74, -o + 5z = -59. Let i be 2/(-6) - o/(-63). Which is greater: 1 or i? 1 Let f = 0.02 - -0.09. Let b = 0.11 - f. Is b less than -9? False Let i = 73 - 72.26. Let l = 0.06 + i. Which is bigger: l or 2/3? l Let j = 35 + -23. Let i = 12.14 - j. Which is bigger: 1 or i? 1 Let f = 1583194/71 + -22298. Let y be (-2)/(-3) + (-2944)/4686. Let b = y + f. Does b = 0? False Let f be ((-3)/(-9))/((-1)/9). Let h be (-14)/f + (-4)/6. Suppose 4b - 4 = h. Is b at least 1? True Let y be ((-28)/20)/(3/(-35)). Let k = -17 + y. Are 0.02 and k unequal? True Let u be (-1 - 2) + 4 - 0. Suppose -2p = 8, -2p = -4h - p + 184. Let a = -309/7 + h. Which is bigger: a or u? u Let z = 0.1 + -0.1. Let j(t) = -2t - 6. Let i be 186/(-42) - 6/(-14). Let q be j(i). Which is greater: q or z? q Let w(y) = 3y + 2. Let v be w(-3). Let l = -12 - v. Let r(p) = p + 1. Let m be r(l). Is -4 greater than m? False Let n(d) = d*3 - 3d + 3. Let t be n(2). Suppose -i + tw = 16, -3i - 3w = -i - 20. Suppose i = -h + 5h. Which is greater: 0 or h? h Let v be (1/(-22))/((-6)/(-72)). Which is smaller: -1 or v? -1 Let p = -0.5 + 0.55. Is p < 0.1? True Suppose -2i = -2n - 14, -5 = -4n + 5i - 33. Is n <= -7? True Let w be (-13 + 7)(-1)/2. Are w and 4 unequal? True Let y = 9 + -10. Let i be (0 + 1 - y)/2. Are i and -1 equal? False Suppose -11l = -7l. Which is bigger: l or -2/5? l Let c = -534/7 + 76. Which is greater: c or -1/4? -1/4 Let b be (-11)/2 - 2/(-4). Let j(f) = -f2 - 7f - 7. Let h be j(b). Suppose -5o = 3p + 3, h - 4 = -5o + p. Do -1/2 and o have the same value? False Suppose -2o - 13 = 13. Is -15 > o? False Let b(v) = -v - 2. Let a be b(-2). Is a greater than or equal to -2/69? True Let h = -1023/5 - -204. Which is smaller: h or -1? -1 Let c be (-1 - -6) + -3 + 2/(-1). Let z = -107/3 + 2467/69. Is c greater than or equal to z? False Let o(b) = -b + 5. Let h be o(4). Suppose -3s + 4s - 4 = -2c, 3s = 6. Let z be c - (32/(-10))/(-4). Which is smaller: h or z? z Suppose 2d - 14 = 5w, 3d = -2w + w + 4. Is -12/17 at least w? True Let t(g) = g*2 + 3g + 2. Let s be t(-5). Let j be (-2)/6 - s/18. Which is smaller: 2/17 or j? j Let z = -147 + 1026/7. Let t = 30 + -29. Is z equal to t? False Let z = 18 + -27. Let m = -13 - z. Are m and -3 equal? False Let t = -0.025 - -4.025. Is 5 equal to t? False Let j(c) = c*3 - 3c*2 - 4c + 2. Let b be j(4). Let l(n) = 2 - 1 - 2 + n*2. Let u be l(1). Which is smaller: b or u? u Suppose -d = j - 5, -3d + d + j + 7 = 0. Suppose -dh + 6 = 3i, -3i + 2h = -5i + 4. Is i smaller than 2? False Let o = -285/7 - -41. Let k = 1 + 2. Let g = -4 + k. Which is bigger: o or g? o Let k(d) be the second derivative of 2d3/3 - d2/2 + 6d. Let l be k(-3). Are -12 and l non-equal? True Suppose -7h + 12 = -3h + 2j, 0 = -3h + 2j - 5. Suppose 4z = 3z + h. Is z less than or equal to 2/15? False Let d = -16.81 + -0.19. Let x = 12.9 + d. Let p = x + 4. Which is smaller: 0.1 or p? p Let p be (12/426)/((-6)/2). Which is bigger: 1 or p? 1 Let c be 3/(-2)2/8. Let w(r) = -r3 - 4r*2 - r + 4. Let k be w(-4). Suppose 5j - kj = 0. Is c smaller than j? True Suppose 1 = -2b - 7. Let z be (b/16)/((-2)/4). Suppose j - 5 = -2r, -r - 7 = -j - 4r. Do z and j have different values? True Let t be ((-10)/4)/(4/8). Let u = 11 + -1. Let p = t + u. Which is smaller: 4 or p? 4 Suppose -2z + z = 2. Let l = 0 - -1. Let d be (l/2)/(2/(-4)). Are z and d unequal? True Suppose 1 = -4a + 161. Let q = a - -16. Let b be 62/q - 4/16. Which is greater: 1 or b? 1 Let f be 2/(-2 - -4)6. Let o be (f/(-4))/((-2)/(-4)). Which is smaller: -12/5 or o? o Let p be (-6)/((-6)/(9/3)). Suppose -1 = 2r - p. Are 2 and r equal? False Let q = -359/2156 + -3/196. Let f be -1 - (1 + (-1 - 1)). Which is smaller: q or f? q Let r = -2.4 + 48.4. Which is smaller: 0.1 or r? 0.1 Suppose 0 = -d + 4j - 3, 5d - 6 = -2j + 1. Is 4/5 at least d? False Suppose 3z + 4l + 172 + 549 = 0, 5z - 2l + 1193 = 0. Let j = 951/4 + z. Is j > 0.1? False Suppose -129 = 4s - 145. Let d = -8 - -15. Let q(t) = t*3 - 8t*2 + 7t + 5. Let o be q(d). Is s at least as big as o? False Let y be 42 + 6/1 + (-1 - 2). Is y >= 44? True Let o = -8 + 7.4. Let d be 6/(-9) + (-2)/6. Let x be (d - (-1 + 1))1. Are x and o nonequal? True Let v be (-1)/2 - (-2)/8. Let w = 14 + -11.7. Let d = -0.3 + w. Which is smaller: d or v? v Let m = 3/2 - 5/6. Suppose 3h + 7 = 2w, 0 = 5h - 3w + 2w. Is m <= h? True Let d(n) be the third derivative of -n*4/24 + 7n*3/6 + 4n*2. Let k be d(7). Let t = -39/220 - 1/44. Are t and k nonequal? True Let b be 23/(-21) + 119/245. Is 1/3 > b? True Let p = -160 + 159. Let x be (8/(-18))/((-10)/(-3)). Is p equal to x? False Let s be 1/(-6)3/2. Let i = 17 - 16. Which is greater: s or i? i Suppose 82 = -5z + 62. Which is smaller: z or 2? z Let k = -53 + 38. Is k equal to -17? False Let o = -4 + 4. Suppose m = -om - 1. Let y be -12/4m. Does 1 = y? False Let a(v) = -4v - 3. Let y be a(-1). Which is smaller: y or -1/19? -1/19 Let z(h) = h*2 - 10h + 1. Let f be z	{ "pile_set_name": "DM Mathematics" }
, -726, -727, -728? -729 What comes next: -2, -41, -116, -233, -398, -617, -896, -1241? -1658 What comes next: 155, 597, 1335, 2369, 3699, 5325? 7247 What comes next: -15, 2, 31, 72, 125, 190? 267 What is the next term in -36, -72, -110, -150, -192, -236? -282 What comes next: 2, -12, -32, -58, -90? -128 What is the next term in -1906, -1904, -1902, -1900, -1898, -1896? -1894 What is the next term in -50, -67, -96, -137, -190? -255 What comes next: -385, -378, -367, -352, -333? -310 What is the next term in 55, 104, 165, 244, 347, 480, 649, 860? 1119 What comes next: 145, 257, 379, 517, 677, 865, 1087, 1349? 1657 What is the next term in 63, 223, 475, 807, 1207? 1663 What is next in 68, 125, 168, 197, 212? 213 What comes next: -21, -45, -69, -93, -117? -141 What is the next term in -904, -1808, -2712, -3616, -4520, -5424? -6328 What is next in 7, 15, 21, 25? 27 What is the next term in 21, 19, 13, 3, -11? -29 What comes next: -50, -193, -432, -767, -1198, -1725, -2348? -3067 What is the next term in -570, -559, -544, -531, -526, -535? -564 What is the next term in 13, 27, 65, 133, 237, 383, 577? 825 What comes next: -53, -119, -201, -305, -437? -603 What is the next term in -154, -277, -410, -559, -730, -929, -1162, -1435? -1754 What comes next: 13, -20, -125, -338, -695, -1232, -1985? -2990 What is next in -147, -631, -1431, -2541, -3955, -5667, -7671? -9961 What comes next: 638, 641, 654, 683, 734, 813, 926? 1079 What is the next term in 436, 453, 488, 547, 636, 761? 928 What is next in 301, 301, 303, 307, 313, 321, 331? 343 What is next in -987, -1978, -2969, -3960, -4951, -5942? -6933 What comes next: -3, 16, 47, 96, 169, 272, 411? 592 What is the next term in 13180, 13175, 13168, 13159, 13148, 13135, 13120? 13103 What comes next: -15, 19, 115, 303, 613, 1075, 1719? 2575 What is next in 15, -9, -63, -159, -309, -525? -819 What comes next: 41, 105, 195, 323, 501, 741, 1055? 1455 What comes next: 42, 104, 208, 354, 542, 772, 1044? 1358 What comes next: -15, 0, 15, 30, 45? 60 What comes next: 208, 226, 258, 310, 388, 498? 646 What is next in -121, -240, -357, -472, -585, -696? -805 What is the next term in -29, -90, -197, -356, -573? -854 What comes next: -93, -94, -95? -96 What is the next term in 535, 532, 527, 520? 511 What is the next term in 104, 418, 948, 1700, 2680? 3894 What is next in 1060, 1052, 1040, 1024, 1004, 980? 952 What is next in 813, 812, 811, 810, 809, 808? 807 What is the next term in 359, 525, 691? 857 What is next in -70, -127, -184, -241? -298 What comes next: -52, -85, -88, -49, 44, 203? 440 What is the next term in -3, -26, -63, -114, -179? -258 What comes next: 312, 308, 300, 288, 272, 252, 228? 200 What is the next term in -466, -935, -1404, -1873, -2342, -2811? -3280 What is next in 1020, 2041, 3062? 4083 What comes next: 6, -5, -34, -87, -170, -289, -450, -659? -922 What is the next term in -131, -139, -153, -173, -199, -231, -269? -313 What is next in -1675, -1680, -1685, -1690, -1695, -1700? -1705 What is the next term in -50, -26, -4, 16? 34 What is next in 17, 39, 99, 215, 405? 687 What is the next term in 279, 543, 793, 1023, 1227, 1399, 1533? 1623 What is next in -2193, -2197, -2211, -2241, -2293, -2373? -2487 What comes next: -1, 1, -7, -31, -77, -151, -259? -407 What comes next: -413, -1625, -3657, -6515, -10205, -14733? -20105 What comes next: -69, -193, -317, -441, -565, -689? -813 What is next in -63, -72, -67, -42, 9, 92? 213 What comes next: 18, 55, 108, 177? 262 What comes next: -200, -195, -190? -185 What is next in 17, 66, 197, 452, 873, 1502, 2381? 3552 What is the next term in 40, 77, 114, 151, 188? 225 What comes next: -14, -19, -28, -41, -58, -79, -104? -133 What comes next: 5, 26, 83, 194, 377, 650, 1031? 1538 What comes next: 154, 158, 164, 172, 182, 194? 208 What comes next: -24, -32, -40, -48, -56? -64 What is the next term in -910, -911, -912? -913 What comes next: 18, 35, 50, 63, 74? 83 What is the next term in -183, -182, -181, -180? -179 What is next in 1661, 1659, 1657, 1655, 1653, 1651? 1649 What is next in -281, -282, -283, -284, -285? -286 What is the next term in 35, 64, 93? 122 What is next in 66, 455, 1508, 3555, 6926, 11951? 18960 What is the next term in 116, 109, 102, 95, 88, 81? 74 What is the next term in 64, 438, 1460, 3454, 6744, 11654, 18508, 27630? 39344 What is next in -11, -30, -49, -68, -87, -106? -125 What is the next term in 33, 62, 89, 114, 137, 158? 177 What is next in 127, 532, 1207, 2152, 3367, 4852? 6607 What is the next term in -170, -308, -434, -542, -626? -680 What is the next term in 546, 2175, 4890, 8691? 13578 What is the next term in -2788, -2783, -2778? -2773 What is next in 314, 282, 252, 224? 198 What comes next: -499, -508, -533, -580, -655, -764, -913? -1108 What is next in 11, 19, 27, 35, 43? 51 What is next in 12751, 12750, 12749, 12748, 12747, 12746? 12745 What is the next term in -23, -28, -35, -44, -55? -68 What comes next: -433, -3397, -11447, -27127, -52981? -91553 What comes next: 221, 219, 205, 173, 117, 31, -91, -255? -467 What is next in 17, 19, 25, 35? 49 What is the next term in -3, -5, -11, -21? -35 What comes next: 283, 274, 257, 232, 199, 158? 109 What comes next: 375, 336, 297? 258 What comes next: -101, -94, -85, -74, -61, -46, -29? -10 What is next in 46, 49, 52, 55? 58 What comes next: 84, 86, 98, 126, 176, 254, 366? 518 What is next in -1565, -3132, -4699, -6266, -7833, -9400? -10967 What comes next: -115, -134, -155, -178? -203 What comes next: -1960, -1940, -1900, -1834, -1736, -1600? -1420 What is the next term in 429, 430, 431, 432? 433 What is the next term in 602, 601, 598, 593, 586, 577, 566? 553 What comes next: 401, 1613, 3627, 6437, 10037? 14421 What comes next: -1002, -993, -982, -969? -954 What is next in -5002, -5003, -5004, -5005, -5006, -5007? -5008 What is the next term in -172, -170, -166, -160, -152? -142 What is next in 1137, 1134, 1131? 1128 What is next in -536, -523, -520, -533, -568, -631, -728, -865? -1048 What comes next: -7, -32, -63, -100, -143, -192, -247? -308 What is the next term in 12, 5, -2, -9, -16, -23? -30 What is the next term in 132, 131, 130? 129 What comes next: 15, 24, 37, 54, 75, 100? 129 What comes next: 28, 30, 32, 34? 36 What is next in -315, -615, -911, -1203, -1491, -1775, -2055? -2331 What is the next term in 1424, 2843, 4260, 5675, 7088, 8499? 9908 What is next in -2, -9, -30, -71, -138, -237, -374? -555 What comes next: -11, -18, -25, -32, -39, -46? -53 What is the next term in 9, 28, 51, 72, 85, 84, 63? 16 What is next in 185, 352, 519, 686? 853 What comes next: 690, 1273, 1842, 2391, 2914, 3405? 3858 What is the next term in 905, 901, 897, 893, 889, 885? 881 What is the next term in -99, -195, -291? -387 What is next in -2868, -5734, -8600? -11466 What is the next term in -9, -7, -5, -3, -1, 1? 3 What is the next term in -3517, -28162, -95057, -225328, -440101, -760502, -1207657? -1802692 What is next in -3, 13, 43, 93, 169? 277 What is next in 6, -9, -58, -159, -330? -589 What is next in 4, 5, 6, 7, 8? 9 What is next in -1728, -3439, -5150, -6861, -8572? -10283 What is next in 55, 138, 275, 466? 711 What is next in -38, -36, -34, -32? -30 What is the next term in 178, 248, 340, 466, 638? 868 What is the next term in 525, 1050, 1575? 2100 What is the next term in -22, -19, 2, 47, 122, 233? 386 What is next in -7, -16, -39, -82, -151, -252, -391? -574 What comes next: 16, 136, 460, 1090, 2128? 3676 What is the next term in 80, 90, 124, 194, 312, 490, 740, 1074? 1504 What is the next term in -237, -496, -745, -978, -1189, -1372, -1521, -1630? -1693 What is next in -22, -45, -68, -91, -114, -137? -160 What comes next: 6, -18, -42, -66, -90? -114 What comes next: 269, 251, 227, 203, 185, 179? 191 What is next in -14, 9, 92, 265, 558, 1001, 1624? 2457 What is next in 55, 62, 71, 82, 95? 110 What is the next term in 4624, 4619, 4610, 4597? 4580 What is next in 1010, 1014, 1018, 1022, 1026, 1030? 1034 What comes next: 100, 197, 280, 343, 380? 385 What is next in -178, -181, -184, -187, -190? -193 What comes next: -3296, -3299, -3302, -3305, -3308? -3311 What is next in -297, -585, -873, -1161, -1449? -1737 What is the next term in 74, 185, 306, 437, 578? 729 What comes next: -36	{ "pile_set_name": "DM Mathematics" }
et d = 221 - 883/4. Let x(l) be the second derivative of -5l + 0l*3 + 0 - dl*4 + 0l*2. Let b(p) = -2p. What is b(x(i))? 6i2 Let o(j) = -7j*2. Let l(n) = 244256n. Calculate l(o(f)). -1709792f2 Let b(g) = 1. Let j(n) = 3n*2 - 2. Let p(r) = 4b(r) + 2j(r). Let f be 27/5 - (-9)/15. Let x(m) = m2 + f - 6. Determine x(p(i)). 36i*4 Let b(c) = -6c. Let g(d) = d - 2. Let q(w) = 188w - 188. Let f(x) = 94g(x) - q(x). Determine b(f(l)). 564l Let w(z) = -286z*2 + 77z + 1540. Let j(y) = -11y2 + 3y + 60. Let d(x) = -77j(x) + 3w(x). Let v(k) = -4k2 - 5k + 3k + 2k. Calculate v(d(h)). -484h4 Let f(a) = a. Let l(z) = -201341z. Calculate f(l(m)). -201341m Suppose m + 11m - 24 = 0. Let k(l) = 2l. Let t(j) = 3j. Let x(o) = mk(o) - t(o). Let d(h) = -2h2 - h2 + 2h2. What is x(d(r))? -r2 Suppose -2s + s = -c - 7, 2c = 3s - 16. Let o(i) = 10is - 8i*2 - 21i*2. Let f(n) = -2n. What is f(o(v))? 38v2 Suppose 0 = -8c + 9c. Let x(l) = 5l*2 - 11l*2 + 7l*2 + cl*2. Let q(n) = 27n*2. Calculate q(x(d)). 27d4 Let z(f) = f2. Let v(w) = 16w. Suppose 4o = -4m - 24, 0 = -2o - 4m - 1 - 15. Let x(k) = -3k. Let h(a) = ov(a) - 22x(a). Calculate z(h(t)). 4t2 Let x(w) = 4w*2 + 260. Let t(h) = 2h. Give x(t(p)). 16p2 + 260 Let u(a) be the second derivative of -a4/3 - a. Let p(q) = 24 - 62 + 38 - 2q. What is p(u(h))? 8h2 Let t(j) = -4j. Let y = 101 + -98. Let w(b) be the second derivative of 0by + 2b + 0b2 + 0 - 1/6b*4. Calculate w(t(x)). -32x*2 Let g(f) = 5f - 18. Let o(p) = 2p2 - 9532 + 9532. Give g(o(w)). 10w2 - 18 Let q(d) = -d2 + 6d2 - 2d2. Let l(a) = a2 - a + 2. Let s(m) = -8m2 + 10m - 20. Let y(n) = -30l(n) - 3s(n). Determine y(q(z)). -54z4 Let w(y) = 2y*2. Let s(j) be the first derivative of -13j*4/8 - 5j*2/2 + 3. Let f(b) be the second derivative of s(b). Determine w(f(r)). 3042r*2 Let b(g) = 6007g*2 - 3 + 1 - 6004g*2 + 2. Let o(i) = 38i. Give o(b(d)). 114d2 Let y(m) = -46m2 + 207. Let z(l) = -l2 + 3. Let h(b) = -y(b) + 69z(b). Let k(g) = -19g*2. Give h(k(i)). -8303i*4 Let z(d) = 4d. Let k(h) be the second derivative of -h*3/6 + 2h - 141. What is z(k(i))? -4i Let y(n) = 4n. Suppose -4o = -2b - 10, 0 = -5o + 4b - 4 + 24. Suppose -2d + o = -4. Let w(u) = 5 + u2 + du*2 - 5. Determine y(w(r)). 12r*2 Let s(y) = -722y*2 - 716y*2 + 1436y*2. Let k(g) = 2g*2 - 3. Calculate k(s(u)). 8u*4 - 3 Suppose -5y = u - 0u - 75, 0 = y - 4u + 6. Let t(b) = yb - 8b + 4b. Let x(c) = 2c*2. Calculate x(t(j)). 200j*2 Let l(v) be the first derivative of -3v*2/2 + 129. Let o(x) = 200x. What is l(o(q))? -600q Let r(y) = -8y*2 - 15y*2 - 9y*2 + 37y*2 - 10y2. Let c(p) = p2 - 8. What is r(c(s))? -5s4 + 80s*2 - 320 Let o(a) = -2a*2. Let u(d) be the third derivative of 0d + 0 - 4d2 - 1/24d*4 + 0d*3. Calculate u(o(f)). 2f*2 Let a(n) = 80n*2. Let p(k) = -3k*2 + 4k + 4. Let r(b) = -6b2 + 9b + 9. Let u(j) = -9p(j) + 4r(j). Give a(u(t)). 720t4 Let s(a) = a2 + a - 1. Let q(f) = -3f*2 + 23f + 4. Let c(k) = q(k) + 4s(k). Let o(z) = -4z*2. Give o(c(h)). -4h*4 - 216h*3 - 2916h*2 Let j(f) be the second derivative of -3f*4/2 - 2f. Let z(l) = 2l2 + l + 5. Let y be z(-2). Let c(g) = -yg*2 + 8g*2 + 5g*2. Calculate j(c(h)). -72h4 Let x(h) = h2 - 36. Let l(k) = -226k + 1. Calculate l(x(t)). -226t*2 + 8137 Let m(w) = -3w*2 + 8w*2 - 5w*2 - 2w*2 + 6w*2. Let t(a) = 2a - 3. Let x be t(4). Let b(g) = 3g - xg + g. Determine b(m(p)). -4p2 Let c(f) = 7f. Let y be 7 - ((-18)/(-3) + -4). Let a(u) = yu2 + u2 - 2u*2. Calculate c(a(m)). 28m*2 Let p(b) = -84289b. Let d(c) = 4c2. What is d(p(j))? 28418542084j*2 Let g(y) = 0y - y + 4y + 5y - 4y. Let n(b) = -3b*2 + 3b2 + b2. What is g(n(r))? 4r2 Let g(p) = 916p + 2. Let n(l) = 13l. Determine g(n(i)). 11908i + 2 Let w(b) = 30b2 + 2b. Let f(c) = -439c. Give w(f(d)). 5781630d*2 - 878d Let d(l) = l*2 + 6l2 - l2. Let x(p) = -701496p + 701494p + 5 - 5. Determine d(x(o)). 24o2 Let i(n) = 70n. Let z(y) = -114y. Give z(i(b)). -7980b Let u(g) = 27884g2. Let p(n) = 3n*2. Calculate p(u(f)). 2332552368f*4 Let l(d) = -4d. Let o(w) = 162w2 - 33w - 33. Let i(b) = -20b2 + 4b + 4. Let c(a) = 33i(a) + 4o(a). Give l(c(r)). 48r2 Let b(d) be the second derivative of 0d*3 + 0d*2 + 0 + 1/3d*4 - 2d. Let a(v) be the second derivative of v*4/4 - 55v. Calculate a(b(o)). 48o4 Let f(r) = -31r + 536. Let a(m) = -2m2. Calculate a(f(z)). -1922z*2 + 66464z - 574592 Let b(h) = -3h. Let n = -30 + 30. Let f(w) = 8w - 6w + nw + 2w. Calculate f(b(t)). -12t Let n(t) = 3t. Let c(a) be the third derivative of 15a4/8 - a3/6 - 445a2. Calculate n(c(v)). 135v - 3 Let y(q) = 3660q. Let p(o) = 3o - 11. Calculate p(y(t)). 10980t - 11 Let j(l) be the first derivative of -l2/2 - 3l + 13. Let o(g) = -1. Let h(w) = -j(w) + 3o(w). Let q(a) = 16a*2. Determine q(h(m)). 16m*2 Let r(z) = -2z. Let k(i) = -14i. Let h(s) = k(s) - 6r(s). Let d(w) = w*2 - w. Determine h(d(y)). -2y*2 + 2y Let w(p) = 3p2. Let b(m) = -2m + 5. Let l(r) = 3r - 9. Let d(h) = -9b(h) - 5l(h). What is w(d(u))? 27u*2 Let d(n) = n - 2n - n. Let t(a) be the second derivative of -17a4/24 - 9a*2 - 71a. Let v(q) be the first derivative of t(q). Give v(d(o)). 34o Let t(c) be the third derivative of 5c*4/24 + 130c*2. Let s(y) = -2y*2 + 45. Calculate s(t(u)). -50u*2 + 45 Let v be 44/(-10) - (-24)/60. Let m(q) = 4q + 2. Let u(g) = -21g - 11. Let z(n) = vu(n) - 22m(n). Let w(j) = -15j. Calculate z(w(o)). 60o Let w(d) = -5d2 + 5. Let v(o) be the first derivative of -o2/2 - 219. Calculate w(v(z)). -5z2 + 5 Let p(g) = 1381867g. Let i(a) = -2a. Determine i(p(w)). -2763734w Let d(f) = -4f2. Let c be 6/(-9) + 14/3. Let p(m) = cm - 4m - m + 5m. Calculate d(p(l)). -64l2 Let g(w) = -2w*2. Let i(m) be the first derivative of 3m4/4 - m2/2 + 1. Let a(r) be the second derivative of i(r). Calculate g(a(f)). -648f2 Let l(x) = 2x. Let n(r) be the first derivative of r*3/3 - 2r*2 - 3r - 2. Let v be n(5). Let u(z) = -vz2 + 2z2 + z2. Give u(l(k)). 4k2 Let r(g) = -391g. Let c(t) = 23t - 6. Let f(v) = -4v + 1. Let s(l) = c(l) + 6f(l). Give r(s(w)). 391w Let f(z) = 712z2 + 3. Let j(g) = -17g. Give f(j(t)). 205768t2 + 3 Let s(f) be the second derivative of -f6/120 - 2f*3/3 - 8f. Let w(p) be the second derivative of s(p). Let g(y) = -3y2. What is g(w(j))? -27j*4 Let p(s) = 3 + 0s + 2s + 0s - 3. Let u(a) = -274a. Give u(p(n)). -548n Let y(t) be the first derivative of -3t2/2 + 54. Let m(p) = p + 1. Let k(j) = j + 3. Let b(c) = k(c) - 3m(c). Determine y(b(r)). 6r Let u(a) = 9a*2. Let j(l) = 195 + 7l - 38l + 194 - 389. Determine u(j(p)). 8649p*2 Let x(h) = -1 - 24 + 5 - 4h. Let c(u) = u + 6. Let i(a) = 10c(a) + 3x(a). Let l(d) = 2d + 11d*2 - 2d. Calculate i(l(r)). -22r2 Let h(t) = 2t - 2. Let k(s) = 20s + 12. Let u(i) = 6h(i) + k(i). Let y(f) = f - 293 + 293. Calculate y(u(j)). 32j Let u(j) be the first derivative of -2j3/3 - j2 - 15. Let v(k) = k. Determine v(u(b)). -2b2 - 2b Let y(z) = -1757z - 3. Let q(g) = g2. Calculate q(y(l)). 3087049l*2 + 10542l + 9 Let b(h) = -68225h2 + 2. Let r(m) = -4m. Give b(r(x)). -1091600x2 + 2 Let j be (1/(-3))/(5/(-60)). Let l(t) = -jt + 3t - 2t. Let u(s) = -9s + 9s - 3s. Calculate u(l(h)). 9h Let x(r) = -2r + 1. Let z(b) = 2. Suppose -15 + 6 = -q - 2y, 2q - y = -7. Let d(c) = qz(c) + 2x(c). Let a(k) = 11k*2. Give a(d(p)). 176p*2 Let u(c) = 3c. Let n(v) = 2v. Suppose -p + 3p + 2g = 0, -g = 3. Let j(z) = pu(z) - 5n(z). Let y(q) = -6q + 5. Give j(y(h)). 6h - 5 Let a(b) = 14b*2. Let s be 9/(-3) - (-7 - 1). Let g(l) = -2l*2 - s + 4 + 1. Determine g(a(q)). -392q*4 Let w(a) = 27a*2. Let d(i) be the third derivative of -9i*5/20 + 203i*2. What is w(d(b))? 19683b*4 Let y(d) be the first derivative of 3d*2 + 4. Let t(m) = -2m + 25 + 4m - 25. Determine y(t(w)). 12w Let k(g) = -	{ "pile_set_name": "DM Mathematics" }
= -1.456076 - k. Round m to four dps. 0.0039 Let v = -4171.60293 + 4171.4. Round v to one decimal place. -0.2 Let k = 53303.723 - 53331. Let t = -27.6 - k. What is t rounded to 1 dp? -0.3 Let b = 1552 - 449. Let h = 2.35817 - 1093.96817. Let v = b + h. What is v rounded to zero decimal places? 11 Suppose -9l = -263019852 + 1834509852. Round l to the nearest one million. -175000000 Let q = 3.775 - 3.7747326. Round q to five dps. 0.00027 Let n = -12.9 - -14.89. Let x = n + -2.31. What is x rounded to 1 decimal place? -0.3 Let b = -196.27 + 269.3. Let c = -13.13 + b. Let w = -130.1 + c. Round w to the nearest ten. -70 Let g = 16.338 - -3.208. What is g rounded to 1 dp? 19.5 Let d = -13254 - -13253.9964713. What is d rounded to three decimal places? -0.004 Let r be (1 - 0/(-2))270500150/25. Suppose 3w + 3s - r = w, 10820010 = 2w + 5s. What is w rounded to the nearest 100000? 5400000 Let o = 48.9 + 176.1. Let g = -87 + o. Let x = -137.99999939 + g. Round x to 7 dps. 0.0000006 Let y = -19565830.7 - -19565830.224999948. Let l = -0.475 - y. What is l rounded to seven dps? 0.0000001 Let y = -8.449 + -0.151. Let z = -97.1 - y. What is z rounded to the nearest 10? -90 Let a = 4849.1 + -5127. Let v = a - -273.973. Round v to zero decimal places. -4 Let c = -1.26 - -191.26. Let j = c - 190.063. What is j rounded to two decimal places? -0.06 Let z = 162 + -84. Let i = z - 77.99999408. What is i rounded to 7 decimal places? 0.0000059 Let x = 167.882 - 168. Let y = 0.1180888 + x. What is y rounded to 5 dps? 0.00009 Let l = -35120276991.99999707 - -35120276781. Let p = 916 - 1127. Let i = l - p. What is i rounded to 7 dps? 0.0000029 Let g = 5172334286.199752 + -5172887860. Let x = 553572 + g. Let q = -1.8 - x. What is q rounded to 5 decimal places? 0.00025 Let p be ((-20)/8)/(1/(-1500)). Let r be 20000/((27/p)/(-9)). What is r rounded to the nearest one million? -25000000 Let d = -55.414 + 55.437801. What is d rounded to four decimal places? 0.0238 Let d = -449.00000838 + 449. Round d to six dps. -0.000008 Suppose -849 = -8n - 209. Let q = n - 6160. What is q rounded to the nearest 1000? -6000 Let z = -501.4 + 501.40023374. What is z rounded to five dps? 0.00023 Let a = -8128.238 + 8110. What is a rounded to one decimal place? -18.2 Suppose 3g - 4i + 58512768 = -i, 5g + 97521260 = i. Let f = 30244251 + g. What is f rounded to the nearest 100000? 10700000 Let i = -33 - -63. Let z = 14 - i. Let p = z + 15.9985. Round p to 3 decimal places. -0.002 Let s = 133.42 - 135. Let m = 19.68 - 20. Let y = m + s. Round y to the nearest integer. -2 Let s = 773 - 746.55. Let g = s + -26. Let m = g - 0.449924. What is m rounded to five decimal places? 0.00008 Suppose -h + 12 = 3h. Let a(x) = 46665x - 11. Let b(y) = 419986y - 98. Let k(w) = -35a(w) + 4b(w). Let s be k(h). Round s to the nearest 100000. 100000 Let m = -3367385573.65600113 - -3367399938.957. Let g = m - 14365.068. Let h = g + -0.233. Round h to 7 decimal places. -0.0000011 Let m = 1348 - -28612. Let r be (m/(-21))/5-375. Round r to the nearest 100000. 100000 Let g = -10.35 - -663.35. Let i = g + -652.999999268. Round i to 7 decimal places. 0.0000007 Let k = 174 + -174. Suppose -j + 2v - 2999996 = 0, k = -3j + 5v - 3590190 - 5409800. Round j to the nearest one hundred thousand. -3000000 Let w(h) be the third derivative of 0 - 821/3h4 - h2 - 2/3h3 + 0h. Let g be w(-3). Round g to the nearest 1000. 20000 Let y(v) = v*2 - v - 33. Let q be y(26). Suppose 0 = 2o + 5t + 109 + q, 4t = -3o - 1103. Round o to the nearest 10. -370 Let x = 15602 + -11765. Round x to the nearest 100. 3800 Let i = -0.239 + -0.019. Let l = i - 132.742. Let t = 132.9894 + l. What is t rounded to two decimal places? -0.01 Let z(o) = 13003o - 27. Let d = -21 - -36. Suppose 0 = -5q + 30 + d. Let b be z(q). What is b rounded to the nearest 10000? 120000 Let s = -1.4429 + -0.8449. Round s to two decimal places. -2.29 Let b = -6311 - -6315.981. Round b to 1 dp. 5 Let q = 2887436.2 + -2887436.259986257. Let i = q - -18.059997057. Let j = 18 - i. Round j to 6 dps. -0.000011 Let o be -5 + (3 + 973508 - (-7 - 91/(-7))). What is o rounded to the nearest ten thousand? 970000 Let i(a) = -346a*3 - 4a*2 + 3a - 22. Let z be i(22). What is z rounded to the nearest 10000? -3690000 Let t = 1557.1 - 1494. Let l = 6.9 + t. Let d = l - 70.0003. Round d to 3 decimal places. 0 Let b(d) = -d*2 - 6d - 8773. Let c be b(0). Let y be c/13 + 80/(-13) + 6. What is y rounded to the nearest ten? -680 Suppose 0v + 6 = -2v, 63 = 3z - 3v. Let x be 197988/z - 6/(-9). Let o be (-21 + 103)/((-2)/x). Round o to the nearest one hundred thousand. -500000 Let q = 18334.999823 + -18335. Round q to five dps. -0.00018 Let w = -379.78 + 376. Let g = -14.6 + 6.19. Let m = w - g. What is m rounded to one decimal place? 4.6 Let y = -33 - -17. Let s = y + 46. Let w = 19.8 - s. Round w to the nearest integer. -10 Let b = -0.1627 + 1185.3627. Round b to the nearest 100. 1200 Let o = 4928.60193 + -4928.2. Round o to two decimal places. 0.4 Let j = 201 + -586. Let g = -374.66 - j. What is g rounded to zero decimal places? 10 Let r = 1838 + -1746. Let l = 4158.9 + -4250.915. Let i = r + l. Round i to 3 dps. -0.015 Let r be (4 + (6 - -85774))(-3)/4. Let q = r - -91725. Suppose 6x + 215187 = q. What is x rounded to the nearest 1000? -31000 Let f = -40852.950341 - -40853. Round f to two decimal places. 0.05 Let n = 0.3004 - -306.1196. Let f = -309 + n. What is f rounded to 1 dp? -2.6 Suppose -7p + 3443468 = -653072. Suppose 3i - 155780 - p = 0. What is i rounded to the nearest one hundred thousand? 200000 Let a = -2847.097 + 3.797. What is a rounded to the nearest ten? -2840 Suppose -3f = 3v + 65865, 14f - 15f + v - 21945 = 0. What is f rounded to the nearest 1000? -22000 Let t = -222 + 222.3248. Let g = -0.31 + t. Let l = g + 0.7072. What is l rounded to two decimal places? 0.72 Let x = -780.97 + 13.97. Let a = x + 767.000001051. Round a to 7 dps. 0.0000011 Let j = -20.1478 + 20.1. Let w = 10969 + -10969.05021. Let n = w - j. Round n to four decimal places. -0.0024 Let i = 491420.218814 - 491439. Let x = i + -0.108714. Let p = x - -18.9. Round p to 3 dps. 0.01 Let u = -1590276.16799644 - -1589801.168. Let o = u - -475. Round o to six dps. 0.000004 Let y be (52 + 8)10/(-4). Let h be y(3 - (-10)/(-6)). Let p be (0 + -35)h4/(-2). Round p to the nearest ten thousand. -10000 Let x = -2133.15 - -2134.39003. Let z = x - 1.24. Round z to three decimal places. 0 Let g = 210 + -209.99996718. Round g to five decimal places. 0.00003 Let t = 19456 - 19439.549. Let q = 858.149 - 858. Let z = q + t. Round z to 0 decimal places. 17 Let z = -3.113 + 3.26. Let b = z - -71.853. Let k = b - 72.35. What is k rounded to 2 dps? -0.35 Let d = -1.158 - 183.842. Let u = 2030033.1 + -2030218.09843. Let k = u - d. Round k to three decimal places. 0.002 Let v = 3925.164 - 3999. Round v to the nearest 10. -70 Let t be 252/40 - 2770334/28. Round t to the nearest 1000. -99000 Let g = 61820878.18 - 61821159.1800299. Let m = -281 - g. What is m rounded to five decimal places? 0.00003 Let o = -302 - -567. Let q = -264.9999905 + o. What is q rounded to six decimal places? 0.00001 Let m(o) = -27o2 - 6o + 7. Let q(k) = -k*2 + k - 1. Let j(v) = -m(v) - 4q(v). Let p be j(-3). Suppose p + 322 = -4c. Round c to the nearest 10. -150 Let n = 3 + -396. Let u = 392.99978 + n. Round u to 5 dps. -0.00022 Suppose 3y - 13 + 16 = 0. Let z be 4/2 + (0/(-2))/y. Let r be 4201(-25)/z. What is r rounded to the nearest 1000? -1000 Let d = 61866 - 90543. Let z be 1/(0 + (-1)/1721323). Let p = z + d. Round p to the nearest 100000. -1800000 Let i = -90 + 120. Suppose t - i - 12 = 0. Let q be (t/5)/(56/(-20) + 3). Round q to the nearest 10. 40 Let n = -32036 - -32036.000018563. Round n to five decimal places. 0.00002 Let j = -78.110637 + 78.11. Round j to four dps. -0.0006 Let l = -0.0324 + -292.9676. Let b = l - -292.62. What is b rounded to 1 dp? -0.4 Let n = -5619 + 5629.541. What is n rounded to one decimal place? 10.5 Let j = 0.419 - 0.464. Let t = 0.103 - j. What is t rounded to 2 decimal places? 0.15 Let r = 56200 - 34432. Suppose -r = 2t - 3f, -2t - 1377 = 5*f + 20423. Round	{ "pile_set_name": "DM Mathematics" }
- x*3 + 2x*2 - 7x + 11. Is f(v) a composite number? True Let x(q) = -97q3 - 10q*2 - 27q + 249. Is x(-17) prime? True Let x(o) = -3o2 + 3o + 32888. Let q be x(0). Suppose -4b = -4f - 21818 - 11058, -4b + f = -q. Is b a prime number? False Suppose -10h = -5 - 15. Suppose 2b = -h, 9u = 10u - 5b - 7. Suppose -uc = f - 2577, 0 = -f + 2c + 1432 + 1149. Is f composite? False Let q be (-24)/((2/(-130))/(3 + 10)). Suppose -4y - y - q = -5h, 4h - 5y = 16222. Suppose 0 = o - 3k - 1043, k + 1157 + h = 5o. Is o a prime number? False Let o(l) = -5l3 + 911l*2 + 9l - 3. Is o(14) prime? False Let k = 1170 + 2617. Is k prime? False Let p be -105-6371/14. Suppose -3n = 4b - 25037, p = n + n - b. Is n prime? False Suppose 5t + 5 + 7 = 3z, 0 = -4z - 2t - 10. Let w(i) = 3i2 - i - 2. Let l be w(z). Is 3436/7 + l/14 a prime number? True Suppose -276t = -23717164 + 4233496. Is t a composite number? True Let d = -23974 - -64667. Is d composite? False Let h(i) = -2i3 + 19i*2 + 10i - 4. Let c(d) = 5d3 - 39d*2 - 19d + 7. Let n(m) = -6c(m) - 13h(m). Is n(-9) a prime number? True Let b = 5425 + 10455. Let t = 22875 - b. Suppose 0 = -9z + 4z + t. Is z a prime number? True Let d = -6775 - -12398. Is d composite? False Let x be ((-32)/80)/((-2)/5). Let h = 127 + -130. Is (-907)/((-2 + x)(-3)/h) composite? False Suppose -j + 54593 = s - 29568, 2j - 168336 = 5s. Is j a prime number? True Let b(v) = -6537v + 215. Is b(-2) composite? True Let q be (3175 + 1)(0 - -1). Suppose -5f + 2u - 36 = 6u, -3f = -5u - 8. Is q/40 + f/10 prime? True Suppose 5d = 2n + 2461691, -120n = -124n - 32. Is d prime? False Suppose -19511 - 44323 = -z - x, -x - 319200 = -5z. Is z a prime number? True Let h(m) = 8m*2 + 11m*2 + 46 - 12m - 24m2 + 6m*2. Is h(15) a prime number? False Is (5 - (-119200)/(-15) - -8)3/(-1) a prime number? True Let n = 149 - 133. Let v = 633 + n. Is v composite? True Let z(i) = i*3 + 5i*2 - 8i + 6. Let j be z(3). Is 15192/j(-174)/(-8) prime? False Let v be 0 - 29078 - 55/(-11). Let w = 47440 + v. Is w prime? True Let c(t) = 10t - 21 + 18t + 294t*2 - 23t. Is c(4) composite? False Let k = 9410 - 2071. Suppose -3r = 2x - k, x + 3x - r = 14713. Is x a composite number? False Suppose 4m - 5i = 70487, -3m + 22i = 24i - 52871. Is m a composite number? False Suppose 0 = -11b - 11 + 66. Let f(r) = r3 + br*3 + 16r*2 - 5r*3 - 6. Is f(-15) a prime number? False Let d(a) = 1148a + 904a - 31 + 318a. Is d(6) composite? True Is (-116)/(-3)22647 + 97 + -92 prime? True Let u(z) be the first derivative of -z3/3 + z2/2 + 91z + 13. Let n = 36 + -36. Is u(n) a composite number? True Let p be 3/18 - 195798/36-1. Let j = 2612 + p. Is j a composite number? True Let q(u) be the third derivative of -299u*4/24 - 7u*3 - 8u*2 + 5. Suppose -2h = 6, -3t = 5h + 31 + 23. Is q(t) a prime number? False Suppose 120831 + 68169 = 25d. Suppose -35556 = -12j - d. Is j prime? True Suppose 0 = -13c - 806240 + 314489. Is c/(-3) - 1-2 prime? True Let k = -6592 - -4334. Let u = 9321 - k. Is u a prime number? True Let s = 815 - 817. Let c(l) = -1025l + 9. Is c(s) composite? True Let x(d) = -83 + 84d*2 + 7d + 45 + 41. Is x(-4) a composite number? False Is -5 - (1019164/(-30) + 36/270) prime? True Suppose 29v - 15v = -25v + 8113443. Is v a prime number? True Suppose -3x + 1808648 = 4c, 0 = -186x + 190x - 16. Is c prime? True Let r(g) = g3 - 10g*2 - 19g + 19. Let u be r(13). Let b be (-28)/(-4) - 3 - u. Let d = 501 + b. Is d a prime number? False Is 784277 + (-4 - 72/(-9)) composite? True Let i be ((-78)/(-52))/((-1)/(-118)). Suppose 184a - ia = 79121. Is a a prime number? False Suppose -108i + 1268162 = -94i. Is i a prime number? True Let s(b) = 7b3 + 2b*2 + 4b + 3. Let d be s(-1). Let x be (-2)/6 - 2/d. Suppose r - 3r + 4126 = x. Is r a prime number? True Let o = -11 - -61. Suppose 19m = 29m - o. Suppose -2b - 3 = -3b, y = -mb + 592. Is y composite? False Let u = -39 - -41. Let l = 0 + u. Let c(f) = 37f3 - 3f + 3. Is c(l) a composite number? False Suppose 3s + 4o - 11610 = 68199, -4o = 5s - 133007. Is s composite? True Is ((-2)/(-6))/((-260)/(-30571320)) a composite number? True Let a = 71306 - -160847. Is a a composite number? False Is (-3524171)/(-21) + (-2)/3 + -8 prime? True Is 8 + -3 - -3 - -64463 a prime number? False Let z = -4274 + 5895. Is z composite? False Suppose 63315 = -19j + 4j. Let c = j + 9308. Is c a prime number? True Suppose -3h - 928 = -m, -2m + 143 = -3h - 783. Let v = -279 - -132. Let n = v - h. Is n composite? False Let g(a) = 357a*2 - 7a + 303. Is g(-38) composite? False Suppose -2m - 1082418 = -4p, 0 = -2p + 4m - 23098 + 564304. Is p prime? False Suppose -4c - 4n = -608732, 5c + 2n = 7n + 760905. Is c a prime number? False Let d be 2/8 + (-57)/(-12). Suppose -13p + 12499 = 3o - 9p, do = 3p + 20851. Is o composite? True Let n = -309118 + 593507. Is n prime? False Let o = -84 - -82. Is o(-85)/(-30)-156 - -3 prime? True Suppose -5k + 3k - 1963598 = -16k. Is k a prime number? False Let c be (-1)/(-4 - 9431/(-2358)). Let l be 5 - ((-18)/21)/(2/504). Let h = c + l. Is h a prime number? True Let m(w) = 111w + 158. Let u be m(20). Suppose 3k = g + u, 5k + g = 2k + 2380. Is k a composite number? True Is 3604861-3(-7)/273 a composite number? False Let q = 244 - 240. Suppose 288 - 1468 = -n + 3s, -4n - qs + 4672 = 0. Is n a prime number? True Let g be ((-46)/(-6))/((-1)/(-3)). Let f = -29 + g. Let i(o) = -89o - 7. Is i(f) prime? False Let c be 60/644/34. Let j = c - 5. Suppose -3i = 12, -5i + 3061 = -jz + 3z. Is z a composite number? True Suppose 11 = k - 4. Suppose -k = 2g - 5g. Suppose 3a - 3v = 942, -1594 = -ga + 3v - 6v. Is a prime? True Is ((-2)/4)/((-371)/218861062) composite? True Let k(r) = r*3 + 5r. Let g be k(0). Suppose g = -16o + 108086 + 12858. Is o composite? False Suppose 193v = 16v + 17994705. Is v prime? False Let c be -6941/6. Let v be (4 - (-8542)/10) + (-16)/(-20). Let o = c + v. Is o a composite number? True Let y = 246 + -238. Is ((-21)/(-3))/(((-32)/(-3908))/y) composite? True Suppose 6f + 43863 = -3f + 12f. Is f a prime number? True Let h = -89 - -155. Let w = -4 + -27. Let j = w + h. Is j a prime number? False Suppose -2a - 16 = -b - 212, 3b = 12. Is ((-127850)/a)/(1/(-2)) a composite number? False Suppose 0 = 7h - 3361 - 161328. Let g = -16310 + h. Is g a composite number? True Let a(y) be the first derivative of 5y*2/2 - 4y + 2. Let q be a(6). Suppose q + 751 = 3m. Is m prime? False Let s(r) = 8r - 12. Let h(i) = 7i - 12. Let o(a) = 7h(a) - 6s(a). Let j be o(-6). Let b(c) = -183c + 47. Is b(j) a prime number? False Let i = -29177 - -41110. Let c = 19002 - i. Is c a composite number? False Suppose 7r - 63793 = 27088. Suppose 0 = z + 3p + p - 3227, -r = -4z - p. Is z composite? True Let d(g) = g + 8. Let a be d(-4). Let l(h) = 262h*2 + 7h - 19. Is l(a) a composite number? False Suppose 2q + 8956 = -2364. Let s = 8229 + q. Is s composite? True Let z = -4205 + 2725. Let a = z + 7509. Is a a composite number? False Let t(g) = g3 - 25g*2 + 33g + 14. Let c be t(26). Let b = c - 551. Is b a prime number? True Let z = 2241 - -1617. Let j = 2491 + z. Is j prime? False Let k(j) = 9j3 + j2 - 19. Let m be k(-6). Let x = -644 - m. Is x composite? False Suppose 48p = 1752 + 168. Is p/(8 - 13) - -23749 prime? True Suppose 12m - 332 - 196 = 0. Is (-3)/(18/(-10420))66/m composite? True Let z = 21 - 18. Suppose 3a - 24 = zn, -25 = 5n - 2a - 0a. Let b(q) = -52q*3 - 2q*2 + q - 4. Is b(n) composite? True Suppose 145q - 3186522 = 4332163. Is q composite? False Let r = -451851 + 640460. Is r a prime number? True Suppose -w - 5c = -5w + 28, -2w - 12 = 4c. Suppose -4r - 156 = -2x - 2x, -wx = -r - 76. Is x a composite number? False Suppose 3z = -q + 7281, 0 = 3q + 4z - 26148 + 4330. Suppose -4l + 7b - 3b = -14572, 3b = -2l + q. Is l prime? False Let p be (-4)/(-14) + (5 - (-65112)/56). Let z = p - 51. Is z prime? True Let c(f) = -25f3 + 2f*2 + 4f - 11. Let r be c(2). Let x = r - -698. Is x a prime number? True	{ "pile_set_name": "DM Mathematics" }
5w - 64. Let z(m) = m2 + 55m + 63. Let o(y) = jz(y) + 5b(y). What is the first derivative of o(q) wrt q? -2q - 55 Suppose -j = -3t - 2 - 2, -2t = 4j - 16. Find the third derivative of -12m4 + 11 - 81m*3 + 4m*2 - 25 + 14m*j wrt m. 48m - 486 What is the third derivative of 1932g4 - 17590051g*2 - 5g - 1 + 5g + 17589667g*2 wrt g? 46368g Let v(f) = 782f3 - 319f*2 + 2f + 4. Let a(j) = -779j3 + 319j*2 - 3j - 6. Let g(i) = 2a(i) + 3v(i). What is the third derivative of g(m) wrt m? 4728 Let g be (6 - 1) + (8 - 4 - 6). Suppose -gb + 18 = 3b. What is the third derivative of -5a3 + 2a*3 - 6a*b + 5a*2 - 4a*2 wrt a? -54 Let l(o) be the second derivative of -17o4/4 - o3/3 - 4823o2/2 + 3069o. What is the second derivative of l(t) wrt t? -102 Let q be 7/(-21) - -1(-1)/(-3). Let g be 2/4 + q + (-36)/(-24). What is the third derivative of -4s*5 + 11s*5 - 17s*5 + 7s*g wrt s? -600s*2 Let i = -305 + 310. What is the third derivative of -10y*4 - 63y*6 - 3y*2 - 4y + y*2 + iy + 12y4 wrt y? -7560y*3 + 48y Let t(z) = -2212z6 + 84z*2 + 16z + 5. Let d(y) = 1106y6 - 42y*2 - 9y - 3. Let m(j) = -5d(j) - 3t(j). What is the third derivative of m(f) wrt f? 132720f3 Let m(g) be the third derivative of -587g*6/40 - 2047g*3/6 - 2026g*2. Differentiate m(i) with respect to i. -5283i*2 Let s = 0 + 27. Find the third derivative of -si2 - i5 + 17i2 - 4i*4 - 2i*5 + 5i*4 wrt i. -180i*2 + 24i Find the third derivative of -279v5 - 255v*5 - 3v*4 + 551v*5 + 551v*2 - 3v wrt v. 1020v2 - 72v What is the second derivative of -2617 - 8l + 4807l*5 + 1110l*5 - 19l + 2607 + 4694l5 wrt l? 212220l*3 Let s(c) be the first derivative of 65c6 - c4/4 + 2c3 + 9013c*2/2 - 8497. What is the second derivative of s(q) wrt q? 7800q*3 - 6q + 12 Let o(h) = -2 + h - h + 5h - 3h - h*2. Let t(u) = 93u*2 + 2u + 2. Let m(q) = 2o(q) - t(q). Find the second derivative of m(i) wrt i. -190 Let g be ((-547547)/(-44))/13 - (-1)/(-4). Let q(y) = 6y - 4. Let z be q(3). What is the second derivative of -g + zm + 957 + 5m*5 wrt m? 100m*3 Differentiate 1522 + 734d*4 + 128d*4 + 132 - 220 with respect to d. 3448d*3 What is the third derivative of -195j*2 - 395j*3 + 2561j*2 - 3j - 3j4 + 3j wrt j? -72j - 2370 Let t(q) be the third derivative of 0 + 0q + 5q3 - 1/24q*4 - 85q*2 + 0q*6 + 97/210q*7 + 0q*5. What is the second derivative of t(c) wrt c? 1164c2 Let y(d) = d2 + 24d - 130. Let u be y(-29). Suppose -3k - 2t - 37 = -6k, -5t - 43 = -2k. What is the derivative of 16x + k - 15 - u + 17x wrt x? 33 Let a(g) = 741g2 - 114g + 14. Let d(j) = 247j2 - 38j + 5. Let r(c) = -6a(c) + 17d(c). What is the second derivative of r(o) wrt o? -494 Let j(c) = -8c - 53. Let m be j(-7). What is the first derivative of 174x*m + 40 - 48x*3 - 74x*3 + 16 wrt x? 156x*2 Let h(z) be the second derivative of -61z*4/3 + 1073z*3/3 - 2z + 609. Find the second derivative of h(d) wrt d. -488 What is the second derivative of 655i4 - 3i*2 + 715i*4 - 872i*4 - 1299i wrt i? 5976i2 - 6 Let m be (-62)/(-217) - 61/(-7). Differentiate -14y*3 - 12y*3 - 27 + my*3 + 28 wrt y. -51y*2 Let v(n) = -20 - 10 - 2n + n*2 - 8n. Let m be v(13). What is the third derivative of mg2 + g6 + 7g - 7g wrt g? 120g*3 Suppose 145z = 143z + 60. Find the second derivative of 301f*2 - 55f - 301f2 + 17f + zf3 + 1 wrt f. 180f Let i(r) = r*2 - 9r + 15. Let m be i(6). Let a be 4/(-6)m/22. Find the third derivative of -17b5 - 4b*2 + 4b*2 + 11b*a - 2b*5 wrt b. -1140b*2 Let r(b) = 6302b*2 + 2549b. Let i(x) = -138645x2 - 56069x. Let q(j) = 3i(j) + 65r(j). What is the second derivative of q(w) wrt w? -12610 Let t(d) = -d*3 + 13d*2 - 22d + 9. Let r be t(11). What is the second derivative of 49g2 - rg + 24g + g - 7g wrt g? 98 Let p(z) be the second derivative of 1685z3/6 + 1166z*2 + 423z + 5. What is the derivative of p(b) wrt b? 1685 Let o be 11 + -1 - (-1)/(-2 - -3). Let n = -9 - -13. What is the second derivative of 5v - 14v*4 + ov*4 - nv wrt v? -36v2 Find the third derivative of -2r*4 + 2r*4 - 153r*6 + 149r*2 + 1633r*6 + 1981r*2 wrt r. 177600r*3 What is the second derivative of -x - 10976 + 0x + 1576049x4 + 4183 - 1583257x*4 wrt x? -86496x*2 Suppose 3u + 9 = 0, p + 99 = 4p - 2u. Find the second derivative of 10 - 116m2 + 0 - 14 + 3 - pm wrt m. -232 Suppose 49o - 53o = -104. Suppose 3k = -10k + o. What is the second derivative of 13t - 14t*5 - 116t*2 - 118t*2 + 234t*k wrt t? -280t*3 Suppose -3i + 3 = -3h, -h = -3i - 5h + 38. Let j be 2/(((-21)/i)/(-7)). Find the third derivative of -55s*5 + 49s*5 - 2s*j + 2s*4 - 6s*2 wrt s. -360s*2 Let s(a) = 10a - 18. Let c(b) = -9b + 8 + 27 + 10b - 25b. Let i(x) = -2c(x) - 5s(x). Find the first derivative of i(f) wrt f. -2 Suppose 0 = -f - 5q + 3q, 9 = -3f + 3q. Let m be ((-10)/(-35))/(f/(-14)). What is the derivative of -4d*4 + md*4 - 15 - 413d + 0d4 + 388d wrt d? -8d3 - 25 Suppose -5v = v - 72. Suppose 8y = 5y + v. What is the derivative of -6 + 12hy - 3 - 11 wrt h? 48h*3 Find the third derivative of -412v*3 + 117 - 1236v*4 - 14v*2 - 295v*3 + 707v*3 wrt v. -29664v Let t(x) be the first derivative of -115x3/3 - 551x2/2 + 824. What is the second derivative of t(h) wrt h? -230 Let w(z) = z2 - 10z + 24. Let b be w(8). Suppose 0 = -12o + bo + 16. What is the second derivative of -33v + 2v2 + ov*2 - 7v + 29v2 wrt v? 70 Let w = -3842 + 2654. Let j be 1/(w/596 + 2)1. Find the third derivative of -jp6 - 34p*2 + 62p*6 + 61p*6 wrt p. -3120p*3 What is the second derivative of -6r*2 + 945r*3 + 553 - 552 - 25r + 6r2 wrt r? 5670r Find the third derivative of -577u2 + 580u*2 - 690 - 689u*3 - 347u*3 wrt u. -6216 Let p(w) = -8w - 46. Let s be p(-6). What is the third derivative of 2ms + 2m*6 + 13m*6 + 614m - 3m2 - 625m wrt m? 1800m3 Let l(d) be the second derivative of 1297d*7/42 - 71d*4 - 17d + 7. What is the third derivative of l(z) wrt z? 77820z2 Let u(i) be the third derivative of 203i6/60 + i5/10 + 1804i3/3 + 1806i*2. What is the first derivative of u(y) wrt y? 1218y*2 + 12y Let j(m) = 1224m2 - 14m - 4455. Let s(g) = 2040g2 - 24g - 7425. Let z(v) = 12j(v) - 7s(v). What is the first derivative of z(t) wrt t? 816t Let g(z) be the third derivative of -971z*8/336 - 127z*5/12 - 121z*2. What is the third derivative of g(s) wrt s? -58260s*2 Let i(s) be the first derivative of -116/3s*3 + 73/4s*4 + 0s*2 + 103 + 0s. Find the third derivative of i(t) wrt t. 438 Let n(v) = 26v - 9. Let q be n(8). Let o = q + -8. What is the second derivative of 3l + 5l - ol*3 + 172l*3 wrt l? -114l Let m(j) be the first derivative of 83j5/20 + 59j*2/2 - 73j + 83. Let i(q) be the first derivative of m(q). What is the first derivative of i(k) wrt k? 249k2 Let p(y) = -272y*3 + 14y*2 - 180y + 413. Let n(l) = 273l3 - 13l*2 + 181l - 352. Let d(q) = 7n(q) + 6p(q). Find the second derivative of d(t) wrt t. 1674t - 14 Let l(j) = -j2 + 13j + 38. Let x be l(10). What is the derivative of 27f - xf + 114 - 108f + 170 - 50f wrt f? -199 Let x(i) = i4 + i3 - i*2 - 4. Let w(q) = 238q*4 - 4q*3 + 6q*2 - 8q + 157. Let g(f) = w(f) + 4x(f). Find the second derivative of g(t) wrt t. 2904t*2 + 4 Suppose -1143s = -1172s. Let d(k) be the second derivative of 1/2k*3 - 20k + 0k2 + 1/4k4 + s. Find the second derivative of d(g) wrt g. 6 Let f(d) be the third derivative of d9/126 + 83d8/84 + 119d*5/30 - 5d*4/24 - 638d*2 + 2. What is the third derivative of f(r) wrt r? 480r*3 + 19920r*2 Let q(p) be the third derivative of 25p*9/252 - 137p*6/120 + 13p*5/15 + 19p*3/3 - 588p*2 - 5p. What is the third derivative of q(b) wrt b? 6000b3 - 822 Differentiate -9y2 + y2 + 0y2 + 507 + 8y*4 - 3y*2 + 131 wrt y. 32y*3 - 22y What is the third derivative of 11691q4 - 10132q*4 + 618q**2	{ "pile_set_name": "DM Mathematics" }
tor -8 - jq2 + 56q - 48q2 + 11q*2 - 54q*3. -2(q + 2)(3q - 1)(9q - 2) Let q(j) be the first derivative of -6/11j2 + 7/22j*4 - 1/33j*6 + 2/33j*3 + 0j - 1 - 2/55j5. Find k such that q(k) = 0. -3, -1, 0, 1, 2 Let r be 19 - (71/5 - 4464/(-2480)). Determine a so that 1246/3a*2 - 2/3a*5 - 384 + 352a - 94/3a4 - 1054/3a*r = 0. -24, -1, 1 Suppose 38 = x - 0x + 2w, -3x + 3w + 78 = 0. Let k = 33 - x. Factor -219o*5 + 4o*4 + 216o5 - o4 - 3o2 + ko*3. -3o*2(o - 1)*2(o + 1) Factor 8230l2 - 36l - 2654 + 327 - 212l - 8231l2 - 13049. -(l + 124)2 Suppose -1120o + 696o = -848. Factor 1/9vo + 4/9v + 4/9. (v + 2)*2/9 Suppose 17765 = -37k + 18k. Let n = k - -935. Factor 3x*2 + n - 3/7x. 3x(7x - 1)/7 Let h = -60 - -67. Suppose -4z + 4c + 5 = -h, 4c = 5z - 15. Factor 36d*2 + 8 + 15d*3 + 10d*3 + 1 + 30d - 7d3 + zd*4. 3(d + 1)*3(d + 3) Suppose 0p2 - 24/7p*4 + 0p - 26/7p3 + 2/7p*5 + 0 = 0. Calculate p. -1, 0, 13 Let o(p) be the first derivative of 3p*5/10 - 3p*4/4 - 3p*3/2 + 3p*2 + 6p + 1562. Factor o(c). 3(c - 2)2(c + 1)*2/2 Let p(o) be the second derivative of -o + 6 + 0o*2 + 0o*3 - 1/4o*5 + 35/12o*4. Solve p(i) = 0 for i. 0, 7 Factor -616137/5 + 3/5x*3 + 31329/5x - 531/5x2. 3(x - 59)*3/5 Let s be (-2378600)/22932 - (-1)/(-9) - -5. Let v = -680/7 - s. Find k, given that -4/13k + 0 - 10/13k3 - vk*2 = 0. -2, -1/5, 0 Let c = -93/1861 + 4559/16749. Factor -16/9g - cg3 + 0 + 4/3g*2. -2g(g - 4)(g - 2)/9 Find d such that 14/15d3 + 157504/5d + 1716/5d2 - 135424/15 = 0. -184, 2/7 Determine u so that -3288/11 + 6/11u*3 + 3312/11u - 846/11u2 = 0. 2, 137 Let k(d) = 3d + 59. Let q be k(-13). Solve 56r2 - 83r*2 + 4r*4 - 24r*3 - 20r + 75r2 + 12 - qr = 0. 1, 3 Let r(p) be the second derivative of p*6/10 - 81p*5/20 + 125p*4/4 + 975p*3/2 - 3375p*2 - 1357p. Factor r(j). 3(j - 15)2(j - 2)(j + 5) Find f such that 51 - 21/4f*2 + 1/4f*3 + 14f = 0. -2, 6, 17 Let p(n) be the first derivative of 2n3/45 + 32n*2/15 - 246n/5 + 412. Determine f so that p(f) = 0. -41, 9 Suppose -5c = -15, 0 = 17p - 16p - 3c + 6. Factor 4vp + 9v + 14v - 15v - 12v2. 4v(v - 2)(v - 1) Find u, given that 0 - 12u2 - 4/9u*3 - 368/9u = 0. -23, -4, 0 Factor 1/5b2 + 182/5b + 181/5. (b + 1)(b + 181)/5 Let u(n) be the third derivative of -n5/4 + 3115n*4/24 + 520n*3/3 - 98n*2 - n + 1. Factor u(l). -5(l - 208)(3l + 1) Let g(a) be the first derivative of 2a5/35 - 2a*4/7 - 8a*3/7 - 614. Determine x, given that g(x) = 0. -2, 0, 6 Let v = 389291/8 + -48661. Factor -9/2 + vx*2 + 3/2x. 3(x - 2)(x + 6)/8 Let x(m) be the first derivative of m*6/60 - 29m5/300 - m4/40 + 56m2 - 74. Let v(r) be the second derivative of x(r). Factor v(l). l(l - 3)(10l + 1)/5 Suppose t*3 + 7411t - 6720t + 29241 - 515t*2 + 28208t + 174t2 = 0. What is t? -1, 171 Let h(o) be the first derivative of o4 - 44o*3 - 2730o*2 - 39884o - 1559. What is w in h(w) = 0? -13, 59 Factor -2s2 + 28s*2 - 41s - 9s2 - 12s*2 - 69s + 360. 5(s - 18)(s - 4) Let c(h) = -3 + 12 - 7 - 3h - h3 + 4h*2. Let u be c(3). Factor k - 21 + 23 - 4k*2 + 4k*3 - uk5 + k4 + k*4 - 3k. -2(k - 1)3(k + 1)*2 Factor -5432/11f + 2/11f2 + 3688328/11. 2(f - 1358)*2/11 Let i = -394708 + 394712. Determine a so that -9/8a*2 - 9/8a*3 - 3/8a*i + 0 - 3/8a = 0. -1, 0 Let z(t) be the third derivative of t*5/105 - 41t*4/42 + 296t3/21 - t2 - 2t - 548. Factor z(f). 4(f - 37)(f - 4)/7 Let z = 579793/2 - 289865. Solve -183/8h*2 - 21/4h*3 - 27/2 - zh - 3/8h4 = 0 for h. -6, -1 Let b be 52/(-88)(-6)/31. Let i = b + 1. Factor 8/11 + 8/11o*4 + 2/11o*2 - 24/11o + io3. 2(o + 2)*2(2o - 1)2/11 Let o(w) be the first derivative of w4/6 - 40w*3/9 + 25w*2 - 1294. Factor o(v). 2v(v - 15)(v - 5)/3 Let r(p) = p*2 + 3p + 1318. Let g be r(0). Factor -gz4 + 1321z*4 + 0z*2 + 3z*3 - 6z*2. 3z*2(z - 1)(z + 2) Let s(q) be the third derivative of q7/210 + 13q*6/40 + 8q*5/15 - 19q*4/2 - 2171q2. Suppose s(t) = 0. Calculate t. -38, -3, 0, 2 Let x(c) be the second derivative of c7/294 - 23c6/210 - 19c*5/35 - 13c*4/21 - 126c. Let x(r) = 0. What is r? -2, -1, 0, 26 Let f = -1060/337 + 15986/1011. Find c such that -f + 40/3c - 2/3c*2 = 0. 1, 19 Let b be (-11)/(-44)-58 + 15. Let x(o) be the second derivative of -5/12o6 + 0o*3 - 5/24o*4 + 0o*2 - bo*5 - 13o + 0 - 5/42o7. Factor x(p). -5p*2(p + 1)*2(2p + 1)/2 Suppose -11o + 14o = 12. Factor -18 - 865l*2 + 710l*2 + 79l*3 + 91l + 10l - 7l*o. -(l - 9)(l - 1)*2(7l - 2) Suppose 0 = 3036n - 3032n - 16. Let u be -2(n + (-125)/30). Solve 0 + 2/3z - uz*2 = 0. 0, 2 Suppose 319v - 326v = -70. Factor -35 - 5 - 9z + z*2 + 74 - vz. (z - 17)(z - 2) Let g(k) be the second derivative of 2k*6/75 - 4k*5/5 - 47k*4/15 + 44k*3/5 + 203k. Factor g(c). 4c(c - 22)(c - 1)(c + 3)/5 Let p be (-38 + (-2662)/(-88))(-36)/21. Suppose 3b*4 + pb + 15/7b3 - 111/7b*2 - 18/7 = 0. What is b? -3, 2/7, 1 Let k(x) = -4x*3 - 8x + 34x2 - 14x*2 + 8 - 10x*2. Let i(g) = 7g*3 - 19g*2 + 17g - 15. Let f(w) = -3i(w) - 5k(w). Let f(b) = 0. What is b? 1, 5 Let v(d) be the second derivative of -d*4/12 + 9d*3/5 + 11d*2/10 + 279d - 1. Factor v(i). -(i - 11)(5i + 1)/5 Let b(z) be the third derivative of -z6/420 + z5/105 + 19z4/28 + 18z*3/7 + 2242z*2. Suppose b(x) = 0. Calculate x. -6, -1, 9 Suppose -4c + 15c - 649 = 0. Factor -18 - 30t + 119t2 + 32t*3 - ct*2 - 44t*2. 2(t - 1)(4t + 3)*2 Suppose -1478k = -916k + 23 - 1147. Let -3/4x*k + 9/2 - 15/4x = 0. Calculate x. -6, 1 Suppose -714 = -230c + 247c. Let r be (-104)/(-13) - (-329)/c. Factor -rd2 + 5/3 - 3/2d. -(d - 1)(d + 10)/6 Factor -3w*3 - 407w - 1110w - 164w - 345w2 + 349w. -3w(w + 4)(w + 111) Let w(k) = -4k - 20. Let h be w(-5). Suppose -165r + 161r = -12. Determine u, given that -3u2 + h - 3/2u*r + 0u = 0. -2, 0 Let b be (177/(-42) - -4)119/(-765). Let q(a) be the second derivative of 0 - 1/20a*5 + 1/6a*3 + ba*6 - 4a - 1/12a4 + 0a*2. Factor q(m). m(m - 1)*2(m + 1) Find k, given that -82/3k2 + 1/6k*5 - 19/3 - 43/3k*3 - 131/6k - 7/3k4 = 0. -2, -1, 19 Let v = -90632/15 - -6044. Let d(g) be the first derivative of 49/5g*2 - 14 + 0g + 1/10g4 - vg3. Suppose d(p) = 0. What is p? 0, 7 Let k(y) = y5 - 4y4 - y2 + 2y + 1. Let m(r) = 7r5 - 78r*4 + 156r*3 - 160r*2 + 63r + 6. Let h(w) = -30k(w) + 5m(w). Factor h(u). 5u(u - 51)(u - 1)3 Let r = 63 + -31. Solve -ri*4 + 72i*4 - 36i*4 + 4i - 12i2 - 12i = 0. -1, 0, 2 Suppose 2s - 19 = -15. What is q in 0q*4 + 3q*4 + 10q - sq4 - 15q*2 + 4q*4 = 0? -2, 0, 1 Let l(r) = -48r*2 + 220r + 16. Let p(x) = 46x2 - 220x - 16. Let z(m) = 5l(m) + 4p(m). Suppose z(q) = 0. Calculate q. -1/14, 4 Suppose 9h2 - 123h*2 - 7518 + 31h*2 + 36h*2 + 38h*2 + 11283h = 0. What is h? 2/3, 1253 Factor -4/5o2 - 32/5o + 528. -4(o - 22)(o + 30)/5 Let u be 735/(-280)(-2)/35. Let p(y) be the first derivative of 0y - 3 + uy2 + 1/30y*3. Factor p(o). o(o + 3)/10 Let j(v) be the third derivative of v*5/60 + 11v*4/12 + 12v*3 - 2v*2 + 35. Let i be j(-4). Let -8/9t + it2 + 0 + 2/9t3 = 0. Calculate t. -2, 0, 2 Let q(x) be the second derivative of x7/84 - 43x5/40 - 7x*4/4 + 493x + 6. Suppose q(f) = 0. What is f? -6, -1, 0, 7 Let k(w) be the first derivative of -43w + w3 - 1/2w4 - w2 + 1/10w5 + 43. Let n(y) be the first derivative of k(y). Factor n(l). 2(l - 1)*3 Suppose 219u - 239u = -80. Let l(j) be the first derivative of -1/10j*2 + 0j - 10 - 1/5j3 + 1/5j*u. Determine y, given that l(y) = 0. -1/4, 0, 1 Factor -57k*2 + 855k*3 - 191k2 + k4 + 845k - 6k*4 - 1447k*2. -5k(k - 169)(k - 1)*2 Factor 51n*2 + 836n*3 + 30n - 484n3 - 349n*3 - 288. 3(n - 2)(n + 3)(n + 16) Let p = 142581867/1462378 - 6/731189. Determine g, given that pg3 - 3/2g*4 + 3267 - 3663/2g	{ "pile_set_name": "DM Mathematics" }
ng k is positive. k*(-87/88) Simplify (((g/(ggg3g))*15(g(-3))(-2/57))(-37))(-21/4) assuming g is positive. g*(-1105671/76) Simplify ((pp(-1)/p)(2/3)((p/(pp/(p*(-5)/p))pp)/p)/p(3/4))/((ppp(3/7)pp)(-32))(-1/8) assuming p is positive. p(-2111/84) Simplify (v/v(-2/3))(-26/7)(v0/v)(-34)(v/v(-1/2)(v/(vv/v1))/v)/(vv/v*(-1/2)vv)(-23) assuming v is positive. v(2768/21) Simplify ((qqq/(((q(-1)/q)/q)/q)q)*(-24)q*(1/2)/(q/(qq*5)))/((qq(-1))(-10/7)(q/((q/(q/q(-2/3)))/q)qq)(4/7)) assuming q is positive. q(-1135/6) Simplify (u/u12u/(((uuu*7u)/u)/uu))(-41)/((u(-2/3))(-36)((uu/u(6/11)u)/u)/(u*(-9)/uu)) assuming u is positive. u(8190/11) Simplify ((i0)(-47))(-2/19)((ii/(i/(iii/(i/(i*(-5/2)i)))))/(i/(i/(((ii(-4/7)ii)/i)/i))))/((i/i(-2))/ii/i(-7)) assuming i is positive. i(-125/14) Simplify ((((d/(d/(d/((d*(1/9)d)/dd))d))/(d/((d/(d*(-12)dd))/d)))(23/4))29)(-28) assuming d is positive. d(-331499/9) Simplify (((q/q(-1/8))(-1/10))(-18))(1/5) assuming q is positive. q(81/200) Simplify (((r/r(-13))/r3)/(rr(6/7)/r)(-3/19))3 assuming r is positive. r(4443/133) Simplify ((h/((h*(-1/19)/h)/h)(((h/((h*(-3/14)/h)/h)h)/hh)/h)/h)/((((h(-2/3)h)/h)/h)/(hh/(h/((h/h(-9))/h)h)h)))(-38) assuming h is positive. h(-13513/21) Simplify ((pp((p/(p2p)p)/p)/p)30((pp/(p/(p/p(1/8)pp)))/pppp)/p15)(-25) assuming p is positive. p(7825/8) Simplify ((((p(2/7)p)/p)/p(-3))/((p(3/5)/p)/p(-5)))/((p1/p)4)0 assuming p is positive. p(-46/35) Simplify ((ww/w(22/9))(17/4)/((((w((ww*38w)/w)/www)/ww)/w)/(w/w(21/5))))(1/32) assuming w is positive. w(-2029/1440) Simplify ((zz*4z)/(((((z/(z/(z/(z/(z*(2/15)/zz))z)))/z)/z)/zzz)/z)(zz/(z/(zz*(-1/2)))z)*27)/((zz(2/7))(6/11))(7/10) assuming z is positive. z(24379/330) Simplify (((((ll/(l/(l/l(7/5))))/l)/l)/(ll*43))/((ll(-2/3))/((l/l(-8))/l)))23 assuming l is positive. l(-13018/15) Simplify (aa/(aa*(-37))a(5/8))/(a(-14)aaa(22/5)) assuming a is positive. a(1849/40) Simplify n(1/4)n(n(n/((nn/(n/(n/(n(-2/11)/n))n))/nn))/nn)/nn/n(-3/5)nn(n*(1/4)n)/n((n/n(-7))/n7)(-1) assuming n is positive. n(321/110) Simplify (((o/(oo(-10)))/o9)/(o(-30)/o(-1/54)))(3/4) assuming o is positive. o(1673/72) Simplify (m/m(-5))/(m/m(-1/4)mmm)m*(-1/6)mm/(m(-2/5)m)(mmm(2/7))(-42)/(m(2/5))(-8/11) assuming m is positive. m(-61199/660) Simplify (((j/(jj/(((j/(jj(-27)))/j)/j)))/((j(-11)/jj)/j))/(j*(-7/6)j/(j/(j/j10))))31 assuming j is positive. j(8587/6) Simplify (o(2/13)o(-1)o*(-3/2)/(oo*(-1/6)o))/(((o1/o)/((o(3/5)/o)/o))/(((o/(o*0/o))/o)/(ooo(1/5)oo))) assuming o is positive. o(-1712/195) Simplify ((d(3/2)d)/(d/(dd11))(d/(d/((d*(-5/4)ddd)/d)))/((dd/d17)/d))12 assuming d is positive. d363 Simplify ((iiii/i*(1/11)i(-1/27))/(i(1/14))22)(-1/4) assuming i is positive. i(-4783/8316) Simplify ((s(2/7)/ss(1/35))/(s(2/35))(8/5))45 assuming s is positive. s(-1224/35) Simplify (((i/(i(-31)/i))/i)/((ii/i(14/13))/i))/(i(-3)i(-25)ii) assuming i is positive. i(755/13) Simplify ((d/d1)(-2/5))(-9/7)/(((d/((d(-3/7)/d)/d)d)/(d/(dd(1/6)d)))/((((d/((d*4/d)/d))/d)/dd)/d(3/8))) assuming d is positive. d(-1339/168) Simplify w/w*2w*(3/5)www*1wwww(2/3)((w/w*(-6))/(w(w/(((w/w*(-2/11))/w)/w))/ww))(3/17) assuming w is positive. w(19648/2805) Simplify ((w/((((w*(-2/17)w)/w)/w)/w))/(w/(w/w(2/17))))(-25)(ww*1/www/(w/(ww(-5))))(-2/9) assuming w is positive. w(-671/9) Simplify (o(2/3)/(o*3o))/(o*0o)*(-2/53)(oo(2/5)oo(-2/7))/((oooo*(-3)o)/(oo(-1))) assuming o is positive. o(-12139/5565) Simplify ((i(-10)ii(7/2))/(((i(2/7)/ii)/i)/(i/i(-10))))45 assuming i is positive. i*(3915/14) Simplify (((vv*(-8)(v/((v/((v/(v/v4))/v))/v))/v)/(v(-2/7))(-7/2))(-1/15))2 assuming v is positive. v(2/3) Simplify (l(lll(-1/2))/ll)(-6)/(l4ll*(-2/13)l)(l/l(2/9)ll(-2/7))/(l5/(l/(lll(2/9)))) assuming l is positive. l(-20947/819) Simplify ((vv*(-1)v)(-1/5)/(v(-8))(-2/37))20 assuming v is positive. v*(-468/37) Simplify (((iiii(1/5))(-29)/(i/(i/(i/(((iii*(-3/8)/ii)/i)/i)ii))iii/i(-3)))24)(25/4) assuming i is positive. i(-61305/4) Simplify (((d/(dd*(1/13)/dddd))/d)/d)*(-14)/(dd11)(-47) assuming d is positive. d(8074/13) Simplify (h(5/6)/(h*(-3/5)/h)(h1)(-6/13))/(((h(-1)/h)/h)(-24)h(-2/7)hhhh(4/3)hhh) assuming h is positive. h(-70139/910) Simplify (((p6p5)/((p(-15)p)/p(3/11)))(-1/30))11 assuming p is positive. p(-139/15) Simplify (f/(f/(((f*(-1/4)f)/f)/f)))*(13/2)(f(2/3))23((f(-2/3))(-31))3 assuming f is positive. f(1661/24) Simplify (o(2/25)oooo(4/5)(o*9o)(-31))(-4/19) assuming o is positive. o(30612/475) Simplify ((i(-1))*(-20/7)/(i/(ii/i*(-1)i))(1/7))/((i(-1))(-13/8))(33/5) assuming i is positive. i(-2083/280) Simplify ((z/((z/(z/(z(-2/5)/z)))/z))*(3/26)((zz(3/4))/zzz)/(z5z))/((z*(-1/8)z/(z*(-8)z)z)/(z(-2/7)/z)(-3/10)) assuming z is positive. z(-41303/3640) Simplify (u2/uu)*(3/5)(uu(-1/4)/u)/(u(-6)/u)(u/u1)33((u/(u0u))/u)16 assuming u is positive. u(-161/20) Simplify m/(m/m*17)mm34m(m21m)(-2/11) assuming m is positive. m49 Simplify (g/g*(2/15)g/g*(-2/33)g)32/(((g/g(-2))/g)7)(-3/8) assuming g is positive. g(21763/220) Simplify ((o(2/17)/o2)/((o(-6)o)/(o/(o/o(-4)))))/(((o((o/o*(1/2))/o)/o)/o)/(oo*(4/3)o)o(-3/7)/o(-1/6)) assuming o is positive. o(1504/357) Simplify (((c(-3/5))4)(-25/6))(2/17) assuming c is positive. c(20/17) Simplify ((j/(jj(-4/3)))/(j(-1/2)/j))*(-12/7)(j(1/4))5/(((j*(4/7)j)/j)/jj/(j/(j/j2))) assuming j is positive. j(-61/28) Simplify (oo(-1))(1/27)o(1/6)(o(o/(o(2/19)/o))/o)/oo((oo(o/o1)/oo)/o)*(1/7)/(ooo(2/7)oo(-3/7)) assuming o is positive. o(-521/798) Simplify ((n(-3)/nnn(n/(n*(-3/2)/n))/nn(n/(nn(1/5)))/n(-4/5))(-3))(-21) assuming n is positive. n(1323/10) Simplify ((o(-14/3)/(o*(1/33)/oo))/(oo/(o/(oo/o*(-3)))o)(-2/11))(-2/5) assuming o is positive. o(226/165) Simplify ((m(-3/8)m)6(m/m*(1/27)mmm)30)(-5/2) assuming m is positive. m(-22075/72) Simplify (h/h1)*(5/18)h*(-6)/hh*4(h(2/3))(9/10)h(-1)(hh/h(3/4))/h assuming h is positive. h(-63/20) Simplify ((q(qq(-1)/qq)/qq/q(-1/4))/(q(-2/5)/q)32)/(qq*3q/q*(-6)q*(4/9)/(qq(-3/5)/q)) assuming q is positive. q(6121/180) Simplify (h/(h/(h*(-5)/h))h10)(10/9)/((hh(2/5))39)(-39) assuming h is positive. h(96023/45) Simplify (i1i)*38/((ii/i*(-5/4))/(i(i(i(4/7)/i)/ii)/i))(i(-7)i*7i)(-19) assuming i is positive. i(1521/28) Simplify (((m(2/7))(-39)m(-1/8)m/(m*1m))(-10/9))(2/9) assuming m is positive. m(1145/378) Simplify q(-3)/((q*4q)/q)qq*(-3/8)(q(q3q)/qq)/q(((qq/(q/(qq/(q(q/(q(-4)/q))/q)qq))q)/q)/(q*(-6)q))(3/4) assuming q is positive. q(5/8) Simplify (mm/(mm*(1/10)mmm)mm)/mm(-3/4)(m(m/(mm*(-8)))/m)/(mm*1m)((m(-1/3)/m)/m(-7))/((m/(mmm1))/m8) assuming m is positive. m(1129/60) Simplify ((s/((s/((ss(1/11))/s))/s))(2/101)/(s*40s(3/7)))35 assuming s is positive. s*(-1571225/1111) Simplify ((n(n/(nnn(-1)))/n)/n)/n(2/27)(nn(n/(nn*3))/nn)/n*(7/3)(n0)(-3/20)/(n*(-6)n5) assuming n is positive. n(-92/27) Simplify ((zz14z)/(zz14/z))15(z/(z/(z/(z/(zz/(z/(z/((zz/(z/z*(-2))zz)/zz))))z))))(4/15)(((z(2/7)/z)/z)/z)(-2/65) assuming z is positive. z*(13688/455) Simplify ((s/(ss(sss(-2/5)s)/ss))(14/5)/(s/s(-8))13)(-35) assuming s is positive. s(22239/5) Simplify n(-1)/(nn*(-1/4))n*5nnnnnnnn/((nn*(-1/3))/n)((n(1/3)/n)/n)40/(n*9n/(n**(-1	{ "pile_set_name": "DM Mathematics" }
29620g? 2039091084g*2 What is the first derivative of -2137a*3i + 7a3 - 29ai + 7501a + 7i + 36 wrt i? -2137a*3 - 29a + 7 Find the third derivative of -4958000v3 - 624005v*2 wrt v. -29748000 Find the third derivative of -9s*6 + 10817848s*5 - 62s*2 - 16s + 27779. -1080s3 + 649070880s*2 What is the second derivative of 20901256z*4 + 28885531z wrt z? 250815072z2 What is the first derivative of 220071043jm + 76926272j wrt m? 220071043j What is the third derivative of -3v*5 - 306027v4 + v2 - 9775905? -180v2 - 7344648v What is the second derivative of -277522836s3 + 345247108s? -1665137016s What is the second derivative of 40g*5 - 6g*4 + 114g*2 - 12102g - 23 wrt g? 800g3 - 72g*2 + 228 What is the derivative of 2bj2 + 56781bj + b - 353497j*2 - 1 wrt b? 2j*2 + 56781j + 1 What is the first derivative of -5o3y - 6oy + 53591o + 22y + 70802 wrt o? -15o2y - 6y + 53591 What is the derivative of -2g*3 + 1238898g*2 + 17422697? -6g*2 + 2477796g Differentiate 3660803i4 - 2i + 12785660 with respect to i. 14643212i3 - 2 What is the first derivative of 38g*3nr2 - 33g*3r*2 - 50849g*3r + 7064g2nr2 wrt n? 38g*3r*2 + 7064g*2r*2 What is the second derivative of -39610519c*3 - 2c*2 + 1921348c + 101 wrt c? -237663114c - 4 Find the third derivative of 138766343w*3 - 9550w*2 - 24441w wrt w. 832598058 What is the first derivative of 102d3h*2p + 423d3h*2 - 9d*3h + 5d2h*2 - 59d*2 - 12102dh2p wrt p? 102d3h*2 - 12102dh2 Find the first derivative of 4j*3x + 483j3 + 7928j + 713732x wrt x. 4j*3 + 713732 What is the third derivative of -9218838s*3 - 19s*2 - 7616 wrt s? -55313028 Find the first derivative of -4017u*3 + 10955u + 1867601. -12051u2 + 10955 What is the third derivative of -1366g*5 - 151112g*4 + 4g*2 + 4090g - 1100 wrt g? -81960g2 - 3626688g What is the second derivative of -3gw*3 + 305664gw2 + 64600gw - 2g - 2w3 - 8w wrt w? -18gw + 611328g - 12w What is the second derivative of iu2x - 3iux + 2ix + 518i - 3514475u2x + 2u + 2x wrt u? 2ix - 7028950x What is the derivative of -104564928b + 943425034 wrt b? -104564928 Find the third derivative of 410715u2w*3 + 1916u*2w*2 + 1605u*2w - uw4 wrt w. 2464290u*2 - 24uw What is the second derivative of 10669842r*2 - 12393937r wrt r? 21339684 Find the first derivative of -192419808c2 + 64182940. -384839616c What is the second derivative of -257585970h2s - 827hs + 15h - 1915s + 1 wrt h? -515171940s Differentiate 3236069no2 - 2661o*2 + 155 wrt n. 3236069o*2 What is the second derivative of 4405012d*2w3 - d2w2 + 3dw3 + 1901216 wrt d? 8810024w*3 - 2w*2 Find the second derivative of 5964645o*3 + 28529480o wrt o. 35787870o Find the first derivative of -1665308bd2 + 15bd - 1280235d*2 - 3 wrt b. -1665308d*2 + 15d What is the derivative of -4445139lp*3s - 264p3s - 1002p3 + 2p*2s - ps - 4p wrt l? -4445139p3s What is the derivative of -26375752u + 22647845? -26375752 Find the third derivative of 77655i*6 + 4i*4 - 13i*3 + 69i*2 - 7i - 78. 9318600i3 + 96i - 78 Differentiate 396645209h - 718847414. 396645209 What is the second derivative of -2825n*4 - 2149n*3 - 15434851n? -33900n2 - 12894n What is the first derivative of -2q2st + 1838qst + 2025qt - 76986st - t - 1 wrt q? -4qst + 1838st + 2025t What is the derivative of l*4 + 7l*3 - 4439l*2 + 64l - 810274999? 4l3 + 21l*2 - 8878l + 64 What is the third derivative of 340g3x*2 - 4944g*3x + 3g2x*2 - 2974gx2 + 419 wrt g? 2040x*2 - 29664x Find the third derivative of -i*4 + 6062631i*3 + 19i*2 + 3i - 131 wrt i. -24i + 36375786 Find the second derivative of -1000c*2dl + 2610c*2d + 2c2l + 164cdl + 5cd - 68c + 3d - 5l wrt c. -2000dl + 5220d + 4l What is the second derivative of -40940l2uz + 1122l*2z - 3230luz - 19218lu - 2lz + 2u wrt l? -81880uz + 2244z Differentiate -2d*2 + 7145031d - 6323554 wrt d. -4d + 7145031 Find the third derivative of -5669878b*3 + 11968147b*2 wrt b. -34019268 Find the second derivative of 85284168h*2 + 6h - 2636271 wrt h. 170568336 Differentiate -94286b2 + 65b - 41294869 with respect to b. -188572b + 65 Find the second derivative of 7869099f*2o*2 - 7f*2o - 212f2 - 13f wrt o. 15738198f2 Find the third derivative of 11020405a*4 - 1482938a*2 wrt a. 264489720a What is the first derivative of 205l4 - 5l*2 + 8033l + 27721406? 820l3 - 10l + 8033 Differentiate -2359g2t + 5g2 + g + 43t*3 - 401741 with respect to t. -2359g*2 + 129t*2 What is the third derivative of -669h*3mnv2 + h3mv*2 + 10h*3nv3 - 19h*3 + 2hnv*3 + 14136mnv*3 + 30nv wrt v? 60h*3n + 12hn + 84816mn Find the third derivative of -439f3x*3 + 23f*3x*2 + 2f*2x - 5f2 - 8506x3 - x2 - 20 wrt x. -2634f3 - 51036 What is the derivative of 20034348k*2 + 1467408? 40068696k What is the third derivative of x*4 + 6775394x3 + x2 + 90x - 895? 24x + 40652364 What is the second derivative of 9232797o4 - o2 - 2637704o wrt o? 110793564o2 - 2 What is the second derivative of -21874147c*2 + 5c + 668143 wrt c? -43748294 Find the second derivative of 23204t4 + 281t*3 + 61t + 1964 wrt t. 278448t2 + 1686t Find the second derivative of -104c5 + 7c*3 + 705c*2 - 18334620c. -2080c3 + 42c + 1410 Differentiate 35806131hq - 134222h + 4q - 130 with respect to q. 35806131h + 4 Differentiate -16490f*4 + 16846897. -65960f*3 What is the first derivative of 30w*3 + 3w*2 + 138671w - 377081930 wrt w? 90w2 + 6w + 138671 Find the first derivative of 9618672ju*2 + 2ju + 4385934j + u wrt u. 19237344ju + 2j + 1 What is the second derivative of 3j*2q + 1442061j2 + 46jq - 756j + 11q wrt j? 6q + 2884122 Find the first derivative of 185461543c2 + 98560832. 370923086c Differentiate -41451248b + 45005661. -41451248 What is the derivative of 4b*3 - 3343155b + 344901783? 12b2 - 3343155 What is the third derivative of 3f*3o4 + f3o2 + f3o + 6f3 - 9598fo4 - 48876fo + 10o*3 wrt o? 72f*3o - 230352fo + 60 What is the third derivative of 10974j5 + 20j*4 + 8j*3 - 15676j*2 - j + 32? 658440j*2 + 480j + 48 What is the third derivative of -363382885t3 + 123856874t*2? -2180297310 Differentiate 220169q*3 - 2q*2 - q - 8838625 with respect to q. 660507q*2 - 4q - 1 Find the third derivative of g*5r + 1512460g4r + 4489192g2r + 2gr wrt g. 60g2r + 36299040gr What is the derivative of -59695bi*3j*3 + 3bij*3 + 2i*3j*3 + 2i*3 + 5i*2j*3 + 3262i*2j + j*2 wrt b? -59695i*3j*3 + 3ij3 Find the third derivative of -280i*6 + 60594i*3l*2 - 18060i*2l*2 - 4i*2l + 7il + 2l2 + 1 wrt i. -33600i*3 + 363564l*2 Find the third derivative of -55w*5 - 8w*4 + 439w*3 + 9760244w*2. -3300w*2 - 192w + 2634 Find the first derivative of -18202620n + 1860795 wrt n. -18202620 Differentiate 4951876t + 3012556 wrt t. 4951876 Find the second derivative of 3f5r + 2006911f3r*3 + 4fr3 + 2fr2 + 25f - 3r3 - 4828r wrt f. 60f3r + 12041466fr*3 Find the first derivative of -5di2 - 394012d - 142437i2 + 3i - 4 wrt i. -10di - 284874i + 3 What is the third derivative of -41287095g*4 + 54615450g*2 wrt g? -990890280g What is the third derivative of 50a4q + 70458a3q*3 + 14a*3q + 2a2q*3 + 1331a + 18391q2 wrt a? 1200aq + 422748q*3 + 84q What is the second derivative of 903j3k*4 + 512j*3k + 5569jk*3 - 15jk - 74 wrt k? 10836j*3k*2 + 33414jk What is the third derivative of 24446649r*4 - 7r*2 - 2734r + 51? 586719576r What is the second derivative of -8079441j*2w + 6645jw - 74w + 1 wrt j? -16158882w What is the second derivative of -4y5 + 1204522y*3 + 9y - 1692016? -80y3 + 7227132y What is the third derivative of -62629f5 + 151f**3 + 1	{ "pile_set_name": "DM Mathematics" }
ov - 14/3o*2 + 8/3 + 0o = 0. What is o? -2, -1, 2/3 Find w such that -4w5 + 5891w*2 + 165w3 + w5 + 6w4 - 6059w2 = 0. -7, 0, 1, 8 Let p(a) = -a3 + a*2 - 1. Let w(o) be the first derivative of -5o*4 + 15o*3 + 10o*2 - 25o + 3. Let d(f) = -25p(f) + w(f). What is s in d(s) = 0? -2, 0 Let n(a) be the second derivative of -a4/36 - 2a*3/9 - 52a. Factor n(l). -l(l + 4)/3 Let n(m) = m3 + m2 + 1. Let p(c) = 7c*3 - 4c*2 + 17c - 2. Let i(q) = 6n(q) - p(q). Factor i(d). -(d - 8)(d - 1)*2 Let i(v) be the first derivative of 11/34v*4 + 4 - 6/17v - 38/51v3 + 13/17v*2 - 4/85v*5. Let i(x) = 0. Calculate x. 1/2, 1, 3 Let k(z) be the first derivative of 1/30z*6 - 7z*2 - 1/5z*5 - 1 + 0z*3 + 0z + 1/3z4. Let x(q) be the second derivative of k(q). Factor x(v). 4v(v - 2)(v - 1) Let o = -26 - -31. Let n(f) = 6f4 - 26f*3 + 4f*2 - 8. Let p(q) = 4q*4 - 17q*3 + 3q*2 - 5. Let m(x) = on(x) - 8p(x). Find v such that m(v) = 0. 0, 1, 2 Let j(i) be the second derivative of 5i*6/6 - 3i*5/2 - 37i*4/4 - 34i*3/3 - 6i*2 + 227i. Determine n, given that j(n) = 0. -1, -2/5, 3 Let v(p) = p*3 + 3p*2 + 8p - 9. Let g be v(-4). Let y = g + 59. Let 6/5h3 - 2/5h*4 - 6/5h*y + 0 + 2/5h = 0. Calculate h. 0, 1 Let u(s) = s*3 - 3s*2 - 63s - 111. Let i be u(-5). Factor 0 - 2/7ri - 8/7r + 0r2 + 6/7r*3. -2r(r - 2)2(r + 1)/7 Let l(d) be the first derivative of -d*7/70 - 3d*6/40 + 3d*5/10 + 7d*4/2 + 12d*3 + 5d*2 - 24. Let w(h) be the second derivative of l(h). Factor w(k). -3(k - 3)(k + 2)3 Let i(x) be the third derivative of -x5/135 + x4/18 + 8x*3/27 + 60x*2. Factor i(n). -4(n - 4)(n + 1)/9 Let c(y) be the first derivative of -2/25y*5 + 0y + 1/5y2 - 1/10y*4 + 2/15y*3 + 2. Factor c(o). -2o(o - 1)(o + 1)*2/5 Factor 26/21u*2 + 2/21u*4 - 4/3u*3 + 0 + 0u. 2u2(u - 13)(u - 1)/21 Let w(g) be the second derivative of g6/240 + 7g5/120 - g4/48 - 7g3/12 + 19g*2 + g - 6. Let b(v) be the first derivative of w(v). Factor b(f). (f - 1)(f + 1)(f + 7)/2 Suppose -88r + 114r = 52. What is i in 1/7i*3 - 2/7 - 3/7i + 0ir = 0? -1, 2 Let z(u) = -2u + 4u - 10 - 6u - 3u + 5u*2. Let b(t) = -t. Let f(q) = 2b(q) - z(q). Suppose f(y) = 0. What is y? -1, 2 Suppose 54q + 69q = 13q. Suppose -2/7u*3 + 0 + 2/7u + qu2 = 0. What is u? -1, 0, 1 Let p(n) be the second derivative of 10n - 2/3n4 + 0 - 1/10n*5 + 1/42n*7 + 1/15n*6 - 7/6n3 - n2. Factor p(j). (j - 2)(j + 1)4 Let t(f) be the second derivative of -1/135f*6 + 5/9f*2 - 14/27f*3 - 1/45f*5 + 2/9f*4 + 4f + 0. Solve t(d) = 0 for d. -5, 1 Let s be (2/(-30))/(2/4962). Let f = -165 - s. Factor 7/5b + 4/5b*2 - f. (b + 2)(4b - 1)/5 Let a(r) be the second derivative of 0 + 1/4r*2 - 14r + 1/6r3 + 1/24r4. Let a(m) = 0. Calculate m. -1 Let g(m) be the first derivative of m4/30 - 2m3/15 + m2/5 - m + 11. Let z(s) be the first derivative of g(s). Factor z(u). 2(u - 1)2/5 Let p(x) be the first derivative of -x4/22 - 10x3/33 + 8x*2/11 + 96x/11 + 59. Factor p(l). -2(l - 3)(l + 4)*2/11 Suppose 52b = 54b + a - 13, 0 = 2b + 4a - 34. Suppose 4/19 - 18/19l + 6/19l2 + 8/19l*b = 0. Calculate l. -2, 1/4, 1 Let x(j) = 20j*2 + 395j - 8845. Let n(u) = u*2 - u - 1. Let a(g) = -25n(g) + x(g). Factor a(v). -5(v - 42)2 Let d(z) be the third derivative of z8/1344 + z7/84 + z6/15 + 19z*5/120 + 5z*4/32 + 53z*2 + 2z. Solve d(g) = 0. -5, -3, -1, 0 Let m(d) = d*2 + 2d + 1. Let v(a) = 48a3 + 24a*2 - 40a - 16. Let i(s) = -28m(s) - 2v(s). Factor i(r). -4(r + 1)(3r - 1)(8r + 1) Let h(f) be the first derivative of -4 - f4 - 2f*2 - 8/3f*3 + 0f. Factor h(b). -4b(b + 1)*2 Determine n, given that -144/13 - 18/13n*3 - 600/13n + 212/13n2 = 0. -2/9, 6 Let i(b) = 6b*2 - 9b + 36. Let l(p) = -7p2 + 5p - 36. Let v(o) = 4i(o) + 3l(o). Factor v(n). 3(n - 4)(n - 3) Let w = 901 + -899. Let 0 - 4/11q4 + 0q + 0qw + 2/11q*5 + 2/11q*3 = 0. Calculate q. 0, 1 Factor 18d*3 + 24d*2 + 18/5 + 3/5d*5 + 15d + 6d4. 3(d + 1)*4(d + 6)/5 Let i(l) be the first derivative of -l8/1176 - l7/147 - 2l6/105 - 2l*5/105 - 4l*2 + 8. Let r(x) be the second derivative of i(x). Factor r(o). -2o*2(o + 1)(o + 2)2/7 Suppose -88c + 3c2 - 11c*2 - 14 - 8c*3 - 44c*2 - 18 = 0. What is c? -4, -2, -1/2 Let k(p) = -p + 27. Let c be k(25). Factor 3/2m*c - 3/2m + 0. 3m(m - 1)/2 Let a(f) be the first derivative of 4f5/15 - 5f*4/6 - 8f3/9 + f2 - 31. Determine q so that a(q) = 0. -1, 0, 1/2, 3 Let v(x) = -7x2 - 189x + 4. Let h be v(-27). Factor -1/2b5 + 0b + 0b2 - 3/2bh + 0 - b3. -b*3(b + 1)(b + 2)/2 Suppose 2v = 6k - 2k - 2, 0 = 5k + v - 13. Factor 4/5o*k + 4/5 + 8/5o. 4(o + 1)2/5 Let v(r) be the first derivative of -r9/3024 - r8/560 - r7/420 - 8r*3 + 12. Let g(o) be the third derivative of v(o). What is h in g(h) = 0? -2, -1, 0 Suppose -3p - 2s + 21 = 2s, -s = -5p + 12. Let q = p - 8/3. Factor -3d*5 + 2/3d*3 + 0 + 4/3d*2 - 4d*4 - qd. -d(d + 1)2(3d - 1)2/3 Let p = -10675 + 10675. Factor p + 0u*2 - 2/3u + 2/3u3. 2u(u - 1)(u + 1)/3 Suppose -j = 5h + 19, 0 - 17 = 3j - 5h. Let f be (-2)/(-15)15(-2)/j. Let -4/9 - 2/3l + fl2 + 2/3l3 = 0. What is l? -1, -2/3, 1 Let b(c) be the second derivative of c4/3 - 76c3/3 + 144c*2 + 279c. Factor b(a). 4(a - 36)(a - 2) Let a be (-47201)/726 + ((-12)/(-22))/3. Let d = a - -65. Determine f, given that -1/6 + 1/3f - df*2 = 0. 1 Let g(q) = -7q*3 + 5q*2 - 13q + 3. Let d(l) = -48l3 + 36l*2 - 90l + 21. Let c(m) = 4d(m) - 27g(m). Factor c(k). -3(k - 1)3 Let t(k) be the second derivative of k4/20 - 19k*3/30 - 7k*2/5 + 68k + 1. Solve t(c) = 0. -2/3, 7 Let o(g) be the first derivative of g6/75 - g5/10 - 13g4/30 - 7g*3/15 - 25g + 14. Let r(a) be the first derivative of o(a). Factor r(h). 2h(h - 7)(h + 1)2/5 Let h be (-18)/24 + (-38)/(-8). Let 2i*2 - hi - 2i2 - 4i*2 = 0. Calculate i. -1, 0 Let k be (-81)/(-45) + (-2)/(-10). Suppose -40 = -14h + 9h. Factor 6r*2 - 86r*2 - h - 36r*3 - 80r*k - 28r*3 - 68r. -4(r + 2)(4r + 1)2 Let f(j) be the first derivative of 0j*3 - 1/3j*2 - 1/15j*5 + 1/6j*4 - 2 + 1/3j. Factor f(a). -(a - 1)*3(a + 1)/3 Let f be ((-83)/8)/(0 - (-8)/80). Let b = f + 104. Let -1/4x2 - b - 1/2x = 0. What is x? -1 Let s(x) = 3x3 - 20x*2 + 32x - 9. Let y(l) = l*2 + l. Suppose -31o = -34o + 6. Let a(t) = os(t) + 2y(t). Let a(n) = 0. What is n? 1/3, 3 Let q be (-36)/(-10) + (2/(-60))/((-87)/1044). What is i in 10/3i*4 - 2i*3 - q - 18i*2 - 50/3i = 0? -1, -2/5, 3 Let c(q) be the first derivative of -3q4/4 + 9q*3 - 39q*2 + 72q + 313. Factor c(k). -3(k - 4)(k - 3)(k - 2) Find o such that -5/6o*2 + 0 + 0o = 0. 0 Let x(c) = -c*2 + 57c - 752. Let j be x(36). Find n such that -6/13nj - 4/13n*2 + 14/13n*3 + 0 + 0n = 0. 0, 1/3, 2 Suppose -1331p + 1523p = 0. Factor 2/3y3 + 0y*2 + 0 + py + 2/3y4. 2y*3(y + 1)/3 Let j be (-169)/(-65) + (-2)/(-5). Factor 2/3q2 - 1/6q*j + 0 - 2/3q. -q(q - 2)2/6 Suppose 784a = 780a. Find v, given that 8/19v*2 + 2/19v + a = 0. -1/4, 0 Let a(j) be the second derivative of -j6/210 + j4/42 - 8j2 - 5j. Let k(m) be the first derivative of a(m). Solve k(o) = 0. -1, 0, 1 Let c(o) be the first derivative of -7/6o3 - 7 + 1/2o*2 + 0o. Factor c(y). -y(7y - 2)/2 Let b(n) = 58n3 - 112n*2 + 211n - 101. Let k(q) = 25q3 - 56q*2 + 106q - 51. Let p(s) = -3b(s) + 7k(s). Factor p(w). (w - 54)(w - 1)2 Let h(u) be the third derivative of -u8/336 + 2u*7/35 - 3u*6/8 + 5u*5/6 - 23u2. Factor h(d). -d2(d - 5)2(d - 2) Let k(d) = -d*2 - 38d + 3241. Let x be k(41). Determine o so that xo2 + 0 + 8/7o*3 - 4/7o = 0. -2, 0, 1/4 Suppose 32/19a - 2/19a*2 + 34/19 = 0. Calculate a. -1, 17 Let s(x) be the first derivative of -14 - 5/9x*2 + 4/9x - 2/9x3. Factor s(d). -2(d + 2)(3d - 1)/9 Let d = -2453/24 + 409/4. Let f(a) be the third derivative of 0a + 1/120a	{ "pile_set_name": "DM Mathematics" }
)*3(m + 2)/11 Let n(y) be the first derivative of y5/5 - y4 - y*3/3 + 2y*2 - 33. Factor n(l). l(l - 4)(l - 1)(l + 1) Let v(o) = -o*2 - 12 + 12. Let w(d) = 2d*2 - 4d. Let m(i) = -4v(i) - w(i). Factor m(k). 2k(k + 2) Suppose a = 3c + 12, 3a + 0 = -c - 4. Let l(x) = x3 - x2. Let y be l(a). Solve 2 + 22j*4 + 2j - 28j3 - 24j*2 + 24j*5 + yj + 2j = 0 for j. -1, -1/4, 1/3, 1 Let h be 20 - 15 - (-48)/(-10). Let -ho*4 + 0 - 3/5o*2 - 3/5o*3 - 1/5o = 0. What is o? -1, 0 Suppose 3c = -3x + 12, 0 = -c - c + x + 2. Let p(t) be the first derivative of 3 - 1/2tc + 1/2t*3 + 0t. Solve p(v) = 0 for v. 0, 2/3 Determine p so that 502p2 - 259p*2 - 251p*2 - 4p*3 = 0. -2, 0 Let f(x) = 4x*2 - x - 1. Let q be f(-1). Suppose -2b + 1 + 17 = 2j, 2j = -b + 17. Factor -s*q - 5 - 12s2 - 1 - s4 + 4 - 8s3 - js. -2(s + 1)4 Find x, given that 5/2 - 45/4x + 5x2 = 0. 1/4, 2 Suppose 4p - 10 = n, -3p + 8 = 2p + n. Factor -l*p - 70 + 2l - l*3 + 70. -l(l - 1)(l + 2) Let i(z) be the second derivative of -z4/12 + z3/6 - 13z. Suppose i(a) = 0. What is a? 0, 1 Suppose -3j = -0j. Let b(i) be the first derivative of 1/6i4 + 2 + 1/15i*5 - 1/3i - 1/3i2 + ji*3. Factor b(u). (u - 1)(u + 1)*3/3 Let y(v) be the first derivative of v - 1/18v*4 + 0v*5 + 0v*3 - 3 + 1/45v*6 + 0v*2. Let h(x) be the first derivative of y(x). Factor h(b). 2b*2(b - 1)(b + 1)/3 Let r(n) be the first derivative of n5/30 - n4/24 + 3n*2/2 - 5. Let d(o) be the second derivative of r(o). Let d(k) = 0. Calculate k. 0, 1/2 Determine w, given that -3w*2 + 65w*3 + 20w + 5w5 + 615w*4 - 57w*2 - 645w*4 = 0. 0, 1, 2 Let u(w) = -5w + 4w + 5w - w*2 + 0w - 2. Let n be u(2). Factor 0 - 1/4p - 1/4p*n. -p(p + 1)/4 Let d = 1 - -2. Factor dw - 5w + 0w - w2 - 1. -(w + 1)2 Let z(g) = -2g + 14. Let j be z(7). Let n(p) be the second derivative of -1/10p5 - p + 1/3p*4 + 0 - 1/3p*3 + jp*2. Factor n(h). -2h(h - 1)2 Let 0m + 3/4m2 - 3 = 0. Calculate m. -2, 2 Let o be 0/23(-2)/(-2). Suppose j - 2k - 10 = o, 19 = j - 0j - 5k. Suppose 0 + 3/7p*5 - 6/7p + 3/7pj - 9/7p*3 - 15/7p2 = 0. Calculate p. -1, 0, 2 Let t(g) be the first derivative of g5/30 + g*4/6 + 5g3/18 + g2/6 + 5. Factor t(x). x(x + 1)2(x + 2)/6 Let k(t) be the first derivative of -t*6/10 - 3t5/40 + t4/8 + 2t + 4. Let g(r) be the first derivative of k(r). Suppose g(h) = 0. Calculate h. -1, 0, 1/2 Let b(f) be the second derivative of f9/10584 - f7/2940 + f3/6 - 2f. Let s(h) be the second derivative of b(h). Factor s(g). 2g3(g - 1)(g + 1)/7 Let o = 16 - 31/2. Let x(s) be the first derivative of 0s*2 - os*4 - 2 + 8s - 2s3. Find m, given that x(m) = 0. -2, 1 Let b(y) be the first derivative of y2 - 4y + 1/6y4 - 2/3y*3 + 3. Let v(u) be the first derivative of b(u). Suppose v(d) = 0. Calculate d. 1 Let a be 0 - (-4 - (-1 - 0)). Let w(u) be the first derivative of 1 - 2/3ua + u2 + 0u + 2/5u*5 - 1/2u*4. What is s in w(s) = 0? -1, 0, 1 Let g = 49319/7 + -7027. Let v = -128/7 + g. Suppose 0y*4 + 0y*2 + 2/7y*3 + 0y + 0 - vy5 = 0. What is y? -1, 0, 1 Suppose -2k - 4q + 2 = 0, 2k - 3q - 24 = -15. Find p, given that -16/7p*2 + 4/7 - 6/7p - 6/7pk = 0. -2, -1, 1/3 Let h(j) be the first derivative of 1/6j*3 + 0j + 1/2j2 - 5. Factor h(a). a(a + 2)/2 Let x(z) be the second derivative of z*5/25 - 3z*4/5 + 16z*3/5 - 32z*2/5 - 14z. Factor x(q). 4(q - 4)2(q - 1)/5 Let c(r) = 2r2 - r - 3. Let p be c(7). Factor -33x*5 + 119x*4 + 16x + 4 - 23x2 - px*3 - 16x*5 + 21x3. -(x - 1)3(7x + 2)*2 Let o = -4 + 7. Factor or*4 - 3 - 3r + 4r3 + 0r3 - r3 - 9r2 + 9. 3(r - 1)*2(r + 1)(r + 2) Determine l, given that -8l*3 - 2l*3 + 2l*4 - 4l*4 + 6l*3 = 0. -2, 0 Suppose 0 = 3y - 8y + 20. Factor 2t*4 + 7t*3 - 5t*3 + yt*2 + 2t*2 + 2t + 4t3. 2t(t + 1)3 Let q(h) be the first derivative of -1/5h*5 + 0h*3 - 6 + 1/18h*6 + 1/6h*4 + 0h + 0h2. Solve q(z) = 0 for z. 0, 1, 2 Let u = 3 + 3. Let h = u + -4. Factor i4 + i3 + 2i*3 - hi + 3i2 + 3i. i(i + 1)3 Let n(f) = -7f*3 + 11f*2 - 13f - 23. Let s(q) = 8q3 - 10q*2 + 14q + 22. Let u(b) = 5n(b) + 4s(b). Factor u(x). -3(x - 3)2(x + 1) Suppose -r - 339 + 342 = 0. Let k be (-3 - -2)(-3)/5. Determine o, given that 3o*r + ko*4 + 24/5o*2 + 0 + 12/5o = 0. -2, -1, 0 Let b be -1 - (1 + -3 + -4). Factor -2h2 + h4 + 2h4 - h3 + h2 + hb - 2h4. h2(h - 1)(h + 1)2 Let j = 334/5 + -67. Let b = 9/20 + j. Factor -bk2 - 1 - k. -(k + 2)2/4 Let j(y) be the third derivative of -y6/320 + y5/40 - 5y4/64 + y3/8 + 21y*2. Suppose j(c) = 0. Calculate c. 1, 2 Let j be 1(-1 + 0)-6. Let o = j + -4. Solve 5i + i*2 - 5i + oi3 - 8i*4 = 0 for i. -1/4, 0, 1/2 Suppose -3j + 6f + 10 = 2f, -5f = 2j + 1. What is w in 1/7 + 1/7wj - 2/7w = 0? 1 Let t = -12 + 12. Let f(d) be the third derivative of -1/210d5 + 0d - 2/21d3 + 3d*2 - 1/28d4 + t. Determine c so that f(c) = 0. -2, -1 Let j(i) be the third derivative of -i7/315 + i6/180 + i5/90 - i*4/36 - 6i*2. Find f, given that j(f) = 0. -1, 0, 1 Let n(q) be the second derivative of 1/30q*4 + q - 1/50q*5 + 0 - 1/5q*2 + 1/15q*3. Factor n(p). -2(p - 1)*2(p + 1)/5 Find g, given that 7/4g - 5/4g*2 - 3/4 + 1/4g*3 = 0. 1, 3 Let 3k*4 + 56k + 16k + 27 + 24k*3 + 68k*2 - 2k*2 = 0. Calculate k. -3, -1 Solve 0 - 3/2b*4 + 0b - 6b2 - 6b3 = 0 for b. -2, 0 Let x(h) = -13 - 7 + h2 - 2h3 + h4 - 5h + 15. Let o(r) = -r*4 + 2r3 - r2 + 4r + 4. Let g(j) = -5o(j) - 4x(j). Determine b so that g(b) = 0. 0, 1 Let i(n) be the second derivative of 0 + 0n*3 - 2n - 5/84n7 + 0n*4 + 1/30n*6 + 0n*2 + 0n*5. Solve i(o) = 0 for o. 0, 2/5 Factor -w + 3w*2 - 2w + 6w3 - 10w*3 - 3 + 7w*3. 3(w - 1)(w + 1)2 Factor 0 + 0l + l*4 + 0l*3 - 1/3l*5 + 0l2. -l4(l - 3)/3 Suppose -3x + 2x + 4 = 0. Let l(d) = -2d*3 - 4d2 - 4. Let t(m) = m2 + 1. Let r(n) = xt(n) + l(n). Determine y so that r(y) = 0. 0 Let g(w) = -2w*4 - 4w*3 - 2w2 + 5. Let y = 12 + -4. Let n = 5 - y. Let b(j) = -j4 - 2j3 - j2 + 3. Let t(q) = ng(q) + 5b(q). Factor t(c). c2(c + 1)*2 Let h be (3/1)/((-198)/(-4)). Let p = h + 20/33. Let -5/3q + 5/3q3 - p + 3q*2 - 7/3q4 = 0. Calculate q. -1, -2/7, 1 Let y(k) = k2 - 11k - 8. Let c be y(12). Find d, given that -2d - d*2 - 4d + 4d + cd = 0. 0, 2 Let s(d) be the third derivative of 0d7 + 1/8d*4 + 0d*3 + 0 - 1/20d*6 + 0d + 0d5 + 1/112d8 + d2. Let s(f) = 0. Calculate f. -1, 0, 1 Let 1/4h2 + 7/4 + 2h = 0. Calculate h. -7, -1 Factor -1 + 8y - 63/4y*2. -(7y - 2)(9y - 2)/4 Suppose -u = p - 2p - 2, -4p - 32 = 4u. Let o = u - -5. Factor 5 + 2i*o - 2 - 5 + 0i*2. 2(i - 1)(i + 1) Let d(q) be the first derivative of -14q*6/3 + 64q*5/5 - 4q*4 - 56q*3/3 + 22q*2 - 8q - 4. Find i such that d(i) = 0. -1, 2/7, 1 Let g(z) be the third derivative of z5/180 - z4/9 + 8z3/9 - 7z*2. Solve g(w) = 0 for w. 4 Suppose -r + 7 = -i, 2i - r - 3r + 16 = 0. Let f = i + 8. Factor fu*2 - 3u + 0u + 5u. 2u(u + 1) Let j(g) be the first derivative of 7g6/30 - 2g*5/25 - 7g*4/20 + 2g*3/15 - 3. Find p, given that j(p) = 0. -1, 0, 2/7, 1 Let m(p) = -2p*3 + 34p*2 - 48p + 8. Let h(d) = -d*3 + 11d*2 - 16d + 3. Let x(c) = 8h(c) - 3m(c). Let x(q) = 0. Calculate q. -8, 0, 1 Let z(d) be the third derivative of -d*5/24 - 25d*4/48 - 5d*3/2 + 18d*2. Solve z(y) = 0. -3, -2 Let l = -391/378 - -15/14. Let s(m) be the second derivative of 1/90m*5 + 1/135m*6 + 0 - lm*3 + 0m*2 - 1/54m*4 + 2m. Factor s(r). 2r(r - 1)(r + 1)2/9 Let 9/5 + 3q - 8/5q2 - 16/5q*3 = 0. Calculate q. -3/4, 1 Let w(d) = 2d*2 - 12d + 18. Let t be w(2). Factor 0 + 1/7yt + 2/7y. y(y + 2)/7 Let l(n) be the second derivative of -n5/25 + n4/15 + 10n. Factor l(c). -4c2(c - 1)/5 Let s be (-4)/(-16) + 2/(-8). Suppose 7p - 12p = s. Factor p + 0q + 1/4q2. q2/4 Determine c, given that 53	{ "pile_set_name": "DM Mathematics" }
PM? 11:41 PM What is 680 minutes before 6:35 PM? 7:15 AM What is 323 minutes after 5:22 AM? 10:45 AM How many minutes are there between 5:58 AM and 7:26 AM? 88 What is 578 minutes before 3:35 AM? 5:57 PM How many minutes are there between 5:33 AM and 3:38 PM? 605 How many minutes are there between 11:12 PM and 11:21 PM? 9 What is 538 minutes before 11:33 PM? 2:35 PM What is 121 minutes before 7:40 PM? 5:39 PM What is 467 minutes before 3:52 PM? 8:05 AM What is 27 minutes after 9:56 PM? 10:23 PM What is 144 minutes before 6:14 AM? 3:50 AM What is 665 minutes before 3:04 PM? 3:59 AM How many minutes are there between 10:12 AM and 9:40 PM? 688 What is 714 minutes after 1:20 PM? 1:14 AM What is 466 minutes before 6:40 AM? 10:54 PM What is 636 minutes before 2:25 PM? 3:49 AM What is 97 minutes after 2:08 AM? 3:45 AM How many minutes are there between 7:11 PM and 10:54 PM? 223 How many minutes are there between 3:51 AM and 6:06 AM? 135 How many minutes are there between 9:44 PM and 11:50 PM? 126 What is 611 minutes after 5:44 AM? 3:55 PM How many minutes are there between 8:09 PM and 6:55 AM? 646 How many minutes are there between 11:18 PM and 10:43 AM? 685 What is 44 minutes after 1:08 PM? 1:52 PM What is 327 minutes before 10:18 PM? 4:51 PM What is 553 minutes after 8:22 AM? 5:35 PM What is 283 minutes before 3:34 PM? 10:51 AM What is 699 minutes after 10:15 AM? 9:54 PM How many minutes are there between 1:33 AM and 7:15 AM? 342 What is 525 minutes before 9:19 PM? 12:34 PM What is 286 minutes after 5:52 PM? 10:38 PM How many minutes are there between 1:24 PM and 10:33 PM? 549 How many minutes are there between 3:07 AM and 5:36 AM? 149 What is 274 minutes after 6:10 AM? 10:44 AM What is 420 minutes before 7:29 PM? 12:29 PM What is 576 minutes before 8:43 PM? 11:07 AM How many minutes are there between 3:24 PM and 1:33 AM? 609 How many minutes are there between 5:51 PM and 12:51 AM? 420 What is 211 minutes after 12:26 AM? 3:57 AM What is 82 minutes after 4:15 PM? 5:37 PM What is 502 minutes after 9:35 AM? 5:57 PM How many minutes are there between 8:44 PM and 1:44 AM? 300 What is 430 minutes before 3:46 PM? 8:36 AM How many minutes are there between 7:23 AM and 2:49 PM? 446 How many minutes are there between 3:46 AM and 7:55 AM? 249 How many minutes are there between 10:33 AM and 3:46 PM? 313 How many minutes are there between 2:24 AM and 6:50 AM? 266 What is 255 minutes before 7:24 AM? 3:09 AM What is 591 minutes after 3:51 PM? 1:42 AM How many minutes are there between 11:30 PM and 12:59 AM? 89 How many minutes are there between 12:39 PM and 9:45 PM? 546 What is 501 minutes after 10:45 PM? 7:06 AM How many minutes are there between 2:08 AM and 3:17 AM? 69 How many minutes are there between 3:30 AM and 12:37 PM? 547 How many minutes are there between 5:51 AM and 4:38 PM? 647 What is 77 minutes before 5:02 PM? 3:45 PM How many minutes are there between 10:38 PM and 7:12 AM? 514 What is 33 minutes before 6:43 AM? 6:10 AM What is 428 minutes before 10:10 AM? 3:02 AM How many minutes are there between 9:58 AM and 12:53 PM? 175 How many minutes are there between 5:48 PM and 4:22 AM? 634 What is 159 minutes before 7:25 AM? 4:46 AM How many minutes are there between 8:34 PM and 5:18 AM? 524 How many minutes are there between 9:13 AM and 4:12 PM? 419 How many minutes are there between 12:16 PM and 8:53 PM? 517 How many minutes are there between 12:47 AM and 5:21 AM? 274 How many minutes are there between 10:48 PM and 2:11 AM? 203 What is 385 minutes before 9:54 PM? 3:29 PM How many minutes are there between 10:54 AM and 10:49 PM? 715 What is 203 minutes before 4:26 PM? 1:03 PM What is 36 minutes before 5:40 AM? 5:04 AM What is 677 minutes before 4:56 PM? 5:39 AM How many minutes are there between 11:56 PM and 11:39 AM? 703 How many minutes are there between 11:24 AM and 11:28 AM? 4 What is 707 minutes before 1:53 PM? 2:06 AM What is 463 minutes after 1:40 AM? 9:23 AM How many minutes are there between 11:01 AM and 2:12 PM? 191 How many minutes are there between 6:51 PM and 2:45 AM? 474 What is 322 minutes after 7:10 AM? 12:32 PM How many minutes are there between 1:13 AM and 11:36 AM? 623 How many minutes are there between 5:34 PM and 3:26 AM? 592 What is 680 minutes after 11:46 AM? 11:06 PM How many minutes are there between 1:33 AM and 12:16 PM? 643 What is 56 minutes after 9:58 AM? 10:54 AM How many minutes are there between 6:48 PM and 12:12 AM? 324 How many minutes are there between 1:54 PM and 12:33 AM? 639 How many minutes are there between 10:46 PM and 11:53 PM? 67 What is 676 minutes before 3:10 AM? 3:54 PM How many minutes are there between 2:16 PM and 3:05 PM? 49 How many minutes are there between 3:39 PM and 9:32 PM? 353 What is 582 minutes after 9:46 PM? 7:28 AM What is 665 minutes before 8:35 AM? 9:30 PM How many minutes are there between 10:52 AM and 6:40 PM? 468 What is 618 minutes before 12:26 AM? 2:08 PM What is 439 minutes after 8:35 AM? 3:54 PM How many minutes are there between 8:50 PM and 7:52 AM? 662 How many minutes are there between 1:25 AM and 8:15 AM? 410 What is 547 minutes before 10:55 PM? 1:48 PM How many minutes are there between 7:19 AM and 7:30 AM? 11 What is 453 minutes before 3:37 PM? 8:04 AM How many minutes are there between 7:57 PM and 7:51 AM? 714 What is 289 minutes after 6:47 AM? 11:36 AM How many minutes are there between 7:27 AM and 9:08 AM? 101 How many minutes are there between 1:23 PM and 5:47 PM? 264 How many minutes are there between 8:45 PM and 2:52 AM? 367 What is 663 minutes after 3:23 AM? 2:26 PM How many minutes are there between 8:18 AM and 9:00 AM? 42 What is 612 minutes before 5:59 PM? 7:47 AM How many minutes are there between 4:51 AM and 7:29 AM? 158 What is 445 minutes after 12:17 AM? 7:42 AM How many minutes are there between 4:29 PM and 9:46 PM? 317 How many minutes are there between 3:27 PM and 5:35 PM? 128 What is 421 minutes before 7:44 PM? 12:43 PM How many minutes are there between 4:07 AM and 9:32 AM? 325 How many minutes are there between 2:51 AM and 8:19 AM? 328 What is 505 minutes after 11:12 AM? 7:37 PM What is 54 minutes after 12:43 PM? 1:37 PM How many minutes are there between 3:36 AM and 8:13 AM? 277 What is 342 minutes after 10:04 AM? 3:46 PM What is 197 minutes before 6:11 PM? 2:54 PM What is 560 minutes after 12:41 AM? 10:01 AM How many minutes are there between 3:13 PM and 1:24 AM? 611 What is 291 minutes after 11:36 AM? 4:27 PM How many minutes are there between 3:43 AM and 2:00 PM? 617 What is 97 minutes before 8:23 PM? 6:46 PM How many minutes are there between 1:33 AM and 7:33 AM? 360 How many minutes are there between 9:45 AM and 6:51 PM? 546 What is 264 minutes before 12:57 PM? 8:33 AM How many minutes are there between 7:41 PM and 2:42 AM? 421 How many minutes are there between 4:51 PM and 1:28 AM? 517 How many minutes are there between 10:23 AM and 9:23 PM? 660 What is 355 minutes before 8:44 PM? 2:49 PM What is 303 minutes before 6:46 AM? 1:43 AM What is 612 minutes before 1:53 AM? 3:41 PM How many minutes are there between 12:38 PM and 2:41 PM? 123 What is 624 minutes before 2:04 AM? 3:40 PM How many minutes are there between 5:06 PM and 3:34 AM? 628 How many minutes are there between 8:22 AM and 1:20 PM? 298 How many minutes are there between 10:57 PM and 12:52 AM? 115 How many minutes are there between 4:57 AM and 1:10 PM? 493 What is 472 minutes after 2:43 AM? 10:35 AM What is 481 minutes after 1:45 PM? 9:46 PM What is 102 minutes after 7:35 AM? 9:17 AM What is 270 minutes before 4:23 PM? 11:53 AM What is 595 minutes before 2:29 AM? 4:34 PM How many minutes are there between 7:05 AM and 4:49 PM? 584 What is 139 minutes before 10:11 AM? 7:52 AM How many minutes are there between 2:00 AM and 1:31 PM? 691 What is 144 minutes before 11:01 AM? 8:37 AM How many minutes are there between 12:28 PM and 11:14 PM? 646 How many minutes are there between 1:47 AM and 5:24 AM? 217 How many minutes are there between 8:28 AM and 6:38 PM? 610 What is 692 minutes before 9:59 PM? 10:27 AM What is 467 minutes after 6:50 AM? 2:37 PM What is 344 minutes before 4:19 AM? 10:35 PM What is 56 minutes before 2:47 AM? 1:51 AM How many minutes are there between 4:26 PM and 3:31 AM? 665 What	{ "pile_set_name": "DM Mathematics" }
factor of 17312064 and 14016. 192 Calculate the greatest common factor of 251 and 12464. 1 Calculate the highest common factor of 30135104 and 4037. 367 What is the greatest common factor of 36084 and 465558? 186 What is the highest common factor of 4333448 and 140? 28 Calculate the highest common divisor of 63 and 102815757. 9 What is the greatest common factor of 94685155 and 425? 85 Calculate the highest common divisor of 1690902 and 23892. 1086 What is the greatest common divisor of 330931 and 17346? 59 What is the highest common divisor of 115374731 and 4814? 2407 What is the greatest common factor of 9520826 and 35? 7 What is the greatest common divisor of 183 and 139840426? 61 What is the highest common factor of 16 and 52971256? 8 Calculate the highest common factor of 22172 and 15654396. 964 What is the highest common divisor of 308280 and 69160? 280 What is the highest common factor of 24 and 52577552? 8 Calculate the greatest common divisor of 5725211 and 173634. 673 Calculate the highest common divisor of 1122 and 37753362. 102 What is the greatest common factor of 13166952 and 64? 8 What is the greatest common divisor of 861215 and 185? 5 Calculate the highest common factor of 366754206 and 1781. 1781 Calculate the greatest common factor of 11375 and 1345. 5 What is the highest common divisor of 936 and 8040474? 234 What is the highest common factor of 20897887 and 459551? 7789 What is the greatest common factor of 2222 and 52074388? 202 Calculate the highest common factor of 417724 and 13124. 68 Calculate the greatest common divisor of 363806765 and 35. 35 Calculate the greatest common factor of 269435557 and 71. 71 What is the highest common divisor of 1403890 and 4120? 1030 What is the highest common divisor of 161172 and 171? 9 What is the highest common factor of 4160 and 5779540? 260 What is the greatest common factor of 5248265 and 2960? 185 What is the greatest common divisor of 403800 and 68646? 4038 Calculate the highest common factor of 22224965 and 385. 35 What is the greatest common factor of 4435508 and 286? 22 Calculate the greatest common factor of 1613188 and 52976. 172 What is the highest common factor of 48384 and 3874500? 756 What is the highest common factor of 143598949 and 442? 221 What is the greatest common divisor of 38962 and 641332? 46 Calculate the highest common factor of 2418924 and 5172. 12 Calculate the greatest common factor of 404 and 1248. 4 What is the greatest common factor of 921 and 29013? 3 Calculate the highest common factor of 94905 and 972135. 2565 What is the greatest common factor of 20192432 and 728? 104 Calculate the highest common factor of 620920 and 624188. 3268 Calculate the greatest common factor of 572242 and 10488. 38 What is the highest common divisor of 960621838 and 22? 22 What is the highest common factor of 22 and 1633901929? 11 What is the highest common factor of 4011106 and 55? 11 What is the greatest common factor of 1014455 and 3? 1 Calculate the highest common factor of 39624 and 50817. 39 What is the highest common factor of 2030 and 11727310? 2030 What is the highest common factor of 5454 and 771? 3 What is the highest common factor of 4716154 and 11687? 899 Calculate the greatest common divisor of 11478016 and 880. 176 What is the highest common factor of 125064 and 1523349? 1737 What is the greatest common factor of 4273 and 38315991? 4273 Calculate the greatest common divisor of 360 and 786633570. 90 Calculate the highest common factor of 6192850 and 50. 50 Calculate the greatest common factor of 90377708 and 23984. 5996 What is the highest common divisor of 1023096 and 1873608? 1128 What is the highest common factor of 2304 and 25748208? 144 Calculate the highest common divisor of 29 and 2783153693. 29 What is the highest common factor of 27 and 25198065? 9 What is the greatest common divisor of 7994 and 5548978? 1142 Calculate the highest common factor of 1159907 and 175. 7 What is the highest common factor of 6957204657 and 1833? 1833 What is the greatest common factor of 3643384 and 115? 23 What is the highest common factor of 54211060 and 60? 20 Calculate the greatest common divisor of 178 and 284495798. 178 Calculate the highest common divisor of 544 and 1739508. 68 Calculate the greatest common factor of 2008 and 11910703. 251 Calculate the greatest common factor of 927584 and 29155. 7 What is the greatest common divisor of 8146863 and 1449? 9 Calculate the greatest common divisor of 576 and 444834. 18 What is the greatest common divisor of 5006 and 71863633? 2503 What is the highest common factor of 39215 and 64139? 31 Calculate the highest common divisor of 48 and 6229926. 6 What is the greatest common factor of 959838 and 1958? 22 What is the highest common factor of 144 and 26014164? 12 Calculate the highest common divisor of 165527635 and 20. 5 What is the greatest common divisor of 56 and 5553702? 14 Calculate the greatest common factor of 36 and 6125121. 9 What is the greatest common factor of 755478 and 7929? 9 What is the greatest common factor of 15496468 and 944? 236 What is the highest common divisor of 97291 and 5146529? 1649 What is the greatest common divisor of 10910 and 40510? 10 Calculate the greatest common divisor of 10 and 764984. 2 What is the greatest common divisor of 29393 and 11121383? 1547 Calculate the greatest common factor of 223 and 64064. 1 Calculate the greatest common divisor of 168 and 326712. 24 What is the greatest common divisor of 2354929423 and 3157? 3157 What is the highest common divisor of 851221701 and 9012? 2253 Calculate the greatest common factor of 6090 and 3837135. 435 Calculate the highest common divisor of 34 and 1131164. 2 What is the greatest common divisor of 57028 and 5426352? 212 What is the greatest common factor of 124208232 and 168? 24 What is the highest common factor of 2916080 and 9060? 20 What is the highest common factor of 50 and 950960? 10 What is the highest common divisor of 8742273 and 5553? 1851 Calculate the greatest common divisor of 56 and 170663066. 14 Calculate the greatest common divisor of 8305840 and 80. 80 Calculate the greatest common factor of 910 and 3635510. 10 Calculate the highest common divisor of 32421023 and 799. 799 Calculate the greatest common factor of 161473 and 4537. 13 Calculate the highest common divisor of 316920515 and 15. 5 What is the greatest common factor of 4663505 and 6545? 385 What is the highest common divisor of 93987 and 12674262? 177 Calculate the greatest common divisor of 728019 and 1656. 207 Calculate the highest common factor of 629 and 13376314. 629 Calculate the greatest common factor of 5133 and 15405195. 177 Calculate the greatest common factor of 4231563 and 63273. 483 What is the greatest common divisor of 4392620 and 3760? 940 Calculate the greatest common factor of 167810 and 11748430. 1730 What is the greatest common divisor of 361971 and 797858? 1087 Calculate the greatest common factor of 1024827 and 25320. 633 Calculate the greatest common divisor of 20622 and 350. 14 Calculate the highest common divisor of 1031426 and 13574. 22 What is the highest common factor of 970224 and 1424? 16 Calculate the highest common factor of 136485135 and 135. 135 Calculate the highest common factor of 159990 and 17805. 15 What is the highest common factor of 6543995 and 1160? 145 Calculate the highest common factor of 11978 and 6725873. 113 What is the highest common factor of 41113000 and 520? 40 What is the highest common factor of 30329 and 33020? 13 What is the highest common factor of 2753650 and 80? 10 Calculate the highest common factor of 296 and 261576. 8 What is the highest common factor of 9256 and 264508? 356 Calculate the greatest common divisor of 1936131844 and 4. 4 What is the highest common divisor of 144948160 and 320? 320 Calculate the greatest common divisor of 136 and 6390640. 136 Calculate the highest common factor of 5579400 and 132. 12 What is the highest common factor of 106 and 2562852683? 53 Calculate the highest common factor of 28196 and 11816. 28 What is the greatest common divisor of 86152320 and 288? 288 Calculate the highest common divisor of 379604472 and 624. 312 What is the highest common factor of 894540 an	{ "pile_set_name": "DM Mathematics" }
a - 998a. -1889a Collect the terms in 8 + 24w + 24w + 77w - 11w. 114w + 8 Collect the terms in 171s + 174s - 704s + 177s + 172s. -10s Collect the terms in 6566m - 6563m - 40329 + 40329. 3m Collect the terms in -1134 + 691 - 93a*2 + 443. -93a*2 Collect the terms in 40c + 45c - 130c + 24c. -21c Collect the terms in 241u3 - 66u*3 + 47u*3. 222u*3 Collect the terms in -4i - 7i + 47160 + 47171 - 94331. -11i Collect the terms in 2940a2 + 3a*3 + 2948a*2 + 0a*3 - 5888a*2 - 4a3. -a3 Collect the terms in -6258 - 5x2 + 7424 - 1166. -5x*2 Collect the terms in -129 + 2363n*2 - 131 + 260. 2363n*2 Collect the terms in 138d*2 - 317816d + 317816d. 138d*2 Collect the terms in 312 - 28g*2 - 312 - 3g + 3g + 25g*2. -3g*2 Collect the terms in 2m*3 - 10052017m + 10052017m. 2m*3 Collect the terms in -3d*2 + 4d*2 - 232d + 207d. d2 - 25d Collect the terms in -950d2 - 723d*2 - 640d*2 - 1057d*2. -3370d*2 Collect the terms in 16s*3 + 55s*3 - 82s*2 - 117s*3 + 82s*2. -46s*3 Collect the terms in -1 - 1 + 395729y*3 + 2 - 395730y3. -y3 Collect the terms in 7r2 + 1647r - 900r - 747r. 7r2 Collect the terms in -38 + 77 - 59r*3 - 39 - 18r*3. -77r*3 Collect the terms in v + 37v*2 - 7v + 5v2 - 2v*3 + 6v. -2v3 + 42v*2 Collect the terms in 5h*3 - 11h*3 - 6h*3 - 2h*3 - 25h*3. -39h*3 Collect the terms in 2i - 5i2 + 3i*2 + 1373 - 4773. -2i*2 + 2i - 3400 Collect the terms in -97 - 143 - 108 - k2 + 251. -k2 - 97 Collect the terms in 400960j2 + 8j*3 - 400960j*2. 8j*3 Collect the terms in 2069y*3 + 2 + 1 - 3 - 993y*3 - 1073y*3. 3y*3 Collect the terms in 10g*2 + 3g*2 + 9g*2 - 24g*2 + 9g*2. 7g*2 Collect the terms in y - 39935 + 39935 - 20y*2. -20y*2 + y Collect the terms in -1461r*2 - 1750r*2 - 402r*2. -3613r*2 Collect the terms in -27 + 59 - 32 + 138w. 138w Collect the terms in 2 + 7 + 5 - 9 - 9j - 5. -9j Collect the terms in 761174q*2 - 380587q*2 + 2q*3 - 380587q*2. 2q*3 Collect the terms in 120x*2 + 82x*2 - 268x*2 + 83x*2. 17x*2 Collect the terms in -153s + 53s3 + 149s - 30s3. 23s*3 - 4s Collect the terms in -h*3 - 338h + 338h + 0h3. -h3 Collect the terms in -37l3 + 18122 + 2l*2 - 18122. -37l*3 + 2l*2 Collect the terms in 397t*2 + 33t + 399t2 + 27t*3 - 795t*2. 27t3 + t2 + 33t Collect the terms in 10 - 12 + 1 + 2w + 6 - 5w. -3w + 5 Collect the terms in 2y - 2y - 105649y3. -105649y*3 Collect the terms in 4b + 1133b2 + 891 - 4b - 891. 1133b2 Collect the terms in 1 - 1 + 5z - 21z2 + 19z*2. -2z*2 + 5z Collect the terms in 118 - 118 + 10h - 16h + 8h. 2h Collect the terms in 65 - 3j - 36 - 50. -3j - 21 Collect the terms in -25y2 + 80 + 15y*2 - 4y + 0y + 9y2. -y2 - 4y + 80 Collect the terms in 212q*3 - 3q*2 - 214q*3 + 10 + 3q*2. -2q*3 + 10 Collect the terms in 7y + 2084645 - 32y - 2084645. -25y Collect the terms in 50095i2 + 2i*3 - 24672i*2 - 25423i*2. 2i*3 Collect the terms in 502 + 9c - 293 - 7c - 219. 2c - 10 Collect the terms in -6h2 - 1024 - 59h*3 - 3h*2 + 8h*2. -59h3 - h2 - 1024 Collect the terms in -1345315599d - 10d*2 + 1345315599d + 4d2. -6d*2 Collect the terms in 73 - 3q*2 - 43 + 8q*2 - 30. 5q2 Collect the terms in j3 + 3j3 - 3j*3 + 27j*3 - 12j*3 - 13j*3. 3j*3 Collect the terms in -67305d*2 - 13d*3 + 67305d*2. -13d*3 Collect the terms in 137 - 2f - 78 + 186 - 85 - 86 - 74. -2f Collect the terms in 50o + 109o + 122o - 40o + 0o. 241o Collect the terms in -32q + q*3 + 4q*3 + 66q - 34q. 5q*3 Collect the terms in -2 + 0 + 72v*2 + 76v*2 - 163v*2. -15v*2 - 2 Collect the terms in -14b - 18b - 41b + 16. -73b + 16 Collect the terms in 0k*3 - 521k + 4k3 - k3. 3k*3 - 521k Collect the terms in 12t + 57t*3 + 3t + 677t3. 734t*3 + 15t Collect the terms in 7 + 0 + 666t3 - 6 - 1. 666t*3 Collect the terms in 871y + 349y + 895y. 2115y Collect the terms in 7 - 7 + 20 - 12 - 8 - 3v. -3v Collect the terms in -4883i*2 - 4868i*2 + 5 - 4 - 1 + 9713i*2. -38i*2 Collect the terms in 41 - 26n - 18 + 28n - 23. 2n Collect the terms in 2436x3 - 1340x*3 - 1112x*3. -16x*3 Collect the terms in -67o + 2o2 - 3o*2 - 6o*2 - 30. -7o*2 - 67o - 30 Collect the terms in 132 - 3b + 341 - 473. -3b Collect the terms in 27n + 29n - 11 + 11 - 48n + 27n. 35n Collect the terms in -18a*3 + 24a*2 + 43a*2 - 67a*2 + 11a*3 + 5a*3. -2a*3 Collect the terms in -923g*2 + 9g*3 + 5 - 5 + 923g*2. 9g*3 Collect the terms in 277o*3 + 196o*3 + 1620o*3. 2093o*3 Collect the terms in 245c*2 - 11 - 247c*2 + 149. -2c*2 + 138 Collect the terms in 4n*2 + 7550n - 3766n - 3784n. 4n2 Collect the terms in 26 - 36 + 10 + 15x*2 - 109x*2. -94x*2 Collect the terms in 292a*2 - 180a*2 - 165a*2. -53a*2 Collect the terms in 4 + 242k + 256k - 4 - 499k. -k Collect the terms in 9z - 469198z*2 - 3z*3 + 469198z*2. -3z*3 + 9z Collect the terms in -167r2 + 2 + 167r2 - 13 + r3 + 11. r*3 Collect the terms in -11a*2 + 1199 + 4a*2 + 8a2. a2 + 1199 Collect the terms in 191f3 - 728f*3 + 186f*3 + 192f*3 + 176f*3. 17f*3 Collect the terms in -3v*2 + 4v2 - 236 + 480 - v - 242. v2 - v + 2 Collect the terms in 701x2 + 3x*3 + 5x*3 - 701x*2. 8x*3 Collect the terms in -13i + 13i - 103i*3 - 67i*3. -170i*3 Collect the terms in 7 - 41836i*3 - 7. -41836i*3 Collect the terms in -17631p*2 + 2 - 2 + 6458p*2. -11173p*2 Collect the terms in -331o*3 - 1073 + 1073. -331o*3 Collect the terms in -251j - 259j + 508j + 13. -2j + 13 Collect the terms in 18273l - 6092l - 6089l - 6095l. -3l Collect the terms in -16204d + 16204d - 10d3. -10d*3 Collect the terms in -48 - 57 + 138 - 33 - 4m*3. -4m*3 Collect the terms in 10610j - 21002j + 10391j. -j Collect the terms in 7a3 + 23a*2 + 22a*2 + 42a*2 + 23a*2 - 111a*2. 7a3 - a2 Collect the terms in -t - 2t + 2 + 0t - 41t3. -41t*3 - 3t + 2 Collect the terms in -3c - 2c*2 + 2c - 1885 + 0c. -2c*2 - c - 1885 Collect the terms in -9a*2 + 3a - 14a2 - 15a*2. -38a*2 + 3a Collect the terms in -50v - v - 37v - 8v - 13v. -109v Collect the terms in 5b*3 - 3 - 3b*3 + 0b*3 + 3 + 8b. 2b3 + 8b Collect the terms in -201t2 - 191 + 383 - 192. -201t*2 Collect the terms in 62r - 10r + r + 2r*2 - 53r. 2r2 Collect the terms in 1639p*3 + 947p*3 + 91p*3 + 655p*3. 3332p*3 Collect the terms in -303u*2 - 94u*2 - 85u*2. -482u*2 Collect the terms in -29 + 6 - 46g*3 + 64g*3 - 18. 18g*3 - 41 Collect the terms in -233642m*2 - 1 + 1. -233642m*2 Collect the terms in 32t*2 - 14t*2 - 2t*2 - 4t*2 - 14t*2. -2t*2 Collect the terms in 132c*2 - 4205c - 1005c - 134c*2. -2c*2 - 5210c Collect the terms in 7892g - 2626g - 2631g - 2632g. 3g Collect the terms in -1697 + 496 + 1201 - 11r*3. -11r*3 Collect the terms in 859k*3 + 678k*3 - 1790k*3. -253k*3 Collect the terms in -4d + 5d + 3d - 2d. 2d Collect the terms in -132a3 + 10a + 102a3 + 10a - 20a. -30a*3 Collect the terms in -11554 - 1817m*3 + 11554. -1817m*3 Collect the terms in 2361n*3 + 0n*2 - 1172n*3 + 0n*2 - 1195n*3. -6n*3 Collect the terms in -18 + 412m*3 + 18. 412m*3 Collect the terms in -206n*3 + 49n*3 + 59n*3 + 91n*3. -7n*3 Collect the terms in -35 - 24 + 19p*2 + 59. 19p*2 Collect the terms in -4w*2 + 26w3 - w2 - 46w3 + 19w*3 + 16w2. -w3 + 11w2 Collect the terms in -1340w - 1327w + 2631w. -36w Collect the terms in -38i - 18i + 25i - 52i. -83i Collect the terms in -n - 23n + 41n. 17n Collect the terms in 2w*2 - 5768w + 11866w - 6098w. 2w2 Collect the terms in -3p - 8p + 2p + 54p - 67p. -22p Collect the terms in 5x - 22x + 9x - 10 + 5x + 4x. x - 10 Collect the terms in 4t - 2t + 47 + 28 - 125 - 132. 2t - 182 Collect the terms in -3u**3 - 163552395 + 163552	{ "pile_set_name": "DM Mathematics" }
0j + 0j)(2j - j - 2j) - 2j*2 - 3j*2 + 0j*2) as n + vj + qj2 and give q. 2892 Express -38p + p*2 + 18p - 2p4 + 15p - 2p3 + 0p*2 in the form ip*4 + ap + gp2 + w + yp*3 and give a. -5 Rearrange (2x - 1 + 1)(-2 + 2 + x2) + 4x3 - x3 - 4x3 + 6x*3 - 3x - 133x2 + 5x + 138x2 to sx*3 + ix + f + hx2 and give i. 2 Rearrange -i + 471 + 33i*2 - 476 + 0i + 0i to the form ci*2 + f + ri and give f. -5 Express (-2 + 2 - 5y2)(-47y2 + 162y*2 - 1078 + 1079) as t + fy + uy4 + ky*2 + xy*3 and give k. -5 Express -5i - 1406 + 4i - i + 1262 as h + mi and give m. -2 Express (12 - 6 + 7)(-81 + 40 + 42 - b2 - b - 3b*3) in the form l + ob + rb3 + ib*2 and give i. -13 Rearrange (-33b + 33b + 87b*2)(-7b + 5 - 5) to the form ub*2 + g + qb + ob3 and give o. -609 Rearrange 6g*2 + 9g + g*2 + 0g*2 - 6g*2 + 5g*3 to the form kg*2 + yg + f + ig3 and give k. 1 Rearrange -12v - 3 - 13v - 62v*3 - 3v + 28v to t + iv*2 + cv*3 + zv and give t. -3 Express (-1 + 494c + 1 + 0 - 1000c)(0 + 2 - 3) as x + zc and give z. 506 Express (-1 + 5s + 1)(-519s + 56s*3 + 51s*3 - 108s*3) as v + ws*3 + bs + as4 + gs*2 and give a. -5 Express (2m + 0m - 3m)(-3 + 1 + 0) + 0m + m + m + 2m + 0 + 0 - 57m - 56m - 9 + 26m as fm + w and give f. -81 Express (-3g*2 - 4g*2 + 5g*2 + (-2 + 1 + 0)(2g - 2g - g)(21 - 21 - 6g))(1256 - 1254 - g - 2g) as ng2 + dg + fg3 + b and give f. 24 Rearrange -8r*2 - 8r*2 + 24r*2 - 3r*2 + 38r + 160r to the form cr*2 + d + nr and give d. 0 Rearrange -10v4 - 7v*4 + 2v*4 + (-6 + 2 + 2)(23v4 - v4 + 8v*4) to the form b + jv + iv3 + rv*4 + sv*2 and give j. 0 Rearrange -440j*4 - 287j*4 - 38j*4 + (3j - 3j + 2j)(j3 - j3 + j3) to dj*3 + c + gj + rj2 + pj*4 and give r. 0 Express 13 - 2f*2 - 842f + 840f - 4 as b + cf*2 + qf and give c. -2 Express (-19 - 52 + 7)(-69 + 69 - n)(-n*2 + 4 - 4) as gn*2 + rn*3 + tn + p and give r. -64 Express (3 + 3u - 2u + u)(-431u*2 - 471u*2 + 993u*2) as du + x + wu2 + au*3 and give a. 182 Rearrange 8 - 1 + 3m*3 - 4m*3 - 9m*4 - 3 to the form gm*4 + um*2 + xm*3 + jm + k and give g. -9 Express 59j3 - 4j*2 + 2j*2 + 2j*2 - 2j + 83j3 as v + aj + pj3 + zj*2 and give p. 142 Express (-33 - 2d*2 + 33)(-4d2 + d2 + 4d*2) + 3d*4 + 3d*2 - 4d*2 - 6d*4 as k + zd + id2 + ad*3 + jd*4 and give j. -5 Express -4 - 5r - 16r + 3r*2 - 16r + r*3 + 38r in the form s + fr + qr*2 + xr*3 and give f. 1 Rearrange 9p + 460p2 + 8p - 17p to b + np + yp2 and give y. 460 Rearrange -7w - 2w + 54 - 15 - 25 - 20 to the form x + uw and give x. -6 Rearrange 26f4 + 148f - 146f + 2f*2 - 119f*4 to r + nf*2 + of*3 + if + af4 and give i. 2 Express -16 + 113 + 75v*2 - 77v*2 as kv + w + uv2 and give w. 97 Express (-56 + 56 - 7q)(2 - 4 + 0)(0 - 2 - 1)(9q*2 - 2q*2 + 2q*2) as wq*3 + z + pq*2 + mq and give w. -378 Rearrange -1033 + 7a + 516 + 476 to the form z + da and give z. -41 Express (2 - 5 + 2)((-9 + 3 - 9)(q + 0q - 3q) + q - q - q + 7q + 45 - 45)(0 + 1 - 3) as n + uq and give u. 72 Rearrange (0 - 2 + 1)(2w2 + 3w - 3w) + w2 - 4w*2 + 0w*2 + 34w*2 - 77w*2 - 111w*2 to the form sw*2 + b + lw and give s. -159 Rearrange 66244f + 44f*2 + 2 - 66244f to qf2 + uf + r and give q. 44 Rearrange -7u2 + 4u*2 - 23u*2 + 42 + 21u*2 to j + vu*2 + su and give j. 42 Rearrange -843q - 277q - 37q + 1 to the form zq + b and give b. 1 Rearrange ((2 + 2 - 2)(-1 + 1 - 2) - 4 + 6 - 3 - 4 + 2 + 0)(-7j - 253 + 254 + 3j) to sj + v and give s. 28 Express -s + 2s*2 - 4s*2 - 2s + 5s + 2s - 4s4 in the form ls + js2 + bs*3 + h + zs*4 and give b. 0 Express -13a*2 + 13a - 3a3 + 11a*2 + 30a + 2a3 as xa*2 + ua*3 + da + w and give d. 43 Rearrange -21g2 + 4g + 7g + 5g - 13g to jg + og2 + f and give j. 3 Express (4s*3 + 8s*3 - 6s*3)(-33 + 17 + 2) as ps + b + ks*2 + ds*3 and give d. -84 Rearrange -193w*4 + 389w*4 + 2 - 195w*4 - 5w to the form cw + b + sw*2 + rw*4 + tw*3 and give b. 2 Rearrange -58g*3 - 238g*2 + 238g*2 + (-4 - g + 4)(g*2 + 0g*2 - 2g*2) to vg*2 + sg + a + cg3 and give a. 0 Express ((2t - 3t + 3t)(-2t + 0t + 3t) - 2t + t2 + 2t)(4 - 3 + 1)(8t - 12 - 7t - 3t) in the form xt*3 + ht*2 + at + y and give x. -12 Rearrange (4g3 - 6g3 - g3)(2 + 3 - 4)(247 + 144g - 247) to the form ag*4 + yg + wg3 + n + lg*2 and give a. -432 Rearrange (-s - 4 + 3s + 2)(-19 - 34 + 9) to as + n and give a. -88 Express 39y - 42y + 40 - 9 - y*2 in the form gy*2 + q + cy and give g. -1 Rearrange ((12 - 6 + 4)(-1 + 1 + 2) - 2 + 1 + 8)(0i + i + 2i) to the form di + x and give d. 81 Rearrange (-i2 + 2i*2 - 3i*2)((2 - 2i - 2)(-5 + 2 + 1) - 4i + 4i + i + 205i + 107i - 41i) to ni*3 + j + bi + si2 and give n. -552 Express 591c*3 + 13c*2 + 585c3 - c4 - 1213c3 as vc + uc2 + zc*3 + t + xc*4 and give u. 13 Express (1 + 2w - 1)(102w - 234w - 101w) + 3w + w2 - 3w as dw + mw*2 + h and give m. -465 Rearrange 9n*3 - 8n3 - n3 - 2n4 + 1 + 5n + 10n2 to the form dn*4 + sn + j + bn3 + mn*2 and give s. 5 Rearrange 259i + 129i + 311i - 135i to the form f + ji and give j. 564 Rearrange 513z - 614z - 264z to l + uz and give u. -365 Rearrange -853 + 426 + 427 + 6m to the form km + u and give k. 6 Express -157 + 53o + 204 - 50 as co + i and give c. 53 Rearrange 1391g2 - 1 + 4g + 2 - 1363g2 to the form mg*2 + s + lg and give m. 28 Express -69x - 42x + 7x as v + lx and give l. -104 Rearrange 4w2 + 9w*2 + 4w*3 - 11w*2 + 0w*2 - 3w to the form kw2 + o + bw*3 + fw and give b. 4 Rearrange 4t3 - 7t*3 - 7t*4 + t + 8t*2 + 7t*3 + 5t*4 to kt*3 + r + mt*4 + ct + at2 and give a. 8 Express 7w*4 + 3 + 0w*3 - 2w*3 - 407w*2 + 408w*2 as lw*2 + y + iw*3 + gw*4 + mw and give l. 1 Rearrange (0 + 0 - m)(m + 0m - 8m)(-2m + 2m + 3m2) + 3m*4 - 3m4 - m4 to qm + vm*3 + o + bm*2 + sm*4 and give s. 20 Express 4r*2 - r + 0r - 3r2 + (-1 + 1 + 3r)(r + 2r + 3r) + (-1 - 2r + 1)(2r - r - 3r) in the form zr*2 + u + mr and give z. 23 Rearrange (-17z + 2z*2 + 6z + 16z)(-5z + 5z + 6z) to the form mz*3 + dz*2 + p + gz and give m. 12 Express 47z + 89z + 91z + 5z - z - 5z - 5z + 2z + 4z + (5z - 3z - 4z)(4 - 3 - 3) - 2z - 4z + 5z - 2 + 2 - z as az + c and give c. 0 Express 89297 - 89297 + 0p + p - 9p2 + p4 - 3p4 + p3 in the form tp*3 + up + dp4 + c + gp*2 and give d. -2 Rearrange -11q - 12q4 + 11q + 2q4 - q2 + q2 - 1 + (5q*3 - 5q*3 - 3q*3)(q - 4q + 0q) to iq + l + cq*2 + nq*4 + wq*3 and give n. -1 Rearrange (0 + 4 - 2 + (-1 - 1 + 3)(1 - 3 + 0) - 14 + 13 + 55)(-34 - 32 + 58 + 3a) to the form va + l and give l. -432 Express ((1 + 3 - 3)(1 + 2 + 0) + 3 - 7 + 3)(-3a - 5a - 4a) as ia + y and give i. -24 Rearrange (5z*4 - 48 + 48 + (18z*2 - 18z*2 - 9z*3)(0z + 0z - 2 + 2z))(2 + 2 - 3) to qz4 + cz + sz2 + tz*3 + a and give t. 18 Express -8b*2 - 4b2 - b2 - 7536b3 + 2 - 5b*2 + 7534b3 - b4 in the form cb + db*4 + l + ob*3 + yb*2 and give y. -18 Express -126p*2 + 2 - 2p*3 + 130p*2 + 27p*4 - 22p*4 as tp*3 + hp*4 + f + vp*2 + ip and give h. 5 Express -90z2 + 156z*2 + 154z*2 - 20z*2 as jz + az2 + q and give a. 200 Express 101 - 4 + k - 46 + 2k + 78 in the form v + jk and give v. 129 Express (-202v*2 + 2 - 2 + 73v*2)(-9v - 9v + 3v) in the form lv*2 + jv*3 + d + fv and give j. 1935 Express 167l4 - 4l3 + l2 + 12l + 2l*3 + 2 - 165l*4 as u + dl + sl3 + jl*2 + ql*4 and give j. 1 Rearrange (-56d + 2d + 11d + 4d)(-809d + 809d - 176d2) to the form n + wd*3 + yd + pd2 and give w. 6864 Express 10q*4 + 68q2 - q4 - 12q4 + (q - 2q - q)(2q + q*3 - 2q) in	{ "pile_set_name": "DM Mathematics" }
o five dps. 0.00001 Suppose -60 = 4j + 4k, -4j - 60 = -0j - 2k. Let m be (-400)/j(-28718 - 1 - 6). What is m rounded to the nearest one hundred thousand? -800000 Let d = -196.08 - -196.07954097. What is d rounded to five decimal places? -0.00046 Let a(s) = 1833s - 70. Suppose -3x - 8x = -187. Suppose -5o - x = 5w + 8, 15 = 3w. Let b be a(o). What is b rounded to the nearest ten thousand? -20000 Let x = 5926.9981019 + -5927. Round x to 4 decimal places. -0.0019 Let o(z) = -19z + 2967z*3 - 718z*2 + 1434z*2 - 722z*2 - 6. Let c be o(14). What is c rounded to the nearest one million? 8000000 Suppose 0 = -2p + 5o + 12, -3p + 5o = 2p - 15. Suppose -2m = -5 + p. Suppose 4 = -mc, 4226 = -z + c + 698. Round z to the nearest one hundred. -3500 Let y = 40 - -153. Let l = y + -193.00000129. Round l to 7 dps. -0.0000013 Let b = -118.4 - 0.6. Let c = 118.999719 + b. What is c rounded to 4 decimal places? -0.0003 Let g = -5.55936 - -5.1. Let s = -2.2 + 2.66. Let c = s + g. Round c to 4 decimal places. 0.0006 Let p = -1081.03 - -1089. Let a = 315.03 + p. Let s = a - 323.00000894. What is s rounded to 6 dps? -0.000009 Let r = -37566586537336.933400621 + 37566586582892. Let p = 45555.2836 - r. Let x = 0.217 - p. Round x to 7 decimal places. -0.0000006 Let n = 5988.73 + -6016. Let x = -27.5459 - n. Round x to two decimal places. -0.28 Let m(o) = 328o2 + 31o - 11. Let j be m(28). Let t = j + -1518009. What is t rounded to the nearest one million? -1000000 Let h(d) = d*3 + 2d*2 - 3d + 2. Let a be h(1). Let k be a/1(-259)/14-2340502. Let q = -129698574 + k. What is q rounded to the nearest one million? -43000000 Suppose 11o = 5o - 36. Let w(f) = 279f2 - 10f - 34. Let k be w(o). Round k to the nearest one thousand. 10000 Let d = 50185 + -50185.00020319. What is d rounded to 5 decimal places? -0.0002 Let w(l) = -35l2 - 30l - 320. Let k be w(-38). What is k rounded to the nearest one thousand? -50000 Let x = 32.4 + -114.4. Let n = -81.999661 - x. Round n to four decimal places. 0.0003 Let z(l) = l*3 + 3l*2 + 2l + 5. Let k(o) = -1. Let i(n) = 5k(n) - z(n). Let q be 0 + -2 - (11 - 2). Let t be i(q). Round t to the nearest one hundred. 1000 Let t = -6174244 - -17560345. Let d = 7026101 - t. Round d to the nearest 100000. -4400000 Suppose -r - 3s = 3r - 2361, -4r - 4s + 2360 = 0. Let n be 200r300/9. What is n rounded to the nearest 1000000? 4000000 Let m = 432 + -419. Suppose -md + 23d - 1248000 = 0. What is d rounded to the nearest 10000? 120000 Let h = 53529 - 53565.059. Let b = 0.041 - h. Let d = -36.100000298 + b. What is d rounded to 7 decimal places? -0.0000003 Let a = -5689.99996705 + 5690. Round a to 5 dps. 0.00003 Let c = 882 + -876. Let w be (-167000)/c-9(-70)/21. What is w rounded to the nearest ten thousand? -840000 Let u = -13143 + 13143.000006759. Round u to seven dps. 0.0000068 Suppose -2d + 216 = -0j - 4j, 0 = -j + 5d - 54. Let n = j + 56. Suppose nf = -736147 - 1083853. What is f rounded to the nearest one hundred thousand? -900000 Suppose -2986349627 - 885150663 = -29d. Suppose 14j - f - 133500002 = 9j, -5j + 5f = -d. What is j rounded to the nearest 1000000? 27000000 Let b = -750.0732 - -750. Let j = b - -0.2596. Round j to two decimal places. 0.19 Let c = 1543679 - 771619. Suppose 0 = 9n + 2491060 - c. What is n rounded to the nearest 100000? -200000 Let j = 7369 + -7369.0013403. What is j rounded to four dps? -0.0013 Let x = 154127.8 + -141479. What is x rounded to the nearest one thousand? 13000 Let i(y) = 88 + 3 - 4147y + 25 - 27. Let p be i(-13). Round p to the nearest 1000. 54000 Let d be 2/6 + 21/(-9). Let n be (-4374)/7 + (-4)/((-56)/d). Let q be n/10(-78561 + 1). Round q to the nearest 1000000. 5000000 Let g = 137 - 134. Suppose 5b = -5m - 42499975, b - 25500020 = 3m - gb. What is m rounded to the nearest one million? -9000000 Let u = 0.8047 - 0.80449405. What is u rounded to six dps? 0.000206 Let h be (-45519)/(-18)3440-10. Let b = 5976217 - h. Let q = 9056817 - b. Round q to the nearest 1000000. -30000000 Let f(x) = -3787x*3 + 30x*2 + 18x + 65. Let s be f(-5). Round s to the nearest 100000. 500000 Let f = 0.34034 + -0.358007. What is f rounded to 3 dps? -0.018 Let o(a) = -8a - 17. Let m be o(-3). Suppose -13g = -mg - 18. Suppose gt + 7759 = 2029. Round t to the nearest 100. -1900 Let x = -1044 - -930.7. Let t = -213.5 - x. What is t rounded to the nearest ten? -100 Suppose 39 = -50m - 311. Let l(o) = 3o*3 + 10o*2 + 20o + 42. Let n be l(m). What is n rounded to the nearest one hundred? -600 Let p = 241 - 241.0218. Let w = 8.03 - 8. Let x = p + w. What is x rounded to three decimal places? 0.008 Let b(p) = -p*3 + 18p*2 - 11p - 75. Let z be b(17). Suppose za + 2a - 8207000 = 0. Round a to the nearest 10000. 280000 Let b be (484/154 - 3) + 117461/(-7). What is b rounded to the nearest one thousand? -17000 Let f = 0.21443 + -0.235872. Round f to four dps. -0.0214 Let q be (-24)/161158424/(-6). Let p = q + -845606. Round p to the nearest ten thousand. -560000 Suppose -2i + 17771690 = -5356352. Let h = 18634021 - i. What is h rounded to the nearest one million? 7000000 Let z = 1040.44 + -1040.4400066821. What is z rounded to 6 decimal places? -0.000007 Let v = 914 - 914.0000162. Round v to six decimal places. -0.000016 Let u = -79 - -115. Let i = u - 96. Let r = i - -59.99999712. Round r to seven decimal places. -0.0000029 Suppose -104958 = 3x + 85242. What is x rounded to the nearest 1000? -63000 Let a = 7 + -10. Let m be a + 3 - -3(-4)/(-4). Suppose -2y + p = my + 156996, -94220 = 3y + 5p. What is y rounded to the nearest 1000? -31000 Let c = -117 + 61. Let t = 4696.1675062 + -4752.16751. Let d = c - t. Round d to 6 decimal places. 0.000004 Let p = 11.7 - 234.7. Let y = p - -223.00206. What is y rounded to 4 dps? 0.0021 Let p = 0.88 - -425.12. Let m = -426.01026 + p. Round m to three decimal places. -0.01 Let i = -0.28009024 + 0.05909426. Let n = -0.221 - i. Round n to 7 dps. -0.000004 Suppose n - 5p + 17 = 0, -5p + 11 = -n - 2n. Let z be (0 + (-73)/(-3))(n + 3). Let t be (45)/((-1)/z). What is t rounded to the nearest one hundred? -2900 Let a = 33396 - 67495. What is a rounded to the nearest 1000? -34000 Let v = -0.37367 - 0.03453. Let p = 0.38317 + v. What is p rounded to 3 dps? -0.025 Let k = 6580.0449 - 6578. What is k rounded to 2 dps? 2.04 Let s = -91602.68519 - -91559.68519101. Let g = -0.51 - 42.49. Let f = s - g. What is f rounded to seven dps? 0.000001 Let i = 250.31155 + -0.01155. Let f = 109.9 - i. Let d = f - -158. What is d rounded to the nearest integer? 18 Suppose 0 = 3p + 58 - 43, -3u + 4p = 161555980. Round u to the nearest one hundred thousand. -53900000 Let m(w) = -7w3 + 4w*2 - 4w + 2. Let u be m(2). Let b be u/(-8) - -3(-6)/(-72). Suppose 0 = -bx - 475 + 133. What is x rounded to zero dps? -57 Let w = -7525.9973912 - -7526. What is w rounded to four decimal places? 0.0026 Let y = 877.06233 - 7.44533. Let f = y - 870. Let j = f + -0.067. What is j rounded to one decimal place? -0.5 Suppose -q = 3j - 1458118, j - 3q - 126554 = 359502. Let m = j + -738041. What is m rounded to the nearest ten thousand? -250000 Let t = -236 - -267.7. Let o = 32.172 - t. Round o to one decimal place. 0.5 Let t = -147000 - -147000.74721. Round t to 1 decimal place. 0.7 Let n = 276.3284 + 4.0016. Round n to the nearest 10. 280 Let z = 11486 + -11739.92. Round z to the nearest 10. -250 Suppose -11d + 15d - 40 = 0. Suppose d - 76 = -3*x. What is x rounded to the nearest 100? 0 Let j = -1444665600 - -1444667639.998471. Let z = 2040 - j. What is z rounded to four decimal places? 0.0015 Let f = 818 - 707. Let x = f - 77.4. What is x rounded to the nearest ten? 30 Let f be ((4/5)/((-44)/110))/(-1). Let d be ((-5)/((-30)/8))/(f/(-27975)). Round d to the nearest 1000. -19000 Let d = -481.267 + 0.267. Let i = -480.34 - d. Round i to one dp. 0.7 Let f = -51.8 - 17.2. Let r = -3267.245 - -3336.1. Let a = f + r. Round a to 2 dps. -0.15 Let o = -28.89 + 29. Let w = 324.89 + o. Let s = 324.9999714 - w. Round s to 6 decimal places. -0.000029 Let y = -35.14 + 43.214. What is y rounded to one dp? 8.1 Let f be ((-9725)/50)/((-2)/(-116	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.